]>
Commit | Line | Data |
---|---|---|
5e13499c | 1 | %!PS-Adobe-2.0 |
d7935593 | 2 | %%Creator: dvips(k) 5.995 Copyright 2015 Radical Eye Software |
5e13499c | 3 | %%Title: bashref.dvi |
d345f817 | 4 | %%CreationDate: Mon Jan 25 10:12:29 2016 |
037a8b7f | 5 | %%Pages: 177 |
5e13499c CR |
6 | %%PageOrder: Ascend |
7 | %%BoundingBox: 0 0 612 792 | |
c302751c | 8 | %%DocumentFonts: CMBX12 CMR10 CMTT10 CMSL10 CMSY10 CMMI12 CMMI10 CMCSC10 |
6e51e0d0 | 9 | %%+ CMTI10 CMSLTT10 SFRM1095 CMTT12 CMTT9 CMMI9 CMR9 |
d3ad40de | 10 | %%DocumentPaperSizes: Letter |
5e13499c CR |
11 | %%EndComments |
12 | %DVIPSWebPage: (www.radicaleye.com) | |
13 | %DVIPSCommandLine: dvips -D 600 -t letter -o bashref.ps bashref.dvi | |
d3ad40de | 14 | %DVIPSParameters: dpi=600 |
d345f817 | 15 | %DVIPSSource: TeX output 2016.01.25:1012 |
d3ad40de | 16 | %%BeginProcSet: tex.pro 0 0 |
5e13499c CR |
17 | %! |
18 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
19 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
20 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
21 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
22 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
23 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
24 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
25 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
26 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
27 | N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin | |
28 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array | |
29 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 | |
30 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N | |
31 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
32 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
33 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
34 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
d3ad40de CR |
35 | 1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S |
36 | /BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy | |
37 | setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask | |
38 | restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
5e13499c CR |
39 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put |
40 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
41 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
42 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
43 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
44 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
45 | 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 | |
46 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N | |
45c0f7f8 CR |
47 | /dir 0 def/dyy{/dir 0 def}B/dyt{/dir 1 def}B/dty{/dir 2 def}B/dtt{/dir 3 |
48 | def}B/p{dir 2 eq{-90 rotate show 90 rotate}{dir 3 eq{-90 rotate show 90 | |
49 | rotate}{show}ifelse}ifelse}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 | |
50 | N/Ry 0 N/V{}B/RV/v{/Ry X/Rx X V}B statusdict begin/product where{pop | |
51 | false[(Display)(NeXT)(LaserWriter 16/600)]{A length product length le{A | |
52 | length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse} | |
53 | forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{ | |
54 | BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat | |
55 | {BDot}imagemask grestore}}ifelse B/QV{gsave newpath transform round exch | |
56 | round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 | |
57 | rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B | |
58 | /M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M} | |
59 | B/g{0 M}B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p | |
60 | -3 w}B/n{p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{ | |
61 | 0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
5e13499c | 62 | |
6e51e0d0 CR |
63 | %%EndProcSet |
64 | %%BeginProcSet: cm-super-t1.enc 0 0 | |
65 | % This file is generated from `T1uni.map' and `glyphlist.txt', `gl-other.txt' | |
66 | % | |
67 | % LIGKERN hyphen hyphen =: endash ; endash hyphen =: emdash ; | |
68 | % LIGKERN quoteleft quoteleft =: quotedblleft ; | |
69 | % LIGKERN quoteright quoteright =: quotedblright ; | |
70 | % LIGKERN comma comma =: quotedblbase ; less less =: guillemotleft ; | |
71 | % LIGKERN greater greater =: guillemotright ; | |
72 | % LIGKERN f f =: ff ; f i =: fi ; f l =: fl ; ff i =: ffi ; ff l =: ffl ; | |
73 | % | |
74 | % LIGKERN space {} * ; * {} space ; zero {} * ; * {} zero ; | |
75 | % LIGKERN one {} * ; * {} one ; two {} * ; * {} two ; | |
76 | % LIGKERN three {} * ; * {} three ; four {} * ; * {} four ; | |
77 | % LIGKERN five {} * ; * {} five ; six {} * ; * {} six ; | |
78 | % LIGKERN seven {} * ; * {} seven ; eight {} * ; * {} eight ; | |
79 | % LIGKERN nine {} * ; * {} nine ; | |
80 | % | |
81 | /T1Encoding [ | |
82 | % 0x00 | |
83 | /grave | |
84 | /acute | |
85 | /circumflex | |
86 | /tilde | |
87 | /dieresis | |
88 | /hungarumlaut | |
89 | /ring | |
90 | /caron | |
91 | /breve | |
92 | /macron | |
93 | /dotaccent | |
94 | /cedilla | |
95 | /ogonek | |
96 | /quotesinglbase | |
97 | /guilsinglleft | |
98 | /guilsinglright | |
99 | % 0x10 | |
100 | /quotedblleft | |
101 | /quotedblright | |
102 | /quotedblbase | |
103 | /guillemotleft | |
104 | /guillemotright | |
105 | /endash | |
106 | /emdash | |
107 | /afii61664 | |
108 | /perthousandzero % PERTHOUSAND ZERO | |
109 | /dotlessi | |
110 | /dotlessj | |
111 | /ff | |
112 | /fi | |
113 | /fl | |
114 | /ffi | |
115 | /ffl | |
116 | % 0x20 | |
117 | /uni2423 | |
118 | /exclam | |
119 | /quotedbl | |
120 | /numbersign | |
121 | /dollar | |
122 | /percent | |
123 | /ampersand | |
124 | /quoteright | |
125 | /parenleft | |
126 | /parenright | |
127 | /asterisk | |
128 | /plus | |
129 | /comma | |
130 | /hyphen | |
131 | /period | |
132 | /slash | |
133 | % 0x30 | |
134 | /zero | |
135 | /one | |
136 | /two | |
137 | /three | |
138 | /four | |
139 | /five | |
140 | /six | |
141 | /seven | |
142 | /eight | |
143 | /nine | |
144 | /colon | |
145 | /semicolon | |
146 | /less | |
147 | /equal | |
148 | /greater | |
149 | /question | |
150 | % 0x40 | |
151 | /at | |
152 | /A | |
153 | /B | |
154 | /C | |
155 | /D | |
156 | /E | |
157 | /F | |
158 | /G | |
159 | /H | |
160 | /I | |
161 | /J | |
162 | /K | |
163 | /L | |
164 | /M | |
165 | /N | |
166 | /O | |
167 | % 0x50 | |
168 | /P | |
169 | /Q | |
170 | /R | |
171 | /S | |
172 | /T | |
173 | /U | |
174 | /V | |
175 | /W | |
176 | /X | |
177 | /Y | |
178 | /Z | |
179 | /bracketleft | |
180 | /backslash | |
181 | /bracketright | |
182 | /asciicircum | |
183 | /underscore | |
184 | % 0x60 | |
185 | /quoteleft | |
186 | /a | |
187 | /b | |
188 | /c | |
189 | /d | |
190 | /e | |
191 | /f | |
192 | /g | |
193 | /h | |
194 | /i | |
195 | /j | |
196 | /k | |
197 | /l | |
198 | /m | |
199 | /n | |
200 | /o | |
201 | % 0x70 | |
202 | /p | |
203 | /q | |
204 | /r | |
205 | /s | |
206 | /t | |
207 | /u | |
208 | /v | |
209 | /w | |
210 | /x | |
211 | /y | |
212 | /z | |
213 | /braceleft | |
214 | /bar | |
215 | /braceright | |
216 | /asciitilde | |
217 | /hyphen.alt % HANGING HYPHEN | |
218 | % 0x80 | |
219 | /Abreve | |
220 | /Aogonek | |
221 | /Cacute | |
222 | /Ccaron | |
223 | /Dcaron | |
224 | /Ecaron | |
225 | /Eogonek | |
226 | /Gbreve | |
227 | /Lacute | |
228 | /Lcaron | |
229 | /Lslash | |
230 | /Nacute | |
231 | /Ncaron | |
232 | /Eng | |
233 | /Ohungarumlaut | |
234 | /Racute | |
235 | % 0x90 | |
236 | /Rcaron | |
237 | /Sacute | |
238 | /Scaron | |
239 | /Scedilla | |
240 | /Tcaron | |
241 | /Tcommaaccent | |
242 | /Uhungarumlaut | |
243 | /Uring | |
244 | /Ydieresis | |
245 | /Zacute | |
246 | /Zcaron | |
247 | /Zdotaccent | |
248 | /IJ | |
249 | /Idotaccent | |
250 | /dcroat | |
251 | /section | |
252 | % 0xA0 | |
253 | /abreve | |
254 | /aogonek | |
255 | /cacute | |
256 | /ccaron | |
257 | /dcaron | |
258 | /ecaron | |
259 | /eogonek | |
260 | /gbreve | |
261 | /lacute | |
262 | /lcaron | |
263 | /lslash | |
264 | /nacute | |
265 | /ncaron | |
266 | /eng | |
267 | /ohungarumlaut | |
268 | /racute | |
269 | % 0xB0 | |
270 | /rcaron | |
271 | /sacute | |
272 | /scaron | |
273 | /scedilla | |
274 | /tcaron | |
275 | /tcommaaccent | |
276 | /uhungarumlaut | |
277 | /uring | |
278 | /ydieresis | |
279 | /zacute | |
280 | /zcaron | |
281 | /zdotaccent | |
282 | /ij | |
283 | /exclamdown | |
284 | /questiondown | |
285 | /sterling | |
286 | % 0xC0 | |
287 | /Agrave | |
288 | /Aacute | |
289 | /Acircumflex | |
290 | /Atilde | |
291 | /Adieresis | |
292 | /Aring | |
293 | /AE | |
294 | /Ccedilla | |
295 | /Egrave | |
296 | /Eacute | |
297 | /Ecircumflex | |
298 | /Edieresis | |
299 | /Igrave | |
300 | /Iacute | |
301 | /Icircumflex | |
302 | /Idieresis | |
303 | % 0xD0 | |
304 | /Eth | |
305 | /Ntilde | |
306 | /Ograve | |
307 | /Oacute | |
308 | /Ocircumflex | |
309 | /Otilde | |
310 | /Odieresis | |
311 | /OE | |
312 | /Oslash | |
313 | /Ugrave | |
314 | /Uacute | |
315 | /Ucircumflex | |
316 | /Udieresis | |
317 | /Yacute | |
318 | /Thorn | |
319 | /SS % Germandbls | |
320 | % 0xE0 | |
321 | /agrave | |
322 | /aacute | |
323 | /acircumflex | |
324 | /atilde | |
325 | /adieresis | |
326 | /aring | |
327 | /ae | |
328 | /ccedilla | |
329 | /egrave | |
330 | /eacute | |
331 | /ecircumflex | |
332 | /edieresis | |
333 | /igrave | |
334 | /iacute | |
335 | /icircumflex | |
336 | /idieresis | |
337 | % 0xF0 | |
338 | /eth | |
339 | /ntilde | |
340 | /ograve | |
341 | /oacute | |
342 | /ocircumflex | |
343 | /otilde | |
344 | /odieresis | |
345 | /oe | |
346 | /oslash | |
347 | /ugrave | |
348 | /uacute | |
349 | /ucircumflex | |
350 | /udieresis | |
351 | /yacute | |
352 | /thorn | |
353 | /germandbls % or /germandbls.alt | |
354 | ] def | |
355 | ||
5e13499c | 356 | %%EndProcSet |
d3ad40de | 357 | %%BeginProcSet: texps.pro 0 0 |
37c41ab1 CR |
358 | %! |
359 | TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 | |
360 | index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll | |
361 | exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]FontType 0 | |
362 | ne{/Metrics exch def dict begin Encoding{exch dup type/integertype ne{ | |
363 | pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get | |
364 | div def}ifelse}forall Metrics/Metrics currentdict end def}{{1 index type | |
365 | /nametype eq{exit}if exch pop}loop}ifelse[2 index currentdict end | |
366 | definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{dup | |
367 | sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll | |
368 | mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[ | |
369 | exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}if} | |
370 | forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}def | |
8a9c66f6 | 371 | end |
37c41ab1 CR |
372 | |
373 | %%EndProcSet | |
037a8b7f CR |
374 | %%BeginFont: CMSY10 |
375 | %!PS-AdobeFont-1.0: CMSY10 003.002 | |
376 | %%Title: CMSY10 | |
45c0f7f8 CR |
377 | %Version: 003.002 |
378 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
379 | %%Creator: David M. Jones | |
380 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
037a8b7f | 381 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSY10. |
45c0f7f8 CR |
382 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. |
383 | % This license is in the accompanying file OFL.txt, and is also | |
384 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
385 | %%EndComments | |
037a8b7f CR |
386 | FontDirectory/CMSY10 known{/CMSY10 findfont dup/UniqueID known{dup |
387 | /UniqueID get 5096651 eq exch/FontType get 1 eq and}{pop false}ifelse | |
45c0f7f8 | 388 | {save true}{false}ifelse}{false}ifelse |
37c41ab1 | 389 | 11 dict begin |
45c0f7f8 CR |
390 | /FontType 1 def |
391 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
037a8b7f CR |
392 | /FontName /CMSY10 def |
393 | /FontBBox {-29 -960 1116 775 }readonly def | |
45c0f7f8 CR |
394 | /PaintType 0 def |
395 | /FontInfo 9 dict dup begin | |
396 | /version (003.002) readonly def | |
037a8b7f CR |
397 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSY10.) readonly def |
398 | /FullName (CMSY10) readonly def | |
37c41ab1 CR |
399 | /FamilyName (Computer Modern) readonly def |
400 | /Weight (Medium) readonly def | |
037a8b7f CR |
401 | /ItalicAngle -14.04 def |
402 | /isFixedPitch false def | |
45c0f7f8 CR |
403 | /UnderlinePosition -100 def |
404 | /UnderlineThickness 50 def | |
37c41ab1 | 405 | end readonly def |
37c41ab1 CR |
406 | /Encoding 256 array |
407 | 0 1 255 {1 index exch /.notdef put} for | |
037a8b7f CR |
408 | dup 0 /minus put |
409 | dup 13 /circlecopyrt put | |
410 | dup 15 /bullet put | |
411 | dup 33 /arrowright put | |
412 | dup 55 /mapsto put | |
413 | dup 110 /backslash put | |
37c41ab1 | 414 | readonly def |
37c41ab1 CR |
415 | currentdict end |
416 | currentfile eexec | |
037a8b7f CR |
417 | D9D66F633B846AB284BCF8B0411B772DE5CD06DFE1BE899059C588357426D7A0 |
418 | 7B684C079A47D271426064AD18CB9750D8A986D1D67C1B2AEEF8CE785CC19C81 | |
419 | DE96489F740045C5E342F02DA1C9F9F3C167651E646F1A67CF379789E311EF91 | |
420 | 511D0F605B045B279357D6FC8537C233E7AEE6A4FDBE73E75A39EB206D20A6F6 | |
421 | 1021961B748D419EBEEB028B592124E174CA595C108E12725B9875544955CFFD | |
422 | 028B698EF742BC8C19F979E35B8E99CADDDDC89CC6C59733F2A24BC3AF36AD86 | |
423 | 1319147A4A219ECB92D0D9F6228B51A97C29547000FCC8A581BE543D73F1FED4 | |
424 | 3D08C53693138003C01E1D216B185179E1856E2A05AA6C66AABB68B7E4409021 | |
425 | 91AA9D8E4C5FBBDA55F1BB6BC679EABA06BE9795DB920A6343CE934B04D75DF2 | |
426 | E0C30B8FD2E475FE0D66D4AA65821864C7DD6AC9939A04094EEA832EAD33DB7A | |
427 | 11EE8D595FB0E543D0E80D31D584B97879B3C7B4A85CC6358A41342D70AD0B97 | |
428 | C14123421FE8A7D131FB0D03900B392FDA0ABAFC25E946D2251F150EC595E857 | |
429 | D17AE424DB76B431366086F377B2A0EEFD3909E3FA35E51886FC318989C1EF20 | |
430 | B6F5990F1D39C22127F0A47BC8461F3AFDF87D9BDA4B6C1D1CFD7513F1E3C3D3 | |
431 | 93BEF764AA832316343F9FE869A720E4AA87AE76FA87A833BBC5892DE05B867F | |
432 | 10FA225E233BCFA9BB51F46A6DF22ADCEACC01C3CD1F54C9AEFA25E92EFAC00D | |
433 | 7E2BA427C25483BA42A199F4D2E43DFCE79A7156F7417ACF78E41FCA91E6C9EF | |
434 | B933450D851B73A6AB6AEA7EE4C710CB5C14270D1674FA334686653793FCB31B | |
435 | 491E870D3C2BC654D2C1DE463EC9BA29D7371AA1078800EF93D3F66263A2EBBB | |
436 | F5723697BF7448BD0D2E301544BECF497FD475B85DFEF52AF4F8F8BE445CABE6 | |
437 | 019318806D10C5952157FF8F8286C1EE701545C8F60EFA854EAE66835A2046A6 | |
438 | 915D395F1E0366EFE0C0391583FE001FF16D82A2E2DA5F57754A2C6F69306E36 | |
439 | 356ECF8EFC3F1188AD6FCD2427E0580C97A5B69B4E0E09B85EEDE142F5ADD2F0 | |
440 | 5DE51D6DB72B127412A0D57106C19CA493048A4F815129ABE767D51715B1515D | |
441 | 9C21067CB5BC88741B7298C83EAE36A866DFA87D8981F179B1C31292F56BBB64 | |
442 | 3C430779468AAF07C8A8B4934E1E775FE3F35186BD1FA6EE3689C1C750678AF1 | |
443 | FBF9B23195A124C5C991FE670AC0C86FD39D2B07B9A319E74EFD498B45820252 | |
444 | 720ECDF7294F7B0B137CEB86D33BFCEB8606985A3260FD669E461C8BE94216C5 | |
445 | D434FD8854F44EE66E5A289A9F9E32BC36AF645D53F96652602BAED418C8D726 | |
446 | BD04A1B4617551FE4DEF54083D414F7DCE004E6BB2DC9C2EF7CE232B254BA2C5 | |
447 | 7DCBD36C2072ED46FF711F121A701E2284BF1B718B3164382B8F453D68FA0377 | |
448 | DFE106503B8401D4DB87F5402A3AC9A442FA060B0610A9524D530C7157C26B56 | |
449 | AC970FCC1D5655FFFFA39246E6420CF97D08ADFB7B05822679BD40C638DDF0E7 | |
450 | A97BFE8918B611A145AC965C203F1428812F9D340AF499B3A915B22BE798594E | |
451 | 0F520109FC81E452180AE45B170FF999C5FC2761C6CECD8742A5A6FC97F16743 | |
452 | AD4EFCC6572A6D3F3E4E330C5CB2FF6FEA48A5B64DD3DBE943BD9918D4A18E18 | |
453 | CBCF598AEFBB6AB3CD2CBC9BFD6099272F6543F3E532E0E21E614BD2880B1023 | |
454 | 0AC234CB705827BF016DB84E00E8C255FDEFA0101A842929540B7B4AA8A089BD | |
455 | 5EFF05B72356B6BC3727817823B5CDBB1B963103000D7F2A4E2A1472FC3E614B | |
456 | 5CBCB6D6D784023173DEFEBFA8F9ED87EC1A0A9EE98CA59CFC964CF943DC683F | |
457 | E9E00DA718C4425A705A69D99988EC6F152525C790912C2E46A2381A569424AB | |
458 | 54DF4798BC2D7E7A361E7991641D4B756CE2A7FF4A2848927092C59C2C4B8809 | |
459 | E13AB84FB6B111E680D7FB9F2FFC2C5C66B0B501E4447C2E46C10E2F6124476F | |
460 | A140C404CFE2DC9E0199BF61E035CEB481D438139A9630934E541D261FFD2906 | |
461 | 4CAD99E20655FA746AFB81EDBB5601F5FD6B1D6832A01D585E2C55053F6A7378 | |
462 | 4DAACCAC7608DBDADAAE732D66B3E7F87E79756337C1A961E53A4651BE7C77F4 | |
463 | 038B89C87F650C54A2A90EB7F1D525BB353F33318551EE8D84A6A83C718EA5A4 | |
464 | B2AC0F7306B1E095819B87015A90CA3ED739B09061782C28CDB36BA4BD5E5308 | |
465 | 5CBB70414E4112193DAC4A1FA30996327230D1E021F3CD8115E12D239D93FFDC | |
466 | B645910EB29E40D830E7BAF2DB255FD7C4E776557BB38157917D993EAC245837 | |
467 | A3B515147043574157B8342D829C7228CCEA843ABC89D1785A9672A5923FC4CD | |
468 | 2F3FF27E6FCACF84E2D3136CA2C0FD3EF1EE7354CD04C38B5FB874553646ED2D | |
469 | CEDF7E362EADD04B18051F20A8FB0DE18E152385B9D05F98A3A7EF177824E246 | |
470 | 455ABE69E2F700EB78185CCFC07E3B4C6FA301112528D977367D30D0D5D59EDE | |
471 | FAEB706DDC970A9E296236C725B2B55B09B9C336B8E23CBA5FB8692D56F33B03 | |
472 | 16294E5FC7FAA42E96395A57CE51CA8DDD77442F142E2E576B778373FB31C81C | |
473 | 16840BB422CA827E30A81829648BDF1CA36700EA32AD888D097C1FE0A05B2D9F | |
474 | 483AEE40269DF09AF0D1AD3DF80C45DDC59C2A03FBB661C79B87853737C6D352 | |
475 | 67626B657321B16198DBD6DB98A092F17878AE4698121E1006E53D6F9B0A3BE2 | |
476 | 3FB68828EF854A0CDBAA68B37ABCA6AD4A3D809AAF0BAB1697A81FE59C98C472 | |
477 | 1E33CD70A75A22C249DD11D76C2575ED3370A25892A16D2FD569CDA70C130770 | |
478 | 93F493C7D47D6F9A5424A7A542BAD726BFC3AB225DCEBBE6AC4BE006F8C7C0EA | |
479 | 051424B08305BF2D951AB2986AAFEA04E078CA79B399585BFF0F1ADCED02E15B | |
480 | 8765EB6BF6A8E4D0901EFF2C3AA104924EAD9637A35D877E0C51A3C37DA78CD4 | |
481 | 8643C8CE6DCDDE3F116A6C2390F948E5371BEB5AD2E87B41C5F01FB5C196C436 | |
482 | 6E256A88D082E3F46E4EFFBF605B2EFF1E9D9AD5EE4DDC323A137CD9451EDEE0 | |
483 | 06F7D82898D71FAF2362C0FCF1F726F97F820305B7CE20728CA08C63575083A7 | |
484 | 84BA28B7DE2B916432475510E274C12FFD1660A717F51DACFDF0A102D85224E0 | |
485 | D6DB607BB72569ABB8A7BC6A10354CBBC01732EFE35B72062DF269CB25EA3DE6 | |
486 | DC603B04C90C5912D2C38D7A5ACDCDD3F6F116D884F0D8C528F69D5D47BA20DB | |
487 | 0A9E585C7D8CC3C324FE8A1DF150279F7E8FB43BDB720E624E5E9918032C02CD | |
488 | 8020636AE5C38DA2484B7F4B34163E0D0A561B43B80E97746DC05C871AB620EC | |
489 | C5D47101ECED4A7E25F291184BEF8B80024AA7BB456C1B83A907652B331DEA34 | |
490 | 754226C39C6889EBEEFDAD081E01EF8FE47751987667836FDE4C8BB8A3FD4406 | |
491 | 1E643B4EA37BD370734D1A2DB17C2F4B74B4ED75098B433601F75A88C9A37A05 | |
492 | CCB157EF6E32023BFA33973F3E655A4D58289136996FCFA61EEABD70791B6523 | |
493 | 1FF5DE71AB8A17038923118A5EED8D59C4C58D246FFA9BB26472346B40C8741F | |
494 | 153D19CAFF20DD2A86C6DB89154A630FB1761929FC3F0448EE2F089C1C953E02 | |
495 | 905BA8DE75D101A982A611056C4B237596C10951DD98BAB838B742D3CF7DE718 | |
496 | 617DB72E5268583223E37E029D1C8FD3F1D21690151F76B76C52C725CA135CA2 | |
497 | 8666553E863CE188BFC9B99AF56AC2DB5BFEBEB12FB563D00244EB89E478657A | |
498 | 98AF2E1223C1ABC25A4500E8119B86EB3C26B8A2F3505A3E5610F89B7C34E278 | |
499 | 53FA0A54A7F46D84A35EFEC36AE660A9E3C37EE3864106702DE5AF6C45ABF64B | |
500 | 888A4A51323138CE77DB935576FE6B4824B6942DF80625098CE1B5B32B234F1D | |
501 | 052A9D6039697118A9D793793775D8729D8574A2E74D7109C7B7E23BC5E2E87A | |
502 | CA8E019203952A4892544E1AD3D4EDD22971611358AB230E9A2ABDF00A288501 | |
503 | A01B67C42B33F6B78C39562DB50F4663B922D9BE0D8A150311AE44B83C1F129F | |
504 | 07337323E9A23211EE58E16043E127C6F9574019179F5635648A011266677B56 | |
505 | B5D0201A4E1470B952A1579B57AB2329CD4C615395023C653F784D36B5EE3672 | |
506 | 10D191F29EA508CE84763CA4CE7C2C5229E38E241255A5CABCD6C7CBAED901A2 | |
507 | CA53B5E24111921CDDF83578D33D463D70EDACA0E470D8F592303FB6BFD68B4D | |
508 | 3F3BE2D7C5EC8BBF10C90111A33E205F2649B56E8443F6FAA6C721C66575AE12 | |
509 | D4C40F1F46CF9E9DA675AB5D5840D938780CD9E4AD6736ECBEB6A4397613586F | |
510 | 849B51048AC5F9405E03E14540A5E5582F61CDCDB57EDDF95A8C6705F433EE16 | |
511 | 648F098C03DED8A2AD94AE3DE202D629B9422ABB031318D48F2C85F9DBFA17BE | |
512 | 84708AA3B6C9F81F4508F7A5CB7B6646AB8722ECF817877B77D473F577556DAA | |
513 | 2BA0ABACFCF5DEA7498C47328E873019A956FBB250FD9D8885D21D368FA70CBD | |
514 | 2709D2DA44EE7A9869963EAB48789541906DE49FAE785ECE1F18A22C7E7ED204 | |
515 | 9768896B78E9EB7A2BD6EEC1B26083940656ECD689D92942CC8AF05CBF82AED0 | |
516 | B45A7DF4DD7AA6526FB597322560B9ED3087A65B5EEF1371C328A021411BFE3B | |
517 | D9B5088B2F1AAE381FFED52D2D1E02CD0DA78683E3B06171CBE94BE9760005D7 | |
518 | 135893D7CC2DB097F6AC664D9594CF1C650F84DA80D2EDE04802DBA33CE3DAFE | |
519 | EB7A37E8AEFA4FDA6252FF21E8673DD98E67124D5DBC7BACF361E57077B71939 | |
520 | C1D1FB923E4E35C075CD1BCBE0E80DAEA1320D55B43EAB45D9B26C366B278782 | |
521 | 7519FDC482D98839BF0DF2E7C3A56A1C1A3FC0E57A75CA414F6536C1FE8EB7A0 | |
522 | 4ADFEE3BEDA0F53BE8CF5F64230784A797133E8CD46BCCB3BF38BCE38A73CCE2 | |
523 | 9E073ADE792F7128231DDD1F63E6156ADB2609C200837C2E8A2D93D2A7BC9171 | |
524 | 050C709A71E44E32B1B03C92EB5CF1D3BAB1C38E027DC4ED9AED633D98CD7486 | |
525 | 3F773ACF8AE332631CF2ABE6D606607593FE862ADE31803964E3F4DC3CE3A271 | |
526 | C76BDD95C87CDB3B87BC26FC7A16D567EEC62E6FF0D471B4853DB8A94D4CACF8 | |
527 | 843824F818083F10E88D52FC4253E8203292CB40F1414AE7E51DD7347007C342 | |
528 | CD70E8E9F2D2A13D71213B841DDEAAB208AD9EA644591C15DEB084165F9DF24B | |
529 | B91D3BBEEC2E34E38EF16A0C3F00700A7BDCBBFED2EC0D09601AD6538288DB50 | |
530 | 3478B051B5E16B604A0341FE621A58718D960D699D3FAD284310DCF54EB13175 | |
531 | 19A75A539EE98E804AEA24689D3540F0F12951A3C01FACCE9A7BAF4D0DAFA946 | |
532 | FF65A4D2A4C39969607272C6886F44E90ABE27CA3A1F12A29D9B32E60E8E34F0 | |
533 | 17C5FE43D0E69A99A922D98909B2BBCD145E59A5E7F5426B3988F73B09A525F6 | |
534 | 8BD4915663C1301323180E760BE81CB874B020FDA3AE63340E4261E4F3E4949B | |
535 | CC0966BDC4426190BE9F5D77F76A72AD925662E5FE1CEF9CCAB68F0BD33DA003 | |
536 | F11EB91AC4502FBD6AE48DA0F9D07C35B96B103E379B8A83A05FE728F1716194 | |
537 | 1F650F75BEBADB2E3810388F3E2DC7B19F1BA9E32925F2FD9F19F4E8701F3E4E | |
538 | 4069125D7C401144740691E7A460021A47B1E27997FC1DDABEC5BD0EE0B20194 | |
539 | 2D579C7D6727AA124083242BDA46D8E116E2751C5F298851A62B60AEBE82A929 | |
540 | 9B9F2492BA35690D1EFD16215B8EF14E7A3803B93C28FA41D971B05B6AF3B593 | |
541 | E74AD1E68A5FCE12A86E63B78BFEA87D3949FD164F12277A4688BE96356791CB | |
542 | 8671C49365608F3EDECC109321AF92B4C29CAF073DA3A7D73E913D0D83FAC5EB | |
543 | BD884D4C686056404DAAAD6F82F94F803FA1FB0DD8908D1DF08FB87A8BB83027 | |
544 | 04DE0CBB1C6FEB6B517FBD7CF065120079E608CE41893C2BC96A347826CCDFD5 | |
545 | C69E161217F2127A59F1A6F22037641613F191F22D5B4CDCBCC2EE5615623404 | |
546 | ABA7BE6C5FE475481615B2AC1A2412E54688DD21E44CC9AF5F16E634AFCA389C | |
547 | 4D740B7B51BB141BFAD1080E7C726C1606A28ED492E6BDE9F800EFACD1513909 | |
548 | 84E98CEB6A0B7A2A6F3E1D1DCC3B2552795E0932673E59ECC56DDD37A1D52BA6 | |
549 | C3F0E905978AB568941A163F4CE3AAB5C5B16F86016EC47BA6F3F7AAAA77C3B6 | |
550 | 09C8C3ABDB6D514A76ECD37C37AA88B5860630B3406B494F7725975596F84777 | |
551 | D9CF48686EC9C5DBCC1D78513F591C7C10AB9D153B3D41426B7BF668B0D04503 | |
552 | 56BCB686258462C1DC61095724B9F3312316262FD7C1AEC6E54DE7E5A7BD8EFF | |
553 | 035299B8FD8A4A7B0F51404F4A760F4D8B4C0FB7A32FA4B2383AB6E9C78FDEDB | |
554 | FE6A5788D38A6701B123630C2A6D820A684166FBBC83DB17069494FBD411B333 | |
555 | CB37E2491C5BD035A33867A6D3A3D420CC31ACF43AA07182CAAE67E40EC63663 | |
556 | B678F71D4C6E0EC3A0AAF904CD3AA66E0DE5E3CDE049E94249B39A1C06E3CE9A | |
557 | F974B2484BB2CDA14282B9511E505B3C89F9C802218AE40D1A7541335C5736DD | |
558 | CD565D4B9F4CC78F3A393737EDB4FBD0DA299E21CCFEBA5478EEF013F0552A8B | |
559 | 0BB11FF46CCDB784E8BDCF730A16363E66572049E42C695886EAB42A9AD9094C | |
560 | B635DF4B5B9BD9B9AE8455DFA3EEFC77653190F9A8B1E93B7281C2A21EA7DDA9 | |
561 | 33484745BDF7E3DD63C7AC66C286C9A5A698A5E4D7A91710B7FF943FB23609B6 | |
562 | 4B442F83CB795788FAB5E9CF3F75D5487DA26170E4561C7941C910B088C3B86D | |
563 | F844B0F340CF82786A3FCF347048463EBD2006281A816627065DDA6CD4D3AC5E | |
564 | 2024BC96C7D896381BBB567951E7A1F29D4E95351298B000D29E5F3D0448CB5A | |
565 | CFDAE1BADE9403B90371C3A07D208948AFA022A69C519434B6813086ADF518D5 | |
566 | 88E0B92072A44BA1B3EBB630A13B7AB90992E85B6D67361C8D96F3E0D826FF37 | |
567 | 17B67E4B1EB7BADFD98D7F4FD17BECE740ADF13C141EBF0A91CB105DABB32FE0 | |
568 | 55086D56A0D358841D15FD349E6B95512E4EDF4C430216FF85C2ABE995E4B40A | |
569 | A6044CC8820AD885C07E052B3F91C2E9A1D163BFFD210F7BE95B923E2500DB50 | |
570 | 2075106DB541C267BD450B25B670CE80BCD068D4DBFF2D82634175B61FBD3BC3 | |
571 | 406131F44C7D6F18D375D1F2270829DDF29DC14DBB58A30AC193245D18DE91F8 | |
572 | AB88AB548D8138605BB5A50073295534E314366E26665AE70482B890E4101D6B | |
573 | 60E4F3B37ABCA1346DAAE8FDB8DD9C832EFF3E73BA470E2BACE7B8515CB43388 | |
574 | C27AF99FF9322175CF8D4947E6B3846AFF5163E972156847F58A66660EC8A3A6 | |
575 | 5FB47C9F637B4CBB4C73B6A080B0CF6FD1E9665E92032540570FFCC747C67C50 | |
576 | 822811AADC404BC7ECD1673E8AA6C3A2F1D82F39430B58C29145E2F1B679C46E | |
577 | 94EDC711883F1E4EA84117A54757E8895A40401A26E1437B39A2F65CAADD6E02 | |
578 | D71FA8AF7453668DC613F326A3344F74AD7AC67569AF399385500ABDA5EDD3BA | |
579 | 343CC5EDD4B558467626850E752B9959FEF1454E53E7A3DCBC2255AD8F6AB4FE | |
580 | 894455118A61C58840CB68A925ACCAD75CEACE863D806916228F0614191A1CD5 | |
581 | DC9BAE256018615AA3725834519449B0A88B4F396654E74099C007930ADB1327 | |
582 | DD119BF799FE3B0B223E1EDA04FE2DA7A1C879143E1C33B6C6344F4BA033AD6F | |
583 | 8E88C33DEF1977796B454BAB2494C930F492A518E8198C708A75FFEF8C49C324 | |
584 | A718AB59B889DED521229E741FFE53F98EBE88B0405AD523254FD3FA4BBE96DA | |
585 | DA1C27C1C979A0DD4E61C3B1F4C4DE01E42F1C4435EECFC02D97994BC8AF5270 | |
586 | E7CB1458D76ED0229C5FFB4A23B8716018F9050970895D51722CDE8F2EA3D947 | |
587 | DFF374D84915D5C5D16463A6FFCD079D1ED416C4347BF831FF0C4ADFB61295DC | |
588 | 4D5785BB0852BF472CFC97EC174491CAF961AB90629F055E75DAA6D9898E8653 | |
589 | 5BCF379816CAE46FEA62E7BE8E9B953466E51828172C4DBD0E1BBAD1CE28B5B1 | |
590 | 02B3E36403BE80B49A47446A6677FCED438F01D60EB10F478C89528FA337D0D8 | |
591 | 88D3FC123C076507ACDAF783A9A6E24ED73BF24B6E0F11C13E532DE5F70B15A0 | |
592 | 657F5ED27D204449A841ED19E01432CFFE928E921321113780D036D34F2797DE | |
593 | D4459CFD15BB117B5C9745EF3CD2B296D91FAD48C80B136D94476967E255F808 | |
594 | AD2B5D522ADEC64176833756510391815A1D4A8DA1D0AEE7CAD36A1D161889F2 | |
595 | 3347D5B6BC503300FDDD48F594F391D5FB42C42113C538E707C16EE24A3F375E | |
596 | 7C506E8F49CE50FF9DEF3B4A4C1BEB3848EAA3477349833BA22D2A9012287D8B | |
597 | A8C4CB4307A1188ACC0E6E9338E1559BE5FAFF381BD82A6C71C267409468B3C0 | |
598 | 2C1A29F4281D565836EAE57F680490FEA4A952FF64C8CD11C377C294DCD1EC25 | |
599 | CEFB2B6DCE959D0208F85B6E32E9B44FD455F9B134A5306D95EA29F37BB8B86D | |
600 | 9E592159338E1293F449380E13C21AE42E6C5B367635D8F3EDD0C81B37D0D5C1 | |
601 | 85EF82D2206BA76018DBD8C44955402CE2D267B676DEECFED0F918A438388768 | |
602 | 7DDB1DB399F422D8207FD68296B47EA6DF29F65C0D2C348CB8F01E1EA2D816B5 | |
603 | 1589AA62C940029578FBC01B948EAB0D5ED52C99284933E99D1A992A02498979 | |
604 | 6494274540CF65F40840AD4E4F0555ACB4E3E205CB21D2A719D894EBD6AC97E6 | |
605 | 838F33387EAFA7520FB7D9340333CFD8C917239C7284FFF46DAD2546F30A4D40 | |
606 | D9A0B014A8142D81B552F9E3D569B542CC1FBBCD91243F29ABD46BD09D82B017 | |
607 | 45B9F84A98CCFFF16203C6B60F2A1D215B07C41DAC3EF6C088EB5C7C8D440C38 | |
608 | A1BDBC14E3EEC57B4C334C320CB26E2BD241B95A50C37A3CA5FC10ED997FA35F | |
609 | D058BFEAFE8AB7419EED1C1A41F853C86FFFAAF0682243CD590742552B908E23 | |
610 | E6C11A20D321DBB0F3146F39FF5336993E84AAFD77317E89D3C4FD6BAE405693 | |
611 | 82D5E3EC86EB1AE230280D5138762F7DF3E61024BDA7F4E7DD000099832C370F | |
612 | 165D275B5F615277B7ED7FF7EC1879B9CB97DF3EF836E35676597051B1CD3478 | |
613 | 57991EDCF56F16C0F9492A7B18EB041D5A0B41BE167B8CBE7DFD85E85F19696E | |
614 | 0E13D3C181DE00FF97794144F034FA67AB1CB633D6FD75D94BB9665CC48E92EF | |
615 | 27DF654D70D8FCC85C0C1F684CBD43B5A09F22C265F709F122EC2C91A7BA9071 | |
616 | 409B2AA79354679F3DE43B999A18E23FA6621CB6C788A2D7B2A1A2D505CA5AF5 | |
617 | 6673CA914A5C9B5703B2D45902D1218C54182D0162ED61D208D441E5D68F4562 | |
618 | AC516A7CF9CF2187C259949D14867CC53AFAFCBA1C108534E9DE04FB79CD7066 | |
619 | 9381F77DD9E8EA2B0EA7FBA43C1876CC9D0805B86F53B75CB1533447DF83F8D5 | |
620 | 3765616594F4213A03A581F88626536F177E2D6B55E599B13E6CFE5267CBA5D6 | |
621 | 78D4AA7A031C92C9CB7CB8394DADC469316AF2342FD51D33BD0E | |
37c41ab1 CR |
622 | 0000000000000000000000000000000000000000000000000000000000000000 |
623 | 0000000000000000000000000000000000000000000000000000000000000000 | |
624 | 0000000000000000000000000000000000000000000000000000000000000000 | |
625 | 0000000000000000000000000000000000000000000000000000000000000000 | |
626 | 0000000000000000000000000000000000000000000000000000000000000000 | |
627 | 0000000000000000000000000000000000000000000000000000000000000000 | |
628 | 0000000000000000000000000000000000000000000000000000000000000000 | |
629 | 0000000000000000000000000000000000000000000000000000000000000000 | |
630 | cleartomark | |
45c0f7f8 | 631 | {restore}if |
37c41ab1 CR |
632 | %%EndFont |
633 | %%BeginFont: CMR9 | |
45c0f7f8 CR |
634 | %!PS-AdobeFont-1.0: CMR9 003.002 |
635 | %%Title: CMR9 | |
636 | %Version: 003.002 | |
637 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
638 | %%Creator: David M. Jones | |
639 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
640 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMR9. | |
641 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
642 | % This license is in the accompanying file OFL.txt, and is also | |
643 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
644 | %%EndComments | |
645 | FontDirectory/CMR9 known{/CMR9 findfont dup/UniqueID known{dup | |
646 | /UniqueID get 5000792 eq exch/FontType get 1 eq and}{pop false}ifelse | |
647 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 648 | 11 dict begin |
45c0f7f8 CR |
649 | /FontType 1 def |
650 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
651 | /FontName /CMR9 def | |
652 | /FontBBox {-39 -250 1036 750 }readonly def | |
45c0f7f8 CR |
653 | /PaintType 0 def |
654 | /FontInfo 9 dict dup begin | |
655 | /version (003.002) readonly def | |
656 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMR9.) readonly def | |
37c41ab1 CR |
657 | /FullName (CMR9) readonly def |
658 | /FamilyName (Computer Modern) readonly def | |
659 | /Weight (Medium) readonly def | |
660 | /ItalicAngle 0 def | |
661 | /isFixedPitch false def | |
45c0f7f8 CR |
662 | /UnderlinePosition -100 def |
663 | /UnderlineThickness 50 def | |
37c41ab1 | 664 | end readonly def |
37c41ab1 CR |
665 | /Encoding 256 array |
666 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
667 | dup 12 /fi put |
668 | dup 44 /comma put | |
669 | dup 48 /zero put | |
670 | dup 49 /one put | |
671 | dup 50 /two put | |
672 | dup 51 /three put | |
673 | dup 52 /four put | |
674 | dup 53 /five put | |
675 | dup 54 /six put | |
676 | dup 55 /seven put | |
677 | dup 56 /eight put | |
678 | dup 57 /nine put | |
679 | dup 65 /A put | |
680 | dup 66 /B put | |
681 | dup 68 /D put | |
d3ad40de CR |
682 | dup 72 /H put |
683 | dup 73 /I put | |
d3ad40de CR |
684 | dup 77 /M put |
685 | dup 78 /N put | |
686 | dup 79 /O put | |
687 | dup 80 /P put | |
688 | dup 82 /R put | |
689 | dup 83 /S put | |
d3ad40de CR |
690 | dup 88 /X put |
691 | dup 97 /a put | |
692 | dup 98 /b put | |
693 | dup 99 /c put | |
694 | dup 100 /d put | |
695 | dup 101 /e put | |
696 | dup 102 /f put | |
697 | dup 103 /g put | |
698 | dup 104 /h put | |
699 | dup 105 /i put | |
700 | dup 106 /j put | |
701 | dup 107 /k put | |
702 | dup 108 /l put | |
703 | dup 109 /m put | |
704 | dup 110 /n put | |
705 | dup 111 /o put | |
706 | dup 112 /p put | |
707 | dup 113 /q put | |
708 | dup 114 /r put | |
709 | dup 115 /s put | |
710 | dup 116 /t put | |
711 | dup 117 /u put | |
712 | dup 118 /v put | |
713 | dup 119 /w put | |
714 | dup 120 /x put | |
715 | dup 121 /y put | |
716 | dup 122 /z put | |
37c41ab1 | 717 | readonly def |
37c41ab1 CR |
718 | currentdict end |
719 | currentfile eexec | |
45c0f7f8 CR |
720 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
721 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
722 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
723 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
724 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
725 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
726 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2DB9AF72336CC4AD340 | |
727 | 15A449513D5F74BFB9A68ABC471020464E3E6E33008238B123DEDE18557D712E | |
728 | ED5223722892A4DAC477120B8C9F3FE3FD334EACD3E8AABDC3C967C61FF003B4 | |
729 | B10C56D6A490CE9594D57A2D431B9E5E10FE3D8832E227A7087611431ABCD029 | |
730 | 85F4865E17E17F8CFBD2CADC97E0A8820E3ACEC873F31464466A9545E967E53C | |
731 | DBDDB8478E69063FBB891566BAF88B7660A4405B16834761F041CCF7650AF955 | |
732 | F9E853AA9F5F4382E1FE7D0C5BB4023818A2383F91249D48CE021250EC9EEB1D | |
733 | 2835E18FB73026250B32A8849067D5E2258797C917F998F2D4121D96560C5FB5 | |
734 | B5D3471216639A8671B6DFAC5E3554EC36D9A72518525A795590C74DD70DA3A7 | |
735 | 78BFC43E51D6F2BA52F17D4DD00D389D3983EC54912AFF73684A8A7E345537B7 | |
736 | E62361C04A47859DA084BC72EA53512DC54132EB2EE671793603015652EAFDE3 | |
737 | 41C4B6B679BD60AEC5153EA0D2200CB1D097DAD770F5F31E6FC475A225995277 | |
738 | B867B731D5401E2D02B85BA85158C80FF7E2BBCC42B98AC867E67D25DB656072 | |
739 | 55A0D32AB7AA483A5A9686CEA4E2B3031D90D84DB3E2DEE7706C91BA81CB8DAA | |
740 | 700E5F61E07D6998C9552C81B66FD10A10033D49EF3BCB0FF22ED0A3737523C9 | |
741 | 8F851C61C4BF8A213BF6EC70C956AE48B5BD276CC0437C72BF6515B10739919A | |
742 | F00F6ADD2798CB211668842349171A5AEB0664D2C44397E55A4A9EBDF54A3EF4 | |
743 | FBBCDAD9DAEF4B0CAEF7112FA828F2F8D9F633D37E5516AB5ECEA87342EF8DC4 | |
744 | 3A50548490F5BC9A8A1F98AC7AEAD9D913BFA10CA86D73AEB5BACC1FEEFDCC15 | |
745 | B3655522CCA2C772E902FAB2A6FC153597D52763EB44AB7489FF061F7F58E8F2 | |
746 | AEAAF4D17F36CBFC00D3C653F335D14240C87DB4339DA9D30A5BD1F502BC9013 | |
747 | 461B9DB2FBEEC01BB18990439A0E9CA6576BC9CF6B1A3DB9386C4A5D4AA6A5DC | |
748 | CFA45FB75F22E10ECB72565DB441A194902C91427B4F676E531C661F7A2C3C85 | |
749 | CD534D1C89B6779B2EDC8E44667B992C20C70B663BFBF680A6CF4383EB7CA26C | |
750 | 4D1F06B5EF4025BBE65795F1EDB5CCB97050872D6C07BC2974F905ACDB7A765F | |
751 | 291365D6C8152153E7F017A25FB4476C60FD9EAF9A121633DBEAC32F62850223 | |
752 | D6418566AB350F90F4B35F19598478F76B63E347D4C61E203D4DB8ECB9889181 | |
753 | C387F4B663A502C638761D2782BB96EAC81A0108D7BD6938F67FEBB69218D115 | |
754 | D8E89CFABCE15C6ACC7FEB983332A51A6A73CF4E341574F366713D7FB29956D9 | |
755 | 9BF238A87483D37E526A2EA2F101EDD34E34CB92730DCA7235AA0027189BE405 | |
756 | 2DAB4AA021A30C28B26C50808E1E965C02F6212EC7C72F5683339425A7739380 | |
757 | A422E6191ED8453AF0CAAA424AE44DFA7CC5C2F6EAA8D73A5101D8E9517DBCFB | |
758 | 2858D0E8ECB7DC430EF23A9E4428CB7DED8D035D6050251AC101A2D0E884721E | |
759 | 2F21E573F948048BB8FF888911C508CC198BD750083B339500C426AFCD5634A6 | |
760 | AAAC1C7E91249667B231BBFC64B4317192FE07FE9DA0DDB5E517D097AAE46577 | |
761 | 9555F29D45C67CDE9812CAD03F220B20519F2FF32DCA56A554D4296FE2D1F3FB | |
762 | B209B5270E0E695EA5A0EF1144957CE045881AEB8D05D72CE57F4D34617AED67 | |
763 | 0D3AF0472CD8D60933651626550366E300E72A9C89ACD475C2E2ED9BD44B472D | |
764 | 9DAFE943F8E02A6DC38E447EED964624C37C3130E48211CA279BB6A0BD59466B | |
765 | 42F3D89B5746F29E084E22CF58395AF0F29E55113F3A3F2F52CB3A6DF3D026D0 | |
766 | C81754B8E2E4A15F6943BE9D0087D5166060734FD07C4C57D7C7D90E8C9C1F35 | |
767 | 623CEEE3ABAE75E1A18A1E3B50B7266BD2D8E812CFEB4A46B856885B185640D6 | |
768 | B9C22179551002B94282F57FB433B7FF157D2F0D240836B72AF4A331668AE5D4 | |
769 | E6B85415F4E8B9D2F9AF90FAFAA0A3866DF417CA5A31348CF9B41B8F5F4D2F97 | |
770 | CCF7ADE851B5E2E2F6E319AAF5792EBB9DA2C6AA8B73D889F3CDAA42932CDA7D | |
771 | 07A7E59183CD89520DDFC36E5D513BFD8AD0886046585F29B4D7F42CC0C27AA7 | |
772 | 53915AB1167D292FE91957E94A57FEE2D49C20C9070ECD736BDEE0F046E60350 | |
773 | EA539DC298156A4E0D019E7D481FDDA6861E20678516AB80ABEC1F09B126BCB9 | |
774 | 52E8272A06BB6DD87ACFC423B4A4FC9A3DC8DCAEBB807C5F748F1FF8B17B8B88 | |
775 | F426206BF1B7B7D239D26BC3CF0776C467A98CFBBCA5FB6145D5900137ED19DC | |
776 | D002F10704AA680EC753C22E29AAB15712EF22AF73D80820A1EEE953463D4EA3 | |
777 | 81FAF99518D4FD0F862A324FC44C4B9542A92C5B60CC983CC8F647CE5BDB4D6D | |
778 | B92B380E0E5F7208A9CD91FA9A469548162C761C1BA05AC9D60B766764D821B6 | |
779 | B4E17F56CE455F06EA1EE2D38FE47581746C4C5FBA63AEE2B58E877D1A8FA83A | |
780 | 31C972D53B64E92EEEA147426A92CFBF76FC614119C6E9C6476FD6A069C803BF | |
781 | E949FBE50B5AB1F1463F9747E8D353F7BBD991C4F90F920BC9407D8E24720293 | |
782 | 846D052214E60390C3CB926D38C83AF697425D80C2B4FC4706615B905516B733 | |
783 | 46ACA325CEA68FB21B2D17CF0B68BA4DF249368625CF83441EDBF2B86C957C1E | |
784 | 44CD722BD2537CE84FBA07EC7AE15C840041B9F7F3040072E6084CD55B301C08 | |
785 | A64A53BD4D3DC30DCAC6C152F316ABC59B8EE978793EBD568849DCC2A75A495A | |
786 | BC83470D503F8E389F54B4A4A31624E83C601B43AC1E52CB811FAA7CA6B644A5 | |
787 | 1AE0BFD4FC774C9C9DFC2769ABFA9C83F900BE2DD4010416053A1D4874E6ECF4 | |
788 | D86E44B4CAB15D53E5630C144B0C15B58DAAD785BA298B1893D1B09BA5D40344 | |
789 | 6678FD2D17FF6674433C976D6DAC659175CED26139967C9B2B9CFFD78FC2570A | |
790 | E5142141C2888DBF2DC8503F9137CE7CB21A1EBC2D65BF33FCEFBC85C9CB736E | |
791 | 24E8595CE934AB032CC70BD6A3B0F3BDBFBBE185512FDB7BE3D4A6620478453E | |
792 | 75D044BF770B44C9741E31985E6DAF5A318D7BED12B02A4BCFE60D25EF12843D | |
793 | EFC9BAE2A3F2EFAD66D7858E83EB46BB09D2FF8AE9C43844A7001C86ED97AF51 | |
794 | C511E3A89A1BE349FF5215D1A57843EF51456B9838133846F19BE79AAA5C1AB0 | |
795 | 5F400E5E8E7B0BF96EFCA3B8F0894BE589F2C9FB6C97BD16D38F0A237CD4F034 | |
796 | 099C41F85C7E2C7BEC8E02C4F327306A53B4B48B26A8926670CEEF96F6DF2281 | |
797 | 7C2DAD99EF8B81BBB777227C2475AE7400DC393D9C0445E925DB1E955950F7AE | |
798 | 53E9AC4306794239346A419F7B5DF4168382EF5956B81F83BD4BB7635B3BCC84 | |
799 | 7D84D05AEDC02D14675D777CD19B08124001A4F4EA96990D96000C082A12F00F | |
800 | 7FEF793A7FA69D56D3A38D012168C5458B667190AFE80E02C816CAFF0A71953C | |
801 | D80B085CD286027E2FDBB05452AA762FD7C813B2E19A79C74190E04E746C4933 | |
802 | CE1E300CAF5DD53B08110509BDA404EF07FA1BC5224BF1205DE8E0C3276A13DD | |
803 | 866675103B960C5F36644F96B4FAC16F5D6E91F74629B318FCCC8E8CB13EB76B | |
804 | B0B7B90718D913A52A04732EA3667674994A325A7973C601A7DDD50F658E0826 | |
805 | ACB8E53D4914B0274AED98D7BC3B2B7F9D48A7ECC2F8ABEE05CF2C4F2B90360B | |
806 | B7DF779EAF3E103D1D83EDBE32DDA873768D8C37DC10A5354A94B4153049AD64 | |
807 | FF3E0BB51AB91D7C0B4134D8731CD0270DAAF19BED9EAD800A14B65B68EEE89B | |
808 | 40DD624111670DDC7C030DEFE0D1B96420E249332445C155BA96231C88E70643 | |
809 | D526BDF3CA1E05FEE72CE2B881CFC01ED780C10E89F0828AD55FE29043BC56E8 | |
810 | 2750A6DD15AADD54492F6092618F4CC6A31766B17FC60766D18C307EFC9BB787 | |
811 | 39047DAD6B38419EFBA46B4E2C932F97451FE78AD75FA90DE409FC6DD46585D2 | |
812 | 1941F5ED47A8FBAEF5A917A240959E8D9F9917DEA3247D9CAE6BF7A88DB4C4A4 | |
813 | F9F5A6DCE542420A032FF3392FE0F3357B51F884D6181583A554F75B1DF192E9 | |
814 | 253CC828FF06B0D992D5316435980B044BB191508C7C45CD90F797F88856424B | |
815 | 14A5707459C50EDCF3E3D8D1667AAA83015405354CE744C66D9A5728F29E0085 | |
816 | 6DBF740717FA0799E3BCC4ED7841588B496A5E549B953A7FD288B4A045DB611E | |
817 | E3B2F35963FF18ACCB1C968BEEA2CBF52B3999AAF89A05320BB2E97F52CFE06B | |
818 | 9F10E3A79865A3059A957F97972D80ADF678A36E2B586C101FC6AFA4D137C13E | |
819 | EE7102C9B8EF78CB057F8B7476F146E8FF5C897FD5503DD198128CFF7B5FB339 | |
820 | FAD0AF0EA967F77B07B367A4AC9F668F8BED99B98E87FAC750EE045602D76C3F | |
821 | 289FC9D97694C96AAC0AD1BD3FA94DF2CBCEA24B40F47B9B59E54EECEE7AC4C3 | |
822 | A3F5D19160E4C1EA830D57FBE10D8D46AC5CA0260F22FAA45236F0F542BEA9C5 | |
823 | 5A88F878F68B36114E0573900C65E305462B22A3429A17C7A567694414DDDA46 | |
824 | 5F30542B8FD4F00F6C295B2E8D3A986B953D96822DB2ECD48E8BB1763434E652 | |
825 | 152EF3717F5E7FA10FF0B01D9F64E22C5DBD7254629658887BACEC0ABDE972EE | |
826 | 67299FB84A05B3EFE22B6976DB4CCA384232DDAE38C31623A4E39EA2E82C1EA3 | |
827 | BBB68F1A7DBF405DEC37CB7203A895C36A44BD2D63F45B3888AF91D37B510A59 | |
828 | 3C921BB44DA620892AD87B665F69F6FA510B071ECC403CB2BE2F54B3969C9E88 | |
829 | 713244BC97C1466DA8216DA7600C221E7E7EF5C789D2E12B36422023A03E11BF | |
830 | 2790FD6062FE6BF62F5010A92F0A104B76E255A0975E04F6F20F760881BDA7F5 | |
831 | D834D1D328B6EC19AA7D5E5678A84C74C82553DBE8BB5765E84F5A8789032143 | |
832 | 6020940B4B8D45FC3433D356E28C25F42D0C19F911213D85951B2B00D01B77BB | |
833 | A4C72E964F9D95422BEDE582A05CD52E03D28A996E6CC8FCD910CBAB728073F9 | |
834 | F9FAEED5470FFA55930447C5BA816F826F983D53EC9941EC8364B3060FD74C95 | |
835 | 26D4F5CA753B574FD2FA4D1D333785241D8741B79E628BC852FDC35478C5ED9A | |
836 | C1BE88C5EE7302816E65C12B58EA16FEDD4672EB3E24B6EDAD5DCE263BA8A970 | |
837 | 350B651E5A9F3C281D85BC3F44EADD0D93402E36489BA5185E7D388974B0B700 | |
838 | 70575188BB610CCA20F081E2CBDA13DCC6F72567962ADB342E02C1E763B673C5 | |
839 | F7384E24C6E1730A3A790D690A2103AEF88E0C1D4480DC9B25E5C8C9E1919C95 | |
840 | F83320179B4C7C4A26D559BFB24D7D596FB73758C9990C451E77FCDDD17763B8 | |
841 | 9C30A9534E3CB6680D3D419D4B70B0B0A0D160FCCDE169714E373F65B7144CC2 | |
842 | DB9A44E041211E1517D3148E65A2486CBE5E74E625261CCF65392FB4F3091473 | |
843 | F9E8DF327D59A58558E5C9F7190DB577D5DC658F5E36258291C708B3D224653D | |
844 | 064BB6079F91293FC733710893AD1C96169B30CBFE4E9D52E7EFAE4AFEE68FEF | |
845 | 1AFD5E7E9DFCE8DE332B0FDC0514F9B3090AC85BBFB527FD8034DD33E9576325 | |
846 | A8769AE09AF1BA792447DDD932B98FC9486B39E0B04DDB3EFB7A30DA0940B33E | |
847 | E27490E0E841E87B1C90E5248A91742ABEDC10F43A8AF0F9C5B4A4930B1AADAF | |
848 | 01874B9AC3B8D0DBECCDA6CD7E96471FAA15CB7F8A599C5746327CE392224C3C | |
849 | 40BD60AF97BCA6FF6FCAB2FEA114D7300B89E91C3BC92D5B3E2C83BB37992D8C | |
850 | 72F661EFD0AA034C738C019DFB79BF40651A1A34BC1EB9F5AAF58F8B3DA32645 | |
851 | 24AFF8636486F08BC21533B5FF7391B0679A78DFDCB03DAF6BB7475A1D51DAC1 | |
852 | EE4BE9B986655D1FDB6936445EF99B58B303FE79F11275EEA96A9F6808EA8775 | |
853 | D873D1052FAC93769789C700F20EB2ED6D15676F6E563A769CA9298E463FC311 | |
854 | 83281483B1C953370D196727A6A0E66D32D9480AB1B6DCA77868C1A2D5DB6483 | |
855 | 5F31EB6B18EEFEF1CDC31533E69B0AFC6B30FC9912DC89BAAEEADC30BE14F448 | |
856 | 1A6B70D36A5D9B01799BEEA686066114910842D022EB464A9A1E8F0A5628BA69 | |
857 | AA9A1925CCADD44703BC67A89F3B48E4680726DC4360274185CF3C8AB747A8FC | |
858 | 4B928AD62B092EFE48B01E33ED756DB696171FDB775396BBA138E056F71EDAE3 | |
859 | 7A1E4CC272B8418114B0E81DE0BC43DB3C133167344488820A92DF10FFA26FB9 | |
860 | 65FCA2C87D302E956DE6B4FE145145440C83DB43A68F8B29A592B127BDF49063 | |
861 | B7F11E155CD4CAE305525BEA56B7C412A6260426407BD892A3F2B444AC3421E6 | |
862 | FB6E6425EB5C3053C5644666B80405530FA0012B54557327C98E0F4F064099A6 | |
863 | 4ACAAFC1870359C1B6FBE7606BB8A26026AE20C212210449905E628AF1B20490 | |
864 | 8CE908B7EF3E3DB551C85AEB0F7FEB6A8D215B97998E5DD9C7CCFB2A9402B8B6 | |
865 | 1770D4023777D4B45A73F471355353412C51D4CE71FAD1E0AFBD87B5F86307F3 | |
866 | 10D0B94F1194EFFB64AD5DA54A4200490F609CA8B912E149F8217ABB1E9EBB3B | |
867 | C4470E7365CF5E1E761AA1945044B225BD53D142F6588C50E0644740F7DD55E4 | |
868 | 8F73201E5354A8BC78339211AFC4935F44701FBA043AAC4BA4698E9D7700029A | |
869 | C79F992F62627C91EB855F64C4B251718FDA71EDAF082A0C7B00550949D617A0 | |
870 | 7071FB14F05620CCF2180941341D8E60FC88823438FD728A4042AFA8B853107F | |
871 | 852F631518B61B234565291B5D5B89DA818DEE3AE3B68A2869DFA63255CC882C | |
872 | 3B16BBA08FCE3632E57FF7A07F857A1F0FDCADAB39D77960BD827CCC8661A997 | |
873 | 648BF5BEBC0FD2286C2A112A8DEB9CCB6330A049170D5D68EEEEA011D3EF3EBD | |
874 | 855236B9380087CBBB6BE24191F728B7EAC5B50F7A547AA0989B7C7D3437DBCE | |
875 | 1669341264E290646F2C8C5A3ACAAC7CB63DC692FAAE13E9B40E8BD39FE16A0C | |
876 | 1660CE66872D061056C04DDDC265C024BEF8B7E3C3AEE76FE5C9702002C28BE0 | |
877 | B180295EE00E567FA2E5CD1638226D24A7C732E1BD8103B476EF5702768689C7 | |
878 | D4FCD47F2AB94A2B1FBAE6ABF87B09E7713C773FB65CA83F7318035B332B9F99 | |
879 | 24A2C8897527021321D003AAD7C273E4BFA2710B9BB26C2CFD3D9A5D7ED1096C | |
880 | 552D50028AE2476FCD6D12A5D0A897521313ED1A3A8456A70C16EAA50A3E6733 | |
881 | 6DC89FEC56AB54A579EF264377A103939D5EE00A90B4F2206D0023AF9491FBE0 | |
882 | 800C6540FC945199E20E945F46CEEA2E885F6800B9DF042BCEF4291A4B1A62C8 | |
883 | 6A7ACFF872B25FA3AE69E0093F3D0FF13A3313430C06F1AF94D500431566F659 | |
884 | E8C859A5F80F5BD2E85C8E32603D3745628E8FE6FBC50FA68F9C3811A2BEFEA4 | |
885 | 5852CAE2AE5AAD3230ED050593BAD0A9581EB7B327C6916B8FC348F4C23E6FA2 | |
886 | 00FA28AAACCB3091C1D83F7BB88672A53A2EA3B8C7C24374E400C57F0F01019F | |
887 | E52D5C47F389D4C9AF126F4080F9AB8D1C8F470932BBECCEC72A9796F6E965A4 | |
888 | 82057DDB43D68298A00880D4C2E2496F26F015FD83C5549215753459310339B7 | |
889 | 6B2961EEEE74DA31FEC8E2BDDA42D4080A32372AC372524BDDA580EF6634ACE3 | |
890 | 128C69D04D890DCA337212B109585C665AA83EFE47D5BABC2627A86EAD11BF7D | |
891 | 744176652C7F9497785A7A06A994ED8414BBE8B26E74D48CB83FA24AAFBDD507 | |
892 | 84A90195EA3D77BCE8C2BEDDD1DC52E8164DF15D65B916EBDF3A8A76849653DF | |
893 | AE3CAF9561AF3B705F75B9E5DFD6758DB65A2FD54683759912E0D0035CFBCD86 | |
894 | 5C7018E5F1DFB86B739C4749DDCFB2F40529E1F15174DF4AE9833958B66ED869 | |
895 | 920CFB9524F05AB2FA84A4AC41A02490699F277A3B4ECC3C31ACF79E884B979C | |
896 | AEFF660A8EEF118C79F8DA266F89F32078B1C333DFA5264D6B64371276ED4DBD | |
897 | 5A2DF213D85A56B1CA85DEA53ED0299C1FA48D463B11FC9A0751C986CAABB184 | |
898 | 829B1133CA8422DC11C6CEAAD463FEB468FC7AA2DDBE2E708D27D89164B12BD8 | |
899 | B9A71A1D06D2FA9ED0B02168B32F6CC0FE765F2AF8A19C7196EE55648E642184 | |
900 | BDF993C99EF7C10AD2A7962DB9B7851E6EE24A0C53475186BB44083AE18254B9 | |
901 | F1CEA0B66A6581C81DE19DA8EEC9330A030F3384C1DF8216E5A25FB38C1B94F3 | |
902 | 403C3541593A016CB5FD306F41F40E82D4561EBCBF76153BDFCF338284348755 | |
903 | 0208360C5842FCD6B2D614387575B6E49F4B5A4DA281A352ABE8B76CFCD94A00 | |
904 | 1C586D19B68D965BD8D7EF0DC87271478CB4D0D1633676A2FC51B36876002A9B | |
905 | F5D632ED778BA9EA1C3741FFCC15AEEC11C8E1544DA7358473325812E50C2135 | |
906 | 84ECE7DCE281956681179C09C0E8DBAC5E4424AAD00FDA269BCD6412F1D6DCE0 | |
907 | 2BC7CABF85AE803D620F5140C63DAC4B0E5F7896343973FBB99486B93B6DB58F | |
908 | 38ACBE8868CC58B3918C1AB4406FBCC7BE8496C78C9D628716BF1E306AA802D4 | |
909 | 5FAC522B1EE90448387DB8E85235FFAAF3754E2317B693D567A488753993B8C5 | |
910 | DA3C8FA50A35202958FD0BF2900A6CE175920C2EC7CD449D4DB189A50958BF17 | |
911 | 644345CC38250088A694CF0F482ECC55ADCD02E17B3CCE66213A6163B8B44C9A | |
912 | 89068E3B5301D2364F85BF9DF7C77342796363A7B6B294CE26DBB9179DC15756 | |
913 | E1B32CE919AF44BC79A3AA8FDF6118345B2AE03F3B11D57D9AF50EBCF7152E37 | |
914 | 15510FBF60F16756FC674E2BF58E88CAB2CA2E8B47F50096C51179684331FD61 | |
915 | 8B34520C9C7D01E1511C924FA76B3CAF79501E0AA2C6E1EC6F00CB6CE24B4123 | |
916 | F493B149B5A5147EF6BF1EF3CD21A76945B95082E1FB3C5A150D8AF793348E8C | |
917 | A988354FA46E3775486A6999E022EBE293E8396C8F9416929607730606CFA772 | |
918 | BC8388BA5D64B79E52DD2048ABF21661121A001E6A75731B5DC43CE040396BD7 | |
919 | B85603C8A0F37E522FD0CBA63C454B12960451CE65A69F98FB2FDBAE725C0999 | |
920 | 05FB68B4C1D320F5F3D61FA8446BE6F8BC46AD9CFA5674A3EC73B8F3419AF9EF | |
921 | 7A1A3C9EDE3BD6359902D4B5F3AB4E3FF9CB2E1937937AFA182C651985703F20 | |
922 | FB70E37AADED6345EF4E83CB140FF92310BACFBDA11F2CD5AD93AA7563D7426B | |
923 | 0D4B6CF9B669F9A702956CA845E3814E4B5491E58F8C89714229942165A6E8E6 | |
924 | 58982D89C4FA7BC557214BF9ACE2C63AD88F2D1B18A04F510211687C35AA1F7F | |
925 | D2003D4E60400B95E70422024A7111D926F1B5A77074910710594B95680CFC4D | |
926 | 911FC16B928D9644340A9D2382767FE6AD453E8E4CBF19F77D3DA2934B11FC95 | |
927 | A6900C3CA3F2B6AE4290A005F908305CB37700680D76C4999AFE509B18305D28 | |
928 | 88C36292D6DA208A8D42F8B81FDEA7E93EE59D6AF3F1A3522EE91BE71BC655B9 | |
929 | 79C49B033A036E1FCD94FC581AE732A224F055503CFC69FBCDEA39CB00DC8A0B | |
930 | 4BEFED99CFC4E44ED51DEDF9EA825FF6BB97D316726531CB4BA083B033C0B69B | |
931 | 8068D5D3E3E31DED5F6267439F149549A6E12B00BA85818AEB491978364D9F7D | |
932 | 7375CBD6C5511CC846D0058BD2CE5467EBCEACE5CBEB2D33AC8E12A84CA620EA | |
933 | 99A0ED916B7770A056F6A9C361CD5118B5DDB10A5A4E643FFB8FC5DCBACDCB28 | |
934 | 696E26D030C5918548AD8B87E21E1B4BAA91AF23663CDE350A21C2CEEFD28947 | |
935 | BC07BB49404FA39F251E36B95B7338EF03F2E63FBE0E023452097F21931A2599 | |
936 | 4EBA7BFA669EBEDC0F5B33375DFE6DB1638D19D4B5112B5338B14C93F707D340 | |
937 | 056B2B75AFE418EAF9CD57ED842F7B5FFF037B3A4B369C63E4DF9F0BDB4E39C6 | |
938 | C5BE8EDA628F1C6FEEBC9D9886DBE502CCAA86092646094118069757DAC25C38 | |
939 | 2CA53CBA27577BAF2C57196489CBA54B96C650A1C130184A4444CDE2D0CB1A49 | |
940 | FADCAF1FE3A66334F85FAFB00F142F28AF2D8FEFC29FE8E0FDA448F181040BF1 | |
941 | 62EA7AE75100BA46B49EF30F596CD9091164AF70666E254938BF6A44F01BBD2C | |
942 | 4160164FD89FCD358E48908BEFBAAC4411B52390CEED6B46D729698CCA8E164C | |
943 | F77CEBB50C5254F81570E414B1E9E79269D3B2575E161620CC732C0405A29ED7 | |
944 | 1E5A6597D35B11EE08DC09FC9C27F0126C22C73A0EED657D7F91790777E7D8B1 | |
945 | EBAFB0EC9ADAEFEF7F6A91A1028E46D76289EB1BC15D3597CFCD78D88B633759 | |
946 | 93CB4477596E28A1E413BE25D513BA611757C994AE812C5A6D9AD3F770499252 | |
947 | C7F53E585E03B2FF056EECFB7ABAC474A981D757AB3B6F281744F01713782887 | |
948 | 9BE48307BC5516A067743C054A3927E015AB0B2AD2D80D229BA32FDAB660C3C2 | |
949 | 40DE8C83E1E4941B8D765B879222847F855960604EFF94E9D99E4AD0FF2E887D | |
950 | 54DB39B984A9E9F69ABDDBB2A452661703841BE79200EDF24C4172D736B461E9 | |
951 | 8BC314AC1CE1650083B18B2AD809B5F2DCB314651433E357042A8AA73A184D38 | |
952 | 290AFF0443C4A293CA6F04643EA3C313FC6070D76400B0BCCEDD20B5F0A67200 | |
953 | 01584F0062794AD3D82C83FCE4380E28312815EE20DF3DD21D381046940A8C96 | |
954 | 4DFCB07E5A558DBF1DE489FF4FCD1C851A597B0EA58604BD16DC8FD89B9E70CC | |
955 | 36F99E8327E9112D98C1AA1C355FEC942E879C3CF8C358FE955B1E2518C81270 | |
956 | 9BBB3F4BDDB57D04685FC0D90AD3566A81086B3BF196B2CDD42BD1455F588342 | |
957 | C817CB9E0E75A0A24BE751B46DE8DC974554DF975D02864773F2EE856A0CF595 | |
958 | 0D614F71A1AAF4A72DB4E5896AE9C2B33F993C006DD7F644DD1B3AEBBF34AF8F | |
959 | A809C51EEF38E3912E82F7F15F4DBB9D6E5D7974B1B871AB3F3A48B72F0356DF | |
960 | CAD862D11273580D1BEC9E88931B7B9C74B8AC3DB5F3B3FA05213D3CE48C0F2B | |
961 | 237A7DDC33D850D1B2B5B8CB7CC1A1A2221451FFF0AF88175EEF18EB932F47FA | |
962 | 9A8A97F92B6E2A01CF8BDDCEED9E1776A1A3D4328FB7F8537689CCE7F145A8A6 | |
963 | 2DAD7C9C23C0DBA934E4803FCF9E7C292E67D748F972415E62E56B60DE016930 | |
964 | B82AD792313A7D1CE655B0E08076AEE57E1BA5FB00FA2B264771507126FDEDBC | |
965 | 688FA19EF5A87B5958A952A2CE751BF57B84FF314D5A005C32D5E7B63A56F336 | |
966 | BE5C5BEDAC69462C93252A6C5CFA9C3AF6C40C8A2D13A738DBC1730D665FA91C | |
967 | 60280FBCCF36E3EDEDA845C74817706474551248130533880FCB0B81C5BD0340 | |
968 | B85157690619844D18A13AF540F18DA0AA3B172636B1FFB5380D937F11BB8F48 | |
969 | E14384548CD17D33133B624733533E20C1C7A68F32C814E73C790EE009EE9721 | |
970 | FE6B3C0503A45BF0D1747BD8D5E55E0021A12F97D8A913EC9AC33856CE65D0C6 | |
971 | 4BECD978E7B1C5A22FB51800C9B554341C40C619DE8053C50A3828E2B2AD44BB | |
972 | 54F2D6AD9B0EF34235533491A2C369324D5045A6A72041FC486D20370D571D6E | |
973 | 8ED76A32C6F4CB552933AE68B1E71945F9316C6F5DB23CF258A27C358D8F207A | |
974 | 0B19A734F426D447CD45F2ECA02BE75BE30DAF9FE2F84DBB35DAF6663F34D0FC | |
975 | C25F317EBD33FCFAA24848D0F56B54009C105B42BF5CD900AD2C1393D57EE2E0 | |
976 | 6438DD0ACD28B342F813A7C9C0D1CF42E459589F5D7A102F8551158611E14AE4 | |
977 | 9033B687C0D41927D592D79F14FF0467EF256DD23FBFD7AAB6D514C0A7204009 | |
978 | A1B8BB21323997EFFBE265D369AFF7093B13E98A26AE4B55F9F5F5B5EB77D844 | |
979 | 7F1ED62F1A030DA13046FB40C94080BA76C9C7F25AEBFBDF76997DAD76884D80 | |
980 | 854959216CF55D0A4F13E559B9382617523947D1E5BCA59E7CE7BE0EAF7C269F | |
981 | 4887C747072D7C96115B9C1145CAB6BEE769A4CAD44518413FA7BBEA3DA15BBC | |
982 | E07087389695E766B103DDE55D1F8C1D04F9FB3334A36942CB754F89EBF3EFF0 | |
983 | 679DF5BE6C3E6616B77FE1DC41B111A8029140BF783F2F27268E54CBCAABF4BA | |
984 | FD116E27995957C0CC70B58A501847218F77F84AD941E244D1A72A50F537720A | |
985 | 4BFFD96C7FCFE7B4A79A0BC31377D462371E4024166CDFE5186AEDFA642EABF2 | |
986 | 9FD28CC8CC0C57B2C883B10357C5446D501D0803338FA9F50816D17F6FEB077D | |
987 | 5DCCC960972610D8AD90DCED3B00F6FBF110FCA7E929E7D393C508DBE61CC834 | |
988 | EF0AA977EA93C2A3C9CDF7E5C608F838B1B3CB734DD982A1AC623ADB79254851 | |
989 | 474E0E1C2AED4B35A9A18010451F2D7482A9DAC24942F38E8B1AF5D2AD6AA0D1 | |
990 | BEA5DB0D318A434EBE068EA54431DCC06FA6F926172B8E50CF99A61745EE3372 | |
991 | 49520D7C1B343AAF52BF71F3905BB01CC894D8DE06AA256BBA16F57EDC72094C | |
992 | 5AF15066607143AFA5878C3090E58FFCA4723DFC356BE32A4F3CDFB06D012A67 | |
993 | 892C6A003A3882F41F09AB778C8E8E10C1AF7C458194706535EA8D4072A61E70 | |
994 | 9176ED028D863C9E5A0AD6949F439A1FF4FADBF40E5E928CEA8777FC00DDB0D1 | |
995 | E822AEC89BB6B4B336070F0D2BC30AA4AD2A11DBC1F8B9B0549D50949CD3F47C | |
996 | C71FCB5081AF3D9E311A28E18E7FD6289B11D1A39EFF0497D9795B85E260F970 | |
997 | 799696C14BA5D5B9151C72DB327CCE9AC8AF75125DA580A2ABBD51E4F6CB72D9 | |
998 | 9ACDCDBA1CD5C9B03898D71294D500F3FB5CDAD4397430A86D6B3977CA15A2CE | |
999 | 1A87CFE80A49CE46988BEBBD8A7860937AD2DF3DC11005ABB4773ECF0007BD95 | |
1000 | BBF8837949DAA8988D6BB30E422E9DAA401D4FFD63015B094F0A457FCF9AAE88 | |
1001 | 3F3E024679830D4150E525BCA3498B184EAF19AD2867770F1F03469433077651 | |
1002 | 0094B6581D5B0E54EDD40111A97E60E73C0B9330C9CF68A003D9749902BC0ABD | |
1003 | 8474348A4869B6FD17F55C705C12C31A028151848C6737F72698D1BE9C7088A6 | |
1004 | 29E22CB19BF8E3042249D0C2583101AF3ACC511A810D47A473FBF542EC8209F2 | |
1005 | A3D16F24E2DCABAE3CCCF382BA30E258AB884479532DD04A6DA6604DF2B32625 | |
1006 | B3CC54C079281BA50EDDA55B30154547E9A8761659AADB488A018AEEAF68F80E | |
1007 | 0C7034F74267EB98E471E5BA1A9BEE783C32BE433A46FB39D161210FFB2D862B | |
1008 | B62B8EB2B3C4A5C51A5214B96FB4FA1E040BDA70507B5B20071E401C23CFC0D7 | |
1009 | 702EEEDFE1CE5419628C804607362866A89FC32212EC9A32400E65ACF2AAF06D | |
1010 | 2211C1013BB3178BD882E77D1781AF39374641925FDDCAD306E8C03E28FE4104 | |
1011 | 750D9AF95BFA667F3A2992A1DD79560AF95D3B5398CD3BECF601C7A42B9B0D30 | |
1012 | 943B26DB414F1661C0EF2A1E8D8191E649AF2A33D3F1A4F340F7CE44B95C923C | |
1013 | EE17F390D1A6480F1C10D55EF9B8007BD1FED5ED6123F9998225BE27A8E6E2B3 | |
1014 | 5843A30AAC796EEB9C47F143C965AD99DBF3AFDB7B491C465DB02CD8DE18D62F | |
1015 | 9E3201C95B045490043DA9DACDF9DAD3E79492DF5B2B33A85B2610A1CF604F98 | |
1016 | 913BB447E6FA6834AF454BA5D841B7D8EFD9733FA010ADEF81A2E4C2D6874D8E | |
1017 | 80811743BB114A07DC96A66E8520A4054BC1AF6C080147BF8C0B55678194467F | |
1018 | 909043328297E38C777DA2104B14C0E7C7F0D6AAFBD5CE82531DA83DAFAB4059 | |
1019 | 70DC981AF4E6A75187B499A13D918600D4D68CB073BFEB8F4EC1E48451E10236 | |
1020 | ACEDF95B93467357C7028C6BC1AFE878E1988B39DA06C2123727AA6549815BD4 | |
1021 | E88BE89E04CD0D9226C8FC0118CB9DE223ED54684A86284D3F6E0192DD8EC04B | |
1022 | F1E5ADC9B5001C6A5D57605EAE071648045C256B743E02DDE3729D4A2E82BD0B | |
1023 | A448C6153732FBA2B507607517E0E8F4B3A44A4BA58D546C5A446100B9D94033 | |
1024 | B68D986182DBE076AA0BF2BA88B85A1EB27A1F4F48C77987A84E9FC3F2BD19CE | |
1025 | F0359FB3C2C0E4A1908D209F78C64A1B6C4F6F9DFA036B764F87715B7AB94E4C | |
1026 | 153F2640F2BBF27A088F1BD64455648CC448B808F15FF1A1209EBC6C6FAEC16A | |
1027 | B2D161F097766B771C80593A0225256080B651B0BC64B5D07A04DC34C767A796 | |
1028 | B371F1974633D579A7BBE8F5CF1152AE55F7F0766A316CEBBF79D7C59F11DDFB | |
1029 | 6A89E19FF51BFB7DF15FDB6045892B586B6BD1C86C85E01BED07F0E60270B4D9 | |
1030 | 2302E6572419FCF662763ED382EAC4FD445BCFC78F62C1CD65F9D12A35EA2D97 | |
1031 | 22B818CE6C8CED2C7EEDFABC2F54E043A9DD67645050C2A715093A7EAEAB21DC | |
1032 | 99D14DD19FA2A6A268171AA569A86E6F879F4EBDA7A992F2F6F4ABEA25C489F0 | |
1033 | E4123EE182BD059A8515708BCA74846920202EE2ABBE9D53DC2CC16BBDAF02C5 | |
1034 | BD46600A6E80BD3A477AA960A4A2906651A7338419529F30755BFB064ACF916E | |
1035 | 9F4D354C309DBDB3479EC7F9F5EFA0058E10742DB647B0C45EB886A2F997DE9F | |
1036 | 534C01676E9EE0CC91DAE378111A7B0359978A43F1CE9EA98AF86FB5C59A894A | |
1037 | B418CB112B4BA5BF017A7AC5D2D1F003FB274715A1D35B4BCCE309FDB9EE0DD1 | |
1038 | AF8567E3F5002155C6413A31D8970CB1A42A6D6E16B67CB24D1609EF671DBF2F | |
1039 | B1085E1505CB05BEF96770B176A19F521D60B2F9AC46A5464A2401E2945F4559 | |
1040 | 1D0603255DCA93B1F958381D3DB4A5FED62548BDEE0CBD9977AED1F17A00F19E | |
1041 | 1CF565C08EC5B4DE3C108B15615285BDB402A4480EFA1AD102846B3E543EDE5A | |
1042 | 5E6F7D37743479426F267415347E4C356B92F7D5D4A0632F333E5CFF2870FE19 | |
1043 | 6C398FD66A952EFD26CD6C3BBC23041CD57D0860BC421D710D06E2FEA071080B | |
1044 | 56212A069CDDED701398CD9185BEEF08FA0AB16C97C7FE79FE16D6A6B11B7AF1 | |
1045 | A8816DEA4F99D2EE29A357913C51D569700D5C84A52ADD60F9E75562567E9AB5 | |
1046 | E35A1A1F656D12D0EEBD2AAB9846FAB4F7DE2699CF6D100E973DD0E5373289A9 | |
1047 | 570A364A562306BF8501CACA8DB84C63F1EDE6BED1432B138EE201635897586E | |
1048 | 912EDC76BACE7047C529617C42582643BACEA3DE8B895B2AE895F77B140C4E15 | |
1049 | 69E8ED61B57223B2BBC5C9E5A9A4475A2FB97BCE4DBF40280469FB1C685884ED | |
1050 | C5974BE43BEB2A20AC947BEB1CB5CAC0A35E0D7671702AC28BCC4A999E57DA38 | |
1051 | 194210379106144B965CDC4F246D0CACA7CD201A72007CE0C5FFCC37EBCF76E9 | |
1052 | 45A77F7FCF51C434A9A89A020CA63A27A65972C05887FBE1BBC42B4F4F73957F | |
1053 | 7D33819A42CE80975F3034FB97366691F43273B5B93E472B51D792AC8BC7ADD1 | |
1054 | 3519A5AD82C8A0087853DBEA22DFAD4B8534D21B8FC56316AE951E53F81EDC7B | |
1055 | CADBDEECE84759DA9C23073B64561BA02B8DF0C2459165AF170FB95B316201BE | |
1056 | D38F5982A2609E1BD8FBD493573F4E52843A2CD17B30B715DBCD82146AD366A6 | |
1057 | DCFF854DEFE6B59491BB56B0632C28D29AA90C76DB5FA0C1F9B128B9B12D53E2 | |
1058 | DA7BF86CDBB5E9432751AC5476690DCDA8F8F8CCF639FDBA2DEF0CA00BCB5011 | |
1059 | CECD240F45B271B6015EB7B7654CFB5DA4A2E8F320FB1E9234B98626D9D8D8F4 | |
1060 | 057FDFAD9811182BD620CFF4DE2864AE715AFAD34840D128A30AFD1307FBFB6C | |
1061 | 876DDE39C2796C1718ED8A2DA7D9EB4D4341DF3F534419618FE709DF8BABAF3F | |
1062 | 3FE8288D735493B788668B75845CCBAC3F8C00CFE5E1552DC7107782512C509C | |
1063 | A20C301A0DB7BCC34CB41D75A104E27B6059B0C3A6C504DF208CC3BF011D04F1 | |
1064 | 2AE2716010DDF5AE6133701AC7058B43118C84B41CCC0DC299B6606912276854 | |
1065 | 4B83958032CB8EBA71753D1BEBED53D2EEA20CF31FBC5072B2EAB23AEBE5248A | |
1066 | FA27968481E19EB28B98414B7D31C7F26BB1924B291C366EBB48C571B3A7926F | |
1067 | 749B80FA339E44259F0119A5BD8B57E08DA3D0742043E5BC1C19A346B4895AC1 | |
1068 | 3A04F9343956FF300493843F4E4B099F729BD3FD908A6DBBCFFA5ED0215A0BE3 | |
1069 | 35ABF720CF166B5BCDD246BF0FDCBE949150BEF341C9E69E05FCC71E0C3E16ED | |
1070 | 4CF58BA615D931F318A071CDDC95EE4F7C5115AEA57B7858628F8E13DE33E771 | |
1071 | 1F57861F42DB53EBBC4332DD5D3F96098E01BD1D66EB13144C2CE6A0558279EA | |
1072 | 51742CD7208D1C1E65A283D1CA73556856863CD47D78D1FC79CCE077BC2E5D14 | |
1073 | F10606DA0FEBF17CF8401A6CA37CFFD262A87432223A80BB1ABADED4261D46EC | |
1074 | A83D208F90699DE6C9A389BB96F6C3F4E02777D308C2E3F508A14E21B1446E2A | |
1075 | 33BD47CA44355E7E128C73B9B3CCF46F50760248270603260C40BD9FCA63C01A | |
1076 | F3270E80DC263E0B5BEEADFB0AD0EA48ACE0023AA6EBD736AAD1E999C492C674 | |
1077 | 167E3746D71B4F58E6CD01B59C73A1E3AC18CEF0891FE511EAC8444133133AB4 | |
1078 | DC7CB359F92E7C53DE1E022B448E7E4E566D4FBD0096F4583EDC6756797D8635 | |
1079 | 523B99ABBA63EAA2F25F1AB5F7C687D41B933897E1F8B27A6952E46381EF63BF | |
1080 | FBA20918503CE2EC45C1A17E29CB5E462DFB547958356E2FF656C3A7C600F28A | |
1081 | 888A1B5DEE4D72CE606CD61AAC7E426BAC6119584F552F04B3D7EC96ED1EF048 | |
1082 | 0FFC3B36569070BF4FCD2E46B3792E3A365D695CBB7E4826B4C83B1BFA88FDD2 | |
1083 | 133A119122B249CACAA06EDF17D451B21136D01E343A78F365A0116510CB5C2B | |
1084 | E947F1ECF2A62A32330D778525EA0D577B8F84FF34C27E30FC3C650697B96139 | |
1085 | C54204EA3DBFD74E6C42281A27C121F757FECCE281DB11740E3A56F380C79471 | |
1086 | 294ACA3D94D03F62AC700C4B9E53C55AA423C5E0E7581192DF9CBBE60753DD4D | |
1087 | 181FBE50213D9D0705DA4CECF039B959308EDBFE219BE4E0541D30175E448717 | |
1088 | 8496143152423969B755D9CDA8B1329836CC618BC0994B93DD83578BA6FDBD21 | |
1089 | AF4923DC8E1075B8BEF515738F2E681DB3D6E9AF5F7AA7BA32FEA6C6C10DA83B | |
1090 | E1E01A0359A25C564AA1739D56FB040C56018CA5E8F69EDDD735BCE0EAF3EFCF | |
1091 | 7E9E6696C48AE1FA14D4CEBAA680170D300027C1329DFC81CB6C2349EE9789C0 | |
1092 | D15F7F2E1490447870E09FD26D40F18E5DE32E945996FDA4E8A9F77995C9AEEF | |
1093 | 24E82B7F26D107251EFEFD92A62FDC3E46E357EABF76D4B7D3543F02A33941C3 | |
1094 | 0EA0A9E1691533C2E2EF79E02E0C4579794418496499C47C1E01C03D30616371 | |
1095 | B14C9850A0FF427FAD4F21FC84777EBB8B0CA14F7526C37779D1ED6ED2526E29 | |
1096 | 1072467F0AC8079F509C634445322A859FF846F437D6455A0AC702D59B0F932F | |
1097 | 0EF41B329F42F83566FBA693B87C45E95D743F6523DE11DFA2CF7144CC329060 | |
1098 | BE3C24F17A584998B4EFA6E48CB65ADC840D6554793A9647E3BFEA0B865832D0 | |
1099 | 9657A13D20641ADE20DDAC86D26583F5DA14101DA5C971CB385FAB7F4848CB1D | |
1100 | 8800CC239CB3A9E79FD1CCB5A667DE7184EF65A459FFCE472240A803D0ADB5C5 | |
1101 | 7FD08B11C77EE7BB13B787DF3E01B99D57D101D8B209B6F7A274299E1EC57BDE | |
1102 | 0D385104C7C0D5F0F835EADB865073C334B74BFD2F5F34705E07334855658D49 | |
1103 | 4A1FDE32645FA4DE91CDA7B17B941D0B23F104BB3377E983099AB3B61F794956 | |
1104 | F4854DF574FDA0B4C356C90ACBA0963F98390FA630BFEE1E2D9F995FC82BCD6F | |
1105 | 8C658B842D9574AF472082B60E52CC67070DA5AB29A7C973C9399749018CB904 | |
1106 | 88A6FA21224F8DE7EF9F8069B12CC04622CBB7A0C55BA8AEA0523C6D4A64B089 | |
1107 | 27E52BBA3B44E98569DBB50ECE9C48B2DDBE9502680E5B618A30C4B95DBEBC91 | |
1108 | 9BA2355A940F6304770E70DED7453EC77B3C9C732C9DB9567E4193FB23C89592 | |
1109 | 7BB60137EDFC52DF7B06F1262DA52F926E48CD5A750F71FDFC573EB8462845A0 | |
1110 | 4EA8E0DAAC302A0EF2A156444F8703D5702EB6C9B58DC70F7F154C0F22A6B53F | |
1111 | 573FBE610D2A2DA232B21DC38D37D56D147670ECCA5DD005B990257691E5548F | |
1112 | 4095517F9FDB1EA0670BB3C325092635CD1207F565B27A6F901AD91484855A71 | |
1113 | A8683156ACB1A795255E8EB09D32F598E9475C97BA191469642FC49C81EE721F | |
1114 | 77B6363572A188885DBD798057AFF88DDF08724DF475B00BB73F681D975E9CF1 | |
1115 | 1BFC142990DD34F2E1726FCC8D9F10BD9FDFA8A7BC92212709F00855B547E630 | |
1116 | C26BE4D5488927E8992AD160D8B55FC68C0F1D6A54C0679D275E58A3CAE51977 | |
1117 | B8048A8C2455D58F200DE978859A7D1FC44304C7EA735EFE591E28EC3DD083A9 | |
1118 | 9E53D4EA808E10F4B9F3866643E2A0D1CC177FDB0F2CEC6C3DF9B1A92A6ACFAC | |
1119 | 08BE08436F708C3D13DB49DF09EEB57866CDD598B663F10AB42CD229E6325317 | |
1120 | F55716A44C75E7CD8D2B292DF39DE5040DB9F3563CFD2C186065730A0712D446 | |
1121 | 501BAED4FD53A9D8F521624E270FA7F932294726E4B84A3FBB7659AD1C5A9240 | |
1122 | DAFC17654ECCDC38A9FAF28F301F10E5923F33DDB0B9AE116143218BB22BC3CE | |
1123 | 402633B164D6E4E3B3788216DE8E9B38677C71AEF5DD109C63641AA99C2B2DCA | |
1124 | EB99606BC079F386CE077B9647CF93B400D50D11162AABEB08F42A19C52F9D68 | |
1125 | 80FF02F006874D2AA3F41BA095DECE25CB7E021C91D25EFC992390C1ACB76357 | |
1126 | 9225F06096DDD549FB855CD9F8FDEEFD1375D702E2E806760529475ABA67EE50 | |
1127 | B70FC8860FBBAD5745459DCB1B8AB9F1EAA5084080C2FF89141FF10B459DFB93 | |
1128 | 2C35A171AE9219ED5FE507CE7E3813C94F346E924792B1130E9355628980A18C | |
1129 | 6F808F28C396EC813617EBFF922F73BBC8651438A1614C9F24043D110A589B89 | |
1130 | 3FFB6F4E99C0AB4EA4E50A6284644137F093D527AB9490A7EBF6140D9DC1FB98 | |
1131 | 5090CA16E9F08BE79B49912963719B3B35A442FCA493EE5198F9916F8655005A | |
1132 | 9EE372FC4404CB4168F82F810A58371ACF7AFD46CA46F2F94B194429255A9BC9 | |
1133 | 4185CEC1C929945451968B0817842B3BAA28A1CE1E10B6CCC328E0487CFE90BC | |
1134 | 3BD9EECF5F8FF1C99C8805A4970CD486F4DC9BAB0129E86B1F67F08070F04A46 | |
1135 | B0910BA9E173FD4DCB568B08BBECFCF6695414662DE690BF32A90237C8B0E72C | |
1136 | 206D09A580DC92A135179A5E3F1E611A3B05DBB05E4A8D51BA3D0A165D3C40A6 | |
1137 | AE013DEBDF26FA757F6CBC881BE672BB467C1920C067A0B2A49A532A391A8E87 | |
1138 | F2C6E50D247AB108A1740D4D82F955A91D49E95259A3DF9715F34CB45ED5DC9A | |
1139 | 77631A4A1553EDB8D4ABD93869FF52D3CF0017CF887B408C02E8509DFCECDD27 | |
1140 | A295ECFE0332BDA5678C4393ADDD5D171B5FBD360CCA5810F79F5F879939DAE7 | |
1141 | 892D53FF5F505CC0501BD40590420A291BFE8E67F09AB7A3E0665F6AA8FD04F9 | |
1142 | 67C4B0084C48F9DE8F7E0785F3261844E45C9F5D4A45855BC5B7E00CBB865B31 | |
1143 | 2BDBC1B1292DC374B6190D12246DB97BCF04F679DE3605E532451B3E9D7F5997 | |
1144 | E1F353BD1E35CB11C850C9CD5ECBC40C9685DCEAAD279E315FCF85855D6B40C5 | |
1145 | D0FEE8692D4108B04338A70A50BC6E2C04F4472E294A182B88C9021AD8C0ADA8 | |
1146 | 0C7A752F764548A51DFECA58D6E39AB4F78BE0A83DF6D60D25CB0F328D8FFD49 | |
1147 | 16427FFF198D1FC3F574B3271688A31DA28952EF065C884BC0FFEB547360A372 | |
1148 | 7C39E5F2FC458831B9C42128CA69A8198FA0545CFB207856D6BA97E113FF7E26 | |
1149 | DC46395E649205C83DC7565F4130CD6BDD44ED8D4D383D0F37B34C6F2DC98CC7 | |
1150 | 4F96BA2722C996879329A4B27089F0A68FD6355D26946039F25D013AAD2F22FF | |
1151 | 12FD7F617282C6F005A6EB12554C47FEE2A5B1D0FC7C595B9DAF268084C91B37 | |
1152 | 5FE0ED62A934EB511362D1F14BCAC4950EBFBB2A3D1F45C1E34498871CB4C346 | |
1153 | 54B7349577D54D26385D784C5E3C2D869A7336159724FAE151FAEB10E231F3C3 | |
1154 | A17B959192186081556463C3F5EE6FFDB06E82B8B9BD08C0443D8CD84BD6EA7B | |
1155 | 1C2BDB46327CA21FCF002B3E8EF4DECE86077AFE6BB5A941B9E068CA023D54C2 | |
1156 | 8E91E503F48B0B4B96ABB07F084C2EADE9B2F41415EB312B9EE0612E69F51177 | |
1157 | 654AD20A2D93D457E2FC3C66C3705F9B48A947329BE59DC7B871C055C590FFC3 | |
1158 | F6B5FD8212255D25EB7787E637D5CCAE0E1EA386BF0B911F414BA45E30F36CCD | |
1159 | 6F5A17D0A887B5BEC58B8E8D228E12C9568F820A7F820B6C9B6631EA8C2340EB | |
1160 | 377CEB0A490166FC33AE1F38D3629C090606D3E8AE8662A98D6C63793B1077CF | |
1161 | 092624F46AE4548DB4B22FB602C39EA2E74B5A26DCCCD210E043D508849703E1 | |
1162 | 451C8A9061514DC7312755EF16C2165DC1DDE554A29C8AB6F9ABC9A5127041F9 | |
1163 | FC22CD3BF15A4A23DFC8FD5661DCDB1E1E1EA65E77DE4A8D60A2E564F467F071 | |
1164 | 5C8EB4509C3F9A97D0371EBBD4584430AC8EF155084B63B9848FD4CE2B5C6DB2 | |
1165 | C3A1946B4BEFA7B088587F912D20F0A2E15A580584441A4742312DD4B34503FD | |
1166 | 338BFA7BFEB94379353CE264541D33433C4E996BECF418A2E3295B9961FBDF28 | |
1167 | 77EB608CC870B97D9EB43FC3AF2DBAFEF337BE2F108DDFBFA090190158A244F0 | |
1168 | 8A757A95FF8E25B6FBCE09A1DD6FC5C8897456E12AE7A9AAAF0E42FC632D35AD | |
1169 | EA2C00D7C61E047CB071163F05FB5ADAE82D0E177BB7E6C9492C2FC9F511F75C | |
1170 | 0FCBF74F06E057F6B66D3F72873559C5C983DA7D7E75EEF7B783EA44E4AEDAFB | |
1171 | 2FD8C3779D38EFEFEE5BD565C3A73D307D81EC6C45C2F02B7B342DFBE2356484 | |
1172 | BE59EF6527E956D8E1C48C80395F34CF4AE1B8B5C2A06072DE5C59255ABA30B4 | |
1173 | 3B5039CE2524141C0BA73CF79209B0B5AF17C59BA0EAB437802A22A2E2D6407C | |
1174 | C861A71EA547220134412109DFA1F6D78BB0C34F6FD36003850FD3D9EDF39741 | |
1175 | 2EBB9AA349BB5801C9FCFBAB69E1D3BD5F4752663E616A8E1FE486545F3F1BA3 | |
1176 | 8F8A11E4C13B2CF97A497C2333A22C696B499647DD7439D3D7B636FBEED2D32C | |
1177 | 86FF745763413B53E064B16E5BF157C9DF7313FB9D46C752B52E963BFAFCB392 | |
1178 | 531F4E46194A3BE24E2F51EC9BD57FD5E82668E2AA9D72DFDF7F4500C1B81526 | |
1179 | C09DEF71CA6D3A3A7ABB1BEF21E99DDDB82D307BAE2B6FB28FEFA5160E18304D | |
1180 | 25B1665A7375FFACA6C843A0E8BCBBF59FBE24068A79ED68A6F45AEB7201BB6F | |
1181 | 06EF67DD19243E68DB34025209E851DE3AB65D10E108316E733DFD25B0F8CC8C | |
1182 | 056740761BCF195AA6E1C2857BDE85983408D400A96EDB887889F7CCFF403606 | |
1183 | F9C01F7CA76C9CEFFFC9AB7D3ADCA36A0269283F5A65594ED68F43DC1BFC6117 | |
1184 | 1D113760B0F469C34CF089EAEC99C5F7448BF6285DB05D35CE182CD80491D88E | |
1185 | 3CF21FDB249EC96516EA42BA9A716283C7C60A1D9E7EB9E217B2B4EE5F316110 | |
1186 | 2DECF4D895423D64B87B776883FA49225B6061E820C9425129736754184CDEC0 | |
1187 | 67B63E5D07A455BE0B9AE382FC997195AE0AC4C07FB761EA5002C3943008F7A4 | |
1188 | BC04588165242A9F4C31E811EBF1E145C2D102D1D7C9331EE6660E054E74CD7D | |
1189 | 8FA19BEBD2F89BDEA0DD0B54B0E1B5EBE3E9CB1E5A1F477CCAE0955BFE9950E0 | |
1190 | 01211AC8F3430F958A4DFC6E74502D9E2EDF5E2CE261DE00D8DA75BCDB83293A | |
1191 | 0802B7D5F14BE14380DC1013877AE4624853F3FA041F944D19185862A8DCE73F | |
1192 | 5F0181BD84C3E65AD11B2F0A2FE36B1803084E82274CF4BE3B0151D309C3F104 | |
1193 | 771C6DC985D7DDDC77BA40D844173A9486B539DCE051DC82FF6D6831F99B9891 | |
1194 | 48D6B027B8B6B6279E6CEC7D0606DAAB1A86F2309F1A4842A1DFDD5116FBFEA5 | |
1195 | 0AB6C354CB65782464770B72B39DDBA2565CDE941D68ED928151E23675B541EF | |
1196 | 33B070ACC0ED70A3A18D0833CE7A90C911840E06577872FD4C3A67E7C195F73C | |
1197 | 2418EF0889AB1AEA93269CB1B98CEF136DD38DDEEC2450F7C5FAA9775973E178 | |
1198 | 1182455E0321C4DF13B1EC1466D8F5BBBFC38A2A054B57FED2E429ADD7CD3EB3 | |
1199 | 425F266AD5F0B37576EF54143D42D675E895EF20F54E1CAFE0F2A2D2075B28FB | |
1200 | EC034601A147177976623733D6FC00CBE2DDB1E9DC5DD9E7D12AF9E589843FD3 | |
1201 | 607AFD7DCC3AC648862C559B98790640A78E112B757B15FA513A76E1C3AC4074 | |
1202 | DD520E94998D5DB08C1D3E822FEC4ECBFD1E398B480AE01690B14BF92948135B | |
1203 | 4C042F70CDF3B988BD02CD54CDCACF912AF09C0C59CF23F84094E5C976E6392D | |
1204 | D7D5ABC68E9EE23C080B564096A30F67241987999244686137175D8570DE9AE4 | |
1205 | 57EF670B5576BBC1C0AD4E26D7817B202674F70CA62A5EEB882C2ED1C6272C00 | |
1206 | 5598595DF2AC7F82FD1C9606183157EAE7575B07828BC2C0B2D171F86BF3900E | |
1207 | 43FFD4F6463FB5C6A1201D26A8B58677F7CB00C5CBDE1FABE2641CC2172775C6 | |
1208 | 3F9FB0496CE71E179D70333A628091B47A3100A5B4CE624EC9CE5E4D740CE3E0 | |
1209 | 0F03450F95138A0437BD3A7C4F6FAFD1B8B2A0EE07FDF76E427A8ADEE7CBED56 | |
1210 | B57F9522F8CBDC3236224E6E3FADB549018E757E090E1CEEE91C45C032CF1F25 | |
1211 | 67FE17978B998DEE1635236EAAE953623BE263D2C444327E91C4EF9740B768F8 | |
1212 | 70A6CFEC3511252D7432C96E5B11B7AA80BF620B63B82AA4777823F7D0266A75 | |
1213 | 6DDBBC79CB7EF862FC8AA67C07B87C40EAFC0C81C122AC0348F7702E95760F93 | |
1214 | 33508D7852E4A494F5C6CCEB7CF67F1AFD391977AE0D85397BC85BA02C0C02ED | |
1215 | 51C9489230B568BDBB8485087350E140611053373E46EDE979AF4C1D1047925E | |
1216 | 9F67E9708D11BC71659DD61D3166B156670D67046AC2EBA08A25FCF2B84E7BB9 | |
1217 | 56FAA25B67004C1D6DF8D12D4E9F1E3793CC1667EA7DFD6D67243DCFAB276AC4 | |
1218 | DA755EC98D63C11D5D10E59D74A4CF627F699F1A018B2AD652584A810B2DC519 | |
1219 | 549B2CE246622CB20DB69F25399315A33B244BE0C05FEBAE53D00E4E266DEEDB | |
1220 | D1912D49E6699105767FE996B0CE64AF777E5D559D36BB141456339447216362 | |
1221 | 59721641A762F6F6A54CEB3D0D2D3F75927E362D6A6A99CA6A8BF739681A60C3 | |
1222 | 232E952935AE9B34DD4FD3D15385F5A30B045F3670D517BFB924BCAB0371F3D3 | |
1223 | CE9C5161D8C634BCCCD3134F8AE366D3D7B2C7B32EA89FD61231E30DD3DC1BD7 | |
1224 | FD295D5E49051F6C35DD7AEF31CA904FC20F36F19E0B9B838750868D69A752BC | |
1225 | 64398CF36B006D8313D0A349C9D93AF56F0E01274D9AB369309B9F4E4BD0B8F9 | |
1226 | C6B3C66F38C3027CD1AF8802BC82904F3A619F89D5CA5BB78150A8D39B9A92A8 | |
1227 | 9B5F5BD2674CBA06F7819C0C9261EA9671810A804C1C14CD6A1D7116F9491BBE | |
1228 | 269653566173D334F26E76CB8AC3C345D47220D777449AC0E82B435A2817AF7A | |
1229 | 711A664519CFC16804C966D8AC088DA2AAAAC79AE21E7B538F3554B65CF29AC1 | |
1230 | 57B646E6BA127A7A0B169EC680ECF5C230CAA91A9ED6AB2A54B8EB7E8C94DA78 | |
1231 | 67C22B180ED661264EB2004EEDF1923FC5EE30E0A6F87DDC414B7507887F8411 | |
1232 | 9B999F25ECBDCF8FC3D9AF99AB8AC08736091CA28D78E77354F3205CD56F9221 | |
1233 | B6CB6D81A34E3C954F73BB23BC73D4E4E6B961EB4589E5C2E21E426D78E71958 | |
1234 | 3782FAA65DC184CB4944FCBAD6ED0A882F8767E2E8A8CF272683BBCA8A4657FF | |
1235 | 8E856DB3188939D424341DD0D9B8074461D8F15FBFCFA7AD63C81C4F51396640 | |
1236 | 9FF1B14685624376BD753D186F75C695CFF5BF63EC9B20D2CE365BD0A4822069 | |
1237 | 686C8737732EA874127D96CE11F889A71071771D8356A5BCE475F98D79C8CA22 | |
1238 | E98F5175D0016913B0C927616AEC836578F02024E3D4FAE49F428F68A026C592 | |
1239 | 37870C5DE3A1833AE1C24D461FEA | |
37c41ab1 CR |
1240 | 0000000000000000000000000000000000000000000000000000000000000000 |
1241 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1242 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1243 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1244 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1245 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1246 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1247 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1248 | cleartomark | |
45c0f7f8 | 1249 | {restore}if |
37c41ab1 | 1250 | %%EndFont |
c302751c | 1251 | %%BeginFont: CMMI9 |
45c0f7f8 CR |
1252 | %!PS-AdobeFont-1.0: CMMI9 003.002 |
1253 | %%Title: CMMI9 | |
1254 | %Version: 003.002 | |
1255 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1256 | %%Creator: David M. Jones | |
1257 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1258 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI9. | |
1259 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1260 | % This license is in the accompanying file OFL.txt, and is also | |
1261 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1262 | %%EndComments | |
1263 | FontDirectory/CMMI9 known{/CMMI9 findfont dup/UniqueID known{dup | |
1264 | /UniqueID get 5087384 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1265 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1266 | 11 dict begin |
45c0f7f8 CR |
1267 | /FontType 1 def |
1268 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1269 | /FontName /CMMI9 def | |
1270 | /FontBBox {-29 -250 1075 750 }readonly def | |
45c0f7f8 CR |
1271 | /PaintType 0 def |
1272 | /FontInfo 10 dict dup begin | |
1273 | /version (003.002) readonly def | |
1274 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI9.) readonly def | |
c302751c | 1275 | /FullName (CMMI9) readonly def |
37c41ab1 CR |
1276 | /FamilyName (Computer Modern) readonly def |
1277 | /Weight (Medium) readonly def | |
1278 | /ItalicAngle -14.04 def | |
1279 | /isFixedPitch false def | |
45c0f7f8 CR |
1280 | /UnderlinePosition -100 def |
1281 | /UnderlineThickness 50 def | |
1282 | /ascent 750 def | |
37c41ab1 | 1283 | end readonly def |
37c41ab1 CR |
1284 | /Encoding 256 array |
1285 | 0 1 255 {1 index exch /.notdef put} for | |
c302751c | 1286 | dup 58 /period put |
37c41ab1 | 1287 | readonly def |
37c41ab1 CR |
1288 | currentdict end |
1289 | currentfile eexec | |
45c0f7f8 CR |
1290 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
1291 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
1292 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
1293 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
1294 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
1295 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
1296 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBD07FC5A8862A8DB | |
1297 | 7E2B90C16137614CDAFB584A32E50C0935109679E31306B8BDD29F1756946A67 | |
1298 | 7A7C2D9BA6FAB9B20A424AA0E6F4BA64C2801C2FB5A1156CBEED0ACB95F697B8 | |
1299 | BC2A6E6AA7EB1F9FD8E3C9B1A16697EE1F0E7400421A7765AB218FC837A49365 | |
1300 | 82DC6B2C877A7DA84A81E6126EE96DB25C17A207D3020A045DCDAA064360DFFC | |
1301 | E3CD50E21ED239D2A6450D04F879A26443ADEB6A20ACC504989876476C7D1A74 | |
1302 | 91564FEA1F4CC2C8C8FDF666DB537F315AE1886C73CB5B00E67E7B398A6C018E | |
1303 | 540EAEE98BB8136C4F044EDD63C33431D2CF9740F051DF365A4045D9D8782112 | |
1304 | 7BB5D494D9235BA98CF2F30CB119F5A904C32AD04C960C43FC1F5FD8DA7D90D8 | |
1305 | 93AFB59F3FF4F796481AE2A7548F948FECFC6C127C4D3F159B08F206AE8C296D | |
1306 | EE470DB2F879EA79475E029D22D7A8535C09A18689DB0609CC233E5199C02756 | |
1307 | 972CC9C94D9FCE264DEE5D75C8D651E4E2D1189AD9588CB815722BB5EE3C379A | |
1308 | 6F31C2E6AE1AE4CCEB29766190AFA20EA937114978752189F1A9F42B39483149 | |
1309 | 796FCFA123BA9CCD1D9BE28289660BCAE16C40B5B504058D55CFCBFB4F4E3D94 | |
1310 | DDBF39F157E63946534DA81C018B1C01B9F10DDB55E0A5C2B3985ED1977C039B | |
1311 | D6755EA42CD09E27751E159C30B93F376DBE61CD3AED34BA36A768F232EB3B80 | |
1312 | E3E6B77C4A48D408217818E398B83D995AB6BC871F20991DF57313D6EB0C793D | |
1313 | 0F28088EBDB7F38DAF7E01AAB3476EC24D7BB38A9889A7D3038D930FF4289B83 | |
1314 | F54A7BE1E2D98A3822098D2E4D067A0D400C20C0B2B4BBD74C13ED1B827490F9 | |
1315 | ECF48F8C3994C1C5AAC9CF783BFA4F307528F51EAB55F961808A42ED53F00C97 | |
1316 | 72A432EAEDCFCFB622389BDA707B6ACC9433B065CF29EBFE93AD14B8ECD5F47F | |
1317 | F073F11822C49B8BE924CDFA6348C3A75E9BB9BF3F31C41716B34794B28CDAC9 | |
1318 | 4DB8B087E180A9B3B17680F73D9C12C8D86A922C948093629F5D7F542ED882A1 | |
1319 | 692F4F6696865E53E3E2DD43B2D5E8C989CFAA5CA5C4C5999045E170BDE9921C | |
1320 | BACD6F2863F5553EAB2BA2D4A9034729EC0C4201DE90DA89B0A27C5A5C974109 | |
1321 | 4E37BFB3F46B3A506169FB0C68E1CAFC844419A8D261A1FD86A3BB78E33D5FB1 | |
1322 | CFC687A5975987CE45155E5FDFAF0CC5FD5568CB1C26212F92E88255F0549F59 | |
1323 | 41B33125946DE43436BEC00804063FBF03EC796E3361B1C852EC3038D107F80A | |
1324 | 9198968265D5488B26D7670B22C2D75EDFFD1B7B4AAFA36DFD94640C9D0E2D20 | |
1325 | 5BCA18683EFB91834A3939AB8EB60E2F09655BE003582634C52770DA9668C292 | |
1326 | 2E02929D812EE2B0CC65F020064AD5BDAC5F5693B30508F40ED8E20E87149BD5 | |
1327 | 8DD41AFF83FD1944804017DC5A04512E593549FFFAE501131CE2FDB65EFD0B8B | |
1328 | 33809CBAEE411B3941C241550B9C30DD28088708F1C0CC3125CBEDCD985EAD28 | |
1329 | 03313741F67DB5744A87B381147D5BA70AE1145C27F794854628D87D6C1ECCA1 | |
1330 | 749E3465B950175D3C3F40E344297BD92D3190041A4392033A79BEAEAABB8DBE | |
1331 | CC14E39612F43721CFAE6F79074429221CA588AA2501DE520A464DE157A03AFE | |
1332 | 3C082FAE7628FC0C57FFC61D0330AE6332D20FDBB09BF36848FE05E782D6379F | |
1333 | 64F9C82C45402481B0A35989027F9756BF5A79DA2D96E10F39167ADB4305578F | |
1334 | 90B509B6891338FA1D67DCFD61804AA6621526B2EE4769589A2646581712AC05 | |
1335 | DA6E98D16494F07D612743058F54FEE516BD89A8EC3E03F9D7F905175D3412C8 | |
1336 | F7329077FD6EB25213F3CAC94BA0C3363B759401B6EF7548C7D709F3241D030D | |
1337 | 4EB46A1AE81863C412BDDAEA6084C37143A4C5E41BC646315B1CD09F934186CF | |
1338 | 49D1D8239E363A435307030BD79536B50B723A39DD763DB539F24A10DDA12BD4 | |
1339 | E467339D2D6DB177D6FC539FA77D2DE4118EBAC161E928749F7C753ADEF86117 | |
1340 | 58619F1155C563DF2E11ACA8347908B98113AED58FCD0394150EEC94B7F986EE | |
1341 | 88BF7171D208D8F1774B1DD478F0C2958AE372D257E7EDF0F6B5D6059CC4D5D3 | |
1342 | B00FCBD2E9CBE79235B9A5A3E943CC27AABB58728C95C7DBD4F4A1F8A4DA99AE | |
1343 | 7377B0CC0BFBD454794398AE0D5F7281771FFE87B25A819F36E692286A42D776 | |
1344 | 01794A43CA9BB30FB8FFDAAF014F909A369E34C2F6C75B7D4EB9DB0580E33F46 | |
1345 | 19654443AFF8384B95600B86FF8E41FEFD032355626D60C7507C058EF832DF41 | |
1346 | 194B48A36F11082D1DCF4723E21401E0C7447AABFAB4639B26E3D2730E348F55 | |
1347 | 53EBFF39CDD03E06E2FA5FB379603C879EDB7E1A10F89695C9C47DEEE52BE0A3 | |
1348 | F446F187AB9D7E93E6F9387F21129034F36DF40605D28FD526AF82CA9D232BE4 | |
1349 | 412567F06B38ECCD496EF40A7B243E46C9FEBA4F1BF4B1ECA029C5EC239353D6 | |
1350 | C0B100BF7E7DB33BD1277DE104F15AA19F37340A777741AD1AD693BC76DA48CC | |
1351 | C6F83CD84591ECFEE375979972B0FAC4C10B625E4BFB261B9FFFA83C31DA0108 | |
1352 | 4FFB6377466E9739E0EB64424BD9FC7239C7DD834EC6788A0F97FE714AF92831 | |
1353 | E1BA36A8A9E24739F1DC82DC26CC3CE28C210AA7C569B19E1784D663A0CA4E81 | |
1354 | AFF43E86D6F5F63778847700072CEB77A4EB946DC1F23DBC00BCE773203F76DF | |
1355 | 00F0B085F31420672974DDC642D885E95BA6BBE43E1CA8ABF464D9881CDECC7A | |
1356 | E98E31B9754C9B72A8BD5CF6D4D214DBC3BA7A0CDF6635953F5AC1E7639C4A91 | |
1357 | C7AECE4C75CA3389C348F656FC2CC96C84C85A926237B6504DB51937C9CFCDAC | |
1358 | B75C31ED570D180757884E27757783DB2D5F35ECC48C496CDA342D49AA947BF8 | |
1359 | 2FDAD2F19DFE8CD1C76A8FA08F33681F3E12E229D7DAB45BE3A3F258B5ED4980 | |
1360 | F15340CF20D965252843E026803E8AEE736EC41CCA82167401977AB719AA2F50 | |
1361 | 0B791EEAA82027B3C712D2EB9D14BF8F94FBDE2227609BCAC41EC08DE2BAC023 | |
1362 | 28352F913F7DF08D4E1C66E83F764578B22B4EB7191E852B91ADCCB1BCFDB1F4 | |
1363 | E63DFD152E86FA9DE9BC8908130EFDE29CC4401339C05B5B9764CF8EFF14951A | |
1364 | C6C13AF979546996BF22F2B96D3D585B90CD27DADEC78914DA48432C6ACBDD42 | |
1365 | 20EF583FD41F2F6D6D10C3DF7DD077304B5940BB0462656E306CBD91EB9B756B | |
1366 | 7014B1884A36201EC582FC9345C386043DD2818FC301EF78791C1D7854F8FACE | |
1367 | 5DE9801DE9F59D5B4271E003AB897B2EF49501589D681D59CFFD9B03F722EEF4 | |
1368 | 74ABD29997515DA3591496B62666744EA76DCA45504F8075C0652D6779DBEAE4 | |
1369 | 90430C2945FBD60AD53B51DDBEFC7ED703C418B4B244C8FFA5A3C1B7600C5A55 | |
1370 | 3EBDB93C16AC191C3A28EB2279BD3F0D67C826BC6A73D3C0AD02262368AB4621 | |
1371 | 98A1605F2887BC5880E1AF2780330E0FD01D7CAACBB0F008A42C427F38236066 | |
1372 | 54799594E515B289044BAC4DADF8B3686B4372C5110201221FDA923F131E07E7 | |
1373 | 93C44BAD406838BA4D1C277EF74098B8C0EDC41EEDD58C195D7DFF5FEDBF96FC | |
1374 | 19CEBC6C3006DD2CBF76916B4298BB915663C2F61AFD7747E03A03BD7280197A | |
1375 | 9DA590E3D081C6F53DBF94E8D6FDDDD910A70AB18A0F6D48A590FFAB314D6CFD | |
1376 | E3FB20C1F3C91063F00726A2C13A3D48323F9854839405E5A29D66A43E6E2B84 | |
1377 | A8B3765F1D817071D4D6FF42BC785C2D11AB2B9452F141696CE19C6AFB9777DB | |
1378 | 107D6E22D8CC6C26440BC48248AD8805C4329D46BF433741CB519B21663392DA | |
1379 | 5DC7FC9BF37E5BC396BFADD7263D09F6B4D69594AB386B7BDFCF3BACB97A0E08 | |
1380 | 22013E716E642592A20136CF9CFD61D4E515D80E06A4CB4FC9D9B916C93CEA95 | |
1381 | B83B98C48CF36C1D02291D4F5C0419338D64E33C90C90EDD2BA3B96D70FAFE0D | |
1382 | 403A060CFF448D3E28A9B1E3916018465E86095BAAB4706CF7ED350D7C554789 | |
1383 | D7F4FE5F180767DE8739259E68CF142040BE1E2E8C6152DE3417C1FAEA7584B6 | |
1384 | 20781DC4A9796431EE713DAC4E713C839D7A4FDC8AB6BFEFFE767AFD8B67FDA6 | |
1385 | 943AD387E5D3BCB09039ADB64ECC2BE2620C6EC269E708DD06C311F450099E33 | |
1386 | AF46AEC644222E7DC4DBB9371EE12CFBC4F9B27AB46AD1DA96CE006E1DF8291F | |
1387 | A550A93026CBFFC1087B134EC6EA76F5E109CDA58FF47338A0039A786A575F70 | |
1388 | B8A03A4F9C8D07A4C856C77D9BCC8E3EAA740172D0C2D0A15BA35C9E5717D7FA | |
1389 | 2691774DDE730BB9D7C70D7AE103DB8D35F3728470C76EBA0E670634E1A0BA84 | |
1390 | 2FA102BAD7271DF2680D86A4CA6FC353869987700E5E3FD778165456033D624F | |
1391 | E9B3E80EBF431ACC934AA0357E824B8AD73E222B510DE8445C55C07C8E5DE46D | |
1392 | E478F832BDDECAF2EBB11941DCF84CCD887043FAED9AA90D12BC8CA9A0C8D94F | |
1393 | 8D3BF1F80B14B6CAE6BB1C6AA405AA64BB94D5A82CFEA548BA070796A02F9642 | |
1394 | 87326D066101435AB9EB40BA9EA9E61B363F5F5E3B924369796E8B78DE3414A4 | |
1395 | 2B79C6A13ECB2F34E6299658D07D2B3DEF3D4383CE009A927F0EF5C196652842 | |
1396 | D96B857AB5E905201E7E8BA21A5EBED1FC6863BA9A1A6E5390407F75055E2EEC | |
1397 | 512FBDB3E82CEA13663F1A1944DA072C765D8CED06AB461470C5723BDC1271D4 | |
1398 | 4D1D049D3EB131743F1EC9A6ADDAA038ACA2C41D139DC6A84EC3C61AC7F1E559 | |
1399 | 6155CC2F49171F6E07CF56D721D9728E87FC7DCBCAC46455A3694C765FE807E9 | |
1400 | 9CBC2D304AF37E0F28CCB22F239541B53A4D24D09C662559267467EA487BD33A | |
1401 | 0BEFD4899B581D20582930703A868655C31BE935364CA6A95FBCB22CB714C040 | |
1402 | 9718824DFE97929D0482430726CCB5A5307957DD2432A9B6271E849148DEB76B | |
1403 | FAA290FF6D0B18DC5B76407852E81C105EC6CFAB0F620C6DC9DA555A33C167B1 | |
1404 | 430A8BC338BFC7D75B7099CC906AD923FA107C74D3FBB719D77A4E5A685FF9D8 | |
1405 | 56424EE4AA074434B809D894ED50F6A60A035C5223EA25DD8983B9B34210DABE | |
1406 | 718D7B2BEB293FF1B63CFB1CBDAFC69552963D90F5E3FF533A3FDBB626E9FAA3 | |
1407 | F3C119E5E01C7BFF832A033C3515BF049E29558B1DAD652F2888E339E67D15AE | |
1408 | 95F9BD14E3253DFE9072B24C0E7E85025B71096AF51C86AECB2921126A43156B | |
1409 | EC812B32B1164BD9B2B947D503C015616DBF2024F5C8CB3236C1DCA653D661FE | |
1410 | 6B1C19A22D272A176B7F1B7F9E67AF40DB0EFD4940E58B2A050249CA4E55CAF7 | |
1411 | 6ACFD84FB46FEF952D18552B3972D79D808B4C263B8C7E1BB647A2D03E102867 | |
1412 | 630D5C3F2C917F765A4F6FB8106BA6A9D0093E27A4CB6049C2371287D94B5111 | |
1413 | 6E7020776EBD744C6C920464BBBC0AC206033E8240017F8CCB112596ECD7CAFA | |
1414 | 89950CF43FD87ACA750C03A778A37FBCE9C82C2F5ABB135BB02DA8E8C0D24475 | |
1415 | 3BEA9D79372D0022FF1ABD378C151417DBC69FE5C9CA38D23A3900E34BF924A2 | |
1416 | 90777ACDC37930B67DD44A2E76DDBD9B89598D5F626BFD325A978D277265DA47 | |
1417 | 38CFAF16E7FF1946E15F41CA73F7B4B02E5AE8FC4C37B115BC567E4EEEFEFC34 | |
1418 | EC8974B1465AE57759EDDA28DD38A9210871D35D331AE1BE6097C3EC21C770C9 | |
1419 | B25D040B2ECCC3AEB1EA1BF99E0C2C0F192C13BB9152CFCF75332E03F9CEC376 | |
1420 | 9B8C285A35F53655BE38713E09AE34BA2DA9C06FA42A6FD2D00CBF2AFD2BADB9 | |
1421 | 1571629C65DA38A431710CF5B01FCA68E8B8569922FBC3F9B64A5509B6F677AF | |
1422 | 1B97E91FFFEB6308AB68AC58F9BA43DB5E764021E75B56170EB44C2C0A7DB86C | |
1423 | 62B8982256D3621EBE3DB3994DBF5C5A14CF34B4AF3BD5697F8E3203085DE9D5 | |
1424 | 84B0598169760B925463E93DC87CE70AF4C2DF0F4287D2F2069847BCCF7A37A2 | |
1425 | AD451D5ACE4DBCCB2E14D5DF38B226952E7446BF87BEC736EF3D5AE793304618 | |
1426 | D66D3299AB9F9CA1D13F134FAEDF36750046E27706C7CBD8E0877BB6276E5196 | |
1427 | BC2A355D109C0253644918E1CC11B717DE6FBDA201E769812752888CD66268F6 | |
1428 | 4ACF4A9449378F9F9923D584BA1B51F33663BE7A306887BC14A37E3C5A4654E6 | |
1429 | 531D6EB63DE3946BD8BA95CFB037991174F36D61D842071E6625605CAA350A24 | |
1430 | FE551025D10871FE0E2599A63900C8520EF4911C53A03897C8BEE152451708E2 | |
1431 | 43FCF4E700C583A5E8DBCC03BF9CAB864DBD19E1760945DEA0EC0BA38BEA8256 | |
1432 | D3A8D4F70F6685A99C6BD2BA8B412A26C002D76138CFCC7DF6802931E5D97BA6 | |
1433 | 0151F6A4C572235B4196B22B7B2D14B32886DF0D2CA8A277ABAAC53B63F64CE4 | |
1434 | E4C088192AAB674497E8AF81961359C389B51F4A257373D907C615030BFBEF53 | |
1435 | DBD99058FD06E352450B658478C10454AC8FC0232B70D5CB916981978053E358 | |
1436 | 99D322A07294748BA427FFD1E45C909171017B52B7C742FD77A8560852D819DD | |
1437 | 8DD53211A14D7B2FD11E42941722FD3985D627FDAF87EB57326A0D290B5077D1 | |
1438 | 8A4230BEB40523A8565F95E0D44F036A571DB698EDD9D94FEC9512369E5E5E73 | |
1439 | A3CA5C142617944F4F99C0697ED088ACAC007FCE06E5A6EDE7D0E03A3399DCE5 | |
1440 | 362271BC31533866BA79FD1FB3F608B22CCD4111FFB1BA35D920A23AD157C6B3 | |
1441 | C3DAE11069D5E46DEDA7158C6478D8B8C0D9DC237CDF0CC6633911673C43FB79 | |
1442 | E4F9B7F27495201E5ADE66255BC2CBE9D9F237DECB62A19D62CB41A1C92432D2 | |
1443 | 07F0629E913A71B3F1AAF8B8C5AC66D3C8605A48F8913E39C859E163DB1DBC8F | |
1444 | 0ACFEE80A40B6172032E95A76B752B873FB4DF23CF3A655AF1A1B88C8DC156C6 | |
1445 | 190DE72973950565454C0A188A33395FD3D529A88F2B578356DE8EBBC12F04C4 | |
1446 | 5B899F667D9E6F3A4EC6DD8DE71FD4C2E2B6D56823EE4E0526679D71FF1B868D | |
1447 | F261489F06F97B010CCBE640E2F57BA3DC3332B329F7958394BA9777D833AB50 | |
1448 | 005E8E9232547104065ACE33396772B0E0BD66D2C6CC54DEDD071E444D8C95F8 | |
1449 | 6F88B31E20FDB80F77C83151B7E25BD3736B4F9BDC52EE78C41E9475E5A6D94C | |
1450 | D348AB42F5E36B4F167D29EBDFBD43B03F77EB296B06A36880FF17D412E77EA9 | |
1451 | F2E7C25FD05E16BEC6732681EA21AC3FF6893B93FC09316A370CDDB86D9E6087 | |
1452 | F6042C3F9ECD742778389170F5F041329782FB9F9702F7533E51F355F71825AE | |
1453 | 2BF4F8FE50D413AC9A20C41B42537FDBE8DDC5A5C793D3760C1EE13716068752 | |
1454 | F0AF10812250BEDFB4D7133FD58F4587BACD572505C84A7D3802D27443175FE0 | |
1455 | 0D89C3398B55176D8642AFBAB5CBCDFD6220C8488564B4306D74A58CD2921AAD | |
1456 | 73CF803C754DAC2F30A5324886E273064FA51781D5BC596BFEDDCE3982EA1AA2 | |
1457 | 62CA7BAA1B16C6EBB99B2AAC4E6C9CEFB3D10F19987045C4918DB239E6E63D79 | |
1458 | 5F44B9D097118D081153AFF96E5EB39CBFBB99A3BE30909F614869031358EB98 | |
1459 | F07A97EA78AE50375941B2474DB46AF3305F2B208D45921F93743A6CB8AC584F | |
1460 | 6BEBE25ECAADD5A789EF60C9F54446687E7B030DA3E5243189F02BA46BFD28B7 | |
1461 | DC14822E136AC7E40CE20458DDBF356488045C95907363864CD6943643BF0109 | |
1462 | EE027A3091C11EA392EA91320EBFEA3B857370AD8EB86D73F035A476F7058222 | |
1463 | E8CDE78CA1AA9EA69A8AA6EBFF3E67324C567B914134DE042D6F8F18A9373107 | |
1464 | 536E8D90189917D343F5299024239E2EC1D2D177D82DC8E344A7CF2AC71AEC18 | |
1465 | 36F139E7A4EB59A67192BCA9ED0EB25DE13032F6FEAFC3B1F4FC81BB0EDC41DF | |
1466 | B9EB92618667C59EA499B788CD26C2137D70F1B0AF793AF5AD0D0941F2E746E3 | |
1467 | F5A7F0288BC1EE11E982EAAE763CA422D72FBBC0D754AD58FBF92629DC8866A0 | |
1468 | 431213513744DB48E52EFC89C83FEB082588E4F30D7DA77BB598E51CAE7E4900 | |
1469 | 5CD570C914EFBA426BAFF7A56FC775ECF5BE13F2C42E51EF96784E5201C0B64C | |
1470 | 074AC229FF0BFDF71E6D5E08D8755D2C12B770B6466A9C9C61C15582DCD2FF78 | |
1471 | E9E74DC2B1CAA344EC0339EBFF92CD2CC1D62E2FA8FF15E7459A83C6CFA58A77 | |
1472 | 2F1A40BD276E76B675FD6834052B33BF9190F04DF6AA5FA3BB7D77A88DD5B600 | |
1473 | 324C5E28216F47682EC29EABF35BA842BA2294A3D72B126EBB852AB741186C9F | |
1474 | FC84B12DC4A6CEC08F2D03EE61B65C845841EE17F1B765649A | |
37c41ab1 CR |
1475 | 0000000000000000000000000000000000000000000000000000000000000000 |
1476 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1477 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1478 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1479 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1480 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1481 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1482 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1483 | cleartomark | |
45c0f7f8 | 1484 | {restore}if |
37c41ab1 CR |
1485 | %%EndFont |
1486 | %%BeginFont: CMSLTT10 | |
45c0f7f8 CR |
1487 | %!PS-AdobeFont-1.0: CMSLTT10 003.002 |
1488 | %%Title: CMSLTT10 | |
1489 | %Version: 003.002 | |
1490 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1491 | %%Creator: David M. Jones | |
1492 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1493 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSLTT10. | |
1494 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1495 | % This license is in the accompanying file OFL.txt, and is also | |
1496 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1497 | %%EndComments | |
1498 | FontDirectory/CMSLTT10 known{/CMSLTT10 findfont dup/UniqueID known{dup | |
1499 | /UniqueID get 5000800 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1500 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1501 | 11 dict begin |
45c0f7f8 CR |
1502 | /FontType 1 def |
1503 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1504 | /FontName /CMSLTT10 def | |
1505 | /FontBBox {-20 -233 617 696 }readonly def | |
45c0f7f8 CR |
1506 | /PaintType 0 def |
1507 | /FontInfo 9 dict dup begin | |
1508 | /version (003.002) readonly def | |
1509 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSLTT10.) readonly def | |
37c41ab1 CR |
1510 | /FullName (CMSLTT10) readonly def |
1511 | /FamilyName (Computer Modern) readonly def | |
1512 | /Weight (Medium) readonly def | |
1513 | /ItalicAngle -9.46 def | |
1514 | /isFixedPitch true def | |
45c0f7f8 CR |
1515 | /UnderlinePosition -100 def |
1516 | /UnderlineThickness 50 def | |
37c41ab1 | 1517 | end readonly def |
37c41ab1 CR |
1518 | /Encoding 256 array |
1519 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de | 1520 | dup 39 /quoteright put |
d3ad40de CR |
1521 | dup 45 /hyphen put |
1522 | dup 48 /zero put | |
1523 | dup 49 /one put | |
1524 | dup 50 /two put | |
1525 | dup 51 /three put | |
1526 | dup 58 /colon put | |
1527 | dup 65 /A put | |
1528 | dup 67 /C put | |
1529 | dup 68 /D put | |
1530 | dup 69 /E put | |
1531 | dup 70 /F put | |
1532 | dup 72 /H put | |
1533 | dup 73 /I put | |
1534 | dup 74 /J put | |
1535 | dup 76 /L put | |
1536 | dup 77 /M put | |
1537 | dup 78 /N put | |
1538 | dup 80 /P put | |
1539 | dup 82 /R put | |
1540 | dup 84 /T put | |
1541 | dup 88 /X put | |
1542 | dup 92 /backslash put | |
1543 | dup 95 /underscore put | |
1544 | dup 97 /a put | |
1545 | dup 98 /b put | |
1546 | dup 99 /c put | |
1547 | dup 100 /d put | |
1548 | dup 101 /e put | |
1549 | dup 102 /f put | |
1550 | dup 103 /g put | |
1551 | dup 104 /h put | |
1552 | dup 105 /i put | |
1553 | dup 106 /j put | |
1554 | dup 107 /k put | |
1555 | dup 108 /l put | |
1556 | dup 109 /m put | |
1557 | dup 110 /n put | |
1558 | dup 111 /o put | |
1559 | dup 112 /p put | |
1560 | dup 113 /q put | |
1561 | dup 114 /r put | |
1562 | dup 115 /s put | |
1563 | dup 116 /t put | |
1564 | dup 117 /u put | |
1565 | dup 118 /v put | |
1566 | dup 119 /w put | |
1567 | dup 120 /x put | |
1568 | dup 121 /y put | |
37c41ab1 | 1569 | readonly def |
37c41ab1 CR |
1570 | currentdict end |
1571 | currentfile eexec | |
45c0f7f8 CR |
1572 | D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 |
1573 | 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 | |
1574 | 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 | |
1575 | 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E | |
1576 | ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF | |
1577 | B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 | |
1578 | A9373ABECDBF32FA68AABB66FAB0C970A3354A335FEDDA1C288245E6C890B8DA | |
1579 | 3D0EB953283ABFE372221EEB1586B0167F634E3F29CADCAB484B81A243CE1E3F | |
1580 | D5106AD6BDB1AEC91123377F816711CB9D5140120FEA84B8205B79D1569509FC | |
1581 | 6B671211985CEF51691C45A168740BD826464B2CB0ABC575E7D453161328F80F | |
1582 | 3AF1C99EC219010EC6C95E0A8D1909719CF18BE424967E90DF67537220E60C3C | |
1583 | 4345B154D08F9EA684710E659DFFB0BA1B7FDDCD519305900A5E1CDA219A6C90 | |
1584 | DF8BD712A3686DAB90344E8784C7A9AF3318550285039B701B9FA1D3A3C3B6C2 | |
1585 | 753F1E794A3463A173C99A9EC0E2AB5737134CEC2C97CD6A37E38692ADB4B131 | |
1586 | 54697B7BBBB23680C72CE96066D8007B90AF0FC5958232AB4F21826691E9874D | |
1587 | 107F47DAC1026298D787989BD77CB43A09FC95F6997DB00D8483AE9C2716CBD3 | |
1588 | 7CDF02DA34FDA2F0754ED0968270E118DDD8BAAAA65C41D699E2BCC2556AA231 | |
1589 | 328187D2F50FD518CF458B0BA1F7DBAF4B231CFD61D5DC56335B53C3013BCCC9 | |
1590 | 85690E19E992ACE55EEF2BA7A75DEE6DC33933C226FC1494269B7CA4CBAE987C | |
1591 | 2C787386400172AE3F44AE47115F4117EED866713BDDCA4A7AF658C49F913CB7 | |
1592 | 308635000043F63BA210410A66E192289592882C477B2EEA0B2A339F0E7CF450 | |
1593 | CA0EF79D3A6C28598825CA03FD688DA60C95EF707C6E67CB7E57DE7A80545195 | |
1594 | 739ACBDF27069F34C9E0216C3D17CFE7A652B910FCC9B9AECC2E646809C22D93 | |
1595 | FAFAD465DE794755AFF5BEC17160C9563B5C51D07022E2D3A256FB5CACE131D6 | |
1596 | F4B30F591A0419D957D8F0DCAA0A8D65A8D83422AD7C2613FF13A302E152B312 | |
1597 | 3F1ABB45E42084EAC894FE335C07324849C9736D00C872C4551997DB889AF17A | |
1598 | A52C5AA77DEB548B0103B77F65717F70B90C1BBAEA7BCB4959F32851A9882A3F | |
1599 | 55673F24103D6BF7FB3AD3EC3CC50FD8FBB4A6B13C3D278174320713A7B327CC | |
1600 | A71F01E50840B33D0FC3F5F6A6F2B0F2D0E38494B1C73096A430510F927235FB | |
1601 | 69E931DA8CE5415EE88D0248565E3347353621A48F7948AC9EAB5F5057541B50 | |
1602 | 82BA955D90BBC82E582FD71904445A59186022FB928015235B60830DA59813D0 | |
1603 | 8DA3FC306C43FF8BB2CB6772B1F7BA3C1AA4B2343E7DA7E065EA53A4E5E28DC8 | |
1604 | 0790F2D5CFB203CB135A08DCC9702B59A63290444F202756E55B9FB053F773D6 | |
1605 | 0F69C63E74DE593E49186FF4304E8FA76C3E3006358DE549E946DB69431981E8 | |
1606 | 1261C9C9A884E4EC708F69E6AF5D22C5BAC49F2AE85903E3D48D03B7B97054F1 | |
1607 | D2937A0C685D912D6D20A75A77712164DCBF8FE4D5460DACE139C5A934EEA09F | |
1608 | B94DBF168A4BC03A9D689936D833018FF43837DF9519AD10F357F00BC068E737 | |
1609 | 170FC9FC6715165F733A0B6FADB9ABB48B845167DBE6D771C916577FC2132863 | |
1610 | 767DC6E3D460E779254194AA690983184D934F5E858C1176B3862B69B42EBE7D | |
1611 | EC9AC4E020085D474093F7694C8A8C2025D4B0163E29320C384D62A9F3FBCB1F | |
1612 | AB5A374EF3DBA48AC2147A207AEFE8B78BECEBC55C97B538F3A0FF4589D171E3 | |
1613 | 826342C8A5186224FEE54E4C6AD5EB02BCB4088B132FA1A48362824BEF161235 | |
1614 | 8E661DCFDFD8429C65CCEF63902D0E07C2FEC1DC2756D942F13FECCB7E8A8048 | |
1615 | 345338F24B7808E46A04A915C111F939E2669A12FAC0BA4F74B832EAC83EABEE | |
1616 | 67E2817C058E69C2010F2572FDD15194CD8DF0FE9F827D349C0444A18D1A86FD | |
1617 | 802BC120A5114FA3523C221242C7E767B0AAF6AD15DA1561CE8EB18A2401D71E | |
1618 | 20481FA5F1E247CB5288F47795A6A3A3BB186E89EAAC4A54AC91405427136127 | |
1619 | 5B151203426830F7CADABDB3FF63B40CA29CF8E667E71615869978E99E6F3F07 | |
1620 | 0170EACDE3DC62DC05681D7680E2E96C30002AE34A4E5EAEDF88577601A82C36 | |
1621 | 22D625A03B0451D7BBAAAE0C396711500E94A482EA787495073F16A76D1657DC | |
1622 | 4EA7C7B83BC30CE7F145B65B6E2ADC207D192CE3B5FEF7031F4BD64F57E1BEFF | |
1623 | CCFFE06F1E4ECA48B442DF413766A70DA626359183A9B24C70419487423C816B | |
1624 | 4BCB067E661E47E172563090D6328BD738D2B0FE41A0C1D7A47576A79BAFC880 | |
1625 | 0473229D134F998909898301CEF50A82B627A9A06DF59D0B9C530EC5D877F1E5 | |
1626 | 220D3A1ABD2ACBFDF1933F92B3137B22B9F95A961D93B729307749A50D8A6403 | |
1627 | 7AD0F9C40743E39B8D198CFCF7C033D99440D46D821D97545B930EF92E7AE005 | |
1628 | 27F2FC766FDD4790FD1913C7A13328E73E587618ABD9008022C5C6C23935CEFE | |
1629 | B5ECA2CEBA1D25DD846B48423F7186E03B1F61C8F1D5AC95CE03C83B2F221300 | |
1630 | 7A761D6CB5F7F9251D3F9A7F4B25B99EE7A1347ED3059A811A82A35A033E9B07 | |
1631 | A4FB2A95009576F48665605C478E5F6C1B135016FEB4AE6A6BE4B4359836E04D | |
1632 | 45AA11366992162973FB6266547C2E570B8F56F6D992D2C0F63950A16839FE10 | |
1633 | F56E59D93A37573E3268C5892C9F3358753D1FAD6379E82BE740FA17236E96F7 | |
1634 | C53A2FF785FAB86AD17EB1DE8A6AA9C69B91C9D9B43B5188E51F6939FEC21B65 | |
1635 | AF17DCE95DD3BA4F1DD51F0BD5E5869A1ECA7398B6E664EB0D189181E9C23012 | |
1636 | DC1E54C146842A90909DBEC03B79B58909205F2CB2A7F83C66B437D7F7DB9781 | |
1637 | FF0C67F004E979C95B706D8D85255CCD827CF6196D847DB380B56980109E96CA | |
1638 | 997157BE78A4F758CE59D78158A854EF2C20099438F74777D3B0298D45BA86D4 | |
1639 | 3C0AC30C984718FD62ABA0567AF0A70C1DD41953E3E7212D5C562085177E650A | |
1640 | 2ACD49940551E3F7619B4CC31DBF67AC15D938619B95DBF66E6D1300B1BB8605 | |
1641 | 31C4011379FB5388CA49E4A9BD6C921560CB8D513F8716A0733D2A7D77E62D22 | |
1642 | A69B54E9048CA168D210816E613CF6357706EF6B118A1263B858B7E19AA98891 | |
1643 | 43BD675B06C893579957BAB97199ACB82C080593ECB8B66A7334779CC16E4D0D | |
1644 | 4AF365CA6AF9727AE29417B61A5FD52452873B1D666044F8E7C1F6C6AA3397B5 | |
1645 | 94A5780F4005FB5E41698FADD1594B505A58253D68D2AE3320E22165D198050E | |
1646 | 425820CC0A43FF1D61F168D87CDD30C14D387610B6CDB63BAA39B3EC9B3CA616 | |
1647 | FF1CC679227749DED3DDEA26B4D97C633090DCB8D8A6E5E07E3579E4A99BF1D5 | |
1648 | 51E43D1D7F139C9CB1D76D8F693A3F23A74EFBE79F01E0B850BC6B6C7F62C2E9 | |
1649 | 859469A144853434895D73DA6BD2B348A48BA80E79327ABD96539F2EA2209852 | |
1650 | E1BF6B0B819D7C68A9A1D0F6F39416E3EC4AC21DCD3C51D3B5B8D417EFAE165F | |
1651 | 2A7E0B76E558AC9F685A76FEC7E3C73CD607D9025DE6113BE5D0401887A53910 | |
1652 | 82A813B026A502B51D484797D9D7E79A25B6624940AEDB4A15F2C73CA1AF60FA | |
1653 | 22D15BFBF268EB044FAE17822511AC6580D1D74DBA3C3335217780B29FEE792D | |
1654 | 200B00B8CD888A8BFF15D938FC758BB5CD9B3E08E1AC6CD1669E663BE86711A5 | |
1655 | 892684DFCAF70C11E803164994BDAD89128AAD6461D4558AC2ECA3E05EB56D32 | |
1656 | 0290AB16A6DF7133DDCBDEAE89C6CD83552792E23CBF567D57E46548EEB0A140 | |
1657 | 437492B53C14419B6FE7E64AC23923A9E85F56A9DF209DC4E6BCAF1E045F9CA3 | |
1658 | BB904BFA150F4083C18B0CB5580450CDB657EA768E71222C71DA911A722AB9D9 | |
1659 | E18B6847F417125C40EA8A0CA1F551A4548712D098209C78DF9C3F78605E5402 | |
1660 | DA2DBE2218E49B819296D5AC88D17DDBA982E171733D1E9E295B3157C9B90BF1 | |
1661 | CE68CB185947D1E3D7544155B741296D14B064BEFD3E6AF25C74006CF6800551 | |
1662 | 80FCAAEE6FC9105E1674EDFE68C45617D8D3E2264CD395EE94EDD017EB85884F | |
1663 | FDF530EDF4F3F14750CA066F149E688FAF8EF4B5FE6AB515CD298E8D170346CA | |
1664 | 9B32BAD1D86DC147BD12EBEDF6CE1E749C5B48314F512470A568C172C35CFA41 | |
1665 | 031E34586A89404CB5372D7B2C7A6D96F420D4D7C2D4C08184F4AF86B4536A90 | |
1666 | 9367598424112A7B05D7107B23695CBCD569002290599E0FF4EC5C852C31F5F3 | |
1667 | 9BD56BB840DC17DEEA579E7A7A9F764788D4E3774BD523D21267869224D68891 | |
1668 | 4523070E80A123B58F7B579866332FC38A41A5915EC06F2D14FBE4A6CAF59AEB | |
1669 | 57E98D661637EBB885AA5D74AD429CCFF64E5149815E7350118E6385F4C74E0B | |
1670 | 2EB474A6DED021D429F01C9B0634A09250C40E22B3BFE1B7246D18116D585F39 | |
1671 | 0E06E9B5F27A6CB77C8E9462189CB900CFEF08F798CAE15FBD94587F33816EE9 | |
1672 | 03FB2DA6826EB69D8C284AB9F7B00630D0420EB6E35E0E288BA25F5C2345C067 | |
1673 | 22412633898AF99C2FB232D1469025BF262B567F29A05F4816FE8EEF5F02BD79 | |
1674 | 06202F6A1E3E5D4B3C91BA8D5FF53D5136BF70E5FAEF441A7310CA83721711FC | |
1675 | 39EE48BFB2FF287234B1A6102AF146B10A632A53AF97E11FFAC3A2A86BBAE3BD | |
1676 | E0459ECF0305366078066F2CC628A3918E775E4236651B3D817AF1684B07A163 | |
1677 | A0142D16F55D2FB5F2255A8813B8E54EF3E801E95A4A226AB8C0476AC5EDCAD6 | |
1678 | 9258ACB6F7C0CBDD298A0B816560622A1871FBE2FAEBFE697A8216A0D8FE30C6 | |
1679 | B1BA6C3E975F78182743842E7F851064037394142AC91B2530FB1D511EB20F3F | |
1680 | 79EDD8B7E1579D35F6E7B2883C47A46B6C1A458BECD6BE58AAFD834A7D82A553 | |
1681 | 2FE4E66878E4699856DEDE964F454638F768AEDB595A883E380408F558015FB5 | |
1682 | 8720954ECE2704AFAD4D62E8BB2657C4FA920D72248B3F762B2F12D125B796AA | |
1683 | 1C4BD6B42D766EC1C9B2C7AA4B6A3474BF753742DE8AB76D0AB0DD9A20EE2DCA | |
1684 | 0F34CB25995ED3183759CA83ABC32B8BDF0B06EF169252587971F7D37463BFA2 | |
1685 | BE36B2E45559DD73DE7CBE29DE92B9BE6B9F8093F934BA311D81E18A8DA92FC3 | |
1686 | 312E3FAB43C53E803975981F0076EBB8F257C123908450661B6FA79E7ECE98F3 | |
1687 | B0A94E0DE3A4DCC8E0FEC106CDEDAA297A75BF1E40F3C2419BF72A644F452E2F | |
1688 | 9A8793810319885EB3AB23B1E80E8B62A889311355C73722C18E62711A7E6A16 | |
1689 | A5B923408444B13F6522FECA9A60B067EE332B83E1A69CD835C9D69B5D8859D6 | |
1690 | 91F9276863D2E2E8193641E4239F4ED15E2C482C735BF5434BAA454EC2830C1F | |
1691 | 7CF766DAC9E924F17F03093132627673BA3D99DC2DBFC89E5BA032C16D3C1C8D | |
1692 | 78B3C464081044DB53C7A29E925F4157EEEE928C8E28EDA5F0A4BB6E0042D8AC | |
1693 | 7595C350645118172D04FBF06B2C9A9F3603A54B57999E2960C993724CCD6A09 | |
1694 | 766BDF73F66E07FCA9BD09079CE8010E6CFECBE2E5DE1EA4E280AB78D5184C11 | |
1695 | 016385007CB5AC0BC95955A1E88EA1A1D8EFEA886007708BA063F556D9284D4D | |
1696 | C764E75CECA51BEE3D35DFCEBF6175953D30FDAC00F23B1721A1DD577945B5E3 | |
1697 | 8176A21A649D907B5F63C71718ECF32ECCF1B26BF15AF694F1045CF98FC75278 | |
1698 | E9782ACD3D83CBDBEE690D29B3176E745AAE436382D258CB22F3DEDD02E441FC | |
1699 | 6A9931AC2F61156DE258DAAD5EDAD41E6C0DFC902173168BB4F51DFA7EA615C8 | |
1700 | B0F92FDB118378CBAC3D56B6B9BB0883C0C14EAA67396AAA7987222A132B7959 | |
1701 | 44FC1E9D6DB6D549DFBEF8D2DD8C53DD3B66935FC239E74E2C440CCA13C068EB | |
1702 | C4A3B69F499F573D076E2C92E24F2C69B806591B0807CD903E078683854963EE | |
1703 | 5125C3640860CEF37BE186DB781475554BFE6C528A9633AD5772BD53244E24AB | |
1704 | 42CA2D1123AF45FA257940CE611D83014DF04E60220E9AF27CB2A2247BBB004A | |
1705 | F5722A5EF058FDC7DC2B6ED1406649DBAA58DF2ED3A91483D60F11C4A39BAF57 | |
1706 | CB1E320A987B790672CDD3E3BEF4A67032244DED2FF4588B2072CDABFEB36009 | |
1707 | 9F4BCBEE16F811A44CEC77F8AE873C90C0F4C975E51014ECBD45A56A63F034C2 | |
1708 | 82212977023A132E5C88AAA826D841FDE9CBCE7A01E4B6F0EBDDB9A69EFEBD72 | |
1709 | 0B41EDA807CEDB791084047624BC11CE10B7A0A311272EFC9E013FA374D97EA5 | |
1710 | F7998FD908748CA72D8CABFD0F01220C2114D3B462B22FB71A23B284B1CBC7D9 | |
1711 | EA20BE71F8ACCED21F096009A14A7C7B51450BA51514707EB46B9FAAB31CFBEA | |
1712 | E1DDA6F5D9AF0B6E7D05A1EEEEECD606427B0F2363D1B882B50140466B9D3CBD | |
1713 | D00DB06DDD1BD4681E367DAA4B7C405C6281B67FFF794041738FC6A01D261CDD | |
1714 | F6E0A330985F2CA782CBCC02B6F4EE5993434F656B91A51CC03B1D73FFA6629F | |
1715 | 14F6075EBFD83B702D8844A96CFB5C14051595BC7DB2218156A6DEDA5C98CAD8 | |
1716 | BEB5284D9D9F86406A8C1AE85857185991C360E5F44DEF352A1F301207BE94C2 | |
1717 | 9A3A11BA468FACB3FA2D683419C44EFDD7C8F1079659F3ABD89D7F168B1591E5 | |
1718 | 6105F9B3FA481BA953CD34CCFE73E427D3AFC46E5C58C2981198BA284DB8B37A | |
1719 | 6647BEAA561799877DD6858FCA71CA6003F2961FAA529906673EA94D82D78116 | |
1720 | 4DAC81011FD175DA707C1E15D4B6FF19F8720A4E05E6E103E2DE880FA9C192BE | |
1721 | C5ABE7C311C2ECCBCE8F9713DBA74AEC37A61C8F21F271B35F0F7C88B182525B | |
1722 | A4183377597ACDA9A6E2F181725D427795B975BC4168A408D292CAA484BD1B8C | |
1723 | 9DC62E737ABC805C8FCB7E96454DA032B601345570EAE0379BDA84BB6D15D780 | |
1724 | 42FA1E068A7D62F152B43B788513E13724666FAB4E2B4F04B0448194E46582CE | |
1725 | 7389BAF0D1DD4435BAA6B82AC305C04686B89FD51197C721D941BD2893596024 | |
1726 | 1598E6C2BD84527EDA6FAB782033E4BB4F964FBACD96CAEC3F3CF89CBABF6B4D | |
1727 | 4D3AD14A03D4BE931632BB03BC2B92842FAD51A19A756892D5B978DB695D0540 | |
1728 | CC9D030C612E2B201D60D09F56332DD0BA1351EE62816C21A35C33DC11B37BE4 | |
1729 | D2F164ACD836A5CA1553CBC733E3B159860454B17064B4E22D3764FF6293BC81 | |
1730 | CFA3B2325C8E072857F6FF4ADAA8818247D431A28D3C5FDFBFB24A6CAA327AC1 | |
1731 | 0B3630C84ED9F0D33B8255A3CAA9C5A0C79F7BF6BA3B9801C3BD0B30AEF7CCA9 | |
1732 | 92F25E332EA97A7CC653C93D1497992D6B76363885B92ADE34C2A33E30A3B1A0 | |
1733 | 57E9C16D8CEC189565808D3FAC92973C71CDE74DE9D8781CCAF88747758014C4 | |
1734 | 5B62667D4D2CC5EBEBE77C5AD00C6A69D1819F5A786964501E077EB3BBEA52A4 | |
1735 | 57729AEDF35253F7E1D31F2DD1587BC15CCFC1B0CA930DA83E2031B099A38158 | |
1736 | 8D1849E7145AC74777A3C7136DEABB0C787E5A218309A65EC7D128147EDE3AE0 | |
1737 | C0AC039B56F767A22555CFCC12DCBC7F5A5A3B4E86EF5A69EEA93DF0BAF2A3F3 | |
1738 | 7504F5C6A7A67388D2F9045BD755BEB7DFBC2EED679497EBEC808BE20FDCB5C7 | |
1739 | B586463BBB898DECCCF7249E9047DA943FAF0718A2050FCFDF8A4C2029FBA674 | |
1740 | EA64003AC03A847185936FC375CC67B3006EA681F61F640C3640A78D0C7FF521 | |
1741 | D477981E23E5956BAF42252463FDBEC49BB560A9428D248B0C5250CFA2A49CD9 | |
1742 | DBCEF73123C13BA382D3CF6A7B8A8CA3191D379A659F0E2C6E9CAFE9DA2AC074 | |
1743 | F622E397A2F7C73347364AE249B11AE2C34AA7F0D27B5F35D548D5AD1228597D | |
1744 | D16A478C901D3A34D870BA39F770885B7DE62298F0114752435050E99EA4E5E0 | |
1745 | 56B965EA185E8DF96B9FE97EE23DD45AADBFE02B427222B9FC99DA94FB2648B8 | |
1746 | 46BD30F881BAD3820DCA4D8093BA0FE70E03482CC063B751439125623FA7AE40 | |
1747 | 52DB2A380D89D5E37BF264CC73DA9A1540031587F481A0F146C6ED6F3F2957FA | |
1748 | 19477F075ACF64D424279612DA5AE02B2A140048386D01B1F30EADF2050B71A7 | |
1749 | 993773D5B68C6FE65EAC53411AC6E7E26E49BE5FE1079A8BC565D2CEB7E3B896 | |
1750 | 593D720DBF66CDB26DA5D8E533A346845E31374A7C85FB6B06C3D54FE3408013 | |
1751 | 864CB0954A2FFC00ED17CC167AF714716376B789A71059DF2032E0E907761E81 | |
1752 | F0C887810337F52662AF43FA1A7528923B0A30A217FA184ACB73207EB3018D5C | |
1753 | 09EA88CA0873AE690E94D43B360D9C1070D7CBAE9BBA72E82EF9914D3AED6D1A | |
1754 | 5539585EA969F0A1407C8FEDAB69BA3EEE3097D5B123C5770D5ACBCB0882F35A | |
1755 | E8A3E3B1FE3903A941EA2090266B60D218407AB99EEF38F18C9FA307D73E2F5C | |
1756 | 42F8C37E2F668BA6B0779791D8404E2B2CA52E28F0B34C85250B0D6AAF9D2DCA | |
1757 | A12133B5B601D971345EB6D892B85FB971DB8C4A4188ADA6575DC6DC42D2F0C8 | |
1758 | 4EB946AB47F487B6B4C4C59B2FCEB1291C386805C5B62B61FD7310A13B4620BA | |
1759 | 650DDF28FC1AF21FA124C16EE8ABB98904F03E7F49E54348B1AF2211A1768768 | |
1760 | D62E35EA2EF7F2756B58168F9FFB5785DAEAB324C90FDF6207E670DF277D6AB5 | |
1761 | F0924B26BCF52CDA2980680320314F41244B73DA6367C434B5DCDB96B6F0F454 | |
9f178efb CR |
1762 | 89BE7553B58CB230BE71B2C7A7F1D63C3B1E80C159DD941027EA44D54767355C |
1763 | 6EB30D38D407FA1189474C2F9D3FD92F5CC6CECC63CF6CA6B33D77F08D274A1B | |
1764 | 0AD7C2DCEE55F1B425BCB98F24D0BD431A5BAF6F42BF897BDE9198E6BB331C81 | |
1765 | 6B5B63F3604235FB733A882BA5464A3E5415341C8E9A2E79A5896C8C334CCBB8 | |
1766 | A2047CB4E6BB167BD586FFC4A1409B4C13DA0B84608126D10754D562A9812A79 | |
1767 | F2B3078B7CD1D0A37A192E1D58623331B582E62291B6EF6FE3C92E8EC9A40C37 | |
1768 | B251270944393FCF133426FBCE86A318E16141654DD7BB12AD46B60A05E86D3F | |
1769 | 14BDDE12FE3B17F9E2443E057FD0A25677D1F17C2BD87F84BA7D6AE3E7EF3EF9 | |
1770 | 3DEB268B580A7823253430FF8D80FEFA0F9E4F66D0733E251E7F680B8B23B7B5 | |
1771 | A614F4FAEFAB880843451E4D9840AF7B8BBB6333E010A169528748AFBAE9A6D9 | |
1772 | 499E221149C0AA19D536F3F121DF1AE056D3D0FF5C6D837BD8061153501F0209 | |
1773 | 79076B4E0C63738C54BB31156F2273A327D3B6D0DDB5039D27D1C4020E90C94E | |
1774 | 4A4B156B32F28DD132D2AB4D9CFE18B7851A65BA965382B23CCC0915EB6847A0 | |
1775 | B14492B0405395BDDAB36C2205F229891D989196608455629CB3CD67E07DEDB6 | |
1776 | A09E68BE431182D6CE52CE41B8531FF111ECECA60A68E7E7BDB6B91C7B694688 | |
1777 | 47786E04588AE7D21DC6F2309D492FC9795DD054C150ED94110A7F89CF3E92F7 | |
1778 | 4649D3F4C778FBF02ADA9E577C5EBA24A1F0278E9D9DC5556A60EADEC068AC57 | |
1779 | 5359E9FD0D2E3E7B0006127F95F333D2BE77C70EBB163EA9679207C76C999903 | |
1780 | 50D76BDAB2DF0D6A506EEA9C952A3D28D419FB78CC64078CD91C39A5D4FCD9B9 | |
1781 | D135A4E24E373E24047EF1180D3BF51DE4167F3945825B7124198FCDF7432E20 | |
1782 | C35BE9B0C7C0CC194867C4CE9BCD27860826C14749B811E8FEE29015CD65E7F5 | |
1783 | 307300B316054B7914CB7464E6AA37DFF4BD0AFC04C0E8BFD1269E2D4CB5A201 | |
1784 | 785C32B6B5656A7F6CA6AD8F7C77DF8F70B8F99C88BD8D548E78986096C917F1 | |
1785 | C0C195F4CE7972F1354B95D1BD84934D80CFD09FA14F3DF37300B5E8C208C66B | |
1786 | C544BFBF9B18AA7E27AC4E8567CB7188C20B1807BE56BB2B348C551767F40A07 | |
1787 | 022EBCBE0749DE0D8FF1E2792A0BF2B84C940A127203E2216EA4F8689C84C739 | |
1788 | 58D5693082E057B67C9BD80FBCA6463D9EFBA2B9F4D3C8F239C1A70D8A4A824C | |
1789 | B045489E1C6BCD28DA4F1BEA2BD80D424722479D0E8A1A99A8B2FE26822D3198 | |
1790 | 722E2D276A123A95128EB6C5C6AF9AAD213D088EE92917E0870179888296F4D1 | |
1791 | 0FFB87A340D7F052B07C6274027559A8B3843F2422C3640848CD8BF664645EA7 | |
1792 | 20EBCB14E9B15F552E9E793B2F5D7BFE849817CCDD9BAF7DBA26BEED536DF80B | |
1793 | E250F831A12EC703AEE5ED6F5C688849B00C85AF124451A29CB67398FD3D4015 | |
1794 | C5D8824B7EC81F85CE9170560BEACD43ABF5EB5329A4E38431F243099B8F88F6 | |
1795 | 58E8F6A7DF8AED9153CA90F9C941320750E5C26262BD14CE3CDBA9AED2270546 | |
1796 | 24917E378761B5A96F0689511C12A0E598E7BD54A6ABD40AA4FE651AAB9DE733 | |
1797 | 88677F863423C714476E797F4A22B94AF646819D91F9612E6E5CCFD9F7D11AB2 | |
1798 | DBDD3C8ED9D257E5A8BE4B7DF9997EB2ED23EBF4BFCBA1993796E34AD93C8CAD | |
1799 | DDEE75EC199BF642C34BA24E323A7099C4B7D232328ED3C7A3BD476FC0B3D921 | |
1800 | 8E773970ED221BFD47FC656BD14FEE47F06834C55C0EF960DF0265E847EA4421 | |
1801 | CF81FDFB40A4C997B1EDA3556FCD8BB4EB141EAF4DF853FD353120BBD37D4B44 | |
1802 | 2CA1C1D5D8A5626870AAFD925B461A65FA0E2924A197F27B224E53A7140A83C3 | |
1803 | 10A7F3868E4801C216EBFC5F8391A1576C69537686DB1CF7F2AE299FB03CF222 | |
1804 | 6A38A57466A9C0DC13E9A8200649DA837A6C40E002C25114F0CFB3D2C0A9AF20 | |
1805 | C7B387856AEEE008AD60FA1B26179D95B3486DD3E5BBD096D4B105117418F60B | |
1806 | 26AEFDF53A815F712956AFAE0585B243D5A2B4AF5B517023867F57ECE2D538D3 | |
1807 | 89804EFA77C0D9CE905A3303F19A9AB3B228A03B88CB26631814A36C27D09E56 | |
1808 | E965514293048ACF6BBAC80329F0422591F06637A274F2582A6BC59ECE5DBB7B | |
1809 | 7CB5056822A2426E4359DE632F89734AEB6F783952B007EA1D2EBB7CFB1C1D78 | |
1810 | 7EADDF28CA76CE34F78E568B11AA69FAB64D8B0FC933FAD372B9EF19D5F31A25 | |
1811 | 35BAF075193980F69141538B7E7586E8DB534762CBD9E95442AD17C8C2F438D4 | |
1812 | DAC23C5F5D772D1809ECEB13809662C6C8B97DCFA5AFD46C6CF3FC6F07BDD604 | |
1813 | 5A4C473C7FF3ED34462A79487EB47D5BD4580E98BD44CFF016DCC942E831F7BC | |
1814 | 759A345622F5C65C067C83F7474EBEEF62E63F5B49519E0E1A7BA279784977DB | |
1815 | C646DFE8D0AC7D78CD27B8F9D8E18A3A1C1AD427A85401543B0CE4F4469FE14F | |
1816 | BFD02FEBB2050BD06558FEBA3F61D35AE7A0E49639DF68910174F41A20F5C839 | |
1817 | 79545CB64FA870FA9AAB20B80CE7D85DB8A0F64915E1742E5835B5152BCD4B89 | |
1818 | 4E7BC34E8D8CC93F5DE675090B7BDAD2728022F29D6A7D0F5508A189B8E0CCBB | |
1819 | 87AB29B9680978381252A9A37AD5CEBA8E4F8CA2C06D7A2133FF94B3AF05EA7B | |
1820 | 0C1497955A4E04183092871E66A7386E063B58764B62C33B6997F2E0D7F4AB76 | |
1821 | 6093F606DF3C4E5F8A06E9D602E36F2DF4CA2E8C59EA6F8537A8269EEE427271 | |
1822 | E1FFFFEC053811328AB1FC60821F4C13D277EC66F56F27E0208726C915CBF178 | |
1823 | D2DFBEB767FE08AF1DEF4219F6C97BA5505DA3CF06BCE02E8E5013872DDB0E9B | |
1824 | 01103E8F7213F1A00C473349820BA7F202C9F8632B9D7AC4FCC98287175CB2EC | |
1825 | 7800B05D4A7617335D1CCC2094F70BA6556A99F2B9365409971DA4BA1913B7E8 | |
1826 | D6D84BBF1CB40FFCBC9B1C6306E9A148F39874A1E2A8FC677EB621FB46304D59 | |
1827 | B982A381886E99BE387640FAEFCE8182A2CC9AC76C1078D9E03CEAFA0747AACE | |
1828 | 16F9A95F5A97265A208ABD10C3BF49C1856461B710A29887CB6D57B61D24DDC1 | |
1829 | 5DBBFEE1DD43EA93F9B0B70276253A89546A4E3918B5C93A991AD372606F091F | |
1830 | EC35362E95CAAC00280DB8BA15DFA28F9AF7A6F9EC51FB2ADE3D15599AF01627 | |
1831 | B4D96F3D35FC4995EB18DA916FB6D24B56D60084E0CD8A32AB934845FF24B689 | |
1832 | 67883D3EAB40BAB8FEBC3C17F6145CE0B96BA50A9ABEC6F1FF955C9FF80DF500 | |
1833 | BEEC7AEEA8C2FAA50968A57FFA5E9AFBAFF08451A63625918621B8FE9A46255C | |
1834 | 86B9E145C2526E4D27F974D74221FC90BC691454D7CC6413AEE3321D64E57F58 | |
1835 | 81DF5C5954C794492D4135F130855678C8BB7C4A3E3551D2E89F3DF6B049D857 | |
1836 | 9115B3697E07024C34985FDAF5EF24210B2864F9471879835FBFED10D7535002 | |
1837 | E806CE05BEC90ACF31E49AA6C62D9E169196A7C358E1AA5C886C1E1544568C2B | |
1838 | 500F208319AFCB37CBE4A568136B1791844DB5B627F66C75DBB7FCAAC4EA4620 | |
1839 | 323DD1FC501727D74CEEA2C3D1B4D63779120AE0B0843FC978E1EAA6FE4FC337 | |
1840 | 46F12F90D6168313CA077B85990EF9C6EB27F71D3B8C262FDBB297B1B88625E4 | |
1841 | 62143BD515F6FEFEBAAF35ADF8B57486A14DC57614488C332E2B81B946397168 | |
1842 | 1069CE21C21E8F44B2DB9EFC2F4160F17ADC55DA7218DBE64FBD5BABCA4C5718 | |
1843 | 9748B61B8F7F9573847E7BB62DCA710100AD39FA555C2C3B3800BCE7C78BA404 | |
1844 | 3DBEE48BA6328F47B1E72A507432BE4A7EA3F0AF034B2E29A4CFFAE8B30AF806 | |
1845 | F71936B5FE86F73F9C4B81123E1AE017B60EB2EB108EAC9579F3EF142CEEC861 | |
1846 | EAECCABA38C637306D8379C02548B4B33FB5D8A6169B3899A2D0499899946371 | |
1847 | BCD7D8D37924B66E4DFDF25ECD17408AA78A9A1D1C8A3615E428EDAE3E56017A | |
1848 | 0C2CD79A0D92E6DDC54746E5095B4659D73A251F3B7FD7625CE7EAC3EFB61409 | |
1849 | C1463D4015619BA3746F278188E2F30F997D477491D39625C2B829845D4EA97E | |
1850 | 56D7F3883CDD5938BF1BDCA2DF5BBD0E3D495554A01840E7E7A081A736DF6D7E | |
1851 | 6BDD580F717261F6A3953157DA05AA3B57FBB1E977C6A43555F7BDFCB35C8B8E | |
1852 | B6356A4F1B01317B029918AB1C0400CD32A41515CA55E59CDC9C4641A570DA65 | |
1853 | 96FA304094735B8B070FCDBA01DABC55C493A390F3A0B60D31C6EE3176BD5257 | |
1854 | F6CFCD17682833155B9DE734CE94A232BF9FD8AA45C35DCC0B16FEE6EC241BC1 | |
1855 | E944B183ACFFCBA57219D6BD9132E9610780D4AB07FB2F77428114E800CB5855 | |
1856 | 0C26502E4B09AD0EC8A4B342DA732E24CBCBC7BEB15322BC3A4B004CB9652D27 | |
1857 | B85525C0E59DF15D972EE00D5D6DCDDE1A141DEDF0BF9309463C7D5D0D95077C | |
1858 | F41EACAFA40CBA65004AC680983DB2CC892C1089A58514051E2C0FC16D74056B | |
1859 | 34151DCA72FADD08765BF73139A2A15A46067064490DAC5AB5039C545DE452F7 | |
1860 | 35416482DD79C77BD0256D6BE9005C80902D9BE36F06FA4431F1DFBA7C982C66 | |
1861 | E141DA88A07902D83D1A83C0538DF2F8F8719409259196EC46B9D7815E17F836 | |
1862 | 4F06E024C1A05A594BCC8C7489B3DE9E9C3B9D2D15B8149F6D09A35A8444CE1C | |
1863 | 704E2B8F273FAD8128A6033E871F1A36B95969EF3EA5EE8DE9B2720FED92D43A | |
1864 | B894DFB54E6F3E4D92E18AFD7B4D72FD675AB7447729F4F618FAC4938ABBE9BF | |
1865 | 29045FD578CFEDE3BAFA55419C564CE39F324592304FF7B339DC2D889C157BE3 | |
1866 | A182E42DBCB6BEA7773CE2A058EE2076C77CC98F0C37CE8128E1671D8BD8AEB3 | |
1867 | 1E724BE5297AEF6F8F90719D75E2218470034C970C7C3BC4CE46234CF25F3092 | |
1868 | 526AD39838F4DD2399A4DE9BE341EA932FC616B02FBFE7EC68AD6E98F5AB3040 | |
1869 | C00C615ED7C7D427387D5AA99594EAFD54D3CE88DEEAB0A408C14B48217D73B7 | |
1870 | AAFF60D219FC71262E05BF9D15DA7739FAB52683D27A3E094B40D84E3C272D26 | |
1871 | F9CC125000AADA491137363EEBDE57EF302943F26E7DE08EC71707B62E717F92 | |
1872 | BE14CB7F5D4FF8A802030B10FA8AB4D93286AC064E0547032E2AAFA3E353F4A2 | |
1873 | 4B3EA80EF4221C81BA5698D58A460C0412B1C1BF143E547DCA6CCA584011B55F | |
1874 | 526742925DBE8300564D621015796CD280DE573A0A733C5F6B2D4AD811EE4778 | |
1875 | FE60F46ACF6B6943B07B0EB0E4636823430A301B06BE688CC24785A8896BCD42 | |
1876 | 39B97D9963BB74BD8BF05217B615983E27994FBEDB0577010E46BCAA04DB1A72 | |
1877 | 77F4ED8257D145EC44B2B65B408BC71239F1C2E8434C1C2FEE4642BEA1C60C7A | |
1878 | F02BF44140D0DA3E94D7658312A212FABFC0AA74F3512D513E82248BACD86A15 | |
1879 | B5A2C71F3692C8D702FA11B262ECE33B382C681D54BC275FBAB326D928A6A327 | |
1880 | AB2ABFF6C4A65339D945A671AD839DEACA7412ACA3253B399BA17E363B213FCC | |
1881 | 962725E0BD8CCE55985438700204353C507E4DB96C1B57DD7A071124476A5095 | |
1882 | BDA4C678F514AA63CADCF7003C73F0C505590526C0D1BCD7DAC0236243AEE48A | |
1883 | 5F351E12194DE6754336416227A63FE6C37D472EA1688AFD88FC94922094E799 | |
1884 | 930F9952B2B1B86D1436C843A90AA230139B82449E16EA8B29108AA624933D1F | |
1885 | 5BB7E1EC1E7F570BD1DC0D2A9C338F4590D590AFE417D289B103E11156D66DEF | |
1886 | F9E1F1F3A68DF07D69FB9CF4D09F2E2D47C2168E0BCECB8BA1CF856826B51D23 | |
1887 | D440D7EE177DC922BA367BC69871D037A508B80E75F43C331F7BB5FC96493932 | |
1888 | 0B3CA39DB05BB29C08348C3F0FAC71ADA5C07BCFD160FE677A8A030BDE2C4A6C | |
1889 | A866D89CAFBFE647B36F7931664F82997CBFDECB6F88C795609D1C94DC80F09A | |
1890 | 87221FDA3A699D0748F97E682B5B8C7B1EBA75BD44070DDBECB03824F9EA4E1B | |
1891 | BC66A08A1A0F8AA3DC482D408C83B469315A2ABA685726CEA99BC3D15799D28D | |
1892 | F81E0BB958E34A1670C23FCEE68A0DADD2BE3CFCC1914A9FA1B1A661693ADFC6 | |
1893 | 378969C2E400E5D4AB0CB7DC0FA364893D2484DA98264CB50205B7B9A2532492 | |
1894 | 81A2697B7FA4FC77E71D3117608ED7C474AA2FFEE8B3F1DD942CB16A1FF06C6F | |
1895 | 3741AF6972D09A5EDA91B4EDE291A7B3E3D481005BB578DC5AF13C88EEE51380 | |
1896 | 78E57D8E073FA46B89A1DD73D51AB11B44048CE2F031031018697B2DA15BB05E | |
1897 | B69E9E54F85E09EE3EBCFF390A9CF28B6F0932A46C9306911F2F36B8CA3ABC14 | |
1898 | 022697A6BC560C0A688BD1E49AA9F9CF4917130ECF08F8C500E0096A8BE65E01 | |
1899 | EE5A2618E3C9DDD1D227EB584EB0763C6294B91DADC65AA8F1DB42BA25E77B9B | |
1900 | AAAABEC083135CC61C18987128961505D602E409C3DB90F301CE2C792AB7ABD8 | |
1901 | 1B7442AB1C8D5B1FB5AB30444752254A530B227A1E7CBC615B045031FB07468D | |
1902 | DADBE63C9D1AC6F9742738FCF2896ECE73C131063E6FB3B954A77D1CD1F5764E | |
1903 | 3D65A43B627E8E7E10C5966C93E9794A3211D8B349D7F82427A65DA39B4AD1AE | |
1904 | A98733594453F400B9841AD3207DF9A908372B8B7F8EAC363D0DDFB90411A468 | |
1905 | 1F3F0E7A8DE83F3CEC745BF43D341A20F53BD0667B70613FDB9B1379FA61BC9E | |
1906 | 516118F7B1DC7A7B049E116A7A254F0A363694920EA156DF045038B14C229E6D | |
1907 | 19417309B6DFF125580B5279D6CAE9AACA31A1D21AAEA8DE32180F3456AF61E8 | |
1908 | AE8011BFA62D7B5A8123A02131D2F622211D74F104CD729CBE44EBC70672C064 | |
1909 | 6D8CE2956C78B8CAF172B77E78F715DDA875A492CDD8357CB3AA3ED817043631 | |
1910 | 0D278C6AB079AEC3C765D5E0267BD01C1D3F7AAACD0CF34EF8DD2FC5FF8FE85D | |
1911 | E410CBDCE53C792C0ED5092162DB85E6465C058D95816008077E22EB8A98B8D2 | |
1912 | 5A4069933FD3F3DE33926152C7DC712807784C17863EC78F9FD11A335BF8C700 | |
1913 | F4963F7C1A72505DB453012507A3EE51F7F2E814CB77769356C7654B9569B68D | |
1914 | 36C1EBCFACDF5C8D91D664820758BA73A83EA9660E33D4589C6950CC5C612710 | |
1915 | E9E97BEB5CB43F4109FC0F9E5EA126C1A9F2C4617CA146013F01E810EED40041 | |
1916 | 5D09159A5B53FAF73B151499CF4BA3B79A19034CE461298D1B805E161CE837C1 | |
1917 | AE9A7298DB9DD9E54C347E64772AF100A5C736173D5D9EF4C45B8FF6B0ECA17D | |
1918 | C1ED7FA96FAC530778D72CAB4D9920BC6C137EB3187B1DEE669419753B6472C4 | |
1919 | D29CF8ECD1D43AC03DB1413FE6D4A883857E2574C68AEC9AC7F7D3173E9EA7AD | |
1920 | 1A8762EB2841D29BA98B8C59BF52ADB41A1C06A50FA66C169605BF950AFFFED3 | |
1921 | 6CF7FEE0126C0AF7DD7A85796BE7D93A124581EF530AA62DF4CB06A15A17D5E3 | |
1922 | F6B6B72CD7481D238B2EF97123EE55872A43599ADCD48443DD9DFBFD469C71D2 | |
1923 | 624FE39A15FB5CC331E29B20DD1994FDBADF7E2843ADFEFFB38AF6E727638848 | |
1924 | 4BB02352C312A363C3920604853550205484499FE4B1D8A29A4913F440E37CBA | |
1925 | 9CFE762651749B33BA532DDFEBA257869BE4585699ED7E918FF72D25F3EC0C71 | |
1926 | FC49EF6C38DD1105AE50D5DC13F6F1AE2FC3264C549FB4D8D1A959F25DFE913C | |
1927 | 1ABC41ECBB5B538BA1C4870E73599BA518FF41B6445D40C9B9BDAC2D552E4533 | |
1928 | 670DE0C40C155E46AEDF4B74BD44A521815B69981F4F33EBB774391320D8B6DB | |
1929 | AD9C9545557E21A90EA55CFA69B967F3E136CCA7A1E4C9D312D9D08940DECDC9 | |
1930 | 1CF646FB7704DFDF783BBB1739DA1D2EF502B7B3A1FBEAD958DC99F086E6B623 | |
1931 | F33ADC3A758138E47EA3DE1FEC42EBC6D675C658B9AAA4C4054B1F81CCC4D216 | |
1932 | 9559BDFD542140F2A101095F2B3FFEA124F407A8B650032265A48F065C3C5BD9 | |
1933 | 66D843E3A2BA4CD7BF56A6A10D90345B51969A03DF45C91EBC2F3023A3E71B4A | |
1934 | B6A7DADD9E3EC5C70207F743157A9A0ECE23A7A95798C2174281A7900919878D | |
1935 | 955EBCA90D02F07876BC3F5EB1252A82D891FB3E0FB9FC032080E6F700981030 | |
1936 | 0E81FC3E75AC8623405CCAFA66161D5D471EA952F0FD4021754CB61A7B1445AC | |
1937 | 0547EBD4D78F141651A5DEA6262F0A05559DEFD434C5485FFBEEE7DA647AFECD | |
1938 | 6468D4D3905576FC4F670BA39F9956149CC371A31ACA929CAF0668B667DC2CF1 | |
1939 | 8810C6CF9EA23CD5576C110183155DBF15F24CF0973532800274127C6C5C9C79 | |
1940 | EB121C5F0B74D824DDFA3EC4BD7BBB8799875B8A4776B60F840AE96A8F65724F | |
1941 | AAC3BB862EA6F8697D935C60C2DF962F042521BB1D3EB9C064F2CBFD84208D94 | |
1942 | 0E9DD9242157F4D3DB05194E82FAD5EF8C09092055463620D1B4ACE3BF9CFDC4 | |
1943 | 989840A2CE7BF62D69BBC387D0184EBD87755E4DCEB8296D1005E79779A19B14 | |
1944 | 354345A8A0324F1E61D88A22BC423D3DB4686ACB6CCA3CC515B6A5CCA6C888FD | |
1945 | EC2CCB767778AE3FFD7ECBD8BF1828E5BDDF119247F11B299D5272C475C67113 | |
1946 | 8F124D25A87AD26E8B7713A5189FDD920EAFC2D9069664744B6E7DE1AB20E798 | |
1947 | 8BF9B8885BED5CBAB904032F6245AC752F392524C2FE09F636B59B17ACCE1E56 | |
1948 | ECDE4533FEE75C6ACA81D3FD7F6032B865D8B6F34DF1A99E01FB6534659921FB | |
1949 | 81631346B4530CC2E6B15389D7D494A4851C5F7CB502B394E840ECB67D359B77 | |
1950 | E940F25E96B3AA4DBFB0689C0C8D41EBFB5A9ABF7B817AC487093BA1013E345F | |
1951 | B42647E031C22B77A319062324A7BBFDC9DAB8D5B1E0FA4FBF8036AD46E554F9 | |
1952 | 6B925144323B7A79B103E808A43954DB3A03120EE5BF48438C0ED2807DE82FF1 | |
1953 | 6800AA8EEEA5C70DE747B76246A437B09F402C8E1B545636E0860F670D10E42D | |
1954 | 9A579DEFDAFC447917E0AE0AD49F49EFEEAD72A83149A22A82F909670FDF4A9A | |
1955 | B106147A6CD6D9CA4FD64191B7883E89C30FFC30D3262B9B09CD7D2440D85F28 | |
1956 | 983B191CEDBCDBC06375195625EB247DAF10FC3F01259E59184F462B79592181 | |
1957 | DF37D70E698785E55E0810FC9A5094CA115B2067FBEE8ECB004856C68A18AE7C | |
1958 | 9BB1186342D173068A4BD0020FC703BC1AE0D6C8EF419288D7D0F09042C5CAC3 | |
1959 | 6DDFFAF9A79B811C55F41AC87F93DF99604165A6D6E5938016C155EC65393512 | |
1960 | EF633ED422AD5BF8C66AD82B3B2B0FC59F40ACA8B62B2195D84478F920C39EFC | |
1961 | 328C9EEAB999D28CB365ABA1A99475D57D5BE151E107BCA6C65D535D8E83EF91 | |
1962 | 35EC4BBDC0C5A124CE24ED6438F2103FA03BC103F899CC0E12428A807763DDC6 | |
1963 | CD11E4E11749145810B387906A7B3065BCF1E29A1815ED266DB7A429C3FB2860 | |
1964 | AF3305E4FE74E02626385FAB8833954B803CFF6231810CA8CE55EDB2DC2B1548 | |
1965 | 82CFD8F105CC916B0A55E3955BEF60680B544501937E9A6FBDFF46E12B114967 | |
1966 | 2066512D019B1D727D3759A708E5D8D8FCD99AEB82B3F660602F8BAF091A7AE9 | |
1967 | ECBF15E7720F671E85C5FE0F2871CE1EC0A7B8E923EDD845F6C8F8CEACC70DDD | |
1968 | B2F87D25890FF1DB39BFF89A3A35B8B14742B4571F412CDF868177E406C9D07D | |
1969 | B759D6D32A7CE22D9E9FD13802A170F20E9FD757B9DA76B12712FF6DD0E8F4E7 | |
1970 | 4A296ED2795FFA5A0C3CE468C7A9CCA440C599C207BB084B1DEE83817A7F23EA | |
1971 | 1A4ECF72B3786D72D12FE3123D33559793046B7773C9E93AC1172026014A1917 | |
1972 | 4B66A90C5AF50072C231F0B633F00EFED86156FF0FBD451C161DD06EDF438A38 | |
1973 | 91FA7FFBA022A4468296A7132A3D88AC243B69C70F21B7AEB32BB5AA21800620 | |
1974 | BE6C8116466BB843FEBE361D1DE93F7C38033C95EBFA922FCC45E812B48B1A23 | |
1975 | C33DE814EE885A2354B37C05E405D27A0D3870E19CC718284FDD45F7926758DC | |
1976 | 62D79AC3C0EAF56B6812049148970442ABD34E0C0F49A6711A134C5568004C24 | |
1977 | F92B455E8085D77F48ECE5FE9F27FA91379C939919E78B60A54E235B0936B3F0 | |
1978 | E1300BB4CBFD05A18DBBBD76524B4084D54D990F5EA51E5670906E358B4977C1 | |
1979 | 83A7124F6BC09AEC282DB90C2FCCD9D909B57959E6E68D2E50344100EB1B6BD0 | |
1980 | 1A1FF2C2F0B250AC9B1FFB4A4EF3F28C022F7F873C7B3AF76E1830C9B039154F | |
1981 | B3C3BD97DB32958B718D53B552A7A0B033E84EE515B42184A22A10D77FFE32EC | |
1982 | 0E1CD1708021D7931DC73448FB098A61C93B7D03F98465BA42D4B927AB115C49 | |
1983 | C0CB10C0BD55B16E6BA017306506D3D610ABECFA480D8840DAAF23CA03AFD9CF | |
1984 | 1075C8E9B821499DE23D4882C081D51649E5C9BBFF1431057D95D61351287B03 | |
1985 | 0C9A6BD89F33C02555E1D3DA7F03CC395C1E3633FC902F060DF903FC96C19719 | |
1986 | A5B6A39E | |
37c41ab1 CR |
1987 | 0000000000000000000000000000000000000000000000000000000000000000 |
1988 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1989 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1990 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1991 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1992 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1993 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1994 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1995 | cleartomark | |
45c0f7f8 | 1996 | {restore}if |
37c41ab1 CR |
1997 | %%EndFont |
1998 | %%BeginFont: CMTT9 | |
45c0f7f8 CR |
1999 | %!PS-AdobeFont-1.0: CMTT9 003.002 |
2000 | %%Title: CMTT9 | |
2001 | %Version: 003.002 | |
2002 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
2003 | %%Creator: David M. Jones | |
2004 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
2005 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT9. | |
2006 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
2007 | % This license is in the accompanying file OFL.txt, and is also | |
2008 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
2009 | %%EndComments | |
2010 | FontDirectory/CMTT9 known{/CMTT9 findfont dup/UniqueID known{dup | |
2011 | /UniqueID get 5000831 eq exch/FontType get 1 eq and}{pop false}ifelse | |
2012 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 2013 | 11 dict begin |
45c0f7f8 CR |
2014 | /FontType 1 def |
2015 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
2016 | /FontName /CMTT9 def | |
2017 | /FontBBox {-6 -233 542 698 }readonly def | |
45c0f7f8 CR |
2018 | /PaintType 0 def |
2019 | /FontInfo 9 dict dup begin | |
2020 | /version (003.002) readonly def | |
2021 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT9.) readonly def | |
37c41ab1 CR |
2022 | /FullName (CMTT9) readonly def |
2023 | /FamilyName (Computer Modern) readonly def | |
2024 | /Weight (Medium) readonly def | |
2025 | /ItalicAngle 0 def | |
2026 | /isFixedPitch true def | |
45c0f7f8 CR |
2027 | /UnderlinePosition -100 def |
2028 | /UnderlineThickness 50 def | |
37c41ab1 | 2029 | end readonly def |
37c41ab1 CR |
2030 | /Encoding 256 array |
2031 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
2032 | dup 33 /exclam put |
2033 | dup 35 /numbersign put | |
2034 | dup 36 /dollar put | |
2035 | dup 38 /ampersand put | |
2036 | dup 39 /quoteright put | |
2037 | dup 40 /parenleft put | |
2038 | dup 41 /parenright put | |
2039 | dup 42 /asterisk put | |
2040 | dup 44 /comma put | |
2041 | dup 45 /hyphen put | |
2042 | dup 46 /period put | |
2043 | dup 47 /slash put | |
2044 | dup 48 /zero put | |
2045 | dup 49 /one put | |
2046 | dup 50 /two put | |
2047 | dup 51 /three put | |
2048 | dup 52 /four put | |
2049 | dup 58 /colon put | |
2050 | dup 59 /semicolon put | |
2051 | dup 60 /less put | |
2052 | dup 62 /greater put | |
2053 | dup 63 /question put | |
2054 | dup 64 /at put | |
2055 | dup 65 /A put | |
2056 | dup 66 /B put | |
2057 | dup 67 /C put | |
2058 | dup 68 /D put | |
2059 | dup 69 /E put | |
2060 | dup 70 /F put | |
2061 | dup 71 /G put | |
2062 | dup 72 /H put | |
2063 | dup 73 /I put | |
2064 | dup 75 /K put | |
2065 | dup 76 /L put | |
2066 | dup 77 /M put | |
2067 | dup 78 /N put | |
2068 | dup 79 /O put | |
2069 | dup 80 /P put | |
2070 | dup 82 /R put | |
2071 | dup 83 /S put | |
2072 | dup 84 /T put | |
2073 | dup 85 /U put | |
2074 | dup 86 /V put | |
2075 | dup 87 /W put | |
2076 | dup 88 /X put | |
2077 | dup 89 /Y put | |
2078 | dup 90 /Z put | |
2079 | dup 91 /bracketleft put | |
2080 | dup 93 /bracketright put | |
2081 | dup 94 /asciicircum put | |
2082 | dup 95 /underscore put | |
2083 | dup 96 /quoteleft put | |
2084 | dup 97 /a put | |
2085 | dup 98 /b put | |
2086 | dup 99 /c put | |
2087 | dup 100 /d put | |
2088 | dup 101 /e put | |
2089 | dup 102 /f put | |
2090 | dup 103 /g put | |
2091 | dup 104 /h put | |
2092 | dup 105 /i put | |
2093 | dup 106 /j put | |
2094 | dup 107 /k put | |
2095 | dup 108 /l put | |
2096 | dup 109 /m put | |
2097 | dup 110 /n put | |
2098 | dup 111 /o put | |
2099 | dup 112 /p put | |
2100 | dup 113 /q put | |
2101 | dup 114 /r put | |
2102 | dup 115 /s put | |
2103 | dup 116 /t put | |
2104 | dup 117 /u put | |
2105 | dup 118 /v put | |
2106 | dup 119 /w put | |
2107 | dup 120 /x put | |
2108 | dup 121 /y put | |
2109 | dup 122 /z put | |
2110 | dup 123 /braceleft put | |
2111 | dup 125 /braceright put | |
2112 | dup 126 /asciitilde put | |
37c41ab1 | 2113 | readonly def |
37c41ab1 CR |
2114 | currentdict end |
2115 | currentfile eexec | |
45c0f7f8 CR |
2116 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
2117 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
2118 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
2119 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
2120 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
2121 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
2122 | C01924195A181D03F5054A93B71E5065F8D92FE23794DDF2E6BABDA4215500A0 | |
2123 | 42D1A3D0D02C0C98BB1D6ED0B7791274C38B038FC7921FF1FB8FAE7258C09259 | |
2124 | 4B8E1BD9EDCEDE9ADAD9BD9598EEA9691589649A9A21539161E374075BEE3457 | |
2125 | 689F308A4A7AC9F2FE4B301A6C36B0442FB92E3B002623493DC087800B5A0521 | |
2126 | 0DB96A23175AC584DE166F59142779F26FEE9783E28DE49FC3A8D6583EE63FBA | |
2127 | 610DA773CA18ACE6F64A4867A1A7817120ABF9DE4D17782866E6CB6B65A9F6D8 | |
2128 | 3667C8D3E61E5356E35343FDD4C6436DF73934470916CB5F0ECEA6BFF092E735 | |
2129 | C7C355B56189D1DD5715EC97E50145FFC17BB1497315A9585D713A7A6DFC7933 | |
2130 | 995468EFD0F59E3C15865B87925A3F2930E20D5A35970E2C44F1629FA16E00EE | |
2131 | EE21EFC50D49F5BC02300D0A7BB85E649CB4E2E828C8B1C5469463013E71D723 | |
2132 | 2CB11BCBAC191AC751A2AF7FC228395CE9472DC1809052012AEC2CD66695DAF0 | |
2133 | 4CA04234F0187F4116C93F59A7F1F8123DE87F111853B785A20CA8B49B3B0CEC | |
2134 | B11AD345E1A11578D2EFEB0536D125237086CC8CD9F34A5137AC5DDFD8746014 | |
2135 | D74AAE8239B81ACF65F379CF2153B06A238A2D767F294CAE0D79228F0B7D45CE | |
2136 | 510AC9657A1776202FEF42F96D476E7DF407786AEA12DEA0013D3B4C5D0640F5 | |
2137 | BC5BB72C34066270399CE595827175B23B25072723BD24E07F6BCD9EF0175DEF | |
2138 | 93714BAA53960F81103CFB731CED4A267B53727BCA3C97B0BA5004055D4EF0EC | |
2139 | F725658E53AC86E4061B489AD4154915C3981B3B703E1E2A8D390CCECCA99385 | |
2140 | 45EBE35441B062D7D12DAB2B31569387187D74A4043FD71F1C6D352EAE0F6757 | |
2141 | 4345FBFB6DB15CAE47CAC4BAE47AECAE5FF5EC19057DCEFA1B23F47364ABDF47 | |
2142 | 088A7C6A2AE26B10459B6D41CB69182FD1472F326CE3A15B59255D1DE3B616D8 | |
2143 | 9D1F12561038839781E657C896B8C58A32DF5AEA23732A0966D96C68C988ED7A | |
2144 | 09B7E2C8F9F3D0D56879764781566299A4EDD3588BDF70E3D924D25074F30988 | |
2145 | E35BDD827AE4D0B4A06F55A9976BF0DB3C0B1D09CD08E8CB168B50617691638C | |
2146 | 0EC1A791C228177D4FFB021EC3DF5082CA3487AD2EFC8DE9466A690ADDB4C52A | |
2147 | FE2A6DB4CC275CD33D9136E735279FBB2008D59E667905EBB04326EC33C98B2C | |
2148 | 94744B7F540D86E90DED64572ECF1EAD3A58EC101642B245A9C7232DC8FB8741 | |
2149 | 03F97883BB32FB955C22F878FA0FD114451A3B3859B0B5537AFAB73AEC7DB2BF | |
2150 | 409E1FB41D473714F6BEA73CB085139879FA31710E01915C2938C37BAD6D7D71 | |
2151 | 45B897E00857D3931A489EAC7B42BCE4E65F73F67FE027CE482DC47598ABCB95 | |
2152 | 39E98DA8ECA3E23F0799D5963ABA6E2984DEACBE7B46B40ADC6213E0F4D08971 | |
2153 | 58F68C946C748E4B4217CBA2391BE2086C9758F4E32C9B6413E48D84D33A6E85 | |
2154 | 84747029C0A9C9B92841D217A902BA8EB333999D62FDA9F82BFC8ED11F67988A | |
2155 | 0CAE42182E414A9766AFFF4B046A09D476F8E3F15A8C7829BEE982D8350BDF5F | |
2156 | F215F2BBBF68D4B567BAB798B9604C79306C475926E9FEC0F07A99F43473C6FD | |
2157 | B15AC29C3D07FEBAD1BAFF75AAF2FBE94F104F1DBF838044FAD94B661B06AECD | |
2158 | D9AEBD02B60CA4546DD6B5B5C1A3833ED07845671CEFCA8955CE0DE5DB8FC93B | |
2159 | 3306683CBFB8E5B79A863DE78D455DE9D592043C2686F88A43140F8B9F3B553B | |
2160 | 7047420E93E753829F8D47AC7621CFE3626F271E31F0019CC02D0B57F67BB47D | |
2161 | 8CFB63E902EA3231C00EC66EEC0D30FE8394558BD3535C888C4CEFC6EB72E737 | |
2162 | 712ADC6300162D5D79BEE0CA1F6E4127A0BC90656C01692F6D82C85550AFC97E | |
2163 | C2693E379160FDB9636FA41AE9C75B7F6643B05971C6D67CE30971D590FC07B3 | |
2164 | E0B36B4D1C7F25110B5DA2130D574FA292B47322975A2BADBDB39AAE69BDDBDA | |
2165 | A880F9AAB580117708C79204DFFDC08BF4A48919B5C22228845CE8C3109E93AC | |
2166 | 2479E523B8A1C12A6E541118F121DC6B4EAED83491A03192D5C3A2A45D1A2467 | |
2167 | 757E7B377C635CF5CAE11A7CB49D49F3A1BB2286090B5F0E4F89869D1771D50C | |
2168 | 54B5C5E091E3048A2C194F0ED00DD64FB95BAC6FA9D61ECD093ED416DA3A4981 | |
2169 | DB07CFF17C4F55C62DF628EBFF06FAC3F3D3F91C30EBB34052BE1A08F5EDA4B9 | |
2170 | 08977197950A282B84E21D43C64BE3AE4BCE22C70E7D392DE09D89B7F23351AD | |
2171 | 6AD37225C12BA79EC9951F5DA1E505DB26200190ADE0E549305B7530CB86EFD2 | |
2172 | A896F13A97E51754F70B609CB4511CEFC38BA579C071E9510A49982389980DC5 | |
2173 | 336D6C4A2DB100DFEC4055C7AA9C55880F94FBEA9EB280BEF66CB8E1E38A359D | |
2174 | E5AFB12B540CD599085ADDA7FC2C72E7C873015773FFEECA2C596B75BC39A3EB | |
2175 | 3C43FA2E53C0D7993042F3D652BCC483E48B7F6C94C3FF6D38E276086A6AE67A | |
2176 | E5A571B9C72E0D7824E0BC2ADF51A393B9E334649F786EC1923C854382B89627 | |
2177 | 1B9E701AE5A6C42E672B2C6A33C8BBCA8F69B9061E787D6B92183F20CF4C3903 | |
2178 | FF5417427B84798C82BE28D2C81624E3920CA61EC9EADB364B5A6E50E49A1A72 | |
2179 | A9A090A1FCD84814B8B2708AD787D2B5015DA1305874F58C5EB62F843685FCB6 | |
2180 | 465FCA80176CAB2B2FE65E0A270BCE1E3DB97564BEDFAE5CA44395A8DF4505C0 | |
2181 | 3E103CC3B914359B2870DA6CD30382EAE8949131CFE31E9E75C3E47A3834BB32 | |
2182 | CF183D4A8B9001710D0A11390C9DAD116196568591D38C2AF4ADD852F31494EF | |
2183 | 573462759A35415900360882739789D6B89ACEFA251C5ED90ED704DD7C3C80CA | |
2184 | 9F6CDED69537D201D520C99E69EEAD5D3C0EB84C166660B3C190166D93EDFE6D | |
2185 | 15BCB6DC5CDCA825E48D33845CC2FB15291AAB823F25CF8BB0A1EAED8BEC524D | |
2186 | D9CA016027141FAC9D35B64FB9C224552F29EF6B32497254E319090E698FD8A5 | |
2187 | 15491CDFE1B988C79A0E3B9D01E12FF084E9FA86CCAE02A3EE6F2917B61A2CC1 | |
2188 | 64B8CAF309D1AB48A34227A7729DFF99CB6EC282E3FAEDD2673779AA7E4C1789 | |
2189 | D93FDC37FE95F087C5F88F53D30A2DA9C913BF205FC6BDD060A40184F4AAEB3C | |
2190 | D080D63B89CA3DEFF310D09EF0A83F3914BD5B7932980ECE139EF0313C20B4C8 | |
2191 | 576EE0FE3F28FAF4D3CE7CD0890BC824A85B8EF4636BDF1EF1BB519F93D36540 | |
2192 | ED09FAF93FD71992CA2CE2E83F5355162ECEB32AD218092F45D5A61A44E67135 | |
2193 | EF0453589CECDC6962D0E8DA7E7567603BAF50B2C8F1CA65EA5320984E7D69AC | |
2194 | 9A7D3D7F92565D79E8C9DD2D92CCA7DE9CD058545E9F98AA47904D70E1897099 | |
2195 | 3C4C852B3BA131DDD348433C336BDF5FBDFB62120DDEAEB3255E3207B0C84A0A | |
2196 | 1ECF9EC869DB9BFA3693B03FCB27C5A5D3CDD62630DEDE91B4DD5B9784BF0BDD | |
2197 | FC6EEC3FA7ACA9E15FAE47CDD9B7FCD2BF0EFA10716F08C0AF25FF67CB6F9598 | |
2198 | C607D2FCA452417D2C69DC808A9441A66492394C3450BD30632AE739EAD654BA | |
2199 | 4343459CA36B6D5B2C12C39495952F2EF93D82C73E33236785A79609E260C4E0 | |
2200 | CF3A3C950DE71DDC3939D42DB1CB1CA917CEAD56979A70F8F3B207C805319FA7 | |
2201 | 3C000AE2B21D711A6D78C7BFB901334DC06F59EAB6D94B507734C27971F8458D | |
2202 | D00193645AB92FB8FE163D5C51AE4F40BDB4F2C51691E76EE0636F071F37AAA9 | |
2203 | BA78BD12459CA499210EB0CE2F8BD317387797C33F5933AE7A6264DA06B4A6A6 | |
2204 | 1188326147A16B205D1F965872DED7D8EDB3294FAD2FCDF0D423329E9CCF879D | |
2205 | 4E0B966D509F45527F7609DD09694D286F6FF7535EF8971B7DFBAF608A19D442 | |
2206 | C133207EB1152ABBD11C455D0977F66A9B73E51381D1CA4B66E87C0C7175A63D | |
2207 | 80C699A052F00C41DAEF42E7A40E07B1B14107AB0787E24E17C1462960E3C54C | |
2208 | AE73BE4924464FB177EC62F116B2822842541543EFF7ABDDEE197D6BD8F8D4E6 | |
2209 | 59175D8C5957550B70BE775AD52FFF6E7C00DA7CDC16E1DF7446BB5D8FD82647 | |
2210 | 3E9F87D5EA365C82A2D991321ECB14A9E3AEADC5A56665DF7072D6DAE402BCB6 | |
2211 | 14D92B17F9E063E4E9D8D239C91F5C7C0BCD2FBD936C9D4A0B57659420343B59 | |
2212 | B395BBD1AB5B6003F653699D57E7581F9813CC98D4F072FB78899D6DECC42D34 | |
2213 | F2787EDEA64058B46C4BFAA2BB96E9BE5CACE8D91E4C080ADFC0FA0D4A29C6B8 | |
2214 | 54FEA9E11DBCF53D9CA40A21AE5076451EDAB3593E56B6D453DC8EAB8C78B588 | |
2215 | 34D4C4F36861B5649BC1E9F3091E704BDA7613ED45C911DFECA74EEA05165191 | |
2216 | 825F95A947CAF382FBAF01F3B8B041ACCDF39718D7DC5BA6CA12BB20EEE96439 | |
2217 | BF2E2628AA3BD2C91998E6247A690FCB0CC95F286F427345CC4F1115BA3A6E54 | |
2218 | 4743355F2CC991CBDFF5725902C1F5A6DEFDC8638A26EA456C33C27773D6214F | |
2219 | 66536CD2E44FD253531732D5A8C44B336B1BB47B0477350EB8CF74889B93402E | |
2220 | 2356A9CAAFCA562315D8E0B3F42F08932CB87BA2499A875AFA08D11DA73B38AF | |
2221 | F46D03B7F639A8D7BF88CF07FFF4E91716DCCE6E2CCAB60A64D5E40EFD8B336A | |
2222 | 1BFCC4CB04F49DE1FBDE7AA5B2092A6EDBD913D161A3271AB6411622D0E14416 | |
2223 | 37F81E0102F5B0F2F9A2B27819E4BACD7C50E29D6291AE5B0973C657761545A6 | |
2224 | 741729620EF2BF1046B3913399C10982EE5F4142CF461EA31042E432CC79A1A1 | |
2225 | 39C607D22E45A6DEC008CB4BF6007CDE9DD5802B49A62C8E02A6D448B64177CC | |
2226 | 887AD71D171B99E7ABE2085B37D90B3BD8513995D9A57F53184DA474F6DB5E49 | |
2227 | B73E04CC214EA5398DF7D7541F94E623E8687B511640457A48A68E9D9D6584CD | |
2228 | 15B57CC044D8091C771D175F2EEDD411099BC8F7B4317DC503BB5E405AEEB526 | |
2229 | 5E6E1B1F2705275D274E012A98F66075CEB90AFC648B964DDC0E9C4AE7B24CE1 | |
2230 | 80B051022E5781A533A21DCFB97893847D685137EAD85BA708A7E118C72FA839 | |
2231 | A9E460B5D17365A0AF1F53A98319FB64A5819B087F554BC056C4BE44113A5404 | |
2232 | BEF759F890C1CA5E7AE156F4F8106FDB4F8DFCCC640976983EADB30976344048 | |
2233 | 2A86D7B2AF4A01CA736B98D52ACE392AD4BECE7E61C710B08B66F01857CA460B | |
2234 | B8376E257113E10F6DEDF14CE2A4E6A99ECBCD302C36CADB713D849EAE9EB598 | |
2235 | F29DC98531D793B79F83091F9B136809E006F34E423D528CC4309AFFB3EEB47B | |
2236 | 9A9DE4D5B25CE953345C326BCBE2B4912641780637783084D3D12693F8135483 | |
2237 | CBB0AC4EE0B5610D7CEB7DF205830BDB9BB404DC1B28FB0824CC187B26C19A91 | |
2238 | DA0025EC739BF3993700101D042DED86D67F5FB87912CFC51AA7DF53F2162D62 | |
2239 | 6314A2CE13810D0B8D81F45771391A236422CFA0F35F7A0CDF14ACB2724AA57B | |
2240 | 7C2C28D53029B1146558610E0CFBBF72A85AB9BA308F846228F299F13F68E8F7 | |
2241 | D963B2EE9EF7D4C21690632B640BDDAD0556EFA4EFBF035F13377ABB5CBC280B | |
2242 | 9E0C12AACB153C93351E5BA95A7D149010E204950A59C7FC6581D9703468C1E9 | |
2243 | EFAE37E7E6ACB892B3F8D1248D9A4A72F642FECC5E0B25C15EEB921EDDE84D12 | |
2244 | 0E524FE6133C4921FF4921242392C12FBE69744D53739F7E849C1B96C4020AB2 | |
2245 | 1FF10DEA608F111749E2FBD8DBCB17F353DCB3075B4F4B8186963EFE95A76A10 | |
2246 | 85AA5BB6DB4095291974221829A8E436680F4860E01C3843BE5BB3101D0869C0 | |
2247 | EFCE08D187BC04F58C7A450A59093680A0F09E8E3F12DF5223E7EAFEFA01978F | |
2248 | D8354753A68022CC92C71F2CA732DADAA8A466D4AAE5999B0DC077715671F518 | |
2249 | E6277741F44AE798EE50DF44CCF71FCF8BC71F76374005FEBC4883C6EDA854B0 | |
2250 | 88C0C2B476709AA809ECE41AE786DB1A32B3FBBCC14921673578D3514C8CA842 | |
2251 | E1FF90BE33F7B93ADF6BFB8B1AFBBD080783BEF056A6BFAEF676F7BF9F2DFCC8 | |
2252 | 01D255A9F0391951210D60D4D4DCA93AA858B38C0D7B8FD740D5FC6F277C2A68 | |
2253 | 54CC2DE1F40B6347201FCA2A0A91822708D820CE645C3E4E5A09FE25721AB33A | |
2254 | 97871ED448F38FC5A349D81F402B34461D840D5768BFC6849439AB6115104F78 | |
2255 | B87115B1DAE12542EA898F86ACE247709817850B067F537E6137196101D46DD2 | |
2256 | D842EA03EF4501E34074E8458E638ACC4EB349A7430AB035BEF2DD4CE00554F9 | |
2257 | 18F9FE32A55AC1E7E50D64AAFDA278D77A7149C59DC5B1E3064A4B281A54C9CE | |
2258 | A5EA94ABEAE4C6D5674C208ABC72563976487136AF2E21F835BEFD232D7F0D13 | |
2259 | 1D19932367F51D5379934DA7F1635AC51EE5CEBFA63D4D32F018DEF13624EE62 | |
2260 | 31DAE68A08DBE3B4FDAAFC75291C8C6CC7A657E3C7453C7D1461A36E88E633D5 | |
2261 | 408253B673AD87A9FB2D0F56DF1305916D14D5DD62051E27BCE09CEE9A1F14AF | |
2262 | 1D7164BA5FB6E6EC8D38750F7E28BE330909F303ECDEE692E347DE13C8C2F82E | |
2263 | 29C8BE6EFD76546F362A12A1C2DC12389EA95ACB4DCBE95620F0C193EAD91B33 | |
2264 | BAAC5801AE827B9AB3FCE5D11D1D7854F8FA8A31670119CC0CA98628F801838B | |
2265 | AAC7EF90AC5466BE69CE3E3CD9951A5EB9AC08014285422F6DA6F6E221BB30F8 | |
2266 | 0042A11F2E4B765BB0D142AD52F4D85785EA71B2E1CE20728B9E9306CE93268D | |
2267 | 99B822A5AB5232EC7E26EE1160850AD3905864A01357F22722B6A54D4EBE58CE | |
2268 | 480EAD9FBF068EE965AC4B5FD2FA8CCB91ECFC6E90B9C49268CA0B0FDAD23ADC | |
2269 | D5A74B41149BB08454054C451AD0DA4CCF8B60F2EBD061AA03A011D548B6B481 | |
2270 | FAB00AF9225BB5463F27FD67333FB51F8664536267E95CFAA0BE3BC1B8F889CB | |
2271 | 587A3A4FA2B45864F07E11372C9507A625C0030EF7030A0B4D931BCC48F6DD51 | |
2272 | A4D1F63FDC4B59C1CB18E6242E9F4B4B8AD9755B870FE60D640181FB7EB8120C | |
2273 | C56F51DC8C47FCC6318C2145EDCBEFA7BC4253315BA67FD2B3D4AF6A9F3F229C | |
2274 | AB75B592EADE15B1FB5FDBA1C0F786BD21A51506B7A2E42C2D086BA6F84D1B3D | |
2275 | AC7531545F0B01346831FF36A52CAC1E390F99AEDC265B44B0FC9C581BBA6BE4 | |
2276 | 48B723811EBCAEA5FEFAEA7E5B987F2C7B3E9A65D2D14A7B74F099401C57E367 | |
2277 | 385352D0776D2A908F7A5A2E4D4160946C5591397877025C8C387CA413EFED56 | |
2278 | 8B142E8341E349DB4DBA422A4FEE56A573972A0C66590175158E48850A9F7F38 | |
2279 | 4B95726787B8F969FDBC97491CC81CABC976CD00A27D1DFCA7CF467A956C1C6C | |
2280 | 839817AEF8794B6151FAE9261119DD5DB787DC9D3B420FD325ED6599FACADE0C | |
2281 | 320D54C2E0D296537E22C1783670A9D9BECAEC63853EC2F05A990260DC189D63 | |
2282 | 7CCC0BDDF2CF7585071ABAC14630666737041194D0777EA4292AE60BD7F7100E | |
2283 | DB568C90F0D899EA006CA423CFFD6EC70A5D3D8AC43C747DBAD3B02219E47D8D | |
2284 | DE030631F4678C357A58ECC52782B31B50CFD44EC33F41585E51B27E3997D33F | |
2285 | 461BEF897220AEC80007F13C5A1EE3A0430CA899047DF944831F8B010A7DE74A | |
2286 | BFD26001472DC00CDC9F17CC435F61ADAD4E9AE062ED477FC621FDDF9242C449 | |
2287 | 1BB3F77FDD1519A251B663A693D84B42BF0962F537757F38CE5C5D56B98AB10A | |
2288 | 3B70C8AE8D52DCAFCEC22E7B09D3C4EFDA1841C74CA975E4F8294F7BDC796500 | |
2289 | 0ABE197ED3737A65F7BAE601C91DB3983EAE11DA3EA18ABBBA3650DC361C2E77 | |
2290 | EF9F97618B0C337A906FF39926D2B0B7883ABBA650816C4C6B34EEA836994EEA | |
2291 | AFEDDE56E0099D0E09EB88EB093544B9BF4871200746A0409C475FC4232A38D8 | |
2292 | F3105B0FF44E4F132378DD12D9E796412FD0F9478322215E9F59E69396C35AC4 | |
2293 | 097C4995B2C3BAB2DD04B1A7097DE16DFDD76465E79ADEEBA90489ADD0914EBA | |
2294 | 53E11A43ECB11D072C68D2131BE1C7C43CB9DD5FBA0A67BA43D6851AD4CD3BC7 | |
2295 | 39AE2E22CCC183A56CEB71D4F9F578518E376426E42B6390426A8434B5A83E78 | |
2296 | 77A5B9963BAECD5FA5521C2A29418764E4EC1A72462B04957F823E2817A7F8D0 | |
2297 | 1512919889500024B1C42EC107E8B8533C0B314EE4E23313A4C1BDB009A2073F | |
2298 | 9BAB479A3F9DA76CCD65629CCEF78015ADBC2D0D124B3BB2D322FC4D209E417D | |
2299 | 84BC3C758B6AB64A01E25C9C7B71D741AF90A19A339F99A0BE9FC39622F04C6F | |
2300 | 737474CFEC19C890A657BCE192B9DCD8F273CDC5294875DD4507DC5723EBB357 | |
2301 | 73DB0933927DC21081E67E5DCF4E41FAA6E00E8DF04128F86348FB0718068FA9 | |
2302 | 918319C4EE9D090CDF348153B6CC48648C55E889B4FFD3D75466F1B50C437546 | |
2303 | 7DD9CF20980B148F60BB146402DC0732A27F255DCB859CFB6F9D329C12FB14A6 | |
2304 | 7824D6DE27B03FF85BC59703A5D6C5B7D1CEBCF3C3FCD71D6D6F0311E41BF8BF | |
2305 | 0609D23C84720FA9EAC961C9D49C2E962D9618C32BAFBAA8CAB0B2F616E57DA6 | |
2306 | 8CB44C5595A22377B28599F7D34A3BEA4173E1D31A2A6C5670D1F026EE2092A1 | |
2307 | DD0D2BBACAB46E5B0A7113B1BC379709C5870981E482E01EE3D16AF9ACF1A5D8 | |
2308 | 7ABDB4BA5C3B13AF047826F360C8892642B482C3C61FAC97F332888AE156B35C | |
2309 | 5C8415A75B4F0F25F8E95BC4102FEB4A8287C544C99778EB0C163C22481F615B | |
2310 | 0004F764FB7CCB01AE01A614AFC9650D3934F748E8785416BBC89F66C696AF5B | |
2311 | B5F6F125F115241728D85E7159FCDBB10B64598249BB0E6FF1AF845B0A2370AE | |
2312 | E6A973023FCAC4BB6158D48B0C928ABC4E29A0DD611D0F5266AAC8239064C266 | |
2313 | 82D4D33B032418967406BC98156CFCE1F091F733D8BAB9523690B4D6765DBADC | |
2314 | 210E814DB8715A269474EC0501CF66FA0D8FD224EDDE93AF243032E73714F730 | |
2315 | FB382372C0F9B9372450FA6F13689C9429EDE1A105F234B216263A7D0A917A15 | |
2316 | D1FC128580A16B5572436E398C353A0EC62539CAA188901FC30DF7511C1BF6E3 | |
2317 | B462203AE937653C4562FFFF03078EE7A184F554E6F01932AFD07722A00E50BB | |
2318 | 2D2BB785961F76273A16CEEB0EE833DFE14BBA539CC7E48F67A9D20C94283137 | |
2319 | BE84025E86C714DC9C6FD7CE4D1D0C50B6EDC79E066521FDFAB6285C83A68B4E | |
2320 | B1A119875B4E45BF5403950A25286214CB4183C345173F72E6ACFEA5C13B4D2D | |
2321 | FD12BD235193EE6BB66519B553CD963EDD68E7EF9439DF0411C8193ACB183C09 | |
2322 | 4143657304B1BE2AB8D2D0203E677FA1DD01152D2ECF9D987B16C3FE0B3F5F12 | |
2323 | 5C920243E1CB5FDCBE97DF55102EDED12811F3F7165F4FE1F6FD5A6BA809824C | |
2324 | 041FF9441529509EF4442EA873E8E7FF507607D526DD27315859B31D0AC11475 | |
2325 | 53C573EBF9DC37A4667133E99D8AA608ACB729F90B736395211043CCA3272AD1 | |
2326 | 470F1EB485629AA8B9DCB56479F734703D859F1E4EE8789FD6F739D0122348F5 | |
2327 | 1D487FAF1F24EF7A14CF69ADE7A87550F55F394506BC7627A5E319B30F362528 | |
2328 | 8AB497EC03B69B58736A5EE0AD63743E7F22125536104674EA63F9AC5286A746 | |
2329 | 47C73EE8E0320E7DC098CF43F23EDEF32D213523125110140F46202435EA8E79 | |
2330 | E285C7F3AA0C5877F75FE0F16BDF478A00A6F380C7B677BE479FE900ED3C4A0C | |
2331 | 832966F634C63211B58E9AAC3A3346ACACBD040164B491287B45E0131479046F | |
2332 | B430EDCF59B0DB6B0594775AA57CE029EE8DC445463169EA976945A5765AC390 | |
2333 | CA615933FD05173C47D30DD5CCBD56D89B4557C7192C31D7B500B779D7DD3707 | |
2334 | BD4B64980767B6C9A1BC9A948DFB8518AEF581A1D888C6F767F3315EE99F57E8 | |
2335 | 4EAA54D04A3A9E34B100024AA7C49DFE273231E3DF17073CCAF5B0EF20566755 | |
2336 | 6831F85C57454D1B0A5A8438EFC7F4E396F09CC200643564BADECD2208915FEC | |
2337 | 78E94025CEC8ED965EEE5F6B8BA081478231547355F93491915CFC4DBD619862 | |
2338 | 0F99133CE7F44756C593C8DF1874E973237ACB17F9614B79D45672CF62AFE009 | |
2339 | EC61B395BD96B0081DE750421A41E9D474F0E030C6B8591D364F29A6D7246EF1 | |
2340 | 6B4CF9B931A9A474011C62D504F408651692921AE83116CA0E4E6F41AF877FC3 | |
2341 | CE77764197719291E68B01570AB7038D91B8B81EA501DCB5ECB6083B6764BE3D | |
2342 | DF21B4B3A1E1A5C917F324A1CE5AF92BE3B2F8634A140637425F9BDFBD21FF33 | |
2343 | CBA42069981B230D211602FEF410EFDC199B6DF283343FA5E6B4FF2804DE56A1 | |
2344 | 61DDC684579F82C65DAC3A4F92B34FFB6273EF4F4591317B8D2250850BBA236B | |
2345 | C1E36185BC3C8C7A7654B24D7A10A489BDF675F6EFE7B4253F14CB3B5ECD1756 | |
2346 | 1882F3D139EB5EC7860D70A176D1536F5119A6C23EE9AE9AB21B586DA19B483C | |
2347 | 6BEBA87C457B9DE3D7C71DD7F97E352B642D84455E44EFC54417ADBE7E190F7B | |
2348 | 7ABF6FA0EA84A394C8316BF420D6E2DE5B867E6D602365925C3ACFC69ED653A1 | |
2349 | DA30FF3B49D407237196B9401B1EDB7EF2260E582D02B18EDD38AC0016F28896 | |
2350 | 0A61CA720216012D0FE2B58D5D675D25A679B1D70FAC10A4EB38060C0BB1AD1D | |
2351 | D1C59BD5F44FDD8768EFBE75B6795543533C02198E21A4B8A5430C2C432E45AA | |
2352 | 0C0937D6CED532EE6714C58ADFE2B15B117E9AEDFFC1E172716C756260BA9931 | |
2353 | 23AB837CCC7C36BD6B86B628BAA7D6002720AF00411E9D039E435EE479D5015E | |
2354 | 23DC9F3993546E50A442CD9D0429F7AF22D9F14064CADF2A3062F218582CA520 | |
2355 | 3FD8E0F30B224408594EC426C8DEA57ED60FAB24461611E86302C421BA600CDF | |
2356 | D4EDBF4044F0E2893143D4BABF0A6AA09F28FB4190B779B82A61C65264A199D7 | |
2357 | C2F50BD82837F08970F630E1CC74B4EF421B1032967FEF552DF3C1C83ED995BC | |
2358 | CB9192ED8AAA906CD9708A4882150B27B1E75FFC0D1383C50BB3E6C36F5CBF28 | |
2359 | C0572BD2F01AFFEE5927EBE3B6CB8FE778ED2B524E252F59AF00A3F8F880116B | |
2360 | 8EA655D9C6A68CAA28DB7A75003D0C3B653C7587BD1A7D93BE73CA6219024EA1 | |
2361 | 07C31E7F7BC9B874183C9337538C925226CDC48FA25D51A6A0677A2BFF699AE1 | |
2362 | E28D9E58369BD6AD73ABA706531DE565E1984A9C89D0C1EC6FC030A93D3D863F | |
2363 | C45EA66F195CFEFF9A03A1673BC544FB4F491AE5E50ECFF7F34B095DA96288F4 | |
2364 | 31C02347DCB6792ABE9DE684A1A92318A2BDA38C2D8DDEF29B8FED450DCDCC7A | |
2365 | 5C5D124FF0DA047D37E8874370D5537AEE869E771835EA607E1634BC0707C0FF | |
2366 | 75D5764B867BEDD8FA075F0CBBA7191B3CBAFC9EF8DFE79E9D7FD5A58916101A | |
2367 | A920F37BC5EC845621EFE3A953C19853C2989FD31952FC4876A8F7C58C4F21C1 | |
2368 | 31E6ECE0389BFDC8D6E391B04D443EDEFAEB77985808C398583BC4D8C9979A38 | |
2369 | 9842C4FCB7A4E84BD67BE72551A43B2B330293D8655A3D6655A2358E014F5686 | |
2370 | 613D19B474AE0A92A80E6E701F4B63EDAF59C3E12DD961A5B413FD1CB5400743 | |
2371 | 91F673B3502C6FD90A1349D649EBA4F5D8A6E5AA41F1A4DE1C387E22C9CC2733 | |
2372 | D542291D5B2E5CCD0E1FC1835BD6A74F5DB97FC174730AF33CFE5E68349BEFB6 | |
2373 | F2C76171C578412F075F9730567BE7A2644B17012DDA04D681018CBE09BDFCA6 | |
2374 | 1BB460699CBD6006C031A02634BE0B16375FDB9C582EBE6683B60768BC3901E7 | |
2375 | 4388A7E058B61713E3046F28F5ABF58417DA878E1870787C472FA08C2FAC7517 | |
2376 | 4CE71727BB69D19BB40AEB50F1BD66704EA37D2A0B82F60D72E15440BD27064C | |
2377 | E67CA41D97349309151DA28E1A7850587569A794E9FE46848A4611066291973C | |
2378 | A6CD19857B92F0E36B271F24D54ED663A7C64DE3534B0989D41E21E01469AD69 | |
2379 | 916AE35C5177C6BA8CEDA45C92694077DF3EBB0377269619F9925876919A472D | |
2380 | 14751E6515118EF9B84A5DD8C92695818BA4C959485EE1EDB6C6D3553B6FBD27 | |
2381 | A0FC42DDF20BB335F7D46F0951C51E9BB69FA6E7C76A8C960FB6A4305FDD2A30 | |
2382 | 234A5EFA64C34948422255C14C2A0D8A57174AFB7DF3DB2F520EBB401CA2DD79 | |
2383 | FDF6C624654DFFCEA8FCF5B34C34CAA7C6EAEBA6DC98E8557042126E49E51C3E | |
2384 | BB7C91497A44A69E4EBCBDC0656AA5A7F419D0443576F530C8136AE8612589CE | |
2385 | 781205654730006F3A39B4F3E5301784F164A2C87C2F86C894EAFB5E79D7231B | |
2386 | E410219BED0210BADEFCF27EEF683A01FE01DAB70AC8DC4E82ACCF6B5BFB4DAC | |
2387 | A42AEF344755A06DE8A6BF6F2786435E2EB1D103C8FA4306573BE699571880DA | |
2388 | 53548A1FC1F24E50B3C2BACE9261C0245F671694A0FBFB4ADAD535AB9949C020 | |
2389 | DEFE36F7EA12B3F8D80E3E3D7B3CBBD8B6EB0AD2573DD5DD0B4FABBC790C9F28 | |
2390 | 428B33CA533D5A6348D1A64D868863F4385A3F19D9F4766B6B81CF634981090D | |
2391 | AF0D763F09A2919A9DABC0DC4602D72F8747176F947A92077956FF59FD0D88CF | |
2392 | FE224B9B16C5DD710E6DE3B94D47DED695BCE5414A3794E4CEB7845915272ECF | |
2393 | E4A657C7B53DE7DE96A8C901DA24D54A467EE083181CEE606E5917FED2C97728 | |
2394 | 57887C7D19EEA950AADF6E8A99798789757BA126D925E330BB7D931FDF4EE14A | |
2395 | 04F58858CE09DCB1F57B8F780DABEDD1C26D72C9A5287C9DD30365693C5DD06D | |
2396 | 7365B309AF1C97BD3443B393309929F6D1AE27A1CB55C2F5085EE81928E138F4 | |
2397 | 4FA21E90C89F0397C9CDB4D707780F2418B38D8A8D76793C868D4BBF10AFBCD2 | |
2398 | 9BBB8202DCC02C37BE63D3CD22208A23743025921A54307A72037E6356EF807F | |
2399 | B2E7DF2B94C51F19895C3C059DB4C42C2DBF4E08E27E31A294B580E2367D2F63 | |
2400 | 0C074F03DB73EEC7293AB98DEF387B3C18761C716EE02C95315A36D42BC5334D | |
2401 | 984E6E35587BC0711D1B7F8EA8656C8059683C49CA41B0520D6FE1952A1991DC | |
2402 | 659D83269307EAAF5A9CA8000FA086B55587FCD0C798FD93905B1CD88A9AA33E | |
2403 | 9DBC2FE2A89CC800565567422052BCF5BAA443EB441E3B7B6AF0322014458764 | |
2404 | 7AAEF162D0E03F28F1D0A0EEED8714442E9DC41FD4B90436DB8A7E3A9431E726 | |
2405 | FAC0CB7151B6236B2438DCE9EE814A358DC10699244FAFB932C928E0E878D91E | |
2406 | 36E840135A9F372A0DC2EECA730E8490F4D42DE218150497C5EE87A5FF5C2282 | |
2407 | 3AA9D4B71996F86F8BDA700EBC01E3054459AA3F87CAB9C3A230551D4534C3AD | |
2408 | 18F6C76C41E10DB9DD67D19614A516BDD39C432005676C78B36C53BDB3646934 | |
2409 | 3AE6BC84D339851BD4D07CEC26129467C7181760DE58D0A288FF1F0DEE52D68A | |
2410 | 8423FEA92D3D9331F75E3B062BDB37BEE45D5C338BFC462612D1CA5CFF432D7D | |
2411 | 89D34ABEB9F42CB40A63BBECECACC033538136B3F9B81F1230453A52549B648F | |
2412 | E8AA9EE2B0AE82A1904FB78A6237247DD96B906B82945AAA772DA058B85494B5 | |
2413 | DBF53ADE76C1013C1DCC7A19AA3ADD198E3EEDE3269C4F3A6DFE54CBD17C7608 | |
2414 | 3BF7513E37D9C8D688087E2A09B863882D46454A5B99CBFF538C008FA9BADC2C | |
2415 | 004ED4ECE65C4301862323B134BA11C6D4E691AA899C0E83CEA6A625AED13F65 | |
2416 | 78D330A389A6D6EC23CD82D70D53D4F571C9D872E1A09679444FE686A12647B1 | |
2417 | 6BB67C8AA4D500F6DACCB2E0C682C835D24C646A51259A72ED3E281C93743832 | |
2418 | A51B3B89D38E575B8521A39D87F8105F892AE9BE53FD758B8DBE2021716ACFB7 | |
2419 | 350D5408C621CDEDC04E63DC4468C301435C2C2D61F3B2C24117F9ACBCD9E3A6 | |
2420 | BEA36A9A4227287DCACA0EBB1C6267F23BC0C3E0F28A89184FACFB919D49843B | |
2421 | AEA30EDC40944FFE38FFBD7B33B6B05F5AE1D0E168E924AC698B7200D2E86C14 | |
2422 | E79E6768E27E848768A75DD694B48FE4839058824A9F5C472081962020B96FE8 | |
2423 | 45DBD7153E2086C2DECB97B99850286211660573EB090E315BD727C989B8FE41 | |
2424 | D25635F195218A2F15FE8A5C5FAD2857F75969D1257158EE5C52055C1E11D18A | |
2425 | 8770E2DE895D7118B3886FD549441424F56DCB3820D5709B9D838435AAE4D64B | |
2426 | 6F49CB37B640BD905D6C3FC1E53C8304B0EB694269D6C48D81300DD537373040 | |
2427 | 65B95EF64F81AEE581FFAFFF8B32DBFC16B4F1F7FF9DDCE9CF5D6A8A6D79E4C4 | |
2428 | 209E47E16C32343B7D8B65D863F33717FC01CEF14A0F012805FAA46552535809 | |
2429 | 14126B88CCC2F0E276F5EB42E0C7628CB2397645DD951E31566B9D80F4379A57 | |
2430 | 8D10288DD980E93AD47F7F5EB41C4E0DE8AFC5118CFE87A804F309C6A9D1E126 | |
2431 | C0912E55D9B1FA95611FE7FD22C722610746316AA8703953AEE8D52F4B67F0E8 | |
2432 | 1C12A3A1A38B3AFC87E78B29AB79174E1CB09880DED63F5EE28AE6916E9BDF2D | |
2433 | 3DBBF6F8A09A229BCFE45B37D0E28A3A519DD20CD8B7AFAABCF0EEE058EC5BEC | |
2434 | 98CA3FF46CDB8324A5CFD9985AFD545B1425BA1B1F8A3209D159925194C2C7B4 | |
2435 | F353F587F1CEC839996FB9761DA1343F24A17BBE4206324041E9DB6DC5CFB21E | |
2436 | 789DCC82093269E3D2894773C8BCD25DB0D6B3DBF7A799276936132C262C2F0C | |
2437 | 980D6689EBC8459C62E19C91EF5169439185F8DB0946D7156108A689F9B0A52D | |
2438 | 10E02422207CDF2CEF1C2B5D3D50E4D458B4A6C936CE9E6A6C4975AFD8790E5D | |
2439 | 057FACE7B96263BAE67A549B42F8CA016C5EF42B55C2FDF20D3A25A68B13FA44 | |
2440 | 99D57478B9FFB6BACF69CABEA3C64B559A0D0897176CE2BE218396DD2CB25D70 | |
2441 | 59BB599060F97D2CA6422F46D28D3FED8AA36FE161A91DADE4B621EC24BEB0DB | |
2442 | 31FAB9F4B67209C5DA12F4AC49B8BADD510C8226962D4657A80DD7DD49104E88 | |
2443 | A0287F75C8784516C98BD7BD15D91F4513384B46BB097291EF6D6229A529BF62 | |
2444 | 0A5F4AF3C21150A058B08D0B47DAF540DB98EAAFC88E117BC9DBA9AC19DDD756 | |
2445 | 9A90C45BA3E8C37368C7E44BD6BDFD96619ED819CB067ECBC13BE325409987C6 | |
2446 | CB804C705C040AE82EEA129A1A7AD4B7B362E799F2CE5C0390722A16FC60B1E8 | |
2447 | 44B0B85D097AE0D5E08DEC18C3E576E22268D7F0CDA46D9469019C20EAE9BA74 | |
2448 | 7B49EA6166F5AC94672063D25C4C0E8FCE359712939ACEDFFF9AB5E7442A2A00 | |
2449 | A7E7A05E9E10A209672155C03EB12CD5E80155A5DEE3D503BA08D71E423C472B | |
2450 | A74CD26E15A200FBAB8E94086928E73860E50BB7389B3A8E0E833ABAC5FF8C62 | |
2451 | B894E007E5C220FAE6D53ADE85C747BD84D88BD0F40132A0D1FE51ECDCE1BE9B | |
2452 | BD89734A56C3577515520025A7743F45B01D74588DAED6FCC209CC819CE0DC65 | |
2453 | B590337F93D92D71615422728C6A8AA4D357A4E350BF6CE2480D4E1A818EFD9C | |
2454 | E6243B96F72EF5C5E88645A73189D9772E97911A0713A03201A69D78A98F743C | |
2455 | C0C8562CD876F8DE0A488CCAA3EC11142190BC32B2D8FFBEE6E155EFD20BB003 | |
2456 | 055C74D843F2AB34D9552E5620FACE9E40C04DD84E29A602151B7C3352798963 | |
2457 | 94674A8246B77CECFCC9A896B64F296EBD891E669A538343C0394E6634D9BDB7 | |
2458 | AB6D9C584DC7DEDF6AEB695FF83953653CED9E2B7F6E5D2A965B60F1FD3DC752 | |
2459 | 3FE4EBD010AD47E0A9FD989B15559783B429F50B3A70A1D8CFCBC150A492A8C6 | |
2460 | 4F570111E78A66DB463BB2EA226890FC25BD5CCFAEDAB7DEB2D081480821426B | |
2461 | 45EDFD5C048A41F295415C43E86930C53961D954B54F6886044A1C5F6D2526EF | |
2462 | F6521BFA9BCEA510AB3E1731719DA2E83729BD08AA2814663532756B1AC5E199 | |
2463 | 329025C143B47106919977514AC51B681FBBF5B115AB82A15E24C7315091DFD4 | |
2464 | CD11E813DCFB89355F4CFAFBBD54822018E7EA7ACB3A06DE7B571267E0C66BD5 | |
2465 | 6DEFA8A8AED615B9A7F40B138841D094D5BEB32197BF5213BA572AED3C87AC6F | |
2466 | 6ED6356BA2A2B9A3E26E43B3E6780BB66CC93A1A2CE94C90D48ADCA2BE608B64 | |
2467 | 7C0C0410A9134B81EF24CCDC7426E5096CAE44EE96D666A4F3F72774105AB03E | |
2468 | 320FC752F294CA8A537BE8EB6FA85F069E6809553D3A9CB3384E132275D2028A | |
2469 | DC6CE52E75DE9142E8D19C656F7A74D985BEC5367F151A151E5D41346AF70ED3 | |
2470 | 14D68F0C83E4EC225E6F60A48200AAA0FAC3725551B8859AF513FFBE2AB3C205 | |
2471 | DCD56B1177021C5D819DC38BA8A042DB92A0A34224E37250AA0F65707C2786C6 | |
2472 | 189F518C2E635D327D999949C4358402F4EFB6237C8A0A8BBC01E9B01F58A83E | |
2473 | 3BF161E39EF504F2E31BB62F27B4830EAE9B05977DA47EF338817109E0BA1059 | |
2474 | 6DFFC6426DBBCE33297E6D36D3492B098C1691DEA31FDF967BE80808199760C8 | |
2475 | 46E9D075B01F433DD5A43A2AD872061B3852B74BB421B3564E57C44ED0DE500B | |
2476 | D976E02B51C656974673846B1B5E31F7F9EB5FAB81F92F62ED34EA0715950780 | |
2477 | 6F5674E2D6120A4B9B89F749120921EE65043A66F0272B75C05BDDD09217A10F | |
2478 | E9E93E647617CA513F52252556D23F34248D0EBDB3FFCA6BD7C31E3369CB1F0C | |
2479 | 20BF53BDF7C4F7A1C37BAD112254C227FACDFD40CA33EDF4688600E16586A5B1 | |
2480 | D53C2AFEEAA2416B29948B4FA677FC1EAC94B4A7A2AA4EFFA901F90B56BC2F04 | |
2481 | 921AAC33FA46982497BD267EC185F64A2C6F51C48691908568A4F9814175AC6B | |
2482 | E1B34565EF12D99AD27B74481FCBA29E4C58C8D031DAC1E58E24AE5E432C74E4 | |
2483 | CFDA7278C66FE60C11D9501EE25CFB8F816F06D1427D8A8A119F7E9A66471847 | |
2484 | 90BEA16129627D6E12463C9DB6E4CBF9AC20F51EEFC808ED48D41F334115616C | |
2485 | FC0F037AAEAB996F754FA6A8653B8912BA0A9BD0D0EA381B3A54A86155156D1E | |
2486 | BF1BFF694F9EEA20EBE388D4F01CE5117C0EA6E061B807AD4B53270006E6CC45 | |
2487 | 5016272BB7FE8540070D51A260A018E09D9A1C7CB3E3C6409BC1993E59667A42 | |
2488 | 049F2393C872D0E8EC41FBC2671D0F5E4B99BDC5AD13F7B0930B881CC049FC39 | |
2489 | 938DD4D270BA8FD68DFF2ADCC21C7C24ABD1391C947142F1C7CC6E7EE5D31252 | |
2490 | F84B92C304757C0B8394E9E2C2D4DCEBD7709FA645B883D8A5F9657FE6116F2C | |
2491 | 891F3DB3BD7DEA5922EE488678297C5A043720DDD777451AB916FA664519A6A8 | |
2492 | 9BE9214DC67D68FAF516E19E1F65F162C246B6C010911220978C2FAEEA7023CD | |
2493 | E2C2A175D2C79817AD4E4364090B9C6B95CE86840857599448EA77982CDEE30D | |
2494 | F4E739DE78F7C1831B2FAD322EB48FCA0ED8FE56A0BE9E26E6921171C31F8E79 | |
2495 | D5A59BC6225A0AA217FEB684D1CCF1B12E21DBEF1F1315C920EB46163B5C2F46 | |
2496 | 80669943D09CD519256D5A4DE9144FD5103B52774A530D2A4318E9ABFFEF15A0 | |
2497 | 24F0590F23BA7612351FC0BD9E5F9A5A8D6ECB677978C4E2AFC4560986B7A8DD | |
2498 | 0CC30A82C2CBD2707A18D988C164F2B8CED74B1C12991E705F005E3A8D10BB25 | |
2499 | F5A45974096ED5C5F8A09ADA293175C763CDF9C3484C4B9ABA9839BB9028425F | |
2500 | DD34E700820CA4B2BAF969C1DEEE659A6FF568EDE7B58400C07BDA06310B92EE | |
2501 | 17FEF247A7FAFBB56044FAD23EB2933D8F313A161767FE211FC103F392A9A1E8 | |
2502 | B633A259920A15D19A4F5780C09071ED04C83FBAB9ABF344A1B0F1FBD2A96A87 | |
2503 | E03F2785DD00CFD5B3B95736CFE6315E86E8A5E838F4C02B36859AB4CA203FED | |
2504 | 4AB0D43E2964FEF26993ACA619F1CF12D3DCFBD8E50AD02A72A6593EB876E244 | |
2505 | D5CDFEE1128408A5C10B5E70D680299E8A33489E1179FA0F753B7FABBB826BD1 | |
2506 | 39D7F7A8E7C15C359E24B6569640123700FF628B2D76E2B7B2DE7C2F098A7A46 | |
2507 | 8309CCDEA49CD277E96366EF221C4DBCCF17882C4565340EA41EBE83998AC89F | |
2508 | D66825F75F751395FACA772DFCEDA5E3368094CF378C31DF2B405D92690F2546 | |
2509 | AA982FE7F32660E0FB33BF253F632FE978DDAFEECCF840997558C607ECF0CD57 | |
2510 | 5CDB3EE71642ADAC37D462F7A23541F850382BC1140C8437FC62C34CD9BE7002 | |
2511 | 0C136657F2ED4AF914AD3AEC860B2E873A77C818E491440EEE98075FBD7EE393 | |
2512 | B68FAB94C574EC914FAE259B065C8666CBB2D3604F9FFAA52DEB5F157079D53D | |
2513 | 3FBBCC93C598FD83769A8C039EFA0C7BDC027A34721E437E548F120137EC099B | |
2514 | 15D65CF68B5F2E5ACBD11A46A6E2168F6E38DACB52D0AF949B8BFC8AA92A6C1B | |
2515 | E5A362B1B05A46F3E58921F6A1CD4C97730B14D31F0C1E2C132D25B2A63D631D | |
2516 | C65813C00332FB695789D21D9903B3CD1425CC36C25C18C7D49014F85BB771C8 | |
2517 | D0D18204492ECCBF69D97B2342457C95A7CBD46C489690CE6B4A4363653B9D46 | |
2518 | A5A03BB8BC675B56A1CDFC8E0C3BC7DD7E4804E61DD27EB6D25119887EEF49DE | |
2519 | 905543AEA98A60471A3D512D63CFA12F8768CBDCF8F9EDD9AF084027DBF313DD | |
2520 | 059EC75136FC08C22D280B76F1A4AE628CF21DB9A6E567085DCEF55E68812A8D | |
2521 | F72DFBF59786430216884E02416419FEC67428E36B62093250EE61EDA4E9FDC9 | |
2522 | 08F01063F9841E1A5FC54F34A65F738A9E330E8074930BD9E85F05AB0E9DDCF1 | |
2523 | 2CCC343C8BA7619FA512292B53F37BC95635A3EE07C3E4E91B123E2CC34EA9F9 | |
2524 | 123C38F41B1DF9C2A7034BD05D83CFC2B86D69639B8C34940F53F44D5F549305 | |
2525 | F196464989975EF35F33B2B4B52CA9EDC6B32033B63BB03462CC58BBED662365 | |
2526 | 2F36F7A46A371A60B245D53F9A7DAA64428EECD40A8F4C93D460490B092558CB | |
2527 | 647E53E34771DC04DEEB2C285965F4DCF2CCB8669ADB238CC12897F7DF46E6DB | |
2528 | FD9D5BFBEA1DD262C4CC1B24E681643FAB80B34D057BC920ABAED5B39D2ACFE7 | |
2529 | 4CA3A1999ACF8C9AD0F99B12922D37C03D06B77985EF38B3FBCBD6AFD21572BF | |
2530 | 84A7BB8C4ED5C3BE657673F8E9F3A1655C0179A4CA565D3B6F0949B2CBBEC189 | |
2531 | B0B46D5727EA5EDB274B66C9FD872C00969B9C6B7CDC3A8CEC053A443CB847F2 | |
2532 | 540FAE81CBE3F6B306D1B8B913919D1B9FC029CD5D414DB2E16C7EC97F0BC73C | |
2533 | 1BDCD5F3FB0695EB84873FA73629005D7CE48A9A1374CD2A0DAC7F507D3F04EA | |
2534 | A8F71F37B65C4D5F5928C7A59BDB73E1702D4E9508519508DF62DD29AE1209FA | |
2535 | 8766D6311A78B12C830AC0D870CB02DAC0D6434801CB48972C196E0CC92BDDEA | |
2536 | 398622BAA5B384FB8A0396777CF517A08F646774EFD5C6CAB81C37ED7AF68276 | |
2537 | C86AD81C3C41476A6398A6A22D65421526EEC405F6CC9F2520FAD97FFDDBA3EF | |
2538 | 9E8DD5295CE2390650C5B19930B45A410083442196A24413ED58BC3994D003EE | |
2539 | F13DA0A43E7D99C70365FE768AADD61628BDF66FFC0D4195AE0CB7FF33EE475E | |
2540 | 2B0EB97F66B2FE63D3436568729519B2639BF5AD17F7061BF9F8A2EADDC7F806 | |
2541 | 50C1EBC0AF0BAB233868B10EC7711A0C2FFAACDCE3C49D3A0301C49B82A2DD78 | |
2542 | 92BD6740EC601CBD20D460B90EED562B2AE48E55A7C28C8643B4DACAE95AD33F | |
2543 | 27F2CB34AC65A0E62BE71CDC3D05361D1F07584945E4E89514C40D8A3132C707 | |
2544 | A4D56B054572CAF5F12E40406C26E5077C9E255516000F1733B136CA5C58961D | |
2545 | A9B22F6FEE7B57DA278A3F8F2B8A2B52B5E2E1FED54F14AFC9F13B18734E42C5 | |
2546 | C04846F7CEE4700920DAC45D381100CF7D5DF4E601D3B933998D86D5FDFDF666 | |
2547 | CC4ECF675477D74327EAB256DC1727A44C3F7A6A970D9598EB46A5C38E81F3C5 | |
2548 | 10D8307C19D849BBEB0C962BFBB37409195756E505278D619A73140B2C661235 | |
2549 | 2091B4C6A3C81A3F532B8168E69EB1DA998C84834C2C87A910A2A65B264A20AD | |
2550 | 50F7B5B8DDA82DC3F45F394BAAE1BAAF5FE217BB95A30E2164C3193083013EDB | |
2551 | 950B9F2F8559B483BD35507E77A8C59CE5E6571EF07AA5ADFC51C4E54346AE1E | |
2552 | 6E22EE5A58C7B31687B936299B29547E214971677A0D5FDC566E61EA08E86BC6 | |
2553 | 976077F73FBC8EA0CFCA796D37DDF0977130FF25C4791DC6CD5B7450A594BD1B | |
2554 | 291A8650DFFFAB3154F4129AEBE08C3A0F76A61F23A6662795F20B096772DA49 | |
2555 | FDC818E8F431C8D7488139A55443B81474F5D80D63E1CC6B1AA2241C0AEE0169 | |
2556 | 9077ED92D2CB61C71F765AEB0A26665F2677D214B6C5EF0111171B165531D3E4 | |
2557 | 7E9E43F1659A4F3E96BFE53F74D902BCCB2557013D900D19B86DBEE27F12CE31 | |
2558 | A94697D4DA12D98DF2F197BF7B7F6380E1CD7D1F9E13B65D5841A990642DE6F8 | |
2559 | 0F86E9C087D82FD2A903B7C5191D7D87CB2797C3B24432F7D29BB50DE05D37A5 | |
2560 | B9090F2D26B1AF1EF3DF11645E317BBAD8136611F64885A3D635C3C1F1F42995 | |
2561 | 83BB3D6719766FE2D016B42753A30887C1D57DF9CB860FAC2F95BF993EB7DC4B | |
2562 | F61EA29CCCA247F2728D4504648A8EE0B7FA0A766282E63511F89CAD7B612348 | |
2563 | 7E83A9D8F233757716321B251D122D9793FCC20090AB7BE19B1575A3AD6CB93B | |
2564 | 9FED5A9A6CDD855A1F09FCBE5C9DD97F93C49FAD92D3DAB4B32DFAE82E36165D | |
2565 | 5A6BFCE2AEA0F568A481C480D75C1F32ABA8FB904CCBF3FA6AAF58C02B501A62 | |
2566 | 4D6C1F8F690BB4B7325A31B13A712549AFA18174BDFDA6010BBFECCCDFDB06B9 | |
2567 | 406732F56AA41EFBC80266EBF0B9852EE08E76EEB14A276935114FAD24214CB5 | |
2568 | D177262C90AB93798A00D55A152D635C96846D70395C7EAC49F7A750027F9024 | |
2569 | 3781BEE23D56131397B4B241BC6976A4F2B04C8C64EFD55E801D833664019765 | |
2570 | 7A22B810889C096B55AD2B4D8963CE240D5DF0FDAB71E9091A167A80F5A3418F | |
2571 | DF87AA78FFB1EFEBD8A2C97E8E7667B289BC23CFC16F0B138CE179402015CC4D | |
2572 | F36912CAE318490F6A050B56B778DCEDA7AD335FBB6F3F05C526C8B5EF0B7BD2 | |
2573 | DFBCF5FD5C40F39B6A3455B86B34E89060AB0E6AB96C3914019CEE49EED033F2 | |
2574 | EE547725E1EDD60358DDF57F9EC734134515949C482D52079316D9A2481A1547 | |
2575 | 94B4CA6724EFABBE3DE13F07951329A119D84A07CA8CDB199704694F4B3AF26B | |
2576 | 95DABE0B18F99025A88898EDE46BB3C314FDDA77018279B5DC8C854096F3C7F5 | |
2577 | 4DE88F3BE84881A03C5E19A77B769EC57B4F6E5BB885485CF242A23C6E5FC322 | |
2578 | 04511A00F27AB274232A97A2E5C45188538013667C552E804283C579F1700DD8 | |
2579 | B3C70F6D22FE133C15FA6D5095582333F9B4495282BAD0537B90BC6548427F7E | |
2580 | 12C9D744869A3F5F133CB2CA078C83B80F95AAEE5D64203110CA1AF12E5E0273 | |
2581 | 298B2EB72DBB5FBC3F6A6D7004FAA17AEFB086870C83E8D742EE560DEAA5F727 | |
2582 | CD7BA16A4D6FAB7ED191AB92BA39300BFB73EE31B7820D85DAE74DE35B2E3FF5 | |
2583 | 8879D9D02B251D7903CA30DA07E2B5694F23631CFB5EB08656AECE21A93DA6B9 | |
2584 | EB6CE1A290631B795A55CA75A5EFBC99BD1E21C40D7374181C96B43B696F9079 | |
2585 | E7BC8BCC96044E09E48EAA625B9D5C53CAF79C84E8032A0F976EC2FEEA9583AC | |
2586 | 25DCC02DEC8D4798E0C145CC523E5EEE82A1A73AE0EFBB08876278A7983FFF86 | |
2587 | 527052AC0100CB273390888702DA5C62889808C3DC427BCC5B0A8D787102E641 | |
2588 | 2ABFCA74C325F26A74AE2CC7637C9996547B34F33CE355165910F2C0E6445E7E | |
2589 | 70DE25D7D187EF97902D4D535956A4ADA1F1FA0CE9881399477A0B72CFB5F841 | |
2590 | 1893157F662F071419B5AAB14EE66E1D478AA9DDA4E4DCDAFB7060EC629ADFAF | |
2591 | 5C779DE9AB8A65A65722109954599B931C42DE431F5A988459BE94F48F7D2539 | |
2592 | 1A8D09133020EA37FA9C7CF8A32C9C1BAE51E112CFCF59CD7FA6E9676BAFD4D8 | |
2593 | 093CBF4FCC3BB2E468ED55E28D75DF47CCF621662632E2087A8227945723823C | |
2594 | 02629CCDF94D5168A3810B815522588487CD8AD69EDE6D7FA593E638F603D808 | |
2595 | 0E2DC9278B63534E63D22876BDEE3A7CAB88C637DC55C9D1C4F3309C01DF68F0 | |
2596 | 3919523B2CE7CA52961AA3C2E618EFE1BBCD2C8DC65EC648CD380E3421F287C7 | |
2597 | 6F7308C13F6D857C74522BE6A0B09E15420CFAAE8DE28CFE6350217DA9DB5083 | |
2598 | D15B0CA455D343119E3C1D25F1CA143D5568D63CE32856F21328D5AAD69236BD | |
2599 | 208BEC83099D6652E91253440A613155EBE7F2D902CAC765F5049FB5433AD361 | |
2600 | 7C7EF2BF062877DB1981B9481F961A097D0402CD89E0BFA180027E29B990C2EF | |
2601 | 138AACF0D146CE117990CB9561FA6C0A8D1929D5B8BA4C4D9168D6A744ED4B4F | |
2602 | 457EFD4B36189371E60DCE4D2D97EDE139145241DFB26394A142D4457AFC0E04 | |
2603 | 990DBBF7E40FF9CC5B0624E9B898CEED3A63865690D1CA256330F472EFA9059E | |
2604 | 81920A9D365AD4CF9618E64AF8FE19DEFEFAAABF8B878C42C07490AA600C0E56 | |
2605 | 76E6C97F5B0038169395855E4338C84108D1ACB59E5482AF5FA034769A116EF2 | |
2606 | F408FDFAF2205DAD5AE5324EE9F1AC7192E070EA40EF350817F8A69D680DCEE2 | |
2607 | 1B30277FDCE432D5541D27536E9086C2C74B2B0D5AB976C3E188EBED10777172 | |
2608 | 76F7D7F73E38D15D03809B350C2F55E80AB7EB7D4C4C9B7DD97179F36DB5E4F0 | |
2609 | 1140662023CA3C389A8B168A68303117179A4AF84A64B2C2A56ACCBECD6A98AA | |
2610 | 14CD43B8CD3FB79202D957E0D5BFFB49967E5421426205FE24C9608E5F591854 | |
2611 | DF895083505CD0A4F53DA06D931AFE3BB68F3FC3DCEC7059D3FF5218BF5F1082 | |
2612 | CDEA29587E7E9E357EC1329411FCCA0C3078E9787A12EA78D59B2E8CF2AF09C8 | |
2613 | DA12B2B0EA4A43283C8FC9AC945EB0E63CCFE272BE758B0F8B2C9BAC46F3BA97 | |
2614 | D05C0E720C584E805589D2804EFEFEDA9962B4CD5B145FF7305FA959B660FC9B | |
2615 | 37C79503EBC2D1639D2593B0A9F24EE3CC07352614C0B6C531585F27CFB6EFCF | |
2616 | 044F2F2A261B0C2D79FF78899DB6B1F2FB06BFAFEB488504D2FD579F55980DFE | |
2617 | 9D15DBCCC176E41EA7AD6364D40D931CE561E0AB57F5FEA21549290E539A3C7F | |
2618 | DCE12F4ED93538385B2D30DFA578BAC6DC92A144A72D1C2CEA334ACA6F6C2133 | |
2619 | D1996B97AE8B102EC56426ED5D59DBBA11BA7D6FD39A8692F0931B64538975F5 | |
2620 | 61B79F8640773407E873FB4714516037A5C6FFA8C796A9B01898CDFDC2A3F2A1 | |
2621 | 5D3BD4C09165F6AFA9EEA3E0C84DB1D058A4C54EC0673860170038CC318DCCF7 | |
2622 | 1F3960F12AA2C9447090D91B0EF8A320E933FC8E89FDA5D5897266A4D156BDB4 | |
2623 | 077745CC076FB9A12F9D3BE989E2F8ABF44F4BF842DF548111DE129B36B535ED | |
2624 | E5ECF8AB96D94EDB9E0484E00BF942491ED250EA8E062FC59F223A85F26649CC | |
2625 | AB1AF18824045625756CE044529471B253B1F3B5FA2BBC3DCEDC457C0A42E29D | |
2626 | 7A152AE14C8D60122C5AEAF5D4360E51BE81A84F3A6CB164181DD1B62AB204E2 | |
2627 | 3F078794D9FE570D6115B1C9DEA193996CEBDC5A32D8EF3EA3C309B9F87C726C | |
2628 | 5F2957494663A92639A418C450D42D027053DE7342921EEFD3CCF162DBD32E16 | |
2629 | 9C8FF39084FE1117958230EF168E6FA9B48590EDC108D7FDCEBD76BAAAFFBD0A | |
2630 | 4EBBA485DEA8C89778456A1A36F420FE78B0A8F854CFDE7E26E76CDC2270C983 | |
2631 | 1D5D914F3EEEC7E4105228ADD1646013CAE11C03108C6971EAD9C13524537A4C | |
2632 | 2CC3D193CE5CF0FED9939AF23E241FF6C82FCBE73CACA6B4B6F88C17A18CE4D3 | |
2633 | 4F49BEFCF830777A1B26CF228DA61EA5177A826645B18F21C10E06C748E113C9 | |
2634 | 03402DFE318270EAA54F518FF635C340FF581055C1529CD6976951F6819D5A45 | |
2635 | A4DD081C55E7597D257DB9E2E3DBD46B0878895155DB0C4D859B1E61291EAFFA | |
2636 | 7F2816E365A5D6AF6EACFD49362833DE3ECA447871D071BEACE9EB8591F31EC7 | |
2637 | CBCE3C2EA428301FCEB42ED2E082F89476F39F7EB993044B8DC23832B25DD3AB | |
2638 | FD6E0A199A3CF03A79F323FF826682C8FEC47BB2B74C22A92D01F0E0CD8CEBB5 | |
2639 | C59ECEE83A7B02E949225EDEE26D5D11521DB381A26E30CEAC4D8E2FFB87E0F1 | |
2640 | 44ED94C0E3C022D4B2DC2922321EEF1BB71DE6C221535B0EB6A9837C8A775440 | |
2641 | BDC58FAA05C859F05A654242BBB4620D92E5E8B3C5A937B98064BF97549E68B8 | |
2642 | 8FD29B4E57EE27055217C910A199900E2A465051AE0573E3D46E5CD541BBBA59 | |
2643 | 5062CF9444E95536CAB30FDCD35A56AF4F5038E65690633DA9890CE8229F6EB9 | |
2644 | E5BAA68E54F9AF6590B4FDAD42B7BC0A6708A1C2E809B743A5767ED46FCB9847 | |
2645 | 8274E288E9B2A49803D238ED5FAEFBDE3863B29D55118E3ADC937E4B02287439 | |
2646 | B452DD41CE8298B10AE99AE275D45C5E0EB5680DDDE9F449855FF97B28AD1A9B | |
2647 | BE728BC56C8B4632938A4337D794EFDB56050F5459C031DCCBB1CFAEBBA79348 | |
2648 | F5514685F1F16FADF390B55DB5B671D0E020C03C8D301683FDA4BE8CDB3C7948 | |
2649 | 2F5648A2E049A495608CE414857236A70AAEF5EBAABAF1A0950A2B0B814AFD0D | |
2650 | 443CD6D2E0365332CEBFD557DD16FE1E3342A85057C5C8337ECEE5466406A324 | |
2651 | B7A5F881BBB2E442C9775A1C33B5321887E3A8E8001ABAA65B1B2BD1191D6659 | |
2652 | 3BBD32F2B01A37BBFE2A3964BF37646262E4D667BEBCAF970226BE5AFFB86A1A | |
2653 | 21CC0D74E7376B9634EC8BCC46D551FAA67603D4B707DCBF6C65D932FC76C2B4 | |
2654 | 8B2D03F5E29C4E2327F5791CCE1E42395319739422607AFC0B6962680A04A5CE | |
2655 | B9FCA10C3EA7F9B1CFEA675F44029F68E3C9C0B90CD7751040239137508E1E3F | |
2656 | 1FFCA19DA7B0933ACEB8239703097AFA4DBEC0FD8F94AA7854F83DF191A44326 | |
2657 | EA23CB5F18E342A9110D30A1D9427492564E7CA82FA80CDE8B7ADD8787B3FCDF | |
2658 | A5D52B14B6147262461F3563101CD20A457672F78F9BCB7F996D7699975C018C | |
2659 | 07ABAE4E0987AEB32A45577BA6157B51E9BBC37839FCBB886B8987389D8C82C2 | |
2660 | 0281A89F98874003140328866916A547FF0B47F24982E346FEC11458EF35C95B | |
2661 | 033F35334E2956A631F7192A | |
37c41ab1 CR |
2662 | 0000000000000000000000000000000000000000000000000000000000000000 |
2663 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2664 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2665 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2666 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2667 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2668 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2669 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2670 | cleartomark | |
45c0f7f8 | 2671 | {restore}if |
37c41ab1 | 2672 | %%EndFont |
c302751c | 2673 | %%BeginFont: CMR10 |
45c0f7f8 CR |
2674 | %!PS-AdobeFont-1.0: CMR10 003.002 |
2675 | %%Title: CMR10 | |
2676 | %Version: 003.002 | |
2677 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
2678 | %%Creator: David M. Jones | |
2679 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
2680 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMR10. | |
2681 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
2682 | % This license is in the accompanying file OFL.txt, and is also | |
2683 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
2684 | %%EndComments | |
2685 | FontDirectory/CMR10 known{/CMR10 findfont dup/UniqueID known{dup | |
2686 | /UniqueID get 5000793 eq exch/FontType get 1 eq and}{pop false}ifelse | |
2687 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 2688 | 11 dict begin |
45c0f7f8 CR |
2689 | /FontType 1 def |
2690 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
2691 | /FontName /CMR10 def | |
2692 | /FontBBox {-40 -250 1009 750 }readonly def | |
45c0f7f8 CR |
2693 | /PaintType 0 def |
2694 | /FontInfo 9 dict dup begin | |
2695 | /version (003.002) readonly def | |
2696 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMR10.) readonly def | |
c302751c | 2697 | /FullName (CMR10) readonly def |
37c41ab1 CR |
2698 | /FamilyName (Computer Modern) readonly def |
2699 | /Weight (Medium) readonly def | |
2700 | /ItalicAngle 0 def | |
2701 | /isFixedPitch false def | |
45c0f7f8 CR |
2702 | /UnderlinePosition -100 def |
2703 | /UnderlineThickness 50 def | |
37c41ab1 | 2704 | end readonly def |
37c41ab1 CR |
2705 | /Encoding 256 array |
2706 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
2707 | dup 11 /ff put |
2708 | dup 12 /fi put | |
c302751c CR |
2709 | dup 13 /fl put |
2710 | dup 14 /ffi put | |
d3ad40de | 2711 | dup 33 /exclam put |
c302751c | 2712 | dup 34 /quotedblright put |
6e51e0d0 | 2713 | dup 35 /numbersign put |
d3ad40de | 2714 | dup 36 /dollar put |
c302751c | 2715 | dup 37 /percent put |
a8fd3f3e | 2716 | dup 38 /ampersand put |
d3ad40de | 2717 | dup 39 /quoteright put |
c302751c CR |
2718 | dup 40 /parenleft put |
2719 | dup 41 /parenright put | |
9f178efb | 2720 | dup 42 /asterisk put |
d3ad40de CR |
2721 | dup 44 /comma put |
2722 | dup 45 /hyphen put | |
2723 | dup 46 /period put | |
c302751c | 2724 | dup 47 /slash put |
d3ad40de CR |
2725 | dup 48 /zero put |
2726 | dup 49 /one put | |
2727 | dup 50 /two put | |
2728 | dup 51 /three put | |
2729 | dup 52 /four put | |
2730 | dup 53 /five put | |
2731 | dup 54 /six put | |
2732 | dup 55 /seven put | |
2733 | dup 56 /eight put | |
2734 | dup 57 /nine put | |
2735 | dup 58 /colon put | |
c302751c CR |
2736 | dup 59 /semicolon put |
2737 | dup 61 /equal put | |
d3ad40de | 2738 | dup 63 /question put |
6e51e0d0 | 2739 | dup 64 /at put |
d3ad40de CR |
2740 | dup 65 /A put |
2741 | dup 66 /B put | |
2742 | dup 67 /C put | |
2743 | dup 68 /D put | |
2744 | dup 69 /E put | |
2745 | dup 70 /F put | |
2746 | dup 71 /G put | |
2747 | dup 72 /H put | |
2748 | dup 73 /I put | |
2749 | dup 74 /J put | |
2750 | dup 75 /K put | |
2751 | dup 76 /L put | |
2752 | dup 77 /M put | |
2753 | dup 78 /N put | |
2754 | dup 79 /O put | |
2755 | dup 80 /P put | |
2756 | dup 81 /Q put | |
2757 | dup 82 /R put | |
2758 | dup 83 /S put | |
2759 | dup 84 /T put | |
2760 | dup 85 /U put | |
2761 | dup 86 /V put | |
2762 | dup 87 /W put | |
2763 | dup 88 /X put | |
2764 | dup 89 /Y put | |
c302751c | 2765 | dup 90 /Z put |
d3ad40de | 2766 | dup 91 /bracketleft put |
c302751c | 2767 | dup 92 /quotedblleft put |
d3ad40de CR |
2768 | dup 93 /bracketright put |
2769 | dup 96 /quoteleft put | |
2770 | dup 97 /a put | |
2771 | dup 98 /b put | |
2772 | dup 99 /c put | |
2773 | dup 100 /d put | |
2774 | dup 101 /e put | |
2775 | dup 102 /f put | |
2776 | dup 103 /g put | |
2777 | dup 104 /h put | |
2778 | dup 105 /i put | |
2779 | dup 106 /j put | |
2780 | dup 107 /k put | |
2781 | dup 108 /l put | |
2782 | dup 109 /m put | |
2783 | dup 110 /n put | |
2784 | dup 111 /o put | |
2785 | dup 112 /p put | |
2786 | dup 113 /q put | |
2787 | dup 114 /r put | |
2788 | dup 115 /s put | |
2789 | dup 116 /t put | |
2790 | dup 117 /u put | |
2791 | dup 118 /v put | |
2792 | dup 119 /w put | |
2793 | dup 120 /x put | |
2794 | dup 121 /y put | |
c302751c CR |
2795 | dup 122 /z put |
2796 | dup 123 /endash put | |
2797 | dup 124 /emdash put | |
37c41ab1 | 2798 | readonly def |
37c41ab1 CR |
2799 | currentdict end |
2800 | currentfile eexec | |
45c0f7f8 CR |
2801 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
2802 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
2803 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
2804 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
2805 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
2806 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
2807 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2DB9B8591E5F01442D8 | |
2808 | 569672CF86B91C3F79C5DDC97C190EE0082814A5B5A2A5E77C790F087E729079 | |
2809 | 24A5AC880DDED58334DD5E8DC6A0B2BD4F04B17334A74BF8FF5D88B7B678A04A | |
2810 | 2255C050CB39A389106B0C672A1912AFA86A49EFD02E61E6509E50EE35E67944 | |
2811 | 8FC63D91C3D2794B49A0C2993832BC4CDC8F7BD7575AD61BCDF42E2E421AA93E | |
2812 | 3FF9E4FAD980256D8B377043A07FC75D6169338028692CCA8CD1FE92FD60AD26 | |
2813 | D57B7519B80A8F8DCE9CEE5CDF720AF268D3C14099498A843D76E3B6C0328F24 | |
2814 | D36EFE7F5C4E5B5C612786200C8DE3A41EE5F1FFAF4097653CFCDC8F4FD32E0B | |
2815 | 03EDB3E413283B9EFB0AC33B055617005BC9B0057FD68C52D1B0E67F0C571685 | |
2816 | 767F2AA85ADE4E0104A1C777733D5E318A22A9944336E5B98D965E50D31F357A | |
2817 | 8B6EA5A0EA98E1B027CE68C2EDB149EDDD04ED74A1B3D206D471A0C11C11449B | |
2818 | DE190BBFEBC08C9E1B7513B43DA3134D6B11A2516E6E86B67F68C970A320D05E | |
2819 | 94FEC57FB347606DF89989C33482BD09D011C55AA920319E7B26A205D3D0F004 | |
2820 | 22466F09C0482A164CFB27EF6ED2B040ECCC3DCAF345B5A73676F193D43123B7 | |
2821 | 72FD6CFC5E37930E61EBD5A6307E4DE70194E6384EC0D79DB6AD86D3B319A31C | |
2822 | 8B0589D0FE28241D8ACE280D0530EE99C80723E560BB72AE9D53F4713181F491 | |
2823 | 344B06D3027BA4E9E94D4305BE1D817197C54C8FF56CD6964165F6448ECC8A8A | |
2824 | 64B48B4F0FD69299A137589E2491A283509B21A3A5772F75B7602A9F60AE559B | |
2825 | 07A58436D04222C73EAEA72DE9A5A441F88D27C11F4F91255EFE280E91A4ACAC | |
2826 | 1E98A4E5E6C57B9AE86FD218C3CD8F24A4104156A80F13821384E529783C52C8 | |
2827 | 78B94AB3A0096090867ED32E8A30980E737922037F75F062BD83BF4F5929BC51 | |
2828 | CC22AEE2DBBAAA001CFFBFF41D258424FAD888FFF1BEAB796A44E3126159E120 | |
2829 | 7E4025C676CF94888A1971AEF8B6764B3AF4A92D36FAF6FC56FD049710EE3782 | |
2830 | BC2CD84FE2473F133BE03C1346B875463F126DCAB15C7A9BCC9A727D23611462 | |
2831 | 4E8D2BFD2466600285D79518712B8681ABCD69608E6AA9578F7BD771EC36E01A | |
2832 | 5A17BC17E375020ECA59B43790ABEB9DF5F4FBBEF807E5699EFEAC563E1ACC5D | |
2833 | EFA336E75DE6D8248E9381BB110884FDC89C2F9A41EBBC9A8A1F98E6A41F68BE | |
2834 | EE30E25CA148C1EFF42DFF8C214A6537AB11F260B8C329A4947B5FC8DC9C5622 | |
2835 | 4DF7BF4FBFB00380D47BABB03BC30627AA74103E553F55278F538EDD8C1E64CE | |
2836 | 0F1398CA0AB5A86630139B4A7E8FC02804CAFF3830114640AE50D2FDA3B561B5 | |
2837 | C63AD7EE3347804CBB40FB1E77A6C89735DD870351C3A1811591AB493251B904 | |
2838 | 314F65791963C0412377C1D02362C5E9655F1C3D4803CD379A8EF24C48218C2E | |
2839 | DF1165840462BF37DDE1B8D5FF09FA2C3B261E2F1A65ECFBE5D4EAD43B52C029 | |
2840 | EEB3948CB8A252CBAF545C8FA1C31E920E23A12DD7222CEF2D2A513BD758EA13 | |
2841 | DA33BF5FBF1D734653EB83DA2D374A5B9A0CE316F24EE375D6DF6BDA49954C2E | |
2842 | DB25A88821193636119D469BA66E5DAA9C92520FD4F84426A4E54273FA469084 | |
2843 | 7517817A6EE3E21176D333825E88046F50B3CF6938AF9BA79A2F51398239EB91 | |
2844 | 1A2D07F7FCD948427FF62F40FF95E39FE1A1AA8451411563FD5388472251C155 | |
2845 | 69BDE9283B41900B21EB1190D06E6B13B7794FED020D2C1BDD205AE77B084BCE | |
2846 | EF628249398B496DE85B406FC2E1939EF00DFC84C07E26CF72EC401BAAE756E5 | |
2847 | 7F6673216E7560D1C2A723CB405EE5CA474A07F61B81F8836482F73DC9516D67 | |
2848 | CE0CB770EAD755B6B356198B4B97EBB29C63456953270CCC8D5650C1D006E69D | |
2849 | 38DE2DFEAB27DAD50A817F0D645D30AF5B75A7B53CBD3D2B8D87BD0A7E525AF3 | |
2850 | 22F7ADDFCE31716914C2318260C2E2B4664893921B68C5A93334A361D94A759C | |
2851 | 0D7B146D6FD94F0442D672BDA0F6432E18F3C5DFA37ADA378D95B75F413C9ED1 | |
2852 | BB5C606A3EC7DFB3F796F59B0478C13FD1900381EFE0BB5242D5B5D34D03AF1D | |
2853 | 4BDC93EAF8020E26CA23C8B0E7DDEBBC6762A557067A4CE05A524188A8F02E2F | |
2854 | 3625DA38DFCF381727887F5646A3995A8A38A5FB1E5D5EBB395FDD0B7C8E71AD | |
2855 | B48EEDB62AB2CE99D121435EFBBFCEEA69AE9ED8238B60CC7288DE33C766CDFE | |
2856 | 15B767B4AE2E6CE0965E77272AC9F86023DA620548CFAC85BC751C44218A29C9 | |
2857 | 849F1C2DCBDFAD895B54E51A569952ED50F82DC8A19F367E7E44643854EFD6B3 | |
2858 | FCAEB04E55E4661C82D31E2932611748480EF61FB2FBFB0CFB940BEA81AFCD84 | |
2859 | 4C6A6332D7A600170E38A8EAFCD4F93DC153C43175434C86BC747348FAC61B76 | |
2860 | 1FEC9027C1A193E55C80F1F20B5317AA0A05AAA36AE235F6E49F06E570FEE798 | |
2861 | 84857D7552EA92EF3EFAD52DE39C2F8F43C59E3A957B7B926FC95FC4B60186DF | |
2862 | 7F3523EE2AB74E294C8C4BCD8B4975E84849E0FBDA6C0B0F24A636DFA578B122 | |
2863 | CF97BC5089E21E9F5298D1C9F30CB8BAFF6A3A11BB4D9A0A5CF2B18D055C44CA | |
2864 | 4FD4D8FE1AF3630907DE7E585AA811F9CD11FB2C8FC791851D651009FA5DF20B | |
2865 | 3C33FD2FF848A9E3F5652BD294965A332DD3F246C91B0ADA34017FF2451D1394 | |
2866 | F9C3C95AAC6EC8062BE98E8914D51DA6A164AD13938693D446044859D03A949D | |
2867 | F9AC5DF4A000CDA98BB516D762CB9F6D44B5268FD0C26E88BC4A760C0F75A140 | |
2868 | DEBDECA4F511128B7D2805872160C55236F0A0FA7637FF0D4E94AC079CD3C8A7 | |
2869 | D03A5A56F26B0438B577C46011A10532FEBCAD14FBD6032E224F45691A726886 | |
2870 | 56F305231EB2FCDF59C8BBFCB5DBD2D093A0E84D62AC93A2312CA69295E937C4 | |
2871 | 8DBA1802B85F54B5E7E6D6216A918F911FF705D3B5CF055F1D873B96283A0B53 | |
2872 | 59344D910CD396D883F6F7836BA65FAB4393A773A8F6BC298069E5BA38210EED | |
2873 | 49C9D920F718E3FCE692527DC7CCE6963BF744F2C91BC5952564196D60574E86 | |
2874 | 87A0FAB21F2DB2BD5A51D7FBD8FC19946D24E5A228462C4772F978E650ADCE3B | |
2875 | 8D66B9C21279C531CA1C3A8ECE3420BB65837287A7222CC3673A2A5F8BBFDB60 | |
2876 | C719CD073EF9A23675198462C7C87B24CC92D6AEE5C25AC63855CC3281494342 | |
2877 | D28F3D2FDE0C183486769A4FD5B0143193D31FCB2C2A14E487BBD96D0BADBB64 | |
2878 | D1B56021C363A795BF10E2DB448261C363A54A4AC1182B470C457AA82DF3F5D1 | |
2879 | F4B329806141EBD53CAE309319B94133D7EBDC2D0453A905ADD207364371E178 | |
2880 | 0A95C2686E3B34C4A978BFC0EE968C39ABA00889BC5149162C2B54483D44FD3B | |
2881 | 5CFF41F611C7E03B94945F414560E874D7CF27FFD0630890D7D7EA66CBD15448 | |
2882 | 229059E1C436BB33D69552B5367AB5D53591C4678D0C704DD3EA23F5D9E8A7AC | |
2883 | 17D003C19E333E726FFFA2961F33C70F429085F7BFE3E2510F59B78F58B19CB4 | |
2884 | 01B48E184BAD9020FECCE3AF52048A056981DAEA02AE78197E65855DDB170616 | |
2885 | F54278395D9EA50DC83761AE759F9CDEF9E1948E7002414FC05286ED793E6662 | |
2886 | 3347F2A9AF8917493D7305B92CF93E8E9185F70015F5594084298A6C2F9FD3C0 | |
2887 | 689F262AC9FEDC9B89577ECDE92F08D3142209FBCE7B5C0A840CC767BCA56C20 | |
2888 | 4E4E545E2BE4D21C53855CEE4CD0AB35D1A604C0FFFF77DBAE4289752276559F | |
2889 | A05FEE65F45ECAF44E95E23FAB6052195C7948AF0B1126482D4E02D72BF8AB03 | |
2890 | DE0F1A632F7672AD9DDE70EDC82AA993678A82BEAD0BC2649C4707FD8509810D | |
2891 | 364B5C6FE0E10772E95288C622C2F06C634F4DF8C7FD1432BC9310D5F24FEE3F | |
2892 | 7AB324863D6DABAA1576E70643CA79EF4D7DF4105093D66CEE0F3B87D2164A7F | |
2893 | 26EA05F5C4645B22D3E1BFD2219657712C168FD90DE801FB0F32759E80DEC1E1 | |
2894 | 43CEEB19FED12D757205043FC98FEC62D6A8D8B97BC083B4A0E985AF7850D6FD | |
2895 | 8716B9957C1C35A0675BC53DF672C425C79F43FDABAEE7D63F092CF271C9A9D7 | |
2896 | C41F40C4189510987887942E60A412B3EEC84C9A6E1AC7D54D528F5604B72C08 | |
2897 | 94B7882621A5BF1F325B92FF96B80878CC550D1AE4D8196E41CB1251856609A5 | |
2898 | C4D3BD05A922D0D45E039D9450DEF8490A3E924E41434194910BF60BA1B08BE1 | |
2899 | B41824345627745541A4F1703E956328F6227D11C74946B38CFB096139979E56 | |
2900 | 4E723B889B44C6D78673868C89912F8B4F0B4B485F1587A637B630F92E6072D5 | |
2901 | 7F3B44EA6FD96BBD4FC28A6C1D90805E3BE3E42A7BC9C880762966C55BC04E01 | |
2902 | 204D083AE976FAE6F37C94F27E68F8C0F28D52B17F6C0FD7C9150701FD78F8CE | |
2903 | B8E8DC9260E3974005EB5CA728171F482D765016C94D4ADFE4A42EF42212BC56 | |
2904 | 7E4EEEE8B0D2A7856CD4E44F55C0BAB762F92CB8D64C17022D4BF3A47C12F5E6 | |
2905 | 279FC23101FEE93753653CE8CEDC3B75C9CCB29BF1D4554C6120DE8EE750FCBB | |
2906 | E38B5D915206974962E320362E59B3F21B3AB1875703191043D03284D4467346 | |
2907 | CFF2F98CEB4845B73ED8E003E0DC94251B73E13A9B51A3F1430BCF6A21EB9B7A | |
2908 | 65E17FA411F53BE6432F1506232B8159E008FA257F884A4A01AC53BE91754D78 | |
2909 | BF14A5B0FBFB9C31BF4908355F8A762052968DF526D118708CCB0B7CB5BEE285 | |
2910 | 6DAB6CD2E3934178E60BECB11AAB5478623CF6C50C92F8BB5D1A583609028FA7 | |
2911 | B8A53B791BDC9EF76A124F3F7641857E4BEA0837CB36176EC9A522EA7F41B8D3 | |
2912 | 63C37D1145367BD300F17B54522A834BBB74DE12BF9EB26ACE6F24A046D58F89 | |
2913 | 4D4B7DF74875F1A0C1C9D97BE0849593D7B398EB4B00BEBC8C8D1497B6EF831A | |
2914 | A35380FFB7F1AFA4D888AA52C9482E8B1755CC209905F98F40D95B44D4DCBCB6 | |
2915 | 67423D1BC2F3560FF0A8B4F0CAC352A4EE2C1D946E45AAEC8A6AD40303F3382C | |
2916 | DF0756BFA3B1ED64C169E56ED1C760F2FF0E24DC5C9F41306EF8D2628153D30A | |
2917 | 5DCB0791126BEFD4947D7EF08301FE015F2B0008DFFCBF9F2D4D859FD43EC7D9 | |
2918 | C5BE237E9BF6665B7B1BEBB362F0C0C3A8D86010B9C97FA741C97C2E0513386C | |
2919 | 9C26C235B14DD2A58BFDAC7B5F63DB4DA6D5D37D0098175A9071590E1DF66A3D | |
2920 | B8173A047C29D7D35557F06132CC920B5460B8AFC11D23D09A4E45D089F5EB51 | |
2921 | 963FA1A6256E359D485107FD143B2BF21FDE9DA5744BC2615E86C31C89470CF0 | |
2922 | D06C6397D9FCCB316EA9989430240759D2C4945D941F159FC02327F34B042BAB | |
2923 | B5C3A47C78E8C1A6FBCD396B1A51CC4B020B8AD401841EDABACECDB482D6EC5B | |
2924 | 72D2BFEB4556720FADD49D07307C8B22ACB7E310CA4151A85C71EEF70E8D15DE | |
2925 | B3B00F26E0E166C14647A65ADA228A3D1C89025BE059306565DB1B1EFC37D358 | |
2926 | 8C1EB024254AFD049BA977BD4C2C605050E17940A89D0D4C5D963E792320F5DB | |
2927 | 3706682E03D25D9E02487247819551465092CC22B6B56E93F3AB528038FEC3F0 | |
2928 | 668F866707A19B0463BE706EC729D2EE1653AAC7E29BD25BFB3241D4792F5152 | |
2929 | ED415B4E7FA92C2EE5A22E27E8B75542C492E56D811C192E95542A6FE0BFE5A5 | |
2930 | 69273C2ABED4300D491B92D2AECDD278404CB84B1BB1BD7AFEC858215837D118 | |
2931 | C0E928BE7E07CFEEB51A6D21375B772B8248C994564014015232A0DA4BEA1754 | |
2932 | 3274F407FED0837A236371F1A32056240F2015B1E7F4B2CA72C6B58610A66F13 | |
2933 | 407CFFBA5E0A2893C1F572D50F51286E9133B5A84239C9493B0574E77D281D01 | |
2934 | 11D00683354A000C9700EAFBC1FD104EA19DFCB87470190E7E2CE26E3A6FD0FF | |
2935 | 2620B87B82AC8686B6206B530F17E9348BC7D04B948348802CE53A312443DB87 | |
2936 | 4DBBA5313A6A2A8DAB8A1CC9A594FF8C299281C0A261C8CB2226B732FBEEDE40 | |
2937 | 2C6ACC74A1A61379E2E1CD5548CD908268A32FA83D8504C442EA0E183ADBF7FF | |
2938 | 9FD09C037AB03516ECCA93FF048235BD11A25DB07F164512A079C5392AC7F889 | |
2939 | CE96AE5C8D9580BCAFCC087C35E76EED1A671E87C12E3045E15A687134736DF8 | |
2940 | DA984772AFD189D68571A2ED7256F1E204230E41D3D9DD876F938951714A3973 | |
2941 | 0CA9310489F8E807C1C7A4E51AEA5BC030610A5D7263FF7E0F9FDE3E5E37A362 | |
2942 | 5B919000BD94D978583B942EB79CF2BEAC33FEBC9A67272EB10865BA8FB75FD7 | |
2943 | 9D280AB59F91B96C16C982DE848D76D8FA8620DFD7C80B7DEAE7264350D6FB3A | |
2944 | EF04794DA3305844A7CF718F6D1A4A3AFF6826173A076A1372ABFC54ED3AC6C2 | |
2945 | 09C9287FC830556CA694E21CA5342ECA7B10C90AFC4783D841D7B1E34FA3DB7A | |
2946 | 2B706F3E21B0FBAB23E7257962FC3BC309CEA2C7239A9D6B44CC96825115ABD2 | |
2947 | AF9A2566D2F3382C01569FBDB94C8D664A5DA0F7DC3DD140CA77C743D7BC1420 | |
2948 | 324ECF9E4780280EB119885E96A6C619CE3C0C8E1E264E2DEB137E5DC8149786 | |
2949 | 486D65667ECF47B1A1E20E9E6E4FC8323E0BC8E61BDD3BCDFC6575C69C03E31A | |
2950 | EFFC290472CBBD049DE3F840AEE37A2486034240F80E75D8A79E0762377DF660 | |
2951 | 52B12EAA16D678990B11A9BFBC03C1D4FCDA9FD4FFBB3E88352438102F10B7C5 | |
2952 | 9F04C013B6575B5E948FAB58EA691984A0E54E6B9F3F505FFFEF74D06FA1CDF3 | |
2953 | 4B8A95904C8A2763AA8AF5B71D00F5DE09DC1CDF87A08B6D181453063E14C12D | |
2954 | B7BB3775A6E2A901636273D9EEB833EA8CF20FD83AE899E28DADE10EEEC20BD7 | |
2955 | BD93085A4B1AC80AC1AE8280C14767F1A487BD066007A0D050317BD081131A14 | |
2956 | 6EA0898ED59E46DA7B6254BDCCBC660686E2EDA0E77A705A653733BB5C5497D0 | |
2957 | B130359F866CF293FB6EF0C2AC5BAA2DB0DED045E2DED3A2612D078333260359 | |
2958 | 16CF0CCB272D34767EA069E0F0B0D42327A18529D72E890EDA6195C2688438ED | |
2959 | E9ACDBEED41E81CA8EB5E43C2B09CE266EFCA03F2D7FF57F12B06F9E54FCC6A6 | |
2960 | 546676F6FFC5B8B7D3F0982B6FF0D21D949309F0C0B175CC1D0976F8C55C6AED | |
2961 | 6E821C39041E22D91AB30922F2B2EC2746BC7DAB484991542FBC82D87B487507 | |
2962 | 559AB466F73EE23C2D3194DC5CE4C9AE66D3164613AC5CBB3DB501B64DA7C91B | |
2963 | C7ED2EE9027FC0906820B35D4F2CF66C4F9CE4A884B7C07155BCA884ECA5EB3A | |
2964 | ABB83F84DB1F5639599DC7D3F51241AB5D95C3BCB7AB1EC90B4BC989F74FB354 | |
2965 | 04B2D7366A34D335A47B8C00C05CB423482BF6C7970A95545424A08AFF9A035B | |
2966 | 7F83F52B65A9799CE76E303B85664B624C65E9CA58184C7BE2BB9D9C86A4DE5A | |
2967 | 8165EE3DA2E652B5022EE7893896BABD88931DE1D538F615787645DF5ACBBA0B | |
2968 | A8E5B899A37321AA7D4B283AC9234978C2DD81813A1EE5DB6EC170DAC1B6EF02 | |
2969 | 94892635B498765C07A38D2E9DB0B7581B11056C28278F89B0E60998379C07EB | |
2970 | C0EAEDC32AA69B8B836F92A61AFD35688315B2C3F860632FC13E4BDFB63214BC | |
2971 | 41CC6859EAB3AC3034449213CAB99FA1D216563419CD6D6CE4E1B56F33E6C654 | |
2972 | 7AA9DCB5B05FC068DF02AC32408C8010AD004F6CCA9887830927F8CBCD49CDB5 | |
2973 | 18CAC1EAFF815FF2F6F527F936948201565003022C6C7390B4E3C2B219FB4F76 | |
2974 | 9F12BD25CA7B3B61D1A2F8DFEE795D04D5428B42FB66E0C254AF7B7A10CEF7FD | |
2975 | E5ADA5E217BE24851180E9A1700FBA66C7D2B0D7BFDE4F4EED1D24B821A40947 | |
2976 | 5620363657F6D048E651A689822CF815E72FC8AE9D835BE31D1DD8B54C9A717F | |
2977 | 4DC319B4B59AE073936EA40B070524C7E71D5A7B64436DA107749746B516E29F | |
2978 | E3BBCB8F8C473E706670E11E5B221716F315FF097CD1841D0069FA69EA1898FF | |
2979 | 9F9EC2518C77806A19730C97F54BEAD604548D553D4A6EDB247853225E24E7E9 | |
2980 | 89D71F6BC94DB986467E755CCC99069B313F5745B02B4BB608A39F0A0A732B87 | |
2981 | 7EA2DED68219754BF1FBCA350327572D769C962EF9242132D93A5C8E9725D8D3 | |
2982 | AAAEC15ED0F362471AA58488620156F3474FA59CA080EA96FE995D2B3DEEADF3 | |
2983 | 3141D157481C66507725ACA5953CBBE1ACEE7E3F02C72C6552D15EB3D612730E | |
2984 | 61A06A43575568DC3CF3844BABF04CA767E2995196097015E0C4F622C4356B6B | |
2985 | F41DBAFD797A4B9D7AC22332C552043EF98913D0D9B50CA6B7CDAF903BC5C04F | |
2986 | D20A952BA5CC35B646ACD0A287C956B98C450051AF6AAF79DF37F8954473F8F6 | |
2987 | 652BF03AE2AE82B99D820CF93F5FC0BA17EBD7AF90313E70594EB5C354023BFA | |
2988 | 07912408F1757319C7288E99872B907D5AB583B082EEED8AB079C63E38B07D11 | |
2989 | 6744856E689A479CB3A8BC081F33CB06755926204981DC0A45B3ACC18F6865BB | |
2990 | EE2C50DB43B62E3630FC1D9B1FFB3BFFAA6D0A20C0381ADF48E4D916BEE85BA2 | |
2991 | BB40F538F55C11D50F882B73913840B45161262BC8B0012694C3EF26452F9B77 | |
2992 | 2CD7C7AD6BFEEAFE31C8A721C2D46AA00C10681BA9970D09F1E10DDC250E2AC3 | |
2993 | 9A160EC8C9654FCEB36AC2B586E978D54744FC8A0E963D8EF6E228ADD22D093B | |
2994 | B889C940206F504F14DD921D909BE06EC9BACBC23EB9E9D137FBC983570FFD2E | |
2995 | CC5D2EB5D2A4A8604A4AD418B800EDC6B89809E0009760E9470F037FDD15E649 | |
2996 | 93E9C8FCD9436AF02447C7F5AC380FBE69D1405189E8DBFDACF0E7DAECFA095F | |
2997 | E6AE1A2E9ACFC032BA9A5DEDE9DDEE22A88D9A1F1E0FD9BAE2D88FA168386D43 | |
2998 | 4B93EFF3AD84A9C05A80462BB3A940B2F7311CF7054F501BDD4F1347213C9327 | |
2999 | 5653B73E9D78866901235C66B0C49CBDE3A1BA3A11991E6B8443117745D96020 | |
9f178efb CR |
3000 | 38F4A74D9676E4E99291D4420C57ADE4A8D5214D07B14916D83DF15114393048 |
3001 | FBE0DB83223F609ABE120AB877FEF549B6E2389487BB7ECF1979BCB0785DAD1A | |
3002 | 2916961A1DA60AB491FC90BCD6578571226B4DFD204E75FF18FB5E72DFE8A028 | |
3003 | C66F8576254930567A877DBD22F8372E7BA4F23F9497ED653906F5F67A66A1B2 | |
3004 | 51957AEB8D443550161075E5523F3D2AFF386E2640B276C3EC5EDAB74AC0DC94 | |
3005 | 7D975D7F5781A652BD13AA7F97ADDBE68847167997ACDD038E74E930D8248F0C | |
3006 | 2CCBC094031C7147BD8D4DD664184695CF8C474845692540FE2B8A72CDF9DB62 | |
3007 | BE05E15A05F59D56E5EDBE7C371BE5CB3B276FC7A03B5942057EC3136591A1B9 | |
3008 | 15E504DC497B663A9DD1729EFD1478C233B9317351D000DC0982F061BFF25A3A | |
3009 | 8983E560AE31E321DFB137C77C0AEC704F8DA99024232F26AA6920D58CB17DE3 | |
3010 | C1BC8E20988FBC4705E594569BEFC3F6666785B2FFA49367E3CC695F2A1EB846 | |
3011 | DEB37E120B0F4C0783C0D54655C143C4F74DA0690C6D08D07ED225F361BC0F86 | |
3012 | 572D79540730791DCAC15823991FD5DF1AB8F25F84EF40C085B17C9070C59EE6 | |
3013 | 31DCE45AFA78440BDE4C69A4D954C2006070A2C310179851F2D39B1B5D3EDBAA | |
3014 | 289570BE80F25D75116BBDA61F002B832F9EF2C32B53258B15A1174225168B28 | |
3015 | EC3324C6EC61E5711811E658A1BA65C8D2D47CEC6071CD88DBCDE9CFD2BC34DF | |
3016 | 1ECD2226AD588B50AF2399D171E99D8086DDE33E24640A767F249797B1B742CC | |
3017 | F4E95A64E1AF8D88FB128194673CDEFD6A1672DD1D03B6749E729587C0CB7C6D | |
3018 | 13BFC785759F35578D611E924CD89FF87DFBC5C93FA7BE150624825F7D137CBB | |
3019 | FBFB1238C1A397826B8D1DF0A39EBDABA5F10B37FE8C27568E1C088F279A0E28 | |
3020 | 020DFD377694024FA154AB5C06EDC3CAAC3CB5A69297E1079F5C2F351D81614C | |
3021 | D73ED708907A96F6F8FB0994D3247045E8D41028432E91C7ADB2F22066D6F8D2 | |
3022 | 701298CC9FDA7928F99CA135B69808AF6FA1E0A3CCE1BFDE234E9218A565FE28 | |
3023 | 96541CB9381E887182873FD7866F5F8415EBE92E51E7FF064D6CEB7BDBEE4DF9 | |
3024 | 97633E53488AB11EE93137AA185AA7E4AA043BC73DF1739C92B4D3A8C46BA689 | |
3025 | B9F8FA73BE010D7C4F9007937AD0EE3EE4E3041C72A2C4DB92C6C5433DF33A10 | |
3026 | 700F9E891885DAFDA44A00781BD019A9FFFDB6FDF9361520D50AA5037E654C8A | |
3027 | ACD179511AF61BA10DB29A0535972DDE8B838091B5EC3F6C3408E02B8CBB3FD1 | |
3028 | E213E2C53DB7AB14D465CB0E4FE2A2CAFA20E74BF4601CC23687FA7921CB1B86 | |
3029 | 6DB57E04C99BF7F56FED75A052362016840676DE91888490B4A1DFE0C079C88D | |
3030 | C8C3BD3527F7C006E1403DABB47C3F9174208A379C221931724F06270985BDE6 | |
3031 | A53263227EDB00124C5677613BEA94BA029F9D6F8BD1F7B87C4426210AE554C0 | |
3032 | 7BC707199BF6DB673E40D55741CE1F0853504A414099BA8E0BC7F5EBA5392684 | |
3033 | 79552A5D4F7C0CD3A6D80B18014008AB011C8C66C74D32AAD748EF30C1AD484D | |
3034 | B56BFB090C5BB937E81189912665F332911E11E83CCE75A79DEC2838E811D5B7 | |
3035 | DA85AD6ACB7D8A98D15DEC66504CF2131FF06AC9A8A4FBC4CF34EFB8455C231D | |
3036 | 0F73A50052AC8FCFB2B2ACB95033AF04078E9CB99551FBB1C46EE6C413D86C90 | |
3037 | AE8BD7FBDB7BA6E9087658C79C4758E242256C0546DB76A3857BC89F26A4DD9A | |
3038 | F4A848104BF1ADB2DCDA25C79BBBDB66CE1C1A45C7427FE7CE5BDDA7CB599B4D | |
3039 | B5D346B15414DC9688A9D00F0372DB98FD33E6164E5D78D6CCEEF0FEA60A7F5A | |
3040 | 9873AA7E2A7F98893AC5A9598B71BD06D13D2766489248190A262E5EAA459888 | |
3041 | 6D0A38261697EBFA55180F3D416C2190B36C309202D1619A405764612BAA3506 | |
3042 | 7D157F49FA1E0A7F252FCB0B8459A30975E02748AE1A891FD6BB288E0D7C144A | |
3043 | 1D348F1DDD145912678DAE1906796591E35012373AE01E18515F5CC3BB29A629 | |
3044 | F8B28B54376A9E10D0CFB29B81981E66F27B6AF44DDE0A3621B9ADADA9588201 | |
3045 | 11A0362FEF840B200C84480177C9E3F0777350BE92707BA916A90AA81160D498 | |
3046 | 6417DB6C7E15766EC5C9058CD51879041BDF2D2514B0D6B968CA0A300EE2E30B | |
3047 | 6AE41238D76DF324B0502BF79D58C2DA1FF7E384891182AA59918DC8EDF92299 | |
3048 | BA162134FC3DADB6FA5CEABB94D1CA9BE1635F769EAA88377AD96510A4DA8F8C | |
3049 | 5319E0C06CDBDA1BA9845302F716DECFF7B965BE413A7BCFF3C4EADC91626070 | |
3050 | 9A5776EC64C67DDBDBBC66F16962306631D70E62616DE4997ECFE39DC6BC9A75 | |
3051 | D2297C2159066195F43B7002138456AE7EF69220925877C87405D06144D250E3 | |
3052 | 55EEF1575DE8564BF98E2ED403591F2EA4F6AD71A126A9B1F5D350819058FE4A | |
3053 | 949B8C3A7907A725B463B752EB3B44B090C731EBB86FAFE24340D1A89D3FC0A6 | |
3054 | B89E64C3FA480C91DFCCE4922C000B0533A052FB9305EA3B58A38A3AC2688715 | |
3055 | A7C7418637C393439725F0509B3B08E07DE5E0350A005E4C5DB815CD317EDACF | |
3056 | 6460DADCF9281BC6523DC8FFFFE18CFFB2EC61884E7B324806851A91F7E0336C | |
3057 | F86AF2C88F1EA1EAF0F87013AFC7DAB6F6BE426D92A406437E38C75614AAC461 | |
3058 | 4EDBD8F129D985A1385B0F9F1A4E6D9936FEC600F4E431C653DFD1D56F694471 | |
3059 | FABDCEC7BAAA0C266D35D7380AEE587F61DA5CD1229D99F82BFA7B1A45A165FB | |
3060 | 658A4E7A741E11931D6E5C1358CF76056CC0DCF4B623C2A8CCED91694E46661F | |
3061 | BCBA0225541BA9A58EA1F2E2B2402299EF2B691C39A87AB3D5C722DB2738EDC6 | |
3062 | 8ADEB09750D714286EB392D198A55784AD908470517724B92849D539ACAE89E7 | |
3063 | A8E37CF20CA87635FF92F1140DDBAA76CD52BFC0B40FBFCA768F837D0AFBC7E9 | |
3064 | BBC89422CBD6429B284F67AD2DF917AF69346A5BFE8DA3DA8F9597C2265F3BC5 | |
3065 | A90CCE79572DB45176AED6E1A5FBADC98816F0E29BF58DBCEF62EF76A8D8C845 | |
3066 | 4C7E9AB94A0EA43D2FA271BEA800890613D8247171938596CE4948BCBC7960AD | |
3067 | 5B2BA3E0A4384749A7D88F3DD515CC1DA7292EE9775B67F621E156020419D0D2 | |
3068 | 1A6AF5B51E64D3EA7D182AA65AD1F663FB28739B86F9EE5880A5A96C3AE1C563 | |
3069 | 7A002FD0ECE3AEE80AF18A0FBCA3EDD496C18C8974E856BA39226C382CF8541F | |
3070 | F7E2C35B3CEB1DEE3BA8F346199944BE2F350E4C3DC89D789250C3C5192236AC | |
3071 | 513D1A3058230470BBA11E0B39141F48065B808B6FC459A897C304B749B5A656 | |
3072 | 38B55950D6F379A535CE2816498DE36D03747FD07514C2DA1764217BF2DE17BF | |
3073 | C8FB2F06382136D301953DC42EA0B429489275571F6B86AAF496E6A2EB196547 | |
3074 | B76BD6DFF6054DAFC9CDC11FBC541426DF0351ED027FE76128411F6F62DAD159 | |
3075 | C116B43AC59C885B3308B158EB74405541F2BD247BEED5D3B35554EABCC133F1 | |
3076 | B71EA3C7C7876661EEDC141818A3E8A9C519E7054E26DC023320A0166FED1C19 | |
3077 | DB1C3044D23E5BA7F039D86ACFBCB5F881A6FF9135E1F5DCF910A873E6F7DF8F | |
3078 | 11372C039D09A875DDACA3FFADB73504C1749932C3792CA80D78979CE0269AD7 | |
3079 | 47CBE7CA39E26FCE1E71DB711D176644423FB964CF8CCDF16FBB686877B1B99B | |
3080 | FC570BBEE55DC7F2AED8E81FF38DFD61322F1FB69E5CD6EEB8135128A35FC23A | |
3081 | 5ADD95D4F873B2EFD14A1FF76CD20454BD3BD2752C9A5F0C21F1E5F39C5865C6 | |
3082 | D4874580E6224B22FAB9240E0346C843AF0C495E7FD5B3310D90A6308D47E882 | |
3083 | EAF80772C87D3F7FB9DDA52F253FE4E3D1E56EBFCBDB9BB9A977DC7E9772428C | |
3084 | 47EDCE4D4F793F4DB9C66E65827109E83723E50424A87B36D6E74DD05B327128 | |
3085 | E407252F937ABE315B18312C8BE965E84ED9C895D275A331EBA6E872DBCEE1BB | |
3086 | C6254960940B95F46CAB4F8469E7412F546E62683AA356366F454308367A789E | |
3087 | B1E6F3A07B87829111DD17856727E948E0FAECA4EB00192F125C2331011AABA8 | |
3088 | F4067FD01D56853FA445ADEAE5901242DF460ED8AEF939332F87D81DBE9A30A4 | |
3089 | 18884AFF8A7F00530BC7DDD3A1E6C40549BE3E567B225E7C8844F0AF3E19A4A7 | |
3090 | E61F818A5F1BC836012FBB9AC4A5AE737FFA908EBFC88B2EAA62877B05B1B1BB | |
3091 | 65062420B89BC4C3C4B7CFAD1148C6A373F26ABA9A8DDC74DBFE47937035DB49 | |
