]>
Commit | Line | Data |
---|---|---|
5e13499c | 1 | %!PS-Adobe-2.0 |
9f178efb | 2 | %%Creator: dvips(k) 5.991 Copyright 2011 Radical Eye Software |
5e13499c | 3 | %%Title: bashref.dvi |
aaf6036e | 4 | %%CreationDate: Mon Jul 16 16:12:34 2012 |
9f178efb | 5 | %%Pages: 176 |
5e13499c CR |
6 | %%PageOrder: Ascend |
7 | %%BoundingBox: 0 0 612 792 | |
c302751c CR |
8 | %%DocumentFonts: CMBX12 CMR10 CMTT10 CMSL10 CMSY10 CMMI12 CMMI10 CMCSC10 |
9 | %%+ CMTI10 CMSLTT10 CMTT12 CMTT9 CMMI9 CMR9 | |
d3ad40de | 10 | %%DocumentPaperSizes: Letter |
5e13499c CR |
11 | %%EndComments |
12 | %DVIPSWebPage: (www.radicaleye.com) | |
13 | %DVIPSCommandLine: dvips -D 600 -t letter -o bashref.ps bashref.dvi | |
d3ad40de | 14 | %DVIPSParameters: dpi=600 |
aaf6036e | 15 | %DVIPSSource: TeX output 2012.07.16:1612 |
d3ad40de | 16 | %%BeginProcSet: tex.pro 0 0 |
5e13499c CR |
17 | %! |
18 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
19 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
20 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
21 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
22 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
23 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
24 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
25 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
26 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
27 | N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin | |
28 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array | |
29 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 | |
30 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N | |
31 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
32 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
33 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
34 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
d3ad40de CR |
35 | 1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S |
36 | /BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy | |
37 | setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask | |
38 | restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
5e13499c CR |
39 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put |
40 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
41 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
42 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
43 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
44 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
45 | 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 | |
46 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N | |
45c0f7f8 CR |
47 | /dir 0 def/dyy{/dir 0 def}B/dyt{/dir 1 def}B/dty{/dir 2 def}B/dtt{/dir 3 |
48 | def}B/p{dir 2 eq{-90 rotate show 90 rotate}{dir 3 eq{-90 rotate show 90 | |
49 | rotate}{show}ifelse}ifelse}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 | |
50 | N/Ry 0 N/V{}B/RV/v{/Ry X/Rx X V}B statusdict begin/product where{pop | |
51 | false[(Display)(NeXT)(LaserWriter 16/600)]{A length product length le{A | |
52 | length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse} | |
53 | forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{ | |
54 | BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat | |
55 | {BDot}imagemask grestore}}ifelse B/QV{gsave newpath transform round exch | |
56 | round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 | |
57 | rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B | |
58 | /M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M} | |
59 | B/g{0 M}B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p | |
60 | -3 w}B/n{p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{ | |
61 | 0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
5e13499c CR |
62 | |
63 | %%EndProcSet | |
d3ad40de | 64 | %%BeginProcSet: texps.pro 0 0 |
37c41ab1 CR |
65 | %! |
66 | TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 | |
67 | index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll | |
68 | exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]FontType 0 | |
69 | ne{/Metrics exch def dict begin Encoding{exch dup type/integertype ne{ | |
70 | pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get | |
71 | div def}ifelse}forall Metrics/Metrics currentdict end def}{{1 index type | |
72 | /nametype eq{exit}if exch pop}loop}ifelse[2 index currentdict end | |
73 | definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{dup | |
74 | sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll | |
75 | mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[ | |
76 | exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}if} | |
77 | forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}def | |
8a9c66f6 | 78 | end |
37c41ab1 CR |
79 | |
80 | %%EndProcSet | |
81 | %%BeginFont: CMTT12 | |
45c0f7f8 CR |
82 | %!PS-AdobeFont-1.0: CMTT12 003.002 |
83 | %%Title: CMTT12 | |
84 | %Version: 003.002 | |
85 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
86 | %%Creator: David M. Jones | |
87 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
88 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT12. | |
89 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
90 | % This license is in the accompanying file OFL.txt, and is also | |
91 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
92 | %%EndComments | |
93 | FontDirectory/CMTT12 known{/CMTT12 findfont dup/UniqueID known{dup | |
94 | /UniqueID get 5000833 eq exch/FontType get 1 eq and}{pop false}ifelse | |
95 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 96 | 11 dict begin |
45c0f7f8 CR |
97 | /FontType 1 def |
98 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
99 | /FontName /CMTT12 def | |
100 | /FontBBox {-1 -234 524 695 }readonly def | |
101 | /UniqueID 5000833 def | |
102 | /PaintType 0 def | |
103 | /FontInfo 9 dict dup begin | |
104 | /version (003.002) readonly def | |
105 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT12.) readonly def | |
37c41ab1 CR |
106 | /FullName (CMTT12) readonly def |
107 | /FamilyName (Computer Modern) readonly def | |
108 | /Weight (Medium) readonly def | |
109 | /ItalicAngle 0 def | |
110 | /isFixedPitch true def | |
45c0f7f8 CR |
111 | /UnderlinePosition -100 def |
112 | /UnderlineThickness 50 def | |
37c41ab1 | 113 | end readonly def |
37c41ab1 CR |
114 | /Encoding 256 array |
115 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
116 | dup 45 /hyphen put |
117 | dup 103 /g put | |
118 | dup 104 /h put | |
119 | dup 105 /i put | |
120 | dup 108 /l put | |
121 | dup 110 /n put | |
122 | dup 111 /o put | |
123 | dup 115 /s put | |
124 | dup 123 /braceleft put | |
125 | dup 125 /braceright put | |
37c41ab1 | 126 | readonly def |
37c41ab1 CR |
127 | currentdict end |
128 | currentfile eexec | |
45c0f7f8 CR |
129 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
130 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
131 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
132 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
133 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
134 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
135 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1B57D05DA0555DF933BB0 | |
136 | 7B42D264831116C06C79335D519461E7B0E870A6715E3D74A08D1BCF86E3BCC3 | |
137 | A43FC6BAD1C68BD9D4AFCC06D845FD1F1E70D7A47F0BBCAECE8396E04591E5E3 | |
138 | 4797F646AFEEB7DB548183F0B74C9BB6BA2AA04E7F5950EC8AE97C741D4B2C5C | |
139 | A8E7A8DF5A36A30B5A7592D95E1DBC63EF33C92FE459792CED29E2B8B6919251 | |
140 | 75EF62089BD7D44A6E1F9B62EC802FBE62B821DA1C3B2DDED45D27964AD29ED0 | |
141 | 9FB7868F3A8FEADA87A8E42D52C1EB7229D7C79B60BDA263F2BDB025AE14A507 | |
142 | 098FA274206BACFB4A0A7257D5998EE8F0FDCA79CB61DD1FC59DADD11E16BF02 | |
143 | ECDFD706CDA1E72054D4EB55AF7BA9F19955886BC0BD6E0E3FE3769C94AF3581 | |
144 | DFB2BCD67FE2892AF07E858A01280194D8DD7332B3D0A585C87FAB056C2EAA9B | |
145 | 5AD48D1C9F00CEF8EF0D1408DBE1C03D04B231D7B8D5D998FE0CD7EE19828EF2 | |
146 | F988EBF6DDBFEE00F04A4A1F4E1A55DED7EF3AACEAB5005F1962C724A017C914 | |
147 | 2936E2E0DF26A55ACD7DD836C6035CBF07981C1BCE3615064F0540A1034C69B4 | |
148 | E3908E76EF8925D486DF0B4A8E1F02D8AA99585A7C31847AB9382F83880C1C21 | |
149 | C496AB2DF8E7BD4643B28B704B5F6B53429D3EE940A79135F5BF0396E5B46F23 | |
150 | 42AF406C26D12BEA7A41F332AEB75DF43C15334CF4651A99F602036946B1B91D | |
151 | 4BB0D2E51C20216D892C8173241AC8FD15A37C3CDD8AB4FB67D8565AFA61C068 | |
152 | 95E3D6E46D7C09BBD09428207D506AD43C693F3C3D787F6A5C39084AE45E81C9 | |
153 | 830900DB50DAD10A17E118FB5E9680B5194716A788FF7514A1167DD1A305FBE5 | |
154 | 5925388A2E95AE46E8806E0F7B954D1A9F70EE29B069A9FEB0349298CE5311BB | |
155 | CAB039C21AEB714781BBCDBF2FFCBE7C4750D7693ED142ED0475EE9DB5D5F94F | |
156 | 4D4613E2C379E494464447C4167C625D70B9DBE4756DEF299974B704A3C238DC | |
157 | FCD3AD96645559ACA5056F7FD695D2AA709960E30F055ADBDCC7FDF641920A9F | |
158 | A279AAB98424E76D01937F9CFE3CF4E3779650D7C2DC38AB27FB81EB16C19B13 | |
159 | D47E0AC60C83641CCC1A00136625FE274C6AC706B516CBF14C54000BC2B7BD20 | |
160 | A28D40FCD6D9B321855BDA608E23BD365208DAB23983C0D8A7C9DDC28ED62216 | |
161 | 12A20A3068D843B5FA016B8C6B9BBD36356BF85A128F96F0CE861FB9C998BB21 | |
162 | E8624E3DE453C686D41DA7B72ABD919C5BE2F24440D11962C77742A8C0115A72 | |
163 | 9E974E71247FCD58318A4347813D4D5A73CF882A7513E2EFE05CE8C7195BDDC7 | |
164 | DF250B59AD14D02D2991E2D0CF2D0022EF52D78781711697FB784B832DB7FD5D | |
165 | A70B5A3A2F51985422B685644B23FB4BD39E743817606055EA9E919202151B7C | |
166 | 3374BD7F327FAA9E033893D3B05E305FB06C4098FBC0E96C9746CEECB1A71DFF | |
167 | 174DE4BFC20805F23170D4E9CC591CB605E243C953608656053E47D42692A516 | |
168 | 54CDD59EC3DBEFD075E63B234272548CBDF06E539A62441AAFC6F19FF9EF4C9E | |
169 | 59B4E5B46EE95B68678F1CA9507342AE1BB5B64C4F0C0DA6110ECB0DFA7120BC | |
170 | EEAADE70224CA0AA0DE936474CD031B5333FEC81039B73F62F9AEB9EFC2ABFCD | |
171 | 91BC8221B86E5FA9E077300E2240FFD8ED945485EDC31E1628908EE3CC15356F | |
172 | AE422BAEF4CF53716A5DA300B0EA0864C09EFA4B80355337349FD222079081BA | |
173 | 2F3D4C652BA1BB7ADB825A7DA1F7FE91B22E974AD9DB1777CA2B9568D52FF869 | |
174 | 7109343257EF3197B571790146662A4228A807D5C03EEF3649498C8A74A1A57E | |
175 | D808D1557B8F6CA4E8EF4AB0D35AF5F1292EB70577C5FBB8C36F63BB1F3B2CD0 | |
176 | FEDAEF4BC620290B59C745B367ECDF5CE962EBF66A22B2D80F275F1EA4C0E20B | |
177 | 76259BFC054BB4BF0A9A7869ADCBB18B21067CE4548982D43DF7C20B5F1573F4 | |
178 | 9A82B4746FC28220FBD402EF6F64C182472E732CB71C4382637DF498B5181B09 | |
179 | 331ACD2628B0D7320F180FF56E10E4C00A54C92D98578BCD5050EB477F8B5587 | |
180 | 5D19A43AEEF01B1898D9B33DB4001364DE863BB463095F4A880A288594E9C29B | |
181 | 92C038B2AC0519AA4E0E2796EB9D8BCF2344207F57C1AE7EE6538DF1F13DCA70 | |
182 | 9D04886CAB82BB020C7425B9206BC84DDB28735A0E0FAD39E2DABE78DC83C438 | |
183 | E6DAFA3BC97F19F250300A0629C4F7D7DD2D3A44BC64AB9E5CC4E6CB42D78AB7 | |
184 | 2FD0EAC23458847740997AEF151BF758E50D06839BF6A6E46824044574A18F21 | |
185 | D595F2C9E958FAD04B6F31375D24E1BDEEE484E46D4128E44D62711212867ED1 | |
186 | 12C3E7FE9FE9AE0BA73D7F39B4A4F4918D22384B30BD70AAE305F27905C64082 | |
187 | 6603F819836432CF488668C1102817334B8A6DA8715EB2486656BA048BDB7388 | |
188 | 6962CC2FDD4E659F92C2E651DE36654F986AA54EA16ECBAD44E18323AFD392EC | |
189 | 949B628C2154A2F84831A0369C2EF715EC943E11DF179DF507FBCA729A367BAF | |
190 | D9CD115F5CCE44A2745F62F0715C8654EC1502BAA0CAD3CD9A4B1FA3025BFD8F | |
191 | C4DE0F32E82B8E2EB3D2594C9FF5FAFB60ADAA1EE1E83C181FDB49F677082E29 | |
192 | 0D3798E85DEF6B535E46D455E94B0FA07D55C774BAC2BA6EF6B11DF3019DD48C | |
193 | 3C52E1F3B0891094F7C92D83695EDE6C08FA10FE826C08429407824C45B4266F | |
194 | E51889E5C7CD98DB6F32C5C96D4C87A220A6DA621F7971DD723C68B847679AFF | |
195 | 509F5882E39A1BEB248790DC8B1CCC48951B1A40747A7F63E602D5E45F2BB16B | |
196 | 72F5D48DE4D1DEF6B7EA7EA9CE63170925D5957D64E13ECF00966DE010490B47 | |
197 | C85B7A98AC16F4291ACB7D81D1ACEA572FEDC8337C7DC9B734C2EFA2EA52E590 | |
198 | 6969682039B6B991719245C94586F52C4DD92BF33457DF69B42BAEA4F1222D4F | |
199 | EB972C57A0BAA11AEE39E4F94D9F4F098416F1497F0DD231B1DE520F12F24BD6 | |
200 | 47C7B3FB15E963D52C8137BC1243D5731F76559333DFFFF2F34F47FA31EC28D0 | |
201 | C78C54A599A97EB7C5F07F26A266024CA314BD198D06E30B775BA30AEAAFE10A | |
202 | 10D52067EEBA50EB67F01426426CCD079A6C016C86EE5FCF229946EC02F9BD52 | |
203 | 98C1C40D7C4797ADE8ED7FB1CDCF39A1AD5C0DE46B543C3738C305B57C152FE9 | |
204 | 2575ADE0A3CCE1BFDE234E5DAA477BE479D76BD69FAC6CEAD570C97802A34A55 | |
205 | 35CA2D6C2006C4D422EAE12F72C39FF0562FC497D0B9AD301047CF1D42543295 | |
206 | A16A8C06B1DCFCB0CA5FB7A29541BFE828E2D1B6B0034C2F0D48346AD98BCB42 | |
207 | B3CC9E57F5CC0EA63D5FFAE3ED4DD44605E27E5913388F9661CF4A7B6C2BC76A | |
208 | A4D944B170DC4BFD0411A8DF2D36D514E12F77231D5AB3DE6112BFB5C6309F92 | |
209 | 31C0A932846E7C2BAF2306640B9E54C583F6486317BB4E6308C232E26FD86698 | |
210 | 636F814E6D55C8E1C52B184F5EE6518A86F11B6CB55EE663DD8D71F5FDBBFA71 | |
211 | 394638EE1450E851205AB4CBF9ADDF | |
37c41ab1 CR |
212 | 0000000000000000000000000000000000000000000000000000000000000000 |
213 | 0000000000000000000000000000000000000000000000000000000000000000 | |
214 | 0000000000000000000000000000000000000000000000000000000000000000 | |
215 | 0000000000000000000000000000000000000000000000000000000000000000 | |
216 | 0000000000000000000000000000000000000000000000000000000000000000 | |
217 | 0000000000000000000000000000000000000000000000000000000000000000 | |
218 | 0000000000000000000000000000000000000000000000000000000000000000 | |
219 | 0000000000000000000000000000000000000000000000000000000000000000 | |
220 | cleartomark | |
45c0f7f8 | 221 | {restore}if |
37c41ab1 CR |
222 | %%EndFont |
223 | %%BeginFont: CMR9 | |
45c0f7f8 CR |
224 | %!PS-AdobeFont-1.0: CMR9 003.002 |
225 | %%Title: CMR9 | |
226 | %Version: 003.002 | |
227 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
228 | %%Creator: David M. Jones | |
229 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
230 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMR9. | |
231 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
232 | % This license is in the accompanying file OFL.txt, and is also | |
233 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
234 | %%EndComments | |
235 | FontDirectory/CMR9 known{/CMR9 findfont dup/UniqueID known{dup | |
236 | /UniqueID get 5000792 eq exch/FontType get 1 eq and}{pop false}ifelse | |
237 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 238 | 11 dict begin |
45c0f7f8 CR |
239 | /FontType 1 def |
240 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
241 | /FontName /CMR9 def | |
242 | /FontBBox {-39 -250 1036 750 }readonly def | |
243 | /UniqueID 5000792 def | |
244 | /PaintType 0 def | |
245 | /FontInfo 9 dict dup begin | |
246 | /version (003.002) readonly def | |
247 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMR9.) readonly def | |
37c41ab1 CR |
248 | /FullName (CMR9) readonly def |
249 | /FamilyName (Computer Modern) readonly def | |
250 | /Weight (Medium) readonly def | |
251 | /ItalicAngle 0 def | |
252 | /isFixedPitch false def | |
45c0f7f8 CR |
253 | /UnderlinePosition -100 def |
254 | /UnderlineThickness 50 def | |
37c41ab1 | 255 | end readonly def |
37c41ab1 CR |
256 | /Encoding 256 array |
257 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
258 | dup 12 /fi put |
259 | dup 44 /comma put | |
260 | dup 48 /zero put | |
261 | dup 49 /one put | |
262 | dup 50 /two put | |
263 | dup 51 /three put | |
264 | dup 52 /four put | |
265 | dup 53 /five put | |
266 | dup 54 /six put | |
267 | dup 55 /seven put | |
268 | dup 56 /eight put | |
269 | dup 57 /nine put | |
270 | dup 65 /A put | |
271 | dup 66 /B put | |
272 | dup 68 /D put | |
d3ad40de CR |
273 | dup 72 /H put |
274 | dup 73 /I put | |
d3ad40de CR |
275 | dup 77 /M put |
276 | dup 78 /N put | |
277 | dup 79 /O put | |
278 | dup 80 /P put | |
279 | dup 82 /R put | |
280 | dup 83 /S put | |
d3ad40de CR |
281 | dup 88 /X put |
282 | dup 97 /a put | |
283 | dup 98 /b put | |
284 | dup 99 /c put | |
285 | dup 100 /d put | |
286 | dup 101 /e put | |
287 | dup 102 /f put | |
288 | dup 103 /g put | |
289 | dup 104 /h put | |
290 | dup 105 /i put | |
291 | dup 106 /j put | |
292 | dup 107 /k put | |
293 | dup 108 /l put | |
294 | dup 109 /m put | |
295 | dup 110 /n put | |
296 | dup 111 /o put | |
297 | dup 112 /p put | |
298 | dup 113 /q put | |
299 | dup 114 /r put | |
300 | dup 115 /s put | |
301 | dup 116 /t put | |
302 | dup 117 /u put | |
303 | dup 118 /v put | |
304 | dup 119 /w put | |
305 | dup 120 /x put | |
306 | dup 121 /y put | |
307 | dup 122 /z put | |
37c41ab1 | 308 | readonly def |
37c41ab1 CR |
309 | currentdict end |
310 | currentfile eexec | |
45c0f7f8 CR |
311 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
312 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
313 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
314 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
315 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
316 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
317 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2DB9AF72336CC4AD340 | |
318 | 15A449513D5F74BFB9A68ABC471020464E3E6E33008238B123DEDE18557D712E | |
319 | ED5223722892A4DAC477120B8C9F3FE3FD334EACD3E8AABDC3C967C61FF003B4 | |
320 | B10C56D6A490CE9594D57A2D431B9E5E10FE3D8832E227A7087611431ABCD029 | |
321 | 85F4865E17E17F8CFBD2CADC97E0A8820E3ACEC873F31464466A9545E967E53C | |
322 | DBDDB8478E69063FBB891566BAF88B7660A4405B16834761F041CCF7650AF955 | |
323 | F9E853AA9F5F4382E1FE7D0C5BB4023818A2383F91249D48CE021250EC9EEB1D | |
324 | 2835E18FB73026250B32A8849067D5E2258797C917F998F2D4121D96560C5FB5 | |
325 | B5D3471216639A8671B6DFAC5E3554EC36D9A72518525A795590C74DD70DA3A7 | |
326 | 78BFC43E51D6F2BA52F17D4DD00D389D3983EC54912AFF73684A8A7E345537B7 | |
327 | E62361C04A47859DA084BC72EA53512DC54132EB2EE671793603015652EAFDE3 | |
328 | 41C4B6B679BD60AEC5153EA0D2200CB1D097DAD770F5F31E6FC475A225995277 | |
329 | B867B731D5401E2D02B85BA85158C80FF7E2BBCC42B98AC867E67D25DB656072 | |
330 | 55A0D32AB7AA483A5A9686CEA4E2B3031D90D84DB3E2DEE7706C91BA81CB8DAA | |
331 | 700E5F61E07D6998C9552C81B66FD10A10033D49EF3BCB0FF22ED0A3737523C9 | |
332 | 8F851C61C4BF8A213BF6EC70C956AE48B5BD276CC0437C72BF6515B10739919A | |
333 | F00F6ADD2798CB211668842349171A5AEB0664D2C44397E55A4A9EBDF54A3EF4 | |
334 | FBBCDAD9DAEF4B0CAEF7112FA828F2F8D9F633D37E5516AB5ECEA87342EF8DC4 | |
335 | 3A50548490F5BC9A8A1F98AC7AEAD9D913BFA10CA86D73AEB5BACC1FEEFDCC15 | |
336 | B3655522CCA2C772E902FAB2A6FC153597D52763EB44AB7489FF061F7F58E8F2 | |
337 | AEAAF4D17F36CBFC00D3C653F335D14240C87DB4339DA9D30A5BD1F502BC9013 | |
338 | 461B9DB2FBEEC01BB18990439A0E9CA6576BC9CF6B1A3DB9386C4A5D4AA6A5DC | |
339 | CFA45FB75F22E10ECB72565DB441A194902C91427B4F676E531C661F7A2C3C85 | |
340 | CD534D1C89B6779B2EDC8E44667B992C20C70B663BFBF680A6CF4383EB7CA26C | |
341 | 4D1F06B5EF4025BBE65795F1EDB5CCB97050872D6C07BC2974F905ACDB7A765F | |
342 | 291365D6C8152153E7F017A25FB4476C60FD9EAF9A121633DBEAC32F62850223 | |
343 | D6418566AB350F90F4B35F19598478F76B63E347D4C61E203D4DB8ECB9889181 | |
344 | C387F4B663A502C638761D2782BB96EAC81A0108D7BD6938F67FEBB69218D115 | |
345 | D8E89CFABCE15C6ACC7FEB983332A51A6A73CF4E341574F366713D7FB29956D9 | |
346 | 9BF238A87483D37E526A2EA2F101EDD34E34CB92730DCA7235AA0027189BE405 | |
347 | 2DAB4AA021A30C28B26C50808E1E965C02F6212EC7C72F5683339425A7739380 | |
348 | A422E6191ED8453AF0CAAA424AE44DFA7CC5C2F6EAA8D73A5101D8E9517DBCFB | |
349 | 2858D0E8ECB7DC430EF23A9E4428CB7DED8D035D6050251AC101A2D0E884721E | |
350 | 2F21E573F948048BB8FF888911C508CC198BD750083B339500C426AFCD5634A6 | |
351 | AAAC1C7E91249667B231BBFC64B4317192FE07FE9DA0DDB5E517D097AAE46577 | |
352 | 9555F29D45C67CDE9812CAD03F220B20519F2FF32DCA56A554D4296FE2D1F3FB | |
353 | B209B5270E0E695EA5A0EF1144957CE045881AEB8D05D72CE57F4D34617AED67 | |
354 | 0D3AF0472CD8D60933651626550366E300E72A9C89ACD475C2E2ED9BD44B472D | |
355 | 9DAFE943F8E02A6DC38E447EED964624C37C3130E48211CA279BB6A0BD59466B | |
356 | 42F3D89B5746F29E084E22CF58395AF0F29E55113F3A3F2F52CB3A6DF3D026D0 | |
357 | C81754B8E2E4A15F6943BE9D0087D5166060734FD07C4C57D7C7D90E8C9C1F35 | |
358 | 623CEEE3ABAE75E1A18A1E3B50B7266BD2D8E812CFEB4A46B856885B185640D6 | |
359 | B9C22179551002B94282F57FB433B7FF157D2F0D240836B72AF4A331668AE5D4 | |
360 | E6B85415F4E8B9D2F9AF90FAFAA0A3866DF417CA5A31348CF9B41B8F5F4D2F97 | |
361 | CCF7ADE851B5E2E2F6E319AAF5792EBB9DA2C6AA8B73D889F3CDAA42932CDA7D | |
362 | 07A7E59183CD89520DDFC36E5D513BFD8AD0886046585F29B4D7F42CC0C27AA7 | |
363 | 53915AB1167D292FE91957E94A57FEE2D49C20C9070ECD736BDEE0F046E60350 | |
364 | EA539DC298156A4E0D019E7D481FDDA6861E20678516AB80ABEC1F09B126BCB9 | |
365 | 52E8272A06BB6DD87ACFC423B4A4FC9A3DC8DCAEBB807C5F748F1FF8B17B8B88 | |
366 | F426206BF1B7B7D239D26BC3CF0776C467A98CFBBCA5FB6145D5900137ED19DC | |
367 | D002F10704AA680EC753C22E29AAB15712EF22AF73D80820A1EEE953463D4EA3 | |
368 | 81FAF99518D4FD0F862A324FC44C4B9542A92C5B60CC983CC8F647CE5BDB4D6D | |
369 | B92B380E0E5F7208A9CD91FA9A469548162C761C1BA05AC9D60B766764D821B6 | |
370 | B4E17F56CE455F06EA1EE2D38FE47581746C4C5FBA63AEE2B58E877D1A8FA83A | |
371 | 31C972D53B64E92EEEA147426A92CFBF76FC614119C6E9C6476FD6A069C803BF | |
372 | E949FBE50B5AB1F1463F9747E8D353F7BBD991C4F90F920BC9407D8E24720293 | |
373 | 846D052214E60390C3CB926D38C83AF697425D80C2B4FC4706615B905516B733 | |
374 | 46ACA325CEA68FB21B2D17CF0B68BA4DF249368625CF83441EDBF2B86C957C1E | |
375 | 44CD722BD2537CE84FBA07EC7AE15C840041B9F7F3040072E6084CD55B301C08 | |
376 | A64A53BD4D3DC30DCAC6C152F316ABC59B8EE978793EBD568849DCC2A75A495A | |
377 | BC83470D503F8E389F54B4A4A31624E83C601B43AC1E52CB811FAA7CA6B644A5 | |
378 | 1AE0BFD4FC774C9C9DFC2769ABFA9C83F900BE2DD4010416053A1D4874E6ECF4 | |
379 | D86E44B4CAB15D53E5630C144B0C15B58DAAD785BA298B1893D1B09BA5D40344 | |
380 | 6678FD2D17FF6674433C976D6DAC659175CED26139967C9B2B9CFFD78FC2570A | |
381 | E5142141C2888DBF2DC8503F9137CE7CB21A1EBC2D65BF33FCEFBC85C9CB736E | |
382 | 24E8595CE934AB032CC70BD6A3B0F3BDBFBBE185512FDB7BE3D4A6620478453E | |
383 | 75D044BF770B44C9741E31985E6DAF5A318D7BED12B02A4BCFE60D25EF12843D | |
384 | EFC9BAE2A3F2EFAD66D7858E83EB46BB09D2FF8AE9C43844A7001C86ED97AF51 | |
385 | C511E3A89A1BE349FF5215D1A57843EF51456B9838133846F19BE79AAA5C1AB0 | |
386 | 5F400E5E8E7B0BF96EFCA3B8F0894BE589F2C9FB6C97BD16D38F0A237CD4F034 | |
387 | 099C41F85C7E2C7BEC8E02C4F327306A53B4B48B26A8926670CEEF96F6DF2281 | |
388 | 7C2DAD99EF8B81BBB777227C2475AE7400DC393D9C0445E925DB1E955950F7AE | |
389 | 53E9AC4306794239346A419F7B5DF4168382EF5956B81F83BD4BB7635B3BCC84 | |
390 | 7D84D05AEDC02D14675D777CD19B08124001A4F4EA96990D96000C082A12F00F | |
391 | 7FEF793A7FA69D56D3A38D012168C5458B667190AFE80E02C816CAFF0A71953C | |
392 | D80B085CD286027E2FDBB05452AA762FD7C813B2E19A79C74190E04E746C4933 | |
393 | CE1E300CAF5DD53B08110509BDA404EF07FA1BC5224BF1205DE8E0C3276A13DD | |
394 | 866675103B960C5F36644F96B4FAC16F5D6E91F74629B318FCCC8E8CB13EB76B | |
395 | B0B7B90718D913A52A04732EA3667674994A325A7973C601A7DDD50F658E0826 | |
396 | ACB8E53D4914B0274AED98D7BC3B2B7F9D48A7ECC2F8ABEE05CF2C4F2B90360B | |
397 | B7DF779EAF3E103D1D83EDBE32DDA873768D8C37DC10A5354A94B4153049AD64 | |
398 | FF3E0BB51AB91D7C0B4134D8731CD0270DAAF19BED9EAD800A14B65B68EEE89B | |
399 | 40DD624111670DDC7C030DEFE0D1B96420E249332445C155BA96231C88E70643 | |
400 | D526BDF3CA1E05FEE72CE2B881CFC01ED780C10E89F0828AD55FE29043BC56E8 | |
401 | 2750A6DD15AADD54492F6092618F4CC6A31766B17FC60766D18C307EFC9BB787 | |
402 | 39047DAD6B38419EFBA46B4E2C932F97451FE78AD75FA90DE409FC6DD46585D2 | |
403 | 1941F5ED47A8FBAEF5A917A240959E8D9F9917DEA3247D9CAE6BF7A88DB4C4A4 | |
404 | F9F5A6DCE542420A032FF3392FE0F3357B51F884D6181583A554F75B1DF192E9 | |
405 | 253CC828FF06B0D992D5316435980B044BB191508C7C45CD90F797F88856424B | |
406 | 14A5707459C50EDCF3E3D8D1667AAA83015405354CE744C66D9A5728F29E0085 | |
407 | 6DBF740717FA0799E3BCC4ED7841588B496A5E549B953A7FD288B4A045DB611E | |
408 | E3B2F35963FF18ACCB1C968BEEA2CBF52B3999AAF89A05320BB2E97F52CFE06B | |
409 | 9F10E3A79865A3059A957F97972D80ADF678A36E2B586C101FC6AFA4D137C13E | |
410 | EE7102C9B8EF78CB057F8B7476F146E8FF5C897FD5503DD198128CFF7B5FB339 | |
411 | FAD0AF0EA967F77B07B367A4AC9F668F8BED99B98E87FAC750EE045602D76C3F | |
412 | 289FC9D97694C96AAC0AD1BD3FA94DF2CBCEA24B40F47B9B59E54EECEE7AC4C3 | |
413 | A3F5D19160E4C1EA830D57FBE10D8D46AC5CA0260F22FAA45236F0F542BEA9C5 | |
414 | 5A88F878F68B36114E0573900C65E305462B22A3429A17C7A567694414DDDA46 | |
415 | 5F30542B8FD4F00F6C295B2E8D3A986B953D96822DB2ECD48E8BB1763434E652 | |
416 | 152EF3717F5E7FA10FF0B01D9F64E22C5DBD7254629658887BACEC0ABDE972EE | |
417 | 67299FB84A05B3EFE22B6976DB4CCA384232DDAE38C31623A4E39EA2E82C1EA3 | |
418 | BBB68F1A7DBF405DEC37CB7203A895C36A44BD2D63F45B3888AF91D37B510A59 | |
419 | 3C921BB44DA620892AD87B665F69F6FA510B071ECC403CB2BE2F54B3969C9E88 | |
420 | 713244BC97C1466DA8216DA7600C221E7E7EF5C789D2E12B36422023A03E11BF | |
421 | 2790FD6062FE6BF62F5010A92F0A104B76E255A0975E04F6F20F760881BDA7F5 | |
422 | D834D1D328B6EC19AA7D5E5678A84C74C82553DBE8BB5765E84F5A8789032143 | |
423 | 6020940B4B8D45FC3433D356E28C25F42D0C19F911213D85951B2B00D01B77BB | |
424 | A4C72E964F9D95422BEDE582A05CD52E03D28A996E6CC8FCD910CBAB728073F9 | |
425 | F9FAEED5470FFA55930447C5BA816F826F983D53EC9941EC8364B3060FD74C95 | |
426 | 26D4F5CA753B574FD2FA4D1D333785241D8741B79E628BC852FDC35478C5ED9A | |
427 | C1BE88C5EE7302816E65C12B58EA16FEDD4672EB3E24B6EDAD5DCE263BA8A970 | |
428 | 350B651E5A9F3C281D85BC3F44EADD0D93402E36489BA5185E7D388974B0B700 | |
429 | 70575188BB610CCA20F081E2CBDA13DCC6F72567962ADB342E02C1E763B673C5 | |
430 | F7384E24C6E1730A3A790D690A2103AEF88E0C1D4480DC9B25E5C8C9E1919C95 | |
431 | F83320179B4C7C4A26D559BFB24D7D596FB73758C9990C451E77FCDDD17763B8 | |
432 | 9C30A9534E3CB6680D3D419D4B70B0B0A0D160FCCDE169714E373F65B7144CC2 | |
433 | DB9A44E041211E1517D3148E65A2486CBE5E74E625261CCF65392FB4F3091473 | |
434 | F9E8DF327D59A58558E5C9F7190DB577D5DC658F5E36258291C708B3D224653D | |
435 | 064BB6079F91293FC733710893AD1C96169B30CBFE4E9D52E7EFAE4AFEE68FEF | |
436 | 1AFD5E7E9DFCE8DE332B0FDC0514F9B3090AC85BBFB527FD8034DD33E9576325 | |
437 | A8769AE09AF1BA792447DDD932B98FC9486B39E0B04DDB3EFB7A30DA0940B33E | |
438 | E27490E0E841E87B1C90E5248A91742ABEDC10F43A8AF0F9C5B4A4930B1AADAF | |
439 | 01874B9AC3B8D0DBECCDA6CD7E96471FAA15CB7F8A599C5746327CE392224C3C | |
440 | 40BD60AF97BCA6FF6FCAB2FEA114D7300B89E91C3BC92D5B3E2C83BB37992D8C | |
441 | 72F661EFD0AA034C738C019DFB79BF40651A1A34BC1EB9F5AAF58F8B3DA32645 | |
442 | 24AFF8636486F08BC21533B5FF7391B0679A78DFDCB03DAF6BB7475A1D51DAC1 | |
443 | EE4BE9B986655D1FDB6936445EF99B58B303FE79F11275EEA96A9F6808EA8775 | |
444 | D873D1052FAC93769789C700F20EB2ED6D15676F6E563A769CA9298E463FC311 | |
445 | 83281483B1C953370D196727A6A0E66D32D9480AB1B6DCA77868C1A2D5DB6483 | |
446 | 5F31EB6B18EEFEF1CDC31533E69B0AFC6B30FC9912DC89BAAEEADC30BE14F448 | |
447 | 1A6B70D36A5D9B01799BEEA686066114910842D022EB464A9A1E8F0A5628BA69 | |
448 | AA9A1925CCADD44703BC67A89F3B48E4680726DC4360274185CF3C8AB747A8FC | |
449 | 4B928AD62B092EFE48B01E33ED756DB696171FDB775396BBA138E056F71EDAE3 | |
450 | 7A1E4CC272B8418114B0E81DE0BC43DB3C133167344488820A92DF10FFA26FB9 | |
451 | 65FCA2C87D302E956DE6B4FE145145440C83DB43A68F8B29A592B127BDF49063 | |
452 | B7F11E155CD4CAE305525BEA56B7C412A6260426407BD892A3F2B444AC3421E6 | |
453 | FB6E6425EB5C3053C5644666B80405530FA0012B54557327C98E0F4F064099A6 | |
454 | 4ACAAFC1870359C1B6FBE7606BB8A26026AE20C212210449905E628AF1B20490 | |
455 | 8CE908B7EF3E3DB551C85AEB0F7FEB6A8D215B97998E5DD9C7CCFB2A9402B8B6 | |
456 | 1770D4023777D4B45A73F471355353412C51D4CE71FAD1E0AFBD87B5F86307F3 | |
457 | 10D0B94F1194EFFB64AD5DA54A4200490F609CA8B912E149F8217ABB1E9EBB3B | |
458 | C4470E7365CF5E1E761AA1945044B225BD53D142F6588C50E0644740F7DD55E4 | |
459 | 8F73201E5354A8BC78339211AFC4935F44701FBA043AAC4BA4698E9D7700029A | |
460 | C79F992F62627C91EB855F64C4B251718FDA71EDAF082A0C7B00550949D617A0 | |
461 | 7071FB14F05620CCF2180941341D8E60FC88823438FD728A4042AFA8B853107F | |
462 | 852F631518B61B234565291B5D5B89DA818DEE3AE3B68A2869DFA63255CC882C | |
463 | 3B16BBA08FCE3632E57FF7A07F857A1F0FDCADAB39D77960BD827CCC8661A997 | |
464 | 648BF5BEBC0FD2286C2A112A8DEB9CCB6330A049170D5D68EEEEA011D3EF3EBD | |
465 | 855236B9380087CBBB6BE24191F728B7EAC5B50F7A547AA0989B7C7D3437DBCE | |
466 | 1669341264E290646F2C8C5A3ACAAC7CB63DC692FAAE13E9B40E8BD39FE16A0C | |
467 | 1660CE66872D061056C04DDDC265C024BEF8B7E3C3AEE76FE5C9702002C28BE0 | |
468 | B180295EE00E567FA2E5CD1638226D24A7C732E1BD8103B476EF5702768689C7 | |
469 | D4FCD47F2AB94A2B1FBAE6ABF87B09E7713C773FB65CA83F7318035B332B9F99 | |
470 | 24A2C8897527021321D003AAD7C273E4BFA2710B9BB26C2CFD3D9A5D7ED1096C | |
471 | 552D50028AE2476FCD6D12A5D0A897521313ED1A3A8456A70C16EAA50A3E6733 | |
472 | 6DC89FEC56AB54A579EF264377A103939D5EE00A90B4F2206D0023AF9491FBE0 | |
473 | 800C6540FC945199E20E945F46CEEA2E885F6800B9DF042BCEF4291A4B1A62C8 | |
474 | 6A7ACFF872B25FA3AE69E0093F3D0FF13A3313430C06F1AF94D500431566F659 | |
475 | E8C859A5F80F5BD2E85C8E32603D3745628E8FE6FBC50FA68F9C3811A2BEFEA4 | |
476 | 5852CAE2AE5AAD3230ED050593BAD0A9581EB7B327C6916B8FC348F4C23E6FA2 | |
477 | 00FA28AAACCB3091C1D83F7BB88672A53A2EA3B8C7C24374E400C57F0F01019F | |
478 | E52D5C47F389D4C9AF126F4080F9AB8D1C8F470932BBECCEC72A9796F6E965A4 | |
479 | 82057DDB43D68298A00880D4C2E2496F26F015FD83C5549215753459310339B7 | |
480 | 6B2961EEEE74DA31FEC8E2BDDA42D4080A32372AC372524BDDA580EF6634ACE3 | |
481 | 128C69D04D890DCA337212B109585C665AA83EFE47D5BABC2627A86EAD11BF7D | |
482 | 744176652C7F9497785A7A06A994ED8414BBE8B26E74D48CB83FA24AAFBDD507 | |
483 | 84A90195EA3D77BCE8C2BEDDD1DC52E8164DF15D65B916EBDF3A8A76849653DF | |
484 | AE3CAF9561AF3B705F75B9E5DFD6758DB65A2FD54683759912E0D0035CFBCD86 | |
485 | 5C7018E5F1DFB86B739C4749DDCFB2F40529E1F15174DF4AE9833958B66ED869 | |
486 | 920CFB9524F05AB2FA84A4AC41A02490699F277A3B4ECC3C31ACF79E884B979C | |
487 | AEFF660A8EEF118C79F8DA266F89F32078B1C333DFA5264D6B64371276ED4DBD | |
488 | 5A2DF213D85A56B1CA85DEA53ED0299C1FA48D463B11FC9A0751C986CAABB184 | |
489 | 829B1133CA8422DC11C6CEAAD463FEB468FC7AA2DDBE2E708D27D89164B12BD8 | |
490 | B9A71A1D06D2FA9ED0B02168B32F6CC0FE765F2AF8A19C7196EE55648E642184 | |
491 | BDF993C99EF7C10AD2A7962DB9B7851E6EE24A0C53475186BB44083AE18254B9 | |
492 | F1CEA0B66A6581C81DE19DA8EEC9330A030F3384C1DF8216E5A25FB38C1B94F3 | |
493 | 403C3541593A016CB5FD306F41F40E82D4561EBCBF76153BDFCF338284348755 | |
494 | 0208360C5842FCD6B2D614387575B6E49F4B5A4DA281A352ABE8B76CFCD94A00 | |
495 | 1C586D19B68D965BD8D7EF0DC87271478CB4D0D1633676A2FC51B36876002A9B | |
496 | F5D632ED778BA9EA1C3741FFCC15AEEC11C8E1544DA7358473325812E50C2135 | |
497 | 84ECE7DCE281956681179C09C0E8DBAC5E4424AAD00FDA269BCD6412F1D6DCE0 | |
498 | 2BC7CABF85AE803D620F5140C63DAC4B0E5F7896343973FBB99486B93B6DB58F | |
499 | 38ACBE8868CC58B3918C1AB4406FBCC7BE8496C78C9D628716BF1E306AA802D4 | |
500 | 5FAC522B1EE90448387DB8E85235FFAAF3754E2317B693D567A488753993B8C5 | |
501 | DA3C8FA50A35202958FD0BF2900A6CE175920C2EC7CD449D4DB189A50958BF17 | |
502 | 644345CC38250088A694CF0F482ECC55ADCD02E17B3CCE66213A6163B8B44C9A | |
503 | 89068E3B5301D2364F85BF9DF7C77342796363A7B6B294CE26DBB9179DC15756 | |
504 | E1B32CE919AF44BC79A3AA8FDF6118345B2AE03F3B11D57D9AF50EBCF7152E37 | |
505 | 15510FBF60F16756FC674E2BF58E88CAB2CA2E8B47F50096C51179684331FD61 | |
506 | 8B34520C9C7D01E1511C924FA76B3CAF79501E0AA2C6E1EC6F00CB6CE24B4123 | |
507 | F493B149B5A5147EF6BF1EF3CD21A76945B95082E1FB3C5A150D8AF793348E8C | |
508 | A988354FA46E3775486A6999E022EBE293E8396C8F9416929607730606CFA772 | |
509 | BC8388BA5D64B79E52DD2048ABF21661121A001E6A75731B5DC43CE040396BD7 | |
510 | B85603C8A0F37E522FD0CBA63C454B12960451CE65A69F98FB2FDBAE725C0999 | |
511 | 05FB68B4C1D320F5F3D61FA8446BE6F8BC46AD9CFA5674A3EC73B8F3419AF9EF | |
512 | 7A1A3C9EDE3BD6359902D4B5F3AB4E3FF9CB2E1937937AFA182C651985703F20 | |
513 | FB70E37AADED6345EF4E83CB140FF92310BACFBDA11F2CD5AD93AA7563D7426B | |
514 | 0D4B6CF9B669F9A702956CA845E3814E4B5491E58F8C89714229942165A6E8E6 | |
515 | 58982D89C4FA7BC557214BF9ACE2C63AD88F2D1B18A04F510211687C35AA1F7F | |
516 | D2003D4E60400B95E70422024A7111D926F1B5A77074910710594B95680CFC4D | |
517 | 911FC16B928D9644340A9D2382767FE6AD453E8E4CBF19F77D3DA2934B11FC95 | |
518 | A6900C3CA3F2B6AE4290A005F908305CB37700680D76C4999AFE509B18305D28 | |
519 | 88C36292D6DA208A8D42F8B81FDEA7E93EE59D6AF3F1A3522EE91BE71BC655B9 | |
520 | 79C49B033A036E1FCD94FC581AE732A224F055503CFC69FBCDEA39CB00DC8A0B | |
521 | 4BEFED99CFC4E44ED51DEDF9EA825FF6BB97D316726531CB4BA083B033C0B69B | |
522 | 8068D5D3E3E31DED5F6267439F149549A6E12B00BA85818AEB491978364D9F7D | |
523 | 7375CBD6C5511CC846D0058BD2CE5467EBCEACE5CBEB2D33AC8E12A84CA620EA | |
524 | 99A0ED916B7770A056F6A9C361CD5118B5DDB10A5A4E643FFB8FC5DCBACDCB28 | |
525 | 696E26D030C5918548AD8B87E21E1B4BAA91AF23663CDE350A21C2CEEFD28947 | |
526 | BC07BB49404FA39F251E36B95B7338EF03F2E63FBE0E023452097F21931A2599 | |
527 | 4EBA7BFA669EBEDC0F5B33375DFE6DB1638D19D4B5112B5338B14C93F707D340 | |
528 | 056B2B75AFE418EAF9CD57ED842F7B5FFF037B3A4B369C63E4DF9F0BDB4E39C6 | |
529 | C5BE8EDA628F1C6FEEBC9D9886DBE502CCAA86092646094118069757DAC25C38 | |
530 | 2CA53CBA27577BAF2C57196489CBA54B96C650A1C130184A4444CDE2D0CB1A49 | |
531 | FADCAF1FE3A66334F85FAFB00F142F28AF2D8FEFC29FE8E0FDA448F181040BF1 | |
532 | 62EA7AE75100BA46B49EF30F596CD9091164AF70666E254938BF6A44F01BBD2C | |
533 | 4160164FD89FCD358E48908BEFBAAC4411B52390CEED6B46D729698CCA8E164C | |
534 | F77CEBB50C5254F81570E414B1E9E79269D3B2575E161620CC732C0405A29ED7 | |
535 | 1E5A6597D35B11EE08DC09FC9C27F0126C22C73A0EED657D7F91790777E7D8B1 | |
536 | EBAFB0EC9ADAEFEF7F6A91A1028E46D76289EB1BC15D3597CFCD78D88B633759 | |
537 | 93CB4477596E28A1E413BE25D513BA611757C994AE812C5A6D9AD3F770499252 | |
538 | C7F53E585E03B2FF056EECFB7ABAC474A981D757AB3B6F281744F01713782887 | |
539 | 9BE48307BC5516A067743C054A3927E015AB0B2AD2D80D229BA32FDAB660C3C2 | |
540 | 40DE8C83E1E4941B8D765B879222847F855960604EFF94E9D99E4AD0FF2E887D | |
541 | 54DB39B984A9E9F69ABDDBB2A452661703841BE79200EDF24C4172D736B461E9 | |
542 | 8BC314AC1CE1650083B18B2AD809B5F2DCB314651433E357042A8AA73A184D38 | |
543 | 290AFF0443C4A293CA6F04643EA3C313FC6070D76400B0BCCEDD20B5F0A67200 | |
544 | 01584F0062794AD3D82C83FCE4380E28312815EE20DF3DD21D381046940A8C96 | |
545 | 4DFCB07E5A558DBF1DE489FF4FCD1C851A597B0EA58604BD16DC8FD89B9E70CC | |
546 | 36F99E8327E9112D98C1AA1C355FEC942E879C3CF8C358FE955B1E2518C81270 | |
547 | 9BBB3F4BDDB57D04685FC0D90AD3566A81086B3BF196B2CDD42BD1455F588342 | |
548 | C817CB9E0E75A0A24BE751B46DE8DC974554DF975D02864773F2EE856A0CF595 | |
549 | 0D614F71A1AAF4A72DB4E5896AE9C2B33F993C006DD7F644DD1B3AEBBF34AF8F | |
550 | A809C51EEF38E3912E82F7F15F4DBB9D6E5D7974B1B871AB3F3A48B72F0356DF | |
551 | CAD862D11273580D1BEC9E88931B7B9C74B8AC3DB5F3B3FA05213D3CE48C0F2B | |
552 | 237A7DDC33D850D1B2B5B8CB7CC1A1A2221451FFF0AF88175EEF18EB932F47FA | |
553 | 9A8A97F92B6E2A01CF8BDDCEED9E1776A1A3D4328FB7F8537689CCE7F145A8A6 | |
554 | 2DAD7C9C23C0DBA934E4803FCF9E7C292E67D748F972415E62E56B60DE016930 | |
555 | B82AD792313A7D1CE655B0E08076AEE57E1BA5FB00FA2B264771507126FDEDBC | |
556 | 688FA19EF5A87B5958A952A2CE751BF57B84FF314D5A005C32D5E7B63A56F336 | |
557 | BE5C5BEDAC69462C93252A6C5CFA9C3AF6C40C8A2D13A738DBC1730D665FA91C | |
558 | 60280FBCCF36E3EDEDA845C74817706474551248130533880FCB0B81C5BD0340 | |
559 | B85157690619844D18A13AF540F18DA0AA3B172636B1FFB5380D937F11BB8F48 | |
560 | E14384548CD17D33133B624733533E20C1C7A68F32C814E73C790EE009EE9721 | |
561 | FE6B3C0503A45BF0D1747BD8D5E55E0021A12F97D8A913EC9AC33856CE65D0C6 | |
562 | 4BECD978E7B1C5A22FB51800C9B554341C40C619DE8053C50A3828E2B2AD44BB | |
563 | 54F2D6AD9B0EF34235533491A2C369324D5045A6A72041FC486D20370D571D6E | |
564 | 8ED76A32C6F4CB552933AE68B1E71945F9316C6F5DB23CF258A27C358D8F207A | |
565 | 0B19A734F426D447CD45F2ECA02BE75BE30DAF9FE2F84DBB35DAF6663F34D0FC | |
566 | C25F317EBD33FCFAA24848D0F56B54009C105B42BF5CD900AD2C1393D57EE2E0 | |
567 | 6438DD0ACD28B342F813A7C9C0D1CF42E459589F5D7A102F8551158611E14AE4 | |
568 | 9033B687C0D41927D592D79F14FF0467EF256DD23FBFD7AAB6D514C0A7204009 | |
569 | A1B8BB21323997EFFBE265D369AFF7093B13E98A26AE4B55F9F5F5B5EB77D844 | |
570 | 7F1ED62F1A030DA13046FB40C94080BA76C9C7F25AEBFBDF76997DAD76884D80 | |
571 | 854959216CF55D0A4F13E559B9382617523947D1E5BCA59E7CE7BE0EAF7C269F | |
572 | 4887C747072D7C96115B9C1145CAB6BEE769A4CAD44518413FA7BBEA3DA15BBC | |
573 | E07087389695E766B103DDE55D1F8C1D04F9FB3334A36942CB754F89EBF3EFF0 | |
574 | 679DF5BE6C3E6616B77FE1DC41B111A8029140BF783F2F27268E54CBCAABF4BA | |
575 | FD116E27995957C0CC70B58A501847218F77F84AD941E244D1A72A50F537720A | |
576 | 4BFFD96C7FCFE7B4A79A0BC31377D462371E4024166CDFE5186AEDFA642EABF2 | |
577 | 9FD28CC8CC0C57B2C883B10357C5446D501D0803338FA9F50816D17F6FEB077D | |
578 | 5DCCC960972610D8AD90DCED3B00F6FBF110FCA7E929E7D393C508DBE61CC834 | |
579 | EF0AA977EA93C2A3C9CDF7E5C608F838B1B3CB734DD982A1AC623ADB79254851 | |
580 | 474E0E1C2AED4B35A9A18010451F2D7482A9DAC24942F38E8B1AF5D2AD6AA0D1 | |
581 | BEA5DB0D318A434EBE068EA54431DCC06FA6F926172B8E50CF99A61745EE3372 | |
582 | 49520D7C1B343AAF52BF71F3905BB01CC894D8DE06AA256BBA16F57EDC72094C | |
583 | 5AF15066607143AFA5878C3090E58FFCA4723DFC356BE32A4F3CDFB06D012A67 | |
584 | 892C6A003A3882F41F09AB778C8E8E10C1AF7C458194706535EA8D4072A61E70 | |
585 | 9176ED028D863C9E5A0AD6949F439A1FF4FADBF40E5E928CEA8777FC00DDB0D1 | |
586 | E822AEC89BB6B4B336070F0D2BC30AA4AD2A11DBC1F8B9B0549D50949CD3F47C | |
587 | C71FCB5081AF3D9E311A28E18E7FD6289B11D1A39EFF0497D9795B85E260F970 | |
588 | 799696C14BA5D5B9151C72DB327CCE9AC8AF75125DA580A2ABBD51E4F6CB72D9 | |
589 | 9ACDCDBA1CD5C9B03898D71294D500F3FB5CDAD4397430A86D6B3977CA15A2CE | |
590 | 1A87CFE80A49CE46988BEBBD8A7860937AD2DF3DC11005ABB4773ECF0007BD95 | |
591 | BBF8837949DAA8988D6BB30E422E9DAA401D4FFD63015B094F0A457FCF9AAE88 | |
592 | 3F3E024679830D4150E525BCA3498B184EAF19AD2867770F1F03469433077651 | |
593 | 0094B6581D5B0E54EDD40111A97E60E73C0B9330C9CF68A003D9749902BC0ABD | |
594 | 8474348A4869B6FD17F55C705C12C31A028151848C6737F72698D1BE9C7088A6 | |
595 | 29E22CB19BF8E3042249D0C2583101AF3ACC511A810D47A473FBF542EC8209F2 | |
596 | A3D16F24E2DCABAE3CCCF382BA30E258AB884479532DD04A6DA6604DF2B32625 | |
597 | B3CC54C079281BA50EDDA55B30154547E9A8761659AADB488A018AEEAF68F80E | |
598 | 0C7034F74267EB98E471E5BA1A9BEE783C32BE433A46FB39D161210FFB2D862B | |
599 | B62B8EB2B3C4A5C51A5214B96FB4FA1E040BDA70507B5B20071E401C23CFC0D7 | |
600 | 702EEEDFE1CE5419628C804607362866A89FC32212EC9A32400E65ACF2AAF06D | |
601 | 2211C1013BB3178BD882E77D1781AF39374641925FDDCAD306E8C03E28FE4104 | |
602 | 750D9AF95BFA667F3A2992A1DD79560AF95D3B5398CD3BECF601C7A42B9B0D30 | |
603 | 943B26DB414F1661C0EF2A1E8D8191E649AF2A33D3F1A4F340F7CE44B95C923C | |
604 | EE17F390D1A6480F1C10D55EF9B8007BD1FED5ED6123F9998225BE27A8E6E2B3 | |
605 | 5843A30AAC796EEB9C47F143C965AD99DBF3AFDB7B491C465DB02CD8DE18D62F | |
606 | 9E3201C95B045490043DA9DACDF9DAD3E79492DF5B2B33A85B2610A1CF604F98 | |
607 | 913BB447E6FA6834AF454BA5D841B7D8EFD9733FA010ADEF81A2E4C2D6874D8E | |
608 | 80811743BB114A07DC96A66E8520A4054BC1AF6C080147BF8C0B55678194467F | |
609 | 909043328297E38C777DA2104B14C0E7C7F0D6AAFBD5CE82531DA83DAFAB4059 | |
610 | 70DC981AF4E6A75187B499A13D918600D4D68CB073BFEB8F4EC1E48451E10236 | |
611 | ACEDF95B93467357C7028C6BC1AFE878E1988B39DA06C2123727AA6549815BD4 | |
612 | E88BE89E04CD0D9226C8FC0118CB9DE223ED54684A86284D3F6E0192DD8EC04B | |
613 | F1E5ADC9B5001C6A5D57605EAE071648045C256B743E02DDE3729D4A2E82BD0B | |
614 | A448C6153732FBA2B507607517E0E8F4B3A44A4BA58D546C5A446100B9D94033 | |
615 | B68D986182DBE076AA0BF2BA88B85A1EB27A1F4F48C77987A84E9FC3F2BD19CE | |
616 | F0359FB3C2C0E4A1908D209F78C64A1B6C4F6F9DFA036B764F87715B7AB94E4C | |
617 | 153F2640F2BBF27A088F1BD64455648CC448B808F15FF1A1209EBC6C6FAEC16A | |
618 | B2D161F097766B771C80593A0225256080B651B0BC64B5D07A04DC34C767A796 | |
619 | B371F1974633D579A7BBE8F5CF1152AE55F7F0766A316CEBBF79D7C59F11DDFB | |
620 | 6A89E19FF51BFB7DF15FDB6045892B586B6BD1C86C85E01BED07F0E60270B4D9 | |
621 | 2302E6572419FCF662763ED382EAC4FD445BCFC78F62C1CD65F9D12A35EA2D97 | |
622 | 22B818CE6C8CED2C7EEDFABC2F54E043A9DD67645050C2A715093A7EAEAB21DC | |
623 | 99D14DD19FA2A6A268171AA569A86E6F879F4EBDA7A992F2F6F4ABEA25C489F0 | |
624 | E4123EE182BD059A8515708BCA74846920202EE2ABBE9D53DC2CC16BBDAF02C5 | |
625 | BD46600A6E80BD3A477AA960A4A2906651A7338419529F30755BFB064ACF916E | |
626 | 9F4D354C309DBDB3479EC7F9F5EFA0058E10742DB647B0C45EB886A2F997DE9F | |
627 | 534C01676E9EE0CC91DAE378111A7B0359978A43F1CE9EA98AF86FB5C59A894A | |
628 | B418CB112B4BA5BF017A7AC5D2D1F003FB274715A1D35B4BCCE309FDB9EE0DD1 | |
629 | AF8567E3F5002155C6413A31D8970CB1A42A6D6E16B67CB24D1609EF671DBF2F | |
630 | B1085E1505CB05BEF96770B176A19F521D60B2F9AC46A5464A2401E2945F4559 | |
631 | 1D0603255DCA93B1F958381D3DB4A5FED62548BDEE0CBD9977AED1F17A00F19E | |
632 | 1CF565C08EC5B4DE3C108B15615285BDB402A4480EFA1AD102846B3E543EDE5A | |
633 | 5E6F7D37743479426F267415347E4C356B92F7D5D4A0632F333E5CFF2870FE19 | |
634 | 6C398FD66A952EFD26CD6C3BBC23041CD57D0860BC421D710D06E2FEA071080B | |
635 | 56212A069CDDED701398CD9185BEEF08FA0AB16C97C7FE79FE16D6A6B11B7AF1 | |
636 | A8816DEA4F99D2EE29A357913C51D569700D5C84A52ADD60F9E75562567E9AB5 | |
637 | E35A1A1F656D12D0EEBD2AAB9846FAB4F7DE2699CF6D100E973DD0E5373289A9 | |
638 | 570A364A562306BF8501CACA8DB84C63F1EDE6BED1432B138EE201635897586E | |
639 | 912EDC76BACE7047C529617C42582643BACEA3DE8B895B2AE895F77B140C4E15 | |
640 | 69E8ED61B57223B2BBC5C9E5A9A4475A2FB97BCE4DBF40280469FB1C685884ED | |
641 | C5974BE43BEB2A20AC947BEB1CB5CAC0A35E0D7671702AC28BCC4A999E57DA38 | |
642 | 194210379106144B965CDC4F246D0CACA7CD201A72007CE0C5FFCC37EBCF76E9 | |
643 | 45A77F7FCF51C434A9A89A020CA63A27A65972C05887FBE1BBC42B4F4F73957F | |
644 | 7D33819A42CE80975F3034FB97366691F43273B5B93E472B51D792AC8BC7ADD1 | |
645 | 3519A5AD82C8A0087853DBEA22DFAD4B8534D21B8FC56316AE951E53F81EDC7B | |
646 | CADBDEECE84759DA9C23073B64561BA02B8DF0C2459165AF170FB95B316201BE | |
647 | D38F5982A2609E1BD8FBD493573F4E52843A2CD17B30B715DBCD82146AD366A6 | |
648 | DCFF854DEFE6B59491BB56B0632C28D29AA90C76DB5FA0C1F9B128B9B12D53E2 | |
649 | DA7BF86CDBB5E9432751AC5476690DCDA8F8F8CCF639FDBA2DEF0CA00BCB5011 | |
650 | CECD240F45B271B6015EB7B7654CFB5DA4A2E8F320FB1E9234B98626D9D8D8F4 | |
651 | 057FDFAD9811182BD620CFF4DE2864AE715AFAD34840D128A30AFD1307FBFB6C | |
652 | 876DDE39C2796C1718ED8A2DA7D9EB4D4341DF3F534419618FE709DF8BABAF3F | |
653 | 3FE8288D735493B788668B75845CCBAC3F8C00CFE5E1552DC7107782512C509C | |
654 | A20C301A0DB7BCC34CB41D75A104E27B6059B0C3A6C504DF208CC3BF011D04F1 | |
655 | 2AE2716010DDF5AE6133701AC7058B43118C84B41CCC0DC299B6606912276854 | |
656 | 4B83958032CB8EBA71753D1BEBED53D2EEA20CF31FBC5072B2EAB23AEBE5248A | |
657 | FA27968481E19EB28B98414B7D31C7F26BB1924B291C366EBB48C571B3A7926F | |
658 | 749B80FA339E44259F0119A5BD8B57E08DA3D0742043E5BC1C19A346B4895AC1 | |
659 | 3A04F9343956FF300493843F4E4B099F729BD3FD908A6DBBCFFA5ED0215A0BE3 | |
660 | 35ABF720CF166B5BCDD246BF0FDCBE949150BEF341C9E69E05FCC71E0C3E16ED | |
661 | 4CF58BA615D931F318A071CDDC95EE4F7C5115AEA57B7858628F8E13DE33E771 | |
662 | 1F57861F42DB53EBBC4332DD5D3F96098E01BD1D66EB13144C2CE6A0558279EA | |
663 | 51742CD7208D1C1E65A283D1CA73556856863CD47D78D1FC79CCE077BC2E5D14 | |
664 | F10606DA0FEBF17CF8401A6CA37CFFD262A87432223A80BB1ABADED4261D46EC | |
665 | A83D208F90699DE6C9A389BB96F6C3F4E02777D308C2E3F508A14E21B1446E2A | |
666 | 33BD47CA44355E7E128C73B9B3CCF46F50760248270603260C40BD9FCA63C01A | |
667 | F3270E80DC263E0B5BEEADFB0AD0EA48ACE0023AA6EBD736AAD1E999C492C674 | |
668 | 167E3746D71B4F58E6CD01B59C73A1E3AC18CEF0891FE511EAC8444133133AB4 | |
669 | DC7CB359F92E7C53DE1E022B448E7E4E566D4FBD0096F4583EDC6756797D8635 | |
670 | 523B99ABBA63EAA2F25F1AB5F7C687D41B933897E1F8B27A6952E46381EF63BF | |
671 | FBA20918503CE2EC45C1A17E29CB5E462DFB547958356E2FF656C3A7C600F28A | |
672 | 888A1B5DEE4D72CE606CD61AAC7E426BAC6119584F552F04B3D7EC96ED1EF048 | |
673 | 0FFC3B36569070BF4FCD2E46B3792E3A365D695CBB7E4826B4C83B1BFA88FDD2 | |
674 | 133A119122B249CACAA06EDF17D451B21136D01E343A78F365A0116510CB5C2B | |
675 | E947F1ECF2A62A32330D778525EA0D577B8F84FF34C27E30FC3C650697B96139 | |
676 | C54204EA3DBFD74E6C42281A27C121F757FECCE281DB11740E3A56F380C79471 | |
677 | 294ACA3D94D03F62AC700C4B9E53C55AA423C5E0E7581192DF9CBBE60753DD4D | |
678 | 181FBE50213D9D0705DA4CECF039B959308EDBFE219BE4E0541D30175E448717 | |
679 | 8496143152423969B755D9CDA8B1329836CC618BC0994B93DD83578BA6FDBD21 | |
680 | AF4923DC8E1075B8BEF515738F2E681DB3D6E9AF5F7AA7BA32FEA6C6C10DA83B | |
681 | E1E01A0359A25C564AA1739D56FB040C56018CA5E8F69EDDD735BCE0EAF3EFCF | |
682 | 7E9E6696C48AE1FA14D4CEBAA680170D300027C1329DFC81CB6C2349EE9789C0 | |
683 | D15F7F2E1490447870E09FD26D40F18E5DE32E945996FDA4E8A9F77995C9AEEF | |
684 | 24E82B7F26D107251EFEFD92A62FDC3E46E357EABF76D4B7D3543F02A33941C3 | |
685 | 0EA0A9E1691533C2E2EF79E02E0C4579794418496499C47C1E01C03D30616371 | |
686 | B14C9850A0FF427FAD4F21FC84777EBB8B0CA14F7526C37779D1ED6ED2526E29 | |
687 | 1072467F0AC8079F509C634445322A859FF846F437D6455A0AC702D59B0F932F | |
688 | 0EF41B329F42F83566FBA693B87C45E95D743F6523DE11DFA2CF7144CC329060 | |
689 | BE3C24F17A584998B4EFA6E48CB65ADC840D6554793A9647E3BFEA0B865832D0 | |
690 | 9657A13D20641ADE20DDAC86D26583F5DA14101DA5C971CB385FAB7F4848CB1D | |
691 | 8800CC239CB3A9E79FD1CCB5A667DE7184EF65A459FFCE472240A803D0ADB5C5 | |
692 | 7FD08B11C77EE7BB13B787DF3E01B99D57D101D8B209B6F7A274299E1EC57BDE | |
693 | 0D385104C7C0D5F0F835EADB865073C334B74BFD2F5F34705E07334855658D49 | |
694 | 4A1FDE32645FA4DE91CDA7B17B941D0B23F104BB3377E983099AB3B61F794956 | |
695 | F4854DF574FDA0B4C356C90ACBA0963F98390FA630BFEE1E2D9F995FC82BCD6F | |
696 | 8C658B842D9574AF472082B60E52CC67070DA5AB29A7C973C9399749018CB904 | |
697 | 88A6FA21224F8DE7EF9F8069B12CC04622CBB7A0C55BA8AEA0523C6D4A64B089 | |
698 | 27E52BBA3B44E98569DBB50ECE9C48B2DDBE9502680E5B618A30C4B95DBEBC91 | |
699 | 9BA2355A940F6304770E70DED7453EC77B3C9C732C9DB9567E4193FB23C89592 | |
700 | 7BB60137EDFC52DF7B06F1262DA52F926E48CD5A750F71FDFC573EB8462845A0 | |
701 | 4EA8E0DAAC302A0EF2A156444F8703D5702EB6C9B58DC70F7F154C0F22A6B53F | |
702 | 573FBE610D2A2DA232B21DC38D37D56D147670ECCA5DD005B990257691E5548F | |
703 | 4095517F9FDB1EA0670BB3C325092635CD1207F565B27A6F901AD91484855A71 | |
704 | A8683156ACB1A795255E8EB09D32F598E9475C97BA191469642FC49C81EE721F | |
705 | 77B6363572A188885DBD798057AFF88DDF08724DF475B00BB73F681D975E9CF1 | |
706 | 1BFC142990DD34F2E1726FCC8D9F10BD9FDFA8A7BC92212709F00855B547E630 | |
707 | C26BE4D5488927E8992AD160D8B55FC68C0F1D6A54C0679D275E58A3CAE51977 | |
708 | B8048A8C2455D58F200DE978859A7D1FC44304C7EA735EFE591E28EC3DD083A9 | |
709 | 9E53D4EA808E10F4B9F3866643E2A0D1CC177FDB0F2CEC6C3DF9B1A92A6ACFAC | |
710 | 08BE08436F708C3D13DB49DF09EEB57866CDD598B663F10AB42CD229E6325317 | |
711 | F55716A44C75E7CD8D2B292DF39DE5040DB9F3563CFD2C186065730A0712D446 | |
712 | 501BAED4FD53A9D8F521624E270FA7F932294726E4B84A3FBB7659AD1C5A9240 | |
713 | DAFC17654ECCDC38A9FAF28F301F10E5923F33DDB0B9AE116143218BB22BC3CE | |
714 | 402633B164D6E4E3B3788216DE8E9B38677C71AEF5DD109C63641AA99C2B2DCA | |
715 | EB99606BC079F386CE077B9647CF93B400D50D11162AABEB08F42A19C52F9D68 | |
716 | 80FF02F006874D2AA3F41BA095DECE25CB7E021C91D25EFC992390C1ACB76357 | |
717 | 9225F06096DDD549FB855CD9F8FDEEFD1375D702E2E806760529475ABA67EE50 | |
718 | B70FC8860FBBAD5745459DCB1B8AB9F1EAA5084080C2FF89141FF10B459DFB93 | |
719 | 2C35A171AE9219ED5FE507CE7E3813C94F346E924792B1130E9355628980A18C | |
720 | 6F808F28C396EC813617EBFF922F73BBC8651438A1614C9F24043D110A589B89 | |
721 | 3FFB6F4E99C0AB4EA4E50A6284644137F093D527AB9490A7EBF6140D9DC1FB98 | |
722 | 5090CA16E9F08BE79B49912963719B3B35A442FCA493EE5198F9916F8655005A | |
723 | 9EE372FC4404CB4168F82F810A58371ACF7AFD46CA46F2F94B194429255A9BC9 | |
724 | 4185CEC1C929945451968B0817842B3BAA28A1CE1E10B6CCC328E0487CFE90BC | |
725 | 3BD9EECF5F8FF1C99C8805A4970CD486F4DC9BAB0129E86B1F67F08070F04A46 | |
726 | B0910BA9E173FD4DCB568B08BBECFCF6695414662DE690BF32A90237C8B0E72C | |
727 | 206D09A580DC92A135179A5E3F1E611A3B05DBB05E4A8D51BA3D0A165D3C40A6 | |
728 | AE013DEBDF26FA757F6CBC881BE672BB467C1920C067A0B2A49A532A391A8E87 | |
729 | F2C6E50D247AB108A1740D4D82F955A91D49E95259A3DF9715F34CB45ED5DC9A | |
730 | 77631A4A1553EDB8D4ABD93869FF52D3CF0017CF887B408C02E8509DFCECDD27 | |
731 | A295ECFE0332BDA5678C4393ADDD5D171B5FBD360CCA5810F79F5F879939DAE7 | |
732 | 892D53FF5F505CC0501BD40590420A291BFE8E67F09AB7A3E0665F6AA8FD04F9 | |
733 | 67C4B0084C48F9DE8F7E0785F3261844E45C9F5D4A45855BC5B7E00CBB865B31 | |
734 | 2BDBC1B1292DC374B6190D12246DB97BCF04F679DE3605E532451B3E9D7F5997 | |
735 | E1F353BD1E35CB11C850C9CD5ECBC40C9685DCEAAD279E315FCF85855D6B40C5 | |
736 | D0FEE8692D4108B04338A70A50BC6E2C04F4472E294A182B88C9021AD8C0ADA8 | |
737 | 0C7A752F764548A51DFECA58D6E39AB4F78BE0A83DF6D60D25CB0F328D8FFD49 | |
738 | 16427FFF198D1FC3F574B3271688A31DA28952EF065C884BC0FFEB547360A372 | |
739 | 7C39E5F2FC458831B9C42128CA69A8198FA0545CFB207856D6BA97E113FF7E26 | |
740 | DC46395E649205C83DC7565F4130CD6BDD44ED8D4D383D0F37B34C6F2DC98CC7 | |
741 | 4F96BA2722C996879329A4B27089F0A68FD6355D26946039F25D013AAD2F22FF | |
742 | 12FD7F617282C6F005A6EB12554C47FEE2A5B1D0FC7C595B9DAF268084C91B37 | |
743 | 5FE0ED62A934EB511362D1F14BCAC4950EBFBB2A3D1F45C1E34498871CB4C346 | |
744 | 54B7349577D54D26385D784C5E3C2D869A7336159724FAE151FAEB10E231F3C3 | |
745 | A17B959192186081556463C3F5EE6FFDB06E82B8B9BD08C0443D8CD84BD6EA7B | |
746 | 1C2BDB46327CA21FCF002B3E8EF4DECE86077AFE6BB5A941B9E068CA023D54C2 | |
747 | 8E91E503F48B0B4B96ABB07F084C2EADE9B2F41415EB312B9EE0612E69F51177 | |
748 | 654AD20A2D93D457E2FC3C66C3705F9B48A947329BE59DC7B871C055C590FFC3 | |
749 | F6B5FD8212255D25EB7787E637D5CCAE0E1EA386BF0B911F414BA45E30F36CCD | |
750 | 6F5A17D0A887B5BEC58B8E8D228E12C9568F820A7F820B6C9B6631EA8C2340EB | |
751 | 377CEB0A490166FC33AE1F38D3629C090606D3E8AE8662A98D6C63793B1077CF | |
752 | 092624F46AE4548DB4B22FB602C39EA2E74B5A26DCCCD210E043D508849703E1 | |
753 | 451C8A9061514DC7312755EF16C2165DC1DDE554A29C8AB6F9ABC9A5127041F9 | |
754 | FC22CD3BF15A4A23DFC8FD5661DCDB1E1E1EA65E77DE4A8D60A2E564F467F071 | |
755 | 5C8EB4509C3F9A97D0371EBBD4584430AC8EF155084B63B9848FD4CE2B5C6DB2 | |
756 | C3A1946B4BEFA7B088587F912D20F0A2E15A580584441A4742312DD4B34503FD | |
757 | 338BFA7BFEB94379353CE264541D33433C4E996BECF418A2E3295B9961FBDF28 | |
758 | 77EB608CC870B97D9EB43FC3AF2DBAFEF337BE2F108DDFBFA090190158A244F0 | |
759 | 8A757A95FF8E25B6FBCE09A1DD6FC5C8897456E12AE7A9AAAF0E42FC632D35AD | |
760 | EA2C00D7C61E047CB071163F05FB5ADAE82D0E177BB7E6C9492C2FC9F511F75C | |
761 | 0FCBF74F06E057F6B66D3F72873559C5C983DA7D7E75EEF7B783EA44E4AEDAFB | |
762 | 2FD8C3779D38EFEFEE5BD565C3A73D307D81EC6C45C2F02B7B342DFBE2356484 | |
763 | BE59EF6527E956D8E1C48C80395F34CF4AE1B8B5C2A06072DE5C59255ABA30B4 | |
764 | 3B5039CE2524141C0BA73CF79209B0B5AF17C59BA0EAB437802A22A2E2D6407C | |
765 | C861A71EA547220134412109DFA1F6D78BB0C34F6FD36003850FD3D9EDF39741 | |
766 | 2EBB9AA349BB5801C9FCFBAB69E1D3BD5F4752663E616A8E1FE486545F3F1BA3 | |
767 | 8F8A11E4C13B2CF97A497C2333A22C696B499647DD7439D3D7B636FBEED2D32C | |
768 | 86FF745763413B53E064B16E5BF157C9DF7313FB9D46C752B52E963BFAFCB392 | |
769 | 531F4E46194A3BE24E2F51EC9BD57FD5E82668E2AA9D72DFDF7F4500C1B81526 | |
770 | C09DEF71CA6D3A3A7ABB1BEF21E99DDDB82D307BAE2B6FB28FEFA5160E18304D | |
771 | 25B1665A7375FFACA6C843A0E8BCBBF59FBE24068A79ED68A6F45AEB7201BB6F | |
772 | 06EF67DD19243E68DB34025209E851DE3AB65D10E108316E733DFD25B0F8CC8C | |
773 | 056740761BCF195AA6E1C2857BDE85983408D400A96EDB887889F7CCFF403606 | |
774 | F9C01F7CA76C9CEFFFC9AB7D3ADCA36A0269283F5A65594ED68F43DC1BFC6117 | |
775 | 1D113760B0F469C34CF089EAEC99C5F7448BF6285DB05D35CE182CD80491D88E | |
776 | 3CF21FDB249EC96516EA42BA9A716283C7C60A1D9E7EB9E217B2B4EE5F316110 | |
777 | 2DECF4D895423D64B87B776883FA49225B6061E820C9425129736754184CDEC0 | |
778 | 67B63E5D07A455BE0B9AE382FC997195AE0AC4C07FB761EA5002C3943008F7A4 | |
779 | BC04588165242A9F4C31E811EBF1E145C2D102D1D7C9331EE6660E054E74CD7D | |
780 | 8FA19BEBD2F89BDEA0DD0B54B0E1B5EBE3E9CB1E5A1F477CCAE0955BFE9950E0 | |
781 | 01211AC8F3430F958A4DFC6E74502D9E2EDF5E2CE261DE00D8DA75BCDB83293A | |
782 | 0802B7D5F14BE14380DC1013877AE4624853F3FA041F944D19185862A8DCE73F | |
783 | 5F0181BD84C3E65AD11B2F0A2FE36B1803084E82274CF4BE3B0151D309C3F104 | |
784 | 771C6DC985D7DDDC77BA40D844173A9486B539DCE051DC82FF6D6831F99B9891 | |
785 | 48D6B027B8B6B6279E6CEC7D0606DAAB1A86F2309F1A4842A1DFDD5116FBFEA5 | |
786 | 0AB6C354CB65782464770B72B39DDBA2565CDE941D68ED928151E23675B541EF | |
787 | 33B070ACC0ED70A3A18D0833CE7A90C911840E06577872FD4C3A67E7C195F73C | |
788 | 2418EF0889AB1AEA93269CB1B98CEF136DD38DDEEC2450F7C5FAA9775973E178 | |
789 | 1182455E0321C4DF13B1EC1466D8F5BBBFC38A2A054B57FED2E429ADD7CD3EB3 | |
790 | 425F266AD5F0B37576EF54143D42D675E895EF20F54E1CAFE0F2A2D2075B28FB | |
791 | EC034601A147177976623733D6FC00CBE2DDB1E9DC5DD9E7D12AF9E589843FD3 | |
792 | 607AFD7DCC3AC648862C559B98790640A78E112B757B15FA513A76E1C3AC4074 | |
793 | DD520E94998D5DB08C1D3E822FEC4ECBFD1E398B480AE01690B14BF92948135B | |
794 | 4C042F70CDF3B988BD02CD54CDCACF912AF09C0C59CF23F84094E5C976E6392D | |
795 | D7D5ABC68E9EE23C080B564096A30F67241987999244686137175D8570DE9AE4 | |
796 | 57EF670B5576BBC1C0AD4E26D7817B202674F70CA62A5EEB882C2ED1C6272C00 | |
797 | 5598595DF2AC7F82FD1C9606183157EAE7575B07828BC2C0B2D171F86BF3900E | |
798 | 43FFD4F6463FB5C6A1201D26A8B58677F7CB00C5CBDE1FABE2641CC2172775C6 | |
799 | 3F9FB0496CE71E179D70333A628091B47A3100A5B4CE624EC9CE5E4D740CE3E0 | |
800 | 0F03450F95138A0437BD3A7C4F6FAFD1B8B2A0EE07FDF76E427A8ADEE7CBED56 | |
801 | B57F9522F8CBDC3236224E6E3FADB549018E757E090E1CEEE91C45C032CF1F25 | |
802 | 67FE17978B998DEE1635236EAAE953623BE263D2C444327E91C4EF9740B768F8 | |
803 | 70A6CFEC3511252D7432C96E5B11B7AA80BF620B63B82AA4777823F7D0266A75 | |
804 | 6DDBBC79CB7EF862FC8AA67C07B87C40EAFC0C81C122AC0348F7702E95760F93 | |
805 | 33508D7852E4A494F5C6CCEB7CF67F1AFD391977AE0D85397BC85BA02C0C02ED | |
806 | 51C9489230B568BDBB8485087350E140611053373E46EDE979AF4C1D1047925E | |
807 | 9F67E9708D11BC71659DD61D3166B156670D67046AC2EBA08A25FCF2B84E7BB9 | |
808 | 56FAA25B67004C1D6DF8D12D4E9F1E3793CC1667EA7DFD6D67243DCFAB276AC4 | |
809 | DA755EC98D63C11D5D10E59D74A4CF627F699F1A018B2AD652584A810B2DC519 | |
810 | 549B2CE246622CB20DB69F25399315A33B244BE0C05FEBAE53D00E4E266DEEDB | |
811 | D1912D49E6699105767FE996B0CE64AF777E5D559D36BB141456339447216362 | |
812 | 59721641A762F6F6A54CEB3D0D2D3F75927E362D6A6A99CA6A8BF739681A60C3 | |
813 | 232E952935AE9B34DD4FD3D15385F5A30B045F3670D517BFB924BCAB0371F3D3 | |
814 | CE9C5161D8C634BCCCD3134F8AE366D3D7B2C7B32EA89FD61231E30DD3DC1BD7 | |
815 | FD295D5E49051F6C35DD7AEF31CA904FC20F36F19E0B9B838750868D69A752BC | |
816 | 64398CF36B006D8313D0A349C9D93AF56F0E01274D9AB369309B9F4E4BD0B8F9 | |
817 | C6B3C66F38C3027CD1AF8802BC82904F3A619F89D5CA5BB78150A8D39B9A92A8 | |
818 | 9B5F5BD2674CBA06F7819C0C9261EA9671810A804C1C14CD6A1D7116F9491BBE | |
819 | 269653566173D334F26E76CB8AC3C345D47220D777449AC0E82B435A2817AF7A | |
820 | 711A664519CFC16804C966D8AC088DA2AAAAC79AE21E7B538F3554B65CF29AC1 | |
821 | 57B646E6BA127A7A0B169EC680ECF5C230CAA91A9ED6AB2A54B8EB7E8C94DA78 | |
822 | 67C22B180ED661264EB2004EEDF1923FC5EE30E0A6F87DDC414B7507887F8411 | |
823 | 9B999F25ECBDCF8FC3D9AF99AB8AC08736091CA28D78E77354F3205CD56F9221 | |
824 | B6CB6D81A34E3C954F73BB23BC73D4E4E6B961EB4589E5C2E21E426D78E71958 | |
825 | 3782FAA65DC184CB4944FCBAD6ED0A882F8767E2E8A8CF272683BBCA8A4657FF | |
826 | 8E856DB3188939D424341DD0D9B8074461D8F15FBFCFA7AD63C81C4F51396640 | |
827 | 9FF1B14685624376BD753D186F75C695CFF5BF63EC9B20D2CE365BD0A4822069 | |
828 | 686C8737732EA874127D96CE11F889A71071771D8356A5BCE475F98D79C8CA22 | |
829 | E98F5175D0016913B0C927616AEC836578F02024E3D4FAE49F428F68A026C592 | |
830 | 37870C5DE3A1833AE1C24D461FEA | |
37c41ab1 CR |
831 | 0000000000000000000000000000000000000000000000000000000000000000 |
832 | 0000000000000000000000000000000000000000000000000000000000000000 | |
833 | 0000000000000000000000000000000000000000000000000000000000000000 | |
834 | 0000000000000000000000000000000000000000000000000000000000000000 | |
835 | 0000000000000000000000000000000000000000000000000000000000000000 | |
836 | 0000000000000000000000000000000000000000000000000000000000000000 | |
837 | 0000000000000000000000000000000000000000000000000000000000000000 | |
838 | 0000000000000000000000000000000000000000000000000000000000000000 | |
839 | cleartomark | |
45c0f7f8 | 840 | {restore}if |
37c41ab1 | 841 | %%EndFont |
c302751c | 842 | %%BeginFont: CMMI9 |
45c0f7f8 CR |
843 | %!PS-AdobeFont-1.0: CMMI9 003.002 |
844 | %%Title: CMMI9 | |
845 | %Version: 003.002 | |
846 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
847 | %%Creator: David M. Jones | |
848 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
849 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI9. | |
850 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
851 | % This license is in the accompanying file OFL.txt, and is also | |
852 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
853 | %%EndComments | |
854 | FontDirectory/CMMI9 known{/CMMI9 findfont dup/UniqueID known{dup | |
855 | /UniqueID get 5087384 eq exch/FontType get 1 eq and}{pop false}ifelse | |
856 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 857 | 11 dict begin |
45c0f7f8 CR |
858 | /FontType 1 def |
859 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
860 | /FontName /CMMI9 def | |
861 | /FontBBox {-29 -250 1075 750 }readonly def | |
862 | /UniqueID 5087384 def | |
863 | /PaintType 0 def | |
864 | /FontInfo 10 dict dup begin | |
865 | /version (003.002) readonly def | |
866 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI9.) readonly def | |
c302751c | 867 | /FullName (CMMI9) readonly def |
37c41ab1 CR |
868 | /FamilyName (Computer Modern) readonly def |
869 | /Weight (Medium) readonly def | |
870 | /ItalicAngle -14.04 def | |
871 | /isFixedPitch false def | |
45c0f7f8 CR |
872 | /UnderlinePosition -100 def |
873 | /UnderlineThickness 50 def | |
874 | /ascent 750 def | |
37c41ab1 | 875 | end readonly def |
37c41ab1 CR |
876 | /Encoding 256 array |
877 | 0 1 255 {1 index exch /.notdef put} for | |
c302751c | 878 | dup 58 /period put |
37c41ab1 | 879 | readonly def |
37c41ab1 CR |
880 | currentdict end |
881 | currentfile eexec | |
45c0f7f8 CR |
882 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
883 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
884 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
885 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
886 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
887 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
888 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBD07FC5A8862A8DB | |