3092 | 20F0B8E788C0AD02381732BEB2B9587D6B50E6F7B4E9DAD171B8C64B60A04776 | |
3093 | F70BDD9C6C8831AE39561701FB54D68810E4C3249C32E4D39BB40C500C8A735D | |
3094 | F316A68985E3A0338D8CF730881326E2B76D75BD2566D7387C0DD8C5724592D5 | |
3095 | 1FEE9798B269DE09387D3A1EDAB20063BA852726BC7EF07CED98E2DD1957F94F | |
3096 | 7E336F6047A935E128444DA8F525FF1E458ADBCB1B6D910B68955DCC59512591 | |
3097 | 2F1228007F9524A0AA6113FC6805AC4ED806D5CE6E03AC9EB6830EA9A7AE975D | |
3098 | 99A4FDA50B92FB6977BCE8BCBE2D8EA44BCE9B39718584A452205C4349561CBC | |
3099 | 7B1E281C058D0BE636CDDE883E1C1AE3802A35C5426443AEB6FF705EC26AF94A | |
3100 | 2A7BC536F373C0EBAB41C780E56F5BD1CA645DCED5090CF32D4F0E5A780651A0 | |
3101 | 477CB27558B2D0E2AE3D0A02565EE38D5F437D01308A6BEF55E80422F5B5B56F | |
3102 | 6DD11ED717B034083F9BB1536D76E321255A137E618B398875B5BB8F5AF02B6E | |
6e51e0d0 CR |
3103 | B4DFFB173C424B24BCAF3C9271A54166A65927519C9770B0DC44CE276ED0C20C |
3104 | 8EF41AC3AEBEB0996DEE664E8F872023710D0BA81DD3A3EBF79BC24717BA1280 | |
3105 | 9E9CEE362F5BBADAF6D8200835311B1063FAE4D6EC8325A694EC516AFD24FF99 | |
3106 | EEE758AC14E76FA1573462BCAA75D246AC363C412185D20CDF1539011C35D1C9 | |
3107 | B3B3717F6A37DE522943CF9B3D8CF284B4C0068A1ABD9B58FDFC20CFDC45BCA3 | |
3108 | DD054AF00C18CD7EAF8DFFD45C28A82C7B417AB7188BDB49A5871320B2EFE0B0 | |
3109 | 25CE25F3BEFB53856689A44D365C55218190B407B7BF9855ADCBEC5C0094CA63 | |
3110 | 11E014EAFA0D1BB324D3B1D94DA4A7AAE9D29C71E2D5F122F1C79726731FD066 | |
3111 | 6545816A5E05DE1F8DEF865DDAE0D80E9AD0120A0C81384AFA5BCAED3F8FF80B | |
3112 | B9F8C8A7517A3863034C312BE64AEABAD77A5269253883D460DCB2F0A3B28700 | |
3113 | 255BB96397D1D613A14C3368C9F27F3E42B887108793F4B12E2233E5A3620BC4 | |
3114 | F886F124503FE64421C1A40C37B25127094476713D39EB73004CB56E877935BF | |
3115 | BA0C7B095414A1FD59CA11573B86EA32E297BA38B907938B3A25992F0563022D | |
3116 | CF54FD863B8792EFB58A27DC2CA6C4DF48B9388F5676CD462C1AC745488F6BA4 | |
3117 | 2B923427A7D29935417E010099FEB69B16BE5A2AF7B4883BBA80815A09693AD3 | |
3118 | 2B78D3A939FF18798043F7C88A76BDD527B554BEBAEF922FDC9B381D72C7CD3C | |
3119 | 49698A1444FC33E276D3B9263CAFA375F1E64C8B39C89D4A65FC42A7183E41F4 | |
3120 | 1C3F0CF7EBBE5260F862EBBA059765497817B8597DECFCDDDA5C1D15AFD3C3D1 | |
3121 | 6F1A8E43709540948B1E3B41E32AC13B469222867483B0E765FB427300AE9BB5 | |
3122 | 4CED17DE5C45EC8391687036EF43D57835CFE689B99FA0B860E3FAA6471417AB | |
3123 | BD505F23013DBD726BB5645F3006BDAFFD5ED0CAA7428EAFB448E0A30F8B7858 | |
3124 | 311E3FC16FAF9FAC5E86998E4954AC4C9E32FBE6E9DF280B457BE80DDA2959A4 | |
3125 | 0A874282A7F9AE5236843298C26D5D4160A4554ADBD3EF0254C4F2D108D49DAD | |
3126 | E1D1B996D5147560D574FC238DD005D18CB32A6CD73C265F05E0AEA17C73E3F7 | |
3127 | 2FAA00290D1A6361CF67EEAA68800D9212BB5B8F0259FC8D133A21E6BD375FF0 | |
3128 | 4BB0FB1E78F065E51298E97164C1FF241336428932D1AB97E1D0ADEE93BA8903 | |
3129 | A8124A3169AE0B905465D7E8DF132D903C9B4C64074147F2BDB1F722BC261E10 | |
3130 | D366C246E8D664CB57A92883CD7174218655BA68D9919D0C8678DC4E7A7E66B5 | |
3131 | DD7DA4E011769991DA9D93311A06A623B680DDCA32B287104A1D7BBD05AA061E | |
3132 | 019BE06684F9BF987FA635B9764DCEC3A3286340A7D50355663D5556103267CF | |
3133 | 8CD9DDB4DAF109C47176A1E9443F3E2703788B85B6FDC8951783D08F02DF72AB | |
3134 | DB5F8739B2B9B38CC813796F48FCC21B0CFEBC8F074E464989AE5EDDEE5CC3EA | |
3135 | 69C281CC4CC295360FC11F67AF3746CE3598A215FA109709A4B193BFEA270261 | |
3136 | 8ACB9B7081A9D60CC49AB3F25B0B6F922672E58708BD707AF7DF35E32E7CB939 | |
3137 | CC25BE8392B3DF687FB67F25342671FA831264230CA39D189AB6267095B7CBE5 | |
3138 | 09DDBFD5512A8831DFDCF53CDA45E3F0C097C0C4DA1F12589F7AB3D83178E9FB | |
3139 | 2E9B5236ABD35A872EB9A37ED9545C6ADAF8FF2000E67AA8C8A8E61C9829F29C | |
3140 | 5555FA19BF6949AE81487EBA68E8ACB6244ED2EE8CD537155B68BD1305FCE20D | |
3141 | 710147B9AB3CCF6BBC0F2C3D8D77D783ADFA68B208829F05522211E28432729E | |
3142 | AE8A8C09C04174BAEF8D560D62733BBAF506D2EBA030AA77F18A38EA8E98B38B | |
3143 | C03B5A3C33A7B36EBFD1D55D503FC06F19056EEF9D1D01CE279D2BF23B04E880 | |
3144 | D6873E16AAA583ABBEF1EA8E5D6C3D038738573081E264C01DFBEEEF02B8844B | |
3145 | 19BB8D27BAD7354AD310ED720DE2D4240F3106275AEF6F7ED61735D799306DB6 | |
3146 | 4A3BECE20525769A0D99EB90D957297D5913CC48A98EEE84FEE5D02B30651CA3 | |
3147 | B7573DE50F1B9D8D50E5746394DA8C5BA5D71CF1647F80BC9337F00EC31476E3 | |
3148 | 1019B41BD01DE7FD55886402565F688D1E09810DD8AF982032B048548D87AEBF | |
3149 | B20C6B938C6D8F96C2D7B42A1E69DBFE6AC28D166804E03AC698B180A48503D0 | |
3150 | 0549D2DD2EBA5C601841A711DBE9D7019E5DE56CF78457F412E42CEEC248DC5A | |
3151 | C0F349903F745E40897D0331124749D0F9F9C71B704E4CB0898AC7120A880215 | |
3152 | 236800020AC60B1E5682656534F3332C2DB06A7510AEA061D9206B4C033A80F8 | |
3153 | 77DC8EAF7D32A7B791FA3930647CB1A29228DE62A9733C6AE072144BEFF15651 | |
3154 | 791C8F99508DA1E3F8B451985DC68251044FEF9F91C7578A2F3956D97D544D3D | |
3155 | 0E6A3F7719F9561B47D76612D833BDB64780728A6456E8CF273BB708FFFEF743 | |
3156 | CF069E55B1A871718E02778CA80A5D21597D597246C260AD390E5F4A285A5CCD | |
3157 | E55AE1C37589EE307C6D2E1DEFC605C9BC33511968CC8AA7E61F5390951087AC | |
3158 | F4376C5BC48DCB22D8F0CA6CABF25383616DADD012FAD655FF4198245209E305 | |
3159 | 274D18A98D760203C8AB09F7204A967D07B75E7650BE0A0595742F821F74193D | |
3160 | CA0AF1A4875F50D1F3F2786C5532EA3913B3589215386E78157D6F38C4860698 | |
3161 | 7DC51E51908A7AA304DF1233ABAE2B3C9B03F2496B320DCA5B7DE98FFBFD6FF6 | |
3162 | EFD2FFECDCEA32D0A7F799382366C6325B89C94B37CED9A1A1BC88602AC5D9BD | |
3163 | 1BEDB8D5CD2D38FD1FA33703C41F979BC24F1609B3B35295CF756551F9F2D770 | |
3164 | ADC3D23C5B7C6A777CB33A06791EE8481BF577A94016A061D8AF8882466F7499 | |
3165 | E66E7E93F104E599C79CB6F76D42608B9BC1171A9AFAAD93E846008330DC3C0B | |
3166 | 6E8BC7623E8693C1E7E8B5B8BC426B1EF8EE705D2E806486775BAC15660BDB75 | |
3167 | 66BD708939D23762BFB8628A863C4F9978F83733049F63709066CD4203476CF4 | |
3168 | 575DB5CA5B5F01D8E4DF345D78C2A938B5EEEE618507B2AC9EB9C4BC9B64CFBD | |
3169 | AECF052FA5D93B306C075AA8A645E5B93D1005C252F0DAB540243C7E3C3EE52C | |
3170 | 0886A5D89A30DAAB4ED8F38ECE11217F0198347E62BDA7A1BEB6D46482BE3726 | |
3171 | 33CFBB23A78756BA63741693D764467273078167DA48362985CCEA2889133C7F | |
3172 | A5B0BA827E92333BB02221F6757E4ACB8C2198BD7A976A29387CFB9B7F51C65C | |
3173 | 2E151D1D1F73470B14587A6F11AAD77465975961CB77306E7793EDAC65EA7AD5 | |
3174 | E562F2673FBE78794C9D38659647EF5189F6ADD9B4250085A59F84C0448EE47A | |
3175 | A073B712B6B1CE984DDE3125960C16AC77098424004666BA6116A042551B48E7 | |
3176 | 507FA464B21209D31C506D1DAFB628FC2AB30279E6148F3A2DFDD183FD770551 | |
3177 | 0CD3FE854FD619E7D2B62A8888C300838E41744BA759EA4E4F19AD5CD249E8DF | |
3178 | 74E81BFBFBEE42B2F67370B748B1B3FD5C6201866D8CFFF8D9ED127F43F4009A | |
3179 | CB5D9651587B54ACB8C6D410128362A74EB358437D0CEBB9E0FEA7FFC27A5509 | |
3180 | E799762B27F30B5FAA4ED3B492752B04702E48B1D0C55155157FD7B4E578A560 | |
3181 | 5C0343A472546826E9B9B80E91867D2D4C3EEC02133BC338954AC6B58499AA9D | |
3182 | 24CC3CBD2023E962D147618C08BBDDCDF36E91EC2D51D6DEB97A1477D8156707 | |
3183 | 9C1B858385FBA45CF0FE74563A5D5A51ACCC3EFE991429A8CE57131AD56F352C | |
3184 | E95401BEE11B310C96E9C3CFACACA00114625BA7B4400FFBC5947574317E8699 | |
3185 | 90BD8678107AAFFE1516A59027E9907359B61C6B8A97B4F99A338BEFDA2C25DC | |
3186 | D6413A0CAC46051E76BF732CFFCCD0FF1408DD26C76DFFB54F7745C79F3A7ED3 | |
3187 | 1D9F8BED7C6977067E6C8E46EFEC63AE0D3953175A6E51DA38EFA2DEF475DD93 | |
3188 | 1C34376F5C6C6218DF78EB84773361B9339FA58A88E96C646F291CEEF398D281 | |
3189 | E0DEB2EE21C3EDE0996427EDA0CA0A44247B1A0E03BD9366E75F763C9B1D2BD8 | |
3190 | 00D2066BEF933DC6AB3586EEBD04E6D750A22978ABE902200200B468135B690F | |
3191 | B840BEAD5EF80E068F6F87442D93848684A127EA79F4A8A24DE737A373ECCA3B | |
3192 | B405847430C138E51DC18C367702E868CBAAEF6890FEE68A75C5781F32B96D86 | |
3193 | BF5A0C99F04DF2B7FE968B6566BD816C96D7EE35A863C0D4635047FF09F68302 | |
3194 | EF62B9293BBB8BADCFA64C6CD9024C4F739C8C730BD62F2B613C6E1923F04BD5 | |
3195 | 62C556E3927411C2655045B9744C9DCB7F1DA9C1B5C70A145E9A35DACF1B68A8 | |
3196 | B5DAE1C62DF9220483F1DC721D559B87D7CD802AB539AF1BF3E434EBCB796A8E | |
3197 | 378B1139CB3DD3134DE8F40C716BA87185D3E406E3C941D336A1436D891803E3 | |
3198 | D2C8E627204A343811FA82FD1A232FFD6915501C1B158E890C534CB94FCD9ABA | |
3199 | F64EAF649056C1198F0F58F56D3E1C91C167D4D9B4481D48A12CE297D5DCD0BB | |
3200 | 8BE16BF18DE1D58F7D2587B70FF5734EF8391DC5F709BC39E729713CDCFC2EC4 | |
3201 | 5E7AA863CBEE1CE8185E657E7FA6565EBD6868F478554E96FA808A708B48E463 | |
3202 | AACC817DF43EB9A5233606A402F3A83FCE99F73B8DD819A4D014FB435BA7F23D | |
3203 | F2AC40C473A34FEAF0A5DE457AB5A18A6CEEE95A55FF604AB5225C5C1DB6C6C7 | |
3204 | 0C7647F075E5FD3CBA9F3B316887B4A01F1C2FE09719B4BD09A84C5A3DCB82BF | |
3205 | F5EE9FD0133F987FCF77098E0CB919CA7FB8468059FD35088B97705F180D5A19 | |
3206 | CDEFA29A02C5D3EC4893985A2478B0BE83B18FABD32654040A2F2A9BF7BB4F7B | |
3207 | 5781D2A6B5E416BA14BDBB481B3D619B0C885CB392111E32B2AD6C8BA13E9F93 | |
3208 | 49CC4B5A35B1F93B68A5ACCA4823DE44BA8979181E50A3804E43D6245488A15A | |
3209 | BD51999A729A20B9DE927F728E59312ABCF89176C35BDED4BEBEC14636B19989 | |
3210 | CB8BF2927C1BDF5460BBB09BA81FB83020BE4D4B69179C8E3B838D6763946166 | |
3211 | B328ED82B448CAB5EC2331CE7601EE8B39B334BCE11038B0EBD8437E5463C640 | |
3212 | 73C5FACEA06A219AE83515674CEF03AA2F5FEACF656ADBAB944CBB237813CDC5 | |
3213 | 06C303EA518CC59486410D65F5E5395DE84D0EBF8EA37633BECF5A08851B4758 | |
3214 | 1BAE6460B2B67D29A8F88FBE52A26DE7A6E6D859CA00BF437837DC123C459B9E | |
3215 | 43FB6DA6B79DC16C60F9035EE3B10E2CCEA9F7ED4FE29667E0559A3A34F6B550 | |
3216 | E4184ED8E953247B104DE7D912C5BF66F3259214FF091096DAD710C9F4EF531B | |
3217 | B4C6B3BFBB4715F3654587A5EAC63C917E100F37862B03EC240E762F2DF72CCC | |
3218 | 9CBF233ED204EB966F6A34519C0A169EA6130D18CB8E53EE96B7A63C828CFB28 | |
3219 | 45CDBBF7FD775137119B7C7BB2A665074691199B387ECF452A3DC5F859D4248F | |
3220 | 3A02D4D65167A9E6C92E0A16D293ACE234C049D98E961D14D070DF2A7F55C232 | |
3221 | B2CBF0378ED83686DF80E05DD417153A3FB34A7B2F0DEFA69A34E19CBFF56D1F | |
3222 | 14EB4CEFE99DE9CABC5F0FDDEDED79A50F29151294E2576CE97CA00F734702C7 | |
3223 | B94243299D8080957B7102AB370D5448226870CBB5DEA5A295D3D5C8F7D1B5C9 | |
3224 | 44E6F16F703E4CD3F74B37AD19BB53635CC4801A317C953F2A131F82DBF39694 | |
3225 | FE552FC18B94EEFC490A579F263DCF470D2AF1336C166F0FC69D84800CB1765D | |
3226 | 85937598431461E7B5DB95839BFA81D51ADE49E4242E2DEA4560DF41D27C7733 | |
3227 | 2D1F036614FA1AB505537197F419E6722D4EBAF5DB087FCFF838E782D239BE68 | |
3228 | 43AB130B26003747C36CFFE7A96CF8522F3F369E1E6443C923C4EF6616241DC2 | |
3229 | 5366259FA9FB2559B5B797ECFA474D491E96F2CF07DFCB0765A1A7B0FA8EB181 | |
3230 | 0A82708A93C8C8C2EC711CEB46D4A4D51ED42E6D023932F6C29F7E4D9735A5D5 | |
3231 | 269481F9A92673E88970CD15DD2F532A2D96C48150C10854F3A98B200612EED5 | |
3232 | C2074848780E53C5E086AB78EBD0444A064C5377945680900997D1739E93EABB | |
3233 | 520519269E2516C7757FFACF312E6725805BB2261552C760CB68A7BCDDA0438E | |
3234 | 0BD4E6DD87C204039396684FDFC4398421E1D94B110F2831AC0DA589822357AD | |
3235 | A78CEF72FAB2EFCC848DE7C5486AC56D56DBD0BCB39D608F40E0981572B9FB0E | |
3236 | 51F11778CDE7A9DCE029ACD63D61C22135CA5AC9DA490C29FF12165AE20F3127 | |
3237 | 9D57AF7441F31659BDA2872A720100F3F63D9CBEB596FCC23FE1BDC7DAB26FD8 | |
3238 | 00182A4EB8C9ED92B3BB9971AD01063CA67ABE06F51F66232545EA42AC145113 | |
3239 | 1BB165ED65DCC3A1C0E288FED14706BD7FA08D3D4F143B8B3BA68BEABE09225D | |
3240 | 2D0524B51E2D7ECDFAC0F8D66C7D96D885D0D87B7657F6134B3E7D0493E4BA5A | |
3241 | 6DD7591027A957EF7E04AD08B10D93205A5F268E65B30242AD7D07C2EF59238F | |
3242 | F5B6FB46BAFB04D0E354072DD934FC5C63A4FD47541A4BA4B68E531E4614BEF5 | |
3243 | 15AC43BEB87A1204B9BC873E9E79BAE958F4622077B7F7C2EBC0FFB7F7B6EA39 | |
3244 | C9D47152C26BC4A41188B367569A22762B8800E715416B7B396BB3B5ABC11A19 | |
3245 | C427DA9CC6EFAB2450C54030DC95A775422AF14156388FC0DB8901D3D13CB248 | |
3246 | B774DC8E8E36C7FEB216ECD93288F0520FDA6FCAC443C62347D680CFE38039F4 | |
3247 | 1D15F56B06632BB1E91AA8E098EF73D8A054AF1A8E327BC6E7D37EF19166633D | |
3248 | 1714371B2E916869E420A69BFC9AF4CCD3F1DA4569D3542AA43722748E5079E6 | |
3249 | EBDAD7306314586BB17C9C7FF0825D865AF14F0FB03EA08F5E2D22A97B9702A4 | |
3250 | 8A169602A94B3F08ED7A0CF6B9288E35FD989F2D0020411EE777702C408920E2 | |
3251 | 7A7F37E36734BA4937FEC3B14FB1FCC92BE0944C9D893929A63DEA8030DFD9BF | |
3252 | 86C40A4E5421C663BEE7F2C29248B4839E441AD9D04F051AA0991A6D6EC47280 | |
3253 | 10CEF96A41D329CB263A566A2D0C993FB918C6356C1249BC14BBE3B39596F7FE | |
3254 | DF719A7A9175B271E37F0C3B46B6F1A53ED40E6C3EA4313A7C90B65997EBD308 | |
3255 | E2F08EA3B7038E0694294BE05E9583BC74306255DE19846A692C0D0D64506C30 | |
3256 | F1E7B83EE2090F0B0C9A1DE01474DF9DC7D618193149E95DB2F6BD8C0DDE48C9 | |
3257 | 625313BC0C265A6A4BF5FC9598EF8E16477DD19068CD1AB4C52777E9CBD2EF5F | |
3258 | 99E28F5A2CE31E2924C196492A8E3319B1024C84CBD4FC175BE286F1F0829E3C | |
3259 | 7628AA9FFFB1810C93336E3749A818E46206A3E415139064C9C7D004D0CEC1F1 | |
3260 | FAB611B672C0EB951AB9CEFE67BEB2817BE9248F887836DB614BD26A59CCA79F | |
3261 | 04CA82700DDD8D792E89EA14D0B90FB3F8D6648090A39C99894C8CB638EADAEB | |
3262 | D9BC62555D36EBED36A39AD7601BCE938D26C84EB1A6302CA1111B0C362C7718 | |
3263 | 3791067E2B506460D1BE71A13D02451036C4FAD7B917CC9CB347E8FC30EDE59E | |
3264 | 8BF9874561A4B0E4235BBA799471EFBAAA64DC644958D1695526A86D56DAA3B6 | |
3265 | 8AFA3A1AA7B66C840DDA7860072BF4C937B37FDA41922388FF8B4E3C305335BB | |
3266 | ED114714115CFE1385261C6EF0EC27CE200A0B2434BE519CF064FD5860CB7395 | |
3267 | C934A9D7B06DAA01F039DCF3318F393E22AA8CCEA80F58094F5129B06A5856C6 | |
3268 | 9DB2EEB9B377135ACDD04876012CFCE0CAEFA831CDDE6B3ABF574573EB6D72D6 | |
3269 | F03D294CE59A42D5348781C90D1F0D8BDCF770E6989A939E3FD42A68D34E6B0E | |
3270 | A0AE88E2B52577B1BAA36EEA23071FCFB8FC4C41A8FCB9F8871F265D78B274B2 | |
3271 | D0D8F92D55011A124E037B5254162E7956465E96DC76D0CD96643AF172BD33A9 | |
3272 | DD48C30161EF717BA3AE6C7231F05DC4E330964C01F6BE6EE652AEE0AA41086A | |
3273 | B2FB3DEE6697965BF24EFDEB87D49BB4D617A10480CC29C978C953A0B826E470 | |
3274 | BC73AB39F4A8A94306CAC840DE844C60F650537E695C6323991AB9038DB838DC | |
3275 | 0264EDB30E27E3F38B9073C8F7FAEEEF4B8285FDFEFF1C7CB16E43C712D78345 | |
3276 | 813848FC335ACBA0768BCA0A9D57E99026CF04808F002FD842AF9DDD4E72BC61 | |
3277 | 4997B2B39E28E971F60F8D96B66D8EB5911B8856287E3CC2D24D662312C238F3 | |
3278 | 777745B73A30CF91BCAF4C6205808A2286285462580052DE31EC1EDB0BBDE46E | |
3279 | 5DBA461A815EEDCA60F8D64F7A2A84613DEB4C4745EBD6C04DAE969BF4681B5A | |
3280 | F95ABFAFD2E9FB49A8504348551E67EB6EED4F87362FF9A5CC9BF06478E815E9 | |
3281 | EB946FBAC21430CF51569E331E0060BABFC7B21535D987B480FE1264A3738EB9 | |
3282 | F67197E54D9C2B032A06AAACD80FEEE298763DF5CFD00E2814F58A69A8643AB3 | |
3283 | 3902057079A36C46D8ABE38C48ECCC6F7491D4D4A581A452C48CFC961DD8E85A | |
3284 | 5929131DD9543262E81C96631C7FD7B94C724102DE9C365AD97D6ABAF44AEFEC | |
3285 | BFFCB5DB96D395117A665FD30A70E8090C3883FCF7ABE76954BFC07E4467E5D6 | |
3286 | 262D9C949ADA532E94F9676D15DE90911D34BA384081A789D304584C688025BA | |
3287 | 4F6EABB4ABBD427CD00FF823773B11F283241BAA9B9719808D7FC5E77FCFFFA4 | |
3288 | F95DAA339D4843AD99133A1DE37103F386B4092343814923FCC22A87D8A91F98 | |
3289 | 3E72139EA419D61789C36D99A207600C188477278887467F15D6A6635BC18D38 | |
3290 | 53FC280A6AF75015E003E2C80F312FC1D967203234583FF829FF13890D62FDAD | |
3291 | 69DBF4D1AA69AB22A11A64662AFA11952042294C55F890EC1805936402B7C229 | |
3292 | F0A33C29453754544D92CB1E338AB7F3337BAFDC535CC93DCA0A049368B91FB7 | |
3293 | 07670DEC8F84592CA1B4B8CF94E0D6A64A0DF9C0C239382D283AB166206B1893 | |
3294 | 510E6320866A16450FBC2B0F82A38E460689EB07AD663A0785971D53E42EDD4A | |
3295 | 4BA81BAECF10B93B346B20FBAA70E4D15AFEFBE7CCA040D982A92E7853D055E2 | |
3296 | 065A09DEBCFA1B2ECAE26C38F8DBD378E976FF597397C27828EE0E6791B8641A | |
3297 | 95CEAAEE1849027B06DA878994B70F94C835444F6B69A2DFBD6E4FECA5160C53 | |
3298 | 7F12F395CBB410A6C92DFF74F8CDDAF64EFCF4F8ED9B832AD75E48B3F01DBFA8 | |
3299 | 86D7ABCC22CA3C13603580C64B639948E2B74654FC8AF03B4F56BC8302645BB3 | |
3300 | B682950933DF6086F8641FEA62CC01F451312D22F4CC5804EDCDF981F6DEE997 | |
3301 | BB777110A8E8ACADFAF6428096108F535472D856AF4165C255A1B43342202F3B | |
3302 | A72C931CD8A966D1898B78B12B14DBC0D3663983A9E2153CBC23184A4FDA6A0F | |
3303 | 779AF83DB6FA36FF6258473B17FB452EA4AB02F0D34C0B8C8E1FBBB35B680D94 | |
3304 | 0201AB0D0F0637DDE7031FDD239BCD083FF5A28AC9AAB7271D9179A8AE589B26 | |
3305 | A897659AA8E9CA50ADCECF5D5F4D21C7142D4A85678466CBF033D883ADF819FD | |
3306 | CD27E3A6046F3EAEF987DD9171440DE702ECFD3AA51C12AEAB971FB8E3128291 | |
3307 | 592A3619A00A4DDE933F960CF460C31AB712D12AE4A37357E42CAA235672926B | |
3308 | 00FF510B7686F013ED7841FD01805D2496293CC262F80E730D2FB94EF320314B | |
3309 | 2E9BFC65A17A0BCC2233F53ACCC3ADFFAE00F19277AFABBBE4D2E377BE54EC2D | |
3310 | 82038A9D3A35D7B13744E468A1AB3D0231D394EBEFF06BC1D52F18430F7F77E8 | |
3311 | DB47FE2A958D86452CB7FB6FAB65198AC7507BAC92FF4F46B97A265BB80E99EE | |
3312 | B2211B9989BBF73B1753B4BD6730271DB7679FAF4D3B223839094C1C980C15D3 | |
3313 | 2C9E74DC9DCE7CE0D48B1E2A8E2E3DEBE2DCF6FF7B8407FA88F59A8D572E818F | |
3314 | 0C6AEF5B4A99F83398F97B162429D82A62E2377361853F630E7D0A7D728DFEC6 | |
3315 | EE39A9DAD89967BF1579C57AB99CD78DE820C407CAE52C2D7E65C97A594FCE3D | |
3316 | 378AC8FF6F8867E8953FBE91D2D8131AF97821F28D6EAA5A9F025DF790FA0967 | |
3317 | 2C0A1339E953EEE5FC75F76FEEEE780F332A1C0C08DD80EEF52F1CB7E02DFE52 | |
3318 | 86F148A998753B27CB823FA9B4907B37007A5FDB8395AB3FEE7CCD947D1F6CFE | |
3319 | E81CD88BC9690E2F89F7CB130C9A2834F938B3D562A42CEFDC45A38E6BF62ADA | |
3320 | 1517974E61F6D35267795C7A9E945856824329B14E70EB350C997756A8FC0A8F | |
3321 | 7CBABC48C4AAF0A5D6A8F58AC190AC3F980C00D93FEFF1539D417AF2DFBE1021 | |
3322 | 2882782C625D2BD323B9E0D53F1494F8CEF84ABEE30CA90C251887075A697386 | |
3323 | 89F38001C3B2FDA9991D9A5EDA186C37DFBD0A77D47E24204981DC0A45B3AC66 | |
3324 | DD14D43A8A9826A0BBD96FE2279638F5AF12F010474075C381BE0243E3217199 | |
3325 | ABF00214D7D13F66411A6AB4FDBFDDF295163DEF72E788302F63FA8225F08ECE | |
3326 | 1F32D71BDBCC1ECBBC067187C9713C686E3EDF304BD3C58981C76B6943E66F34 | |
3327 | 2BE57CB3145FE9A286F570074DC259CDAB2A415DCFDCAF46FA3E195FD43C38F5 | |
3328 | A612D653E3F178E16D9FCCB637CAC9AFEA648AF52B945B9BFE37F241DF9DDD61 | |
3329 | 5425B37F903B079F337E8E15B70CCDB8920F15AF89538608A573E7C9008BE814 | |
3330 | FFAD305F0B94C7AE5F3DB35D34C04C1A250E89C252759581AD933896B468547F | |
3331 | BF0AFC136FEC40C7436120A944979C9DB4D492A52B0FD658E8083E0EACBC60DE | |
3332 | 67DCC01E3F87F04754223A34732D211B43248A5A5BDB19992CAF481A564DC9DE | |
3333 | B16CABD3BBF40BB4F84D67015773F7261FB175806DBA97597A0A8AF8920596A1 | |
3334 | 3C77C728F23CDA310161CC8573ADE490419AE08CEB622DB6883CF0B75D43F0B8 | |
3335 | B37715EB9AFD9CBA33DEC10BD2D78E541499738D77A6450B93B795EBAD5F44C7 | |
3336 | 311134D264B1881069ED3422281C15D1822DE565FF7768B80B58096D5B03D168 | |
3337 | 0158B52A52B7B5B94609793DB02F8EA785A2E0A039FE4F8CBA3CD0C2A934F2D0 | |
3338 | A2F862F75093FFB2743748EAE9947B5D9F56CA0D67ABCC01E4432BE67E22DE05 | |
3339 | 39664D8D7E9D732A897F03DF889A0D3C09E60C4F3A3996AED7293B8743353739 | |
3340 | DE1D41C5FEDC2BBF6662BFC35660CF8EA4F2C0DA06AE90AE91A9E0A8BC94D43A | |
3341 | B79F3778BB68BB937032EE09062E1C4611EF8E86CB7007F2AA7DD3E46A31AC00 | |
3342 | 8CC36771023DE9E9BB5483C051FFEF412A14A65F30DF95C91990408BBB8A1E6E | |
3343 | FE801BA15666D3C270F045A8178BE9E424998653471706D0D86D49967771961C | |
3344 | 3F62F1B6F36652DE97526AD89E748221893C9B6E5915C1504FF46B6CD09D85F5 | |
3345 | 57F881284D70C35BEA64731C99C0D865E2E9C9FFBD50806164157CE198DF009F | |
3346 | B560FA76FD75CF742308B01F8ABF13E7F9DF82298FE454C1F709387B6F23C306 | |
3347 | 61FD8651CA2F51C5F28786D6766B4339928115601BB265F6895712C39D4EB75E | |
3348 | 1E1EBE9BD2E808299CAD5092397B7AFC8B386E992AF8A47FB618101925514570 | |
3349 | 2CF7F3D9418ECDF120DE0D9B14BA35A19312BB4C87C9A1862E7AC946AAF7E0DB | |
3350 | 9126282D6813095178325D6F7510550788D387CC3F7936E5BDFC55543FC2AD73 | |
3351 | 0A47BF75CB6B625FE8F087C3E53330DA3EDA69BEB3601FE3223BF111C6235FC6 | |
3352 | 8ACA71E69693779A68F93DB849000C3915225B007E9F1A64211A66634F67247D | |
3353 | CB39A389107705AD40B0EE4D1E1AFB6B6F6E7F1D59D12847F748BAA026367172 | |
3354 | 61FB9E0FF8EAD4609047340623E92C4954683F777B761B09A1B6E06E13977B66 | |
3355 | B7D5B557C9E0682A0E4EB4B04EC5191E68ED14DB179A9E167389023CEBD2F046 | |
3356 | 05B7B10F352B91FBC1D499BC63A8B63A782692732DD2C49C0532E0D98BF9B5B9 | |
3357 | F1EDF5A5E00EA42DF50F9FF5700FA06DE26B5EFDBD15375BFB87068ABFD6101E | |
3358 | 4DCFB11A4F6CE0A126B1AF08A0DD21B487FCE447DB919FB215BF614D5027E67C | |
3359 | CBDD8B631B0755EF9B2F6E261D4EE7D892285D1579F3027F9B04BCB1DB28A8E3 | |
3360 | BB0E83592AB3BF25CB92A3BA038A91C5854402DD5C47E1F535750D1090DEE1BB | |
3361 | A5AB0785C67806FE7A4D1C7DA3A8D40E5F8EECD2DB7F5221ECC3AAE50BC607A5 | |
3362 | 6B91C718E2092102B2958EEE11B3FAA96868D425513142D1C374886E63A705EE | |
3363 | 6D996AE31AC5F89456AD296DD490CA6E63BA98B78E4E9FC2AB540F27D47BAA6D | |
3364 | C8BA9D2F10FB380F3C37575FDCAFC69F42E83301FCFA1DC31DEE29087614B306 | |
3365 | F158970D92374D7435EF08EFB3B32BECBC3C6C9FBD42951801B86C715A7FB306 | |
3366 | 65B90CFF9FDE5AA20F20BC8DA696E5FE7214E98F39D2EE60185F926027A6CD5B | |
3367 | 960579744D143C1A7BC8BDF10C70003858B2A6EE72F854CD35ECCEC8E92BD664 | |
3368 | F9734FEBD981C41DAA2A42AE83697E3B030C9E2C6C3969293D324A7D68274044 | |
3369 | 487004C3F6FAC5B64BA149DF711EDF2F17881864AEDE3E1E4C3147BB3DDB4ED0 | |
3370 | 2F79305B402E76F974CD56CB04A4B562DFF36B40DBED2F35D38DBCA5CE8DDD12 | |
3371 | 70C28A19C891D126927DAAECF16B2DF41802882956716BDBB442E9F062DAF65F | |
3372 | 6E3808CF58F9A4912209644195F04B4A5B209314017E96A700903AF6F4A8E8EA | |
3373 | 6CE36F67EA9139F816CC75A806C3585BBFD882F14028770670FEA22F34358E0D | |
3374 | CD9626705BEDEB3A0965697647220C1962FCE67D0D3E2B9FC5DA3C3861F84209 | |
3375 | C56B90CC792B95076CD73D35974433DF6567FCE72A24162B434208A79117055E | |
3376 | 53BE3CDCA527E33638F940BED805EE57A3526186F80ADC5B6ACAEE25E2081A63 | |
3377 | 3E6D985A8A6256F923B971E34BDA04D21EA99D34095AB201BF44B62258B19ECC | |
3378 | 45149754F896F64FBBBA939E41A11082C307165C5EA32F7C8CDEB80851B5219B | |
3379 | 7A680F7A8D02C9BAB72FE3B941E324F554E34F5DD5E4936250A82DB846F5966B | |
3380 | 779F29A9A4E53BCEA49CB4C6CC7D0034515E9F7B357B6AFC0FCC6FCDA1A34B5B | |
3381 | 103062647367EB77762F6B47773264536E40536C5DB2985C3048969F9D6C698A | |
3382 | EEB959112EC964BDB8DC3C6F307477C2615BB536C03E9C9B346A7916D1C69C0E | |
3383 | 116DD955FEE0B8F6A0B476DDF245B7C901473A96C2C53DFB5BF4833F984F4D42 | |
3384 | C06B6751BFA6D96E9493139AEE7BE7839B8CB2290735C80542C40D266283CF68 | |
3385 | 4DE60FABB54F29A930357CD2AAA60F5E85D1E674610F2E7C280401061AD47B55 | |
3386 | 5A1EA0B0196423DD4DC994CD41094818332B99FC9218B2D628E86983DBC5B842 | |
3387 | AEDB7362D479C940452A947973C8BCCD46588808F0F9FFC55EF2D75C1C075BF7 | |
3388 | FE6C21DF51E5F6B00D807B033ACD1C7C6A8B3CCB7332E5ADC93433422095C0C3 | |
3389 | 8CBDC619DC8EAC0382428C88443B16ED0DF49CD042D38082CDA4DFB035CE50C3 | |
3390 | 9271344F46D3765ACA3E1B2942215F559EF1E308DBC2AF0659DC980F5DCEC6DA | |
3391 | B33D596CB3F26EDD5A11D6647DB7AC5AC4FD41B62BC353356CD12DA5FC6EC2ED | |
3392 | 86DB312ED5C8323E1C766A0108ECE43C11D2BA0A63F1BE2B0A9D40EB995647C1 | |
3393 | 82D5C9FC55169F50121ECA94D1953CFBF9F38B1FE0C7DD8B786902A841F24A23 | |
3394 | B8762B929FB5AF021414A5321C7288BCA19A240EE15D106043DA19354C4EE1B2 | |
3395 | 434A967968C29B9125BE84A907D22B0BC2A2CD09AED00F3CC3C5C7C9AE7C906A | |
3396 | 7050756D4E67E11F2F2C14DE59A92C013849CAD0A1B6CD32C0CEAD2A4B20AD3E | |
3397 | ACF8CE2AA125F1EE154B79690659E1B90563E3884B47699AE1F7A71579C3C4CD | |
3398 | B66E6FA9BF98769452C5A2BD8B54112351F05BB77D3D3E3EE9250953BBA94EC9 | |
3399 | C0DAF20B0606C3CFCE4815A876F9CAB8A9A2E5662F7764050A0F5A7852B9AE4B | |
3400 | 5799C95B8718D481452AB4262A843E01CCE943DBB8377B7052FB397600962A01 | |
3401 | 25E5FA112149DF197FD9C8F16BE5819096B87CB3555969026B8A5F4FCDBF3171 | |
3402 | BB1D5F36E7CF89D94457F4CFFFECFD8BB3E009655D799C4F262FBEF937E5107A | |
3403 | 511677585FE4D4560C34F03183E6293EC2BDECF5DB400CD1A29BA1678083CBDF | |
3404 | EAFE8D078B72B42BC1CEF9FB5FAB5B2EAA044F5E98D99D9B907A3FE4E1BD4E0A | |
3405 | 2B845C58D7D0119C323AAC85463968D97A651A087DF3B6866EE0D09BA5583D8A | |
3406 | 8DB9837B487DF5FA27624BE3C7F17E6C734D294A1D200D971EAECF983A0A2378 | |
3407 | BC2FF6B206A5121EC01229C14E0C22CFE7371AE1007ED8F556B54347ED545D05 | |
3408 | EB488D7DBD5F668F45986703122FFF97A19523731B7D3CDFF8FE45ECCF2B91A2 | |
3409 | 0907AB03E8698E0E3F6D846A4417B9F66703DEC16AB8DE158431D3424BF6462A | |
3410 | 70085CD88F8BD3DF2023F0738FA6E3F36E752DBE7590F6BBFE1BA8092CB69B54 | |
3411 | BA30D871F6200BB9CEAAD3D6A5AD721FD4A48D002BDFD8E339483D6E32ABE379 | |
3412 | 914BE6B673F6FF3CC20BB2A971184433A714E802CBAFE2C85DD5F0E29B5F9459 | |
3413 | 16AFA7D594B373139006786FB5B8594D50C91217D49ECE8E684C292946D79658 | |
3414 | A9BC010ACED5F757796BB9C32F98409ECA6511351E340C2C9E3CE2AC1007A52E | |
3415 | 95E6DA9F56E11D4B0586F88A149FA8A2BE78DD25F89BF504A99140A7453E4C3B | |
3416 | EC9F94B300E4F6AB24C4528E029DBC0C61E116BDA8F0AE3108E3269A76927509 | |
3417 | 95B41AAF17DB3759D04E9F0E7CA4863A9A771A49293B1EE6CB38E33A125342D0 | |
3418 | 6C63AB27F308D08F60F4DEB8C0A335B115D25683F8AFF549598A3B1E88BBCBFB | |
3419 | 7C418723054B346E748DB987ADF0EB40FD0B8FAAFE5871EDDF9D68821C8C9643 | |
3420 | 7A3EF4FD3BDE591022C83EECE829BE8189C6D819708103BB96A29CD107F416FE | |
3421 | 3230C3E7E358722AFD9469FFF2C7FD9DEC35BE527B99BAFF00C799B99080BE0E | |
3422 | C88272197BFDEE472E29D1A197083F1BF10324E834C9D76190223E095487AB37 | |
3423 | 50BB4FC92179754DD1138F9A55269137543FDE3173BB57BF3E5A2C42F5C58536 | |
3424 | BF4FE748D9033B0E319E3061A7044883A795BFF107E9C12F2449197FD29A2BD4 | |
3425 | C5B7DBC42C28596D43CA57E4184250213D3EE5D447A0D8023E2BDCA6B095DAB2 | |
3426 | 3094B07797FA4AD49A4BC874F462D46F9DB4A21773BA0181B3482CF9235D9C78 | |
3427 | B967B280FF82EF3938F51211D5822F527127A5B4D7D643A443581EC8599C62A9 | |
3428 | A91D57B358D8787A39DFC4AD363869F6002E1EE878EC3573521ABBA11B6FAA80 | |
3429 | 2F73E889DE675B42463A8488C72AF383482D6509F49786ADA521F76D93C4A91B | |
3430 | 7A5B23417305F5F89FB34261C2FF16B3BF983B19DBAB9BB6B1A2EBA3C2AF80C7 | |
3431 | 450248EFADA22E1F8D18CBEE599C8D210498432C47CA067449143710A73DA7C1 | |
3432 | 38C859665D0D88FF0E4ACB573E954655B5DD4B8C7DBE9B8A3B2C4526872CEB80 | |
3433 | 45CB40C3D53F89ACEF33BF54BA05439AB4137D9F6A5F7CC983CC0344216AEE0E | |
3434 | 2BCED1790BF4506A8908E1D7AC441366E9938551A962C6AF4BF5E2E6B706CB0D | |
3435 | 8572EC4AC8CA0714A5EF6D4861932F42509F217477AC1547A3F96CCD15787A6B | |
3436 | B7DFFA17B0F44E83A08486E779A1E36B7748B17F2D09FE6D7717E1CD3E306004 | |
3437 | F69F2EE47DD0A9FEDA1D43558C8217FC810C109B8E55446B6F151D44C08FC996 | |
3438 | 63530C24C7F0B8A59AE9FB7ECD212902BD8E4115A6F6411266A57CA3F7532E2F | |
3439 | C631F18FAAEE1F1B7224B598AC585A4279155501B1BE29E06893A8C56DE80D66 | |
3440 | 4D5586C74C54B88D1B61602D44CAC618E21F447A3A17123F9032AE7B7854C08E | |
3441 | E63B5335540A7F4B36DCD11A47FC8E672E8EDBD9BE813702927FA8B0E0715943 | |
3442 | E1AD81AFDA2350A8D9C05295A208EAB36592672ED05E16C4D9392B3CDC1EAC2C | |
3443 | 526F600BACC7C2F6E0AD1283259B1388E83880DF85DC9790DCED3EE2CB06245C | |
3444 | 3FA795567CF8F6E63059D974D5E2DA8B5262CBEAE15984ED2D6FBE0C5580CD20 | |
3445 | 05640AC7C4D28C5692D3F814A1A90A7BA2633A68A7A9752AE74761AD428B19DB | |
3446 | 79133438C8E0CACA1624A5780A14DF07A74003E6EF75F75662EF6E817223BACB | |
3447 | 0B0B47C05B22016F6EC2E518EA8AF4DA0BDC4B02EBBA5D746CCD8F698E5F25CC | |
3448 | 47184CA13E1670BC214C44C27A70CE6DFBFA31B6C82B015C1A4F64F2C767960D | |
3449 | E2E40BC61F84B19C6F874381488053602966F43AE5058C0FAD7FCD563D01DC11 | |
3450 | 09C7252BD1FC94D7975F72047395F685A7FABA083130F64B8DEA9029F14C6AC6 | |
3451 | 874B97B05248E3D6A435711263526F395BA49D30A21D4AE548141E399FBAB5B1 | |
3452 | 6EE081015FE3C5663CCC484B8B4183EFB92E69EFFDD7F01F518569E03A72C4FB | |
3453 | 6772A0644FA922FC56B0B99B1F35832A11D929CAEC8280793D062109E3BC57B9 | |
3454 | 43E01331FCA8548A573FEB914F916BE1D06D2561296972C28F6AB92BD7C739FB | |
3455 | B1D5251FC46E2ACA742585DA6C13ABF373F66B51B45B44DB1471220A3C5AC33D | |
3456 | B1CBEA5B541B8C1AAEE38ED30735CB1C12D02DF0F6770979AE08BA566887CFF7 | |
3457 | 54C4AF9ACC382793D4BF251D09A088691EDF51E72BD9BF9F2455A8380D40723B | |
3458 | 1D90B78C210ED9972BA6BEAD25A7B240219C012E3757353802DA6183C365F51D | |
3459 | D94C2C57373A44EC5C422D3959C140BD87F1271405B33BB9747A78E5460A96DE | |
3460 | 2C1E98D4B4FD3A15E10989FAFBBA5C57644D6206CDB81493667B3E4FD684F3F5 | |
3461 | 8FAEC6F36B47625DAC46AF37D9A04536EB5D64B84D17FA194BA862BADF76E107 | |
3462 | 548B078BD5DEAFEC764E789E6CC8E78039801CC4716FFF5E7857B0FA3BC31CA7 | |
3463 | E1AB37C519A9EFC58DD1D3926226A3AB147EEDF10D63CBCDAF2DE66E4356711D | |
3464 | EFB9601764562A81D21D943A01AAA3D814DA167531C164BDE763F6E3D619FE40 | |
3465 | 4705A2A03672929945500B4D11F01ECB2B09CED1927029D49A9ABC19B23463EB | |
3466 | 0FAB85297CE11F97C1D560C5CFD27691E39FAAA95B468A502988BA484664EF88 | |
3467 | 2630187E829EAFC67146942DAFE5DD566A72FD6BF32B33F27B383ABF99F9E438 | |
3468 | C30F7CF8513F209A6B4E76F16BEA603005E8F71C817BA98D25B415B930988A1D | |
3469 | 4EFC4CC7BA7801869D53863261CCAF234BBC398FFC8D7F736F231E77DC9C0EA3 | |
3470 | 1AA359D0A1962649825F59DBBA3B5975D70B2D6FBEE024FEBB2908E47858568D | |
3471 | 4BF000D59D21F549FBC46726878B0123BC5F2450F60B092AB46065DDC9BB7D41 | |
3472 | 8E3CDB9982369E2CED9B88B58D47A94A108324E6BC009395CB656230FD9C5EC3 | |
3473 | 8631D1F70F5B29CBABA91706687A4EC238AADFD7BC3B43166134AC044E72007B | |
3474 | 8BB28A578560F256B2C9F818D948CD3CB57E351BA8F34834C164F3AF6F544B64 | |
3475 | 0DA5FF8D23E70669BE37DDD66EDD81132EE4AC92607D6309C5CDFC6D800FA012 | |
3476 | BEDEF9E53F5F3DE3B0955FF6D7F6AFAF7C5026F2B989F8103E4FD2E39176E5C7 | |
3477 | A50333B89EC266B1C39E2534EA4AB75B62B90962065D26D8958DE43A879FB0A6 | |
3478 | 316D86559080C6048BF798AAB878E578673FF67A92741F60CADD40265C658184 | |
3479 | A42E9B85997CC8BB4696F50CB08AA5F0F1A658041F6C32A0859B99E9B41A0141 | |
3480 | E9EC90FDA5A358995A7FE0F8E7D5B74F1CEE7C6EE8272B35BD242B5219AC103B | |
3481 | CDD20FB4F83F7BC30E2D0DC150B036CEB93C92908D53C6FD6D2D5BE1A1EB1596 | |
3482 | CD9374A4F388507EB1624048C79366F13C1319E410B9EEF4F33C5BC5BA7392CE | |
3483 | 852B8F2F649AF0781AD969BA91CE623BAAE3A45626D4A6D98F210C30C60DFB30 | |
3484 | 72C19559C54ECD9FBE406551B0B3C8B1833A8834E1BFECD87A20D90B25F4859A | |
3485 | 3A7A21054BD82BD20A3E2112F447ADAD7BDE83EE87ED04683DAB283627AEC13E | |
3486 | 450DA15C25855BC4ADA345C1D92CB5880AD4466DDA84568FF703A824A8EE8E29 | |
3487 | F0E221661D6BCF20BF046F80C044A860A2925E96063CCE02D044DAA35923E5FF | |
3488 | 6DAEFA7845ECDA7EB4D3145F0436EB4850AB3A65120C32BD2AFAFF65518A7529 | |
3489 | AF8B2E8F5DB78B7F789ED6144D3EE5588A64DC1709E64C69B3907A8B4872AAC2 | |
3490 | 896172C0119889060CFC265751C8A781208282157BA8F925BFDFE72E4AE0BB4C | |
3491 | D472F838F9FD40E229A3B36F18D96C99FE8D88CA44BD2702C5723D7BD75CA5E7 | |
3492 | E606909DC6EF9550DC7866C54E6F08F6993E6AC0E78CA0FDB60DB16AFE9149D9 | |
3493 | CE9E29E6461C1FDCAC59B0CA7814F7CB663BD335998F2B946407D92791AB32CA | |
3494 | BC3FAF02A19178205981B654FBC761D3316337936BB9C02F4435E9FF33A93228 | |
3495 | CDCB3DBD347E15779CEB58473E78A5AF2F234F2FF350FF5F2589FD2A3F38EA2A | |
3496 | 0411507AE1ED51B550AD45D561344D3A6470C9449E25522F261E9F861A87F272 | |
3497 | 250144D4A7FF42EFE2F53F262B4D50A9296958A5FCCAB2A72192C87AA4D7163E | |
3498 | F5C23005FB2BFDDBB7696A39A987822C4D71A1BCFFF58FCE32435CE6580DC9FF | |
3499 | F02B40A04772837D1C090B31D98E73E79D6E63D973AF32C762643D50575E99B2 | |
3500 | D2944583F89A5C23DB7BC78F34E2A23079DFE9CE9E9AD70C5EA9AC910B721861 | |
3501 | 9CD2CF56C2E9F92311D2F4319C4E55411BCE3D593188E4324A653B730C2435DA | |
3502 | 3D2839B68C3919AF4DFE343C1F1BE951985F50F264253552CC514B6962EA363D | |
3503 | CA92F7AFF2A2F64B14194F69137D3EE3E4854B0BE9E9D9400EF10A9F1B40A01F | |
3504 | 0AB88A7542A3F40A29B012ACD52C644EBE181CD24FBAA9A2687A182BDC142695 | |
3505 | 6013E51C2A8E561A067760B4696EC55E2DF1D6A04CEE65E74A11F712BCB2F8A6 | |
3506 | 9994358EC86660EC04F7DA6C7A133CAB415B034B567F36DC71EDD3DEF8F0802D | |
3507 | 437DC1488532EDEC290E147FC9279F4821F0EA2F5BA6E2A43B64CAF0B1942F33 | |
3508 | 215C18ED620C928F1EA7D0452613927FE3A78377C01542FBA8A397D0C6D6D26B | |
3509 | AEE8F0A3C15AE5CC927CA38E4C0CD2AB9C71B6780E5EE878523177130C291C70 | |
3510 | 75D865FD73B3A875F450331C332ED0205F74355A07C528AA047568789CE16005 | |
3511 | A3CDB32578707DFABCA888B476BDB2FBC69425F9157AE29C0E807B4D996DA7E0 | |
3512 | 75C8F714F2EF2803C456E2EE318F6111C286CC7305D2C1E270643BAD7587DC7D | |
3513 | 4030E32069D4CB84C8F07D0DF1E492E4F4C9AC6C71ADC174925CECA25FE6878C | |
3514 | 4C2BD2D4E3A3CFF16E0FCD8C308B759C2A4FEEDF484BEB0F5BB9B7895DC641D2 | |
3515 | 922631FD2E23257128523B31B369AEC4D3A63E3AB3DBE2F649BA1C2E4BB4F8FA | |
3516 | 7CC579D3C6FBF2B045EAEC3E5522802DF1E107179B98CDB9F0A9D400CC5DC89C | |
3517 | 561A93455644ECF841E34C28FD690062504AEF2D5E09E9E84230E93B56B741D1 | |
3518 | 1AC88BDB4E77B90D49DAFF1333758F9E72CC153F4F1823407E9EA929067E180B | |
3519 | 989D5B459D867D3B242CECABDA3439BA08BE3F96155B62E3323FFD874DB7897B | |
3520 | CC139739546D83739C5C1665F6CCD89F74CB7C07138891E23DACABD4B67AD04A | |
3521 | 1DA2D547378B8E77D1D6CF3A89295BC499F383FEE55EA8359544EF60ACF1F750 | |
3522 | 1C607FFAA1AA10A361DDDE23B2858E77C71F0FD2D47ECDE5E77CEE1DA878A8B1 | |
3523 | 40211679D7691011B81246ACFF2B487F106FEFF52E79B7B7B05442D846FA7381 | |
3524 | 98E1EE04940FD3446A516B47C815943870C9CA9C1B1BDA2894AD89DEA6E1B96E | |
3525 | 60C94BE49C89A0FC4B009AEAA8B9E658798B79AB404EB06515D23D0C83465473 | |
3526 | 4833AFB6B56761858EDBC5E125891D58DE477CD512943AEFCFCCA741D39CFA02 | |
3527 | E0CBD9045ED5FAF2580C39A1102196A85E1CBC67A1C56A7CDFA12BE2AD351D9F | |
3528 | 37D4783CD6A8B0EA717B5FE28D7B39000712E37E622A821D040AC927726402E3 | |
3529 | 63345131FE928E3147B83D619DA8F212E144B19EDA829C7F6CBDE636F76ABEB7 | |
3530 | 82658AE7276C2F8BEFD02188598DC592E05666984DA2BC8C9F3549E96DF45D44 | |
3531 | 9FC713AF972127020E99F95AF3904EAA898F4B67D19BA296AA36FBC14C4DC5AB | |
3532 | C88DCCE567002214C7518098D015FA37AF02BEA5D9F5845FE3FF9037C15EBC79 | |
3533 | 4CDCB7D79129ACBFD2573A884EDEAF3939E2D3D6967F1A0117A0DC6C8597FD47 | |
3534 | 01813A0B01D60D7709BC55D5DDFCB08F53B441D7EEC6544FF96638CF1ED431EC | |
3535 | 794A0E716F63233C0D80E8B4123F30E632AD427857EF57A6CF6A106F5382EF74 | |
3536 | F9088615AF05E3362609E86DC9CB58CD2F709F8196FB61FB4F82F9B1F0792B09 | |
3537 | D6AD2F194A9353F60EDE331B84B7704F0C797415FAC6F5DBD56D39B44A45D1DE | |
3538 | B6A2319784AF1B2A9573DB75B573926AFC074627FAA9E8B4BF773A802896CC96 | |
3539 | 65B535DDA172851A2F052934E7D7D593D3E2644444F7C635179D00536099420E | |
3540 | CC56526A9FBCA1B2DDFC48D479DD9A928197AE138735926D72737FE8EF7D1B21 | |
3541 | 6425B94AF20B5EE8BC00FD87705DB8DF11ADF16715177FE917C2AAE6DC1CE5EC | |
3542 | EBFA2BBC044398B8F85DF05D50BA8A53E97F44D6CCE9690F901A50B844416408 | |
3543 | 91F0DA30C55BC25008122D9A08EE92A8C84F6CEACF40591E4320A114E2B62F15 | |
3544 | 92971E5DD0613D6D323245F1DE0C5397802E88C79D9C8C7719F4A13902828BDB | |
3545 | 34D6E8D8B68BEEF5A4AB6A4DFCD93AF6ACE8C60A16A593474CB17982F611D6B1 | |
3546 | 3294A28699B8E8E73C27C68910AB90B2CC147944323A5F339A5844B674AD75EE | |
3547 | 7BA8094D3BFA4FBE6D1EFBBF7603607E38B920BF9CE43E418452E4D61A6D28C1 | |
3548 | F91CC04699210332A1555931106ECB43AC1FE2D08882F0E9180E5924C0335693 | |
3549 | AA13697E9F7F1091D71360D373661CBAA631992B3B2627DA5340DC655F712572 | |
3550 | FD675340127A1CBEFE3656AB4009BCD1BAE64048275146C32E79F031EEC428A2 | |
3551 | 0B786601B1B44D5BF9E464CAF224E5636B0D2D83EF07E81A545EE9A5F9A531D2 | |
3552 | 064EC94A90714E13760440450A6ACF3DD244C32A9ED0A65C546BA46C27FD7801 | |
3553 | C94F5C0735A1E9E6934D30AD680799FB3A761896C9E1F1BC0422CEEDDE021770 | |
3554 | 1837B9A79B0F8775340CE0C2A18E260F6C471E98A3C6E4AC73A148CAB6EFAB3C | |
3555 | E50F14240785645FEE335349C9B8D59B99FD884EA4A1C878A5AB6934511DA544 | |
3556 | 7D009675FD5B62F999ED528C3B70D337A7D93D4D14522D1270B5C345B5ADE5ED | |
3557 | 518AB80590221630B0E66A85B1DC67A6CDC6B3694F8EE53BF90223FD68ACF7D9 | |
3558 | A4106D543E16EA756EC3CF9C96FAD7E45A8966B8BBBD5B1E5E9509F2DDA57EC1 | |
3559 | AB2B457D495F9C8452376C11C649FE4015844D876967666AF9824AE5E3ED033C | |
3560 | D3DE8808897B223FB36CC42BF7867775B8B97610CAD61760B48C7F3F2DE23908 | |
3561 | 035EA9A89551B4AC734DEFF55D121AA9D365BFE4C621AC78344A11360E042213 | |
3562 | EE8F7EB0EEC8BEC6C9294D22467B5D6DB1A0B0E03F371E1AE162C5DD46DD127F | |
3563 | F8F75142EA07F5F5E3B4848E9F4B884F0257D4FCBA87797839A716CAAF03EE52 | |
3564 | FF4479EB9FA912146C609AD0784C7EBC41CD480FB7B3CBA7D5BB91BEBA43B5BC | |
3565 | AA5E4A9CEDB68B34B4EF7A15AE58EEBD677D7D2ACB6570A569F79AA9F8C08334 | |
3566 | 2575F0AD37AD980DECA14BD61D6D0F38DA4C8F5E4350778BE866AB63AA8260F0 | |
3567 | 3D9105FD3738B1C5417EBC9BE27027718016DAB611E3D06529A5F9C2C0A05371 | |
3568 | 3A7B87144805AE4E317F26B518FAC096F5A9BAA8EA45D77BE19CDD1E352FC955 | |
3569 | 1ADDD93B080C6E95DE94CE3CC6AE60E797B09EB9FF1EA0B5C60822953F8612A5 | |
3570 | 93923E7D7FA07A86AD52B23D3D0B88630B88D6E8C62D009DEF41CC7D95EAC8EB | |
3571 | B26AC8E3DCF0929016378EC4841E1C4F951059105BB7F4D9D827ABA155102A09 | |
3572 | 0242EDC57D050CBB9A0B6C5302B1534EC041093CF0C05C0E30F0B3513F3F5356 | |
3573 | 75E913640AE066B795197E009D880CF19ED6C92FBE4D9CD3C96C88A59F2097E3 | |
3574 | D9F0F923CF7537FC69D5C714DA5E53CBEF307D8BA7FEB8CAF2DC63B9B07D4556 | |
3575 | CF751C7AA7CB1268BEE3591838C5DA625BDD22B4748A2118B7073C7AC7A885A1 | |
3576 | 4996A7900CE4F42B19383E12F0BFBF0862E3A539F952038E1149B57D3B92DD18 | |
3577 | FC33B2AEFF202D53D5212300869B57A104AD5640DDE1A5E3F1240482EA9CC7DD | |
3578 | A63BE8B6DB82A2FBB5DFD31E72A6CED413ABA65C6DD3674A76E547A4CC9C1C5A | |
3579 | 504992A649C7F2AC469A9BCA5E9C84333AA74C686A863A05FB73110E466A34C1 | |
3580 | 3E3AE5E21B912282BEDAE14864E420B05F9E2EE8B1C523B362A4237929BF2D06 | |
3581 | A0D398D91ADCFD021113D4489736B4D8E703D77F2BB92973874EE461E76ECFE3 | |
3582 | D114EEB3F611531FF20CE6310C338C6C426F2CDE535C69E3F14CBFE16F48C7E7 | |
3583 | 7420777D9A175710174DD5E23B2BA6FFEC521907939AD66488857BE8021B385B | |
3584 | D6E1162BFD8BB36174E0D5C238BFD778BA5817BF31B2624429080A5B93AC98E3 | |
3585 | B6C5E9C792F9B1CBA7BBDF63277A28B6891DDCD36D0CF656C4F510C77AA08991 | |
3586 | 0545717C76D2289D77C79DB34F2FF22E29AFB3F5E9B6313A2F582E4DDD2373CE | |
3587 | 6064843D24FBC35B1A08AAD4A9B408541301166DBE585317FF2A8E15C25DA94F | |
3588 | 5A5B9D11F5F0B1A658648C529717151A96623F590FD41908A5CA20CDC0D75D84 | |
3589 | 6DBFD25E5D4739177AF9 | |
37c41ab1 CR |
3590 | 0000000000000000000000000000000000000000000000000000000000000000 |
3591 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3592 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3593 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3594 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3595 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3596 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3597 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3598 | cleartomark | |
45c0f7f8 | 3599 | {restore}if |
37c41ab1 | 3600 | %%EndFont |
c302751c | 3601 | %%BeginFont: CMCSC10 |
45c0f7f8 CR |
3602 | %!PS-AdobeFont-1.0: CMCSC10 003.002 |
3603 | %%Title: CMCSC10 | |
3604 | %Version: 003.002 | |
3605 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
3606 | %%Creator: David M. Jones | |
3607 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
3608 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMCSC10. | |
3609 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
3610 | % This license is in the accompanying file OFL.txt, and is also | |
3611 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
3612 | %%EndComments | |
3613 | FontDirectory/CMCSC10 known{/CMCSC10 findfont dup/UniqueID known{dup | |
3614 | /UniqueID get 5087402 eq exch/FontType get 1 eq and}{pop false}ifelse | |
3615 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 3616 | 11 dict begin |
45c0f7f8 CR |
3617 | /FontType 1 def |
3618 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
3619 | /FontName /CMCSC10 def | |
3620 | /FontBBox {14 -250 1077 750 }readonly def | |
45c0f7f8 CR |
3621 | /PaintType 0 def |
3622 | /FontInfo 10 dict dup begin | |
3623 | /version (003.002) readonly def | |
3624 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMCSC10.) readonly def | |
c302751c CR |
3625 | /FullName (CMCSC10) readonly def |
3626 | /FamilyName (Computer Modern) readonly def | |
3627 | /Weight (Medium) readonly def | |
3628 | /ItalicAngle 0 def | |
3629 | /isFixedPitch false def | |
45c0f7f8 CR |
3630 | /UnderlinePosition -100 def |
3631 | /UnderlineThickness 50 def | |
3632 | /ascent 750 def | |
c302751c | 3633 | end readonly def |
c302751c CR |
3634 | /Encoding 256 array |
3635 | 0 1 255 {1 index exch /.notdef put} for | |
3636 | dup 45 /hyphen put | |
3637 | dup 47 /slash put | |
3638 | dup 50 /two put | |
3639 | dup 97 /a put | |
3640 | dup 98 /b put | |
3641 | dup 99 /c put | |
3642 | dup 100 /d put | |
3643 | dup 101 /e put | |
3644 | dup 102 /f put | |
3645 | dup 103 /g put | |
3646 | dup 105 /i put | |
3647 | dup 108 /l put | |
3648 | dup 109 /m put | |
3649 | dup 110 /n put | |
3650 | dup 111 /o put | |
3651 | dup 112 /p put | |
3652 | dup 114 /r put | |
3653 | dup 115 /s put | |
3654 | dup 117 /u put | |
3655 | dup 120 /x put | |
3656 | readonly def | |
c302751c CR |
3657 | currentdict end |
3658 | currentfile eexec | |
45c0f7f8 CR |
3659 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
3660 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
3661 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
3662 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
3663 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
3664 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
3665 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BB89566A9BDEC70EB4F2 | |
3666 | 048A6EB631F05C014D372103E37FC3FA317EBC9973565A638403DA02E48B7D31 | |
3667 | CFF6C241DC5CDB470561002FF46437C06EF93BC99352DF04393C661FFFBF4BA2 | |
3668 | 0723ABD9B3E9CA9E63BA57EFDBAE684655CBBDBA15ADAE43E1A2C98A3CF060A3 | |
3669 | D16AF8FE3A49B50A24C20EEED716E49AF6013D4D38CD9CC41A91C17E4D04D79D | |
3670 | 567E1EF49110AA9C34464E95D81A730ECEB2C9AF38FBA6B45E253288438B4CB3 | |
3671 | DC75B3A906D4357293BA41E59C35223A6C9CBD6FF5FC90C2D07CBB376C7320FF | |
3672 | 435A6251822BFCBB612CE630EDF826C37E95F541C21B93FCE127591D5E38165E | |
3673 | 2B58A34AAE37712BC58B63FFD70AB80F4F24612CFD2F1466BAAF3CA2BCB45148 | |
3674 | D0DEA0E9B8FBA4C4FF5B8B3CB02E461355051842BD1C94F41066B9B909DB83B1 | |
3675 | DCDCBEF7CD00A43E4C0B8191A29600CA197F0BA227FB8309BB539D2A620BAC70 | |
3676 | 8A1AB2DFA51ADC9873B8E5582DCD3ED154E5D727D1665F99BD89883D69E6CC2F | |
3677 | DB3A57AEB612171A88E22F038461DE03FC357F771675E34E90D4D19B4B36891C | |
3678 | 9D2333960400E97494F4FC4DBCE6A73C34A0409E433BBDC0AAAEBA7D3555066E | |
3679 | 1CFBB4515C8B573C9B9DD12ED5B6ECEBE35AD0DDEA9DB004FC6CB540B5117B49 | |
3680 | 59CABE5FD74C6F5B6482B42C20B5FF0467D1DBD7CED2CC651CA57852B6FBB402 | |
3681 | A6764DB342889132C911CAA713A7F2FDD8A5E849345D6C81025E02F5B8B682BA | |
3682 | 90CC9B467FBC37362436EA6BF8EB62D784B01D5430147945BC09D1F49EE89F2E | |
3683 | 3E2B8E6D439248A56F82F2E03EA5C7A922F2813BE6538A3A423BEBC55B345AFB | |
3684 | 3B3C125306749E137C647D78028AE1FBF3E1A82C260132832A9668F454D39C41 | |
3685 | 736717DED0A99F6B11F005F0E1D07FE84713AAB4C042FDC166AA146D7B5E9198 | |
3686 | E4F485BE5B135EA281FF1C1E616B5AAF02771F58C5840CB5A427FF9794F93E94 | |
3687 | 17FD799C78AED1DC4810BCEF4C6C51D3C1504EA2C6F2B29805B7ECF97B5F637D | |
3688 | FE92E168CB9029E90404CB54FB312FC7AA8A9F2F524C03E61F03B1E31D4F061E | |
3689 | 1677B39D5D30C9FD4673E1723F4AE3CCF38593AD6D7F61E9DF3C010E51F25085 | |
3690 | 35D51105E1464BA146A78D7297D4D310AD91342A0BB942034A3EC0696B467367 | |
3691 | 3E39D202D637E6B14D0EBCA6AD3CF22B07D4CA69C0FCBB6C93782B2F0DFC5AC1 | |
3692 | 5D8A16CB5EDB671A0C1BA9D10F63CEAFCD0E06E42C730C8EF769CCFD57937245 | |
3693 | 658F486036D37E8BDDE5670A212FB488A8753322A5B170C9662750AA958C0BBD | |
3694 | 8E97D8239D2A08B30416504DEEC4E506013E037C91785C674F8A6A44E23FEE6F | |
3695 | CCC00CC5E4D355B0871FDB8ECD64F70EE32449BB5D6F84F8C8AA2D5B1A489BA9 | |
3696 | D7FF2DBAA8D0B84054E93D64D3E77850A3724824914A0F821EEC3D605DD851A7 | |
3697 | 606936B8B9E24D6E932E16C448140FE94DD96C75AECB73850035ED9C04A1D93C | |
3698 | 64B21E7D4657E030483EC5C3554AEF8BE4D0FE5B9743B875340B09E01273DAE8 | |
3699 | F256C50A1A8F2E0417440A8BB0173F59E11523E1CEF2593A4AC5AF2167627B00 | |
3700 | C5EA97D125EB8A4BD4C372877ABF10F5B7B149D73787E0834BFB3084E9508DF7 | |
3701 | 072DD71637019599252059738D4D6BC57A9358E4B14F6AF9C4B31DB8E25C29B3 | |
3702 | 7A15F9953BD73ACDE5F0445A5DC406BB4635FAE51C1D8202AE31730E6F355317 | |
3703 | 1DC197DB0B6177307C60E5D38F4487363EE051B2E609A52BC4D45B14B6558B6B | |
3704 | 5E1618748794B8340752CDBE7756C068975B559615D4CD5A97CE30BAA7B2B1A3 | |
3705 | 2FEF2E055232B24FD8A21BECDE1B6A479A28EC80AE2CD16DB50B30B4A6CFCF06 | |
3706 | 491C7CD5AC29FB964D4846415233947522676DEABDA0D9535F8507D33693930C | |
3707 | B4E4240A02B0CE7EA288516B8A6EF908D7F8BAF9012D052C6AC96D9F8F6ADB07 | |
3708 | 8984F3559C5E7E3022A957982155FC9CD599C74E18328D3AB46F9DD15D1C4C3F | |
3709 | 9B93ADB4489BA02CFCF57DE6270F3AD2F8597BE71786510EF08142F430EE5568 | |
3710 | 4F9DDB792B7C46B6135E341DBBF062FBC50FABA80CD4A384157BAE57CBEA9781 | |
3711 | AA4416323265168AC097DE7E30A0D4750143A4FCE70A863A31876A8FA5327C3E | |
3712 | 36E89589E363AA2B1A6E8B09F5AEB8FFFD0396067173465B6503383DE517A6EA | |
3713 | 88C0FC08578398C2A721E5AEB29F4AC9BC990A50CD87BD35A11F9E81F68E7B85 | |
3714 | 5E5B95A4F9A5D30379EF90D78E1E466DEF867BAEFC4F5ED2C762BFF099C1C2B3 | |
3715 | 5E0DA1C2FB33BE1379413CDDB1EE6BB3A495331F72F2FAEB8152E8AD5FD334A8 | |
3716 | AAB0082A71D5574B618EA8D487B8FAF1B445F3395B1E21224F5492A0E06F5152 | |
3717 | 7726835C900E2E52BE3B7B654183AEDEC68053DD0AF19EF6DBC10B6FC08EC7D0 | |
3718 | CC0E2C8FAF8C9A4C21FB7C34E074BBA4EE64226BEC8C928A784C1BEE35B72EC8 | |
3719 | E9295240B29DDC2539CD118BAC38DB3917D14CD33AB45FE47E827F2A2B193AFF | |
3720 | 53C5396C52CEA4F43F06AC2D08C74CC85D608CBA267175EC31311EE25AB48DD9 | |
3721 | FE811B411AE426C9FC0B6044D1EBF130231623F1566CEA4D1C06D8032FD9808A | |
3722 | 94479C842BC41B675CF6B90113BD681F8D43F51D5016D80EDC11D7640FB950D4 | |
3723 | E709A46184406ED90D0892A4CD9062938A8205697A200DBE1F38EB166EFEA0EC | |
3724 | 4FCB45CDAF82EA103DD6FDD03D146F3E42EDA6496064DB3F4FC1C5280C9E604B | |
3725 | D5EBCA08BF2AAC90156C11EF68137DC76502EBF216F3AF3EE30DD2676D218428 | |
3726 | F41C655093F8B530FCA378B5769F262A6FDB4B66B83F18F050E77227E28D71F4 | |
3727 | 5F4425CB8D51B3DAE872CD86D7804F870BC564A6DA1CA13EDB00D131CE4F6460 | |
3728 | 7021661B99612629DCC20C85CF155EDC5111E015A77B0B82A8FC1EBB374B7EF2 | |
3729 | 361419BA93B857D5C9944BB5B4AEDD86ABCC261542077FE09701C96370168579 | |
3730 | 5F89D5AAA08D700E2643E88C2FB8D1D56D37AAA9744872E7C050B4CE046B47A7 | |
3731 | 83F224FA9FD311C955EFBF173042C8FC66524135F579B1397828870D5C9DC71F | |
3732 | 8615FADE2A1CFAEA90F732B6C266E2F3048FC43EDA7A6B6D98E9DB793CF457B3 | |
3733 | F5877E7A055C92B0246FEA8C72B3B3456F93BF36E2651D32CD614C3AECC0B4BC | |
3734 | F824C8363E593A6458D37408FC5B09883B280005DD24123E2D4B1B85F4113327 | |
3735 | EEDD9186A4AF2CD6439B46C5C168C125CA80F9EE9E68906620EE126CFBF26E15 | |
3736 | B269838A54224EDCFE2A373EB750D4829BFA410DE5F1541E428BB1E024AF496D | |
3737 | F5F1C151F5A645C8622F2EF9088D57A2811868A8A8BFCDBFCE3ACB8463AC35B4 | |
3738 | 8B6F44E1C1232805842F56FA468F81FF37D5D55B81CA56058558544C142EB3BE | |
3739 | 07CFB1F75DECB1E48C14D6AFDD455989AA6FFE8B8DC54F462B3C20E31D270BCE | |
3740 | 8E68E2B43A6625AC7E9792704FAAD6CE8BBE0B341DA7189EBB3E9D5375B27FD4 | |
3741 | 12506D5BCA50AEDC6955E6C3C7BAA84BACAF7ABDF3A270C7734EC3C6EC22793B | |
3742 | E67B0E288F99699D38DA8B79F2D21DD97945FBDDD132A8F0BF947950D3C0B4AA | |
3743 | EB7B2C435AFE54489E1930610311D718AC610C21A644F34CB2D1959B3066F39B | |
3744 | EADEAB5CFC6AF4D191D86B02402B00D1C5262707861C5308730579795EB53207 | |
3745 | A291A27A8B5C4DAE0A87A0C6A260026CA3CB620E1002E066A515D7990F3DEA29 | |
3746 | 0FAC962E0B82B7A6C86B1EDC54007822BAECED673FAAEF88C8109777EB79A53F | |
3747 | AF3C58546974F2F56E70E9B5CB59ACB5C27CB01895557B2D82134D7F02029B24 | |
3748 | 3331621F38E68717F5CB68A8892D0B9C0A8ED4F8BB56E80505170D44C6856128 | |
3749 | 2DED0254ADA4875CF56B4D97372AAE730D4C77A2940DC8C178274DF88A9EE037 | |
3750 | 215C6FE7B9D481EE4DE809B124C0270782411ACCCF89906A8B143D0BA8B2CEDE | |
3751 | E9B90465C3E57A4FD9AD2702323450256ABD09A1F8C26F08480317C08B75B720 | |
3752 | 70A161C99715A35A94DD5C9647ED0F8A5337B774C8E54F9653AC859485A1FED5 | |
3753 | 37B725A7E4BA58711CBCDA6054E34CBD8E9F9460179DA7DBD243D81A1531FDDE | |
3754 | BF2BD425BD9DBE75EAA333B1F5793669A215549A774597E6ADA16D323FE5601A | |
3755 | EDA41092730009A99BF5B5AAE281844A6BF3292D4D4EDE36B4FD8BCAEB6EB72F | |
3756 | AC5D3CD53D0D621CA9EA8D254FDCB2B5161EE9E80B266563F669805A3A15271A | |
3757 | 0753983004A1ECC7FBADF62AFEA4DAB49A178C231759857DB910668BDB07CB3F | |
3758 | 7E8EC24901863088B3231EE3FA563924032C91CA9D68DB398F9BD9AC0C651EC8 | |
3759 | 9051C9F709CD784F3FF5951DECD7E869ACC34B83AECDB011E6594347855EE7F5 | |
3760 | 28811F744A4BD70D4E9077EA7EC19FFCF612689F12B34332857AE41F13E6D16A | |
3761 | 962DB9B6AAAC167B9FBDF0068EA13412F318384134B29F3F0C399F1973A3564E | |
3762 | F9C3C39B5BDD4C98D81A6CB476E565860B50704BD65ABD630A5F1372F2D826F3 | |
3763 | 3AD47C08B8AD3176A170C369EF3CEEB190134006D6135C5B8CCDBE1C11FFF1EC | |
3764 | 3F6D8C46E15C4F5EB9ED9F31A129594D542D40DC3815CD075A0DBB648D868AF5 | |
3765 | 15A05C4BDB28BF23653A3AD96CF6AFC065DCCCB23D5D9A945F8CBB539DD3BFA8 | |
3766 | DB8F1FBF9B6F25B41EB4309995CA3D5D6ABD70CBB4A2F0C6364E5439AD1045FF | |
3767 | 72F6B45A30BD3A548CFAADDCC6C15D46F6D783D3E520215751DC98335A4ED512 | |
3768 | D7D19235CDF911CC69F3CF4365B678EBF3E87C456A4E77339C74930083445588 | |
3769 | 462529C22A96A28C5CE87AFA0C981F26CAED5A1C8DBCDDA612624DBE0373F026 | |
3770 | 465185A4D8C73CCD8D71EE97116F8F7D341B87FD78F9CCB9FBDA2A7799711607 | |
3771 | 6BBA855AE9D5C505870DC85FDFAAA130A351D56AADBFBD6A7D52055E3200F8B7 | |
3772 | 8AE9A00092B55DEA8BDE224B4BA7FD4A191CB1FFC4CB995FEE1AC2883AB69E1A | |
3773 | AFFC09AB5B9AE311A030A5BA05E2213F9BBF016C8FA80689C069314D91274B20 | |
3774 | 53FCC65C7D7B3A7504887525BFFA060304931672A078BCD7F269595686310E34 | |
3775 | E1ECA868899BC402D17EC36CE40D5041D7CEDA77F7764C9D98793F5334F574DF | |
3776 | E93CB10A5E8ADAE95CE63D2339557091B4B4911A4987CF21B7F1DBADBC2DD605 | |
3777 | 8EB72473C1F2EABCC44E0D0339EECB55DA74085606C3F89D57ACFBF5755A5395 | |
3778 | CA8D4BD47E4EE8D8B882D3AB31A1F0C62E74654C7E041E4FF2693A38A9796064 | |
3779 | 46526B0A37E6B5BF8E48E80EDEF81E34DA8F6CC9025936A4D0E6D709D61B7B5C | |
3780 | AB550397117F3F9D2F5A542A64DEA8E1178F7337124D6B56BA92F659AAD694D7 | |
3781 | 391028731E01284BFEA635314A8DA8DF7A34EA3B6B2F8803BE6DCB423A9E8015 | |
3782 | 55EBD90EBAE8A00298B3B6B1C02BA516AF528122C1F2B07EF69F5466C2C36643 | |
3783 | 0D665D6561705509B7582D8301AF3C32E2F3B9433E3E04D62117C7E8A368BDE1 | |
3784 | 0D4DAA1C415B2A6573116D2A169AFEF700A83F55D88813585E89C94C07802BA8 | |
3785 | 3AE8F9BC3CDBFD9C2E35D062B1FD6E79E1EF104FC70B0AB09D12CA027F33F85A | |
3786 | 22F0ECBB4AD55FE8C616B82C46CE69A600E4F767BD7A9C5F9B37A3196B038384 | |
3787 | 5DEF76A8884425FE598A63AEB19FA698C2AF7CAA4983CEC789268E22BA051EE0 | |
3788 | 20A40633D22D8F707626ED30E8273EAAD1C065F0B2E1718B5AC853ABE09330C3 | |
3789 | B0082A71D557169BC1559B6D285A3499D41C4CCF1F74884EC3917EB9C574371E | |
3790 | AFE8578DDCA459B8D22C0188A8D150437B05FB92022C95EB6FBCC954216B5FED | |
3791 | CBC7C90B9A1F061376A9840FB64390A6BA99CFC8279A86A730C6DBFD14C53C4B | |
3792 | 7277D676BD42203677E9ABEEC8C97E13DAA626474513B06F8734DD784F2FBBB9 | |
3793 | B3B448B8E8221E380AB4A86D3A683B86A54129519D50DD4FE63B30954D805CED | |
3794 | A9A5D9A39C58B65B08E1C19555E927C6DBF7FD07252B2B57F62B905D6B488201 | |
3795 | 213D106A41033B26FFBAC2E616DA6ADA6D560BADF10E68872806CFD6F6E19D7B | |
3796 | 57CF1F7A030A7BAD374F16A977E0ECB8742D034ADAF9C247DA19C8AEA74EF6CE | |
3797 | DAFD6B1DC562FD3B77E4D008BDE4D8C7FCA9895DA1AC9EAA01C32A0DA712B082 | |
3798 | 9438E77230D38FC4153E1711417B918BA6CC03203A5FF082AF880F48518D8271 | |
3799 | C1121E4F1386B30A7F1BC6F10EA98443F8A65C867A109336B808BC9A8E2A75AC | |
3800 | F950835AA84B56F59DA4C8A18859C3B68F6B6DE09A6675F639EA9107BDB67B0F | |
3801 | 54EBC564BC2D781B61C14363A54956BA78A2BB89C9F966C94EEFC29EE9F4E23E | |
3802 | C0BF750144DC289F0DEE1F8A25BB52E54F656FAFEE4BD2DA57E1306BBE648051 | |
3803 | 1D0CFD6A23A3DF082E3CF13197BF1B7FB22B2CD427BB78F455C9634DF989DC90 | |
3804 | 7BB2AE247B1C99AB2062855B2948341B0F857ACD750B59E370A6698C6A1F5287 | |
3805 | 72A4A9628A592E313956C242DF8277EDD2F1FDFB07CDC104275FFBF796D7518A | |
3806 | DF49FF3CDEC3BDFF1D290C382F244DF18005ECDABF0C5C2C64EEC4383E2E07DC | |
3807 | 5C82587C071E59B46B7BEF31D268F39D9B12D534344FBA515E9DE8F166FAD1E2 | |
3808 | 7D1558967AAAD3829D3F7EC6938D20E5379F414532976ABA844D97A5E9078901 | |
3809 | EAE4D0ED1F4C7EE7A2D80D891A5013D6409A38ACFA497F5A169EB7F9F4890DC4 | |
3810 | 62FA6A89EA48267331F086992B9CA9305E16611E6AEE67DCDD588A25D37F45B1 | |
3811 | 0DE75C802EE021E574B64B3969DE2E5061ED9364B646C38D4BBA86802CA6338A | |
3812 | 94E135D2256920EBFB1AA22D9E90C7D16853F0DF9F2D942748EE540E4FCE63C6 | |
3813 | 5380D7AB4ADD6CB00FE8F7867E4862D8DB432F28331428CC350CDF7F447A65ED | |
3814 | D7683ECA35A22ADD06E9FE6BAF060913AEEE7B2B8EE4798E437698CC9EB2428E | |
3815 | 74CE73F84D0D2292DE709D71FFF8901C3505370E6F1D4E28E6B7372492C65A88 | |
3816 | 159371B1D60D77CEC93B272B6C5394EE1D2EF9969DB2838B8E128553879A1BA5 | |
3817 | 2884B0A596E8FC3D1E648B7E26A4AC57DF09B9CE09B2F91D8CA618CA52AB3DBD | |
3818 | D005A56A420366069B73146A6F58E88BA49671A1AB7C2070C3D42AA770285143 | |
3819 | 40AE7D7868C0E1993506B07C086AD7D4F28CE2D15853FC5FBCBF9425D8012B9E | |
3820 | DB6E1E5002517659C8DA69DCEACA94F368537668843D281FC11782F1C5F71977 | |
3821 | CA215349EE6F20565DE3D8D8212A40E1227A4B22965FA64A0B02C62BFDE97E6F | |
3822 | C3C54FED4057EF9D258C42D7440C78C5E0CC58A40DD74ECED4152F70A93CE71A | |
3823 | 1B3A57C46F74A6D27BF98C97CCD31A8EA487260F224A3E40F52C65490AB4098A | |
3824 | 7B9EEB54A5A415C8C88568F7D9EFE74BBB785FA18AA27D9201F28BBC477A20A5 | |
3825 | D1307AA78EB8C7CAD409AB64B29E4115E45F5FADDCC80CA74B296C4265A40614 | |
3826 | 37F2ACD8386AC0202D6FDB6711E8CB06442F209D781E940ADDD6D881D4F8E874 | |
3827 | 357C533115923B90138FFE31D3577C6AAE60D768970FAAB682CD0DCA3E9A9A68 | |
3828 | 6393E4B772691C1013ADFFC90C508D51B02D2518ADCC7E79F7DE5DF9D18B8435 | |
3829 | 6129064DD1A3995E5A6F45D78287CC10A0EAFBF47223494C5EA934B1BC2F7C53 | |
3830 | 686C5880303F9E3ADC8B100D441D944686E1FD811C646C6DD0224F6CF55FA87F | |
3831 | D132EF50450879A25242A18683BD6D0266F8F333F3768D1952B0F32AA75106D8 | |
3832 | EC0AB703F287E847CB91FFB88CD9DA174B49171822BDE34621CF41EA772230A6 | |
3833 | 3088F8D19CF2364A329162D39E166AC728B15800222E54C40FDA8B73C48CE82B | |
3834 | B2B3E7EF15157FB4510BCDD7EEBBE3FDDF708EA08540D94827AF3EA1B210446C | |
3835 | DEA9EE0EE9B4758863AA33FC296740F0DD9B42A45861516AAE6208F189D8CB8E | |
3836 | BBBDDBCC34B65A7D17B8BE932148C39084A9C71516582BCE25EBF7C1E0D84314 | |
3837 | 45B273AF903055D53313DBD159BB698038A397AEF418B4446739318E8D273642 | |
3838 | 095B1E04CC60718A2DC2BCD99B34202878786A58AE7C2F43D985874AB8A3F204 | |
3839 | 4DBD4B9240EE96F0487CB687830972BF302F262C6381B2C79773EEB152B712E9 | |
3840 | 34E8229E0B59788EB9B9FC1AC1E123751D1FF032610410F0847E6B9B9A575306 | |
3841 | 53FC00ED82D0BDA8EB008F2380FDBA06D2F8C0210A261508BA95DD600436E0BF | |
3842 | 5E8A00CE3C92859961557763D413E79CDD37FDB07131FDC420EF525CC0B5377F | |
3843 | 9772D3876DBFDB57FE6275D187832F2B7A635967B201E70B532E85838ED3874B | |
3844 | 82B36AB9EAB7DD4D2B5C4140419CA04E87316E802CC93DE6336C22FEBE80C3A5 | |
3845 | D43A0F808E5E6A17F7BCF812FF5EE5AC1959E07F36B24C9192E375FCA3C0A84C | |
3846 | 1D1DD2093D4F151B9FEFBA90DB4E94A1D68E49DF5A715A5BE04E7B7D8C384D61 | |
3847 | 5DDD71F057FEF51DE7D002AB3BFE0096C47EB3AAC7B89EEEB9E2F9CFC6BCDFD9 | |
3848 | A438C1097D5253E49DC0DE5B6E8F976AE8894914BF8CAB5236C8A3BB2A437CE6 | |
3849 | 374D96AFC592F1238357817E1F2836EA763A3C0DEA2DD3F7D758BA61307C21F4 | |
3850 | 796A18638504797DD9A5131EC48DB0D23FC9A3E069B2FECA5B36A2260C6FED2E | |
3851 | 6EBDE3AED119EDFA96B837C56202ADF7F7747291A43CDDED6EB7DB5B9373CB78 | |
3852 | F6FA0B92BB2C17AD8DA549E878D8DEA681028539E5E2A223E2F9BA4CA09A6FF4 | |
3853 | EA195F1EAE62CC33F2282888962B9032D1C83EC4EDD832866A472426EBA6080A | |
3854 | 75E02F39CE0421C5C06B9D593022C23D675D7BE879FCE0B20A9CBB394F9D3815 | |
3855 | 9C847518BB8DDBF3A89D699C1FA84E704B02BC85D61ADA5E548CD8DBE269A3E7 | |
3856 | 03626A0FEE75E116F95B5D31C73BC852C5FDCF524542BFD9D05D8EB4B2A114E0 | |
3857 | C2FFCE282CBD87D82C1D4E64772B0492068B139B1795E287899CED7791EF5C8F | |
3858 | E77391C51552FF08DAA85BC8B9896CB5C792C3E1C4D44E3CAC1EAEC02E4B986F | |
3859 | E5059463613DD3643F8DCE2264FA66D712A0DACCF86DDAB315393219F5EBD18E | |
3860 | E220AD61CE3C67664615A5F9734421152382E8EA9CBED8269ACFFC37873BA329 | |
3861 | 20649A6F684D31BF37194952496E8B962B75B83CEDE72F0DAAB761120B710677 | |
3862 | F3AECF2A67F512F7C423B1DA012D0D0D44F009346C4953447950F514731830D1 | |
3863 | 59D01BFF4511CD0257D5ECC2CC4A859E0ED92627F659547C8F137DC0F49F06D6 | |
3864 | 02F624EEBDBC779FBECB1816A88F02B3565A9C3D42E919F755F3D80F6FAB681B | |
3865 | 585B5A49F62581EDE1D1DF1906007A8926932FE74FA2A94B92026DE9D678EA3B | |
3866 | ABC3C2EE5A3757317AD5F5CD361A511F4019CAF77C46C8FFE4615CD6CFDF7F8C | |
3867 | 8CD06F1A2DDBD3BBA03FBBF8DCC898EE71E7D19CDE66971150359310D0BB68B8 | |
3868 | 65F3E41D34C8D063A71C27B6C0F27753A9E35D291477858E5B734D72C40C4573 | |
3869 | 203C5529340CB56BC00EA0E02B3DB54173E6480D29D957E6735146163980F0A8 | |
3870 | CA4086192E6095F411939DD3FF19854F8F58B39A23D3ABA22BEAE05C4B6B6845 | |
3871 | 98968C08559A037DE955F77359FC39249C1149BC4634D10DAABB086A23D9A37A | |
3872 | 73A61EAB63BE3B1A8D8E76ED94E731169E892B469056757EC885D8AC4FF50E5C | |
3873 | 1D80EFE20E40E26006953C53D765B3BCB4C5396646DB3AEF01F939BD163ADD87 | |
3874 | FEB1E55A73722A0866DEC922EFF8B06AFDF2FC742EB1CA422822BB378310A994 | |
3875 | 794062BE62D5BC4D44C25655C902F4FB4FA63CE21E095E4DF3723CFE7D2D961F | |
3876 | 10A715B194ED855942588BDA460A28F1B5D849A34D85756CC8CE874E2384AD9F | |
3877 | 3A1C348996EA94927BCE9715A8B229C0D7FCC2C07592052796D7BAE23DF895DA | |
3878 | 1CF991E912EAC97601FD79F35616A1F23D82647BCB49C360740CF010CA4E8ADF | |
3879 | 97A9CAC032D12919CC167CA4C2E6C60EBB4AB87C8F2BDF71E28E91A9BC96056F | |
3880 | 5D905902AE964E5336CFDACC8C5CFC5607D75CA5F364AB8E9A65FD372BF15FA9 | |
3881 | 0CE1519CD7DBF31F92D2A078754E4BF90F3121F6F698DEC238404EDDD4EEA153 | |
3882 | 0335941E4EB8F08DE0104FD8633BE277E9ED26FC65D28FC1D604D8504B2F788A | |
3883 | 11E2206ACE8AB33D14CE9D4CFC917008D44AFA2B1877C3D42455593889867784 | |
3884 | 7CE696EABDEF95872F065DAFEFAC253F367D47127CE76FCB85BBF0684DD1663C | |
3885 | 876E68EC35B21593A10EA5553311880B8EF744014CD1ACFC067FDFD46978BA23 | |
3886 | C86FBA05CEB66E67621680BEE0ABF82364D4E3235A20033437C6B84A71FB34E6 | |
3887 | F8A160AC477A1302B4F98D00FDDB2A35ED9B315700669D9D8A3D254F786316AF | |
3888 | 882CAC6555A766281A0836CD45D8CD8245CA69729260D54C11DB43032A0FAC0B | |
3889 | 05869ED0A432CEF854FE665BACB0F780C9123B4DA1E1895F8717DDE4A58BD3FD | |
3890 | D214195066D4587463E839EDF667E475BC04EEDAEC41422AC9BC27C238E88318 | |
3891 | 7DFFED5D04AAFB1F63AC651B1A4113B7CE9838ABAF75632EDA8B5EE0C8474678 | |
3892 | 58898AD595ACD99029DC34EB4BADE834C04444941C3D8280B93951A9E8554EF9 | |
3893 | 5F0FAA218DD8224B94807CE2D8DF7E4A5E2B28C44A551DB0708B5D6D5F000B96 | |
3894 | 0422A8E953233296B6E5EA698921F1EEEBDF0C5CC72263663895940B4C1EA28E | |
3895 | E0E3AF21698D5430D6495E32E0D5F5E538EF835FBCF4A96DAD8F011B145584EF | |
3896 | 1C33809372DF602D1FB3D80A4EAB65897F672642E4317926DF178BAB6F9851C7 | |
3897 | 63613B3DB11FF07F9C7582592B620C7767D005D7B0C28AF2D309E6CAC222055F | |
3898 | 2C20A58AC1B407641B483D571B9E959A3AE0DEF316EFF7A4514D5313C47AAFBE | |
3899 | 82CC583BEB32F20E4C3A5650B58812EF357B68F26882D30A6BBEBDE64E2FD910 | |
3900 | AB8D974CE5C968C7D34390529F4714A9F1D2373DB1D912D418225932541FB250 | |
3901 | 9C74346749DE9C5662B1C40437E783A78A283AD6EF43B2C111DEFBEECEB17ED7 | |
3902 | 3630AE404B310F1148C82F4969A794D945CA5E1C18F39BB6F9C46EDC8BC3C88B | |
3903 | FAC2116B2338E1AF9C975ECC8474BCA351E3FDF89ED4352FF6A3D6C7EF7A7BDC | |
3904 | DD4B2DA9E7C77F8A6623B670963D2B9B9A80F8445E17B85194AD45E02FF10484 | |
3905 | 85E0A700BDE9F574487F9494B424646D48999EA67D469A22B9CB72123F31EA5E | |
3906 | 51C07370BFB1C5EDB4ADE75E7111A0116C212920F1362353BF58F33D7E8EE680 | |
3907 | DBF8085B46AFC40ED9FFD7AE756CB267D0F321FDB71F2DD35FBD3003E91E2758 | |
3908 | 3DED65748BE5CD0D2D244E8FA187749FED44ED0C71056AD954FCF656DE28E70B | |
3909 | 93A79EB4D7BD59E92911EC64EA794732A79B9908B7C6DD42C99BDF07AAA06E07 | |
3910 | 5CD6497C489BC56B09E44D22D0FE69521A9BA20ACBFDAB8EE718625711BF479E | |
3911 | 512FEC4A8F9EC7CF66D4CC44E2D0EA1235BF17C3D0AD6859385CECA3D4A640B0 | |
3912 | 762D325D3A449BF7115CE8469A493C494721D6636BCB9C55ACF1D0F3489E5534 | |
3913 | 4A76A8F3E3AD6252D8CBD3EDFDAC890A7B497286241AFE35B2261B66018A1523 | |
3914 | 4B9FD31AE07A6CCA6B91A176BC38BC03F97D71F80270E14B83B012FA5270B7B4 | |
3915 | 73F889DED2D4BFB24536E495F96BDF408E3840AF1567E9960A4F22F0B749749B | |
3916 | C156336BD7F349F2F82CE54B459462CB7C9846CC090E752DCDC871FF0873076E | |
3917 | 8885B0AEF490DB0C9FA98A8FDF84EDFD52AB0F992EEB236A79FB8FB52718EBA6 | |
3918 | E0D586512F81079D468A75336540163B966670B437304F3272CF6E49252662C6 | |
3919 | 419E8B2B14D240A1DB0CF6EF14E024F9D8C6882F865D7E007B46DB65E2E6AB1A | |
3920 | 22C5F096B255E91CABA7C441A3149FFB4E19BA97E5D43779C2A80208E279A91E | |
3921 | 8B8A281C079B819BBB6A5B1A62F34D59B7223D9FBB5F5E96F0D9AFEBD3CE3D57 | |
3922 | A4C4D2345776FCA140EA95242C8AF1EE7B93D2676209B750ABFCFC8CAF50F578 | |
3923 | 4C364CF8BC46839A4379624D56B7B917743E9D6A284E7B315D461ED66B262413 | |
3924 | A9AE1741C633A92061DF92AAF78A18586CDCA41248C586F7D272378F9CA76980 | |
3925 | 202A391CC9FD46794140F06CC75AF2F4986D690939E083CDF9B96D066B1EC8F3 | |
3926 | DE3B68AC8FAB84970B1A199B3F3AA5BE27ED8119F306CC5F26230C16E9D9FB31 | |
3927 | 1EE9D3F5175E4D4D7A8A2945000C37BC73816AEDE6F2AC0F09B788C9988BA69B | |
3928 | 82CF336482F490F05725696EB080E460FC03B3E28C1B3613C8E5FE3DEA048D97 | |
3929 | 4AC72C9955FDE282FA8C8385B30E3A7EFE247B48B370DCB439FA721BED19AF4C | |
3930 | FDC3D3543A25A4E0273419B6CDD7209FB336C1542BA56257E5D31B70529C12D7 | |
3931 | 524617868F4F3B49799322EDF504750D1BAAE307ABC4843704B64ED8AD4996B7 | |
3932 | 5193CEA660390527734BF1448AC09998E70FF15BD70F8B6388B0A987CBC783FC | |
3933 | 990F7A5EA016EBC024F12BC9812C7C4DD6E991DB89415A49D0B265E453732F4D | |
3934 | 2B6BB50E995E719B00DEBE74E7D1E291A739C4EAB39B5A61763DDB65BDA6E1C9 | |
3935 | 17C49BF1A76546BE0EDAAA17310AB2D01BDF059B066263C8FFBDA53281C882DA | |
3936 | E2DA35ECE5B4454C8031DBECD8675B60E54261A7D1F70560C6D8CBAB436EF058 | |
3937 | 5A0189426AF00AD7EB43FBD13976D8D769ED2639ACBF613A308C941CDB5A632F | |
3938 | F76E14224909A8E7E45B9B5A47BDC9B7B3E3616AEC4DEEAF2899A59B6E144802 | |
3939 | 534109EB0E3ECD270E417B2E9CD8D27DE637AC798ED5CCF791061297A0B218A6 | |
3940 | 1188C03BAC8DD8DD783BBBF8C4C9AE98E8F1EFC4684CA4BEE6D533458BB229ED | |
3941 | 4E31392DC4591DF2D2D07632EBEC0A5FA2C4508C1FD48D56EE871EAF4A84AC07 | |
3942 | A1E34CA2CD81ED369043998A23DD01301D41C582963F07EC3417F09ABF45844E | |
3943 | A74F386BA813F0AC462FE268407B9D2A8813FFCA604C342CE82493DAF631B2B3 | |
3944 | B6D3E9F3398761C4B958569F0D833D27973B07F9DA9D84AC512C284844C04866 | |
3945 | 74A325E4ED894F640B8F802097B7C6C4F04BBBC8A7BC6EAECC60EBBF4E676A30 | |
3946 | 4A5D0DE4AB45D0C913CCEEB8032D1946A35928BFB0FD76AE324E7E3CEB5B99C9 | |
3947 | 0A0A6EBAA6F6D8E4292F9C5408D3859CFDEBFC9413032FA1A6E194C5F616A3D6 | |
3948 | FB0FEB8966534CCC9E6D67DFCA105E8994810D8EE414DAFC80B8A95CAFA254CA | |
3949 | CCAA72B84130B5E485529013A35040074072A8A63B2F4384D976BBFA0A743C5A | |
3950 | 0A079A2CD15E598801AD121303CC37A2FD3942776FD1AA0805BED2B646D4D1CD | |
3951 | 9DE65CB859735EDC177C5A4D1A54C3E8BE7A91BCA91AB93A9DACAC90204CC207 | |
3952 | 8432E95B2C47654DA02EC1664566E2137860F16F798E0A1EFFC819F4304B0FE2 | |
3953 | AA54AFE0AF6CC26D417B0CC9E3F5F6B9BD6DDDE6A2D7FC4C840E4AEF73452D16 | |
3954 | 241FF01413DF2125BA3563B3A49EECC8EC4D0BF06283B3C8242F362A546E71B6 | |
3955 | 21F3C6DA63882992A14E295926387D66EA6D9F296455276D4FEF0CDC706FBC25 | |
3956 | 57169AAF546A1BC72114A3A6DC3A1A76CE001962D771C267864A987188BF6087 | |
3957 | 183573E3E9DED10D7023965D29F19C8950B6B9B83E680010995360E54911AAAB | |
3958 | 44D07524518EE59F58E49485E885F56FF2CF8D30FC5779770685C305AEC4262C | |
3959 | B8C0C194C26F5E122DF5E4153316C971460C3B3B336C1B72 | |
c302751c CR |
3960 | 0000000000000000000000000000000000000000000000000000000000000000 |
3961 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3962 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3963 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3964 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3965 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3966 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3967 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3968 | cleartomark | |
45c0f7f8 | 3969 | {restore}if |
c302751c | 3970 | %%EndFont |
037a8b7f CR |
3971 | %%BeginFont: CMTT12 |
3972 | %!PS-AdobeFont-1.0: CMTT12 003.002 | |
3973 | %%Title: CMTT12 | |
3974 | %Version: 003.002 | |
3975 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
3976 | %%Creator: David M. Jones | |
3977 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
3978 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT12. | |
3979 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
3980 | % This license is in the accompanying file OFL.txt, and is also | |
3981 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
3982 | %%EndComments | |
3983 | FontDirectory/CMTT12 known{/CMTT12 findfont dup/UniqueID known{dup | |
3984 | /UniqueID get 5000833 eq exch/FontType get 1 eq and}{pop false}ifelse | |
3985 | {save true}{false}ifelse}{false}ifelse | |
3986 | 11 dict begin | |
3987 | /FontType 1 def | |
3988 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
3989 | /FontName /CMTT12 def | |
3990 | /FontBBox {-1 -234 524 695 }readonly def | |
3991 | /PaintType 0 def | |
3992 | /FontInfo 9 dict dup begin | |
3993 | /version (003.002) readonly def | |
3994 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT12.) readonly def | |
3995 | /FullName (CMTT12) readonly def | |
3996 | /FamilyName (Computer Modern) readonly def | |
3997 | /Weight (Medium) readonly def | |
3998 | /ItalicAngle 0 def | |
3999 | /isFixedPitch true def | |
4000 | /UnderlinePosition -100 def | |
4001 | /UnderlineThickness 50 def | |
4002 | end readonly def | |
4003 | /Encoding 256 array | |
4004 | 0 1 255 {1 index exch /.notdef put} for | |
4005 | dup 45 /hyphen put | |
4006 | dup 103 /g put | |
4007 | dup 104 /h put | |
4008 | dup 105 /i put | |
4009 | dup 108 /l put | |
4010 | dup 110 /n put | |
4011 | dup 111 /o put | |
4012 | dup 115 /s put | |
4013 | readonly def | |
4014 | currentdict end | |
4015 | currentfile eexec | |
4016 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 | |
4017 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
4018 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
4019 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
4020 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
4021 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
4022 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1B57D05DA0555DF933BB0 | |
4023 | 7B42D264831116C06C79335D519461E7B0E870A6715E3D74A08D1BCF86E3BCC3 | |
4024 | A43FC6BAD1C68BD9D4AFCC06D845FD1F1E70D7A47F0BBCAECE8396E04591E5E3 | |
4025 | 4797F646AFEEB7DB548183F0B74C9BB6BA2AA04E7F5950EC8AE97C741D4B2C5C | |
4026 | A8E7A8DF5A36A30B5A7592D95E1DBC63EF33C92FE459792CED29E2B8B6919251 | |
4027 | 75EF62089BD7D44A6E1F9B62EC802FBE62B821DA1C3B2DDED45D27964AD29ED0 | |
4028 | 9FB7868F3A8FEADA87A8E42D52C1EB7229D7C79B60BDA263F2BDB025AE14A507 | |
4029 | 098FA274206BACFB4A0A7257D5998EE8F0FDCA79CB61DD1FC59DADD11E16BF02 | |
4030 | ECDFD706CDA1E72054D4EB55AF7BA9F19955886BC0BD6E0E3FE3769C94AF3581 | |
4031 | DFB2BCD67FE2892AF07E858A01280194D8DD7332B3D0A585C87FAB056C2EAA9B | |
4032 | 5AD48D1C9F00CEF8EF0D1408DBE1C03D04B231D7B8D5D998FE0CD7EE19828EF2 | |
4033 | F988EBF6DDBFEE00F04A4A1F4E1A55DED7EF3AACEAB5005F1962C724A017C914 | |
4034 | 2936E2E0DF26A55ACD7DD836C6035CBF07981C1BCE3615064F0540A1034C69B4 | |
4035 | E3908E76EF8925D486DF0B4A8E1F02D8AA99585A7C31847AB9382F83880C1C21 | |
4036 | C496AB2DF8E7BD4643B28B704B5F6B53429D3EE940A79135F5BF0396E5B46F23 | |
4037 | 42AF406C26D12BEA7A41F332AEB75DF43C15334CF4651A99F602036946B1B91D | |
4038 | 4BB0D2E51C20216D892C8173241AC8FD15A37C3CDD8AB4FB67D8565AFA61C068 | |
4039 | 95E3D6E46D7C09BBD09428207D506AD43C693F3C3D787F6A5C39084AE45E81C9 | |
4040 | 830900DB50DAD10A17E118FB5E9680B5194716A788FF7514A1167DD1A305FBE5 | |
4041 | 5925388A2E95AE46E8806E0F7B954D1A9F70EE29B069A9FEB0349298CE5311BB | |
4042 | CAB039C21AEB714781BBCDBF2FFCBE7C4750D7693ED142ED0475EE9DB5D5F94F | |
4043 | 4D4613E2C379E494464447C4167C625D70B9DBE4756DEF299974B704A3C238DC | |
4044 | FCD3AD96645559ACA5056F7FD695D2AA709960E30F055ADBDCC7FDF641920A9F | |
4045 | A279AAB98424E76D01937F9CFE3CF4E3779650D7C2DC38AB27FB81EB16C19B13 | |
4046 | D47E0AC60C83641CCC1A00136625FE274C6AC706B516CBF14C54000BC2B7BD20 | |
4047 | A28D40FCD6D9B321855BDA608E23BD365208DAB23983C0D8A7C9DDC28ED62216 | |
4048 | 12A20A3068D843B5FA016B8C6B9BBD36356BF85A128F96F0CE861FB9C998BB21 | |
4049 | E8624E3DE453C686D41DA7B72ABD919C5BE2F24440D11962C77742A8C0115A72 | |
4050 | 9E974E71247FCD58318A4347813D4D5A73CF882A7513E2EFE05CE8C7195BDDC7 | |
4051 | DF250B59AD14D02D2991E2D0CF2D0022EF52D78F043D6D7FEEC3E77B6982B1C0 | |
4052 | 8CE51E4D3C8342C08ABD84EFCC8239883D8E66CB0FB0BFE8699155B179CCD63E | |
4053 | 884C502F7F0496A01360C67D7A9BFC8533346485646AF058A743472B3276FB96 | |
4054 | EC4C82188A4A67763ABCE6AF7898C3B924A01118DCE34C77F22E62BB4C4CB561 | |
4055 | 75C93226142D43D5ECB9F43C3A275A52F9E5AE4C9BB9E614082AAEAC5E7453DE | |
4056 | B3F71F9FB747033E227E84E853E75E79771B71495CACE8F911329274CE752AFC | |
4057 | 46C993132BA8CF6B9DA2CFC11A0BD57C9A4BC11B7A6D68A4C346D9768E6A6204 | |
4058 | 4227F51932162DA350878EF80D0F4084C82CC61F3223010D771EBE7DEC1B80CF | |
4059 | 327393AAD4C689BF6A791CA2925878C51069C4F06ABFA42B66860082301FCA71 | |
4060 | EA52BED540116A9B12D9741A4C078F207F92B78923C7965A47A3130CCAEF480F | |
4061 | 6B4AD58077FBECC4F99F53BC1F4F24CF3777182A7ADC32FE3260C774E5244912 | |
4062 | 470697609A0726EECB72390E6C5C5A1204521D45316989E3C0B4D398958D4363 | |
4063 | 3C7A4524B500241161C55C4D8C4CB06034BD825AA2CF2A6895BB9A30BFF00422 | |
4064 | 553E4346A53B271C70DE5D0A5AEB92F81CAC1A0E75E47229AA80C8DB09EE3B19 | |
4065 | 6E9D3EC0E7ECAB7B879C652282A376C52E5BBF5D4BAF051A0A995460B7F427E9 | |
4066 | 521743E74783312E8D7100DE1F31C1C7C85DA33D8D0A626E6E6184DDD538EA7F | |
4067 | 46D50247225E036DB3E6072395C88026D429659DFCFC6416D22A9BE285EEA910 | |
4068 | F7B1B74275B8B043721A829F2D4FE6140E5AFB78F0CFCC27FF27ACE773131462 | |
4069 | 48B271781695D31C909FED024B2F3220C206B63601A1B02DBBE2C5D94D027982 | |
4070 | F9E7EA6D4B0A812D28855CF62D372A040F138069F7C28BE3344262EA72795CAC | |
4071 | 2CC8E21D1A666ABFED384875FD2D098066FF0CD902AD6725AECFE61B2CD83860 | |
4072 | 82E587B8893F5E09B155EBD813030499E534C050D6902E5F8BA296030512ACCE | |
4073 | BF19933ECDDA6DAAA1848686DAC81EC429CA7AB1A73B7DFEC0750B404F601F1E | |
4074 | 6755F07C0784A56E403C5962905E9147E44E8042C3858E4A91F7B8A71143263C | |
4075 | 21DC47E481DF1A38EC4A9F682FE059FE80F257576FEF3A3300A36BC27273152A | |
4076 | 78019783D0BC34AB29353EDAEDF48FF6C5DC27C1633CE1CE2C03509992549B87 | |
4077 | 75AE1100939A6A2F5AA2BC7C534357687DA72129B9C9F2E511BD95452F10DF8C | |
4078 | A698CEE0BCAF726111B63C4838F05AC5B2EB43D04115145CDBF2EDCC1EFAB612 | |
4079 | 5E35EF5CCC5F4296536DC96F1326B86C65DE657BA06E5B97BB7C4F8ED11DF9CD | |
4080 | 969FA4302F06A5D43B48D40D3DE360F6A7B8F329022CF5B13A33980E8BE54325 | |
4081 | 17FE37C9D78E73A74B5734231ADF0594A2E5F2DAD9BCB682A0F5C59507032DE3 | |
4082 | AD0C62E50C258F1F820ADF788D6611CBE6D1988D09D07F8813D6A3EDEBE034C8 | |
4083 | 05F7EDC5DD2E4C15B60FE9284E267C8F7DF53F3CC13C131201DE819049324E53 | |
4084 | 499FE93874A92EF07AD0121B8FDA88F7D60DE52E2B20AF958A77421F221F8B29 | |
4085 | B2188307F484E1832988059E5A68C52AA7E840D805E646F17DFFDCE1A2A8C0B5 | |
4086 | 2CF6F218A06EE1E2543461030E9697624B086FC6619205C04230CC8DADA60721 | |
4087 | F5C4622673ACA45BEABBE3941E7F40080D652567DED98AA3404A4384DA3006A4 | |
4088 | E8A9298AC3FEF04C92A273 | |
4089 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4090 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4091 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4092 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4093 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4094 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4095 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4096 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4097 | cleartomark | |
4098 | {restore}if | |
4099 | %%EndFont | |
6e51e0d0 CR |
4100 | %%BeginFont: SFRM1095 |
4101 | %!FontType1-1.0: SFRM1095 0.3 | |
4102 | %%CreationDate: Wed Sep 12 2001 | |
4103 | % Copyright (c) 2001 Vladimir Volovich <vvv@vsu.ru>. | |
4104 | % See the file COPYING (GNU General Public License) for license conditions. | |
4105 | % Converted from METAFONT EC/TC and LH fonts: | |
4106 | % ecrm1095, tcrm1095, larm1095, lbrm1095, lcrm1095, rxrm1095. | |
4107 | 11 dict begin | |
4108 | /FontInfo 6 dict dup begin | |
4109 | /version (0.3) def | |
4110 | /FullName (Computer Modern Roman) def | |
4111 | /FamilyName (Computer Modern) def | |
4112 | /ItalicAngle 0 def | |
4113 | /isFixedPitch false def | |
4114 | /Weight (Medium) def | |
4115 | end readonly def | |
4116 | /FontName /SFRM1095 def | |
4117 | /Encoding StandardEncoding def | |
4118 | /PaintType 0 def | |
4119 | /FontType 1 def | |
4120 | /FontMatrix [0.001 0 0 0.001 0 0] def | |
4121 | /FontBBox{-188 -320 1445 942}readonly def | |
4122 | currentdict end | |
4123 | currentfile eexec | |
4124 | D9D66F633B846A97B686A97E45A3D0AA052BD0CE60552BD63101D7CDBEEF5B11 | |
4125 | 69C468645FE4ED1AF2541AA0770C1DCF81623DE0ECDF49F2B522618F650CE6CB | |
4126 | CC8C21885DD61AF8A523AA677EAEDDFA51A1F9B1885EEE0456196D634E04EF89 | |
4127 | F17499DAD982502ACC349B9EEAAE4A71A73D1147318C60A8BAC10510DE90D8D3 | |
4128 | F46E47295D27129A5AFE0C65E22BAD10D06885A2EE623FF8E1D90287A083E00C | |
4129 | EF25195F68A2A98170E48759F33528B839DFD4B92DF0482493852D12053A7904 | |
4130 | BF6E144B9488970F220C299E80886366662C1276120E72472BF84082B9EEC729 | |
4131 | F7007ECDC5A850C88810EA679DABE81714004E65D938DA9ABDF29C949A52EF02 | |
4132 | EDA8451563235D51286E9133FFC7A27067DF0332ED614AC2D4FAB88EC84E6CB9 | |
4133 | FAB41C933E84B88097BA8742BC30A81416D1CAA3545F08E2554B28362B99B79E | |
4134 | FC42281922B94604AABAF5F7A9B8E2D9A4358F38F2382EF9544B859D098DF243 | |
4135 | 034CC475CEDEBF0EDD0A60C907127BB32F7D85A62A44E90B4056D9B4B2FF3A49 | |
4136 | 786032C6B25794E2C0003C7852C6B0688351FBFC43300FB0B72880BB7B58BB61 | |
4137 | 3D1064E7D4DDB128A9B38EF7510B7E5F82BDE39489E2D1DF08816781B13836E4 | |
4138 | 89390F84577F31776FE43A5F94F817A4AA4A698AA4AE84B178FCB65F1B5A5CE1 | |
4139 | 334417595F6E40849041565BAA497F6E4B8F4305D849128C9A26A98B909EABE9 | |
4140 | 8F2659189ED27C588ADC7C744712B4D9AD0C5DD25D1233E979DE7F53C5F1C47C | |
4141 | E9DF254086E5EC70EBC6B7E080060BA72F15E6BB75C75011B15B7ABB6BF761DD | |
4142 | 428FF1BD688938C75BEABA7DEE2AF49364D2E198FDC7F8FA2313BBE598ED3703 | |
4143 | 7ECAAA4670BE3A85C693ACA829A5936778BCDCDB38A5981D4CAC8994E2B2F086 | |
4144 | 26D8793AC1393D49A8F2FE391F0EF8899F63CFA5A77BC739C867C6CFB9A226B4 | |
4145 | 620AED34573F068052604331B7E8E1F0C3BC0BD7DF733F056DB8C3F57E3035BB | |
4146 | EC82DF5B511453A952D429AC721A4F94D5C9BA5B83545948643D0596F4C6C9C5 | |
4147 | 796BEC7B26EB9D729F337E0FDFA91E5955585C330D0C4F193FAC870A28CE054C | |
4148 | 8942BDA170717B7AE9927C936DF0076507F55CA2979BADD3EFACC0A599933EB6 | |
4149 | F148BB7C3D61066CCC93A5856D253D759F30E37534743210743F0D53F58D0B45 | |
4150 | 463F053E19A16E5A1B111915D1E664802F8C6C3ACA0F1BFCF3E209D1FD6C79D1 | |
4151 | 5D867E142AD6E69933768274F4E2AB57CC518AD5A1C120887EEDDDF18C291BE7 | |
4152 | B3DB17E8FDB124B11B6142DC60F560DDD668D700614732F3FBAC4637B9F41361 | |
4153 | 54CD2D8757A9D9BEDD1EC72FDAAED3CE4A1144F1E919FDB952BA7CA1E3D31C3E | |
4154 | 9E434E2E44E7A83AE3480EBE89E0881584045E4AA5814897382EEE5FB5C9410C | |
4155 | 2DC7A2136551DE2AA713487A77B911A7E7AEE41F0BEA1FDAC1950473B1394479 | |
4156 | 513741DE60091BFB9751C780D99F2DADD5AD8283DC9CD1C81B902C9F3C9C3EB9 | |
4157 | 55608E09D6DD423540BCF72394A24F81135C9D9063C0F4441BFE0120E03558D3 | |
4158 | 4A16744457EC281AB2A60432C97DEDD16B2F1FF4C1A90D72D46C9F9BE984C6E3 | |
4159 | E239F98B59A938C2A6490889B437CFC21D923572530E41B7567A9C7E2464DB2B | |
4160 | 18FAF3EB7CBFE7BED6E77219C0366A7D54D469CE3FF62E75FCA2ED6A46F3E5C4 | |
4161 | 489992EE1A42C19DA52F0CB2B1A6956BB3F1767B97FDF225685FF7C9E9243497 | |
4162 | 144D31ECF634CABABB79E323CFD483BD7A7B0C2679A9C3DFF0D44F09F084CF3E | |
4163 | 886CBC91C5386A266730CE2AF3863534E2450583F6ABB520C27C4EFEA01EBC8A | |
4164 | F019D25B7BDB40CD6712D7DF2DEBF0BC70A92D3B64D1FDF723DBF3D4AE939E96 | |
4165 | D93646BAAE0BC57BB244AAF47ADE59A5228F057192D917E2BBBF588335E09095 | |
4166 | 1CD4AA406C1D10C8EE6812DA676A8FD166461064BE4150CB95C41FC055FF8FA1 | |
4167 | 89A4BAACB0B978A58EDDDB0CBEBF6566D47CC0AFC93110751B59EA33AB5D6EAB | |
4168 | 0DB9A65CB16A053495F06B0D49A70BA8A7826EB571B8428AFE5EBB99AB9B56C6 | |
4169 | F69DCC77C25BBBB53FF25C5DB5CB8E742E3C0BFC25098B4CAEF12D299C886881 | |
4170 | 0D4EB71D637BC0CD4D63BD6B4F5FEF9B083D95C34FB9E7BC9FCCAC0B9C7D8AB1 | |
4171 | 1816B17AFBFE1DA146662723887E435E17AD2E2315AD800EBEE700B3C12B50EF | |
4172 | 4A48C2839AB4BB367E908F59BB5AB88635C3E1B89948BE9F32EFEDC2E439CC79 | |
4173 | BD9754280477F7C982850438092D309C213D70F8D476728119E8FA03762C22B8 | |
4174 | 89AC2A2A7C0BEBB0C91CAA95BCCDF91AA918766C82A978B7313870327F89107E | |
4175 | 11A44FF02F597C8D4B085F6D7A098233ADADA521CDF34A78081F8965DCA615FB | |
4176 | 55DB12C1E3459E49C273ABD2663B13447365C9C1C52E192282E96049FD58506F | |
4177 | FBC9507DDD77014C29275D1352CD5FC765853E858A5781F2DA41360D32FB5A54 | |
4178 | D04E088FD99F8C01DF740E587AACB0E431E03E170CBDA9FF1FCDE8D9FF5E43A5 | |
4179 | 73166AF5990B238122AB322F709FEF2F0E2FA7C04FBB62C5383997BC9CFAC8EE | |
4180 | 3FAD26E788DB37ECB388CD80A7D861AA9E9199E7BD065BD7A4D21A0D56DA9323 | |
4181 | 2AFAE158CBB662283EA7310D32FB5A54D04E088FD99F8C01DF7535A5156B8344 | |
4182 | F1CCDE84A46AB2CC7F0CFD113074A1C4D90758EE58F61589051A0150121A7BAB | |
4183 | A636171E6814A1398DCB9F13FE9B11ED5A5F2EEAC14E0C831B2540D10BC0EDAE | |
4184 | 833A83965A33180B0AEA361848DF8FE8E50DF6856F1D10C8EE6BB5198CFB7607 | |
4185 | B6B044160CBE8D4CFF067DF3579918B19B9128C2A83512FC0567CF47B38961BD | |
4186 | CC60FB8C6330A30AFEA9B276DA89313D6A83343298F34461B13C382575BE392E | |
4187 | F94E3EA3004D6D37C025DA3F1846E41606DD510D2C7D0BE9DD194E46BE7CAAF7 | |
4188 | A60D496CE85D2393457C50B2D586E010C7C4C7272F496F0CED0084EA956455F6 | |
4189 | 2EE57D13B6485B968190360A3E30210D2664BF91C73AD1A811651CAC09A9DC0E | |
4190 | 3A328E1DCA16082699B41A3D533703E58E366E871C982F262478E41DA3483028 | |
4191 | 6BDBF03E444C6F0F4DA2CE9AB049F324F887732D21C4BF9C5365C603C9971CFA | |
4192 | 7E45249203329FB9B4054B163C166E1322DED12CAAE39E289C126301D25076D0 | |
4193 | 2FD409FABA5247D7A25945AD5881E18C2DAEC09606228CF925557DDFA155400F | |
4194 | 8D446CFB8AD19704B6C544CFCE47ACCB854A74DEB5C646318679DD738987F800 | |
4195 | 96844722729076811B5054DA998F9AEBE37DE5068418F41A007E645599C0BC21 | |
4196 | 8363573C695B3F68111CE4A6199C8BD40D61E46A153C3C25D0C7DC125415D125 | |
4197 | D0C6130BB6B603ED78153E0CFE7384F7481FD4EDA141C27898B3636398EFBBC1 | |
4198 | 9E81060816655B2F7052016A4C72A6A1CDB83BCCB2EB475A9BE17EB08A5ADA04 | |
4199 | CA8AACF6FE68BBDE580243B111BE76EC06E70CB7751A8B206143D0134BF52670 | |
4200 | BB3F44DD8AA7D26283A483CB46286EE0A9BB4FDB0337342BBF362C236C30A120 | |
4201 | D85812760265E3B283F48C05E78F47CF5C678F54658A30EBD7AAD5840F3C7B9E | |
4202 | 21D8CA390CFD164792FF2040E07FA087FDA110A93430C7FAD65C951AEEF79D91 | |
4203 | FC25EC950E250511BB22156C2886A249CD442575934D385554B2B4534AC28C31 | |
4204 | 43A657DC937CFAF3F6C87EF4F2826BB02C41DB634D91B70BCCC4F83F4C32796F | |
4205 | C5664490597DA5F2CAC7C0013B18373EF51520DFE081F95E0C1693D02E39AA2B | |
4206 | E356FD312C233285B2A8C8C337504C1EA7E9E1F6BD250B5874842F68C92DA11D | |
4207 | F74E6068495709EDCC6E4BB3A96AA3A4C89411FF06B66DA03FCBB052CF5DE837 | |
4208 | 4834FDB84E2248DBC10CD7454636E97E399A7AC5A16A2191D763AFC09588F5EE | |
4209 | 57E80130CBDAF18FE2F530BDBD2CFC21D684AF84A8CA37BF2258C80CA61485BB | |
4210 | 27EFEBB52E5FDDA77E57AC8EEB3811BE2BC948A926FBBBAE974D9CE89333C945 | |
4211 | A9DFE37E5F34BA68EE97019BDBDAC7482826B8F71EC51A777B64C52B1C37326D | |
4212 | 1172F83F6E4DF93B37E66CDD6344810758B10B2EA8C68918DBDBC72F8821F1E1 | |
4213 | 96AB78288A2E00C2E03FA05640009DD0EB0D0D318C6A726DE5D8F2B1B035C658 | |
4214 | D09053A4B27B18F18BE4396C900A730908D832F3E8A21C36E32F2D603D0263C0 | |
4215 | 8EADB43290CC59C43AD57D357057B13C9ABE55F11DAAA8D78574C430939CEF9E | |
4216 | FB36B462DA71CFB6E86C72ACAA04D5FE4732AC386F52D4AC92C47F9B11FC32E5 | |
4217 | B188AF2890EE3786AE2772D2FBC5D75A7FC59B0519F32D930B71AAEC8B88F1F5 | |
4218 | DCBACC2CBB9951DCC8F21A26F197A309C26ABBC4C25E3FF22B2A511A96F0BFF1 | |
4219 | 2BD9AA37DA5DDDF261EAB0E48C62DE0885B8D074A7642D59C8E216B5F0A8B327 | |
4220 | 1794E0BA5B672E41832562DE119AC5DA1AFB74AA66885ADB605AF60B44C1D904 | |
4221 | EF85F00E1F143A19DAC00F751E77EE62D394ACD26B463F7C7EBE4EFD40DD93F8 | |
4222 | 81C2956C4250F5F28207671D7AFB3AC09FDD0126533384CF1B2004F31E053135 | |
4223 | 44EDCAD0114140E52B7E153C354CF3F2BF37A15E2D19A2ED688710B6F9F83C5B | |
4224 | BA14795934112F7963FFD217F016DE82353B915549CECBDF7BDFC6FA4F7B74BE | |
4225 | E202170C9F25C7448970684BC555C8390E34A5098F55E0B003B841CAE775D48C | |
4226 | 1603730AF8C091C0622640AC5A0B46757165B44F0AE1EC1072DA26A8EE0DA335 | |
4227 | A6BC8AF994F5508921F3D9E4E09B375A58ACBB9E6B0448903E19A5CF2A51F619 | |
4228 | 81D2A539A4556B9C25722D4DFAAB480586C90874DCDFC2D70716B18572557BE9 | |
4229 | E9CAB7F5A3959D5419DD9FEC22D015EBB5D4BB5CABE110D76E8A76D6EF3513DB | |
4230 | 5C23D3AE05BEFA77BF6B4ED5C413E8DB87B5ABD1B2FA9B3BF37A81C784ABC42B | |
4231 | 1FEFDE6DF012974241B33B67AA67FA38798336F7354F0984D612DBB455D0662B | |
4232 | C8F15F12DA07E391480C1A150213ABBBB0F2927D223D5752B69C930053655C34 | |
4233 | FC487DD271A8AF594F457F6A083C4150686FBCBD60832E4E7D0D4987CAE5484B | |
4234 | CA81A230A21F9C49DFBEB24C94C93ADC954B9B3B3EC484C502BD0DFD605F6D5E | |
4235 | 13158237535FA2EADA044ADCC1E1AD42918C8C67320F6621369C250D5335FC05 | |
4236 | AFEA1B294EA5D2A6F335FADB80CB26FCE9EBC0A4EBF72DD47806EBA23C3BCD77 | |
4237 | 7F175E2041EA03E2F0B2BD2B81E9A6DD43BA3486375883C30B8606D917C678B6 | |
4238 | 6E567A92A0E0DE89BEE5E5AC45C9202D46EED5E045302B71EABAC5FD997A9A7D | |
4239 | 8F522B2CA316B7FDF16CE4981DBC25E4E2FCE3981324B16A18236476FE242584 | |
4240 | AE70C683199B7647325D295528EB7CB15A7E3940FE2D248945015E9DEEB9EB26 | |
4241 | 7012041740F5A2A6C7DB7B2358EBC0358E9385E734D208957ADFC7DEF83F5E5F | |
4242 | 4EDE55E2F078E994312214EEAF63F8D0B481C3D523E712901AD838AF2D840055 | |
4243 | E57D34F8FDD4C842D64D3D94B1CA46CEADF497A2FC75A45AC59F8696DE49672E | |
4244 | E33773AEB31A204F01793262E820E813949115DB90A7C798BDDEA0D5D1E699ED | |
4245 | 753593F2B6373BD24D4647CF35A448037ED5E72DF3175DD6744ABAA0E2E0864A | |
4246 | 2F4EFF3B07B035520A598CDF1AA97D7DC3057414513DDDDE40C2A9DEFB23631C | |
4247 | B2291ECEEF4D18652CEA451BB1559C0743FE3205BFB6711F1026A613D244BB07 | |
4248 | DB3830F07F32EA637775BCC1B2CEF0C6B0D119AF6CCA17DB1B03AB1E9281C568 | |
4249 | 33502239B067013D261BBF33358AAB8803C451B2F570EC34BBA052170AB42F95 | |
4250 | F9386DA11A2C7BB9C05E8C9FDC96111549EAC90DFD8DC906C03F0281C40EC1BF | |
4251 | EB6B15455CF32FCE5C7DF6F55C91132223FD13FBD62A787EB15CF3E4E6E59AB7 | |
4252 | A529DA186B178CC6E8A4D876794527F3AD72FA86B7C2BAE14D3E5A41D8F90754 | |
4253 | AA28185D92C9ECBBDE4EE53E2BBDF05AB4C9700C1367B3D81FFC1AA34A79CEC1 | |
4254 | 1CA7D422CB58C8E21870F680E48EB1B2D5A30D974A7E9B24DE13958976C76225 | |
4255 | 45415635E32FF316DC4A69B3CD5EFC6EF5F845C8E24C92166C9076691817FA6E | |
4256 | AA5D1F1CE12235DEA3902F3C355CBDA5CC344376A5394AAA7C2CB50BCF32DB50 | |
4257 | 4B6D9BED63F0A8928C0C06829558B714FD54F355501EEBE29882185A6CA1703F | |
4258 | 6AE65F03CB07406324CCDF00093EBC76627A11A84B5EDB688D20DF49616D8D3F | |
4259 | 7491719761E7627CF8FDCFC0DD2265160BEB33ADBE3AD01E7464370E3E0F9D45 | |
4260 | 51FC9A87C678EAE5B16A564333DB11687FCB4D1D82C75A2F551FB4F940E0C71D | |
4261 | 74CFDDA0974D787BE959B2B87FE13DC290C53819DBDC2081CCD16F34F0A61AF4 | |
4262 | 3CF53914B713820BF8F2243C0679345EFD56307165AEDF16E3BC771EFBFF595E | |
4263 | C6B1DB8B028342D5DA1E8CF3FF4269126B48BDDE9BEEF7896CBA70EC77063CFB | |
4264 | 0EB3C6FF697509736BCACAA7F03C4C326875396F0499B198DAF7842384C36C2F | |
4265 | 36B17A65A1D9FB77649DD78499592C817679F344E0B88D80B8D78EEF9EC6A9FF | |
4266 | 41F4D635520B2269035CEDDCB3B5518D63DEBAD4F365A70533AE119F11323AB2 | |
4267 | EF07047536DA6370C07B2215C3A82BFDB44DA593C6B3A33BACC38A105BEA2109 | |
4268 | 06DC63737E3EB362A122FE90CE8EF37B9C73FA6933BF27C39EBDE137F15AC495 | |
4269 | 7F58F6549759FFD86C2BD3A09490AB47B60E204B16910AFB0C18E4F2361AA033 | |
4270 | 9BE5EF972F4B52F18548E3CB947F083768C7254FC019CBD8C4DE7E01DFA456A1 | |
4271 | 065EF834C7B146FD395ADBB9FB72B8EABF58EE9E2B2276C87FB83CEAD49BBA55 | |
4272 | 7DA56ECA50BE1AE4819EA3C72DBE30F363D43C75287945B0DE47D1FF0283C494 | |
4273 | EA65527E8708279B3B2437BF1CA2456E260020E4FC0A85BA18562CDB8261FDBE | |
4274 | 0B928EF40F0DD40E215B8BBD40BB5B5DCF2FD9AB4D5AF64F82EC77BFF8C37BE3 | |
4275 | 74BB9B2E44C819E84CE2C634D55A9EEB4F6DA28025C3831B601AD254108178F3 | |
4276 | 3EC068E78ED8C72AFC5C3BE0BFE17F31A23B55E7158FFC40381F36DFEB6612EF | |
4277 | 33A54D2004D92F0A44B3468DBAC0ED5E34F70561F5E77DA369754685B7F6B04F | |
4278 | 233454A59AFDF45F28383B05B6120717744B58D2A96BA706CC9317B5E7FD0848 | |
4279 | 56665EB38E31C7F8C87B0C65041A5D2E349CB4264523AABF9C10CA95CDD3BE1D | |
4280 | 9923C1A11D046FFC2E82A09E36ED0146978DC383AC6D70EABB20327360CF7EE1 | |
4281 | DC4DE736760F5CF3B47F7BA082DCBF881ED8DEBC1A4580C287418295CFEBFB01 | |
4282 | 51B09DFC98C8A8C9C5F9AAA6971CA95D96A23166E5931F7E464B288F4E357112 | |
4283 | 4111BB33FB7F0E042448478D3ED7AAEA57D1B0B4E237F919152F8D9E86229BFC | |
4284 | B8D59BF9FB9E0062A3ED67A367669D0F2F8EFEB2219E5FFE7400A9DC725ADA62 | |
4285 | 706D4D1860BC04D4432F49D7F4271376678D381B148D72DAD9012173FF3779A1 | |
4286 | 7C4D92B28D3117888C864440902499FF0F9BEAB0C83FBD788E26B0BA47484188 | |
4287 | FC01B0349E045421E7D912E1BD329A536F61169344F16D65F6B90DB87E22F72D | |
4288 | 8E6F486F8D21E6DAE282C35A2723464F560CAD8B31A931CCA7A2FDB9530769FC | |
4289 | BE0A5F66F1D4DBC0EAF834D078CFAFA415F43DC87AC62A1D8913334016B3FF37 | |
4290 | 20902A7E5644848A57346228A13D7B1C757DFA9B5FC4E9E1DCB2C2AA2FD37386 | |
4291 | 87E6B350662256D158D8C7DCD2F7AB1E02D6C5C8E3ECB1C6055A6C0B807B8FF7 | |
4292 | 997E562EDBEDF7646B64165A55DED91178BF13FD30ADC1A6B6D621B1A7AEE1F4 | |
4293 | 2E30D49CF3BD0656F584CECE76A17151913D7ADB223727B47EB3D7F491385112 | |
4294 | D36848973526DDAD7C1C1C0FB672EC627172D10DD33ADF2445483470F28AF65F | |
4295 | 29CB086189B3FFA31E0CDA710B6DE2B0EE515A46A3FCFC354AF01AF5C5D0B301 | |
4296 | C8FDEADC6DB9D492554777965E2751A715F8FFB6E0248AC51928DD65CA4F6574 | |
4297 | BB1E01B3ED95D736691EBEA8ADFCD8265F128A67C372720840A206056F66A7A4 | |
4298 | 10E1722E4C1BDEA8C980250F9E034C29FE0F7D2F5DAACAE3173C865CA9C4C240 | |
4299 | 49B6D4D0CD90B75D3BC68B8C84605923075A9A2D5D6F7008365E52796975CCA5 | |
4300 | 02770D168EAF28C337D45762A08817666907C68142CFAB9D75C4F6D6A73FB4C0 | |
4301 | 748F038F140CB009A24A80270037C9B5E514E04AEAD7CA8468C4D22E1059F2D2 | |
4302 | EA0E7CA2979C7066F1629B49FDB893DBECF6620FF9C48132297E81F717820A90 | |
4303 | BDB45E16CA1D0D9C152B12D50AF4E1B2519FBB2B779218C5E42E31FDF82448E3 | |
4304 | 5AFC5F90AA018902EFFC4D5A14D4326911F7055F9B7AC5B592E2E2D3A198E2C7 | |
4305 | F476CB49DBA0FFB2CAAF494DAD087639203084CEA25DED422E0F8A30634FF1DF | |
4306 | EE5C61FEEC33D547A17961534B3535AA673AE15F560DDFF08EA7AC126882B57F | |
4307 | A1AE8A5313E6D21F67FB6D16AD32690FCE021616D0DB89C51001090A4A7FB515 | |
4308 | 139B751F6137DFEA833004F4689474DE3A8FF64D98EF09D25802C3B35DD2DED9 | |
4309 | FB5300E4F50E5CC70FAD3A21917D15D5DAAFE30DC1CCF79A359B81AA3F21359D | |
4310 | 297B9795636C03E483A80D47A4826930854329FAC093193AEE3A19BA91063421 | |
4311 | 988EA0ACD987862A716C42F071140254B72AC91B91911CD6A9D275FD7F6636B7 | |
4312 | 4B1B0A47FD39120411E1D5442E711A6C1EB0741C67B0A44C1A2F98C9FF245A9D | |
4313 | 5AE4A04B529CC5FDBABB1C6E8C1590B3CE658EB77B58F4D04803DC351C5645D0 | |
4314 | 4DB49D76906E068C3FB553AE91FDFF5F22F734DC4BF8E9D019B06D3A1BB7CDCE | |
4315 | 9101E9D2276CCACFB36B9EC74AD213BCE896FAC45D08EBE43E676816DDA135EA | |
4316 | 8B78003042DA8581975D4C14CBDECE0B027AE87DF28611F387E64B951812C848 | |
4317 | B661FCC0DF91B39DEF14976D7D00609DE2DB8195C186E376F4029CBACE3AF24D | |
4318 | AABB788FB1AC87D58BF341F95EC2DBD14BFF27D3DAD9A06569FD4EEE40C516AC | |
4319 | D809E761BFCA049DCD6F8E43E60A0BFE64BCB922D1989CC14EAC1987147A5559 | |
4320 | 4F1CA14635DF029AC387BE36036BAEA8AE7DD09D090EBE271FE59FD806894A72 | |
4321 | 61C714D6D08322726CAAF168C08CE31F26CDF6613C06CC50DBD59B70DA211B44 | |
4322 | 1BFA22AD62D56AD098FFB998E25FABBD89A2C17EB7A3AE81F79C05AA4677D744 | |
4323 | 7F412484C16CFB322FABEACF98AF9F152E3217D0F2593D6863E7872C5B6F82BB | |
4324 | FDFD09B13FA639680E972DC7B086D7DAAB076CF346814556119BDFBDC3A16374 | |
4325 | E7B92CE50B3BEE8B7C26856BDD3C2ED98337C2B877ED5EE4878C50F06A64F750 | |
4326 | E9C8CA83B7FE6C91E10FA717CCEC0D2F8E21CB5A2367B5C90A81897B6973FAD7 | |
4327 | D4D95F6BEDE4E1EBE6D852A937D5D814AA6BA62324C08AC12FC09C5037588F7B | |
4328 | 1B043BC503D725EC657F47DE02CBA939ECD8418F4B7C705EDA3E9AF1E623A989 | |
4329 | 074165DB0DDD59B7ECF513C714B7D0A1013E4E3F2B071F6A6DB89B7BBC2774B8 | |
4330 | 87ADA7C572B0AA702156B715159829BA38A9EC28E1CF3494B0CEC876A97B4617 | |
4331 | 2CC9162F204C36850CA9188B0B97300CDB1AB4F57B55D39BC539BFA5047B032F | |
4332 | 02A88CDF11D098FD30F6A6B82B98AB9D288570FE18E4E6A707179D96287D438F | |
4333 | 2D5D3C2305C5FAF075E0979EAB1DB645AD9DC87A621219C260FF67C2DB8D541F | |
4334 | 8BE9E20ACDCF64C4C721AEF5B2B65761D0310CEF36B1A3E57092DEFB978A43F8 | |
4335 | B553169F523517518CA0618E31F9A5940EDA42D8B9D851AD1E77BC1C0C8EED23 | |
4336 | F469B0568B5A556A5FD5A20F5F4E00FA6F030ECC5E711865F1549E409792F7DA | |
4337 | D1FFD1BE1E6DD22619163B98EB0425319E738254ADA0AE57FE29E121B0D8F172 | |
4338 | DD717E0B59842BE9F6B37FEC3F1BBECE15664851EDA3DA3A1848191C38F2CF60 | |
4339 | 7A262D4440322C26150C605AADAD4EC3EF0CA22D6A2F63BE63C9C08EA643B68B | |
4340 | 9C88ED95D2F2F0868CC40278DC2752A1E61C793FB87EE69A6D348F98A0174B09 | |
4341 | 5AE09E214EDA066174A6823347B831ADF2619281E43A71D549FE194D5AD4ED5B | |
4342 | 1DE112CA90BB9D92C57FC3D89F1A57F7CEF2ACE8E944B8B725557F567D9DFC72 | |
4343 | 3D28B0E11DA3F81633C042B5FD05513542A2B431B3744E2E9581ED828F5F8A8A | |
4344 | C600F526EA874274FEB94E64F0AD787F47C98899DAA4552E447D4B97B3774334 | |
4345 | 8DF26A38D7CD36EA79B64CB31DB0302BFD0DD2280E10FFDEF59E2D1F6452FB09 | |
4346 | E2A7015523BC1A46AC2F816135FD4EC198D30E95203ECD2623E83FFC1436FF74 | |
4347 | 068CFF87C1ABDE2D31AD1FEEE6031D889A25B9F2C05036F16BBDC143705545D8 | |
4348 | 4D14A2467639644AFF1D239BB08AA769BB5476DD4FE9974DC01E85C02F82958C | |
4349 | 12C3AAE071BF1E57C358F72290F15A2655C1C79DB5E5264133AD0139F9F9B540 | |
4350 | 972A3FD82BF0377FDB8711A746B9F4C6016172C30CB33CEC0B327DA0DE2668BB | |
4351 | CD41 | |
4352 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4353 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4354 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4355 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4356 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4357 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4358 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4359 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4360 | cleartomark | |
4361 | %%EndFont | |
c302751c | 4362 | %%BeginFont: CMBX12 |
45c0f7f8 CR |
4363 | %!PS-AdobeFont-1.0: CMBX12 003.002 |
4364 | %%Title: CMBX12 | |
4365 | %Version: 003.002 | |
4366 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
4367 | %%Creator: David M. Jones | |
4368 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
4369 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMBX12. | |
4370 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
4371 | % This license is in the accompanying file OFL.txt, and is also | |
4372 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
4373 | %%EndComments | |
4374 | FontDirectory/CMBX12 known{/CMBX12 findfont dup/UniqueID known{dup | |
4375 | /UniqueID get 5000769 eq exch/FontType get 1 eq and}{pop false}ifelse | |
4376 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 4377 | 11 dict begin |
45c0f7f8 CR |
4378 | /FontType 1 def |
4379 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
4380 | /FontName /CMBX12 def | |
4381 | /FontBBox {-53 -251 1139 750 }readonly def | |
45c0f7f8 CR |
4382 | /PaintType 0 def |
4383 | /FontInfo 9 dict dup begin | |
4384 | /version (003.002) readonly def | |
4385 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMBX12.) readonly def | |
c302751c CR |
4386 | /FullName (CMBX12) readonly def |
4387 | /FamilyName (Computer Modern) readonly def | |
4388 | /Weight (Bold) readonly def | |
4389 | /ItalicAngle 0 def | |
4390 | /isFixedPitch false def | |
45c0f7f8 CR |
4391 | /UnderlinePosition -100 def |
4392 | /UnderlineThickness 50 def | |
c302751c | 4393 | end readonly def |
c302751c CR |
4394 | /Encoding 256 array |
4395 | 0 1 255 {1 index exch /.notdef put} for | |
4396 | dup 11 /ff put | |
4397 | dup 12 /fi put | |
4398 | dup 33 /exclam put | |
4399 | dup 35 /numbersign put | |
4400 | dup 36 /dollar put | |
c302751c CR |
4401 | dup 42 /asterisk put |
4402 | dup 44 /comma put | |
4403 | dup 45 /hyphen put | |
4404 | dup 46 /period put | |
4405 | dup 48 /zero put | |
4406 | dup 49 /one put | |
4407 | dup 50 /two put | |
4408 | dup 51 /three put | |
4409 | dup 52 /four put | |
4410 | dup 53 /five put | |
4411 | dup 54 /six put | |
4412 | dup 55 /seven put | |
4413 | dup 56 /eight put | |
4414 | dup 57 /nine put | |
4415 | dup 58 /colon put | |
4416 | dup 63 /question put | |
4417 | dup 64 /at put | |
4418 | dup 65 /A put | |
4419 | dup 66 /B put | |
4420 | dup 67 /C put | |
4421 | dup 68 /D put | |
4422 | dup 69 /E put | |
4423 | dup 70 /F put | |
4424 | dup 71 /G put | |
4425 | dup 72 /H put | |
4426 | dup 73 /I put | |
4427 | dup 74 /J put | |
4428 | dup 75 /K put | |
4429 | dup 76 /L put | |
4430 | dup 77 /M put | |
4431 | dup 78 /N put | |
4432 | dup 79 /O put | |
4433 | dup 80 /P put | |
4434 | dup 81 /Q put | |
4435 | dup 82 /R put | |
4436 | dup 83 /S put | |
4437 | dup 84 /T put | |
4438 | dup 85 /U put | |
4439 | dup 86 /V put | |
4440 | dup 87 /W put | |
4441 | dup 88 /X put | |
4442 | dup 89 /Y put | |
4443 | dup 91 /bracketleft put | |
4444 | dup 93 /bracketright put | |
c302751c CR |
4445 | dup 97 /a put |
4446 | dup 98 /b put | |
4447 | dup 99 /c put | |
4448 | dup 100 /d put | |
4449 | dup 101 /e put | |
4450 | dup 102 /f put | |
4451 | dup 103 /g put | |
4452 | dup 104 /h put | |
4453 | dup 105 /i put | |
4454 | dup 106 /j put | |
4455 | dup 107 /k put | |
4456 | dup 108 /l put | |
4457 | dup 109 /m put | |
4458 | dup 110 /n put | |
4459 | dup 111 /o put | |
4460 | dup 112 /p put | |
4461 | dup 113 /q put | |
4462 | dup 114 /r put | |
4463 | dup 115 /s put | |
4464 | dup 116 /t put | |
4465 | dup 117 /u put | |
4466 | dup 118 /v put | |
4467 | dup 119 /w put | |
4468 | dup 120 /x put | |
4469 | dup 121 /y put | |
037a8b7f | 4470 | dup 123 /endash put |
c302751c | 4471 | readonly def |
c302751c CR |
4472 | currentdict end |
4473 | currentfile eexec | |
45c0f7f8 CR |
4474 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
4475 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
4476 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
4477 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
4478 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
4479 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
4480 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2D43A151FEE81296FBE | |
4481 | 0CF37DF6A338C826464BA5198991445EC4BE80971DB687336AE8F74B516E333D | |
4482 | 2D8AB74D362C559AAE6ACFAE49AEEF4F52E28C869222C1301D041E7A0BC1B608 | |
4483 | 1BF728EF9E98F3A12EB2714E7F16B14E055FE1FA0EEFB058860ACADEDA9D0E4C | |
4484 | 42E3C6F1E4869471BFAA3760175F3FBD842755A9D7847EBF605F18293B42F557 | |
4485 | FBE2715002669091BB033E1AAD657532F34F7C66E4F04D63ABB07E6CB9D9AEAE | |
4486 | 78EDE8B79DD9BC87A1FF445EAA05B5572BB880E69F4DE1F82D7F0E9980AB0C18 | |
4487 | 22C448B0B1722D3CC33C56FF287CECB80658B3AF5E7675BE82CEFF3DAD5942EE | |
4488 | A03C955FF979E41E54BCFB5316A9AB8945C403A73180D0961416EC9C92F49811 | |
4489 | 4B91BC4C788392994587517718521E416D469F69952149FF7F9224377EBA1065 | |
4490 | 4A727BF806A112A7B45B0A1BA1D5A23683960575368D9EAC8C04753BF7465AF7 | |
4491 | 95F25C258C63E4FDFFD0B412FD381946AA38C0B961652BCEC30322C47BF4755D | |
4492 | 9F91880688AF066E32FFB22E1A52DE741307AD3ED830D6BAA1D1F562919666DC | |
4493 | 5E8FD9862AC8600B0AE0BC7FC779252AAC57248744ACC8A8AAFA836BCF09B0DF | |
4494 | 9253DFBB1CB77EA8A59D42D1B18FF25E9AED72FA62FEC3F126F030F5D7DED9C3 | |
4495 | CF60FE890BA4A48E39E687BFFAEAB96AE542A6387F6624486037C8924002A511 | |
4496 | BEE5FBFD780AC1D4BEC3FBC47A930BAD0280D444259528B6C565DE11DE36BB65 | |
4497 | 9BADC55C1EDA1A80458E98896D782DFB5C137897419602809F9BF8CA39F00C68 | |
4498 | EFB9E076FB324C2963F23CBFED28B9EF70EAA4E4B903225D1F199A7162AB239A | |
4499 | D92D71C18B1B682D04C6A48926275BCB16D413B2A0E953E1257E0B12D8B717CE | |
4500 | 2EC84CFBC046A4338A69F454A469B12118E562B4F56C5FFB3CA5D357513E6FFE | |
4501 | 947A564B229C7FD873057D5C7CDF03E958294A1003B37D8DF565A70A00A3734B | |
4502 | 0138AE5277D383D10C2BD853EF806D3CCDC47739F0E374A3DF3B63638B949ED6 | |
4503 | 4EC25869DC1C0B1F4DBDFFCC97382841D8F10F3635C792139A1EC462FDBA379C | |
4504 | BE0990CA2E70FE73137AFBBF30CA54954D7E7377CC50BDD780DDD4C7FDC77AD2 | |
4505 | F3EB1169F14A0041F18160F43C24FAF556DB5D621709FBC544CE55424F7446D4 | |
4506 | 6AC07A51C8CD5161AB0AD5084A96FB35D77F1CA155147DEF8D7A590EA6939514 | |
4507 | D4A226588295CE0007BA8A550895511C8D80BBE5CDFB8A50D249C3BDCA974415 | |
4508 | F5557914A9B805782F399E4078DDB6264F1A49A9A5BA45E284A5196E9828EBA8 | |
4509 | 481D357B8D9E6ECA631A6204439FDFACE7D7E6A2392726107CB7D2517CD19A24 | |
4510 | FBE592C119626DB221BBB635B6EB84845C16A9585282E34958B961F4A543AF9D | |
4511 | 419B6A9105BF185FC767712D923437BE08A9C0EB92AB6792DBDC671029B6FCA6 | |
4512 | 7F717FCE379C0F3B51C6CF042A762ED04898FBB4B0105C3C4ADDDC18C51BAA3B | |
4513 | 70A93666669547081D9246732CFF74C83EE90DA17F5B4F8BAF47FE4D81590988 | |
4514 | 2858C9B96071341FA0A0D23BDD4947FC9BC2297913CFBD4FD6CA4303AB3179AE | |
4515 | 0203F1BD502065F90CE9BEA3B52DAFE4A29446082EA0E6B1D7AF1F31D0AD02CC | |
4516 | 9A7FACE2CA86E5FE0F6A425B28A5940ECA306891CECDB3CFC7A5BBC76B5D9E8A | |
4517 | C754379ADE80B4D72CE493010317BF21A0CF4A0A55C1246218839DCA3F4D626D | |
4518 | 1F4161D38F54AD5142C1CEE95C61D8BB10FAD4B772F4955777AFDE8AE5A837C2 | |
4519 | A2BBB11D0BF5DA2E63D0B75ED421DBA9C789B281B01846B65DC572BA69591969 | |
4520 | 21265DB722AE86BD8CAA3D887C975A617ACEDDFB7AAB341F47532AC0F354A530 | |
4521 | 7662C089DA3939588774FFA16FC4A52555DED6D6F51DE718BF5F345C23C90198 | |
4522 | 17B77CB8B5D53A5CE7A79F3E286B6A59F3F6178AC8BF15C0A15C1A8A95D03B60 | |
4523 | 30EBE53DE328CE085CD9A1D49C69AA299C5B58B24334A546F6E274C1B534DC8F | |
4524 | 3289553F560C2F81E413ADB92FA0E7DD1C2F39D5FD268EBA97AB7335ECF28257 | |
4525 | 96B4EADB7D0778706CB41C7E9C882760E7670936774A1088FFB2011115FDADB3 | |
4526 | B69EBD5108760762521C25C968C3E282DC3400001AC8FB1EA27FF643E3025950 | |
4527 | 1D617BB8BB321281708E496277E11DD3AE0023DA9F25AD06B39C7CF527FED27B | |
4528 | 57397E88D3DF70EE4FCCEFC8A0927D6B05517E571B3E70ECC99F3CBA32CCD4DE | |
4529 | B8BF22626B6C94FE65598A88AB90D238461EBD9A098DADEA4091AF1CDD7560EC | |
4530 | 8E1B9BC2321686E1759E6B8A270C8CB4A254F7368039602EAEAB86ED21CDED91 | |
4531 | 8F2DB9889F46981C494C7EAF5E819B91C129F0740B8002B510014985E5791F59 | |
4532 | B16879CC6521D8E9F1C4C1890AC85A78022BE614BEFF318AB2616F0C3F02405E | |
4533 | BB425D1555472A2642BA7686E431DC3FB8A1688B76660D9957C3FDE8D58109AC | |
4534 | 21B1234C9DDF3F0FAF93BCF7B2F88A001F23162E1A13E5E9118D51B485B70A91 | |
4535 | D0CBC39CF44413FD8686D9030782DAB58064F5B987E0402AF5B264B17BD31BD4 | |
4536 | FDF63951BECD73ACA6138854EF35B062D01F33073850D9C09A818828C581241F | |
4537 | A625AB3638081DD0F00F946BE5450D38489CECEA4E66B4D85CC8AE0157E2AEE4 | |
4538 | A22A9313829F24D573101D84CC1784D1CED7DFAD5DD966601370C6CCBB723082 | |
4539 | A86BBAF0A5D867D0D2E3CA16E14E5109A29EF02649C47E12E88B3B397D65CACA | |
4540 | DEB9940B92100744D686066F8250FF30E5F13D81428EE238A2E4E07ACE0F5C38 | |
4541 | 7D79D4A336D0D26AF9C2B84088ED8ECDF94A1E3FADB45AFDAB46CAD6FF950B0F | |
4542 | 07AA2CDF82374DA76C56D29C80138841EB13F0D02ADD32F88B23E282ECC845F9 | |
4543 | BB9AAECE9CDC644AC2D49577A92307A83A99434F6493156DF25DBF0FCF2EC21E | |
4544 | 8C50A312C3D19E0609C0038554CF4FEF3ACEB7A833FD54B06EF0D617C2971C89 | |
4545 | E4C06075B09B84A4F78A82152B9A9C540B1D881313C2C74F20ED064A9606EC2C | |
4546 | B56D7BB4797F1EEF4A9B13579CCF311FA4A4DFA62D80FDB7F535CC6526D1AAE5 | |
4547 | 45C008EAF024B48C377522F74D939A475970533E645B1BFA81997549AFF26F67 | |
4548 | 2AAE6C2EFA357DB3B525276EF330905688777057F4E4CBF584520A534A8587E5 | |
4549 | 5A8360891E75A15205E8ADAC4A4E5A6E27D0C4A7D492216E4BC023AB027F37AF | |
4550 | A8DC7579BA50204D5F45A51460C5BD8A5A7F87668CA6451137F2F59E117BBE28 | |
4551 | 5C40820882A5546FA76F0CF49F8A6EC445F0647CC3227C400F56E7E9B84A6975 | |
4552 | E85E243CC1666DBAFF4E07EEAF3AF71BDACB30DAEA792F2B8504CAB071544F01 | |
4553 | 5D66243D529C479D276FE22F7E275D9E7FA9C6EECA18716B2F213916E32C1D94 | |
4554 | 6E32397B41AC6779543218E506569E3544803BBF9B404A983EBA62A494187B30 | |
4555 | 8D3DFA4E1237A2E5E08224A60492C09ADAD8775B7CDB830520829BA164209ACB | |
4556 | BCDEB2D574CEBFB7AE4BE72DF4EB1945FEF2458761AD8DCC0D378AEB7DA002C6 | |
4557 | 9C14A665DAAA532B0ABA98D7BFB5A6151FF6703385AF7AE8FD315A492FCCDBCB | |
4558 | B825707F9566B3B4943A3C61C3DEFDC31A843A2D67AB06891F3E110DD8C73D3B | |
4559 | B5E4151B51D9F13905D7D94DB9ABBFCAF35F43B6EEE256B1A80ED6D1739D8D5E | |
4560 | 8C767F6F0E8704C5345D028A2A6DAFD9BB7AA048B8B895FE9423A7ACE858BADD | |
4561 | 595CB074A128DAFE08FDFFD6BDAC0114159A702FDCBF8013804B0CAEAD7AF38E | |
4562 | FAF086A3248AD4FCA1401A85AE2F72E3E6956DC0996FE8ADB18F89B14A208A15 | |
4563 | 13F81AF73D0DB72F78C4DA634ADE3C73756CAE6AF2E149C26316DFD93370BE1A | |
4564 | FB4A79F77A67C07CB0A53C78367F21661D4AFE9E27328E077B522B50FD9AE2E3 | |
4565 | DA087BE481515B5DD7BF894A96A84A6C78874100505B7DDE1D22EFCE8D58B3AB | |
4566 | 313AB5495F72E2CA4E6AE22C0CB854302B9990372F1661D9F0A517F90686F248 | |
4567 | C5643008B3D29F7296E5C8FD4049886662EFDD4106E17C879F5D41CE84F87E89 | |
4568 | F6A3117C968B95A35940CC29C43E1E0DEF51C1E46B676301F40D59615C3F73DD | |
4569 | DE37B72FF7105DB84227DA5241583272AB1C3CD97AE11C1EE98FFDB5E5F44844 | |
4570 | 8FC41BEA5C54B26341AFF6830D9D0A5A2901B0653D8BD0746838194D240FF753 | |
4571 | E99750D3383373F453723D86BE97B571B8B84D8696089B5CFDD53E6C562A2197 | |
4572 | A8C4FB0CC690C27761A816B441029D3D306245052E0C41B53025D8CB7267CFE3 | |
4573 | C17FDFE348E765326F91AEB700CC49162DF748171214252CBC821493DD01AA20 | |
4574 | 417D66DF47EBEFFF3E9BB2B0A2BE7D9B8C68BD570FC2EB0FA54CECC318F04C43 | |
4575 | 19598BDE93F2F13DC7847354C99059AB20593EE51E94F9D4E9241869D605AAF4 | |
4576 | 9D9B5FD88C3798A039A67993C5EC68B6326B132E647F67EACCA7F7AE7F718D85 | |
4577 | 12666E90D7C73EF210E344964A38228B236679A2B18F5E081234CAA2458F8D83 | |
4578 | 3F0CA308D19663CB12EB904076EF88E556407C33C9380A6A3D68A9EFE65387C1 | |
4579 | A1BCD2D26DFD2AC0881EC30E81C0A4E76C244A2BD822EE88C4A60B480D107E68 | |
4580 | 90E419A1F512E865BA922A7830909BC2611A80931CB2E9344529586726614D94 | |
4581 | 3AC5200FB9FF68AD9686506C5EFA8788C0AD0251AFE7F95E84683380CDB421C5 | |
4582 | B1A783B6D5F3A6BD1BC1C14B363DB01C87C0796DCDD5BECF41A1A9F43183CF6B | |
4583 | 82C2AE49F0BFDC5DEF7729F2E638EE6EA9E4D059EB9BB1B992AD8C82D501A550 | |
4584 | 1BF73CBBFE740179B54E193E84A55DCD61B343C1852780FFB44248FC9426AC94 | |
4585 | AA2B3FE20FBA30F6C4D1E0FF3EDCDD8C0F57CCB50CDB0EFE2E04A8927E239C1D | |
4586 | 9B026C7929BB48461D4D695FFC766C8A0E545B1BCC2AA068D1865333108E7985 | |
4587 | 2D93F9B00EA0A90939D0D3840D59B6CC0CE2C147B2E1A9A4F14270FE3ACF51D5 | |
4588 | 99F7349106165AD627CBBB0ABA01ECC6D3A14C1DC1ED23A9DB9865BB4396C51A | |
4589 | 31ECD001EAC94B33C34E29C5611148EF3E55DD61813470B8F3CE32564C749414 | |
4590 | 3C93C77EA5A3538A0B5AE3FC4DA32813B06772E0E48E25BB39F3F6FDCC077E86 | |
4591 | F86FA50E18FD19EB2F37311CE87F18F3BC85CE7FD71CA92D5C3264E34E04A2E5 | |
4592 | 70C79D99F54D6C6D9D527AE45EBB48411221134587D2253E7C8ED7658EDCA34E | |
4593 | 5E768DD14E0200470F73C44D006CE8CB35DE1CA3EC10ADC668B0662A7774C891 | |
4594 | 84EC95A31DD872F0728D9F65CA80940080E04630BE4DEC77A2C49E3913C39978 | |
4595 | BF145F8832AF2C4385EBCDB15F9D32C22CBA0CF950877717D6F1591D7C0B8047 | |
4596 | 8C9BFCB16AF7124ED83137695F3D69228DB633053208C29E0ABA1B06A7FB3EE7 | |
4597 | 5625CB44927E2DA6E038A6E62DEBDA2D96A03177982D8FA33BAAF4426E05F4B7 | |
4598 | 9C1748B3FF7691F9888E7FF864A10B9DF761A41E6B5CFAD2BDD7E1C4924AC97B | |
4599 | F4B352705316DD1A58637CC12D71C18A5CA691AB2AA8F171590EC24582B1123E | |
4600 | 94D4DC587D8F99E18A711776BF4013C96446BFECFEE4C809EA94B169088024DE | |
4601 | 0CBD20199A915AA406F0BD5F3D63D1467C49B4691AEBBB35ED6624F2D7BB74BC | |
4602 | E80FD92B9FD04DD9C2BE9B6FD29EC7EC07FAB447511C61DD299C783BC09AE2A4 | |
4603 | 7B3CBCA6A20C6631D06D0B2E2482A50612BB7C29B7E7D0A205EB0E8436702581 | |
4604 | 596BC996ABD58CD8D5BAAE4B1478195CAFF98FE0141287296C4EFB8D2E7A8442 | |
4605 | F0A3AA9F9264329982532295A176BA1867EF732BBAC49AF485D9D0F7130F617E | |
4606 | 7F7DEEF935874D55A22240F8EDE4F247D5F73481373A392D40A8076BD91079E1 | |
4607 | 1CE5998BA13D48D56B49A92B4A18430E316405D2E2E391B496A1934671FF1785 | |
4608 | AF42BA3B2D14B8E04014437FD194455C50289DFBA61B5C377BCBDADA48E82DEE | |
4609 | 4E70EF5E9DC03064907BCB8BE4D59DE069FB0C0CB140DA54708E630767313F9F | |
4610 | 744594AD8A499CFEF733E640A11FD74E46A749F9C7D18D49251BF85C6EB4668D | |
4611 | 67598C31A8F90922FEAEAD4B83B6E7184567DC798E4BA1C4C9B3461A478D63CA | |
4612 | 054F13B502DACB674EB49D6BB935E5EC82BF99FDA7D47C581AD7F940DF4FC6FA | |
4613 | 6C6D25D647033AC69505F0CAC58DE99087F365531A6283CB89CB644688963C3B | |
4614 | 8B2203A94294E58739EF23C7803630A1F9121D62BE1977DE2F41687C8CAF87FE | |
4615 | CBD7AD3B98E0D95C8C6E1A7CCB0E09465AA874DC90A0F5DB2C5E7C130297FD39 | |
4616 | EFE63B0350B5139D09E6864D22C3F1150B29196E40EEF9723E71158B7ECFB8E4 | |
4617 | C426FEDCD439420B7F1C251FADA347C9A2C49738B5A17922E1EA93CA7B125B76 | |
4618 | 57449EAA9C1D591CAD327D0E98EF2D44D614EE9ED49DD31ACAC0B956620B6BA5 | |
4619 | 5BF6D08CA7541059D5ED2EF00AE2EE95488F5645BF6837D9241C0D3959B7580F | |
4620 | C9ECB2BCF3E65C07D52EC9CFB21C11CD4C883E44C173214C900C44D2E1E43DD1 | |
4621 | CE8DFE3DA93C38B548BC4EC46FF91F30CFB97525E1FD4E77686433B20BABF8D2 | |
4622 | 848C1CDF1BCF185CFD7A81D2D4BB826E837E2AF35CFC4F419F698DB0C43E9F9C | |
4623 | B0FB628AC9A3CBE9B1FF4A067016E70333E78B32AB2D89C483834B31F5808FDB | |
4624 | 77492E099F1504DABCA5722C7860CDCEDB2DDEB512FFCC7D287F4945FD711F28 | |
4625 | 87BC3D36173566B81FC2C1290C717A09697DAC6072408E20926D39270121CE58 | |
4626 | 3EF97CE12EDD7F87F2C8CFE36C3C0400869C0D813B71C425343EE0CDF717BDD8 | |
4627 | 409D5297D0F8F7FDEB0257C0A391F5635E0DB1116058942FF3E7C94D5F2873A7 | |
4628 | A3B0ADAFC3835AF2BE474E6741319BC6695FB37F59AEE388F81F6E66F910000B | |
4629 | 72E6BA7531B4378CEFEEDC79CCF4947BA1703823B5AB4F4AD73D9615C66C489D | |
4630 | 99D68E49C9BF765B7FC547BAB9640D51D5A7A2396507AB5A4DFF3D14F52422CD | |
4631 | 8FCFEAA06A56C6C7FFCD29C9A7A59DDD2A909A9363FE5F1E9629616D25ED38CB | |
4632 | E754C059E4379318CC491C3B1A90128693AC53F80F8210FAEA7EE638902A7D3C | |
4633 | 82B95B3F5AE340EC1B648DBB9FB679D6E80B7F426D8671FE7136D97F51E2D2F3 | |
4634 | C9CE9183E4061CA40091A2A70DBB9ECBB19CE3F65ADD0FB346B54BAB182E2CD0 | |
4635 | EAF4C0F402C25573FB344EA771B297BEB615FCD0595172E84ED2A62FF8962634 | |
4636 | 23C19076C2A9ECEED5135994EB397303A9619C76DC55E032DA83FBA441BD484A | |
4637 | 59F70A5110A8927F6239A14D4E223E189A5462E4A92EAEFFA4B961A2A32B320F | |
4638 | C2B4E8C1821FA67A655B5042C15E4DE1FB3652B55078DB123573C4E986B19DB0 | |
4639 | 1C5131F3DFAB271C30A5476B4A19D8FC922E31879C34BAED94C07A4841B8209C | |
4640 | 403369FB8E842610D1EB4662B6171A4465FD0E819964F62EC5B0ADC92F08CF90 | |
4641 | 1DE0B410FFBAD16F6D355E8AD72CCF67961EDB6CDA82398021007C2D0462E893 | |
4642 | 75EB0710AE4A6CDD15077C9DEFC5774EF4A657734D703CE42174259B58E5277E | |
4643 | 0DF26BF59AF8D1A3E7DC12E3C12AA4B67CF35B19962F6950C2020B698D971B35 | |
4644 | 82FF84E72F72FBB0C54A112BADBAE6C4CAA358BDE6A705AB59332C3850CA3D25 | |
4645 | C7564499BC1319121CE0D93218210C68080AFF33420E3CB3A48BF9EB66BC07C8 | |
4646 | A79D8CD8E78C200FF7CFA3DAED0B9E87E6141C88B436D8FCBA50AC195FCBB9BC | |
4647 | 9512B95FE3A37FFAAB39850FCEBD4D50A243EA416E73F53B4B00F3B6EAE0CA06 | |
6e51e0d0 CR |
4648 | 0693AFFEF215D00BFCAD02E45496D7C8F5E99EB9096FC4300D038C1AFD31EC4C |
4649 | 5ACA6B72C1BE7204E37A4CBBCB1EC26AB87F2FF82DE20601025169A5FBD2D060 | |
4650 | 62B5B2DBC288C79C33B596832AA18D730AD572C6EDFABCBD36DEA87C0F323C3D | |
4651 | 6E537AD3B43C6F3A905597570A8C6B0B4A5E08C08EAFF9731E745F2BA8ED0C0E | |
4652 | 1ADF7821CFCD4E38F3F4C243CAD31D9F8FC68B9043740852B4CCBDD37BF728E5 | |
4653 | 648215961FA82A0C847ADCC5187331D0863A4573BE520C02CAE14AED4F06B3F1 | |
4654 | FB4A318AB54CD86DEC824707B29F858FD726A167F2333855C0575EAF4EBEA0B6 | |
4655 | 754B1775F967140641FC06F82B191244186FF347A351FBD8FA62E8C978B21F6A | |
4656 | E124929876488AFA97FAD262BE3D172E2F03F564F1325C9F1E050C83C12E0CE3 | |
4657 | C7F58270B5C40B46B3F592FB41FFB7F59EBD69B2F489441E398FEF7F84C85055 | |
4658 | 531D95FD21629B0E509C2FCEE995D025BAD5D3F28CDBA5CD414405ACBD936C3F | |
4659 | AA4CB2620D7426002161F983AE95E542EB8553AFF7E57B82E05FDD5FC433E1DB | |
4660 | BBCFFB1ED92299DB0291CAB10A84529B7FE279C62628A24A2FC36B01976E13A9 | |
4661 | C528A198B8EC8654AD69CCB5C209964A2B25D6DA9BA0FFB366D19D8C69701D7E | |
4662 | 8ECBEA88569601C80ACCC2D5487DDBDC27DC463A53A8E59F9EC17D0ECB7D2188 | |
4663 | B6CEC6BBCEE631DBB9959A9855B997481B5D88B8BA29995053CF42C5518A3E8C | |
4664 | AD21553A0F6BC3483624B013D3537F7C85D7C558A9C772554CFC1C3FE7A70633 | |
037a8b7f CR |
4665 | 318A99508F5D2FB656B5A91E94F80F74C7472F507428AADC375AB9F18CCED8EE |
4666 | 9DD57456CA8DB8D3B133596CFF2D510746BFA00B23F4001A3D0E8A24476C497F | |
4667 | A14422160995F3378EC9A74A5D72D776BF8BF91146E73518E61C94AC5C7ACEE7 | |
4668 | 783E29B29962E638F75366A0C0235475327F024CC6C824A52A6C25E669546A39 | |
4669 | C3459E06945AF250269C9F7B541B1EDA04DF9B9C7B442CC7484595E7B1A860C2 | |
4670 | EE36E1F845BC6E79C445E11925A881A0D3A9849030954BC5FBFED8D254AB3307 | |
4671 | A399E20BC127C05EC76D54C928A3CE1F99F672A8F47C8520C5D444D1EACEE114 | |
4672 | A71EBF58CA1088DEF117A723C391F62C0AF3985BCFD5526503360C33B1DB957C | |
4673 | 039360854589686E27DCA9375B709FF2F8F5EAED9564F979A245AE2498556344 | |
4674 | 69E2A27804B51D5C52844E3582CFA648E82492354EE0A312AFCC4E90866F63CD | |
4675 | 173E4CC6A74D82568D0CD88E078BEB0A5232202C7F74C3A8C80DA4CA4BE6C421 | |
4676 | 15B80B4A2A50F91F7841F60C5EBB4DC67ABB15A3A285214E20B5090E25EC9C7A | |
4677 | 2A8F1C9F2FD755368F61370634A37A2EBDC4B8728D2439D55B73596A2D5B28BB | |
4678 | A83A38BFCE4B84AA3D8D373C53DCF5DBB5A327D9364288907C0ABC0D5E6B1D1F | |
4679 | 7E57E3E21ECD67DD9E3F0E86E00BAE52ABF645D6FE70EEBAD9C853FE34801A46 | |
4680 | 8F6BAB6A2C22BAE5DED459A3F06096ECBA2D20C707A5F47FA067FCEC8C8D6466 | |
4681 | 9E478B07712A577400F5FFC65EC107578C4E6F28961509BB7C41E49F5E45FC1F | |
4682 | ED4AF951E8BF1B261E06E4D8AC3B4CD60AA0FC495E73E6203605E5473047818A | |
4683 | 46C98482D55F198EFECEA05092BF11A982798FACA6AC540293AA90208B56E2B4 | |
4684 | 05A05AA45B2F8A67CA109A6987A670340523EAABC230E0034454E773C31543EB | |
4685 | C1C2A99CBD1DC7532E2D2169C3C25B5853E2F0148E4AB501112B8BF210A5B39C | |
4686 | 1C4E8991DD2DDCC634D3D63415B5C7DFC564102751C1BCA38AEAA8F4E69D603C | |
4687 | 13A5B5A81BAACDBF724AAF76189BF3DB6239A7E19A1B2D6DB4943910A0FEC76B | |
4688 | 233994CDB5A903872A55E51561F06A6B999E0F91C9FEA20E0176612E869FC157 | |
4689 | CA648E8C2C4859D3C17905352F1E950675D8C56369B50BC8C75413021319BE2D | |
4690 | C982926A6CFC9FDFD4BD728E8FC1B6FA1074FD7271C136B260C013A9A33CDFED | |
4691 | A82DB154C0423B391E7BDD9C5B35D92D3C4F5CA5C773AD3712840EF3BD5F3C0C | |
4692 | 9BF19092B9296CFDA740566999ABF31B92E8AA5A92D29840D33625338A3E7C02 | |
4693 | 5854A6B272591E3B581BFCFC1620C9C0F0B128B0B69CF0FE34E56B191FF65DD0 | |
4694 | 59BB27457FB4CAE161551620278082F048A6BE2B9073ACF7A6BFAC7D1F9F7F0B | |
4695 | 3DBB05CBA5BE5424E1A07BA58458074101EB3731E775802C97133C9FEAE5494F | |
4696 | C0EAA6D6CF2DDBC064CE7696F610A3DD93024161BFF27FA1D8075A295BE3B80F | |
4697 | CC225A257619628F07D9D740349854CBF43BD72E25F63249470C6AD3E171C6AE | |
4698 | 149931C1434F22B467BC377604669C077F5806E9193F9E16A737C19BD3FD5C3B | |
4699 | 7420A718C022EF57CFC7D7BDFE22C3FE896EF34BFDC09A6D5A6E559D6E1F4D31 | |
4700 | 8A6B69C544385C1CB338D352749ED74FD1A051ED6579D5F1673522CB02BC25D4 | |
4701 | 5A9A51D740B3A9B6AA52F2B9532A32F4C22FECE7BE96873ACFA2836063BABD50 | |
4702 | D4D0647FCF2FC9975A2ADAB86FE1AB14A5FB4C3A576387A993E9EAD3D401D3B9 | |
4703 | F231F890215B7192A71327BE72F2405E94E47EB82C9A7479B00C6122A94DFEB3 | |
4704 | 293F1F328765B0AB7A2D4B51C48E5E2B6E7C96C765EFB49FEBCB593DF1A90284 | |
4705 | 4C0723CBD625288D62D821F47FC3C28473B3C5DD3322C8D16C4EBEA14523376A | |
4706 | 844F4E51F255B2C1FEFDE840EF9F3E5812411FDB55185100403155B295C63B3A | |
4707 | DBC92BAC9D6973F0D609CD11CC3C3BE89C92CDB21B6C976164FCE64C78C7DCFC | |
4708 | DC64B362067DB28BA59ECB57C2A5880EDCE8DF84606B2A87979DB086E06ABE21 | |
4709 | 2663D35368F31CE867F91BF71FF831CE0E38084F98D501095CD4706C2B82FD59 | |
4710 | 4E1501EDA7B03CCA974AA84EE5B39FED998FFC3D641B2634D72D92AE5B8BE9BF | |
4711 | 64FBCA1B8A80969285372EBCF24A27AE19B48009B144376992058FC36C23CC5A | |
4712 | 6E4A0CF12337A9EB8AF4EB6694621877CAD1C713A85940DCCE4FA1EFB2CAC5A1 | |
4713 | 5FC3CBB1E61418DE140D044900F52A6BACC68CECF39C9491756BD3153D07768E | |
4714 | 9D271FDF798A9BE772E9D6203CB03206020B45BF76810C0315448861A5A2030F | |
4715 | DA8EC1254C22D7CC89684B5AAA2141B7FE3AA4EA3BF55D907B8AD5FDD7488DF2 | |
4716 | A92B28261638A4862130B2EDC13E78F97B9E61B0E933F0AA0EDF58A66BE288FE | |
4717 | 84C209CC1881C5E57ACB026EE9EEA1CBCD4A4B02E7FDEE62BF76D885E26B2297 | |
4718 | 2C274B7FB21A9B660E934FEA1471473999B90DF953DCFB6D68DF5D2E021349D3 | |
4719 | 14314662237C892EE094D4735D2858FFCD6DD748530645E493C98D80A8285CE5 | |
4720 | 6715A6328533B1397C3705CD56E0C75387838B370112A8B235ADC17A0A56E03C | |
4721 | D175FB1AC49115DF3A8068BFAE58E8CBBCE530216BBBD0F9F3944427571544F2 | |
4722 | 8C62339695952397AB33C31BB14D2B0C9F3ADA35ADFA8E4C4B60412A4ED03363 | |
4723 | 7EB00119980897F8FAD36DD39AAEB4D841CB7FD8A232A277AF527D50DE49C5BD | |
4724 | 936E0784FA8D2E9820110C5BA10584B294B2791FD0E49A687753DEE31EA923DE | |
4725 | BBD92D8C08FBACD88FE0677BCAB4938C5902229AE85756DA918D1EAAC6290FF7 | |
4726 | D9F6060953B2BEF26E8C07CC430D70EB307F1C727A57F3D46BD6267A03FF3437 | |
4727 | E1D2A9716E3C4054FC42D3C0246721BDC61D4A5BDD65016F90D55BE8FB63BFD7 | |
4728 | 06B527A49F84B91FB321607879A9669EDFBA9668D1B4DBD407A7D53F7EF6CC40 | |
4729 | 83B4F1A930BA2432BF2C984C4EA14CBFB7030CD0BC1DE50473BE03E04BE50DD1 | |
4730 | 7FB991971A7410A7EE4118F6FE4198835C448B709D612075D0187F1D064A55D0 | |
4731 | BF3AEBDEAC29A16EB33EB458F44B0664E74A58EA5BDD24B9EE38374F68E2A923 | |
4732 | 8E6EF9E9F26315A22BFE353D875F5ADDF0821009F568476C9642BD3B942090F9 | |
4733 | 39B7902DA57E8C13BDD10ED0E137F3521D1B29F287FD6CDFA7D26E2EAF839C7A | |
4734 | 38F06ACD6D713FCBFF0510C4C35038553E463A0761F0A23DC9030F6CC4FF96BF | |
4735 | 99AF97F7D9267593812BE751607032E736626FAE21BA2912CB67547A5624F9FF | |
4736 | 3253923D889FEADC594F8975A032E566CEB10E876AF5047937881C262732BFB8 | |
4737 | 1F73C6FD56077C00902C6EBB852D1747B8FFFB1468E8204A9400C4AAF7F7504B | |
4738 | 89244B5317C1DB608BAF91FABC56827754D6AB01EB4188C1DD73EB4258F962F6 | |
4739 | D18B5C14089225B509D23D5CD4C1DC4EBDEAD354A1B108466BDC3DD86535C7D5 | |
4740 | 9DC062AC8F099821864264F13C4AB2441E7ACD2C47AF331AAEE509B0BA31A92F | |
4741 | 18CCEE565B5CE02FF94D635AAAFD9497FD00E8CFD213D22F06BE684D43369131 | |
4742 | 24DA92CD0D50373B137892A8B6A9D619094621247B06BE1E433FDB25CBEDDE0C | |
4743 | A7DBFF7A6CCD6DD55186F56A089E3901136B014C0F5AC86C819D5824292E6FBB | |
4744 | 17704445C90AC7BE8252FEB750B78804B33B2CDA000073A5530C7A7F2A4AE279 | |
4745 | 4D627939E1DF094EFFD5FCE391C4CF81949BF45203819647EDEC018D18CC1D5A | |
4746 | C0C1B1FE3D2BCBABEA21861E2F2FE5DA884F134A93F17F001DE4D595014F3E76 | |
4747 | D4ABF5249A652CA8B53ECE9461924FD87EA819F5F68893EED1A7A1FE4F231514 | |
4748 | 3E69D4993A48F014F7E4FAAFF2D8685DF2FF50A41F309F5626E6328EBE3D7793 | |
4749 | 6B8EB46F10997C63901343326BC91D6945666C8B3362A1A94A73AAD158E38E2D | |
4750 | 1436AF6B3AD32B064A6FFFBEAE70AD11ABCE5ACBF810974EED6623FF916F947E | |
4751 | 8897C2171970FE02EF18874092950F75632A916FC6EE77883AF461597245F0AE | |
4752 | 8C9C7005217A59C63F192A57B8CB74D07048E7A25F294418AAAB0ED28B0229D4 | |
4753 | 2571A21B6B46570EC066319191D8B155B903598F4942F692E3547AFE51D76191 | |
4754 | 3A16F163FCB3A73C36471EE438FD549754C91190553CAD1FCC0BA3B1C1921470 | |
4755 | 78784DBF40B54294F9EC7EC7F5A8D574CF9CF9D22B5AFA790BA5659631FA3059 | |
4756 | E2E1953F58FB83780B1C99407D48B75A13999CC536089B8AED30485E52DC4985 | |
4757 | 82D1A5790B451407C982AD06399DABB46A1A4AFAB1FB85F11B558723706CA227 | |
4758 | 37FA6429311FC4A178800ED5DAFFE353929EE385E7AC9E04E4FC63C66296C1E6 | |
4759 | 3C5E2DEDD62975D7743C6D35155A5A8367EF7395E4092F095745C3192A5A66A9 | |
4760 | 7AE6B45029753FB2230B881A5F7B0A393AB2193B15C06535458598458618C70A | |
4761 | CA5EAAA28AAFE895B5D4CF0A6B2E3C2573F790EB4E0B91C69E1E17FA78B77CC1 | |
4762 | 376510918CDF6E955F231BD7DBE1D4B0C1B663DDDBBCD1D95024181273D58215 | |
4763 | A7455285B8DE11E9795DC15B579EA328D21E9E2F8F276D3D7DD7DD69A5BED0A9 | |
4764 | 351216C84EBFDB27DA7A3E151B42BFD9165B491D670014B3FA0274F15863F51C | |
4765 | 54C322A69313804D6960AA6F0CD14A970F28182796656266DF384B25F627CF3B | |
4766 | 5D51F9831719A33AE20EB9CD0511871B416E3DDD76916219B7C93431CF22C76B | |
4767 | DBBF4D6E85432A920C532D8EED18515C4352A52E0B3CECCBADFC1C1133267F2E | |
4768 | D66668799BCCA45FB84FEC96E1BE5F9F62784043B71C05383C353CC53F04162A | |
4769 | 9D8419FF16DF736F4CEDF9EC973C501587145DB5E1F1ED63838CD8312011F19F | |
4770 | 94F8BDA1CF1225204B9510B972ABAA4F6E9A92A86787127AD97A42BD3952C5D5 | |
4771 | 3C588E96FBC8B48C088979F3881BE01C85B53BD456E0EAC91B8A899BFE0E5C1B | |
4772 | D6E38EB78BBA172D26B7F1F6E90F029AFD3CCC6E3B101777F6E045D8892C2005 | |
4773 | 12CEE278F85797C382624E847BDC406BDFC013F099F6236C6B4C21D85F205D3E | |
4774 | 6FFE140165D3176467E7B241E4BCEDCB0850B03E2810045E79E3190BC6D251C9 | |
4775 | 8A2D9CA4314B334868DD0B63DB9D00CCE4D80B4D359E54E9E81F01799905F8A5 | |
4776 | FC2860201F49F53045CAF0D9DDF9EEA4B00221BE2EEEB189D5E1CB6B15DC91E2 | |
4777 | DA3C7A24A571BB9517F8FAC84F7DD0A41F53148D61BC69C6BA042714A69340D2 | |
4778 | 86F5874B6653A43EFFD735CBAF59B539B91C1B05E6699A74B1995D5E6AB5601F | |
4779 | 9A606A94F85F32DE43ACF78E3E2B75411565BCD9A90491E29E22DB3596F92BA6 | |
4780 | F7C2DE622841483492295376FCE5EE8BA0B13D54740109D82F686810A03CED91 | |
4781 | CA7442086B0E3A5DCC22F11FAADA1474AE0B6A893B3CA6065343D21B834F7239 | |
4782 | 48B88675A71B046352293E2FA73932485BFFE08C8CF502F6BE95E999660D8B2A | |
4783 | 0FA634AB11C8C4765CB478F19595D5AC0EEAC22E20BD6F30B1A1E3B10805CE25 | |
4784 | FA694E5DEA8DC007C05D654BA6593C846B1FB7548A7ADB2579811D5785EAD68B | |
4785 | AD679E1B61F5FF45E4F8684C7EB447EBB9C9F19C1D346A1D321F2D49E84FD923 | |
4786 | 5C54CAA7F85B97232B8CEE6BD06F88F71755AFBD86D0CD6FA10ACF67CE92B40C | |
4787 | 605C488E397A2CC9C206C3D96133EF0CCBAEA910F86DD04D645AB8D40F440439 | |
4788 | 3D5F0DE8C89DD451C007793ACB6592E65441A9F49BAADB4C33EEF1BB685A74A1 | |
4789 | 25BFB78143CF48AE6E4220532452C6437E8FA281C961C9D205DB1B9ECE54A7B2 | |
4790 | 02128113842C8454CDD922610DEDEC6AFA3605F800A2C66B1E014EE0520FA2EC | |
4791 | E033F8E7BA6C6A64334D877426070CC64F4A30CF382F2FA2511FCC4E8F32B68B | |
4792 | 10D7EEC8A2D3FEB524B64E1ACC9A5D888916D1C52CB3358E4064926E46A0E80A | |
4793 | D7D379A531BE1B3679CD227B51E6D6C02FF46437C0689E7E5346D47AF8694844 | |
4794 | 8DD0BA48D36677A4E612DF41F5109385E07B96AE023621BEEFA0A691E2AA2B90 | |
4795 | E8CADEA34F5570B8B23BC40420ED1D6B2561C28A147E099EEDA54721E38D48EF | |
4796 | 4C685E67F4228E94F657486A8066269822E58B38B3BC343F9D5F57987579C683 | |
4797 | 1568DB43597420CE2BACAC2BB30614464BA2D6CD239CAA21F4CABD42E0025967 | |
4798 | 017314B488D7E5EE80E110F82477CCEE750ED06A76054A57FEA3E58EDA4E3C3E | |
4799 | E420DAF021E8ED0D4EF74864A7A1E824C4FF703ECE2C7A1E6BBEDCF03E07B370 | |
4800 | 4E1165A4EDD682BE80FFB57B031CF2F1AA3A087FD8F0097423DD6C5CB7534B5D | |
4801 | 657B06513CBA6B7003EEF17DE1694B408603A07E466032CE47A12D891803588E | |
4802 | B1C2A4654A823859C31F6A9C1E43A6CD1BC33ED401C057ACF6226FB683A81D5A | |
4803 | 9275BE95DC05E58600D03387859171860B5CC021542EC0F9A1D09564CD5D1AB9 | |
4804 | AB4D7912746DB575690193F7AF9F1E8796C9D768C36CC1E7881B7DAF0B577A49 | |
4805 | 3120506D2C28E487509CE32C3AF08DDAD24E3661C510A118B1E6532BBF715A0D | |
4806 | 6823411E2F423322A0AE1278664A2A391525C51407FC44082FA112B052D18241 | |
4807 | C4BD149FD298430464B8805A392636365F16B552C3A8C85FB4391779C219E8C8 | |
4808 | 7666533C8173D05FBD8380AF078D402E8ECD110D8211100B61C2B3AD289F2ED8 | |
4809 | 06513E48847DEC3265DDA8589CE2D08462D88BC1DE42C42C7B85C5814FDE1A22 | |
4810 | 185627E533C6D6FEF2F08829E4308401F9A3688E43966F682E008CBCEA1FAA78 | |
4811 | AF167872B047977087BABE9CBD0D32C5BEE00DBA8FB601CA91632BCBCF931FB2 | |
4812 | 6A7545A1B85240B4CC322AB87215F7FD0861E2E15D6610793D37343DDD37CFE2 | |
4813 | DA8FE76F21F89D36681AA6A43DC0A18AEE2B8890A7888DEBDC7706B0950C5941 | |
4814 | 1B4E0DA58D126082D077CDED69545AEC02608232764F1BD76E619096084F6A40 | |
4815 | E2C90B7DCC3EC1B44B0A9D57CF9A26175839B5E794DDF3D971A66BD17066F96B | |
4816 | 8F5BCD802920130F76E434A76F8FAE8CE36A682B88013043CD4FC58F0E43957E | |
4817 | 6BAD3CD19DA0CDDC20A1A59232EBA4B3D7BFBDFB03B340476C88C8D1E2610162 | |
4818 | AFA87AE597856905EA9E3BF9A9F876708E4EE74EA2B873CD6334EF39934E82EF | |
4819 | 57FED286EC865B17F0458D8C80EEA530A48AE583D90327BEF4D5572C2D6302B7 | |
4820 | 2826CDC8273D472681AADF689B1C35468B4BD921176E2E6110B701CEE8849057 | |
4821 | 1308F271EB8865D933305FAC772D81DBB57AB63B9FE4A099FC5C12A3D0C3B53E | |
4822 | 5734D8F9A6363E7A495DA00171614BB09EAC3DBDF70FF4BE66A1B7CBDB0EE947 | |
4823 | A66EFB7FE439A044014FE080B3456E6882885826AB7F7607B83420EB3F1938BC | |
4824 | CD256A898830737E39B674A2AA18FFEF4A5060294EB206535C95C56EBDE03FC6 | |
4825 | 58A99B4F468DFA4BE4F63E1355C57B9365CFC853D4DA74774E8C6EC887F1BA26 | |
4826 | 5D1850271128267EAD0C2B707BC18382C8F1C30F45DE1BA668B694AA78AFBB5D | |
4827 | C8948DA576469BA18204F616F978E606BE2B07BD972F3247351D3F8119EFA501 | |
4828 | 7C471171B70EF45ED3557A26501F599B7606A1F3D3F543C840B38AB2A9AE7D3F | |
4829 | 9AA1633E6DE860AB2378329FB9513F1B479B9C553EE43B4565E49D4FB7E39CD2 | |
4830 | 998D5FC63EEDA03C1CFB5CC07F3203AACA07C853B69DABD3B48FF745B79AE1F4 | |
4831 | E6013DA04F13E069648104D5A38A2678F31BB1DD166D07578DA08A3476E773E0 | |
4832 | 9C23D8E05016ED76A0CCA6BC01BF814996AAF260249389C47CC8CE66B454A5E9 | |
4833 | 2643DC04C42CFB12FBB9ADB0E78C79C982D7F24B2FB4E5D32EE804FFEDC9FDC0 | |
4834 | B9984261D8124B3086B2303636C1DCD552AB7CD18AE2E6BFE248D02882014F5D | |
4835 | 659C48DB8AE75DD1C5589272EC3D33A552089E26F80142AD0CC676F70A94E2A8 | |
4836 | 70BD0F2DE0F1BEAA038C6EE73CF58AA15BE408EFFDE8BC1B2645E1C13272EEB2 | |
4837 | 45E63EC4B4E34DE3F1BF7E8530DDDCAD1DB9477E253BB0CDD7DB76423668F37B | |
4838 | 6D8CF668643783F562D1A88F831885F92165158476A408B5891AE6583B10E0A8 | |
4839 | 2DC1178398D7DDD886B05FEEEF6505C499EAE9A4ED51099D3D424879E7BBD4AA | |
4840 | 61C14D18B0239F63C1E6A3D559D232C4833E09C36B5E7A22ADC68E1963610666 | |
4841 | 1A6BDFB86A6693CC2CB647A4E339C09BF17FDD40BF22CD952491A5F5A66B9732 | |
4842 | 017B68D7961C360A317C013F335CD54FAED7A0F75C75C25C575DE3E65E3F0FDE | |
4843 | C30C7FA545BAA0A3A1A22BB859C16F58E93FB0CA74E98E3899D7923C055AE485 | |
4844 | E75FE2C05DFF8874F452796F95BAB9CBD271423DB40C6087626C5122454C6A9C | |
4845 | BBF205BC00D07D9830F8AD3A76A5A228E9911583358D2122F959B233A8F590FE | |
4846 | BB916539D2AF54A10C52AC6541B1C1CE997480908E02A722256EDB75BEC4E962 | |
4847 | 1CE8BDDABF01A673F31775C408EAA2A5FED6AAC014B05C36F3C54D9AD2DCD025 | |
4848 | BB70733EA2185F9FD618788854DF25427E870D37224C6B6617E3FA0C251C3FB0 | |
4849 | 6B358CA539D752088A0945DF665D6488E37017EBCC6502CABE9CE267BA87A6DA | |
4850 | E48B1F12FAA0BF3C12FA2E860259C6586FA7843F584CDA55404C88D283141685 | |
4851 | 41812C6FEFA7A66AE6C731929D09CE093EC6712749285DC2FD2512F40EC1B114 | |
4852 | 70B7613B43D761CB6A02F570A059331ADFA10921C3A3C4E6BE9637FC8B690F23 | |
4853 | 138A098D8E1EC01EFF56C86D246BE7270FFAA7C512C6FBD96E3C472F939C1893 | |
4854 | C8A3394C34045B700CF10355913744AF99463D6E2573106B2FB9ED07B79ECEDA | |
4855 | F9F6D041B6061CFD8E02887E5C5B0194243F3DCB40909C3C03333A279E0D9A9B | |
4856 | 037B84BD6F7300D0E5EAF980EE53B7FD883886528D521DDE4F74536C7F1C5BA8 | |
4857 | 6CF279C90DDBB82DDD1EED77FDB05E8350DA91080BCEE5E3C84F003325433D10 | |
4858 | D03C08B43EF95318EA3748DB9BF84D57A712C0308E80F5A54A38F0B2F7AA403B | |
4859 | C57BD4BB6243F7A0B09AB0C885735D9861115ACA7567ADEA6FEC6F59973584BD | |
4860 | 43B3AFD18824327CD6C21D4FE1F16F6C67D01B97FBB6F70DB5D7D6E46FDE0D09 | |
4861 | DBC1E45DCF82E9FB3D465175DCBBF254C59447D3C3DF1F66E0EF8CB6653EA52E | |
4862 | 4C1D346D33499D2CF129D9704D74AC399DA2A23092216969B5B8D8B520F05DB0 | |
4863 | 345E1BE31E211BE01A1B1FEDCD9F2699E9533385D29F0C80F990CA5A874EC60D | |
4864 | 8CDBC045FC2E2F6E7A2E426C485DD04C4052A80568951B7C5B7A7FDF8DD163A3 | |
4865 | CA1D6A36A80B7CB4401674E6E1B9E8F2DEF2ACBF87879AF5131DBDF6A0458B01 | |
4866 | 3243CAFB8284DF8C4F946C328B453A363103665491D387CB40A493B9159F46F1 | |
4867 | E95207F8E71D827A15A895EB17899D2C0FD610B9C3D3F8378310602034DA6BB4 | |
4868 | 6131CE208D659FD3AEB590D2CA5918ABD2C10E16DC378CC922D605C66850C6FF | |
4869 | 2CA7BB0A1538BE6DD5CCBE51CA7509A995F2FBA6D2813AFFFB625604D25D5BE3 | |
4870 | 4B677D6CC459FED33F0A58E740A1EF93455D2B7CD3B6D7ABEE83D3BC3823F2AA | |
4871 | FA77DA4784BB1DBDA4083D991F9104BB62EFE168D1BA37A2E3EA54BFE6FC2C94 | |
4872 | 47078B5E340D2237B312258AA715FE854291D40061B6AA9F9907146EB2FA3B1E | |
4873 | A1CCF2C8D2FB8230406FEBA3D184317B4F7F777410261D500F55751A0A445DCF | |
4874 | 8B100FE5B149B2D2880C3390422BBB8E8C6B8A8B773072A0091C1BBF8415B329 | |
4875 | D16FE300AD05CB4B62C90ED22ECCE09B5786547455213BDCA572889B926E3DC2 | |
4876 | 6FCA839E42D5519C1C2CDCF412755B645AF3BC38897CE7750B8E47F6E352702C | |
4877 | 9C554B0E2ADB99F2A0CDF93DCF419AA331BA310ACD315C11912F4F8898EE964D | |
4878 | C1E9B8606981B25AEB7E411114D74B37952C0528E51447675CD888D80A0F15C6 | |
4879 | 21A42FC33BB3346D51B6BA20B726EC79F582A90EC43EE690F0A83B83D2E23F3E | |
4880 | 4F5C12E8BD48F1CFD04A189937925596C040562F4DA681B185BEABB00F7EEF7E | |
4881 | 1E44F8ADFC6792AFC7C3C809338A6B1C046917289139040D382F60652624775E | |
4882 | 6C6214AF5BE1D81A2A23CF2380BF6A13E88E87E2F1095B60798AB4F657A26671 | |
4883 | FE1C598578506C804FD43FFBFB76DF8D4C8E647F9D021C46011E70880A8AEDA8 | |
4884 | CBF3F181533340999B7620066A460E564C3C23FA8B29CC1BC8D337E2B1E49ED6 | |
4885 | 9D10EAD96A52AB4D06982F4C48873C6F4872054695F253B592B83A1BC90A4BA9 | |
4886 | 8371C4D319DD261B9A0AB13F74274E5B376A3288FF60C93421F114B51355E725 | |
4887 | FB265D39C00AABB2DE4300968FBE7F652C4EC71A7EBD58A20F2B4C1E2D1E3646 | |
4888 | 902A0F815E9D67B50861D6CC2AE3AB45BDDF3782D685ED8E41C0D8F1FA37F238 | |
4889 | 00A8A3ACAD22D898CF8E95855558179BC84D199C6C79A3EE2651167A4067A9A3 | |
4890 | 49109AE7F53B59EEB1F57DFD4A00077DFC2BD2CB1E3169F0A348D4DDD2D9BFDB | |
4891 | A31951065B0230504FEC2975FB5015838759745EEA1347DE8591A58783F1EA48 | |
4892 | C7A7456E94BD2ECB916B85160277F98FDEC95DEFA7FC19532AF90C6AB3399C55 | |
4893 | 86BF03B871A4C4386714AC62E44857919EEB2658D1AD72570D70F1F9926D6B3A | |
4894 | D12988299F620196898ADC3125C5A7D11765025B237983BA1DB66418B484B022 | |
4895 | EA1018CB14150269A089EE9CB3EAF08D4F7E15E29048F729B9D39A15C00B8715 | |
4896 | F030F927C8AC027A3B040CCD0CA1FFC5C6BCBD00457BDDB418BA3805C30AC43B | |
4897 | A8DAAE706D404E22DFEB24AF9874D741C9DA45B3163C259E8DBFFB6ECECE2B97 | |
4898 | 6BD4335015222631F5D86490C0F9BD7C22ABD32D6DD412DF772548B38399EC08 | |
4899 | 0E28700A2ADAE8F0D50EFC4CA8642E0E996D72BFCDEE1CFB252A6F4D8E03347E | |
4900 | F6328BF18282ECBC88DE3FF382726F910FAC2DD599E63EF7C3068C1CD785D101 | |
4901 | 16B7671ECE1E0D30CCA1C6F2D3AB5E81E309696DBE4973F71D240C207CF73CAA | |
4902 | D620DBE563AC9B2000A628E8657A45A24030432AC74B5ABDD022CCF6AB855E1A | |
4903 | 61619EB4DBB848A6C2ED5745005938EC8F516979806AF5E714704027A0CECE87 | |
4904 | 4C44DAE80608392EE0EE0E39555ACADF1D3A873D35CA84D87ECC2AC41937CB62 | |
4905 | B250E3C1AB878BA32AE2E161D13FA536A305B352E3E0210636A81C6655CFED25 | |
4906 | A2B75AAA6FB0D2FCF696358223E78DBC2B9BCA15271F7612769ADC00BA66A2FA | |
4907 | 8E38ACEB99E18B7B4A5C2B7977169EC141121F0664EAD87EDDA372BE22988222 | |
4908 | 27D477A6A4715C71091CB2F01C6B3176160BEE79CC8FC854166DBB093A49DCF5 | |
4909 | E45AB3B20EF3223684E83C8FFB2D5DE9CB49754799E038B748E75C99EBA6D69B | |
4910 | 36E162CC3860E33896371D0164C14138181F2E00FFC08E2A3619E1820A560C7F | |
4911 | 63B054216AC8CBA7B034AEEA8E735705AEBB0D78F17856E1A0476DA6E543E985 | |
4912 | 4F7AAD98E3ABB2D7B4B1629FB0E24B9FF10F06192AC8475CF8C35EE3E635BEF6 | |
4913 | ACA79F1847FB84C4B20E6067BC0593C7C39657E08A3CFF64915F887D5B99356D | |
4914 | 91C0722A917B347945E1A867B062C016EBB7D924F11C74873EB4656B61A41CCE | |
4915 | DA1780D204D28B6F0CDCB1E059B3517A5AB44D45B43221DC53FC699BBDC4F2D2 | |
4916 | 865C697EAA3B49D2AF5A4CBB66244196A3D8A09C8815FFDA307DA47760CFAD34 | |
4917 | 434D00946C23BE41A6292220F0CC19CED3277801C9C1C3CBFC755A261B4ADA4A | |
4918 | 0C9C3E7F8ADB77A5C68021775619D9CE770B4FE975CD468BC5CED173CE1356CD | |
4919 | A26E6AE273197511E50A014B19A5B79C7B75A57B08185B20AED966A4C9DB4426 | |
4920 | 1294A5BF040A05A4FE60FB202C7CD2BE018DA7702CDE728193B72F03C3C0F1EE | |
4921 | 58CEF81EF167CE9F8967B4DB7A3A3BC0868B8542DFF05D46DA08CA79F62ABDC4 | |
4922 | 39373C66A08D536491CCB5EE828E410576057488E85A47D5D9F99F748E19AC88 | |
4923 | E207C21EB573B9429A7086A93CA63467B3EDFE08931BF575DB82B76AA9C05E00 | |
4924 | 29C7D4F53CA16E6DD53BF23A0991B1C5B4902E4DDD5178E55C2BAEA308C5877A | |
4925 | 3A21D1184FDAF68ADF993920AAD2EDB045E98C990584EFED9250A332BBC01217 | |
4926 | DD58CCBF7DB9C0E51473CA37655DECE639C28E04EB47E5B52DCA10E92BF83F08 | |
4927 | AF3EC395D0A74BCD4377EB7AFBD1F0B521F6D8F0741A07BE28D6A8C235B90B7E | |
4928 | B448354C9FD450F98270B3083515004B56718E81C4C6654E40B692780D83695C | |
4929 | 3F456A401A6D24740C67A485AA8B616B94B23EB889AE93CE66F5CD6916E32C66 | |
4930 | 809F5D3C4D52195D1335F89D1AEA6C07A1AC8E8F30AC662E11541536C50A6763 | |
4931 | 5D8C71FA8E0EA2BB0141FCADA7AF9CA0A69AC758DF87159707038D81DD706B6D | |
4932 | 123D53212F77FBF6AC06A7771FE86D254F9E6B29045CB60628EF491A26226D02 | |
4933 | D799A4B2E1E4DC25BB157BBDFD0958E1A4617EFF11145D3EB94A389F514D1247 | |
4934 | 4B6A4CDE1DDF18A826C0BA8FBDCA2045C3BD3465C371248428A4CE147069B2DE | |
4935 | 63E85D5F92038E8986DF08510C6FF1DCD615A7164A287A8C8C869C4B1151820C | |
4936 | 8BE898107D19E768E66125C6A6BCA28D1A99BD7E6F58F60DA14E77ABA2001B54 | |
4937 | 899B488C4DE7DA167A762CA3CAB0E8D157F6BED3679F019546F0322A7F6ED7E0 | |
4938 | D6AB34BF0F646E07A4C08EABC1DC40062E17386A406F88FF43C3AD322E8A85B3 | |
4939 | 9EC8C24C751ECCA65BC7A2ABC5BC0E8C883ED0FE37DC111181650CC6DF943495 | |
4940 | 5F0DEE475D1CFED3C23655E6053A884DC41E8A4D194A02051E5F7F38C625FF89 | |
4941 | 5894F611575CF75A533095881952BAB2C81BD8C303C903C81D937E4D72A28261 | |
4942 | 2167382EB3632D975CADB689A7DD5419F12E32DE2345CFAD7A85A9ACE0E63BB5 | |
4943 | 3C49A690274EBCC5CDE015218223D2FAE1A1E7344932BD8CD076FE564F523B92 | |
4944 | 6B50380301C36A67A264AC735C9B038CFD7D897ADAEC00EC65E174F47EF1EF0E | |
4945 | F4A1C83EAEC77CD415ADBFF5E3AF7769661AD8506C356C20595B1BBB7BFF1808 | |
4946 | 92015E73FEBB58376DB5368C54BD47B486330BD22F9E1804A05B350671BA373D | |
4947 | 737BD0BBF7E78ECE5C76FCE2B1DA10BDC7074164DCE3D2940F1CDBD02A996EB9 | |
4948 | 7F4227B2446C7BDC11AA79B727696467941A4C2E3D51E3EAF366EAC7857F8180 | |
4949 | AB05461898B99098E955BFA09A8371FCF1EB671DE86C89776B7C90AFB9A4EE02 | |
4950 | 39B35FFDE25BE1585476BDE88912D1E2D4C1083BA56BA4346B90EE84E6CE5BDD | |
4951 | A7CB599B4D716F7F25668D8C559E2347F20311D49CC7D3D4AA0117D017F065D6 | |
4952 | E43EB82320EEE8B29B7C7B83A6CF79D3A20B16393235FCE7F9D0D5592A80B33C | |
4953 | E664FD2F2B0FFDF29C89F7F5A5B0EA96456CC42DE1C2BC36E791BDEE54293D48 | |
4954 | BAD9DFA71606A78B5C2B8120A45F17A394F417C60CC181EB7ACA7D461A1A8095 | |
4955 | 2372E368C1869D19E4A1A23607B6C2B0FAEF474C703492E7C1D68A3248CB8F77 | |
4956 | FB17BDF28A502BACFB2E4601BE018D24EC2CEAA4537271B2B9BB7807CF447BDF | |
4957 | 5A7DF27A00D96C481ABE0B02EC0B61606505E357FBC1BF8F1A198A184BFC8B88 | |
4958 | 1ECCF1EEAFADC8D299F72370BF10AF53EDCA219DBBE145E0F1FF317515BEC422 | |
4959 | 623045574C79B689412F5E7E5B66FB463E11C507DCFAF31AC1AC380F35CB7DA3 | |
4960 | FF9A0B82402DE0696CA50B4CAF93667A489C1640867AD454CB797645710D9929 | |
4961 | 4857D74A887D7E458109B90202A50ED46F0375F71482C7C6BC14E5CA6B001206 | |
4962 | 62A44754C351B56B41AA8324EECF26A80E7D3FD85086741E70FD33C8BBD546C6 | |
4963 | 3AA832DD5BDB976D17B28481B7DAF12DEF348DDFAAC53E3455F82DEB8056C13E | |
4964 | 931F9159178FF1C744AA7882E7D49D88398EB3D023A272B8A89FB5659AF715D3 | |
4965 | 0809BB26F3EF80A788CF54449988A73B416219862845F904E091951992A279F8 | |
4966 | 33FF4A4CC37F9AFD5521E41F6FF1F12B1D9C7C0482BB38D1BE007DDCCCC37C9E | |
4967 | 1F7F34B5ECEC3E6DDF6F6EDFD95605BF60F55F2B1D345430A89813FE189F391E | |
4968 | 844C44571502F66FC3A56B222DFEF0D676041A660E6D741D8F72967DDE8C0A3E | |
4969 | 96BC0FE3243DC07CBC1F0E99619BEA04EE85039B404122E496AA7BE34A4775AD | |
4970 | E4A310C1C020AFC6E74279DBDD0F6F374691D8E3B6EEC90B11AABD20E59F8595 | |
4971 | 3397C7E9BA2052454250585469A67EF40741A9F09BA2A2A04885CED6AAAC081D | |
4972 | 0475A63CA91BFA5D6A3770C1CF80F9D01521A51D815ABB1F31A89EA13412BA42 | |
4973 | 7F1916165E012C0A94135C485E42A5161C7B94A02724B5E6D196D42BE3F408A1 | |
4974 | C11D207F5EA2CC3F2DEDBACF246719BD222861389AAC1ACFB94496CDFC5F3348 | |
4975 | 4ED4336E52D03342822CC7E267C2C9694D9C07448ED043C56C57123B08124AB6 | |
4976 | 8EC0700E42478E6F0FEFBB0549B2BE787570D2AED16C44AACBD6933A925055A2 | |
4977 | 022517A427181398FF7ADAAF7910954360EB4403E16A92D7203A4587ADB06169 | |
4978 | EADDEBC7EA4AD684C2FCB0C1008CA92508C4B755E93401568145C5555C8B794E | |
4979 | F9FE03CDD2D904FF6B3C4429188DE0ACA011BC44D0ADAC60939EEDBAB25AD69D | |
4980 | 48A5E171F88DC43B1511C6883DA9AEA734590F09FB58793D0BA23CC46DFE5FE8 | |
4981 | A9C82D1411002EC457793FE7DA76D29FB65F026587DB905A1EE651AF6E4F2122 | |
4982 | A8561A524984E0FA2FBDFEB7A8A4935DF29E126C1CF41ED66412FCDA7D07053F | |
4983 | EEDB110E865CED746D2530704C3D906DA828873B6AF2FC2D9E9EFD835D71BEB4 | |
4984 | A0C889B6156AE539B48E0D8026F5A8FD0DEB71FF8EAFC66BEA2130B9005645C7 | |
4985 | 6FCA01DE45783C2D7B75EE9A9A6A8F5BA5F1B13EBDAF2F246D701507DADB5518 | |
4986 | CA8E75918A1975617EDD5F5701AC7FDD1365F9408E3BA2171D4903A78D223BB8 | |
4987 | 0CA0E842DDBBA3C6B41D2339A7C620692F10C4FA9E8C950AAC4E86607955BD81 | |
4988 | A4E3B0131984BEF21770B436B286B93456646004854BA2055C3DE31CDF212205 | |
4989 | 883E2D4DDF58152F192E50B4663F0F9779B455C665ACD6F40E7948351BD9F78F | |
4990 | 24550832F18950ED308B402D5FC6327CFE094F1090871431A59C7238CF1AA562 | |
4991 | 3A976BCD5808405E7BCC3DED691D332C9B279C849936CD65A6FEBCF58CC2311A | |
4992 | 054CBD1D630459B59071379C3865C3C6A14E22B5B0381F44372DF1DBC8727B1C | |
4993 | 59A733C294C4322E243223A986FB8D2BF832755B5CEED304E6B3699998B223E8 | |
4994 | E28EA70BEA1358C2CEB7AB07112D30B83197B263E56937CDD0F074EC29FAE7BC | |
4995 | 8D6A89133CE8F837D64B703BC40EB64F2DCC73C763A0D31F3C058B5E9443EEB7 | |
4996 | 52874573C500ACAE072071AF89FB9C4F4641AECCD14F7315150E5947731C8963 | |
4997 | 55403D9A4A92EFAAAC4F5F6E95B4751351C4177271712F85495397CCFCCEE992 | |
4998 | 98E7DBADAE9D3C1F273AA78F75012CA5AA357DB035655B3D98ACC2988169E894 | |
4999 | C573D80D60010DFE08394A6D05932944E07BAF050AEC00E45E04A424C6C351C1 | |
5000 | 511DB1E856616281570F6DB61D75078B2D1DB18629731358D8663C615782D63D | |
5001 | E6D7D9464CD95D8B446E563D684D16914B0CA2978C473CB514A5A06D25522569 | |
5002 | 9CD74C4E46C95DCA19C8AE79ECF576A677BBEE3510F93C4176A4B5F1A4F24E36 | |
5003 | E0C5CEB30DCED55B7B051C01AB5251CB839AC2E371944C169D9CA4AE4B91450C | |
5004 | 5503BFFCEBFE1AFE8574E2020D3DF2BC16BEDEEEB76C7FBE3FEF7F085BBF4BCF | |
5005 | 2513333E3A01DCA64322049010D1802D1E50B50E39768F960BA243AE4A79C12A | |
5006 | 54D8F7CB63476916E634273F76663E4496466DB6BC16CE9E74727C9EE9FE79FD | |
5007 | B27EF3DF0E46EA9C028AA3FE5470E983BB251AC803FC07164644F385B6BA347F | |
5008 | 3FC80E540BB262BB5E0CA619CBED3C8A4311B9C2B0EB70DAAAB4DBD04CA642A9 | |
5009 | 53FA5B77D48384A8FE1F706DAE7DC478145A2F97FE5075092149C536F32A83C8 | |
5010 | 32DEB9CBF5177AB311222565F16AAC5109F31F7C84321824ED15CF558D65BCA4 | |
5011 | 9A73C570753D325F081EE9A3A78AA2F18258C5DFB32739242C0297C185C22200 | |
5012 | 34C6F979B51240A7B1A3326677929904B567550051B4D548F3AAA253111F7316 | |
5013 | D3C84FC22E64F65882773C7AC585041DFFE3A6A15F365D825FA0C43DE16DB215 | |
5014 | 243E53975DFAB3C1FA30D6CB8B52B9C55FEF96526624D5D8807AA901B16293F3 | |
5015 | AE0C4E03E6E22ABD78342AF9837A380BB99B68ADF493C1FB18CC4B968D707AB7 | |
5016 | B744D296FFEB8F2178B7C47D94DEDEAA916AABF76FA32BC0B86E2526F66ECF17 | |
5017 | 6FE4A289C2571DE0F86B9B44459726C41C6C648838F928A8E6FA682A43DEA7FC | |
5018 | 3C724137DAEBD60591A73E72F2A92373103808D3973501F08647028F83F2A9FF | |
5019 | 400344095BCEC1EDA8A93325FDD58769ECB58511436843AFC403B5ACA14B7F22 | |
5020 | AD9D64C888F1A8F4E2FAD374804A72E16C0DCC0F2F56B91B3908FAF52A2C6DAD | |
5021 | EB9BF87C40FE29015B6E655F40FAC45FEE240C5DE731CF7B54C0F48027697146 | |
5022 | 3A6FF6ADE84F6CC90E3799331799DA11AA92F445929BF4A95E9C5F4BD4D63CA1 | |
5023 | C84FE7BE3CDCA2ADF4DCEA99EBCD25D7724760516259D45DDC9D6CDF7E538128 | |
5024 | F3D92F8676AC2D0CFC3687AFB29E8BAE8671ADE209AECC9CED20037759EAB6AE | |
5025 | 42E1B41111C9BB92D422CD344E7CB85A7403788C7765AAFA62CBA09A5522A6A5 | |
5026 | 0EBE06D0ACD23E77BEF1A15A9E99A4713E67E7C08467C6B2890EEE9AA1F0558F | |
5027 | EC24065FBFB04573E13C52137EACC7A931791A5D5F675AB42E9B716DECB6308D | |
5028 | EF96E59E36E8D40B99A1E6D9F2DA7F32C1E47091733341D89DD109FCA2AFD4B6 | |
5029 | 2D65D6366EAFE4A5BB0891B9344557DB94F065B3CD7D75874AD92F24454C2B21 | |
5030 | C4D2600AAD92684996A07B4DBC73BF4A3A01620373202E31B7495DCA42DA4B50 | |
5031 | 6464003C1431AF808D30E08C4AF67E5CAE26F78188000AA0E8C97151491BF1C4 | |
5032 | 94B1CDD72126412E0673ACD9B9322C3EBAA2AA1D039EFB53BD2C708873BF77A4 | |
5033 | 7C89B9A48EFAB9E55ABE4FBB6FE868A9B2D86F96A5DB527514C6361DEAB44B53 | |
5034 | BC93CE3D3546324D72B13FDCB33F519812C1D9D66ECC126F8C3724F4D194DCD6 | |
5035 | 3FA6E6F06B2509FCEF85C6A80F9C2ADC3D15A9562D2A65C4D1392FF915679CA4 | |
5036 | 36E048D8C93D540DFE0265952094E7E6C8CB33BDCD517247FB81D564670F3964 | |
5037 | E65AD1F253EC49752D8ABF2CE12B2425551E7F03D5AFF08A7AF854E99322B8AD | |
5038 | 4C2A300672CB3A06B668A11B752BBE824C07531EB46698EE6C6B65112CB77F0A | |
5039 | FEFA9A531F51D29EE7F45E8D0C73ADA57B32099FE3F0DD59BB97BCEF2CBA4E84 | |
5040 | D892E8B6880397808D46E78E05F42AACF717A2DDEC317BE5E5FFCAEA963032AE | |
5041 | 515B76D34F880C049F3DF624FB85DAAFE31882A2D7CC9C29E7EF28E2AA4C46A2 | |
5042 | FE2B035FF8303879C436EA4A2BC67DF287FF0C3430E9566857F0CAF38CDFD955 | |
5043 | 559249751A61BB9ABB4946A31881ADED4F938C6468318A97B9F1D60A59C996C9 | |
5044 | C8154F002185DDE6063E67449A6E0A9D9155EF95A7EEC84568EC8DEC4E3E9D6D | |
5045 | 5E3E37F01FA5CD500715E0777C0B8FC6940C4BB4E6BE1CBFF8D7F461CCEF1641 | |
5046 | 9FBBE9EF79801121137F5336350701ECC4A2ED838874BA412944545B2395C1CC | |
5047 | 6873816AFAB5F4B71E978EBA442C309799F81E66312BD6585FDF500075CCD649 | |
5048 | DA023880E008D9E046660FEE0C93B5FF18722BDF423C5D820DCE694C6803B83B | |
5049 | 101E61412650B945C63348D5053C3F97B6D38821A262600A8231E151718268DE | |
5050 | 4DCB22329C49DF12D9135872A03CD900DAF07D8F3A396A39FC9A5FD04C8AD26D | |
5051 | 4A41211D509B31D9032418D372A90CA0AF2E16DB8996E659CF103EC725BC4820 | |
5052 | 9ACFB3C8D5155D87A2AFCE311BA6A18F95E37A9218BB5A45620FA20FD485FBC6 | |
5053 | DFBA5A3FA163833657572CC295C5BE868D584046555006623FAACB6602F612B5 | |
5054 | E6DA8CF67C8C7664992B8062C25E877B578194A33F29039ABD44B3DF14980E77 | |
5055 | 18F51B2AC035CF9CC17F6C6C3D75D2FF145B14CBC4F9A551D5050B7E52C855E7 | |
5056 | B5D02F32D2807518958AF87E7380B6968C51A54C735000F02DD66B2E837EE0FD | |
5057 | BAD9D9603E517B55B8A9765B5C6301040A83E56AE013786CB760C98DB9537966 | |
5058 | 8D9AE205EE938ACEAE707397C3BE2980B090C3B50C814A247F82B3267FD63506 | |
5059 | A21E253CA1FE7DA323C9AEE3F8BFAB2D9DF4A01F18DD530E3C618C889B219610 | |
5060 | E313775F33870ED4791EAFA21B649142534100060E28CA081A2391F1458F3ECD | |
5061 | CAB0BB41419C90D0C9CA95C5A4631A01DF76F52DDE04C6570F22578D556AB841 | |
5062 | A38FFC5A97300AAAB48177442755D76247F84BF57284B05E5D8DE15D0F69D689 | |
5063 | 0264FCC502E5A8D8FC2DE3F7823A0363F1BDEC4B694282D0850CCCBFFD84F4AC | |
5064 | 06CEB968973837652E674C1F953725039933EB7988BA490D4D8567EE3BAE7BD0 | |
5065 | 21CC586C3CDD38F79B0A3A94FB81FACD7D9ED04B4007345A4C7A47860E38F965 | |
5066 | 8CB23565121D1E7A0D0F3F3B7DA86BC3BDF2B4CF412BEBE667E6C427F3F86E63 | |
5067 | DCF7920FECF73F2E421E54F6F0A8E84A8BDE2D0B9C5E441F4C428CE8622360CF | |
5068 | 6D319385106B2590E0D1A8B6C56DFDE8874A3F30D6DC25C1ECB02356D488BAA8 | |
5069 | C2BA0E8CFF8EF6DA75E2EEA6D27E822F511BBA288F7AB46B3C519FA75B676B55 | |
5070 | 72E553764D23EC460CB17BAB327FACE33450E14D8329F2339600F0366869153A | |
5071 | D775A0F12471286F485A65054859B96A00723E1C451C6A8A05C88B32D10AB013 | |
5072 | 94D834F675EE8DE2A26910F924583509BBAB4B1DCC5B1FC8781D80E8CF024EAE | |
5073 | BED6FE0FBBE088F73987477FCE10B4055C28199A91BFDCE080B5F52A1DD5EF9E | |
5074 | 8506B78DE1DAAA88DCDE13C048AAC003735970A5A74E469EA21D2078FF721966 | |
5075 | FEC29EB8D667540184E3CE37797EBA575CFE7F484C71F16D84ACFCC11A769250 | |
5076 | 585B7E825E70BC5AF10B9DA5D4E0D7661B486DE2B1357259D473A57598E257B3 | |
5077 | 993F51D3FC6E6EEB9F4792150179796020914877D26AEB07C527CAA4468AC50B | |
5078 | 56D8BF2F137F59E55AF7E778DB993EA55FF446CEE4E8E5D87852F211CC342557 | |
5079 | D2F3647F6BC423260E2AC6398D | |
c302751c CR |
5080 | 0000000000000000000000000000000000000000000000000000000000000000 |
5081 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5082 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5083 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5084 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5085 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5086 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5087 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5088 | cleartomark | |
45c0f7f8 | 5089 | {restore}if |
c302751c CR |
5090 | %%EndFont |
5091 | %%BeginFont: CMTI10 | |
45c0f7f8 CR |
5092 | %!PS-AdobeFont-1.0: CMTI10 003.002 |
5093 | %%Title: CMTI10 | |
5094 | %Version: 003.002 | |
5095 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5096 | %%Creator: David M. Jones | |
5097 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5098 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTI10. | |
5099 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5100 | % This license is in the accompanying file OFL.txt, and is also | |
5101 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5102 | %%EndComments | |
5103 | FontDirectory/CMTI10 known{/CMTI10 findfont dup/UniqueID known{dup | |
5104 | /UniqueID get 5000828 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5105 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5106 | 11 dict begin |
45c0f7f8 CR |
5107 | /FontType 1 def |
5108 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5109 | /FontName /CMTI10 def | |
5110 | /FontBBox {-35 -250 1124 750 }readonly def | |
45c0f7f8 CR |
5111 | /PaintType 0 def |
5112 | /FontInfo 9 dict dup begin | |
5113 | /version (003.002) readonly def | |
5114 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTI10.) readonly def | |
c302751c CR |
5115 | /FullName (CMTI10) readonly def |
5116 | /FamilyName (Computer Modern) readonly def | |
5117 | /Weight (Medium) readonly def | |
5118 | /ItalicAngle -14.04 def | |
5119 | /isFixedPitch false def | |
45c0f7f8 CR |
5120 | /UnderlinePosition -100 def |
5121 | /UnderlineThickness 50 def | |
c302751c | 5122 | end readonly def |
c302751c CR |
5123 | /Encoding 256 array |
5124 | 0 1 255 {1 index exch /.notdef put} for | |
5125 | dup 12 /fi put | |
5126 | dup 45 /hyphen put | |
5127 | dup 97 /a put | |
5128 | dup 99 /c put | |
5129 | dup 100 /d put | |
5130 | dup 101 /e put | |
5131 | dup 103 /g put | |
5132 | dup 105 /i put | |
5133 | dup 108 /l put | |
5134 | dup 109 /m put | |
5135 | dup 110 /n put | |
5136 | dup 111 /o put | |
5137 | dup 112 /p put | |
5138 | dup 114 /r put | |
5139 | dup 115 /s put | |
5140 | dup 116 /t put | |
5141 | dup 118 /v put | |
5142 | dup 120 /x put | |
5143 | readonly def | |
c302751c CR |
5144 | currentdict end |
5145 | currentfile eexec | |
45c0f7f8 CR |
5146 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
5147 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
5148 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
5149 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
5150 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
5151 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
5152 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1B57C5FD29DA32D34C95E | |
5153 | 2AB2ADB3F60EEB0600C8ADE15A2380DE10AC5AAD585FBD13097B1A7E8E210D4A | |
5154 | EE96785449E07F0C8EBC2EC5EFBFD0897DFDC15E5BFAC9584D8DE95C5AB288CD | |
5155 | 8AD8B9BEF0B8E5F887B3B0B331542FC8184DCCB753DB6ACEEF98B85756B988DF | |
5156 | CAF1AE0DBE7D37D5F44A2E760AAE3A5197C27B15E32275A64946C3E4D0476FD2 | |
5157 | 7FDE148C788DD2106F7C825E270588AC05B57E625AB17BDD02306F9E5FC851DC | |
5158 | 32A5A6EDC43C770A71419B2C0C8074EF3F222C8A2097CD81A91F333A521B3A09 | |
5159 | 482A4FE1CB231CE344AD126AA284C3280AAC3AD162CF0EE241BFB4C8F20502FF | |
5160 | 118507F5D1B5FD898571015E73E5CF2281085072E00D401F6F59761EEC3E8381 | |
5161 | 1F26F75DB66C504AB6BABA87D121B1E7040A07AA2FE01F80DBC246CC03C4B2DC | |
5162 | C2A715980C52B7F96BC1A78FCC7F4F52EEED5F705E08FC1E5BBFCAD121FA88AA | |
5163 | 8EBE58172C162AF409DBB0728F14923ED02A65EA24E5D52B6AD07777455A70A4 | |
5164 | 61833D3789C719BA92E901232599767E423D5AD9C807670BE0E7B5CFF8256A20 | |
5165 | C7BF7214FFE0342809570F5966A2C43E784F35015D9040BA34FEAB6A6F089504 | |
5166 | 3A40A9E9D711A2721D3F4998371430FB3C94BFC619559B97D49627BB630F4B70 | |
5167 | 9D0A8FE4E916235335C3962F3CFDB04C4A3CF714DB5E260F4E66FFF2F27CEF2A | |
5168 | D4AA26BBCAED23B8BDC98F8F453BA27AD7758537561E766B82DC3032E92A9EB0 | |
5169 | 125D98A22C5466AF069BF72A9BFA052A8628FEC6A6AD0B711DFFEDE3AA2D7CE8 | |
5170 | 34EA487038EF50F953B8B4471CBA6FC3C53877EC1BC94582B1123EDF44B4056A | |
5171 | 30F49394BDE22CDAD7F01951C7013D26979277D18EFA594E8F4F2B5E615187D9 | |
5172 | 39E842EC28461B9ABA52020A127D2CB9002A673A435B13C10602EEFDBBA6BD49 | |
5173 | 9DDEAB9E68D655443A5C2492BA061C1391A51592BA8C353A6F6A0708E8860184 | |
5174 | 2B5D031D2CAB87D618E9F6F7A0BF3F66B3FD5A25BB91F7F1F5F99CFF56EFF4FF | |
5175 | 0A35C55658001ED2E97B26C869292F6274D433A5443179DBB8EE987196306348 | |
5176 | 3F9E87C6422AFFDD30080C9AC4EE7FE5E2DCBFEE4974331F4AAE479FD8806D4D | |
5177 | 9C2B85FC69EB0453AD827A1E767E5C484BDFBF5C8D6E2B3C96298B390F22D757 | |
5178 | 802643A79D5E29CF3AEDF0E12CFBECA4663444FC87F2027571DBA9ECF688BF28 | |
5179 | FF0DDB3AEDBA0FB28447CB4B5D5205F40C1E7A525FD7373392EEFFD910AC82D0 | |
5180 | 98E71660A1B3227C4A2592F3E853CA4CDF64DF19A52582E167234F4036FAAAB9 | |
5181 | 5446BE102DE2BF43E82F0112C2A20F15A3F92C6571AC761665A905362C4F8BDF | |
5182 | AC8705519C99862CD9C0D75113C4AB5FBB83C880E46B82715B5628890D9103AD | |
5183 | A2329638B95D93C4DECDC5E6C588C9D5183EE6FC28FAF9825F02DCA567306D93 | |
5184 | 5440987A81B51EE7291107A08F201C609FEF91A8F0587E8B13D4BAF74A5A6815 | |
5185 | DE9E4441F46AF8E1DDDFA2D611C889614040B144A5EC064DEE4638C04EAB2E37 | |
5186 | 4CA8F50FB8C4D65BB296DCCCD39F1F554CFBED96670A91F515CA10EF896874BC | |
5187 | 8EF48C6447752C70FF5A06F928DB55586354076773BFF7E94C4C3A7A1C1F421B | |
5188 | A9B4E3936EC26E0C19BBBFC90F021E877F54B62108F6DD1C7F6D5B8E64FC9362 | |
5189 | E173F01BF2904B7E5A08B3543611562C2714099DE7D4FA330DB148B560A9601F | |
5190 | 42A84452811CE213DCE782A0D7809CFD954D6BC1EBF2BA4D1B18F50FA8174C96 | |
5191 | 3E0120E266AD5DDB40B3F6798AC28CDC5C3C4BC34583528F5B5DC8A222B80B59 | |
5192 | A3A93DC715D061EC6915E6E6E21A25425C25E8747C60F170D61047108826F96F | |
5193 | 7830E220C108B441B6EA3198E33C49BAD8D43086E49F5A2BC7958A1A8CD011C4 | |
5194 | 49045193394696EC3DDD0BE084E8F2E9F0B9496F035C0DEC1CE11409DF566428 | |
5195 | D50043CFF5CDD1092F6E0807E660B68163BCA738E8D98FC6EE3F713164CD204C | |
5196 | 0BA84FFF4F33F47BC31750B448603D7ADB9AE92FA91AEBBBEC0DCD66980E6955 | |
5197 | CEB425ED07115B24E40F53B29B9D840842EAC691B4F591F866DF27556474B485 | |
5198 | 1C6F53DD72499847109B16C7093984A6B8487D4F3870DD517945CD90E648C1BB | |
5199 | 8A6861E540FCF9D75B984B5009B5CC760CBE297042C240DD624111670B703388 | |
5200 | 6FE6FC0E89C6B4C88F51DFF3913D0CC1FB4770C8CBEADD4B86393605C0B6C468 | |
5201 | 83CA5594754411B6FC331EF56D7CD6D247FAE42E966583C29239A8F862348D29 | |
5202 | 60B177984B6B957E733DB4D275015691D91443BBB13C2DA96097A29733CDB284 | |
5203 | 42F89C85A7A743338C9DD3BBC4EE53F695E5163E6E1ABE5791ABF100B198B9B2 | |
5204 | 1C21E2FA2FB4AFE7F9BB2D381260CDD3A2CC05BF513AA1E80ED69FA27BC5ED5A | |
5205 | 21445BF00BC2F997B356D94AF13736C6D3B0613EB6F4CD96A685FEB672661DCA | |
5206 | 206105EDC3CA07900676EB2FAB37F48D2E8207BDE1463894DA3C5B1488AC1EE9 | |
5207 | D39DAF691648048F5D7A384B8927F8DA2BE3602669F71D80686E427F395134E7 | |
5208 | 7ADCC611BA91AD4B7A0237213C60CF2C905359C90795230344FC3C50A22BD44B | |
5209 | 55B2044792509F50F5C21F53D9F9E9F063ADBED3AB99E2613B23334FE8DF70B4 | |
5210 | 6120F2EDF69F50BE793EE145B9FF9C73179DE640FC2ACEB5C6617F918CEEB762 | |
5211 | 4CD81E665B2E544864D13230B058717B207D3CC5D6647D5343DB4D0356082392 | |
5212 | 871EFFA896631A7E0D6477942B632074A9A4EF7B09D4701B1639BAAB4E03A40E | |
5213 | 9B54A7A4F845CD63F88831EBFA4FB847847CB98F3455CB5957F2E0A0F5623645 | |
5214 | DBB5C5564C7F8B117D6E27E65C0F3EA81AE67B4AE4B201E7C4FB0A8364FE53F5 | |
5215 | 41A7CE8F834C2C4B322809B353A5E63BBA7BF3B7DC1A85EA700BD287C2BD3FC8 | |
5216 | 2832B0BB4695FC937FF5EF06FCD87DCE6DE793C2B1EE10E6450352C17726155F | |
5217 | 220D550B1759E15AB2C1D5968E52C8080CD280E99D3CCC0E80C2EF8BBFD96001 | |
5218 | A226FEED7311EFB4B67F424B557A877379A15BCA54780F0CD2CCA00400B9B39D | |
5219 | 981C6B552AFD2506D1B23618FA9AE6D8143CD7198A8482CB416CCE62B992347F | |
5220 | 337D505A4078713BBD91E5535BD58EF0351EBDCD749CC24D4AD39F8CECD7D6C8 | |
5221 | 139756680A4C03A58B3374CEC658D30160AE4863A3938A891BB59CBE02BB451B | |
5222 | 1BA4B2B6E68AB61DEB85F95E3C909B8B66E220B9F18280161C279F10F7093CDC | |
5223 | 100A53D542F071CC0A5AF834DC1D18738F5DD62A5573E884E1FFD22BD810828A | |
5224 | 1EA47F8218C15A2E97CBC609927DA3CC2B802EA4A0D7EB57627C135E3B065905 | |
5225 | F97597D818A2C5CC6F328AD25AD11FA50F1E4FE637980B7474D6F85A521892FB | |
5226 | 72989AABEBE02A2D0EFE88A6F67AC29F5D8DDFEDAAF465C439983C6B84389FF7 | |
5227 | A6434462BEB7B07DBE4BBA61ACD4A60C55B5C0AAE527DE381DFECA2E6BAFDC8D | |
5228 | 310364ECB42CAFF72BA93C067B2F02D1CA7C34AE7CDC46787A0E234C8BE8A928 | |
5229 | 7A6F3DDE0338FAD532A9886E8E3525B85DD39364AB03EC4C0DD25DC179CC1989 | |
5230 | 1BE232E387E857C78332D834679195E10F1E7B87B7966DA3B2238F53D1E13FE2 | |
5231 | 8F55ED6A92A750C7250C9B91E29796621E7E9520373214D7DA81B2875A986D33 | |
5232 | 80382AFF6DE1F829F048E57664D9C4ACE91E4684A51023943A4964AB5657D610 | |
5233 | 3A5405EFD4CFD1EBA684243E15093C9667797BB47617B66054EE02C41FFEC45C | |
5234 | C1BAE8AD56B00D323FCB1D2744F061FA16E161988741A319B1564E04BA210996 | |
5235 | 4F9F02A3268CABE450D166A763F5284954564A1C86B76544C5F5ACDFE0D758DB | |
5236 | 865A1CFCF9FE8CD5F9C3B2998C56468FD52DF8EE60C6935A3D221EAEC7714E3B | |
5237 | 301371C7DDA0B03A2416238F2B47BAD3A2C5021C886DF51C695AF9C87A864B48 | |
5238 | 3BB3FE0B355EED5454B59B25A0D8A1B8CBD356C24F64D9B55E16C30C011365C9 | |
5239 | 1E0380753BA3EDC0868788D5F50B9353D0227BCEE1BE36998B2622C0759BD66B | |
5240 | E4444250589F9CEDE766D8B940770CB6B89503E925B35C00CBEC2873D2DC4A29 | |
5241 | 0823FB7A3717B69A7DEDBAAECC067949932728E89BEECAA91DE3AF9BF070B9C0 | |
5242 | 30EEFA8C0A55C8388CAA2F0515915C98E67FA095BB98967D14B0DCAFA9622E4E | |
5243 | 2E0EBFC768D80585ACDF28D8A5C2B6EE2FE7AAF62FFB90F569F84A0903996DF0 | |
5244 | C1D5723366C436E4088F3E2BB9B47F9789052A71CF5C49908CDC1DDA194BFB89 | |
5245 | 14D7E3D7D4D72A150FD6FFD8303E9DE5A97A71B808B8BDF2AE466F31BF5D7A4A | |
5246 | 44F81230BBE2B456A221E2F72A8B59F8FEA8D31F8A005A5BD93B9F49CFDC3DCC | |
5247 | CE2B67090460F632271C7157BDC2F05BC2749FD562FC28682A616A52D1B67654 | |
5248 | DF78B7843A9EC26A7DE2EB168F874904C2915B97534B2D4D9F74A9573A771D34 | |
5249 | 9F7BC855E8F794621BF6AD471BCC347E2DF5F620F5C209E33A4CBF1EA85AEA87 | |
5250 | 4492A77342DD33EF615FF34037D660B713C908786D9022051B825226545827A3 | |
5251 | 2AD1B05D654DB6E6D261B4E8AF0933AD1F0FCFC7201E1A7C1B4199F160C38676 | |
5252 | 21ABA2DDF1CEB655B3EC3226E0B122976EEA998F7A5241F062E54AD1DFD6ED26 | |
5253 | 47C99A439E0AE95415059179867CDD3F0FF751F3141309F40E00A6C7C28433E4 | |
5254 | F649BCD5DAA64177580E05C495EE7BCBCC5FBF104DAF360CC2711386655B26F9 | |
5255 | D349D887EEB32ADE595241560FD5924A1745A22E6A01DB9C285EF14596EBFF0F | |
5256 | 03F36EB2E0A7C3864F819EF7B0855121292D49482F046A55CD7271FE03F02EA5 | |
5257 | 886864D9D8EC22A68C23089EAEFFF03DED6484D8C341861EF8B6FD3C5BDF5AC8 | |
5258 | 352DA4E13A1E30D0CB71E090E9CFB9AB2CAFD0CA7C34AE7D8E3B2EB4666834BD | |
5259 | 9CCD1AC2108348AFEF6071796F4BB2FFA4A67ED917E76A109FA2DC2A30D744A0 | |
5260 | 9AE653A748C1D18FB52595D84E87F1C1FB6B2F32667FE203262C66627AEFFED3 | |
5261 | 92B23861E5EB238BB4EDCE09DAE1C65BAFC198CDD1B45D42CDF93E16BB82D35F | |
5262 | 821E9E49067E966AFAB2AB52928F8DD6359984071FC37AA652FB834A09E5BD93 | |
5263 | 3AFAE161140E74C6531E413E8FBBFC42BFE8A464B71EB1D8CAA93B33D7BCC3B0 | |
5264 | 47C7EEFCD3E9FCF26FF9441DD9BDE68D77AD7251C06BBB9A2103049E8827CAF0 | |
5265 | F26BEF33F656A690235DEEC623CC519AFA82DE2AE16FB99F780FD7D8290DA40B | |
5266 | 9B604AEF36B529FD184239E7D50561A07428D28E51B55546590A1AEAD4B7F2B1 | |
5267 | AB8C5B9022C1FA03E33F8F409B24911AB8BFCF6EF4A8E415263C789F89063E71 | |
5268 | C0910DC20347469380B7FC1EEB87D4CED7F4A361E58B61C91AFCABA35C03F978 | |
5269 | B9FB5257C31657EE48504C355CE893FE3C553274C641DBC4004F5D5B879CC5ED | |
5270 | D3F21F867F6DF054127067DE86189F0B59A1B90FDABCDFEE61423609D888EEFD | |
5271 | F4A1367129962110C651D9481CEDDB8C5C2576A59AED64E95F7ED042AEAE2F7E | |
5272 | 81AC0C408E593DC30DCAC334EDE9EE27D932B98F040DDCD195D6155607DD2038 | |
5273 | 970EB78221A94C52BD4F0EAC65F1FC10E5DAA93C17266F351669CAE56F42B68C | |
5274 | 6D01E1EA03AE554D63CE76D800FDD9CFD89F80A241EAEFF7EDFA41794EA25CE7 | |
5275 | 97BD5028464D2CD45B53834B4AEF8BF0B9E7C6ECDEACEC887E8790A47A93F668 | |
5276 | A9095E5FA1116A122C0E5B74E2226C654D3187C6CFD8807917820423DA3EC1DE | |
5277 | AA020EEEF2280C44A15209EE2F3FC1776875308CEAD38571E7BF889F287E4594 | |
5278 | 971A83605E0B4169D4A23EE790515223DF8724054EDAD905F57918FC0BC64F96 | |
5279 | 514B4BF7DC9BA79E763C22C977FB6146B10D26FEA1BAA7BAF21312F78D1625A7 | |
5280 | 8E242D743471DB5821408AB786E4A7EA9D35E30E85533C617689F95758FB2C7C | |
5281 | 392E759C299DCCE36689686DE0C4DCE32649493650BA194A6208C5EAB670B170 | |
5282 | 3F2C70BF0EF0E3BE2FB0A79224FF4ECECD6BB3388C6D06867A0E5E3DB93C1B2F | |
5283 | 464C23E44D3132E7D4086E3B59B1D13F49EB4772DEDF8EDC4F603217233FB7BE | |
5284 | C13C28648E9AA51D53F11FB896839F97AEDD8834BCA53CB0021AE91FD8E95E2E | |
5285 | F8A094093AF556B9639F508A401542B06821FF9DE1A745FE9AC5CACD5E8E1053 | |
5286 | 911442FC15CA5333751ABFE2C617D38FA1DC332BFEF44AE569DC631C93EC54D6 | |
5287 | 261583A695F5A392867A57F59B741EFCD2DCFECBC55D1EA5F2317601C9DFE9ED | |
5288 | D1EA466210FFA905A8F85BD58B98991BEA58DFD1CDED5C9B086D42CCE632DADA | |
5289 | 147941917B879139E016B0DDEB8446BA017FC8EE5A354533D667B0835F5D027D | |
5290 | C2D580C16B80B3D05CC92C0465CAE077729F0A15B2DAFC89DCD349B3F81D0516 | |
5291 | C65526EB5C10E45A8A85D716EE35FB9AB201FD7C89ADE5AD925A174169DA20FB | |
5292 | 61E96C73A143DF964C20589EF24A0FCFE6195317F2FA0D2249C0D8E649C3D9AD | |
5293 | FF13332EA2E4C9CD36D8443EC8F027B61CEF92C6A6B72DD4ACBACC16E429A9A3 | |
5294 | F5F29C1631360E32F8C1C93ACB22F810B86D2969A7480F486F62F8488BEEC74C | |
5295 | 2C1AF13BB92BC578E8CD30BEA6BC8CB68ED730F54CED0167605FA76AD7B7E88C | |
5296 | 7AE7688E598F91C471BD65A542E96D64B1EAF19FB4F1234308C48C2DC86E2193 | |
5297 | 11ABDB4C6189C6F201627C693691A86DD07FF55C30FDB3F72381E09C6080FD7C | |
5298 | 9182762E5001E30F52A216E0B71E4D2D4E2F3B20F95DF3A11FDB2D2B5B5FAA66 | |
5299 | C46226D5E0C77066349770514E5675550FAC9394FB27CD2C2F974F1FD58C04A3 | |
5300 | 1EF53A8AB3B2202CCA1CEFA66228E1480A0709436C44BD3319C40CF888AE4692 | |
5301 | 5DBBB52B15CF3A518F627F672135A24D5DB9B2EBEF04C860AECF231EBB5A3BF5 | |
5302 | 6DCCD5E72FE4B6DD29E896691868A7DE4120AD06AC573F5608B8449B38E71CA0 | |
5303 | EB5CDA3F942482EA7973661170F81DC88D54DD5B92323F46F833DFA757107E9E | |
5304 | F62A47CC50FAA1B68ED535C3E0E1073532A05ED339C8D70B3B9864808ABACD23 | |
5305 | AA95E9FDA43D54C66A675FA074E0A5B8777D3C07850A09087F36852B5351F35D | |
5306 | 8BC4DDFCA35CF29CD5E3DE118A741FAC4DED36847F2E2C6CFE08669301722D94 | |
5307 | 376F540982958074E7F1383C409652F6C99DA39FE90B38221E75BC1ECB93ABF6 | |
5308 | B00F410A0C5651DB418566AB350FDA1789AFD88286AF3BCB42B98386F7BC144B | |
5309 | 02DEB8940D20A6B3062F0C4244EABC50923390064F1D027A8BACC3DE45156E56 | |
5310 | 4A942D1B87F1C4A76B0D4D6801AE792CCAE3009BF25368B31B6AD5476FBD3BFF | |
5311 | 9759EF463EF5E78E10B7BF64005B2ABE0E8813950A08A1808587A98E0021D0DD | |
5312 | 751AD515E8278F1A0759E85D8A084490BBB0F8206484AA36388B1013643D3198 | |
5313 | 3509078847BDAE08E76FA5BF3E3A73C323CE093DCC148E3C02C2DE1E26C94D5A | |
5314 | 40EC8308ECB02FF7DD04EC1005A2A0DC74D4E587F10A3EF349E828F69FD38962 | |
5315 | 2F0C74D5DAB3ED6CC9F97008ACCE74C086A503948DEF1AAF58FC8BEC703CD360 | |
5316 | D32098A56AC776B1BD08442052A2A4EF6C8798F7CDC102AF1A2009657254762A | |
5317 | 0793F79A39DCD6ADBAA5EC84A7ED6018BBE727E5D477893D84F157074B24C13E | |
5318 | 8D4881C7DF8ADC13EBA0D89745EF93B7616EC5355600BB0D2B630AABA3CF2946 | |
5319 | AFFD0B2B724EF0F28393F2034B2E69DA5061426805353EB4D80E20739BC4C510 | |
5320 | 6C45275B8261DCBA10DE1D104B12F46ACD230977EE7D7D1D35D2814139E38C4B | |
5321 | CA6937CCFA653349B1EF64A98457F7B4B5D8F2978F16ECCEF7054905863AA46E | |
5322 | DD524CB33459220C71E9EFA7845A3A760A507B3D3ABC525B35930B613710A13D | |
5323 | 098832C58EBBC8B0CA6AD516E6385792C59220331D0922A1F6F838A8DE13C337 | |
5324 | 900462F952EABBDC2EB1FBF94A66186C177501453CD3FE3582073DD86F04406B | |
5325 | 41B6AEB440DA475E13240445D46726A6D45185D56BAB8807CEC8A8F7CE1AD149 | |
5326 | 7CE2E1BB5DE4E5B9592241DD136479A65905FD0062C91DFF7349874BFEA5D9EA | |
5327 | 2F610ADB9AE7757B2307A1BB9D6797D9F9C4844A59841C7C7682105E23A374BC | |
5328 | A91885E7410F56F60C29AB8B417E2D6092F8BB70A2DD5DEDD4BA1077D7CC62FD | |
5329 | EA43428C6F79C332342E15F75B08A1ED360B3511F823E75AD49BA7AE63B19238 | |
5330 | 2AFE8FAC2715E2FDC895E95036D23127557837506A3B542B0E4651CE2B89C252 | |
5331 | 31EE8ADC26E2C04E8E30A9CA12F066CE01953BE7867171FF6C7E834742C36C3B | |
5332 | 58E74E4B482CB85FD4D24DB03D753F260A585D552CDC9E1941446F2F5B45FF24 | |
5333 | 2DA4932B973139F328E7E92828B900BFD398B6F41DAA0D6861C66AA7F5E3299C | |
5334 | 87A5925CE0E0F9E09AAE0792954A1F2C0AAA8288DEEFFE579E38A3CE8A943EB4 | |
5335 | 55322A87C1634074EBEC25F724DC1BCC1BC10458CA6C4395659B0DB6B612C151 | |
5336 | 557CC669D8DC37769E59A5AC6BF061C79FEE265DBB59520EB8FFEA273601D1E8 | |
5337 | 2984B8AE31AE343F37D03E2BF97DC48AFE50BB6138C7B9F9B5E28672A37BD8F5 | |
5338 | 8F8C98DC43DB22C6537028798198E2D3B0453ED72487267D653DD50F1BBBDA92 | |
5339 | 833A987A95FC1F275B90B581B4BB62B6863A4CFAE37F715EDF3EA5A33679FEB6 | |
5340 | 4847ABB4B3D170C275B9F1AC3156D731198DACE0B051674E85B758500AC9FBEE | |
5341 | ECC75EBBD85F8D62AAA328FB09C6526F853077AEF7EFBFC2B6A29D6D508B1E19 | |
5342 | EAFA4C67EEE44045B9F15B9762B3DDF5CE5C18B23A5C2F73A1F6DF7F8679AB78 | |
5343 | 843AA41FD2A7DC02B45B729EB76C66A89F5F76E5C4A0C0563B1EC5E75D72EE35 | |
5344 | A7F1FC89216B60D82F6F2B8DBE85E4FF4D63712C689E696F60B52AB622C2A4F9 | |
5345 | 37C380775EDB72638D3F81F61D8D74C76D813DDFFF35ABD9A502F2BC7FF65754 | |
5346 | 2A8660A5A53E0CDC2E8A95B6E33CA153EB711DC796D313C8183D707D3F0E3EE8 | |
5347 | BA65E0FCE3F1C07F3D93F77056688B5496AE35A6BA0B59619DE78640A8C3F7D9 | |
5348 | 7DC5E94894E1E63A7D80600B945B1CCA50F1B85F57673C6CE09EFC4E229D4635 | |
5349 | 48AB466118D273BAF7C1B52A067A88C00EBFA7FCB378F1575BC0145F294E6F7F | |
5350 | 8007602C6560476FA20BDB91831B22404DB1C4C167594B1216C25226D262FEC6 | |
5351 | F5D0DBAC4B8D743C669CFF2068CB9BCD2DAE8CD6EE1B33BBF7514C4E5EA79D46 | |
5352 | 11AAEEA72B791C22A1822E686F3858E95A37D9CEF904EDEC7EBFB0E60995CF64 | |
5353 | 57CF0EAAE6D4925126349DE06E101868BED82BB51E911852E6780772912570AF | |
5354 | CD5690C6DA70110DD9903BAA3BAD581D206571D1E57712C75D112254C7A3DC8C | |
5355 | 892B66CA346EE682E7D910343C1CCD07465D9E49489839BEDA6174FB2E0DB935 | |
5356 | 2D2CBA6B67ADDA1BAA6A51690A10C819692C9BD35BDC689F9DEFEA78BFE79C47 | |
5357 | C9CCFB3D04D20F1D3E0B73498FC0BDC50A3BA6DDB3FAB9458803BB26487C1397 | |
5358 | 511717CA3493A7590E27B34C2E2E1BE2ED884CAFD5F7C185CD6EDA68951673D6 | |
5359 | 384E6CD12944F86D178E73C8D78D9048A5B1E2FCB489E723F8178F842B362BC9 | |
5360 | F3E4D511B369670908B2C8087AA29F8B592B8AF7018311C0F12A8D45A3625096 | |
5361 | D4C88B19890571C60821F38310685F8DEE7A7A5D209265986F92AAF11143DC85 | |
5362 | F435BC210621851001B6A402E3A07D0F204A3B0D75DA3CD7FF6637D1F434B962 | |
5363 | F404DB3C6BC318EF517AA0836A975C5196976250B5D6B21DF528FB47181F5279 | |
5364 | E1EEBBA0F344D7EABE71904B5C1DB0FD07694C469085D50DF4990E294334E785 | |
5365 | 5E5BCC4ADCD38685147CE535B23F3027AAC01A0D65AC751D9CA289B4A8906A64 | |
5366 | 165427976FE6FD699442196B0C247C960C9086AB2E440885D2C32FFC5FC7105F | |
5367 | 6C40A76A1968AADBBAD6F3C21FBC076F4F67DE62E1CECD38BE03720FFA886743 | |
5368 | 846FFD2005F85371FFB9C962AE2D88586DC9DA2F98996DF8572551C3D49E1ED4 | |
5369 | 41248FA76E07B2A5CB9C3451247F60C7AA164ED895CD6290427E828A7FB72F71 | |
5370 | 7CC249C92A012C0FE99FC07EE7E084E190CCCB95E66A39EAFA7934598C69F04C | |
5371 | 68B2C68DF99ADB347AB05F1905B8704A51FBF9471FB20CCD3CC87EF9FD75DDDE | |
5372 | 125EA68997DDE4174DFA0ADA2664E7209E4EA1B460CBDFA79D033D33FA9C5075 | |
5373 | DB424689F927F06ADB87DF0C3F4600ADC9CDB197E41430047247E7645A0AAFFE | |
5374 | 750AA1A154498C0B5371ADB099C1E273DE2E367DDE7ADEC2CAF9406A67585AB0 | |
5375 | D39F051BC556A8E569AB9EA4E69557A1DFCB8CD459403A616821AC61E35DE1E9 | |
5376 | 2673435E5969EE48F3B9F9777E5F70C682FB7C10E6E7FAC5F5732C9EC2DEFD5F | |
5377 | 9A28572ACC62C108861AB22894979195B88E6A08A533629295A58643F854BC9E | |
5378 | 082F9073AC94EE08DC1CFC626DE4D341D7994178E708D4D8226897B54CC2B4DE | |
5379 | B37D5BEDC430404177977EEEFD7201713AC45FE927D4FBA0F2613A2FBCF890C1 | |
5380 | 908E1DBCCD277E78E42363374E103BBD6C3DAD925A9422469648B9D8BE7391F6 | |
5381 | B448994EA40AF3A3EA7E6E938D0F93B9EBB4E09B5D2E8D9ABF1F4AAEE8A0A304 | |
5382 | EDBA6DF569ECD449FF362660B11DE8A13A71C6C8186273C7417C4572DDD8B993 | |
5383 | C96289B16223B271D026929B2CB9D3AB7A3511F09C6F303A7006705482E9AEF4 | |
5384 | FC76BC1B1FD42095857751315F5B06701E774FF08920342667E99EBBF5A19210 | |
5385 | 9AAEDC8033E06007AA89BEFA5A1616095A8E90C999BC3EB266879EDE7D1218F1 | |
5386 | 3CB238D180C463AAF853E315CA564247B6E029D8200B9DB7B13EAE09264A5DD1 | |
5387 | 4A080EAEDA74C7FD21BB208FD8EBEC1D650C0AE392C67D65C1773A68F2CA313C | |
5388 | 15FE2E4A0B6E7DA9CE391BF6D854431F0EEB550A818B6B95EFE6F72504AF5CE9 | |
5389 | 73DC8E3326E2E57F4031688F10D1C272D41AB40B7EBA371ED357E67C31DBFDA0 | |
5390 | B8412EDBFBC2B6F26FD7331BC965DDFB1A4A17B72BB94338283A8D9139B9816F | |
5391 | D13C12E07B69E9FBD0C5FA9B1DAC2E51324695102DAAFA746D969E5F64980707 | |
5392 | 228DA50443B2917FF685F5872D782CA265734036B7A7D75588C638AB9687D34D | |
5393 | D0221C0B3EB0A8DFE91598F07CE2C35E1C4E01E26D0358841EDADA02D3844B26 | |
5394 | C39D492C480244124F422EFE57D38DD912EC98582F05C74B4ED83BE81C363376 | |
5395 | B816F23D10C5C8CA831E1351F3BF914B07F638FA5712A1E05E3B751E756296C9 | |
5396 | 2FF074FFC22CFC383804A92057155C4E43FA4990734C83257E810F3C2A62F42C | |
5397 | B5328A41BE80C23F49479EF84BA8D13BF3A45EC435781B9480659A4D58041190 | |
5398 | 3DA62807723CDF1EE71EFA22BB67887DA88EB20DDC0D1A36A75C06BBA651DE67 | |
5399 | 651BB57824E4F5264DEAA04927D2A29730B7293E08FE3FAE5FF493EDDC0F2232 | |
5400 | 9476F3CA26707E823808329390EC9D8913AAC2D8DF2A6B5673E1A0F4E7E67C9A | |
5401 | D006E7DD429BCC550DF7323DAB781F82A837C83C80DDB8970CE699153576ABD7 | |
5402 | 4BA82C753C82F19E30B853DD086DB119C48ADA56C39352E3C6B1FA232390BA3D | |
5403 | 02482A6B845C324593FF845A572E1F026941AE3DDBFF83E8230FD5214B631EDC | |
5404 | 69E178C52B5FB4BFF0C89B756E759147596D038850F0A468B20163093F8BADE8 | |
5405 | FB0F718C66D82C41A29EBEC417DE0B72C4F8E746EEEA33F2BFC0063E2514456D | |
5406 | 6EC34CA68E1C667D47FB582C3A259AF4D0859C68AAC0E5F89CC91A1F508CE835 | |
5407 | E29B7860E6484F8B0D75C1635A32FDE55F119C8222A5D00D9C45930C9F5C97BE | |
5408 | A28EFB48BEF95ABD910E66CBC4C34AF6299A84CA55F780A013E8B3DBC4E57F2A | |
5409 | 1EEE358D24775DEC537CEE09212EB3208E497330427706696335F03BA50BD193 | |
5410 | E022E668C6602731D51102FB7BBBF43A630BC428FCE711882EFE6E7739DC10BB | |
5411 | 63B60272DE6FE4841F7728EA80F871F1648E3478DA71BF29F66FC3565AC3C632 | |
5412 | AEDBCCDDA048A807FCB6CC497A1CA11C6E802C1ABEC3BD80E116A648531484F1 | |
5413 | 722E3EDA1EAF6DFF1D3CBB1759C4AEF33A300E7770B8A24F7EAD130B31A0AEF6 | |
5414 | 26C369A8DDD409A1343BB66DB2B2F7882FD168C008D5721B3EF2DE8B56EA35D9 | |
5415 | 2E456FCEF55927D78D20A99B96EE83A25BAD4DB679511BF4E27E552F871612C9 | |
5416 | 6B8C2D5BAF77B648C654AE0D9E6402998E07906B58984B94987216AB9EDB2699 | |
5417 | E0EDFB6AD08E25F2575E1B93157F2F6A0D215ADCE1D21AFB6E4DCA3635E2D4B7 | |
5418 | 825A4EAF8568D1A2ED4D6E8C9C6DBFC08D259001EEA83D3ED9A416435A79B56B | |
5419 | 3F7B0AE9A5781694E22FC68152BB68409B61B9A59CC8D58CE1EA9C0DBB329554 | |
5420 | 44E4D85F3A4BFCF8AD90771A203FEBD6EE00D118EA5833C96F1BC0CAABFE69FB | |
5421 | 0BCC46E7A3280E16976D86722168F695FB6422734512954A97AA0BA8AF8155ED | |
5422 | 2434100023E1FFCC504AFFEF6C2F70B1F2506E53648271DDCB82754F9775C323 | |
5423 | B77590E86374A9B01FD57FBDD3F3BF8D61CACB66909E6C95C81BA7B083913635 | |
5424 | 30C7C0BB9EB7310F23D2991BC6D5CFA9A35AAD04B14CC5540A16C9BE0094A8DB | |
5425 | 058B1DC4D5744C8F89257A04B1D8544C1405D8FA71A780E92D767A170C269668 | |
5426 | 202ABE3126680D93532C2EB8EC3A140D604C79906C626AB0185669AF9A425CAA | |
5427 | 465C3DD47810CBA44AD7E2BFCA99FCDA98EB641608032051AC5CC30329C28536 | |
5428 | F5637FC7E371BEFE11320FDB5B6530E513CB14122289CEFA88A97733E4F888D1 | |
5429 | 23030714F61091B5ADFFE84E3505E32C347EE1D624AE666E8BC6F416F78CF6F5 | |
5430 | 96FE5D12F574F8114C71A10596847A8BA0B03DEDB6AC72F218129B223F422908 | |
5431 | 138A916F2605142D5EFF5F4BDA5627E59DAAE09A674B7D5BCECDD63BF5E7C119 | |
5432 | 410A36161335A18A93891CABC830833D1FAC47B7A85BC9EA27BCE6F727E7D35B | |
5433 | 348918F512C3BF7769C185A277BA930170AAAC6708F04F00C47251D2679DB455 | |
5434 | F9BB928838F148C1AFEA1C56AA779C54948B9DC0E827706834D9469825FEB644 | |
5435 | 6AF843E71E44D0380311A3A6D9B7543A6A24B475BEB483D63BAC1B9421211570 | |
5436 | FF9BEA65E81FDAAF0E00A1555B0A69C8355143DA9B547BD1AED32120C58AFA09 | |
5437 | AC34163ACFBFE0E00D57A5ECC73E522AF84A2EE0C9655C6AE6E67BF4473CD8A7 | |
5438 | E7F95AB4EEB4AF83ADF597547CDE2426F200FB8824E2A826356096B962F31B98 | |
5439 | AB1B27FD681C1F67EC07FFEE7240F704E925E62749E2D2C7CD85C61F14B8A03A | |
5440 | 666339793934155EB270C0C7B58AB8DF6C52B72038257BE0CDDD9B2A484DC97E | |
5441 | 862C67F7AEE273480192980A5BCD8CCDDB87CBED18899B09B0A485FB4A1FB061 | |
5442 | 79A918589500995F12211C3E636FD1A7F6F746A231E42C80152EE4E2C1E65FC4 | |
5443 | 4075CD6B10A7183C711573498FC034C82A5B66EED4F921646F8A9AC989F7C655 | |
5444 | BC0C74049D81A3AA11FFC20CD823BBBEB6E58FED16B9AC143EF2E2981BCB5605 | |
5445 | 71C71C8BE4112AF04B3D2D9C46F948C8E3862AAF882871C3A05CF720DB14ABBD | |
5446 | B0B2A5C41E35DA879B3109E31226C317CE405C2186F54D710AA503B8EC76BE1D | |
5447 | BABDC05B316D5382568D4938C7D462B3009A648BDC22C640CE6E891375DC26F2 | |
5448 | A7B36C4F4DBF909B2858AD23DB71783204AFA075488322462A92F0E6739E0A28 | |
5449 | 486BD3BC19B3665275ABE63BA5B31936B0097A08717141505568962BBD257511 | |
5450 | B714C52EE8CA7A37B3C0322B7F5A5690BE2FB23AA9FB322107CA58B4CA4032BD | |
5451 | 2026815102CD4688655FACF599739F8C10EE5890AB65B167C5FC0C8F855EF2E5 | |
5452 | 0B3F95EDE6BED4CC277CBFD004B7D13734F605E1B929204850434638F7244B70 | |
5453 | 176FDEDEEED09D16703108DF3041687BE3EF06ECC78CA7BD028A24676753F889 | |
5454 | 32E2B027250023B80E514BCE566E9CAB8F8B516544EED082741972528E2D9D94 | |
5455 | 29D8F03449066FA4412350A5549767945AF5E678BCBE884532DA8C66A612465F | |
5456 | 4E2D1CA7353C2F7E0418E1C989026583844702D344900E05FB45FED3401FBED1 | |
5457 | F63830D700F1EC2F4AED4EF8D077EB9903AE3E1AEC126EF9A03AC25D5FB37CD1 | |
5458 | 8CAD9A29B803EE39CD78AEA670E2304EFDF0B9E52537DF6BDDD44022F0C00895 | |
5459 | 6EDCCFCCD3430853617597EFDC25E915E4F977F9910D640FB088085A96E7FB59 | |
5460 | 3570E01A50A7D4903E01C398B5F461BF23638812C245AAE2F5DE500FD2D44E57 | |
5461 | 336BDD4B538C081BBFDEE78D8FC75A19F204A15C2E18BBE879BEC3F675663D3B | |
5462 | 73124D4FE6BB1AA1E6E5D6FAB878B479523CC51E4E734AA090DC70DF610CE359 | |
5463 | 8357A2C4842AEC553871063A9127C952AC9A64FE3891CD4D0879B41CAAA2FF8B | |
5464 | 0F4336BE27DC0C179FF91D867FAB89D05E382EC85C2DD1E1BFB4B66C6EF9AB3A | |
5465 | 7A7FA0285EF3B67A1249BBB1493AAA17E355690753D2978D937FA5373D195D9C | |
5466 | 9F2A3F7F6F71BB04BC47EFC7D24F11DAAFA20FEBBE5098976E8C002629C7A5D0 | |
5467 | 4BC339B70105CEF46994F8780AB84FD47367F996418E00BE7002 | |
c302751c CR |
5468 | 0000000000000000000000000000000000000000000000000000000000000000 |
5469 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5470 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5471 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5472 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5473 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5474 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5475 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5476 | cleartomark | |
45c0f7f8 | 5477 | {restore}if |
c302751c CR |
5478 | %%EndFont |
5479 | %%BeginFont: CMMI10 | |
45c0f7f8 CR |
5480 | %!PS-AdobeFont-1.0: CMMI10 003.002 |
5481 | %%Title: CMMI10 | |
5482 | %Version: 003.002 | |
5483 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5484 | %%Creator: David M. Jones | |
5485 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5486 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI10. | |
5487 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5488 | % This license is in the accompanying file OFL.txt, and is also | |
5489 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5490 | %%EndComments | |
5491 | FontDirectory/CMMI10 known{/CMMI10 findfont dup/UniqueID known{dup | |
5492 | /UniqueID get 5087385 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5493 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5494 | 11 dict begin |
45c0f7f8 CR |
5495 | /FontType 1 def |
5496 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5497 | /FontName /CMMI10 def | |
5498 | /FontBBox {-32 -250 1048 750 }readonly def | |
45c0f7f8 CR |
5499 | /PaintType 0 def |
5500 | /FontInfo 10 dict dup begin | |
5501 | /version (003.002) readonly def | |
5502 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI10.) readonly def | |
c302751c CR |
5503 | /FullName (CMMI10) readonly def |
5504 | /FamilyName (Computer Modern) readonly def | |
5505 | /Weight (Medium) readonly def | |
5506 | /ItalicAngle -14.04 def | |
5507 | /isFixedPitch false def | |
45c0f7f8 CR |
5508 | /UnderlinePosition -100 def |
5509 | /UnderlineThickness 50 def | |
5510 | /ascent 750 def | |
c302751c | 5511 | end readonly def |
c302751c CR |
5512 | /Encoding 256 array |
5513 | 0 1 255 {1 index exch /.notdef put} for | |
5514 | dup 58 /period put | |
5515 | readonly def | |
c302751c CR |
5516 | currentdict end |
5517 | currentfile eexec | |
45c0f7f8 CR |
5518 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
5519 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
5520 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
5521 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
5522 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
5523 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
5524 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBC7878DFBD546AC2 | |
5525 | 1EF6CC527FEEA044B7C8E686367E920F575AD585387358FFF41BCB212922791C | |
5526 | 7B0BD3BED7C6D8F3D9D52D0F181CD4D164E75851D04F64309D810A0DEA1E257B | |
5527 | 0D7633CEFE93FEF9D2FB7901453A46F8ACA007358D904E0189AE7B7221545085 | |
5528 | EDD3D5A3CEACD6023861F13C8A345A68115425E94B8FDCCEC1255454EC3E7A37 | |
5529 | 404F6C00A3BCCF851B929D4FE66B6D8FD1C0C80130541609759F18EF07BCD133 | |
5530 | 78CBC4A0D8A796A2574260C6A952CA73D9EB5C28356F5C90D1A59DC788762BFF | |
5531 | A1B6F0614958D09751C0DB2309406F6B4489125B31C5DD365B2F140CB5E42CEE | |
5532 | 88BE11C7176E6BBC90D24E40956279FBDC9D89A6C4A1F4D27EC57F496602FBC4 | |
5533 | C854143903A53EF1188D117C49F8B6F2498B4698C25F2C5E8D8BD833206F88FC | |
5534 | BD5B495EB993A26B6055BD0BBA2B3DDFD462C39E022D4A1760C845EA448DED88 | |
5535 | 98C44BAAB85CD0423E00154C4741240EB3A2290B67144A4C80C88BE3D59AD760 | |
5536 | E553DAC4E8BA00B06398B1D0DFE96FB89449D4AE18CE8B27AFE75D2B84EFDB44 | |
5537 | 143FD887F8FB364D000651912E40B0BAEDDA5AD57A3BC0E411E1AD908C77DCE3 | |
5538 | 981985F98E258A9BB3A1B845FC4A21BCC54559E51BC0E6C22F0C38540F8C9490 | |
5539 | 88A0E23EA504FA79F8960CC9D58611C519D3ACDC63FB2FBCAE6674357D7F2285 | |
5540 | 4BCC9F54D3DA421D744D3A341DA3B494BB526C0734E1A8FC71501745399F7683 | |
5541 | FD17EC3044419A88C3979FD2ABA5B0130907B145A8462AAF0A9B511D2C8A7C7F | |
5542 | 347FF6AC057E6512902BFD2918E2CD31DE615F5D643764E900B60287670AE18F | |
5543 | FDE15545D8BC69591A8CBBB275AFFC9B14BD68DF0AAB32268FB84844D4DBC7BB | |
5544 | C591C1AC5102C50A9C7BAAA848DA88B0519F0F5F0813BF055CF0E3C86F633A04 | |
5545 | B779D2E8E656DB1E09A66A85FE21CA8BA5523F472A229E83F2C4E91ABA46C733 | |
5546 | F3C7B5775B06C97782BC225C46385BEBDC61572458EFC5CF4190AB7A9C1C92DA | |
5547 | 29F84BAACF552089195966E3AD9E57CC914D20B6962BE80429A16D4DF1ECAA66 | |
5548 | 36C4343FADF0B2B48F12E2EB8443C4AA29D00949255F3968617F98B8ABD4CC12 | |
5549 | 048B838EE243A21AC808BD295195E4AE9027005F52258BFCA915C8D9AED9A2C0 | |
5550 | 80814F79CF943FBE3594C530A22A92E11BE80FCEC1684C4F56712D5846B0749C | |
5551 | 9B54A979B315222F209DEE72583B03093EC38F7C5B9F9BCB21DBE8EDDAE9BE8B | |
5552 | 75ACE6B12A31083AC8348EC84D1D29D2297A266284B7E9734E207DAF59A25F4E | |
5553 | 4AA38509E993C5394FED76E6A2F25462685C4C86C6E8CFC9863338EC1428BDFC | |
5554 | 74616BB1BC8948B0ED4C87C15B4405F3A7796F9DB3798FFFE8BD0A94E834817B | |
5555 | D5E9812E308D0CC920470A6F2CD088FCB80462BF7CB3F039A7DF3DAF5B2B5355 | |
5556 | E083A385CD2EAF0FC181E40E96DD7E9AB9EF5C7E6866A13B8A54718E950FE097 | |
5557 | EF0951A357114F18CE9933D28B3A77AA71E3CE884661F13284BCED5D5FD1A86D | |
5558 | 543E588FF473DC2CF9A4DC312500135F29C2D0174B32018C8DBD40EF9A232883 | |
5559 | 710A1F2AB2CD11312300ACDF789A9B7B93D2035D81D1C84984D92D78A53A00C6 | |
5560 | EDA94B24BBAC1AD17774A4E07E6F74ABD90415965616AD540C8ECD8C3A44EE4F | |
5561 | 7F4F6BB6238C5062D63FA59B7BF08BE93FAEA70A2AB08FBEAAF7DBF56B95FD93 | |
5562 | 03CA406543BA6C9527D0DF01F5108D31A51778A5EB1C93F27B72B46146A353A2 | |
5563 | 01CACBC829603B9989A87CF64528682CCBA0562A8165B185C58A5C6BB72F5E89 | |
5564 | 500ACCAAB8ECEFBB2640E99EAEEC4EA979AA793D013D61D8ACF8784FF8D9398F | |
5565 | F6A252A709324FB39509F0B3A4E725E82F53543383C6765BE556CC897C758208 | |
5566 | AA3AD37B0406E4A79F8F0A6C1983FC73E71CD858C0DB66ED66D5D992978614EE | |
5567 | 1EA91EBE191E082EBA1FC040AF19A2202575C2EBEB8058833E3520FA03D2F915 | |
5568 | 85C1ED337E457B9FEEB0C6EF2735EFDA6E0D05FA641BCF698AC6B97751E8306C | |
5569 | 4DF00A39B8581FF53DB8F8525FDB196D85950906CCB59B8EF171349AA3B567B1 | |
5570 | 6A00819947A995FB383C3C1709C9A2C113B2E40BB832B7D4A0FBA0B16A2C455F | |
5571 | 55809CC425C403E9668DC66BE45B71A81C332FD4DB279D22A2959962304A8F18 | |
5572 | 085893DAC61317D24A8F198FDAB95F3B86F0AFD35047B868A9A17037A2829A02 | |
5573 | BAB042F75F349E197A7EED41984C2859754CAFD0251439921C248B463B516951 | |
5574 | 2E1322C80D73F9CBCAA63A585450275AC2492E4D3FB78E800F788254DB5E610D | |
5575 | CF788DF5C70FF99892BCDF16133E34B24B77C8F097F546B87C603DDB8998B66E | |
5576 | BACB68BA27462AF54AA405682EC96D701F0D474DECD5F95CA2102DF639EB169E | |
5577 | D518162C2BAE45FF698B6DE15FC6E7DE48C336C40A670FD26952A6BAB09115E1 | |
5578 | 991F0073419F2CC2A1C08BE91096936AA0C37E4ED3CCCEE235476074B8FF1125 | |
5579 | 6BDE3701F85532D8BB64CCC927CC335281C95EA689706F0AC717DC2CF680C754 | |
5580 | E5EFD7FA4BB8880B2B727A964C876D4A223069D4E6001771F0E23EAD2A4BBC80 | |
5581 | E76675297B2EF05F52BF4E71B3EE2BE3048CF088C79540113C66AE98B2FD3CB1 | |
5582 | B0741A215FD070882C52765009D7D711DAA2508F19AE7DDA15229A856AC49BC3 | |
5583 | 4DDF40814FF96500E4B9B02D412E94623C5FDCC76C0FB8E42DF56A904FE49D65 | |
5584 | 1DA7C53901B2EA71AB658A464D3ABDE27D9DB8D9E0B48F64E61A2495AD5D8DAB | |
5585 | B5E72424AD017DF37964AF911BD7FA21A5EB4775DC8E95EF0C0EB856B00D89D7 | |
5586 | 8172A1DE8530767D317B8256103E53CFB877E10686A04F5A08F8DC58D843DEBA | |
5587 | FD5F40597588663D103689F6EB3EB14D06E18C8078F2538B43E712DF491FC5C6 | |
5588 | AF639256C8C6134B64D560D8476DEA6329D995E46CC4BC78841C59E73648B47E | |
5589 | BFA7DE0846422F738454AE77E822A083405289247BD7C478BE4974F742CD6051 | |
5590 | E99FBB1D1B3FBABFEE855174734EE45E87D0AADF32B1283B911162A9955847FD | |
5591 | 38944D70584FAA6B1A7191C5C134B73F98EB632B69E2F0C0F94156787C34C8A3 | |
5592 | 7622A029D58F9626B74F8A8A1F3803E0BC20E0EADEB1E99B70F1BD9F980FB751 | |
5593 | 2A842843DE42EB142A84D5D3138629AE9EAF6F3479C423E8829C8816FA6EFA27 | |
5594 | DCE5580E65AA9854B1C64163DC318420CD993C15BFD76A8BA1182860A6B03D6D | |
5595 | 22B8CF43CFE6C8AB27C64842E239CAE707D3086BADDE1D7C94E3BC96319470D6 | |
5596 | 8D26915C575CFDD03271D6BB9DE86A0EB6EEA6E768B224A626C62A9AB48A6EDB | |
5597 | 44F70BB5AF991CDF9736D65933E81CC57A78F623F33EC9AF535F2F25FA4EEC90 | |
5598 | D50DB7E87F31E971A75A33A301CA6013EEC5A4E179D695B33DADF2C98364434A | |
5599 | 42926776000B610E17524162253F6FA638D6581C18F99EA0BD1D2E24D2424ADF | |
5600 | C05010D08192485153DD03930C7BF45237593E484F9851E6D464FA10FECA5D9E | |
5601 | 0C8CCC97DE029030900CDBB491C5CF226DBF903CFE7735D939C3FDF3A20B70CE | |
5602 | 66579B28B99313FEE914E295388C7BC8E055A2E54EA3A8206D3C8F4F7C0BA5E6 | |
5603 | E519419FD8CE215F7B8E9BEC604A9E3FE272A0328A24E31997C8A91E0946BCF1 | |
5604 | 6943A97CBED2AB9FC636B49828BBB8B89E0BBC2653796431224895ABA5DAC41E | |
5605 | 1854BD9764E86147FD7624F736F40DE3B7582EDDFD15C2BDE3F22B5A54D7DF10 | |
5606 | B87A1301CE85CFC061689A890A321412A13314AE96DCD3EDA75035FDD8F4AB9B | |
5607 | 897A2C68263A68457032C469987970648BA2D88B1C5375DFEAA35A917B8A952E | |
5608 | EE670427942AEDB3CB599C5746180E392837D371E15D860620ABDB6AA7772C40 | |
5609 | A5E346661673ACA530BE3D8E3FFB895E5DA3DC23B1B43C080C77F7E47847F0F3 | |
5610 | F3AA5CA9E4BF75FC5EBD18D19F21A7DAA3B11CABC6E4070A15F7DBC8B05EB6AA | |
5611 | A02EF1B078EB66D61D6AFE41DA9B36FE7EC9EF94D1EA26282A9871E2CACB3126 | |
5612 | 2AD49C2D9B50A6E47D8F2CCAD50992D1B430979A45FD9E76182A19964BB2A1F6 | |
5613 | 51779A2B258DC1DF4C2F3074621286831F3848AC152DDD2BA561E6586ADA88D3 | |
5614 | 598A2CE2CD048F027CE0008B828BD915887D7785341E8305DF2346ADB76BE99F | |
5615 | 87B02173BDC334E9221C8DF54114A6B24C1C5340299512FA6C8C51AB4C8778CE | |
5616 | 178CEF531C6D1B5FF0A1BE8EFF767F959BD4C345C52699A29A17B2A230842BF6 | |
5617 | 4B011217D6D24EDAC3F6D53482786F1CA33169B90ECD499407D37CE9B70DDF78 | |
5618 | 7B7547B32952535BA9ACD1E244447AE3FCED3AF28717083CF9590A09780984D6 | |
5619 | AF0743C82AE4FB3E2BB2856A4153A3967A023FFC35382D6C22D84A924900B6A6 | |
5620 | 3DDD400E6D2418DA6C27F2FA34C075C902B89EBAE658B3C9A18EEE449DA5A379 | |
5621 | 337DE95CB7AB3F0970CF1A5D8FAD8090E495570FDFB2FBBA79244780D8035547 | |
5622 | C5A55BB21A2270F724BF5D442CDC5BB9F09BE0CAE59B1C2270F0BDACE698F2C5 | |
5623 | DE8F66BFB9634904B161F5BA2B1950048300D69BABD312D58D89C4ED527AF7BA | |
5624 | 7DA2478EDC2CDEE3473DD8A8ED9D891CD1FC21F23013228BB3281B71FCE959BD | |
5625 | 6F8E9059D682A7FCC5265A0620992D4FA8D78377EB34CE3ECA070EE3707239BC | |
5626 | 98907DB0120CE42ABA32CF97127E28382BDDFD685674279F588D4F951216C355 | |
5627 | 821361790F64C2CC720DE97E8ECB57326C43EE47367628E05769E106868B54F4 | |
5628 | C33C9951908DF6FC4F5ED2C7787BD8FA591BBB3E9C6C1DA94CC5E38D9B20C886 | |
5629 | 7D237572FF46DD896A4D6163408EA6CEFAC398EE041EAE29D577E75326CA17A6 | |
5630 | B072D47A7B13EC441CE6DAA042ECD02134CBFA6809A435050413817193DAEB16 | |
5631 | A5882C8AEA44BCF36E74E9ECCDFE7E19FF5A5DD7A94E5AB4F8702C3DA7F42325 | |
5632 | 23C808670A0490F5B373DADE40814FF9650241D3D69C91FBC5ECE728F827D9BF | |
5633 | C928602E05477903449E079164CA39859C4BCA60C579F490AA455F82B5050BB3 | |
5634 | 969AFB478E0D4A257B3356EA3CD62051FCE6C6B1929CFF85BFDF166BEF658E10 | |
5635 | 3A55E007F38EBBB248B3F0B8ED1925106B499B762E45113AE1AC9DE09644C84B | |
5636 | 9C08034B297314EE69BC32DB6E7D7FB9913CE5AC17E7335979E9DCCE2BAB3725 | |
5637 | 1976155551F9706A576FE0E3ADCCF72C87683291528ECB749CB0ED291966E239 | |
5638 | B5E3630676BD409E08F85BC1AEC9A2D4135376284A96EA24431243BD6FE8B966 | |
5639 | 95F11A4BB53F392E0AEFEA623064FF8A7002367B0A515635CB2D2DDFB9B4A8D7 | |
5640 | FE721754E81BBA548848A235B91AD4E4F7DB19CCE2F61D277FC00AB956EB93BE | |
5641 | 44AB4970CA56BF59506C94ED160FB1E25D3DF2988A532BDB787BFB8539D22986 | |
5642 | FDC378AC31444E63C4727FEE121A43751043849E6DCAC5B59D0FC703AAFBBFD4 | |
5643 | E8B7C268F21615AD02CE9DABEFA27B5FE6A6441B619539CAB1F810F1263447AA | |
5644 | 633F5DAF483752EF1A0421740E3A811D2D2898CBF53E7F686C9223FD7235F02D | |
5645 | 6F90D2D48CC20AB87778DE3C6FB335E0F0EC20B5DC5B65223FE117526DE2C72F | |
5646 | FE839DF93CB2A7D66CD900CB325F891E311BEC932F703FB4FEFA29DB8B9C88DD | |
5647 | 375EC71B3D58C7BC59ADA91971A3BDA1ADEA629CE6CC92BD542CDDFAA7706FB2 | |
5648 | 6CDDE2DF07E56D6741916AE8E8744339816F3E6C38062747AA9FDA2A2678A6B7 | |
5649 | EFEA870AA3A4D71B25EE3013EAB1DBA34401B867C7A41AE51E0421D41D3BB83C | |
5650 | E120C8FEABA6E5DEC53A689C21426D4BBCB68CB37568761C360E6D4E3596FB7D | |
5651 | F4DEC7918E58C0293D12D6DDA7E9DCDAAD7C939F55CD1BC4A228B31E9A904156 | |
5652 | DA6B40B08E6ACE674618B768DD681C772A3E55FE096CF949CF3B0460ABDCD891 | |
5653 | D17B37B355B29AB5137899C036F31DA026244FA25FB798FBE5105BDA29F46538 | |
5654 | D3D3AC1001A7BCECE64DE94FFE6C354166A0F97256137BDFA07F6E22A3D1D2F4 | |
5655 | 9588DBAE95E895BC5E64DDCBBAA8D0A22C229B42CB717FC711E7E9DF793DF80B | |
5656 | 9F14754585A3C7E17F37B32924B9F9870DA8635E3E18BD1DCD81EDF01834D9C6 | |
5657 | B33F23C956C2FCBFA47D84422F583459D827D1E120B97694D12F1F54D02379C0 | |
5658 | D288F7104F3FFCF4F76E3494F4ACBD1BE3A15543CC680924C78A473F8E311ADF | |
5659 | 8FE00A04C6C393DE61AD3EDA5BC031E2353076A2489391B52632387CA28A7B93 | |
5660 | FBB065A6EF3658AE80B1ADA47E9B2539E73A71FA75645F85ED8ECC257FB4CF26 | |
5661 | B6C912DE9D0F9899E70BECCB934AD32CF49A093371A9F73DE6255EBC39DE1E7F | |
5662 | 00D0CBDABD4D0383977E694890E71FBE5C376BE5F3A80C28987417504F515C50 | |
5663 | 909F3D31178BB9B1D085BE514F71B910A9085BD6122DDC72A150BFE266920E49 | |
5664 | 5661BCB4BAB51D6DEFE32B616963DBD989FCDD1637B294CE4E288655FBEFA1BF | |
5665 | 7F25BBF8CF17C2D5FD161A7C2CC9CC7490D9BF15A1D35B3BFA43ADE256E88BDA | |
5666 | BD490D92907C57BAC408A575EC84D6AEE070148C7C9A91C03B09FDBD792E8FF0 | |
5667 | C0B886AAD2EDD86541E5E579359D40E3AC312ACD3D8FD49F71BD533DDF8859B1 | |
5668 | BAF17F1884E331DD07CEEF93B71D492AEBAADF7A263450A7A72210CE630A0D37 | |
5669 | BF024BDC09ACC882816B8C22C62AE38A3A8D0F6EBC2B1B2C0B8161A8B076DD5D | |
5670 | 4B779C0788546BB4CF57332230D237856B00D79C28A7C01D11F44B7304F69075 | |
5671 | 94B97A745DA43D1BE561372CE611C345A843834E46AD9DDB16CABCD3FA33D6F1 | |
5672 | F6B5C0497F5EE5400B305CDC16A7EC286AA4D45D0EEBB9DA06AC9C5294D68EC9 | |
5673 | E4DC3CA2B92CE8FC0526184A86EDC7AB34D67E60AC12D9CA8FD300235EC968BA | |
5674 | 92C6FBDA47572BC5600F25249F60AD287CBDAE980E747FCBE7EE5CD323E733F0 | |
5675 | 63553B494D3DDEB9CC1480B5C3BB79A28E419AA65B18CB297AB383419E890E2A | |
5676 | CE6F98C9900CCB4675280A10CF060B8D220DDA1BE55DFA65715EABCC1AFAA271 | |
5677 | B1F8732341613E17B231231A0D24D4D7FC198AE04D89A99C4536217769C6FBD9 | |
5678 | 5EE24A6302F97438F7C0E311C878F674B4477A5ADA3952CDE4055AC408B8174E | |
5679 | 86F8FB797646DFFFE0ECA25D1BAB9A9F71F3926D3D85AA63E7A8C931D71E79E0 | |
5680 | AF1EAC26FADE468F4FF7F3861D14C10E3BE1F9EAFD6D3A544E8108D5DAB5B180 | |
5681 | 3950C74818BC8AF4758A108F462EF1826647A49667F5E482038C54716856D9BC | |
5682 | 35F29922846D2148F92F943E951D7438C73D6A60459A8003174036C64E1629CD | |
5683 | 155D47FD04B03C023AD67CD5A70C98AB556EEAB8C48169706E5B352F6505D580 | |
5684 | AC945171BFE62E81F8F500438AC3B64D857BA5BC54C2C4BBB237F8FA51296255 | |
5685 | E66A92A61FE13FDE781D393557EB72CEBAD86511035F775FAC39A0479CCD400F | |
5686 | 226709118F887F47CC2ECC8F79816D4A945B2845F50AFD62D8C9A9BBF4739496 | |
5687 | 9E644BC9F7B04803B7EE75A09EAE94365F6F374B4FCEB0B506C76297564B9B6B | |
5688 | 8B812BC3A33929AA94692572B010E6210AEAA312BDFC88BF302244AB9D587A9B | |
5689 | 919823FD01DE12438D960944D1977800FEB49E638C32E5B188B1CA033E0C37EE | |
5690 | A142F746367888AA119535F0CCAF7EAA461B790EB089D2D6962E28A398439BB7 | |
5691 | 9C9943654D7A2D765B46BC0DD1F915327F369162E1BA1BA83110B93F442905E0 | |
5692 | 523BFF5E279508A98568CD5CFD18FABBE9D17265A9081E7BF64155A2CE3C0DF7 | |
5693 | 88D00671AD65654709589BAD7EA65BBA811387ABA5CA0BC3F66D3D48597A0D1D | |
5694 | 2C268375DF47CCF62166262AE4840AB03BF49BE67A05EF66328EC729F03CA5FF | |
5695 | AD3937FC053E223303565DC771ACF32E63DFB96D5030E787961D72D02C195C66 | |
5696 | B48E9AF0309DC169CFE8D16E2818DA94693A18F027DEA0D916672480464F7E22 | |
5697 | CA6E431FE38D3FC019BDD229E064B72C545C61C6EA55984565CCA88ACB01F744 | |
5698 | 3B4593CC8944C70F30925FB48A16342CC26D444F54CA15E5A624C4A2DAA2AEF8 | |
5699 | 404145BBA339F2A2D6FC2F3ECE54387761CA1213C8D56FF96E37C6147CA44B84 | |
5700 | 262EA87E7CC10D931E6B5B80D7F09813498497AA84ACB4AC69BC6C8481ED2953 | |
5701 | 084F560D7B1CF90555E69BD2AF7C5D944E8E3506165014652462BE1BC81CA341 | |
5702 | E1B0725159D36DA0FFF3577D1DEBC5D91AE683FB0384 | |
c302751c CR |
5703 | 0000000000000000000000000000000000000000000000000000000000000000 |
5704 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5705 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5706 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5707 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5708 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5709 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5710 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5711 | cleartomark | |
45c0f7f8 | 5712 | {restore}if |
c302751c CR |
5713 | %%EndFont |
5714 | %%BeginFont: CMMI12 | |
45c0f7f8 CR |
5715 | %!PS-AdobeFont-1.0: CMMI12 003.002 |
5716 | %%Title: CMMI12 | |
5717 | %Version: 003.002 | |
5718 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5719 | %%Creator: David M. Jones | |
5720 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5721 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI12. | |
5722 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5723 | % This license is in the accompanying file OFL.txt, and is also | |
5724 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5725 | %%EndComments | |
5726 | FontDirectory/CMMI12 known{/CMMI12 findfont dup/UniqueID known{dup | |
5727 | /UniqueID get 5087386 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5728 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5729 | 11 dict begin |
45c0f7f8 CR |
5730 | /FontType 1 def |
5731 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5732 | /FontName /CMMI12 def | |
5733 | /FontBBox {-31 -250 1026 750 }readonly def | |
45c0f7f8 CR |
5734 | /PaintType 0 def |
5735 | /FontInfo 10 dict dup begin | |
5736 | /version (003.002) readonly def | |
5737 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI12.) readonly def | |
c302751c CR |
5738 | /FullName (CMMI12) readonly def |
5739 | /FamilyName (Computer Modern) readonly def | |
5740 | /Weight (Medium) readonly def | |
5741 | /ItalicAngle -14.04 def | |
5742 | /isFixedPitch false def | |
45c0f7f8 CR |
5743 | /UnderlinePosition -100 def |
5744 | /UnderlineThickness 50 def | |
5745 | /ascent 750 def | |
c302751c | 5746 | end readonly def |
c302751c CR |
5747 | /Encoding 256 array |
5748 | 0 1 255 {1 index exch /.notdef put} for | |
5749 | dup 58 /period put | |
5750 | readonly def | |
c302751c CR |
5751 | currentdict end |
5752 | currentfile eexec | |
45c0f7f8 CR |
5753 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
5754 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
5755 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
5756 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
5757 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
5758 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
5759 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBFE3573BF464E2BE | |
5760 | 882A715BE109B49A15C32F62CF5C10257E5EA12C24F72137EB63297C28625AC3 | |
5761 | 2274038691582D6D75FE8F895A0813982793297E49CC9B54053BA2ABD429156A | |
5762 | 7FFCD7B19DAA44E2107720921B74185AE507AC33141819511A6AC20BC20FB541 | |
5763 | 0B5AAEC5743673E9E39C1976D5E6EB4E4D8E2B31BEA302E5AF1B2FBCEC6D9E69 | |
5764 | 987970648B9276232093695D55A806D87648B1749CB537E78BB08AA83A5001F7 | |
5765 | 609CD1D17FFA1043EB3807AF0B596AF38C91A9675E2A53196FEF45849C95F7DC | |
5766 | 182A5EC0EC4435A8A4B6E1CDBF9A5AF457564EA72BF85228EB6FD244F2511F5A | |
5767 | CA9B71A65D53CC06EF5F7EC3A85106139A4D312378BC22183C09A229577B793A | |
5768 | 1B7422611C03E84BF809F46C62CE52D3AE29CE01C32B202ACDAA5B72733EB0AE | |
5769 | C31D7EF7BA88D2D14F85313F7A8B9B7A5B124B03AB923744D336C969E5CE304D | |
5770 | 3AD977A46664479EDEFB69F113024E761C05FA48A54072DF9E12C2F352ACB3E6 | |
5771 | D04F6EEFFDE209E7FA3DA22E5B1D1409461F4286B7F4F8251B44E5CB7805762E | |
5772 | E129FF4A06A7458F3191926B1CAF70E32C6571AD2DC07C34FF62840896F4D200 | |
5773 | 761B1A7FA356526D1E3AB4C542AF13623BAEB9F61B1BEEF79A9205B1FEFDAE24 | |
5774 | 8799D516A9ACC30BC0139C63C9A0523E9D5439213B67D490C96F902958779B8F | |
5775 | 68BD8E9FDDCE8A3A2E35877DB6C94B7612382ED8F218EB1157D2ADD090A2448D | |
5776 | 10B99FBC9211C5629ED1C61C74FE93041E5AA03EA4AC3FFDA00C2B6E719CFAA4 | |
5777 | 262FE17F66804A6B54D3669836EE4367D2A2991580C5564463C973CA0DA38AC6 | |
5778 | 922716E13B4A807B50304B8826CEFEAA47C305FC07EB2AF25FA7945797237B16 | |
5779 | 56CDE17AB0834F5C97E0CC5741B061C6FF3A8DD1A79B9A173B66A6A750538E26 | |
5780 | 32FBC92E75BA15CFFE22A7302F47908547007402569158F62C29BA2956534FEA | |
5781 | 7DACF1E507AC309DAE8C325F2A6023D2FBD81EF42146BFCE6A16A6310A650460 | |
5782 | 7B07BB7647C8760FADDF0DBBCD3DA6CC4645D1732DB3A22D8B76E1D2D48E4D4A | |
5783 | 46F4BEB80CE65F3517283A1AE08391FD1C10ED452133706BC6725AABC80107FD | |
5784 | 754A8BA47B0281D479F052CE26A723EFFACB79B213041A536542AB334769A2BF | |
5785 | 88505D82C498ABDD5A73EB539530F47CAC52825D16A969C8BB56D4A7F2830B8F | |
5786 | CB63B92B576E7BD922A4B25E634751F8A3B7C4EBAFCB373EDC8B8281B1D1371A | |
5787 | 7844E9AD990CFF09F0D7ED73A5CF873D2D5C9E8A9923CFA31E1A4B4CCCC40760 | |
5788 | 8B3AC8FC3C88BC08BD7407725281BB879A1A822D94997826418F1B89D303F2C0 | |
5789 | BE7A0102E6F529630CBF1BC5BF3E4578C164A3DDE45E62A957EF3FB7F0FBBA6B | |
5790 | CA1E79A1ED195B6A11CFB345B663C5E72FA55D80476F604F6C4257B51686AE25 | |
5791 | 8F7D159FE605DDA0AC74BAA5034F29FFFD403070013C6E2D8EF6A0990D91173B | |
5792 | D5A3AEB98B64E412991505C3CB7C2CDE13C091FEB3DFBCAF30C4C19511102300 | |
5793 | 135BD5D444BB55692013F52056908DFAB2ABFACE81A58423ACEC59344CEF7D4A | |
5794 | C5A3EFFFFF70759BC3E593D878281225060B97D1BEE6B26EED90571FEAFA1812 | |
5795 | 1115C0EEC892F5DE6FDD68321A0B3F10A2D771B79BD85476AF6018472A499A86 | |
5796 | 07D64CFF4550866AFE590C471C80EB12CB3A989A60BC7BED39097C12D9286E39 | |
5797 | 14C7952C4C64820B4DE44A1827B7B0B535244E93FDB80036D6332F90F95B472D | |
5798 | 7031E7E3819E881BD0313CFA112EB3AAE943C99C47635CCA7E34DC0306C04E5D | |
5799 | 2E9F60FF037EB11602BE74E8E6B711392E866E3E55D988F7C856417A2B9C186D | |
5800 | 639819B4786D039B77F8578EF63C088FF28BD08D8353031445C8498A8F445BC3 | |
5801 | D08923D32AC04BF3CAFEFCCC1E77EA894F4E846F47EF62D6841B8D8576FEAE8F | |
5802 | 90044626869D04D61D64D56E8C51AF8C18D6CC3FEF3B6C4F7D56FE3260354948 | |
5803 | 10104F69B117FB8269292579A7D52FED688C663B643D8D99F13956612271073E | |
5804 | 1A337AED059B7A93819A28CDF01569CBEB51069D22ADAE25C47355560F402B2E | |
5805 | 8C9900DA82B79C64497C8494F42FABE5AC41791C2010D98FB7E593C744F250DC | |
5806 | D837DB0EAA4F75D0016970F3AE8359878A08CF9A697A06C5EA945819151265B9 | |
5807 | 1A12122B98F79185DF852257BB4798E7DC03712EA6ED34F6E6AE1476788DBC33 | |
5808 | 9229FADB8D581BE1A63F596698DBD6DB98A092F67197A4FD4A50B648F2691875 | |
5809 | EE2495D6BB310078F516785A0CEC7EB6E8305FDBAEB1D15690409FE32DD9CFAE | |
5810 | DBD3866FB63EBCAAB73E3E4BE5D7F3AA44793938AAF3F8341683F0790F1D46A3 | |
5811 | 60CE083F9BEDDA22E0639A92393960F86602216FA51E2754BC2F4CD0BDECE3D8 | |
5812 | FFAB7E0E49613DD4956C9A10AEA798BDA1F756C755BEC12147ADECAB0FB73B7D | |
5813 | 203A11D84DD2AB5AA98FD38C1C2573570FD49A4924A94A106D2A7D850E793608 | |
5814 | FB135853E8C4204441CDBE697FD0CB330B1C3596F32D2BCBF263237EAB362D09 | |
5815 | DA6F531B40384DC91F30674760CA7B64BA1968F6A7FC9EBEF431A1AFC5E76D7F | |
5816 | 2D44DCB7F61C7F6B16196B3E8B47343F572DBA8B8B21B43E35BB6B2DD5C7982D | |
5817 | 244FD4304D254D6CCB5E8CF70E77F50812F41A988EEB3B26BF0F6F69BBA18077 | |
5818 | 31134B5A5823D10FEF6201D045AEE7A24E0F25376E9FC66340C56C05F6CD810B | |
5819 | 724D85CC4BB8D789834A447CBBA159565D08BA5793D8599035BB5063271518E8 | |
5820 | F6C50E7DCE71B1D186270DDC860C6DC0CD506010EB5B1FDF6BE47A9A18CC15D7 | |
5821 | D657E58BED9EECAD5CE5D49F63139A39BC52C6584BB2C3264D51BD584B40F8EA | |
5822 | AFCD8B83F548594386EB2B05CE803105E84931DC6E7A1398073D48E130E0D907 | |
5823 | CD0F1ECC3254EDF5D4DDBF44415DC9BA66C673820CDB0FDF033D59BE2B5EFCEF | |
5824 | 01FF9D33EDC88F8D522E07F1689D024DBCD09A16A63519E1764C8630FF36058D | |
5825 | CFC07027E0ECDA01E0E85B166C613B22F587B4D355EB018BA93E92A36007B4DA | |
5826 | 287FF5A91F7D8A0EDF5554ACCF45AC8066E88865C5692E63EB99CAC81367B605 | |
5827 | 8E6C19EB98EBFE0D2D161B447B9A70CDD1122C7B78A413369016E6D8481E2AE9 | |
5828 | 9AA97B5DD0ACC9B0820F7742CEB2F46F89F3E2092621969A88DC0156B4F941A1 | |
5829 | 6BF1546D4B136657C47B082A8A35FE96016BAF3D9679B8C32EDDD6AE6DF3BFB5 | |
5830 | 7854074FA019707FC22BFA82299E72ADF9A980AE29A8E2434277E58B01F6B03C | |
5831 | 192E1E25DADD49F6E3F69799AE62B56E00B60A031BF8721DB8B2CB6D4A4C15CA | |
5832 | AB1FDE010AB7DC0DDED977389B101B8E53A949222FAA126656E02817DD32B0D4 | |
5833 | A49516CEC2B97EA7C78FD66229B044EB92F502384BCC6CCDFFF995EABE3BB7A9 | |
5834 | 50D5D1AED861E7D3BA8D333026C673C5762712E763E59261426044583D789C67 | |
5835 | A606B96F97663F92BF104CE02FBFDFC521EC0D6670B7D4F85A229F51426DE912 | |
5836 | 3B729C4A535FB7C88D0A5E78074751B58885DD6BDD2DD9E9C83F105E8CF63DDF | |
5837 | CA7DB39D0319CA7CC2E73F42747F007574DE25AE1538B4D493D22D0D5F0F80C6 | |
5838 | 5F6FA3937C8391DE2F0116F81DB2DB0EF751EC838A7F85F163A6F48804E84B96 | |
5839 | 8D715EF25B7E2A5CAECC558D80F421052A1D698F3B8452AC27E30A4E6226E3CE | |
5840 | 084C8A83ADA0818A110923CF7AC7AD4CB92AE4ABBE0A9EC1FF935FD02774C1F7 | |
5841 | 92A278E513012AD17722A23C55EF82E18F8847B5CCE47F4FE3EC508BA563F7B2 | |
5842 | AE56C94285A18DED4D432FB0CEFC05A20BC17DDF9FF919C724810A8ED7358A27 | |
5843 | 97EC93C1A13C443A91947FE1F6F528EA7B628917FA7E554A1D7B31ED46C5ABCF | |
5844 | 92BA57961C8876DB4041305EBB029B03D8351D5E2819FF87E97ED214D8F1CEF5 | |
5845 | 7F7668DDE223721C0B810F4A4AC81CA4EAC86EAE546E1B15D91E626FB9A31824 | |
5846 | 5BFF17C4E79FD56ADBF6DBF01BAF6453A81EBDCB38A5FC0FD0FF0646B3B0D199 | |
5847 | 13E2E59A1B5CAB6DE5329BE389BA0E2A2AB55CA40B711ED746C24F1E48892E76 | |
5848 | 6DACF7DA163CDC90CF076763008E7A899870CDED5A80758E6177BE6B93B07EB1 | |
5849 | 5800A3BF7B9AAC3FA825CE594EF5B7546B181375FA8F37608DF17856D2F8EBD5 | |
5850 | 6030A9E6F6BEAF224AD2AEF76D03B023E2FCB922CB8E3C6816AABB61FE6E4F83 | |
5851 | F21B4935102C860ECA03DBEFCA461F0E5B93E5A8D18440BCF7D1D6252A24CB6E | |
5852 | A64FDAC8B67C4888519AA368D9C4A8C08C7155DF5BACD75C5196C571C3C456C4 | |
5853 | 7CE8D90215FA6EE8CDD72C48740F7F5930EC3632DB63A9C8D2DA125088C0F05A | |
5854 | 9FC83D16B7F53163F4EB6FF372C6C3115F1E68EB35967D11126EDEDF0BF80817 | |
5855 | E68A698183B3EB0A207DB43786E1B9D289359D75AD5E465328CAA90E712C2962 | |
5856 | AE2A466173F2FF30EB535A6054BB0B875DC8552C16B49DF17CF84D98D35497BD | |
5857 | F55E273FCBB0C735899529A69990E09149FBD2DDE64B7FA8D50AE83925DF03C8 | |
5858 | 0B63EA158FBABB12A028803DA4B9DD6C48C0FEC469C4E730729F4BB420D5B003 | |
5859 | 1918B4AE9CF35CFD31E8E62A44C0484E3D00143BF1D330235E821E5CFEAB4D31 | |
5860 | 7CB4604DB1F310457FCF9075A3527279644D908DE847CCD00B6F50DBDEF91D3E | |
5861 | 38238CAF550FDCABA2C3A46237218DCC5A09AFAF69997E1EBDA7EFE6FC99ECC8 | |
5862 | 5D4AFD5EE35FE2346BE79B499EC8EC436868154A947D13BC02C780EBA4B9E64F | |
5863 | 3026F1BF5DC1F8D64FEA1281EA40B4BC355638A3A59BD9055BCBB232FA45EA0B | |
5864 | B405131B64F105814019BC55466EE78E9E9ABB62DB30EA452F7EFD7196C76A85 | |
5865 | 15B2CFCD89922CADC0F392B0C54A231F3999AEFB53C24EB0C63B0C8A1A1ABB6B | |
5866 | AAB2F93E5ECC7AB90EADA320E918106BAAFC1F8C425C617639984629018BA674 | |
5867 | 6FF4F338AC43E23BC3740542911C058D43A49A11CB3A0CC8E3088BB5BA6048D6 | |
5868 | CC2AD250DE956BFBE83BB24C945C20D9C22E7105983F284EF478F9B68BFB0322 | |
5869 | EEB7D62802CBAAEFF1C2332159DCC7243EA40CE15C734EA905E04C476B178B82 | |
5870 | A08ABCB0B86A7330C75E62EE7844C9E22DDB013ADDF20AFE08122EE1B930A81D | |
5871 | 806A0F8CC584CB7FF5F56F9B35E5FF78FD93E7E4A40C64537464EAA275FE88F4 | |
5872 | 461FC6A467C8A69B9A9FBC10D44AC1B753D313A8E7D97F5FAEB60F82855658D1 | |
5873 | 4DCEE043C8FCDFD8A29DD091F3BA55874A458B2B8989F35055C72FC411382361 | |
5874 | 9AADC717E602B48D7C9521D3971A6F7EB19D539445DDE9EFBC5B58FA9E5E426C | |
5875 | 172C45CDA24985FC4632287FC3B15849DEB56F5A061993AB10A6BC59868534E6 | |
5876 | 69888175053108B77E4978D971B4EC57224C0F93EEA4C15AE92254140A94704E | |
5877 | ED5666FC06C5341F643F779CC88A9E81891565C63B6F7F6286E664F4E0A48690 | |
5878 | 356DC96F1B98026C563700772485B83BFA06435D4E0793EF822F423C93FBACA0 | |
5879 | E5D889D2B76771C6F0EE997A5DB43C2F6921132890406E3C33F6F159B14C5D78 | |
5880 | 7C151BDFFDD02B697315F191B5490073EB418A4FF2A398C68D44F0CD1B87CF9C | |
5881 | B52F12728B72F94D752D23151196A256908135C87991E508B8906CE2539DCA8A | |
5882 | 31F86809C8C6C18A09F6129BD7CDC6B37E76B648788056851F22BD3E3B5772FF | |
5883 | EC01D822B57FFDB3BAE624F05531292641FD6A7E3666152D18F6C653048DD7D7 | |
5884 | 98A942C840C4A0FA662F260B21C64214152BB86F03662A330109C5AC0A5EBA30 | |
5885 | C6201F558858130703DF76AF4FBBEE069BDE45C0D9467077D85FFED4F9BA9C61 | |
5886 | AED87D67CDCA453A6528AC5BA153E1039D9CCC556CEA5CBB542265FF54A1B208 | |
5887 | E0E13740E7E7C26AA00AEE909F8F3ADC2726081A744D8EF6BB711BF5F611A900 | |
5888 | 76F91C26A338DA13A7160A9F42410CCEB3190000D963D036FDA05A29F598EF40 | |
5889 | 8FAE6F8E7E6F50C99C3304A573501C13A00023085F057DF331E3354CBE65D573 | |
5890 | CAE73BF15B3B96B502E0AAF2B4A86237E98A997AAEFFF4227D5A26E8972C48E7 | |
5891 | 761F430733E6EF8AB2D903C17FAFBFA21C25F8A0AC157D397BF3CC1AE7598F0A | |
5892 | 2BE4FB46B29443CE57F41FD5F91122E9D86F903E94D5B55E2BB95949C156D138 | |
5893 | 89883BEFD634311F9280C7F028DCA6408D3A682DF5B55B9F7ABF08F019190F60 | |
5894 | D39E4F0E80F0594235B09A5320109638B938633A2C196E4ED2B43DCD8643C3CF | |
5895 | C6123B076B7F73352F906D96FDE0FBF50CCCA432712C574D5857838BAC30B485 | |
5896 | D25024EB254A7EFE57D1DF0892C275CDB3DF77602F0FED0FAEBC644BCACA04B8 | |
5897 | B424DB125E487794CAB36E01B5E1A26F5E1E97A739AA36D77A12F5B45338EB39 | |
5898 | AF36CEBDED55DCBFCF497FD475FC6BAB5530AD6153C6BD982564EE8712185F1F | |
5899 | D5EA7ADF4104661168A01994C1FD773A50C8AD6A3E4D332E4D59521BB8BBC6C3 | |
5900 | 866EB4AC3EA4532477E6CBF6BBF0860031C3B916AA25E3492670EA67F55CF4FD | |
5901 | 207C684A0DDB6F4AD21B2909CBA71BCE2E762012B0927BA72367A6AE0AF87F73 | |
5902 | 756C9BC85E4EDE35317E2CCCD138C02C7A8013AFDC1A48C3A4BB8EF257BDEEA7 | |
5903 | 60E012F54D12D31D18DC59D5E526F12567B8688B4B67E16B56713870300016BD | |
5904 | A3B9DA87FDC865246AF8E94316799110D86B1DDADB8A673402D4226C519C058A | |
5905 | 1D1E5A5778584FC28AF12819B1924060BC4F54B1054EA6AB0149E04B8C4302D4 | |
5906 | A56D8A347EB5D3D2A0E12CF7E35059BDB53D9FF6BD25F6D9619BC4669CFC1048 | |
5907 | C6C9978B8751B840F27D82A69075832BE59F55C1737CBB1220FB8FF691FDBDF3 | |
5908 | 03BD7D225A9372AC221C38245E48320E1CCF898D9EEDD678E5B8C65B7F588321 | |
5909 | 1A3953EEB9B39EA9A8CB72DB08C3E9234DFFF5FDF9DF804C021D57E97DA7622B | |
5910 | 97F4CB6E0EB640E0DC9EA15C5193F92A3A7565F4C7A4C9CC327F7CD2C44900AE | |
5911 | D9E76FFE62FC37FA376E77131B566AE67C3E09DA80F198BBB995EE8FA47EEDB8 | |
5912 | 4B467C6C7DB8AEA745CF8C56B8BE56534E9C56FCB2B7006426DFE93D728FA4CF | |
5913 | 94F131C549814E54ECE7C914C5FE8E4961D3437CE7475D03534B62650F551D97 | |
5914 | 201C794AA877445DBEB11C85ADF6119B05360700F8CEDE4766E3A1D7A35CDDC7 | |
5915 | 9ABF7C619E3868A39D1852DBE1EEAF5D7898C78323873AC005542B68C43C5000 | |
5916 | CC58F675EB595F87C879694751494676465891E8A897158B481F11A171CCBBD7 | |
5917 | 29603F00210CFD7FF31FE3D273933ECC34AFBCC4108D9B76D9ECE63EA06CF939 | |
5918 | 4799092A54A749DACB82C1424E9879672C8BC084C360014C9C1B6D5D65C68AED | |
5919 | 66CE329C3AD712C0A36BE7EF03FDF339CAA2E0336D387A693B1DFAB5D5164E31 | |
5920 | 14755A158168962C9B399F8F1DF3FF5060D7464D5071058C30C572A2BC7DEE53 | |
5921 | 84BD7614A4BEC4C84E18CF7EC81C811724463BD46CECA5FB57B0F55EAE20CC74 | |
5922 | 6AD815D1897B037C197D2456797B992C20C70B663BF99FE28C513B4E221C8E12 | |
5923 | 49779F8C0AE8517048ADDF7CDF0D698E3EFE60071C4997B7F5EF12B6CB65390C | |
5924 | 224F13FBB99FFC034C0710F05019899689B6D3350BBA65C7CE7C2AB03D81B9A5 | |
5925 | 5F3D65E4D462DAB189006669F7390A78A1B8908A4C913B15DB8827DFF15BB9A4 | |
5926 | A6037DDB643103B937257A7DAB025F09D53FBBC2BCB6B0BCD8D56B2B2784E498 | |
5927 | 1F6CF8470DCC892AD0CFE11578718948BABF9C1427084643B66BB9181094E29D | |
5928 | 5FBE37708E1D8A6B7518A96876844CB66954227A7A6AF28DD075A462526DD5D6 | |
5929 | 40EECC56FA366106E55C7068997B54B7F0D03AC1AD45D28C67C7ECA99DBEDB1C | |
5930 | E18A79C353113E2E05B837E703278B202112B1C69E42A69D64B62F0E7D8F7E5B | |
5931 | C1F93F0F99EC20EF312046F4B0CD7DAB31E422070B629A7FA96583CF3F1519CD | |
5932 | CF08806F40ACD7BB5C960F21E9DA7FB3C72CBA0801ADE83DF738A4EC94F2977D | |
5933 | 2B95A166BA4AE28CAD1E37FBBF49D342CDB4DF615E2C5F3076313AC517C350DE | |
5934 | 710F5D52DE31DF69864D29DABF14234DF13904BA4333B0D714EEA55CDD79DE45 | |
5935 | FF5D64259C877191547076B1C7684CD252C0337BD9DF66CDC5DBAA4F3102F2E8 | |
5936 | FE48385C55727B80D11F3BE0B7568AA9356FB2B180A6B1392D620DED02F0B736 | |
5937 | 5F4399FB9D32DFBC8ED942AD311C82250DA8BFE98D65 | |
c302751c CR |
5938 | 0000000000000000000000000000000000000000000000000000000000000000 |
5939 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5940 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5941 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5942 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5943 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5944 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5945 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5946 | cleartomark | |
45c0f7f8 | 5947 | {restore}if |
c302751c | 5948 | %%EndFont |
037a8b7f CR |
5949 | %%BeginFont: CMSL10 |
5950 | %!PS-AdobeFont-1.0: CMSL10 003.002 | |
5951 | %%Title: CMSL10 | |
45c0f7f8 CR |
5952 | %Version: 003.002 |
5953 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5954 | %%Creator: David M. Jones | |
5955 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
037a8b7f | 5956 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSL10. |
45c0f7f8 CR |
5957 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. |
5958 | % This license is in the accompanying file OFL.txt, and is also | |
5959 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5960 | %%EndComments | |
037a8b7f CR |
5961 | FontDirectory/CMSL10 known{/CMSL10 findfont dup/UniqueID known{dup |
5962 | /UniqueID get 5000798 eq exch/FontType get 1 eq and}{pop false}ifelse | |
45c0f7f8 | 5963 | {save true}{false}ifelse}{false}ifelse |
c302751c | 5964 | 11 dict begin |
45c0f7f8 CR |
5965 | /FontType 1 def |
5966 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
037a8b7f CR |
5967 | /FontName /CMSL10 def |
5968 | /FontBBox {-62 -250 1123 750 }readonly def | |
45c0f7f8 CR |
5969 | /PaintType 0 def |
5970 | /FontInfo 9 dict dup begin | |
5971 | /version (003.002) readonly def | |
037a8b7f CR |
5972 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSL10.) readonly def |
5973 | /FullName (CMSL10) readonly def | |
c302751c CR |
5974 | /FamilyName (Computer Modern) readonly def |
5975 | /Weight (Medium) readonly def | |
037a8b7f | 5976 | /ItalicAngle -9.46 def |
c302751c | 5977 | /isFixedPitch false def |
45c0f7f8 CR |
5978 | /UnderlinePosition -100 def |
5979 | /UnderlineThickness 50 def | |
c302751c | 5980 | end readonly def |
c302751c CR |
5981 | /Encoding 256 array |
5982 | 0 1 255 {1 index exch /.notdef put} for | |
037a8b7f CR |
5983 | dup 11 /ff put |
5984 | dup 12 /fi put | |
5985 | dup 14 /ffi put | |
5986 | dup 36 /dollar put | |
5987 | dup 45 /hyphen put | |
5988 | dup 49 /one put | |
5989 | dup 50 /two put | |
5990 | dup 51 /three put | |
5991 | dup 52 /four put | |
5992 | dup 65 /A put | |
5993 | dup 66 /B put | |
5994 | dup 67 /C put | |
5995 | dup 68 /D put | |
5996 | dup 69 /E put | |
5997 | dup 70 /F put | |
5998 | dup 71 /G put | |
5999 | dup 72 /H put | |
6000 | dup 73 /I put | |
6001 | dup 75 /K put | |
6002 | dup 76 /L put | |
6003 | dup 77 /M put | |
6004 | dup 78 /N put | |
6005 | dup 79 /O put | |
6006 | dup 80 /P put | |
6007 | dup 82 /R put | |
6008 | dup 83 /S put | |
6009 | dup 84 /T put | |
6010 | dup 85 /U put | |
6011 | dup 87 /W put | |
6012 | dup 88 /X put | |
6013 | dup 89 /Y put | |
6014 | dup 97 /a put | |
6015 | dup 98 /b put | |
6016 | dup 99 /c put | |
6017 | dup 100 /d put | |
6018 | dup 101 /e put | |
6019 | dup 102 /f put | |
6020 | dup 103 /g put | |
6021 | dup 104 /h put | |
6022 | dup 105 /i put | |
6023 | dup 106 /j put | |
6024 | dup 107 /k put | |
6025 | dup 108 /l put | |
6026 | dup 109 /m put | |
6027 | dup 110 /n put | |
6028 | dup 111 /o put | |
6029 | dup 112 /p put | |
6030 | dup 113 /q put | |
6031 | dup 114 /r put | |
6032 | dup 115 /s put | |
6033 | dup 116 /t put | |
6034 | dup 117 /u put | |
6035 | dup 118 /v put | |
6036 | dup 119 /w put | |
6037 | dup 120 /x put | |
6038 | dup 121 /y put | |
c302751c | 6039 | readonly def |
c302751c CR |
6040 | currentdict end |
6041 | currentfile eexec | |
45c0f7f8 CR |
6042 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
6043 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
6044 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
6045 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
6046 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
6047 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
6048 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1BA6FC8D4362C3CE32E0D | |
6049 | DCE118A7394CB72B56624142B74A3863C1D054C7CB14F89CBAFF08A4162FC384 | |
6050 | 7FEDA760DD8E09028C461D7C8C765390E13667DD233EA2E20063634941F668C0 | |
6051 | C14657504A30C0C298F341B0EC9D1247E084CC760B7D4F27874744CDC5D76814 | |
6052 | 25E2367955EA15B0B5CD2C4A0B21F3653FCC70D32D6AC6E28FB470EB246D6ED5 | |
6053 | 7872201EF784EE43930DC4801FC99043C93D789F5ED9A09946EC104C430B5581 | |
6054 | 299CB76590919D5538B16837F966CF6B213D6E40238F55B4E0F715DBD2A8B8B8 | |
6055 | 80A4B633D128EB01BB783569E827F83AF61665C0510C7EA8E6FC89A30B0BC0EB | |
6056 | 5A53E5E67EF62D8855F6606E421BD351916549C569C7368AAFB714E22A023584 | |
6057 | 8B1D6B52FC6F635E44058690002C6BA02CEC21C54CC8875B408A8BB84F445894 | |
6058 | 5D6B3E4841CA20AF852A660FE9C832F773691DC6F7197FF3DEAEE97418A5ED2F | |
6059 | F2AE65300416227CD3BB03C29003C770CD7D2A7A2E4C1DCA193651C2CDDBF93B | |
6060 | 966938788694BFB562AB0010268955FC3555E5984CCAB0A9B7590C77C9BC713E | |
6061 | A29E5BD7193A4E971D1752DDD0F0AA4648E7E87BBCE66A1E836C715C408B07A5 | |
6062 | 9EB56BEFD4596706CF839BA4CFA90CAD4038C1E006B51913279A2C31FBEE5BD4 | |
6063 | A7D74F9103CE6124F5B439CB860987DF44FE17EF88EF1BF62C67060D25696BCD | |
6064 | 94ADF08F04E349CEBDF9D3389D870D94CC05E393B3F4362A13A6A672EE5E8F5A | |
6065 | DFE7046AFE3EBAEA58FFEBA4A47BF61F92E2003756DA643CCF2C9DFCCAB62669 | |
6066 | E3C2A18D690B64D907F50BCA155A85E47C3A6954C6FF7ACA36D8DFCE777B7929 | |
6067 | 5F5D5F787B9C247ABF13D6D7B4A8F06BA25CCB342F8A5071325CDA86AD71BA23 | |
6068 | 8A9695C7D1D50D0AAC267AB7CDBA7AAF46A264B7B081B7E79AD937FEE4969FD5 | |
6069 | 155A99E652461EFFB4BD010E5885631E2B2497D6B8C43CE77D7D47FE201DD46E | |
6070 | 4482FFDCE150A1183C22C004A0AF0E1F42AA6804E038E1DFC8B0A3CE26B52038 | |
6071 | 44D2E7F759DA5C252489E5525963D68BC27C82247BEB18818C7D4CF0BC5CC97D | |
6072 | 8C701034B8DF798DD4CE36C3F8B1FD40B2DA14EA75583852875031AF8C909EE0 | |
6073 | 04495FDCD04B05A5EFEBA56A8CAC1F57F1B8AB91FB25C81CD51EE69D6E0F52CC | |
6074 | A0E12CF7E3187D67DF71A599FFD895FAA7BF80E2E6B96592BE77AE96905BAF0F | |
6075 | F547355A36C443797DDA7C414AA606CF9153E03450B77D1BA4088D739DF55F07 | |
6076 | 111B9E11AF37F45B6EDE6D7AC126E05886A57C83886DA87761BE600DEECD1344 | |
6077 | 8A82BD652BE7ABFE6A0F50ED7C6F4EE12CDFD80CA7A5518692F267C51C3FE76C | |
6078 | 567BB8DDBE09A2AF901F79AD02B435287CB8057B3D5EE6655071F67B00438728 | |
6079 | C4C3EBD648BAF650993AFE5E2B29074A99ED0FB725D9B8CE8B0292B08A280214 | |
6080 | C3AF252BEEAD30C88F72E322FAC3E9D78A1038F5DFC41F7BF1AE3744A0677094 | |
6081 | 51B77C2D630B67853FE5E975A395C06A4D4DA744040B272C2B88D8B7ED3A2C01 | |
6082 | 66F503C9DFD3C7DDAC865900D2A4F2CDF517F449851DB1963468D0266D7A3E58 | |
6083 | 9F6B2A1843E6444274F16A9930302DACD8D2BC4588765099A86BCCD8A31DF0E6 | |
6084 | 2853114DFF2D19F812F19AE6C2E419D7AC1BC024D1195074FD0C6717BFB389A4 | |
6085 | 4D5428E7BB2E4F9E9FDEDED7BDCBDD3460805AEA0B5F6460C2FDF19273CE5BA7 | |
6086 | 5D3AAE0DB94C6AFA8339646191C23B0149E7CBF136FC4C844E025A38935DF256 | |
6087 | 0A0A6466A45EE8B9B23B6A055856FB084F87C73BA28F1883E3B184CD813C72F9 | |
6088 | 233B78CA4E125ABD26F29B92CD9DF39D6FDC2A217E2B6B45D9B0A4D536790A5D | |
6089 | BC0903069565A442FA7466414D948AC432C6B75D8D0E1DBB217CA3DC38A52DEF | |
6090 | 62E9D5AE9E753956C13819D93148C7683BE4F71B80BC066D8C19FC807FB1C086 | |
6091 | B49215DCF56A91A42089F0D063B9981925691F7DDE3237403AC714F5CC3ACA88 | |
6092 | DB2F1DD205578C00472FD70C8BA4F752E3923ACF3164D442A6B639902ED060D0 | |
6093 | C5777BC20F9A3BDA60FA3BC986C38136FBD2E8F910E32EF36377C9CC187F4AFA | |
6094 | CCEC423DB925B378522B748BDF12D523804CABA83CB5A7ED69FAB9AAB75EE8FC | |
6095 | 38D9866E3754C4E2F2B9AEFA804044D878DED0E114EA0E9682FCF38F6628E63D | |
6096 | FE1C1B5615E54FAE8684566EDC4B616F76EEFD6207E0386F06D3BFFA26425F24 | |
6097 | 303CC7C8A8D7021E7D09B202616988287838C3DBCE3179B4FB5C726E603A47F2 | |
6098 | 8248CB508F327D1291CF3F08F7C88298DC2D0F778D24304EFCF6E074182BF5B1 | |
6099 | 8E6551811FD6991971692108E289B61053D6DCBA2925B3903E8916EBD09D97A2 | |
6100 | C6D08E89DE4C0CDF7185E1E00DF456B249F0BFC686E04FDAAD2772DC2C39DD53 | |
6101 | 9C23A41471267F53A87E5C2B8CBCDB66CE0B9844BC506428E6150B48D2FA6363 | |
6102 | 4FDB2CEDFBAE0B7DBCE4D83E29B2955F8966272CB865EDB360C8A8C19EC62A29 | |
6103 | 03066483E4083524A1E8D80FE3867BC1AA91753C26ACBE8489AB0E3330206212 | |
6104 | 93E07ED473DBF457EB8489E66FB4B8ED8A9EA8911CF9308CFE3E6D6F36810EE8 | |
6105 | 91CCB11BD548617B2C683C354452B9229E7C9E68828BBEC324420DF7C188CCE0 | |
6106 | FBB514547553A7E9B38AC265783891F42DA472388569C8E7594F7E8810895A27 | |
6107 | 06E456902A8D9F65CA808F1FD475D011C4572F8A654BA01D67942226A663D179 | |
6108 | 95149FFF41A9F55AE84EEB9A6A39C017D7E4FD6EFEEE7FF3CE847CDB064A4954 | |
6109 | 9DCD273B810E0F259501BA4003A3EC1ABA6E13D24C0B57FF82D6DF077833B6A2 | |
6110 | 7EA54801BA81DB961C261689C0887FAD83771E55D3D137AFBB21779397E11972 | |
6111 | 6C6CA922F45AFA5C0526863A5AD8B9C0775CCBA17FFD37A44CED4710884DBC31 | |
6112 | 5C9D3F5441595B86CF7CA2EEE42AE87896E9E60EBF5F35C2B7FDBF9A9CDAE262 | |
6113 | 3F48396F0F741E9DDF1D4FEF75E68AFB020D06CC29B3A7B2ED819D1AABC12B91 | |
6114 | CA2A65F1AFDDA2F3FB322E0268DBBA024663E49EFF076455338FE31A16B04EC1 | |
6115 | 797EAB0B49AFFB906A0690A1E8E2F5314773E1CCFFF43E6FB3875AC907F0C5D0 | |
6116 | DCB9BCC127014D472463560CA0CB1C2CE614D94177C7A52A5B089316689C8112 | |
6117 | CA57E35D716D956DBF9013B1E5B9626456B1433C8C15FA906458F957133B9E19 | |
6118 | 8D46DC3AC015F7602538C2AE3927C6DDBACF38E59220C2F5AF36B68DE9117C51 | |
6119 | 04CF7DF32B1AF55B87D1D8A5F4BCFEC66F63B32B6548DEDA3AAB06C5310E4757 | |
6120 | 78AFF947DA22809B360FE535506A554DDDE5A6F2411246653710ECE5CD3185BE | |
6121 | 730520A766C47E1ED01890059882BE1432586864E1A86A7F586438C8DD35C00F | |
6122 | 021A741ED47E0F16DB6070ED0C50038632CA4AC2975578A8372A080CC0447C79 | |
6123 | CEABDF2BCD5E78564247B0F0025F556DA8FB62125227849EACFB724A4AE3EF57 | |
6124 | 90C07A5B27D2E59425F56BF8AD84C5F5310FEB1BC73D536339FC2E6A5BE2DAFD | |
6125 | 97FC835E0D52F680F80ACA37DB498AACF152B9B44626CD89E3302C3EE1623EE0 | |
6126 | F998FA78305960AAB9F483F731F5F67A8C963C23DB8E48FB804EF8B86FAFE7F9 | |
6127 | 4C09641915FA7E3930AC922682313408BC1607C76751CEEAFD660206A39CF394 | |
6128 | 40ABE2A313AB7D5FD6444E219DC5C26734D322BA268D330AC17959A390D6C8E7 | |
6129 | 3A155095BDD66516DAD5D65519A7FB871ECDA77061EFB21F359158B4470EF79B | |
6130 | 362C35C06B85C9A9505C8361939C6AC013F2CFE8EEF46FD8CB4452AAB3EF1FA7 | |
6131 | DC066557BADC2ADDDF7DDC2A0E1DD4A357E27A2073427EACF9B9035DA5272136 | |
6132 | 7DF37E26D96ED4B2ACD60596E039BCB15E259C72FEB3344E3EEE3D4F17DF4233 | |
6133 | 04C1416BCADE80BD483DD8C9AF979E1C7D50C4CF015870703F88B92C4FE46AB8 | |
6134 | DE6717B55C460C805B391B84333097E116F4A51F631FAFAB34CFC925BEE8B72B | |
6135 | C9FD5F5A79D8F2295FBFAE649DC6AB47794AC7D73431FFE5BE992F2B5AC67049 | |
6136 | B5208251C0E442385A9FACF25E3A98D7F5D4C2A1ABDC600AABE84769CA83350F | |
6137 | 9B87F71CEAD3600E02FF9AC03C1B5C21C84F911511A0CF0111BAC7605EE31229 | |
6138 | 3C526A79D943D92E1CC3C38ABE82D560CFD4172F318030852A5FCC0534B8B3FE | |
6139 | D7365987C8B48A072907B26CDC2108130A33233E8E0BB5FDF14FB55098A10EA2 | |
6140 | B51AD9EFB119F82B08D256D396D3263FBD9DBF172D43A90ACD1A31F3E89E8571 | |
6141 | 74BE98B9560E2CD661A2F93C69FEA3FF26B00772AE2C2C24B98D3D122EA2AA8A | |
6142 | 44652CCDF4EF4F01CA7D62A976E23E8A86291F43BFAF38FD9C325E70F9C36CB5 | |
6143 | A181DAD30156E98339E6A0498D3420B7BB3B4E651A9090D4A17604AE386273A8 | |
6144 | 3D4AE8CC18345E6E19DF06BA848F203F74B161D6A8882991CBA7385F308696A1 | |
6145 | BEEB0130D938A764B98A2001A38489B1334025EA848CA44A116D64926D460D64 | |
6146 | 01159E77EA7ED9ECE7BA77635BE564A4ED89315BDFF54ACE6AA1A26591D13CD4 | |
6147 | 6D6425CA7933769B842192858D10998509396829263290A3A7CFEBBDA3EE6CDD | |
6148 | DF1E492AECDFF7941B53573F01F623CA0A5ECC9D05A3D0954F7AE8CE94AC3B2A | |
6149 | CD4E27519B2E16F033EB732AA024BBAF74626DB55DC74B1FDDB07FAE98B4AC5C | |
6150 | 683CFD8744F361838D343B657EBF52DEEE7AEA7565C5BEEFE455DDDBC4DCCA7D | |
6151 | 87D6D769C5ECCF14118A14A85A86865777C8E28F953160D5E82844AE54D541DF | |
6152 | 550D5F1519E183E0C42BE88F0458CE8087F2CD4B1B49A8E9E3D127C4A4CB74A6 | |
6153 | 2E73BF4CC317781D03FF04BC36AC0E4AF99E2ACAD20F6F8029DE8A035DAB40DB | |
6154 | 17D237850BCDD05931FF4B0FE2D0B79EC5A88FE0236271CCB075BD194AA25AFB | |
6155 | 3FB93A5206F61A14602E4EB6F1C31C654527CE0C02D04314DF9AFD710D0EBB9E | |
6156 | F8721B97F5FB18E27507E1F800B5509A58A1A8296C72B7B73F99B6CFE42E9C2F | |
6157 | B63B3555475E562672645CD374BCDE937A9B05A157FB3E74C8297507253E957B | |
6158 | 1A9DC421946734CEFA3D5EE357DAC7E9DE17A5BDDEF6B2D2A740BC58128FC514 | |
6159 | 61154664412BA1C05209EC992A77B7CA45AB7C0EEBF590A5B5652866008CDEF7 | |
6160 | 124A3003AE6A7CF9DF3C72750CBD281358CD2FF25B162B78CBB971DB3477F8D2 | |
6161 | ECA3EE9CBC90323B2C236E375337EA0848CD7CB5781A2B0A42DE7E4D99DB2746 | |
6162 | 0B26796CEE129D23C76794B7CE21C13C7D4A998B752C8CF43A4821B736EBE246 | |
6163 | D2A2BD7BA3351FBCD1B0A501EC1EAABE60D06DA2FE39BE1F0AD629769FDDC933 | |
6164 | F9D02F9686EC8C2D7455C26AF4DD3F6860B2289E3A30E1C254AD17D731CB73B2 | |
6165 | BF4DFE90CAEECE3ED0CD3FB4C8F4C7BE1C056AB4E9B95781A8968E3CC1010003 | |
6166 | 75DFBC4AB9F6B27C5A9AD88D94441A8ADF09EB275E5F0E5E6F3BFEA0FA8C308A | |
6167 | 8593ABA0645ECA8FDC3F0E264B35D4B0DDB86B93CD8A047FC409E18196B501C3 | |
6168 | B003622999C47BAC04FD1ABD8AD359C977766E9643EF3BD6385306B08EE3E13E | |
6169 | 7DA5A06AE33D17A3D574C6390DB6E9429754B210F0C349C359559C7EAA2350BD | |
6170 | F61D4D8A92B1AF697BC620FA0351E67E0D9F41A95A47EE0BF210C2C48691901F | |
6171 | F905F65693DCB85BE412F097480F6A7266AE0A928729DA0F691CBFFF3B276EA7 | |
6172 | 322BCD2206D96E3DAFDFB992CA8F2955F0E8B882729DFF840569D12E4DA1775E | |
6173 | 523AA734552AAB6F2F16B89B39F1A3FF0E07EA08D13E612F201716C67F327017 | |
6174 | 6C041760DA30374434808273062C1FFA2C47B3FB578807BC26537F542040FF77 | |
6175 | 66C995EF3E8B08B09FCD3EE89C30F157158A739606D2CEAA26694A4F1CEA6633 | |
6176 | B54933141CB85C60AB262E2D4E824A3B85C2BEF810DD774F296AB37D0BAE7182 | |
6177 | 5648CD18556ACB124246A75474B232D712C2358908B5D9A76F82C626BFDE01A1 | |
6178 | 093B8FA6AA0B32F2CDEF737B28BC0448FF816DDB5812131DA0DD5979D77C3838 | |
6179 | B978CC3F6778A4BFCE9A7087EFB19749285AE4C92B99A6649DA349A2E0889D72 | |
6180 | 6D4FC664522F06C8C4D86D30BA43ED4E42211217D01636A4E17E2A132D26F394 | |
6181 | EC34EA12D84594AED9C6CDBBC0908860F39B240FA7D7B3003DB10322498691CF | |
6182 | A294C0FC7ACC0BAD1EED3E9D60AAE3F7429695892D1A21CEBF062C6129B33966 | |
6183 | 8B2EF6E932F9891DE6028B81C5E9B23278D35B7F0D83989BCBA25E20E9D503DE | |
6184 | 144DC485F09A4EFA1268AC5E4B551C5B2F1D51E9B9B9C0FEE585204F869D0BE0 | |
6185 | 7287D7570A12940A47C1F51AC6134F03B415C30E147C49F89228855D093EE55F | |
6186 | 172711F37776E97A99CC4B36E2F10713E36FB279FD3FA5A0EB9F3938F42E2BB9 | |
6187 | 254EB8F0C0F30391735019E02BFDA21D9813C6A22279B898EAF01AA892B14DC6 | |
6188 | 5912B9275167AB46EBC420836CC1A5F38A4EB47C039A7BCA62BC3FCE4199FC71 | |
6189 | 011DD6E5FFA0F3D7F04AC02AF91B9249B9F993AE346572329DA852115BEF8460 | |
6190 | B94690E790003586F473F37EAB5AC2922F5F663EE2C3C0C336A8DB71650631AC | |
6191 | 0A923A389AC911CB215EC2EC7D50CF8AEFD59EBFFA53A9F1FFB7E6215F17093E | |
6192 | 3975F186FE23BB5FA5474C11408FABD223E1E6F62035B5A5C1AEFD8899F00FFB | |
6193 | E729C2D5FD551E80716CEA4E8281660286A802AAE8D5834F37F2EAC46297E57E | |
6194 | 993B09251DD7789D3467417E393B7DEABD06676B96241B0E43ED1A1A9FC3B12E | |
6195 | 0D34B2B0792B79AA648FE9450C3B209FB6D7D91F50C52A5DAB0BC81A8B698BD9 | |
6196 | 18946EFF691912D7348D48FE68CD876FC6F71F81165D0C3272DA1A992308D9E0 | |
6197 | ED6D0A4DAD679AF495F62B78D462B463BD4A40931172290C615B3B3B6B47E45F | |
6198 | CEBB85E0A6AB6832067CA6D403C239530D07F199788AA4DD52553836851C5228 | |
6199 | 1072406F6D7323A334E7A7FCA588897C4FBA6D4F7DEB65525EFB74E539C988C3 | |
6200 | A685A98752F7198E77E456A545F0D23A1BEF81EF58B02D289CF980A3F17BEC8A | |
6201 | 6F83DD90C4A917EB0E5E2B444A608E2E9D2FF80620E16AC1D7775C0A10C1299B | |
6202 | BEE0E1AB24C50647E5CA1DA65CFF3B2C295F0644CA7826E1DC6FADEA93D66A20 | |
6203 | DE852F20AD224D28DB900519EB1569837139C833F24B799F7EBE3FDC14235323 | |
6204 | 1D0BCD4991C861F38DF413A5A5588B73AEC3BBFDB885CE17BB3E97B4E6A79761 | |
6205 | 93EC8418C2BC4725CD61B5E30C07352F647C3FD50083878C13CFAC241DDCB082 | |
6206 | E53703D182068727F9EB6FACEC25F6D901D7309ED7370867E34E267519E22D62 | |
6207 | 4FC7093448BD0D6B1C43D318A3E14C92032325C132AE0FF7ED707E1FA4A955FB | |
6208 | F5224BE0045CB14ECC321D0F333FE24EEFCC504F7C756451D7693C3E6CA87526 | |
6209 | 4912E1B6DB935BDE76FBFAFCA4ED473F1D2618812CFF25A6859C626A216603C1 | |
6210 | 361BE3E071FCFEC2D4BF2FEBDE07DBD56A1BFF8303901168FA06488BA6B76F36 | |
6211 | 95B0A90D7724E9ADB567C2ADC65CF3482CF47FD1D16F70AA19A97D0F9EFC611C | |
6212 | AEA5E1ACCDA7FB2DF05E9480936281484BC329F0B771775E73F7FD72FE3F45F0 | |
6213 | 50ADBD03932B38F37A8F0A66B2F739EA3AC8811C8F514E68C5643E4AFF485C81 | |
6214 | 88475A523D7FCCA5C8809BD49846C77795A38DC6406082000236A4D2628B5932 | |
6215 | AB7916D44EC2210CB941B1455867E510E9D8A0B83CB645BCABDCDBFCD51A4E12 | |
6216 | 60CFFEF0CCA548F654037D01CD631FC4E1F97B4F65DA9AE79D99F13A726E93DC | |
6217 | BBB027B7D175FD17A704C4668F6F8428262959DACA9F8C687C923CFA053804C9 | |
6218 | 9B2005FA7E0F07D81E52A9A37AD5CEBA8EA63929093ED0DAB9F7C99C82A50E6C | |
6219 | 6440387049A0C359218F5268C9A28F581783BB9D29E08772D7252FAFA6739687 | |
6220 | 22570150178893C418531769CB3D96F799BF1C6415820F96B6EFAB5344E82796 | |
6221 | 38A0DF66609F5EA332C1065274EC93027D264B84B52AA8AD82E13E2A41AED340 | |
6222 | B240D1888CB89FBB748FD10B214773D466A44AA2AF44371CA8B9A4450DA76EDC | |
6223 | 0167B4015A270B9983B89EFFA023A3DFFDE181B90C51D70557B0844362B0652A | |
6224 | 6345C6EC83DFEFE099455232455943718297254186940D6305C96EE2B9E3E7C9 | |
6225 | A622D25E0471AC31A8ED3AF8897BD19E322CFC3BD3860D8A0634081D9AF53A9D | |
ad4aef08 CR |
6226 | 84F4ED39D8127CBCAF9AD48E9CBD10A67A2CD0CF93D61B0A2266A5D10C0D1B53 |
6227 | 45C41DCC3245CB3488020BF6049ED80E9A761F13650E3438D14F0EC89C11D18D | |
6228 | E44B6E47887F7BC25AFDE2D512647277B9CE23AAB30B7F1ED5DF84921B567F16 | |
6229 | CE118D5A71B65A72FE62F278D04B1311E20739AFA6D0C911CB0F041C38FC5E0F | |
6230 | E4CAC661E2D9102EEFB4CFE26354CA4BB30A07F2B686F1A4FD8EEB048BEB735B | |
6231 | A14E7905A8A538B98AC7B6C8E329B6DB2DB726C5B2B07E26F9C90A4E76C69EA1 | |
6232 | D928BBD0E1CA65D7402C3925A88BB09C7AA025E178D6579DA73010BF80A1332E | |
6233 | 63C347B2A1911FF3BB0D28FCB85ED78684BDCC488A7D4D2BB91BB593ED517EFF | |
6234 | F0F618EF3CA13C5D281820ECE618DF32302A0EA74D7A956A0304BEC2B6CC41B1 | |
6235 | 60A2BEE2BE369B2D9BF516E1379DF717F0D6DCDDD7855BA1475AC908334E992E | |
6236 | C84426AECF7209756184AE6CBDEE2005AFF66C89C743CB682403750794A927D9 | |
6237 | A00127CF00165DE8D171DDE90F403CD145C0B7AFA9BD46C33968D50D294148F2 | |
6238 | 99D4B9424546FC2F0722BC22FCC5C91FA5384C95669931A721F15F0FF5752BED | |
6239 | 6477E8A28931AC48A54699C21DA1B305EA37C12B24B00E7A0A2C9AAEC359FCF0 | |
6240 | 18AA95A4E5701E7CFAA3D40F82C4CC20E27E9E47ED47767FEAC71CA0C22724DF | |
6241 | 4A60B70242C35BF769D1612031ADE0B3441925EB80EFF02BD1198FABD652D0C5 | |
6242 | CB11A54728D9093958A5F5B9F27174BA5FF4E59A1432B21DB95C262D3999AE8D | |
6243 | 3B41E4E5091B55780DC9F4303532CB055E7B24768E70A06F19F0F794D7F62239 | |
6244 | 6ACB7AB588C7DBDC9B71B38A92947AB68AA4D62EF3A3A88B4D94A6B7EDE12B69 | |
6245 | 49EABD0595AB29374374CC92553993F18AF65CAF555ADFFF11171FF7B18ACFAC | |
6246 | E87DBA35D6FE93754F475043791F00B1C1AC0796791775B22DE7AE5C04828EDD | |
6247 | DC30A00A6171300C6D65292A3FBC28EFCC8019CDFDAD405F8E29C43CCCEA3B0E | |
6248 | 7A7E8526F631C35857CB9B29CC29A6809637444D659BE385375395A6CFD5C44E | |
6249 | 5461CE4F66B114DEB16F2D38968512BB9F3D19D08C7E703F1FD705CCB1AB804E | |
6250 | 107B97B09D1036A7DB5381E9B138C9233C265AD6276F5C1F9067F58B82BED76E | |
6251 | 53B450BC3C015769AA7114DDA03FA38DBEF4A395796C7DD303CC708B118B4D63 | |
6252 | 7A702B99D29BE641BFA37F6FA8BA2EACACFA57A1982974F77DF26A9FC28BD110 | |
6253 | 2DFB33ABBE73E70CC60C8467CA62A943187046A0AED988A3AF7651A69DE5FA65 | |
6254 | F2EB7948AC50F8321CA69E02EC5DCDEF33B591CDB6B66B6B1ACC58EF567B92D9 | |
6255 | 1A27162F811E0A5D55CD6731CD237C1F912BE6382943C1F4524D606187819BFC | |
6256 | A850FEB374775960D66693F2B403903FE44163FF4A0D45E21898716AAA47B981 | |
6257 | 25274AA20F0BFDBCEB529C417FBD16B9F31AE20DEF23166A1E8D32150ECB2728 | |
6258 | EEAC9565BAC22C00CA9D4F47286C7034E96EADF138F320D1C18AA199446A277E | |
6259 | FF8FC90E337B6E04FF4C46434A8ECF1E411E2BB12175CF3997C62E1220CA6B42 | |
6260 | 64D03960C7C5CCF873D12B4834B73A32FC8471F14EF941071B971F1BAF36B49F | |
6261 | 8CE1310F09D42A217861210066766BE13E7103BD2D8F0486EC592B99F38B9B89 | |
6262 | AA15010CBD1D19BB4E4E2C321FD88C2AC255427AB2B4C77572577D4EBBF493BF | |
6263 | FE24B8739F771185D80120ADDAE236FACE47778E1E04A0359D60068BD20422B0 | |
6264 | F3467AE613FCBED36B4C9D131E854A80B01DEC5C4FE955AB5CED1021DAEDA722 | |
6265 | DD1254F51EBD07AAB22DC0765F57191ED0A75FDE50BB145536AF35C3017C6067 | |
6266 | CFF6410970179923D3B9765F633D991BB8F8BB72566E748D76A2649E21D98590 | |
6267 | EB4070C5777B195B8EA22F9EDC711AAAECAC4C3CDCD19181E63ECE52A9FA3B85 | |
6268 | 08D8376FE890668FFCF11FFAB44EFBF2720375B524057D350EBD718D094D919C | |
6269 | F97CFA593D48847FBD6170595943405A019CAB17B75CD4DABA1610F3515CC01B | |
6270 | 84222867AFBFD9700AFCA5E57BBDBDCC8567235F3704949CAC1B405E7EC3ADFE | |
6271 | 6B3463E0D6B5706557B83172CF604B8B2A58538430CC7DE33A5A6E169D18506F | |
6272 | 3FD7F0EEFB083D6300B16150FC27801760DB690FCE4418F0B410ABF1573D3F5E | |
6273 | 603D73D40679B0F1B842F708115C547C3B3DF1E846D52AAF8615FD8A7DE426A5 | |
6274 | 3CE27D064FE50903140620137DC9651E646A0526BCDE4BB3F1B64483C24B98EA | |
6275 | 7361FADE8BDCC23DD19CFCED7EA733FF262A7FD65CDCA423A14B27EB321D34D5 | |
6276 | 0F5F90FFCAA3DAC323CBE5BD09BF91E906A5EBBEB55A0190099766F2DB280096 | |
6277 | 335E5E5E3F14181FB0699B6C267478D7CB48FB6362FF72A453A124CBBE0FA8ED | |
6278 | E42133899E820915B6E3A8B0EC82E76FDD1D4F4B27044C27538717ED0BE41B9E | |
6279 | 89126E513104BDE9A5453B1A73CAD8976D13C67C785C4028860D02CDC2DC0645 | |
6280 | AAE179BE17C49DA8A6268AF82A8A9FB8A4F26D3E4C0B5DC7AEE18D2BC95E7B8C | |
6281 | F13FF31F40AC72047FE48817E2A2F71D77C81469101F19CCB7B86CCBF0364FEF | |
6282 | 2CC8A915B20F9A949DEF1A45A1DDFFC88AEADE0FB3D638931A84CAA7FC10AE33 | |
6283 | 02E538AA472D951F2B97B21A506D1677C5FCC30BA7B5443FBC642179D253689F | |
6284 | 2980471A237F622A14A570F232DD885BD8F66C2449A8A434E8132F8D58A86BEC | |
6285 | 48D627687108798FB4C8A84F5CE88721898C687E6DC0ACEB47261F89AD9A3A1F | |
6286 | 44B63C73002F6F338BA880CA3DE4900C378542737263264B7C2EC21953744548 | |
6287 | DDFF14BF008F8429A12484304DDA3C4F769221081D1C75F39CF785B11DB4B6FC | |
6288 | BE27B473FFB49160DA29BC5C205D21CD2030BE08E406747673A0DB0720A82363 | |
6289 | 950F059413D4994ED0A9975D4AE94D6580B1A42773F07753090A9BEFD093722A | |
6290 | 0043130256D4A7A2ABFDEFDDEC878D8098F373E325B16EF7B3773EC72A011B76 | |
6291 | 4357BAA1A4B56A8D8C8BE988E6F815FE40CBCD3BABEA9A1590B60D891B613C27 | |
6292 | 7825F6058B0497C7C4393467ED8DDB8F88C15087E623AEB6D05568E4838E388C | |
6293 | EBB708FD7386DF5E020B27F5307EF401DA3C4397B8A475B40CBFA4E518628F5E | |
6294 | 5A1ADD4E79E14E72DE0D3DC7C1B6EE2785D4221ED22F8A2DBA5628C897A35A5B | |
6295 | 54A1767DF59FB0569CB787AD82CBA050B2D51275176EDCABEDFBEDF7DDFF9AB9 | |
6296 | 8DFB0582386A7D078845811041D05C82FADD2DE71AA5004FA463B04DBD60CC44 | |
6297 | D0057C4C30E6095D23B6A247BA70CACAF81A4BC0373816188395888887CB6784 | |
6298 | E24B5A65FF3ED9DD681FEB4533B837D4C2DEB1B9AA5DD0A3118F88278A383B94 | |
6299 | 422438257AA993C9EEB0F45C12DC1C93B5CD628B2010628422C5A66A1B7F4418 | |
6300 | 6F7411CC00A36AB05E3C4A51124677CBD417F3E72ACD5C705F01E89CE0D1E726 | |
6301 | 70FB8CEF1879D2152B177B3792CDE557C67C93D220457A098272879E864E020A | |
6302 | 3878BBD1620F05303400F0B537D222E742A9371F37B781BB0A720EC93DB5C099 | |
6303 | AE0A2F6E55D3C694EEE143E3133B10E3B4502B8041FAB5CAF6418743A1CA7D7C | |
6304 | AE0A8F29973ED9B4EA82D0544DFA406C011E42865C0836191FE2392EDF93E89D | |
6305 | 99D59DE2B4C09074DA7C8661AF0A9E37E27D6F07252B30B2CD24D2636E5256E0 | |
6306 | 3E61FEFB743E6E87267C163D43673411F3A14F891DF034AAA2F2D2AB133793F1 | |
6307 | 8CCC454976229F2E57874BD92979A4B94110D630E4BB02BACE6249BB738FE96E | |
6308 | 24087A965AA5D0684A252F1C732F1C56AB9F5BD0164237A5BE15130187518A21 | |
6309 | FB9457DC12600A4236272499986F57240ACA7268D9990F1375877C70B742AEFF | |
6310 | F20557F43846233F6114F8C174FED6DBC3BF7852FE5628BD5CFA250E463E67C4 | |
6311 | 753C56B9A10AC2A4EE4EC9440447F2E7371550BF91511C8F336EF9352BC3427C | |
6312 | FC17B8B8626066B1B5BABDF1D45F33C7BA4D4F0C43F5BB9FA2C36583A7FAB9A1 | |
6313 | EF21DF17575CD5DCBF606E564EC87C63D57B7CFC72460846448D01E007093DD9 | |
6314 | 9BF57E18910E472790D29EB88DD1CDBA87910C6C4998308210823F992B29C38F | |
6315 | 0C420623347BCDC52751A14B8ECC58F27B6311C31A59F7661A21D1B2B5BC11ED | |
6316 | 68C807A086E05786B5E6091DBA26B2C4C2B4531C1A0F9AC0976F9D50A1AFF8AC | |
6317 | DCDAC4568B88EAFECAF7BD1566C4B0B91385CDC9BDF264E28EEA33CEF4EC51F0 | |
6318 | 3EB360571E8CFAAABCEDCBE7A7D93E4582176E2868D2281EF5FC7F75CD7A9017 | |
6319 | E592C375B2512D2A3D6CB8973A6300B64738A8E4C1FA9E278A4BFAB2550A2309 | |
6320 | 770577D0C5ADAEF4A028FF5D551952B86521144FAC12ECE5E5CFB45A80EF9D62 | |
6321 | 731FE38839CBBC64B916BABCEB5A09DDE1135705D6AC4D611B760152CC64B7C4 | |
6322 | ABF78206B1992A27122D238D24BD4AFB8379EBB5B5210B2E932E983B77AE1802 | |
6323 | 9C892AE8DF3B36DB44DA461C9030A3565557E6B15F161386A8D0A1D04C572DCE | |
6324 | 7C23E8790A297B4D866017346EDCD257B4F0DA96FC30A4F529BC931941479BBB | |
6325 | 261E17511C9A779AC39B22F0343153E7D835CC5932091EEAD47CF63D1E730A0E | |
6326 | 1157D3D259EA39E202C783941A73CB7C5603A673C03742838CC7BDDE32E1350A | |
6327 | 4A86F40FF34961241E890DC311FBE8A36E4744A1646EEE7A207DC316F5E25CC7 | |
6328 | E3CC4F1BBBA3E36D6705F45A4C379EF000D59DA15767720D75611496A9D632CF | |
6329 | 5621F0969611234AB48FF342A04C6293D5472E457BF81D6064EDFC0F44A9E5AA | |
6330 | 1B772D08F49162E5FFA2BC610C0AF91921B51EEC5D6B7D2576033356F7F33FEA | |
6331 | DDAC2B393312FAFBB7D17E952BB152C38A8384C3FF701CB671347EEA29D4E73B | |
6332 | E71D670FA1BA055DBFB487220F6BEA357AD8ECB3BCC7F77DDC236BAC7CF5FEBA | |
6333 | 7628F5EA10233713B3891C6B67AAB0D3C6AA594D80713C1B96927AF89129B69A | |
6334 | 6C043FCDA2F352A800802330A8238D638F798F4BBB7C54E9685C3CCEA32751B5 | |
6335 | 717703FC2B0D796DBF4766A7083433B6D629F245E0DE0F601FD74158EBB0F134 | |
6336 | B72B5D7129246E2E2FC5673C1CEFDDD822C4806C9910A5326FAFFAF34215F3AD | |
6337 | 99C3113E50EBBAEA9853BC56602BB053793DCF12E4B873D3467342E27312BBBC | |
6338 | D02752C3B6A47CF84A297D28BD3FD25870114A55A323551D028669C37FFAD6B3 | |
6339 | 99D786057CA02624513B073C9C29744954FD5AF9AFFA26AE9C15959EA884E16E | |
6340 | 620A7A138CCD2181945BF7E101D4F06E6F5DF7E9D73BE317B3661B35C1F62214 | |
6341 | E129ADCA71344C781E6E9E1ECC9A064386E7DCC3F768E4F5295F6E9387FFB146 | |
6342 | C10166BF0638FBB7662EE484158957AACFD2E82BA237DF4185924977538BB8E3 | |
6343 | CE992843305EAB5FD94CAA9E0574EBBC8C5AD0C608E021BF091E8B6B04A68ABC | |
6344 | EE8F2DF7CF10638294335F0A60E765DA7085007640C93FBE28D36C25714F79C2 | |
6345 | 36E58ED9D7C7C2153D2F3C826332F9CCB5F8B885DA1BB7B4D50216799E96F40C | |
6346 | 71C3D18FEBDFA61DF3ED1CE1FA509E8CA9489679253753EC72F75056B312737C | |
6347 | 5538EC44A03324D1E1673B30BFBDC3F7F1E39F7E89A1A892F400A067C626CDA3 | |
6348 | 4707C44558CF0EDFCDFF49AE1688FDC33C0B57B8121A747468D353DDCA12DBD2 | |
6349 | BC67559A8DDC13ADA201E39F2F9E9EF489DAE46F67A4D7F0FCFE5903A3414CC1 | |
6350 | 8AB5B2D964B5B61EF371F898F904D7E0C2D61029AA0AD17A67E47729FADF757A | |
6351 | A480EF93A14679F98A95578342341844D7269E0E0097C5806F57423842E77D7C | |
6352 | A61CD293CFABEDC397979618F5FE2316FAB4176CE3F61A950A54B2F9A3DCABF8 | |
6353 | 33947FB1B3E95324A3E647349DE49F4FF49F22E9063BB476E0AC14610EBEF55F | |
6354 | 925B1A75F831C3C723DD24FE40D8AFA87D9469FF04CBCC871291BD6A3713B5C6 | |
6355 | D7EA7B5D5DDFA9CA257554746D78B2B36F4516D9CE6FF8CEDBCB31D030195FEE | |
6356 | 9BE3D95139B498DFEC44E26CAC2A77B010FFC5A1FC4195BD901BDDA758EDF749 | |
6357 | 5D4FEC73A568063D39ACA617DA80F65633D42B0CF1148FB1E7C5CA25B50EA90C | |
6358 | 54441DD7FDD559ACDCDEA3B571FFE904FB56A0B771425D74B952B7EC2D068A0D | |
6359 | C12EECD513F6AD5F301F2DD46687EBD7244D719D77AC5D4FC76CDF4716A477FE | |
6360 | 6D5266B9B0B13191B2435B550D1A38B17A750B64931EDA6FD26D8F90222CB8CD | |
6361 | BE68C829333DE429EB35BBB9F360B2FFB7780BF956B672D1E16730DC876DA3FA | |
6362 | 8DDEB7F18E82E51FC575B1ECD64BD0CB3BA3E76145CAB6C3576FA8BFEF56BCE1 | |
6363 | E24E14FE2CBF26417F9C4CDC4C965D056D51307E9B2FFF45179F188B8D2D0C10 | |
6364 | 513CC21A84D27B36FA0A14B70DEC21D427BD874B773C2EAF74CF2DCD04C0BAD8 | |
6365 | DA72D4BEE652348C712A391BEED641D1DB07D07AE62FEFCF89C21B427190FA84 | |
6366 | 0269E59BD51BC2774D51CF53B7FAB70546D5F58DFCBD710A56BB6F8DEF87F1B2 | |
6367 | 9AA5B8DBCC8E61307B42ED560CB4AA68C9DA56B9A2C2E84A57899339FF1E896D | |
6368 | 2E78151F38F22ACC9C6CD2F0BA1DE426E42F6F8B4210AD772E9F6ADADC8D79B5 | |
6369 | EA761976EFE602590AF7A976D1223F68F86C2E36ECAE00825D964237E832DDBE | |
6370 | E4FFA28E876C61749F1C1BEA793295A5DC6E29A729FCAAFD6254E9EB5D292743 | |
6371 | 2707953576A180A0253B6EB06C815EA1F9DA7887BB4EC2ACA690F21F1DE1B060 | |
6372 | 001D1E80FEAFF9505F1087B35F32201F1E0E891AB42790CABFDD8BA21A80DD9E | |
6373 | 4BB15CA6A92C2379BDE2340B54075E1E4277C27FD25331736C1594A0A1F54051 | |
6374 | 957FC4AE2E467E386F9BB644FC26D47177AD50F20141469E0771F07407828A98 | |
6375 | CA3F10F1EF3431B65E9A1407E54BE5139ACF2EC930AD3478E54459C5E48E6F9D | |
6376 | C6EEED387822A391C1AA8793577D8CD3BFA9DE45112128A93DE58C49524A76A6 | |
6377 | 0D86BBF7261CE424330B4DF642037C4CBD30A2B0A000B4D970CAC33F828A09A1 | |
6378 | 605AD7F89B617C770DB19BBBDC5A4A8F52B1CF312D300D0C0575AA93E9F26418 | |
6379 | 3C82C196AD529AA52D0EF942C8731984A668A5C89686E24F113CB5638DFA762A | |
6380 | 90DBF8A8BDF46B1118591C7A841D8D56BF5744DB63AE3FB3538F815097193B6D | |
6381 | 59033FF0418DDEB7C0CFF6D4517A35A7B4633A4350A9F9AA7CD5CA8E8E0AC353 | |
6382 | B16AB3B903579ACBA88AAC575F298B5BE14995A76E3084E578FE5230F45FB1E7 | |
6383 | B7B9D21BED39F5B2C117A6AA21FCC00AC8D1E2C56AB24AA15E97EC484AB788E7 | |
6384 | C640F05DAA0460A0B4E9C8503C20BE5D42029A3A1FB3FB29B0E4B2BBE59505A6 | |
6385 | F808449902CADC5620489BA1ED619B4CE1B83E516231F07472B3905CA8CAD8C9 | |
6386 | 3AAE780F0FC1FB4F9771F9E27E3DAE55F75660904057C015CFD3C2C21394AA60 | |
6387 | 6F67B304AD1BCF0DED6D671BB89AA2AA50BAAEDD0B1C04773886A04ADAF60C5B | |
6388 | CECC90C741804AB20233ACDC0EA1CEB4D3C6B0DE10AAC05FCCEA939B19B012DE | |
6389 | 2420BB17D8A1989B12530C1A0C196207F0A653615CE0BBEA3436562DB70FA750 | |
6390 | 5EB5C7449E0E797AD2B4D226FFE75A459867ED16D62808ECCF4F42E558D32039 | |
6391 | 18CEBDFE50DCAB0A807C02B8914A482166D3EF5DFD7825A70A163B232BFC6D35 | |
6392 | 44419E988103F5233D64583F54206F81D17B5C2C103CCD09552DC1DD3C7B014C | |
6393 | A602DEF221A959CD5BB9ADE1B392D9FECE841BF9393EBA6096E34B0E0F071A56 | |
6394 | 3007E9BE2309AA3938CD811C204FCCEB780D718DEE7FC4B54864D6A8EC6E5A6D | |
6395 | CC5973F89180D77D546C98CC3F0B1BFF6CAE192F7BB56CBBD572C60EB3E32CF4 | |
6396 | 351D25A91AAB05E506BB34103633F12F96DBD4A48F7860A5A4AEB2F5AF3C26E3 | |
6397 | FDCF7D711DAC9DA853C4680D3438242AA4B4F31CD30730D2BAD60D53EC855904 | |
6398 | 52E504154986FB18D70B388BA034D613EEA3139C9D345A9C32645464DEDA4080 | |
6399 | 5AEC9C95622FB25BB84AEFA350ED064F9F6D36D065AB5C3623BB8C530F450383 | |
6400 | 27693BCDBEA43016499089AE96EFC1674E0C781C3D57035C9EF683EE7AA9B0D9 | |
6401 | 129EEA4005CC5013C0125340CEB995974A3C5115A337857D9A64432C8E1DB730 | |
6402 | 34A45C5444799FDEB48876A9FE5967E2DC5CEE966FCC7B6D44AA6646A6866705 | |
6403 | B03AAF1680FFD7AC4532DD9236FB93E06707CD473A784F2A0CCA080614532841 | |
6404 | FC6E17A3EC2071ED95630A0BFFA5E193755FBE6F5E47BB01F2D001112DC9BE21 | |
6405 | 321BB52EAD97981DA21ED58C7EE9F1222CDDCBACBECA9EE6514F44EE67F9147F | |
6406 | 4EE0AB51013B5347406C9E68E1B02ADB349F1683D97B11BF372E40BEB0933E53 | |
6407 | 47B85006E4D890D1FDEBB3DF28F979B38F35D2CE40C2CF5150C2A3E89878B423 | |
6408 | 9F276BD4DBE2D360BCD56EA90D2D2E4081FB2250041D7F91FED785256EF63DA1 | |
6409 | 2A5E309CF063606B4D459BFF752C1FD839ED7B34CA9E35C640C74CAEC1B4E4F5 | |
6410 | A4E248CA558D5DD00A353E7DA3AF7F103937A1929A08501B9EBAE0C5E9370473 | |
6411 | D129C4D85F926E8E9EE2F66F24EA474ADAAD82BB8E7776ECB6B04D46EDCBD2C2 | |
6412 | 3FEC310DB22C105A3781ACFDC48F4CD510E78DEC88D45551AB54D3E7A592BABA | |
6413 | 2DB6F3D69FA6C76F824FBF91E601E53E9E1789ED7D99E1EA1C2291C2B8BDA2B5 | |
6414 | FC8EF6490DD3689B718A60BEA5DBC7315E90C475DC3A8777F0507D26A89FBF32 | |
6415 | 3D65AAB9E6BA8827A40FBE05E8101D678606425930695B7212A53B06B723E99C | |
6416 | E8F4E1C25B6C605996E3325B03F06F8EF607C53BAD9D0457F3FD3839A5A776E0 | |
6417 | 8009C33DA9593A898BE25FD4F9410FB0EF1D2451AC04210CFD2350D093EB0E63 | |
6418 | DCCFD3D9B0BD93201E22FA29EF190423156398838045FFA8A0C2D82FBDDC031D | |
6419 | AB5F28D4C4F599240AB650E4E464630776A69E189DB265F5CC821BF1FA583F62 | |
6420 | B0F3C95717D0588E37E6ABD75997E4AA9C207B2A0D72A7F210F90B9FE4ECECA0 | |
6421 | 30C4C79401EBE7DAB29B8F8CFE9DFD8E2BEE13F60727427BC341C1C458C87C5E | |
6422 | 2BEDCCA1C57859C5E6344E73A8EBF5C69B8696AC909FFBD1827D8627D19C6A65 | |
6423 | 6E0B30B4A3798597BBBE6920CDC6FA7641323F9BBD55ED9594D3E7FFB8AC2A33 | |
6424 | 103B2AC07CB3F3F13BECF1A1004CD335B66EE50070B73A1995D92D37B70A6D6A | |
6425 | F15C733F684ADD14D0A0FC72C4C85409EE499DE4880D0D43D254FE64BE0E0521 | |
6426 | 299ECC1A0006A81FBB29436C1667DF12806067DA65B1065F5D13693EB6E7BFE8 | |
6427 | 73C96D74DF79B229A14AEEFCB3BFA49AF4335E39C4F01EAADC45B8CA1985ED4D | |
6428 | 204FA17FD2292159486E9E16036BC2DB6DFDEA0513B5EAC2E330230B3E480618 | |
6429 | F10FDD28EF6540BEA5176780DF7F6E1F9266C16D6B3DD4F5913F377DFFAEC6BA | |
6430 | 5F46E222AA879FDE24C7EB91DBBFF972AC2E046580E9A08E7743652909CD36EE | |
6431 | C19EC34657B85CD9972F117AACA53A5CE725A4034B7C5E924E3605475A38D237 | |
6432 | DA7D847534A82D4C6FF313300BA22715F3D860A69218B81A428D991B9E4CE68C | |
6433 | E7BC3702AE8460E9E987C34B2B99447153F5A3B258946D6D89F165BADA389A2C | |
6434 | 19AC4AE8EC3B6D3DB19A153C9418628784B0451DCA07E395DCC7703016257C84 | |
6435 | B9B982EAB6B28DC56EAFCC747DFF63E58017BF02BDF382C42855D313DB09C185 | |
6436 | 115747F9037DA3A1EFCCA66A1273B89D52BB24A71B15D09CB7F064D6B8FF87D5 | |
6437 | 2548C8C2F6263B7C1B725DAF2259092618C0626D8FE56BC5503A727A0641EFE3 | |
6438 | 52A757AE040862B287369103FCE96987DCA9541E7572169E7685E46CD859EFD3 | |
6439 | ECBA9E2AAD5C0C6DBDC10691C0A33D3F2828EB8750B38A023D10F03545947991 | |
6440 | AE73901A3AF5D159D08FB7B0C14C318B05F606469E014C24373B22D3FB5F613C | |
6441 | 54338D3C963D5A4BA0DB432D1C8D825C86478A9D3010CC2F61B0A78CC9421E8E | |
6442 | B3061AF22FB8AD68CFB67DC52256D2903FFD2C2E2625AB396F2AD254C62CD95A | |
6443 | 3E1A80C0A683B7D46CCF682C8FF288F48940116EE40DBA2E3F2ECDC5E899613B | |
6444 | 587C1CCDEA37B26DD65B20D1C5410B91064EAA71CC11EE1512C308DC0F531D6D | |
6445 | 321FD8C67E1B01E2B624459F31F4935F0BA76F0156008EF59B60D1C31539151A | |
6446 | B99E94CF328C6D024D304FD8152DB5BDCAABE4BC885FF9C18D01727D1B07B891 | |
6447 | A61BDBB3AC8F10DE2974A803FEC0CBDBFD92D04A4E14AED1F275B46E485E6B1D | |
6448 | 7C905051A643BC92E50FCC4229E08ECCD400032B99D37D34102A25E12F040027 | |
6449 | F6587991C200A76E654665F8B6A76B315C13F5C3A0231FA0EEF44212A07E878C | |
6450 | 45C71818EBC120E6503681985B6E2F823767E2840575BD1F0FECDDBDB49B93DC | |
6451 | 07952607A2FD0A5B0E70FD2D884DF7EA37D724442F9D012374D35BCF322A8C21 | |
6452 | CFFE14A146B5C64BD584CDC9979F02AEACDC60EBE65EE184621ADFA04D9BBD9B | |
6453 | C2E56BA990CC24FAF5D65EA80578A2ABEBD053780F2B9BCE917A1CCF34C8AC43 | |
6454 | 596A571C7832DA1024A8B274A7E8628CBE9488E6B1D42E2368893EC54E7FAD55 | |
6455 | A207A74ADBAA302A10286906503432A3A61BE8C2A28B2B8C5A9BAFDD1DA5D618 | |
6456 | AB8A6567BD140318C85662F46A19169F13E07DCADE1182575D212FF6576F017B | |
6457 | F8C0945BC7CC00842B2D74985789C360C3AB4D76DBF4391FA9C1F47891F67F19 | |
6458 | 2CE34FFB9ED7B6EE772B510D3390A1FED7A893865BAF4132F91A676FE24680C2 | |
6459 | 1505FCED53401B381F3D1F0A7D475CEF103E43FBF7FC1BB18DD57C99B756FDEC | |
6460 | 7E31B3DDC977CD34D7B577051BFDF956AA6F7C61575503474670BA367115D60B | |
6461 | 87CD2CA6233E932EFC1F3E46E408394008815BF09908A5A62B5B314B8DCCB3A7 | |
6462 | 9703351F62FF48B58D64792337FCDE59F66B21E948D19BE95392C79EECDD0647 | |
6463 | 173DA0A65F174D9359A0E09FFAA5CD2A40D397DCEEF56C5F94C0EB856C40A70A | |
6464 | E46E0FC2364BED779584F269C4301CA425F05CBF99EC441DB67E15F6F66339E5 | |
6465 | D58D35085D0D659510EF769570C239A67562E92362CF1AEADED5C70C686CD434 | |
6466 | 2D6D5087C5254AE1BAC0F58BED650E22E5EC6115B1F05185C01287E8F696F05F | |
6467 | 34CEBF284A65342BE596CFE2C41DD8691C0CD346FEC556C2A752335E159876B0 | |
6468 | 8E45B31F439CA3E244274F82E945EFD6F2D814E5237C51196D6B143228FCA788 | |
6469 | AA63CBD035E5989543F1EDB2CBD17B09283DE5380630A194F8189ECF1379EB96 | |
6470 | 3977E67F934BF98508D20CC63AE03772C9783D7BCC4997CB8B237F7B9D7479AC | |
6471 | D7DA60947549215209F86833430E1977C1396CD7F60569847349FA3A89ED12AE | |
6472 | 51D230288DC4D775332BBECD96FC4C63CDFC5C580F45BACEF0517DF7EA5E52C5 | |
6473 | 63024775DE8D4EFF10EFE88DA538770EF6A3B11CFFC872CA021275F3311F7B08 | |
6474 | C0991FBCD679ECDEC5F89C1D6FFC4D328A0632CA07808DA38967E2AB1E83AE19 | |
6475 | 990360D6E53DEC1D1B15C069C93B58E77785BD24931EC5099E97E151E663CCBB | |
6476 | 618CB4FBB0C51183C367F44E7C9C6760E054ED47DA817941F84564C8764240D3 | |
6477 | 6C3060868793279335D044233223157FDC3ED0C07017628F4E2FACFEFC508C98 | |
6478 | B8BE1F55FB67597E7742EE0135635401C0BBC1153DC40FA79A94115DAA111365 | |
6479 | 05DED7204200D3D1324AE3C645BDA3B9D710CC10E9080C619FD3D06FE90FE2CD | |
6480 | 15C6512FCF776DEA7DF9157728AC1FEC5CD467762B7FA1CFCA54102EB8E4AB1F | |
6481 | 7476010D348697D06001DC098A7326E85B6AB1B07AC7AA178178E306D2A87DA9 | |
6482 | 85FC9AB8117FD688F47BD22209B3A1D0C93083093F236C8E1B02ED15D83C33DE | |
6483 | 11A1FB6FE719BC830824BC3328A7E49F5A873DAD276C56BD1D1AF38CAFEA899A | |
6484 | 389C8A9DB9077118A0424DC44E7DE3DD7655FB8F6992451BDD52BE843AA1E1B8 | |
6485 | 2BF771CB438A29F8E4DBFFC4E19C98B084E0E03A2ECFCF20A2AA0779D388A02F | |
6486 | 72FFCA20A11F708D4D7178CB9A0EAC0D1704E183F632076BB91FB29089F2C415 | |
6487 | 87225E605C21E978727923B2C197E8078B95397BD9C65197ABB48926A2405C10 | |
6488 | 958A0B8BED8642D5C03C13208ECE983CCF85BF8B3E9B4245C591962E858C7E69 | |
6489 | 6582EE85C87100C78F71B007C314CB802CFE6B7D0EB9647972E9087A58BC7F78 | |
6490 | B8286D4F4FEA114CD39446F7B78D3C62F09DB1788A6C222622145DB84C966ACD | |
6491 | 9CF1CFEB0970CBA95C434F3BADD9C94FB920B61758EF7868DB006CB9573FFB63 | |
6492 | 090FE21FB752779109B0883B8FB18E0AE30B06C311CD740349919AFF8F7CE341 | |
6493 | FE8AA12A4AD3C6E4C5193965012CD3B2AF97F61407D971FF1CBC88FEFB0798C5 | |
6494 | 0AC8867C5943F906463B37AC97CC5EE1BAE2A2D5140373E47550EC7C6F8FCE28 | |
6495 | AA925D32635187588D606F97152A350F4F947AF926111ED0156516B8993DF0E5 | |
6496 | 8924CF692123ABA594B0456E7B9BA4B02333D93C41A38717E37E7A712A3F890A | |
6497 | 4A5A2D8B1533A30B3B71810A219D2208CC930C220809BCB5F36DB30A6BCCAA38 | |
6498 | 56DE7D23ED9C96E2A8C72953B16E260D6E09EAB74156950B04C3257D9AFFE231 | |
6499 | 0B62951CBCB49A09030B2D78A891FB32B699742D2C50DC7458946313AE2AC0D7 | |
6500 | EB73B761E55B2A04589FB00339405FC3159032AFEF73AF70809B709AB6B0E4CB | |
6501 | 28623E96601DABB5F1B3AAF774D33CDC08718C0105E23858530FB96FA7C31904 | |
6502 | 3CBEE89CDB5C2A793A0069AE0C871193A41F572B66B602B58C0296436D068802 | |
6503 | EA8B67BE1023512A35978D3CAAC054AD7AA7F0DA016F41637F193FC89B795FE5 | |
6504 | E41481E11F63E857A1C6B63D07219791842DD5B6312347D20258392D09D95A55 | |
6505 | 3EAD367242BDBD530E3E3E2A7120702CFC9963125FBC187A232A03062ED3F96F | |
6506 | 04B54D0F8A3F5A546DE9E7681A9B7BD3E3C8F705922DDD6CB26F695EC527CCED | |
6507 | DDE297B16CC18582D68002F76F0D33396783F8942837CA994BA252513C41F2BC | |
6508 | 412B6622652B3059E9255462EE4A1CBCF81140FF1B52EB35F908E6546740F993 | |
6509 | E3C5E73EF0D9FFBAEF5C87F8229FC0CC6B20D23BD9AB242CA2DB98EF7728CFCE | |
6510 | D04763F6ADD6E73D22A432C21A4F0C7D3F1180CF70C58FA9A058588357C0A5A8 | |
6511 | EC78207946D27D9A92FA75F14B9E4CF297D88906C99FEAA72FB1712B096A26E0 | |
6512 | 8516B7EE29A7FB4E371ABC9204087C14535DB58EF419C5F6FB17C19DC140F091 | |
6513 | D622144EB55301F2D6DA0D0DEA492C4A262DD4F154683446B5495F368A1D64FC | |
6514 | A002B8876566C9877B297CE3BC277846CFF0D172B8639F44DECC452B853D4D6A | |
6515 | 5D542D09467C72F1828D28F4CDBB9F88F49B62291E893D0A34C4210EEE8C496F | |
6516 | 373B478DEEC3CDD54E79437076FAF11AFDCA710FAD6E764A9A509876BF9B02E1 | |
6517 | 06A72423B570EB0FEF20F16E6E00A9A0A42D360C6FDB1347610D835EFECA024F | |
6518 | 1AC9202696B454E17857A7A7AB3A256187E056ADD478CB53EB4E59CAF829432C | |
6519 | 75A2F22D94F64705B88AD444343D4F57C131E8E63D1C596C4862901488B32B2F | |
6520 | 8DFE99DC26808BAE9407213AAC51F539525D37717D2A7B5010E4EC5530B5DEA2 | |
6521 | 5FD1BDCB4801566841050E88FA011D4697D72578B7996406B8CE183F036D9335 | |
6522 | 88DEACE05D25498E2CD79CF1A747487C3DDC42130FFD11286CF1875B4333CCFA | |
6523 | 8442436B13CB80D5A89F3303870870E9548CB2A9E570659F0B73CCDB5F1009E9 | |
6524 | 118CF5B44247762DEDAA6FBE729A3214B5766147988437E72B0E8B32CA1DF1DA | |
6525 | AC8D77B8F8BACE1D8500B6D58BC6A8288C126461AAB0EBE1E2EE7622FADB4D3E | |
6526 | F160AED1B52BCA0A704BECDED7CA2012D6FCB2E98CEE74A2D7C467785D5210C6 | |
6527 | 05575C75DB41191ED6B2BACF1EB0F6A17D1CCDE10EFB0D1623C49F3A52C44A8C | |
6528 | 9EB2AB272EE869841F39E1E72D750D1AD5CE2327A098F9D13C897BDF0EBDCEB8 | |
6529 | F15444E8AA1209EBBDF904850DE4571DDB125D34F143755CB048F5C5AF3B3ABE | |
6530 | EF05F5034BF348296F09738C06FDC144B7713132C5757D9A8DE365EB21C9AB5C | |
6531 | 424B4930AFFD7EA03928BC200ACA870D65A6A87A9F6A885C1188387F3BD8BCF9 | |
6532 | AEEDDDFE6254D6AD640A25BF742A745F33F4722C5EAFCD3E67CD098491971121 | |
6533 | 02DC643FF4DB71A9458919C8C8A266FE20D3637F0188D2ED49481CF0C0EB0BDD | |
6534 | F7460E837FAE3289CDF78B7CAA67F52B98E04E5ED744CA9A8D72BCA22B78F19F | |
6535 | 14EF24C72B7D483D2F03815AAD8236E06FF5D1C4908F8EC89300E21D2336E022 | |
6536 | E7C02FA6266255229CA7AD057A86AE5CEE956743CCF3763B95251D4F10013790 | |
6537 | BBDB6F6EE8114613DA0E265DF13B74ABA350F5BCBBE53EFCC074F6F19611D88E | |
6538 | 9F276F52BB62CA550F62B16A695C932E3515B942D2686ED2215CF411285AD334 | |
6539 | A63CF8D4DC2CF5A824C80DBCF7708808415CA8803707FBCE59B59523CB6AE8F9 | |
6540 | 08E3D11996D3D7808D3AE1302149BE86E3F70946930A5EF776A234FD37D5584A | |
6541 | 495912798C385486722D32A6D01341AA02787B42D289F23DCCEDF67F38E5CE75 | |
6542 | 1D768A05209E55AC5AF03CA58720EB0B8F3266AE349BE0886AFC8115AEB45FB9 | |
6543 | F8547736A1E068674FAA085A41178D3C2A5030A622C75629F6E224BCA766E086 | |
6544 | 114EE50337CC45D5F8F39D8F782BF4341DBC17811ABBDB6FFE8D8B8EC0813436 | |
6545 | A0D092C1AA0C92F0092D1B4A6D7FBBDE61D570D5B74480344C9666FC01CC07E0 | |
6546 | 8C9202E88EF265ABDCAD12045ADE417D3C29D837A4DD066FE141697611098E81 | |
6547 | 8100EF53433477802DF070E88B76A3BED85ABF5B93058011C8B16CAA0387A1A5 | |
6548 | 730FFCBC09DE20A017C911BFF4A5B4DADDEDEC2365FD178D3A288194FE5AD32C | |
6549 | A9D6AFBEEBB05A365462F9645E03F37ADC4B46C80A2305C3D959D842C7DF5CAA | |
6550 | F65A4A8FE43F42B342C3B3D97FBCB31C7FC441B6E8E01DA716EB38C736B3E968 | |
6551 | D0EED472103E33F1624207C63E02C30032D9BD4620224073CE14F2F5F7F3ADF5 | |
6552 | 7E835B168AB8C24DDB7C66523DE038CE91EAA70B60FCBB45979440A641F3B9CE | |
6553 | C032F560E902653714B803245C0B8BC46A254AA867DA7083EB2273DE81FA0F0C | |
6554 | 13AB83BCCAE9ABC8A33475464CAB21974B4F6B9FB439DF8C1683E91C70F7A22A | |
6555 | D8ECE10D54D664A2684E8753448F49342505C15328708BAF94A2089CF44FC0D8 | |
6556 | 0FE83E1860E95BD2CC330047CA486A4C1DBA61548617B0711CE9F2FFC986E9DD | |
6557 | 69621D48462A8EF21A5C730A9AFAF9FC340D06DE2E1AD10BFC30FEF90604D72E | |
6558 | C151649F765A1A65B09405EB10149B2F9C3B6CB8C2498A7FD69C371850A28E15 | |
6559 | D001888E8821DD7A3845F2C70EFBBB08300D7CBCB976831BC2145CB8C856207B | |
6560 | 1ECA9D27614F6B1534AD17EEFD6DF88411826A2ADC20A9E060E79DD9B3FC9425 | |
6561 | A19CF213F2B89D6B71409C781DAC8DBA00314319417652099BD7F637D65A9CFE | |
6562 | D3ED843628C740B0C7059338B2940EF373E851F722C2B475BFC1C18699148E2C | |
6563 | E0FDC3C012829FA69B8F42C08F36767154AFA79131D4BD6E68AEF4221B83A925 | |
6564 | D384E5CC415DFAB15458B1E867A4D2BDB558C21C8461677EE36503FCC9C4495E | |
6565 | EEAFBD937BA690826FFBB0D5C6F855BE42C907DF11C8AC7AAAAA98031533316D | |
6566 | D6739FB3887E2460F93991A0A7DAC9F41396638680899DB6D934E5655F9F4C27 | |
6567 | 492AE20B322D912174F1F0BFCC88C24BC9BFDC1777FAC99238B2EB55A115C886 | |
6568 | CB30CB984680E6C9DC554954F5FB25362838A3F20CD715EB23E44077AFF2D5F3 | |
6569 | EE0407E067C202133BDF89600E40B5B50CC2D5AAB17464FA917D30FA36FAEE98 | |
6570 | 5AE929D6624016536A3ABEE523CF597AE6DD93F51F67CF0F70356089B8398D21 | |
6571 | 643DC8C267263301219D43345E0F60D08F9C85F542CADEFBB77A8C82CBF9BDFE | |
6572 | 094BB5B53A91CE560D6DFF007A94A2329D072C415344A6DCAC2C3246A0A9B0B0 | |
6573 | AED75AB44BA60A30E06B375690DB237B340D358392F0D36CE3802638C638ED07 | |
6574 | 334102999B4DE2F010BBFED3E2D07124E37F44C7D2BB1CDF608D76B30CB4A038 | |
6575 | 5C483979E2A89FFDFED4ED4C56C301137205D3257005BE8A59A2A18E0FD97413 | |
6576 | 5F9F91940128A6D0857510F3DD5EBC028F38F9951EC6159B2E7965782C284570 | |
6577 | 8BFFFA180ADB09FEC193B7DB8E447DC2DFB0EDDD9FB0430D9FBE5141F714E2DC | |
6578 | AC2E2689F2A24C8FAFFB6ABB59F4E8874C588D2BAEBDB1F6DE0781C66C053B7B | |
6579 | BFEF8E986199F33D52FE9448B67BA40B7C970CBC92B8C06030A9A15C63233C19 | |
6580 | 5B444218C571B9BCC07EDD39417F43B458F53B5EC2DAEC99BC9D4F83C4FCA1C6 | |
6581 | B86EEB2B0D9698C9DB52F50F06CB27B149D3CCDD21174B17955A68D9F8195F46 | |
6582 | 46EBDEF81EFCC5A9259072DE9F0082CB8191D8F536A729D544C7683B7056EE10 | |
6583 | 8FB8FC70052D988D75ED34A7FE10C4FEEB105A0EF3C2B96C20A72A77A1BF5DBD | |
6584 | DCEADDF4D308744F7A7397ABF6292CB1516EDF945D7CB90147E5213FED1E0B0A | |
6585 | 5261A049778983C13D1C6A916A61773874024FC2CA69CB563708A77DAC475396 | |
6586 | 31ADAD54ABFCFBB918C9CACD6A281139311947DAFAC6CFD0D4CABC9954EC3176 | |
6587 | CE6D4FF9E182039BEC3E19D08C6B70D4E93193E4CD6E01B95D9A00E693E8462D | |
6588 | 4F49F92307515B0C76AC4FC4D864BE0A47FBAC55FBCDC8C7F299955B7D0A7BF0 | |
6589 | 768B24879D38CFE5ADB9BF450E2A5F6A4992F792FAE4669D81778EBCA2DDEAAD | |
6590 | 5D6FF3FED569633C82E64BDB2F49AE6C4F78E88DF6FB64856F81184DEB825149 | |
6591 | 1D1752D36B6DE94BAE058D301A6AEF8D6447B690AA740A18F069AE107A6CF257 | |
6592 | 0A9F8543E94DD9718EF1FD7ACEEF0706A7D5672C60261C90BCA5A5F88F111054 | |
6593 | 1724ADC2E19E1114FFADCE989F02C2473194A361C4A1C190D82EEF2B4261E7A2 | |
6594 | B794A03F65130DB01BE22AC9F007DE1CF647330A5F3064EB1F4BF688B6A7C64E | |
6595 | 801824FADBD122B593B281881C014CD1896E76CCFAEF10B2D9FAC5104A86B93B | |
6596 | 261EA4B7A9FC1A46BB1E58D1BE20C07B5487282F2F6DCE16A27A5BCD82777DD4 | |
6597 | B96FFC1A83E4E0AFA129514FBF8270153A755F289AE491B9106E9F388D9C8188 | |
6598 | F8C4AB953C6DA15B352C9DE6F0909AFB893021980AA28FF3B9B20C3858FE2B75 | |
6599 | 67D8986326BD73917DDB4BA8A38EC38515582A0930688E8E0608E28D504BDE86 | |
6600 | 1AF67BC7F5D148AAC191E517E9FF35E03D160B089CC1D547E84FDC8D5FA17CE8 | |
6601 | 5490870B089D4EA945AA47FC2B22ECE37CBBE766C0B38746601588CB91E14178 | |
6602 | 9C6FDBD71BEDF78711AEEDE67015D056543AA7A7AA491A4FB7F3CDA7400D4F02 | |
6603 | 21B8D1822FB22AD9CDEC77D790F693712507FAFCF7C7B688D61D791C5AEF938E | |
6604 | 67BB2263889F70775DFE31DEA89362B2A354A66341EA25CA2B7D0B9751B063C1 | |
6605 | 43311686A0262E6516BA3073B97B551F62B171D92A093BEEAD77F518AA47D27E | |
6606 | EA28F94A52B4F062EAF22A3BB55231C02ACA8F4D24575D1B20871DADAA50A45D | |
6607 | 9DBBE67E40A4E7C73707AA92542D259D86CC2812C03D45F55F1F106389207307 | |
6608 | E6F819F6E72D4A3D7C7C35D501B8B4DD87B3C5245C239D50515A9DB6E6F63554 | |
6609 | 3D539FD90D037719E641B091F043FF90DB4BE267967368ED11C7C5A978955AF2 | |
6610 | 7E3D3FEB5DB2F73C9F17E77B29E2518C042231C0A6149CAFB0A772F2A2DD22D6 | |
6611 | 0950A033E805DBD139D32729595752AD697749DD3AAC4E80B8EF7192A02C7E60 | |
6612 | C222C4BF0B4846AC80D8A503A13FE09D1E8680E701308148D04684D72F5D3924 | |
6613 | 80D0DD922ADDC93E6C9A92746DF9F342AF9584492AEA82A3EC637875420B7784 | |
6614 | 14B139E1540C94B5FA115AA2A414021CD04598898FF8B8634AF360B9223E968E | |
6615 | AEF3F4522034DF40A8D445DA9BC639EC4A33315DB7AD426B1ADB9F75BCA977CD | |
6616 | 3FD7E509C26F319B5C4A33C82FE0C6DF3BDD7DF26A21F3B39BEFDE002A1FCFB0 | |
6617 | 817CFCEE79B333044FCC04B0B4A9A95C35600BD6265DB61B5F6B2A679A7AA0B9 | |
6618 | FB0D6E5DACA9307FF3B847DFB6EB2AFE9674FF68D5528C7F5E5FC724F704C0A9 | |
6619 | F061FA3B46A4C382842554BA19DC3A9D452AF54B47E5C3B24D62FCD2F195AAD3 | |
6620 | 504443027AD89DC28CC0751F1FD6BC6F730CCDCB1FCCD3A8F9984B7887A7FA1D | |
6621 | 017F337337FD07DB4DF862A8FE056259BFC7B3A8451BD1A55DFE8B72FC716CAD | |
6622 | 82748E02BDEDB0FD7965C2781CE769F26480D82DE5A496FD5DC8C262F2C9EA41 | |
6623 | 691B450115B1540A0032E7CD4A1F77C1B2F9F47D60F30E4A9EC3F9B56E6038CD | |
6624 | 00660BB8A136DA68D522DA12EC4CA4487D3563E42A0652451F406BDDD67A6733 | |
6625 | 7516148E0DD09086F08C1D40E7EF70D176E974431DA1F2ECC17CB312C85170F8 | |
6626 | 5AE1A8D6C0EE3C6835D853F64511A6F0B66F6CDD08DFF911A9363D16F4BAD56E | |
6627 | 0BF03DEF1B878D1939AC19A126C5CA54FD0FD875540DFE10B2CF97BD0A11A681 | |
6628 | 7961AFD1FB1962BD7CF163B3B9CC8FB4701D40DD739AE4280D1BFFF8922E9C6D | |
6629 | A4A4EBE6503CBDFEAA86A0DD12A3B524D8FEA8827E715DC3B7CA378466BCE60B | |
6630 | 7FFA482662E85514643C5ABD7210F836F591662F331E51C7943165F8609E8A73 | |
6631 | E49AC4769EAED66D075AE1BB0D259FA08122D8BCFCABA7F160 | |
c302751c CR |
6632 | 0000000000000000000000000000000000000000000000000000000000000000 |
6633 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6634 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6635 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6636 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6637 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6638 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6639 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6640 | cleartomark | |
45c0f7f8 | 6641 | {restore}if |
c302751c CR |
6642 | %%EndFont |
6643 | %%BeginFont: CMTT10 | |
45c0f7f8 CR |
6644 | %!PS-AdobeFont-1.0: CMTT10 003.002 |
6645 | %%Title: CMTT10 | |
6646 | %Version: 003.002 | |
6647 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
6648 | %%Creator: David M. Jones | |
6649 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
6650 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT10. | |
6651 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
6652 | % This license is in the accompanying file OFL.txt, and is also | |
6653 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
6654 | %%EndComments | |
6655 | FontDirectory/CMTT10 known{/CMTT10 findfont dup/UniqueID known{dup | |
6656 | /UniqueID get 5000832 eq exch/FontType get 1 eq and}{pop false}ifelse | |
6657 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 6658 | 11 dict begin |
45c0f7f8 CR |
6659 | /FontType 1 def |
6660 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
6661 | /FontName /CMTT10 def | |
6662 | /FontBBox {-4 -233 537 696 }readonly def | |
45c0f7f8 CR |
6663 | /PaintType 0 def |
6664 | /FontInfo 9 dict dup begin | |
6665 | /version (003.002) readonly def | |
6666 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT10.) readonly def | |
c302751c CR |
6667 | /FullName (CMTT10) readonly def |
6668 | /FamilyName (Computer Modern) readonly def | |
6669 | /Weight (Medium) readonly def | |
6670 | /ItalicAngle 0 def | |
6671 | /isFixedPitch true def | |
45c0f7f8 CR |
6672 | /UnderlinePosition -100 def |
6673 | /UnderlineThickness 50 def | |
c302751c | 6674 | end readonly def |
c302751c CR |
6675 | /Encoding 256 array |
6676 | 0 1 255 {1 index exch /.notdef put} for | |
6677 | dup 33 /exclam put | |
6678 | dup 34 /quotedbl put | |
6679 | dup 35 /numbersign put | |
6680 | dup 36 /dollar put | |
6681 | dup 37 /percent put | |
6682 | dup 38 /ampersand put | |
6683 | dup 39 /quoteright put | |
6684 | dup 40 /parenleft put | |
6685 | dup 41 /parenright put | |
6686 | dup 42 /asterisk put | |
6687 | dup 43 /plus put | |
6688 | dup 44 /comma put | |
6689 | dup 45 /hyphen put | |
6690 | dup 46 /period put | |
6691 | dup 47 /slash put | |
6692 | dup 48 /zero put | |
6693 | dup 49 /one put | |
6694 | dup 50 /two put | |
6695 | dup 51 /three put | |
6696 | dup 52 /four put | |
6697 | dup 53 /five put | |
6698 | dup 54 /six put | |
6699 | dup 55 /seven put | |
6700 | dup 56 /eight put | |
6701 | dup 57 /nine put | |
6702 | dup 58 /colon put | |
6703 | dup 59 /semicolon put | |
6704 | dup 60 /less put | |
6705 | dup 61 /equal put | |
6706 | dup 62 /greater put | |
6707 | dup 63 /question put | |
6708 | dup 64 /at put | |
6709 | dup 65 /A put | |
6710 | dup 66 /B put | |
6711 | dup 67 /C put | |
6712 | dup 68 /D put | |
6713 | dup 69 /E put | |
6714 | dup 70 /F put | |
6715 | dup 71 /G put | |
6716 | dup 72 /H put | |
6717 | dup 73 /I put | |
6718 | dup 75 /K put | |
6719 | dup 76 /L put | |
6720 | dup 77 /M put | |
6721 | dup 78 /N put | |
6722 | dup 79 /O put | |
6723 | dup 80 /P put | |
6724 | dup 81 /Q put | |
6725 | dup 82 /R put | |
6726 | dup 83 /S put | |
6727 | dup 84 /T put | |
6728 | dup 85 /U put | |
6729 | dup 86 /V put | |
6730 | dup 87 /W put | |
6731 | dup 88 /X put | |
6732 | dup 89 /Y put | |
6733 | dup 90 /Z put | |
6734 | dup 91 /bracketleft put | |
6735 | dup 92 /backslash put | |
6736 | dup 93 /bracketright put | |
6737 | dup 94 /asciicircum put | |
6738 | dup 95 /underscore put | |
6739 | dup 96 /quoteleft put | |
6740 | dup 97 /a put | |
6741 | dup 98 /b put | |
6742 | dup 99 /c put | |
6743 | dup 100 /d put | |
6744 | dup 101 /e put | |
6745 | dup 102 /f put | |
6746 | dup 103 /g put | |
6747 | dup 104 /h put | |
6748 | dup 105 /i put | |
6749 | dup 106 /j put | |
6750 | dup 107 /k put | |
6751 | dup 108 /l put | |
6752 | dup 109 /m put | |
6753 | dup 110 /n put | |
6754 | dup 111 /o put | |
6755 | dup 112 /p put | |
6756 | dup 113 /q put | |
6757 | dup 114 /r put | |
6758 | dup 115 /s put | |
6759 | dup 116 /t put | |
6760 | dup 117 /u put | |
6761 | dup 118 /v put | |
6762 | dup 119 /w put | |
6763 | dup 120 /x put | |
6764 | dup 121 /y put | |
6765 | dup 122 /z put | |
6766 | dup 123 /braceleft put | |
6767 | dup 124 /bar put | |
6768 | dup 125 /braceright put | |
6769 | dup 126 /asciitilde put | |
6770 | readonly def | |
c302751c CR |
6771 | currentdict end |
6772 | currentfile eexec | |
45c0f7f8 CR |
6773 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
6774 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
6775 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
6776 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
6777 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
6778 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
6779 | C01924195A181D03F5054A93B71E5065F8D92FE23794DDF2E5ECEBA191DB82B3 | |
6780 | 7A69521B0C4D40495B5D9CE7A3AF33D17EE69979B82B715BAD8A5904C5DE0260 | |
6781 | 6C15950CCF6E188A0CDF841EB68E5A2F88253E382140F87C87E55C9EA93B8C89 | |
6782 | 14A36CDF630D6BE7CD36DBDCE22B21778E8648B97B7EC6742EB5114BDF0454B0 | |
6783 | 0EA7B1FE236C84C0E5308C871F67B973892890557AA12E00B2C20C71F516C397 | |
6784 | 3F3BBD14A1D0149CA064391056E45E9470FC7F6F556ABC82653B3C8049AB5CF4 | |
6785 | BA83C8F2158C236B2FFD4208846013BAF4165E8BB8D334C8FF2E8D74AF5DAB2F | |
6786 | D44788869B08399421AAA900ECC6A2D594641C121660D4B5F512938994C18DD0 | |
6787 | FCD9B008F68F0351D21ED735B2740CB1E0C1CCD25EB548C35B844601D98828DB | |
6788 | 556F71D07E081A593FF12DAF83676492A0FFE16E95717A07082B43A966C1EE8F | |
6789 | 8A59E1255E1705C43A23CF29A5E4A6547C93F1680A870EE7BAD8CF74D838CD5E | |
6790 | F806911D8FE4262ED8E7F5BC58B92C9C6D74F8AD45FBB021EC7E97393018B9DB | |
6791 | B1B84E7B243ADB05ADD3F1DB3692ADC5D47FEC7DF93080669E63281F1576B673 | |
6792 | 125EDF08016664BE73364F65389F7C3B66623AD1754ECBEF9E5CE6948D933787 | |
6793 | A5674279ACB2EBECD3B4E6361419AB32028A27670C9F3E18B746A10B00AF6D77 | |
6794 | 4EC00E3BE521C02A99AE5BAA98F793EB1228952BE67934B91472E01AF7B816BC | |
6795 | 56D7F19F631A1927846D800C107B1E9CBFF9D2DD513B4A8CE2E0DFD77B1ED178 | |
6796 | E43FA7052765E9FAF89989D490D8FEF6C536EC0D4AE27A74F474B98DA9E6B92F | |
6797 | 15E063DB260571979A5DE2423920CE1F59F56EB11E00E3BB9D466A8263E1E385 | |
6798 | 2014BEFDA8D1EA3EDA04BE32AEE6CD15C5C010A1DF7F705A2C0C18E87C8DCCE9 | |
6799 | 05D9163181CBA56C0FAC8C06A2990554C8E759D076B01BBEADE3B5FB8B551390 | |
6800 | 6C8E4A2A1C6E7D9C708614626F3770C0AB7DD2027469C77975C27576065862AD | |
6801 | 04E5E50CEBE907E3E991FA0C627302C0E207B4D5992BEBAB5853AD1C0D271728 | |
6802 | C76F40A79392ACCA7358F948AC65DC823CFDA59E1FF69CEBB6B7EC3CF21669E4 | |
6803 | 70D999508F9C49E2D9F8818CA53C977D93E15FBBBAF75B1E84F0BA62BCC4BAFA | |
6804 | 4EEC82D804C8A8C0210F3E5E258BB1F6921AF02BA9861BAD5C3D5FC8CEFABA8A | |
6805 | A607E547B802096F7AEB09FBA99C83C9A494B94408DD607CA6561A6E6660C473 | |
6806 | 62CF8D35F31D052F6C6C8138A8E1430CBA7EA6973D6D510C1A06B3FBD79D9364 | |
6807 | 240C1A00272DA44B89A9FE8D5BF36DC1B5EBB4A78ADBE9C5EDB485F093D9517D | |
6808 | 69E1AC9A8E6C9D7C324E3797CFEAD9A18E82E03F69B2CED7D5DDCD1A218BF2E2 | |
6809 | ED2293AE999FE2A4B5213A10083EE0407BCF8007670B8C737EAB30311C868D84 | |
6810 | 121149ACB4A27F3ED6C0C181C98AAAF51B105F264B5672D7F745131ABAB5BEA4 | |
6811 | 0C9B43C0DD9116D6DC61F90BE72018F290D26D5E9D341055CAF09C9F45333CDB | |
6812 | D45B7954271767F638EEC499F7B53C2CC5774EA7A7F024C4CABFB93D9CB1856A | |
6813 | 0C671A4ECA7C62EA5242648A84E7F3AFB9547A0AFC29593CFCE6D8B873A78157 | |
6814 | D337CABD291431C0A2CE1F37E0CD7340567AC206FF98E4B5A6410F70F750451C | |
6815 | 550EFB54AA259A1B236CA9CB730D2CEF125EC65D959441F7CC9768F777B44844 | |
6816 | CC9842A307C72B740680ACBBF6AA35FA7A94825069BF7696ED81A371A9E5475A | |
6817 | 9D997F2DFAD339AADF797F7E03E654234455AC3D17702A420EE0A597BA31BDE4 | |
6818 | FEB8DBA7C61D311CC90441A620164DC22DC2D373973EF84CC553453AB1B3337F | |
6819 | 7B39983B8DFFB3A9425F119B45C1CD37A76F905777B3154CA6200792F1759D06 | |
6820 | E017890F4041A385F2238E3C48B6C8EE6F5258463FDBFF7AC762F6C4363926D6 | |
6821 | 50F004D473B7B7F73CA686B559C2885F1AA761653C727A77D73431E9D110E76A | |
6822 | 2E55C68CD50F43997C9B2FC4710F8C8540909829E215678E63BB8363C4B8AF05 | |
6823 | 9986102BB36580D9CA95CD216B7C321822CB41B2E0422CD077F3B55E0246FDB2 | |
6824 | 44D5976F67296B5B0BE4B06F6E43535C21164E6C5089C3E9BA2D6B30888C57DE | |
6825 | 49DC8D9D46C0D5EDC47ACF2C03B72DE3B69512508539019B759280BABEA12BC9 | |
6826 | 385308A0395C4CD33182A10A5A229743379C2075D82D8BFCE4A66E1AA087A091 | |
6827 | 8F5372684FA5037D1B92D50CD9CB4F50AD4F8EE7D51F1C9E63C721CB5B9BD011 | |
6828 | 6F0A8DD4FDCD2B008F223A1036D90F0F3B252487DE7898F9AFBB3A9D9CD49E0C | |
6829 | EF4ADAD5155A98D2125ED5A3D3907F67301649519419F33CD942E8DDEAC1BDA0 | |
6830 | E90C431B198F646766A8FA9F8D1561B57E126EF604838C0C1966655CF31FB7EB | |
6831 | C8CCC434FC1C96046D38203E1791EC824A3D7AED85C029288D4608CA7668A2BE | |
6832 | 484C99639F121845B22EEFCE0A3B808261921AA042AE19E641769E91277BEC29 | |
6833 | 4594082CCB3058F90FAC4A700A8A827ACA00FCF574ABC8EB7DBCECD97F2B22C0 | |
6834 | 0AA19E8739B81AF8C6F621D69B8E6F29BAE233FBA655A0AF5BDFD7F5C6B9167C | |
6835 | 6BC7AB693D45EF2AD999F5DA3CEFA39BA48A17EE6D9F2C4DAB91AE3F0044DC3F | |
6836 | 5D5506CE4675AA928B0092D6F173644F91295216D8BBB14CDDE0AD524A4D545C | |
6837 | 1B5E284A3BF0396664081CFB4F186A84A0D24D61E82F4767C1E55A0642720CF3 | |
6838 | 909FA1AB8EAB78030B59BEA067DEDBD2F1D0340E790AB2777DB18248521934A8 | |
6839 | BB38A58B7F633DEA4291B0D5D13E9A882C974697CC6D3B49E030C94EA29B5506 | |
6840 | CC29C44D01B4751B453A46A9F6BF3BF135AE87A4CE232AF57B66578310DE41E0 | |
6841 | 2A6AC422117F1963C4D7CC306BD25A6E724E51921779F22F029733122E23E2F0 | |
6842 | CB340008813ABB104380C80A492B3FC6D0BB07CB8D8409E9576891EF6E5C9D08 | |
6843 | EB8320DFA31BAFFBD336D0C2BBC3D3B2D30368B9860768FC080D30569C7F7811 | |
6844 | 0EBEDA2962476113625EEB555490B8CE4C5F99D74ED10F738C61854CFF8B41C6 | |
6845 | 9402E56BE8856144A1A05D0B05F4CB7EF728B2F4F5A439F18C3B68CEFA41E59A | |
6846 | D8308ADC92EC1289DC84CF48D2CDEFF509A145BF945E1E00D552D329EBD2A7C4 | |
6847 | 21D58082CC8FA790E981F4AC8EAB99950678FD3A7DA3DF13778681B208DD71A0 | |
6848 | 7C3CBD0664B37C9EDC6B601D79A2C51FB54DAEE849F93209793849104E722D3F | |
6849 | 52DFAF7047EEEDDFE744787A5801E4AC2C3D58EC5DDC15FCEE03990C53B0C57A | |
6850 | FC54F125A04C8E4A0ADAA725808C587E7DAFB9F784FA2875689979D316DC22BD | |
6851 | AA36B306A1ABCF907B63C6476737B746099973CAEA8C1E2C5C41F27E0F7DE8D7 | |
6852 | F0D942E34E92F43FE902653D4D2EBB6F3B9F7928B1550A82AF234D45D028F429 | |
6853 | 067652BD3D391BF423AE72B9CB1E8D91E898161BE3A7849D456A861A2046711E | |
6854 | E934DC59442AE7D81661CE8EF727D8D7DDC0270E937E40F896AEAE6171661431 | |
6855 | C1025C53172F9D366834BA0054FBFD84503FBAE328B6FDEA180F8EA35B1DA937 | |
6856 | 5CC3B8F00C206908C2FFFFA6A7AC6915D15EA44BDCF29E2BFCFD4A849535F19B | |
6857 | 0D307C696BE8205C7D84B9C77F02EF27D911056EDBB4080E4D3ED72788666CAD | |
6858 | CD91B0ECE27A177DB23320A7FA9C31408B4D02D2A4B1CC6DDE1A6CAC3D8EC1EC | |
6859 | 2226EC98E51046D1EC26FA20EE62D24747D83CF4941DCE5CCEEC0DBE387149CD | |
6860 | E05B19FFCAFC0D117F9A3E60DCD4C815228D98EF95EB559AD0ACC0D50FFDF714 | |
6861 | 56C3C812EA5ADBB013BBD956A7C4CC0ED7D3E25D5C9AF5E626F18297F75D4957 | |
6862 | F5B0B33379114B903FE98BCF35C3FF76FEE1D9AEB711F2962276531F7380EE3F | |
6863 | E368720E0292A170A15C5539B1FC7BB954EE2624B504CB8C805B8D31AC38307F | |
6864 | 0513606F09211AE64DAC447693B2A0AD15E9A64C34F5A911ECD0ABCA90E9791D | |
6865 | 67C6BD202B0858EF96E7722305B8AC02B01AB1706CC6AE875A8DDD15EE349046 | |
6866 | EAA65005E7866B506EDFB7A5A2AFD5C9E9DCC821A79EE9C1EA2C7BBA32A40BC7 | |
6867 | CEC26DB1AC473C8C3960ACEC581B37D6569E8C8C42950BAB7930B65E1570E3F8 | |
6868 | 9A7FA719F1DCFDA45A3BF2AAB32C9A93BA3552608A61C623DE59BCB346E87EF5 | |
6869 | 9CF025A87803161221C5C1C6F6B3403712C76E9D755C7BD68D7F2DC03C14CDF0 | |
6870 | C1BBED1D648B905B4B17037B7263C1EA7A7F06FAAC4E09E08483A8D714C19861 | |
6871 | 327CD9C32DDF850302DD6DDE24912D00C22ECDF3CDFB18FA831A41A7488EC203 | |
6872 | F564CFE30D506F0829A96D35A7E09C3DCD107D589B627A15B55C5D6649126BEC | |
6873 | 60B88C55ECCBB4E680265D9EAB4CE22965D3B1AF759B01ACB0D0E6C92B6B4EFD | |
6874 | A81E6A648708979487FC591CF09631310D46891423F4EC159A73E30D8DD147A4 | |
6875 | B0EACF6D45D18CD16CEB8176F03ABCB41F2234747B9733C8FAF34AE5D43D3BA5 | |
6876 | 0CE0FACFC9B087F84FB6C68678BC6E76022B1526D6E5B3A48EC1A110BD75F45F | |
6877 | 1C4DC6D39F254976453F57DF873B7D635C80C42026DE020E5BAFE0DA0D54D1E1 | |
6878 | DC634D2621BA184347E5252F645A6A1DB7657C48124186F0E4C644077457C24D | |
6879 | 55753C651A9A7B6349867641464B515B821349C795A645420508673B93750D0C | |
6880 | 7A3B33EB1F09782033742AE8F3A23FC02284E6C03818FADD1731361542E3FA3E | |
6881 | 75B8D52B668C3E18A4AE967D0FC3157083D952AFB8144D549E69EAAC51C279C5 | |
6882 | E5D88A0D9D53013DFFB4352A1598FF84DCDE6FA32FC377306B9B92C0F96EE149 | |
6883 | 8CD55E7B2445B86CCA7A547FA732D52D59025129FD8C6333AC0DF4F0CFF6287E | |
6884 | F2036D5DBBB3B91B92F12FEBE0B61A313A4DB5A9CF0BB3DDB781A56FEBFFACCB | |
6885 | 8CB9D1D3DBDBC4CB6AAE6769E470582403CB920630221B68BCB625CD4605FA8F | |
6886 | D3D5B7A1A28D15E44B38E92E906C138E72C15B86F64C38E23BF0440052A8C914 | |
6887 | 54397F49DBED99D0AF7CEA3B0A05FF37C2D7EAE1412567E6776333237C31E3C0 | |
6888 | 49949EC8BFD6E0F6446CE2D4DCD2C1524A288818CC5D159BF8463A847AE4A2B9 | |
6889 | CC8C58F822804B81B13BF4F2DEB6229C4F51F093075581791D02C36A13B855A0 | |
6890 | 34900AA7CD4F1A797652656FE3A8425A38F421C4CC0ACA1CDD44FA6B31219276 | |
6891 | 1CDE1CD63D6A58CE705CB56CCA1260F9B86E989019071563A9B4C274A87558CA | |
6892 | 6EF1660D574EDA276801F0057740E2C3B80D253D697736484D892CE1AB128B8A | |
6893 | DECD69712F5E70E895FBAA927E8194D792A04AB6CE205E04E38A433BBB793FB4 | |
6894 | E8BBC4279D58A223C6673D909D6AFECD246E66A52F4CB35E5931D24C828489BD | |
6895 | 4ECAF621A220D8ECF702BEB01C4FC7510197D3F6D15321EC87175ADBA6434ECD | |
6896 | 2B5A306E91375CAD22CD94301763E4A8B981472890422C5488FCD523C9CB17DC | |
6897 | ED22FBF12D5F7525D0D6BCFE8CE85B0DFB1D6F989C267FFBA0A996D309E4A934 | |
6898 | 3DB54A9D29C88B9D55D7300DA3D46419256C5A07A2A529A8DE8BD1727281F5FE | |
6899 | 97033D861E0531B14E811378EC1AF1CC7EE9BA2B07D935843D3053F673979F8C | |
6900 | FAFD59D555B56CE338F606747238B22BD62C42BB7238FEA335678D474A643570 | |
6901 | A9E7B4970E8C541CE9DBC7BF70ED7BA33639D6744A18379455029E934C95E2EF | |
6902 | 639C4848CE9A0879B51649FAB023A71782444B451F92A34CB8A124270CCF86D4 | |
6903 | D18EEF5C1D2B2A29012613851C49F50702D63BACF95EE2AB4D72B375E0A62615 | |
6904 | E0991E130A67ECBA9E05329B740708F1CB148724C3A6E5E3AEC1F88EBCA398D2 | |
6905 | 1CA8827C977D72734310233176D1AE26C55CF2CEACA62223315C28FCF6305C7E | |
6906 | A22414D4739A059F552F1F9372CCCA5FED4F9AC987942848EB498900269511F3 | |
6907 | F408CBEA0659B954F5F1B18AE4FB270213646F9B28AE4439D2BA2D3E0AAAA780 | |
6908 | 5E530E4EFC8A060EB979E12191044509DA0C14397AFF949E12DC970658D5EAF5 | |
6909 | 4EA963F5BC1407A32F3837CA6A24B7F3D60EB8E6222B702E25ED903F9D21AE50 | |
6910 | 664A095009BDEAF4B78DAF94E5A55D48366CABF07791A1684B2F54EA69070844 | |
6911 | 4F031AF8DF416C2D3679F8BA038B0DC9DD0400CA6B34667BCBBC07E62C1668A8 | |
6912 | 35A8C57C9048A7227E672E89681B54D662079A189A9E96A3CA96D8DD10189B04 | |
6913 | 1DA49BA2729F1CA585B1BD5C467295285D52E47CA904235A1A3E48EFAE9EB6F6 | |
6914 | 01374125CE89D53C276858668CF45D2F092DDCAA52418E0BB94C2B8266B4D88A | |
6915 | 5D911507BB1DDA3D8F6E7C14A91CA11AE799EC42E993098E18CADA70BD2A1D82 | |
6916 | 2C39326C6E3F9E84CD9758B9AE43D79BF99E6A0CD713E95B3D9B7DB90D127DE0 | |
6917 | DAFEBF850CAAACBD860B5DEF2082F1ADA64B44B193C4A1417BE221FDCA36456C | |
6918 | BE5934C8CE3ED55AE3A11697C2D682B7D0F72D48976451D205783BE25DBD2507 | |
6919 | 39C14FFB4BB828DFD187104F38A7F11D5F0698C11E8C1D4F107CACE573FDC4B1 | |
6920 | C56FDAE47024D6FD16A2FEABB434CA320300FC4B6C1B6CA08F76C60B7C08A665 | |
6921 | 99F404DBA8A2A1EB18EF6750E4EC186E31561A3F080BA6562967546715859481 | |
6922 | 7BA782940F5C5D06626D6F6A412CA7C13820EC7C1DF23E15E5829F698CF617BE | |
6923 | D940523E4EE4ADECEC48C24297DBAD528BA1DCE7AC335A1D15D55415B108EFC8 | |
6924 | 6D45030D27B3EA63B2B4CD771DBE66AE0218ABB1153D4B7482289D1313CEF184 | |
6925 | 5C960B1E3C3C953912CC6F4521D1E15636C1545EEE457EFB87B88C9E43CC2F38 | |
6926 | 6BC4BC96969F4FF28ABB06F4454C01CEF1B6DC538F1E832FC1666D977E5A881B | |
6927 | F72F1B4C7DD4BE167A5535F1163A0706F9A0B26400178DF8A128FB5EBE6A7B81 | |
6928 | E478AD183EC06622B591337B9F1872AAEA356F4FC67EE767B34CB5A4D90702D9 | |
6929 | 39FB846947F4096FB3DCF16EC81455164783BA0B5D723060DAFF411B68307E81 | |
6930 | 7BEA1D9A47A5AA3D648E618C83C60F060029E6EC4D46B045FA7415BAB2AD0AA5 | |
6931 | ED9C729C24136F6AF61E6409C0B5CA760B16225641E268A68CFB8260BBEAFC77 | |
6932 | 6626EBD97195E77CAB425CFB0096D805D9EE699E41680D095AE9FA10122A7882 | |
6933 | 2F00F495C9EB2102DF0D3E61833BC0A2E468C5CF7AB430FDB7C0BE3DF2C0D230 | |
6934 | 1580BAA25D65F599378D873165482A1FBB224AEA89C6BCCFBDBA42AE1C5DCF41 | |
6935 | 06969F585CD3B737D1388D6359F5468D88FCD2279BDB270F6A858FB7D2ABDEFE | |
6936 | 5EE8FB79FA437F8F50237B92C307B73B0DCB808D07A9C3255CB9B3B17039CE5A | |
6937 | 288103D05D132863FB522A02CEE3839EF9AF7F07D99732F0B8B384745369FB3E | |
6938 | 7901166478F4A16076A1504C5E98D17408494E270BBF4470ED12B4332422679F | |
6939 | 759F1D93984D7E506D16950DB6C2682FE1379EFFA6F6C95DD71F6E55BE3EF6AF | |
6940 | E0CB25388EEB436E6527806FC75484133F6E561DEB979D5C1FFEFDAF2A6D964E | |
6941 | 03BAE0BD593C2992AD84569C81050F7A793C5263E50C2F50B98C4CC703EAE17A | |
6942 | 6AEDAACE312DAFAF5278D125B6EFC5587484F61DAFF46B87B7C9B1EEDECA4859 | |
6943 | 314A9A9E2248467DE1E54D90DD671660B9040B3E0DD982260822177EFD757266 | |
6944 | 74A16C83A7FB168016A320D3DF3BD7726F1F4EC90EE5DFE810C96B099FD4368D | |
6945 | 906AE4699049EFD37E8EF058D4B97BF71106445AADD4FC6E90615A0066823A36 | |
6946 | 673B8DE32322BBE861AE251226B4385AB28702831270DBD25D666FBB0AD7B96E | |
6947 | A44E891EA1EAF0F87013AFC982E33D67A28E96E0C9CB99B9E4192536830D9901 | |
6948 | 931A8CAFA41289633B20BA3BD7AA3414B6DA8D57CCF2FBE39920CC06361F075B | |
6949 | CC40335DB9A0071CFF77F6B7BB47F3100DBDC9C4A58C2B81EC99E8E966AF3390 | |
6950 | E3FBCC28BA1D79961C8A1584266454DF772FBA99664D74D4A89FC82FFEDFCFE1 | |
6951 | 4C9E4A04291E803D142E37E7ACA66AB279378F2F192FFB2B5BBAD18B95F03136 | |
6952 | 2CB594A3D6D3F8576B90A6C4DAD6D6C8EE07AF682F925F01D0B26CBA347C03BE | |
6953 | F3B0585CF4539FDC66915E22117078CC94D621F31DCB3E021998A5D6EE94CA4B | |
6954 | E214D07517283D56973D8E4367392BF6C1150DEBF459D141AE0941C1C8C5CFBE | |
6955 | E735D796E365A1B0F60BB4CF2801EAFE4889EE5F338D3C4885368281B3C95CCE | |
6956 | 251C28A90D318A8A0384439B38D63B94757252062EA44E88509FDD2E75FAAB71 | |
6957 | 7329622828B2785C1A8B26351BC74237A6BF99216652ACBD4CCF54CFC8AC72A6 | |
6958 | 46342F1E32D4318E7E27C7B2DAC943B3E72C472FC6F1DDA8684AA922516A672C | |
6959 | E969C047E318B5E3B1270C1BEB1C4071A15BC81B29B268C679B41FC5E381BE33 | |
6960 | DD95F0D68118CBB60C521E5CB2BA46A10E50E9238163713290DF6DD8A27D3813 | |
6961 | F871C07E725D4518013D9A84CEC96782541E5580E33C2EBCDB18F08EB4655A46 | |
6962 | 507A8526DB26C854928B81FD502B0CCE4A68943C12078F57C10F4E85FBEE1025 | |
6963 | 46D925B8B3B447D4920410FEEB9844FABE985F9228FDD9F58392F2F3BD650E49 | |
6964 | 2E3AD5A14984874DF4572816931885CE8A448EC95BBF40DDF4F85653AD90A88C | |
6965 | C4A879C0C7596E61997B972E8A55E57B17F802C738E5C7A8FBF6424F8B131B23 | |
6966 | CEE3EA3747DB066246C250EAD335A76FA166ABF75120CECB59076AB31A51F176 | |
6967 | 57176CBE8C802A97B0542A5CFD6D5E6D7EC848B923012E45D9F065BFFA0D03E6 | |
6968 | 788B68BA4DE51DA37994948F859D41C28BA939C3A82BFDB44DA585AE80B8CD7B | |
6969 | A6EEA79B70BFB4864E06F06A9751BD2D2A209D150D7135E0A25D67263EDD2A7C | |
6970 | C63B5B76ADB05D44BD5BC0BB3EBCE2E74E1AE5F7DE07A59D90C932DAA2553505 | |
6971 | 27F2AFC05F7CEB39E1C7E54F69FB0BBB069959F2FBD11709F8E81F6E7CA06DBA | |
6972 | 1CBDD8E7A78487462596DA288B50B295E46F4C3D9BA862688C68859734B232A7 | |
6973 | 4B371D2BD786924F186524765E789EEAA30B20C069322D42C893A30BF1BD2C46 | |
6974 | F8F3732DDFE80B8FC1789239345944D8B457824FD80D11184E73FBA30EB80A9F | |
6975 | 2FD466826D4E666E3A835B98A1D4AE5D17053A6A648E26E77BD08F9A3E02956A | |
6976 | AE82C4929E9666F539079846527D0E326FE7CBBF86E3722BA3E53F8A5121080B | |
6977 | ACF8D3C67A2A1DF624B9DB92105D3C833F5A6ECEC108E026E1D3D968967A1447 | |
6978 | 15CEFDD09123D56606134BC3449404ADAB1330C9238DE48F3CDFBC91EB86D7B3 | |
6979 | 8B85B5BA97376A0673E434DBFF19798EA90BFBD94493E2D21976F8106FC0C276 | |
6980 | C81C9B9F7D4A68120DDA56FC6EC65FFA40DB78A60A05EC270A106DEEBD2CB92B | |
6981 | F0622BD2B1D43771DF39AAD3ECB655F317AB483F7290C148690903AAA636583C | |
6982 | 99DE3DBA99EFE20773D3D8DDD816A28D7BD8881DE570BAF5C7A30679179E1214 | |
6983 | FCFED81605FE56AEA21C1894167F93D648B474352A65C0756F812F97AB435ADD | |
6984 | 22C031A21714A626DE35308AC51CD676DB1748DD2773532294FA77CFB2AAFD32 | |
6985 | A72BB7A045F12B4934A768F89217233DBBD69B900B28492A26713CA5D61A9042 | |
6986 | A982CB071F1F875718FAC168E4E275860DB6369B8114E1BDD4801110B62C3E3E | |
6987 | CF140554C826967A99F4E9726526E87D57BF845CE38E33893E5F9788769B6A4B | |
6988 | A4577C38C8D45AF2EDC9F4FA7DD9979AB8E14FF5D8956233AB4C02982BE8E561 | |
6989 | C63B7BC314793F634DB6F086E1A60D9FC3B69D3A7C20A99FBF3CB028CDBCEB60 | |
6990 | E803C8DC3C5F0CCAC030905E72BBAC052520CB0E40E23B46B2150DE67F61E4B1 | |
6991 | 8C4D55904B7F90DDE4A4A78B11AE1009DE46DA396791B1C0EA63FB6897FDFA0F | |
6992 | 42474042E7E9B06A703A7C6E672AC6705506F3C0B6861BC85CEBB9DC9BCFDE0D | |
6993 | 43F5248CD7CAD4B89835BACABBCE6C791BC35FE7211E775C009844FC75CBF6CA | |
6994 | DA6A6B7B488270BFAFFA3E9950914CB0F88C8AB7CDEFD2FDE11ADA7073037EF3 | |
6995 | 1A5CEEE37090F3A56D06FBC70597907A26498593783878C02722ECFD5D65903C | |
6996 | 7D421CAFA78924DD27756853568535B02533C3393183D6E30DA6ED4BD6582E09 | |
6997 | A5A4B4404EC452E91CB44515AC6124EBADAAE8A98D8A95E7D14DA39951EBC461 | |
6998 | D426490071462F246794023DE1BDC04AB0F1834D50F748C3C60A07E1FB8EF400 | |
6999 | 78DBAB90B59500BD1232A872ED51928329CC8F06E83164FBB2D0B24222223EE5 | |
7000 | 992241E8E00D5DCCD6DB9A8E2325ADBE12FC8512AC127BBEABDA739672C1644B | |
7001 | 554850CD75724E6779A7E76424CAF89E9455860E0AE2679231F4A535C0ED4336 | |
7002 | 313717D6F7A4A4DA833847A1BCFC7BF99234FA645F2B85C9A9AAF7108931E3CB | |
7003 | 077A9C571E57B0D7EFD92B56C3AA4FCEC0BCAA96005E649AE8012366BE6E62CD | |
7004 | 9E742F8F45AE4C96BCD73AD80AFB6F061D629ABEAEC3018CFF45E41F46751953 | |
7005 | 44E490B1355DC49C1E10BF343307263584091D122ABB1E3892E532B6DBAA105F | |
7006 | CD48375C112331EC5DB49E4D4CE2D126C9274B21E678E5E3EAAD4EA0CAAA29A7 | |
7007 | 86FD8819217B195EC6E40AF23ABCD71156656DAD38C931C8730715A2773DC44C | |
7008 | 4DEF14D92C2A054739F27D7EF349A0EB76D952BD9BA169B4F85C09D80984D232 | |
7009 | 2CB4A3812BDE539DC79E2EDC7C221739D16B10246A5F57151C210878556D4176 | |
7010 | 31EFF3AB6C4D78C4F0DF81692B3C9BDE4F85242BF0E84BACBFA39688BB222A81 | |
7011 | E85E9CB332868ED5B64E140C66E242B97A90C13B6DFBC3D285A49BA9D4BA1A47 | |
7012 | 64D83577FFB50BF974D953F42A249ADF9AC228CC4D8E82213FD463BC757AFF26 | |
7013 | DF4D1678FBCD55AFD5FB3014C0380B2F8CA9D6400DF2AA041580A6FA5694ADBA | |
7014 | 674286F00E531693DB28F7C996D5A66F80AAAF53001EDFBC065C72FA5BE3F114 | |
7015 | 1FA3354376AEF7374AE1D0A8E9B06C58FD029922164DC9FA09343FB6652232E2 | |
7016 | 2EE34C662F0092BE479D739ACE775C6F589775DD768B736F7391B9AEBDE7F760 | |
7017 | 727702E145CF749DC457B2E98A36C52416107B1E59084B5F777B61511B8D17AC | |
7018 | 88386A7933CAF852CA23FE179B67DF8DCF15800755605847ECC0FD77873727FC | |
7019 | 1AF2BA8BC75D30E26C40913771E528724FD7C5DE284A8B58AE55A5C48AF26AC8 | |
7020 | 02E155B8FCD6755D8F7F5A6F1AE66E4D24A13567B6463B18E65972BD75ABF732 | |
7021 | FB41F87A62FECE9A50C697BCEA1E3B3DF1E3DC961DCA598220CC746326F85F83 | |
7022 | 72E803A4E69106EC5BCA01139F92171DBF9964BBEC8D3370039623CA1F927CBF | |
7023 | FE7DA71B04B4321EB4D3FCB27F8404994CC7DE5F26AB8FC019A203D6DF2F449D | |
7024 | 85A4F103F7604986A1AC1F7D05D239E728FD6AD1DB5024B0A0542130D2B0E7EA | |
7025 | 4432F910F9FD75568F5732EAC95F7A87CEBC359949C26595741533E952327791 | |
7026 | 87E42DF84E1064E1BDD3F5A6455087B8E9C783AB9ABBCAF032E9FA32C27ED7E6 | |
7027 | CA7E3D1D76CD1905166090BD81A85485B9B4E976DB2E19A8E62EFB795FD6298C | |
7028 | 9ADA57D5BDA2FEBB227F0EFEC59E4B51E06B8358006F9D79C1EFE92510D6046B | |
7029 | 6AFEEDC793137DE622A8B3F5C9E3B21F29A98A589D9CEE75E348FD4D206415CE | |
7030 | 508AB95A7496236AF1F6F5ED6B3ADFBAF1E35B51484F9B1E0C11C5AEAB9336F5 | |
7031 | A8861ACE1EC74C4A145A64E4FC8F6BEB3A16B021AFF4AEDA59B06326A8D7FCB3 | |
7032 | 3B75F9729BFB7EEEDA8A1774728C80AED40BC35D42045E5CEEBBBEFAD2566CB1 | |
7033 | AD69A9A972826DF0F2303BB232367E611C115E8955DC97779B1AF269B84574C0 | |
7034 | 9D816C88BAE3AACA6428CFC648FCF0869AD9236591E3B8FA326BD2EDE7F97286 | |
7035 | 511C75F4EE4F7B4DA33BA2CE7F778D92AE7C1B4844CAB3ED8FCA285454D78469 | |
7036 | 1639D24729E8002E4507A114407DF51543CF7DFFDB7E05ADB2D36E139F2DBACF | |
7037 | D90AF274AFB3E5AB5B38918A28EDFCF6EACA78248BEFDC2FAC0E041AD35B130F | |
7038 | 8A91E20251CE976680FCE3F8B65B33118EF7C138CA1260D3CA855C94FCC02CC2 | |
7039 | B29C94A3FFD38056ACE512DE680DA29D97BCFC35FB2A85057E484FC9F72C9A7D | |
7040 | 08AFAFCA705335C6E9AEDAFA97D884E0E463E79D8AB45DDF86C56EC922283C4B | |
7041 | 777EAABC0D57BEE30D4D47FFA16FEAE2FA972E36516480E1FCAFFA5CE692B7E8 | |
7042 | 8F887C5AE573B96643F10BC62FAFA4BC6CD04F5353C0D40CBCEFBBA4DE7B8960 | |
7043 | 352E7F6497C9C4489779028934084522336B5E5DF6FF84A78158ED5035FFFC9F | |
7044 | F199AFD543D5D81C0155F3EE0E7F6FAF7898F7F26941D417F7AB37703FE67D37 | |
7045 | C263078FDC85C5430CF379E657FF9ADA0C00DBD605386F5494459C63D4AC057B | |
7046 | 2E061B06E17B54AEF38A9EB401FD4C76C6755F2AB651473DA2F19E28C89229E3 | |
7047 | FD385D8559EFFEEE5D0CEF127A8A6CF9017459466E0FAC341DE1994C03A0CA5A | |
7048 | 799CCD03DD2B41A05F7B36493638AAF8D7CD380E03726B0A18B02A46A0BCA027 | |
7049 | 9BF16ED75AE0494C36161ED2C22DD7036FBBA2E319106B9A56FECC732B87E2F2 | |
7050 | 596167125221D42DE9D4435DAD321F878FDA68B9E72DBC2E31178621327BAC50 | |
7051 | 72148C123D4C8568DE822169839906B9F0ACAF3B4DCEB9352C8A9E246A9A5EA7 | |
7052 | 31E04981D0A53F44B6905704CFFB9F0463518C02538DEF2DBDABE936D1213FBB | |
7053 | FCD28F833C5872057CAA92536B8E8EBA129745E2E2B5A9F07086A1212D466785 | |
7054 | EE640432A0E47C91CCFF3FED5669C8ABC2B43551AD04E7A2FEE2F3C16511F7D4 | |
7055 | 048A8207351E83AD32A72360A2DB1AA8F78C5D2630D770F5E13D5C49BE166475 | |
7056 | 79483B2F7FEBC1D73B04E0E5D9B8243DBEF7E5D201D9F644B150A230B5CF9B90 | |
7057 | CA34BB8474BCF408E37757B8CE5B33FE7400A68C70F542C7E2A22B8C0AB1EF9F | |
7058 | 2BBA7A646A4C872C43C0A748F078AA98A13E882085B460050CB3F5B09B62EC01 | |
7059 | AB87AF8DFCA6823ED6CF8426EC115C5E4DA335FE416E1D37311B7FD56793CCA0 | |
7060 | BF90B579B0FD4E4E1D0A26FB0C1D490D99CF4994693630FA343960E15AFFC596 | |
7061 | 49BB7297BFB82FD56BBCB36DC1597F94A157AEDFC53419BA867CC02C26464BC0 | |
7062 | 2875127C688DA6902567716A908153DB4CBF710CDBCE50AB98E0CCF1DF5CC571 | |
7063 | 00027F6582CF6AB4E584436471D3C8DA2D780E5B02A9B1717364899D51EC679D | |
7064 | CF5F4A4981EDC24F710E892772E4F891AD02B7B98A113FB1AD2B5A51046693A4 | |
7065 | 19D03A75A3140C19791C85A0DDD173BB3618E9498CDDC8696CCA6EF81729AD1E | |
7066 | EFE4F3D6242E1766A3079371D1D1833841F46F04F2F8029D8C1943F6986A95E4 | |
7067 | 9E77806F221CECAFB3EAE0F979DADC5D2E4715BFB5C64245CBD2300E59030B99 | |
7068 | 0885F08417E1A0C57C3746230F9EF4E968C0F41F67706BDA2E983012BF317612 | |
7069 | 38E9C0178F027EDA0E679F306AF71F0D8985C712C4B4BBBFC57A86AE052CC2FE | |
7070 | 5C1BDFD948801509ADFD4FF9FA7A25E30D6CCC7C7E418EEAB34C4ECC6AC8FADA | |
7071 | 637B5CC70136EA5A57B727EB11075755A7840215CE2B9939BBB6C3A7E22DE42E | |
7072 | B3725C1AD0BEE0A54C0B57CB93E6A20E319E2FE4515D80D09972E0A742D20DE0 | |
7073 | 55117C1B9F3C181456406FCA70A7E3B757A813F7CF9E3562EB8CAE1CFB65DAA2 | |
7074 | B384C17AE103C20851906846AA4AA5EEE5EE989F292D42B11EB4C4FC057EE4BB | |
7075 | B09A4D81E8AF0CE1C851B2E328E977207A6989F13F7FF039A4E295507CF0A53F | |
7076 | 10A345A516EDB7C5FD5763CC27543452249D229BC22099C6FC1DFCC07A35144C | |
7077 | 6267BE8D5BDCE57F9C7C65F6A64A74DC2207C8601231477DD57BC8259B26C683 | |
7078 | 22FD4DBF0E3BD814E31C9E194CE2EB212268A249216DB084226802B79DC72AAB | |
7079 | FAC4ED3AF6BC51E2D9A1D5A37F5124BEBB1E0B010C34A1B7FBCED45414AD2285 | |
7080 | 43BE684BC7BB56C5036D182AFECC061F749522456B4DCD80E3315F48E7E8AB98 | |
7081 | 40C4FBDE71DA957C8FD860C4AB02C97578BC8299EF448A526CFC585F27EA14E8 | |
7082 | 88F9928CBF87C8E46F69100F0CB43E2720B0BC8DCA50D59FEFBB84383B4036A3 | |
7083 | 0ED89F67B433AB4BF686487194107C63BF989A80D761EF3FB20146A0A496E5E9 | |
7084 | 26375866581146F3537156051C61F82AA5C68B6E8418297DDA7704EA50262775 | |
7085 | B96E1E1D7643370288780188ABCF25B9B23BBE408EC5DE254F51469D5FB06FF6 | |
7086 | 2EA926F94CF1730E014F34822ED267643B773B7CADF967D431B6F3DDC998E56A | |
7087 | 243880E9F772F3BAB3702C19C5DC92ACF864D6A771783E178F4A7BFBAD36008A | |
7088 | F0A61C5B437A69E31235DDA9898B4B081F1176C197C0834CAA25FDC9BEB696AA | |
7089 | 8ABD1FDBE17E30070690EDA533E2EBC19180DCE4CA8146D6657BDDB765DDFB21 | |
7090 | D0CDB86912E49DB109F66DBB9226E297945BCE9073E724EBABB58E42AD94CDA4 | |
7091 | C9DAEC40F79F3A3D36777B18C61DC9D22EC351324FAC3426917C893E36C8D953 | |
7092 | 4ACFACA05F8764BC61A17F6B40D3A97177B97CF88C2B0023ECB3F29F9CB347DC | |
7093 | E686012FB31904DCA042679776108D9D611EEE971D341ABCEACBD0866DA21DCC | |
7094 | 270D3DBBBC9CD438F4F651B58D1405A82960CA991CF690B8B564033154645D8D | |
7095 | ED5E4E059D9DFAF3A5C2BA1C1AFE1B865901C8D117262CAB210A3C7A03443544 | |
7096 | E22EA5577AEF1378A9A4528592F32A8AEBCB1CB6A7E4948FF78C6FD230A5892B | |
7097 | D8953ED89392929FB91C042D31E7E8A4912FC701E722D7FAF0308625B3B748F2 | |
7098 | 26DE427383236E131022A95395C72B3DEBB139C81811582FA4E9C7F970FA605D | |
7099 | C8DBB3ED8B141428ACE6DF426B2567B10C5D68A4060F25D5D64BA262101CF5C3 | |
7100 | 4B7948CDEB6CAC66FFFA0F1795C5F3174F7D319D252DC2D22BD08FAB54CEA742 | |
7101 | 64C0C6B94BDF182DC0942C0C82E82A0B04654A7C2E6BE685EC3DAF1D5FE48790 | |
7102 | DA815DBBD0A176BB4D4424ED7F893B4CED54C2EF94D73CBB154E547CD33D874A | |
7103 | E754A17AD1F10C23BC5FA4E709330A10A73C93B843D8CD8A65D5A4241B35CD19 | |
7104 | 938F2BA2FA95551F0C2FEF1CB8B056D9A9120F7607BD4C497762C577B66B2DF6 | |
7105 | 8F3F661EBD7F3E73E3A0032790ED80F774423A026F8ADE2FA82129E1FF27DB3A | |
7106 | 1B6E603479668FD783735606F7AC6BE9D65C17F7ECCA3B622C13F0FC95F8259D | |
7107 | DA4801A7EE18656AAC3D730CF2E17FCE8657AD6289850DC06E897A759F7B53CA | |
7108 | 502E764B07FDDBE6E99D25ECF1600D6646622334871C57133A8AFD03FBBC2368 | |
7109 | 1BCDABFA9FF4C4A9EF150045F694A3AA487BE461BDD2BF1BBB38BBC365837063 | |
7110 | 70963C7C1E7E4809797F4E497DBF6D5A90A71D6E89BEEDD5D16B31ADCAD67A81 | |
7111 | A9A3085B4CA7BD93E1A9591BD4A7C88FF930EE7A131C5F3338817D88AE31813A | |
7112 | C09D5E7120AFA6565B0A647A40CA94B78F20905B7110FE44A90794F7F0CD63DB | |
7113 | E99675C781255B7BA257CEB14DFDF9C13A02701B0FE41C6A6F50CC62C028A3BA | |
7114 | E9A918549B7F9F206DA0909F2009CC87BBB565F281F24D0ACBCB71F12709DB31 | |
7115 | 5D355415D97F66DB25CAC37E90BEDB51F2FA97E0A61EF85E845F702D0B3AF935 | |
7116 | 14F3EB201323209D76C7C5970AEFCE4225FFB4A1477B177BB52332AA0539291B | |
7117 | 9B8004F23CE4E055F7AB6D6F2A8E74C2994306A407A4FC831D1C887C42FFD0DF | |
7118 | EF07891681C7F4AA914AECC427057A8D73261E25F82DC3EEE7295C0870E91523 | |
7119 | E15187584B32B8F8B0F2E9BF4E67E5A2858F00B0C59DA1B1B59B00374C6C6AD9 | |
7120 | 741E0998EE0DCC6F5ACD1925CC40807D5B66E971CDCFA4651BBF2490FADD15EF | |
7121 | C8A7EA3ECD078D34D875C3EC5EDAB74AC0DCA00F2329184455C24C97EB0AD4C5 | |
7122 | 40B8E4AA2CE6E7816580F9DBCDAE7F01AF0533397CD37C401D4841B60CB976EB | |
7123 | E3093FC863F368C85AECE6E6CF7D9ADABDF628D9806C1269A0EE06FEC90948E5 | |
7124 | CBE40C0A2C72E08D9AD94F07470692D571F595E465CB32BF486AE9C3971B6F7B | |
7125 | FBBDE2699E1FC9DACB156D880DA379262A98C6708A9850FF8EE36C35FF636E46 | |
7126 | D8D00FB3550786C1D73E6B91F9B35D6998F33BC953E0C8AFF996F4C707F8DBAA | |
7127 | AFD76432E45605D5E703C2569856A0BD8C8ACB29BCAC87F1A72F859D20205328 | |
7128 | 6272929343C1CBCB053D7E19AEC4B2EFAA765B2002F43E7F62ED5281C94ABDAE | |
7129 | 750B2C88B3801559FC6DF0D66E55952FD67AD41718D49D35DBF2B7CCBC1E755E | |
7130 | 800ABB45EA4D7547756CE9E6D3AE0B80D8D97D681DFFCF4D5D5330F0FD6AA729 | |
7131 | 5BCB1475F18E9612197D6F5F7C7AE8FB931C242993D385AAE7829391D370819A | |
7132 | 496B9518C6F913E666C27F0896C7684AA1DB1A335C7B50762B4F8445D45C907B | |
7133 | 9E30F7FD84E403DACCB0A8DFF2940312386C315FFA700B0E42242EEE04042E2A | |
7134 | 3F4840E719A42FAC426870CC20DF083537010550A6B43A02A330D92CE15222FB | |
7135 | BE6A9F6EFA44F7987224533983D96BD2E1E536437F89E2E43884AE09FF5C7902 | |
7136 | A284704F78AC067C332EA207F53CAB61ED51EF3FE79A9B7A373C3DF72A4F3A5D | |
7137 | 67B4F60BB470E5D093FD880AD32809160E550CC1EE67E01CFA80318C03E6FDAD | |
7138 | A8E744FEA593E2761C60D2CE83F3F6D3A2B203739C62A69D4E271FA12372C45F | |
7139 | 6C378E4CC21B9B0CBFCF43233562E4BD4D52F7A634D1F0493F8DE445D140EA4A | |
7140 | D3956E9971263B7C3CAEC8AC83E541D58F52E00C1C80EBD9A31F0A9D17FA2D63 | |
7141 | E5E0D22CA28D51E39A055C40AB769EF224AEFE2AF714E322FDCB9770EB00686B | |
7142 | 208AAEE2160D059DEED823FF4F9769359C183A6A6398F9E4ED55397F02C68FB1 | |
7143 | 016CB495A0599DED25BF1006343DF9AB7C3BAEBD1EB2F99F4FCB07E84AD2D959 | |
7144 | D1D573B89C220DAD815D9EBA41CEF4D664630082DB97645AEA6779A8F0D7765E | |
7145 | B76A4B8B429CF95F22474EEF2FF1C792DD525E50E1EE0A1ECD78570970B62293 | |
7146 | 43DBE6E9B97585B754AEFE28E960B5F8B3F549EC7F168FFFC5EBB52C7CDDACCB | |
7147 | DF9E1FD89F2F8CEE44285E79724FDDFED021AAD2025006239EE5CA8543B86200 | |
7148 | C7E8522668B07608615F6F102E295003B1B89264810A2BFC3DAFECFF126B1807 | |
7149 | 2388839274203BEEC2B319C7F263ABBE6B181FECB5FDB9516E8F0456B6A1BEAD | |
7150 | 7F45DB0F95F4943B2ACF52CB30DFDC6EC936A6292DC2AD0BD67164900CECF3DC | |
7151 | 097528073246A88607DDEE1DE4BCFC298892F3B73E897734D7001A466170F60E | |
7152 | 5F2948ED36A6AC13975086A2D68B6CD8B033CD14C1B85EEE4AD3679D74DEB998 | |
7153 | AF62D045BF1102FB3927E5B9078F8AF93A0ADDF1937276C423CD346F30D17D3C | |
7154 | C57CE052053EC21A2991D063B157FD535850DD63E55890427BC2C883785DFBA2 | |
7155 | 436BDED247251001AB1AE56EA19880B88B3F1BFA6C232876E6C002E9EA850700 | |
7156 | 517C80537C27033737A162B10B179624F869FEC056F339D5A292E6E945E7BB31 | |
7157 | A271CA30990B4AA5874CAD851C1154275BBA868EDA5D156F4663E2D436DE6DD2 | |
7158 | 74E6579AB19EC803927046D9130BD9E735D64248A6FA78F1DD6B51DF0B1DD553 | |
7159 | 316D96795355878C426BDA09F052D54880E5F3E5C1F29786DA0A8084D81A5849 | |
7160 | B2A301BFF171446EEB4DAECAF40D8C4F6C489BEA6C592F8257E68C514180756D | |
7161 | A13569A03827561348B73584D69626B3175247018DB9DFAA9E989E55C97F9A32 | |
7162 | B02423EA16FADA78FE1E3C56EF4122C640EB8D77C5E957B5E425A2FBFD173423 | |
7163 | E8AA1758A91E1B5B85D174D7DA1F11B3AA76761346D2464BDBA290435A6DA50C | |
7164 | 1F14E14FE29396C918E3E4C388E93D1C3F7A7161FC61DFA1543D4CA86B6A3A5D | |
7165 | B64FC69BADC3F3E0F7DA2AA5FD6C39700C2CB8A6C823D2620D39FBB0B507003B | |
7166 | 6D28C8D67F57C019DE3D8A4B6BD01CF0B305163BB1229F470AAD7436D13C326C | |
7167 | 5D205B4C818D0F765E2B9FDDE26B033D1060EBEEAD6E5C49EC8C6F395B54C259 | |
7168 | 4E24E89DB787773423E358A1C64C3FDEE4CCBAAC4AC652012A0CD7269A062643 | |
7169 | 0F52A1BD1DEE9401B5835752C48CD0B705476B00458D31E70599761C793987D1 | |
7170 | 1A14288D5EB2C9452C2C4524202A40A8C773AA8A3B9D10ABFF457478532B2C58 | |
7171 | 0DA8776E116853B77D1A8EE320C87B23A693BB5D3E77A9C419772675690DD75C | |
7172 | 7AC5BC3ACF97BB11C70C0261EB5DECD96577D755B03EECBC66B3B8FAFAD87950 | |
7173 | 94AA617A40E4CFE88939F28D0D36C5C6FB5B4F6E4321BDBF12DCD428BDEC76DC | |
7174 | 192AD968A9699084DBFFA3FE06D5F79D336DD6CFCA4C9E1F427A29DB1F4F0492 | |
7175 | A29F5F052310D455E8AE1847083B70EE57C4799FF4B470655D855B8298FD3694 | |
7176 | 66E00CF5D04415601598C0ABD6802FA0DC4C12965546076E46C2DE87467CCC8D | |
7177 | F9ED9FE429CDE1DB2AFE61363327B4D11F46C678B59E74F8F09D8B9C14C48004 | |
7178 | CEC93F33A4A6906CD71B2414C05B3599E4D1FC1EB839D4B5E5968711359D3BB2 | |
7179 | 8E6E262896409C7EE86DF7A8CF1DCA1EDCB2BE723CAAF5B1D7DC94F093864855 | |
7180 | 7FB08EF776FDCF9DD8342ECB7F7B307542880A7C04D3BD09D65BE13F80E36120 | |
7181 | 24BBE4C422F1CC0DC956CE53261B903ABA0E0CF1CB0AA8895C0DA8127DE3DC9D | |
7182 | 4B491926B5408AC8D29D2FE62CC3CEF548C0A57A1DA202EAEA8F4584D8B64E49 | |
7183 | A3D11A48600CC0913B744180AFB6873BE72DCDFF8EA2203E34082E011C87C3F8 | |
7184 | EE91457705ED0BD4E2C193B7E818B50DDDD734F2BA1B876D262C39D94B0FC27F | |
7185 | 0B5A87423EAE91BDAB38BE457EB0309D05FA5E458109305C03295FC39B0D06BD | |
7186 | BFA2B4520DD610E12C3AF842A94296108FB67495B300991C3491F0983B5A0403 | |
7187 | 68A8D19218D9429EE400C3B91DDE2A9F163684D9F28120B584FEC88628EAA60F | |
7188 | 79F5988BE7BE31153A675BC7B344E7F62CE85E8850361D1996D57E71690472BB | |
7189 | 8055755DE965D795E6D2424F7D76AE7F249AEF4BFD75103B2CE4D62FECCD2FAE | |
7190 | 3702A57A3320C54D19D5015ABA5AF39B237C53D38DBD80773C0B9D6406574BFA | |
7191 | 48BA4EE71769AD140E202D24D9F1691BA072E1AF182FD6DC06C2FD25E3437E38 | |
7192 | ED1D0033E77D2B188F3A84EAE17787110EC5462EF5CD0FEBBE5CE39976B5CDA4 | |
7193 | 8206BE5EB8A06C7698C5E6A45EC7F59CAD3D6ED3AC19FABF3D29C9AEBEFDD74A | |
7194 | 6B7261D349FE509BD769D9A24B16C276C917F0CBE8B25FFE19BF8528E1C46D38 | |
7195 | 3738E3CEE8170E3EE323A464A3C8FF30B3DAD0BE87518E008E37F60DB471E3EC | |
7196 | 110E9B8AAA5C875AF759126B39B90A8E7BCB25FA3EFA783AF7B069AED1887A19 | |
7197 | 6A75C799940E5352C34A93F125DE82A7387CFDD7073A28C1026C9E06A1D8163B | |
7198 | E66DC3BAAEBBDF96B7B3143B9414AB45643D022294C2AF8C87EBFF1276EF991B | |
7199 | 7A1C720C1A7CFD392F211A190A530A19012EB117670AFAE4CF700048D901A5BE | |
7200 | 074F9B05AA555FA4ED6D0A92C08E4B795279F9BE48887886B5121DDD857E8A86 | |
7201 | A2885B9A672C72BAB990E0AF6DCCC769A7E18E65A86B3E1482D8297FD98E0510 | |
7202 | 30B27AFCB9B261771A1AFC298F96E272E779A8B6AB6B03410ECE32B7B69369C7 | |
7203 | 5597FDD08BF2E6CA29E093428DBB0BC53C64E5ECBF216111AC90E82822E7604B | |
7204 | A9AF479BE9FD2FB2ED27EBF4027C22357DB27A5A6FBC6B14607DC26F95A81BA5 | |
7205 | 1737D6C406B19857FFF2903F966DCD56BB73B06F5F74C917517DF95D8D5E5108 | |
7206 | 350AB839CBDFD7D1F3C687D0B6B576FFE108AE8708B967C29F9840A0D6784789 | |
7207 | DDD7A0D76E92082162603CC916ADAD75BB205E7C9B7A72D286C5411F3771EB6B | |
7208 | 9F9022BB24AC9EE7700907280F52862F1D542605F3D3AB06679252DB9A8A4E41 | |
7209 | FD9740AE35473A9FD025F364B863DDD063AF91A114EB529A38F28C4B4551E276 | |
7210 | F76C254669B81BD3CA8479F0C7208AFE5A1927F2AB12FBEC47FE0BF9AC3DBF3C | |
7211 | 340DC67125FA0D65B245260B32FB74F90CCA6D327874BDB6C252614C75425F20 | |
7212 | 2AD8C9ADD15733715B9281DB9D73C66B9664491416643C04165C64F5939CA73F | |
7213 | F8D7652592F391E59B82EF0BEDA9DC7F42713005E4AEAA1111EAB4E74BD99119 | |
7214 | D86490DEE3DA6C021B36D7AFDF9EEDBB1E3253176EF0607469E0982034AF57A8 | |
7215 | 83F024DD4B42B99BBA110514E52498F6BE463B3053DF5114F2D6644FA27702D3 | |
7216 | 15DB327F632E3750171BDAD75F0B7D2A84267C712132373A2FE740BB086D53B5 | |
7217 | C3E9A68583159E46FE46ED3B645B0FD505D206E09D438052E27B75EFE7F5D83F | |
7218 | BC153E4BAD47FF241AD46BE13605E1840C5C2CE3492C29EA5FFF5550AA3986E4 | |
7219 | FF28A404908C88269D821EB2FBB193DC311750F6163D75872603A254B949C756 | |
7220 | CB97829F0BE3AD796D52969E483A0A53CA650CFB9AD57E0F4DED89C7746341EB | |
7221 | 3D3333F06556BC61BABC3553C7B0D83DDC5B3BFDC77DBD9B6DE41680DD6439E9 | |
7222 | 4C9FA49DF62830C86E7A4B1CBD37F2794EB6DAFC3F1676697392A6A635E626DD | |
7223 | 3A3BC9E2378C152F9895178C694596191B37BE3DD8C0FF34C82C386289EBD7CC | |
7224 | B63139A3243F193EA10211A8E390B4C4046663CEC373928556F5CC99FE094ED2 | |
7225 | 841DDF013CAA6CA5C48CD9382CB776964B38BC24BB009DF203DB81D4EE3A4463 | |
7226 | C5F2BD876E0C9B9B226FF39C0CE6E67589A38388A02A81D3DEA72CC031BB8B2F | |
7227 | 66C481F00167DC0BEEE6740A78D736F429B44B82A3B01ED2127052646DB442FC | |
7228 | C1EC78B100F11D42512810F26EEABFFDEE3E46DD584FCC2194896F7BB5670634 | |
7229 | 480771223C1E2641A253CE2490AD75591FD94F19B2DBA95F0CD64EE4BA03D3B2 | |
7230 | BB0C7A6437B610004CA4F1B914D9075051F7CBB6CDA305F6337307F317CC05C7 | |
7231 | 8BA5A409ED6D915263680852670F8A474AB0646ACF77FA3AC35332DFE2B00CEA | |
7232 | FA99D25DAC950B173DB84ACD9DD99AB23973390FE32E384C6003FEB9A4D3FB1A | |
7233 | CA17FE87AD558921F203432EC00D0BD9E0294A0364048A9743516F46EAC01B7A | |
7234 | AF23DACE21FC2D26692D8F1A85F1B0AA8156D6360B322724C4804FAE55DFA814 | |
7235 | ACCE2F8508335CD775539E7931007A73DFDEEF7695487B10BB0D95FCA66D0F53 | |
7236 | 6E86DD15234A025709C4F7DD08761711D05655EAD8122D8BA2F7177E820B48C2 | |
7237 | 5EC82CD16644832ADF374ACF193975B4635FB374451D0AED47030807CFDCF240 | |
7238 | 783160D79230AAC1F2E5066F09C327ACE24CA2D712D08749FC63C3D8EDADCE22 | |
7239 | B81A7E03350AE88F30BE8222B6954ED0D2910AECBA460EC21BB032C4D5DC1B12 | |
7240 | 39F1EB91215B384CDE3F1FBDABA298E37D4460D0B07B0493053444AC73654815 | |
7241 | 376ADD2F64BDE78BF59CD75D93A3A3BC730562E9A1F2A730A2F766AA19DE458F | |
7242 | 06DD501B215E0C2070CD64DDE13E99719671FA4809FBCB6623E206253081A50F | |
7243 | 5329F16F1B0F0F69276852A7A0AC023A821B8E7880F9D7AE5DA74D0483AACB4F | |
7244 | FF09D975ABF439500ADEADA4990CA29A50D82C0A7704F11DDE0C9C8E4DA21382 | |
7245 | C4F7289719D9A4A44BF2735CCAA2BCA698A5FAEC9A3BCCDDA1C88CCE18510733 | |
7246 | 5A88B88A193C9DF15ACD00F20A965C11DD8A35CE316EF3E4716AB3FB4EC6288A | |
7247 | 91C0F824FC9933315C9A71CA786C9305A9A30F407777F0AEA7D341D1D9605378 | |
7248 | 72CF445A4A2E3666C0075E2F9AAC3F452811EF7E60E6C04F37F3808FE8BD39F2 | |
7249 | 346F5E25757E3ED2232F1B9B4DADF83DA45F7F302809251973F705CF71E34C18 | |
7250 | 7C452C4B5D29E0CB74CD6EA67637FFF0E9D9B211FF96E04FFFE9A27BE5E13BF6 | |
7251 | B51EF214FF4F0A58C5D5734E6BCB0ECD419AE3CF79AB67D1B3EAE70FC1E83691 | |
7252 | 095D0C370C9CF847C2A914F0B810124D763A972464C5F2C1F69914A8672D46EE | |
7253 | 30F9EFFA7E9628D667E5DB582C123160BF28E77DBBD77598F14A32DD74F67032 | |
7254 | B4A0537D0FF938CC61BB0F9798B600FFB1AD7AE6AEE67E0FC6557FC3FBAA1E4E | |
7255 | C793B0D207EE0395913818CB2446E9B82B880537C1625C70ACBC87F97CEA8C77 | |
7256 | 82E6229E1734F80FBF8477F062F3836FA9DCF83A4BA49703FE3DCB5F2CF6266F | |
7257 | 4480EDFA91B1D98FAB8BE14DA6E84B9D58B46DE5D034734496474241F59317F4 | |
7258 | 4AE4AFFABA7CA3FA149A26CF5050B83BDCB1C56B529900AA20EE6098D135E65E | |
7259 | 61026EF0852D497B3799DA044CB378332924CA360A1C62E24B5A0628813829AF | |
7260 | A1236DD728559DAA01188D6EBBF3CEF983C5201904D03A46B62A41E9C5F494DB | |
7261 | 135F6B62BD5F3745625E96E1B401848BFD935AD1FE128507866FB807693E8376 | |
7262 | 634F1B39763087EE7E454069D5CED93DAE8BE9D1366669A152968E2DF13EFA54 | |
7263 | D1A631CCCA33D914CC1DA8C0DF8ECE2FABD18641FFB43BB5E82DD0A56CC20DCC | |
7264 | 64EC0A7A04709085C80C2A1477CF85A29D0C11F204CEA455072DFBA6F5F5C693 | |
7265 | CB2B56EA189926EB51E92D2B5D89F25AB94E1F7FA208916FFE89601B616B41EB | |
7266 | EFA70F4C8CFC3FAD1D056E4076E8CDC2C3058A2B35B34FA0A29A2ED3746060AD | |
7267 | 1A6B6988B1B0986DE495FDE9A8C45119DA7EC756E1C83C89842C8744AC4B80DC | |
7268 | 264792E2E8D5AE4120BC57C170C742EEB0EAE8C9C4537AE432654DA4DF89FD45 | |
7269 | AE0DBDD92D0DDFA0C90C4FB90FD5A7ABB522A193117153CF578A584447FCD674 | |
7270 | 548ECB9250DA4669DDC8CDBEBBA49999F2519DE29B0CE693DEB2F420D4B0CE02 | |
7271 | D9AA3C2C15A6DC98495E1EA54C7670482E2B1034B91692285AC47EFD6271659E | |
7272 | 400D6D7DC137A904647FD092B1B4D59170F1EED8E29FCD584FEA2C77642AB839 | |
7273 | 0A44403D75504E8DDF1BDBBA6B51B7F9F64B63676B6FBDE514701B9333312126 | |
7274 | 4D8AC19B638254A4BFDEACA80AB2CBC4DD12AB48BC34771E210FB576FA0DE013 | |
7275 | 5C49E765028D57C056BD7C14E6941B0A92A2073CA3CCA67E9A18F18BE4934550 | |
7276 | EFB984B486B9036B8E3221F63D8642E2C71E6547A8E4B25FC3EC3C42D27DFD85 | |
7277 | E85F2D08C69CDCF3174A09E363E92A8B3D75BFD57CA37144D5267BA4D1750988 | |
7278 | 8FA3A9B9100838AA7DFFA97C5E4D2516F5649CA756C97C5A3D500A60D2AC5039 | |
7279 | 812B603639C2E3CE36F26CC0AFCB385A5BBD582E7BD1B5920F67DBAF9ABF9EE5 | |
7280 | FCF66EECB566DD87F0618AB73199C230034DE379CAC1F6BD17526305D6B6ECD5 | |
7281 | 8C5C57FA76FA775B2A25C7F5C83C27A1F4C71DCA93487469004EDFF855A156C0 | |
7282 | 8C8EE1972CEB91B9292F5619118F7DA38B1FCDD069D71D0DAE61BE55AF0E255B | |
7283 | 3B8D2DE974592BCA7D92F0DE92538C74A801CF16A424621627BEE5BEC2CC5E68 | |
7284 | 9B88BE0ADDB7C8125F7C35D74A52779C6D5D87143506EAB799765589617D08F3 | |
7285 | 1305B15752D134A97F7D872CF330F4B3BB62946570C5EA7DB77612DF9B7F91E9 | |
7286 | 22321623627FEC40FA04FDC1AA21DECC7AE531510375D6F68A68C6B8BD649A67 | |
7287 | A3E24B30E04ACC2171A510DCD77F7688E2ABD7D3346BD84E8363BCDB2EABBE0E | |
7288 | 5BC87A595CE80F977190EF06D3D0BE12DA50EA0C33D25617A9DA8940967906B5 | |
7289 | F5317F4CDCE1DCC7ED48B4AC4DA131EBCCD11F7D241551AF8A2A723A5C634EAC | |
7290 | 575113186D3B83F8B6E2E50796481B6CA50D440D5B20C5206A85F539FB7D52B8 | |
7291 | B831EF10B784D195BF7EFF05A9125A3B90CE131D84ADBBE6E47AAC2FBE51DDDF | |
7292 | 1286C0DCCA8343F7803FCB25CD690EF9FB49C1C3B91BB7FCE5D330C781744502 | |
7293 | AE46FEC050B4C695101F3B86ACE09D502572DFF5F8534DBE6DEAE838B4000712 | |
7294 | 4B21697BA3FCDCCB3B858251438F05B3EA1F8CABC08A502C5324D1315214E7DA | |
7295 | 6B62576C10E6EE9A69FDB9D424FE1C7BC32CF37EE9EFC42B9F6726C486762574 | |
7296 | 03913F9B3F5A20B1EFA8D4E072EA2F641D7AF64403C4EC76E3A81185B976499D | |
7297 | C78FAD546598AB094B628942EBA51C11FD572264BFC7B0E97A1715D7443F29EB | |
7298 | 7BB4E6848383836F99850E22316C73B76B0E6848008B832E49B7373A94DADEE4 | |
7299 | E7EB32C428F531FFA2067E3316A47C08068D93E27525A9A2A915CD9F204AB4DE | |
7300 | 01EF65ECE8167C184DFA747930AA322FC136DE0D412E99E6F37ACF87A788141B | |
7301 | 3043A3B0D20DDE8C2137EF0DA77A899A581A51AC4CD5A1031F84BD428D0A17A9 | |
7302 | 989877277917D07CB806DF051C23F1AB0049FBDE843B34CFC9DEC4147D97759E | |
7303 | 983C395F0C9DC2832139DFDE0455002BEBC392E7617156400301F76441347A3E | |
7304 | E94D2FB65A31DA189BCC3CE94AFC1613B546D424A36EB2F83F3444DDAB0F03A0 | |
7305 | F3C270A9B8BC62465F46D83929DB7F0240E52CAC458194BFD50645F825D0C41C | |
7306 | 773B1D6757625906C7643BDCE990E24467C011ACDAF6D4A26A62D71FAF1F475C | |
7307 | F14CA4D545E9E4F80BB01F3AC573D046DA7356FB9884CAE3A29DC357BC8CB255 | |
7308 | E5108AB355F0E087902C9BB458DCE8F341F1AEB79E468EE9A45855FE037780E7 | |
7309 | 9EA9ADC1CFA141A3F976DFEF51A428D237F234BF5C694DAD4CCF2AE84FFAB574 | |
7310 | A25C1FBA2F38110C305D962420A310FE93301B8677478BDBBBDC518B8C94E819 | |
7311 | 26BD2529D0EBF0E770CB3A1E107440D135848D2F90CE8F37693EDAF6071B79F4 | |
7312 | FEA5ABF4D9F2DC67F2468F2BDA3FA968EED4CAF8D7A22CB28AA43804F72F56B9 | |
7313 | 545DBD0E3F27DD5617329305CD8577AF38CD4C472CB181CF3DBEA07CD42C6C1C | |
7314 | 51E819286FFFC75E38F5EFF96C763F51A31A78B0848CF56DE1A2CBE2F39B0C41 | |
7315 | FC7C0D42D48D6C75516316B27F6C34AE6D5F5873233914790ECE044C014E9796 | |
7316 | 20E200F53FC51ABFEC15C1E08D36E9A4DA7E58DAC014E2C0627EE8ACC6AD021A | |
7317 | D2E2C431ACE954602EB99D4584250637F807507A17DA18521B6820E066058B09 | |
7318 | 8C2B4609FDEA9E02007A097F833C7A9854D74B38DC81016759DD8FC6F98071FE | |
7319 | 620AFA1A8DE5AA974C281A1DEC9C8B866E7E350BE5EF3C7C53F82280790CF239 | |
7320 | C847E4C7F74BCEBED8BCC57D4C01BC4394F0E9EC5AD01852B3B06B93A477A1AB | |
7321 | AA97B588415A03C1984B0C9619C899DFD4766A2CE91CD6A65120E07756100696 | |
7322 | 297345CACCE1551A2CB549077A292B73ECD47C3A098049BC49F2125BBF004DAA | |
7323 | 8827C407B06A07E5F39CC17843FE876FB2DC6CA2ADC0A4D8812901FC82913ECF | |
7324 | BD04C66B3647B7A698B4BC6C2F136C04AF4792F10C31231F2A04E4B55538CC17 | |
7325 | AFE4B47BA2F575BB4E7E222E9F6A4F904F11CBBC6DF6C2F3C15DCF268A39D6AB | |
7326 | DEB9D091EFE6ECD5DF61ED23E570D484A6AFD5F8D34B7D484F76F150D3D97EBE | |
7327 | 5E91D7A458FAB380BE167E7F2FAAC82BC2C7F3C14BDFD06D9665F5AB2CE34800 | |
7328 | E779AC43B70E22199D3BC4A2A14EFD5D20AF12D8CC26BCE54762ECCA9D9F5FDE | |
7329 | 84B43104575B2D6533FD3BD245AAAA4B82314EAEC2E6E566EB32AE367D2F2BBE | |
7330 | 8F6DF9D63F56693D701E259ED828A3E27561A5901B87F606AADBEDDD7E846AC1 | |
7331 | F07D1ACCEC90CF6AB18114A140FE4BC918EDC9B06284B40E2C82D4BE3C1EAB92 | |
7332 | E2E2F0DE115737561F7ACA173B81C9AF7EFCD6797BC1AE6366646C8F1ADC38A9 | |
7333 | F1928933BFB6AB474FA81D8C006AA11B76461ED98DB4DCB95D7772E3D15C2A29 | |
7334 | F116DF0437225E8EA1FC5C3997633CD63539069F7788AAB84BC9FA8A1A61316D | |
7335 | 2C0F07D2914A61B0418912B276561540BE5DBC1F7A20241E85ED95BB775E16D4 | |
7336 | 1F22262C8128967F53031EBA86D0A2184DEB01D51D4F7E15BADE50B7DE246C05 | |
7337 | 38B9B49D264A4B29A372FCBF57323308C71A0E14748850B56D51BB932B1DCAA3 | |
7338 | A1469E84536A42B0D8B55A0292C8050D6CD1BFDCC4D287B15082801EA40AB8DE | |
7339 | CD8628D0E1252DBC57333D74841246D7A6392F158EAA9FD5BC6CB2E535DDBEAB | |
7340 | F16FF32617952596187203D41342DF7FC1E0CAEA2EE8F012236DAB0208A626E4 | |
7341 | 5FC5EC819580727F7890BF2B114523A3006CFE3B67F19419A009826C635C4B2C | |
7342 | 10CED88293D753A6FC63C5C17A424E911169E316DAC022EE37A5F93A6D7BB446 | |
7343 | 5402EDB1F758FFCCBE83F7842CF09E84DAC17CC8A5D0521CDBCA8B320D90F24F | |
7344 | 32AA9B86DAFD068FB0D234C94EC0889134DCCF83F8B0C89F67D660EC4D6E2B34 | |
7345 | D4CC5E094049ACFA09767E7C0AFD789767D0660825FC94878BFCA40105597194 | |
7346 | BDF88A8636D180BAFEF635601218B47E1242497D1E90E7A0F1098FE4161E6C7D | |
7347 | D1E920DBECEDE54FD9D8EA40E25881F0E31C3FECCA22ED507DF496122D25AF56 | |
7348 | E6E690952EC746BE46F4D228D54C634B04D036DD33252E5A5B6309E559EB9CF9 | |
7349 | DD17101EF262D5FEBE9C207007A2E7F3BCCCE3243333F0A79C1779E727414D60 | |
7350 | B451BDC14BA3FFCBB9D49641DE51BE92C7D136C2C910559A6EE106DC05CB4890 | |
7351 | 322BC12FD592C4789FD8368DFB7827A67FF8FADE351646D0B4B35F74A924E229 | |
7352 | DDCBE1B5D24D049CBD4424B123B6AAE7F5AF8AEEC7F862431541F6B755A272CE | |
7353 | 177CAB058D297A35041646435664056644B2422B2CB890080C3BEC3C52C6363C | |
7354 | B843F24977C482C7A37CF18DEDE4E8FECB280E86263BBB5BD413A9BE19329817 | |
7355 | EC424B1AEEEF713A52D68143AF0DC2B02F293425F041A616D148ABED9E7FA7A0 | |
7356 | AE99B5762A52E38BE8E7148EF22808632CBDEA8613948D8E3D576580FA3F4B3E | |
7357 | 0B5F9E1B240BC7D0744FB1D121E3231994DEDE24B919A72869C15B839DDD9917 | |
7358 | D3BF2466E673B142E4B527B17893D3405603E1271E2D005A6318DC98CFA3D25C | |
7359 | 3A7B59A16B1D6C5C31F267B964E951DFDB1143F8D9005E378A3D4F5B072911CC | |
7360 | 814C191A806A989BC176544E45BA9A5CB16281394572CC6275A96865BEAB6F9D | |
7361 | 06DD94701FB30DEAC86652473C182379F43877528F28AB0B5FD9669347003055 | |
7362 | 2E6169601690053E00E18BE7FA7143DA61EA74326BE8122E56485E65B0572821 | |
7363 | BBE05576C1D9706EE219A8377338E93DFFFEE5E37E6054412A9B875A092C948C | |
7364 | C4663F161AEBAFBB964859E9056D42B76A806A2B1C435318459E272DD51339B6 | |
7365 | B16BC73787ADF1D7A2CD630CA98F8B6C479693BA427D7096E83AAC35B6D1CCAE | |
7366 | B5879B03B706C6AA3FC1A1D180315A2252DE59C45E9429E107D7A73A645AB182 | |
7367 | 6FCD53B44907874A1B286BC50D9051160CBFB374856E59C961C376C3B553454B | |
7368 | 108BC5FFAC60EB8C7426A70A1FFC2CE80D8989A3EEC43A9AD51771D48884BB32 | |
7369 | 1749E328FDCCD4FDD104E80EB6813FB98D83139791DD2A2C9ED7A70BC458DB09 | |
7370 | 5D73B21DAF0FFC110324B8F2BC145FA61962C5D78B4D6C8D014D6938AF09F36A | |
7371 | 2A3E5634A140A1A525BFCAA00616AA1D8195A8A68E4260B8ADDDF789B131C074 | |
7372 | 01EF325E06AEA94A459CE1F51F312C3C19142528AC941551F324BE2653BBCF38 | |
7373 | 46DDC6BDF7EF77D68C32F4DE7D8604E63A632AB2108086C77B94DC31D926D1E7 | |
7374 | 1D3653D8B35CC5AC431368B7B2D7C3A565FEE9D9B2E366F265A627FE7B4378C4 | |
7375 | 81A0C4DBDDE6F7DD940F08764D307A5B09097320431AA76A41C4ADE92C260588 | |
7376 | 522B197B802DC488FA2169BC2E13AE36A98591E1673C1CAC29B4E0E15D2227E7 | |
7377 | 80928CA4C060FECE89B014C3FB6A42313FC438E448DDD73CB66ADEF1FACF2E2A | |
7378 | 4601F76ECFF658D97BC22C765C0B1B04B03EE08A41E2C778A8E5954CABE7B386 | |
7379 | BFC2DC7C60E720BAB2B1A726D8AF4933355F21731FD7C930F31720C1E16F6C01 | |
7380 | C0C8B6747961B605CDFFB02FD6D6A7758B1097AA1D47C6DA9DBF0F87E55672AD | |
7381 | FE93D17DA6FE7B2E3A5360C5BF0C3F4715165CC6748BC95CFA74D4AD57B481B9 | |
7382 | 3784040A6B1BB028CA9F69B6AE52CFF8FF3FD169FDE1A85B52651D99B4042E72 | |
7383 | D5E952BD9F976EFA21C935F2ECBF5C8D4D8BA0AA97DD1458650F6DB9C80B3B21 | |
7384 | F60761C150944567DE98E9DED3BB831A57DE2A5C8CC4417D0D02BF24EB09C2A7 | |
7385 | B8262EFB223FDEDB45E75E2559190060C676B43721B5894EA52440AAAF72B77D | |
7386 | 42138ABF062B92255DCE006EC18492D4CC0CA6FE753E8851305B967B4B01D481 | |
7387 | 85D8A1B78CAEBEB99ED44E5BD7B0CD242B46F8C3C4B1DCE6B103497A89D0C48A | |
7388 | FCA2DDB3CBEF2CC076673FE28DD397F4975BF03EABF542C8ECAE8311822A6564 | |
7389 | 14C20DE022F9AFBF672B31D124F96E2475073E6B53F8032685A45AC7181B0158 | |
7390 | A6FDBF2DFCC9D842D42E098BC02AEFABA6D571821604BBDC389E80931BC8A767 | |
7391 | A92DC7CE49EDDC3C89521CD3AF5AEFF121EAA27B74A37BF043B1AC045A0D9A38 | |
7392 | 8767D85D15DBF0F5ABC495207AA3AD05BE201642206044F470EFDF4A8D52C050 | |
7393 | D600F04B97ACED3F7FC8A56E7640A6A4AAAE1816F3A77D887A378AA0B130B509 | |
7394 | 72A8ADBD5808E9BBB7F83216D995EC74FD168D5A3D171AB9C52A0E21169172A2 | |
7395 | 9C680D926D2327A314835700D399CE25A8311D22D1127B43CB8A9D900133C4D1 | |
7396 | CA1F71C4331F37DBE7F26650B4D512C5E192635CD8CF4C560AB5BFFE0671424D | |
7397 | 456BA00271A643AA2477DAB650F682D89B932BEBB5A66EBC9072A469EE78E0B3 | |
7398 | 86F58B1BA76F31B978C167A0E5CE18889C4DA968CEF94EFA70060960E1D53535 | |
7399 | 17230FC0C8AA0E878AD3D6E306533800DB46BF785219872DBCAAEC33A236A8AA | |
7400 | E86D9C9316CEE8D75888217824D56420EF7AFE70E18C6AC6E7E71161373D574A | |
7401 | D399548B201868F2D1B2DEC136ECFEFE25C307630331F2F893FE36E0CCC8113F | |
7402 | 9D7A6DE87881BC713E6B438F1E804B2C6F00DAA4FF0A33F2B051EE2655BD8583 | |
7403 | 9AA5BB2F7A4AD400F34963FA1BD28D5AB933EAE84C047D636122BE431DB097BC | |
7404 | 85D7CB6C30B09333A567F7DFC0A0482E4373512294562297BACC2F53E2BF1718 | |
7405 | 4E23AA470CB1879235832D66846522B8EC1536E17172B8DA9DEB14877C9405D4 | |
7406 | 531E548E8ACEBE66D41992C0D0A25CE7FE2641DC2F06A1399C864A7C1155DDD4 | |
7407 | 20A2D292688E6426B147572C2CD3706C96C22C977A4A6C4A30A54C7DDD50DCB9 | |
7408 | 7BBC5C0B744CD85DF88166B916C0F1909A38742C6BCB58045C4223B70F4B3BAD | |
7409 | 74EBBE8395A3F64A14D6838554EB6AB7CE417DD7448EBB4F3EE10B13B454C4EA | |
7410 | 949AF16A87E72ED21159408171A4847199C5E403FADCC67D0FFA5A58452ADC67 | |
7411 | FC3C597826B20BD85A1AC7BFA715531D99DDA5155185E3FBF29DDF559A103F75 | |
7412 | 538AC8CC0B4C4041288E89B387F6ABE04F90E8CEB2099293D1DC4FE00647C80C | |
7413 | 5DBE532282708D050BC6A226F45DBC314D109554BB25CF04770ED4874EED1B1F | |
7414 | E18E006F254BB4297C435B416A9AFC6FC51568D89317BCDD9885E2D1ED15F4F7 | |
7415 | AF253B5FAEE5CC44BF9D860982B7F4706C8B8018E6488E337B773A4A7AAF9998 | |
7416 | 6796B30721736F7AB66CE22EBEF616FE5847929A2E08D64DA7E912F4CA899F73 | |
7417 | 6A0A1F1F2163886A7C5E6999D98AB9708EADE2030050B2D05AEF0AA9447F8698 | |
7418 | 7C191DD81DB9131D0DC19BB7CD0CD9A60AEBBA3FAD203CA51B6FECB75EC91C14 | |
7419 | EE75CBB49420594C7B9A56EDE29343B5D1817AFF27B71F0BF2B8D59D8198C2B7 | |
7420 | A9F4091A085C973412051D6ACCD3F0B37D502D8FE193CD5E42769D1F497847CF | |
7421 | B986233F0DE24FE2F4ED03BFA105DD04182887D3C6CB827A1D5B00170B8DFA5E | |
7422 | EB1BE4FEEACCC82A5BB4BCE2C8320CBCF6EEBFC955025F3980763F51170EA440 | |
7423 | C2144AD36893326E5A3DC214AF59FF505E8168593AB9543FC6690F0D63262FBB | |
7424 | 978B833906430E5D2DC99D729D1CCE7A0A91725537BCF91DFBF8073EEE494A2B | |
7425 | E38F1AA3D81C602D05FAD3CA3A8A5A7E1F0A7F7CA736B561F3C29275E68D01E1 | |
7426 | FA253D089243988C475ABF8077C71DD93F1414E69FAEE565F42C863C61BE554B | |
7427 | 44C92919D78D898E70510D9EA1FCAB702FD53337263606A777A001224390AA6C | |
7428 | D8CA04FE8F34D61F03E083D0A050EA3985ED026479142A7184494C615A7AC675 | |
7429 | 97B6196C56F2034850A77938B7585B18AEEA2D249E41D25302DFF2416FCADC13 | |
7430 | E69030FD907778821C66F93220A31991386640AC2315A5B7DB80B4AE91A6A4D7 | |
7431 | 8BC19E632295CFECA8D65B4045C5A7614852CD48686A27D61F6DC6ED6120D30D | |
7432 | 92C97F4D0B5135823FA4A59DFB7633 | |
c302751c CR |
7433 | 0000000000000000000000000000000000000000000000000000000000000000 |
7434 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7435 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7436 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7437 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7438 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7439 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7440 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7441 | cleartomark | |
45c0f7f8 | 7442 | {restore}if |
c302751c | 7443 | %%EndFont |
37c41ab1 | 7444 | TeXDict begin 40258431 52099146 1000 600 600 (bashref.dvi) |
037a8b7f | 7445 | @start /Fa 145[60 110[{}1 119.552 /CMSY10 rf /Fb 133[34 |
6e51e0d0 CR |
7446 | 41 41 55 41 43 30 30 30 41 43 38 43 64 21 41 23 21 43 |
7447 | 38 23 34 43 34 43 38 8[58 4[43 57 1[52 60 58 70 3[28 | |
7448 | 58 3[59 1[54 58 7[38 38 38 38 38 38 38 38 38 38 3[21 | |
7449 | 31[43 12[{}50 74.7198 /CMR9 rf /Fc 197[21 58[{}1 74.7198 | |
7450 | /CMMI9 rf /Fd 134[39 39 2[39 39 39 39 2[39 39 39 39 2[39 | |
c61bfbfd CR |
7451 | 39 1[39 39 39 2[39 19[39 27[39 39 2[39 45[{}20 74.7198 |
7452 | /CMSLTT10 rf /Fe 129[39 39 1[39 39 39 39 39 39 39 39 | |
37c41ab1 | 7453 | 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 |
c61bfbfd CR |
7454 | 39 39 39 39 39 1[39 39 39 39 39 39 39 39 39 39 1[39 39 |
7455 | 39 39 39 39 1[39 39 39 39 39 39 39 39 39 39 39 39 1[39 | |
7456 | 39 39 5[39 39 39 39 39 39 39 39 39 1[39 39 39 39 39 1[39 | |
7457 | 39 1[39 33[{}81 74.7198 /CMTT9 rf /Ff 167[62 3[60 46 | |
7458 | 2[57 1[62 76 52 1[43 1[62 65 54 1[63 60 67[{}13 83.022 | |
7459 | /CMR10 rf /Fg 135[67 2[67 1[50 2[61 69 5[33 1[70 2[68 | |
7460 | 52[60 47[{}9 109.174 /CMCSC10 rf /Fh 140[56 3[56 56 1[56 | |
7461 | 2[56 56 56 57[56 45[{}8 109.091 /CMTT12 rf /Fi 130[45 | |
7462 | 1[45 123[{ T1Encoding ReEncodeFont }2 91.3242 /SFRM1095 | |
7463 | rf /Fj 134[48 48 48 48 48 48 48 48 48 48 48 48 48 48 | |
7464 | 48 48 48 48 48 48 48 48 48 48 48 1[48 2[48 3[48 3[48 | |
7465 | 1[48 1[48 1[48 48 48 1[48 48 48 1[48 48 48 48 1[48 6[48 | |
7466 | 6[48 48 48 48 2[48 5[48 39[{}49 90.9091 /CMSLTT10 rf | |
7467 | /Fk 134[65 65 89 65 68 48 48 50 65 68 61 68 102 34 65 | |
7468 | 1[34 68 61 37 56 68 55 68 60 7[93 1[127 1[94 85 68 92 | |
7469 | 92 84 92 96 116 74 96 1[46 96 96 77 81 94 89 87 93 1[58 | |
7470 | 5[61 61 61 61 61 61 61 61 61 61 1[34 41 34 31[68 72 11[{}62 | |
7471 | 109.091 /CMBX12 rf /Fl 135[42 1[42 1[30 37 38 1[46 46 | |
7472 | 51 74 23 2[28 1[42 1[42 46 42 1[46 51[33 32[51 12[{}18 | |
7473 | 90.9091 /CMTI10 rf /Fm 135[56 2[56 1[42 55 1[51 58 56 | |
7474 | 68 47 2[27 1[58 49 51 57 54 53 56 46[50 2[50 1[34 45[{}20 | |
7475 | 90.9091 /CMCSC10 rf /Fn 197[25 58[{}1 90.9091 /CMMI10 | |
7476 | rf /Fo 197[33 58[{}1 119.552 /CMMI12 rf /Fp 134[85 85 | |
7477 | 1[85 90 63 64 66 1[90 81 90 134 45 1[49 45 90 81 49 74 | |
7478 | 90 72 90 78 10[122 124 112 90 120 3[126 153 97 1[83 60 | |
7479 | 126 127 101 106 124 117 115 122 7[81 81 81 81 81 81 81 | |
7480 | 81 81 81 35[90 94 11[{}52 143.462 /CMBX12 rf /Fq 200[0 | |
7481 | 21[91 17[45 1[91 12[71{}5 90.9091 /CMSY10 rf /Fr 134[48 | |
7482 | 48 66 48 51 35 36 36 48 51 45 51 76 25 48 28 25 51 45 | |
7483 | 28 40 51 40 51 45 7[68 68 93 1[68 66 51 67 1[62 71 68 | |
7484 | 83 57 71 1[33 68 71 59 62 69 66 64 68 12[45 45 45 45 | |
7485 | 3[30 8[45 21[76 1[51 53 11[{}56 90.9091 /CMSL10 rf /Fs | |
037a8b7f CR |
7486 | 132[67 1[71 71 97 71 75 52 53 55 1[75 67 75 112 37 71 |
7487 | 41 37 75 67 41 61 75 60 75 65 3[37 1[37 1[102 102 139 | |
7488 | 102 103 94 75 100 101 92 101 105 128 81 105 69 50 105 | |
7489 | 106 85 88 103 97 96 102 105 64 4[37 67 67 67 67 67 67 | |
7490 | 67 67 67 67 1[37 1[37 1[67 5[67 112 1[41 20[75 78 11[{}73 | |
c61bfbfd | 7491 | 119.552 /CMBX12 rf /Ft 129[48 48 48 48 48 48 48 48 48 |
258e3d46 | 7492 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
37c41ab1 | 7493 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
c61bfbfd | 7494 | 48 48 48 48 48 48 48 1[48 48 48 48 48 48 48 48 48 48 |
37c41ab1 | 7495 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
c61bfbfd CR |
7496 | 48 48 48 48 48 48 48 48 48 48 48 48 48 33[{}93 90.9091 |
7497 | /CMTT10 rf /Fu 131[91 45 40 48 48 66 48 51 35 36 36 48 | |
7498 | 51 45 51 76 25 48 28 25 51 45 28 40 51 40 51 45 25 2[25 | |
7499 | 45 25 56 68 68 93 68 68 66 51 67 71 62 71 68 83 57 71 | |
7500 | 47 33 68 71 59 62 69 66 64 68 71 43 1[71 1[25 25 45 45 | |
7501 | 45 45 45 45 45 45 45 45 45 25 30 25 1[45 35 35 25 71 | |
7502 | 76 45 76 45 25 18[76 51 51 53 11[{}91 90.9091 /CMR10 | |
7503 | rf /Fv 138[108 1[76 79 3[108 1[54 3[108 1[59 88 1[86 | |
7504 | 1[94 14[144 4[184 10[138 66[{}13 172.154 /CMBX12 rf end | |
5e13499c CR |
7505 | %%EndProlog |
7506 | %%BeginSetup | |
7507 | %%Feature: *Resolution 600dpi | |
7508 | TeXDict begin | |
7509 | %%BeginPaperSize: Letter | |
45c0f7f8 CR |
7510 | /setpagedevice where |
7511 | { pop << /PageSize [612 792] >> setpagedevice } | |
7512 | { /letter where { pop letter } if } | |
7513 | ifelse | |
5e13499c | 7514 | %%EndPaperSize |
37c41ab1 | 7515 | end |
5e13499c CR |
7516 | %%EndSetup |
7517 | %%Page: 1 1 | |
6e51e0d0 CR |
7518 | TeXDict begin 1 0 bop 150 1318 a Fv(Bash)64 b(Reference)j(Man)-5 |
7519 | b(ual)p 150 1385 3600 34 v 2361 1481 a Fu(Reference)31 | |
8a0829e9 | 7520 | b(Do)s(cumen)m(tation)i(for)d(Bash)2428 1589 y(Edition)h(4.4,)g(for)f |
d345f817 CR |
7521 | Ft(Bash)g Fu(V)-8 b(ersion)31 b(4.4.)3218 1697 y(Jan)m(uary)f(2016)150 |
7522 | 4927 y Fs(Chet)45 b(Ramey)-11 b(,)46 b(Case)g(W)-11 b(estern)46 | |
7523 | b(Reserv)l(e)g(Univ)l(ersit)l(y)150 5068 y(Brian)f(F)-11 | |
7524 | b(o)l(x,)45 b(F)-11 b(ree)45 b(Soft)l(w)l(are)h(F)-11 | |
fc527055 | 7525 | b(oundation)p 150 5141 3600 17 v eop end |
5e13499c | 7526 | %%Page: 2 2 |
6e51e0d0 | 7527 | TeXDict begin 2 1 bop 150 4279 a Fu(This)35 b(text)h(is)g(a)g(brief)f |
37c41ab1 | 7528 | (description)h(of)f(the)h(features)g(that)g(are)g(presen)m(t)g(in)f |
d345f817 CR |
7529 | (the)h(Bash)f(shell)h(\(v)m(ersion)150 4389 y(4.4,)c(25)f(Jan)m(uary)f |
7530 | (2016\).)150 4523 y(This)35 b(is)h(Edition)f(4.4,)k(last)d(up)s(dated)f | |
7531 | (25)h(Jan)m(uary)f(2016,)k(of)d Fr(The)f(GNU)i(Bash)e(Reference)i(Man)m | |
7532 | (ual)p Fu(,)150 4633 y(for)30 b Ft(Bash)p Fu(,)g(V)-8 | |
7533 | b(ersion)31 b(4.4.)150 4767 y(Cop)m(yrigh)m(t)602 4764 | |
7534 | y(c)577 4767 y Fq(\015)f Fu(1988{2016)35 b(F)-8 b(ree)31 | |
7535 | b(Soft)m(w)m(are)h(F)-8 b(oundation,)31 b(Inc.)390 4902 | |
7536 | y(P)m(ermission)21 b(is)f(gran)m(ted)h(to)g(cop)m(y)-8 | |
33723c84 CR |
7537 | b(,)24 b(distribute)c(and/or)h(mo)s(dify)e(this)i(do)s(cumen)m(t)f |
7538 | (under)f(the)390 5011 y(terms)25 b(of)h(the)f(GNU)h(F)-8 | |
aaf6036e | 7539 | b(ree)27 b(Do)s(cumen)m(tation)g(License,)g(V)-8 b(ersion)26 |
ad4aef08 | 7540 | b(1.3)g(or)f(an)m(y)h(later)g(v)m(ersion)390 5121 y(published)43 |
aaf6036e CR |
7541 | b(b)m(y)h(the)h(F)-8 b(ree)46 b(Soft)m(w)m(are)g(F)-8 |
7542 | b(oundation;)53 b(with)44 b(no)g(In)m(v)-5 b(arian)m(t)46 | |
ad4aef08 | 7543 | b(Sections,)j(no)390 5230 y(F)-8 b(ron)m(t-Co)m(v)m(er)31 |
aaf6036e | 7544 | b(T)-8 b(exts,)30 b(and)f(no)f(Bac)m(k-Co)m(v)m(er)k(T)-8 |
9f178efb | 7545 | b(exts.)41 b(A)29 b(cop)m(y)h(of)f(the)g(license)h(is)f(included)390 |
ad4aef08 CR |
7546 | 5340 y(in)h(the)h(section)g(en)m(titled)h(\\GNU)f(F)-8 |
7547 | b(ree)32 b(Do)s(cumen)m(tation)g(License".)p eop end | |
5e13499c | 7548 | %%Page: -1 3 |
6e51e0d0 | 7549 | TeXDict begin -1 2 bop 3725 -116 a Fu(i)150 299 y Fp(T)-13 |
967625cd | 7550 | b(able)53 b(of)h(Con)l(ten)l(ts)150 649 y Fs(1)135 b(In)l(tro)t |
037a8b7f CR |
7551 | (duction)31 b Fo(:)19 b(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7552 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7553 | f(:)h(:)f(:)h(:)f(:)g(:)44 b Fs(1)275 786 y Fu(1.1)92 | |
7554 | b(What)31 b(is)f(Bash?)10 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7555 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7556 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7557 | (:)f(:)h(:)f(:)g(:)h(:)23 b Fu(1)275 896 y(1.2)92 b(What)31 | |
7558 | b(is)f(a)h(shell?)22 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
c302751c | 7559 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
037a8b7f CR |
7560 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7561 | g(:)h(:)35 b Fu(1)150 1147 y Fs(2)135 b(De\014nitions)31 | |
7562 | b Fo(:)20 b(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f | |
7563 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:) | |
7564 | f(:)h(:)f(:)g(:)h(:)43 b Fs(3)150 1425 y(3)135 b(Basic)45 | |
7565 | b(Shell)g(F)-11 b(eatures)19 b Fo(:)h(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7566 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7567 | h(:)f(:)32 b Fs(5)275 1562 y Fu(3.1)92 b(Shell)30 b(Syn)m(tax)13 | |
7568 | b Fn(:)j(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7569 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
c302751c | 7570 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
037a8b7f CR |
7571 | 27 b Fu(5)399 1671 y(3.1.1)93 b(Shell)30 b(Op)s(eration)14 |
7572 | b Fn(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7573 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h | |
7574 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)28 b Fu(5)399 | |
7575 | 1781 y(3.1.2)93 b(Quoting)23 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7576 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
c302751c | 7577 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
037a8b7f CR |
7578 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)37 b Fu(6)524 1890 y(3.1.2.1)93 |
7579 | b(Escap)s(e)30 b(Character)19 b Fn(:)d(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7580 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7581 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)33 b Fu(6)524 | |
7582 | 2000 y(3.1.2.2)93 b(Single)31 b(Quotes)16 b Fn(:)g(:)f(:)g(:)h(:)f(:)h | |
7583 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7584 | h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)30 | |
7585 | b Fu(6)524 2110 y(3.1.2.3)93 b(Double)31 b(Quotes)14 | |
7586 | b Fn(:)i(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7587 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7588 | (:)h(:)f(:)g(:)h(:)f(:)28 b Fu(6)524 2219 y(3.1.2.4)93 | |
7589 | b(ANSI-C)30 b(Quoting)15 b Fn(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
c302751c | 7590 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) |
037a8b7f CR |
7591 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)29 b Fu(6)524 |
7592 | 2329 y(3.1.2.5)93 b(Lo)s(cale-Sp)s(eci\014c)32 b(T)-8 | |
7593 | b(ranslation)17 b Fn(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7594 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)30 | |
7595 | b Fu(7)399 2438 y(3.1.3)93 b(Commen)m(ts)14 b Fn(:)i(:)f(:)g(:)h(:)f(:) | |
c302751c CR |
7596 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7597 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
037a8b7f CR |
7598 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)28 b Fu(7)275 2548 y(3.2)92 |
7599 | b(Shell)30 b(Commands)9 b Fn(:)15 b(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7600 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7601 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7602 | (:)h(:)f(:)23 b Fu(8)399 2658 y(3.2.1)93 b(Simple)30 | |
7603 | b(Commands)15 b Fn(:)f(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7604 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7605 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)29 b Fu(8)399 | |
7606 | 2767 y(3.2.2)93 b(Pip)s(elines)26 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h | |
7607 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7608 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7609 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)40 b Fu(8)399 2877 y(3.2.3)93 | |
7610 | b(Lists)30 b(of)h(Commands)23 b Fn(:)14 b(:)i(:)f(:)g(:)h(:)f(:)h(:)f | |
220537f2 | 7611 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f CR |
7612 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)36 |
7613 | b Fu(9)399 2986 y(3.2.4)93 b(Comp)s(ound)28 b(Commands)12 | |
7614 | b Fn(:)i(:)h(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7615 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7616 | (:)h(:)f(:)25 b Fu(9)524 3096 y(3.2.4.1)93 b(Lo)s(oping)30 | |
7617 | b(Constructs)16 b Fn(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
220537f2 | 7618 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
037a8b7f CR |
7619 | (:)h(:)f(:)h(:)29 b Fu(10)524 3205 y(3.2.4.2)93 b(Conditional)31 |
7620 | b(Constructs)25 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7621 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7622 | 39 b Fu(10)524 3315 y(3.2.4.3)93 b(Grouping)30 b(Commands)22 | |
7623 | b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7624 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)36 | |
7625 | b Fu(14)399 3425 y(3.2.5)93 b(Copro)s(cesses)26 b Fn(:)15 | |
7626 | b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7627 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7628 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)39 b Fu(15)399 | |
7629 | 3534 y(3.2.6)93 b(GNU)31 b(P)m(arallel)13 b Fn(:)k(:)f(:)f(:)h(:)f(:)h | |
7630 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
c302751c | 7631 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
037a8b7f CR |
7632 | (:)f(:)g(:)h(:)26 b Fu(15)275 3644 y(3.3)92 b(Shell)30 |
7633 | b(F)-8 b(unctions)16 b Fn(:)g(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7634 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7635 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7636 | (:)h(:)29 b Fu(17)275 3753 y(3.4)92 b(Shell)30 b(P)m(arameters)c | |
7637 | Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
c302751c | 7638 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f CR |
7639 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)38 b |
7640 | Fu(18)399 3863 y(3.4.1)93 b(P)m(ositional)32 b(P)m(arameters)8 | |
7641 | b Fn(:)17 b(:)f(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7642 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7643 | h(:)f(:)h(:)21 b Fu(19)399 3973 y(3.4.2)93 b(Sp)s(ecial)30 | |
7644 | b(P)m(arameters)c Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7645 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
7646 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)37 b Fu(20)275 4082 | |
7647 | y(3.5)92 b(Shell)30 b(Expansions)24 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h | |
c302751c | 7648 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
037a8b7f CR |
7649 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7650 | (:)g(:)h(:)f(:)38 b Fu(21)399 4192 y(3.5.1)93 b(Brace)31 | |
7651 | b(Expansion)9 b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7652 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7653 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)22 b | |
7654 | Fu(21)399 4301 y(3.5.2)93 b(Tilde)30 b(Expansion)18 b | |
7655 | Fn(:)d(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f | |
7656 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7657 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)31 b Fu(22)399 4411 y(3.5.3)93 | |
7658 | b(Shell)30 b(P)m(arameter)i(Expansion)26 b Fn(:)15 b(:)g(:)h(:)f(:)h(:) | |
c302751c | 7659 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
037a8b7f CR |
7660 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)39 b Fu(23)399 4521 y(3.5.4)93 |
7661 | b(Command)29 b(Substitution)20 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
c302751c | 7662 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
037a8b7f CR |
7663 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)33 b Fu(29)399 4630 |
7664 | y(3.5.5)93 b(Arithmetic)31 b(Expansion)c Fn(:)15 b(:)h(:)f(:)g(:)h(:)f | |
7665 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7666 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)40 b | |
7667 | Fu(29)399 4740 y(3.5.6)93 b(Pro)s(cess)30 b(Substitution)15 | |
7668 | b Fn(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7669 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7670 | (:)f(:)g(:)h(:)28 b Fu(29)399 4849 y(3.5.7)93 b(W)-8 | |
7671 | b(ord)31 b(Splitting)d Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7672 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7673 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)41 | |
7674 | b Fu(30)399 4959 y(3.5.8)93 b(Filename)32 b(Expansion)22 | |
7675 | b Fn(:)14 b(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7676 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7677 | f(:)h(:)f(:)g(:)35 b Fu(30)524 5068 y(3.5.8.1)93 b(P)m(attern)31 | |
7678 | b(Matc)m(hing)14 b Fn(:)k(:)d(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
c302751c | 7679 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f CR |
7680 | h(:)f(:)g(:)h(:)f(:)h(:)27 b Fu(31)399 5178 y(3.5.9)93 |
7681 | b(Quote)31 b(Remo)m(v)-5 b(al)17 b Fn(:)g(:)e(:)h(:)f(:)h(:)f(:)g(:)h | |
7682 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7683 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)30 | |
7684 | b Fu(32)275 5288 y(3.6)92 b(Redirections)14 b Fn(:)i(:)f(:)g(:)h(:)f(:) | |
7685 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7686 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7687 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)27 b Fu(32)p | |
7688 | eop end | |
5e13499c | 7689 | %%Page: -2 4 |
6e51e0d0 | 7690 | TeXDict begin -2 3 bop 3699 -116 a Fu(ii)399 83 y(3.6.1)93 |
037a8b7f CR |
7691 | b(Redirecting)31 b(Input)11 b Fn(:)j(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7692 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7693 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)24 | |
7694 | b Fu(33)399 193 y(3.6.2)93 b(Redirecting)31 b(Output)15 | |
7695 | b Fn(:)f(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7696 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7697 | (:)f(:)g(:)h(:)f(:)28 b Fu(34)399 302 y(3.6.3)93 b(App)s(ending)28 | |
7698 | b(Redirected)k(Output)20 b Fn(:)14 b(:)h(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7699 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7700 | (:)33 b Fu(34)399 412 y(3.6.4)93 b(Redirecting)31 b(Standard)e(Output)h | |
7701 | (and)f(Standard)h(Error)16 b Fn(:)e(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)29 | |
8a0829e9 | 7702 | b Fu(34)399 521 y(3.6.5)93 b(App)s(ending)28 b(Standard)i(Output)f(and) |
037a8b7f CR |
7703 | h(Standard)f(Error)d Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)40 |
7704 | b Fu(34)399 631 y(3.6.6)93 b(Here)31 b(Do)s(cumen)m(ts)15 | |
7705 | b Fn(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7706 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7707 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)27 b Fu(35)399 741 y(3.6.7)93 | |
7708 | b(Here)31 b(Strings)16 b Fn(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
c302751c | 7709 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f CR |
7710 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)29 |
7711 | b Fu(35)399 850 y(3.6.8)93 b(Duplicating)32 b(File)f(Descriptors)25 | |
7712 | b Fn(:)15 b(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7713 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)37 | |
7714 | b Fu(35)399 960 y(3.6.9)93 b(Mo)m(ving)32 b(File)f(Descriptors)d | |
6e51e0d0 | 7715 | Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
037a8b7f CR |
7716 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7717 | 40 b Fu(36)399 1069 y(3.6.10)93 b(Op)s(ening)29 b(File)j(Descriptors)f | |
7718 | (for)f(Reading)h(and)f(W)-8 b(riting)29 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f | |
7719 | (:)41 b Fu(36)275 1179 y(3.7)92 b(Executing)31 b(Commands)24 | |
7720 | b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7721 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7722 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 b Fu(36)399 1289 y(3.7.1)93 | |
7723 | b(Simple)30 b(Command)f(Expansion)11 b Fn(:)k(:)g(:)h(:)f(:)g(:)h(:)f | |
7724 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7725 | h(:)f(:)g(:)h(:)f(:)24 b Fu(36)399 1398 y(3.7.2)93 b(Command)29 | |
7726 | b(Searc)m(h)i(and)f(Execution)15 b Fn(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7727 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7728 | 28 b Fu(37)399 1508 y(3.7.3)93 b(Command)29 b(Execution)i(En)m | |
7729 | (vironmen)m(t)17 b Fn(:)e(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7730 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)30 b Fu(37)399 | |
7731 | 1617 y(3.7.4)93 b(En)m(vironmen)m(t)26 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h | |
7732 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
c302751c | 7733 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
037a8b7f CR |
7734 | (:)f(:)g(:)h(:)39 b Fu(38)399 1727 y(3.7.5)93 b(Exit)31 |
7735 | b(Status)16 b Fn(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
c302751c | 7736 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
037a8b7f CR |
7737 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)29 |
7738 | b Fu(39)399 1836 y(3.7.6)93 b(Signals)23 b Fn(:)15 b(:)h(:)f(:)h(:)f(:) | |
7739 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7740 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7741 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)36 b Fu(39)275 | |
7742 | 1946 y(3.8)92 b(Shell)30 b(Scripts)12 b Fn(:)i(:)i(:)f(:)h(:)f(:)h(:)f | |
c302751c CR |
7743 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7744 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
037a8b7f CR |
7745 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)25 b Fu(40)150 2197 |
7746 | y Fs(4)135 b(Shell)45 b(Builtin)g(Commands)14 b Fo(:)20 | |
7747 | b(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7748 | (:)h(:)f(:)h(:)f(:)27 b Fs(41)275 2334 y Fu(4.1)92 b(Bourne)30 | |
7749 | b(Shell)g(Builtins)16 b Fn(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7750 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7751 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)29 | |
7752 | b Fu(41)275 2443 y(4.2)92 b(Bash)30 b(Builtin)h(Commands)13 | |
7753 | b Fn(:)h(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7754 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7755 | (:)f(:)g(:)h(:)f(:)26 b Fu(48)275 2553 y(4.3)92 b(Mo)s(difying)30 | |
7756 | b(Shell)g(Beha)m(vior)18 b Fn(:)f(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7757 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7758 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)31 b Fu(59)399 | |
7759 | 2663 y(4.3.1)93 b(The)30 b(Set)g(Builtin)14 b Fn(:)i(:)f(:)h(:)f(:)g(:) | |
7760 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7761 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7762 | f(:)g(:)27 b Fu(59)399 2772 y(4.3.2)93 b(The)30 b(Shopt)f(Builtin)21 | |
7763 | b Fn(:)16 b(:)g(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7764 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7765 | h(:)f(:)h(:)f(:)g(:)h(:)34 b Fu(63)275 2882 y(4.4)92 | |
7766 | b(Sp)s(ecial)30 b(Builtins)9 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7767 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7768 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7769 | f(:)g(:)h(:)f(:)22 b Fu(69)150 3132 y Fs(5)135 b(Shell)45 | |
7770 | b(V)-11 b(ariables)11 b Fo(:)20 b(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f | |
7771 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:) | |
7772 | f(:)h(:)f(:)g(:)h(:)f(:)24 b Fs(70)275 3269 y Fu(5.1)92 | |
7773 | b(Bourne)30 b(Shell)g(V)-8 b(ariables)10 b Fn(:)17 b(:)e(:)g(:)h(:)f(:) | |
7774 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
c302751c | 7775 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f CR |
7776 | 23 b Fu(70)275 3379 y(5.2)92 b(Bash)30 b(V)-8 b(ariables)26 |
7777 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7778 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7779 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)38 | |
7780 | b Fu(70)150 3630 y Fs(6)135 b(Bash)44 b(F)-11 b(eatures)32 | |
7781 | b Fo(:)19 b(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7782 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7783 | 44 b Fs(81)275 3767 y Fu(6.1)92 b(In)m(v)m(oking)31 b(Bash)16 | |
7784 | b Fn(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
c302751c | 7785 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
037a8b7f CR |
7786 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)29 |
7787 | b Fu(81)275 3876 y(6.2)92 b(Bash)30 b(Startup)g(Files)f | |
7788 | Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7789 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7790 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)41 b Fu(83)275 | |
7791 | 3986 y(6.3)92 b(In)m(teractiv)m(e)32 b(Shells)19 b Fn(:)d(:)f(:)h(:)f | |
7792 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
c302751c | 7793 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
037a8b7f CR |
7794 | (:)h(:)f(:)g(:)h(:)f(:)h(:)32 b Fu(84)399 4095 y(6.3.1)93 |
7795 | b(What)31 b(is)f(an)h(In)m(teractiv)m(e)h(Shell?)25 b | |
7796 | Fn(:)16 b(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7797 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 | |
7798 | b Fu(85)399 4205 y(6.3.2)93 b(Is)30 b(this)g(Shell)g(In)m(teractiv)m | |
7799 | (e?)22 b Fn(:)d(:)c(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
c302751c | 7800 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f CR |
7801 | h(:)35 b Fu(85)399 4315 y(6.3.3)93 b(In)m(teractiv)m(e)33 |
7802 | b(Shell)d(Beha)m(vior)11 b Fn(:)17 b(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7803 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7804 | (:)h(:)f(:)g(:)h(:)f(:)24 b Fu(85)275 4424 y(6.4)92 b(Bash)30 | |
7805 | b(Conditional)h(Expressions)10 b Fn(:)k(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7806 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7807 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)23 b Fu(86)275 4534 y(6.5)92 | |
7808 | b(Shell)30 b(Arithmetic)13 b Fn(:)k(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
c302751c | 7809 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
037a8b7f CR |
7810 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7811 | (:)h(:)26 b Fu(88)275 4643 y(6.6)92 b(Aliases)20 b Fn(:)d(:)e(:)h(:)f | |
7812 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7813 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7814 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)33 | |
7815 | b Fu(89)275 4753 y(6.7)92 b(Arra)m(ys)25 b Fn(:)16 b(:)f(:)h(:)f(:)g(:) | |
7816 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7817 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7818 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)38 | |
7819 | b Fu(90)275 4863 y(6.8)92 b(The)29 b(Directory)j(Stac)m(k)16 | |
7820 | b Fn(:)h(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7821 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7822 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)29 b Fu(91)399 4972 | |
7823 | y(6.8.1)93 b(Directory)32 b(Stac)m(k)f(Builtins)23 b | |
7824 | Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7825 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7826 | 36 b Fu(92)275 5082 y(6.9)92 b(Con)m(trolling)31 b(the)g(Prompt)13 | |
7827 | b Fn(:)h(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7828 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7829 | (:)f(:)g(:)h(:)f(:)h(:)25 b Fu(93)275 5191 y(6.10)92 | |
7830 | b(The)30 b(Restricted)h(Shell)11 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
c302751c | 7831 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
037a8b7f CR |
7832 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)24 |
7833 | b Fu(94)275 5301 y(6.11)92 b(Bash)31 b(POSIX)e(Mo)s(de)17 | |
7834 | b Fn(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7835 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7836 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)30 b Fu(95)p eop end | |
8e1a6eaa | 7837 | %%Page: -3 5 |
6e51e0d0 | 7838 | TeXDict begin -3 4 bop 3674 -116 a Fu(iii)150 83 y Fs(7)135 |
037a8b7f CR |
7839 | b(Job)45 b(Con)l(trol)15 b Fo(:)21 b(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:) |
7840 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h | |
7841 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)28 b Fs(99)275 | |
7842 | 220 y Fu(7.1)92 b(Job)30 b(Con)m(trol)h(Basics)26 b Fn(:)16 | |
7843 | b(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7844 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7845 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)38 b Fu(99)275 330 y(7.2)92 | |
7846 | b(Job)30 b(Con)m(trol)h(Builtins)11 b Fn(:)k(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7847 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
037a8b7f CR |
7848 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)24 |
7849 | b Fu(100)275 439 y(7.3)92 b(Job)30 b(Con)m(trol)h(V)-8 | |
7850 | b(ariables)26 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7851 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7852 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)38 b Fu(102)150 | |
7853 | 690 y Fs(8)135 b(Command)45 b(Line)g(Editing)11 b Fo(:)20 | |
7854 | b(:)g(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f | |
7855 | (:)g(:)h(:)f(:)h(:)k Fs(103)275 827 y Fu(8.1)92 b(In)m(tro)s(duction)30 | |
7856 | b(to)h(Line)f(Editing)12 b Fn(:)k(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7857 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7858 | h(:)f(:)g(:)h(:)f(:)h(:)25 b Fu(103)275 936 y(8.2)92 | |
7859 | b(Readline)31 b(In)m(teraction)14 b Fn(:)j(:)e(:)g(:)h(:)f(:)h(:)f(:)g | |
7860 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7861 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)27 | |
7862 | b Fu(103)399 1046 y(8.2.1)93 b(Readline)31 b(Bare)g(Essen)m(tials)13 | |
7863 | b Fn(:)j(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7864 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)26 | |
967625cd | 7865 | b Fu(104)399 1156 y(8.2.2)93 b(Readline)31 b(Mo)m(v)m(emen)m(t)i |
037a8b7f CR |
7866 | (Commands)13 b Fn(:)i(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7867 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)27 | |
7868 | b Fu(104)399 1265 y(8.2.3)93 b(Readline)31 b(Killing)g(Commands)24 | |
7869 | b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7870 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 | |
7871 | b Fu(105)399 1375 y(8.2.4)93 b(Readline)31 b(Argumen)m(ts)17 | |
7872 | b Fn(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7873 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7874 | (:)f(:)h(:)30 b Fu(105)399 1484 y(8.2.5)93 b(Searc)m(hing)31 | |
7875 | b(for)f(Commands)f(in)h(the)h(History)15 b Fn(:)g(:)h(:)f(:)h(:)f(:)h | |
7876 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)28 b Fu(105)275 | |
7877 | 1594 y(8.3)92 b(Readline)31 b(Init)f(File)8 b Fn(:)17 | |
7878 | b(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7879 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7880 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)22 b Fu(106)399 1704 | |
7881 | y(8.3.1)93 b(Readline)31 b(Init)f(File)i(Syn)m(tax)21 | |
7882 | b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7883 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)34 | |
7884 | b Fu(106)399 1813 y(8.3.2)93 b(Conditional)31 b(Init)f(Constructs)14 | |
7885 | b Fn(:)h(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7886 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)27 | |
7887 | b Fu(114)399 1923 y(8.3.3)93 b(Sample)30 b(Init)g(File)20 | |
7888 | b Fn(:)d(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7889 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7890 | (:)h(:)f(:)g(:)h(:)f(:)h(:)33 b Fu(115)275 2032 y(8.4)92 | |
7891 | b(Bindable)30 b(Readline)h(Commands)19 b Fn(:)c(:)g(:)h(:)f(:)h(:)f(:)g | |
9f178efb | 7892 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f CR |
7893 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)33 b Fu(118)399 2142 y(8.4.1)93 |
7894 | b(Commands)29 b(F)-8 b(or)31 b(Mo)m(ving)16 b Fn(:)h(:)e(:)h(:)f(:)g(:) | |
7895 | h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7896 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)29 b Fu(118)399 | |
7897 | 2252 y(8.4.2)93 b(Commands)29 b(F)-8 b(or)31 b(Manipulating)g(The)f | |
7898 | (History)c Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7899 | f(:)39 b Fu(119)399 2361 y(8.4.3)93 b(Commands)29 b(F)-8 | |
7900 | b(or)31 b(Changing)f(T)-8 b(ext)9 b Fn(:)17 b(:)e(:)h(:)f(:)h(:)f(:)g | |
7901 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) | |
7902 | h(:)f(:)23 b Fu(120)399 2471 y(8.4.4)93 b(Killing)31 | |
7903 | b(And)e(Y)-8 b(anking)10 b Fn(:)17 b(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7904 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
037a8b7f CR |
7905 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)24 b Fu(121)399 |
7906 | 2580 y(8.4.5)93 b(Sp)s(ecifying)30 b(Numeric)g(Argumen)m(ts)25 | |
7907 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7908 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)39 b Fu(123)399 | |
7909 | 2690 y(8.4.6)93 b(Letting)31 b(Readline)g(T)m(yp)s(e)f(F)-8 | |
7910 | b(or)31 b(Y)-8 b(ou)20 b Fn(:)c(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7911 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)33 | |
7912 | b Fu(123)399 2800 y(8.4.7)93 b(Keyb)s(oard)29 b(Macros)9 | |
6e51e0d0 | 7913 | b Fn(:)17 b(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
c302751c | 7914 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
037a8b7f CR |
7915 | h(:)f(:)h(:)f(:)g(:)h(:)22 b Fu(125)399 2909 y(8.4.8)93 |
7916 | b(Some)30 b(Miscellaneous)j(Commands)14 b Fn(:)f(:)j(:)f(:)h(:)f(:)g(:) | |
c302751c | 7917 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
037a8b7f CR |
7918 | (:)f(:)27 b Fu(125)275 3019 y(8.5)92 b(Readline)31 b(vi)f(Mo)s(de)e |
7919 | Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
c302751c | 7920 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
037a8b7f CR |
7921 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)41 b Fu(127)275 |
7922 | 3128 y(8.6)92 b(Programmable)30 b(Completion)25 b Fn(:)15 | |
7923 | b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7924 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)37 | |
7925 | b Fu(128)275 3238 y(8.7)92 b(Programmable)30 b(Completion)h(Builtins)14 | |
7926 | b Fn(:)i(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7927 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)28 b Fu(130)275 | |
7928 | 3347 y(8.8)92 b(A)30 b(Programmable)h(Completion)g(Example)8 | |
7929 | b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7930 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)22 b Fu(133)150 3598 y | |
7931 | Fs(9)135 b(Using)45 b(History)h(In)l(teractiv)l(ely)28 | |
7932 | b Fo(:)22 b(:)d(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7933 | (:)h(:)41 b Fs(136)275 3735 y Fu(9.1)92 b(Bash)30 b(History)h(F)-8 | |
7934 | b(acilities)9 b Fn(:)19 b(:)c(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
c302751c | 7935 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f CR |
7936 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)22 b Fu(136)275 |
7937 | 3845 y(9.2)92 b(Bash)30 b(History)h(Builtins)d Fn(:)16 | |
7938 | b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7939 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7940 | h(:)f(:)h(:)f(:)41 b Fu(136)275 3954 y(9.3)92 b(History)31 | |
7941 | b(Expansion)10 b Fn(:)k(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7942 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7943 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)23 | |
7944 | b Fu(138)399 4064 y(9.3.1)93 b(Ev)m(en)m(t)31 b(Designators)19 | |
7945 | b Fn(:)e(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7946 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7947 | (:)h(:)f(:)g(:)h(:)32 b Fu(139)399 4174 y(9.3.2)93 b(W)-8 | |
7948 | b(ord)31 b(Designators)c Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7949 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7950 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)39 b Fu(139)399 | |
7951 | 4283 y(9.3.3)93 b(Mo)s(di\014ers)15 b Fn(:)g(:)g(:)h(:)f(:)g(:)h(:)f(:) | |
7952 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
c302751c | 7953 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
037a8b7f | 7954 | h(:)f(:)h(:)f(:)g(:)29 b Fu(140)p eop end |
967625cd CR |
7955 | %%Page: -4 6 |
7956 | TeXDict begin -4 5 bop 3677 -116 a Fu(iv)150 83 y Fs(10)135 | |
037a8b7f CR |
7957 | b(Installing)46 b(Bash)16 b Fo(:)j(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7958 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7959 | f(:)h(:)f(:)29 b Fs(141)275 220 y Fu(10.1)92 b(Basic)32 | |
7960 | b(Installation)8 b Fn(:)17 b(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
c302751c | 7961 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
037a8b7f CR |
7962 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)22 |
7963 | b Fu(141)275 330 y(10.2)92 b(Compilers)30 b(and)g(Options)17 | |
7964 | b Fn(:)d(:)i(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7965 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7966 | (:)f(:)h(:)f(:)30 b Fu(142)275 439 y(10.3)92 b(Compiling)30 | |
7967 | b(F)-8 b(or)32 b(Multiple)f(Arc)m(hitectures)10 b Fn(:)16 | |
7968 | b(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7969 | (:)g(:)h(:)f(:)h(:)f(:)23 b Fu(142)275 549 y(10.4)92 | |
7970 | b(Installation)32 b(Names)22 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7971 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7972 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)35 | |
7973 | b Fu(142)275 658 y(10.5)92 b(Sp)s(ecifying)30 b(the)g(System)h(T)m(yp)s | |
7974 | (e)21 b Fn(:)14 b(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
c302751c | 7975 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
037a8b7f CR |
7976 | h(:)34 b Fu(142)275 768 y(10.6)92 b(Sharing)30 b(Defaults)24 |
7977 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
c302751c | 7978 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f CR |
7979 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)37 b Fu(143)275 |
7980 | 878 y(10.7)92 b(Op)s(eration)30 b(Con)m(trols)12 b Fn(:)k(:)f(:)h(:)f | |
c302751c | 7981 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f CR |
7982 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7983 | (:)h(:)f(:)25 b Fu(143)275 987 y(10.8)92 b(Optional)31 | |
7984 | b(F)-8 b(eatures)19 b Fn(:)d(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7985 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7986 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)32 | |
7987 | b Fu(143)150 1238 y Fs(App)t(endix)44 b(A)119 b(Rep)t(orting)46 | |
7988 | b(Bugs)21 b Fo(:)f(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h | |
7989 | (:)f(:)g(:)h(:)f(:)35 b Fs(148)150 1498 y(App)t(endix)44 | |
7990 | b(B)125 b(Ma)7 b(jor)46 b(Di\013erences)g(F)-11 b(rom)284 | |
7991 | 1639 y(The)45 b(Bourne)f(Shell)35 b Fo(:)19 b(:)h(:)f(:)h(:)f(:)h(:)f | |
7992 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:) | |
7993 | f(:)g(:)h(:)f(:)h(:)47 b Fs(149)275 1776 y Fu(B.1)92 | |
7994 | b(Implemen)m(tation)31 b(Di\013erences)h(F)-8 b(rom)31 | |
7995 | b(The)e(SVR4.2)j(Shell)22 b Fn(:)15 b(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7996 | (:)35 b Fu(153)150 2027 y Fs(App)t(endix)44 b(C)124 b(GNU)36 | |
7997 | b(F)-11 b(ree)35 b(Do)t(cumen)l(tation)i(License)25 b | |
7998 | Fo(:)20 b(:)29 b Fs(155)150 2305 y(App)t(endix)44 b(D)118 | |
7999 | b(Indexes)27 b Fo(:)20 b(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
8000 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)40 | |
8001 | b Fs(163)275 2442 y Fu(D.1)92 b(Index)29 b(of)i(Shell)f(Builtin)h | |
8002 | (Commands)23 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
8003 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)38 | |
8004 | b Fu(163)275 2552 y(D.2)92 b(Index)29 b(of)i(Shell)f(Reserv)m(ed)h(W)-8 | |
8005 | b(ords)20 b Fn(:)c(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f | |
8006 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)34 | |
8007 | b Fu(164)275 2661 y(D.3)92 b(P)m(arameter)31 b(and)f(V)-8 | |
8008 | b(ariable)32 b(Index)27 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
8009 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
8010 | h(:)f(:)g(:)42 b Fu(164)275 2771 y(D.4)92 b(F)-8 b(unction)31 | |
8011 | b(Index)24 b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
8012 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
8013 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 | |
8014 | b Fu(167)275 2880 y(D.5)92 b(Concept)30 b(Index)15 b | |
8015 | Fn(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
8016 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
8017 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)29 b | |
8018 | Fu(169)p eop end | |
5e13499c | 8019 | %%Page: 1 7 |
037a8b7f CR |
8020 | TeXDict begin 1 6 bop 3705 -116 a Fu(1)150 299 y Fp(1)80 |
8021 | b(In)l(tro)t(duction)150 604 y Fs(1.1)68 b(What)45 b(is)g(Bash?)150 | |
8022 | 763 y Fu(Bash)38 b(is)g(the)g(shell,)i(or)d(command)h(language)h(in)m | |
6e51e0d0 | 8023 | (terpreter,)h(for)e(the)g Fm(gnu)f Fu(op)s(erating)h(system.)63 |
967625cd | 8024 | b(The)150 873 y(name)33 b(is)g(an)g(acron)m(ym)g(for)g(the)g(`)p |
6e51e0d0 | 8025 | Ft(Bourne-Again)27 b(SHell)p Fu(',)32 b(a)i(pun)d(on)i(Stephen)f |
967625cd | 8026 | (Bourne,)h(the)g(author)150 983 y(of)f(the)f(direct)h(ancestor)h(of)e |
6e51e0d0 | 8027 | (the)h(curren)m(t)f(Unix)g(shell)h Ft(sh)p Fu(,)f(whic)m(h)g(app)s |
967625cd | 8028 | (eared)g(in)g(the)h(Sev)m(en)m(th)g(Edition)150 1092 |
37c41ab1 | 8029 | y(Bell)g(Labs)e(Researc)m(h)h(v)m(ersion)g(of)f(Unix.)275 |
967625cd | 8030 | 1221 y(Bash)f(is)g(largely)i(compatible)f(with)f Ft(sh)g |
6e51e0d0 CR |
8031 | Fu(and)g(incorp)s(orates)g(useful)g(features)g(from)g(the)g(Korn)g |
8032 | (shell)150 1330 y Ft(ksh)37 b Fu(and)h(the)g(C)g(shell)g | |
8033 | Ft(csh)p Fu(.)64 b(It)38 b(is)g(in)m(tended)g(to)h(b)s(e)f(a)g | |
8034 | (conforman)m(t)h(implemen)m(tation)h(of)e(the)g Fm(ieee)150 | |
967625cd | 8035 | 1440 y(posix)c Fu(Shell)g(and)g(T)-8 b(o)s(ols)35 b(p)s(ortion)f(of)g |
6e51e0d0 | 8036 | (the)h Fm(ieee)f(posix)f Fu(sp)s(eci\014cation)j(\()p |
967625cd | 8037 | Fm(ieee)e Fu(Standard)f(1003.1\).)56 b(It)150 1550 y(o\013ers)31 |
6e51e0d0 CR |
8038 | b(functional)f(impro)m(v)m(emen)m(ts)i(o)m(v)m(er)g Ft(sh)d |
8039 | Fu(for)i(b)s(oth)e(in)m(teractiv)m(e)k(and)d(programming)g(use.)275 | |
967625cd | 8040 | 1678 y(While)h(the)g Fm(gnu)f Fu(op)s(erating)h(system)g(pro)m(vides)f |
37c41ab1 | 8041 | (other)h(shells,)g(including)f(a)h(v)m(ersion)g(of)g |
6e51e0d0 CR |
8042 | Ft(csh)p Fu(,)f(Bash)150 1788 y(is)j(the)h(default)f(shell.)49 |
8043 | b(Lik)m(e)34 b(other)g Fm(gnu)f Fu(soft)m(w)m(are,)i(Bash)f(is)f(quite) | |
37c41ab1 | 8044 | h(p)s(ortable.)49 b(It)33 b(curren)m(tly)g(runs)f(on)150 |
967625cd | 8045 | 1897 y(nearly)c(ev)m(ery)g(v)m(ersion)g(of)f(Unix)h(and)e(a)i(few)f |
6e51e0d0 | 8046 | (other)h(op)s(erating)g(systems)f Fq(\000)g Fu(indep)s(enden)m |
967625cd | 8047 | (tly-supp)s(orted)150 2007 y(p)s(orts)j(exist)h(for)f |
6e51e0d0 | 8048 | Fm(ms-dos)p Fu(,)f Fm(os/2)p Fu(,)i(and)f(Windo)m(ws)g(platforms.)150 |
967625cd | 8049 | 2236 y Fs(1.2)68 b(What)45 b(is)g(a)h(shell?)150 2395 |
6e51e0d0 | 8050 | y Fu(A)m(t)32 b(its)f(base,)h(a)f(shell)g(is)h(simply)e(a)h(macro)h |
c302751c | 8051 | (pro)s(cessor)f(that)g(executes)i(commands.)42 b(The)30 |
967625cd | 8052 | b(term)h(macro)150 2505 y(pro)s(cessor)25 b(means)g(functionalit)m(y)i |
c302751c | 8053 | (where)d(text)j(and)d(sym)m(b)s(ols)h(are)h(expanded)e(to)i(create)h |
967625cd | 8054 | (larger)f(expres-)150 2615 y(sions.)275 2743 y(A)34 b(Unix)h(shell)g |
c302751c | 8055 | (is)f(b)s(oth)g(a)h(command)g(in)m(terpreter)g(and)f(a)h(programming)f |
967625cd | 8056 | (language.)55 b(As)35 b(a)g(com-)150 2853 y(mand)30 b(in)m(terpreter,)i |
37c41ab1 | 8057 | (the)g(shell)f(pro)m(vides)g(the)h(user)e(in)m(terface)j(to)f(the)f |
6e51e0d0 | 8058 | (ric)m(h)h(set)g(of)f Fm(gnu)g Fu(utilities.)44 b(The)150 |
967625cd | 8059 | 2962 y(programming)30 b(language)h(features)f(allo)m(w)h(these)g |
d3ad40de | 8060 | (utilities)g(to)g(b)s(e)e(com)m(bined.)41 b(Files)31 |
967625cd | 8061 | b(con)m(taining)g(com-)150 3072 y(mands)e(can)i(b)s(e)e(created,)j(and) |
37c41ab1 | 8062 | d(b)s(ecome)i(commands)f(themselv)m(es.)42 b(These)30 |
967625cd | 8063 | b(new)f(commands)h(ha)m(v)m(e)i(the)150 3182 y(same)j(status)g(as)g |
6e51e0d0 CR |
8064 | (system)g(commands)f(in)g(directories)i(suc)m(h)e(as)h |
8065 | Ft(/bin)p Fu(,)g(allo)m(wing)h(users)e(or)g(groups)g(to)150 | |
967625cd CR |
8066 | 3291 y(establish)d(custom)f(en)m(vironmen)m(ts)h(to)g(automate)h(their) |
8067 | f(common)f(tasks.)275 3420 y(Shells)j(ma)m(y)h(b)s(e)f(used)g(in)m | |
37c41ab1 CR |
8068 | (teractiv)m(ely)k(or)d(non-in)m(teractiv)m(ely)-8 b(.)54 |
8069 | b(In)33 b(in)m(teractiv)m(e)j(mo)s(de,)f(they)e(accept)150 | |
967625cd | 8070 | 3529 y(input)21 b(t)m(yp)s(ed)h(from)g(the)h(k)m(eyb)s(oard.)37 |
37c41ab1 | 8071 | b(When)22 b(executing)i(non-in)m(teractiv)m(ely)-8 b(,)27 |
967625cd CR |
8072 | b(shells)c(execute)g(commands)150 3639 y(read)30 b(from)g(a)h(\014le.) |
8073 | 275 3768 y(A)41 b(shell)g(allo)m(ws)h(execution)h(of)e | |
6e51e0d0 | 8074 | Fm(gnu)g Fu(commands,)i(b)s(oth)e(sync)m(hronously)f(and)h(async)m |
967625cd | 8075 | (hronously)-8 b(.)150 3877 y(The)29 b(shell)g(w)m(aits)i(for)e(sync)m |
d3ad40de | 8076 | (hronous)f(commands)h(to)h(complete)h(b)s(efore)e(accepting)i(more)e |
967625cd | 8077 | (input;)g(asyn-)150 3987 y(c)m(hronous)22 b(commands)h(con)m(tin)m(ue)h |
37c41ab1 | 8078 | (to)f(execute)h(in)e(parallel)i(with)f(the)f(shell)h(while)g(it)g |
967625cd | 8079 | (reads)g(and)f(executes)150 4096 y(additional)35 b(commands.)50 |
6e51e0d0 | 8080 | b(The)33 b Fr(redirection)h Fu(constructs)g(p)s(ermit)f(\014ne-grained) |
967625cd | 8081 | g(con)m(trol)i(of)f(the)g(input)150 4206 y(and)40 b(output)f(of)i |
37c41ab1 CR |
8082 | (those)f(commands.)70 b(Moreo)m(v)m(er,)45 b(the)c(shell)f(allo)m(ws)h |
8083 | (con)m(trol)h(o)m(v)m(er)g(the)e(con)m(ten)m(ts)i(of)150 | |
967625cd | 8084 | 4316 y(commands')30 b(en)m(vironmen)m(ts.)275 4444 y(Shells)k(also)i |
37c41ab1 | 8085 | (pro)m(vide)g(a)f(small)h(set)f(of)g(built-in)g(commands)g(\()p |
6e51e0d0 | 8086 | Fr(builtins)t Fu(\))g(implemen)m(ting)h(function-)150 |
967625cd | 8087 | 4554 y(alit)m(y)i(imp)s(ossible)e(or)g(incon)m(v)m(enien)m(t)j(to)e |
37c41ab1 | 8088 | (obtain)g(via)g(separate)g(utilities.)61 b(F)-8 b(or)37 |
967625cd | 8089 | b(example,)i Ft(cd)p Fu(,)e Ft(break)p Fu(,)150 4663 |
6e51e0d0 | 8090 | y Ft(continue)p Fu(,)28 b(and)i Ft(exec)f Fu(cannot)i(b)s(e)f(implemen) |
74d0116b | 8091 | m(ted)h(outside)g(of)f(the)h(shell)f(b)s(ecause)h(they)f(directly)h |
967625cd | 8092 | (ma-)150 4773 y(nipulate)d(the)g(shell)g(itself.)41 b(The)27 |
6e51e0d0 | 8093 | b Ft(history)p Fu(,)g Ft(getopts)p Fu(,)f Ft(kill)p Fu(,)i(or)g |
967625cd | 8094 | Ft(pwd)f Fu(builtins,)h(among)g(others,)h(could)150 4883 |
74d0116b CR |
8095 | y(b)s(e)34 b(implemen)m(ted)g(in)g(separate)h(utilities,)i(but)d(they)g |
8096 | (are)g(more)h(con)m(v)m(enien)m(t)h(to)f(use)f(as)g(builtin)g(com-)150 | |
967625cd | 8097 | 4992 y(mands.)40 b(All)31 b(of)f(the)h(shell)f(builtins)g(are)h |
74d0116b CR |
8098 | (describ)s(ed)e(in)h(subsequen)m(t)g(sections.)275 5121 |
8099 | y(While)39 b(executing)h(commands)e(is)g(essen)m(tial,)43 | |
c302751c CR |
8100 | b(most)c(of)g(the)g(p)s(o)m(w)m(er)f(\(and)g(complexit)m(y\))j(of)e |
8101 | (shells)150 5230 y(is)34 b(due)f(to)i(their)f(em)m(b)s(edded)f | |
8102 | (programming)h(languages.)52 b(Lik)m(e)35 b(an)m(y)f(high-lev)m(el)i | |
8103 | (language,)h(the)d(shell)150 5340 y(pro)m(vides)c(v)-5 | |
8104 | b(ariables,)32 b(\015o)m(w)e(con)m(trol)i(constructs,)f(quoting,)g(and) | |
8105 | f(functions.)p eop end | |
5e13499c | 8106 | %%Page: 2 8 |
6e51e0d0 | 8107 | TeXDict begin 2 7 bop 150 -116 a Fu(Chapter)30 b(1:)41 |
ad4aef08 CR |
8108 | b(In)m(tro)s(duction)2592 b(2)275 299 y(Shells)21 b(o\013er)i(features) |
8109 | f(geared)h(sp)s(eci\014cally)g(for)f(in)m(teractiv)m(e)j(use)d(rather)g | |
c302751c CR |
8110 | (than)g(to)h(augmen)m(t)g(the)f(pro-)150 408 y(gramming)32 |
8111 | b(language.)48 b(These)32 b(in)m(teractiv)m(e)j(features)d(include)g | |
8112 | (job)g(con)m(trol,)j(command)c(line)i(editing,)150 518 | |
8113 | y(command)d(history)g(and)g(aliases.)42 b(Eac)m(h)31 | |
37c41ab1 CR |
8114 | b(of)g(these)g(features)f(is)h(describ)s(ed)e(in)h(this)g(man)m(ual.)p |
8115 | eop end | |
5e13499c | 8116 | %%Page: 3 9 |
037a8b7f CR |
8117 | TeXDict begin 3 8 bop 3705 -116 a Fu(3)150 299 y Fp(2)80 |
8118 | b(De\014nitions)150 552 y Fu(These)30 b(de\014nitions)g(are)h(used)e | |
8119 | (throughout)h(the)h(remainder)f(of)g(this)h(man)m(ual.)150 | |
8120 | 720 y Ft(POSIX)240 b Fu(A)27 b(family)g(of)g(op)s(en)f(system)g | |
8121 | (standards)g(based)g(on)h(Unix.)39 b(Bash)27 b(is)g(primarily)f | |
8122 | (concerned)630 830 y(with)k(the)h(Shell)f(and)g(Utilities)i(p)s(ortion) | |
8123 | e(of)h(the)f Fm(posix)g Fu(1003.1)j(standard.)150 995 | |
8124 | y Ft(blank)240 b Fu(A)30 b(space)h(or)g(tab)f(c)m(haracter.)150 | |
8125 | 1161 y Ft(builtin)144 b Fu(A)35 b(command)g(that)g(is)g(implemen)m(ted) | |
8126 | g(in)m(ternally)h(b)m(y)f(the)g(shell)g(itself,)i(rather)d(than)h(b)m | |
8127 | (y)630 1271 y(an)30 b(executable)i(program)e(somewhere)h(in)f(the)g | |
8128 | (\014le)h(system.)150 1436 y Ft(control)d(operator)630 | |
8129 | 1546 y Fu(A)20 b Ft(token)f Fu(that)i(p)s(erforms)e(a)i(con)m(trol)g | |
6e51e0d0 CR |
8130 | (function.)37 b(It)21 b(is)f(a)h Ft(newline)d Fu(or)j(one)f(of)h(the)f |
8131 | (follo)m(wing:)630 1655 y(`)p Ft(||)p Fu(',)31 b(`)p | |
8132 | Ft(&&)p Fu(',)f(`)p Ft(&)p Fu(',)h(`)p Ft(;)p Fu(',)g(`)p | |
8133 | Ft(;;)p Fu(',)f(`)p Ft(|)p Fu(',)h(`)p Ft(|&)p Fu(',)f(`)p | |
8134 | Ft(\()p Fu(',)h(or)g(`)p Ft(\))p Fu('.)150 1821 y Ft(exit)e(status)630 | |
8135 | 1931 y Fu(The)f(v)-5 b(alue)29 b(returned)e(b)m(y)h(a)h(command)f(to)h | |
ed35cb4a | 8136 | (its)g(caller.)41 b(The)28 b(v)-5 b(alue)29 b(is)f(restricted)h(to)h |
a9fac3b2 | 8137 | (eigh)m(t)630 2040 y(bits,)h(so)f(the)h(maxim)m(um)f(v)-5 |
6e51e0d0 | 8138 | b(alue)31 b(is)f(255.)150 2206 y Ft(field)240 b Fu(A)27 |
ed35cb4a | 8139 | b(unit)g(of)g(text)h(that)g(is)f(the)g(result)g(of)g(one)h(of)f(the)g |
a9fac3b2 | 8140 | (shell)g(expansions.)40 b(After)27 b(expansion,)630 2315 |
ed35cb4a | 8141 | y(when)e(executing)h(a)g(command,)h(the)f(resulting)f(\014elds)g(are)h |
a9fac3b2 | 8142 | (used)f(as)h(the)g(command)f(name)630 2425 y(and)30 b(argumen)m(ts.)150 |
6e51e0d0 CR |
8143 | 2591 y Ft(filename)96 b Fu(A)30 b(string)h(of)f(c)m(haracters)i(used)e |
8144 | (to)h(iden)m(tify)g(a)f(\014le.)150 2756 y Ft(job)336 | |
8145 | b Fu(A)31 b(set)h(of)f(pro)s(cesses)g(comprising)g(a)g(pip)s(eline,)g | |
ed35cb4a | 8146 | (and)g(an)m(y)g(pro)s(cesses)g(descended)g(from)f(it,)630 |
a9fac3b2 | 8147 | 2866 y(that)h(are)g(all)g(in)f(the)h(same)f(pro)s(cess)g(group.)150 |
6e51e0d0 | 8148 | 3031 y Ft(job)f(control)630 3141 y Fu(A)22 b(mec)m(hanism)g(b)m(y)f |
ed35cb4a | 8149 | (whic)m(h)h(users)f(can)h(selectiv)m(ely)i(stop)e(\(susp)s(end\))e(and) |
a9fac3b2 | 8150 | h(restart)i(\(resume\))630 3251 y(execution)32 b(of)e(pro)s(cesses.)150 |
d7935593 CR |
8151 | 3416 y Ft(metacharacter)630 3526 y Fu(A)23 b(c)m(haracter)h(that,)h |
8152 | (when)d(unquoted,)h(separates)h(w)m(ords.)37 b(A)23 b(metac)m(haracter) | |
8153 | i(is)e(a)g Ft(space)p Fu(,)630 3635 y Ft(tab)p Fu(,)29 | |
8154 | b Ft(newline)p Fu(,)e(or)i(one)h(of)f(the)h(follo)m(wing)g(c)m | |
8155 | (haracters:)42 b(`)p Ft(|)p Fu(',)29 b(`)p Ft(&)p Fu(',)h(`)p | |
8156 | Ft(;)p Fu(',)g(`)p Ft(\()p Fu(',)g(`)p Ft(\))p Fu(',)g(`)p | |
8157 | Ft(<)p Fu(',)f(or)h(`)p Ft(>)p Fu('.)150 3801 y Ft(name)288 | |
8158 | b Fu(A)37 b Ft(word)f Fu(consisting)i(solely)h(of)e(letters,)j(n)m(um)m | |
8159 | (b)s(ers,)e(and)f(underscores,)h(and)f(b)s(eginning)630 | |
8160 | 3910 y(with)23 b(a)g(letter)h(or)f(underscore.)38 b Ft(Name)p | |
8161 | Fu(s)22 b(are)h(used)f(as)i(shell)f(v)-5 b(ariable)24 | |
8162 | b(and)e(function)h(names.)630 4020 y(Also)31 b(referred)f(to)h(as)f(an) | |
8163 | h Ft(identifier)p Fu(.)150 4186 y Ft(operator)96 b Fu(A)38 | |
8164 | b Ft(control)28 b(operator)36 b Fu(or)h(a)i Ft(redirection)27 | |
8165 | b(operator)p Fu(.)61 b(See)38 b(Section)g(3.6)h([Redirec-)630 | |
8166 | 4295 y(tions],)f(page)f(32,)i(for)d(a)g(list)h(of)f(redirection)h(op)s | |
8167 | (erators.)58 b(Op)s(erators)35 b(con)m(tain)j(at)f(least)630 | |
8168 | 4405 y(one)31 b(unquoted)e Ft(metacharacter)p Fu(.)150 | |
8169 | 4570 y Ft(process)f(group)630 4680 y Fu(A)i(collection)k(of)c(related)h | |
8170 | (pro)s(cesses)g(eac)m(h)g(ha)m(ving)g(the)g(same)f(pro)s(cess)g(group)g | |
6e51e0d0 CR |
8171 | Fm(id)p Fu(.)150 4846 y Ft(process)e(group)h(ID)630 4955 |
8172 | y Fu(A)h(unique)g(iden)m(ti\014er)h(that)f(represen)m(ts)h(a)g | |
8173 | Ft(process)d(group)h Fu(during)g(its)i(lifetime.)150 | |
8174 | 5121 y Ft(reserved)d(word)630 5230 y Fu(A)h Ft(word)e | |
8175 | Fu(that)i(has)f(a)h(sp)s(ecial)g(meaning)f(to)h(the)g(shell.)40 | |
ed35cb4a | 8176 | b(Most)30 b(reserv)m(ed)e(w)m(ords)g(in)m(tro)s(duce)630 |
a9fac3b2 | 8177 | 5340 y(shell)j(\015o)m(w)f(con)m(trol)i(constructs,)f(suc)m(h)f(as)g |
6e51e0d0 | 8178 | Ft(for)g Fu(and)g Ft(while)p Fu(.)p eop end |
5e13499c | 8179 | %%Page: 4 10 |
6e51e0d0 CR |
8180 | TeXDict begin 4 9 bop 150 -116 a Fu(Chapter)30 b(2:)41 |
8181 | b(De\014nitions)2662 b(4)150 299 y Ft(return)29 b(status)630 | |
8182 | 408 y Fu(A)h(synon)m(ym)g(for)g Ft(exit)g(status)p Fu(.)150 | |
8183 | 568 y Ft(signal)192 b Fu(A)40 b(mec)m(hanism)h(b)m(y)e(whic)m(h)h(a)h | |
a9fac3b2 CR |
8184 | (pro)s(cess)e(ma)m(y)i(b)s(e)e(noti\014ed)h(b)m(y)g(the)h(k)m(ernel)f |
8185 | (of)g(an)g(ev)m(en)m(t)630 677 y(o)s(ccurring)30 b(in)g(the)h(system.) | |
6e51e0d0 | 8186 | 150 837 y Ft(special)d(builtin)630 946 y Fu(A)j(shell)f(builtin)g |
a9fac3b2 | 8187 | (command)h(that)g(has)f(b)s(een)g(classi\014ed)h(as)g(sp)s(ecial)g(b)m |
6e51e0d0 CR |
8188 | (y)f(the)h Fm(posix)f Fu(stan-)630 1056 y(dard.)150 1215 |
8189 | y Ft(token)240 b Fu(A)38 b(sequence)h(of)f(c)m(haracters)h(considered)f | |
a9fac3b2 | 8190 | (a)h(single)g(unit)e(b)m(y)h(the)h(shell.)64 b(It)38 |
6e51e0d0 CR |
8191 | b(is)g(either)h(a)630 1325 y Ft(word)29 b Fu(or)i(an)f |
8192 | Ft(operator)p Fu(.)150 1484 y Ft(word)288 b Fu(A)28 b(sequence)g(of)g | |
a9fac3b2 CR |
8193 | (c)m(haracters)h(treated)g(as)f(a)g(unit)f(b)m(y)h(the)g(shell.)40 |
8194 | b(W)-8 b(ords)28 b(ma)m(y)g(not)g(include)630 1594 y(unquoted)i | |
6e51e0d0 | 8195 | Ft(metacharacters)p Fu(.)p eop end |
5e13499c | 8196 | %%Page: 5 11 |
037a8b7f CR |
8197 | TeXDict begin 5 10 bop 3705 -116 a Fu(5)150 299 y Fp(3)80 |
8198 | b(Basic)54 b(Shell)e(F)-13 b(eatures)150 601 y Fu(Bash)21 | |
8199 | b(is)g(an)f(acron)m(ym)i(for)e(`)p Ft(Bourne-Again)27 | |
6e51e0d0 | 8200 | b(SHell)p Fu('.)37 b(The)20 b(Bourne)g(shell)h(is)g(the)g(traditional)h |
967625cd | 8201 | (Unix)f(shell)150 710 y(originally)h(written)f(b)m(y)f(Stephen)g |
c302751c | 8202 | (Bourne.)38 b(All)21 b(of)g(the)g(Bourne)f(shell)h(builtin)f(commands)g |
967625cd | 8203 | (are)i(a)m(v)-5 b(ailable)150 820 y(in)26 b(Bash,)h(The)f(rules)f(for)h |
c302751c | 8204 | (ev)-5 b(aluation)28 b(and)d(quoting)h(are)h(tak)m(en)g(from)f(the)g |
967625cd CR |
8205 | Fm(posix)f Fu(sp)s(eci\014cation)i(for)f(the)150 929 |
8206 | y(`standard')k(Unix)g(shell.)275 1086 y(This)h(c)m(hapter)i(brie\015y)e | |
c302751c | 8207 | (summarizes)h(the)h(shell's)f(`building)g(blo)s(c)m(ks':)45 |
967625cd | 8208 | b(commands,)32 b(con)m(trol)i(struc-)150 1196 y(tures,)k(shell)e |
6e51e0d0 CR |
8209 | (functions,)h(shell)g Fl(p)-5 b(ar)g(ameters)p Fu(,)41 |
8210 | b(shell)36 b(expansions,)i Fl(r)-5 b(e)g(dir)g(e)g(ctions)p | |
967625cd | 8211 | Fu(,)40 b(whic)m(h)c(are)h(a)f(w)m(a)m(y)h(to)150 1306 |
c302751c CR |
8212 | y(direct)31 b(input)e(and)h(output)g(from)g(and)g(to)h(named)f |
8213 | (\014les,)g(and)g(ho)m(w)g(the)h(shell)g(executes)g(commands.)150 | |
967625cd | 8214 | 1580 y Fs(3.1)68 b(Shell)45 b(Syn)l(tax)150 1740 y Fu(When)40 |
c302751c CR |
8215 | b(the)h(shell)g(reads)f(input,)i(it)f(pro)s(ceeds)f(through)g(a)h |
8216 | (sequence)g(of)g(op)s(erations.)71 b(If)40 b(the)h(input)150 | |
967625cd | 8217 | 1849 y(indicates)31 b(the)f(b)s(eginning)f(of)h(a)g(commen)m(t,)h(the)f |
c302751c | 8218 | (shell)g(ignores)g(the)g(commen)m(t)h(sym)m(b)s(ol)f(\(`)p |
967625cd CR |
8219 | Ft(#)p Fu('\),)h(and)e(the)150 1959 y(rest)i(of)f(that)h(line.)275 |
8220 | 2116 y(Otherwise,)h(roughly)f(sp)s(eaking,)i(the)f(shell)g(reads)g(its) | |
c302751c | 8221 | g(input)f(and)h(divides)f(the)i(input)e(in)m(to)h(w)m(ords)150 |
967625cd | 8222 | 2225 y(and)23 b(op)s(erators,)j(emplo)m(ying)e(the)g(quoting)h(rules)e |
37c41ab1 | 8223 | (to)h(select)i(whic)m(h)d(meanings)h(to)h(assign)f(v)-5 |
967625cd CR |
8224 | b(arious)23 b(w)m(ords)150 2335 y(and)30 b(c)m(haracters.)275 |
8225 | 2492 y(The)38 b(shell)h(then)f(parses)g(these)h(tok)m(ens)h(in)m(to)f | |
37c41ab1 | 8226 | (commands)g(and)f(other)h(constructs,)i(remo)m(v)m(es)f(the)150 |
967625cd | 8227 | 2602 y(sp)s(ecial)31 b(meaning)f(of)g(certain)h(w)m(ords)f(or)g(c)m |
37c41ab1 | 8228 | (haracters,)i(expands)d(others,)h(redirects)h(input)e(and)g(output)150 |
967625cd | 8229 | 2711 y(as)d(needed,)g(executes)g(the)g(sp)s(eci\014ed)e(command,)j(w)m |
37c41ab1 | 8230 | (aits)f(for)f(the)g(command's)g(exit)i(status,)f(and)f(mak)m(es)150 |
967625cd | 8231 | 2821 y(that)31 b(exit)g(status)g(a)m(v)-5 b(ailable)33 |
37c41ab1 | 8232 | b(for)d(further)f(insp)s(ection)h(or)h(pro)s(cessing.)150 |
967625cd | 8233 | 3043 y Fk(3.1.1)63 b(Shell)41 b(Op)s(eration)150 3190 |
6e51e0d0 | 8234 | y Fu(The)c(follo)m(wing)h(is)f(a)h(brief)e(description)i(of)f(the)g |
c302751c | 8235 | (shell's)h(op)s(eration)f(when)f(it)i(reads)f(and)f(executes)j(a)150 |
967625cd CR |
8236 | 3299 y(command.)h(Basically)-8 b(,)34 b(the)c(shell)h(do)s(es)f(the)h |
8237 | (follo)m(wing:)199 3456 y(1.)61 b(Reads)42 b(its)h(input)e(from)h(a)g | |
8a0829e9 | 8238 | (\014le)h(\(see)g(Section)g(3.8)g([Shell)f(Scripts],)j(page)e(40\),)k |
967625cd | 8239 | (from)41 b(a)i(string)330 3566 y(supplied)30 b(as)h(an)g(argumen)m(t)h |
6e51e0d0 | 8240 | (to)g(the)f Ft(-c)g Fu(in)m(v)m(o)s(cation)i(option)f(\(see)g(Section)g |
967625cd CR |
8241 | (6.1)g([In)m(v)m(oking)g(Bash],)330 3675 y(page)f(81\),)h(or)e(from)g |
8242 | (the)h(user's)f(terminal.)199 3821 y(2.)61 b(Breaks)43 | |
37c41ab1 | 8243 | b(the)g(input)f(in)m(to)h(w)m(ords)f(and)g(op)s(erators,)k(ob)s(eying)d |
967625cd | 8244 | (the)g(quoting)g(rules)f(describ)s(ed)f(in)330 3931 y(Section)27 |
37c41ab1 | 8245 | b(3.1.2)i([Quoting],)f(page)f(6.)40 b(These)26 b(tok)m(ens)i(are)f |
6e51e0d0 | 8246 | (separated)g(b)m(y)f Ft(metacharacters)p Fu(.)36 b(Alias)330 |
967625cd CR |
8247 | 4040 y(expansion)30 b(is)h(p)s(erformed)d(b)m(y)j(this)f(step)g(\(see)i |
8248 | (Section)f(6.6)g([Aliases],)i(page)e(89\).)199 4186 y(3.)61 | |
37c41ab1 CR |
8249 | b(P)m(arses)35 b(the)g(tok)m(ens)g(in)m(to)h(simple)e(and)g(comp)s |
8250 | (ound)f(commands)h(\(see)h(Section)h(3.2)f([Shell)g(Com-)330 | |
967625cd | 8251 | 4296 y(mands],)30 b(page)h(8\).)199 4442 y(4.)61 b(P)m(erforms)40 |
37c41ab1 | 8252 | b(the)h(v)-5 b(arious)40 b(shell)h(expansions)f(\(see)h(Section)g(3.5)g |
967625cd | 8253 | ([Shell)g(Expansions],)h(page)f(21\),)330 4551 y(breaking)35 |
37c41ab1 | 8254 | b(the)g(expanded)g(tok)m(ens)h(in)m(to)g(lists)f(of)g(\014lenames)h |
967625cd | 8255 | (\(see)g(Section)f(3.5.8)i([Filename)g(Ex-)330 4661 y(pansion],)30 |
595e3e69 | 8256 | b(page)h(30\))h(and)e(commands)g(and)g(argumen)m(ts.)199 |
967625cd | 8257 | 4807 y(5.)61 b(P)m(erforms)36 b(an)m(y)i(necessary)f(redirections)g |
fc527055 | 8258 | (\(see)h(Section)f(3.6)h([Redirections],)i(page)e(32\))g(and)e(re-)330 |
967625cd | 8259 | 4916 y(mo)m(v)m(es)c(the)e(redirection)h(op)s(erators)g(and)f(their)g |
c302751c | 8260 | (op)s(erands)f(from)h(the)h(argumen)m(t)f(list.)199 5062 |
37c41ab1 | 8261 | y(6.)61 b(Executes)31 b(the)g(command)f(\(see)h(Section)g(3.7)h |
8a0829e9 | 8262 | ([Executing)f(Commands],)f(page)h(36\).)199 5208 y(7.)61 |
37c41ab1 CR |
8263 | b(Optionally)40 b(w)m(aits)g(for)f(the)g(command)g(to)h(complete)g(and) |
8264 | f(collects)i(its)f(exit)g(status)f(\(see)h(Sec-)330 5317 | |
8a0829e9 | 8265 | y(tion)31 b(3.7.5)h([Exit)f(Status],)g(page)g(39\).)p |
37c41ab1 | 8266 | eop end |
5e13499c | 8267 | %%Page: 6 12 |
6e51e0d0 | 8268 | TeXDict begin 6 11 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
ad4aef08 | 8269 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(6)150 299 |
6e51e0d0 | 8270 | y Fk(3.1.2)63 b(Quoting)150 446 y Fu(Quoting)32 b(is)h(used)e(to)i |
ad4aef08 CR |
8271 | (remo)m(v)m(e)h(the)e(sp)s(ecial)h(meaning)f(of)h(certain)g(c)m |
8272 | (haracters)g(or)f(w)m(ords)g(to)h(the)f(shell.)150 555 | |
8273 | y(Quoting)c(can)f(b)s(e)g(used)f(to)j(disable)e(sp)s(ecial)h(treatmen)m | |
8274 | (t)h(for)e(sp)s(ecial)h(c)m(haracters,)i(to)e(prev)m(en)m(t)g(reserv)m | |
8275 | (ed)150 665 y(w)m(ords)i(from)g(b)s(eing)g(recognized)h(as)g(suc)m(h,)f | |
8276 | (and)g(to)h(prev)m(en)m(t)g(parameter)g(expansion.)275 | |
967625cd | 8277 | 795 y(Eac)m(h)22 b(of)g(the)g(shell)g(metac)m(haracters)i(\(see)f |
ad4aef08 | 8278 | (Chapter)e(2)i([De\014nitions],)h(page)f(3\))g(has)e(sp)s(ecial)i |
967625cd | 8279 | (meaning)150 905 y(to)40 b(the)g(shell)f(and)g(m)m(ust)g(b)s(e)g |
ad4aef08 | 8280 | (quoted)g(if)h(it)g(is)f(to)h(represen)m(t)g(itself.)68 |
967625cd | 8281 | b(When)39 b(the)h(command)f(history)150 1015 y(expansion)i(facilities)j |
01ed5ba4 | 8282 | (are)e(b)s(eing)f(used)g(\(see)h(Section)h(9.3)f([History)h(In)m |
967625cd | 8283 | (teraction],)j(page)c(138\),)47 b(the)150 1124 y Fr(history)30 |
6e51e0d0 CR |
8284 | b(expansion)h Fu(c)m(haracter,)h(usually)f(`)p Ft(!)p |
8285 | Fu(',)g(m)m(ust)f(b)s(e)g(quoted)h(to)g(prev)m(en)m(t)g(history)g | |
967625cd | 8286 | (expansion.)41 b(See)150 1234 y(Section)22 b(9.1)g([Bash)f(History)h(F) |
900a813b | 8287 | -8 b(acilities],)26 b(page)c(136,)j(for)20 b(more)h(details)h |
967625cd | 8288 | (concerning)g(history)f(expansion.)275 1364 y(There)37 |
6e51e0d0 CR |
8289 | b(are)h(three)f(quoting)h(mec)m(hanisms:)56 b(the)38 |
8290 | b Fr(escap)s(e)g(c)m(haracter)p Fu(,)j(single)d(quotes,)i(and)d(double) | |
967625cd CR |
8291 | 150 1474 y(quotes.)150 1665 y Fk(3.1.2.1)63 b(Escap)s(e)41 |
8292 | b(Character)150 1812 y Fu(A)36 b(non-quoted)f(bac)m(kslash)h(`)p | |
6e51e0d0 | 8293 | Ft(\\)p Fu(')g(is)f(the)h(Bash)g(escap)s(e)f(c)m(haracter.)58 |
c302751c | 8294 | b(It)36 b(preserv)m(es)f(the)h(literal)h(v)-5 b(alue)36 |
967625cd | 8295 | b(of)150 1921 y(the)27 b(next)g(c)m(haracter)h(that)f(follo)m(ws,)i |
6e51e0d0 | 8296 | (with)d(the)h(exception)g(of)g Ft(newline)p Fu(.)38 b(If)26 |
967625cd | 8297 | b(a)h Ft(\\newline)d Fu(pair)i(app)s(ears,)150 2031 y(and)k(the)h(bac)m |
6e51e0d0 CR |
8298 | (kslash)g(itself)g(is)g(not)g(quoted,)g(the)f Ft(\\newline)f |
8299 | Fu(is)h(treated)i(as)f(a)g(line)g(con)m(tin)m(uation)h(\(that)150 | |
967625cd CR |
8300 | 2140 y(is,)f(it)g(is)f(remo)m(v)m(ed)h(from)f(the)h(input)e(stream)i |
8301 | (and)f(e\013ectiv)m(ely)j(ignored\).)150 2331 y Fk(3.1.2.2)63 | |
8302 | b(Single)42 b(Quotes)150 2478 y Fu(Enclosing)24 b(c)m(haracters)h(in)e | |
6e51e0d0 | 8303 | (single)h(quotes)g(\(`)p Ft(')p Fu('\))g(preserv)m(es)g(the)f(literal)i |
c302751c | 8304 | (v)-5 b(alue)24 b(of)g(eac)m(h)g(c)m(haracter)h(within)150 |
967625cd | 8305 | 2588 y(the)31 b(quotes.)42 b(A)31 b(single)h(quote)f(ma)m(y)g(not)g(o)s |
c302751c | 8306 | (ccur)g(b)s(et)m(w)m(een)g(single)h(quotes,)f(ev)m(en)h(when)d |
967625cd CR |
8307 | (preceded)i(b)m(y)g(a)150 2697 y(bac)m(kslash.)150 2888 |
8308 | y Fk(3.1.2.3)63 b(Double)42 b(Quotes)150 3035 y Fu(Enclosing)24 | |
6e51e0d0 CR |
8309 | b(c)m(haracters)h(in)f(double)f(quotes)h(\(`)p Ft(")p |
8310 | Fu('\))g(preserv)m(es)g(the)g(literal)h(v)-5 b(alue)24 | |
967625cd | 8311 | b(of)g(all)g(c)m(haracters)h(within)150 3145 y(the)34 |
6e51e0d0 CR |
8312 | b(quotes,)h(with)f(the)g(exception)h(of)f(`)p Ft($)p |
8313 | Fu(',)h(`)p Ft(`)p Fu(',)g(`)p Ft(\\)p Fu(',)g(and,)f(when)f(history)g | |
967625cd CR |
8314 | (expansion)h(is)g(enabled,)h(`)p Ft(!)p Fu('.)150 3254 |
8315 | y(When)e(the)h(shell)g(is)g(in)f Fm(posix)g Fu(mo)s(de)g(\(see)i | |
8316 | (Section)f(6.11)i([Bash)e(POSIX)e(Mo)s(de],)k(page)e(95\),)i(the)e(`)p | |
8317 | Ft(!)p Fu(')150 3364 y(has)28 b(no)g(sp)s(ecial)h(meaning)g(within)f | |
8318 | (double)g(quotes,)h(ev)m(en)g(when)f(history)g(expansion)g(is)g | |
8319 | (enabled.)40 b(The)150 3474 y(c)m(haracters)h(`)p Ft($)p | |
8320 | Fu(')e(and)g(`)p Ft(`)p Fu(')g(retain)h(their)f(sp)s(ecial)h(meaning)f | |
8321 | (within)g(double)g(quotes)h(\(see)g(Section)g(3.5)150 | |
8322 | 3583 y([Shell)29 b(Expansions],)g(page)h(21\).)41 b(The)28 | |
8323 | b(bac)m(kslash)i(retains)f(its)h(sp)s(ecial)f(meaning)g(only)g(when)f | |
8324 | (follo)m(w)m(ed)150 3693 y(b)m(y)41 b(one)f(of)h(the)g(follo)m(wing)h | |
8325 | (c)m(haracters:)63 b(`)p Ft($)p Fu(',)43 b(`)p Ft(`)p | |
8326 | Fu(',)h(`)p Ft(")p Fu(',)g(`)p Ft(\\)p Fu(',)f(or)e Ft(newline)p | |
8327 | Fu(.)69 b(Within)41 b(double)f(quotes,)150 3802 y(bac)m(kslashes)25 | |
8328 | b(that)h(are)f(follo)m(w)m(ed)h(b)m(y)e(one)h(of)g(these)g(c)m | |
8329 | (haracters)h(are)f(remo)m(v)m(ed.)40 b(Bac)m(kslashes)26 | |
8330 | b(preceding)150 3912 y(c)m(haracters)35 b(without)e(a)h(sp)s(ecial)f | |
8331 | (meaning)h(are)f(left)h(unmo)s(di\014ed.)47 b(A)34 b(double)f(quote)g | |
8332 | (ma)m(y)h(b)s(e)f(quoted)150 4022 y(within)h(double)h(quotes)g(b)m(y)g | |
8333 | (preceding)g(it)g(with)g(a)g(bac)m(kslash.)55 b(If)35 | |
8334 | b(enabled,)h(history)f(expansion)g(will)150 4131 y(b)s(e)f(p)s | |
8335 | (erformed)g(unless)g(an)h(`)p Ft(!)p Fu(')g(app)s(earing)f(in)h(double) | |
8336 | f(quotes)i(is)f(escap)s(ed)g(using)f(a)h(bac)m(kslash.)55 | |
8337 | b(The)150 4241 y(bac)m(kslash)31 b(preceding)f(the)h(`)p | |
8338 | Ft(!)p Fu(')f(is)h(not)g(remo)m(v)m(ed.)275 4371 y(The)41 | |
8339 | b(sp)s(ecial)h(parameters)f(`)p Ft(*)p Fu(')h(and)f(`)p | |
8340 | Ft(@)p Fu(')h(ha)m(v)m(e)g(sp)s(ecial)g(meaning)g(when)f(in)g(double)g | |
8341 | (quotes)h(\(see)150 4481 y(Section)31 b(3.5.3)h([Shell)f(P)m(arameter)h | |
8342 | (Expansion],)e(page)h(23\).)150 4672 y Fk(3.1.2.4)63 | |
8343 | b(ANSI-C)40 b(Quoting)150 4819 y Fu(W)-8 b(ords)43 b(of)f(the)h(form)f | |
8344 | Ft($')p Fj(string)p Ft(')e Fu(are)j(treated)g(sp)s(ecially)-8 | |
8345 | b(.)79 b(The)42 b(w)m(ord)g(expands)f(to)j Fr(string)p | |
8346 | Fu(,)h(with)150 4928 y(bac)m(kslash-escap)s(ed)f(c)m(haracters)h | |
8347 | (replaced)f(as)g(sp)s(eci\014ed)f(b)m(y)g(the)g(ANSI)g(C)g(standard.)79 | |
8348 | b(Bac)m(kslash)150 5038 y(escap)s(e)31 b(sequences,)g(if)f(presen)m(t,) | |
8349 | h(are)g(deco)s(ded)f(as)g(follo)m(ws:)150 5189 y Ft(\\a)384 | |
8350 | b Fu(alert)31 b(\(b)s(ell\))150 5340 y Ft(\\b)384 b Fu(bac)m(kspace)p | |
8351 | eop end | |
5e13499c | 8352 | %%Page: 7 13 |
6e51e0d0 | 8353 | TeXDict begin 7 12 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
37c41ab1 | 8354 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(7)150 299 |
967625cd CR |
8355 | y Ft(\\e)150 408 y(\\E)384 b Fu(an)30 b(escap)s(e)h(c)m(haracter)h |
8356 | (\(not)f(ANSI)f(C\))150 572 y Ft(\\f)384 b Fu(form)30 | |
8357 | b(feed)150 735 y Ft(\\n)384 b Fu(newline)150 898 y Ft(\\r)g | |
8358 | Fu(carriage)32 b(return)150 1061 y Ft(\\t)384 b Fu(horizon)m(tal)32 | |
8359 | b(tab)150 1224 y Ft(\\v)384 b Fu(v)m(ertical)32 b(tab)150 | |
8360 | 1387 y Ft(\\\\)384 b Fu(bac)m(kslash)150 1551 y Ft(\\')g | |
8361 | Fu(single)31 b(quote)150 1714 y Ft(\\")384 b Fu(double)30 | |
8362 | b(quote)150 1877 y Ft(\\?)384 b Fu(question)31 b(mark)150 | |
8363 | 2040 y Ft(\\)p Fj(nnn)288 b Fu(the)31 b(eigh)m(t-bit)h(c)m(haracter)g | |
8364 | (whose)e(v)-5 b(alue)31 b(is)f(the)h(o)s(ctal)g(v)-5 | |
8365 | b(alue)31 b Fr(nnn)e Fu(\(one)i(to)g(three)g(digits\))150 | |
8366 | 2203 y Ft(\\x)p Fj(HH)288 b Fu(the)36 b(eigh)m(t-bit)i(c)m(haracter)f | |
8367 | (whose)f(v)-5 b(alue)36 b(is)g(the)g(hexadecimal)h(v)-5 | |
8368 | b(alue)36 b Fr(HH)46 b Fu(\(one)37 b(or)f(t)m(w)m(o)630 | |
8369 | 2313 y(hex)30 b(digits\))150 2476 y Ft(\\u)p Fj(HHHH)192 | |
8370 | b Fu(the)33 b(Unico)s(de)f(\(ISO/IEC)g(10646\))j(c)m(haracter)f(whose)e | |
8371 | (v)-5 b(alue)33 b(is)g(the)g(hexadecimal)g(v)-5 b(alue)630 | |
8372 | 2586 y Fr(HHHH)41 b Fu(\(one)31 b(to)g(four)f(hex)g(digits\))150 | |
8373 | 2749 y Ft(\\U)p Fj(HHHHHHHH)630 2858 y Fu(the)j(Unico)s(de)f(\(ISO/IEC) | |
220537f2 | 8374 | g(10646\))j(c)m(haracter)f(whose)e(v)-5 b(alue)33 b(is)g(the)g |
967625cd CR |
8375 | (hexadecimal)g(v)-5 b(alue)630 2968 y Fr(HHHHHHHH)42 |
8376 | b Fu(\(one)31 b(to)g(eigh)m(t)g(hex)g(digits\))150 3131 | |
6e51e0d0 | 8377 | y Ft(\\c)p Fj(x)336 b Fu(a)31 b(con)m(trol-)p Fr(x)38 |
967625cd | 8378 | b Fu(c)m(haracter)150 3296 y(The)30 b(expanded)f(result)i(is)f |
984a1947 | 8379 | (single-quoted,)i(as)f(if)f(the)g(dollar)h(sign)g(had)e(not)i(b)s(een)f |
967625cd CR |
8380 | (presen)m(t.)150 3499 y Fk(3.1.2.5)63 b(Lo)s(cale-Sp)s(eci\014c)41 |
8381 | b(T)-10 b(ranslation)150 3646 y Fu(A)28 b(double-quoted)g(string)f | |
6e51e0d0 CR |
8382 | (preceded)h(b)m(y)f(a)h(dollar)h(sign)e(\(`)p Ft($)p |
8383 | Fu('\))i(will)f(cause)g(the)g(string)g(to)g(b)s(e)f(translated)150 | |
967625cd | 8384 | 3756 y(according)f(to)f(the)g(curren)m(t)g(lo)s(cale.)41 |
6e51e0d0 CR |
8385 | b(If)24 b(the)h(curren)m(t)g(lo)s(cale)h(is)f Ft(C)g |
8386 | Fu(or)g Ft(POSIX)p Fu(,)f(the)h(dollar)h(sign)f(is)g(ignored.)150 | |
967625cd CR |
8387 | 3865 y(If)30 b(the)g(string)h(is)f(translated)h(and)f(replaced,)h(the)g |
8388 | (replacemen)m(t)h(is)e(double-quoted.)275 4004 y(Some)20 | |
984a1947 | 8389 | b(systems)h(use)f(the)h(message)h(catalog)h(selected)f(b)m(y)f(the)g |
6e51e0d0 | 8390 | Ft(LC_MESSAGES)c Fu(shell)k(v)-5 b(ariable.)39 b(Others)150 |
967625cd | 8391 | 4113 y(create)g(the)e(name)g(of)g(the)g(message)h(catalog)i(from)d(the) |
6e51e0d0 | 8392 | g(v)-5 b(alue)37 b(of)g(the)h Ft(TEXTDOMAIN)c Fu(shell)j(v)-5 |
967625cd | 8393 | b(ariable,)150 4223 y(p)s(ossibly)31 b(adding)g(a)g(su\016x)g(of)h(`)p |
6e51e0d0 CR |
8394 | Ft(.mo)p Fu('.)43 b(If)31 b(y)m(ou)h(use)f(the)h Ft(TEXTDOMAIN)c |
8395 | Fu(v)-5 b(ariable,)33 b(y)m(ou)f(ma)m(y)g(need)f(to)h(set)150 | |
967625cd | 8396 | 4332 y(the)22 b Ft(TEXTDOMAINDIR)d Fu(v)-5 b(ariable)23 |
984a1947 | 8397 | b(to)g(the)f(lo)s(cation)i(of)e(the)h(message)g(catalog)i(\014les.)38 |
967625cd | 8398 | b(Still)23 b(others)f(use)g(b)s(oth)150 4442 y(v)-5 b(ariables)31 |
6e51e0d0 | 8399 | b(in)f(this)g(fashion:)41 b Ft(TEXTDOMAINDIR)p Fu(/)p |
967625cd | 8400 | Ft(LC_MESSAGES)p Fu(/LC)p 2528 4442 28 4 v 34 w(MESSA)m(GES/)p |
6e51e0d0 CR |
8401 | Ft(TEXTDOMAIN)p Fu(.mo.)150 4645 y Fk(3.1.3)63 b(Commen)m(ts)150 |
8402 | 4792 y Fu(In)21 b(a)i(non-in)m(teractiv)m(e)h(shell,)g(or)e(an)g(in)m | |
8403 | (teractiv)m(e)j(shell)d(in)g(whic)m(h)g(the)g Ft(interactive_comments) | |
8404 | 16 b Fu(option)150 4902 y(to)40 b(the)f Ft(shopt)e Fu(builtin)h(is)h | |
c302751c | 8405 | (enabled)g(\(see)h(Section)g(4.3.2)g([The)f(Shopt)f(Builtin],)k(page)e |
fc527055 | 8406 | (63\),)i(a)d(w)m(ord)150 5011 y(b)s(eginning)26 b(with)g(`)p |
6e51e0d0 | 8407 | Ft(#)p Fu(')g(causes)h(that)f(w)m(ord)g(and)g(all)h(remaining)g(c)m |
c302751c | 8408 | (haracters)g(on)f(that)h(line)g(to)g(b)s(e)f(ignored.)150 |
220537f2 | 8409 | 5121 y(An)43 b(in)m(teractiv)m(e)j(shell)e(without)f(the)g |
6e51e0d0 CR |
8410 | Ft(interactive_comments)38 b Fu(option)44 b(enabled)f(do)s(es)g(not)g |
8411 | (allo)m(w)150 5230 y(commen)m(ts.)56 b(The)34 b Ft | |
8412 | (interactive_comments)c Fu(option)35 b(is)g(on)g(b)m(y)g(default)g(in)g | |
220537f2 | 8413 | (in)m(teractiv)m(e)j(shells.)55 b(See)150 5340 y(Section)30 |
900a813b | 8414 | b(6.3)f([In)m(teractiv)m(e)j(Shells],)d(page)h(84,)g(for)e(a)i |
220537f2 CR |
8415 | (description)e(of)h(what)g(mak)m(es)h(a)f(shell)g(in)m(teractiv)m(e.)p |
8416 | eop end | |
c302751c | 8417 | %%Page: 8 14 |
6e51e0d0 | 8418 | TeXDict begin 8 13 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
ad4aef08 | 8419 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(8)150 299 |
6e51e0d0 CR |
8420 | y Fs(3.2)68 b(Shell)45 b(Commands)150 458 y Fu(A)d(simple)g(shell)g |
8421 | (command)f(suc)m(h)h(as)g Ft(echo)29 b(a)h(b)g(c)41 b | |
8422 | Fu(consists)i(of)f(the)f(command)h(itself)h(follo)m(w)m(ed)g(b)m(y)150 | |
ad4aef08 | 8423 | 568 y(argumen)m(ts,)31 b(separated)g(b)m(y)f(spaces.)275 |
1101193a CR |
8424 | 704 y(More)h(complex)h(shell)f(commands)g(are)g(comp)s(osed)g(of)g |
8425 | (simple)g(commands)g(arranged)g(together)h(in)150 814 | |
ad4aef08 | 8426 | y(a)f(v)-5 b(ariet)m(y)32 b(of)f(w)m(a)m(ys:)41 b(in)31 |
220537f2 | 8427 | b(a)g(pip)s(eline)f(in)g(whic)m(h)g(the)h(output)f(of)h(one)f(command)h |
1101193a | 8428 | (b)s(ecomes)f(the)h(input)f(of)150 923 y(a)h(second,)f(in)h(a)f(lo)s |
220537f2 | 8429 | (op)h(or)f(conditional)i(construct,)f(or)f(in)g(some)h(other)g |
6e51e0d0 CR |
8430 | (grouping.)150 1124 y Fk(3.2.1)63 b(Simple)41 b(Commands)150 |
8431 | 1271 y Fu(A)29 b(simple)f(command)g(is)h(the)g(kind)e(of)i(command)f | |
220537f2 | 8432 | (encoun)m(tered)h(most)g(often.)40 b(It's)29 b(just)f(a)h(sequence)g |
6e51e0d0 CR |
8433 | (of)150 1381 y(w)m(ords)22 b(separated)i(b)m(y)e Ft(blank)p |
8434 | Fu(s,)i(terminated)f(b)m(y)g(one)g(of)g(the)g(shell's)g(con)m(trol)h | |
1101193a | 8435 | (op)s(erators)f(\(see)h(Chapter)f(2)150 1491 y([De\014nitions],)37 |
220537f2 | 8436 | b(page)e(3\).)54 b(The)35 b(\014rst)e(w)m(ord)i(generally)g(sp)s |
c302751c | 8437 | (eci\014es)g(a)g(command)f(to)h(b)s(e)f(executed,)j(with)150 |
1101193a CR |
8438 | 1600 y(the)31 b(rest)f(of)h(the)f(w)m(ords)g(b)s(eing)g(that)h |
8439 | (command's)f(argumen)m(ts.)275 1736 y(The)h(return)h(status)g(\(see)i | |
8a0829e9 | 8440 | (Section)f(3.7.5)h([Exit)f(Status],)h(page)f(39\))g(of)g(a)g(simple)f |
1101193a | 8441 | (command)g(is)h(its)150 1846 y(exit)38 b(status)f(as)g(pro)m(vided)f(b) |
6e51e0d0 CR |
8442 | m(y)h(the)g Fm(posix)f Fu(1003.1)j Ft(waitpid)c Fu(function,)j(or)f |
8443 | (128)p Ft(+)p Fr(n)g Fu(if)g(the)g(command)150 1956 y(w)m(as)31 | |
8444 | b(terminated)g(b)m(y)f(signal)h Fr(n)p Fu(.)150 2157 | |
fc527055 CR |
8445 | y Fk(3.2.2)63 b(Pip)s(elines)150 2304 y Fu(A)21 b Ft(pipeline)d |
8446 | Fu(is)j(a)g(sequence)g(of)g(one)g(or)g(more)g(commands)f(separated)h(b) | |
8447 | m(y)g(one)g(of)g(the)g(con)m(trol)h(op)s(erators)150 | |
8448 | 2413 y(`)p Ft(|)p Fu(')31 b(or)f(`)p Ft(|&)p Fu('.)275 | |
8449 | 2550 y(The)f(format)i(for)f(a)h(pip)s(eline)f(is)390 | |
8450 | 2686 y Ft([time)46 b([-p]])h([!])g Fj(command1)e Ft([)j(|)f(or)g(|&)g | |
6e51e0d0 CR |
8451 | Fj(command2)f Ft(])h(...)150 2822 y Fu(The)25 b(output)f(of)i(eac)m(h)g |
8452 | (command)f(in)f(the)i(pip)s(eline)e(is)i(connected)g(via)f(a)h(pip)s(e) | |
8453 | e(to)i(the)f(input)f(of)h(the)h(next)150 2932 y(command.)40 | |
8454 | b(That)29 b(is,)h(eac)m(h)h(command)e(reads)g(the)h(previous)f | |
8455 | (command's)g(output.)40 b(This)29 b(connection)150 3041 | |
8456 | y(is)h(p)s(erformed)f(b)s(efore)h(an)m(y)h(redirections)g(sp)s | |
8457 | (eci\014ed)f(b)m(y)g(the)g(command.)275 3178 y(If)k(`)p | |
8458 | Ft(|&)p Fu(')h(is)f(used,)i Fr(command1)7 b Fu('s)35 | |
8459 | b(standard)f(error,)i(in)e(addition)h(to)h(its)f(standard)f(output,)i | |
8460 | (is)e(con-)150 3287 y(nected)h(to)g Fr(command2)7 b Fu('s)35 | |
8461 | b(standard)f(input)f(through)h(the)g(pip)s(e;)i(it)f(is)g(shorthand)e | |
8462 | (for)h Ft(2>&1)29 b(|)p Fu(.)53 b(This)150 3397 y(implicit)41 | |
8463 | b(redirection)f(of)g(the)g(standard)f(error)g(to)h(the)g(standard)f | |
8464 | (output)g(is)h(p)s(erformed)e(after)j(an)m(y)150 3506 | |
8465 | y(redirections)31 b(sp)s(eci\014ed)f(b)m(y)g(the)g(command.)275 | |
8466 | 3643 y(The)36 b(reserv)m(ed)g(w)m(ord)g Ft(time)g Fu(causes)h(timing)g | |
122f603c | 8467 | (statistics)h(to)f(b)s(e)f(prin)m(ted)g(for)g(the)h(pip)s(eline)f(once) |
1101193a | 8468 | h(it)150 3752 y(\014nishes.)51 b(The)34 b(statistics)i(curren)m(tly)e |
122f603c | 8469 | (consist)h(of)f(elapsed)h(\(w)m(all-clo)s(c)m(k\))i(time)e(and)f(user)f |
6e51e0d0 CR |
8470 | (and)h(system)150 3862 y(time)e(consumed)e(b)m(y)h(the)g(command's)g |
8471 | (execution.)44 b(The)31 b Ft(-p)f Fu(option)i(c)m(hanges)g(the)f | |
8472 | (output)g(format)g(to)150 3971 y(that)j(sp)s(eci\014ed)e(b)m(y)h | |
8473 | Fm(posix)p Fu(.)49 b(When)33 b(the)g(shell)g(is)h(in)e | |
8474 | Fm(posix)h Fu(mo)s(de)g(\(see)h(Section)g(6.11)g([Bash)g(POSIX)150 | |
900a813b | 8475 | 4081 y(Mo)s(de],)40 b(page)f(95\),)i(it)d(do)s(es)f(not)h(recognize)i |
6e51e0d0 CR |
8476 | Ft(time)c Fu(as)i(a)g(reserv)m(ed)g(w)m(ord)f(if)h(the)g(next)g(tok)m |
8477 | (en)g(b)s(egins)150 4191 y(with)33 b(a)g(`)p Ft(-)p Fu('.)49 | |
8478 | b(The)33 b Ft(TIMEFORMAT)d Fu(v)-5 b(ariable)34 b(ma)m(y)g(b)s(e)f(set) | |
9ec5ed66 | 8479 | g(to)h(a)g(format)f(string)g(that)h(sp)s(eci\014es)f(ho)m(w)g(the)150 |
1101193a | 8480 | 4300 y(timing)38 b(information)g(should)e(b)s(e)h(displa)m(y)m(ed.)62 |
9ec5ed66 | 8481 | b(See)38 b(Section)g(5.2)g([Bash)g(V)-8 b(ariables],)41 |
900a813b | 8482 | b(page)d(70,)i(for)e(a)150 4410 y(description)27 b(of)g(the)h(a)m(v)-5 |
6e51e0d0 CR |
8483 | b(ailable)29 b(formats.)40 b(The)26 b(use)h(of)g Ft(time)f |
8484 | Fu(as)i(a)f(reserv)m(ed)g(w)m(ord)g(p)s(ermits)f(the)h(timing)150 | |
1101193a | 8485 | 4519 y(of)38 b(shell)g(builtins,)i(shell)e(functions,)i(and)d(pip)s |
6e51e0d0 | 8486 | (elines.)63 b(An)38 b(external)h Ft(time)e Fu(command)h(cannot)g(time) |
1101193a | 8487 | 150 4629 y(these)31 b(easily)-8 b(.)275 4765 y(When)29 |
6e51e0d0 | 8488 | b(the)h(shell)h(is)f(in)f Fm(posix)g Fu(mo)s(de)h(\(see)h(Section)f |
900a813b | 8489 | (6.11)i([Bash)e(POSIX)f(Mo)s(de],)i(page)g(95\),)g Ft(time)150 |
6e51e0d0 | 8490 | 4875 y Fu(ma)m(y)26 b(b)s(e)f(follo)m(w)m(ed)j(b)m(y)d(a)h(newline.)39 |
9ec5ed66 | 8491 | b(In)25 b(this)h(case,)i(the)d(shell)h(displa)m(ys)g(the)g(total)h |
1101193a | 8492 | (user)e(and)g(system)h(time)150 4984 y(consumed)33 b(b)m(y)h(the)h |
6e51e0d0 CR |
8493 | (shell)f(and)f(its)i(c)m(hildren.)51 b(The)34 b Ft(TIMEFORMAT)d |
8494 | Fu(v)-5 b(ariable)35 b(ma)m(y)g(b)s(e)e(used)g(to)i(sp)s(ecify)150 | |
1101193a | 8495 | 5094 y(the)c(format)f(of)h(the)f(time)h(information.)275 |
9ec5ed66 CR |
8496 | 5230 y(If)24 b(the)h(pip)s(eline)g(is)g(not)g(executed)h(async)m |
8497 | (hronously)f(\(see)h(Section)g(3.2.3)h([Lists],)g(page)e(9\),)i(the)f | |
8498 | (shell)150 5340 y(w)m(aits)31 b(for)f(all)i(commands)e(in)g(the)g(pip)s | |
8499 | (eline)g(to)h(complete.)p eop end | |
220537f2 | 8500 | %%Page: 9 15 |
6e51e0d0 | 8501 | TeXDict begin 9 14 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
9ec5ed66 CR |
8502 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(9)275 299 |
8503 | y(Eac)m(h)25 b(command)g(in)g(a)g(pip)s(eline)g(is)g(executed)h(in)f | |
8504 | (its)g(o)m(wn)h(subshell)e(\(see)i(Section)g(3.7.3)h([Command)150 | |
fc527055 | 8505 | 408 y(Execution)36 b(En)m(vironmen)m(t],)i(page)e(37\).)58 |
9ec5ed66 CR |
8506 | b(The)36 b(exit)g(status)g(of)g(a)g(pip)s(eline)g(is)f(the)h(exit)h |
8507 | (status)f(of)g(the)150 518 y(last)27 b(command)f(in)f(the)i(pip)s | |
6e51e0d0 | 8508 | (eline,)f(unless)g(the)g Ft(pipefail)e Fu(option)i(is)g(enabled)g |
9ec5ed66 | 8509 | (\(see)h(Section)g(4.3.1)h([The)150 628 y(Set)34 b(Builtin],)j(page)e |
fc527055 | 8510 | (59\).)53 b(If)34 b Ft(pipefail)e Fu(is)i(enabled,)h(the)g(pip)s |
9ec5ed66 CR |
8511 | (eline's)f(return)f(status)h(is)h(the)f(v)-5 b(alue)35 |
8512 | b(of)150 737 y(the)d(last)h(\(righ)m(tmost\))h(command)e(to)h(exit)g | |
8513 | (with)e(a)i(non-zero)f(status,)h(or)f(zero)h(if)f(all)h(commands)f | |
8514 | (exit)150 847 y(successfully)-8 b(.)67 b(If)38 b(the)h(reserv)m(ed)g(w) | |
6e51e0d0 | 8515 | m(ord)g(`)p Ft(!)p Fu(')g(precedes)g(the)g(pip)s(eline,)h(the)g(exit)f |
9ec5ed66 CR |
8516 | (status)g(is)g(the)g(logical)150 956 y(negation)h(of)f(the)f(exit)i |
8517 | (status)f(as)f(describ)s(ed)g(ab)s(o)m(v)m(e.)66 b(The)38 | |
8518 | b(shell)h(w)m(aits)h(for)e(all)h(commands)g(in)f(the)150 | |
8519 | 1066 y(pip)s(eline)30 b(to)h(terminate)g(b)s(efore)f(returning)g(a)h(v) | |
6e51e0d0 CR |
8520 | -5 b(alue.)150 1262 y Fk(3.2.3)63 b(Lists)41 b(of)h(Commands)150 |
8521 | 1409 y Fu(A)37 b Ft(list)e Fu(is)i(a)g(sequence)g(of)g(one)g(or)f(more) | |
220537f2 | 8522 | h(pip)s(elines)f(separated)h(b)m(y)g(one)g(of)f(the)h(op)s(erators)g(`) |
6e51e0d0 CR |
8523 | p Ft(;)p Fu(',)i(`)p Ft(&)p Fu(',)150 1518 y(`)p Ft(&&)p |
8524 | Fu(',)31 b(or)f(`)p Ft(||)p Fu(',)g(and)g(optionally)i(terminated)f(b)m | |
8525 | (y)f(one)h(of)f(`)p Ft(;)p Fu(',)h(`)p Ft(&)p Fu(',)g(or)f(a)h | |
8526 | Ft(newline)p Fu(.)275 1651 y(Of)23 b(these)h(list)g(op)s(erators,)i(`)p | |
8527 | Ft(&&)p Fu(')d(and)g(`)p Ft(||)p Fu(')h(ha)m(v)m(e)h(equal)f | |
8528 | (precedence,)i(follo)m(w)m(ed)f(b)m(y)f(`)p Ft(;)p Fu(')g(and)f(`)p | |
8529 | Ft(&)p Fu(',)i(whic)m(h)150 1761 y(ha)m(v)m(e)32 b(equal)e(precedence.) | |
74d0116b | 8530 | 275 1893 y(A)f(sequence)h(of)g(one)g(or)g(more)g(newlines)f(ma)m(y)h |
6e51e0d0 | 8531 | (app)s(ear)f(in)h(a)g Ft(list)e Fu(to)j(delimit)f(commands,)g(equiv-) |
74d0116b | 8532 | 150 2003 y(alen)m(t)i(to)f(a)g(semicolon.)275 2136 y(If)c(a)h(command)f |
220537f2 | 8533 | (is)h(terminated)g(b)m(y)g(the)g(con)m(trol)h(op)s(erator)f(`)p |
6e51e0d0 CR |
8534 | Ft(&)p Fu(',)h(the)e(shell)h(executes)h(the)f(command)150 |
8535 | 2245 y(async)m(hronously)g(in)h(a)g(subshell.)39 b(This)28 | |
8536 | b(is)h(kno)m(wn)f(as)h(executing)h(the)f(command)g(in)f(the)h | |
8537 | Fr(bac)m(kground)p Fu(.)150 2355 y(The)f(shell)h(do)s(es)f(not)h(w)m | |
37c41ab1 | 8538 | (ait)g(for)f(the)h(command)f(to)i(\014nish,)d(and)h(the)h(return)e |
74d0116b | 8539 | (status)i(is)g(0)g(\(true\).)40 b(When)150 2464 y(job)g(con)m(trol)h |
220537f2 | 8540 | (is)g(not)f(activ)m(e)i(\(see)f(Chapter)f(7)h([Job)f(Con)m(trol],)j |
900a813b | 8541 | (page)e(99\),)j(the)d(standard)e(input)g(for)150 2574 |
220537f2 CR |
8542 | y(async)m(hronous)k(commands,)k(in)d(the)f(absence)i(of)f(an)m(y)g |
8543 | (explicit)h(redirections,)j(is)43 b(redirected)h(from)150 | |
6e51e0d0 CR |
8544 | 2684 y Ft(/dev/null)p Fu(.)275 2816 y(Commands)19 b(separated)j(b)m(y)f |
8545 | (a)g(`)p Ft(;)p Fu(')g(are)h(executed)g(sequen)m(tially;)k(the)21 | |
74d0116b | 8546 | b(shell)g(w)m(aits)h(for)f(eac)m(h)h(command)150 2926 |
37c41ab1 CR |
8547 | y(to)31 b(terminate)h(in)e(turn.)39 b(The)30 b(return)f(status)i(is)f |
8548 | (the)h(exit)g(status)g(of)g(the)f(last)h(command)f(executed.)275 | |
6e51e0d0 | 8549 | 3059 y Fm(and)g Fu(and)h Fm(or)g Fu(lists)h(are)g(sequences)f(of)h(one) |
6a8fd0ed | 8550 | g(or)f(more)h(pip)s(elines)e(separated)i(b)m(y)g(the)f(con)m(trol)i(op) |
6e51e0d0 CR |
8551 | s(er-)150 3168 y(ators)e(`)p Ft(&&)p Fu(')f(and)g(`)p |
8552 | Ft(||)p Fu(',)h(resp)s(ectiv)m(ely)-8 b(.)42 b Fm(and)30 | |
8553 | b Fu(and)f Fm(or)h Fu(lists)h(are)g(executed)g(with)f(left)h(asso)s | |
8554 | (ciativit)m(y)-8 b(.)275 3301 y(An)30 b Fm(and)f Fu(list)i(has)f(the)h | |
8555 | (form)390 3434 y Fj(command1)46 b Ft(&&)h Fj(command2)150 | |
8556 | 3566 y Fr(command2)38 b Fu(is)30 b(executed)i(if,)e(and)g(only)g(if,)h | |
8557 | Fr(command1)38 b Fu(returns)29 b(an)h(exit)h(status)g(of)g(zero.)275 | |
8558 | 3699 y(An)f Fm(or)f Fu(list)i(has)f(the)h(form)390 3832 | |
8559 | y Fj(command1)46 b Ft(||)h Fj(command2)150 3965 y Fr(command2)38 | |
8560 | b Fu(is)30 b(executed)i(if,)e(and)g(only)g(if,)h Fr(command1)38 | |
8561 | b Fu(returns)29 b(a)i(non-zero)g(exit)g(status.)275 4097 | |
8562 | y(The)h(return)g(status)i(of)f Fm(and)f Fu(and)h Fm(or)f | |
8563 | Fu(lists)i(is)f(the)g(exit)h(status)g(of)f(the)g(last)h(command)f | |
8564 | (executed)150 4207 y(in)d(the)h(list.)150 4403 y Fk(3.2.4)63 | |
8565 | b(Comp)s(ound)42 b(Commands)150 4550 y Fu(Comp)s(ound)32 | |
8566 | b(commands)j(are)g(the)g(shell)g(programming)f(constructs.)54 | |
8567 | b(Eac)m(h)35 b(construct)g(b)s(egins)f(with)150 4659 | |
8568 | y(a)k(reserv)m(ed)f(w)m(ord)h(or)f(con)m(trol)i(op)s(erator)f(and)f(is) | |
8569 | g(terminated)h(b)m(y)f(a)h(corresp)s(onding)f(reserv)m(ed)g(w)m(ord)150 | |
8570 | 4769 y(or)44 b(op)s(erator.)81 b(An)m(y)44 b(redirections)g(\(see)h | |
fc527055 | 8571 | (Section)g(3.6)g([Redirections],)j(page)d(32\))g(asso)s(ciated)g(with) |
6e51e0d0 CR |
8572 | 150 4878 y(a)g(comp)s(ound)e(command)i(apply)f(to)h(all)h(commands)e |
8573 | (within)g(that)h(comp)s(ound)e(command)i(unless)150 4988 | |
8574 | y(explicitly)32 b(o)m(v)m(erridden.)275 5121 y(In)20 | |
74d0116b CR |
8575 | b(most)h(cases)g(a)g(list)h(of)f(commands)f(in)g(a)h(comp)s(ound)f |
8576 | (command's)g(description)h(ma)m(y)g(b)s(e)f(separated)150 | |
8577 | 5230 y(from)30 b(the)h(rest)g(of)g(the)g(command)g(b)m(y)f(one)h(or)g | |
8578 | (more)g(newlines,)g(and)f(ma)m(y)i(b)s(e)e(follo)m(w)m(ed)i(b)m(y)f(a)g | |
8579 | (newline)150 5340 y(in)f(place)h(of)g(a)g(semicolon.)p | |
8580 | eop end | |
5e13499c | 8581 | %%Page: 10 16 |
6e51e0d0 | 8582 | TeXDict begin 10 15 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
ad4aef08 CR |
8583 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(10)275 299 |
8584 | y(Bash)45 b(pro)m(vides)h(lo)s(oping)g(constructs,)j(conditional)e | |
8585 | (commands,)j(and)44 b(mec)m(hanisms)i(to)g(group)150 | |
8586 | 408 y(commands)30 b(and)g(execute)i(them)e(as)g(a)h(unit.)150 | |
6e51e0d0 CR |
8587 | 609 y Fk(3.2.4.1)63 b(Lo)s(oping)43 b(Constructs)150 |
8588 | 756 y Fu(Bash)31 b(supp)s(orts)d(the)j(follo)m(wing)g(lo)s(oping)g | |
74d0116b | 8589 | (constructs.)275 891 y(Note)k(that)f(wherev)m(er)g(a)g(`)p |
6e51e0d0 | 8590 | Ft(;)p Fu(')g(app)s(ears)f(in)h(the)g(description)g(of)g(a)g(command's) |
74d0116b | 8591 | g(syn)m(tax,)i(it)e(ma)m(y)h(b)s(e)150 1001 y(replaced)c(with)f(one)h |
6e51e0d0 CR |
8592 | (or)f(more)g(newlines.)150 1162 y Ft(until)240 b Fu(The)30 |
8593 | b(syn)m(tax)h(of)f(the)h Ft(until)e Fu(command)h(is:)870 | |
8594 | 1297 y Ft(until)46 b Fj(test-commands)p Ft(;)e(do)j Fj | |
8595 | (consequent-commands)p Ft(;)c(done)630 1432 y Fu(Execute)f | |
8596 | Fr(consequen)m(t-commands)k Fu(as)41 b(long)h(as)f Fr(test-commands)46 | |
8597 | b Fu(has)41 b(an)g(exit)h(status)630 1542 y(whic)m(h)c(is)h(not)g | |
8598 | (zero.)67 b(The)38 b(return)g(status)h(is)f(the)h(exit)h(status)f(of)g | |
8599 | (the)g(last)g(command)630 1651 y(executed)31 b(in)f Fr(consequen)m | |
8600 | (t-commands)p Fu(,)i(or)e(zero)h(if)g(none)f(w)m(as)h(executed.)150 | |