889 | 7E2B90C16137614CDAFB584A32E50C0935109679E31306B8BDD29F1756946A67 | |
890 | 7A7C2D9BA6FAB9B20A424AA0E6F4BA64C2801C2FB5A1156CBEED0ACB95F697B8 | |
891 | BC2A6E6AA7EB1F9FD8E3C9B1A16697EE1F0E7400421A7765AB218FC837A49365 | |
892 | 82DC6B2C877A7DA84A81E6126EE96DB25C17A207D3020A045DCDAA064360DFFC | |
893 | E3CD50E21ED239D2A6450D04F879A26443ADEB6A20ACC504989876476C7D1A74 | |
894 | 91564FEA1F4CC2C8C8FDF666DB537F315AE1886C73CB5B00E67E7B398A6C018E | |
895 | 540EAEE98BB8136C4F044EDD63C33431D2CF9740F051DF365A4045D9D8782112 | |
896 | 7BB5D494D9235BA98CF2F30CB119F5A904C32AD04C960C43FC1F5FD8DA7D90D8 | |
897 | 93AFB59F3FF4F796481AE2A7548F948FECFC6C127C4D3F159B08F206AE8C296D | |
898 | EE470DB2F879EA79475E029D22D7A8535C09A18689DB0609CC233E5199C02756 | |
899 | 972CC9C94D9FCE264DEE5D75C8D651E4E2D1189AD9588CB815722BB5EE3C379A | |
900 | 6F31C2E6AE1AE4CCEB29766190AFA20EA937114978752189F1A9F42B39483149 | |
901 | 796FCFA123BA9CCD1D9BE28289660BCAE16C40B5B504058D55CFCBFB4F4E3D94 | |
902 | DDBF39F157E63946534DA81C018B1C01B9F10DDB55E0A5C2B3985ED1977C039B | |
903 | D6755EA42CD09E27751E159C30B93F376DBE61CD3AED34BA36A768F232EB3B80 | |
904 | E3E6B77C4A48D408217818E398B83D995AB6BC871F20991DF57313D6EB0C793D | |
905 | 0F28088EBDB7F38DAF7E01AAB3476EC24D7BB38A9889A7D3038D930FF4289B83 | |
906 | F54A7BE1E2D98A3822098D2E4D067A0D400C20C0B2B4BBD74C13ED1B827490F9 | |
907 | ECF48F8C3994C1C5AAC9CF783BFA4F307528F51EAB55F961808A42ED53F00C97 | |
908 | 72A432EAEDCFCFB622389BDA707B6ACC9433B065CF29EBFE93AD14B8ECD5F47F | |
909 | F073F11822C49B8BE924CDFA6348C3A75E9BB9BF3F31C41716B34794B28CDAC9 | |
910 | 4DB8B087E180A9B3B17680F73D9C12C8D86A922C948093629F5D7F542ED882A1 | |
911 | 692F4F6696865E53E3E2DD43B2D5E8C989CFAA5CA5C4C5999045E170BDE9921C | |
912 | BACD6F2863F5553EAB2BA2D4A9034729EC0C4201DE90DA89B0A27C5A5C974109 | |
913 | 4E37BFB3F46B3A506169FB0C68E1CAFC844419A8D261A1FD86A3BB78E33D5FB1 | |
914 | CFC687A5975987CE45155E5FDFAF0CC5FD5568CB1C26212F92E88255F0549F59 | |
915 | 41B33125946DE43436BEC00804063FBF03EC796E3361B1C852EC3038D107F80A | |
916 | 9198968265D5488B26D7670B22C2D75EDFFD1B7B4AAFA36DFD94640C9D0E2D20 | |
917 | 5BCA18683EFB91834A3939AB8EB60E2F09655BE003582634C52770DA9668C292 | |
918 | 2E02929D812EE2B0CC65F020064AD5BDAC5F5693B30508F40ED8E20E87149BD5 | |
919 | 8DD41AFF83FD1944804017DC5A04512E593549FFFAE501131CE2FDB65EFD0B8B | |
920 | 33809CBAEE411B3941C241550B9C30DD28088708F1C0CC3125CBEDCD985EAD28 | |
921 | 03313741F67DB5744A87B381147D5BA70AE1145C27F794854628D87D6C1ECCA1 | |
922 | 749E3465B950175D3C3F40E344297BD92D3190041A4392033A79BEAEAABB8DBE | |
923 | CC14E39612F43721CFAE6F79074429221CA588AA2501DE520A464DE157A03AFE | |
924 | 3C082FAE7628FC0C57FFC61D0330AE6332D20FDBB09BF36848FE05E782D6379F | |
925 | 64F9C82C45402481B0A35989027F9756BF5A79DA2D96E10F39167ADB4305578F | |
926 | 90B509B6891338FA1D67DCFD61804AA6621526B2EE4769589A2646581712AC05 | |
927 | DA6E98D16494F07D612743058F54FEE516BD89A8EC3E03F9D7F905175D3412C8 | |
928 | F7329077FD6EB25213F3CAC94BA0C3363B759401B6EF7548C7D709F3241D030D | |
929 | 4EB46A1AE81863C412BDDAEA6084C37143A4C5E41BC646315B1CD09F934186CF | |
930 | 49D1D8239E363A435307030BD79536B50B723A39DD763DB539F24A10DDA12BD4 | |
931 | E467339D2D6DB177D6FC539FA77D2DE4118EBAC161E928749F7C753ADEF86117 | |
932 | 58619F1155C563DF2E11ACA8347908B98113AED58FCD0394150EEC94B7F986EE | |
933 | 88BF7171D208D8F1774B1DD478F0C2958AE372D257E7EDF0F6B5D6059CC4D5D3 | |
934 | B00FCBD2E9CBE79235B9A5A3E943CC27AABB58728C95C7DBD4F4A1F8A4DA99AE | |
935 | 7377B0CC0BFBD454794398AE0D5F7281771FFE87B25A819F36E692286A42D776 | |
936 | 01794A43CA9BB30FB8FFDAAF014F909A369E34C2F6C75B7D4EB9DB0580E33F46 | |
937 | 19654443AFF8384B95600B86FF8E41FEFD032355626D60C7507C058EF832DF41 | |
938 | 194B48A36F11082D1DCF4723E21401E0C7447AABFAB4639B26E3D2730E348F55 | |
939 | 53EBFF39CDD03E06E2FA5FB379603C879EDB7E1A10F89695C9C47DEEE52BE0A3 | |
940 | F446F187AB9D7E93E6F9387F21129034F36DF40605D28FD526AF82CA9D232BE4 | |
941 | 412567F06B38ECCD496EF40A7B243E46C9FEBA4F1BF4B1ECA029C5EC239353D6 | |
942 | C0B100BF7E7DB33BD1277DE104F15AA19F37340A777741AD1AD693BC76DA48CC | |
943 | C6F83CD84591ECFEE375979972B0FAC4C10B625E4BFB261B9FFFA83C31DA0108 | |
944 | 4FFB6377466E9739E0EB64424BD9FC7239C7DD834EC6788A0F97FE714AF92831 | |
945 | E1BA36A8A9E24739F1DC82DC26CC3CE28C210AA7C569B19E1784D663A0CA4E81 | |
946 | AFF43E86D6F5F63778847700072CEB77A4EB946DC1F23DBC00BCE773203F76DF | |
947 | 00F0B085F31420672974DDC642D885E95BA6BBE43E1CA8ABF464D9881CDECC7A | |
948 | E98E31B9754C9B72A8BD5CF6D4D214DBC3BA7A0CDF6635953F5AC1E7639C4A91 | |
949 | C7AECE4C75CA3389C348F656FC2CC96C84C85A926237B6504DB51937C9CFCDAC | |
950 | B75C31ED570D180757884E27757783DB2D5F35ECC48C496CDA342D49AA947BF8 | |
951 | 2FDAD2F19DFE8CD1C76A8FA08F33681F3E12E229D7DAB45BE3A3F258B5ED4980 | |
952 | F15340CF20D965252843E026803E8AEE736EC41CCA82167401977AB719AA2F50 | |
953 | 0B791EEAA82027B3C712D2EB9D14BF8F94FBDE2227609BCAC41EC08DE2BAC023 | |
954 | 28352F913F7DF08D4E1C66E83F764578B22B4EB7191E852B91ADCCB1BCFDB1F4 | |
955 | E63DFD152E86FA9DE9BC8908130EFDE29CC4401339C05B5B9764CF8EFF14951A | |
956 | C6C13AF979546996BF22F2B96D3D585B90CD27DADEC78914DA48432C6ACBDD42 | |
957 | 20EF583FD41F2F6D6D10C3DF7DD077304B5940BB0462656E306CBD91EB9B756B | |
958 | 7014B1884A36201EC582FC9345C386043DD2818FC301EF78791C1D7854F8FACE | |
959 | 5DE9801DE9F59D5B4271E003AB897B2EF49501589D681D59CFFD9B03F722EEF4 | |
960 | 74ABD29997515DA3591496B62666744EA76DCA45504F8075C0652D6779DBEAE4 | |
961 | 90430C2945FBD60AD53B51DDBEFC7ED703C418B4B244C8FFA5A3C1B7600C5A55 | |
962 | 3EBDB93C16AC191C3A28EB2279BD3F0D67C826BC6A73D3C0AD02262368AB4621 | |
963 | 98A1605F2887BC5880E1AF2780330E0FD01D7CAACBB0F008A42C427F38236066 | |
964 | 54799594E515B289044BAC4DADF8B3686B4372C5110201221FDA923F131E07E7 | |
965 | 93C44BAD406838BA4D1C277EF74098B8C0EDC41EEDD58C195D7DFF5FEDBF96FC | |
966 | 19CEBC6C3006DD2CBF76916B4298BB915663C2F61AFD7747E03A03BD7280197A | |
967 | 9DA590E3D081C6F53DBF94E8D6FDDDD910A70AB18A0F6D48A590FFAB314D6CFD | |
968 | E3FB20C1F3C91063F00726A2C13A3D48323F9854839405E5A29D66A43E6E2B84 | |
969 | A8B3765F1D817071D4D6FF42BC785C2D11AB2B9452F141696CE19C6AFB9777DB | |
970 | 107D6E22D8CC6C26440BC48248AD8805C4329D46BF433741CB519B21663392DA | |
971 | 5DC7FC9BF37E5BC396BFADD7263D09F6B4D69594AB386B7BDFCF3BACB97A0E08 | |
972 | 22013E716E642592A20136CF9CFD61D4E515D80E06A4CB4FC9D9B916C93CEA95 | |
973 | B83B98C48CF36C1D02291D4F5C0419338D64E33C90C90EDD2BA3B96D70FAFE0D | |
974 | 403A060CFF448D3E28A9B1E3916018465E86095BAAB4706CF7ED350D7C554789 | |
975 | D7F4FE5F180767DE8739259E68CF142040BE1E2E8C6152DE3417C1FAEA7584B6 | |
976 | 20781DC4A9796431EE713DAC4E713C839D7A4FDC8AB6BFEFFE767AFD8B67FDA6 | |
977 | 943AD387E5D3BCB09039ADB64ECC2BE2620C6EC269E708DD06C311F450099E33 | |
978 | AF46AEC644222E7DC4DBB9371EE12CFBC4F9B27AB46AD1DA96CE006E1DF8291F | |
979 | A550A93026CBFFC1087B134EC6EA76F5E109CDA58FF47338A0039A786A575F70 | |
980 | B8A03A4F9C8D07A4C856C77D9BCC8E3EAA740172D0C2D0A15BA35C9E5717D7FA | |
981 | 2691774DDE730BB9D7C70D7AE103DB8D35F3728470C76EBA0E670634E1A0BA84 | |
982 | 2FA102BAD7271DF2680D86A4CA6FC353869987700E5E3FD778165456033D624F | |
983 | E9B3E80EBF431ACC934AA0357E824B8AD73E222B510DE8445C55C07C8E5DE46D | |
984 | E478F832BDDECAF2EBB11941DCF84CCD887043FAED9AA90D12BC8CA9A0C8D94F | |
985 | 8D3BF1F80B14B6CAE6BB1C6AA405AA64BB94D5A82CFEA548BA070796A02F9642 | |
986 | 87326D066101435AB9EB40BA9EA9E61B363F5F5E3B924369796E8B78DE3414A4 | |
987 | 2B79C6A13ECB2F34E6299658D07D2B3DEF3D4383CE009A927F0EF5C196652842 | |
988 | D96B857AB5E905201E7E8BA21A5EBED1FC6863BA9A1A6E5390407F75055E2EEC | |
989 | 512FBDB3E82CEA13663F1A1944DA072C765D8CED06AB461470C5723BDC1271D4 | |
990 | 4D1D049D3EB131743F1EC9A6ADDAA038ACA2C41D139DC6A84EC3C61AC7F1E559 | |
991 | 6155CC2F49171F6E07CF56D721D9728E87FC7DCBCAC46455A3694C765FE807E9 | |
992 | 9CBC2D304AF37E0F28CCB22F239541B53A4D24D09C662559267467EA487BD33A | |
993 | 0BEFD4899B581D20582930703A868655C31BE935364CA6A95FBCB22CB714C040 | |
994 | 9718824DFE97929D0482430726CCB5A5307957DD2432A9B6271E849148DEB76B | |
995 | FAA290FF6D0B18DC5B76407852E81C105EC6CFAB0F620C6DC9DA555A33C167B1 | |
996 | 430A8BC338BFC7D75B7099CC906AD923FA107C74D3FBB719D77A4E5A685FF9D8 | |
997 | 56424EE4AA074434B809D894ED50F6A60A035C5223EA25DD8983B9B34210DABE | |
998 | 718D7B2BEB293FF1B63CFB1CBDAFC69552963D90F5E3FF533A3FDBB626E9FAA3 | |
999 | F3C119E5E01C7BFF832A033C3515BF049E29558B1DAD652F2888E339E67D15AE | |
1000 | 95F9BD14E3253DFE9072B24C0E7E85025B71096AF51C86AECB2921126A43156B | |
1001 | EC812B32B1164BD9B2B947D503C015616DBF2024F5C8CB3236C1DCA653D661FE | |
1002 | 6B1C19A22D272A176B7F1B7F9E67AF40DB0EFD4940E58B2A050249CA4E55CAF7 | |
1003 | 6ACFD84FB46FEF952D18552B3972D79D808B4C263B8C7E1BB647A2D03E102867 | |
1004 | 630D5C3F2C917F765A4F6FB8106BA6A9D0093E27A4CB6049C2371287D94B5111 | |
1005 | 6E7020776EBD744C6C920464BBBC0AC206033E8240017F8CCB112596ECD7CAFA | |
1006 | 89950CF43FD87ACA750C03A778A37FBCE9C82C2F5ABB135BB02DA8E8C0D24475 | |
1007 | 3BEA9D79372D0022FF1ABD378C151417DBC69FE5C9CA38D23A3900E34BF924A2 | |
1008 | 90777ACDC37930B67DD44A2E76DDBD9B89598D5F626BFD325A978D277265DA47 | |
1009 | 38CFAF16E7FF1946E15F41CA73F7B4B02E5AE8FC4C37B115BC567E4EEEFEFC34 | |
1010 | EC8974B1465AE57759EDDA28DD38A9210871D35D331AE1BE6097C3EC21C770C9 | |
1011 | B25D040B2ECCC3AEB1EA1BF99E0C2C0F192C13BB9152CFCF75332E03F9CEC376 | |
1012 | 9B8C285A35F53655BE38713E09AE34BA2DA9C06FA42A6FD2D00CBF2AFD2BADB9 | |
1013 | 1571629C65DA38A431710CF5B01FCA68E8B8569922FBC3F9B64A5509B6F677AF | |
1014 | 1B97E91FFFEB6308AB68AC58F9BA43DB5E764021E75B56170EB44C2C0A7DB86C | |
1015 | 62B8982256D3621EBE3DB3994DBF5C5A14CF34B4AF3BD5697F8E3203085DE9D5 | |
1016 | 84B0598169760B925463E93DC87CE70AF4C2DF0F4287D2F2069847BCCF7A37A2 | |
1017 | AD451D5ACE4DBCCB2E14D5DF38B226952E7446BF87BEC736EF3D5AE793304618 | |
1018 | D66D3299AB9F9CA1D13F134FAEDF36750046E27706C7CBD8E0877BB6276E5196 | |
1019 | BC2A355D109C0253644918E1CC11B717DE6FBDA201E769812752888CD66268F6 | |
1020 | 4ACF4A9449378F9F9923D584BA1B51F33663BE7A306887BC14A37E3C5A4654E6 | |
1021 | 531D6EB63DE3946BD8BA95CFB037991174F36D61D842071E6625605CAA350A24 | |
1022 | FE551025D10871FE0E2599A63900C8520EF4911C53A03897C8BEE152451708E2 | |
1023 | 43FCF4E700C583A5E8DBCC03BF9CAB864DBD19E1760945DEA0EC0BA38BEA8256 | |
1024 | D3A8D4F70F6685A99C6BD2BA8B412A26C002D76138CFCC7DF6802931E5D97BA6 | |
1025 | 0151F6A4C572235B4196B22B7B2D14B32886DF0D2CA8A277ABAAC53B63F64CE4 | |
1026 | E4C088192AAB674497E8AF81961359C389B51F4A257373D907C615030BFBEF53 | |
1027 | DBD99058FD06E352450B658478C10454AC8FC0232B70D5CB916981978053E358 | |
1028 | 99D322A07294748BA427FFD1E45C909171017B52B7C742FD77A8560852D819DD | |
1029 | 8DD53211A14D7B2FD11E42941722FD3985D627FDAF87EB57326A0D290B5077D1 | |
1030 | 8A4230BEB40523A8565F95E0D44F036A571DB698EDD9D94FEC9512369E5E5E73 | |
1031 | A3CA5C142617944F4F99C0697ED088ACAC007FCE06E5A6EDE7D0E03A3399DCE5 | |
1032 | 362271BC31533866BA79FD1FB3F608B22CCD4111FFB1BA35D920A23AD157C6B3 | |
1033 | C3DAE11069D5E46DEDA7158C6478D8B8C0D9DC237CDF0CC6633911673C43FB79 | |
1034 | E4F9B7F27495201E5ADE66255BC2CBE9D9F237DECB62A19D62CB41A1C92432D2 | |
1035 | 07F0629E913A71B3F1AAF8B8C5AC66D3C8605A48F8913E39C859E163DB1DBC8F | |
1036 | 0ACFEE80A40B6172032E95A76B752B873FB4DF23CF3A655AF1A1B88C8DC156C6 | |
1037 | 190DE72973950565454C0A188A33395FD3D529A88F2B578356DE8EBBC12F04C4 | |
1038 | 5B899F667D9E6F3A4EC6DD8DE71FD4C2E2B6D56823EE4E0526679D71FF1B868D | |
1039 | F261489F06F97B010CCBE640E2F57BA3DC3332B329F7958394BA9777D833AB50 | |
1040 | 005E8E9232547104065ACE33396772B0E0BD66D2C6CC54DEDD071E444D8C95F8 | |
1041 | 6F88B31E20FDB80F77C83151B7E25BD3736B4F9BDC52EE78C41E9475E5A6D94C | |
1042 | D348AB42F5E36B4F167D29EBDFBD43B03F77EB296B06A36880FF17D412E77EA9 | |
1043 | F2E7C25FD05E16BEC6732681EA21AC3FF6893B93FC09316A370CDDB86D9E6087 | |
1044 | F6042C3F9ECD742778389170F5F041329782FB9F9702F7533E51F355F71825AE | |
1045 | 2BF4F8FE50D413AC9A20C41B42537FDBE8DDC5A5C793D3760C1EE13716068752 | |
1046 | F0AF10812250BEDFB4D7133FD58F4587BACD572505C84A7D3802D27443175FE0 | |
1047 | 0D89C3398B55176D8642AFBAB5CBCDFD6220C8488564B4306D74A58CD2921AAD | |
1048 | 73CF803C754DAC2F30A5324886E273064FA51781D5BC596BFEDDCE3982EA1AA2 | |
1049 | 62CA7BAA1B16C6EBB99B2AAC4E6C9CEFB3D10F19987045C4918DB239E6E63D79 | |
1050 | 5F44B9D097118D081153AFF96E5EB39CBFBB99A3BE30909F614869031358EB98 | |
1051 | F07A97EA78AE50375941B2474DB46AF3305F2B208D45921F93743A6CB8AC584F | |
1052 | 6BEBE25ECAADD5A789EF60C9F54446687E7B030DA3E5243189F02BA46BFD28B7 | |
1053 | DC14822E136AC7E40CE20458DDBF356488045C95907363864CD6943643BF0109 | |
1054 | EE027A3091C11EA392EA91320EBFEA3B857370AD8EB86D73F035A476F7058222 | |
1055 | E8CDE78CA1AA9EA69A8AA6EBFF3E67324C567B914134DE042D6F8F18A9373107 | |
1056 | 536E8D90189917D343F5299024239E2EC1D2D177D82DC8E344A7CF2AC71AEC18 | |
1057 | 36F139E7A4EB59A67192BCA9ED0EB25DE13032F6FEAFC3B1F4FC81BB0EDC41DF | |
1058 | B9EB92618667C59EA499B788CD26C2137D70F1B0AF793AF5AD0D0941F2E746E3 | |
1059 | F5A7F0288BC1EE11E982EAAE763CA422D72FBBC0D754AD58FBF92629DC8866A0 | |
1060 | 431213513744DB48E52EFC89C83FEB082588E4F30D7DA77BB598E51CAE7E4900 | |
1061 | 5CD570C914EFBA426BAFF7A56FC775ECF5BE13F2C42E51EF96784E5201C0B64C | |
1062 | 074AC229FF0BFDF71E6D5E08D8755D2C12B770B6466A9C9C61C15582DCD2FF78 | |
1063 | E9E74DC2B1CAA344EC0339EBFF92CD2CC1D62E2FA8FF15E7459A83C6CFA58A77 | |
1064 | 2F1A40BD276E76B675FD6834052B33BF9190F04DF6AA5FA3BB7D77A88DD5B600 | |
1065 | 324C5E28216F47682EC29EABF35BA842BA2294A3D72B126EBB852AB741186C9F | |
1066 | FC84B12DC4A6CEC08F2D03EE61B65C845841EE17F1B765649A | |
37c41ab1 CR |
1067 | 0000000000000000000000000000000000000000000000000000000000000000 |
1068 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1069 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1070 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1071 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1072 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1073 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1074 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1075 | cleartomark | |
45c0f7f8 | 1076 | {restore}if |
37c41ab1 CR |
1077 | %%EndFont |
1078 | %%BeginFont: CMSLTT10 | |
45c0f7f8 CR |
1079 | %!PS-AdobeFont-1.0: CMSLTT10 003.002 |
1080 | %%Title: CMSLTT10 | |
1081 | %Version: 003.002 | |
1082 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1083 | %%Creator: David M. Jones | |
1084 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1085 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSLTT10. | |
1086 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1087 | % This license is in the accompanying file OFL.txt, and is also | |
1088 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1089 | %%EndComments | |
1090 | FontDirectory/CMSLTT10 known{/CMSLTT10 findfont dup/UniqueID known{dup | |
1091 | /UniqueID get 5000800 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1092 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1093 | 11 dict begin |
45c0f7f8 CR |
1094 | /FontType 1 def |
1095 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1096 | /FontName /CMSLTT10 def | |
1097 | /FontBBox {-20 -233 617 696 }readonly def | |
1098 | /UniqueID 5000800 def | |
1099 | /PaintType 0 def | |
1100 | /FontInfo 9 dict dup begin | |
1101 | /version (003.002) readonly def | |
1102 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSLTT10.) readonly def | |
37c41ab1 CR |
1103 | /FullName (CMSLTT10) readonly def |
1104 | /FamilyName (Computer Modern) readonly def | |
1105 | /Weight (Medium) readonly def | |
1106 | /ItalicAngle -9.46 def | |
1107 | /isFixedPitch true def | |
45c0f7f8 CR |
1108 | /UnderlinePosition -100 def |
1109 | /UnderlineThickness 50 def | |
37c41ab1 | 1110 | end readonly def |
37c41ab1 CR |
1111 | /Encoding 256 array |
1112 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de | 1113 | dup 39 /quoteright put |
d3ad40de CR |
1114 | dup 45 /hyphen put |
1115 | dup 48 /zero put | |
1116 | dup 49 /one put | |
1117 | dup 50 /two put | |
1118 | dup 51 /three put | |
1119 | dup 58 /colon put | |
1120 | dup 65 /A put | |
1121 | dup 67 /C put | |
1122 | dup 68 /D put | |
1123 | dup 69 /E put | |
1124 | dup 70 /F put | |
1125 | dup 72 /H put | |
1126 | dup 73 /I put | |
1127 | dup 74 /J put | |
1128 | dup 76 /L put | |
1129 | dup 77 /M put | |
1130 | dup 78 /N put | |
1131 | dup 80 /P put | |
1132 | dup 82 /R put | |
1133 | dup 84 /T put | |
1134 | dup 88 /X put | |
1135 | dup 92 /backslash put | |
1136 | dup 95 /underscore put | |
1137 | dup 97 /a put | |
1138 | dup 98 /b put | |
1139 | dup 99 /c put | |
1140 | dup 100 /d put | |
1141 | dup 101 /e put | |
1142 | dup 102 /f put | |
1143 | dup 103 /g put | |
1144 | dup 104 /h put | |
1145 | dup 105 /i put | |
1146 | dup 106 /j put | |
1147 | dup 107 /k put | |
1148 | dup 108 /l put | |
1149 | dup 109 /m put | |
1150 | dup 110 /n put | |
1151 | dup 111 /o put | |
1152 | dup 112 /p put | |
1153 | dup 113 /q put | |
1154 | dup 114 /r put | |
1155 | dup 115 /s put | |
1156 | dup 116 /t put | |
1157 | dup 117 /u put | |
1158 | dup 118 /v put | |
1159 | dup 119 /w put | |
1160 | dup 120 /x put | |
1161 | dup 121 /y put | |
37c41ab1 | 1162 | readonly def |
37c41ab1 CR |
1163 | currentdict end |
1164 | currentfile eexec | |
45c0f7f8 CR |
1165 | D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 |
1166 | 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 | |
1167 | 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 | |
1168 | 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E | |
1169 | ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF | |
1170 | B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 | |
1171 | A9373ABECDBF32FA68AABB66FAB0C970A3354A335FEDDA1C288245E6C890B8DA | |
1172 | 3D0EB953283ABFE372221EEB1586B0167F634E3F29CADCAB484B81A243CE1E3F | |
1173 | D5106AD6BDB1AEC91123377F816711CB9D5140120FEA84B8205B79D1569509FC | |
1174 | 6B671211985CEF51691C45A168740BD826464B2CB0ABC575E7D453161328F80F | |
1175 | 3AF1C99EC219010EC6C95E0A8D1909719CF18BE424967E90DF67537220E60C3C | |
1176 | 4345B154D08F9EA684710E659DFFB0BA1B7FDDCD519305900A5E1CDA219A6C90 | |
1177 | DF8BD712A3686DAB90344E8784C7A9AF3318550285039B701B9FA1D3A3C3B6C2 | |
1178 | 753F1E794A3463A173C99A9EC0E2AB5737134CEC2C97CD6A37E38692ADB4B131 | |
1179 | 54697B7BBBB23680C72CE96066D8007B90AF0FC5958232AB4F21826691E9874D | |
1180 | 107F47DAC1026298D787989BD77CB43A09FC95F6997DB00D8483AE9C2716CBD3 | |
1181 | 7CDF02DA34FDA2F0754ED0968270E118DDD8BAAAA65C41D699E2BCC2556AA231 | |
1182 | 328187D2F50FD518CF458B0BA1F7DBAF4B231CFD61D5DC56335B53C3013BCCC9 | |
1183 | 85690E19E992ACE55EEF2BA7A75DEE6DC33933C226FC1494269B7CA4CBAE987C | |
1184 | 2C787386400172AE3F44AE47115F4117EED866713BDDCA4A7AF658C49F913CB7 | |
1185 | 308635000043F63BA210410A66E192289592882C477B2EEA0B2A339F0E7CF450 | |
1186 | CA0EF79D3A6C28598825CA03FD688DA60C95EF707C6E67CB7E57DE7A80545195 | |
1187 | 739ACBDF27069F34C9E0216C3D17CFE7A652B910FCC9B9AECC2E646809C22D93 | |
1188 | FAFAD465DE794755AFF5BEC17160C9563B5C51D07022E2D3A256FB5CACE131D6 | |
1189 | F4B30F591A0419D957D8F0DCAA0A8D65A8D83422AD7C2613FF13A302E152B312 | |
1190 | 3F1ABB45E42084EAC894FE335C07324849C9736D00C872C4551997DB889AF17A | |
1191 | A52C5AA77DEB548B0103B77F65717F70B90C1BBAEA7BCB4959F32851A9882A3F | |
1192 | 55673F24103D6BF7FB3AD3EC3CC50FD8FBB4A6B13C3D278174320713A7B327CC | |
1193 | A71F01E50840B33D0FC3F5F6A6F2B0F2D0E38494B1C73096A430510F927235FB | |
1194 | 69E931DA8CE5415EE88D0248565E3347353621A48F7948AC9EAB5F5057541B50 | |
1195 | 82BA955D90BBC82E582FD71904445A59186022FB928015235B60830DA59813D0 | |
1196 | 8DA3FC306C43FF8BB2CB6772B1F7BA3C1AA4B2343E7DA7E065EA53A4E5E28DC8 | |
1197 | 0790F2D5CFB203CB135A08DCC9702B59A63290444F202756E55B9FB053F773D6 | |
1198 | 0F69C63E74DE593E49186FF4304E8FA76C3E3006358DE549E946DB69431981E8 | |
1199 | 1261C9C9A884E4EC708F69E6AF5D22C5BAC49F2AE85903E3D48D03B7B97054F1 | |
1200 | D2937A0C685D912D6D20A75A77712164DCBF8FE4D5460DACE139C5A934EEA09F | |
1201 | B94DBF168A4BC03A9D689936D833018FF43837DF9519AD10F357F00BC068E737 | |
1202 | 170FC9FC6715165F733A0B6FADB9ABB48B845167DBE6D771C916577FC2132863 | |
1203 | 767DC6E3D460E779254194AA690983184D934F5E858C1176B3862B69B42EBE7D | |
1204 | EC9AC4E020085D474093F7694C8A8C2025D4B0163E29320C384D62A9F3FBCB1F | |
1205 | AB5A374EF3DBA48AC2147A207AEFE8B78BECEBC55C97B538F3A0FF4589D171E3 | |
1206 | 826342C8A5186224FEE54E4C6AD5EB02BCB4088B132FA1A48362824BEF161235 | |
1207 | 8E661DCFDFD8429C65CCEF63902D0E07C2FEC1DC2756D942F13FECCB7E8A8048 | |
1208 | 345338F24B7808E46A04A915C111F939E2669A12FAC0BA4F74B832EAC83EABEE | |
1209 | 67E2817C058E69C2010F2572FDD15194CD8DF0FE9F827D349C0444A18D1A86FD | |
1210 | 802BC120A5114FA3523C221242C7E767B0AAF6AD15DA1561CE8EB18A2401D71E | |
1211 | 20481FA5F1E247CB5288F47795A6A3A3BB186E89EAAC4A54AC91405427136127 | |
1212 | 5B151203426830F7CADABDB3FF63B40CA29CF8E667E71615869978E99E6F3F07 | |
1213 | 0170EACDE3DC62DC05681D7680E2E96C30002AE34A4E5EAEDF88577601A82C36 | |
1214 | 22D625A03B0451D7BBAAAE0C396711500E94A482EA787495073F16A76D1657DC | |
1215 | 4EA7C7B83BC30CE7F145B65B6E2ADC207D192CE3B5FEF7031F4BD64F57E1BEFF | |
1216 | CCFFE06F1E4ECA48B442DF413766A70DA626359183A9B24C70419487423C816B | |
1217 | 4BCB067E661E47E172563090D6328BD738D2B0FE41A0C1D7A47576A79BAFC880 | |
1218 | 0473229D134F998909898301CEF50A82B627A9A06DF59D0B9C530EC5D877F1E5 | |
1219 | 220D3A1ABD2ACBFDF1933F92B3137B22B9F95A961D93B729307749A50D8A6403 | |
1220 | 7AD0F9C40743E39B8D198CFCF7C033D99440D46D821D97545B930EF92E7AE005 | |
1221 | 27F2FC766FDD4790FD1913C7A13328E73E587618ABD9008022C5C6C23935CEFE | |
1222 | B5ECA2CEBA1D25DD846B48423F7186E03B1F61C8F1D5AC95CE03C83B2F221300 | |
1223 | 7A761D6CB5F7F9251D3F9A7F4B25B99EE7A1347ED3059A811A82A35A033E9B07 | |
1224 | A4FB2A95009576F48665605C478E5F6C1B135016FEB4AE6A6BE4B4359836E04D | |
1225 | 45AA11366992162973FB6266547C2E570B8F56F6D992D2C0F63950A16839FE10 | |
1226 | F56E59D93A37573E3268C5892C9F3358753D1FAD6379E82BE740FA17236E96F7 | |
1227 | C53A2FF785FAB86AD17EB1DE8A6AA9C69B91C9D9B43B5188E51F6939FEC21B65 | |
1228 | AF17DCE95DD3BA4F1DD51F0BD5E5869A1ECA7398B6E664EB0D189181E9C23012 | |
1229 | DC1E54C146842A90909DBEC03B79B58909205F2CB2A7F83C66B437D7F7DB9781 | |
1230 | FF0C67F004E979C95B706D8D85255CCD827CF6196D847DB380B56980109E96CA | |
1231 | 997157BE78A4F758CE59D78158A854EF2C20099438F74777D3B0298D45BA86D4 | |
1232 | 3C0AC30C984718FD62ABA0567AF0A70C1DD41953E3E7212D5C562085177E650A | |
1233 | 2ACD49940551E3F7619B4CC31DBF67AC15D938619B95DBF66E6D1300B1BB8605 | |
1234 | 31C4011379FB5388CA49E4A9BD6C921560CB8D513F8716A0733D2A7D77E62D22 | |
1235 | A69B54E9048CA168D210816E613CF6357706EF6B118A1263B858B7E19AA98891 | |
1236 | 43BD675B06C893579957BAB97199ACB82C080593ECB8B66A7334779CC16E4D0D | |
1237 | 4AF365CA6AF9727AE29417B61A5FD52452873B1D666044F8E7C1F6C6AA3397B5 | |
1238 | 94A5780F4005FB5E41698FADD1594B505A58253D68D2AE3320E22165D198050E | |
1239 | 425820CC0A43FF1D61F168D87CDD30C14D387610B6CDB63BAA39B3EC9B3CA616 | |
1240 | FF1CC679227749DED3DDEA26B4D97C633090DCB8D8A6E5E07E3579E4A99BF1D5 | |
1241 | 51E43D1D7F139C9CB1D76D8F693A3F23A74EFBE79F01E0B850BC6B6C7F62C2E9 | |
1242 | 859469A144853434895D73DA6BD2B348A48BA80E79327ABD96539F2EA2209852 | |
1243 | E1BF6B0B819D7C68A9A1D0F6F39416E3EC4AC21DCD3C51D3B5B8D417EFAE165F | |
1244 | 2A7E0B76E558AC9F685A76FEC7E3C73CD607D9025DE6113BE5D0401887A53910 | |
1245 | 82A813B026A502B51D484797D9D7E79A25B6624940AEDB4A15F2C73CA1AF60FA | |
1246 | 22D15BFBF268EB044FAE17822511AC6580D1D74DBA3C3335217780B29FEE792D | |
1247 | 200B00B8CD888A8BFF15D938FC758BB5CD9B3E08E1AC6CD1669E663BE86711A5 | |
1248 | 892684DFCAF70C11E803164994BDAD89128AAD6461D4558AC2ECA3E05EB56D32 | |
1249 | 0290AB16A6DF7133DDCBDEAE89C6CD83552792E23CBF567D57E46548EEB0A140 | |
1250 | 437492B53C14419B6FE7E64AC23923A9E85F56A9DF209DC4E6BCAF1E045F9CA3 | |
1251 | BB904BFA150F4083C18B0CB5580450CDB657EA768E71222C71DA911A722AB9D9 | |
1252 | E18B6847F417125C40EA8A0CA1F551A4548712D098209C78DF9C3F78605E5402 | |
1253 | DA2DBE2218E49B819296D5AC88D17DDBA982E171733D1E9E295B3157C9B90BF1 | |
1254 | CE68CB185947D1E3D7544155B741296D14B064BEFD3E6AF25C74006CF6800551 | |
1255 | 80FCAAEE6FC9105E1674EDFE68C45617D8D3E2264CD395EE94EDD017EB85884F | |
1256 | FDF530EDF4F3F14750CA066F149E688FAF8EF4B5FE6AB515CD298E8D170346CA | |
1257 | 9B32BAD1D86DC147BD12EBEDF6CE1E749C5B48314F512470A568C172C35CFA41 | |
1258 | 031E34586A89404CB5372D7B2C7A6D96F420D4D7C2D4C08184F4AF86B4536A90 | |
1259 | 9367598424112A7B05D7107B23695CBCD569002290599E0FF4EC5C852C31F5F3 | |
1260 | 9BD56BB840DC17DEEA579E7A7A9F764788D4E3774BD523D21267869224D68891 | |
1261 | 4523070E80A123B58F7B579866332FC38A41A5915EC06F2D14FBE4A6CAF59AEB | |
1262 | 57E98D661637EBB885AA5D74AD429CCFF64E5149815E7350118E6385F4C74E0B | |
1263 | 2EB474A6DED021D429F01C9B0634A09250C40E22B3BFE1B7246D18116D585F39 | |
1264 | 0E06E9B5F27A6CB77C8E9462189CB900CFEF08F798CAE15FBD94587F33816EE9 | |
1265 | 03FB2DA6826EB69D8C284AB9F7B00630D0420EB6E35E0E288BA25F5C2345C067 | |
1266 | 22412633898AF99C2FB232D1469025BF262B567F29A05F4816FE8EEF5F02BD79 | |
1267 | 06202F6A1E3E5D4B3C91BA8D5FF53D5136BF70E5FAEF441A7310CA83721711FC | |
1268 | 39EE48BFB2FF287234B1A6102AF146B10A632A53AF97E11FFAC3A2A86BBAE3BD | |
1269 | E0459ECF0305366078066F2CC628A3918E775E4236651B3D817AF1684B07A163 | |
1270 | A0142D16F55D2FB5F2255A8813B8E54EF3E801E95A4A226AB8C0476AC5EDCAD6 | |
1271 | 9258ACB6F7C0CBDD298A0B816560622A1871FBE2FAEBFE697A8216A0D8FE30C6 | |
1272 | B1BA6C3E975F78182743842E7F851064037394142AC91B2530FB1D511EB20F3F | |
1273 | 79EDD8B7E1579D35F6E7B2883C47A46B6C1A458BECD6BE58AAFD834A7D82A553 | |
1274 | 2FE4E66878E4699856DEDE964F454638F768AEDB595A883E380408F558015FB5 | |
1275 | 8720954ECE2704AFAD4D62E8BB2657C4FA920D72248B3F762B2F12D125B796AA | |
1276 | 1C4BD6B42D766EC1C9B2C7AA4B6A3474BF753742DE8AB76D0AB0DD9A20EE2DCA | |
1277 | 0F34CB25995ED3183759CA83ABC32B8BDF0B06EF169252587971F7D37463BFA2 | |
1278 | BE36B2E45559DD73DE7CBE29DE92B9BE6B9F8093F934BA311D81E18A8DA92FC3 | |
1279 | 312E3FAB43C53E803975981F0076EBB8F257C123908450661B6FA79E7ECE98F3 | |
1280 | B0A94E0DE3A4DCC8E0FEC106CDEDAA297A75BF1E40F3C2419BF72A644F452E2F | |
1281 | 9A8793810319885EB3AB23B1E80E8B62A889311355C73722C18E62711A7E6A16 | |
1282 | A5B923408444B13F6522FECA9A60B067EE332B83E1A69CD835C9D69B5D8859D6 | |
1283 | 91F9276863D2E2E8193641E4239F4ED15E2C482C735BF5434BAA454EC2830C1F | |
1284 | 7CF766DAC9E924F17F03093132627673BA3D99DC2DBFC89E5BA032C16D3C1C8D | |
1285 | 78B3C464081044DB53C7A29E925F4157EEEE928C8E28EDA5F0A4BB6E0042D8AC | |
1286 | 7595C350645118172D04FBF06B2C9A9F3603A54B57999E2960C993724CCD6A09 | |
1287 | 766BDF73F66E07FCA9BD09079CE8010E6CFECBE2E5DE1EA4E280AB78D5184C11 | |
1288 | 016385007CB5AC0BC95955A1E88EA1A1D8EFEA886007708BA063F556D9284D4D | |
1289 | C764E75CECA51BEE3D35DFCEBF6175953D30FDAC00F23B1721A1DD577945B5E3 | |
1290 | 8176A21A649D907B5F63C71718ECF32ECCF1B26BF15AF694F1045CF98FC75278 | |
1291 | E9782ACD3D83CBDBEE690D29B3176E745AAE436382D258CB22F3DEDD02E441FC | |
1292 | 6A9931AC2F61156DE258DAAD5EDAD41E6C0DFC902173168BB4F51DFA7EA615C8 | |
1293 | B0F92FDB118378CBAC3D56B6B9BB0883C0C14EAA67396AAA7987222A132B7959 | |
1294 | 44FC1E9D6DB6D549DFBEF8D2DD8C53DD3B66935FC239E74E2C440CCA13C068EB | |
1295 | C4A3B69F499F573D076E2C92E24F2C69B806591B0807CD903E078683854963EE | |
1296 | 5125C3640860CEF37BE186DB781475554BFE6C528A9633AD5772BD53244E24AB | |
1297 | 42CA2D1123AF45FA257940CE611D83014DF04E60220E9AF27CB2A2247BBB004A | |
1298 | F5722A5EF058FDC7DC2B6ED1406649DBAA58DF2ED3A91483D60F11C4A39BAF57 | |
1299 | CB1E320A987B790672CDD3E3BEF4A67032244DED2FF4588B2072CDABFEB36009 | |
1300 | 9F4BCBEE16F811A44CEC77F8AE873C90C0F4C975E51014ECBD45A56A63F034C2 | |
1301 | 82212977023A132E5C88AAA826D841FDE9CBCE7A01E4B6F0EBDDB9A69EFEBD72 | |
1302 | 0B41EDA807CEDB791084047624BC11CE10B7A0A311272EFC9E013FA374D97EA5 | |
1303 | F7998FD908748CA72D8CABFD0F01220C2114D3B462B22FB71A23B284B1CBC7D9 | |
1304 | EA20BE71F8ACCED21F096009A14A7C7B51450BA51514707EB46B9FAAB31CFBEA | |
1305 | E1DDA6F5D9AF0B6E7D05A1EEEEECD606427B0F2363D1B882B50140466B9D3CBD | |
1306 | D00DB06DDD1BD4681E367DAA4B7C405C6281B67FFF794041738FC6A01D261CDD | |
1307 | F6E0A330985F2CA782CBCC02B6F4EE5993434F656B91A51CC03B1D73FFA6629F | |
1308 | 14F6075EBFD83B702D8844A96CFB5C14051595BC7DB2218156A6DEDA5C98CAD8 | |
1309 | BEB5284D9D9F86406A8C1AE85857185991C360E5F44DEF352A1F301207BE94C2 | |
1310 | 9A3A11BA468FACB3FA2D683419C44EFDD7C8F1079659F3ABD89D7F168B1591E5 | |
1311 | 6105F9B3FA481BA953CD34CCFE73E427D3AFC46E5C58C2981198BA284DB8B37A | |
1312 | 6647BEAA561799877DD6858FCA71CA6003F2961FAA529906673EA94D82D78116 | |
1313 | 4DAC81011FD175DA707C1E15D4B6FF19F8720A4E05E6E103E2DE880FA9C192BE | |
1314 | C5ABE7C311C2ECCBCE8F9713DBA74AEC37A61C8F21F271B35F0F7C88B182525B | |
1315 | A4183377597ACDA9A6E2F181725D427795B975BC4168A408D292CAA484BD1B8C | |
1316 | 9DC62E737ABC805C8FCB7E96454DA032B601345570EAE0379BDA84BB6D15D780 | |
1317 | 42FA1E068A7D62F152B43B788513E13724666FAB4E2B4F04B0448194E46582CE | |
1318 | 7389BAF0D1DD4435BAA6B82AC305C04686B89FD51197C721D941BD2893596024 | |
1319 | 1598E6C2BD84527EDA6FAB782033E4BB4F964FBACD96CAEC3F3CF89CBABF6B4D | |
1320 | 4D3AD14A03D4BE931632BB03BC2B92842FAD51A19A756892D5B978DB695D0540 | |
1321 | CC9D030C612E2B201D60D09F56332DD0BA1351EE62816C21A35C33DC11B37BE4 | |
1322 | D2F164ACD836A5CA1553CBC733E3B159860454B17064B4E22D3764FF6293BC81 | |
1323 | CFA3B2325C8E072857F6FF4ADAA8818247D431A28D3C5FDFBFB24A6CAA327AC1 | |
1324 | 0B3630C84ED9F0D33B8255A3CAA9C5A0C79F7BF6BA3B9801C3BD0B30AEF7CCA9 | |