8601 | 1812 y Ft(while)240 b Fu(The)30 b(syn)m(tax)h(of)f(the)h | |
8602 | Ft(while)e Fu(command)h(is:)870 1947 y Ft(while)46 b | |
8603 | Fj(test-commands)p Ft(;)e(do)j Fj(consequent-commands)p | |
8604 | Ft(;)c(done)630 2082 y Fu(Execute)f Fr(consequen)m(t-commands)k | |
8605 | Fu(as)41 b(long)h(as)f Fr(test-commands)46 b Fu(has)41 | |
74d0116b | 8606 | b(an)g(exit)h(status)630 2192 y(of)34 b(zero.)53 b(The)34 |
220537f2 | 8607 | b(return)f(status)h(is)h(the)f(exit)h(status)g(of)f(the)g(last)h |
6e51e0d0 CR |
8608 | (command)f(executed)h(in)630 2301 y Fr(consequen)m(t-commands)p |
8609 | Fu(,)c(or)g(zero)g(if)f(none)g(w)m(as)h(executed.)150 | |
8610 | 2462 y Ft(for)336 b Fu(The)30 b(syn)m(tax)h(of)f(the)h | |
8611 | Ft(for)e Fu(command)i(is:)870 2597 y Ft(for)47 b Fj(name)g | |
8612 | Ft([)g([in)g([)p Fj(words)f Ft(...)o(])i(])f(;)h(])f(do)g | |
8613 | Fj(commands)p Ft(;)e(done)630 2732 y Fu(Expand)31 b Fr(w)m(ords)p | |
8614 | Fu(,)j(and)e(execute)i Fr(commands)i Fu(once)d(for)g(eac)m(h)h(mem)m(b) | |
8615 | s(er)e(in)g(the)h(resultan)m(t)630 2841 y(list,)d(with)f | |
8616 | Fr(name)34 b Fu(b)s(ound)27 b(to)i(the)h(curren)m(t)e(mem)m(b)s(er.)40 | |
8617 | b(If)28 b(`)p Ft(in)i Fj(words)p Fu(')e(is)h(not)g(presen)m(t,)h(the) | |
8618 | 630 2951 y Ft(for)f Fu(command)g(executes)i(the)e Fr(commands)k | |
8619 | Fu(once)d(for)f(eac)m(h)i(p)s(ositional)f(parameter)g(that)630 | |
8620 | 3060 y(is)d(set,)h(as)f(if)g(`)p Ft(in)j("$@")p Fu(')c(had)g(b)s(een)g | |
8621 | (sp)s(eci\014ed)g(\(see)i(Section)f(3.4.2)i([Sp)s(ecial)e(P)m | |
8622 | (arameters],)630 3170 y(page)c(20\).)39 b(The)21 b(return)g(status)h | |
8623 | (is)g(the)g(exit)h(status)f(of)g(the)g(last)g(command)g(that)g | |
8624 | (executes.)630 3280 y(If)i(there)h(are)h(no)e(items)i(in)e(the)h | |
8625 | (expansion)g(of)g Fr(w)m(ords)p Fu(,)h(no)f(commands)f(are)h(executed,) | |
8626 | j(and)630 3389 y(the)j(return)e(status)i(is)f(zero.)630 | |
8627 | 3524 y(An)g(alternate)i(form)e(of)h(the)f Ft(for)g Fu(command)g(is)g | |
8628 | (also)h(supp)s(orted:)870 3659 y Ft(for)47 b(\(\()g Fj(expr1)f | |
8629 | Ft(;)i Fj(expr2)e Ft(;)i Fj(expr3)e Ft(\)\))h(;)h(do)f | |
8630 | Fj(commands)e Ft(;)j(done)630 3794 y Fu(First,)38 b(the)f(arithmetic)h | |
8631 | (expression)e Fr(expr1)43 b Fu(is)36 b(ev)-5 b(aluated)38 | |
74d0116b | 8632 | b(according)f(to)g(the)g(rules)f(de-)630 3904 y(scrib)s(ed)41 |
c302751c | 8633 | b(b)s(elo)m(w)h(\(see)h(Section)g(6.5)g([Shell)g(Arithmetic],)j(page)d |
900a813b | 8634 | (88\).)77 b(The)42 b(arithmetic)630 4014 y(expression)33 |
6e51e0d0 | 8635 | b Fr(expr2)41 b Fu(is)34 b(then)f(ev)-5 b(aluated)35 |
c302751c | 8636 | b(rep)s(eatedly)f(un)m(til)g(it)g(ev)-5 b(aluates)35 |
6e51e0d0 CR |
8637 | b(to)g(zero.)51 b(Eac)m(h)630 4123 y(time)23 b Fr(expr2)30 |
8638 | b Fu(ev)-5 b(aluates)25 b(to)e(a)g(non-zero)h(v)-5 b(alue,)25 | |
8639 | b Fr(commands)h Fu(are)d(executed)g(and)g(the)g(arith-)630 | |
8640 | 4233 y(metic)29 b(expression)f Fr(expr3)36 b Fu(is)28 | |
37c41ab1 | 8641 | b(ev)-5 b(aluated.)41 b(If)28 b(an)m(y)h(expression)f(is)g(omitted,)i |
74d0116b | 8642 | (it)f(b)s(eha)m(v)m(es)g(as)630 4342 y(if)i(it)h(ev)-5 |
37c41ab1 CR |
8643 | b(aluates)32 b(to)g(1.)44 b(The)30 b(return)g(v)-5 b(alue)32 |
8644 | b(is)f(the)g(exit)h(status)g(of)f(the)g(last)h(command)f(in)630 | |
6e51e0d0 | 8645 | 4452 y Fr(commands)j Fu(that)d(is)f(executed,)i(or)e(false)h(if)f(an)m |
9ec5ed66 | 8646 | (y)h(of)g(the)f(expressions)g(is)h(in)m(v)-5 b(alid.)275 |
6e51e0d0 | 8647 | 4613 y(The)26 b Ft(break)g Fu(and)h Ft(continue)e Fu(builtins)i(\(see)h |
1101193a | 8648 | (Section)h(4.1)f([Bourne)g(Shell)f(Builtins],)i(page)f(41\))g(ma)m(y) |
74d0116b | 8649 | 150 4723 y(b)s(e)i(used)f(to)i(con)m(trol)h(lo)s(op)f(execution.)150 |
6e51e0d0 CR |
8650 | 4923 y Fk(3.2.4.2)63 b(Conditional)42 b(Constructs)150 |
8651 | 5095 y Ft(if)384 b Fu(The)30 b(syn)m(tax)h(of)f(the)h | |
8652 | Ft(if)f Fu(command)g(is:)870 5230 y Ft(if)47 b Fj(test-commands)p | |
8653 | Ft(;)d(then)965 5340 y Fj(consequent-commands)p Ft(;)p | |
8654 | eop end | |
220537f2 | 8655 | %%Page: 11 17 |
6e51e0d0 | 8656 | TeXDict begin 11 16 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
220537f2 | 8657 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(11)870 299 |
6e51e0d0 CR |
8658 | y Ft([elif)46 b Fj(more-test-commands)p Ft(;)d(then)965 |
8659 | 408 y Fj(more-consequents)p Ft(;])870 518 y([else)j Fj | |
8660 | (alternate-consequents)p Ft(;])870 628 y(fi)630 757 y | |
8661 | Fu(The)53 b Fr(test-commands)58 b Fu(list)c(is)g(executed,)60 | |
74d0116b | 8662 | b(and)53 b(if)g(its)h(return)e(status)i(is)f(zero,)61 |
6e51e0d0 CR |
8663 | b(the)630 867 y Fr(consequen)m(t-commands)44 b Fu(list)d(is)f |
8664 | (executed.)70 b(If)40 b Fr(test-commands)k Fu(returns)39 | |
8665 | b(a)h(non-zero)630 976 y(status,)45 b(eac)m(h)e Ft(elif)d | |
8666 | Fu(list)i(is)g(executed)h(in)e(turn,)j(and)d(if)g(its)h(exit)h(status)f | |
9f178efb | 8667 | (is)f(zero,)46 b(the)630 1086 y(corresp)s(onding)37 b |
6e51e0d0 CR |
8668 | Fr(more-consequen)m(ts)42 b Fu(is)c(executed)g(and)f(the)h(command)g |
8669 | (completes.)63 b(If)630 1196 y(`)p Ft(else)29 b Fj | |
8670 | (alternate-consequents)p Fu(')c(is)30 b(presen)m(t,)h(and)f(the)g | |
8671 | (\014nal)g(command)g(in)g(the)g(\014nal)630 1305 y Ft(if)44 | |
8672 | b Fu(or)g Ft(elif)f Fu(clause)i(has)f(a)h(non-zero)g(exit)g(status,)j | |
8673 | (then)c Fr(alternate-consequen)m(ts)51 b Fu(is)630 1415 | |
ed35cb4a | 8674 | y(executed.)k(The)34 b(return)g(status)h(is)f(the)h(exit)h(status)f(of) |
9f178efb | 8675 | g(the)g(last)g(command)g(executed,)630 1524 y(or)30 b(zero)i(if)e(no)g |
6e51e0d0 CR |
8676 | (condition)h(tested)g(true.)150 1674 y Ft(case)288 b |
8677 | Fu(The)30 b(syn)m(tax)h(of)f(the)h Ft(case)e Fu(command)h(is:)870 | |
8678 | 1803 y Ft(case)47 b Fj(word)f Ft(in)h([)h([\(])f Fj(pattern)f | |
8679 | Ft([|)h Fj(pattern)p Ft(]...)m(\))g Fj(command-list)e | |
8680 | Ft(;;]...)h(esac)630 1933 y(case)20 b Fu(will)i(selectiv)m(ely)j | |
8681 | (execute)e(the)e Fr(command-list)k Fu(corresp)s(onding)20 | |
8682 | b(to)i(the)g(\014rst)f Fr(pattern)630 2042 y Fu(that)42 | |
8a0829e9 CR |
8683 | b(matc)m(hes)g Fr(w)m(ord)p Fu(.)73 b(If)41 b(the)g Ft(nocasematch)d |
8684 | Fu(shell)j(option)h(\(see)g(the)g(description)f(of)630 | |
6e51e0d0 | 8685 | 2152 y Ft(shopt)34 b Fu(in)h(Section)h(4.3.2)h([The)e(Shopt)f |
fc527055 | 8686 | (Builtin],)k(page)e(63\))g(is)g(enabled,)g(the)g(matc)m(h)g(is)630 |
6e51e0d0 CR |
8687 | 2262 y(p)s(erformed)29 b(without)i(regard)g(to)g(the)g(case)h(of)f |
8688 | (alphab)s(etic)g(c)m(haracters.)44 b(The)30 b(`)p Ft(|)p | |
8689 | Fu(')h(is)g(used)630 2371 y(to)e(separate)g(m)m(ultiple)g(patterns,)g | |
8690 | (and)e(the)i(`)p Ft(\))p Fu(')f(op)s(erator)g(terminates)h(a)g(pattern) | |
8691 | f(list.)41 b(A)630 2481 y(list)31 b(of)g(patterns)f(and)g(an)g(asso)s | |
8692 | (ciated)i(command-list)f(is)f(kno)m(wn)g(as)h(a)g Fr(clause)p | |
8693 | Fu(.)630 2610 y(Eac)m(h)42 b(clause)g(m)m(ust)f(b)s(e)g(terminated)h | |
8694 | (with)e(`)p Ft(;;)p Fu(',)45 b(`)p Ft(;&)p Fu(',)f(or)d(`)p | |
8695 | Ft(;;&)p Fu('.)73 b(The)41 b Fr(w)m(ord)j Fu(under-)630 | |
8696 | 2720 y(go)s(es)35 b(tilde)f(expansion,)h(parameter)g(expansion,)g | |
8697 | (command)f(substitution,)h(arithmetic)630 2829 y(expansion,)47 | |
8698 | b(and)d(quote)g(remo)m(v)-5 b(al)45 b(b)s(efore)f(matc)m(hing)h(is)f | |
8699 | (attempted.)82 b(Eac)m(h)45 b Fr(pattern)630 2939 y Fu(undergo)s(es)38 | |
8700 | b(tilde)h(expansion,)i(parameter)e(expansion,)i(command)d | |
8701 | (substitution,)j(and)630 3049 y(arithmetic)32 b(expansion.)630 | |
8702 | 3178 y(There)e(ma)m(y)g(b)s(e)f(an)h(arbitrary)g(n)m(um)m(b)s(er)f(of)h | |
8703 | Ft(case)f Fu(clauses,)i(eac)m(h)g(terminated)g(b)m(y)e(a)i(`)p | |
8704 | Ft(;;)p Fu(',)630 3288 y(`)p Ft(;&)p Fu(',)c(or)e(`)p | |
8705 | Ft(;;&)p Fu('.)39 b(The)25 b(\014rst)g(pattern)h(that)g(matc)m(hes)h | |
8706 | (determines)e(the)h(command-list)g(that)630 3397 y(is)35 | |
8707 | b(executed.)55 b(It's)35 b(a)g(common)g(idiom)g(to)g(use)g(`)p | |
8708 | Ft(*)p Fu(')g(as)g(the)g(\014nal)f(pattern)h(to)h(de\014ne)e(the)630 | |
9f178efb CR |
8709 | 3507 y(default)d(case,)g(since)g(that)g(pattern)f(will)h(alw)m(a)m(ys)h |
8710 | (matc)m(h.)630 3636 y(Here)j(is)g(an)g(example)h(using)e | |
6e51e0d0 | 8711 | Ft(case)g Fu(in)g(a)h(script)g(that)h(could)f(b)s(e)f(used)g(to)h |
9f178efb | 8712 | (describ)s(e)g(one)630 3746 y(in)m(teresting)d(feature)f(of)f(an)g |
6e51e0d0 | 8713 | (animal:)870 3875 y Ft(echo)47 b(-n)g("Enter)f(the)h(name)f(of)i(an)f |
9f178efb CR |
8714 | (animal:)f(")870 3985 y(read)h(ANIMAL)870 4095 y(echo)g(-n)g("The)f |
8715 | ($ANIMAL)g(has)h(")870 4204 y(case)g($ANIMAL)e(in)965 | |
8716 | 4314 y(horse)i(|)g(dog)g(|)h(cat\))e(echo)h(-n)g("four";;)965 | |
8717 | 4423 y(man)g(|)h(kangaroo)d(\))j(echo)e(-n)i("two";;)965 | |
8718 | 4533 y(*\))g(echo)e(-n)h("an)g(unknown)f(number)g(of";;)870 | |
6e51e0d0 CR |
8719 | 4643 y(esac)870 4752 y(echo)h(")g(legs.")630 4902 y Fu(If)25 |
8720 | b(the)h(`)p Ft(;;)p Fu(')g(op)s(erator)g(is)g(used,)g(no)g(subsequen)m | |
9f178efb | 8721 | (t)f(matc)m(hes)i(are)f(attempted)h(after)g(the)f(\014rst)630 |
6e51e0d0 CR |
8722 | 5011 y(pattern)g(matc)m(h.)40 b(Using)26 b(`)p Ft(;&)p |
8723 | Fu(')f(in)h(place)g(of)g(`)p Ft(;;)p Fu(')g(causes)g(execution)h(to)f | |
8724 | (con)m(tin)m(ue)h(with)f(the)630 5121 y Fr(command-list)39 | |
8725 | b Fu(asso)s(ciated)f(with)e(the)g(next)g(clause,)j(if)d(an)m(y)-8 | |
8726 | b(.)59 b(Using)37 b(`)p Ft(;;&)p Fu(')f(in)g(place)h(of)630 | |
8727 | 5230 y(`)p Ft(;;)p Fu(')30 b(causes)g(the)g(shell)g(to)g(test)h(the)f | |
9f178efb | 8728 | (patterns)g(in)f(the)h(next)g(clause,)h(if)e(an)m(y)-8 |
74d0116b | 8729 | b(,)31 b(and)f(execute)630 5340 y(an)m(y)h(asso)s(ciated)h |
6e51e0d0 | 8730 | Fr(command-list)h Fu(on)d(a)h(successful)f(matc)m(h.)p |
220537f2 CR |
8731 | eop end |
8732 | %%Page: 12 18 | |
6e51e0d0 | 8733 | TeXDict begin 12 17 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
ad4aef08 | 8734 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(12)630 299 |
6e51e0d0 CR |
8735 | y(The)26 b(return)f(status)h(is)g(zero)h(if)f(no)g Fr(pattern)g |
8736 | Fu(is)g(matc)m(hed.)40 b(Otherwise,)27 b(the)g(return)e(status)630 | |
8737 | 408 y(is)30 b(the)h(exit)g(status)g(of)f(the)h Fr(command-list)i | |
8738 | Fu(executed.)150 564 y Ft(select)630 697 y Fu(The)g Ft(select)f | |
8739 | Fu(construct)i(allo)m(ws)h(the)f(easy)g(generation)h(of)e(men)m(us.)50 | |
ad4aef08 | 8740 | b(It)34 b(has)f(almost)i(the)630 806 y(same)c(syn)m(tax)g(as)f(the)h |
6e51e0d0 CR |
8741 | Ft(for)e Fu(command:)870 939 y Ft(select)46 b Fj(name)h |
8742 | Ft([in)g Fj(words)f Ft(...)o(];)h(do)h Fj(commands)p | |
8743 | Ft(;)d(done)630 1072 y Fu(The)25 b(list)h(of)f(w)m(ords)g(follo)m(wing) | |
8744 | i Ft(in)d Fu(is)h(expanded,)h(generating)h(a)e(list)h(of)g(items.)39 | |
8745 | b(The)25 b(set)h(of)630 1181 y(expanded)i(w)m(ords)h(is)g(prin)m(ted)f | |
8746 | (on)h(the)g(standard)f(error)h(output)f(stream,)i(eac)m(h)g(preceded) | |
8747 | 630 1291 y(b)m(y)21 b(a)g(n)m(um)m(b)s(er.)37 b(If)20 | |
8748 | b(the)i(`)p Ft(in)30 b Fj(words)p Fu(')20 b(is)h(omitted,)j(the)d(p)s | |
8749 | (ositional)h(parameters)g(are)f(prin)m(ted,)630 1401 | |
8750 | y(as)28 b(if)f(`)p Ft(in)j("$@")p Fu(')d(had)f(b)s(een)h(sp)s | |
8751 | (eci\014ed.)39 b(The)27 b Ft(PS3)g Fu(prompt)f(is)i(then)f(displa)m(y)m | |
8752 | (ed)h(and)f(a)h(line)630 1510 y(is)h(read)f(from)h(the)f(standard)g | |
8753 | (input.)39 b(If)29 b(the)g(line)g(consists)g(of)g(a)g(n)m(um)m(b)s(er)e | |
8754 | (corresp)s(onding)630 1620 y(to)36 b(one)f(of)h(the)f(displa)m(y)m(ed)h | |
8755 | (w)m(ords,)g(then)f(the)g(v)-5 b(alue)36 b(of)f Fr(name)40 | |
8756 | b Fu(is)35 b(set)h(to)g(that)g(w)m(ord.)54 b(If)630 1729 | |
8757 | y(the)37 b(line)h(is)f(empt)m(y)-8 b(,)39 b(the)e(w)m(ords)g(and)f | |
8758 | (prompt)g(are)i(displa)m(y)m(ed)f(again.)62 b(If)37 b | |
8759 | Ft(EOF)f Fu(is)h(read,)630 1839 y(the)c Ft(select)e Fu(command)i | |
8760 | (completes.)50 b(An)m(y)33 b(other)g(v)-5 b(alue)33 b(read)g(causes)g | |
8761 | Fr(name)38 b Fu(to)c(b)s(e)e(set)630 1948 y(to)f(n)m(ull.)41 | |
8762 | b(The)30 b(line)g(read)h(is)f(sa)m(v)m(ed)h(in)g(the)f(v)-5 | |
8763 | b(ariable)31 b Ft(REPLY)p Fu(.)630 2081 y(The)42 b Fr(commands)j | |
8764 | Fu(are)d(executed)h(after)g(eac)m(h)g(selection)h(un)m(til)e(a)h | |
8765 | Ft(break)d Fu(command)i(is)630 2191 y(executed,)32 b(at)f(whic)m(h)f(p) | |
8766 | s(oin)m(t)g(the)h Ft(select)d Fu(command)i(completes.)630 | |
74d0116b | 8767 | 2323 y(Here)39 b(is)g(an)g(example)h(that)f(allo)m(ws)i(the)e(user)f |
220537f2 | 8768 | (to)i(pic)m(k)f(a)g(\014lename)h(from)e(the)h(curren)m(t)630 |
74d0116b | 8769 | 2433 y(directory)-8 b(,)32 b(and)d(displa)m(ys)i(the)f(name)h(and)f |
6e51e0d0 | 8770 | (index)f(of)i(the)g(\014le)f(selected.)870 2566 y Ft(select)46 |
74d0116b CR |
8771 | b(fname)g(in)i(*;)870 2675 y(do)870 2785 y(echo)f(you)g(picked)f |
8772 | ($fname)g(\\\($REPLY\\\))870 2894 y(break;)870 3004 y(done)150 | |
6e51e0d0 CR |
8773 | 3160 y(\(\(...)o(\)\))870 3292 y(\(\()h Fj(expression)e |
8774 | Ft(\)\))630 3425 y Fu(The)33 b(arithmetic)i Fr(expression)f | |
8775 | Fu(is)f(ev)-5 b(aluated)35 b(according)g(to)f(the)g(rules)f(describ)s | |
74d0116b | 8776 | (ed)g(b)s(elo)m(w)630 3535 y(\(see)j(Section)f(6.5)h([Shell)f |
900a813b | 8777 | (Arithmetic],)i(page)f(88\).)55 b(If)34 b(the)h(v)-5 |
74d0116b | 8778 | b(alue)35 b(of)g(the)g(expression)g(is)630 3644 y(non-zero,)27 |
220537f2 | 8779 | b(the)f(return)e(status)i(is)g(0;)h(otherwise)f(the)g(return)e(status)i |
74d0116b | 8780 | (is)g(1.)39 b(This)25 b(is)g(exactly)630 3754 y(equiv)-5 |
6e51e0d0 CR |
8781 | b(alen)m(t)32 b(to)870 3886 y Ft(let)47 b(")p Fj(expression)p |
8782 | Ft(")630 4019 y Fu(See)25 b(Section)h(4.2)h([Bash)e(Builtins],)i(page)f | |
8783 | (48,)i(for)c(a)i(full)f(description)g(of)g(the)h Ft(let)e | |
8784 | Fu(builtin.)150 4175 y Ft([[...)o(]])870 4308 y([[)47 | |
8785 | b Fj(expression)e Ft(]])630 4440 y Fu(Return)25 b(a)h(status)f(of)h(0)g | |
8786 | (or)g(1)g(dep)s(ending)e(on)h(the)h(ev)-5 b(aluation)27 | |
8787 | b(of)e(the)h(conditional)h(expres-)630 4550 y(sion)j | |
8788 | Fr(expression)p Fu(.)41 b(Expressions)29 b(are)i(comp)s(osed)f(of)g | |
8789 | (the)h(primaries)f(describ)s(ed)f(b)s(elo)m(w)h(in)630 | |
8790 | 4659 y(Section)36 b(6.4)h([Bash)f(Conditional)g(Expressions],)h(page)f | |
900a813b | 8791 | (86.)57 b(W)-8 b(ord)36 b(splitting)h(and)e(\014le-)630 |
6e51e0d0 CR |
8792 | 4769 y(name)d(expansion)g(are)h(not)g(p)s(erformed)d(on)j(the)f(w)m |
8793 | (ords)g(b)s(et)m(w)m(een)h(the)f Ft([[)g Fu(and)f Ft(]])p | |
8794 | Fu(;)i(tilde)630 4879 y(expansion,)e(parameter)g(and)f(v)-5 | |
ad4aef08 CR |
8795 | b(ariable)31 b(expansion,)g(arithmetic)g(expansion,)g(command)630 |
8796 | 4988 y(substitution,)40 b(pro)s(cess)f(substitution,)h(and)e(quote)h | |
8797 | (remo)m(v)-5 b(al)40 b(are)f(p)s(erformed.)63 b(Condi-)630 | |
8798 | 5098 y(tional)32 b(op)s(erators)e(suc)m(h)g(as)h(`)p | |
6e51e0d0 CR |
8799 | Ft(-f)p Fu(')f(m)m(ust)g(b)s(e)g(unquoted)g(to)h(b)s(e)e(recognized)j |
8800 | (as)f(primaries.)630 5230 y(When)k(used)f(with)h Ft([[)p | |
8801 | Fu(,)h(the)f(`)p Ft(<)p Fu(')g(and)g(`)p Ft(>)p Fu(')g(op)s(erators)g | |
ad4aef08 CR |
8802 | (sort)g(lexicographically)j(using)d(the)630 5340 y(curren)m(t)30 |
8803 | b(lo)s(cale.)p eop end | |
220537f2 | 8804 | %%Page: 13 19 |
6e51e0d0 | 8805 | TeXDict begin 13 18 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
220537f2 | 8806 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(13)630 299 |
6e51e0d0 CR |
8807 | y(When)22 b(the)h(`)p Ft(==)p Fu(')f(and)g(`)p Ft(!=)p |
8808 | Fu(')g(op)s(erators)h(are)g(used,)g(the)g(string)f(to)i(the)e(righ)m(t) | |
74d0116b CR |
8809 | h(of)g(the)g(op)s(erator)630 408 y(is)31 b(considered)g(a)h(pattern)f |
8810 | (and)g(matc)m(hed)h(according)g(to)g(the)g(rules)f(describ)s(ed)f(b)s | |
1101193a | 8811 | (elo)m(w)h(in)630 518 y(Section)d(3.5.8.1)h([P)m(attern)f(Matc)m |
8a0829e9 | 8812 | (hing],)h(page)f(31,)g(as)f(if)g(the)g Ft(extglob)d Fu(shell)j(option)g |
6e51e0d0 CR |
8813 | (w)m(ere)630 628 y(enabled.)46 b(The)31 b(`)p Ft(=)p |
8814 | Fu(')h(op)s(erator)h(is)f(iden)m(tical)h(to)g(`)p Ft(==)p | |
8a0829e9 CR |
8815 | Fu('.)46 b(If)31 b(the)h Ft(nocasematch)d Fu(shell)j(option)630 |
8816 | 737 y(\(see)42 b(the)f(description)g(of)h Ft(shopt)d | |
6e51e0d0 | 8817 | Fu(in)i(Section)h(4.3.2)h([The)e(Shopt)f(Builtin],)45 |
fc527055 | 8818 | b(page)d(63\))630 847 y(is)e(enabled,)i(the)e(matc)m(h)h(is)e(p)s |
1101193a CR |
8819 | (erformed)g(without)g(regard)h(to)h(the)f(case)g(of)g(alphab)s(etic)630 |
8820 | 956 y(c)m(haracters.)h(The)28 b(return)e(v)-5 b(alue)28 | |
6e51e0d0 CR |
8821 | b(is)g(0)g(if)g(the)g(string)g(matc)m(hes)h(\(`)p Ft(==)p |
8822 | Fu('\))f(or)g(do)s(es)f(not)h(matc)m(h)630 1066 y(\(`)p | |
8823 | Ft(!=)p Fu('\)the)33 b(pattern,)g(and)f(1)g(otherwise.)47 | |
1101193a CR |
8824 | b(An)m(y)32 b(part)g(of)h(the)f(pattern)g(ma)m(y)h(b)s(e)f(quoted)g(to) |
8825 | 630 1176 y(force)f(the)g(quoted)f(p)s(ortion)g(to)h(b)s(e)f(matc)m(hed) | |
8826 | h(as)g(a)f(string.)630 1316 y(An)j(additional)i(binary)e(op)s(erator,)i | |
6e51e0d0 CR |
8827 | (`)p Ft(=~)p Fu(',)g(is)f(a)m(v)-5 b(ailable,)37 b(with)c(the)h(same)g |
8828 | (precedence)h(as)630 1426 y(`)p Ft(==)p Fu(')29 b(and)f(`)p | |
8829 | Ft(!=)p Fu('.)40 b(When)29 b(it)g(is)g(used,)f(the)h(string)g(to)h(the) | |
1101193a CR |
8830 | e(righ)m(t)i(of)f(the)g(op)s(erator)g(is)g(consid-)630 |
8831 | 1536 y(ered)34 b(an)g(extended)g(regular)g(expression)g(and)f(matc)m | |
6e51e0d0 CR |
8832 | (hed)i(accordingly)g(\(as)f(in)g Fl(r)-5 b(e)g(gex)11 |
8833 | b Fu(3\)\).)630 1645 y(The)29 b(return)f(v)-5 b(alue)30 | |
1101193a CR |
8834 | b(is)g(0)g(if)f(the)h(string)g(matc)m(hes)g(the)g(pattern,)g(and)f(1)h |
8835 | (otherwise.)41 b(If)29 b(the)630 1755 y(regular)e(expression)g(is)h | |
8836 | (syn)m(tactically)i(incorrect,)f(the)e(conditional)i(expression's)e | |
8837 | (return)630 1864 y(v)-5 b(alue)40 b(is)g(2.)68 b(If)39 | |
8a0829e9 | 8838 | b(the)h Ft(nocasematch)c Fu(shell)k(option)g(\(see)g(the)g(description) |
6e51e0d0 | 8839 | g(of)f Ft(shopt)f Fu(in)630 1974 y(Section)32 b(4.3.2)g([The)f(Shopt)f |
fc527055 | 8840 | (Builtin],)i(page)g(63\))g(is)f(enabled,)g(the)g(matc)m(h)h(is)e(p)s |
1101193a CR |
8841 | (erformed)630 2084 y(without)36 b(regard)g(to)h(the)f(case)h(of)f |
8842 | (alphab)s(etic)h(c)m(haracters.)59 b(An)m(y)36 b(part)g(of)h(the)f | |
8843 | (pattern)630 2193 y(ma)m(y)31 b(b)s(e)f(quoted)h(to)g(force)g(the)g | |
8844 | (quoted)g(p)s(ortion)f(to)h(b)s(e)f(matc)m(hed)h(as)g(a)g(string.)41 | |
8845 | b(Brac)m(k)m(et)630 2303 y(expressions)27 b(in)f(regular)i(expressions) | |
8846 | e(m)m(ust)h(b)s(e)g(treated)h(carefully)-8 b(,)29 b(since)e(normal)g | |
8847 | (quot-)630 2412 y(ing)38 b(c)m(haracters)h(lose)f(their)g(meanings)f(b) | |
8848 | s(et)m(w)m(een)h(brac)m(k)m(ets.)64 b(If)37 b(the)h(pattern)f(is)h | |
8849 | (stored)630 2522 y(in)33 b(a)i(shell)f(v)-5 b(ariable,)35 | |
8850 | b(quoting)f(the)g(v)-5 b(ariable)35 b(expansion)e(forces)i(the)f(en)m | |
8851 | (tire)g(pattern)g(to)630 2632 y(b)s(e)h(matc)m(hed)i(as)f(a)g(string.) | |
8852 | 56 b(Substrings)34 b(matc)m(hed)j(b)m(y)f(paren)m(thesized)g(sub)s | |
8853 | (expressions)630 2741 y(within)k(the)g(regular)g(expression)g(are)g(sa) | |
8854 | m(v)m(ed)i(in)d(the)i(arra)m(y)f(v)-5 b(ariable)41 b | |
6e51e0d0 CR |
8855 | Ft(BASH_REMATCH)p Fu(.)630 2851 y(The)30 b(elemen)m(t)i(of)e |
8856 | Ft(BASH_REMATCH)d Fu(with)j(index)g(0)h(is)g(the)f(p)s(ortion)g(of)h | |
1101193a | 8857 | (the)f(string)h(matc)m(h-)630 2960 y(ing)j(the)g(en)m(tire)g(regular)g |
6e51e0d0 CR |
8858 | (expression.)50 b(The)34 b(elemen)m(t)h(of)f Ft(BASH_REMATCH)c |
8859 | Fu(with)j(index)g Fr(n)630 3070 y Fu(is)d(the)h(p)s(ortion)f(of)g(the)h | |
8860 | (string)f(matc)m(hing)i(the)e Fr(n)p Fu(th)g(paren)m(thesized)h(sub)s | |
1101193a CR |
8861 | (expression.)630 3211 y(F)-8 b(or)28 b(example,)h(the)e(follo)m(wing)i |
8862 | (will)e(matc)m(h)h(a)g(line)f(\(stored)h(in)e(the)i(shell)f(v)-5 | |
6e51e0d0 | 8863 | b(ariable)28 b Fr(line)5 b Fu(\))28 b(if)630 3320 y(there)22 |
1101193a CR |
8864 | b(is)g(a)h(sequence)f(of)h(c)m(haracters)g(in)f(the)g(v)-5 |
8865 | b(alue)23 b(consisting)g(of)f(an)m(y)h(n)m(um)m(b)s(er,)f(including)630 | |
8866 | 3430 y(zero,)31 b(of)g(space)g(c)m(haracters,)h(zero)f(or)g(one)f | |
6e51e0d0 CR |
8867 | (instances)h(of)g(`)p Ft(a)p Fu(',)f(then)g(a)h(`)p Ft(b)p |
8868 | Fu(':)870 3571 y Ft([[)47 b($line)g(=~)g([[:space:]]*\(a\)?b)c(]])630 | |
8869 | 3712 y Fu(That)24 b(means)g(v)-5 b(alues)24 b(lik)m(e)h(`)p | |
8870 | Ft(aab)p Fu(')e(and)h(`)30 b Ft(aaaaaab)p Fu(')22 b(will)i(matc)m(h,)j | |
1101193a | 8871 | (as)d(will)g(a)g(line)g(con)m(taining)630 3821 y(a)31 |
6e51e0d0 | 8872 | b(`)p Ft(b)p Fu(')f(an)m(ywhere)h(in)f(its)g(v)-5 b(alue.)630 |
1101193a | 8873 | 3962 y(Storing)31 b(the)g(regular)g(expression)f(in)h(a)g(shell)g(v)-5 |
45c0f7f8 | 8874 | b(ariable)31 b(is)g(often)g(a)g(useful)f(w)m(a)m(y)i(to)f(a)m(v)m(oid) |
1101193a | 8875 | 630 4072 y(problems)f(with)g(quoting)h(c)m(haracters)i(that)e(are)g(sp) |
45c0f7f8 | 8876 | s(ecial)g(to)h(the)f(shell.)41 b(It)31 b(is)g(sometimes)630 |
1101193a | 8877 | 4181 y(di\016cult)24 b(to)h(sp)s(ecify)f(a)h(regular)g(expression)f |
45c0f7f8 | 8878 | (literally)i(without)f(using)e(quotes,)k(or)d(to)h(k)m(eep)630 |
1101193a | 8879 | 4291 y(trac)m(k)33 b(of)g(the)f(quoting)g(used)g(b)m(y)g(regular)g |
45c0f7f8 | 8880 | (expressions)g(while)g(pa)m(ying)h(atten)m(tion)h(to)f(the)630 |
1101193a | 8881 | 4401 y(shell's)25 b(quote)g(remo)m(v)-5 b(al.)40 b(Using)25 |
45c0f7f8 | 8882 | b(a)g(shell)g(v)-5 b(ariable)26 b(to)f(store)g(the)g(pattern)g |
1101193a | 8883 | (decreases)g(these)630 4510 y(problems.)40 b(F)-8 b(or)31 |
45c0f7f8 | 8884 | b(example,)g(the)g(follo)m(wing)h(is)e(equiv)-5 b(alen)m(t)32 |
6e51e0d0 | 8885 | b(to)f(the)g(ab)s(o)m(v)m(e:)870 4651 y Ft(pattern='[[:space:]]*\(a\))o |
1101193a | 8886 | (?b')870 4761 y([[)47 b($line)g(=~)g($pattern)e(]])630 |
6e51e0d0 | 8887 | 4902 y Fu(If)28 b(y)m(ou)h(w)m(an)m(t)g(to)g(matc)m(h)h(a)e(c)m |
45c0f7f8 | 8888 | (haracter)j(that's)e(sp)s(ecial)g(to)g(the)g(regular)f(expression)g |
1101193a | 8889 | (gram-)630 5011 y(mar,)g(it)g(has)g(to)g(b)s(e)f(quoted)h(to)g(remo)m |
45c0f7f8 | 8890 | (v)m(e)h(its)f(sp)s(ecial)g(meaning.)40 b(This)27 b(means)g(that)h(in)g |
6e51e0d0 CR |
8891 | (the)630 5121 y(pattern)e(`)p Ft(xxx.txt)p Fu(',)g(the)h(`)p |
8892 | Ft(.)p Fu(')f(matc)m(hes)i(an)m(y)e(c)m(haracter)i(in)e(the)h(string)f | |
1101193a | 8893 | (\(its)h(usual)f(regular)630 5230 y(expression)g(meaning\),)i(but)e(in) |
6e51e0d0 CR |
8894 | g(the)h(pattern)f(`)p Ft("xxx.txt")p Fu(')f(it)i(can)g(only)f(matc)m(h) |
8895 | i(a)e(literal)630 5340 y(`)p Ft(.)p Fu('.)56 b(Shell)35 | |
45c0f7f8 | 8896 | b(programmers)f(should)h(tak)m(e)i(sp)s(ecial)e(care)i(with)e(bac)m |
1101193a | 8897 | (kslashes,)i(since)f(bac)m(k-)p eop end |
45c0f7f8 | 8898 | %%Page: 14 20 |
6e51e0d0 | 8899 | TeXDict begin 14 19 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
ad4aef08 | 8900 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(14)630 299 |
1101193a CR |
8901 | y(slashes)27 b(are)g(used)f(b)s(oth)g(b)m(y)h(the)f(shell)h(and)f |
8902 | (regular)h(expressions)g(to)g(remo)m(v)m(e)h(the)f(sp)s(ecial)630 | |
8903 | 408 y(meaning)h(from)f(the)h(follo)m(wing)i(c)m(haracter.)41 | |
ad4aef08 | 8904 | b(The)27 b(follo)m(wing)j(t)m(w)m(o)f(sets)f(of)g(commands)g(are)630 |
037a8b7f CR |
8905 | 518 y Fl(not)40 b Fu(equiv)-5 b(alen)m(t:)870 649 y Ft(pattern='\\.') |
8906 | 870 868 y([[)47 b(.)h(=~)f($pattern)e(]])870 978 y([[)i(.)h(=~)f(\\.)g | |
8907 | (]])870 1197 y([[)g(.)h(=~)f("$pattern")e(]])870 1307 | |
8908 | y([[)i(.)h(=~)f('\\.')f(]])630 1438 y Fu(The)28 b(\014rst)h(t)m(w)m(o)h | |
ad4aef08 | 8909 | (matc)m(hes)g(will)f(succeed,)h(but)f(the)g(second)g(t)m(w)m(o)h(will)f |
037a8b7f | 8910 | (not,)h(b)s(ecause)f(in)g(the)630 1547 y(second)39 b(t)m(w)m(o)i(the)e |
ad4aef08 | 8911 | (bac)m(kslash)h(will)f(b)s(e)g(part)g(of)g(the)h(pattern)f(to)h(b)s(e)e |
037a8b7f | 8912 | (matc)m(hed.)68 b(In)39 b(the)630 1657 y(\014rst)31 b(t)m(w)m(o)h |
ad4aef08 | 8913 | (examples,)h(the)e(bac)m(kslash)h(remo)m(v)m(es)h(the)f(sp)s(ecial)g |
037a8b7f | 8914 | (meaning)f(from)g(`)p Ft(.)p Fu(',)h(so)g(the)630 1766 |
6e51e0d0 | 8915 | y(literal)f(`)p Ft(.)p Fu(')e(matc)m(hes.)42 b(If)28 |
ad4aef08 | 8916 | b(the)i(string)f(in)g(the)g(\014rst)g(examples)g(w)m(ere)h(an)m(ything) |
037a8b7f | 8917 | g(other)f(than)630 1876 y(`)p Ft(.)p Fu(',)g(sa)m(y)g(`)p |
6e51e0d0 CR |
8918 | Ft(a)p Fu(',)g(the)f(pattern)g(w)m(ould)g(not)h(matc)m(h,)h(b)s(ecause) |
8919 | e(the)g(quoted)g(`)p Ft(.)p Fu(')h(in)e(the)i(pattern)630 | |
037a8b7f CR |
8920 | 1986 y(loses)i(its)g(sp)s(ecial)g(meaning)f(of)h(matc)m(hing)g(an)m(y)g |
8921 | (single)g(c)m(haracter.)630 2116 y(Expressions)23 b(ma)m(y)h(b)s(e)e | |
ad4aef08 | 8922 | (com)m(bined)i(using)f(the)h(follo)m(wing)h(op)s(erators,)g(listed)f |
037a8b7f CR |
8923 | (in)f(decreasing)630 2226 y(order)30 b(of)g(precedence:)630 |
8924 | 2378 y Ft(\()g Fj(expression)e Ft(\))1110 2488 y Fu(Returns)i(the)h(v) | |
6e51e0d0 CR |
8925 | -5 b(alue)31 b(of)g Fr(expression)p Fu(.)42 b(This)30 |
8926 | b(ma)m(y)i(b)s(e)e(used)g(to)i(o)m(v)m(erride)g(the)1110 | |
037a8b7f CR |
8927 | 2598 y(normal)e(precedence)h(of)g(op)s(erators.)630 2750 |
8928 | y Ft(!)f Fj(expression)1110 2860 y Fu(T)-8 b(rue)30 b(if)g | |
8929 | Fr(expression)g Fu(is)h(false.)630 3012 y Fj(expression1)c | |
8930 | Ft(&&)j Fj(expression2)1110 3122 y Fu(T)-8 b(rue)30 b(if)g(b)s(oth)g | |
6e51e0d0 | 8931 | Fr(expression1)38 b Fu(and)29 b Fr(expression2)38 b Fu(are)31 |
037a8b7f CR |
8932 | b(true.)630 3274 y Fj(expression1)c Ft(||)j Fj(expression2)1110 |
8933 | 3384 y Fu(T)-8 b(rue)30 b(if)g(either)h Fr(expression1)38 | |
6e51e0d0 | 8934 | b Fu(or)30 b Fr(expression2)38 b Fu(is)30 b(true.)630 |
037a8b7f | 8935 | 3536 y(The)24 b Ft(&&)h Fu(and)f Ft(||)g Fu(op)s(erators)h(do)g(not)g |
6e51e0d0 | 8936 | (ev)-5 b(aluate)27 b Fr(expression2)32 b Fu(if)25 b(the)g(v)-5 |
037a8b7f | 8937 | b(alue)25 b(of)g Fr(expression1)630 3646 y Fu(is)30 b(su\016cien)m(t)h |
6e51e0d0 | 8938 | (to)g(determine)g(the)f(return)g(v)-5 b(alue)31 b(of)f(the)h(en)m(tire) |
037a8b7f CR |
8939 | g(conditional)h(expression.)150 3838 y Fk(3.2.4.3)63 |
8940 | b(Grouping)43 b(Commands)150 3985 y Fu(Bash)30 b(pro)m(vides)g(t)m(w)m | |
6e51e0d0 | 8941 | (o)h(w)m(a)m(ys)f(to)h(group)e(a)h(list)g(of)g(commands)f(to)i(b)s(e)e |
037a8b7f | 8942 | (executed)h(as)g(a)h(unit.)40 b(When)29 b(com-)150 4094 |
6e51e0d0 CR |
8943 | y(mands)h(are)i(group)s(ed,)f(redirections)h(ma)m(y)g(b)s(e)e(applied)i |
8944 | (to)g(the)f(en)m(tire)h(command)g(list.)44 b(F)-8 b(or)32 | |
037a8b7f | 8945 | b(example,)150 4204 y(the)f(output)f(of)g(all)h(the)g(commands)f(in)g |
6e51e0d0 | 8946 | (the)h(list)g(ma)m(y)g(b)s(e)e(redirected)i(to)g(a)g(single)g(stream.) |
037a8b7f CR |
8947 | 150 4356 y Ft(\(\))870 4487 y(\()47 b Fj(list)g Ft(\))630 |
8948 | 4618 y Fu(Placing)30 b(a)f(list)g(of)g(commands)f(b)s(et)m(w)m(een)i | |
6e51e0d0 | 8949 | (paren)m(theses)e(causes)i(a)f(subshell)e(en)m(vironmen)m(t)630 |
037a8b7f CR |
8950 | 4728 y(to)k(b)s(e)e(created)j(\(see)f(Section)g(3.7.3)h([Command)d |
8951 | (Execution)i(En)m(vironmen)m(t],)g(page)f(37\),)630 4837 | |
6e51e0d0 CR |
8952 | y(and)d(eac)m(h)h(of)g(the)f(commands)g(in)g Fr(list)j |
8953 | Fu(to)f(b)s(e)d(executed)j(in)e(that)h(subshell.)38 b(Since)28 | |
037a8b7f | 8954 | b(the)f Fr(list)630 4947 y Fu(is)i(executed)g(in)f(a)h(subshell,)g(v)-5 |
122f603c | 8955 | b(ariable)29 b(assignmen)m(ts)g(do)g(not)g(remain)f(in)g(e\013ect)j |
037a8b7f CR |
8956 | (after)e(the)630 5057 y(subshell)g(completes.)150 5209 |
8957 | y Ft({})870 5340 y({)47 b Fj(list)p Ft(;)g(})p eop end | |
45c0f7f8 | 8958 | %%Page: 15 21 |
6e51e0d0 | 8959 | TeXDict begin 15 20 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
037a8b7f CR |
8960 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(15)630 299 |
8961 | y(Placing)30 b(a)g(list)g(of)g(commands)f(b)s(et)m(w)m(een)h(curly)f | |
8962 | (braces)g(causes)h(the)f(list)h(to)g(b)s(e)f(executed)630 | |
8963 | 408 y(in)d(the)h(curren)m(t)g(shell)f(con)m(text.)42 | |
8964 | b(No)27 b(subshell)f(is)g(created.)41 b(The)26 b(semicolon)i(\(or)f | |
8965 | (newline\))630 518 y(follo)m(wing)32 b Fr(list)h Fu(is)d(required.)275 | |
8966 | 668 y(In)44 b(addition)h(to)h(the)f(creation)i(of)e(a)g(subshell,)j | |
74d0116b | 8967 | (there)e(is)f(a)g(subtle)g(di\013erence)h(b)s(et)m(w)m(een)f(these)150 |
037a8b7f | 8968 | 778 y(t)m(w)m(o)c(constructs)e(due)g(to)g(historical)i(reasons.)67 |
6e51e0d0 | 8969 | b(The)39 b(braces)g(are)h Ft(reserved)28 b(words)p Fu(,)40 |
037a8b7f | 8970 | b(so)g(they)f(m)m(ust)150 887 y(b)s(e)d(separated)h(from)f(the)g |
6e51e0d0 | 8971 | Fr(list)j Fu(b)m(y)e Ft(blank)p Fu(s)e(or)h(other)h(shell)f(metac)m |
037a8b7f | 8972 | (haracters.)62 b(The)36 b(paren)m(theses)h(are)150 997 |
6e51e0d0 | 8973 | y Ft(operators)p Fu(,)23 b(and)h(are)g(recognized)i(as)e(separate)i |
74d0116b | 8974 | (tok)m(ens)f(b)m(y)f(the)g(shell)h(ev)m(en)g(if)f(they)g(are)h(not)f |
037a8b7f CR |
8975 | (separated)150 1107 y(from)30 b(the)g Fr(list)j Fu(b)m(y)e(whitespace.) |
8976 | 275 1236 y(The)e(exit)j(status)e(of)h(b)s(oth)f(of)g(these)h | |
6e51e0d0 | 8977 | (constructs)g(is)f(the)h(exit)g(status)f(of)h Fr(list)p |
037a8b7f | 8978 | Fu(.)150 1426 y Fk(3.2.5)63 b(Copro)s(cesses)150 1573 |
6e51e0d0 CR |
8979 | y Fu(A)37 b Ft(coprocess)c Fu(is)k(a)g(shell)f(command)h(preceded)f(b)m |
8980 | (y)g(the)h Ft(coproc)d Fu(reserv)m(ed)j(w)m(ord.)59 b(A)36 | |
037a8b7f | 8981 | b(copro)s(cess)h(is)150 1683 y(executed)g(async)m(hronously)g(in)f(a)h |
74d0116b | 8982 | (subshell,)g(as)g(if)g(the)f(command)h(had)f(b)s(een)f(terminated)i |
037a8b7f | 8983 | (with)g(the)150 1793 y(`)p Ft(&)p Fu(')d(con)m(trol)h(op)s(erator,)g |
74d0116b | 8984 | (with)f(a)g(t)m(w)m(o-w)m(a)m(y)i(pip)s(e)d(established)h(b)s(et)m(w)m |
037a8b7f CR |
8985 | (een)h(the)f(executing)h(shell)f(and)f(the)150 1902 y(copro)s(cess.)275 |
8986 | 2032 y(The)c(format)i(for)f(a)h(copro)s(cess)g(is:)390 | |
8987 | 2162 y Ft(coproc)46 b([)p Fj(NAME)p Ft(])g Fj(command)g | |
8988 | Ft([)p Fj(redirections)p Ft(])150 2292 y Fu(This)39 b(creates)j(a)e | |
6e51e0d0 CR |
8989 | (copro)s(cess)h(named)f Fr(NAME)p Fu(.)70 b(If)40 b Fr(NAME)46 |
8990 | b Fu(is)40 b(not)g(supplied,)i(the)e(default)h(name)f(is)150 | |
037a8b7f | 8991 | 2401 y Fr(COPR)m(OC)p Fu(.)d Fr(NAME)28 b Fu(m)m(ust)23 |
6e51e0d0 | 8992 | b(not)g(b)s(e)e(supplied)h(if)g Fr(command)k Fu(is)d(a)g(simple)f |
037a8b7f | 8993 | (command)g(\(see)i(Section)f(3.2.1)150 2511 y([Simple)39 |
6e51e0d0 CR |
8994 | b(Commands],)h(page)g(8\);)k(otherwise,)e(it)d(is)g(in)m(terpreted)h |
8995 | (as)f(the)g(\014rst)f(w)m(ord)h(of)g(the)g(simple)150 | |
037a8b7f | 8996 | 2621 y(command.)275 2750 y(When)j(the)i(copro)s(cess)f(is)g(executed,) |
122f603c | 8997 | 48 b(the)43 b(shell)g(creates)i(an)e(arra)m(y)g(v)-5 |
037a8b7f | 8998 | b(ariable)44 b(\(see)g(Section)g(6.7)150 2860 y([Arra)m(ys],)32 |
900a813b | 8999 | b(page)g(90\))h(named)e Ft(NAME)f Fu(in)h(the)h(con)m(text)h(of)e(the)h |
122f603c | 9000 | (executing)g(shell.)44 b(The)31 b(standard)f(output)150 |
037a8b7f | 9001 | 2970 y(of)g Fr(command)j Fu(is)d(connected)g(via)g(a)g(pip)s(e)f(to)i |
122f603c | 9002 | (a)f(\014le)g(descriptor)f(in)g(the)h(executing)h(shell,)f(and)g(that)g |
037a8b7f | 9003 | (\014le)150 3079 y(descriptor)i(is)f(assigned)h(to)g |
6e51e0d0 CR |
9004 | Ft(NAME)p Fu([0].)45 b(The)31 b(standard)g(input)f(of)i |
9005 | Fr(command)j Fu(is)d(connected)h(via)f(a)g(pip)s(e)150 | |
037a8b7f | 9006 | 3189 y(to)39 b(a)g(\014le)f(descriptor)g(in)g(the)g(executing)i(shell,) |
122f603c | 9007 | g(and)e(that)h(\014le)f(descriptor)g(is)g(assigned)h(to)g |
037a8b7f | 9008 | Ft(NAME)p Fu([1].)150 3298 y(This)31 b(pip)s(e)g(is)h(established)g(b)s |
122f603c | 9009 | (efore)g(an)m(y)g(redirections)g(sp)s(eci\014ed)g(b)m(y)f(the)i |
037a8b7f | 9010 | (command)e(\(see)i(Section)g(3.6)150 3408 y([Redirections],)25 |
fc527055 | 9011 | b(page)e(32\).)39 b(The)21 b(\014le)h(descriptors)g(can)g(b)s(e)f |
8e1a6eaa | 9012 | (utilized)i(as)f(argumen)m(ts)h(to)f(shell)g(commands)150 |
037a8b7f | 9013 | 3518 y(and)33 b(redirections)g(using)g(standard)f(w)m(ord)h |
9f178efb | 9014 | (expansions.)49 b(The)33 b(\014le)g(descriptors)g(are)g(not)h(a)m(v)-5 |
037a8b7f | 9015 | b(ailable)35 b(in)150 3627 y(subshells.)275 3757 y(The)27 |
9f178efb CR |
9016 | b(pro)s(cess)h(ID)h(of)f(the)h(shell)f(spa)m(wned)g(to)h(execute)h(the) |
9017 | e(copro)s(cess)h(is)f(a)m(v)-5 b(ailable)31 b(as)d(the)h(v)-5 | |
037a8b7f CR |
9018 | b(alue)29 b(of)150 3867 y(the)k(v)-5 b(ariable)33 b Ft(NAME)p |
9019 | 850 3867 28 4 v 39 w Fu(PID.)g(The)f Ft(wait)f Fu(builtin)h(command)g | |
9f178efb | 9020 | (ma)m(y)h(b)s(e)f(used)g(to)h(w)m(ait)h(for)e(the)h(copro)s(cess)150 |
037a8b7f | 9021 | 3976 y(to)e(terminate.)275 4106 y(Since)20 b(the)g(copro)s(cess)h(is)g |
ad4aef08 | 9022 | (created)g(as)g(an)f(async)m(hronous)g(command,)i(the)f |
037a8b7f | 9023 | Ft(coproc)d Fu(command)i(alw)m(a)m(ys)150 4216 y(returns)29 |
ad4aef08 | 9024 | b(success.)41 b(The)30 b(return)f(status)i(of)f(a)h(copro)s(cess)g(is)f |
037a8b7f CR |
9025 | (the)h(exit)g(status)g(of)f Fr(command)p Fu(.)150 4406 |
9026 | y Fk(3.2.6)63 b(GNU)41 b(P)m(arallel)150 4553 y Fu(There)30 | |
c2fa6583 CR |
9027 | b(are)h(w)m(a)m(ys)g(to)g(run)f(commands)g(in)g(parallel)h(that)h(are)e |
9028 | (not)h(built)g(in)m(to)g(Bash.)41 b(GNU)31 b(P)m(arallel)i(is)150 | |
037a8b7f | 9029 | 4662 y(a)e(to)s(ol)g(to)g(do)f(just)g(that.)275 4792 |
c2fa6583 CR |
9030 | y(GNU)e(P)m(arallel,)i(as)e(its)g(name)f(suggests,)j(can)d(b)s(e)g |
9031 | (used)g(to)h(build)f(and)g(run)f(commands)h(in)h(parallel.)150 | |
037a8b7f | 9032 | 4902 y(Y)-8 b(ou)41 b(ma)m(y)g(run)e(the)h(same)h(command)f(with)g |
220537f2 | 9033 | (di\013eren)m(t)h(argumen)m(ts,)j(whether)39 b(they)i(are)g |
037a8b7f | 9034 | (\014lenames,)150 5011 y(usernames,)27 b(hostnames,)h(or)e(lines)h |
c2fa6583 | 9035 | (read)f(from)h(\014les.)39 b(GNU)27 b(P)m(arallel)i(pro)m(vides)d |
037a8b7f | 9036 | (shorthand)g(references)150 5121 y(to)38 b(man)m(y)g(of)g(the)g(most)g |
c2fa6583 | 9037 | (common)g(op)s(erations)g(\(input)f(lines,)j(v)-5 b(arious)38 |
037a8b7f CR |
9038 | b(p)s(ortions)f(of)h(the)g(input)e(line,)150 5230 y(di\013eren)m(t)f(w) |
9039 | m(a)m(ys)h(to)f(sp)s(ecify)f(the)h(input)f(source,)i(and)e(so)h(on\).) | |
9040 | 54 b(P)m(arallel)36 b(can)f(replace)h Ft(xargs)d Fu(or)i(feed)150 | |
9041 | 5340 y(commands)30 b(from)g(its)h(input)e(sources)h(to)i(sev)m(eral)f | |
9042 | (di\013eren)m(t)g(instances)g(of)g(Bash.)p eop end | |
45c0f7f8 | 9043 | %%Page: 16 22 |
6e51e0d0 | 9044 | TeXDict begin 16 21 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
037a8b7f CR |
9045 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(16)275 299 |
9046 | y(F)-8 b(or)33 b(a)g(complete)h(description,)g(refer)e(to)i(the)f(GNU)g | |
9047 | (P)m(arallel)i(do)s(cumen)m(tation.)48 b(A)33 b(few)f(examples)150 | |
9048 | 408 y(should)d(pro)m(vide)i(a)g(brief)e(in)m(tro)s(duction)i(to)g(its)g | |
9049 | (use.)275 541 y(F)-8 b(or)37 b(example,)i(it)e(is)f(easy)h(to)g | |
9050 | (replace)h Ft(xargs)d Fu(to)i(gzip)g(all)g(h)m(tml)g(\014les)f(in)h | |
9051 | (the)f(curren)m(t)g(directory)150 650 y(and)30 b(its)h(sub)s | |
9052 | (directories:)390 783 y Ft(find)47 b(.)g(-type)f(f)i(-name)e('*.html')g | |
9053 | (-print)g(|)h(parallel)f(gzip)150 915 y Fu(If)30 b(y)m(ou)h(need)f(to)h | |
9054 | (protect)h(sp)s(ecial)f(c)m(haracters)g(suc)m(h)g(as)f(newlines)h(in)f | |
9055 | (\014le)g(names,)h(use)f(\014nd's)f Ft(-print0)150 1025 | |
9056 | y Fu(option)i(and)f(parallel's)h Ft(-0)f Fu(option.)275 | |
9057 | 1157 y(Y)-8 b(ou)34 b(can)g(use)f(P)m(arallel)j(to)e(mo)m(v)m(e)h | |
9058 | (\014les)f(from)f(the)h(curren)m(t)f(directory)h(when)f(the)h(n)m(um)m | |
9059 | (b)s(er)e(of)i(\014les)150 1267 y(is)c(to)s(o)i(large)f(to)g(pro)s | |
9060 | (cess)f(with)g(one)h Ft(mv)f Fu(in)m(v)m(o)s(cation:)390 | |
9061 | 1399 y Ft(ls)47 b(|)h(parallel)d(mv)i({})h(destdir)275 | |
9062 | 1532 y Fu(As)28 b(y)m(ou)h(can)g(see,)g(the)g Fi({})g | |
9063 | Fu(is)g(replaced)g(with)f(eac)m(h)i(line)f(read)f(from)g(standard)g | |
9064 | (input.)39 b(While)29 b(using)150 1641 y Ft(ls)g Fu(will)h(w)m(ork)g | |
9065 | (in)f(most)h(instances,)h(it)f(is)g(not)g(su\016cien)m(t)g(to)h(deal)f | |
9066 | (with)f(all)i(\014lenames.)40 b(If)30 b(y)m(ou)g(need)f(to)150 | |
9067 | 1751 y(accommo)s(date)j(sp)s(ecial)f(c)m(haracters)h(in)e(\014lenames,) | |
9068 | h(y)m(ou)f(can)h(use)390 1883 y Ft(find)47 b(.)g(-depth)f(1)i(\\!)f | |
9069 | (-name)f('.*')h(-print0)f(|)h(parallel)f(-0)h(mv)g({})g(destdir)150 | |
9070 | 2016 y Fu(as)31 b(alluded)f(to)h(ab)s(o)m(v)m(e.)275 | |
9071 | 2148 y(This)e(will)i(run)e(as)h(man)m(y)h Ft(mv)e Fu(commands)h(as)h | |
9072 | (there)f(are)h(\014les)f(in)h(the)f(curren)m(t)g(directory)-8 | |
9073 | b(.)42 b(Y)-8 b(ou)31 b(can)150 2258 y(em)m(ulate)h(a)f(parallel)g | |
9074 | Ft(xargs)e Fu(b)m(y)h(adding)g(the)h Ft(-X)f Fu(option:)390 | |
9075 | 2390 y Ft(find)47 b(.)g(-depth)f(1)i(\\!)f(-name)f('.*')h(-print0)f(|)h | |
9076 | (parallel)f(-0)h(-X)g(mv)g({})g(destdir)275 2523 y Fu(GNU)31 | |
9077 | b(P)m(arallel)i(can)e(replace)h(certain)g(common)g(idioms)f(that)g(op)s | |
9078 | (erate)h(on)f(lines)g(read)g(from)f(a)i(\014le)150 2632 | |
9079 | y(\(in)e(this)h(case,)g(\014lenames)g(listed)g(one)f(p)s(er)g(line\):) | |
9080 | 390 2765 y Ft(while)46 b(IFS=)h(read)g(-r)g(x;)g(do)390 | |
9081 | 2874 y(do-something1)d("$x")j("config-$x")390 2984 y(do-something2)d(<) | |
9082 | k("$x")390 3093 y(done)f(<)g(file)g(|)g(process-output)150 | |
9083 | 3226 y Fu(with)30 b(a)h(more)f(compact)i(syn)m(tax)f(reminiscen)m(t)g | |
9084 | (of)g(lam)m(b)s(das:)390 3358 y Ft(cat)47 b(list)g(|)g(parallel)f | |
c2fa6583 | 9085 | ("do-something1)d({})48 b(config-{})d(;)i(do-something2)e(<)i({}")g(|)g |
037a8b7f | 9086 | (process-output)275 3491 y Fu(P)m(arallel)31 b(pro)m(vides)e(a)h |
c2fa6583 | 9087 | (built-in)g(mec)m(hanism)g(to)g(remo)m(v)m(e)h(\014lename)e |
037a8b7f CR |
9088 | (extensions,)i(whic)m(h)e(lends)g(itself)150 3600 y(to)i(batc)m(h)g |
9089 | (\014le)g(transformations)f(or)g(renaming:)390 3733 y | |
6e51e0d0 | 9090 | Ft(ls)47 b(*.gz)g(|)g(parallel)f(-j+0)g("zcat)h({})g(|)g(bzip2)g |
037a8b7f | 9091 | (>{.}.bz2)e(&&)j(rm)f({}")150 3865 y Fu(This)28 b(will)i(recompress)e |
c2fa6583 | 9092 | (all)i(\014les)f(in)g(the)g(curren)m(t)g(directory)g(with)g(names)g |
037a8b7f | 9093 | (ending)f(in)h(.gz)h(using)f(bzip2,)150 3975 y(running)37 |
6e51e0d0 CR |
9094 | b(one)i(job)f(p)s(er)f(CPU)h(\(-j)p Ft(+)p Fu(0\))i(in)e(parallel.)66 |
9095 | b(\(W)-8 b(e)40 b(use)e Ft(ls)g Fu(for)h(brevit)m(y)g(here;)j(using)c | |
037a8b7f | 9096 | Ft(find)g Fu(as)150 4084 y(ab)s(o)m(v)m(e)e(is)g(more)f(robust)f(in)h |
c2fa6583 | 9097 | (the)h(face)g(of)f(\014lenames)h(con)m(taining)g(unexp)s(ected)f(c)m |
037a8b7f | 9098 | (haracters.\))57 b(P)m(arallel)150 4194 y(can)31 b(tak)m(e)h(argumen)m |
c2fa6583 | 9099 | (ts)e(from)g(the)h(command)f(line;)h(the)f(ab)s(o)m(v)m(e)i(can)f(also) |
037a8b7f CR |
9100 | g(b)s(e)f(written)g(as)390 4326 y Ft(parallel)46 b("zcat)g({})h(|)h |
9101 | (bzip2)e(>{.}.bz2)f(&&)j(rm)f({}")g(:::)g(*.gz)275 4459 | |
6e51e0d0 | 9102 | y Fu(If)24 b(a)i(command)f(generates)h(output,)g(y)m(ou)g(ma)m(y)f(w)m |
c2fa6583 | 9103 | (an)m(t)h(to)g(preserv)m(e)g(the)f(input)f(order)h(in)g(the)g(output.) |
037a8b7f CR |
9104 | 150 4568 y(F)-8 b(or)31 b(instance,)g(the)g(follo)m(wing)h(command)390 |
9105 | 4701 y Ft({)47 b(echo)g(foss.org.my)e(;)i(echo)g(debian.org;)e(echo)h | |
220537f2 | 9106 | (freenetproject.org;)d(})k(|)h(parallel)d(traceroute)150 |
037a8b7f | 9107 | 4833 y Fu(will)31 b(displa)m(y)f(as)h(output)f(the)g(traceroute)i(in)m |
c2fa6583 | 9108 | (v)m(o)s(cation)h(that)e(\014nishes)e(\014rst.)40 b(Adding)30 |
037a8b7f CR |
9109 | b(the)g Ft(-k)g Fu(option)390 4966 y Ft({)47 b(echo)g(foss.org.my)e(;)i |
9110 | (echo)g(debian.org;)e(echo)h(freenetproject.org;)d(})k(|)h(parallel)d | |
9111 | (-k)i(traceroute)150 5098 y Fu(will)31 b(ensure)e(that)i(the)g(output)f | |
9112 | (of)g Ft(traceroute)e(foss.org.my)f Fu(is)k(displa)m(y)m(ed)g(\014rst.) | |
9113 | 275 5230 y(Finally)-8 b(,)31 b(P)m(arallel)h(can)e(b)s(e)f(used)g(to)i | |
9114 | (run)d(a)i(sequence)h(of)f(shell)g(commands)f(in)h(parallel,)h(similar) | |
9115 | f(to)150 5340 y(`)p Ft(cat)g(file)f(|)h(bash)p Fu('.)53 | |
9116 | b(It)35 b(is)g(not)g(uncommon)f(to)i(tak)m(e)g(a)f(list)h(of)f | |
9117 | (\014lenames,)h(create)g(a)g(series)f(of)g(shell)p eop | |
9118 | end | |
1101193a | 9119 | %%Page: 17 23 |
6e51e0d0 | 9120 | TeXDict begin 17 22 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
037a8b7f CR |
9121 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(17)150 299 |
9122 | y(commands)27 b(to)h(op)s(erate)h(on)e(them,)h(and)f(feed)h(that)g | |
9123 | (list)g(of)g(commnds)e(to)j(a)f(shell.)40 b(P)m(arallel)29 | |
9124 | b(can)f(sp)s(eed)150 408 y(this)i(up.)40 b(Assuming)30 | |
9125 | b(that)h Ft(file)e Fu(con)m(tains)i(a)g(list)g(of)g(shell)f(commands,)h | |
9126 | (one)f(p)s(er)g(line,)390 540 y Ft(parallel)46 b(-j)h(10)g(<)g(file)150 | |
9127 | 672 y Fu(will)37 b(ev)-5 b(aluate)38 b(the)f(commands)f(using)g(the)h | |
1101193a | 9128 | (shell)g(\(since)g(no)f(explicit)i(command)e(is)h(supplied)e(as)i(an) |
037a8b7f CR |
9129 | 150 781 y(argumen)m(t\),)31 b(in)f(blo)s(c)m(ks)h(of)g(ten)f(shell)h |
9130 | (jobs)f(at)h(a)g(time.)150 1016 y Fs(3.3)68 b(Shell)45 | |
9131 | b(F)-11 b(unctions)150 1175 y Fu(Shell)35 b(functions)h(are)g(a)g(w)m | |
1101193a | 9132 | (a)m(y)g(to)h(group)e(commands)g(for)h(later)g(execution)h(using)e(a)h |
037a8b7f | 9133 | (single)g(name)g(for)150 1285 y(the)f(group.)55 b(They)35 |
6e51e0d0 CR |
9134 | b(are)g(executed)h(just)f(lik)m(e)h(a)g Ft(")p Fu(regular)p |
9135 | Ft(")f Fu(command.)54 b(When)35 b(the)h(name)f(of)g(a)h(shell)150 | |
037a8b7f | 9136 | 1395 y(function)j(is)g(used)f(as)h(a)h(simple)f(command)g(name,)i(the)e |
1101193a | 9137 | (list)h(of)f(commands)g(asso)s(ciated)i(with)d(that)150 |
037a8b7f | 9138 | 1504 y(function)25 b(name)h(is)g(executed.)40 b(Shell)25 |
1101193a | 9139 | b(functions)g(are)i(executed)f(in)f(the)h(curren)m(t)g(shell)g(con)m |
037a8b7f CR |
9140 | (text;)j(no)c(new)150 1614 y(pro)s(cess)30 b(is)g(created)i(to)f(in)m |
9141 | (terpret)g(them.)275 1745 y(F)-8 b(unctions)30 b(are)h(declared)g | |
9142 | (using)f(this)g(syn)m(tax:)390 1877 y Fj(name)47 b Ft(\(\))g | |
6e51e0d0 | 9143 | Fj(compound-command)c Ft([)48 b Fj(redirections)c Ft(])275 |
037a8b7f | 9144 | 2008 y Fu(or)390 2140 y Ft(function)i Fj(name)g Ft([\(\)])h |
6e51e0d0 | 9145 | Fj(compound-command)c Ft([)48 b Fj(redirections)c Ft(])275 |
037a8b7f | 9146 | 2271 y Fu(This)31 b(de\014nes)h(a)h(shell)g(function)g(named)f |
6e51e0d0 | 9147 | Fr(name)p Fu(.)48 b(The)32 b(reserv)m(ed)h(w)m(ord)f |
037a8b7f | 9148 | Ft(function)f Fu(is)h(optional.)49 b(If)150 2381 y(the)39 |
6e51e0d0 CR |
9149 | b Ft(function)f Fu(reserv)m(ed)h(w)m(ord)g(is)g(supplied,)i(the)e |
9150 | (paren)m(theses)h(are)f(optional.)69 b(The)39 b Fr(b)s(o)s(dy)45 | |
037a8b7f | 9151 | b Fu(of)40 b(the)150 2491 y(function)h(is)h(the)g(comp)s(ound)e |
6e51e0d0 | 9152 | (command)h Fr(comp)s(ound-command)j Fu(\(see)e(Section)h(3.2.4)g([Comp) |
037a8b7f | 9153 | s(ound)150 2600 y(Commands],)33 b(page)h(9\).)49 b(That)33 |
6e51e0d0 CR |
9154 | b(command)f(is)h(usually)g(a)g Fr(list)j Fu(enclosed)e(b)s(et)m(w)m |
9155 | (een)f Fi({)h Fu(and)e Fi(})p Fu(,)i(but)e(ma)m(y)150 | |
037a8b7f | 9156 | 2710 y(b)s(e)39 b(an)m(y)h(comp)s(ound)e(command)i(listed)g(ab)s(o)m(v) |
fc527055 | 9157 | m(e,)j(with)d(one)g(exception:)60 b(If)39 b(the)h Ft(function)e |
037a8b7f | 9158 | Fu(reserv)m(ed)150 2819 y(w)m(ord)g(is)g(used,)h(but)f(the)g(paren)m |
fc527055 | 9159 | (theses)h(are)f(not)h(supplied,)g(the)f(braces)g(are)h(required.)63 |
037a8b7f | 9160 | b Fr(comp)s(ound-)150 2929 y(command)39 b Fu(is)c(executed)h(whenev)m |
fc527055 | 9161 | (er)f Fr(name)41 b Fu(is)35 b(sp)s(eci\014ed)g(as)g(the)h(name)f(of)h |
037a8b7f | 9162 | (a)f(command.)56 b(When)35 b(the)150 3038 y(shell)d(is)h(in)f |
fc527055 | 9163 | Fm(posix)f Fu(mo)s(de)h(\(see)h(Section)g(6.11)h([Bash)f(POSIX)e(Mo)s |
900a813b | 9164 | (de],)j(page)f(95\),)h Fr(name)j Fu(ma)m(y)c(not)g(b)s(e)150 |
037a8b7f | 9165 | 3148 y(the)k(same)g(as)g(one)g(of)g(the)f(sp)s(ecial)i(builtins)e |
967625cd | 9166 | (\(see)h(Section)h(4.4)g([Sp)s(ecial)f(Builtins],)i(page)e(69\).)61 |
037a8b7f | 9167 | b(An)m(y)150 3258 y(redirections)32 b(\(see)g(Section)h(3.6)f |
fc527055 | 9168 | ([Redirections],)i(page)e(32\))h(asso)s(ciated)g(with)e(the)h(shell)f |
037a8b7f CR |
9169 | (function)h(are)150 3367 y(p)s(erformed)d(when)g(the)i(function)f(is)g |
9170 | (executed.)275 3499 y(A)44 b(function)g(de\014nition)h(ma)m(y)g(b)s(e)f | |
fc527055 | 9171 | (deleted)h(using)f(the)h Ft(-f)f Fu(option)h(to)g(the)g |
037a8b7f CR |
9172 | Ft(unset)e Fu(builtin)h(\(see)150 3608 y(Section)31 b(4.1)h([Bourne)e |
9173 | (Shell)g(Builtins],)h(page)h(41\).)275 3740 y(The)26 | |
fc527055 CR |
9174 | b(exit)i(status)g(of)f(a)h(function)f(de\014nition)g(is)g(zero)h |
9175 | (unless)f(a)g(syn)m(tax)h(error)f(o)s(ccurs)g(or)g(a)h(readonly)150 | |
037a8b7f | 9176 | 3849 y(function)k(with)f(the)i(same)f(name)g(already)h(exists.)46 |
fc527055 | 9177 | b(When)32 b(executed,)h(the)f(exit)h(status)g(of)f(a)g(function)150 |
037a8b7f CR |
9178 | 3959 y(is)e(the)h(exit)g(status)g(of)f(the)h(last)g(command)f(executed) |
9179 | i(in)e(the)g(b)s(o)s(dy)-8 b(.)275 4091 y(Note)22 b(that)f(for)f | |
fc527055 | 9180 | (historical)i(reasons,)h(in)e(the)g(most)g(common)g(usage)g(the)g |
037a8b7f | 9181 | (curly)f(braces)h(that)g(surround)150 4200 y(the)38 b(b)s(o)s(dy)d(of)j |
fc527055 CR |
9182 | (the)f(function)g(m)m(ust)g(b)s(e)g(separated)h(from)f(the)g(b)s(o)s |
9183 | (dy)f(b)m(y)h Ft(blank)p Fu(s)f(or)h(newlines.)62 b(This)150 | |
037a8b7f | 9184 | 4310 y(is)38 b(b)s(ecause)g(the)h(braces)f(are)h(reserv)m(ed)f(w)m |
fc527055 | 9185 | (ords)g(and)f(are)i(only)f(recognized)i(as)e(suc)m(h)g(when)f(they)i |
037a8b7f | 9186 | (are)150 4419 y(separated)26 b(from)f(the)h(command)f(list)i(b)m(y)e |
fc527055 | 9187 | (whitespace)h(or)g(another)g(shell)g(metac)m(haracter.)41 |
037a8b7f | 9188 | b(Also,)28 b(when)150 4529 y(using)i(the)g(braces,)h(the)g |
fc527055 | 9189 | Fr(list)i Fu(m)m(ust)d(b)s(e)g(terminated)h(b)m(y)f(a)h(semicolon,)h(a) |
037a8b7f | 9190 | e(`)p Ft(&)p Fu(',)h(or)g(a)f(newline.)275 4660 y(When)i(a)i(function)f |
fc527055 | 9191 | (is)g(executed,)i(the)e(argumen)m(ts)h(to)g(the)f(function)g(b)s(ecome) |
037a8b7f | 9192 | g(the)h(p)s(ositional)g(pa-)150 4770 y(rameters)42 b(during)e(its)i |
ac18b312 | 9193 | (execution)h(\(see)f(Section)g(3.4.1)h([P)m(ositional)h(P)m |
037a8b7f CR |
9194 | (arameters],)i(page)c(19\).)75 b(The)150 4880 y(sp)s(ecial)37 |
9195 | b(parameter)f(`)p Ft(#)p Fu(')g(that)h(expands)e(to)i(the)f(n)m(um)m(b) | |
9196 | s(er)f(of)h(p)s(ositional)h(parameters)f(is)g(up)s(dated)f(to)150 | |
9197 | 4989 y(re\015ect)h(the)f(c)m(hange.)56 b(Sp)s(ecial)35 | |
9198 | b(parameter)h Ft(0)f Fu(is)g(unc)m(hanged.)54 b(The)35 | |
9199 | b(\014rst)f(elemen)m(t)j(of)e(the)g Ft(FUNCNAME)150 5099 | |
9200 | y Fu(v)-5 b(ariable)31 b(is)g(set)f(to)i(the)e(name)h(of)f(the)h | |
9201 | (function)f(while)g(the)h(function)f(is)g(executing.)275 | |
9202 | 5230 y(All)25 b(other)g(asp)s(ects)g(of)g(the)g(shell)g(execution)h(en) | |
9203 | m(vironmen)m(t)g(are)f(iden)m(tical)h(b)s(et)m(w)m(een)g(a)f(function)g | |
9204 | (and)150 5340 y(its)35 b(caller)i(with)d(these)i(exceptions:)50 | |
9205 | b(the)36 b Ft(DEBUG)d Fu(and)h Ft(RETURN)g Fu(traps)g(are)i(not)f | |
9206 | (inherited)f(unless)h(the)p eop end | |
c2fa6583 | 9207 | %%Page: 18 24 |
6e51e0d0 | 9208 | TeXDict begin 18 23 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
fc527055 | 9209 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(18)150 299 |
037a8b7f CR |
9210 | y(function)26 b(has)g(b)s(een)f(giv)m(en)i(the)g Ft(trace)d |
9211 | Fu(attribute)j(using)f(the)g Ft(declare)e Fu(builtin)i(or)g(the)h | |
9212 | Ft(-o)i(functrace)150 408 y Fu(option)f(has)e(b)s(een)h(enabled)g(with) | |
9213 | g(the)g Ft(set)f Fu(builtin,)i(\(in)f(whic)m(h)f(case)j(all)f | |
9214 | (functions)e(inherit)h(the)g Ft(DEBUG)150 518 y Fu(and)33 | |
9215 | b Ft(RETURN)f Fu(traps\),)j(and)e(the)h Ft(ERR)f Fu(trap)h(is)g(not)g | |
9216 | (inherited)f(unless)g(the)h Ft(-o)c(errtrace)h Fu(shell)j(option)150 | |
9217 | 628 y(has)h(b)s(een)f(enabled.)55 b(See)35 b(Section)h(4.1)g([Bourne)f | |
9218 | (Shell)g(Builtins],)i(page)f(41,)i(for)c(the)i(description)f(of)150 | |
9219 | 737 y(the)c Ft(trap)e Fu(builtin.)275 885 y(The)38 b | |
9220 | Ft(FUNCNEST)f Fu(v)-5 b(ariable,)42 b(if)d(set)h(to)g(a)g(n)m(umeric)f | |
9221 | (v)-5 b(alue)39 b(greater)h(than)f(0,)j(de\014nes)d(a)g(maxim)m(um)150 | |
9222 | 995 y(function)24 b(nesting)h(lev)m(el.)40 b(F)-8 b(unction)25 | |
220537f2 | 9223 | b(in)m(v)m(o)s(cations)i(that)e(exceed)g(the)g(limit)g(cause)g(the)g |
037a8b7f CR |
9224 | (en)m(tire)g(command)150 1105 y(to)31 b(ab)s(ort.)275 |
9225 | 1253 y(If)37 b(the)g(builtin)g(command)h Ft(return)d | |
6e51e0d0 | 9226 | Fu(is)j(executed)g(in)g(a)g(function,)h(the)e(function)h(completes)h |
037a8b7f | 9227 | (and)150 1362 y(execution)25 b(resumes)e(with)h(the)g(next)g(command)f |
220537f2 | 9228 | (after)i(the)f(function)f(call.)40 b(An)m(y)24 b(command)f(asso)s |
037a8b7f | 9229 | (ciated)150 1472 y(with)36 b(the)h Ft(RETURN)d Fu(trap)i(is)h(executed) |
220537f2 | 9230 | g(b)s(efore)f(execution)i(resumes.)57 b(When)37 b(a)f(function)g |
037a8b7f | 9231 | (completes,)150 1581 y(the)h(v)-5 b(alues)38 b(of)f(the)g(p)s |
220537f2 | 9232 | (ositional)h(parameters)f(and)g(the)g(sp)s(ecial)h(parameter)f(`)p |
037a8b7f | 9233 | Ft(#)p Fu(')g(are)h(restored)f(to)h(the)150 1691 y(v)-5 |
220537f2 CR |
9234 | b(alues)26 b(they)f(had)g(prior)f(to)i(the)g(function's)f(execution.)40 |
9235 | b(If)25 b(a)h(n)m(umeric)f(argumen)m(t)h(is)f(giv)m(en)h(to)g | |
037a8b7f | 9236 | Ft(return)p Fu(,)150 1801 y(that)j(is)g(the)f(function's)h(return)e |
220537f2 | 9237 | (status;)j(otherwise)f(the)f(function's)h(return)e(status)i(is)f(the)h |
037a8b7f CR |
9238 | (exit)h(status)150 1910 y(of)h(the)f(last)h(command)f(executed)i(b)s |
9239 | (efore)e(the)g Ft(return)p Fu(.)275 2058 y(V)-8 b(ariables)31 | |
45c0f7f8 | 9240 | b(lo)s(cal)g(to)f(the)g(function)f(ma)m(y)i(b)s(e)e(declared)h(with)f |
6e51e0d0 | 9241 | (the)h Ft(local)f Fu(builtin.)40 b(These)29 b(v)-5 b(ariables)150 |
037a8b7f CR |
9242 | 2168 y(are)31 b(visible)g(only)f(to)h(the)g(function)f(and)g(the)g |
9243 | (commands)g(it)h(in)m(v)m(ok)m(es.)275 2316 y(F)-8 b(unction)51 | |
6e51e0d0 | 9244 | b(names)f(and)g(de\014nitions)g(ma)m(y)i(b)s(e)e(listed)h(with)f(the)h |
037a8b7f | 9245 | Ft(-f)f Fu(option)h(to)g(the)g Ft(declare)150 2426 y |
6e51e0d0 CR |
9246 | Fu(\()p Ft(typeset)p Fu(\))35 b(builtin)g(command)h(\(see)h(Section)g |
9247 | (4.2)g([Bash)f(Builtins],)i(page)f(48\).)59 b(The)35 | |
037a8b7f | 9248 | b Ft(-F)h Fu(option)g(to)150 2535 y Ft(declare)e Fu(or)i |
6e51e0d0 | 9249 | Ft(typeset)e Fu(will)i(list)h(the)f(function)g(names)g(only)g(\(and)g |
037a8b7f | 9250 | (optionally)h(the)f(source)g(\014le)h(and)150 2645 y(line)c(n)m(um)m(b) |
6e51e0d0 CR |
9251 | s(er,)g(if)f(the)h Ft(extdebug)e Fu(shell)i(option)g(is)g(enabled\).)49 |
9252 | b(F)-8 b(unctions)33 b(ma)m(y)h(b)s(e)e(exp)s(orted)g(so)h(that)150 | |
037a8b7f | 9253 | 2754 y(subshells)j(automatically)k(ha)m(v)m(e)f(them)e(de\014ned)f |
6e51e0d0 | 9254 | (with)h(the)h Ft(-f)e Fu(option)i(to)g(the)g Ft(export)d |
037a8b7f | 9255 | Fu(builtin)i(\(see)150 2864 y(Section)c(4.1)g([Bourne)f(Shell)g |
6e51e0d0 | 9256 | (Builtins],)i(page)f(41\).)47 b(Note)33 b(that)g(shell)f(functions)g |
037a8b7f | 9257 | (and)f(v)-5 b(ariables)33 b(with)150 2973 y(the)d(same)g(name)g(ma)m(y) |
6e51e0d0 | 9258 | g(result)g(in)g(m)m(ultiple)g(iden)m(tically-named)i(en)m(tries)f(in)e |
037a8b7f | 9259 | (the)h(en)m(vironmen)m(t)g(passed)150 3083 y(to)h(the)g(shell's)f(c)m |
6e51e0d0 | 9260 | (hildren.)41 b(Care)30 b(should)g(b)s(e)f(tak)m(en)j(in)e(cases)h |
037a8b7f | 9261 | (where)f(this)g(ma)m(y)h(cause)g(a)g(problem.)275 3231 |
6e51e0d0 CR |
9262 | y(F)-8 b(unctions)33 b(ma)m(y)g(b)s(e)g(recursiv)m(e.)48 |
9263 | b(The)32 b Ft(FUNCNEST)f Fu(v)-5 b(ariable)34 b(ma)m(y)f(b)s(e)f(used)g | |
037a8b7f | 9264 | (to)i(limit)g(the)f(depth)f(of)150 3341 y(the)27 b(function)f(call)i |
6e51e0d0 CR |
9265 | (stac)m(k)h(and)d(restrict)h(the)g(n)m(um)m(b)s(er)f(of)h(function)f |
9266 | (in)m(v)m(o)s(cations.)42 b(By)27 b(default,)g(no)g(limit)150 | |
037a8b7f CR |
9267 | 3450 y(is)j(placed)h(on)g(the)f(n)m(um)m(b)s(er)f(of)i(recursiv)m(e)f |
9268 | (calls.)150 3711 y Fs(3.4)68 b(Shell)45 b(P)l(arameters)150 | |
9269 | 3871 y Fu(A)23 b Fr(parameter)31 b Fu(is)23 b(an)g(en)m(tit)m(y)i(that) | |
9ec5ed66 | 9270 | f(stores)g(v)-5 b(alues.)39 b(It)23 b(can)h(b)s(e)f(a)g |
6e51e0d0 | 9271 | Ft(name)p Fu(,)h(a)g(n)m(um)m(b)s(er,)f(or)h(one)f(of)h(the)f(sp)s |
037a8b7f | 9272 | (ecial)150 3980 y(c)m(haracters)i(listed)e(b)s(elo)m(w.)39 |
6e51e0d0 CR |
9273 | b(A)23 b Fr(v)-5 b(ariable)30 b Fu(is)23 b(a)g(parameter)h(denoted)f(b) |
9274 | m(y)h(a)f Ft(name)p Fu(.)37 b(A)24 b(v)-5 b(ariable)24 | |
037a8b7f | 9275 | b(has)f(a)g Fr(v)-5 b(alue)150 4090 y Fu(and)33 b(zero)i(or)f(more)g |
6e51e0d0 | 9276 | Fr(attributes)p Fu(.)52 b(A)m(ttributes)35 b(are)f(assigned)g(using)g |
037a8b7f | 9277 | (the)g Ft(declare)e Fu(builtin)h(command)150 4200 y(\(see)e(the)g |
6e51e0d0 | 9278 | (description)f(of)h(the)f Ft(declare)f Fu(builtin)h(in)g(Section)h(4.2) |
037a8b7f | 9279 | g([Bash)g(Builtins],)g(page)g(48\).)275 4348 y(A)d(parameter)h(is)g |
c302751c CR |
9280 | (set)g(if)f(it)h(has)f(b)s(een)g(assigned)h(a)g(v)-5 |
9281 | b(alue.)40 b(The)28 b(n)m(ull)h(string)f(is)h(a)g(v)-5 | |
037a8b7f | 9282 | b(alid)28 b(v)-5 b(alue.)41 b(Once)150 4457 y(a)31 b(v)-5 |
c302751c | 9283 | b(ariable)31 b(is)f(set,)i(it)e(ma)m(y)h(b)s(e)f(unset)g(only)h(b)m(y)f |
037a8b7f | 9284 | (using)g(the)g Ft(unset)f Fu(builtin)h(command.)275 4605 |
c302751c | 9285 | y(A)g(v)-5 b(ariable)31 b(ma)m(y)g(b)s(e)f(assigned)g(to)i(b)m(y)e(a)h |
037a8b7f CR |
9286 | (statemen)m(t)h(of)e(the)h(form)390 4754 y Fj(name)p |
9287 | Ft(=[)p Fj(value)p Ft(])150 4902 y Fu(If)j Fr(v)-5 b(alue)40 | |
9288 | b Fu(is)35 b(not)g(giv)m(en,)h(the)f(v)-5 b(ariable)35 | |
9289 | b(is)g(assigned)g(the)f(n)m(ull)h(string.)53 b(All)35 | |
9290 | b Fr(v)-5 b(alue)5 b Fu(s)35 b(undergo)f(tilde)h(ex-)150 | |
9291 | 5011 y(pansion,)h(parameter)f(and)f(v)-5 b(ariable)36 | |
e1e48bba | 9292 | b(expansion,)f(command)g(substitution,)h(arithmetic)g(expansion,)150 |
037a8b7f | 9293 | 5121 y(and)k(quote)h(remo)m(v)-5 b(al)42 b(\(detailed)h(b)s(elo)m(w\).) |
6e51e0d0 | 9294 | 72 b(If)40 b(the)h(v)-5 b(ariable)41 b(has)g(its)g Ft(integer)e |
037a8b7f | 9295 | Fu(attribute)i(set,)j(then)150 5230 y Fr(v)-5 b(alue)38 |
6e51e0d0 CR |
9296 | b Fu(is)33 b(ev)-5 b(aluated)34 b(as)f(an)g(arithmetic)h(expression)f |
9297 | (ev)m(en)h(if)e(the)h Ft($\(\(...)o(\)\))f Fu(expansion)h(is)g(not)g | |
037a8b7f | 9298 | (used)150 5340 y(\(see)e(Section)g(3.5.5)i([Arithmetic)e(Expansion],)f |
fc527055 | 9299 | (page)h(29\).)42 b(W)-8 b(ord)31 b(splitting)g(is)g(not)f(p)s |
037a8b7f CR |
9300 | (erformed,)f(with)p eop end |
9301 | %%Page: 19 25 | |
9302 | TeXDict begin 19 24 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9303 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(19)150 299 | |
9304 | y(the)35 b(exception)h(of)f Ft("$@")f Fu(as)h(explained)g(b)s(elo)m(w.) | |
9305 | 54 b(Filename)36 b(expansion)f(is)g(not)g(p)s(erformed.)53 | |
9306 | b(Assign-)150 408 y(men)m(t)33 b(statemen)m(ts)h(ma)m(y)f(also)g(app)s | |
9307 | (ear)f(as)g(argumen)m(ts)h(to)g(the)g Ft(alias)p Fu(,)e | |
9308 | Ft(declare)p Fu(,)g Ft(typeset)p Fu(,)g Ft(export)p Fu(,)150 | |
9309 | 518 y Ft(readonly)p Fu(,)38 b(and)g Ft(local)f Fu(builtin)h(commands)g | |
9310 | (\()p Fr(declaration)j Fu(commands\).)64 b(When)39 b(in)f | |
9311 | Fm(posix)f Fu(mo)s(de)150 628 y(\(see)c(Section)f(6.11)h([Bash)g(POSIX) | |
9312 | d(Mo)s(de],)j(page)f(95\),)i(these)e(builtins)f(ma)m(y)i(app)s(ear)e | |
9313 | (in)g(a)h(command)150 737 y(after)i(one)g(or)f(more)h(instances)g(of)f | |
9314 | (the)h Ft(command)d Fu(builtin)i(and)g(retain)h(these)g(assignmen)m(t)g | |
9315 | (statemen)m(t)150 847 y(prop)s(erties.)275 977 y(In)29 | |
fc527055 CR |
9316 | b(the)h(con)m(text)i(where)d(an)h(assignmen)m(t)h(statemen)m(t)h(is)e |
9317 | (assigning)g(a)h(v)-5 b(alue)30 b(to)h(a)f(shell)g(v)-5 | |
037a8b7f | 9318 | b(ariable)31 b(or)150 1086 y(arra)m(y)24 b(index)f(\(see)h(Section)g |
900a813b | 9319 | (6.7)g([Arra)m(ys],)i(page)e(90\),)i(the)e(`)p Ft(+=)p |
fc527055 | 9320 | Fu(')f(op)s(erator)g(can)h(b)s(e)f(used)f(to)i(app)s(end)e(to)i(or)150 |
037a8b7f | 9321 | 1196 y(add)k(to)i(the)f(v)-5 b(ariable's)30 b(previous)e(v)-5 |
fc527055 | 9322 | b(alue.)41 b(This)28 b(includes)g(argumen)m(ts)i(to)f(builtin)g |
037a8b7f | 9323 | (commands)f(suc)m(h)h(as)150 1305 y Ft(declare)e Fu(that)i(accept)h |
fc527055 CR |
9324 | (assignmen)m(t)f(statemen)m(ts)h(\()p Fr(declaration)h |
9325 | Fu(commands\).)40 b(When)28 b(`)p Ft(+=)p Fu(')h(is)f(applied)150 | |
037a8b7f | 9326 | 1415 y(to)d(a)f(v)-5 b(ariable)24 b(for)g(whic)m(h)f(the)h |
fc527055 CR |
9327 | Fr(in)m(teger)32 b Fu(attribute)24 b(has)g(b)s(een)f(set,)j |
9328 | Fr(v)-5 b(alue)29 b Fu(is)24 b(ev)-5 b(aluated)25 b(as)f(an)g | |
037a8b7f | 9329 | (arithmetic)150 1525 y(expression)30 b(and)f(added)g(to)i(the)f(v)-5 |
fc527055 CR |
9330 | b(ariable's)30 b(curren)m(t)g(v)-5 b(alue,)31 b(whic)m(h)e(is)h(also)h |
9331 | (ev)-5 b(aluated.)42 b(When)29 b(`)p Ft(+=)p Fu(')h(is)150 | |
037a8b7f | 9332 | 1634 y(applied)25 b(to)h(an)f(arra)m(y)h(v)-5 b(ariable)26 |
fc527055 | 9333 | b(using)f(comp)s(ound)f(assignmen)m(t)i(\(see)g(Section)g(6.7)g([Arra)m |
037a8b7f | 9334 | (ys],)h(page)f(90\),)150 1744 y(the)33 b(v)-5 b(ariable's)33 |
fc527055 CR |
9335 | b(v)-5 b(alue)33 b(is)g(not)g(unset)f(\(as)h(it)g(is)g(when)e(using)i |
9336 | (`)p Ft(=)p Fu('\),)g(and)f(new)g(v)-5 b(alues)33 b(are)g(app)s(ended)e | |
037a8b7f | 9337 | (to)150 1853 y(the)26 b(arra)m(y)h(b)s(eginning)e(at)i(one)f(greater)h |
fc527055 | 9338 | (than)f(the)g(arra)m(y's)h(maxim)m(um)f(index)f(\(for)i(indexed)e(arra) |
037a8b7f | 9339 | m(ys\),)j(or)150 1963 y(added)c(as)i(additional)g(k)m(ey-v)-5 |
fc527055 CR |
9340 | b(alue)26 b(pairs)f(in)g(an)g(asso)s(ciativ)m(e)j(arra)m(y)-8 |
9341 | b(.)40 b(When)24 b(applied)h(to)h(a)g(string-v)-5 b(alued)150 | |
037a8b7f | 9342 | 2073 y(v)g(ariable,)31 b Fr(v)-5 b(alue)36 b Fu(is)31 |
fc527055 | 9343 | b(expanded)e(and)h(app)s(ended)f(to)i(the)f(v)-5 b(ariable's)32 |
037a8b7f | 9344 | b(v)-5 b(alue.)275 2202 y(A)41 b(v)-5 b(ariable)42 b(can)f(b)s(e)f |
fc527055 | 9345 | (assigned)i(the)f Fr(nameref)58 b Fu(attribute)42 b(using)f(the)g |
037a8b7f | 9346 | Ft(-n)f Fu(option)i(to)g(the)f Ft(\\)p Fu(fBde-)150 2312 |
fc527055 CR |
9347 | y(clare)p Ft(\\)p Fu(fP)j(or)f Ft(\\)p Fu(fBlo)s(cal)p |
9348 | Ft(\\)p Fu(fP)h(builtin)e(commands)h(\(see)h(Section)h(4.2)f([Bash)g | |
037a8b7f | 9349 | (Builtins],)j(page)d(48\))g(to)150 2422 y(create)37 b(a)e |
fc527055 CR |
9350 | Fr(nameref)p Fu(,)h(or)f(a)h(reference)f(to)h(another)g(v)-5 |
9351 | b(ariable.)55 b(This)34 b(allo)m(ws)j(v)-5 b(ariables)35 | |
037a8b7f | 9352 | b(to)h(b)s(e)f(manipu-)150 2531 y(lated)k(indirectly)-8 |
fc527055 CR |
9353 | b(.)64 b(Whenev)m(er)38 b(the)h(nameref)e(v)-5 b(ariable)39 |
9354 | b(is)f(referenced,)i(assigned)e(to,)j(unset,)e(or)f(has)150 | |
037a8b7f | 9355 | 2641 y(its)d(attributes)g(mo)s(di\014ed)f(\(other)h(than)f(the)h |
fc527055 | 9356 | (nameref)f(attribute)i(itself)7 b(\),)37 b(the)e(op)s(eration)g(is)f |
037a8b7f | 9357 | (actually)150 2750 y(p)s(erformed)23 b(on)i(the)g(v)-5 |
fc527055 CR |
9358 | b(ariable)25 b(sp)s(eci\014ed)f(b)m(y)h(the)g(nameref)f(v)-5 |
9359 | b(ariable's)26 b(v)-5 b(alue.)39 b(A)25 b(nameref)g(is)f(commonly)150 | |
037a8b7f | 9360 | 2860 y(used)f(within)g(shell)h(functions)g(to)g(refer)g(to)g(a)g(v)-5 |
fc527055 | 9361 | b(ariable)25 b(whose)e(name)h(is)g(passed)f(as)h(an)g(argumen)m(t)g(to) |
037a8b7f | 9362 | h(the)150 2970 y(function.)40 b(F)-8 b(or)28 b(instance,)i(if)e(a)g(v) |
fc527055 | 9363 | -5 b(ariable)29 b(name)f(is)g(passed)g(to)h(a)f(shell)g(function)g(as)g |
037a8b7f CR |
9364 | (its)h(\014rst)e(argumen)m(t,)150 3079 y(running)390 |
9365 | 3209 y Ft(declare)46 b(-n)h(ref=$1)150 3339 y Fu(inside)31 | |
fc527055 CR |
9366 | b(the)h(function)f(creates)i(a)g(nameref)e(v)-5 b(ariable)32 |
9367 | b Fr(ref)49 b Fu(whose)32 b(v)-5 b(alue)32 b(is)g(the)f(v)-5 | |
037a8b7f | 9368 | b(ariable)33 b(name)e(passed)150 3448 y(as)e(the)h(\014rst)e(argumen)m |
fc527055 CR |
9369 | (t.)41 b(References)30 b(and)e(assignmen)m(ts)i(to)g |
9370 | Fr(ref)p Fu(,)f(and)g(c)m(hanges)h(to)g(its)f(attributes,)i(are)150 | |
037a8b7f | 9371 | 3558 y(treated)g(as)f(references,)g(assignmen)m(ts,)h(and)e(attribute)i |
fc527055 | 9372 | (mo)s(di\014cations)f(to)h(the)f(v)-5 b(ariable)30 b(whose)g(name)150 |
037a8b7f | 9373 | 3668 y(w)m(as)h(passed)f(as)g Ft($1)p Fu(.)275 3798 y(If)h(the)g(con)m |
fc527055 CR |
9374 | (trol)i(v)-5 b(ariable)32 b(in)g(a)f Ft(for)g Fu(lo)s(op)h(has)f(the)g |
9375 | (nameref)h(attribute,)g(the)g(list)g(of)g(w)m(ords)f(can)h(b)s(e)150 | |
037a8b7f | 9376 | 3907 y(a)h(list)h(of)f(shell)g(v)-5 b(ariables,)34 b(and)e(a)i(name)f |
fc527055 | 9377 | (reference)g(will)g(b)s(e)f(established)h(for)g(eac)m(h)h(w)m(ord)e(in) |
037a8b7f | 9378 | h(the)g(list,)150 4017 y(in)c(turn,)g(when)g(the)h(lo)s(op)g(is)g |
fc527055 | 9379 | (executed.)41 b(Arra)m(y)30 b(v)-5 b(ariables)30 b(cannot)h(b)s(e)e |
037a8b7f | 9380 | (giv)m(en)h(the)g(nameref)g(attribute.)150 4126 y(Ho)m(w)m(ev)m(er,)39 |
fc527055 CR |
9381 | b(nameref)d(v)-5 b(ariables)36 b(can)g(reference)g(arra)m(y)g(v)-5 |
9382 | b(ariables)37 b(and)e(subscripted)f(arra)m(y)i(v)-5 b(ariables.)150 | |
037a8b7f | 9383 | 4236 y(Namerefs)36 b(can)f(b)s(e)g(unset)g(using)g(the)h |
fc527055 | 9384 | Ft(-n)e Fu(option)i(to)g(the)g Ft(unset)e Fu(builtin)h(\(see)h(Section) |
037a8b7f | 9385 | g(4.1)h([Bourne)150 4345 y(Shell)43 b(Builtins],)j(page)e(41\).)79 |
fc527055 | 9386 | b(Otherwise,)45 b(if)e Ft(unset)e Fu(is)i(executed)h(with)e(the)h(name) |
037a8b7f | 9387 | g(of)g(a)g(nameref)150 4455 y(v)-5 b(ariable)31 b(as)g(an)f(argumen)m |
fc527055 | 9388 | (t,)h(the)g(v)-5 b(ariable)31 b(referenced)f(b)m(y)g(the)h(nameref)f(v) |
037a8b7f CR |
9389 | -5 b(ariable)31 b(will)g(b)s(e)f(unset.)150 4645 y Fk(3.4.1)63 |
9390 | b(P)m(ositional)41 b(P)m(arameters)150 4792 y Fu(A)28 | |
9391 | b Fr(p)s(ositional)h(parameter)35 b Fu(is)28 b(a)g(parameter)g(denoted) | |
9392 | g(b)m(y)g(one)g(or)g(more)g(digits,)h(other)g(than)e(the)h(single)150 | |
9393 | 4902 y(digit)34 b Ft(0)p Fu(.)48 b(P)m(ositional)36 b(parameters)d(are) | |
9394 | g(assigned)h(from)e(the)i(shell's)f(argumen)m(ts)g(when)f(it)i(is)f(in) | |
9395 | m(v)m(ok)m(ed,)150 5011 y(and)38 b(ma)m(y)i(b)s(e)e(reassigned)i(using) | |
9396 | e(the)h Ft(set)g Fu(builtin)f(command.)67 b(P)m(ositional)41 | |
9397 | b(parameter)e Ft(N)g Fu(ma)m(y)h(b)s(e)150 5121 y(referenced)34 | |
6e51e0d0 CR |
9398 | b(as)h Ft(${N})p Fu(,)g(or)f(as)h Ft($N)e Fu(when)h Ft(N)g |
9399 | Fu(consists)h(of)f(a)h(single)g(digit.)54 b(P)m(ositional)37 | |
037a8b7f | 9400 | b(parameters)d(ma)m(y)150 5230 y(not)j(b)s(e)f(assigned)h(to)g(with)f |
6e51e0d0 CR |
9401 | (assignmen)m(t)i(statemen)m(ts.)61 b(The)36 b Ft(set)g |
9402 | Fu(and)g Ft(shift)f Fu(builtins)h(are)h(used)f(to)150 | |
037a8b7f CR |
9403 | 5340 y(set)k(and)f(unset)f(them)i(\(see)g(Chapter)f(4)g([Shell)h |
9404 | (Builtin)g(Commands],)h(page)f(41\).)68 b(The)39 b(p)s(ositional)p | |
9405 | eop end | |
9406 | %%Page: 20 26 | |
9407 | TeXDict begin 20 25 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9408 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(20)150 299 | |
9409 | y(parameters)44 b(are)g(temp)s(orarily)g(replaced)h(when)e(a)h(shell)g | |
9410 | (function)g(is)g(executed)g(\(see)h(Section)g(3.3)150 | |
9411 | 408 y([Shell)30 b(F)-8 b(unctions],)32 b(page)f(17\).)275 | |
9412 | 540 y(When)c(a)i(p)s(ositional)g(parameter)g(consisting)f(of)h(more)f | |
1101193a | 9413 | (than)g(a)g(single)h(digit)g(is)f(expanded,)g(it)h(m)m(ust)150 |
037a8b7f CR |
9414 | 650 y(b)s(e)h(enclosed)h(in)f(braces.)150 844 y Fk(3.4.2)63 |
9415 | b(Sp)s(ecial)41 b(P)m(arameters)150 991 y Fu(The)d(shell)g(treats)h | |
1101193a CR |
9416 | (sev)m(eral)g(parameters)f(sp)s(ecially)-8 b(.)65 b(These)38 |
9417 | b(parameters)h(ma)m(y)f(only)g(b)s(e)g(referenced;)150 | |
037a8b7f CR |
9418 | 1101 y(assignmen)m(t)31 b(to)g(them)g(is)f(not)h(allo)m(w)m(ed.)150 |
9419 | 1255 y Ft(*)432 b Fu(\($*\))38 b(Expands)d(to)i(the)f(p)s(ositional)h | |
6e51e0d0 | 9420 | (parameters,)h(starting)f(from)f(one.)59 b(When)36 b(the)g(ex-)630 |
037a8b7f CR |
9421 | 1365 y(pansion)h(is)h(not)g(within)f(double)g(quotes,)j(eac)m(h)f(p)s |
9422 | (ositional)f(parameter)g(expands)f(to)i(a)630 1474 y(separate)e(w)m | |
595e3e69 | 9423 | (ord.)56 b(In)35 b(con)m(texts)i(where)e(it)h(is)g(p)s(erformed,)g |
037a8b7f | 9424 | (those)g(w)m(ords)f(are)h(sub)5 b(ject)35 b(to)630 1584 |
595e3e69 | 9425 | y(further)h(w)m(ord)h(splitting)h(and)f(pathname)g(expansion.)61 |
037a8b7f | 9426 | b(When)38 b(the)f(expansion)g(o)s(ccurs)630 1694 y(within)25 |
595e3e69 | 9427 | b(double)h(quotes,)h(it)f(expands)f(to)i(a)f(single)g(w)m(ord)f(with)h |
037a8b7f | 9428 | (the)g(v)-5 b(alue)26 b(of)g(eac)m(h)h(param-)630 1803 |
595e3e69 CR |
9429 | y(eter)32 b(separated)h(b)m(y)e(the)h(\014rst)f(c)m(haracter)i(of)f |
9430 | (the)g Ft(IFS)f Fu(sp)s(ecial)h(v)-5 b(ariable.)45 b(That)32 | |
037a8b7f | 9431 | b(is,)g Ft("$*")630 1913 y Fu(is)f(equiv)-5 b(alen)m(t)32 |
595e3e69 CR |
9432 | b(to)g Ft("$1)p Fj(c)p Ft($2)p Fj(c)p Ft(...)m(")p Fu(,)f(where)g |
9433 | Fr(c)37 b Fu(is)31 b(the)g(\014rst)f(c)m(haracter)j(of)e(the)g(v)-5 | |
037a8b7f | 9434 | b(alue)32 b(of)f(the)630 2022 y Ft(IFS)e Fu(v)-5 b(ariable.)41 |
595e3e69 | 9435 | b(If)29 b Ft(IFS)g Fu(is)h(unset,)f(the)h(parameters)g(are)g(separated) |
037a8b7f | 9436 | g(b)m(y)g(spaces.)41 b(If)29 b Ft(IFS)g Fu(is)630 2132 |
595e3e69 | 9437 | y(n)m(ull,)i(the)f(parameters)h(are)g(joined)f(without)g(in)m(terv)m |
037a8b7f | 9438 | (ening)i(separators.)150 2286 y Ft(@)432 b Fu(\($@\))35 |
595e3e69 | 9439 | b(Expands)e(to)i(the)g(p)s(ositional)g(parameters,)h(starting)f(from)f |
037a8b7f | 9440 | (one.)53 b(When)34 b(the)g(ex-)630 2396 y(pansion)41 |
595e3e69 | 9441 | b(o)s(ccurs)g(within)f(double)h(quotes,)k(eac)m(h)d(parameter)g |
037a8b7f | 9442 | (expands)e(to)i(a)g(separate)630 2506 y(w)m(ord.)50 b(That)34 |
595e3e69 CR |
9443 | b(is,)g Ft("$@")f Fu(is)g(equiv)-5 b(alen)m(t)35 b(to)g |
9444 | Ft("$1")29 b("$2")g(...)o Fu(.)51 b(If)33 b(the)h(double-quoted)f(ex-) | |
037a8b7f | 9445 | 630 2615 y(pansion)38 b(o)s(ccurs)h(within)f(a)h(w)m(ord,)i(the)e |
6e51e0d0 | 9446 | (expansion)g(of)g(the)g(\014rst)f(parameter)h(is)g(joined)630 |
037a8b7f CR |
9447 | 2725 y(with)i(the)h(b)s(eginning)e(part)i(of)f(the)h(original)g(w)m |
9448 | (ord,)i(and)d(the)h(expansion)f(of)g(the)h(last)630 2834 | |
6e51e0d0 CR |
9449 | y(parameter)31 b(is)f(joined)g(with)f(the)i(last)g(part)e(of)i(the)f |
9450 | (original)h(w)m(ord.)40 b(When)30 b(there)h(are)f(no)630 | |
037a8b7f | 9451 | 2944 y(p)s(ositional)e(parameters,)h Ft("$@")d Fu(and)h |
6e51e0d0 | 9452 | Ft($@)f Fu(expand)h(to)h(nothing)f(\(i.e.,)j(they)e(are)f(remo)m(v)m |
037a8b7f | 9453 | (ed\).)150 3098 y Ft(#)432 b Fu(\($#\))31 b(Expands)e(to)i(the)g(n)m |
6e51e0d0 | 9454 | (um)m(b)s(er)e(of)h(p)s(ositional)i(parameters)e(in)g(decimal.)150 |
037a8b7f | 9455 | 3253 y Ft(?)432 b Fu(\($?\))88 b(Expands)45 b(to)h(the)g(exit)h(status) |
6e51e0d0 | 9456 | f(of)g(the)g(most)h(recen)m(tly)g(executed)g(foreground)630 |
037a8b7f | 9457 | 3362 y(pip)s(eline.)150 3517 y Ft(-)432 b Fu(\($-,)24 |
6e51e0d0 CR |
9458 | b(a)e(h)m(yphen.\))37 b(Expands)20 b(to)i(the)f(curren)m(t)h(option)f |
9459 | (\015ags)h(as)f(sp)s(eci\014ed)g(up)s(on)f(in)m(v)m(o)s(cation,)630 | |
037a8b7f | 9460 | 3626 y(b)m(y)38 b(the)h Ft(set)f Fu(builtin)g(command,)j(or)d(those)i |
6e51e0d0 | 9461 | (set)f(b)m(y)f(the)h(shell)g(itself)g(\(suc)m(h)g(as)g(the)g |
037a8b7f | 9462 | Ft(-i)630 3736 y Fu(option\).)150 3890 y Ft($)432 b Fu(\($$\))31 |
6e51e0d0 CR |
9463 | b(Expands)d(to)j(the)e(pro)s(cess)h Fm(id)f Fu(of)h(the)g(shell.)41 |
9464 | b(In)28 b(a)i Ft(\(\))f Fu(subshell,)h(it)g(expands)e(to)j(the)630 | |
037a8b7f CR |
9465 | 4000 y(pro)s(cess)f Fm(id)g Fu(of)h(the)g(in)m(v)m(oking)g(shell,)g |
9466 | (not)g(the)f(subshell.)150 4154 y Ft(!)432 b Fu(\($!\))51 | |
6e51e0d0 CR |
9467 | b(Expands)32 b(to)i(the)g(pro)s(cess)f Fm(id)h Fu(of)f(the)h(job)f |
9468 | (most)h(recen)m(tly)h(placed)f(in)m(to)g(the)g(bac)m(k-)630 | |
037a8b7f | 9469 | 4264 y(ground,)26 b(whether)g(executed)g(as)h(an)f(async)m(hronous)f |
6e51e0d0 | 9470 | (command)h(or)g(using)g(the)g Ft(bg)f Fu(builtin)630 |
037a8b7f CR |
9471 | 4374 y(\(see)31 b(Section)h(7.2)f([Job)f(Con)m(trol)h(Builtins],)g |
9472 | (page)h(100\).)150 4528 y Ft(0)432 b Fu(\($0\))46 b(Expands)d(to)i(the) | |
9473 | g(name)g(of)f(the)h(shell)g(or)f(shell)h(script.)83 b(This)44 | |
9474 | b(is)g(set)h(at)h(shell)630 4638 y(initialization.)d(If)27 | |
9475 | b(Bash)h(is)g(in)m(v)m(ok)m(ed)h(with)e(a)i(\014le)e(of)h(commands)g | |
9476 | (\(see)g(Section)h(3.8)g([Shell)630 4747 y(Scripts],)g(page)g(40\),)h | |
9477 | Ft($0)e Fu(is)h(set)g(to)g(the)f(name)h(of)f(that)h(\014le.)41 | |
9478 | b(If)28 b(Bash)g(is)h(started)g(with)f(the)630 4857 y | |
9479 | Ft(-c)i Fu(option)h(\(see)h(Section)g(6.1)f([In)m(v)m(oking)h(Bash],)g | |
9480 | (page)f(81\),)i(then)d Ft($0)g Fu(is)h(set)g(to)h(the)f(\014rst)630 | |
9481 | 4966 y(argumen)m(t)g(after)g(the)g(string)g(to)g(b)s(e)f(executed,)i | |
9482 | (if)f(one)g(is)f(presen)m(t.)42 b(Otherwise,)31 b(it)g(is)f(set)630 | |
9483 | 5076 y(to)h(the)g(\014lename)f(used)g(to)h(in)m(v)m(ok)m(e)h(Bash,)f | |
9484 | (as)g(giv)m(en)g(b)m(y)f(argumen)m(t)h(zero.)150 5230 | |
9485 | y Ft(_)432 b Fu(\($)p 716 5230 28 4 v 41 w(,)41 b(an)e(underscore.\))67 | |
9486 | b(A)m(t)40 b(shell)f(startup,)i(set)f(to)g(the)f(absolute)h(pathname)f | |
9487 | (used)f(to)630 5340 y(in)m(v)m(ok)m(e)43 b(the)e(shell)g(or)g(shell)g | |
9488 | (script)g(b)s(eing)f(executed)i(as)f(passed)g(in)f(the)h(en)m(vironmen) | |
9489 | m(t)p eop end | |
c2fa6583 | 9490 | %%Page: 21 27 |
6e51e0d0 | 9491 | TeXDict begin 21 26 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
037a8b7f CR |
9492 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(21)630 299 |
9493 | y(or)34 b(argumen)m(t)g(list.)52 b(Subsequen)m(tly)-8 | |
9494 | b(,)34 b(expands)f(to)i(the)f(last)h(argumen)m(t)f(to)g(the)g(previous) | |
9495 | 630 408 y(command,)g(after)f(expansion.)48 b(Also)34 | |
9496 | b(set)g(to)f(the)g(full)g(pathname)g(used)f(to)i(in)m(v)m(ok)m(e)h(eac) | |
9497 | m(h)630 518 y(command)29 b(executed)h(and)f(placed)g(in)g(the)h(en)m | |
9498 | (vironmen)m(t)f(exp)s(orted)g(to)h(that)g(command.)630 | |
9499 | 628 y(When)g(c)m(hec)m(king)i(mail,)g(this)e(parameter)h(holds)f(the)g | |
9500 | (name)h(of)f(the)h(mail)g(\014le.)150 866 y Fs(3.5)68 | |
9501 | b(Shell)45 b(Expansions)150 1025 y Fu(Expansion)27 b(is)i(p)s(erformed) | |
9502 | d(on)i(the)g(command)g(line)h(after)f(it)h(has)f(b)s(een)f(split)h(in)m | |
9503 | (to)i Ft(token)p Fu(s.)38 b(There)28 b(are)150 1135 y(sev)m(en)j(kinds) | |
9504 | e(of)i(expansion)f(p)s(erformed:)225 1268 y Fq(\017)60 | |
9505 | b Fu(brace)31 b(expansion)225 1401 y Fq(\017)60 b Fu(tilde)31 | |
9506 | b(expansion)225 1535 y Fq(\017)60 b Fu(parameter)31 b(and)f(v)-5 | |
9507 | b(ariable)31 b(expansion)225 1668 y Fq(\017)60 b Fu(command)30 | |
9508 | b(substitution)225 1801 y Fq(\017)60 b Fu(arithmetic)32 | |
9509 | b(expansion)225 1934 y Fq(\017)60 b Fu(w)m(ord)30 b(splitting)225 | |
9510 | 2067 y Fq(\017)60 b Fu(\014lename)31 b(expansion)275 | |
9511 | 2224 y(The)24 b(order)h(of)h(expansions)f(is:)39 b(brace)25 | |
d76edd30 | 9512 | b(expansion;)j(tilde)e(expansion,)g(parameter)g(and)f(v)-5 |
037a8b7f | 9513 | b(ariable)26 b(ex-)150 2334 y(pansion,)j(arithmetic)i(expansion,)f(and) |
d76edd30 | 9514 | f(command)g(substitution)g(\(done)g(in)h(a)f(left-to-righ)m(t)k |
037a8b7f CR |
9515 | (fashion\);)150 2444 y(w)m(ord)d(splitting;)h(and)f(\014lename)h |
9516 | (expansion.)275 2577 y(On)42 b(systems)h(that)h(can)g(supp)s(ort)e(it,) | |
6e51e0d0 | 9517 | 47 b(there)d(is)f(an)h(additional)g(expansion)f(a)m(v)-5 |
037a8b7f | 9518 | b(ailable:)69 b Fr(pro)s(cess)150 2686 y(substitution)p |
6e51e0d0 CR |
9519 | Fu(.)50 b(This)33 b(is)h(p)s(erformed)e(at)j(the)f(same)g(time)g(as)g |
9520 | (tilde,)i(parameter,)f(v)-5 b(ariable,)35 b(and)f(arith-)150 | |
037a8b7f CR |
9521 | 2796 y(metic)d(expansion)g(and)e(command)i(substitution.)275 |
9522 | 2929 y(Only)k(brace)i(expansion,)h(w)m(ord)e(splitting,)j(and)d | |
220537f2 | 9523 | (\014lename)g(expansion)g(can)h(c)m(hange)h(the)e(n)m(um)m(b)s(er)150 |
037a8b7f | 9524 | 3039 y(of)h(w)m(ords)f(of)g(the)h(expansion;)i(other)e(expansions)f |
220537f2 | 9525 | (expand)g(a)h(single)g(w)m(ord)f(to)h(a)g(single)g(w)m(ord.)58 |
037a8b7f | 9526 | b(The)150 3148 y(only)32 b(exceptions)i(to)f(this)f(are)h(the)f |
6e51e0d0 | 9527 | (expansions)g(of)h Ft("$@")e Fu(\(see)i(Section)g(3.4.2)h([Sp)s(ecial)f |
037a8b7f | 9528 | (P)m(arameters],)150 3258 y(page)e(20\))h(and)d Ft("${)p |
6e51e0d0 | 9529 | Fj(name)p Ft([@]}")e Fu(\(see)32 b(Section)f(6.7)g([Arra)m(ys],)h(page) |
037a8b7f | 9530 | f(90\).)275 3391 y(After)41 b(all)i(expansions,)h Ft(quote)29 |
6e51e0d0 | 9531 | b(removal)40 b Fu(\(see)i(Section)h(3.5.9)g([Quote)f(Remo)m(v)-5 |
037a8b7f CR |
9532 | b(al],)47 b(page)42 b(32\))h(is)150 3501 y(p)s(erformed.)150 |
9533 | 3697 y Fk(3.5.1)63 b(Brace)40 b(Expansion)150 3844 y | |
6e51e0d0 | 9534 | Fu(Brace)32 b(expansion)f(is)f(a)i(mec)m(hanism)f(b)m(y)f(whic)m(h)h |
c2fa6583 | 9535 | (arbitrary)f(strings)h(ma)m(y)g(b)s(e)f(generated.)43 |
037a8b7f | 9536 | b(This)30 b(mec)m(h-)150 3954 y(anism)35 b(is)h(similar)f(to)h |
6e51e0d0 | 9537 | Fr(\014lename)g(expansion)f Fu(\(see)i(Section)f(3.5.8)h([Filename)g |
037a8b7f | 9538 | (Expansion],)f(page)g(30\),)150 4064 y(but)26 b(the)h(\014lenames)g |
c2fa6583 CR |
9539 | (generated)h(need)f(not)g(exist.)40 b(P)m(atterns)28 |
9540 | b(to)f(b)s(e)g(brace)g(expanded)f(tak)m(e)i(the)f(form)g(of)150 | |
037a8b7f | 9541 | 4173 y(an)j(optional)h Fr(pream)m(ble)p Fu(,)g(follo)m(w)m(ed)g(b)m(y)f |
6e51e0d0 | 9542 | (either)g(a)h(series)f(of)g(comma-separated)i(strings)d(or)h(a)h |
037a8b7f | 9543 | (sequence)150 4283 y(expression)36 b(b)s(et)m(w)m(een)g(a)h(pair)e(of)i |
6e51e0d0 | 9544 | (braces,)g(follo)m(w)m(ed)h(b)m(y)e(an)g(optional)h Fr(p)s(ostscript)p |
037a8b7f CR |
9545 | Fu(.)57 b(The)36 b(pream)m(ble)g(is)150 4392 y(pre\014xed)28 |
9546 | b(to)h(eac)m(h)h(string)f(con)m(tained)h(within)e(the)h(braces,)g(and)g | |
9547 | (the)g(p)s(ostscript)f(is)h(then)f(app)s(ended)f(to)150 | |
9548 | 4502 y(eac)m(h)32 b(resulting)e(string,)h(expanding)e(left)j(to)f(righ) | |
9549 | m(t.)275 4635 y(Brace)37 b(expansions)f(ma)m(y)h(b)s(e)f(nested.)59 | |
37c41ab1 | 9550 | b(The)36 b(results)g(of)h(eac)m(h)g(expanded)f(string)g(are)h(not)g |
037a8b7f CR |
9551 | (sorted;)150 4745 y(left)31 b(to)g(righ)m(t)g(order)f(is)g(preserv)m |
9552 | (ed.)41 b(F)-8 b(or)31 b(example,)390 4878 y Ft(bash$)46 | |
9553 | b(echo)h(a{d,c,b}e)390 4988 y(ade)g(ace)g(abe)275 5121 | |
6e51e0d0 CR |
9554 | y Fu(A)23 b(sequence)g(expression)g(tak)m(es)i(the)e(form)g |
9555 | Ft({)p Fj(x)p Ft(..)p Fj(y)p Ft([..)p Fj(incr)p Ft(]})p | |
9556 | Fu(,)e(where)i Fr(x)29 b Fu(and)23 b Fr(y)30 b Fu(are)24 | |
037a8b7f | 9557 | b(either)g(in)m(tegers)150 5230 y(or)42 b(single)h(c)m(haracters,)48 |
6e51e0d0 | 9558 | b(and)41 b Fr(incr)p Fu(,)46 b(an)c(optional)i(incremen)m(t,)i(is)c(an) |
037a8b7f | 9559 | h(in)m(teger.)78 b(When)42 b(in)m(tegers)i(are)150 5340 |
6e51e0d0 CR |
9560 | y(supplied,)f(the)f(expression)f(expands)f(to)i(eac)m(h)h(n)m(um)m(b)s |
9561 | (er)d(b)s(et)m(w)m(een)i Fr(x)47 b Fu(and)41 b Fr(y)p | |
037a8b7f CR |
9562 | Fu(,)j(inclusiv)m(e.)75 b(Supplied)p eop end |
9563 | %%Page: 22 28 | |
9564 | TeXDict begin 22 27 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9565 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(22)150 299 | |
9566 | y(in)m(tegers)33 b(ma)m(y)e(b)s(e)g(pre\014xed)f(with)h(`)p | |
9567 | Ft(0)p Fu(')h(to)g(force)g(eac)m(h)g(term)g(to)g(ha)m(v)m(e)g(the)g | |
9568 | (same)g(width.)42 b(When)31 b(either)150 408 y Fr(x)43 | |
9569 | b Fu(or)36 b Fr(y)44 b Fu(b)s(egins)36 b(with)g(a)h(zero,)i(the)e | |
9570 | (shell)g(attempts)g(to)g(force)g(all)h(generated)f(terms)g(to)g(con)m | |
9571 | (tain)h(the)150 518 y(same)e(n)m(um)m(b)s(er)e(of)i(digits,)i | |
9572 | (zero-padding)d(where)h(necessary)-8 b(.)57 b(When)35 | |
9573 | b(c)m(haracters)i(are)f(supplied,)g(the)150 628 y(expression)24 | |
9574 | b(expands)g(to)h(eac)m(h)h(c)m(haracter)g(lexicographically)h(b)s(et)m | |
9575 | (w)m(een)e Fr(x)30 b Fu(and)24 b Fr(y)p Fu(,)i(inclusiv)m(e,)h(using)d | |
9576 | (the)150 737 y(default)32 b(C)g(lo)s(cale.)48 b(Note)34 | |
9577 | b(that)f(b)s(oth)e Fr(x)39 b Fu(and)31 b Fr(y)40 b Fu(m)m(ust)32 | |
9578 | b(b)s(e)g(of)g(the)h(same)f(t)m(yp)s(e.)47 b(When)32 | |
9579 | b(the)g(incremen)m(t)150 847 y(is)d(supplied,)g(it)h(is)f(used)f(as)i | |
9580 | (the)f(di\013erence)h(b)s(et)m(w)m(een)g(eac)m(h)g(term.)41 | |
9581 | b(The)29 b(default)g(incremen)m(t)h(is)f(1)h(or)f(-1)150 | |
9582 | 956 y(as)i(appropriate.)275 1085 y(Brace)36 b(expansion)g(is)f(p)s | |
9583 | (erformed)f(b)s(efore)h(an)m(y)h(other)g(expansions,)h(and)e(an)m(y)g | |
9584 | (c)m(haracters)i(sp)s(ecial)150 1195 y(to)32 b(other)g(expansions)g | |
9585 | (are)g(preserv)m(ed)f(in)h(the)f(result.)45 b(It)32 b(is)g(strictly)g | |
9586 | (textual.)46 b(Bash)32 b(do)s(es)f(not)h(apply)150 1305 | |
9587 | y(an)m(y)27 b(syn)m(tactic)i(in)m(terpretation)g(to)f(the)f(con)m(text) | |
9588 | i(of)e(the)g(expansion)g(or)g(the)h(text)g(b)s(et)m(w)m(een)f(the)h | |
9589 | (braces.)150 1414 y(T)-8 b(o)37 b(a)m(v)m(oid)g(con\015icts)g(with)f | |
9590 | (parameter)h(expansion,)g(the)g(string)f(`)p Ft(${)p | |
9591 | Fu(')g(is)g(not)g(considered)g(eligible)i(for)150 1524 | |
9592 | y(brace)31 b(expansion.)275 1653 y(A)e(correctly-formed)i(brace)f | |
9593 | (expansion)f(m)m(ust)h(con)m(tain)h(unquoted)e(op)s(ening)g(and)g | |
9594 | (closing)i(braces,)150 1762 y(and)h(at)i(least)g(one)f(unquoted)g | |
9595 | (comma)g(or)g(a)h(v)-5 b(alid)33 b(sequence)g(expression.)48 | |
9596 | b(An)m(y)33 b(incorrectly)h(formed)150 1872 y(brace)d(expansion)f(is)g | |
9597 | (left)h(unc)m(hanged.)275 2001 y(A)25 b Fi({)h Fu(or)f(`)p | |
9598 | Ft(,)p Fu(')g(ma)m(y)h(b)s(e)f(quoted)h(with)f(a)g(bac)m(kslash)h(to)g | |
9599 | (prev)m(en)m(t)g(its)g(b)s(eing)f(considered)g(part)g(of)h(a)g(brace) | |
9600 | 150 2110 y(expression.)51 b(T)-8 b(o)34 b(a)m(v)m(oid)i(con\015icts)e | |
9601 | (with)g(parameter)g(expansion,)h(the)f(string)g(`)p Ft(${)p | |
9602 | Fu(')g(is)g(not)g(considered)150 2220 y(eligible)e(for)e(brace)h | |
9603 | (expansion.)275 2349 y(This)f(construct)h(is)g(t)m(ypically)i(used)d | |
9604 | (as)h(shorthand)f(when)g(the)h(common)g(pre\014x)f(of)h(the)g(strings)g | |
9605 | (to)150 2458 y(b)s(e)f(generated)h(is)g(longer)g(than)f(in)g(the)g(ab)s | |
9606 | (o)m(v)m(e)i(example:)390 2587 y Ft(mkdir)46 b | |
9607 | (/usr/local/src/bash/{old,n)o(ew,)o(dist)o(,bug)o(s})275 | |
9608 | 2716 y Fu(or)390 2845 y Ft(chown)g(root)h(/usr/{ucb/{ex,edit},lib/)o | |
9609 | ({ex?)o(.?*,)o(how)o(_ex})o(})150 3033 y Fk(3.5.2)63 | |
9610 | b(Tilde)41 b(Expansion)150 3180 y Fu(If)29 b(a)h(w)m(ord)g(b)s(egins)f | |
9611 | (with)g(an)h(unquoted)f(tilde)h(c)m(haracter)h(\(`)p | |
9612 | Ft(~)p Fu('\),)g(all)g(of)f(the)g(c)m(haracters)h(up)d(to)j(the)f | |
9613 | (\014rst)150 3290 y(unquoted)24 b(slash)g(\(or)h(all)h(c)m(haracters,)h | |
9614 | (if)e(there)g(is)f(no)h(unquoted)e(slash\))i(are)g(considered)g(a)g | |
9615 | Fr(tilde-pre\014x)p Fu(.)150 3400 y(If)38 b(none)g(of)g(the)h(c)m | |
9616 | (haracters)g(in)f(the)h(tilde-pre\014x)f(are)h(quoted,)h(the)f(c)m | |
9617 | (haracters)h(in)d(the)i(tilde-pre\014x)150 3509 y(follo)m(wing)28 | |
9618 | b(the)g(tilde)f(are)h(treated)g(as)f(a)g(p)s(ossible)g | |
9619 | Fr(login)h(name)p Fu(.)39 b(If)27 b(this)g(login)h(name)f(is)g(the)g(n) | |
9620 | m(ull)g(string,)150 3619 y(the)35 b(tilde)g(is)g(replaced)g(with)f(the) | |
9621 | h(v)-5 b(alue)35 b(of)g(the)g Ft(HOME)e Fu(shell)i(v)-5 | |
9622 | b(ariable.)54 b(If)34 b Ft(HOME)g Fu(is)h(unset,)g(the)g(home)150 | |
9623 | 3728 y(directory)e(of)g(the)f(user)g(executing)i(the)e(shell)h(is)f | |
9624 | (substituted)g(instead.)47 b(Otherwise,)33 b(the)g(tilde-pre\014x)150 | |
9625 | 3838 y(is)d(replaced)h(with)f(the)h(home)f(directory)h(asso)s(ciated)h | |
9626 | (with)e(the)h(sp)s(eci\014ed)e(login)j(name.)275 3967 | |
9627 | y(If)g(the)h(tilde-pre\014x)f(is)h(`)p Ft(~+)p Fu(',)g(the)g(v)-5 | |
9628 | b(alue)33 b(of)g(the)g(shell)g(v)-5 b(ariable)34 b Ft(PWD)d | |
9629 | Fu(replaces)j(the)f(tilde-pre\014x.)47 b(If)150 4076 | |
9630 | y(the)31 b(tilde-pre\014x)f(is)g(`)p Ft(~-)p Fu(',)h(the)f(v)-5 | |
9631 | b(alue)31 b(of)g(the)f(shell)h(v)-5 b(ariable)31 b Ft(OLDPWD)p | |
9632 | Fu(,)e(if)h(it)h(is)g(set,)g(is)f(substituted.)275 4205 | |
9633 | y(If)f(the)h(c)m(haracters)h(follo)m(wing)h(the)e(tilde)g(in)g(the)g | |
595e3e69 | 9634 | (tilde-pre\014x)g(consist)g(of)g(a)h(n)m(um)m(b)s(er)d |
037a8b7f | 9635 | Fr(N)p Fu(,)j(optionally)150 4315 y(pre\014xed)22 b(b)m(y)h(a)h(`)p |
595e3e69 CR |
9636 | Ft(+)p Fu(')f(or)h(a)f(`)p Ft(-)p Fu(',)j(the)d(tilde-pre\014x)g(is)h |
9637 | (replaced)f(with)g(the)h(corresp)s(onding)e(elemen)m(t)j(from)e(the)150 | |
037a8b7f | 9638 | 4425 y(directory)36 b(stac)m(k,)i(as)e(it)g(w)m(ould)f(b)s(e)g(displa)m |
595e3e69 | 9639 | (y)m(ed)h(b)m(y)g(the)f Ft(dirs)g Fu(builtin)g(in)m(v)m(ok)m(ed)i(with) |
037a8b7f | 9640 | e(the)g(c)m(haracters)150 4534 y(follo)m(wing)40 b(tilde)f(in)g(the)f |
595e3e69 | 9641 | (tilde-pre\014x)h(as)g(an)f(argumen)m(t)h(\(see)h(Section)f(6.8)h([The) |
037a8b7f | 9642 | e(Directory)i(Stac)m(k],)150 4644 y(page)c(91\).)57 b(If)35 |
595e3e69 CR |
9643 | b(the)g(tilde-pre\014x,)i(sans)e(the)h(tilde,)h(consists)f(of)g(a)f(n)m |
9644 | (um)m(b)s(er)f(without)i(a)f(leading)h(`)p Ft(+)p Fu(')g(or)150 | |
037a8b7f CR |
9645 | 4753 y(`)p Ft(-)p Fu(',)31 b(`)p Ft(+)p Fu(')f(is)h(assumed.)275 |
9646 | 4882 y(If)e(the)i(login)g(name)g(is)f(in)m(v)-5 b(alid,)31 | |
595e3e69 | 9647 | b(or)g(the)f(tilde)h(expansion)f(fails,)i(the)e(w)m(ord)g(is)h(left)g |
037a8b7f | 9648 | (unc)m(hanged.)275 5011 y(Eac)m(h)38 b(v)-5 b(ariable)38 |
595e3e69 | 9649 | b(assignmen)m(t)h(is)e(c)m(hec)m(k)m(ed)j(for)d(unquoted)g |
037a8b7f | 9650 | (tilde-pre\014xes)h(immediately)g(follo)m(wing)150 5121 |
595e3e69 CR |
9651 | y(a)d(`)p Ft(:)p Fu(')g(or)g(the)g(\014rst)f(`)p Ft(=)p |
9652 | Fu('.)54 b(In)34 b(these)h(cases,)i(tilde)e(expansion)g(is)g(also)h(p)s | |
037a8b7f | 9653 | (erformed.)52 b(Consequen)m(tly)-8 b(,)37 b(one)150 5230 |
595e3e69 CR |
9654 | y(ma)m(y)29 b(use)e(\014lenames)h(with)g(tildes)g(in)g(assignmen)m(ts)g |
9655 | (to)h Ft(PATH)p Fu(,)f Ft(MAILPATH)p Fu(,)e(and)h Ft(CDPATH)p | |
037a8b7f CR |
9656 | Fu(,)g(and)h(the)g(shell)150 5340 y(assigns)j(the)f(expanded)g(v)-5 |
9657 | b(alue.)p eop end | |
9658 | %%Page: 23 29 | |
9659 | TeXDict begin 23 28 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9660 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(23)275 299 | |
9661 | y(The)29 b(follo)m(wing)j(table)g(sho)m(ws)e(ho)m(w)g(Bash)h(treats)g | |
9662 | (unquoted)e(tilde-pre\014xes:)150 446 y Ft(~)432 b Fu(The)30 | |
9663 | b(v)-5 b(alue)31 b(of)f Ft($HOME)150 593 y(~/foo)240 | |
9664 | b($HOME/foo)150 741 y(~fred/foo)630 850 y Fu(The)30 b(sub)s(directory)f | |
9665 | Ft(foo)h Fu(of)g(the)h(home)f(directory)h(of)g(the)f(user)g | |
9666 | Ft(fred)150 997 y(~+/foo)192 b($PWD/foo)150 1145 y(~-/foo)g | |
9667 | (${OLDPWD-'~-'}/foo)150 1292 y(~)p Fj(N)384 b Fu(The)30 | |
9668 | b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m(y)f(`)p | |
9669 | Ft(dirs)g(+)p Fj(N)p Fu(')150 1439 y Ft(~+)p Fj(N)336 | |
9670 | b Fu(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m | |
9671 | (y)f(`)p Ft(dirs)g(+)p Fj(N)p Fu(')150 1586 y Ft(~-)p | |
9672 | Fj(N)336 b Fu(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m | |
9673 | (ed)h(b)m(y)f(`)p Ft(dirs)g(-)p Fj(N)p Fu(')150 1774 | |
9674 | y Fk(3.5.3)63 b(Shell)41 b(P)m(arameter)f(Expansion)150 | |
9675 | 1920 y Fu(The)g(`)p Ft($)p Fu(')h(c)m(haracter)i(in)m(tro)s(duces)d | |
9676 | (parameter)h(expansion,)j(command)d(substitution,)i(or)e(arithmetic)150 | |
9677 | 2030 y(expansion.)d(The)22 b(parameter)h(name)f(or)g(sym)m(b)s(ol)h(to) | |
9678 | g(b)s(e)e(expanded)h(ma)m(y)h(b)s(e)f(enclosed)h(in)f(braces,)i(whic)m | |
9679 | (h)150 2140 y(are)31 b(optional)g(but)f(serv)m(e)h(to)h(protect)f(the)g | |
9680 | (v)-5 b(ariable)31 b(to)g(b)s(e)f(expanded)g(from)g(c)m(haracters)i | |
9681 | (immediately)150 2249 y(follo)m(wing)g(it)f(whic)m(h)f(could)g(b)s(e)g | |
9682 | (in)m(terpreted)h(as)f(part)h(of)f(the)h(name.)275 2378 | |
9683 | y(When)44 b(braces)i(are)f(used,)j(the)e(matc)m(hing)g(ending)f(brace)g | |
9684 | (is)g(the)g(\014rst)g(`)p Ft(})p Fu(')g(not)g(escap)s(ed)h(b)m(y)f(a) | |
9685 | 150 2487 y(bac)m(kslash)40 b(or)f(within)g(a)g(quoted)g(string,)j(and)c | |
9686 | (not)i(within)e(an)h(em)m(b)s(edded)f(arithmetic)j(expansion,)150 | |
9687 | 2597 y(command)30 b(substitution,)g(or)h(parameter)g(expansion.)275 | |
9688 | 2725 y(The)40 b(basic)i(form)f(of)g(parameter)h(expansion)f(is)h($)p | |
6e51e0d0 | 9689 | Fi({)p Fr(parameter)7 b Fi(})p Fu(.)74 b(The)41 b(v)-5 |
037a8b7f | 9690 | b(alue)42 b(of)g Fr(parameter)48 b Fu(is)150 2835 y(substituted.)43 |
6e51e0d0 | 9691 | b(The)31 b Fr(parameter)39 b Fu(is)31 b(a)h(shell)f(parameter)h(as)g |
9f178efb | 9692 | (describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g(3.4)h([Shell)150 |
037a8b7f | 9693 | 2944 y(P)m(arameters],)e(page)f(18\))h(or)e(an)g(arra)m(y)h(reference)f |
900a813b | 9694 | (\(see)i(Section)f(6.7)g([Arra)m(ys],)g(page)g(90\).)42 |
037a8b7f | 9695 | b(The)29 b(braces)150 3054 y(are)j(required)g(when)f |
6e51e0d0 | 9696 | Fr(parameter)39 b Fu(is)32 b(a)h(p)s(ositional)f(parameter)h(with)f |
037a8b7f | 9697 | (more)g(than)g(one)g(digit,)i(or)e(when)150 3164 y Fr(parameter)37 |
6e51e0d0 | 9698 | b Fu(is)31 b(follo)m(w)m(ed)h(b)m(y)e(a)h(c)m(haracter)h(that)f(is)f |
9f178efb | 9699 | (not)h(to)g(b)s(e)f(in)m(terpreted)g(as)h(part)f(of)h(its)f(name.)275 |
037a8b7f | 9700 | 3292 y(If)k(the)h(\014rst)f(c)m(haracter)i(of)f Fr(parameter)42 |
8a0829e9 | 9701 | b Fu(is)35 b(an)g(exclamation)i(p)s(oin)m(t)e(\(!\),)i(and)d |
037a8b7f | 9702 | Fr(parameter)42 b Fu(is)34 b(not)i(a)150 3402 y Fr(nameref)p |
8a0829e9 CR |
9703 | Fu(,)i(it)f(in)m(tro)s(duces)f(a)h(lev)m(el)h(of)f(v)-5 |
9704 | b(ariable)37 b(indirection.)59 b(Bash)37 b(uses)f(the)g(v)-5 | |
037a8b7f | 9705 | b(alue)37 b(of)g(the)f(v)-5 b(ariable)150 3511 y(formed)22 |
8a0829e9 CR |
9706 | b(from)f(the)h(rest)h(of)f Fr(parameter)29 b Fu(as)22 |
9707 | b(the)g(name)h(of)f(the)g(v)-5 b(ariable;)26 b(this)c(v)-5 | |
037a8b7f | 9708 | b(ariable)23 b(is)f(then)g(expanded)150 3621 y(and)34 |
8a0829e9 CR |
9709 | b(that)h(v)-5 b(alue)35 b(is)g(used)f(in)g(the)h(rest)g(of)g(the)g |
9710 | (substitution,)g(rather)g(than)f(the)h(v)-5 b(alue)35 | |
037a8b7f | 9711 | b(of)g Fr(parameter)150 3730 y Fu(itself.)52 b(This)33 |
8a0829e9 CR |
9712 | b(is)g(kno)m(wn)h(as)g Ft(indirect)28 b(expansion)p Fu(.)48 |
9713 | b(If)33 b Fr(parameter)41 b Fu(is)34 b(a)g(nameref,)h(this)e(expands)g | |
037a8b7f | 9714 | (to)150 3840 y(the)d(name)g(of)g(the)h(v)-5 b(ariable)30 |
8a0829e9 | 9715 | b(referenced)g(b)m(y)g Fr(parameter)37 b Fu(instead)31 |
037a8b7f | 9716 | b(of)f(p)s(erforming)f(the)h(complete)h(indi-)150 3950 |
8a0829e9 CR |
9717 | y(rect)i(expansion.)46 b(The)32 b(exceptions)i(to)f(this)f(are)h(the)f |
9718 | (expansions)g(of)h($)p Fi({)p Fu(!)p Fr(pre\014x)6 b | |
9719 | Fu(*)p Fi(})33 b Fu(and)f($)p Fi({)p Fu(!)p Fr(name)5 | |
037a8b7f CR |
9720 | b Fu([@])p Fi(})150 4059 y Fu(describ)s(ed)28 b(b)s(elo)m(w.)41 |
9721 | b(The)28 b(exclamation)j(p)s(oin)m(t)f(m)m(ust)f(immediately)h(follo)m | |
9722 | (w)g(the)g(left)f(brace)h(in)f(order)f(to)150 4169 y(in)m(tro)s(duce)i | |
9723 | (indirection.)275 4297 y(In)39 b(eac)m(h)i(of)g(the)f(cases)h(b)s(elo)m | |
9724 | (w,)i Fr(w)m(ord)h Fu(is)c(sub)5 b(ject)40 b(to)h(tilde)f(expansion,)j | |
9725 | (parameter)e(expansion,)150 4407 y(command)30 b(substitution,)g(and)g | |
9726 | (arithmetic)i(expansion.)275 4535 y(When)h(not)h(p)s(erforming)e | |
9f178efb | 9727 | (substring)h(expansion,)h(using)g(the)f(form)h(describ)s(ed)e(b)s(elo)m |
037a8b7f | 9728 | (w)i(\(e.g.,)i(`)p Ft(:-)p Fu('\),)150 4645 y(Bash)d(tests)h(for)e(a)i |
9f178efb | 9729 | (parameter)f(that)h(is)e(unset)h(or)g(n)m(ull.)48 b(Omitting)33 |
037a8b7f | 9730 | b(the)h(colon)f(results)g(in)g(a)g(test)h(only)150 4754 |
9f178efb CR |
9731 | y(for)c(a)i(parameter)f(that)g(is)g(unset.)41 b(Put)31 |
9732 | b(another)f(w)m(a)m(y)-8 b(,)33 b(if)e(the)f(colon)i(is)f(included,)f | |
037a8b7f | 9733 | (the)h(op)s(erator)g(tests)150 4864 y(for)36 b(b)s(oth)g |
6e51e0d0 | 9734 | Fr(parameter)7 b Fu('s)37 b(existence)h(and)e(that)i(its)f(v)-5 |
9f178efb | 9735 | b(alue)37 b(is)g(not)f(n)m(ull;)k(if)d(the)g(colon)h(is)e(omitted,)k |
037a8b7f CR |
9736 | (the)150 4974 y(op)s(erator)31 b(tests)g(only)f(for)g(existence.)150 |
9737 | 5121 y Ft(${)p Fj(parameter)p Ft(:)p Fq(\000)p Fj(word)p | |
9738 | Ft(})630 5230 y Fu(If)g Fr(parameter)37 b Fu(is)30 b(unset)g(or)h(n)m | |
6e51e0d0 | 9739 | (ull,)f(the)h(expansion)f(of)g Fr(w)m(ord)k Fu(is)c(substituted.)40 |
037a8b7f CR |
9740 | b(Otherwise,)630 5340 y(the)31 b(v)-5 b(alue)30 b(of)h |
9741 | Fr(parameter)37 b Fu(is)31 b(substituted.)p eop end | |
9742 | %%Page: 24 30 | |
9743 | TeXDict begin 24 29 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9744 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(24)150 299 | |
9745 | y Ft(${)p Fj(parameter)p Ft(:=)p Fj(word)p Ft(})630 408 | |
9746 | y Fu(If)33 b Fr(parameter)40 b Fu(is)33 b(unset)f(or)h(n)m(ull,)h(the)f | |
595e3e69 | 9747 | (expansion)g(of)g Fr(w)m(ord)j Fu(is)d(assigned)g(to)h |
037a8b7f | 9748 | Fr(parameter)p Fu(.)630 518 y(The)c(v)-5 b(alue)32 b(of)f |
595e3e69 | 9749 | Fr(parameter)38 b Fu(is)31 b(then)g(substituted.)42 b(P)m(ositional)33 |
037a8b7f | 9750 | b(parameters)e(and)f(sp)s(ecial)630 628 y(parameters)h(ma)m(y)g(not)f |
595e3e69 | 9751 | (b)s(e)g(assigned)h(to)g(in)f(this)g(w)m(a)m(y)-8 b(.)150 |
037a8b7f CR |
9752 | 786 y Ft(${)p Fj(parameter)p Ft(:?)p Fj(word)p Ft(})630 |
9753 | 896 y Fu(If)26 b Fr(parameter)33 b Fu(is)26 b(n)m(ull)g(or)g(unset,)h | |
595e3e69 | 9754 | (the)f(expansion)g(of)g Fr(w)m(ord)k Fu(\(or)c(a)h(message)g(to)g(that) |
037a8b7f | 9755 | f(e\013ect)630 1005 y(if)i Fr(w)m(ord)j Fu(is)d(not)g(presen)m(t\))h |
595e3e69 | 9756 | (is)f(written)g(to)h(the)f(standard)f(error)h(and)f(the)h(shell,)h(if)f |
037a8b7f | 9757 | (it)h(is)f(not)630 1115 y(in)m(teractiv)m(e,)33 b(exits.)42 |
6e51e0d0 | 9758 | b(Otherwise,)30 b(the)h(v)-5 b(alue)31 b(of)f Fr(parameter)38 |
037a8b7f CR |
9759 | b Fu(is)30 b(substituted.)150 1273 y Ft(${)p Fj(parameter)p |
9760 | Ft(:+)p Fj(word)p Ft(})630 1383 y Fu(If)35 b Fr(parameter)42 | |
6e51e0d0 | 9761 | b Fu(is)36 b(n)m(ull)f(or)h(unset,)g(nothing)g(is)f(substituted,)i |
037a8b7f CR |
9762 | (otherwise)e(the)h(expansion)630 1492 y(of)31 b Fr(w)m(ord)i |
9763 | Fu(is)e(substituted.)150 1650 y Ft(${)p Fj(parameter)p | |
9764 | Ft(:)p Fj(offset)p Ft(})150 1760 y(${)p Fj(parameter)p | |
9765 | Ft(:)p Fj(offset)p Ft(:)p Fj(lengt)o(h)p Ft(})630 1870 | |
6e51e0d0 CR |
9766 | y Fu(This)f(is)h(referred)f(to)h(as)g(Substring)f(Expansion.)41 |
9767 | b(It)31 b(expands)f(to)h(up)f(to)h Fr(length)g Fu(c)m(harac-)630 | |
037a8b7f | 9768 | 1979 y(ters)k(of)g(the)h(v)-5 b(alue)35 b(of)g Fr(parameter)42 |
6e51e0d0 | 9769 | b Fu(starting)36 b(at)g(the)f(c)m(haracter)i(sp)s(eci\014ed)d(b)m(y)h |
037a8b7f | 9770 | Fr(o\013set)p Fu(.)55 b(If)630 2089 y Fr(parameter)32 |
6e51e0d0 CR |
9771 | b Fu(is)26 b(`)p Ft(@)p Fu(',)g(an)f(indexed)g(arra)m(y)h(subscripted)e |
9772 | (b)m(y)h(`)p Ft(@)p Fu(')g(or)h(`)p Ft(*)p Fu(',)g(or)g(an)f(asso)s | |
037a8b7f | 9773 | (ciativ)m(e)j(ar-)630 2198 y(ra)m(y)g(name,)h(the)f(results)g(di\013er) |
6e51e0d0 | 9774 | g(as)g(describ)s(ed)f(b)s(elo)m(w.)40 b(If)28 b Fr(length)g |
037a8b7f | 9775 | Fu(is)g(omitted,)i(it)f(expands)630 2308 y(to)e(the)g(substring)f(of)g |
6e51e0d0 | 9776 | (the)h(v)-5 b(alue)27 b(of)g Fr(parameter)33 b Fu(starting)28 |
1101193a | 9777 | b(at)f(the)g(c)m(haracter)h(sp)s(eci\014ed)e(b)m(y)630 |
037a8b7f | 9778 | 2418 y Fr(o\013set)37 b Fu(and)d(extending)g(to)h(the)f(end)g(of)g(the) |
6e51e0d0 | 9779 | g(v)-5 b(alue.)53 b Fr(length)34 b Fu(and)g Fr(o\013set)j |
037a8b7f CR |
9780 | Fu(are)e(arithmetic)630 2527 y(expressions)30 b(\(see)h(Section)g(6.5)h |
9781 | ([Shell)e(Arithmetic],)i(page)f(88\).)630 2661 y(If)39 | |
6e51e0d0 | 9782 | b Fr(o\013set)k Fu(ev)-5 b(aluates)41 b(to)f(a)g(n)m(um)m(b)s(er)f |
1101193a | 9783 | (less)h(than)f(zero,)k(the)d(v)-5 b(alue)40 b(is)g(used)e(as)i(an)g |
037a8b7f | 9784 | (o\013set)630 2771 y(in)33 b(c)m(haracters)i(from)f(the)f(end)g(of)h |
6e51e0d0 | 9785 | (the)g(v)-5 b(alue)34 b(of)g Fr(parameter)p Fu(.)51 b(If)33 |
037a8b7f | 9786 | b Fr(length)h Fu(ev)-5 b(aluates)35 b(to)g(a)630 2880 |
6e51e0d0 CR |
9787 | y(n)m(um)m(b)s(er)23 b(less)h(than)g(zero,)j(it)d(is)h(in)m(terpreted)f |
9788 | (as)g(an)h(o\013set)g(in)f(c)m(haracters)h(from)f(the)g(end)g(of)630 | |
037a8b7f | 9789 | 2990 y(the)31 b(v)-5 b(alue)31 b(of)g Fr(parameter)38 |
6e51e0d0 | 9790 | b Fu(rather)30 b(than)h(a)g(n)m(um)m(b)s(er)f(of)g(c)m(haracters,)j |
037a8b7f | 9791 | (and)d(the)h(expansion)630 3099 y(is)39 b(the)g(c)m(haracters)i(b)s(et) |
6e51e0d0 | 9792 | m(w)m(een)f Fr(o\013set)i Fu(and)c(that)i(result.)67 |
037a8b7f | 9793 | b(Note)40 b(that)g(a)g(negativ)m(e)h(o\013set)630 3209 |
1101193a CR |
9794 | y(m)m(ust)27 b(b)s(e)g(separated)g(from)g(the)g(colon)i(b)m(y)e(at)h |
9795 | (least)g(one)f(space)h(to)g(a)m(v)m(oid)h(b)s(eing)e(confused)630 | |
037a8b7f CR |
9796 | 3319 y(with)j(the)h(`)p Ft(:-)p Fu(')f(expansion.)630 |
9797 | 3453 y(Here)43 b(are)g(some)f(examples)h(illustrating)g(substring)f | |
9798 | (expansion)g(on)g(parameters)h(and)630 3562 y(subscripted)29 | |
9799 | b(arra)m(ys:)630 3696 y Ft($)47 b(string=01234567890abcdefgh)630 | |
9800 | 3806 y($)g(echo)g(${string:7})630 3915 y(7890abcdefgh)630 | |
9801 | 4025 y($)g(echo)g(${string:7:0})630 4244 y($)g(echo)g(${string:7:2})630 | |
9802 | 4354 y(78)630 4463 y($)g(echo)g(${string:7:-2})630 4573 | |
9803 | y(7890abcdef)630 4682 y($)g(echo)g(${string:)e(-7})630 | |
9804 | 4792 y(bcdefgh)630 4902 y($)i(echo)g(${string:)e(-7:0})630 | |
9805 | 5121 y($)i(echo)g(${string:)e(-7:2})630 5230 y(bc)630 | |
9806 | 5340 y($)i(echo)g(${string:)e(-7:-2})p eop end | |
9f178efb | 9807 | %%Page: 25 31 |
6e51e0d0 | 9808 | TeXDict begin 25 30 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
9f178efb | 9809 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(25)630 299 |
037a8b7f CR |
9810 | y Ft(bcdef)630 408 y($)47 b(set)g(--)h(01234567890abcdefgh)630 |
9811 | 518 y($)f(echo)g(${1:7})630 628 y(7890abcdefgh)630 737 | |
9812 | y($)g(echo)g(${1:7:0})630 956 y($)g(echo)g(${1:7:2})630 | |
9813 | 1066 y(78)630 1176 y($)g(echo)g(${1:7:-2})630 1285 y(7890abcdef)630 | |
9814 | 1395 y($)g(echo)g(${1:)g(-7})630 1504 y(bcdefgh)630 1614 | |
9815 | y($)g(echo)g(${1:)g(-7:0})630 1833 y($)g(echo)g(${1:)g(-7:2})630 | |
9816 | 1943 y(bc)630 2052 y($)g(echo)g(${1:)g(-7:-2})630 2162 | |
9817 | y(bcdef)630 2271 y($)g(array[0]=01234567890abcdef)o(gh)630 | |
9818 | 2381 y($)g(echo)g(${array[0]:7})630 2491 y(7890abcdefgh)630 | |
9819 | 2600 y($)g(echo)g(${array[0]:7:0})630 2819 y($)g(echo)g | |
9820 | (${array[0]:7:2})630 2929 y(78)630 3039 y($)g(echo)g(${array[0]:7:-2}) | |
9821 | 630 3148 y(7890abcdef)630 3258 y($)g(echo)g(${array[0]:)e(-7})630 | |
9822 | 3367 y(bcdefgh)630 3477 y($)i(echo)g(${array[0]:)e(-7:0})630 | |
9823 | 3696 y($)i(echo)g(${array[0]:)e(-7:2})630 3806 y(bc)630 | |
9824 | 3915 y($)i(echo)g(${array[0]:)e(-7:-2})630 4025 y(bcdef)630 | |
9825 | 4171 y Fu(If)22 b Fr(parameter)30 b Fu(is)23 b(`)p Ft(@)p | |
9826 | Fu(',)i(the)e(result)g(is)g Fr(length)h Fu(p)s(ositional)f(parameters)h | |
9827 | (b)s(eginning)e(at)i Fr(o\013set)p Fu(.)630 4281 y(A)36 | |
9828 | b(negativ)m(e)j Fr(o\013set)g Fu(is)e(tak)m(en)g(relativ)m(e)i(to)e | |
9829 | (one)g(greater)g(than)f(the)h(greatest)h(p)s(ositional)630 | |
9830 | 4390 y(parameter,)29 b(so)f(an)g(o\013set)h(of)f(-1)g(ev)-5 | |
9831 | b(aluates)30 b(to)e(the)g(last)h(p)s(ositional)g(parameter.)40 | |
9832 | b(It)28 b(is)g(an)630 4500 y(expansion)i(error)g(if)h | |
9833 | Fr(length)f Fu(ev)-5 b(aluates)32 b(to)f(a)g(n)m(um)m(b)s(er)e(less)i | |
9834 | (than)f(zero.)630 4646 y(The)i(follo)m(wing)i(examples)f(illustrate)h | |
9835 | (substring)d(expansion)i(using)f(p)s(ositional)h(param-)630 | |
9836 | 4755 y(eters:)630 4902 y Ft($)47 b(set)g(--)h(1)f(2)g(3)h(4)f(5)h(6)f | |
9837 | (7)h(8)f(9)h(0)f(a)h(b)f(c)g(d)h(e)f(f)h(g)f(h)630 5011 | |
9838 | y($)g(echo)g(${@:7})630 5121 y(7)g(8)h(9)f(0)h(a)f(b)h(c)f(d)h(e)f(f)h | |
9839 | (g)f(h)630 5230 y($)g(echo)g(${@:7:0})p eop end | |
c2fa6583 | 9840 | %%Page: 26 32 |
6e51e0d0 | 9841 | TeXDict begin 26 31 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
c2fa6583 | 9842 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(26)630 299 |
037a8b7f CR |
9843 | y Ft($)47 b(echo)g(${@:7:2})630 408 y(7)g(8)630 518 y($)g(echo)g |
9844 | (${@:7:-2})630 628 y(bash:)f(-2:)h(substring)f(expression)f(<)i(0)630 | |
9845 | 737 y($)g(echo)g(${@:)g(-7:2})630 847 y(b)g(c)630 956 | |
9846 | y($)g(echo)g(${@:0})630 1066 y(./bash)f(1)i(2)f(3)g(4)h(5)f(6)h(7)f(8)h | |
9847 | (9)f(0)h(a)f(b)h(c)f(d)g(e)h(f)f(g)h(h)630 1176 y($)f(echo)g(${@:0:2}) | |
9848 | 630 1285 y(./bash)f(1)630 1395 y($)h(echo)g(${@:)g(-7:0})630 | |
9849 | 1677 y Fu(If)36 b Fr(parameter)43 b Fu(is)36 b(an)g(indexed)g(arra)m(y) | |
6e51e0d0 | 9850 | g(name)g(subscripted)f(b)m(y)h(`)p Ft(@)p Fu(')g(or)h(`)p |
037a8b7f | 9851 | Ft(*)p Fu(',)h(the)e(result)g(is)630 1786 y(the)j Fr(length)g |
6e51e0d0 CR |
9852 | Fu(mem)m(b)s(ers)f(of)h(the)f(arra)m(y)i(b)s(eginning)d(with)i |
9853 | Ft(${)p Fj(parameter)p Ft([)p Fj(offset)p Ft(]})p Fu(.)60 | |
037a8b7f | 9854 | b(A)630 1896 y(negativ)m(e)33 b Fr(o\013set)g Fu(is)e(tak)m(en)h |
6e51e0d0 | 9855 | (relativ)m(e)g(to)g(one)f(greater)g(than)g(the)f(maxim)m(um)h(index)f |
037a8b7f | 9856 | (of)h(the)630 2005 y(sp)s(eci\014ed)38 b(arra)m(y)-8 |
6e51e0d0 CR |
9857 | b(.)65 b(It)38 b(is)g(an)h(expansion)f(error)f(if)i Fr(length)f |
9858 | Fu(ev)-5 b(aluates)40 b(to)f(a)g(n)m(um)m(b)s(er)e(less)630 | |
037a8b7f | 9859 | 2115 y(than)30 b(zero.)630 2287 y(These)23 b(examples)i(sho)m(w)e(ho)m |
9f178efb | 9860 | (w)h(y)m(ou)g(can)g(use)f(substring)f(expansion)i(with)f(indexed)g |
037a8b7f CR |
9861 | (arra)m(ys:)630 2459 y Ft($)47 b(array=\(0)f(1)h(2)h(3)f(4)h(5)f(6)h(7) |
9862 | f(8)h(9)f(0)h(a)f(b)g(c)h(d)f(e)h(f)f(g)h(h\))630 2569 | |
9863 | y($)f(echo)g(${array[@]:7})630 2679 y(7)g(8)h(9)f(0)h(a)f(b)h(c)f(d)h | |
9864 | (e)f(f)h(g)f(h)630 2788 y($)g(echo)g(${array[@]:7:2})630 | |
9865 | 2898 y(7)g(8)630 3007 y($)g(echo)g(${array[@]:)e(-7:2})630 | |
9866 | 3117 y(b)i(c)630 3226 y($)g(echo)g(${array[@]:)e(-7:-2})630 | |
9867 | 3336 y(bash:)h(-2:)h(substring)f(expression)f(<)i(0)630 | |
9868 | 3446 y($)g(echo)g(${array[@]:0})630 3555 y(0)g(1)h(2)f(3)h(4)f(5)h(6)f | |
9869 | (7)h(8)f(9)h(0)f(a)g(b)h(c)f(d)h(e)f(f)h(g)f(h)630 3665 | |
9870 | y($)g(echo)g(${array[@]:0:2})630 3774 y(0)g(1)630 3884 | |
9871 | y($)g(echo)g(${array[@]:)e(-7:0})630 4166 y Fu(Substring)25 | |
9872 | b(expansion)g(applied)h(to)h(an)f(asso)s(ciativ)m(e)j(arra)m(y)d(pro)s | |
9873 | (duces)f(unde\014ned)f(results.)630 4338 y(Substring)32 | |
9874 | b(indexing)i(is)f(zero-based)i(unless)e(the)h(p)s(ositional)g | |
9875 | (parameters)g(are)g(used,)g(in)630 4448 y(whic)m(h)29 | |
fc527055 CR |
9876 | b(case)i(the)f(indexing)g(starts)g(at)g(1)g(b)m(y)g(default.)41 |
9877 | b(If)29 b Fr(o\013set)k Fu(is)d(0,)g(and)f(the)h(p)s(ositional)630 | |
037a8b7f CR |
9878 | 4557 y(parameters)h(are)f(used,)g Ft($@)g Fu(is)g(pre\014xed)g(to)h |
9879 | (the)f(list.)150 4792 y Ft(${!)p Fj(prefix)p Ft(*})150 | |
9880 | 4902 y(${!)p Fj(prefix)p Ft(@})630 5011 y Fu(Expands)24 | |
9881 | b(to)h(the)g(names)g(of)g(v)-5 b(ariables)26 b(whose)f(names)f(b)s | |
9882 | (egin)h(with)f Fr(pre\014x)p Fu(,)i(separated)f(b)m(y)630 | |
9883 | 5121 y(the)k(\014rst)f(c)m(haracter)j(of)e(the)g Ft(IFS)f | |
9884 | Fu(sp)s(ecial)i(v)-5 b(ariable.)41 b(When)29 b(`)p Ft(@)p | |
9885 | Fu(')g(is)g(used)f(and)h(the)g(expan-)630 5230 y(sion)35 | |
9886 | b(app)s(ears)g(within)f(double)h(quotes,)i(eac)m(h)f(v)-5 | |
9887 | b(ariable)36 b(name)f(expands)g(to)g(a)h(separate)630 | |
9888 | 5340 y(w)m(ord.)p eop end | |
9889 | %%Page: 27 33 | |
9890 | TeXDict begin 27 32 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9891 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(27)150 299 | |
9892 | y Ft(${!)p Fj(name)p Ft([@]})150 408 y(${!)p Fj(name)p | |
9893 | Ft([*]})630 518 y Fu(If)26 b Fr(name)32 b Fu(is)27 b(an)f(arra)m(y)h(v) | |
9894 | -5 b(ariable,)29 b(expands)d(to)h(the)g(list)g(of)g(arra)m(y)g(indices) | |
9895 | g(\(k)m(eys\))h(assigned)630 628 y(in)c Fr(name)p Fu(.)39 | |
9896 | b(If)24 b Fr(name)30 b Fu(is)24 b(not)h(an)f(arra)m(y)-8 | |
9897 | b(,)27 b(expands)c(to)j(0)f(if)f Fr(name)30 b Fu(is)24 | |
9898 | b(set)h(and)f(n)m(ull)g(otherwise.)630 737 y(When)39 | |
9899 | b(`)p Ft(@)p Fu(')h(is)f(used)g(and)f(the)i(expansion)f(app)s(ears)g | |
9900 | (within)f(double)h(quotes,)k(eac)m(h)d(k)m(ey)630 847 | |
9901 | y(expands)30 b(to)h(a)f(separate)i(w)m(ord.)150 1011 | |
9902 | y Ft(${#)p Fj(parameter)p Ft(})630 1121 y Fu(The)40 b(length)g(in)g(c)m | |
9903 | (haracters)i(of)e(the)h(expanded)e(v)-5 b(alue)41 b(of)f | |
9904 | Fr(parameter)47 b Fu(is)40 b(substituted.)630 1230 y(If)i | |
9905 | Fr(parameter)50 b Fu(is)43 b(`)p Ft(*)p Fu(')g(or)g(`)p | |
6e51e0d0 | 9906 | Ft(@)p Fu(',)k(the)c(v)-5 b(alue)43 b(substituted)f(is)h(the)g(n)m(um)m |
037a8b7f | 9907 | (b)s(er)f(of)h(p)s(ositional)630 1340 y(parameters.)i(If)32 |
6e51e0d0 CR |
9908 | b Fr(parameter)38 b Fu(is)32 b(an)g(arra)m(y)g(name)g(subscripted)f(b)m |
9909 | (y)g(`)p Ft(*)p Fu(')h(or)g(`)p Ft(@)p Fu(',)g(the)g(v)-5 | |
037a8b7f | 9910 | b(alue)630 1450 y(substituted)30 b(is)h(the)g(n)m(um)m(b)s(er)e(of)i |
ad4aef08 | 9911 | (elemen)m(ts)i(in)d(the)h(arra)m(y)-8 b(.)43 b(If)30 |
037a8b7f | 9912 | b Fr(parameter)38 b Fu(is)31 b(an)f(indexed)630 1559 |
595e3e69 CR |
9913 | y(arra)m(y)37 b(name)g(subscripted)f(b)m(y)h(a)g(negativ)m(e)i(n)m(um)m |
9914 | (b)s(er,)f(that)f(n)m(um)m(b)s(er)f(is)g(in)m(terpreted)i(as)630 | |
037a8b7f | 9915 | 1669 y(relativ)m(e)47 b(to)g(one)e(greater)i(than)e(the)h(maxim)m(um)f |
6e51e0d0 | 9916 | (index)g(of)g Fr(parameter)p Fu(,)50 b(so)c(negativ)m(e)630 |
037a8b7f | 9917 | 1778 y(indices)30 b(coun)m(t)h(bac)m(k)g(from)f(the)h(end)e(of)i(the)f |
ad4aef08 | 9918 | (arra)m(y)-8 b(,)32 b(and)e(an)g(index)g(of)g(-1)h(references)g(the)630 |
037a8b7f CR |
9919 | 1888 y(last)g(elemen)m(t.)150 2052 y Ft(${)p Fj(parameter)p |
9920 | Ft(#)p Fj(word)p Ft(})150 2162 y(${)p Fj(parameter)p | |
9921 | Ft(##)p Fj(word)p Ft(})630 2271 y Fu(The)g Fr(w)m(ord)k | |
6e51e0d0 | 9922 | Fu(is)d(expanded)f(to)i(pro)s(duce)e(a)h(pattern)g(just)f(as)i(in)e |
037a8b7f | 9923 | (\014lename)h(expansion)g(\(see)630 2381 y(Section)k(3.5.8)h([Filename) |
595e3e69 | 9924 | g(Expansion],)g(page)f(30\).)56 b(If)35 b(the)h(pattern)f(matc)m(hes)i |
037a8b7f | 9925 | (the)e(b)s(e-)630 2491 y(ginning)28 b(of)g(the)h(expanded)e(v)-5 |
6e51e0d0 | 9926 | b(alue)29 b(of)f Fr(parameter)p Fu(,)h(then)f(the)g(result)g(of)h(the)f |
037a8b7f | 9927 | (expansion)g(is)630 2600 y(the)36 b(expanded)f(v)-5 b(alue)36 |
6e51e0d0 | 9928 | b(of)g Fr(parameter)43 b Fu(with)35 b(the)h(shortest)g(matc)m(hing)h |
037a8b7f | 9929 | (pattern)f(\(the)g(`)p Ft(#)p Fu(')630 2710 y(case\))26 |
6e51e0d0 CR |
9930 | b(or)f(the)g(longest)g(matc)m(hing)h(pattern)f(\(the)g(`)p |
9931 | Ft(##)p Fu(')g(case\))h(deleted.)39 b(If)24 b Fr(parameter)32 | |
037a8b7f | 9932 | b Fu(is)25 b(`)p Ft(@)p Fu(')630 2819 y(or)j(`)p Ft(*)p |
6e51e0d0 | 9933 | Fu(',)i(the)e(pattern)h(remo)m(v)-5 b(al)29 b(op)s(eration)g(is)f |
9ec5ed66 | 9934 | (applied)h(to)g(eac)m(h)g(p)s(ositional)g(parameter)g(in)630 |
037a8b7f | 9935 | 2929 y(turn,)i(and)g(the)h(expansion)g(is)g(the)g(resultan)m(t)g(list.) |
6e51e0d0 | 9936 | 45 b(If)32 b Fr(parameter)38 b Fu(is)32 b(an)g(arra)m(y)g(v)-5 |
037a8b7f | 9937 | b(ariable)630 3039 y(subscripted)39 b(with)g(`)p Ft(@)p |
6e51e0d0 | 9938 | Fu(')h(or)g(`)p Ft(*)p Fu(',)j(the)d(pattern)h(remo)m(v)-5 |
9ec5ed66 | 9939 | b(al)41 b(op)s(eration)f(is)g(applied)g(to)h(eac)m(h)630 |
037a8b7f CR |
9940 | 3148 y(mem)m(b)s(er)30 b(of)g(the)h(arra)m(y)g(in)f(turn,)f(and)h(the)h |
9941 | (expansion)f(is)g(the)h(resultan)m(t)g(list.)150 3313 | |
6e51e0d0 | 9942 | y Ft(${)p Fj(parameter)p Ft(\045)p Fj(word)p Ft(})150 |
037a8b7f CR |
9943 | 3422 y(${)p Fj(parameter)p Ft(\045\045)p Fj(word)p Ft(})630 |
9944 | 3532 y Fu(The)k Fr(w)m(ord)k Fu(is)c(expanded)g(to)h(pro)s(duce)e(a)i | |
6e51e0d0 | 9945 | (pattern)f(just)g(as)h(in)f(\014lename)h(expansion.)55 |
037a8b7f | 9946 | b(If)630 3641 y(the)43 b(pattern)g(matc)m(hes)h(a)g(trailing)g(p)s |
6e51e0d0 | 9947 | (ortion)e(of)h(the)g(expanded)g(v)-5 b(alue)43 b(of)g |
037a8b7f | 9948 | Fr(parameter)p Fu(,)630 3751 y(then)c(the)g(result)g(of)h(the)f |
6e51e0d0 | 9949 | (expansion)g(is)h(the)f(v)-5 b(alue)40 b(of)f Fr(parameter)46 |
037a8b7f | 9950 | b Fu(with)39 b(the)h(shortest)630 3861 y(matc)m(hing)31 |
6e51e0d0 CR |
9951 | b(pattern)e(\(the)h(`)p Ft(\045)p Fu(')g(case\))h(or)e(the)h(longest)h |
9952 | (matc)m(hing)f(pattern)g(\(the)g(`)p Ft(\045\045)p Fu(')g(case\))630 | |
037a8b7f | 9953 | 3970 y(deleted.)49 b(If)32 b Fr(parameter)40 b Fu(is)33 |
6e51e0d0 | 9954 | b(`)p Ft(@)p Fu(')g(or)g(`)p Ft(*)p Fu(',)h(the)f(pattern)g(remo)m(v)-5 |
037a8b7f | 9955 | b(al)34 b(op)s(eration)g(is)f(applied)f(to)630 4080 y(eac)m(h)38 |
eb2bb562 | 9956 | b(p)s(ositional)g(parameter)g(in)f(turn,)h(and)e(the)h(expansion)g(is)h |
037a8b7f | 9957 | (the)f(resultan)m(t)h(list.)61 b(If)630 4189 y Fr(parameter)38 |
6e51e0d0 CR |
9958 | b Fu(is)32 b(an)f(arra)m(y)h(v)-5 b(ariable)32 b(subscripted)e(with)h |
9959 | (`)p Ft(@)p Fu(')g(or)h(`)p Ft(*)p Fu(',)g(the)f(pattern)h(remo)m(v)-5 | |
037a8b7f CR |
9960 | b(al)630 4299 y(op)s(eration)30 b(is)g(applied)f(to)i(eac)m(h)g(mem)m |
9961 | (b)s(er)e(of)h(the)g(arra)m(y)g(in)f(turn,)g(and)g(the)h(expansion)g | |
9962 | (is)630 4408 y(the)h(resultan)m(t)g(list.)150 4573 y | |
9963 | Ft(${)p Fj(parameter)p Ft(/)p Fj(pattern)p Ft(/)p Fj(stri)o(ng)p | |
9964 | Ft(})630 4682 y Fu(The)37 b Fr(pattern)g Fu(is)g(expanded)g(to)h(pro)s | |
9965 | (duce)e(a)h(pattern)g(just)g(as)h(in)e(\014lename)i(expansion.)630 | |
9966 | 4792 y Fr(P)m(arameter)46 b Fu(is)38 b(expanded)f(and)g(the)i(longest)g | |
6e51e0d0 | 9967 | (matc)m(h)g(of)f Fr(pattern)g Fu(against)h(its)f(v)-5 |
037a8b7f | 9968 | b(alue)39 b(is)630 4902 y(replaced)34 b(with)e Fr(string)p |
6e51e0d0 CR |
9969 | Fu(.)49 b(If)33 b Fr(pattern)g Fu(b)s(egins)g(with)f(`)p |
9970 | Ft(/)p Fu(',)j(all)f(matc)m(hes)g(of)f Fr(pattern)g Fu(are)h(re-)630 | |
037a8b7f | 9971 | 5011 y(placed)28 b(with)f Fr(string)p Fu(.)40 b(Normally)28 |
6e51e0d0 | 9972 | b(only)f(the)h(\014rst)e(matc)m(h)j(is)e(replaced.)40 |
037a8b7f | 9973 | b(If)27 b Fr(pattern)g Fu(b)s(egins)630 5121 y(with)34 |
6e51e0d0 CR |
9974 | b(`)p Ft(#)p Fu(',)h(it)g(m)m(ust)f(matc)m(h)h(at)f(the)h(b)s(eginning) |
9975 | e(of)h(the)g(expanded)f(v)-5 b(alue)35 b(of)f Fr(parameter)p | |
037a8b7f | 9976 | Fu(.)630 5230 y(If)g Fr(pattern)g Fu(b)s(egins)g(with)g(`)p |
6e51e0d0 | 9977 | Ft(\045)p Fu(',)h(it)g(m)m(ust)f(matc)m(h)h(at)g(the)f(end)g(of)g(the)h |
037a8b7f | 9978 | (expanded)e(v)-5 b(alue)35 b(of)630 5340 y Fr(parameter)p |
6e51e0d0 CR |
9979 | Fu(.)41 b(If)29 b Fr(string)37 b Fu(is)29 b(n)m(ull,)h(matc)m(hes)h(of) |
9980 | e Fr(pattern)h Fu(are)g(deleted)g(and)f(the)g Ft(/)g | |
037a8b7f CR |
9981 | Fu(follo)m(wing)p eop end |
9982 | %%Page: 28 34 | |
9983 | TeXDict begin 28 33 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9984 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(28)630 299 | |
9985 | y Fr(pattern)33 b Fu(ma)m(y)h(b)s(e)e(omitted.)50 b(If)33 | |
9986 | b(the)g Ft(nocasematch)d Fu(shell)j(option)h(\(see)g(the)f(description) | |
9987 | 630 408 y(of)28 b Ft(shopt)e Fu(in)h(Section)i(4.3.2)g([The)e(Shopt)g | |
9988 | (Builtin],)i(page)g(63\))g(is)e(enabled,)i(the)e(matc)m(h)i(is)630 | |
9989 | 518 y(p)s(erformed)f(without)j(regard)e(to)i(the)f(case)i(of)e(alphab)s | |
9990 | (etic)g(c)m(haracters.)42 b(If)30 b Fr(parameter)37 b | |
9991 | Fu(is)630 628 y(`)p Ft(@)p Fu(')31 b(or)g(`)p Ft(*)p | |
8a0829e9 | 9992 | Fu(',)g(the)g(substitution)f(op)s(eration)h(is)g(applied)f(to)i(eac)m |
037a8b7f | 9993 | (h)g(p)s(ositional)f(parameter)g(in)630 737 y(turn,)g(and)g(the)h |
8a0829e9 CR |
9994 | (expansion)g(is)g(the)g(resultan)m(t)g(list.)45 b(If)32 |
9995 | b Fr(parameter)38 b Fu(is)32 b(an)g(arra)m(y)g(v)-5 b(ariable)630 | |
037a8b7f | 9996 | 847 y(subscripted)23 b(with)g(`)p Ft(@)p Fu(')i(or)f(`)p |
8a0829e9 | 9997 | Ft(*)p Fu(',)h(the)g(substitution)e(op)s(eration)i(is)f(applied)g(to)g |
037a8b7f CR |
9998 | (eac)m(h)i(mem)m(b)s(er)630 956 y(of)31 b(the)f(arra)m(y)h(in)f(turn,)g |
9999 | (and)f(the)i(expansion)f(is)h(the)f(resultan)m(t)h(list.)150 | |
10000 | 1107 y Ft(${)p Fj(parameter)p Ft(^)p Fj(pattern)p Ft(})150 | |
10001 | 1217 y(${)p Fj(parameter)p Ft(^^)p Fj(pattern)p Ft(})150 | |
10002 | 1326 y(${)p Fj(parameter)p Ft(,)p Fj(pattern)p Ft(})150 | |
10003 | 1436 y(${)p Fj(parameter)p Ft(,,)p Fj(pattern)p Ft(})630 | |
10004 | 1545 y Fu(This)36 b(expansion)g(mo)s(di\014es)g(the)g(case)i(of)f | |
fc527055 | 10005 | (alphab)s(etic)g(c)m(haracters)h(in)e Fr(parameter)p |
037a8b7f | 10006 | Fu(.)59 b(The)630 1655 y Fr(pattern)33 b Fu(is)g(expanded)e(to)j(pro)s |
fc527055 | 10007 | (duce)d(a)j(pattern)e(just)g(as)h(in)g(\014lename)g(expansion.)47 |
037a8b7f | 10008 | b(Eac)m(h)630 1765 y(c)m(haracter)32 b(in)e(the)g(expanded)f(v)-5 |
fc527055 | 10009 | b(alue)31 b(of)f Fr(parameter)37 b Fu(is)30 b(tested)h(against)h |
037a8b7f | 10010 | Fr(pattern)p Fu(,)e(and,)g(if)630 1874 y(it)j(matc)m(hes)h(the)g |
fc527055 | 10011 | (pattern,)f(its)h(case)g(is)f(con)m(v)m(erted.)49 b(The)33 |
037a8b7f | 10012 | b(pattern)g(should)f(not)h(attempt)630 1984 y(to)f(matc)m(h)g(more)f |
fc527055 CR |
10013 | (than)g(one)g(c)m(haracter.)44 b(The)30 b(`)p Ft(^)p |
10014 | Fu(')i(op)s(erator)f(con)m(v)m(erts)h(lo)m(w)m(ercase)i(letters)630 | |
037a8b7f | 10015 | 2093 y(matc)m(hing)i Fr(pattern)f Fu(to)h(upp)s(ercase;)h(the)e(`)p |
fc527055 | 10016 | Ft(,)p Fu(')g(op)s(erator)g(con)m(v)m(erts)i(matc)m(hing)f(upp)s |
037a8b7f | 10017 | (ercase)630 2203 y(letters)e(to)f(lo)m(w)m(ercase.)50 |
fc527055 CR |
10018 | b(The)32 b(`)p Ft(^^)p Fu(')h(and)f(`)p Ft(,,)p Fu(')g(expansions)h |
10019 | (con)m(v)m(ert)h(eac)m(h)g(matc)m(hed)f(c)m(har-)630 | |
037a8b7f | 10020 | 2313 y(acter)c(in)f(the)h(expanded)e(v)-5 b(alue;)30 |
6e51e0d0 | 10021 | b(the)e(`)p Ft(^)p Fu(')g(and)g(`)p Ft(,)p Fu(')g(expansions)g(matc)m |
037a8b7f | 10022 | (h)h(and)f(con)m(v)m(ert)i(only)630 2422 y(the)37 b(\014rst)g(c)m |
1101193a | 10023 | (haracter)i(in)e(the)g(expanded)g(v)-5 b(alue.)61 b(If)37 |
6e51e0d0 | 10024 | b Fr(pattern)g Fu(is)h(omitted,)i(it)e(is)f(treated)630 |
037a8b7f | 10025 | 2532 y(lik)m(e)h(a)f(`)p Ft(?)p Fu(',)i(whic)m(h)d(matc)m(hes)i(ev)m |
6e51e0d0 CR |
10026 | (ery)f(c)m(haracter.)61 b(If)37 b Fr(parameter)43 b Fu(is)37 |
10027 | b(`)p Ft(@)p Fu(')g(or)f(`)p Ft(*)p Fu(',)j(the)e(case)630 | |
037a8b7f | 10028 | 2641 y(mo)s(di\014cation)29 b(op)s(eration)f(is)g(applied)g(to)h(eac)m |
1101193a | 10029 | (h)h(p)s(ositional)f(parameter)f(in)g(turn,)g(and)g(the)630 |
037a8b7f | 10030 | 2751 y(expansion)38 b(is)g(the)g(resultan)m(t)h(list.)65 |
6e51e0d0 | 10031 | b(If)37 b Fr(parameter)46 b Fu(is)38 b(an)g(arra)m(y)g(v)-5 |
037a8b7f | 10032 | b(ariable)39 b(subscripted)630 2861 y(with)26 b(`)p Ft(@)p |
6e51e0d0 | 10033 | Fu(')f(or)h(`)p Ft(*)p Fu(',)h(the)f(case)h(mo)s(di\014cation)f(op)s |
1101193a | 10034 | (eration)h(is)e(applied)h(to)h(eac)m(h)g(mem)m(b)s(er)e(of)h(the)630 |
037a8b7f CR |
10035 | 2970 y(arra)m(y)31 b(in)f(turn,)f(and)h(the)h(expansion)f(is)g(the)h |
10036 | (resultan)m(t)g(list.)150 3121 y Ft(${)p Fj(parameter)p | |
10037 | Ft(@)p Fj(operator)p Ft(})630 3230 y Fu(The)d(expansion)h(is)f(either)h | |
8a0829e9 | 10038 | (a)g(transformation)g(of)g(the)g(v)-5 b(alue)29 b(of)g |
037a8b7f | 10039 | Fr(parameter)35 b Fu(or)29 b(informa-)630 3340 y(tion)e(ab)s(out)f |
8a0829e9 CR |
10040 | Fr(parameter)33 b Fu(itself,)28 b(dep)s(ending)c(on)i(the)h(v)-5 |
10041 | b(alue)26 b(of)h Fr(op)s(erator)p Fu(.)39 b(Eac)m(h)27 | |
037a8b7f CR |
10042 | b Fr(op)s(erator)630 3450 y Fu(is)j(a)h(single)g(letter:)630 |
10043 | 3600 y Ft(Q)432 b Fu(The)30 b(expansion)h(is)g(a)g(string)f(that)i(is)f | |
8a0829e9 | 10044 | (the)g(v)-5 b(alue)31 b(of)g Fr(parameter)37 b Fu(quoted)31 |
037a8b7f CR |
10045 | b(in)1110 3710 y(a)g(format)f(that)h(can)g(b)s(e)f(reused)f(as)i |
10046 | (input.)630 3861 y Ft(E)432 b Fu(The)48 b(expansion)h(is)g(a)g(string)g | |
8a0829e9 | 10047 | (that)h(is)f(the)g(v)-5 b(alue)49 b(of)g Fr(parameter)56 |
037a8b7f | 10048 | b Fu(with)1110 3970 y(bac)m(kslash)36 b(escap)s(e)f(sequences)h |
8a0829e9 | 10049 | (expanded)e(as)h(with)g(the)g Ft($'...)o(')f Fu(quoting)1110 |
037a8b7f CR |
10050 | 4080 y(mec)m(hansim.)630 4230 y Ft(P)432 b Fu(The)22 |
10051 | b(expansion)h(is)g(a)g(string)g(that)g(is)g(the)g(result)g(of)g | |
10052 | (expanding)f(the)h(v)-5 b(alue)24 b(of)1110 4340 y Fr(parameter)31 | |
10053 | b Fu(as)24 b(if)f(it)h(w)m(ere)g(a)g(prompt)f(string)h(\(see)g(Section) | |
10054 | h(6.9)g([Con)m(trolling)1110 4450 y(the)31 b(Prompt],)f(page)h(93\).) | |
10055 | 630 4600 y Ft(A)432 b Fu(The)24 b(expansion)g(is)g(a)h(string)f(in)g | |
10056 | (the)g(form)g(of)h(an)f(assignmen)m(t)h(statemen)m(t)h(or)1110 | |
10057 | 4710 y Ft(declare)h Fu(command)i(that,)h(if)f(ev)-5 b(aluated,)31 | |
10058 | b(will)e(recreate)i Fr(parameter)36 b Fu(with)1110 4819 | |
10059 | y(its)31 b(attributes)g(and)e(v)-5 b(alue.)630 4970 y | |
10060 | Ft(a)432 b Fu(The)30 b(expansion)g(is)g(a)h(string)f(consisting)h(of)g | |
10061 | (\015ag)g(v)-5 b(alues)30 b(represen)m(ting)h Fr(pa-)1110 | |
10062 | 5080 y(rameter)7 b Fu('s)31 b(attributes.)630 5230 y(If)e | |
10063 | Fr(parameter)37 b Fu(is)30 b(`)p Ft(@)p Fu(')g(or)g(`)p | |
10064 | Ft(*)p Fu(',)g(the)g(op)s(eration)g(is)g(applied)f(to)i(eac)m(h)g(p)s | |
10065 | (ositional)f(parameter)630 5340 y(in)24 b(turn,)g(and)f(the)h | |
10066 | (expansion)g(is)g(the)g(resultan)m(t)h(list.)39 b(If)23 | |
10067 | b Fr(parameter)31 b Fu(is)24 b(an)g(arra)m(y)g(v)-5 b(ariable)p | |
10068 | eop end | |
8a0829e9 CR |
10069 | %%Page: 29 35 |
10070 | TeXDict begin 29 34 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10071 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(29)630 299 | |
037a8b7f | 10072 | y(subscripted)24 b(with)h(`)p Ft(@)p Fu(')h(or)g(`)p |
8a0829e9 | 10073 | Ft(*)p Fu(',)h(the)e(op)s(eration)h(is)g(applied)f(to)h(eac)m(h)h(mem)m |
037a8b7f CR |
10074 | (b)s(er)e(of)h(the)f(arra)m(y)630 408 y(in)30 b(turn,)g(and)f(the)i |
10075 | (expansion)f(is)h(the)f(resultan)m(t)h(list.)630 544 | |
8a0829e9 CR |
10076 | y(The)22 b(result)g(of)g(the)h(expansion)f(is)g(sub)5 |
10077 | b(ject)22 b(to)h(w)m(ord)f(splitting)g(and)g(pathname)g(expansion)630 | |
037a8b7f CR |
10078 | 654 y(as)31 b(describ)s(ed)e(b)s(elo)m(w.)150 855 y Fk(3.5.4)63 |
10079 | b(Command)41 b(Substitution)150 1002 y Fu(Command)f(substitution)h | |
10080 | (allo)m(ws)i(the)e(output)g(of)h(a)f(command)g(to)h(replace)g(the)g | |
10081 | (command)f(itself.)150 1112 y(Command)29 b(substitution)h(o)s(ccurs)h | |
10082 | (when)e(a)i(command)f(is)g(enclosed)h(as)g(follo)m(ws:)390 | |
10083 | 1248 y Ft($\()p Fj(command)p Ft(\))150 1385 y Fu(or)390 | |
10084 | 1522 y Ft(`)p Fj(command)p Ft(`)150 1659 y Fu(Bash)20 | |
10085 | b(p)s(erforms)f(the)i(expansion)f(b)m(y)g(executing)i | |
967625cd | 10086 | Fr(command)h Fu(in)d(a)h(subshell)e(en)m(vironmen)m(t)i(and)f |
037a8b7f | 10087 | (replacing)150 1768 y(the)40 b(command)g(substitution)f(with)h(the)g |
967625cd | 10088 | (standard)f(output)g(of)h(the)g(command,)i(with)e(an)m(y)g(trailing)150 |
037a8b7f | 10089 | 1878 y(newlines)e(deleted.)64 b(Em)m(b)s(edded)37 b(newlines)h(are)g |
967625cd | 10090 | (not)g(deleted,)j(but)d(they)g(ma)m(y)h(b)s(e)e(remo)m(v)m(ed)i(during) |
037a8b7f | 10091 | 150 1988 y(w)m(ord)30 b(splitting.)42 b(The)30 b(command)g |
967625cd | 10092 | (substitution)h Ft($\(cat)e Fj(file)p Ft(\))g Fu(can)h(b)s(e)g |
037a8b7f | 10093 | (replaced)h(b)m(y)g(the)f(equiv)-5 b(alen)m(t)150 2097 |
967625cd | 10094 | y(but)30 b(faster)g Ft($\(<)g Fj(file)p Ft(\))p Fu(.)275 |
037a8b7f | 10095 | 2234 y(When)j(the)i(old-st)m(yle)h(bac)m(kquote)f(form)f(of)g |
967625cd | 10096 | (substitution)g(is)g(used,)h(bac)m(kslash)f(retains)h(its)f(literal)150 |
037a8b7f | 10097 | 2343 y(meaning)k(except)h(when)e(follo)m(w)m(ed)j(b)m(y)e(`)p |
967625cd CR |
10098 | Ft($)p Fu(',)j(`)p Ft(`)p Fu(',)f(or)e(`)p Ft(\\)p Fu('.)64 |
10099 | b(The)38 b(\014rst)f(bac)m(kquote)j(not)e(preceded)g(b)m(y)g(a)150 | |
037a8b7f | 10100 | 2453 y(bac)m(kslash)k(terminates)f(the)h(command)e(substitution.)72 |
967625cd | 10101 | b(When)41 b(using)f(the)i Ft($\()p Fj(command)p Ft(\))c |
037a8b7f | 10102 | Fu(form,)43 b(all)150 2563 y(c)m(haracters)32 b(b)s(et)m(w)m(een)f(the) |
967625cd | 10103 | f(paren)m(theses)h(mak)m(e)g(up)f(the)g(command;)h(none)f(are)h |
037a8b7f | 10104 | (treated)g(sp)s(ecially)-8 b(.)275 2699 y(Command)22 |
967625cd CR |
10105 | b(substitutions)g(ma)m(y)i(b)s(e)e(nested.)39 b(T)-8 |
10106 | b(o)23 b(nest)g(when)f(using)h(the)g(bac)m(kquoted)h(form,)g(escap)s(e) | |
037a8b7f CR |
10107 | 150 2809 y(the)31 b(inner)e(bac)m(kquotes)j(with)e(bac)m(kslashes.)275 |
10108 | 2946 y(If)e(the)i(substitution)e(app)s(ears)h(within)g(double)f | |
967625cd | 10109 | (quotes,)i(w)m(ord)f(splitting)h(and)f(\014lename)g(expansion)150 |
037a8b7f CR |
10110 | 3055 y(are)i(not)f(p)s(erformed)f(on)h(the)h(results.)150 |
10111 | 3257 y Fk(3.5.5)63 b(Arithmetic)40 b(Expansion)150 3404 | |
8a0829e9 | 10112 | y Fu(Arithmetic)25 b(expansion)g(allo)m(ws)g(the)g(ev)-5 |
fc527055 | 10113 | b(aluation)26 b(of)f(an)f(arithmetic)i(expression)e(and)g(the)g |
037a8b7f CR |
10114 | (substitution)150 3513 y(of)31 b(the)f(result.)41 b(The)30 |
10115 | b(format)g(for)g(arithmetic)i(expansion)e(is:)390 3650 | |
10116 | y Ft($\(\()47 b Fj(expression)e Ft(\)\))275 3787 y Fu(The)33 | |
fc527055 | 10117 | b(expression)g(is)h(treated)g(as)g(if)g(it)g(w)m(ere)g(within)f(double) |
037a8b7f | 10118 | h(quotes,)h(but)e(a)h(double)f(quote)h(inside)150 3897 |
fc527055 CR |
10119 | y(the)k(paren)m(theses)g(is)g(not)g(treated)h(sp)s(ecially)-8 |
10120 | b(.)65 b(All)38 b(tok)m(ens)h(in)f(the)g(expression)f(undergo)g | |
037a8b7f | 10121 | (parameter)150 4006 y(and)26 b(v)-5 b(ariable)28 b(expansion,)g |
fc527055 | 10122 | (command)e(substitution,)i(and)e(quote)i(remo)m(v)-5 |
037a8b7f | 10123 | b(al.)41 b(The)26 b(result)h(is)g(treated)h(as)150 4116 |
595e3e69 | 10124 | y(the)j(arithmetic)g(expression)f(to)h(b)s(e)f(ev)-5 |
037a8b7f CR |
10125 | b(aluated.)42 b(Arithmetic)31 b(expansions)g(ma)m(y)g(b)s(e)e(nested.) |
10126 | 275 4252 y(The)34 b(ev)-5 b(aluation)37 b(is)f(p)s(erformed)e | |
10127 | (according)i(to)g(the)g(rules)f(listed)h(b)s(elo)m(w)g(\(see)g(Section) | |
10128 | g(6.5)h([Shell)150 4362 y(Arithmetic],)32 b(page)f(88\).)42 | |
10129 | b(If)30 b(the)h(expression)f(is)g(in)m(v)-5 b(alid,)32 | |
10130 | b(Bash)e(prin)m(ts)g(a)h(message)g(indicating)h(failure)150 | |
10131 | 4472 y(to)f(the)g(standard)e(error)h(and)g(no)g(substitution)g(o)s | |
10132 | (ccurs.)150 4673 y Fk(3.5.6)63 b(Pro)s(cess)42 b(Substitution)150 | |
10133 | 4820 y Fu(Pro)s(cess)33 b(substitution)g(allo)m(ws)i(a)e(pro)s(cess's)g | |
10134 | (input)f(or)h(output)g(to)h(b)s(e)f(referred)f(to)i(using)f(a)g | |
10135 | (\014lename.)150 4930 y(It)d(tak)m(es)i(the)f(form)f(of)390 | |
10136 | 5066 y Ft(<\()p Fj(list)p Ft(\))150 5203 y Fu(or)390 | |
10137 | 5340 y Ft(>\()p Fj(list)p Ft(\))p eop end | |
8a0829e9 CR |
10138 | %%Page: 30 36 |
10139 | TeXDict begin 30 35 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
037a8b7f CR |
10140 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(30)150 299 |
10141 | y(The)28 b(pro)s(cess)h Fr(list)j Fu(is)d(run)e(async)m(hronously)-8 | |
10142 | b(,)30 b(and)e(its)i(input)e(or)h(output)f(app)s(ears)h(as)g(a)g | |
10143 | (\014lename.)41 b(This)150 408 y(\014lename)25 b(is)g(passed)g(as)g(an) | |
10144 | g(argumen)m(t)h(to)g(the)f(curren)m(t)g(command)g(as)g(the)g(result)g | |
10145 | (of)g(the)h(expansion.)38 b(If)150 518 y(the)28 b Ft(>\()p | |
10146 | Fj(list)p Ft(\))d Fu(form)i(is)g(used,)h(writing)f(to)h(the)g(\014le)f | |
10147 | (will)h(pro)m(vide)g(input)e(for)h Fr(list)p Fu(.)41 | |
10148 | b(If)26 b(the)i Ft(<\()p Fj(list)p Ft(\))d Fu(form)150 | |
10149 | 628 y(is)g(used,)g(the)f(\014le)h(passed)f(as)h(an)f(argumen)m(t)h | |
10150 | (should)e(b)s(e)h(read)h(to)g(obtain)g(the)f(output)g(of)h | |
10151 | Fr(list)p Fu(.)40 b(Note)25 b(that)150 737 y(no)33 b(space)g(ma)m(y)g | |
10152 | (app)s(ear)f(b)s(et)m(w)m(een)i(the)f Ft(<)f Fu(or)h | |
10153 | Ft(>)f Fu(and)g(the)h(left)h(paren)m(thesis,)f(otherwise)h(the)f | |
10154 | (construct)150 847 y(w)m(ould)j(b)s(e)g(in)m(terpreted)g(as)h(a)f | |
10155 | (redirection.)59 b(Pro)s(cess)36 b(substitution)g(is)h(supp)s(orted)d | |
10156 | (on)i(systems)g(that)150 956 y(supp)s(ort)29 b(named)h(pip)s(es)f(\()p | |
10157 | Fm(fif)n(o)p Fu(s\))h(or)h(the)f Ft(/dev/fd)f Fu(metho)s(d)h(of)g | |
d345f817 | 10158 | (naming)g(op)s(en)g(\014les.)275 1099 y(When)36 b(a)m(v)-5 |
037a8b7f | 10159 | b(ailable,)40 b(pro)s(cess)c(substitution)h(is)f(p)s(erformed)f(sim)m |
d345f817 | 10160 | (ultaneously)i(with)g(parameter)g(and)150 1209 y(v)-5 |
037a8b7f | 10161 | b(ariable)31 b(expansion,)g(command)f(substitution,)g(and)g(arithmetic) |
d345f817 CR |
10162 | i(expansion.)150 1417 y Fk(3.5.7)63 b(W)-10 b(ord)41 |
10163 | b(Splitting)150 1564 y Fu(The)30 b(shell)h(scans)g(the)g(results)f(of)h | |
037a8b7f | 10164 | (parameter)g(expansion,)g(command)g(substitution,)g(and)f(arithmetic) |
d345f817 CR |
10165 | 150 1673 y(expansion)g(that)h(did)f(not)g(o)s(ccur)h(within)e(double)h |
10166 | (quotes)h(for)f(w)m(ord)g(splitting.)275 1816 y(The)e(shell)g(treats)i | |
6e51e0d0 | 10167 | (eac)m(h)g(c)m(haracter)g(of)f Ft($IFS)e Fu(as)i(a)g(delimiter,)h(and)e |
d345f817 | 10168 | (splits)g(the)h(results)f(of)h(the)g(other)150 1926 y(expansions)22 |
1101193a | 10169 | b(in)m(to)i(w)m(ords)e(using)h(these)g(c)m(haracters)h(as)f(\014eld)f |
6e51e0d0 | 10170 | (terminators.)39 b(If)22 b Ft(IFS)g Fu(is)h(unset,)h(or)e(its)h(v)-5 |
d345f817 | 10171 | b(alue)150 2036 y(is)36 b(exactly)j Ft(<space><tab><newline>)p |
6e51e0d0 | 10172 | Fu(,)32 b(the)37 b(default,)h(then)e(sequences)h(of)67 |
d345f817 | 10173 | b Ft(<space>)p Fu(,)36 b Ft(<tab>)p Fu(,)h(and)150 2145 |
6e51e0d0 | 10174 | y Ft(<newline>)28 b Fu(at)k(the)f(b)s(eginning)f(and)h(end)f(of)h(the)g |
1101193a | 10175 | (results)g(of)g(the)g(previous)g(expansions)f(are)i(ignored,)150 |
d345f817 | 10176 | 2255 y(and)k(an)m(y)h(sequence)h(of)f Ft(IFS)f Fu(c)m(haracters)i(not)f |
1101193a | 10177 | (at)h(the)f(b)s(eginning)f(or)h(end)f(serv)m(es)h(to)h(delimit)f(w)m |
d345f817 | 10178 | (ords.)150 2364 y(If)43 b Ft(IFS)f Fu(has)h(a)h(v)-5 |
8a0829e9 | 10179 | b(alue)43 b(other)h(than)f(the)g(default,)k(then)c(sequences)h(of)f |
d345f817 | 10180 | (the)h(whitespace)f(c)m(haracters)150 2474 y Ft(space)p |
967625cd CR |
10181 | Fu(,)29 b Ft(tab)p Fu(,)h(and)g Ft(newline)e Fu(are)j(ignored)g(at)g |
10182 | (the)f(b)s(eginning)g(and)g(end)g(of)g(the)h(w)m(ord,)f(as)h(long)g(as) | |
d345f817 | 10183 | g(the)150 2584 y(whitespace)c(c)m(haracter)h(is)f(in)f(the)g(v)-5 |
967625cd | 10184 | b(alue)27 b(of)g Ft(IFS)e Fu(\(an)i Ft(IFS)e Fu(whitespace)i(c)m |
d345f817 | 10185 | (haracter\).)42 b(An)m(y)26 b(c)m(haracter)i(in)150 2693 |
967625cd CR |
10186 | y Ft(IFS)c Fu(that)h(is)g(not)f Ft(IFS)g Fu(whitespace,)j(along)f(with) |
10187 | e(an)m(y)h(adjacen)m(t)h Ft(IFS)e Fu(whitespace)h(c)m(haracters,)i | |
d345f817 | 10188 | (delimits)150 2803 y(a)k(\014eld.)40 b(A)31 b(sequence)g(of)f |
967625cd | 10189 | Ft(IFS)g Fu(whitespace)h(c)m(haracters)h(is)e(also)h(treated)h(as)f(a)f |
d345f817 | 10190 | (delimiter.)42 b(If)30 b(the)g(v)-5 b(alue)150 2912 y(of)31 |
967625cd | 10191 | b Ft(IFS)e Fu(is)h(n)m(ull,)h(no)f(w)m(ord)g(splitting)h(o)s(ccurs.)275 |
d345f817 | 10192 | 3055 y(Explicit)21 b(n)m(ull)g(argumen)m(ts)g(\()p Ft("")g |
037a8b7f | 10193 | Fu(or)g Ft('')p Fu(\))f(are)h(retained)h(and)e(passed)g(to)i(commands)e |
d345f817 | 10194 | (as)i(empt)m(y)f(strings.)150 3165 y(Unquoted)37 b(implicit)i(n)m(ull)f |
037a8b7f | 10195 | (argumen)m(ts,)i(resulting)d(from)g(the)h(expansion)g(of)g(parameters)f |
d345f817 | 10196 | (that)i(ha)m(v)m(e)150 3275 y(no)32 b(v)-5 b(alues,)33 |
037a8b7f CR |
10197 | b(are)f(remo)m(v)m(ed.)47 b(If)32 b(a)g(parameter)h(with)e(no)h(v)-5 |
10198 | b(alue)33 b(is)f(expanded)f(within)h(double)f(quotes,)j(a)150 | |
d345f817 | 10199 | 3384 y(n)m(ull)c(argumen)m(t)g(results)g(and)f(is)h(retained)g(and)f |
037a8b7f | 10200 | (passed)g(to)i(a)f(command)g(as)g(an)f(empt)m(y)i(string.)40 |
d345f817 | 10201 | b(When)150 3494 y(a)f(quoted)f(n)m(ull)g(argumen)m(t)h(app)s(ears)e(as) |
037a8b7f | 10202 | i(part)f(of)g(a)g(w)m(ord)g(whose)g(expansion)g(is)h(non-n)m(ull,)h |
d345f817 CR |
10203 | (the)e(n)m(ull)150 3603 y(argumen)m(t)i(is)f(remo)m(v)m(ed.)69 |
10204 | b(That)39 b(is,)j(the)e(w)m(ord)f Ft(-d'')f Fu(b)s(ecomes)i | |
10205 | Ft(-d)e Fu(after)i(w)m(ord)f(splitting)h(and)f(n)m(ull)150 | |
10206 | 3713 y(argumen)m(t)31 b(remo)m(v)-5 b(al.)275 3856 y(Note)31 | |
10207 | b(that)g(if)g(no)f(expansion)g(o)s(ccurs,)g(no)h(splitting)g(is)f(p)s | |
10208 | (erformed.)150 4064 y Fk(3.5.8)63 b(Filename)41 b(Expansion)150 | |
10209 | 4211 y Fu(After)30 b(w)m(ord)f(splitting,)i(unless)d(the)i | |
10210 | Ft(-f)f Fu(option)h(has)f(b)s(een)g(set)h(\(see)g(Section)h(4.3.1)g | |
10211 | ([The)e(Set)h(Builtin],)150 4320 y(page)d(59\),)i(Bash)d(scans)h(eac)m | |
10212 | (h)h(w)m(ord)e(for)g(the)h(c)m(haracters)g(`)p Ft(*)p | |
10213 | Fu(',)h(`)p Ft(?)p Fu(',)g(and)e(`)p Ft([)p Fu('.)39 | |
10214 | b(If)26 b(one)h(of)g(these)f(c)m(haracters)150 4430 y(app)s(ears,)h | |
037a8b7f CR |
10215 | (then)f(the)h(w)m(ord)f(is)h(regarded)g(as)g(a)g Fr(pattern)p |
10216 | Fu(,)g(and)g(replaced)g(with)f(an)h(alphab)s(etically)h(sorted)150 | |
d345f817 | 10217 | 4539 y(list)k(of)f(\014lenames)g(matc)m(hing)h(the)f(pattern)g(\(see)h |
037a8b7f | 10218 | (Section)f(3.5.8.1)j([P)m(attern)e(Matc)m(hing],)h(page)f(31\).)43 |
d345f817 | 10219 | b(If)150 4649 y(no)26 b(matc)m(hing)i(\014lenames)e(are)h(found,)f(and) |
037a8b7f | 10220 | g(the)h(shell)f(option)h Ft(nullglob)d Fu(is)j(disabled,)g(the)g(w)m |
d345f817 | 10221 | (ord)f(is)g(left)150 4759 y(unc)m(hanged.)40 b(If)30 |
037a8b7f CR |
10222 | b(the)g Ft(nullglob)e Fu(option)i(is)h(set,)f(and)g(no)g(matc)m(hes)h |
10223 | (are)g(found,)e(the)h(w)m(ord)g(is)g(remo)m(v)m(ed.)150 | |
d345f817 | 10224 | 4868 y(If)i(the)g Ft(failglob)e Fu(shell)i(option)h(is)f(set,)h(and)f |
037a8b7f | 10225 | (no)g(matc)m(hes)h(are)g(found,)e(an)h(error)g(message)h(is)f(prin)m |
d345f817 | 10226 | (ted)150 4978 y(and)e(the)g(command)g(is)h(not)f(executed.)42 |
900a813b | 10227 | b(If)30 b(the)g(shell)h(option)g Ft(nocaseglob)c Fu(is)k(enabled,)f |
d345f817 | 10228 | (the)h(matc)m(h)g(is)150 5087 y(p)s(erformed)e(without)h(regard)h(to)g |
900a813b | 10229 | (the)f(case)i(of)e(alphab)s(etic)h(c)m(haracters.)275 |
d345f817 | 10230 | 5230 y(When)23 b(a)h(pattern)f(is)h(used)f(for)g(\014lename)h |
900a813b | 10231 | (expansion,)h(the)e(c)m(haracter)i(`)p Ft(.)p Fu(')f(at)g(the)g(start)g |
d345f817 | 10232 | (of)g(a)g(\014lename)150 5340 y(or)f(immediately)i(follo)m(wing)g(a)f |
900a813b | 10233 | (slash)f(m)m(ust)h(b)s(e)f(matc)m(hed)h(explicitly)-8 |
d345f817 CR |
10234 | b(,)27 b(unless)c(the)g(shell)h(option)g Ft(dotglob)p |
10235 | eop end | |
037a8b7f CR |
10236 | %%Page: 31 37 |
10237 | TeXDict begin 31 36 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
d345f817 CR |
10238 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(31)150 299 |
10239 | y(is)33 b(set.)51 b(When)33 b(matc)m(hing)h(a)g(\014lename,)h(the)e | |
10240 | (slash)h(c)m(haracter)h(m)m(ust)e(alw)m(a)m(ys)i(b)s(e)e(matc)m(hed)h | |
10241 | (explicitly)-8 b(.)150 408 y(In)30 b(other)g(cases,)i(the)e(`)p | |
10242 | Ft(.)p Fu(')h(c)m(haracter)h(is)e(not)h(treated)g(sp)s(ecially)-8 | |
10243 | b(.)275 536 y(See)28 b(the)g(description)g(of)g Ft(shopt)e | |
10244 | Fu(in)i(Section)g(4.3.2)i([The)e(Shopt)f(Builtin],)i(page)g(63,)g(for)f | |
10245 | (a)g(descrip-)150 646 y(tion)j(of)f(the)h Ft(nocaseglob)p | |
10246 | Fu(,)d Ft(nullglob)p Fu(,)g Ft(failglob)p Fu(,)h(and)g | |
10247 | Ft(dotglob)g Fu(options.)275 773 y(The)j Ft(GLOBIGNORE)f | |
10248 | Fu(shell)i(v)-5 b(ariable)34 b(ma)m(y)g(b)s(e)f(used)f(to)i(restrict)g | |
10249 | (the)g(set)f(of)h(\014lenames)f(matc)m(hing)i(a)150 883 | |
10250 | y(pattern.)k(If)25 b Ft(GLOBIGNORE)e Fu(is)j(set,)h(eac)m(h)g(matc)m | |
10251 | (hing)g(\014lename)f(that)g(also)h(matc)m(hes)f(one)g(of)g(the)g | |
10252 | (patterns)150 992 y(in)36 b Ft(GLOBIGNORE)d Fu(is)j(remo)m(v)m(ed)h | |
10253 | (from)e(the)i(list)f(of)g(matc)m(hes.)59 b(If)36 b(the)g | |
10254 | Ft(nocaseglob)d Fu(option)k(is)f(set,)i(the)150 1102 | |
10255 | y(matc)m(hing)i(against)g(the)f(patterns)f(in)h Ft(GLOBIGNORE)d | |
8a0829e9 | 10256 | Fu(is)j(p)s(erformed)e(without)h(regard)h(to)h(case.)66 |
d345f817 | 10257 | b(The)150 1212 y(\014lenames)41 b Ft(.)f Fu(and)g Ft(..)h |
8a0829e9 CR |
10258 | Fu(are)g(alw)m(a)m(ys)h(ignored)f(when)f Ft(GLOBIGNORE)e |
10259 | Fu(is)i(set)i(and)e(not)h(n)m(ull.)72 b(Ho)m(w)m(ev)m(er,)150 | |
d345f817 | 10260 | 1321 y(setting)30 b Ft(GLOBIGNORE)d Fu(to)j(a)f(non-n)m(ull)g(v)-5 |
8a0829e9 | 10261 | b(alue)30 b(has)f(the)g(e\013ect)i(of)f(enabling)f(the)h |
d345f817 | 10262 | Ft(dotglob)d Fu(shell)i(option,)150 1431 y(so)j(all)h(other)f |
8a0829e9 CR |
10263 | (\014lenames)g(b)s(eginning)f(with)h(a)g(`)p Ft(.)p Fu(')g(will)h(matc) |
10264 | m(h.)46 b(T)-8 b(o)32 b(get)h(the)f(old)g(b)s(eha)m(vior)g(of)h | |
d345f817 | 10265 | (ignoring)150 1540 y(\014lenames)c(b)s(eginning)f(with)h(a)h(`)p |
8a0829e9 CR |
10266 | Ft(.)p Fu(',)f(mak)m(e)h(`)p Ft(.*)p Fu(')f(one)h(of)f(the)g(patterns)g |
10267 | (in)g Ft(GLOBIGNORE)p Fu(.)37 b(The)29 b Ft(dotglob)150 | |
d345f817 CR |
10268 | 1650 y Fu(option)i(is)f(disabled)g(when)g Ft(GLOBIGNORE)d |
10269 | Fu(is)k(unset.)150 1835 y Fk(3.5.8.1)63 b(P)m(attern)40 | |
10270 | b(Matc)m(hing)150 1982 y Fu(An)m(y)24 b(c)m(haracter)h(that)f(app)s | |
8a0829e9 | 10271 | (ears)f(in)g(a)h(pattern,)i(other)e(than)f(the)h(sp)s(ecial)g(pattern)g |
d345f817 | 10272 | (c)m(haracters)h(describ)s(ed)150 2092 y(b)s(elo)m(w,)31 |
8a0829e9 CR |
10273 | b(matc)m(hes)g(itself.)42 b(The)29 b Fm(nul)h Fu(c)m(haracter)i(ma)m(y) |
10274 | e(not)h(o)s(ccur)f(in)g(a)h(pattern.)40 b(A)31 b(bac)m(kslash)g(escap)s | |
d345f817 | 10275 | (es)150 2201 y(the)38 b(follo)m(wing)g(c)m(haracter;)43 |
8a0829e9 | 10276 | b(the)37 b(escaping)i(bac)m(kslash)e(is)h(discarded)f(when)f(matc)m |
d345f817 | 10277 | (hing.)63 b(The)36 b(sp)s(ecial)150 2311 y(pattern)30 |
8a0829e9 | 10278 | b(c)m(haracters)i(m)m(ust)f(b)s(e)e(quoted)i(if)f(they)h(are)f(to)i(b)s |
d345f817 | 10279 | (e)d(matc)m(hed)i(literally)-8 b(.)275 2439 y(The)29 |
8a0829e9 | 10280 | b(sp)s(ecial)i(pattern)g(c)m(haracters)h(ha)m(v)m(e)f(the)g(follo)m |
d345f817 | 10281 | (wing)h(meanings:)150 2584 y Ft(*)432 b Fu(Matc)m(hes)31 |
8a0829e9 CR |
10282 | b(an)m(y)e(string,)h(including)f(the)g(n)m(ull)g(string.)41 |
10283 | b(When)29 b(the)g Ft(globstar)e Fu(shell)i(option)630 | |
d345f817 | 10284 | 2694 y(is)37 b(enabled,)h(and)e(`)p Ft(*)p Fu(')h(is)g(used)f(in)g(a)h |
9ec5ed66 | 10285 | (\014lename)g(expansion)g(con)m(text,)j(t)m(w)m(o)e(adjacen)m(t)g(`)p |
d345f817 | 10286 | Ft(*)p Fu('s)630 2803 y(used)f(as)g(a)h(single)g(pattern)g(will)f(matc) |
8a0829e9 | 10287 | m(h)i(all)f(\014les)f(and)g(zero)h(or)g(more)f(directories)i(and)630 |
d345f817 | 10288 | 2913 y(sub)s(directories.)g(If)25 b(follo)m(w)m(ed)j(b)m(y)e(a)g(`)p |
6e51e0d0 | 10289 | Ft(/)p Fu(',)h(t)m(w)m(o)g(adjacen)m(t)h(`)p Ft(*)p Fu('s)e(will)g |
d345f817 CR |
10290 | (matc)m(h)h(only)f(directories)630 3022 y(and)k(sub)s(directories.)150 |
10291 | 3168 y Ft(?)432 b Fu(Matc)m(hes)32 b(an)m(y)f(single)g(c)m(haracter.) | |
10292 | 150 3313 y Ft([...)o(])241 b Fu(Matc)m(hes)27 b(an)m(y)e(one)g(of)g | |
8a0829e9 | 10293 | (the)g(enclosed)g(c)m(haracters.)41 b(A)25 b(pair)f(of)h(c)m(haracters) |
d345f817 | 10294 | i(separated)e(b)m(y)g(a)630 3423 y(h)m(yphen)k(denotes)i(a)g |
6e51e0d0 | 10295 | Fr(range)g(expression)p Fu(;)f(an)m(y)h(c)m(haracter)h(that)f(falls)g |
d345f817 | 10296 | (b)s(et)m(w)m(een)g(those)g(t)m(w)m(o)630 3533 y(c)m(haracters,)d |
ad4aef08 | 10297 | (inclusiv)m(e,)f(using)d(the)h(curren)m(t)f(lo)s(cale's)j(collating)g |
d345f817 | 10298 | (sequence)e(and)f(c)m(haracter)630 3642 y(set,)31 b(is)f(matc)m(hed.)42 |
ad4aef08 | 10299 | b(If)30 b(the)g(\014rst)g(c)m(haracter)i(follo)m(wing)g(the)e(`)p |
6e51e0d0 | 10300 | Ft([)p Fu(')h(is)f(a)h(`)p Ft(!)p Fu(')f(or)g(a)h(`)p |
d345f817 | 10301 | Ft(^)p Fu(')g(then)f(an)m(y)630 3752 y(c)m(haracter)c(not)f(enclosed)g |
6e51e0d0 | 10302 | (is)g(matc)m(hed.)40 b(A)25 b(`)p Fq(\000)p Fu(')f(ma)m(y)i(b)s(e)e |
d345f817 | 10303 | (matc)m(hed)h(b)m(y)f(including)h(it)g(as)g(the)630 3861 |
ad4aef08 | 10304 | y(\014rst)32 b(or)h(last)h(c)m(haracter)h(in)e(the)g(set.)50 |
6e51e0d0 | 10305 | b(A)33 b(`)p Ft(])p Fu(')g(ma)m(y)h(b)s(e)e(matc)m(hed)i(b)m(y)f |
d345f817 | 10306 | (including)g(it)g(as)h(the)630 3971 y(\014rst)25 b(c)m(haracter)i(in)e |
ad4aef08 | 10307 | (the)h(set.)40 b(The)25 b(sorting)h(order)f(of)h(c)m(haracters)h(in)f |
d345f817 | 10308 | (range)g(expressions)f(is)630 4081 y(determined)h(b)m(y)h(the)g(curren) |
fc527055 | 10309 | m(t)f(lo)s(cale)j(and)d(the)h(v)-5 b(alues)27 b(of)g(the)g |
d345f817 CR |
10310 | Ft(LC_COLLATE)d Fu(and)i Ft(LC_ALL)630 4190 y Fu(shell)31 |
10311 | b(v)-5 b(ariables,)31 b(if)f(set.)630 4318 y(F)-8 b(or)34 | |
74d0116b | 10312 | b(example,)g(in)f(the)g(default)g(C)f(lo)s(cale,)k(`)p |
6e51e0d0 | 10313 | Ft([a-dx-z])p Fu(')31 b(is)i(equiv)-5 b(alen)m(t)34 b(to)g(`)p |
d345f817 | 10314 | Ft([abcdxyz])p Fu('.)630 4427 y(Man)m(y)68 b(lo)s(cales)h(sort)f(c)m |
74d0116b | 10315 | (haracters)h(in)e(dictionary)i(order,)76 b(and)67 b(in)g(these)h(lo)s |
d345f817 | 10316 | (cales)630 4537 y(`)p Ft([a-dx-z])p Fu(')36 b(is)i(t)m(ypically)i(not)e |
595e3e69 | 10317 | (equiv)-5 b(alen)m(t)39 b(to)g(`)p Ft([abcdxyz])p Fu(';)g(it)g(migh)m |
d345f817 | 10318 | (t)f(b)s(e)f(equiv)-5 b(alen)m(t)630 4647 y(to)34 b(`)p |
037a8b7f CR |
10319 | Ft([aBbCcDdxXyYz])p Fu(',)c(for)j(example.)49 b(T)-8 |
10320 | b(o)33 b(obtain)h(the)f(traditional)h(in)m(terpretation)h(of)630 | |
d345f817 | 10321 | 4756 y(ranges)e(in)f(brac)m(k)m(et)i(expressions,)g(y)m(ou)f(can)g |
967625cd | 10322 | (force)g(the)g(use)f(of)h(the)g(C)f(lo)s(cale)i(b)m(y)f(setting)630 |
d345f817 | 10323 | 4866 y(the)c Ft(LC_COLLATE)e Fu(or)i Ft(LC_ALL)f Fu(en)m(vironmen)m(t)i |
900a813b | 10324 | (v)-5 b(ariable)30 b(to)g(the)f(v)-5 b(alue)30 b(`)p |
d345f817 CR |
10325 | Ft(C)p Fu(',)g(or)f(enable)h(the)630 4975 y Ft(globasciiranges)c |
10326 | Fu(shell)31 b(option.)630 5103 y(Within)23 b(`)p Ft([)p | |
900a813b CR |
10327 | Fu(')h(and)e(`)p Ft(])p Fu(',)j Fr(c)m(haracter)g(classes)j |
10328 | Fu(can)c(b)s(e)e(sp)s(eci\014ed)h(using)f(the)i(syn)m(tax)f | |
d345f817 | 10329 | Ft([:)p Fr(class)t Ft(:])p Fu(,)630 5212 y(where)30 b |
900a813b | 10330 | Fr(class)35 b Fu(is)30 b(one)h(of)f(the)h(follo)m(wing)h(classes)f |
d345f817 | 10331 | (de\014ned)e(in)h(the)h Fm(posix)f Fu(standard:)870 5340 |
900a813b | 10332 | y Ft(alnum)142 b(alpha)g(ascii)f(blank)h(cntrl)g(digit)g(graph)g(lower) |
d345f817 | 10333 | p eop end |
037a8b7f CR |
10334 | %%Page: 32 38 |
10335 | TeXDict begin 32 37 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
d345f817 CR |
10336 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(32)870 299 |
10337 | y Ft(print)142 b(punct)g(space)f(upper)h(word)190 b(xdigit)630 | |
10338 | 430 y Fu(A)42 b(c)m(haracter)h(class)f(matc)m(hes)h(an)m(y)f(c)m | |
10339 | (haracter)h(b)s(elonging)f(to)g(that)g(class.)75 b(The)41 | |
10340 | b Ft(word)630 539 y Fu(c)m(haracter)32 b(class)f(matc)m(hes)h(letters,) | |
10341 | f(digits,)h(and)d(the)i(c)m(haracter)h(`)p Ft(_)p Fu('.)630 | |
10342 | 670 y(Within)25 b(`)p Ft([)p Fu(')f(and)g(`)p Ft(])p | |
10343 | Fu(',)i(an)e Fr(equiv)-5 b(alence)26 b(class)j Fu(can)24 | |
10344 | b(b)s(e)g(sp)s(eci\014ed)g(using)g(the)g(syn)m(tax)h | |
10345 | Ft([=)p Fr(c)6 b Ft(=])p Fu(,)630 780 y(whic)m(h)29 b(matc)m(hes)i(all) | |
10346 | f(c)m(haracters)h(with)e(the)h(same)g(collation)h(w)m(eigh)m(t)g(\(as)f | |
10347 | (de\014ned)e(b)m(y)i(the)630 890 y(curren)m(t)g(lo)s(cale\))j(as)d(the) | |
10348 | h(c)m(haracter)h Fr(c)p Fu(.)630 1021 y(Within)22 b(`)p | |
10349 | Ft([)p Fu(')f(and)g(`)p Ft(])p Fu(',)j(the)d(syn)m(tax)h | |
10350 | Ft([.)p Fr(sym)m(b)s(ol)t Ft(.])e Fu(matc)m(hes)i(the)g(collating)i | |
10351 | (sym)m(b)s(ol)d Fr(sym)m(b)s(ol)p Fu(.)275 1173 y(If)29 | |
10352 | b(the)g Ft(extglob)f Fu(shell)h(option)h(is)g(enabled)f(using)g(the)h | |
10353 | Ft(shopt)e Fu(builtin,)h(sev)m(eral)i(extended)f(pattern)150 | |
10354 | 1283 y(matc)m(hing)37 b(op)s(erators)e(are)h(recognized.)58 | |
6e51e0d0 | 10355 | b(In)35 b(the)g(follo)m(wing)i(description,)g(a)f Fr(pattern-list)j |
d345f817 | 10356 | Fu(is)d(a)g(list)g(of)150 1392 y(one)d(or)f(more)h(patterns)f |
6e51e0d0 | 10357 | (separated)h(b)m(y)f(a)h(`)p Ft(|)p Fu('.)47 b(Comp)s(osite)33 |
9f178efb | 10358 | b(patterns)f(ma)m(y)i(b)s(e)d(formed)h(using)g(one)h(or)150 |
d345f817 CR |
10359 | 1502 y(more)e(of)f(the)h(follo)m(wing)g(sub-patterns:)150 |
10360 | 1654 y Ft(?\()p Fj(pattern-list)p Ft(\))630 1764 y Fu(Matc)m(hes)h | |
6e51e0d0 | 10361 | (zero)f(or)g(one)f(o)s(ccurrence)h(of)f(the)h(giv)m(en)g(patterns.)150 |
d345f817 | 10362 | 1916 y Ft(*\()p Fj(pattern-list)p Ft(\))630 2026 y Fu(Matc)m(hes)h |
6e51e0d0 | 10363 | (zero)f(or)g(more)f(o)s(ccurrences)h(of)f(the)h(giv)m(en)g(patterns.) |
d345f817 | 10364 | 150 2178 y Ft(+\()p Fj(pattern-list)p Ft(\))630 2288 |
6e51e0d0 | 10365 | y Fu(Matc)m(hes)h(one)f(or)f(more)h(o)s(ccurrences)f(of)h(the)f(giv)m |
d345f817 CR |
10366 | (en)i(patterns.)150 2440 y Ft(@\()p Fj(pattern-list)p |
10367 | Ft(\))630 2550 y Fu(Matc)m(hes)g(one)f(of)f(the)h(giv)m(en)g(patterns.) | |
10368 | 150 2702 y Ft(!\()p Fj(pattern-list)p Ft(\))630 2811 | |
6e51e0d0 | 10369 | y Fu(Matc)m(hes)h(an)m(ything)f(except)g(one)g(of)f(the)h(giv)m(en)g |
d345f817 CR |
10370 | (patterns.)150 3004 y Fk(3.5.9)63 b(Quote)41 b(Remo)m(v)-7 |
10371 | b(al)150 3151 y Fu(After)32 b(the)g(preceding)g(expansions,)h(all)f | |
8a0829e9 CR |
10372 | (unquoted)f(o)s(ccurrences)h(of)g(the)h(c)m(haracters)g(`)p |
10373 | Ft(\\)p Fu(',)g(`)p Ft(')p Fu(',)f(and)g(`)p Ft(")p Fu(')150 | |
d345f817 CR |
10374 | 3260 y(that)f(did)f(not)g(result)g(from)g(one)h(of)g(the)f(ab)s(o)m(v)m |
10375 | (e)i(expansions)e(are)h(remo)m(v)m(ed.)150 3494 y Fs(3.6)68 | |
10376 | b(Redirections)150 3653 y Fu(Before)32 b(a)f(command)f(is)h(executed,)h | |
fc527055 | 10377 | (its)f(input)e(and)h(output)h(ma)m(y)g(b)s(e)f Fr(redirected)k |
d345f817 | 10378 | Fu(using)c(a)i(sp)s(ecial)f(no-)150 3763 y(tation)d(in)m(terpreted)f(b) |
fc527055 | 10379 | m(y)f(the)h(shell.)40 b(Redirection)27 b(allo)m(ws)h(commands')f |
d345f817 | 10380 | (\014le)f(handles)g(to)i(b)s(e)e(duplicated,)150 3873 |
fc527055 | 10381 | y(op)s(ened,)i(closed,)i(made)e(to)h(refer)f(to)h(di\013eren)m(t)f |
ad4aef08 | 10382 | (\014les,)h(and)f(can)g(c)m(hange)h(the)g(\014les)f(the)g(command)g |
d345f817 | 10383 | (reads)150 3982 y(from)39 b(and)g(writes)h(to.)69 b(Redirection)40 |
abe2eb5b | 10384 | b(ma)m(y)g(also)h(b)s(e)e(used)g(to)h(mo)s(dify)f(\014le)g(handles)g |
d345f817 | 10385 | (in)g(the)h(curren)m(t)150 4092 y(shell)e(execution)h(en)m(vironmen)m |
abe2eb5b | 10386 | (t.)65 b(The)37 b(follo)m(wing)j(redirection)f(op)s(erators)f(ma)m(y)g |
d345f817 | 10387 | (precede)h(or)f(app)s(ear)150 4201 y(an)m(ywhere)30 b(within)f(a)h |
abe2eb5b | 10388 | (simple)f(command)h(or)f(ma)m(y)i(follo)m(w)g(a)f(command.)40 |
d345f817 | 10389 | b(Redirections)30 b(are)g(pro)s(cessed)150 4311 y(in)g(the)h(order)f |
595e3e69 | 10390 | (they)g(app)s(ear,)g(from)g(left)h(to)g(righ)m(t.)275 |
d345f817 | 10391 | 4442 y(Eac)m(h)45 b(redirection)h(that)f(ma)m(y)h(b)s(e)e(preceded)g(b) |
fc527055 | 10392 | m(y)h(a)h(\014le)f(descriptor)f(n)m(um)m(b)s(er)g(ma)m(y)h(instead)h(b) |
d345f817 | 10393 | s(e)150 4551 y(preceded)41 b(b)m(y)g(a)h(w)m(ord)f(of)g(the)h(form)f |
6e51e0d0 | 10394 | Fi({)p Fr(v)-5 b(arname)5 b Fi(})p Fu(.)74 b(In)41 b(this)g(case,)k |
d345f817 | 10395 | (for)c(eac)m(h)i(redirection)f(op)s(erator)150 4661 y(except)30 |
037a8b7f CR |
10396 | b Ft(>)p Fu(&-)f(and)f Ft(<)p Fu(&-,)h(the)g(shell)g(will)h(allo)s |
10397 | (cate)h(a)e(\014le)h(descriptor)e(greater)j(than)d(10)i(and)e(assign)i | |
d345f817 | 10398 | (it)f(to)150 4771 y Fi({)p Fr(v)-5 b(arname)5 b Fi(})p |
037a8b7f CR |
10399 | Fu(.)45 b(If)31 b Ft(>)p Fu(&-)g(or)h Ft(<)p Fu(&-)f(is)h(preceded)f(b) |
10400 | m(y)g Fi({)p Fr(v)-5 b(arname)5 b Fi(})p Fu(,)33 b(the)f(v)-5 | |
10401 | b(alue)32 b(of)g Fr(v)-5 b(arname)36 b Fu(de\014nes)31 | |
d345f817 | 10402 | b(the)h(\014le)150 4880 y(descriptor)e(to)h(close.)275 |
037a8b7f CR |
10403 | 5011 y(In)c(the)i(follo)m(wing)h(descriptions,)g(if)e(the)h(\014le)g |
10404 | (descriptor)f(n)m(um)m(b)s(er)g(is)g(omitted,)i(and)f(the)f(\014rst)g | |
10405 | (c)m(har-)150 5121 y(acter)42 b(of)f(the)g(redirection)g(op)s(erator)g | |
10406 | (is)g(`)p Ft(<)p Fu(',)i(the)e(redirection)g(refers)g(to)g(the)g | |
10407 | (standard)f(input)f(\(\014le)150 5230 y(descriptor)33 | |
10408 | b(0\).)49 b(If)33 b(the)g(\014rst)f(c)m(haracter)i(of)g(the)f | |
10409 | (redirection)g(op)s(erator)h(is)f(`)p Ft(>)p Fu(',)h(the)f(redirection) | |
10410 | g(refers)150 5340 y(to)e(the)g(standard)e(output)h(\(\014le)h | |
10411 | (descriptor)f(1\).)p eop end | |
8a0829e9 CR |
10412 | %%Page: 33 39 |
10413 | TeXDict begin 33 38 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
037a8b7f CR |
10414 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(33)275 299 |
10415 | y(The)31 b(w)m(ord)h(follo)m(wing)i(the)f(redirection)g(op)s(erator)f | |
900a813b | 10416 | (in)g(the)h(follo)m(wing)h(descriptions,)f(unless)e(other-)150 |
037a8b7f | 10417 | 408 y(wise)21 b(noted,)i(is)e(sub)5 b(jected)21 b(to)h(brace)f |
900a813b | 10418 | (expansion,)i(tilde)f(expansion,)h(parameter)e(expansion,)i(command)150 |
037a8b7f | 10419 | 518 y(substitution,)31 b(arithmetic)h(expansion,)f(quote)h(remo)m(v)-5 |
900a813b | 10420 | b(al,)33 b(\014lename)e(expansion,)g(and)f(w)m(ord)h(splitting.)150 |
037a8b7f CR |
10421 | 628 y(If)f(it)h(expands)e(to)i(more)g(than)f(one)h(w)m(ord,)f(Bash)h |
10422 | (rep)s(orts)e(an)h(error.)275 790 y(Note)h(that)g(the)g(order)f(of)g | |
900a813b | 10423 | (redirections)h(is)g(signi\014can)m(t.)41 b(F)-8 b(or)31 |
037a8b7f CR |
10424 | b(example,)h(the)e(command)390 953 y Ft(ls)47 b(>)h Fj(dirlist)d |
10425 | Ft(2>&1)150 1115 y Fu(directs)28 b(b)s(oth)f(standard)g(output)g | |
10426 | (\(\014le)h(descriptor)f(1\))i(and)e(standard)f(error)i(\(\014le)g | |
10427 | (descriptor)f(2\))h(to)h(the)150 1225 y(\014le)h Fr(dirlist)p | |
10428 | Fu(,)h(while)f(the)h(command)390 1388 y Ft(ls)47 b(2>&1)g(>)g | |
10429 | Fj(dirlist)150 1550 y Fu(directs)28 b(only)f(the)h(standard)e(output)i | |
10430 | (to)g(\014le)f Fr(dirlist)p Fu(,)h(b)s(ecause)g(the)f(standard)g(error) | |
10431 | g(w)m(as)h(made)f(a)h(cop)m(y)150 1660 y(of)j(the)f(standard)g(output)g | |
10432 | (b)s(efore)g(the)g(standard)g(output)g(w)m(as)g(redirected)h(to)g | |
10433 | Fr(dirlist)p Fu(.)275 1822 y(Bash)26 b(handles)f(sev)m(eral)j | |
10434 | (\014lenames)e(sp)s(ecially)h(when)f(they)g(are)g(used)g(in)g | |
10435 | (redirections,)i(as)e(describ)s(ed)150 1932 y(in)k(the)h(follo)m(wing)g | |
10436 | (table:)150 2133 y Ft(/dev/fd/)p Fj(fd)630 2243 y Fu(If)f | |
10437 | Fr(fd)j Fu(is)d(a)h(v)-5 b(alid)31 b(in)m(teger,)h(\014le)e(descriptor) | |
10438 | h Fr(fd)i Fu(is)d(duplicated.)150 2431 y Ft(/dev/stdin)630 | |
10439 | 2540 y Fu(File)i(descriptor)e(0)h(is)f(duplicated.)150 | |
10440 | 2728 y Ft(/dev/stdout)630 2837 y Fu(File)i(descriptor)e(1)h(is)f | |
10441 | (duplicated.)150 3025 y Ft(/dev/stderr)630 3134 y Fu(File)i(descriptor) | |
10442 | e(2)h(is)f(duplicated.)150 3322 y Ft(/dev/tcp/)p Fj(host)p | |
10443 | Ft(/)p Fj(port)630 3431 y Fu(If)41 b Fr(host)i Fu(is)f(a)g(v)-5 | |
8a0829e9 | 10444 | b(alid)41 b(hostname)h(or)f(In)m(ternet)h(address,)i(and)c |
037a8b7f | 10445 | Fr(p)s(ort)j Fu(is)f(an)f(in)m(teger)i(p)s(ort)630 3541 |
8a0829e9 CR |
10446 | y(n)m(um)m(b)s(er)23 b(or)i(service)h(name,)g(Bash)f(attempts)h(to)f |
10447 | (op)s(en)f(the)h(corresp)s(onding)f(TCP)g(so)s(c)m(k)m(et.)150 | |
037a8b7f | 10448 | 3728 y Ft(/dev/udp/)p Fj(host)p Ft(/)p Fj(port)630 3838 |
6e51e0d0 CR |
10449 | y Fu(If)41 b Fr(host)i Fu(is)f(a)g(v)-5 b(alid)41 b(hostname)h(or)f(In) |
10450 | m(ternet)h(address,)i(and)c Fr(p)s(ort)j Fu(is)f(an)f(in)m(teger)i(p)s | |
037a8b7f | 10451 | (ort)630 3948 y(n)m(um)m(b)s(er)23 b(or)h(service)h(name,)h(Bash)e |
6e51e0d0 | 10452 | (attempts)h(to)g(op)s(en)f(the)g(corresp)s(onding)f(UDP)i(so)s(c)m(k)m |
037a8b7f | 10453 | (et.)275 4149 y(A)30 b(failure)h(to)g(op)s(en)e(or)i(create)h(a)e |
fc527055 | 10454 | (\014le)h(causes)g(the)f(redirection)h(to)g(fail.)275 |
037a8b7f | 10455 | 4312 y(Redirections)f(using)e(\014le)i(descriptors)f(greater)h(than)f |
fc527055 | 10456 | (9)h(should)e(b)s(e)h(used)f(with)h(care,)h(as)g(they)f(ma)m(y)150 |
037a8b7f CR |
10457 | 4421 y(con\015ict)i(with)f(\014le)h(descriptors)f(the)g(shell)h(uses)f |
10458 | (in)m(ternally)-8 b(.)150 4649 y Fk(3.6.1)63 b(Redirecting)40 | |
10459 | b(Input)150 4796 y Fu(Redirection)35 b(of)f(input)f(causes)i(the)f | |
fc527055 | 10460 | (\014le)g(whose)g(name)g(results)g(from)g(the)g(expansion)g(of)g |
037a8b7f | 10461 | Fr(w)m(ord)k Fu(to)d(b)s(e)150 4905 y(op)s(ened)d(for)g(reading)g(on)g |
fc527055 CR |
10462 | (\014le)h(descriptor)f Ft(n)p Fu(,)h(or)f(the)g(standard)g(input)f |
10463 | (\(\014le)i(descriptor)f(0\))h(if)f Ft(n)g Fu(is)h(not)150 | |
037a8b7f CR |
10464 | 5015 y(sp)s(eci\014ed.)275 5177 y(The)c(general)j(format)e(for)h |
10465 | (redirecting)g(input)e(is:)390 5340 y Ft([)p Fj(n)p Ft(]<)p | |
10466 | Fj(word)p eop end | |
8a0829e9 CR |
10467 | %%Page: 34 40 |
10468 | TeXDict begin 34 39 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
037a8b7f CR |
10469 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(34)150 299 |
10470 | y Fk(3.6.2)63 b(Redirecting)40 b(Output)150 446 y Fu(Redirection)31 | |
8a0829e9 CR |
10471 | b(of)g(output)f(causes)h(the)f(\014le)h(whose)f(name)g(results)h(from)e |
10472 | (the)i(expansion)f(of)h Fr(w)m(ord)i Fu(to)f(b)s(e)150 | |
037a8b7f | 10473 | 555 y(op)s(ened)d(for)g(writing)g(on)g(\014le)h(descriptor)f |
8a0829e9 | 10474 | Fr(n)p Fu(,)g(or)g(the)h(standard)e(output)h(\(\014le)h(descriptor)f |
037a8b7f | 10475 | (1\))h(if)g Fr(n)e Fu(is)i(not)150 665 y(sp)s(eci\014ed.)40 |
8a0829e9 CR |
10476 | b(If)30 b(the)g(\014le)h(do)s(es)f(not)h(exist)g(it)g(is)f(created;)i |
10477 | (if)e(it)h(do)s(es)f(exist)h(it)g(is)g(truncated)f(to)h(zero)g(size.) | |
037a8b7f CR |
10478 | 275 812 y(The)e(general)j(format)e(for)h(redirecting)g(output)f(is:)390 |
10479 | 959 y Ft([)p Fj(n)p Ft(]>[|])p Fj(word)275 1107 y Fu(If)g(the)h | |
10480 | (redirection)g(op)s(erator)g(is)g(`)p Ft(>)p Fu(',)g(and)f(the)h | |
10481 | Ft(noclobber)d Fu(option)j(to)g(the)g Ft(set)f Fu(builtin)g(has)h(b)s | |
10482 | (een)150 1216 y(enabled,)h(the)g(redirection)h(will)f(fail)h(if)e(the)i | |
10483 | (\014le)e(whose)h(name)g(results)g(from)f(the)h(expansion)g(of)g | |
10484 | Fr(w)m(ord)150 1326 y Fu(exists)f(and)f(is)g(a)h(regular)g(\014le.)41 | |
37c41ab1 | 10485 | b(If)30 b(the)h(redirection)g(op)s(erator)g(is)f(`)p |
6e51e0d0 | 10486 | Ft(>|)p Fu(',)h(or)f(the)h(redirection)g(op)s(erator)g(is)150 |
037a8b7f | 10487 | 1435 y(`)p Ft(>)p Fu(')36 b(and)f(the)g Ft(noclobber)e |
6e51e0d0 | 10488 | Fu(option)j(is)g(not)g(enabled,)h(the)e(redirection)h(is)g(attempted)g |
037a8b7f CR |
10489 | (ev)m(en)h(if)e(the)h(\014le)150 1545 y(named)30 b(b)m(y)g |
10490 | Fr(w)m(ord)k Fu(exists.)150 1757 y Fk(3.6.3)63 b(App)s(ending)42 | |
10491 | b(Redirected)e(Output)150 1904 y Fu(Redirection)23 b(of)e(output)h(in)f | |
74d0116b | 10492 | (this)h(fashion)f(causes)h(the)g(\014le)g(whose)f(name)h(results)f |
037a8b7f | 10493 | (from)g(the)h(expansion)g(of)150 2013 y Fr(w)m(ord)28 |
6e51e0d0 CR |
10494 | b Fu(to)e(b)s(e)e(op)s(ened)g(for)h(app)s(ending)e(on)i(\014le)g |
10495 | (descriptor)g Fr(n)p Fu(,)g(or)g(the)g(standard)f(output)h(\(\014le)g | |
037a8b7f | 10496 | (descriptor)150 2123 y(1\))31 b(if)f Fr(n)g Fu(is)h(not)f(sp)s |
74d0116b | 10497 | (eci\014ed.)40 b(If)30 b(the)h(\014le)f(do)s(es)g(not)h(exist)g(it)g |
037a8b7f CR |
10498 | (is)f(created.)275 2270 y(The)f(general)j(format)e(for)h(app)s(ending)e |
10499 | (output)h(is:)390 2417 y Ft([)p Fj(n)p Ft(]>>)p Fj(word)150 | |
10500 | 2629 y Fk(3.6.4)63 b(Redirecting)40 b(Standard)h(Output)g(and)g | |
10501 | (Standard)g(Error)150 2776 y Fu(This)33 b(construct)i(allo)m(ws)g(b)s | |
9ec5ed66 | 10502 | (oth)f(the)g(standard)g(output)f(\(\014le)i(descriptor)f(1\))h(and)f |
037a8b7f | 10503 | (the)g(standard)f(error)150 2886 y(output)d(\(\014le)h(descriptor)f |
74d0116b | 10504 | (2\))h(to)g(b)s(e)f(redirected)h(to)g(the)f(\014le)h(whose)f(name)h(is) |
037a8b7f | 10505 | f(the)g(expansion)h(of)f Fr(w)m(ord)p Fu(.)275 3033 y(There)f(are)i(t)m |
74d0116b | 10506 | (w)m(o)h(formats)e(for)h(redirecting)g(standard)e(output)h(and)g |
037a8b7f CR |
10507 | (standard)f(error:)390 3180 y Ft(&>)p Fj(word)150 3328 |
10508 | y Fu(and)390 3475 y Ft(>&)p Fj(word)150 3622 y Fu(Of)h(the)g(t)m(w)m(o) | |
8a0829e9 CR |
10509 | i(forms,)e(the)h(\014rst)e(is)i(preferred.)39 b(This)30 |
10510 | b(is)g(seman)m(tically)j(equiv)-5 b(alen)m(t)32 b(to)390 | |
037a8b7f | 10511 | 3769 y Ft(>)p Fj(word)46 b Ft(2>&1)275 3916 y Fu(When)41 |
8a0829e9 CR |
10512 | b(using)g(the)h(second)f(form,)k Fr(w)m(ord)f Fu(ma)m(y)e(not)g(expand) |
10513 | f(to)h(a)g(n)m(um)m(b)s(er)f(or)g(`)p Ft(-)p Fu('.)75 | |
037a8b7f | 10514 | b(If)41 b(it)h(do)s(es,)150 4026 y(other)27 b(redirection)g(op)s |
8a0829e9 | 10515 | (erators)f(apply)h(\(see)g(Duplicating)h(File)f(Descriptors)h(b)s(elo)m |
037a8b7f CR |
10516 | (w\))f(for)f(compatibilit)m(y)150 4135 y(reasons.)150 |
10517 | 4347 y Fk(3.6.5)63 b(App)s(ending)42 b(Standard)f(Output)g(and)g | |
10518 | (Standard)g(Error)150 4494 y Fu(This)33 b(construct)i(allo)m(ws)g(b)s | |
8a0829e9 | 10519 | (oth)f(the)g(standard)g(output)f(\(\014le)i(descriptor)f(1\))h(and)f |
037a8b7f | 10520 | (the)g(standard)f(error)150 4604 y(output)d(\(\014le)h(descriptor)f |
8a0829e9 | 10521 | (2\))h(to)g(b)s(e)f(app)s(ended)f(to)i(the)f(\014le)h(whose)f(name)g |
037a8b7f | 10522 | (is)h(the)f(expansion)h(of)f Fr(w)m(ord)p Fu(.)275 4751 |
8a0829e9 | 10523 | y(The)f(format)i(for)f(app)s(ending)f(standard)h(output)g(and)f |
037a8b7f CR |
10524 | (standard)h(error)g(is:)390 4898 y Ft(&>>)p Fj(word)150 |
10525 | 5046 y Fu(This)g(is)g(seman)m(tically)j(equiv)-5 b(alen)m(t)32 | |
10526 | b(to)390 5193 y Ft(>>)p Fj(word)46 b Ft(2>&1)275 5340 | |
8a0829e9 CR |
10527 | y Fu(\(see)31 b(Duplicating)h(File)f(Descriptors)g(b)s(elo)m(w\).)p |
10528 | eop end | |
10529 | %%Page: 35 41 | |
10530 | TeXDict begin 35 40 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10531 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(35)150 299 | |
10532 | y Fk(3.6.6)63 b(Here)41 b(Do)s(cumen)m(ts)150 446 y Fu(This)26 | |
10533 | b(t)m(yp)s(e)g(of)h(redirection)g(instructs)f(the)g(shell)h(to)g(read)f | |
10534 | (input)g(from)g(the)g(curren)m(t)h(source)f(un)m(til)h(a)g(line)150 | |
10535 | 555 y(con)m(taining)h(only)e Fr(w)m(ord)k Fu(\(with)c(no)g(trailing)h | |
10536 | (blanks\))f(is)g(seen.)40 b(All)27 b(of)f(the)g(lines)h(read)f(up)f(to) | |
10537 | i(that)g(p)s(oin)m(t)150 665 y(are)k(then)f(used)f(as)i(the)g(standard) | |
10538 | e(input)h(\(or)g(\014le)h(descriptor)f Fr(n)g Fu(if)g | |
10539 | Fr(n)g Fu(is)g(sp)s(eci\014ed\))g(for)h(a)f(command.)275 | |
10540 | 823 y(The)f(format)i(of)g(here-do)s(cumen)m(ts)f(is:)390 | |
10541 | 982 y Ft([)p Fj(n)p Ft(]<<[)p Fq(\000)p Ft(])p Fj(word)772 | |
10542 | 1091 y(here-document)390 1201 y(delimiter)275 1360 y | |
6e51e0d0 | 10543 | Fu(No)i(parameter)h(and)f(v)-5 b(ariable)32 b(expansion,)h(command)f |
8a0829e9 | 10544 | (substitution,)h(arithmetic)g(expansion,)g(or)150 1469 |
6e51e0d0 CR |
10545 | y(\014lename)38 b(expansion)g(is)g(p)s(erformed)e(on)i |
10546 | Fr(w)m(ord)p Fu(.)62 b(If)38 b(an)m(y)g(c)m(haracters)h(in)e | |
8a0829e9 | 10547 | Fr(w)m(ord)42 b Fu(are)c(quoted,)i(the)e Fr(de-)150 1579 |
6e51e0d0 CR |
10548 | y(limiter)h Fu(is)32 b(the)h(result)f(of)g(quote)h(remo)m(v)-5 |
10549 | b(al)33 b(on)f Fr(w)m(ord)p Fu(,)g(and)g(the)g(lines)g(in)g(the)g | |
8a0829e9 | 10550 | (here-do)s(cumen)m(t)g(are)h(not)150 1688 y(expanded.)71 |
6e51e0d0 | 10551 | b(If)40 b Fr(w)m(ord)k Fu(is)d(unquoted,)h(all)g(lines)f(of)g(the)f |
278286c9 | 10552 | (here-do)s(cumen)m(t)h(are)g(sub)5 b(jected)41 b(to)g(param-)150 |
8a0829e9 CR |
10553 | 1798 y(eter)c(expansion,)i(command)d(substitution,)i(and)e(arithmetic)i |
10554 | (expansion,)g(the)f(c)m(haracter)i(sequence)150 1907 | |
6e51e0d0 CR |
10555 | y Ft(\\newline)28 b Fu(is)j(ignored,)f(and)g(`)p Ft(\\)p |
10556 | Fu(')h(m)m(ust)f(b)s(e)g(used)f(to)i(quote)g(the)g(c)m(haracters)h(`)p | |
10557 | Ft(\\)p Fu(',)e(`)p Ft($)p Fu(',)h(and)f(`)p Ft(`)p Fu('.)275 | |
8a0829e9 | 10558 | 2066 y(If)21 b(the)i(redirection)g(op)s(erator)g(is)f(`)p |
6e51e0d0 | 10559 | Ft(<<-)p Fu(',)i(then)e(all)h(leading)g(tab)g(c)m(haracters)h(are)e |
8a0829e9 | 10560 | (stripp)s(ed)f(from)h(input)150 2175 y(lines)33 b(and)f(the)h(line)h |
6e51e0d0 CR |
10561 | (con)m(taining)g Fr(delimiter)p Fu(.)49 b(This)32 b(allo)m(ws)i |
10562 | (here-do)s(cumen)m(ts)f(within)f(shell)i(scripts)e(to)150 | |
8a0829e9 CR |
10563 | 2285 y(b)s(e)e(inden)m(ted)g(in)g(a)h(natural)f(fashion.)150 |
10564 | 2508 y Fk(3.6.7)63 b(Here)41 b(Strings)150 2655 y Fu(A)30 | |
74d0116b | 10565 | b(v)-5 b(arian)m(t)32 b(of)e(here)h(do)s(cumen)m(ts,)f(the)g(format)h |
8a0829e9 CR |
10566 | (is:)390 2814 y Ft([)p Fj(n)p Ft(]<<<)46 b Fj(word)275 |
10567 | 2972 y Fu(The)21 b Fr(w)m(ord)k Fu(undergo)s(es)c(brace)h(expansion,)i | |
10568 | (tilde)e(expansion,)i(parameter)e(and)f(v)-5 b(ariable)23 | |
10569 | b(expansion,)150 3082 y(command)j(substitution,)g(arithmetic)i | |
10570 | (expansion,)f(and)e(quote)i(remo)m(v)-5 b(al.)40 b(P)m(athname)27 | |
967625cd CR |
10571 | b(expansion)f(and)150 3191 y(w)m(ord)32 b(splitting)h(are)g(not)g(p)s |
10572 | (erformed.)46 b(The)32 b(result)g(is)h(supplied)e(as)i(a)f(single)i | |
10573 | (string,)f(with)f(a)h(newline)150 3301 y(app)s(ended,)c(to)i(the)g | |
10574 | (command)f(on)g(its)h(standard)e(input)h(\(or)g(\014le)h(descriptor)f | |
10575 | Fr(n)g Fu(if)g Fr(n)g Fu(is)g(sp)s(eci\014ed\).)150 3524 | |
10576 | y Fk(3.6.8)63 b(Duplicating)41 b(File)g(Descriptors)150 | |
10577 | 3671 y Fu(The)30 b(redirection)h(op)s(erator)390 3829 | |
10578 | y Ft([)p Fj(n)p Ft(]<&)p Fj(word)150 3988 y Fu(is)k(used)e(to)j | |
10579 | (duplicate)f(input)f(\014le)g(descriptors.)53 b(If)34 | |
10580 | b Fr(w)m(ord)k Fu(expands)c(to)h(one)g(or)g(more)g(digits,)h(the)f | |
10581 | (\014le)150 4098 y(descriptor)e(denoted)h(b)m(y)f Fr(n)g | |
10582 | Fu(is)g(made)h(to)g(b)s(e)f(a)g(cop)m(y)h(of)g(that)g(\014le)f | |
8a0829e9 CR |
10583 | (descriptor.)50 b(If)33 b(the)h(digits)g(in)f Fr(w)m(ord)150 |
10584 | 4207 y Fu(do)c(not)h(sp)s(ecify)f(a)h(\014le)f(descriptor)g(op)s(en)g | |
10585 | (for)g(input,)g(a)h(redirection)g(error)f(o)s(ccurs.)40 | |
10586 | b(If)29 b Fr(w)m(ord)j Fu(ev)-5 b(aluates)150 4317 y(to)31 | |
10587 | b(`)p Ft(-)p Fu(',)g(\014le)g(descriptor)g Fr(n)f Fu(is)g(closed.)43 | |
10588 | b(If)30 b Fr(n)g Fu(is)g(not)h(sp)s(eci\014ed,)f(the)h(standard)f | |
10589 | (input)g(\(\014le)h(descriptor)f(0\))150 4426 y(is)g(used.)275 | |
10590 | 4585 y(The)f(op)s(erator)390 4743 y Ft([)p Fj(n)p Ft(]>&)p | |
10591 | Fj(word)150 4902 y Fu(is)40 b(used)g(similarly)h(to)g(duplicate)f | |
10592 | (output)g(\014le)h(descriptors.)70 b(If)40 b Fr(n)f Fu(is)i(not)f(sp)s | |
10593 | (eci\014ed,)i(the)f(standard)150 5011 y(output)30 b(\(\014le)g | |
10594 | (descriptor)g(1\))h(is)f(used.)39 b(If)30 b(the)g(digits)h(in)e | |
10595 | Fr(w)m(ord)34 b Fu(do)29 b(not)i(sp)s(ecify)e(a)i(\014le)f(descriptor)g | |
10596 | (op)s(en)150 5121 y(for)35 b(output,)h(a)g(redirection)g(error)e(o)s | |
10597 | (ccurs.)55 b(If)35 b Fr(w)m(ord)j Fu(ev)-5 b(aluates)37 | |
10598 | b(to)f(`)p Ft(-)p Fu(',)h(\014le)e(descriptor)g Fr(n)g | |
10599 | Fu(is)g(closed.)150 5230 y(As)f(a)g(sp)s(ecial)h(case,)h(if)e | |
10600 | Fr(n)f Fu(is)h(omitted,)i(and)e Fr(w)m(ord)j Fu(do)s(es)d(not)g(expand) | |
10601 | f(to)i(one)f(or)g(more)g(digits)h(or)f(`)p Ft(-)p Fu(',)150 | |
10602 | 5340 y(the)d(standard)e(output)h(and)g(standard)f(error)h(are)h | |
10603 | (redirected)g(as)g(describ)s(ed)e(previously)-8 b(.)p | |
fc527055 | 10604 | eop end |
8a0829e9 CR |
10605 | %%Page: 36 42 |
10606 | TeXDict begin 36 41 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10607 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(36)150 299 | |
10608 | y Fk(3.6.9)63 b(Mo)m(ving)41 b(File)h(Descriptors)150 | |
967625cd CR |
10609 | 446 y Fu(The)30 b(redirection)h(op)s(erator)390 572 y |
10610 | Ft([)p Fj(n)p Ft(]<&)p Fj(digit)p Ft(-)150 698 y Fu(mo)m(v)m(es)i(the)f | |
8a0829e9 CR |
10611 | (\014le)g(descriptor)f Fr(digit)k Fu(to)d(\014le)g(descriptor)g |
10612 | Fr(n)p Fu(,)f(or)h(the)g(standard)f(input)f(\(\014le)j(descriptor)e | |
967625cd | 10613 | (0\))150 808 y(if)f Fr(n)g Fu(is)h(not)f(sp)s(eci\014ed.)40 |
8a0829e9 | 10614 | b Fr(digit)33 b Fu(is)e(closed)g(after)g(b)s(eing)f(duplicated)g(to)h |
967625cd CR |
10615 | Fr(n)p Fu(.)275 934 y(Similarly)-8 b(,)31 b(the)f(redirection)h(op)s |
10616 | (erator)390 1061 y Ft([)p Fj(n)p Ft(]>&)p Fj(digit)p | |
10617 | Ft(-)150 1187 y Fu(mo)m(v)m(es)e(the)g(\014le)f(descriptor)f | |
6e51e0d0 | 10618 | Fr(digit)k Fu(to)e(\014le)f(descriptor)g Fr(n)p Fu(,)g(or)g(the)g |
abe2eb5b | 10619 | (standard)f(output)h(\(\014le)g(descriptor)g(1\))150 |
967625cd CR |
10620 | 1297 y(if)i Fr(n)g Fu(is)h(not)f(sp)s(eci\014ed.)150 |
10621 | 1479 y Fk(3.6.10)63 b(Op)s(ening)42 b(File)g(Descriptors)g(for)g | |
10622 | (Reading)e(and)h(W)-10 b(riting)150 1626 y Fu(The)30 | |
10623 | b(redirection)h(op)s(erator)390 1753 y Ft([)p Fj(n)p | |
10624 | Ft(]<>)p Fj(word)150 1879 y Fu(causes)39 b(the)g(\014le)g(whose)g(name) | |
6e51e0d0 | 10625 | g(is)g(the)g(expansion)g(of)g Fr(w)m(ord)j Fu(to)d(b)s(e)g(op)s(ened)f |
967625cd | 10626 | (for)g(b)s(oth)h(reading)g(and)150 1989 y(writing)33 |
6e51e0d0 CR |
10627 | b(on)f(\014le)h(descriptor)f Fr(n)p Fu(,)h(or)g(on)f(\014le)h |
10628 | (descriptor)g(0)g(if)f Fr(n)g Fu(is)h(not)g(sp)s(eci\014ed.)47 | |
967625cd CR |
10629 | b(If)32 b(the)h(\014le)f(do)s(es)h(not)150 2098 y(exist,)e(it)g(is)g |
10630 | (created.)150 2323 y Fs(3.7)68 b(Executing)46 b(Commands)150 | |
10631 | 2539 y Fk(3.7.1)63 b(Simple)41 b(Command)h(Expansion)150 | |
10632 | 2686 y Fu(When)33 b(a)g(simple)g(command)g(is)g(executed,)h(the)g | |
abe2eb5b | 10633 | (shell)f(p)s(erforms)e(the)i(follo)m(wing)i(expansions,)e(assign-)150 |
967625cd CR |
10634 | 2795 y(men)m(ts,)e(and)f(redirections,)h(from)f(left)h(to)g(righ)m(t.) |
10635 | 199 2922 y(1.)61 b(The)38 b(w)m(ords)f(that)i(the)g(parser)e(has)h | |
122f603c | 10636 | (mark)m(ed)g(as)h(v)-5 b(ariable)39 b(assignmen)m(ts)g(\(those)g |
967625cd | 10637 | (preceding)f(the)330 3031 y(command)30 b(name\))h(and)f(redirections)h |
122f603c | 10638 | (are)f(sa)m(v)m(ed)i(for)e(later)h(pro)s(cessing.)199 |
967625cd | 10639 | 3157 y(2.)61 b(The)39 b(w)m(ords)g(that)i(are)f(not)g(v)-5 |
122f603c | 10640 | b(ariable)40 b(assignmen)m(ts)h(or)e(redirections)i(are)f(expanded)f |
967625cd | 10641 | (\(see)h(Sec-)330 3267 y(tion)d(3.5)i([Shell)e(Expansions],)h(page)g |
1101193a | 10642 | (21\).)61 b(If)37 b(an)m(y)g(w)m(ords)f(remain)h(after)h(expansion,)h |
967625cd | 10643 | (the)e(\014rst)330 3377 y(w)m(ord)31 b(is)g(tak)m(en)h(to)g(b)s(e)f |
8a0829e9 | 10644 | (the)g(name)h(of)f(the)h(command)f(and)f(the)i(remaining)f(w)m(ords)g |
967625cd | 10645 | (are)g(the)h(argu-)330 3486 y(men)m(ts.)199 3612 y(3.)61 |
8a0829e9 CR |
10646 | b(Redirections)25 b(are)f(p)s(erformed)f(as)h(describ)s(ed)f(ab)s(o)m |
10647 | (v)m(e)i(\(see)g(Section)g(3.6)g([Redirections],)i(page)d(32\).)199 | |
967625cd | 10648 | 3739 y(4.)61 b(The)25 b(text)h(after)f(the)g(`)p Ft(=)p |
8a0829e9 | 10649 | Fu(')h(in)e(eac)m(h)j(v)-5 b(ariable)25 b(assignmen)m(t)h(undergo)s(es) |
967625cd | 10650 | e(tilde)i(expansion,)g(parameter)330 3848 y(expansion,)49 |
8a0829e9 | 10651 | b(command)d(substitution,)j(arithmetic)d(expansion,)k(and)45 |
967625cd CR |
10652 | b(quote)h(remo)m(v)-5 b(al)46 b(b)s(efore)330 3958 y(b)s(eing)30 |
10653 | b(assigned)h(to)g(the)f(v)-5 b(ariable.)275 4101 y(If)32 | |
8a0829e9 CR |
10654 | b(no)i(command)f(name)g(results,)h(the)g(v)-5 b(ariable)34 |
10655 | b(assignmen)m(ts)g(a\013ect)h(the)f(curren)m(t)f(shell)h(en)m(viron-) | |
967625cd | 10656 | 150 4211 y(men)m(t.)39 b(Otherwise,)27 b(the)e(v)-5 b(ariables)26 |
8a0829e9 | 10657 | b(are)g(added)f(to)h(the)f(en)m(vironmen)m(t)h(of)g(the)f(executed)h |
967625cd | 10658 | (command)g(and)150 4320 y(do)35 b(not)f(a\013ect)j(the)d(curren)m(t)h |
8a0829e9 | 10659 | (shell)g(en)m(vironmen)m(t.)54 b(If)34 b(an)m(y)h(of)g(the)f(assignmen) |
967625cd | 10660 | m(ts)i(attempts)f(to)h(assign)150 4430 y(a)j(v)-5 b(alue)39 |
8a0829e9 CR |
10661 | b(to)g(a)g(readonly)f(v)-5 b(ariable,)42 b(an)c(error)g(o)s(ccurs,)j |
10662 | (and)c(the)i(command)f(exits)h(with)g(a)f(non-zero)150 | |
967625cd | 10663 | 4539 y(status.)275 4666 y(If)33 b(no)g(command)g(name)h(results,)g |
8a0829e9 CR |
10664 | (redirections)g(are)g(p)s(erformed,)f(but)g(do)h(not)f(a\013ect)i(the)f |
10665 | (curren)m(t)150 4775 y(shell)d(en)m(vironmen)m(t.)41 | |
10666 | b(A)30 b(redirection)h(error)f(causes)h(the)g(command)f(to)h(exit)g | |
10667 | (with)f(a)h(non-zero)g(status.)275 4902 y(If)26 b(there)i(is)f(a)h | |
10668 | (command)f(name)h(left)g(after)g(expansion,)g(execution)h(pro)s(ceeds)e | |
10669 | (as)g(describ)s(ed)f(b)s(elo)m(w.)150 5011 y(Otherwise,)39 | |
10670 | b(the)e(command)g(exits.)62 b(If)37 b(one)g(of)g(the)h(expansions)f | |
10671 | (con)m(tained)h(a)g(command)f(substitu-)150 5121 y(tion,)i(the)d(exit)h | |
10672 | (status)g(of)f(the)h(command)f(is)h(the)f(exit)h(status)g(of)f(the)h | |
10673 | (last)g(command)f(substitution)150 5230 y(p)s(erformed.)55 | |
10674 | b(If)35 b(there)g(w)m(ere)h(no)g(command)f(substitutions,)i(the)e | |
10675 | (command)h(exits)g(with)f(a)h(status)g(of)150 5340 y(zero.)p | |
10676 | eop end | |
10677 | %%Page: 37 43 | |
10678 | TeXDict begin 37 42 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10679 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(37)150 299 | |
10680 | y Fk(3.7.2)63 b(Command)41 b(Searc)m(h)f(and)h(Execution)150 | |
10681 | 446 y Fu(After)i(a)h(command)f(has)g(b)s(een)f(split)h(in)m(to)h(w)m | |
10682 | (ords,)j(if)c(it)g(results)g(in)g(a)h(simple)f(command)g(and)f(an)150 | |
10683 | 555 y(optional)32 b(list)f(of)f(argumen)m(ts,)h(the)g(follo)m(wing)g | |
10684 | (actions)h(are)f(tak)m(en.)199 697 y(1.)61 b(If)24 b(the)g(command)g | |
10685 | (name)g(con)m(tains)i(no)e(slashes,)i(the)e(shell)h(attempts)g(to)g(lo) | |
10686 | s(cate)h(it.)39 b(If)24 b(there)g(exists)330 807 y(a)h(shell)g | |
10687 | (function)f(b)m(y)g(that)h(name,)h(that)f(function)f(is)h(in)m(v)m(ok)m | |
10688 | (ed)h(as)e(describ)s(ed)g(in)g(Section)h(3.3)h([Shell)330 | |
10689 | 916 y(F)-8 b(unctions],)31 b(page)h(17.)199 1054 y(2.)61 | |
10690 | b(If)41 b(the)g(name)h(do)s(es)f(not)g(matc)m(h)i(a)e(function,)j(the)e | |
10691 | (shell)f(searc)m(hes)i(for)e(it)h(in)f(the)g(list)h(of)g(shell)330 | |
10692 | 1164 y(builtins.)e(If)30 b(a)h(matc)m(h)g(is)f(found,)g(that)h(builtin) | |
10693 | f(is)g(in)m(v)m(ok)m(ed.)199 1302 y(3.)61 b(If)40 b(the)g(name)h(is)f | |
10694 | (neither)h(a)f(shell)h(function)f(nor)g(a)g(builtin,)j(and)d(con)m | |
10695 | (tains)h(no)g(slashes,)i(Bash)330 1411 y(searc)m(hes)c(eac)m(h)g | |
10696 | (elemen)m(t)g(of)g Ft($PATH)d Fu(for)i(a)g(directory)h(con)m(taining)g | |
10697 | (an)f(executable)h(\014le)f(b)m(y)g(that)330 1521 y(name.)56 | |
10698 | b(Bash)36 b(uses)f(a)h(hash)e(table)j(to)f(remem)m(b)s(er)f(the)h(full) | |
10699 | f(pathnames)g(of)h(executable)h(\014les)e(to)330 1631 | |
10700 | y(a)m(v)m(oid)e(m)m(ultiple)f Ft(PATH)f Fu(searc)m(hes)i(\(see)f(the)g | |
10701 | (description)g(of)f Ft(hash)g Fu(in)g(Section)i(4.1)f([Bourne)g(Shell) | |
10702 | 330 1740 y(Builtins],)37 b(page)f(41\).)55 b(A)35 b(full)g(searc)m(h)g | |
10703 | (of)g(the)g(directories)h(in)f Ft($PATH)e Fu(is)i(p)s(erformed)f(only)h | |
10704 | (if)g(the)330 1850 y(command)24 b(is)h(not)g(found)e(in)i(the)g(hash)f | |
10705 | (table.)39 b(If)25 b(the)f(searc)m(h)i(is)e(unsuccessful,)h(the)g | |
10706 | (shell)g(searc)m(hes)330 1959 y(for)e(a)h(de\014ned)e(shell)h(function) | |
10707 | h(named)e Ft(command_not_found_handle)p Fu(.)32 b(If)23 | |
10708 | b(that)h(function)f(exists,)330 2069 y(it)32 b(is)f(in)m(v)m(ok)m(ed)i | |
10709 | (with)e(the)h(original)g(command)f(and)g(the)h(original)g(command's)f | |
10710 | (argumen)m(ts)h(as)g(its)330 2178 y(argumen)m(ts,)h(and)e(the)i | |
10711 | (function's)e(exit)i(status)g(b)s(ecomes)f(the)g(exit)h(status)f(of)h | |
10712 | (the)f(shell.)46 b(If)31 b(that)330 2288 y(function)g(is)g(not)g | |
10713 | (de\014ned,)f(the)i(shell)f(prin)m(ts)f(an)h(error)g(message)h(and)f | |
10714 | (returns)e(an)i(exit)h(status)g(of)330 2398 y(127.)199 | |
10715 | 2536 y(4.)61 b(If)33 b(the)g(searc)m(h)h(is)g(successful,)g(or)f(if)g | |
10716 | (the)h(command)f(name)g(con)m(tains)i(one)f(or)f(more)g(slashes,)i(the) | |
10717 | 330 2645 y(shell)g(executes)h(the)f(named)f(program)g(in)h(a)g | |
10718 | (separate)h(execution)f(en)m(vironmen)m(t.)55 b(Argumen)m(t)35 | |
10719 | b(0)330 2755 y(is)30 b(set)h(to)h(the)e(name)h(giv)m(en,)g(and)f(the)h | |
eb2bb562 | 10720 | (remaining)f(argumen)m(ts)h(to)g(the)g(command)f(are)h(set)g(to)g(the) |
8a0829e9 CR |
10721 | 330 2864 y(argumen)m(ts)g(supplied,)e(if)h(an)m(y)-8 |
10722 | b(.)199 3002 y(5.)61 b(If)35 b(this)h(execution)h(fails)f(b)s(ecause)g | |
74d0116b | 10723 | (the)f(\014le)h(is)g(not)g(in)f(executable)j(format,)f(and)e(the)h |
8a0829e9 | 10724 | (\014le)g(is)g(not)330 3112 y(a)d(directory)-8 b(,)34 |
6e51e0d0 CR |
10725 | b(it)f(is)g(assumed)e(to)j(b)s(e)d(a)i Fr(shell)g(script)h |
10726 | Fu(and)e(the)h(shell)f(executes)i(it)f(as)g(describ)s(ed)e(in)330 | |
8a0829e9 CR |
10727 | 3222 y(Section)g(3.8)h([Shell)e(Scripts],)g(page)i(40.)199 |
10728 | 3360 y(6.)61 b(If)38 b(the)h(command)f(w)m(as)h(not)g(b)s(egun)e(async) | |
10729 | m(hronously)-8 b(,)42 b(the)c(shell)h(w)m(aits)h(for)e(the)h(command)f | |
10730 | (to)330 3469 y(complete)32 b(and)e(collects)i(its)f(exit)g(status.)150 | |
10731 | 3675 y Fk(3.7.3)63 b(Command)41 b(Execution)f(En)m(vironmen)m(t)150 | |
10732 | 3822 y Fu(The)30 b(shell)g(has)h(an)f Fr(execution)h(en)m(vironmen)m(t) | |
10733 | p Fu(,)h(whic)m(h)e(consists)h(of)f(the)h(follo)m(wing:)225 | |
10734 | 3964 y Fq(\017)60 b Fu(op)s(en)32 b(\014les)g(inherited)g(b)m(y)h(the)f | |
ad4aef08 | 10735 | (shell)h(at)g(in)m(v)m(o)s(cation,)j(as)c(mo)s(di\014ed)g(b)m(y)g |
8a0829e9 CR |
10736 | (redirections)h(supplied)e(to)330 4074 y(the)g Ft(exec)e |
10737 | Fu(builtin)225 4212 y Fq(\017)60 b Fu(the)28 b(curren)m(t)g(w)m(orking) | |
6e51e0d0 CR |
10738 | h(directory)g(as)f(set)h(b)m(y)f Ft(cd)p Fu(,)g Ft(pushd)p |
10739 | Fu(,)g(or)g Ft(popd)p Fu(,)g(or)g(inherited)g(b)m(y)g(the)h(shell)f(at) | |
8a0829e9 | 10740 | 330 4321 y(in)m(v)m(o)s(cation)225 4459 y Fq(\017)60 |
fc527055 CR |
10741 | b Fu(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)g(as)h(set)g(b)m(y)f |
10742 | Ft(umask)f Fu(or)h(inherited)g(from)g(the)h(shell's)f(paren)m(t)225 | |
8a0829e9 CR |
10743 | 4597 y Fq(\017)60 b Fu(curren)m(t)30 b(traps)g(set)h(b)m(y)f |
10744 | Ft(trap)225 4735 y Fq(\017)60 b Fu(shell)30 b(parameters)f(that)h(are)g | |
fc527055 | 10745 | (set)g(b)m(y)g(v)-5 b(ariable)30 b(assignmen)m(t)g(or)g(with)f |
8a0829e9 CR |
10746 | Ft(set)f Fu(or)i(inherited)f(from)g(the)330 4845 y(shell's)i(paren)m(t) |
10747 | f(in)g(the)h(en)m(vironmen)m(t)225 4983 y Fq(\017)60 | |
fc527055 | 10748 | b Fu(shell)44 b(functions)f(de\014ned)f(during)h(execution)i(or)e |
595e3e69 | 10749 | (inherited)h(from)f(the)h(shell's)g(paren)m(t)f(in)h(the)330 |
8a0829e9 | 10750 | 5092 y(en)m(vironmen)m(t)225 5230 y Fq(\017)60 b Fu(options)33 |
595e3e69 | 10751 | b(enabled)g(at)h(in)m(v)m(o)s(cation)h(\(either)f(b)m(y)f(default)g(or) |
8a0829e9 CR |
10752 | g(with)g(command-line)g(argumen)m(ts\))h(or)330 5340 |
10753 | y(b)m(y)c Ft(set)p eop end | |
10754 | %%Page: 38 44 | |
10755 | TeXDict begin 38 43 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10756 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(38)225 299 | |
10757 | y Fq(\017)60 b Fu(options)31 b(enabled)f(b)m(y)g Ft(shopt)f | |
10758 | Fu(\(see)j(Section)f(4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g(63\))225 | |
10759 | 429 y Fq(\017)60 b Fu(shell)31 b(aliases)g(de\014ned)f(with)g | |
900a813b | 10760 | Ft(alias)f Fu(\(see)i(Section)g(6.6)h([Aliases],)g(page)f(89\))225 |
8a0829e9 | 10761 | 558 y Fq(\017)60 b Fu(v)-5 b(arious)50 b(pro)s(cess)f |
6e51e0d0 | 10762 | Fm(id)p Fu(s,)55 b(including)49 b(those)i(of)e(bac)m(kground)h(jobs)f |
8a0829e9 | 10763 | (\(see)i(Section)g(3.2.3)g([Lists],)330 668 y(page)31 |
6e51e0d0 | 10764 | b(9\),)g(the)g(v)-5 b(alue)31 b(of)f Ft($$)p Fu(,)g(and)g(the)h(v)-5 |
8a0829e9 | 10765 | b(alue)31 b(of)f Ft($PPID)275 817 y Fu(When)k(a)g(simple)h(command)f |
abe2eb5b | 10766 | (other)g(than)g(a)h(builtin)f(or)g(shell)h(function)f(is)g(to)h(b)s(e)f |
8a0829e9 CR |
10767 | (executed,)i(it)f(is)150 927 y(in)m(v)m(ok)m(ed)25 b(in)f(a)g(separate) |
10768 | h(execution)g(en)m(vironmen)m(t)g(that)f(consists)g(of)h(the)f(follo)m | |
10769 | (wing.)40 b(Unless)24 b(otherwise)150 1037 y(noted,)31 | |
a8fd3f3e | 10770 | b(the)f(v)-5 b(alues)31 b(are)g(inherited)f(from)g(the)g(shell.)225 |
8a0829e9 | 10771 | 1166 y Fq(\017)60 b Fu(the)31 b(shell's)h(op)s(en)e(\014les,)i(plus)e |
4a8bb13f | 10772 | (an)m(y)h(mo)s(di\014cations)h(and)e(additions)h(sp)s(eci\014ed)g(b)m |
8a0829e9 | 10773 | (y)g(redirections)g(to)330 1276 y(the)g(command)225 1406 |
6e51e0d0 | 10774 | y Fq(\017)60 b Fu(the)31 b(curren)m(t)f(w)m(orking)g(directory)225 |
8a0829e9 CR |
10775 | 1535 y Fq(\017)60 b Fu(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)225 |
10776 | 1665 y Fq(\017)60 b Fu(shell)32 b(v)-5 b(ariables)33 | |
122f603c | 10777 | b(and)e(functions)h(mark)m(ed)g(for)g(exp)s(ort,)g(along)h(with)f(v)-5 |
8a0829e9 | 10778 | b(ariables)32 b(exp)s(orted)g(for)g(the)330 1774 y(command,)e(passed)g |
122f603c | 10779 | (in)g(the)h(en)m(vironmen)m(t)g(\(see)g(Section)g(3.7.4)i([En)m |
8a0829e9 | 10780 | (vironmen)m(t],)e(page)g(38\))225 1904 y Fq(\017)60 b |
6e51e0d0 | 10781 | Fu(traps)31 b(caugh)m(t)h(b)m(y)f(the)g(shell)h(are)f(reset)h(to)g(the) |
122f603c | 10782 | f(v)-5 b(alues)32 b(inherited)e(from)h(the)g(shell's)h(paren)m(t,)g |
8a0829e9 CR |
10783 | (and)330 2014 y(traps)e(ignored)h(b)m(y)f(the)g(shell)h(are)g(ignored) |
10784 | 275 2163 y(A)41 b(command)g(in)m(v)m(ok)m(ed)i(in)e(this)h(separate)g | |
122f603c | 10785 | (en)m(vironmen)m(t)g(cannot)g(a\013ect)h(the)f(shell's)g(execution)150 |
8a0829e9 | 10786 | 2273 y(en)m(vironmen)m(t.)275 2403 y(Command)35 b(substitution,)j |
122f603c | 10787 | (commands)e(group)s(ed)f(with)i(paren)m(theses,)h(and)e(async)m |
8a0829e9 | 10788 | (hronous)g(com-)150 2512 y(mands)c(are)h(in)m(v)m(ok)m(ed)i(in)d(a)i |
122f603c | 10789 | (subshell)e(en)m(vironmen)m(t)h(that)h(is)f(a)g(duplicate)h(of)f(the)g |
8a0829e9 | 10790 | (shell)g(en)m(vironmen)m(t,)150 2622 y(except)i(that)g(traps)f(caugh)m |
122f603c CR |
10791 | (t)h(b)m(y)f(the)h(shell)f(are)g(reset)h(to)g(the)f(v)-5 |
10792 | b(alues)35 b(that)g(the)f(shell)h(inherited)e(from)150 | |
8a0829e9 | 10793 | 2731 y(its)g(paren)m(t)f(at)h(in)m(v)m(o)s(cation.)49 |
122f603c | 10794 | b(Builtin)32 b(commands)g(that)h(are)g(in)m(v)m(ok)m(ed)h(as)e(part)g |
8a0829e9 | 10795 | (of)h(a)f(pip)s(eline)g(are)h(also)150 2841 y(executed)41 |
122f603c CR |
10796 | b(in)f(a)h(subshell)e(en)m(vironmen)m(t.)72 b(Changes)40 |
10797 | b(made)g(to)h(the)g(subshell)e(en)m(vironmen)m(t)i(cannot)150 | |
8a0829e9 CR |
10798 | 2951 y(a\013ect)32 b(the)f(shell's)f(execution)i(en)m(vironmen)m(t.)275 |
10799 | 3080 y(Subshells)c(spa)m(wned)i(to)h(execute)g(command)f(substitutions) | |
6e51e0d0 | 10800 | g(inherit)g(the)g(v)-5 b(alue)31 b(of)f(the)h Ft(-e)e |
8a0829e9 | 10801 | Fu(option)150 3190 y(from)23 b(the)i(paren)m(t)f(shell.)38 |
6e51e0d0 | 10802 | b(When)24 b(not)g(in)g Fm(posix)f Fu(mo)s(de,)i(Bash)f(clears)h(the)f |
8a0829e9 CR |
10803 | Ft(-e)f Fu(option)i(in)e(suc)m(h)h(subshells.)275 3319 |
10804 | y(If)f(a)h(command)g(is)g(follo)m(w)m(ed)h(b)m(y)f(a)g(`)p | |
6e51e0d0 | 10805 | Ft(&)p Fu(')g(and)f(job)h(con)m(trol)h(is)f(not)g(activ)m(e,)k(the)c |
8a0829e9 | 10806 | (default)g(standard)f(input)150 3429 y(for)35 b(the)g(command)g(is)g |
6e51e0d0 | 10807 | (the)g(empt)m(y)h(\014le)f Ft(/dev/null)p Fu(.)52 b(Otherwise,)37 |
8a0829e9 | 10808 | b(the)e(in)m(v)m(ok)m(ed)h(command)f(inherits)150 3539 |
6e51e0d0 | 10809 | y(the)c(\014le)f(descriptors)g(of)h(the)f(calling)i(shell)f(as)f(mo)s |
8a0829e9 CR |
10810 | (di\014ed)g(b)m(y)g(redirections.)150 3728 y Fk(3.7.4)63 |
10811 | b(En)m(vironmen)m(t)150 3875 y Fu(When)29 b(a)g(program)f(is)h(in)m(v)m | |
6e51e0d0 CR |
10812 | (ok)m(ed)h(it)g(is)f(giv)m(en)g(an)g(arra)m(y)g(of)g(strings)g(called)h |
10813 | (the)f Fr(en)m(vironmen)m(t)p Fu(.)41 b(This)28 b(is)h(a)150 | |
8a0829e9 CR |
10814 | 3985 y(list)i(of)g(name-v)-5 b(alue)31 b(pairs,)f(of)h(the)f(form)g |
10815 | Ft(name=value)p Fu(.)275 4114 y(Bash)39 b(pro)m(vides)g(sev)m(eral)i(w) | |
ad4aef08 | 10816 | m(a)m(ys)g(to)f(manipulate)f(the)h(en)m(vironmen)m(t.)69 |
8a0829e9 | 10817 | b(On)38 b(in)m(v)m(o)s(cation,)44 b(the)c(shell)150 4224 |
ad4aef08 | 10818 | y(scans)g(its)h(o)m(wn)f(en)m(vironmen)m(t)h(and)f(creates)i(a)f |
fc527055 | 10819 | (parameter)f(for)g(eac)m(h)i(name)e(found,)i(automatically)150 |
8a0829e9 | 10820 | 4334 y(marking)26 b(it)g(for)g Fr(exp)s(ort)h Fu(to)g(c)m(hild)f(pro)s |
595e3e69 | 10821 | (cesses.)39 b(Executed)26 b(commands)g(inherit)g(the)g(en)m(vironmen)m |
8a0829e9 | 10822 | (t.)39 b(The)150 4443 y Ft(export)c Fu(and)i(`)p Ft(declare)29 |
595e3e69 | 10823 | b(-x)p Fu(')36 b(commands)h(allo)m(w)i(parameters)e(and)g(functions)g |
8a0829e9 | 10824 | (to)h(b)s(e)e(added)h(to)h(and)150 4553 y(deleted)21 |
fc527055 CR |
10825 | b(from)f(the)h(en)m(vironmen)m(t.)38 b(If)20 b(the)h(v)-5 |
10826 | b(alue)21 b(of)g(a)g(parameter)g(in)f(the)g(en)m(vironmen)m(t)i(is)e | |
8a0829e9 | 10827 | (mo)s(di\014ed,)i(the)150 4662 y(new)31 b(v)-5 b(alue)32 |
fc527055 CR |
10828 | b(b)s(ecomes)f(part)h(of)f(the)h(en)m(vironmen)m(t,)g(replacing)h(the)e |
10829 | (old.)44 b(The)31 b(en)m(vironmen)m(t)h(inherited)150 | |
8a0829e9 | 10830 | 4772 y(b)m(y)f(an)m(y)g(executed)h(command)f(consists)g(of)g(the)g |
fc527055 | 10831 | (shell's)h(initial)g(en)m(vironmen)m(t,)g(whose)f(v)-5 |
8a0829e9 | 10832 | b(alues)31 b(ma)m(y)h(b)s(e)150 4882 y(mo)s(di\014ed)26 |
595e3e69 CR |
10833 | b(in)g(the)h(shell,)h(less)f(an)m(y)g(pairs)f(remo)m(v)m(ed)i(b)m(y)f |
10834 | (the)g Ft(unset)e Fu(and)h(`)p Ft(export)j(-n)p Fu(')e(commands,)g | |
8a0829e9 CR |
10835 | (plus)150 4991 y(an)m(y)k(additions)f(via)h(the)g Ft(export)d |
10836 | Fu(and)i(`)p Ft(declare)f(-x)p Fu(')h(commands.)275 5121 | |
595e3e69 | 10837 | y(The)j(en)m(vironmen)m(t)i(for)f(an)m(y)g(simple)h(command)f(or)g |
220537f2 | 10838 | (function)g(ma)m(y)g(b)s(e)g(augmen)m(ted)h(temp)s(orarily)150 |
8a0829e9 | 10839 | 5230 y(b)m(y)c(pre\014xing)e(it)i(with)g(parameter)g(assignmen)m(ts,)h |
220537f2 | 10840 | (as)e(describ)s(ed)g(in)g(Section)i(3.4)g([Shell)e(P)m(arameters],)150 |
8a0829e9 | 10841 | 5340 y(page)g(18.)41 b(These)29 b(assignmen)m(t)i(statemen)m(ts)g |
220537f2 | 10842 | (a\013ect)f(only)g(the)f(en)m(vironmen)m(t)h(seen)g(b)m(y)f(that)h |
8a0829e9 CR |
10843 | (command.)p eop end |
10844 | %%Page: 39 45 | |
10845 | TeXDict begin 39 44 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10846 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(39)275 299 | |
10847 | y(If)30 b(the)h Ft(-k)g Fu(option)g(is)g(set)h(\(see)g(Section)g(4.3.1) | |
10848 | g([The)f(Set)g(Builtin],)h(page)g(59\),)h(then)e(all)g(parameter)150 | |
10849 | 408 y(assignmen)m(ts)f(are)g(placed)h(in)e(the)h(en)m(vironmen)m(t)g | |
10850 | (for)g(a)g(command,)f(not)h(just)f(those)i(that)f(precede)g(the)150 | |
10851 | 518 y(command)g(name.)275 662 y(When)h(Bash)h(in)m(v)m(ok)m(es)i(an)e | |
10852 | (external)h(command,)f(the)g(v)-5 b(ariable)33 b(`)p | |
10853 | Ft($_)p Fu(')f(is)g(set)h(to)f(the)g(full)g(pathname)150 | |
10854 | 772 y(of)f(the)f(command)g(and)g(passed)g(to)h(that)g(command)f(in)g | |
10855 | (its)h(en)m(vironmen)m(t.)150 980 y Fk(3.7.5)63 b(Exit)40 | |
10856 | b(Status)150 1127 y Fu(The)26 b(exit)h(status)f(of)g(an)g(executed)h | |
10857 | (command)f(is)g(the)h(v)-5 b(alue)26 b(returned)f(b)m(y)h(the)g | |
10858 | Fr(w)m(aitpid)k Fu(system)d(call)g(or)150 1237 y(equiv)-5 | |
10859 | b(alen)m(t)33 b(function.)45 b(Exit)32 b(statuses)g(fall)g(b)s(et)m(w)m | |
10860 | (een)h(0)f(and)f(255,)i(though,)f(as)g(explained)g(b)s(elo)m(w,)h(the) | |
10861 | 150 1346 y(shell)i(ma)m(y)g(use)f(v)-5 b(alues)35 b(ab)s(o)m(v)m(e)g | |
10862 | (125)h(sp)s(ecially)-8 b(.)54 b(Exit)35 b(statuses)g(from)f(shell)h | |
10863 | (builtins)f(and)f(comp)s(ound)150 1456 y(commands)j(are)g(also)h | |
10864 | (limited)g(to)g(this)f(range.)58 b(Under)36 b(certain)h(circumstances,) | |
10865 | h(the)e(shell)h(will)f(use)150 1566 y(sp)s(ecial)31 b(v)-5 | |
10866 | b(alues)31 b(to)g(indicate)g(sp)s(eci\014c)f(failure)h(mo)s(des.)275 | |
10867 | 1710 y(F)-8 b(or)32 b(the)g(shell's)g(purp)s(oses,)e(a)j(command)e | |
10868 | (whic)m(h)h(exits)g(with)g(a)g(zero)g(exit)h(status)f(has)f(succeeded.) | |
10869 | 150 1819 y(A)e(non-zero)h(exit)g(status)g(indicates)g(failure.)40 | |
10870 | b(This)28 b(seemingly)i(coun)m(ter-in)m(tuitiv)m(e)i(sc)m(heme)e(is)f | |
10871 | (used)g(so)150 1929 y(there)34 b(is)g(one)g(w)m(ell-de\014ned)g(w)m(a)m | |
10872 | (y)g(to)h(indicate)g(success)f(and)f(a)h(v)-5 b(ariet)m(y)35 | |
10873 | b(of)f(w)m(a)m(ys)h(to)f(indicate)h(v)-5 b(arious)150 | |
10874 | 2038 y(failure)38 b(mo)s(des.)62 b(When)37 b(a)h(command)f(terminates)i | |
10875 | (on)e(a)h(fatal)h(signal)g(whose)e(n)m(um)m(b)s(er)f(is)i | |
10876 | Fr(N)p Fu(,)i(Bash)150 2148 y(uses)30 b(the)g(v)-5 b(alue)31 | |
10877 | b(128)p Ft(+)p Fr(N)42 b Fu(as)30 b(the)h(exit)g(status.)275 | |
10878 | 2292 y(If)k(a)h(command)g(is)g(not)g(found,)g(the)g(c)m(hild)h(pro)s | |
10879 | (cess)e(created)i(to)g(execute)g(it)g(returns)d(a)j(status)f(of)150 | |
10880 | 2401 y(127.)42 b(If)30 b(a)h(command)f(is)g(found)f(but)h(is)g(not)h | |
10881 | (executable,)h(the)f(return)e(status)i(is)f(126.)275 | |
10882 | 2545 y(If)i(a)i(command)f(fails)g(b)s(ecause)g(of)h(an)f(error)f | |
74d0116b | 10883 | (during)g(expansion)h(or)g(redirection,)i(the)f(exit)g(status)150 |
8a0829e9 | 10884 | 2655 y(is)c(greater)i(than)e(zero.)275 2799 y(The)38 |
74d0116b | 10885 | b(exit)h(status)g(is)g(used)f(b)m(y)g(the)h(Bash)g(conditional)h |
8a0829e9 | 10886 | (commands)e(\(see)h(Section)h(3.2.4.2)h([Con-)150 2909 |
74d0116b CR |
10887 | y(ditional)i(Constructs],)h(page)f(10\))g(and)e(some)i(of)f(the)g(list) |
10888 | g(constructs)g(\(see)h(Section)f(3.2.3)i([Lists],)150 | |
8a0829e9 | 10889 | 3018 y(page)31 b(9\).)275 3162 y(All)40 b(of)g(the)h(Bash)f(builtins)f |
c2fa6583 | 10890 | (return)g(an)h(exit)h(status)g(of)f(zero)h(if)f(they)g(succeed)g(and)g |
8a0829e9 | 10891 | (a)g(non-zero)150 3272 y(status)34 b(on)f(failure,)i(so)f(they)g(ma)m |
c2fa6583 | 10892 | (y)g(b)s(e)f(used)g(b)m(y)g(the)h(conditional)h(and)e(list)h |
8a0829e9 CR |
10893 | (constructs.)50 b(All)35 b(builtins)150 3381 y(return)e(an)i(exit)g |
10894 | (status)g(of)f(2)h(to)g(indicate)h(incorrect)f(usage,)h(generally)g(in) | |
10895 | m(v)-5 b(alid)35 b(options)g(or)f(missing)150 3491 y(argumen)m(ts.)150 | |
10896 | 3700 y Fk(3.7.6)63 b(Signals)150 3847 y Fu(When)36 b(Bash)g(is)h(in)m | |
10897 | (teractiv)m(e,)j(in)c(the)h(absence)f(of)h(an)m(y)f(traps,)i(it)e | |
10898 | (ignores)h Ft(SIGTERM)d Fu(\(so)j(that)g(`)p Ft(kill)150 | |
10899 | 3956 y(0)p Fu(')c(do)s(es)g(not)g(kill)g(an)g(in)m(teractiv)m(e)j | |
10900 | (shell\),)f(and)d Ft(SIGINT)f Fu(is)i(caugh)m(t)h(and)f(handled)f(\(so) | |
10901 | h(that)h(the)f Ft(wait)150 4066 y Fu(builtin)24 b(is)h(in)m | |
10902 | (terruptible\).)39 b(When)24 b(Bash)g(receiv)m(es)j(a)d | |
10903 | Ft(SIGINT)p Fu(,)h(it)g(breaks)f(out)h(of)f(an)m(y)h(executing)h(lo)s | |
10904 | (ops.)150 4175 y(In)31 b(all)h(cases,)h(Bash)f(ignores)g | |
10905 | Ft(SIGQUIT)p Fu(.)42 b(If)32 b(job)f(con)m(trol)i(is)e(in)h(e\013ect)h | |
900a813b | 10906 | (\(see)f(Chapter)f(7)h([Job)g(Con)m(trol],)150 4285 y(page)f(99\),)h |
8a0829e9 CR |
10907 | (Bash)e(ignores)h Ft(SIGTTIN)p Fu(,)e Ft(SIGTTOU)p Fu(,)g(and)g |
10908 | Ft(SIGTSTP)p Fu(.)275 4429 y(Non-builtin)i(commands)g(started)g(b)m(y)g | |
10909 | (Bash)h(ha)m(v)m(e)g(signal)g(handlers)e(set)i(to)g(the)g(v)-5 | |
10910 | b(alues)31 b(inherited)150 4538 y(b)m(y)37 b(the)h(shell)g(from)f(its)h | |
10911 | (paren)m(t.)62 b(When)38 b(job)f(con)m(trol)i(is)e(not)h(in)f | |
10912 | (e\013ect,)k(async)m(hronous)c(commands)150 4648 y(ignore)f | |
10913 | Ft(SIGINT)e Fu(and)h Ft(SIGQUIT)e Fu(in)j(addition)f(to)i(these)f | |
10914 | (inherited)f(handlers.)55 b(Commands)35 b(run)f(as)i(a)150 | |
10915 | 4758 y(result)27 b(of)h(command)f(substitution)h(ignore)g(the)g(k)m | |
10916 | (eyb)s(oard-generated)g(job)g(con)m(trol)h(signals)f | |
10917 | Ft(SIGTTIN)p Fu(,)150 4867 y Ft(SIGTTOU)p Fu(,)h(and)g | |
10918 | Ft(SIGTSTP)p Fu(.)275 5011 y(The)h(shell)i(exits)g(b)m(y)f(default)g | |
10919 | (up)s(on)f(receipt)i(of)f(a)h Ft(SIGHUP)p Fu(.)42 b(Before)32 | |
10920 | b(exiting,)h(an)e(in)m(teractiv)m(e)j(shell)150 5121 | |
10921 | y(resends)41 b(the)i Ft(SIGHUP)e Fu(to)i(all)g(jobs,)i(running)c(or)h | |
10922 | (stopp)s(ed.)76 b(Stopp)s(ed)41 b(jobs)h(are)h(sen)m(t)g | |
10923 | Ft(SIGCONT)d Fu(to)150 5230 y(ensure)32 b(that)h(they)g(receiv)m(e)i | |
10924 | (the)e Ft(SIGHUP)p Fu(.)47 b(T)-8 b(o)33 b(prev)m(en)m(t)g(the)g(shell) | |
10925 | g(from)g(sending)f(the)h Ft(SIGHUP)e Fu(signal)150 5340 | |
10926 | y(to)i(a)g(particular)g(job,)g(it)g(should)f(b)s(e)g(remo)m(v)m(ed)h | |
10927 | (from)g(the)f(jobs)g(table)i(with)e(the)h Ft(disown)e | |
10928 | Fu(builtin)h(\(see)p eop end | |
10929 | %%Page: 40 46 | |
10930 | TeXDict begin 40 45 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10931 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(40)150 299 | |
900a813b CR |
10932 | y(Section)28 b(7.2)g([Job)e(Con)m(trol)i(Builtins],)g(page)g(100\))h |
10933 | (or)e(mark)m(ed)g(to)g(not)g(receiv)m(e)i Ft(SIGHUP)c | |
10934 | Fu(using)i Ft(disown)150 408 y(-h)p Fu(.)275 543 y(If)38 | |
10935 | b(the)h Ft(huponexit)e Fu(shell)i(option)g(has)g(b)s(een)f(set)i(with)f | |
fc527055 | 10936 | Ft(shopt)e Fu(\(see)j(Section)g(4.3.2)h([The)e(Shopt)150 |
8a0829e9 | 10937 | 653 y(Builtin],)31 b(page)g(63\),)h(Bash)f(sends)e(a)i |
595e3e69 | 10938 | Ft(SIGHUP)e Fu(to)i(all)g(jobs)f(when)f(an)i(in)m(teractiv)m(e)i(login) |
8a0829e9 | 10939 | e(shell)g(exits.)275 787 y(If)38 b(Bash)h(is)g(w)m(aiting)h(for)f(a)g |
595e3e69 | 10940 | (command)f(to)i(complete)g(and)e(receiv)m(es)j(a)e(signal)h(for)e(whic) |
8a0829e9 | 10941 | m(h)h(a)g(trap)150 897 y(has)c(b)s(een)f(set,)i(the)f(trap)g(will)g |
595e3e69 | 10942 | (not)g(b)s(e)f(executed)i(un)m(til)f(the)g(command)f(completes.)55 |
8a0829e9 | 10943 | b(When)35 b(Bash)g(is)150 1006 y(w)m(aiting)j(for)f(an)g(async)m |
595e3e69 | 10944 | (hronous)g(command)g(via)h(the)f Ft(wait)f Fu(builtin,)i(the)g |
8a0829e9 | 10945 | (reception)g(of)f(a)g(signal)h(for)150 1116 y(whic)m(h)d(a)g(trap)g |
6e51e0d0 CR |
10946 | (has)g(b)s(een)f(set)h(will)h(cause)f(the)g Ft(wait)f |
10947 | Fu(builtin)h(to)g(return)f(immediately)i(with)f(an)g(exit)150 | |
8a0829e9 | 10948 | 1225 y(status)c(greater)g(than)f(128,)i(immediately)g(after)f(whic)m(h) |
967625cd CR |
10949 | f(the)h(trap)f(is)g(executed.)150 1466 y Fs(3.8)68 b(Shell)45 |
10950 | b(Scripts)150 1626 y Fu(A)30 b(shell)f(script)h(is)f(a)h(text)h(\014le) | |
1101193a | 10951 | f(con)m(taining)h(shell)f(commands.)40 b(When)29 b(suc)m(h)g(a)h |
967625cd | 10952 | (\014le)g(is)f(used)g(as)h(the)g(\014rst)150 1735 y(non-option)c |
6e51e0d0 CR |
10953 | (argumen)m(t)h(when)e(in)m(v)m(oking)i(Bash,)g(and)f(neither)g(the)g |
10954 | Ft(-c)g Fu(nor)f Ft(-s)h Fu(option)g(is)g(supplied)f(\(see)150 | |
967625cd | 10955 | 1845 y(Section)39 b(6.1)g([In)m(v)m(oking)g(Bash],)h(page)f(81\),)i |
6e51e0d0 | 10956 | (Bash)d(reads)g(and)f(executes)i(commands)f(from)f(the)i(\014le,)150 |
967625cd | 10957 | 1954 y(then)32 b(exits.)46 b(This)32 b(mo)s(de)f(of)i(op)s(eration)f |
6e51e0d0 | 10958 | (creates)i(a)e(non-in)m(teractiv)m(e)j(shell.)46 b(The)31 |
967625cd | 10959 | b(shell)i(\014rst)e(searc)m(hes)150 2064 y(for)d(the)g(\014le)g(in)g |
6e51e0d0 CR |
10960 | (the)g(curren)m(t)f(directory)-8 b(,)30 b(and)d(lo)s(oks)i(in)e(the)i |
10961 | (directories)g(in)e Ft($PATH)g Fu(if)h(not)g(found)e(there.)275 | |
967625cd | 10962 | 2198 y(When)34 b(Bash)h(runs)e(a)i(shell)g(script,)g(it)h(sets)f(the)f |
6e51e0d0 | 10963 | (sp)s(ecial)i(parameter)f Ft(0)f Fu(to)h(the)g(name)g(of)g(the)g |
967625cd | 10964 | (\014le,)150 2308 y(rather)k(than)g(the)h(name)f(of)h(the)f(shell,)j |
122f603c | 10965 | (and)d(the)h(p)s(ositional)g(parameters)f(are)h(set)g(to)g(the)g |
967625cd | 10966 | (remain-)150 2418 y(ing)f(argumen)m(ts,)j(if)d(an)m(y)g(are)g(giv)m |
122f603c | 10967 | (en.)67 b(If)39 b(no)g(additional)g(argumen)m(ts)h(are)f(supplied,)h |
967625cd CR |
10968 | (the)f(p)s(ositional)150 2527 y(parameters)31 b(are)f(unset.)275 |
10969 | 2662 y(A)39 b(shell)h(script)f(ma)m(y)h(b)s(e)f(made)h(executable)h(b)m | |
6e51e0d0 | 10970 | (y)e(using)g(the)h Ft(chmod)e Fu(command)h(to)h(turn)e(on)i(the)150 |
967625cd | 10971 | 2771 y(execute)j(bit.)73 b(When)41 b(Bash)g(\014nds)e(suc)m(h)i(a)h |
6e51e0d0 | 10972 | (\014le)f(while)g(searc)m(hing)h(the)f Ft($PATH)f Fu(for)h(a)h |
967625cd CR |
10973 | (command,)h(it)150 2881 y(spa)m(wns)30 b(a)g(subshell)g(to)h(execute)h |
10974 | (it.)41 b(In)30 b(other)g(w)m(ords,)g(executing)390 3015 | |
10975 | y Ft(filename)46 b Fj(arguments)150 3150 y Fu(is)30 b(equiv)-5 | |
10976 | b(alen)m(t)32 b(to)f(executing)390 3284 y Ft(bash)47 | |
10977 | b(filename)e Fj(arguments)150 3419 y Fu(if)30 b Ft(filename)d | |
8a0829e9 CR |
10978 | Fu(is)j(an)f(executable)j(shell)e(script.)40 b(This)29 |
10979 | b(subshell)g(reinitializes)i(itself,)g(so)f(that)h(the)e(e\013ect)150 | |
967625cd | 10980 | 3528 y(is)36 b(as)h(if)g(a)f(new)g(shell)h(had)f(b)s(een)g(in)m(v)m(ok) |
8a0829e9 | 10981 | m(ed)h(to)h(in)m(terpret)e(the)h(script,)h(with)e(the)h(exception)h |
967625cd | 10982 | (that)f(the)150 3638 y(lo)s(cations)25 b(of)g(commands)e(remem)m(b)s |
8a0829e9 | 10983 | (ered)h(b)m(y)g(the)g(paren)m(t)g(\(see)h(the)f(description)g(of)g |
967625cd | 10984 | Ft(hash)f Fu(in)h(Section)h(4.1)150 3748 y([Bourne)30 |
8a0829e9 | 10985 | b(Shell)h(Builtins],)g(page)g(41\))h(are)e(retained)h(b)m(y)f(the)h(c)m |
967625cd | 10986 | (hild.)275 3882 y(Most)36 b(v)m(ersions)g(of)g(Unix)f(mak)m(e)h(this)g |
8a0829e9 | 10987 | (a)g(part)f(of)h(the)g(op)s(erating)g(system's)f(command)h(execution) |
967625cd | 10988 | 150 3992 y(mec)m(hanism.)50 b(If)33 b(the)g(\014rst)g(line)h(of)f(a)h |
8a0829e9 | 10989 | (script)f(b)s(egins)g(with)g(the)g(t)m(w)m(o)i(c)m(haracters)g(`)p |
967625cd | 10990 | Ft(#!)p Fu(',)f(the)g(remainder)150 4101 y(of)d(the)g(line)h(sp)s |
8a0829e9 CR |
10991 | (eci\014es)e(an)h(in)m(terpreter)g(for)g(the)g(program.)43 |
10992 | b(Th)m(us,)30 b(y)m(ou)h(can)h(sp)s(ecify)e(Bash,)i Ft(awk)p | |
967625cd | 10993 | Fu(,)e(P)m(erl,)150 4211 y(or)g(some)h(other)g(in)m(terpreter)g(and)e |
8a0829e9 | 10994 | (write)i(the)f(rest)h(of)g(the)f(script)g(\014le)h(in)f(that)h |
967625cd | 10995 | (language.)275 4345 y(The)40 b(argumen)m(ts)h(to)g(the)g(in)m |
fc527055 | 10996 | (terpreter)g(consist)g(of)g(a)g(single)h(optional)f(argumen)m(t)h |
967625cd | 10997 | (follo)m(wing)g(the)150 4455 y(in)m(terpreter)33 b(name)h(on)f(the)g |
fc527055 | 10998 | (\014rst)f(line)i(of)f(the)g(script)g(\014le,)h(follo)m(w)m(ed)h(b)m(y) |
967625cd | 10999 | e(the)g(name)g(of)g(the)h(script)f(\014le,)150 4565 y(follo)m(w)m(ed)g |
fc527055 CR |
11000 | (b)m(y)f(the)f(rest)h(of)g(the)f(argumen)m(ts.)45 b(Bash)31 |
11001 | b(will)h(p)s(erform)e(this)i(action)h(on)e(op)s(erating)h(systems)150 | |
967625cd | 11002 | 4674 y(that)24 b(do)g(not)f(handle)g(it)h(themselv)m(es.)40 |
fc527055 | 11003 | b(Note)25 b(that)f(some)g(older)g(v)m(ersions)f(of)h(Unix)f(limit)i |
967625cd CR |
11004 | (the)f(in)m(terpreter)150 4784 y(name)30 b(and)g(argumen)m(t)h(to)g(a)g |
11005 | (maxim)m(um)f(of)h(32)g(c)m(haracters.)275 4918 y(Bash)h(scripts)g | |
fc527055 | 11006 | (often)g(b)s(egin)g(with)g Ft(#!)e(/bin/bash)g Fu(\(assuming)i(that)h |
967625cd | 11007 | (Bash)f(has)g(b)s(een)f(installed)i(in)150 5028 y Ft(/bin)p |
fc527055 CR |
11008 | Fu(\),)26 b(since)h(this)f(ensures)f(that)i(Bash)f(will)h(b)s(e)f(used) |
11009 | f(to)i(in)m(terpret)f(the)h(script,)g(ev)m(en)g(if)f(it)h(is)f | |
967625cd | 11010 | (executed)150 5137 y(under)j(another)h(shell.)p eop end |
1101193a | 11011 | %%Page: 41 47 |
037a8b7f | 11012 | TeXDict begin 41 46 bop 3659 -116 a Fu(41)150 299 y Fp(4)80 |
967625cd | 11013 | b(Shell)53 b(Builtin)f(Commands)150 499 y Fu(Builtin)34 |
c302751c CR |
11014 | b(commands)f(are)h(con)m(tained)g(within)f(the)h(shell)g(itself.)50 |
11015 | b(When)34 b(the)f(name)h(of)f(a)h(builtin)f(com-)150 | |
967625cd | 11016 | 608 y(mand)26 b(is)i(used)e(as)i(the)g(\014rst)e(w)m(ord)h(of)h(a)f |
37c41ab1 | 11017 | (simple)h(command)f(\(see)h(Section)g(3.2.1)h([Simple)f(Commands],)150 |
967625cd | 11018 | 718 y(page)21 b(8\),)j(the)d(shell)g(executes)h(the)f(command)f |
37c41ab1 | 11019 | (directly)-8 b(,)24 b(without)d(in)m(v)m(oking)h(another)f(program.)37 |
967625cd | 11020 | b(Builtin)150 828 y(commands)f(are)h(necessary)g(to)g(implemen)m(t)g |
37c41ab1 | 11021 | (functionalit)m(y)h(imp)s(ossible)e(or)h(incon)m(v)m(enien)m(t)h(to)f |
967625cd CR |
11022 | (obtain)150 937 y(with)30 b(separate)h(utilities.)275 |
11023 | 1065 y(This)c(section)j(brie\015y)e(describ)s(es)g(the)h(builtins)f | |
ac18b312 | 11024 | (whic)m(h)g(Bash)h(inherits)f(from)g(the)h(Bourne)g(Shell,)g(as)150 |
967625cd | 11025 | 1174 y(w)m(ell)i(as)g(the)g(builtin)e(commands)h(whic)m(h)h(are)f |
ac18b312 | 11026 | (unique)g(to)h(or)f(ha)m(v)m(e)i(b)s(een)d(extended)i(in)f(Bash.)275 |
967625cd | 11027 | 1302 y(Sev)m(eral)45 b(builtin)e(commands)h(are)h(describ)s(ed)e(in)h |
ac18b312 | 11028 | (other)g(c)m(hapters:)69 b(builtin)43 b(commands)h(whic)m(h)150 |
967625cd | 11029 | 1412 y(pro)m(vide)23 b(the)h(Bash)f(in)m(terface)i(to)f(the)g(job)f |
37c41ab1 | 11030 | (con)m(trol)i(facilities)g(\(see)f(Section)h(7.2)f([Job)f(Con)m(trol)h |
967625cd | 11031 | (Builtins],)150 1521 y(page)37 b(100\),)i(the)d(directory)g(stac)m(k)h |
900a813b | 11032 | (\(see)g(Section)g(6.8.1)g([Directory)h(Stac)m(k)f(Builtins],)h(page)e |
967625cd | 11033 | (92\),)j(the)150 1631 y(command)23 b(history)h(\(see)g(Section)g(9.2)h |
900a813b | 11034 | ([Bash)f(History)g(Builtins],)h(page)g(136\),)h(and)d(the)h |
967625cd | 11035 | (programmable)150 1740 y(completion)32 b(facilities)g(\(see)g(Section)f |
900a813b | 11036 | (8.7)g([Programmable)g(Completion)g(Builtins],)g(page)h(130\).)275 |
967625cd CR |
11037 | 1868 y(Man)m(y)f(of)f(the)h(builtins)e(ha)m(v)m(e)j(b)s(een)e(extended) |
11038 | g(b)m(y)g Fm(posix)g Fu(or)g(Bash.)275 1996 y(Unless)20 | |
d7935593 | 11039 | b(otherwise)h(noted,)h(eac)m(h)g(builtin)e(command)g(do)s(cumen)m(ted)g |
967625cd | 11040 | (as)h(accepting)h(options)e(preceded)150 2105 y(b)m(y)29 |
d7935593 CR |
11041 | b(`)p Ft(-)p Fu(')g(accepts)i(`)p Ft(--)p Fu(')e(to)h(signify)f(the)g |
11042 | (end)g(of)g(the)h(options.)40 b(The)29 b Ft(:)p Fu(,)g | |
11043 | Ft(true)p Fu(,)g Ft(false)p Fu(,)f(and)h Ft(test)f Fu(builtins)150 | |
967625cd | 11044 | 2215 y(do)34 b(not)h(accept)h(options)f(and)f(do)g(not)h(treat)h(`)p |
d7935593 CR |
11045 | Ft(--)p Fu(')e(sp)s(ecially)-8 b(.)54 b(The)34 b Ft(exit)p |
11046 | Fu(,)h Ft(logout)p Fu(,)f Ft(return)p Fu(,)g Ft(break)p | |
967625cd | 11047 | Fu(,)150 2325 y Ft(continue)p Fu(,)22 b Ft(let)p Fu(,)i(and)e |
d7935593 | 11048 | Ft(shift)f Fu(builtins)h(accept)i(and)e(pro)s(cess)g(argumen)m(ts)h(b)s |
967625cd | 11049 | (eginning)f(with)g(`)p Ft(-)p Fu(')h(without)150 2434 |
d7935593 CR |
11050 | y(requiring)41 b(`)p Ft(--)p Fu('.)74 b(Other)41 b(builtins)g(that)h |
11051 | (accept)h(argumen)m(ts)e(but)g(are)h(not)g(sp)s(eci\014ed)f(as)g | |
967625cd | 11052 | (accepting)150 2544 y(options)25 b(in)m(terpret)f(argumen)m(ts)h(b)s |
d7935593 CR |
11053 | (eginning)e(with)h(`)p Ft(-)p Fu(')h(as)f(in)m(v)-5 b(alid)25 |
11054 | b(options)g(and)e(require)h(`)p Ft(--)p Fu(')g(to)h(prev)m(en)m(t)150 | |
967625cd CR |
11055 | 2653 y(this)30 b(in)m(terpretation.)150 2880 y Fs(4.1)68 |