1325 | 92F25E332EA97A7CC653C93D1497992D6B76363885B92ADE34C2A33E30A3B1A0 | |
1326 | 57E9C16D8CEC189565808D3FAC92973C71CDE74DE9D8781CCAF88747758014C4 | |
1327 | 5B62667D4D2CC5EBEBE77C5AD00C6A69D1819F5A786964501E077EB3BBEA52A4 | |
1328 | 57729AEDF35253F7E1D31F2DD1587BC15CCFC1B0CA930DA83E2031B099A38158 | |
1329 | 8D1849E7145AC74777A3C7136DEABB0C787E5A218309A65EC7D128147EDE3AE0 | |
1330 | C0AC039B56F767A22555CFCC12DCBC7F5A5A3B4E86EF5A69EEA93DF0BAF2A3F3 | |
1331 | 7504F5C6A7A67388D2F9045BD755BEB7DFBC2EED679497EBEC808BE20FDCB5C7 | |
1332 | B586463BBB898DECCCF7249E9047DA943FAF0718A2050FCFDF8A4C2029FBA674 | |
1333 | EA64003AC03A847185936FC375CC67B3006EA681F61F640C3640A78D0C7FF521 | |
1334 | D477981E23E5956BAF42252463FDBEC49BB560A9428D248B0C5250CFA2A49CD9 | |
1335 | DBCEF73123C13BA382D3CF6A7B8A8CA3191D379A659F0E2C6E9CAFE9DA2AC074 | |
1336 | F622E397A2F7C73347364AE249B11AE2C34AA7F0D27B5F35D548D5AD1228597D | |
1337 | D16A478C901D3A34D870BA39F770885B7DE62298F0114752435050E99EA4E5E0 | |
1338 | 56B965EA185E8DF96B9FE97EE23DD45AADBFE02B427222B9FC99DA94FB2648B8 | |
1339 | 46BD30F881BAD3820DCA4D8093BA0FE70E03482CC063B751439125623FA7AE40 | |
1340 | 52DB2A380D89D5E37BF264CC73DA9A1540031587F481A0F146C6ED6F3F2957FA | |
1341 | 19477F075ACF64D424279612DA5AE02B2A140048386D01B1F30EADF2050B71A7 | |
1342 | 993773D5B68C6FE65EAC53411AC6E7E26E49BE5FE1079A8BC565D2CEB7E3B896 | |
1343 | 593D720DBF66CDB26DA5D8E533A346845E31374A7C85FB6B06C3D54FE3408013 | |
1344 | 864CB0954A2FFC00ED17CC167AF714716376B789A71059DF2032E0E907761E81 | |
1345 | F0C887810337F52662AF43FA1A7528923B0A30A217FA184ACB73207EB3018D5C | |
1346 | 09EA88CA0873AE690E94D43B360D9C1070D7CBAE9BBA72E82EF9914D3AED6D1A | |
1347 | 5539585EA969F0A1407C8FEDAB69BA3EEE3097D5B123C5770D5ACBCB0882F35A | |
1348 | E8A3E3B1FE3903A941EA2090266B60D218407AB99EEF38F18C9FA307D73E2F5C | |
1349 | 42F8C37E2F668BA6B0779791D8404E2B2CA52E28F0B34C85250B0D6AAF9D2DCA | |
1350 | A12133B5B601D971345EB6D892B85FB971DB8C4A4188ADA6575DC6DC42D2F0C8 | |
1351 | 4EB946AB47F487B6B4C4C59B2FCEB1291C386805C5B62B61FD7310A13B4620BA | |
1352 | 650DDF28FC1AF21FA124C16EE8ABB98904F03E7F49E54348B1AF2211A1768768 | |
1353 | D62E35EA2EF7F2756B58168F9FFB5785DAEAB324C90FDF6207E670DF277D6AB5 | |
1354 | F0924B26BCF52CDA2980680320314F41244B73DA6367C434B5DCDB96B6F0F454 | |
9f178efb CR |
1355 | 89BE7553B58CB230BE71B2C7A7F1D63C3B1E80C159DD941027EA44D54767355C |
1356 | 6EB30D38D407FA1189474C2F9D3FD92F5CC6CECC63CF6CA6B33D77F08D274A1B | |
1357 | 0AD7C2DCEE55F1B425BCB98F24D0BD431A5BAF6F42BF897BDE9198E6BB331C81 | |
1358 | 6B5B63F3604235FB733A882BA5464A3E5415341C8E9A2E79A5896C8C334CCBB8 | |
1359 | A2047CB4E6BB167BD586FFC4A1409B4C13DA0B84608126D10754D562A9812A79 | |
1360 | F2B3078B7CD1D0A37A192E1D58623331B582E62291B6EF6FE3C92E8EC9A40C37 | |
1361 | B251270944393FCF133426FBCE86A318E16141654DD7BB12AD46B60A05E86D3F | |
1362 | 14BDDE12FE3B17F9E2443E057FD0A25677D1F17C2BD87F84BA7D6AE3E7EF3EF9 | |
1363 | 3DEB268B580A7823253430FF8D80FEFA0F9E4F66D0733E251E7F680B8B23B7B5 | |
1364 | A614F4FAEFAB880843451E4D9840AF7B8BBB6333E010A169528748AFBAE9A6D9 | |
1365 | 499E221149C0AA19D536F3F121DF1AE056D3D0FF5C6D837BD8061153501F0209 | |
1366 | 79076B4E0C63738C54BB31156F2273A327D3B6D0DDB5039D27D1C4020E90C94E | |
1367 | 4A4B156B32F28DD132D2AB4D9CFE18B7851A65BA965382B23CCC0915EB6847A0 | |
1368 | B14492B0405395BDDAB36C2205F229891D989196608455629CB3CD67E07DEDB6 | |
1369 | A09E68BE431182D6CE52CE41B8531FF111ECECA60A68E7E7BDB6B91C7B694688 | |
1370 | 47786E04588AE7D21DC6F2309D492FC9795DD054C150ED94110A7F89CF3E92F7 | |
1371 | 4649D3F4C778FBF02ADA9E577C5EBA24A1F0278E9D9DC5556A60EADEC068AC57 | |
1372 | 5359E9FD0D2E3E7B0006127F95F333D2BE77C70EBB163EA9679207C76C999903 | |
1373 | 50D76BDAB2DF0D6A506EEA9C952A3D28D419FB78CC64078CD91C39A5D4FCD9B9 | |
1374 | D135A4E24E373E24047EF1180D3BF51DE4167F3945825B7124198FCDF7432E20 | |
1375 | C35BE9B0C7C0CC194867C4CE9BCD27860826C14749B811E8FEE29015CD65E7F5 | |
1376 | 307300B316054B7914CB7464E6AA37DFF4BD0AFC04C0E8BFD1269E2D4CB5A201 | |
1377 | 785C32B6B5656A7F6CA6AD8F7C77DF8F70B8F99C88BD8D548E78986096C917F1 | |
1378 | C0C195F4CE7972F1354B95D1BD84934D80CFD09FA14F3DF37300B5E8C208C66B | |
1379 | C544BFBF9B18AA7E27AC4E8567CB7188C20B1807BE56BB2B348C551767F40A07 | |
1380 | 022EBCBE0749DE0D8FF1E2792A0BF2B84C940A127203E2216EA4F8689C84C739 | |
1381 | 58D5693082E057B67C9BD80FBCA6463D9EFBA2B9F4D3C8F239C1A70D8A4A824C | |
1382 | B045489E1C6BCD28DA4F1BEA2BD80D424722479D0E8A1A99A8B2FE26822D3198 | |
1383 | 722E2D276A123A95128EB6C5C6AF9AAD213D088EE92917E0870179888296F4D1 | |
1384 | 0FFB87A340D7F052B07C6274027559A8B3843F2422C3640848CD8BF664645EA7 | |
1385 | 20EBCB14E9B15F552E9E793B2F5D7BFE849817CCDD9BAF7DBA26BEED536DF80B | |
1386 | E250F831A12EC703AEE5ED6F5C688849B00C85AF124451A29CB67398FD3D4015 | |
1387 | C5D8824B7EC81F85CE9170560BEACD43ABF5EB5329A4E38431F243099B8F88F6 | |
1388 | 58E8F6A7DF8AED9153CA90F9C941320750E5C26262BD14CE3CDBA9AED2270546 | |
1389 | 24917E378761B5A96F0689511C12A0E598E7BD54A6ABD40AA4FE651AAB9DE733 | |
1390 | 88677F863423C714476E797F4A22B94AF646819D91F9612E6E5CCFD9F7D11AB2 | |
1391 | DBDD3C8ED9D257E5A8BE4B7DF9997EB2ED23EBF4BFCBA1993796E34AD93C8CAD | |
1392 | DDEE75EC199BF642C34BA24E323A7099C4B7D232328ED3C7A3BD476FC0B3D921 | |
1393 | 8E773970ED221BFD47FC656BD14FEE47F06834C55C0EF960DF0265E847EA4421 | |
1394 | CF81FDFB40A4C997B1EDA3556FCD8BB4EB141EAF4DF853FD353120BBD37D4B44 | |
1395 | 2CA1C1D5D8A5626870AAFD925B461A65FA0E2924A197F27B224E53A7140A83C3 | |
1396 | 10A7F3868E4801C216EBFC5F8391A1576C69537686DB1CF7F2AE299FB03CF222 | |
1397 | 6A38A57466A9C0DC13E9A8200649DA837A6C40E002C25114F0CFB3D2C0A9AF20 | |
1398 | C7B387856AEEE008AD60FA1B26179D95B3486DD3E5BBD096D4B105117418F60B | |
1399 | 26AEFDF53A815F712956AFAE0585B243D5A2B4AF5B517023867F57ECE2D538D3 | |
1400 | 89804EFA77C0D9CE905A3303F19A9AB3B228A03B88CB26631814A36C27D09E56 | |
1401 | E965514293048ACF6BBAC80329F0422591F06637A274F2582A6BC59ECE5DBB7B | |
1402 | 7CB5056822A2426E4359DE632F89734AEB6F783952B007EA1D2EBB7CFB1C1D78 | |
1403 | 7EADDF28CA76CE34F78E568B11AA69FAB64D8B0FC933FAD372B9EF19D5F31A25 | |
1404 | 35BAF075193980F69141538B7E7586E8DB534762CBD9E95442AD17C8C2F438D4 | |
1405 | DAC23C5F5D772D1809ECEB13809662C6C8B97DCFA5AFD46C6CF3FC6F07BDD604 | |
1406 | 5A4C473C7FF3ED34462A79487EB47D5BD4580E98BD44CFF016DCC942E831F7BC | |
1407 | 759A345622F5C65C067C83F7474EBEEF62E63F5B49519E0E1A7BA279784977DB | |
1408 | C646DFE8D0AC7D78CD27B8F9D8E18A3A1C1AD427A85401543B0CE4F4469FE14F | |
1409 | BFD02FEBB2050BD06558FEBA3F61D35AE7A0E49639DF68910174F41A20F5C839 | |
1410 | 79545CB64FA870FA9AAB20B80CE7D85DB8A0F64915E1742E5835B5152BCD4B89 | |
1411 | 4E7BC34E8D8CC93F5DE675090B7BDAD2728022F29D6A7D0F5508A189B8E0CCBB | |
1412 | 87AB29B9680978381252A9A37AD5CEBA8E4F8CA2C06D7A2133FF94B3AF05EA7B | |
1413 | 0C1497955A4E04183092871E66A7386E063B58764B62C33B6997F2E0D7F4AB76 | |
1414 | 6093F606DF3C4E5F8A06E9D602E36F2DF4CA2E8C59EA6F8537A8269EEE427271 | |
1415 | E1FFFFEC053811328AB1FC60821F4C13D277EC66F56F27E0208726C915CBF178 | |
1416 | D2DFBEB767FE08AF1DEF4219F6C97BA5505DA3CF06BCE02E8E5013872DDB0E9B | |
1417 | 01103E8F7213F1A00C473349820BA7F202C9F8632B9D7AC4FCC98287175CB2EC | |
1418 | 7800B05D4A7617335D1CCC2094F70BA6556A99F2B9365409971DA4BA1913B7E8 | |
1419 | D6D84BBF1CB40FFCBC9B1C6306E9A148F39874A1E2A8FC677EB621FB46304D59 | |
1420 | B982A381886E99BE387640FAEFCE8182A2CC9AC76C1078D9E03CEAFA0747AACE | |
1421 | 16F9A95F5A97265A208ABD10C3BF49C1856461B710A29887CB6D57B61D24DDC1 | |
1422 | 5DBBFEE1DD43EA93F9B0B70276253A89546A4E3918B5C93A991AD372606F091F | |
1423 | EC35362E95CAAC00280DB8BA15DFA28F9AF7A6F9EC51FB2ADE3D15599AF01627 | |
1424 | B4D96F3D35FC4995EB18DA916FB6D24B56D60084E0CD8A32AB934845FF24B689 | |
1425 | 67883D3EAB40BAB8FEBC3C17F6145CE0B96BA50A9ABEC6F1FF955C9FF80DF500 | |
1426 | BEEC7AEEA8C2FAA50968A57FFA5E9AFBAFF08451A63625918621B8FE9A46255C | |
1427 | 86B9E145C2526E4D27F974D74221FC90BC691454D7CC6413AEE3321D64E57F58 | |
1428 | 81DF5C5954C794492D4135F130855678C8BB7C4A3E3551D2E89F3DF6B049D857 | |
1429 | 9115B3697E07024C34985FDAF5EF24210B2864F9471879835FBFED10D7535002 | |
1430 | E806CE05BEC90ACF31E49AA6C62D9E169196A7C358E1AA5C886C1E1544568C2B | |
1431 | 500F208319AFCB37CBE4A568136B1791844DB5B627F66C75DBB7FCAAC4EA4620 | |
1432 | 323DD1FC501727D74CEEA2C3D1B4D63779120AE0B0843FC978E1EAA6FE4FC337 | |
1433 | 46F12F90D6168313CA077B85990EF9C6EB27F71D3B8C262FDBB297B1B88625E4 | |
1434 | 62143BD515F6FEFEBAAF35ADF8B57486A14DC57614488C332E2B81B946397168 | |
1435 | 1069CE21C21E8F44B2DB9EFC2F4160F17ADC55DA7218DBE64FBD5BABCA4C5718 | |
1436 | 9748B61B8F7F9573847E7BB62DCA710100AD39FA555C2C3B3800BCE7C78BA404 | |
1437 | 3DBEE48BA6328F47B1E72A507432BE4A7EA3F0AF034B2E29A4CFFAE8B30AF806 | |
1438 | F71936B5FE86F73F9C4B81123E1AE017B60EB2EB108EAC9579F3EF142CEEC861 | |
1439 | EAECCABA38C637306D8379C02548B4B33FB5D8A6169B3899A2D0499899946371 | |
1440 | BCD7D8D37924B66E4DFDF25ECD17408AA78A9A1D1C8A3615E428EDAE3E56017A | |
1441 | 0C2CD79A0D92E6DDC54746E5095B4659D73A251F3B7FD7625CE7EAC3EFB61409 | |
1442 | C1463D4015619BA3746F278188E2F30F997D477491D39625C2B829845D4EA97E | |
1443 | 56D7F3883CDD5938BF1BDCA2DF5BBD0E3D495554A01840E7E7A081A736DF6D7E | |
1444 | 6BDD580F717261F6A3953157DA05AA3B57FBB1E977C6A43555F7BDFCB35C8B8E | |
1445 | B6356A4F1B01317B029918AB1C0400CD32A41515CA55E59CDC9C4641A570DA65 | |
1446 | 96FA304094735B8B070FCDBA01DABC55C493A390F3A0B60D31C6EE3176BD5257 | |
1447 | F6CFCD17682833155B9DE734CE94A232BF9FD8AA45C35DCC0B16FEE6EC241BC1 | |
1448 | E944B183ACFFCBA57219D6BD9132E9610780D4AB07FB2F77428114E800CB5855 | |
1449 | 0C26502E4B09AD0EC8A4B342DA732E24CBCBC7BEB15322BC3A4B004CB9652D27 | |
1450 | B85525C0E59DF15D972EE00D5D6DCDDE1A141DEDF0BF9309463C7D5D0D95077C | |
1451 | F41EACAFA40CBA65004AC680983DB2CC892C1089A58514051E2C0FC16D74056B | |
1452 | 34151DCA72FADD08765BF73139A2A15A46067064490DAC5AB5039C545DE452F7 | |
1453 | 35416482DD79C77BD0256D6BE9005C80902D9BE36F06FA4431F1DFBA7C982C66 | |
1454 | E141DA88A07902D83D1A83C0538DF2F8F8719409259196EC46B9D7815E17F836 | |
1455 | 4F06E024C1A05A594BCC8C7489B3DE9E9C3B9D2D15B8149F6D09A35A8444CE1C | |
1456 | 704E2B8F273FAD8128A6033E871F1A36B95969EF3EA5EE8DE9B2720FED92D43A | |
1457 | B894DFB54E6F3E4D92E18AFD7B4D72FD675AB7447729F4F618FAC4938ABBE9BF | |
1458 | 29045FD578CFEDE3BAFA55419C564CE39F324592304FF7B339DC2D889C157BE3 | |
1459 | A182E42DBCB6BEA7773CE2A058EE2076C77CC98F0C37CE8128E1671D8BD8AEB3 | |
1460 | 1E724BE5297AEF6F8F90719D75E2218470034C970C7C3BC4CE46234CF25F3092 | |
1461 | 526AD39838F4DD2399A4DE9BE341EA932FC616B02FBFE7EC68AD6E98F5AB3040 | |
1462 | C00C615ED7C7D427387D5AA99594EAFD54D3CE88DEEAB0A408C14B48217D73B7 | |
1463 | AAFF60D219FC71262E05BF9D15DA7739FAB52683D27A3E094B40D84E3C272D26 | |
1464 | F9CC125000AADA491137363EEBDE57EF302943F26E7DE08EC71707B62E717F92 | |
1465 | BE14CB7F5D4FF8A802030B10FA8AB4D93286AC064E0547032E2AAFA3E353F4A2 | |
1466 | 4B3EA80EF4221C81BA5698D58A460C0412B1C1BF143E547DCA6CCA584011B55F | |
1467 | 526742925DBE8300564D621015796CD280DE573A0A733C5F6B2D4AD811EE4778 | |
1468 | FE60F46ACF6B6943B07B0EB0E4636823430A301B06BE688CC24785A8896BCD42 | |
1469 | 39B97D9963BB74BD8BF05217B615983E27994FBEDB0577010E46BCAA04DB1A72 | |
1470 | 77F4ED8257D145EC44B2B65B408BC71239F1C2E8434C1C2FEE4642BEA1C60C7A | |
1471 | F02BF44140D0DA3E94D7658312A212FABFC0AA74F3512D513E82248BACD86A15 | |
1472 | B5A2C71F3692C8D702FA11B262ECE33B382C681D54BC275FBAB326D928A6A327 | |
1473 | AB2ABFF6C4A65339D945A671AD839DEACA7412ACA3253B399BA17E363B213FCC | |
1474 | 962725E0BD8CCE55985438700204353C507E4DB96C1B57DD7A071124476A5095 | |
1475 | BDA4C678F514AA63CADCF7003C73F0C505590526C0D1BCD7DAC0236243AEE48A | |
1476 | 5F351E12194DE6754336416227A63FE6C37D472EA1688AFD88FC94922094E799 | |
1477 | 930F9952B2B1B86D1436C843A90AA230139B82449E16EA8B29108AA624933D1F | |
1478 | 5BB7E1EC1E7F570BD1DC0D2A9C338F4590D590AFE417D289B103E11156D66DEF | |
1479 | F9E1F1F3A68DF07D69FB9CF4D09F2E2D47C2168E0BCECB8BA1CF856826B51D23 | |
1480 | D440D7EE177DC922BA367BC69871D037A508B80E75F43C331F7BB5FC96493932 | |
1481 | 0B3CA39DB05BB29C08348C3F0FAC71ADA5C07BCFD160FE677A8A030BDE2C4A6C | |
1482 | A866D89CAFBFE647B36F7931664F82997CBFDECB6F88C795609D1C94DC80F09A | |
1483 | 87221FDA3A699D0748F97E682B5B8C7B1EBA75BD44070DDBECB03824F9EA4E1B | |
1484 | BC66A08A1A0F8AA3DC482D408C83B469315A2ABA685726CEA99BC3D15799D28D | |
1485 | F81E0BB958E34A1670C23FCEE68A0DADD2BE3CFCC1914A9FA1B1A661693ADFC6 | |
1486 | 378969C2E400E5D4AB0CB7DC0FA364893D2484DA98264CB50205B7B9A2532492 | |
1487 | 81A2697B7FA4FC77E71D3117608ED7C474AA2FFEE8B3F1DD942CB16A1FF06C6F | |
1488 | 3741AF6972D09A5EDA91B4EDE291A7B3E3D481005BB578DC5AF13C88EEE51380 | |
1489 | 78E57D8E073FA46B89A1DD73D51AB11B44048CE2F031031018697B2DA15BB05E | |
1490 | B69E9E54F85E09EE3EBCFF390A9CF28B6F0932A46C9306911F2F36B8CA3ABC14 | |
1491 | 022697A6BC560C0A688BD1E49AA9F9CF4917130ECF08F8C500E0096A8BE65E01 | |
1492 | EE5A2618E3C9DDD1D227EB584EB0763C6294B91DADC65AA8F1DB42BA25E77B9B | |
1493 | AAAABEC083135CC61C18987128961505D602E409C3DB90F301CE2C792AB7ABD8 | |
1494 | 1B7442AB1C8D5B1FB5AB30444752254A530B227A1E7CBC615B045031FB07468D | |
1495 | DADBE63C9D1AC6F9742738FCF2896ECE73C131063E6FB3B954A77D1CD1F5764E | |
1496 | 3D65A43B627E8E7E10C5966C93E9794A3211D8B349D7F82427A65DA39B4AD1AE | |
1497 | A98733594453F400B9841AD3207DF9A908372B8B7F8EAC363D0DDFB90411A468 | |
1498 | 1F3F0E7A8DE83F3CEC745BF43D341A20F53BD0667B70613FDB9B1379FA61BC9E | |
1499 | 516118F7B1DC7A7B049E116A7A254F0A363694920EA156DF045038B14C229E6D | |
1500 | 19417309B6DFF125580B5279D6CAE9AACA31A1D21AAEA8DE32180F3456AF61E8 | |
1501 | AE8011BFA62D7B5A8123A02131D2F622211D74F104CD729CBE44EBC70672C064 | |
1502 | 6D8CE2956C78B8CAF172B77E78F715DDA875A492CDD8357CB3AA3ED817043631 | |
1503 | 0D278C6AB079AEC3C765D5E0267BD01C1D3F7AAACD0CF34EF8DD2FC5FF8FE85D | |
1504 | E410CBDCE53C792C0ED5092162DB85E6465C058D95816008077E22EB8A98B8D2 | |
1505 | 5A4069933FD3F3DE33926152C7DC712807784C17863EC78F9FD11A335BF8C700 | |
1506 | F4963F7C1A72505DB453012507A3EE51F7F2E814CB77769356C7654B9569B68D | |
1507 | 36C1EBCFACDF5C8D91D664820758BA73A83EA9660E33D4589C6950CC5C612710 | |
1508 | E9E97BEB5CB43F4109FC0F9E5EA126C1A9F2C4617CA146013F01E810EED40041 | |
1509 | 5D09159A5B53FAF73B151499CF4BA3B79A19034CE461298D1B805E161CE837C1 | |
1510 | AE9A7298DB9DD9E54C347E64772AF100A5C736173D5D9EF4C45B8FF6B0ECA17D | |
1511 | C1ED7FA96FAC530778D72CAB4D9920BC6C137EB3187B1DEE669419753B6472C4 | |
1512 | D29CF8ECD1D43AC03DB1413FE6D4A883857E2574C68AEC9AC7F7D3173E9EA7AD | |
1513 | 1A8762EB2841D29BA98B8C59BF52ADB41A1C06A50FA66C169605BF950AFFFED3 | |
1514 | 6CF7FEE0126C0AF7DD7A85796BE7D93A124581EF530AA62DF4CB06A15A17D5E3 | |
1515 | F6B6B72CD7481D238B2EF97123EE55872A43599ADCD48443DD9DFBFD469C71D2 | |
1516 | 624FE39A15FB5CC331E29B20DD1994FDBADF7E2843ADFEFFB38AF6E727638848 | |
1517 | 4BB02352C312A363C3920604853550205484499FE4B1D8A29A4913F440E37CBA | |
1518 | 9CFE762651749B33BA532DDFEBA257869BE4585699ED7E918FF72D25F3EC0C71 | |
1519 | FC49EF6C38DD1105AE50D5DC13F6F1AE2FC3264C549FB4D8D1A959F25DFE913C | |
1520 | 1ABC41ECBB5B538BA1C4870E73599BA518FF41B6445D40C9B9BDAC2D552E4533 | |
1521 | 670DE0C40C155E46AEDF4B74BD44A521815B69981F4F33EBB774391320D8B6DB | |
1522 | AD9C9545557E21A90EA55CFA69B967F3E136CCA7A1E4C9D312D9D08940DECDC9 | |
1523 | 1CF646FB7704DFDF783BBB1739DA1D2EF502B7B3A1FBEAD958DC99F086E6B623 | |
1524 | F33ADC3A758138E47EA3DE1FEC42EBC6D675C658B9AAA4C4054B1F81CCC4D216 | |
1525 | 9559BDFD542140F2A101095F2B3FFEA124F407A8B650032265A48F065C3C5BD9 | |
1526 | 66D843E3A2BA4CD7BF56A6A10D90345B51969A03DF45C91EBC2F3023A3E71B4A | |
1527 | B6A7DADD9E3EC5C70207F743157A9A0ECE23A7A95798C2174281A7900919878D | |
1528 | 955EBCA90D02F07876BC3F5EB1252A82D891FB3E0FB9FC032080E6F700981030 | |
1529 | 0E81FC3E75AC8623405CCAFA66161D5D471EA952F0FD4021754CB61A7B1445AC | |
1530 | 0547EBD4D78F141651A5DEA6262F0A05559DEFD434C5485FFBEEE7DA647AFECD | |
1531 | 6468D4D3905576FC4F670BA39F9956149CC371A31ACA929CAF0668B667DC2CF1 | |
1532 | 8810C6CF9EA23CD5576C110183155DBF15F24CF0973532800274127C6C5C9C79 | |
1533 | EB121C5F0B74D824DDFA3EC4BD7BBB8799875B8A4776B60F840AE96A8F65724F | |
1534 | AAC3BB862EA6F8697D935C60C2DF962F042521BB1D3EB9C064F2CBFD84208D94 | |
1535 | 0E9DD9242157F4D3DB05194E82FAD5EF8C09092055463620D1B4ACE3BF9CFDC4 | |
1536 | 989840A2CE7BF62D69BBC387D0184EBD87755E4DCEB8296D1005E79779A19B14 | |
1537 | 354345A8A0324F1E61D88A22BC423D3DB4686ACB6CCA3CC515B6A5CCA6C888FD | |
1538 | EC2CCB767778AE3FFD7ECBD8BF1828E5BDDF119247F11B299D5272C475C67113 | |
1539 | 8F124D25A87AD26E8B7713A5189FDD920EAFC2D9069664744B6E7DE1AB20E798 | |
1540 | 8BF9B8885BED5CBAB904032F6245AC752F392524C2FE09F636B59B17ACCE1E56 | |
1541 | ECDE4533FEE75C6ACA81D3FD7F6032B865D8B6F34DF1A99E01FB6534659921FB | |
1542 | 81631346B4530CC2E6B15389D7D494A4851C5F7CB502B394E840ECB67D359B77 | |
1543 | E940F25E96B3AA4DBFB0689C0C8D41EBFB5A9ABF7B817AC487093BA1013E345F | |
1544 | B42647E031C22B77A319062324A7BBFDC9DAB8D5B1E0FA4FBF8036AD46E554F9 | |
1545 | 6B925144323B7A79B103E808A43954DB3A03120EE5BF48438C0ED2807DE82FF1 | |
1546 | 6800AA8EEEA5C70DE747B76246A437B09F402C8E1B545636E0860F670D10E42D | |
1547 | 9A579DEFDAFC447917E0AE0AD49F49EFEEAD72A83149A22A82F909670FDF4A9A | |
1548 | B106147A6CD6D9CA4FD64191B7883E89C30FFC30D3262B9B09CD7D2440D85F28 | |
1549 | 983B191CEDBCDBC06375195625EB247DAF10FC3F01259E59184F462B79592181 | |
1550 | DF37D70E698785E55E0810FC9A5094CA115B2067FBEE8ECB004856C68A18AE7C | |
1551 | 9BB1186342D173068A4BD0020FC703BC1AE0D6C8EF419288D7D0F09042C5CAC3 | |
1552 | 6DDFFAF9A79B811C55F41AC87F93DF99604165A6D6E5938016C155EC65393512 | |
1553 | EF633ED422AD5BF8C66AD82B3B2B0FC59F40ACA8B62B2195D84478F920C39EFC | |
1554 | 328C9EEAB999D28CB365ABA1A99475D57D5BE151E107BCA6C65D535D8E83EF91 | |
1555 | 35EC4BBDC0C5A124CE24ED6438F2103FA03BC103F899CC0E12428A807763DDC6 | |
1556 | CD11E4E11749145810B387906A7B3065BCF1E29A1815ED266DB7A429C3FB2860 | |
1557 | AF3305E4FE74E02626385FAB8833954B803CFF6231810CA8CE55EDB2DC2B1548 | |
1558 | 82CFD8F105CC916B0A55E3955BEF60680B544501937E9A6FBDFF46E12B114967 | |
1559 | 2066512D019B1D727D3759A708E5D8D8FCD99AEB82B3F660602F8BAF091A7AE9 | |
1560 | ECBF15E7720F671E85C5FE0F2871CE1EC0A7B8E923EDD845F6C8F8CEACC70DDD | |
1561 | B2F87D25890FF1DB39BFF89A3A35B8B14742B4571F412CDF868177E406C9D07D | |
1562 | B759D6D32A7CE22D9E9FD13802A170F20E9FD757B9DA76B12712FF6DD0E8F4E7 | |
1563 | 4A296ED2795FFA5A0C3CE468C7A9CCA440C599C207BB084B1DEE83817A7F23EA | |
1564 | 1A4ECF72B3786D72D12FE3123D33559793046B7773C9E93AC1172026014A1917 | |
1565 | 4B66A90C5AF50072C231F0B633F00EFED86156FF0FBD451C161DD06EDF438A38 | |
1566 | 91FA7FFBA022A4468296A7132A3D88AC243B69C70F21B7AEB32BB5AA21800620 | |
1567 | BE6C8116466BB843FEBE361D1DE93F7C38033C95EBFA922FCC45E812B48B1A23 | |
1568 | C33DE814EE885A2354B37C05E405D27A0D3870E19CC718284FDD45F7926758DC | |
1569 | 62D79AC3C0EAF56B6812049148970442ABD34E0C0F49A6711A134C5568004C24 | |
1570 | F92B455E8085D77F48ECE5FE9F27FA91379C939919E78B60A54E235B0936B3F0 | |
1571 | E1300BB4CBFD05A18DBBBD76524B4084D54D990F5EA51E5670906E358B4977C1 | |
1572 | 83A7124F6BC09AEC282DB90C2FCCD9D909B57959E6E68D2E50344100EB1B6BD0 | |
1573 | 1A1FF2C2F0B250AC9B1FFB4A4EF3F28C022F7F873C7B3AF76E1830C9B039154F | |
1574 | B3C3BD97DB32958B718D53B552A7A0B033E84EE515B42184A22A10D77FFE32EC | |
1575 | 0E1CD1708021D7931DC73448FB098A61C93B7D03F98465BA42D4B927AB115C49 | |
1576 | C0CB10C0BD55B16E6BA017306506D3D610ABECFA480D8840DAAF23CA03AFD9CF | |
1577 | 1075C8E9B821499DE23D4882C081D51649E5C9BBFF1431057D95D61351287B03 | |
1578 | 0C9A6BD89F33C02555E1D3DA7F03CC395C1E3633FC902F060DF903FC96C19719 | |
1579 | A5B6A39E | |
37c41ab1 CR |
1580 | 0000000000000000000000000000000000000000000000000000000000000000 |
1581 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1582 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1583 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1584 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1585 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1586 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1587 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1588 | cleartomark | |
45c0f7f8 | 1589 | {restore}if |
37c41ab1 CR |
1590 | %%EndFont |
1591 | %%BeginFont: CMTT9 | |
45c0f7f8 CR |
1592 | %!PS-AdobeFont-1.0: CMTT9 003.002 |
1593 | %%Title: CMTT9 | |
1594 | %Version: 003.002 | |
1595 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1596 | %%Creator: David M. Jones | |
1597 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1598 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT9. | |
1599 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1600 | % This license is in the accompanying file OFL.txt, and is also | |
1601 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1602 | %%EndComments | |
1603 | FontDirectory/CMTT9 known{/CMTT9 findfont dup/UniqueID known{dup | |
1604 | /UniqueID get 5000831 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1605 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1606 | 11 dict begin |
45c0f7f8 CR |
1607 | /FontType 1 def |
1608 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1609 | /FontName /CMTT9 def | |
1610 | /FontBBox {-6 -233 542 698 }readonly def | |
1611 | /UniqueID 5000831 def | |
1612 | /PaintType 0 def | |
1613 | /FontInfo 9 dict dup begin | |
1614 | /version (003.002) readonly def | |
1615 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT9.) readonly def | |
37c41ab1 CR |
1616 | /FullName (CMTT9) readonly def |
1617 | /FamilyName (Computer Modern) readonly def | |
1618 | /Weight (Medium) readonly def | |
1619 | /ItalicAngle 0 def | |
1620 | /isFixedPitch true def | |
45c0f7f8 CR |
1621 | /UnderlinePosition -100 def |
1622 | /UnderlineThickness 50 def | |
37c41ab1 | 1623 | end readonly def |
37c41ab1 CR |
1624 | /Encoding 256 array |
1625 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
1626 | dup 33 /exclam put |
1627 | dup 35 /numbersign put | |
1628 | dup 36 /dollar put | |
1629 | dup 38 /ampersand put | |
1630 | dup 39 /quoteright put | |
1631 | dup 40 /parenleft put | |
1632 | dup 41 /parenright put | |
1633 | dup 42 /asterisk put | |
1634 | dup 44 /comma put | |
1635 | dup 45 /hyphen put | |
1636 | dup 46 /period put | |
1637 | dup 47 /slash put | |
1638 | dup 48 /zero put | |
1639 | dup 49 /one put | |
1640 | dup 50 /two put | |
1641 | dup 51 /three put | |
1642 | dup 52 /four put | |
1643 | dup 58 /colon put | |
1644 | dup 59 /semicolon put | |
1645 | dup 60 /less put | |
1646 | dup 62 /greater put | |
1647 | dup 63 /question put | |
1648 | dup 64 /at put | |
1649 | dup 65 /A put | |
1650 | dup 66 /B put | |
1651 | dup 67 /C put | |
1652 | dup 68 /D put | |
1653 | dup 69 /E put | |
1654 | dup 70 /F put | |
1655 | dup 71 /G put | |
1656 | dup 72 /H put | |
1657 | dup 73 /I put | |
1658 | dup 75 /K put | |
1659 | dup 76 /L put | |
1660 | dup 77 /M put | |
1661 | dup 78 /N put | |
1662 | dup 79 /O put | |
1663 | dup 80 /P put | |
1664 | dup 82 /R put | |
1665 | dup 83 /S put | |
1666 | dup 84 /T put | |
1667 | dup 85 /U put | |
1668 | dup 86 /V put | |
1669 | dup 87 /W put | |
1670 | dup 88 /X put | |
1671 | dup 89 /Y put | |
1672 | dup 90 /Z put | |
1673 | dup 91 /bracketleft put | |
1674 | dup 93 /bracketright put | |
1675 | dup 94 /asciicircum put | |
1676 | dup 95 /underscore put | |
1677 | dup 96 /quoteleft put | |
1678 | dup 97 /a put | |
1679 | dup 98 /b put | |
1680 | dup 99 /c put | |
1681 | dup 100 /d put | |
1682 | dup 101 /e put | |
1683 | dup 102 /f put | |
1684 | dup 103 /g put | |
1685 | dup 104 /h put | |
1686 | dup 105 /i put | |
1687 | dup 106 /j put | |
1688 | dup 107 /k put | |
1689 | dup 108 /l put | |
1690 | dup 109 /m put | |
1691 | dup 110 /n put | |
1692 | dup 111 /o put | |
1693 | dup 112 /p put | |
1694 | dup 113 /q put | |
1695 | dup 114 /r put | |
1696 | dup 115 /s put | |
1697 | dup 116 /t put | |
1698 | dup 117 /u put | |
1699 | dup 118 /v put | |
1700 | dup 119 /w put | |
1701 | dup 120 /x put | |
1702 | dup 121 /y put | |
1703 | dup 122 /z put | |
1704 | dup 123 /braceleft put | |
1705 | dup 125 /braceright put | |
1706 | dup 126 /asciitilde put | |
37c41ab1 | 1707 | readonly def |
37c41ab1 CR |
1708 | currentdict end |
1709 | currentfile eexec | |
45c0f7f8 CR |
1710 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
1711 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
1712 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
1713 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
1714 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
1715 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
1716 | C01924195A181D03F5054A93B71E5065F8D92FE23794DDF2E6BABDA4215500A0 | |
1717 | 42D1A3D0D02C0C98BB1D6ED0B7791274C38B038FC7921FF1FB8FAE7258C09259 | |
1718 | 4B8E1BD9EDCEDE9ADAD9BD9598EEA9691589649A9A21539161E374075BEE3457 | |
1719 | 689F308A4A7AC9F2FE4B301A6C36B0442FB92E3B002623493DC087800B5A0521 | |
1720 | 0DB96A23175AC584DE166F59142779F26FEE9783E28DE49FC3A8D6583EE63FBA | |
1721 | 610DA773CA18ACE6F64A4867A1A7817120ABF9DE4D17782866E6CB6B65A9F6D8 | |
1722 | 3667C8D3E61E5356E35343FDD4C6436DF73934470916CB5F0ECEA6BFF092E735 | |
1723 | C7C355B56189D1DD5715EC97E50145FFC17BB1497315A9585D713A7A6DFC7933 | |
1724 | 995468EFD0F59E3C15865B87925A3F2930E20D5A35970E2C44F1629FA16E00EE | |
1725 | EE21EFC50D49F5BC02300D0A7BB85E649CB4E2E828C8B1C5469463013E71D723 | |
1726 | 2CB11BCBAC191AC751A2AF7FC228395CE9472DC1809052012AEC2CD66695DAF0 | |
1727 | 4CA04234F0187F4116C93F59A7F1F8123DE87F111853B785A20CA8B49B3B0CEC | |
1728 | B11AD345E1A11578D2EFEB0536D125237086CC8CD9F34A5137AC5DDFD8746014 | |
1729 | D74AAE8239B81ACF65F379CF2153B06A238A2D767F294CAE0D79228F0B7D45CE | |
1730 | 510AC9657A1776202FEF42F96D476E7DF407786AEA12DEA0013D3B4C5D0640F5 | |
1731 | BC5BB72C34066270399CE595827175B23B25072723BD24E07F6BCD9EF0175DEF | |
1732 | 93714BAA53960F81103CFB731CED4A267B53727BCA3C97B0BA5004055D4EF0EC | |
1733 | F725658E53AC86E4061B489AD4154915C3981B3B703E1E2A8D390CCECCA99385 | |
1734 | 45EBE35441B062D7D12DAB2B31569387187D74A4043FD71F1C6D352EAE0F6757 | |
1735 | 4345FBFB6DB15CAE47CAC4BAE47AECAE5FF5EC19057DCEFA1B23F47364ABDF47 | |
1736 | 088A7C6A2AE26B10459B6D41CB69182FD1472F326CE3A15B59255D1DE3B616D8 | |
1737 | 9D1F12561038839781E657C896B8C58A32DF5AEA23732A0966D96C68C988ED7A | |
1738 | 09B7E2C8F9F3D0D56879764781566299A4EDD3588BDF70E3D924D25074F30988 | |
1739 | E35BDD827AE4D0B4A06F55A9976BF0DB3C0B1D09CD08E8CB168B50617691638C | |
1740 | 0EC1A791C228177D4FFB021EC3DF5082CA3487AD2EFC8DE9466A690ADDB4C52A | |
1741 | FE2A6DB4CC275CD33D9136E735279FBB2008D59E667905EBB04326EC33C98B2C | |
1742 | 94744B7F540D86E90DED64572ECF1EAD3A58EC101642B245A9C7232DC8FB8741 | |
1743 | 03F97883BB32FB955C22F878FA0FD114451A3B3859B0B5537AFAB73AEC7DB2BF | |
1744 | 409E1FB41D473714F6BEA73CB085139879FA31710E01915C2938C37BAD6D7D71 | |
1745 | 45B897E00857D3931A489EAC7B42BCE4E65F73F67FE027CE482DC47598ABCB95 | |
1746 | 39E98DA8ECA3E23F0799D5963ABA6E2984DEACBE7B46B40ADC6213E0F4D08971 | |
1747 | 58F68C946C748E4B4217CBA2391BE2086C9758F4E32C9B6413E48D84D33A6E85 | |
1748 | 84747029C0A9C9B92841D217A902BA8EB333999D62FDA9F82BFC8ED11F67988A | |
1749 | 0CAE42182E414A9766AFFF4B046A09D476F8E3F15A8C7829BEE982D8350BDF5F | |
1750 | F215F2BBBF68D4B567BAB798B9604C79306C475926E9FEC0F07A99F43473C6FD | |
1751 | B15AC29C3D07FEBAD1BAFF75AAF2FBE94F104F1DBF838044FAD94B661B06AECD | |
1752 | D9AEBD02B60CA4546DD6B5B5C1A3833ED07845671CEFCA8955CE0DE5DB8FC93B | |
1753 | 3306683CBFB8E5B79A863DE78D455DE9D592043C2686F88A43140F8B9F3B553B | |
1754 | 7047420E93E753829F8D47AC7621CFE3626F271E31F0019CC02D0B57F67BB47D | |
1755 | 8CFB63E902EA3231C00EC66EEC0D30FE8394558BD3535C888C4CEFC6EB72E737 | |
1756 | 712ADC6300162D5D79BEE0CA1F6E4127A0BC90656C01692F6D82C85550AFC97E | |
1757 | C2693E379160FDB9636FA41AE9C75B7F6643B05971C6D67CE30971D590FC07B3 | |
1758 | E0B36B4D1C7F25110B5DA2130D574FA292B47322975A2BADBDB39AAE69BDDBDA | |
1759 | A880F9AAB580117708C79204DFFDC08BF4A48919B5C22228845CE8C3109E93AC | |
1760 | 2479E523B8A1C12A6E541118F121DC6B4EAED83491A03192D5C3A2A45D1A2467 | |
1761 | 757E7B377C635CF5CAE11A7CB49D49F3A1BB2286090B5F0E4F89869D1771D50C | |
1762 | 54B5C5E091E3048A2C194F0ED00DD64FB95BAC6FA9D61ECD093ED416DA3A4981 | |
1763 | DB07CFF17C4F55C62DF628EBFF06FAC3F3D3F91C30EBB34052BE1A08F5EDA4B9 | |
1764 | 08977197950A282B84E21D43C64BE3AE4BCE22C70E7D392DE09D89B7F23351AD | |
1765 | 6AD37225C12BA79EC9951F5DA1E505DB26200190ADE0E549305B7530CB86EFD2 | |
1766 | A896F13A97E51754F70B609CB4511CEFC38BA579C071E9510A49982389980DC5 | |
1767 | 336D6C4A2DB100DFEC4055C7AA9C55880F94FBEA9EB280BEF66CB8E1E38A359D | |
1768 | E5AFB12B540CD599085ADDA7FC2C72E7C873015773FFEECA2C596B75BC39A3EB | |
1769 | 3C43FA2E53C0D7993042F3D652BCC483E48B7F6C94C3FF6D38E276086A6AE67A | |
1770 | E5A571B9C72E0D7824E0BC2ADF51A393B9E334649F786EC1923C854382B89627 | |
1771 | 1B9E701AE5A6C42E672B2C6A33C8BBCA8F69B9061E787D6B92183F20CF4C3903 | |
1772 | FF5417427B84798C82BE28D2C81624E3920CA61EC9EADB364B5A6E50E49A1A72 | |
1773 | A9A090A1FCD84814B8B2708AD787D2B5015DA1305874F58C5EB62F843685FCB6 | |
1774 | 465FCA80176CAB2B2FE65E0A270BCE1E3DB97564BEDFAE5CA44395A8DF4505C0 | |
1775 | 3E103CC3B914359B2870DA6CD30382EAE8949131CFE31E9E75C3E47A3834BB32 | |
1776 | CF183D4A8B9001710D0A11390C9DAD116196568591D38C2AF4ADD852F31494EF | |
1777 | 573462759A35415900360882739789D6B89ACEFA251C5ED90ED704DD7C3C80CA | |
1778 | 9F6CDED69537D201D520C99E69EEAD5D3C0EB84C166660B3C190166D93EDFE6D | |
1779 | 15BCB6DC5CDCA825E48D33845CC2FB15291AAB823F25CF8BB0A1EAED8BEC524D | |
1780 | D9CA016027141FAC9D35B64FB9C224552F29EF6B32497254E319090E698FD8A5 | |