11056 | b(Bourne)45 b(Shell)g(Builtins)150 3040 y Fu(The)22 b(follo)m(wing)j | |
d7935593 | 11057 | (shell)d(builtin)h(commands)f(are)h(inherited)g(from)f(the)h(Bourne)g |
967625cd | 11058 | (Shell.)38 b(These)22 b(commands)150 3149 y(are)31 b(implemen)m(ted)g |
d7935593 | 11059 | (as)f(sp)s(eci\014ed)g(b)m(y)g(the)h Fm(posix)e Fu(standard.)150 |
967625cd CR |
11060 | 3295 y Ft(:)h Fu(\(a)h(colon\))870 3405 y Ft(:)47 b([)p |
11061 | Fj(arguments)p Ft(])630 3532 y Fu(Do)c(nothing)f(b)s(ey)m(ond)g | |
6e51e0d0 | 11062 | (expanding)f Fr(argumen)m(ts)46 b Fu(and)c(p)s(erforming)f |
967625cd CR |
11063 | (redirections.)76 b(The)630 3642 y(return)29 b(status)i(is)f(zero.)150 |
11064 | 3788 y Ft(.)g Fu(\(a)h(p)s(erio)s(d\))870 3897 y Ft(.)47 | |
bce12dd7 | 11065 | b Fj(filename)f Ft([)p Fj(arguments)p Ft(])630 4025 y |
6e51e0d0 CR |
11066 | Fu(Read)34 b(and)f(execute)i(commands)e(from)g(the)h |
11067 | Fr(\014lename)39 b Fu(argumen)m(t)34 b(in)f(the)h(curren)m(t)g(shell) | |
bce12dd7 | 11068 | 630 4134 y(con)m(text.)45 b(If)31 b Fr(\014lename)37 |
6e51e0d0 CR |
11069 | b Fu(do)s(es)31 b(not)g(con)m(tain)i(a)e(slash,)h(the)g |
11070 | Ft(PATH)e Fu(v)-5 b(ariable)32 b(is)f(used)f(to)i(\014nd)630 | |
bce12dd7 | 11071 | 4244 y Fr(\014lename)p Fu(.)52 b(When)34 b(Bash)g(is)h(not)f(in)g |
6e51e0d0 | 11072 | Fm(posix)f Fu(mo)s(de,)i(the)g(curren)m(t)f(directory)g(is)g(searc)m |
bce12dd7 | 11073 | (hed)630 4354 y(if)d Fr(\014lename)36 b Fu(is)31 b(not)h(found)d(in)i |
6e51e0d0 | 11074 | Ft($PATH)p Fu(.)41 b(If)31 b(an)m(y)g Fr(argumen)m(ts)k |
bce12dd7 | 11075 | Fu(are)c(supplied,)f(they)i(b)s(ecome)630 4463 y(the)e(p)s(ositional)h |
6e51e0d0 | 11076 | (parameters)g(when)e Fr(\014lename)35 b Fu(is)30 b(executed.)42 |
bce12dd7 CR |
11077 | b(Otherwise)30 b(the)g(p)s(ositional)630 4573 y(parameters)40 |
11078 | b(are)f(unc)m(hanged.)67 b(If)39 b(the)g Ft(-T)g Fu(option)g(is)h | |
11079 | (enabled,)h Ft(source)d Fu(inherits)h(an)m(y)630 4682 | |
11080 | y(trap)31 b(on)g Ft(DEBUG)p Fu(;)f(if)i(it)f(is)g(not,)h(an)m(y)g | |
11081 | Ft(DEBUG)e Fu(trap)h(string)g(is)g(sa)m(v)m(ed)h(and)f(restored)g | |
11082 | (around)630 4792 y(the)41 b(call)i(to)e Ft(source)p Fu(,)i(and)d | |
11083 | Ft(source)f Fu(unsets)i(the)g Ft(DEBUG)f Fu(trap)h(while)g(it)g | |
11084 | (executes.)74 b(If)630 4902 y Ft(-T)39 b Fu(is)g(not)h(set,)j(and)c | |
11085 | (the)g(sourced)h(\014le)f(c)m(hanges)i(the)e Ft(DEBUG)f | |
11086 | Fu(trap,)k(the)e(new)f(v)-5 b(alue)40 b(is)630 5011 y(retained)e(when)e | |
11087 | Ft(source)g Fu(completes.)63 b(The)37 b(return)f(status)h(is)h(the)f | |
11088 | (exit)i(status)e(of)h(the)630 5121 y(last)g(command)e(executed,)j(or)e | |
11089 | (zero)h(if)e(no)h(commands)f(are)h(executed.)61 b(If)36 | |
11090 | b Fr(\014lename)42 b Fu(is)630 5230 y(not)f(found,)h(or)e(cannot)h(b)s | |
11091 | (e)f(read,)j(the)e(return)e(status)i(is)g(non-zero.)71 | |
11092 | b(This)40 b(builtin)g(is)630 5340 y(equiv)-5 b(alen)m(t)32 | |
11093 | b(to)f Ft(source)p Fu(.)p eop end | |
1101193a | 11094 | %%Page: 42 48 |
6e51e0d0 | 11095 | TeXDict begin 42 47 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
bce12dd7 CR |
11096 | b(Shell)30 b(Builtin)h(Commands)2069 b(42)150 299 y Ft(break)870 |
11097 | 428 y(break)46 b([)p Fj(n)p Ft(])630 558 y Fu(Exit)f(from)f(a)g | |
11098 | Ft(for)p Fu(,)k Ft(while)p Fu(,)e Ft(until)p Fu(,)h(or)d | |
11099 | Ft(select)f Fu(lo)s(op.)83 b(If)44 b Fr(n)g Fu(is)g(supplied,)j(the)e | |
11100 | Fr(n)p Fu(th)630 667 y(enclosing)c(lo)s(op)f(is)h(exited.)70 | |
11101 | b Fr(n)40 b Fu(m)m(ust)g(b)s(e)f(greater)j(than)d(or)i(equal)f(to)h(1.) | |
11102 | 70 b(The)40 b(return)630 777 y(status)31 b(is)f(zero)h(unless)f | |
11103 | Fr(n)g Fu(is)g(not)h(greater)g(than)g(or)f(equal)h(to)g(1.)150 | |
11104 | 927 y Ft(cd)870 1056 y(cd)47 b([-L|[-P)f([-e]])g([-@])h([)p | |
11105 | Fj(directory)p Ft(])630 1186 y Fu(Change)27 b(the)g(curren)m(t)f(w)m | |
11106 | (orking)h(directory)g(to)h Fr(directory)p Fu(.)40 b(If)26 | |
11107 | b Fr(directory)35 b Fu(is)27 b(not)g(supplied,)630 1295 | |
11108 | y(the)f(v)-5 b(alue)26 b(of)f(the)h Ft(HOME)e Fu(shell)i(v)-5 | |
45c0f7f8 | 11109 | b(ariable)26 b(is)g(used.)38 b(An)m(y)25 b(additional)i(argumen)m(ts)e |
bce12dd7 | 11110 | (follo)m(wing)630 1405 y Fr(directory)39 b Fu(are)31 |
45c0f7f8 | 11111 | b(ignored.)41 b(If)30 b(the)h(shell)g(v)-5 b(ariable)31 |
6e51e0d0 | 11112 | b Ft(CDPATH)e Fu(exists,)i(it)g(is)g(used)f(as)g(a)h(searc)m(h)630 |
bce12dd7 | 11113 | 1514 y(path:)39 b(eac)m(h)29 b(directory)g(name)f(in)f |
6e51e0d0 | 11114 | Ft(CDPATH)g Fu(is)h(searc)m(hed)g(for)g Fr(directory)p |
bce12dd7 | 11115 | Fu(,)h(with)f(alternativ)m(e)630 1624 y(directory)j(names)g(in)f |
6e51e0d0 CR |
11116 | Ft(CDPATH)f Fu(separated)j(b)m(y)e(a)h(colon)h(\(`)p |
11117 | Ft(:)p Fu('\).)43 b(If)30 b Fr(directory)39 b Fu(b)s(egins)30 | |
bce12dd7 CR |
11118 | b(with)630 1733 y(a)h(slash,)f Ft(CDPATH)f Fu(is)h(not)h(used.)630 |
11119 | 1863 y(The)g Ft(-P)h Fu(option)g(means)g(to)h(not)f(follo)m(w)h(sym)m | |
6e51e0d0 | 11120 | (b)s(olic)g(links:)44 b(sym)m(b)s(olic)32 b(links)g(are)g(resolv)m(ed) |
bce12dd7 | 11121 | 630 1973 y(while)41 b Ft(cd)f Fu(is)h(tra)m(v)m(ersing)h |
6e51e0d0 | 11122 | Fr(directory)49 b Fu(and)40 b(b)s(efore)g(pro)s(cessing)h(an)f |
bce12dd7 CR |
11123 | (instance)i(of)f(`)p Ft(..)p Fu(')f(in)630 2082 y Fr(directory)p |
11124 | Fu(.)630 2212 y(By)34 b(default,)h(or)e(when)g(the)g | |
6e51e0d0 | 11125 | Ft(-L)g Fu(option)h(is)g(supplied,)f(sym)m(b)s(olic)h(links)f(in)h |
bce12dd7 | 11126 | Fr(directory)42 b Fu(are)630 2321 y(resolv)m(ed)31 b(after)g |
6e51e0d0 | 11127 | Ft(cd)f Fu(pro)s(cesses)g(an)g(instance)h(of)g(`)p Ft(..)p |
bce12dd7 | 11128 | Fu(')f(in)g Fr(directory)p Fu(.)630 2451 y(If)35 b(`)p |
6e51e0d0 CR |
11129 | Ft(..)p Fu(')f(app)s(ears)h(in)f Fr(directory)p Fu(,)j(it)f(is)f(pro)s |
11130 | (cessed)f(b)m(y)h(remo)m(ving)h(the)f(immediately)h(pre-)630 | |
bce12dd7 | 11131 | 2560 y(ceding)31 b(pathname)f(comp)s(onen)m(t,)h(bac)m(k)g(to)g(a)g |
6e51e0d0 | 11132 | (slash)f(or)h(the)f(b)s(eginning)g(of)g Fr(directory)p |
bce12dd7 | 11133 | Fu(.)630 2690 y(If)i(the)i Ft(-e)e Fu(option)h(is)g(supplied)f(with)g |
6e51e0d0 | 11134 | Ft(-P)h Fu(and)f(the)h(curren)m(t)g(w)m(orking)g(directory)g(cannot)630 |
bce12dd7 | 11135 | 2800 y(b)s(e)k(successfully)g(determined)g(after)i(a)e(successful)h |
6e51e0d0 | 11136 | (directory)g(c)m(hange,)i Ft(cd)d Fu(will)h(return)630 |
bce12dd7 | 11137 | 2909 y(an)30 b(unsuccessful)f(status.)630 3039 y(On)41 |
6e51e0d0 CR |
11138 | b(systems)h(that)h(supp)s(ort)d(it,)46 b(the)c Ft(-@)g |
11139 | Fu(option)g(presen)m(ts)g(the)g(extended)g(attributes)630 | |
bce12dd7 CR |
11140 | 3148 y(asso)s(ciated)32 b(with)e(a)h(\014le)f(as)h(a)f(directory)-8 |
11141 | b(.)630 3278 y(If)41 b Fr(directory)49 b Fu(is)41 b(`)p | |
6e51e0d0 | 11142 | Ft(-)p Fu(',)j(it)e(is)f(con)m(v)m(erted)h(to)g Ft($OLDPWD)d |
bce12dd7 CR |
11143 | Fu(b)s(efore)i(the)g(directory)h(c)m(hange)g(is)630 3387 |
11144 | y(attempted.)630 3517 y(If)33 b(a)h(non-empt)m(y)g(directory)g(name)f | |
6e51e0d0 | 11145 | (from)g Ft(CDPATH)f Fu(is)h(used,)h(or)g(if)f(`)p Ft(-)p |
bce12dd7 | 11146 | Fu(')h(is)f(the)h(\014rst)f(argu-)630 3626 y(men)m(t,)28 |
d76edd30 | 11147 | b(and)e(the)h(directory)g(c)m(hange)h(is)f(successful,)h(the)f |
bce12dd7 | 11148 | (absolute)g(pathname)g(of)f(the)h(new)630 3736 y(w)m(orking)k |
d76edd30 | 11149 | (directory)g(is)f(written)g(to)i(the)e(standard)g(output.)630 |
bce12dd7 CR |
11150 | 3866 y(The)f(return)g(status)h(is)f(zero)i(if)e(the)h(directory)g(is)g |
11151 | (successfully)g(c)m(hanged,)g(non-zero)g(oth-)630 3975 | |
11152 | y(erwise.)150 4125 y Ft(continue)870 4254 y(continue)46 | |
11153 | b([)p Fj(n)p Ft(])630 4384 y Fu(Resume)32 b(the)g(next)g(iteration)i | |
6e51e0d0 | 11154 | (of)e(an)g(enclosing)h Ft(for)p Fu(,)f Ft(while)p Fu(,)f |
bce12dd7 | 11155 | Ft(until)p Fu(,)g(or)h Ft(select)f Fu(lo)s(op.)630 4493 |
6e51e0d0 CR |
11156 | y(If)f Fr(n)h Fu(is)g(supplied,)e(the)j(execution)g(of)f(the)g |
11157 | Fr(n)p Fu(th)f(enclosing)i(lo)s(op)f(is)f(resumed.)42 | |
bce12dd7 | 11158 | b Fr(n)30 b Fu(m)m(ust)h(b)s(e)630 4603 y(greater)39 |
37c41ab1 | 11159 | b(than)f(or)g(equal)g(to)h(1.)63 b(The)38 b(return)e(status)j(is)e |
bce12dd7 CR |
11160 | (zero)i(unless)e Fr(n)h Fu(is)g(not)g(greater)630 4712 |
11161 | y(than)30 b(or)g(equal)h(to)g(1.)150 4862 y Ft(eval)870 | |
11162 | 4991 y(eval)47 b([)p Fj(arguments)p Ft(])630 5121 y Fu(The)25 | |
6e51e0d0 | 11163 | b(argumen)m(ts)h(are)g(concatenated)i(together)f(in)m(to)f(a)g(single)h |
bce12dd7 | 11164 | (command,)f(whic)m(h)g(is)f(then)630 5230 y(read)35 b(and)g(executed,)j |
6e51e0d0 | 11165 | (and)d(its)h(exit)g(status)g(returned)e(as)h(the)h(exit)g(status)g(of)g |
bce12dd7 | 11166 | Ft(eval)p Fu(.)54 b(If)630 5340 y(there)31 b(are)f(no)h(argumen)m(ts)f |
6e51e0d0 | 11167 | (or)h(only)f(empt)m(y)h(argumen)m(ts,)g(the)f(return)g(status)g(is)h |
bce12dd7 | 11168 | (zero.)p eop end |
1101193a | 11169 | %%Page: 43 49 |
6e51e0d0 | 11170 | TeXDict begin 43 48 bop 150 -116 a Fu(Chapter)30 b(4:)h(Shell)f |
bce12dd7 CR |
11171 | (Builtin)h(Commands)2079 b(43)150 299 y Ft(exec)870 430 |
11172 | y(exec)47 b([-cl])f([-a)h Fj(name)p Ft(])f([)p Fj(command)g | |
11173 | Ft([)p Fj(arguments)p Ft(]])630 562 y Fu(If)36 b Fr(command)k | |
11174 | Fu(is)c(supplied,)h(it)g(replaces)h(the)e(shell)h(without)f(creating)i | |
11175 | (a)f(new)f(pro)s(cess.)630 671 y(If)k(the)h Ft(-l)e Fu(option)i(is)g | |
11176 | (supplied,)h(the)e(shell)h(places)g(a)g(dash)f(at)h(the)f(b)s(eginning) | |
11177 | g(of)h(the)630 781 y(zeroth)36 b(argumen)m(t)h(passed)e(to)h | |
11178 | Fr(command)p Fu(.)57 b(This)35 b(is)h(what)f(the)h Ft(login)e | |
11179 | Fu(program)i(do)s(es.)630 891 y(The)i Ft(-c)g Fu(option)g(causes)h | |
11180 | Fr(command)j Fu(to)d(b)s(e)f(executed)h(with)f(an)g(empt)m(y)h(en)m | |
11181 | (vironmen)m(t.)630 1000 y(If)c Ft(-a)g Fu(is)h(supplied,)f(the)h(shell) | |
11182 | g(passes)f Fr(name)41 b Fu(as)36 b(the)f(zeroth)i(argumen)m(t)f(to)g | |
11183 | Fr(command)p Fu(.)630 1110 y(If)c Fr(command)j Fu(cannot)e(b)s(e)f | |
45c0f7f8 | 11184 | (executed)h(for)f(some)g(reason,)h(a)g(non-in)m(teractiv)m(e)i(shell)d |
bce12dd7 | 11185 | (exits,)630 1219 y(unless)27 b(the)g Ft(execfail)e Fu(shell)i(option)h |
45c0f7f8 | 11186 | (is)f(enabled.)40 b(In)27 b(that)g(case,)j(it)d(returns)f(failure.)40 |
bce12dd7 | 11187 | b(An)630 1329 y(in)m(teractiv)m(e)d(shell)c(returns)g(failure)h(if)f |
6e51e0d0 | 11188 | (the)h(\014le)g(cannot)g(b)s(e)f(executed.)52 b(If)33 |
bce12dd7 | 11189 | b(no)h Fr(command)630 1439 y Fu(is)27 b(sp)s(eci\014ed,)g(redirections) |
d76edd30 | 11190 | h(ma)m(y)f(b)s(e)g(used)f(to)i(a\013ect)g(the)f(curren)m(t)g(shell)g |
bce12dd7 | 11191 | (en)m(vironmen)m(t.)40 b(If)630 1548 y(there)34 b(are)h(no)f |
d76edd30 | 11192 | (redirection)h(errors,)g(the)f(return)f(status)i(is)f(zero;)j |
bce12dd7 CR |
11193 | (otherwise)e(the)f(return)630 1658 y(status)d(is)f(non-zero.)150 |
11194 | 1811 y Ft(exit)870 1943 y(exit)47 b([)p Fj(n)p Ft(])630 | |
11195 | 2074 y Fu(Exit)30 b(the)g(shell,)h(returning)d(a)j(status)f(of)g | |
6e51e0d0 | 11196 | Fr(n)f Fu(to)h(the)g(shell's)g(paren)m(t.)41 b(If)30 |
bce12dd7 | 11197 | b Fr(n)f Fu(is)h(omitted,)h(the)630 2184 y(exit)c(status)g(is)g(that)g |
45c0f7f8 | 11198 | (of)g(the)g(last)g(command)f(executed.)41 b(An)m(y)26 |
bce12dd7 CR |
11199 | b(trap)h(on)f Ft(EXIT)f Fu(is)i(executed)630 2293 y(b)s(efore)j(the)h |
11200 | (shell)f(terminates.)150 2447 y Ft(export)870 2578 y(export)46 | |
6e51e0d0 | 11201 | b([-fn])g([-p])h([)p Fj(name)p Ft([=)p Fj(value)p Ft(]])630 |
bce12dd7 | 11202 | 2710 y Fu(Mark)40 b(eac)m(h)h Fr(name)k Fu(to)40 b(b)s(e)f(passed)g(to) |
6e51e0d0 | 11203 | i(c)m(hild)f(pro)s(cesses)f(in)g(the)h(en)m(vironmen)m(t.)70 |
bce12dd7 | 11204 | b(If)39 b(the)630 2819 y Ft(-f)33 b Fu(option)h(is)g(supplied,)f(the)h |
6e51e0d0 | 11205 | Fr(name)5 b Fu(s)33 b(refer)g(to)i(shell)e(functions;)i(otherwise)f |
bce12dd7 | 11206 | (the)g(names)630 2929 y(refer)c(to)h(shell)g(v)-5 b(ariables.)41 |
6e51e0d0 | 11207 | b(The)30 b Ft(-n)f Fu(option)i(means)f(to)h(no)f(longer)h(mark)f(eac)m |
bce12dd7 | 11208 | (h)i Fr(name)j Fu(for)630 3039 y(exp)s(ort.)52 b(If)33 |
6e51e0d0 CR |
11209 | b(no)h Fr(names)k Fu(are)c(supplied,)g(or)g(if)g(the)g |
11210 | Ft(-p)g Fu(option)g(is)g(giv)m(en,)j(a)d(list)h(of)f(names)630 | |
bce12dd7 | 11211 | 3148 y(of)d(all)h(exp)s(orted)e(v)-5 b(ariables)31 b(is)g(displa)m(y)m |
6e51e0d0 | 11212 | (ed.)43 b(The)30 b Ft(-p)g Fu(option)i(displa)m(ys)e(output)h(in)f(a)h |
bce12dd7 | 11213 | (form)630 3258 y(that)25 b(ma)m(y)g(b)s(e)f(reused)g(as)h(input.)38 |
6e51e0d0 CR |
11214 | b(If)24 b(a)h(v)-5 b(ariable)25 b(name)g(is)g(follo)m(w)m(ed)h(b)m(y)e |
11215 | (=)p Fr(v)-5 b(alue)p Fu(,)27 b(the)d(v)-5 b(alue)630 | |
bce12dd7 CR |
11216 | 3367 y(of)31 b(the)f(v)-5 b(ariable)31 b(is)g(set)g(to)g |
11217 | Fr(v)-5 b(alue)p Fu(.)630 3499 y(The)29 b(return)e(status)j(is)f(zero)h | |
6e51e0d0 | 11218 | (unless)e(an)h(in)m(v)-5 b(alid)29 b(option)h(is)f(supplied,)f(one)i |
bce12dd7 | 11219 | (of)f(the)g(names)630 3608 y(is)k(not)g(a)h(v)-5 b(alid)33 |
6e51e0d0 | 11220 | b(shell)h(v)-5 b(ariable)33 b(name,)i(or)e Ft(-f)f Fu(is)h(supplied)f |
bce12dd7 CR |
11221 | (with)h(a)g(name)g(that)h(is)f(not)h(a)630 3718 y(shell)d(function.)150 |
11222 | 3871 y Ft(getopts)870 4003 y(getopts)46 b Fj(optstring)f(name)i | |
6e51e0d0 CR |
11223 | Ft([)p Fj(args)p Ft(])630 4134 y(getopts)28 b Fu(is)i(used)g(b)m(y)g |
11224 | (shell)g(scripts)g(to)g(parse)g(p)s(ositional)h(parameters.)41 | |
11225 | b Fr(optstring)d Fu(con-)630 4244 y(tains)k(the)g(option)f(c)m | |
11226 | (haracters)i(to)g(b)s(e)d(recognized;)49 b(if)42 b(a)f(c)m(haracter)j | |
11227 | (is)d(follo)m(w)m(ed)i(b)m(y)f(a)630 4354 y(colon,)33 | |
11228 | b(the)f(option)g(is)g(exp)s(ected)g(to)h(ha)m(v)m(e)g(an)e(argumen)m | |
11229 | (t,)i(whic)m(h)f(should)e(b)s(e)h(separated)630 4463 | |
11230 | y(from)40 b(it)g(b)m(y)g(whitespace.)70 b(The)40 b(colon)h(\(`)p | |
11231 | Ft(:)p Fu('\))g(and)e(question)h(mark)g(\(`)p Ft(?)p | |
11232 | Fu('\))h(ma)m(y)f(not)h(b)s(e)630 4573 y(used)d(as)g(option)h(c)m | |
11233 | (haracters.)67 b(Eac)m(h)39 b(time)g(it)g(is)f(in)m(v)m(ok)m(ed,)k | |
11234 | Ft(getopts)37 b Fu(places)i(the)g(next)630 4682 y(option)29 | |
11235 | b(in)f(the)h(shell)g(v)-5 b(ariable)30 b Fr(name)p Fu(,)f(initializing) | |
11236 | i Fr(name)j Fu(if)28 b(it)h(do)s(es)g(not)g(exist,)h(and)e(the)630 | |
11237 | 4792 y(index)33 b(of)g(the)h(next)f(argumen)m(t)h(to)g(b)s(e)e(pro)s | |
11238 | (cessed)h(in)m(to)h(the)g(v)-5 b(ariable)34 b Ft(OPTIND)p | |
11239 | Fu(.)48 b Ft(OPTIND)630 4902 y Fu(is)41 b(initialized)i(to)f(1)f(eac)m | |
11240 | (h)h(time)g(the)f(shell)g(or)g(a)g(shell)g(script)g(is)g(in)m(v)m(ok)m | |
11241 | (ed.)74 b(When)41 b(an)630 5011 y(option)36 b(requires)e(an)h(argumen)m | |
11242 | (t,)i Ft(getopts)c Fu(places)j(that)g(argumen)m(t)g(in)m(to)g(the)f(v) | |
11243 | -5 b(ariable)630 5121 y Ft(OPTARG)p Fu(.)55 b(The)35 | |
11244 | b(shell)g(do)s(es)h(not)g(reset)g Ft(OPTIND)e Fu(automatically;)41 | |
11245 | b(it)36 b(m)m(ust)f(b)s(e)g(man)m(ually)630 5230 y(reset)i(b)s(et)m(w)m | |
11246 | (een)g(m)m(ultiple)h(calls)f(to)g Ft(getopts)e Fu(within)h(the)h(same)g | |
d76edd30 CR |
11247 | (shell)f(in)m(v)m(o)s(cation)j(if)e(a)630 5340 y(new)30 |
11248 | b(set)h(of)f(parameters)h(is)f(to)i(b)s(e)d(used.)p eop | |
11249 | end | |
1101193a | 11250 | %%Page: 44 50 |
6e51e0d0 | 11251 | TeXDict begin 44 49 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
d76edd30 | 11252 | b(Shell)30 b(Builtin)h(Commands)2069 b(44)630 299 y(When)41 |
6e51e0d0 CR |
11253 | b(the)h(end)e(of)i(options)g(is)f(encoun)m(tered,)k Ft(getopts)39 |
11254 | b Fu(exits)j(with)f(a)h(return)e(v)-5 b(alue)630 408 | |
11255 | y(greater)32 b(than)e(zero.)41 b Ft(OPTIND)29 b Fu(is)h(set)h(to)g(the) | |
d76edd30 | 11256 | g(index)f(of)g(the)h(\014rst)f(non-option)g(argumen)m(t,)630 |
6e51e0d0 CR |
11257 | 518 y(and)g Fr(name)35 b Fu(is)c(set)g(to)g(`)p Ft(?)p |
11258 | Fu('.)630 655 y Ft(getopts)c Fu(normally)j(parses)e(the)i(p)s | |
d76edd30 | 11259 | (ositional)g(parameters,)g(but)e(if)i(more)f(argumen)m(ts)h(are)630 |
6e51e0d0 CR |
11260 | 765 y(giv)m(en)h(in)f Fr(args)p Fu(,)h Ft(getopts)e Fu(parses)h(those)h |
11261 | (instead.)630 902 y Ft(getopts)h Fu(can)h(rep)s(ort)g(errors)g(in)h(t)m | |
d76edd30 | 11262 | (w)m(o)h(w)m(a)m(ys.)51 b(If)33 b(the)h(\014rst)e(c)m(haracter)k(of)d |
6e51e0d0 CR |
11263 | Fr(optstring)42 b Fu(is)34 b(a)630 1011 y(colon,)g Fr(silen)m(t)h |
11264 | Fu(error)d(rep)s(orting)f(is)i(used.)45 b(In)31 b(normal)h(op)s | |
d76edd30 | 11265 | (eration,)h(diagnostic)h(messages)630 1121 y(are)c(prin)m(ted)e(when)g |
ad4aef08 | 11266 | (in)m(v)-5 b(alid)30 b(options)g(or)f(missing)g(option)g(argumen)m(ts)h |
d76edd30 | 11267 | (are)f(encoun)m(tered.)630 1230 y(If)34 b(the)g(v)-5 |
6e51e0d0 | 11268 | b(ariable)35 b Ft(OPTERR)d Fu(is)i(set)h(to)f(0,)i(no)e(error)g |
d76edd30 | 11269 | (messages)h(will)f(b)s(e)f(displa)m(y)m(ed,)j(ev)m(en)f(if)630 |
6e51e0d0 CR |
11270 | 1340 y(the)c(\014rst)e(c)m(haracter)j(of)f Ft(optstring)d |
11271 | Fu(is)i(not)h(a)f(colon.)630 1477 y(If)39 b(an)h(in)m(v)-5 | |
11272 | b(alid)41 b(option)f(is)g(seen,)i Ft(getopts)c Fu(places)j(`)p | |
11273 | Ft(?)p Fu(')f(in)m(to)h Fr(name)k Fu(and,)d(if)e(not)g(silen)m(t,)630 | |
d76edd30 | 11274 | 1587 y(prin)m(ts)f(an)h(error)f(message)h(and)f(unsets)g |
6e51e0d0 | 11275 | Ft(OPTARG)p Fu(.)67 b(If)39 b Ft(getopts)f Fu(is)i(silen)m(t,)j(the)c |
d76edd30 | 11276 | (option)630 1696 y(c)m(haracter)32 b(found)d(is)h(placed)h(in)f |
6e51e0d0 | 11277 | Ft(OPTARG)f Fu(and)h(no)g(diagnostic)i(message)f(is)g(prin)m(ted.)630 |
d76edd30 | 11278 | 1833 y(If)c(a)g(required)f(argumen)m(t)i(is)f(not)g(found,)g(and)f |
6e51e0d0 CR |
11279 | Ft(getopts)f Fu(is)i(not)h(silen)m(t,)h(a)e(question)g(mark)630 |
11280 | 1943 y(\(`)p Ft(?)p Fu('\))h(is)g(placed)g(in)f Fr(name)p | |
11281 | Fu(,)h Ft(OPTARG)e Fu(is)h(unset,)h(and)f(a)g(diagnostic)i(message)g | |
11282 | (is)e(prin)m(ted.)39 b(If)630 2052 y Ft(getopts)28 b | |
11283 | Fu(is)h(silen)m(t,)i(then)e(a)h(colon)h(\(`)p Ft(:)p | |
11284 | Fu('\))f(is)g(placed)g(in)f Fr(name)35 b Fu(and)29 b | |
11285 | Ft(OPTARG)f Fu(is)h(set)h(to)h(the)630 2162 y(option)g(c)m(haracter)h | |
11286 | (found.)150 2326 y Ft(hash)870 2463 y(hash)47 b([-r])f([-p)h | |
11287 | Fj(filename)p Ft(])e([-dt])i([)p Fj(name)p Ft(])630 2600 | |
11288 | y Fu(Eac)m(h)32 b(time)g Ft(hash)e Fu(is)h(in)m(v)m(ok)m(ed,)j(it)d | |
45c0f7f8 | 11289 | (remem)m(b)s(ers)g(the)g(full)g(pathnames)g(of)h(the)f(commands)630 |
6e51e0d0 | 11290 | 2710 y(sp)s(eci\014ed)i(as)i Fr(name)k Fu(argumen)m(ts,)c(so)g(they)f |
122f603c | 11291 | (need)g(not)g(b)s(e)f(searc)m(hed)i(for)f(on)g(subsequen)m(t)630 |
d76edd30 CR |
11292 | 2819 y(in)m(v)m(o)s(cations.)79 b(The)41 b(commands)h(are)h(found)e(b)m |
11293 | (y)h(searc)m(hing)i(through)d(the)i(directories)630 2929 | |
6e51e0d0 CR |
11294 | y(listed)37 b(in)g Ft($PATH)p Fu(.)58 b(An)m(y)37 b(previously-remem)m |
11295 | (b)s(ered)f(pathname)h(is)g(discarded.)59 b(The)37 b | |
11296 | Ft(-p)630 3039 y Fu(option)d(inhibits)f(the)h(path)g(searc)m(h,)h(and)e | |
11297 | Fr(\014lename)39 b Fu(is)34 b(used)f(as)h(the)f(lo)s(cation)j(of)e | |
11298 | Fr(name)p Fu(.)630 3148 y(The)42 b Ft(-r)g Fu(option)h(causes)f(the)h | |
11299 | (shell)g(to)g(forget)g(all)h(remem)m(b)s(ered)d(lo)s(cations.)79 | |
11300 | b(The)42 b Ft(-d)630 3258 y Fu(option)31 b(causes)g(the)f(shell)h(to)g | |
11301 | (forget)h(the)f(remem)m(b)s(ered)e(lo)s(cation)j(of)f(eac)m(h)h | |
11302 | Fr(name)p Fu(.)41 b(If)30 b(the)630 3367 y Ft(-t)39 b | |
11303 | Fu(option)h(is)g(supplied,)g(the)g(full)f(pathname)h(to)g(whic)m(h)f | |
11304 | (eac)m(h)i Fr(name)k Fu(corresp)s(onds)38 b(is)630 3477 | |
11305 | y(prin)m(ted.)k(If)30 b(m)m(ultiple)i Fr(name)k Fu(argumen)m(ts)31 | |
11306 | b(are)g(supplied)f(with)g Ft(-t)g Fu(the)h Fr(name)36 | |
11307 | b Fu(is)31 b(prin)m(ted)630 3587 y(b)s(efore)e(the)i(hashed)e(full)g | |
11308 | (pathname.)41 b(The)29 b Ft(-l)g Fu(option)i(causes)f(output)f(to)i(b)s | |
11309 | (e)e(displa)m(y)m(ed)630 3696 y(in)23 b(a)h(format)g(that)g(ma)m(y)g(b) | |
11310 | s(e)f(reused)f(as)i(input.)37 b(If)23 b(no)h(argumen)m(ts)f(are)h(giv)m | |
11311 | (en,)i(or)e(if)f(only)h Ft(-l)630 3806 y Fu(is)35 b(supplied,)f | |
11312 | (information)h(ab)s(out)g(remem)m(b)s(ered)f(commands)g(is)h(prin)m | |
11313 | (ted.)53 b(The)34 b(return)630 3915 y(status)d(is)f(zero)h(unless)f(a)h | |
11314 | Fr(name)k Fu(is)c(not)f(found)f(or)i(an)f(in)m(v)-5 b(alid)31 | |
11315 | b(option)g(is)f(supplied.)150 4080 y Ft(pwd)870 4217 | |
11316 | y(pwd)47 b([-LP])630 4354 y Fu(Prin)m(t)29 b(the)g(absolute)h(pathname) | |
11317 | e(of)h(the)h(curren)m(t)e(w)m(orking)h(directory)-8 b(.)42 | |
11318 | b(If)28 b(the)h Ft(-P)f Fu(option)630 4463 y(is)39 b(supplied,)h(the)f | |
11319 | (pathname)g(prin)m(ted)g(will)g(not)h(con)m(tain)g(sym)m(b)s(olic)f | |
11320 | (links.)67 b(If)38 b(the)i Ft(-L)630 4573 y Fu(option)k(is)g(supplied,) | |
11321 | i(the)e(pathname)f(prin)m(ted)h(ma)m(y)g(con)m(tain)h(sym)m(b)s(olic)f | |
11322 | (links.)80 b(The)630 4682 y(return)26 b(status)h(is)h(zero)g(unless)e | |
11323 | (an)h(error)g(is)g(encoun)m(tered)g(while)h(determining)f(the)g(name) | |
11324 | 630 4792 y(of)k(the)f(curren)m(t)g(directory)h(or)f(an)h(in)m(v)-5 | |
11325 | b(alid)31 b(option)g(is)f(supplied.)150 4956 y Ft(readonly)870 | |
11326 | 5093 y(readonly)46 b([-aAf])g([-p])g([)p Fj(name)p Ft([=)p | |
11327 | Fj(value)p Ft(]])e(...)630 5230 y Fu(Mark)33 b(eac)m(h)h | |
11328 | Fr(name)39 b Fu(as)33 b(readonly)-8 b(.)49 b(The)32 b(v)-5 | |
11329 | b(alues)34 b(of)f(these)g(names)g(ma)m(y)h(not)f(b)s(e)f(c)m(hanged)630 | |
11330 | 5340 y(b)m(y)38 b(subsequen)m(t)g(assignmen)m(t.)65 b(If)38 | |
11331 | b(the)h Ft(-f)f Fu(option)g(is)h(supplied,)g(eac)m(h)h | |
11332 | Fr(name)j Fu(refers)38 b(to)p eop end | |
d76edd30 | 11333 | %%Page: 45 51 |
6e51e0d0 CR |
11334 | TeXDict begin 45 50 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
11335 | b(Shell)30 b(Builtin)h(Commands)2069 b(45)630 299 y(a)37 | |
11336 | b(shell)g(function.)59 b(The)36 b Ft(-a)g Fu(option)h(means)f(eac)m(h)i | |
11337 | Fr(name)k Fu(refers)36 b(to)h(an)f(indexed)g(arra)m(y)630 | |
11338 | 408 y(v)-5 b(ariable;)28 b(the)f Ft(-A)e Fu(option)h(means)g(eac)m(h)h | |
11339 | Fr(name)k Fu(refers)26 b(to)g(an)g(asso)s(ciativ)m(e)i(arra)m(y)f(v)-5 | |
11340 | b(ariable.)630 518 y(If)35 b(b)s(oth)g(options)h(are)h(supplied,)f | |
11341 | Ft(-A)f Fu(tak)m(es)i(precedence.)58 b(If)35 b(no)h Fr(name)k | |
11342 | Fu(argumen)m(ts)d(are)630 628 y(giv)m(en,)k(or)c(if)h(the)g | |
11343 | Ft(-p)f Fu(option)h(is)f(supplied,)i(a)f(list)g(of)g(all)g(readonly)g | |
11344 | (names)f(is)h(prin)m(ted.)630 737 y(The)32 b(other)g(options)g(ma)m(y)h | |
11345 | (b)s(e)f(used)f(to)i(restrict)g(the)f(output)g(to)h(a)f(subset)g(of)g | |
11346 | (the)g(set)h(of)630 847 y(readonly)c(names.)41 b(The)28 | |
11347 | b Ft(-p)h Fu(option)h(causes)g(output)e(to)j(b)s(e)d(displa)m(y)m(ed)i | |
11348 | (in)f(a)h(format)f(that)630 956 y(ma)m(y)j(b)s(e)e(reused)g(as)i | |
11349 | (input.)42 b(If)30 b(a)i(v)-5 b(ariable)31 b(name)h(is)f(follo)m(w)m | |
11350 | (ed)h(b)m(y)f(=)p Fr(v)-5 b(alue)p Fu(,)32 b(the)f(v)-5 | |
11351 | b(alue)32 b(of)630 1066 y(the)i(v)-5 b(ariable)34 b(is)f(set)i(to)f | |
11352 | Fr(v)-5 b(alue)p Fu(.)50 b(The)33 b(return)g(status)g(is)h(zero)g | |
11353 | (unless)f(an)g(in)m(v)-5 b(alid)34 b(option)630 1176 | |
11354 | y(is)c(supplied,)f(one)h(of)g(the)g Fr(name)35 b Fu(argumen)m(ts)30 | |
11355 | b(is)g(not)g(a)g(v)-5 b(alid)31 b(shell)f(v)-5 b(ariable)30 | |
11356 | b(or)g(function)630 1285 y(name,)h(or)f(the)h Ft(-f)e | |
11357 | Fu(option)i(is)g(supplied)e(with)h(a)h(name)f(that)h(is)f(not)h(a)g | |
fc527055 CR |
11358 | (shell)f(function.)150 1462 y Ft(return)870 1606 y(return)46 |
11359 | b([)p Fj(n)p Ft(])630 1749 y Fu(Cause)37 b(a)g(shell)h(function)f(to)g | |
6e51e0d0 | 11360 | (stop)h(executing)g(and)e(return)h(the)g(v)-5 b(alue)37 |
fc527055 | 11361 | b Fr(n)g Fu(to)h(its)f(caller.)630 1858 y(If)h Fr(n)h |
6e51e0d0 CR |
11362 | Fu(is)g(not)g(supplied,)h(the)f(return)e(v)-5 b(alue)40 |
11363 | b(is)f(the)g(exit)g(status)g(of)g(the)g(last)h(command)630 | |
fc527055 CR |
11364 | 1968 y(executed)i(in)f(the)g(function.)72 b(If)41 b Ft(return)e |
11365 | Fu(is)i(executed)h(b)m(y)f(a)h(trap)f(handler,)i(the)e(last)630 | |
11366 | 2078 y(command)d(used)f(to)i(determine)f(the)g(status)g(is)h(the)f | |
11367 | (last)h(command)e(executed)i(b)s(efore)630 2187 y(the)28 | |
11368 | b(trap)f(handler.)39 b(if)28 b Ft(return)e Fu(is)h(executed)i(during)d | |
11369 | (a)i Ft(DEBUG)f Fu(trap,)h(the)g(last)g(command)630 2297 | |
11370 | y(used)f(to)h(determine)g(the)f(status)h(is)g(the)f(last)i(command)e | |
11371 | (executed)h(b)m(y)g(the)f(trap)h(handler)630 2406 y(b)s(efore)e | |
11372 | Ft(return)f Fu(w)m(as)i(in)m(v)m(ok)m(ed.)41 b Ft(return)25 | |
11373 | b Fu(ma)m(y)i(also)g(b)s(e)f(used)g(to)h(terminate)h(execution)g(of)630 | |
11374 | 2516 y(a)34 b(script)g(b)s(eing)g(executed)g(with)g(the)g | |
6e51e0d0 | 11375 | Ft(.)g Fu(\()p Ft(source)p Fu(\))f(builtin,)h(returning)f(either)i |
fc527055 | 11376 | Fr(n)e Fu(or)h(the)630 2626 y(exit)j(status)f(of)g(the)g(last)h |
d76edd30 | 11377 | (command)e(executed)i(within)e(the)h(script)g(as)g(the)g(exit)h(status) |
fc527055 | 11378 | 630 2735 y(of)i(the)g(script.)65 b(If)38 b Fr(n)g Fu(is)h(supplied,)h |
d76edd30 | 11379 | (the)f(return)e(v)-5 b(alue)39 b(is)g(its)g(least)h(signi\014can)m(t)g |
fc527055 | 11380 | (8)f(bits.)630 2845 y(An)m(y)g(command)f(asso)s(ciated)j(with)d(the)h |
6e51e0d0 | 11381 | Ft(RETURN)e Fu(trap)i(is)g(executed)g(b)s(efore)g(execution)630 |
fc527055 | 11382 | 2954 y(resumes)29 b(after)h(the)g(function)g(or)g(script.)40 |
6e51e0d0 | 11383 | b(The)29 b(return)g(status)h(is)g(non-zero)g(if)g Ft(return)e |
fc527055 | 11384 | Fu(is)630 3064 y(supplied)h(a)i(non-n)m(umeric)g(argumen)m(t)g(or)f(is) |
d76edd30 | 11385 | h(used)f(outside)h(a)g(function)f(and)g(not)h(during)630 |
fc527055 CR |
11386 | 3173 y(the)g(execution)g(of)g(a)f(script)h(b)m(y)f Ft(.)g |
11387 | Fu(or)g Ft(source)p Fu(.)150 3351 y Ft(shift)870 3494 | |
11388 | y(shift)46 b([)p Fj(n)p Ft(])630 3637 y Fu(Shift)41 b(the)g(p)s | |
6e51e0d0 | 11389 | (ositional)h(parameters)g(to)g(the)f(left)h(b)m(y)g Fr(n)p |
fc527055 | 11390 | Fu(.)73 b(The)40 b(p)s(ositional)j(parameters)630 3747 |
6e51e0d0 CR |
11391 | y(from)34 b Fr(n)p Ft(+)p Fu(1)39 b(.)22 b(.)h(.)45 b |
11392 | Ft($#)34 b Fu(are)g(renamed)g(to)h Ft($1)k Fu(.)22 b(.)g(.)46 | |
11393 | b Ft($#)p Fu(-)p Fr(n)p Fu(.)51 b(P)m(arameters)36 b(represen)m(ted)e | |
fc527055 | 11394 | (b)m(y)g(the)630 3856 y(n)m(um)m(b)s(ers)25 b Ft($#)i |
6e51e0d0 CR |
11395 | Fu(to)g Ft($#)p Fu(-)p Fr(n)p Ft(+)p Fu(1)g(are)g(unset.)39 |
11396 | b Fr(n)26 b Fu(m)m(ust)h(b)s(e)f(a)i(non-negativ)m(e)h(n)m(um)m(b)s(er) | |
fc527055 | 11397 | c(less)i(than)g(or)630 3966 y(equal)33 b(to)h Ft($#)p |
6e51e0d0 CR |
11398 | Fu(.)47 b(If)33 b Fr(n)f Fu(is)h(zero)g(or)g(greater)h(than)f |
11399 | Ft($#)p Fu(,)g(the)g(p)s(ositional)g(parameters)g(are)h(not)630 | |
fc527055 | 11400 | 4075 y(c)m(hanged.)48 b(If)32 b Fr(n)g Fu(is)h(not)f(supplied,)h(it)g |
09767ff0 | 11401 | (is)f(assumed)g(to)h(b)s(e)f(1.)48 b(The)32 b(return)g(status)h(is)f |
fc527055 | 11402 | (zero)630 4185 y(unless)e Fr(n)f Fu(is)i(greater)g(than)g |
6e51e0d0 | 11403 | Ft($#)e Fu(or)i(less)f(than)h(zero,)g(non-zero)g(otherwise.)150 |
fc527055 CR |
11404 | 4362 y Ft(test)150 4472 y([)870 4615 y(test)47 b Fj(expr)630 |
11405 | 4758 y Fu(Ev)-5 b(aluate)40 b(a)f(conditional)h(express)f(ion)g | |
6e51e0d0 | 11406 | Fr(expr)45 b Fu(and)38 b(return)g(a)h(status)g(of)g(0)g(\(true\))h(or)f |
fc527055 | 11407 | (1)630 4868 y(\(false\).)j(Eac)m(h)31 b(op)s(erator)f(and)f(op)s(erand) |
122f603c | 11408 | g(m)m(ust)h(b)s(e)f(a)i(separate)g(argumen)m(t.)41 b(Expressions)630 |
fc527055 | 11409 | 4977 y(are)26 b(comp)s(osed)f(of)g(the)h(primaries)f(describ)s(ed)f(b)s |
122f603c | 11410 | (elo)m(w)h(in)g(Section)h(6.4)h([Bash)e(Conditional)630 |
900a813b | 11411 | 5087 y(Expressions],)39 b(page)g(86.)64 b Ft(test)37 |
6e51e0d0 | 11412 | b Fu(do)s(es)g(not)h(accept)i(an)m(y)e(options,)i(nor)e(do)s(es)f(it)h |
fc527055 | 11413 | (accept)630 5197 y(and)30 b(ignore)h(an)f(argumen)m(t)h(of)f |
6e51e0d0 | 11414 | Ft(--)g Fu(as)h(signifying)f(the)h(end)f(of)g(options.)630 |
fc527055 | 11415 | 5340 y(When)g(the)h Ft([)f Fu(form)g(is)g(used,)g(the)g(last)i(argumen) |
6e51e0d0 | 11416 | m(t)e(to)i(the)e(command)g(m)m(ust)h(b)s(e)e(a)i Ft(])p |
fc527055 | 11417 | Fu(.)p eop end |
1101193a | 11418 | %%Page: 46 52 |
6e51e0d0 | 11419 | TeXDict begin 46 51 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
fc527055 CR |
11420 | b(Shell)30 b(Builtin)h(Commands)2069 b(46)630 299 y(Expressions)23 |
11421 | b(ma)m(y)h(b)s(e)e(com)m(bined)i(using)f(the)h(follo)m(wing)h(op)s | |
11422 | (erators,)g(listed)f(in)f(decreasing)630 408 y(order)30 | |
11423 | b(of)h(precedence.)43 b(The)30 b(ev)-5 b(aluation)33 | |
11424 | b(dep)s(ends)28 b(on)j(the)g(n)m(um)m(b)s(er)f(of)h(argumen)m(ts;)g | |
11425 | (see)630 518 y(b)s(elo)m(w.)41 b(Op)s(erator)30 b(precedence)h(is)f | |
11426 | (used)g(when)f(there)i(are)f(\014v)m(e)h(or)f(more)h(argumen)m(ts.)630 | |
11427 | 667 y Ft(!)f Fj(expr)210 b Fu(T)-8 b(rue)30 b(if)g Fr(expr)37 | |
11428 | b Fu(is)30 b(false.)630 817 y Ft(\()g Fj(expr)f Ft(\))133 | |
11429 | b Fu(Returns)23 b(the)i(v)-5 b(alue)25 b(of)f Fr(expr)p | |
11430 | Fu(.)38 b(This)24 b(ma)m(y)h(b)s(e)e(used)h(to)h(o)m(v)m(erride)g(the)g | |
11431 | (normal)1110 927 y(precedence)31 b(of)f(op)s(erators.)630 | |
11432 | 1076 y Fj(expr1)f Ft(-a)h Fj(expr2)1110 1186 y Fu(T)-8 | |
11433 | b(rue)30 b(if)g(b)s(oth)g Fr(expr1)37 b Fu(and)30 b Fr(expr2)38 | |
11434 | b Fu(are)30 b(true.)630 1335 y Fj(expr1)f Ft(-o)h Fj(expr2)1110 | |
11435 | 1445 y Fu(T)-8 b(rue)30 b(if)g(either)h Fr(expr1)38 b | |
11436 | Fu(or)30 b Fr(expr2)37 b Fu(is)31 b(true.)630 1594 y(The)37 | |
11437 | b Ft(test)f Fu(and)g Ft([)h Fu(builtins)g(ev)-5 b(aluate)39 | |
11438 | b(conditional)f(expressions)f(using)g(a)g(set)h(of)f(rules)630 | |
11439 | 1704 y(based)30 b(on)g(the)h(n)m(um)m(b)s(er)e(of)h(argumen)m(ts.)630 | |
11440 | 1853 y(0)h(argumen)m(ts)1110 1963 y(The)f(expression)g(is)g(false.)630 | |
11441 | 2112 y(1)h(argumen)m(t)1110 2222 y(The)f(expression)g(is)g(true)h(if)f | |
11442 | (and)g(only)g(if)h(the)f(argumen)m(t)h(is)f(not)h(n)m(ull.)630 | |
11443 | 2371 y(2)g(argumen)m(ts)1110 2481 y(If)f(the)h(\014rst)f(argumen)m(t)h | |
11444 | (is)g(`)p Ft(!)p Fu(',)g(the)g(expression)g(is)g(true)f(if)h(and)f | |
11445 | (only)h(if)g(the)1110 2590 y(second)j(argumen)m(t)f(is)h(n)m(ull.)50 | |
11446 | b(If)33 b(the)h(\014rst)e(argumen)m(t)i(is)g(one)g(of)f(the)h(unary) | |
11447 | 1110 2700 y(conditional)42 b(op)s(erators)f(\(see)g(Section)h(6.4)f | |
11448 | ([Bash)g(Conditional)g(Expres-)1110 2809 y(sions],)34 | |
900a813b | 11449 | b(page)f(86\),)i(the)e(expression)f(is)h(true)g(if)g(the)g(unary)e |
fc527055 CR |
11450 | (test)j(is)f(true.)47 b(If)1110 2919 y(the)33 b(\014rst)g(argumen)m(t)h |
11451 | (is)f(not)g(a)h(v)-5 b(alid)34 b(unary)e(op)s(erator,)i(the)g | |
11452 | (expression)f(is)1110 3029 y(false.)630 3178 y(3)e(argumen)m(ts)1110 | |
11453 | 3288 y(The)44 b(follo)m(wing)i(conditions)f(are)g(applied)f(in)g(the)g | |
11454 | (order)g(listed.)84 b(If)44 b(the)1110 3397 y(second)f(argumen)m(t)g | |
11455 | (is)g(one)g(of)g(the)g(binary)f(conditional)i(op)s(erators)f(\(see)1110 | |
11456 | 3507 y(Section)h(6.4)g([Bash)g(Conditional)g(Expressions],)i(page)e | |
900a813b | 11457 | (86\),)k(the)43 b(result)1110 3616 y(of)h(the)h(expression)f(is)g(the)g |
510e20a2 | 11458 | (result)g(of)h(the)f(binary)g(test)h(using)e(the)i(\014rst)1110 |
fc527055 | 11459 | 3726 y(and)31 b(third)g(argumen)m(ts)i(as)f(op)s(erands.)44 |
6e51e0d0 | 11460 | b(The)31 b(`)p Ft(-a)p Fu(')h(and)g(`)p Ft(-o)p Fu(')f(op)s(erators)i |
fc527055 CR |
11461 | (are)1110 3836 y(considered)25 b(binary)g(op)s(erators)g(when)f(there)i |
11462 | (are)f(three)h(argumen)m(ts.)39 b(If)25 b(the)1110 3945 | |
6e51e0d0 | 11463 | y(\014rst)j(argumen)m(t)h(is)g(`)p Ft(!)p Fu(',)h(the)f(v)-5 |
510e20a2 | 11464 | b(alue)29 b(is)g(the)g(negation)i(of)e(the)g(t)m(w)m(o-argumen)m(t)1110 |
fc527055 CR |
11465 | 4055 y(test)38 b(using)f(the)g(second)g(and)g(third)f(argumen)m(ts.)61 |
11466 | b(If)37 b(the)g(\014rst)f(argumen)m(t)1110 4164 y(is)j(exactly)i(`)p | |
6e51e0d0 | 11467 | Ft(\()p Fu(')f(and)f(the)g(third)g(argumen)m(t)h(is)f(exactly)i(`)p |
fc527055 | 11468 | Ft(\))p Fu(',)h(the)e(result)f(is)1110 4274 y(the)46 |
510e20a2 | 11469 | b(one-argumen)m(t)g(test)h(of)f(the)f(second)h(argumen)m(t.)86 |
fc527055 CR |
11470 | b(Otherwise,)50 b(the)1110 4384 y(expression)30 b(is)h(false.)630 |
11471 | 4533 y(4)g(argumen)m(ts)1110 4643 y(If)h(the)i(\014rst)e(argumen)m(t)h | |
6e51e0d0 | 11472 | (is)g(`)p Ft(!)p Fu(',)h(the)f(result)g(is)g(the)g(negation)h(of)f(the) |
fc527055 CR |
11473 | g(three-)1110 4752 y(argumen)m(t)h(expression)f(comp)s(osed)h(of)f(the) |
11474 | h(remaining)g(argumen)m(ts.)50 b(Oth-)1110 4862 y(erwise,)34 | |
510e20a2 | 11475 | b(the)f(expression)g(is)g(parsed)g(and)f(ev)-5 b(aluated)34 |
fc527055 CR |
11476 | b(according)h(to)e(prece-)1110 4971 y(dence)e(using)e(the)i(rules)f |
11477 | (listed)h(ab)s(o)m(v)m(e.)630 5121 y(5)g(or)f(more)h(argumen)m(ts)1110 | |
11478 | 5230 y(The)43 b(expression)f(is)i(parsed)e(and)g(ev)-5 | |
11479 | b(aluated)45 b(according)f(to)f(precedence)1110 5340 | |
11480 | y(using)30 b(the)g(rules)g(listed)h(ab)s(o)m(v)m(e.)p | |
d76edd30 | 11481 | eop end |
1101193a | 11482 | %%Page: 47 53 |
6e51e0d0 | 11483 | TeXDict begin 47 52 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
fc527055 CR |
11484 | b(Shell)30 b(Builtin)h(Commands)2069 b(47)630 299 y(When)40 |
11485 | b(used)f(with)g Ft(test)g Fu(or)h(`)p Ft([)p Fu(',)j(the)d(`)p | |
11486 | Ft(<)p Fu(')g(and)f(`)p Ft(>)p Fu(')h(op)s(erators)g(sort)g | |
11487 | (lexicographically)630 408 y(using)30 b(ASCI)s(I)f(ordering.)150 | |
11488 | 559 y Ft(times)870 689 y(times)630 819 y Fu(Prin)m(t)37 | |
11489 | b(out)h(the)g(user)e(and)h(system)g(times)h(used)f(b)m(y)g(the)h(shell) | |
11490 | f(and)g(its)h(c)m(hildren.)61 b(The)630 929 y(return)29 | |
11491 | b(status)i(is)f(zero.)150 1080 y Ft(trap)870 1210 y(trap)47 | |
11492 | b([-lp])f([)p Fj(arg)p Ft(])g([)p Fj(sigspec)g Ft(...)o(])630 | |
11493 | 1340 y Fu(The)d(commands)f(in)h Fr(arg)51 b Fu(are)44 | |
11494 | b(to)g(b)s(e)e(read)h(and)g(executed)h(when)e(the)h(shell)g(receiv)m | |
11495 | (es)630 1450 y(signal)36 b Fr(sigsp)s(ec)p Fu(.)57 b(If)35 | |
11496 | b Fr(arg)44 b Fu(is)36 b(absen)m(t)g(\(and)f(there)h(is)g(a)f(single)i | |
11497 | Fr(sigsp)s(ec)6 b Fu(\))35 b(or)h(equal)g(to)h(`)p Ft(-)p | |
11498 | Fu(',)630 1559 y(eac)m(h)k(sp)s(eci\014ed)e(signal's)h(disp)s(osition)g | |
11499 | (is)f(reset)i(to)f(the)g(v)-5 b(alue)40 b(it)g(had)f(when)g(the)h | |
11500 | (shell)630 1669 y(w)m(as)33 b(started.)47 b(If)32 b Fr(arg)41 | |
11501 | b Fu(is)32 b(the)h(n)m(ull)f(string,)i(then)e(the)g(signal)i(sp)s | |
11502 | (eci\014ed)d(b)m(y)i(eac)m(h)g Fr(sigsp)s(ec)630 1778 | |
11503 | y Fu(is)g(ignored)h(b)m(y)f(the)g(shell)h(and)e(commands)h(it)h(in)m(v) | |
11504 | m(ok)m(es.)51 b(If)33 b Fr(arg)41 b Fu(is)33 b(not)h(presen)m(t)f(and)g | |
11505 | Ft(-p)630 1888 y Fu(has)g(b)s(een)g(supplied,)f(the)i(shell)f(displa)m | |
11506 | (ys)h(the)f(trap)g(commands)g(asso)s(ciated)i(with)e(eac)m(h)630 | |
11507 | 1998 y Fr(sigsp)s(ec)p Fu(.)47 b(If)31 b(no)i(argumen)m(ts)f(are)h | |
11508 | (supplied,)e(or)i(only)f Ft(-p)g Fu(is)g(giv)m(en,)i | |
11509 | Ft(trap)d Fu(prin)m(ts)h(the)g(list)630 2107 y(of)c(commands)f(asso)s | |
11510 | (ciated)i(with)f(eac)m(h)h(signal)f(n)m(um)m(b)s(er)e(in)i(a)g(form)f | |
11511 | (that)h(ma)m(y)h(b)s(e)e(reused)630 2217 y(as)f(shell)h(input.)38 | |
11512 | b(The)26 b Ft(-l)f Fu(option)i(causes)f(the)g(shell)h(to)g(prin)m(t)e | |
11513 | (a)i(list)f(of)h(signal)g(names)f(and)630 2326 y(their)33 | |
11514 | b(corresp)s(onding)f(n)m(um)m(b)s(ers.)47 b(Eac)m(h)34 | |
11515 | b Fr(sigsp)s(ec)39 b Fu(is)33 b(either)g(a)h(signal)g(name)f(or)g(a)g | |
11516 | (signal)630 2436 y(n)m(um)m(b)s(er.)39 b(Signal)31 b(names)f(are)h | |
11517 | (case)h(insensitiv)m(e)f(and)f(the)g Ft(SIG)g Fu(pre\014x)f(is)i | |
11518 | (optional.)630 2566 y(If)k(a)g Fr(sigsp)s(ec)41 b Fu(is)35 | |
11519 | b Ft(0)g Fu(or)g Ft(EXIT)p Fu(,)g Fr(arg)43 b Fu(is)35 | |
11520 | b(executed)h(when)e(the)h(shell)h(exits.)55 b(If)35 b(a)g | |
11521 | Fr(sigsp)s(ec)41 b Fu(is)630 2676 y Ft(DEBUG)p Fu(,)32 | |
11522 | b(the)g(command)g Fr(arg)40 b Fu(is)33 b(executed)g(b)s(efore)f(ev)m | |
11523 | (ery)h(simple)f(command,)h Ft(for)e Fu(com-)630 2785 | |
11524 | y(mand,)d Ft(case)g Fu(command,)h Ft(select)e Fu(command,)i(ev)m(ery)h | |
11525 | (arithmetic)g Ft(for)d Fu(command,)j(and)630 2895 y(b)s(efore)22 | |
11526 | b(the)g(\014rst)f(command)h(executes)i(in)e(a)g(shell)h(function.)37 | |
11527 | b(Refer)22 b(to)h(the)g(description)f(of)630 3004 y(the)i | |
11528 | Ft(extdebug)d Fu(option)j(to)h(the)f Ft(shopt)e Fu(builtin)h(\(see)i | |
11529 | (Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)630 3114 | |
11530 | y(page)33 b(63\))g(for)f(details)h(of)f(its)h(e\013ect)g(on)f(the)g | |
11531 | Ft(DEBUG)f Fu(trap.)46 b(If)31 b(a)i Fr(sigsp)s(ec)38 | |
11532 | b Fu(is)32 b Ft(RETURN)p Fu(,)f(the)630 3224 y(command)h | |
6e51e0d0 | 11533 | Fr(arg)41 b Fu(is)33 b(executed)g(eac)m(h)h(time)f(a)g(shell)g |
fc527055 | 11534 | (function)g(or)f(a)h(script)g(executed)g(with)630 3333 |
6e51e0d0 | 11535 | y(the)e Ft(.)f Fu(or)g Ft(source)f Fu(builtins)g(\014nishes)h |
fc527055 | 11536 | (executing.)630 3463 y(If)20 b(a)i Fr(sigsp)s(ec)27 b |
6e51e0d0 CR |
11537 | Fu(is)21 b Ft(ERR)p Fu(,)h(the)f(command)g Fr(arg)29 |
11538 | b Fu(is)21 b(executed)h(whenev)m(er)e(a)i(pip)s(eline)e(\(whic)m(h)h | |
fc527055 | 11539 | (ma)m(y)630 3573 y(consist)35 b(of)g(a)f(single)h(simple)g(command\),)h |
ad4aef08 | 11540 | (a)e(list,)j(or)d(a)h(comp)s(ound)e(command)h(returns)630 |
fc527055 | 11541 | 3682 y(a)41 b(non-zero)g(exit)h(status,)h(sub)5 b(ject)41 |
ad4aef08 | 11542 | b(to)g(the)g(follo)m(wing)h(conditions.)72 b(The)40 b |
fc527055 | 11543 | Ft(ERR)f Fu(trap)i(is)630 3792 y(not)c(executed)h(if)f(the)h(failed)f |
ad4aef08 | 11544 | (command)g(is)g(part)g(of)h(the)f(command)g(list)h(immediately)630 |
fc527055 | 11545 | 3902 y(follo)m(wing)30 b(an)e Ft(until)f Fu(or)i Ft(while)e |
6e51e0d0 | 11546 | Fu(k)m(eyw)m(ord,)i(part)g(of)f(the)h(test)g(follo)m(wing)h(the)f |
fc527055 | 11547 | Ft(if)f Fu(or)g Ft(elif)630 4011 y Fu(reserv)m(ed)45 |
ad4aef08 | 11548 | b(w)m(ords,)j(part)c(of)h(a)g(command)g(executed)g(in)g(a)g |
fc527055 | 11549 | Ft(&&)f Fu(or)h Ft(||)f Fu(list)h(except)h(the)630 4121 |
6e51e0d0 CR |
11550 | y(command)28 b(follo)m(wing)j(the)d(\014nal)h Ft(&&)f |
11551 | Fu(or)g Ft(||)p Fu(,)h(an)m(y)g(command)f(in)h(a)g(pip)s(eline)f(but)g | |
fc527055 | 11552 | (the)h(last,)630 4230 y(or)d(if)g(the)f(command's)h(return)f(status)h |
6e51e0d0 | 11553 | (is)g(b)s(eing)f(in)m(v)m(erted)i(using)e Ft(!)p Fu(.)39 |
fc527055 | 11554 | b(These)25 b(are)i(the)f(same)630 4340 y(conditions)31 |
6e51e0d0 | 11555 | b(ob)s(ey)m(ed)f(b)m(y)h(the)f Ft(errexit)f Fu(\()p Ft(-e)p |
fc527055 | 11556 | Fu(\))h(option.)630 4470 y(Signals)37 b(ignored)f(up)s(on)f(en)m(try)i |
6e51e0d0 | 11557 | (to)g(the)f(shell)h(cannot)g(b)s(e)f(trapp)s(ed)f(or)h(reset.)59 |
fc527055 | 11558 | b(T)-8 b(rapp)s(ed)630 4580 y(signals)28 b(that)f(are)h(not)f(b)s(eing) |
6e51e0d0 | 11559 | g(ignored)g(are)g(reset)h(to)g(their)f(original)h(v)-5 |
fc527055 CR |
11560 | b(alues)28 b(in)e(a)i(subshell)630 4689 y(or)i(subshell)g(en)m |
11561 | (vironmen)m(t)h(when)e(one)i(is)f(created.)630 4819 y(The)g(return)f | |
6e51e0d0 CR |
11562 | (status)i(is)f(zero)h(unless)f(a)h Fr(sigsp)s(ec)36 b |
11563 | Fu(do)s(es)30 b(not)h(sp)s(ecify)f(a)g(v)-5 b(alid)31 | |
fc527055 CR |
11564 | b(signal.)150 4970 y Ft(umask)870 5100 y(umask)46 b([-p])h([-S])g([)p |
11565 | Fj(mode)p Ft(])630 5230 y Fu(Set)30 b(the)f(shell)h(pro)s(cess's)f | |
6e51e0d0 CR |
11566 | (\014le)h(creation)g(mask)g(to)g Fr(mo)s(de)p Fu(.)40 |
11567 | b(If)29 b Fr(mo)s(de)34 b Fu(b)s(egins)29 b(with)g(a)h(digit,)630 | |
fc527055 | 11568 | 5340 y(it)e(is)f(in)m(terpreted)g(as)g(an)g(o)s(ctal)i(n)m(um)m(b)s |
6932f7f5 | 11569 | (er;)e(if)g(not,)h(it)g(is)f(in)m(terpreted)g(as)g(a)h(sym)m(b)s(olic)f |
fc527055 | 11570 | (mo)s(de)p eop end |
1101193a | 11571 | %%Page: 48 54 |
6e51e0d0 | 11572 | TeXDict begin 48 53 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
fc527055 CR |
11573 | b(Shell)30 b(Builtin)h(Commands)2069 b(48)630 299 y(mask)29 |
11574 | b(similar)g(to)g(that)h(accepted)g(b)m(y)f(the)g Ft(chmod)e | |
11575 | Fu(command.)40 b(If)28 b Fr(mo)s(de)34 b Fu(is)28 b(omitted,)j(the)630 | |
11576 | 408 y(curren)m(t)39 b(v)-5 b(alue)40 b(of)f(the)g(mask)g(is)h(prin)m | |
11577 | (ted.)66 b(If)39 b(the)g Ft(-S)g Fu(option)g(is)h(supplied)d(without)j | |
11578 | (a)630 518 y Fr(mo)s(de)d Fu(argumen)m(t,)d(the)e(mask)g(is)h(prin)m | |
11579 | (ted)f(in)g(a)g(sym)m(b)s(olic)h(format.)47 b(If)32 b(the)g | |
11580 | Ft(-p)g Fu(option)h(is)630 628 y(supplied,)f(and)f Fr(mo)s(de)37 | |
11581 | b Fu(is)32 b(omitted,)i(the)f(output)f(is)g(in)g(a)g(form)g(that)h(ma)m | |
11582 | (y)g(b)s(e)e(reused)h(as)630 737 y(input.)62 b(The)38 | |
11583 | b(return)f(status)h(is)g(zero)g(if)g(the)g(mo)s(de)g(is)g(successfully) | |
11584 | g(c)m(hanged)g(or)g(if)g(no)630 847 y Fr(mo)s(de)d Fu(argumen)m(t)c(is) | |
11585 | f(supplied,)g(and)f(non-zero)i(otherwise.)630 977 y(Note)38 | |
11586 | b(that)e(when)g(the)g(mo)s(de)g(is)g(in)m(terpreted)h(as)f(an)g(o)s | |
11587 | (ctal)i(n)m(um)m(b)s(er,)e(eac)m(h)i(n)m(um)m(b)s(er)d(of)630 | |
967625cd | 11588 | 1086 y(the)f(umask)g(is)h(subtracted)f(from)f Ft(7)p |
fc527055 | 11589 | Fu(.)53 b(Th)m(us,)34 b(a)h(umask)e(of)i Ft(022)e Fu(results)h(in)g(p)s |
967625cd CR |
11590 | (ermissions)630 1196 y(of)d Ft(755)p Fu(.)150 1347 y |
11591 | Ft(unset)870 1477 y(unset)46 b([-fnv])g([)p Fj(name)p | |
11592 | Ft(])630 1607 y Fu(Remo)m(v)m(e)36 b(eac)m(h)f(v)-5 b(ariable)35 | |
fc527055 | 11593 | b(or)f(function)f Fr(name)p Fu(.)52 b(If)33 b(the)i Ft(-v)e |
967625cd | 11594 | Fu(option)h(is)g(giv)m(en,)j(eac)m(h)e Fr(name)630 1716 |
fc527055 CR |
11595 | y Fu(refers)24 b(to)h(a)g(shell)f(v)-5 b(ariable)25 b(and)f(that)h(v)-5 |
11596 | b(ariable)25 b(is)f(rem)m(v)m(o)m(v)m(ed.)41 b(If)23 | |
967625cd | 11597 | b(the)i Ft(-f)f Fu(option)g(is)h(giv)m(en,)630 1826 y(the)37 |
fc527055 CR |
11598 | b Fr(name)5 b Fu(s)37 b(refer)f(to)i(shell)f(functions,)h(and)e(the)h |
11599 | (function)g(de\014nition)f(is)h(remo)m(v)m(ed.)61 b(If)630 | |
967625cd | 11600 | 1936 y(the)34 b Ft(-n)e Fu(option)i(is)g(supplied,)f(and)g |
6e51e0d0 | 11601 | Fr(name)38 b Fu(is)c(a)f(v)-5 b(ariable)34 b(with)g(the)f |
967625cd | 11602 | Fr(nameref)51 b Fu(attribute,)630 2045 y Fr(name)42 b |
6e51e0d0 CR |
11603 | Fu(will)37 b(b)s(e)f(unset)g(rather)g(than)h(the)g(v)-5 |
11604 | b(ariable)37 b(it)g(references.)60 b Ft(-n)36 b Fu(has)g(no)h(e\013ect) | |
967625cd | 11605 | h(if)630 2155 y(the)h Ft(-f)g Fu(option)g(is)h(supplied.)65 |
6e51e0d0 | 11606 | b(If)39 b(no)g(options)h(are)f(supplied,)h(eac)m(h)h |
967625cd | 11607 | Fr(name)j Fu(refers)39 b(to)h(a)630 2264 y(v)-5 b(ariable;)37 |
6e51e0d0 | 11608 | b(if)d(there)g(is)g(no)g(v)-5 b(ariable)34 b(b)m(y)g(that)h(name,)g(an) |
967625cd | 11609 | m(y)f(function)g(with)f(that)i(name)f(is)630 2374 y(unset.)46 |
6e51e0d0 | 11610 | b(Readonly)33 b(v)-5 b(ariables)33 b(and)e(functions)h(ma)m(y)h(not)g |
967625cd | 11611 | (b)s(e)e(unset.)47 b(The)31 b(return)h(status)630 2483 |
6e51e0d0 | 11612 | y(is)e(zero)i(unless)d(a)i Fr(name)36 b Fu(is)30 b(readonly)-8 |
967625cd CR |
11613 | b(.)150 2715 y Fs(4.2)68 b(Bash)45 b(Builtin)g(Commands)150 |
11614 | 2875 y Fu(This)c(section)h(describ)s(es)f(builtin)f(commands)h(whic)m | |
6e51e0d0 | 11615 | (h)g(are)h(unique)e(to)j(or)e(ha)m(v)m(e)h(b)s(een)f(extended)g(in)150 |
967625cd CR |
11616 | 2984 y(Bash.)g(Some)30 b(of)h(these)g(commands)f(are)g(sp)s(eci\014ed)g |
11617 | (in)g(the)h Fm(posix)e Fu(standard.)150 3135 y Ft(alias)870 | |
11618 | 3265 y(alias)46 b([-p])h([)p Fj(name)p Ft([=)p Fj(value)p | |
11619 | Ft(])d(...)o(])630 3395 y Fu(Without)26 b(argumen)m(ts)f(or)g(with)f | |
6e51e0d0 | 11620 | (the)h Ft(-p)g Fu(option,)h Ft(alias)e Fu(prin)m(ts)g(the)h(list)h(of)f |
967625cd | 11621 | (aliases)h(on)f(the)630 3505 y(standard)g(output)g(in)g(a)h(form)f |
6e51e0d0 | 11622 | (that)h(allo)m(ws)h(them)e(to)h(b)s(e)f(reused)g(as)g(input.)39 |
967625cd | 11623 | b(If)25 b(argumen)m(ts)630 3614 y(are)j(supplied,)e(an)i(alias)g(is)f |
6e51e0d0 CR |
11624 | (de\014ned)f(for)h(eac)m(h)h Fr(name)33 b Fu(whose)27 |
11625 | b Fr(v)-5 b(alue)33 b Fu(is)27 b(giv)m(en.)41 b(If)26 | |
967625cd | 11626 | b(no)h Fr(v)-5 b(alue)630 3724 y Fu(is)37 b(giv)m(en,)j(the)d(name)g |
6e51e0d0 | 11627 | (and)g(v)-5 b(alue)37 b(of)h(the)f(alias)h(is)f(prin)m(ted.)61 |
967625cd CR |
11628 | b(Aliases)38 b(are)f(describ)s(ed)f(in)630 3833 y(Section)31 |
11629 | b(6.6)h([Aliases],)g(page)f(89.)150 3984 y Ft(bind)870 | |
11630 | 4114 y(bind)47 b([-m)g Fj(keymap)p Ft(])e([-lpsvPSVX])870 | |
11631 | 4224 y(bind)i([-m)g Fj(keymap)p Ft(])e([-q)i Fj(function)p | |
6e51e0d0 | 11632 | Ft(])f([-u)g Fj(function)p Ft(])g([-r)h Fj(keyseq)p Ft(])870 |
fc527055 | 11633 | 4333 y(bind)g([-m)g Fj(keymap)p Ft(])e(-f)j Fj(filename)870 |
967625cd | 11634 | 4443 y Ft(bind)f([-m)g Fj(keymap)p Ft(])e(-x)j Fj(keyseq:shell-command) |
fc527055 | 11635 | 870 4552 y Ft(bind)f([-m)g Fj(keymap)p Ft(])e Fj(keyseq:function-name) |
967625cd | 11636 | 870 4662 y Ft(bind)i([-m)g Fj(keymap)p Ft(])e Fj |
fc527055 | 11637 | (keyseq:readline-command)630 4792 y Fu(Displa)m(y)22 |
9f178efb | 11638 | b(curren)m(t)f(Readline)h(\(see)f(Chapter)g(8)g([Command)f(Line)h |
900a813b | 11639 | (Editing],)j(page)e(103\))g(k)m(ey)630 4902 y(and)36 |
9f178efb | 11640 | b(function)g(bindings,)i(bind)d(a)i(k)m(ey)g(sequence)g(to)h(a)f |
fc527055 | 11641 | (Readline)g(function)f(or)h(macro,)630 5011 y(or)44 b(set)h(a)g |
9f178efb | 11642 | (Readline)f(v)-5 b(ariable.)83 b(Eac)m(h)45 b(non-option)g(argumen)m(t) |
fc527055 | 11643 | f(is)g(a)h(command)f(as)g(it)630 5121 y(w)m(ould)e(app)s(ear)f(in)h(a)h |
9f178efb | 11644 | (Readline)g(initialization)i(\014le)d(\(see)h(Section)g(8.3)g |
900a813b | 11645 | ([Readline)g(Init)630 5230 y(File],)c(page)d(106\),)j(but)c(eac)m(h)h |
9f178efb | 11646 | (binding)f(or)g(command)h(m)m(ust)f(b)s(e)g(passed)g(as)h(a)g(separate) |
fc527055 CR |
11647 | 630 5340 y(argumen)m(t;)31 b(e.g.,)h(`)p Ft |
11648 | ("\\C-x\\C-r":re-read-init-f)o(ile)p Fu('.)p eop end | |
1101193a | 11649 | %%Page: 49 55 |
6e51e0d0 | 11650 | TeXDict begin 49 54 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
fc527055 CR |
11651 | b(Shell)30 b(Builtin)h(Commands)2069 b(49)630 299 y(Options,)30 |
11652 | b(if)h(supplied,)e(ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 | |
11653 | 454 y Ft(-m)e Fj(keymap)66 b Fu(Use)54 b Fr(k)m(eymap)j | |
11654 | Fu(as)d(the)g(k)m(eymap)g(to)h(b)s(e)e(a\013ected)i(b)m(y)f(the)g | |
11655 | (subsequen)m(t)1110 563 y(bindings.)46 b(Acceptable)34 | |
11656 | b Fr(k)m(eymap)i Fu(names)c(are)h Ft(emacs)p Fu(,)f Ft(emacs-standard)p | |
11657 | Fu(,)1110 673 y Ft(emacs-meta)p Fu(,)99 b Ft(emacs-ctlx)p | |
11658 | Fu(,)f Ft(vi)p Fu(,)j Ft(vi-move)p Fu(,)f Ft(vi-command)p | |
037a8b7f CR |
11659 | Fu(,)f(and)1110 782 y Ft(vi-insert)p Fu(.)81 b Ft(vi)44 |
11660 | b Fu(is)h(equiv)-5 b(alen)m(t)46 b(to)g Ft(vi-command)c | |
11661 | Fu(\()p Ft(vi-move)h Fu(is)i(also)h(a)1110 892 y(synon)m(ym\);)30 | |
11662 | b Ft(emacs)f Fu(is)i(equiv)-5 b(alen)m(t)32 b(to)f Ft(emacs-standard)p | |
11663 | Fu(.)630 1047 y Ft(-l)384 b Fu(List)31 b(the)f(names)g(of)h(all)g | |
11664 | (Readline)g(functions.)630 1201 y Ft(-p)384 b Fu(Displa)m(y)34 | |
11665 | b(Readline)f(function)g(names)g(and)f(bindings)f(in)i(suc)m(h)f(a)i(w)m | |
11666 | (a)m(y)f(that)1110 1311 y(they)e(can)f(b)s(e)g(used)g(as)g(input)g(or)g | |
11667 | (in)g(a)h(Readline)g(initialization)i(\014le.)630 1466 | |
11668 | y Ft(-P)384 b Fu(List)31 b(curren)m(t)f(Readline)h(function)f(names)g | |
11669 | (and)g(bindings.)630 1620 y Ft(-v)384 b Fu(Displa)m(y)25 | |
11670 | b(Readline)f(v)-5 b(ariable)25 b(names)f(and)f(v)-5 b(alues)24 | |
11671 | b(in)g(suc)m(h)f(a)i(w)m(a)m(y)f(that)h(they)1110 1730 | |
11672 | y(can)31 b(b)s(e)e(used)h(as)h(input)e(or)h(in)g(a)h(Readline)g | |
11673 | (initialization)j(\014le.)630 1885 y Ft(-V)384 b Fu(List)31 | |
11674 | b(curren)m(t)f(Readline)h(v)-5 b(ariable)31 b(names)f(and)g(v)-5 | |
11675 | b(alues.)630 2039 y Ft(-s)384 b Fu(Displa)m(y)39 b(Readline)f(k)m(ey)g | |
ad4aef08 | 11676 | (sequences)f(b)s(ound)f(to)i(macros)g(and)f(the)g(strings)1110 |
037a8b7f CR |
11677 | 2149 y(they)d(output)f(in)h(suc)m(h)f(a)h(w)m(a)m(y)h(that)f(they)g |
11678 | (can)g(b)s(e)f(used)g(as)h(input)e(or)i(in)g(a)1110 2259 | |
11679 | y(Readline)d(initialization)i(\014le.)630 2413 y Ft(-S)384 | |
11680 | b Fu(Displa)m(y)39 b(Readline)f(k)m(ey)g(sequences)f(b)s(ound)f(to)i | |
11681 | (macros)g(and)f(the)g(strings)1110 2523 y(they)31 b(output.)630 | |
11682 | 2678 y Ft(-f)f Fj(filename)1110 2787 y Fu(Read)h(k)m(ey)g(bindings)e | |
11683 | (from)h Fr(\014lename)p Fu(.)630 2942 y Ft(-q)g Fj(function)1110 | |
11684 | 3051 y Fu(Query)g(ab)s(out)g(whic)m(h)g(k)m(eys)h(in)m(v)m(ok)m(e)h | |
11685 | (the)f(named)f Fr(function)p Fu(.)630 3206 y Ft(-u)g | |
11686 | Fj(function)1110 3316 y Fu(Un)m(bind)f(all)i(k)m(eys)g(b)s(ound)e(to)i | |
11687 | (the)f(named)g Fr(function)p Fu(.)630 3471 y Ft(-r)g | |
11688 | Fj(keyseq)66 b Fu(Remo)m(v)m(e)32 b(an)m(y)f(curren)m(t)f(binding)f | |
11689 | (for)h Fr(k)m(eyseq)p Fu(.)630 3625 y Ft(-x)g Fj(keyseq:shell-command) | |
11690 | 1110 3735 y Fu(Cause)35 b Fr(shell-command)k Fu(to)d(b)s(e)f(executed)h | |
6e51e0d0 | 11691 | (whenev)m(er)f Fr(k)m(eyseq)j Fu(is)d(en)m(tered.)1110 |
fc527055 CR |
11692 | 3844 y(When)46 b Fr(shell-command)k Fu(is)c(executed,)51 |
11693 | b(the)46 b(shell)g(sets)g(the)g Ft(READLINE_)1110 3954 | |
6e51e0d0 | 11694 | y(LINE)37 b Fu(v)-5 b(ariable)38 b(to)g(the)g(con)m(ten)m(ts)i(of)e |
fc527055 | 11695 | (the)g(Readline)g(line)g(bu\013er)f(and)g(the)1110 4064 |
6e51e0d0 | 11696 | y Ft(READLINE_POINT)e Fu(v)-5 b(ariable)39 b(to)h(the)e(curren)m(t)h |
fc527055 | 11697 | (lo)s(cation)h(of)f(the)g(insertion)1110 4173 y(p)s(oin)m(t.)59 |
6e51e0d0 | 11698 | b(If)37 b(the)f(executed)i(command)e(c)m(hanges)i(the)f(v)-5 |
fc527055 | 11699 | b(alue)37 b(of)f Ft(READLINE_)1110 4283 y(LINE)29 b Fu(or)h |
6e51e0d0 | 11700 | Ft(READLINE_POINT)p Fu(,)c(those)31 b(new)e(v)-5 b(alues)31 |
fc527055 CR |
11701 | b(will)f(b)s(e)f(re\015ected)i(in)f(the)1110 4392 y(editing)h(state.) |
11702 | 630 4547 y Ft(-X)384 b Fu(List)27 b(all)i(k)m(ey)f(sequences)f(b)s | |
6e51e0d0 | 11703 | (ound)e(to)j(shell)g(commands)e(and)h(the)g(asso)s(ciated)1110 |
fc527055 CR |
11704 | 4657 y(commands)j(in)g(a)h(format)g(that)f(can)h(b)s(e)f(reused)f(as)i |
11705 | (input.)630 4811 y(The)26 b(return)f(status)i(is)f(zero)i(unless)d(an)i | |
6e51e0d0 | 11706 | (in)m(v)-5 b(alid)27 b(option)g(is)f(supplied)f(or)i(an)f(error)g(o)s |
fc527055 CR |
11707 | (ccurs.)150 4966 y Ft(builtin)870 5098 y(builtin)46 b([)p |
11708 | Fj(shell-builtin)e Ft([)p Fj(args)p Ft(]])630 5230 y | |
6e51e0d0 CR |
11709 | Fu(Run)35 b(a)i(shell)f(builtin,)i(passing)e(it)h Fr(args)p |
11710 | Fu(,)h(and)e(return)f(its)i(exit)g(status.)59 b(This)35 | |
fc527055 CR |
11711 | b(is)i(useful)630 5340 y(when)29 b(de\014ning)h(a)g(shell)h(function)f |
11712 | (with)g(the)g(same)h(name)f(as)h(a)g(shell)f(builtin,)g(retaining)p | |
11713 | eop end | |
6e51e0d0 CR |
11714 | %%Page: 50 56 |
11715 | TeXDict begin 50 55 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
fc527055 CR |
11716 | b(Shell)30 b(Builtin)h(Commands)2069 b(50)630 299 y(the)34 |
11717 | b(functionalit)m(y)h(of)f(the)f(builtin)g(within)g(the)h(function.)50 | |
11718 | b(The)33 b(return)g(status)h(is)f(non-)630 408 y(zero)e(if)g | |
11719 | Fr(shell-builtin)f Fu(is)g(not)h(a)g(shell)f(builtin)g(command.)150 | |
11720 | 579 y Ft(caller)870 719 y(caller)46 b([)p Fj(expr)p Ft(])630 | |
11721 | 859 y Fu(Returns)34 b(the)g(con)m(text)j(of)e(an)m(y)g(activ)m(e)i | |
11722 | (subroutine)c(call)j(\(a)f(shell)g(function)f(or)h(a)g(script)630 | |
11723 | 969 y(executed)c(with)f(the)h Ft(.)f Fu(or)g Ft(source)f | |
11724 | Fu(builtins\).)630 1109 y(Without)45 b Fr(expr)p Fu(,)j | |
11725 | Ft(caller)43 b Fu(displa)m(ys)i(the)f(line)h(n)m(um)m(b)s(er)f(and)g | |
11726 | (source)g(\014lename)h(of)g(the)630 1218 y(curren)m(t)35 | |
11727 | b(subroutine)g(call.)58 b(If)35 b(a)h(non-negativ)m(e)i(in)m(teger)f | |
11728 | (is)f(supplied)e(as)i Fr(expr)p Fu(,)h Ft(caller)630 | |
11729 | 1328 y Fu(displa)m(ys)k(the)f(line)h(n)m(um)m(b)s(er,)h(subroutine)d | |
6e51e0d0 | 11730 | (name,)44 b(and)c(source)g(\014le)h(corresp)s(onding)e(to)630 |
fc527055 | 11731 | 1437 y(that)c(p)s(osition)g(in)f(the)h(curren)m(t)f(execution)i(call)g |
6e51e0d0 | 11732 | (stac)m(k.)54 b(This)34 b(extra)h(information)g(ma)m(y)630 |
fc527055 | 11733 | 1547 y(b)s(e)30 b(used,)g(for)g(example,)h(to)g(prin)m(t)f(a)h(stac)m |
d76edd30 | 11734 | (k)h(trace.)42 b(The)29 b(curren)m(t)i(frame)f(is)g(frame)h(0.)630 |
fc527055 | 11735 | 1687 y(The)d(return)g(v)-5 b(alue)29 b(is)g(0)g(unless)f(the)h(shell)g |
6e51e0d0 | 11736 | (is)g(not)g(executing)h(a)f(subroutine)e(call)j(or)f |
fc527055 | 11737 | Fr(expr)630 1797 y Fu(do)s(es)h(not)h(corresp)s(ond)e(to)i(a)g(v)-5 |
37c41ab1 | 11738 | b(alid)30 b(p)s(osition)h(in)f(the)g(call)i(stac)m(k.)150 |
fc527055 CR |
11739 | 1967 y Ft(command)870 2107 y(command)46 b([-pVv])g Fj(command)g |
11740 | Ft([)p Fj(arguments)f Ft(...)o(])630 2247 y Fu(Runs)32 | |
6e51e0d0 | 11741 | b Fr(command)k Fu(with)d Fr(argumen)m(ts)k Fu(ignoring)c(an)m(y)g |
fc527055 | 11742 | (shell)h(function)e(named)h Fr(command)p Fu(.)630 2357 |
37c41ab1 | 11743 | y(Only)39 b(shell)i(builtin)e(commands)h(or)g(commands)f(found)g(b)m(y) |
fc527055 | 11744 | h(searc)m(hing)h(the)f Ft(PATH)f Fu(are)630 2466 y(executed.)59 |
6e51e0d0 CR |
11745 | b(If)36 b(there)h(is)f(a)h(shell)f(function)g(named)g |
11746 | Ft(ls)p Fu(,)h(running)e(`)p Ft(command)29 b(ls)p Fu(')35 | |
fc527055 | 11747 | b(within)630 2576 y(the)c(function)f(will)h(execute)g(the)g(external)g |
6e51e0d0 | 11748 | (command)g Ft(ls)f Fu(instead)g(of)h(calling)h(the)f(func-)630 |
fc527055 | 11749 | 2685 y(tion)36 b(recursiv)m(ely)-8 b(.)56 b(The)34 b |
6e51e0d0 | 11750 | Ft(-p)h Fu(option)g(means)g(to)h(use)f(a)g(default)h(v)-5 |
fc527055 | 11751 | b(alue)35 b(for)g Ft(PATH)f Fu(that)i(is)630 2795 y(guaran)m(teed)f(to) |
6e51e0d0 | 11752 | f(\014nd)e(all)j(of)f(the)g(standard)f(utilities.)52 |
fc527055 | 11753 | b(The)33 b(return)g(status)h(in)f(this)h(case)630 2905 |
6e51e0d0 | 11754 | y(is)29 b(127)g(if)g Fr(command)j Fu(cannot)d(b)s(e)e(found)h(or)g(an)g |
45c0f7f8 | 11755 | (error)h(o)s(ccurred,)f(and)g(the)h(exit)g(status)g(of)630 |
fc527055 | 11756 | 3014 y Fr(command)34 b Fu(otherwise.)630 3154 y(If)e(either)h(the)f |
6e51e0d0 | 11757 | Ft(-V)g Fu(or)g Ft(-v)g Fu(option)h(is)f(supplied,)g(a)h(description)f |
fc527055 | 11758 | (of)h Fr(command)j Fu(is)c(prin)m(ted.)630 3264 y(The)f |
6e51e0d0 | 11759 | Ft(-v)h Fu(option)g(causes)g(a)g(single)h(w)m(ord)f(indicating)g(the)g |
fc527055 | 11760 | (command)g(or)g(\014le)g(name)g(used)630 3373 y(to)40 |
6e51e0d0 CR |
11761 | b(in)m(v)m(ok)m(e)h Fr(command)h Fu(to)e(b)s(e)e(displa)m(y)m(ed;)44 |
11762 | b(the)39 b Ft(-V)f Fu(option)i(pro)s(duces)d(a)j(more)f(v)m(erb)s(ose) | |
fc527055 | 11763 | 630 3483 y(description.)61 b(In)36 b(this)h(case,)j(the)e(return)e |
6e51e0d0 | 11764 | (status)h(is)g(zero)h(if)f Fr(command)k Fu(is)c(found,)h(and)630 |
fc527055 CR |
11765 | 3593 y(non-zero)31 b(if)f(not.)150 3763 y Ft(declare)870 |
11766 | 3903 y(declare)46 b([-aAfFgilnrtux])d([-p])k([)p Fj(name)p | |
11767 | Ft([=)p Fj(value)p Ft(])d(...)o(])630 4043 y Fu(Declare)29 | |
54a1fa7c | 11768 | b(v)-5 b(ariables)28 b(and)e(giv)m(e)j(them)e(attributes.)40 |
6e51e0d0 | 11769 | b(If)27 b(no)g Fr(name)5 b Fu(s)27 b(are)h(giv)m(en,)h(then)e(displa)m |
fc527055 CR |
11770 | (y)630 4153 y(the)k(v)-5 b(alues)30 b(of)h(v)-5 b(ariables)31 |
11771 | b(instead.)630 4293 y(The)k Ft(-p)f Fu(option)i(will)g(displa)m(y)f | |
6e51e0d0 | 11772 | (the)h(attributes)g(and)e(v)-5 b(alues)36 b(of)f(eac)m(h)i |
fc527055 | 11773 | Fr(name)p Fu(.)55 b(When)36 b Ft(-p)630 4402 y Fu(is)i(used)g(with)g |
6e51e0d0 | 11774 | Fr(name)43 b Fu(argumen)m(ts,)e(additional)e(options,)i(other)d(than)g |
fc527055 CR |
11775 | Ft(-f)g Fu(and)g Ft(-F)p Fu(,)i(are)630 4512 y(ignored.)630 |
11776 | 4652 y(When)g Ft(-p)g Fu(is)g(supplied)f(without)i Fr(name)k | |
6e51e0d0 | 11777 | Fu(argumen)m(ts,)f Ft(declare)38 b Fu(will)j(displa)m(y)f(the)h(at-)630 |
fc527055 | 11778 | 4762 y(tributes)31 b(and)f(v)-5 b(alues)31 b(of)g(all)h(v)-5 |
54a1fa7c | 11779 | b(ariables)31 b(ha)m(ving)h(the)f(attributes)g(sp)s(eci\014ed)f(b)m(y)h |
fc527055 | 11780 | (the)g(addi-)630 4871 y(tional)k(options.)52 b(If)34 |
6e51e0d0 | 11781 | b(no)g(other)g(options)g(are)g(supplied)f(with)h Ft(-p)p |
fc527055 | 11782 | Fu(,)g Ft(declare)e Fu(will)j(displa)m(y)630 4981 y(the)e(attributes)h |
6e51e0d0 CR |
11783 | (and)e(v)-5 b(alues)33 b(of)g(all)h(shell)f(v)-5 b(ariables.)50 |
11784 | b(The)32 b Ft(-f)g Fu(option)i(will)f(restrict)h(the)630 | |
fc527055 | 11785 | 5090 y(displa)m(y)d(to)g(shell)f(functions.)630 5230 |
6e51e0d0 CR |
11786 | y(The)41 b Ft(-F)f Fu(option)i(inhibits)e(the)i(displa)m(y)f(of)g |
11787 | (function)g(de\014nitions;)47 b(only)41 b(the)g(function)630 | |
fc527055 | 11788 | 5340 y(name)30 b(and)f(attributes)i(are)f(prin)m(ted.)40 |
6e51e0d0 | 11789 | b(If)30 b(the)g Ft(extdebug)e Fu(shell)i(option)g(is)g(enabled)g(using) |
fc527055 | 11790 | p eop end |
1101193a | 11791 | %%Page: 51 57 |
6e51e0d0 | 11792 | TeXDict begin 51 56 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
fc527055 CR |
11793 | b(Shell)30 b(Builtin)h(Commands)2069 b(51)630 299 y Ft(shopt)24 |
11794 | b Fu(\(see)i(Section)g(4.3.2)i([The)d(Shopt)f(Builtin],)k(page)e(63\),) | |
11795 | i(the)d(source)h(\014le)f(name)h(and)630 408 y(line)31 | |
d7935593 CR |
11796 | b(n)m(um)m(b)s(er)e(where)h(eac)m(h)h Fr(name)36 b Fu(is)30 |
11797 | b(de\014ned)f(are)i(displa)m(y)m(ed)g(as)g(w)m(ell.)41 | |
11798 | b Ft(-F)30 b Fu(implies)h Ft(-f)p Fu(.)630 543 y(The)36 | |
11799 | b Ft(-g)g Fu(option)h(forces)g(v)-5 b(ariables)37 b(to)g(b)s(e)f | |
11800 | (created)i(or)e(mo)s(di\014ed)g(at)h(the)g(global)h(scop)s(e,)630 | |
11801 | 653 y(ev)m(en)g(when)e Ft(declare)f Fu(is)j(executed)g(in)f(a)g(shell)h | |
11802 | (function.)61 b(It)37 b(is)g(ignored)h(in)f(all)h(other)630 | |
11803 | 763 y(cases.)630 897 y(The)27 b(follo)m(wing)h(options)g(can)f(b)s(e)g | |
11804 | (used)f(to)i(restrict)g(output)e(to)i(v)-5 b(ariables)28 | |
11805 | b(with)f(the)g(sp)s(ec-)630 1007 y(i\014ed)j(attributes)h(or)f(to)h | |
11806 | (giv)m(e)h(v)-5 b(ariables)31 b(attributes:)630 1167 | |
11807 | y Ft(-a)384 b Fu(Eac)m(h)36 b Fr(name)k Fu(is)34 b(an)h(indexed)g(arra) | |
11808 | m(y)g(v)-5 b(ariable)36 b(\(see)f(Section)h(6.7)g([Arra)m(ys],)1110 | |
900a813b | 11809 | 1277 y(page)31 b(90\).)630 1437 y Ft(-A)384 b Fu(Eac)m(h)24 |
6e51e0d0 | 11810 | b Fr(name)k Fu(is)23 b(an)g(asso)s(ciativ)m(e)j(arra)m(y)e(v)-5 |
ad4aef08 | 11811 | b(ariable)24 b(\(see)g(Section)g(6.7)g([Arra)m(ys],)1110 |
900a813b | 11812 | 1547 y(page)31 b(90\).)630 1707 y Ft(-f)384 b Fu(Use)31 |
fc527055 | 11813 | b(function)f(names)g(only)-8 b(.)630 1867 y Ft(-i)384 |
6e51e0d0 | 11814 | b Fu(The)36 b(v)-5 b(ariable)37 b(is)f(to)h(b)s(e)f(treated)h(as)g(an)f |
09767ff0 | 11815 | (in)m(teger;)41 b(arithmetic)c(ev)-5 b(aluation)1110 |
900a813b | 11816 | 1976 y(\(see)29 b(Section)f(6.5)h([Shell)f(Arithmetic],)i(page)e(88\))h |
fc527055 CR |
11817 | (is)f(p)s(erformed)e(when)h(the)1110 2086 y(v)-5 b(ariable)31 |
11818 | b(is)g(assigned)f(a)h(v)-5 b(alue.)630 2246 y Ft(-l)384 | |
6e51e0d0 | 11819 | b Fu(When)26 b(the)g(v)-5 b(ariable)27 b(is)f(assigned)g(a)g(v)-5 |
8e1a6eaa | 11820 | b(alue,)28 b(all)f(upp)s(er-case)e(c)m(haracters)j(are)1110 |
fc527055 CR |
11821 | 2356 y(con)m(v)m(erted)k(to)f(lo)m(w)m(er-case.)43 b(The)30 |
11822 | b(upp)s(er-case)g(attribute)h(is)g(disabled.)630 2516 | |
6e51e0d0 CR |
11823 | y Ft(-n)384 b Fu(Giv)m(e)28 b(eac)m(h)g Fr(name)k Fu(the)27 |
11824 | b Fr(nameref)44 b Fu(attribute,)28 b(making)f(it)h(a)f(name)f | |
fc527055 CR |
11825 | (reference)1110 2626 y(to)41 b(another)g(v)-5 b(ariable.)72 |
11826 | b(That)40 b(other)h(v)-5 b(ariable)41 b(is)f(de\014ned)f(b)m(y)i(the)f | |
11827 | (v)-5 b(alue)1110 2735 y(of)36 b Fr(name)p Fu(.)56 b(All)36 | |
11828 | b(references,)h(assignmen)m(ts,)h(and)d(attribute)h(mo)s(di\014cations) | |
11829 | 1110 2845 y(to)30 b Fr(name)p Fu(,)f(except)h(for)f(c)m(hanging)h(the)f | |
11830 | Ft(-n)g Fu(attribute)h(itself,)g(are)f(p)s(erformed)1110 | |
11831 | 2954 y(on)g(the)h(v)-5 b(ariable)30 b(referenced)f(b)m(y)h | |
11832 | Fr(name)5 b Fu('s)29 b(v)-5 b(alue.)41 b(The)29 b(nameref)g(attribute) | |
11833 | 1110 3064 y(cannot)i(b)s(e)f(applied)g(to)h(arra)m(y)g(v)-5 | |
11834 | b(ariables.)630 3224 y Ft(-r)384 b Fu(Mak)m(e)25 b Fr(name)5 | |
11835 | b Fu(s)23 b(readonly)-8 b(.)39 b(These)24 b(names)f(cannot)h(then)f(b)s | |
11836 | (e)g(assigned)h(v)-5 b(alues)1110 3334 y(b)m(y)30 b(subsequen)m(t)g | |
11837 | (assignmen)m(t)h(statemen)m(ts)h(or)f(unset.)630 3494 | |
6e51e0d0 CR |
11838 | y Ft(-t)384 b Fu(Giv)m(e)33 b(eac)m(h)h Fr(name)j Fu(the)32 |
11839 | b Ft(trace)f Fu(attribute.)46 b(T)-8 b(raced)32 b(functions)g(inherit)g | |
fc527055 | 11840 | (the)1110 3603 y Ft(DEBUG)26 b Fu(and)h Ft(RETURN)f Fu(traps)h(from)g |
6e51e0d0 | 11841 | (the)h(calling)h(shell.)40 b(The)27 b(trace)i(attribute)1110 |
fc527055 CR |
11842 | 3713 y(has)h(no)g(sp)s(ecial)h(meaning)g(for)f(v)-5 b(ariables.)630 |
11843 | 3873 y Ft(-u)384 b Fu(When)28 b(the)h(v)-5 b(ariable)29 | |
6e51e0d0 | 11844 | b(is)f(assigned)h(a)f(v)-5 b(alue,)30 b(all)f(lo)m(w)m(er-case)i(c)m |
fc527055 | 11845 | (haracters)f(are)1110 3983 y(con)m(v)m(erted)i(to)f(upp)s(er-case.)40 |
6e51e0d0 | 11846 | b(The)30 b(lo)m(w)m(er-case)j(attribute)e(is)g(disabled.)630 |
fc527055 | 11847 | 4143 y Ft(-x)384 b Fu(Mark)30 b(eac)m(h)h Fr(name)k Fu(for)29 |
122f603c | 11848 | b(exp)s(ort)h(to)g(subsequen)m(t)f(commands)h(via)g(the)g(en)m(vi-)1110 |
fc527055 | 11849 | 4253 y(ronmen)m(t.)630 4413 y(Using)e(`)p Ft(+)p Fu(')h(instead)f(of)g |
6e51e0d0 | 11850 | (`)p Ft(-)p Fu(')g(turns)f(o\013)i(the)f(attribute)h(instead,)g(with)f |
fc527055 | 11851 | (the)g(exceptions)h(that)630 4522 y(`)p Ft(+a)p Fu(')h(ma)m(y)h(not)f |
45c0f7f8 | 11852 | (b)s(e)f(used)g(to)i(destro)m(y)g(an)f(arra)m(y)g(v)-5 |
6e51e0d0 | 11853 | b(ariable)31 b(and)f(`)p Ft(+r)p Fu(')g(will)g(not)g(remo)m(v)m(e)i |
fc527055 | 11854 | (the)630 4632 y(readonly)e(attribute.)41 b(When)30 b(used)f(in)g(a)h |
6e51e0d0 | 11855 | (function,)g Ft(declare)e Fu(mak)m(es)j(eac)m(h)f Fr(name)35 |
fc527055 | 11856 | b Fu(lo)s(cal,)630 4741 y(as)f(with)f(the)g Ft(local)f |
6e51e0d0 | 11857 | Fu(command,)i(unless)f(the)g Ft(-g)g Fu(option)h(is)f(used.)49 |
fc527055 | 11858 | b(If)33 b(a)h(v)-5 b(ariable)34 b(name)630 4851 y(is)c(follo)m(w)m(ed)i |
6e51e0d0 CR |
11859 | (b)m(y)f(=)p Fr(v)-5 b(alue)p Fu(,)30 b(the)h(v)-5 b(alue)31 |
11860 | b(of)f(the)h(v)-5 b(ariable)31 b(is)g(set)g(to)g Fr(v)-5 | |
fc527055 | 11861 | b(alue)p Fu(.)630 4986 y(When)41 b(using)g Ft(-a)g Fu(or)h |
15baad62 | 11862 | Ft(-A)e Fu(and)h(the)h(comp)s(ound)e(assignmen)m(t)i(syn)m(tax)g(to)g |
fc527055 | 11863 | (create)h(arra)m(y)630 5096 y(v)-5 b(ariables,)28 b(additional)f |
15baad62 | 11864 | (attributes)g(do)f(not)h(tak)m(e)h(e\013ect)g(un)m(til)e(subsequen)m(t) |
fc527055 | 11865 | g(assignmen)m(ts.)630 5230 y(The)35 b(return)f(status)i(is)g(zero)g |
15baad62 | 11866 | (unless)f(an)g(in)m(v)-5 b(alid)36 b(option)g(is)g(encoun)m(tered,)h |
fc527055 | 11867 | (an)f(attempt)630 5340 y(is)c(made)g(to)g(de\014ne)f(a)h(function)g |
15baad62 | 11868 | (using)f(`)p Ft(-f)f(foo=bar)p Fu(',)h(an)h(attempt)g(is)g(made)g(to)h |
fc527055 | 11869 | (assign)p eop end |
6e51e0d0 CR |
11870 | %%Page: 52 58 |
11871 | TeXDict begin 52 57 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
fc527055 CR |
11872 | b(Shell)30 b(Builtin)h(Commands)2069 b(52)630 299 y(a)42 |
11873 | b(v)-5 b(alue)43 b(to)g(a)f(readonly)g(v)-5 b(ariable,)47 | |
11874 | b(an)42 b(attempt)h(is)f(made)g(to)h(assign)f(a)h(v)-5 | |
11875 | b(alue)42 b(to)h(an)630 408 y(arra)m(y)30 b(v)-5 b(ariable)30 | |
11876 | b(without)g(using)e(the)i(comp)s(ound)e(assignmen)m(t)i(syn)m(tax)g | |
900a813b | 11877 | (\(see)h(Section)f(6.7)630 518 y([Arra)m(ys],)47 b(page)c(90\),)48 |
fc527055 CR |
11878 | b(one)43 b(of)g(the)g Fr(names)k Fu(is)c(not)g(a)g(v)-5 |
11879 | b(alid)43 b(shell)g(v)-5 b(ariable)44 b(name,)i(an)630 | |
11880 | 628 y(attempt)28 b(is)f(made)h(to)f(turn)f(o\013)i(readonly)f(status)g | |
15baad62 | 11881 | (for)g(a)h(readonly)f(v)-5 b(ariable,)29 b(an)e(attempt)630 |
fc527055 | 11882 | 737 y(is)h(made)h(to)g(turn)e(o\013)i(arra)m(y)f(status)h(for)f(an)g |
15baad62 | 11883 | (arra)m(y)h(v)-5 b(ariable,)30 b(or)e(an)g(attempt)i(is)e(made)g(to)630 |
fc527055 | 11884 | 847 y(displa)m(y)j(a)f(non-existen)m(t)i(function)e(with)g |
037a8b7f CR |
11885 | Ft(-f)p Fu(.)150 1005 y Ft(echo)870 1139 y(echo)47 b([-neE])f([)p |
11886 | Fj(arg)g Ft(...])630 1273 y Fu(Output)31 b(the)i Fr(arg)8 | |
15baad62 | 11887 | b Fu(s,)33 b(separated)g(b)m(y)g(spaces,)g(terminated)g(with)f(a)h |
037a8b7f | 11888 | (newline.)47 b(The)32 b(return)630 1383 y(status)f(is)f(0)h(unless)f(a) |
15baad62 | 11889 | h(write)g(error)f(o)s(ccurs.)41 b(If)30 b Ft(-n)g Fu(is)h(sp)s |
037a8b7f | 11890 | (eci\014ed,)f(the)h(trailing)g(newline)g(is)630 1492 |
15baad62 CR |
11891 | y(suppressed.)38 b(If)29 b(the)h Ft(-e)f Fu(option)h(is)f(giv)m(en,)i |
11892 | (in)m(terpretation)g(of)e(the)h(follo)m(wing)h(bac)m(kslash-)630 | |
037a8b7f | 11893 | 1602 y(escap)s(ed)43 b(c)m(haracters)h(is)e(enabled.)78 |
15baad62 | 11894 | b(The)42 b Ft(-E)g Fu(option)h(disables)g(the)g(in)m(terpretation)h(of) |
037a8b7f | 11895 | 630 1711 y(these)27 b(escap)s(e)g(c)m(haracters,)i(ev)m(en)e(on)g |
15baad62 | 11896 | (systems)f(where)g(they)h(are)g(in)m(terpreted)g(b)m(y)f(default.)630 |
037a8b7f | 11897 | 1821 y(The)32 b Ft(xpg_echo)f Fu(shell)i(option)g(ma)m(y)h(b)s(e)e |
1101193a | 11898 | (used)g(to)h(dynamically)h(determine)f(whether)f(or)630 |
037a8b7f | 11899 | 1931 y(not)h Ft(echo)f Fu(expands)g(these)h(escap)s(e)h(c)m(haracters)g |
6e51e0d0 | 11900 | (b)m(y)f(default.)48 b Ft(echo)32 b Fu(do)s(es)g(not)i(in)m(terpret)630 |
037a8b7f CR |
11901 | 2040 y Ft(--)c Fu(to)h(mean)f(the)h(end)f(of)g(options.)630 |
11902 | 2174 y Ft(echo)f Fu(in)m(terprets)i(the)f(follo)m(wing)i(escap)s(e)f | |
11903 | (sequences:)630 2332 y Ft(\\a)384 b Fu(alert)31 b(\(b)s(ell\))630 | |
11904 | 2491 y Ft(\\b)384 b Fu(bac)m(kspace)630 2649 y Ft(\\c)g | |
11905 | Fu(suppress)28 b(further)h(output)630 2807 y Ft(\\e)630 | |
11906 | 2917 y(\\E)384 b Fu(escap)s(e)630 3075 y Ft(\\f)g Fu(form)30 | |
11907 | b(feed)630 3233 y Ft(\\n)384 b Fu(new)30 b(line)630 3392 | |
11908 | y Ft(\\r)384 b Fu(carriage)32 b(return)630 3550 y Ft(\\t)384 | |
11909 | b Fu(horizon)m(tal)32 b(tab)630 3708 y Ft(\\v)384 b Fu(v)m(ertical)32 | |
11910 | b(tab)630 3867 y Ft(\\\\)384 b Fu(bac)m(kslash)630 4025 | |
6e51e0d0 | 11911 | y Ft(\\0)p Fj(nnn)240 b Fu(the)32 b(eigh)m(t-bit)i(c)m(haracter)g |
9f178efb | 11912 | (whose)e(v)-5 b(alue)33 b(is)f(the)g(o)s(ctal)i(v)-5 |
037a8b7f CR |
11913 | b(alue)32 b Fr(nnn)f Fu(\(zero)i(to)1110 4134 y(three)e(o)s(ctal)g |
11914 | (digits\))630 4293 y Ft(\\x)p Fj(HH)288 b Fu(the)38 b(eigh)m(t-bit)i(c) | |
6e51e0d0 | 11915 | m(haracter)g(whose)e(v)-5 b(alue)39 b(is)f(the)h(hexadecimal)g(v)-5 |
037a8b7f CR |
11916 | b(alue)39 b Fr(HH)1110 4402 y Fu(\(one)31 b(or)f(t)m(w)m(o)i(hex)e |
11917 | (digits\))630 4561 y Ft(\\u)p Fj(HHHH)192 b Fu(the)41 | |
45c0f7f8 | 11918 | b(Unico)s(de)g(\(ISO/IEC)f(10646\))j(c)m(haracter)g(whose)e(v)-5 |
037a8b7f | 11919 | b(alue)41 b(is)g(the)g(hex-)1110 4670 y(adecimal)32 b(v)-5 |
6e51e0d0 | 11920 | b(alue)31 b Fr(HHHH)41 b Fu(\(one)31 b(to)g(four)e(hex)h(digits\))630 |
037a8b7f | 11921 | 4829 y Ft(\\U)p Fj(HHHHHHHH)1110 4938 y Fu(the)41 b(Unico)s(de)g |
45c0f7f8 | 11922 | (\(ISO/IEC)f(10646\))j(c)m(haracter)g(whose)e(v)-5 b(alue)41 |
037a8b7f | 11923 | b(is)g(the)g(hex-)1110 5048 y(adecimal)32 b(v)-5 b(alue)31 |
6e51e0d0 | 11924 | b Fr(HHHHHHHH)41 b Fu(\(one)31 b(to)g(eigh)m(t)h(hex)e(digits\))150 |
037a8b7f CR |
11925 | 5206 y Ft(enable)870 5340 y(enable)46 b([-a])h([-dnps])f([-f)g |
11926 | Fj(filename)p Ft(])g([)p Fj(name)g Ft(...)o(])p eop end | |
15baad62 CR |
11927 | %%Page: 53 59 |
11928 | TeXDict begin 53 58 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
037a8b7f CR |
11929 | b(Shell)30 b(Builtin)h(Commands)2069 b(53)630 299 y(Enable)36 |
11930 | b(and)f(disable)h(builtin)g(shell)g(commands.)56 b(Disabling)37 | |
11931 | b(a)g(builtin)e(allo)m(ws)i(a)f(disk)630 408 y(command)e(whic)m(h)g | |
11932 | (has)g(the)g(same)h(name)f(as)h(a)f(shell)h(builtin)e(to)i(b)s(e)f | |
11933 | (executed)h(without)630 518 y(sp)s(ecifying)27 b(a)g(full)g(pathname,)g | |
11934 | (ev)m(en)h(though)f(the)g(shell)g(normally)g(searc)m(hes)h(for)f | |
11935 | (builtins)630 628 y(b)s(efore)35 b(disk)g(commands.)55 | |
11936 | b(If)35 b Ft(-n)g Fu(is)g(used,)h(the)g Fr(name)5 b Fu(s)35 | |
11937 | b(b)s(ecome)h(disabled.)55 b(Otherwise)630 737 y Fr(name)5 | |
11938 | b Fu(s)44 b(are)h(enabled.)82 b(F)-8 b(or)45 b(example,)k(to)c(use)f | |
11939 | (the)g Ft(test)f Fu(binary)h(found)f(via)h Ft($PATH)630 | |
11940 | 847 y Fu(instead)31 b(of)f(the)h(shell)f(builtin)g(v)m(ersion,)h(t)m | |
11941 | (yp)s(e)g(`)p Ft(enable)e(-n)h(test)p Fu('.)630 983 y(If)45 | |
11942 | b(the)i Ft(-p)e Fu(option)h(is)g(supplied,)j(or)d(no)g | |
11943 | Fr(name)51 b Fu(argumen)m(ts)46 b(app)s(ear,)k(a)c(list)h(of)f(shell) | |
11944 | 630 1092 y(builtins)37 b(is)h(prin)m(ted.)63 b(With)38 | |
6e51e0d0 | 11945 | b(no)f(other)h(argumen)m(ts,)j(the)d(list)g(consists)g(of)g(all)h |
037a8b7f | 11946 | (enabled)630 1202 y(shell)d(builtins.)57 b(The)35 b Ft(-a)h |
6e51e0d0 | 11947 | Fu(option)g(means)g(to)g(list)h(eac)m(h)g(builtin)f(with)f(an)h |
037a8b7f CR |
11948 | (indication)h(of)630 1311 y(whether)30 b(or)g(not)h(it)g(is)f(enabled.) |
11949 | 630 1447 y(The)22 b Ft(-f)f Fu(option)h(means)g(to)h(load)g(the)f(new)g | |
6e51e0d0 | 11950 | (builtin)f(command)h Fr(name)27 b Fu(from)22 b(shared)f(ob)5 |
037a8b7f | 11951 | b(ject)630 1557 y Fr(\014lename)p Fu(,)33 b(on)e(systems)h(that)h(supp) |
15baad62 | 11952 | s(ort)d(dynamic)i(loading.)46 b(The)31 b Ft(-d)g Fu(option)h(will)h |
037a8b7f CR |
11953 | (delete)630 1667 y(a)e(builtin)f(loaded)h(with)f Ft(-f)p |
11954 | Fu(.)630 1802 y(If)j(there)i(are)f(no)g(options,)h(a)f(list)h(of)f(the) | |
6e51e0d0 | 11955 | g(shell)g(builtins)g(is)g(displa)m(y)m(ed.)52 b(The)33 |
037a8b7f | 11956 | b Ft(-s)g Fu(option)630 1912 y(restricts)j Ft(enable)d |
6e51e0d0 CR |
11957 | Fu(to)j(the)f Fm(posix)f Fu(sp)s(ecial)i(builtins.)54 |
11958 | b(If)34 b Ft(-s)h Fu(is)g(used)f(with)g Ft(-f)p Fu(,)i(the)f(new)630 | |
037a8b7f | 11959 | 2022 y(builtin)30 b(b)s(ecomes)h(a)f(sp)s(ecial)h(builtin)f(\(see)i |
967625cd | 11960 | (Section)f(4.4)g([Sp)s(ecial)g(Builtins],)g(page)g(69\).)630 |
037a8b7f | 11961 | 2158 y(The)26 b(return)f(status)h(is)g(zero)h(unless)e(a)i |
6e51e0d0 | 11962 | Fr(name)k Fu(is)26 b(not)g(a)h(shell)f(builtin)g(or)g(there)g(is)g(an)g |
037a8b7f CR |
11963 | (error)630 2267 y(loading)31 b(a)g(new)f(builtin)g(from)g(a)g(shared)g |
11964 | (ob)5 b(ject.)150 2429 y Ft(help)870 2565 y(help)47 b([-dms])f([)p | |
11965 | Fj(pattern)p Ft(])630 2701 y Fu(Displa)m(y)40 b(helpful)e(information)h | |
6e51e0d0 | 11966 | (ab)s(out)g(builtin)f(commands.)66 b(If)38 b Fr(pattern)h |
037a8b7f | 11967 | Fu(is)g(sp)s(eci\014ed,)630 2811 y Ft(help)28 b Fu(giv)m(es)i(detailed) |
6e51e0d0 | 11968 | g(help)e(on)h(all)h(commands)e(matc)m(hing)i Fr(pattern)p |
037a8b7f CR |
11969 | Fu(,)g(otherwise)f(a)g(list)h(of)630 2920 y(the)h(builtins)e(is)i(prin) |
11970 | m(ted.)630 3056 y(Options,)f(if)h(supplied,)e(ha)m(v)m(e)i(the)g(follo) | |
11971 | m(wing)h(meanings:)630 3218 y Ft(-d)384 b Fu(Displa)m(y)32 | |
6e51e0d0 | 11972 | b(a)e(short)g(description)h(of)f(eac)m(h)i Fr(pattern)630 |
037a8b7f | 11973 | 3381 y Ft(-m)384 b Fu(Displa)m(y)32 b(the)e(description)g(of)h(eac)m(h) |
6e51e0d0 | 11974 | h Fr(pattern)e Fu(in)g(a)h(manpage-lik)m(e)h(format)630 |
037a8b7f CR |
11975 | 3543 y Ft(-s)384 b Fu(Displa)m(y)32 b(only)e(a)h(short)f(usage)h |
11976 | (synopsis)e(for)i(eac)m(h)g Fr(pattern)630 3705 y Fu(The)f(return)f | |
6e51e0d0 | 11977 | (status)i(is)f(zero)h(unless)f(no)g(command)h(matc)m(hes)g |
037a8b7f | 11978 | Fr(pattern)p Fu(.)150 3867 y Ft(let)870 4003 y(let)47 |
6e51e0d0 | 11979 | b Fj(expression)e Ft([)p Fj(expression)g Ft(...)o(])630 |
037a8b7f | 11980 | 4139 y Fu(The)c Ft(let)g Fu(builtin)g(allo)m(ws)i(arithmetic)f(to)h(b)s |
6e51e0d0 | 11981 | (e)d(p)s(erformed)g(on)i(shell)g(v)-5 b(ariables.)74 |
037a8b7f | 11982 | b(Eac)m(h)630 4248 y Fr(expression)31 b Fu(is)g(ev)-5 |
6e51e0d0 | 11983 | b(aluated)32 b(according)f(to)h(the)f(rules)g(giv)m(en)h(b)s(elo)m(w)f |
037a8b7f | 11984 | (in)f(Section)i(6.5)g([Shell)630 4358 y(Arithmetic],)51 |
900a813b | 11985 | b(page)46 b(88.)87 b(If)45 b(the)g(last)h Fr(expression)g |
6e51e0d0 | 11986 | Fu(ev)-5 b(aluates)47 b(to)f(0,)k Ft(let)44 b Fu(returns)g(1;)630 |
037a8b7f CR |
11987 | 4468 y(otherwise)31 b(0)g(is)f(returned.)150 4630 y Ft(local)870 |
11988 | 4766 y(local)46 b([)p Fj(option)p Ft(])g Fj(name)p Ft([=)p | |
11989 | Fj(value)p Ft(])e(...)630 4902 y Fu(F)-8 b(or)27 b(eac)m(h)g(argumen)m | |
6e51e0d0 CR |
11990 | (t,)g(a)f(lo)s(cal)h(v)-5 b(ariable)27 b(named)e Fr(name)31 |
11991 | b Fu(is)26 b(created,)i(and)d(assigned)h Fr(v)-5 b(alue)p | |
037a8b7f | 11992 | Fu(.)630 5011 y(The)37 b Fr(option)h Fu(can)f(b)s(e)g(an)m(y)h(of)f |
6e51e0d0 | 11993 | (the)h(options)g(accepted)g(b)m(y)g Ft(declare)p Fu(.)59 |
037a8b7f | 11994 | b Ft(local)36 b Fu(can)i(only)630 5121 y(b)s(e)j(used)h(within)f(a)i |
6e51e0d0 CR |
11995 | (function;)48 b(it)42 b(mak)m(es)h(the)f(v)-5 b(ariable)43 |
11996 | b Fr(name)48 b Fu(ha)m(v)m(e)43 b(a)f(visible)h(scop)s(e)630 | |
037a8b7f | 11997 | 5230 y(restricted)h(to)f(that)h(function)e(and)g(its)i(c)m(hildren.)78 |
8a0829e9 | 11998 | b(If)42 b Fr(name)48 b Fu(is)43 b(`)p Ft(-)p Fu(',)j(the)d(set)h(of)f |
037a8b7f CR |
11999 | (shell)630 5340 y(options)34 b(is)f(made)g(lo)s(cal)i(to)f(the)f |
12000 | (function)g(in)g(whic)m(h)g Ft(local)f Fu(is)h(in)m(v)m(ok)m(ed:)48 | |
12001 | b(shell)34 b(options)p eop end | |
ad4aef08 | 12002 | %%Page: 54 60 |
6e51e0d0 | 12003 | TeXDict begin 54 59 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
037a8b7f CR |
12004 | b(Shell)30 b(Builtin)h(Commands)2069 b(54)630 299 y(c)m(hanged)32 |
12005 | b(using)e(the)i Ft(set)e Fu(builtin)h(inside)g(the)g(function)g(are)g | |
12006 | (restored)h(to)g(their)f(original)630 408 y(v)-5 b(alues)25 | |
12007 | b(when)e(the)i(function)f(returns.)37 b(The)24 b(return)f(status)i(is)f | |
12008 | (zero)i(unless)d Ft(local)g Fu(is)i(used)630 518 y(outside)k(a)f | |
12009 | (function,)h(an)f(in)m(v)-5 b(alid)29 b Fr(name)k Fu(is)28 | |
12010 | b(supplied,)g(or)g Fr(name)34 b Fu(is)28 b(a)h(readonly)f(v)-5 | |
12011 | b(ariable.)150 681 y Ft(logout)870 817 y(logout)46 b([)p | |
12012 | Fj(n)p Ft(])630 953 y Fu(Exit)31 b(a)g(login)g(shell,)g(returning)e(a)i | |
12013 | (status)g(of)f Fr(n)g Fu(to)h(the)g(shell's)f(paren)m(t.)150 | |
12014 | 1116 y Ft(mapfile)870 1252 y(mapfile)46 b([-d)h Fj(delim)p | |
12015 | Ft(])f([-n)h Fj(count)p Ft(])f([-O)h Fj(origin)p Ft(])f([-s)g | |
12016 | Fj(count)p Ft(])h([-t])f([-u)h Fj(fd)p Ft(])1061 1362 | |
12017 | y([-C)g Fj(callback)p Ft(])e([-c)i Fj(quantum)p Ft(])f([)p | |
12018 | Fj(array)p Ft(])630 1498 y Fu(Read)38 b(lines)f(from)g(the)h(standard)e | |
12019 | (input)g(in)m(to)j(the)e(indexed)g(arra)m(y)h(v)-5 b(ariable)38 | |
12020 | b Fr(arra)m(y)p Fu(,)i(or)630 1607 y(from)28 b(\014le)h(descriptor)f | |
8a0829e9 CR |
12021 | Fr(fd)k Fu(if)c(the)h Ft(-u)f Fu(option)h(is)g(supplied.)39 |
12022 | b(The)28 b(v)-5 b(ariable)29 b Ft(MAPFILE)e Fu(is)i(the)630 | |
037a8b7f | 12023 | 1717 y(default)i Fr(arra)m(y)p Fu(.)41 b(Options,)30 |
8a0829e9 | 12024 | b(if)g(supplied,)g(ha)m(v)m(e)h(the)g(follo)m(wing)h(meanings:)630 |
037a8b7f | 12025 | 1880 y Ft(-d)384 b Fu(The)37 b(\014rst)g(c)m(haracter)i(of)f |
8a0829e9 | 12026 | Fr(delim)g Fu(is)f(used)g(to)h(terminate)h(eac)m(h)g(input)d(line,)1110 |
037a8b7f | 12027 | 1989 y(rather)30 b(than)g(newline.)630 2152 y Ft(-n)384 |
fc527055 CR |
12028 | b Fu(Cop)m(y)30 b(at)h(most)g Fr(coun)m(t)i Fu(lines.)41 |
12029 | b(If)30 b Fr(coun)m(t)j Fu(is)d(0,)h(all)h(lines)e(are)h(copied.)630 | |
037a8b7f | 12030 | 2315 y Ft(-O)384 b Fu(Begin)31 b(assigning)g(to)g Fr(arra)m(y)39 |
fc527055 | 12031 | b Fu(at)31 b(index)f Fr(origin)p Fu(.)41 b(The)30 b(default)h(index)f |
037a8b7f CR |
12032 | (is)g(0.)630 2477 y Ft(-s)384 b Fu(Discard)31 b(the)f(\014rst)g |
12033 | Fr(coun)m(t)j Fu(lines)e(read.)630 2640 y Ft(-t)384 b | |
0385211b | 12034 | Fu(Remo)m(v)m(e)32 b(a)f(trailing)g Fr(delim)g Fu(\(default)g |
037a8b7f | 12035 | (newline\))f(from)g(eac)m(h)i(line)f(read.)630 2803 y |
0385211b CR |
12036 | Ft(-u)384 b Fu(Read)31 b(lines)f(from)g(\014le)h(descriptor)f |
12037 | Fr(fd)j Fu(instead)e(of)f(the)h(standard)e(input.)630 | |
037a8b7f | 12038 | 2966 y Ft(-C)384 b Fu(Ev)-5 b(aluate)33 b Fr(callbac)m(k)39 |
fc527055 | 12039 | b Fu(eac)m(h)33 b(time)f Fr(quan)m(tum)p Fu(P)f(lines)h(are)g(read.)45 |
037a8b7f CR |
12040 | b(The)31 b Ft(-c)g Fu(op-)1110 3075 y(tion)g(sp)s(eci\014es)f |
12041 | Fr(quan)m(tum)p Fu(.)630 3238 y Ft(-c)384 b Fu(Sp)s(ecify)30 | |
fc527055 | 12042 | b(the)g(n)m(um)m(b)s(er)f(of)i(lines)f(read)h(b)s(et)m(w)m(een)g(eac)m |
037a8b7f | 12043 | (h)g(call)h(to)f Fr(callbac)m(k)p Fu(.)630 3401 y(If)36 |
fc527055 CR |
12044 | b Ft(-C)g Fu(is)g(sp)s(eci\014ed)g(without)g Ft(-c)p |
12045 | Fu(,)h(the)g(default)f(quan)m(tum)g(is)h(5000.)60 b(When)36 | |
037a8b7f | 12046 | b Fr(callbac)m(k)44 b Fu(is)630 3510 y(ev)-5 b(aluated,)30 |
fc527055 | 12047 | b(it)e(is)g(supplied)f(the)h(index)f(of)i(the)f(next)g(arra)m(y)g |
037a8b7f | 12048 | (elemen)m(t)h(to)g(b)s(e)e(assigned)i(and)630 3620 y(the)39 |
fc527055 CR |
12049 | b(line)g(to)h(b)s(e)e(assigned)h(to)h(that)f(elemen)m(t)i(as)e |
12050 | (additional)h(argumen)m(ts.)66 b Fr(callbac)m(k)47 b | |
037a8b7f | 12051 | Fu(is)630 3729 y(ev)-5 b(aluated)32 b(after)e(the)h(line)g(is)f(read)g |
fc527055 | 12052 | (but)g(b)s(efore)g(the)h(arra)m(y)g(elemen)m(t)g(is)g(assigned.)630 |
037a8b7f | 12053 | 3866 y(If)25 b(not)g(supplied)f(with)h(an)g(explicit)i(origin,)g |
6e51e0d0 | 12054 | Ft(mapfile)c Fu(will)j(clear)g Fr(arra)m(y)34 b Fu(b)s(efore)24 |
037a8b7f | 12055 | b(assigning)630 3975 y(to)31 b(it.)630 4111 y Ft(mapfile)41 |
6e51e0d0 | 12056 | b Fu(returns)g(successfully)i(unless)e(an)i(in)m(v)-5 |
1101193a | 12057 | b(alid)43 b(option)g(or)g(option)g(argumen)m(t)g(is)630 |
037a8b7f | 12058 | 4221 y(supplied,)29 b Fr(arra)m(y)39 b Fu(is)30 b(in)m(v)-5 |
6e51e0d0 CR |
12059 | b(alid)31 b(or)g(unassignable,)f(or)h Fr(arra)m(y)38 |
12060 | b Fu(is)31 b(not)f(an)h(indexed)e(arra)m(y)-8 b(.)150 | |
037a8b7f CR |
12061 | 4384 y Ft(printf)870 4520 y(printf)46 b([-v)h Fj(var)p |
12062 | Ft(])g Fj(format)f Ft([)p Fj(arguments)p Ft(])630 4656 | |
6e51e0d0 CR |
12063 | y Fu(W)-8 b(rite)27 b(the)g(formatted)f Fr(argumen)m(ts)k |
12064 | Fu(to)d(the)f(standard)f(output)h(under)e(the)i(con)m(trol)i(of)e(the) | |
037a8b7f | 12065 | 630 4765 y Fr(format)p Fu(.)66 b(The)39 b Ft(-v)f Fu(option)h(causes)g |
6e51e0d0 | 12066 | (the)g(output)g(to)g(b)s(e)f(assigned)h(to)h(the)f(v)-5 |
037a8b7f | 12067 | b(ariable)39 b Fr(v)-5 b(ar)630 4875 y Fu(rather)30 b(than)g(b)s(eing)g |
8a0829e9 | 12068 | (prin)m(ted)g(to)h(the)g(standard)e(output.)630 5011 |
6e51e0d0 CR |
12069 | y(The)36 b Fr(format)i Fu(is)f(a)f(c)m(haracter)i(string)e(whic)m(h)g |
12070 | (con)m(tains)i(three)e(t)m(yp)s(es)g(of)h(ob)5 b(jects:)53 | |
8a0829e9 | 12071 | b(plain)630 5121 y(c)m(haracters,)41 b(whic)m(h)c(are)h(simply)e |
1101193a | 12072 | (copied)i(to)g(standard)f(output,)i(c)m(haracter)g(escap)s(e)e(se-)630 |
8a0829e9 CR |
12073 | 5230 y(quences,)g(whic)m(h)f(are)g(con)m(v)m(erted)h(and)f(copied)g(to) |
12074 | g(the)g(standard)f(output,)i(and)f(format)630 5340 y(sp)s | |
6e51e0d0 | 12075 | (eci\014cations,)j(eac)m(h)e(of)g(whic)m(h)f(causes)g(prin)m(ting)g(of) |
8a0829e9 CR |
12076 | h(the)f(next)h(successiv)m(e)g Fr(argumen)m(t)p Fu(.)p |
12077 | eop end | |
1101193a | 12078 | %%Page: 55 61 |
6e51e0d0 | 12079 | TeXDict begin 55 60 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
8a0829e9 CR |
12080 | b(Shell)30 b(Builtin)h(Commands)2069 b(55)630 299 y(In)24 |
12081 | b(addition)h(to)g(the)g(standard)f Ft(printf\(1\))e Fu(formats,)27 | |
12082 | b Ft(printf)c Fu(in)m(terprets)i(the)f(follo)m(wing)630 | |
33723c84 CR |
12083 | 408 y(extensions:)630 573 y Ft(\045b)384 b Fu(Causes)38 |
12084 | b Ft(printf)f Fu(to)j(expand)e(bac)m(kslash)h(escap)s(e)g(sequences)g | |
12085 | (in)f(the)h(cor-)1110 682 y(resp)s(onding)31 b Fr(argumen)m(t)j | |
12086 | Fu(in)e(the)h(same)f(w)m(a)m(y)h(as)g Ft(echo)c(-e)j | |
12087 | Fu(\(see)h(Section)g(4.2)1110 792 y([Bash)e(Builtins],)g(page)g(48\).) | |
12088 | 630 956 y Ft(\045q)384 b Fu(Causes)32 b Ft(printf)e Fu(to)i(output)g | |
12089 | (the)g(corresp)s(onding)f Fr(argumen)m(t)j Fu(in)d(a)i(format)1110 | |
12090 | 1066 y(that)e(can)g(b)s(e)e(reused)h(as)h(shell)f(input.)630 | |
12091 | 1230 y Ft(\045\()p Fj(datefmt)p Ft(\)T)1110 1340 y Fu(Causes)f | |
12092 | Ft(printf)e Fu(to)j(output)f(the)g(date-time)i(string)e(resulting)h | |
12093 | (from)e(using)1110 1450 y Fr(datefm)m(t)45 b Fu(as)d(a)g(format)g | |
12094 | (string)g(for)g Ft(strftime)p Fu(\(3\).)74 b(The)41 b(corresp)s(onding) | |
12095 | 1110 1559 y Fr(argumen)m(t)h Fu(is)e(an)g(in)m(teger)i(represen)m(ting) | |
12096 | e(the)g(n)m(um)m(b)s(er)f(of)h(seconds)g(since)1110 1669 | |
12097 | y(the)24 b(ep)s(o)s(c)m(h.)38 b(Tw)m(o)24 b(sp)s(ecial)h(argumen)m(t)f | |
12098 | (v)-5 b(alues)24 b(ma)m(y)h(b)s(e)e(used:)36 b(-1)25 | |
12099 | b(represen)m(ts)1110 1778 y(the)30 b(curren)m(t)g(time,)h(and)e(-2)i | |
12100 | (represen)m(ts)f(the)g(time)h(the)f(shell)g(w)m(as)g(in)m(v)m(ok)m(ed.) | |
12101 | 1110 1888 y(If)38 b(no)g(argumen)m(t)h(is)f(sp)s(eci\014ed,)i(con)m(v)m | |
ad4aef08 | 12102 | (ersion)f(b)s(eha)m(v)m(es)g(as)g(if)f(-1)h(had)f(b)s(een)1110 |
33723c84 CR |
12103 | 1998 y(giv)m(en.)k(This)29 b(is)i(an)f(exception)i(to)f(the)f(usual)g |
12104 | Ft(printf)f Fu(b)s(eha)m(vior.)630 2162 y(Argumen)m(ts)f(to)h | |
ad4aef08 | 12105 | (non-string)e(format)i(sp)s(eci\014ers)e(are)h(treated)h(as)g(C)e |
33723c84 | 12106 | (language)j(constan)m(ts,)630 2271 y(except)22 b(that)g(a)g(leading)g |
ad4aef08 | 12107 | (plus)e(or)h(min)m(us)f(sign)i(is)f(allo)m(w)m(ed,)k(and)c(if)g(the)g |
33723c84 | 12108 | (leading)h(c)m(haracter)h(is)630 2381 y(a)i(single)g(or)f(double)h |
ad4aef08 CR |
12109 | (quote,)h(the)f(v)-5 b(alue)25 b(is)f(the)h(ASCI)s(I)e(v)-5 |
12110 | b(alue)25 b(of)f(the)h(follo)m(wing)h(c)m(haracter.)630 | |
33723c84 | 12111 | 2518 y(The)31 b Fr(format)i Fu(is)f(reused)e(as)i(necessary)f(to)i |
6e51e0d0 | 12112 | (consume)e(all)h(of)f(the)h Fr(argumen)m(ts)p Fu(.)44 |
33723c84 | 12113 | b(If)30 b(the)i Fr(for-)630 2628 y(mat)c Fu(requires)e(more)g |
6e51e0d0 | 12114 | Fr(argumen)m(ts)k Fu(than)25 b(are)i(supplied,)e(the)h(extra)h(format)f |
33723c84 | 12115 | (sp)s(eci\014cations)630 2737 y(b)s(eha)m(v)m(e)j(as)g(if)f(a)h(zero)g |
ad4aef08 | 12116 | (v)-5 b(alue)29 b(or)g(n)m(ull)f(string,)h(as)g(appropriate,)g(had)f(b) |
33723c84 | 12117 | s(een)g(supplied.)38 b(The)630 2847 y(return)29 b(v)-5 |
ad4aef08 | 12118 | b(alue)31 b(is)g(zero)g(on)f(success,)h(non-zero)g(on)f(failure.)150 |
33723c84 | 12119 | 3011 y Ft(read)870 3148 y(read)47 b([-ers])f([-a)h Fj(aname)p |
6e51e0d0 | 12120 | Ft(])f([-d)h Fj(delim)p Ft(])f([-i)h Fj(text)p Ft(])f([-n)h |
33723c84 | 12121 | Fj(nchars)p Ft(])1061 3258 y([-N)g Fj(nchars)p Ft(])f([-p)h |
6e51e0d0 | 12122 | Fj(prompt)p Ft(])e([-t)i Fj(timeout)p Ft(])f([-u)h Fj(fd)p |
33723c84 | 12123 | Ft(])g([)p Fj(name)f Ft(...)o(])630 3395 y Fu(One)26 |
6e51e0d0 | 12124 | b(line)h(is)g(read)f(from)h(the)f(standard)g(input,)h(or)g(from)f(the)h |
33723c84 | 12125 | (\014le)f(descriptor)h Fr(fd)i Fu(supplied)630 3504 y(as)23 |
6e51e0d0 CR |
12126 | b(an)g(argumen)m(t)h(to)f(the)h Ft(-u)e Fu(option,)j(and)e(the)g |
12127 | (\014rst)f(w)m(ord)h(is)g(assigned)g(to)h(the)f(\014rst)g | |
33723c84 | 12128 | Fr(name)p Fu(,)630 3614 y(the)32 b(second)g(w)m(ord)f(to)i(the)f |
6e51e0d0 | 12129 | (second)g Fr(name)p Fu(,)g(and)g(so)g(on,)g(with)f(lefto)m(v)m(er)j(w)m |
33723c84 | 12130 | (ords)e(and)f(their)630 3724 y(in)m(terv)m(ening)f(separators)g |
6e51e0d0 | 12131 | (assigned)g(to)g(the)g(last)g Fr(name)p Fu(.)40 b(If)29 |
33723c84 | 12132 | b(there)h(are)g(few)m(er)f(w)m(ords)g(read)630 3833 y(from)36 |
6e51e0d0 | 12133 | b(the)i(input)d(stream)j(than)e(names,)j(the)e(remaining)g(names)g(are) |
33723c84 | 12134 | g(assigned)h(empt)m(y)630 3943 y(v)-5 b(alues.)40 b(The)26 |
6e51e0d0 CR |
12135 | b(c)m(haracters)j(in)d(the)i(v)-5 b(alue)27 b(of)g(the)g |
12136 | Ft(IFS)f Fu(v)-5 b(ariable)28 b(are)f(used)g(to)g(split)g(the)h(line) | |
33723c84 | 12137 | 630 4052 y(in)m(to)36 b(w)m(ords)e(using)g(the)h(same)g(rules)f(the)h |
6e51e0d0 | 12138 | (shell)g(uses)f(for)g(expansion)h(\(describ)s(ed)f(ab)s(o)m(v)m(e)630 |
33723c84 | 12139 | 4162 y(in)j(Section)h(3.5.7)i([W)-8 b(ord)38 b(Splitting],)i(page)e |
8a0829e9 | 12140 | (30\).)63 b(The)37 b(bac)m(kslash)h(c)m(haracter)h(`)p |
33723c84 | 12141 | Ft(\\)p Fu(')e(ma)m(y)630 4271 y(b)s(e)28 b(used)g(to)i(remo)m(v)m(e)g |
6e51e0d0 | 12142 | (an)m(y)f(sp)s(ecial)h(meaning)f(for)g(the)g(next)g(c)m(haracter)h |
33723c84 | 12143 | (read)f(and)f(for)h(line)630 4381 y(con)m(tin)m(uation.)42 |
6e51e0d0 | 12144 | b(If)27 b(no)h(names)f(are)h(supplied,)g(the)f(line)h(read)g(is)g |
33723c84 | 12145 | (assigned)g(to)g(the)g(v)-5 b(ariable)630 4491 y Ft(REPLY)p |
bce12dd7 | 12146 | Fu(.)67 b(The)39 b(exit)h(status)g(is)f(zero,)k(unless)c(end-of-\014le) |
33723c84 | 12147 | h(is)g(encoun)m(tered,)i Ft(read)c Fu(times)630 4600 |
bce12dd7 CR |
12148 | y(out)32 b(\(in)g(whic)m(h)g(case)h(the)f(status)h(is)f(greater)h(than) |
12149 | f(128\),)i(a)f(v)-5 b(ariable)32 b(assignmen)m(t)h(error)630 | |
33723c84 | 12150 | 4710 y(\(suc)m(h)28 b(as)h(assigning)g(to)g(a)f(readonly)h(v)-5 |
6e51e0d0 | 12151 | b(ariable\))29 b(o)s(ccurs,)g(or)f(an)g(in)m(v)-5 b(alid)29 |
33723c84 CR |
12152 | b(\014le)g(descriptor)f(is)630 4819 y(supplied)h(as)i(the)f(argumen)m |
12153 | (t)h(to)g Ft(-u)p Fu(.)630 4956 y(Options,)f(if)h(supplied,)e(ha)m(v)m | |
8a0829e9 | 12154 | (e)i(the)g(follo)m(wing)h(meanings:)630 5121 y Ft(-a)e |
6e51e0d0 CR |
12155 | Fj(aname)114 b Fu(The)34 b(w)m(ords)f(are)i(assigned)f(to)h(sequen)m |
12156 | (tial)h(indices)e(of)g(the)g(arra)m(y)h(v)-5 b(ariable)1110 | |
8a0829e9 | 12157 | 5230 y Fr(aname)p Fu(,)29 b(starting)h(at)f(0.)40 b(All)29 |
6e51e0d0 | 12158 | b(elemen)m(ts)h(are)e(remo)m(v)m(ed)i(from)d Fr(aname)34 |
8a0829e9 CR |
12159 | b Fu(b)s(efore)1110 5340 y(the)d(assignmen)m(t.)41 b(Other)30 |
12160 | b Fr(name)36 b Fu(argumen)m(ts)30 b(are)h(ignored.)p | |
12161 | eop end | |
fc527055 CR |
12162 | %%Page: 56 62 |
12163 | TeXDict begin 56 61 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
8a0829e9 CR |
12164 | b(Shell)30 b(Builtin)h(Commands)2069 b(56)630 299 y Ft(-d)30 |
12165 | b Fj(delim)114 b Fu(The)41 b(\014rst)h(c)m(haracter)h(of)f | |
12166 | Fr(delim)g Fu(is)g(used)g(to)g(terminate)h(the)f(input)f(line,)1110 | |
0385211b | 12167 | 408 y(rather)30 b(than)g(newline.)630 560 y Ft(-e)384 |
6e51e0d0 | 12168 | b Fu(Readline)46 b(\(see)g(Chapter)e(8)h([Command)f(Line)h(Editing],)50 |
900a813b | 12169 | b(page)45 b(103\))i(is)1110 669 y(used)37 b(to)i(obtain)g(the)f(line.) |
9f178efb | 12170 | 65 b(Readline)39 b(uses)e(the)i(curren)m(t)f(\(or)g(default,)j(if)1110 |
0385211b CR |
12171 | 779 y(line)31 b(editing)g(w)m(as)f(not)h(previously)f(activ)m(e\))j |
12172 | (editing)e(settings.)630 930 y Ft(-i)f Fj(text)162 b | |
6e51e0d0 | 12173 | Fu(If)36 b(Readline)i(is)f(b)s(eing)g(used)f(to)h(read)g(the)g(line,)j |
0385211b CR |
12174 | Fr(text)f Fu(is)e(placed)h(in)m(to)g(the)1110 1040 y(editing)31 |
12175 | b(bu\013er)e(b)s(efore)h(editing)h(b)s(egins.)630 1191 | |
fc527055 | 12176 | y Ft(-n)f Fj(nchars)66 b Ft(read)38 b Fu(returns)f(after)j(reading)f |
15baad62 | 12177 | Fr(nc)m(hars)j Fu(c)m(haracters)e(rather)f(than)g(w)m(aiting)1110 |
0385211b CR |
12178 | 1301 y(for)d(a)h(complete)h(line)f(of)g(input,)g(but)f(honors)g(a)h |
12179 | (delimiter)g(if)f(few)m(er)h(than)1110 1410 y Fr(nc)m(hars)d | |
8a0829e9 | 12180 | Fu(c)m(haracters)e(are)e(read)h(b)s(efore)f(the)g(delimiter.)630 |
0385211b | 12181 | 1562 y Ft(-N)g Fj(nchars)66 b Ft(read)39 b Fu(returns)f(after)j |
fc527055 | 12182 | (reading)e(exactly)j Fr(nc)m(hars)h Fu(c)m(haracters)f(rather)d(than) |
0385211b CR |
12183 | 1110 1671 y(w)m(aiting)32 b(for)f(a)g(complete)i(line)e(of)g(input,)g |
12184 | (unless)f(EOF)h(is)g(encoun)m(tered)g(or)1110 1781 y | |
fc527055 | 12185 | Ft(read)f Fu(times)i(out.)43 b(Delimiter)33 b(c)m(haracters)f(encoun)m |
0385211b | 12186 | (tered)g(in)f(the)g(input)g(are)1110 1891 y(not)g(treated)h(sp)s |
fc527055 | 12187 | (ecially)f(and)f(do)h(not)g(cause)g Ft(read)e Fu(to)j(return)d(un)m |
0385211b CR |
12188 | (til)i Fr(nc)m(hars)1110 2000 y Fu(c)m(haracters)26 b(are)f(read.)38 |
12189 | b(The)24 b(result)g(is)h(not)f(split)h(on)f(the)h(c)m(haracters)h(in)e | |
12190 | Ft(IFS)p Fu(;)1110 2110 y(the)e(in)m(ten)m(t)i(is)e(that)h(the)f(v)-5 | |
12191 | b(ariable)23 b(is)f(assigned)g(exactly)i(the)e(c)m(haracters)i(read) | |
12192 | 1110 2219 y(\(with)30 b(the)h(exception)h(of)e(bac)m(kslash;)h(see)g | |
12193 | (the)g Ft(-r)f Fu(option)h(b)s(elo)m(w\).)630 2371 y | |
12194 | Ft(-p)f Fj(prompt)66 b Fu(Displa)m(y)38 b Fr(prompt)p | |
6e51e0d0 | 12195 | Fu(,)g(without)e(a)h(trailing)h(newline,)h(b)s(efore)d(attempting)i(to) |
0385211b CR |
12196 | 1110 2480 y(read)f(an)m(y)h(input.)60 b(The)37 b(prompt)g(is)g(displa)m |
12197 | (y)m(ed)h(only)f(if)g(input)g(is)g(coming)1110 2590 y(from)30 | |
12198 | b(a)h(terminal.)630 2741 y Ft(-r)384 b Fu(If)21 b(this)h(option)g(is)f | |
6e51e0d0 | 12199 | (giv)m(en,)k(bac)m(kslash)d(do)s(es)f(not)h(act)h(as)f(an)f(escap)s(e)h |
0385211b | 12200 | (c)m(haracter.)1110 2851 y(The)30 b(bac)m(kslash)i(is)f(considered)g |
6e51e0d0 | 12201 | (to)h(b)s(e)e(part)h(of)g(the)g(line.)43 b(In)30 b(particular,)i(a)1110 |
0385211b CR |
12202 | 2960 y(bac)m(kslash-newline)f(pair)f(ma)m(y)h(not)g(b)s(e)f(used)f(as)i |
12203 | (a)g(line)f(con)m(tin)m(uation.)630 3112 y Ft(-s)384 | |
6e51e0d0 | 12204 | b Fu(Silen)m(t)28 b(mo)s(de.)40 b(If)27 b(input)f(is)i(coming)g(from)f |
0385211b CR |
12205 | (a)h(terminal,)h(c)m(haracters)g(are)f(not)1110 3221 |
12206 | y(ec)m(ho)s(ed.)630 3373 y Ft(-t)i Fj(timeout)1110 3482 | |
6e51e0d0 | 12207 | y Fu(Cause)42 b Ft(read)g Fu(to)h(time)h(out)f(and)f(return)f(failure)i |
0385211b | 12208 | (if)g(a)g(complete)h(line)f(of)1110 3592 y(input)26 b(\(or)h(a)g(sp)s |
6e51e0d0 | 12209 | (eci\014ed)f(n)m(um)m(b)s(er)g(of)h(c)m(haracters\))h(is)f(not)g(read)g |
0385211b | 12210 | (within)f Fr(time-)1110 3701 y(out)37 b Fu(seconds.)53 |
6e51e0d0 | 12211 | b Fr(timeout)38 b Fu(ma)m(y)d(b)s(e)f(a)h(decimal)h(n)m(um)m(b)s(er)d |
0385211b | 12212 | (with)h(a)h(fractional)1110 3811 y(p)s(ortion)29 b(follo)m(wing)h(the)f |
6e51e0d0 | 12213 | (decimal)h(p)s(oin)m(t.)40 b(This)29 b(option)g(is)g(only)g(e\013ectiv) |
0385211b | 12214 | m(e)j(if)1110 3921 y Ft(read)j Fu(is)i(reading)g(input)e(from)h(a)h |
6e51e0d0 | 12215 | (terminal,)i(pip)s(e,)e(or)g(other)f(sp)s(ecial)i(\014le;)1110 |
0385211b | 12216 | 4030 y(it)31 b(has)g(no)g(e\013ect)h(when)e(reading)h(from)g(regular)g |
6e51e0d0 | 12217 | (\014les.)42 b(If)30 b Ft(read)g Fu(times)h(out,)1110 |
0385211b | 12218 | 4140 y Ft(read)d Fu(sa)m(v)m(es)j(an)m(y)f(partial)h(input)d(read)i(in) |
6e51e0d0 | 12219 | m(to)h(the)e(sp)s(eci\014ed)g(v)-5 b(ariable)31 b Fr(name)p |
0385211b | 12220 | Fu(.)1110 4249 y(If)k Fr(timeout)j Fu(is)e(0,)h Ft(read)e |
6e51e0d0 | 12221 | Fu(returns)f(immediately)-8 b(,)39 b(without)c(trying)h(to)g(read)1110 |
0385211b | 12222 | 4359 y(and)30 b(data.)44 b(The)30 b(exit)i(status)f(is)g(0)g(if)g |
6e51e0d0 | 12223 | (input)f(is)h(a)m(v)-5 b(ailable)34 b(on)c(the)i(sp)s(eci\014ed)1110 |
0385211b CR |
12224 | 4468 y(\014le)g(descriptor,)g(non-zero)h(otherwise.)46 |
12225 | b(The)31 b(exit)i(status)f(is)g(greater)h(than)1110 4578 | |
12226 | y(128)f(if)e(the)h(timeout)g(is)f(exceeded.)630 4729 | |
6e51e0d0 | 12227 | y Ft(-u)g Fj(fd)258 b Fu(Read)31 b(input)e(from)h(\014le)g(descriptor)h |
0385211b | 12228 | Fr(fd)p Fu(.)150 4881 y Ft(readarray)870 4990 y(readarray)45 |
fc527055 CR |
12229 | b([-d)i Fj(delim)p Ft(])f([-n)h Fj(count)p Ft(])f([-O)h |
12230 | Fj(origin)p Ft(])f([-s)h Fj(count)p Ft(])f([-t])h([-u)g | |
0385211b CR |
12231 | Fj(fd)p Ft(])1061 5100 y([-C)g Fj(callback)p Ft(])e([-c)i |
12232 | Fj(quantum)p Ft(])f([)p Fj(array)p Ft(])630 5230 y Fu(Read)38 | |
fc527055 CR |
12233 | b(lines)f(from)g(the)h(standard)e(input)g(in)m(to)j(the)e(indexed)g |
12234 | (arra)m(y)h(v)-5 b(ariable)38 b Fr(arra)m(y)p Fu(,)i(or)630 | |
0385211b CR |
12235 | 5340 y(from)30 b(\014le)g(descriptor)h Fr(fd)i Fu(if)d(the)h |
12236 | Ft(-u)e Fu(option)i(is)g(supplied.)p eop end | |
1101193a | 12237 | %%Page: 57 63 |
6e51e0d0 | 12238 | TeXDict begin 57 62 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
0385211b CR |
12239 | b(Shell)30 b(Builtin)h(Commands)2069 b(57)630 299 y(A)30 |
12240 | b(synon)m(ym)g(for)g Ft(mapfile)p Fu(.)150 462 y Ft(source)870 | |
12241 | 598 y(source)46 b Fj(filename)630 734 y Fu(A)30 b(synon)m(ym)g(for)g | |
fc527055 | 12242 | Ft(.)g Fu(\(see)i(Section)f(4.1)g([Bourne)g(Shell)f(Builtins],)h(page)g |
0385211b CR |
12243 | (41\).)150 897 y Ft(type)870 1033 y(type)47 b([-afptP])e([)p |
12244 | Fj(name)i Ft(...)o(])630 1169 y Fu(F)-8 b(or)42 b(eac)m(h)g | |
fc527055 | 12245 | Fr(name)p Fu(,)i(indicate)e(ho)m(w)g(it)f(w)m(ould)g(b)s(e)g(in)m |
0385211b CR |
12246 | (terpreted)g(if)g(used)f(as)i(a)f(command)630 1279 y(name.)630 |
12247 | 1415 y(If)g(the)g Ft(-t)g Fu(option)h(is)f(used,)j Ft(type)c | |
fc527055 | 12248 | Fu(prin)m(ts)h(a)h(single)g(w)m(ord)f(whic)m(h)g(is)g(one)h(of)g(`)p |
0385211b | 12249 | Ft(alias)p Fu(',)630 1524 y(`)p Ft(function)p Fu(',)32 |
fc527055 CR |
12250 | b(`)p Ft(builtin)p Fu(',)g(`)p Ft(file)p Fu(')g(or)h(`)p |
12251 | Ft(keyword)p Fu(',)f(if)h Fr(name)38 b Fu(is)33 b(an)f(alias,)j(shell)e | |
0385211b | 12252 | (function,)630 1634 y(shell)i(builtin,)g(disk)g(\014le,)h(or)e(shell)h |
fc527055 | 12253 | (reserv)m(ed)g(w)m(ord,)h(resp)s(ectiv)m(ely)-8 b(.)55 |
0385211b | 12254 | b(If)34 b(the)h Fr(name)40 b Fu(is)35 b(not)630 1743 |
fc527055 | 12255 | y(found,)29 b(then)h(nothing)h(is)f(prin)m(ted,)g(and)g |
0385211b | 12256 | Ft(type)f Fu(returns)g(a)i(failure)g(status.)630 1880 |
fc527055 CR |
12257 | y(If)25 b(the)g Ft(-p)g Fu(option)h(is)f(used,)h Ft(type)e |
12258 | Fu(either)h(returns)g(the)g(name)g(of)h(the)f(disk)g(\014le)g(that)h(w) | |
0385211b | 12259 | m(ould)630 1989 y(b)s(e)k(executed,)h(or)g(nothing)f(if)g |
6e51e0d0 | 12260 | Ft(-t)g Fu(w)m(ould)g(not)h(return)e(`)p Ft(file)p Fu('.)630 |
0385211b | 12261 | 2125 y(The)h Ft(-P)g Fu(option)h(forces)g(a)g(path)f(searc)m(h)h(for)g |
6e51e0d0 | 12262 | (eac)m(h)g Fr(name)p Fu(,)g(ev)m(en)g(if)g Ft(-t)f Fu(w)m(ould)g(not)h |
0385211b | 12263 | (return)630 2235 y(`)p Ft(file)p Fu('.)630 2371 y(If)f(a)g(command)g |
15baad62 | 12264 | (is)g(hashed,)f Ft(-p)h Fu(and)f Ft(-P)g Fu(prin)m(t)h(the)g(hashed)f |
0385211b | 12265 | (v)-5 b(alue,)31 b(whic)m(h)f(is)g(not)g(neces-)630 2481 |
15baad62 | 12266 | y(sarily)h(the)f(\014le)h(that)g(app)s(ears)e(\014rst)h(in)g |
0385211b | 12267 | Ft($PATH)p Fu(.)630 2617 y(If)22 b(the)i Ft(-a)e Fu(option)h(is)g |
15baad62 | 12268 | (used,)h Ft(type)e Fu(returns)f(all)j(of)f(the)g(places)h(that)f(con)m |
0385211b | 12269 | (tain)i(an)d(executable)630 2726 y(named)32 b Fr(\014le)p |
15baad62 | 12270 | Fu(.)49 b(This)32 b(includes)h(aliases)h(and)e(functions,)i(if)f(and)f |
0385211b CR |
12271 | (only)h(if)g(the)g Ft(-p)f Fu(option)i(is)630 2836 y(not)d(also)g |
12272 | (used.)630 2972 y(If)f(the)g Ft(-f)g Fu(option)g(is)h(used,)e | |
15baad62 | 12273 | Ft(type)g Fu(do)s(es)h(not)h(attempt)g(to)g(\014nd)d(shell)j |
0385211b CR |
12274 | (functions,)f(as)g(with)630 3082 y(the)h Ft(command)d |
12275 | Fu(builtin.)630 3218 y(The)j(return)f(status)h(is)g(zero)h(if)f(all)h | |
15baad62 | 12276 | (of)f(the)h Fr(names)i Fu(are)e(found,)e(non-zero)i(if)f(an)m(y)g(are)h |
0385211b | 12277 | (not)630 3328 y(found.)150 3490 y Ft(typeset)870 3626 |
15baad62 | 12278 | y(typeset)46 b([-afFgrxilnrtux])d([-p])k([)p Fj(name)p |
0385211b | 12279 | Ft([=)p Fj(value)p Ft(])d(...)o(])630 3763 y Fu(The)31 |
15baad62 | 12280 | b Ft(typeset)e Fu(command)i(is)g(supplied)f(for)h(compatibilit)m(y)i |
0385211b | 12281 | (with)e(the)g(Korn)f(shell.)44 b(It)31 b(is)630 3872 |
15baad62 | 12282 | y(a)g(synon)m(ym)f(for)g(the)g Ft(declare)f Fu(builtin)h(command.)150 |
0385211b CR |
12283 | 4035 y Ft(ulimit)870 4171 y(ulimit)46 b([-HSabcdefiklmnpqrstuvxPT)o(])c |
12284 | ([)p Fj(limit)p Ft(])630 4307 y(ulimit)25 b Fu(pro)m(vides)h(con)m | |
15baad62 | 12285 | (trol)i(o)m(v)m(er)g(the)f(resources)f(a)m(v)-5 b(ailable)29 |
0385211b | 12286 | b(to)e(pro)s(cesses)f(started)h(b)m(y)g(the)630 4417 |
15baad62 CR |
12287 | y(shell,)i(on)f(systems)g(that)h(allo)m(w)h(suc)m(h)e(con)m(trol.)41 |
12288 | b(If)28 b(an)g(option)h(is)f(giv)m(en,)i(it)e(is)h(in)m(terpreted)630 | |
0385211b | 12289 | 4526 y(as)i(follo)m(ws:)630 4689 y Ft(-S)384 b Fu(Change)30 |
15baad62 | 12290 | b(and)g(rep)s(ort)g(the)g(soft)h(limit)g(asso)s(ciated)h(with)e(a)h |
0385211b | 12291 | (resource.)630 4852 y Ft(-H)384 b Fu(Change)30 b(and)g(rep)s(ort)g(the) |
15baad62 | 12292 | g(hard)g(limit)h(asso)s(ciated)h(with)e(a)h(resource.)630 |
0385211b CR |
12293 | 5015 y Ft(-a)384 b Fu(All)31 b(curren)m(t)f(limits)h(are)g(rep)s |
12294 | (orted.)630 5177 y Ft(-b)384 b Fu(The)30 b(maxim)m(um)g(so)s(c)m(k)m | |
12295 | (et)i(bu\013er)e(size.)630 5340 y Ft(-c)384 b Fu(The)30 | |
12296 | b(maxim)m(um)g(size)h(of)g(core)g(\014les)f(created.)p | |
12297 | eop end | |
6e51e0d0 CR |
12298 | %%Page: 58 64 |
12299 | TeXDict begin 58 63 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
0385211b CR |
12300 | b(Shell)30 b(Builtin)h(Commands)2069 b(58)630 299 y Ft(-d)384 |
12301 | b Fu(The)30 b(maxim)m(um)g(size)h(of)g(a)g(pro)s(cess's)f(data)h | |
bce12dd7 | 12302 | (segmen)m(t.)630 450 y Ft(-e)384 b Fu(The)30 b(maxim)m(um)g(sc)m |
0385211b | 12303 | (heduling)h(priorit)m(y)f(\()p Ft(")p Fu(nice)p Ft(")p |
bce12dd7 | 12304 | Fu(\).)630 601 y Ft(-f)384 b Fu(The)30 b(maxim)m(um)g(size)h(of)g |
0385211b | 12305 | (\014les)f(written)h(b)m(y)f(the)g(shell)h(and)f(its)h(c)m(hildren.)630 |
bce12dd7 CR |
12306 | 753 y Ft(-i)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(p)s |
12307 | (ending)e(signals.)630 904 y Ft(-k)384 b Fu(The)30 b(maxim)m(um)g(n)m | |
0385211b | 12308 | (um)m(b)s(er)f(of)i(kqueues)f(that)h(ma)m(y)g(b)s(e)e(allo)s(cated.)630 |
bce12dd7 CR |
12309 | 1055 y Ft(-l)384 b Fu(The)30 b(maxim)m(um)g(size)h(that)g(ma)m(y)g(b)s |
12310 | (e)f(lo)s(c)m(k)m(ed)i(in)m(to)f(memory)-8 b(.)630 1206 | |
8a0829e9 | 12311 | y Ft(-m)384 b Fu(The)36 b(maxim)m(um)g(residen)m(t)h(set)g(size)g |
bce12dd7 CR |
12312 | (\(man)m(y)g(systems)f(do)h(not)f(honor)g(this)1110 1316 |
12313 | y(limit\).)630 1467 y Ft(-n)384 b Fu(The)38 b(maxim)m(um)h(n)m(um)m(b)s | |
8a0829e9 | 12314 | (er)e(of)i(op)s(en)f(\014le)h(descriptors)g(\(most)g(systems)g(do)1110 |
bce12dd7 CR |
12315 | 1577 y(not)31 b(allo)m(w)g(this)g(v)-5 b(alue)31 b(to)g(b)s(e)e(set\).) |
12316 | 630 1728 y Ft(-p)384 b Fu(The)30 b(pip)s(e)f(bu\013er)h(size.)630 | |
12317 | 1879 y Ft(-q)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(b)m | |
12318 | (ytes)g(in)f(POSIX)f(message)j(queues.)630 2031 y Ft(-r)384 | |
8a0829e9 | 12319 | b Fu(The)30 b(maxim)m(um)g(real-time)i(sc)m(heduling)f(priorit)m(y)-8 |
bce12dd7 CR |
12320 | b(.)630 2182 y Ft(-s)384 b Fu(The)30 b(maxim)m(um)g(stac)m(k)i(size.) |
12321 | 630 2333 y Ft(-t)384 b Fu(The)30 b(maxim)m(um)g(amoun)m(t)h(of)f(cpu)g | |
12322 | (time)h(in)f(seconds.)630 2484 y Ft(-u)384 b Fu(The)30 | |
8a0829e9 | 12323 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(pro)s(cesses)f(a)m(v)-5 |
bce12dd7 | 12324 | b(ailable)33 b(to)e(a)f(single)i(user.)630 2636 y Ft(-v)384 |
8a0829e9 | 12325 | b Fu(The)41 b(maxim)m(um)h(amoun)m(t)g(of)h(virtual)f(memory)g(a)m(v)-5 |
bce12dd7 | 12326 | b(ailable)44 b(to)e(the)g(shell,)1110 2745 y(and,)30 |
8a0829e9 | 12327 | b(on)g(some)h(systems,)g(to)g(its)g(c)m(hildren.)630 |
bce12dd7 CR |
12328 | 2896 y Ft(-x)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i |
12329 | (\014le)f(lo)s(c)m(ks.)630 3048 y Ft(-P)384 b Fu(The)30 | |
8a0829e9 | 12330 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(pseudoterminals.)630 |
bce12dd7 CR |
12331 | 3199 y Ft(-T)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i |
12332 | (threads.)630 3350 y(If)36 b Fr(limit)k Fu(is)c(giv)m(en,)k(and)c(the)h | |
6e51e0d0 | 12333 | Ft(-a)f Fu(option)h(is)f(not)h(used,)h Fr(limit)h Fu(is)e(the)g(new)f |
bce12dd7 | 12334 | (v)-5 b(alue)37 b(of)g(the)630 3460 y(sp)s(eci\014ed)c(resource.)51 |
6e51e0d0 CR |
12335 | b(The)34 b(sp)s(ecial)g Fr(limit)j Fu(v)-5 b(alues)34 |
12336 | b Ft(hard)p Fu(,)g Ft(soft)p Fu(,)g(and)f Ft(unlimited)e | |
bce12dd7 | 12337 | Fu(stand)630 3569 y(for)h(the)g(curren)m(t)g(hard)f(limit,)i(the)g |
6e51e0d0 | 12338 | (curren)m(t)f(soft)g(limit,)h(and)f(no)g(limit,)h(resp)s(ectiv)m(ely)-8 |
bce12dd7 | 12339 | b(.)48 b(A)630 3679 y(hard)37 b(limit)h(cannot)h(b)s(e)e(increased)h(b) |
6e51e0d0 | 12340 | m(y)f(a)h(non-ro)s(ot)g(user)f(once)i(it)f(is)g(set;)k(a)c(soft)g |
bce12dd7 | 12341 | (limit)630 3788 y(ma)m(y)j(b)s(e)e(increased)i(up)e(to)h(the)h(v)-5 |
6e51e0d0 | 12342 | b(alue)40 b(of)g(the)h(hard)e(limit.)70 b(Otherwise,)43 |
bce12dd7 | 12343 | b(the)d(curren)m(t)630 3898 y(v)-5 b(alue)29 b(of)h(the)f(soft)g(limit) |
6e51e0d0 | 12344 | h(for)e(the)h(sp)s(eci\014ed)g(resource)g(is)g(prin)m(ted,)g(unless)f |
bce12dd7 | 12345 | (the)h Ft(-H)f Fu(option)630 4008 y(is)h(supplied.)39 |
6e51e0d0 CR |
12346 | b(When)29 b(setting)h(new)f(limits,)h(if)f(neither)g |
12347 | Ft(-H)g Fu(nor)f Ft(-S)h Fu(is)g(supplied,)f(b)s(oth)h(the)630 | |
bce12dd7 | 12348 | 4117 y(hard)i(and)h(soft)h(limits)g(are)f(set.)48 b(If)31 |
6e51e0d0 | 12349 | b(no)i(option)f(is)h(giv)m(en,)h(then)e Ft(-f)g Fu(is)g(assumed.)46 |
bce12dd7 CR |
12350 | b(V)-8 b(alues)630 4227 y(are)31 b(in)f(1024-b)m(yte)j(incremen)m(ts,)e |
12351 | (except)g(for)f Ft(-t)p Fu(,)g(whic)m(h)g(is)g(in)g(seconds;)h | |
12352 | Ft(-p)p Fu(,)f(whic)m(h)g(is)g(in)630 4336 y(units)h(of)g(512-b)m(yte)j | |
12353 | (blo)s(c)m(ks;)e Ft(-P)p Fu(,)f Ft(-T)p Fu(,)h Ft(-b)p | |
12354 | Fu(,)f Ft(-k)p Fu(,)g Ft(-n)g Fu(and)f Ft(-u)p Fu(,)h(whic)m(h)h(are)f | |
12355 | (unscaled)g(v)-5 b(alues;)630 4446 y(and,)31 b(when)f(in)g | |
12356 | Fm(posix)g Fu(Mo)s(de)h(\(see)h(Section)g(6.11)g([Bash)g(POSIX)e(Mo)s | |
900a813b | 12357 | (de],)h(page)h(95\),)h Ft(-c)630 4556 y Fu(and)d Ft(-f)p |
bce12dd7 CR |
12358 | Fu(,)g(whic)m(h)g(are)h(in)f(512-b)m(yte)i(incremen)m(ts.)630 |
12359 | 4686 y(The)i(return)g(status)h(is)f(zero)i(unless)e(an)g(in)m(v)-5 | |
8a0829e9 | 12360 | b(alid)36 b(option)f(or)f(argumen)m(t)i(is)e(supplied,)h(or)630 |
bce12dd7 CR |
12361 | 4796 y(an)30 b(error)g(o)s(ccurs)g(while)h(setting)g(a)g(new)f(limit.) |
12362 | 150 4947 y Ft(unalias)870 5077 y(unalias)46 b([-a])g([)p | |
8a0829e9 | 12363 | Fj(name)h Ft(...)g(])630 5208 y Fu(Remo)m(v)m(e)42 b(eac)m(h)f |
6e51e0d0 CR |
12364 | Fr(name)k Fu(from)39 b(the)i(list)f(of)g(aliases.)71 |
12365 | b(If)40 b Ft(-a)f Fu(is)h(supplied,)h(all)g(aliases)h(are)630 | |
8a0829e9 | 12366 | 5317 y(remo)m(v)m(ed.)g(Aliases)31 b(are)g(describ)s(ed)e(in)h(Section) |
900a813b | 12367 | i(6.6)f([Aliases],)h(page)f(89.)p eop end |
fc527055 CR |
12368 | %%Page: 59 65 |
12369 | TeXDict begin 59 64 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
8a0829e9 CR |
12370 | b(Shell)30 b(Builtin)h(Commands)2069 b(59)150 299 y Fs(4.3)68 |
12371 | b(Mo)t(difying)45 b(Shell)g(Beha)l(vior)150 520 y Fk(4.3.1)63 | |
12372 | b(The)41 b(Set)g(Builtin)150 667 y Fu(This)35 b(builtin)h(is)g(so)g | |
45c0f7f8 | 12373 | (complicated)i(that)f(it)f(deserv)m(es)h(its)f(o)m(wn)g(section.)59 |
6e51e0d0 | 12374 | b Ft(set)35 b Fu(allo)m(ws)j(y)m(ou)e(to)h(c)m(hange)150 |
8a0829e9 | 12375 | 777 y(the)c(v)-5 b(alues)34 b(of)f(shell)g(options)h(and)e(set)i(the)f |
9ec5ed66 | 12376 | (p)s(ositional)h(parameters,)h(or)e(to)h(displa)m(y)f(the)g(names)h |
8a0829e9 CR |
12377 | (and)150 886 y(v)-5 b(alues)31 b(of)f(shell)h(v)-5 b(ariables.)150 |
12378 | 1041 y Ft(set)870 1172 y(set)47 b([--abefhkmnptuvxBCEHPT])41 | |
6e51e0d0 | 12379 | b([-o)47 b Fj(option-name)p Ft(])e([)p Fj(argument)g |
8a0829e9 | 12380 | Ft(...)o(])870 1282 y(set)i([+abefhkmnptuvxBCEHPT])42 |
6e51e0d0 | 12381 | b([+o)47 b Fj(option-name)p Ft(])d([)p Fj(argument)h |
8a0829e9 | 12382 | Ft(...)o(])630 1414 y Fu(If)22 b(no)h(options)g(or)g(argumen)m(ts)g |
6e51e0d0 | 12383 | (are)g(supplied,)g Ft(set)f Fu(displa)m(ys)g(the)h(names)g(and)f(v)-5 |
8a0829e9 | 12384 | b(alues)23 b(of)g(all)630 1523 y(shell)j(v)-5 b(ariables)27 |
54cdd75a | 12385 | b(and)e(functions,)h(sorted)g(according)h(to)g(the)f(curren)m(t)f(lo)s |
8a0829e9 | 12386 | (cale,)k(in)c(a)i(format)630 1633 y(that)i(ma)m(y)h(b)s(e)e(reused)g |
fc527055 | 12387 | (as)h(input)f(for)h(setting)h(or)e(resetting)i(the)f(curren)m(tly-set)h |
8a0829e9 | 12388 | (v)-5 b(ariables.)630 1743 y(Read-only)37 b(v)-5 b(ariables)37 |
fc527055 | 12389 | b(cannot)h(b)s(e)e(reset.)59 b(In)36 b Fm(posix)g Fu(mo)s(de,)i(only)f |
8a0829e9 CR |
12390 | (shell)f(v)-5 b(ariables)38 b(are)630 1852 y(listed.)630 |
12391 | 1984 y(When)29 b(options)g(are)g(supplied,)f(they)h(set)h(or)f(unset)f | |
fc527055 | 12392 | (shell)h(attributes.)41 b(Options,)29 b(if)g(sp)s(ec-)630 |
8a0829e9 CR |
12393 | 2094 y(i\014ed,)h(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
12394 | 2248 y Ft(-a)384 b Fu(Eac)m(h)37 b(v)-5 b(ariable)36 | |
12395 | b(or)g(function)g(that)g(is)g(created)h(or)f(mo)s(di\014ed)f(is)h(giv)m | |
12396 | (en)h(the)1110 2357 y(exp)s(ort)28 b(attribute)h(and)f(mark)m(ed)g(for) | |
12397 | g(exp)s(ort)g(to)h(the)g(en)m(vironmen)m(t)f(of)h(sub-)1110 | |
12398 | 2467 y(sequen)m(t)i(commands.)630 2621 y Ft(-b)384 b | |
12399 | Fu(Cause)44 b(the)h(status)g(of)f(terminated)h(bac)m(kground)g(jobs)f | |
12400 | (to)h(b)s(e)f(rep)s(orted)1110 2730 y(immediately)-8 | |
12401 | b(,)30 b(rather)d(than)f(b)s(efore)h(prin)m(ting)g(the)g(next)g | |
12402 | (primary)g(prompt.)630 2885 y Ft(-e)384 b Fu(Exit)65 | |
12403 | b(immediately)g(if)f(a)h(pip)s(eline)e(\(see)i(Section)g(3.2.2)h([Pip)s | |
12404 | (elines],)1110 2994 y(page)56 b(8\),)62 b(whic)m(h)55 | |
12405 | b(ma)m(y)h(consist)f(of)h(a)f(single)h(simple)f(command)g(\(see)1110 | |
12406 | 3104 y(Section)30 b(3.2.1)i([Simple)d(Commands],)g(page)h(8\),)h(a)f | |
12407 | (list)g(\(see)h(Section)f(3.2.3)1110 3213 y([Lists],)66 | |
12408 | b(page)59 b(9\),)67 b(or)58 b(a)h(comp)s(ound)e(command)h(\(see)h | |
12409 | (Section)g(3.2.4)1110 3323 y([Comp)s(ound)67 b(Commands],)77 | |
12410 | b(page)69 b(9\))g(returns)e(a)i(non-zero)g(status.)1110 | |
12411 | 3432 y(The)41 b(shell)g(do)s(es)g(not)g(exit)h(if)f(the)h(command)f | |
12412 | (that)h(fails)f(is)g(part)g(of)h(the)1110 3542 y(command)g(list)h | |
6e51e0d0 | 12413 | (immediately)g(follo)m(wing)g(a)g Ft(while)e Fu(or)h |
8a0829e9 | 12414 | Ft(until)e Fu(k)m(eyw)m(ord,)1110 3652 y(part)61 b(of)g(the)g(test)h |
6e51e0d0 | 12415 | (in)e(an)h Ft(if)f Fu(statemen)m(t,)71 b(part)61 b(of)g(an)m(y)g |
8a0829e9 | 12416 | (command)1110 3761 y(executed)50 b(in)e(a)h Ft(&&)f Fu(or)h |
6e51e0d0 | 12417 | Ft(||)f Fu(list)h(except)g(the)g(command)g(follo)m(wing)h(the)1110 |
8a0829e9 | 12418 | 3871 y(\014nal)37 b Ft(&&)g Fu(or)g Ft(||)p Fu(,)h(an)m(y)g(command)f |
9f178efb | 12419 | (in)g(a)g(pip)s(eline)g(but)g(the)g(last,)j(or)e(if)f(the)1110 |
8a0829e9 | 12420 | 3980 y(command's)c(return)f(status)h(is)g(b)s(eing)g(in)m(v)m(erted)h |
6e51e0d0 | 12421 | (with)e Ft(!)p Fu(.)48 b(If)33 b(a)g(comp)s(ound)1110 |
8a0829e9 CR |
12422 | 4090 y(command)g(other)g(than)f(a)i(subshell)d(returns)h(a)h(non-zero)h |
12423 | (status)f(b)s(ecause)1110 4200 y(a)k(command)g(failed)g(while)g | |
6e51e0d0 | 12424 | Ft(-e)f Fu(w)m(as)i(b)s(eing)e(ignored,)j(the)e(shell)g(do)s(es)g(not) |
8a0829e9 | 12425 | 1110 4309 y(exit.)42 b(A)30 b(trap)g(on)h Ft(ERR)p Fu(,)e(if)i(set,)g |
6e51e0d0 | 12426 | (is)f(executed)i(b)s(efore)e(the)g(shell)h(exits.)1110 |
8a0829e9 CR |
12427 | 4441 y(This)f(option)h(applies)f(to)h(the)g(shell)g(en)m(vironmen)m(t)g |
12428 | (and)f(eac)m(h)h(subshell)f(en-)1110 4551 y(vironmen)m(t)j(separately)i | |
6e51e0d0 | 12429 | (\(see)f(Section)g(3.7.3)h([Command)d(Execution)i(En-)1110 |
8a0829e9 CR |
12430 | 4660 y(vironmen)m(t],)i(page)f(37\),)i(and)d(ma)m(y)h(cause)f |
12431 | (subshells)g(to)h(exit)g(b)s(efore)f(exe-)1110 4770 y(cuting)d(all)g | |
12432 | (the)g(commands)f(in)g(the)g(subshell.)1110 4902 y(If)41 | |
ad4aef08 | 12433 | b(a)g(comp)s(ound)e(command)i(or)g(shell)g(function)g(executes)h(in)f |
8a0829e9 | 12434 | (a)g(con)m(text)1110 5011 y(where)31 b Ft(-e)g Fu(is)g(b)s(eing)g |
6e51e0d0 | 12435 | (ignored,)h(none)f(of)h(the)f(commands)g(executed)h(within)1110 |
8a0829e9 CR |
12436 | 5121 y(the)j(comp)s(ound)f(command)h(or)g(function)f(b)s(o)s(dy)g(will) |
12437 | h(b)s(e)f(a\013ected)j(b)m(y)e(the)1110 5230 y Ft(-e)25 | |
6e51e0d0 | 12438 | b Fu(setting,)j(ev)m(en)e(if)g Ft(-e)f Fu(is)h(set)g(and)f(a)h(command) |
8a0829e9 | 12439 | g(returns)e(a)i(failure)g(status.)1110 5340 y(If)32 b(a)i(comp)s(ound)d |
6e51e0d0 | 12440 | (command)i(or)g(shell)g(function)f(sets)i Ft(-e)e Fu(while)h(executing) |
8a0829e9 | 12441 | p eop end |
15baad62 CR |
12442 | %%Page: 60 66 |
12443 | TeXDict begin 60 65 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
8a0829e9 CR |
12444 | b(Shell)30 b(Builtin)h(Commands)2069 b(60)1110 299 y(in)40 |
12445 | b(a)h(con)m(text)i(where)d Ft(-e)g Fu(is)h(ignored,)j(that)d(setting)h | |
12446 | (will)f(not)g(ha)m(v)m(e)h(an)m(y)1110 408 y(e\013ect)g(un)m(til)e(the) | |
12447 | h(comp)s(ound)e(command)h(or)g(the)g(command)g(con)m(taining)1110 | |
12448 | 518 y(the)31 b(function)f(call)h(completes.)630 682 y | |
12449 | Ft(-f)384 b Fu(Disable)31 b(\014lename)g(expansion)f(\(globbing\).)630 | |
12450 | 847 y Ft(-h)384 b Fu(Lo)s(cate)33 b(and)e(remem)m(b)s(er)h(\(hash\))g | |
fc527055 | 12451 | (commands)f(as)h(they)g(are)g(lo)s(ok)m(ed)h(up)e(for)1110 |
8a0829e9 CR |
12452 | 956 y(execution.)42 b(This)29 b(option)i(is)g(enabled)f(b)m(y)g |
12453 | (default.)630 1121 y Ft(-k)384 b Fu(All)34 b(argumen)m(ts)g(in)f(the)h | |
fc527055 | 12454 | (form)f(of)g(assignmen)m(t)h(statemen)m(ts)i(are)d(placed)h(in)1110 |
8a0829e9 CR |
12455 | 1230 y(the)k(en)m(vironmen)m(t)g(for)g(a)g(command,)h(not)f(just)f |
12456 | (those)i(that)f(precede)g(the)1110 1340 y(command)30 | |
12457 | b(name.)630 1504 y Ft(-m)384 b Fu(Job)32 b(con)m(trol)h(is)f(enabled)g | |
900a813b | 12458 | (\(see)h(Chapter)f(7)g([Job)g(Con)m(trol],)i(page)e(99\).)47 |
8a0829e9 | 12459 | b(All)1110 1614 y(pro)s(cesses)27 b(run)f(in)i(a)g(separate)g(pro)s |
fc527055 | 12460 | (cess)f(group.)40 b(When)27 b(a)h(bac)m(kground)f(job)1110 |
8a0829e9 CR |
12461 | 1724 y(completes,)32 b(the)f(shell)f(prin)m(ts)g(a)h(line)f(con)m |
12462 | (taining)i(its)f(exit)g(status.)630 1888 y Ft(-n)384 | |
fc527055 | 12463 | b Fu(Read)38 b(commands)f(but)f(do)i(not)f(execute)i(them.)62 |
8a0829e9 | 12464 | b(This)37 b(ma)m(y)h(b)s(e)f(used)f(to)1110 1998 y(c)m(hec)m(k)d(a)e |
fc527055 | 12465 | (script)g(for)g(syn)m(tax)h(errors.)42 b(This)30 b(option)i(is)f |
8a0829e9 CR |
12466 | (ignored)g(b)m(y)g(in)m(terac-)1110 2107 y(tiv)m(e)h(shells.)630 |
12467 | 2271 y Ft(-o)e Fj(option-name)1110 2381 y Fu(Set)h(the)f(option)h | |
15baad62 | 12468 | (corresp)s(onding)e(to)i Fr(option-name)5 b Fu(:)1110 |
8a0829e9 CR |
12469 | 2545 y Ft(allexport)1590 2655 y Fu(Same)30 b(as)h Ft(-a)p |
12470 | Fu(.)1110 2819 y Ft(braceexpand)1590 2929 y Fu(Same)f(as)h | |
12471 | Ft(-B)p Fu(.)1110 3093 y Ft(emacs)240 b Fu(Use)25 b(an)f | |
15baad62 | 12472 | Ft(emacs)p Fu(-st)m(yle)h(line)f(editing)h(in)m(terface)h(\(see)g |
8a0829e9 | 12473 | (Chapter)e(8)1590 3203 y([Command)33 b(Line)g(Editing],)h(page)h |
900a813b | 12474 | (103\).)51 b(This)32 b(also)i(a\013ects)1590 3313 y(the)d(editing)g(in) |
8a0829e9 | 12475 | m(terface)h(used)d(for)h Ft(read)f(-e)p Fu(.)1110 3477 |
15baad62 | 12476 | y Ft(errexit)144 b Fu(Same)30 b(as)h Ft(-e)p Fu(.)1110 |
8a0829e9 CR |
12477 | 3641 y Ft(errtrace)96 b Fu(Same)30 b(as)h Ft(-E)p Fu(.)1110 |
12478 | 3806 y Ft(functrace)1590 3915 y Fu(Same)f(as)h Ft(-T)p | |
12479 | Fu(.)1110 4080 y Ft(hashall)144 b Fu(Same)30 b(as)h Ft(-h)p | |
12480 | Fu(.)1110 4244 y Ft(histexpand)1590 4354 y Fu(Same)f(as)h | |
12481 | Ft(-H)p Fu(.)1110 4518 y Ft(history)144 b Fu(Enable)39 | |
15baad62 | 12482 | b(command)g(history)-8 b(,)42 b(as)d(describ)s(ed)f(in)h(Section)h(9.1) |
900a813b | 12483 | 1590 4628 y([Bash)d(History)g(F)-8 b(acilities],)41 b(page)c(136.)60 |
8a0829e9 CR |
12484 | b(This)36 b(option)h(is)f(on)1590 4737 y(b)m(y)30 b(default)h(in)f(in)m |
12485 | (teractiv)m(e)j(shells.)1110 4902 y Ft(ignoreeof)1590 | |
12486 | 5011 y Fu(An)d(in)m(teractiv)m(e)j(shell)e(will)g(not)f(exit)h(up)s(on) | |
12487 | e(reading)i(EOF.)1110 5176 y Ft(keyword)144 b Fu(Same)30 | |
12488 | b(as)h Ft(-k)p Fu(.)1110 5340 y Ft(monitor)144 b Fu(Same)30 | |
12489 | b(as)h Ft(-m)p Fu(.)p eop end | |
6e51e0d0 CR |
12490 | %%Page: 61 67 |
12491 | TeXDict begin 61 66 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12492 | b(Shell)30 b(Builtin)h(Commands)2069 b(61)1110 299 y | |
8a0829e9 CR |
12493 | Ft(noclobber)1590 408 y Fu(Same)30 b(as)h Ft(-C)p Fu(.)1110 |
12494 | 563 y Ft(noexec)192 b Fu(Same)30 b(as)h Ft(-n)p Fu(.)1110 | |
12495 | 718 y Ft(noglob)192 b Fu(Same)30 b(as)h Ft(-f)p Fu(.)1110 | |
12496 | 873 y Ft(nolog)240 b Fu(Curren)m(tly)30 b(ignored.)1110 | |
12497 | 1027 y Ft(notify)192 b Fu(Same)30 b(as)h Ft(-b)p Fu(.)1110 | |
12498 | 1182 y Ft(nounset)144 b Fu(Same)30 b(as)h Ft(-u)p Fu(.)1110 | |
12499 | 1337 y Ft(onecmd)192 b Fu(Same)30 b(as)h Ft(-t)p Fu(.)1110 | |
12500 | 1491 y Ft(physical)96 b Fu(Same)30 b(as)h Ft(-P)p Fu(.)1110 | |
12501 | 1646 y Ft(pipefail)96 b Fu(If)44 b(set,)k(the)d(return)e(v)-5 | |
fc527055 | 12502 | b(alue)45 b(of)f(a)h(pip)s(eline)e(is)i(the)f(v)-5 b(alue)45 |
8a0829e9 CR |
12503 | b(of)1590 1756 y(the)33 b(last)h(\(righ)m(tmost\))h(command)e(to)h |
12504 | (exit)g(with)f(a)g(non-zero)1590 1865 y(status,)28 b(or)f(zero)g(if)f | |
fc527055 | 12505 | (all)i(commands)e(in)g(the)h(pip)s(eline)f(exit)i(suc-)1590 |
8a0829e9 CR |
12506 | 1975 y(cessfully)-8 b(.)41 b(This)30 b(option)h(is)f(disabled)g(b)m(y)h |
12507 | (default.)1110 2130 y Ft(posix)240 b Fu(Change)30 b(the)g(b)s(eha)m | |
fc527055 | 12508 | (vior)h(of)f(Bash)g(where)g(the)g(default)h(op)s(era-)1590 |
8a0829e9 CR |
12509 | 2239 y(tion)25 b(di\013ers)f(from)g(the)h Fm(posix)f |
12510 | Fu(standard)f(to)i(matc)m(h)h(the)f(stan-)1590 2349 y(dard)32 | |
900a813b | 12511 | b(\(see)i(Section)g(6.11)h([Bash)e(POSIX)f(Mo)s(de],)j(page)e(95\).) |
8a0829e9 CR |
12512 | 1590 2458 y(This)k(is)g(in)m(tended)g(to)h(mak)m(e)g(Bash)g(b)s(eha)m |
12513 | (v)m(e)g(as)g(a)f(strict)h(su-)1590 2568 y(p)s(erset)30 | |
12514 | b(of)h(that)f(standard.)1110 2723 y Ft(privileged)1590 | |
12515 | 2832 y Fu(Same)g(as)h Ft(-p)p Fu(.)1110 2987 y Ft(verbose)144 | |
12516 | b Fu(Same)30 b(as)h Ft(-v)p Fu(.)1110 3142 y Ft(vi)384 | |
6e51e0d0 | 12517 | b Fu(Use)36 b(a)g Ft(vi)p Fu(-st)m(yle)g(line)g(editing)g(in)m |
8a0829e9 | 12518 | (terface.)58 b(This)35 b(also)h(a\013ects)1590 3251 y(the)31 |
6e51e0d0 | 12519 | b(editing)g(in)m(terface)h(used)d(for)h Ft(read)f(-e)p |
8a0829e9 CR |
12520 | Fu(.)1110 3406 y Ft(xtrace)192 b Fu(Same)30 b(as)h Ft(-x)p |
12521 | Fu(.)630 3561 y Ft(-p)384 b Fu(T)-8 b(urn)33 b(on)h(privileged)h(mo)s | |
6e51e0d0 | 12522 | (de.)51 b(In)34 b(this)g(mo)s(de,)h(the)f Ft($BASH_ENV)e |
8a0829e9 | 12523 | Fu(and)h Ft($ENV)1110 3670 y Fu(\014les)23 b(are)h(not)f(pro)s(cessed,) |
ad4aef08 | 12524 | h(shell)g(functions)e(are)i(not)f(inherited)g(from)f(the)i(en-)1110 |
8a0829e9 | 12525 | 3780 y(vironmen)m(t,)h(and)e(the)g Ft(SHELLOPTS)p Fu(,)f |
6e51e0d0 | 12526 | Ft(BASHOPTS)p Fu(,)h Ft(CDPATH)e Fu(and)i Ft(GLOBIGNORE)1110 |
8a0829e9 | 12527 | 3890 y Fu(v)-5 b(ariables,)23 b(if)e(they)g(app)s(ear)f(in)g(the)h(en)m |
aaf6036e | 12528 | (vironmen)m(t,)i(are)e(ignored.)38 b(If)20 b(the)h(shell)1110 |
8a0829e9 | 12529 | 3999 y(is)37 b(started)h(with)f(the)g(e\013ectiv)m(e)j(user)d |
ad4aef08 | 12530 | (\(group\))g(id)g(not)g(equal)h(to)g(the)f(real)1110 |
8a0829e9 CR |
12531 | 4109 y(user)h(\(group\))h(id,)i(and)d(the)h Ft(-p)f Fu(option)i(is)e |
12532 | (not)i(supplied,)f(these)h(actions)1110 4218 y(are)32 | |
6e51e0d0 | 12533 | b(tak)m(en)i(and)d(the)h(e\013ectiv)m(e)j(user)c(id)h(is)g(set)h(to)f |
8a0829e9 | 12534 | (the)h(real)f(user)g(id.)45 b(If)32 b(the)1110 4328 y |
6e51e0d0 | 12535 | Ft(-p)i Fu(option)h(is)g(supplied)f(at)h(startup,)h(the)f(e\013ectiv)m |
8a0829e9 | 12536 | (e)i(user)d(id)g(is)h(not)g(reset.)1110 4437 y(T)-8 b(urning)35 |
6e51e0d0 | 12537 | b(this)i(option)g(o\013)g(causes)g(the)g(e\013ectiv)m(e)i(user)d(and)g |
8a0829e9 CR |
12538 | (group)g(ids)g(to)1110 4547 y(b)s(e)30 b(set)h(to)g(the)f(real)h(user)f |
12539 | (and)g(group)g(ids.)630 4702 y Ft(-t)384 b Fu(Exit)31 | |
6e51e0d0 | 12540 | b(after)g(reading)f(and)g(executing)h(one)g(command.)630 |
8a0829e9 | 12541 | 4856 y Ft(-u)384 b Fu(T)-8 b(reat)25 b(unset)e(v)-5 b(ariables)25 |
6e51e0d0 | 12542 | b(and)e(parameters)h(other)h(than)e(the)h(sp)s(ecial)h(param-)1110 |
8a0829e9 | 12543 | 4966 y(eters)35 b(`)p Ft(@)p Fu(')f(or)g(`)p Ft(*)p Fu(')h(as)f(an)g |
6e51e0d0 | 12544 | (error)g(when)f(p)s(erforming)g(parameter)i(expansion.)1110 |
8a0829e9 CR |
12545 | 5076 y(An)28 b(error)h(message)g(will)g(b)s(e)f(written)h(to)h(the)e |
12546 | (standard)g(error,)h(and)f(a)h(non-)1110 5185 y(in)m(teractiv)m(e)k | |
12547 | (shell)e(will)g(exit.)630 5340 y Ft(-v)384 b Fu(Prin)m(t)30 | |
12548 | b(shell)h(input)e(lines)i(as)g(they)f(are)h(read.)p eop | |
12549 | end | |
fc527055 CR |
12550 | %%Page: 62 68 |
12551 | TeXDict begin 62 67 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
8a0829e9 CR |
12552 | b(Shell)30 b(Builtin)h(Commands)2069 b(62)630 299 y Ft(-x)384 |
12553 | b Fu(Prin)m(t)21 b(a)h(trace)h(of)f(simple)f(commands,)i | |
12554 | Ft(for)e Fu(commands,)i Ft(case)d Fu(commands,)1110 408 | |
12555 | y Ft(select)29 b Fu(commands,)j(and)e(arithmetic)j Ft(for)d | |
12556 | Fu(commands)h(and)f(their)i(argu-)1110 518 y(men)m(ts)h(or)f(asso)s | |
12557 | (ciated)i(w)m(ord)e(lists)h(after)g(they)f(are)h(expanded)f(and)f(b)s | |
12558 | (efore)1110 628 y(they)i(are)g(executed.)49 b(The)32 | |
12559 | b(v)-5 b(alue)33 b(of)g(the)g Ft(PS4)f Fu(v)-5 b(ariable)34 | |
12560 | b(is)f(expanded)f(and)1110 737 y(the)24 b(resultan)m(t)h(v)-5 | |
12561 | b(alue)24 b(is)g(prin)m(ted)g(b)s(efore)f(the)h(command)g(and)f(its)i | |
12562 | (expanded)1110 847 y(argumen)m(ts.)630 1000 y Ft(-B)384 | |
12563 | b Fu(The)41 b(shell)g(will)g(p)s(erform)f(brace)h(expansion)g(\(see)h | |
12564 | (Section)g(3.5.1)g([Brace)1110 1110 y(Expansion],)30 | |
12565 | b(page)h(21\).)42 b(This)30 b(option)h(is)f(on)g(b)m(y)h(default.)630 | |
12566 | 1263 y Ft(-C)384 b Fu(Prev)m(en)m(t)25 b(output)e(redirection)h(using)f | |
12567 | (`)p Ft(>)p Fu(',)i(`)p Ft(>&)p Fu(',)g(and)e(`)p Ft(<>)p | |
12568 | Fu(')g(from)h(o)m(v)m(erwriting)1110 1373 y(existing)31 | |
12569 | b(\014les.)630 1526 y Ft(-E)384 b Fu(If)39 b(set,)j(an)m(y)e(trap)f(on) | |
12570 | g Ft(ERR)g Fu(is)g(inherited)g(b)m(y)g(shell)h(functions,)h(command) | |
12571 | 1110 1636 y(substitutions,)35 b(and)e(commands)g(executed)i(in)f(a)g | |
12572 | (subshell)f(en)m(vironmen)m(t.)1110 1745 y(The)d Ft(ERR)f | |
12573 | Fu(trap)i(is)f(normally)h(not)f(inherited)g(in)g(suc)m(h)g(cases.)630 | |
12574 | 1899 y Ft(-H)384 b Fu(Enable)38 b(`)p Ft(!)p Fu(')h(st)m(yle)h(history) | |
12575 | e(substitution)g(\(see)h(Section)h(9.3)f([History)g(In-)1110 | |
900a813b | 12576 | 2008 y(teraction],)g(page)d(138\).)57 b(This)34 b(option)i(is)f(on)g(b) |
8a0829e9 CR |
12577 | m(y)h(default)f(for)g(in)m(teractiv)m(e)1110 2118 y(shells.)630 |
12578 | 2271 y Ft(-P)384 b Fu(If)39 b(set,)j(do)d(not)g(resolv)m(e)i(sym)m(b)s | |
12579 | (olic)e(links)g(when)f(p)s(erforming)g(commands)1110 | |
12580 | 2381 y(suc)m(h)29 b(as)h Ft(cd)f Fu(whic)m(h)g(c)m(hange)h(the)g | |
12581 | (curren)m(t)f(directory)-8 b(.)42 b(The)28 b(ph)m(ysical)j(direc-)1110 | |
12582 | 2491 y(tory)j(is)g(used)f(instead.)52 b(By)34 b(default,)h(Bash)f | |
12583 | (follo)m(ws)h(the)f(logical)i(c)m(hain)f(of)1110 2600 | |
12584 | y(directories)j(when)d(p)s(erforming)h(commands)g(whic)m(h)g(c)m(hange) | |
12585 | i(the)f(curren)m(t)1110 2710 y(directory)-8 b(.)1110 | |
12586 | 2841 y(F)g(or)42 b(example,)i(if)d Ft(/usr/sys)e Fu(is)i(a)g(sym)m(b)s | |
12587 | (olic)g(link)g(to)h Ft(/usr/local/sys)1110 2951 y Fu(then:)1350 | |
12588 | 3082 y Ft($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 3192 | |
12589 | y(/usr/sys)1350 3302 y($)g(cd)h(..;)f(pwd)1350 3411 y(/usr)1110 | |
12590 | 3543 y Fu(If)30 b Ft(set)f(-P)h Fu(is)h(on,)f(then:)1350 | |
12591 | 3674 y Ft($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 3784 | |
12592 | y(/usr/local/sys)1350 3893 y($)g(cd)h(..;)f(pwd)1350 | |
12593 | 4003 y(/usr/local)630 4156 y(-T)384 b Fu(If)34 b(set,)j(an)m(y)e(trap)g | |
12594 | (on)g Ft(DEBUG)e Fu(and)i Ft(RETURN)e Fu(are)i(inherited)g(b)m(y)f | |
12595 | (shell)i(func-)1110 4266 y(tions,)k(command)d(substitutions,)h(and)f | |
12596 | (commands)g(executed)h(in)f(a)h(sub-)1110 4376 y(shell)33 | |
12597 | b(en)m(vironmen)m(t.)49 b(The)32 b Ft(DEBUG)g Fu(and)g | |
12598 | Ft(RETURN)f Fu(traps)h(are)i(normally)f(not)1110 4485 | |
12599 | y(inherited)d(in)g(suc)m(h)g(cases.)630 4639 y Ft(--)384 | |
12600 | b Fu(If)44 b(no)g(argumen)m(ts)g(follo)m(w)i(this)e(option,)k(then)c | |
12601 | (the)h(p)s(ositional)g(parame-)1110 4748 y(ters)31 b(are)g(unset.)40 | |
12602 | b(Otherwise,)31 b(the)f(p)s(ositional)i(parameters)f(are)f(set)h(to)h | |
12603 | (the)1110 4858 y Fr(argumen)m(ts)p Fu(,)f(ev)m(en)g(if)f(some)h(of)g | |
12604 | (them)f(b)s(egin)g(with)g(a)h(`)p Ft(-)p Fu('.)630 5011 | |
12605 | y Ft(-)432 b Fu(Signal)45 b(the)g(end)f(of)h(options,)k(cause)c(all)h | |
12606 | (remaining)e Fr(argumen)m(ts)49 b Fu(to)d(b)s(e)1110 | |
12607 | 5121 y(assigned)33 b(to)h(the)g(p)s(ositional)g(parameters.)49 | |
12608 | b(The)33 b Ft(-x)g Fu(and)f Ft(-v)h Fu(options)h(are)1110 | |
12609 | 5230 y(turned)k(o\013.)68 b(If)38 b(there)i(are)f(no)g(argumen)m(ts,)j | |
12610 | (the)e(p)s(ositional)g(parameters)1110 5340 y(remain)30 | |
12611 | b(unc)m(hanged.)p eop end | |
fc527055 CR |
12612 | %%Page: 63 69 |
12613 | TeXDict begin 63 68 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
8a0829e9 CR |
12614 | b(Shell)30 b(Builtin)h(Commands)2069 b(63)630 299 y(Using)27 |
12615 | b(`)p Ft(+)p Fu(')h(rather)f(than)g(`)p Ft(-)p Fu(')g(causes)h(these)f | |
12616 | (options)h(to)g(b)s(e)e(turned)g(o\013.)40 b(The)27 b(options)h(can)630 | |
12617 | 408 y(also)36 b(b)s(e)f(used)f(up)s(on)g(in)m(v)m(o)s(cation)j(of)e | |
12618 | (the)g(shell.)56 b(The)34 b(curren)m(t)h(set)h(of)f(options)h(ma)m(y)g | |
12619 | (b)s(e)630 518 y(found)29 b(in)h Ft($-)p Fu(.)630 659 | |
12620 | y(The)43 b(remaining)h(N)f Fr(argumen)m(ts)48 b Fu(are)c(p)s(ositional) | |
12621 | g(parameters)g(and)f(are)h(assigned,)j(in)630 769 y(order,)30 | |
6e51e0d0 CR |
12622 | b(to)h Ft($1)p Fu(,)f Ft($2)p Fu(,)36 b(.)22 b(.)g(.)42 |
12623 | b Ft($N)p Fu(.)e(The)30 b(sp)s(ecial)h(parameter)g Ft(#)f | |
8a0829e9 | 12624 | Fu(is)g(set)h(to)g(N.)630 910 y(The)f(return)f(status)i(is)f(alw)m(a)m |
ed35cb4a | 12625 | (ys)i(zero)f(unless)f(an)g(in)m(v)-5 b(alid)31 b(option)g(is)f |
8a0829e9 CR |
12626 | (supplied.)150 1123 y Fk(4.3.2)63 b(The)41 b(Shopt)h(Builtin)150 |
12627 | 1270 y Fu(This)30 b(builtin)g(allo)m(ws)h(y)m(ou)g(to)g(c)m(hange)h | |
45c0f7f8 | 12628 | (additional)f(shell)f(optional)i(b)s(eha)m(vior.)150 |
8a0829e9 CR |
12629 | 1450 y Ft(shopt)870 1591 y(shopt)46 b([-pqsu])g([-o])h([)p |
12630 | Fj(optname)e Ft(...])630 1732 y Fu(T)-8 b(oggle)37 b(the)e(v)-5 | |
6e51e0d0 | 12631 | b(alues)35 b(of)g(settings)h(con)m(trolling)g(optional)g(shell)f(b)s |
8a0829e9 | 12632 | (eha)m(vior.)55 b(The)34 b(settings)630 1842 y(can)24 |
6e51e0d0 CR |
12633 | b(b)s(e)g(either)h(those)f(listed)h(b)s(elo)m(w,)h(or,)f(if)g(the)f |
12634 | Ft(-o)f Fu(option)i(is)f(used,)h(those)g(a)m(v)-5 b(ailable)26 | |
8a0829e9 | 12635 | b(with)630 1952 y(the)k Ft(-o)f Fu(option)i(to)f(the)g |
fc527055 | 12636 | Ft(set)f Fu(builtin)h(command)f(\(see)i(Section)g(4.3.1)g([The)f(Set)g |
8a0829e9 | 12637 | (Builtin],)630 2061 y(page)i(59\).)45 b(With)32 b(no)f(options,)h(or)g |
fc527055 | 12638 | (with)f(the)g Ft(-p)g Fu(option,)h(a)g(list)g(of)f(all)i(settable)g |
8a0829e9 | 12639 | (options)630 2171 y(is)j(displa)m(y)m(ed,)h(with)f(an)f(indication)i |
fc527055 | 12640 | (of)e(whether)g(or)h(not)g(eac)m(h)h(is)e(set.)57 b(The)35 |
8a0829e9 | 12641 | b Ft(-p)g Fu(option)630 2280 y(causes)i(output)e(to)i(b)s(e)e(displa)m |
fc527055 | 12642 | (y)m(ed)i(in)f(a)g(form)g(that)h(ma)m(y)f(b)s(e)g(reused)f(as)h(input.) |
8a0829e9 CR |
12643 | 57 b(Other)630 2390 y(options)31 b(ha)m(v)m(e)g(the)g(follo)m(wing)h |
12644 | (meanings:)630 2563 y Ft(-s)384 b Fu(Enable)30 b(\(set\))i(eac)m(h)f | |
12645 | Fr(optname)p Fu(.)630 2736 y Ft(-u)384 b Fu(Disable)31 | |
12646 | b(\(unset\))g(eac)m(h)h Fr(optname)p Fu(.)630 2909 y | |
6e51e0d0 | 12647 | Ft(-q)384 b Fu(Suppresses)28 b(normal)h(output;)h(the)g(return)e |
8a0829e9 | 12648 | (status)i(indicates)h(whether)e(the)1110 3019 y Fr(optname)37 |
6e51e0d0 CR |
12649 | b Fu(is)31 b(set)h(or)f(unset.)43 b(If)31 b(m)m(ultiple)h |
12650 | Fr(optname)37 b Fu(argumen)m(ts)31 b(are)h(giv)m(en)1110 | |
8a0829e9 CR |
12651 | 3128 y(with)d Ft(-q)p Fu(,)g(the)g(return)f(status)h(is)g(zero)h(if)f |
12652 | (all)h Fr(optnames)j Fu(are)d(enabled;)f(non-)1110 3238 | |
12653 | y(zero)i(otherwise.)630 3411 y Ft(-o)384 b Fu(Restricts)22 | |
6e51e0d0 CR |
12654 | b(the)f(v)-5 b(alues)22 b(of)f Fr(optname)27 b Fu(to)22 |
12655 | b(b)s(e)e(those)i(de\014ned)e(for)h(the)g Ft(-o)f Fu(option)1110 | |
8a0829e9 CR |
12656 | 3520 y(to)31 b(the)g Ft(set)e Fu(builtin)h(\(see)h(Section)h(4.3.1)g |
12657 | ([The)e(Set)g(Builtin],)i(page)f(59\).)630 3693 y(If)e(either)i | |
6e51e0d0 CR |
12658 | Ft(-s)e Fu(or)h Ft(-u)f Fu(is)h(used)f(with)g(no)h Fr(optname)35 |
12659 | b Fu(argumen)m(ts,)c Ft(shopt)d Fu(sho)m(ws)h(only)h(those)630 | |
8a0829e9 CR |
12660 | 3803 y(options)h(whic)m(h)f(are)h(set)f(or)h(unset,)f(resp)s(ectiv)m |
12661 | (ely)-8 b(.)630 3944 y(Unless)30 b(otherwise)h(noted,)g(the)g | |
6e51e0d0 | 12662 | Ft(shopt)d Fu(options)j(are)g(disabled)f(\(o\013)7 b(\))32 |
8a0829e9 | 12663 | b(b)m(y)e(default.)630 4086 y(The)d(return)f(status)i(when)f(listing)h |
6e51e0d0 | 12664 | (options)g(is)f(zero)i(if)e(all)i Fr(optnames)i Fu(are)d(enabled,)g |
8a0829e9 | 12665 | (non-)630 4195 y(zero)40 b(otherwise.)66 b(When)39 b(setting)h(or)f |
6e51e0d0 | 12666 | (unsetting)g(options,)i(the)e(return)f(status)h(is)g(zero)630 |
8a0829e9 CR |
12667 | 4305 y(unless)30 b(an)g Fr(optname)36 b Fu(is)30 b(not)h(a)g(v)-5 |
12668 | b(alid)30 b(shell)h(option.)630 4446 y(The)f(list)h(of)f | |
12669 | Ft(shopt)f Fu(options)i(is:)630 4619 y Ft(autocd)192 | |
6e51e0d0 | 12670 | b Fu(If)27 b(set,)h(a)g(command)f(name)g(that)h(is)f(the)g(name)g(of)h |
8a0829e9 | 12671 | (a)f(directory)h(is)f(executed)1110 4729 y(as)j(if)f(it)h(w)m(ere)f |
6e51e0d0 | 12672 | (the)h(argumen)m(t)g(to)g(the)f Ft(cd)g Fu(command.)40 |
8a0829e9 CR |
12673 | b(This)29 b(option)g(is)h(only)1110 4838 y(used)g(b)m(y)g(in)m |
12674 | (teractiv)m(e)j(shells.)630 5011 y Ft(cdable_vars)1110 | |
12675 | 5121 y Fu(If)h(this)h(is)g(set,)i(an)e(argumen)m(t)g(to)h(the)f | |
12676 | Ft(cd)f Fu(builtin)h(command)f(that)i(is)f(not)1110 5230 | |
ad4aef08 | 12677 | y(a)c(directory)g(is)g(assumed)f(to)h(b)s(e)f(the)h(name)f(of)h(a)g(v) |
8a0829e9 CR |
12678 | -5 b(ariable)31 b(whose)g(v)-5 b(alue)31 b(is)1110 5340 |
12679 | y(the)g(directory)f(to)i(c)m(hange)f(to.)p eop end | |
12680 | %%Page: 64 70 | |
12681 | TeXDict begin 64 69 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12682 | b(Shell)30 b(Builtin)h(Commands)2069 b(64)630 299 y Ft(cdspell)144 | |
6e51e0d0 | 12683 | b Fu(If)27 b(set,)h(minor)f(errors)f(in)h(the)g(sp)s(elling)h(of)f(a)g |
8a0829e9 | 12684 | (directory)h(comp)s(onen)m(t)f(in)g(a)h Ft(cd)1110 408 |
6e51e0d0 | 12685 | y Fu(command)i(will)h(b)s(e)f(corrected.)43 b(The)30 |
ad4aef08 | 12686 | b(errors)g(c)m(hec)m(k)m(ed)j(for)d(are)h(transp)s(osed)1110 |
8a0829e9 | 12687 | 518 y(c)m(haracters,)46 b(a)c(missing)f(c)m(haracter,)47 |
8e1a6eaa | 12688 | b(and)40 b(a)i(c)m(haracter)h(to)s(o)g(man)m(y)-8 b(.)74 |
8a0829e9 CR |
12689 | b(If)42 b(a)1110 628 y(correction)25 b(is)e(found,)g(the)h(corrected)g |
12690 | (path)f(is)g(prin)m(ted,)h(and)f(the)g(command)1110 737 | |
220537f2 | 12691 | y(pro)s(ceeds.)40 b(This)30 b(option)h(is)f(only)h(used)e(b)m(y)h(in)m |
967625cd | 12692 | (teractiv)m(e)k(shells.)630 902 y Ft(checkhash)1110 1011 |
8a0829e9 | 12693 | y Fu(If)29 b(this)h(is)g(set,)g(Bash)g(c)m(hec)m(ks)h(that)g(a)f |
967625cd | 12694 | (command)f(found)g(in)g(the)h(hash)f(table)1110 1121 |
8a0829e9 | 12695 | y(exists)k(b)s(efore)f(trying)h(to)h(execute)g(it.)48 |
967625cd | 12696 | b(If)32 b(a)h(hashed)e(command)i(no)f(longer)1110 1230 |
8a0829e9 | 12697 | y(exists,)f(a)g(normal)f(path)g(searc)m(h)h(is)g(p)s(erformed.)630 |
967625cd | 12698 | 1395 y Ft(checkjobs)1110 1504 y Fu(If)d(set,)i(Bash)e(lists)h(the)g |
8a0829e9 | 12699 | (status)g(of)f(an)m(y)h(stopp)s(ed)f(and)g(running)e(jobs)i(b)s(efore) |
967625cd | 12700 | 1110 1614 y(exiting)42 b(an)f(in)m(teractiv)m(e)j(shell.)72 |
8a0829e9 | 12701 | b(If)41 b(an)m(y)g(jobs)f(are)i(running,)g(this)f(causes)1110 |
967625cd CR |
12702 | 1724 y(the)30 b(exit)g(to)g(b)s(e)f(deferred)g(un)m(til)h(a)f(second)h |
12703 | (exit)g(is)g(attempted)h(without)e(an)1110 1833 y(in)m(terv)m(ening)j | |
900a813b | 12704 | (command)e(\(see)h(Chapter)f(7)h([Job)f(Con)m(trol],)i(page)f(99\).)42 |
967625cd CR |
12705 | b(The)1110 1943 y(shell)31 b(alw)m(a)m(ys)g(p)s(ostp)s(ones)f(exiting)h |
12706 | (if)g(an)m(y)f(jobs)g(are)h(stopp)s(ed.)630 2107 y Ft(checkwinsize)1110 | |
12707 | 2217 y Fu(If)41 b(set,)k(Bash)c(c)m(hec)m(ks)i(the)f(windo)m(w)e(size)j | |
12708 | (after)f(eac)m(h)g(command)f(and,)j(if)1110 2326 y(necessary)-8 | |
8a0829e9 | 12709 | b(,)31 b(up)s(dates)f(the)g(v)-5 b(alues)31 b(of)g Ft(LINES)e |
967625cd | 12710 | Fu(and)g Ft(COLUMNS)p Fu(.)630 2491 y Ft(cmdhist)144 |
fc527055 | 12711 | b Fu(If)33 b(set,)j(Bash)e(attempts)h(to)g(sa)m(v)m(e)g(all)g(lines)f |
967625cd | 12712 | (of)g(a)h(m)m(ultiple-line)g(command)1110 2600 y(in)c(the)g(same)g |
fc527055 | 12713 | (history)g(en)m(try)-8 b(.)42 b(This)30 b(allo)m(ws)i(easy)g |
967625cd CR |
12714 | (re-editing)g(of)f(m)m(ulti-line)1110 2710 y(commands.)630 |
12715 | 2874 y Ft(compat31)96 b Fu(If)27 b(set,)i(Bash)e(c)m(hanges)i(its)f(b)s | |
fc527055 | 12716 | (eha)m(vior)f(to)i(that)f(of)f(v)m(ersion)h(3.1)h(with)e(resp)s(ect) |
967625cd CR |
12717 | 1110 2984 y(to)39 b(quoted)f(argumen)m(ts)g(to)h(the)f(conditional)h |
12718 | (command's)f(`)p Ft(=~)p Fu(')g(op)s(erator)1110 3093 | |
fc527055 | 12719 | y(and)i(with)f(resp)s(ect)i(to)g(lo)s(cale-sp)s(eci\014c)h(string)e |
967625cd | 12720 | (comparison)g(when)f(using)1110 3203 y(the)31 b Ft([[)e |
fc527055 CR |
12721 | Fu(conditional)j(command's)e(`)p Ft(<)p Fu(')h(and)f(`)p |
12722 | Ft(>)p Fu(')g(op)s(erators.)41 b(Bash)31 b(v)m(ersions)1110 | |
967625cd CR |
12723 | 3313 y(prior)g(to)h(bash-4.1)g(use)g(ASCI)s(I)e(collation)j(and)e |
12724 | (strcmp\(3\);)i(bash-4.1)g(and)1110 3422 y(later)e(use)f(the)h(curren)m | |
fc527055 | 12725 | (t)f(lo)s(cale's)i(collation)h(sequence)e(and)f(strcoll\(3\).)630 |
967625cd | 12726 | 3587 y Ft(compat32)96 b Fu(If)27 b(set,)i(Bash)e(c)m(hanges)i(its)f(b)s |
fc527055 | 12727 | (eha)m(vior)f(to)i(that)f(of)f(v)m(ersion)h(3.2)h(with)e(resp)s(ect) |
967625cd CR |
12728 | 1110 3696 y(to)34 b(lo)s(cale-sp)s(eci\014c)h(string)e(comparison)g |
12729 | (when)f(using)h(the)g Ft([[)g Fu(conditional)1110 3806 | |
12730 | y(command's)21 b(`)p Ft(<)p Fu(')g(and)f(`)p Ft(>)p Fu(')h(op)s | |
12731 | (erators)g(\(see)h(previous)e(item\))i(and)e(the)h(e\013ect)i(of)1110 | |
12732 | 3915 y(in)m(terrupting)h(a)h(command)e(list.)40 b(Bash)24 | |
12733 | b(v)m(ersions)h(3.2)g(and)f(earlier)h(con)m(tin)m(ue)1110 | |
12734 | 4025 y(with)33 b(the)g(next)g(command)g(in)g(the)g(list)h(after)f(one)h | |
12735 | (terminates)g(due)e(to)i(an)1110 4134 y(in)m(terrupt.)630 | |
12736 | 4299 y Ft(compat40)96 b Fu(If)27 b(set,)i(Bash)e(c)m(hanges)i(its)f(b)s | |
12737 | (eha)m(vior)f(to)i(that)f(of)f(v)m(ersion)h(4.0)h(with)e(resp)s(ect) | |
12738 | 1110 4408 y(to)34 b(lo)s(cale-sp)s(eci\014c)h(string)e(comparison)g | |
12739 | (when)f(using)h(the)g Ft([[)g Fu(conditional)1110 4518 | |
12740 | y(command's)28 b(`)p Ft(<)p Fu(')h(and)f(`)p Ft(>)p Fu(')h(op)s | |
12741 | (erators)f(\(see)i(description)e(of)h Ft(compat31)p Fu(\))e(and)1110 | |
12742 | 4628 y(the)38 b(e\013ect)i(of)e(in)m(terrupting)f(a)i(command)e(list.) | |
12743 | 64 b(Bash)38 b(v)m(ersions)h(4.0)g(and)1110 4737 y(later)24 | |
fc527055 | 12744 | b(in)m(terrupt)f(the)g(list)h(as)g(if)f(the)h(shell)f(receiv)m(ed)i |
967625cd | 12745 | (the)e(in)m(terrupt;)i(previous)1110 4847 y(v)m(ersions)31 |
fc527055 | 12746 | b(con)m(tin)m(ue)g(with)f(the)h(next)g(command)f(in)g(the)g(list.)630 |
967625cd | 12747 | 5011 y Ft(compat41)96 b Fu(If)25 b(set,)j(Bash,)e(when)f(in)g |
fc527055 | 12748 | Fm(posix)g Fu(mo)s(de,)i(treats)f(a)g(single)h(quote)f(in)f(a)h |
967625cd CR |
12749 | (double-)1110 5121 y(quoted)46 b(parameter)h(expansion)f(as)g(a)h(sp)s |
12750 | (ecial)f(c)m(haracter.)90 b(The)45 b(single)1110 5230 | |
fc527055 | 12751 | y(quotes)34 b(m)m(ust)g(matc)m(h)h(\(an)f(ev)m(en)h(n)m(um)m(b)s(er\))e |
967625cd | 12752 | (and)g(the)h(c)m(haracters)h(b)s(et)m(w)m(een)1110 5340 |
fc527055 | 12753 | y(the)40 b(single)g(quotes)g(are)g(considered)g(quoted.)69 |
967625cd | 12754 | b(This)38 b(is)i(the)g(b)s(eha)m(vior)g(of)p eop end |
fc527055 CR |
12755 | %%Page: 65 71 |
12756 | TeXDict begin 65 70 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
967625cd CR |
12757 | b(Shell)30 b(Builtin)h(Commands)2069 b(65)1110 299 y |
12758 | Fm(posix)39 b Fu(mo)s(de)g(through)g(v)m(ersion)h(4.1.)69 | |
12759 | b(The)39 b(default)g(Bash)h(b)s(eha)m(vior)g(re-)1110 | |
12760 | 408 y(mains)30 b(as)h(in)f(previous)g(v)m(ersions.)630 | |
12761 | 564 y Ft(compat42)96 b Fu(If)29 b(set,)i(Bash)f(do)s(es)f(not)h(pro)s | |
12762 | (cess)g(the)g(replacemen)m(t)h(string)e(in)h(the)g(pattern)1110 | |
12763 | 674 y(substitution)g(w)m(ord)g(expansion)g(using)g(quote)h(remo)m(v)-5 | |
12764 | b(al.)630 830 y Ft(compat43)96 b Fu(If)24 b(set,)j(Bash)e(do)s(es)g | |
12765 | (not)g(prin)m(t)g(a)g(w)m(arning)g(message)h(if)f(an)g(attempt)h(is)f | |
12766 | (made)1110 939 y(to)43 b(use)g(a)g(quoted)f(comp)s(ound)f(arra)m(y)i | |
12767 | (assignmen)m(t)h(as)f(an)f(argumen)m(t)h(to)1110 1049 | |
12768 | y Ft(declare)p Fu(,)31 b(mak)m(es)i(w)m(ord)f(expansion)g(errors)g | |
12769 | (non-fatal)i(errors)d(that)i(cause)1110 1158 y(the)28 | |
12770 | b(curren)m(t)h(command)f(to)h(fail)g(\(the)f(default)h(b)s(eha)m(vior)f | |
12771 | (is)h(to)g(mak)m(e)g(them)1110 1268 y(fatal)42 b(errors)e(that)i(cause) | |
12772 | f(the)h(shell)f(to)g(exit\),)k(and)c(do)s(es)f(not)h(reset)h(the)1110 | |
12773 | 1377 y(lo)s(op)34 b(state)h(when)f(a)g(shell)g(function)g(is)g | |
12774 | (executed)h(\(this)f(allo)m(ws)h Ft(break)e Fu(or)1110 | |
12775 | 1487 y Ft(continue)25 b Fu(in)j(a)g(shell)g(function)f(to)i(a\013ect)g | |
12776 | (lo)s(ops)f(in)f(the)h(caller's)h(con)m(text\).)630 1643 | |
12777 | y Ft(complete_fullquote)1110 1752 y Fu(If)i(set,)g(Bash)h(quotes)f(all) | |
12778 | h(shell)f(metac)m(haracters)i(in)e(\014lenames)g(and)g(direc-)1110 | |
12779 | 1862 y(tory)g(names)f(when)g(p)s(erforming)f(completion.)43 | |
12780 | b(If)30 b(not)h(set,)g(Bash)g(remo)m(v)m(es)1110 1972 | |
8a0829e9 | 12781 | y(metac)m(haracters)40 b(suc)m(h)d(as)h(the)g(dollar)g(sign)g(from)f |
967625cd | 12782 | (the)h(set)g(of)f(c)m(haracters)1110 2081 y(that)f(will)g(b)s(e)f |
8a0829e9 | 12783 | (quoted)g(in)g(completed)i(\014lenames)e(when)f(these)i(metac)m(har-) |
967625cd | 12784 | 1110 2191 y(acters)29 b(app)s(ear)e(in)g(shell)h(v)-5 |
fc527055 | 12785 | b(ariable)28 b(references)g(in)f(w)m(ords)g(to)i(b)s(e)e(completed.) |
967625cd | 12786 | 1110 2300 y(This)k(means)i(that)g(dollar)f(signs)g(in)g(v)-5 |
fc527055 | 12787 | b(ariable)33 b(names)g(that)f(expand)g(to)h(di-)1110 |
967625cd CR |
12788 | 2410 y(rectories)28 b(will)g(not)f(b)s(e)f(quoted;)j(ho)m(w)m(ev)m(er,) |
12789 | g(an)m(y)e(dollar)h(signs)f(app)s(earing)f(in)1110 2519 | |
122f603c CR |
12790 | y(\014lenames)j(will)h(not)f(b)s(e)g(quoted,)h(either.)41 |
12791 | b(This)28 b(is)i(activ)m(e)h(only)e(when)g(bash)1110 | |
967625cd CR |
12792 | 2629 y(is)39 b(using)f(bac)m(kslashes)i(to)g(quote)g(completed)f |
12793 | (\014lenames.)67 b(This)38 b(v)-5 b(ariable)1110 2739 | |
122f603c | 12794 | y(is)41 b(set)g(b)m(y)g(default,)j(whic)m(h)c(is)h(the)g(default)g |
967625cd CR |
12795 | (Bash)g(b)s(eha)m(vior)g(in)g(v)m(ersions)1110 2848 y(through)30 |
12796 | b(4.2.)630 3004 y Ft(direxpand)1110 3114 y Fu(If)k(set,)i(Bash)f | |
122f603c | 12797 | (replaces)g(directory)g(names)g(with)f(the)g(results)h(of)f(w)m(ord)g |
967625cd CR |
12798 | (ex-)1110 3223 y(pansion)k(when)g(p)s(erforming)f(\014lename)i |
12799 | (completion.)67 b(This)38 b(c)m(hanges)i(the)1110 3333 | |
fc527055 | 12800 | y(con)m(ten)m(ts)29 b(of)e(the)g(readline)h(editing)g(bu\013er.)38 |
967625cd | 12801 | b(If)27 b(not)g(set,)i(Bash)e(attempts)h(to)1110 3442 |
fc527055 | 12802 | y(preserv)m(e)j(what)f(the)g(user)g(t)m(yp)s(ed.)630 |
967625cd | 12803 | 3598 y Ft(dirspell)96 b Fu(If)26 b(set,)i(Bash)f(attempts)g(sp)s |
fc527055 | 12804 | (elling)g(correction)g(on)g(directory)g(names)f(during)1110 |
967625cd CR |
12805 | 3708 y(w)m(ord)36 b(completion)h(if)f(the)g(directory)g(name)g |
12806 | (initially)h(supplied)e(do)s(es)h(not)1110 3817 y(exist.)630 | |
12807 | 3973 y Ft(dotglob)144 b Fu(If)27 b(set,)i(Bash)f(includes)g | |
fc527055 | 12808 | (\014lenames)g(b)s(eginning)f(with)g(a)h(`.')41 b(in)27 |
967625cd CR |
12809 | b(the)h(results)g(of)1110 4083 y(\014lename)j(expansion.)630 |
12810 | 4238 y Ft(execfail)96 b Fu(If)24 b(this)h(is)f(set,)j(a)e(non-in)m | |
45c0f7f8 | 12811 | (teractiv)m(e)i(shell)e(will)f(not)h(exit)h(if)e(it)h(cannot)h(execute) |
967625cd | 12812 | 1110 4348 y(the)i(\014le)g(sp)s(eci\014ed)g(as)g(an)g(argumen)m(t)g(to) |
6e51e0d0 | 12813 | h(the)f Ft(exec)f Fu(builtin)h(command.)39 b(An)1110 |
967625cd CR |
12814 | 4457 y(in)m(teractiv)m(e)33 b(shell)e(do)s(es)f(not)g(exit)i(if)e |
12815 | Ft(exec)f Fu(fails.)630 4613 y Ft(expand_aliases)1110 | |
12816 | 4723 y Fu(If)j(set,)h(aliases)g(are)g(expanded)e(as)h(describ)s(ed)f(b) | |
12817 | s(elo)m(w)h(under)f(Aliases,)i(Sec-)1110 4832 y(tion)38 | |
900a813b | 12818 | b(6.6)h([Aliases],)j(page)d(89.)64 b(This)37 b(option)h(is)g(enabled)g |
967625cd CR |
12819 | (b)m(y)g(default)g(for)1110 4942 y(in)m(teractiv)m(e)33 |
12820 | b(shells.)630 5098 y Ft(extdebug)96 b Fu(If)30 b(set,)h(b)s(eha)m(vior) | |
ad4aef08 | 12821 | g(in)m(tended)f(for)g(use)g(b)m(y)g(debuggers)g(is)h(enabled:)1159 |
967625cd | 12822 | 5230 y(1.)61 b(The)37 b Ft(-F)g Fu(option)h(to)g(the)g |
6e51e0d0 | 12823 | Ft(declare)d Fu(builtin)i(\(see)i(Section)f(4.2)h([Bash)1290 |
967625cd CR |
12824 | 5340 y(Builtins],)29 b(page)g(48\))g(displa)m(ys)f(the)g(source)h |
12825 | (\014le)f(name)g(and)f(line)h(n)m(um-)p eop end | |
fc527055 CR |
12826 | %%Page: 66 72 |
12827 | TeXDict begin 66 71 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
967625cd CR |
12828 | b(Shell)30 b(Builtin)h(Commands)2069 b(66)1290 299 y(b)s(er)29 |
12829 | b(corresp)s(onding)g(to)i(eac)m(h)g(function)f(name)g(supplied)f(as)i | |
12830 | (an)f(argu-)1290 408 y(men)m(t.)1159 541 y(2.)61 b(If)20 | |
12831 | b(the)h(command)g(run)e(b)m(y)i(the)f Ft(DEBUG)g Fu(trap)g(returns)g(a) | |
12832 | h(non-zero)g(v)-5 b(alue,)1290 651 y(the)31 b(next)f(command)g(is)h | |
12833 | (skipp)s(ed)e(and)g(not)i(executed.)1159 783 y(3.)61 | |
33723c84 CR |
12834 | b(If)37 b(the)g(command)g(run)f(b)m(y)i(the)f Ft(DEBUG)f |
12835 | Fu(trap)h(returns)f(a)i(v)-5 b(alue)38 b(of)f(2,)1290 | |
967625cd CR |
12836 | 893 y(and)c(the)g(shell)h(is)f(executing)i(in)e(a)h(subroutine)e(\(a)i |
12837 | (shell)g(function)f(or)1290 1003 y(a)h(shell)g(script)f(executed)h(b)m | |
33723c84 | 12838 | (y)g(the)f Ft(.)h Fu(or)f Ft(source)f Fu(builtins\),)i(the)g(shell)1290 |
967625cd CR |
12839 | 1112 y(sim)m(ulates)d(a)g(call)h(to)f Ft(return)p Fu(.)1159 |
12840 | 1245 y(4.)61 b Ft(BASH_ARGC)34 b Fu(and)i Ft(BASH_ARGV)e | |
33723c84 | 12841 | Fu(are)j(up)s(dated)e(as)h(describ)s(ed)g(in)g(their)1290 |
967625cd CR |
12842 | 1354 y(descriptions)30 b(\(see)i(Section)f(5.2)g([Bash)g(V)-8 |
12843 | b(ariables],)32 b(page)f(70\).)1159 1487 y(5.)61 b(F)-8 | |
900a813b | 12844 | b(unction)57 b(tracing)g(is)g(enabled:)93 b(command)56 |
967625cd | 12845 | b(substitution,)63 b(shell)1290 1597 y(functions,)32 |
33723c84 | 12846 | b(and)e(subshells)h(in)m(v)m(ok)m(ed)i(with)e Ft(\()f |
967625cd CR |
12847 | Fj(command)e Ft(\))j Fu(inherit)h(the)1290 1706 y Ft(DEBUG)d |
12848 | Fu(and)h Ft(RETURN)e Fu(traps.)1159 1839 y(6.)61 b(Error)41 | |
33723c84 | 12849 | b(tracing)i(is)f(enabled:)63 b(command)42 b(substitution,)i(shell)f |
967625cd | 12850 | (func-)1290 1948 y(tions,)32 b(and)e(subshells)g(in)m(v)m(ok)m(ed)i |
33723c84 | 12851 | (with)e Ft(\()g Fj(command)f Ft(\))h Fu(inherit)h(the)g |
967625cd | 12852 | Ft(ERR)1290 2058 y Fu(trap.)630 2214 y Ft(extglob)144 |
33723c84 | 12853 | b Fu(If)26 b(set,)i(the)f(extended)f(pattern)h(matc)m(hing)g(features)g |
967625cd | 12854 | (describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)1110 2323 y(Section)j(3.5.8.1)i |
33723c84 | 12855 | ([P)m(attern)f(Matc)m(hing],)g(page)f(31\))h(are)f(enabled.)630 |
967625cd | 12856 | 2479 y Ft(extquote)96 b Fu(If)51 b(set,)58 b Ft($')p |
900a813b | 12857 | Fj(string)p Ft(')49 b Fu(and)i Ft($")p Fj(string)p Ft(")e |
967625cd | 12858 | Fu(quoting)k(is)e(p)s(erformed)f(within)1110 2589 y Ft(${)p |
900a813b | 12859 | Fj(parameter)p Ft(})31 b Fu(expansions)k(enclosed)g(in)g(double)f |
967625cd CR |
12860 | (quotes.)55 b(This)33 b(option)1110 2698 y(is)d(enabled)h(b)m(y)f |
12861 | (default.)630 2854 y Ft(failglob)96 b Fu(If)36 b(set,)j(patterns)d | |
900a813b | 12862 | (whic)m(h)g(fail)h(to)h(matc)m(h)f(\014lenames)f(during)g(\014lename)g |
967625cd CR |
12863 | (ex-)1110 2964 y(pansion)30 b(result)g(in)g(an)g(expansion)h(error.)630 |
12864 | 3119 y Ft(force_fignore)1110 3229 y Fu(If)43 b(set,)k(the)d(su\016xes)f | |
6e51e0d0 | 12865 | (sp)s(eci\014ed)f(b)m(y)i(the)f Ft(FIGNORE)f Fu(shell)h(v)-5 |
967625cd | 12866 | b(ariable)44 b(cause)1110 3339 y(w)m(ords)31 b(to)h(b)s(e)f(ignored)h |
fc527055 | 12867 | (when)f(p)s(erforming)f(w)m(ord)h(completion)i(ev)m(en)f(if)g(the)1110 |
967625cd CR |
12868 | 3448 y(ignored)37 b(w)m(ords)g(are)g(the)h(only)f(p)s(ossible)g |
12869 | (completions.)62 b(See)37 b(Section)h(5.2)1110 3558 y([Bash)24 | |
900a813b | 12870 | b(V)-8 b(ariables],)27 b(page)e(70,)h(for)d(a)h(description)g(of)g |
967625cd CR |
12871 | Ft(FIGNORE)p Fu(.)37 b(This)22 b(option)1110 3667 y(is)30 |
12872 | b(enabled)h(b)m(y)f(default.)630 3823 y Ft(globasciiranges)1110 | |
12873 | 3933 y Fu(If)j(set,)h(range)f(expressions)g(used)f(in)h(pattern)g(matc) | |
12874 | m(hing)h(brac)m(k)m(et)h(expres-)1110 4042 y(sions)28 | |
fc527055 | 12875 | b(\(see)h(Section)h(3.5.8.1)g([P)m(attern)g(Matc)m(hing],)h(page)e |
967625cd | 12876 | (31\))g(b)s(eha)m(v)m(e)g(as)g(if)1110 4152 y(in)i(the)g(traditional)i |
fc527055 | 12877 | (C)d(lo)s(cale)j(when)d(p)s(erforming)g(comparisons.)44 |
967625cd | 12878 | b(That)31 b(is,)1110 4261 y(the)d(curren)m(t)g(lo)s(cale's)i(collating) |
fc527055 | 12879 | h(sequence)d(is)h(not)f(tak)m(en)h(in)m(to)g(accoun)m(t,)i(so)1110 |
967625cd | 12880 | 4371 y(`)p Ft(b)p Fu(')j(will)g(not)g(collate)i(b)s(et)m(w)m(een)e(`)p |
fc527055 | 12881 | Ft(A)p Fu(')g(and)f(`)p Ft(B)p Fu(',)h(and)f(upp)s(er-case)g(and)g(lo)m |
967625cd CR |
12882 | (w)m(er-)1110 4481 y(case)e(ASCI)s(I)e(c)m(haracters)j(will)f(collate)i |
12883 | (together.)630 4636 y Ft(globstar)96 b Fu(If)38 b(set,)j(the)e(pattern) | |
fc527055 | 12884 | f(`)p Ft(**)p Fu(')h(used)e(in)i(a)f(\014lename)h(expansion)f(con)m |
967625cd | 12885 | (text)j(will)1110 4746 y(matc)m(h)36 b(all)g(\014les)f(and)f(zero)i(or) |
fc527055 | 12886 | f(more)g(directories)h(and)e(sub)s(directories.)54 b(If)1110 |
967625cd | 12887 | 4855 y(the)30 b(pattern)g(is)g(follo)m(w)m(ed)i(b)m(y)d(a)i(`)p |
6e51e0d0 | 12888 | Ft(/)p Fu(',)f(only)g(directories)h(and)f(sub)s(directories)1110 |
967625cd | 12889 | 4965 y(matc)m(h.)630 5121 y Ft(gnu_errfmt)1110 5230 y |
6e51e0d0 | 12890 | Fu(If)35 b(set,)j(shell)e(error)g(messages)g(are)h(written)e(in)h(the)g |
967625cd CR |
12891 | (standard)f Fm(gnu)g Fu(error)1110 5340 y(message)c(format.)p |
12892 | eop end | |
6e51e0d0 CR |
12893 | %%Page: 67 73 |
12894 | TeXDict begin 67 72 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
967625cd CR |
12895 | b(Shell)30 b(Builtin)h(Commands)2069 b(67)630 299 y Ft(histappend)1110 |
12896 | 408 y Fu(If)27 b(set,)j(the)e(history)g(list)g(is)g(app)s(ended)e(to)j | |
12897 | (the)f(\014le)g(named)f(b)m(y)h(the)g(v)-5 b(alue)29 | |
12898 | b(of)1110 518 y(the)d Ft(HISTFILE)d Fu(v)-5 b(ariable)26 | |
12899 | b(when)e(the)h(shell)h(exits,)h(rather)e(than)h(o)m(v)m(erwriting)1110 | |
12900 | 628 y(the)31 b(\014le.)630 814 y Ft(histreedit)1110 924 | |
12901 | y Fu(If)i(set,)h(and)f(Readline)h(is)f(b)s(eing)g(used,)g(a)g(user)g | |
12902 | (is)g(giv)m(en)h(the)g(opp)s(ortunit)m(y)1110 1033 y(to)d(re-edit)g(a)g | |
12903 | (failed)g(history)f(substitution.)630 1219 y Ft(histverify)1110 | |
12904 | 1329 y Fu(If)35 b(set,)i(and)e(Readline)h(is)f(b)s(eing)g(used,)h(the)f | |
12905 | (results)g(of)g(history)h(substitu-)1110 1439 y(tion)h(are)g(not)g | |
12906 | (immediately)h(passed)e(to)h(the)g(shell)g(parser.)59 | |
12907 | b(Instead,)38 b(the)1110 1548 y(resulting)i(line)f(is)h(loaded)g(in)m | |
12908 | (to)g(the)g(Readline)g(editing)g(bu\013er,)h(allo)m(wing)1110 | |
12909 | 1658 y(further)29 b(mo)s(di\014cation.)630 1844 y Ft(hostcomplete)1110 | |
12910 | 1954 y Fu(If)38 b(set,)j(and)c(Readline)i(is)f(b)s(eing)g(used,)h(Bash) | |
12911 | g(will)f(attempt)h(to)g(p)s(erform)1110 2063 y(hostname)d(completion)h | |
12912 | (when)e(a)h(w)m(ord)f(con)m(taining)i(a)f(`)p Ft(@)p | |
12913 | Fu(')g(is)g(b)s(eing)f(com-)1110 2173 y(pleted)g(\(see)h(Section)f | |
12914 | (8.4.6)i([Commands)d(F)-8 b(or)36 b(Completion],)g(page)g(123\).)1110 | |
12915 | 2282 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.)630 | |
12916 | 2469 y Ft(huponexit)1110 2578 y Fu(If)i(set,)i(Bash)f(will)h(send)d | |
8a0829e9 | 12917 | Ft(SIGHUP)h Fu(to)h(all)h(jobs)e(when)g(an)g(in)m(teractiv)m(e)k(login) |
967625cd CR |
12918 | 1110 2688 y(shell)31 b(exits)g(\(see)g(Section)g(3.7.6)h([Signals],)g |
12919 | (page)f(39\).)630 2874 y Ft(inherit_errexit)1110 2984 | |
12920 | y Fu(If)e(set,)h(command)g(substitution)f(inherits)g(the)g(v)-5 | |
12921 | b(alue)30 b(of)g(the)f Ft(errexit)f Fu(op-)1110 3093 | |
12922 | y(tion,)33 b(instead)g(of)f(unsetting)g(it)h(in)f(the)g(subshell)f(en)m | |
12923 | (vironmen)m(t.)46 b(This)32 b(op-)1110 3203 y(tion)f(is)f(enabled)h | |
12924 | (when)e Fm(posix)h Fu(mo)s(de)g(is)g(enabled.)630 3389 | |
12925 | y Ft(interactive_comments)1110 3499 y Fu(Allo)m(w)d(a)g(w)m(ord)e(b)s | |
12926 | (eginning)g(with)h(`)p Ft(#)p Fu(')g(to)h(cause)f(that)h(w)m(ord)f(and) | |
12927 | f(all)i(remain-)1110 3608 y(ing)41 b(c)m(haracters)i(on)e(that)h(line)g | |
12928 | (to)g(b)s(e)f(ignored)g(in)g(an)g(in)m(teractiv)m(e)j(shell.)1110 | |
12929 | 3718 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.)630 | |
12930 | 3904 y Ft(lastpipe)96 b Fu(If)24 b(set,)i(and)e(job)g(con)m(trol)i(is)f | |
fc527055 | 12931 | (not)f(activ)m(e,)k(the)d(shell)f(runs)f(the)i(last)g(command)1110 |
967625cd CR |
12932 | 4014 y(of)37 b(a)h(pip)s(eline)e(not)h(executed)h(in)f(the)g(bac)m |
12933 | (kground)g(in)g(the)g(curren)m(t)g(shell)1110 4124 y(en)m(vironmen)m | |
12934 | (t.)630 4310 y Ft(lithist)144 b Fu(If)22 b(enabled,)i(and)d(the)h | |
6e51e0d0 | 12935 | Ft(cmdhist)e Fu(option)j(is)f(enabled,)i(m)m(ulti-line)f(commands)1110 |
967625cd CR |
12936 | 4419 y(are)28 b(sa)m(v)m(ed)h(to)g(the)f(history)g(with)f(em)m(b)s |
12937 | (edded)g(newlines)h(rather)g(than)f(using)1110 4529 y(semicolon)32 | |
12938 | b(separators)f(where)e(p)s(ossible.)630 4715 y Ft(login_shell)1110 | |
12939 | 4825 y Fu(The)35 b(shell)h(sets)g(this)f(option)h(if)g(it)g(is)f | |
1101193a | 12940 | (started)h(as)g(a)g(login)g(shell)g(\(see)g(Sec-)1110 |
967625cd | 12941 | 4934 y(tion)29 b(6.1)g([In)m(v)m(oking)h(Bash],)f(page)g(81\).)41 |
1101193a | 12942 | b(The)28 b(v)-5 b(alue)29 b(ma)m(y)g(not)f(b)s(e)g(c)m(hanged.)630 |
967625cd | 12943 | 5121 y Ft(mailwarn)96 b Fu(If)34 b(set,)i(and)e(a)h(\014le)g(that)g |
1101193a | 12944 | (Bash)f(is)h(c)m(hec)m(king)h(for)f(mail)g(has)f(b)s(een)g(accessed) |
967625cd | 12945 | 1110 5230 y(since)24 b(the)h(last)g(time)f(it)h(w)m(as)f(c)m(hec)m(k)m |
6e51e0d0 | 12946 | (ed,)k(the)c(message)h Ft("The)k(mail)h(in)f Fj(mail-)1110 |
967625cd | 12947 | 5340 y(file)g Ft(has)h(been)f(read")g Fu(is)h(displa)m(y)m(ed.)p |
8a0829e9 | 12948 | eop end |
6e51e0d0 CR |
12949 | %%Page: 68 74 |
12950 | TeXDict begin 68 73 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
967625cd CR |
12951 | b(Shell)30 b(Builtin)h(Commands)2069 b(68)630 299 y Ft |
12952 | (no_empty_cmd_completion)1110 408 y Fu(If)30 b(set,)g(and)g(Readline)g | |
12953 | (is)h(b)s(eing)e(used,)h(Bash)g(will)g(not)g(attempt)i(to)e(searc)m(h) | |
12954 | 1110 518 y(the)25 b Ft(PATH)f Fu(for)h(p)s(ossible)f(completions)j | |
12955 | (when)d(completion)i(is)f(attempted)h(on)1110 628 y(an)k(empt)m(y)h | |
12956 | (line.)630 801 y Ft(nocaseglob)1110 911 y Fu(If)38 b(set,)k(Bash)d | |
12957 | (matc)m(hes)g(\014lenames)g(in)f(a)h(case-insensitiv)m(e)j(fashion)c | |
12958 | (when)1110 1020 y(p)s(erforming)29 b(\014lename)i(expansion.)630 | |
12959 | 1194 y Ft(nocasematch)1110 1304 y Fu(If)42 b(set,)k(Bash)d(matc)m(hes)g | |
12960 | (patterns)g(in)f(a)h(case-insensitiv)m(e)i(fashion)d(when)1110 | |
12961 | 1413 y(p)s(erforming)31 b(matc)m(hing)i(while)f(executing)i | |
12962 | Ft(case)d Fu(or)h Ft([[)g Fu(conditional)h(com-)1110 | |
12963 | 1523 y(mands,)d(when)g(p)s(erforming)g(pattern)h(substitution)g(w)m | |
12964 | (ord)g(expansions,)g(or)1110 1632 y(when)g(\014ltering)i(p)s(ossible)f | |
12965 | (completions)h(as)g(part)f(of)h(programmable)f(com-)1110 | |
12966 | 1742 y(pletion.)630 1915 y Ft(nullglob)96 b Fu(If)23 | |
12967 | b(set,)j(Bash)e(allo)m(ws)g(\014lename)g(patterns)g(whic)m(h)f(matc)m | |
12968 | (h)h(no)g(\014les)f(to)i(expand)1110 2025 y(to)31 b(a)g(n)m(ull)f | |
12969 | (string,)h(rather)f(than)g(themselv)m(es.)630 2199 y | |
12970 | Ft(progcomp)96 b Fu(If)25 b(set,)i(the)f(programmable)g(completion)g | |
12971 | (facilities)i(\(see)f(Section)f(8.6)h([Pro-)1110 2308 | |
12972 | y(grammable)45 b(Completion],)k(page)c(128\))h(are)f(enabled.)82 | |
12973 | b(This)44 b(option)h(is)1110 2418 y(enabled)30 b(b)m(y)h(default.)630 | |
12974 | 2591 y Ft(promptvars)1110 2701 y Fu(If)50 b(set,)56 b(prompt)49 | |
8a0829e9 | 12975 | b(strings)h(undergo)g(parameter)h(expansion,)k(command)1110 |
967625cd CR |
12976 | 2811 y(substitution,)35 b(arithmetic)g(expansion,)g(and)e(quote)i(remo) |
12977 | m(v)-5 b(al)35 b(after)f(b)s(eing)1110 2920 y(expanded)53 | |
8a0829e9 | 12978 | b(as)h(describ)s(ed)e(b)s(elo)m(w)i(\(see)h(Section)f(6.9)h([Con)m |
967625cd | 12979 | (trolling)g(the)1110 3030 y(Prompt],)30 b(page)h(93\).)42 |
8a0829e9 | 12980 | b(This)30 b(option)h(is)f(enabled)h(b)m(y)f(default.)630 |
967625cd | 12981 | 3203 y Ft(restricted_shell)1110 3313 y Fu(The)40 b(shell)h(sets)g(this) |
8a0829e9 | 12982 | g(option)g(if)g(it)h(is)e(started)i(in)e(restricted)i(mo)s(de)e(\(see) |
967625cd | 12983 | 1110 3423 y(Section)c(6.10)g([The)f(Restricted)g(Shell],)i(page)e |
900a813b | 12984 | (94\).)56 b(The)34 b(v)-5 b(alue)35 b(ma)m(y)h(not)1110 |
967625cd CR |
12985 | 3532 y(b)s(e)c(c)m(hanged.)49 b(This)32 b(is)h(not)h(reset)f(when)f |
12986 | (the)h(startup)g(\014les)f(are)i(executed,)1110 3642 | |
8a0829e9 | 12987 | y(allo)m(wing)k(the)e(startup)f(\014les)h(to)g(disco)m(v)m(er)h |
967625cd CR |
12988 | (whether)f(or)f(not)i(a)f(shell)g(is)g(re-)1110 3751 |
12989 | y(stricted.)630 3925 y Ft(shift_verbose)1110 4034 y Fu(If)g(this)g(is)g | |
8a0829e9 | 12990 | (set,)j(the)d Ft(shift)f Fu(builtin)h(prin)m(ts)f(an)h(error)g(message) |
967625cd CR |
12991 | i(when)d(the)1110 4144 y(shift)30 b(coun)m(t)h(exceeds)g(the)g(n)m(um)m |
12992 | (b)s(er)e(of)h(p)s(ositional)i(parameters.)630 4318 y | |
12993 | Ft(sourcepath)1110 4427 y Fu(If)22 b(set,)j(the)e Ft(source)e | |
8a0829e9 | 12994 | Fu(builtin)h(uses)g(the)h(v)-5 b(alue)23 b(of)g Ft(PATH)e |
967625cd | 12995 | Fu(to)j(\014nd)d(the)h(directory)1110 4537 y(con)m(taining)29 |
8a0829e9 | 12996 | b(the)e(\014le)h(supplied)e(as)h(an)g(argumen)m(t.)40 |
967625cd CR |
12997 | b(This)27 b(option)h(is)f(enabled)1110 4646 y(b)m(y)j(default.)630 |
12998 | 4820 y Ft(xpg_echo)96 b Fu(If)31 b(set,)h(the)g Ft(echo)e | |
6e51e0d0 | 12999 | Fu(builtin)h(expands)f(bac)m(kslash-escap)s(e)j(sequences)f(b)m(y)f |
967625cd | 13000 | (de-)1110 4930 y(fault.)630 5103 y(The)c(return)f(status)i(when)f |
6e51e0d0 | 13001 | (listing)h(options)g(is)f(zero)i(if)e(all)i Fr(optnames)i |
967625cd | 13002 | Fu(are)d(enabled,)g(non-)630 5213 y(zero)40 b(otherwise.)66 |
1101193a | 13003 | b(When)39 b(setting)h(or)f(unsetting)g(options,)i(the)e(return)f |
967625cd CR |
13004 | (status)h(is)g(zero)630 5322 y(unless)30 b(an)g Fr(optname)36 |
13005 | b Fu(is)30 b(not)h(a)g(v)-5 b(alid)30 b(shell)h(option.)p | |
aaf6036e | 13006 | eop end |
1101193a | 13007 | %%Page: 69 75 |
900a813b | 13008 | TeXDict begin 69 74 bop 150 -116 a Fu(Chapter)30 b(4:)41 |
967625cd CR |
13009 | b(Shell)30 b(Builtin)h(Commands)2069 b(69)150 299 y Fs(4.4)68 |
13010 | b(Sp)t(ecial)45 b(Builtins)150 458 y Fu(F)-8 b(or)35 | |
13011 | b(historical)h(reasons,)g(the)e Fm(posix)g Fu(standard)f(has)i | |
13012 | (classi\014ed)f(sev)m(eral)i(builtin)e(commands)g(as)h | |
13013 | Fl(sp)-5 b(e-)150 568 y(cial)p Fu(.)47 b(When)33 b(Bash)f(is)h | |
13014 | (executing)g(in)f Fm(posix)g Fu(mo)s(de,)h(the)g(sp)s(ecial)g(builtins) | |
13015 | e(di\013er)i(from)f(other)g(builtin)150 677 y(commands)e(in)g(three)h | |
13016 | (resp)s(ects:)199 812 y(1.)61 b(Sp)s(ecial)31 b(builtins)e(are)i(found) | |
13017 | e(b)s(efore)h(shell)h(functions)f(during)f(command)h(lo)s(okup.)199 | |
13018 | 946 y(2.)61 b(If)30 b(a)h(sp)s(ecial)g(builtin)f(returns)f(an)h(error)g | |
13019 | (status,)h(a)g(non-in)m(teractiv)m(e)i(shell)d(exits.)199 | |
13020 | 1081 y(3.)61 b(Assignmen)m(t)30 b(statemen)m(ts)h(preceding)f(the)f | |
13021 | (command)g(sta)m(y)i(in)e(e\013ect)i(in)e(the)h(shell)f(en)m(vironmen)m | |
13022 | (t)330 1191 y(after)i(the)f(command)h(completes.)275 | |
13023 | 1350 y(When)36 b(Bash)g(is)h(not)f(executing)i(in)e Fm(posix)f | |
13024 | Fu(mo)s(de,)j(these)f(builtins)f(b)s(eha)m(v)m(e)h(no)f(di\013eren)m | |
13025 | (tly)h(than)150 1460 y(the)31 b(rest)f(of)h(the)f(Bash)h(builtin)e | |
13026 | (commands.)41 b(The)30 b(Bash)g Fm(posix)g Fu(mo)s(de)g(is)g(describ)s | |
13027 | (ed)f(in)h(Section)h(6.11)150 1569 y([Bash)g(POSIX)e(Mo)s(de],)i(page)g | |
13028 | (95.)275 1704 y(These)f(are)g(the)h Fm(posix)f Fu(sp)s(ecial)h | |
13029 | (builtins:)390 1838 y Ft(break)46 b(:)i(.)f(continue)f(eval)g(exec)h | |
13030 | (exit)g(export)f(readonly)f(return)h(set)390 1948 y(shift)g(trap)h | |
13031 | (unset)p eop end | |
900a813b | 13032 | %%Page: 70 76 |
037a8b7f | 13033 | TeXDict begin 70 75 bop 3659 -116 a Fu(70)150 299 y Fp(5)80 |
967625cd | 13034 | b(Shell)53 b(V)-13 b(ariables)150 539 y Fu(This)21 b(c)m(hapter)i |
c302751c CR |
13035 | (describ)s(es)e(the)i(shell)f(v)-5 b(ariables)23 b(that)f(Bash)h(uses.) |
13036 | 37 b(Bash)23 b(automatically)h(assigns)f(default)150 | |
967625cd CR |
13037 | 648 y(v)-5 b(alues)31 b(to)g(a)g(n)m(um)m(b)s(er)e(of)h(v)-5 |
13038 | b(ariables.)150 892 y Fs(5.1)68 b(Bourne)45 b(Shell)g(V)-11 | |
13039 | b(ariables)150 1051 y Fu(Bash)30 b(uses)g(certain)h(shell)g(v)-5 | |
c302751c | 13040 | b(ariables)31 b(in)f(the)g(same)h(w)m(a)m(y)g(as)g(the)f(Bourne)g |
967625cd | 13041 | (shell.)41 b(In)30 b(some)g(cases,)i(Bash)150 1161 y(assigns)f(a)f |
c302751c | 13042 | (default)h(v)-5 b(alue)31 b(to)g(the)f(v)-5 b(ariable.)150 |
967625cd | 13043 | 1323 y Ft(CDPATH)192 b Fu(A)39 b(colon-separated)i(list)e(of)g |
c302751c | 13044 | (directories)h(used)f(as)g(a)g(searc)m(h)h(path)e(for)h(the)g |
967625cd | 13045 | Ft(cd)f Fu(builtin)630 1433 y(command.)150 1594 y Ft(HOME)288 |
6e51e0d0 CR |
13046 | b Fu(The)23 b(curren)m(t)h(user's)f(home)g(directory;)k(the)d(default)g |
13047 | (for)f(the)h Ft(cd)f Fu(builtin)g(command.)38 b(The)630 | |
967625cd | 13048 | 1704 y(v)-5 b(alue)37 b(of)f(this)g(v)-5 b(ariable)37 |
37c41ab1 | 13049 | b(is)g(also)g(used)e(b)m(y)h(tilde)h(expansion)f(\(see)i(Section)f |
967625cd CR |
13050 | (3.5.2)h([Tilde)630 1813 y(Expansion],)30 b(page)h(22\).)150 |
13051 | 1975 y Ft(IFS)336 b Fu(A)25 b(list)i(of)e(c)m(haracters)i(that)f | |
37c41ab1 | 13052 | (separate)g(\014elds;)h(used)e(when)f(the)i(shell)f(splits)h(w)m(ords)e |
967625cd | 13053 | (as)i(part)630 2084 y(of)31 b(expansion.)150 2246 y Ft(MAIL)288 |
6e51e0d0 CR |
13054 | b Fu(If)44 b(this)g(parameter)h(is)g(set)g(to)g(a)f(\014lename)h(or)f |
13055 | (directory)h(name)g(and)f(the)g Ft(MAILPATH)630 2355 | |
13056 | y Fu(v)-5 b(ariable)32 b(is)e(not)h(set,)h(Bash)f(informs)f(the)h(user) | |
e05be32d | 13057 | f(of)h(the)g(arriv)-5 b(al)31 b(of)g(mail)g(in)g(the)g(sp)s(eci\014ed) |
967625cd CR |
13058 | 630 2465 y(\014le)f(or)h(Maildir-format)g(directory)-8 |
13059 | b(.)150 2626 y Ft(MAILPATH)96 b Fu(A)33 b(colon-separated)i(list)f(of)f | |
37c41ab1 | 13060 | (\014lenames)h(whic)m(h)f(the)g(shell)g(p)s(erio)s(dically)h(c)m(hec)m |
e05be32d | 13061 | (ks)g(for)f(new)630 2736 y(mail.)60 b(Eac)m(h)37 b(list)g(en)m(try)g |
37c41ab1 | 13062 | (can)g(sp)s(ecify)f(the)h(message)h(that)f(is)g(prin)m(ted)f(when)f |
967625cd | 13063 | (new)h(mail)630 2845 y(arriv)m(es)31 b(in)g(the)g(mail)g(\014le)g(b)m |
122f603c | 13064 | (y)g(separating)h(the)f(\014lename)g(from)f(the)h(message)h(with)e(a)i |
6e51e0d0 CR |
13065 | (`)p Ft(?)p Fu('.)630 2955 y(When)g(used)f(in)h(the)g(text)i(of)e(the)g |
13066 | (message,)i Ft($_)e Fu(expands)f(to)i(the)f(name)g(of)h(the)f(curren)m | |
967625cd | 13067 | (t)630 3064 y(mail)f(\014le.)150 3226 y Ft(OPTARG)192 |
6e51e0d0 CR |
13068 | b Fu(The)30 b(v)-5 b(alue)31 b(of)f(the)h(last)g(option)g(argumen)m(t)g |
13069 | (pro)s(cessed)f(b)m(y)g(the)g Ft(getopts)f Fu(builtin.)150 | |
967625cd | 13070 | 3387 y Ft(OPTIND)192 b Fu(The)30 b(index)g(of)g(the)h(last)g(option)g |
6e51e0d0 | 13071 | (argumen)m(t)g(pro)s(cessed)f(b)m(y)g(the)g Ft(getopts)f |
967625cd | 13072 | Fu(builtin.)150 3548 y Ft(PATH)288 b Fu(A)32 b(colon-separated)i(list)f |
37c41ab1 | 13073 | (of)f(directories)h(in)e(whic)m(h)h(the)g(shell)g(lo)s(oks)h(for)f |
967625cd | 13074 | (commands.)45 b(A)630 3658 y(zero-length)e(\(n)m(ull\))g(directory)f |
6e51e0d0 | 13075 | (name)g(in)g(the)g(v)-5 b(alue)42 b(of)g Ft(PATH)f Fu(indicates)i(the)f |
967625cd | 13076 | (curren)m(t)630 3768 y(directory)-8 b(.)49 b(A)33 b(n)m(ull)f |
37c41ab1 | 13077 | (directory)i(name)e(ma)m(y)i(app)s(ear)e(as)h(t)m(w)m(o)h(adjacen)m(t)g |
967625cd CR |
13078 | (colons,)g(or)f(as)g(an)630 3877 y(initial)f(or)e(trailing)h(colon.)150 |
13079 | 4039 y Ft(PS1)336 b Fu(The)35 b(primary)f(prompt)h(string.)55 | |
6e51e0d0 | 13080 | b(The)35 b(default)h(v)-5 b(alue)35 b(is)h(`)p Ft(\\s-\\v\\$)28 |
967625cd | 13081 | b Fu('.)56 b(See)36 b(Section)g(6.9)630 4148 y([Con)m(trolling)42 |
900a813b | 13082 | b(the)e(Prompt],)j(page)e(93,)j(for)c(the)g(complete)i(list)f(of)f |
967625cd CR |
13083 | (escap)s(e)h(sequences)630 4258 y(that)31 b(are)g(expanded)e(b)s(efore) |
13084 | h Ft(PS1)g Fu(is)g(displa)m(y)m(ed.)150 4419 y Ft(PS2)336 | |
6e51e0d0 CR |
13085 | b Fu(The)30 b(secondary)g(prompt)g(string.)41 b(The)29 |
13086 | b(default)i(v)-5 b(alue)31 b(is)f(`)p Ft(>)g Fu('.)150 | |
967625cd | 13087 | 4663 y Fs(5.2)68 b(Bash)45 b(V)-11 b(ariables)150 4822 |
6e51e0d0 | 13088 | y Fu(These)45 b(v)-5 b(ariables)46 b(are)g(set)g(or)f(used)f(b)m(y)h |
c302751c | 13089 | (Bash,)50 b(but)44 b(other)i(shells)f(do)h(not)f(normally)h(treat)g |
967625cd | 13090 | (them)150 4932 y(sp)s(ecially)-8 b(.)275 5068 y(A)24 |
c302751c CR |
13091 | b(few)g(v)-5 b(ariables)24 b(used)g(b)m(y)f(Bash)i(are)f(describ)s(ed)f |
13092 | (in)h(di\013eren)m(t)g(c)m(hapters:)38 b(v)-5 b(ariables)25 | |
967625cd | 13093 | b(for)f(con)m(trolling)150 5178 y(the)31 b(job)f(con)m(trol)h |
37c41ab1 | 13094 | (facilities)i(\(see)e(Section)g(7.3)h([Job)e(Con)m(trol)h(V)-8 |
900a813b | 13095 | b(ariables],)32 b(page)g(102\).)150 5340 y Ft(BASH)288 |
6e51e0d0 | 13096 | b Fu(The)30 b(full)g(pathname)g(used)g(to)h(execute)h(the)e(curren)m(t) |
37c41ab1 | 13097 | g(instance)h(of)g(Bash.)p eop end |
900a813b CR |
13098 | %%Page: 71 77 |
13099 | TeXDict begin 71 76 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13100 | b(Shell)30 b(V)-8 b(ariables)2459 b(71)150 299 y Ft(BASHOPTS)96 | |
6e51e0d0 | 13101 | b Fu(A)31 b(colon-separated)h(list)f(of)g(enabled)f(shell)h(options.)41 |
8f714a7c | 13102 | b(Eac)m(h)31 b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 |
6e51e0d0 CR |
13103 | b(alid)630 408 y(argumen)m(t)37 b(for)g(the)g Ft(-s)f |
13104 | Fu(option)i(to)f(the)g Ft(shopt)f Fu(builtin)g(command)h(\(see)g | |
fc527055 | 13105 | (Section)h(4.3.2)630 518 y([The)e(Shopt)g(Builtin],)i(page)f(63\).)60 |
6e51e0d0 CR |
13106 | b(The)36 b(options)h(app)s(earing)f(in)g Ft(BASHOPTS)e |
13107 | Fu(are)i(those)630 628 y(rep)s(orted)e(as)h(`)p Ft(on)p | |
13108 | Fu(')f(b)m(y)h(`)p Ft(shopt)p Fu('.)53 b(If)34 b(this)g(v)-5 | |
8f714a7c CR |
13109 | b(ariable)36 b(is)f(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)630 |
13110 | 737 y(starts)25 b(up,)f(eac)m(h)i(shell)e(option)h(in)e(the)i(list)g | |
13111 | (will)f(b)s(e)g(enabled)g(b)s(efore)g(reading)g(an)m(y)g(startup)630 | |
13112 | 847 y(\014les.)41 b(This)29 b(v)-5 b(ariable)31 b(is)g(readonly)-8 | |
967625cd | 13113 | b(.)150 1029 y Ft(BASHPID)144 b Fu(Expands)35 b(to)i(the)f(pro)s(cess)f |
e05be32d | 13114 | (ID)i(of)f(the)g(curren)m(t)g(Bash)g(pro)s(cess.)58 b(This)35 |
967625cd | 13115 | b(di\013ers)h(from)g Ft($$)630 1139 y Fu(under)31 b(certain)j |
8f714a7c | 13116 | (circumstances,)h(suc)m(h)e(as)g(subshells)f(that)i(do)f(not)g(require) |
967625cd CR |
13117 | g(Bash)g(to)h(b)s(e)630 1249 y(re-initialized.)150 1431 |
13118 | y Ft(BASH_ALIASES)630 1541 y Fu(An)40 b(asso)s(ciativ)m(e)j(arra)m(y)d | |
8f714a7c | 13119 | (v)-5 b(ariable)41 b(whose)f(mem)m(b)s(ers)f(corresp)s(ond)g(to)i(the)f |
967625cd | 13120 | (in)m(ternal)h(list)630 1650 y(of)c(aliases)h(as)f(main)m(tained)g(b)m |
6e51e0d0 | 13121 | (y)g(the)g Ft(alias)e Fu(builtin.)59 b(\(see)37 b(Section)h(4.1)f |
967625cd CR |
13122 | ([Bourne)g(Shell)630 1760 y(Builtins],)31 b(page)g(41\).)42 |
13123 | b(Elemen)m(ts)31 b(added)e(to)i(this)f(arra)m(y)h(app)s(ear)f(in)g(the) | |
13124 | g(alias)h(list;)h(ho)m(w-)630 1870 y(ev)m(er,)k(unsetting)f(arra)m(y)g | |
13125 | (elemen)m(ts)g(curren)m(tly)g(do)s(es)f(not)g(cause)h(aliases)h(to)f(b) | |
13126 | s(e)f(remo)m(v)m(ed)630 1979 y(from)25 b(the)h(alias)h(list.)40 | |
13127 | b(If)25 b Ft(BASH_ALIASES)d Fu(is)k(unset,)g(it)g(loses)h(its)f(sp)s | |
13128 | (ecial)g(prop)s(erties,)g(ev)m(en)630 2089 y(if)k(it)h(is)g(subsequen)m | |
037a8b7f CR |
13129 | (tly)f(reset.)150 2271 y Ft(BASH_ARGC)630 2381 y Fu(An)39 |
13130 | b(arra)m(y)g(v)-5 b(ariable)40 b(whose)f(v)-5 b(alues)39 | |
13131 | b(are)h(the)f(n)m(um)m(b)s(er)f(of)h(parameters)g(in)g(eac)m(h)h(frame) | |
13132 | 630 2491 y(of)i(the)g(curren)m(t)g(bash)f(execution)i(call)g(stac)m(k.) | |
13133 | 76 b(The)42 b(n)m(um)m(b)s(er)e(of)i(parameters)g(to)h(the)630 | |
13134 | 2600 y(curren)m(t)38 b(subroutine)f(\(shell)i(function)e(or)i(script)f | |
13135 | (executed)h(with)e Ft(.)h Fu(or)g Ft(source)p Fu(\))f(is)h(at)630 | |
13136 | 2710 y(the)27 b(top)g(of)g(the)g(stac)m(k.)41 b(When)27 | |
13137 | b(a)g(subroutine)f(is)h(executed,)i(the)e(n)m(um)m(b)s(er)f(of)h | |
13138 | (parameters)630 2819 y(passed)44 b(is)h(pushed)e(on)m(to)j | |
13139 | Ft(BASH_ARGC)p Fu(.)81 b(The)44 b(shell)h(sets)g Ft(BASH_ARGC)e | |
13140 | Fu(only)i(when)e(in)630 2929 y(extended)34 b(debugging)f(mo)s(de)g | |
13141 | (\(see)i(Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)i(page)g(63,)g(for) | |
13142 | 630 3039 y(a)c(description)f(of)h(the)f Ft(extdebug)e | |
13143 | Fu(option)j(to)g(the)g Ft(shopt)e Fu(builtin\).)150 3221 | |
13144 | y Ft(BASH_ARGV)630 3331 y Fu(An)24 b(arra)m(y)g(v)-5 | |
13145 | b(ariable)25 b(con)m(taining)h(all)f(of)f(the)h(parameters)f(in)g(the)g | |
13146 | (curren)m(t)g(bash)g(execution)630 3440 y(call)35 b(stac)m(k.)53 | |
13147 | b(The)34 b(\014nal)g(parameter)g(of)g(the)g(last)h(subroutine)e(call)i | |
13148 | (is)f(at)h(the)f(top)h(of)f(the)630 3550 y(stac)m(k;)28 | |
13149 | b(the)c(\014rst)f(parameter)i(of)f(the)g(initial)i(call)f(is)f(at)h | |
13150 | (the)f(b)s(ottom.)39 b(When)24 b(a)g(subroutine)630 3660 | |
13151 | y(is)40 b(executed,)j(the)d(parameters)h(supplied)d(are)i(pushed)f(on)m | |
13152 | (to)i Ft(BASH_ARGV)p Fu(.)66 b(The)40 b(shell)630 3769 | |
13153 | y(sets)28 b Ft(BASH_ARGV)e Fu(only)i(when)f(in)h(extended)g(debugging)g | |
13154 | (mo)s(de)g(\(see)h(Section)f(4.3.2)i([The)630 3879 y(Shopt)g(Builtin],) | |
13155 | h(page)g(63,)g(for)g(a)f(description)h(of)f(the)h Ft(extdebug)d | |
13156 | Fu(option)j(to)g(the)f Ft(shopt)630 3988 y Fu(builtin\).)150 | |
13157 | 4171 y Ft(BASH_CMDS)630 4281 y Fu(An)k(asso)s(ciativ)m(e)i(arra)m(y)f | |
13158 | (v)-5 b(ariable)35 b(whose)f(mem)m(b)s(ers)f(corresp)s(ond)g(to)i(the)f | |
13159 | (in)m(ternal)h(hash)630 4390 y(table)c(of)g(commands)f(as)g(main)m | |
13160 | (tained)h(b)m(y)g(the)f Ft(hash)f Fu(builtin)h(\(see)h(Section)g(4.1)h | |
13161 | ([Bourne)630 4500 y(Shell)42 b(Builtins],)k(page)d(41\).)77 | |
13162 | b(Elemen)m(ts)43 b(added)e(to)i(this)f(arra)m(y)h(app)s(ear)f(in)f(the) | |
13163 | i(hash)630 4609 y(table;)k(ho)m(w)m(ev)m(er,)e(unsetting)c(arra)m(y)g | |
13164 | (elemen)m(ts)i(curren)m(tly)d(do)s(es)h(not)g(cause)g(command)630 | |
967625cd CR |
13165 | 4719 y(names)36 b(to)g(b)s(e)f(remo)m(v)m(ed)i(from)e(the)h(hash)f |
13166 | (table.)58 b(If)36 b Ft(BASH_CMDS)d Fu(is)j(unset,)h(it)f(loses)h(its) | |
13167 | 630 4829 y(sp)s(ecial)31 b(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)g | |
13168 | (subsequen)m(tly)f(reset.)150 5011 y Ft(BASH_COMMAND)630 | |
13169 | 5121 y Fu(The)39 b(command)h(curren)m(tly)g(b)s(eing)f(executed)i(or)e | |
13170 | (ab)s(out)h(to)g(b)s(e)f(executed,)44 b(unless)39 b(the)630 | |
13171 | 5230 y(shell)g(is)g(executing)g(a)g(command)g(as)g(the)f(result)h(of)g | |
13172 | (a)g(trap,)i(in)d(whic)m(h)g(case)i(it)f(is)g(the)630 | |
13173 | 5340 y(command)30 b(executing)i(at)f(the)f(time)h(of)g(the)g(trap.)p | |
13174 | eop end | |
900a813b CR |
13175 | %%Page: 72 78 |
13176 | TeXDict begin 72 77 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
967625cd CR |
13177 | b(Shell)30 b(V)-8 b(ariables)2459 b(72)150 299 y Ft(BASH_COMPAT)630 |
13178 | 408 y Fu(The)33 b(v)-5 b(alue)34 b(is)f(used)g(to)h(set)f(the)h | |
13179 | (shell's)g(compatibilit)m(y)h(lev)m(el.)51 b(See)34 b(Section)g(4.3.2)h | |
13180 | ([The)630 518 y(Shopt)40 b(Builtin],)45 b(page)c(63,)k(for)c(a)g | |
13181 | (description)g(of)g(the)g(v)-5 b(arious)41 b(compatibilit)m(y)i(lev)m | |
13182 | (els)630 628 y(and)31 b(their)g(e\013ects.)45 b(The)31 | |
13183 | b(v)-5 b(alue)31 b(ma)m(y)h(b)s(e)f(a)h(decimal)g(n)m(um)m(b)s(er)e | |
13184 | (\(e.g.,)j(4.2\))g(or)e(an)h(in)m(teger)630 737 y(\(e.g.,)39 | |
13185 | b(42\))f(corresp)s(onding)d(to)i(the)f(desired)f(compatibilit)m(y)k | |
13186 | (lev)m(el.)59 b(If)36 b Ft(BASH_COMPAT)d Fu(is)630 847 | |
13187 | y(unset)k(or)g(set)h(to)g(the)g(empt)m(y)f(string,)j(the)d | |
13188 | (compatibilit)m(y)j(lev)m(el)f(is)e(set)h(to)g(the)g(default)630 | |
13189 | 956 y(for)i(the)h(curren)m(t)f(v)m(ersion.)72 b(If)40 | |
13190 | b Ft(BASH_COMPAT)e Fu(is)i(set)h(to)h(a)e(v)-5 b(alue)41 | |
13191 | b(that)h(is)e(not)h(one)g(of)630 1066 y(the)f(v)-5 b(alid)40 | |
13192 | b(compatibilit)m(y)i(lev)m(els,)i(the)c(shell)g(prin)m(ts)f(an)h(error) | |
13193 | f(message)i(and)f(sets)g(the)630 1176 y(compatibilit)m(y)23 | |
13194 | b(lev)m(el)f(to)f(the)f(default)h(for)f(the)g(curren)m(t)g(v)m(ersion.) | |
13195 | 38 b(The)20 b(v)-5 b(alid)21 b(compatibilit)m(y)630 1285 | |
13196 | y(lev)m(els)40 b(corresp)s(ond)e(to)h(the)g(compatibilit)m(y)i(options) | |
13197 | e(accepted)h(b)m(y)f(the)g Ft(shopt)e Fu(builtin)630 | |
13198 | 1395 y(describ)s(ed)20 b(ab)s(o)m(v)m(e)i(\(for)g(example,)h | |
13199 | Fr(compat42)31 b Fu(means)21 b(that)g(4.2)i(and)d(42)i(are)g(v)-5 | |
13200 | b(alid)21 b(v)-5 b(alues\).)630 1504 y(The)30 b(curren)m(t)g(v)m | |
13201 | (ersion)h(is)f(also)i(a)e(v)-5 b(alid)31 b(v)-5 b(alue.)150 | |
13202 | 1655 y Ft(BASH_ENV)96 b Fu(If)28 b(this)g(v)-5 b(ariable)30 | |
13203 | b(is)e(set)h(when)f(Bash)g(is)h(in)m(v)m(ok)m(ed)h(to)f(execute)h(a)e | |
13204 | (shell)h(script,)g(its)g(v)-5 b(alue)29 b(is)630 1765 | |
13205 | y(expanded)k(and)h(used)g(as)g(the)h(name)f(of)g(a)h(startup)f(\014le)g | |
13206 | (to)h(read)f(b)s(efore)g(executing)i(the)630 1874 y(script.)41 | |
13207 | b(See)30 b(Section)h(6.2)h([Bash)f(Startup)e(Files],)j(page)f(83.)150 | |
13208 | 2025 y Ft(BASH_EXECUTION_STRING)630 2134 y Fu(The)f(command)g(argumen)m | |
13209 | (t)h(to)g(the)g Ft(-c)e Fu(in)m(v)m(o)s(cation)k(option.)150 | |
13210 | 2285 y Ft(BASH_LINENO)630 2395 y Fu(An)62 b(arra)m(y)i(v)-5 | |
13211 | b(ariable)63 b(whose)g(mem)m(b)s(ers)e(are)j(the)e(line)h(n)m(um)m(b)s | |
13212 | (ers)f(in)g(source)h(\014les)630 2504 y(where)46 b(eac)m(h)i(corresp)s | |
13213 | (onding)d(mem)m(b)s(er)h(of)h Fr(FUNCNAME)53 b Fu(w)m(as)47 | |
13214 | b(in)m(v)m(ok)m(ed.)91 b Ft(${BASH_)630 2614 y(LINENO[$i]})39 | |
13215 | b Fu(is)i(the)h(line)g(n)m(um)m(b)s(er)e(in)i(the)f(source)h(\014le)g | |
13216 | (\()p Ft(${BASH_SOURCE[$i+1]})p Fu(\))630 2724 y(where)d | |
13217 | Ft(${FUNCNAME[$i]})c Fu(w)m(as)k(called)i(\(or)e Ft | |
13218 | (${BASH_LINENO[$i-1]})34 b Fu(if)39 b(referenced)630 | |
13219 | 2833 y(within)30 b(another)g(shell)h(function\).)41 b(Use)31 | |
6e51e0d0 | 13220 | b Ft(LINENO)d Fu(to)j(obtain)g(the)g(curren)m(t)f(line)h(n)m(um)m(b)s |
967625cd | 13221 | (er.)150 2984 y Ft(BASH_LOADABLES_PATH)630 3093 y Fu(A)39 |
d7935593 | 13222 | b(colon-separated)i(list)f(of)f(directories)h(in)f(whic)m(h)g(the)g |
967625cd | 13223 | (shell)h(lo)s(oks)f(for)g(dynamically)630 3203 y(loadable)32 |
d7935593 | 13224 | b(builtins)d(sp)s(eci\014ed)h(b)m(y)g(the)h Ft(enable)e |
967625cd | 13225 | Fu(command.)150 3354 y Ft(BASH_REMATCH)630 3463 y Fu(An)43 |
d7935593 CR |
13226 | b(arra)m(y)i(v)-5 b(ariable)44 b(whose)g(mem)m(b)s(ers)f(are)h |
13227 | (assigned)g(b)m(y)f(the)h(`)p Ft(=~)p Fu(')g(binary)f(op)s(erator)630 | |
967625cd | 13228 | 3573 y(to)37 b(the)f Ft([[)g Fu(conditional)i(command)e(\(see)h |
d7935593 | 13229 | (Section)g(3.2.4.2)i([Conditional)e(Constructs],)630 |
967625cd | 13230 | 3682 y(page)e(10\).)52 b(The)33 b(elemen)m(t)j(with)d(index)g(0)i(is)f |
d7935593 | 13231 | (the)g(p)s(ortion)f(of)h(the)g(string)g(matc)m(hing)h(the)630 |
967625cd | 13232 | 3792 y(en)m(tire)29 b(regular)f(expression.)40 b(The)27 |
d7935593 | 13233 | b(elemen)m(t)j(with)d(index)h Fr(n)f Fu(is)h(the)g(p)s(ortion)g(of)g |
967625cd | 13234 | (the)g(string)630 3902 y(matc)m(hing)j(the)g Fr(n)p Fu(th)f(paren)m |
d7935593 | 13235 | (thesized)h(sub)s(expression.)39 b(This)29 b(v)-5 b(ariable)31 |
967625cd CR |
13236 | b(is)g(read-only)-8 b(.)150 4052 y Ft(BASH_SOURCE)630 |
13237 | 4162 y Fu(An)40 b(arra)m(y)h(v)-5 b(ariable)41 b(whose)f(mem)m(b)s(ers) | |
d7935593 | 13238 | g(are)h(the)g(source)f(\014lenames)h(where)f(the)g(corre-)630 |
967625cd | 13239 | 4271 y(sp)s(onding)27 b(shell)i(function)f(names)g(in)g(the)h |
d7935593 | 13240 | Ft(FUNCNAME)d Fu(arra)m(y)j(v)-5 b(ariable)30 b(are)f(de\014ned.)38 |
967625cd | 13241 | b(The)630 4381 y(shell)26 b(function)g Ft(${FUNCNAME[$i]})c |
6e51e0d0 | 13242 | Fu(is)k(de\014ned)f(in)g(the)h(\014le)h Ft(${BASH_SOURCE[$i]})21 |
967625cd CR |
13243 | b Fu(and)630 4491 y(called)32 b(from)d Ft(${BASH_SOURCE[$i+1]})150 |
13244 | 4641 y(BASH_SUBSHELL)630 4751 y Fu(Incremen)m(ted)24 | |
f6da9f85 | 13245 | b(b)m(y)f(one)h(within)f(eac)m(h)i(subshell)d(or)i(subshell)e(en)m |
967625cd | 13246 | (vironmen)m(t)i(when)f(the)h(shell)630 4861 y(b)s(egins)30 |
f6da9f85 | 13247 | b(executing)h(in)f(that)h(en)m(vironmen)m(t.)42 b(The)30 |
967625cd CR |
13248 | b(initial)h(v)-5 b(alue)31 b(is)f(0.)150 5011 y Ft(BASH_VERSINFO)630 |
13249 | 5121 y Fu(A)36 b(readonly)g(arra)m(y)g(v)-5 b(ariable)37 | |
900a813b | 13250 | b(\(see)f(Section)h(6.7)g([Arra)m(ys],)h(page)e(90\))h(whose)f(mem)m(b) |
967625cd | 13251 | s(ers)630 5230 y(hold)c(v)m(ersion)h(information)f(for)g(this)g |
f6da9f85 | 13252 | (instance)h(of)g(Bash.)46 b(The)32 b(v)-5 b(alues)32 |
967625cd CR |
13253 | b(assigned)h(to)g(the)630 5340 y(arra)m(y)e(mem)m(b)s(ers)e(are)i(as)g |
13254 | (follo)m(ws:)p eop end | |
900a813b CR |
13255 | %%Page: 73 79 |
13256 | TeXDict begin 73 78 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
967625cd CR |
13257 | b(Shell)30 b(V)-8 b(ariables)2459 b(73)630 299 y Ft(BASH_VERSINFO[0]) |
13258 | 1110 408 y Fu(The)30 b(ma)5 b(jor)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e | |
13259 | (\(the)i Fr(release)5 b Fu(\).)630 578 y Ft(BASH_VERSINFO[1])1110 | |
13260 | 687 y Fu(The)30 b(minor)g(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
13261 | Fr(v)m(ersion)p Fu(\).)630 857 y Ft(BASH_VERSINFO[2])1110 | |
13262 | 966 y Fu(The)f(patc)m(h)h(lev)m(el.)630 1136 y Ft(BASH_VERSINFO[3])1110 | |
13263 | 1245 y Fu(The)f(build)f(v)m(ersion.)630 1415 y Ft(BASH_VERSINFO[4])1110 | |
13264 | 1524 y Fu(The)h(release)i(status)e(\(e.g.,)j Fr(b)s(eta1)7 | |
13265 | b Fu(\).)630 1694 y Ft(BASH_VERSINFO[5])1110 1803 y Fu(The)30 | |
13266 | b(v)-5 b(alue)31 b(of)f Ft(MACHTYPE)p Fu(.)150 1973 y | |
13267 | Ft(BASH_VERSION)630 2082 y Fu(The)g(v)m(ersion)h(n)m(um)m(b)s(er)e(of)h | |
13268 | (the)h(curren)m(t)f(instance)h(of)g(Bash.)150 2252 y | |
13269 | Ft(BASH_XTRACEFD)630 2361 y Fu(If)f(set)h(to)h(an)e(in)m(teger)i | |
8f714a7c | 13270 | (corresp)s(onding)e(to)h(a)g(v)-5 b(alid)31 b(\014le)g(descriptor,)g |
967625cd | 13271 | (Bash)g(will)g(write)g(the)630 2471 y(trace)37 b(output)f(generated)h |
6e51e0d0 | 13272 | (when)f(`)p Ft(set)29 b(-x)p Fu(')36 b(is)g(enabled)h(to)g(that)f |
967625cd | 13273 | (\014le)h(descriptor.)58 b(This)630 2580 y(allo)m(ws)29 |
8f714a7c | 13274 | b(tracing)h(output)d(to)i(b)s(e)f(separated)g(from)g(diagnostic)h(and)f |
967625cd | 13275 | (error)f(messages.)41 b(The)630 2690 y(\014le)31 b(descriptor)f(is)h |
6e51e0d0 | 13276 | (closed)g(when)f Ft(BASH_XTRACEFD)d Fu(is)k(unset)f(or)g(assigned)h(a)g |
967625cd | 13277 | (new)f(v)-5 b(alue.)630 2800 y(Unsetting)45 b Ft(BASH_XTRACEFD)40 |
6e51e0d0 | 13278 | b Fu(or)k(assigning)g(it)g(the)g(empt)m(y)h(string)e(causes)i(the)f |
967625cd | 13279 | (trace)630 2909 y(output)33 b(to)i(b)s(e)d(sen)m(t)j(to)f(the)g |
6e51e0d0 | 13280 | (standard)e(error.)50 b(Note)35 b(that)g(setting)f Ft(BASH_XTRACEFD)c |
967625cd | 13281 | Fu(to)630 3019 y(2)39 b(\(the)h(standard)e(error)g(\014le)h |
8f714a7c | 13282 | (descriptor\))h(and)e(then)h(unsetting)g(it)g(will)g(result)g(in)g(the) |
967625cd CR |
13283 | 630 3128 y(standard)30 b(error)g(b)s(eing)f(closed.)150 |
13284 | 3298 y Ft(CHILD_MAX)630 3407 y Fu(Set)35 b(the)h(n)m(um)m(b)s(er)e(of)h | |
ad4aef08 | 13285 | (exited)h(c)m(hild)g(status)f(v)-5 b(alues)36 b(for)f(the)g(shell)g(to) |
967625cd | 13286 | h(remem)m(b)s(er.)55 b(Bash)630 3517 y(will)37 b(not)g(allo)m(w)i(this) |
ad4aef08 | 13287 | e(v)-5 b(alue)37 b(to)h(b)s(e)e(decreased)i(b)s(elo)m(w)f(a)g |
967625cd | 13288 | Fm(posix)p Fu(-mandated)f(minim)m(um,)630 3626 y(and)30 |
ad4aef08 CR |
13289 | b(there)g(is)g(a)h(maxim)m(um)f(v)-5 b(alue)30 b(\(curren)m(tly)h |
13290 | (8192\))h(that)f(this)f(ma)m(y)g(not)h(exceed.)41 b(The)630 | |
967625cd CR |
13291 | 3736 y(minim)m(um)30 b(v)-5 b(alue)30 b(is)h(system-dep)s(enden)m(t.) |
13292 | 150 3905 y Ft(COLUMNS)144 b Fu(Used)32 b(b)m(y)f(the)h | |
6e51e0d0 | 13293 | Ft(select)e Fu(command)h(to)i(determine)f(the)f(terminal)i(width)d |
967625cd | 13294 | (when)h(prin)m(ting)630 4015 y(selection)39 b(lists.)63 |
6e51e0d0 | 13295 | b(Automatically)41 b(set)d(if)f(the)h Ft(checkwinsize)d |
967625cd | 13296 | Fu(option)j(is)f(enabled)h(\(see)630 4125 y(Section)44 |
fc527055 | 13297 | b(4.3.2)h([The)e(Shopt)g(Builtin],)k(page)d(63\),)k(or)43 |
967625cd CR |
13298 | b(in)g(an)g(in)m(teractiv)m(e)j(shell)e(up)s(on)630 4234 |
13299 | y(receipt)31 b(of)g(a)g Ft(SIGWINCH)p Fu(.)150 4403 y | |
13300 | Ft(COMP_CWORD)630 4513 y Fu(An)38 b(index)g(in)m(to)h | |
6e51e0d0 | 13301 | Ft(${COMP_WORDS})c Fu(of)k(the)g(w)m(ord)f(con)m(taining)i(the)e |
967625cd | 13302 | (curren)m(t)g(cursor)g(p)s(o-)630 4623 y(sition.)72 b(This)40 |
ad4aef08 CR |
13303 | b(v)-5 b(ariable)41 b(is)f(a)m(v)-5 b(ailable)43 b(only)e(in)f(shell)h |
13304 | (functions)f(in)m(v)m(ok)m(ed)i(b)m(y)e(the)h(pro-)630 | |
967625cd CR |
13305 | 4732 y(grammable)36 b(completion)g(facilities)i(\(see)e(Section)g(8.6)g |
13306 | ([Programmable)g(Completion],)630 4842 y(page)31 b(128\).)150 | |
13307 | 5011 y Ft(COMP_LINE)630 5121 y Fu(The)38 b(curren)m(t)h(command)f | |
ad4aef08 | 13308 | (line.)66 b(This)37 b(v)-5 b(ariable)40 b(is)f(a)m(v)-5 |
967625cd | 13309 | b(ailable)41 b(only)d(in)h(shell)f(functions)630 5230 |
ad4aef08 | 13310 | y(and)25 b(external)h(commands)f(in)m(v)m(ok)m(ed)h(b)m(y)f(the)h |
967625cd CR |
13311 | (programmable)f(completion)i(facilities)g(\(see)630 5340 |
13312 | y(Section)k(8.6)h([Programmable)f(Completion],)g(page)g(128\).)p | |
13313 | eop end | |
900a813b CR |
13314 | %%Page: 74 80 |
13315 | TeXDict begin 74 79 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
967625cd CR |
13316 | b(Shell)30 b(V)-8 b(ariables)2459 b(74)150 299 y Ft(COMP_POINT)630 |
13317 | 408 y Fu(The)25 b(index)g(of)h(the)g(curren)m(t)f(cursor)g(p)s(osition) | |
13318 | h(relativ)m(e)i(to)e(the)g(b)s(eginning)f(of)g(the)h(curren)m(t)630 | |
13319 | 518 y(command.)40 b(If)27 b(the)h(curren)m(t)g(cursor)g(p)s(osition)g | |
13320 | (is)g(at)g(the)g(end)g(of)g(the)g(curren)m(t)g(command,)630 | |
13321 | 628 y(the)i(v)-5 b(alue)30 b(of)g(this)g(v)-5 b(ariable)31 | |
13322 | b(is)f(equal)g(to)h Ft(${#COMP_LINE})p Fu(.)37 b(This)29 | |
13323 | b(v)-5 b(ariable)31 b(is)f(a)m(v)-5 b(ailable)630 737 | |
13324 | y(only)36 b(in)f(shell)h(functions)f(and)g(external)h(commands)g(in)m | |
13325 | (v)m(ok)m(ed)h(b)m(y)e(the)h(programmable)630 847 y(completion)c | |
13326 | (facilities)g(\(see)g(Section)f(8.6)g([Programmable)g(Completion],)h | |
13327 | (page)f(128\).)150 1011 y Ft(COMP_TYPE)630 1121 y Fu(Set)c(to)h(an)f | |
13328 | (in)m(teger)h(v)-5 b(alue)28 b(corresp)s(onding)e(to)h(the)h(t)m(yp)s | |
13329 | (e)f(of)g(completion)h(attempted)g(that)630 1230 y(caused)e(a)h | |
13330 | (completion)h(function)e(to)h(b)s(e)f(called:)40 b Fr(T)-8 | |
13331 | b(AB)p Fu(,)27 b(for)g(normal)f(completion,)j(`)p Ft(?)p | |
13332 | Fu(',)e(for)630 1340 y(listing)35 b(completions)h(after)f(successiv)m | |
13333 | (e)g(tabs,)h(`)p Ft(!)p Fu(',)g(for)e(listing)h(alternativ)m(es)i(on)d | |
13334 | (partial)630 1450 y(w)m(ord)22 b(completion,)k(`)p Ft(@)p | |
13335 | Fu(',)f(to)e(list)g(completions)h(if)f(the)g(w)m(ord)f(is)h(not)g(unmo) | |
13336 | s(di\014ed,)f(or)h(`)p Ft(\045)p Fu(',)h(for)630 1559 | |
13337 | y(men)m(u)i(completion.)41 b(This)25 b(v)-5 b(ariable)27 | |
13338 | b(is)g(a)m(v)-5 b(ailable)28 b(only)f(in)f(shell)g(functions)g(and)g | |
13339 | (external)630 1669 y(commands)32 b(in)m(v)m(ok)m(ed)i(b)m(y)e(the)g | |
13340 | (programmable)h(completion)g(facilities)i(\(see)e(Section)g(8.6)630 | |
13341 | 1778 y([Programmable)e(Completion],)h(page)f(128\).)150 | |
13342 | 1943 y Ft(COMP_KEY)96 b Fu(The)29 b(k)m(ey)i(\(or)g(\014nal)e(k)m(ey)i | |
d3ad40de | 13343 | (of)f(a)g(k)m(ey)h(sequence\))g(used)e(to)i(in)m(v)m(ok)m(e)h(the)e |
967625cd CR |
13344 | (curren)m(t)g(completion)630 2052 y(function.)150 2217 |
13345 | y Ft(COMP_WORDBREAKS)630 2326 y Fu(The)f(set)i(of)e(c)m(haracters)j | |
d3ad40de | 13346 | (that)e(the)g(Readline)g(library)g(treats)g(as)g(w)m(ord)g(separators)g |
967625cd | 13347 | (when)630 2436 y(p)s(erforming)i(w)m(ord)h(completion.)51 |
6e51e0d0 | 13348 | b(If)33 b Ft(COMP_WORDBREAKS)c Fu(is)34 b(unset,)g(it)f(loses)i(its)e |
967625cd CR |
13349 | (sp)s(ecial)630 2545 y(prop)s(erties,)d(ev)m(en)h(if)f(it)h(is)g |
13350 | (subsequen)m(tly)f(reset.)150 2710 y Ft(COMP_WORDS)630 | |
13351 | 2819 y Fu(An)36 b(arra)m(y)g(v)-5 b(ariable)37 b(consisting)g(of)f(the) | |
d3ad40de | 13352 | g(individual)f(w)m(ords)h(in)f(the)h(curren)m(t)g(command)630 |
967625cd | 13353 | 2929 y(line.)94 b(The)47 b(line)i(is)f(split)g(in)m(to)h(w)m(ords)e(as) |
6e51e0d0 | 13354 | h(Readline)h(w)m(ould)f(split)g(it,)53 b(using)47 b Ft(COMP_)630 |
967625cd | 13355 | 3039 y(WORDBREAKS)34 b Fu(as)i(describ)s(ed)g(ab)s(o)m(v)m(e.)60 |
6932f7f5 | 13356 | b(This)36 b(v)-5 b(ariable)37 b(is)f(a)m(v)-5 b(ailable)39 |
967625cd | 13357 | b(only)e(in)f(shell)h(func-)630 3148 y(tions)32 b(in)m(v)m(ok)m(ed)i(b) |
6932f7f5 | 13358 | m(y)d(the)i(programmable)f(completion)h(facilities)h(\(see)f(Section)g |
967625cd CR |
13359 | (8.6)g([Pro-)630 3258 y(grammable)e(Completion],)g(page)g(128\).)150 |
13360 | 3422 y Ft(COMPREPLY)630 3532 y Fu(An)37 b(arra)m(y)h(v)-5 | |
ad4aef08 | 13361 | b(ariable)38 b(from)f(whic)m(h)g(Bash)g(reads)g(the)h(p)s(ossible)e |
967625cd | 13362 | (completions)j(generated)630 3641 y(b)m(y)33 b(a)g(shell)h(function)f |
ad4aef08 | 13363 | (in)m(v)m(ok)m(ed)h(b)m(y)f(the)g(programmable)h(completion)g(facilit)m |
967625cd | 13364 | (y)h(\(see)f(Sec-)630 3751 y(tion)g(8.6)g([Programmable)g(Completion],) |
900a813b | 13365 | h(page)f(128\).)51 b(Eac)m(h)34 b(arra)m(y)g(elemen)m(t)h(con)m(tains) |
967625cd | 13366 | 630 3861 y(one)c(p)s(ossible)f(completion.)150 4025 y |
6e51e0d0 | 13367 | Ft(COPROC)192 b Fu(An)27 b(arra)m(y)g(v)-5 b(ariable)28 |
ad4aef08 | 13368 | b(created)g(to)f(hold)g(the)g(\014le)g(descriptors)g(for)g(output)f |
967625cd | 13369 | (from)h(and)f(input)630 4134 y(to)31 b(an)f(unnamed)f(copro)s(cess)i |
ad4aef08 | 13370 | (\(see)g(Section)h(3.2.5)g([Copro)s(cesses],)f(page)g(15\).)150 |
967625cd | 13371 | 4299 y Ft(DIRSTACK)96 b Fu(An)26 b(arra)m(y)h(v)-5 b(ariable)28 |
ad4aef08 | 13372 | b(con)m(taining)g(the)f(curren)m(t)f(con)m(ten)m(ts)j(of)e(the)f |
967625cd | 13373 | (directory)i(stac)m(k.)41 b(Direc-)630 4408 y(tories)33 |
ad4aef08 | 13374 | b(app)s(ear)f(in)g(the)h(stac)m(k)h(in)e(the)h(order)f(they)h(are)g |
6e51e0d0 | 13375 | (displa)m(y)m(ed)g(b)m(y)f(the)h Ft(dirs)e Fu(builtin.)630 |
967625cd | 13376 | 4518 y(Assigning)f(to)h(mem)m(b)s(ers)f(of)g(this)g(arra)m(y)g(v)-5 |
ad4aef08 | 13377 | b(ariable)31 b(ma)m(y)g(b)s(e)e(used)h(to)h(mo)s(dify)e(directories)630 |
967625cd | 13378 | 4628 y(already)41 b(in)f(the)h(stac)m(k,)k(but)40 b(the)h |
6e51e0d0 | 13379 | Ft(pushd)e Fu(and)h Ft(popd)f Fu(builtins)h(m)m(ust)h(b)s(e)e(used)h |
967625cd | 13380 | (to)i(add)630 4737 y(and)37 b(remo)m(v)m(e)h(directories.)63 |
ad4aef08 | 13381 | b(Assignmen)m(t)37 b(to)h(this)f(v)-5 b(ariable)38 b(will)g(not)f(c)m |
967625cd | 13382 | (hange)i(the)e(cur-)630 4847 y(ren)m(t)c(directory)-8 |
6e51e0d0 | 13383 | b(.)47 b(If)32 b Ft(DIRSTACK)e Fu(is)i(unset,)g(it)h(loses)g(its)g(sp)s |
ad4aef08 | 13384 | (ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)630 |
967625cd | 13385 | 4956 y(subsequen)m(tly)d(reset.)150 5121 y Ft(EMACS)240 |
6e51e0d0 | 13386 | b Fu(If)31 b(Bash)h(\014nds)d(this)j(v)-5 b(ariable)32 |
ad4aef08 | 13387 | b(in)f(the)h(en)m(vironmen)m(t)g(when)e(the)i(shell)f(starts)h(with)f |
967625cd | 13388 | (v)-5 b(alue)630 5230 y(`)p Ft(t)p Fu(',)36 b(it)f(assumes)f(that)h |
ad4aef08 | 13389 | (the)g(shell)f(is)h(running)e(in)h(an)g(Emacs)h(shell)g(bu\013er)e(and) |
967625cd CR |
13390 | h(disables)630 5340 y(line)d(editing.)p eop end |
13391 | %%Page: 75 81 | |
13392 | TeXDict begin 75 80 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13393 | b(Shell)30 b(V)-8 b(ariables)2459 b(75)150 299 y Ft(ENV)336 | |
6e51e0d0 CR |
13394 | b Fu(Similar)35 b(to)g Ft(BASH_ENV)p Fu(;)h(used)e(when)g(the)h(shell)g |
13395 | (is)g(in)m(v)m(ok)m(ed)h(in)e Fm(posix)h Fu(Mo)s(de)g(\(see)g(Sec-)630 | |
967625cd CR |
13396 | 408 y(tion)c(6.11)h([Bash)f(POSIX)e(Mo)s(de],)i(page)g(95\).)150 |
13397 | 564 y Ft(EUID)288 b Fu(The)30 b(n)m(umeric)g(e\013ectiv)m(e)j(user)d | |
ad4aef08 | 13398 | (id)g(of)g(the)h(curren)m(t)f(user.)40 b(This)30 b(v)-5 |
967625cd CR |
13399 | b(ariable)31 b(is)f(readonly)-8 b(.)150 720 y Ft(EXECIGNORE)630 |
13400 | 830 y Fu(A)29 b(colon-separated)h(list)f(of)g(shell)g(patterns)f(\(see) | |
13401 | i(Section)f(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)630 | |
13402 | 939 y(page)h(31\))h(de\014ning)e(the)h(list)g(of)g(\014lenames)g(to)h | |
13403 | (b)s(e)e(ignored)g(b)m(y)h(command)g(searc)m(h.)42 b(Files)630 | |
13404 | 1049 y(whose)23 b(full)g(pathnames)f(matc)m(h)i(one)g(of)f(these)h | |
13405 | (patterns)f(are)g(not)g(considered)g(executable)630 1158 | |
13406 | y(\014les)40 b(for)f(the)h(purp)s(oses)d(of)j(completion)h(and)e | |
13407 | (command)g(execution.)70 b(This)38 b(do)s(es)i(not)630 | |
13408 | 1268 y(a\013ect)24 b(the)f(b)s(eha)m(vior)g(of)g(the)g | |
13409 | Ft([)p Fu(,)i Ft(test)p Fu(,)e(and)f Ft([[)g Fu(commands.)38 | |
13410 | b(Use)23 b(this)g(v)-5 b(ariable)24 b(to)f(ignore)630 | |
13411 | 1377 y(shared)h(library)h(\014les)g(that)g(ha)m(v)m(e)h(the)f | |
13412 | (executable)i(bit)e(set,)i(but)d(are)h(not)g(executable)i(\014les.)630 | |
13413 | 1487 y(The)j(pattern)g(matc)m(hing)i(honors)e(the)g(setting)i(of)e(the) | |
13414 | h Ft(extglob)d Fu(shell)j(option.)150 1643 y Ft(FCEDIT)192 | |
bce12dd7 CR |
13415 | b Fu(The)30 b(editor)h(used)e(as)i(a)g(default)f(b)m(y)h(the)f |
13416 | Ft(-e)g Fu(option)h(to)g(the)f Ft(fc)g Fu(builtin)g(command.)150 | |
967625cd | 13417 | 1799 y Ft(FIGNORE)144 b Fu(A)35 b(colon-separated)i(list)f(of)g |
bce12dd7 | 13418 | (su\016xes)e(to)i(ignore)g(when)e(p)s(erforming)g(\014lename)i(comple-) |
967625cd | 13419 | 630 1908 y(tion.)k(A)27 b(\014lename)g(whose)f(su\016x)g(matc)m(hes)i |
bce12dd7 | 13420 | (one)f(of)g(the)g(en)m(tries)g(in)g Ft(FIGNORE)d Fu(is)j(excluded)630 |
967625cd | 13421 | 2018 y(from)j(the)g(list)h(of)g(matc)m(hed)g(\014lenames.)41 |
6e51e0d0 | 13422 | b(A)30 b(sample)h(v)-5 b(alue)31 b(is)f(`)p Ft(.o:~)p |
967625cd | 13423 | Fu(')150 2173 y Ft(FUNCNAME)96 b Fu(An)35 b(arra)m(y)i(v)-5 |
37c41ab1 | 13424 | b(ariable)36 b(con)m(taining)h(the)f(names)g(of)g(all)g(shell)g |
967625cd | 13425 | (functions)g(curren)m(tly)f(in)h(the)630 2283 y(execution)g(call)h |
bce12dd7 | 13426 | (stac)m(k.)57 b(The)34 b(elemen)m(t)j(with)e(index)g(0)h(is)f(the)g |
967625cd | 13427 | (name)h(of)f(an)m(y)h(curren)m(tly-)630 2393 y(executing)f(shell)f |
bce12dd7 | 13428 | (function.)51 b(The)34 b(b)s(ottom-most)h(elemen)m(t)g(\(the)g(one)f |
967625cd | 13429 | (with)g(the)g(highest)630 2502 y(index\))e(is)h Ft("main")p |
bce12dd7 | 13430 | Fu(.)44 b(This)32 b(v)-5 b(ariable)33 b(exists)g(only)g(when)e(a)i |
967625cd | 13431 | (shell)f(function)g(is)g(executing.)630 2612 y(Assignmen)m(ts)23 |
d7935593 CR |
13432 | b(to)f Ft(FUNCNAME)e Fu(ha)m(v)m(e)k(no)e(e\013ect.)39 |
13433 | b(If)22 b Ft(FUNCNAME)e Fu(is)i(unset,)h(it)g(loses)g(its)f(sp)s(ecial) | |
967625cd CR |
13434 | 630 2721 y(prop)s(erties,)30 b(ev)m(en)h(if)f(it)h(is)g(subsequen)m |
13435 | (tly)f(reset.)630 2854 y(This)h(v)-5 b(ariable)32 b(can)f(b)s(e)g(used) | |
d7935593 | 13436 | g(with)g Ft(BASH_LINENO)d Fu(and)j Ft(BASH_SOURCE)p Fu(.)40 |
967625cd | 13437 | b(Eac)m(h)32 b(elemen)m(t)630 2964 y(of)g Ft(FUNCNAME)d |
d7935593 | 13438 | Fu(has)j(corresp)s(onding)e(elemen)m(ts)j(in)f Ft(BASH_LINENO)c |
967625cd | 13439 | Fu(and)k Ft(BASH_SOURCE)c Fu(to)630 3073 y(describ)s(e)39 |
d7935593 CR |
13440 | b(the)h(call)h(stac)m(k.)70 b(F)-8 b(or)41 b(instance,)i |
13441 | Ft(${FUNCNAME[$i]})35 b Fu(w)m(as)41 b(called)f(from)g(the)630 | |
967625cd | 13442 | 3183 y(\014le)27 b Ft(${BASH_SOURCE[$i+1]})21 b Fu(at)27 |
d7935593 | 13443 | b(line)h(n)m(um)m(b)s(er)d Ft(${BASH_LINENO[$i]})p Fu(.)34 |
967625cd | 13444 | b(The)27 b Ft(caller)630 3292 y Fu(builtin)j(displa)m(ys)g(the)h |
d7935593 | 13445 | (curren)m(t)f(call)i(stac)m(k)g(using)d(this)i(information.)150 |
967625cd | 13446 | 3448 y Ft(FUNCNEST)96 b Fu(If)34 b(set)i(to)f(a)h(n)m(umeric)e(v)-5 |
d7935593 | 13447 | b(alue)36 b(greater)g(than)e(0,)j(de\014nes)d(a)h(maxim)m(um)g |
967625cd | 13448 | (function)g(nesting)630 3558 y(lev)m(el.)42 b(F)-8 b(unction)29 |
9ec5ed66 | 13449 | b(in)m(v)m(o)s(cations)h(that)f(exceed)h(this)e(nesting)h(lev)m(el)h |
967625cd CR |
13450 | (will)f(cause)g(the)f(curren)m(t)630 3667 y(command)i(to)h(ab)s(ort.) |
13451 | 150 3823 y Ft(GLOBIGNORE)630 3933 y Fu(A)38 b(colon-separated)i(list)f | |
9ec5ed66 | 13452 | (of)f(patterns)g(de\014ning)f(the)h(set)g(of)h(\014lenames)f(to)g(b)s |
967625cd | 13453 | (e)g(ignored)630 4042 y(b)m(y)31 b(\014lename)g(expansion.)43 |
9ec5ed66 | 13454 | b(If)31 b(a)h(\014lename)f(matc)m(hed)h(b)m(y)f(a)g(\014lename)h |
967625cd | 13455 | (expansion)f(pattern)630 4152 y(also)i(matc)m(hes)g(one)f(of)g(the)g |
6e51e0d0 | 13456 | (patterns)g(in)f Ft(GLOBIGNORE)p Fu(,)f(it)i(is)g(remo)m(v)m(ed)h(from) |
967625cd CR |
13457 | e(the)h(list)h(of)630 4261 y(matc)m(hes.)41 b(The)27 |
13458 | b(pattern)g(matc)m(hing)h(honors)f(the)g(setting)i(of)e(the)h | |
13459 | Ft(extglob)d Fu(shell)i(option.)150 4417 y Ft(GROUPS)192 | |
6e51e0d0 | 13460 | b Fu(An)36 b(arra)m(y)g(v)-5 b(ariable)37 b(con)m(taining)g(the)f(list) |
ad4aef08 | 13461 | h(of)f(groups)g(of)g(whic)m(h)f(the)i(curren)m(t)e(user)h(is)g(a)630 |
967625cd | 13462 | 4527 y(mem)m(b)s(er.)41 b(Assignmen)m(ts)30 b(to)i Ft(GROUPS)d |
d7935593 | 13463 | Fu(ha)m(v)m(e)i(no)g(e\013ect.)42 b(If)30 b Ft(GROUPS)f |
967625cd | 13464 | Fu(is)i(unset,)f(it)h(loses)h(its)630 4636 y(sp)s(ecial)f(prop)s |
d7935593 | 13465 | (erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f(reset.)150 |
967625cd | 13466 | 4792 y Ft(histchars)630 4902 y Fu(Up)c(to)g(three)g(c)m(haracters)i |
d7935593 | 13467 | (whic)m(h)d(con)m(trol)j(history)d(expansion,)i(quic)m(k)g |
967625cd | 13468 | (substitution,)g(and)630 5011 y(tok)m(enization)k(\(see)f(Section)f |
900a813b | 13469 | (9.3)h([History)f(In)m(teraction],)i(page)f(138\).)41 |
967625cd | 13470 | b(The)29 b(\014rst)e(c)m(harac-)630 5121 y(ter)j(is)f(the)g |
6e51e0d0 | 13471 | Fr(history)g(expansion)g Fu(c)m(haracter,)j(that)e(is,)f(the)h(c)m |
967625cd | 13472 | (haracter)h(whic)m(h)d(signi\014es)i(the)630 5230 y(start)25 |
6e51e0d0 CR |
13473 | b(of)f(a)h(history)f(expansion,)i(normally)e(`)p Ft(!)p |
13474 | Fu('.)39 b(The)24 b(second)g(c)m(haracter)i(is)e(the)g(c)m(haracter)630 | |
967625cd CR |
13475 | 5340 y(whic)m(h)36 b(signi\014es)g(`quic)m(k)h(substitution')f(when)f |
13476 | (seen)h(as)g(the)g(\014rst)f(c)m(haracter)j(on)e(a)g(line,)p | |
13477 | eop end | |
13478 | %%Page: 76 82 | |
13479 | TeXDict begin 76 81 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13480 | b(Shell)30 b(V)-8 b(ariables)2459 b(76)630 299 y(normally)27 | |
13481 | b(`)p Ft(^)p Fu('.)39 b(The)26 b(optional)i(third)d(c)m(haracter)j(is)e | |
13482 | (the)h(c)m(haracter)h(whic)m(h)e(indicates)h(that)630 | |
13483 | 408 y(the)34 b(remainder)f(of)h(the)g(line)g(is)f(a)h(commen)m(t)h | |
9ec5ed66 | 13484 | (when)e(found)f(as)i(the)g(\014rst)f(c)m(haracter)i(of)f(a)630 |
967625cd | 13485 | 518 y(w)m(ord,)i(usually)f(`)p Ft(#)p Fu('.)55 b(The)34 |
9ec5ed66 | 13486 | b(history)h(commen)m(t)h(c)m(haracter)h(causes)e(history)g |
967625cd | 13487 | (substitution)630 628 y(to)27 b(b)s(e)f(skipp)s(ed)f(for)i(the)f |
9ec5ed66 | 13488 | (remaining)h(w)m(ords)f(on)h(the)f(line.)40 b(It)27 b(do)s(es)f(not)h |
967625cd CR |
13489 | (necessarily)g(cause)630 737 y(the)k(shell)f(parser)g(to)h(treat)g(the) |
13490 | g(rest)g(of)f(the)h(line)f(as)h(a)g(commen)m(t.)150 887 | |
13491 | y Ft(HISTCMD)144 b Fu(The)35 b(history)h(n)m(um)m(b)s(er,)g(or)f(index) | |
13492 | g(in)h(the)g(history)f(list,)j(of)e(the)g(curren)m(t)f(command.)56 | |
13493 | b(If)630 996 y Ft(HISTCMD)28 b Fu(is)h(unset,)h(it)g(loses)h(its)f(sp)s | |
13494 | (ecial)g(prop)s(erties,)g(ev)m(en)g(if)g(it)g(is)g(subsequen)m(tly)f | |
13495 | (reset.)150 1146 y Ft(HISTCONTROL)630 1255 y Fu(A)40 | |
13496 | b(colon-separated)i(list)f(of)f(v)-5 b(alues)40 b(con)m(trolling)i(ho)m | |
13497 | (w)e(commands)g(are)h(sa)m(v)m(ed)g(on)f(the)630 1365 | |
13498 | y(history)29 b(list.)41 b(If)28 b(the)h(list)h(of)f(v)-5 | |
6e51e0d0 | 13499 | b(alues)29 b(includes)f(`)p Ft(ignorespace)p Fu(',)f(lines)i(whic)m(h)g |
967625cd | 13500 | (b)s(egin)f(with)630 1474 y(a)39 b(space)g(c)m(haracter)i(are)e(not)g |
9ec5ed66 | 13501 | (sa)m(v)m(ed)g(in)g(the)g(history)f(list.)66 b(A)39 b(v)-5 |
967625cd | 13502 | b(alue)39 b(of)g(`)p Ft(ignoredups)p Fu(')630 1584 y(causes)34 |
9ec5ed66 CR |
13503 | b(lines)h(whic)m(h)f(matc)m(h)h(the)f(previous)f(history)h(en)m(try)h |