1781 | 15491CDFE1B988C79A0E3B9D01E12FF084E9FA86CCAE02A3EE6F2917B61A2CC1 | |
1782 | 64B8CAF309D1AB48A34227A7729DFF99CB6EC282E3FAEDD2673779AA7E4C1789 | |
1783 | D93FDC37FE95F087C5F88F53D30A2DA9C913BF205FC6BDD060A40184F4AAEB3C | |
1784 | D080D63B89CA3DEFF310D09EF0A83F3914BD5B7932980ECE139EF0313C20B4C8 | |
1785 | 576EE0FE3F28FAF4D3CE7CD0890BC824A85B8EF4636BDF1EF1BB519F93D36540 | |
1786 | ED09FAF93FD71992CA2CE2E83F5355162ECEB32AD218092F45D5A61A44E67135 | |
1787 | EF0453589CECDC6962D0E8DA7E7567603BAF50B2C8F1CA65EA5320984E7D69AC | |
1788 | 9A7D3D7F92565D79E8C9DD2D92CCA7DE9CD058545E9F98AA47904D70E1897099 | |
1789 | 3C4C852B3BA131DDD348433C336BDF5FBDFB62120DDEAEB3255E3207B0C84A0A | |
1790 | 1ECF9EC869DB9BFA3693B03FCB27C5A5D3CDD62630DEDE91B4DD5B9784BF0BDD | |
1791 | FC6EEC3FA7ACA9E15FAE47CDD9B7FCD2BF0EFA10716F08C0AF25FF67CB6F9598 | |
1792 | C607D2FCA452417D2C69DC808A9441A66492394C3450BD30632AE739EAD654BA | |
1793 | 4343459CA36B6D5B2C12C39495952F2EF93D82C73E33236785A79609E260C4E0 | |
1794 | CF3A3C950DE71DDC3939D42DB1CB1CA917CEAD56979A70F8F3B207C805319FA7 | |
1795 | 3C000AE2B21D711A6D78C7BFB901334DC06F59EAB6D94B507734C27971F8458D | |
1796 | D00193645AB92FB8FE163D5C51AE4F40BDB4F2C51691E76EE0636F071F37AAA9 | |
1797 | BA78BD12459CA499210EB0CE2F8BD317387797C33F5933AE7A6264DA06B4A6A6 | |
1798 | 1188326147A16B205D1F965872DED7D8EDB3294FAD2FCDF0D423329E9CCF879D | |
1799 | 4E0B966D509F45527F7609DD09694D286F6FF7535EF8971B7DFBAF608A19D442 | |
1800 | C133207EB1152ABBD11C455D0977F66A9B73E51381D1CA4B66E87C0C7175A63D | |
1801 | 80C699A052F00C41DAEF42E7A40E07B1B14107AB0787E24E17C1462960E3C54C | |
1802 | AE73BE4924464FB177EC62F116B2822842541543EFF7ABDDEE197D6BD8F8D4E6 | |
1803 | 59175D8C5957550B70BE775AD52FFF6E7C00DA7CDC16E1DF7446BB5D8FD82647 | |
1804 | 3E9F87D5EA365C82A2D991321ECB14A9E3AEADC5A56665DF7072D6DAE402BCB6 | |
1805 | 14D92B17F9E063E4E9D8D239C91F5C7C0BCD2FBD936C9D4A0B57659420343B59 | |
1806 | B395BBD1AB5B6003F653699D57E7581F9813CC98D4F072FB78899D6DECC42D34 | |
1807 | F2787EDEA64058B46C4BFAA2BB96E9BE5CACE8D91E4C080ADFC0FA0D4A29C6B8 | |
1808 | 54FEA9E11DBCF53D9CA40A21AE5076451EDAB3593E56B6D453DC8EAB8C78B588 | |
1809 | 34D4C4F36861B5649BC1E9F3091E704BDA7613ED45C911DFECA74EEA05165191 | |
1810 | 825F95A947CAF382FBAF01F3B8B041ACCDF39718D7DC5BA6CA12BB20EEE96439 | |
1811 | BF2E2628AA3BD2C91998E6247A690FCB0CC95F286F427345CC4F1115BA3A6E54 | |
1812 | 4743355F2CC991CBDFF5725902C1F5A6DEFDC8638A26EA456C33C27773D6214F | |
1813 | 66536CD2E44FD253531732D5A8C44B336B1BB47B0477350EB8CF74889B93402E | |
1814 | 2356A9CAAFCA562315D8E0B3F42F08932CB87BA2499A875AFA08D11DA73B38AF | |
1815 | F46D03B7F639A8D7BF88CF07FFF4E91716DCCE6E2CCAB60A64D5E40EFD8B336A | |
1816 | 1BFCC4CB04F49DE1FBDE7AA5B2092A6EDBD913D161A3271AB6411622D0E14416 | |
1817 | 37F81E0102F5B0F2F9A2B27819E4BACD7C50E29D6291AE5B0973C657761545A6 | |
1818 | 741729620EF2BF1046B3913399C10982EE5F4142CF461EA31042E432CC79A1A1 | |
1819 | 39C607D22E45A6DEC008CB4BF6007CDE9DD5802B49A62C8E02A6D448B64177CC | |
1820 | 887AD71D171B99E7ABE2085B37D90B3BD8513995D9A57F53184DA474F6DB5E49 | |
1821 | B73E04CC214EA5398DF7D7541F94E623E8687B511640457A48A68E9D9D6584CD | |
1822 | 15B57CC044D8091C771D175F2EEDD411099BC8F7B4317DC503BB5E405AEEB526 | |
1823 | 5E6E1B1F2705275D274E012A98F66075CEB90AFC648B964DDC0E9C4AE7B24CE1 | |
1824 | 80B051022E5781A533A21DCFB97893847D685137EAD85BA708A7E118C72FA839 | |
1825 | A9E460B5D17365A0AF1F53A98319FB64A5819B087F554BC056C4BE44113A5404 | |
1826 | BEF759F890C1CA5E7AE156F4F8106FDB4F8DFCCC640976983EADB30976344048 | |
1827 | 2A86D7B2AF4A01CA736B98D52ACE392AD4BECE7E61C710B08B66F01857CA460B | |
1828 | B8376E257113E10F6DEDF14CE2A4E6A99ECBCD302C36CADB713D849EAE9EB598 | |
1829 | F29DC98531D793B79F83091F9B136809E006F34E423D528CC4309AFFB3EEB47B | |
1830 | 9A9DE4D5B25CE953345C326BCBE2B4912641780637783084D3D12693F8135483 | |
1831 | CBB0AC4EE0B5610D7CEB7DF205830BDB9BB404DC1B28FB0824CC187B26C19A91 | |
1832 | DA0025EC739BF3993700101D042DED86D67F5FB87912CFC51AA7DF53F2162D62 | |
1833 | 6314A2CE13810D0B8D81F45771391A236422CFA0F35F7A0CDF14ACB2724AA57B | |
1834 | 7C2C28D53029B1146558610E0CFBBF72A85AB9BA308F846228F299F13F68E8F7 | |
1835 | D963B2EE9EF7D4C21690632B640BDDAD0556EFA4EFBF035F13377ABB5CBC280B | |
1836 | 9E0C12AACB153C93351E5BA95A7D149010E204950A59C7FC6581D9703468C1E9 | |
1837 | EFAE37E7E6ACB892B3F8D1248D9A4A72F642FECC5E0B25C15EEB921EDDE84D12 | |
1838 | 0E524FE6133C4921FF4921242392C12FBE69744D53739F7E849C1B96C4020AB2 | |
1839 | 1FF10DEA608F111749E2FBD8DBCB17F353DCB3075B4F4B8186963EFE95A76A10 | |
1840 | 85AA5BB6DB4095291974221829A8E436680F4860E01C3843BE5BB3101D0869C0 | |
1841 | EFCE08D187BC04F58C7A450A59093680A0F09E8E3F12DF5223E7EAFEFA01978F | |
1842 | D8354753A68022CC92C71F2CA732DADAA8A466D4AAE5999B0DC077715671F518 | |
1843 | E6277741F44AE798EE50DF44CCF71FCF8BC71F76374005FEBC4883C6EDA854B0 | |
1844 | 88C0C2B476709AA809ECE41AE786DB1A32B3FBBCC14921673578D3514C8CA842 | |
1845 | E1FF90BE33F7B93ADF6BFB8B1AFBBD080783BEF056A6BFAEF676F7BF9F2DFCC8 | |
1846 | 01D255A9F0391951210D60D4D4DCA93AA858B38C0D7B8FD740D5FC6F277C2A68 | |
1847 | 54CC2DE1F40B6347201FCA2A0A91822708D820CE645C3E4E5A09FE25721AB33A | |
1848 | 97871ED448F38FC5A349D81F402B34461D840D5768BFC6849439AB6115104F78 | |
1849 | B87115B1DAE12542EA898F86ACE247709817850B067F537E6137196101D46DD2 | |
1850 | D842EA03EF4501E34074E8458E638ACC4EB349A7430AB035BEF2DD4CE00554F9 | |
1851 | 18F9FE32A55AC1E7E50D64AAFDA278D77A7149C59DC5B1E3064A4B281A54C9CE | |
1852 | A5EA94ABEAE4C6D5674C208ABC72563976487136AF2E21F835BEFD232D7F0D13 | |
1853 | 1D19932367F51D5379934DA7F1635AC51EE5CEBFA63D4D32F018DEF13624EE62 | |
1854 | 31DAE68A08DBE3B4FDAAFC75291C8C6CC7A657E3C7453C7D1461A36E88E633D5 | |
1855 | 408253B673AD87A9FB2D0F56DF1305916D14D5DD62051E27BCE09CEE9A1F14AF | |
1856 | 1D7164BA5FB6E6EC8D38750F7E28BE330909F303ECDEE692E347DE13C8C2F82E | |
1857 | 29C8BE6EFD76546F362A12A1C2DC12389EA95ACB4DCBE95620F0C193EAD91B33 | |
1858 | BAAC5801AE827B9AB3FCE5D11D1D7854F8FA8A31670119CC0CA98628F801838B | |
1859 | AAC7EF90AC5466BE69CE3E3CD9951A5EB9AC08014285422F6DA6F6E221BB30F8 | |
1860 | 0042A11F2E4B765BB0D142AD52F4D85785EA71B2E1CE20728B9E9306CE93268D | |
1861 | 99B822A5AB5232EC7E26EE1160850AD3905864A01357F22722B6A54D4EBE58CE | |
1862 | 480EAD9FBF068EE965AC4B5FD2FA8CCB91ECFC6E90B9C49268CA0B0FDAD23ADC | |
1863 | D5A74B41149BB08454054C451AD0DA4CCF8B60F2EBD061AA03A011D548B6B481 | |
1864 | FAB00AF9225BB5463F27FD67333FB51F8664536267E95CFAA0BE3BC1B8F889CB | |
1865 | 587A3A4FA2B45864F07E11372C9507A625C0030EF7030A0B4D931BCC48F6DD51 | |
1866 | A4D1F63FDC4B59C1CB18E6242E9F4B4B8AD9755B870FE60D640181FB7EB8120C | |
1867 | C56F51DC8C47FCC6318C2145EDCBEFA7BC4253315BA67FD2B3D4AF6A9F3F229C | |
1868 | AB75B592EADE15B1FB5FDBA1C0F786BD21A51506B7A2E42C2D086BA6F84D1B3D | |
1869 | AC7531545F0B01346831FF36A52CAC1E390F99AEDC265B44B0FC9C581BBA6BE4 | |
1870 | 48B723811EBCAEA5FEFAEA7E5B987F2C7B3E9A65D2D14A7B74F099401C57E367 | |
1871 | 385352D0776D2A908F7A5A2E4D4160946C5591397877025C8C387CA413EFED56 | |
1872 | 8B142E8341E349DB4DBA422A4FEE56A573972A0C66590175158E48850A9F7F38 | |
1873 | 4B95726787B8F969FDBC97491CC81CABC976CD00A27D1DFCA7CF467A956C1C6C | |
1874 | 839817AEF8794B6151FAE9261119DD5DB787DC9D3B420FD325ED6599FACADE0C | |
1875 | 320D54C2E0D296537E22C1783670A9D9BECAEC63853EC2F05A990260DC189D63 | |
1876 | 7CCC0BDDF2CF7585071ABAC14630666737041194D0777EA4292AE60BD7F7100E | |
1877 | DB568C90F0D899EA006CA423CFFD6EC70A5D3D8AC43C747DBAD3B02219E47D8D | |
1878 | DE030631F4678C357A58ECC52782B31B50CFD44EC33F41585E51B27E3997D33F | |
1879 | 461BEF897220AEC80007F13C5A1EE3A0430CA899047DF944831F8B010A7DE74A | |
1880 | BFD26001472DC00CDC9F17CC435F61ADAD4E9AE062ED477FC621FDDF9242C449 | |
1881 | 1BB3F77FDD1519A251B663A693D84B42BF0962F537757F38CE5C5D56B98AB10A | |
1882 | 3B70C8AE8D52DCAFCEC22E7B09D3C4EFDA1841C74CA975E4F8294F7BDC796500 | |
1883 | 0ABE197ED3737A65F7BAE601C91DB3983EAE11DA3EA18ABBBA3650DC361C2E77 | |
1884 | EF9F97618B0C337A906FF39926D2B0B7883ABBA650816C4C6B34EEA836994EEA | |
1885 | AFEDDE56E0099D0E09EB88EB093544B9BF4871200746A0409C475FC4232A38D8 | |
1886 | F3105B0FF44E4F132378DD12D9E796412FD0F9478322215E9F59E69396C35AC4 | |
1887 | 097C4995B2C3BAB2DD04B1A7097DE16DFDD76465E79ADEEBA90489ADD0914EBA | |
1888 | 53E11A43ECB11D072C68D2131BE1C7C43CB9DD5FBA0A67BA43D6851AD4CD3BC7 | |
1889 | 39AE2E22CCC183A56CEB71D4F9F578518E376426E42B6390426A8434B5A83E78 | |
1890 | 77A5B9963BAECD5FA5521C2A29418764E4EC1A72462B04957F823E2817A7F8D0 | |
1891 | 1512919889500024B1C42EC107E8B8533C0B314EE4E23313A4C1BDB009A2073F | |
1892 | 9BAB479A3F9DA76CCD65629CCEF78015ADBC2D0D124B3BB2D322FC4D209E417D | |
1893 | 84BC3C758B6AB64A01E25C9C7B71D741AF90A19A339F99A0BE9FC39622F04C6F | |
1894 | 737474CFEC19C890A657BCE192B9DCD8F273CDC5294875DD4507DC5723EBB357 | |
1895 | 73DB0933927DC21081E67E5DCF4E41FAA6E00E8DF04128F86348FB0718068FA9 | |
1896 | 918319C4EE9D090CDF348153B6CC48648C55E889B4FFD3D75466F1B50C437546 | |
1897 | 7DD9CF20980B148F60BB146402DC0732A27F255DCB859CFB6F9D329C12FB14A6 | |
1898 | 7824D6DE27B03FF85BC59703A5D6C5B7D1CEBCF3C3FCD71D6D6F0311E41BF8BF | |
1899 | 0609D23C84720FA9EAC961C9D49C2E962D9618C32BAFBAA8CAB0B2F616E57DA6 | |
1900 | 8CB44C5595A22377B28599F7D34A3BEA4173E1D31A2A6C5670D1F026EE2092A1 | |
1901 | DD0D2BBACAB46E5B0A7113B1BC379709C5870981E482E01EE3D16AF9ACF1A5D8 | |
1902 | 7ABDB4BA5C3B13AF047826F360C8892642B482C3C61FAC97F332888AE156B35C | |
1903 | 5C8415A75B4F0F25F8E95BC4102FEB4A8287C544C99778EB0C163C22481F615B | |
1904 | 0004F764FB7CCB01AE01A614AFC9650D3934F748E8785416BBC89F66C696AF5B | |
1905 | B5F6F125F115241728D85E7159FCDBB10B64598249BB0E6FF1AF845B0A2370AE | |
1906 | E6A973023FCAC4BB6158D48B0C928ABC4E29A0DD611D0F5266AAC8239064C266 | |
1907 | 82D4D33B032418967406BC98156CFCE1F091F733D8BAB9523690B4D6765DBADC | |
1908 | 210E814DB8715A269474EC0501CF66FA0D8FD224EDDE93AF243032E73714F730 | |
1909 | FB382372C0F9B9372450FA6F13689C9429EDE1A105F234B216263A7D0A917A15 | |
1910 | D1FC128580A16B5572436E398C353A0EC62539CAA188901FC30DF7511C1BF6E3 | |
1911 | B462203AE937653C4562FFFF03078EE7A184F554E6F01932AFD07722A00E50BB | |
1912 | 2D2BB785961F76273A16CEEB0EE833DFE14BBA539CC7E48F67A9D20C94283137 | |
1913 | BE84025E86C714DC9C6FD7CE4D1D0C50B6EDC79E066521FDFAB6285C83A68B4E | |
1914 | B1A119875B4E45BF5403950A25286214CB4183C345173F72E6ACFEA5C13B4D2D | |
1915 | FD12BD235193EE6BB66519B553CD963EDD68E7EF9439DF0411C8193ACB183C09 | |
1916 | 4143657304B1BE2AB8D2D0203E677FA1DD01152D2ECF9D987B16C3FE0B3F5F12 | |
1917 | 5C920243E1CB5FDCBE97DF55102EDED12811F3F7165F4FE1F6FD5A6BA809824C | |
1918 | 041FF9441529509EF4442EA873E8E7FF507607D526DD27315859B31D0AC11475 | |
1919 | 53C573EBF9DC37A4667133E99D8AA608ACB729F90B736395211043CCA3272AD1 | |
1920 | 470F1EB485629AA8B9DCB56479F734703D859F1E4EE8789FD6F739D0122348F5 | |
1921 | 1D487FAF1F24EF7A14CF69ADE7A87550F55F394506BC7627A5E319B30F362528 | |
1922 | 8AB497EC03B69B58736A5EE0AD63743E7F22125536104674EA63F9AC5286A746 | |
1923 | 47C73EE8E0320E7DC098CF43F23EDEF32D213523125110140F46202435EA8E79 | |
1924 | E285C7F3AA0C5877F75FE0F16BDF478A00A6F380C7B677BE479FE900ED3C4A0C | |
1925 | 832966F634C63211B58E9AAC3A3346ACACBD040164B491287B45E0131479046F | |
1926 | B430EDCF59B0DB6B0594775AA57CE029EE8DC445463169EA976945A5765AC390 | |
1927 | CA615933FD05173C47D30DD5CCBD56D89B4557C7192C31D7B500B779D7DD3707 | |
1928 | BD4B64980767B6C9A1BC9A948DFB8518AEF581A1D888C6F767F3315EE99F57E8 | |
1929 | 4EAA54D04A3A9E34B100024AA7C49DFE273231E3DF17073CCAF5B0EF20566755 | |
1930 | 6831F85C57454D1B0A5A8438EFC7F4E396F09CC200643564BADECD2208915FEC | |
1931 | 78E94025CEC8ED965EEE5F6B8BA081478231547355F93491915CFC4DBD619862 | |
1932 | 0F99133CE7F44756C593C8DF1874E973237ACB17F9614B79D45672CF62AFE009 | |
1933 | EC61B395BD96B0081DE750421A41E9D474F0E030C6B8591D364F29A6D7246EF1 | |
1934 | 6B4CF9B931A9A474011C62D504F408651692921AE83116CA0E4E6F41AF877FC3 | |
1935 | CE77764197719291E68B01570AB7038D91B8B81EA501DCB5ECB6083B6764BE3D | |
1936 | DF21B4B3A1E1A5C917F324A1CE5AF92BE3B2F8634A140637425F9BDFBD21FF33 | |
1937 | CBA42069981B230D211602FEF410EFDC199B6DF283343FA5E6B4FF2804DE56A1 | |
1938 | 61DDC684579F82C65DAC3A4F92B34FFB6273EF4F4591317B8D2250850BBA236B | |
1939 | C1E36185BC3C8C7A7654B24D7A10A489BDF675F6EFE7B4253F14CB3B5ECD1756 | |
1940 | 1882F3D139EB5EC7860D70A176D1536F5119A6C23EE9AE9AB21B586DA19B483C | |
1941 | 6BEBA87C457B9DE3D7C71DD7F97E352B642D84455E44EFC54417ADBE7E190F7B | |
1942 | 7ABF6FA0EA84A394C8316BF420D6E2DE5B867E6D602365925C3ACFC69ED653A1 | |
1943 | DA30FF3B49D407237196B9401B1EDB7EF2260E582D02B18EDD38AC0016F28896 | |
1944 | 0A61CA720216012D0FE2B58D5D675D25A679B1D70FAC10A4EB38060C0BB1AD1D | |
1945 | D1C59BD5F44FDD8768EFBE75B6795543533C02198E21A4B8A5430C2C432E45AA | |
1946 | 0C0937D6CED532EE6714C58ADFE2B15B117E9AEDFFC1E172716C756260BA9931 | |
1947 | 23AB837CCC7C36BD6B86B628BAA7D6002720AF00411E9D039E435EE479D5015E | |
1948 | 23DC9F3993546E50A442CD9D0429F7AF22D9F14064CADF2A3062F218582CA520 | |
1949 | 3FD8E0F30B224408594EC426C8DEA57ED60FAB24461611E86302C421BA600CDF | |
1950 | D4EDBF4044F0E2893143D4BABF0A6AA09F28FB4190B779B82A61C65264A199D7 | |
1951 | C2F50BD82837F08970F630E1CC74B4EF421B1032967FEF552DF3C1C83ED995BC | |
1952 | CB9192ED8AAA906CD9708A4882150B27B1E75FFC0D1383C50BB3E6C36F5CBF28 | |
1953 | C0572BD2F01AFFEE5927EBE3B6CB8FE778ED2B524E252F59AF00A3F8F880116B | |
1954 | 8EA655D9C6A68CAA28DB7A75003D0C3B653C7587BD1A7D93BE73CA6219024EA1 | |
1955 | 07C31E7F7BC9B874183C9337538C925226CDC48FA25D51A6A0677A2BFF699AE1 | |
1956 | E28D9E58369BD6AD73ABA706531DE565E1984A9C89D0C1EC6FC030A93D3D863F | |
1957 | C45EA66F195CFEFF9A03A1673BC544FB4F491AE5E50ECFF7F34B095DA96288F4 | |
1958 | 31C02347DCB6792ABE9DE684A1A92318A2BDA38C2D8DDEF29B8FED450DCDCC7A | |
1959 | 5C5D124FF0DA047D37E8874370D5537AEE869E771835EA607E1634BC0707C0FF | |
1960 | 75D5764B867BEDD8FA075F0CBBA7191B3CBAFC9EF8DFE79E9D7FD5A58916101A | |
1961 | A920F37BC5EC845621EFE3A953C19853C2989FD31952FC4876A8F7C58C4F21C1 | |
1962 | 31E6ECE0389BFDC8D6E391B04D443EDEFAEB77985808C398583BC4D8C9979A38 | |
1963 | 9842C4FCB7A4E84BD67BE72551A43B2B330293D8655A3D6655A2358E014F5686 | |
1964 | 613D19B474AE0A92A80E6E701F4B63EDAF59C3E12DD961A5B413FD1CB5400743 | |
1965 | 91F673B3502C6FD90A1349D649EBA4F5D8A6E5AA41F1A4DE1C387E22C9CC2733 | |
1966 | D542291D5B2E5CCD0E1FC1835BD6A74F5DB97FC174730AF33CFE5E68349BEFB6 | |
1967 | F2C76171C578412F075F9730567BE7A2644B17012DDA04D681018CBE09BDFCA6 | |
1968 | 1BB460699CBD6006C031A02634BE0B16375FDB9C582EBE6683B60768BC3901E7 | |
1969 | 4388A7E058B61713E3046F28F5ABF58417DA878E1870787C472FA08C2FAC7517 | |
1970 | 4CE71727BB69D19BB40AEB50F1BD66704EA37D2A0B82F60D72E15440BD27064C | |
1971 | E67CA41D97349309151DA28E1A7850587569A794E9FE46848A4611066291973C | |
1972 | A6CD19857B92F0E36B271F24D54ED663A7C64DE3534B0989D41E21E01469AD69 | |
1973 | 916AE35C5177C6BA8CEDA45C92694077DF3EBB0377269619F9925876919A472D | |
1974 | 14751E6515118EF9B84A5DD8C92695818BA4C959485EE1EDB6C6D3553B6FBD27 | |
1975 | A0FC42DDF20BB335F7D46F0951C51E9BB69FA6E7C76A8C960FB6A4305FDD2A30 | |
1976 | 234A5EFA64C34948422255C14C2A0D8A57174AFB7DF3DB2F520EBB401CA2DD79 | |
1977 | FDF6C624654DFFCEA8FCF5B34C34CAA7C6EAEBA6DC98E8557042126E49E51C3E | |
1978 | BB7C91497A44A69E4EBCBDC0656AA5A7F419D0443576F530C8136AE8612589CE | |
1979 | 781205654730006F3A39B4F3E5301784F164A2C87C2F86C894EAFB5E79D7231B | |
1980 | E410219BED0210BADEFCF27EEF683A01FE01DAB70AC8DC4E82ACCF6B5BFB4DAC | |
1981 | A42AEF344755A06DE8A6BF6F2786435E2EB1D103C8FA4306573BE699571880DA | |
1982 | 53548A1FC1F24E50B3C2BACE9261C0245F671694A0FBFB4ADAD535AB9949C020 | |
1983 | DEFE36F7EA12B3F8D80E3E3D7B3CBBD8B6EB0AD2573DD5DD0B4FABBC790C9F28 | |
1984 | 428B33CA533D5A6348D1A64D868863F4385A3F19D9F4766B6B81CF634981090D | |
1985 | AF0D763F09A2919A9DABC0DC4602D72F8747176F947A92077956FF59FD0D88CF | |
1986 | FE224B9B16C5DD710E6DE3B94D47DED695BCE5414A3794E4CEB7845915272ECF | |
1987 | E4A657C7B53DE7DE96A8C901DA24D54A467EE083181CEE606E5917FED2C97728 | |
1988 | 57887C7D19EEA950AADF6E8A99798789757BA126D925E330BB7D931FDF4EE14A | |
1989 | 04F58858CE09DCB1F57B8F780DABEDD1C26D72C9A5287C9DD30365693C5DD06D | |
1990 | 7365B309AF1C97BD3443B393309929F6D1AE27A1CB55C2F5085EE81928E138F4 | |
1991 | 4FA21E90C89F0397C9CDB4D707780F2418B38D8A8D76793C868D4BBF10AFBCD2 | |
1992 | 9BBB8202DCC02C37BE63D3CD22208A23743025921A54307A72037E6356EF807F | |
1993 | B2E7DF2B94C51F19895C3C059DB4C42C2DBF4E08E27E31A294B580E2367D2F63 | |
1994 | 0C074F03DB73EEC7293AB98DEF387B3C18761C716EE02C95315A36D42BC5334D | |
1995 | 984E6E35587BC0711D1B7F8EA8656C8059683C49CA41B0520D6FE1952A1991DC | |
1996 | 659D83269307EAAF5A9CA8000FA086B55587FCD0C798FD93905B1CD88A9AA33E | |
1997 | 9DBC2FE2A89CC800565567422052BCF5BAA443EB441E3B7B6AF0322014458764 | |
1998 | 7AAEF162D0E03F28F1D0A0EEED8714442E9DC41FD4B90436DB8A7E3A9431E726 | |
1999 | FAC0CB7151B6236B2438DCE9EE814A358DC10699244FAFB932C928E0E878D91E | |
2000 | 36E840135A9F372A0DC2EECA730E8490F4D42DE218150497C5EE87A5FF5C2282 | |
2001 | 3AA9D4B71996F86F8BDA700EBC01E3054459AA3F87CAB9C3A230551D4534C3AD | |
2002 | 18F6C76C41E10DB9DD67D19614A516BDD39C432005676C78B36C53BDB3646934 | |
2003 | 3AE6BC84D339851BD4D07CEC26129467C7181760DE58D0A288FF1F0DEE52D68A | |
2004 | 8423FEA92D3D9331F75E3B062BDB37BEE45D5C338BFC462612D1CA5CFF432D7D | |
2005 | 89D34ABEB9F42CB40A63BBECECACC033538136B3F9B81F1230453A52549B648F | |
2006 | E8AA9EE2B0AE82A1904FB78A6237247DD96B906B82945AAA772DA058B85494B5 | |
2007 | DBF53ADE76C1013C1DCC7A19AA3ADD198E3EEDE3269C4F3A6DFE54CBD17C7608 | |
2008 | 3BF7513E37D9C8D688087E2A09B863882D46454A5B99CBFF538C008FA9BADC2C | |
2009 | 004ED4ECE65C4301862323B134BA11C6D4E691AA899C0E83CEA6A625AED13F65 | |
2010 | 78D330A389A6D6EC23CD82D70D53D4F571C9D872E1A09679444FE686A12647B1 | |
2011 | 6BB67C8AA4D500F6DACCB2E0C682C835D24C646A51259A72ED3E281C93743832 | |
2012 | A51B3B89D38E575B8521A39D87F8105F892AE9BE53FD758B8DBE2021716ACFB7 | |
2013 | 350D5408C621CDEDC04E63DC4468C301435C2C2D61F3B2C24117F9ACBCD9E3A6 | |
2014 | BEA36A9A4227287DCACA0EBB1C6267F23BC0C3E0F28A89184FACFB919D49843B | |
2015 | AEA30EDC40944FFE38FFBD7B33B6B05F5AE1D0E168E924AC698B7200D2E86C14 | |
2016 | E79E6768E27E848768A75DD694B48FE4839058824A9F5C472081962020B96FE8 | |
2017 | 45DBD7153E2086C2DECB97B99850286211660573EB090E315BD727C989B8FE41 | |
2018 | D25635F195218A2F15FE8A5C5FAD2857F75969D1257158EE5C52055C1E11D18A | |
2019 | 8770E2DE895D7118B3886FD549441424F56DCB3820D5709B9D838435AAE4D64B | |
2020 | 6F49CB37B640BD905D6C3FC1E53C8304B0EB694269D6C48D81300DD537373040 | |
2021 | 65B95EF64F81AEE581FFAFFF8B32DBFC16B4F1F7FF9DDCE9CF5D6A8A6D79E4C4 | |
2022 | 209E47E16C32343B7D8B65D863F33717FC01CEF14A0F012805FAA46552535809 | |
2023 | 14126B88CCC2F0E276F5EB42E0C7628CB2397645DD951E31566B9D80F4379A57 | |
2024 | 8D10288DD980E93AD47F7F5EB41C4E0DE8AFC5118CFE87A804F309C6A9D1E126 | |
2025 | C0912E55D9B1FA95611FE7FD22C722610746316AA8703953AEE8D52F4B67F0E8 | |
2026 | 1C12A3A1A38B3AFC87E78B29AB79174E1CB09880DED63F5EE28AE6916E9BDF2D | |
2027 | 3DBBF6F8A09A229BCFE45B37D0E28A3A519DD20CD8B7AFAABCF0EEE058EC5BEC | |
2028 | 98CA3FF46CDB8324A5CFD9985AFD545B1425BA1B1F8A3209D159925194C2C7B4 | |
2029 | F353F587F1CEC839996FB9761DA1343F24A17BBE4206324041E9DB6DC5CFB21E | |
2030 | 789DCC82093269E3D2894773C8BCD25DB0D6B3DBF7A799276936132C262C2F0C | |
2031 | 980D6689EBC8459C62E19C91EF5169439185F8DB0946D7156108A689F9B0A52D | |
2032 | 10E02422207CDF2CEF1C2B5D3D50E4D458B4A6C936CE9E6A6C4975AFD8790E5D | |
2033 | 057FACE7B96263BAE67A549B42F8CA016C5EF42B55C2FDF20D3A25A68B13FA44 | |
2034 | 99D57478B9FFB6BACF69CABEA3C64B559A0D0897176CE2BE218396DD2CB25D70 | |
2035 | 59BB599060F97D2CA6422F46D28D3FED8AA36FE161A91DADE4B621EC24BEB0DB | |
2036 | 31FAB9F4B67209C5DA12F4AC49B8BADD510C8226962D4657A80DD7DD49104E88 | |
2037 | A0287F75C8784516C98BD7BD15D91F4513384B46BB097291EF6D6229A529BF62 | |
2038 | 0A5F4AF3C21150A058B08D0B47DAF540DB98EAAFC88E117BC9DBA9AC19DDD756 | |
2039 | 9A90C45BA3E8C37368C7E44BD6BDFD96619ED819CB067ECBC13BE325409987C6 | |
2040 | CB804C705C040AE82EEA129A1A7AD4B7B362E799F2CE5C0390722A16FC60B1E8 | |
2041 | 44B0B85D097AE0D5E08DEC18C3E576E22268D7F0CDA46D9469019C20EAE9BA74 | |
2042 | 7B49EA6166F5AC94672063D25C4C0E8FCE359712939ACEDFFF9AB5E7442A2A00 | |
2043 | A7E7A05E9E10A209672155C03EB12CD5E80155A5DEE3D503BA08D71E423C472B | |
2044 | A74CD26E15A200FBAB8E94086928E73860E50BB7389B3A8E0E833ABAC5FF8C62 | |
2045 | B894E007E5C220FAE6D53ADE85C747BD84D88BD0F40132A0D1FE51ECDCE1BE9B | |
2046 | BD89734A56C3577515520025A7743F45B01D74588DAED6FCC209CC819CE0DC65 | |
2047 | B590337F93D92D71615422728C6A8AA4D357A4E350BF6CE2480D4E1A818EFD9C | |
2048 | E6243B96F72EF5C5E88645A73189D9772E97911A0713A03201A69D78A98F743C | |
2049 | C0C8562CD876F8DE0A488CCAA3EC11142190BC32B2D8FFBEE6E155EFD20BB003 | |
2050 | 055C74D843F2AB34D9552E5620FACE9E40C04DD84E29A602151B7C3352798963 | |
2051 | 94674A8246B77CECFCC9A896B64F296EBD891E669A538343C0394E6634D9BDB7 | |
2052 | AB6D9C584DC7DEDF6AEB695FF83953653CED9E2B7F6E5D2A965B60F1FD3DC752 | |
2053 | 3FE4EBD010AD47E0A9FD989B15559783B429F50B3A70A1D8CFCBC150A492A8C6 | |
2054 | 4F570111E78A66DB463BB2EA226890FC25BD5CCFAEDAB7DEB2D081480821426B | |
2055 | 45EDFD5C048A41F295415C43E86930C53961D954B54F6886044A1C5F6D2526EF | |
2056 | F6521BFA9BCEA510AB3E1731719DA2E83729BD08AA2814663532756B1AC5E199 | |
2057 | 329025C143B47106919977514AC51B681FBBF5B115AB82A15E24C7315091DFD4 | |
2058 | CD11E813DCFB89355F4CFAFBBD54822018E7EA7ACB3A06DE7B571267E0C66BD5 | |
2059 | 6DEFA8A8AED615B9A7F40B138841D094D5BEB32197BF5213BA572AED3C87AC6F | |
2060 | 6ED6356BA2A2B9A3E26E43B3E6780BB66CC93A1A2CE94C90D48ADCA2BE608B64 | |
2061 | 7C0C0410A9134B81EF24CCDC7426E5096CAE44EE96D666A4F3F72774105AB03E | |
2062 | 320FC752F294CA8A537BE8EB6FA85F069E6809553D3A9CB3384E132275D2028A | |
2063 | DC6CE52E75DE9142E8D19C656F7A74D985BEC5367F151A151E5D41346AF70ED3 | |
2064 | 14D68F0C83E4EC225E6F60A48200AAA0FAC3725551B8859AF513FFBE2AB3C205 | |
2065 | DCD56B1177021C5D819DC38BA8A042DB92A0A34224E37250AA0F65707C2786C6 | |
2066 | 189F518C2E635D327D999949C4358402F4EFB6237C8A0A8BBC01E9B01F58A83E | |
2067 | 3BF161E39EF504F2E31BB62F27B4830EAE9B05977DA47EF338817109E0BA1059 | |
2068 | 6DFFC6426DBBCE33297E6D36D3492B098C1691DEA31FDF967BE80808199760C8 | |
2069 | 46E9D075B01F433DD5A43A2AD872061B3852B74BB421B3564E57C44ED0DE500B | |
2070 | D976E02B51C656974673846B1B5E31F7F9EB5FAB81F92F62ED34EA0715950780 | |
2071 | 6F5674E2D6120A4B9B89F749120921EE65043A66F0272B75C05BDDD09217A10F | |
2072 | E9E93E647617CA513F52252556D23F34248D0EBDB3FFCA6BD7C31E3369CB1F0C | |
2073 | 20BF53BDF7C4F7A1C37BAD112254C227FACDFD40CA33EDF4688600E16586A5B1 | |
2074 | D53C2AFEEAA2416B29948B4FA677FC1EAC94B4A7A2AA4EFFA901F90B56BC2F04 | |
2075 | 921AAC33FA46982497BD267EC185F64A2C6F51C48691908568A4F9814175AC6B | |
2076 | E1B34565EF12D99AD27B74481FCBA29E4C58C8D031DAC1E58E24AE5E432C74E4 | |
2077 | CFDA7278C66FE60C11D9501EE25CFB8F816F06D1427D8A8A119F7E9A66471847 | |
2078 | 90BEA16129627D6E12463C9DB6E4CBF9AC20F51EEFC808ED48D41F334115616C | |
2079 | FC0F037AAEAB996F754FA6A8653B8912BA0A9BD0D0EA381B3A54A86155156D1E | |
2080 | BF1BFF694F9EEA20EBE388D4F01CE5117C0EA6E061B807AD4B53270006E6CC45 | |
2081 | 5016272BB7FE8540070D51A260A018E09D9A1C7CB3E3C6409BC1993E59667A42 | |
2082 | 049F2393C872D0E8EC41FBC2671D0F5E4B99BDC5AD13F7B0930B881CC049FC39 | |
2083 | 938DD4D270BA8FD68DFF2ADCC21C7C24ABD1391C947142F1C7CC6E7EE5D31252 | |
2084 | F84B92C304757C0B8394E9E2C2D4DCEBD7709FA645B883D8A5F9657FE6116F2C | |
2085 | 891F3DB3BD7DEA5922EE488678297C5A043720DDD777451AB916FA664519A6A8 | |
2086 | 9BE9214DC67D68FAF516E19E1F65F162C246B6C010911220978C2FAEEA7023CD | |
2087 | E2C2A175D2C79817AD4E4364090B9C6B95CE86840857599448EA77982CDEE30D | |
2088 | F4E739DE78F7C1831B2FAD322EB48FCA0ED8FE56A0BE9E26E6921171C31F8E79 | |
2089 | D5A59BC6225A0AA217FEB684D1CCF1B12E21DBEF1F1315C920EB46163B5C2F46 | |
2090 | 80669943D09CD519256D5A4DE9144FD5103B52774A530D2A4318E9ABFFEF15A0 | |
2091 | 24F0590F23BA7612351FC0BD9E5F9A5A8D6ECB677978C4E2AFC4560986B7A8DD | |
2092 | 0CC30A82C2CBD2707A18D988C164F2B8CED74B1C12991E705F005E3A8D10BB25 | |
2093 | F5A45974096ED5C5F8A09ADA293175C763CDF9C3484C4B9ABA9839BB9028425F | |
2094 | DD34E700820CA4B2BAF969C1DEEE659A6FF568EDE7B58400C07BDA06310B92EE | |
2095 | 17FEF247A7FAFBB56044FAD23EB2933D8F313A161767FE211FC103F392A9A1E8 | |
2096 | B633A259920A15D19A4F5780C09071ED04C83FBAB9ABF344A1B0F1FBD2A96A87 | |
2097 | E03F2785DD00CFD5B3B95736CFE6315E86E8A5E838F4C02B36859AB4CA203FED | |
2098 | 4AB0D43E2964FEF26993ACA619F1CF12D3DCFBD8E50AD02A72A6593EB876E244 | |
2099 | D5CDFEE1128408A5C10B5E70D680299E8A33489E1179FA0F753B7FABBB826BD1 | |
2100 | 39D7F7A8E7C15C359E24B6569640123700FF628B2D76E2B7B2DE7C2F098A7A46 | |
2101 | 8309CCDEA49CD277E96366EF221C4DBCCF17882C4565340EA41EBE83998AC89F | |
2102 | D66825F75F751395FACA772DFCEDA5E3368094CF378C31DF2B405D92690F2546 | |
2103 | AA982FE7F32660E0FB33BF253F632FE978DDAFEECCF840997558C607ECF0CD57 | |
2104 | 5CDB3EE71642ADAC37D462F7A23541F850382BC1140C8437FC62C34CD9BE7002 | |
2105 | 0C136657F2ED4AF914AD3AEC860B2E873A77C818E491440EEE98075FBD7EE393 | |
2106 | B68FAB94C574EC914FAE259B065C8666CBB2D3604F9FFAA52DEB5F157079D53D | |
2107 | 3FBBCC93C598FD83769A8C039EFA0C7BDC027A34721E437E548F120137EC099B | |
2108 | 15D65CF68B5F2E5ACBD11A46A6E2168F6E38DACB52D0AF949B8BFC8AA92A6C1B | |
2109 | E5A362B1B05A46F3E58921F6A1CD4C97730B14D31F0C1E2C132D25B2A63D631D | |
2110 | C65813C00332FB695789D21D9903B3CD1425CC36C25C18C7D49014F85BB771C8 | |
2111 | D0D18204492ECCBF69D97B2342457C95A7CBD46C489690CE6B4A4363653B9D46 | |
2112 | A5A03BB8BC675B56A1CDFC8E0C3BC7DD7E4804E61DD27EB6D25119887EEF49DE | |
2113 | 905543AEA98A60471A3D512D63CFA12F8768CBDCF8F9EDD9AF084027DBF313DD | |
2114 | 059EC75136FC08C22D280B76F1A4AE628CF21DB9A6E567085DCEF55E68812A8D | |
2115 | F72DFBF59786430216884E02416419FEC67428E36B62093250EE61EDA4E9FDC9 | |
2116 | 08F01063F9841E1A5FC54F34A65F738A9E330E8074930BD9E85F05AB0E9DDCF1 | |
2117 | 2CCC343C8BA7619FA512292B53F37BC95635A3EE07C3E4E91B123E2CC34EA9F9 | |
2118 | 123C38F41B1DF9C2A7034BD05D83CFC2B86D69639B8C34940F53F44D5F549305 | |
2119 | F196464989975EF35F33B2B4B52CA9EDC6B32033B63BB03462CC58BBED662365 | |
2120 | 2F36F7A46A371A60B245D53F9A7DAA64428EECD40A8F4C93D460490B092558CB | |
2121 | 647E53E34771DC04DEEB2C285965F4DCF2CCB8669ADB238CC12897F7DF46E6DB | |
2122 | FD9D5BFBEA1DD262C4CC1B24E681643FAB80B34D057BC920ABAED5B39D2ACFE7 | |
2123 | 4CA3A1999ACF8C9AD0F99B12922D37C03D06B77985EF38B3FBCBD6AFD21572BF | |
2124 | 84A7BB8C4ED5C3BE657673F8E9F3A1655C0179A4CA565D3B6F0949B2CBBEC189 | |
2125 | B0B46D5727EA5EDB274B66C9FD872C00969B9C6B7CDC3A8CEC053A443CB847F2 | |
2126 | 540FAE81CBE3F6B306D1B8B913919D1B9FC029CD5D414DB2E16C7EC97F0BC73C | |
2127 | 1BDCD5F3FB0695EB84873FA73629005D7CE48A9A1374CD2A0DAC7F507D3F04EA | |
2128 | A8F71F37B65C4D5F5928C7A59BDB73E1702D4E9508519508DF62DD29AE1209FA | |
2129 | 8766D6311A78B12C830AC0D870CB02DAC0D6434801CB48972C196E0CC92BDDEA | |
2130 | 398622BAA5B384FB8A0396777CF517A08F646774EFD5C6CAB81C37ED7AF68276 | |
2131 | C86AD81C3C41476A6398A6A22D65421526EEC405F6CC9F2520FAD97FFDDBA3EF | |
2132 | 9E8DD5295CE2390650C5B19930B45A410083442196A24413ED58BC3994D003EE | |
2133 | F13DA0A43E7D99C70365FE768AADD61628BDF66FFC0D4195AE0CB7FF33EE475E | |
2134 | 2B0EB97F66B2FE63D3436568729519B2639BF5AD17F7061BF9F8A2EADDC7F806 | |
2135 | 50C1EBC0AF0BAB233868B10EC7711A0C2FFAACDCE3C49D3A0301C49B82A2DD78 | |
2136 | 92BD6740EC601CBD20D460B90EED562B2AE48E55A7C28C8643B4DACAE95AD33F | |
2137 | 27F2CB34AC65A0E62BE71CDC3D05361D1F07584945E4E89514C40D8A3132C707 | |
2138 | A4D56B054572CAF5F12E40406C26E5077C9E255516000F1733B136CA5C58961D | |
2139 | A9B22F6FEE7B57DA278A3F8F2B8A2B52B5E2E1FED54F14AFC9F13B18734E42C5 | |
2140 | C04846F7CEE4700920DAC45D381100CF7D5DF4E601D3B933998D86D5FDFDF666 | |
2141 | CC4ECF675477D74327EAB256DC1727A44C3F7A6A970D9598EB46A5C38E81F3C5 | |
2142 | 10D8307C19D849BBEB0C962BFBB37409195756E505278D619A73140B2C661235 | |
2143 | 2091B4C6A3C81A3F532B8168E69EB1DA998C84834C2C87A910A2A65B264A20AD | |
2144 | 50F7B5B8DDA82DC3F45F394BAAE1BAAF5FE217BB95A30E2164C3193083013EDB | |
2145 | 950B9F2F8559B483BD35507E77A8C59CE5E6571EF07AA5ADFC51C4E54346AE1E | |
2146 | 6E22EE5A58C7B31687B936299B29547E214971677A0D5FDC566E61EA08E86BC6 | |
2147 | 976077F73FBC8EA0CFCA796D37DDF0977130FF25C4791DC6CD5B7450A594BD1B | |
2148 | 291A8650DFFFAB3154F4129AEBE08C3A0F76A61F23A6662795F20B096772DA49 | |
2149 | FDC818E8F431C8D7488139A55443B81474F5D80D63E1CC6B1AA2241C0AEE0169 | |
2150 | 9077ED92D2CB61C71F765AEB0A26665F2677D214B6C5EF0111171B165531D3E4 | |
2151 | 7E9E43F1659A4F3E96BFE53F74D902BCCB2557013D900D19B86DBEE27F12CE31 | |
2152 | A94697D4DA12D98DF2F197BF7B7F6380E1CD7D1F9E13B65D5841A990642DE6F8 | |
2153 | 0F86E9C087D82FD2A903B7C5191D7D87CB2797C3B24432F7D29BB50DE05D37A5 | |
2154 | B9090F2D26B1AF1EF3DF11645E317BBAD8136611F64885A3D635C3C1F1F42995 | |
2155 | 83BB3D6719766FE2D016B42753A30887C1D57DF9CB860FAC2F95BF993EB7DC4B | |
2156 | F61EA29CCCA247F2728D4504648A8EE0B7FA0A766282E63511F89CAD7B612348 | |
2157 | 7E83A9D8F233757716321B251D122D9793FCC20090AB7BE19B1575A3AD6CB93B | |
2158 | 9FED5A9A6CDD855A1F09FCBE5C9DD97F93C49FAD92D3DAB4B32DFAE82E36165D | |
2159 | 5A6BFCE2AEA0F568A481C480D75C1F32ABA8FB904CCBF3FA6AAF58C02B501A62 | |
2160 | 4D6C1F8F690BB4B7325A31B13A712549AFA18174BDFDA6010BBFECCCDFDB06B9 | |
2161 | 406732F56AA41EFBC80266EBF0B9852EE08E76EEB14A276935114FAD24214CB5 | |
2162 | D177262C90AB93798A00D55A152D635C96846D70395C7EAC49F7A750027F9024 | |
2163 | 3781BEE23D56131397B4B241BC6976A4F2B04C8C64EFD55E801D833664019765 | |
2164 | 7A22B810889C096B55AD2B4D8963CE240D5DF0FDAB71E9091A167A80F5A3418F | |
2165 | DF87AA78FFB1EFEBD8A2C97E8E7667B289BC23CFC16F0B138CE179402015CC4D | |
2166 | F36912CAE318490F6A050B56B778DCEDA7AD335FBB6F3F05C526C8B5EF0B7BD2 | |
2167 | DFBCF5FD5C40F39B6A3455B86B34E89060AB0E6AB96C3914019CEE49EED033F2 | |
2168 | EE547725E1EDD60358DDF57F9EC734134515949C482D52079316D9A2481A1547 | |
2169 | 94B4CA6724EFABBE3DE13F07951329A119D84A07CA8CDB199704694F4B3AF26B | |
2170 | 95DABE0B18F99025A88898EDE46BB3C314FDDA77018279B5DC8C854096F3C7F5 | |
2171 | 4DE88F3BE84881A03C5E19A77B769EC57B4F6E5BB885485CF242A23C6E5FC322 | |
2172 | 04511A00F27AB274232A97A2E5C45188538013667C552E804283C579F1700DD8 | |
2173 | B3C70F6D22FE133C15FA6D5095582333F9B4495282BAD0537B90BC6548427F7E | |
2174 | 12C9D744869A3F5F133CB2CA078C83B80F95AAEE5D64203110CA1AF12E5E0273 | |
2175 | 298B2EB72DBB5FBC3F6A6D7004FAA17AEFB086870C83E8D742EE560DEAA5F727 | |
2176 | CD7BA16A4D6FAB7ED191AB92BA39300BFB73EE31B7820D85DAE74DE35B2E3FF5 | |
2177 | 8879D9D02B251D7903CA30DA07E2B5694F23631CFB5EB08656AECE21A93DA6B9 | |
2178 | EB6CE1A290631B795A55CA75A5EFBC99BD1E21C40D7374181C96B43B696F9079 | |
2179 | E7BC8BCC96044E09E48EAA625B9D5C53CAF79C84E8032A0F976EC2FEEA9583AC | |
2180 | 25DCC02DEC8D4798E0C145CC523E5EEE82A1A73AE0EFBB08876278A7983FFF86 | |
2181 | 527052AC0100CB273390888702DA5C62889808C3DC427BCC5B0A8D787102E641 | |
2182 | 2ABFCA74C325F26A74AE2CC7637C9996547B34F33CE355165910F2C0E6445E7E | |
2183 | 70DE25D7D187EF97902D4D535956A4ADA1F1FA0CE9881399477A0B72CFB5F841 | |
2184 | 1893157F662F071419B5AAB14EE66E1D478AA9DDA4E4DCDAFB7060EC629ADFAF | |
2185 | 5C779DE9AB8A65A65722109954599B931C42DE431F5A988459BE94F48F7D2539 | |
2186 | 1A8D09133020EA37FA9C7CF8A32C9C1BAE51E112CFCF59CD7FA6E9676BAFD4D8 | |
2187 | 093CBF4FCC3BB2E468ED55E28D75DF47CCF621662632E2087A8227945723823C | |
2188 | 02629CCDF94D5168A3810B815522588487CD8AD69EDE6D7FA593E638F603D808 | |
2189 | 0E2DC9278B63534E63D22876BDEE3A7CAB88C637DC55C9D1C4F3309C01DF68F0 | |
2190 | 3919523B2CE7CA52961AA3C2E618EFE1BBCD2C8DC65EC648CD380E3421F287C7 | |
2191 | 6F7308C13F6D857C74522BE6A0B09E15420CFAAE8DE28CFE6350217DA9DB5083 | |
2192 | D15B0CA455D343119E3C1D25F1CA143D5568D63CE32856F21328D5AAD69236BD | |
2193 | 208BEC83099D6652E91253440A613155EBE7F2D902CAC765F5049FB5433AD361 | |
2194 | 7C7EF2BF062877DB1981B9481F961A097D0402CD89E0BFA180027E29B990C2EF | |
2195 | 138AACF0D146CE117990CB9561FA6C0A8D1929D5B8BA4C4D9168D6A744ED4B4F | |
2196 | 457EFD4B36189371E60DCE4D2D97EDE139145241DFB26394A142D4457AFC0E04 | |
2197 | 990DBBF7E40FF9CC5B0624E9B898CEED3A63865690D1CA256330F472EFA9059E | |
2198 | 81920A9D365AD4CF9618E64AF8FE19DEFEFAAABF8B878C42C07490AA600C0E56 | |
2199 | 76E6C97F5B0038169395855E4338C84108D1ACB59E5482AF5FA034769A116EF2 | |
2200 | F408FDFAF2205DAD5AE5324EE9F1AC7192E070EA40EF350817F8A69D680DCEE2 | |
2201 | 1B30277FDCE432D5541D27536E9086C2C74B2B0D5AB976C3E188EBED10777172 | |
2202 | 76F7D7F73E38D15D03809B350C2F55E80AB7EB7D4C4C9B7DD97179F36DB5E4F0 | |
2203 | 1140662023CA3C389A8B168A68303117179A4AF84A64B2C2A56ACCBECD6A98AA | |
2204 | 14CD43B8CD3FB79202D957E0D5BFFB49967E5421426205FE24C9608E5F591854 | |
2205 | DF895083505CD0A4F53DA06D931AFE3BB68F3FC3DCEC7059D3FF5218BF5F1082 | |
2206 | CDEA29587E7E9E357EC1329411FCCA0C3078E9787A12EA78D59B2E8CF2AF09C8 | |
2207 | DA12B2B0EA4A43283C8FC9AC945EB0E63CCFE272BE758B0F8B2C9BAC46F3BA97 | |
2208 | D05C0E720C584E805589D2804EFEFEDA9962B4CD5B145FF7305FA959B660FC9B | |
2209 | 37C79503EBC2D1639D2593B0A9F24EE3CC07352614C0B6C531585F27CFB6EFCF | |
2210 | 044F2F2A261B0C2D79FF78899DB6B1F2FB06BFAFEB488504D2FD579F55980DFE | |
2211 | 9D15DBCCC176E41EA7AD6364D40D931CE561E0AB57F5FEA21549290E539A3C7F | |
2212 | DCE12F4ED93538385B2D30DFA578BAC6DC92A144A72D1C2CEA334ACA6F6C2133 | |
2213 | D1996B97AE8B102EC56426ED5D59DBBA11BA7D6FD39A8692F0931B64538975F5 | |
2214 | 61B79F8640773407E873FB4714516037A5C6FFA8C796A9B01898CDFDC2A3F2A1 | |
2215 | 5D3BD4C09165F6AFA9EEA3E0C84DB1D058A4C54EC0673860170038CC318DCCF7 | |
2216 | 1F3960F12AA2C9447090D91B0EF8A320E933FC8E89FDA5D5897266A4D156BDB4 | |
2217 | 077745CC076FB9A12F9D3BE989E2F8ABF44F4BF842DF548111DE129B36B535ED | |
2218 | E5ECF8AB96D94EDB9E0484E00BF942491ED250EA8E062FC59F223A85F26649CC | |
2219 | AB1AF18824045625756CE044529471B253B1F3B5FA2BBC3DCEDC457C0A42E29D | |
2220 | 7A152AE14C8D60122C5AEAF5D4360E51BE81A84F3A6CB164181DD1B62AB204E2 | |
2221 | 3F078794D9FE570D6115B1C9DEA193996CEBDC5A32D8EF3EA3C309B9F87C726C | |
2222 | 5F2957494663A92639A418C450D42D027053DE7342921EEFD3CCF162DBD32E16 | |
2223 | 9C8FF39084FE1117958230EF168E6FA9B48590EDC108D7FDCEBD76BAAAFFBD0A | |
2224 | 4EBBA485DEA8C89778456A1A36F420FE78B0A8F854CFDE7E26E76CDC2270C983 | |
2225 | 1D5D914F3EEEC7E4105228ADD1646013CAE11C03108C6971EAD9C13524537A4C | |
2226 | 2CC3D193CE5CF0FED9939AF23E241FF6C82FCBE73CACA6B4B6F88C17A18CE4D3 | |
2227 | 4F49BEFCF830777A1B26CF228DA61EA5177A826645B18F21C10E06C748E113C9 | |
2228 | 03402DFE318270EAA54F518FF635C340FF581055C1529CD6976951F6819D5A45 | |
2229 | A4DD081C55E7597D257DB9E2E3DBD46B0878895155DB0C4D859B1E61291EAFFA | |
2230 | 7F2816E365A5D6AF6EACFD49362833DE3ECA447871D071BEACE9EB8591F31EC7 | |
2231 | CBCE3C2EA428301FCEB42ED2E082F89476F39F7EB993044B8DC23832B25DD3AB | |
2232 | FD6E0A199A3CF03A79F323FF826682C8FEC47BB2B74C22A92D01F0E0CD8CEBB5 | |
2233 | C59ECEE83A7B02E949225EDEE26D5D11521DB381A26E30CEAC4D8E2FFB87E0F1 | |
2234 | 44ED94C0E3C022D4B2DC2922321EEF1BB71DE6C221535B0EB6A9837C8A775440 | |
2235 | BDC58FAA05C859F05A654242BBB4620D92E5E8B3C5A937B98064BF97549E68B8 | |
2236 | 8FD29B4E57EE27055217C910A199900E2A465051AE0573E3D46E5CD541BBBA59 | |
2237 | 5062CF9444E95536CAB30FDCD35A56AF4F5038E65690633DA9890CE8229F6EB9 | |
2238 | E5BAA68E54F9AF6590B4FDAD42B7BC0A6708A1C2E809B743A5767ED46FCB9847 | |
2239 | 8274E288E9B2A49803D238ED5FAEFBDE3863B29D55118E3ADC937E4B02287439 | |
2240 | B452DD41CE8298B10AE99AE275D45C5E0EB5680DDDE9F449855FF97B28AD1A9B | |
2241 | BE728BC56C8B4632938A4337D794EFDB56050F5459C031DCCBB1CFAEBBA79348 | |
2242 | F5514685F1F16FADF390B55DB5B671D0E020C03C8D301683FDA4BE8CDB3C7948 | |
2243 | 2F5648A2E049A495608CE414857236A70AAEF5EBAABAF1A0950A2B0B814AFD0D | |
2244 | 443CD6D2E0365332CEBFD557DD16FE1E3342A85057C5C8337ECEE5466406A324 | |
2245 | B7A5F881BBB2E442C9775A1C33B5321887E3A8E8001ABAA65B1B2BD1191D6659 | |
2246 | 3BBD32F2B01A37BBFE2A3964BF37646262E4D667BEBCAF970226BE5AFFB86A1A | |
2247 | 21CC0D74E7376B9634EC8BCC46D551FAA67603D4B707DCBF6C65D932FC76C2B4 | |
2248 | 8B2D03F5E29C4E2327F5791CCE1E42395319739422607AFC0B6962680A04A5CE | |
2249 | B9FCA10C3EA7F9B1CFEA675F44029F68E3C9C0B90CD7751040239137508E1E3F | |
2250 | 1FFCA19DA7B0933ACEB8239703097AFA4DBEC0FD8F94AA7854F83DF191A44326 | |
2251 | EA23CB5F18E342A9110D30A1D9427492564E7CA82FA80CDE8B7ADD8787B3FCDF | |
2252 | A5D52B14B6147262461F3563101CD20A457672F78F9BCB7F996D7699975C018C | |
2253 | 07ABAE4E0987AEB32A45577BA6157B51E9BBC37839FCBB886B8987389D8C82C2 | |
2254 | 0281A89F98874003140328866916A547FF0B47F24982E346FEC11458EF35C95B | |
2255 | 033F35334E2956A631F7192A | |
37c41ab1 CR |
2256 | 0000000000000000000000000000000000000000000000000000000000000000 |
2257 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2258 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2259 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2260 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2261 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2262 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2263 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2264 | cleartomark | |
45c0f7f8 | 2265 | {restore}if |
37c41ab1 | 2266 | %%EndFont |
c302751c | 2267 | %%BeginFont: CMR10 |
45c0f7f8 CR |
2268 | %!PS-AdobeFont-1.0: CMR10 003.002 |
2269 | %%Title: CMR10 | |
2270 | %Version: 003.002 | |
2271 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
2272 | %%Creator: David M. Jones | |
2273 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
2274 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMR10. | |
2275 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
2276 | % This license is in the accompanying file OFL.txt, and is also | |
2277 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
2278 | %%EndComments | |
2279 | FontDirectory/CMR10 known{/CMR10 findfont dup/UniqueID known{dup | |
2280 | /UniqueID get 5000793 eq exch/FontType get 1 eq and}{pop false}ifelse | |
2281 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 2282 | 11 dict begin |
45c0f7f8 CR |
2283 | /FontType 1 def |
2284 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
2285 | /FontName /CMR10 def | |
2286 | /FontBBox {-40 -250 1009 750 }readonly def | |
2287 | /UniqueID 5000793 def | |
2288 | /PaintType 0 def | |
2289 | /FontInfo 9 dict dup begin | |
2290 | /version (003.002) readonly def | |
2291 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMR10.) readonly def | |
c302751c | 2292 | /FullName (CMR10) readonly def |
37c41ab1 CR |
2293 | /FamilyName (Computer Modern) readonly def |
2294 | /Weight (Medium) readonly def | |
2295 | /ItalicAngle 0 def | |
2296 | /isFixedPitch false def | |
45c0f7f8 CR |
2297 | /UnderlinePosition -100 def |
2298 | /UnderlineThickness 50 def | |
37c41ab1 | 2299 | end readonly def |
37c41ab1 CR |
2300 | /Encoding 256 array |
2301 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
2302 | dup 11 /ff put |
2303 | dup 12 /fi put | |
c302751c CR |
2304 | dup 13 /fl put |
2305 | dup 14 /ffi put | |
d3ad40de | 2306 | dup 33 /exclam put |
c302751c | 2307 | dup 34 /quotedblright put |
d3ad40de | 2308 | dup 36 /dollar put |
c302751c | 2309 | dup 37 /percent put |
a8fd3f3e | 2310 | dup 38 /ampersand put |
d3ad40de | 2311 | dup 39 /quoteright put |
c302751c CR |
2312 | dup 40 /parenleft put |
2313 | dup 41 /parenright put | |
9f178efb | 2314 | dup 42 /asterisk put |
d3ad40de CR |
2315 | dup 44 /comma put |
2316 | dup 45 /hyphen put | |
2317 | dup 46 /period put | |
c302751c | 2318 | dup 47 /slash put |
d3ad40de CR |
2319 | dup 48 /zero put |
2320 | dup 49 /one put | |
2321 | dup 50 /two put | |
2322 | dup 51 /three put | |
2323 | dup 52 /four put | |
2324 | dup 53 /five put | |
2325 | dup 54 /six put | |
2326 | dup 55 /seven put | |
2327 | dup 56 /eight put | |
2328 | dup 57 /nine put | |
2329 | dup 58 /colon put | |
c302751c CR |
2330 | dup 59 /semicolon put |
2331 | dup 61 /equal put | |
d3ad40de | 2332 | dup 63 /question put |
d3ad40de CR |
2333 | dup 65 /A put |
2334 | dup 66 /B put | |
2335 | dup 67 /C put | |
2336 | dup 68 /D put | |
2337 | dup 69 /E put | |
2338 | dup 70 /F put | |
2339 | dup 71 /G put | |
2340 | dup 72 /H put | |
2341 | dup 73 /I put | |
2342 | dup 74 /J put | |
2343 | dup 75 /K put | |
2344 | dup 76 /L put | |
2345 | dup 77 /M put | |
2346 | dup 78 /N put | |
2347 | dup 79 /O put | |
2348 | dup 80 /P put | |
2349 | dup 81 /Q put | |
2350 | dup 82 /R put | |
2351 | dup 83 /S put | |
2352 | dup 84 /T put | |
2353 | dup 85 /U put | |
2354 | dup 86 /V put | |
2355 | dup 87 /W put | |
2356 | dup 88 /X put | |
2357 | dup 89 /Y put | |
c302751c | 2358 | dup 90 /Z put |
d3ad40de | 2359 | dup 91 /bracketleft put |
c302751c | 2360 | dup 92 /quotedblleft put |
d3ad40de CR |
2361 | dup 93 /bracketright put |
2362 | dup 96 /quoteleft put | |
2363 | dup 97 /a put | |
2364 | dup 98 /b put | |
2365 | dup 99 /c put | |
2366 | dup 100 /d put | |
2367 | dup 101 /e put | |
2368 | dup 102 /f put | |
2369 | dup 103 /g put | |
2370 | dup 104 /h put | |
2371 | dup 105 /i put | |
2372 | dup 106 /j put | |
2373 | dup 107 /k put | |
2374 | dup 108 /l put | |
2375 | dup 109 /m put | |
2376 | dup 110 /n put | |
2377 | dup 111 /o put | |
2378 | dup 112 /p put | |
2379 | dup 113 /q put | |
2380 | dup 114 /r put | |
2381 | dup 115 /s put | |
2382 | dup 116 /t put | |
2383 | dup 117 /u put | |
2384 | dup 118 /v put | |
2385 | dup 119 /w put | |
2386 | dup 120 /x put | |
2387 | dup 121 /y put | |
c302751c CR |
2388 | dup 122 /z put |
2389 | dup 123 /endash put | |
2390 | dup 124 /emdash put | |
37c41ab1 | 2391 | readonly def |
37c41ab1 CR |
2392 | currentdict end |
2393 | currentfile eexec | |
45c0f7f8 CR |
2394 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
2395 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
2396 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
2397 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
2398 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
2399 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
2400 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2DB9B8591E5F01442D8 | |
2401 | 569672CF86B91C3F79C5DDC97C190EE0082814A5B5A2A5E77C790F087E729079 | |
2402 | 24A5AC880DDED58334DD5E8DC6A0B2BD4F04B17334A74BF8FF5D88B7B678A04A | |
2403 | 2255C050CB39A389106B0C672A1912AFA86A49EFD02E61E6509E50EE35E67944 | |
2404 | 8FC63D91C3D2794B49A0C2993832BC4CDC8F7BD7575AD61BCDF42E2E421AA93E | |
2405 | 3FF9E4FAD980256D8B377043A07FC75D6169338028692CCA8CD1FE92FD60AD26 | |
2406 | D57B7519B80A8F8DCE9CEE5CDF720AF268D3C14099498A843D76E3B6C0328F24 | |
2407 | D36EFE7F5C4E5B5C612786200C8DE3A41EE5F1FFAF4097653CFCDC8F4FD32E0B | |
2408 | 03EDB3E413283B9EFB0AC33B055617005BC9B0057FD68C52D1B0E67F0C571685 | |
2409 | 767F2AA85ADE4E0104A1C777733D5E318A22A9944336E5B98D965E50D31F357A | |
2410 | 8B6EA5A0EA98E1B027CE68C2EDB149EDDD04ED74A1B3D206D471A0C11C11449B | |
2411 | DE190BBFEBC08C9E1B7513B43DA3134D6B11A2516E6E86B67F68C970A320D05E | |
2412 | 94FEC57FB347606DF89989C33482BD09D011C55AA920319E7B26A205D3D0F004 | |
2413 | 22466F09C0482A164CFB27EF6ED2B040ECCC3DCAF345B5A73676F193D43123B7 | |
2414 | 72FD6CFC5E37930E61EBD5A6307E4DE70194E6384EC0D79DB6AD86D3B319A31C | |
2415 | 8B0589D0FE28241D8ACE280D0530EE99C80723E560BB72AE9D53F4713181F491 | |
2416 | 344B06D3027BA4E9E94D4305BE1D817197C54C8FF56CD6964165F6448ECC8A8A | |
2417 | 64B48B4F0FD69299A137589E2491A283509B21A3A5772F75B7602A9F60AE559B | |
2418 | 07A58436D04222C73EAEA72DE9A5A441F88D27C11F4F91255EFE280E91A4ACAC | |
2419 | 1E98A4E5E6C57B9AE86FD218C3CD8F24A4104156A80F13821384E529783C52C8 | |
2420 | 78B94AB3A0096090867ED32E8A30980E737922037F75F062BD83BF4F5929BC51 | |
2421 | CC22AEE2DBBAAA001CFFBFF41D258424FAD888FFF1BEAB796A44E3126159E120 | |
2422 | 7E4025C676CF94888A1971AEF8B6764B3AF4A92D36FAF6FC56FD049710EE3782 | |
2423 | BC2CD84FE2473F133BE03C1346B875463F126DCAB15C7A9BCC9A727D23611462 | |
2424 | 4E8D2BFD2466600285D79518712B8681ABCD69608E6AA9578F7BD771EC36E01A | |
2425 | 5A17BC17E375020ECA59B43790ABEB9DF5F4FBBEF807E5699EFEAC563E1ACC5D | |
2426 | EFA336E75DE6D8248E9381BB110884FDC89C2F9A41EBBC9A8A1F98E6A41F68BE | |
2427 | EE30E25CA148C1EFF42DFF8C214A6537AB11F260B8C329A4947B5FC8DC9C5622 | |
2428 | 4DF7BF4FBFB00380D47BABB03BC30627AA74103E553F55278F538EDD8C1E64CE | |
2429 | 0F1398CA0AB5A86630139B4A7E8FC02804CAFF3830114640AE50D2FDA3B561B5 | |
2430 | C63AD7EE3347804CBB40FB1E77A6C89735DD870351C3A1811591AB493251B904 | |
2431 | 314F65791963C0412377C1D02362C5E9655F1C3D4803CD379A8EF24C48218C2E | |
2432 | DF1165840462BF37DDE1B8D5FF09FA2C3B261E2F1A65ECFBE5D4EAD43B52C029 | |
2433 | EEB3948CB8A252CBAF545C8FA1C31E920E23A12DD7222CEF2D2A513BD758EA13 | |
2434 | DA33BF5FBF1D734653EB83DA2D374A5B9A0CE316F24EE375D6DF6BDA49954C2E | |
2435 | DB25A88821193636119D469BA66E5DAA9C92520FD4F84426A4E54273FA469084 | |
2436 | 7517817A6EE3E21176D333825E88046F50B3CF6938AF9BA79A2F51398239EB91 | |
2437 | 1A2D07F7FCD948427FF62F40FF95E39FE1A1AA8451411563FD5388472251C155 | |
2438 | 69BDE9283B41900B21EB1190D06E6B13B7794FED020D2C1BDD205AE77B084BCE | |
2439 | EF628249398B496DE85B406FC2E1939EF00DFC84C07E26CF72EC401BAAE756E5 | |
2440 | 7F6673216E7560D1C2A723CB405EE5CA474A07F61B81F8836482F73DC9516D67 | |
2441 | CE0CB770EAD755B6B356198B4B97EBB29C63456953270CCC8D5650C1D006E69D | |
2442 | 38DE2DFEAB27DAD50A817F0D645D30AF5B75A7B53CBD3D2B8D87BD0A7E525AF3 | |
2443 | 22F7ADDFCE31716914C2318260C2E2B4664893921B68C5A93334A361D94A759C | |
2444 | 0D7B146D6FD94F0442D672BDA0F6432E18F3C5DFA37ADA378D95B75F413C9ED1 | |
2445 | BB5C606A3EC7DFB3F796F59B0478C13FD1900381EFE0BB5242D5B5D34D03AF1D | |
2446 | 4BDC93EAF8020E26CA23C8B0E7DDEBBC6762A557067A4CE05A524188A8F02E2F | |
2447 | 3625DA38DFCF381727887F5646A3995A8A38A5FB1E5D5EBB395FDD0B7C8E71AD | |
2448 | B48EEDB62AB2CE99D121435EFBBFCEEA69AE9ED8238B60CC7288DE33C766CDFE | |
2449 | 15B767B4AE2E6CE0965E77272AC9F86023DA620548CFAC85BC751C44218A29C9 | |
2450 | 849F1C2DCBDFAD895B54E51A569952ED50F82DC8A19F367E7E44643854EFD6B3 | |
2451 | FCAEB04E55E4661C82D31E2932611748480EF61FB2FBFB0CFB940BEA81AFCD84 | |
2452 | 4C6A6332D7A600170E38A8EAFCD4F93DC153C43175434C86BC747348FAC61B76 | |
2453 | 1FEC9027C1A193E55C80F1F20B5317AA0A05AAA36AE235F6E49F06E570FEE798 | |
2454 | 84857D7552EA92EF3EFAD52DE39C2F8F43C59E3A957B7B926FC95FC4B60186DF | |
2455 | 7F3523EE2AB74E294C8C4BCD8B4975E84849E0FBDA6C0B0F24A636DFA578B122 | |
2456 | CF97BC5089E21E9F5298D1C9F30CB8BAFF6A3A11BB4D9A0A5CF2B18D055C44CA | |
2457 | 4FD4D8FE1AF3630907DE7E585AA811F9CD11FB2C8FC791851D651009FA5DF20B | |
2458 | 3C33FD2FF848A9E3F5652BD294965A332DD3F246C91B0ADA34017FF2451D1394 | |
2459 | F9C3C95AAC6EC8062BE98E8914D51DA6A164AD13938693D446044859D03A949D | |
2460 | F9AC5DF4A000CDA98BB516D762CB9F6D44B5268FD0C26E88BC4A760C0F75A140 | |
2461 | DEBDECA4F511128B7D2805872160C55236F0A0FA7637FF0D4E94AC079CD3C8A7 | |
2462 | D03A5A56F26B0438B577C46011A10532FEBCAD14FBD6032E224F45691A726886 | |
2463 | 56F305231EB2FCDF59C8BBFCB5DBD2D093A0E84D62AC93A2312CA69295E937C4 | |
2464 | 8DBA1802B85F54B5E7E6D6216A918F911FF705D3B5CF055F1D873B96283A0B53 | |
2465 | 59344D910CD396D883F6F7836BA65FAB4393A773A8F6BC298069E5BA38210EED | |
2466 | 49C9D920F718E3FCE692527DC7CCE6963BF744F2C91BC5952564196D60574E86 | |
2467 | 87A0FAB21F2DB2BD5A51D7FBD8FC19946D24E5A228462C4772F978E650ADCE3B | |
2468 | 8D66B9C21279C531CA1C3A8ECE3420BB65837287A7222CC3673A2A5F8BBFDB60 | |
2469 | C719CD073EF9A23675198462C7C87B24CC92D6AEE5C25AC63855CC3281494342 | |
2470 | D28F3D2FDE0C183486769A4FD5B0143193D31FCB2C2A14E487BBD96D0BADBB64 | |
2471 | D1B56021C363A795BF10E2DB448261C363A54A4AC1182B470C457AA82DF3F5D1 | |
2472 | F4B329806141EBD53CAE309319B94133D7EBDC2D0453A905ADD207364371E178 | |
2473 | 0A95C2686E3B34C4A978BFC0EE968C39ABA00889BC5149162C2B54483D44FD3B | |
2474 | 5CFF41F611C7E03B94945F414560E874D7CF27FFD0630890D7D7EA66CBD15448 | |
2475 | 229059E1C436BB33D69552B5367AB5D53591C4678D0C704DD3EA23F5D9E8A7AC | |
2476 | 17D003C19E333E726FFFA2961F33C70F429085F7BFE3E2510F59B78F58B19CB4 | |
2477 | 01B48E184BAD9020FECCE3AF52048A056981DAEA02AE78197E65855DDB170616 | |
2478 | F54278395D9EA50DC83761AE759F9CDEF9E1948E7002414FC05286ED793E6662 | |
2479 | 3347F2A9AF8917493D7305B92CF93E8E9185F70015F5594084298A6C2F9FD3C0 | |
2480 | 689F262AC9FEDC9B89577ECDE92F08D3142209FBCE7B5C0A840CC767BCA56C20 | |
2481 | 4E4E545E2BE4D21C53855CEE4CD0AB35D1A604C0FFFF77DBAE4289752276559F | |
2482 | A05FEE65F45ECAF44E95E23FAB6052195C7948AF0B1126482D4E02D72BF8AB03 | |
2483 | DE0F1A632F7672AD9DDE70EDC82AA993678A82BEAD0BC2649C4707FD8509810D | |
2484 | 364B5C6FE0E10772E95288C622C2F06C634F4DF8C7FD1432BC9310D5F24FEE3F | |
2485 | 7AB324863D6DABAA1576E70643CA79EF4D7DF4105093D66CEE0F3B87D2164A7F | |
2486 | 26EA05F5C4645B22D3E1BFD2219657712C168FD90DE801FB0F32759E80DEC1E1 | |
2487 | 43CEEB19FED12D757205043FC98FEC62D6A8D8B97BC083B4A0E985AF7850D6FD | |
2488 | 8716B9957C1C35A0675BC53DF672C425C79F43FDABAEE7D63F092CF271C9A9D7 | |
2489 | C41F40C4189510987887942E60A412B3EEC84C9A6E1AC7D54D528F5604B72C08 | |
2490 | 94B7882621A5BF1F325B92FF96B80878CC550D1AE4D8196E41CB1251856609A5 | |
2491 | C4D3BD05A922D0D45E039D9450DEF8490A3E924E41434194910BF60BA1B08BE1 | |
2492 | B41824345627745541A4F1703E956328F6227D11C74946B38CFB096139979E56 | |
2493 | 4E723B889B44C6D78673868C89912F8B4F0B4B485F1587A637B630F92E6072D5 | |
2494 | 7F3B44EA6FD96BBD4FC28A6C1D90805E3BE3E42A7BC9C880762966C55BC04E01 | |
2495 | 204D083AE976FAE6F37C94F27E68F8C0F28D52B17F6C0FD7C9150701FD78F8CE | |
2496 | B8E8DC9260E3974005EB5CA728171F482D765016C94D4ADFE4A42EF42212BC56 | |
2497 | 7E4EEEE8B0D2A7856CD4E44F55C0BAB762F92CB8D64C17022D4BF3A47C12F5E6 | |
2498 | 279FC23101FEE93753653CE8CEDC3B75C9CCB29BF1D4554C6120DE8EE750FCBB | |
2499 | E38B5D915206974962E320362E59B3F21B3AB1875703191043D03284D4467346 | |
2500 | CFF2F98CEB4845B73ED8E003E0DC94251B73E13A9B51A3F1430BCF6A21EB9B7A | |
2501 | 65E17FA411F53BE6432F1506232B8159E008FA257F884A4A01AC53BE91754D78 | |
2502 | BF14A5B0FBFB9C31BF4908355F8A762052968DF526D118708CCB0B7CB5BEE285 | |
2503 | 6DAB6CD2E3934178E60BECB11AAB5478623CF6C50C92F8BB5D1A583609028FA7 | |
2504 | B8A53B791BDC9EF76A124F3F7641857E4BEA0837CB36176EC9A522EA7F41B8D3 | |
2505 | 63C37D1145367BD300F17B54522A834BBB74DE12BF9EB26ACE6F24A046D58F89 | |
2506 | 4D4B7DF74875F1A0C1C9D97BE0849593D7B398EB4B00BEBC8C8D1497B6EF831A | |
2507 | A35380FFB7F1AFA4D888AA52C9482E8B1755CC209905F98F40D95B44D4DCBCB6 | |
2508 | 67423D1BC2F3560FF0A8B4F0CAC352A4EE2C1D946E45AAEC8A6AD40303F3382C | |
2509 | DF0756BFA3B1ED64C169E56ED1C760F2FF0E24DC5C9F41306EF8D2628153D30A | |
2510 | 5DCB0791126BEFD4947D7EF08301FE015F2B0008DFFCBF9F2D4D859FD43EC7D9 | |
2511 | C5BE237E9BF6665B7B1BEBB362F0C0C3A8D86010B9C97FA741C97C2E0513386C | |
2512 | 9C26C235B14DD2A58BFDAC7B5F63DB4DA6D5D37D0098175A9071590E1DF66A3D | |
2513 | B8173A047C29D7D35557F06132CC920B5460B8AFC11D23D09A4E45D089F5EB51 | |
2514 | 963FA1A6256E359D485107FD143B2BF21FDE9DA5744BC2615E86C31C89470CF0 | |
2515 | D06C6397D9FCCB316EA9989430240759D2C4945D941F159FC02327F34B042BAB | |
2516 | B5C3A47C78E8C1A6FBCD396B1A51CC4B020B8AD401841EDABACECDB482D6EC5B | |
2517 | 72D2BFEB4556720FADD49D07307C8B22ACB7E310CA4151A85C71EEF70E8D15DE | |
2518 | B3B00F26E0E166C14647A65ADA228A3D1C89025BE059306565DB1B1EFC37D358 | |
2519 | 8C1EB024254AFD049BA977BD4C2C605050E17940A89D0D4C5D963E792320F5DB | |
2520 | 3706682E03D25D9E02487247819551465092CC22B6B56E93F3AB528038FEC3F0 | |
2521 | 668F866707A19B0463BE706EC729D2EE1653AAC7E29BD25BFB3241D4792F5152 | |
2522 | ED415B4E7FA92C2EE5A22E27E8B75542C492E56D811C192E95542A6FE0BFE5A5 | |
2523 | 69273C2ABED4300D491B92D2AECDD278404CB84B1BB1BD7AFEC858215837D118 | |
2524 | C0E928BE7E07CFEEB51A6D21375B772B8248C994564014015232A0DA4BEA1754 | |
2525 | 3274F407FED0837A236371F1A32056240F2015B1E7F4B2CA72C6B58610A66F13 | |
2526 | 407CFFBA5E0A2893C1F572D50F51286E9133B5A84239C9493B0574E77D281D01 | |
2527 | 11D00683354A000C9700EAFBC1FD104EA19DFCB87470190E7E2CE26E3A6FD0FF | |
2528 | 2620B87B82AC8686B6206B530F17E9348BC7D04B948348802CE53A312443DB87 | |
2529 | 4DBBA5313A6A2A8DAB8A1CC9A594FF8C299281C0A261C8CB2226B732FBEEDE40 | |
2530 | 2C6ACC74A1A61379E2E1CD5548CD908268A32FA83D8504C442EA0E183ADBF7FF | |
2531 | 9FD09C037AB03516ECCA93FF048235BD11A25DB07F164512A079C5392AC7F889 | |
2532 | CE96AE5C8D9580BCAFCC087C35E76EED1A671E87C12E3045E15A687134736DF8 | |
2533 | DA984772AFD189D68571A2ED7256F1E204230E41D3D9DD876F938951714A3973 | |
2534 | 0CA9310489F8E807C1C7A4E51AEA5BC030610A5D7263FF7E0F9FDE3E5E37A362 | |
2535 | 5B919000BD94D978583B942EB79CF2BEAC33FEBC9A67272EB10865BA8FB75FD7 | |
2536 | 9D280AB59F91B96C16C982DE848D76D8FA8620DFD7C80B7DEAE7264350D6FB3A | |
2537 | EF04794DA3305844A7CF718F6D1A4A3AFF6826173A076A1372ABFC54ED3AC6C2 | |
2538 | 09C9287FC830556CA694E21CA5342ECA7B10C90AFC4783D841D7B1E34FA3DB7A | |
2539 | 2B706F3E21B0FBAB23E7257962FC3BC309CEA2C7239A9D6B44CC96825115ABD2 | |
2540 | AF9A2566D2F3382C01569FBDB94C8D664A5DA0F7DC3DD140CA77C743D7BC1420 | |
2541 | 324ECF9E4780280EB119885E96A6C619CE3C0C8E1E264E2DEB137E5DC8149786 | |
2542 | 486D65667ECF47B1A1E20E9E6E4FC8323E0BC8E61BDD3BCDFC6575C69C03E31A | |
2543 | EFFC290472CBBD049DE3F840AEE37A2486034240F80E75D8A79E0762377DF660 | |
2544 | 52B12EAA16D678990B11A9BFBC03C1D4FCDA9FD4FFBB3E88352438102F10B7C5 | |
2545 | 9F04C013B6575B5E948FAB58EA691984A0E54E6B9F3F505FFFEF74D06FA1CDF3 | |
2546 | 4B8A95904C8A2763AA8AF5B71D00F5DE09DC1CDF87A08B6D181453063E14C12D | |
2547 | B7BB3775A6E2A901636273D9EEB833EA8CF20FD83AE899E28DADE10EEEC20BD7 | |
2548 | BD93085A4B1AC80AC1AE8280C14767F1A487BD066007A0D050317BD081131A14 | |
2549 | 6EA0898ED59E46DA7B6254BDCCBC660686E2EDA0E77A705A653733BB5C5497D0 | |
2550 | B130359F866CF293FB6EF0C2AC5BAA2DB0DED045E2DED3A2612D078333260359 | |
2551 | 16CF0CCB272D34767EA069E0F0B0D42327A18529D72E890EDA6195C2688438ED | |
2552 | E9ACDBEED41E81CA8EB5E43C2B09CE266EFCA03F2D7FF57F12B06F9E54FCC6A6 | |
2553 | 546676F6FFC5B8B7D3F0982B6FF0D21D949309F0C0B175CC1D0976F8C55C6AED | |
2554 | 6E821C39041E22D91AB30922F2B2EC2746BC7DAB484991542FBC82D87B487507 | |
2555 | 559AB466F73EE23C2D3194DC5CE4C9AE66D3164613AC5CBB3DB501B64DA7C91B | |
2556 | C7ED2EE9027FC0906820B35D4F2CF66C4F9CE4A884B7C07155BCA884ECA5EB3A | |
2557 | ABB83F84DB1F5639599DC7D3F51241AB5D95C3BCB7AB1EC90B4BC989F74FB354 | |
2558 | 04B2D7366A34D335A47B8C00C05CB423482BF6C7970A95545424A08AFF9A035B | |
2559 | 7F83F52B65A9799CE76E303B85664B624C65E9CA58184C7BE2BB9D9C86A4DE5A | |
2560 | 8165EE3DA2E652B5022EE7893896BABD88931DE1D538F615787645DF5ACBBA0B | |
2561 | A8E5B899A37321AA7D4B283AC9234978C2DD81813A1EE5DB6EC170DAC1B6EF02 | |
2562 | 94892635B498765C07A38D2E9DB0B7581B11056C28278F89B0E60998379C07EB | |
2563 | C0EAEDC32AA69B8B836F92A61AFD35688315B2C3F860632FC13E4BDFB63214BC | |
2564 | 41CC6859EAB3AC3034449213CAB99FA1D216563419CD6D6CE4E1B56F33E6C654 | |
2565 | 7AA9DCB5B05FC068DF02AC32408C8010AD004F6CCA9887830927F8CBCD49CDB5 | |
2566 | 18CAC1EAFF815FF2F6F527F936948201565003022C6C7390B4E3C2B219FB4F76 | |
2567 | 9F12BD25CA7B3B61D1A2F8DFEE795D04D5428B42FB66E0C254AF7B7A10CEF7FD | |
2568 | E5ADA5E217BE24851180E9A1700FBA66C7D2B0D7BFDE4F4EED1D24B821A40947 | |
2569 | 5620363657F6D048E651A689822CF815E72FC8AE9D835BE31D1DD8B54C9A717F | |
2570 | 4DC319B4B59AE073936EA40B070524C7E71D5A7B64436DA107749746B516E29F | |
2571 | E3BBCB8F8C473E706670E11E5B221716F315FF097CD1841D0069FA69EA1898FF | |
2572 | 9F9EC2518C77806A19730C97F54BEAD604548D553D4A6EDB247853225E24E7E9 | |
2573 | 89D71F6BC94DB986467E755CCC99069B313F5745B02B4BB608A39F0A0A732B87 | |
2574 | 7EA2DED68219754BF1FBCA350327572D769C962EF9242132D93A5C8E9725D8D3 | |
2575 | AAAEC15ED0F362471AA58488620156F3474FA59CA080EA96FE995D2B3DEEADF3 | |
2576 | 3141D157481C66507725ACA5953CBBE1ACEE7E3F02C72C6552D15EB3D612730E | |
2577 | 61A06A43575568DC3CF3844BABF04CA767E2995196097015E0C4F622C4356B6B | |
2578 | F41DBAFD797A4B9D7AC22332C552043EF98913D0D9B50CA6B7CDAF903BC5C04F | |
2579 | D20A952BA5CC35B646ACD0A287C956B98C450051AF6AAF79DF37F8954473F8F6 | |
2580 | 652BF03AE2AE82B99D820CF93F5FC0BA17EBD7AF90313E70594EB5C354023BFA | |
2581 | 07912408F1757319C7288E99872B907D5AB583B082EEED8AB079C63E38B07D11 | |
2582 | 6744856E689A479CB3A8BC081F33CB06755926204981DC0A45B3ACC18F6865BB | |
2583 | EE2C50DB43B62E3630FC1D9B1FFB3BFFAA6D0A20C0381ADF48E4D916BEE85BA2 | |
2584 | BB40F538F55C11D50F882B73913840B45161262BC8B0012694C3EF26452F9B77 | |
2585 | 2CD7C7AD6BFEEAFE31C8A721C2D46AA00C10681BA9970D09F1E10DDC250E2AC3 | |
2586 | 9A160EC8C9654FCEB36AC2B586E978D54744FC8A0E963D8EF6E228ADD22D093B | |
2587 | B889C940206F504F14DD921D909BE06EC9BACBC23EB9E9D137FBC983570FFD2E | |
2588 | CC5D2EB5D2A4A8604A4AD418B800EDC6B89809E0009760E9470F037FDD15E649 | |
2589 | 93E9C8FCD9436AF02447C7F5AC380FBE69D1405189E8DBFDACF0E7DAECFA095F | |
2590 | E6AE1A2E9ACFC032BA9A5DEDE9DDEE22A88D9A1F1E0FD9BAE2D88FA168386D43 | |
2591 | 4B93EFF3AD84A9C05A80462BB3A940B2F7311CF7054F501BDD4F1347213C9327 | |
2592 | 5653B73E9D78866901235C66B0C49CBDE3A1BA3A11991E6B8443117745D96020 | |
9f178efb CR |
2593 | 38F4A74D9676E4E99291D4420C57ADE4A8D5214D07B14916D83DF15114393048 |
2594 | FBE0DB83223F609ABE120AB877FEF549B6E2389487BB7ECF1979BCB0785DAD1A | |
2595 | 2916961A1DA60AB491FC90BCD6578571226B4DFD204E75FF18FB5E72DFE8A028 | |
2596 | C66F8576254930567A877DBD22F8372E7BA4F23F9497ED653906F5F67A66A1B2 | |
2597 | 51957AEB8D443550161075E5523F3D2AFF386E2640B276C3EC5EDAB74AC0DC94 | |
2598 | 7D975D7F5781A652BD13AA7F97ADDBE68847167997ACDD038E74E930D8248F0C | |
2599 | 2CCBC094031C7147BD8D4DD664184695CF8C474845692540FE2B8A72CDF9DB62 | |
2600 | BE05E15A05F59D56E5EDBE7C371BE5CB3B276FC7A03B5942057EC3136591A1B9 | |
2601 | 15E504DC497B663A9DD1729EFD1478C233B9317351D000DC0982F061BFF25A3A | |
2602 | 8983E560AE31E321DFB137C77C0AEC704F8DA99024232F26AA6920D58CB17DE3 | |
2603 | C1BC8E20988FBC4705E594569BEFC3F6666785B2FFA49367E3CC695F2A1EB846 | |
2604 | DEB37E120B0F4C0783C0D54655C143C4F74DA0690C6D08D07ED225F361BC0F86 | |
2605 | 572D79540730791DCAC15823991FD5DF1AB8F25F84EF40C085B17C9070C59EE6 | |
2606 | 31DCE45AFA78440BDE4C69A4D954C2006070A2C310179851F2D39B1B5D3EDBAA | |
2607 | 289570BE80F25D75116BBDA61F002B832F9EF2C32B53258B15A1174225168B28 | |
2608 | EC3324C6EC61E5711811E658A1BA65C8D2D47CEC6071CD88DBCDE9CFD2BC34DF | |
2609 | 1ECD2226AD588B50AF2399D171E99D8086DDE33E24640A767F249797B1B742CC | |
2610 | F4E95A64E1AF8D88FB128194673CDEFD6A1672DD1D03B6749E729587C0CB7C6D | |
2611 | 13BFC785759F35578D611E924CD89FF87DFBC5C93FA7BE150624825F7D137CBB | |
2612 | FBFB1238C1A397826B8D1DF0A39EBDABA5F10B37FE8C27568E1C088F279A0E28 | |
2613 | 020DFD377694024FA154AB5C06EDC3CAAC3CB5A69297E1079F5C2F351D81614C | |
2614 | D73ED708907A96F6F8FB0994D3247045E8D41028432E91C7ADB2F22066D6F8D2 | |
2615 | 701298CC9FDA7928F99CA135B69808AF6FA1E0A3CCE1BFDE234E9218A565FE28 | |
2616 | 96541CB9381E887182873FD7866F5F8415EBE92E51E7FF064D6CEB7BDBEE4DF9 | |
2617 | 97633E53488AB11EE93137AA185AA7E4AA043BC73DF1739C92B4D3A8C46BA689 | |
2618 | B9F8FA73BE010D7C4F9007937AD0EE3EE4E3041C72A2C4DB92C6C5433DF33A10 | |
2619 | 700F9E891885DAFDA44A00781BD019A9FFFDB6FDF9361520D50AA5037E654C8A | |
2620 | ACD179511AF61BA10DB29A0535972DDE8B838091B5EC3F6C3408E02B8CBB3FD1 | |
2621 | E213E2C53DB7AB14D465CB0E4FE2A2CAFA20E74BF4601CC23687FA7921CB1B86 | |
2622 | 6DB57E04C99BF7F56FED75A052362016840676DE91888490B4A1DFE0C079C88D | |