13504 | (to)g(not)f(b)s(e)f(sa)m(v)m(ed.)53 b(A)34 b(v)-5 b(alue)630 | |
967625cd | 13505 | 1694 y(of)32 b(`)p Ft(ignoreboth)p Fu(')d(is)j(shorthand)e(for)i(`)p |
6e51e0d0 | 13506 | Ft(ignorespace)p Fu(')d(and)i(`)p Ft(ignoredups)p Fu('.)42 |
967625cd | 13507 | b(A)32 b(v)-5 b(alue)32 b(of)630 1803 y(`)p Ft(erasedups)p |
bce12dd7 | 13508 | Fu(')f(causes)i(all)h(previous)f(lines)g(matc)m(hing)h(the)f(curren)m |
967625cd | 13509 | (t)g(line)g(to)h(b)s(e)e(remo)m(v)m(ed)630 1913 y(from)42 |
bce12dd7 CR |
13510 | b(the)h(history)f(list)i(b)s(efore)e(that)h(line)g(is)g(sa)m(v)m(ed.)78 |
13511 | b(An)m(y)43 b(v)-5 b(alue)43 b(not)g(in)f(the)h(ab)s(o)m(v)m(e)630 | |
967625cd | 13512 | 2022 y(list)35 b(is)g(ignored.)53 b(If)34 b Ft(HISTCONTROL)e |
bce12dd7 | 13513 | Fu(is)i(unset,)i(or)e(do)s(es)h(not)g(include)f(a)h(v)-5 |
967625cd | 13514 | b(alid)35 b(v)-5 b(alue,)36 b(all)630 2132 y(lines)30 |
37c41ab1 CR |
13515 | b(read)g(b)m(y)g(the)g(shell)g(parser)g(are)g(sa)m(v)m(ed)h(on)f(the)g |
13516 | (history)g(list,)h(sub)5 b(ject)30 b(to)g(the)g(v)-5 | |
967625cd | 13517 | b(alue)630 2242 y(of)42 b Ft(HISTIGNORE)p Fu(.)73 b(The)42 |
37c41ab1 | 13518 | b(second)g(and)g(subsequen)m(t)f(lines)h(of)h(a)f(m)m(ulti-line)h(comp) |
967625cd | 13519 | s(ound)630 2351 y(command)33 b(are)h(not)g(tested,)i(and)d(are)h(added) |
bce12dd7 | 13520 | f(to)h(the)g(history)g(regardless)g(of)g(the)f(v)-5 b(alue)630 |
967625cd | 13521 | 2461 y(of)31 b Ft(HISTCONTROL)p Fu(.)150 2610 y Ft(HISTFILE)96 |
6e51e0d0 | 13522 | b Fu(The)27 b(name)h(of)g(the)g(\014le)g(to)h(whic)m(h)f(the)g(command) |
8f714a7c | 13523 | f(history)h(is)g(sa)m(v)m(ed.)41 b(The)27 b(default)h(v)-5 |
967625cd CR |
13524 | b(alue)630 2720 y(is)30 b Ft(~/.bash_history)p Fu(.)150 |
13525 | 2869 y Ft(HISTFILESIZE)630 2979 y Fu(The)c(maxim)m(um)f(n)m(um)m(b)s | |
8f714a7c | 13526 | (er)g(of)h(lines)h(con)m(tained)g(in)f(the)g(history)g(\014le.)39 |
967625cd | 13527 | b(When)26 b(this)g(v)-5 b(ariable)630 3088 y(is)25 b(assigned)h(a)g(v) |
45c0f7f8 CR |
13528 | -5 b(alue,)27 b(the)f(history)f(\014le)h(is)f(truncated,)i(if)e |
13529 | (necessary)-8 b(,)28 b(to)e(con)m(tain)g(no)g(more)630 | |
967625cd | 13530 | 3198 y(than)37 b(that)h(n)m(um)m(b)s(er)d(of)j(lines)f(b)m(y)g(remo)m |
45c0f7f8 | 13531 | (ving)h(the)f(oldest)h(en)m(tries.)62 b(The)37 b(history)g(\014le)g(is) |
967625cd | 13532 | 630 3308 y(also)i(truncated)f(to)h(this)e(size)i(after)g(writing)f(it)g |
9f178efb | 13533 | (when)f(a)h(shell)h(exits.)64 b(If)37 b(the)h(v)-5 b(alue)39 |
967625cd | 13534 | b(is)630 3417 y(0,)g(the)e(history)f(\014le)h(is)g(truncated)f(to)i |
9f178efb | 13535 | (zero)f(size.)60 b(Non-n)m(umeric)37 b(v)-5 b(alues)37 |
967625cd | 13536 | b(and)f(n)m(umeric)630 3527 y(v)-5 b(alues)31 b(less)f(than)g(zero)h |
9f178efb | 13537 | (inhibit)f(truncation.)41 b(The)29 b(shell)i(sets)f(the)h(default)f(v) |
967625cd | 13538 | -5 b(alue)31 b(to)g(the)630 3636 y(v)-5 b(alue)31 b(of)f |
6e51e0d0 | 13539 | Ft(HISTSIZE)f Fu(after)h(reading)h(an)m(y)g(startup)f(\014les.)150 |
967625cd | 13540 | 3786 y Ft(HISTIGNORE)630 3895 y Fu(A)j(colon-separated)h(list)f(of)g |
09767ff0 | 13541 | (patterns)f(used)g(to)h(decide)g(whic)m(h)f(command)g(lines)h(should) |
967625cd | 13542 | 630 4005 y(b)s(e)f(sa)m(v)m(ed)h(on)g(the)f(history)h(list.)47 |
09767ff0 | 13543 | b(Eac)m(h)33 b(pattern)g(is)f(anc)m(hored)h(at)g(the)f(b)s(eginning)g |
967625cd | 13544 | (of)h(the)630 4115 y(line)43 b(and)e(m)m(ust)h(matc)m(h)h(the)g |
6e51e0d0 | 13545 | (complete)h(line)e(\(no)h(implicit)g(`)p Ft(*)p Fu(')f(is)g(app)s |
967625cd | 13546 | (ended\).)75 b(Eac)m(h)630 4224 y(pattern)42 b(is)g(tested)g(against)h |
09767ff0 | 13547 | (the)f(line)g(after)g(the)g(c)m(hec)m(ks)h(sp)s(eci\014ed)e(b)m(y)h |
967625cd | 13548 | Ft(HISTCONTROL)630 4334 y Fu(are)37 b(applied.)59 b(In)36 |
ad4aef08 | 13549 | b(addition)h(to)g(the)g(normal)g(shell)f(pattern)h(matc)m(hing)h(c)m |
967625cd | 13550 | (haracters,)i(`)p Ft(&)p Fu(')630 4443 y(matc)m(hes)d(the)f(previous)g |
6e51e0d0 | 13551 | (history)g(line.)57 b(`)p Ft(&)p Fu(')36 b(ma)m(y)h(b)s(e)e(escap)s(ed) |
967625cd | 13552 | h(using)g(a)g(bac)m(kslash;)k(the)630 4553 y(bac)m(kslash)34 |
ad4aef08 | 13553 | b(is)g(remo)m(v)m(ed)h(b)s(efore)e(attempting)i(a)g(matc)m(h.)51 |
967625cd | 13554 | b(The)34 b(second)f(and)h(subsequen)m(t)630 4663 y(lines)e(of)h(a)g(m)m |
ad4aef08 | 13555 | (ulti-line)g(comp)s(ound)e(command)h(are)h(not)f(tested,)i(and)e(are)g |
967625cd CR |
13556 | (added)g(to)h(the)630 4772 y(history)k(regardless)h(of)f(the)g(v)-5 |
13557 | b(alue)38 b(of)f Ft(HISTIGNORE)p Fu(.)58 b(The)37 b(pattern)g(matc)m | |
13558 | (hing)i(honors)630 4882 y(the)31 b(setting)g(of)g(the)f | |
13559 | Ft(extglob)f Fu(shell)h(option.)630 5011 y Ft(HISTIGNORE)20 | |
6e51e0d0 CR |
13560 | b Fu(subsumes)g(the)j(function)f(of)h Ft(HISTCONTROL)p |
13561 | Fu(.)35 b(A)23 b(pattern)f(of)h(`)p Ft(&)p Fu(')g(is)f(iden)m(tical)630 | |
967625cd | 13562 | 5121 y(to)k Ft(ignoredups)p Fu(,)e(and)h(a)h(pattern)g(of)f(`)p |
6e51e0d0 | 13563 | Ft([)31 b(]*)p Fu(')25 b(is)h(iden)m(tical)h(to)f Ft(ignorespace)p |
967625cd | 13564 | Fu(.)36 b(Com)m(bining)630 5230 y(these)30 b(t)m(w)m(o)h(patterns,)f |
37c41ab1 | 13565 | (separating)g(them)g(with)f(a)h(colon,)h(pro)m(vides)e(the)h |
967625cd CR |
13566 | (functionalit)m(y)h(of)630 5340 y Ft(ignoreboth)p Fu(.)p |
13567 | eop end | |
13568 | %%Page: 77 83 | |
13569 | TeXDict begin 77 82 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13570 | b(Shell)30 b(V)-8 b(ariables)2459 b(77)150 299 y Ft(HISTSIZE)96 | |
13571 | b Fu(The)37 b(maxim)m(um)g(n)m(um)m(b)s(er)e(of)j(commands)f(to)g | |
13572 | (remem)m(b)s(er)g(on)g(the)g(history)g(list.)62 b(If)37 | |
13573 | b(the)630 408 y(v)-5 b(alue)26 b(is)g(0,)i(commands)d(are)h(not)h(sa)m | |
13574 | (v)m(ed)g(in)e(the)h(history)g(list.)40 b(Numeric)26 | |
13575 | b(v)-5 b(alues)26 b(less)g(than)630 518 y(zero)i(result)e(in)h(ev)m | |
45c0f7f8 | 13576 | (ery)g(command)g(b)s(eing)f(sa)m(v)m(ed)i(on)f(the)g(history)f(list)i |
967625cd | 13577 | (\(there)f(is)g(no)g(limit\).)630 628 y(The)j(shell)g(sets)h(the)g |
45c0f7f8 | 13578 | (default)f(v)-5 b(alue)31 b(to)g(500)h(after)f(reading)f(an)m(y)h |
967625cd CR |
13579 | (startup)f(\014les.)150 803 y Ft(HISTTIMEFORMAT)630 913 |
13580 | y Fu(If)44 b(this)g(v)-5 b(ariable)45 b(is)f(set)g(and)g(not)g(n)m | |
45c0f7f8 | 13581 | (ull,)k(its)d(v)-5 b(alue)44 b(is)g(used)g(as)g(a)h(format)f(string)g |
967625cd | 13582 | (for)630 1022 y Fr(strftime)c Fu(to)35 b(prin)m(t)f(the)h(time)g(stamp) |
45c0f7f8 | 13583 | f(asso)s(ciated)i(with)f(eac)m(h)g(history)g(en)m(try)f(displa)m(y)m |
967625cd | 13584 | (ed)630 1132 y(b)m(y)g(the)f Ft(history)f Fu(builtin.)50 |
45c0f7f8 | 13585 | b(If)33 b(this)h(v)-5 b(ariable)34 b(is)g(set,)h(time)f(stamps)g(are)g |
967625cd CR |
13586 | (written)f(to)i(the)630 1241 y(history)26 b(\014le)g(so)g(they)g(ma)m |
13587 | (y)h(b)s(e)e(preserv)m(ed)g(across)i(shell)f(sessions.)39 | |
13588 | b(This)25 b(uses)h(the)g(history)630 1351 y(commen)m(t)31 | |
13589 | b(c)m(haracter)h(to)f(distinguish)f(timestamps)h(from)f(other)g | |
13590 | (history)h(lines.)150 1526 y Ft(HOSTFILE)96 b Fu(Con)m(tains)33 | |
13591 | b(the)g(name)f(of)h(a)g(\014le)f(in)g(the)h(same)g(format)g(as)f | |
13592 | Ft(/etc/hosts)e Fu(that)j(should)f(b)s(e)630 1636 y(read)21 | |
13593 | b(when)g(the)g(shell)h(needs)f(to)h(complete)h(a)e(hostname.)38 | |
13594 | b(The)21 b(list)h(of)g(p)s(ossible)f(hostname)630 1745 | |
13595 | y(completions)27 b(ma)m(y)f(b)s(e)f(c)m(hanged)h(while)f(the)h(shell)g | |
13596 | (is)f(running;)h(the)g(next)f(time)i(hostname)630 1855 | |
13597 | y(completion)33 b(is)g(attempted)g(after)g(the)f(v)-5 | |
bce12dd7 | 13598 | b(alue)33 b(is)f(c)m(hanged,)i(Bash)e(adds)f(the)i(con)m(ten)m(ts)h(of) |
967625cd | 13599 | 630 1965 y(the)h(new)f(\014le)g(to)h(the)g(existing)h(list.)53 |
bce12dd7 | 13600 | b(If)34 b Ft(HOSTFILE)e Fu(is)j(set,)h(but)e(has)g(no)h(v)-5 |
967625cd | 13601 | b(alue,)36 b(or)e(do)s(es)630 2074 y(not)d(name)f(a)h(readable)g |
bce12dd7 | 13602 | (\014le,)g(Bash)f(attempts)i(to)f(read)f Ft(/etc/hosts)e |
967625cd | 13603 | Fu(to)j(obtain)g(the)f(list)630 2184 y(of)h(p)s(ossible)f(hostname)h |
bce12dd7 | 13604 | (completions.)43 b(When)31 b Ft(HOSTFILE)d Fu(is)j(unset,)f(the)h |
967625cd | 13605 | (hostname)g(list)630 2293 y(is)f(cleared.)150 2469 y |
bce12dd7 | 13606 | Ft(HOSTNAME)96 b Fu(The)30 b(name)g(of)h(the)f(curren)m(t)h(host.)150 |
967625cd CR |
13607 | 2644 y Ft(HOSTTYPE)96 b Fu(A)30 b(string)h(describing)f(the)g(mac)m |
13608 | (hine)h(Bash)g(is)f(running)f(on.)150 2819 y Ft(IGNOREEOF)630 | |
13609 | 2929 y Fu(Con)m(trols)e(the)h(action)g(of)f(the)g(shell)g(on)g(receipt) | |
bce12dd7 | 13610 | h(of)f(an)g Ft(EOF)f Fu(c)m(haracter)i(as)g(the)f(sole)h(input.)630 |
967625cd | 13611 | 3039 y(If)i(set,)i(the)f(v)-5 b(alue)32 b(denotes)f(the)g(n)m(um)m(b)s |
6e51e0d0 | 13612 | (er)f(of)h(consecutiv)m(e)i Ft(EOF)d Fu(c)m(haracters)i(that)f(can)h(b) |
967625cd | 13613 | s(e)630 3148 y(read)40 b(as)f(the)h(\014rst)f(c)m(haracter)i(on)f(an)f |
8f714a7c | 13614 | (input)g(line)h(b)s(efore)f(the)h(shell)g(will)g(exit.)70 |
967625cd | 13615 | b(If)39 b(the)630 3258 y(v)-5 b(ariable)38 b(exists)f(but)f(do)s(es)g |
3eb2d94a | 13616 | (not)h(ha)m(v)m(e)h(a)g(n)m(umeric)e(v)-5 b(alue)37 b(\(or)h(has)e(no)h |
967625cd | 13617 | (v)-5 b(alue\))37 b(then)g(the)630 3367 y(default)31 |
8f714a7c | 13618 | b(is)g(10.)43 b(If)30 b(the)h(v)-5 b(ariable)31 b(do)s(es)g(not)g |
6e51e0d0 | 13619 | (exist,)h(then)e Ft(EOF)g Fu(signi\014es)h(the)g(end)f(of)h(input)630 |
967625cd CR |
13620 | 3477 y(to)g(the)g(shell.)41 b(This)29 b(is)i(only)f(in)g(e\013ect)i |
13621 | (for)e(in)m(teractiv)m(e)j(shells.)150 3652 y Ft(INPUTRC)144 | |
6e51e0d0 | 13622 | b Fu(The)68 b(name)h(of)f(the)h(Readline)g(initialization)j(\014le,)78 |
967625cd CR |
13623 | b(o)m(v)m(erriding)69 b(the)g(default)g(of)630 3762 y |
13624 | Ft(~/.inputrc)p Fu(.)150 3937 y Ft(LANG)288 b Fu(Used)28 | |
37c41ab1 | 13625 | b(to)h(determine)f(the)g(lo)s(cale)h(category)h(for)e(an)m(y)h |
967625cd | 13626 | (category)h(not)e(sp)s(eci\014cally)g(selected)630 4047 |
6e51e0d0 | 13627 | y(with)i(a)h(v)-5 b(ariable)31 b(starting)g(with)f Ft(LC_)p |
967625cd | 13628 | Fu(.)150 4222 y Ft(LC_ALL)192 b Fu(This)28 b(v)-5 b(ariable)29 |
6e51e0d0 CR |
13629 | b(o)m(v)m(errides)h(the)f(v)-5 b(alue)29 b(of)g Ft(LANG)f |
13630 | Fu(and)g(an)m(y)h(other)g Ft(LC_)f Fu(v)-5 b(ariable)29 | |
967625cd CR |
13631 | b(sp)s(ecifying)630 4332 y(a)i(lo)s(cale)h(category)-8 |
13632 | b(.)150 4507 y Ft(LC_COLLATE)630 4617 y Fu(This)37 b(v)-5 | |
ad4aef08 | 13633 | b(ariable)38 b(determines)g(the)g(collation)i(order)d(used)g(when)f |
967625cd | 13634 | (sorting)i(the)g(results)g(of)630 4726 y(\014lename)e(expansion,)i(and) |
ad4aef08 | 13635 | e(determines)g(the)h(b)s(eha)m(vior)f(of)g(range)h(expressions,)h |
967625cd | 13636 | (equiv-)630 4836 y(alence)e(classes,)h(and)e(collating)i(sequences)e |
ad4aef08 | 13637 | (within)f(\014lename)h(expansion)g(and)f(pattern)630 |
967625cd CR |
13638 | 4945 y(matc)m(hing)d(\(see)h(Section)f(3.5.8)h([Filename)g(Expansion],) |
13639 | e(page)h(30\).)150 5121 y Ft(LC_CTYPE)96 b Fu(This)36 | |
ad4aef08 | 13640 | b(v)-5 b(ariable)37 b(determines)f(the)h(in)m(terpretation)h(of)f(c)m |
967625cd | 13641 | (haracters)h(and)e(the)g(b)s(eha)m(vior)h(of)630 5230 |
ad4aef08 | 13642 | y(c)m(haracter)46 b(classes)g(within)e(\014lename)h(expansion)g(and)f |
967625cd CR |
13643 | (pattern)h(matc)m(hing)h(\(see)f(Sec-)630 5340 y(tion)31 |
13644 | b(3.5.8)h([Filename)g(Expansion],)e(page)h(30\).)p eop | |
13645 | end | |
900a813b CR |
13646 | %%Page: 78 84 |
13647 | TeXDict begin 78 83 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
967625cd CR |
13648 | b(Shell)30 b(V)-8 b(ariables)2459 b(78)150 299 y Ft(LC_MESSAGES)630 |
13649 | 408 y Fu(This)25 b(v)-5 b(ariable)27 b(determines)f(the)g(lo)s(cale)i | |
13650 | (used)d(to)i(translate)g(double-quoted)f(strings)g(pre-)630 | |
13651 | 518 y(ceded)31 b(b)m(y)f(a)h(`)p Ft($)p Fu(')f(\(see)h(Section)h | |
13652 | (3.1.2.5)g([Lo)s(cale)g(T)-8 b(ranslation],)32 b(page)f(7\).)150 | |
13653 | 679 y Ft(LC_NUMERIC)630 788 y Fu(This)f(v)-5 b(ariable)31 | |
13654 | b(determines)f(the)h(lo)s(cale)h(category)g(used)e(for)g(n)m(um)m(b)s | |
13655 | (er)f(formatting.)150 949 y Ft(LC_TIME)144 b Fu(This)25 | |
13656 | b(v)-5 b(ariable)26 b(determines)g(the)g(lo)s(cale)h(category)h(used)d | |
13657 | (for)g(data)h(and)f(time)i(formatting.)150 1110 y Ft(LINENO)192 | |
13658 | b Fu(The)30 b(line)h(n)m(um)m(b)s(er)e(in)h(the)g(script)h(or)f(shell)g | |
13659 | (function)h(curren)m(tly)f(executing.)150 1271 y Ft(LINES)240 | |
33723c84 | 13660 | b Fu(Used)43 b(b)m(y)g(the)g Ft(select)e Fu(command)i(to)g(determine)g |
967625cd | 13661 | (the)g(column)g(length)g(for)g(prin)m(ting)630 1380 y(selection)c |
33723c84 | 13662 | (lists.)63 b(Automatically)41 b(set)d(if)f(the)h Ft(checkwinsize)d |
967625cd | 13663 | Fu(option)j(is)f(enabled)h(\(see)630 1490 y(Section)44 |
bce12dd7 | 13664 | b(4.3.2)h([The)e(Shopt)g(Builtin],)k(page)d(63\),)k(or)43 |
967625cd CR |
13665 | b(in)g(an)g(in)m(teractiv)m(e)j(shell)e(up)s(on)630 1599 |
13666 | y(receipt)31 b(of)g(a)g Ft(SIGWINCH)p Fu(.)150 1760 y | |
bce12dd7 CR |
13667 | Ft(MACHTYPE)96 b Fu(A)26 b(string)g(that)h(fully)f(describ)s(es)f(the)h |
13668 | (system)g(t)m(yp)s(e)h(on)f(whic)m(h)f(Bash)i(is)f(executing,)i(in)e | |
967625cd CR |
13669 | (the)630 1870 y(standard)k Fm(gnu)g Fr(cpu-compan)m(y-system)h |
13670 | Fu(format.)150 2030 y Ft(MAILCHECK)630 2140 y Fu(Ho)m(w)d(often)g(\(in) | |
33723c84 | 13671 | g(seconds\))g(that)g(the)f(shell)h(should)f(c)m(hec)m(k)i(for)e(mail)h |
967625cd | 13672 | (in)f(the)h(\014les)g(sp)s(eci\014ed)630 2250 y(in)i(the)h |
bce12dd7 CR |
13673 | Ft(MAILPATH)e Fu(or)i Ft(MAIL)e Fu(v)-5 b(ariables.)43 |
13674 | b(The)30 b(default)h(is)f(60)i(seconds.)42 b(When)30 | |
967625cd | 13675 | b(it)h(is)g(time)630 2359 y(to)37 b(c)m(hec)m(k)h(for)e(mail,)j(the)e |
bce12dd7 | 13676 | (shell)f(do)s(es)g(so)h(b)s(efore)f(displa)m(ying)h(the)f(primary)g |
967625cd | 13677 | (prompt.)57 b(If)630 2469 y(this)37 b(v)-5 b(ariable)38 |
bce12dd7 | 13678 | b(is)f(unset,)h(or)f(set)h(to)g(a)f(v)-5 b(alue)38 b(that)f(is)g(not)h |
967625cd | 13679 | (a)f(n)m(um)m(b)s(er)f(greater)i(than)f(or)630 2578 y(equal)31 |
bce12dd7 | 13680 | b(to)g(zero,)g(the)g(shell)g(disables)f(mail)h(c)m(hec)m(king.)150 |
967625cd | 13681 | 2739 y Ft(MAPFILE)144 b Fu(An)35 b(arra)m(y)h(v)-5 b(ariable)36 |
bce12dd7 | 13682 | b(created)g(to)h(hold)e(the)g(text)i(read)e(b)m(y)g(the)h |
967625cd CR |
13683 | Ft(mapfile)d Fu(builtin)i(when)630 2849 y(no)30 b(v)-5 |
13684 | b(ariable)31 b(name)g(is)f(supplied.)150 3009 y Ft(OLDPWD)192 | |
bce12dd7 | 13685 | b Fu(The)30 b(previous)g(w)m(orking)g(directory)h(as)g(set)g(b)m(y)f |
967625cd | 13686 | (the)h Ft(cd)e Fu(builtin.)150 3170 y Ft(OPTERR)192 b |
bce12dd7 CR |
13687 | Fu(If)35 b(set)i(to)f(the)h(v)-5 b(alue)36 b(1,)i(Bash)e(displa)m(ys)g |
13688 | (error)f(messages)i(generated)g(b)m(y)f(the)g Ft(getopts)630 | |
967625cd | 13689 | 3280 y Fu(builtin)30 b(command.)150 3440 y Ft(OSTYPE)192 |
bce12dd7 | 13690 | b Fu(A)30 b(string)h(describing)f(the)g(op)s(erating)h(system)g(Bash)f |
967625cd | 13691 | (is)h(running)d(on.)150 3601 y Ft(PIPESTATUS)630 3711 |
bce12dd7 | 13692 | y Fu(An)23 b(arra)m(y)h(v)-5 b(ariable)24 b(\(see)h(Section)f(6.7)h |
900a813b | 13693 | ([Arra)m(ys],)g(page)f(90\))h(con)m(taining)g(a)f(list)g(of)g(exit)g |
967625cd | 13694 | (sta-)630 3820 y(tus)h(v)-5 b(alues)27 b(from)e(the)h(pro)s(cesses)g |
bce12dd7 | 13695 | (in)f(the)h(most-recen)m(tly-executed)j(foreground)c(pip)s(eline)630 |
967625cd CR |
13696 | 3930 y(\(whic)m(h)30 b(ma)m(y)h(con)m(tain)h(only)f(a)f(single)h |
13697 | (command\).)150 4091 y Ft(POSIXLY_CORRECT)630 4200 y | |
6e51e0d0 CR |
13698 | Fu(If)h(this)g(v)-5 b(ariable)34 b(is)e(in)g(the)h(en)m(vironmen)m(t)g |
13699 | (when)e(Bash)i(starts,)g(the)g(shell)g(en)m(ters)g Fm(posix)630 | |
967625cd | 13700 | 4310 y Fu(mo)s(de)22 b(\(see)h(Section)g(6.11)h([Bash)e(POSIX)f(Mo)s |
900a813b | 13701 | (de],)k(page)e(95\))g(b)s(efore)f(reading)g(the)g(startup)630 |
967625cd | 13702 | 4419 y(\014les,)36 b(as)e(if)h(the)f Ft(--posix)f Fu(in)m(v)m(o)s |
6e51e0d0 | 13703 | (cation)j(option)f(had)f(b)s(een)g(supplied.)51 b(If)34 |
967625cd | 13704 | b(it)h(is)g(set)g(while)630 4529 y(the)c(shell)f(is)h(running,)d(Bash)j |
6e51e0d0 | 13705 | (enables)g Fm(posix)e Fu(mo)s(de,)h(as)h(if)f(the)h(command)870 |
967625cd CR |
13706 | 4664 y Ft(set)47 b(-o)g(posix)630 4799 y Fu(had)30 b(b)s(een)f |
13707 | (executed.)150 4960 y Ft(PPID)288 b Fu(The)30 b(pro)s(cess)g | |
6e51e0d0 | 13708 | Fm(id)g Fu(of)h(the)f(shell's)h(paren)m(t)g(pro)s(cess.)40 |
ad4aef08 | 13709 | b(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 b(.)150 |
967625cd | 13710 | 5121 y Ft(PROMPT_COMMAND)630 5230 y Fu(If)32 b(set,)h(the)f(v)-5 |
45c0f7f8 | 13711 | b(alue)33 b(is)f(in)m(terpreted)g(as)g(a)h(command)f(to)h(execute)g(b)s |
967625cd CR |
13712 | (efore)f(the)g(prin)m(ting)g(of)630 5340 y(eac)m(h)g(primary)d(prompt)g |
13713 | (\()p Ft($PS1)p Fu(\).)p eop end | |
33723c84 CR |
13714 | %%Page: 79 85 |
13715 | TeXDict begin 79 84 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
967625cd CR |
13716 | b(Shell)30 b(V)-8 b(ariables)2459 b(79)150 299 y Ft(PROMPT_DIRTRIM)630 |
13717 | 408 y Fu(If)27 b(set)g(to)h(a)g(n)m(um)m(b)s(er)e(greater)i(than)f | |
13718 | (zero,)i(the)e(v)-5 b(alue)28 b(is)f(used)g(as)g(the)h(n)m(um)m(b)s(er) | |
13719 | e(of)h(trailing)630 518 y(directory)35 b(comp)s(onen)m(ts)g(to)h | |
13720 | (retain)f(when)f(expanding)g(the)h Ft(\\w)f Fu(and)g | |
13721 | Ft(\\W)g Fu(prompt)g(string)630 628 y(escap)s(es)21 b(\(see)h(Section)f | |
13722 | (6.9)h([Con)m(trolling)g(the)f(Prompt],)h(page)f(93\).)39 | |
13723 | b(Characters)21 b(remo)m(v)m(ed)630 737 y(are)31 b(replaced)g(with)f | |
13724 | (an)g(ellipsis.)150 911 y Ft(PS0)336 b Fu(The)30 b(v)-5 | |
13725 | b(alue)32 b(of)f(this)f(parameter)i(is)f(expanded)f(lik)m(e)i | |
13726 | Fr(PS1)38 b Fu(and)30 b(displa)m(y)m(ed)h(b)m(y)g(in)m(teractiv)m(e)630 | |
13727 | 1020 y(shells)f(after)h(reading)g(a)g(command)f(and)f(b)s(efore)h(the)h | |
13728 | (command)f(is)h(executed.)150 1194 y Ft(PS3)336 b Fu(The)34 | |
13729 | b(v)-5 b(alue)35 b(of)f(this)g(v)-5 b(ariable)35 b(is)g(used)e(as)i | |
13730 | (the)f(prompt)g(for)g(the)g Ft(select)f Fu(command.)52 | |
13731 | b(If)630 1303 y(this)30 b(v)-5 b(ariable)31 b(is)g(not)f(set,)i(the)e | |
13732 | Ft(select)f Fu(command)h(prompts)f(with)h(`)p Ft(#?)g | |
13733 | Fu(')150 1477 y Ft(PS4)336 b Fu(The)24 b(v)-5 b(alue)25 | |
13734 | b(is)f(the)h(prompt)e(prin)m(ted)h(b)s(efore)g(the)h(command)f(line)h | |
13735 | (is)f(ec)m(ho)s(ed)i(when)d(the)i Ft(-x)630 1587 y Fu(option)32 | |
13736 | b(is)f(set)h(\(see)g(Section)h(4.3.1)g([The)e(Set)g(Builtin],)i(page)f | |
13737 | (59\).)45 b(The)31 b(\014rst)f(c)m(haracter)630 1696 | |
13738 | y(of)k Ft(PS4)g Fu(is)g(replicated)i(m)m(ultiple)f(times,)h(as)e | |
13739 | (necessary)-8 b(,)37 b(to)e(indicate)g(m)m(ultiple)g(lev)m(els)h(of)630 | |
13740 | 1806 y(indirection.)41 b(The)30 b(default)h(is)f(`)p | |
13741 | Ft(+)g Fu('.)150 1979 y Ft(PWD)336 b Fu(The)30 b(curren)m(t)g(w)m | |
33723c84 | 13742 | (orking)h(directory)g(as)f(set)h(b)m(y)f(the)h Ft(cd)f |
967625cd CR |
13743 | Fu(builtin.)150 2153 y Ft(RANDOM)192 b Fu(Eac)m(h)30 |
13744 | b(time)g(this)f(parameter)g(is)g(referenced,)h(a)f(random)g(in)m(teger) | |
13745 | h(b)s(et)m(w)m(een)g(0)f(and)g(32767)630 2262 y(is)i(generated.)43 | |
33723c84 CR |
13746 | b(Assigning)31 b(a)g(v)-5 b(alue)31 b(to)g(this)g(v)-5 |
13747 | b(ariable)31 b(seeds)g(the)g(random)f(n)m(um)m(b)s(er)f(gen-)630 | |
967625cd | 13748 | 2372 y(erator.)150 2545 y Ft(READLINE_LINE)630 2655 y |
33723c84 CR |
13749 | Fu(The)e(con)m(ten)m(ts)i(of)f(the)g(Readline)g(line)g(bu\013er,)f(for) |
13750 | h(use)f(with)g(`)p Ft(bind)j(-x)p Fu(')d(\(see)h(Section)h(4.2)630 | |
967625cd CR |
13751 | 2765 y([Bash)i(Builtins],)g(page)g(48\).)150 2938 y Ft(READLINE_POINT) |
13752 | 630 3048 y Fu(The)23 b(p)s(osition)g(of)g(the)h(insertion)f(p)s(oin)m | |
33723c84 | 13753 | (t)g(in)g(the)g(Readline)h(line)f(bu\013er,)h(for)f(use)g(with)g(`)p |
967625cd CR |
13754 | Ft(bind)630 3157 y(-x)p Fu(')30 b(\(see)h(Section)h(4.2)f([Bash)g |
13755 | (Builtins],)g(page)g(48\).)150 3331 y Ft(REPLY)240 b | |
33723c84 | 13756 | Fu(The)30 b(default)g(v)-5 b(ariable)32 b(for)e(the)g |
967625cd | 13757 | Ft(read)g Fu(builtin.)150 3504 y Ft(SECONDS)144 b Fu(This)40 |
33723c84 CR |
13758 | b(v)-5 b(ariable)41 b(expands)f(to)h(the)g(n)m(um)m(b)s(er)e(of)i |
13759 | (seconds)g(since)g(the)f(shell)h(w)m(as)g(started.)630 | |
967625cd | 13760 | 3614 y(Assignmen)m(t)i(to)g(this)g(v)-5 b(ariable)43 |
5cdaaf76 | 13761 | b(resets)g(the)g(coun)m(t)g(to)g(the)g(v)-5 b(alue)43 |
967625cd | 13762 | b(assigned,)j(and)c(the)630 3724 y(expanded)35 b(v)-5 |
5cdaaf76 | 13763 | b(alue)36 b(b)s(ecomes)h(the)f(v)-5 b(alue)36 b(assigned)g(plus)f(the)h |
967625cd CR |
13764 | (n)m(um)m(b)s(er)f(of)h(seconds)g(since)630 3833 y(the)31 |
13765 | b(assignmen)m(t.)150 4007 y Ft(SHELL)240 b Fu(The)29 | |
5cdaaf76 CR |
13766 | b(full)h(pathname)g(to)h(the)f(shell)g(is)g(k)m(ept)g(in)g(this)g(en)m |
13767 | (vironmen)m(t)g(v)-5 b(ariable.)42 b(If)29 b(it)i(is)f(not)630 | |
967625cd | 13768 | 4116 y(set)36 b(when)f(the)h(shell)g(starts,)i(Bash)e(assigns)h(to)f |
5cdaaf76 | 13769 | (it)h(the)f(full)f(pathname)h(of)g(the)g(curren)m(t)630 |
967625cd CR |
13770 | 4226 y(user's)30 b(login)h(shell.)150 4399 y Ft(SHELLOPTS)630 |
13771 | 4509 y Fu(A)g(colon-separated)h(list)f(of)g(enabled)f(shell)h(options.) | |
37c41ab1 | 13772 | 41 b(Eac)m(h)31 b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 |
967625cd | 13773 | b(alid)630 4619 y(argumen)m(t)28 b(for)f(the)h Ft(-o)e |
6e51e0d0 | 13774 | Fu(option)i(to)g(the)g Ft(set)e Fu(builtin)h(command)g(\(see)i(Section) |
967625cd | 13775 | f(4.3.1)h([The)630 4728 y(Set)g(Builtin],)h(page)f(59\).)42 |
6e51e0d0 | 13776 | b(The)28 b(options)h(app)s(earing)f(in)g Ft(SHELLOPTS)e |
967625cd | 13777 | Fu(are)j(those)h(rep)s(orted)630 4838 y(as)g(`)p Ft(on)p |
6e51e0d0 | 13778 | Fu(')f(b)m(y)h(`)p Ft(set)g(-o)p Fu('.)40 b(If)29 b(this)h(v)-5 |
8f714a7c | 13779 | b(ariable)30 b(is)g(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)h |
967625cd | 13780 | (starts)g(up,)630 4947 y(eac)m(h)41 b(shell)e(option)h(in)f(the)h(list) |
8f714a7c | 13781 | g(will)f(b)s(e)g(enabled)h(b)s(efore)f(reading)g(an)m(y)h(startup)f |
967625cd CR |
13782 | (\014les.)630 5057 y(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 |
13783 | b(.)150 5230 y Ft(SHLVL)240 b Fu(Incremen)m(ted)21 b(b)m(y)g(one)g(eac) | |
8f714a7c | 13784 | m(h)h(time)f(a)h(new)e(instance)h(of)g(Bash)g(is)g(started.)38 |
967625cd CR |
13785 | b(This)20 b(is)h(in)m(tended)630 5340 y(to)31 b(b)s(e)f(a)h(coun)m(t)g |
13786 | (of)f(ho)m(w)h(deeply)f(y)m(our)g(Bash)h(shells)f(are)h(nested.)p | |
33723c84 | 13787 | eop end |
900a813b CR |
13788 | %%Page: 80 86 |
13789 | TeXDict begin 80 85 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
967625cd CR |
13790 | b(Shell)30 b(V)-8 b(ariables)2459 b(80)150 299 y Ft(TIMEFORMAT)630 |
13791 | 408 y Fu(The)30 b(v)-5 b(alue)32 b(of)f(this)g(parameter)g(is)g(used)f | |
13792 | (as)h(a)g(format)h(string)f(sp)s(ecifying)f(ho)m(w)h(the)g(tim-)630 | |
13793 | 518 y(ing)37 b(information)f(for)h(pip)s(elines)f(pre\014xed)f(with)h | |
13794 | (the)h Ft(time)e Fu(reserv)m(ed)i(w)m(ord)f(should)g(b)s(e)630 | |
13795 | 628 y(displa)m(y)m(ed.)k(The)27 b(`)p Ft(\045)p Fu(')h(c)m(haracter)h | |
13796 | (in)m(tro)s(duces)e(an)h(escap)s(e)g(sequence)g(that)g(is)f(expanded)g | |
13797 | (to)630 737 y(a)37 b(time)g(v)-5 b(alue)36 b(or)h(other)f(information.) | |
13798 | 59 b(The)36 b(escap)s(e)g(sequences)h(and)e(their)i(meanings)630 | |
13799 | 847 y(are)31 b(as)f(follo)m(ws;)i(the)f(braces)f(denote)h(optional)h(p) | |
13800 | s(ortions.)630 1006 y Ft(\045\045)384 b Fu(A)30 b(literal)i(`)p | |
13801 | Ft(\045)p Fu('.)630 1166 y Ft(\045[)p Fj(p)p Ft(][l]R)96 | |
13802 | b Fu(The)30 b(elapsed)h(time)g(in)f(seconds.)630 1325 | |
13803 | y Ft(\045[)p Fj(p)p Ft(][l]U)96 b Fu(The)30 b(n)m(um)m(b)s(er)f(of)h | |
13804 | (CPU)g(seconds)h(sp)s(en)m(t)f(in)g(user)f(mo)s(de.)630 | |
13805 | 1484 y Ft(\045[)p Fj(p)p Ft(][l]S)96 b Fu(The)30 b(n)m(um)m(b)s(er)f | |
13806 | (of)h(CPU)g(seconds)h(sp)s(en)m(t)f(in)g(system)g(mo)s(de.)630 | |
13807 | 1644 y Ft(\045P)384 b Fu(The)30 b(CPU)g(p)s(ercen)m(tage,)i(computed)e | |
13808 | (as)h(\(\045U)f Ft(+)g Fu(\045S\))g(/)h(\045R.)630 1803 | |
13809 | y(The)23 b(optional)j Fr(p)g Fu(is)e(a)g(digit)h(sp)s(ecifying)e(the)h | |
13810 | (precision,)i(the)e(n)m(um)m(b)s(er)f(of)h(fractional)h(digits)630 | |
13811 | 1913 y(after)36 b(a)f(decimal)i(p)s(oin)m(t.)55 b(A)35 | |
13812 | b(v)-5 b(alue)36 b(of)f(0)h(causes)g(no)f(decimal)h(p)s(oin)m(t)f(or)h | |
13813 | (fraction)g(to)g(b)s(e)630 2022 y(output.)48 b(A)m(t)34 | |
13814 | b(most)f(three)g(places)h(after)f(the)g(decimal)h(p)s(oin)m(t)f(ma)m(y) | |
13815 | h(b)s(e)e(sp)s(eci\014ed;)i(v)-5 b(alues)630 2132 y(of)31 | |
13816 | b Fr(p)h Fu(greater)g(than)e(3)h(are)f(c)m(hanged)h(to)g(3.)42 | |
13817 | b(If)29 b Fr(p)k Fu(is)d(not)h(sp)s(eci\014ed,)f(the)h(v)-5 | |
13818 | b(alue)30 b(3)h(is)g(used.)630 2267 y(The)54 b(optional)h | |
13819 | Ft(l)f Fu(sp)s(eci\014es)g(a)h(longer)f(format,)61 b(including)54 | |
13820 | b(min)m(utes,)61 b(of)54 b(the)g(form)630 2376 y Fr(MM)10 | |
13821 | b Fu(m)p Fr(SS)p Fu(.)p Fr(FF)d Fu(s.)103 b(The)50 b(v)-5 | |
13822 | b(alue)52 b(of)f Fr(p)j Fu(determines)d(whether)f(or)h(not)h(the)f | |
13823 | (fraction)h(is)630 2486 y(included.)630 2620 y(If)30 | |
13824 | b(this)g(v)-5 b(ariable)31 b(is)g(not)f(set,)i(Bash)e(acts)h(as)g(if)f | |
13825 | (it)h(had)f(the)h(v)-5 b(alue)870 2755 y Ft | |
33723c84 | 13826 | ($'\\nreal\\t\0453lR\\nuser\\t\0453)o(lU\\n)o(sys\\)o(t\0453)o(lS')630 |
967625cd | 13827 | 2889 y Fu(If)37 b(the)g(v)-5 b(alue)38 b(is)f(n)m(ull,)i(no)f(timing)f |
33723c84 | 13828 | (information)h(is)f(displa)m(y)m(ed.)62 b(A)37 b(trailing)i(newline)e |
967625cd CR |
13829 | (is)630 2999 y(added)30 b(when)f(the)i(format)f(string)h(is)f(displa)m |
13830 | (y)m(ed.)150 3158 y Ft(TMOUT)240 b Fu(If)22 b(set)h(to)g(a)g(v)-5 | |
6e51e0d0 | 13831 | b(alue)23 b(greater)h(than)e(zero,)j Ft(TMOUT)d Fu(is)g(treated)i(as)e |
967625cd | 13832 | (the)h(default)g(timeout)g(for)g(the)630 3268 y Ft(read)31 |
6e51e0d0 | 13833 | b Fu(builtin)h(\(see)h(Section)f(4.2)i([Bash)e(Builtins],)h(page)g |
967625cd | 13834 | (48\).)47 b(The)32 b Ft(select)e Fu(command)630 3377 |
bce12dd7 | 13835 | y(\(see)f(Section)h(3.2.4.2)g([Conditional)g(Constructs],)e(page)i |
967625cd | 13836 | (10\))f(terminates)g(if)g(input)e(do)s(es)630 3487 y(not)k(arriv)m(e)g |
bce12dd7 | 13837 | (after)g Ft(TMOUT)e Fu(seconds)h(when)f(input)h(is)g(coming)h(from)f(a) |
967625cd | 13838 | h(terminal.)630 3621 y(In)40 b(an)h(in)m(teractiv)m(e)i(shell,)h(the)d |
9f178efb | 13839 | (v)-5 b(alue)41 b(is)g(in)m(terpreted)g(as)f(the)h(n)m(um)m(b)s(er)f |
967625cd | 13840 | (of)h(seconds)f(to)630 3731 y(w)m(ait)28 b(for)e(a)g(line)h(of)g(input) |
9f178efb | 13841 | e(after)i(issuing)f(the)h(primary)e(prompt.)39 b(Bash)26 |
967625cd | 13842 | b(terminates)h(after)630 3841 y(w)m(aiting)32 b(for)e(that)h(n)m(um)m |
9f178efb | 13843 | (b)s(er)e(of)h(seconds)h(if)f(a)h(complete)h(line)e(of)h(input)e(do)s |
967625cd | 13844 | (es)h(not)h(arriv)m(e.)150 4000 y Ft(TMPDIR)192 b Fu(If)39 |
9f178efb | 13845 | b(set,)j(Bash)e(uses)f(its)h(v)-5 b(alue)40 b(as)f(the)h(name)f(of)h(a) |
967625cd | 13846 | g(directory)g(in)f(whic)m(h)g(Bash)h(creates)630 4110 |
9f178efb | 13847 | y(temp)s(orary)30 b(\014les)g(for)g(the)h(shell's)g(use.)150 |
967625cd | 13848 | 4269 y Ft(UID)336 b Fu(The)30 b(n)m(umeric)g(real)h(user)f(id)g(of)g |
9f178efb CR |
13849 | (the)h(curren)m(t)f(user.)40 b(This)30 b(v)-5 b(ariable)31 |
13850 | b(is)f(readonly)-8 b(.)p eop end | |
900a813b | 13851 | %%Page: 81 87 |
037a8b7f | 13852 | TeXDict begin 81 86 bop 3659 -116 a Fu(81)150 299 y Fp(6)80 |
967625cd CR |
13853 | b(Bash)54 b(F)-13 b(eatures)150 502 y Fu(This)30 b(c)m(hapter)h |
13854 | (describ)s(es)e(features)i(unique)e(to)i(Bash.)150 731 | |
13855 | y Fs(6.1)68 b(In)l(v)l(oking)46 b(Bash)390 890 y Ft(bash)h([long-opt])e | |
6e51e0d0 CR |
13856 | ([-ir])h([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)p |
13857 | Ft(])e([-O)i Fj(shopt_option)p Ft(])e([)p Fj(ar-)390 | |
967625cd | 13858 | 1000 y(gument)h Ft(...)o(])390 1110 y(bash)h([long-opt])e |
6e51e0d0 CR |
13859 | ([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)p Ft(])f([-O)h |
13860 | Fj(shopt_option)p Ft(])d(-c)j Fj(string)f Ft([)p Fj(ar-)390 | |
967625cd | 13861 | 1219 y(gument)g Ft(...)o(])390 1329 y(bash)h([long-opt])e(-s)i |
6e51e0d0 | 13862 | ([-abefhkmnptuvxdBCDHP])42 b([-o)k Fj(option)p Ft(])g([-O)h |
967625cd CR |
13863 | Fj(shopt_option)p Ft(])d([)p Fj(ar-)390 1438 y(gument)i |
13864 | Ft(...)o(])275 1567 y Fu(All)31 b(of)g(the)f(single-c)m(haracter)k | |
6e51e0d0 | 13865 | (options)d(used)f(with)g(the)h Ft(set)f Fu(builtin)g(\(see)h(Section)h |
967625cd | 13866 | (4.3.1)g([The)f(Set)150 1676 y(Builtin],)45 b(page)c(59\))i(can)e(b)s |
6e51e0d0 | 13867 | (e)f(used)h(as)g(options)g(when)f(the)i(shell)f(is)g(in)m(v)m(ok)m(ed.) |
967625cd | 13868 | 74 b(In)41 b(addition,)j(there)150 1786 y(are)38 b(sev)m(eral)h(m)m |
eb0b2ad8 CR |
13869 | (ulti-c)m(haracter)h(options)d(that)h(y)m(ou)g(can)g(use.)61 |
13870 | b(These)38 b(options)f(m)m(ust)h(app)s(ear)e(on)i(the)150 | |
967625cd CR |
13871 | 1896 y(command)30 b(line)h(b)s(efore)f(the)g(single-c)m(haracter)j |
13872 | (options)e(to)g(b)s(e)f(recognized.)150 2043 y Ft(--debugger)630 | |
13873 | 2152 y Fu(Arrange)j(for)g(the)g(debugger)g(pro\014le)g(to)h(b)s(e)e | |
37c41ab1 | 13874 | (executed)i(b)s(efore)f(the)g(shell)g(starts.)49 b(T)-8 |
037a8b7f CR |
13875 | b(urns)630 2262 y(on)35 b(extended)g(debugging)f(mo)s(de)h(\(see)g |
13876 | (Section)h(4.3.2)h([The)d(Shopt)g(Builtin],)j(page)f(63,)630 | |
967625cd CR |
13877 | 2371 y(for)30 b(a)h(description)f(of)h(the)f Ft(extdebug)f |
13878 | Fu(option)h(to)h(the)g Ft(shopt)e Fu(builtin\).)150 2519 | |
13879 | y Ft(--dump-po-strings)630 2628 y Fu(A)37 b(list)g(of)f(all)i | |
6e51e0d0 | 13880 | (double-quoted)e(strings)g(preceded)g(b)m(y)h(`)p Ft($)p |
967625cd | 13881 | Fu(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 2738 |
6e51e0d0 CR |
13882 | y(output)29 b(in)g(the)g Fm(gnu)g Ft(gettext)f Fu(PO)g(\(p)s(ortable)i |
13883 | (ob)5 b(ject\))30 b(\014le)g(format.)40 b(Equiv)-5 b(alen)m(t)31 | |
967625cd CR |
13884 | b(to)f Ft(-D)630 2847 y Fu(except)h(for)f(the)h(output)f(format.)150 |
13885 | 2995 y Ft(--dump-strings)630 3104 y Fu(Equiv)-5 b(alen)m(t)31 | |
13886 | b(to)g Ft(-D)p Fu(.)150 3251 y Ft(--help)192 b Fu(Displa)m(y)32 | |
6e51e0d0 | 13887 | b(a)e(usage)h(message)h(on)e(standard)g(output)g(and)f(exit)j |
967625cd CR |
13888 | (successfully)-8 b(.)150 3399 y Ft(--init-file)27 b Fj(filename)150 |
13889 | 3508 y Ft(--rcfile)h Fj(filename)630 3618 y Fu(Execute)23 | |
6e51e0d0 CR |
13890 | b(commands)e(from)g Fr(\014lename)28 b Fu(\(instead)22 |
13891 | b(of)g Ft(~/.bashrc)p Fu(\))e(in)h(an)h(in)m(teractiv)m(e)i(shell.)150 | |
967625cd CR |
13892 | 3765 y Ft(--login)144 b Fu(Equiv)-5 b(alen)m(t)31 b(to)g |
13893 | Ft(-l)p Fu(.)150 3912 y Ft(--noediting)630 4022 y Fu(Do)h(not)e(use)h | |
6e51e0d0 | 13894 | (the)g Fm(gnu)f Fu(Readline)i(library)e(\(see)h(Chapter)g(8)g([Command) |
967625cd | 13895 | f(Line)g(Editing],)630 4131 y(page)h(103\))h(to)f(read)g(command)f |
6e51e0d0 | 13896 | (lines)g(when)g(the)g(shell)h(is)f(in)m(teractiv)m(e.)150 |
967625cd | 13897 | 4278 y Ft(--noprofile)630 4388 y Fu(Don't)22 b(load)g(the)g |
6e51e0d0 | 13898 | (system-wide)f(startup)g(\014le)h Ft(/etc/profile)c Fu(or)j(an)m(y)h |
967625cd | 13899 | (of)f(the)h(p)s(ersonal)f(ini-)630 4498 y(tialization)34 |
6e51e0d0 | 13900 | b(\014les)e Ft(~/.bash_profile)p Fu(,)c Ft(~/.bash_login)p |
967625cd | 13901 | Fu(,)g(or)k Ft(~/.profile)c Fu(when)j(Bash)630 4607 y(is)f(in)m(v)m(ok) |
6e51e0d0 CR |
13902 | m(ed)i(as)f(a)g(login)g(shell.)150 4754 y Ft(--norc)192 |
13903 | b Fu(Don't)35 b(read)f(the)g Ft(~/.bashrc)e Fu(initialization)k(\014le) | |
13904 | f(in)e(an)h(in)m(teractiv)m(e)j(shell.)52 b(This)33 b(is)h(on)630 | |
967625cd | 13905 | 4864 y(b)m(y)c(default)h(if)f(the)h(shell)f(is)h(in)m(v)m(ok)m(ed)h(as) |
6e51e0d0 CR |
13906 | e Ft(sh)p Fu(.)150 5011 y Ft(--posix)144 b Fu(Change)24 |
13907 | b(the)h(b)s(eha)m(vior)f(of)g(Bash)h(where)e(the)i(default)f(op)s | |
13908 | (eration)h(di\013ers)f(from)f(the)i Fm(posix)630 5121 | |
13909 | y Fu(standard)35 b(to)h(matc)m(h)g(the)g(standard.)55 | |
eb0b2ad8 | 13910 | b(This)35 b(is)h(in)m(tended)f(to)h(mak)m(e)h(Bash)f(b)s(eha)m(v)m(e)g |
6e51e0d0 | 13911 | (as)g(a)630 5230 y(strict)26 b(sup)s(erset)e(of)h(that)g(standard.)38 |
900a813b | 13912 | b(See)26 b(Section)f(6.11)i([Bash)e(POSIX)f(Mo)s(de],)j(page)f(95,)630 |
6e51e0d0 CR |
13913 | 5340 y(for)k(a)h(description)f(of)h(the)f(Bash)h Fm(posix)f |
13914 | Fu(mo)s(de.)p eop end | |
900a813b CR |
13915 | %%Page: 82 88 |
13916 | TeXDict begin 82 87 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
13917 | b(Bash)30 b(F)-8 b(eatures)2484 b(82)150 299 y Ft(--restricted)630 | |
6e51e0d0 CR |
13918 | 408 y Fu(Mak)m(e)54 b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h |
13919 | (Section)g(6.10)h([The)d(Restricted)j(Shell],)630 518 | |
900a813b | 13920 | y(page)31 b(94\).)150 687 y Ft(--verbose)630 796 y Fu(Equiv)-5 |
6e51e0d0 | 13921 | b(alen)m(t)31 b(to)g Ft(-v)p Fu(.)41 b(Prin)m(t)30 b(shell)g(input)g |
fc527055 CR |
13922 | (lines)g(as)h(they're)g(read.)150 965 y Ft(--version)630 |
13923 | 1074 y Fu(Sho)m(w)d(v)m(ersion)g(information)g(for)g(this)g(instance)h | |
13924 | (of)f(Bash)g(on)g(the)g(standard)f(output)h(and)630 1184 | |
13925 | y(exit)j(successfully)-8 b(.)275 1357 y(There)28 b(are)i(sev)m(eral)g | |
6e51e0d0 | 13926 | (single-c)m(haracter)i(options)d(that)h(ma)m(y)g(b)s(e)e(supplied)g(at) |
fc527055 | 13927 | i(in)m(v)m(o)s(cation)h(whic)m(h)e(are)150 1467 y(not)i(a)m(v)-5 |
6e51e0d0 | 13928 | b(ailable)32 b(with)e(the)h Ft(set)e Fu(builtin.)150 |
fc527055 CR |
13929 | 1640 y Ft(-c)384 b Fu(Read)66 b(and)f(execute)i(commands)e(from)g(the)h |
13930 | (\014rst)e(non-option)i(argumen)m(t)g Fr(com-)630 1749 | |
13931 | y(mand)p 859 1749 28 4 v 39 w(string)p Fu(,)34 b(then)e(exit.)49 | |
13932 | b(If)32 b(there)h(are)g(argumen)m(ts)g(after)g(the)g | |
13933 | Fr(command)p 3303 1749 V 40 w(string)p Fu(,)h(the)630 | |
13934 | 1859 y(\014rst)e(argumen)m(t)h(is)g(assigned)g(to)h Ft($0)e | |
13935 | Fu(and)h(an)m(y)g(remaining)g(argumen)m(ts)g(are)g(assigned)g(to)630 | |
13936 | 1968 y(the)38 b(p)s(ositional)h(parameters.)65 b(The)37 | |
13937 | b(assignmen)m(t)i(to)g Ft($0)f Fu(sets)g(the)h(name)f(of)g(the)g | |
13938 | (shell,)630 2078 y(whic)m(h)30 b(is)h(used)e(in)h(w)m(arning)g(and)g | |
13939 | (error)g(messages.)150 2247 y Ft(-i)384 b Fu(F)-8 b(orce)22 | |
eb0b2ad8 CR |
13940 | b(the)g(shell)f(to)g(run)f(in)m(teractiv)m(ely)-8 b(.)41 |
13941 | b(In)m(teractiv)m(e)23 b(shells)e(are)h(describ)s(ed)d(in)i(Section)h | |
900a813b | 13942 | (6.3)630 2356 y([In)m(teractiv)m(e)33 b(Shells],)e(page)g(84.)150 |
fc527055 | 13943 | 2525 y Ft(-l)384 b Fu(Mak)m(e)33 b(this)e(shell)h(act)g(as)g(if)f(it)h |
eb0b2ad8 | 13944 | (had)f(b)s(een)f(directly)i(in)m(v)m(ok)m(ed)h(b)m(y)f(login.)44 |
fc527055 | 13945 | b(When)31 b(the)h(shell)630 2634 y(is)37 b(in)m(teractiv)m(e,)43 |
eb0b2ad8 | 13946 | b(this)37 b(is)g(equiv)-5 b(alen)m(t)39 b(to)f(starting)h(a)e(login)i |
6e51e0d0 | 13947 | (shell)e(with)g(`)p Ft(exec)30 b(-l)g(bash)p Fu('.)630 |
fc527055 | 13948 | 2744 y(When)h(the)g(shell)h(is)f(not)g(in)m(teractiv)m(e,)k(the)c |
eb0b2ad8 | 13949 | (login)h(shell)g(startup)f(\014les)g(will)g(b)s(e)g(executed.)630 |
fc527055 | 13950 | 2853 y(`)p Ft(exec)e(bash)h(-l)p Fu(')43 b(or)h(`)p Ft(exec)29 |
6e51e0d0 | 13951 | b(bash)g(--login)p Fu(')42 b(will)i(replace)h(the)f(curren)m(t)f(shell) |
fc527055 | 13952 | h(with)g(a)630 2963 y(Bash)26 b(login)g(shell.)39 b(See)26 |
900a813b | 13953 | b(Section)g(6.2)h([Bash)e(Startup)g(Files],)j(page)e(83,)i(for)d(a)h |
fc527055 CR |
13954 | (description)630 3073 y(of)31 b(the)f(sp)s(ecial)h(b)s(eha)m(vior)g(of) |
13955 | f(a)h(login)g(shell.)150 3241 y Ft(-r)384 b Fu(Mak)m(e)54 | |
37c41ab1 | 13956 | b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h(Section)g(6.10)h([The) |
900a813b | 13957 | d(Restricted)j(Shell],)630 3351 y(page)31 b(94\).)150 |
fc527055 | 13958 | 3519 y Ft(-s)384 b Fu(If)24 b(this)h(option)h(is)f(presen)m(t,)h(or)f |
eb0b2ad8 | 13959 | (if)g(no)f(argumen)m(ts)i(remain)e(after)i(option)f(pro)s(cessing,)h |
fc527055 | 13960 | (then)630 3629 y(commands)i(are)h(read)g(from)f(the)h(standard)f |
eb0b2ad8 | 13961 | (input.)39 b(This)28 b(option)h(allo)m(ws)h(the)f(p)s(ositional)630 |
fc527055 CR |
13962 | 3738 y(parameters)i(to)g(b)s(e)f(set)g(when)g(in)m(v)m(oking)h(an)g(in) |
13963 | m(teractiv)m(e)i(shell.)150 3907 y Ft(-D)384 b Fu(A)37 | |
37c41ab1 | 13964 | b(list)g(of)f(all)i(double-quoted)e(strings)g(preceded)g(b)m(y)h(`)p |
6e51e0d0 | 13965 | Ft($)p Fu(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 |
fc527055 CR |
13966 | 4017 y(output.)63 b(These)38 b(are)g(the)g(strings)g(that)h(are)f(sub)5 |
13967 | b(ject)38 b(to)h(language)g(translation)g(when)630 4126 | |
6e51e0d0 CR |
13968 | y(the)e(curren)m(t)g(lo)s(cale)h(is)f(not)g Ft(C)g Fu(or)f |
13969 | Ft(POSIX)g Fu(\(see)h(Section)h(3.1.2.5)h([Lo)s(cale)g(T)-8 | |
fc527055 | 13970 | b(ranslation],)630 4236 y(page)31 b(7\).)42 b(This)29 |
6e51e0d0 | 13971 | b(implies)i(the)f Ft(-n)g Fu(option;)h(no)f(commands)g(will)h(b)s(e)f |
fc527055 CR |
13972 | (executed.)150 4404 y Ft([-+]O)f([)p Fj(shopt_option)p |
13973 | Ft(])630 4514 y Fr(shopt)p 854 4514 V 40 w(option)44 | |
6e51e0d0 | 13974 | b Fu(is)g(one)h(of)f(the)g(shell)h(options)f(accepted)h(b)m(y)f(the)h |
fc527055 CR |
13975 | Ft(shopt)d Fu(builtin)i(\(see)630 4623 y(Section)32 b(4.3.2)h([The)e |
13976 | (Shopt)f(Builtin],)i(page)g(63\).)44 b(If)31 b Fr(shopt)p | |
13977 | 2724 4623 V 40 w(option)g Fu(is)g(presen)m(t,)h Ft(-O)f | |
13978 | Fu(sets)630 4733 y(the)24 b(v)-5 b(alue)24 b(of)g(that)h(option;)h | |
6e51e0d0 | 13979 | Ft(+O)e Fu(unsets)f(it.)39 b(If)23 b Fr(shopt)p 2423 |
fc527055 CR |
13980 | 4733 V 40 w(option)h Fu(is)g(not)g(supplied,)g(the)g(names)630 |
13981 | 4843 y(and)31 b(v)-5 b(alues)32 b(of)g(the)g(shell)g(options)g | |
6e51e0d0 | 13982 | (accepted)h(b)m(y)f Ft(shopt)e Fu(are)i(prin)m(ted)f(on)h(the)g |
fc527055 | 13983 | (standard)630 4952 y(output.)40 b(If)29 b(the)h(in)m(v)m(o)s(cation)h |
6e51e0d0 | 13984 | (option)f(is)f Ft(+O)p Fu(,)h(the)f(output)g(is)h(displa)m(y)m(ed)g(in) |
fc527055 CR |
13985 | f(a)h(format)f(that)630 5062 y(ma)m(y)i(b)s(e)f(reused)f(as)i(input.) |
13986 | 150 5230 y Ft(--)384 b Fu(A)38 b Ft(--)g Fu(signals)g(the)h(end)e(of)i | |
6e51e0d0 | 13987 | (options)f(and)g(disables)g(further)f(option)h(pro)s(cessing.)64 |
fc527055 CR |
13988 | b(An)m(y)630 5340 y(argumen)m(ts)31 b(after)g(the)f Ft(--)g |
13989 | Fu(are)h(treated)g(as)g(\014lenames)f(and)g(argumen)m(ts.)p | |
13990 | eop end | |
900a813b CR |
13991 | %%Page: 83 89 |
13992 | TeXDict begin 83 88 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
13993 | b(Bash)30 b(F)-8 b(eatures)2484 b(83)275 299 y(A)27 b | |
fc527055 CR |
13994 | Fl(lo)-5 b(gin)35 b Fu(shell)27 b(is)g(one)h(whose)f(\014rst)f(c)m |
13995 | (haracter)j(of)e(argumen)m(t)h(zero)f(is)h(`)p Ft(-)p | |
13996 | Fu(',)g(or)f(one)g(in)m(v)m(ok)m(ed)i(with)e(the)150 | |
037a8b7f | 13997 | 408 y Ft(--login)h Fu(option.)275 555 y(An)g Fl(inter)-5 |
fc527055 CR |
13998 | b(active)37 b Fu(shell)30 b(is)f(one)g(started)h(without)f(non-option)h |
13999 | (argumen)m(ts,)g(unless)e Ft(-s)h Fu(is)g(sp)s(eci\014ed,)150 | |
037a8b7f | 14000 | 665 y(without)k(sp)s(ecifying)h(the)f Ft(-c)g Fu(option,)i(and)e(whose) |
fc527055 | 14001 | g(input)g(and)f(output)h(are)h(b)s(oth)f(connected)h(to)g(ter-)150 |
037a8b7f | 14002 | 774 y(minals)g(\(as)g(determined)f(b)m(y)h Ft(isatty\(3\))p |
fc527055 | 14003 | Fu(\),)e(or)i(one)g(started)g(with)f(the)h Ft(-i)f Fu(option.)51 |
037a8b7f CR |
14004 | b(See)33 b(Section)i(6.3)150 884 y([In)m(teractiv)m(e)e(Shells],)e |
14005 | (page)g(84,)g(for)f(more)h(information.)275 1031 y(If)i(argumen)m(ts)h | |
fc527055 | 14006 | (remain)g(after)h(option)f(pro)s(cessing,)h(and)e(neither)h(the)g |
037a8b7f | 14007 | Ft(-c)g Fu(nor)f(the)h Ft(-s)g Fu(option)g(has)150 1140 |
fc527055 CR |
14008 | y(b)s(een)44 b(supplied,)j(the)d(\014rst)g(argumen)m(t)h(is)g(assumed)e |
14009 | (to)j(b)s(e)d(the)i(name)g(of)f(a)h(\014le)g(con)m(taining)h(shell)150 | |
037a8b7f | 14010 | 1250 y(commands)30 b(\(see)g(Section)h(3.8)g([Shell)f(Scripts],)g(page) |
8a0829e9 | 14011 | h(40\).)41 b(When)30 b(Bash)g(is)g(in)m(v)m(ok)m(ed)i(in)d(this)h |
037a8b7f | 14012 | (fashion,)150 1359 y Ft($0)37 b Fu(is)g(set)h(to)h(the)e(name)h(of)f |
fc527055 | 14013 | (the)h(\014le,)i(and)c(the)i(p)s(ositional)g(parameters)g(are)g(set)g |
037a8b7f | 14014 | (to)g(the)g(remaining)150 1469 y(argumen)m(ts.)h(Bash)26 |
fc527055 | 14015 | b(reads)f(and)g(executes)h(commands)f(from)g(this)g(\014le,)i(then)e |
037a8b7f | 14016 | (exits.)40 b(Bash's)25 b(exit)i(status)150 1579 y(is)f(the)h(exit)h |
fc527055 | 14017 | (status)e(of)h(the)g(last)g(command)f(executed)h(in)g(the)f(script.)40 |
037a8b7f CR |
14018 | b(If)26 b(no)g(commands)g(are)h(executed,)150 1688 y(the)k(exit)g |
14019 | (status)g(is)f(0.)150 1947 y Fs(6.2)68 b(Bash)45 b(Startup)g(Files)150 | |
14020 | 2107 y Fu(This)23 b(section)j(describ)s(es)d(ho)m(w)i(Bash)f(executes)h | |
c302751c | 14021 | (its)g(startup)f(\014les.)38 b(If)24 b(an)m(y)h(of)f(the)h(\014les)f |
037a8b7f | 14022 | (exist)h(but)e(cannot)150 2216 y(b)s(e)29 b(read,)i(Bash)f(rep)s(orts)f |
122f603c | 14023 | (an)h(error.)40 b(Tildes)30 b(are)g(expanded)f(in)h(\014lenames)g(as)g |
037a8b7f | 14024 | (describ)s(ed)f(ab)s(o)m(v)m(e)i(under)150 2326 y(Tilde)f(Expansion)g |
c2fa6583 | 14025 | (\(see)h(Section)h(3.5.2)g([Tilde)e(Expansion],)h(page)g(22\).)275 |
037a8b7f | 14026 | 2473 y(In)m(teractiv)m(e)h(shells)f(are)g(describ)s(ed)e(in)h(Section)h |
900a813b | 14027 | (6.3)h([In)m(teractiv)m(e)h(Shells],)d(page)h(84.)150 |
037a8b7f CR |
14028 | 2684 y Fk(In)m(v)m(ok)m(ed)40 b(as)h(an)f(in)m(teractiv)m(e)f(login)j |
14029 | (shell,)g(or)g(with)e Fh(--login)150 2831 y Fu(When)c(Bash)f(is)h(in)m | |
6e51e0d0 | 14030 | (v)m(ok)m(ed)h(as)f(an)g(in)m(teractiv)m(e)j(login)d(shell,)i(or)e(as)g |
037a8b7f | 14031 | (a)g(non-in)m(teractiv)m(e)i(shell)e(with)g(the)150 2940 |
6e51e0d0 CR |
14032 | y Ft(--login)30 b Fu(option,)k(it)f(\014rst)e(reads)h(and)g(executes)i |
14033 | (commands)e(from)f(the)i(\014le)f Ft(/etc/profile)p Fu(,)e(if)i(that) | |
037a8b7f | 14034 | 150 3050 y(\014le)44 b(exists.)80 b(After)44 b(reading)g(that)g |
6e51e0d0 | 14035 | (\014le,)j(it)d(lo)s(oks)g(for)f Ft(~/.bash_profile)p |
037a8b7f | 14036 | Fu(,)g Ft(~/.bash_login)p Fu(,)h(and)150 3160 y Ft(~/.profile)p |
6e51e0d0 | 14037 | Fu(,)25 b(in)i(that)g(order,)h(and)e(reads)h(and)f(executes)j(commands) |
037a8b7f | 14038 | d(from)h(the)g(\014rst)f(one)i(that)f(exists)150 3269 |
6e51e0d0 CR |
14039 | y(and)j(is)h(readable.)42 b(The)30 b Ft(--noprofile)d |
14040 | Fu(option)k(ma)m(y)g(b)s(e)f(used)g(when)g(the)h(shell)f(is)h(started)g | |
037a8b7f | 14041 | (to)g(inhibit)150 3379 y(this)f(b)s(eha)m(vior.)275 3526 |
0385211b CR |
14042 | y(When)h(an)g(in)m(teractiv)m(e)k(login)d(shell)g(exits,)h(or)f(a)g |
14043 | (non-in)m(teractiv)m(e)i(login)f(shell)e(executes)i(the)f | |
037a8b7f | 14044 | Ft(exit)150 3635 y Fu(builtin)g(command,)i(Bash)e(reads)h(and)f |
0385211b | 14045 | (executes)i(commands)e(from)g(the)h(\014le)g Ft(~/.bash_logout)p |
037a8b7f | 14046 | Fu(,)d(if)i(it)150 3745 y(exists.)150 3956 y Fk(In)m(v)m(ok)m(ed)40 |
0385211b | 14047 | b(as)h(an)f(in)m(teractiv)m(e)f(non-login)k(shell)150 |
037a8b7f | 14048 | 4103 y Fu(When)g(an)h(in)m(teractiv)m(e)i(shell)e(that)g(is)f(not)h(a)g |
6e51e0d0 | 14049 | (login)g(shell)g(is)f(started,)48 b(Bash)c(reads)f(and)g(executes)150 |
037a8b7f | 14050 | 4213 y(commands)31 b(from)g Ft(~/.bashrc)p Fu(,)f(if)h(that)h(\014le)g |
6e51e0d0 | 14051 | (exists.)44 b(This)31 b(ma)m(y)h(b)s(e)f(inhibited)g(b)m(y)g(using)g |
037a8b7f | 14052 | (the)h Ft(--norc)150 4322 y Fu(option.)40 b(The)27 b |
6e51e0d0 | 14053 | Ft(--rcfile)h Fj(file)e Fu(option)h(will)g(force)h(Bash)f(to)h(read)f |
037a8b7f CR |
14054 | (and)f(execute)j(commands)d(from)h Fr(\014le)150 4432 |
14055 | y Fu(instead)k(of)f Ft(~/.bashrc)p Fu(.)275 4579 y(So,)g(t)m(ypically) | |
6e51e0d0 | 14056 | -8 b(,)33 b(y)m(our)d Ft(~/.bash_profile)c Fu(con)m(tains)32 |
037a8b7f CR |
14057 | b(the)f(line)390 4725 y Ft(if)47 b([)h(-f)f(~/.bashrc)e(];)i(then)g(.)g |
14058 | (~/.bashrc;)e(fi)150 4872 y Fu(after)31 b(\(or)g(b)s(efore\))f(an)m(y)h | |
14059 | (login-sp)s(eci\014c)g(initializations.)150 5083 y Fk(In)m(v)m(ok)m(ed) | |
14060 | 40 b(non-in)m(teractiv)m(ely)150 5230 y Fu(When)33 b(Bash)g(is)g | |
6e51e0d0 CR |
14061 | (started)h(non-in)m(teractiv)m(ely)-8 b(,)37 b(to)d(run)e(a)h(shell)h |
14062 | (script,)g(for)f(example,)i(it)e(lo)s(oks)h(for)f(the)150 | |
037a8b7f | 14063 | 5340 y(v)-5 b(ariable)35 b Ft(BASH_ENV)d Fu(in)i(the)h(en)m(vironmen)m |
6e51e0d0 | 14064 | (t,)h(expands)e(its)g(v)-5 b(alue)35 b(if)g(it)g(app)s(ears)e(there,)j |
037a8b7f | 14065 | (and)e(uses)g(the)p eop end |
900a813b CR |
14066 | %%Page: 84 90 |
14067 | TeXDict begin 84 89 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
037a8b7f CR |
14068 | b(Bash)30 b(F)-8 b(eatures)2484 b(84)150 299 y(expanded)30 |
14069 | b(v)-5 b(alue)30 b(as)h(the)g(name)f(of)h(a)f(\014le)h(to)g(read)f(and) | |
14070 | g(execute.)42 b(Bash)31 b(b)s(eha)m(v)m(es)g(as)g(if)f(the)g(follo)m | |
14071 | (wing)150 408 y(command)g(w)m(ere)h(executed:)390 552 | |
14072 | y Ft(if)47 b([)h(-n)f("$BASH_ENV")e(];)i(then)f(.)i("$BASH_ENV";)c(fi) | |
14073 | 150 696 y Fu(but)30 b(the)g(v)-5 b(alue)31 b(of)g(the)f | |
14074 | Ft(PATH)f Fu(v)-5 b(ariable)32 b(is)e(not)h(used)e(to)i(searc)m(h)g | |
14075 | (for)f(the)h(\014lename.)275 840 y(As)42 b(noted)g(ab)s(o)m(v)m(e,)47 | |
fc527055 | 14076 | b(if)42 b(a)h(non-in)m(teractiv)m(e)i(shell)d(is)g(in)m(v)m(ok)m(ed)i |
037a8b7f | 14077 | (with)e(the)h Ft(--login)d Fu(option,)46 b(Bash)150 949 |
fc527055 | 14078 | y(attempts)31 b(to)g(read)g(and)e(execute)j(commands)e(from)g(the)h |
037a8b7f CR |
14079 | (login)g(shell)g(startup)e(\014les.)150 1158 y Fk(In)m(v)m(ok)m(ed)40 |
14080 | b(with)g(name)h Fh(sh)150 1305 y Fu(If)c(Bash)g(is)g(in)m(v)m(ok)m(ed)i | |
fc527055 | 14081 | (with)e(the)g(name)g Ft(sh)p Fu(,)i(it)f(tries)f(to)h(mimic)g(the)f |
037a8b7f | 14082 | (startup)g(b)s(eha)m(vior)g(of)h(historical)150 1414 |
fc527055 CR |
14083 | y(v)m(ersions)31 b(of)f Ft(sh)g Fu(as)h(closely)h(as)e(p)s(ossible,)g |
14084 | (while)h(conforming)f(to)h(the)g Fm(posix)e Fu(standard)h(as)h(w)m | |
037a8b7f | 14085 | (ell.)275 1558 y(When)50 b(in)m(v)m(ok)m(ed)j(as)f(an)f(in)m(teractiv)m |
fc527055 | 14086 | (e)j(login)e(shell,)57 b(or)51 b(as)g(a)h(non-in)m(teractiv)m(e)h |
037a8b7f | 14087 | (shell)f(with)f(the)150 1668 y Ft(--login)31 b Fu(option,)k(it)e |
fc527055 | 14088 | (\014rst)g(attempts)h(to)g(read)f(and)g(execute)h(commands)f(from)g |
037a8b7f | 14089 | Ft(/etc/profile)d Fu(and)150 1777 y Ft(~/.profile)p Fu(,)d(in)i(that)i |
fc527055 | 14090 | (order.)39 b(The)30 b Ft(--noprofile)c Fu(option)k(ma)m(y)g(b)s(e)f |
037a8b7f | 14091 | (used)g(to)h(inhibit)f(this)h(b)s(eha)m(vior.)150 1887 |
fc527055 CR |
14092 | y(When)36 b(in)m(v)m(ok)m(ed)i(as)e(an)g(in)m(teractiv)m(e)j(shell)e |
14093 | (with)f(the)g(name)h Ft(sh)p Fu(,)g(Bash)f(lo)s(oks)h(for)f(the)h(v)-5 | |
037a8b7f | 14094 | b(ariable)37 b Ft(ENV)p Fu(,)150 1997 y(expands)29 b(its)i(v)-5 |
6e51e0d0 CR |
14095 | b(alue)30 b(if)h(it)f(is)g(de\014ned,)g(and)f(uses)h(the)g(expanded)g |
14096 | (v)-5 b(alue)30 b(as)h(the)f(name)g(of)g(a)h(\014le)f(to)h(read)150 | |
037a8b7f | 14097 | 2106 y(and)g(execute.)46 b(Since)32 b(a)g(shell)g(in)m(v)m(ok)m(ed)h |
6e51e0d0 | 14098 | (as)f Ft(sh)f Fu(do)s(es)g(not)h(attempt)h(to)g(read)e(and)g(execute)i |
037a8b7f | 14099 | (commands)150 2216 y(from)39 b(an)m(y)g(other)h(startup)e(\014les,)k |
6e51e0d0 | 14100 | (the)d Ft(--rcfile)e Fu(option)j(has)f(no)g(e\013ect.)69 |
037a8b7f | 14101 | b(A)39 b(non-in)m(teractiv)m(e)j(shell)150 2325 y(in)m(v)m(ok)m(ed)32 |
6e51e0d0 | 14102 | b(with)e(the)g(name)h Ft(sh)f Fu(do)s(es)g(not)g(attempt)i(to)f(read)f |
037a8b7f | 14103 | (an)m(y)h(other)g(startup)e(\014les.)275 2469 y(When)h(in)m(v)m(ok)m |
6e51e0d0 CR |
14104 | (ed)h(as)g Ft(sh)p Fu(,)f(Bash)h(en)m(ters)g Fm(posix)e |
14105 | Fu(mo)s(de)h(after)h(the)g(startup)f(\014les)g(are)h(read.)150 | |
037a8b7f CR |
14106 | 2678 y Fk(In)m(v)m(ok)m(ed)40 b(in)h Fg(posix)g Fk(mo)s(de)150 |
14107 | 2824 y Fu(When)28 b(Bash)h(is)g(started)g(in)g Fm(posix)f | |
6e51e0d0 | 14108 | Fu(mo)s(de,)g(as)h(with)g(the)g Ft(--posix)d Fu(command)j(line)g |
037a8b7f | 14109 | (option,)h(it)f(follo)m(ws)150 2934 y(the)24 b Fm(posix)f |
6e51e0d0 CR |
14110 | Fu(standard)h(for)f(startup)h(\014les.)38 b(In)24 b(this)g(mo)s(de,)h |
14111 | (in)m(teractiv)m(e)i(shells)d(expand)f(the)h Ft(ENV)f | |
037a8b7f | 14112 | Fu(v)-5 b(ariable)150 3044 y(and)30 b(commands)g(are)g(read)h(and)e |
c302751c | 14113 | (executed)j(from)d(the)i(\014le)f(whose)g(name)h(is)f(the)h(expanded)e |
037a8b7f CR |
14114 | (v)-5 b(alue.)41 b(No)150 3153 y(other)31 b(startup)f(\014les)g(are)h |
14115 | (read.)150 3362 y Fk(In)m(v)m(ok)m(ed)40 b(b)m(y)g(remote)h(shell)h | |
14116 | (daemon)150 3509 y Fu(Bash)36 b(attempts)h(to)g(determine)f(when)f(it)i | |
c302751c | 14117 | (is)f(b)s(eing)g(run)e(with)i(its)g(standard)g(input)f(connected)i(to)g |
037a8b7f | 14118 | (a)150 3618 y(net)m(w)m(ork)h(connection,)j(as)c(when)g(executed)h(b)m |
6e51e0d0 | 14119 | (y)f(the)h(remote)g(shell)g(daemon,)h(usually)e Ft(rshd)p |
037a8b7f | 14120 | Fu(,)h(or)g(the)150 3728 y(secure)c(shell)f(daemon)h |
6e51e0d0 | 14121 | Ft(sshd)p Fu(.)49 b(If)33 b(Bash)g(determines)h(it)g(is)f(b)s(eing)g |
037a8b7f | 14122 | (run)f(in)i(this)f(fashion,)h(it)g(reads)g(and)150 3837 |
6e51e0d0 CR |
14123 | y(executes)29 b(commands)e(from)g Ft(~/.bashrc)p Fu(,)e(if)j(that)g |
14124 | (\014le)f(exists)h(and)f(is)g(readable.)41 b(It)27 b(will)h(not)f(do)h | |
037a8b7f | 14125 | (this)f(if)150 3947 y(in)m(v)m(ok)m(ed)k(as)f Ft(sh)p |
6e51e0d0 CR |
14126 | Fu(.)40 b(The)29 b Ft(--norc)f Fu(option)i(ma)m(y)g(b)s(e)f(used)f(to)j |
14127 | (inhibit)e(this)g(b)s(eha)m(vior,)h(and)f(the)h Ft(--rcfile)150 | |
037a8b7f | 14128 | 4057 y Fu(option)36 b(ma)m(y)g(b)s(e)e(used)h(to)h(force)g(another)f |
6e51e0d0 | 14129 | (\014le)h(to)g(b)s(e)e(read,)j(but)d(neither)i Ft(rshd)e |
037a8b7f | 14130 | Fu(nor)h Ft(sshd)f Fu(generally)150 4166 y(in)m(v)m(ok)m(e)e(the)f |
6e51e0d0 | 14131 | (shell)f(with)h(those)f(options)h(or)f(allo)m(w)i(them)f(to)g(b)s(e)e |
037a8b7f | 14132 | (sp)s(eci\014ed.)150 4375 y Fk(In)m(v)m(ok)m(ed)40 b(with)g(unequal)h |
6e51e0d0 | 14133 | (e\013ectiv)m(e)e(and)i(real)g Fg(uid/gid)p Fk(s)150 |
037a8b7f | 14134 | 4522 y Fu(If)34 b(Bash)h(is)g(started)g(with)f(the)h(e\013ectiv)m(e)i |
6e51e0d0 | 14135 | (user)d(\(group\))h(id)f(not)h(equal)g(to)g(the)g(real)g(user)f |
037a8b7f | 14136 | (\(group\))h(id,)150 4631 y(and)26 b(the)i Ft(-p)e Fu(option)h(is)g |
6e51e0d0 | 14137 | (not)h(supplied,)e(no)h(startup)g(\014les)g(are)g(read,)h(shell)f |
037a8b7f | 14138 | (functions)g(are)g(not)g(inherited)150 4741 y(from)41 |
6e51e0d0 CR |
14139 | b(the)g(en)m(vironmen)m(t,)j(the)d Ft(SHELLOPTS)p Fu(,)h |
14140 | Ft(BASHOPTS)p Fu(,)g Ft(CDPATH)p Fu(,)g(and)e Ft(GLOBIGNORE)e | |
037a8b7f | 14141 | Fu(v)-5 b(ariables,)45 b(if)150 4850 y(they)28 b(app)s(ear)f(in)h(the)g |
6e51e0d0 | 14142 | (en)m(vironmen)m(t,)i(are)e(ignored,)h(and)e(the)h(e\013ectiv)m(e)j |
037a8b7f | 14143 | (user)c(id)h(is)g(set)g(to)h(the)f(real)h(user)150 4960 |
6e51e0d0 CR |
14144 | y(id.)62 b(If)38 b(the)f Ft(-p)h Fu(option)g(is)f(supplied)g(at)h(in)m |
14145 | (v)m(o)s(cation,)k(the)c(startup)f(b)s(eha)m(vior)h(is)g(the)g(same,)i | |
037a8b7f CR |
14146 | (but)d(the)150 5070 y(e\013ectiv)m(e)c(user)d(id)g(is)g(not)h(reset.) |
14147 | 150 5324 y Fs(6.3)68 b(In)l(teractiv)l(e)47 b(Shells)p | |
fc527055 | 14148 | eop end |
900a813b CR |
14149 | %%Page: 85 91 |
14150 | TeXDict begin 85 90 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14151 | b(Bash)30 b(F)-8 b(eatures)2484 b(85)150 299 y Fk(6.3.1)63 | |
fc527055 CR |
14152 | b(What)40 b(is)h(an)g(In)m(teractiv)m(e)e(Shell?)150 |
14153 | 446 y Fu(An)g(in)m(teractiv)m(e)k(shell)d(is)g(one)g(started)g(without) | |
14154 | g(non-option)g(argumen)m(ts,)j(unless)c Ft(-s)h Fu(is)f(sp)s | |
14155 | (eci\014ed,)150 555 y(without)30 b(sp)s(ecifying)g(the)g | |
14156 | Ft(-c)f Fu(option,)h(and)g(whose)f(input)g(and)g(error)h(output)f(are)h | |
14157 | (b)s(oth)f(connected)i(to)150 665 y(terminals)g(\(as)g(determined)f(b)m | |
14158 | (y)g Ft(isatty\(3\))p Fu(\),)e(or)j(one)f(started)h(with)f(the)h | |
14159 | Ft(-i)f Fu(option.)275 797 y(An)g(in)m(teractiv)m(e)j(shell)d | |
14160 | (generally)i(reads)e(from)g(and)g(writes)g(to)h(a)g(user's)f(terminal.) | |
14161 | 275 929 y(The)i Ft(-s)g Fu(in)m(v)m(o)s(cation)j(option)f(ma)m(y)f(b)s | |
14162 | (e)g(used)f(to)i(set)f(the)g(p)s(ositional)h(parameters)f(when)f(an)h | |
14163 | (in)m(ter-)150 1038 y(activ)m(e)g(shell)d(is)h(started.)150 | |
14164 | 1232 y Fk(6.3.2)63 b(Is)41 b(this)g(Shell)g(In)m(teractiv)m(e?)150 | |
14165 | 1379 y Fu(T)-8 b(o)30 b(determine)g(within)f(a)h(startup)g(script)f | |
14166 | (whether)g(or)h(not)g(Bash)g(is)g(running)e(in)m(teractiv)m(ely)-8 | |
14167 | b(,)33 b(test)e(the)150 1489 y(v)-5 b(alue)30 b(of)g(the)f(`)p | |
6e51e0d0 CR |
14168 | Ft(-)p Fu(')h(sp)s(ecial)g(parameter.)41 b(It)29 b(con)m(tains)i |
14169 | Ft(i)e Fu(when)g(the)g(shell)h(is)f(in)m(teractiv)m(e.)44 | |
fc527055 CR |
14170 | b(F)-8 b(or)30 b(example:)390 1621 y Ft(case)47 b("$-")f(in)390 |
14171 | 1730 y(*i*\))h(echo)f(This)h(shell)f(is)h(interactive)e(;;)390 | |
14172 | 1840 y(*\))i(echo)g(This)f(shell)h(is)g(not)g(interactive)e(;;)390 | |
14173 | 1949 y(esac)275 2081 y Fu(Alternativ)m(ely)-8 b(,)28 | |
6e51e0d0 CR |
14174 | b(startup)23 b(scripts)h(ma)m(y)g(examine)g(the)g(v)-5 |
14175 | b(ariable)25 b Ft(PS1)p Fu(;)g(it)g(is)e(unset)h(in)f(non-in)m | |
fc527055 CR |
14176 | (teractiv)m(e)150 2191 y(shells,)31 b(and)e(set)i(in)f(in)m(teractiv)m |
14177 | (e)k(shells.)40 b(Th)m(us:)390 2323 y Ft(if)47 b([)h(-z)f("$PS1")f(];)h | |
14178 | (then)772 2432 y(echo)f(This)h(shell)f(is)i(not)f(interactive)390 | |
14179 | 2542 y(else)772 2651 y(echo)f(This)h(shell)f(is)i(interactive)390 | |
14180 | 2761 y(fi)150 2955 y Fk(6.3.3)63 b(In)m(teractiv)m(e)38 | |
14181 | b(Shell)k(Beha)m(vior)150 3102 y Fu(When)30 b(the)h(shell)f(is)h | |
c302751c | 14182 | (running)d(in)m(teractiv)m(ely)-8 b(,)34 b(it)d(c)m(hanges)h(its)f(b)s |
fc527055 | 14183 | (eha)m(vior)f(in)g(sev)m(eral)i(w)m(a)m(ys.)199 3234 |
37c41ab1 CR |
14184 | y(1.)61 b(Startup)37 b(\014les)g(are)h(read)f(and)g(executed)h(as)f |
14185 | (describ)s(ed)g(in)g(Section)h(6.2)g([Bash)g(Startup)e(Files],)330 | |
900a813b CR |
14186 | 3343 y(page)31 b(83.)199 3475 y(2.)61 b(Job)35 b(Con)m(trol)g(\(see)h |
14187 | (Chapter)f(7)g([Job)g(Con)m(trol],)i(page)f(99\))g(is)f(enabled)g(b)m | |
fc527055 | 14188 | (y)g(default.)55 b(When)34 b(job)330 3585 y(con)m(trol)h(is)f(in)f |
37c41ab1 | 14189 | (e\013ect,)k(Bash)d(ignores)g(the)g(k)m(eyb)s(oard-generated)h(job)e |
fc527055 CR |
14190 | (con)m(trol)i(signals)g Ft(SIGTTIN)p Fu(,)330 3694 y |
14191 | Ft(SIGTTOU)p Fu(,)29 b(and)g Ft(SIGTSTP)p Fu(.)199 3826 | |
6e51e0d0 CR |
14192 | y(3.)61 b(Bash)39 b(expands)f(and)g(displa)m(ys)h Ft(PS1)f |
14193 | Fu(b)s(efore)h(reading)g(the)g(\014rst)f(line)h(of)g(a)g(command,)i | |
fc527055 | 14194 | (and)d(ex-)330 3936 y(pands)30 b(and)g(displa)m(ys)h |
6e51e0d0 | 14195 | Ft(PS2)e Fu(b)s(efore)i(reading)g(the)g(second)f(and)h(subsequen)m(t)f |
967625cd CR |
14196 | (lines)h(of)g(a)g(m)m(ulti-line)330 4045 y(command.)40 |
14197 | b(Bash)31 b(displa)m(ys)f Ft(PS0)g Fu(after)h(it)g(reads)f(a)h(command) | |
14198 | f(but)f(b)s(efore)h(executing)i(it.)199 4177 y(4.)61 | |
14199 | b(Bash)26 b(executes)i(the)e(v)-5 b(alue)27 b(of)f(the)h | |
14200 | Ft(PROMPT_COMMAND)22 b Fu(v)-5 b(ariable)27 b(as)g(a)f(command)g(b)s | |
14201 | (efore)g(prin)m(ting)330 4287 y(the)31 b(primary)e(prompt,)h | |
14202 | Ft($PS1)f Fu(\(see)i(Section)g(5.2)h([Bash)f(V)-8 b(ariables],)32 | |
14203 | b(page)f(70\).)199 4419 y(5.)61 b(Readline)27 b(\(see)g(Chapter)e(8)h | |
14204 | ([Command)g(Line)g(Editing],)h(page)g(103\))g(is)f(used)g(to)g(read)g | |
14205 | (commands)330 4528 y(from)k(the)g(user's)g(terminal.)199 | |
14206 | 4660 y(6.)61 b(Bash)36 b(insp)s(ects)g(the)h(v)-5 b(alue)37 | |
14207 | b(of)f(the)g Ft(ignoreeof)e Fu(option)j(to)g Ft(set)29 | |
14208 | b(-o)36 b Fu(instead)h(of)f(exiting)i(imme-)330 4770 | |
14209 | y(diately)f(when)e(it)i(receiv)m(es)h(an)e Ft(EOF)f Fu(on)h(its)g | |
14210 | (standard)f(input)g(when)h(reading)g(a)g(command)g(\(see)330 | |
14211 | 4879 y(Section)31 b(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(59\).)199 | |
14212 | 5011 y(7.)61 b(Command)43 b(history)h(\(see)h(Section)g(9.1)g([Bash)f | |
14213 | (History)h(F)-8 b(acilities],)51 b(page)45 b(136\))h(and)d(history)330 | |
14214 | 5121 y(expansion)h(\(see)i(Section)f(9.3)h([History)g(In)m(teraction],) | |
14215 | k(page)45 b(138\))h(are)f(enabled)g(b)m(y)f(default.)330 | |
fc527055 | 14216 | 5230 y(Bash)28 b(will)g(sa)m(v)m(e)h(the)f(command)f(history)h(to)g |
6e51e0d0 | 14217 | (the)g(\014le)g(named)f(b)m(y)h Ft($HISTFILE)d Fu(when)h(a)i(shell)g |
fc527055 | 14218 | (with)330 5340 y(history)i(enabled)h(exits.)p eop end |
900a813b CR |
14219 | %%Page: 86 92 |
14220 | TeXDict begin 86 91 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14221 | b(Bash)30 b(F)-8 b(eatures)2484 b(86)199 299 y(8.)61 | |
fc527055 | 14222 | b(Alias)31 b(expansion)g(\(see)g(Section)g(6.6)g([Aliases],)i(page)e |
967625cd | 14223 | (89\))h(is)e(p)s(erformed)f(b)m(y)h(default.)199 430 |
fc527055 CR |
14224 | y(9.)61 b(In)24 b(the)g(absence)h(of)f(an)m(y)h(traps,)g(Bash)g |
14225 | (ignores)f Ft(SIGTERM)f Fu(\(see)i(Section)g(3.7.6)h([Signals],)g(page) | |
967625cd | 14226 | f(39\).)154 562 y(10.)61 b(In)26 b(the)h(absence)h(of)f(an)m(y)g |
fc527055 CR |
14227 | (traps,)g Ft(SIGINT)e Fu(is)i(caugh)m(t)h(and)f(handled)e(\(\(see)k |
14228 | (Section)e(3.7.6)i([Signals],)330 672 y(page)i(39\).)42 | |
14229 | b Ft(SIGINT)29 b Fu(will)h(in)m(terrupt)g(some)h(shell)g(builtins.)154 | |
967625cd | 14230 | 803 y(11.)61 b(An)40 b(in)m(teractiv)m(e)j(login)e(shell)g(sends)e(a)i |
6e51e0d0 | 14231 | Ft(SIGHUP)d Fu(to)j(all)g(jobs)f(on)g(exit)h(if)g(the)f |
967625cd | 14232 | Ft(huponexit)e Fu(shell)330 913 y(option)31 b(has)f(b)s(een)g(enabled)g |
fc527055 | 14233 | (\(see)h(Section)g(3.7.6)i([Signals],)e(page)g(39\).)154 |
967625cd | 14234 | 1044 y(12.)61 b(The)29 b Ft(-n)g Fu(in)m(v)m(o)s(cation)j(option)e(is)g |
6e51e0d0 | 14235 | (ignored,)g(and)f(`)p Ft(set)h(-n)p Fu(')f(has)h(no)f(e\013ect)j(\(see) |
967625cd CR |
14236 | e(Section)h(4.3.1)g([The)330 1154 y(Set)g(Builtin],)g(page)g(59\).)154 |
14237 | 1285 y(13.)61 b(Bash)32 b(will)g(c)m(hec)m(k)i(for)e(mail)g(p)s(erio)s | |
6e51e0d0 CR |
14238 | (dically)-8 b(,)34 b(dep)s(ending)c(on)i(the)g(v)-5 b(alues)32 |
14239 | b(of)g(the)h Ft(MAIL)p Fu(,)e Ft(MAILPATH)p Fu(,)330 | |
967625cd | 14240 | 1395 y(and)f Ft(MAILCHECK)e Fu(shell)i(v)-5 b(ariables)31 |
6e51e0d0 | 14241 | b(\(see)h(Section)f(5.2)g([Bash)g(V)-8 b(ariables],)32 |
967625cd | 14242 | b(page)f(70\).)154 1526 y(14.)61 b(Expansion)32 b(errors)h(due)f(to)i |
6e51e0d0 CR |
14243 | (references)f(to)h(un)m(b)s(ound)c(shell)j(v)-5 b(ariables)34 |
14244 | b(after)g(`)p Ft(set)29 b(-u)p Fu(')k(has)g(b)s(een)330 | |
967625cd | 14245 | 1636 y(enabled)d(will)h(not)g(cause)g(the)f(shell)h(to)g(exit)g(\(see)g |
fc527055 | 14246 | (Section)h(4.3.1)g([The)e(Set)h(Builtin],)g(page)g(59\).)154 |
967625cd | 14247 | 1767 y(15.)61 b(The)48 b(shell)h(will)f(not)h(exit)g(on)g(expansion)f |
6e51e0d0 | 14248 | (errors)g(caused)g(b)m(y)h Fr(v)-5 b(ar)54 b Fu(b)s(eing)48 |
967625cd | 14249 | b(unset)g(or)h(n)m(ull)f(in)330 1877 y Ft(${)p Fj(var)p |
6e51e0d0 CR |
14250 | Ft(:?)p Fj(word)p Ft(})27 b Fu(expansions)j(\(see)h(Section)h(3.5.3)g |
14251 | ([Shell)e(P)m(arameter)i(Expansion],)e(page)h(23\).)154 | |
967625cd | 14252 | 2009 y(16.)61 b(Redirection)31 b(errors)f(encoun)m(tered)h(b)m(y)f |
6e51e0d0 | 14253 | (shell)h(builtins)f(will)g(not)h(cause)g(the)f(shell)h(to)g(exit.)154 |
967625cd | 14254 | 2140 y(17.)61 b(When)26 b(running)f(in)i Fm(posix)e Fu(mo)s(de,)j(a)f |
6e51e0d0 | 14255 | (sp)s(ecial)g(builtin)f(returning)g(an)g(error)h(status)g(will)g(not)f |
967625cd CR |
14256 | (cause)330 2250 y(the)31 b(shell)f(to)h(exit)h(\(see)f(Section)g(6.11)h |
14257 | ([Bash)f(POSIX)e(Mo)s(de],)i(page)g(95\).)154 2381 y(18.)61 | |
6e51e0d0 CR |
14258 | b(A)34 b(failed)g Ft(exec)f Fu(will)h(not)g(cause)g(the)g(shell)g(to)g |
14259 | (exit)h(\(see)f(Section)h(4.1)g([Bourne)f(Shell)f(Builtins],)330 | |
967625cd | 14260 | 2491 y(page)e(41\).)154 2622 y(19.)61 b(P)m(arser)31 |
37c41ab1 | 14261 | b(syn)m(tax)f(errors)g(will)h(not)g(cause)g(the)f(shell)h(to)g(exit.) |
967625cd | 14262 | 154 2754 y(20.)61 b(Simple)21 b(sp)s(elling)h(correction)g(for)g |
6e51e0d0 | 14263 | (directory)g(argumen)m(ts)f(to)i(the)e Ft(cd)g Fu(builtin)g(is)h |
967625cd | 14264 | (enabled)f(b)m(y)h(default)330 2863 y(\(see)35 b(the)g(description)f |
6e51e0d0 | 14265 | (of)h(the)f Ft(cdspell)f Fu(option)h(to)i(the)e Ft(shopt)f |
967625cd CR |
14266 | Fu(builtin)h(in)g(Section)h(4.3.2)h([The)330 2973 y(Shopt)30 |
14267 | b(Builtin],)h(page)g(63\).)154 3105 y(21.)61 b(The)42 | |
d3ad40de | 14268 | b(shell)h(will)g(c)m(hec)m(k)h(the)f(v)-5 b(alue)43 b(of)f(the)h |
6e51e0d0 | 14269 | Ft(TMOUT)e Fu(v)-5 b(ariable)44 b(and)e(exit)h(if)g(a)g(command)f(is)h |
967625cd | 14270 | (not)330 3214 y(read)30 b(within)g(the)g(sp)s(eci\014ed)f(n)m(um)m(b)s |
6e51e0d0 | 14271 | (er)g(of)i(seconds)f(after)g(prin)m(ting)g Ft($PS1)f |
967625cd CR |
14272 | Fu(\(see)i(Section)g(5.2)h([Bash)330 3324 y(V)-8 b(ariables],)32 |
14273 | b(page)f(70\).)150 3559 y Fs(6.4)68 b(Bash)45 b(Conditional)h | |
14274 | (Expressions)150 3718 y Fu(Conditional)26 b(expressions)g(are)g(used)f | |
6e51e0d0 | 14275 | (b)m(y)g(the)h Ft([[)f Fu(comp)s(ound)g(command)g(and)g(the)h |
967625cd CR |
14276 | Ft(test)f Fu(and)g Ft([)g Fu(builtin)150 3828 y(commands.)275 |
14277 | 3959 y(Expressions)32 b(ma)m(y)h(b)s(e)g(unary)f(or)h(binary)-8 | |
c302751c | 14278 | b(.)48 b(Unary)33 b(expressions)f(are)i(often)f(used)f(to)i(examine)g |
967625cd | 14279 | (the)150 4069 y(status)i(of)g(a)g(\014le.)57 b(There)35 |
6e51e0d0 | 14280 | b(are)h(string)g(op)s(erators)g(and)f(n)m(umeric)h(comparison)g(op)s |
967625cd | 14281 | (erators)g(as)g(w)m(ell.)57 b(If)150 4178 y(the)27 b |
6e51e0d0 CR |
14282 | Fr(\014le)33 b Fu(argumen)m(t)28 b(to)g(one)f(of)g(the)h(primaries)f |
14283 | (is)g(of)g(the)h(form)f Ft(/dev/fd/)p Fj(N)p Fu(,)e(then)i(\014le)h | |
967625cd | 14284 | (descriptor)f Fr(N)37 b Fu(is)150 4288 y(c)m(hec)m(k)m(ed.)51 |
6e51e0d0 CR |
14285 | b(If)32 b(the)h Fr(\014le)39 b Fu(argumen)m(t)33 b(to)h(one)f(of)g(the) |
14286 | g(primaries)g(is)g(one)g(of)h Ft(/dev/stdin)p Fu(,)d | |
967625cd | 14287 | Ft(/dev/stdout)p Fu(,)150 4397 y(or)f Ft(/dev/stderr)p |
6e51e0d0 | 14288 | Fu(,)e(\014le)i(descriptor)h(0,)g(1,)g(or)f(2,)h(resp)s(ectiv)m(ely)-8 |
967625cd | 14289 | b(,)32 b(is)f(c)m(hec)m(k)m(ed.)275 4529 y(When)37 b(used)g(with)g |
6e51e0d0 CR |
14290 | Ft([[)p Fu(,)i(the)f(`)p Ft(<)p Fu(')g(and)f(`)p Ft(>)p |
14291 | Fu(')h(op)s(erators)g(sort)g(lexicographically)i(using)d(the)h(curren)m | |
967625cd CR |
14292 | (t)150 4639 y(lo)s(cale.)k(The)30 b Ft(test)f Fu(command)i(uses)f(ASCI) |
14293 | s(I)e(ordering.)275 4770 y(Unless)44 b(otherwise)h(sp)s(eci\014ed,)j | |
e6062848 | 14294 | (primaries)c(that)h(op)s(erate)g(on)g(\014les)f(follo)m(w)i(sym)m(b)s |
967625cd | 14295 | (olic)f(links)g(and)150 4880 y(op)s(erate)31 b(on)f(the)h(target)h(of)e |
e6062848 | 14296 | (the)h(link,)f(rather)h(than)f(the)g(link)h(itself.)150 |
967625cd CR |
14297 | 5033 y Ft(-a)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
14298 | Fr(\014le)36 b Fu(exists.)150 5187 y Ft(-b)30 b Fj(file)162 | |
6e51e0d0 | 14299 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
eb0b2ad8 | 14300 | b(and)f(is)g(a)h(blo)s(c)m(k)g(sp)s(ecial)g(\014le.)150 |
fc527055 | 14301 | 5340 y Ft(-c)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
6e51e0d0 | 14302 | Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(a)h(c)m(haracter)h(sp)s(ecial) |
fc527055 | 14303 | f(\014le.)p eop end |
900a813b CR |
14304 | %%Page: 87 93 |
14305 | TeXDict begin 87 92 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14306 | b(Bash)30 b(F)-8 b(eatures)2484 b(87)150 299 y Ft(-d)30 | |
6e51e0d0 | 14307 | b Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 |
fc527055 CR |
14308 | b Fu(exists)31 b(and)f(is)g(a)h(directory)-8 b(.)150 |
14309 | 457 y Ft(-e)30 b Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g | |
14310 | Fr(\014le)36 b Fu(exists.)150 614 y Ft(-f)30 b Fj(file)162 | |
6e51e0d0 | 14311 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
fc527055 CR |
14312 | b(and)f(is)g(a)h(regular)f(\014le.)150 772 y Ft(-g)g |
14313 | Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b | |
14314 | Fu(exists)31 b(and)f(its)g(set-group-id)h(bit)g(is)f(set.)150 | |
14315 | 930 y Ft(-h)g Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 | |
14316 | b Fu(exists)31 b(and)f(is)g(a)h(sym)m(b)s(olic)g(link.)150 | |
14317 | 1088 y Ft(-k)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g | |
14318 | Fr(\014le)36 b Fu(exists)31 b(and)f(its)g Ft(")p Fu(stic)m(ky)p | |
14319 | Ft(")h Fu(bit)g(is)f(set.)150 1246 y Ft(-p)g Fj(file)162 | |
6e51e0d0 | 14320 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
fc527055 CR |
14321 | b(and)f(is)g(a)h(named)f(pip)s(e)f(\(FIF)m(O\).)150 1404 |
14322 | y Ft(-r)h Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 | |
14323 | b Fu(exists)31 b(and)f(is)g(readable.)150 1561 y Ft(-s)g | |
14324 | Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b | |
14325 | Fu(exists)31 b(and)f(has)g(a)g(size)i(greater)f(than)f(zero.)150 | |
14326 | 1719 y Ft(-t)g Fj(fd)258 b Fu(T)-8 b(rue)30 b(if)g(\014le)h(descriptor) | |
14327 | f Fr(fd)j Fu(is)e(op)s(en)e(and)h(refers)g(to)h(a)g(terminal.)150 | |
14328 | 1877 y Ft(-u)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g | |
6e51e0d0 | 14329 | Fr(\014le)36 b Fu(exists)31 b(and)f(its)g(set-user-id)h(bit)f(is)h |
fc527055 | 14330 | (set.)150 2035 y Ft(-w)f Fj(file)162 b Fu(T)-8 b(rue)30 |
6e51e0d0 | 14331 | b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(writable.)150 |
fc527055 | 14332 | 2193 y Ft(-x)g Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
6e51e0d0 | 14333 | Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(executable.)150 |
fc527055 | 14334 | 2350 y Ft(-G)g Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
6e51e0d0 | 14335 | Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(o)m(wned)g(b)m(y)h(the)f |
fc527055 | 14336 | (e\013ectiv)m(e)j(group)d(id.)150 2508 y Ft(-L)g Fj(file)162 |
6e51e0d0 | 14337 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
fc527055 | 14338 | b(and)f(is)g(a)h(sym)m(b)s(olic)g(link.)150 2666 y Ft(-N)f |
6e51e0d0 CR |
14339 | Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b |
14340 | Fu(exists)31 b(and)f(has)g(b)s(een)f(mo)s(di\014ed)h(since)g(it)h(w)m | |
fc527055 | 14341 | (as)g(last)g(read.)150 2824 y Ft(-O)f Fj(file)162 b Fu(T)-8 |
6e51e0d0 | 14342 | b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(o)m(wned)g(b)m |
fc527055 | 14343 | (y)h(the)f(e\013ectiv)m(e)j(user)d(id.)150 2982 y Ft(-S)g |
6e51e0d0 | 14344 | Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b |
fc527055 CR |
14345 | Fu(exists)31 b(and)f(is)g(a)h(so)s(c)m(k)m(et.)150 3139 |
14346 | y Fj(file1)e Ft(-ef)g Fj(file2)630 3249 y Fu(T)-8 b(rue)30 | |
6e51e0d0 CR |
14347 | b(if)g Fr(\014le1)38 b Fu(and)30 b Fr(\014le2)38 b Fu(refer)30 |
14348 | b(to)i(the)e(same)h(device)g(and)f(ino)s(de)g(n)m(um)m(b)s(ers.)150 | |
fc527055 | 14349 | 3407 y Fj(file1)f Ft(-nt)g Fj(file2)630 3516 y Fu(T)-8 |
6e51e0d0 CR |
14350 | b(rue)23 b(if)h Fr(\014le1)32 b Fu(is)24 b(new)m(er)g(\(according)h(to) |
14351 | g(mo)s(di\014cation)f(date\))h(than)f Fr(\014le2)p Fu(,)i(or)e(if)g | |
fc527055 CR |
14352 | Fr(\014le1)31 b Fu(exists)630 3626 y(and)f Fr(\014le2)38 |
14353 | b Fu(do)s(es)30 b(not.)150 3784 y Fj(file1)f Ft(-ot)g | |
14354 | Fj(file2)630 3893 y Fu(T)-8 b(rue)30 b(if)g Fr(\014le1)38 | |
6e51e0d0 CR |
14355 | b Fu(is)31 b(older)f(than)g Fr(\014le2)p Fu(,)i(or)e(if)g |
14356 | Fr(\014le2)38 b Fu(exists)31 b(and)f Fr(\014le1)38 b | |
fc527055 CR |
14357 | Fu(do)s(es)30 b(not.)150 4051 y Ft(-o)g Fj(optname)630 |
14358 | 4161 y Fu(T)-8 b(rue)41 b(if)g(the)g(shell)h(option)f | |
6e51e0d0 | 14359 | Fr(optname)47 b Fu(is)41 b(enabled.)73 b(The)41 b(list)h(of)f(options)h |
fc527055 | 14360 | (app)s(ears)e(in)630 4270 y(the)33 b(description)h(of)f(the)g |
6e51e0d0 | 14361 | Ft(-o)g Fu(option)g(to)h(the)g Ft(set)e Fu(builtin)h(\(see)h(Section)g |
fc527055 CR |
14362 | (4.3.1)h([The)e(Set)630 4380 y(Builtin],)e(page)g(59\).)150 |
14363 | 4538 y Ft(-v)f Fj(varname)630 4647 y Fu(T)-8 b(rue)30 | |
6e51e0d0 CR |
14364 | b(if)g(the)h(shell)f(v)-5 b(ariable)32 b Fr(v)-5 b(arname)35 |
14365 | b Fu(is)30 b(set)h(\(has)g(b)s(een)e(assigned)i(a)g(v)-5 | |
fc527055 | 14366 | b(alue\).)150 4805 y Ft(-R)30 b Fj(varname)630 4915 y |
6e51e0d0 CR |
14367 | Fu(T)-8 b(rue)30 b(if)g(the)h(shell)f(v)-5 b(ariable)32 |
14368 | b Fr(v)-5 b(arname)35 b Fu(is)30 b(set)h(and)f(is)h(a)f(name)h | |
fc527055 | 14369 | (reference.)150 5073 y Ft(-z)f Fj(string)66 b Fu(T)-8 |
6e51e0d0 | 14370 | b(rue)30 b(if)g(the)h(length)g(of)f Fr(string)38 b Fu(is)31 |
fc527055 | 14371 | b(zero.)150 5230 y Ft(-n)f Fj(string)150 5340 y(string)192 |
6e51e0d0 | 14372 | b Fu(T)-8 b(rue)30 b(if)g(the)h(length)g(of)f Fr(string)38 |
fc527055 | 14373 | b Fu(is)31 b(non-zero.)p eop end |
900a813b CR |
14374 | %%Page: 88 94 |
14375 | TeXDict begin 88 93 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14376 | b(Bash)30 b(F)-8 b(eatures)2484 b(88)150 299 y Fj(string1)28 | |
fc527055 CR |
14377 | b Ft(==)i Fj(string2)150 408 y(string1)e Ft(=)i Fj(string2)630 |
14378 | 518 y Fu(T)-8 b(rue)43 b(if)h(the)g(strings)g(are)g(equal.)82 | |
14379 | b(When)44 b(used)f(with)g(the)h Ft([[)g Fu(command,)j(this)d(p)s(er-) | |
14380 | 630 628 y(forms)d(pattern)g(matc)m(hing)i(as)f(describ)s(ed)e(ab)s(o)m | |
14381 | (v)m(e)j(\(see)f(Section)g(3.2.4.2)i([Conditional)630 | |
14382 | 737 y(Constructs],)30 b(page)h(10\).)630 872 y(`)p Ft(=)p | |
14383 | Fu(')g(should)e(b)s(e)h(used)f(with)h(the)h Ft(test)e | |
967625cd CR |
14384 | Fu(command)h(for)g Fm(posix)g Fu(conformance.)150 1032 |
14385 | y Fj(string1)e Ft(!=)i Fj(string2)630 1142 y Fu(T)-8 | |
fc527055 | 14386 | b(rue)30 b(if)g(the)h(strings)f(are)h(not)f(equal.)150 |
967625cd | 14387 | 1302 y Fj(string1)e Ft(<)i Fj(string2)630 1412 y Fu(T)-8 |
fc527055 | 14388 | b(rue)30 b(if)g Fr(string1)38 b Fu(sorts)31 b(b)s(efore)f |
967625cd CR |
14389 | Fr(string2)38 b Fu(lexicographically)-8 b(.)150 1572 |
14390 | y Fj(string1)28 b Ft(>)i Fj(string2)630 1682 y Fu(T)-8 | |
fc527055 | 14391 | b(rue)30 b(if)g Fr(string1)38 b Fu(sorts)31 b(after)g |
967625cd CR |
14392 | Fr(string2)38 b Fu(lexicographically)-8 b(.)150 1842 |
14393 | y Fj(arg1)29 b Ft(OP)h Fj(arg2)630 1952 y Ft(OP)j Fu(is)h(one)g(of)h(`) | |
fc527055 CR |
14394 | p Ft(-eq)p Fu(',)f(`)p Ft(-ne)p Fu(',)h(`)p Ft(-lt)p |
14395 | Fu(',)g(`)p Ft(-le)p Fu(',)f(`)p Ft(-gt)p Fu(',)h(or)f(`)p | |
14396 | Ft(-ge)p Fu('.)51 b(These)34 b(arithmetic)h(binary)630 | |
967625cd | 14397 | 2061 y(op)s(erators)h(return)e(true)i(if)f Fr(arg1)44 |
fc527055 | 14398 | b Fu(is)36 b(equal)g(to,)i(not)e(equal)g(to,)i(less)e(than,)h(less)f |
967625cd | 14399 | (than)f(or)630 2171 y(equal)29 b(to,)g(greater)h(than,)e(or)g(greater)i |
fc527055 | 14400 | (than)d(or)i(equal)f(to)h Fr(arg2)p Fu(,)h(resp)s(ectiv)m(ely)-8 |
967625cd | 14401 | b(.)42 b Fr(Arg1)36 b Fu(and)630 2280 y Fr(arg2)j Fu(ma)m(y)30 |
fc527055 | 14402 | b(b)s(e)g(p)s(ositiv)m(e)i(or)e(negativ)m(e)j(in)m(tegers.)150 |
967625cd | 14403 | 2523 y Fs(6.5)68 b(Shell)45 b(Arithmetic)150 2682 y Fu(The)35 |
fc527055 CR |
14404 | b(shell)g(allo)m(ws)i(arithmetic)f(expressions)f(to)h(b)s(e)f(ev)-5 |
14405 | b(aluated,)38 b(as)d(one)h(of)f(the)h(shell)f(expansions)g(or)150 | |
967625cd | 14406 | 2792 y(b)m(y)30 b(the)h Ft(let)e Fu(and)h(the)h Ft(-i)e |
fc527055 | 14407 | Fu(option)i(to)g(the)g Ft(declare)d Fu(builtins.)275 |
967625cd | 14408 | 2927 y(Ev)-5 b(aluation)27 b(is)g(done)f(in)g(\014xed-width)g(in)m |
fc527055 | 14409 | (tegers)i(with)e(no)h(c)m(hec)m(k)h(for)e(o)m(v)m(er\015o)m(w,)j |
967625cd | 14410 | (though)d(division)h(b)m(y)150 3037 y(0)g(is)g(trapp)s(ed)f(and)h |
fc527055 CR |
14411 | (\015agged)g(as)h(an)f(error.)39 b(The)26 b(op)s(erators)h(and)g(their) |
14412 | g(precedence,)h(asso)s(ciativit)m(y)-8 b(,)32 b(and)150 | |
967625cd | 14413 | 3146 y(v)-5 b(alues)35 b(are)h(the)f(same)g(as)h(in)e(the)h(C)g |
fc527055 | 14414 | (language.)56 b(The)35 b(follo)m(wing)h(list)g(of)f(op)s(erators)g(is)g |
967625cd | 14415 | (group)s(ed)f(in)m(to)150 3256 y(lev)m(els)27 b(of)f(equal-precedence)i |
fc527055 | 14416 | (op)s(erators.)39 b(The)25 b(lev)m(els)j(are)e(listed)h(in)e(order)h |
967625cd | 14417 | (of)g(decreasing)g(precedence.)150 3416 y Fj(id)p Ft(++)j |
fc527055 | 14418 | Fj(id)p Ft(--)67 b Fu(v)-5 b(ariable)31 b(p)s(ost-incremen)m(t)g(and)f |
967625cd | 14419 | (p)s(ost-decremen)m(t)150 3577 y Ft(++)p Fj(id)f Ft(--)p |
fc527055 | 14420 | Fj(id)67 b Fu(v)-5 b(ariable)31 b(pre-incremen)m(t)g(and)f |
967625cd CR |
14421 | (pre-decremen)m(t)150 3737 y Ft(-)g(+)354 b Fu(unary)29 |
14422 | b(min)m(us)h(and)g(plus)150 3897 y Ft(!)g(~)354 b Fu(logical)33 | |
14423 | b(and)d(bit)m(wise)h(negation)150 4058 y Ft(**)384 b | |
14424 | Fu(exp)s(onen)m(tiation)150 4218 y Ft(*)30 b(/)g(\045)276 | |
fc527055 | 14425 | b Fu(m)m(ultiplication,)33 b(division,)d(remainder)150 |
967625cd CR |
14426 | 4378 y Ft(+)g(-)354 b Fu(addition,)31 b(subtraction)150 |
14427 | 4539 y Ft(<<)f(>>)258 b Fu(left)31 b(and)f(righ)m(t)h(bit)m(wise)g | |
14428 | (shifts)150 4699 y Ft(<=)f(>=)g(<)g(>)102 b Fu(comparison)150 | |
14429 | 4859 y Ft(==)30 b(!=)258 b Fu(equalit)m(y)32 b(and)e(inequalit)m(y)150 | |
14430 | 5019 y Ft(&)432 b Fu(bit)m(wise)31 b(AND)150 5180 y Ft(^)432 | |
fc527055 CR |
14431 | b Fu(bit)m(wise)31 b(exclusiv)m(e)h(OR)150 5340 y Ft(|)432 |
14432 | b Fu(bit)m(wise)31 b(OR)p eop end | |
900a813b CR |
14433 | %%Page: 89 95 |
14434 | TeXDict begin 89 94 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14435 | b(Bash)30 b(F)-8 b(eatures)2484 b(89)150 299 y Ft(&&)384 | |
967625cd CR |
14436 | b Fu(logical)33 b(AND)150 445 y Ft(||)384 b Fu(logical)33 |
14437 | b(OR)150 590 y Ft(expr)c(?)h(expr)f(:)h(expr)630 700 | |
14438 | y Fu(conditional)i(op)s(erator)150 846 y Ft(=)e(*=)g(/=)g(\045=)f(+=)h | |
14439 | (-=)g(<<=)f(>>=)h(&=)g(^=)f(|=)630 955 y Fu(assignmen)m(t)150 | |
14440 | 1101 y Ft(expr1)g(,)h(expr2)630 1211 y Fu(comma)275 1356 | |
fc527055 CR |
14441 | y(Shell)38 b(v)-5 b(ariables)39 b(are)g(allo)m(w)m(ed)i(as)e(op)s |
14442 | (erands;)i(parameter)e(expansion)g(is)f(p)s(erformed)g(b)s(efore)g(the) | |
967625cd | 14443 | 150 1466 y(expression)g(is)g(ev)-5 b(aluated.)66 b(Within)38 |
6e51e0d0 | 14444 | b(an)h(expression,)h(shell)e(v)-5 b(ariables)39 b(ma)m(y)g(also)g(b)s |
967625cd | 14445 | (e)f(referenced)g(b)m(y)150 1575 y(name)31 b(without)f(using)g(the)h |
6e51e0d0 | 14446 | (parameter)g(expansion)f(syn)m(tax.)42 b(A)31 b(shell)f(v)-5 |
967625cd | 14447 | b(ariable)32 b(that)f(is)f(n)m(ull)h(or)f(unset)150 1685 |
6e51e0d0 CR |
14448 | y(ev)-5 b(aluates)41 b(to)f(0)g(when)e(referenced)h(b)m(y)g(name)h |
14449 | (without)f(using)g(the)g(parameter)h(expansion)f(syn)m(tax.)150 | |
967625cd | 14450 | 1795 y(The)c(v)-5 b(alue)37 b(of)f(a)h(v)-5 b(ariable)36 |
6e51e0d0 | 14451 | b(is)g(ev)-5 b(aluated)38 b(as)e(an)g(arithmetic)h(expression)f(when)f |
967625cd | 14452 | (it)h(is)g(referenced,)i(or)150 1904 y(when)31 b(a)i(v)-5 |
6e51e0d0 CR |
14453 | b(ariable)33 b(whic)m(h)f(has)g(b)s(een)f(giv)m(en)j(the)e |
14454 | Fr(in)m(teger)40 b Fu(attribute)33 b(using)f(`)p Ft(declare)d(-i)p | |
967625cd | 14455 | Fu(')i(is)i(assigned)150 2014 y(a)j(v)-5 b(alue.)58 b(A)36 |
6e51e0d0 CR |
14456 | b(n)m(ull)f(v)-5 b(alue)37 b(ev)-5 b(aluates)37 b(to)g(0.)57 |
14457 | b(A)36 b(shell)g(v)-5 b(ariable)37 b(need)e(not)h(ha)m(v)m(e)h(its)f | |
967625cd | 14458 | Fr(in)m(teger)44 b Fu(attribute)150 2123 y(turned)29 |
6e51e0d0 | 14459 | b(on)h(to)i(b)s(e)d(used)h(in)g(an)g(expression.)275 |
967625cd | 14460 | 2251 y(Constan)m(ts)41 b(with)g(a)h(leading)f(0)h(are)g(in)m(terpreted) |
6e51e0d0 | 14461 | f(as)g(o)s(ctal)i(n)m(um)m(b)s(ers.)72 b(A)41 b(leading)h(`)p |
967625cd | 14462 | Ft(0x)p Fu(')f(or)g(`)p Ft(0X)p Fu(')150 2361 y(denotes)30 |
6e51e0d0 CR |
14463 | b(hexadecimal.)42 b(Otherwise,)30 b(n)m(um)m(b)s(ers)f(tak)m(e)i(the)f |
14464 | (form)g([)p Fr(base)5 b Ft(#)p Fu(])p Fr(n)p Fu(,)30 | |
967625cd | 14465 | b(where)f(the)i(optional)g Fr(base)150 2470 y Fu(is)e(a)h(decimal)g(n)m |
6e51e0d0 CR |
14466 | (um)m(b)s(er)e(b)s(et)m(w)m(een)h(2)h(and)e(64)i(represen)m(ting)g(the) |
14467 | f(arithmetic)i(base,)e(and)g Fr(n)g Fu(is)g(a)g(n)m(um)m(b)s(er)150 | |
967625cd | 14468 | 2580 y(in)c(that)g(base.)39 b(If)25 b Fr(base)5 b Ft(#)24 |
8a0829e9 CR |
14469 | b Fu(is)h(omitted,)j(then)c(base)h(10)h(is)f(used.)38 |
14470 | b(When)25 b(sp)s(ecifying)f Fr(n)p Fu(,)i(the)f(digits)h(greater)150 | |
967625cd | 14471 | 2689 y(than)33 b(9)h(are)g(represen)m(ted)g(b)m(y)f(the)h(lo)m(w)m |
6e51e0d0 CR |
14472 | (ercase)i(letters,)g(the)d(upp)s(ercase)g(letters,)j(`)p |
14473 | Ft(@)p Fu(',)e(and)f(`)p Ft(_)p Fu(',)i(in)e(that)150 | |
967625cd | 14474 | 2799 y(order.)69 b(If)39 b Fr(base)45 b Fu(is)40 b(less)g(than)g(or)f |
abe2eb5b | 14475 | (equal)i(to)f(36,)k(lo)m(w)m(ercase)e(and)d(upp)s(ercase)g(letters)i |
967625cd | 14476 | (ma)m(y)g(b)s(e)e(used)150 2909 y(in)m(terc)m(hangeably)32 |
abe2eb5b | 14477 | b(to)f(represen)m(t)g(n)m(um)m(b)s(ers)e(b)s(et)m(w)m(een)i(10)g(and)f |
967625cd | 14478 | (35.)275 3036 y(Op)s(erators)44 b(are)h(ev)-5 b(aluated)46 |
abe2eb5b | 14479 | b(in)f(order)f(of)h(precedence.)85 b(Sub-expressions)44 |
967625cd | 14480 | b(in)g(paren)m(theses)i(are)150 3146 y(ev)-5 b(aluated)32 |
abe2eb5b | 14481 | b(\014rst)d(and)h(ma)m(y)h(o)m(v)m(erride)g(the)g(precedence)g(rules)f |
967625cd | 14482 | (ab)s(o)m(v)m(e.)150 3373 y Fs(6.6)68 b(Aliases)150 3532 |
6e51e0d0 | 14483 | y Fr(Aliases)41 b Fu(allo)m(w)d(a)f(string)f(to)h(b)s(e)f(substituted)g |
abe2eb5b | 14484 | (for)g(a)g(w)m(ord)g(when)g(it)h(is)f(used)f(as)i(the)g(\014rst)e(w)m |
967625cd | 14485 | (ord)h(of)h(a)150 3642 y(simple)32 b(command.)45 b(The)31 |
abe2eb5b | 14486 | b(shell)i(main)m(tains)f(a)h(list)f(of)g(aliases)i(that)e(ma)m(y)h(b)s |
967625cd CR |
14487 | (e)e(set)h(and)g(unset)f(with)h(the)150 3752 y Ft(alias)d |
14488 | Fu(and)h Ft(unalias)e Fu(builtin)i(commands.)275 3879 | |
abe2eb5b CR |
14489 | y(The)f(\014rst)f(w)m(ord)i(of)f(eac)m(h)i(simple)f(command,)g(if)f |
14490 | (unquoted,)g(is)h(c)m(hec)m(k)m(ed)h(to)g(see)f(if)g(it)g(has)f(an)g | |
967625cd | 14491 | (alias.)150 3989 y(If)24 b(so,)i(that)g(w)m(ord)e(is)h(replaced)g(b)m |
abe2eb5b | 14492 | (y)f(the)h(text)h(of)e(the)h(alias.)40 b(The)24 b(c)m(haracters)i(`)p |
6e51e0d0 | 14493 | Ft(/)p Fu(',)h(`)p Ft($)p Fu(',)f(`)p Ft(`)p Fu(',)g(`)p |
967625cd | 14494 | Ft(=)p Fu(')f(and)f(an)m(y)h(of)150 4098 y(the)e(shell)g(metac)m |
abe2eb5b CR |
14495 | (haracters)i(or)e(quoting)g(c)m(haracters)h(listed)g(ab)s(o)m(v)m(e)g |
14496 | (ma)m(y)f(not)g(app)s(ear)f(in)h(an)g(alias)h(name.)150 | |
967625cd | 14497 | 4208 y(The)e(replacemen)m(t)h(text)g(ma)m(y)g(con)m(tain)h(an)m(y)e(v) |
abe2eb5b | 14498 | -5 b(alid)23 b(shell)f(input,)h(including)f(shell)g(metac)m(haracters.) |
967625cd | 14499 | 40 b(The)150 4318 y(\014rst)35 b(w)m(ord)g(of)h(the)g(replacemen)m(t)i |
abe2eb5b | 14500 | (text)e(is)g(tested)h(for)e(aliases,)k(but)c(a)h(w)m(ord)g(that)g(is)g |
967625cd | 14501 | (iden)m(tical)i(to)e(an)150 4427 y(alias)c(b)s(eing)f(expanded)f(is)h |
abe2eb5b | 14502 | (not)g(expanded)f(a)h(second)g(time.)43 b(This)30 b(means)h(that)g(one) |
967625cd | 14503 | g(ma)m(y)h(alias)g Ft(ls)e Fu(to)150 4537 y Ft("ls)f(-F")p |
6e51e0d0 | 14504 | Fu(,)f(for)f(instance,)i(and)d(Bash)i(do)s(es)f(not)h(try)f(to)h |
abe2eb5b | 14505 | (recursiv)m(ely)g(expand)e(the)i(replacemen)m(t)h(text.)40 |
967625cd | 14506 | b(If)150 4646 y(the)31 b(last)h(c)m(haracter)h(of)e(the)h(alias)g(v)-5 |
6e51e0d0 | 14507 | b(alue)31 b(is)h(a)f Fr(blank)p Fu(,)g(then)g(the)g(next)h(command)e(w) |
967625cd CR |
14508 | m(ord)h(follo)m(wing)i(the)150 4756 y(alias)f(is)e(also)h(c)m(hec)m(k)m |
14509 | (ed)i(for)d(alias)h(expansion.)275 4884 y(Aliases)e(are)f(created)i | |
6e51e0d0 | 14510 | (and)d(listed)i(with)f(the)g Ft(alias)f Fu(command,)h(and)g(remo)m(v)m |
fc527055 CR |
14511 | (ed)h(with)f(the)g Ft(unalias)150 4993 y Fu(command.)275 |
14512 | 5121 y(There)44 b(is)h(no)g(mec)m(hanism)g(for)f(using)h(argumen)m(ts)g | |
6e51e0d0 | 14513 | (in)f(the)h(replacemen)m(t)i(text,)i(as)d(in)e Ft(csh)p |
fc527055 | 14514 | Fu(.)83 b(If)150 5230 y(argumen)m(ts)37 b(are)h(needed,)g(a)g(shell)f |
6e51e0d0 | 14515 | (function)f(should)g(b)s(e)h(used)f(\(see)i(Section)g(3.3)g([Shell)f(F) |
fc527055 | 14516 | -8 b(unctions],)150 5340 y(page)31 b(17\).)p eop end |
900a813b CR |
14517 | %%Page: 90 96 |
14518 | TeXDict begin 90 95 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14519 | b(Bash)30 b(F)-8 b(eatures)2484 b(90)275 299 y(Aliases)33 | |
fc527055 CR |
14520 | b(are)h(not)e(expanded)g(when)g(the)h(shell)g(is)g(not)g(in)m(teractiv) |
14521 | m(e,)j(unless)c(the)h Ft(expand_aliases)150 408 y Fu(shell)e(option)f | |
14522 | (is)h(set)g(using)f Ft(shopt)f Fu(\(see)i(Section)g(4.3.2)h([The)e | |
14523 | (Shopt)g(Builtin],)h(page)g(63\).)275 540 y(The)38 b(rules)h | |
14524 | (concerning)h(the)f(de\014nition)g(and)g(use)g(of)g(aliases)i(are)e | |
14525 | (somewhat)h(confusing.)67 b(Bash)150 650 y(alw)m(a)m(ys)33 | |
14526 | b(reads)f(at)g(least)i(one)e(complete)h(line)f(of)g(input)f(b)s(efore)g | |
967625cd | 14527 | (executing)i(an)m(y)g(of)f(the)g(commands)f(on)150 759 |
fc527055 CR |
14528 | y(that)22 b(line.)39 b(Aliases)23 b(are)f(expanded)f(when)g(a)h |
14529 | (command)g(is)f(read,)j(not)e(when)f(it)h(is)g(executed.)39 | |
14530 | b(Therefore,)150 869 y(an)24 b(alias)i(de\014nition)e(app)s(earing)g | |
14531 | (on)g(the)h(same)g(line)f(as)h(another)g(command)f(do)s(es)g(not)h(tak) | |
967625cd | 14532 | m(e)h(e\013ect)g(un)m(til)150 978 y(the)k(next)f(line)h(of)g(input)f |
fc527055 CR |
14533 | (is)g(read.)40 b(The)29 b(commands)h(follo)m(wing)h(the)e(alias)i |
14534 | (de\014nition)e(on)h(that)g(line)g(are)150 1088 y(not)j(a\013ected)h(b) | |
14535 | m(y)f(the)g(new)f(alias.)49 b(This)32 b(b)s(eha)m(vior)h(is)g(also)g | |
14536 | (an)g(issue)g(when)e(functions)i(are)g(executed.)150 | |
14537 | 1198 y(Aliases)c(are)g(expanded)e(when)g(a)i(function)e(de\014nition)h | |
14538 | (is)g(read,)h(not)f(when)g(the)g(function)g(is)g(executed,)150 | |
967625cd | 14539 | 1307 y(b)s(ecause)36 b(a)h(function)f(de\014nition)f(is)i(itself)g(a)f |
fc527055 CR |
14540 | (command.)58 b(As)36 b(a)h(consequence,)h(aliases)g(de\014ned)d(in)h(a) |
14541 | 150 1417 y(function)28 b(are)h(not)g(a)m(v)-5 b(ailable)31 | |
14542 | b(un)m(til)e(after)g(that)g(function)f(is)g(executed.)41 | |
14543 | b(T)-8 b(o)29 b(b)s(e)f(safe,)i(alw)m(a)m(ys)g(put)e(alias)150 | |
967625cd | 14544 | 1526 y(de\014nitions)i(on)g(a)h(separate)g(line,)g(and)f(do)g(not)h |
fc527055 | 14545 | (use)f Ft(alias)f Fu(in)h(comp)s(ound)f(commands.)275 |
967625cd | 14546 | 1658 y(F)-8 b(or)31 b(almost)g(ev)m(ery)g(purp)s(ose,)e(shell)i |
fc527055 | 14547 | (functions)f(are)g(preferred)g(o)m(v)m(er)h(aliases.)150 |
967625cd | 14548 | 1893 y Fs(6.7)68 b(Arra)l(ys)150 2052 y Fu(Bash)33 b(pro)m(vides)g |
fc527055 | 14549 | (one-dimensional)g(indexed)f(and)h(asso)s(ciativ)m(e)i(arra)m(y)e(v)-5 |
c302751c | 14550 | b(ariables.)49 b(An)m(y)33 b(v)-5 b(ariable)33 b(ma)m(y)150 |
967625cd | 14551 | 2162 y(b)s(e)e(used)h(as)g(an)g(indexed)f(arra)m(y;)j(the)e |
6e51e0d0 | 14552 | Ft(declare)e Fu(builtin)h(will)i(explicitly)g(declare)g(an)f(arra)m(y) |
967625cd | 14553 | -8 b(.)46 b(There)32 b(is)150 2271 y(no)h(maxim)m(um)g(limit)h(on)f |
c302751c | 14554 | (the)g(size)h(of)g(an)f(arra)m(y)-8 b(,)35 b(nor)d(an)m(y)i(requiremen) |
967625cd | 14555 | m(t)f(that)h(mem)m(b)s(ers)e(b)s(e)g(indexed)150 2381 |
c302751c CR |
14556 | y(or)26 b(assigned)h(con)m(tiguously)-8 b(.)41 b(Indexed)25 |
14557 | b(arra)m(ys)i(are)f(referenced)g(using)g(in)m(tegers)i(\(including)e | |
967625cd | 14558 | (arithmetic)150 2490 y(expressions)38 b(\(see)h(Section)g(6.5)h([Shell) |
900a813b | 14559 | e(Arithmetic],)k(page)d(88\)\))h(and)d(are)i(zero-based;)k(asso)s |
967625cd | 14560 | (ciativ)m(e)150 2600 y(arra)m(ys)37 b(use)f(arbitrary)g(strings.)59 |
9f178efb | 14561 | b(Unless)36 b(otherwise)h(noted,)h(indexed)e(arra)m(y)h(indices)f(m)m |
967625cd CR |
14562 | (ust)g(b)s(e)g(non-)150 2710 y(negativ)m(e)d(in)m(tegers.)275 |
14563 | 2841 y(An)26 b(indexed)h(arra)m(y)h(is)f(created)h(automatically)j(if)c | |
d9e1f41e | 14564 | (an)m(y)g(v)-5 b(ariable)28 b(is)g(assigned)f(to)h(using)f(the)g(syn)m |
967625cd CR |
14565 | (tax)390 2973 y Fj(name)p Ft([)p Fj(subscript)p Ft(]=)p |
14566 | Fj(value)150 3104 y Fu(The)34 b Fr(subscript)h Fu(is)g(treated)g(as)g | |
f6da9f85 CR |
14567 | (an)f(arithmetic)i(expression)e(that)h(m)m(ust)g(ev)-5 |
14568 | b(aluate)36 b(to)f(a)g(n)m(um)m(b)s(er.)51 b(T)-8 b(o)150 | |
967625cd CR |
14569 | 3214 y(explicitly)32 b(declare)f(an)g(arra)m(y)-8 b(,)31 |
14570 | b(use)390 3345 y Ft(declare)46 b(-a)h Fj(name)150 3477 | |
14571 | y Fu(The)30 b(syn)m(tax)390 3608 y Ft(declare)46 b(-a)h | |
14572 | Fj(name)p Ft([)p Fj(subscript)p Ft(])150 3740 y Fu(is)30 | |
6e51e0d0 | 14573 | b(also)i(accepted;)g(the)e Fr(subscript)h Fu(is)g(ignored.)150 |
967625cd CR |
14574 | 3871 y(Asso)s(ciativ)m(e)i(arra)m(ys)d(are)h(created)h(using)390 |
14575 | 4003 y Ft(declare)46 b(-A)h Fj(name)p Ft(.)275 4134 y | |
6e51e0d0 CR |
14576 | Fu(A)m(ttributes)f(ma)m(y)h(b)s(e)e(sp)s(eci\014ed)g(for)h(an)g(arra)m |
14577 | (y)g(v)-5 b(ariable)47 b(using)e(the)h Ft(declare)e Fu(and)h | |
967625cd | 14578 | Ft(readonly)150 4244 y Fu(builtins.)40 b(Eac)m(h)31 b(attribute)g |
6e51e0d0 | 14579 | (applies)g(to)g(all)g(mem)m(b)s(ers)f(of)g(an)h(arra)m(y)-8 |
967625cd CR |
14580 | b(.)275 4376 y(Arra)m(ys)30 b(are)h(assigned)f(to)h(using)f(comp)s |
14581 | (ound)f(assignmen)m(ts)i(of)g(the)f(form)390 4507 y Fj(name)p | |
14582 | Ft(=\()p Fj(value1)44 b(value2)j Ft(...)f(\))150 4639 | |
6e51e0d0 CR |
14583 | y Fu(where)38 b(eac)m(h)i Fr(v)-5 b(alue)44 b Fu(is)39 |
14584 | b(of)g(the)g(form)f Ft([)p Fj(subscript)p Ft(]=)p Fr(string)p | |
14585 | Fu(.)63 b(Indexed)37 b(arra)m(y)j(assignmen)m(ts)f(do)g(not)150 | |
967625cd | 14586 | 4748 y(require)31 b(an)m(ything)g(but)f Fr(string)p Fu(.)43 |
6e51e0d0 | 14587 | b(When)31 b(assigning)g(to)h(indexed)e(arra)m(ys,)i(if)f(the)g |
967625cd | 14588 | (optional)h(subscript)e(is)150 4858 y(supplied,)i(that)h(index)f(is)h |
122f603c | 14589 | (assigned)g(to;)h(otherwise)f(the)g(index)f(of)h(the)g(elemen)m(t)h |
967625cd | 14590 | (assigned)f(is)f(the)h(last)150 4967 y(index)d(assigned)h(to)g(b)m(y)f |
122f603c | 14591 | (the)g(statemen)m(t)j(plus)c(one.)41 b(Indexing)30 b(starts)h(at)g |
967625cd | 14592 | (zero.)275 5099 y(When)f(assigning)h(to)g(an)f(asso)s(ciativ)m(e)j |
6e51e0d0 | 14593 | (arra)m(y)-8 b(,)32 b(the)e(subscript)f(is)i(required.)275 |
fc527055 | 14594 | 5230 y(This)f(syn)m(tax)j(is)e(also)i(accepted)g(b)m(y)f(the)f |
6e51e0d0 | 14595 | Ft(declare)f Fu(builtin.)44 b(Individual)31 b(arra)m(y)h(elemen)m(ts)h |
fc527055 | 14596 | (ma)m(y)g(b)s(e)150 5340 y(assigned)e(to)g(using)f(the)g |
6e51e0d0 | 14597 | Fj(name)p Ft([)p Fj(subscript)p Ft(]=)p Fj(value)25 b |
fc527055 CR |
14598 | Fu(syn)m(tax)31 b(in)m(tro)s(duced)e(ab)s(o)m(v)m(e.)p |
14599 | eop end | |
900a813b CR |
14600 | %%Page: 91 97 |
14601 | TeXDict begin 91 96 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14602 | b(Bash)30 b(F)-8 b(eatures)2484 b(91)275 299 y(When)30 | |
fc527055 CR |
14603 | b(assigning)h(to)h(an)e(indexed)g(arra)m(y)-8 b(,)32 |
14604 | b(if)f Fr(name)36 b Fu(is)31 b(subscripted)e(b)m(y)i(a)g(negativ)m(e)i | |
14605 | (n)m(um)m(b)s(er,)c(that)150 408 y(n)m(um)m(b)s(er)43 | |
14606 | b(is)h(in)m(terpreted)h(as)f(relativ)m(e)j(to)e(one)f(greater)i(than)e | |
14607 | (the)g(maxim)m(um)g(index)g(of)h Fr(name)p Fu(,)j(so)150 | |
14608 | 518 y(negativ)m(e)30 b(indices)d(coun)m(t)h(bac)m(k)g(from)f(the)g(end) | |
14609 | g(of)g(the)h(arra)m(y)-8 b(,)29 b(and)e(an)g(index)g(of)g(-1)h | |
967625cd | 14610 | (references)g(the)f(last)150 628 y(elemen)m(t.)275 777 |
fc527055 CR |
14611 | y(An)m(y)h(elemen)m(t)h(of)g(an)f(arra)m(y)g(ma)m(y)h(b)s(e)f |
14612 | (referenced)g(using)g Ft(${)p Fj(name)p Ft([)p Fj(subscript)p | |
967625cd | 14613 | Ft(]})p Fu(.)35 b(The)27 b(braces)i(are)150 886 y(required)f(to)j(a)m |
fc527055 CR |
14614 | (v)m(oid)f(con\015icts)g(with)f(the)h(shell's)f(\014lename)h(expansion) |
14615 | f(op)s(erators.)41 b(If)28 b(the)i Fr(subscript)g Fu(is)150 | |
967625cd | 14616 | 996 y(`)p Ft(@)p Fu(')f(or)h(`)p Ft(*)p Fu(',)f(the)h(w)m(ord)f |
6e51e0d0 CR |
14617 | (expands)f(to)i(all)g(mem)m(b)s(ers)e(of)i(the)f(arra)m(y)h |
14618 | Fr(name)p Fu(.)40 b(These)29 b(subscripts)f(di\013er)h(only)150 | |
967625cd | 14619 | 1105 y(when)36 b(the)g(w)m(ord)g(app)s(ears)g(within)g(double)g |
fc527055 | 14620 | (quotes.)60 b(If)36 b(the)h(w)m(ord)f(is)g(double-quoted,)j |
967625cd | 14621 | Ft(${)p Fj(name)p Ft([*]})150 1215 y Fu(expands)25 b(to)h(a)g(single)h |
fc527055 CR |
14622 | (w)m(ord)e(with)g(the)h(v)-5 b(alue)26 b(of)g(eac)m(h)h(arra)m(y)f(mem) |
14623 | m(b)s(er)f(separated)h(b)m(y)g(the)f(\014rst)g(c)m(harac-)150 | |
967625cd | 14624 | 1324 y(ter)j(of)g(the)h Ft(IFS)e Fu(v)-5 b(ariable,)29 |
fc527055 CR |
14625 | b(and)f Ft(${)p Fj(name)p Ft([@]})d Fu(expands)i(eac)m(h)i(elemen)m(t)h |
14626 | (of)e Fr(name)33 b Fu(to)c(a)f(separate)h(w)m(ord.)150 | |
967625cd | 14627 | 1434 y(When)j(there)h(are)f(no)g(arra)m(y)h(mem)m(b)s(ers,)f |
6e51e0d0 | 14628 | Ft(${)p Fj(name)p Ft([@]})e Fu(expands)h(to)i(nothing.)47 |
967625cd | 14629 | b(If)31 b(the)i(double-quoted)150 1544 y(expansion)39 |
6e51e0d0 | 14630 | b(o)s(ccurs)h(within)f(a)h(w)m(ord,)i(the)d(expansion)h(of)g(the)f |
967625cd | 14631 | (\014rst)g(parameter)h(is)g(joined)f(with)h(the)150 1653 |
6e51e0d0 CR |
14632 | y(b)s(eginning)29 b(part)g(of)h(the)f(original)i(w)m(ord,)e(and)g(the)h |
14633 | (expansion)f(of)h(the)f(last)i(parameter)e(is)h(joined)f(with)150 | |
967625cd | 14634 | 1763 y(the)g(last)h(part)f(of)g(the)g(original)h(w)m(ord.)40 |
122f603c | 14635 | b(This)28 b(is)h(analogous)h(to)f(the)h(expansion)e(of)h(the)g(sp)s |
967625cd | 14636 | (ecial)h(param-)150 1872 y(eters)g(`)p Ft(@)p Fu(')f(and)g(`)p |
6e51e0d0 CR |
14637 | Ft(*)p Fu('.)41 b Ft(${#)p Fj(name)p Ft([)p Fj(subscript)p |
14638 | Ft(]})24 b Fu(expands)k(to)i(the)g(length)g(of)f Ft(${)p | |
14639 | Fj(name)p Ft([)p Fj(subscript)p Ft(]})p Fu(.)35 b(If)150 | |
967625cd | 14640 | 1982 y Fr(subscript)28 b Fu(is)g(`)p Ft(@)p Fu(')f(or)h(`)p |
8a0829e9 CR |
14641 | Ft(*)p Fu(',)g(the)g(expansion)f(is)g(the)h(n)m(um)m(b)s(er)e(of)i |
14642 | (elemen)m(ts)g(in)f(the)h(arra)m(y)-8 b(.)41 b(If)27 | |
967625cd | 14643 | b(the)g Fr(subscript)150 2092 y Fu(used)34 b(to)h(reference)g(an)f |
8a0829e9 CR |
14644 | (elemen)m(t)i(of)f(an)f(indexed)g(arra)m(y)h(ev)-5 b(aluates)36 |
14645 | b(to)f(a)g(n)m(um)m(b)s(er)e(less)i(than)f(zero,)i(it)150 | |
967625cd | 14646 | 2201 y(is)c(in)m(terpreted)h(as)f(relativ)m(e)i(to)f(one)f(greater)h |
8a0829e9 | 14647 | (than)f(the)h(maxim)m(um)f(index)f(of)h(the)h(arra)m(y)-8 |
967625cd | 14648 | b(,)33 b(so)g(negativ)m(e)150 2311 y(indices)d(coun)m(t)h(bac)m(k)h |
8a0829e9 CR |
14649 | (from)e(the)g(end)g(of)g(the)h(arra)m(y)-8 b(,)31 b(and)f(an)g(index)g |
14650 | (of)h(-1)g(refers)f(to)h(the)g(last)g(elemen)m(t.)275 | |
967625cd | 14651 | 2460 y(Referencing)41 b(an)f(arra)m(y)h(v)-5 b(ariable)42 |
8a0829e9 | 14652 | b(without)e(a)h(subscript)e(is)i(equiv)-5 b(alen)m(t)42 |
967625cd | 14653 | b(to)f(referencing)g(with)g(a)150 2569 y(subscript)35 |
8a0829e9 CR |
14654 | b(of)h(0.)57 b(An)m(y)36 b(reference)g(to)h(a)f(v)-5 |
14655 | b(ariable)36 b(using)g(a)g(v)-5 b(alid)36 b(subscript)f(is)h(legal,)j | |
967625cd CR |
14656 | (and)c Ft(bash)g Fu(will)150 2679 y(create)d(an)e(arra)m(y)h(if)f |
14657 | (necessary)-8 b(.)275 2828 y(An)35 b(arra)m(y)i(v)-5 | |
8a0829e9 CR |
14658 | b(ariable)37 b(is)g(considered)f(set)h(if)f(a)h(subscript)e(has)h(b)s |
14659 | (een)g(assigned)g(a)h(v)-5 b(alue.)59 b(The)36 b(n)m(ull)150 | |
967625cd CR |
14660 | 2937 y(string)30 b(is)h(a)g(v)-5 b(alid)30 b(v)-5 b(alue.)275 |
14661 | 3086 y(It)29 b(is)h(p)s(ossible)f(to)h(obtain)g(the)f(k)m(eys)i | |
6e51e0d0 CR |
14662 | (\(indices\))f(of)f(an)h(arra)m(y)g(as)f(w)m(ell)i(as)f(the)f(v)-5 |
14663 | b(alues.)41 b($)p Fi({)p Fu(!)p Fr(name)5 b Fu([@])p | |
967625cd | 14664 | Fi(})150 3196 y Fu(and)39 b($)p Fi({)p Fu(!)p Fr(name)5 |
6e51e0d0 CR |
14665 | b Fu([*])p Fi(})43 b Fu(expand)c(to)i(the)f(indices)h(assigned)f(in)g |
14666 | (arra)m(y)g(v)-5 b(ariable)41 b Fr(name)p Fu(.)70 b(The)39 | |
967625cd | 14667 | b(treatmen)m(t)150 3305 y(when)i(in)g(double)g(quotes)h(is)f(similar)h |
6e51e0d0 | 14668 | (to)h(the)e(expansion)h(of)f(the)h(sp)s(ecial)g(parameters)g(`)p |
967625cd CR |
14669 | Ft(@)p Fu(')g(and)f(`)p Ft(*)p Fu(')150 3415 y(within)30 |
14670 | b(double)g(quotes.)275 3564 y(The)j Ft(unset)g Fu(builtin)h(is)g(used)g | |
6e51e0d0 CR |
14671 | (to)h(destro)m(y)g(arra)m(ys.)52 b Ft(unset)29 b Fj(name)p |
14672 | Ft([)p Fj(subscript)p Ft(])h Fu(destro)m(ys)35 b(the)g(ar-)150 | |
967625cd | 14673 | 3673 y(ra)m(y)j(elemen)m(t)h(at)g(index)e Fr(subscript)p |
6e51e0d0 | 14674 | Fu(.)61 b(Negativ)m(e)41 b(subscripts)36 b(to)i(indexed)g(arra)m(ys)g |
967625cd | 14675 | (are)g(in)m(terpreted)g(as)150 3783 y(describ)s(ed)f(ab)s(o)m(v)m(e.)67 |
6e51e0d0 CR |
14676 | b(Care)38 b(m)m(ust)h(b)s(e)f(tak)m(en)h(to)h(a)m(v)m(oid)g(un)m(w)m |
14677 | (an)m(ted)e(side)h(e\013ects)h(caused)e(b)m(y)h(\014lename)150 | |
967625cd | 14678 | 3893 y(expansion.)50 b Ft(unset)29 b Fj(name)p Fu(,)34 |
6e51e0d0 CR |
14679 | b(where)f Fr(name)39 b Fu(is)34 b(an)f(arra)m(y)-8 b(,)36 |
14680 | b(remo)m(v)m(es)f(the)f(en)m(tire)g(arra)m(y)-8 b(.)52 | |
967625cd | 14681 | b(A)33 b(subscript)g(of)150 4002 y(`)p Ft(*)p Fu(')e(or)f(`)p |
6e51e0d0 | 14682 | Ft(@)p Fu(')g(also)i(remo)m(v)m(es)f(the)g(en)m(tire)g(arra)m(y)-8 |
967625cd | 14683 | b(.)275 4151 y(The)20 b Ft(declare)p Fu(,)h Ft(local)p |
6e51e0d0 CR |
14684 | Fu(,)h(and)e Ft(readonly)f Fu(builtins)h(eac)m(h)i(accept)g(a)g |
14685 | Ft(-a)e Fu(option)h(to)h(sp)s(ecify)f(an)f(indexed)150 | |
967625cd | 14686 | 4261 y(arra)m(y)28 b(and)f(a)h Ft(-A)e Fu(option)i(to)g(sp)s(ecify)f |
6e51e0d0 CR |
14687 | (an)h(asso)s(ciativ)m(e)i(arra)m(y)-8 b(.)40 b(If)27 |
14688 | b(b)s(oth)g(options)h(are)g(supplied,)f Ft(-A)f Fu(tak)m(es)150 | |
967625cd | 14689 | 4370 y(precedence.)55 b(The)35 b Ft(read)f Fu(builtin)h(accepts)h(a)g |
6e51e0d0 | 14690 | Ft(-a)e Fu(option)i(to)g(assign)f(a)g(list)h(of)f(w)m(ords)g(read)g |
967625cd | 14691 | (from)g(the)150 4480 y(standard)h(input)g(to)i(an)f(arra)m(y)-8 |
6e51e0d0 | 14692 | b(,)40 b(and)c(can)h(read)g(v)-5 b(alues)38 b(from)e(the)h(standard)g |
967625cd | 14693 | (input)f(in)m(to)i(individual)150 4589 y(arra)m(y)f(elemen)m(ts.)62 |
6e51e0d0 CR |
14694 | b(The)36 b Ft(set)g Fu(and)h Ft(declare)d Fu(builtins)j(displa)m(y)g |
14695 | (arra)m(y)g(v)-5 b(alues)37 b(in)g(a)g(w)m(a)m(y)h(that)g(allo)m(ws)150 | |
967625cd | 14696 | 4699 y(them)30 b(to)h(b)s(e)f(reused)g(as)g(input.)150 |
d7935593 CR |
14697 | 4961 y Fs(6.8)68 b(The)45 b(Directory)g(Stac)l(k)150 |
14698 | 5121 y Fu(The)21 b(directory)h(stac)m(k)h(is)e(a)h(list)g(of)f(recen)m | |
6e51e0d0 | 14699 | (tly-visited)j(directories.)39 b(The)20 b Ft(pushd)g |
d7935593 | 14700 | Fu(builtin)h(adds)g(directories)150 5230 y(to)42 b(the)f(stac)m(k)i(as) |
6e51e0d0 CR |
14701 | e(it)h(c)m(hanges)g(the)f(curren)m(t)g(directory)-8 b(,)45 |
14702 | b(and)40 b(the)i Ft(popd)e Fu(builtin)g(remo)m(v)m(es)j(sp)s(eci\014ed) | |
d7935593 | 14703 | 150 5340 y(directories)29 b(from)f(the)h(stac)m(k)h(and)d(c)m(hanges)j |
6e51e0d0 | 14704 | (the)e(curren)m(t)g(directory)h(to)g(the)g(directory)f(remo)m(v)m(ed.) |
d7935593 | 14705 | 41 b(The)p eop end |
900a813b CR |
14706 | %%Page: 92 98 |
14707 | TeXDict begin 92 97 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14708 | b(Bash)30 b(F)-8 b(eatures)2484 b(92)150 299 y Ft(dirs)34 | |
d7935593 CR |
14709 | b Fu(builtin)g(displa)m(ys)h(the)g(con)m(ten)m(ts)i(of)e(the)g |
14710 | (directory)h(stac)m(k.)56 b(The)34 b(curren)m(t)h(directory)g(is)g(alw) | |
14711 | m(a)m(ys)150 408 y(the)c Ft(")p Fu(top)p Ft(")f Fu(of)g(the)h | |
14712 | (directory)g(stac)m(k.)275 542 y(The)k(con)m(ten)m(ts)i(of)f(the)h | |
14713 | (directory)f(stac)m(k)h(are)f(also)h(visible)g(as)f(the)g(v)-5 | |
14714 | b(alue)36 b(of)g(the)g Ft(DIRSTACK)e Fu(shell)150 651 | |
14715 | y(v)-5 b(ariable.)150 848 y Fk(6.8.1)63 b(Directory)40 | |
14716 | b(Stac)m(k)g(Builtins)150 1018 y Ft(dirs)870 1151 y(dirs)47 | |
14717 | b([-clpv])e([+)p Fj(N)i Ft(|)h(-)p Fj(N)p Ft(])630 1284 | |
14718 | y Fu(Displa)m(y)35 b(the)f(list)g(of)g(curren)m(tly)g(remem)m(b)s(ered) | |
14719 | f(directories.)51 b(Directories)36 b(are)e(added)f(to)630 | |
14720 | 1394 y(the)28 b(list)h(with)f(the)g Ft(pushd)f Fu(command;)i(the)f | |
14721 | Ft(popd)f Fu(command)h(remo)m(v)m(es)h(directories)g(from)630 | |
14722 | 1503 y(the)i(list.)41 b(The)30 b(curren)m(t)g(directory)h(is)f(alw)m(a) | |
14723 | m(ys)i(the)f(\014rst)e(directory)i(in)f(the)h(stac)m(k.)630 | |
14724 | 1660 y Ft(-c)384 b Fu(Clears)31 b(the)f(directory)h(stac)m(k)h(b)m(y)e | |
14725 | (deleting)h(all)h(of)e(the)h(elemen)m(ts.)630 1817 y | |
fc527055 | 14726 | Ft(-l)384 b Fu(Pro)s(duces)31 b(a)h(listing)h(using)e(full)h |
d7935593 | 14727 | (pathnames;)h(the)f(default)g(listing)h(format)1110 1926 |
fc527055 | 14728 | y(uses)d(a)h(tilde)g(to)g(denote)g(the)f(home)h(directory)-8 |
d7935593 | 14729 | b(.)630 2083 y Ft(-p)384 b Fu(Causes)30 b Ft(dirs)f Fu(to)i(prin)m(t)f |
fc527055 | 14730 | (the)h(directory)g(stac)m(k)h(with)e(one)g(en)m(try)h(p)s(er)e(line.) |
d7935593 | 14731 | 630 2240 y Ft(-v)384 b Fu(Causes)36 b Ft(dirs)f Fu(to)i(prin)m(t)f(the) |
fc527055 | 14732 | g(directory)h(stac)m(k)h(with)e(one)h(en)m(try)f(p)s(er)f(line,)1110 |
d7935593 CR |
14733 | 2349 y(pre\014xing)30 b(eac)m(h)h(en)m(try)g(with)f(its)h(index)e(in)i |
14734 | (the)f(stac)m(k.)630 2506 y Ft(+)p Fj(N)384 b Fu(Displa)m(ys)23 | |
fc527055 | 14735 | b(the)f Fr(N)10 b Fu(th)21 b(directory)h(\(coun)m(ting)h(from)e(the)h |
d7935593 | 14736 | (left)g(of)g(the)g(list)g(prin)m(ted)1110 2615 y(b)m(y)30 |
fc527055 | 14737 | b Ft(dirs)f Fu(when)h(in)m(v)m(ok)m(ed)i(without)e(options\),)h |
d7935593 | 14738 | (starting)g(with)g(zero.)630 2772 y Ft(-)p Fj(N)384 b |
fc527055 CR |
14739 | Fu(Displa)m(ys)47 b(the)g Fr(N)10 b Fu(th)46 b(directory)h(\(coun)m |
14740 | (ting)g(from)f(the)g(righ)m(t)h(of)g(the)f(list)1110 | |
d7935593 CR |
14741 | 2882 y(prin)m(ted)25 b(b)m(y)g Ft(dirs)g Fu(when)f(in)m(v)m(ok)m(ed)j |
14742 | (without)f(options\),)h(starting)g(with)e(zero.)150 3038 | |
14743 | y Ft(popd)870 3171 y(popd)47 b([-n])f([+)p Fj(N)h Ft(|)h(-)p | |
14744 | Fj(N)p Ft(])630 3304 y Fu(When)32 b(no)g(argumen)m(ts)h(are)g(giv)m | |
14745 | (en,)h Ft(popd)d Fu(remo)m(v)m(es)j(the)f(top)f(directory)h(from)f(the) | |
14746 | g(stac)m(k)630 3414 y(and)f(p)s(erforms)e(a)j Ft(cd)f | |
fc527055 | 14747 | Fu(to)h(the)f(new)g(top)h(directory)-8 b(.)44 b(The)31 |
d7935593 | 14748 | b(elemen)m(ts)i(are)e(n)m(um)m(b)s(ered)f(from)630 3524 |
fc527055 CR |
14749 | y(0)j(starting)g(at)g(the)f(\014rst)g(directory)g(listed)h(with)f |
14750 | Ft(dirs)p Fu(;)g(that)h(is,)g Ft(popd)e Fu(is)i(equiv)-5 | |
d7935593 CR |
14751 | b(alen)m(t)33 b(to)630 3633 y Ft(popd)c(+0)p Fu(.)630 |
14752 | 3790 y Ft(-n)384 b Fu(Suppresses)27 b(the)j(normal)g(c)m(hange)g(of)g | |
14753 | (directory)g(when)e(remo)m(ving)j(directo-)1110 3899 | |
fc527055 | 14754 | y(ries)f(from)g(the)h(stac)m(k,)h(so)f(that)g(only)f(the)h(stac)m(k)g |
d7935593 | 14755 | (is)g(manipulated.)630 4056 y Ft(+)p Fj(N)384 b Fu(Remo)m(v)m(es)22 |
6e51e0d0 | 14756 | b(the)f Fr(N)10 b Fu(th)20 b(directory)g(\(coun)m(ting)i(from)e(the)g |
d7935593 CR |
14757 | (left)h(of)g(the)f(list)h(prin)m(ted)1110 4166 y(b)m(y)30 |
14758 | b Ft(dirs)p Fu(\),)g(starting)h(with)f(zero.)630 4322 | |
6e51e0d0 CR |
14759 | y Ft(-)p Fj(N)384 b Fu(Remo)m(v)m(es)46 b(the)g Fr(N)10 |
14760 | b Fu(th)44 b(directory)h(\(coun)m(ting)h(from)f(the)g(righ)m(t)g(of)g | |
d7935593 CR |
14761 | (the)g(list)1110 4432 y(prin)m(ted)30 b(b)m(y)g Ft(dirs)p |
14762 | Fu(\),)g(starting)h(with)f(zero.)150 4588 y Ft(pushd)870 | |
14763 | 4721 y(pushd)46 b([-n])h([+)p Fj(N)g Ft(|)g Fj(-N)h Ft(|)f | |
14764 | Fj(dir)p Ft(])630 4855 y Fu(Sa)m(v)m(e)30 b(the)e(curren)m(t)g | |
6e51e0d0 | 14765 | (directory)h(on)f(the)h(top)f(of)h(the)f(directory)h(stac)m(k)h(and)e |
d7935593 CR |
14766 | (then)g Ft(cd)f Fu(to)i Fr(dir)p Fu(.)630 4964 y(With)39 |
14767 | b(no)f(argumen)m(ts,)j Ft(pushd)c Fu(exc)m(hanges)j(the)f(top)f(t)m(w)m | |
14768 | (o)i(directories)g(and)d(mak)m(es)j(the)630 5074 y(new)30 | |
14769 | b(top)g(the)h(curren)m(t)f(directory)-8 b(.)630 5230 | |
14770 | y Ft(-n)384 b Fu(Suppresses)24 b(the)j(normal)f(c)m(hange)h(of)g | |
14771 | (directory)f(when)g(rotating)h(or)f(adding)1110 5340 | |
14772 | y(directories)31 b(to)h(the)e(stac)m(k,)i(so)f(that)g(only)f(the)h | |
14773 | (stac)m(k)h(is)e(manipulated.)p eop end | |
900a813b CR |
14774 | %%Page: 93 99 |
14775 | TeXDict begin 93 98 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14776 | b(Bash)30 b(F)-8 b(eatures)2484 b(93)630 299 y Ft(+)p | |
d7935593 CR |
14777 | Fj(N)384 b Fu(Brings)29 b(the)f Fr(N)10 b Fu(th)29 b(directory)g |
14778 | (\(coun)m(ting)h(from)e(the)g(left)i(of)e(the)h(list)g(prin)m(ted)1110 | |
14779 | 408 y(b)m(y)34 b Ft(dirs)p Fu(,)g(starting)h(with)f(zero\))i(to)f(the)f | |
14780 | (top)g(of)h(the)f(list)h(b)m(y)f(rotating)i(the)1110 | |
967625cd | 14781 | 518 y(stac)m(k.)630 682 y Ft(-)p Fj(N)384 b Fu(Brings)23 |
d7935593 CR |
14782 | b(the)g Fr(N)10 b Fu(th)23 b(directory)h(\(coun)m(ting)g(from)e(the)i |
14783 | (righ)m(t)f(of)g(the)h(list)f(prin)m(ted)1110 792 y(b)m(y)34 | |
14784 | b Ft(dirs)p Fu(,)g(starting)h(with)f(zero\))i(to)f(the)f(top)g(of)h | |
14785 | (the)f(list)h(b)m(y)f(rotating)i(the)1110 902 y(stac)m(k.)630 | |
967625cd | 14786 | 1066 y Fj(dir)336 b Fu(Mak)m(es)28 b Fr(dir)33 b Fu(b)s(e)27 |
d7935593 | 14787 | b(the)g(top)g(of)g(the)h(stac)m(k,)h(making)e(it)h(the)f(new)g(curren)m |
967625cd | 14788 | (t)g(direc-)1110 1175 y(tory)k(as)f(if)h(it)g(had)e(b)s(een)h(supplied) |
d7935593 | 14789 | f(as)i(an)f(argumen)m(t)h(to)g(the)f Ft(cd)g Fu(builtin.)150 |
967625cd CR |
14790 | 1424 y Fs(6.9)68 b(Con)l(trolling)47 b(the)e(Prompt)150 |
14791 | 1583 y Fu(The)24 b(v)-5 b(alue)24 b(of)h(the)f(v)-5 b(ariable)25 | |
fc527055 | 14792 | b Ft(PROMPT_COMMAND)20 b Fu(is)25 b(examined)f(just)g(b)s(efore)f(Bash) |
967625cd | 14793 | i(prin)m(ts)e(eac)m(h)j(primary)150 1693 y(prompt.)39 |
fc527055 CR |
14794 | b(If)28 b Ft(PROMPT_COMMAND)d Fu(is)j(set)h(and)f(has)g(a)h(non-n)m |
14795 | (ull)f(v)-5 b(alue,)29 b(then)f(the)h(v)-5 b(alue)29 | |
967625cd CR |
14796 | b(is)f(executed)i(just)150 1802 y(as)h(if)f(it)h(had)f(b)s(een)f(t)m |
14797 | (yp)s(ed)h(on)h(the)f(command)g(line.)275 1942 y(In)d(addition,)j(the)f | |
1101193a CR |
14798 | (follo)m(wing)h(table)f(describ)s(es)f(the)h(sp)s(ecial)g(c)m |
14799 | (haracters)h(whic)m(h)f(can)f(app)s(ear)g(in)h(the)150 | |
967625cd CR |
14800 | 2051 y(prompt)g(v)-5 b(ariables)32 b Ft(PS1)d Fu(to)i |
14801 | Ft(PS4)p Fu(:)150 2218 y Ft(\\a)384 b Fu(A)30 b(b)s(ell)h(c)m | |
14802 | (haracter.)150 2382 y Ft(\\d)384 b Fu(The)30 b(date,)h(in)f | |
6e51e0d0 CR |
14803 | Ft(")p Fu(W)-8 b(eekda)m(y)32 b(Mon)m(th)f(Date)p Ft(")h |
14804 | Fu(format)f(\(e.g.,)h Ft(")p Fu(T)-8 b(ue)30 b(Ma)m(y)h(26)p | |
967625cd CR |
14805 | Ft(")p Fu(\).)150 2547 y Ft(\\D{)p Fj(format)p Ft(})630 |
14806 | 2656 y Fu(The)c Fr(format)i Fu(is)f(passed)e(to)i Ft(strftime)p | |
6e51e0d0 | 14807 | Fu(\(3\))f(and)f(the)i(result)f(is)g(inserted)g(in)m(to)h(the)g(prompt) |
967625cd | 14808 | 630 2766 y(string;)42 b(an)d(empt)m(y)f Fr(format)j Fu(results)d(in)g |
6e51e0d0 | 14809 | (a)h(lo)s(cale-sp)s(eci\014c)h(time)f(represen)m(tation.)65 |
967625cd | 14810 | b(The)630 2875 y(braces)31 b(are)f(required.)150 3040 |
6e51e0d0 | 14811 | y Ft(\\e)384 b Fu(An)30 b(escap)s(e)h(c)m(haracter.)150 |
967625cd CR |
14812 | 3204 y Ft(\\h)384 b Fu(The)30 b(hostname,)h(up)e(to)i(the)g(\014rst)e |
14813 | (`.'.)150 3368 y Ft(\\H)384 b Fu(The)30 b(hostname.)150 | |
14814 | 3533 y Ft(\\j)384 b Fu(The)30 b(n)m(um)m(b)s(er)f(of)h(jobs)g(curren)m | |
14815 | (tly)h(managed)g(b)m(y)f(the)g(shell.)150 3697 y Ft(\\l)384 | |
6e51e0d0 | 14816 | b Fu(The)30 b(basename)h(of)f(the)h(shell's)f(terminal)h(device)g |
967625cd CR |
14817 | (name.)150 3861 y Ft(\\n)384 b Fu(A)30 b(newline.)150 |
14818 | 4025 y Ft(\\r)384 b Fu(A)30 b(carriage)i(return.)150 | |
14819 | 4190 y Ft(\\s)384 b Fu(The)22 b(name)g(of)h(the)f(shell,)i(the)f | |
6e51e0d0 | 14820 | (basename)f(of)h Ft($0)f Fu(\(the)g(p)s(ortion)g(follo)m(wing)i(the)f |
967625cd CR |
14821 | (\014nal)e(slash\).)150 4354 y Ft(\\t)384 b Fu(The)30 |
14822 | b(time,)h(in)f(24-hour)h(HH:MM:SS)g(format.)150 4518 | |
6e51e0d0 | 14823 | y Ft(\\T)384 b Fu(The)30 b(time,)h(in)f(12-hour)h(HH:MM:SS)g(format.) |
967625cd CR |
14824 | 150 4683 y Ft(\\@)384 b Fu(The)30 b(time,)h(in)f(12-hour)h(am/pm)f |
14825 | (format.)150 4847 y Ft(\\A)384 b Fu(The)30 b(time,)h(in)f(24-hour)h | |
d7935593 | 14826 | (HH:MM)g(format.)150 5011 y Ft(\\u)384 b Fu(The)30 b(username)g(of)g |
967625cd | 14827 | (the)h(curren)m(t)f(user.)150 5176 y Ft(\\v)384 b Fu(The)30 |
d7935593 | 14828 | b(v)m(ersion)h(of)f(Bash)h(\(e.g.,)h(2.00\))150 5340 |
6e51e0d0 | 14829 | y Ft(\\V)384 b Fu(The)30 b(release)i(of)e(Bash,)h(v)m(ersion)g |
d7935593 CR |
14830 | Ft(+)f Fu(patc)m(hlev)m(el)i(\(e.g.,)h(2.00.0\))p eop |
14831 | end | |
900a813b CR |
14832 | %%Page: 94 100 |
14833 | TeXDict begin 94 99 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14834 | b(Bash)30 b(F)-8 b(eatures)2484 b(94)150 299 y Ft(\\w)384 | |
d7935593 CR |
14835 | b Fu(The)34 b(curren)m(t)h(w)m(orking)g(directory)-8 |
14836 | b(,)37 b(with)e Ft($HOME)e Fu(abbreviated)j(with)e(a)h(tilde)h(\(uses)f | |
14837 | (the)630 408 y Ft($PROMPT_DIRTRIM)26 b Fu(v)-5 b(ariable\).)150 | |
967625cd | 14838 | 568 y Ft(\\W)384 b Fu(The)30 b(basename)h(of)f Ft($PWD)p |
d7935593 | 14839 | Fu(,)g(with)g Ft($HOME)f Fu(abbreviated)h(with)g(a)h(tilde.)150 |
967625cd CR |
14840 | 728 y Ft(\\!)384 b Fu(The)30 b(history)g(n)m(um)m(b)s(er)f(of)i(this)f |
14841 | (command.)150 888 y Ft(\\#)384 b Fu(The)30 b(command)g(n)m(um)m(b)s(er) | |
14842 | f(of)i(this)f(command.)150 1048 y Ft(\\$)384 b Fu(If)30 | |
d7935593 | 14843 | b(the)g(e\013ectiv)m(e)j(uid)d(is)g(0,)h Ft(#)p Fu(,)g(otherwise)g |
967625cd | 14844 | Ft($)p Fu(.)150 1208 y Ft(\\)p Fj(nnn)288 b Fu(The)30 |
d7935593 | 14845 | b(c)m(haracter)i(whose)e(ASCI)s(I)f(co)s(de)h(is)h(the)f(o)s(ctal)i(v) |
967625cd CR |
14846 | -5 b(alue)31 b Fr(nnn)p Fu(.)150 1368 y Ft(\\\\)384 b |
14847 | Fu(A)30 b(bac)m(kslash.)150 1527 y Ft(\\[)384 b Fu(Begin)38 | |
d7935593 CR |
14848 | b(a)f(sequence)g(of)g(non-prin)m(ting)g(c)m(haracters.)61 |
14849 | b(This)36 b(could)h(b)s(e)g(used)f(to)h(em)m(b)s(ed)g(a)630 | |
967625cd CR |
14850 | 1637 y(terminal)31 b(con)m(trol)h(sequence)e(in)m(to)i(the)e(prompt.) |
14851 | 150 1797 y Ft(\\])384 b Fu(End)29 b(a)i(sequence)g(of)f(non-prin)m | |
14852 | (ting)g(c)m(haracters.)275 1957 y(The)25 b(command)h(n)m(um)m(b)s(er)f | |
d7935593 | 14853 | (and)h(the)g(history)g(n)m(um)m(b)s(er)f(are)i(usually)f(di\013eren)m |
967625cd | 14854 | (t:)39 b(the)26 b(history)g(n)m(um)m(b)s(er)150 2066 |
d7935593 | 14855 | y(of)h(a)f(command)h(is)f(its)h(p)s(osition)f(in)g(the)h(history)f |
fc527055 | 14856 | (list,)i(whic)m(h)f(ma)m(y)g(include)f(commands)g(restored)g(from)150 |
967625cd | 14857 | 2176 y(the)39 b(history)h(\014le)f(\(see)h(Section)g(9.1)h([Bash)e |
900a813b | 14858 | (History)h(F)-8 b(acilities],)45 b(page)40 b(136\),)j(while)d(the)f |
967625cd | 14859 | (command)150 2286 y(n)m(um)m(b)s(er)j(is)h(the)h(p)s(osition)f(in)g |
fc527055 | 14860 | (the)g(sequence)h(of)f(commands)g(executed)h(during)e(the)i(curren)m(t) |
967625cd | 14861 | f(shell)150 2395 y(session.)275 2530 y(After)35 b(the)g(string)g(is)g |
fc527055 | 14862 | (deco)s(ded,)h(it)f(is)g(expanded)f(via)i(parameter)f(expansion,)i |
967625cd | 14863 | (command)d(substi-)150 2640 y(tution,)k(arithmetic)f(expansion,)g(and)e |
fc527055 | 14864 | (quote)h(remo)m(v)-5 b(al,)39 b(sub)5 b(ject)35 b(to)i(the)f(v)-5 |
967625cd | 14865 | b(alue)36 b(of)g(the)g Ft(promptvars)150 2749 y Fu(shell)31 |
fc527055 | 14866 | b(option)f(\(see)i(Section)f(4.2)g([Bash)g(Builtins],)g(page)g(48\).) |
967625cd CR |
14867 | 150 2991 y Fs(6.10)68 b(The)45 b(Restricted)h(Shell)150 |
14868 | 3150 y Fu(If)34 b(Bash)g(is)g(started)g(with)g(the)g(name)h | |
6e51e0d0 | 14869 | Ft(rbash)p Fu(,)e(or)h(the)h Ft(--restricted)30 b Fu(or)k |
967625cd | 14870 | Ft(-r)g Fu(option)g(is)g(supplied)f(at)150 3260 y(in)m(v)m(o)s(cation,) |
6e51e0d0 CR |
14871 | d(the)d(shell)g(b)s(ecomes)h(restricted.)40 b(A)27 b(restricted)h |
14872 | (shell)f(is)g(used)f(to)i(set)f(up)f(an)h(en)m(vironmen)m(t)150 | |
967625cd | 14873 | 3369 y(more)g(con)m(trolled)i(than)e(the)g(standard)g(shell.)40 |
6e51e0d0 | 14874 | b(A)27 b(restricted)h(shell)f(b)s(eha)m(v)m(es)h(iden)m(tically)h(to)f |
967625cd | 14875 | Ft(bash)e Fu(with)150 3479 y(the)31 b(exception)g(that)g(the)g(follo)m |
6e51e0d0 | 14876 | (wing)h(are)e(disallo)m(w)m(ed)i(or)e(not)h(p)s(erformed:)225 |
967625cd CR |
14877 | 3614 y Fq(\017)60 b Fu(Changing)30 b(directories)h(with)g(the)f |
14878 | Ft(cd)g Fu(builtin.)225 3749 y Fq(\017)60 b Fu(Setting)31 | |
37c41ab1 | 14879 | b(or)f(unsetting)h(the)g(v)-5 b(alues)30 b(of)h(the)f |
6e51e0d0 | 14880 | Ft(SHELL)p Fu(,)g Ft(PATH)p Fu(,)f Ft(ENV)p Fu(,)h(or)g |
967625cd | 14881 | Ft(BASH_ENV)e Fu(v)-5 b(ariables.)225 3883 y Fq(\017)60 |
6e51e0d0 | 14882 | b Fu(Sp)s(ecifying)30 b(command)g(names)g(con)m(taining)i(slashes.)225 |
967625cd | 14883 | 4018 y Fq(\017)60 b Fu(Sp)s(ecifying)30 b(a)h(\014lename)f(con)m |
37c41ab1 | 14884 | (taining)i(a)f(slash)f(as)h(an)f(argumen)m(t)h(to)g(the)f |
967625cd | 14885 | Ft(.)h Fu(builtin)e(command.)225 4153 y Fq(\017)60 b |
6e51e0d0 CR |
14886 | Fu(Sp)s(ecifying)32 b(a)g(\014lename)h(con)m(taining)h(a)e(slash)g(as)h |
14887 | (an)f(argumen)m(t)h(to)g(the)f Ft(-p)g Fu(option)h(to)g(the)f | |
967625cd | 14888 | Ft(hash)330 4262 y Fu(builtin)e(command.)225 4397 y Fq(\017)60 |
6e51e0d0 | 14889 | b Fu(Imp)s(orting)30 b(function)g(de\014nitions)g(from)f(the)i(shell)g |
967625cd | 14890 | (en)m(vironmen)m(t)g(at)g(startup.)225 4532 y Fq(\017)60 |
6e51e0d0 CR |
14891 | b Fu(P)m(arsing)31 b(the)f(v)-5 b(alue)31 b(of)g Ft(SHELLOPTS)d |
14892 | Fu(from)h(the)i(shell)g(en)m(vironmen)m(t)g(at)g(startup.)225 | |
967625cd | 14893 | 4666 y Fq(\017)60 b Fu(Redirecting)31 b(output)f(using)g(the)h(`)p |
6e51e0d0 CR |
14894 | Ft(>)p Fu(',)g(`)p Ft(>|)p Fu(',)f(`)p Ft(<>)p Fu(',)h(`)p |
14895 | Ft(>&)p Fu(',)f(`)p Ft(&>)p Fu(',)h(and)e(`)p Ft(>>)p | |
967625cd | 14896 | Fu(')i(redirection)g(op)s(erators.)225 4801 y Fq(\017)60 |
6e51e0d0 | 14897 | b Fu(Using)31 b(the)f Ft(exec)f Fu(builtin)h(to)h(replace)h(the)e |
967625cd | 14898 | (shell)h(with)f(another)h(command.)225 4936 y Fq(\017)60 |
6e51e0d0 CR |
14899 | b Fu(Adding)24 b(or)g(deleting)i(builtin)e(commands)g(with)h(the)f |
14900 | Ft(-f)g Fu(and)g Ft(-d)g Fu(options)h(to)h(the)e Ft(enable)f | |
967625cd | 14901 | Fu(builtin.)225 5071 y Fq(\017)60 b Fu(Using)31 b(the)f |
6e51e0d0 | 14902 | Ft(enable)f Fu(builtin)h(command)g(to)h(enable)g(disabled)f(shell)g |
d7935593 | 14903 | (builtins.)225 5205 y Fq(\017)60 b Fu(Sp)s(ecifying)30 |
6e51e0d0 | 14904 | b(the)g Ft(-p)g Fu(option)h(to)g(the)g Ft(command)d Fu(builtin.)225 |
d7935593 | 14905 | 5340 y Fq(\017)60 b Fu(T)-8 b(urning)29 b(o\013)i(restricted)g(mo)s(de) |
6e51e0d0 | 14906 | f(with)g(`)p Ft(set)g(+r)p Fu(')g(or)g(`)p Ft(set)g(+o)g(restricted)p |
d7935593 | 14907 | Fu('.)p eop end |
900a813b CR |
14908 | %%Page: 95 101 |
14909 | TeXDict begin 95 100 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14910 | b(Bash)30 b(F)-8 b(eatures)2484 b(95)275 299 y(These)30 | |
d7935593 | 14911 | b(restrictions)h(are)g(enforced)f(after)h(an)m(y)g(startup)f(\014les)g |
967625cd | 14912 | (are)h(read.)275 427 y(When)j(a)i(command)e(that)i(is)f(found)f(to)h(b) |
d7935593 | 14913 | s(e)g(a)g(shell)g(script)g(is)g(executed)h(\(see)g(Section)g(3.8)g |
967625cd | 14914 | ([Shell)150 537 y(Scripts],)25 b(page)e(40\),)j Ft(rbash)c |
d7935593 | 14915 | Fu(turns)g(o\013)i(an)m(y)f(restrictions)h(in)f(the)g(shell)h(spa)m |
967625cd CR |
14916 | (wned)e(to)i(execute)g(the)g(script.)150 766 y Fs(6.11)68 |
14917 | b(Bash)45 b(POSIX)f(Mo)t(de)150 925 y Fu(Starting)39 | |
6e51e0d0 CR |
14918 | b(Bash)f(with)g(the)h Ft(--posix)d Fu(command-line)j(option)g(or)f |
14919 | (executing)h(`)p Ft(set)30 b(-o)g(posix)p Fu(')37 b(while)150 | |
967625cd | 14920 | 1035 y(Bash)26 b(is)g(running)e(will)j(cause)f(Bash)g(to)h(conform)f |
6e51e0d0 | 14921 | (more)g(closely)h(to)g(the)f Fm(posix)f Fu(standard)g(b)m(y)h(c)m |
967625cd | 14922 | (hanging)150 1144 y(the)31 b(b)s(eha)m(vior)f(to)h(matc)m(h)g(that)g |
d7935593 | 14923 | (sp)s(eci\014ed)f(b)m(y)g Fm(posix)g Fu(in)g(areas)h(where)f(the)h |
967625cd | 14924 | (Bash)f(default)h(di\013ers.)275 1273 y(When)f(in)m(v)m(ok)m(ed)h(as)g |
6e51e0d0 | 14925 | Ft(sh)p Fu(,)f(Bash)h(en)m(ters)g Fm(posix)e Fu(mo)s(de)h(after)h |
967625cd | 14926 | (reading)g(the)f(startup)g(\014les.)275 1401 y(The)f(follo)m(wing)j |
6e51e0d0 | 14927 | (list)f(is)g(what's)f(c)m(hanged)h(when)e(`)p Fm(posix)h |
967625cd | 14928 | Fu(mo)s(de')h(is)f(in)g(e\013ect:)199 1530 y(1.)61 b(When)28 |
ad4aef08 | 14929 | b(a)i(command)e(in)g(the)h(hash)f(table)i(no)e(longer)h(exists,)h(Bash) |
6e51e0d0 | 14930 | f(will)g(re-searc)m(h)h Ft($PATH)d Fu(to)i(\014nd)330 |
967625cd | 14931 | 1640 y(the)i(new)e(lo)s(cation.)43 b(This)29 b(is)i(also)g(a)m(v)-5 |
6e51e0d0 | 14932 | b(ailable)33 b(with)d(`)p Ft(shopt)f(-s)h(checkhash)p |
967625cd | 14933 | Fu('.)199 1768 y(2.)61 b(The)42 b(message)h(prin)m(ted)e(b)m(y)h(the)g |
122f603c | 14934 | (job)g(con)m(trol)i(co)s(de)e(and)f(builtins)h(when)f(a)h(job)g(exits)h |
967625cd CR |
14935 | (with)f(a)330 1878 y(non-zero)31 b(status)g(is)f(`Done\(status\)'.)199 |
14936 | 2006 y(3.)61 b(The)40 b(message)h(prin)m(ted)f(b)m(y)g(the)h(job)f(con) | |
ad4aef08 | 14937 | m(trol)h(co)s(de)g(and)f(builtins)f(when)h(a)g(job)g(is)h(stopp)s(ed)e |
967625cd | 14938 | (is)330 2116 y(`Stopp)s(ed\()p Fr(signame)5 b Fu(\)',)31 |
6e51e0d0 | 14939 | b(where)f Fr(signame)36 b Fu(is,)31 b(for)f(example,)h |
967625cd CR |
14940 | Ft(SIGTSTP)p Fu(.)199 2244 y(4.)61 b(Alias)31 b(expansion)g(is)f(alw)m |
14941 | (a)m(ys)i(enabled,)e(ev)m(en)i(in)e(non-in)m(teractiv)m(e)j(shells.)199 | |
14942 | 2373 y(5.)61 b(Reserv)m(ed)40 b(w)m(ords)g(app)s(earing)f(in)h(a)g(con) | |
7d92f73f | 14943 | m(text)i(where)d(reserv)m(ed)h(w)m(ords)f(are)i(recognized)g(do)f(not) |
967625cd | 14944 | 330 2483 y(undergo)30 b(alias)h(expansion.)199 2611 y(6.)61 |
6e51e0d0 CR |
14945 | b(The)38 b Fm(posix)h Ft(PS1)f Fu(and)g Ft(PS2)g Fu(expansions)g(of)i |
14946 | (`)p Ft(!)p Fu(')f(to)g(the)g(history)g(n)m(um)m(b)s(er)f(and)g(`)p | |
967625cd | 14947 | Ft(!!)p Fu(')h(to)g(`)p Ft(!)p Fu(')h(are)330 2721 y(enabled,)26 |
ac18b312 | 14948 | b(and)f(parameter)g(expansion)g(is)g(p)s(erformed)e(on)i(the)g(v)-5 |
6e51e0d0 | 14949 | b(alues)25 b(of)g Ft(PS1)f Fu(and)h Ft(PS2)f Fu(regardless)330 |
967625cd CR |
14950 | 2830 y(of)31 b(the)f(setting)i(of)e(the)h Ft(promptvars)c |
14951 | Fu(option.)199 2959 y(7.)61 b(The)30 b Fm(posix)g Fu(startup)f(\014les) | |
6e51e0d0 | 14952 | i(are)g(executed)g(\()p Ft($ENV)p Fu(\))f(rather)g(than)g(the)h(normal) |
967625cd | 14953 | f(Bash)g(\014les.)199 3087 y(8.)61 b(Tilde)30 b(expansion)g(is)f(only)h |
ac18b312 | 14954 | (p)s(erformed)f(on)h(assignmen)m(ts)g(preceding)g(a)g(command)g(name,)g |
967625cd CR |
14955 | (rather)330 3197 y(than)g(on)g(all)i(assignmen)m(t)f(statemen)m(ts)h |
14956 | (on)e(the)h(line.)199 3325 y(9.)61 b(The)30 b(default)g(history)h | |
14957 | (\014le)f(is)h Ft(~/.sh_history)26 b Fu(\(this)31 b(is)f(the)h(default) | |
14958 | g(v)-5 b(alue)30 b(of)h Ft($HISTFILE)p Fu(\).)154 3454 | |
14959 | y(10.)61 b(Redirection)25 b(op)s(erators)f(do)g(not)g(p)s(erform)f | |
d7935593 | 14960 | (\014lename)h(expansion)g(on)g(the)g(w)m(ord)f(in)h(the)g(redirection) |
967625cd CR |
14961 | 330 3564 y(unless)30 b(the)g(shell)h(is)f(in)m(teractiv)m(e.)154 |
14962 | 3692 y(11.)61 b(Redirection)31 b(op)s(erators)g(do)f(not)h(p)s(erform)e | |
14963 | (w)m(ord)h(splitting)h(on)f(the)h(w)m(ord)f(in)g(the)g(redirection.)154 | |
14964 | 3821 y(12.)61 b(F)-8 b(unction)35 b(names)g(m)m(ust)f(b)s(e)g(v)-5 | |
6e51e0d0 | 14965 | b(alid)35 b(shell)f Ft(name)p Fu(s.)52 b(That)34 b(is,)i(they)f(ma)m(y) |
967625cd | 14966 | g(not)g(con)m(tain)g(c)m(haracters)330 3930 y(other)e(than)g(letters,)h |
eb0b2ad8 | 14967 | (digits,)h(and)d(underscores,)h(and)f(ma)m(y)h(not)g(start)h(with)e(a)h |
967625cd | 14968 | (digit.)49 b(Declaring)330 4040 y(a)31 b(function)f(with)g(an)g(in)m(v) |
eb0b2ad8 | 14969 | -5 b(alid)31 b(name)g(causes)f(a)h(fatal)h(syn)m(tax)f(error)f(in)g |
967625cd | 14970 | (non-in)m(teractiv)m(e)j(shells.)154 4168 y(13.)61 b(F)-8 |
122f603c | 14971 | b(unction)31 b(names)f(ma)m(y)h(not)g(b)s(e)f(the)g(same)h(as)g(one)f |
d7935593 | 14972 | (of)h(the)f Fm(posix)g Fu(sp)s(ecial)h(builtins.)154 |
967625cd | 14973 | 4297 y(14.)61 b Fm(posix)30 b Fu(sp)s(ecial)h(builtins)e(are)i(found)e |
d7935593 | 14974 | (b)s(efore)h(shell)h(functions)f(during)f(command)h(lo)s(okup.)154 |
967625cd | 14975 | 4425 y(15.)61 b(Literal)28 b(tildes)g(that)f(app)s(ear)f(as)i(the)f |
fc527055 | 14976 | (\014rst)f(c)m(haracter)j(in)d(elemen)m(ts)j(of)e(the)g |
967625cd | 14977 | Ft(PATH)f Fu(v)-5 b(ariable)27 b(are)h(not)330 4535 y(expanded)i(as)g |
fc527055 | 14978 | (describ)s(ed)f(ab)s(o)m(v)m(e)j(under)d(Section)i(3.5.2)h([Tilde)f |
967625cd | 14979 | (Expansion],)f(page)h(22.)154 4663 y(16.)61 b(The)29 |
d7935593 | 14980 | b Ft(time)g Fu(reserv)m(ed)h(w)m(ord)g(ma)m(y)g(b)s(e)g(used)f(b)m(y)h |
fc527055 | 14981 | (itself)g(as)g(a)h(command.)40 b(When)30 b(used)f(in)g(this)h(w)m(a)m |
967625cd | 14982 | (y)-8 b(,)330 4773 y(it)33 b(displa)m(ys)g(timing)g(statistics)h(for)e |
fc527055 | 14983 | (the)h(shell)g(and)f(its)g(completed)i(c)m(hildren.)47 |
967625cd | 14984 | b(The)32 b Ft(TIMEFORMAT)330 4883 y Fu(v)-5 b(ariable)31 |
fc527055 | 14985 | b(con)m(trols)h(the)e(format)h(of)g(the)f(timing)h(information.)154 |
967625cd | 14986 | 5011 y(17.)61 b(When)33 b(parsing)g(and)f(expanding)h(a)h($)p |
fc527055 | 14987 | Fi({)6 b Fu(.)22 b(.)h(.)11 b Fi(})33 b Fu(expansion)g(that)h(app)s |
967625cd | 14988 | (ears)f(within)f(double)h(quotes,)330 5121 y(single)42 |
fc527055 | 14989 | b(quotes)g(are)g(no)g(longer)g(sp)s(ecial)g(and)f(cannot)i(b)s(e)e |
967625cd | 14990 | (used)g(to)h(quote)g(a)g(closing)h(brace)f(or)330 5230 |
fc527055 CR |
14991 | y(other)31 b(sp)s(ecial)h(c)m(haracter,)i(unless)c(the)i(op)s(erator)f |
14992 | (is)g(one)h(of)f(those)h(de\014ned)e(to)i(p)s(erform)e(pattern)330 | |
967625cd CR |
14993 | 5340 y(remo)m(v)-5 b(al.)42 b(In)30 b(this)g(case,)i(they)e(do)g(not)h |
14994 | (ha)m(v)m(e)h(to)f(app)s(ear)e(as)i(matc)m(hed)g(pairs.)p | |
14995 | eop end | |
14996 | %%Page: 96 102 | |
14997 | TeXDict begin 96 101 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14998 | b(Bash)30 b(F)-8 b(eatures)2484 b(96)154 299 y(18.)61 | |
14999 | b(The)29 b(parser)g(do)s(es)g(not)h(recognize)h Ft(time)d | |
15000 | Fu(as)i(a)g(reserv)m(ed)f(w)m(ord)g(if)h(the)f(next)h(tok)m(en)h(b)s | |
15001 | (egins)d(with)i(a)330 408 y(`)p Ft(-)p Fu('.)154 540 | |
15002 | y(19.)61 b(The)30 b(`)p Ft(!)p Fu(')h(c)m(haracter)h(do)s(es)e(not)h | |
15003 | (in)m(tro)s(duce)g(history)f(expansion)h(within)f(a)h(double-quoted)g | |
15004 | (string,)330 650 y(ev)m(en)g(if)f(the)h Ft(histexpand)d | |
15005 | Fu(option)i(is)h(enabled.)154 781 y(20.)61 b(If)24 b(a)g | |
15006 | Fm(posix)g Fu(sp)s(ecial)h(builtin)f(returns)f(an)h(error)g(status,)i | |
15007 | (a)e(non-in)m(teractiv)m(e)j(shell)e(exits.)39 b(The)24 | |
15008 | b(fatal)330 891 y(errors)30 b(are)h(those)f(listed)h(in)f(the)h | |
15009 | Fm(posix)e Fu(standard,)h(and)g(include)g(things)g(lik)m(e)i(passing)e | |
15010 | (incorrect)330 1000 y(options,)43 b(redirection)d(errors,)i(v)-5 | |
15011 | b(ariable)41 b(assignmen)m(t)g(errors)e(for)g(assignmen)m(ts)i | |
15012 | (preceding)f(the)330 1110 y(command)30 b(name,)h(and)f(so)g(on.)154 | |
15013 | 1241 y(21.)61 b(A)31 b(non-in)m(teractiv)m(e)j(shell)d(exits)h(with)e | |
15014 | (an)h(error)g(status)g(if)g(a)g(v)-5 b(ariable)32 b(assignmen)m(t)g | |
15015 | (error)e(o)s(ccurs)330 1351 y(when)38 b(no)h(command)g(name)g(follo)m | |
15016 | (ws)i(the)e(assignmen)m(t)h(statemen)m(ts.)69 b(A)39 | |
15017 | b(v)-5 b(ariable)40 b(assignmen)m(t)330 1461 y(error)30 | |
15018 | b(o)s(ccurs,)g(for)g(example,)i(when)d(trying)i(to)g(assign)f(a)h(v)-5 | |
15019 | b(alue)31 b(to)g(a)g(readonly)f(v)-5 b(ariable.)154 1592 | |
15020 | y(22.)61 b(A)31 b(non-in)m(teractiv)m(e)j(shell)d(exits)h(with)e(an)h | |
15021 | (error)g(status)g(if)g(a)g(v)-5 b(ariable)32 b(assignmen)m(t)g(error)e | |
15022 | (o)s(ccurs)330 1702 y(in)g(an)g(assignmen)m(t)i(statemen)m(t)g | |
15023 | (preceding)e(a)h(sp)s(ecial)g(builtin,)f(but)g(not)g(with)h(an)m(y)f | |
15024 | (other)h(simple)330 1811 y(command.)154 1943 y(23.)61 | |
15025 | b(A)43 b(non-in)m(teractiv)m(e)i(shell)e(exits)h(with)f(an)f(error)h | |
15026 | (status)g(if)g(the)g(iteration)h(v)-5 b(ariable)44 b(in)f(a)g | |
15027 | Ft(for)330 2052 y Fu(statemen)m(t)32 b(or)f(the)f(selection)i(v)-5 | |
15028 | b(ariable)32 b(in)e(a)g Ft(select)f Fu(statemen)m(t)j(is)f(a)f | |
15029 | (readonly)h(v)-5 b(ariable.)154 2184 y(24.)61 b(Non-in)m(teractiv)m(e) | |
15030 | 34 b(shells)c(exit)h(if)g Fr(\014lename)k Fu(in)30 b | |
15031 | Ft(.)g Fr(\014lename)36 b Fu(is)31 b(not)f(found.)154 | |
15032 | 2315 y(25.)61 b(Non-in)m(teractiv)m(e)41 b(shells)d(exit)h(if)f(a)g | |
15033 | (syn)m(tax)g(error)g(in)f(an)h(arithmetic)h(expansion)f(results)f(in)h | |
15034 | (an)330 2425 y(in)m(v)-5 b(alid)31 b(expression.)154 | |
15035 | 2556 y(26.)61 b(Non-in)m(teractiv)m(e)34 b(shells)c(exit)h(on)g(w)m | |
15036 | (ord)f(expansion)g(errors.)154 2688 y(27.)61 b(Non-in)m(teractiv)m(e)27 | |
15037 | b(shells)c(exit)i(if)e(there)h(is)f(a)h(syn)m(tax)g(error)f(in)g(a)h | |
15038 | (script)f(read)g(with)h(the)f Ft(.)g Fu(or)h Ft(source)330 | |
15039 | 2798 y Fu(builtins,)30 b(or)g(in)g(a)h(string)g(pro)s(cessed)e(b)m(y)i | |
15040 | (the)f Ft(eval)f Fu(builtin.)154 2929 y(28.)61 b(Pro)s(cess)30 | |
15041 | b(substitution)g(is)h(not)f(a)m(v)-5 b(ailable.)154 3061 | |
15042 | y(29.)61 b(While)32 b(v)-5 b(ariable)32 b(indirection)f(is)g(a)m(v)-5 | |
15baad62 | 15043 | b(ailable,)34 b(it)d(ma)m(y)h(not)f(b)s(e)g(applied)g(to)g(the)h(`)p |
6e51e0d0 | 15044 | Ft(#)p Fu(')f(and)f(`)p Ft(?)p Fu(')h(sp)s(ecial)330 |
967625cd | 15045 | 3170 y(parameters.)154 3302 y(30.)61 b(Assignmen)m(t)23 |
6e51e0d0 | 15046 | b(statemen)m(ts)h(preceding)e Fm(posix)f Fu(sp)s(ecial)i(builtins)f(p)s |
967625cd CR |
15047 | (ersist)g(in)f(the)i(shell)f(en)m(vironmen)m(t)330 3411 |
15048 | y(after)31 b(the)f(builtin)g(completes.)154 3543 y(31.)61 | |
eb0b2ad8 CR |
15049 | b(Assignmen)m(t)35 b(statemen)m(ts)h(preceding)f(shell)f(function)g |
15050 | (calls)i(p)s(ersist)e(in)g(the)h(shell)f(en)m(vironmen)m(t)330 | |
967625cd | 15051 | 3652 y(after)d(the)f(function)h(returns,)e(as)i(if)f(a)h |
6e51e0d0 | 15052 | Fm(posix)e Fu(sp)s(ecial)i(builtin)f(command)g(had)g(b)s(een)g |
967625cd CR |
15053 | (executed.)154 3784 y(32.)61 b(The)31 b Ft(command)e |
15054 | Fu(builtin)i(do)s(es)g(not)h(prev)m(en)m(t)f(builtins)g(that)h(tak)m(e) | |
15055 | h(assignmen)m(t)f(statemen)m(ts)h(as)f(ar-)330 3893 y(gumen)m(ts)40 | |
15056 | b(from)e(expanding)h(them)g(as)h(assignmen)m(t)g(statemen)m(ts;)46 | |
15057 | b(when)38 b(not)i(in)f Fm(posix)f Fu(mo)s(de,)330 4003 | |
15058 | y(assignmen)m(t)k(builtins)e(lose)h(their)g(assignmen)m(t)h(statemen)m | |
15059 | (t)h(expansion)d(prop)s(erties)g(when)g(pre-)330 4113 | |
15060 | y(ceded)31 b(b)m(y)f Ft(command)p Fu(.)154 4244 y(33.)61 | |
15061 | b(The)27 b Ft(bg)g Fu(builtin)g(uses)g(the)h(required)f(format)h(to)g | |
15062 | (describ)s(e)f(eac)m(h)i(job)e(placed)h(in)f(the)h(bac)m(kground,)330 | |
15063 | 4354 y(whic)m(h)h(do)s(es)g(not)g(include)g(an)g(indication)h(of)f | |
15064 | (whether)f(the)h(job)g(is)g(the)h(curren)m(t)e(or)h(previous)g(job.)154 | |
15065 | 4485 y(34.)61 b(The)23 b(output)f(of)i(`)p Ft(kill)29 | |
15066 | b(-l)p Fu(')23 b(prin)m(ts)f(all)i(the)g(signal)f(names)g(on)g(a)h | |
15067 | (single)g(line,)h(separated)e(b)m(y)g(spaces,)330 4595 | |
15068 | y(without)30 b(the)h(`)p Ft(SIG)p Fu(')f(pre\014x.)154 | |
15069 | 4726 y(35.)61 b(The)30 b Ft(kill)f Fu(builtin)h(do)s(es)g(not)h(accept) | |
15070 | h(signal)f(names)f(with)g(a)h(`)p Ft(SIG)p Fu(')f(pre\014x.)154 | |
15071 | 4858 y(36.)61 b(The)38 b Ft(export)f Fu(and)g Ft(readonly)f | |
15072 | Fu(builtin)i(commands)g(displa)m(y)h(their)f(output)g(in)g(the)h | |
15073 | (format)g(re-)330 4967 y(quired)30 b(b)m(y)g Fm(posix)p | |
15074 | Fu(.)154 5099 y(37.)61 b(The)30 b Ft(trap)f Fu(builtin)h(displa)m(ys)g | |
6e51e0d0 | 15075 | (signal)i(names)e(without)g(the)h(leading)g Ft(SIG)p |
967625cd | 15076 | Fu(.)154 5230 y(38.)61 b(The)39 b Ft(trap)e Fu(builtin)i(do)s(esn't)g |
6e51e0d0 | 15077 | (c)m(hec)m(k)h(the)g(\014rst)e(argumen)m(t)i(for)e(a)i(p)s(ossible)e |
967625cd | 15078 | (signal)i(sp)s(eci\014cation)330 5340 y(and)30 b(rev)m(ert)i(the)e |
6e51e0d0 | 15079 | (signal)i(handling)e(to)h(the)g(original)h(disp)s(osition)e(if)h(it)g |
967625cd | 15080 | (is,)g(unless)f(that)h(argumen)m(t)p eop end |
900a813b CR |
15081 | %%Page: 97 103 |
15082 | TeXDict begin 97 102 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
967625cd CR |
15083 | b(Bash)30 b(F)-8 b(eatures)2484 b(97)330 299 y(consists)29 |
15084 | b(solely)g(of)g(digits)g(and)f(is)g(a)h(v)-5 b(alid)29 | |
15085 | b(signal)g(n)m(um)m(b)s(er.)38 b(If)28 b(users)g(w)m(an)m(t)h(to)g | |
15086 | (reset)g(the)g(handler)330 408 y(for)h(a)g(giv)m(en)h(signal)g(to)f | |
15087 | (the)h(original)g(disp)s(osition,)f(they)g(should)f(use)h(`)p | |
15088 | Ft(-)p Fu(')g(as)g(the)g(\014rst)f(argumen)m(t.)154 548 | |
15089 | y(39.)61 b(The)21 b Ft(.)h Fu(and)f Ft(source)f Fu(builtins)h(do)g(not) | |
15090 | h(searc)m(h)h(the)f(curren)m(t)f(directory)h(for)g(the)g(\014lename)f | |
15091 | (argumen)m(t)330 658 y(if)30 b(it)h(is)g(not)f(found)f(b)m(y)i(searc)m | |
15092 | (hing)g Ft(PATH)p Fu(.)154 797 y(40.)61 b(Enabling)21 | |
15093 | b Fm(posix)g Fu(mo)s(de)g(has)g(the)g(e\013ect)i(of)e(setting)i(the)e | |
15094 | Ft(inherit_errexit)d Fu(option,)23 b(so)f(subshells)330 | |
15095 | 907 y(spa)m(wned)27 b(to)i(execute)g(command)e(substitutions)h(inherit) | |
15096 | f(the)h(v)-5 b(alue)28 b(of)g(the)g Ft(-e)f Fu(option)h(from)g(the)330 | |
15097 | 1016 y(paren)m(t)37 b(shell.)62 b(When)37 b(the)g Ft(inherit_errexit)c | |
15098 | Fu(option)38 b(is)f(not)h(enabled,)h(Bash)e(clears)h(the)g | |
15099 | Ft(-e)330 1126 y Fu(option)31 b(in)f(suc)m(h)g(subshells.)154 | |
15100 | 1265 y(41.)61 b(When)43 b(the)g Ft(alias)f Fu(builtin)g(displa)m(ys)i | |
15101 | (alias)g(de\014nitions,)i(it)d(do)s(es)g(not)g(displa)m(y)h(them)f | |
15102 | (with)g(a)330 1375 y(leading)31 b(`)p Ft(alias)e Fu(')i(unless)f(the)g | |
15103 | Ft(-p)g Fu(option)h(is)f(supplied.)154 1514 y(42.)61 | |
d7935593 CR |
15104 | b(When)40 b(the)g Ft(set)f Fu(builtin)h(is)g(in)m(v)m(ok)m(ed)h |
15105 | (without)f(options,)j(it)e(do)s(es)f(not)g(displa)m(y)g(shell)g | |
967625cd CR |
15106 | (function)330 1624 y(names)30 b(and)g(de\014nitions.)154 |
15107 | 1763 y(43.)61 b(When)36 b(the)g Ft(set)g Fu(builtin)g(is)g(in)m(v)m(ok) | |
d7935593 | 15108 | m(ed)i(without)e(options,)i(it)f(displa)m(ys)f(v)-5 b(ariable)37 |
967625cd | 15109 | b(v)-5 b(alues)37 b(without)330 1873 y(quotes,)26 b(unless)d(they)i |
fc527055 | 15110 | (con)m(tain)g(shell)f(metac)m(haracters,)k(ev)m(en)d(if)f(the)g(result) |
967625cd CR |
15111 | g(con)m(tains)i(nonprin)m(ting)330 1983 y(c)m(haracters.)154 |
15112 | 2122 y(44.)61 b(When)35 b(the)g Ft(cd)f Fu(builtin)h(is)g(in)m(v)m(ok)m | |
6e51e0d0 | 15113 | (ed)i(in)d Fr(logical)41 b Fu(mo)s(de,)36 b(and)f(the)g(pathname)g |
967625cd | 15114 | (constructed)g(from)330 2232 y Ft($PWD)i Fu(and)h(the)h(directory)f |
ad4aef08 | 15115 | (name)h(supplied)e(as)i(an)f(argumen)m(t)h(do)s(es)f(not)g(refer)h(to)g |
967625cd | 15116 | (an)f(existing)330 2341 y(directory)-8 b(,)32 b Ft(cd)d |
6e51e0d0 | 15117 | Fu(will)i(fail)g(instead)g(of)f(falling)h(bac)m(k)h(to)f |
967625cd | 15118 | Fr(ph)m(ysical)j Fu(mo)s(de.)154 2481 y(45.)61 b(The)36 |
6e51e0d0 | 15119 | b Ft(pwd)f Fu(builtin)h(v)m(eri\014es)h(that)g(the)f(v)-5 |
ad4aef08 | 15120 | b(alue)37 b(it)g(prin)m(ts)e(is)i(the)f(same)h(as)f(the)h(curren)m(t)f |
967625cd | 15121 | (directory)-8 b(,)330 2590 y(ev)m(en)31 b(if)f(it)h(is)g(not)f(ask)m |
6e51e0d0 | 15122 | (ed)h(to)g(c)m(hec)m(k)h(the)f(\014le)f(system)h(with)f(the)h |
967625cd | 15123 | Ft(-P)e Fu(option.)154 2730 y(46.)61 b(When)35 b(listing)g(the)g |
6e51e0d0 | 15124 | (history)-8 b(,)36 b(the)f Ft(fc)g Fu(builtin)f(do)s(es)g(not)h |
967625cd | 15125 | (include)g(an)f(indication)i(of)f(whether)f(or)330 2839 |
ad4aef08 | 15126 | y(not)d(a)f(history)h(en)m(try)f(has)g(b)s(een)g(mo)s(di\014ed.)154 |
967625cd CR |
15127 | 2979 y(47.)61 b(The)30 b(default)g(editor)h(used)f(b)m(y)g |
15128 | Ft(fc)g Fu(is)g Ft(ed)p Fu(.)154 3118 y(48.)61 b(The)37 | |
6e51e0d0 | 15129 | b Ft(type)g Fu(and)g Ft(command)f Fu(builtins)i(will)g(not)g(rep)s(ort) |
122f603c | 15130 | f(a)i(non-executable)g(\014le)f(as)g(ha)m(ving)h(b)s(een)330 |
967625cd | 15131 | 3228 y(found,)26 b(though)h(the)g(shell)g(will)g(attempt)h(to)g |
122f603c | 15132 | (execute)g(suc)m(h)f(a)g(\014le)g(if)g(it)g(is)g(the)g(only)g(so-named) |
967625cd CR |
15133 | g(\014le)330 3337 y(found)i(in)h Ft($PATH)p Fu(.)154 |
15134 | 3477 y(49.)61 b(The)33 b Ft(vi)f Fu(editing)i(mo)s(de)f(will)g(in)m(v)m | |
6e51e0d0 | 15135 | (ok)m(e)i(the)e Ft(vi)g Fu(editor)h(directly)f(when)f(the)i(`)p |
967625cd CR |
15136 | Ft(v)p Fu(')f(command)g(is)g(run,)330 3587 y(instead)e(of)f(c)m(hec)m |
15137 | (king)i Ft($VISUAL)d Fu(and)g Ft($EDITOR)p Fu(.)154 3726 | |
15138 | y(50.)61 b(When)41 b(the)g Ft(xpg_echo)e Fu(option)i(is)g(enabled,)j | |
122f603c | 15139 | (Bash)d(do)s(es)g(not)g(attempt)h(to)g(in)m(terpret)f(an)m(y)h(ar-)330 |
967625cd | 15140 | 3836 y(gumen)m(ts)35 b(to)g Ft(echo)e Fu(as)i(options.)54 |
1c72c0cd | 15141 | b(Eac)m(h)35 b(argumen)m(t)g(is)f(displa)m(y)m(ed,)j(after)e(escap)s(e) |
967625cd CR |
15142 | g(c)m(haracters)h(are)330 3945 y(con)m(v)m(erted.)154 |
15143 | 4085 y(51.)61 b(The)30 b Ft(ulimit)f Fu(builtin)g(uses)h(a)h(blo)s(c)m | |
6e51e0d0 | 15144 | (k)g(size)g(of)g(512)g(b)m(ytes)g(for)f(the)h Ft(-c)f |
967625cd | 15145 | Fu(and)g Ft(-f)f Fu(options.)154 4224 y(52.)61 b(The)39 |
6e51e0d0 CR |
15146 | b(arriv)-5 b(al)41 b(of)f Ft(SIGCHLD)e Fu(when)h(a)h(trap)g(is)g(set)h |
15147 | (on)f Ft(SIGCHLD)e Fu(do)s(es)h(not)h(in)m(terrupt)g(the)g | |
967625cd | 15148 | Ft(wait)330 4334 y Fu(builtin)c(and)h(cause)g(it)h(to)f(return)f |
e1e48bba | 15149 | (immediately)-8 b(.)62 b(The)37 b(trap)f(command)h(is)g(run)e(once)j |
967625cd CR |
15150 | (for)f(eac)m(h)330 4443 y(c)m(hild)31 b(that)g(exits.)154 |
15151 | 4583 y(53.)61 b(The)27 b Ft(read)f Fu(builtin)g(ma)m(y)i(b)s(e)e(in)m | |
abe2eb5b | 15152 | (terrupted)h(b)m(y)g(a)h(signal)f(for)g(whic)m(h)g(a)h(trap)f(has)g(b)s |
967625cd | 15153 | (een)f(set.)40 b(If)27 b(Bash)330 4692 y(receiv)m(es)41 |
6e51e0d0 CR |
15154 | b(a)f(trapp)s(ed)e(signal)i(while)f(executing)h Ft(read)p |
15155 | Fu(,)h(the)e(trap)h(handler)e(executes)i(and)f Ft(read)330 | |
967625cd CR |
15156 | 4802 y Fu(returns)29 b(an)h(exit)i(status)e(greater)i(than)e(128.)275 |
15157 | 4976 y(There)k(is)g(other)h Fm(posix)f Fu(b)s(eha)m(vior)h(that)g(Bash) | |
eb0b2ad8 | 15158 | g(do)s(es)f(not)h(implemen)m(t)g(b)m(y)g(default)f(ev)m(en)i(when)d(in) |
967625cd CR |
15159 | 150 5086 y Fm(posix)d Fu(mo)s(de.)40 b(Sp)s(eci\014cally:)199 |
15160 | 5230 y(1.)61 b(The)30 b Ft(fc)f Fu(builtin)h(c)m(hec)m(ks)i | |
6e51e0d0 | 15161 | Ft($EDITOR)c Fu(as)j(a)f(program)g(to)h(edit)g(history)f(en)m(tries)h |
967625cd | 15162 | (if)f Ft(FCEDIT)f Fu(is)h(unset,)330 5340 y(rather)g(than)g(defaulting) |
6e51e0d0 | 15163 | h(directly)g(to)g Ft(ed)p Fu(.)40 b Ft(fc)30 b Fu(uses)g |
967625cd | 15164 | Ft(ed)g Fu(if)g Ft(EDITOR)f Fu(is)h(unset.)p eop end |
900a813b CR |
15165 | %%Page: 98 104 |
15166 | TeXDict begin 98 103 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
967625cd CR |
15167 | b(Bash)30 b(F)-8 b(eatures)2484 b(98)199 299 y(2.)61 |
15168 | b(As)29 b(noted)g(ab)s(o)m(v)m(e,)i(Bash)e(requires)g(the)g | |
15169 | Ft(xpg_echo)e Fu(option)j(to)g(b)s(e)e(enabled)h(for)g(the)g | |
15170 | Ft(echo)f Fu(builtin)330 408 y(to)j(b)s(e)f(fully)g(conforman)m(t.)275 | |
15171 | 568 y(Bash)c(can)g(b)s(e)f(con\014gured)h(to)g(b)s(e)g | |
15172 | Fm(posix)p Fu(-conforman)m(t)g(b)m(y)g(default,)h(b)m(y)f(sp)s | |
15173 | (ecifying)g(the)g Ft(--enable-)150 677 y(strict-posix-default)c | |
15174 | Fu(to)27 b Ft(configure)e Fu(when)h(building)h(\(see)h(Section)g(10.8)g | |
15175 | ([Optional)g(F)-8 b(eatures],)150 787 y(page)31 b(143\).)p | |
d7935593 | 15176 | eop end |
900a813b | 15177 | %%Page: 99 105 |
037a8b7f CR |
15178 | TeXDict begin 99 104 bop 3659 -116 a Fu(99)150 299 y |
15179 | Fp(7)80 b(Job)54 b(Con)l(trol)150 518 y Fu(This)25 b(c)m(hapter)i | |
15180 | (discusses)f(what)g(job)f(con)m(trol)j(is,)f(ho)m(w)f(it)h(w)m(orks,)g | |
15181 | (and)f(ho)m(w)g(Bash)g(allo)m(ws)h(y)m(ou)g(to)g(access)150 | |
15182 | 628 y(its)k(facilities.)150 863 y Fs(7.1)68 b(Job)45 | |
15183 | b(Con)l(trol)h(Basics)150 1022 y Fu(Job)27 b(con)m(trol)i(refers)e(to)h | |
15184 | (the)g(abilit)m(y)h(to)f(selectiv)m(ely)j(stop)c(\(susp)s(end\))f(the)i | |
15185 | (execution)h(of)e(pro)s(cesses)h(and)150 1132 y(con)m(tin)m(ue)38 | |
15186 | b(\(resume\))g(their)f(execution)h(at)g(a)g(later)g(p)s(oin)m(t.)61 | |
15187 | b(A)37 b(user)g(t)m(ypically)i(emplo)m(ys)f(this)f(facilit)m(y)150 | |
967625cd | 15188 | 1241 y(via)27 b(an)e(in)m(teractiv)m(e)k(in)m(terface)f(supplied)d |
c302751c | 15189 | (join)m(tly)h(b)m(y)g(the)h(op)s(erating)f(system)g(k)m(ernel's)h |
967625cd | 15190 | (terminal)f(driv)m(er)150 1351 y(and)k(Bash.)275 1482 |
6e51e0d0 | 15191 | y(The)23 b(shell)i(asso)s(ciates)h(a)f Fr(job)h Fu(with)e(eac)m(h)i |
c302751c | 15192 | (pip)s(eline.)38 b(It)25 b(k)m(eeps)f(a)h(table)h(of)e(curren)m(tly)h |
967625cd | 15193 | (executing)g(jobs,)150 1592 y(whic)m(h)33 b(ma)m(y)i(b)s(e)e(listed)h |
6e51e0d0 | 15194 | (with)f(the)h Ft(jobs)f Fu(command.)50 b(When)33 b(Bash)h(starts)g(a)g |
967625cd CR |
15195 | (job)g(async)m(hronously)-8 b(,)34 b(it)150 1701 y(prin)m(ts)c(a)h |
15196 | (line)f(that)h(lo)s(oks)g(lik)m(e:)390 1833 y Ft([1])47 | |
15197 | b(25647)150 1965 y Fu(indicating)34 b(that)g(this)f(job)g(is)g(job)g(n) | |
6e51e0d0 | 15198 | m(um)m(b)s(er)f(1)i(and)f(that)g(the)h(pro)s(cess)f Fm(id)g |
967625cd | 15199 | Fu(of)g(the)h(last)g(pro)s(cess)f(in)g(the)150 2074 y(pip)s(eline)42 |
c302751c CR |
15200 | b(asso)s(ciated)i(with)e(this)g(job)g(is)h(25647.)78 |
15201 | b(All)43 b(of)g(the)g(pro)s(cesses)f(in)g(a)h(single)g(pip)s(eline)f | |
967625cd | 15202 | (are)150 2184 y(mem)m(b)s(ers)30 b(of)g(the)h(same)f(job.)41 |
6e51e0d0 | 15203 | b(Bash)30 b(uses)g(the)h Fr(job)h Fu(abstraction)f(as)g(the)g(basis)f |
967625cd | 15204 | (for)g(job)g(con)m(trol.)275 2315 y(T)-8 b(o)23 b(facilitate)j(the)d |
c302751c | 15205 | (implemen)m(tation)i(of)f(the)f(user)f(in)m(terface)j(to)f(job)f(con)m |
967625cd | 15206 | (trol,)j(the)d(op)s(erating)h(system)150 2425 y(main)m(tains)j(the)f |
c302751c | 15207 | (notion)h(of)f(a)g(curren)m(t)g(terminal)g(pro)s(cess)g(group)g |
6e51e0d0 | 15208 | Fm(id)p Fu(.)39 b(Mem)m(b)s(ers)26 b(of)g(this)g(pro)s(cess)f(group)150 |
967625cd | 15209 | 2534 y(\(pro)s(cesses)h(whose)g(pro)s(cess)g(group)g |
6e51e0d0 | 15210 | Fm(id)g Fu(is)h(equal)g(to)g(the)f(curren)m(t)g(terminal)h(pro)s(cess)f |
967625cd | 15211 | (group)f Fm(id)p Fu(\))i(receiv)m(e)150 2644 y(k)m(eyb)s |
6e51e0d0 CR |
15212 | (oard-generated)22 b(signals)g(suc)m(h)e(as)h Ft(SIGINT)p |
15213 | Fu(.)36 b(These)21 b(pro)s(cesses)g(are)g(said)g(to)g(b)s(e)g(in)f(the) | |
967625cd | 15214 | h(foreground.)150 2754 y(Bac)m(kground)38 b(pro)s(cesses)f(are)h(those) |
6e51e0d0 | 15215 | g(whose)f(pro)s(cess)g(group)g Fm(id)h Fu(di\013ers)f(from)g(the)g |
967625cd | 15216 | (terminal's;)42 b(suc)m(h)150 2863 y(pro)s(cesses)24 |
37c41ab1 CR |
15217 | b(are)g(imm)m(une)g(to)g(k)m(eyb)s(oard-generated)h(signals.)40 |
15218 | b(Only)23 b(foreground)g(pro)s(cesses)h(are)g(allo)m(w)m(ed)150 | |
967625cd | 15219 | 2973 y(to)g(read)e(from)h(or,)h(if)f(the)g(user)f(so)i(sp)s(eci\014es)e |
6e51e0d0 | 15220 | (with)h Ft(stty)29 b(tostop)p Fu(,)23 b(write)g(to)g(the)h(terminal.)38 |
967625cd | 15221 | b(Bac)m(kground)150 3082 y(pro)s(cesses)27 b(whic)m(h)g(attempt)h(to)f |
6e51e0d0 | 15222 | (read)g(from)g(\(write)g(to)h(when)e Ft(stty)j(tostop)d |
967625cd | 15223 | Fu(is)h(in)f(e\013ect\))j(the)e(terminal)150 3192 y(are)32 |
6e51e0d0 | 15224 | b(sen)m(t)g(a)g Ft(SIGTTIN)e Fu(\()p Ft(SIGTTOU)p Fu(\))g(signal)i(b)m |
602bb739 | 15225 | (y)g(the)g(k)m(ernel's)g(terminal)g(driv)m(er,)g(whic)m(h,)g(unless)f |
967625cd CR |
15226 | (caugh)m(t,)150 3302 y(susp)s(ends)d(the)i(pro)s(cess.)275 |
15227 | 3433 y(If)k(the)i(op)s(erating)g(system)f(on)h(whic)m(h)f(Bash)g(is)h | |
602bb739 | 15228 | (running)d(supp)s(orts)h(job)h(con)m(trol,)j(Bash)e(con)m(tains)150 |
967625cd | 15229 | 3543 y(facilities)30 b(to)f(use)f(it.)40 b(T)m(yping)28 |
6e51e0d0 CR |
15230 | b(the)g Fr(susp)s(end)h Fu(c)m(haracter)h(\(t)m(ypically)g(`)p |
15231 | Ft(^Z)p Fu(',)f(Con)m(trol-Z\))g(while)f(a)g(pro)s(cess)150 | |
967625cd | 15232 | 3652 y(is)42 b(running)f(causes)i(that)g(pro)s(cess)f(to)h(b)s(e)f |
602bb739 | 15233 | (stopp)s(ed)f(and)h(returns)f(con)m(trol)j(to)f(Bash.)77 |
967625cd | 15234 | b(T)m(yping)42 b(the)150 3762 y Fr(dela)m(y)m(ed)k(susp)s(end)f |
6e51e0d0 | 15235 | Fu(c)m(haracter)h(\(t)m(ypically)g(`)p Ft(^Y)p Fu(',)i(Con)m(trol-Y\))e |
602bb739 | 15236 | (causes)e(the)h(pro)s(cess)e(to)i(b)s(e)f(stopp)s(ed)150 |
967625cd | 15237 | 3871 y(when)26 b(it)i(attempts)h(to)f(read)f(input)g(from)f(the)i |
602bb739 | 15238 | (terminal,)h(and)e(con)m(trol)h(to)g(b)s(e)f(returned)f(to)j(Bash.)39 |
967625cd | 15239 | b(The)150 3981 y(user)e(then)g(manipulates)h(the)g(state)h(of)f(this)f |
6e51e0d0 | 15240 | (job,)j(using)d(the)h Ft(bg)f Fu(command)g(to)h(con)m(tin)m(ue)h(it)f |
967625cd | 15241 | (in)g(the)150 4091 y(bac)m(kground,)g(the)f Ft(fg)g Fu(command)f(to)i |
602bb739 | 15242 | (con)m(tin)m(ue)g(it)f(in)f(the)h(foreground,)h(or)f(the)g |
967625cd | 15243 | Ft(kill)f Fu(command)g(to)150 4200 y(kill)27 b(it.)40 |
6e51e0d0 | 15244 | b(A)27 b(`)p Ft(^Z)p Fu(')g(tak)m(es)h(e\013ect)g(immediately)-8 |
602bb739 | 15245 | b(,)29 b(and)d(has)h(the)f(additional)i(side)e(e\013ect)j(of)d(causing) |
967625cd | 15246 | h(p)s(ending)150 4310 y(output)j(and)g(t)m(yp)s(eahead)h(to)g(b)s(e)e |
c302751c | 15247 | (discarded.)275 4441 y(There)j(are)g(a)h(n)m(um)m(b)s(er)e(of)i(w)m(a)m |
602bb739 | 15248 | (ys)g(to)h(refer)e(to)h(a)g(job)f(in)g(the)h(shell.)47 |
6e51e0d0 | 15249 | b(The)32 b(c)m(haracter)i(`)p Ft(\045)p Fu(')f(in)m(tro)s(duces)150 |
967625cd | 15250 | 4551 y(a)e(job)f(sp)s(eci\014cation)h(\()p Fr(jobsp)s(ec)6 |
6e51e0d0 CR |
15251 | b Fu(\).)275 4682 y(Job)31 b(n)m(um)m(b)s(er)f Ft(n)h |
15252 | Fu(ma)m(y)h(b)s(e)f(referred)g(to)h(as)g(`)p Ft(\045n)p | |
15253 | Fu('.)44 b(The)31 b(sym)m(b)s(ols)g(`)p Ft(\045\045)p | |
15254 | Fu(')h(and)f(`)p Ft(\045+)p Fu(')g(refer)h(to)g(the)g(shell's)150 | |
c302751c | 15255 | 4792 y(notion)k(of)f(the)g(curren)m(t)g(job,)h(whic)m(h)f(is)g(the)g |
eb2bb562 | 15256 | (last)h(job)f(stopp)s(ed)f(while)h(it)h(w)m(as)g(in)e(the)i(foreground) |
c302751c | 15257 | e(or)150 4902 y(started)27 b(in)g(the)g(bac)m(kground.)40 |
6e51e0d0 | 15258 | b(A)27 b(single)g(`)p Ft(\045)p Fu(')g(\(with)g(no)g(accompan)m(ying)i |
c302751c | 15259 | (job)d(sp)s(eci\014cation\))i(also)g(refers)150 5011 |
09767ff0 | 15260 | y(to)k(the)e(curren)m(t)h(job.)42 b(The)30 b(previous)g(job)h(ma)m(y)g |
6e51e0d0 | 15261 | (b)s(e)f(referenced)h(using)f(`)p Ft(\045-)p Fu('.)42 |
c302751c | 15262 | b(If)30 b(there)h(is)g(only)g(a)g(single)150 5121 y(job,)g(`)p |
6e51e0d0 | 15263 | Ft(\045+)p Fu(')g(and)f(`)p Ft(\045-)p Fu(')h(can)h(b)s(oth)e(b)s(e)g |
09767ff0 | 15264 | (used)h(to)g(refer)g(to)h(that)g(job.)42 b(In)30 b(output)h(p)s |
c302751c | 15265 | (ertaining)g(to)g(jobs)g(\(e.g.,)150 5230 y(the)39 b(output)f(of)g(the) |
6e51e0d0 CR |
15266 | h Ft(jobs)e Fu(command\),)k(the)d(curren)m(t)h(job)f(is)g(alw)m(a)m(ys) |
15267 | i(\015agged)f(with)f(a)h(`)p Ft(+)p Fu(',)i(and)d(the)150 | |
15268 | 5340 y(previous)30 b(job)g(with)g(a)h(`)p Ft(-)p Fu('.)p | |
c302751c | 15269 | eop end |
900a813b CR |
15270 | %%Page: 100 106 |
15271 | TeXDict begin 100 105 bop 150 -116 a Fu(Chapter)30 b(7:)41 | |
15272 | b(Job)30 b(Con)m(trol)2526 b(100)275 299 y(A)38 b(job)g(ma)m(y)h(also)g | |
ad4aef08 CR |
15273 | (b)s(e)f(referred)f(to)j(using)d(a)i(pre\014x)e(of)i(the)f(name)h(used) |
15274 | e(to)i(start)g(it,)i(or)e(using)f(a)150 408 y(substring)29 | |
c302751c | 15275 | b(that)i(app)s(ears)f(in)g(its)h(command)f(line.)41 b(F)-8 |
6e51e0d0 CR |
15276 | b(or)31 b(example,)g(`)p Ft(\045ce)p Fu(')f(refers)g(to)h(a)g(stopp)s |
15277 | (ed)e Ft(ce)h Fu(job.)150 518 y(Using)d(`)p Ft(\045?ce)p | |
15278 | Fu(',)g(on)f(the)h(other)g(hand,)g(refers)f(to)h(an)m(y)g(job)g(con)m | |
15279 | (taining)h(the)f(string)f(`)p Ft(ce)p Fu(')h(in)f(its)h(command)150 | |
c302751c CR |
15280 | 628 y(line.)41 b(If)30 b(the)h(pre\014x)e(or)h(substring)f(matc)m(hes)j |
15281 | (more)e(than)h(one)f(job,)h(Bash)f(rep)s(orts)g(an)g(error.)275 | |
967625cd | 15282 | 761 y(Simply)g(naming)h(a)g(job)g(can)g(b)s(e)f(used)h(to)g(bring)f(it) |
6e51e0d0 CR |
15283 | i(in)m(to)g(the)f(foreground:)41 b(`)p Ft(\0451)p Fu(')31 |
15284 | b(is)g(a)h(synon)m(ym)e(for)150 871 y(`)p Ft(fg)g(\0451)p | |
15285 | Fu(',)i(bringing)f(job)g(1)g(from)g(the)h(bac)m(kground)f(in)m(to)i | |
15286 | (the)e(foreground.)44 b(Similarly)-8 b(,)32 b(`)p Ft(\0451)e(&)p | |
967625cd CR |
15287 | Fu(')i(resumes)150 980 y(job)e(1)h(in)f(the)g(bac)m(kground,)h(equiv)-5 |
15288 | b(alen)m(t)32 b(to)f(`)p Ft(bg)f(\0451)p Fu(')275 1114 | |
c302751c | 15289 | y(The)g(shell)i(learns)f(immediately)i(whenev)m(er)e(a)h(job)f(c)m |
37c41ab1 | 15290 | (hanges)h(state.)45 b(Normally)-8 b(,)33 b(Bash)e(w)m(aits)i(un)m(til) |
967625cd | 15291 | 150 1223 y(it)25 b(is)g(ab)s(out)f(to)i(prin)m(t)e(a)h(prompt)f(b)s |
37c41ab1 | 15292 | (efore)g(rep)s(orting)h(c)m(hanges)g(in)g(a)g(job's)f(status)h(so)g(as) |
967625cd | 15293 | g(to)g(not)g(in)m(terrupt)150 1333 y(an)m(y)k(other)f(output.)40 |
6e51e0d0 CR |
15294 | b(If)28 b(the)g Ft(-b)g Fu(option)g(to)h(the)g Ft(set)e |
15295 | Fu(builtin)h(is)g(enabled,)h(Bash)g(rep)s(orts)e(suc)m(h)h(c)m(hanges) | |
15296 | 150 1443 y(immediately)d(\(see)g(Section)g(4.3.1)g([The)f(Set)g | |
fc527055 | 15297 | (Builtin],)i(page)f(59\).)40 b(An)m(y)24 b(trap)f(on)h |
967625cd CR |
15298 | Ft(SIGCHLD)e Fu(is)i(executed)150 1552 y(for)30 b(eac)m(h)i(c)m(hild)e |
15299 | (pro)s(cess)g(that)h(exits.)275 1686 y(If)25 b(an)h(attempt)h(to)g | |
d3ad40de | 15300 | (exit)g(Bash)f(is)h(made)f(while)g(jobs)f(are)i(stopp)s(ed,)f(\(or)h |
967625cd | 15301 | (running,)e(if)h(the)g Ft(checkjobs)150 1795 y Fu(option)e(is)f |
d3ad40de | 15302 | (enabled)h({)g(see)g(Section)g(4.3.2)h([The)e(Shopt)g(Builtin],)j(page) |
fc527055 | 15303 | e(63\),)i(the)e(shell)f(prin)m(ts)g(a)h(w)m(arning)150 |
967625cd | 15304 | 1905 y(message,)k(and)c(if)i(the)f Ft(checkjobs)e Fu(option)j(is)f |
d3ad40de | 15305 | (enabled,)i(lists)e(the)h(jobs)f(and)f(their)i(statuses.)39 |
967625cd | 15306 | b(The)25 b Ft(jobs)150 2014 y Fu(command)36 b(ma)m(y)h(then)f(b)s(e)f |
d3ad40de | 15307 | (used)g(to)i(insp)s(ect)f(their)g(status.)59 b(If)36 |
967625cd | 15308 | b(a)g(second)g(attempt)i(to)f(exit)g(is)f(made)150 2124 |
d3ad40de CR |
15309 | y(without)e(an)f(in)m(terv)m(ening)i(command,)f(Bash)g(do)s(es)f(not)h |
15310 | (prin)m(t)g(another)f(w)m(arning,)i(and)e(an)m(y)h(stopp)s(ed)150 | |
967625cd CR |
15311 | 2234 y(jobs)c(are)h(terminated.)150 2472 y Fs(7.2)68 |
15312 | b(Job)45 b(Con)l(trol)h(Builtins)150 2656 y Ft(bg)870 | |
15313 | 2789 y(bg)h([)p Fj(jobspec)f Ft(...)o(])630 2923 y Fu(Resume)24 | |
6e51e0d0 CR |
15314 | b(eac)m(h)h(susp)s(ended)d(job)i Fr(jobsp)s(ec)29 b Fu(in)24 |
15315 | b(the)g(bac)m(kground,)h(as)g(if)f(it)h(had)e(b)s(een)g(started)630 | |
967625cd | 15316 | 3032 y(with)32 b(`)p Ft(&)p Fu('.)45 b(If)31 b Fr(jobsp)s(ec)37 |
6e51e0d0 | 15317 | b Fu(is)32 b(not)g(supplied,)f(the)h(curren)m(t)g(job)f(is)h(used.)45 |
967625cd | 15318 | b(The)31 b(return)g(status)630 3142 y(is)i(zero)g(unless)f(it)h(is)g |
6e51e0d0 | 15319 | (run)e(when)h(job)g(con)m(trol)i(is)f(not)g(enabled,)h(or,)f(when)f |
967625cd | 15320 | (run)f(with)h(job)630 3252 y(con)m(trol)h(enabled,)g(an)m(y)f |
6e51e0d0 | 15321 | Fr(jobsp)s(ec)37 b Fu(w)m(as)32 b(not)g(found)f(or)g(sp)s(eci\014es)h |
967625cd CR |
15322 | (a)g(job)g(that)g(w)m(as)g(started)630 3361 y(without)e(job)g(con)m |
15323 | (trol.)150 3519 y Ft(fg)870 3652 y(fg)47 b([)p Fj(jobspec)p | |
15324 | Ft(])630 3786 y Fu(Resume)c(the)g(job)g Fr(jobsp)s(ec)48 | |
6e51e0d0 | 15325 | b Fu(in)43 b(the)g(foreground)g(and)f(mak)m(e)j(it)e(the)h(curren)m(t)f |
967625cd | 15326 | (job.)78 b(If)630 3895 y Fr(jobsp)s(ec)41 b Fu(is)c(not)f(supplied,)h |
37c41ab1 | 15327 | (the)f(curren)m(t)h(job)f(is)g(used.)58 b(The)36 b(return)f(status)h |
967625cd | 15328 | (is)h(that)g(of)630 4005 y(the)d(command)g(placed)h(in)m(to)g(the)f |
37c41ab1 | 15329 | (foreground,)g(or)g(non-zero)h(if)f(run)f(when)g(job)g(con)m(trol)630 |
967625cd | 15330 | 4114 y(is)i(disabled)g(or,)i(when)d(run)g(with)h(job)g(con)m(trol)h |
6e51e0d0 | 15331 | (enabled,)h Fr(jobsp)s(ec)j Fu(do)s(es)35 b(not)h(sp)s(ecify)f(a)630 |
967625cd | 15332 | 4224 y(v)-5 b(alid)31 b(job)f(or)g Fr(jobsp)s(ec)35 b |
6e51e0d0 | 15333 | Fu(sp)s(eci\014es)30 b(a)h(job)f(that)h(w)m(as)g(started)g(without)f |
967625cd CR |
15334 | (job)g(con)m(trol.)150 4381 y Ft(jobs)870 4515 y(jobs)47 |
15335 | b([-lnprs])e([)p Fj(jobspec)p Ft(])870 4625 y(jobs)i(-x)g | |
15336 | Fj(command)f Ft([)p Fj(arguments)p Ft(])630 4758 y Fu(The)30 | |
6e51e0d0 | 15337 | b(\014rst)f(form)h(lists)h(the)g(activ)m(e)h(jobs.)41 |
37c41ab1 | 15338 | b(The)30 b(options)g(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
967625cd | 15339 | 4916 y Ft(-l)384 b Fu(List)31 b(pro)s(cess)f Fm(id)p |
6e51e0d0 | 15340 | Fu(s)g(in)g(addition)h(to)g(the)f(normal)h(information.)630 |
967625cd | 15341 | 5073 y Ft(-n)384 b Fu(Displa)m(y)26 b(information)f(only)h(ab)s(out)e |
c302751c | 15342 | (jobs)h(that)g(ha)m(v)m(e)i(c)m(hanged)e(status)h(since)1110 |
967625cd | 15343 | 5183 y(the)31 b(user)e(w)m(as)i(last)g(noti\014ed)f(of)h(their)f |
6e51e0d0 CR |
15344 | (status.)630 5340 y Ft(-p)384 b Fu(List)31 b(only)f(the)h(pro)s(cess)f |
15345 | Fm(id)g Fu(of)h(the)f(job's)g(pro)s(cess)g(group)g(leader.)p | |
602bb739 | 15346 | eop end |
900a813b CR |
15347 | %%Page: 101 107 |
15348 | TeXDict begin 101 106 bop 150 -116 a Fu(Chapter)30 b(7:)41 | |
15349 | b(Job)30 b(Con)m(trol)2526 b(101)630 299 y Ft(-r)384 | |
d7935593 CR |
15350 | b Fu(Displa)m(y)32 b(only)e(running)f(jobs.)630 461 y |
15351 | Ft(-s)384 b Fu(Displa)m(y)32 b(only)e(stopp)s(ed)f(jobs.)630 | |
15352 | 622 y(If)23 b Fr(jobsp)s(ec)28 b Fu(is)23 b(giv)m(en,)i(output)e(is)g | |
6e51e0d0 CR |
15353 | (restricted)h(to)g(information)f(ab)s(out)g(that)h(job.)37 |
15354 | b(If)23 b Fr(jobsp)s(ec)630 732 y Fu(is)30 b(not)h(supplied,)e(the)i | |
15355 | (status)g(of)f(all)h(jobs)f(is)h(listed.)630 868 y(If)k(the)g | |
15356 | Ft(-x)f Fu(option)i(is)f(supplied,)g Ft(jobs)f Fu(replaces)i(an)m(y)f | |
15357 | Fr(jobsp)s(ec)40 b Fu(found)34 b(in)h Fr(command)j Fu(or)630 | |
15358 | 977 y Fr(argumen)m(ts)j Fu(with)c(the)h(corresp)s(onding)e(pro)s(cess)h | |
15359 | (group)f Fm(id)p Fu(,)k(and)c(executes)j Fr(command)p | |
15360 | Fu(,)630 1087 y(passing)30 b(it)h Fr(argumen)m(t)r Fu(s,)g(returning)f | |
15361 | (its)g(exit)i(status.)150 1249 y Ft(kill)870 1384 y(kill)47 | |
15362 | b([-s)g Fj(sigspec)p Ft(])e([-n)i Fj(signum)p Ft(])f([-)p | |
15363 | Fj(sigspec)p Ft(])f Fj(jobspec)h Ft(or)h Fj(pid)870 1494 | |
900a813b CR |
15364 | y Ft(kill)g(-l|-L)f([)p Fj(exit_status)p Ft(])630 1630 |
15365 | y Fu(Send)22 b(a)i(signal)g(sp)s(eci\014ed)f(b)m(y)g | |
15366 | Fr(sigsp)s(ec)29 b Fu(or)24 b Fr(sign)m(um)f Fu(to)h(the)g(pro)s(cess)f | |
15367 | (named)g(b)m(y)g(job)g(sp)s(eci\014-)630 1739 y(cation)k | |
15368 | Fr(jobsp)s(ec)j Fu(or)25 b(pro)s(cess)g Fm(id)h Fr(pid)p | |
15369 | Fu(.)38 b Fr(sigsp)s(ec)31 b Fu(is)25 b(either)h(a)g(case-insensitiv)m | |
15370 | (e)i(signal)e(name)630 1849 y(suc)m(h)37 b(as)g Ft(SIGINT)f | |
15371 | Fu(\(with)h(or)g(without)g(the)g Ft(SIG)g Fu(pre\014x\))f(or)h(a)h | |
15372 | (signal)g(n)m(um)m(b)s(er;)h Fr(sign)m(um)630 1958 y | |
15373 | Fu(is)g(a)f(signal)i(n)m(um)m(b)s(er.)63 b(If)39 b Fr(sigsp)s(ec)44 | |
15374 | b Fu(and)38 b Fr(sign)m(um)g Fu(are)h(not)g(presen)m(t,)h | |
15375 | Ft(SIGTERM)d Fu(is)h(used.)630 2068 y(The)27 b Ft(-l)h | |
15376 | Fu(option)g(lists)h(the)f(signal)h(names.)39 b(If)28 | |
15377 | b(an)m(y)g(argumen)m(ts)h(are)f(supplied)f(when)g Ft(-l)g | |
15378 | Fu(is)630 2178 y(giv)m(en,)32 b(the)g(names)e(of)i(the)f(signals)g | |
15379 | (corresp)s(onding)f(to)i(the)f(argumen)m(ts)g(are)h(listed,)g(and)630 | |
15380 | 2287 y(the)c(return)f(status)h(is)g(zero.)41 b Fr(exit)p | |
15381 | 1796 2287 28 4 v 41 w(status)32 b Fu(is)c(a)g(n)m(um)m(b)s(er)f(sp)s | |
15382 | (ecifying)g(a)i(signal)f(n)m(um)m(b)s(er)f(or)630 2397 | |
15383 | y(the)h(exit)h(status)g(of)f(a)h(pro)s(cess)e(terminated)i(b)m(y)f(a)h | |
15384 | (signal.)40 b(The)28 b Ft(-L)g Fu(option)g(is)g(equiv)-5 | |
15385 | b(alen)m(t)630 2506 y(to)34 b Ft(-l)p Fu(.)47 b(The)32 | |
15386 | b(return)g(status)h(is)g(zero)g(if)g(at)g(least)h(one)f(signal)h(w)m | |
15387 | (as)f(successfully)g(sen)m(t,)h(or)630 2616 y(non-zero)d(if)f(an)h | |
15388 | (error)f(o)s(ccurs)g(or)g(an)g(in)m(v)-5 b(alid)31 b(option)g(is)f | |
15389 | (encoun)m(tered.)150 2778 y Ft(wait)870 2913 y(wait)47 | |
15390 | b([-n])f([)p Fj(jobspec)g Ft(or)h Fj(pid)g Ft(...)o(])630 | |
15391 | 3049 y Fu(W)-8 b(ait)28 b(un)m(til)f(the)f(c)m(hild)h(pro)s(cess)f(sp)s | |
15392 | (eci\014ed)g(b)m(y)g(eac)m(h)h(pro)s(cess)f Fm(id)h Fr(pid)i | |
15393 | Fu(or)d(job)g(sp)s(eci\014cation)630 3159 y Fr(jobsp)s(ec)j | |
15394 | Fu(exits)c(and)f(return)g(the)g(exit)h(status)g(of)g(the)f(last)h | |
15395 | (command)g(w)m(aited)g(for.)39 b(If)23 b(a)i(job)630 | |
15396 | 3268 y(sp)s(ec)j(is)g(giv)m(en,)i(all)f(pro)s(cesses)f(in)g(the)g(job)g | |
15397 | (are)h(w)m(aited)g(for.)40 b(If)27 b(no)i(argumen)m(ts)f(are)h(giv)m | |
15398 | (en,)630 3378 y(all)f(curren)m(tly)g(activ)m(e)i(c)m(hild)e(pro)s | |
15399 | (cesses)f(are)h(w)m(aited)g(for,)g(and)f(the)h(return)e(status)i(is)g | |
15400 | (zero.)630 3487 y(If)f(the)g Ft(-n)g Fu(option)h(is)f(supplied,)g | |
6e51e0d0 CR |
15401 | Ft(wait)f Fu(w)m(aits)i(for)f(an)m(y)h(job)f(to)h(terminate)g(and)f |
15402 | (returns)f(its)630 3597 y(exit)37 b(status.)56 b(If)36 | |
15403 | b(neither)f Fr(jobsp)s(ec)41 b Fu(nor)35 b Fr(pid)j Fu(sp)s(eci\014es)d | |
15404 | (an)h(activ)m(e)i(c)m(hild)e(pro)s(cess)f(of)h(the)630 | |
15405 | 3707 y(shell,)31 b(the)f(return)g(status)g(is)h(127.)150 | |
15406 | 3868 y Ft(disown)870 4004 y(disown)46 b([-ar])g([-h])h([)p | |
967625cd CR |
15407 | Fj(jobspec)f Ft(...)h(|)g Fj(pid)g Ft(...)g(])630 4140 |
15408 | y Fu(Without)33 b(options,)h(remo)m(v)m(e)g(eac)m(h)f | |
15409 | Fr(jobsp)s(ec)38 b Fu(from)32 b(the)h(table)g(of)g(activ)m(e)h(jobs.)47 | |
15410 | b(If)32 b(the)h Ft(-h)630 4249 y Fu(option)j(is)f(giv)m(en,)i(the)f | |
15411 | (job)f(is)g(not)g(remo)m(v)m(ed)h(from)f(the)g(table,)j(but)c(is)i | |
15412 | (mark)m(ed)f(so)g(that)630 4359 y Ft(SIGHUP)e Fu(is)j(not)f(sen)m(t)h | |
15413 | (to)g(the)f(job)g(if)g(the)g(shell)h(receiv)m(es)h(a)e | |
15414 | Ft(SIGHUP)p Fu(.)54 b(If)34 b Fr(jobsp)s(ec)40 b Fu(is)c(not)630 | |
15415 | 4468 y(presen)m(t,)41 b(and)d(neither)h(the)g Ft(-a)f | |
15416 | Fu(nor)g(the)h Ft(-r)f Fu(option)h(is)g(supplied,)g(the)g(curren)m(t)g | |
15417 | (job)f(is)630 4578 y(used.)g(If)25 b(no)h Fr(jobsp)s(ec)k | |
15418 | Fu(is)c(supplied,)f(the)h Ft(-a)f Fu(option)h(means)g(to)g(remo)m(v)m | |
15419 | (e)h(or)e(mark)h(all)g(jobs;)630 4688 y(the)31 b Ft(-r)e | |
15420 | Fu(option)i(without)g(a)f Fr(jobsp)s(ec)36 b Fu(argumen)m(t)30 | |
15421 | b(restricts)h(op)s(eration)g(to)g(running)e(jobs.)150 | |
15422 | 4849 y Ft(suspend)870 4985 y(suspend)46 b([-f])630 5121 | |
15423 | y Fu(Susp)s(end)31 b(the)i(execution)h(of)g(this)f(shell)g(un)m(til)h | |
15424 | (it)g(receiv)m(es)h(a)e Ft(SIGCONT)f Fu(signal.)50 b(A)33 | |
15425 | b(login)630 5230 y(shell)28 b(cannot)g(b)s(e)f(susp)s(ended;)g(the)g | |
15426 | Ft(-f)g Fu(option)i(can)f(b)s(e)f(used)g(to)h(o)m(v)m(erride)h(this)e | |
15427 | (and)g(force)630 5340 y(the)k(susp)s(ension.)p eop end | |
900a813b CR |
15428 | %%Page: 102 108 |
15429 | TeXDict begin 102 107 bop 150 -116 a Fu(Chapter)30 b(7:)41 | |
15430 | b(Job)30 b(Con)m(trol)2526 b(102)275 299 y(When)30 b(job)f(con)m(trol)j | |
6e51e0d0 CR |
15431 | (is)e(not)h(activ)m(e,)i(the)d Ft(kill)f Fu(and)h Ft(wait)f |
15432 | Fu(builtins)g(do)h(not)h(accept)h Fr(jobsp)s(ec)j Fu(argu-)150 | |
ad4aef08 | 15433 | 408 y(men)m(ts.)41 b(They)30 b(m)m(ust)g(b)s(e)g(supplied)f(pro)s(cess) |
967625cd CR |
15434 | h Fm(id)p Fu(s.)150 649 y Fs(7.3)68 b(Job)45 b(Con)l(trol)h(V)-11 |
15435 | b(ariables)150 834 y Ft(auto_resume)630 943 y Fu(This)31 | |
ad4aef08 CR |
15436 | b(v)-5 b(ariable)32 b(con)m(trols)g(ho)m(w)g(the)f(shell)h(in)m |
15437 | (teracts)h(with)e(the)h(user)e(and)h(job)g(con)m(trol.)45 | |
967625cd | 15438 | b(If)630 1053 y(this)28 b(v)-5 b(ariable)30 b(exists)f(then)f(single)h |
c302751c | 15439 | (w)m(ord)f(simple)h(commands)f(without)g(redirections)i(are)630 |
967625cd | 15440 | 1162 y(treated)h(as)g(candidates)f(for)g(resumption)g(of)g(an)g |
c302751c | 15441 | (existing)h(job.)41 b(There)29 b(is)h(no)h(am)m(biguit)m(y)630 |
967625cd | 15442 | 1272 y(allo)m(w)m(ed;)f(if)d(there)g(is)g(more)g(than)f(one)h(job)g(b)s |
c302751c | 15443 | (eginning)f(with)g(the)h(string)g(t)m(yp)s(ed,)g(then)g(the)630 |
967625cd | 15444 | 1381 y(most)j(recen)m(tly)h(accessed)f(job)f(will)h(b)s(e)f(selected.) |
c302751c | 15445 | 42 b(The)29 b(name)g(of)h(a)g(stopp)s(ed)e(job,)i(in)f(this)630 |
967625cd | 15446 | 1491 y(con)m(text,)h(is)e(the)g(command)g(line)g(used)f(to)h(start)g |
c302751c | 15447 | (it.)41 b(If)27 b(this)h(v)-5 b(ariable)28 b(is)g(set)g(to)h(the)e(v)-5 |
967625cd | 15448 | b(alue)630 1601 y(`)p Ft(exact)p Fu(',)33 b(the)g(string)g(supplied)f |
37c41ab1 | 15449 | (m)m(ust)h(matc)m(h)g(the)h(name)f(of)g(a)g(stopp)s(ed)f(job)h |
967625cd | 15450 | (exactly;)j(if)630 1710 y(set)29 b(to)h(`)p Ft(substring)p |
6e51e0d0 | 15451 | Fu(',)d(the)i(string)g(supplied)e(needs)i(to)g(matc)m(h)h(a)f |
967625cd | 15452 | (substring)f(of)h(the)g(name)630 1820 y(of)38 b(a)f(stopp)s(ed)g(job.) |
6e51e0d0 | 15453 | 62 b(The)37 b(`)p Ft(substring)p Fu(')e(v)-5 b(alue)38 |
37c41ab1 | 15454 | b(pro)m(vides)f(functionalit)m(y)i(analogous)g(to)630 |
967625cd | 15455 | 1929 y(the)f(`)p Ft(\045?)p Fu(')f(job)h Fm(id)f Fu(\(see)i(Section)f |
900a813b | 15456 | (7.1)h([Job)f(Con)m(trol)g(Basics],)j(page)d(99\).)64 |
967625cd | 15457 | b(If)37 b(set)h(to)h(an)m(y)630 2039 y(other)32 b(v)-5 |
37c41ab1 | 15458 | b(alue,)32 b(the)g(supplied)e(string)i(m)m(ust)f(b)s(e)g(a)h(pre\014x)f |
967625cd | 15459 | (of)h(a)g(stopp)s(ed)e(job's)i(name;)g(this)630 2149 |
37c41ab1 | 15460 | y(pro)m(vides)e(functionalit)m(y)i(analogous)g(to)f(the)g(`)p |
6e51e0d0 | 15461 | Ft(\045)p Fu(')f(job)g Fm(id)p Fu(.)p eop end |
900a813b | 15462 | %%Page: 103 109 |
037a8b7f CR |
15463 | TeXDict begin 103 108 bop 3614 -116 a Fu(103)150 299 |
15464 | y Fp(8)80 b(Command)54 b(Line)f(Editing)150 635 y Fu(This)28 | |
15465 | b(c)m(hapter)i(describ)s(es)e(the)h(basic)g(features)h(of)f(the)g | |
15466 | Fm(gnu)f Fu(command)h(line)g(editing)h(in)m(terface.)42 | |
15467 | b(Com-)150 745 y(mand)c(line)i(editing)f(is)g(pro)m(vided)g(b)m(y)g | |
15468 | (the)g(Readline)h(library)-8 b(,)41 b(whic)m(h)e(is)g(used)f(b)m(y)h | |
15469 | (sev)m(eral)h(di\013eren)m(t)150 855 y(programs,)34 b(including)e | |
15470 | (Bash.)49 b(Command)32 b(line)i(editing)f(is)g(enabled)g(b)m(y)g | |
15471 | (default)g(when)f(using)h(an)g(in-)150 964 y(teractiv)m(e)h(shell,)d | |
15472 | (unless)g(the)g Ft(--noediting)d Fu(option)k(is)f(supplied)e(at)j | |
15473 | (shell)f(in)m(v)m(o)s(cation.)45 b(Line)31 b(editing)150 | |
15474 | 1074 y(is)g(also)h(used)f(when)f(using)h(the)g Ft(-e)g | |
15475 | Fu(option)h(to)g(the)f Ft(read)f Fu(builtin)h(command)g(\(see)h | |
15476 | (Section)g(4.2)h([Bash)150 1183 y(Builtins],)j(page)f(48\).)52 | |
15477 | b(By)35 b(default,)g(the)f(line)h(editing)f(commands)g(are)h(similar)f | |
15478 | (to)h(those)f(of)g(Emacs.)150 1293 y(A)h(vi-st)m(yle)h(line)f(editing)g | |
15479 | (in)m(terface)h(is)e(also)i(a)m(v)-5 b(ailable.)55 b(Line)34 | |
15480 | b(editing)h(can)g(b)s(e)f(enabled)g(at)h(an)m(y)g(time)150 | |
15481 | 1402 y(using)h(the)g Ft(-o)30 b(emacs)35 b Fu(or)h Ft(-o)30 | |
15482 | b(vi)35 b Fu(options)i(to)g(the)f Ft(set)f Fu(builtin)h(command)g | |
15483 | (\(see)h(Section)g(4.3.1)h([The)150 1512 y(Set)31 b(Builtin],)g(page)g | |
15484 | (59\),)h(or)e(disabled)g(using)g(the)h Ft(+o)e(emacs)g | |
15485 | Fu(or)i Ft(+o)e(vi)h Fu(options)h(to)g Ft(set)p Fu(.)150 | |
15486 | 1804 y Fs(8.1)68 b(In)l(tro)t(duction)45 b(to)g(Line)h(Editing)150 | |
15487 | 1963 y Fu(The)30 b(follo)m(wing)i(paragraphs)d(describ)s(e)h(the)h | |
15488 | (notation)g(used)f(to)h(represen)m(t)f(k)m(eystrok)m(es.)275 | |
15489 | 2132 y(The)35 b(text)i Fj(C-k)f Fu(is)g(read)g(as)h(`Con)m(trol-K')g | |
15490 | (and)f(describ)s(es)f(the)h(c)m(haracter)i(pro)s(duced)d(when)g(the)h | |
15491 | Ft(k)150 2242 y Fu(k)m(ey)31 b(is)g(pressed)e(while)h(the)h(Con)m(trol) | |
15492 | g(k)m(ey)g(is)g(depressed.)275 2410 y(The)g(text)i Fj(M-k)e | |
15493 | Fu(is)h(read)f(as)i(`Meta-K')g(and)f(describ)s(es)f(the)h(c)m(haracter) | |
15494 | h(pro)s(duced)e(when)f(the)i(Meta)150 2520 y(k)m(ey)i(\(if)f(y)m(ou)h | |
15495 | (ha)m(v)m(e)g(one\))g(is)f(depressed,)g(and)f(the)h Ft(k)g | |
15496 | Fu(k)m(ey)h(is)f(pressed.)48 b(The)32 b(Meta)j(k)m(ey)e(is)h(lab)s | |
15497 | (eled)f Ft(ALT)150 2629 y Fu(on)c(man)m(y)h(k)m(eyb)s(oards.)40 | |
15498 | b(On)29 b(k)m(eyb)s(oards)g(with)h(t)m(w)m(o)h(k)m(eys)f(lab)s(eled)g | |
6e51e0d0 | 15499 | Ft(ALT)e Fu(\(usually)i(to)g(either)g(side)g(of)g(the)150 |
967625cd | 15500 | 2739 y(space)h(bar\),)f(the)g Ft(ALT)f Fu(on)h(the)g(left)h(side)f(is)g |
c302751c | 15501 | (generally)h(set)f(to)h(w)m(ork)f(as)g(a)h(Meta)g(k)m(ey)-8 |
967625cd | 15502 | b(.)42 b(The)29 b Ft(ALT)g Fu(k)m(ey)i(on)150 2849 y(the)c(righ)m(t)h |
c302751c CR |
15503 | (ma)m(y)g(also)g(b)s(e)f(con\014gured)f(to)i(w)m(ork)f(as)h(a)f(Meta)i |
15504 | (k)m(ey)f(or)f(ma)m(y)h(b)s(e)e(con\014gured)h(as)g(some)h(other)150 | |
967625cd CR |
15505 | 2958 y(mo)s(di\014er,)i(suc)m(h)g(as)g(a)h(Comp)s(ose)f(k)m(ey)h(for)f |
15506 | (t)m(yping)h(accen)m(ted)h(c)m(haracters.)275 3127 y(If)23 | |
6e51e0d0 CR |
15507 | b(y)m(ou)i(do)f(not)h(ha)m(v)m(e)h(a)f(Meta)g(or)g Ft(ALT)e |
15508 | Fu(k)m(ey)-8 b(,)27 b(or)e(another)f(k)m(ey)i(w)m(orking)e(as)h(a)g | |
967625cd | 15509 | (Meta)h(k)m(ey)-8 b(,)27 b(the)d(iden)m(tical)150 3236 |
c302751c | 15510 | y(k)m(eystrok)m(e)30 b(can)f(b)s(e)f(generated)h(b)m(y)g(t)m(yping)g |
6e51e0d0 CR |
15511 | Ft(ESC)e Fl(\014rst)p Fu(,)j(and)e(then)g(t)m(yping)h |
15512 | Ft(k)p Fu(.)40 b(Either)28 b(pro)s(cess)g(is)g(kno)m(wn)150 | |
967625cd CR |
15513 | 3346 y(as)j Fr(metafying)39 b Fu(the)30 b Ft(k)g Fu(k)m(ey)-8 |
15514 | b(.)275 3515 y(The)39 b(text)j Fj(M-C-k)d Fu(is)h(read)g(as)h | |
c302751c | 15515 | (`Meta-Con)m(trol-k')j(and)39 b(describ)s(es)h(the)g(c)m(haracter)i |
967625cd CR |
15516 | (pro)s(duced)d(b)m(y)150 3624 y Fr(metafying)g Fj(C-k)p |
15517 | Fu(.)275 3793 y(In)c(addition,)j(sev)m(eral)f(k)m(eys)g(ha)m(v)m(e)g | |
c302751c | 15518 | (their)f(o)m(wn)g(names.)58 b(Sp)s(eci\014cally)-8 b(,)38 |
6e51e0d0 | 15519 | b Ft(DEL)p Fu(,)f Ft(ESC)p Fu(,)g Ft(LFD)p Fu(,)g Ft(SPC)p |
967625cd | 15520 | Fu(,)g Ft(RET)p Fu(,)150 3902 y(and)d Ft(TAB)f Fu(all)j(stand)e(for)g |
c302751c | 15521 | (themselv)m(es)i(when)d(seen)i(in)f(this)g(text,)j(or)d(in)h(an)f(init) |
967625cd | 15522 | h(\014le)f(\(see)i(Section)f(8.3)150 4012 y([Readline)f(Init)g(File],)i |
900a813b | 15523 | (page)e(106\).)52 b(If)33 b(y)m(our)g(k)m(eyb)s(oard)h(lac)m(ks)g(a)g |
6e51e0d0 | 15524 | Ft(LFD)f Fu(k)m(ey)-8 b(,)36 b(t)m(yping)e Ft(C-j)e Fu(will)i(pro)s |
967625cd | 15525 | (duce)150 4122 y(the)d(desired)e(c)m(haracter.)43 b(The)30 |
6e51e0d0 CR |
15526 | b Ft(RET)f Fu(k)m(ey)i(ma)m(y)g(b)s(e)f(lab)s(eled)h |
15527 | Ft(Return)d Fu(or)j Ft(Enter)d Fu(on)j(some)g(k)m(eyb)s(oards.)150 | |
15528 | 4413 y Fs(8.2)68 b(Readline)47 b(In)l(teraction)150 4573 | |
15529 | y Fu(Often)32 b(during)g(an)g(in)m(teractiv)m(e)j(session)e(y)m(ou)g(t) | |
c302751c CR |
15530 | m(yp)s(e)g(in)f(a)h(long)g(line)g(of)f(text,)j(only)d(to)i(notice)g |
15531 | (that)f(the)150 4682 y(\014rst)f(w)m(ord)g(on)g(the)g(line)h(is)g | |
37c41ab1 | 15532 | (missp)s(elled.)46 b(The)32 b(Readline)h(library)f(giv)m(es)h(y)m(ou)g |
a9fac3b2 | 15533 | (a)g(set)g(of)f(commands)g(for)150 4792 y(manipulating)e(the)g(text)h |
37c41ab1 CR |
15534 | (as)f(y)m(ou)g(t)m(yp)s(e)g(it)g(in,)g(allo)m(wing)h(y)m(ou)f(to)h |
15535 | (just)e(\014x)g(y)m(our)h(t)m(yp)s(o,)g(and)g(not)g(forcing)150 | |
a9fac3b2 | 15536 | 4902 y(y)m(ou)e(to)h(ret)m(yp)s(e)g(the)f(ma)5 b(jorit)m(y)29 |
37c41ab1 | 15537 | b(of)f(the)h(line.)40 b(Using)28 b(these)h(editing)g(commands,)f(y)m |
a9fac3b2 | 15538 | (ou)h(mo)m(v)m(e)g(the)g(cursor)150 5011 y(to)35 b(the)f(place)i(that)e |
37c41ab1 | 15539 | (needs)g(correction,)j(and)d(delete)h(or)f(insert)h(the)f(text)h(of)g |
c302751c CR |
15540 | (the)f(corrections.)54 b(Then,)150 5121 y(when)24 b(y)m(ou)h(are)g |
15541 | (satis\014ed)g(with)g(the)g(line,)i(y)m(ou)e(simply)f(press)g | |
6e51e0d0 | 15542 | Ft(RET)p Fu(.)39 b(Y)-8 b(ou)25 b(do)g(not)g(ha)m(v)m(e)h(to)g(b)s(e)e |
c302751c | 15543 | (at)h(the)h(end)150 5230 y(of)33 b(the)h(line)g(to)g(press)e |
6e51e0d0 | 15544 | Ft(RET)p Fu(;)i(the)g(en)m(tire)g(line)f(is)h(accepted)g(regardless)g |
c302751c CR |
15545 | (of)f(the)h(lo)s(cation)h(of)e(the)h(cursor)150 5340 |
15546 | y(within)c(the)g(line.)p eop end | |
900a813b CR |
15547 | %%Page: 104 110 |
15548 | TeXDict begin 104 109 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
15549 | b(Command)29 b(Line)i(Editing)2062 b(104)150 299 y Fk(8.2.1)63 | |
6e51e0d0 | 15550 | b(Readline)40 b(Bare)h(Essen)m(tials)150 446 y Fu(In)31 |
ad4aef08 CR |
15551 | b(order)h(to)h(en)m(ter)g(c)m(haracters)g(in)m(to)g(the)g(line,)g |
15552 | (simply)e(t)m(yp)s(e)i(them.)46 b(The)31 b(t)m(yp)s(ed)h(c)m(haracter)i | |
15553 | (app)s(ears)150 555 y(where)e(the)h(cursor)e(w)m(as,)j(and)e(then)g | |
15554 | (the)h(cursor)e(mo)m(v)m(es)j(one)f(space)g(to)g(the)g(righ)m(t.)47 | |
15555 | b(If)32 b(y)m(ou)h(mist)m(yp)s(e)g(a)150 665 y(c)m(haracter,)f(y)m(ou)f | |
15556 | (can)g(use)f(y)m(our)g(erase)h(c)m(haracter)h(to)f(bac)m(k)g(up)f(and)f | |
c302751c | 15557 | (delete)j(the)f(mist)m(yp)s(ed)e(c)m(haracter.)275 806 |
a9fac3b2 CR |
15558 | y(Sometimes)i(y)m(ou)g(ma)m(y)h(mist)m(yp)s(e)e(a)i(c)m(haracter,)g |
15559 | (and)e(not)i(notice)g(the)f(error)f(un)m(til)h(y)m(ou)g(ha)m(v)m(e)h(t) | |
c302751c | 15560 | m(yp)s(ed)150 916 y(sev)m(eral)e(other)f(c)m(haracters.)42 |
a9fac3b2 | 15561 | b(In)28 b(that)i(case,)g(y)m(ou)f(can)g(t)m(yp)s(e)h |
6e51e0d0 | 15562 | Fj(C-b)d Fu(to)j(mo)m(v)m(e)g(the)f(cursor)g(to)g(the)g(left,)i(and)150 |
c302751c | 15563 | 1026 y(then)f(correct)i(y)m(our)e(mistak)m(e.)42 b(Afterw)m(ards,)31 |
37c41ab1 | 15564 | b(y)m(ou)f(can)h(mo)m(v)m(e)h(the)e(cursor)g(to)h(the)g(righ)m(t)g |
6e51e0d0 | 15565 | (with)f Fj(C-f)p Fu(.)275 1167 y(When)i(y)m(ou)h(add)f(text)h(in)f(the) |
a9fac3b2 | 15566 | h(middle)f(of)h(a)g(line,)h(y)m(ou)e(will)h(notice)h(that)f(c)m |
c302751c | 15567 | (haracters)h(to)g(the)e(righ)m(t)150 1277 y(of)d(the)g(cursor)f(are)h |
5e13499c | 15568 | (`pushed)e(o)m(v)m(er')j(to)g(mak)m(e)f(ro)s(om)g(for)f(the)h(text)h |
37c41ab1 | 15569 | (that)f(y)m(ou)g(ha)m(v)m(e)h(inserted.)40 b(Lik)m(ewise,)150 |
c302751c | 15570 | 1386 y(when)d(y)m(ou)g(delete)i(text)g(b)s(ehind)c(the)j(cursor,)h(c)m |
37c41ab1 | 15571 | (haracters)g(to)f(the)g(righ)m(t)g(of)g(the)g(cursor)e(are)i(`pulled) |
c302751c | 15572 | 150 1496 y(bac)m(k')24 b(to)f(\014ll)g(in)f(the)h(blank)f(space)i |
37c41ab1 | 15573 | (created)f(b)m(y)g(the)g(remo)m(v)-5 b(al)24 b(of)f(the)g(text.)39 |
c302751c | 15574 | b(A)23 b(list)g(of)g(the)g(bare)f(essen)m(tials)150 1605 |
37c41ab1 | 15575 | y(for)30 b(editing)h(the)g(text)g(of)g(an)f(input)f(line)i(follo)m(ws.) |
6e51e0d0 CR |
15576 | 150 1775 y Fj(C-b)336 b Fu(Mo)m(v)m(e)32 b(bac)m(k)g(one)e(c)m |
15577 | (haracter.)150 1941 y Fj(C-f)336 b Fu(Mo)m(v)m(e)32 b(forw)m(ard)e(one) | |
15578 | h(c)m(haracter.)150 2108 y Ft(DEL)e Fu(or)i Ft(Backspace)630 | |
15579 | 2217 y Fu(Delete)i(the)d(c)m(haracter)i(to)f(the)g(left)g(of)f(the)h | |
15580 | (cursor.)150 2384 y Fj(C-d)336 b Fu(Delete)33 b(the)d(c)m(haracter)i | |
c302751c CR |
15581 | (underneath)d(the)i(cursor.)150 2550 y(Prin)m(ting)g(c)m(haracters)630 |
15582 | 2660 y(Insert)f(the)g(c)m(haracter)i(in)m(to)g(the)e(line)h(at)g(the)g | |
6e51e0d0 CR |
15583 | (cursor.)150 2826 y Fj(C-_)e Fu(or)i Fj(C-x)e(C-u)630 |
15584 | 2936 y Fu(Undo)k(the)h(last)g(editing)g(command.)50 b(Y)-8 | |
c302751c CR |
15585 | b(ou)34 b(can)f(undo)g(all)h(the)f(w)m(a)m(y)i(bac)m(k)f(to)g(an)g |
15586 | (empt)m(y)630 3045 y(line.)150 3215 y(\(Dep)s(ending)29 | |
6e51e0d0 CR |
15587 | b(on)h(y)m(our)f(con\014guration,)i(the)e Ft(Backspace)e |
15588 | Fu(k)m(ey)k(b)s(e)d(set)j(to)f(delete)h(the)e(c)m(haracter)i(to)g(the) | |
c302751c | 15589 | 150 3324 y(left)37 b(of)f(the)h(cursor)e(and)h(the)g |
6e51e0d0 CR |
15590 | Ft(DEL)g Fu(k)m(ey)h(set)f(to)h(delete)h(the)e(c)m(haracter)i |
15591 | (underneath)d(the)h(cursor,)i(lik)m(e)150 3434 y Fj(C-d)p | |
15592 | Fu(,)30 b(rather)g(than)g(the)h(c)m(haracter)h(to)f(the)f(left)h(of)g | |
15593 | (the)f(cursor.\))150 3640 y Fk(8.2.2)63 b(Readline)40 | |
15594 | b(Mo)m(v)m(emen)m(t)h(Commands)150 3787 y Fu(The)27 b(ab)s(o)m(v)m(e)i | |
c302751c CR |
15595 | (table)g(describ)s(es)e(the)g(most)i(basic)f(k)m(eystrok)m(es)h(that)f |
15596 | (y)m(ou)g(need)g(in)f(order)g(to)i(do)e(editing)i(of)150 | |
15597 | 3897 y(the)k(input)f(line.)49 b(F)-8 b(or)34 b(y)m(our)f(con)m(v)m | |
15598 | (enience,)j(man)m(y)d(other)g(commands)f(ha)m(v)m(e)j(b)s(een)d(added)g | |
6e51e0d0 CR |
15599 | (in)h(addition)150 4006 y(to)j Fj(C-b)p Fu(,)f Fj(C-f)p |
15600 | Fu(,)g Fj(C-d)p Fu(,)h(and)e Ft(DEL)p Fu(.)54 b(Here)35 | |
c302751c | 15601 | b(are)g(some)h(commands)e(for)h(mo)m(ving)h(more)f(rapidly)f(ab)s(out)h |
6e51e0d0 CR |
15602 | (the)150 4116 y(line.)150 4286 y Fj(C-a)336 b Fu(Mo)m(v)m(e)32 |
15603 | b(to)g(the)e(start)h(of)g(the)f(line.)150 4452 y Fj(C-e)336 | |
15604 | b Fu(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
15605 | 4618 y Fj(M-f)336 b Fu(Mo)m(v)m(e)32 b(forw)m(ard)e(a)h(w)m(ord,)f | |
c302751c | 15606 | (where)g(a)h(w)m(ord)f(is)g(comp)s(osed)g(of)h(letters)h(and)d(digits.) |
6e51e0d0 CR |
15607 | 150 4785 y Fj(M-b)336 b Fu(Mo)m(v)m(e)32 b(bac)m(kw)m(ard)f(a)g(w)m |
15608 | (ord.)150 4951 y Fj(C-l)336 b Fu(Clear)31 b(the)f(screen,)h(reprin)m | |
c302751c | 15609 | (ting)f(the)h(curren)m(t)f(line)h(at)g(the)f(top.)275 |
6e51e0d0 CR |
15610 | 5121 y(Notice)c(ho)m(w)f Fj(C-f)e Fu(mo)m(v)m(es)j(forw)m(ard)e(a)h(c)m |
15611 | (haracter,)j(while)d Fj(M-f)e Fu(mo)m(v)m(es)j(forw)m(ard)e(a)h(w)m | |
37c41ab1 CR |
15612 | (ord.)39 b(It)24 b(is)h(a)g(lo)s(ose)150 5230 y(con)m(v)m(en)m(tion)32 |
15613 | b(that)f(con)m(trol)g(k)m(eystrok)m(es)h(op)s(erate)e(on)g(c)m | |
15614 | (haracters)h(while)f(meta)h(k)m(eystrok)m(es)h(op)s(erate)e(on)150 | |
15615 | 5340 y(w)m(ords.)p eop end | |
900a813b CR |
15616 | %%Page: 105 111 |
15617 | TeXDict begin 105 110 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
15618 | b(Command)29 b(Line)i(Editing)2062 b(105)150 299 y Fk(8.2.3)63 | |
6e51e0d0 CR |
15619 | b(Readline)40 b(Killing)i(Commands)150 446 y Fr(Killing)35 |
15620 | b Fu(text)28 b(means)e(to)h(delete)h(the)f(text)g(from)g(the)f(line,)i | |
c302751c | 15621 | (but)e(to)h(sa)m(v)m(e)h(it)g(a)m(w)m(a)m(y)g(for)e(later)i(use,)f |
6e51e0d0 | 15622 | (usually)150 555 y(b)m(y)g Fr(y)m(anking)35 b Fu(\(re-inserting\))28 |
c302751c CR |
15623 | b(it)g(bac)m(k)f(in)m(to)h(the)f(line.)40 b(\(`Cut')27 |
15624 | b(and)g(`paste')h(are)f(more)g(recen)m(t)h(jargon)f(for)150 | |
15625 | 665 y(`kill')32 b(and)d(`y)m(ank'.\))275 801 y(If)g(the)i(description)f | |
15626 | (for)g(a)h(command)f(sa)m(ys)g(that)h(it)g(`kills')g(text,)h(then)e(y)m | |
15627 | (ou)g(can)h(b)s(e)e(sure)h(that)h(y)m(ou)150 911 y(can)g(get)g(the)g | |
15628 | (text)g(bac)m(k)g(in)f(a)h(di\013eren)m(t)g(\(or)g(the)f(same\))h | |
15629 | (place)h(later.)275 1047 y(When)23 b(y)m(ou)g(use)g(a)h(kill)g | |
15630 | (command,)g(the)g(text)g(is)f(sa)m(v)m(ed)i(in)e(a)g | |
6e51e0d0 | 15631 | Fr(kill-ring)p Fu(.)39 b(An)m(y)24 b(n)m(um)m(b)s(er)e(of)h(consecutiv) |
c302751c | 15632 | m(e)150 1157 y(kills)31 b(sa)m(v)m(e)i(all)f(of)f(the)g(killed)h(text)g |
37c41ab1 | 15633 | (together,)g(so)g(that)f(when)f(y)m(ou)h(y)m(ank)h(it)f(bac)m(k,)h(y)m |
c302751c | 15634 | (ou)g(get)g(it)f(all.)43 b(The)150 1267 y(kill)33 b(ring)f(is)g(not)h |
37c41ab1 CR |
15635 | (line)g(sp)s(eci\014c;)g(the)g(text)g(that)g(y)m(ou)g(killed)f(on)h(a)f |
15636 | (previously)g(t)m(yp)s(ed)h(line)f(is)h(a)m(v)-5 b(ailable)150 | |
c302751c CR |
15637 | 1376 y(to)31 b(b)s(e)f(y)m(ank)m(ed)h(bac)m(k)g(later,)h(when)d(y)m(ou) |
15638 | i(are)g(t)m(yping)f(another)h(line.)275 1513 y(Here)f(is)h(the)f(list)h | |
6e51e0d0 CR |
15639 | (of)g(commands)f(for)g(killing)h(text.)150 1675 y Fj(C-k)336 |
15640 | b Fu(Kill)31 b(the)f(text)i(from)e(the)g(curren)m(t)g(cursor)g(p)s | |
c302751c | 15641 | (osition)h(to)g(the)f(end)g(of)g(the)h(line.)150 1836 |
6e51e0d0 | 15642 | y Fj(M-d)336 b Fu(Kill)27 b(from)f(the)g(cursor)g(to)h(the)f(end)g(of)h |
37c41ab1 | 15643 | (the)f(curren)m(t)g(w)m(ord,)h(or,)h(if)e(b)s(et)m(w)m(een)h(w)m(ords,) |
c302751c | 15644 | g(to)g(the)630 1946 y(end)j(of)g(the)h(next)f(w)m(ord.)41 |
37c41ab1 | 15645 | b(W)-8 b(ord)30 b(b)s(oundaries)f(are)i(the)g(same)f(as)h(those)g(used) |
6e51e0d0 | 15646 | f(b)m(y)g Fj(M-f)p Fu(.)150 2107 y Fj(M-DEL)240 b Fu(Kill)31 |
c302751c CR |
15647 | b(from)f(the)h(cursor)f(the)g(start)h(of)g(the)g(curren)m(t)f(w)m(ord,) |
15648 | h(or,)f(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)i(the)630 | |
15649 | 2217 y(start)39 b(of)f(the)h(previous)f(w)m(ord.)64 b(W)-8 | |
15650 | b(ord)39 b(b)s(oundaries)e(are)i(the)f(same)h(as)g(those)f(used)g(b)m | |
6e51e0d0 | 15651 | (y)630 2326 y Fj(M-b)p Fu(.)150 2487 y Fj(C-w)336 b Fu(Kill)35 |
c302751c | 15652 | b(from)g(the)g(cursor)f(to)i(the)f(previous)g(whitespace.)55 |
6e51e0d0 CR |
15653 | b(This)34 b(is)h(di\013eren)m(t)h(than)e Fj(M-DEL)630 |
15654 | 2597 y Fu(b)s(ecause)c(the)h(w)m(ord)f(b)s(oundaries)f(di\013er.)275 | |
15655 | 2759 y(Here)42 b(is)f(ho)m(w)h(to)g Fr(y)m(ank)47 b Fu(the)42 | |
c302751c CR |
15656 | b(text)g(bac)m(k)h(in)m(to)f(the)g(line.)74 b(Y)-8 b(anking)43 |
15657 | b(means)e(to)h(cop)m(y)h(the)e(most-)150 2869 y(recen)m(tly-killed)33 | |
6e51e0d0 CR |
15658 | b(text)e(from)f(the)g(kill)i(bu\013er.)150 3031 y Fj(C-y)336 |
15659 | b Fu(Y)-8 b(ank)31 b(the)f(most)h(recen)m(tly)h(killed)f(text)g(bac)m | |
c302751c | 15660 | (k)g(in)m(to)h(the)e(bu\013er)g(at)h(the)f(cursor.)150 |
6e51e0d0 | 15661 | 3192 y Fj(M-y)336 b Fu(Rotate)36 b(the)f(kill-ring,)i(and)d(y)m(ank)h |
c302751c | 15662 | (the)f(new)g(top.)54 b(Y)-8 b(ou)35 b(can)g(only)f(do)h(this)f(if)h |
6e51e0d0 CR |
15663 | (the)g(prior)630 3302 y(command)30 b(is)h Fj(C-y)e Fu(or)h |
15664 | Fj(M-y)p Fu(.)150 3503 y Fk(8.2.4)63 b(Readline)40 b(Argumen)m(ts)150 | |
15665 | 3650 y Fu(Y)-8 b(ou)40 b(can)f(pass)g(n)m(umeric)f(argumen)m(ts)i(to)f | |
c302751c CR |
15666 | (Readline)h(commands.)67 b(Sometimes)39 b(the)g(argumen)m(t)h(acts)150 |
15667 | 3760 y(as)g(a)h(rep)s(eat)f(coun)m(t,)j(other)e(times)f(it)h(is)f(the)g | |
6e51e0d0 | 15668 | Fl(sign)47 b Fu(of)41 b(the)f(argumen)m(t)g(that)h(is)f(signi\014can)m |
c302751c | 15669 | (t.)71 b(If)40 b(y)m(ou)150 3869 y(pass)33 b(a)h(negativ)m(e)i(argumen) |
37c41ab1 | 15670 | m(t)e(to)g(a)g(command)f(whic)m(h)g(normally)h(acts)g(in)f(a)h(forw)m |
c302751c | 15671 | (ard)f(direction,)i(that)150 3979 y(command)g(will)h(act)g(in)f(a)h |
37c41ab1 | 15672 | (bac)m(kw)m(ard)f(direction.)57 b(F)-8 b(or)36 b(example,)h(to)f(kill)g |
c302751c | 15673 | (text)g(bac)m(k)g(to)g(the)g(start)g(of)150 4088 y(the)31 |
6e51e0d0 CR |
15674 | b(line,)g(y)m(ou)f(migh)m(t)h(t)m(yp)s(e)g(`)p Ft(M--)f(C-k)p |
15675 | Fu('.)275 4225 y(The)d(general)i(w)m(a)m(y)h(to)e(pass)g(n)m(umeric)g | |
37c41ab1 | 15676 | (argumen)m(ts)h(to)g(a)f(command)g(is)g(to)h(t)m(yp)s(e)f(meta)i |
c302751c | 15677 | (digits)e(b)s(efore)150 4334 y(the)j(command.)42 b(If)30 |
37c41ab1 | 15678 | b(the)h(\014rst)f(`digit')i(t)m(yp)s(ed)f(is)g(a)g(min)m(us)f(sign)h |
6e51e0d0 | 15679 | (\(`)p Ft(-)p Fu('\),)h(then)f(the)g(sign)f(of)h(the)g(argumen)m(t)150 |
c302751c | 15680 | 4444 y(will)39 b(b)s(e)e(negativ)m(e.)66 b(Once)38 b(y)m(ou)h(ha)m(v)m |
37c41ab1 | 15681 | (e)g(t)m(yp)s(ed)f(one)h(meta)g(digit)g(to)f(get)i(the)e(argumen)m(t)h |
c302751c | 15682 | (started,)i(y)m(ou)150 4554 y(can)29 b(t)m(yp)s(e)g(the)g(remainder)f |
37c41ab1 | 15683 | (of)h(the)g(digits,)h(and)f(then)f(the)h(command.)40 |
6e51e0d0 CR |
15684 | b(F)-8 b(or)30 b(example,)g(to)f(giv)m(e)i(the)e Fj(C-d)150 |
15685 | 4663 y Fu(command)37 b(an)g(argumen)m(t)h(of)g(10,)i(y)m(ou)e(could)f | |
15686 | (t)m(yp)s(e)h(`)p Ft(M-1)29 b(0)h(C-d)p Fu(',)39 b(whic)m(h)e(will)h | |
c302751c | 15687 | (delete)h(the)e(next)h(ten)150 4773 y(c)m(haracters)32 |
6e51e0d0 CR |
15688 | b(on)e(the)h(input)e(line.)150 4974 y Fk(8.2.5)63 b(Searc)m(hing)40 |
15689 | b(for)i(Commands)g(in)f(the)g(History)150 5121 y Fu(Readline)35 | |
c302751c CR |
15690 | b(pro)m(vides)f(commands)g(for)g(searc)m(hing)h(through)e(the)i |
15691 | (command)f(history)g(\(see)h(Section)g(9.1)150 5230 y([Bash)i(History)h | |
900a813b | 15692 | (F)-8 b(acilities],)42 b(page)37 b(136\))i(for)d(lines)h(con)m(taining) |
c302751c | 15693 | i(a)e(sp)s(eci\014ed)f(string.)60 b(There)36 b(are)i(t)m(w)m(o)150 |
6e51e0d0 CR |
15694 | 5340 y(searc)m(h)31 b(mo)s(des:)40 b Fr(incremen)m(tal)35 |
15695 | b Fu(and)30 b Fr(non-incremen)m(tal)p Fu(.)p eop end | |
900a813b CR |
15696 | %%Page: 106 112 |
15697 | TeXDict begin 106 111 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
15698 | b(Command)29 b(Line)i(Editing)2062 b(106)275 299 y(Incremen)m(tal)26 | |
ad4aef08 CR |
15699 | b(searc)m(hes)h(b)s(egin)e(b)s(efore)g(the)h(user)f(has)h(\014nished)e |
15700 | (t)m(yping)i(the)g(searc)m(h)g(string.)39 b(As)26 b(eac)m(h)150 | |
15701 | 408 y(c)m(haracter)37 b(of)e(the)h(searc)m(h)g(string)f(is)h(t)m(yp)s | |
15702 | (ed,)g(Readline)g(displa)m(ys)g(the)f(next)h(en)m(try)g(from)e(the)i | |
15703 | (history)150 518 y(matc)m(hing)25 b(the)f(string)g(t)m(yp)s(ed)g(so)g | |
15704 | (far.)39 b(An)23 b(incremen)m(tal)j(searc)m(h)e(requires)g(only)g(as)g | |
15705 | (man)m(y)g(c)m(haracters)i(as)150 628 y(needed)i(to)i(\014nd)d(the)i | |
15706 | (desired)f(history)h(en)m(try)-8 b(.)41 b(T)-8 b(o)29 | |
15707 | b(searc)m(h)h(bac)m(kw)m(ard)f(in)f(the)h(history)g(for)f(a)i | |
6e51e0d0 CR |
15708 | (particular)150 737 y(string,)g(t)m(yp)s(e)f Fj(C-r)p |
15709 | Fu(.)40 b(T)m(yping)29 b Fj(C-s)g Fu(searc)m(hes)h(forw)m(ard)f | |
ad4aef08 CR |
15710 | (through)g(the)g(history)-8 b(.)41 b(The)29 b(c)m(haracters)i(presen)m |
15711 | (t)150 847 y(in)38 b(the)g(v)-5 b(alue)38 b(of)g(the)g | |
6e51e0d0 | 15712 | Ft(isearch-terminators)33 b Fu(v)-5 b(ariable)39 b(are)f(used)f(to)i |
ad4aef08 CR |
15713 | (terminate)g(an)f(incremen)m(tal)150 956 y(searc)m(h.)71 |
15714 | b(If)40 b(that)h(v)-5 b(ariable)41 b(has)f(not)h(b)s(een)e(assigned)i | |
6e51e0d0 CR |
15715 | (a)f(v)-5 b(alue,)44 b(the)c Ft(ESC)g Fu(and)f Fj(C-J)h |
15716 | Fu(c)m(haracters)i(will)150 1066 y(terminate)h(an)g(incremen)m(tal)g | |
15717 | (searc)m(h.)78 b Fj(C-g)41 b Fu(will)i(ab)s(ort)f(an)g(incremen)m(tal)i | |
ad4aef08 CR |
15718 | (searc)m(h)f(and)f(restore)h(the)150 1176 y(original)30 |
15719 | b(line.)41 b(When)28 b(the)h(searc)m(h)h(is)f(terminated,)h(the)f | |
15720 | (history)g(en)m(try)g(con)m(taining)h(the)f(searc)m(h)h(string)150 | |
037a8b7f | 15721 | 1285 y(b)s(ecomes)h(the)f(curren)m(t)g(line.)275 1414 |
ad4aef08 | 15722 | y(T)-8 b(o)31 b(\014nd)e(other)j(matc)m(hing)g(en)m(tries)g(in)e(the)h |
6e51e0d0 | 15723 | (history)g(list,)h(t)m(yp)s(e)g Fj(C-r)e Fu(or)h Fj(C-s)f |
037a8b7f | 15724 | Fu(as)h(appropriate.)43 b(This)150 1524 y(will)26 b(searc)m(h)h(bac)m |
37c41ab1 CR |
15725 | (kw)m(ard)g(or)f(forw)m(ard)g(in)f(the)i(history)f(for)g(the)g(next)g |
15726 | (en)m(try)h(matc)m(hing)g(the)f(searc)m(h)h(string)150 | |
037a8b7f | 15727 | 1633 y(t)m(yp)s(ed)37 b(so)h(far.)63 b(An)m(y)38 b(other)f(k)m(ey)i |
37c41ab1 | 15728 | (sequence)f(b)s(ound)e(to)i(a)g(Readline)h(command)e(will)h(terminate)h |
037a8b7f | 15729 | (the)150 1743 y(searc)m(h)26 b(and)f(execute)i(that)f(command.)39 |
6e51e0d0 | 15730 | b(F)-8 b(or)26 b(instance,)h(a)f Ft(RET)f Fu(will)g(terminate)i(the)f |
037a8b7f | 15731 | (searc)m(h)g(and)e(accept)150 1852 y(the)30 b(line,)g(thereb)m(y)f |
c302751c | 15732 | (executing)i(the)e(command)g(from)g(the)h(history)f(list.)41 |
037a8b7f | 15733 | b(A)29 b(mo)m(v)m(emen)m(t)j(command)d(will)150 1962 |
c302751c CR |
15734 | y(terminate)i(the)g(searc)m(h,)g(mak)m(e)h(the)e(last)h(line)g(found)e |
15735 | (the)i(curren)m(t)f(line,)h(and)f(b)s(egin)g(editing.)275 | |
037a8b7f | 15736 | 2091 y(Readline)35 b(remem)m(b)s(ers)f(the)h(last)h(incremen)m(tal)g |
6e51e0d0 | 15737 | (searc)m(h)f(string.)54 b(If)34 b(t)m(w)m(o)j Fj(C-r)p |
037a8b7f | 15738 | Fu(s)c(are)i(t)m(yp)s(ed)g(without)150 2200 y(an)m(y)i(in)m(terv)m |
c302751c CR |
15739 | (ening)g(c)m(haracters)h(de\014ning)e(a)h(new)f(searc)m(h)h(string,)h |
15740 | (an)m(y)f(remem)m(b)s(ered)e(searc)m(h)i(string)g(is)150 | |
037a8b7f | 15741 | 2310 y(used.)275 2439 y(Non-incremen)m(tal)48 b(searc)m(hes)g(read)e |
c302751c | 15742 | (the)h(en)m(tire)h(searc)m(h)f(string)g(b)s(efore)f(starting)h(to)h |
037a8b7f | 15743 | (searc)m(h)f(for)150 2548 y(matc)m(hing)d(history)e(lines.)78 |
c302751c | 15744 | b(The)42 b(searc)m(h)h(string)g(ma)m(y)g(b)s(e)f(t)m(yp)s(ed)g(b)m(y)g |
037a8b7f CR |
15745 | (the)h(user)f(or)h(b)s(e)f(part)g(of)h(the)150 2658 y(con)m(ten)m(ts)32 |
15746 | b(of)f(the)f(curren)m(t)g(line.)150 2887 y Fs(8.3)68 | |
15747 | b(Readline)47 b(Init)e(File)150 3046 y Fu(Although)f(the)g(Readline)g | |
c302751c | 15748 | (library)f(comes)i(with)e(a)h(set)h(of)f(Emacs-lik)m(e)h(k)m |
037a8b7f | 15749 | (eybindings)f(installed)g(b)m(y)150 3156 y(default,)26 |
c302751c CR |
15750 | b(it)g(is)e(p)s(ossible)h(to)g(use)f(a)i(di\013eren)m(t)f(set)g(of)g(k) |
15751 | m(eybindings.)38 b(An)m(y)25 b(user)f(can)h(customize)h(programs)150 | |
037a8b7f | 15752 | 3266 y(that)45 b(use)f(Readline)h(b)m(y)f(putting)g(commands)g(in)g(an) |
6e51e0d0 | 15753 | g Fr(inputrc)49 b Fu(\014le,)g(con)m(v)m(en)m(tionally)e(in)d(his)g |
037a8b7f | 15754 | (home)150 3375 y(directory)-8 b(.)59 b(The)35 b(name)i(of)f(this)g |
c302751c | 15755 | (\014le)g(is)g(tak)m(en)h(from)f(the)g(v)-5 b(alue)37 |
6e51e0d0 | 15756 | b(of)f(the)g(shell)h(v)-5 b(ariable)36 b Ft(INPUTRC)p |
037a8b7f | 15757 | Fu(.)56 b(If)150 3485 y(that)36 b(v)-5 b(ariable)36 b(is)f(unset,)h |
6e51e0d0 CR |
15758 | (the)f(default)h(is)f Ft(~/.inputrc)p Fu(.)52 b(If)35 |
15759 | b(that)g(\014le)h(do)s(es)e(not)i(exist)g(or)f(cannot)h(b)s(e)150 | |
037a8b7f CR |
15760 | 3594 y(read,)31 b(the)f(ultimate)i(default)e(is)h Ft(/etc/inputrc)p |
15761 | Fu(.)275 3723 y(When)e(a)h(program)f(whic)m(h)h(uses)f(the)h(Readline)g | |
6e51e0d0 | 15762 | (library)f(starts)h(up,)f(the)h(init)g(\014le)f(is)h(read,)g(and)f(the) |
037a8b7f | 15763 | 150 3833 y(k)m(ey)i(bindings)e(are)i(set.)275 3961 y(In)26 |
6e51e0d0 CR |
15764 | b(addition,)i(the)f Ft(C-x)i(C-r)d Fu(command)h(re-reads)g(this)f(init) |
15765 | h(\014le,)h(th)m(us)f(incorp)s(orating)g(an)m(y)g(c)m(hanges)150 | |
037a8b7f CR |
15766 | 4071 y(that)k(y)m(ou)g(migh)m(t)g(ha)m(v)m(e)g(made)g(to)g(it.)150 |
15767 | 4259 y Fk(8.3.1)63 b(Readline)40 b(Init)h(File)g(Syn)m(tax)150 | |
15768 | 4406 y Fu(There)f(are)i(only)f(a)g(few)g(basic)g(constructs)h(allo)m(w) | |
c302751c | 15769 | m(ed)h(in)d(the)h(Readline)h(init)f(\014le.)73 b(Blank)41 |
037a8b7f | 15770 | b(lines)h(are)150 4515 y(ignored.)72 b(Lines)41 b(b)s(eginning)f(with)h |
6e51e0d0 CR |
15771 | (a)g(`)p Ft(#)p Fu(')g(are)h(commen)m(ts.)73 b(Lines)41 |
15772 | b(b)s(eginning)f(with)g(a)i(`)p Ft($)p Fu(')f(indicate)150 | |
037a8b7f | 15773 | 4625 y(conditional)e(constructs)f(\(see)g(Section)h(8.3.2)g |
900a813b | 15774 | ([Conditional)g(Init)e(Constructs],)j(page)e(114\).)64 |
037a8b7f CR |
15775 | b(Other)150 4735 y(lines)31 b(denote)g(v)-5 b(ariable)31 |
15776 | b(settings)g(and)f(k)m(ey)h(bindings.)150 4882 y(V)-8 | |
15777 | b(ariable)32 b(Settings)630 4992 y(Y)-8 b(ou)41 b(can)g(mo)s(dify)e | |
c302751c | 15778 | (the)i(run-time)f(b)s(eha)m(vior)g(of)h(Readline)g(b)m(y)f(altering)h |
037a8b7f | 15779 | (the)g(v)-5 b(alues)41 b(of)630 5102 y(v)-5 b(ariables)34 |
6e51e0d0 | 15780 | b(in)f(Readline)i(using)e(the)g Ft(set)g Fu(command)g(within)g(the)h |
037a8b7f CR |
15781 | (init)g(\014le.)50 b(The)33 b(syn)m(tax)630 5211 y(is)d(simple:)870 |
15782 | 5340 y Ft(set)47 b Fj(variable)e(value)p eop end | |
900a813b CR |
15783 | %%Page: 107 113 |
15784 | TeXDict begin 107 112 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
037a8b7f CR |
15785 | b(Command)29 b(Line)i(Editing)2062 b(107)630 299 y(Here,)29 |
15786 | b(for)e(example,)h(is)g(ho)m(w)f(to)h(c)m(hange)g(from)f(the)g(default) | |
15787 | h(Emacs-lik)m(e)h(k)m(ey)f(binding)e(to)630 408 y(use)k | |
15788 | Ft(vi)g Fu(line)h(editing)g(commands:)870 541 y Ft(set)47 | |
15789 | b(editing-mode)d(vi)630 674 y Fu(V)-8 b(ariable)36 b(names)f(and)g(v)-5 | |
15790 | b(alues,)36 b(where)f(appropriate,)h(are)g(recognized)g(without)f | |
15791 | (regard)630 783 y(to)c(case.)42 b(Unrecognized)31 b(v)-5 | |
15792 | b(ariable)31 b(names)g(are)f(ignored.)630 916 y(Bo)s(olean)c(v)-5 | |
15793 | b(ariables)26 b(\(those)g(that)g(can)f(b)s(e)f(set)i(to)g(on)f(or)g | |
15794 | (o\013)7 b(\))25 b(are)h(set)f(to)h(on)f(if)g(the)g(v)-5 | |
15795 | b(alue)26 b(is)630 1026 y(n)m(ull)e(or)g(empt)m(y)-8 | |
6e51e0d0 | 15796 | b(,)27 b Fr(on)d Fu(\(case-insensitiv)m(e\),)29 b(or)24 |
1c72c0cd | 15797 | b(1.)39 b(An)m(y)25 b(other)f(v)-5 b(alue)25 b(results)f(in)g(the)g(v) |
037a8b7f CR |
15798 | -5 b(ariable)630 1135 y(b)s(eing)30 b(set)h(to)g(o\013.)630 |
15799 | 1268 y(The)37 b Ft(bind)30 b(-V)37 b Fu(command)g(lists)i(the)f(curren) | |
1c72c0cd | 15800 | m(t)f(Readline)i(v)-5 b(ariable)38 b(names)g(and)f(v)-5 |
037a8b7f CR |
15801 | b(alues.)630 1377 y(See)31 b(Section)g(4.2)g([Bash)g(Builtins],)g(page) |
15802 | g(48.)630 1510 y(A)f(great)i(deal)f(of)g(run-time)f(b)s(eha)m(vior)g | |
1c72c0cd | 15803 | (is)g(c)m(hangeable)j(with)d(the)g(follo)m(wing)i(v)-5 |
037a8b7f | 15804 | b(ariables.)630 1666 y Ft(bell-style)1110 1775 y Fu(Con)m(trols)44 |
1c72c0cd | 15805 | b(what)g(happ)s(ens)e(when)h(Readline)i(w)m(an)m(ts)f(to)h(ring)e(the)h |
037a8b7f | 15806 | (termi-)1110 1885 y(nal)37 b(b)s(ell.)61 b(If)37 b(set)h(to)g(`)p |
6e51e0d0 | 15807 | Ft(none)p Fu(',)g(Readline)g(nev)m(er)g(rings)e(the)i(b)s(ell.)61 |
037a8b7f | 15808 | b(If)36 b(set)i(to)1110 1995 y(`)p Ft(visible)p Fu(',)32 |
37c41ab1 | 15809 | b(Readline)i(uses)f(a)g(visible)g(b)s(ell)g(if)g(one)g(is)g(a)m(v)-5 |
037a8b7f | 15810 | b(ailable.)51 b(If)33 b(set)g(to)1110 2104 y(`)p Ft(audible)p |
6e51e0d0 | 15811 | Fu(')j(\(the)i(default\),)i(Readline)e(attempts)g(to)h(ring)e(the)g |
037a8b7f CR |
15812 | (terminal's)1110 2214 y(b)s(ell.)630 2370 y Ft(bind-tty-special-chars) |
15813 | 1110 2479 y Fu(If)e(set)g(to)h(`)p Ft(on)p Fu(')f(\(the)g(default\),)i | |
fc527055 | 15814 | (Readline)f(attempts)g(to)g(bind)d(the)i(con)m(trol)1110 |
037a8b7f CR |
15815 | 2589 y(c)m(haracters)30 b(treated)g(sp)s(ecially)g(b)m(y)f(the)g(k)m |
15816 | (ernel's)h(terminal)f(driv)m(er)g(to)h(their)1110 2698 | |
15817 | y(Readline)h(equiv)-5 b(alen)m(ts.)630 2854 y Ft(blink-matching-paren) | |
15818 | 1110 2964 y Fu(If)36 b(set)g(to)h(`)p Ft(on)p Fu(',)h(Readline)f | |
fc527055 | 15819 | (attempts)g(to)g(brie\015y)e(mo)m(v)m(e)j(the)f(cursor)e(to)i(an)1110 |
037a8b7f CR |
15820 | 3073 y(op)s(ening)k(paren)m(thesis)h(when)f(a)h(closing)h(paren)m |
15821 | (thesis)e(is)h(inserted.)74 b(The)1110 3183 y(default)31 | |
15822 | b(is)f(`)p Ft(off)p Fu('.)630 3339 y Ft(colored-completion-prefi)o(x) | |
15823 | 1110 3448 y Fu(If)f(set)h(to)g(`)p Ft(on)p Fu(',)g(when)e(listing)i | |
8a0829e9 | 15824 | (completions,)h(Readline)f(displa)m(ys)g(the)f(com-)1110 |
037a8b7f | 15825 | 3558 y(mon)c(pre\014x)f(of)i(the)f(set)h(of)g(p)s(ossible)f |
8a0829e9 | 15826 | (completions)h(using)f(a)h(di\013eren)m(t)g(color.)1110 |
037a8b7f CR |
15827 | 3667 y(The)39 b(color)i(de\014nitions)f(are)g(tak)m(en)h(from)f(the)g |
15828 | (v)-5 b(alue)40 b(of)g(the)g Ft(LS_COLORS)1110 3777 y | |
8a0829e9 | 15829 | Fu(en)m(vironmen)m(t)31 b(v)-5 b(ariable.)41 b(The)30 |
037a8b7f CR |
15830 | b(default)h(is)f(`)p Ft(off)p Fu('.)630 3933 y Ft(colored-stats)1110 |
15831 | 4042 y Fu(If)c(set)h(to)g(`)p Ft(on)p Fu(',)h(Readline)f(displa)m(ys)g | |
8a0829e9 | 15832 | (p)s(ossible)f(completions)h(using)f(di\013eren)m(t)1110 |
037a8b7f | 15833 | 4152 y(colors)40 b(to)g(indicate)g(their)f(\014le)h(t)m(yp)s(e.)67 |
abe2eb5b | 15834 | b(The)38 b(color)j(de\014nitions)d(are)i(tak)m(en)1110 |
037a8b7f | 15835 | 4261 y(from)24 b(the)h(v)-5 b(alue)25 b(of)g(the)g Ft(LS_COLORS)d |
6e51e0d0 | 15836 | Fu(en)m(vironmen)m(t)j(v)-5 b(ariable.)40 b(The)24 b(default)1110 |
037a8b7f CR |
15837 | 4371 y(is)30 b(`)p Ft(off)p Fu('.)630 4527 y Ft(comment-begin)1110 |
15838 | 4636 y Fu(The)62 b(string)g(to)h(insert)f(at)h(the)g(b)s(eginning)e(of) | |
15839 | h(the)h(line)f(when)g(the)1110 4746 y Ft(insert-comment)26 | |
6e51e0d0 | 15840 | b Fu(command)31 b(is)f(executed.)42 b(The)30 b(default)g(v)-5 |
037a8b7f CR |
15841 | b(alue)31 b(is)f Ft("#")p Fu(.)630 4902 y Ft(completion-display-width) |
15842 | 1110 5011 y Fu(The)41 b(n)m(um)m(b)s(er)f(of)i(screen)g(columns)f(used) | |
15843 | g(to)h(displa)m(y)g(p)s(ossible)f(matc)m(hes)1110 5121 | |
eb0b2ad8 | 15844 | y(when)28 b(p)s(erforming)g(completion.)41 b(The)29 b(v)-5 |
037a8b7f CR |
15845 | b(alue)29 b(is)g(ignored)g(if)g(it)h(is)f(less)g(than)1110 |
15846 | 5230 y(0)e(or)f(greater)h(than)f(the)g(terminal)h(screen)f(width.)39 | |
15847 | b(A)26 b(v)-5 b(alue)27 b(of)f(0)h(will)f(cause)1110 | |
15848 | 5340 y(matc)m(hes)32 b(to)f(b)s(e)e(displa)m(y)m(ed)i(one)g(p)s(er)e | |
15849 | (line.)41 b(The)30 b(default)h(v)-5 b(alue)31 b(is)f(-1.)p | |
8a0829e9 | 15850 | eop end |
900a813b CR |
15851 | %%Page: 108 114 |
15852 | TeXDict begin 108 113 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
037a8b7f CR |
15853 | b(Command)29 b(Line)i(Editing)2062 b(108)630 299 y Ft |
15854 | (completion-ignore-case)1110 408 y Fu(If)27 b(set)h(to)g(`)p | |
6e51e0d0 | 15855 | Ft(on)p Fu(',)g(Readline)g(p)s(erforms)e(\014lename)h(matc)m(hing)i |
037a8b7f | 15856 | (and)e(completion)1110 518 y(in)j(a)h(case-insensitiv)m(e)i(fashion.)40 |
8a0829e9 | 15857 | b(The)30 b(default)h(v)-5 b(alue)30 b(is)h(`)p Ft(off)p |
037a8b7f | 15858 | Fu('.)630 706 y Ft(completion-map-case)1110 816 y Fu(If)22 |
8a0829e9 | 15859 | b(set)g(to)h(`)p Ft(on)p Fu(',)h(and)e Fr(completion-ignore-case)31 |
037a8b7f | 15860 | b Fu(is)22 b(enabled,)i(Readline)f(treats)1110 925 y(h)m(yphens)29 |
fc527055 CR |
15861 | b(\(`)p Ft(-)p Fu('\))j(and)e(underscores)g(\(`)p Ft(_)p |
15862 | Fu('\))i(as)f(equiv)-5 b(alen)m(t)32 b(when)e(p)s(erforming)1110 | |
037a8b7f CR |
15863 | 1035 y(case-insensitiv)m(e)j(\014lename)d(matc)m(hing)i(and)e |
15864 | (completion.)630 1223 y Ft(completion-prefix-displa)o(y-le)o(ngth)1110 | |
15865 | 1332 y Fu(The)h(length)g(in)g(c)m(haracters)i(of)f(the)f(common)h | |
15866 | (pre\014x)e(of)h(a)h(list)g(of)f(p)s(ossible)1110 1442 | |
fc527055 | 15867 | y(completions)g(that)f(is)g(displa)m(y)m(ed)g(without)g(mo)s |
037a8b7f | 15868 | (di\014cation.)41 b(When)29 b(set)h(to)h(a)1110 1551 |
fc527055 | 15869 | y(v)-5 b(alue)26 b(greater)h(than)e(zero,)j(common)e(pre\014xes)e |
037a8b7f | 15870 | (longer)j(than)e(this)g(v)-5 b(alue)27 b(are)1110 1661 |
ad4aef08 | 15871 | y(replaced)k(with)f(an)g(ellipsis)h(when)e(displa)m(ying)i(p)s(ossible) |
037a8b7f CR |
15872 | f(completions.)630 1849 y Ft(completion-query-items)1110 |
15873 | 1958 y Fu(The)c(n)m(um)m(b)s(er)f(of)h(p)s(ossible)g(completions)h | |
15874 | (that)g(determines)f(when)f(the)i(user)1110 2068 y(is)i(ask)m(ed)h | |
ad4aef08 | 15875 | (whether)f(the)h(list)g(of)f(p)s(ossibilities)h(should)e(b)s(e)h |
037a8b7f | 15876 | (displa)m(y)m(ed.)41 b(If)29 b(the)1110 2178 y(n)m(um)m(b)s(er)d(of)h |
ad4aef08 | 15877 | (p)s(ossible)f(completions)i(is)f(greater)h(than)e(this)h(v)-5 |
037a8b7f | 15878 | b(alue,)28 b(Readline)1110 2287 y(will)f(ask)g(the)f(user)g(whether)g |
ad4aef08 | 15879 | (or)g(not)h(he)f(wishes)g(to)i(view)e(them;)i(otherwise,)1110 |
037a8b7f | 15880 | 2397 y(they)d(are)f(simply)g(listed.)40 b(This)23 b(v)-5 |
ad4aef08 | 15881 | b(ariable)25 b(m)m(ust)g(b)s(e)e(set)i(to)g(an)g(in)m(teger)g(v)-5 |
037a8b7f | 15882 | b(alue)1110 2506 y(greater)26 b(than)f(or)f(equal)i(to)f(0.)40 |
ed35cb4a | 15883 | b(A)24 b(negativ)m(e)j(v)-5 b(alue)26 b(means)e(Readline)i(should)1110 |
037a8b7f CR |
15884 | 2616 y(nev)m(er)31 b(ask.)41 b(The)29 b(default)i(limit)g(is)g |
15885 | Ft(100)p Fu(.)630 2804 y Ft(convert-meta)1110 2913 y | |
6e51e0d0 | 15886 | Fu(If)22 b(set)g(to)h(`)p Ft(on)p Fu(',)h(Readline)f(will)f(con)m(v)m |
220537f2 | 15887 | (ert)i(c)m(haracters)f(with)f(the)g(eigh)m(th)h(bit)f(set)1110 |
037a8b7f | 15888 | 3023 y(to)33 b(an)e Fm(asci)r(i)h Fu(k)m(ey)h(sequence)f(b)m(y)g |
c302751c | 15889 | (stripping)f(the)h(eigh)m(th)h(bit)f(and)f(pre\014xing)1110 |
037a8b7f CR |
15890 | 3133 y(an)24 b Ft(ESC)g Fu(c)m(haracter,)j(con)m(v)m(erting)f(them)f |
15891 | (to)g(a)g(meta-pre\014xed)f(k)m(ey)h(sequence.)1110 3242 | |
6e51e0d0 | 15892 | y(The)30 b(default)g(v)-5 b(alue)31 b(is)g(`)p Ft(on)p |
037a8b7f | 15893 | Fu('.)630 3430 y Ft(disable-completion)1110 3540 y Fu(If)36 |
6e51e0d0 | 15894 | b(set)h(to)h(`)p Ft(On)p Fu(',)g(Readline)f(will)g(inhibit)f(w)m(ord)h |
037a8b7f | 15895 | (completion.)60 b(Completion)1110 3649 y(c)m(haracters)28 |
eb0b2ad8 | 15896 | b(will)e(b)s(e)f(inserted)h(in)m(to)h(the)g(line)f(as)g(if)g(they)h |
037a8b7f | 15897 | (had)e(b)s(een)g(mapp)s(ed)1110 3759 y(to)31 b Ft(self-insert)p |
6e51e0d0 | 15898 | Fu(.)38 b(The)30 b(default)g(is)h(`)p Ft(off)p Fu('.)630 |
037a8b7f | 15899 | 3947 y Ft(editing-mode)1110 4056 y Fu(The)d Ft(editing-mode)e |
6e51e0d0 | 15900 | Fu(v)-5 b(ariable)29 b(con)m(trols)h(whic)m(h)e(default)h(set)h(of)e(k) |
037a8b7f | 15901 | m(ey)i(bind-)1110 4166 y(ings)25 b(is)g(used.)38 b(By)26 |
eb0b2ad8 | 15902 | b(default,)g(Readline)g(starts)f(up)f(in)h(Emacs)g(editing)h(mo)s(de,) |
037a8b7f | 15903 | 1110 4275 y(where)j(the)g(k)m(eystrok)m(es)i(are)e(most)h(similar)f(to) |
eb0b2ad8 | 15904 | h(Emacs.)40 b(This)29 b(v)-5 b(ariable)30 b(can)1110 |
037a8b7f | 15905 | 4385 y(b)s(e)g(set)h(to)g(either)g(`)p Ft(emacs)p Fu(')e(or)h(`)p |
8a0829e9 CR |
15906 | Ft(vi)p Fu('.)630 4573 y Ft(emacs-mode-string)1110 4682 |
15907 | y Fu(This)f(string)h(is)f(displa)m(y)m(ed)i(immediately)g(b)s(efore)e | |
15908 | (the)h(last)g(line)h(of)e(the)h(pri-)1110 4792 y(mary)43 | |
15909 | b(prompt)g(when)f(emacs)i(editing)g(mo)s(de)f(is)g(activ)m(e.)82 | |
15910 | b(The)43 b(v)-5 b(alue)44 b(is)1110 4902 y(expanded)28 | |
15911 | b(lik)m(e)i(a)f(k)m(ey)g(binding,)f(so)h(the)g(standard)f(set)h(of)g | |
15912 | (meta-)g(and)f(con-)1110 5011 y(trol)36 b(pre\014xes)e(and)h(bac)m | |
15913 | (kslash)h(escap)s(e)g(sequences)g(is)f(a)m(v)-5 b(ailable.)58 | |
15914 | b(Use)36 b(the)1110 5121 y(`)p Ft(\\1)p Fu(')i(and)f(`)p | |
15915 | Ft(\\2)p Fu(')h(escap)s(es)g(to)h(b)s(egin)e(and)h(end)f(sequences)h | |
15916 | (of)g(non-prin)m(ting)1110 5230 y(c)m(haracters,)27 b(whic)m(h)c(can)h | |
15917 | (b)s(e)f(used)f(to)j(em)m(b)s(ed)e(a)h(terminal)g(con)m(trol)h | |
15918 | (sequence)1110 5340 y(in)m(to)31 b(the)g(mo)s(de)f(string.)41 | |
15919 | b(The)29 b(default)i(is)f(`)p Ft(@)p Fu('.)p eop end | |
900a813b CR |
15920 | %%Page: 109 115 |
15921 | TeXDict begin 109 114 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
15922 | b(Command)29 b(Line)i(Editing)2062 b(109)630 299 y Ft | |
8a0829e9 CR |
15923 | (echo-control-characters)1110 408 y Fu(When)30 b(set)h(to)g(`)p |
15924 | Ft(on)p Fu(',)f(on)g(op)s(erating)h(systems)f(that)h(indicate)g(they)g | |