2623 | C8C3BD3527F7C006E1403DABB47C3F9174208A379C221931724F06270985BDE6 | |
2624 | A53263227EDB00124C5677613BEA94BA029F9D6F8BD1F7B87C4426210AE554C0 | |
2625 | 7BC707199BF6DB673E40D55741CE1F0853504A414099BA8E0BC7F5EBA5392684 | |
2626 | 79552A5D4F7C0CD3A6D80B18014008AB011C8C66C74D32AAD748EF30C1AD484D | |
2627 | B56BFB090C5BB937E81189912665F332911E11E83CCE75A79DEC2838E811D5B7 | |
2628 | DA85AD6ACB7D8A98D15DEC66504CF2131FF06AC9A8A4FBC4CF34EFB8455C231D | |
2629 | 0F73A50052AC8FCFB2B2ACB95033AF04078E9CB99551FBB1C46EE6C413D86C90 | |
2630 | AE8BD7FBDB7BA6E9087658C79C4758E242256C0546DB76A3857BC89F26A4DD9A | |
2631 | F4A848104BF1ADB2DCDA25C79BBBDB66CE1C1A45C7427FE7CE5BDDA7CB599B4D | |
2632 | B5D346B15414DC9688A9D00F0372DB98FD33E6164E5D78D6CCEEF0FEA60A7F5A | |
2633 | 9873AA7E2A7F98893AC5A9598B71BD06D13D2766489248190A262E5EAA459888 | |
2634 | 6D0A38261697EBFA55180F3D416C2190B36C309202D1619A405764612BAA3506 | |
2635 | 7D157F49FA1E0A7F252FCB0B8459A30975E02748AE1A891FD6BB288E0D7C144A | |
2636 | 1D348F1DDD145912678DAE1906796591E35012373AE01E18515F5CC3BB29A629 | |
2637 | F8B28B54376A9E10D0CFB29B81981E66F27B6AF44DDE0A3621B9ADADA9588201 | |
2638 | 11A0362FEF840B200C84480177C9E3F0777350BE92707BA916A90AA81160D498 | |
2639 | 6417DB6C7E15766EC5C9058CD51879041BDF2D2514B0D6B968CA0A300EE2E30B | |
2640 | 6AE41238D76DF324B0502BF79D58C2DA1FF7E384891182AA59918DC8EDF92299 | |
2641 | BA162134FC3DADB6FA5CEABB94D1CA9BE1635F769EAA88377AD96510A4DA8F8C | |
2642 | 5319E0C06CDBDA1BA9845302F716DECFF7B965BE413A7BCFF3C4EADC91626070 | |
2643 | 9A5776EC64C67DDBDBBC66F16962306631D70E62616DE4997ECFE39DC6BC9A75 | |
2644 | D2297C2159066195F43B7002138456AE7EF69220925877C87405D06144D250E3 | |
2645 | 55EEF1575DE8564BF98E2ED403591F2EA4F6AD71A126A9B1F5D350819058FE4A | |
2646 | 949B8C3A7907A725B463B752EB3B44B090C731EBB86FAFE24340D1A89D3FC0A6 | |
2647 | B89E64C3FA480C91DFCCE4922C000B0533A052FB9305EA3B58A38A3AC2688715 | |
2648 | A7C7418637C393439725F0509B3B08E07DE5E0350A005E4C5DB815CD317EDACF | |
2649 | 6460DADCF9281BC6523DC8FFFFE18CFFB2EC61884E7B324806851A91F7E0336C | |
2650 | F86AF2C88F1EA1EAF0F87013AFC7DAB6F6BE426D92A406437E38C75614AAC461 | |
2651 | 4EDBD8F129D985A1385B0F9F1A4E6D9936FEC600F4E431C653DFD1D56F694471 | |
2652 | FABDCEC7BAAA0C266D35D7380AEE587F61DA5CD1229D99F82BFA7B1A45A165FB | |
2653 | 658A4E7A741E11931D6E5C1358CF76056CC0DCF4B623C2A8CCED91694E46661F | |
2654 | BCBA0225541BA9A58EA1F2E2B2402299EF2B691C39A87AB3D5C722DB2738EDC6 | |
2655 | 8ADEB09750D714286EB392D198A55784AD908470517724B92849D539ACAE89E7 | |
2656 | A8E37CF20CA87635FF92F1140DDBAA76CD52BFC0B40FBFCA768F837D0AFBC7E9 | |
2657 | BBC89422CBD6429B284F67AD2DF917AF69346A5BFE8DA3DA8F9597C2265F3BC5 | |
2658 | A90CCE79572DB45176AED6E1A5FBADC98816F0E29BF58DBCEF62EF76A8D8C845 | |
2659 | 4C7E9AB94A0EA43D2FA271BEA800890613D8247171938596CE4948BCBC7960AD | |
2660 | 5B2BA3E0A4384749A7D88F3DD515CC1DA7292EE9775B67F621E156020419D0D2 | |
2661 | 1A6AF5B51E64D3EA7D182AA65AD1F663FB28739B86F9EE5880A5A96C3AE1C563 | |
2662 | 7A002FD0ECE3AEE80AF18A0FBCA3EDD496C18C8974E856BA39226C382CF8541F | |
2663 | F7E2C35B3CEB1DEE3BA8F346199944BE2F350E4C3DC89D789250C3C5192236AC | |
2664 | 513D1A3058230470BBA11E0B39141F48065B808B6FC459A897C304B749B5A656 | |
2665 | 38B55950D6F379A535CE2816498DE36D03747FD07514C2DA1764217BF2DE17BF | |
2666 | C8FB2F06382136D301953DC42EA0B429489275571F6B86AAF496E6A2EB196547 | |
2667 | B76BD6DFF6054DAFC9CDC11FBC541426DF0351ED027FE76128411F6F62DAD159 | |
2668 | C116B43AC59C885B3308B158EB74405541F2BD247BEED5D3B35554EABCC133F1 | |
2669 | B71EA3C7C7876661EEDC141818A3E8A9C519E7054E26DC023320A0166FED1C19 | |
2670 | DB1C3044D23E5BA7F039D86ACFBCB5F881A6FF9135E1F5DCF910A873E6F7DF8F | |
2671 | 11372C039D09A875DDACA3FFADB73504C1749932C3792CA80D78979CE0269AD7 | |
2672 | 47CBE7CA39E26FCE1E71DB711D176644423FB964CF8CCDF16FBB686877B1B99B | |
2673 | FC570BBEE55DC7F2AED8E81FF38DFD61322F1FB69E5CD6EEB8135128A35FC23A | |
2674 | 5ADD95D4F873B2EFD14A1FF76CD20454BD3BD2752C9A5F0C21F1E5F39C5865C6 | |
2675 | D4874580E6224B22FAB9240E0346C843AF0C495E7FD5B3310D90A6308D47E882 | |
2676 | EAF80772C87D3F7FB9DDA52F253FE4E3D1E56EBFCBDB9BB9A977DC7E9772428C | |
2677 | 47EDCE4D4F793F4DB9C66E65827109E83723E50424A87B36D6E74DD05B327128 | |
2678 | E407252F937ABE315B18312C8BE965E84ED9C895D275A331EBA6E872DBCEE1BB | |
2679 | C6254960940B95F46CAB4F8469E7412F546E62683AA356366F454308367A789E | |
2680 | B1E6F3A07B87829111DD17856727E948E0FAECA4EB00192F125C2331011AABA8 | |
2681 | F4067FD01D56853FA445ADEAE5901242DF460ED8AEF939332F87D81DBE9A30A4 | |
2682 | 18884AFF8A7F00530BC7DDD3A1E6C40549BE3E567B225E7C8844F0AF3E19A4A7 | |
2683 | E61F818A5F1BC836012FBB9AC4A5AE737FFA908EBFC88B2EAA62877B05B1B1BB | |
2684 | 65062420B89BC4C3C4B7CFAD1148C6A373F26ABA9A8DDC74DBFE47937035DB49 | |
2685 | 20F0B8E788C0AD02381732BEB2B9587D6B50E6F7B4E9DAD171B8C64B60A04776 | |
2686 | F70BDD9C6C8831AE39561701FB54D68810E4C3249C32E4D39BB40C500C8A735D | |
2687 | F316A68985E3A0338D8CF730881326E2B76D75BD2566D7387C0DD8C5724592D5 | |
2688 | 1FEE9798B269DE09387D3A1EDAB20063BA852726BC7EF07CED98E2DD1957F94F | |
2689 | 7E336F6047A935E128444DA8F525FF1E458ADBCB1B6D910B68955DCC59512591 | |
2690 | 2F1228007F9524A0AA6113FC6805AC4ED806D5CE6E03AC9EB6830EA9A7AE975D | |
2691 | 99A4FDA50B92FB6977BCE8BCBE2D8EA44BCE9B39718584A452205C4349561CBC | |
2692 | 7B1E281C058D0BE636CDDE883E1C1AE3802A35C5426443AEB6FF705EC26AF94A | |
2693 | 2A7BC536F373C0EBAB41C780E56F5BD1CA645DCED5090CF32D4F0E5A780651A0 | |
2694 | 477CB27558B2D0E2AE3D0A02565EE38D5F437D01308A6BEF55E80422F5B5B56F | |
2695 | 6DD11ED717B034083F9BB1536D76E321255A137E618B398875B5BB8F5AF02B6E | |
2696 | B4DFFB173C424B2619F448F7CC3A206BBE5A6246CC152C59C909C600F63AE940 | |
2697 | 60ACB023DEE119BF9575D15049B5DF6441715F68B7082B9444408864120F5EAC | |
2698 | 9AA03C7C0DC1FFE2C4F80F12B93F6735B9F0BFB8FD5009D8ECE097B08A198D7F | |
2699 | 0DD0D8F3F32E23EEBE92D456E6C19F095F70FB5A0A4EC5A0A28E2A1B48E97728 | |
2700 | 18BB643C3174C5B882454561D9FB758B35D8D1AEB3C6323693353496BBBB7A21 | |
2701 | 5DEDEBA1AEAC77D8189B2F2E67A9534E197055EDA86604E54A0692BDCD66B790 | |
2702 | 068C176C2DC9F8C808E941210A9701E7036C6090536CC8E57D7930DAAB3810F8 | |
2703 | CA78AC8BA0583A692B3707D8EFF67852F1D10C2316CE94B0A86565F33AA21D95 | |
2704 | F10EB3AC20610AD3E994906B46C6341AEFFC14D68FA18DCD7F47031862B77761 | |
2705 | 33AA4697C83E422B68E3088C75454BEED7F2B2683DEA162D64A2C13A6FB9AEA4 | |
2706 | 805376FC30C38D71FEAB0270ADBCBAD2783F4EB5CBFE07B3C8092CFB44CAC100 | |
2707 | 596981C49C201729363F55CB5BD83002BD6C48EB90BD0025D0DE37FA60BD65E2 | |
2708 | 0471A4D7603AB24B35F54D8CBFB69C66F8B7479DC373EAF98E179445C3C75D83 | |
2709 | A4E3F5FAD36BDF55E1277757AEDF5C5E653CD8D20E88A4E2A35C3DD1B28EF3A6 | |
2710 | AE0BAF0B4EE0183528D3D4D477A37B1F1C8FA2ADC6AD45436B44E7DB3CDA336C | |
2711 | 21984BD90389BB4DDC946C5BB90DD36F3F2B717EE91AAE5DEDFCC61346445AAA | |
2712 | 20C69B691AE897BF37C4CD53E7EBBD2A688329980006FB57DDC23A76CC50319B | |
2713 | 664277FA194B7B3E6B367A64DA7EBE5C2F49BB2654E9F9E2F90DDAD323134ACD | |
2714 | 7E791DD8D54952927ABDF05859F1E7A261142BC8E3FEE76D68DE3D934A6CDEA9 | |
2715 | EE0EE9B475A5E0A8EDD62B373557B19FB378E20CAFF7E6D7B8971397651754F2 | |
2716 | 0C1AA7352058FFFEDF2678D577786B0A1A8D0808B3E8730B61181173E1D303F1 | |
2717 | F7E76AD64859FF5174978587BD32367BE92A0BF88EAC6C6CD1F4C961C2042C3D | |
2718 | 2F30FB270135154DB5AA09BF613BB9E481B003006E230362A670175F08FC95A0 | |
2719 | 9A04E761D19EBB5B5E35B178FA281E1F9D542012BE66BD263D5E0D33F5D9AA55 | |
2720 | 65AA4E7455DC8DAA3B1282847D24867F1E2FFC0BD6FEB64EB3E24456C8D7BF03 | |
2721 | 2E63825C24B8D6EB7CCE2D711A218FC3388321F35029B10C914A76A86A2979DF | |
2722 | 065AAE38A3F880BA047D4D1DC7FF83B27D5E0364CE9BF40618E9AF2079365F3D | |
2723 | F3C3D03B6140A53DE5FDB0D85D448ED3EC184EBA2B807FB3013B3C1CA1A586FD | |
2724 | ACDB00F8DB768ADA36F90005EAAE1A89E8E40DB045F2C1095F8958D9193CAB72 | |
2725 | ECFFB9AF10717656BA3B2E3D09B0E7911768AA2B661A2C87D66FBE26CA23F6FF | |
2726 | EDEDBA40CD167F1442F4560EC101A605EF5A76972190424F0950923396C7E375 | |
2727 | D3B55F06B378166B6A2472B83F8E77810BA74FC39102DCA7DF768449EEDC53DF | |
2728 | 25FF749A0212C8E77E78B7C6E53F306FC870F71F07F7202CE18ED5A1D68B8B61 | |
2729 | E653DA69E05E6B2C0731B3D298AC63257B63B773CB51D9C9651C5D7DD655F503 | |
2730 | AEBC24932ABE55B9B2FAED40FF745685F0F7DAB850521F1F28934F151CE0E760 | |
2731 | 3C95C6FC654D51E5F280BE0301EEABDC20A53CCD02D6EBB7C743DAE40684B157 | |
2732 | 8E69DE455563628C63938D6E77E76FC488E905753D58A74E6059F3834EE88B5B | |
2733 | E11BD205B63E7F44AED092763076166B8AE25CD12A3F2294B94C19724F97ADD8 | |
2734 | 2E8FEAF5841F52D654A5E366454C625413D5D14069BDB1C02D34F8C1E04669FA | |
2735 | 50BAF7DF9FEDB9745D3C220886B78DE4B272C043F37D8A9B97C584B63FEDAF5B | |
2736 | EA8FDE3A373DAE7C2C029C892C4501E140EF3ED7A1710ABD761BE6E39CB18F55 | |
2737 | 21529A69844CD87C3E55284348E9297B5969A37FACE43C4E10870B61801CCEA4 | |
2738 | A236288DB3F6537F7E6EDB5A39B0BDDFB74523F3B78026A98C6C7F7647AE4005 | |
2739 | 51F0B7333CF9DBEFAD223CF07D577F09D9E40E4DA34A7A91A6827D628FBEC964 | |
2740 | 7BD672722BE1647A4A51ED1E53536958A13DF69165C10471CC39B939813DA837 | |
2741 | 26506BD312569097CE4C542330127D8316574BC6B13F234B514B13B151F49F38 | |
2742 | 5FCC1511A11B3E488E31E7EB29ED38D4D9A04D1606263ADCE796364A0E1EE611 | |
2743 | 73145BA0ED50B329ED72DF373701AB8F83DDC0BE85D296C396C94471E617993F | |
2744 | 34C7F27E96963A3EFEDDE4E89BDBA7C606BC6FE2AB63CE2C8C52724C004924CD | |
2745 | B284DBEE7559427559FC1A5C5EE739B150E03FAA4573E4FA0D16090679BEB417 | |
2746 | 78621339D334002D01BBEFA8D4D8E02425105261E9B093CBB0337301155CC554 | |
2747 | 7B4AFDBA72FF0D111D26AA6C89AE3D8BF0ED28CBA683301DE49049527C0F8618 | |
2748 | A1B48D9906D88475DF2F3A9657BEFCE34FAD0A4801B959221A49C6C7425F20E8 | |
2749 | 889401BA118221E6196957A790C159360437D7852A27E752C05C01180F80F2E4 | |
2750 | 5FB6D1A0B2B781546585A448E7D528769B554936849DB7AF7CDEB393B86CFE30 | |
2751 | 0C4430F7859146D7A5E371F0C443AC6B5A6876245643A2E147806EF7E65470DC | |
2752 | 5BA1574A7849C14F51951453FB88BCA11C8B6D5B3BDA0DFE79B68B9C3AF7CAA6 | |
2753 | DB4412E0AE6D40004418B10DC55DCBEF8411D6A2B4238EA63B9C4B7B7210757E | |
2754 | 4B1148742AD2ECDD1F39E47826EB95E38F304BF507AEE75EA8F814C537FA1494 | |
2755 | FBF1E1177B98262B9C7B3E06028936A2BA5741F135FD20B32BC987CDAC91C6F2 | |
2756 | A528DE9C430ABE7B8A3DFE96B2C4B7453BD94595DDF7F726810143A8BD7F121D | |
2757 | 4E2745AA2A2CBAF48576476D8346D0637BD329FCD2D15D164A78B4A845421D98 | |
2758 | 2E9B65C14E8810A2E4ECF05966B2DAFD9FFC2E23A27E74AD8A8F41964B206CF5 | |
2759 | 46CAA9F0CB4F9302113C4B84EABE1C34EA1DA560286FB89D069E933AAA6CCC8F | |
2760 | 8AFC1A6D5CD46B2D3FC079C42A3CD448B724F859C71755DE746791E6D2663C62 | |
2761 | C801F5A3851EE07EC782DCB89CA9284302F1B238962F02A970221E248BA87485 | |
2762 | 3352872C96DF0AE2A25125880852F9BC3FF3EC521E5377907E1A4823F6F71D8F | |
2763 | 4A00F6B64393895826FA8A795A22FF0ACDD7B434BC0B6B8CF644F277B5AFC638 | |
2764 | CD6110E69851E986261C4FEC776D9FF446F974F01DA8B66C29AE35FDD26287CC | |
2765 | AFFEC304EF0F4B4D0207A48822373DB031BA5B0207A27C202B8E6A9225569269 | |
2766 | FF224E7A5C7952A2C9CA7C574877654F5A885AEB53157CD9E1F86FB8CE6BDEE6 | |
2767 | 3B4B18BD0DF048CACAEB8B1653521B1CAC70674C8E0E0F52D1D20FDABF255735 | |
2768 | AE84F2460B88FAB55BDEBB0E92319BA90A6860DC939EAAF454D3A1E7CBB60ED9 | |
2769 | F94363F069F6A7209BC408E29C2769BCC287A634BCB8DA80836DCDFDDD265D6A | |
2770 | BFA28CA76A1ADE69A8EAF62540903706ABE09BC0E91DD87EB38D1482BF79862F | |
2771 | 85E4131AD1B172EE0F47B627EA39F14BF808E2E7399E7A59886A48B57F06BF74 | |
2772 | 2A81D5A429F8D96153B68EC82AFE4E3046B20CE5B56A6197196EB1BF5063E415 | |
2773 | F75969C72918F0FDBD0B6301A3582DF9089151515B021904659D1BE4B43B29D8 | |
2774 | A485C48F803C9F74186C527DCFC6322A48E4DA39A29A7DA79EC395AE61FF11BC | |
2775 | 9860E8036B67A06CE3ACAC15BD6F5E0BEA287EEE4F16EB3C905AD31BEB76E434 | |
2776 | 028449F1FF147AF28F382929EC5AAC6F0528D4A5600895EF0852908D4BB6986A | |
2777 | 34BE0B0F5BFA99443441E4396ADF11820A37FD7EB079601CA692CB3C950447BA | |
2778 | 46AEC7F4BF6EA0787F9522A015D41C58DC0A9ED32103892D3071110EA6189FCC | |
2779 | 940C1F39290BBF3253CB42E015108018D91CA8EF5D52BAEF026FD1D20C395B55 | |
2780 | E0C6A8C0E199E9678594AEBADB4C7CA15CD16B1D97B9E9414077E4B9D7D37482 | |
2781 | A2153944B22860F6E736F0E3B88AE3B66C7FBAD2545E2867F7728A4E317360AA | |
2782 | 51EBA228CD7BD89C5CF33F50F00382E2F38A75837487AD9D5058423A5B0D4FC6 | |
2783 | C40ACF7D697AA00F8C0DE7B99855022B457C2268E5316F7F496326F3C86E7EE2 | |
2784 | 83FFC6DC42BEB91978670559466F2918BA13C5E7BCD36D589100C292D0FC124B | |
2785 | 567BC886C60C646A20A0DA1E59620BC57F2CC3C7042C08FB6D992C2CEBAA45FC | |
2786 | B81B5D09D8FF740CB6DD5E908D6821B32E0EDEF8660AAAFA262844D5213914D2 | |
2787 | 828D12AB9EEEF9EA65078B05975B4625D5505518C08CE8C150F5CF933B17C7EC | |
2788 | 879D9839BD08BC38F84A0AC362C260CD0B56A504351AD2DEFDE3EF044F9312F5 | |
2789 | B9973552C834A293EE64C2BBA4D47B2A95DA434BECBF22D26624CEA215B6F364 | |
2790 | 1902EB2150210540FF8B9678AA483FB1C3F103DD6DD86B0E3016A4DD00EB7B5A | |
2791 | BA836EF9E9F26307F4648603AF92FD8B9EEA19125091C3F33F50D9EFA965B7AA | |
2792 | E6D8F5EEA76A1874DB12C874162074F615A0C141647EBBD184AF5D53418BA286 | |
2793 | AA3A10106EF65F09511B26EA124725C81583B79351B96322257EA15583C600C6 | |
2794 | 0E8307CAE7853FA002CADB2A90CDF98C8FEEA629A25037E718017B87B806145F | |
2795 | F20E0057F9CD60F0133CB01BDC8E502D2C4B9100DBEDF93F955A35B70900EAD5 | |
2796 | C045B891E0CFA1F75031BA2B346D0CF632BD629A9C5D3258C1D7E0C9D1D1593A | |
2797 | 110BDEF6FB4B638AFC2F78DA1B4CB524A2B3502A4D62E7B13A3D55A68B00199F | |
2798 | 5687A3D259126CEAFADF2499D0133959B0BA9629D95668D7AF12D82A906236A4 | |
2799 | 837635EE78F931B00EC1BEFCEBD8B97D468A0D38B449841947B4A772BBD5FD5F | |
2800 | 7B1B657B2520AAA600A439E395584E339DCBFD6D0256006F7C9D39904B55416D | |
2801 | 507548A98EACF534C4587595D6A9E276699BBF2BF016D4CEF438CA37052FDAF3 | |
2802 | DA3D2D3441E31A623D3CB143119FF95A1F04BA7D3A9B5E561C492658B3F5444A | |
2803 | 7DE7BDF42A7E211A6F624BAFFE91D61EE884FD84F06124ED9677A15B6131FF49 | |
2804 | 205BF0B9F7CBA8D2A6BAF952F5022EBC8AC56567FBE269472A08FEA231219970 | |
2805 | B7A9D9842EAB692AEBDC37C749562680FB7953D8359D8307558B8624E048BDCF | |
2806 | C45CCE9134E120F8EA1A4186E57821CD91DFDA1512200D0F1ED8844A13554EFA | |
2807 | 077E848618A426A480B82B4556079C11393F07F355AB53494B965A3B304DFE8B | |
2808 | 020CFCB4782C58065F0ABA591F4B807003ECFD955C73E38F37CFCE482B2A5A30 | |
2809 | D32D608A142EB964B6B66C3B6F0FDCF83BB5E36E45E43EB045A7BDAF0C75953F | |
2810 | D382040EA2B54AD9AF2F7E9B582B19318D7987DDEA32280EAF70407FC80F3459 | |
2811 | F92A5F4627E229EF4ABAE598BD9C3324B07276B9E945CE4B74163B9DE723933F | |
2812 | 6BED2E0BE0B8E95ABDE2C4FD331CEB50944C8EA073AB32C0B7BCA5AD33455872 | |
2813 | 08A32D4C25F67FFE0ABC8DA05DAF65F6886BDDA191B493BA7A1211CC98C7FCDC | |
2814 | 25F0A251CE379F378F73F9C3FED8DE5AEB3D4C8E2CCA39687138DFF0D1E26E96 | |
2815 | E9D3A4F6FBF5CB961911C0018F762BAF53CEFB2AF145C55E7AF367790D2BACB6 | |
2816 | 411D6F5DCE3F27C4C490A9852ECF4C6A2659407FFD1FA16B5C8EA47A5BB00E34 | |
2817 | 4BFA4446A6925E5D5752245AEDC5D4E5B2BF51908ACA64418DE64E3C1DD1A052 | |
2818 | BAD0CD6A1176091CF1A595BA13CF260ECE6375BA1A5ED68C0F21BF01A7EABC4C | |
2819 | 189E2FBA359BC17FFBE565628CD01662CD4EAEF2AE0836A742381B59E4770907 | |
2820 | 0252C2B21CA6471173CCA084F38E1A10B5D38E4D609BF30BCA7FA4223A4B44CD | |
2821 | 8564002503E8C1FE7596CF9F3F6ED4497223A1AA2844ACD08BF7E7804BBF232A | |
2822 | FC2B030F1126608707757B37F2BF295B3EEB61ACA417C12C877600DF9E412EC4 | |
2823 | 22313D45B0A92903DBC36F336B9CDEADD122024E4E9EC1719A05AF161314CF59 | |
2824 | 550518D598C1F432F6F619D68C47250AE9631837EEB52180E307237DBC0FCA5C | |
2825 | D6445C5EA4284C0834AC268955B7084BA7D1384E8D4FBEFCAB3A1C8735FF57DF | |
2826 | CC8FFE2BBF52AB9AC097C1AF30C46548BF5CD32D71502CBDEB3982F85793C229 | |
2827 | F72039A25336266E5BBEB3005FE48F771ED9AA3161E88121B62F8D03976FFE66 | |
2828 | 4D40E1DB342A9DC540225796DB48828FC2FF676382AF3D3E70E75DE05D7AFD43 | |
2829 | DDD0A21B5F28209FBE9C0D1713595D17EC31F94D3AE98131E25663BEEEDD8D77 | |
2830 | ACE63ADA18690128517D2A9C1EF0EFD2F8BC2C68F4DB891B4B5BE0A0A647FC5C | |
2831 | 7248EC6256375DB235F48FE85AB575EB69EE092289102409A26E924F816408E9 | |
2832 | 6A148480E3E0A426607D185993F36CCFB81468D01F25343F91969EB0C65C73AA | |
2833 | 2407EE10DD59CFF0DF9BE2FB4069D03CC036E4EFC709B039F529F6159A3FAADC | |
2834 | 95FA4993E57EC1DEEFC39131156A75BDC06A2659DCDC0A9FE78C4F6DF5ECFC77 | |
2835 | 8D555E10336C4B9A873CE4F58A9607EAF7AD34C45A8C788864C39B9750E4CD30 | |
2836 | 5BB52329B609780125FA6960DDB2CC21E368571785C1E61D4BA2CF57E996312D | |
2837 | 8785290A893183DB2B8590E4C65F25E6B67CF08DF9713FE785DE8956BF9F6E95 | |
2838 | C8D0BE11BB23DB038BEF4FFD7A5C3C41F88A72A64E3C0358228DDFAE06E428B5 | |
2839 | 2ABF80AE2D3C194A4C31DA6F294E7B988AA655D3105C5E0A01CA3D2F073F1C09 | |
2840 | 903CAB398F3E78BBEAEE9AA555B5867D1A577BE0B7CE7B92A9C2E418C156DD6D | |
2841 | 1C286A527A8345B852E6E364FD6DDAF9A350446AE32D8C195FB34D177BB12278 | |
2842 | 03B0A4C993C2CC198476C3EB7E910FAA8441062670E619F06F543B4F0DBD92E8 | |
2843 | DDD0F9EAED33CC1717996FF3C961F1A31BC34351FE75CB3AE344D97D164C9C47 | |
2844 | EBC30F73E3782842FCCD01C64627602BD39C36EB76DE02AE3D71472C78112819 | |
2845 | A7B109DEE09357627A3AFC0D48BD43D322E9B8BF2C05EAAB45D3495B86A1E639 | |
2846 | 5E43817B1ADCFD85BE0AE455EF4EFEF75A6C52CB8210AF749222124594646BB4 | |
2847 | 5C6E89246CD90B89D60C2E141CD5093AAD78C31F724EB7C14F69AC451C68C700 | |
2848 | A520FEF0ACFFD8B4B2092A3D6534E2495D58B8AB3D76199A62EFDC2F12C39606 | |
2849 | EF7B0F73FB37BACDD3A3813220B4CBC66978AB207DF7164F05DEB3F9F7916F21 | |
2850 | 647A6482D143482480CC14C7676CD04094C740EF0CCFC2AEA3B4E4DBE57DE61B | |
2851 | B67188036B013E93EB47CB55BC96C4DFFD6D671602E53C7807D04597708FC7C9 | |
2852 | F56819B28BD7E2731F3A0C71F08CEED40C354946F5CA237467DCA92069CFD851 | |
2853 | 7BA1C0E398C721E597D47024670F64EF00BCC74036C9FF94BA8DDA00E2B5F152 | |
2854 | 8F6D8FD9C58CE4B32D1F9E17490B76FB107AE92E4BE09378E00ADE4C7E737D4B | |
2855 | 9B26672994CAFFA7B04EFDA7332AC5FDD175E996B4DF867A5A5B95CD40AEAF51 | |
2856 | 5B91313A4ED9D4EE86EC9B5CAA594AB82F85D89B42AF50AACED0CA3046292E9A | |
2857 | D8EA95CFD0F67259D21E1C6D9E3CA990C2B159205F34F270EDD783277FA33993 | |
2858 | 5F8EB1163FEC6C2A627218BED8BA4C38120E46BF161E75B623811C1B2E1FE99A | |
2859 | CF93CDF69995D628C6965CC12D5216C1A829CCC390DBB87D6FC5DCD0CBD188C7 | |
2860 | DFFFF86E17D5AA1162084DF13F51D139A3932B8107091A507E613F8FF9AAFC8E | |
2861 | EC4FB236994E73D8277EE91FAB4DE51D88E0CBEBA66BF190372DC182C643228A | |
2862 | 9B6E7E0B61904496EF1646D7BE9BD12A49D78364706F4A2C494EE8B768230113 | |
2863 | 80E61EC3F9A33A2BE64F7F82FBEC5A4537C4A10D7D4A902F7208572B6ED7E8EF | |
2864 | 0A70D05D876B5D1163AC5E8E179BD0015DCC0614DEA8185FE58C207B5B559291 | |
2865 | A44B5D6B43208F3BBCB61185498F9C2DD395A1E27180704BECFBDB2D2E7F3350 | |
2866 | 3E41D557D930D0BB781057C9322F2A23AD4D362D316EA4E46FF98336C761E9B8 | |
2867 | C638AA52F5DE03FDC7FBA76FA91DFA604B811B60227CDAB0AFD7EBA04C7F5500 | |
2868 | E71F6B96E79EB210BFDB3C4E17F8DE361C46A55BAE38F520504B4049F4D3C0F7 | |
2869 | 0552AC71AE9ECD8C35F49EFE8F446088AA12607F77A0A132B78E7CF4776532AF | |
2870 | 1B2218EA9138E76106341AD429D8609D77EB18796AF95E857EE12AE941DFD293 | |
2871 | 2318DDB0112E3FC3916C38491E14D620033DCD1D2F568A06C120EB7694390AEE | |
2872 | 21F3CA365EE38DCC3D67790684697DC838DFEE3BF615B7CC620928366B8A2ACD | |
2873 | CA3DA7A679F863BE6DA27245224DBD069AF51D28E7FC3925724903704F362772 | |
2874 | 67A2D8C3B1E4C0F343BD5EAB5C821E9DD828A465A80A7DF48F5F1153DC56228A | |
2875 | 15F81915064028C561A7D9DC00504A12B5212A658A992388250771ED09B25619 | |
2876 | 08473133667466EDE64986FF166FC705DF06F970716602DDB38AE398AB0EA5D3 | |
2877 | FE88D039FD3CEBEE13D999870890EFE9521E30A4C78C154B9F59D2C0DB526950 | |
2878 | F4C803889FF887377848979FD5A5C135E541EECB1D296B053CFF2BA6BA2CB48E | |
2879 | 137B678F06B1091389ED9E69CBE13A653E37A14A09B754B1430C265F503622EE | |
2880 | F87B1C22C747C6622ABBD1C3C75A8A0D980651BFCA3712291C119DE5FCE60E02 | |
2881 | CCC0463AAB39B8EE681FF905B4FB35D7501F95D0A87B2587FA0E16ED8B773586 | |
2882 | CA262BEACA20E1D3F33E07B38C9609C780472B665D577A1F868D629D84B3C8B1 | |
2883 | CAA7861633380407324D4FB9F3047CC3E8642B4CD1A035E3C0A10B0F43FC24C4 | |
2884 | 92273CBAA7144D6530A256B2DE5D15AD3341E28A6561C1DA1BA572EF8AC0DC84 | |
2885 | 274111F1CDF068595A77DD907A8381204026EBEB0C230EB3C563FD62DC5DF9B5 | |
2886 | 4B7FB4A788BE81CCF9B912A186AD5DD1B402A5E4668DA0A28AE3C3EDE128B4BE | |
2887 | 80DFC9DF0C000D812D932F80C2822B1640C8E3F46CEC9255FB2991EE1D3FC7C9 | |
2888 | F42669091B433190A5773AB2DE3B6A808EF33CE857D93D8B5DE09E2B864C1BBA | |
2889 | 0AF8E9411252D76FF921CB6E705539D2B773F752269BD3158A25999552415708 | |
2890 | BFDE7B4FAB16E3E511C90EB134511BD8B13FFA2C3D92AC07962A201EFA8A9BD0 | |
2891 | EB9B25A7512478C70BB4985620C8C92DA55060E18C70C03C5B54A1E48B39FFA2 | |
2892 | C06EF56825E934988061EC893E6163D4D4663D51835DC13F98C27C5E5A186AE8 | |
2893 | 5C63668210386C7F90B5B227A1BA65988D5E7B74B2F18CA8B30C08F1148A8A5C | |
2894 | 7FA3F8C1047602BD4706725689C367B5024AAAB48E604AF5A54877571913672F | |
2895 | 7266C5ABAE9E1F15581D195A8BF6913E875AD4C58999B19367801BA52193025A | |
2896 | B0AFFB630245F26A283A94170F1598CBDEE99DC2A1C07507BAABD4FA60039A7E | |
2897 | 8CB91728F69F2046680A8AF6679F902F71563A0657FD94BD029DA971BD4EE571 | |
2898 | 7BBCF3C1527987CAF4C3CACCD502BC7653632532E139F0BD2BEE36E8D37E314B | |
2899 | 372B2F3752D3343581CCD5DEBFAE11A09BF4334F73D1FC50EEC98A00DC81E160 | |
2900 | E7DB6EC3916038DCB96700A607ACDDD929323DFD961CD5057F4472AB3BD98108 | |
2901 | 6BA0C2708152EF29C77DE49615E1CD52153DC95D130758238977CCCAC94D3A16 | |
2902 | EF90CBACEA3BA3C4E3BB9AF83854AFEA1301F8EDEB4C448354F30F1CC469FB14 | |
2903 | 2C85A552465AFFACE55115AA7AF3A7D7FA9F2B3186B9D0E2655F73F5FEDF7F80 | |
2904 | 50A83D40D050E358F6904BD8FE102F19D707DB078A843AF32DF381E341FD3D4F | |
2905 | 3B75F547CB126F70EE4C36D8B8787F0ABCB2A190B0490F22FD304041B0E4DF8B | |
2906 | 35A64217EE77C40802292F7A4A0A92D249D789532F02A33B8CBF938381801FFB | |
2907 | 051D924F5A52A5C539C57C13683B1D335197F069F5D5D7A43CAB5FC1B6BCB27A | |
2908 | FF820CB8FFAFE4425A11A3D1484B296CBD7BFD68596DAD18BFF8631B872C89E4 | |
2909 | E82BC21D71961677146744ECDBFFDA389AC3C1B4CEF371D02C3069788997B959 | |
2910 | 7F56FC475657CEE7E1526829FC8EC8FEC33F5DD316A19F8F91E425A51606F987 | |
2911 | 99495DBB3AA2EA3116BDDF6464ECE47EC9792F7A2CC58ED980DA3583C9EAF207 | |
2912 | FBA9912578E18A9461A42A0A7E192F83429F653E1C54CBDA83EFCE597259BD10 | |
2913 | EC8C15406E64E3FD1E62734462F66A1A8AA59F03C7E8D671BB2F71EF7CC9A235 | |
2914 | D0ACEEC8EA98B35DB4025AAF6627811B437A8E52F10AEA99FFB30C4A780450F3 | |
2915 | D6352D7DFDD0DC031675813F476BA4522EE91BE71BC655F2C390B56D36652058 | |
2916 | A203457679CFC54F75B515ECC64955A9B6F0818D835E33E8E3EC65040FF4DF88 | |
2917 | DB5DCC5D848557D88188161686F4195F26035B5C7E0B172A20EFABC8CBDD2E4C | |
2918 | 11A03C4FC4D73D7D5008D67F4118F3364D1144AC4042812FF53AE2421C9794C5 | |
2919 | 4A8C2E21B1D674C1B842AE430854AA1EF951521BC95DB6A7811A6385AC19A61A | |
2920 | 86DFDEEBA2C8F9ABB91F6699F97A1DB7F943B49991650301C3FFBD7670E013F2 | |
2921 | 54094C629A6819655A4C00B2A35E62D68DFDE02F682FA0341B1CA83C3CE9AC1A | |
2922 | C10D170B957C239F911CE1126A92F84E7C79F37F9EAB542457D8CF1C90674ECC | |
2923 | 4F1CEAA8897E73746B4845C1AD7E7ABBEBD755AD1CEB3BF2E39B2C87A2CF45D5 | |
2924 | 167D24FD7656A9AE53C0EB5B5F5493B9CB809DAF833CC6EF29F47AF82EF1759B | |
2925 | 36D0C527CB5B6BA3C80DF3D409A8BBAA6E837A14D959888467C7163C6296D920 | |
2926 | 40629C57255C4C2F93380C1C4D894E9960D980FB07D85AF29956FB705195963E | |
2927 | 8C3B456CBE21B099EE0415EEA67C7F437CE777F1C94579890DE6639E39CADD67 | |
2928 | 06D76B937312612E41B38016F3F4CE03D1E73064DDC7C6C9E970892A55DB007D | |
2929 | 30BC2C5CDA0580E2DF13A4EE79A298B5BE53F30100CFAFC23E578B8ADDBE3515 | |
2930 | 485728E382359D114C1015DE055A6BA02462C8224D8D0DED58A54E06153E42A2 | |
2931 | EF0977CE9129C70776A6908A6E8B7E58A4358778DBAFD944277A92D12E6E27FA | |
2932 | E6DAC6958F8507475AA3DA3883C5A6F3FA83324E37079E6B44A52313B3991940 | |
2933 | 7CCD7FAFB690B86AA40A237347955E567F2370FB63CADB84FF1B9AC99FDC2355 | |
2934 | 30A3B2C74B3F28F8F28FF30B9EC8112800AAD2419A982C3FD4480C45D91A3095 | |
2935 | B55FAB80ABCEFA4E1DEE7F7934D3D987BB9F2C842E8B54BF8C53615EAB170102 | |
2936 | 4102F969A27A85B2D9059DD56B737E7A5FD13318C174ABBD72A4001093FE66C6 | |
2937 | 4654BCD1C94C3EB35D3FE7ECE712DC781C2269530E395DA15402516F8689777B | |
2938 | D80A5607EB8F1710896230C61F227B96B30D90F34F95F945578C6F57EBAB5754 | |
2939 | AF5B56938118D79E98C816C901CB7E489689E5C3D6DFE80234237EA96BF17F19 | |
2940 | E3595E614C3675EE55262BF288064A9599E7AB5E22718A5B3EC97BB7ADFC352C | |
2941 | E3028FE22E3FCABB7717D4643AE4E291FDD07DB0015EAD90938D970ADF56660B | |
2942 | 07B35F3D5CA96200DD491826249E7244C30FEED75325D0DEA44D42584E3979FA | |
2943 | BBCBA15A68B2BDB658D748D5A54FFC69E2F4777E2BC8FFD9B8222EE4AD0C7634 | |
2944 | E1E514FDE2A91445EF7A57F1DD74B041002A5679A0900617D776B704B82AF17D | |
2945 | 4A4F1F9D8C655EB6E7DF245AD4A21CA0709D78CC50D3BD8605BBA89B8326C87D | |
2946 | 08CEFFFAE3F4747E65D6166C2B77A8FF6CFF312D4997538390FF97E1F1324CB2 | |
2947 | D62575DDF37DAC2A5941B252AC6C53A1E4AFF31A478BDF1FA36E55DB8AF6EBBB | |
2948 | 4CDEE70E5CB4DD2A91E9B85F5E9A1FB125E91ACC965A0A1981646396D63B510C | |
2949 | AB27EC3730CE29CB8B44A07696C026EF713B16A1976F981E9431D115B2FB9049 | |
2950 | C71DE7DBF37C93D92938518614C2F4E9027A5825812A8F8D89B44324A7072992 | |
2951 | 9B2B3F9C5CACBA7E93C207BD6598349EBFD88ECE219BA69805109FF4A4F180DA | |
2952 | 725B221623F04D88C18540334A0F94160878089735A78DF3A9841157EC183725 | |
2953 | 5ECCF645CC2CE98A372AE54EF603EBD99F7F8B4AD7885D2A139E0D777A098696 | |
2954 | 58BBBFD322CC5C4BBB41A76B4939BEAD8E0FF9FF056FFE301D5CA626D5057988 | |
2955 | EFBD86845BF377C99A5B8C4F305448AE05E657DCC59C69AB96E73BDD82DDCD20 | |
2956 | 75D6BF26FB34A4E304D164ED532FBB642D418F4031D77140EEC9D2EEA628E67F | |
2957 | 2A41A546105858D93779E8EAEAFC3C5E30B564993A65A6681A7B8F08F9A81F95 | |
2958 | 3F1BEF143AEF54D16B69763E8699343C2DBA3B7B18F24516CC27DF4E6CFBFC51 | |
2959 | 3D0ABFEA8661D21A8C6901AE8FAAE1C69DE48F797A4EF9E74E5D3AB4DDAB9A13 | |
2960 | 6DA9597CAFDA19735E373C0CCB9AC00CBA8612ECE2FADB52402B5551C918ED17 | |
2961 | D6EE1A3271CC1BA38820A8B2277FC9082742F001FD3EB7580C12E4896F0E1FFB | |
2962 | 2662B7838342B9C59D6871CDF40DDF37C5CF9E9DABB50EDFBA071108A505DF75 | |
2963 | B7F80350BF7FC5952AADED7CDBE037763C946C41229697B99F8410EEF31561B6 | |
2964 | AAFA8ADFA46C1A323AF857116054C3C610A7C68DD9207CA1EEC49C65D61B45A3 | |
2965 | BFF5A1D9D8E550D21014C230E6FE8CCB8827D4C1E9275C24EA409B9DA6982A45 | |
2966 | 87479ACBFF83EAB2407525CC9F7171F444350724F42BD668110559BE4A0FE069 | |
2967 | 11CF8BE111D312377F9E7A299278F2BEF5D756E0716C47DB80230FAA44E80D19 | |
2968 | E33FCA90BAF261127367BFA5FCB439EF490B0BADDD6FEF9B7C662CFA4568C524 | |
2969 | 04FED1E8E476C8F4D453B5CA08CB4C93F5C845E2D55D10C4AAE4F5341C57911C | |
2970 | 2B3AC4E44F8236F55938C35BF2209D0B0620D59E0D0959EEAE2336DCAF39E75B | |
2971 | 6D908FD1CD7AFE1351DD3608B00D30CC5C349ED51EC5844028A2E997FFDE6DD4 | |
2972 | 140CB0BCFA6EF678E063B8E43F2FF63D0E5C0A2B6B102EBAD19F1E7465791063 | |
2973 | 0A87230C289B36BA2AB6C45BFC4ECADF46D2D2A9AD636A3E1C441757B5435EAD | |
2974 | 0039B4BDD2FE49C8B274A9BC20C8C9279F66640B4CFC79B594262D8484C4DC15 | |
2975 | 10B9C4CB8EDD33E4E4B2CA82E1EFE51F8F6474769204F442977DBF7FA93662B5 | |
2976 | 7FB88B0FE3D01B0418C30E8CDB3A345586A77889F32C7D3B32D6CFD99D33FFBC | |
2977 | 87A496B3ADCCB0CFFBD6F0F8503BB431AC53CFBC9CD74CA839534B0904146B6F | |
2978 | DA37C37E38BFD3018754C12F23CCAD2E8B9D785D0D991B6CCE7573D1A3CD11DE | |
2979 | 5C13279763F7C01CFC080ACC80DCD121BDDE7D753F9E7EA5B081A880A3ABF6D0 | |
2980 | 2A9E99436DF4E0D1BF51DB50836885D2BDF679547C03D32CC24EC7AE525AFA60 | |
2981 | 2F01519855F2710166ABB6524780517CBE6CA03613BCEC4F815A3F26A325A919 | |
2982 | E88298FAB2029FE4809801B9F34BA5DE4913FC8AD53C2C69DB0823D341EDF7A8 | |
2983 | 0BDD5820C5320F83136F120C62E533616962B0AC1113F7C5FEA153E53DF8DD93 | |
2984 | 6B1275A9EB69A1AAF094FB239EB39B0FCA7DEB28FDEA4F28DEEB8D036DCED361 | |
2985 | A73FF212ACF355846A1ADECEBCC3130259B23D01F51EAF1D98B7C5EF0E72000C | |
2986 | 0885CCB2229D7196EE55648E64212CB18BEF3292F638BDD0B05EF3787CC8A6E6 | |
2987 | B34FDDBF722CA2A4892DB03C1FEA5AFBC2BF9DE80533FCB41291E2B6B160827A | |
2988 | 326D5A32CF971BAC82760AD86C8AC025DC943E5BD2B02B012996A58A2D7371FB | |
2989 | AA61478DF11B081A869AB6EB67694FDF49A60613ABD7C12AC62F19D3B7CB7F94 | |
2990 | 9D8C61817B29DC2AE96F6A8715BAECAD56FFFFCF5D03905FDAFF3F8B9B319CB3 | |
2991 | 25252AB3EBEB0C85C6817243E775859099B8B9CDA71851E35525DE464F6BC259 | |
2992 | 459F6B4DDBDEBC31A1EEE64AFDA5B0D90B8E55872EE65CC571A513FD0CAE86FC | |
2993 | 5D690AD99B291F6D4FFFEDB3BAF7214F50CE37511566D7CA2766AA5704382270 | |
2994 | A41379495A953F247BF4C7A4DBBA37691ED9C7E2BF2462802C3522DD6364E59C | |
2995 | 90327ED2D7C89322361465B73A022FE3D27F35746F6E88C9B8A4F0311EE686D2 | |
2996 | F31D307C5F5A8F1E4723CCD8FC47E39D9FB4CD4BDC300084E2348D00E71A516D | |
2997 | 1C65DE9428E18A31BD9F71D99552BE2C55747D7A6E499B985101FD19CF584ED1 | |
2998 | B30DDB63008915336EC5375503C6B126575A1251B503473E4A0D4CDF23014DC7 | |
2999 | BD807BD934C74EF0CADA54A1E1D0705F3C1D8AFAAD5F4CFEF35DABD67B80BDD7 | |
3000 | 5DF273B7B6BC19E131B1BB05DB694D121199416E9DBCA7A7DEB13E64FEC3BE53 | |
3001 | 491DA79BFE22B4D76200C73935A4D588E0F48F1C991759E2451D04E2C30942D2 | |
3002 | B710FAA2C7E16471ED375D1369F606C591096086AA37E9BAD2B4DE2344199EAB | |
3003 | 1A9435041E4BEB8CE0FC53E78864E55EEE1A6E6CCE4E92B1C67D13D6D0FB1F93 | |
3004 | F628153EB9857ECEBF77415AE693593C57F3D4E76C56CA055799E6495E406A51 | |
3005 | 073AA03085E104709B4DF3066ABCB45E7C3784480596E2853A512A772C576DE7 | |
3006 | 1DB7056028D6874DA38CB6B4D00688D168D80F5E89D572921BEDCCE7FA4FC142 | |
3007 | 1226F1F900872E91EAC1DC4427DF7F99C50BCF92B81638B2023927F92FC3A715 | |