15925 | (supp)s(ort)1110 518 y(it,)i(readline)e(ec)m(ho)s(es)i(a)f(c)m | |
15926 | (haracter)h(corresp)s(onding)d(to)j(a)f(signal)g(generated)1110 | |
15927 | 628 y(from)e(the)g(k)m(eyb)s(oard.)41 b(The)30 b(default)g(is)h(`)p | |
15928 | Ft(on)p Fu('.)630 778 y Ft(enable-bracketed-paste)1110 | |
15929 | 888 y Fu(When)24 b(set)h(to)h(`)p Ft(On)p Fu(',)g(Readline)f(will)g | |
15930 | (con\014gure)f(the)h(terminal)g(in)f(a)h(w)m(a)m(y)g(that)1110 | |
15931 | 998 y(will)k(enable)f(it)h(to)g(insert)g(eac)m(h)g(paste)g(in)m(to)g | |
15932 | (the)g(editing)g(bu\013er)e(as)i(a)f(single)1110 1107 | |
15933 | y(string)33 b(of)f(c)m(haracters,)j(instead)e(of)g(treating)h(eac)m(h)g | |
15934 | (c)m(haracter)g(as)f(if)f(it)i(had)1110 1217 y(b)s(een)e(read)i(from)e | |
15935 | (the)i(k)m(eyb)s(oard.)49 b(This)32 b(can)h(prev)m(en)m(t)h(pasted)f(c) | |
15936 | m(haracters)1110 1326 y(from)d(b)s(eing)g(in)m(terpreted)h(as)f | |
15937 | (editing)h(commands.)41 b(The)29 b(default)i(is)f(`)p | |
15938 | Ft(off)p Fu('.)630 1477 y Ft(enable-keypad)1110 1587 | |
15939 | y Fu(When)23 b(set)h(to)g(`)p Ft(on)p Fu(',)h(Readline)f(will)g(try)f | |
15940 | (to)h(enable)g(the)f(application)i(k)m(eypad)1110 1696 | |
15941 | y(when)h(it)h(is)f(called.)41 b(Some)27 b(systems)f(need)h(this)f(to)h | |
15942 | (enable)g(the)g(arro)m(w)g(k)m(eys.)1110 1806 y(The)j(default)g(is)h(`) | |
15943 | p Ft(off)p Fu('.)630 1956 y Ft(enable-meta-key)1110 2066 | |
15944 | y Fu(When)40 b(set)g(to)g(`)p Ft(on)p Fu(',)j(Readline)d(will)g(try)g | |
15945 | (to)g(enable)g(an)m(y)g(meta)h(mo)s(di\014er)1110 2176 | |
15946 | y(k)m(ey)i(the)e(terminal)i(claims)f(to)h(supp)s(ort)d(when)h(it)h(is)g | |
15947 | (called.)76 b(On)41 b(man)m(y)1110 2285 y(terminals,)c(the)e(meta)h(k)m | |
15948 | (ey)g(is)f(used)g(to)h(send)e(eigh)m(t-bit)j(c)m(haracters.)56 | |
15949 | b(The)1110 2395 y(default)31 b(is)f(`)p Ft(on)p Fu('.)630 | |
15950 | 2545 y Ft(expand-tilde)1110 2655 y Fu(If)d(set)h(to)h(`)p | |
15951 | Ft(on)p Fu(',)f(tilde)g(expansion)g(is)f(p)s(erformed)f(when)h | |
15952 | (Readline)h(attempts)1110 2765 y(w)m(ord)i(completion.)42 | |
15953 | b(The)30 b(default)g(is)h(`)p Ft(off)p Fu('.)630 2915 | |
15954 | y Ft(history-preserve-point)1110 3025 y Fu(If)41 b(set)h(to)h(`)p | |
15955 | Ft(on)p Fu(',)i(the)c(history)h(co)s(de)g(attempts)h(to)f(place)h(the)f | |
15956 | (p)s(oin)m(t)f(\(the)1110 3134 y(curren)m(t)35 b(cursor)g(p)s | |
15957 | (osition\))g(at)h(the)g(same)f(lo)s(cation)i(on)e(eac)m(h)h(history)g | |
15958 | (line)1110 3244 y(retriev)m(ed)h(with)f Ft(previous-history)c | |
15959 | Fu(or)37 b Ft(next-history)p Fu(.)55 b(The)36 b(default)1110 | |
15960 | 3354 y(is)30 b(`)p Ft(off)p Fu('.)630 3504 y Ft(history-size)1110 | |
15961 | 3614 y Fu(Set)39 b(the)g(maxim)m(um)g(n)m(um)m(b)s(er)f(of)h(history)g | |
15962 | (en)m(tries)h(sa)m(v)m(ed)g(in)f(the)g(history)1110 3724 | |
15963 | y(list.)51 b(If)34 b(set)g(to)h(zero,)g(an)m(y)f(existing)h(history)f | |
15964 | (en)m(tries)g(are)g(deleted)h(and)e(no)1110 3833 y(new)e(en)m(tries)i | |
15965 | (are)f(sa)m(v)m(ed.)46 b(If)31 b(set)h(to)h(a)f(v)-5 | |
15966 | b(alue)32 b(less)g(than)f(zero,)i(the)f(n)m(um)m(b)s(er)1110 | |
15967 | 3943 y(of)f(history)f(en)m(tries)h(is)g(not)g(limited.)42 | |
15968 | b(By)30 b(default,)h(the)g(n)m(um)m(b)s(er)e(of)i(history)1110 | |
15969 | 4052 y(en)m(tries)g(is)g(not)f(limited.)630 4203 y Ft | |
15970 | (horizontal-scroll-mode)1110 4313 y Fu(This)35 b(v)-5 | |
ad4aef08 | 15971 | b(ariable)37 b(can)f(b)s(e)f(set)h(to)h(either)f(`)p |
6e51e0d0 | 15972 | Ft(on)p Fu(')g(or)g(`)p Ft(off)p Fu('.)57 b(Setting)36 |
8a0829e9 | 15973 | b(it)g(to)h(`)p Ft(on)p Fu(')1110 4422 y(means)26 b(that)h(the)f(text)h |
eb0b2ad8 | 15974 | (of)g(the)f(lines)g(b)s(eing)g(edited)h(will)f(scroll)h(horizon)m |
8a0829e9 CR |
15975 | (tally)1110 4532 y(on)32 b(a)g(single)g(screen)g(line)g(when)e(they)i |
15976 | (are)g(longer)h(than)e(the)h(width)f(of)h(the)1110 4641 | |
eb0b2ad8 | 15977 | y(screen,)27 b(instead)g(of)f(wrapping)f(on)m(to)i(a)f(new)g(screen)g |
8a0829e9 | 15978 | (line.)39 b(By)27 b(default,)g(this)1110 4751 y(v)-5 |
6e51e0d0 | 15979 | b(ariable)31 b(is)g(set)f(to)i(`)p Ft(off)p Fu('.)630 |
8a0829e9 | 15980 | 4902 y Ft(input-meta)1110 5011 y Fu(If)f(set)g(to)h(`)p |
6e51e0d0 | 15981 | Ft(on)p Fu(',)g(Readline)g(will)f(enable)h(eigh)m(t-bit)h(input)d(\(it) |
8a0829e9 | 15982 | i(will)f(not)h(clear)1110 5121 y(the)40 b(eigh)m(th)g(bit)g(in)f(the)h |
220537f2 | 15983 | (c)m(haracters)h(it)f(reads\),)j(regardless)c(of)h(what)g(the)1110 |
8a0829e9 | 15984 | 5230 y(terminal)g(claims)h(it)g(can)f(supp)s(ort.)68 |
6e51e0d0 | 15985 | b(The)39 b(default)h(v)-5 b(alue)40 b(is)g(`)p Ft(off)p |
8a0829e9 CR |
15986 | Fu('.)69 b(The)1110 5340 y(name)30 b Ft(meta-flag)e Fu(is)j(a)f(synon)m |
15987 | (ym)g(for)g(this)h(v)-5 b(ariable.)p eop end | |
900a813b CR |
15988 | %%Page: 110 116 |
15989 | TeXDict begin 110 115 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
15990 | b(Command)29 b(Line)i(Editing)2062 b(110)630 299 y Ft | |
8a0829e9 CR |
15991 | (isearch-terminators)1110 408 y Fu(The)51 b(string)h(of)g(c)m |
15992 | (haracters)h(that)f(should)e(terminate)j(an)f(incremen)m(tal)1110 | |
15993 | 518 y(searc)m(h)25 b(without)g(subsequen)m(tly)g(executing)h(the)f(c)m | |
15994 | (haracter)h(as)f(a)g(command)1110 628 y(\(see)38 b(Section)g(8.2.5)h | |
900a813b | 15995 | ([Searc)m(hing],)h(page)e(105\).)62 b(If)37 b(this)g(v)-5 |
8a0829e9 | 15996 | b(ariable)38 b(has)f(not)1110 737 y(b)s(een)e(giv)m(en)h(a)g(v)-5 |
6e51e0d0 | 15997 | b(alue,)37 b(the)f(c)m(haracters)h Ft(ESC)d Fu(and)h |
8a0829e9 | 15998 | Fj(C-J)g Fu(will)h(terminate)g(an)1110 847 y(incremen)m(tal)c(searc)m |
037a8b7f | 15999 | (h.)630 1029 y Ft(keymap)192 b Fu(Sets)39 b(Readline's)g(idea)h(of)f |
9f178efb | 16000 | (the)g(curren)m(t)f(k)m(eymap)h(for)g(k)m(ey)g(binding)f(com-)1110 |
037a8b7f CR |
16001 | 1139 y(mands.)81 b(Acceptable)47 b Ft(keymap)42 b Fu(names)i(are)h |
16002 | Ft(emacs)p Fu(,)i Ft(emacs-standard)p Fu(,)1110 1249 | |
6e51e0d0 CR |
16003 | y Ft(emacs-meta)p Fu(,)99 b Ft(emacs-ctlx)p Fu(,)f Ft(vi)p |
16004 | Fu(,)j Ft(vi-move)p Fu(,)f Ft(vi-command)p Fu(,)f(and)1110 | |
037a8b7f CR |
16005 | 1358 y Ft(vi-insert)p Fu(.)81 b Ft(vi)44 b Fu(is)h(equiv)-5 |
16006 | b(alen)m(t)46 b(to)g Ft(vi-command)c Fu(\()p Ft(vi-move)h | |
16007 | Fu(is)i(also)h(a)1110 1468 y(synon)m(ym\);)g Ft(emacs)39 | |
16008 | b Fu(is)i(equiv)-5 b(alen)m(t)42 b(to)g Ft(emacs-standard)p | |
16009 | Fu(.)68 b(The)40 b(default)1110 1577 y(v)-5 b(alue)52 | |
16010 | b(is)f Ft(emacs)p Fu(.)103 b(The)51 b(v)-5 b(alue)52 | |
16011 | b(of)f(the)h Ft(editing-mode)c Fu(v)-5 b(ariable)52 b(also)1110 | |
16012 | 1687 y(a\013ects)32 b(the)e(default)h(k)m(eymap.)630 | |
16013 | 1870 y Ft(keyseq-timeout)1110 1979 y Fu(Sp)s(eci\014es)25 | |
16014 | b(the)g(duration)g(Readline)h(will)g(w)m(ait)g(for)g(a)f(c)m(haracter)i | |
16015 | (when)e(read-)1110 2089 y(ing)30 b(an)g(am)m(biguous)g(k)m(ey)h | |
16016 | (sequence)f(\(one)g(that)h(can)f(form)g(a)g(complete)h(k)m(ey)1110 | |
16017 | 2198 y(sequence)j(using)e(the)i(input)e(read)h(so)g(far,)h(or)g(can)f | |
16018 | (tak)m(e)i(additional)f(input)1110 2308 y(to)g(complete)g(a)f(longer)h | |
16019 | (k)m(ey)f(sequence\).)49 b(If)33 b(no)f(input)g(is)h(receiv)m(ed)h | |
16020 | (within)1110 2418 y(the)43 b(timeout,)48 b(Readline)43 | |
16021 | b(will)g(use)g(the)g(shorter)g(but)f(complete)j(k)m(ey)e(se-)1110 | |
16022 | 2527 y(quence.)c(Readline)26 b(uses)f(this)h(v)-5 b(alue)26 | |
16023 | b(to)g(determine)g(whether)f(or)g(not)h(input)1110 2637 | |
16024 | y(is)31 b(a)m(v)-5 b(ailable)33 b(on)d(the)h(curren)m(t)f(input)g | |
16025 | (source)h(\()p Ft(rl_instream)d Fu(b)m(y)i(default\).)1110 | |
16026 | 2746 y(The)25 b(v)-5 b(alue)26 b(is)f(sp)s(eci\014ed)f(in)h | |
8a0829e9 | 16027 | (milliseconds,)j(so)d(a)h(v)-5 b(alue)26 b(of)f(1000)i(means)e(that) |
037a8b7f | 16028 | 1110 2856 y(Readline)e(will)g(w)m(ait)g(one)g(second)f(for)g |
8a0829e9 | 16029 | (additional)i(input.)37 b(If)22 b(this)g(v)-5 b(ariable)23 |
037a8b7f | 16030 | b(is)1110 2966 y(set)28 b(to)h(a)f(v)-5 b(alue)29 b(less)f(than)g(or)f |
8a0829e9 | 16031 | (equal)i(to)f(zero,)i(or)e(to)g(a)h(non-n)m(umeric)e(v)-5 |
037a8b7f | 16032 | b(alue,)1110 3075 y(Readline)30 b(will)f(w)m(ait)i(un)m(til)e(another)h |
8a0829e9 | 16033 | (k)m(ey)g(is)f(pressed)g(to)h(decide)f(whic)m(h)g(k)m(ey)1110 |
037a8b7f CR |
16034 | 3185 y(sequence)i(to)g(complete.)42 b(The)30 b(default)g(v)-5 |
16035 | b(alue)31 b(is)g Ft(500)p Fu(.)630 3367 y Ft(mark-directories)1110 | |
16036 | 3477 y Fu(If)38 b(set)g(to)h(`)p Ft(on)p Fu(',)i(completed)e(directory) | |
8a0829e9 | 16037 | f(names)g(ha)m(v)m(e)i(a)e(slash)g(app)s(ended.)1110 |
037a8b7f CR |
16038 | 3587 y(The)30 b(default)g(is)h(`)p Ft(on)p Fu('.)630 |
16039 | 3769 y Ft(mark-modified-lines)1110 3879 y Fu(This)k(v)-5 | |
8a0829e9 | 16040 | b(ariable,)38 b(when)d(set)h(to)h(`)p Ft(on)p Fu(',)g(causes)g |
037a8b7f | 16041 | (Readline)f(to)h(displa)m(y)f(an)f(as-)1110 3988 y(terisk)f(\(`)p |
8a0829e9 | 16042 | Ft(*)p Fu('\))h(at)f(the)g(start)g(of)g(history)g(lines)g(whic)m(h)f |
037a8b7f | 16043 | (ha)m(v)m(e)i(b)s(een)e(mo)s(di\014ed.)1110 4098 y(This)d(v)-5 |
8a0829e9 | 16044 | b(ariable)31 b(is)f(`)p Ft(off)p Fu(')g(b)m(y)g(default.)630 |
037a8b7f | 16045 | 4281 y Ft(mark-symlinked-directori)o(es)1110 4390 y Fu(If)59 |
8a0829e9 | 16046 | b(set)h(to)g(`)p Ft(on)p Fu(',)67 b(completed)60 b(names)f(whic)m(h)g |
037a8b7f | 16047 | (are)h(sym)m(b)s(olic)g(links)f(to)1110 4500 y(directories)71 |
8a0829e9 | 16048 | b(ha)m(v)m(e)f(a)g(slash)f(app)s(ended)f(\(sub)5 b(ject)70 |
037a8b7f | 16049 | b(to)g(the)g(v)-5 b(alue)70 b(of)1110 4609 y Ft(mark-directories)p |
8a0829e9 CR |
16050 | Fu(\).)37 b(The)30 b(default)g(is)g(`)p Ft(off)p Fu('.)630 |
16051 | 4792 y Ft(match-hidden-files)1110 4902 y Fu(This)21 b(v)-5 | |
16052 | b(ariable,)25 b(when)d(set)g(to)h(`)p Ft(on)p Fu(',)h(causes)f | |
16053 | (Readline)g(to)g(matc)m(h)g(\014les)f(whose)1110 5011 | |
16054 | y(names)44 b(b)s(egin)g(with)g(a)g(`)p Ft(.)p Fu(')g(\(hidden)f | |
16055 | (\014les\))i(when)e(p)s(erforming)g(\014lename)1110 5121 | |
16056 | y(completion.)75 b(If)41 b(set)g(to)h(`)p Ft(off)p Fu(',)i(the)e | |
16057 | (leading)g(`)p Ft(.)p Fu(')f(m)m(ust)g(b)s(e)g(supplied)f(b)m(y)1110 | |
16058 | 5230 y(the)34 b(user)g(in)g(the)g(\014lename)g(to)h(b)s(e)f(completed.) | |
16059 | 53 b(This)33 b(v)-5 b(ariable)35 b(is)f(`)p Ft(on)p Fu(')g(b)m(y)1110 | |
16060 | 5340 y(default.)p eop end | |
900a813b CR |
16061 | %%Page: 111 117 |
16062 | TeXDict begin 111 116 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16063 | b(Command)29 b(Line)i(Editing)2062 b(111)630 299 y Ft | |
8a0829e9 CR |
16064 | (menu-complete-display-pr)o(efix)1110 408 y Fu(If)33 |
16065 | b(set)h(to)g(`)p Ft(on)p Fu(',)h(men)m(u)e(completion)i(displa)m(ys)e | |
16066 | (the)h(common)g(pre\014x)e(of)i(the)1110 518 y(list)k(of)g(p)s(ossible) | |
16067 | f(completions)i(\(whic)m(h)e(ma)m(y)h(b)s(e)f(empt)m(y\))i(b)s(efore)e | |
16068 | (cycling)1110 628 y(through)30 b(the)g(list.)42 b(The)29 | |
16069 | b(default)i(is)f(`)p Ft(off)p Fu('.)630 792 y Ft(output-meta)1110 | |
16070 | 902 y Fu(If)35 b(set)h(to)g(`)p Ft(on)p Fu(',)h(Readline)f(will)g | |
16071 | (displa)m(y)f(c)m(haracters)i(with)e(the)h(eigh)m(th)g(bit)1110 | |
16072 | 1011 y(set)h(directly)g(rather)f(than)g(as)h(a)g(meta-pre\014xed)f | |
16073 | (escap)s(e)h(sequence.)59 b(The)1110 1121 y(default)31 | |
16074 | b(is)f(`)p Ft(off)p Fu('.)630 1285 y Ft(page-completions)1110 | |
16075 | 1395 y Fu(If)j(set)i(to)f(`)p Ft(on)p Fu(',)h(Readline)g(uses)e(an)h | |
16076 | (in)m(ternal)h Ft(more)p Fu(-lik)m(e)f(pager)g(to)h(displa)m(y)1110 | |
16077 | 1504 y(a)e(screenful)f(of)g(p)s(ossible)g(completions)i(at)f(a)g(time.) | |
6e51e0d0 | 16078 | 47 b(This)31 b(v)-5 b(ariable)34 b(is)e(`)p Ft(on)p Fu(')1110 |
8a0829e9 CR |
16079 | 1614 y(b)m(y)e(default.)630 1778 y Ft(print-completions-horizo)o(ntal)o |
16080 | (ly)1110 1888 y Fu(If)23 b(set)i(to)g(`)p Ft(on)p Fu(',)g(Readline)g | |
37c41ab1 | 16081 | (will)f(displa)m(y)g(completions)h(with)f(matc)m(hes)h(sorted)1110 |
8a0829e9 CR |
16082 | 1998 y(horizon)m(tally)45 b(in)e(alphab)s(etical)i(order,)i(rather)c |
16083 | (than)g(do)m(wn)g(the)h(screen.)1110 2107 y(The)30 b(default)g(is)h(`)p | |
16084 | Ft(off)p Fu('.)630 2271 y Ft(revert-all-at-newline)1110 | |
16085 | 2381 y Fu(If)e(set)h(to)g(`)p Ft(on)p Fu(',)g(Readline)g(will)g(undo)f | |
a8fd3f3e | 16086 | (all)h(c)m(hanges)h(to)f(history)g(lines)f(b)s(efore)1110 |
8a0829e9 CR |
16087 | 2491 y(returning)f(when)f Ft(accept-line)f Fu(is)j(executed.)41 |
16088 | b(By)29 b(default,)g(history)g(lines)1110 2600 y(ma)m(y)42 | |
a8fd3f3e | 16089 | b(b)s(e)g(mo)s(di\014ed)e(and)h(retain)i(individual)e(undo)g(lists)h |
8a0829e9 CR |
16090 | (across)g(calls)h(to)1110 2710 y Ft(readline)p Fu(.)38 |
16091 | b(The)30 b(default)h(is)f(`)p Ft(off)p Fu('.)630 2874 | |
16092 | y Ft(show-all-if-ambiguous)1110 2984 y Fu(This)f(alters)i(the)f | |
16093 | (default)g(b)s(eha)m(vior)g(of)g(the)h(completion)g(functions.)40 | |
16094 | b(If)29 b(set)1110 3093 y(to)f(`)p Ft(on)p Fu(',)g(w)m(ords)f(whic)m(h) | |
16095 | g(ha)m(v)m(e)i(more)f(than)f(one)h(p)s(ossible)f(completion)h(cause) | |
16096 | 1110 3203 y(the)39 b(matc)m(hes)h(to)g(b)s(e)e(listed)h(immediately)i | |
16097 | (instead)e(of)g(ringing)g(the)g(b)s(ell.)1110 3313 y(The)30 | |
15baad62 | 16098 | b(default)g(v)-5 b(alue)31 b(is)g(`)p Ft(off)p Fu('.)630 |
8a0829e9 | 16099 | 3477 y Ft(show-all-if-unmodified)1110 3587 y Fu(This)38 |
15baad62 | 16100 | b(alters)h(the)g(default)g(b)s(eha)m(vior)g(of)f(the)h(completion)h |
8a0829e9 | 16101 | (functions)e(in)h(a)1110 3696 y(fashion)25 b(similar)h(to)g |
15baad62 | 16102 | Fr(sho)m(w-all-if-am)m(biguous)p Fu(.)41 b(If)25 b(set)h(to)h(`)p |
8a0829e9 | 16103 | Ft(on)p Fu(',)f(w)m(ords)f(whic)m(h)1110 3806 y(ha)m(v)m(e)32 |
15baad62 | 16104 | b(more)f(than)f(one)i(p)s(ossible)e(completion)i(without)f(an)m(y)g(p)s |
8a0829e9 CR |
16105 | (ossible)f(par-)1110 3915 y(tial)43 b(completion)h(\(the)f(p)s(ossible) |
16106 | f(completions)h(don't)f(share)g(a)h(common)1110 4025 | |
15baad62 | 16107 | y(pre\014x\))30 b(cause)g(the)h(matc)m(hes)g(to)g(b)s(e)f(listed)g |
8a0829e9 | 16108 | (immediately)i(instead)e(of)h(ring-)1110 4134 y(ing)g(the)f(b)s(ell.)41 |
15baad62 | 16109 | b(The)30 b(default)g(v)-5 b(alue)31 b(is)f(`)p Ft(off)p |
8a0829e9 CR |
16110 | Fu('.)630 4299 y Ft(show-mode-in-prompt)1110 4408 y Fu(If)g(set)g(to)h |
16111 | (`)p Ft(on)p Fu(',)f(add)f(a)i(c)m(haracter)g(to)g(the)f(b)s(eginning)g | |
16112 | (of)g(the)g(prompt)f(indi-)1110 4518 y(cating)j(the)g(editing)f(mo)s | |
16113 | (de:)42 b(emacs,)33 b(vi)e(command,)g(or)g(vi)g(insertion.)43 | |
16114 | b(The)1110 4628 y(mo)s(de)30 b(strings)g(are)h(user-settable.)42 | |
16115 | b(The)30 b(default)g(v)-5 b(alue)31 b(is)g(`)p Ft(off)p | |
16116 | Fu('.)630 4792 y Ft(skip-completed-text)1110 4902 y Fu(If)h(set)i(to)f | |
16117 | (`)p Ft(on)p Fu(',)h(this)f(alters)g(the)g(default)g(completion)h(b)s | |
16118 | (eha)m(vior)f(when)f(in-)1110 5011 y(serting)d(a)h(single)g(matc)m(h)f | |
16119 | (in)m(to)h(the)g(line.)40 b(It's)30 b(only)f(activ)m(e)i(when)d(p)s | |
16120 | (erform-)1110 5121 y(ing)35 b(completion)h(in)e(the)h(middle)f(of)h(a)f | |
16121 | (w)m(ord.)53 b(If)35 b(enabled,)g(readline)g(do)s(es)1110 | |
16122 | 5230 y(not)41 b(insert)f(c)m(haracters)i(from)e(the)h(completion)h | |
16123 | (that)f(matc)m(h)g(c)m(haracters)1110 5340 y(after)c(p)s(oin)m(t)g(in)g | |
15baad62 | 16124 | (the)g(w)m(ord)f(b)s(eing)g(completed,)k(so)d(p)s(ortions)f(of)h(the)g |
8a0829e9 | 16125 | (w)m(ord)p eop end |
900a813b CR |
16126 | %%Page: 112 118 |
16127 | TeXDict begin 112 117 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16128 | b(Command)29 b(Line)i(Editing)2062 b(112)1110 299 y(follo)m(wing)33 | |
8a0829e9 CR |
16129 | b(the)f(cursor)f(are)h(not)g(duplicated.)45 b(F)-8 b(or)32 |
16130 | b(instance,)h(if)f(this)f(is)h(en-)1110 408 y(abled,)43 | |
16131 | b(attempting)f(completion)g(when)d(the)i(cursor)f(is)g(after)h(the)g(`) | |
16132 | p Ft(e)p Fu(')f(in)1110 518 y(`)p Ft(Makefile)p Fu(')c(will)i(result)f | |
16133 | (in)g(`)p Ft(Makefile)p Fu(')f(rather)h(than)h(`)p Ft(Makefilefile)p | |
16134 | Fu(',)1110 628 y(assuming)d(there)g(is)h(a)f(single)h(p)s(ossible)f | |
16135 | (completion.)56 b(The)35 b(default)g(v)-5 b(alue)1110 | |
16136 | 737 y(is)30 b(`)p Ft(off)p Fu('.)630 894 y Ft(vi-cmd-mode-string)1110 | |
16137 | 1003 y Fu(This)f(string)h(is)f(displa)m(y)m(ed)i(immediately)g(b)s | |
16138 | (efore)e(the)h(last)g(line)h(of)e(the)h(pri-)1110 1113 | |
16139 | y(mary)21 b(prompt)g(when)f(vi)i(editing)g(mo)s(de)f(is)g(activ)m(e)j | |
16140 | (and)d(in)g(command)g(mo)s(de.)1110 1223 y(The)38 b(v)-5 | |
16141 | b(alue)39 b(is)f(expanded)f(lik)m(e)j(a)f(k)m(ey)g(binding,)g(so)g(the) | |
16142 | f(standard)g(set)h(of)1110 1332 y(meta-)30 b(and)e(con)m(trol)i | |
16143 | (pre\014xes)e(and)g(bac)m(kslash)h(escap)s(e)g(sequences)g(is)g(a)m(v) | |
16144 | -5 b(ail-)1110 1442 y(able.)50 b(Use)33 b(the)h(`)p Ft(\\1)p | |
16145 | Fu(')f(and)g(`)p Ft(\\2)p Fu(')g(escap)s(es)g(to)h(b)s(egin)f(and)g | |
16146 | (end)f(sequences)i(of)1110 1551 y(non-prin)m(ting)40 | |
16147 | b(c)m(haracters,)45 b(whic)m(h)40 b(can)g(b)s(e)g(used)g(to)h(em)m(b)s | |
16148 | (ed)f(a)g(terminal)1110 1661 y(con)m(trol)32 b(sequence)f(in)m(to)g | |
16149 | (the)f(mo)s(de)g(string.)41 b(The)30 b(default)h(is)f(`)p | |
16150 | Ft(\(cmd\))p Fu('.)630 1817 y Ft(vi-ins-mode-string)1110 | |
16151 | 1927 y Fu(This)f(string)h(is)f(displa)m(y)m(ed)i(immediately)g(b)s | |
16152 | (efore)e(the)h(last)g(line)h(of)e(the)h(pri-)1110 2037 | |
16153 | y(mary)25 b(prompt)f(when)g(vi)h(editing)h(mo)s(de)e(is)i(activ)m(e)h | |
16154 | (and)d(in)h(insertion)g(mo)s(de.)1110 2146 y(The)38 b(v)-5 | |
16155 | b(alue)39 b(is)f(expanded)f(lik)m(e)j(a)f(k)m(ey)g(binding,)g(so)g(the) | |
16156 | f(standard)g(set)h(of)1110 2256 y(meta-)30 b(and)e(con)m(trol)i | |
16157 | (pre\014xes)e(and)g(bac)m(kslash)h(escap)s(e)g(sequences)g(is)g(a)m(v) | |
16158 | -5 b(ail-)1110 2365 y(able.)50 b(Use)33 b(the)h(`)p Ft(\\1)p | |
16159 | Fu(')f(and)g(`)p Ft(\\2)p Fu(')g(escap)s(es)g(to)h(b)s(egin)f(and)g | |
16160 | (end)f(sequences)i(of)1110 2475 y(non-prin)m(ting)40 | |
16161 | b(c)m(haracters,)45 b(whic)m(h)40 b(can)g(b)s(e)g(used)g(to)h(em)m(b)s | |
16162 | (ed)f(a)g(terminal)1110 2585 y(con)m(trol)32 b(sequence)f(in)m(to)g | |
16163 | (the)f(mo)s(de)g(string.)41 b(The)30 b(default)h(is)f(`)p | |
16164 | Ft(\(ins\))p Fu('.)630 2741 y Ft(visible-stats)1110 2851 | |
16165 | y Fu(If)h(set)i(to)f(`)p Ft(on)p Fu(',)h(a)f(c)m(haracter)i(denoting)e | |
16166 | (a)g(\014le's)g(t)m(yp)s(e)g(is)g(app)s(ended)e(to)j(the)1110 | |
16167 | 2960 y(\014lename)e(when)e(listing)i(p)s(ossible)f(completions.)42 | |
16168 | b(The)30 b(default)g(is)h(`)p Ft(off)p Fu('.)150 3117 | |
16169 | y(Key)f(Bindings)630 3226 y(The)41 b(syn)m(tax)i(for)f(con)m(trolling)h | |
16170 | (k)m(ey)g(bindings)e(in)h(the)g(init)g(\014le)g(is)g(simple.)75 | |
16171 | b(First)43 b(y)m(ou)630 3336 y(need)27 b(to)i(\014nd)d(the)i(name)f(of) | |
16172 | h(the)g(command)f(that)i(y)m(ou)f(w)m(an)m(t)g(to)g(c)m(hange.)41 | |
16173 | b(The)27 b(follo)m(wing)630 3446 y(sections)37 b(con)m(tain)g(tables)g | |
16174 | (of)f(the)g(command)f(name,)j(the)e(default)g(k)m(eybinding,)h(if)f(an) | |
16175 | m(y)-8 b(,)630 3555 y(and)30 b(a)h(short)f(description)g(of)h(what)f | |
16176 | (the)g(command)h(do)s(es.)630 3688 y(Once)36 b(y)m(ou)g(kno)m(w)g(the)g | |
16177 | (name)g(of)g(the)g(command,)h(simply)f(place)h(on)e(a)i(line)f(in)g | |
16178 | (the)g(init)630 3798 y(\014le)e(the)g(name)f(of)h(the)g(k)m(ey)g(y)m | |
16179 | (ou)g(wish)f(to)h(bind)f(the)h(command)f(to,)i(a)f(colon,)i(and)d(then) | |
16180 | 630 3907 y(the)f(name)h(of)f(the)g(command.)46 b(There)32 | |
220537f2 | 16181 | b(can)g(b)s(e)g(no)g(space)g(b)s(et)m(w)m(een)h(the)f(k)m(ey)h(name)g |
8a0829e9 | 16182 | (and)630 4017 y(the)41 b(colon)h({)f(that)g(will)g(b)s(e)g(in)m |
220537f2 | 16183 | (terpreted)g(as)g(part)f(of)h(the)g(k)m(ey)h(name.)72 |
8a0829e9 | 16184 | b(The)40 b(name)h(of)630 4127 y(the)35 b(k)m(ey)g(can)g(b)s(e)f |
eb0b2ad8 | 16185 | (expressed)f(in)i(di\013eren)m(t)g(w)m(a)m(ys,)h(dep)s(ending)d(on)h |
8a0829e9 CR |
16186 | (what)h(y)m(ou)g(\014nd)e(most)630 4236 y(comfortable.)630 |
16187 | 4369 y(In)i(addition)h(to)h(command)f(names,)i(readline)e(allo)m(ws)h | |
220537f2 | 16188 | (k)m(eys)g(to)g(b)s(e)e(b)s(ound)f(to)j(a)f(string)630 |
8a0829e9 CR |
16189 | 4479 y(that)31 b(is)f(inserted)h(when)e(the)i(k)m(ey)g(is)f(pressed)g |
16190 | (\(a)h Fr(macro)5 b Fu(\).)630 4612 y(The)42 b Ft(bind)30 | |
16191 | b(-p)42 b Fu(command)h(displa)m(ys)g(Readline)g(function)g(names)g(and) | |
16192 | f(bindings)g(in)h(a)630 4722 y(format)37 b(that)h(can)f(put)f(directly) | |
16193 | i(in)m(to)g(an)f(initialization)j(\014le.)60 b(See)38 | |
16194 | b(Section)f(4.2)i([Bash)630 4831 y(Builtins],)31 b(page)g(48.)630 | |
16195 | 4988 y Fr(k)m(eyname)5 b Fu(:)42 b Fr(function-name)35 | |
16196 | b Fu(or)c Fr(macro)1110 5097 y(k)m(eyname)k Fu(is)29 | |
16197 | b(the)f(name)h(of)g(a)g(k)m(ey)h(sp)s(elled)e(out)h(in)g(English.)39 | |
16198 | b(F)-8 b(or)30 b(example:)1350 5230 y Ft(Control-u:)45 | |
16199 | b(universal-argument)1350 5340 y(Meta-Rubout:)f(backward-kill-word)p | |
16200 | eop end | |
900a813b CR |
16201 | %%Page: 113 119 |
16202 | TeXDict begin 113 118 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16203 | b(Command)29 b(Line)i(Editing)2062 b(113)1350 299 y Ft(Control-o:)45 | |
8a0829e9 CR |
16204 | b(">)i(output")1110 433 y Fu(In)94 b(the)g(ab)s(o)m(v)m(e)i(example,) |
16205 | 111 b Fj(C-u)94 b Fu(is)g(b)s(ound)f(to)i(the)f(function)1110 | |
16206 | 542 y Ft(universal-argument)p Fu(,)124 b Fj(M-DEL)107 | |
16207 | b Fu(is)i(b)s(ound)e(to)j(the)f(function)1110 652 y Ft | |
16208 | (backward-kill-word)p Fu(,)75 b(and)69 b Fj(C-o)g Fu(is)h(b)s(ound)e | |
16209 | (to)j(run)d(the)i(macro)1110 762 y(expressed)45 b(on)h(the)g(righ)m(t)g | |
16210 | (hand)e(side)i(\(that)h(is,)i(to)e(insert)e(the)h(text)h(`)p | |
16211 | Ft(>)1110 871 y(output)p Fu(')29 b(in)m(to)i(the)g(line\).)1110 | |
16212 | 1005 y(A)62 b(n)m(um)m(b)s(er)e(of)i(sym)m(b)s(olic)h(c)m(haracter)g | |
16213 | (names)f(are)g(recognized)h(while)1110 1115 y(pro)s(cessing)40 | |
6e51e0d0 CR |
16214 | b(this)f(k)m(ey)i(binding)e(syn)m(tax:)60 b Fr(DEL)p |
16215 | Fu(,)42 b Fr(ESC)p Fu(,)g Fr(ESCAPE)p Fu(,)f Fr(LFD)p | |
8a0829e9 | 16216 | Fu(,)1110 1224 y Fr(NEWLINE)p Fu(,)31 b Fr(RET)p Fu(,)f |
6e51e0d0 CR |
16217 | Fr(RETURN)p Fu(,)g Fr(R)m(UBOUT)p Fu(,)h Fr(SP)-8 b(A)m(CE)p |
16218 | Fu(,)31 b Fr(SPC)p Fu(,)e(and)h Fr(T)-8 b(AB)p Fu(.)630 | |
8a0829e9 CR |
16219 | 1383 y Ft(")p Fr(k)m(eyseq)r Ft(")p Fu(:)41 b Fr(function-name)36 |
16220 | b Fu(or)30 b Fr(macro)1110 1492 y(k)m(eyseq)k Fu(di\013ers)d(from)f | |
6e51e0d0 | 16221 | Fr(k)m(eyname)37 b Fu(ab)s(o)m(v)m(e)32 b(in)f(that)h(strings)f |
8a0829e9 | 16222 | (denoting)g(an)g(en-)1110 1602 y(tire)j(k)m(ey)h(sequence)f(can)g(b)s |
a8fd3f3e | 16223 | (e)f(sp)s(eci\014ed,)h(b)m(y)f(placing)i(the)f(k)m(ey)g(sequence)g(in) |
8a0829e9 | 16224 | 1110 1711 y(double)29 b(quotes.)41 b(Some)29 b Fm(gnu)h |
6e51e0d0 | 16225 | Fu(Emacs)f(st)m(yle)i(k)m(ey)f(escap)s(es)g(can)g(b)s(e)f(used,)g(as) |
8a0829e9 CR |
16226 | 1110 1821 y(in)k(the)h(follo)m(wing)i(example,)f(but)e(the)h(sp)s |
16227 | (ecial)h(c)m(haracter)g(names)f(are)g(not)1110 1931 y(recognized.)1350 | |
16228 | 2064 y Ft("\\C-u":)46 b(universal-argument)1350 2174 | |
16229 | y("\\C-x\\C-r":)f(re-read-init-file)1350 2284 y("\\e[11~":)g("Function) | |
16230 | h(Key)g(1")1110 2418 y Fu(In)64 b(the)g(ab)s(o)m(v)m(e)i(example,)74 | |
6e51e0d0 | 16231 | b Fj(C-u)64 b Fu(is)g(again)i(b)s(ound)c(to)k(the)e(function)1110 |
8a0829e9 CR |
16232 | 2527 y Ft(universal-argument)39 b Fu(\(just)k(as)h(it)g(w)m(as)g(in)g |
16233 | (the)f(\014rst)g(example\),)49 b(`)p Fj(C-x)1110 2637 | |
6e51e0d0 CR |
16234 | y(C-r)p Fu(')30 b(is)g(b)s(ound)e(to)j(the)g(function)f |
16235 | Ft(re-read-init-file)p Fu(,)c(and)j(`)p Ft(ESC)h([)g(1)g(1)1110 | |
8a0829e9 CR |
16236 | 2746 y(~)p Fu(')g(is)h(b)s(ound)d(to)j(insert)f(the)h(text)g(`)p |
16237 | Ft(Function)e(Key)g(1)p Fu('.)630 2905 y(The)g(follo)m(wing)i | |
6e51e0d0 | 16238 | Fm(gnu)f Fu(Emacs)g(st)m(yle)h(escap)s(e)f(sequences)g(are)g(a)m(v)-5 |
8a0829e9 CR |
16239 | b(ailable)32 b(when)d(sp)s(ecifying)630 3014 y(k)m(ey)i(sequences:)630 |
16240 | 3173 y Fj(\\C-)336 b Fu(con)m(trol)32 b(pre\014x)630 | |
16241 | 3331 y Fj(\\M-)336 b Fu(meta)31 b(pre\014x)630 3489 y | |
6e51e0d0 | 16242 | Fj(\\e)384 b Fu(an)30 b(escap)s(e)h(c)m(haracter)630 |
8a0829e9 | 16243 | 3647 y Fj(\\\\)384 b Fu(bac)m(kslash)630 3806 y Fj(\\)p |
6e51e0d0 | 16244 | Ft(")g(")p Fu(,)30 b(a)h(double)f(quotation)i(mark)630 |
8a0829e9 CR |
16245 | 3964 y Fj(\\')384 b Ft(')p Fu(,)30 b(a)h(single)g(quote)g(or)f(ap)s |
16246 | (ostrophe)630 4122 y(In)d(addition)h(to)g(the)g Fm(gnu)f | |
6e51e0d0 | 16247 | Fu(Emacs)h(st)m(yle)h(escap)s(e)f(sequences,)h(a)f(second)f(set)h(of)g |
8a0829e9 CR |
16248 | (bac)m(kslash)630 4232 y(escap)s(es)j(is)f(a)m(v)-5 b(ailable:)630 |
16249 | 4390 y Ft(\\a)384 b Fu(alert)31 b(\(b)s(ell\))630 4548 | |
16250 | y Ft(\\b)384 b Fu(bac)m(kspace)630 4707 y Ft(\\d)g Fu(delete)630 | |
16251 | 4865 y Ft(\\f)g Fu(form)30 b(feed)630 5023 y Ft(\\n)384 | |
16252 | b Fu(newline)630 5182 y Ft(\\r)g Fu(carriage)32 b(return)630 | |
16253 | 5340 y Ft(\\t)384 b Fu(horizon)m(tal)32 b(tab)p eop end | |
900a813b CR |
16254 | %%Page: 114 120 |
16255 | TeXDict begin 114 119 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16256 | b(Command)29 b(Line)i(Editing)2062 b(114)630 299 y Ft(\\v)384 | |
8a0829e9 CR |
16257 | b Fu(v)m(ertical)32 b(tab)630 451 y Ft(\\)p Fj(nnn)288 |
16258 | b Fu(the)35 b(eigh)m(t-bit)h(c)m(haracter)g(whose)e(v)-5 | |
16259 | b(alue)35 b(is)g(the)f(o)s(ctal)i(v)-5 b(alue)35 b Fr(nnn)e | |
16260 | Fu(\(one)i(to)1110 561 y(three)c(digits\))630 713 y Ft(\\x)p | |
16261 | Fj(HH)288 b Fu(the)38 b(eigh)m(t-bit)i(c)m(haracter)g(whose)e(v)-5 | |
16262 | b(alue)39 b(is)f(the)h(hexadecimal)g(v)-5 b(alue)39 b | |
16263 | Fr(HH)1110 823 y Fu(\(one)31 b(or)f(t)m(w)m(o)i(hex)e(digits\))630 | |
16264 | 975 y(When)37 b(en)m(tering)h(the)g(text)g(of)g(a)g(macro,)i(single)e | |
16265 | (or)f(double)g(quotes)h(m)m(ust)f(b)s(e)g(used)f(to)630 | |
16266 | 1085 y(indicate)23 b(a)e(macro)h(de\014nition.)38 b(Unquoted)21 | |
16267 | b(text)i(is)e(assumed)g(to)h(b)s(e)f(a)h(function)f(name.)38 | |
16268 | b(In)630 1194 y(the)22 b(macro)f(b)s(o)s(dy)-8 b(,)23 | |
16269 | b(the)e(bac)m(kslash)h(escap)s(es)g(describ)s(ed)e(ab)s(o)m(v)m(e)j | |
16270 | (are)e(expanded.)37 b(Bac)m(kslash)630 1304 y(will)j(quote)h(an)m(y)f | |
16271 | (other)g(c)m(haracter)i(in)d(the)i(macro)f(text,)k(including)39 | |
6e51e0d0 | 16272 | b(`)p Ft(")p Fu(')h(and)g(`)p Ft(')p Fu('.)69 b(F)-8 |
8a0829e9 | 16273 | b(or)630 1414 y(example,)28 b(the)e(follo)m(wing)h(binding)d(will)i |
6e51e0d0 | 16274 | (mak)m(e)h(`)p Fj(C-x)j Ft(\\)p Fu(')c(insert)f(a)h(single)h(`)p |
8a0829e9 CR |
16275 | Ft(\\)p Fu(')f(in)m(to)g(the)g(line:)870 1545 y Ft("\\C-x\\\\":)45 |
16276 | b("\\\\")150 1737 y Fk(8.3.2)63 b(Conditional)41 b(Init)g(Constructs) | |
16277 | 150 1884 y Fu(Readline)c(implemen)m(ts)g(a)h(facilit)m(y)g(similar)f | |
278286c9 | 16278 | (in)g(spirit)f(to)i(the)f(conditional)h(compilation)g(features)f(of)150 |
8a0829e9 | 16279 | 1993 y(the)31 b(C)f(prepro)s(cessor)g(whic)m(h)g(allo)m(ws)i(k)m(ey)g |
278286c9 | 16280 | (bindings)d(and)h(v)-5 b(ariable)32 b(settings)f(to)h(b)s(e)e(p)s |
8a0829e9 | 16281 | (erformed)f(as)i(the)150 2103 y(result)f(of)h(tests.)41 |
278286c9 | 16282 | b(There)30 b(are)h(four)f(parser)f(directiv)m(es)j(used.)150 |
8a0829e9 | 16283 | 2255 y Ft($if)336 b Fu(The)31 b Ft($if)f Fu(construct)i(allo)m(ws)h |
278286c9 | 16284 | (bindings)d(to)i(b)s(e)e(made)i(based)f(on)g(the)g(editing)h(mo)s(de,)g |
8a0829e9 | 16285 | (the)630 2365 y(terminal)39 b(b)s(eing)e(used,)j(or)e(the)g |
278286c9 | 16286 | (application)h(using)f(Readline.)64 b(The)38 b(text)h(of)f(the)g(test) |
8a0829e9 | 16287 | 630 2474 y(extends)30 b(to)h(the)g(end)f(of)g(the)h(line;)g(no)f(c)m |
278286c9 | 16288 | (haracters)i(are)f(required)e(to)i(isolate)i(it.)630 |
8a0829e9 | 16289 | 2627 y Ft(mode)288 b Fu(The)30 b Ft(mode=)e Fu(form)i(of)g(the)h |
6e51e0d0 | 16290 | Ft($if)e Fu(directiv)m(e)j(is)e(used)f(to)i(test)g(whether)e(Read-)1110 |
8a0829e9 | 16291 | 2736 y(line)44 b(is)f(in)g Ft(emacs)f Fu(or)h Ft(vi)g |
6e51e0d0 | 16292 | Fu(mo)s(de.)79 b(This)42 b(ma)m(y)i(b)s(e)e(used)h(in)g(conjunction) |
8a0829e9 | 16293 | 1110 2846 y(with)c(the)h(`)p Ft(set)29 b(keymap)p Fu(')38 |
6e51e0d0 | 16294 | b(command,)k(for)d(instance,)j(to)e(set)g(bindings)e(in)1110 |
8a0829e9 CR |
16295 | 2956 y(the)32 b Ft(emacs-standard)c Fu(and)j Ft(emacs-ctlx)d |
16296 | Fu(k)m(eymaps)k(only)g(if)g(Readline)g(is)1110 3065 y(starting)f(out)g | |
16297 | (in)f Ft(emacs)f Fu(mo)s(de.)630 3218 y Ft(term)288 b | |
6e51e0d0 | 16298 | Fu(The)26 b Ft(term=)g Fu(form)g(ma)m(y)i(b)s(e)e(used)g(to)i(include)f |
8a0829e9 | 16299 | (terminal-sp)s(eci\014c)g(k)m(ey)h(bind-)1110 3327 y(ings,)38 |
6e51e0d0 | 16300 | b(p)s(erhaps)c(to)j(bind)e(the)h(k)m(ey)h(sequences)f(output)g(b)m(y)g |
8a0829e9 | 16301 | (the)g(terminal's)1110 3437 y(function)24 b(k)m(eys.)39 |
6e51e0d0 | 16302 | b(The)23 b(w)m(ord)h(on)f(the)i(righ)m(t)f(side)g(of)g(the)g(`)p |
8a0829e9 | 16303 | Ft(=)p Fu(')g(is)g(tested)h(against)1110 3546 y(b)s(oth)k(the)h(full)g |
6e51e0d0 | 16304 | (name)g(of)g(the)g(terminal)h(and)e(the)i(p)s(ortion)e(of)h(the)g |
8a0829e9 | 16305 | (terminal)1110 3656 y(name)k(b)s(efore)f(the)g(\014rst)g(`)p |
6e51e0d0 | 16306 | Ft(-)p Fu('.)50 b(This)33 b(allo)m(ws)i Ft(sun)e Fu(to)h(matc)m(h)g(b)s |
8a0829e9 CR |
16307 | (oth)f Ft(sun)g Fu(and)1110 3766 y Ft(sun-cmd)p Fu(,)c(for)h(instance.) |
16308 | 630 3918 y Ft(application)1110 4028 y Fu(The)21 b Fr(application)j | |
6e51e0d0 | 16309 | Fu(construct)e(is)g(used)f(to)i(include)f(application-sp)s(eci\014c)h |
8a0829e9 | 16310 | (set-)1110 4137 y(tings.)39 b(Eac)m(h)26 b(program)e(using)g(the)h |
6e51e0d0 | 16311 | (Readline)g(library)g(sets)g(the)g Fr(application)1110 |
8a0829e9 | 16312 | 4247 y(name)p Fu(,)g(and)e(y)m(ou)g(can)h(test)g(for)f(a)g(particular)h |
6e51e0d0 | 16313 | (v)-5 b(alue.)39 b(This)22 b(could)h(b)s(e)g(used)f(to)1110 |
8a0829e9 CR |
16314 | 4356 y(bind)32 b(k)m(ey)h(sequences)g(to)h(functions)e(useful)g(for)h |
16315 | (a)g(sp)s(eci\014c)f(program.)48 b(F)-8 b(or)1110 4466 | |
6e51e0d0 | 16316 | y(instance,)35 b(the)e(follo)m(wing)h(command)f(adds)f(a)i(k)m(ey)f |
8a0829e9 CR |
16317 | (sequence)h(that)f(quotes)1110 4575 y(the)e(curren)m(t)f(or)g(previous) |
16318 | g(w)m(ord)g(in)g(Bash:)1350 4706 y Ft($if)47 b(Bash)1350 | |
16319 | 4816 y(#)g(Quote)g(the)g(current)f(or)h(previous)e(word)1350 | |
16320 | 4926 y("\\C-xq":)h("\\eb\\"\\ef\\"")1350 5035 y($endif)150 | |
16321 | 5188 y($endif)192 b Fu(This)29 b(command,)i(as)f(seen)h(in)f(the)g | |
15baad62 | 16322 | (previous)g(example,)h(terminates)g(an)g Ft($if)e Fu(command.)150 |
8a0829e9 CR |
16323 | 5340 y Ft($else)240 b Fu(Commands)29 b(in)h(this)h(branc)m(h)e(of)i |
16324 | (the)f Ft($if)g Fu(directiv)m(e)i(are)f(executed)g(if)f(the)h(test)g | |
16325 | (fails.)p eop end | |
900a813b CR |
16326 | %%Page: 115 121 |
16327 | TeXDict begin 115 120 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16328 | b(Command)29 b(Line)i(Editing)2062 b(115)150 299 y Ft($include)96 | |
8a0829e9 CR |
16329 | b Fu(This)43 b(directiv)m(e)i(tak)m(es)g(a)e(single)i(\014lename)e(as)h |
16330 | (an)f(argumen)m(t)h(and)f(reads)g(commands)630 408 y(and)38 | |
16331 | b(bindings)f(from)h(that)i(\014le.)65 b(F)-8 b(or)39 | |
16332 | b(example,)j(the)d(follo)m(wing)h(directiv)m(e)g(reads)e(from)630 | |
16333 | 518 y Ft(/etc/inputrc)p Fu(:)870 653 y Ft($include)46 | |
16334 | b(/etc/inputrc)150 852 y Fk(8.3.3)63 b(Sample)41 b(Init)g(File)150 | |
16335 | 999 y Fu(Here)27 b(is)f(an)h(example)g(of)f(an)h Fr(inputrc)k | |
16336 | Fu(\014le.)39 b(This)26 b(illustrates)h(k)m(ey)h(binding,)e(v)-5 | |
16337 | b(ariable)27 b(assignmen)m(t,)i(and)150 1108 y(conditional)j(syn)m | |
16338 | (tax.)p eop end | |
900a813b CR |
16339 | %%Page: 116 122 |
16340 | TeXDict begin 116 121 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16341 | b(Command)29 b(Line)i(Editing)2062 b(116)390 408 y Ft(#)47 | |
278286c9 CR |
16342 | b(This)g(file)g(controls)e(the)i(behaviour)e(of)j(line)e(input)h |
16343 | (editing)e(for)390 518 y(#)i(programs)f(that)h(use)g(the)f(GNU)h | |
16344 | (Readline)f(library.)93 b(Existing)390 628 y(#)47 b(programs)f(include) | |
16345 | g(FTP,)g(Bash,)h(and)g(GDB.)390 737 y(#)390 847 y(#)g(You)g(can)g | |
16346 | (re-read)f(the)h(inputrc)f(file)g(with)h(C-x)g(C-r.)390 | |
16347 | 956 y(#)g(Lines)g(beginning)e(with)i('#')g(are)g(comments.)390 | |
d76edd30 CR |
16348 | 1066 y(#)390 1176 y(#)g(First,)g(include)e(any)i(system-wide)e |
16349 | (bindings)h(and)g(variable)390 1285 y(#)h(assignments)e(from)i | |
16350 | (/etc/Inputrc)390 1395 y($include)f(/etc/Inputrc)390 | |
16351 | 1614 y(#)390 1724 y(#)h(Set)g(various)f(bindings)g(for)h(emacs)f(mode.) | |
16352 | 390 1943 y(set)h(editing-mode)d(emacs)390 2162 y($if)j(mode=emacs)390 | |
5e13499c CR |
16353 | 2381 y(Meta-Control-h:)91 b(backward-kill-word)43 b(Text)k(after)f(the) |
16354 | h(function)f(name)g(is)h(ignored)390 2600 y(#)390 2710 | |
16355 | y(#)g(Arrow)g(keys)f(in)i(keypad)e(mode)390 2819 y(#)390 | |
16356 | 2929 y(#"\\M-OD":)379 b(backward-char)390 3039 y(#"\\M-OC":)g | |
16357 | (forward-char)390 3148 y(#"\\M-OA":)g(previous-history)390 | |
16358 | 3258 y(#"\\M-OB":)g(next-history)390 3367 y(#)390 3477 | |
16359 | y(#)47 b(Arrow)g(keys)f(in)i(ANSI)e(mode)390 3587 y(#)390 | |
16360 | 3696 y("\\M-[D":)380 b(backward-char)390 3806 y("\\M-[C":)g | |
16361 | (forward-char)390 3915 y("\\M-[A":)g(previous-history)390 | |
16362 | 4025 y("\\M-[B":)g(next-history)390 4134 y(#)390 4244 | |
16363 | y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(keypad)f(mode)390 | |
16364 | 4354 y(#)390 4463 y(#"\\M-\\C-OD":)331 b(backward-char)390 | |
16365 | 4573 y(#"\\M-\\C-OC":)g(forward-char)390 4682 y(#"\\M-\\C-OA":)g | |
16366 | (previous-history)390 4792 y(#"\\M-\\C-OB":)g(next-history)390 | |
16367 | 4902 y(#)390 5011 y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(ANSI)g(mode) | |
16368 | 390 5121 y(#)390 5230 y(#"\\M-\\C-[D":)331 b(backward-char)390 | |
37c41ab1 | 16369 | 5340 y(#"\\M-\\C-[C":)g(forward-char)p eop end |
900a813b CR |
16370 | %%Page: 117 123 |
16371 | TeXDict begin 117 122 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16372 | b(Command)29 b(Line)i(Editing)2062 b(117)390 299 y Ft(#"\\M-\\C-[A":) | |
ad4aef08 | 16373 | 331 b(previous-history)390 408 y(#"\\M-\\C-[B":)g(next-history)390 |
37c41ab1 CR |
16374 | 628 y(C-q:)47 b(quoted-insert)390 847 y($endif)390 1066 |
16375 | y(#)g(An)h(old-style)d(binding.)93 b(This)47 b(happens)f(to)h(be)g(the) | |
16376 | g(default.)390 1176 y(TAB:)g(complete)390 1395 y(#)g(Macros)g(that)f | |
16377 | (are)h(convenient)e(for)i(shell)f(interaction)390 1504 | |
16378 | y($if)h(Bash)390 1614 y(#)g(edit)g(the)g(path)390 1724 | |
16379 | y("\\C-xp":)f("PATH=${PATH}\\e\\C-e\\C-a)o(\\ef)o(\\C-f)o(")390 | |
16380 | 1833 y(#)h(prepare)f(to)h(type)g(a)h(quoted)e(word)g(--)390 | |
5e13499c CR |
16381 | 1943 y(#)h(insert)g(open)f(and)h(close)f(double)h(quotes)390 |
16382 | 2052 y(#)g(and)g(move)g(to)g(just)g(after)f(the)h(open)g(quote)390 | |
16383 | 2162 y("\\C-x\\"":)e("\\"\\"\\C-b")390 2271 y(#)i(insert)g(a)g | |
16384 | (backslash)e(\(testing)h(backslash)f(escapes)390 2381 | |
16385 | y(#)i(in)h(sequences)d(and)i(macros\))390 2491 y("\\C-x\\\\":)e("\\\\") | |
16386 | 390 2600 y(#)i(Quote)g(the)g(current)f(or)h(previous)e(word)390 | |
16387 | 2710 y("\\C-xq":)h("\\eb\\"\\ef\\"")390 2819 y(#)h(Add)g(a)h(binding)e | |
16388 | (to)h(refresh)f(the)h(line,)f(which)g(is)h(unbound)390 | |
16389 | 2929 y("\\C-xr":)f(redraw-current-line)390 3039 y(#)h(Edit)g(variable)f | |
16390 | (on)h(current)f(line.)390 3148 y("\\M-\\C-v":)f | |
16391 | ("\\C-a\\C-k$\\C-y\\M-\\C-e\\C-)o(a\\C-)o(y=")390 3258 | |
16392 | y($endif)390 3477 y(#)i(use)g(a)h(visible)e(bell)g(if)h(one)g(is)h | |
16393 | (available)390 3587 y(set)f(bell-style)e(visible)390 | |
16394 | 3806 y(#)i(don't)g(strip)f(characters)f(to)i(7)h(bits)e(when)h(reading) | |
16395 | 390 3915 y(set)g(input-meta)e(on)390 4134 y(#)i(allow)g(iso-latin1)e | |
16396 | (characters)g(to)i(be)g(inserted)f(rather)390 4244 y(#)h(than)g | |
16397 | (converted)e(to)j(prefix-meta)c(sequences)390 4354 y(set)j | |
16398 | (convert-meta)d(off)390 4573 y(#)j(display)f(characters)f(with)i(the)g | |
16399 | (eighth)f(bit)h(set)g(directly)390 4682 y(#)g(rather)g(than)f(as)h | |
16400 | (meta-prefixed)e(characters)390 4792 y(set)i(output-meta)e(on)390 | |
16401 | 5011 y(#)i(if)h(there)e(are)h(more)g(than)f(150)h(possible)f | |
16402 | (completions)e(for)390 5121 y(#)j(a)h(word,)e(ask)h(the)g(user)g(if)g | |
16403 | (he)g(wants)f(to)i(see)f(all)f(of)i(them)390 5230 y(set)f | |
37c41ab1 | 16404 | (completion-query-items)42 b(150)p eop end |
900a813b CR |
16405 | %%Page: 118 124 |
16406 | TeXDict begin 118 123 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16407 | b(Command)29 b(Line)i(Editing)2062 b(118)390 299 y Ft(#)47 | |
278286c9 | 16408 | b(For)g(FTP)390 408 y($if)g(Ftp)390 518 y("\\C-xg":)f("get)g(\\M-?")390 |
5e13499c | 16409 | 628 y("\\C-xt":)g("put)g(\\M-?")390 737 y("\\M-.":)g(yank-last-arg)390 |
967625cd CR |
16410 | 847 y($endif)150 1083 y Fs(8.4)68 b(Bindable)45 b(Readline)i(Commands) |
16411 | 150 1242 y Fu(This)32 b(section)h(describ)s(es)f(Readline)h(commands)f | |
c302751c | 16412 | (that)h(ma)m(y)h(b)s(e)d(b)s(ound)g(to)i(k)m(ey)g(sequences.)48 |
967625cd | 16413 | b(Y)-8 b(ou)33 b(can)150 1352 y(list)40 b(y)m(our)f(k)m(ey)i(bindings)d |
6e51e0d0 | 16414 | (b)m(y)h(executing)i Ft(bind)29 b(-P)39 b Fu(or,)j(for)d(a)h(more)g |
967625cd | 16415 | (terse)g(format,)i(suitable)e(for)f(an)150 1461 y Fr(inputrc)34 |
6e51e0d0 | 16416 | b Fu(\014le,)29 b Ft(bind)g(-p)p Fu(.)40 b(\(See)30 b(Section)f(4.2)h |
1101193a | 16417 | ([Bash)g(Builtins],)g(page)g(48.\))41 b(Command)28 b(names)h(without) |
967625cd CR |
16418 | 150 1571 y(an)h(accompan)m(ying)i(k)m(ey)f(sequence)g(are)g(un)m(b)s |
16419 | (ound)d(b)m(y)i(default.)275 1703 y(In)25 b(the)h(follo)m(wing)i | |
6e51e0d0 CR |
16420 | (descriptions,)f Fr(p)s(oin)m(t)h Fu(refers)e(to)h(the)f(curren)m(t)g |
16421 | (cursor)g(p)s(osition,)h(and)f Fr(mark)31 b Fu(refers)150 | |
967625cd | 16422 | 1813 y(to)40 b(a)f(cursor)f(p)s(osition)h(sa)m(v)m(ed)h(b)m(y)f(the)g |
6e51e0d0 | 16423 | Ft(set-mark)d Fu(command.)66 b(The)38 b(text)i(b)s(et)m(w)m(een)g(the)f |
967625cd CR |
16424 | (p)s(oin)m(t)g(and)150 1922 y(mark)30 b(is)h(referred)e(to)i(as)g(the)f |
16425 | Fr(region)p Fu(.)150 2117 y Fk(8.4.1)63 b(Commands)42 | |
16426 | b(F)-10 b(or)41 b(Mo)m(ving)150 2286 y Ft(beginning-of-line)26 | |
16427 | b(\(C-a\))630 2396 y Fu(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f | |
16428 | (curren)m(t)g(line.)150 2551 y Ft(end-of-line)d(\(C-e\))630 | |
16429 | 2660 y Fu(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
16430 | 2815 y Ft(forward-char)c(\(C-f\))630 2924 y Fu(Mo)m(v)m(e)32 | |
16431 | b(forw)m(ard)e(a)h(c)m(haracter.)150 3079 y Ft(backward-char)c(\(C-b\)) | |
16432 | 630 3189 y Fu(Mo)m(v)m(e)32 b(bac)m(k)g(a)e(c)m(haracter.)150 | |
16433 | 3343 y Ft(forward-word)d(\(M-f\))630 3453 y Fu(Mo)m(v)m(e)32 | |
5e13499c | 16434 | b(forw)m(ard)e(to)h(the)f(end)g(of)g(the)h(next)f(w)m(ord.)41 |
37c41ab1 | 16435 | b(W)-8 b(ords)30 b(are)h(comp)s(osed)f(of)g(letters)i(and)630 |
967625cd CR |
16436 | 3563 y(digits.)150 3717 y Ft(backward-word)27 b(\(M-b\))630 |
16437 | 3827 y Fu(Mo)m(v)m(e)36 b(bac)m(k)e(to)g(the)g(start)g(of)g(the)g | |
37c41ab1 | 16438 | (curren)m(t)f(or)g(previous)g(w)m(ord.)50 b(W)-8 b(ords)34 |
967625cd CR |
16439 | b(are)g(comp)s(osed)630 3936 y(of)d(letters)g(and)f(digits.)150 |
16440 | 4091 y Ft(shell-forward-word)25 b(\(\))630 4201 y Fu(Mo)m(v)m(e)30 | |
a9fac3b2 CR |
16441 | b(forw)m(ard)e(to)h(the)f(end)f(of)h(the)h(next)f(w)m(ord.)40 |
16442 | b(W)-8 b(ords)28 b(are)g(delimited)h(b)m(y)f(non-quoted)630 | |
967625cd CR |
16443 | 4310 y(shell)j(metac)m(haracters.)150 4465 y Ft(shell-backward-word)25 |
16444 | b(\(\))630 4575 y Fu(Mo)m(v)m(e)37 b(bac)m(k)e(to)h(the)f(start)g(of)g | |
a9fac3b2 | 16445 | (the)g(curren)m(t)g(or)f(previous)h(w)m(ord.)53 b(W)-8 |
967625cd CR |
16446 | b(ords)35 b(are)g(delimited)630 4684 y(b)m(y)30 b(non-quoted)h(shell)f |
16447 | (metac)m(haracters.)150 4839 y Ft(clear-screen)d(\(C-l\))630 | |
6e51e0d0 | 16448 | 4948 y Fu(Clear)g(the)g(screen)f(and)h(redra)m(w)f(the)h(curren)m(t)f |
a9fac3b2 | 16449 | (line,)i(lea)m(ving)g(the)f(curren)m(t)g(line)g(at)g(the)g(top)630 |
967625cd | 16450 | 5058 y(of)k(the)f(screen.)150 5213 y Ft(redraw-current-line)25 |
6e51e0d0 | 16451 | b(\(\))630 5322 y Fu(Refresh)30 b(the)g(curren)m(t)h(line.)41 |
c302751c CR |
16452 | b(By)30 b(default,)h(this)f(is)h(un)m(b)s(ound.)p eop |
16453 | end | |
900a813b CR |
16454 | %%Page: 119 125 |
16455 | TeXDict begin 119 124 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16456 | b(Command)29 b(Line)i(Editing)2062 b(119)150 299 y Fk(8.4.2)63 | |
ad4aef08 | 16457 | b(Commands)42 b(F)-10 b(or)41 b(Manipulating)h(The)f(History)150 |
6e51e0d0 CR |
16458 | 473 y Ft(accept-line)27 b(\(Newline)h(or)i(Return\))630 |
16459 | 582 y Fu(Accept)25 b(the)e(line)h(regardless)g(of)f(where)g(the)h | |
ad4aef08 | 16460 | (cursor)e(is.)39 b(If)23 b(this)g(line)h(is)f(non-empt)m(y)-8 |
c302751c | 16461 | b(,)26 b(add)c(it)630 692 y(to)27 b(the)f(history)g(list)h(according)g |
6e51e0d0 CR |
16462 | (to)g(the)f(setting)i(of)e(the)g Ft(HISTCONTROL)d Fu(and)j |
16463 | Ft(HISTIGNORE)630 802 y Fu(v)-5 b(ariables.)42 b(If)30 | |
c302751c CR |
16464 | b(this)h(line)g(is)g(a)g(mo)s(di\014ed)e(history)i(line,)g(then)f |
16465 | (restore)i(the)f(history)f(line)h(to)630 911 y(its)g(original)g(state.) | |
6e51e0d0 CR |
16466 | 150 1075 y Ft(previous-history)26 b(\(C-p\))630 1184 |
16467 | y Fu(Mo)m(v)m(e)32 b(`bac)m(k')g(through)e(the)g(history)h(list,)g | |
16468 | (fetc)m(hing)g(the)g(previous)f(command.)150 1348 y Ft(next-history)d | |
16469 | (\(C-n\))630 1457 y Fu(Mo)m(v)m(e)32 b(`forw)m(ard')f(through)e(the)i | |
c302751c | 16470 | (history)f(list,)i(fetc)m(hing)f(the)g(next)f(command.)150 |
6e51e0d0 CR |
16471 | 1621 y Ft(beginning-of-history)25 b(\(M-<\))630 1730 |
16472 | y Fu(Mo)m(v)m(e)32 b(to)g(the)e(\014rst)g(line)g(in)h(the)f(history)-8 | |
16473 | b(.)150 1894 y Ft(end-of-history)26 b(\(M->\))630 2004 | |
16474 | y Fu(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(input)e(history)-8 | |
c302751c | 16475 | b(,)31 b(i.e.,)h(the)f(line)f(curren)m(tly)h(b)s(eing)f(en)m(tered.)150 |
6e51e0d0 CR |
16476 | 2167 y Ft(reverse-search-history)24 b(\(C-r\))630 2277 |
16477 | y Fu(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g(the)f(curren)m(t)g | |
c302751c CR |
16478 | (line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g(his-)630 |
16479 | 2386 y(tory)g(as)f(necessary)-8 b(.)42 b(This)29 b(is)i(an)f(incremen)m | |
6e51e0d0 | 16480 | (tal)i(searc)m(h.)150 2550 y Ft(forward-search-history)24 |
fc527055 CR |
16481 | b(\(C-s\))630 2659 y Fu(Searc)m(h)44 b(forw)m(ard)f(starting)h(at)h |
16482 | (the)e(curren)m(t)h(line)g(and)f(mo)m(ving)h(`do)m(wn')g(through)f(the) | |
16483 | 630 2769 y(history)30 b(as)h(necessary)-8 b(.)41 b(This)30 | |
6e51e0d0 | 16484 | b(is)g(an)h(incremen)m(tal)g(searc)m(h.)150 2932 y Ft |
c302751c | 16485 | (non-incremental-reverse-)o(sear)o(ch-h)o(ist)o(ory)24 |
6e51e0d0 | 16486 | b(\(M-p\))630 3042 y Fu(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g |
37c41ab1 | 16487 | (the)f(curren)m(t)g(line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g |
c302751c | 16488 | (his-)630 3152 y(tory)36 b(as)g(necessary)h(using)e(a)i(non-incremen)m |
37c41ab1 | 16489 | (tal)g(searc)m(h)f(for)g(a)g(string)g(supplied)f(b)m(y)h(the)630 |
fc527055 CR |
16490 | 3261 y(user.)k(The)30 b(searc)m(h)h(string)f(ma)m(y)h(matc)m(h)g(an)m |
16491 | (ywhere)g(in)f(a)h(history)f(line.)150 3425 y Ft | |
16492 | (non-incremental-forward-)o(sear)o(ch-h)o(ist)o(ory)24 | |
16493 | b(\(M-n\))630 3534 y Fu(Searc)m(h)44 b(forw)m(ard)f(starting)h(at)h | |
16494 | (the)e(curren)m(t)h(line)g(and)f(mo)m(ving)h(`do)m(wn')g(through)f(the) | |
16495 | 630 3644 y(history)27 b(as)f(necessary)i(using)e(a)h(non-incremen)m | |
16496 | (tal)g(searc)m(h)h(for)e(a)h(string)g(supplied)e(b)m(y)i(the)630 | |
16497 | 3754 y(user.)40 b(The)30 b(searc)m(h)h(string)f(ma)m(y)h(matc)m(h)g(an) | |
16498 | m(ywhere)g(in)f(a)h(history)f(line.)150 3917 y Ft | |
16499 | (history-search-forward)24 b(\(\))630 4027 y Fu(Searc)m(h)42 | |
16500 | b(forw)m(ard)f(through)f(the)i(history)f(for)g(the)h(string)f(of)h(c)m | |
16501 | (haracters)h(b)s(et)m(w)m(een)f(the)630 4136 y(start)36 | |
16502 | b(of)h(the)f(curren)m(t)f(line)i(and)e(the)h(p)s(oin)m(t.)58 | |
16503 | b(The)35 b(searc)m(h)i(string)e(m)m(ust)h(matc)m(h)h(at)g(the)630 | |
16504 | 4246 y(b)s(eginning)32 b(of)g(a)h(history)g(line.)47 | |
74d0116b CR |
16505 | b(This)32 b(is)h(a)f(non-incremen)m(tal)i(searc)m(h.)48 |
16506 | b(By)33 b(default,)g(this)630 4355 y(command)d(is)h(un)m(b)s(ound.)150 | |
6e51e0d0 CR |
16507 | 4519 y Ft(history-search-backward)24 b(\(\))630 4629 |
16508 | y Fu(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f(the)h(history)g(for)g | |
37c41ab1 | 16509 | (the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m(een)g(the)630 |
74d0116b CR |
16510 | 4738 y(start)g(of)h(the)f(curren)m(t)f(line)i(and)e(the)h(p)s(oin)m(t.) |
16511 | 58 b(The)35 b(searc)m(h)i(string)e(m)m(ust)h(matc)m(h)h(at)g(the)630 | |
16512 | 4848 y(b)s(eginning)32 b(of)g(a)h(history)g(line.)47 | |
16513 | b(This)32 b(is)h(a)f(non-incremen)m(tal)i(searc)m(h.)48 | |
16514 | b(By)33 b(default,)g(this)630 4957 y(command)d(is)h(un)m(b)s(ound.)150 | |
6e51e0d0 CR |
16515 | 5121 y Ft(history-substr-search-fo)o(rwar)o(d)24 b(\(\))630 |
16516 | 5230 y Fu(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i(history)f(for)g | |
74d0116b CR |
16517 | (the)h(string)f(of)h(c)m(haracters)h(b)s(et)m(w)m(een)f(the)630 |
16518 | 5340 y(start)29 b(of)g(the)g(curren)m(t)g(line)g(and)f(the)h(p)s(oin)m | |
16519 | (t.)40 b(The)29 b(searc)m(h)g(string)g(ma)m(y)g(matc)m(h)h(an)m(ywhere) | |
16520 | p eop end | |
900a813b CR |
16521 | %%Page: 120 126 |
16522 | TeXDict begin 120 125 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16523 | b(Command)29 b(Line)i(Editing)2062 b(120)630 299 y(in)32 | |
278286c9 CR |
16524 | b(a)h(history)g(line.)47 b(This)32 b(is)g(a)h(non-incremen)m(tal)h |
16525 | (searc)m(h.)47 b(By)33 b(default,)h(this)e(command)630 | |
c61bfbfd CR |
16526 | 408 y(is)e(un)m(b)s(ound.)150 573 y Ft(history-substr-search-ba)o(ckwa) |
16527 | o(rd)24 b(\(\))630 683 y Fu(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f | |
278286c9 | 16528 | (the)h(history)g(for)g(the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m |
c61bfbfd | 16529 | (een)g(the)630 793 y(start)29 b(of)g(the)g(curren)m(t)g(line)g(and)f |
278286c9 | 16530 | (the)h(p)s(oin)m(t.)40 b(The)29 b(searc)m(h)g(string)g(ma)m(y)g(matc)m |
c61bfbfd | 16531 | (h)h(an)m(ywhere)630 902 y(in)i(a)h(history)g(line.)47 |
74d0116b | 16532 | b(This)32 b(is)g(a)h(non-incremen)m(tal)h(searc)m(h.)47 |
c61bfbfd CR |
16533 | b(By)33 b(default,)h(this)e(command)630 1012 y(is)e(un)m(b)s(ound.)150 |
16534 | 1177 y Ft(yank-nth-arg)d(\(M-C-y\))630 1286 y Fu(Insert)37 | |
278286c9 | 16535 | b(the)g(\014rst)f(argumen)m(t)i(to)f(the)h(previous)e(command)h |
c61bfbfd | 16536 | (\(usually)g(the)g(second)g(w)m(ord)630 1396 y(on)32 |
278286c9 | 16537 | b(the)g(previous)f(line\))i(at)f(p)s(oin)m(t.)46 b(With)32 |
6e51e0d0 | 16538 | b(an)g(argumen)m(t)g Fr(n)p Fu(,)g(insert)g(the)g Fr(n)p |
c61bfbfd | 16539 | Fu(th)f(w)m(ord)g(from)630 1506 y(the)k(previous)f(command)h(\(the)g(w) |
278286c9 | 16540 | m(ords)g(in)f(the)h(previous)g(command)f(b)s(egin)h(with)f(w)m(ord)630 |
c61bfbfd | 16541 | 1615 y(0\).)69 b(A)40 b(negativ)m(e)h(argumen)m(t)f(inserts)g(the)f |
6e51e0d0 | 16542 | Fr(n)p Fu(th)g(w)m(ord)g(from)g(the)h(end)f(of)h(the)f(previous)630 |
c61bfbfd | 16543 | 1725 y(command.)48 b(Once)33 b(the)g(argumen)m(t)h Fr(n)e |
6e51e0d0 | 16544 | Fu(is)h(computed,)h(the)f(argumen)m(t)g(is)g(extracted)i(as)e(if)630 |
c61bfbfd CR |
16545 | 1834 y(the)e(`)p Ft(!)p Fj(n)p Fu(')f(history)g(expansion)g(had)g(b)s |
16546 | (een)g(sp)s(eci\014ed.)150 1999 y Ft(yank-last-arg)d(\(M-.)i(or)h | |
16547 | (M-_\))630 2109 y Fu(Insert)k(last)i(argumen)m(t)g(to)g(the)f(previous) | |
278286c9 | 16548 | f(command)h(\(the)h(last)f(w)m(ord)g(of)g(the)g(previous)630 |
c61bfbfd | 16549 | 2218 y(history)e(en)m(try\).)51 b(With)34 b(a)g(n)m(umeric)g(argumen)m |
6e51e0d0 | 16550 | (t,)h(b)s(eha)m(v)m(e)f(exactly)h(lik)m(e)g Ft(yank-nth-arg)p |
c61bfbfd | 16551 | Fu(.)630 2328 y(Successiv)m(e)26 b(calls)g(to)f Ft(yank-last-arg)c |
6e51e0d0 | 16552 | Fu(mo)m(v)m(e)27 b(bac)m(k)e(through)f(the)h(history)g(list,)i |
c61bfbfd | 16553 | (inserting)630 2438 y(the)c(last)g(w)m(ord)f(\(or)h(the)g(w)m(ord)f(sp) |
278286c9 | 16554 | s(eci\014ed)g(b)m(y)g(the)h(argumen)m(t)g(to)g(the)g(\014rst)f(call\))i |
c61bfbfd | 16555 | (of)f(eac)m(h)h(line)630 2547 y(in)36 b(turn.)58 b(An)m(y)36 |
278286c9 | 16556 | b(n)m(umeric)h(argumen)m(t)f(supplied)g(to)h(these)g(successiv)m(e)g |
c61bfbfd | 16557 | (calls)h(determines)630 2657 y(the)d(direction)g(to)h(mo)m(v)m(e)g |
278286c9 | 16558 | (through)e(the)h(history)-8 b(.)54 b(A)35 b(negativ)m(e)i(argumen)m(t)e |
c61bfbfd | 16559 | (switc)m(hes)h(the)630 2766 y(direction)23 b(through)g(the)g(history)f |
278286c9 | 16560 | (\(bac)m(k)i(or)f(forw)m(ard\).)38 b(The)22 b(history)h(expansion)g |
c61bfbfd | 16561 | (facilities)630 2876 y(are)28 b(used)f(to)h(extract)h(the)f(last)g |
6e51e0d0 | 16562 | (argumen)m(t,)h(as)e(if)h(the)g(`)p Ft(!$)p Fu(')f(history)g(expansion) |
c61bfbfd | 16563 | h(had)f(b)s(een)630 2986 y(sp)s(eci\014ed.)150 3190 y |
6e51e0d0 | 16564 | Fk(8.4.3)63 b(Commands)42 b(F)-10 b(or)41 b(Changing)g(T)-10 |
c61bfbfd CR |
16565 | b(ext)150 3365 y Fj(end-of-file)27 b Ft(\(usually)h(C-d\))630 |
16566 | 3475 y Fu(The)e(c)m(haracter)h(indicating)h(end-of-\014le)e(as)h(set,)g | |
16567 | (for)f(example,)i(b)m(y)e Ft(stty)p Fu(.)39 b(If)25 b(this)h(c)m | |
16568 | (harac-)630 3584 y(ter)c(is)g(read)g(when)e(there)i(are)h(no)e(c)m | |
16569 | (haracters)j(on)d(the)h(line,)i(and)d(p)s(oin)m(t)h(is)g(at)h(the)f(b)s | |
16570 | (eginning)630 3694 y(of)31 b(the)f(line,)h(Readline)g(in)m(terprets)g | |
16571 | (it)g(as)f(the)h(end)f(of)g(input)f(and)h(returns)f Fm(eof)p | |
16572 | Fu(.)150 3859 y Ft(delete-char)e(\(C-d\))630 3968 y Fu(Delete)35 | |
16573 | b(the)f(c)m(haracter)h(at)f(p)s(oin)m(t.)49 b(If)33 b(this)g(function)g | |
16574 | (is)g(b)s(ound)e(to)j(the)g(same)f(c)m(haracter)630 4078 | |
16575 | y(as)e(the)f(tt)m(y)i Fm(eof)d Fu(c)m(haracter,)j(as)f | |
16576 | Fj(C-d)e Fu(commonly)i(is,)g(see)g(ab)s(o)m(v)m(e)h(for)e(the)g | |
16577 | (e\013ects.)150 4243 y Ft(backward-delete-char)25 b(\(Rubout\))630 | |
16578 | 4353 y Fu(Delete)32 b(the)f(c)m(haracter)g(b)s(ehind)e(the)h(cursor.)40 | |
37c41ab1 | 16579 | b(A)30 b(n)m(umeric)g(argumen)m(t)h(means)f(to)h(kill)g(the)630 |
c61bfbfd CR |
16580 | 4462 y(c)m(haracters)h(instead)e(of)h(deleting)g(them.)150 |
16581 | 4627 y Ft(forward-backward-delete-)o(char)24 b(\(\))630 | |
16582 | 4737 y Fu(Delete)40 b(the)f(c)m(haracter)h(under)c(the)j(cursor,)h | |
37c41ab1 | 16583 | (unless)d(the)i(cursor)e(is)h(at)h(the)g(end)e(of)i(the)630 |
c61bfbfd | 16584 | 4846 y(line,)33 b(in)e(whic)m(h)g(case)i(the)f(c)m(haracter)h(b)s |
37c41ab1 | 16585 | (ehind)d(the)i(cursor)f(is)g(deleted.)46 b(By)32 b(default,)g(this)630 |
c61bfbfd CR |
16586 | 4956 y(is)e(not)h(b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 |
16587 | 5121 y Ft(quoted-insert)27 b(\(C-q)i(or)h(C-v\))630 5230 | |
6e51e0d0 | 16588 | y Fu(Add)j(the)i(next)f(c)m(haracter)i(t)m(yp)s(ed)e(to)h(the)f(line)h |
37c41ab1 | 16589 | (v)m(erbatim.)53 b(This)33 b(is)i(ho)m(w)f(to)h(insert)f(k)m(ey)630 |
c61bfbfd CR |
16590 | 5340 y(sequences)d(lik)m(e)g Fj(C-q)p Fu(,)f(for)g(example.)p |
16591 | eop end | |
900a813b CR |
16592 | %%Page: 121 127 |
16593 | TeXDict begin 121 126 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16594 | b(Command)29 b(Line)i(Editing)2062 b(121)150 299 y Ft(self-insert)27 | |
c61bfbfd | 16595 | b(\(a,)j(b,)g(A,)f(1,)h(!,)g(...)o(\))630 408 y Fu(Insert)g(y)m |
8a0829e9 CR |
16596 | (ourself.)150 573 y Ft(bracketed-paste-begin)25 b(\(\))630 |
16597 | 683 y Fu(This)f(function)h(is)f(in)m(tended)h(to)h(b)s(e)e(b)s(ound)f | |
16598 | (to)i(the)g Ft(")p Fu(brac)m(k)m(eted)h(paste)p Ft(")f | |
16599 | Fu(escap)s(e)h(sequence)630 793 y(sen)m(t)38 b(b)m(y)f(some)h | |
16600 | (terminals,)i(and)d(suc)m(h)g(a)h(binding)e(is)i(assigned)f(b)m(y)h | |
16601 | (default.)62 b(It)38 b(allo)m(ws)630 902 y(Readline)33 | |
16602 | b(to)g(insert)g(the)f(pasted)h(text)g(as)g(a)g(single)g(unit)f(without) | |
16603 | h(treating)h(eac)m(h)f(c)m(har-)630 1012 y(acter)40 b(as)f(if)g(it)g | |
16604 | (had)f(b)s(een)g(read)h(from)f(the)h(k)m(eyb)s(oard.)66 | |
16605 | b(The)39 b(c)m(haracters)h(are)f(inserted)630 1121 y(as)i(if)g(eac)m(h) | |
16606 | i(one)e(w)m(as)h(b)s(ound)d(to)i Ft(self-insert)p Fu(\))e(instead)i(of) | |
16607 | h(executing)g(an)m(y)f(editing)630 1231 y(commands.)150 | |
16608 | 1396 y Ft(transpose-chars)26 b(\(C-t\))630 1505 y Fu(Drag)33 | |
16609 | b(the)f(c)m(haracter)h(b)s(efore)f(the)g(cursor)f(forw)m(ard)h(o)m(v)m | |
16610 | (er)h(the)f(c)m(haracter)i(at)e(the)g(cursor,)630 1615 | |
16611 | y(mo)m(ving)k(the)g(cursor)f(forw)m(ard)g(as)g(w)m(ell.)57 | |
c61bfbfd | 16612 | b(If)35 b(the)h(insertion)g(p)s(oin)m(t)f(is)g(at)i(the)e(end)g(of)h |
8a0829e9 CR |
16613 | (the)630 1724 y(line,)24 b(then)e(this)g(transp)s(oses)f(the)h(last)h |
16614 | (t)m(w)m(o)g(c)m(haracters)g(of)f(the)h(line.)38 b(Negativ)m(e)25 | |
16615 | b(argumen)m(ts)630 1834 y(ha)m(v)m(e)32 b(no)e(e\013ect.)150 | |
16616 | 1999 y Ft(transpose-words)c(\(M-t\))630 2109 y Fu(Drag)33 | |
c61bfbfd CR |
16617 | b(the)g(w)m(ord)f(b)s(efore)g(p)s(oin)m(t)g(past)g(the)h(w)m(ord)f |
16618 | (after)g(p)s(oin)m(t,)i(mo)m(ving)f(p)s(oin)m(t)f(past)g(that)630 | |
8a0829e9 | 16619 | 2218 y(w)m(ord)c(as)h(w)m(ell.)41 b(If)27 b(the)i(insertion)f(p)s(oin)m |
c61bfbfd | 16620 | (t)h(is)f(at)h(the)g(end)e(of)i(the)f(line,)i(this)e(transp)s(oses)g |
8a0829e9 CR |
16621 | (the)630 2328 y(last)j(t)m(w)m(o)h(w)m(ords)e(on)g(the)h(line.)150 |
16622 | 2493 y Ft(upcase-word)c(\(M-u\))630 2602 y Fu(Upp)s(ercase)32 | |
c61bfbfd CR |
16623 | b(the)g(curren)m(t)g(\(or)g(follo)m(wing\))i(w)m(ord.)45 |
16624 | b(With)32 b(a)g(negativ)m(e)j(argumen)m(t,)e(upp)s(er-)630 | |
8a0829e9 CR |
16625 | 2712 y(case)e(the)g(previous)f(w)m(ord,)g(but)g(do)g(not)h(mo)m(v)m(e)h |
16626 | (the)e(cursor.)150 2877 y Ft(downcase-word)d(\(M-l\))630 | |
16627 | 2986 y Fu(Lo)m(w)m(ercase)c(the)f(curren)m(t)f(\(or)h(follo)m(wing\))i | |
74d0116b | 16628 | (w)m(ord.)37 b(With)22 b(a)g(negativ)m(e)i(argumen)m(t,)g(lo)m(w)m |
8a0829e9 CR |
16629 | (ercase)630 3096 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f(mo)m |
16630 | (v)m(e)i(the)f(cursor.)150 3261 y Ft(capitalize-word)26 | |
16631 | b(\(M-c\))630 3370 y Fu(Capitalize)d(the)f(curren)m(t)f(\(or)g(follo)m | |
510e20a2 | 16632 | (wing\))i(w)m(ord.)38 b(With)21 b(a)h(negativ)m(e)h(argumen)m(t,)h |
8a0829e9 CR |
16633 | (capitalize)630 3480 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f |
16634 | (mo)m(v)m(e)i(the)f(cursor.)150 3645 y Ft(overwrite-mode)26 | |
16635 | b(\(\))630 3754 y Fu(T)-8 b(oggle)35 b(o)m(v)m(erwrite)g(mo)s(de.)48 | |
a9fac3b2 | 16636 | b(With)33 b(an)g(explicit)h(p)s(ositiv)m(e)g(n)m(umeric)f(argumen)m(t,) |
8a0829e9 | 16637 | h(switc)m(hes)630 3864 y(to)22 b(o)m(v)m(erwrite)i(mo)s(de.)37 |
a9fac3b2 | 16638 | b(With)22 b(an)g(explicit)h(non-p)s(ositiv)m(e)f(n)m(umeric)g(argumen)m |
8a0829e9 | 16639 | (t,)i(switc)m(hes)e(to)630 3973 y(insert)30 b(mo)s(de.)41 |
6e51e0d0 | 16640 | b(This)30 b(command)h(a\013ects)h(only)e Ft(emacs)f Fu(mo)s(de;)i |
8a0829e9 | 16641 | Ft(vi)f Fu(mo)s(de)g(do)s(es)g(o)m(v)m(erwrite)630 4083 |
a9fac3b2 | 16642 | y(di\013eren)m(tly)-8 b(.)42 b(Eac)m(h)31 b(call)h(to)f |
6e51e0d0 | 16643 | Ft(readline\(\))c Fu(starts)k(in)f(insert)g(mo)s(de.)630 |
8a0829e9 | 16644 | 4220 y(In)52 b(o)m(v)m(erwrite)h(mo)s(de,)58 b(c)m(haracters)c(b)s |
6e51e0d0 | 16645 | (ound)c(to)j Ft(self-insert)c Fu(replace)k(the)g(text)g(at)630 |
8a0829e9 | 16646 | 4330 y(p)s(oin)m(t)59 b(rather)f(than)h(pushing)e(the)i(text)g(to)h |
6e51e0d0 | 16647 | (the)f(righ)m(t.)126 b(Characters)59 b(b)s(ound)d(to)630 |
8a0829e9 CR |
16648 | 4439 y Ft(backward-delete-char)25 b Fu(replace)31 b(the)g(c)m(haracter) |
16649 | h(b)s(efore)e(p)s(oin)m(t)g(with)g(a)h(space.)630 4577 | |
6e51e0d0 | 16650 | y(By)g(default,)f(this)h(command)f(is)g(un)m(b)s(ound.)150 |
8a0829e9 CR |
16651 | 4781 y Fk(8.4.4)63 b(Killing)42 b(And)e(Y)-10 b(anking)150 |
16652 | 4956 y Ft(kill-line)28 b(\(C-k\))630 5066 y Fu(Kill)j(the)f(text)i | |
6e51e0d0 | 16653 | (from)e(p)s(oin)m(t)g(to)h(the)g(end)e(of)i(the)f(line.)150 |
8a0829e9 CR |
16654 | 5230 y Ft(backward-kill-line)25 b(\(C-x)30 b(Rubout\))630 |
16655 | 5340 y Fu(Kill)h(bac)m(kw)m(ard)g(from)e(the)i(cursor)f(to)h(the)f(b)s | |
16656 | (eginning)g(of)h(the)f(curren)m(t)g(line.)p eop end | |
900a813b CR |
16657 | %%Page: 122 128 |
16658 | TeXDict begin 122 127 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16659 | b(Command)29 b(Line)i(Editing)2062 b(122)150 299 y Ft | |
8a0829e9 | 16660 | (unix-line-discard)26 b(\(C-u\))630 408 y Fu(Kill)31 |
fc527055 | 16661 | b(bac)m(kw)m(ard)g(from)e(the)i(cursor)f(to)h(the)f(b)s(eginning)g(of)h |
8a0829e9 CR |
16662 | (the)f(curren)m(t)g(line.)150 571 y Ft(kill-whole-line)c(\(\))630 |
16663 | 681 y Fu(Kill)37 b(all)g(c)m(haracters)h(on)f(the)f(curren)m(t)h(line,) | |
16664 | h(no)f(matter)g(where)f(p)s(oin)m(t)h(is.)59 b(By)36 | |
16665 | b(default,)630 791 y(this)30 b(is)h(un)m(b)s(ound.)150 | |
16666 | 954 y Ft(kill-word)d(\(M-d\))630 1063 y Fu(Kill)i(from)f(p)s(oin)m(t)g | |
fc527055 | 16667 | (to)h(the)g(end)e(of)i(the)f(curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m |
8a0829e9 | 16668 | (w)m(een)g(w)m(ords,)f(to)h(the)g(end)630 1173 y(of)h(the)f(next)h(w)m |
fc527055 | 16669 | (ord.)40 b(W)-8 b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f |
8a0829e9 CR |
16670 | Ft(forward-word)p Fu(.)150 1336 y Ft(backward-kill-word)25 |
16671 | b(\(M-DEL\))630 1445 y Fu(Kill)k(the)g(w)m(ord)g(b)s(ehind)e(p)s(oin)m | |
16672 | (t.)40 b(W)-8 b(ord)29 b(b)s(oundaries)f(are)h(the)g(same)g(as)g | |
16673 | Ft(backward-word)p Fu(.)150 1608 y Ft(shell-kill-word)d(\(\))630 | |
16674 | 1718 y Fu(Kill)k(from)f(p)s(oin)m(t)g(to)h(the)g(end)e(of)i(the)f | |
16675 | (curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)h | |
16676 | (the)g(end)630 1827 y(of)h(the)f(next)h(w)m(ord.)40 b(W)-8 | |
16677 | b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f Ft | |
16678 | (shell-forward-word)p Fu(.)150 1990 y Ft(shell-backward-kill-word)24 | |
16679 | b(\(\))630 2100 y Fu(Kill)e(the)h(w)m(ord)e(b)s(ehind)g(p)s(oin)m(t.)38 | |
a9fac3b2 | 16680 | b(W)-8 b(ord)22 b(b)s(oundaries)f(are)h(the)g(same)h(as)f |
8a0829e9 CR |
16681 | Ft(shell-backward-)630 2209 y(word)p Fu(.)150 2372 y |
16682 | Ft(unix-word-rubout)k(\(C-w\))630 2482 y Fu(Kill)32 b(the)g(w)m(ord)f | |
a9fac3b2 | 16683 | (b)s(ehind)f(p)s(oin)m(t,)i(using)f(white)h(space)g(as)g(a)g(w)m(ord)f |
8a0829e9 CR |
16684 | (b)s(oundary)-8 b(.)43 b(The)31 b(killed)630 2592 y(text)g(is)g(sa)m(v) |
16685 | m(ed)g(on)g(the)f(kill-ring.)150 2755 y Ft(unix-filename-rubout)25 | |
16686 | b(\(\))630 2864 y Fu(Kill)37 b(the)f(w)m(ord)g(b)s(ehind)f(p)s(oin)m | |
74d0116b | 16687 | (t,)j(using)e(white)g(space)h(and)f(the)g(slash)g(c)m(haracter)i(as)f |
8a0829e9 | 16688 | (the)630 2974 y(w)m(ord)30 b(b)s(oundaries.)39 b(The)30 |
74d0116b | 16689 | b(killed)h(text)g(is)g(sa)m(v)m(ed)g(on)g(the)f(kill-ring.)150 |
8a0829e9 | 16690 | 3137 y Ft(delete-horizontal-space)24 b(\(\))630 3246 |
6e51e0d0 | 16691 | y Fu(Delete)33 b(all)e(spaces)g(and)e(tabs)i(around)e(p)s(oin)m(t.)41 |
8a0829e9 CR |
16692 | b(By)31 b(default,)f(this)h(is)f(un)m(b)s(ound.)150 3409 |
16693 | y Ft(kill-region)d(\(\))630 3519 y Fu(Kill)k(the)f(text)i(in)e(the)g | |
510e20a2 | 16694 | (curren)m(t)h(region.)41 b(By)31 b(default,)f(this)h(command)f(is)g(un) |
8a0829e9 CR |
16695 | m(b)s(ound.)150 3682 y Ft(copy-region-as-kill)25 b(\(\))630 |
16696 | 3791 y Fu(Cop)m(y)34 b(the)g(text)h(in)f(the)g(region)g(to)h(the)f | |
510e20a2 | 16697 | (kill)h(bu\013er,)f(so)g(it)h(can)f(b)s(e)f(y)m(ank)m(ed)i(righ)m(t)f |
8a0829e9 CR |
16698 | (a)m(w)m(a)m(y)-8 b(.)630 3901 y(By)31 b(default,)f(this)h(command)f |
16699 | (is)g(un)m(b)s(ound.)150 4064 y Ft(copy-backward-word)25 | |
16700 | b(\(\))630 4173 y Fu(Cop)m(y)38 b(the)h(w)m(ord)f(b)s(efore)g(p)s(oin)m | |
510e20a2 | 16701 | (t)g(to)i(the)e(kill)h(bu\013er.)64 b(The)38 b(w)m(ord)g(b)s(oundaries) |
8a0829e9 | 16702 | f(are)i(the)630 4283 y(same)31 b(as)f Ft(backward-word)p |
6e51e0d0 | 16703 | Fu(.)38 b(By)30 b(default,)h(this)f(command)g(is)h(un)m(b)s(ound.)150 |
8a0829e9 | 16704 | 4446 y Ft(copy-forward-word)26 b(\(\))630 4556 y Fu(Cop)m(y)31 |
37c41ab1 CR |
16705 | b(the)g(w)m(ord)g(follo)m(wing)h(p)s(oin)m(t)f(to)h(the)f(kill)h |
16706 | (bu\013er.)42 b(The)30 b(w)m(ord)h(b)s(oundaries)e(are)j(the)630 | |
8a0829e9 | 16707 | 4665 y(same)f(as)f Ft(forward-word)p Fu(.)38 b(By)30 |
a9fac3b2 | 16708 | b(default,)h(this)g(command)f(is)g(un)m(b)s(ound.)150 |
8a0829e9 | 16709 | 4828 y Ft(yank)f(\(C-y\))630 4938 y Fu(Y)-8 b(ank)31 |
a9fac3b2 | 16710 | b(the)f(top)h(of)g(the)f(kill)h(ring)f(in)m(to)i(the)e(bu\013er)g(at)h |
8a0829e9 | 16711 | (p)s(oin)m(t.)150 5101 y Ft(yank-pop)d(\(M-y\))630 5210 |
6e51e0d0 | 16712 | y Fu(Rotate)36 b(the)f(kill-ring,)i(and)d(y)m(ank)h(the)f(new)g(top.)54 |
a9fac3b2 | 16713 | b(Y)-8 b(ou)35 b(can)g(only)f(do)h(this)f(if)h(the)g(prior)630 |
8a0829e9 CR |
16714 | 5320 y(command)30 b(is)h Ft(yank)e Fu(or)h Ft(yank-pop)p |
16715 | Fu(.)p eop end | |
900a813b CR |
16716 | %%Page: 123 129 |
16717 | TeXDict begin 123 128 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16718 | b(Command)29 b(Line)i(Editing)2062 b(123)150 299 y Fk(8.4.5)63 | |
8a0829e9 CR |
16719 | b(Sp)s(ecifying)42 b(Numeric)f(Argumen)m(ts)150 477 y |
16720 | Ft(digit-argument)26 b(\()p Fj(M-0)p Ft(,)j Fj(M-1)p | |
16721 | Ft(,)h(...)f Fj(M--)p Ft(\))630 586 y Fu(Add)d(this)h(digit)g(to)h(the) | |
16722 | f(argumen)m(t)g(already)h(accum)m(ulating,)h(or)e(start)h(a)f(new)f | |
16723 | (argumen)m(t.)630 696 y Fj(M--)j Fu(starts)i(a)g(negativ)m(e)i(argumen) | |
16724 | m(t.)150 867 y Ft(universal-argument)25 b(\(\))630 977 | |
16725 | y Fu(This)g(is)g(another)h(w)m(a)m(y)g(to)h(sp)s(ecify)e(an)g(argumen)m | |
16726 | (t.)40 b(If)25 b(this)g(command)h(is)f(follo)m(w)m(ed)i(b)m(y)f(one)630 | |
16727 | 1087 y(or)k(more)f(digits,)i(optionally)g(with)e(a)h(leading)h(min)m | |
16728 | (us)e(sign,)h(those)g(digits)g(de\014ne)f(the)h(ar-)630 | |
16729 | 1196 y(gumen)m(t.)41 b(If)28 b(the)i(command)f(is)g(follo)m(w)m(ed)h(b) | |
16730 | m(y)f(digits,)i(executing)f Ft(universal-argument)630 | |
16731 | 1306 y Fu(again)j(ends)e(the)h(n)m(umeric)f(argumen)m(t,)i(but)e(is)h | |
16732 | (otherwise)g(ignored.)45 b(As)32 b(a)g(sp)s(ecial)h(case,)630 | |
16733 | 1415 y(if)g(this)g(command)f(is)h(immediately)h(follo)m(w)m(ed)h(b)m(y) | |
16734 | d(a)h(c)m(haracter)i(that)e(is)g(neither)g(a)g(digit)630 | |
16735 | 1525 y(nor)41 b(min)m(us)f(sign,)k(the)e(argumen)m(t)f(coun)m(t)h(for)f | |
16736 | (the)h(next)f(command)g(is)g(m)m(ultiplied)h(b)m(y)630 | |
16737 | 1635 y(four.)54 b(The)35 b(argumen)m(t)g(coun)m(t)h(is)f(initially)h | |
16738 | (one,)h(so)e(executing)i(this)e(function)f(the)i(\014rst)630 | |
16739 | 1744 y(time)29 b(mak)m(es)h(the)e(argumen)m(t)i(coun)m(t)f(four,)f(a)h | |
16740 | (second)g(time)g(mak)m(es)h(the)e(argumen)m(t)h(coun)m(t)630 | |
16741 | 1854 y(sixteen,)i(and)f(so)h(on.)40 b(By)31 b(default,)g(this)f(is)g | |
16742 | (not)h(b)s(ound)d(to)k(a)e(k)m(ey)-8 b(.)150 2065 y Fk(8.4.6)63 | |
ad4aef08 | 16743 | b(Letting)40 b(Readline)h(T)m(yp)s(e)g(F)-10 b(or)42 |
8a0829e9 CR |
16744 | b(Y)-10 b(ou)150 2243 y Ft(complete)28 b(\(TAB\))630 |
16745 | 2353 y Fu(A)m(ttempt)c(to)f(p)s(erform)e(completion)j(on)f(the)g(text)g | |
c302751c | 16746 | (b)s(efore)f(p)s(oin)m(t.)39 b(The)22 b(actual)i(completion)630 |
8a0829e9 | 16747 | 2462 y(p)s(erformed)33 b(is)h(application-sp)s(eci\014c.)53 |
c302751c | 16748 | b(Bash)35 b(attempts)g(completion)g(treating)h(the)e(text)630 |
8a0829e9 | 16749 | 2572 y(as)39 b(a)h(v)-5 b(ariable)39 b(\(if)h(the)f(text)h(b)s(egins)e |
6e51e0d0 | 16750 | (with)h(`)p Ft($)p Fu('\),)j(username)c(\(if)i(the)f(text)h(b)s(egins)e |
8a0829e9 | 16751 | (with)630 2681 y(`)p Ft(~)p Fu('\),)31 b(hostname)f(\(if)g(the)g(text)h |
6e51e0d0 | 16752 | (b)s(egins)e(with)h(`)p Ft(@)p Fu('\),)h(or)f(command)f(\(including)h |
8a0829e9 | 16753 | (aliases)i(and)630 2791 y(functions\))j(in)f(turn.)53 |
74d0116b | 16754 | b(If)34 b(none)g(of)h(these)h(pro)s(duces)d(a)i(matc)m(h,)i(\014lename) |
8a0829e9 CR |
16755 | e(completion)h(is)630 2901 y(attempted.)150 3072 y Ft |
16756 | (possible-completions)25 b(\(M-?\))630 3182 y Fu(List)35 | |
74d0116b | 16757 | b(the)g(p)s(ossible)f(completions)i(of)e(the)h(text)h(b)s(efore)e(p)s |
8a0829e9 | 16758 | (oin)m(t.)54 b(When)34 b(displa)m(ying)h(com-)630 3291 |
74d0116b CR |
16759 | y(pletions,)f(Readline)f(sets)f(the)h(n)m(um)m(b)s(er)e(of)i(columns)f |
16760 | (used)f(for)i(displa)m(y)f(to)h(the)g(v)-5 b(alue)33 | |
8a0829e9 | 16761 | b(of)630 3401 y Ft(completion-display-width)o Fu(,)g(the)j(v)-5 |
74d0116b | 16762 | b(alue)37 b(of)g(the)f(en)m(vironmen)m(t)h(v)-5 b(ariable)38 |
8a0829e9 CR |
16763 | b Ft(COLUMNS)p Fu(,)630 3510 y(or)30 b(the)h(screen)f(width,)g(in)g |
16764 | (that)h(order.)150 3682 y Ft(insert-completions)25 b(\(M-*\))630 | |
16765 | 3791 y Fu(Insert)30 b(all)h(completions)h(of)f(the)g(text)g(b)s(efore)f | |
74d0116b | 16766 | (p)s(oin)m(t)h(that)g(w)m(ould)f(ha)m(v)m(e)i(b)s(een)e(generated)630 |
8a0829e9 CR |
16767 | 3901 y(b)m(y)g Ft(possible-completions)p Fu(.)150 4073 |
16768 | y Ft(menu-complete)d(\(\))630 4182 y Fu(Similar)d(to)g | |
6e51e0d0 | 16769 | Ft(complete)p Fu(,)f(but)h(replaces)g(the)g(w)m(ord)g(to)g(b)s(e)f |
8a0829e9 | 16770 | (completed)i(with)e(a)i(single)f(matc)m(h)630 4292 y(from)37 |
eb0b2ad8 | 16771 | b(the)h(list)h(of)f(p)s(ossible)f(completions.)64 b(Rep)s(eated)39 |
8a0829e9 | 16772 | b(execution)g(of)f Ft(menu-complete)630 4401 y Fu(steps)i(through)g |
eb0b2ad8 | 16773 | (the)g(list)h(of)f(p)s(ossible)g(completions,)k(inserting)c(eac)m(h)i |
8a0829e9 | 16774 | (matc)m(h)f(in)f(turn.)630 4511 y(A)m(t)e(the)f(end)f(of)h(the)g(list)g |
eb0b2ad8 | 16775 | (of)g(completions,)i(the)e(b)s(ell)g(is)g(rung)f(\(sub)5 |
8a0829e9 | 16776 | b(ject)36 b(to)i(the)f(setting)630 4621 y(of)f Ft(bell-style)p |
6e51e0d0 CR |
16777 | Fu(\))e(and)h(the)h(original)i(text)f(is)f(restored.)57 |
16778 | b(An)36 b(argumen)m(t)h(of)f Fr(n)f Fu(mo)m(v)m(es)i | |
8a0829e9 | 16779 | Fr(n)630 4730 y Fu(p)s(ositions)e(forw)m(ard)f(in)g(the)h(list)h(of)e |
a9fac3b2 | 16780 | (matc)m(hes;)39 b(a)c(negativ)m(e)i(argumen)m(t)e(ma)m(y)g(b)s(e)f |
8a0829e9 | 16781 | (used)g(to)630 4840 y(mo)m(v)m(e)40 b(bac)m(kw)m(ard)e(through)g(the)g |
a9fac3b2 | 16782 | (list.)65 b(This)38 b(command)g(is)g(in)m(tended)g(to)h(b)s(e)f(b)s |
8a0829e9 CR |
16783 | (ound)e(to)630 4949 y Ft(TAB)p Fu(,)30 b(but)f(is)i(un)m(b)s(ound)d(b)m |
16784 | (y)i(default.)150 5121 y Ft(menu-complete-backward)24 | |
16785 | b(\(\))630 5230 y Fu(Iden)m(tical)36 b(to)g Ft(menu-complete)p | |
6e51e0d0 | 16786 | Fu(,)d(but)h(mo)m(v)m(es)j(bac)m(kw)m(ard)e(through)f(the)i(list)f(of)g |
8a0829e9 CR |
16787 | (p)s(ossible)630 5340 y(completions,)d(as)e(if)h Ft(menu-complete)26 |
16788 | b Fu(had)k(b)s(een)g(giv)m(en)h(a)g(negativ)m(e)i(argumen)m(t.)p | |
16789 | eop end | |
900a813b CR |
16790 | %%Page: 124 130 |
16791 | TeXDict begin 124 129 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16792 | b(Command)29 b(Line)i(Editing)2062 b(124)150 299 y Ft | |
8a0829e9 | 16793 | (delete-char-or-list)25 b(\(\))630 408 y Fu(Deletes)41 |
6e51e0d0 | 16794 | b(the)e(c)m(haracter)h(under)e(the)h(cursor)f(if)h(not)g(at)g(the)h(b)s |
8a0829e9 | 16795 | (eginning)e(or)h(end)f(of)h(the)630 518 y(line)50 b(\(lik)m(e)h |
6e51e0d0 | 16796 | Ft(delete-char)p Fu(\).)96 b(If)49 b(at)h(the)g(end)f(of)h(the)f(line,) |
8a0829e9 CR |
16797 | 55 b(b)s(eha)m(v)m(es)c(iden)m(tically)g(to)630 628 y |
16798 | Ft(possible-completions)p Fu(.)35 b(This)30 b(command)g(is)g(un)m(b)s | |
16799 | (ound)e(b)m(y)i(default.)150 803 y Ft(complete-filename)c(\(M-/\))630 | |
16800 | 913 y Fu(A)m(ttempt)32 b(\014lename)e(completion)i(on)e(the)h(text)g(b) | |
16801 | s(efore)f(p)s(oin)m(t.)150 1088 y Ft(possible-filename-comple)o(tion)o | |
16802 | (s)24 b(\(C-x)30 b(/\))630 1197 y Fu(List)f(the)g(p)s(ossible)f | |
3eb2d94a | 16803 | (completions)h(of)g(the)g(text)g(b)s(efore)g(p)s(oin)m(t,)g(treating)h |
8a0829e9 CR |
16804 | (it)f(as)g(a)f(\014lename.)150 1373 y Ft(complete-username)e(\(M-~\)) |
16805 | 630 1482 y Fu(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i(b)s(efore) | |
16806 | e(p)s(oin)m(t,)g(treating)i(it)f(as)f(a)h(username.)150 | |
16807 | 1658 y Ft(possible-username-comple)o(tion)o(s)24 b(\(C-x)30 | |
16808 | b(~\))630 1767 y Fu(List)25 b(the)g(p)s(ossible)g(completions)h(of)f | |
16809 | (the)g(text)h(b)s(efore)f(p)s(oin)m(t,)h(treating)g(it)g(as)f(a)g | |
16810 | (username.)150 1942 y Ft(complete-variable)h(\(M-$\))630 | |
16811 | 2052 y Fu(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i(b)s(efore)e(p) | |
16812 | s(oin)m(t,)g(treating)i(it)f(as)f(a)h(shell)g(v)-5 b(ariable.)150 | |
16813 | 2227 y Ft(possible-variable-comple)o(tion)o(s)24 b(\(C-x)30 | |
16814 | b($\))630 2337 y Fu(List)42 b(the)g(p)s(ossible)g(completions)h(of)f | |
37c41ab1 | 16815 | (the)g(text)h(b)s(efore)e(p)s(oin)m(t,)46 b(treating)d(it)f(as)g(a)h |
8a0829e9 CR |
16816 | (shell)630 2446 y(v)-5 b(ariable.)150 2622 y Ft(complete-hostname)26 |
16817 | b(\(M-@\))630 2731 y Fu(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i | |
74d0116b | 16818 | (b)s(efore)e(p)s(oin)m(t,)g(treating)i(it)f(as)f(a)h(hostname.)150 |
8a0829e9 CR |
16819 | 2907 y Ft(possible-hostname-comple)o(tion)o(s)24 b(\(C-x)30 |
16820 | b(@\))630 3016 y Fu(List)25 b(the)g(p)s(ossible)f(completions)h(of)g | |
74d0116b | 16821 | (the)g(text)g(b)s(efore)g(p)s(oin)m(t,)h(treating)g(it)f(as)f(a)h |
8a0829e9 CR |
16822 | (hostname.)150 3191 y Ft(complete-command)h(\(M-!\))630 |
16823 | 3301 y Fu(A)m(ttempt)32 b(completion)g(on)f(the)g(text)h(b)s(efore)e(p) | |
74d0116b | 16824 | s(oin)m(t,)h(treating)h(it)g(as)f(a)g(command)g(name.)630 |
8a0829e9 CR |
16825 | 3411 y(Command)46 b(completion)i(attempts)g(to)f(matc)m(h)h(the)f(text) |
16826 | h(against)g(aliases,)53 b(reserv)m(ed)630 3520 y(w)m(ords,)36 | |
510e20a2 | 16827 | b(shell)g(functions,)h(shell)e(builtins,)i(and)e(\014nally)g |
8a0829e9 CR |
16828 | (executable)i(\014lenames,)g(in)e(that)630 3630 y(order.)150 |
16829 | 3805 y Ft(possible-command-complet)o(ions)24 b(\(C-x)29 | |
16830 | b(!\))630 3915 y Fu(List)d(the)h(p)s(ossible)f(completions)h(of)f(the)h | |
510e20a2 | 16831 | (text)g(b)s(efore)f(p)s(oin)m(t,)h(treating)g(it)g(as)g(a)f(command)630 |
8a0829e9 CR |
16832 | 4024 y(name.)150 4200 y Ft(dynamic-complete-history)e(\(M-TAB\))630 |
16833 | 4309 y Fu(A)m(ttempt)31 b(completion)h(on)e(the)g(text)h(b)s(efore)f(p) | |
510e20a2 | 16834 | s(oin)m(t,)g(comparing)h(the)f(text)h(against)h(lines)630 |
8a0829e9 CR |
16835 | 4419 y(from)e(the)g(history)h(list)g(for)f(p)s(ossible)g(completion)i |
16836 | (matc)m(hes.)150 4594 y Ft(dabbrev-expand)26 b(\(\))630 | |
16837 | 4704 y Fu(A)m(ttempt)i(men)m(u)e(completion)i(on)f(the)g(text)g(b)s | |
510e20a2 | 16838 | (efore)f(p)s(oin)m(t,)i(comparing)f(the)g(text)h(against)630 |
8a0829e9 CR |
16839 | 4813 y(lines)j(from)e(the)i(history)f(list)h(for)g(p)s(ossible)e |
16840 | (completion)j(matc)m(hes.)150 4988 y Ft(complete-into-braces)25 | |
16841 | b(\(M-{\))630 5098 y Fu(P)m(erform)f(\014lename)f(completion)i(and)f | |
3eb2d94a | 16842 | (insert)f(the)h(list)g(of)g(p)s(ossible)f(completions)i(enclosed)630 |
8a0829e9 | 16843 | 5208 y(within)34 b(braces)h(so)f(the)h(list)g(is)g(a)m(v)-5 |
3eb2d94a | 16844 | b(ailable)37 b(to)e(the)g(shell)g(\(see)g(Section)h(3.5.1)g([Brace)g |
8a0829e9 | 16845 | (Ex-)630 5317 y(pansion],)30 b(page)h(21\).)p eop end |
900a813b CR |
16846 | %%Page: 125 131 |
16847 | TeXDict begin 125 130 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16848 | b(Command)29 b(Line)i(Editing)2062 b(125)150 299 y Fk(8.4.7)63 | |
8a0829e9 CR |
16849 | b(Keyb)s(oard)41 b(Macros)150 469 y Ft(start-kbd-macro)26 |
16850 | b(\(C-x)j(\(\))630 579 y Fu(Begin)i(sa)m(ving)h(the)e(c)m(haracters)i | |
16851 | (t)m(yp)s(ed)e(in)m(to)h(the)g(curren)m(t)f(k)m(eyb)s(oard)g(macro.)150 | |
16852 | 735 y Ft(end-kbd-macro)d(\(C-x)i(\)\))630 845 y Fu(Stop)e(sa)m(ving)h | |
16853 | (the)g(c)m(haracters)g(t)m(yp)s(ed)f(in)m(to)i(the)e(curren)m(t)g(k)m | |
16854 | (eyb)s(oard)g(macro)h(and)f(sa)m(v)m(e)i(the)630 954 | |
16855 | y(de\014nition.)150 1110 y Ft(call-last-kbd-macro)c(\(C-x)k(e\))630 | |
16856 | 1220 y Fu(Re-execute)37 b(the)e(last)h(k)m(eyb)s(oard)f(macro)h | |
16857 | (de\014ned,)f(b)m(y)h(making)f(the)g(c)m(haracters)i(in)e(the)630 | |
16858 | 1329 y(macro)c(app)s(ear)f(as)g(if)h(t)m(yp)s(ed)f(at)h(the)f(k)m(eyb)s | |
16859 | (oard.)150 1486 y Ft(print-last-kbd-macro)25 b(\(\))630 | |
16860 | 1595 y Fu(Prin)m(t)30 b(the)h(last)g(k)m(eb)s(oard)f(macro)h(de\014ned) | |
16861 | e(in)i(a)f(format)h(suitable)g(for)f(the)h Fr(inputrc)k | |
16862 | Fu(\014le.)150 1791 y Fk(8.4.8)63 b(Some)41 b(Miscellaneous)i(Commands) | |
16863 | 150 1962 y Ft(re-read-init-file)26 b(\(C-x)j(C-r\))630 | |
16864 | 2071 y Fu(Read)22 b(in)g(the)g(con)m(ten)m(ts)h(of)f(the)g | |
6e51e0d0 | 16865 | Fr(inputrc)27 b Fu(\014le,)d(and)d(incorp)s(orate)h(an)m(y)h(bindings)d |
8a0829e9 CR |
16866 | (or)i(v)-5 b(ariable)630 2181 y(assignmen)m(ts)31 b(found)e(there.)150 |
16867 | 2337 y Ft(abort)g(\(C-g\))630 2447 y Fu(Ab)s(ort)d(the)h(curren)m(t)f | |
ad4aef08 | 16868 | (editing)h(command)f(and)g(ring)h(the)f(terminal's)h(b)s(ell)g(\(sub)5 |
8a0829e9 CR |
16869 | b(ject)26 b(to)i(the)630 2556 y(setting)j(of)g Ft(bell-style)p |
16870 | Fu(\).)150 2712 y Ft(do-uppercase-version)25 b(\(M-a,)k(M-b,)g(M-)p | |
16871 | Fj(x)p Ft(,)g(...)o(\))630 2822 y Fu(If)e(the)h(meta\014ed)g(c)m | |
6e51e0d0 | 16872 | (haracter)h Fr(x)34 b Fu(is)28 b(lo)m(w)m(ercase,)i(run)d(the)g |
8a0829e9 CR |
16873 | (command)h(that)g(is)g(b)s(ound)d(to)k(the)630 2932 y(corresp)s(onding) |
16874 | g(upp)s(ercase)h(c)m(haracter.)150 3088 y Ft(prefix-meta)d(\(ESC\))630 | |
16875 | 3197 y Fu(Metafy)39 b(the)e(next)h(c)m(haracter)h(t)m(yp)s(ed.)62 | |
74d0116b | 16876 | b(This)37 b(is)g(for)h(k)m(eyb)s(oards)f(without)g(a)h(meta)g(k)m(ey)-8 |
8a0829e9 CR |
16877 | b(.)630 3307 y(T)m(yping)30 b(`)p Ft(ESC)g(f)p Fu(')g(is)h(equiv)-5 |
16878 | b(alen)m(t)31 b(to)g(t)m(yping)g Fj(M-f)p Fu(.)150 3463 | |
16879 | y Ft(undo)e(\(C-_)g(or)h(C-x)g(C-u\))630 3573 y Fu(Incremen)m(tal)h | |
74d0116b | 16880 | (undo,)f(separately)h(remem)m(b)s(ered)f(for)g(eac)m(h)i(line.)150 |
8a0829e9 | 16881 | 3729 y Ft(revert-line)27 b(\(M-r\))630 3838 y Fu(Undo)33 |
74d0116b | 16882 | b(all)h(c)m(hanges)g(made)f(to)h(this)f(line.)49 b(This)32 |
6e51e0d0 | 16883 | b(is)h(lik)m(e)i(executing)f(the)f Ft(undo)f Fu(command)630 |
8a0829e9 CR |
16884 | 3948 y(enough)e(times)h(to)g(get)h(bac)m(k)f(to)g(the)f(b)s(eginning.) |
16885 | 150 4104 y Ft(tilde-expand)d(\(M-&\))630 4214 y Fu(P)m(erform)j(tilde)h | |
16886 | (expansion)g(on)f(the)g(curren)m(t)h(w)m(ord.)150 4370 | |
16887 | y Ft(set-mark)d(\(C-@\))630 4480 y Fu(Set)33 b(the)g(mark)f(to)i(the)f | |
74d0116b | 16888 | (p)s(oin)m(t.)48 b(If)32 b(a)h(n)m(umeric)g(argumen)m(t)g(is)g |
8a0829e9 CR |
16889 | (supplied,)f(the)h(mark)g(is)f(set)630 4589 y(to)f(that)g(p)s(osition.) |
16890 | 150 4745 y Ft(exchange-point-and-mark)24 b(\(C-x)29 b(C-x\))630 | |
16891 | 4855 y Fu(Sw)m(ap)i(the)g(p)s(oin)m(t)g(with)g(the)g(mark.)43 | |
74d0116b | 16892 | b(The)31 b(curren)m(t)g(cursor)f(p)s(osition)i(is)f(set)h(to)f(the)h |
8a0829e9 CR |
16893 | (sa)m(v)m(ed)630 4965 y(p)s(osition,)f(and)e(the)i(old)g(cursor)e(p)s |
16894 | (osition)i(is)f(sa)m(v)m(ed)i(as)e(the)h(mark.)150 5121 | |
16895 | y Ft(character-search)26 b(\(C-]\))630 5230 y Fu(A)f(c)m(haracter)h(is) | |
74d0116b | 16896 | f(read)g(and)f(p)s(oin)m(t)h(is)g(mo)m(v)m(ed)h(to)g(the)f(next)g(o)s |
8a0829e9 | 16897 | (ccurrence)g(of)g(that)g(c)m(haracter.)630 5340 y(A)30 |
37c41ab1 | 16898 | b(negativ)m(e)j(coun)m(t)e(searc)m(hes)g(for)f(previous)g(o)s |
8a0829e9 | 16899 | (ccurrences.)p eop end |
900a813b CR |
16900 | %%Page: 126 132 |
16901 | TeXDict begin 126 131 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16902 | b(Command)29 b(Line)i(Editing)2062 b(126)150 299 y Ft | |
8a0829e9 CR |
16903 | (character-search-backwar)o(d)24 b(\(M-C-]\))630 408 |
16904 | y Fu(A)45 b(c)m(haracter)h(is)f(read)g(and)f(p)s(oin)m(t)h(is)g(mo)m(v) | |
16905 | m(ed)h(to)f(the)g(previous)f(o)s(ccurrence)h(of)g(that)630 | |
16906 | 518 y(c)m(haracter.)d(A)31 b(negativ)m(e)h(coun)m(t)f(searc)m(hes)h | |
16907 | (for)e(subsequen)m(t)f(o)s(ccurrences.)150 722 y Ft(skip-csi-sequence)d | |
16908 | (\(\))630 831 y Fu(Read)i(enough)f(c)m(haracters)h(to)g(consume)f(a)h | |
16909 | (m)m(ulti-k)m(ey)h(sequence)f(suc)m(h)f(as)g(those)h(de\014ned)630 | |
16910 | 941 y(for)37 b(k)m(eys)h(lik)m(e)g(Home)g(and)f(End.)60 | |
16911 | b(Suc)m(h)37 b(sequences)g(b)s(egin)g(with)g(a)h(Con)m(trol)g(Sequence) | |
16912 | 630 1050 y(Indicator)f(\(CSI\),)f(usually)h(ESC-[.)59 | |
6e51e0d0 | 16913 | b(If)36 b(this)g(sequence)h(is)g(b)s(ound)d(to)k Ft("\\)p |
8a0829e9 | 16914 | Fu(e[)p Ft(")p Fu(,)g(k)m(eys)f(pro-)630 1160 y(ducing)31 |
8f714a7c | 16915 | b(suc)m(h)h(sequences)g(will)h(ha)m(v)m(e)g(no)f(e\013ect)h(unless)e |
8a0829e9 | 16916 | (explicitly)j(b)s(ound)c(to)i(a)h(readline)630 1270 y(command,)f |
8f714a7c | 16917 | (instead)g(of)g(inserting)g(stra)m(y)h(c)m(haracters)g(in)m(to)g(the)f |
8a0829e9 CR |
16918 | (editing)h(bu\013er.)44 b(This)31 b(is)630 1379 y(un)m(b)s(ound)d(b)m |
16919 | (y)i(default,)h(but)f(usually)g(b)s(ound)e(to)j(ESC-[.)150 | |
16920 | 1583 y Ft(insert-comment)26 b(\(M-#\))630 1692 y Fu(Without)36 | |
16921 | b(a)g(n)m(umeric)g(argumen)m(t,)h(the)f(v)-5 b(alue)36 | |
16922 | b(of)g(the)g Ft(comment-begin)c Fu(v)-5 b(ariable)36 | |
16923 | b(is)g(in-)630 1802 y(serted)c(at)g(the)g(b)s(eginning)f(of)h(the)f | |
16924 | (curren)m(t)h(line.)45 b(If)31 b(a)h(n)m(umeric)f(argumen)m(t)h(is)g | |
16925 | (supplied,)630 1911 y(this)k(command)h(acts)g(as)g(a)g(toggle:)55 | |
16926 | b(if)37 b(the)f(c)m(haracters)i(at)g(the)e(b)s(eginning)g(of)h(the)g | |
16927 | (line)630 2021 y(do)30 b(not)h(matc)m(h)h(the)f(v)-5 | |
16928 | b(alue)31 b(of)f Ft(comment-begin)p Fu(,)e(the)i(v)-5 | |
16929 | b(alue)31 b(is)g(inserted,)g(otherwise)g(the)630 2131 | |
16930 | y(c)m(haracters)42 b(in)d Ft(comment-begin)e Fu(are)j(deleted)h(from)f | |
16931 | (the)g(b)s(eginning)g(of)g(the)g(line.)71 b(In)630 2240 | |
16932 | y(either)37 b(case,)j(the)e(line)f(is)g(accepted)i(as)e(if)g(a)g | |
16933 | (newline)g(had)g(b)s(een)f(t)m(yp)s(ed.)60 b(The)37 b(default)630 | |
16934 | 2350 y(v)-5 b(alue)32 b(of)g Ft(comment-begin)c Fu(causes)k(this)f | |
16935 | (command)h(to)g(mak)m(e)h(the)e(curren)m(t)h(line)g(a)g(shell)630 | |
16936 | 2459 y(commen)m(t.)40 b(If)26 b(a)h(n)m(umeric)f(argumen)m(t)h(causes)g | |
16937 | (the)f(commen)m(t)i(c)m(haracter)g(to)f(b)s(e)f(remo)m(v)m(ed,)630 | |
16938 | 2569 y(the)31 b(line)f(will)h(b)s(e)f(executed)h(b)m(y)f(the)h(shell.) | |
16939 | 150 2772 y Ft(dump-functions)26 b(\(\))630 2882 y Fu(Prin)m(t)g(all)i | |
16940 | (of)e(the)h(functions)f(and)g(their)g(k)m(ey)h(bindings)e(to)j(the)e | |
16941 | (Readline)h(output)f(stream.)630 2992 y(If)31 b(a)h(n)m(umeric)g | |
16942 | (argumen)m(t)g(is)g(supplied,)f(the)h(output)f(is)h(formatted)g(in)f | |
16943 | (suc)m(h)h(a)g(w)m(a)m(y)g(that)630 3101 y(it)f(can)g(b)s(e)e(made)i | |
16944 | (part)f(of)g(an)h Fr(inputrc)k Fu(\014le.)41 b(This)29 | |
16945 | b(command)h(is)h(un)m(b)s(ound)c(b)m(y)k(default.)150 | |
16946 | 3305 y Ft(dump-variables)26 b(\(\))630 3414 y Fu(Prin)m(t)21 | |
16947 | b(all)h(of)g(the)f(settable)i(v)-5 b(ariables)22 b(and)f(their)g(v)-5 | |
16948 | b(alues)22 b(to)g(the)f(Readline)h(output)f(stream.)630 | |
16949 | 3524 y(If)31 b(a)h(n)m(umeric)g(argumen)m(t)g(is)g(supplied,)f(the)h | |
74d0116b | 16950 | (output)f(is)h(formatted)g(in)f(suc)m(h)h(a)g(w)m(a)m(y)g(that)630 |
8a0829e9 | 16951 | 3634 y(it)f(can)g(b)s(e)e(made)i(part)f(of)g(an)h Fr(inputrc)k |
6e51e0d0 | 16952 | Fu(\014le.)41 b(This)29 b(command)h(is)h(un)m(b)s(ound)c(b)m(y)k |
8a0829e9 CR |
16953 | (default.)150 3837 y Ft(dump-macros)c(\(\))630 3947 y |
16954 | Fu(Prin)m(t)34 b(all)g(of)g(the)g(Readline)g(k)m(ey)h(sequences)f(b)s | |
16955 | (ound)e(to)i(macros)g(and)f(the)h(strings)g(they)630 | |
16956 | 4056 y(output.)53 b(If)35 b(a)g(n)m(umeric)f(argumen)m(t)i(is)e | |
eb0b2ad8 | 16957 | (supplied,)h(the)g(output)g(is)f(formatted)i(in)e(suc)m(h)h(a)630 |
8a0829e9 | 16958 | 4166 y(w)m(a)m(y)c(that)g(it)f(can)g(b)s(e)g(made)g(part)f(of)i(an)e |
6e51e0d0 | 16959 | Fr(inputrc)35 b Fu(\014le.)41 b(This)29 b(command)h(is)g(un)m(b)s(ound) |
8a0829e9 CR |
16960 | d(b)m(y)630 4275 y(default.)150 4479 y Ft(glob-complete-word)e(\(M-g\)) |
16961 | 630 4589 y Fu(The)i(w)m(ord)h(b)s(efore)f(p)s(oin)m(t)h(is)g(treated)h | |
eb0b2ad8 | 16962 | (as)f(a)h(pattern)f(for)f(pathname)h(expansion,)g(with)g(an)630 |
8a0829e9 | 16963 | 4698 y(asterisk)d(implicitly)h(app)s(ended.)37 b(This)23 |
a8fd3f3e | 16964 | b(pattern)i(is)f(used)g(to)h(generate)h(a)e(list)h(of)g(matc)m(hing)630 |
8a0829e9 CR |
16965 | 4808 y(\014le)30 b(names)h(for)f(p)s(ossible)g(completions.)150 |
16966 | 5011 y Ft(glob-expand-word)c(\(C-x)j(*\))630 5121 y Fu(The)40 | |
a8fd3f3e | 16967 | b(w)m(ord)g(b)s(efore)g(p)s(oin)m(t)h(is)g(treated)g(as)g(a)g(pattern)g |
8a0829e9 | 16968 | (for)f(pathname)g(expansion,)k(and)630 5230 y(the)c(list)g(of)f(matc)m |
a8fd3f3e | 16969 | (hing)i(\014le)e(names)g(is)h(inserted,)h(replacing)g(the)e(w)m(ord.)67 |
8a0829e9 | 16970 | b(If)39 b(a)h(n)m(umeric)630 5340 y(argumen)m(t)31 b(is)f(supplied,)g |
6e51e0d0 | 16971 | (a)g(`)p Ft(*)p Fu(')h(is)f(app)s(ended)f(b)s(efore)h(pathname)g |
8a0829e9 | 16972 | (expansion.)p eop end |
900a813b CR |
16973 | %%Page: 127 133 |
16974 | TeXDict begin 127 132 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16975 | b(Command)29 b(Line)i(Editing)2062 b(127)150 299 y Ft | |
8a0829e9 CR |
16976 | (glob-list-expansions)25 b(\(C-x)k(g\))630 408 y Fu(The)k(list)h(of)f |
16977 | (expansions)g(that)h(w)m(ould)f(ha)m(v)m(e)h(b)s(een)f(generated)h(b)m | |
16978 | (y)f Ft(glob-expand-word)630 518 y Fu(is)h(displa)m(y)m(ed,)h(and)e | |
16979 | (the)h(line)g(is)f(redra)m(wn.)50 b(If)33 b(a)h(n)m(umeric)g(argumen)m | |
16980 | (t)g(is)f(supplied,)h(a)g(`)p Ft(*)p Fu(')630 628 y(is)c(app)s(ended)f | |
967625cd CR |
16981 | (b)s(efore)h(pathname)g(expansion.)150 803 y Ft(display-shell-version) |
16982 | 25 b(\(C-x)k(C-v\))630 912 y Fu(Displa)m(y)j(v)m(ersion)e(information)h | |
8a0829e9 | 16983 | (ab)s(out)f(the)h(curren)m(t)f(instance)h(of)f(Bash.)150 |
967625cd | 16984 | 1088 y Ft(shell-expand-line)c(\(M-C-e\))630 1197 y Fu(Expand)34 |
8a0829e9 CR |
16985 | b(the)h(line)h(as)g(the)f(shell)h(do)s(es.)55 b(This)34 |
16986 | b(p)s(erforms)g(alias)i(and)f(history)g(expansion)630 | |
967625cd | 16987 | 1307 y(as)f(w)m(ell)g(as)g(all)h(of)e(the)h(shell)g(w)m(ord)f |
8a0829e9 | 16988 | (expansions)g(\(see)i(Section)f(3.5)h([Shell)e(Expansions],)630 |
967625cd CR |
16989 | 1416 y(page)e(21\).)150 1592 y Ft(history-expand-line)25 |
16990 | b(\(M-^\))630 1701 y Fu(P)m(erform)30 b(history)h(expansion)f(on)g(the) | |
16991 | h(curren)m(t)f(line.)150 1876 y Ft(magic-space)d(\(\))630 | |
16992 | 1986 y Fu(P)m(erform)c(history)g(expansion)g(on)g(the)g(curren)m(t)g | |
8a0829e9 | 16993 | (line)g(and)g(insert)g(a)g(space)h(\(see)g(Section)g(9.3)630 |
967625cd CR |
16994 | 2096 y([History)31 b(In)m(teraction],)i(page)e(138\).)150 |
16995 | 2271 y Ft(alias-expand-line)26 b(\(\))630 2380 y Fu(P)m(erform)i(alias) | |
8a0829e9 | 16996 | i(expansion)e(on)g(the)h(curren)m(t)f(line)h(\(see)g(Section)g(6.6)h |
967625cd CR |
16997 | ([Aliases],)g(page)f(89\).)150 2556 y Ft(history-and-alias-expand)o |
16998 | (-lin)o(e)24 b(\(\))630 2665 y Fu(P)m(erform)30 b(history)h(and)e | |
45c0f7f8 | 16999 | (alias)j(expansion)e(on)g(the)h(curren)m(t)f(line.)150 |
967625cd CR |
17000 | 2840 y Ft(insert-last-argument)25 b(\(M-.)k(or)h(M-_\))630 |
17001 | 2950 y Fu(A)g(synon)m(ym)g(for)g Ft(yank-last-arg)p Fu(.)150 | |
17002 | 3125 y Ft(operate-and-get-next)25 b(\(C-o\))630 3235 | |
6e51e0d0 | 17003 | y Fu(Accept)42 b(the)e(curren)m(t)h(line)f(for)h(execution)g(and)f |
74d0116b | 17004 | (fetc)m(h)i(the)e(next)h(line)g(relativ)m(e)i(to)e(the)630 |
967625cd CR |
17005 | 3344 y(curren)m(t)30 b(line)h(from)f(the)g(history)h(for)f(editing.)41 |
17006 | b(An)m(y)31 b(argumen)m(t)f(is)h(ignored.)150 3520 y | |
17007 | Ft(edit-and-execute-command)24 b(\(C-xC-e\))630 3629 | |
6e51e0d0 | 17008 | y Fu(In)m(v)m(ok)m(e)34 b(an)f(editor)g(on)g(the)g(curren)m(t)f |
74d0116b | 17009 | (command)h(line,)h(and)e(execute)i(the)f(result)g(as)g(shell)630 |
967625cd | 17010 | 3739 y(commands.)81 b(Bash)44 b(attempts)h(to)g(in)m(v)m(ok)m(e)h |
6e51e0d0 | 17011 | Ft($VISUAL)p Fu(,)f Ft($EDITOR)p Fu(,)h(and)d Ft(emacs)g |
967625cd CR |
17012 | Fu(as)h(the)630 3848 y(editor,)31 b(in)f(that)h(order.)150 |
17013 | 4113 y Fs(8.5)68 b(Readline)47 b(vi)e(Mo)t(de)150 4272 | |
6e51e0d0 CR |
17014 | y Fu(While)32 b(the)g(Readline)g(library)f(do)s(es)g(not)h(ha)m(v)m(e)h |
17015 | (a)f(full)f(set)h(of)g Ft(vi)f Fu(editing)h(functions,)f(it)h(do)s(es)g | |
967625cd | 17016 | (con)m(tain)150 4382 y(enough)i(to)h(allo)m(w)g(simple)f(editing)h(of)f |
6e51e0d0 | 17017 | (the)g(line.)52 b(The)34 b(Readline)g Ft(vi)g Fu(mo)s(de)f(b)s(eha)m(v) |
967625cd CR |
17018 | m(es)i(as)f(sp)s(eci\014ed)f(in)150 4491 y(the)e Fm(posix)e |
17019 | Fu(standard.)275 4642 y(In)35 b(order)g(to)i(switc)m(h)f(in)m(teractiv) | |
6e51e0d0 CR |
17020 | m(ely)j(b)s(et)m(w)m(een)d Ft(emacs)f Fu(and)g Ft(vi)g |
17021 | Fu(editing)h(mo)s(des,)h(use)f(the)g(`)p Ft(set)30 b(-o)150 | |
8a0829e9 | 17022 | 4751 y(emacs)p Fu(')43 b(and)h(`)p Ft(set)30 b(-o)f(vi)p |
6e51e0d0 | 17023 | Fu(')44 b(commands)g(\(see)i(Section)f(4.3.1)h([The)e(Set)h(Builtin],)j |
967625cd | 17024 | (page)e(59\).)83 b(The)150 4861 y(Readline)31 b(default)g(is)f |
8a0829e9 | 17025 | Ft(emacs)f Fu(mo)s(de.)275 5011 y(When)g(y)m(ou)i(en)m(ter)f(a)h(line)f |
6e51e0d0 | 17026 | (in)g Ft(vi)f Fu(mo)s(de,)h(y)m(ou)h(are)f(already)h(placed)f(in)g |
8a0829e9 | 17027 | (`insertion')g(mo)s(de,)g(as)h(if)f(y)m(ou)150 5121 y(had)f(t)m(yp)s |
6e51e0d0 CR |
17028 | (ed)g(an)g(`)p Ft(i)p Fu('.)41 b(Pressing)29 b Ft(ESC)f |
17029 | Fu(switc)m(hes)i(y)m(ou)g(in)m(to)h(`command')e(mo)s(de,)h(where)e(y)m | |
8a0829e9 | 17030 | (ou)i(can)g(edit)g(the)150 5230 y(text)35 b(of)f(the)g(line)g(with)f |
6e51e0d0 | 17031 | (the)h(standard)f Ft(vi)g Fu(mo)m(v)m(emen)m(t)j(k)m(eys,)g(mo)m(v)m(e) |
8a0829e9 | 17032 | f(to)f(previous)g(history)f(lines)h(with)150 5340 y(`)p |
6e51e0d0 | 17033 | Ft(k)p Fu(')d(and)e(subsequen)m(t)h(lines)h(with)f(`)p |
8a0829e9 | 17034 | Ft(j)p Fu(',)g(and)g(so)h(forth.)p eop end |
900a813b CR |
17035 | %%Page: 128 134 |
17036 | TeXDict begin 128 133 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17037 | b(Command)29 b(Line)i(Editing)2062 b(128)150 299 y Fs(8.6)68 | |
8a0829e9 CR |
17038 | b(Programmable)47 b(Completion)150 458 y Fu(When)25 b(w)m(ord)g |
17039 | (completion)i(is)f(attempted)g(for)g(an)f(argumen)m(t)h(to)g(a)g | |
17040 | (command)f(for)h(whic)m(h)f(a)h(completion)150 568 y(sp)s | |
17041 | (eci\014cation)40 b(\(a)h Fr(compsp)s(ec)6 b Fu(\))39 | |
6e51e0d0 | 17042 | b(has)h(b)s(een)f(de\014ned)f(using)h(the)h Ft(complete)d |
8a0829e9 | 17043 | Fu(builtin)j(\(see)g(Section)h(8.7)150 677 y([Programmable)h |
900a813b | 17044 | (Completion)f(Builtins],)k(page)d(130\),)j(the)c(programmable)g |
8a0829e9 CR |
17045 | (completion)i(facilities)150 787 y(are)31 b(in)m(v)m(ok)m(ed.)275 |
17046 | 936 y(First,)23 b(the)e(command)g(name)g(is)h(iden)m(ti\014ed.)37 | |
74d0116b | 17047 | b(If)21 b(a)g(compsp)s(ec)g(has)g(b)s(een)f(de\014ned)g(for)h(that)h |
8a0829e9 | 17048 | (command,)150 1046 y(the)44 b(compsp)s(ec)g(is)g(used)f(to)h(generate)i |
74d0116b | 17049 | (the)e(list)g(of)g(p)s(ossible)g(completions)h(for)e(the)h(w)m(ord.)81 |
8a0829e9 | 17050 | b(If)44 b(the)150 1156 y(command)36 b(w)m(ord)g(is)g(the)g(empt)m(y)h |
74d0116b | 17051 | (string)f(\(completion)i(attempted)f(at)g(the)g(b)s(eginning)e(of)h(an) |
8a0829e9 | 17052 | h(empt)m(y)150 1265 y(line\),)30 b(an)m(y)g(compsp)s(ec)f(de\014ned)f |
6e51e0d0 CR |
17053 | (with)h(the)h Ft(-E)e Fu(option)i(to)g Ft(complete)d |
17054 | Fu(is)i(used.)40 b(If)29 b(the)g(command)g(w)m(ord)150 | |
8a0829e9 | 17055 | 1375 y(is)e(a)h(full)e(pathname,)i(a)g(compsp)s(ec)e(for)h(the)g(full)g |
8f714a7c | 17056 | (pathname)g(is)g(searc)m(hed)h(for)f(\014rst.)39 b(If)26 |
8a0829e9 | 17057 | b(no)h(compsp)s(ec)g(is)150 1484 y(found)22 b(for)g(the)h(full)g |
8f714a7c | 17058 | (pathname,)h(an)f(attempt)h(is)f(made)g(to)g(\014nd)f(a)h(compsp)s(ec)f |
8a0829e9 | 17059 | (for)h(the)g(p)s(ortion)f(follo)m(wing)150 1594 y(the)34 |
8f714a7c CR |
17060 | b(\014nal)g(slash.)53 b(If)34 b(those)g(searc)m(hes)i(do)e(not)g |
17061 | (result)h(in)f(a)g(compsp)s(ec,)h(an)m(y)g(compsp)s(ec)f(de\014ned)f | |
8a0829e9 CR |
17062 | (with)150 1704 y(the)e Ft(-D)e Fu(option)i(to)g Ft(complete)d |
17063 | Fu(is)j(used)e(as)i(the)g(default.)275 1853 y(Once)j(a)g(compsp)s(ec)g | |
17064 | (has)g(b)s(een)f(found,)h(it)h(is)f(used)f(to)i(generate)h(the)e(list)h | |
17065 | (of)f(matc)m(hing)h(w)m(ords.)51 b(If)150 1963 y(a)37 | |
17066 | b(compsp)s(ec)f(is)g(not)h(found,)f(the)h(default)f(Bash)h(completion)g | |
17067 | (describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g(8.4.6)150 | |
900a813b | 17068 | 2072 y([Commands)30 b(F)-8 b(or)31 b(Completion],)g(page)g(123\))h(is)f |
8a0829e9 CR |
17069 | (p)s(erformed.)275 2222 y(First,)g(the)g(actions)g(sp)s(eci\014ed)f(b)m |
17070 | (y)h(the)f(compsp)s(ec)h(are)g(used.)40 b(Only)30 b(matc)m(hes)i(whic)m | |
17071 | (h)e(are)h(pre\014xed)150 2331 y(b)m(y)h(the)f(w)m(ord)h(b)s(eing)f | |
17072 | (completed)h(are)g(returned.)44 b(When)31 b(the)h Ft(-f)f | |
17073 | Fu(or)h Ft(-d)f Fu(option)h(is)f(used)g(for)h(\014lename)150 | |
17074 | 2441 y(or)e(directory)h(name)f(completion,)i(the)e(shell)h(v)-5 | |
17075 | b(ariable)31 b Ft(FIGNORE)d Fu(is)i(used)f(to)i(\014lter)g(the)f(matc)m | |
17076 | (hes.)42 b(See)150 2550 y(Section)31 b(5.2)h([Bash)e(V)-8 | |
900a813b | 17077 | b(ariables],)33 b(page)e(70,)g(for)f(a)h(description)g(of)f |
8a0829e9 | 17078 | Ft(FIGNORE)p Fu(.)275 2700 y(An)m(y)22 b(completions)h(sp)s(eci\014ed)f |
6e51e0d0 | 17079 | (b)m(y)g(a)h(\014lename)f(expansion)h(pattern)f(to)h(the)g |
8a0829e9 | 17080 | Ft(-G)e Fu(option)i(are)g(generated)150 2809 y(next.)41 |
6e51e0d0 CR |
17081 | b(The)29 b(w)m(ords)g(generated)h(b)m(y)g(the)g(pattern)f(need)h(not)f |
17082 | (matc)m(h)i(the)f(w)m(ord)f(b)s(eing)g(completed.)41 | |
8a0829e9 | 17083 | b(The)150 2919 y Ft(GLOBIGNORE)29 b Fu(shell)i(v)-5 b(ariable)32 |
6e51e0d0 | 17084 | b(is)g(not)g(used)e(to)i(\014lter)g(the)g(matc)m(hes,)h(but)d(the)i |
8a0829e9 CR |
17085 | Ft(FIGNORE)e Fu(shell)h(v)-5 b(ariable)150 3029 y(is)30 |
17086 | b(used.)275 3178 y(Next,)39 b(the)f(string)f(sp)s(eci\014ed)f(as)h(the) | |
6e51e0d0 | 17087 | g(argumen)m(t)h(to)g(the)f Ft(-W)f Fu(option)i(is)f(considered.)60 |
8a0829e9 | 17088 | b(The)37 b(string)150 3288 y(is)c(\014rst)e(split)i(using)f(the)h(c)m |
6e51e0d0 | 17089 | (haracters)h(in)e(the)h Ft(IFS)e Fu(sp)s(ecial)j(v)-5 |
37c41ab1 | 17090 | b(ariable)33 b(as)g(delimiters.)48 b(Shell)32 b(quoting)h(is)150 |
8a0829e9 | 17091 | 3397 y(honored.)56 b(Eac)m(h)37 b(w)m(ord)e(is)h(then)f(expanded)g |
74d0116b | 17092 | (using)h(brace)g(expansion,)h(tilde)f(expansion,)h(parameter)150 |
8a0829e9 | 17093 | 3507 y(and)44 b(v)-5 b(ariable)46 b(expansion,)j(command)44 |
74d0116b | 17094 | b(substitution,)49 b(and)44 b(arithmetic)i(expansion,)j(as)c(describ)s |
8a0829e9 | 17095 | (ed)150 3616 y(ab)s(o)m(v)m(e)38 b(\(see)f(Section)h(3.5)g([Shell)e |
1101193a | 17096 | (Expansions],)i(page)f(21\).)61 b(The)36 b(results)h(are)g(split)f |
8a0829e9 CR |
17097 | (using)h(the)f(rules)150 3726 y(describ)s(ed)29 b(ab)s(o)m(v)m(e)i |
17098 | (\(see)f(Section)h(3.5.7)h([W)-8 b(ord)30 b(Splitting],)h(page)f(30\).) | |
17099 | 42 b(The)30 b(results)f(of)h(the)g(expansion)150 3836 | |
74d0116b CR |
17100 | y(are)f(pre\014x-matc)m(hed)h(against)g(the)f(w)m(ord)g(b)s(eing)f |
17101 | (completed,)j(and)d(the)i(matc)m(hing)g(w)m(ords)e(b)s(ecome)i(the)150 | |
8a0829e9 | 17102 | 3945 y(p)s(ossible)g(completions.)275 4095 y(After)f(these)g(matc)m |
74d0116b | 17103 | (hes)i(ha)m(v)m(e)f(b)s(een)f(generated,)h(an)m(y)g(shell)f(function)g |
8a0829e9 | 17104 | (or)g(command)g(sp)s(eci\014ed)f(with)150 4204 y(the)36 |
6e51e0d0 CR |
17105 | b Ft(-F)f Fu(and)g Ft(-C)g Fu(options)h(is)g(in)m(v)m(ok)m(ed.)59 |
17106 | b(When)35 b(the)h(command)g(or)f(function)h(is)g(in)m(v)m(ok)m(ed,)i | |
8a0829e9 | 17107 | (the)e Ft(COMP_)150 4314 y(LINE)p Fu(,)42 b Ft(COMP_POINT)p |
6e51e0d0 | 17108 | Fu(,)d Ft(COMP_KEY)p Fu(,)i(and)e Ft(COMP_TYPE)f Fu(v)-5 |
510e20a2 | 17109 | b(ariables)41 b(are)f(assigned)g(v)-5 b(alues)41 b(as)f(describ)s(ed) |
8a0829e9 | 17110 | 150 4423 y(ab)s(o)m(v)m(e)34 b(\(see)g(Section)g(5.2)g([Bash)f(V)-8 |
900a813b | 17111 | b(ariables],)36 b(page)d(70\).)50 b(If)33 b(a)g(shell)g(function)g(is)g |
8a0829e9 | 17112 | (b)s(eing)f(in)m(v)m(ok)m(ed,)k(the)150 4533 y Ft(COMP_WORDS)j |
6e51e0d0 | 17113 | Fu(and)i Ft(COMP_CWORD)d Fu(v)-5 b(ariables)42 b(are)g(also)h(set.)74 |
8a0829e9 | 17114 | b(When)41 b(the)h(function)f(or)h(command)f(is)150 4643 |
45c0f7f8 CR |
17115 | y(in)m(v)m(ok)m(ed,)c(the)e(\014rst)f(argumen)m(t)h(\($1\))h(is)e(the)h |
17116 | (name)g(of)f(the)h(command)f(whose)h(argumen)m(ts)f(are)h(b)s(eing)150 | |
8a0829e9 | 17117 | 4752 y(completed,)30 b(the)f(second)f(argumen)m(t)h(\($2\))h(is)f(the)g |
45c0f7f8 | 17118 | (w)m(ord)f(b)s(eing)g(completed,)i(and)e(the)h(third)e(argumen)m(t)150 |
8a0829e9 | 17119 | 4862 y(\($3\))40 b(is)f(the)f(w)m(ord)h(preceding)f(the)h(w)m(ord)f(b)s |
45c0f7f8 | 17120 | (eing)g(completed)i(on)e(the)h(curren)m(t)f(command)h(line.)65 |
8a0829e9 | 17121 | b(No)150 4971 y(\014ltering)33 b(of)h(the)f(generated)h(completions)g |
45c0f7f8 | 17122 | (against)h(the)e(w)m(ord)g(b)s(eing)f(completed)i(is)g(p)s(erformed;)f |
8a0829e9 CR |
17123 | (the)150 5081 y(function)d(or)g(command)h(has)f(complete)i(freedom)e |
17124 | (in)g(generating)h(the)g(matc)m(hes.)275 5230 y(An)m(y)j(function)h(sp) | |
6e51e0d0 CR |
17125 | s(eci\014ed)f(with)g Ft(-F)g Fu(is)h(in)m(v)m(ok)m(ed)h(\014rst.)53 |
17126 | b(The)35 b(function)f(ma)m(y)h(use)g(an)m(y)g(of)g(the)g(shell)150 | |
8a0829e9 | 17127 | 5340 y(facilities,)50 b(including)44 b(the)h Ft(compgen)d |
6e51e0d0 | 17128 | Fu(and)i Ft(compopt)e Fu(builtins)i(describ)s(ed)f(b)s(elo)m(w)h(\(see) |
8a0829e9 | 17129 | i(Section)f(8.7)p eop end |
900a813b CR |
17130 | %%Page: 129 135 |
17131 | TeXDict begin 129 134 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17132 | b(Command)29 b(Line)i(Editing)2062 b(129)150 299 y([Programmable)31 | |
17133 | b(Completion)h(Builtins],)f(page)h(130\),)g(to)g(generate)g(the)f(matc) | |
8a0829e9 CR |
17134 | m(hes.)42 b(It)31 b(m)m(ust)g(put)f(the)150 408 y(p)s(ossible)g |
17135 | (completions)h(in)f(the)h Ft(COMPREPLY)d Fu(arra)m(y)j(v)-5 | |
17136 | b(ariable,)31 b(one)g(p)s(er)e(arra)m(y)i(elemen)m(t.)275 | |
17137 | 542 y(Next,)26 b(an)m(y)f(command)f(sp)s(eci\014ed)g(with)g(the)h | |
17138 | Ft(-C)f Fu(option)h(is)f(in)m(v)m(ok)m(ed)i(in)e(an)g(en)m(vironmen)m | |
17139 | (t)h(equiv)-5 b(alen)m(t)150 652 y(to)26 b(command)e(substitution.)39 | |
6e51e0d0 | 17140 | b(It)25 b(should)f(prin)m(t)h(a)g(list)h(of)f(completions,)i(one)e(p)s |
8a0829e9 | 17141 | (er)f(line,)j(to)f(the)f(standard)150 762 y(output.)40 |
6e51e0d0 | 17142 | b(Bac)m(kslash)32 b(ma)m(y)f(b)s(e)f(used)g(to)h(escap)s(e)g(a)f |
8a0829e9 | 17143 | (newline,)h(if)f(necessary)-8 b(.)275 896 y(After)24 |
6e51e0d0 CR |
17144 | b(all)i(of)f(the)f(p)s(ossible)g(completions)i(are)f(generated,)i(an)m |
17145 | (y)e(\014lter)g(sp)s(eci\014ed)e(with)i(the)g Ft(-X)e | |
8a0829e9 | 17146 | Fu(option)150 1005 y(is)34 b(applied)g(to)g(the)h(list.)52 |
6e51e0d0 | 17147 | b(The)33 b(\014lter)h(is)g(a)h(pattern)f(as)g(used)f(for)h(pathname)g |
8a0829e9 | 17148 | (expansion;)i(a)e(`)p Ft(&)p Fu(')g(in)g(the)150 1115 |
6e51e0d0 CR |
17149 | y(pattern)28 b(is)f(replaced)h(with)g(the)f(text)i(of)f(the)f(w)m(ord)h |
17150 | (b)s(eing)f(completed.)40 b(A)28 b(literal)h(`)p Ft(&)p | |
8a0829e9 | 17151 | Fu(')f(ma)m(y)g(b)s(e)f(escap)s(ed)150 1224 y(with)38 |
6e51e0d0 CR |
17152 | b(a)h(bac)m(kslash;)k(the)38 b(bac)m(kslash)h(is)g(remo)m(v)m(ed)g(b)s |
17153 | (efore)f(attempting)h(a)g(matc)m(h.)65 b(An)m(y)39 b(completion)150 | |
8a0829e9 | 17154 | 1334 y(that)32 b(matc)m(hes)g(the)g(pattern)g(will)f(b)s(e)g(remo)m(v)m |
6e51e0d0 | 17155 | (ed)h(from)f(the)h(list.)44 b(A)32 b(leading)g(`)p Ft(!)p |
8a0829e9 CR |
17156 | Fu(')f(negates)i(the)f(pattern;)150 1443 y(in)d(this)g(case)h(an)m(y)g |
17157 | (completion)h(not)e(matc)m(hing)h(the)g(pattern)f(will)h(b)s(e)e(remo)m | |
17158 | (v)m(ed.)42 b(If)29 b(the)g Ft(nocasematch)150 1553 y | |
17159 | Fu(shell)k(option)f(\(see)i(the)e(description)g(of)h | |
17160 | Ft(shopt)e Fu(in)h(Section)h(4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g | |
17161 | (63\))h(is)150 1663 y(enabled,)d(the)f(matc)m(h)h(is)g(p)s(erformed)e | |
17162 | (without)h(regard)g(to)h(the)g(case)g(of)g(alphab)s(etic)g(c)m | |
17163 | (haracters.)275 1797 y(Finally)-8 b(,)42 b(an)m(y)c(pre\014x)g(and)f | |
6e51e0d0 | 17164 | (su\016x)h(sp)s(eci\014ed)f(with)i(the)f Ft(-P)g Fu(and)g |
8a0829e9 | 17165 | Ft(-S)f Fu(options)i(are)g(added)f(to)h(eac)m(h)150 1906 |
6e51e0d0 CR |
17166 | y(mem)m(b)s(er)31 b(of)g(the)h(completion)h(list,)f(and)f(the)h(result) |
17167 | f(is)h(returned)e(to)i(the)g(Readline)g(completion)h(co)s(de)150 | |
8a0829e9 CR |
17168 | 2016 y(as)e(the)f(list)h(of)g(p)s(ossible)f(completions.)275 |
17169 | 2150 y(If)d(the)h(previously-applied)f(actions)i(do)f(not)g(generate)h | |
17170 | (an)m(y)f(matc)m(hes,)i(and)d(the)h Ft(-o)h(dirnames)d | |
17171 | Fu(op-)150 2259 y(tion)j(w)m(as)f(supplied)f(to)i Ft(complete)d | |
17172 | Fu(when)h(the)h(compsp)s(ec)g(w)m(as)g(de\014ned,)g(directory)g(name)h | |
17173 | (completion)150 2369 y(is)h(attempted.)275 2503 y(If)35 | |
17174 | b(the)g Ft(-o)30 b(plusdirs)j Fu(option)j(w)m(as)g(supplied)e(to)i | |
17175 | Ft(complete)e Fu(when)g(the)i(compsp)s(ec)f(w)m(as)h(de\014ned,)150 | |
17176 | 2612 y(directory)g(name)f(completion)i(is)e(attempted)h(and)f(an)m(y)h | |
6e51e0d0 | 17177 | (matc)m(hes)g(are)g(added)f(to)h(the)f(results)g(of)h(the)150 |
8a0829e9 | 17178 | 2722 y(other)31 b(actions.)275 2856 y(By)g(default,)i(if)e(a)h(compsp)s |
6e51e0d0 | 17179 | (ec)f(is)h(found,)f(whatev)m(er)h(it)g(generates)h(is)e(returned)g(to)h |
8a0829e9 | 17180 | (the)g(completion)150 2966 y(co)s(de)21 b(as)g(the)g(full)g(set)g(of)g |
6e51e0d0 | 17181 | (p)s(ossible)f(completions.)39 b(The)20 b(default)h(Bash)g(completions) |
8a0829e9 | 17182 | h(are)g(not)f(attempted,)150 3075 y(and)30 b(the)g(Readline)h(default)f |
6e51e0d0 | 17183 | (of)g(\014lename)h(completion)g(is)f(disabled.)41 b(If)29 |
8a0829e9 | 17184 | b(the)i Ft(-o)e(bashdefault)e Fu(option)150 3185 y(w)m(as)d(supplied)e |
6e51e0d0 | 17185 | (to)j Ft(complete)c Fu(when)i(the)g(compsp)s(ec)h(w)m(as)g(de\014ned,)g |
8a0829e9 | 17186 | (the)f(default)h(Bash)g(completions)h(are)150 3294 y(attempted)j(if)f |
6e51e0d0 CR |
17187 | (the)h(compsp)s(ec)f(generates)h(no)f(matc)m(hes.)41 |
17188 | b(If)27 b(the)g Ft(-o)j(default)25 b Fu(option)j(w)m(as)f(supplied)f | |
8a0829e9 | 17189 | (to)150 3404 y Ft(complete)f Fu(when)h(the)h(compsp)s(ec)f(w)m(as)i |
ad4aef08 | 17190 | (de\014ned,)e(Readline's)i(default)f(completion)h(will)f(b)s(e)f(p)s |
8a0829e9 | 17191 | (erformed)150 3513 y(if)k(the)h(compsp)s(ec)f(\(and,)g(if)h(attempted,) |
ad4aef08 | 17192 | g(the)g(default)f(Bash)h(completions\))h(generate)g(no)e(matc)m(hes.) |
8a0829e9 | 17193 | 275 3647 y(When)20 b(a)i(compsp)s(ec)e(indicates)i(that)g(directory)g |
ad4aef08 | 17194 | (name)f(completion)h(is)f(desired,)i(the)e(programmable)150 |
8a0829e9 | 17195 | 3757 y(completion)31 b(functions)e(force)i(Readline)f(to)h(app)s(end)d |
74d0116b | 17196 | (a)i(slash)g(to)g(completed)h(names)e(whic)m(h)h(are)g(sym-)150 |
8a0829e9 | 17197 | 3867 y(b)s(olic)40 b(links)g(to)h(directories,)j(sub)5 |
6e51e0d0 | 17198 | b(ject)40 b(to)h(the)f(v)-5 b(alue)41 b(of)f(the)g Fr(mark-directories) |
8a0829e9 | 17199 | 45 b Fu(Readline)c(v)-5 b(ariable,)150 3976 y(regardless)31 |
6e51e0d0 | 17200 | b(of)f(the)h(setting)g(of)g(the)f Fr(mark-symlink)m(ed-directories)36 |
8a0829e9 | 17201 | b Fu(Readline)31 b(v)-5 b(ariable.)275 4110 y(There)25 |
74d0116b CR |
17202 | b(is)i(some)g(supp)s(ort)e(for)h(dynamically)h(mo)s(difying)f |
17203 | (completions.)40 b(This)26 b(is)g(most)h(useful)f(when)150 | |
8a0829e9 | 17204 | 4220 y(used)40 b(in)h(com)m(bination)i(with)e(a)g(default)h(completion) |
6e51e0d0 | 17205 | g(sp)s(eci\014ed)f(with)g Ft(-D)p Fu(.)72 b(It's)42 b(p)s(ossible)f |
8a0829e9 | 17206 | (for)g(shell)150 4329 y(functions)28 b(executed)h(as)f(completion)i |
6e51e0d0 | 17207 | (handlers)d(to)i(indicate)g(that)g(completion)g(should)e(b)s(e)h |
8a0829e9 | 17208 | (retried)g(b)m(y)150 4439 y(returning)j(an)i(exit)g(status)f(of)h(124.) |
6e51e0d0 | 17209 | 48 b(If)31 b(a)i(shell)f(function)g(returns)f(124,)k(and)c(c)m(hanges)j |
8a0829e9 | 17210 | (the)e(compsp)s(ec)150 4548 y(asso)s(ciated)43 b(with)e(the)g(command)g |
6e51e0d0 | 17211 | (on)g(whic)m(h)g(completion)i(is)e(b)s(eing)g(attempted)h(\(supplied)e |
8a0829e9 | 17212 | (as)i(the)150 4658 y(\014rst)29 b(argumen)m(t)h(when)e(the)i(function)f |
6e51e0d0 | 17213 | (is)g(executed\),)j(programmable)d(completion)i(restarts)f(from)f(the) |
8a0829e9 | 17214 | 150 4768 y(b)s(eginning,)e(with)g(an)h(attempt)g(to)g(\014nd)e(a)i(new) |
6e51e0d0 | 17215 | e(compsp)s(ec)i(for)f(that)h(command.)39 b(This)27 b(allo)m(ws)h(a)g |
8a0829e9 | 17216 | (set)g(of)150 4877 y(completions)33 b(to)f(b)s(e)g(built)f(dynamically) |
510e20a2 | 17217 | i(as)f(completion)h(is)f(attempted,)h(rather)f(than)f(b)s(eing)g |
8a0829e9 | 17218 | (loaded)150 4987 y(all)g(at)g(once.)275 5121 y(F)-8 b(or)38 |
510e20a2 CR |
17219 | b(instance,)h(assuming)e(that)h(there)f(is)h(a)f(library)g(of)g(compsp) |
17220 | s(ecs,)i(eac)m(h)g(k)m(ept)e(in)g(a)h(\014le)f(corre-)150 | |
8a0829e9 | 17221 | 5230 y(sp)s(onding)g(to)j(the)f(name)f(of)h(the)g(command,)i(the)e |
510e20a2 | 17222 | (follo)m(wing)h(default)f(completion)h(function)e(w)m(ould)150 |
8a0829e9 | 17223 | 5340 y(load)31 b(completions)g(dynamically:)p eop end |
900a813b CR |
17224 | %%Page: 130 136 |
17225 | TeXDict begin 130 135 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17226 | b(Command)29 b(Line)i(Editing)2062 b(130)390 299 y Ft | |
8a0829e9 CR |
17227 | (_completion_loader\(\))390 408 y({)581 518 y(.)47 b |
17228 | ("/etc/bash_completion.d/$1)o(.sh)o(")42 b(>/dev/null)j(2>&1)i(&&)g | |
17229 | (return)f(124)390 628 y(})390 737 y(complete)g(-D)h(-F)g | |
1101193a | 17230 | (_completion_loader)c(-o)k(bashdefault)e(-o)i(default)150 |
967625cd CR |
17231 | 972 y Fs(8.7)68 b(Programmable)47 b(Completion)f(Builtins)150 |
17232 | 1131 y Fu(Three)21 b(builtin)g(commands)f(are)i(a)m(v)-5 | |
1101193a | 17233 | b(ailable)24 b(to)e(manipulate)f(the)h(programmable)f(completion)h |
967625cd | 17234 | (facilities:)150 1241 y(one)34 b(to)g(sp)s(ecify)f(ho)m(w)h(the)f |
1101193a | 17235 | (argumen)m(ts)h(to)g(a)g(particular)g(command)f(are)h(to)g(b)s(e)f |
967625cd CR |
17236 | (completed,)j(and)d(t)m(w)m(o)150 1351 y(to)e(mo)s(dify)f(the)g |
17237 | (completion)i(as)e(it)h(is)g(happ)s(ening.)150 1504 y | |
17238 | Ft(compgen)870 1636 y(compgen)46 b([)p Fj(option)p Ft(])f([)p | |
17239 | Fj(word)p Ft(])630 1767 y Fu(Generate)27 b(p)s(ossible)e(completion)i | |
6e51e0d0 | 17240 | (matc)m(hes)g(for)e Fr(w)m(ord)k Fu(according)e(to)f(the)g |
967625cd | 17241 | Fr(option)p Fu(s,)h(whic)m(h)630 1877 y(ma)m(y)32 b(b)s(e)f(an)m(y)h |
6e51e0d0 | 17242 | (option)g(accepted)g(b)m(y)g(the)f Ft(complete)f Fu(builtin)h(with)g |
967625cd | 17243 | (the)g(exception)i(of)f Ft(-p)630 1986 y Fu(and)39 b |
6e51e0d0 | 17244 | Ft(-r)p Fu(,)i(and)e(write)h(the)g(matc)m(hes)g(to)g(the)g(standard)f |
967625cd | 17245 | (output.)68 b(When)39 b(using)g(the)h Ft(-F)630 2096 |
8a0829e9 CR |
17246 | y Fu(or)33 b Ft(-C)f Fu(options,)i(the)e(v)-5 b(arious)33 |
17247 | b(shell)g(v)-5 b(ariables)33 b(set)g(b)m(y)g(the)g(programmable)g | |
967625cd | 17248 | (completion)630 2206 y(facilities,)g(while)d(a)m(v)-5 |
8a0829e9 | 17249 | b(ailable,)33 b(will)e(not)g(ha)m(v)m(e)g(useful)f(v)-5 |
967625cd | 17250 | b(alues.)630 2337 y(The)34 b(matc)m(hes)h(will)g(b)s(e)f(generated)h |
8a0829e9 | 17251 | (in)f(the)h(same)g(w)m(a)m(y)g(as)g(if)f(the)h(programmable)f(com-)630 |
967625cd CR |
17252 | 2447 y(pletion)d(co)s(de)g(had)f(generated)i(them)e(directly)i(from)e |
17253 | (a)h(completion)h(sp)s(eci\014cation)f(with)630 2556 | |
8a0829e9 CR |
17254 | y(the)e(same)h(\015ags.)40 b(If)29 b Fr(w)m(ord)j Fu(is)d(sp)s |
17255 | (eci\014ed,)g(only)g(those)h(completions)g(matc)m(hing)g | |
967625cd CR |
17256 | Fr(w)m(ord)j Fu(will)630 2666 y(b)s(e)d(displa)m(y)m(ed.)630 |
17257 | 2797 y(The)24 b(return)g(v)-5 b(alue)25 b(is)g(true)f(unless)g(an)h(in) | |
6e51e0d0 | 17258 | m(v)-5 b(alid)25 b(option)g(is)g(supplied,)f(or)h(no)g(matc)m(hes)g(w)m |
967625cd CR |
17259 | (ere)630 2907 y(generated.)150 3060 y Ft(complete)870 |
17260 | 3192 y(complete)46 b([-abcdefgjksuv])d([-o)k Fj(comp-option)p | |
17261 | Ft(])e([-DE])h([-A)h Fj(action)p Ft(])f([-)870 3302 y(G)h | |
17262 | Fj(globpat)p Ft(])f([-W)h Fj(wordlist)p Ft(])870 3411 | |
6e51e0d0 | 17263 | y([-F)g Fj(function)p Ft(])e([-C)i Fj(command)p Ft(])f([-X)h |
967625cd | 17264 | Fj(filterpat)p Ft(])870 3521 y([-P)g Fj(prefix)p Ft(])f([-S)h |
6e51e0d0 | 17265 | Fj(suffix)p Ft(])e Fj(name)i Ft([)p Fj(name)f Ft(...])870 |
967625cd CR |
17266 | 3630 y(complete)g(-pr)g([-DE])h([)p Fj(name)f Ft(...)o(])630 |
17267 | 3762 y Fu(Sp)s(ecify)37 b(ho)m(w)h(argumen)m(ts)f(to)i(eac)m(h)g | |
6e51e0d0 | 17268 | Fr(name)j Fu(should)37 b(b)s(e)g(completed.)63 b(If)38 |
967625cd | 17269 | b(the)f Ft(-p)g Fu(option)630 3871 y(is)30 b(supplied,)e(or)i(if)g(no)f |
6e51e0d0 | 17270 | (options)h(are)g(supplied,)f(existing)h(completion)h(sp)s |
967625cd | 17271 | (eci\014cations)g(are)630 3981 y(prin)m(ted)24 b(in)h(a)g(w)m(a)m(y)g |
6e51e0d0 | 17272 | (that)h(allo)m(ws)g(them)e(to)i(b)s(e)e(reused)f(as)i(input.)38 |
967625cd | 17273 | b(The)24 b Ft(-r)g Fu(option)i(remo)m(v)m(es)630 4091 |
6e51e0d0 CR |
17274 | y(a)i(completion)h(sp)s(eci\014cation)f(for)g(eac)m(h)h |
17275 | Fr(name)p Fu(,)f(or,)h(if)e(no)h Fr(name)5 b Fu(s)27 | |
967625cd | 17276 | b(are)h(supplied,)g(all)g(com-)630 4200 y(pletion)k(sp)s |
6e51e0d0 | 17277 | (eci\014cations.)44 b(The)30 b Ft(-D)h Fu(option)h(indicates)g(that)f |
967625cd | 17278 | (the)h(remaining)f(options)h(and)630 4310 y(actions)27 |
6e51e0d0 | 17279 | b(should)e(apply)g(to)i(the)f(\\default")h(command)e(completion;)k |
967625cd | 17280 | (that)e(is,)g(completion)630 4419 y(attempted)g(on)f(a)h(command)f(for) |
6e51e0d0 | 17281 | g(whic)m(h)g(no)g(completion)i(has)d(previously)h(b)s(een)g(de\014ned.) |
967625cd | 17282 | 630 4529 y(The)f Ft(-E)g Fu(option)h(indicates)h(that)f(the)g |
6e51e0d0 | 17283 | (remaining)g(options)g(and)f(actions)i(should)e(apply)g(to)630 |
967625cd | 17284 | 4639 y(\\empt)m(y")32 b(command)e(completion;)i(that)f(is,)f |
6e51e0d0 | 17285 | (completion)i(attempted)f(on)g(a)f(blank)g(line.)630 |
967625cd CR |
17286 | 4770 y(The)f(pro)s(cess)g(of)h(applying)g(these)g(completion)g(sp)s |
17287 | (eci\014cations)h(when)d(w)m(ord)i(completion)630 4880 | |
510e20a2 | 17288 | y(is)35 b(attempted)h(is)f(describ)s(ed)f(ab)s(o)m(v)m(e)j(\(see)f |
8a0829e9 | 17289 | (Section)g(8.6)g([Programmable)g(Completion],)630 4989 |
900a813b | 17290 | y(page)31 b(128\).)42 b(The)30 b Ft(-D)g Fu(option)h(tak)m(es)h |
8a0829e9 | 17291 | (precedence)f(o)m(v)m(er)g Ft(-E)p Fu(.)630 5121 y(Other)d(options,)i |
6e51e0d0 | 17292 | (if)f(sp)s(eci\014ed,)g(ha)m(v)m(e)h(the)f(follo)m(wing)i(meanings.)40 |
8a0829e9 | 17293 | b(The)29 b(argumen)m(ts)g(to)h(the)630 5230 y Ft(-G)p |
6e51e0d0 CR |
17294 | Fu(,)41 b Ft(-W)p Fu(,)h(and)c Ft(-X)h Fu(options)h(\(and,)h(if)f |
17295 | (necessary)-8 b(,)42 b(the)e Ft(-P)f Fu(and)f Ft(-S)h | |
8a0829e9 | 17296 | Fu(options\))h(should)f(b)s(e)630 5340 y(quoted)28 b(to)h(protect)g |
6e51e0d0 | 17297 | (them)f(from)f(expansion)h(b)s(efore)g(the)g Ft(complete)e |
8a0829e9 | 17298 | Fu(builtin)h(is)h(in)m(v)m(ok)m(ed.)p eop end |
900a813b CR |
17299 | %%Page: 131 137 |
17300 | TeXDict begin 131 136 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17301 | b(Command)29 b(Line)i(Editing)2062 b(131)630 299 y Ft(-o)30 | |
8a0829e9 | 17302 | b Fj(comp-option)1110 408 y Fu(The)c Fr(comp-option)i |
6e51e0d0 | 17303 | Fu(con)m(trols)g(sev)m(eral)h(asp)s(ects)e(of)g(the)g(compsp)s(ec's)g |
8a0829e9 | 17304 | (b)s(eha)m(v-)1110 518 y(ior)g(b)s(ey)m(ond)f(the)g(simple)h |
6e51e0d0 | 17305 | (generation)h(of)e(completions.)41 b Fr(comp-option)27 |
8a0829e9 CR |
17306 | b Fu(ma)m(y)1110 628 y(b)s(e)j(one)g(of:)1110 782 y Ft(bashdefault)1590 |
17307 | 892 y Fu(P)m(erform)d(the)h(rest)f(of)h(the)g(default)f(Bash)h | |
17308 | (completions)g(if)g(the)1590 1002 y(compsp)s(ec)i(generates)i(no)e | |
17309 | (matc)m(hes.)1110 1156 y Ft(default)144 b Fu(Use)22 b(Readline's)g | |
17310 | (default)g(\014lename)g(completion)g(if)g(the)g(comp-)1590 | |
17311 | 1266 y(sp)s(ec)30 b(generates)i(no)e(matc)m(hes.)1110 | |
17312 | 1421 y Ft(dirnames)96 b Fu(P)m(erform)46 b(directory)g(name)h | |
17313 | (completion)g(if)f(the)g(compsp)s(ec)1590 1530 y(generates)32 | |
17314 | b(no)e(matc)m(hes.)1110 1685 y Ft(filenames)1590 1794 | |
6e51e0d0 | 17315 | y Fu(T)-8 b(ell)40 b(Readline)f(that)h(the)f(compsp)s(ec)f(generates)j |
8a0829e9 CR |
17316 | (\014lenames,)1590 1904 y(so)29 b(it)h(can)f(p)s(erform)f(an)m(y)h |
17317 | (\014lename-sp)s(eci\014c)h(pro)s(cessing)e(\(lik)m(e)1590 | |
17318 | 2014 y(adding)d(a)h(slash)f(to)h(directory)g(names)f(quoting)h(sp)s | |
17319 | (ecial)g(c)m(har-)1590 2123 y(acters,)39 b(or)d(suppressing)f(trailing) | |
17320 | i(spaces\).)59 b(This)35 b(option)i(is)1590 2233 y(in)m(tended)30 | |
17321 | b(to)g(b)s(e)g(used)f(with)g(shell)i(functions)e(sp)s(eci\014ed)g(with) | |
17322 | 1590 2342 y Ft(-F)p Fu(.)1110 2497 y Ft(noquote)144 b | |
17323 | Fu(T)-8 b(ell)28 b(Readline)g(not)g(to)g(quote)g(the)g(completed)g(w)m | |
17324 | (ords)f(if)h(they)1590 2607 y(are)j(\014lenames)f(\(quoting)h | |
17325 | (\014lenames)g(is)f(the)h(default\).)1110 2761 y Ft(nosort)192 | |
17326 | b Fu(T)-8 b(ell)23 b(Readline)g(not)f(to)h(sort)g(the)f(list)h(of)f(p)s | |
17327 | (ossible)g(completions)1590 2871 y(alphab)s(etically)-8 | |
17328 | b(.)1110 3026 y Ft(nospace)144 b Fu(T)-8 b(ell)40 b(Readline)g(not)g | |
17329 | (to)g(app)s(end)d(a)j(space)g(\(the)f(default\))h(to)1590 | |
17330 | 3135 y(w)m(ords)30 b(completed)h(at)g(the)g(end)f(of)g(the)h(line.)1110 | |
17331 | 3290 y Ft(plusdirs)96 b Fu(After)30 b(an)m(y)h(matc)m(hes)g(de\014ned)d | |
17332 | (b)m(y)i(the)g(compsp)s(ec)g(are)g(gener-)1590 3400 y(ated,)g | |
17333 | (directory)f(name)g(completion)i(is)d(attempted)i(and)f(an)m(y)1590 | |
17334 | 3509 y(matc)m(hes)j(are)e(added)g(to)h(the)g(results)f(of)g(the)h | |
17335 | (other)g(actions.)630 3664 y Ft(-A)f Fj(action)66 b Fu(The)25 | |
17336 | b Fr(action)h Fu(ma)m(y)g(b)s(e)e(one)h(of)h(the)f(follo)m(wing)i(to)e | |
17337 | (generate)i(a)e(list)h(of)f(p)s(ossible)1110 3773 y(completions:)1110 | |
17338 | 3928 y Ft(alias)240 b Fu(Alias)31 b(names.)41 b(Ma)m(y)31 | |
17339 | b(also)h(b)s(e)e(sp)s(eci\014ed)f(as)i Ft(-a)p Fu(.)1110 | |
17340 | 4083 y Ft(arrayvar)96 b Fu(Arra)m(y)31 b(v)-5 b(ariable)31 | |
17341 | b(names.)1110 4238 y Ft(binding)144 b Fu(Readline)30 | |
17342 | b(k)m(ey)f(binding)f(names)h(\(see)h(Section)f(8.4)h([Bindable)1590 | |
900a813b | 17343 | 4347 y(Readline)h(Commands],)f(page)h(118\).)1110 4502 |
8a0829e9 CR |
17344 | y Ft(builtin)144 b Fu(Names)21 b(of)g(shell)f(builtin)h(commands.)37 |
17345 | b(Ma)m(y)21 b(also)h(b)s(e)e(sp)s(eci\014ed)1590 4612 | |
17346 | y(as)31 b Ft(-b)p Fu(.)1110 4766 y Ft(command)144 b Fu(Command)29 | |
6e51e0d0 | 17347 | b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i |
8a0829e9 | 17348 | Ft(-c)p Fu(.)1110 4921 y Ft(directory)1590 5031 y Fu(Directory)h |
6e51e0d0 | 17349 | (names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)g |
8a0829e9 CR |
17350 | Ft(-d)p Fu(.)1110 5185 y Ft(disabled)96 b Fu(Names)31 |
17351 | b(of)g(disabled)f(shell)g(builtins.)1110 5340 y Ft(enabled)144 | |
17352 | b Fu(Names)31 b(of)g(enabled)f(shell)g(builtins.)p eop | |
17353 | end | |
900a813b CR |
17354 | %%Page: 132 138 |
17355 | TeXDict begin 132 137 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17356 | b(Command)29 b(Line)i(Editing)2062 b(132)1110 299 y Ft(export)192 | |
8a0829e9 CR |
17357 | b Fu(Names)34 b(of)f(exp)s(orted)f(shell)h(v)-5 b(ariables.)49 |
17358 | b(Ma)m(y)35 b(also)e(b)s(e)g(sp)s(eci-)1590 408 y(\014ed)d(as)g | |
17359 | Ft(-e)p Fu(.)1110 567 y Ft(file)288 b Fu(File)32 b(names.)40 | |
17360 | b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i Ft(-f)p | |
17361 | Fu(.)1110 725 y Ft(function)96 b Fu(Names)31 b(of)g(shell)f(functions.) | |
17362 | 1110 883 y Ft(group)240 b Fu(Group)30 b(names.)40 b(Ma)m(y)32 | |
17363 | b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)g Ft(-g)p Fu(.)1110 | |
17364 | 1042 y Ft(helptopic)1590 1151 y Fu(Help)37 b(topics)g(as)g(accepted)h | |
17365 | (b)m(y)e(the)h Ft(help)f Fu(builtin)g(\(see)h(Sec-)1590 | |
17366 | 1261 y(tion)31 b(4.2)g([Bash)g(Builtins],)g(page)g(48\).)1110 | |
17367 | 1419 y Ft(hostname)96 b Fu(Hostnames,)89 b(as)76 b(tak)m(en)h(from)f | |
17368 | (the)g(\014le)h(sp)s(eci\014ed)e(b)m(y)1590 1529 y(the)55 | |
17369 | b Ft(HOSTFILE)e Fu(shell)j(v)-5 b(ariable)56 b(\(see)g(Section)g(5.2)h | |
900a813b | 17370 | ([Bash)1590 1638 y(V)-8 b(ariables],)32 b(page)f(70\).)1110 |
8a0829e9 | 17371 | 1797 y Ft(job)336 b Fu(Job)31 b(names,)h(if)g(job)f(con)m(trol)i(is)f |
6e51e0d0 | 17372 | (activ)m(e.)46 b(Ma)m(y)33 b(also)g(b)s(e)e(sp)s(eci-)1590 |
8a0829e9 | 17373 | 1906 y(\014ed)f(as)g Ft(-j)p Fu(.)1110 2064 y Ft(keyword)144 |
6e51e0d0 | 17374 | b Fu(Shell)30 b(reserv)m(ed)h(w)m(ords.)40 b(Ma)m(y)32 |
8a0829e9 CR |
17375 | b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i Ft(-k)p Fu(.)1110 |
17376 | 2223 y Ft(running)144 b Fu(Names)31 b(of)g(running)d(jobs,)i(if)h(job)f | |
17377 | (con)m(trol)h(is)g(activ)m(e.)1110 2381 y Ft(service)144 | |
17378 | b Fu(Service)31 b(names.)41 b(Ma)m(y)31 b(also)g(b)s(e)f(sp)s | |
17379 | (eci\014ed)g(as)g Ft(-s)p Fu(.)1110 2539 y Ft(setopt)192 | |
17380 | b Fu(V)-8 b(alid)39 b(argumen)m(ts)g(for)f(the)h Ft(-o)e | |
17381 | Fu(option)i(to)g(the)g Ft(set)e Fu(builtin)1590 2649 | |
17382 | y(\(see)31 b(Section)h(4.3.1)g([The)e(Set)g(Builtin],)i(page)f(59\).) | |
17383 | 1110 2807 y Ft(shopt)240 b Fu(Shell)40 b(option)g(names)g(as)g | |
17384 | (accepted)i(b)m(y)e(the)g Ft(shopt)e Fu(builtin)1590 | |
17385 | 2917 y(\(see)31 b(Section)h(4.2)f([Bash)g(Builtins],)g(page)g(48\).) | |
17386 | 1110 3075 y Ft(signal)192 b Fu(Signal)31 b(names.)1110 | |
17387 | 3233 y Ft(stopped)144 b Fu(Names)31 b(of)g(stopp)s(ed)e(jobs,)h(if)g | |
17388 | (job)g(con)m(trol)i(is)f(activ)m(e.)1110 3392 y Ft(user)288 | |
17389 | b Fu(User)30 b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f | |
17390 | (as)i Ft(-u)p Fu(.)1110 3550 y Ft(variable)96 b Fu(Names)36 | |
17391 | b(of)g(all)g(shell)g(v)-5 b(ariables.)56 b(Ma)m(y)37 | |
17392 | b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)1590 3660 y Ft(-v)p | |
17393 | Fu(.)630 3818 y Ft(-C)30 b Fj(command)1110 3927 y Fr(command)35 | |
17394 | b Fu(is)e(executed)g(in)e(a)i(subshell)e(en)m(vironmen)m(t,)i(and)f | |
17395 | (its)g(output)g(is)1110 4037 y(used)e(as)g(the)h(p)s(ossible)f | |
17396 | (completions.)630 4195 y Ft(-F)g Fj(function)1110 4305 | |
17397 | y Fu(The)39 b(shell)g(function)g Fr(function)g Fu(is)g(executed)h(in)f | |
17398 | (the)g(curren)m(t)g(shell)g(en)m(vi-)1110 4415 y(ronmen)m(t.)72 | |
45c0f7f8 | 17399 | b(When)41 b(it)g(is)g(executed,)k($1)c(is)g(the)g(name)g(of)g(the)g |
8a0829e9 | 17400 | (command)1110 4524 y(whose)34 b(argumen)m(ts)h(are)g(b)s(eing)f |
45c0f7f8 | 17401 | (completed,)j($2)e(is)f(the)h(w)m(ord)f(b)s(eing)g(com-)1110 |
8a0829e9 CR |
17402 | 4634 y(pleted,)44 b(and)c($3)i(is)e(the)h(w)m(ord)g(preceding)f(the)h |
17403 | (w)m(ord)f(b)s(eing)h(completed,)1110 4743 y(as)g(describ)s(ed)f(ab)s | |
45c0f7f8 | 17404 | (o)m(v)m(e)i(\(see)g(Section)f(8.6)h([Programmable)g(Completion],)1110 |
900a813b | 17405 | 4853 y(page)30 b(128\).)42 b(When)29 b(it)h(\014nishes,)e(the)h(p)s |
8a0829e9 | 17406 | (ossible)g(completions)h(are)g(retriev)m(ed)1110 4963 |
6e51e0d0 | 17407 | y(from)g(the)g(v)-5 b(alue)31 b(of)g(the)f Ft(COMPREPLY)e |
8a0829e9 CR |
17408 | Fu(arra)m(y)j(v)-5 b(ariable.)630 5121 y Ft(-G)30 b Fj(globpat)1110 |
17409 | 5230 y Fu(The)39 b(\014lename)h(expansion)g(pattern)g | |
17410 | Fr(globpat)j Fu(is)d(expanded)f(to)h(generate)1110 5340 | |
17411 | y(the)31 b(p)s(ossible)e(completions.)p eop end | |
900a813b CR |
17412 | %%Page: 133 139 |
17413 | TeXDict begin 133 138 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17414 | b(Command)29 b(Line)i(Editing)2062 b(133)630 299 y Ft(-P)30 | |
8a0829e9 | 17415 | b Fj(prefix)66 b Fr(pre\014x)39 b Fu(is)34 b(added)f(at)i(the)f(b)s |
6e51e0d0 | 17416 | (eginning)f(of)i(eac)m(h)g(p)s(ossible)e(completion)i(after)1110 |
8a0829e9 | 17417 | 408 y(all)c(other)g(options)g(ha)m(v)m(e)g(b)s(een)f(applied.)630 |
967625cd | 17418 | 567 y Ft(-S)g Fj(suffix)66 b Fr(su\016x)26 b Fu(is)20 |
a8fd3f3e | 17419 | b(app)s(ended)f(to)i(eac)m(h)h(p)s(ossible)e(completion)i(after)f(all)g |
967625cd CR |
17420 | (other)g(options)1110 677 y(ha)m(v)m(e)32 b(b)s(een)d(applied.)630 |
17421 | 835 y Ft(-W)h Fj(wordlist)1110 945 y Fu(The)24 b Fr(w)m(ordlist)k | |
6e51e0d0 | 17422 | Fu(is)d(split)g(using)f(the)h(c)m(haracters)i(in)d(the)i |
967625cd | 17423 | Ft(IFS)e Fu(sp)s(ecial)h(v)-5 b(ariable)1110 1054 y(as)36 |
5cdaaf76 | 17424 | b(delimiters,)i(and)e(eac)m(h)h(resultan)m(t)g(w)m(ord)e(is)h |
967625cd | 17425 | (expanded.)57 b(The)35 b(p)s(ossible)1110 1164 y(completions)c(are)e |
5cdaaf76 | 17426 | (the)h(mem)m(b)s(ers)f(of)g(the)h(resultan)m(t)g(list)g(whic)m(h)f |
967625cd CR |
17427 | (matc)m(h)i(the)1110 1274 y(w)m(ord)f(b)s(eing)g(completed.)630 |
17428 | 1432 y Ft(-X)g Fj(filterpat)1110 1542 y Fr(\014lterpat)d | |
6e51e0d0 | 17429 | Fu(is)e(a)g(pattern)g(as)f(used)g(for)h(\014lename)g(expansion.)38 |
967625cd | 17430 | b(It)25 b(is)g(applied)f(to)1110 1651 y(the)30 b(list)f(of)h(p)s |
6e51e0d0 | 17431 | (ossible)f(completions)h(generated)h(b)m(y)e(the)g(preceding)h(options) |
967625cd CR |
17432 | 1110 1761 y(and)d(argumen)m(ts,)i(and)e(eac)m(h)i(completion)g(matc)m |
17433 | (hing)g Fr(\014lterpat)h Fu(is)e(remo)m(v)m(ed)1110 1871 | |
6e51e0d0 CR |
17434 | y(from)i(the)h(list.)42 b(A)30 b(leading)i(`)p Ft(!)p |
17435 | Fu(')e(in)g Fr(\014lterpat)j Fu(negates)f(the)f(pattern;)g(in)f(this) | |
967625cd CR |
17436 | 1110 1980 y(case,)i(an)m(y)e(completion)i(not)f(matc)m(hing)g |
17437 | Fr(\014lterpat)i Fu(is)d(remo)m(v)m(ed.)630 2139 y(The)35 | |
6e51e0d0 CR |
17438 | b(return)g(v)-5 b(alue)37 b(is)f(true)f(unless)h(an)f(in)m(v)-5 |
17439 | b(alid)37 b(option)f(is)g(supplied,)g(an)g(option)h(other)630 | |
967625cd | 17440 | 2248 y(than)h Ft(-p)g Fu(or)g Ft(-r)f Fu(is)h(supplied)f(without)i(a)f |
6e51e0d0 | 17441 | Fr(name)44 b Fu(argumen)m(t,)c(an)e(attempt)i(is)e(made)g(to)630 |
967625cd | 17442 | 2358 y(remo)m(v)m(e)32 b(a)e(completion)i(sp)s(eci\014cation)f(for)f(a) |
8a0829e9 | 17443 | h Fr(name)k Fu(for)30 b(whic)m(h)g(no)g(sp)s(eci\014cation)h(exists,) |
967625cd CR |
17444 | 630 2468 y(or)f(an)h(error)f(o)s(ccurs)g(adding)g(a)g(completion)i(sp)s |
17445 | (eci\014cation.)150 2626 y Ft(compopt)870 2760 y(compopt)46 | |
6e51e0d0 | 17446 | b([-o)h Fj(option)p Ft(])f([-DE])g([+o)h Fj(option)p |
967625cd | 17447 | Ft(])f([)p Fj(name)p Ft(])630 2894 y Fu(Mo)s(dify)33 |
6e51e0d0 CR |
17448 | b(completion)h(options)g(for)f(eac)m(h)h Fr(name)39 b |
17449 | Fu(according)34 b(to)g(the)f Fr(option)p Fu(s,)i(or)e(for)g(the)630 | |
967625cd | 17450 | 3004 y(curren)m(tly-executing)46 b(completion)f(if)f(no)f |
6e51e0d0 | 17451 | Fr(name)5 b Fu(s)44 b(are)h(supplied.)80 b(If)43 b(no)h |
967625cd | 17452 | Fr(option)p Fu(s)h(are)630 3114 y(giv)m(en,)30 b(displa)m(y)e(the)g |
6e51e0d0 | 17453 | (completion)h(options)g(for)e(eac)m(h)i Fr(name)34 b |
967625cd | 17454 | Fu(or)27 b(the)i(curren)m(t)e(completion.)630 3223 y(The)f(p)s(ossible) |
6e51e0d0 CR |
17455 | g(v)-5 b(alues)27 b(of)f Fr(option)h Fu(are)g(those)g(v)-5 |
17456 | b(alid)26 b(for)g(the)h Ft(complete)d Fu(builtin)i(describ)s(ed)630 | |
967625cd | 17457 | 3333 y(ab)s(o)m(v)m(e.)41 b(The)28 b Ft(-D)g Fu(option)h(indicates)h |
6e51e0d0 | 17458 | (that)f(the)g(remaining)g(options)g(should)e(apply)h(to)i(the)630 |
967625cd CR |
17459 | 3442 y(\\default")j(command)f(completion;)i(that)f(is,)g(completion)g |
17460 | (attempted)g(on)f(a)g(command)630 3552 y(for)g(whic)m(h)g(no)g | |
6e51e0d0 | 17461 | (completion)i(has)e(previously)g(b)s(een)g(de\014ned.)45 |
967625cd | 17462 | b(The)32 b Ft(-E)f Fu(option)i(indicates)630 3662 y(that)24 |
6e51e0d0 | 17463 | b(the)g(remaining)g(options)g(should)e(apply)h(to)i(\\empt)m(y")g |
967625cd CR |
17464 | (command)e(completion;)k(that)630 3771 y(is,)k(completion)g(attempted)h |
17465 | (on)e(a)h(blank)f(line.)630 3905 y(The)g Ft(-D)g Fu(option)g(tak)m(es)i | |
17466 | (precedence)f(o)m(v)m(er)h Ft(-E)p Fu(.)630 4039 y(The)23 | |
6e51e0d0 CR |
17467 | b(return)g(v)-5 b(alue)25 b(is)f(true)g(unless)f(an)h(in)m(v)-5 |
17468 | b(alid)24 b(option)h(is)f(supplied,)g(an)g(attempt)h(is)f(made)630 | |
967625cd | 17469 | 4149 y(to)32 b(mo)s(dify)f(the)g(options)h(for)f(a)h |
6e51e0d0 | 17470 | Fr(name)k Fu(for)31 b(whic)m(h)g(no)g(completion)i(sp)s(eci\014cation)f |
967625cd CR |
17471 | (exists,)630 4259 y(or)e(an)h(output)f(error)g(o)s(ccurs.)150 |
17472 | 4499 y Fs(8.8)68 b(A)44 b(Programmable)j(Completion)f(Example)150 | |
17473 | 4658 y Fu(The)37 b(most)g(common)g(w)m(a)m(y)i(to)e(obtain)h | |
45c0f7f8 | 17474 | (additional)g(completion)g(functionalit)m(y)h(b)s(ey)m(ond)d(the)i |
967625cd | 17475 | (default)150 4768 y(actions)29 b Ft(complete)d Fu(and)i |
6e51e0d0 | 17476 | Ft(compgen)e Fu(pro)m(vide)i(is)h(to)f(use)g(a)h(shell)f(function)g |
8a0829e9 CR |
17477 | (and)g(bind)e(it)j(to)g(a)g(particular)150 4877 y(command)h(using)g |
17478 | Ft(complete)e(-F)p Fu(.)275 5011 y(The)j(follo)m(wing)j(function)e(pro) | |
6e51e0d0 | 17479 | m(vides)g(completions)i(for)e(the)g Ft(cd)g Fu(builtin.)46 |
8a0829e9 | 17480 | b(It)32 b(is)h(a)f(reasonably)h(go)s(o)s(d)150 5121 y(example)e(of)f |
45c0f7f8 CR |
17481 | (what)g(shell)g(functions)g(m)m(ust)f(do)h(when)f(used)h(for)f |
17482 | (completion.)42 b(This)29 b(function)h(uses)g(the)150 | |
8a0829e9 | 17483 | 5230 y(w)m(ord)38 b(passsed)g(as)h Ft($2)g Fu(to)g(determine)g(the)g |
45c0f7f8 | 17484 | (directory)g(name)g(to)g(complete.)67 b(Y)-8 b(ou)40 |
8a0829e9 | 17485 | b(can)f(also)g(use)g(the)150 5340 y Ft(COMP_WORDS)28 |
6e51e0d0 | 17486 | b Fu(arra)m(y)i(v)-5 b(ariable;)32 b(the)e(curren)m(t)h(w)m(ord)f(is)g |
8a0829e9 CR |
17487 | (indexed)g(b)m(y)g(the)h Ft(COMP_CWORD)c Fu(v)-5 b(ariable.)p |
17488 | eop end | |
900a813b CR |
17489 | %%Page: 134 140 |
17490 | TeXDict begin 134 139 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17491 | b(Command)29 b(Line)i(Editing)2062 b(134)275 299 y(The)42 | |
8a0829e9 CR |
17492 | b(function)h(relies)h(on)e(the)i Ft(complete)c Fu(and)j |
17493 | Ft(compgen)e Fu(builtins)h(to)i(do)f(m)m(uc)m(h)g(of)g(the)h(w)m(ork,) | |
17494 | 150 408 y(adding)25 b(only)h(the)g(things)g(that)g(the)g(Bash)g | |
17495 | Ft(cd)f Fu(do)s(es)g(b)s(ey)m(ond)g(accepting)j(basic)e(directory)g | |
17496 | (names:)38 b(tilde)150 518 y(expansion)22 b(\(see)h(Section)g(3.5.2)g | |
17497 | ([Tilde)g(Expansion],)g(page)g(22\),)i(searc)m(hing)e(directories)g(in) | |
17498 | e Fr($CDP)-8 b(A)g(TH)p Fu(,)150 628 y(whic)m(h)21 b(is)h(describ)s(ed) | |
17499 | e(ab)s(o)m(v)m(e)j(\(see)f(Section)h(4.1)f([Bourne)g(Shell)f | |
17500 | (Builtins],)j(page)e(41\),)j(and)c(basic)h(supp)s(ort)150 | |
17501 | 737 y(for)31 b(the)h Ft(cdable_vars)d Fu(shell)i(option)h(\(see)h | |
17502 | (Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)i(page)f(63\).)46 | |
17503 | b Ft(_comp_)150 847 y(cd)30 b Fu(mo)s(di\014es)g(the)h(v)-5 | |
17504 | b(alue)31 b(of)g Fr(IFS)36 b Fu(so)31 b(that)g(it)g(con)m(tains)h(only) | |
17505 | f(a)g(newline)g(to)h(accommo)s(date)g(\014le)f(names)150 | |
17506 | 956 y(con)m(taining)i(spaces)g(and)e(tabs)h({)g Ft(compgen)e | |
6e51e0d0 | 17507 | Fu(prin)m(ts)h(the)h(p)s(ossible)f(completions)i(it)g(generates)g(one)f |
8a0829e9 | 17508 | (p)s(er)150 1066 y(line.)275 1230 y(P)m(ossible)24 b(completions)h(go)g |
6e51e0d0 CR |
17509 | (in)m(to)g(the)f Fr(COMPREPL)-8 b(Y)36 b Fu(arra)m(y)24 |
17510 | b(v)-5 b(ariable,)26 b(one)e(completion)i(p)s(er)c(arra)m(y)150 | |
8a0829e9 | 17511 | 1340 y(elemen)m(t.)42 b(The)30 b(programmable)g(completion)i(system)e |
6e51e0d0 | 17512 | (retriev)m(es)h(the)g(completions)g(from)f(there)g(when)150 |
8a0829e9 CR |
17513 | 1450 y(the)h(function)f(returns.)390 1614 y Ft(#)47 b(A)h(completion)d |
17514 | (function)g(for)i(the)g(cd)g(builtin)390 1724 y(#)g(based)g(on)g(the)g | |
6e51e0d0 | 17515 | (cd)g(completion)e(function)h(from)g(the)h(bash_completion)d(package) |
8a0829e9 CR |
17516 | 390 1833 y(_comp_cd\(\))390 1943 y({)581 2052 y(local)i(IFS=$')g |
17517 | (\\t\\n')190 b(#)47 b(normalize)f(IFS)581 2162 y(local)g(cur)h | |
17518 | (_skipdot)f(_cdpath)581 2271 y(local)g(i)i(j)f(k)581 | |
17519 | 2491 y(#)g(Tilde)g(expansion,)e(with)h(side)h(effect)f(of)h(expanding)f | |
17520 | (tilde)g(to)h(full)g(pathname)581 2600 y(case)g("$2")f(in)581 | |
17521 | 2710 y(\\~*\))190 b(eval)46 b(cur="$2")g(;;)581 2819 | |
17522 | y(*\))286 b(cur=$2)46 b(;;)581 2929 y(esac)581 3148 y(#)h(no)h(cdpath)e | |
17523 | (or)h(absolute)e(pathname)h(--)h(straight)f(directory)f(completion)581 | |
17524 | 3258 y(if)i([[)g(-z)g("${CDPATH:-}")e(]])i(||)g([[)g("$cur")f(==)h | |
17525 | (@\(./*|../*|/*\))d(]];)j(then)772 3367 y(#)g(compgen)f(prints)g(paths) | |
6e51e0d0 | 17526 | h(one)f(per)h(line;)g(could)f(also)h(use)g(while)f(loop)772 |
8a0829e9 CR |
17527 | 3477 y(IFS=$'\\n')772 3587 y(COMPREPLY=\()f($\(compgen)g(-d)i(--)g |
17528 | ("$cur"\))f(\))772 3696 y(IFS=$')g(\\t\\n')581 3806 y(#)h | |
6e51e0d0 | 17529 | (CDPATH+directories)c(in)k(the)g(current)f(directory)f(if)j(not)e(in)i |
8a0829e9 CR |
17530 | (CDPATH)581 3915 y(else)772 4025 y(IFS=$'\\n')772 4134 |
17531 | y(_skipdot=false)772 4244 y(#)f(preprocess)e(CDPATH)h(to)i(convert)d | |
17532 | (null)i(directory)e(names)i(to)g(.)772 4354 y(_cdpath=${CDPATH/#:/.:}) | |
17533 | 772 4463 y(_cdpath=${_cdpath//::/:.)o(:})772 4573 y | |
17534 | (_cdpath=${_cdpath/\045:/:.})772 4682 y(for)g(i)g(in)g | |
17535 | (${_cdpath//:/$'\\n'};)c(do)963 4792 y(if)k([[)g($i)g(-ef)g(.)h(]];)f | |
17536 | (then)f(_skipdot=true;)e(fi)963 4902 y(k="${#COMPREPLY[@]}")963 | |
17537 | 5011 y(for)j(j)g(in)g($\()g(compgen)f(-d)h(--)h("$i/$cur")d(\);)i(do) | |
17538 | 1154 5121 y(COMPREPLY[k++]=${j#$i/})375 b(#)48 b(cut)f(off)f(directory) | |
17539 | 963 5230 y(done)772 5340 y(done)p eop end | |
900a813b CR |
17540 | %%Page: 135 141 |
17541 | TeXDict begin 135 140 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17542 | b(Command)29 b(Line)i(Editing)2062 b(135)772 299 y Ft($_skipdot)45 | |
8a0829e9 CR |
17543 | b(||)i(COMPREPLY+=\()e($\(compgen)g(-d)i(--)g("$cur"\))f(\))772 |
17544 | 408 y(IFS=$')g(\\t\\n')581 518 y(fi)581 737 y(#)h(variable)f(names)g | |
45c0f7f8 | 17545 | (if)h(appropriate)e(shell)i(option)f(set)h(and)f(no)i(completions)581 |
8a0829e9 CR |
17546 | 847 y(if)f(shopt)f(-q)i(cdable_vars)c(&&)k([[)f(${#COMPREPLY[@]})c(-eq) |
17547 | k(0)g(]];)g(then)772 956 y(COMPREPLY=\()e($\(compgen)g(-v)i(--)g | |
17548 | ("$cur"\))f(\))581 1066 y(fi)581 1285 y(return)g(0)390 | |
17549 | 1395 y(})275 1529 y Fu(W)-8 b(e)31 b(install)g(the)g(completion)h | |
6e51e0d0 | 17550 | (function)e(using)f(the)i Ft(-F)f Fu(option)h(to)g Ft(complete)p |
8a0829e9 CR |
17551 | Fu(:)390 1664 y Ft(#)47 b(Tell)g(readline)f(to)h(quote)f(appropriate)f |
17552 | (and)i(append)f(slashes)g(to)h(directories;)390 1773 | |
6e51e0d0 | 17553 | y(#)g(use)g(the)g(bash)g(default)f(completion)f(for)i(other)f |
8a0829e9 CR |
17554 | (arguments)390 1883 y(complete)g(-o)h(filenames)e(-o)i(nospace)f(-o)h |
17555 | (bashdefault)e(-F)i(_comp_cd)f(cd)150 2017 y Fu(Since)33 | |
45c0f7f8 CR |
17556 | b(w)m(e'd)g(lik)m(e)i(Bash)e(and)f(Readline)i(to)g(tak)m(e)g(care)g(of) |
17557 | f(some)h(of)f(the)g(other)h(details)g(for)e(us,)i(w)m(e)f(use)150 | |
8a0829e9 | 17558 | 2127 y(sev)m(eral)43 b(other)g(options)f(to)h(tell)g(Bash)f(and)f |
6e51e0d0 | 17559 | (Readline)i(what)f(to)g(do.)76 b(The)41 b Ft(-o)30 b(filenames)39 |
8a0829e9 | 17560 | b Fu(option)150 2237 y(tells)j(Readline)g(that)g(the)f(p)s(ossible)g |
6e51e0d0 | 17561 | (completions)h(should)f(b)s(e)f(treated)i(as)g(\014lenames,)i(and)d |
8a0829e9 CR |
17562 | (quoted)150 2346 y(appropriately)-8 b(.)53 b(That)34 |
17563 | b(option)h(will)g(also)g(cause)g(Readline)g(to)g(app)s(end)e(a)h(slash) | |
17564 | g(to)h(\014lenames)g(it)g(can)150 2456 y(determine)i(are)g(directories) | |
17565 | h(\(whic)m(h)g(is)f(wh)m(y)f(w)m(e)i(migh)m(t)f(w)m(an)m(t)h(to)g | |
17566 | (extend)f Ft(_comp_cd)e Fu(to)i(app)s(end)f(a)150 2565 | |
6e51e0d0 CR |
17567 | y(slash)22 b(if)g(w)m(e're)h(using)f(directories)h(found)e(via)i |
17568 | Fr(CDP)-8 b(A)g(TH)10 b Fu(:)37 b(Readline)23 b(can't)g(tell)g(those)g | |
8a0829e9 | 17569 | (completions)h(are)150 2675 y(directories\).)45 b(The)31 |
6e51e0d0 | 17570 | b Ft(-o)f(nospace)f Fu(option)j(tells)g(Readline)g(to)h(not)e(app)s |
8a0829e9 | 17571 | (end)f(a)i(space)g(c)m(haracter)h(to)f(the)150 2785 y(directory)c |
6e51e0d0 CR |
17572 | (name,)h(in)f(case)h(w)m(e)f(w)m(an)m(t)h(to)f(app)s(end)f(to)h(it.)41 |
17573 | b(The)27 b Ft(-o)j(bashdefault)25 b Fu(option)j(brings)f(in)h(the)150 | |
8a0829e9 | 17574 | 2894 y(rest)h(of)f(the)h Ft(")p Fu(Bash)f(default)p Ft(")h |
6e51e0d0 | 17575 | Fu(completions)g({)g(p)s(ossible)f(completion)i(that)f(Bash)f(adds)g |
8a0829e9 | 17576 | (to)h(the)g(default)150 3004 y(Readline)40 b(set.)68 |
45c0f7f8 | 17577 | b(These)39 b(include)g(things)g(lik)m(e)i(command)e(name)g(completion,) |
8a0829e9 | 17578 | 44 b(v)-5 b(ariable)40 b(completion)150 3113 y(for)i(w)m(ords)g(b)s |
6e51e0d0 | 17579 | (eginning)f(with)h(`)p Ft({)p Fu(',)k(completions)e(con)m(taining)f |
8a0829e9 | 17580 | (pathname)g(expansion)f(patterns)g(\(see)150 3223 y(Section)31 |
595e3e69 | 17581 | b(3.5.8)h([Filename)g(Expansion],)e(page)i(30\),)f(and)f(so)h(on.)275 |
8a0829e9 | 17582 | 3357 y(Once)39 b(installed)i(using)e Ft(complete)p Fu(,)h |
6e51e0d0 | 17583 | Ft(_comp_cd)d Fu(will)j(b)s(e)g(called)g(ev)m(ery)h(time)f(w)m(e)g |
8a0829e9 CR |
17584 | (attempt)h(w)m(ord)150 3467 y(completion)32 b(for)e(a)h |
17585 | Ft(cd)e Fu(command.)275 3601 y(Man)m(y)34 b(more)g(examples)g({)g(an)g | |
45c0f7f8 | 17586 | (extensiv)m(e)h(collection)i(of)c(completions)i(for)f(most)g(of)g(the)g |
8a0829e9 | 17587 | (common)150 3711 y(GNU,)g(Unix,)h(and)d(Lin)m(ux)h(commands)g({)h(are)g |
45c0f7f8 | 17588 | (a)m(v)-5 b(ailable)36 b(as)e(part)f(of)h(the)f(bash)p |
8a0829e9 CR |
17589 | 2943 3711 28 4 v 39 w(completion)i(pro)5 b(ject.)150 |
17590 | 3821 y(This)33 b(is)h(installed)h(b)m(y)f(default)g(on)g(man)m(y)h | |
6e51e0d0 | 17591 | (GNU/Lin)m(ux)f(distributions.)51 b(Originally)35 b(written)f(b)m(y)g |
967625cd CR |
17592 | (Ian)150 3930 y(Macdonald,)44 b(the)d(pro)5 b(ject)41 |
17593 | b(no)m(w)f(liv)m(es)i(at)f Ft(http:)8 b(/)g(/)g(bash-completion)g(.)g | |
17594 | (alioth)g(.)g(debi)o(an)g(.)g(org)f(/)h Fu(.)150 4040 | |
17595 | y(There)30 b(are)h(p)s(orts)e(for)h(other)h(systems)f(suc)m(h)g(as)h | |
17596 | (Solaris)g(and)f(Mac)h(OS)f(X.)275 4174 y(An)54 b(older)h(v)m(ersion)h | |
17597 | (of)f(the)g(bash)p 1532 4174 V 40 w(completion)h(pac)m(k)-5 | |
17598 | b(age)57 b(is)e(distributed)f(with)h(bash)f(in)h(the)150 | |
17599 | 4284 y Ft(examples/complete)26 b Fu(sub)s(directory)-8 | |
6e51e0d0 | 17600 | b(.)p eop end |
900a813b | 17601 | %%Page: 136 142 |
037a8b7f CR |
17602 | TeXDict begin 136 141 bop 3614 -116 a Fu(136)150 299 |
17603 | y Fp(9)80 b(Using)53 b(History)g(In)l(teractiv)l(ely)150 | |
17604 | 498 y Fu(This)42 b(c)m(hapter)h(describ)s(es)f(ho)m(w)g(to)h(use)g(the) | |
6e51e0d0 | 17605 | f Fm(gnu)h Fu(History)g(Library)e(in)m(teractiv)m(ely)-8 |
037a8b7f | 17606 | b(,)50 b(from)42 b(a)h(user's)150 607 y(standp)s(oin)m(t.)76 |
37c41ab1 | 17607 | b(It)42 b(should)f(b)s(e)h(considered)g(a)g(user's)g(guide.)76 |
6e51e0d0 | 17608 | b(F)-8 b(or)43 b(information)f(on)g(using)g(the)g Fm(gnu)150 |
037a8b7f CR |
17609 | 717 y Fu(History)31 b(Library)f(in)g(other)g(programs,)g(see)h(the)g |
17610 | Fm(gnu)f Fu(Readline)h(Library)f(Man)m(ual.)150 944 y | |
17611 | Fs(9.1)68 b(Bash)45 b(History)h(F)-11 b(acilities)150 | |
17612 | 1103 y Fu(When)44 b(the)g Ft(-o)30 b(history)42 b Fu(option)i(to)h(the) | |
6e51e0d0 | 17613 | f Ft(set)f Fu(builtin)h(is)g(enabled)g(\(see)g(Section)h(4.3.1)h([The)e |
037a8b7f | 17614 | (Set)150 1213 y(Builtin],)32 b(page)g(59\),)h(the)e(shell)h(pro)m |
6e51e0d0 | 17615 | (vides)f(access)h(to)g(the)f Fr(command)g(history)p Fu(,)h(the)f(list)h |
037a8b7f | 17616 | (of)f(commands)150 1322 y(previously)h(t)m(yp)s(ed.)47 |
6e51e0d0 CR |
17617 | b(The)33 b(v)-5 b(alue)33 b(of)f(the)h Ft(HISTSIZE)e |
17618 | Fu(shell)h(v)-5 b(ariable)34 b(is)f(used)e(as)i(the)g(n)m(um)m(b)s(er)e | |
037a8b7f | 17619 | (of)i(com-)150 1432 y(mands)i(to)i(sa)m(v)m(e)h(in)e(a)g(history)h |
6e51e0d0 | 17620 | (list.)58 b(The)36 b(text)h(of)g(the)f(last)h Ft($HISTSIZE)d |
037a8b7f | 17621 | Fu(commands)i(\(default)g(500\))150 1541 y(is)h(sa)m(v)m(ed.)61 |
6e51e0d0 CR |
17622 | b(The)36 b(shell)h(stores)h(eac)m(h)g(command)e(in)h(the)g(history)g |
17623 | (list)g(prior)f(to)i(parameter)f(and)f(v)-5 b(ari-)150 | |
037a8b7f | 17624 | 1651 y(able)33 b(expansion)g(but)f(after)h(history)f(expansion)h(is)g |
6e51e0d0 | 17625 | (p)s(erformed,)e(sub)5 b(ject)33 b(to)g(the)g(v)-5 b(alues)33 |
037a8b7f CR |
17626 | b(of)g(the)g(shell)150 1760 y(v)-5 b(ariables)31 b Ft(HISTIGNORE)d |
17627 | Fu(and)h Ft(HISTCONTROL)p Fu(.)275 1888 y(When)g(the)g(shell)h(starts)g | |
37c41ab1 | 17628 | (up,)f(the)h(history)f(is)h(initialized)h(from)e(the)h(\014le)f(named)g |
037a8b7f | 17629 | (b)m(y)h(the)f Ft(HISTFILE)150 1998 y Fu(v)-5 b(ariable)26 |
6e51e0d0 CR |
17630 | b(\(default)g Ft(~/.bash_history)p Fu(\).)35 b(The)24 |
17631 | b(\014le)i(named)e(b)m(y)h(the)h(v)-5 b(alue)25 b(of)h | |
037a8b7f | 17632 | Ft(HISTFILE)c Fu(is)k(truncated,)150 2107 y(if)42 b(necessary)-8 |
37c41ab1 CR |
17633 | b(,)45 b(to)e(con)m(tain)g(no)f(more)g(than)f(the)h(n)m(um)m(b)s(er)f |
17634 | (of)h(lines)g(sp)s(eci\014ed)f(b)m(y)h(the)g(v)-5 b(alue)42 | |
037a8b7f | 17635 | b(of)g(the)150 2217 y Ft(HISTFILESIZE)28 b Fu(v)-5 b(ariable.)46 |
9f178efb | 17636 | b(When)31 b(a)h(shell)g(with)g(history)f(enabled)h(exits,)h(the)f(last) |
037a8b7f | 17637 | h Ft($HISTSIZE)c Fu(lines)150 2326 y(are)35 b(copied)g(from)g(the)g |
9f178efb | 17638 | (history)f(list)i(to)f(the)g(\014le)g(named)f(b)m(y)h |
6e51e0d0 | 17639 | Ft($HISTFILE)p Fu(.)51 b(If)35 b(the)g Ft(histappend)d |
037a8b7f | 17640 | Fu(shell)150 2436 y(option)26 b(is)g(set)g(\(see)h(Section)f(4.2)h |
1101193a | 17641 | ([Bash)f(Builtins],)h(page)g(48\),)h(the)e(lines)g(are)g(app)s(ended)e |
037a8b7f | 17642 | (to)i(the)g(history)150 2545 y(\014le,)36 b(otherwise)f(the)g(history)f |
6e51e0d0 CR |
17643 | (\014le)h(is)f(o)m(v)m(erwritten.)55 b(If)34 b Ft(HISTFILE)e |
17644 | Fu(is)j(unset,)g(or)g(if)f(the)h(history)f(\014le)h(is)150 | |
037a8b7f | 17645 | 2655 y(un)m(writable,)f(the)f(history)g(is)g(not)h(sa)m(v)m(ed.)49 |
9f178efb | 17646 | b(After)34 b(sa)m(ving)g(the)f(history)-8 b(,)34 b(the)g(history)f |
037a8b7f | 17647 | (\014le)g(is)g(truncated)150 2765 y(to)g(con)m(tain)h(no)f(more)g(than) |
6e51e0d0 | 17648 | f Ft($HISTFILESIZE)d Fu(lines.)48 b(If)33 b Ft(HISTFILESIZE)c |
037a8b7f | 17649 | Fu(is)k(unset,)g(or)f(set)i(to)f(n)m(ull,)h(a)150 2874 |
9f178efb CR |
17650 | y(non-n)m(umeric)c(v)-5 b(alue,)31 b(or)f(a)h(n)m(umeric)f(v)-5 |
17651 | b(alue)31 b(less)g(than)f(zero,)h(the)g(history)f(\014le)h(is)f(not)h | |
037a8b7f | 17652 | (truncated.)275 3002 y(If)g(the)h Ft(HISTTIMEFORMAT)d |
6e51e0d0 | 17653 | Fu(is)j(set,)h(the)f(time)h(stamp)f(information)g(asso)s(ciated)i(with) |
037a8b7f | 17654 | e(eac)m(h)h(history)150 3111 y(en)m(try)d(is)h(written)f(to)h(the)f |
d3ad40de | 17655 | (history)h(\014le,)f(mark)m(ed)h(with)f(the)g(history)g(commen)m(t)h(c) |
037a8b7f | 17656 | m(haracter.)43 b(When)30 b(the)150 3221 y(history)22 |
d3ad40de CR |
17657 | b(\014le)h(is)g(read,)h(lines)f(b)s(eginning)e(with)i(the)f(history)h |
17658 | (commen)m(t)g(c)m(haracter)h(follo)m(w)m(ed)h(immediately)150 | |
037a8b7f CR |
17659 | 3330 y(b)m(y)30 b(a)h(digit)g(are)g(in)m(terpreted)g(as)f(timestamps)h |
17660 | (for)f(the)h(follo)m(wing)h(history)e(en)m(try)-8 b(.)275 | |
17661 | 3458 y(The)19 b(builtin)h(command)g Ft(fc)g Fu(ma)m(y)h(b)s(e)f(used)f | |
17662 | (to)i(list)g(or)g(edit)g(and)e(re-execute)j(a)f(p)s(ortion)f(of)g(the)h | |
17663 | (history)150 3567 y(list.)41 b(The)27 b Ft(history)f | |
17664 | Fu(builtin)i(ma)m(y)h(b)s(e)e(used)g(to)i(displa)m(y)g(or)f(mo)s(dify)f | |
17665 | (the)h(history)g(list)h(and)f(manipulate)150 3677 y(the)j(history)g | |
17666 | (\014le.)42 b(When)31 b(using)f(command-line)h(editing,)h(searc)m(h)f | |
17667 | (commands)g(are)g(a)m(v)-5 b(ailable)33 b(in)e(eac)m(h)150 | |
17668 | 3787 y(editing)45 b(mo)s(de)g(that)g(pro)m(vide)g(access)h(to)f(the)g | |
17669 | (history)f(list)i(\(see)f(Section)h(8.4.2)g([Commands)e(F)-8 | |
17670 | b(or)150 3896 y(History],)31 b(page)h(119\).)275 4024 | |
17671 | y(The)47 b(shell)i(allo)m(ws)h(con)m(trol)f(o)m(v)m(er)h(whic)m(h)e | |
17672 | (commands)g(are)h(sa)m(v)m(ed)g(on)f(the)h(history)f(list.)95 | |
17673 | b(The)150 4133 y Ft(HISTCONTROL)25 b Fu(and)j Ft(HISTIGNORE)e | |
17674 | Fu(v)-5 b(ariables)29 b(ma)m(y)h(b)s(e)d(set)j(to)f(cause)g(the)g | |
17675 | (shell)f(to)i(sa)m(v)m(e)g(only)f(a)g(subset)150 4243 | |
17676 | y(of)e(the)g(commands)f(en)m(tered.)40 b(The)26 b Ft(cmdhist)f | |
17677 | Fu(shell)i(option,)h(if)f(enabled,)g(causes)h(the)e(shell)h(to)h | |
17678 | (attempt)150 4352 y(to)23 b(sa)m(v)m(e)h(eac)m(h)f(line)g(of)f(a)h(m)m | |
17679 | (ulti-line)g(command)f(in)g(the)h(same)f(history)g(en)m(try)-8 | |
17680 | b(,)25 b(adding)d(semicolons)h(where)150 4462 y(necessary)37 | |
17681 | b(to)f(preserv)m(e)h(syn)m(tactic)h(correctness.)58 b(The)36 | |
17682 | b Ft(lithist)e Fu(shell)i(option)h(causes)g(the)f(shell)g(to)150 | |
17683 | 4572 y(sa)m(v)m(e)25 b(the)e(command)h(with)f(em)m(b)s(edded)f | |
17684 | (newlines)h(instead)h(of)f(semicolons.)40 b(The)23 b | |
17685 | Ft(shopt)e Fu(builtin)i(is)h(used)150 4681 y(to)31 b(set)g(these)g | |
17686 | (options.)41 b(See)31 b(Section)g(4.2)g([Bash)g(Builtins],)g(page)g | |
17687 | (48,)h(for)e(a)h(description)f(of)h Ft(shopt)p Fu(.)150 | |
17688 | 4908 y Fs(9.2)68 b(Bash)45 b(History)h(Builtins)150 5067 | |
17689 | y Fu(Bash)31 b(pro)m(vides)f(t)m(w)m(o)i(builtin)e(commands)g(whic)m(h) | |
17690 | g(manipulate)g(the)h(history)f(list)h(and)f(history)g(\014le.)150 | |
17691 | 5213 y Ft(fc)870 5340 y(fc)47 b([-e)g Fj(ename)p Ft(])f([-lnr])g([)p | |
17692 | Fj(first)p Ft(])g([)p Fj(last)p Ft(])p eop end | |
900a813b CR |
17693 | %%Page: 137 143 |
17694 | TeXDict begin 137 142 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
17695 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(137)870 | |
037a8b7f CR |
17696 | 299 y Ft(fc)47 b(-s)g([)p Fj(pat)p Ft(=)p Fj(rep)p Ft(])f([)p |
17697 | Fj(command)p Ft(])630 429 y Fu(The)22 b(\014rst)g(form)f(selects)j(a)f | |
17698 | (range)g(of)f(commands)g(from)g Fr(\014rst)i Fu(to)f | |
17699 | Fr(last)i Fu(from)d(the)h(history)f(list)630 539 y(and)i(displa)m(ys)h | |
17700 | (or)g(edits)h(and)e(re-executes)j(them.)39 b(Both)25 | |
17701 | b Fr(\014rst)h Fu(and)f Fr(last)j Fu(ma)m(y)d(b)s(e)g(sp)s(eci\014ed) | |
17702 | 630 648 y(as)31 b(a)g(string)f(\(to)i(lo)s(cate)h(the)d(most)h(recen)m | |
17703 | (t)h(command)f(b)s(eginning)e(with)i(that)g(string\))g(or)630 | |
17704 | 758 y(as)d(a)g(n)m(um)m(b)s(er)f(\(an)h(index)f(in)m(to)i(the)f | |
122f603c | 17705 | (history)g(list,)h(where)e(a)h(negativ)m(e)i(n)m(um)m(b)s(er)d(is)h |
037a8b7f | 17706 | (used)f(as)630 867 y(an)g(o\013set)i(from)e(the)h(curren)m(t)f(command) |
6e51e0d0 | 17707 | h(n)m(um)m(b)s(er\).)39 b(If)27 b Fr(last)j Fu(is)e(not)f(sp)s |
037a8b7f | 17708 | (eci\014ed)g(it)h(is)g(set)g(to)630 977 y Fr(\014rst)p |
6e51e0d0 CR |
17709 | Fu(.)47 b(If)32 b Fr(\014rst)i Fu(is)f(not)g(sp)s(eci\014ed)f(it)h(is)g |
17710 | (set)g(to)h(the)f(previous)f(command)h(for)f(editing)i(and)630 | |
037a8b7f | 17711 | 1087 y Fq(\000)p Fu(16)j(for)g(listing.)61 b(If)36 b(the)h |
6e51e0d0 | 17712 | Ft(-l)f Fu(\015ag)i(is)e(giv)m(en,)k(the)d(commands)f(are)i(listed)f |
037a8b7f | 17713 | (on)g(standard)630 1196 y(output.)59 b(The)36 b Ft(-n)h |
6e51e0d0 | 17714 | Fu(\015ag)g(suppresses)e(the)h(command)h(n)m(um)m(b)s(ers)e(when)h |
037a8b7f | 17715 | (listing.)60 b(The)37 b Ft(-r)630 1306 y Fu(\015ag)e(rev)m(erses)f(the) |
6e51e0d0 | 17716 | h(order)e(of)i(the)f(listing.)53 b(Otherwise,)35 b(the)f(editor)h(giv)m |
037a8b7f | 17717 | (en)g(b)m(y)f Fr(ename)40 b Fu(is)630 1415 y(in)m(v)m(ok)m(ed)33 |
6e51e0d0 CR |
17718 | b(on)f(a)g(\014le)g(con)m(taining)h(those)f(commands.)44 |
17719 | b(If)31 b Fr(ename)38 b Fu(is)31 b(not)h(giv)m(en,)i(the)d(v)-5 | |
037a8b7f | 17720 | b(alue)630 1525 y(of)29 b(the)g(follo)m(wing)i(v)-5 b(ariable)29 |
6e51e0d0 | 17721 | b(expansion)g(is)g(used:)39 b Ft(${FCEDIT:-${EDITOR:-vi}})p |
037a8b7f | 17722 | Fu(.)34 b(This)630 1634 y(sa)m(ys)g(to)g(use)f(the)h(v)-5 |
6e51e0d0 | 17723 | b(alue)34 b(of)f(the)h Ft(FCEDIT)e Fu(v)-5 b(ariable)34 |
122f603c | 17724 | b(if)f(set,)i(or)f(the)f(v)-5 b(alue)34 b(of)g(the)g |
037a8b7f | 17725 | Ft(EDITOR)630 1744 y Fu(v)-5 b(ariable)40 b(if)e(that)i(is)f(set,)i(or) |
6e51e0d0 | 17726 | e Ft(vi)f Fu(if)h(neither)g(is)g(set.)66 b(When)39 b(editing)g(is)g |
037a8b7f CR |
17727 | (complete,)k(the)630 1854 y(edited)31 b(commands)f(are)g(ec)m(ho)s(ed)h |
17728 | (and)f(executed.)630 1984 y(In)k(the)g(second)g(form,)h | |
6e51e0d0 | 17729 | Fr(command)j Fu(is)c(re-executed)i(after)f(eac)m(h)g(instance)g(of)f |
037a8b7f | 17730 | Fr(pat)j Fu(in)d(the)630 2093 y(selected)e(command)e(is)h(replaced)g(b) |
6e51e0d0 | 17731 | m(y)f Fr(rep)p Fu(.)41 b Fr(command)34 b Fu(is)c(in)m(tepreted)h(the)g |
037a8b7f CR |
17732 | (same)g(as)g Fr(\014rst)630 2203 y Fu(ab)s(o)m(v)m(e.)630 |
17733 | 2333 y(A)g(useful)f(alias)i(to)g(use)e(with)h(the)g Ft(fc)f | |
6e51e0d0 | 17734 | Fu(command)h(is)g Ft(r='fc)e(-s')p Fu(,)h(so)h(that)h(t)m(yping)f(`)p |
037a8b7f | 17735 | Ft(r)f(cc)p Fu(')630 2443 y(runs)35 b(the)h(last)h(command)f(b)s |
6e51e0d0 | 17736 | (eginning)g(with)g Ft(cc)f Fu(and)h(t)m(yping)g(`)p Ft(r)p |
037a8b7f | 17737 | Fu(')h(re-executes)h(the)e(last)630 2552 y(command)30 |
900a813b | 17738 | b(\(see)h(Section)h(6.6)f([Aliases],)h(page)g(89\).)150 |
037a8b7f CR |
17739 | 2703 y Ft(history)870 2833 y(history)46 b([)p Fj(n)p |
17740 | Ft(])870 2943 y(history)g(-c)870 3052 y(history)g(-d)h | |
17741 | Fj(offset)870 3162 y Ft(history)f([-anrw])g([)p Fj(filename)p | |
17742 | Ft(])870 3271 y(history)g(-ps)h Fj(arg)630 3402 y Fu(With)26 | |
6e51e0d0 CR |
17743 | b(no)g(options,)h(displa)m(y)f(the)g(history)g(list)g(with)f(line)h(n)m |
17744 | (um)m(b)s(ers.)38 b(Lines)26 b(pre\014xed)e(with)630 | |
037a8b7f | 17745 | 3511 y(a)35 b(`)p Ft(*)p Fu(')g(ha)m(v)m(e)h(b)s(een)e(mo)s(di\014ed.) |
6e51e0d0 | 17746 | 53 b(An)34 b(argumen)m(t)h(of)g Fr(n)f Fu(lists)i(only)f(the)g(last)g |
037a8b7f | 17747 | Fr(n)f Fu(lines.)54 b(If)35 b(the)630 3621 y(shell)30 |
6e51e0d0 | 17748 | b(v)-5 b(ariable)31 b Ft(HISTTIMEFORMAT)26 b Fu(is)k(set)h(and)e(not)i |
37c41ab1 | 17749 | (n)m(ull,)f(it)h(is)f(used)f(as)h(a)h(format)f(string)630 |
037a8b7f | 17750 | 3730 y(for)36 b Fr(strftime)41 b Fu(to)36 b(displa)m(y)g(the)g(time)h |
37c41ab1 | 17751 | (stamp)f(asso)s(ciated)h(with)f(eac)m(h)h(displa)m(y)m(ed)f(history)630 |
037a8b7f | 17752 | 3840 y(en)m(try)-8 b(.)47 b(No)33 b(in)m(terv)m(ening)g(blank)f(is)g |
37c41ab1 | 17753 | (prin)m(ted)g(b)s(et)m(w)m(een)h(the)g(formatted)f(time)h(stamp)g(and) |
037a8b7f CR |
17754 | 630 3950 y(the)e(history)f(line.)630 4080 y(Options,)g(if)h(supplied,)e |
17755 | (ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 4230 | |
6e51e0d0 | 17756 | y Ft(-c)384 b Fu(Clear)23 b(the)g(history)g(list.)39 |
37c41ab1 | 17757 | b(This)22 b(ma)m(y)i(b)s(e)e(com)m(bined)h(with)f(the)h(other)h |
037a8b7f CR |
17758 | (options)1110 4340 y(to)31 b(replace)g(the)g(history)f(list)h |
17759 | (completely)-8 b(.)630 4491 y Ft(-d)30 b Fj(offset)66 | |
6e51e0d0 CR |
17760 | b Fu(Delete)25 b(the)f(history)f(en)m(try)h(at)g(p)s(osition)f |
17761 | Fr(o\013set)p Fu(.)39 b Fr(o\013set)27 b Fu(should)22 | |
037a8b7f CR |
17762 | b(b)s(e)h(sp)s(eci\014ed)1110 4600 y(as)31 b(it)g(app)s(ears)e(when)h |
17763 | (the)g(history)g(is)h(displa)m(y)m(ed.)630 4751 y Ft(-a)384 | |
bce12dd7 | 17764 | b Fu(App)s(end)28 b(the)i(new)f(history)g(lines)h(to)h(the)e(history)h |
037a8b7f | 17765 | (\014le.)41 b(These)29 b(are)h(history)1110 4861 y(lines)36 |
bce12dd7 | 17766 | b(en)m(tered)g(since)f(the)h(b)s(eginning)f(of)g(the)h(curren)m(t)f |
037a8b7f CR |
17767 | (Bash)h(session,)h(but)1110 4970 y(not)31 b(already)g(app)s(ended)d(to) |
17768 | j(the)g(history)f(\014le.)630 5121 y Ft(-n)384 b Fu(App)s(end)32 | |
17769 | b(the)i(history)f(lines)h(not)g(already)g(read)g(from)f(the)h(history)f | |
17770 | (\014le)h(to)1110 5230 y(the)26 b(curren)m(t)f(history)g(list.)40 | |
17771 | b(These)25 b(are)h(lines)g(app)s(ended)e(to)i(the)f(history)h(\014le) | |
17772 | 1110 5340 y(since)31 b(the)f(b)s(eginning)g(of)g(the)h(curren)m(t)f | |
17773 | (Bash)h(session.)p eop end | |
900a813b CR |
17774 | %%Page: 138 144 |
17775 | TeXDict begin 138 143 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
17776 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(138)630 | |
037a8b7f CR |
17777 | 299 y Ft(-r)384 b Fu(Read)31 b(the)f(history)g(\014le)h(and)f(app)s |
17778 | (end)e(its)j(con)m(ten)m(ts)h(to)f(the)g(history)f(list.)630 | |
17779 | 483 y Ft(-w)384 b Fu(W)-8 b(rite)32 b(out)e(the)h(curren)m(t)f(history) | |
17780 | g(list)h(to)h(the)e(history)g(\014le.)630 668 y Ft(-p)384 | |
17781 | b Fu(P)m(erform)31 b(history)f(substitution)h(on)f(the)h | |
6e51e0d0 | 17782 | Fr(arg)8 b Fu(s)31 b(and)f(displa)m(y)h(the)f(result)h(on)1110 |
037a8b7f CR |
17783 | 777 y(the)d(standard)f(output,)i(without)f(storing)g(the)g(results)g |
17784 | (in)g(the)g(history)g(list.)630 962 y Ft(-s)384 b Fu(The)30 | |
6e51e0d0 | 17785 | b Fr(arg)8 b Fu(s)30 b(are)h(added)f(to)h(the)f(end)g(of)h(the)f |
c302751c | 17786 | (history)h(list)g(as)f(a)h(single)g(en)m(try)-8 b(.)630 |
037a8b7f | 17787 | 1146 y(When)26 b(an)m(y)h(of)f(the)g Ft(-w)p Fu(,)h Ft(-r)p |
6e51e0d0 CR |
17788 | Fu(,)g Ft(-a)p Fu(,)g(or)f Ft(-n)f Fu(options)i(is)f(used,)h(if)f |
17789 | Fr(\014lename)32 b Fu(is)26 b(giv)m(en,)i(then)e(it)h(is)630 | |
037a8b7f | 17790 | 1256 y(used)h(as)g(the)h(history)f(\014le.)40 b(If)28 |
6e51e0d0 | 17791 | b(not,)i(then)e(the)g(v)-5 b(alue)29 b(of)g(the)g Ft(HISTFILE)d |
037a8b7f CR |
17792 | Fu(v)-5 b(ariable)29 b(is)f(used.)150 1534 y Fs(9.3)68 |
17793 | b(History)46 b(Expansion)150 1693 y Fu(The)f(History)h(library)e(pro)m | |
6e51e0d0 | 17794 | (vides)i(a)f(history)g(expansion)g(feature)h(that)g(is)f(similar)h(to)g |
037a8b7f | 17795 | (the)f(history)150 1803 y(expansion)g(pro)m(vided)f(b)m(y)h |
6e51e0d0 | 17796 | Ft(csh)p Fu(.)83 b(This)44 b(section)i(describ)s(es)e(the)h(syn)m(tax)h |
037a8b7f CR |
17797 | (used)e(to)i(manipulate)f(the)150 1912 y(history)30 b(information.)275 |
17798 | 2072 y(History)h(expansions)f(in)m(tro)s(duce)g(w)m(ords)g(from)g(the)h | |
c302751c | 17799 | (history)f(list)h(in)m(to)g(the)g(input)f(stream,)h(making)150 |
037a8b7f | 17800 | 2182 y(it)g(easy)g(to)g(rep)s(eat)g(commands,)f(insert)g(the)h(argumen) |
37c41ab1 | 17801 | m(ts)f(to)h(a)g(previous)f(command)g(in)m(to)i(the)e(curren)m(t)150 |
037a8b7f CR |
17802 | 2291 y(input)f(line,)i(or)g(\014x)f(errors)f(in)h(previous)g(commands)g |
17803 | (quic)m(kly)-8 b(.)275 2451 y(History)40 b(expansion)g(is)h(p)s | |
900a813b | 17804 | (erformed)d(immediately)k(after)f(a)f(complete)i(line)f(is)f(read,)j(b) |
037a8b7f CR |
17805 | s(efore)d(the)150 2560 y(shell)31 b(breaks)f(it)h(in)m(to)g(w)m(ords.) |
17806 | 275 2720 y(History)c(expansion)f(tak)m(es)i(place)f(in)f(t)m(w)m(o)i | |
900a813b | 17807 | (parts.)39 b(The)26 b(\014rst)g(is)g(to)h(determine)g(whic)m(h)f(line)h |
037a8b7f | 17808 | (from)f(the)150 2829 y(history)i(list)g(should)f(b)s(e)g(used)g(during) |
900a813b | 17809 | g(substitution.)39 b(The)27 b(second)h(is)g(to)h(select)g(p)s(ortions)e |
037a8b7f | 17810 | (of)h(that)h(line)150 2939 y(for)d(inclusion)f(in)m(to)i(the)f(curren)m |
900a813b | 17811 | (t)f(one.)40 b(The)25 b(line)h(selected)h(from)f(the)g(history)f(is)h |
037a8b7f | 17812 | (called)h(the)f Fr(ev)m(en)m(t)p Fu(,)j(and)150 3048 |
900a813b CR |
17813 | y(the)21 b(p)s(ortions)g(of)g(that)h(line)f(that)h(are)g(acted)g(up)s |
17814 | (on)e(are)h(called)h Fr(w)m(ords)p Fu(.)38 b(V)-8 b(arious)21 | |
17815 | b Fr(mo)s(di\014ers)j Fu(are)e(a)m(v)-5 b(ailable)150 | |
037a8b7f | 17816 | 3158 y(to)35 b(manipulate)f(the)g(selected)i(w)m(ords.)51 |
900a813b | 17817 | b(The)33 b(line)h(is)g(brok)m(en)g(in)m(to)h(w)m(ords)e(in)h(the)g |
037a8b7f | 17818 | (same)h(fashion)e(that)150 3268 y(Bash)i(do)s(es,)h(so)f(that)h(sev)m |
900a813b | 17819 | (eral)g(w)m(ords)e(surrounded)f(b)m(y)i(quotes)g(are)g(considered)g |
037a8b7f | 17820 | (one)g(w)m(ord.)54 b(History)150 3377 y(expansions)34 |
900a813b CR |
17821 | b(are)g(in)m(tro)s(duced)f(b)m(y)h(the)g(app)s(earance)g(of)g(the)g |
17822 | (history)g(expansion)g(c)m(haracter,)i(whic)m(h)e(is)150 | |
037a8b7f | 17823 | 3487 y(`)p Ft(!)p Fu(')39 b(b)m(y)g(default.)66 b(Only)38 |
900a813b CR |
17824 | b(`)p Ft(\\)p Fu(')h(and)f(`)p Ft(')p Fu(')h(ma)m(y)h(b)s(e)e(used)g |
17825 | (to)h(escap)s(e)h(the)f(history)f(expansion)h(c)m(haracter,)150 | |
037a8b7f | 17826 | 3596 y(but)27 b(the)i(history)f(expansion)g(c)m(haracter)i(is)e(also)h |
900a813b | 17827 | (treated)g(as)g(quoted)f(if)g(it)h(immediately)h(precedes)e(the)150 |
037a8b7f CR |
17828 | 3706 y(closing)j(double)f(quote)h(in)f(a)h(double-quoted)g(string.)275 |
17829 | 3865 y(Sev)m(eral)40 b(shell)g(options)g(settable)h(with)e(the)h | |
6e51e0d0 | 17830 | Ft(shopt)e Fu(builtin)h(\(see)h(Section)h(4.2)f([Bash)g(Builtins],)150 |
037a8b7f | 17831 | 3975 y(page)32 b(48\))h(ma)m(y)f(b)s(e)f(used)g(to)i(tailor)g(the)e(b)s |
37c41ab1 | 17832 | (eha)m(vior)h(of)g(history)g(expansion.)44 b(If)31 b(the)h |
037a8b7f | 17833 | Ft(histverify)d Fu(shell)150 4085 y(option)39 b(is)f(enabled,)i(and)e |
37c41ab1 | 17834 | (Readline)g(is)h(b)s(eing)e(used,)j(history)e(substitutions)g(are)g |
037a8b7f | 17835 | (not)h(immediately)150 4194 y(passed)30 b(to)h(the)g(shell)g(parser.)40 |
37c41ab1 | 17836 | b(Instead,)30 b(the)h(expanded)f(line)h(is)f(reloaded)h(in)m(to)h(the)e |
037a8b7f | 17837 | (Readline)h(editing)150 4304 y(bu\013er)e(for)i(further)e(mo)s |
37c41ab1 | 17838 | (di\014cation.)41 b(If)30 b(Readline)h(is)f(b)s(eing)g(used,)g(and)g |
037a8b7f | 17839 | (the)g Ft(histreedit)e Fu(shell)i(option)150 4413 y(is)k(enabled,)h(a)g |
37c41ab1 | 17840 | (failed)g(history)f(expansion)g(will)g(b)s(e)g(reloaded)g(in)m(to)h |
037a8b7f | 17841 | (the)g(Readline)f(editing)h(bu\013er)e(for)150 4523 y(correction.)68 |
6e51e0d0 CR |
17842 | b(The)38 b Ft(-p)h Fu(option)g(to)h(the)f Ft(history)e |
17843 | Fu(builtin)i(command)f(ma)m(y)i(b)s(e)e(used)g(to)i(see)g(what)f(a)150 | |
037a8b7f | 17844 | 4633 y(history)f(expansion)f(will)h(do)g(b)s(efore)f(using)h(it.)63 |
6e51e0d0 | 17845 | b(The)37 b Ft(-s)g Fu(option)i(to)f(the)g Ft(history)e |
037a8b7f | 17846 | Fu(builtin)h(ma)m(y)i(b)s(e)150 4742 y(used)21 b(to)i(add)f(commands)g |
6e51e0d0 | 17847 | (to)g(the)h(end)e(of)i(the)f(history)g(list)h(without)f(actually)i |
037a8b7f | 17848 | (executing)f(them,)h(so)e(that)150 4852 y(they)31 b(are)f(a)m(v)-5 |
6e51e0d0 CR |
17849 | b(ailable)33 b(for)d(subsequen)m(t)g(recall.)42 b(This)29 |
17850 | b(is)i(most)g(useful)e(in)h(conjunction)h(with)f(Readline.)275 | |
900a813b | 17851 | 5011 y(The)j(shell)h(allo)m(ws)h(con)m(trol)h(of)e(the)g(v)-5 |
6e51e0d0 | 17852 | b(arious)34 b(c)m(haracters)h(used)f(b)m(y)f(the)h(history)g(expansion) |
900a813b | 17853 | g(mec)m(h-)150 5121 y(anism)h(with)g(the)g Ft(histchars)d |
6e51e0d0 | 17854 | Fu(v)-5 b(ariable,)38 b(as)d(explained)g(ab)s(o)m(v)m(e)i(\(see)f |
900a813b CR |
17855 | (Section)f(5.2)i([Bash)e(V)-8 b(ariables],)150 5230 y(page)32 |
17856 | b(70\).)44 b(The)31 b(shell)g(uses)g(the)g(history)g(commen)m(t)i(c)m | |
6e51e0d0 | 17857 | (haracter)f(to)g(mark)f(history)g(timestamps)h(when)150 |
900a813b CR |
17858 | 5340 y(writing)e(the)h(history)f(\014le.)p eop end |
17859 | %%Page: 139 145 | |
17860 | TeXDict begin 139 144 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
17861 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(139)150 | |
17862 | 299 y Fk(9.3.1)63 b(Ev)m(en)m(t)39 b(Designators)150 | |
17863 | 446 y Fu(An)32 b(ev)m(en)m(t)j(designator)e(is)g(a)g(reference)g(to)h | |
17864 | (a)f(command)f(line)h(en)m(try)g(in)g(the)g(history)g(list.)48 | |
17865 | b(Unless)33 b(the)150 555 y(reference)e(is)f(absolute,)i(ev)m(en)m(ts)f | |
17866 | (are)g(relativ)m(e)i(to)e(the)f(curren)m(t)g(p)s(osition)h(in)f(the)h | |
17867 | (history)f(list.)150 712 y Ft(!)432 b Fu(Start)34 b(a)f(history)h | |
17868 | (substitution,)g(except)g(when)f(follo)m(w)m(ed)i(b)m(y)e(a)h(space,)h | |
17869 | (tab,)f(the)g(end)f(of)630 822 y(the)i(line,)g(`)p Ft(=)p | |
17870 | Fu(')g(or)f(`)p Ft(\()p Fu(')h(\(when)e(the)i Ft(extglob)d | |
17871 | Fu(shell)j(option)f(is)h(enabled)f(using)g(the)g Ft(shopt)630 | |
17872 | 931 y Fu(builtin\).)150 1088 y Ft(!)p Fj(n)384 b Fu(Refer)30 | |
17873 | b(to)i(command)e(line)g Fr(n)p Fu(.)150 1245 y Ft(!-)p | |
17874 | Fj(n)336 b Fu(Refer)30 b(to)i(the)e(command)g Fr(n)g | |
17875 | Fu(lines)h(bac)m(k.)150 1401 y Ft(!!)384 b Fu(Refer)30 | |
17876 | b(to)i(the)e(previous)g(command.)40 b(This)30 b(is)g(a)h(synon)m(ym)f | |
17877 | (for)g(`)p Ft(!-1)p Fu('.)150 1558 y Ft(!)p Fj(string)144 | |
17878 | b Fu(Refer)25 b(to)h(the)f(most)h(recen)m(t)g(command)f(preceding)g | |
17879 | (the)g(curren)m(t)g(p)s(osition)g(in)g(the)g(history)630 | |
17880 | 1668 y(list)31 b(starting)g(with)f Fr(string)p Fu(.)150 | |
17881 | 1824 y Ft(!?)p Fj(string)p Ft([?])630 1934 y Fu(Refer)25 | |
17882 | b(to)h(the)f(most)h(recen)m(t)g(command)f(preceding)g(the)g(curren)m(t) | |
17883 | g(p)s(osition)g(in)g(the)g(history)630 2044 y(list)32 | |
17884 | b(con)m(taining)i Fr(string)p Fu(.)45 b(The)31 b(trailing)i(`)p | |
17885 | Ft(?)p Fu(')f(ma)m(y)g(b)s(e)f(omitted)i(if)f(the)g Fr(string)39 | |
17886 | b Fu(is)32 b(follo)m(w)m(ed)630 2153 y(immediately)g(b)m(y)e(a)h | |
17887 | (newline.)150 2310 y Ft(^)p Fj(string1)p Ft(^)p Fj(string2)p | |
17888 | Ft(^)630 2420 y Fu(Quic)m(k)h(Substitution.)44 b(Rep)s(eat)32 | |
17889 | b(the)g(last)h(command,)f(replacing)g Fr(string1)40 b | |
17890 | Fu(with)31 b Fr(string2)p Fu(.)630 2529 y(Equiv)-5 b(alen)m(t)31 | |
17891 | b(to)g Ft(!!:s/)p Fj(string1)p Ft(/)p Fj(string2)p Ft(/)p | |
17892 | Fu(.)150 2686 y Ft(!#)384 b Fu(The)30 b(en)m(tire)h(command)f(line)h(t) | |
17893 | m(yp)s(ed)f(so)h(far.)150 2882 y Fk(9.3.2)63 b(W)-10 | |
17894 | b(ord)41 b(Designators)150 3029 y Fu(W)-8 b(ord)27 b(designators)h(are) | |
17895 | g(used)e(to)i(select)h(desired)d(w)m(ords)h(from)f(the)i(ev)m(en)m(t.) | |
17896 | 41 b(A)27 b(`)p Ft(:)p Fu(')g(separates)h(the)f(ev)m(en)m(t)150 | |
17897 | 3139 y(sp)s(eci\014cation)38 b(from)e(the)h(w)m(ord)f(designator.)61 | |
c302751c | 17898 | b(It)37 b(ma)m(y)h(b)s(e)e(omitted)i(if)e(the)h(w)m(ord)g(designator)g |
900a813b | 17899 | (b)s(egins)150 3248 y(with)30 b(a)g(`)p Ft(^)p Fu(',)g(`)p |
6e51e0d0 CR |
17900 | Ft($)p Fu(',)g(`)p Ft(*)p Fu(',)h(`)p Ft(-)p Fu(',)f(or)g(`)p |
17901 | Ft(\045)p Fu('.)41 b(W)-8 b(ords)30 b(are)g(n)m(um)m(b)s(ered)e(from)i | |
c302751c | 17902 | (the)g(b)s(eginning)f(of)h(the)g(line,)g(with)g(the)150 |
900a813b | 17903 | 3358 y(\014rst)f(w)m(ord)f(b)s(eing)h(denoted)h(b)m(y)f(0)h(\(zero\).) |
c302751c | 17904 | 41 b(W)-8 b(ords)30 b(are)g(inserted)f(in)m(to)h(the)g(curren)m(t)f |
900a813b CR |
17905 | (line)g(separated)h(b)m(y)150 3468 y(single)h(spaces.)275 |
17906 | 3601 y(F)-8 b(or)31 b(example,)150 3758 y Ft(!!)384 b | |
6e51e0d0 | 17907 | Fu(designates)37 b(the)f(preceding)g(command.)57 b(When)35 |
c302751c | 17908 | b(y)m(ou)i(t)m(yp)s(e)f(this,)h(the)f(preceding)g(com-)630 |
900a813b | 17909 | 3867 y(mand)30 b(is)g(rep)s(eated)g(in)g(toto.)150 4024 |
6e51e0d0 | 17910 | y Ft(!!:$)288 b Fu(designates)23 b(the)g(last)g(argumen)m(t)g(of)f(the) |
c302751c | 17911 | h(preceding)f(command.)38 b(This)22 b(ma)m(y)h(b)s(e)e(shortened)630 |
900a813b | 17912 | 4133 y(to)31 b Ft(!$)p Fu(.)150 4290 y Ft(!fi:2)240 b |
6e51e0d0 | 17913 | Fu(designates)30 b(the)g(second)f(argumen)m(t)h(of)f(the)h(most)f |
900a813b CR |
17914 | (recen)m(t)i(command)e(starting)h(with)f(the)630 4400 |
17915 | y(letters)j Ft(fi)p Fu(.)275 4556 y(Here)e(are)h(the)g(w)m(ord)f | |
17916 | (designators:)150 4713 y Ft(0)g(\(zero\))114 b Fu(The)30 | |
6e51e0d0 | 17917 | b Ft(0)p Fu(th)g(w)m(ord.)40 b(F)-8 b(or)31 b(man)m(y)g(applications,)h |
900a813b CR |
17918 | (this)e(is)g(the)h(command)f(w)m(ord.)150 4870 y Fj(n)432 |
17919 | b Fu(The)30 b Fr(n)p Fu(th)g(w)m(ord.)150 5027 y Ft(^)432 | |
6e51e0d0 | 17920 | b Fu(The)30 b(\014rst)f(argumen)m(t;)j(that)f(is,)f(w)m(ord)g(1.)150 |
900a813b CR |
17921 | 5183 y Ft($)432 b Fu(The)30 b(last)h(argumen)m(t.)150 |
17922 | 5340 y Ft(\045)432 b Fu(The)30 b(w)m(ord)g(matc)m(hed)h(b)m(y)f(the)h | |
17923 | (most)g(recen)m(t)g(`)p Ft(?)p Fj(string)p Ft(?)p Fu(')e(searc)m(h.)p | |
17924 | eop end | |
17925 | %%Page: 140 146 | |
17926 | TeXDict begin 140 145 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
17927 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(140)150 | |
17928 | 299 y Fj(x)p Ft(-)p Fj(y)336 b Fu(A)30 b(range)h(of)g(w)m(ords;)f(`)p | |
6e51e0d0 | 17929 | Ft(-)p Fj(y)p Fu(')g(abbreviates)h(`)p Ft(0-)p Fj(y)p |
900a813b | 17930 | Fu('.)150 458 y Ft(*)432 b Fu(All)28 b(of)g(the)g(w)m(ords,)g(except)h |
6e51e0d0 CR |
17931 | (the)e Ft(0)p Fu(th.)40 b(This)27 b(is)g(a)h(synon)m(ym)f(for)h(`)p |
17932 | Ft(1-$)p Fu('.)39 b(It)28 b(is)g(not)g(an)f(error)630 | |
900a813b | 17933 | 568 y(to)j(use)g(`)p Ft(*)p Fu(')f(if)h(there)g(is)g(just)f(one)h(w)m |
122f603c | 17934 | (ord)f(in)g(the)h(ev)m(en)m(t;)i(the)d(empt)m(y)i(string)e(is)h |
900a813b CR |
17935 | (returned)e(in)630 677 y(that)j(case.)150 837 y Fj(x)p |
17936 | Ft(*)384 b Fu(Abbreviates)31 b(`)p Fj(x)p Ft(-$)p Fu(')150 | |
17937 | 996 y Fj(x)p Ft(-)384 b Fu(Abbreviates)31 b(`)p Fj(x)p | |
17938 | Ft(-$)p Fu(')f(lik)m(e)h(`)p Fj(x)p Ft(*)p Fu(',)g(but)f(omits)h(the)f | |
17939 | (last)h(w)m(ord.)275 1156 y(If)i(a)h(w)m(ord)g(designator)g(is)g | |
17940 | (supplied)f(without)h(an)g(ev)m(en)m(t)h(sp)s(eci\014cation,)h(the)e | |
17941 | (previous)f(command)150 1265 y(is)d(used)g(as)h(the)f(ev)m(en)m(t.)150 | |
17942 | 1465 y Fk(9.3.3)63 b(Mo)s(di\014ers)150 1611 y Fu(After)29 | |
17943 | b(the)g(optional)g(w)m(ord)g(designator,)g(y)m(ou)g(can)g(add)f(a)h | |
17944 | (sequence)g(of)g(one)g(or)f(more)h(of)g(the)f(follo)m(wing)150 | |
17945 | 1721 y(mo)s(di\014ers,)h(eac)m(h)j(preceded)e(b)m(y)g(a)h(`)p | |
17946 | Ft(:)p Fu('.)150 1880 y Ft(h)432 b Fu(Remo)m(v)m(e)32 | |
6e51e0d0 | 17947 | b(a)f(trailing)g(pathname)g(comp)s(onen)m(t,)g(lea)m(ving)h(only)e(the) |
900a813b | 17948 | h(head.)150 2040 y Ft(t)432 b Fu(Remo)m(v)m(e)32 b(all)f(leading)h |
6e51e0d0 | 17949 | (pathname)e(comp)s(onen)m(ts,)h(lea)m(ving)h(the)e(tail.)150 |
900a813b | 17950 | 2199 y Ft(r)432 b Fu(Remo)m(v)m(e)32 b(a)f(trailing)g(su\016x)f(of)g |
6e51e0d0 | 17951 | (the)h(form)f(`)p Ft(.)p Fj(suffix)p Fu(',)f(lea)m(ving)j(the)f |
900a813b CR |
17952 | (basename.)150 2359 y Ft(e)432 b Fu(Remo)m(v)m(e)32 b(all)f(but)f(the)h |
17953 | (trailing)g(su\016x.)150 2518 y Ft(p)432 b Fu(Prin)m(t)30 | |
6e51e0d0 | 17954 | b(the)h(new)f(command)g(but)g(do)g(not)g(execute)i(it.)150 |
900a813b CR |
17955 | 2677 y Ft(q)432 b Fu(Quote)31 b(the)f(substituted)g(w)m(ords,)g |
17956 | (escaping)h(further)e(substitutions.)150 2837 y Ft(x)432 | |
6e51e0d0 CR |
17957 | b Fu(Quote)32 b(the)f(substituted)g(w)m(ords)f(as)i(with)f(`)p |
17958 | Ft(q)p Fu(',)h(but)e(break)h(in)m(to)i(w)m(ords)d(at)i(spaces,)h(tabs,) | |
900a813b CR |
17959 | 630 2946 y(and)d(newlines.)150 3106 y Ft(s/)p Fj(old)p |
17960 | Ft(/)p Fj(new)p Ft(/)630 3215 y Fu(Substitute)i Fr(new)40 | |
6e51e0d0 CR |
17961 | b Fu(for)32 b(the)h(\014rst)f(o)s(ccurrence)h(of)f Fr(old)37 |
17962 | b Fu(in)32 b(the)h(ev)m(en)m(t)h(line.)48 b(An)m(y)32 | |
900a813b | 17963 | b(delimiter)630 3325 y(ma)m(y)25 b(b)s(e)g(used)f(in)g(place)i(of)f(`)p |
6e51e0d0 CR |
17964 | Ft(/)p Fu('.)39 b(The)24 b(delimiter)h(ma)m(y)h(b)s(e)e(quoted)h(in)f |
17965 | Fr(old)29 b Fu(and)24 b Fr(new)32 b Fu(with)25 b(a)630 | |
900a813b | 17966 | 3435 y(single)k(bac)m(kslash.)40 b(If)28 b(`)p Ft(&)p |
6e51e0d0 | 17967 | Fu(')g(app)s(ears)g(in)f Fr(new)p Fu(,)i(it)f(is)h(replaced)f(b)m(y)g |
900a813b | 17968 | Fr(old)p Fu(.)40 b(A)28 b(single)h(bac)m(kslash)630 3544 |
6e51e0d0 CR |
17969 | y(will)35 b(quote)g(the)g(`)p Ft(&)p Fu('.)54 b(The)34 |
17970 | b(\014nal)g(delimiter)i(is)e(optional)i(if)f(it)g(is)f(the)h(last)h(c)m | |
900a813b CR |
17971 | (haracter)g(on)630 3654 y(the)31 b(input)e(line.)150 |
17972 | 3813 y Ft(&)432 b Fu(Rep)s(eat)31 b(the)f(previous)g(substitution.)150 | |
17973 | 3973 y Ft(g)150 4082 y(a)432 b Fu(Cause)38 b(c)m(hanges)i(to)f(b)s(e)f | |
6e51e0d0 | 17974 | (applied)h(o)m(v)m(er)h(the)f(en)m(tire)g(ev)m(en)m(t)h(line.)66 |
900a813b | 17975 | b(Used)39 b(in)f(conjunction)630 4192 y(with)30 b(`)p |
6e51e0d0 | 17976 | Ft(s)p Fu(',)h(as)f(in)h Ft(gs/)p Fj(old)p Ft(/)p Fj(new)p |
900a813b | 17977 | Ft(/)p Fu(,)c(or)j(with)h(`)p Ft(&)p Fu('.)150 4351 y |
6e51e0d0 CR |
17978 | Ft(G)432 b Fu(Apply)30 b(the)g(follo)m(wing)i(`)p Ft(s)p |
17979 | Fu(')f(mo)s(di\014er)e(once)i(to)g(eac)m(h)h(w)m(ord)e(in)g(the)g(ev)m | |
17980 | (en)m(t.)p eop end | |
900a813b | 17981 | %%Page: 141 147 |
037a8b7f CR |
17982 | TeXDict begin 141 146 bop 3614 -116 a Fu(141)150 299 |
17983 | y Fp(10)80 b(Installing)52 b(Bash)150 554 y Fu(This)31 | |
17984 | b(c)m(hapter)h(pro)m(vides)g(basic)g(instructions)f(for)g(installing)i | |
17985 | (Bash)f(on)f(the)h(v)-5 b(arious)31 b(supp)s(orted)f(plat-)150 | |
17986 | 664 y(forms.)40 b(The)28 b(distribution)h(supp)s(orts)e(the)j | |
17987 | Fm(gnu)f Fu(op)s(erating)h(systems,)f(nearly)h(ev)m(ery)g(v)m(ersion)f | |
17988 | (of)h(Unix,)150 773 y(and)d(sev)m(eral)j(non-Unix)d(systems)h(suc)m(h)g | |
17989 | (as)g(BeOS)g(and)f(In)m(terix.)40 b(Other)28 b(indep)s(enden)m(t)e(p)s | |
17990 | (orts)h(exist)i(for)150 883 y Fm(ms-dos)p Fu(,)h Fm(os/2)p | |
967625cd CR |
17991 | Fu(,)g(and)g(Windo)m(ws)g(platforms.)150 1134 y Fs(10.1)68 |
17992 | b(Basic)45 b(Installation)150 1294 y Fu(These)30 b(are)h(installation)h | |
17993 | (instructions)e(for)h(Bash.)275 1435 y(The)e(simplest)i(w)m(a)m(y)g(to) | |
17994 | g(compile)h(Bash)e(is:)199 1577 y(1.)61 b Ft(cd)38 b | |
6e51e0d0 CR |
17995 | Fu(to)h(the)f(directory)h(con)m(taining)h(the)f(source)f(co)s(de)h(and) |
17996 | f(t)m(yp)s(e)g(`)p Ft(./configure)p Fu(')e(to)j(con\014gure)330 | |
967625cd | 17997 | 1686 y(Bash)c(for)f(y)m(our)h(system.)54 b(If)34 b(y)m(ou're)h(using)f |
6e51e0d0 | 17998 | Ft(csh)g Fu(on)g(an)h(old)g(v)m(ersion)g(of)g(System)f(V,)h(y)m(ou)g |
967625cd | 17999 | (migh)m(t)330 1796 y(need)21 b(to)g(t)m(yp)s(e)g(`)p |
6e51e0d0 CR |
18000 | Ft(sh)30 b(./configure)p Fu(')18 b(instead)j(to)g(prev)m(en)m(t)h |
18001 | Ft(csh)e Fu(from)g(trying)h(to)g(execute)h Ft(configure)330 | |
967625cd | 18002 | 1906 y Fu(itself.)330 2044 y(Running)30 b Ft(configure)f |
6e51e0d0 | 18003 | Fu(tak)m(es)k(some)e(time.)45 b(While)32 b(running,)e(it)i(prin)m(ts)f |
967625cd CR |
18004 | (messages)h(telling)h(whic)m(h)330 2153 y(features)e(it)g(is)f(c)m(hec) |
18005 | m(king)i(for.)199 2291 y(2.)61 b(T)m(yp)s(e)30 b(`)p | |
6e51e0d0 | 18006 | Ft(make)p Fu(')g(to)h(compile)g(Bash)g(and)e(build)h(the)g |
967625cd | 18007 | Ft(bashbug)f Fu(bug)g(rep)s(orting)h(script.)199 2429 |
6e51e0d0 | 18008 | y(3.)61 b(Optionally)-8 b(,)32 b(t)m(yp)s(e)e(`)p Ft(make)g(tests)p |
967625cd | 18009 | Fu(')f(to)i(run)e(the)h(Bash)h(test)g(suite.)199 2567 |
6e51e0d0 CR |
18010 | y(4.)61 b(T)m(yp)s(e)36 b(`)p Ft(make)29 b(install)p |
18011 | Fu(')35 b(to)i(install)h Ft(bash)d Fu(and)h Ft(bashbug)p | |
18012 | Fu(.)57 b(This)35 b(will)i(also)h(install)f(the)g(man)m(ual)330 | |
967625cd | 18013 | 2677 y(pages)31 b(and)f(Info)g(\014le.)275 2847 y(The)20 |
6e51e0d0 | 18014 | b Ft(configure)f Fu(shell)i(script)g(attempts)h(to)g(guess)f(correct)i |
37c41ab1 | 18015 | (v)-5 b(alues)21 b(for)g(v)-5 b(arious)21 b(system-dep)s(enden)m(t)150 |
967625cd | 18016 | 2956 y(v)-5 b(ariables)31 b(used)e(during)g(compilation.)42 |
6e51e0d0 | 18017 | b(It)31 b(uses)e(those)i(v)-5 b(alues)30 b(to)h(create)h(a)e |
967625cd | 18018 | Ft(Makefile)e Fu(in)i(eac)m(h)i(direc-)150 3066 y(tory)k(of)g(the)g |
6e51e0d0 CR |
18019 | (pac)m(k)-5 b(age)38 b(\(the)e(top)g(directory)-8 b(,)38 |
18020 | b(the)e Ft(builtins)p Fu(,)f Ft(doc)p Fu(,)i(and)e Ft(support)e | |
967625cd | 18021 | Fu(directories,)39 b(eac)m(h)150 3176 y(directory)29 |
6e51e0d0 CR |
18022 | b(under)d Ft(lib)p Fu(,)j(and)e(sev)m(eral)j(others\).)40 |
18023 | b(It)29 b(also)g(creates)h(a)e Ft(config.h)e Fu(\014le)j(con)m(taining) | |
967625cd | 18024 | g(system-)150 3285 y(dep)s(enden)m(t)e(de\014nitions.)40 |
6e51e0d0 | 18025 | b(Finally)-8 b(,)31 b(it)d(creates)i(a)f(shell)g(script)f(named)g |
967625cd | 18026 | Ft(config.status)d Fu(that)k(y)m(ou)g(can)150 3395 y(run)h(in)h(the)h |
6e51e0d0 CR |
18027 | (future)f(to)h(recreate)h(the)f(curren)m(t)f(con\014guration,)i(a)f |
18028 | (\014le)f Ft(config.cache)e Fu(that)j(sa)m(v)m(es)h(the)150 | |
967625cd | 18029 | 3504 y(results)39 b(of)g(its)h(tests)g(to)g(sp)s(eed)e(up)g |
6e51e0d0 | 18030 | (recon\014guring,)j(and)e(a)g(\014le)g Ft(config.log)e |
967625cd | 18031 | Fu(con)m(taining)j(compiler)150 3614 y(output)30 b(\(useful)h(mainly)g |
6e51e0d0 | 18032 | (for)f(debugging)h Ft(configure)p Fu(\).)40 b(If)30 b(at)h(some)h(p)s |
967625cd | 18033 | (oin)m(t)e Ft(config.cache)e Fu(con)m(tains)150 3724 |
6e51e0d0 | 18034 | y(results)i(y)m(ou)h(don't)f(w)m(an)m(t)h(to)h(k)m(eep,)f(y)m(ou)g(ma)m |
967625cd | 18035 | (y)g(remo)m(v)m(e)g(or)g(edit)g(it.)275 3865 y(T)-8 b(o)37 |
6e51e0d0 | 18036 | b(\014nd)f(out)i(more)f(ab)s(out)h(the)f(options)h(and)f(argumen)m(ts)g |
967625cd CR |
18037 | (that)h(the)g Ft(configure)d Fu(script)i(under-)150 3975 |
18038 | y(stands,)30 b(t)m(yp)s(e)390 4116 y Ft(bash-2.04$)45 | |
18039 | b(./configure)g(--help)150 4258 y Fu(at)31 b(the)g(Bash)f(prompt)g(in)g | |
18040 | (y)m(our)g(Bash)h(source)f(directory)-8 b(.)275 4399 | |
37c41ab1 CR |
18041 | y(If)53 b(y)m(ou)h(need)f(to)i(do)e(un)m(usual)g(things)g(to)i(compile) |
18042 | g(Bash,)k(please)c(try)e(to)i(\014gure)e(out)h(ho)m(w)150 | |
967625cd | 18043 | 4509 y Ft(configure)47 b Fu(could)j(c)m(hec)m(k)h(whether)e(or)g(not)h |
37c41ab1 | 18044 | (to)h(do)e(them,)55 b(and)49 b(mail)h(di\013s)f(or)h(instructions)f(to) |
967625cd | 18045 | 150 4619 y Ft(bash-maintainers@gnu.org)24 b Fu(so)30 |
37c41ab1 | 18046 | b(they)h(can)g(b)s(e)e(considered)i(for)f(the)g(next)h(release.)275 |
6e51e0d0 CR |
18047 | 4760 y(The)e(\014le)g Ft(configure.ac)d Fu(is)k(used)e(to)j(create)g |
18048 | Ft(configure)c Fu(b)m(y)i(a)h(program)f(called)i(Auto)s(conf.)40 | |
967625cd | 18049 | b(Y)-8 b(ou)150 4870 y(only)34 b(need)g Ft(configure.ac)d |
6e51e0d0 CR |
18050 | Fu(if)i(y)m(ou)i(w)m(an)m(t)g(to)f(c)m(hange)i(it)e(or)g(regenerate)i |
18051 | Ft(configure)31 b Fu(using)j(a)g(new)m(er)150 4979 y(v)m(ersion)25 | |
18052 | b(of)f(Auto)s(conf.)39 b(If)24 b(y)m(ou)h(do)f(this,)i(mak)m(e)f(sure)f | |
18053 | (y)m(ou)h(are)f(using)g(Auto)s(conf)h(v)m(ersion)f(2.50)i(or)f(new)m | |
18054 | (er.)275 5121 y(Y)-8 b(ou)29 b(can)f(remo)m(v)m(e)i(the)f(program)g | |
18055 | (binaries)f(and)g(ob)5 b(ject)29 b(\014les)g(from)f(the)h(source)f(co)s | |
18056 | (de)h(directory)g(b)m(y)150 5230 y(t)m(yping)j(`)p Ft(make)d(clean)p | |
18057 | Fu('.)42 b(T)-8 b(o)32 b(also)g(remo)m(v)m(e)g(the)g(\014les)f(that)g | |
18058 | Ft(configure)e Fu(created)j(\(so)g(y)m(ou)g(can)f(compile)150 | |
37c41ab1 | 18059 | 5340 y(Bash)g(for)f(a)g(di\013eren)m(t)h(kind)f(of)g(computer\),)h(t)m |
6e51e0d0 | 18060 | (yp)s(e)g(`)p Ft(make)e(distclean)p Fu('.)p eop end |
900a813b CR |
18061 | %%Page: 142 148 |
18062 | TeXDict begin 142 147 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
18063 | b(Installing)31 b(Bash)2356 b(142)150 299 y Fs(10.2)68 | |
6e51e0d0 | 18064 | b(Compilers)46 b(and)f(Options)150 458 y Fu(Some)28 b(systems)h |
ad4aef08 | 18065 | (require)f(un)m(usual)f(options)i(for)f(compilation)i(or)f(linking)f |
6e51e0d0 | 18066 | (that)h(the)g Ft(configure)d Fu(script)150 568 y(do)s(es)32 |
ad4aef08 | 18067 | b(not)g(kno)m(w)g(ab)s(out.)44 b(Y)-8 b(ou)33 b(can)f(giv)m(e)h |
6e51e0d0 | 18068 | Ft(configure)d Fu(initial)j(v)-5 b(alues)32 b(for)g(v)-5 |
ad4aef08 CR |
18069 | b(ariables)32 b(b)m(y)g(setting)h(them)150 677 y(in)k(the)g(en)m |
18070 | (vironmen)m(t.)62 b(Using)38 b(a)f(Bourne-compatible)i(shell,)g(y)m(ou) | |
18071 | f(can)g(do)f(that)h(on)f(the)g(command)150 787 y(line)31 | |
967625cd CR |
18072 | b(lik)m(e)g(this:)390 926 y Ft(CC=c89)46 b(CFLAGS=-O2)f(LIBS=-lposix)g |
18073 | (./configure)275 1065 y Fu(On)29 b(systems)h(that)h(ha)m(v)m(e)h(the)f | |
6e51e0d0 | 18074 | Ft(env)e Fu(program,)h(y)m(ou)h(can)g(do)f(it)h(lik)m(e)h(this:)390 |
967625cd CR |
18075 | 1204 y Ft(env)47 b(CPPFLAGS=-I/usr/local/in)o(clud)o(e)42 |
18076 | b(LDFLAGS=-s)j(./configure)275 1343 y Fu(The)29 b(con\014guration)i | |
37c41ab1 | 18077 | (pro)s(cess)f(uses)g(GCC)g(to)h(build)e(Bash)i(if)f(it)h(is)g(a)m(v)-5 |
967625cd CR |
18078 | b(ailable.)150 1590 y Fs(10.3)68 b(Compiling)46 b(F)-11 |
18079 | b(or)45 b(Multiple)g(Arc)l(hitectures)150 1750 y Fu(Y)-8 | |
c302751c CR |
18080 | b(ou)27 b(can)g(compile)g(Bash)g(for)f(more)h(than)f(one)h(kind)f(of)g |
18081 | (computer)h(at)g(the)g(same)g(time,)h(b)m(y)e(placing)i(the)150 | |
967625cd | 18082 | 1859 y(ob)5 b(ject)31 b(\014les)f(for)g(eac)m(h)i(arc)m(hitecture)f(in) |
c302751c CR |
18083 | f(their)g(o)m(wn)h(directory)-8 b(.)41 b(T)-8 b(o)31 |
18084 | b(do)f(this,)g(y)m(ou)h(m)m(ust)f(use)g(a)g(v)m(ersion)150 | |
967625cd | 18085 | 1969 y(of)25 b Ft(make)f Fu(that)h(supp)s(orts)f(the)h |
6e51e0d0 CR |
18086 | Ft(VPATH)e Fu(v)-5 b(ariable,)27 b(suc)m(h)e(as)g(GNU)h |
18087 | Ft(make)p Fu(.)37 b Ft(cd)25 b Fu(to)h(the)f(directory)g(where)g(y)m | |
967625cd | 18088 | (ou)150 2078 y(w)m(an)m(t)34 b(the)f(ob)5 b(ject)34 b(\014les)f(and)f |
6e51e0d0 | 18089 | (executables)i(to)g(go)g(and)e(run)g(the)h Ft(configure)d |
967625cd | 18090 | Fu(script)j(from)g(the)g(source)150 2188 y(directory)-8 |
6e51e0d0 CR |
18091 | b(.)44 b(Y)-8 b(ou)32 b(ma)m(y)g(need)f(to)h(supply)e(the)i |
18092 | Ft(--srcdir=PATH)27 b Fu(argumen)m(t)32 b(to)g(tell)h | |
967625cd | 18093 | Ft(configure)28 b Fu(where)150 2297 y(the)36 b(source)g(\014les)f(are.) |
6e51e0d0 | 18094 | 57 b Ft(configure)33 b Fu(automatically)39 b(c)m(hec)m(ks)e(for)e(the)h |
967625cd CR |
18095 | (source)g(co)s(de)f(in)h(the)f(directory)150 2407 y(that)c |
18096 | Ft(configure)d Fu(is)i(in)g(and)g(in)g(`..'.)275 2546 | |
6e51e0d0 CR |
18097 | y(If)20 b(y)m(ou)h(ha)m(v)m(e)i(to)e(use)g(a)g Ft(make)f |
18098 | Fu(that)i(do)s(es)e(not)i(supp)s(orts)d(the)i Ft(VPATH)e | |
18099 | Fu(v)-5 b(ariable,)24 b(y)m(ou)e(can)f(compile)h(Bash)150 | |
967625cd | 18100 | 2656 y(for)33 b(one)h(arc)m(hitecture)h(at)f(a)g(time)g(in)f(the)h |
37c41ab1 | 18101 | (source)g(co)s(de)f(directory)-8 b(.)51 b(After)34 b(y)m(ou)g(ha)m(v)m |
967625cd | 18102 | (e)h(installed)f(Bash)150 2765 y(for)c(one)h(arc)m(hitecture,)h(use)e |
6e51e0d0 | 18103 | (`)p Ft(make)g(distclean)p Fu(')e(b)s(efore)i(recon\014guring)g(for)g |
967625cd | 18104 | (another)g(arc)m(hitecture.)275 2904 y(Alternativ)m(ely)-8 |
6e51e0d0 | 18105 | b(,)30 b(if)c(y)m(our)g(system)h(supp)s(orts)d(sym)m(b)s(olic)j(links,) |
967625cd | 18106 | g(y)m(ou)g(can)g(use)f(the)g Ft(support/mkclone)150 3014 |
6e51e0d0 CR |
18107 | y Fu(script)d(to)h(create)g(a)f(build)f(tree)i(whic)m(h)f(has)f(sym)m |
18108 | (b)s(olic)i(links)e(bac)m(k)i(to)g(eac)m(h)g(\014le)f(in)g(the)g | |
967625cd | 18109 | (source)g(directory)-8 b(.)150 3123 y(Here's)41 b(an)f(example)i(that)f |
6e51e0d0 | 18110 | (creates)h(a)e(build)g(directory)h(in)f(the)h(curren)m(t)f(directory)h |
967625cd CR |
18111 | (from)f(a)h(source)150 3233 y(directory)31 b Ft(/usr/gnu/src/bash-2.0)p |
18112 | Fu(:)390 3372 y Ft(bash)47 b(/usr/gnu/src/bash-2.0/s)o(uppo)o(rt/)o | |
6e51e0d0 | 18113 | (mkcl)o(one)41 b(-s)47 b(/usr/gnu/src/bash-2.0)42 b(.)150 |
967625cd | 18114 | 3511 y Fu(The)c Ft(mkclone)e Fu(script)i(requires)g(Bash,)i(so)f(y)m |
6e51e0d0 | 18115 | (ou)f(m)m(ust)h(ha)m(v)m(e)g(already)g(built)f(Bash)g(for)g(at)h(least) |
967625cd | 18116 | h(one)150 3620 y(arc)m(hitecture)32 b(b)s(efore)e(y)m(ou)h(can)f |
6e51e0d0 | 18117 | (create)i(build)e(directories)h(for)f(other)h(arc)m(hitectures.)150 |
967625cd | 18118 | 3868 y Fs(10.4)68 b(Installation)47 b(Names)150 4027 |
6e51e0d0 CR |
18119 | y Fu(By)37 b(default,)i(`)p Ft(make)29 b(install)p Fu(')35 |
18120 | b(will)j(install)f(in)m(to)h Ft(/usr/local/bin)p Fu(,)d | |
967625cd | 18121 | Ft(/usr/local/man)p Fu(,)f(etc.)61 b(Y)-8 b(ou)150 4137 |
6e51e0d0 CR |
18122 | y(can)35 b(sp)s(ecify)f(an)h(installation)i(pre\014x)c(other)j(than)e |
18123 | Ft(/usr/local)e Fu(b)m(y)j(giving)g Ft(configure)e Fu(the)h(option)150 | |
967625cd | 18124 | 4246 y Ft(--prefix=)p Fj(PATH)p Fu(,)41 b(or)g(b)m(y)g(sp)s(ecifying)h |
6e51e0d0 CR |
18125 | (a)f(v)-5 b(alue)42 b(for)f(the)h Ft(DESTDIR)d Fu(`)p |
18126 | Ft(make)p Fu(')i(v)-5 b(ariable)42 b(when)f(running)150 | |
967625cd | 18127 | 4356 y(`)p Ft(make)29 b(install)p Fu('.)275 4495 y(Y)-8 |
c302751c CR |
18128 | b(ou)71 b(can)h(sp)s(ecify)f(separate)h(installation)h(pre\014xes)d |
18129 | (for)h(arc)m(hitecture-sp)s(eci\014c)i(\014les)f(and)150 | |
967625cd | 18130 | 4604 y(arc)m(hitecture-indep)s(enden)m(t)44 b(\014les.)80 |
6e51e0d0 | 18131 | b(If)43 b(y)m(ou)h(giv)m(e)h Ft(configure)c Fu(the)j(option)g |
967625cd | 18132 | Ft(--exec-prefix=)p Fj(PATH)p Fu(,)150 4714 y(`)p Ft(make)29 |
6e51e0d0 CR |
18133 | b(install)p Fu(')63 b(will)h(use)f Fr(P)-8 b(A)g(TH)75 |
18134 | b Fu(as)64 b(the)g(pre\014x)e(for)i(installing)h(programs)e(and)h | |
967625cd | 18135 | (libraries.)150 4824 y(Do)s(cumen)m(tation)32 b(and)e(other)h(data)g |
6e51e0d0 | 18136 | (\014les)f(will)h(still)g(use)f(the)h(regular)f(pre\014x.)150 |
967625cd CR |
18137 | 5071 y Fs(10.5)68 b(Sp)t(ecifying)45 b(the)g(System)h(T)l(yp)t(e)150 |
18138 | 5230 y Fu(There)f(ma)m(y)g(b)s(e)f(some)i(features)f | |
6e51e0d0 | 18139 | Ft(configure)e Fu(can)i(not)g(\014gure)g(out)g(automatically)-8 |
967625cd | 18140 | b(,)52 b(but)44 b(need)h(to)150 5340 y(determine)26 b(b)m(y)g(the)g(t)m |
6e51e0d0 | 18141 | (yp)s(e)g(of)g(host)g(Bash)g(will)g(run)f(on.)39 b(Usually)26 |
967625cd CR |
18142 | b Ft(configure)d Fu(can)k(\014gure)e(that)h(out,)i(but)p |
18143 | eop end | |
900a813b CR |
18144 | %%Page: 143 149 |
18145 | TeXDict begin 143 148 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
967625cd CR |
18146 | b(Installing)31 b(Bash)2356 b(143)150 299 y(if)28 b(it)g(prin)m(ts)f(a) |
18147 | h(message)g(sa)m(ying)h(it)f(can)g(not)f(guess)h(the)g(host)f(t)m(yp)s | |
18148 | (e,)i(giv)m(e)g(it)f(the)g Ft(--host=TYPE)c Fu(option.)150 | |
18149 | 408 y(`)p Ft(TYPE)p Fu(')29 b(can)h(either)g(b)s(e)g(a)g(short)f(name)h | |
18150 | (for)f(the)h(system)g(t)m(yp)s(e,)h(suc)m(h)e(as)h(`)p | |
18151 | Ft(sun4)p Fu(',)g(or)f(a)h(canonical)i(name)150 518 y(with)e(three)h | |
18152 | (\014elds:)40 b(`)p Ft(CPU-COMPANY-SYSTEM)p Fu(')26 b(\(e.g.,)32 | |
18153 | b(`)p Ft(i386-unknown-freebsd4.2)p Fu('\).)275 663 y(See)e(the)h | |
18154 | (\014le)f Ft(support/config.sub)c Fu(for)k(the)g(p)s(ossible)g(v)-5 | |
18155 | b(alues)31 b(of)f(eac)m(h)i(\014eld.)150 919 y Fs(10.6)68 | |
18156 | b(Sharing)45 b(Defaults)150 1078 y Fu(If)d(y)m(ou)i(w)m(an)m(t)g(to)f | |
6e51e0d0 CR |
18157 | (set)h(default)f(v)-5 b(alues)43 b(for)g Ft(configure)d |
18158 | Fu(scripts)j(to)h(share,)i(y)m(ou)d(can)g(create)i(a)e(site)150 | |
967625cd | 18159 | 1188 y(shell)48 b(script)f(called)i Ft(config.site)44 |
6e51e0d0 CR |
18160 | b Fu(that)k(giv)m(es)h(default)f(v)-5 b(alues)48 b(for)f(v)-5 |
18161 | b(ariables)48 b(lik)m(e)h Ft(CC)p Fu(,)j Ft(cache_)150 | |
967625cd | 18162 | 1298 y(file)p Fu(,)c(and)d Ft(prefix)p Fu(.)85 b Ft(configure)43 |
6e51e0d0 | 18163 | b Fu(lo)s(oks)j(for)f Ft(PREFIX/share/config.site)39 |
967625cd | 18164 | b Fu(if)46 b(it)g(exists,)k(then)150 1407 y Ft(PREFIX/etc/config.site) |
6e51e0d0 CR |
18165 | 24 b Fu(if)31 b(it)g(exists.)42 b(Or,)30 b(y)m(ou)h(can)g(set)g(the)g |
18166 | Ft(CONFIG_SITE)c Fu(en)m(vironmen)m(t)k(v)-5 b(ari-)150 | |
967625cd | 18167 | 1517 y(able)40 b(to)g(the)g(lo)s(cation)h(of)e(the)h(site)g(script.)67 |
6e51e0d0 | 18168 | b(A)40 b(w)m(arning:)58 b(the)40 b(Bash)g Ft(configure)c |
967625cd CR |
18169 | Fu(lo)s(oks)k(for)f(a)h(site)150 1626 y(script,)31 b(but)e(not)i(all)g |
18170 | Ft(configure)d Fu(scripts)i(do.)150 1883 y Fs(10.7)68 | |
18171 | b(Op)t(eration)46 b(Con)l(trols)150 2042 y Ft(configure)28 | |
6e51e0d0 | 18172 | b Fu(recognizes)k(the)e(follo)m(wing)i(options)f(to)g(con)m(trol)h(ho)m |
967625cd CR |
18173 | (w)e(it)h(op)s(erates.)150 2217 y Ft(--cache-file=)p |
18174 | Fj(file)630 2326 y Fu(Use)d(and)g(sa)m(v)m(e)h(the)f(results)g(of)g | |
6e51e0d0 CR |
18175 | (the)h(tests)f(in)g Fr(\014le)33 b Fu(instead)28 b(of)h |
18176 | Ft(./config.cache)p Fu(.)36 b(Set)28 b Fr(\014le)630 | |
967625cd CR |
18177 | 2436 y Fu(to)j Ft(/dev/null)d Fu(to)j(disable)g(cac)m(hing,)h(for)e |
18178 | (debugging)g Ft(configure)p Fu(.)150 2606 y Ft(--help)192 | |
6e51e0d0 | 18179 | b Fu(Prin)m(t)30 b(a)h(summary)e(of)i(the)f(options)h(to)g |
967625cd CR |
18180 | Ft(configure)p Fu(,)d(and)i(exit.)150 2775 y Ft(--quiet)150 |
18181 | 2885 y(--silent)150 2995 y(-q)384 b Fu(Do)31 b(not)g(prin)m(t)f | |
37c41ab1 | 18182 | (messages)h(sa)m(ying)g(whic)m(h)g(c)m(hec)m(ks)g(are)g(b)s(eing)f |
967625cd | 18183 | (made.)150 3164 y Ft(--srcdir=)p Fj(dir)630 3274 y Fu(Lo)s(ok)i(for)g |
6e51e0d0 CR |
18184 | (the)g(Bash)g(source)h(co)s(de)f(in)g(directory)g Fr(dir)p |
18185 | Fu(.)45 b(Usually)33 b Ft(configure)c Fu(can)j(deter-)630 | |
967625cd CR |
18186 | 3383 y(mine)e(that)h(directory)g(automatically)-8 b(.)150 |
18187 | 3553 y Ft(--version)630 3663 y Fu(Prin)m(t)29 b(the)h(v)m(ersion)g(of)g | |
6e51e0d0 | 18188 | (Auto)s(conf)f(used)g(to)h(generate)h(the)f Ft(configure)d |
967625cd | 18189 | Fu(script,)j(and)f(exit.)275 3838 y Ft(configure)34 b |
6e51e0d0 | 18190 | Fu(also)k(accepts)g(some)g(other,)h(not)e(widely)g(used,)h(b)s |
967625cd | 18191 | (oilerplate)g(options.)61 b(`)p Ft(configure)150 3947 |
6e51e0d0 | 18192 | y(--help)p Fu(')29 b(prin)m(ts)h(the)g(complete)i(list.)150 |
967625cd CR |
18193 | 4203 y Fs(10.8)68 b(Optional)46 b(F)-11 b(eatures)150 |
18194 | 4363 y Fu(The)29 b(Bash)h Ft(configure)d Fu(has)j(a)g(n)m(um)m(b)s(er)f | |
6e51e0d0 | 18195 | (of)h Ft(--enable-)p Fj(feature)25 b Fu(options,)30 b(where)g |
967625cd | 18196 | Fr(feature)35 b Fu(indicates)150 4472 y(an)e(optional)i(part)e(of)h |
6e51e0d0 CR |
18197 | (Bash.)50 b(There)33 b(are)g(also)i(sev)m(eral)g Ft(--with-)p |
18198 | Fj(package)29 b Fu(options,)35 b(where)e Fr(pac)m(k)-5 | |
967625cd | 18199 | b(age)150 4582 y Fu(is)32 b(something)h(lik)m(e)h(`)p |
6e51e0d0 | 18200 | Ft(bash-malloc)p Fu(')c(or)i(`)p Ft(purify)p Fu('.)45 |
c302751c | 18201 | b(T)-8 b(o)33 b(turn)e(o\013)i(the)f(default)h(use)f(of)g(a)h(pac)m(k) |
967625cd | 18202 | -5 b(age,)35 b(use)150 4692 y Ft(--without-)p Fj(package)p |
6e51e0d0 | 18203 | Fu(.)46 b(T)-8 b(o)34 b(con\014gure)g(Bash)g(without)f(a)i(feature)f |
967625cd CR |
18204 | (that)g(is)g(enabled)g(b)m(y)f(default,)i(use)150 4801 |
18205 | y Ft(--disable-)p Fj(feature)p Fu(.)275 4946 y(Here)28 | |
6e51e0d0 CR |
18206 | b(is)g(a)h(complete)g(list)g(of)f(the)h Ft(--enable-)c |
18207 | Fu(and)j Ft(--with-)e Fu(options)i(that)h(the)f(Bash)g | |
967625cd CR |
18208 | Ft(configure)150 5056 y Fu(recognizes.)150 5230 y Ft(--with-afs)630 |
18209 | 5340 y Fu(De\014ne)j(if)f(y)m(ou)h(are)f(using)g(the)h(Andrew)e(File)j | |
18210 | (System)e(from)g(T)-8 b(ransarc.)p eop end | |
900a813b CR |
18211 | %%Page: 144 150 |
18212 | TeXDict begin 144 149 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
967625cd CR |
18213 | b(Installing)31 b(Bash)2356 b(144)150 299 y Ft(--with-bash-malloc)630 |
18214 | 408 y Fu(Use)34 b(the)g(Bash)h(v)m(ersion)f(of)g Ft(malloc)e | |
18215 | Fu(in)i(the)g(directory)h Ft(lib/malloc)p Fu(.)48 b(This)34 | |
18216 | b(is)g(not)g(the)630 518 y(same)e Ft(malloc)e Fu(that)j(app)s(ears)e | |
18217 | (in)g Fm(gnu)h Fu(lib)s(c,)g(but)f(an)h(older)f(v)m(ersion)i | |
18218 | (originally)g(deriv)m(ed)630 628 y(from)f(the)h(4.2)g | |
6e51e0d0 CR |
18219 | Fm(bsd)f Ft(malloc)p Fu(.)45 b(This)31 b Ft(malloc)g |
18220 | Fu(is)i(v)m(ery)f(fast,)i(but)e(w)m(astes)h(some)g(space)g(on)630 | |
967625cd | 18221 | 737 y(eac)m(h)j(allo)s(cation.)58 b(This)34 b(option)i(is)f(enabled)g |
6e51e0d0 | 18222 | (b)m(y)g(default.)56 b(The)34 b Ft(NOTES)g Fu(\014le)h(con)m(tains)i(a) |
967625cd | 18223 | 630 847 y(list)29 b(of)f(systems)f(for)h(whic)m(h)g(this)g(should)e(b)s |
6e51e0d0 | 18224 | (e)i(turned)e(o\013,)j(and)f Ft(configure)d Fu(disables)j(this)630 |
967625cd CR |
18225 | 956 y(option)j(automatically)i(for)d(a)h(n)m(um)m(b)s(er)e(of)i |
18226 | (systems.)150 1120 y Ft(--with-curses)630 1230 y Fu(Use)h(the)h(curses) | |
18227 | e(library)h(instead)g(of)h(the)f(termcap)g(library)-8 | |
18228 | b(.)46 b(This)32 b(should)f(b)s(e)g(supplied)630 1339 | |
6e51e0d0 | 18229 | y(if)f(y)m(our)h(system)f(has)g(an)h(inadequate)g(or)f(incomplete)i |
967625cd CR |
18230 | (termcap)e(database.)150 1503 y Ft(--with-gnu-malloc)630 |
18231 | 1613 y Fu(A)g(synon)m(ym)g(for)g Ft(--with-bash-malloc)p | |
18232 | Fu(.)150 1776 y Ft(--with-installed-readlin)o(e[=)p Fj(P)o(REFI)o(X)p | |
18233 | Ft(])630 1886 y Fu(De\014ne)c(this)f(to)h(mak)m(e)h(Bash)f(link)f(with) | |
6e51e0d0 | 18234 | g(a)h(lo)s(cally-installed)i(v)m(ersion)e(of)g(Readline)g(rather)630 |
967625cd | 18235 | 1996 y(than)f(the)h(v)m(ersion)g(in)f Ft(lib/readline)p |
6e51e0d0 | 18236 | Fu(.)36 b(This)25 b(w)m(orks)g(only)h(with)f(Readline)h(5.0)h(and)e |
967625cd | 18237 | (later)630 2105 y(v)m(ersions.)46 b(If)32 b Fr(PREFIX)41 |
6e51e0d0 | 18238 | b Fu(is)32 b Ft(yes)f Fu(or)i(not)f(supplied,)f Ft(configure)f |
967625cd | 18239 | Fu(uses)i(the)g(v)-5 b(alues)32 b(of)h(the)630 2215 y(mak)m(e)28 |
6e51e0d0 CR |
18240 | b(v)-5 b(ariables)29 b Ft(includedir)24 b Fu(and)j Ft(libdir)p |
18241 | Fu(,)g(whic)m(h)g(are)h(sub)s(directories)f(of)g Ft(prefix)f | |
967625cd | 18242 | Fu(b)m(y)630 2324 y(default,)44 b(to)d(\014nd)f(the)h(installed)g(v)m |
6e51e0d0 | 18243 | (ersion)h(of)f(Readline)g(if)g(it)g(is)g(not)g(in)g(the)g(standard)630 |
967625cd | 18244 | 2434 y(system)35 b(include)f(and)g(library)g(directories.)54 |
6e51e0d0 | 18245 | b(If)34 b Fr(PREFIX)43 b Fu(is)35 b Ft(no)p Fu(,)g(Bash)f(links)h(with) |
967625cd | 18246 | f(the)630 2544 y(v)m(ersion)42 b(in)e Ft(lib/readline)p |
6e51e0d0 | 18247 | Fu(.)70 b(If)40 b Fr(PREFIX)51 b Fu(is)41 b(set)g(to)h(an)m(y)g(other)f |
967625cd | 18248 | (v)-5 b(alue,)44 b Ft(configure)630 2653 y Fu(treats)27 |
37c41ab1 | 18249 | b(it)g(as)f(a)h(directory)g(pathname)f(and)f(lo)s(oks)i(for)f(the)g |
967625cd | 18250 | (installed)h(v)m(ersion)g(of)f(Readline)630 2763 y(in)34 |
37c41ab1 | 18251 | b(sub)s(directories)f(of)h(that)h(directory)g(\(include)f(\014les)g(in) |
6e51e0d0 | 18252 | g Fr(PREFIX)9 b Fu(/)p Ft(include)32 b Fu(and)i(the)630 |
967625cd CR |
18253 | 2872 y(library)c(in)g Fr(PREFIX)9 b Fu(/)p Ft(lib)p Fu(\).)150 |
18254 | 3036 y Ft(--with-purify)630 3146 y Fu(De\014ne)23 b(this)g(to)h(use)f | |
37c41ab1 | 18255 | (the)g(Purify)f(memory)h(allo)s(cation)i(c)m(hec)m(k)m(er)g(from)e |
967625cd CR |
18256 | (Rational)i(Soft)m(w)m(are.)150 3309 y Ft(--enable-minimal-config)630 |
18257 | 3419 y Fu(This)e(pro)s(duces)f(a)i(shell)g(with)f(minimal)h(features,)h | |
37c41ab1 | 18258 | (close)g(to)f(the)g(historical)h(Bourne)e(shell.)275 |
967625cd | 18259 | 3585 y(There)k(are)i(sev)m(eral)g Ft(--enable-)d Fu(options)i(that)h |
6e51e0d0 | 18260 | (alter)g(ho)m(w)f(Bash)g(is)g(compiled)h(and)e(link)m(ed,)i(rather)150 |
967625cd CR |
18261 | 3694 y(than)h(c)m(hanging)h(run-time)f(features.)150 |
18262 | 3860 y Ft(--enable-largefile)630 3970 y Fu(Enable)e(supp)s(ort)f(for)h | |
6e51e0d0 | 18263 | (large)i(\014les)f(\()p Ft(http://www.sas.com/stand)o(ards)o(/la)o |
967625cd CR |
18264 | (rge_)o(file)o(/)630 4079 y(x_open)5 b(.)g(20Mar96)g(.)g(html)p |
18265 | Fu(\))31 b(if)36 b(the)g(op)s(erating)h(system)f(requires)g(sp)s(ecial) | |
18266 | h(compiler)g(op-)630 4189 y(tions)27 b(to)h(build)e(programs)h(whic)m | |
6e51e0d0 | 18267 | (h)g(can)g(access)h(large)h(\014les.)39 b(This)26 b(is)i(enabled)f(b)m |
967625cd CR |
18268 | (y)f(default,)630 4299 y(if)k(the)h(op)s(erating)g(system)f(pro)m |
18269 | (vides)h(large)g(\014le)g(supp)s(ort.)150 4462 y Ft(--enable-profiling) | |
18270 | 630 4572 y Fu(This)g(builds)f(a)i(Bash)g(binary)f(that)h(pro)s(duces)e | |
37c41ab1 | 18271 | (pro\014ling)h(information)h(to)h(b)s(e)d(pro)s(cessed)630 |
967625cd CR |
18272 | 4682 y(b)m(y)g Ft(gprof)f Fu(eac)m(h)j(time)f(it)g(is)f(executed.)150 |
18273 | 4845 y Ft(--enable-static-link)630 4955 y Fu(This)37 | |
c302751c | 18274 | b(causes)h(Bash)f(to)h(b)s(e)f(link)m(ed)h(statically)-8 |
6e51e0d0 | 18275 | b(,)43 b(if)37 b Ft(gcc)g Fu(is)g(b)s(eing)g(used.)61 |
967625cd CR |
18276 | b(This)37 b(could)h(b)s(e)630 5064 y(used)30 b(to)h(build)e(a)i(v)m |
18277 | (ersion)g(to)g(use)f(as)g(ro)s(ot's)h(shell.)275 5230 | |
6e51e0d0 | 18278 | y(The)f(`)p Ft(minimal-config)p Fu(')d(option)k(can)g(b)s(e)f(used)f |
37c41ab1 | 18279 | (to)j(disable)e(all)i(of)f(the)f(follo)m(wing)i(options,)g(but)d(it)150 |
967625cd | 18280 | 5340 y(is)h(pro)s(cessed)g(\014rst,)g(so)h(individual)f(options)g(ma)m |
6e51e0d0 | 18281 | (y)h(b)s(e)f(enabled)g(using)g(`)p Ft(enable-)p Fj(feature)p |
967625cd | 18282 | Fu('.)p eop end |
900a813b CR |
18283 | %%Page: 145 151 |
18284 | TeXDict begin 145 150 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
967625cd CR |
18285 | b(Installing)31 b(Bash)2356 b(145)275 299 y(All)26 b(of)f(the)h(follo)m |
18286 | (wing)h(options)f(except)g(for)g(`)p Ft(disabled-builtins)p | |
18287 | Fu(',)c(`)p Ft(direxpand-default)p Fu(',)h(and)150 408 | |
18288 | y(`)p Ft(xpg-echo-default)p Fu(')28 b(are)33 b(enabled)f(b)m(y)g | |
18289 | (default,)h(unless)e(the)i(op)s(erating)f(system)h(do)s(es)e(not)i(pro) | |
18290 | m(vide)150 518 y(the)e(necessary)f(supp)s(ort.)150 698 | |
18291 | y Ft(--enable-alias)630 807 y Fu(Allo)m(w)41 b(alias)g(expansion)f(and) | |
18292 | f(include)g(the)h Ft(alias)f Fu(and)g Ft(unalias)e Fu(builtins)j(\(see) | |
18293 | g(Sec-)630 917 y(tion)31 b(6.6)g([Aliases],)i(page)e(89\).)150 | |
18294 | 1090 y Ft(--enable-arith-for-comma)o(nd)630 1200 y Fu(Include)21 | |
37c41ab1 | 18295 | b(supp)s(ort)g(for)g(the)i(alternate)g(form)f(of)g(the)g |
6e51e0d0 | 18296 | Ft(for)f Fu(command)h(that)h(b)s(eha)m(v)m(es)f(lik)m(e)i(the)630 |
967625cd | 18297 | 1309 y(C)30 b(language)i Ft(for)d Fu(statemen)m(t)j(\(see)g(Section)f |
220537f2 | 18298 | (3.2.4.1)i([Lo)s(oping)d(Constructs],)h(page)g(10\).)150 |
967625cd | 18299 | 1482 y Ft(--enable-array-variables)630 1592 y Fu(Include)h(supp)s(ort)g |
37c41ab1 | 18300 | (for)h(one-dimensional)h(arra)m(y)f(shell)h(v)-5 b(ariables)33 |
967625cd CR |
18301 | b(\(see)h(Section)g(6.7)h([Ar-)630 1701 y(ra)m(ys],)c(page)g(90\).)150 |
18302 | 1874 y Ft(--enable-bang-history)630 1984 y Fu(Include)36 | |
6e51e0d0 | 18303 | b(supp)s(ort)f(for)h Ft(csh)p Fu(-lik)m(e)h(history)g(substitution)f |
967625cd CR |
18304 | (\(see)h(Section)g(9.3)h([History)f(In-)630 2093 y(teraction],)c(page)e |
18305 | (138\).)150 2266 y Ft(--enable-brace-expansion)630 2376 | |
6e51e0d0 CR |
18306 | y Fu(Include)40 b Ft(csh)p Fu(-lik)m(e)h(brace)f(expansion)g(\()h |
18307 | Ft(b{a,b}c)d Fq(7!)i Ft(bac)30 b(bbc)39 b Fu(\).)71 b(See)40 | |
967625cd CR |
18308 | b(Section)h(3.5.1)630 2485 y([Brace)32 b(Expansion],)e(page)h(21,)h |
18309 | (for)e(a)g(complete)i(description.)150 2658 y Ft | |
18310 | (--enable-casemod-attribu)o(tes)630 2768 y Fu(Include)37 | |
09767ff0 | 18311 | b(supp)s(ort)g(for)g(case-mo)s(difying)i(attributes)g(in)e(the)h |
967625cd | 18312 | Ft(declare)e Fu(builtin)i(and)f(as-)630 2878 y(signmen)m(t)29 |
09767ff0 | 18313 | b(statemen)m(ts.)41 b(V)-8 b(ariables)30 b(with)e(the)g |
6e51e0d0 | 18314 | Fr(upp)s(ercase)k Fu(attribute,)e(for)e(example,)i(will)630 |
967625cd CR |
18315 | 2987 y(ha)m(v)m(e)i(their)e(v)-5 b(alues)31 b(con)m(v)m(erted)h(to)f |
18316 | (upp)s(ercase)e(up)s(on)g(assignmen)m(t.)150 3160 y Ft | |
18317 | (--enable-casemod-expansi)o(on)630 3270 y Fu(Include)h(supp)s(ort)e | |
09767ff0 | 18318 | (for)i(case-mo)s(difying)i(w)m(ord)e(expansions.)150 |
967625cd | 18319 | 3443 y Ft(--enable-command-timing)630 3552 y Fu(Include)43 |
6e51e0d0 | 18320 | b(supp)s(ort)f(for)h(recognizing)i Ft(time)e Fu(as)g(a)h(reserv)m(ed)g |
967625cd | 18321 | (w)m(ord)f(and)g(for)h(displa)m(ying)630 3662 y(timing)37 |
37c41ab1 | 18322 | b(statistics)h(for)e(the)g(pip)s(eline)g(follo)m(wing)i |
6e51e0d0 | 18323 | Ft(time)d Fu(\(see)i(Section)g(3.2.2)h([Pip)s(elines],)630 |
967625cd | 18324 | 3771 y(page)24 b(8\).)39 b(This)23 b(allo)m(ws)h(pip)s(elines)f(as)h(w) |
37c41ab1 | 18325 | m(ell)g(as)g(shell)f(builtins)g(and)g(functions)g(to)h(b)s(e)e(timed.) |
967625cd | 18326 | 150 3944 y Ft(--enable-cond-command)630 4054 y Fu(Include)33 |
6e51e0d0 | 18327 | b(supp)s(ort)f(for)i(the)g Ft([[)f Fu(conditional)i(command.)51 |
967625cd CR |
18328 | b(\(see)34 b(Section)h(3.2.4.2)h([Condi-)630 4164 y(tional)c |
18329 | (Constructs],)e(page)h(10\).)150 4337 y Ft(--enable-cond-regexp)630 | |
18330 | 4446 y Fu(Include)k(supp)s(ort)f(for)i(matc)m(hing)h | |
6e51e0d0 | 18331 | Fm(posix)e Fu(regular)h(expressions)g(using)f(the)h(`)p |
967625cd | 18332 | Ft(=~)p Fu(')g(binary)630 4556 y(op)s(erator)25 b(in)f(the)h |
6e51e0d0 | 18333 | Ft([[)f Fu(conditional)h(command.)39 b(\(see)25 b(Section)h(3.2.4.2)h |
967625cd CR |
18334 | ([Conditional)e(Con-)630 4665 y(structs],)31 b(page)g(10\).)150 |
18335 | 4838 y Ft(--enable-coprocesses)630 4948 y Fu(Include)23 | |
6e51e0d0 CR |
18336 | b(supp)s(ort)f(for)i(copro)s(cesses)g(and)f(the)h Ft(coproc)e |
18337 | Fu(reserv)m(ed)i(w)m(ord)g(\(see)h(Section)f(3.2.2)630 | |
967625cd CR |
18338 | 5057 y([Pip)s(elines],)31 b(page)g(8\).)150 5230 y Ft |
18339 | (--enable-debugger)630 5340 y Fu(Include)f(supp)s(ort)e(for)i(the)h | |
18340 | (bash)f(debugger)g(\(distributed)g(separately\).)p eop | |
18341 | end | |
900a813b CR |
18342 | %%Page: 146 152 |
18343 | TeXDict begin 146 151 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
18344 | b(Installing)31 b(Bash)2356 b(146)150 299 y Ft | |
967625cd CR |
18345 | (--enable-direxpand-defau)o(lt)630 408 y Fu(Cause)53 |
18346 | b(the)g Ft(direxpand)d Fu(shell)j(option)h(\(see)g(Section)f(4.3.2)i | |
18347 | ([The)e(Shopt)f(Builtin],)630 518 y(page)29 b(63\))g(to)f(b)s(e)f | |
18348 | (enabled)h(b)m(y)g(default)g(when)e(the)i(shell)g(starts.)41 | |
18349 | b(It)27 b(is)h(normally)g(disabled)630 628 y(b)m(y)i(default.)150 | |
18350 | 774 y Ft(--enable-directory-stack)630 883 y Fu(Include)j(supp)s(ort)g | |
18351 | (for)h(a)g Ft(csh)p Fu(-lik)m(e)h(directory)f(stac)m(k)i(and)d(the)i | |
6e51e0d0 | 18352 | Ft(pushd)p Fu(,)f Ft(popd)p Fu(,)g(and)f Ft(dirs)630 |
967625cd CR |
18353 | 993 y Fu(builtins)d(\(see)h(Section)g(6.8)h([The)e(Directory)i(Stac)m |
18354 | (k],)g(page)f(91\).)150 1139 y Ft(--enable-disabled-builti)o(ns)630 | |
18355 | 1249 y Fu(Allo)m(w)40 b(builtin)e(commands)g(to)h(b)s(e)f(in)m(v)m(ok)m | |
6e51e0d0 | 18356 | (ed)i(via)f(`)p Ft(builtin)29 b(xxx)p Fu(')37 b(ev)m(en)j(after)f |
967625cd | 18357 | Ft(xxx)e Fu(has)630 1358 y(b)s(een)31 b(disabled)g(using)g(`)p |
6e51e0d0 | 18358 | Ft(enable)d(-n)i(xxx)p Fu('.)43 b(See)32 b(Section)g(4.2)h([Bash)e |
967625cd | 18359 | (Builtins],)i(page)f(48,)630 1468 y(for)e(details)i(of)e(the)h |
6e51e0d0 | 18360 | Ft(builtin)d Fu(and)i Ft(enable)e Fu(builtin)i(commands.)150 |
967625cd | 18361 | 1614 y Ft(--enable-dparen-arithmet)o(ic)630 1724 y Fu(Include)42 |
6e51e0d0 | 18362 | b(supp)s(ort)f(for)h(the)h Ft(\(\(...)o(\)\))f Fu(command)g(\(see)i |
967625cd CR |
18363 | (Section)f(3.2.4.2)i([Conditional)630 1833 y(Constructs],)30 |
18364 | b(page)h(10\).)150 1979 y Ft(--enable-extended-glob)630 | |
18365 | 2089 y Fu(Include)40 b(supp)s(ort)e(for)i(the)h(extended)f(pattern)h | |
09767ff0 | 18366 | (matc)m(hing)g(features)g(describ)s(ed)e(ab)s(o)m(v)m(e)630 |
967625cd CR |
18367 | 2198 y(under)29 b(Section)i(3.5.8.1)i([P)m(attern)e(Matc)m(hing],)i |
18368 | (page)e(31.)150 2345 y Ft(--enable-extended-glob-d)o(efau)o(lt)630 | |
18369 | 2454 y Fu(Set)40 b(the)g(default)g(v)-5 b(alue)41 b(of)f(the)g | |
6e51e0d0 | 18370 | Fr(extglob)j Fu(shell)d(option)g(describ)s(ed)f(ab)s(o)m(v)m(e)i(under) |
967625cd | 18371 | d(Sec-)630 2564 y(tion)31 b(4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g |
037a8b7f | 18372 | (63,)h(to)f(b)s(e)f(enabled.)150 2710 y Ft(--enable-function-import)630 |
967625cd | 18373 | 2819 y Fu(Include)23 b(supp)s(ort)g(for)g(imp)s(orting)h(function)g |
8a0829e9 | 18374 | (de\014nitions)f(exp)s(orted)h(b)m(y)g(another)g(instance)630 |
967625cd | 18375 | 2929 y(of)31 b(the)f(shell)h(from)f(the)g(en)m(vironmen)m(t.)41 |
8a0829e9 | 18376 | b(This)30 b(option)h(is)f(enabled)h(b)m(y)f(default.)150 |
967625cd CR |
18377 | 3075 y Ft(--enable-glob-asciirange)o(-def)o(ault)630 |
18378 | 3185 y Fu(Set)h(the)g(default)f(v)-5 b(alue)31 b(of)g(the)g | |
8a0829e9 | 18379 | Fr(globasciiranges)36 b Fu(shell)31 b(option)g(describ)s(ed)f(ab)s(o)m |
037a8b7f CR |
18380 | (v)m(e)h(under)630 3294 y(Section)39 b(4.3.2)h([The)e(Shopt)g |
18381 | (Builtin],)j(page)e(63,)i(to)f(b)s(e)d(enabled.)65 b(This)37 | |
18382 | b(con)m(trols)j(the)630 3404 y(b)s(eha)m(vior)21 b(of)g(c)m(haracter)h | |
18383 | (ranges)f(when)f(used)g(in)g(pattern)h(matc)m(hing)h(brac)m(k)m(et)g | |
18384 | (expressions.)150 3550 y Ft(--enable-help-builtin)630 | |
18385 | 3660 y Fu(Include)i(the)h Ft(help)f Fu(builtin,)h(whic)m(h)g(displa)m | |
18386 | (ys)f(help)h(on)f(shell)h(builtins)f(and)h(v)-5 b(ariables)25 | |
18387 | b(\(see)630 3769 y(Section)31 b(4.2)h([Bash)e(Builtins],)i(page)f | |
18388 | (48\).)150 3915 y Ft(--enable-history)630 4025 y Fu(Include)e(command)g | |
18389 | (history)h(and)f(the)h Ft(fc)f Fu(and)g Ft(history)e | |
18390 | Fu(builtin)j(commands)f(\(see)h(Sec-)630 4134 y(tion)h(9.1)g([Bash)g | |
18391 | (History)g(F)-8 b(acilities],)34 b(page)d(136\).)150 | |
18392 | 4281 y Ft(--enable-job-control)630 4390 y Fu(This)e(enables)i(the)f | |
18393 | (job)g(con)m(trol)h(features)g(\(see)g(Chapter)f(7)g([Job)g(Con)m | |
18394 | (trol],)h(page)g(99\),)h(if)630 4500 y(the)f(op)s(erating)f(system)h | |
18395 | (supp)s(orts)d(them.)150 4646 y Ft(--enable-multibyte)630 | |
18396 | 4756 y Fu(This)h(enables)i(supp)s(ort)d(for)i(m)m(ultib)m(yte)h(c)m | |
18397 | (haracters)g(if)f(the)g(op)s(erating)h(system)f(pro)m(vides)630 | |
18398 | 4865 y(the)h(necessary)f(supp)s(ort.)150 5011 y Ft | |
18399 | (--enable-net-redirection)o(s)630 5121 y Fu(This)23 b(enables)h(the)g | |
18400 | (sp)s(ecial)h(handling)e(of)h(\014lenames)g(of)g(the)g(form)g | |
18401 | Ft(/dev/tcp/)p Fj(host)p Ft(/)p Fj(port)630 5230 y Fu(and)31 | |
18402 | b Ft(/dev/udp/)p Fj(host)p Ft(/)p Fj(port)26 b Fu(when)31 | |
18403 | b(used)g(in)g(redirections)h(\(see)g(Section)g(3.6)h([Redirec-)630 | |
18404 | 5340 y(tions],)e(page)g(32\).)p eop end | |
900a813b CR |
18405 | %%Page: 147 153 |
18406 | TeXDict begin 147 152 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
967625cd CR |
18407 | b(Installing)31 b(Bash)2356 b(147)150 299 y Ft |
18408 | (--enable-process-substit)o(utio)o(n)630 408 y Fu(This)49 | |
18409 | b(enables)i(pro)s(cess)f(substitution)g(\(see)h(Section)g(3.5.6)h([Pro) | |
037a8b7f | 18410 | s(cess)e(Substitution],)630 518 y(page)31 b(29\))h(if)e(the)h(op)s |
967625cd CR |
18411 | (erating)f(system)h(pro)m(vides)f(the)h(necessary)g(supp)s(ort.)150 |
18412 | 677 y Ft(--enable-progcomp)630 787 y Fu(Enable)d(the)g(programmable)g | |
18413 | (completion)i(facilities)g(\(see)f(Section)g(8.6)g([Programmable)630 | |
18414 | 897 y(Completion],)i(page)h(128\).)42 b(If)30 b(Readline)h(is)f(not)h | |
18415 | (enabled,)f(this)h(option)g(has)f(no)g(e\013ect.)150 | |
18416 | 1056 y Ft(--enable-prompt-string-d)o(ecod)o(ing)630 1166 | |
18417 | y Fu(T)-8 b(urn)30 b(on)i(the)f(in)m(terpretation)i(of)f(a)g(n)m(um)m | |
18418 | (b)s(er)e(of)i(bac)m(kslash-escap)s(ed)g(c)m(haracters)i(in)d(the)630 | |
18419 | 1275 y Ft($PS1)p Fu(,)36 b Ft($PS2)p Fu(,)g Ft($PS3)p | |
18420 | Fu(,)h(and)e Ft($PS4)f Fu(prompt)h(strings.)57 b(See)36 | |
18421 | b(Section)h(6.9)g([Con)m(trolling)g(the)630 1385 y(Prompt],)30 | |
18422 | b(page)h(93,)h(for)e(a)h(complete)h(list)f(of)f(prompt)g(string)g | |
18423 | (escap)s(e)h(sequences.)150 1544 y Ft(--enable-readline)630 | |
18424 | 1654 y Fu(Include)d(supp)s(ort)f(for)h(command-line)h(editing)g(and)f | |
18425 | (history)g(with)g(the)h(Bash)g(v)m(ersion)g(of)630 1763 | |
18426 | y(the)i(Readline)g(library)f(\(see)h(Chapter)f(8)g([Command)g(Line)g | |
18427 | (Editing],)h(page)g(103\).)150 1923 y Ft(--enable-restricted)630 | |
18428 | 2032 y Fu(Include)41 b(supp)s(ort)f(for)i(a)g Fr(restricted)g(shell)p | |
18429 | Fu(.)75 b(If)42 b(this)f(is)h(enabled,)j(Bash,)g(when)c(called)630 | |
18430 | 2142 y(as)f Ft(rbash)p Fu(,)h(en)m(ters)f(a)g(restricted)h(mo)s(de.)68 | |
18431 | b(See)40 b(Section)h(6.10)g([The)f(Restricted)h(Shell],)630 | |
18432 | 2252 y(page)31 b(94,)h(for)e(a)g(description)h(of)f(restricted)h(mo)s | |
18433 | (de.)150 2411 y Ft(--enable-select)630 2521 y Fu(Include)25 | |
18434 | b(the)h Ft(select)f Fu(comp)s(ound)f(command,)j(whic)m(h)e(allo)m(ws)j | |
18435 | (the)e(generation)h(of)f(simple)630 2630 y(men)m(us)k(\(see)h(Section)g | |
18436 | (3.2.4.2)i([Conditional)e(Constructs],)g(page)g(10\).)150 | |
18437 | 2790 y Ft(--enable-separate-helpfi)o(les)630 2899 y Fu(Use)h(external)h | |
18438 | (\014les)f(for)g(the)g(do)s(cumen)m(tation)h(displa)m(y)m(ed)f(b)m(y)g | |
18439 | (the)g Ft(help)f Fu(builtin)h(instead)630 3009 y(of)f(storing)f(the)h | |
18440 | (text)g(in)m(ternally)-8 b(.)150 3168 y Ft(--enable-single-help-str)o | |
18441 | (ings)630 3278 y Fu(Store)40 b(the)g(text)h(displa)m(y)m(ed)g(b)m(y)e | |
18442 | (the)i Ft(help)d Fu(builtin)i(as)g(a)g(single)h(string)f(for)f(eac)m(h) | |
18443 | i(help)630 3387 y(topic.)54 b(This)33 b(aids)i(in)f(translating)h(the)g | |
18444 | (text)g(to)g(di\013eren)m(t)g(languages.)54 b(Y)-8 b(ou)35 | |
18445 | b(ma)m(y)g(need)630 3497 y(to)c(disable)g(this)f(if)g(y)m(our)h | |
18446 | (compiler)g(cannot)f(handle)g(v)m(ery)h(long)g(string)f(literals.)150 | |
18447 | 3656 y Ft(--enable-strict-posix-de)o(faul)o(t)630 3766 | |
18448 | y Fu(Mak)m(e)c(Bash)f Fm(posix)p Fu(-conforman)m(t)g(b)m(y)f(default)h | |
18449 | (\(see)g(Section)h(6.11)g([Bash)f(POSIX)e(Mo)s(de],)630 | |
18450 | 3875 y(page)31 b(95\).)150 4035 y Ft(--enable-usg-echo-defaul)o(t)630 | |
18451 | 4144 y Fu(A)f(synon)m(ym)g(for)g Ft(--enable-xpg-echo-default)p | |
18452 | Fu(.)150 4304 y Ft(--enable-xpg-echo-defaul)o(t)630 4413 | |
6e51e0d0 | 18453 | y Fu(Mak)m(e)c(the)f Ft(echo)e Fu(builtin)i(expand)f(bac)m |
1c72c0cd | 18454 | (kslash-escap)s(ed)h(c)m(haracters)h(b)m(y)f(default,)h(without)630 |
967625cd | 18455 | 4523 y(requiring)d(the)h Ft(-e)f Fu(option.)39 b(This)23 |
6e51e0d0 | 18456 | b(sets)h(the)g(default)g(v)-5 b(alue)24 b(of)g(the)g |
967625cd | 18457 | Ft(xpg_echo)e Fu(shell)h(option)630 4633 y(to)28 b Ft(on)p |
6e51e0d0 CR |
18458 | Fu(,)g(whic)m(h)f(mak)m(es)h(the)g(Bash)f Ft(echo)f Fu(b)s(eha)m(v)m(e) |
18459 | i(more)g(lik)m(e)h(the)e(v)m(ersion)h(sp)s(eci\014ed)f(in)g(the)630 | |
967625cd | 18460 | 4742 y(Single)35 b(Unix)f(Sp)s(eci\014cation,)i(v)m(ersion)e(3.)53 |
6e51e0d0 | 18461 | b(See)35 b(Section)g(4.2)g([Bash)g(Builtins],)h(page)f(48,)630 |
967625cd CR |
18462 | 4852 y(for)30 b(a)h(description)f(of)h(the)f(escap)s(e)h(sequences)g |
18463 | (that)g Ft(echo)e Fu(recognizes.)275 5011 y(The)f(\014le)i | |
6e51e0d0 CR |
18464 | Ft(config-top.h)c Fu(con)m(tains)31 b(C)d(Prepro)s(cessor)h(`)p |
18465 | Ft(#define)p Fu(')f(statemen)m(ts)j(for)f(options)f(whic)m(h)150 | |
967625cd | 18466 | 5121 y(are)35 b(not)g(settable)i(from)d Ft(configure)p |
6e51e0d0 | 18467 | Fu(.)51 b(Some)35 b(of)g(these)g(are)h(not)f(mean)m(t)g(to)h(b)s(e)e(c) |
967625cd | 18468 | m(hanged;)k(b)s(ew)m(are)d(of)150 5230 y(the)h(consequences)g(if)f(y)m |
6e51e0d0 | 18469 | (ou)h(do.)55 b(Read)36 b(the)g(commen)m(ts)g(asso)s(ciated)h(with)e |
967625cd | 18470 | (eac)m(h)i(de\014nition)e(for)g(more)150 5340 y(information)c(ab)s(out) |
6e51e0d0 | 18471 | f(its)h(e\013ect.)p eop end |
900a813b | 18472 | %%Page: 148 154 |
037a8b7f CR |
18473 | TeXDict begin 148 153 bop 3614 -116 a Fu(148)150 299 |
18474 | y Fp(App)t(endix)52 b(A)81 b(Rep)t(orting)53 b(Bugs)150 | |
18475 | 533 y Fu(Please)33 b(rep)s(ort)e(all)h(bugs)f(y)m(ou)h(\014nd)e(in)i | |
18476 | (Bash.)44 b(But)32 b(\014rst,)g(y)m(ou)g(should)e(mak)m(e)j(sure)e | |
18477 | (that)h(it)g(really)h(is)f(a)150 643 y(bug,)d(and)g(that)h(it)g(app)s | |
18478 | (ears)f(in)g(the)h(latest)h(v)m(ersion)f(of)g(Bash.)40 | |
18479 | b(The)29 b(latest)j(v)m(ersion)e(of)f(Bash)h(is)f(alw)m(a)m(ys)150 | |
18480 | 752 y(a)m(v)-5 b(ailable)33 b(for)d(FTP)g(from)g Ft | |
18481 | (ftp://ftp.gnu.org/pub/gn)o(u/ba)o(sh/)o Fu(.)275 887 | |
18482 | y(Once)41 b(y)m(ou)g(ha)m(v)m(e)h(determined)f(that)h(a)f(bug)g | |
18483 | (actually)h(exists,)j(use)c(the)g Ft(bashbug)e Fu(command)i(to)150 | |
18484 | 996 y(submit)25 b(a)h(bug)g(rep)s(ort.)38 b(If)26 b(y)m(ou)g(ha)m(v)m | |
18485 | (e)h(a)f(\014x,)h(y)m(ou)f(are)g(encouraged)h(to)f(mail)h(that)f(as)g | |
18486 | (w)m(ell!)40 b(Suggestions)150 1106 y(and)j(`philosophical')i(bug)e | |
18487 | (rep)s(orts)f(ma)m(y)j(b)s(e)e(mailed)h(to)g Ft(bug-bash@gnu)11 | |
18488 | b(.)g(org)39 b Fu(or)k(p)s(osted)g(to)i(the)150 1215 | |
18489 | y(Usenet)31 b(newsgroup)e Ft(gnu.bash.bug)p Fu(.)275 | |
18490 | 1350 y(All)i(bug)e(rep)s(orts)h(should)f(include:)225 | |
6e51e0d0 CR |
18491 | 1484 y Fq(\017)60 b Fu(The)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(of)h |
18492 | (Bash.)225 1619 y Fq(\017)60 b Fu(The)30 b(hardw)m(are)g(and)g(op)s | |
18493 | (erating)g(system.)225 1753 y Fq(\017)60 b Fu(The)30 | |
18494 | b(compiler)h(used)e(to)i(compile)h(Bash.)225 1888 y Fq(\017)60 | |
18495 | b Fu(A)30 b(description)h(of)f(the)h(bug)f(b)s(eha)m(viour.)225 | |
18496 | 2022 y Fq(\017)60 b Fu(A)30 b(short)h(script)f(or)g(`recip)s(e')h(whic) | |
37c41ab1 | 18497 | m(h)f(exercises)i(the)e(bug)g(and)g(ma)m(y)h(b)s(e)f(used)f(to)i(repro) |
6e51e0d0 | 18498 | s(duce)e(it.)150 2182 y Ft(bashbug)d Fu(inserts)i(the)h(\014rst)f |
37c41ab1 CR |
18499 | (three)g(items)h(automatically)i(in)m(to)f(the)e(template)i(it)f(pro)m |
18500 | (vides)f(for)g(\014ling)h(a)150 2291 y(bug)h(rep)s(ort.)275 | |
18501 | 2426 y(Please)h(send)f(all)h(rep)s(orts)f(concerning)g(this)h(man)m | |
6e51e0d0 | 18502 | (ual)f(to)h Ft(bug-bash@gnu.org)p Fu(.)p eop end |
900a813b | 18503 | %%Page: 149 155 |
037a8b7f CR |
18504 | TeXDict begin 149 154 bop 3614 -116 a Fu(149)150 141 |
18505 | y Fp(App)t(endix)58 b(B)81 b(Ma)9 b(jor)54 b(Di\013erences)d(F)-13 | |
18506 | b(rom)54 b(The)g(Bourne)1088 299 y(Shell)150 530 y Fu(Bash)26 | |
c302751c CR |
18507 | b(implemen)m(ts)h(essen)m(tially)g(the)g(same)f(grammar,)h(parameter)f |
18508 | (and)g(v)-5 b(ariable)27 b(expansion,)g(redirec-)150 | |
18509 | 640 y(tion,)i(and)e(quoting)g(as)h(the)g(Bourne)f(Shell.)40 | |
6e51e0d0 | 18510 | b(Bash)27 b(uses)g(the)h Fm(posix)f Fu(standard)f(as)i(the)g(sp)s |
c302751c CR |
18511 | (eci\014cation)g(of)150 749 y(ho)m(w)34 b(these)h(features)g(are)g(to)g |
18512 | (b)s(e)f(implemen)m(ted.)53 b(There)34 b(are)h(some)g(di\013erences)g | |
18513 | (b)s(et)m(w)m(een)g(the)g(tradi-)150 859 y(tional)e(Bourne)e(shell)h | |
ac18b312 CR |
18514 | (and)f(Bash;)i(this)f(section)g(quic)m(kly)h(details)g(the)e |
18515 | (di\013erences)h(of)g(signi\014cance.)46 b(A)150 969 | |
18516 | y(n)m(um)m(b)s(er)24 b(of)h(these)h(di\013erences)f(are)h(explained)f | |
18517 | (in)g(greater)h(depth)f(in)g(previous)f(sections.)40 | |
18518 | b(This)25 b(section)150 1078 y(uses)33 b(the)i(v)m(ersion)f(of)g | |
6e51e0d0 | 18519 | Ft(sh)f Fu(included)g(in)h(SVR4.2)h(\(the)f(last)h(v)m(ersion)f(of)g |
ac18b312 | 18520 | (the)g(historical)i(Bourne)d(shell\))150 1188 y(as)e(the)f(baseline)h |
6e51e0d0 CR |
18521 | (reference.)225 1322 y Fq(\017)60 b Fu(Bash)32 b(is)h |
18522 | Fm(posix)p Fu(-conforman)m(t,)g(ev)m(en)g(where)f(the)g | |
18523 | Fm(posix)g Fu(sp)s(eci\014cation)h(di\013ers)f(from)g(traditional)330 | |
18524 | 1431 y Ft(sh)e Fu(b)s(eha)m(vior)g(\(see)i(Section)f(6.11)h([Bash)e | |
900a813b | 18525 | (POSIX)g(Mo)s(de],)h(page)g(95\).)225 1565 y Fq(\017)60 |
6e51e0d0 | 18526 | b Fu(Bash)26 b(has)g(m)m(ulti-c)m(haracter)i(in)m(v)m(o)s(cation)g |
1c72c0cd | 18527 | (options)f(\(see)f(Section)h(6.1)g([In)m(v)m(oking)g(Bash],)h(page)e |
900a813b | 18528 | (81\).)225 1699 y Fq(\017)60 b Fu(Bash)40 b(has)f(command-line)h |
9f178efb | 18529 | (editing)g(\(see)h(Chapter)e(8)h([Command)f(Line)g(Editing],)k(page)d |
900a813b | 18530 | (103\))330 1809 y(and)30 b(the)g Ft(bind)g Fu(builtin.)225 |
6e51e0d0 | 18531 | 1943 y Fq(\017)60 b Fu(Bash)46 b(pro)m(vides)g(a)g(programmable)g(w)m |
1c72c0cd | 18532 | (ord)f(completion)i(mec)m(hanism)f(\(see)h(Section)g(8.6)g([Pro-)330 |
900a813b | 18533 | 2052 y(grammable)39 b(Completion],)i(page)e(128\),)i(and)d(builtin)g |
6e51e0d0 CR |
18534 | (commands)f Ft(complete)p Fu(,)h Ft(compgen)p Fu(,)h(and)330 |
18535 | 2162 y Ft(compopt)p Fu(,)29 b(to)i(manipulate)g(it.)225 | |
18536 | 2296 y Fq(\017)60 b Fu(Bash)26 b(has)f(command)h(history)f(\(see)i | |
37c41ab1 | 18537 | (Section)f(9.1)h([Bash)f(History)h(F)-8 b(acilities],)30 |
900a813b | 18538 | b(page)c(136\))i(and)d(the)330 2405 y Ft(history)k Fu(and)h |
6e51e0d0 | 18539 | Ft(fc)g Fu(builtins)g(to)h(manipulate)g(it.)42 b(The)30 |
37c41ab1 | 18540 | b(Bash)h(history)g(list)g(main)m(tains)g(timestamp)330 |
1c72c0cd | 18541 | 2515 y(information)g(and)e(uses)h(the)h(v)-5 b(alue)31 |
6e51e0d0 CR |
18542 | b(of)f(the)h Ft(HISTTIMEFORMAT)26 b Fu(v)-5 b(ariable)32 |
18543 | b(to)f(displa)m(y)f(it.)225 2649 y Fq(\017)60 b Fu(Bash)48 | |
18544 | b(implemen)m(ts)h Ft(csh)p Fu(-lik)m(e)g(history)f(expansion)g(\(see)h | |
1c72c0cd | 18545 | (Section)g(9.3)h([History)f(In)m(teraction],)330 2759 |
900a813b | 18546 | y(page)31 b(138\).)225 2892 y Fq(\017)60 b Fu(Bash)33 |
37c41ab1 | 18547 | b(has)g(one-dimensional)h(arra)m(y)f(v)-5 b(ariables)34 |
900a813b | 18548 | b(\(see)g(Section)g(6.7)g([Arra)m(ys],)g(page)g(90\),)h(and)e(the)330 |
1c72c0cd | 18549 | 3002 y(appropriate)39 b(v)-5 b(ariable)40 b(expansions)f(and)g |
37c41ab1 | 18550 | (assignmen)m(t)h(syn)m(tax)g(to)g(use)f(them.)67 b(Sev)m(eral)40 |
1c72c0cd | 18551 | b(of)g(the)330 3112 y(Bash)32 b(builtins)f(tak)m(e)j(options)e(to)h |
37c41ab1 | 18552 | (act)g(on)e(arra)m(ys.)46 b(Bash)32 b(pro)m(vides)g(a)g(n)m(um)m(b)s |
1c72c0cd | 18553 | (er)f(of)h(built-in)f(arra)m(y)330 3221 y(v)-5 b(ariables.)225 |
6e51e0d0 | 18554 | 3355 y Fq(\017)60 b Fu(The)37 b Ft($'...)n(')g Fu(quoting)g(syn)m(tax,) |
37c41ab1 | 18555 | j(whic)m(h)d(expands)f(ANSI-C)h(bac)m(kslash-escap)s(ed)h(c)m |
1c72c0cd | 18556 | (haracters)g(in)330 3465 y(the)26 b(text)h(b)s(et)m(w)m(een)g(the)g |
37c41ab1 | 18557 | (single)f(quotes,)i(is)e(supp)s(orted)f(\(see)i(Section)g(3.1.2.4)h |
1c72c0cd | 18558 | ([ANSI-C)e(Quoting],)330 3574 y(page)31 b(6\).)225 3708 |
6e51e0d0 CR |
18559 | y Fq(\017)60 b Fu(Bash)30 b(supp)s(orts)f(the)h Ft($"...)o(")f |
18560 | Fu(quoting)i(syn)m(tax)g(to)f(do)g(lo)s(cale-sp)s(eci\014c)i | |
18561 | (translation)g(of)e(the)g(c)m(har-)330 3818 y(acters)g(b)s(et)m(w)m | |
18562 | (een)f(the)f(double)g(quotes.)41 b(The)28 b Ft(-D)p Fu(,)h | |
18563 | Ft(--dump-strings)p Fu(,)c(and)j Ft(--dump-po-strings)330 | |
18564 | 3927 y Fu(in)m(v)m(o)s(cation)42 b(options)d(list)i(the)e(translatable) | |
18565 | i(strings)f(found)e(in)h(a)h(script)g(\(see)g(Section)g(3.1.2.5)330 | |
18566 | 4037 y([Lo)s(cale)32 b(T)-8 b(ranslation],)31 b(page)h(7\).)225 | |
18567 | 4171 y Fq(\017)60 b Fu(Bash)44 b(implemen)m(ts)g(the)f | |
18568 | Ft(!)h Fu(k)m(eyw)m(ord)g(to)g(negate)h(the)f(return)e(v)-5 | |
18569 | b(alue)44 b(of)g(a)g(pip)s(eline)f(\(see)h(Sec-)330 4281 | |
18570 | y(tion)33 b(3.2.2)i([Pip)s(elines],)f(page)g(8\).)49 | |
18571 | b(V)-8 b(ery)33 b(useful)f(when)g(an)h Ft(if)f Fu(statemen)m(t)j(needs) | |
1c72c0cd | 18572 | d(to)i(act)g(only)f(if)330 4390 y(a)k(test)h(fails.)60 |
6e51e0d0 CR |
18573 | b(The)36 b(Bash)g(`)p Ft(-o)30 b(pipefail)p Fu(')35 b(option)i(to)h |
18574 | Ft(set)d Fu(will)i(cause)g(a)g(pip)s(eline)g(to)g(return)f(a)330 | |
1c72c0cd | 18575 | 4500 y(failure)31 b(status)f(if)h(an)m(y)f(command)g(fails.)225 |
6e51e0d0 CR |
18576 | 4634 y Fq(\017)60 b Fu(Bash)34 b(has)g(the)g Ft(time)f |
18577 | Fu(reserv)m(ed)h(w)m(ord)g(and)f(command)h(timing)h(\(see)g(Section)g | |
1c72c0cd | 18578 | (3.2.2)g([Pip)s(elines],)330 4743 y(page)g(8\).)52 b(The)33 |
37c41ab1 | 18579 | b(displa)m(y)i(of)f(the)g(timing)g(statistics)i(ma)m(y)f(b)s(e)e(con)m |
6e51e0d0 CR |
18580 | (trolled)j(with)e(the)g Ft(TIMEFORMAT)330 4853 y Fu(v)-5 |
18581 | b(ariable.)225 4987 y Fq(\017)60 b Fu(Bash)28 b(implemen)m(ts)g(the)f | |
18582 | Ft(for)j(\(\()g Fj(expr1)f Ft(;)h Fj(expr2)f Ft(;)h Fj(expr3)f | |
18583 | Ft(\)\))e Fu(arithmetic)h(for)g(command,)g(sim-)330 5096 | |
18584 | y(ilar)j(to)g(the)g(C)f(language)h(\(see)h(Section)f(3.2.4.1)i([Lo)s | |
18585 | (oping)d(Constructs],)h(page)g(10\).)225 5230 y Fq(\017)60 | |
18586 | b Fu(Bash)31 b(includes)f(the)g Ft(select)f Fu(comp)s(ound)g(command,)i | |
18587 | (whic)m(h)f(allo)m(ws)i(the)f(generation)g(of)g(simple)330 | |
18588 | 5340 y(men)m(us)f(\(see)h(Section)g(3.2.4.2)i([Conditional)e | |
18589 | (Constructs],)g(page)g(10\).)p eop end | |
900a813b CR |
18590 | %%Page: 150 156 |
18591 | TeXDict begin 150 155 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 18592 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
900a813b | 18593 | b(The)f(Bourne)g(Shell)1258 b(150)225 299 y Fq(\017)60 |
6e51e0d0 | 18594 | b Fu(Bash)40 b(includes)g(the)g Ft([[)g Fu(comp)s(ound)e(command,)43 |
1c72c0cd CR |
18595 | b(whic)m(h)c(mak)m(es)i(conditional)h(testing)f(part)f(of)330 |
18596 | 408 y(the)f(shell)g(grammar)g(\(see)h(Section)f(3.2.4.2)j([Conditional) | |
18597 | d(Constructs],)i(page)f(10\),)i(including)330 518 y(optional)32 | |
6e51e0d0 CR |
18598 | b(regular)e(expression)g(matc)m(hing.)225 653 y Fq(\017)60 |
18599 | b Fu(Bash)31 b(pro)m(vides)f(optional)h(case-insensitiv)m(e)i(matc)m | |
18600 | (hing)f(for)e(the)g Ft(case)g Fu(and)f Ft([[)h Fu(constructs.)225 | |
18601 | 789 y Fq(\017)60 b Fu(Bash)27 b(includes)g(brace)h(expansion)f(\(see)h | |
9f178efb | 18602 | (Section)g(3.5.1)i([Brace)e(Expansion],)g(page)g(21\))h(and)d(tilde)330 |
1c72c0cd | 18603 | 898 y(expansion)k(\(see)i(Section)f(3.5.2)h([Tilde)f(Expansion],)f |
6e51e0d0 CR |
18604 | (page)h(22\).)225 1034 y Fq(\017)60 b Fu(Bash)24 b(implemen)m(ts)h |
18605 | (command)e(aliases)j(and)d(the)i Ft(alias)d Fu(and)i | |
18606 | Ft(unalias)e Fu(builtins)h(\(see)i(Section)g(6.6)330 | |
900a813b | 18607 | 1143 y([Aliases],)32 b(page)f(89\).)225 1279 y Fq(\017)60 |
6e51e0d0 CR |
18608 | b Fu(Bash)32 b(pro)m(vides)g(shell)g(arithmetic,)i(the)e |
18609 | Ft(\(\()g Fu(comp)s(ound)e(command)i(\(see)h(Section)f(3.2.4.2)j([Con-) | |
1c72c0cd CR |
18610 | 330 1388 y(ditional)d(Constructs],)e(page)i(10\),)g(and)e(arithmetic)i |
18611 | (expansion)e(\(see)i(Section)f(6.5)h([Shell)f(Arith-)330 | |
900a813b | 18612 | 1498 y(metic],)h(page)f(88\).)225 1633 y Fq(\017)60 b |
6e51e0d0 | 18613 | Fu(V)-8 b(ariables)31 b(presen)m(t)e(in)g(the)g(shell's)h(initial)g(en) |
37c41ab1 | 18614 | m(vironmen)m(t)g(are)g(automatically)i(exp)s(orted)d(to)h(c)m(hild)330 |
1c72c0cd | 18615 | 1743 y(pro)s(cesses.)38 b(The)23 b(Bourne)g(shell)g(do)s(es)g(not)g |
37c41ab1 | 18616 | (normally)g(do)g(this)g(unless)g(the)g(v)-5 b(ariables)24 |
1c72c0cd | 18617 | b(are)f(explicitly)330 1852 y(mark)m(ed)30 b(using)g(the)h |
6e51e0d0 CR |
18618 | Ft(export)e Fu(command.)225 1988 y Fq(\017)60 b Fu(Bash)26 |
18619 | b(supp)s(orts)d(the)j(`)p Ft(+=)p Fu(')f(assignmen)m(t)i(op)s(erator,)g | |
1c72c0cd CR |
18620 | (whic)m(h)e(app)s(ends)f(to)i(the)g(v)-5 b(alue)26 b(of)f(the)h(v)-5 |
18621 | b(ariable)330 2097 y(named)30 b(on)g(the)h(left)g(hand)e(side.)225 | |
6e51e0d0 CR |
18622 | 2233 y Fq(\017)60 b Fu(Bash)36 b(includes)g(the)g Fm(posix)f |
18623 | Fu(pattern)h(remo)m(v)-5 b(al)37 b(`)p Ft(\045)p Fu(',)h(`)p | |
18624 | Ft(#)p Fu(',)g(`)p Ft(\045\045)p Fu(')e(and)f(`)p Ft(##)p | |
18625 | Fu(')h(expansions)g(to)g(remo)m(v)m(e)330 2342 y(leading)f(or)f | |
1c72c0cd CR |
18626 | (trailing)h(substrings)e(from)g(v)-5 b(ariable)35 b(v)-5 |
18627 | b(alues)35 b(\(see)g(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
6e51e0d0 CR |
18628 | 2452 y(Expansion],)30 b(page)h(23\).)225 2587 y Fq(\017)60 |
18629 | b Fu(The)46 b(expansion)g Ft(${#xx})p Fu(,)j(whic)m(h)d(returns)f(the)i | |
18630 | (length)f(of)h Ft(${xx})p Fu(,)i(is)e(supp)s(orted)d(\(see)j(Sec-)330 | |
1c72c0cd | 18631 | 2697 y(tion)31 b(3.5.3)h([Shell)f(P)m(arameter)g(Expansion],)f(page)i |
6e51e0d0 CR |
18632 | (23\).)225 2832 y Fq(\017)60 b Fu(The)30 b(expansion)g |
18633 | Ft(${var:)p Fr(o\013set)r Ft([:)p Fr(length)p Ft(]})p | |
18634 | Fu(,)g(whic)m(h)g(expands)g(to)h(the)g(substring)e(of)i | |
18635 | Ft(var)p Fu('s)e(v)-5 b(alue)330 2942 y(of)43 b(length)g | |
18636 | Fr(length)p Fu(,)k(b)s(eginning)42 b(at)i Fr(o\013set)p | |
18637 | Fu(,)j(is)c(presen)m(t)g(\(see)g(Section)h(3.5.3)h([Shell)e(P)m | |
c2fa6583 | 18638 | (arameter)330 3051 y(Expansion],)30 b(page)h(23\).)225 |
6e51e0d0 CR |
18639 | 3187 y Fq(\017)60 b Fu(The)21 b(expansion)f Ft(${var/[/])p |
18640 | Fr(pattern)p Ft([/)p Fr(replacemen)m(t)r Ft(]})p Fu(,)i(whic)m(h)e | |
18641 | (matc)m(hes)j Fr(pattern)e Fu(and)f(replaces)330 3296 | |
18642 | y(it)29 b(with)e Fr(replacemen)m(t)32 b Fu(in)c(the)g(v)-5 | |
18643 | b(alue)29 b(of)f Ft(var)p Fu(,)g(is)g(a)m(v)-5 b(ailable)31 | |
37c41ab1 | 18644 | b(\(see)e(Section)f(3.5.3)i([Shell)f(P)m(arameter)330 |
6e51e0d0 CR |
18645 | 3406 y(Expansion],)h(page)h(23\).)225 3541 y Fq(\017)60 |
18646 | b Fu(The)33 b(expansion)g Ft(${!)p Fj(prefix)p Ft(*})d | |
18647 | Fu(expansion,)k(whic)m(h)e(expands)h(to)h(the)f(names)g(of)g(all)h | |
18648 | (shell)f(v)-5 b(ari-)330 3651 y(ables)36 b(whose)g(names)g(b)s(egin)g | |
18649 | (with)g Fr(pre\014x)p Fu(,)g(is)g(a)m(v)-5 b(ailable)39 | |
18650 | b(\(see)e(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
18651 | 3761 y(Expansion],)30 b(page)h(23\).)225 3896 y Fq(\017)60 | |
18652 | b Fu(Bash)22 b(has)f Fr(indirect)j Fu(v)-5 b(ariable)22 | |
18653 | b(expansion)g(using)f Ft(${!word})e Fu(\(see)k(Section)f(3.5.3)i | |
c2fa6583 | 18654 | ([Shell)e(P)m(arameter)330 4006 y(Expansion],)30 b(page)h(23\).)225 |
6e51e0d0 CR |
18655 | 4141 y Fq(\017)60 b Fu(Bash)31 b(can)f(expand)g(p)s(ositional)h |
18656 | (parameters)g(b)s(ey)m(ond)e Ft($9)h Fu(using)g Ft(${)p | |
18657 | Fj(num)p Ft(})p Fu(.)225 4276 y Fq(\017)60 b Fu(The)27 | |
18658 | b Fm(posix)g Ft($\(\))g Fu(form)g(of)h(command)g(substitution)f(is)h | |
37c41ab1 | 18659 | (implemen)m(ted)g(\(see)h(Section)f(3.5.4)i([Com-)330 |
8a0829e9 | 18660 | 4386 y(mand)38 b(Substitution],)k(page)e(29\),)j(and)38 |
6e51e0d0 | 18661 | b(preferred)g(to)i(the)g(Bourne)f(shell's)h Ft(``)e Fu(\(whic)m(h)i(is) |
1c72c0cd | 18662 | f(also)330 4495 y(implemen)m(ted)31 b(for)f(bac)m(kw)m(ards)h |
6e51e0d0 | 18663 | (compatibilit)m(y\).)225 4631 y Fq(\017)60 b Fu(Bash)31 |
37c41ab1 | 18664 | b(has)f(pro)s(cess)g(substitution)g(\(see)h(Section)g(3.5.6)h([Pro)s |
037a8b7f | 18665 | (cess)f(Substitution],)f(page)h(29\).)225 4766 y Fq(\017)60 |
6e51e0d0 | 18666 | b Fu(Bash)55 b(automatically)j(assigns)e(v)-5 b(ariables)55 |
37c41ab1 | 18667 | b(that)h(pro)m(vide)f(information)h(ab)s(out)f(the)g(curren)m(t)330 |
6e51e0d0 CR |
18668 | 4876 y(user)40 b(\()p Ft(UID)p Fu(,)i Ft(EUID)p Fu(,)g(and)e |
18669 | Ft(GROUPS)p Fu(\),)h(the)g(curren)m(t)f(host)g(\()p Ft(HOSTTYPE)p | |
18670 | Fu(,)h Ft(OSTYPE)p Fu(,)h Ft(MACHTYPE)p Fu(,)f(and)330 | |
18671 | 4985 y Ft(HOSTNAME)p Fu(\),)55 b(and)c(the)g(instance)h(of)g(Bash)f | |
18672 | (that)h(is)f(running)f(\()p Ft(BASH)p Fu(,)56 b Ft(BASH_VERSION)p | |
18673 | Fu(,)e(and)330 5095 y Ft(BASH_VERSINFO)p Fu(\).)37 b(See)31 | |
900a813b | 18674 | b(Section)g(5.2)h([Bash)e(V)-8 b(ariables],)33 b(page)e(70,)g(for)f |
6e51e0d0 CR |
18675 | (details.)225 5230 y Fq(\017)60 b Fu(The)44 b Ft(IFS)f |
18676 | Fu(v)-5 b(ariable)45 b(is)f(used)f(to)i(split)f(only)g(the)g(results)g | |
1c72c0cd | 18677 | (of)h(expansion,)i(not)d(all)h(w)m(ords)f(\(see)330 5340 |
8a0829e9 | 18678 | y(Section)29 b(3.5.7)h([W)-8 b(ord)29 b(Splitting],)h(page)f(30\).)41 |
1c72c0cd CR |
18679 | b(This)28 b(closes)h(a)g(longstanding)g(shell)f(securit)m(y)h(hole.)p |
18680 | eop end | |
900a813b CR |
18681 | %%Page: 151 157 |
18682 | TeXDict begin 151 156 bop 150 -116 a Fu(App)s(endix)29 | |
37c41ab1 | 18683 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
900a813b | 18684 | b(The)f(Bourne)g(Shell)1258 b(151)225 299 y Fq(\017)60 |
6e51e0d0 CR |
18685 | b Fu(The)36 b(\014lename)h(expansion)f(brac)m(k)m(et)i(expression)f(co) |
18686 | s(de)f(uses)g(`)p Ft(!)p Fu(')h(and)f(`)p Ft(^)p Fu(')h(to)g(negate)h | |
ad4aef08 CR |
18687 | (the)f(set)g(of)330 408 y(c)m(haracters)32 b(b)s(et)m(w)m(een)f(the)f |
18688 | (brac)m(k)m(ets.)43 b(The)29 b(Bourne)i(shell)f(uses)g(only)h(`)p | |
6e51e0d0 CR |
18689 | Ft(!)p Fu('.)225 536 y Fq(\017)60 b Fu(Bash)38 b(implemen)m(ts)g(the)g |
18690 | (full)g(set)g(of)g Fm(posix)f Fu(\014lename)h(expansion)g(op)s | |
18691 | (erators,)i(including)d Fr(c)m(har-)330 646 y(acter)i(classes)p | |
18692 | Fu(,)j Fr(equiv)-5 b(alence)39 b(classes)p Fu(,)j(and)37 | |
18693 | b Fr(collating)k(sym)m(b)s(ols)g Fu(\(see)e(Section)g(3.5.8)h | |
595e3e69 | 18694 | ([Filename)330 756 y(Expansion],)30 b(page)h(30\).)225 |
6e51e0d0 CR |
18695 | 883 y Fq(\017)60 b Fu(Bash)35 b(implemen)m(ts)g(extended)g(pattern)g |
18696 | (matc)m(hing)h(features)f(when)f(the)h Ft(extglob)d Fu(shell)j(option) | |
18697 | 330 993 y(is)30 b(enabled)h(\(see)g(Section)g(3.5.8.1)i([P)m(attern)f | |
8a0829e9 | 18698 | (Matc)m(hing],)g(page)f(31\).)225 1121 y Fq(\017)60 b |
6e51e0d0 CR |
18699 | Fu(It)22 b(is)g(p)s(ossible)g(to)h(ha)m(v)m(e)g(a)f(v)-5 |
18700 | b(ariable)23 b(and)f(a)g(function)g(with)g(the)g(same)g(name;)j | |
18701 | Ft(sh)d Fu(do)s(es)g(not)g(separate)330 1230 y(the)31 | |
18702 | b(t)m(w)m(o)g(name)g(spaces.)225 1358 y Fq(\017)60 b | |
18703 | Fu(Bash)30 b(functions)e(are)i(p)s(ermitted)f(to)h(ha)m(v)m(e)h(lo)s | |
18704 | (cal)g(v)-5 b(ariables)30 b(using)f(the)g Ft(local)f | |
18705 | Fu(builtin,)i(and)e(th)m(us)330 1468 y(useful)i(recursiv)m(e)g | |
18706 | (functions)g(ma)m(y)h(b)s(e)f(written)g(\(see)i(Section)f(4.2)g([Bash)g | |
18707 | (Builtins],)g(page)h(48\).)225 1596 y Fq(\017)60 b Fu(V)-8 | |
18708 | b(ariable)25 b(assignmen)m(ts)g(preceding)e(commands)h(a\013ect)h(only) | |
18709 | f(that)g(command,)h(ev)m(en)f(builtins)g(and)330 1705 | |
18710 | y(functions)36 b(\(see)h(Section)g(3.7.4)h([En)m(vironmen)m(t],)h(page) | |
fc527055 | 18711 | e(38\).)60 b(In)35 b Ft(sh)p Fu(,)j(all)f(v)-5 b(ariable)37 |
6e51e0d0 CR |
18712 | b(assignmen)m(ts)330 1815 y(preceding)30 b(commands)g(are)h(global)h |
18713 | (unless)d(the)i(command)f(is)h(executed)g(from)f(the)g(\014le)h | |
18714 | (system.)225 1943 y Fq(\017)60 b Fu(Bash)44 b(p)s(erforms)e(\014lename) | |
18715 | i(expansion)f(on)h(\014lenames)g(sp)s(eci\014ed)f(as)h(op)s(erands)e | |
18716 | (to)j(input)e(and)330 2052 y(output)30 b(redirection)h(op)s(erators)g | |
fc527055 | 18717 | (\(see)g(Section)g(3.6)h([Redirections],)g(page)f(32\).)225 |
6e51e0d0 CR |
18718 | 2180 y Fq(\017)60 b Fu(Bash)29 b(con)m(tains)h(the)f(`)p |
18719 | Ft(<>)p Fu(')f(redirection)i(op)s(erator,)f(allo)m(wing)i(a)e(\014le)g | |
18720 | (to)g(b)s(e)f(op)s(ened)g(for)h(b)s(oth)f(read-)330 2290 | |
18721 | y(ing)35 b(and)f(writing,)i(and)e(the)h(`)p Ft(&>)p Fu(')g(redirection) | |
18722 | g(op)s(erator,)h(for)f(directing)g(standard)f(output)h(and)330 | |
18723 | 2399 y(standard)30 b(error)g(to)h(the)f(same)h(\014le)f(\(see)i | |
fc527055 | 18724 | (Section)f(3.6)g([Redirections],)h(page)g(32\).)225 2527 |
6e51e0d0 CR |
18725 | y Fq(\017)60 b Fu(Bash)21 b(includes)f(the)h(`)p Ft(<<<)p |
18726 | Fu(')g(redirection)g(op)s(erator,)i(allo)m(wing)g(a)e(string)f(to)i(b)s | |
18727 | (e)e(used)g(as)h(the)g(standard)330 2637 y(input)29 b(to)j(a)e | |
18728 | (command.)225 2765 y Fq(\017)60 b Fu(Bash)32 b(implemen)m(ts)f(the)h(`) | |
18729 | p Ft([n]<&)p Fj(word)p Fu(')d(and)i(`)p Ft([n]>&)p Fj(word)p | |
18730 | Fu(')e(redirection)j(op)s(erators,)g(whic)m(h)f(mo)m(v)m(e)330 | |
18731 | 2874 y(one)g(\014le)f(descriptor)g(to)h(another.)225 | |
18732 | 3002 y Fq(\017)60 b Fu(Bash)25 b(treats)h(a)f(n)m(um)m(b)s(er)e(of)i | |
18733 | (\014lenames)g(sp)s(ecially)g(when)f(they)h(are)g(used)f(in)g | |
18734 | (redirection)i(op)s(erators)330 3112 y(\(see)31 b(Section)h(3.6)f | |
fc527055 | 18735 | ([Redirections],)h(page)f(32\).)225 3240 y Fq(\017)60 |
6e51e0d0 CR |
18736 | b Fu(Bash)33 b(can)f(op)s(en)g(net)m(w)m(ork)i(connections)f(to)h |
18737 | (arbitrary)e(mac)m(hines)h(and)f(services)h(with)f(the)h(redi-)330 | |
18738 | 3349 y(rection)e(op)s(erators)g(\(see)g(Section)g(3.6)h | |
fc527055 | 18739 | ([Redirections],)g(page)f(32\).)225 3477 y Fq(\017)60 |
6e51e0d0 | 18740 | b Fu(The)29 b Ft(noclobber)e Fu(option)j(is)g(a)m(v)-5 |
37c41ab1 | 18741 | b(ailable)32 b(to)e(a)m(v)m(oid)h(o)m(v)m(erwriting)g(existing)g |
ad4aef08 | 18742 | (\014les)e(with)h(output)f(redi-)330 3587 y(rection)39 |
fc527055 | 18743 | b(\(see)h(Section)f(4.3.1)h([The)e(Set)h(Builtin],)i(page)e(59\).)66 |
6e51e0d0 | 18744 | b(The)38 b(`)p Ft(>|)p Fu(')h(redirection)g(op)s(erator)330 |
ad4aef08 | 18745 | 3696 y(ma)m(y)31 b(b)s(e)f(used)f(to)i(o)m(v)m(erride)h |
6e51e0d0 CR |
18746 | Ft(noclobber)p Fu(.)225 3824 y Fq(\017)60 b Fu(The)34 |
18747 | b(Bash)g Ft(cd)g Fu(and)f Ft(pwd)g Fu(builtins)h(\(see)h(Section)g(4.1) | |
1101193a | 18748 | g([Bourne)g(Shell)f(Builtins],)h(page)g(41\))h(eac)m(h)330 |
6e51e0d0 CR |
18749 | 3934 y(tak)m(e)c Ft(-L)e Fu(and)f Ft(-P)h Fu(options)h(to)g(switc)m(h)g |
18750 | (b)s(et)m(w)m(een)g(logical)i(and)c(ph)m(ysical)i(mo)s(des.)225 | |
18751 | 4061 y Fq(\017)60 b Fu(Bash)25 b(allo)m(ws)h(a)g(function)e(to)i(o)m(v) | |
18752 | m(erride)g(a)g(builtin)e(with)h(the)g(same)g(name,)i(and)d(pro)m(vides) | |
18753 | h(access)h(to)330 4171 y(that)34 b(builtin's)f(functionalit)m(y)h | |
18754 | (within)f(the)g(function)g(via)h(the)f Ft(builtin)f Fu(and)g | |
18755 | Ft(command)g Fu(builtins)330 4281 y(\(see)f(Section)h(4.2)f([Bash)g | |
18756 | (Builtins],)g(page)g(48\).)225 4408 y Fq(\017)60 b Fu(The)35 | |
18757 | b Ft(command)e Fu(builtin)i(allo)m(ws)i(selectiv)m(e)h(disabling)e(of)f | |
18758 | (functions)g(when)g(command)g(lo)s(okup)g(is)330 4518 | |
18759 | y(p)s(erformed)29 b(\(see)i(Section)g(4.2)h([Bash)f(Builtins],)g(page)g | |
18760 | (48\).)225 4646 y Fq(\017)60 b Fu(Individual)23 b(builtins)g(ma)m(y)i | |
18761 | (b)s(e)e(enabled)h(or)g(disabled)g(using)f(the)h Ft(enable)f | |
18762 | Fu(builtin)g(\(see)i(Section)g(4.2)330 4756 y([Bash)31 | |
18763 | b(Builtins],)g(page)g(48\).)225 4883 y Fq(\017)60 b Fu(The)26 | |
18764 | b(Bash)h Ft(exec)e Fu(builtin)h(tak)m(es)i(additional)f(options)g(that) | |
d3ad40de | 18765 | g(allo)m(w)h(users)d(to)j(con)m(trol)g(the)e(con)m(ten)m(ts)330 |
ad4aef08 | 18766 | 4993 y(of)35 b(the)f(en)m(vironmen)m(t)h(passed)f(to)h(the)g(executed)g |
d3ad40de | 18767 | (command,)h(and)d(what)i(the)f(zeroth)h(argumen)m(t)330 |
ad4aef08 | 18768 | 5103 y(to)c(the)g(command)f(is)g(to)h(b)s(e)f(\(see)h(Section)h(4.1)f |
1101193a | 18769 | ([Bourne)f(Shell)h(Builtins],)g(page)g(41\).)225 5230 |
6e51e0d0 | 18770 | y Fq(\017)60 b Fu(Shell)29 b(functions)g(ma)m(y)h(b)s(e)f(exp)s(orted)g |
37c41ab1 | 18771 | (to)h(c)m(hildren)f(via)h(the)g(en)m(vironmen)m(t)g(using)f |
6e51e0d0 | 18772 | Ft(export)f(-f)h Fu(\(see)330 5340 y(Section)i(3.3)h([Shell)e(F)-8 |
c2fa6583 | 18773 | b(unctions],)32 b(page)f(17\).)p eop end |
900a813b CR |
18774 | %%Page: 152 158 |
18775 | TeXDict begin 152 157 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 18776 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
900a813b | 18777 | b(The)f(Bourne)g(Shell)1258 b(152)225 299 y Fq(\017)60 |
6e51e0d0 CR |
18778 | b Fu(The)40 b(Bash)h Ft(export)p Fu(,)h Ft(readonly)p |
18779 | Fu(,)f(and)g Ft(declare)d Fu(builtins)j(can)g(tak)m(e)h(a)f | |
18780 | Ft(-f)f Fu(option)i(to)f(act)h(on)330 408 y(shell)30 | |
18781 | b(functions,)f(a)h Ft(-p)f Fu(option)g(to)i(displa)m(y)e(v)-5 | |
18782 | b(ariables)30 b(with)f(v)-5 b(arious)30 b(attributes)g(set)g(in)f(a)h | |
18783 | (format)330 518 y(that)g(can)g(b)s(e)f(used)g(as)g(shell)h(input,)f(a)h | |
18784 | Ft(-n)f Fu(option)h(to)g(remo)m(v)m(e)h(v)-5 b(arious)30 | |
18785 | b(v)-5 b(ariable)30 b(attributes,)h(and)330 628 y(`)p | |
18786 | Ft(name=value)p Fu(')d(argumen)m(ts)j(to)g(set)g(v)-5 | |
37c41ab1 | 18787 | b(ariable)31 b(attributes)g(and)f(v)-5 b(alues)30 b(sim)m(ultaneously) |
6e51e0d0 CR |
18788 | -8 b(.)225 765 y Fq(\017)60 b Fu(The)42 b(Bash)h Ft(hash)f |
18789 | Fu(builtin)g(allo)m(ws)j(a)e(name)g(to)g(b)s(e)f(asso)s(ciated)j(with)d | |
1c72c0cd | 18790 | (an)h(arbitrary)f(\014lename,)330 874 y(ev)m(en)30 b(when)e(that)h |
37c41ab1 | 18791 | (\014lename)g(cannot)h(b)s(e)e(found)g(b)m(y)h(searc)m(hing)g(the)g |
6e51e0d0 | 18792 | Ft($PATH)p Fu(,)g(using)f(`)p Ft(hash)h(-p)p Fu(')g(\(see)330 |
1101193a | 18793 | 984 y(Section)i(4.1)h([Bourne)e(Shell)g(Builtins],)h(page)h(41\).)225 |
6e51e0d0 CR |
18794 | 1121 y Fq(\017)60 b Fu(Bash)27 b(includes)f(a)i Ft(help)d |
18795 | Fu(builtin)i(for)f(quic)m(k)h(reference)h(to)f(shell)g(facilities)i | |
1101193a | 18796 | (\(see)f(Section)g(4.2)g([Bash)330 1230 y(Builtins],)j(page)g(48\).)225 |
6e51e0d0 | 18797 | 1367 y Fq(\017)60 b Fu(The)42 b Ft(printf)g Fu(builtin)g(is)h(a)m(v)-5 |
37c41ab1 | 18798 | b(ailable)45 b(to)f(displa)m(y)f(formatted)g(output)g(\(see)h(Section)g |
1101193a | 18799 | (4.2)g([Bash)330 1477 y(Builtins],)31 b(page)g(48\).)225 |
6e51e0d0 | 18800 | 1614 y Fq(\017)60 b Fu(The)26 b(Bash)h Ft(read)f Fu(builtin)g(\(see)i |
1101193a | 18801 | (Section)g(4.2)g([Bash)f(Builtins],)h(page)g(48\))g(will)f(read)g(a)g |
6e51e0d0 CR |
18802 | (line)g(ending)330 1724 y(in)i(`)p Ft(\\)p Fu(')h(with)f(the)g |
18803 | Ft(-r)g Fu(option,)i(and)d(will)i(use)f(the)h Ft(REPLY)e | |
18804 | Fu(v)-5 b(ariable)30 b(as)g(a)f(default)h(if)f(no)h(non-option)330 | |
18805 | 1833 y(argumen)m(ts)h(are)h(supplied.)42 b(The)30 b(Bash)i | |
18806 | Ft(read)e Fu(builtin)g(also)j(accepts)f(a)g(prompt)e(string)h(with)g | |
18807 | (the)330 1943 y Ft(-p)c Fu(option)h(and)f(will)g(use)h(Readline)g(to)g | |
18808 | (obtain)g(the)g(line)f(when)g(giv)m(en)h(the)g Ft(-e)f | |
18809 | Fu(option.)40 b(The)27 b Ft(read)330 2052 y Fu(builtin)h(also)i(has)e | |
18810 | (additional)i(options)f(to)g(con)m(trol)h(input:)39 b(the)29 | |
18811 | b Ft(-s)f Fu(option)h(will)g(turn)e(o\013)j(ec)m(hoing)330 | |
18812 | 2162 y(of)f(input)f(c)m(haracters)j(as)e(they)g(are)h(read,)f(the)g | |
18813 | Ft(-t)g Fu(option)g(will)h(allo)m(w)g Ft(read)e Fu(to)i(time)g(out)f | |
18814 | (if)g(input)330 2271 y(do)s(es)i(not)h(arriv)m(e)g(within)f(a)h(sp)s | |
18815 | (eci\014ed)f(n)m(um)m(b)s(er)f(of)i(seconds,)g(the)f | |
18816 | Ft(-n)g Fu(option)h(will)g(allo)m(w)h(reading)330 2381 | |
18817 | y(only)38 b(a)g(sp)s(eci\014ed)f(n)m(um)m(b)s(er)f(of)i(c)m(haracters)h | |
18818 | (rather)e(than)g(a)h(full)g(line,)i(and)d(the)h Ft(-d)f | |
18819 | Fu(option)h(will)330 2491 y(read)30 b(un)m(til)h(a)g(particular)f(c)m | |
18820 | (haracter)i(rather)f(than)f(newline.)225 2628 y Fq(\017)60 | |
18821 | b Fu(The)33 b Ft(return)e Fu(builtin)i(ma)m(y)g(b)s(e)g(used)f(to)i(ab) | |
18822 | s(ort)f(execution)h(of)f(scripts)g(executed)h(with)f(the)g | |
18823 | Ft(.)g Fu(or)330 2737 y Ft(source)c Fu(builtins)g(\(see)j(Section)f | |
18824 | (4.1)g([Bourne)g(Shell)f(Builtins],)h(page)g(41\).)225 | |
18825 | 2874 y Fq(\017)60 b Fu(Bash)43 b(includes)g(the)g Ft(shopt)f | |
18826 | Fu(builtin,)k(for)d(\014ner)f(con)m(trol)j(of)e(shell)h(optional)g | |
d3ad40de | 18827 | (capabilities)h(\(see)330 2984 y(Section)c(4.3.2)g([The)f(Shopt)f |
fc527055 | 18828 | (Builtin],)k(page)d(63\),)k(and)39 b(allo)m(ws)i(these)f(options)h(to)f |
d3ad40de CR |
18829 | (b)s(e)f(set)i(and)330 3093 y(unset)30 b(at)h(shell)g(in)m(v)m(o)s |
18830 | (cation)h(\(see)f(Section)h(6.1)f([In)m(v)m(oking)g(Bash],)g(page)h | |
900a813b | 18831 | (81\).)225 3230 y Fq(\017)60 b Fu(Bash)45 b(has)f(m)m(uc)m(h)g(more)h |
d3ad40de | 18832 | (optional)h(b)s(eha)m(vior)e(con)m(trollable)j(with)e(the)f |
6e51e0d0 | 18833 | Ft(set)g Fu(builtin)g(\(see)h(Sec-)330 3340 y(tion)31 |
fc527055 | 18834 | b(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(59\).)225 3477 |
6e51e0d0 CR |
18835 | y Fq(\017)60 b Fu(The)31 b(`)p Ft(-x)p Fu(')g(\()p Ft(xtrace)p |
18836 | Fu(\))g(option)h(displa)m(ys)f(commands)h(other)f(than)h(simple)f | |
18837 | (commands)g(when)g(p)s(er-)330 3587 y(forming)f(an)g(execution)i(trace) | |
fc527055 | 18838 | f(\(see)h(Section)f(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(59\).)225 |
6e51e0d0 | 18839 | 3724 y Fq(\017)60 b Fu(The)28 b Ft(test)g Fu(builtin)h(\(see)h(Section) |
1101193a | 18840 | f(4.1)h([Bourne)f(Shell)g(Builtins],)h(page)g(41\))g(is)f(sligh)m(tly)h |
1c72c0cd | 18841 | (di\013eren)m(t,)330 3833 y(as)23 b(it)g(implemen)m(ts)f(the)h |
6e51e0d0 | 18842 | Fm(posix)f Fu(algorithm,)j(whic)m(h)d(sp)s(eci\014es)g(the)h(b)s(eha)m |
1c72c0cd | 18843 | (vior)f(based)g(on)h(the)f(n)m(um)m(b)s(er)330 3943 y(of)31 |
6e51e0d0 CR |
18844 | b(argumen)m(ts.)225 4080 y Fq(\017)60 b Fu(Bash)31 b(includes)g(the)h |
18845 | Ft(caller)d Fu(builtin,)j(whic)m(h)f(displa)m(ys)g(the)g(con)m(text)i | |
1c72c0cd | 18846 | (of)f(an)m(y)g(activ)m(e)h(subroutine)330 4189 y(call)28 |
37c41ab1 | 18847 | b(\(a)f(shell)f(function)h(or)f(a)h(script)f(executed)h(with)f(the)h |
6e51e0d0 | 18848 | Ft(.)f Fu(or)g Ft(source)f Fu(builtins\).)39 b(This)26 |
1c72c0cd | 18849 | b(supp)s(orts)330 4299 y(the)31 b(bash)e(debugger.)225 |
6e51e0d0 | 18850 | 4436 y Fq(\017)60 b Fu(The)42 b Ft(trap)f Fu(builtin)h(\(see)i(Section) |
1101193a | 18851 | f(4.1)h([Bourne)e(Shell)g(Builtins],)47 b(page)c(41\))h(allo)m(ws)g(a)e |
6e51e0d0 CR |
18852 | Ft(DEBUG)330 4545 y Fu(pseudo-signal)c(sp)s(eci\014cation,)i(similar)e |
18853 | (to)g Ft(EXIT)p Fu(.)62 b(Commands)36 b(sp)s(eci\014ed)h(with)g(a)h | |
18854 | Ft(DEBUG)e Fu(trap)330 4655 y(are)k(executed)g(b)s(efore)f(ev)m(ery)h | |
18855 | (simple)f(command,)j Ft(for)c Fu(command,)k Ft(case)c | |
18856 | Fu(command,)k Ft(select)330 4765 y Fu(command,)35 b(ev)m(ery)g | |
18857 | (arithmetic)g Ft(for)e Fu(command,)i(and)f(b)s(efore)g(the)g(\014rst)f | |
1c72c0cd | 18858 | (command)h(executes)h(in)330 4874 y(a)29 b(shell)g(function.)40 |
6e51e0d0 | 18859 | b(The)28 b Ft(DEBUG)g Fu(trap)g(is)h(not)g(inherited)f(b)m(y)h(shell)g |
1c72c0cd | 18860 | (functions)f(unless)g(the)h(function)330 4984 y(has)35 |
6e51e0d0 CR |
18861 | b(b)s(een)g(giv)m(en)i(the)f Ft(trace)e Fu(attribute)i(or)g(the)g |
18862 | Ft(functrace)d Fu(option)j(has)f(b)s(een)g(enabled)g(using)330 | |
18863 | 5093 y(the)28 b Ft(shopt)e Fu(builtin.)39 b(The)27 b | |
18864 | Ft(extdebug)f Fu(shell)i(option)g(has)f(additional)h(e\013ects)h(on)f | |
18865 | (the)g Ft(DEBUG)e Fu(trap.)330 5230 y(The)21 b Ft(trap)e | |
18866 | Fu(builtin)i(\(see)h(Section)g(4.1)g([Bourne)f(Shell)g(Builtins],)j | |
18867 | (page)e(41\))g(allo)m(ws)g(an)f Ft(ERR)f Fu(pseudo-)330 | |
1c72c0cd | 18868 | 5340 y(signal)30 b(sp)s(eci\014cation,)h(similar)f(to)g |
6e51e0d0 CR |
18869 | Ft(EXIT)f Fu(and)g Ft(DEBUG)p Fu(.)39 b(Commands)28 b(sp)s(eci\014ed)h |
18870 | (with)g(an)g Ft(ERR)g Fu(trap)p eop end | |
900a813b CR |
18871 | %%Page: 153 159 |
18872 | TeXDict begin 153 158 bop 150 -116 a Fu(App)s(endix)29 | |
1c72c0cd | 18873 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
900a813b | 18874 | b(The)f(Bourne)g(Shell)1258 b(153)330 299 y(are)40 b(executed)g(after)g |
1c72c0cd | 18875 | (a)f(simple)h(command)f(fails,)j(with)d(a)h(few)f(exceptions.)68 |
6e51e0d0 CR |
18876 | b(The)39 b Ft(ERR)g Fu(trap)g(is)330 408 y(not)g(inherited)f(b)m(y)h |
18877 | (shell)g(functions)f(unless)g(the)h Ft(-o)29 b(errtrace)37 | |
18878 | b Fu(option)i(to)g(the)g Ft(set)f Fu(builtin)g(is)330 | |
18879 | 518 y(enabled.)330 650 y(The)g Ft(trap)g Fu(builtin)h(\(see)g(Section)h | |
1101193a | 18880 | (4.1)g([Bourne)f(Shell)g(Builtins],)i(page)f(41\))g(allo)m(ws)g(a)g |
967625cd | 18881 | Ft(RETURN)330 759 y Fu(pseudo-signal)35 b(sp)s(eci\014cation,)j |
6e51e0d0 | 18882 | (similar)d(to)h Ft(EXIT)e Fu(and)g Ft(DEBUG)p Fu(.)54 |
c302751c | 18883 | b(Commands)34 b(sp)s(eci\014ed)g(with)h(an)330 869 y |
6e51e0d0 | 18884 | Ft(RETURN)k Fu(trap)i(are)g(executed)h(b)s(efore)e(execution)i(resumes) |
967625cd | 18885 | e(after)h(a)g(shell)g(function)g(or)g(a)g(shell)330 978 |
6e51e0d0 CR |
18886 | y(script)36 b(executed)g(with)g Ft(.)f Fu(or)h Ft(source)e |
18887 | Fu(returns.)56 b(The)35 b Ft(RETURN)f Fu(trap)i(is)g(not)g(inherited)f | |
c302751c | 18888 | (b)m(y)h(shell)330 1088 y(functions)k(unless)h(the)g(function)f(has)h |
6e51e0d0 CR |
18889 | (b)s(een)f(giv)m(en)i(the)f Ft(trace)e Fu(attribute)j(or)e(the)h |
18890 | Ft(functrace)330 1198 y Fu(option)31 b(has)f(b)s(een)g(enabled)g(using) | |
967625cd | 18891 | g(the)g Ft(shopt)f Fu(builtin.)225 1329 y Fq(\017)60 |
6e51e0d0 | 18892 | b Fu(The)30 b(Bash)g Ft(type)f Fu(builtin)h(is)g(more)g(extensiv)m(e)i |
37c41ab1 | 18893 | (and)d(giv)m(es)j(more)e(information)h(ab)s(out)f(the)g(names)330 |
967625cd CR |
18894 | 1439 y(it)h(\014nds)e(\(see)i(Section)g(4.2)h([Bash)e(Builtins],)i |
18895 | (page)f(48\).)225 1570 y Fq(\017)60 b Fu(The)27 b(Bash)h | |
6e51e0d0 CR |
18896 | Ft(umask)e Fu(builtin)h(p)s(ermits)g(a)h Ft(-p)f Fu(option)h(to)h |
18897 | (cause)f(the)g(output)f(to)h(b)s(e)f(displa)m(y)m(ed)h(in)g(the)330 | |
967625cd | 18898 | 1680 y(form)i(of)h(a)g Ft(umask)f Fu(command)g(that)i(ma)m(y)f(b)s(e)f |
6e51e0d0 | 18899 | (reused)g(as)h(input)f(\(see)i(Section)f(4.1)h([Bourne)f(Shell)330 |
967625cd | 18900 | 1789 y(Builtins],)g(page)g(41\).)225 1921 y Fq(\017)60 |
6e51e0d0 CR |
18901 | b Fu(Bash)34 b(implemen)m(ts)h(a)g Ft(csh)p Fu(-lik)m(e)g(directory)f |
18902 | (stac)m(k,)j(and)d(pro)m(vides)g(the)g Ft(pushd)p Fu(,)g | |
967625cd | 18903 | Ft(popd)p Fu(,)g(and)g Ft(dirs)330 2030 y Fu(builtins)g(to)i |
6e51e0d0 | 18904 | (manipulate)f(it)h(\(see)f(Section)h(6.8)g([The)f(Directory)h(Stac)m |
967625cd | 18905 | (k],)i(page)d(91\).)56 b(Bash)35 b(also)330 2140 y(mak)m(es)c(the)g |
6e51e0d0 CR |
18906 | (directory)g(stac)m(k)g(visible)g(as)g(the)f(v)-5 b(alue)31 |
18907 | b(of)g(the)f Ft(DIRSTACK)f Fu(shell)h(v)-5 b(ariable.)225 | |
967625cd | 18908 | 2272 y Fq(\017)60 b Fu(Bash)28 b(in)m(terprets)h(sp)s(ecial)g(bac)m |
6e51e0d0 | 18909 | (kslash-escap)s(ed)g(c)m(haracters)g(in)f(the)h(prompt)e(strings)h |
967625cd | 18910 | (when)f(in)m(ter-)330 2381 y(activ)m(e)33 b(\(see)e(Section)g(6.9)h |
900a813b | 18911 | ([Con)m(trolling)f(the)g(Prompt],)f(page)h(93\).)225 |
967625cd | 18912 | 2513 y Fq(\017)60 b Fu(The)46 b(Bash)h(restricted)g(mo)s(de)f(is)h |
1c72c0cd | 18913 | (more)f(useful)g(\(see)h(Section)h(6.10)g([The)e(Restricted)i(Shell],) |
967625cd CR |
18914 | 330 2622 y(page)31 b(94\);)h(the)f(SVR4.2)g(shell)f(restricted)h(mo)s |
18915 | (de)f(is)h(to)s(o)g(limited.)225 2754 y Fq(\017)60 b | |
6e51e0d0 | 18916 | Fu(The)30 b Ft(disown)f Fu(builtin)h(can)h(remo)m(v)m(e)h(a)f(job)f |
1c72c0cd | 18917 | (from)g(the)h(in)m(ternal)g(shell)g(job)f(table)i(\(see)f(Section)h |
967625cd | 18918 | (7.2)330 2863 y([Job)e(Con)m(trol)h(Builtins],)g(page)g(100\))g(or)g |
900a813b | 18919 | (suppress)d(the)i(sending)g(of)g Ft(SIGHUP)e Fu(to)j(a)g(job)f(when)f |
967625cd CR |
18920 | (the)330 2973 y(shell)i(exits)g(as)f(the)h(result)f(of)h(a)f |
18921 | Ft(SIGHUP)p Fu(.)225 3104 y Fq(\017)60 b Fu(Bash)31 b(includes)f(a)g(n) | |
1c72c0cd | 18922 | m(um)m(b)s(er)f(of)i(features)g(to)g(supp)s(ort)d(a)j(separate)g |
967625cd | 18923 | (debugger)f(for)h(shell)f(scripts.)225 3236 y Fq(\017)60 |
6e51e0d0 CR |
18924 | b Fu(The)28 b(SVR4.2)h(shell)f(has)g(t)m(w)m(o)i(privilege-related)g |
18925 | (builtins)e(\()p Ft(mldmode)e Fu(and)i Ft(priv)p Fu(\))f(not)i(presen)m | |
967625cd | 18926 | (t)f(in)330 3346 y(Bash.)225 3477 y Fq(\017)60 b Fu(Bash)31 |
6e51e0d0 | 18927 | b(do)s(es)f(not)g(ha)m(v)m(e)i(the)e Ft(stop)g Fu(or)g |
967625cd | 18928 | Ft(newgrp)f Fu(builtins.)225 3609 y Fq(\017)60 b Fu(Bash)31 |
6e51e0d0 | 18929 | b(do)s(es)f(not)g(use)g(the)h Ft(SHACCT)d Fu(v)-5 b(ariable)32 |
967625cd | 18930 | b(or)e(p)s(erform)f(shell)i(accoun)m(ting.)225 3740 y |
6e51e0d0 CR |
18931 | Fq(\017)60 b Fu(The)30 b(SVR4.2)h Ft(sh)f Fu(uses)g(a)g |
18932 | Ft(TIMEOUT)f Fu(v)-5 b(ariable)31 b(lik)m(e)h(Bash)e(uses)g | |
967625cd | 18933 | Ft(TMOUT)p Fu(.)150 3894 y(More)h(features)g(unique)e(to)i(Bash)g(ma)m |
1c72c0cd | 18934 | (y)g(b)s(e)f(found)f(in)h(Chapter)f(6)i([Bash)g(F)-8 |
967625cd | 18935 | b(eatures],)32 b(page)f(81.)150 4128 y Fs(B.1)67 b(Implemen)l(tation)48 |
c302751c | 18936 | b(Di\013erences)e(F)-11 b(rom)44 b(The)h(SVR4.2)g(Shell)150 |
967625cd | 18937 | 4288 y Fu(Since)33 b(Bash)h(is)f(a)g(completely)i(new)e(implemen)m |
c302751c | 18938 | (tation,)j(it)e(do)s(es)e(not)i(su\013er)e(from)h(man)m(y)g(of)h(the)f |
967625cd CR |
18939 | (limi-)150 4397 y(tations)f(of)e(the)h(SVR4.2)g(shell.)41 |
18940 | b(F)-8 b(or)31 b(instance:)225 4529 y Fq(\017)60 b Fu(Bash)32 | |
37c41ab1 CR |
18941 | b(do)s(es)f(not)h(fork)f(a)h(subshell)e(when)h(redirecting)h(in)m(to)h |
18942 | (or)e(out)h(of)g(a)g(shell)f(con)m(trol)i(structure)330 | |
967625cd | 18943 | 4639 y(suc)m(h)d(as)h(an)f Ft(if)g Fu(or)g Ft(while)f |
6e51e0d0 | 18944 | Fu(statemen)m(t.)225 4770 y Fq(\017)60 b Fu(Bash)29 b(do)s(es)f(not)h |
37c41ab1 | 18945 | (allo)m(w)h(un)m(balanced)f(quotes.)41 b(The)28 b(SVR4.2)h(shell)g |
967625cd | 18946 | (will)g(silen)m(tly)i(insert)d(a)h(needed)330 4880 y(closing)g(quote)g |
6e51e0d0 | 18947 | (at)f Ft(EOF)f Fu(under)g(certain)h(circumstances.)41 |
37c41ab1 | 18948 | b(This)27 b(can)h(b)s(e)g(the)g(cause)g(of)g(some)h(hard-)330 |
6e51e0d0 | 18949 | 4989 y(to-\014nd)h(errors.)225 5121 y Fq(\017)60 b Fu(The)45 |
37c41ab1 | 18950 | b(SVR4.2)h(shell)f(uses)g(a)g(baro)s(que)g(memory)g(managemen)m(t)i(sc) |
6e51e0d0 CR |
18951 | m(heme)e(based)g(on)g(trapping)330 5230 y Ft(SIGSEGV)p |
18952 | Fu(.)57 b(If)35 b(the)i(shell)f(is)h(started)g(from)e(a)i(pro)s(cess)f | |
18953 | (with)g Ft(SIGSEGV)e Fu(blo)s(c)m(k)m(ed)k(\(e.g.,)h(b)m(y)d(using)330 | |
18954 | 5340 y(the)31 b Ft(system\(\))d Fu(C)i(library)g(function)g(call\),)i | |
1c72c0cd | 18955 | (it)f(misb)s(eha)m(v)m(es)g(badly)-8 b(.)p eop end |
900a813b CR |
18956 | %%Page: 154 160 |
18957 | TeXDict begin 154 159 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 18958 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
900a813b | 18959 | b(The)f(Bourne)g(Shell)1258 b(154)225 299 y Fq(\017)60 |
6e51e0d0 CR |
18960 | b Fu(In)30 b(a)i(questionable)g(attempt)g(at)g(securit)m(y)-8 |
18961 | b(,)33 b(the)e(SVR4.2)h(shell,)g(when)e(in)m(v)m(ok)m(ed)j(without)e | |
18962 | (the)h Ft(-p)330 408 y Fu(option,)39 b(will)d(alter)i(its)e(real)h(and) | |
18963 | f(e\013ectiv)m(e)j Fm(uid)d Fu(and)g Fm(gid)h Fu(if)f(they)h(are)f | |
18964 | (less)h(than)f(some)h(magic)330 518 y(threshold)30 b(v)-5 | |
18965 | b(alue,)31 b(commonly)g(100.)42 b(This)29 b(can)i(lead)g(to)g(unexp)s | |
18966 | (ected)f(results.)225 653 y Fq(\017)60 b Fu(The)30 b(SVR4.2)h(shell)g | |
18967 | (do)s(es)f(not)g(allo)m(w)i(users)e(to)h(trap)f Ft(SIGSEGV)p | |
18968 | Fu(,)f Ft(SIGALRM)p Fu(,)f(or)j Ft(SIGCHLD)p Fu(.)225 | |
18969 | 787 y Fq(\017)60 b Fu(The)34 b(SVR4.2)h(shell)g(do)s(es)g(not)f(allo)m | |
18970 | (w)j(the)d Ft(IFS)p Fu(,)h Ft(MAILCHECK)p Fu(,)f Ft(PATH)p | |
18971 | Fu(,)h Ft(PS1)p Fu(,)g(or)f Ft(PS2)g Fu(v)-5 b(ariables)35 | |
18972 | b(to)330 897 y(b)s(e)30 b(unset.)225 1031 y Fq(\017)60 | |
18973 | b Fu(The)30 b(SVR4.2)h(shell)g(treats)g(`)p Ft(^)p Fu(')f(as)h(the)g | |
18974 | (undo)s(cumen)m(ted)e(equiv)-5 b(alen)m(t)31 b(of)g(`)p | |
18975 | Ft(|)p Fu('.)225 1166 y Fq(\017)60 b Fu(Bash)37 b(allo)m(ws)h(m)m | |
18976 | (ultiple)f(option)g(argumen)m(ts)g(when)e(it)i(is)g(in)m(v)m(ok)m(ed)h | |
18977 | (\()p Ft(-x)30 b(-v)p Fu(\);)40 b(the)c(SVR4.2)i(shell)330 | |
1c72c0cd | 18978 | 1275 y(allo)m(ws)c(only)f(one)g(option)g(argumen)m(t)g(\()p |
6e51e0d0 | 18979 | Ft(-xv)p Fu(\).)47 b(In)32 b(fact,)i(some)f(v)m(ersions)g(of)g(the)g |
1c72c0cd | 18980 | (shell)f(dump)f(core)330 1385 y(if)f(the)h(second)f(argumen)m(t)h(b)s |
6e51e0d0 CR |
18981 | (egins)f(with)g(a)h(`)p Ft(-)p Fu('.)225 1519 y Fq(\017)60 |
18982 | b Fu(The)26 b(SVR4.2)i(shell)f(exits)g(a)g(script)g(if)g(an)m(y)g | |
ac18b312 | 18983 | (builtin)f(fails;)j(Bash)e(exits)g(a)g(script)g(only)g(if)g(one)g(of)g |
6e51e0d0 | 18984 | (the)330 1629 y Fm(posix)34 b Fu(sp)s(ecial)h(builtins)f(fails,)i(and)e |
ac18b312 | 18985 | (only)h(for)f(certain)h(failures,)h(as)f(en)m(umerated)g(in)f(the)h |
6e51e0d0 CR |
18986 | Fm(posix)330 1738 y Fu(standard.)225 1873 y Fq(\017)60 |
18987 | b Fu(The)30 b(SVR4.2)h(shell)g(b)s(eha)m(v)m(es)f(di\013eren)m(tly)h | |
18988 | (when)f(in)m(v)m(ok)m(ed)i(as)e Ft(jsh)g Fu(\(it)h(turns)e(on)h(job)g | |
ac18b312 | 18989 | (con)m(trol\).)p eop end |
900a813b | 18990 | %%Page: 155 161 |
037a8b7f CR |
18991 | TeXDict begin 155 160 bop 3614 -116 a Fu(155)150 299 |
18992 | y Fp(App)t(endix)52 b(C)81 b(GNU)54 b(F)-13 b(ree)53 | |
18993 | b(Do)t(cumen)l(tation)e(License)1359 502 y Fu(V)-8 b(ersion)31 | |
18994 | b(1.3,)g(3)g(No)m(v)m(em)m(b)s(er)h(2008)390 635 y(Cop)m(yrigh)m(t)842 | |
18995 | 632 y(c)817 635 y Fq(\015)e Fu(2000,)j(2001,)f(2002,)g(2007,)h(2008)f | |
18996 | (F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 b(oundation,)31 | |
18997 | b(Inc.)390 745 y Ft(http://fsf.org/)390 964 y Fu(Ev)m(ery)m(one)g(is)g | |
18998 | (p)s(ermitted)f(to)h(cop)m(y)g(and)f(distribute)g(v)m(erbatim)h(copies) | |
18999 | 390 1074 y(of)g(this)f(license)h(do)s(cumen)m(t,)g(but)e(c)m(hanging)j | |
19000 | (it)f(is)f(not)h(allo)m(w)m(ed.)199 1207 y(0.)61 b(PREAMBLE)330 | |
1231ac47 CR |
19001 | 1340 y(The)37 b(purp)s(ose)e(of)i(this)g(License)h(is)f(to)h(mak)m(e)g |
19002 | (a)g(man)m(ual,)h(textb)s(o)s(ok,)h(or)d(other)g(functional)h(and)330 | |
6e51e0d0 | 19003 | 1450 y(useful)29 b(do)s(cumen)m(t)h Fr(free)36 b Fu(in)29 |
37c41ab1 | 19004 | b(the)i(sense)f(of)g(freedom:)41 b(to)31 b(assure)e(ev)m(ery)m(one)j |
c2a47ea9 | 19005 | (the)e(e\013ectiv)m(e)j(freedom)330 1559 y(to)f(cop)m(y)g(and)f |
37c41ab1 | 19006 | (redistribute)g(it,)h(with)g(or)f(without)g(mo)s(difying)g(it,)i |
c2a47ea9 | 19007 | (either)f(commercially)h(or)e(non-)330 1669 y(commercially)-8 |
37c41ab1 | 19008 | b(.)56 b(Secondarily)-8 b(,)36 b(this)f(License)g(preserv)m(es)g(for)f |
c2a47ea9 | 19009 | (the)h(author)f(and)g(publisher)f(a)i(w)m(a)m(y)330 1778 |
37c41ab1 CR |
19010 | y(to)i(get)g(credit)g(for)f(their)g(w)m(ork,)i(while)e(not)g(b)s(eing)g |
19011 | (considered)g(resp)s(onsible)f(for)h(mo)s(di\014cations)330 | |
c2a47ea9 | 19012 | 1888 y(made)30 b(b)m(y)h(others.)330 2021 y(This)22 b(License)i(is)f(a) |
37c41ab1 CR |
19013 | h(kind)e(of)i(\\cop)m(yleft",)j(whic)m(h)c(means)g(that)h(deriv)-5 |
19014 | b(ativ)m(e)24 b(w)m(orks)f(of)h(the)f(do)s(cumen)m(t)330 | |
c2a47ea9 | 19015 | 2131 y(m)m(ust)34 b(themselv)m(es)h(b)s(e)e(free)h(in)g(the)g(same)g |
37c41ab1 | 19016 | (sense.)51 b(It)34 b(complemen)m(ts)h(the)f(GNU)g(General)h(Public)330 |
c2a47ea9 CR |
19017 | 2240 y(License,)c(whic)m(h)f(is)h(a)f(cop)m(yleft)i(license)g(designed) |
19018 | e(for)g(free)h(soft)m(w)m(are.)330 2373 y(W)-8 b(e)31 | |
37c41ab1 CR |
19019 | b(ha)m(v)m(e)f(designed)g(this)f(License)h(in)f(order)g(to)i(use)e(it)h |
19020 | (for)f(man)m(uals)h(for)f(free)h(soft)m(w)m(are,)h(b)s(ecause)330 | |
c2a47ea9 | 19021 | 2483 y(free)42 b(soft)m(w)m(are)i(needs)e(free)g(do)s(cumen)m(tation:) |
37c41ab1 | 19022 | 65 b(a)42 b(free)h(program)f(should)f(come)i(with)f(man)m(uals)330 |
c2a47ea9 | 19023 | 2592 y(pro)m(viding)29 b(the)g(same)g(freedoms)f(that)i(the)f(soft)m(w) |
37c41ab1 | 19024 | m(are)h(do)s(es.)40 b(But)29 b(this)f(License)i(is)f(not)g(limited)g |
c2a47ea9 | 19025 | (to)330 2702 y(soft)m(w)m(are)j(man)m(uals;)f(it)g(can)g(b)s(e)f(used)g |
37c41ab1 | 19026 | (for)g(an)m(y)h(textual)h(w)m(ork,)f(regardless)g(of)g(sub)5 |
c2a47ea9 | 19027 | b(ject)30 b(matter)i(or)330 2812 y(whether)f(it)h(is)f(published)f(as)i |
37c41ab1 | 19028 | (a)f(prin)m(ted)g(b)s(o)s(ok.)44 b(W)-8 b(e)32 b(recommend)f(this)h |
c2a47ea9 CR |
19029 | (License)g(principally)f(for)330 2921 y(w)m(orks)f(whose)h(purp)s(ose)d |
19030 | (is)j(instruction)f(or)g(reference.)199 3054 y(1.)61 | |
19031 | b(APPLICABILITY)29 b(AND)j(DEFINITIONS)330 3187 y(This)39 | |
37c41ab1 | 19032 | b(License)i(applies)f(to)g(an)m(y)h(man)m(ual)f(or)g(other)g(w)m(ork,)i |
c2a47ea9 | 19033 | (in)e(an)m(y)g(medium,)i(that)e(con)m(tains)i(a)330 3297 |
37c41ab1 CR |
19034 | y(notice)h(placed)f(b)m(y)f(the)h(cop)m(yrigh)m(t)h(holder)e(sa)m(ying) |
19035 | h(it)g(can)g(b)s(e)f(distributed)f(under)g(the)i(terms)330 | |
c2a47ea9 | 19036 | 3407 y(of)c(this)f(License.)62 b(Suc)m(h)37 b(a)h(notice)h(gran)m(ts)f |
37c41ab1 | 19037 | (a)g(w)m(orld-wide,)h(ro)m(y)m(alt)m(y-free)i(license,)f(unlimited)d |
c2a47ea9 | 19038 | (in)330 3516 y(duration,)49 b(to)d(use)f(that)g(w)m(ork)h(under)d(the)j |
37c41ab1 | 19039 | (conditions)f(stated)h(herein.)85 b(The)45 b(\\Do)s(cumen)m(t",)330 |
c2a47ea9 | 19040 | 3626 y(b)s(elo)m(w,)29 b(refers)f(to)h(an)m(y)g(suc)m(h)f(man)m(ual)h |
37c41ab1 | 19041 | (or)f(w)m(ork.)40 b(An)m(y)29 b(mem)m(b)s(er)e(of)i(the)f(public)g(is)g |
c2a47ea9 | 19042 | (a)h(licensee,)i(and)330 3735 y(is)25 b(addressed)f(as)h(\\y)m(ou".)40 |
37c41ab1 CR |
19043 | b(Y)-8 b(ou)26 b(accept)g(the)f(license)h(if)f(y)m(ou)h(cop)m(y)-8 |
19044 | b(,)27 b(mo)s(dify)d(or)h(distribute)g(the)g(w)m(ork)330 | |
c2a47ea9 CR |
19045 | 3845 y(in)30 b(a)h(w)m(a)m(y)g(requiring)f(p)s(ermission)f(under)g(cop) |
19046 | m(yrigh)m(t)j(la)m(w.)330 3978 y(A)i(\\Mo)s(di\014ed)f(V)-8 | |
37c41ab1 | 19047 | b(ersion")35 b(of)f(the)g(Do)s(cumen)m(t)g(means)g(an)m(y)g(w)m(ork)f |
c2a47ea9 | 19048 | (con)m(taining)j(the)e(Do)s(cumen)m(t)g(or)330 4088 y(a)k(p)s(ortion)f |
37c41ab1 | 19049 | (of)h(it,)i(either)e(copied)g(v)m(erbatim,)i(or)d(with)h(mo)s |
c2a47ea9 CR |
19050 | (di\014cations)f(and/or)h(translated)g(in)m(to)330 4197 |
19051 | y(another)31 b(language.)330 4330 y(A)26 b(\\Secondary)g(Section")h(is) | |
37c41ab1 | 19052 | f(a)h(named)e(app)s(endix)f(or)i(a)h(fron)m(t-matter)g(section)g(of)f |
c2a47ea9 | 19053 | (the)g(Do)s(cumen)m(t)330 4440 y(that)c(deals)g(exclusiv)m(ely)h(with)e |
37c41ab1 | 19054 | (the)g(relationship)h(of)f(the)h(publishers)d(or)i(authors)g(of)h(the)f |
c2a47ea9 | 19055 | (Do)s(cumen)m(t)330 4549 y(to)38 b(the)f(Do)s(cumen)m(t's)i(o)m(v)m |
37c41ab1 | 19056 | (erall)g(sub)5 b(ject)37 b(\(or)h(to)g(related)g(matters\))g(and)f(con) |
c2a47ea9 | 19057 | m(tains)h(nothing)f(that)330 4659 y(could)j(fall)h(directly)g(within)f |
37c41ab1 CR |
19058 | (that)h(o)m(v)m(erall)i(sub)5 b(ject.)70 b(\(Th)m(us,)42 |
19059 | b(if)e(the)h(Do)s(cumen)m(t)g(is)f(in)g(part)h(a)330 | |
c2a47ea9 | 19060 | 4769 y(textb)s(o)s(ok)24 b(of)g(mathematics,)j(a)d(Secondary)f(Section) |
37c41ab1 | 19061 | h(ma)m(y)g(not)g(explain)g(an)m(y)g(mathematics.\))40 |
c2a47ea9 | 19062 | b(The)330 4878 y(relationship)28 b(could)f(b)s(e)g(a)g(matter)i(of)e |
37c41ab1 | 19063 | (historical)i(connection)f(with)f(the)h(sub)5 b(ject)27 |
c2a47ea9 | 19064 | b(or)g(with)g(related)330 4988 y(matters,)38 b(or)d(of)h(legal,)i |
37c41ab1 | 19065 | (commercial,)h(philosophical,)f(ethical)f(or)e(p)s(olitical)i(p)s |
c2a47ea9 | 19066 | (osition)f(regarding)330 5097 y(them.)330 5230 y(The)25 |
37c41ab1 CR |
19067 | b(\\In)m(v)-5 b(arian)m(t)27 b(Sections")g(are)f(certain)g(Secondary)g |
19068 | (Sections)g(whose)f(titles)i(are)f(designated,)i(as)330 | |
c2a47ea9 | 19069 | 5340 y(b)s(eing)e(those)h(of)g(In)m(v)-5 b(arian)m(t)27 |
37c41ab1 | 19070 | b(Sections,)i(in)d(the)h(notice)h(that)f(sa)m(ys)g(that)g(the)g(Do)s |
c2a47ea9 | 19071 | (cumen)m(t)g(is)g(released)p eop end |
900a813b CR |
19072 | %%Page: 156 162 |
19073 | TeXDict begin 156 161 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 19074 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19075 | b(156)330 299 y(under)26 b(this)i(License.)40 b(If)27 |
ad4aef08 | 19076 | b(a)h(section)h(do)s(es)f(not)f(\014t)h(the)g(ab)s(o)m(v)m(e)h |
c2a47ea9 | 19077 | (de\014nition)e(of)h(Secondary)f(then)h(it)g(is)330 408 |
37c41ab1 CR |
19078 | y(not)k(allo)m(w)m(ed)i(to)e(b)s(e)g(designated)g(as)g(In)m(v)-5 |
19079 | b(arian)m(t.)46 b(The)31 b(Do)s(cumen)m(t)i(ma)m(y)f(con)m(tain)i(zero) | |
c2a47ea9 | 19080 | e(In)m(v)-5 b(arian)m(t)330 518 y(Sections.)39 b(If)25 |
37c41ab1 CR |
19081 | b(the)f(Do)s(cumen)m(t)i(do)s(es)e(not)h(iden)m(tify)g(an)m(y)g(In)m(v) |
19082 | -5 b(arian)m(t)25 b(Sections)h(then)e(there)h(are)g(none.)330 | |
1231ac47 | 19083 | 669 y(The)36 b(\\Co)m(v)m(er)i(T)-8 b(exts")38 b(are)f(certain)g(short) |
c2a47ea9 | 19084 | g(passages)g(of)g(text)g(that)h(are)f(listed,)i(as)d(F)-8 |
1231ac47 | 19085 | b(ron)m(t-Co)m(v)m(er)330 778 y(T)g(exts)26 b(or)f(Bac)m(k-Co)m(v)m(er) |
c2a47ea9 | 19086 | j(T)-8 b(exts,)27 b(in)d(the)h(notice)i(that)e(sa)m(ys)h(that)g(the)f |
1231ac47 | 19087 | (Do)s(cumen)m(t)h(is)f(released)g(under)330 888 y(this)h(License.)40 |
c2a47ea9 CR |
19088 | b(A)25 b(F)-8 b(ron)m(t-Co)m(v)m(er)29 b(T)-8 b(ext)26 |
19089 | b(ma)m(y)h(b)s(e)e(at)i(most)f(5)g(w)m(ords,)g(and)g(a)g(Bac)m(k-Co)m | |
1231ac47 CR |
19090 | (v)m(er)j(T)-8 b(ext)26 b(ma)m(y)330 998 y(b)s(e)k(at)h(most)g(25)g(w)m |
19091 | (ords.)330 1148 y(A)36 b(\\T)-8 b(ransparen)m(t")36 b(cop)m(y)g(of)g | |
c2a47ea9 | 19092 | (the)f(Do)s(cumen)m(t)h(means)g(a)g(mac)m(hine-readable)h(cop)m(y)-8 |
1231ac47 | 19093 | b(,)38 b(represen)m(ted)330 1258 y(in)d(a)h(format)g(whose)g(sp)s |
37c41ab1 | 19094 | (eci\014cation)g(is)g(a)m(v)-5 b(ailable)38 b(to)f(the)f(general)g |
1231ac47 | 19095 | (public,)h(that)f(is)g(suitable)g(for)330 1367 y(revising)c(the)g(do)s |
37c41ab1 | 19096 | (cumen)m(t)f(straigh)m(tforw)m(ardly)i(with)e(generic)i(text)g(editors) |
1231ac47 | 19097 | f(or)f(\(for)h(images)h(com-)330 1477 y(p)s(osed)23 b(of)h(pixels\))g |
37c41ab1 | 19098 | (generic)h(pain)m(t)f(programs)g(or)f(\(for)h(dra)m(wings\))g(some)g |
1231ac47 | 19099 | (widely)g(a)m(v)-5 b(ailable)26 b(dra)m(wing)330 1587 |
37c41ab1 CR |
19100 | y(editor,)k(and)f(that)g(is)g(suitable)h(for)f(input)f(to)i(text)g |
19101 | (formatters)f(or)g(for)g(automatic)i(translation)f(to)330 | |
1231ac47 | 19102 | 1696 y(a)d(v)-5 b(ariet)m(y)28 b(of)f(formats)g(suitable)h(for)e(input) |
37c41ab1 | 19103 | g(to)i(text)g(formatters.)40 b(A)27 b(cop)m(y)g(made)g(in)g(an)g |
1231ac47 | 19104 | (otherwise)330 1806 y(T)-8 b(ransparen)m(t)37 b(\014le)h(format)g |
5e13499c | 19105 | (whose)f(markup,)i(or)e(absence)h(of)g(markup,)g(has)g(b)s(een)f |
1231ac47 | 19106 | (arranged)g(to)330 1915 y(th)m(w)m(art)27 b(or)g(discourage)g |
37c41ab1 | 19107 | (subsequen)m(t)f(mo)s(di\014cation)h(b)m(y)g(readers)f(is)g(not)h(T)-8 |
1231ac47 | 19108 | b(ransparen)m(t.)39 b(An)27 b(image)330 2025 y(format)35 |
37c41ab1 CR |
19109 | b(is)f(not)h(T)-8 b(ransparen)m(t)34 b(if)g(used)g(for)g(an)m(y)g |
19110 | (substan)m(tial)h(amoun)m(t)g(of)g(text.)53 b(A)35 b(cop)m(y)g(that)g | |
1231ac47 CR |
19111 | (is)330 2134 y(not)c(\\T)-8 b(ransparen)m(t")31 b(is)f(called)i |
19112 | (\\Opaque".)330 2285 y(Examples)53 b(of)g(suitable)h(formats)f(for)g(T) | |
6e51e0d0 CR |
19113 | -8 b(ransparen)m(t)53 b(copies)h(include)f(plain)g Fm(asci)r(i)g |
19114 | Fu(without)330 2395 y(markup,)37 b(T)-8 b(exinfo)36 b(input)f(format,)j | |
c302751c | 19115 | (LaT)1759 2414 y(E)1810 2395 y(X)e(input)f(format,)j |
6e51e0d0 CR |
19116 | Ff(SGML)f Fu(or)f Ff(XML)g Fu(using)g(a)g(publicly)330 |
19117 | 2504 y(a)m(v)-5 b(ailable)42 b Ff(DTD)p Fu(,)h(and)c | |
19118 | (standard-conforming)g(simple)h Ff(HTML)p Fu(,)i(P)m(ostScript)e(or)f | |
19119 | Ff(PDF)h Fu(designed)330 2614 y(for)e(h)m(uman)f(mo)s(di\014cation.)65 | |
19120 | b(Examples)38 b(of)h(transparen)m(t)f(image)h(formats)g(include)f | |
19121 | Ff(PNG)p Fu(,)i Ff(X)n(CF)330 2724 y Fu(and)e Ff(JPG)p | |
19122 | Fu(.)64 b(Opaque)38 b(formats)h(include)f(proprietary)h(formats)f(that) | |
19123 | h(can)g(b)s(e)f(read)h(and)f(edited)330 2833 y(only)54 | |
19124 | b(b)m(y)f(proprietary)h(w)m(ord)f(pro)s(cessors,)59 b | |
19125 | Ff(SGML)54 b Fu(or)f Ff(XML)h Fu(for)g(whic)m(h)f(the)h | |
19126 | Ff(DTD)g Fu(and/or)330 2943 y(pro)s(cessing)61 b(to)s(ols)h(are)f(not)g | |
19127 | (generally)i(a)m(v)-5 b(ailable,)71 b(and)60 b(the)h(mac)m | |
19128 | (hine-generated)j Ff(HTML)p Fu(,)330 3052 y(P)m(ostScript)31 | |
19129 | b(or)f Ff(PDF)h Fu(pro)s(duced)d(b)m(y)j(some)f(w)m(ord)g(pro)s | |
19130 | (cessors)g(for)g(output)g(purp)s(oses)f(only)-8 b(.)330 | |
19131 | 3203 y(The)34 b(\\Title)h(P)m(age")i(means,)e(for)f(a)h(prin)m(ted)f(b) | |
19132 | s(o)s(ok,)h(the)f(title)i(page)f(itself,)h(plus)e(suc)m(h)f(follo)m | |
19133 | (wing)330 3313 y(pages)28 b(as)g(are)g(needed)g(to)g(hold,)g(legibly)-8 | |
19134 | b(,)30 b(the)e(material)h(this)e(License)i(requires)e(to)h(app)s(ear)f | |
19135 | (in)h(the)330 3422 y(title)g(page.)40 b(F)-8 b(or)28 | |
19136 | b(w)m(orks)e(in)g(formats)h(whic)m(h)g(do)f(not)h(ha)m(v)m(e)h(an)m(y)e | |
19137 | (title)j(page)e(as)g(suc)m(h,)g(\\Title)h(P)m(age")330 | |
19138 | 3532 y(means)j(the)f(text)i(near)e(the)h(most)g(prominen)m(t)g(app)s | |
19139 | (earance)f(of)h(the)g(w)m(ork's)g(title,)h(preceding)f(the)330 | |
19140 | 3641 y(b)s(eginning)f(of)g(the)h(b)s(o)s(dy)e(of)h(the)h(text.)330 | |
19141 | 3792 y(The)j(\\publisher")g(means)h(an)m(y)f(p)s(erson)g(or)h(en)m(tit) | |
19142 | m(y)h(that)f(distributes)f(copies)i(of)e(the)h(Do)s(cumen)m(t)330 | |
19143 | 3902 y(to)c(the)g(public.)330 4052 y(A)f(section)h(\\En)m(titled)g | |
19144 | (XYZ")f(means)f(a)h(named)g(subunit)e(of)h(the)h(Do)s(cumen)m(t)h | |
19145 | (whose)e(title)i(either)330 4162 y(is)d(precisely)g(XYZ)g(or)f(con)m | |
19146 | (tains)i(XYZ)f(in)f(paren)m(theses)i(follo)m(wing)g(text)g(that)f | |
19147 | (translates)h(XYZ)e(in)330 4271 y(another)e(language.)40 | |
19148 | b(\(Here)26 b(XYZ)f(stands)f(for)h(a)g(sp)s(eci\014c)g(section)h(name)f | |
19149 | (men)m(tioned)h(b)s(elo)m(w,)g(suc)m(h)330 4381 y(as)i(\\Ac)m(kno)m | |
19150 | (wledgemen)m(ts",)33 b(\\Dedications",)e(\\Endorsemen)m(ts",)e(or)f | |
19151 | (\\History".\))42 b(T)-8 b(o)29 b(\\Preserv)m(e)330 4491 | |
19152 | y(the)34 b(Title")h(of)e(suc)m(h)h(a)g(section)g(when)f(y)m(ou)h(mo)s | |
19153 | (dify)e(the)i(Do)s(cumen)m(t)h(means)e(that)h(it)g(remains)g(a)330 | |
19154 | 4600 y(section)e(\\En)m(titled)f(XYZ")g(according)g(to)g(this)g | |
19155 | (de\014nition.)330 4751 y(The)c(Do)s(cumen)m(t)i(ma)m(y)f(include)f(W) | |
19156 | -8 b(arran)m(t)m(y)30 b(Disclaimers)f(next)f(to)g(the)g(notice)h(whic)m | |
19157 | (h)e(states)i(that)330 4861 y(this)34 b(License)g(applies)g(to)h(the)f | |
19158 | (Do)s(cumen)m(t.)52 b(These)33 b(W)-8 b(arran)m(t)m(y)36 | |
19159 | b(Disclaimers)f(are)g(considered)e(to)330 4970 y(b)s(e)k(included)g(b)m | |
19160 | (y)g(reference)h(in)g(this)f(License,)j(but)d(only)h(as)g(regards)f | |
19161 | (disclaiming)i(w)m(arran)m(ties:)330 5080 y(an)m(y)e(other)g | |
19162 | (implication)i(that)e(these)g(W)-8 b(arran)m(t)m(y)39 | |
19163 | b(Disclaimers)f(ma)m(y)g(ha)m(v)m(e)g(is)f(v)m(oid)g(and)f(has)h(no)330 | |
19164 | 5189 y(e\013ect)32 b(on)e(the)h(meaning)f(of)h(this)f(License.)199 | |
19165 | 5340 y(2.)61 b(VERBA)-8 b(TIM)31 b(COPYING)p eop end | |
900a813b CR |
19166 | %%Page: 157 163 |
19167 | TeXDict begin 157 162 bop 150 -116 a Fu(App)s(endix)29 | |
c2a47ea9 | 19168 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19169 | b(157)330 299 y(Y)-8 b(ou)39 b(ma)m(y)f(cop)m(y)h(and)e(distribute)h |
1231ac47 CR |
19170 | (the)g(Do)s(cumen)m(t)h(in)f(an)m(y)g(medium,)h(either)g(commercially)h |
19171 | (or)330 408 y(noncommercially)-8 b(,)48 b(pro)m(vided)42 | |
19172 | b(that)h(this)f(License,)47 b(the)42 b(cop)m(yrigh)m(t)i(notices,)j | |
19173 | (and)42 b(the)h(license)330 518 y(notice)37 b(sa)m(ying)g(this)e | |
19174 | (License)i(applies)e(to)i(the)f(Do)s(cumen)m(t)g(are)g(repro)s(duced)e | |
19175 | (in)i(all)g(copies,)j(and)330 628 y(that)27 b(y)m(ou)g(add)f(no)h | |
19176 | (other)f(conditions)h(whatso)s(ev)m(er)h(to)f(those)g(of)g(this)f | |
19177 | (License.)40 b(Y)-8 b(ou)27 b(ma)m(y)g(not)g(use)330 | |
19178 | 737 y(tec)m(hnical)35 b(measures)d(to)i(obstruct)f(or)g(con)m(trol)h | |
19179 | (the)f(reading)g(or)g(further)e(cop)m(ying)j(of)f(the)g(copies)330 | |
19180 | 847 y(y)m(ou)25 b(mak)m(e)g(or)g(distribute.)38 b(Ho)m(w)m(ev)m(er,)28 | |
37c41ab1 | 19181 | b(y)m(ou)d(ma)m(y)g(accept)h(comp)s(ensation)f(in)f(exc)m(hange)j(for)d |
1231ac47 | 19182 | (copies.)330 956 y(If)32 b(y)m(ou)g(distribute)g(a)h(large)g(enough)f |
37c41ab1 | 19183 | (n)m(um)m(b)s(er)f(of)h(copies)h(y)m(ou)f(m)m(ust)h(also)g(follo)m(w)g |
1231ac47 | 19184 | (the)f(conditions)330 1066 y(in)e(section)i(3.)330 1200 |
37c41ab1 CR |
19185 | y(Y)-8 b(ou)21 b(ma)m(y)h(also)f(lend)g(copies,)i(under)d(the)h(same)g |
19186 | (conditions)g(stated)h(ab)s(o)m(v)m(e,)i(and)c(y)m(ou)h(ma)m(y)g | |
1231ac47 CR |
19187 | (publicly)330 1310 y(displa)m(y)31 b(copies.)199 1443 |
19188 | y(3.)61 b(COPYING)30 b(IN)g(QUANTITY)330 1577 y(If)25 | |
37c41ab1 CR |
19189 | b(y)m(ou)g(publish)f(prin)m(ted)g(copies)i(\(or)g(copies)g(in)f(media)g |
19190 | (that)h(commonly)g(ha)m(v)m(e)g(prin)m(ted)f(co)m(v)m(ers\))i(of)330 | |
1231ac47 | 19191 | 1687 y(the)32 b(Do)s(cumen)m(t,)h(n)m(um)m(b)s(ering)e(more)h(than)f |
37c41ab1 | 19192 | (100,)j(and)d(the)h(Do)s(cumen)m(t's)h(license)f(notice)h(requires)330 |
1231ac47 | 19193 | 1797 y(Co)m(v)m(er)i(T)-8 b(exts,)36 b(y)m(ou)f(m)m(ust)f(enclose)i |
37c41ab1 | 19194 | (the)e(copies)h(in)f(co)m(v)m(ers)i(that)f(carry)-8 b(,)36 |
1231ac47 | 19195 | b(clearly)f(and)f(legibly)-8 b(,)37 b(all)330 1906 y(these)j(Co)m(v)m |
37c41ab1 | 19196 | (er)g(T)-8 b(exts:)59 b(F)-8 b(ron)m(t-Co)m(v)m(er)41 |
5e13499c CR |
19197 | b(T)-8 b(exts)40 b(on)f(the)g(fron)m(t)g(co)m(v)m(er,)44 |
19198 | b(and)38 b(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts)40 b(on)330 | |
1231ac47 | 19199 | 2016 y(the)29 b(bac)m(k)h(co)m(v)m(er.)42 b(Both)30 b(co)m(v)m(ers)h(m) |
37c41ab1 | 19200 | m(ust)e(also)h(clearly)g(and)f(legibly)h(iden)m(tify)f(y)m(ou)h(as)f |
1231ac47 | 19201 | (the)h(publisher)330 2125 y(of)k(these)h(copies.)53 b(The)34 |
37c41ab1 | 19202 | b(fron)m(t)h(co)m(v)m(er)h(m)m(ust)e(presen)m(t)g(the)h(full)f(title)i |
1231ac47 | 19203 | (with)d(all)j(w)m(ords)d(of)i(the)f(title)330 2235 y(equally)e |
37c41ab1 CR |
19204 | (prominen)m(t)e(and)g(visible.)43 b(Y)-8 b(ou)31 b(ma)m(y)g(add)g |
19205 | (other)g(material)h(on)f(the)g(co)m(v)m(ers)h(in)e(addition.)330 | |
1231ac47 | 19206 | 2345 y(Cop)m(ying)36 b(with)g(c)m(hanges)h(limited)g(to)g(the)g(co)m(v) |
37c41ab1 | 19207 | m(ers,)i(as)d(long)h(as)g(they)f(preserv)m(e)g(the)h(title)g(of)g(the) |
1231ac47 | 19208 | 330 2454 y(Do)s(cumen)m(t)h(and)e(satisfy)i(these)f(conditions,)j(can)d |
37c41ab1 | 19209 | (b)s(e)g(treated)h(as)f(v)m(erbatim)h(cop)m(ying)g(in)f(other)330 |
1231ac47 | 19210 | 2564 y(resp)s(ects.)330 2698 y(If)32 b(the)h(required)f(texts)i(for)e |
37c41ab1 | 19211 | (either)h(co)m(v)m(er)i(are)e(to)s(o)g(v)m(oluminous)g(to)g(\014t)g |
1231ac47 | 19212 | (legibly)-8 b(,)35 b(y)m(ou)e(should)f(put)330 2807 y(the)h(\014rst)f |
37c41ab1 CR |
19213 | (ones)h(listed)g(\(as)h(man)m(y)f(as)g(\014t)g(reasonably\))g(on)g(the) |
19214 | g(actual)h(co)m(v)m(er,)h(and)e(con)m(tin)m(ue)h(the)330 | |
1231ac47 | 19215 | 2917 y(rest)d(on)m(to)g(adjacen)m(t)h(pages.)330 3051 |
37c41ab1 CR |
19216 | y(If)27 b(y)m(ou)g(publish)e(or)i(distribute)g(Opaque)f(copies)i(of)f |
19217 | (the)h(Do)s(cumen)m(t)f(n)m(um)m(b)s(ering)f(more)i(than)e(100,)330 | |
1231ac47 | 19218 | 3160 y(y)m(ou)i(m)m(ust)g(either)h(include)e(a)i(mac)m(hine-readable)g |
37c41ab1 | 19219 | (T)-8 b(ransparen)m(t)28 b(cop)m(y)h(along)g(with)e(eac)m(h)i(Opaque) |
1231ac47 | 19220 | 330 3270 y(cop)m(y)-8 b(,)38 b(or)d(state)h(in)f(or)g(with)g(eac)m(h)h |
37c41ab1 | 19221 | (Opaque)e(cop)m(y)i(a)g(computer-net)m(w)m(ork)g(lo)s(cation)h(from)d |
1231ac47 | 19222 | (whic)m(h)330 3380 y(the)24 b(general)i(net)m(w)m(ork-using)f(public)e |
37c41ab1 | 19223 | (has)h(access)i(to)f(do)m(wnload)f(using)g(public-standard)f(net)m(w)m |
1231ac47 | 19224 | (ork)330 3489 y(proto)s(cols)40 b(a)f(complete)h(T)-8 |
5e13499c | 19225 | b(ransparen)m(t)39 b(cop)m(y)g(of)g(the)h(Do)s(cumen)m(t,)i(free)d(of)g |
1231ac47 | 19226 | (added)f(material.)67 b(If)330 3599 y(y)m(ou)39 b(use)g(the)g(latter)h |
37c41ab1 | 19227 | (option,)h(y)m(ou)f(m)m(ust)e(tak)m(e)j(reasonably)e(pruden)m(t)e |
1231ac47 | 19228 | (steps,)k(when)d(y)m(ou)h(b)s(egin)330 3708 y(distribution)f(of)g |
37c41ab1 CR |
19229 | (Opaque)g(copies)h(in)e(quan)m(tit)m(y)-8 b(,)43 b(to)38 |
19230 | b(ensure)g(that)h(this)f(T)-8 b(ransparen)m(t)38 b(cop)m(y)h(will)330 | |
1231ac47 | 19231 | 3818 y(remain)30 b(th)m(us)g(accessible)i(at)f(the)f(stated)h(lo)s |
37c41ab1 | 19232 | (cation)h(un)m(til)e(at)h(least)h(one)e(y)m(ear)h(after)g(the)f(last)h |
1231ac47 | 19233 | (time)330 3927 y(y)m(ou)37 b(distribute)f(an)h(Opaque)f(cop)m(y)i |
37c41ab1 | 19234 | (\(directly)g(or)e(through)g(y)m(our)h(agen)m(ts)h(or)f(retailers\))h |
1231ac47 CR |
19235 | (of)f(that)330 4037 y(edition)31 b(to)g(the)g(public.)330 |
19236 | 4171 y(It)k(is)f(requested,)i(but)e(not)h(required,)g(that)g(y)m(ou)g | |
5e13499c | 19237 | (con)m(tact)h(the)f(authors)f(of)h(the)g(Do)s(cumen)m(t)g(w)m(ell)330 |
1231ac47 | 19238 | 4281 y(b)s(efore)28 b(redistributing)g(an)m(y)h(large)h(n)m(um)m(b)s |
37c41ab1 | 19239 | (er)d(of)i(copies,)h(to)f(giv)m(e)h(them)f(a)g(c)m(hance)h(to)f(pro)m |
1231ac47 CR |
19240 | (vide)g(y)m(ou)330 4390 y(with)h(an)g(up)s(dated)f(v)m(ersion)i(of)g |
19241 | (the)f(Do)s(cumen)m(t.)199 4524 y(4.)61 b(MODIFICA)-8 | |
19242 | b(TIONS)330 4658 y(Y)g(ou)26 b(ma)m(y)g(cop)m(y)g(and)f(distribute)g(a) | |
37c41ab1 | 19243 | h(Mo)s(di\014ed)f(V)-8 b(ersion)26 b(of)g(the)g(Do)s(cumen)m(t)g(under) |
1231ac47 | 19244 | e(the)h(conditions)330 4768 y(of)c(sections)h(2)g(and)e(3)h(ab)s(o)m(v) |
37c41ab1 | 19245 | m(e,)k(pro)m(vided)20 b(that)i(y)m(ou)f(release)i(the)e(Mo)s(di\014ed)f |
1231ac47 | 19246 | (V)-8 b(ersion)22 b(under)d(precisely)330 4877 y(this)29 |
37c41ab1 CR |
19247 | b(License,)h(with)f(the)g(Mo)s(di\014ed)f(V)-8 b(ersion)30 |
19248 | b(\014lling)f(the)g(role)h(of)f(the)g(Do)s(cumen)m(t,)h(th)m(us)f | |
1231ac47 | 19249 | (licensing)330 4987 y(distribution)k(and)h(mo)s(di\014cation)g(of)h |
37c41ab1 | 19250 | (the)f(Mo)s(di\014ed)f(V)-8 b(ersion)35 b(to)g(who)s(ev)m(er)f(p)s |
1231ac47 | 19251 | (ossesses)f(a)i(cop)m(y)g(of)330 5096 y(it.)41 b(In)30 |
37c41ab1 | 19252 | b(addition,)h(y)m(ou)f(m)m(ust)h(do)f(these)h(things)f(in)g(the)h(Mo)s |
1231ac47 | 19253 | (di\014ed)e(V)-8 b(ersion:)357 5230 y(A.)60 b(Use)33 |
c2a47ea9 CR |
19254 | b(in)f(the)h(Title)h(P)m(age)g(\(and)f(on)f(the)h(co)m(v)m(ers,)i(if)e |
19255 | (an)m(y\))g(a)g(title)h(distinct)f(from)g(that)g(of)g(the)510 | |
1231ac47 | 19256 | 5340 y(Do)s(cumen)m(t,)j(and)d(from)g(those)i(of)f(previous)f(v)m |
c2a47ea9 | 19257 | (ersions)h(\(whic)m(h)g(should,)g(if)g(there)g(w)m(ere)g(an)m(y)-8 |
1231ac47 | 19258 | b(,)p eop end |
900a813b CR |
19259 | %%Page: 158 164 |
19260 | TeXDict begin 158 163 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 19261 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19262 | b(158)510 299 y(b)s(e)31 b(listed)h(in)f(the)g(History)h(section)g(of)g |
ad4aef08 CR |
19263 | (the)f(Do)s(cumen)m(t\).)45 b(Y)-8 b(ou)32 b(ma)m(y)g(use)f(the)g(same) |
19264 | h(title)h(as)510 408 y(a)e(previous)f(v)m(ersion)g(if)h(the)f(original) | |
19265 | i(publisher)d(of)h(that)h(v)m(ersion)g(giv)m(es)h(p)s(ermission.)360 | |
19266 | 545 y(B.)61 b(List)31 b(on)f(the)h(Title)g(P)m(age,)i(as)d(authors,)h | |
19267 | (one)g(or)f(more)h(p)s(ersons)e(or)h(en)m(tities)j(resp)s(onsible)c | |
19268 | (for)510 655 y(authorship)c(of)h(the)h(mo)s(di\014cations)f(in)g(the)g | |
19269 | (Mo)s(di\014ed)f(V)-8 b(ersion,)28 b(together)g(with)d(at)i(least)h | |
19270 | (\014v)m(e)510 765 y(of)c(the)g(principal)g(authors)f(of)i(the)f(Do)s | |
19271 | (cumen)m(t)g(\(all)h(of)g(its)f(principal)g(authors,)h(if)f(it)g(has)g | |
19272 | (few)m(er)510 874 y(than)30 b(\014v)m(e\),)h(unless)f(they)h(release)g | |
19273 | (y)m(ou)g(from)f(this)g(requiremen)m(t.)359 1011 y(C.)60 | |
1231ac47 CR |
19274 | b(State)32 b(on)e(the)h(Title)h(page)f(the)g(name)g(of)g(the)g |
19275 | (publisher)e(of)i(the)g(Mo)s(di\014ed)f(V)-8 b(ersion,)32 | |
19276 | b(as)f(the)510 1121 y(publisher.)355 1258 y(D.)61 b(Preserv)m(e)31 | |
19277 | b(all)g(the)g(cop)m(yrigh)m(t)h(notices)f(of)g(the)f(Do)s(cumen)m(t.) | |
19278 | 363 1395 y(E.)60 b(Add)30 b(an)i(appropriate)f(cop)m(yrigh)m(t)i | |
19279 | (notice)f(for)g(y)m(our)f(mo)s(di\014cations)g(adjacen)m(t)i(to)f(the)g | |
19280 | (other)510 1504 y(cop)m(yrigh)m(t)g(notices.)365 1641 | |
19281 | y(F.)61 b(Include,)28 b(immediately)h(after)f(the)h(cop)m(yrigh)m(t)g | |
19282 | (notices,)h(a)e(license)h(notice)g(giving)g(the)f(public)510 | |
19283 | 1751 y(p)s(ermission)23 b(to)j(use)e(the)g(Mo)s(di\014ed)g(V)-8 | |
19284 | b(ersion)25 b(under)e(the)i(terms)f(of)h(this)f(License,)j(in)d(the)g | |
19285 | (form)510 1861 y(sho)m(wn)30 b(in)g(the)g(Addendum)f(b)s(elo)m(w.)353 | |
19286 | 1998 y(G.)61 b(Preserv)m(e)23 b(in)g(that)g(license)h(notice)g(the)f | |
37c41ab1 | 19287 | (full)g(lists)g(of)g(In)m(v)-5 b(arian)m(t)23 b(Sections)h(and)e |
1231ac47 CR |
19288 | (required)g(Co)m(v)m(er)510 2107 y(T)-8 b(exts)31 b(giv)m(en)g(in)f |
19289 | (the)h(Do)s(cumen)m(t's)g(license)h(notice.)357 2244 | |
37c41ab1 | 19290 | y(H.)60 b(Include)30 b(an)g(unaltered)g(cop)m(y)h(of)g(this)f(License.) |
1231ac47 | 19291 | 392 2381 y(I.)60 b(Preserv)m(e)33 b(the)f(section)h(En)m(titled)g |
37c41ab1 | 19292 | (\\History",)h(Preserv)m(e)f(its)f(Title,)i(and)d(add)h(to)h(it)f(an)g |
1231ac47 | 19293 | (item)510 2491 y(stating)d(at)g(least)g(the)g(title,)h(y)m(ear,)g(new)d |
37c41ab1 | 19294 | (authors,)i(and)e(publisher)f(of)j(the)f(Mo)s(di\014ed)f(V)-8 |
1231ac47 | 19295 | b(ersion)510 2600 y(as)32 b(giv)m(en)g(on)f(the)h(Title)g(P)m(age.)45 |
37c41ab1 | 19296 | b(If)31 b(there)h(is)f(no)g(section)i(En)m(titled)f(\\History")h(in)e |
1231ac47 | 19297 | (the)g(Do)s(cu-)510 2710 y(men)m(t,)37 b(create)f(one)f(stating)h(the)f |
37c41ab1 | 19298 | (title,)i(y)m(ear,)g(authors,)f(and)e(publisher)f(of)i(the)g(Do)s |
1231ac47 | 19299 | (cumen)m(t)510 2819 y(as)h(giv)m(en)h(on)f(its)h(Title)g(P)m(age,)i |
37c41ab1 | 19300 | (then)d(add)g(an)g(item)g(describing)g(the)g(Mo)s(di\014ed)g(V)-8 |
1231ac47 CR |
19301 | b(ersion)37 b(as)510 2929 y(stated)31 b(in)f(the)h(previous)f(sen)m |
19302 | (tence.)378 3066 y(J.)60 b(Preserv)m(e)33 b(the)g(net)m(w)m(ork)g(lo)s | |
37c41ab1 | 19303 | (cation,)i(if)d(an)m(y)-8 b(,)34 b(giv)m(en)f(in)g(the)f(Do)s(cumen)m |
1231ac47 | 19304 | (t)h(for)g(public)e(access)j(to)510 3176 y(a)e(T)-8 b(ransparen)m(t)30 |
37c41ab1 | 19305 | b(cop)m(y)i(of)g(the)f(Do)s(cumen)m(t,)h(and)f(lik)m(ewise)h(the)g(net) |
1231ac47 | 19306 | m(w)m(ork)g(lo)s(cations)g(giv)m(en)g(in)510 3285 y(the)g(Do)s(cumen)m |
37c41ab1 | 19307 | (t)g(for)g(previous)f(v)m(ersions)h(it)g(w)m(as)g(based)f(on.)45 |
1231ac47 | 19308 | b(These)31 b(ma)m(y)h(b)s(e)f(placed)h(in)g(the)510 3395 |
37c41ab1 CR |
19309 | y(\\History")27 b(section.)40 b(Y)-8 b(ou)25 b(ma)m(y)h(omit)g(a)f(net) |
19310 | m(w)m(ork)h(lo)s(cation)g(for)f(a)h(w)m(ork)f(that)g(w)m(as)h | |
1231ac47 | 19311 | (published)510 3504 y(at)36 b(least)h(four)e(y)m(ears)i(b)s(efore)e |
37c41ab1 | 19312 | (the)h(Do)s(cumen)m(t)h(itself,)h(or)d(if)h(the)g(original)h(publisher) |
1231ac47 CR |
19313 | d(of)i(the)510 3614 y(v)m(ersion)31 b(it)g(refers)f(to)h(giv)m(es)h(p)s |
19314 | (ermission.)354 3751 y(K.)60 b(F)-8 b(or)24 b(an)m(y)h(section)f(En)m | |
37c41ab1 | 19315 | (titled)h(\\Ac)m(kno)m(wledgemen)m(ts")i(or)d(\\Dedications",)k |
1231ac47 | 19316 | (Preserv)m(e)c(the)g(Title)510 3861 y(of)j(the)f(section,)j(and)d |
37c41ab1 | 19317 | (preserv)m(e)h(in)f(the)h(section)g(all)h(the)e(substance)h(and)f(tone) |
1231ac47 | 19318 | h(of)f(eac)m(h)i(of)f(the)510 3970 y(con)m(tributor)k(ac)m(kno)m |
37c41ab1 | 19319 | (wledgemen)m(ts)i(and/or)d(dedications)h(giv)m(en)h(therein.)368 |
1231ac47 | 19320 | 4107 y(L.)60 b(Preserv)m(e)36 b(all)g(the)g(In)m(v)-5 |
37c41ab1 | 19321 | b(arian)m(t)36 b(Sections)g(of)f(the)h(Do)s(cumen)m(t,)h(unaltered)f |
1231ac47 | 19322 | (in)f(their)g(text)i(and)510 4217 y(in)f(their)g(titles.)58 |
37c41ab1 CR |
19323 | b(Section)37 b(n)m(um)m(b)s(ers)d(or)i(the)g(equiv)-5 |
19324 | b(alen)m(t)38 b(are)e(not)g(considered)g(part)g(of)g(the)510 | |
1231ac47 | 19325 | 4326 y(section)c(titles.)341 4463 y(M.)61 b(Delete)33 |
37c41ab1 CR |
19326 | b(an)m(y)e(section)h(En)m(titled)f(\\Endorsemen)m(ts".)42 |
19327 | b(Suc)m(h)30 b(a)i(section)f(ma)m(y)h(not)f(b)s(e)f(included)510 | |
1231ac47 CR |
19328 | 4573 y(in)g(the)h(Mo)s(di\014ed)e(V)-8 b(ersion.)357 |
19329 | 4710 y(N.)60 b(Do)29 b(not)g(retitle)h(an)m(y)e(existing)i(section)f | |
37c41ab1 | 19330 | (to)g(b)s(e)f(En)m(titled)h(\\Endorsemen)m(ts")g(or)f(to)h(con\015ict)g |
1231ac47 CR |
19331 | (in)510 4819 y(title)j(with)e(an)m(y)h(In)m(v)-5 b(arian)m(t)31 |
19332 | b(Section.)354 4956 y(O.)60 b(Preserv)m(e)31 b(an)m(y)g(W)-8 | |
19333 | b(arran)m(t)m(y)32 b(Disclaimers.)330 5121 y(If)h(the)g(Mo)s(di\014ed)g | |
37c41ab1 | 19334 | (V)-8 b(ersion)34 b(includes)f(new)g(fron)m(t-matter)i(sections)f(or)f |
1231ac47 | 19335 | (app)s(endices)g(that)h(qualify)330 5230 y(as)28 b(Secondary)g |
37c41ab1 | 19336 | (Sections)g(and)f(con)m(tain)j(no)d(material)j(copied)e(from)f(the)h |
1231ac47 | 19337 | (Do)s(cumen)m(t,)i(y)m(ou)e(ma)m(y)g(at)330 5340 y(y)m(our)k(option)h |
c2a47ea9 | 19338 | (designate)h(some)e(or)h(all)g(of)f(these)h(sections)h(as)e(in)m(v)-5 |
1231ac47 | 19339 | b(arian)m(t.)48 b(T)-8 b(o)33 b(do)f(this,)h(add)f(their)p |
c2a47ea9 | 19340 | eop end |
900a813b CR |
19341 | %%Page: 159 165 |
19342 | TeXDict begin 159 164 bop 150 -116 a Fu(App)s(endix)29 | |
c2a47ea9 | 19343 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19344 | b(159)330 299 y(titles)37 b(to)f(the)f(list)h(of)g(In)m(v)-5 |
1231ac47 CR |
19345 | b(arian)m(t)36 b(Sections)g(in)f(the)h(Mo)s(di\014ed)f(V)-8 |
19346 | b(ersion's)36 b(license)g(notice.)57 b(These)330 408 | |
19347 | y(titles)32 b(m)m(ust)e(b)s(e)g(distinct)h(from)e(an)m(y)i(other)g | |
19348 | (section)g(titles.)330 551 y(Y)-8 b(ou)43 b(ma)m(y)g(add)f(a)g(section) | |
19349 | i(En)m(titled)f(\\Endorsemen)m(ts",)j(pro)m(vided)c(it)h(con)m(tains)g | |
19350 | (nothing)g(but)330 661 y(endorsemen)m(ts)30 b(of)g(y)m(our)f(Mo)s | |
37c41ab1 | 19351 | (di\014ed)g(V)-8 b(ersion)31 b(b)m(y)e(v)-5 b(arious)30 |
1231ac47 | 19352 | b(parties|for)g(example,)g(statemen)m(ts)i(of)330 770 |
37c41ab1 CR |
19353 | y(p)s(eer)27 b(review)g(or)g(that)h(the)f(text)i(has)d(b)s(een)h(appro) |
19354 | m(v)m(ed)g(b)m(y)g(an)h(organization)h(as)e(the)h(authoritativ)m(e)330 | |
1231ac47 | 19355 | 880 y(de\014nition)i(of)h(a)f(standard.)330 1022 y(Y)-8 |
37c41ab1 CR |
19356 | b(ou)29 b(ma)m(y)g(add)e(a)i(passage)g(of)g(up)e(to)i(\014v)m(e)g(w)m |
19357 | (ords)e(as)i(a)g(F)-8 b(ron)m(t-Co)m(v)m(er)30 b(T)-8 | |
1231ac47 | 19358 | b(ext,)30 b(and)e(a)g(passage)i(of)e(up)330 1132 y(to)g(25)g(w)m(ords)e |
37c41ab1 CR |
19359 | (as)i(a)f(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext,)29 b(to)f(the)f(end)f(of)i |
19360 | (the)f(list)h(of)f(Co)m(v)m(er)h(T)-8 b(exts)27 b(in)g(the)h(Mo)s | |
1231ac47 | 19361 | (di\014ed)330 1241 y(V)-8 b(ersion.)58 b(Only)35 b(one)h(passage)h(of)f |
37c41ab1 | 19362 | (F)-8 b(ron)m(t-Co)m(v)m(er)38 b(T)-8 b(ext)36 b(and)g(one)g(of)g(Bac)m |
1231ac47 | 19363 | (k-Co)m(v)m(er)j(T)-8 b(ext)36 b(ma)m(y)h(b)s(e)330 1351 |
37c41ab1 CR |
19364 | y(added)27 b(b)m(y)g(\(or)h(through)f(arrangemen)m(ts)h(made)g(b)m(y\)) |
19365 | g(an)m(y)g(one)f(en)m(tit)m(y)-8 b(.)42 b(If)27 b(the)h(Do)s(cumen)m(t) | |
1231ac47 | 19366 | g(already)330 1461 y(includes)34 b(a)g(co)m(v)m(er)h(text)g(for)f(the)g |
37c41ab1 | 19367 | (same)h(co)m(v)m(er,)h(previously)e(added)f(b)m(y)h(y)m(ou)g(or)g(b)m |
1231ac47 | 19368 | (y)g(arrangemen)m(t)330 1570 y(made)h(b)m(y)g(the)h(same)f(en)m(tit)m |
37c41ab1 | 19369 | (y)i(y)m(ou)f(are)f(acting)i(on)e(b)s(ehalf)f(of,)j(y)m(ou)f(ma)m(y)g |
1231ac47 | 19370 | (not)f(add)g(another;)j(but)330 1680 y(y)m(ou)c(ma)m(y)h(replace)g(the) |
37c41ab1 | 19371 | f(old)g(one,)i(on)e(explicit)h(p)s(ermission)e(from)g(the)i(previous)e |
1231ac47 CR |
19372 | (publisher)f(that)330 1789 y(added)e(the)g(old)h(one.)330 |
19373 | 1932 y(The)25 b(author\(s\))h(and)f(publisher\(s\))f(of)i(the)f(Do)s | |
37c41ab1 | 19374 | (cumen)m(t)h(do)g(not)f(b)m(y)h(this)f(License)h(giv)m(e)h(p)s |
1231ac47 | 19375 | (ermission)330 2041 y(to)k(use)f(their)g(names)h(for)f(publicit)m(y)g |
37c41ab1 | 19376 | (for)h(or)f(to)h(assert)g(or)f(imply)g(endorsemen)m(t)g(of)h(an)m(y)g |
1231ac47 CR |
19377 | (Mo)s(di\014ed)330 2151 y(V)-8 b(ersion.)199 2293 y(5.)61 |
19378 | b(COMBINING)31 b(DOCUMENTS)330 2436 y(Y)-8 b(ou)39 b(ma)m(y)g(com)m | |
37c41ab1 | 19379 | (bine)h(the)f(Do)s(cumen)m(t)g(with)g(other)f(do)s(cumen)m(ts)h |
1231ac47 | 19380 | (released)g(under)f(this)g(License,)330 2545 y(under)f(the)h(terms)g |
37c41ab1 | 19381 | (de\014ned)f(in)h(section)h(4)g(ab)s(o)m(v)m(e)g(for)f(mo)s(di\014ed)f |
1231ac47 | 19382 | (v)m(ersions,)k(pro)m(vided)d(that)h(y)m(ou)330 2655 |
37c41ab1 CR |
19383 | y(include)25 b(in)g(the)g(com)m(bination)i(all)f(of)g(the)f(In)m(v)-5 |
19384 | b(arian)m(t)26 b(Sections)g(of)g(all)g(of)f(the)h(original)g(do)s | |
1231ac47 | 19385 | (cumen)m(ts,)330 2765 y(unmo)s(di\014ed,)g(and)g(list)h(them)g(all)g |
37c41ab1 | 19386 | (as)g(In)m(v)-5 b(arian)m(t)28 b(Sections)f(of)g(y)m(our)g(com)m(bined) |
1231ac47 | 19387 | g(w)m(ork)f(in)h(its)g(license)330 2874 y(notice,)32 |
37c41ab1 | 19388 | b(and)e(that)h(y)m(ou)f(preserv)m(e)h(all)g(their)g(W)-8 |
1231ac47 | 19389 | b(arran)m(t)m(y)32 b(Disclaimers.)330 3017 y(The)e(com)m(bined)g(w)m |
37c41ab1 | 19390 | (ork)h(need)e(only)i(con)m(tain)g(one)g(cop)m(y)g(of)f(this)g(License,) |
1231ac47 | 19391 | i(and)d(m)m(ultiple)i(iden)m(tical)330 3126 y(In)m(v)-5 |
37c41ab1 CR |
19392 | b(arian)m(t)33 b(Sections)g(ma)m(y)g(b)s(e)f(replaced)h(with)f(a)h |
19393 | (single)g(cop)m(y)-8 b(.)48 b(If)32 b(there)h(are)g(m)m(ultiple)g(In)m | |
1231ac47 | 19394 | (v)-5 b(arian)m(t)330 3236 y(Sections)27 b(with)g(the)g(same)g(name)g |
37c41ab1 | 19395 | (but)f(di\013eren)m(t)h(con)m(ten)m(ts,)i(mak)m(e)f(the)f(title)h(of)f |
1231ac47 | 19396 | (eac)m(h)h(suc)m(h)f(section)330 3345 y(unique)33 b(b)m(y)h(adding)f |
37c41ab1 | 19397 | (at)i(the)f(end)g(of)g(it,)h(in)f(paren)m(theses,)i(the)e(name)g(of)g |
1231ac47 | 19398 | (the)g(original)h(author)f(or)330 3455 y(publisher)23 |
37c41ab1 | 19399 | b(of)i(that)h(section)g(if)f(kno)m(wn,)h(or)f(else)h(a)f(unique)f(n)m |
5e13499c | 19400 | (um)m(b)s(er.)38 b(Mak)m(e)26 b(the)g(same)f(adjustmen)m(t)330 |
1231ac47 | 19401 | 3565 y(to)g(the)g(section)g(titles)h(in)e(the)h(list)g(of)f(In)m(v)-5 |
37c41ab1 | 19402 | b(arian)m(t)26 b(Sections)f(in)f(the)g(license)i(notice)g(of)e(the)h |
1231ac47 | 19403 | (com)m(bined)330 3674 y(w)m(ork.)330 3817 y(In)41 b(the)g(com)m |
37c41ab1 CR |
19404 | (bination,)46 b(y)m(ou)41 b(m)m(ust)g(com)m(bine)h(an)m(y)g(sections)g |
19405 | (En)m(titled)g(\\History")h(in)e(the)g(v)-5 b(ari-)330 | |
1231ac47 | 19406 | 3926 y(ous)32 b(original)h(do)s(cumen)m(ts,)g(forming)f(one)g(section)h |
37c41ab1 | 19407 | (En)m(titled)g(\\History";)i(lik)m(ewise)f(com)m(bine)f(an)m(y)330 |
1231ac47 | 19408 | 4036 y(sections)g(En)m(titled)f(\\Ac)m(kno)m(wledgemen)m(ts",)k(and)31 |
37c41ab1 | 19409 | b(an)m(y)h(sections)h(En)m(titled)g(\\Dedications".)47 |
1231ac47 CR |
19410 | b(Y)-8 b(ou)330 4145 y(m)m(ust)30 b(delete)i(all)f(sections)h(En)m |
19411 | (titled)f(\\Endorsemen)m(ts.")199 4288 y(6.)61 b(COLLECTIONS)28 | |
19412 | b(OF)i(DOCUMENTS)330 4430 y(Y)-8 b(ou)32 b(ma)m(y)h(mak)m(e)g(a)f | |
37c41ab1 | 19413 | (collection)i(consisting)f(of)f(the)g(Do)s(cumen)m(t)g(and)g(other)g |
1231ac47 | 19414 | (do)s(cumen)m(ts)f(released)330 4540 y(under)41 b(this)h(License,)k |
37c41ab1 | 19415 | (and)c(replace)h(the)g(individual)f(copies)h(of)f(this)g(License)h(in)f |
1231ac47 | 19416 | (the)h(v)-5 b(arious)330 4650 y(do)s(cumen)m(ts)42 b(with)g(a)h(single) |
37c41ab1 | 19417 | g(cop)m(y)h(that)f(is)f(included)g(in)g(the)h(collection,)48 |
1231ac47 | 19418 | b(pro)m(vided)42 b(that)i(y)m(ou)330 4759 y(follo)m(w)38 |
37c41ab1 CR |
19419 | b(the)g(rules)e(of)h(this)g(License)h(for)f(v)m(erbatim)h(cop)m(ying)g |
19420 | (of)f(eac)m(h)h(of)f(the)h(do)s(cumen)m(ts)e(in)h(all)330 | |
1231ac47 | 19421 | 4869 y(other)31 b(resp)s(ects.)330 5011 y(Y)-8 b(ou)32 |
37c41ab1 CR |
19422 | b(ma)m(y)g(extract)h(a)f(single)g(do)s(cumen)m(t)f(from)g(suc)m(h)g(a)h |
19423 | (collection,)i(and)d(distribute)g(it)h(individu-)330 | |
1231ac47 | 19424 | 5121 y(ally)k(under)d(this)i(License,)i(pro)m(vided)e(y)m(ou)g(insert)g |
37c41ab1 | 19425 | (a)g(cop)m(y)h(of)f(this)g(License)g(in)m(to)h(the)g(extracted)330 |
1231ac47 | 19426 | 5230 y(do)s(cumen)m(t,)d(and)f(follo)m(w)i(this)e(License)h(in)g(all)g |
37c41ab1 | 19427 | (other)g(resp)s(ects)f(regarding)h(v)m(erbatim)g(cop)m(ying)h(of)330 |
1231ac47 | 19428 | 5340 y(that)d(do)s(cumen)m(t.)p eop end |
900a813b CR |
19429 | %%Page: 160 166 |
19430 | TeXDict begin 160 165 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 19431 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19432 | b(160)199 299 y(7.)61 b(A)m(GGREGA)-8 b(TION)32 b(WITH)e(INDEPENDENT)h |
ad4aef08 CR |
19433 | (W)m(ORKS)330 441 y(A)d(compilation)i(of)e(the)g(Do)s(cumen)m(t)h(or)f |
19434 | (its)g(deriv)-5 b(ativ)m(es)30 b(with)d(other)i(separate)g(and)e(indep) | |
19435 | s(enden)m(t)330 551 y(do)s(cumen)m(ts)33 b(or)g(w)m(orks,)h(in)f(or)h | |
19436 | (on)f(a)g(v)m(olume)h(of)g(a)f(storage)i(or)e(distribution)g(medium,)g | |
19437 | (is)h(called)330 661 y(an)c(\\aggregate")k(if)c(the)g(cop)m(yrigh)m(t)i | |
19438 | (resulting)e(from)f(the)i(compilation)g(is)f(not)h(used)e(to)i(limit)g | |
19439 | (the)330 770 y(legal)d(righ)m(ts)f(of)g(the)g(compilation's)h(users)e | |
19440 | (b)s(ey)m(ond)g(what)g(the)h(individual)f(w)m(orks)g(p)s(ermit.)39 | |
1231ac47 CR |
19441 | b(When)330 880 y(the)g(Do)s(cumen)m(t)g(is)f(included)g(in)g(an)g |
19442 | (aggregate,)44 b(this)38 b(License)h(do)s(es)f(not)h(apply)f(to)h(the)g | |
19443 | (other)330 989 y(w)m(orks)30 b(in)g(the)h(aggregate)i(whic)m(h)d(are)h | |
19444 | (not)g(themselv)m(es)g(deriv)-5 b(ativ)m(e)32 b(w)m(orks)f(of)f(the)h | |
19445 | (Do)s(cumen)m(t.)330 1132 y(If)22 b(the)h(Co)m(v)m(er)h(T)-8 | |
19446 | b(ext)23 b(requiremen)m(t)g(of)g(section)h(3)f(is)g(applicable)h(to)f | |
19447 | (these)h(copies)f(of)g(the)g(Do)s(cumen)m(t,)330 1241 | |
19448 | y(then)f(if)g(the)h(Do)s(cumen)m(t)g(is)g(less)f(than)g(one)h(half)f | |
19449 | (of)h(the)g(en)m(tire)g(aggregate,)k(the)c(Do)s(cumen)m(t's)g(Co)m(v)m | |
19450 | (er)330 1351 y(T)-8 b(exts)27 b(ma)m(y)g(b)s(e)f(placed)h(on)g(co)m(v)m | |
19451 | (ers)h(that)f(brac)m(k)m(et)h(the)f(Do)s(cumen)m(t)g(within)f(the)h | |
19452 | (aggregate,)j(or)d(the)330 1461 y(electronic)37 b(equiv)-5 | |
19453 | b(alen)m(t)36 b(of)g(co)m(v)m(ers)g(if)f(the)g(Do)s(cumen)m(t)h(is)f | |
19454 | (in)g(electronic)i(form.)54 b(Otherwise)35 b(they)330 | |
19455 | 1570 y(m)m(ust)30 b(app)s(ear)g(on)g(prin)m(ted)g(co)m(v)m(ers)i(that)f | |
19456 | (brac)m(k)m(et)h(the)f(whole)f(aggregate.)199 1713 y(8.)61 | |
19457 | b(TRANSLA)-8 b(TION)330 1855 y(T)g(ranslation)41 b(is)f(considered)f(a) | |
37c41ab1 | 19458 | i(kind)e(of)h(mo)s(di\014cation,)j(so)d(y)m(ou)g(ma)m(y)h(distribute)e |
1231ac47 | 19459 | (translations)330 1965 y(of)45 b(the)f(Do)s(cumen)m(t)h(under)e(the)h |
37c41ab1 | 19460 | (terms)h(of)f(section)i(4.)83 b(Replacing)45 b(In)m(v)-5 |
1231ac47 | 19461 | b(arian)m(t)45 b(Sections)g(with)330 2074 y(translations)h(requires)f |
37c41ab1 | 19462 | (sp)s(ecial)h(p)s(ermission)f(from)g(their)g(cop)m(yrigh)m(t)i |
1231ac47 | 19463 | (holders,)i(but)c(y)m(ou)g(ma)m(y)330 2184 y(include)24 |
37c41ab1 CR |
19464 | b(translations)i(of)e(some)h(or)g(all)g(In)m(v)-5 b(arian)m(t)25 |
19465 | b(Sections)g(in)f(addition)h(to)g(the)g(original)h(v)m(ersions)330 | |
1231ac47 | 19466 | 2293 y(of)32 b(these)f(In)m(v)-5 b(arian)m(t)33 b(Sections.)44 |
37c41ab1 | 19467 | b(Y)-8 b(ou)32 b(ma)m(y)g(include)f(a)h(translation)g(of)g(this)f |
1231ac47 | 19468 | (License,)i(and)d(all)j(the)330 2403 y(license)42 b(notices)g(in)f(the) |
37c41ab1 | 19469 | h(Do)s(cumen)m(t,)j(and)40 b(an)m(y)i(W)-8 b(arran)m(t)m(y)42 |
1231ac47 | 19470 | b(Disclaimers,)k(pro)m(vided)41 b(that)h(y)m(ou)330 2513 |
37c41ab1 CR |
19471 | y(also)f(include)f(the)g(original)h(English)f(v)m(ersion)g(of)g(this)g |
19472 | (License)h(and)e(the)h(original)h(v)m(ersions)g(of)330 | |
1231ac47 | 19473 | 2622 y(those)35 b(notices)g(and)e(disclaimers.)53 b(In)33 |
37c41ab1 | 19474 | b(case)i(of)g(a)f(disagreemen)m(t)h(b)s(et)m(w)m(een)g(the)f |
1231ac47 | 19475 | (translation)i(and)330 2732 y(the)f(original)i(v)m(ersion)e(of)h(this)f |
37c41ab1 | 19476 | (License)h(or)f(a)g(notice)i(or)e(disclaimer,)i(the)f(original)g(v)m |
1231ac47 | 19477 | (ersion)g(will)330 2841 y(prev)-5 b(ail.)330 2984 y(If)28 |
37c41ab1 CR |
19478 | b(a)h(section)h(in)e(the)h(Do)s(cumen)m(t)h(is)e(En)m(titled)i(\\Ac)m |
19479 | (kno)m(wledgemen)m(ts",)i(\\Dedications",)g(or)d(\\His-)330 | |
1231ac47 | 19480 | 3093 y(tory",)f(the)f(requiremen)m(t)f(\(section)i(4\))f(to)g(Preserv)m |
37c41ab1 | 19481 | (e)g(its)f(Title)i(\(section)f(1\))g(will)g(t)m(ypically)h(require)330 |
1231ac47 CR |
19482 | 3203 y(c)m(hanging)j(the)g(actual)h(title.)199 3345 y(9.)61 |
19483 | b(TERMINA)-8 b(TION)330 3488 y(Y)g(ou)30 b(ma)m(y)h(not)f(cop)m(y)-8 | |
37c41ab1 | 19484 | b(,)31 b(mo)s(dify)-8 b(,)30 b(sublicense,)g(or)g(distribute)f(the)h |
1231ac47 CR |
19485 | (Do)s(cumen)m(t)g(except)h(as)f(expressly)330 3598 y(pro)m(vided)38 |
19486 | b(under)f(this)i(License.)65 b(An)m(y)39 b(attempt)h(otherwise)f(to)g | |
19487 | (cop)m(y)-8 b(,)42 b(mo)s(dify)-8 b(,)40 b(sublicense,)h(or)330 | |
19488 | 3707 y(distribute)30 b(it)h(is)f(v)m(oid,)h(and)f(will)h(automatically) | |
19489 | i(terminate)f(y)m(our)e(righ)m(ts)h(under)e(this)h(License.)330 | |
19490 | 3850 y(Ho)m(w)m(ev)m(er,)35 b(if)e(y)m(ou)f(cease)i(all)f(violation)i | |
19491 | (of)d(this)g(License,)i(then)e(y)m(our)h(license)g(from)f(a)h | |
19492 | (particular)330 3959 y(cop)m(yrigh)m(t)k(holder)e(is)h(reinstated)h | |
19493 | (\(a\))f(pro)m(visionally)-8 b(,)39 b(unless)c(and)g(un)m(til)h(the)g | |
19494 | (cop)m(yrigh)m(t)h(holder)330 4069 y(explicitly)42 b(and)e(\014nally)h | |
19495 | (terminates)g(y)m(our)g(license,)j(and)c(\(b\))h(p)s(ermanen)m(tly)-8 | |
19496 | b(,)43 b(if)e(the)g(cop)m(yrigh)m(t)330 4178 y(holder)34 | |
19497 | b(fails)h(to)g(notify)g(y)m(ou)g(of)f(the)h(violation)h(b)m(y)e(some)h | |
19498 | (reasonable)g(means)g(prior)e(to)i(60)h(da)m(ys)330 4288 | |
19499 | y(after)31 b(the)f(cessation.)330 4430 y(Moreo)m(v)m(er,)k(y)m(our)d | |
19500 | (license)i(from)e(a)h(particular)f(cop)m(yrigh)m(t)i(holder)e(is)h | |
19501 | (reinstated)g(p)s(ermanen)m(tly)f(if)330 4540 y(the)d(cop)m(yrigh)m(t)h | |
19502 | (holder)f(noti\014es)g(y)m(ou)g(of)g(the)g(violation)h(b)m(y)f(some)g | |
19503 | (reasonable)h(means,)f(this)g(is)g(the)330 4650 y(\014rst)f(time)i(y)m | |
19504 | (ou)f(ha)m(v)m(e)h(receiv)m(ed)g(notice)g(of)f(violation)i(of)e(this)f | |
19505 | (License)i(\(for)f(an)m(y)g(w)m(ork\))g(from)f(that)330 | |
19506 | 4759 y(cop)m(yrigh)m(t)33 b(holder,)g(and)e(y)m(ou)h(cure)g(the)g | |
19507 | (violation)i(prior)d(to)i(30)f(da)m(ys)h(after)f(y)m(our)g(receipt)h | |
19508 | (of)f(the)330 4869 y(notice.)330 5011 y(T)-8 b(ermination)28 | |
19509 | b(of)g(y)m(our)f(righ)m(ts)h(under)e(this)i(section)g(do)s(es)f(not)h | |
19510 | (terminate)h(the)e(licenses)i(of)f(parties)330 5121 y(who)38 | |
19511 | b(ha)m(v)m(e)h(receiv)m(ed)h(copies)e(or)h(righ)m(ts)f(from)g(y)m(ou)g | |
19512 | (under)f(this)h(License.)64 b(If)38 b(y)m(our)g(righ)m(ts)h(ha)m(v)m(e) | |
19513 | 330 5230 y(b)s(een)25 b(terminated)i(and)e(not)h(p)s(ermanen)m(tly)g | |
19514 | (reinstated,)i(receipt)f(of)f(a)g(cop)m(y)h(of)f(some)h(or)f(all)h(of)f | |
19515 | (the)330 5340 y(same)31 b(material)h(do)s(es)e(not)g(giv)m(e)i(y)m(ou)f | |
19516 | (an)m(y)g(righ)m(ts)f(to)i(use)e(it.)p eop end | |
900a813b CR |
19517 | %%Page: 161 167 |
19518 | TeXDict begin 161 166 bop 150 -116 a Fu(App)s(endix)29 | |
1231ac47 | 19519 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19520 | b(161)154 299 y(10.)61 b(FUTURE)30 b(REVISIONS)f(OF)i(THIS)e(LICENSE) |
1231ac47 CR |
19521 | 330 433 y(The)41 b(F)-8 b(ree)43 b(Soft)m(w)m(are)f(F)-8 |
19522 | b(oundation)43 b(ma)m(y)f(publish)e(new,)k(revised)d(v)m(ersions)h(of)g | |
19523 | (the)g(GNU)g(F)-8 b(ree)330 543 y(Do)s(cumen)m(tation)34 | |
19524 | b(License)e(from)g(time)h(to)g(time.)46 b(Suc)m(h)31 | |
19525 | b(new)h(v)m(ersions)g(will)h(b)s(e)e(similar)h(in)g(spirit)330 | |
19526 | 653 y(to)j(the)g(presen)m(t)f(v)m(ersion,)i(but)e(ma)m(y)h(di\013er)f | |
19527 | (in)g(detail)h(to)g(address)f(new)g(problems)f(or)i(concerns.)330 | |
6e51e0d0 | 19528 | 762 y(See)c Ft(http://www.gnu.org/copy)o(left)o(/)p Fu(.)330 |
1231ac47 CR |
19529 | 897 y(Eac)m(h)f(v)m(ersion)g(of)g(the)f(License)h(is)g(giv)m(en)g(a)g |
19530 | (distinguishing)f(v)m(ersion)h(n)m(um)m(b)s(er.)39 b(If)29 | |
19531 | b(the)g(Do)s(cumen)m(t)330 1006 y(sp)s(eci\014es)45 b(that)h(a)g | |
19532 | (particular)f(n)m(um)m(b)s(ered)f(v)m(ersion)i(of)f(this)g(License)h | |
19533 | (\\or)g(an)m(y)g(later)g(v)m(ersion")330 1116 y(applies)33 | |
19534 | b(to)g(it,)h(y)m(ou)e(ha)m(v)m(e)i(the)f(option)g(of)f(follo)m(wing)i | |
19535 | (the)f(terms)f(and)g(conditions)h(either)g(of)f(that)330 | |
19536 | 1225 y(sp)s(eci\014ed)37 b(v)m(ersion)i(or)e(of)h(an)m(y)h(later)g(v)m | |
37c41ab1 | 19537 | (ersion)f(that)g(has)g(b)s(een)f(published)f(\(not)j(as)f(a)g(draft\))g |
1231ac47 | 19538 | (b)m(y)330 1335 y(the)33 b(F)-8 b(ree)34 b(Soft)m(w)m(are)f(F)-8 |
37c41ab1 | 19539 | b(oundation.)49 b(If)32 b(the)h(Do)s(cumen)m(t)g(do)s(es)g(not)g(sp)s |
1231ac47 | 19540 | (ecify)f(a)h(v)m(ersion)g(n)m(um)m(b)s(er)f(of)330 1445 |
37c41ab1 CR |
19541 | y(this)i(License,)j(y)m(ou)d(ma)m(y)i(c)m(ho)s(ose)f(an)m(y)g(v)m |
19542 | (ersion)g(ev)m(er)g(published)e(\(not)i(as)g(a)f(draft\))h(b)m(y)f(the) | |
1231ac47 CR |
19543 | h(F)-8 b(ree)330 1554 y(Soft)m(w)m(are)33 b(F)-8 b(oundation.)46 |
19544 | b(If)32 b(the)g(Do)s(cumen)m(t)g(sp)s(eci\014es)g(that)g(a)h(pro)m(xy)f | |
19545 | (can)g(decide)g(whic)m(h)g(future)330 1664 y(v)m(ersions)h(of)g(this)f | |
19546 | (License)h(can)g(b)s(e)f(used,)g(that)i(pro)m(xy's)e(public)g(statemen) | |
19547 | m(t)i(of)f(acceptance)i(of)e(a)330 1773 y(v)m(ersion)e(p)s(ermanen)m | |
19548 | (tly)f(authorizes)h(y)m(ou)g(to)g(c)m(ho)s(ose)g(that)g(v)m(ersion)g | |
19549 | (for)f(the)h(Do)s(cumen)m(t.)154 1908 y(11.)61 b(RELICENSING)330 | |
19550 | 2042 y(\\Massiv)m(e)39 b(Multiauthor)f(Collab)s(oration)g(Site")h(\(or) | |
19551 | e(\\MMC)h(Site"\))h(means)e(an)m(y)h(W)-8 b(orld)37 b(Wide)330 | |
19552 | 2152 y(W)-8 b(eb)36 b(serv)m(er)g(that)h(publishes)d(cop)m(yrigh)m | |
19553 | (table)k(w)m(orks)e(and)f(also)i(pro)m(vides)e(prominen)m(t)h | |
19554 | (facilities)330 2262 y(for)27 b(an)m(yb)s(o)s(dy)g(to)h(edit)g(those)g | |
19555 | (w)m(orks.)39 b(A)28 b(public)f(wiki)h(that)g(an)m(yb)s(o)s(dy)e(can)i | |
19556 | (edit)g(is)f(an)h(example)g(of)330 2371 y(suc)m(h)33 | |
19557 | b(a)h(serv)m(er.)51 b(A)34 b(\\Massiv)m(e)i(Multiauthor)e(Collab)s | |
19558 | (oration")h(\(or)f(\\MMC"\))h(con)m(tained)g(in)f(the)330 | |
19559 | 2481 y(site)d(means)f(an)m(y)h(set)g(of)g(cop)m(yrigh)m(table)h(w)m | |
19560 | (orks)e(th)m(us)g(published)f(on)h(the)h(MMC)f(site.)330 | |
19561 | 2615 y(\\CC-BY-SA")36 b(means)f(the)g(Creativ)m(e)i(Commons)e(A)m | |
19562 | (ttribution-Share)g(Alik)m(e)i(3.0)f(license)g(pub-)330 | |
19563 | 2725 y(lished)27 b(b)m(y)f(Creativ)m(e)j(Commons)d(Corp)s(oration,)h(a) | |
19564 | g(not-for-pro\014t)g(corp)s(oration)h(with)e(a)h(principal)330 | |
19565 | 2834 y(place)g(of)f(business)e(in)i(San)f(F)-8 b(rancisco,)29 | |
19566 | b(California,)f(as)e(w)m(ell)h(as)f(future)f(cop)m(yleft)i(v)m(ersions) | |
19567 | f(of)g(that)330 2944 y(license)31 b(published)e(b)m(y)h(that)h(same)g | |
19568 | (organization.)330 3078 y(\\Incorp)s(orate")h(means)e(to)h(publish)e | |
19569 | (or)i(republish)e(a)i(Do)s(cumen)m(t,)g(in)g(whole)g(or)f(in)g(part,)h | |
19570 | (as)g(part)330 3188 y(of)g(another)f(Do)s(cumen)m(t.)330 | |
19571 | 3323 y(An)c(MMC)g(is)h(\\eligible)h(for)e(relicensing")h(if)g(it)f(is)h | |
19572 | (licensed)f(under)f(this)h(License,)i(and)e(if)g(all)h(w)m(orks)330 | |
19573 | 3432 y(that)43 b(w)m(ere)f(\014rst)f(published)f(under)h(this)h | |
19574 | (License)g(somewhere)g(other)g(than)g(this)g(MMC,)h(and)330 | |
19575 | 3542 y(subsequen)m(tly)34 b(incorp)s(orated)h(in)f(whole)h(or)g(in)f | |
19576 | (part)h(in)m(to)h(the)f(MMC,)g(\(1\))h(had)e(no)h(co)m(v)m(er)h(texts) | |
19577 | 330 3651 y(or)30 b(in)m(v)-5 b(arian)m(t)32 b(sections,)g(and)d(\(2\))j | |
19578 | (w)m(ere)f(th)m(us)f(incorp)s(orated)g(prior)g(to)h(No)m(v)m(em)m(b)s | |
19579 | (er)g(1,)g(2008.)330 3786 y(The)40 b(op)s(erator)h(of)g(an)f(MMC)h | |
19580 | (Site)g(ma)m(y)g(republish)e(an)h(MMC)h(con)m(tained)h(in)e(the)h(site) | |
19581 | g(under)330 3895 y(CC-BY-SA)30 b(on)g(the)h(same)f(site)h(at)g(an)m(y)g | |
19582 | (time)g(b)s(efore)e(August)h(1,)h(2009,)h(pro)m(vided)e(the)g(MMC)h(is) | |
19583 | 330 4005 y(eligible)h(for)e(relicensing.)p eop end | |
900a813b CR |
19584 | %%Page: 162 168 |
19585 | TeXDict begin 162 167 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 19586 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
900a813b | 19587 | b(162)150 299 y Fs(ADDENDUM:)45 b(Ho)l(w)h(to)f(use)g(this)h(License)f |
6e51e0d0 | 19588 | (for)g(y)l(our)g(do)t(cumen)l(ts)150 458 y Fu(T)-8 b(o)35 |
ad4aef08 CR |
19589 | b(use)f(this)h(License)g(in)f(a)h(do)s(cumen)m(t)g(y)m(ou)f(ha)m(v)m(e) |
19590 | i(written,)g(include)f(a)f(cop)m(y)i(of)f(the)f(License)h(in)g(the)150 | |
19591 | 568 y(do)s(cumen)m(t)30 b(and)g(put)g(the)g(follo)m(wing)i(cop)m(yrigh) | |
19592 | m(t)g(and)e(license)h(notices)g(just)f(after)h(the)g(title)h(page:)468 | |
6e51e0d0 CR |
19593 | 680 y Fe(Copyright)42 b(\(C\))79 b Fd(year)g(your)40 |
19594 | b(name)p Fe(.)468 767 y(Permission)i(is)e(granted)g(to)g(copy,)h | |
ad4aef08 CR |
19595 | (distribute)g(and/or)g(modify)f(this)g(document)468 854 |
19596 | y(under)h(the)f(terms)g(of)g(the)g(GNU)g(Free)g(Documentation)i | |
19597 | (License,)f(Version)g(1.3)468 941 y(or)f(any)g(later)g(version)h | |
19598 | (published)h(by)d(the)h(Free)g(Software)h(Foundation;)468 | |
19599 | 1029 y(with)g(no)e(Invariant)j(Sections,)f(no)f(Front-Cover)h(Texts,)g | |
19600 | (and)f(no)f(Back-Cover)468 1116 y(Texts.)80 b(A)40 b(copy)g(of)g(the)f | |
19601 | (license)i(is)f(included)h(in)f(the)g(section)g(entitled)h(``GNU)468 | |
6e51e0d0 | 19602 | 1203 y(Free)g(Documentation)h(License''.)275 1337 y Fu(If)d(y)m(ou)h |
ad4aef08 CR |
19603 | (ha)m(v)m(e)h(In)m(v)-5 b(arian)m(t)41 b(Sections,)i(F)-8 |
19604 | b(ron)m(t-Co)m(v)m(er)42 b(T)-8 b(exts)41 b(and)e(Bac)m(k-Co)m(v)m(er)k | |
19605 | (T)-8 b(exts,)43 b(replace)e(the)150 1447 y(\\with)6 | |
19606 | b(.)22 b(.)g(.)12 b(T)-8 b(exts.")41 b(line)31 b(with)f(this:)547 | |
19607 | 1559 y Fe(with)40 b(the)g(Invariant)h(Sections)g(being)g | |
6e51e0d0 CR |
19608 | Fd(list)f(their)g(titles)p Fe(,)h(with)547 1646 y(the)f(Front-Cover)i |
19609 | (Texts)e(being)g Fd(list)p Fe(,)h(and)f(with)g(the)g(Back-Cover)h | |
19610 | (Texts)547 1733 y(being)f Fd(list)p Fe(.)275 1868 y Fu(If)34 | |
19611 | b(y)m(ou)i(ha)m(v)m(e)g(In)m(v)-5 b(arian)m(t)36 b(Sections)g(without)f | |
19612 | (Co)m(v)m(er)h(T)-8 b(exts,)38 b(or)d(some)g(other)h(com)m(bination)g | |
19613 | (of)g(the)150 1978 y(three,)31 b(merge)g(those)g(t)m(w)m(o)g | |
19614 | (alternativ)m(es)i(to)e(suit)f(the)h(situation.)275 2112 | |
19615 | y(If)23 b(y)m(our)h(do)s(cumen)m(t)f(con)m(tains)i(non)m(trivial)g | |
19616 | (examples)g(of)f(program)f(co)s(de,)j(w)m(e)e(recommend)g(releasing)150 | |
19617 | 2222 y(these)44 b(examples)f(in)g(parallel)h(under)e(y)m(our)h(c)m | |
19618 | (hoice)i(of)e(free)g(soft)m(w)m(are)h(license,)k(suc)m(h)43 | |
19619 | b(as)g(the)g(GNU)150 2331 y(General)31 b(Public)f(License,)i(to)f(p)s | |
19620 | (ermit)e(their)i(use)f(in)g(free)g(soft)m(w)m(are.)p | |
19621 | eop end | |
900a813b | 19622 | %%Page: 163 169 |
037a8b7f CR |
19623 | TeXDict begin 163 168 bop 3614 -116 a Fu(163)150 299 |
19624 | y Fp(App)t(endix)52 b(D)81 b(Indexes)150 639 y Fs(D.1)68 | |
19625 | b(Index)45 b(of)g(Shell)g(Builtin)g(Commands)146 806 | |
19626 | y(.)150 923 y Fe(.)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19627 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19628 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19629 | (:)33 b Fb(41)146 1163 y Fs(:)150 1280 y Fe(:)19 b Fc(:)13 | |
19630 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19631 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19632 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(41)146 | |
19633 | 1523 y Fs([)150 1640 y Fe([)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19634 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19635 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19636 | (:)g(:)g(:)33 b Fb(45)146 1881 y Fs(A)150 1998 y Fe(alias)9 | |
19637 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
c302751c | 19638 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
19639 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(48)146 2239 y |
19640 | Fs(B)150 2356 y Fe(bg)14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
c302751c | 19641 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
19642 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)29 |
19643 | b Fb(100)150 2443 y Fe(bind)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19644 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19645 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
19646 | b Fb(48)150 2531 y Fe(break)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g | |
c302751c | 19647 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
19648 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 |
19649 | b Fb(42)150 2618 y Fe(builtin)f Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
c302751c | 19650 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19651 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 |
19652 | b Fb(49)146 2859 y Fs(C)150 2976 y Fe(caller)6 b Fc(:)15 | |
19653 | b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19654 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19655 | g(:)g(:)g(:)h(:)f(:)20 b Fb(50)150 3063 y Fe(cd)c Fc(:)e(:)f(:)g(:)g(:) | |
19656 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19657 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19658 | g(:)g(:)g(:)g(:)g(:)31 b Fb(42)150 3151 y Fe(command)22 | |
19659 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19660 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19661 | h(:)f(:)g(:)g(:)g(:)35 b Fb(50)150 3238 y Fe(compgen)18 | |
19662 | b Fc(:)d(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
c302751c | 19663 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
037a8b7f CR |
19664 | (:)h(:)f(:)g(:)33 b Fb(130)150 3326 y Fe(complete)16 |
19665 | b Fc(:)f(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19666 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19667 | (:)g(:)g(:)31 b Fb(130)150 3413 y Fe(compopt)18 b Fc(:)d(:)e(:)g(:)h(:) | |
c302751c | 19668 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
037a8b7f CR |
19669 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)33 |
19670 | b Fb(133)150 3501 y Fe(continue)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g | |
c302751c | 19671 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
19672 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b |
19673 | Fb(42)146 3741 y Fs(D)150 3858 y Fe(declare)22 b Fc(:)13 | |
19674 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
19675 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19676 | g(:)g(:)g(:)35 b Fb(50)150 3946 y Fe(dirs)11 b Fc(:)j(:)f(:)g(:)h(:)f | |
19677 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19678 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19679 | (:)g(:)h(:)25 b Fb(92)150 4033 y Fe(disown)d Fc(:)13 | |
19680 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19681 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19682 | g(:)g(:)g(:)36 b Fb(101)146 4274 y Fs(E)150 4391 y Fe(echo)11 | |
19683 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19684 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19685 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(52)150 4478 | |
19686 | y Fe(enable)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19687 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19688 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fb(52)150 | |
19689 | 4566 y Fe(eval)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
c302751c | 19690 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
19691 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 |
19692 | b Fb(42)150 4653 y Fe(exec)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19693 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19694 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
19695 | b Fb(43)150 4741 y Fe(exit)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19696 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19697 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
19698 | b Fb(43)150 4828 y Fe(export)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g | |
19699 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19700 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 | |
19701 | b Fb(43)146 5080 y Fs(F)150 5197 y Fe(fc)14 b Fc(:)g(:)f(:)g(:)g(:)g(:) | |
19702 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19703 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19704 | g(:)g(:)g(:)29 b Fb(136)150 5284 y Fe(fg)14 b Fc(:)g(:)f(:)g(:)g(:)g(:) | |
19705 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19706 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19707 | g(:)g(:)g(:)29 b Fb(100)2021 871 y Fs(G)2025 988 y Fe(getopts)22 | |
19708 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
c302751c | 19709 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19710 | g(:)g(:)h(:)f(:)g(:)35 b Fb(43)2021 1250 y Fs(H)2025 |
19711 | 1369 y Fe(hash)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
c302751c | 19712 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
19713 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 |
19714 | b Fb(44)2025 1457 y Fe(help)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
c302751c | 19715 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19716 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 |
19717 | b Fb(53)2025 1544 y Fe(history)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g | |
d7935593 | 19718 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
19719 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b |
19720 | Fb(137)2021 1806 y Fs(J)2025 1924 y Fe(jobs)9 b Fc(:)14 | |
19721 | b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19722 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19723 | g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(100)2021 2186 y Fs(K)2025 | |
19724 | 2303 y Fe(kill)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19725 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19726 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 | |
19727 | b Fb(101)2021 2554 y Fs(L)2025 2672 y Fe(let)14 b Fc(:)f(:)g(:)h(:)f(:) | |
19728 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19729 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19730 | g(:)g(:)h(:)f(:)28 b Fb(53)2025 2760 y Fe(local)9 b Fc(:)14 | |
19731 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19732 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19733 | g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(53)2025 2848 y Fe(logout)6 | |
19734 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19735 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19736 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(54)2021 3110 y Fs(M)2025 | |
19737 | 3227 y Fe(mapfile)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19738 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19739 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(54)2021 | |
19740 | 3489 y Fs(P)2025 3608 y Fe(popd)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g | |
19741 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19742 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 | |
19743 | b Fb(92)2025 3696 y Fe(printf)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g | |
c302751c | 19744 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19745 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 |
19746 | b Fb(54)2025 3784 y Fe(pushd)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
c302751c | 19747 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
037a8b7f CR |
19748 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 |
19749 | b Fb(92)2025 3871 y Fe(pwd)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19750 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19751 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 | |
19752 | b Fb(44)2021 4133 y Fs(R)2025 4251 y Fe(read)11 b Fc(:)j(:)f(:)g(:)g(:) | |
c302751c CR |
19753 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19754 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
037a8b7f CR |
19755 | g(:)g(:)g(:)26 b Fb(55)2025 4339 y Fe(readarray)15 b |
19756 | Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19757 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19758 | g(:)g(:)30 b Fb(56)2025 4427 y Fe(readonly)18 b Fc(:)d(:)e(:)g(:)g(:)g | |
19759 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19760 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
19761 | b Fb(44)2025 4515 y Fe(return)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g | |
19762 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19763 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 | |
19764 | b Fb(45)2021 4765 y Fs(S)2025 4884 y Fe(set)14 b Fc(:)f(:)g(:)h(:)f(:)g | |
19765 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19766 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19767 | (:)g(:)h(:)f(:)28 b Fb(59)2025 4972 y Fe(shift)9 b Fc(:)14 | |
19768 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19769 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19770 | g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(45)2025 5060 y Fe(shopt)9 | |
19771 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
c302751c | 19772 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
19773 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(63)2025 5148 |
19774 | y Fe(source)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19775 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19776 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(57)2025 | |
19777 | 5235 y Fe(suspend)d Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19778 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19779 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(101)p eop end | |
19780 | %%Page: 164 170 | |
19781 | TeXDict begin 164 169 bop 150 -116 a Fu(App)s(endix)29 | |
19782 | b(D:)i(Indexes)2623 b(164)146 294 y Fs(T)150 410 y Fe(test)11 | |
19783 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
6e51e0d0 | 19784 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
037a8b7f CR |
19785 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(45)150 497 |
19786 | y Fe(times)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19787 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19788 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(47)150 | |
19789 | 584 y Fe(trap)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19790 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19791 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
19792 | b Fb(47)150 671 y Fe(type)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19793 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19794 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
19795 | b Fb(57)150 758 y Fe(typeset)d Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19796 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19797 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 | |
19798 | b Fb(57)146 1003 y Fs(U)150 1119 y Fe(ulimit)6 b Fc(:)15 | |
19799 | b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19800 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19801 | g(:)g(:)g(:)h(:)f(:)20 b Fb(57)150 1206 y Fe(umask)9 | |
19802 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19803 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19804 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(47)150 1293 y | |
19805 | Fe(unalias)f Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19806 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19807 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(58)150 1380 y | |
19808 | Fe(unset)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19809 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19810 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(48)2021 | |
19811 | 294 y Fs(W)2025 433 y Fe(wait)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f | |
c302751c | 19812 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
19813 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 |
19814 | b Fb(101)150 1751 y Fs(D.2)68 b(Index)45 b(of)g(Shell)g(Reserv)l(ed)h | |
19815 | (W)-11 b(ords)146 2068 y(!)150 2184 y Fe(!)21 b Fc(:)13 | |
c302751c CR |
19816 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
19817 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
037a8b7f CR |
19818 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b Fb(8)146 |
19819 | 2420 y Fs([)150 2536 y Fe([[)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19820 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19821 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19822 | g(:)31 b Fb(12)146 2778 y Fs(])150 2894 y Fe(]])16 b | |
19823 | Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19824 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19825 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 b Fb(12)146 | |
19826 | 3136 y Fa(n)150 3252 y Fe({)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
c302751c | 19827 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19828 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19829 | (:)g(:)g(:)33 b Fb(14)150 3339 y Fe(})19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:) | |
6e51e0d0 CR |
19830 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19831 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
037a8b7f CR |
19832 | g(:)h(:)f(:)g(:)g(:)33 b Fb(14)146 3574 y Fs(C)150 3690 |
19833 | y Fe(case)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19834 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19835 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b | |
19836 | Fb(11)146 3923 y Fs(D)150 4039 y Fe(do)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g | |
19837 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19838 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19839 | (:)g(:)g(:)g(:)31 b Fb(10)150 4126 y Fe(done)11 b Fc(:)j(:)f(:)g(:)h(:) | |
19840 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
6e51e0d0 | 19841 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
19842 | g(:)g(:)h(:)25 b Fb(10)146 4360 y Fs(E)150 4476 y Fe(elif)11 |
19843 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19844 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19845 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(10)150 4563 | |
19846 | y Fe(else)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19847 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19848 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b | |
19849 | Fb(10)150 4650 y Fe(esac)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19850 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19851 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
19852 | b Fb(11)2021 2067 y Fs(F)2025 2193 y Fe(fi)16 b Fc(:)e(:)f(:)g(:)g(:)g | |
19853 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
6e51e0d0 | 19854 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
037a8b7f CR |
19855 | (:)g(:)g(:)g(:)g(:)31 b Fb(10)2025 2283 y Fe(for)14 b |
19856 | Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
6e51e0d0 | 19857 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
19858 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 b Fb(10)2025 2370 |
19859 | y Fe(function)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19860 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19861 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(17)2021 2668 | |
19862 | y Fs(I)2025 2793 y Fe(if)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
6e51e0d0 | 19863 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
037a8b7f CR |
19864 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19865 | 31 b Fb(10)2025 2880 y Fe(in)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
6e51e0d0 | 19866 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
037a8b7f CR |
19867 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
19868 | g(:)31 b Fb(11)2021 3178 y Fs(S)2025 3300 y Fe(select)6 | |
19869 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19870 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19871 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(12)2021 3598 y Fs(T)2025 | |
19872 | 3723 y Fe(then)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19873 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19874 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 | |
19875 | b Fb(10)2025 3810 y Fe(time)13 b Fc(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
c302751c | 19876 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19877 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)28 |
19878 | b Fb(8)2021 4108 y Fs(U)2025 4230 y Fe(until)9 b Fc(:)14 | |
19879 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19880 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19881 | g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(10)2021 4528 y Fs(W)2025 | |
19882 | 4650 y Fe(while)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19883 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19884 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 | |
19885 | b Fb(10)150 5018 y Fs(D.3)68 b(P)l(arameter)47 b(and)d(V)-11 | |
19886 | b(ariable)46 b(Index)2021 5335 y(!)p eop end | |
900a813b CR |
19887 | %%Page: 165 171 |
19888 | TeXDict begin 165 170 bop 150 -116 a Fu(App)s(endix)29 | |
037a8b7f CR |
19889 | b(D:)i(Indexes)2623 b(165)150 260 y Fe(!)19 b Fc(:)13 |
19890 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19891 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19892 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(20)146 | |
19893 | 539 y Fs(#)150 660 y Fe(#)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19894 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
6e51e0d0 | 19895 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
037a8b7f CR |
19896 | g(:)g(:)33 b Fb(20)146 942 y Fs($)150 1065 y Fe($)19 |
19897 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19898 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19899 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b | |
19900 | Fb(20)150 1154 y Fe($!)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
c302751c | 19901 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19902 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 |
19903 | b Fb(20)150 1243 y Fe($#)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19904 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19905 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19906 | 31 b Fb(20)150 1333 y Fe($$)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19907 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19908 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19909 | (:)31 b Fb(20)150 1422 y Fe($*)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f | |
6e51e0d0 | 19910 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
19911 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19912 | (:)g(:)31 b Fb(20)150 1512 y Fe($-)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h | |
d7935593 | 19913 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
19914 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19915 | (:)g(:)g(:)31 b Fb(20)150 1601 y Fe($?)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g | |
19916 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19917 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19918 | (:)g(:)g(:)g(:)31 b Fb(20)150 1690 y Fe($@)16 b Fc(:)e(:)f(:)g(:)g(:)g | |
d7935593 | 19919 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
19920 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19921 | (:)g(:)g(:)g(:)g(:)31 b Fb(20)150 1780 y Fe($_)16 b Fc(:)e(:)f(:)g(:)g | |
d7935593 | 19922 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19923 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
19924 | (:)g(:)g(:)g(:)g(:)g(:)31 b Fb(20)150 1867 y Fe($0)16 | |
19925 | b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19926 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19927 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 b Fb(20)146 | |
19928 | 2155 y Fs(*)150 2276 y Fe(*)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
fc527055 | 19929 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19930 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19931 | (:)g(:)g(:)33 b Fb(20)146 2555 y Fs({)150 2676 y Fe(-)19 | |
19932 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
d7935593 | 19933 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19934 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b |
19935 | Fb(20)146 2955 y Fs(?)150 3076 y Fe(?)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:) | |
19936 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19937 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19938 | g(:)h(:)f(:)g(:)g(:)33 b Fb(20)146 3355 y Fs(@)150 3476 | |
19939 | y Fe(@)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19940 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19941 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 | |
19942 | b Fb(20)p 156 3755 41 6 v 150 3876 a Fe(_)19 b Fc(:)13 | |
19943 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
d7935593 | 19944 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
19945 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(20)146 |
19946 | 4155 y Fs(0)150 4276 y Fe(0)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
74d0116b | 19947 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19948 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19949 | (:)g(:)g(:)33 b Fb(20)146 4555 y Fs(A)150 4676 y Fe(auto_resume)8 | |
19950 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19951 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19952 | 23 b Fb(102)2021 294 y Fs(B)2025 412 y Fe(BASH)11 b Fc(:)j(:)f(:)g(:)g | |
19953 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19954 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19955 | (:)g(:)g(:)g(:)26 b Fb(70)2025 499 y Fe(BASH_ALIASES)8 | |
19956 | b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19957 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19958 | 22 b Fb(71)2025 587 y Fe(BASH_ARGC)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g | |
d7935593 | 19959 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
19960 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b |
19961 | Fb(71)2025 675 y Fe(BASH_ARGV)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g | |
19962 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19963 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(71)2025 | |
19964 | 763 y Fe(BASH_CMDS)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19965 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19966 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(71)2025 851 y | |
19967 | Fe(BASH_COMMAND)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
8a0829e9 | 19968 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
19969 | g(:)g(:)g(:)g(:)h(:)22 b Fb(71)2025 938 y Fe(BASH_COMPAT)10 |
19970 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19971 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19972 | g(:)25 b Fb(72)2025 1026 y Fe(BASH_ENV)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g | |
19973 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19974 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
19975 | b Fb(72)2025 1114 y Fe(BASH_EXECUTION_STRING)24 b Fc(:)13 | |
19976 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19977 | (:)g(:)g(:)g(:)g(:)34 b Fb(72)2025 1202 y Fe(BASH_LINENO)10 | |
19978 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19979 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19980 | g(:)25 b Fb(72)2025 1289 y Fe(BASH_LOADABLES_PATH)7 b | |
19981 | Fc(:)17 b(:)c(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19982 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(72)2025 | |
19983 | 1377 y Fe(BASH_REMATCH)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
bce12dd7 | 19984 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
037a8b7f CR |
19985 | (:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(72)2025 1465 y Fe(BASH_SOURCE)10 |
19986 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19987 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19988 | g(:)25 b Fb(72)2025 1553 y Fe(BASH_SUBSHELL)g Fc(:)13 | |
19989 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19990 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
19991 | b Fb(72)2025 1641 y Fe(BASH_VERSINFO)25 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g | |
19992 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19993 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 b Fb(72)2025 1728 | |
19994 | y Fe(BASH_VERSION)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19995 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19996 | g(:)g(:)g(:)g(:)h(:)22 b Fb(73)2025 1816 y Fe(BASH_XTRACEFD)j | |
19997 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19998 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
19999 | b Fb(73)2025 1904 y Fe(BASHOPTS)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f | |
20000 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20001 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b | |
20002 | Fb(71)2025 1992 y Fe(BASHPID)22 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
c302751c | 20003 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20004 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 |
20005 | b Fb(71)2025 2080 y Fe(bell-style)11 b Fc(:)k(:)e(:)g(:)g(:)g(:)h(:)f | |
20006 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20007 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)26 b Fb(107)2025 | |
20008 | 2167 y Fe(bind-tty-special-chars)14 b Fc(:)k(:)13 b(:)g(:)h(:)f(:)g(:)g | |
20009 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)29 | |
20010 | b Fb(107)2025 2255 y Fe(blink-matching-paren)24 b Fc(:)13 | |
20011 | b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20012 | (:)g(:)g(:)g(:)h(:)34 b Fb(107)2021 2512 y Fs(C)2025 | |
20013 | 2630 y Fe(CDPATH)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20014 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20015 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b | |
20016 | Fb(70)2025 2717 y Fe(CHILD_MAX)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g | |
20017 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20018 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(73)2025 | |
20019 | 2805 y Fe(colored-completion-prefix)7 b Fc(:)18 b(:)13 | |
20020 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 | |
20021 | b Fb(107)2025 2893 y Fe(colored-stats)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f | |
20022 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20023 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(107)2025 2981 y Fe(COLUMNS)22 | |
20024 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
c302751c | 20025 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20026 | g(:)g(:)h(:)f(:)g(:)35 b Fb(73)2025 3068 y Fe(comment-begin)23 |
20027 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20028 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 | |
20029 | b Fb(107)2025 3156 y Fe(COMP_CWORD)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g | |
20030 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20031 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(73)2025 | |
20032 | 3244 y Fe(COMP_KEY)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20033 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20034 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(74)2025 3332 | |
20035 | y Fe(COMP_LINE)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20036 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20037 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(73)2025 3420 y Fe(COMP_POINT)13 | |
20038 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20039 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20040 | (:)h(:)27 b Fb(74)2025 3507 y Fe(COMP_TYPE)15 b Fc(:)g(:)f(:)f(:)g(:)g | |
20041 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20042 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 | |
20043 | b Fb(74)2025 3595 y Fe(COMP_WORDBREAKS)17 b Fc(:)g(:)c(:)g(:)g(:)g(:)g | |
20044 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20045 | h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(74)2025 3683 y Fe(COMP_WORDS)13 | |
20046 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20047 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20048 | (:)h(:)27 b Fb(74)2025 3771 y Fe(completion-display-width)9 | |
20049 | b Fc(:)19 b(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20050 | (:)h(:)f(:)g(:)24 b Fb(107)2025 3859 y Fe(completion-ignore-case)14 | |
20051 | b Fc(:)k(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20052 | (:)g(:)g(:)h(:)f(:)29 b Fb(108)2025 3946 y Fe(completion-map-case)d | |
20053 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20054 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 b Fb(108)2025 4034 | |
20055 | y Fe(completion-prefix-display-leng)q(th)29 b Fc(:)13 | |
20056 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)38 b Fb(108)2025 4122 | |
20057 | y Fe(completion-query-items)14 b Fc(:)k(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g | |
20058 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)29 | |
20059 | b Fb(108)2025 4210 y Fe(COMPREPLY)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g | |
20060 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20061 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b | |
20062 | Fb(74)2025 4297 y Fe(convert-meta)25 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:) | |
20063 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20064 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(108)2025 4385 | |
20065 | y Fe(COPROC)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20066 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20067 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(74)2021 | |
20068 | 4630 y Fs(D)2025 4748 y Fe(DIRSTACK)d Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:) | |
20069 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20070 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
20071 | b Fb(74)2025 4835 y Fe(disable-completion)7 b Fc(:)17 | |
20072 | b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20073 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(108)p eop end | |
900a813b CR |
20074 | %%Page: 166 172 |
20075 | TeXDict begin 166 171 bop 150 -116 a Fu(App)s(endix)29 | |
037a8b7f CR |
20076 | b(D:)i(Indexes)2623 b(166)146 294 y Fs(E)150 410 y Fe |
20077 | (echo-control-characters)12 b Fc(:)18 b(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g | |
20078 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)26 b Fb(109)150 | |
20079 | 497 y Fe(editing-mode)f Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20080 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20081 | g(:)g(:)g(:)h(:)37 b Fb(108)150 585 y Fe(emacs-mode-string)10 | |
20082 | b Fc(:)17 b(:)c(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20083 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)25 b Fb(108)150 | |
20084 | 672 y Fe(EMACS)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
bce12dd7 | 20085 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
037a8b7f CR |
20086 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 |
20087 | b Fb(74)150 759 y Fe(enable-bracketed-paste)14 b Fc(:)k(:)c(:)f(:)g(:)g | |
20088 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 | |
20089 | b Fb(109)150 847 y Fe(enable-keypad)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g | |
20090 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20091 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(109)150 934 y Fe(ENV)14 | |
20092 | b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20093 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20094 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 b Fb(75)150 | |
20095 | 1021 y Fe(EUID)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20096 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20097 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
20098 | b Fb(75)150 1109 y Fe(EXECIGNORE)13 b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:) | |
20099 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20100 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fb(75)150 | |
20101 | 1196 y Fe(expand-tilde)e Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20102 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20103 | g(:)g(:)g(:)h(:)37 b Fb(109)146 1443 y Fs(F)150 1559 | |
20104 | y Fe(FCEDIT)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20105 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20106 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fb(75)150 | |
20107 | 1646 y Fe(FIGNORE)i Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20108 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20109 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(75)150 | |
20110 | 1734 y Fe(FUNCNAME)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20111 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20112 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(75)150 1821 | |
20113 | y Fe(FUNCNEST)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20114 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20115 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(75)146 2056 y | |
20116 | Fs(G)150 2173 y Fe(GLOBIGNORE)13 b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g | |
20117 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20118 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fb(75)150 | |
20119 | 2260 y Fe(GROUPS)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20120 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20121 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b | |
20122 | Fb(75)146 2495 y Fs(H)150 2612 y Fe(histchars)15 b Fc(:)h(:)d(:)g(:)g | |
bce12dd7 | 20123 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20124 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)30 |
20125 | b Fb(75)150 2699 y Fe(HISTCMD)22 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20126 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20127 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 | |
20128 | b Fb(76)150 2786 y Fe(HISTCONTROL)10 b Fc(:)16 b(:)d(:)g(:)g(:)h(:)f(:) | |
bce12dd7 | 20129 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
037a8b7f CR |
20130 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)25 b Fb(76)150 |
20131 | 2873 y Fe(HISTFILE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20132 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20133 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(76)150 2961 | |
20134 | y Fe(HISTFILESIZE)8 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
bce12dd7 | 20135 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20136 | g(:)g(:)h(:)f(:)g(:)22 b Fb(76)150 3048 y Fe(HISTIGNORE)13 |
20137 | b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20138 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20139 | (:)g(:)27 b Fb(76)150 3135 y Fe(history-preserve-point)14 | |
20140 | b Fc(:)k(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20141 | h(:)f(:)g(:)g(:)29 b Fb(109)150 3223 y Fe(history-size)c | |
20142 | Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20143 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)37 | |
20144 | b Fb(109)150 3310 y Fe(HISTSIZE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g | |
e05be32d | 20145 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
20146 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b |
20147 | Fb(77)150 3397 y Fe(HISTTIMEFORMAT)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f | |
220537f2 | 20148 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
20149 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(77)150 3485 y Fe(HOME)11 |
20150 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20151 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20152 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(70)150 3572 | |
20153 | y Fe(horizontal-scroll-mode)14 b Fc(:)k(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20154 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(109)150 | |
20155 | 3659 y Fe(HOSTFILE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20156 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20157 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(77)150 3747 | |
20158 | y Fe(HOSTNAME)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20159 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20160 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(77)150 3834 y | |
20161 | Fe(HOSTTYPE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20162 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20163 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(77)146 4069 y Fs(I)150 | |
20164 | 4186 y Fe(IFS)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
967625cd | 20165 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20166 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 |
20167 | b Fb(70)150 4273 y Fe(IGNOREEOF)15 b Fc(:)h(:)d(:)g(:)g(:)g(:)g(:)g(:)h | |
20168 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20169 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)30 b Fb(77)150 | |
20170 | 4360 y Fe(input-meta)11 b Fc(:)k(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
220537f2 | 20171 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
037a8b7f CR |
20172 | (:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(109)150 4447 y Fe(INPUTRC)d |
20173 | Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20174 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20175 | h(:)f(:)g(:)g(:)g(:)35 b Fb(77)150 4535 y Fe(isearch-terminators)26 | |
20176 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20177 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(110)146 4770 y | |
20178 | Fs(K)150 4886 y Fe(keymap)22 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20179 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20180 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)36 | |
20181 | b Fb(110)2021 294 y Fs(L)2025 417 y Fe(LANG)11 b Fc(:)j(:)f(:)g(:)g(:)g | |
20182 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20183 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20184 | (:)g(:)g(:)26 b Fb(77)2025 506 y Fe(LC_ALL)6 b Fc(:)14 | |
20185 | b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
220537f2 | 20186 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
037a8b7f CR |
20187 | g(:)g(:)g(:)g(:)g(:)21 b Fb(77)2025 596 y Fe(LC_COLLATE)13 |
20188 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20189 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20190 | (:)h(:)27 b Fb(77)2025 685 y Fe(LC_CTYPE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:) | |
20191 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20192 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
20193 | b Fb(77)2025 774 y Fe(LC_MESSAGES)21 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:) | |
20194 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20195 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)34 b Fb(7,)26 b(78)2025 | |
20196 | 864 y Fe(LC_NUMERIC)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
220537f2 | 20197 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
20198 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(78)2025 953 y Fe(LC_TIME)22 |
20199 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20200 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20201 | g(:)g(:)h(:)f(:)g(:)35 b Fb(78)2025 1043 y Fe(LINENO)6 | |
20202 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
8a0829e9 | 20203 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f | 20204 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(78)2025 1130 y Fe(LINES)9 |
d7935593 | 20205 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
d7935593 | 20206 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
20207 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(78)2021 1410 |
20208 | y Fs(M)2025 1533 y Fe(MACHTYPE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f | |
20209 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20210 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b | |
20211 | Fb(78)2025 1622 y Fe(MAIL)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20212 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20213 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 | |
20214 | b Fb(70)2025 1712 y Fe(MAILCHECK)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:) | |
c302751c | 20215 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
037a8b7f CR |
20216 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(78)2025 |
20217 | 1801 y Fe(MAILPATH)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20218 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20219 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(70)2025 1891 | |
20220 | y Fe(MAPFILE)22 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20221 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20222 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(78)2025 1980 | |
20223 | y Fe(mark-modified-lines)26 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20224 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
20225 | b Fb(110)2025 2069 y Fe(mark-symlinked-directories)27 | |
20226 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20227 | 36 b Fb(110)2025 2159 y Fe(match-hidden-files)7 b Fc(:)17 | |
20228 | b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20229 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(110)2025 2248 | |
20230 | y Fe(menu-complete-display-prefix)17 b Fc(:)h(:)13 b(:)h(:)f(:)g(:)g(:) | |
20231 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)31 b Fb(111)2025 2335 y Fe(meta-flag)13 | |
20232 | b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20233 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20234 | (:)f(:)28 b Fb(109)2021 2627 y Fs(O)2025 2750 y Fe(OLDPWD)6 | |
20235 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20236 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20237 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(78)2025 2839 y Fe(OPTARG)6 | |
20238 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20239 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20240 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(70)2025 2929 y Fe(OPTERR)6 | |
20241 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20242 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20243 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(78)2025 3018 y Fe(OPTIND)6 | |
20244 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20245 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20246 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(70)2025 3108 y Fe(OSTYPE)6 | |
20247 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20248 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20249 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(78)2025 3195 y Fe(output-meta)8 | |
20250 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20251 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20252 | 23 b Fb(111)2021 3486 y Fs(P)2025 3609 y Fe(page-completions)13 | |
20253 | b Fc(:)j(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20254 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)28 b Fb(111)2025 | |
20255 | 3699 y Fe(PATH)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20256 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20257 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 | |
20258 | b Fb(70)2025 3788 y Fe(PIPESTATUS)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g | |
20259 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20260 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(78)2025 | |
20261 | 3877 y Fe(POSIXLY_CORRECT)17 b Fc(:)g(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20262 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20263 | g(:)g(:)g(:)32 b Fb(78)2025 3967 y Fe(PPID)11 b Fc(:)j(:)f(:)g(:)g(:)g | |
20264 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20265 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20266 | (:)g(:)g(:)26 b Fb(78)2025 4056 y Fe(PROMPT_COMMAND)d | |
20267 | Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20268 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)34 | |
20269 | b Fb(78)2025 4146 y Fe(PROMPT_DIRTRIM)23 b Fc(:)13 b(:)g(:)g(:)g(:)g(:) | |
20270 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20271 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)34 b Fb(79)2025 4235 y | |
20272 | Fe(PS0)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
c302751c | 20273 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20274 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 b |
20275 | Fb(79)2025 4325 y Fe(PS1)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
8a0829e9 | 20276 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
037a8b7f CR |
20277 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 |
20278 | b Fb(70)2025 4414 y Fe(PS2)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
5cdaaf76 | 20279 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
20280 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 |
20281 | b Fb(70)2025 4503 y Fe(PS3)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20282 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20283 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 | |
20284 | b Fb(79)2025 4593 y Fe(PS4)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
abe2eb5b | 20285 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
20286 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 |
20287 | b Fb(79)2025 4680 y Fe(PWD)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20288 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20289 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 | |
20290 | b Fb(79)p eop end | |
20291 | %%Page: 167 173 | |
20292 | TeXDict begin 167 172 bop 150 -116 a Fu(App)s(endix)29 | |
20293 | b(D:)i(Indexes)2623 b(167)146 294 y Fs(R)150 411 y Fe(RANDOM)6 | |
20294 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20295 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20296 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fb(79)150 499 y Fe(READLINE_LINE)25 | |
20297 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20298 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 | |
20299 | b Fb(79)150 587 y Fe(READLINE_POINT)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f | |
20300 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20301 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(79)150 674 y Fe(REPLY)9 | |
20302 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20303 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20304 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(79)150 762 y | |
20305 | Fe(revert-all-at-newline)17 b Fc(:)h(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20306 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)32 | |
20307 | b Fb(111)146 1005 y Fs(S)150 1123 y Fe(SECONDS)22 b Fc(:)13 | |
20308 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20309 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20310 | g(:)g(:)g(:)35 b Fb(79)150 1210 y Fe(SHELL)9 b Fc(:)14 | |
20311 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20312 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20313 | g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(79)150 1298 y Fe(SHELLOPTS)15 | |
20314 | b Fc(:)h(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
abe2eb5b | 20315 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
037a8b7f CR |
20316 | (:)g(:)g(:)30 b Fb(79)150 1386 y Fe(SHLVL)9 b Fc(:)14 |
20317 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20318 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20319 | g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(79)150 1474 y Fe(show-all-if-ambiguous) | |
20320 | 17 b Fc(:)h(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20321 | (:)f(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(111)150 1561 y Fe | |
20322 | (show-all-if-unmodified)14 b Fc(:)k(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20323 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(111)150 | |
20324 | 1649 y Fe(show-mode-in-prompt)d Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20325 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 | |
20326 | b Fb(111)150 1736 y Fe(skip-completed-text)26 b Fc(:)13 | |
20327 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20328 | (:)g(:)g(:)g(:)g(:)g(:)37 b Fb(111)2021 294 y Fs(T)2025 | |
20329 | 416 y Fe(TEXTDOMAIN)15 b Fc(:)g(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20330 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20331 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)30 b Fb(7)2025 505 y | |
20332 | Fe(TEXTDOMAINDIR)7 b Fc(:)16 b(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
abe2eb5b | 20333 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
20334 | g(:)g(:)g(:)g(:)g(:)23 b Fb(7)2025 594 y Fe(TIMEFORMAT)13 |
20335 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20336 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20337 | (:)h(:)27 b Fb(80)2025 683 y Fe(TMOUT)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g | |
20338 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20339 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20340 | (:)23 b Fb(80)2025 770 y Fe(TMPDIR)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:) | |
20341 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20342 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 | |
20343 | b Fb(80)2021 1044 y Fs(U)2025 1164 y Fe(UID)14 b Fc(:)f(:)g(:)h(:)f(:)g | |
9f178efb | 20344 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
20345 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
20346 | (:)g(:)h(:)f(:)28 b Fb(80)2021 1438 y Fs(V)2025 1560 | |
20347 | y Fe(vi-cmd-mode-string)7 b Fc(:)17 b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20348 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 | |
20349 | b Fb(112)2025 1649 y Fe(vi-ins-mode-string)7 b Fc(:)17 | |
20350 | b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20351 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(112)2025 1736 | |
20352 | y Fe(visible-stats)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20353 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20354 | f(:)g(:)35 b Fb(112)150 2375 y Fs(D.4)68 b(F)-11 b(unction)44 | |
20355 | b(Index)146 2860 y(A)150 2979 y Fe(abort)27 b(\(C-g\))15 | |
20356 | b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20357 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)30 | |
20358 | b Fb(125)150 3068 y Fe(accept-line)e(\(Newline)g(or)e(Return\))12 | |
20359 | b Fc(:)i(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)27 | |
20360 | b Fb(119)150 3155 y Fe(alias-expand-line)i(\(\))9 b Fc(:)14 | |
20361 | b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20362 | (:)h(:)f(:)g(:)g(:)g(:)24 b Fb(127)146 3422 y Fs(B)150 | |
20363 | 3542 y Fe(backward-char)29 b(\(C-b\))12 b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:) | |
20364 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20365 | (:)26 b Fb(118)150 3630 y Fe(backward-delete-char)k(\(Rubout\))22 | |
20366 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)35 | |
20367 | b Fb(120)150 3718 y Fe(backward-kill-line)30 b(\(C-x)c(Rubout\))e | |
20368 | Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)37 b | |
20369 | Fb(121)150 3807 y Fe(backward-kill-word)30 b(\(M-DEL\))11 | |
20370 | b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20371 | 26 b Fb(122)150 3895 y Fe(backward-word)j(\(M-b\))12 | |
20372 | b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20373 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)26 b Fb(118)150 3983 | |
20374 | y Fe(beginning-of-history)k(\(M-<\))11 b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g | |
20375 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 b Fb(119)150 | |
20376 | 4071 y Fe(beginning-of-line)j(\(C-a\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:) | |
20377 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 | |
20378 | b Fb(118)150 4159 y Fe(bracketed-paste-begin)d(\(\))16 | |
20379 | b Fc(:)e(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20380 | g(:)g(:)31 b Fb(121)146 4426 y Fs(C)150 4545 y Fe(call-last-kbd-macro)f | |
20381 | (\(C-x)c(e\))15 b Fc(:)f(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20382 | g(:)g(:)g(:)30 b Fb(125)150 4634 y Fe(capitalize-word)f(\(M-c\))7 | |
20383 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20384 | (:)g(:)g(:)g(:)g(:)h(:)f(:)21 b Fb(121)150 4722 y Fe(character-search) | |
20385 | 29 b(\(C-]\))23 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20386 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 b Fb(125)150 4810 | |
20387 | y Fe(character-search-backward)31 b(\(M-C-]\))10 b Fc(:)15 | |
20388 | b(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)25 b Fb(126)150 4899 | |
20389 | y Fe(clear-screen)j(\(C-l\))14 b Fc(:)h(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20390 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 | |
20391 | b Fb(118)150 4987 y Fe(complete)e(\(TAB\))7 b Fc(:)15 | |
20392 | b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20393 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 | |
20394 | b Fb(123)150 5075 y Fe(complete-command)29 b(\(M-!\))23 | |
20395 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20396 | (:)f(:)g(:)g(:)g(:)36 b Fb(124)150 5163 y Fe(complete-filename)29 | |
20397 | b(\(M-/\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20398 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(124)150 5252 y Fe | |
20399 | (complete-hostname)c(\(M-@\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20400 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(124)150 | |
20401 | 5340 y Fe(complete-into-braces)d(\(M-{\))11 b Fc(:)j(:)f(:)h(:)f(:)g(:) | |
20402 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 b Fb(124)2025 | |
20403 | 2830 y Fe(complete-username)j(\(M-~\))20 b Fc(:)13 b(:)g(:)g(:)g(:)h(:) | |
20404 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)34 | |
20405 | b Fb(124)2025 2922 y Fe(complete-variable)29 b(\(M-$\))20 | |
20406 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20407 | (:)g(:)g(:)g(:)34 b Fb(124)2025 3015 y Fe(copy-backward-word)29 | |
20408 | b(\(\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20409 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(122)2025 | |
20410 | 3107 y Fe(copy-forward-word)29 b(\(\))9 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f | |
20411 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20412 | 24 b Fb(122)2025 3194 y Fe(copy-region-as-kill)30 b(\(\))21 | |
967625cd | 20413 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
037a8b7f CR |
20414 | (:)h(:)f(:)g(:)g(:)36 b Fb(122)2021 3549 y Fs(D)2025 |
20415 | 3681 y Fe(dabbrev-expand)29 b(\(\))17 b Fc(:)c(:)g(:)g(:)g(:)g(:)h(:)f | |
9f178efb | 20416 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
20417 | g(:)g(:)32 b Fb(124)2025 3774 y Fe(delete-char)c(\(C-d\))17 |
20418 | b Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20419 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(120)2025 | |
20420 | 3866 y Fe(delete-char-or-list)e(\(\))21 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g | |
20421 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 | |
20422 | b Fb(124)2025 3959 y Fe(delete-horizontal-space)31 b(\(\))11 | |
20423 | b Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20424 | 26 b Fb(122)2025 4051 y Fe(digit-argument)j(\()p Fd(M-0)p | |
20425 | Fe(,)d Fd(M-1)p Fe(,)h(...)f Fd(M--)p Fe(\))11 b Fc(:)j(:)f(:)g(:)h(:)f | |
20426 | (:)g(:)g(:)g(:)26 b Fb(123)2025 4143 y Fe(display-shell-version)k | |
20427 | (\(C-x)d(C-v\))c Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)37 | |
20428 | b Fb(127)2025 4227 y Fe(do-uppercase-version)30 b(\(M-a,)2102 | |
20429 | 4314 y(M-b,)c(M-)p Fd(x)p Fe(,)h(...\))10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g | |
20430 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20431 | h(:)f(:)g(:)g(:)g(:)25 b Fb(125)2025 4407 y Fe(downcase-word)j(\(M-l\)) | |
20432 | 12 b Fc(:)i(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20433 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)27 b Fb(121)2025 4499 | |
20434 | y Fe(dump-functions)i(\(\))17 b Fc(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20435 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20436 | 32 b Fb(126)2025 4592 y Fe(dump-macros)c(\(\))7 b Fc(:)14 | |
20437 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20438 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)22 | |
20439 | b Fb(126)2025 4684 y Fe(dump-variables)29 b(\(\))17 b | |
20440 | Fc(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20441 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(126)2025 | |
20442 | 4771 y Fe(dynamic-complete-history)f(\(M-TAB\))13 b Fc(:)h(:)f(:)h(:)f | |
20443 | (:)g(:)g(:)g(:)g(:)g(:)28 b Fb(124)p eop end | |
20444 | %%Page: 168 174 | |
20445 | TeXDict begin 168 173 bop 150 -116 a Fu(App)s(endix)29 | |
20446 | b(D:)i(Indexes)2623 b(168)146 294 y Fs(E)150 412 y Fe | |
20447 | (edit-and-execute-command)31 b(\(C-xC-e\))10 b Fc(:)15 | |
20448 | b(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)25 b Fb(127)150 500 y | |
20449 | Fe(end-kbd-macro)k(\(C-x)d(\)\))13 b Fc(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g | |
20450 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)28 | |
20451 | b Fb(125)150 588 y Fd(end-of-file)g Fe(\(usually)g(C-d\))21 | |
20452 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20453 | (:)g(:)35 b Fb(120)150 676 y Fe(end-of-history)29 b(\(M->\))9 | |
20454 | b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20455 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(119)150 764 y | |
20456 | Fe(end-of-line)k(\(C-e\))17 b Fc(:)d(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20457 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 | |
20458 | b Fb(118)150 851 y Fe(exchange-point-and-mark)f(\(C-x)26 | |
20459 | b(C-x\))17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)32 | |
20460 | b Fb(125)146 1113 y Fs(F)150 1231 y Fe(forward-backward-delete-char)g | |
20461 | (\(\))15 b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 | |
20462 | b Fb(120)150 1319 y Fe(forward-char)e(\(C-f\))14 b Fc(:)h(:)e(:)g(:)g | |
20463 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20464 | h(:)f(:)g(:)g(:)29 b Fb(118)150 1407 y Fe(forward-search-history)i | |
20465 | (\(C-s\))24 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20466 | (:)38 b Fb(119)150 1495 y Fe(forward-word)28 b(\(M-f\))14 | |
20467 | b Fc(:)h(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20468 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(118)146 1746 | |
20469 | y Fs(G)150 1864 y Fe(glob-complete-word)h(\(M-g\))16 | |
20470 | b Fc(:)e(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20471 | g(:)g(:)31 b Fb(126)150 1952 y Fe(glob-expand-word)e(\(C-x)e(*\))c | |
20472 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20473 | (:)g(:)g(:)38 b Fb(126)150 2039 y Fe(glob-list-expansions)30 | |
20474 | b(\(C-x)d(g\))13 b Fc(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20475 | (:)g(:)h(:)27 b Fb(127)146 2301 y Fs(H)150 2419 y Fe | |
20476 | (history-and-alias-expand-line)32 b(\(\))13 b Fc(:)h(:)f(:)g(:)g(:)g(:) | |
20477 | g(:)g(:)g(:)h(:)27 b Fb(127)150 2507 y Fe(history-expand-line)j | |
20478 | (\(M-^\))13 b Fc(:)i(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20479 | g(:)h(:)f(:)g(:)28 b Fb(127)150 2595 y Fe(history-search-backward)j | |
20480 | (\(\))11 b Fc(:)i(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20481 | (:)g(:)g(:)26 b Fb(119)150 2683 y Fe(history-search-forward)31 | |
20482 | b(\(\))13 b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20483 | (:)h(:)f(:)g(:)28 b Fb(119)150 2771 y Fe(history-substr-search-backwar) | |
20484 | q(d)j(\(\))10 b Fc(:)k(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)25 | |
20485 | b Fb(120)150 2859 y Fe(history-substr-search-forward)32 | |
20486 | b(\(\))13 b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)27 | |
20487 | b Fb(119)146 3120 y Fs(I)150 3239 y Fe(insert-comment)i(\(M-#\))9 | |
20488 | b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20489 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(126)150 3327 y | |
20490 | Fe(insert-completions)30 b(\(M-*\))16 b Fc(:)e(:)f(:)g(:)g(:)h(:)f(:)g | |
20491 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)31 b Fb(123)150 | |
20492 | 3414 y Fe(insert-last-argument)f(\(M-.)d(or)f(M-_\))7 | |
20493 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)21 b Fb(127)146 | |
20494 | 3675 y Fs(K)150 3794 y Fe(kill-line)28 b(\(C-k\))23 b | |
20495 | Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20496 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 | |
20497 | b Fb(121)150 3882 y Fe(kill-region)28 b(\(\))7 b Fc(:)14 | |
20498 | b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20499 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 | |
20500 | b Fb(122)150 3970 y Fe(kill-whole-line)29 b(\(\))14 b | |
20501 | Fc(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20502 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(122)150 4057 | |
20503 | y Fe(kill-word)f(\(M-d\))23 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20504 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20505 | g(:)g(:)37 b Fb(122)146 4308 y Fs(M)150 4427 y Fe(magic-space)28 | |
20506 | b(\(\))7 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20507 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 | |
20508 | b Fb(127)150 4515 y Fe(menu-complete)29 b(\(\))19 b Fc(:)14 | |
20509 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20510 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(123)150 | |
20511 | 4602 y Fe(menu-complete-backward)d(\(\))13 b Fc(:)h(:)f(:)g(:)g(:)g(:)g | |
20512 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)28 b Fb(123)2021 | |
20513 | 294 y Fs(N)2025 415 y Fe(next-history)g(\(C-n\))14 b | |
20514 | Fc(:)h(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20515 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 b Fb(119)2025 495 | |
20516 | y Fe(non-incremental-forward-)2102 582 y(search-history)f(\(M-n\))23 | |
20517 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20518 | (:)f(:)g(:)g(:)g(:)37 b Fb(119)2025 669 y Fe(non-incremental-reverse-) | |
20519 | 2102 757 y(search-history)28 b(\(M-p\))23 b Fc(:)14 b(:)f(:)g(:)g(:)g | |
20520 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
20521 | b Fb(119)2021 1045 y Fs(O)2025 1167 y Fe(operate-and-get-next)30 | |
20522 | b(\(C-o\))11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20523 | (:)g(:)g(:)g(:)26 b Fb(127)2025 1254 y Fe(overwrite-mode)j(\(\))17 | |
20524 | b Fc(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20525 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(121)2021 | |
20526 | 1523 y Fs(P)2025 1645 y Fe(possible-command-completions)g(\(C-x)26 | |
20527 | b(!\))9 b Fc(:)14 b(:)f(:)g(:)h(:)f(:)24 b Fb(124)2025 | |
20528 | 1733 y Fe(possible-completions)30 b(\(M-?\))11 b Fc(:)j(:)f(:)g(:)h(:)f | |
20529 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)26 b Fb(123)2025 | |
20530 | 1822 y Fe(possible-filename-completions)32 b(\(C-x)26 | |
20531 | b(/\))7 b Fc(:)14 b(:)f(:)g(:)g(:)22 b Fb(124)2025 1911 | |
20532 | y Fe(possible-hostname-completions)32 b(\(C-x)26 b(@\))7 | |
20533 | b Fc(:)14 b(:)f(:)g(:)g(:)22 b Fb(124)2025 2000 y Fe | |
20534 | (possible-username-completions)32 b(\(C-x)26 b(~\))7 | |
20535 | b Fc(:)14 b(:)f(:)g(:)g(:)22 b Fb(124)2025 2089 y Fe | |
20536 | (possible-variable-completions)32 b(\(C-x)26 b($\))7 | |
20537 | b Fc(:)14 b(:)f(:)g(:)g(:)22 b Fb(124)2025 2178 y Fe(prefix-meta)28 | |
20538 | b(\(ESC\))17 b Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20539 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 | |
20540 | b Fb(125)2025 2267 y Fe(previous-history)d(\(C-p\))22 | |
20541 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20542 | (:)h(:)f(:)g(:)g(:)36 b Fb(119)2025 2354 y Fe(print-last-kbd-macro)30 | |
20543 | b(\(\))19 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20544 | (:)g(:)g(:)g(:)g(:)g(:)g(:)34 b Fb(125)2021 2634 y Fs(Q)2025 | |
20545 | 2753 y Fe(quoted-insert)28 b(\(C-q)f(or)f(C-v\))8 b Fc(:)13 | |
20546 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)22 | |
20547 | b Fb(120)2021 3033 y Fs(R)2025 3155 y Fe(re-read-init-file)29 | |
20548 | b(\(C-x)e(C-r\))15 b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20549 | (:)h(:)f(:)g(:)30 b Fb(125)2025 3244 y Fe(redraw-current-line)g(\(\))21 | |
20550 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20551 | (:)h(:)f(:)g(:)g(:)36 b Fb(118)2025 3332 y Fe(reverse-search-history)30 | |
20552 | b(\(C-r\))24 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20553 | g(:)38 b Fb(119)2025 3420 y Fe(revert-line)28 b(\(M-r\))17 | |
20554 | b Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20555 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(125)2021 | |
20556 | 3689 y Fs(S)2025 3810 y Fe(self-insert)c(\(a,)e(b,)g(A,)g(1,)g(!,)g | |
20557 | (...)q(\))13 b Fc(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)28 | |
20558 | b Fb(121)2025 3899 y Fe(set-mark)f(\(C-@\))7 b Fc(:)15 | |
20559 | b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20560 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)22 | |
20561 | b Fb(125)2025 3988 y Fe(shell-backward-kill-word)31 b(\(\))8 | |
20562 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20563 | 23 b Fb(122)2025 4077 y Fe(shell-backward-word)30 b(\(\))21 | |
20564 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20565 | (:)h(:)f(:)g(:)g(:)36 b Fb(118)2025 4166 y Fe(shell-expand-line)29 | |
20566 | b(\(M-C-e\))13 b Fc(:)i(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20567 | (:)g(:)g(:)g(:)h(:)28 b Fb(127)2025 4255 y Fe(shell-forward-word)h | |
20568 | (\(\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20569 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(118)2025 4344 | |
20570 | y Fe(shell-kill-word)29 b(\(\))14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20571 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20572 | 29 b Fb(122)2025 4433 y Fe(skip-csi-sequence)g(\(\))9 | |
20573 | b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20574 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)24 b Fb(126)2025 4520 | |
20575 | y Fe(start-kbd-macro)29 b(\(C-x)d(\(\))8 b Fc(:)14 b(:)f(:)g(:)h(:)f(:) | |
20576 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)23 | |
20577 | b Fb(125)p eop end | |
900a813b CR |
20578 | %%Page: 169 175 |
20579 | TeXDict begin 169 174 bop 150 -116 a Fu(App)s(endix)29 | |
037a8b7f CR |
20580 | b(D:)i(Indexes)2623 b(169)146 294 y Fs(T)150 415 y Fe(tilde-expand)28 |
20581 | b(\(M-&\))14 b Fc(:)h(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20582 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 | |
20583 | b Fb(125)150 504 y Fe(transpose-chars)g(\(C-t\))7 b Fc(:)14 | |
20584 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20585 | (:)g(:)g(:)h(:)f(:)21 b Fb(121)150 591 y Fe(transpose-words)29 | |
20586 | b(\(M-t\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20587 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)21 b Fb(121)146 | |
20588 | 874 y Fs(U)150 995 y Fe(undo)27 b(\(C-_)f(or)g(C-x)g(C-u\))10 | |
20589 | b Fc(:)k(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20590 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)25 b Fb(125)150 1084 y Fe | |
20591 | (universal-argument)30 b(\(\))7 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20592 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)21 | |
20593 | b Fb(123)150 1173 y Fe(unix-filename-rubout)30 b(\(\))19 | |
20594 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20595 | (:)g(:)h(:)f(:)33 b Fb(122)150 1262 y Fe(unix-line-discard)c(\(C-u\))20 | |
20596 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20597 | (:)g(:)h(:)f(:)33 b Fb(122)2025 264 y Fe(unix-word-rubout)c(\(C-w\))22 | |
20598 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20599 | (:)h(:)f(:)g(:)g(:)36 b Fb(122)2025 351 y Fe(upcase-word)28 | |
20600 | b(\(M-u\))17 b Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20601 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 | |
20602 | b Fb(121)2021 828 y Fs(Y)2025 979 y Fe(yank)26 b(\(C-y\))18 | |
20603 | b Fc(:)c(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20604 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20605 | (:)33 b Fb(122)2025 1077 y Fe(yank-last-arg)28 b(\(M-.)f(or)f(M-_\))8 | |
20606 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20607 | (:)h(:)22 b Fb(120)2025 1175 y Fe(yank-nth-arg)28 b(\(M-C-y\))9 | |
20608 | b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20609 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)24 b Fb(120)2025 1262 | |
20610 | y Fe(yank-pop)j(\(M-y\))7 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20611 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20612 | g(:)g(:)h(:)f(:)22 b Fb(122)150 2011 y Fs(D.5)68 b(Concept)45 | |
20613 | b(Index)146 2605 y(A)150 2724 y Fb(alias)27 b(expansion)7 | |
20614 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20615 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)21 | |
20616 | b Fb(89)150 2813 y(arithmetic)26 b(ev)l(aluation)d Fc(:)13 | |
967625cd | 20617 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
037a8b7f CR |
20618 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(88)150 2901 y(arithmetic)26 |
20619 | b(expansion)11 b Fc(:)j(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20620 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)26 | |
20621 | b Fb(29)150 2989 y(arithmetic,)h(shell)6 b Fc(:)14 b(:)f(:)g(:)g(:)g(:) | |
20622 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20623 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)20 b Fb(88)150 3076 | |
20624 | y(arra)n(ys)h Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20625 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20626 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)35 b Fb(90)146 | |
20627 | 3343 y Fs(B)150 3463 y Fb(bac)n(kground)15 b Fc(:)d(:)i(:)f(:)g(:)g(:)g | |
20628 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20629 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 b | |
20630 | Fb(99)150 3551 y(Bash)d(con\014guration)11 b Fc(:)j(:)f(:)g(:)g(:)h(:)f | |
20631 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20632 | g(:)g(:)g(:)g(:)26 b Fb(141)150 3639 y(Bash)g(installation)9 | |
20633 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20634 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)23 | |
20635 | b Fb(141)150 3728 y(Bourne)j(shell)20 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g | |
20636 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20637 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)34 b | |
20638 | Fb(5)150 3816 y(brace)26 b(expansion)9 b Fc(:)k(:)h(:)f(:)g(:)g(:)g(:)g | |
20639 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20640 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fb(21)150 3903 y(builtin)15 | |
20641 | b Fc(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
967625cd | 20642 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
20643 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)30 b Fb(3)146 4160 y Fs(C)150 |
20644 | 4280 y Fb(command)c(editing)19 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
967625cd | 20645 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
037a8b7f CR |
20646 | g(:)g(:)g(:)34 b Fb(104)150 4368 y(command)26 b(execution)12 |
20647 | b Fc(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20648 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)26 b Fb(37)150 | |
20649 | 4457 y(command)g(expansion)c Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20650 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20651 | 36 b Fb(36)150 4545 y(command)26 b(history)18 b Fc(:)13 | |
20652 | b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20653 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(136)150 | |
20654 | 4633 y(command)26 b(searc)n(h)16 b Fc(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20655 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20656 | g(:)h(:)f(:)g(:)g(:)30 b Fb(37)150 4722 y(command)c(substitution)21 | |
20657 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20658 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(29)150 4810 | |
20659 | y(command)26 b(timing)13 b Fc(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20660 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20661 | g(:)g(:)g(:)g(:)28 b Fb(8)150 4898 y(commands,)e(comp)r(ound)7 | |
20662 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20663 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 b Fb(9)150 | |
20664 | 4987 y(commands,)k(conditional)10 b Fc(:)15 b(:)e(:)g(:)h(:)f(:)g(:)g | |
20665 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20666 | 25 b Fb(10)150 5075 y(commands,)h(grouping)15 b Fc(:)f(:)f(:)g(:)g(:)g | |
20667 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20668 | f(:)g(:)g(:)g(:)29 b Fb(14)150 5163 y(commands,)d(lists)12 | |
20669 | b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20670 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)27 | |
20671 | b Fb(9)150 5252 y(commands,)f(lo)r(oping)e Fc(:)13 b(:)g(:)g(:)g(:)h(:) | |
20672 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20673 | (:)g(:)g(:)g(:)g(:)37 b Fb(10)150 5340 y(commands,)26 | |
20674 | b(pip)r(elines)18 b Fc(:)c(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20675 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)33 | |
20676 | b Fb(8)2025 2575 y(commands,)26 b(shell)c Fc(:)13 b(:)g(:)g(:)g(:)h(:)f | |
967625cd | 20677 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
20678 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 b Fb(8)2025 2663 y(commands,)26 |
20679 | b(simple)e Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20680 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)38 | |
20681 | b Fb(8)2025 2752 y(commen)n(ts,)26 b(shell)13 b Fc(:)h(:)g(:)f(:)g(:)g | |
20682 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20683 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)29 b Fb(7)2025 | |
20684 | 2841 y(completion)d(builtins)c Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20685 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20686 | (:)36 b Fb(130)2025 2930 y(con\014guration)22 b Fc(:)13 | |
20687 | b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20688 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)36 | |
20689 | b Fb(141)2025 3019 y(con)n(trol)26 b(op)r(erator)8 b | |
20690 | Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20691 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)23 | |
20692 | b Fb(3)2025 3106 y(copro)r(cess)18 b Fc(:)c(:)f(:)g(:)h(:)f(:)g(:)g(:)g | |
abe2eb5b | 20693 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20694 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)32 b |
20695 | Fb(15)2021 3384 y Fs(D)2025 3504 y Fb(directory)26 b(stac)n(k)11 | |
20696 | b Fc(:)i(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20697 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)26 | |
20698 | b Fb(91)2021 3782 y Fs(E)2025 3903 y Fb(editing)g(command)g(lines)17 | |
20699 | b Fc(:)c(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20700 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(104)2025 3992 y(en)n(vironmen)n(t) | |
20701 | 18 b Fc(:)12 b(:)h(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20702 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20703 | g(:)g(:)33 b Fb(38)2025 4081 y(ev)l(aluation,)26 b(arithmetic)12 | |
20704 | b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20705 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)26 b Fb(88)2025 4170 | |
20706 | y(ev)n(en)n(t)e(designators)e Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20707 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20708 | g(:)g(:)35 b Fb(139)2025 4259 y(execution)25 b(en)n(vironmen)n(t)17 | |
20709 | b Fc(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20710 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)31 b Fb(37)2025 4347 | |
20711 | y(exit)25 b(status)7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20712 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20713 | (:)g(:)h(:)f(:)g(:)g(:)g(:)22 b Fb(3,)k(39)2025 4436 | |
20714 | y(expansion)9 b Fc(:)k(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20715 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20716 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(21)2025 4525 y(expansion,)i | |
20717 | (arithmetic)18 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20718 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 | |
20719 | b Fb(29)2025 4614 y(expansion,)26 b(brace)16 b Fc(:)d(:)g(:)g(:)g(:)h | |
20720 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20721 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)30 b Fb(21)2025 4703 | |
20722 | y(expansion,)c(\014lename)18 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20723 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20724 | (:)h(:)32 b Fb(30)2025 4792 y(expansion,)26 b(parameter)20 | |
20725 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20726 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)34 b Fb(23)2025 | |
20727 | 4881 y(expansion,)26 b(pathname)7 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f | |
c302751c | 20728 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f CR |
20729 | g(:)g(:)22 b Fb(30)2025 4970 y(expansion,)k(tilde)14 |
20730 | b Fc(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20731 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)28 | |
20732 | b Fb(22)2025 5059 y(expressions,)f(arithmetic)13 b Fc(:)g(:)h(:)f(:)g | |
20733 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20734 | g(:)g(:)g(:)28 b Fb(88)2025 5146 y(expressions,)f(conditional)17 | |
20735 | b Fc(:)d(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20736 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)32 b Fb(86)p eop end | |
20737 | %%Page: 170 176 | |
20738 | TeXDict begin 170 175 bop 150 -116 a Fu(App)s(endix)29 | |
20739 | b(D:)i(Indexes)2623 b(170)146 294 y Fs(F)150 415 y Fb(\014eld)21 | |
20740 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20741 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20742 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)36 b Fb(3)150 | |
20743 | 504 y(\014lename)22 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20744 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20745 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)36 b Fb(3)150 | |
20746 | 593 y(\014lename)26 b(expansion)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
abe2eb5b | 20747 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
20748 | g(:)g(:)g(:)26 b Fb(30)150 682 y(foreground)12 b Fc(:)i(:)f(:)g(:)g(:)g |
20749 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20750 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)26 | |
20751 | b Fb(99)150 769 y(functions,)g(shell)9 b Fc(:)14 b(:)g(:)f(:)g(:)g(:)g | |
20752 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20753 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)23 b Fb(17)146 1048 | |
20754 | y Fs(H)150 1170 y Fb(history)j(builtins)20 b Fc(:)13 | |
20755 | b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20756 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)34 | |
20757 | b Fb(136)150 1259 y(history)26 b(ev)n(en)n(ts)8 b Fc(:)k(:)h(:)g(:)h(:) | |
20758 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20759 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)23 b Fb(139)150 | |
20760 | 1347 y(history)j(expansion)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
8a0829e9 | 20761 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
20762 | f(:)g(:)29 b Fb(138)150 1436 y(history)d(list)9 b Fc(:)14 |
20763 | b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20764 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20765 | 24 b Fb(136)150 1524 y(History)-6 b(,)26 b(ho)n(w)g(to)f(use)19 | |
20766 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20767 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(135)146 | |
20768 | 1803 y Fs(I)150 1924 y Fb(iden)n(ti\014er)12 b Fc(:)g(:)i(:)f(:)g(:)g | |
20769 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20770 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)27 | |
20771 | b Fb(3)150 2013 y(initialization)h(\014le,)e(readline)17 | |
20772 | b Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20773 | g(:)g(:)g(:)g(:)32 b Fb(106)150 2102 y(installation)21 | |
20774 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20775 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20776 | g(:)34 b Fb(141)150 2191 y(in)n(teraction,)27 b(readline)7 | |
20777 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20778 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)22 b Fb(103)150 | |
20779 | 2280 y(in)n(teractiv)n(e)k(shell)20 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g | |
20780 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20781 | g(:)g(:)g(:)35 b Fb(83,)26 b(84)150 2367 y(in)n(ternationalization)c | |
20782 | Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20783 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)35 | |
20784 | b Fb(7)146 2637 y Fs(J)150 2758 y Fb(job)23 b Fc(:)13 | |
20785 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20786 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20787 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)37 b Fb(3)150 2845 | |
20788 | y(job)26 b(con)n(trol)20 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20789 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20790 | (:)h(:)f(:)g(:)g(:)g(:)g(:)34 b Fb(3,)26 b(99)146 3124 | |
20791 | y Fs(K)150 3246 y Fb(kill)g(ring)7 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g | |
8a0829e9 | 20792 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
20793 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 |
20794 | b Fb(105)150 3333 y(killing)27 b(text)6 b Fc(:)12 b(:)i(:)f(:)g(:)g(:)g | |
20795 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20796 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)21 b | |
20797 | Fb(105)146 3612 y Fs(L)150 3733 y Fb(lo)r(calization)i | |
20798 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
d7935593 | 20799 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20800 | h(:)f(:)g(:)35 b Fb(7)150 3821 y(login)27 b(shell)6 b |
20801 | Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20802 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20803 | g(:)g(:)g(:)h(:)20 b Fb(83)146 4100 y Fs(M)150 4221 y | |
20804 | Fb(matc)n(hing,)26 b(pattern)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20805 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20806 | g(:)g(:)g(:)g(:)24 b Fb(31)150 4308 y(metac)n(haracter)7 | |
20807 | b Fc(:)14 b(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20808 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20809 | g(:)22 b Fb(3)2021 294 y Fs(N)2025 422 y Fb(name)d Fc(:)13 | |
20810 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20811 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20812 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)34 b Fb(3)2025 514 y(nativ)n(e)25 | |
20813 | b(languages)c Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
20814 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20815 | g(:)34 b Fb(7)2025 601 y(notation,)26 b(readline)13 b | |
20816 | Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20817 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)28 b Fb(104)2021 | |
20818 | 930 y Fs(O)2025 1055 y Fb(op)r(erator,)f(shell)c Fc(:)13 | |
20819 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20820 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)37 | |
20821 | b Fb(3)2021 1384 y Fs(P)2025 1512 y Fb(parameter)26 b(expansion)13 | |
20822 | b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20823 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 b Fb(23)2025 | |
20824 | 1604 y(parameters)c Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20825 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20826 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(18)2025 1695 y(parameters,)27 | |
20827 | b(p)r(ositional)7 b Fc(:)14 b(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20828 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21 | |
20829 | b Fb(19)2025 1786 y(parameters,)27 b(sp)r(ecial)7 b Fc(:)14 | |
20830 | b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20831 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21 b Fb(20)2025 | |
20832 | 1878 y(pathname)k(expansion)18 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
ad4aef08 | 20833 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20834 | h(:)32 b Fb(30)2025 1969 y(pattern)25 b(matc)n(hing)20 |
20835 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20836 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)35 | |
20837 | b Fb(31)2025 2060 y(pip)r(eline)12 b Fc(:)h(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20838 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20839 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)27 | |
20840 | b Fb(8)2025 2151 y(POSIX)22 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20841 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20842 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)38 | |
20843 | b Fb(3)2025 2243 y(POSIX)24 b(Mo)r(de)17 b Fc(:)d(:)f(:)g(:)g(:)g(:)g | |
8a0829e9 | 20844 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f CR |
20845 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)31 b Fb(95)2025 |
20846 | 2334 y(pro)r(cess)26 b(group)15 b Fc(:)f(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
74d0116b | 20847 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
037a8b7f CR |
20848 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 b Fb(3)2025 2425 |
20849 | y(pro)r(cess)26 b(group)g(ID)11 b Fc(:)h(:)h(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
20850 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20851 | (:)f(:)g(:)g(:)g(:)g(:)26 b Fb(3)2025 2517 y(pro)r(cess)g(substitution) | |
20852 | 11 b Fc(:)i(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20853 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)25 b Fb(29)2025 | |
20854 | 2608 y(programmable)i(completion)8 b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g | |
20855 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)23 | |
20856 | b Fb(128)2025 2695 y(prompting)17 b Fc(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20857 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20858 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(93)2021 | |
20859 | 3024 y Fs(Q)2025 3153 y Fb(quoting)16 b Fc(:)d(:)g(:)g(:)g(:)g(:)g(:)h | |
20860 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20861 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)31 | |
20862 | b Fb(6)2025 3240 y(quoting,)26 b(ANSI)17 b Fc(:)c(:)h(:)f(:)g(:)g(:)g | |
74d0116b | 20863 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20864 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)34 b Fb(6)2021 |
20865 | 3569 y Fs(R)2025 3698 y Fb(Readline,)26 b(ho)n(w)g(to)g(use)11 | |
20866 | b Fc(:)i(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20867 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)26 b Fb(102)2025 | |
20868 | 3789 y(redirection)13 b Fc(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
d7935593 | 20869 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
037a8b7f CR |
20870 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fb(32)2025 3880 |
20871 | y(reserv)n(ed)e(w)n(ord)13 b Fc(:)h(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20872 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20873 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)29 b Fb(3)2025 3972 y(restricted)d(shell)14 | |
20874 | b Fc(:)g(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20875 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)29 | |
20876 | b Fb(94)2025 4059 y(return)c(status)10 b Fc(:)j(:)g(:)h(:)f(:)g(:)g(:)g | |
20877 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20878 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)25 b Fb(4)p | |
20879 | eop end | |
20880 | %%Page: 171 177 | |
20881 | TeXDict begin 171 176 bop 150 -116 a Fu(App)s(endix)29 | |
20882 | b(D:)i(Indexes)2623 b(171)146 294 y Fs(S)150 412 y Fb(shell)26 | |
20883 | b(arithmetic)17 b Fc(:)d(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20884 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20885 | (:)g(:)31 b Fb(88)150 499 y(shell)26 b(function)18 b | |
20886 | Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
20887 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)32 | |
20888 | b Fb(17)150 587 y(shell)26 b(script)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)h(:)f | |
20889 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
20890 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)24 b | |
20891 | Fb(40)150 675 y(shell)i(v)l(ariable)7 b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g | |
20892 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20893 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)21 b Fb(18)150 | |
20894 | 763 y(shell,)27 b(in)n(teractiv)n(e)20 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h | |
20895 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20896 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(84)150 851 y(signal)13 | |
20897 | b Fc(:)h(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20898 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20899 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)28 b Fb(4)150 938 | |
20900 | y(signal)f(handling)6 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
20901 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
20902 | g(:)g(:)g(:)g(:)g(:)21 b Fb(39)150 1026 y(sp)r(ecial)27 | |
20903 | b(builtin)16 b Fc(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
20904 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
20905 | 30 b Fb(4,)c(69)150 1114 y(startup)f(\014les)10 b Fc(:)k(:)f(:)g(:)g(:) | |
20906 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
20907 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)24 | |
20908 | b Fb(83)150 1201 y(susp)r(ending)i(jobs)12 b Fc(:)i(:)f(:)g(:)g(:)g(:)g | |
20909 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20910 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)26 b Fb(99)146 1456 y | |
20911 | Fs(T)150 1574 y Fb(tilde)g(expansion)7 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g | |
8a0829e9 | 20912 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
20913 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(22)150 1662 |
20914 | y(tok)n(en)17 b Fc(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
20915 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
20916 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)32 b | |
20917 | Fb(4)150 1749 y(translation,)27 b(nativ)n(e)f(languages)20 | |
20918 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20919 | (:)g(:)g(:)g(:)34 b Fb(7)2021 294 y Fs(V)2025 437 y Fb(v)l(ariable,)26 | |
20920 | b(shell)14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20921 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
20922 | g(:)g(:)28 b Fb(18)2025 525 y(v)l(ariables,)f(readline)7 | |
20923 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
20924 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 | |
20925 | b Fb(107)2021 954 y Fs(W)2025 1098 y Fb(w)n(ord)10 b | |
20926 | Fc(:)j(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
20927 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
20928 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)25 b Fb(4)2025 1185 | |
20929 | y(w)n(ord)h(splitting)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20930 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20931 | g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(30)2021 1614 y Fs(Y)2025 | |
20932 | 1749 y Fb(y)n(anking)h(text)13 b Fc(:)f(:)h(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
20933 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
20934 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)28 b Fb(105)p eop end | |
5e13499c | 20935 | %%Trailer |
37c41ab1 | 20936 | |
5e13499c CR |
20937 | userdict /end-hook known{end-hook}if |
20938 | %%EOF |