3008 | A409298085299BC4BFD6EA8A97EE7F1E67DF740C08DE389FBD4AC1817C14F0F2 | |
3009 | 919E73D99B5CF6209764D239955795B8B5F0761C092483FF96FD61E6530372D9 | |
3010 | 222A0405937493CFE22D52B4526A45AFF7C3AB57153F802542E4AEE9E68A6FBE | |
3011 | 5149B20449EE4F4AA47FBC0CCA17A489B48CEFB85094854B5F4EEEF84C7E5E60 | |
3012 | D92CF9C46D5095B8AC73C8D97C8B0507B3573756379A457CDE744B7385EFCC21 | |
3013 | 68CFAE2165378F8EC2516E71DD89A62B0075937BA1B4F84A0F010DF2E5E964A2 | |
3014 | 6903EA13D2D17B7B35D19150AD66F8623DCB96D043C0277C80989E59CAF6ECFA | |
3015 | D8BBF338EFAC34668D15B301110F7406ED65DB43B41DD438083F54897AB7B98F | |
3016 | 838D2279C49A48C6301E9C8B616D1426BABF1DD99598B233AD30A13B5BEB8DE4 | |
3017 | EF136163FCC5C3BBAE35FAB402C3036C54F46EC8F5266C02A96D885660EB7FFC | |
3018 | E6A85A28F59F4473E1A3FB6B81664ECC7A35A73AC79D5089D5074C2D3A66026A | |
3019 | 307D9C73187D29CB652C4800C6413B4EA752A275ADCB432021620C4DFA082707 | |
3020 | 352ADC437DF089DCB79C7AEB371D864DC0D16287A71CDA2A958E56D37B080002 | |
3021 | B532E5DCF010D3B1A26B855FD25359A10F84AD3644E5D600DBB78630FE4E39B6 | |
3022 | 4868130A1FFD534B9A4D2BDED8B0795463DF705EEF22171BA3DC6DDD0B07153D | |
3023 | 2AAD6271E9EF6D80690E3CC1D958BC8BD09769805E7DCEDD1CC0A16CB4D824C7 | |
3024 | 5D1EF88F46A08E53D67BC1D27204A185705972E9D9D23462A72CF60D2EBDC5CB | |
3025 | 33BB54AB90AD5ED13C4138E2E89AE8CB5BC9528D90780C1E235305DE7713ABB7 | |
3026 | A3EE834577C8A81F05BFCB0D4DC15FEE6F353E891E7C1BD7E605F40ECA4DDE1D | |
3027 | A9DF8403483DD999FC11B68652830AC0BB8BF1346D056D52548D9F8180E01949 | |
3028 | 3C4C5848CD5E5BEF564114D5429BACFD8035B80E19AD07D1460850618F18820F | |
3029 | CEE2992EC77BC22EDCC6B5B78C8F37E3E722CB691F66F1E71F004B6CB3F8558E | |
3030 | EE5E17E13A12FE5D59DAD2752A626A29B4AE021F9B6DB4B184EE9CA3F2BF7DA4 | |
3031 | 0887D528AE93D547C4E7D8B1A3617F5A5DD8E067B29E88BCC5B646BE478835AD | |
3032 | E40538658779B671AF3A2E2BBEED302F6D5F42CDB3E0669406B48E1D46C1BB79 | |
3033 | 502981331DEF8E4B51AFEE0FF9491FF082375562F5292104691887219C209484 | |
3034 | 7CB6DC824CF415CA3C9D96EDB34A01904F6880AA12BCF1E1F56DE7A10DD12D69 | |
3035 | 83FA9D950A425175F69324D1352AC3CCB76B09BDFB2950E4462CC99820C53B1A | |
3036 | CA33985BD0999C02DE84D9A348D25F9E361E57BA4CECDE862F7448DBA8213700 | |
3037 | F2C44015C4FE822F6CDFADB0B82D04F47AD18467195B3CDCB0959D60C00CEACF | |
3038 | 8A1D1950EDD1767B818A3F57B0FA17C0101A2DBC0500929A29FC28C50800F47A | |
3039 | 38043CCDB3F949C0D0C082929692858D08CFFD6E20652465A3CDE5E24D50DF4E | |
3040 | C7212B2E9AEE131B0EDD0F2E09457867F196EC7BACFB68EC476FB91AFC3CB309 | |
3041 | FA19C4E79430F9C343FB4DF5F8E6BDCD8DB0A2BE0A753E2265FFCC3B08D345FE | |
3042 | 6AA038EF222E300A4707CA6F8F21DF2A9913E44C675712D5FBD6581A7718B67B | |
3043 | A83C19EB4044E9E131C764C7B364BC095EDE2D9DCA582C7C710D7AFD70B845A6 | |
3044 | E5A8605D5D86CC06E8023188501B08CB9AAED731F6EECB38A3A1D7586E26AD39 | |
3045 | 283120121054740C3F25FE464DC2D5D00D4ABBBE26CDAC7B510588810D20E2C4 | |
3046 | 8F0F3DA2919532DFDBFEE036D750ED0289FF00D7E6C0AA09F052C4874309EADA | |
3047 | EDCCA510BC3EFDD894EE7BC7E9F3539C6CCCAA3EA1D3DD6F305427B561C7552B | |
3048 | A02C193E21D95E0B928CA4861278156D2B03DD5F61BFDA4C57F3F9FE2CF39304 | |
3049 | 2BEB3ADCB2A0B07210FA8D4477DC4508D446D9B2056B87702A517D083E2686C3 | |
3050 | 279406D4E723558E527A9BAB3201E3A6408DE34A608C004C34EFC6136EE01E7A | |
3051 | 7C52C5B48ED86BDC246979CC28A7D442C04530C9174EA9C125F0EF822C4D4A05 | |
3052 | A571C01B056D55AD5797D426D0813D8803E9E46630978B7712996C7F7E96CBE2 | |
3053 | A160E6F628CC27607B1BB5C5A76D61D0D0F8E93869B4479D63FE65CBC9F32F82 | |
3054 | E01C7DA4DFFA643305DF43544CEF4339F2248DEB0E1DD00728BAB0AE5251D05B | |
3055 | 3B856A5E333A462E91480F9ED5E6431F56043779BD85A94C0FBC674CEAE4BDAC | |
3056 | 006ADA1B24A3DA3FFFEE2DB573C43B3908707EA1F0F7DEF59E06C397F18FC328 | |
3057 | 799423BC3508FAA5AABDC230039CDE2995B5B850228BD5EC32F5C5248F921C95 | |
3058 | 0104E1FC2D1E59CE35F55884B6B60518AEC8FD81DA3878363C28C9FAF96019FB | |
3059 | 2822AE4DD80318F8701DD49CD5CCB07A8740E8496251D1D6D30496F2C568EAC4 | |
3060 | 0AC3DB6CA871F289B824E82D42A8E95AF072A304D9896F570395F5A21DBE11C8 | |
3061 | F483783912992D5336734B95FDE53DA67AE91CB9D9AF29BB8A52CD54A39D2070 | |
3062 | B996AB101C8EBFE4A04D66F407F1A5A8D0330E3954114E41D71BC8D2FE85D805 | |
3063 | D12A4AD9700F64A0A42E308E0F41E943ED427830E6D1ECE5A2A4F4027FCA6BF7 | |
3064 | F2979E60AFF9F4E6F1CFFA81451D2B508431505096D29C1002F10CD0A2434691 | |
3065 | D643F9C54926F866DE4EA2932E9345272734001A60330B2313D73643589309C9 | |
3066 | FAFA0643A869033E1B79E532C439E6FECA577EFFC89A78CDB672ED7EDCA17101 | |
3067 | 7EDC42CF01F2B0D483690566A2836A0B96A1E9F25732284D53DCC9E54136D164 | |
3068 | 6EB7F0A246319431B33C510118B5E93BF96AA2EA91F8EA047254F9E67CE8F7DA | |
3069 | 7C5088149954EA430DE2BB41F40000C36913C521E6B9861D645981292CBF2558 | |
3070 | D14335C07BD02725418EFCE21927D10148F5ADA862A21938185F1DEE52D550ED | |
3071 | 120DE6644FB7E51C5AC063E3848E43117B522D95AD7BDEA29729A9E85709CFAD | |
3072 | 05A2A69CFA1544447D4B3F4A859C0FF96DC0DEFE78044A0FC85EE91D371D3204 | |
3073 | 7937A2B9CAFC97219848E1A102A18682DCEF3D6FBA50C83D3D1F5CA6A06F1D05 | |
3074 | D965DD0BF0942C261D738A72D94D4ABE288E5AD81451B62456C01F1B568448A7 | |
3075 | 533E20C38646A7B53119DF45A2E82AC51A5DDDE588DF23CDFFCD1E7DF01E6C80 | |
3076 | 0E1DBD537D48269346A9FABEFB387845ABE11F5B951A3C9539DE4778946185F8 | |
3077 | 86F3978D2A0FAB1CB1172BE2DE1CC2908872B03FEA2E71B6D0CCB8462E4FE5BE | |
3078 | 2954CEFEB2A7522CBCF7973B9BB5416CD051B289984D0CD60C8A8BC59F245349 | |
3079 | 8365315EE000B8A7F1460B15130648E7BDEEB73C983A1F9000E8735589CBA965 | |
3080 | 1B3B3216DC4594A6C99156DC64CBBC906E9D9B8A46802CF9589546A00717F4FE | |
3081 | 4DAEF735A0F6266FE8200B4B862FECE518B5A300BD9FFD01FD71272E3736B78D | |
3082 | 91842B53C27AFC216C014AD8F211D924E9D41427EEC27E24B5C7B947BFAA66C4 | |
3083 | 1CD785D1012ED2A787A3612CA3111694728D85756D003E2C18B69B58901785A6 | |
3084 | FECCC6DD966336AFD8D6F2A524E46567AA13A00F27C2CC69208500C8BFE21716 | |
3085 | 27188E8D93F36DF766A29811120BA00E413269E47F057C5EDF7B750785409CF2 | |
3086 | 9F4ED976F82CA0411DD44F11B849626D12D320DA6F95B68504FEE499B64C0A4D | |
3087 | 14076179B9EA36B7EDCA5BD6442974C7B197F78B859E4F9F09095869AF7B44F0 | |
3088 | DF16566A0DF4142A2714C5F02B5A431D5B2ADAD0E0A5CCB7F425A19B15AB0CCB | |
3089 | 8A93C64739655E59E16A1D97B3E5B6056428048B4B01DC0C8CCAC8BFACFCF045 | |
3090 | 140241AEDBEC878FAF85D7DDC3C99642A0F330B484E00927129B6AA97121639C | |
3091 | 6190F0EBD3BA37CEE372DD77A9F1FCBA93F45FA21E9AD8ACD837C780946AC54D | |
3092 | A68E986BCEB6BD70E4DA8CA42F90994C3DECE3B35875C37C806B0CADF2C76EAD | |
3093 | F594DFA26AB52008852E67C0BEE6AE5DA64859234BA355355DFC78065A83CB86 | |
3094 | 194698E1CF8E13882A60A0D4B0D08D20BD80E310032843E5B441EF80BC4FEE11 | |
3095 | 0ECC4B99F51116B65ED83F928881B0D1E0530FFAF622E99AA45D974FA7874CF4 | |
3096 | AF5FA16311486F0EE103BE0D70D28A76A9E4E1930F12CB9B0E43171EFFAFC4F5 | |
3097 | 140F958EE7459E49456D3ABA60DC34AD716461A1468D9DD58D10DD5E5F915A9F | |
3098 | 90E4F73CEADDC166B3645B0039B2CF24E8DFCA2D4A9261C7B13406E12BED3959 | |
3099 | 6AE277F9FA06D8C70E1EFA74906D15845B3FE13EAD56F26E7EA97E2041E5D05E | |
3100 | 283215EB8E5BAFAB596D43DCE4E7C9BA1BB5A4708CCFD769194390F104B1F209 | |
3101 | A1916A440E9500A4089566F29BEE23F9F93C0F3259A4B66141822394EAC11858 | |
3102 | A735368ADCABCB4896111445E253C49E3682641EE3470EBBA8FC08C55B8D540B | |
3103 | 7D8A9FCC205FE1ABD98934CD76E0F2E3C041EA680BA7869547A1F337B3AF2E7D | |
3104 | 1F293A6604B53760053B88DCAE2EE141946CEAE5D3B38554FBF17A6DA9B3FA0D | |
3105 | CC9AF77867AFB98FBDDDEC71DA2B392C9685D98AE10162A0C5F74EB774CF8485 | |
3106 | DE1ECA689996FDA1F4BEBC93914BBA88C68CA9BC146A8FE198B73C77F2393B8C | |
3107 | 4B0718CC95051FAF56755A2EEB1D361151C1B861C8B5259713A8BE80159AAD1A | |
3108 | 80D342F1D9B1378C15DE0E3CECAB0003B8F35454BD40FD3BC629CD89AE4C3F47 | |
3109 | F03F084775A6908AC1E086F17B2803FF5CA178A43F21D0848CCBA17011CB1F23 | |
3110 | 3969BE5517762825775A8092E3ACBE1DBE58804F67F689EF82D9351E2A2E70AE | |
3111 | 2E5B14041857F69C59CCB86C7A8C72DC54EF4485D6CB6D69B959D652BB5B7C32 | |
3112 | 96F25817B29055302404CBDBB20C054B733C78D01A181D85F074FF168F837491 | |
3113 | C30F9857F4978A316771B26874946249144E9B897E097C7D54301F00E49FE807 | |
3114 | DE4AE0D39F5CF337DB4CF6A0B486D430864B8559CCEF874B2275D8C507C37F5B | |
3115 | 213BBEDA0A601D422537CAB32015D5B53188E27B30259B9CA3BBBE4D77EE56BF | |
3116 | 7AA6C092C5ACF3D3EE5564BD91E07D49C8B7C6E5A91B5E7AFD2CA6169CA23C55 | |
3117 | 8FD406A70A7DADB1E8AF288AAB6C82790E797068552C8943D90EB9D40F5348CF | |
3118 | 29A6BF5C19487311B3C7AD762C7A834EBB3E40A0CABC55DA1BB28E1B6E22C9CB | |
3119 | F8D2F1BBC00AA263894111A5C617D38A053903CBED807628BE9299848D5ADFB0 | |
3120 | 630010AC64B48E362C9D69CD26BBD2FA5A9D6179C365195DA1815C9C8EA4E8AE | |
3121 | 72FFD695DB419F1CEA4FBC04086F686F71A19B51AB9782C05C8572DE63B06B86 | |
3122 | 0CB8697C2050D629CDB2BBD50F53462EEA873D9BBD8453FEB75E791433E59446 | |
3123 | 1685A92DA218EB49A2EFC7B7E44285FB960B52D13529FFB245224CAEAD531915 | |
3124 | 74B583979FDEFBF9166F4D2B570F14E752244A892BB0EA06597A0A737728683C | |
3125 | 821EB7E4755AD7A59DB6983B8F721F7B1FE79316B3EB18ECCEE73D4883E69FE1 | |
3126 | 48A58C9C2CFFE6545AA0186C1F75DD99AB87147B5FB7DED13A9E856585B1C221 | |
3127 | CDEB59AE15C737105FED64CF32F360C7685947703D5C727FB71AB789B4DC39B8 | |
3128 | F48DDD537D200589010DC21172878332B92096B9B9008028D52DC32D533D4570 | |
3129 | 0BC551851ACAA9DEA8EE1FBD1281D2597C48386EF526D4AA194F6399C50E52A2 | |
3130 | 447C82F5E9A963B8002126382ADE1D89143D7A210B8161D55180DC7257345554 | |
3131 | C951A4DDD81A586F2529EC7A34BC12434DD673B9BD775ECE74389BDF79CE3D50 | |
3132 | 54FB70012B5C961497D01A8584E18AC73BAB2E3E958E765B5C0270D9DC6D80C7 | |
3133 | 1E879E993825200221A13A818565248E0A6C7C192419E77DED057B081EBE725A | |
3134 | A696E39B2B87B75A7DC6B5F0E83F343AB190F45782054A7F2EE822AC2704A641 | |
3135 | 563EE2A5E8E04D13BA7FAD2EB13CF5361EAAA6973051FAA8A5DE4BFE9116EBE2 | |
3136 | 3BBD30D0A39872E8A1D34A9AE37273D91E4453C098815A6178376C5CADEEAAC3 | |
3137 | 7A492DF7823FA2198871ABD0E2FF87F55E475D51899E915EBD0A2451815154F1 | |
3138 | 4A6C024D214F67762BD9DD483FA26B6BC81ADF3AF215939019313B8547D3A8E8 | |
3139 | 69BEAA3B27D317A2446AB607CE40E067273E8456EA4B07FB2BB07FDAD36B463D | |
3140 | F9398066AC18D59835B8585622414331EBC3925F6CF4421614D9ABD92E5FD3B9 | |
3141 | ACEEE36DFBA857EC8902D109B78BD6832EA9B3AFE43229EECBA30AEE9A9EED9A | |
3142 | 46F4898797A8DAE70923FBEE4F9D936B4AB30515CEA4346AE6F351F7C48897C9 | |
3143 | 2234FC06DD4C9F57585B7355B817006ADC0482D5FEC8DD665192FEE0C3B7B126 | |
3144 | F08C6FD3881ADF43EC2642B202D59A9A98FF082753EBF391C690CCD5A0409F27 | |
3145 | 10DEE1EBA0635A057011325266A9AB924E33F17538234E2BA96D98DBF049871C | |
3146 | EE77458D506F6A354767EEA33D2412B16F0A3412D53FBB3AB420C1E6460AD70E | |
3147 | 6B85912FA9A4FC1A729119EC9609D038E8948E8846F118C9A12C8A03CD691680 | |
3148 | 49D5C12C9AA4AA35E48E658C8B3262F4C56849DD84CF8744FB5734A39375533E | |
3149 | 390BE9CB7CDE8E04A212EAB8E58F9FCFE2C2D547F1B7964016971AC30BA2B8BC | |
3150 | 89E8898809DBEEC910F912D1EF195819931647021AD7DCD57B17D8850FAB41D7 | |
3151 | 9E8F1142B4D067EE0B8C0D7C90476CE63076C832DC2972CDB3B9C22DE6AF8C59 | |
3152 | 306FF6DD83A005AE5236B1BD42CD0E32FC44B156C47B0713B94D0E8D8D04C7D1 | |
3153 | C4E6CB68EFE67526B017A81A399C4A0A87F6CA0139D0BC414671B90B29C51601 | |
3154 | 8CF69066AECB360D7A1513D56E5A673559EDF06B66E17256C0E5CD09F2386E7D | |
3155 | 937619EB018A4070F222959D217F89746478AB1568F60900367FC0BA3EA68919 | |
3156 | 956D6990CB0114119F5015FFB3E788BFA9791AC03A2A954F8B026128BD2250EE | |
3157 | 7E47CE5236EB13B7F144927251B207B502AB7C0B7AD2530997F4B6CD0D10765E | |
3158 | 046CDA527F32B123BD3FF3B57FB5DD25D5FECB7D4030EDAA610B2975E7D1D539 | |
3159 | 908E0A44A3CC6C5A35F5DC94A78158B1640C2BBB2590D2971728303E59FA956B | |
3160 | 7028C5025DD0666A66DCFA45959743504598092EAF64F346CAD55B0BEF469C42 | |
3161 | 98340240AEF816317A05F5822FC52376CDDA0FD6A5D3ECDDDCF04AAB183BFDAC | |
3162 | 36774666B0E5E44B4EEDAB9B29B3CDB31A4FCE80F650018E17814E29BF6B5F08 | |
3163 | 9332233436138D385E622EE570AEA29E4ADF8720CA0496DD517AF5F42E8C8A9B | |
3164 | E2663BA6BED875914553E7830D1C176CB77224ACAF50CB81AB31B775B49358CD | |
3165 | 958A3A65618E26A660AFC91E79F3D670A6E3EBC0423A6B4C140F9A6247401C8E | |
3166 | 0F80E40B57 | |
37c41ab1 CR |
3167 | 0000000000000000000000000000000000000000000000000000000000000000 |
3168 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3169 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3170 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3171 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3172 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3173 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3174 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3175 | cleartomark | |
45c0f7f8 | 3176 | {restore}if |
37c41ab1 | 3177 | %%EndFont |
c302751c | 3178 | %%BeginFont: CMCSC10 |
45c0f7f8 CR |
3179 | %!PS-AdobeFont-1.0: CMCSC10 003.002 |
3180 | %%Title: CMCSC10 | |
3181 | %Version: 003.002 | |
3182 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
3183 | %%Creator: David M. Jones | |
3184 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
3185 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMCSC10. | |
3186 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
3187 | % This license is in the accompanying file OFL.txt, and is also | |
3188 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
3189 | %%EndComments | |
3190 | FontDirectory/CMCSC10 known{/CMCSC10 findfont dup/UniqueID known{dup | |
3191 | /UniqueID get 5087402 eq exch/FontType get 1 eq and}{pop false}ifelse | |
3192 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 3193 | 11 dict begin |
45c0f7f8 CR |
3194 | /FontType 1 def |
3195 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
3196 | /FontName /CMCSC10 def | |
3197 | /FontBBox {14 -250 1077 750 }readonly def | |
3198 | /UniqueID 5087402 def | |
3199 | /PaintType 0 def | |
3200 | /FontInfo 10 dict dup begin | |
3201 | /version (003.002) readonly def | |
3202 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMCSC10.) readonly def | |
c302751c CR |
3203 | /FullName (CMCSC10) readonly def |
3204 | /FamilyName (Computer Modern) readonly def | |
3205 | /Weight (Medium) readonly def | |
3206 | /ItalicAngle 0 def | |
3207 | /isFixedPitch false def | |
45c0f7f8 CR |
3208 | /UnderlinePosition -100 def |
3209 | /UnderlineThickness 50 def | |
3210 | /ascent 750 def | |
c302751c | 3211 | end readonly def |
c302751c CR |
3212 | /Encoding 256 array |
3213 | 0 1 255 {1 index exch /.notdef put} for | |
3214 | dup 45 /hyphen put | |
3215 | dup 47 /slash put | |
3216 | dup 50 /two put | |
3217 | dup 97 /a put | |
3218 | dup 98 /b put | |
3219 | dup 99 /c put | |
3220 | dup 100 /d put | |
3221 | dup 101 /e put | |
3222 | dup 102 /f put | |
3223 | dup 103 /g put | |
3224 | dup 105 /i put | |
3225 | dup 108 /l put | |
3226 | dup 109 /m put | |
3227 | dup 110 /n put | |
3228 | dup 111 /o put | |
3229 | dup 112 /p put | |
3230 | dup 114 /r put | |
3231 | dup 115 /s put | |
3232 | dup 117 /u put | |
3233 | dup 120 /x put | |
3234 | readonly def | |
c302751c CR |
3235 | currentdict end |
3236 | currentfile eexec | |
45c0f7f8 CR |
3237 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
3238 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
3239 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
3240 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
3241 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
3242 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
3243 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BB89566A9BDEC70EB4F2 | |
3244 | 048A6EB631F05C014D372103E37FC3FA317EBC9973565A638403DA02E48B7D31 | |
3245 | CFF6C241DC5CDB470561002FF46437C06EF93BC99352DF04393C661FFFBF4BA2 | |
3246 | 0723ABD9B3E9CA9E63BA57EFDBAE684655CBBDBA15ADAE43E1A2C98A3CF060A3 | |
3247 | D16AF8FE3A49B50A24C20EEED716E49AF6013D4D38CD9CC41A91C17E4D04D79D | |
3248 | 567E1EF49110AA9C34464E95D81A730ECEB2C9AF38FBA6B45E253288438B4CB3 | |
3249 | DC75B3A906D4357293BA41E59C35223A6C9CBD6FF5FC90C2D07CBB376C7320FF | |
3250 | 435A6251822BFCBB612CE630EDF826C37E95F541C21B93FCE127591D5E38165E | |
3251 | 2B58A34AAE37712BC58B63FFD70AB80F4F24612CFD2F1466BAAF3CA2BCB45148 | |
3252 | D0DEA0E9B8FBA4C4FF5B8B3CB02E461355051842BD1C94F41066B9B909DB83B1 | |
3253 | DCDCBEF7CD00A43E4C0B8191A29600CA197F0BA227FB8309BB539D2A620BAC70 | |
3254 | 8A1AB2DFA51ADC9873B8E5582DCD3ED154E5D727D1665F99BD89883D69E6CC2F | |
3255 | DB3A57AEB612171A88E22F038461DE03FC357F771675E34E90D4D19B4B36891C | |
3256 | 9D2333960400E97494F4FC4DBCE6A73C34A0409E433BBDC0AAAEBA7D3555066E | |
3257 | 1CFBB4515C8B573C9B9DD12ED5B6ECEBE35AD0DDEA9DB004FC6CB540B5117B49 | |
3258 | 59CABE5FD74C6F5B6482B42C20B5FF0467D1DBD7CED2CC651CA57852B6FBB402 | |
3259 | A6764DB342889132C911CAA713A7F2FDD8A5E849345D6C81025E02F5B8B682BA | |
3260 | 90CC9B467FBC37362436EA6BF8EB62D784B01D5430147945BC09D1F49EE89F2E | |
3261 | 3E2B8E6D439248A56F82F2E03EA5C7A922F2813BE6538A3A423BEBC55B345AFB | |
3262 | 3B3C125306749E137C647D78028AE1FBF3E1A82C260132832A9668F454D39C41 | |
3263 | 736717DED0A99F6B11F005F0E1D07FE84713AAB4C042FDC166AA146D7B5E9198 | |
3264 | E4F485BE5B135EA281FF1C1E616B5AAF02771F58C5840CB5A427FF9794F93E94 | |
3265 | 17FD799C78AED1DC4810BCEF4C6C51D3C1504EA2C6F2B29805B7ECF97B5F637D | |
3266 | FE92E168CB9029E90404CB54FB312FC7AA8A9F2F524C03E61F03B1E31D4F061E | |
3267 | 1677B39D5D30C9FD4673E1723F4AE3CCF38593AD6D7F61E9DF3C010E51F25085 | |
3268 | 35D51105E1464BA146A78D7297D4D310AD91342A0BB942034A3EC0696B467367 | |
3269 | 3E39D202D637E6B14D0EBCA6AD3CF22B07D4CA69C0FCBB6C93782B2F0DFC5AC1 | |
3270 | 5D8A16CB5EDB671A0C1BA9D10F63CEAFCD0E06E42C730C8EF769CCFD57937245 | |
3271 | 658F486036D37E8BDDE5670A212FB488A8753322A5B170C9662750AA958C0BBD | |
3272 | 8E97D8239D2A08B30416504DEEC4E506013E037C91785C674F8A6A44E23FEE6F | |
3273 | CCC00CC5E4D355B0871FDB8ECD64F70EE32449BB5D6F84F8C8AA2D5B1A489BA9 | |
3274 | D7FF2DBAA8D0B84054E93D64D3E77850A3724824914A0F821EEC3D605DD851A7 | |
3275 | 606936B8B9E24D6E932E16C448140FE94DD96C75AECB73850035ED9C04A1D93C | |
3276 | 64B21E7D4657E030483EC5C3554AEF8BE4D0FE5B9743B875340B09E01273DAE8 | |
3277 | F256C50A1A8F2E0417440A8BB0173F59E11523E1CEF2593A4AC5AF2167627B00 | |
3278 | C5EA97D125EB8A4BD4C372877ABF10F5B7B149D73787E0834BFB3084E9508DF7 | |
3279 | 072DD71637019599252059738D4D6BC57A9358E4B14F6AF9C4B31DB8E25C29B3 | |
3280 | 7A15F9953BD73ACDE5F0445A5DC406BB4635FAE51C1D8202AE31730E6F355317 | |
3281 | 1DC197DB0B6177307C60E5D38F4487363EE051B2E609A52BC4D45B14B6558B6B | |
3282 | 5E1618748794B8340752CDBE7756C068975B559615D4CD5A97CE30BAA7B2B1A3 | |
3283 | 2FEF2E055232B24FD8A21BECDE1B6A479A28EC80AE2CD16DB50B30B4A6CFCF06 | |
3284 | 491C7CD5AC29FB964D4846415233947522676DEABDA0D9535F8507D33693930C | |
3285 | B4E4240A02B0CE7EA288516B8A6EF908D7F8BAF9012D052C6AC96D9F8F6ADB07 | |
3286 | 8984F3559C5E7E3022A957982155FC9CD599C74E18328D3AB46F9DD15D1C4C3F | |
3287 | 9B93ADB4489BA02CFCF57DE6270F3AD2F8597BE71786510EF08142F430EE5568 | |
3288 | 4F9DDB792B7C46B6135E341DBBF062FBC50FABA80CD4A384157BAE57CBEA9781 | |
3289 | AA4416323265168AC097DE7E30A0D4750143A4FCE70A863A31876A8FA5327C3E | |
3290 | 36E89589E363AA2B1A6E8B09F5AEB8FFFD0396067173465B6503383DE517A6EA | |
3291 | 88C0FC08578398C2A721E5AEB29F4AC9BC990A50CD87BD35A11F9E81F68E7B85 | |
3292 | 5E5B95A4F9A5D30379EF90D78E1E466DEF867BAEFC4F5ED2C762BFF099C1C2B3 | |
3293 | 5E0DA1C2FB33BE1379413CDDB1EE6BB3A495331F72F2FAEB8152E8AD5FD334A8 | |
3294 | AAB0082A71D5574B618EA8D487B8FAF1B445F3395B1E21224F5492A0E06F5152 | |
3295 | 7726835C900E2E52BE3B7B654183AEDEC68053DD0AF19EF6DBC10B6FC08EC7D0 | |
3296 | CC0E2C8FAF8C9A4C21FB7C34E074BBA4EE64226BEC8C928A784C1BEE35B72EC8 | |
3297 | E9295240B29DDC2539CD118BAC38DB3917D14CD33AB45FE47E827F2A2B193AFF | |
3298 | 53C5396C52CEA4F43F06AC2D08C74CC85D608CBA267175EC31311EE25AB48DD9 | |
3299 | FE811B411AE426C9FC0B6044D1EBF130231623F1566CEA4D1C06D8032FD9808A | |
3300 | 94479C842BC41B675CF6B90113BD681F8D43F51D5016D80EDC11D7640FB950D4 | |
3301 | E709A46184406ED90D0892A4CD9062938A8205697A200DBE1F38EB166EFEA0EC | |
3302 | 4FCB45CDAF82EA103DD6FDD03D146F3E42EDA6496064DB3F4FC1C5280C9E604B | |
3303 | D5EBCA08BF2AAC90156C11EF68137DC76502EBF216F3AF3EE30DD2676D218428 | |
3304 | F41C655093F8B530FCA378B5769F262A6FDB4B66B83F18F050E77227E28D71F4 | |
3305 | 5F4425CB8D51B3DAE872CD86D7804F870BC564A6DA1CA13EDB00D131CE4F6460 | |
3306 | 7021661B99612629DCC20C85CF155EDC5111E015A77B0B82A8FC1EBB374B7EF2 | |
3307 | 361419BA93B857D5C9944BB5B4AEDD86ABCC261542077FE09701C96370168579 | |
3308 | 5F89D5AAA08D700E2643E88C2FB8D1D56D37AAA9744872E7C050B4CE046B47A7 | |
3309 | 83F224FA9FD311C955EFBF173042C8FC66524135F579B1397828870D5C9DC71F | |
3310 | 8615FADE2A1CFAEA90F732B6C266E2F3048FC43EDA7A6B6D98E9DB793CF457B3 | |
3311 | F5877E7A055C92B0246FEA8C72B3B3456F93BF36E2651D32CD614C3AECC0B4BC | |
3312 | F824C8363E593A6458D37408FC5B09883B280005DD24123E2D4B1B85F4113327 | |
3313 | EEDD9186A4AF2CD6439B46C5C168C125CA80F9EE9E68906620EE126CFBF26E15 | |
3314 | B269838A54224EDCFE2A373EB750D4829BFA410DE5F1541E428BB1E024AF496D | |
3315 | F5F1C151F5A645C8622F2EF9088D57A2811868A8A8BFCDBFCE3ACB8463AC35B4 | |
3316 | 8B6F44E1C1232805842F56FA468F81FF37D5D55B81CA56058558544C142EB3BE | |
3317 | 07CFB1F75DECB1E48C14D6AFDD455989AA6FFE8B8DC54F462B3C20E31D270BCE | |
3318 | 8E68E2B43A6625AC7E9792704FAAD6CE8BBE0B341DA7189EBB3E9D5375B27FD4 | |
3319 | 12506D5BCA50AEDC6955E6C3C7BAA84BACAF7ABDF3A270C7734EC3C6EC22793B | |
3320 | E67B0E288F99699D38DA8B79F2D21DD97945FBDDD132A8F0BF947950D3C0B4AA | |
3321 | EB7B2C435AFE54489E1930610311D718AC610C21A644F34CB2D1959B3066F39B | |
3322 | EADEAB5CFC6AF4D191D86B02402B00D1C5262707861C5308730579795EB53207 | |
3323 | A291A27A8B5C4DAE0A87A0C6A260026CA3CB620E1002E066A515D7990F3DEA29 | |
3324 | 0FAC962E0B82B7A6C86B1EDC54007822BAECED673FAAEF88C8109777EB79A53F | |
3325 | AF3C58546974F2F56E70E9B5CB59ACB5C27CB01895557B2D82134D7F02029B24 | |
3326 | 3331621F38E68717F5CB68A8892D0B9C0A8ED4F8BB56E80505170D44C6856128 | |
3327 | 2DED0254ADA4875CF56B4D97372AAE730D4C77A2940DC8C178274DF88A9EE037 | |
3328 | 215C6FE7B9D481EE4DE809B124C0270782411ACCCF89906A8B143D0BA8B2CEDE | |
3329 | E9B90465C3E57A4FD9AD2702323450256ABD09A1F8C26F08480317C08B75B720 | |
3330 | 70A161C99715A35A94DD5C9647ED0F8A5337B774C8E54F9653AC859485A1FED5 | |
3331 | 37B725A7E4BA58711CBCDA6054E34CBD8E9F9460179DA7DBD243D81A1531FDDE | |
3332 | BF2BD425BD9DBE75EAA333B1F5793669A215549A774597E6ADA16D323FE5601A | |
3333 | EDA41092730009A99BF5B5AAE281844A6BF3292D4D4EDE36B4FD8BCAEB6EB72F | |
3334 | AC5D3CD53D0D621CA9EA8D254FDCB2B5161EE9E80B266563F669805A3A15271A | |
3335 | 0753983004A1ECC7FBADF62AFEA4DAB49A178C231759857DB910668BDB07CB3F | |
3336 | 7E8EC24901863088B3231EE3FA563924032C91CA9D68DB398F9BD9AC0C651EC8 | |
3337 | 9051C9F709CD784F3FF5951DECD7E869ACC34B83AECDB011E6594347855EE7F5 | |
3338 | 28811F744A4BD70D4E9077EA7EC19FFCF612689F12B34332857AE41F13E6D16A | |
3339 | 962DB9B6AAAC167B9FBDF0068EA13412F318384134B29F3F0C399F1973A3564E | |
3340 | F9C3C39B5BDD4C98D81A6CB476E565860B50704BD65ABD630A5F1372F2D826F3 | |
3341 | 3AD47C08B8AD3176A170C369EF3CEEB190134006D6135C5B8CCDBE1C11FFF1EC | |
3342 | 3F6D8C46E15C4F5EB9ED9F31A129594D542D40DC3815CD075A0DBB648D868AF5 | |
3343 | 15A05C4BDB28BF23653A3AD96CF6AFC065DCCCB23D5D9A945F8CBB539DD3BFA8 | |
3344 | DB8F1FBF9B6F25B41EB4309995CA3D5D6ABD70CBB4A2F0C6364E5439AD1045FF | |
3345 | 72F6B45A30BD3A548CFAADDCC6C15D46F6D783D3E520215751DC98335A4ED512 | |
3346 | D7D19235CDF911CC69F3CF4365B678EBF3E87C456A4E77339C74930083445588 | |
3347 | 462529C22A96A28C5CE87AFA0C981F26CAED5A1C8DBCDDA612624DBE0373F026 | |
3348 | 465185A4D8C73CCD8D71EE97116F8F7D341B87FD78F9CCB9FBDA2A7799711607 | |
3349 | 6BBA855AE9D5C505870DC85FDFAAA130A351D56AADBFBD6A7D52055E3200F8B7 | |
3350 | 8AE9A00092B55DEA8BDE224B4BA7FD4A191CB1FFC4CB995FEE1AC2883AB69E1A | |
3351 | AFFC09AB5B9AE311A030A5BA05E2213F9BBF016C8FA80689C069314D91274B20 | |
3352 | 53FCC65C7D7B3A7504887525BFFA060304931672A078BCD7F269595686310E34 | |
3353 | E1ECA868899BC402D17EC36CE40D5041D7CEDA77F7764C9D98793F5334F574DF | |
3354 | E93CB10A5E8ADAE95CE63D2339557091B4B4911A4987CF21B7F1DBADBC2DD605 | |
3355 | 8EB72473C1F2EABCC44E0D0339EECB55DA74085606C3F89D57ACFBF5755A5395 | |
3356 | CA8D4BD47E4EE8D8B882D3AB31A1F0C62E74654C7E041E4FF2693A38A9796064 | |
3357 | 46526B0A37E6B5BF8E48E80EDEF81E34DA8F6CC9025936A4D0E6D709D61B7B5C | |
3358 | AB550397117F3F9D2F5A542A64DEA8E1178F7337124D6B56BA92F659AAD694D7 | |
3359 | 391028731E01284BFEA635314A8DA8DF7A34EA3B6B2F8803BE6DCB423A9E8015 | |
3360 | 55EBD90EBAE8A00298B3B6B1C02BA516AF528122C1F2B07EF69F5466C2C36643 | |
3361 | 0D665D6561705509B7582D8301AF3C32E2F3B9433E3E04D62117C7E8A368BDE1 | |
3362 | 0D4DAA1C415B2A6573116D2A169AFEF700A83F55D88813585E89C94C07802BA8 | |
3363 | 3AE8F9BC3CDBFD9C2E35D062B1FD6E79E1EF104FC70B0AB09D12CA027F33F85A | |
3364 | 22F0ECBB4AD55FE8C616B82C46CE69A600E4F767BD7A9C5F9B37A3196B038384 | |
3365 | 5DEF76A8884425FE598A63AEB19FA698C2AF7CAA4983CEC789268E22BA051EE0 | |
3366 | 20A40633D22D8F707626ED30E8273EAAD1C065F0B2E1718B5AC853ABE09330C3 | |
3367 | B0082A71D557169BC1559B6D285A3499D41C4CCF1F74884EC3917EB9C574371E | |
3368 | AFE8578DDCA459B8D22C0188A8D150437B05FB92022C95EB6FBCC954216B5FED | |
3369 | CBC7C90B9A1F061376A9840FB64390A6BA99CFC8279A86A730C6DBFD14C53C4B | |
3370 | 7277D676BD42203677E9ABEEC8C97E13DAA626474513B06F8734DD784F2FBBB9 | |
3371 | B3B448B8E8221E380AB4A86D3A683B86A54129519D50DD4FE63B30954D805CED | |
3372 | A9A5D9A39C58B65B08E1C19555E927C6DBF7FD07252B2B57F62B905D6B488201 | |
3373 | 213D106A41033B26FFBAC2E616DA6ADA6D560BADF10E68872806CFD6F6E19D7B | |
3374 | 57CF1F7A030A7BAD374F16A977E0ECB8742D034ADAF9C247DA19C8AEA74EF6CE | |
3375 | DAFD6B1DC562FD3B77E4D008BDE4D8C7FCA9895DA1AC9EAA01C32A0DA712B082 | |
3376 | 9438E77230D38FC4153E1711417B918BA6CC03203A5FF082AF880F48518D8271 | |
3377 | C1121E4F1386B30A7F1BC6F10EA98443F8A65C867A109336B808BC9A8E2A75AC | |
3378 | F950835AA84B56F59DA4C8A18859C3B68F6B6DE09A6675F639EA9107BDB67B0F | |
3379 | 54EBC564BC2D781B61C14363A54956BA78A2BB89C9F966C94EEFC29EE9F4E23E | |
3380 | C0BF750144DC289F0DEE1F8A25BB52E54F656FAFEE4BD2DA57E1306BBE648051 | |
3381 | 1D0CFD6A23A3DF082E3CF13197BF1B7FB22B2CD427BB78F455C9634DF989DC90 | |
3382 | 7BB2AE247B1C99AB2062855B2948341B0F857ACD750B59E370A6698C6A1F5287 | |
3383 | 72A4A9628A592E313956C242DF8277EDD2F1FDFB07CDC104275FFBF796D7518A | |
3384 | DF49FF3CDEC3BDFF1D290C382F244DF18005ECDABF0C5C2C64EEC4383E2E07DC | |
3385 | 5C82587C071E59B46B7BEF31D268F39D9B12D534344FBA515E9DE8F166FAD1E2 | |
3386 | 7D1558967AAAD3829D3F7EC6938D20E5379F414532976ABA844D97A5E9078901 | |
3387 | EAE4D0ED1F4C7EE7A2D80D891A5013D6409A38ACFA497F5A169EB7F9F4890DC4 | |
3388 | 62FA6A89EA48267331F086992B9CA9305E16611E6AEE67DCDD588A25D37F45B1 | |
3389 | 0DE75C802EE021E574B64B3969DE2E5061ED9364B646C38D4BBA86802CA6338A | |
3390 | 94E135D2256920EBFB1AA22D9E90C7D16853F0DF9F2D942748EE540E4FCE63C6 | |
3391 | 5380D7AB4ADD6CB00FE8F7867E4862D8DB432F28331428CC350CDF7F447A65ED | |
3392 | D7683ECA35A22ADD06E9FE6BAF060913AEEE7B2B8EE4798E437698CC9EB2428E | |
3393 | 74CE73F84D0D2292DE709D71FFF8901C3505370E6F1D4E28E6B7372492C65A88 | |
3394 | 159371B1D60D77CEC93B272B6C5394EE1D2EF9969DB2838B8E128553879A1BA5 | |
3395 | 2884B0A596E8FC3D1E648B7E26A4AC57DF09B9CE09B2F91D8CA618CA52AB3DBD | |
3396 | D005A56A420366069B73146A6F58E88BA49671A1AB7C2070C3D42AA770285143 | |
3397 | 40AE7D7868C0E1993506B07C086AD7D4F28CE2D15853FC5FBCBF9425D8012B9E | |
3398 | DB6E1E5002517659C8DA69DCEACA94F368537668843D281FC11782F1C5F71977 | |
3399 | CA215349EE6F20565DE3D8D8212A40E1227A4B22965FA64A0B02C62BFDE97E6F | |
3400 | C3C54FED4057EF9D258C42D7440C78C5E0CC58A40DD74ECED4152F70A93CE71A | |
3401 | 1B3A57C46F74A6D27BF98C97CCD31A8EA487260F224A3E40F52C65490AB4098A | |
3402 | 7B9EEB54A5A415C8C88568F7D9EFE74BBB785FA18AA27D9201F28BBC477A20A5 | |
3403 | D1307AA78EB8C7CAD409AB64B29E4115E45F5FADDCC80CA74B296C4265A40614 | |
3404 | 37F2ACD8386AC0202D6FDB6711E8CB06442F209D781E940ADDD6D881D4F8E874 | |
3405 | 357C533115923B90138FFE31D3577C6AAE60D768970FAAB682CD0DCA3E9A9A68 | |
3406 | 6393E4B772691C1013ADFFC90C508D51B02D2518ADCC7E79F7DE5DF9D18B8435 | |
3407 | 6129064DD1A3995E5A6F45D78287CC10A0EAFBF47223494C5EA934B1BC2F7C53 | |
3408 | 686C5880303F9E3ADC8B100D441D944686E1FD811C646C6DD0224F6CF55FA87F | |
3409 | D132EF50450879A25242A18683BD6D0266F8F333F3768D1952B0F32AA75106D8 | |
3410 | EC0AB703F287E847CB91FFB88CD9DA174B49171822BDE34621CF41EA772230A6 | |
3411 | 3088F8D19CF2364A329162D39E166AC728B15800222E54C40FDA8B73C48CE82B | |
3412 | B2B3E7EF15157FB4510BCDD7EEBBE3FDDF708EA08540D94827AF3EA1B210446C | |
3413 | DEA9EE0EE9B4758863AA33FC296740F0DD9B42A45861516AAE6208F189D8CB8E | |
3414 | BBBDDBCC34B65A7D17B8BE932148C39084A9C71516582BCE25EBF7C1E0D84314 | |
3415 | 45B273AF903055D53313DBD159BB698038A397AEF418B4446739318E8D273642 | |
3416 | 095B1E04CC60718A2DC2BCD99B34202878786A58AE7C2F43D985874AB8A3F204 | |
3417 | 4DBD4B9240EE96F0487CB687830972BF302F262C6381B2C79773EEB152B712E9 | |
3418 | 34E8229E0B59788EB9B9FC1AC1E123751D1FF032610410F0847E6B9B9A575306 | |
3419 | 53FC00ED82D0BDA8EB008F2380FDBA06D2F8C0210A261508BA95DD600436E0BF | |
3420 | 5E8A00CE3C92859961557763D413E79CDD37FDB07131FDC420EF525CC0B5377F | |
3421 | 9772D3876DBFDB57FE6275D187832F2B7A635967B201E70B532E85838ED3874B | |
3422 | 82B36AB9EAB7DD4D2B5C4140419CA04E87316E802CC93DE6336C22FEBE80C3A5 | |
3423 | D43A0F808E5E6A17F7BCF812FF5EE5AC1959E07F36B24C9192E375FCA3C0A84C | |
3424 | 1D1DD2093D4F151B9FEFBA90DB4E94A1D68E49DF5A715A5BE04E7B7D8C384D61 | |
3425 | 5DDD71F057FEF51DE7D002AB3BFE0096C47EB3AAC7B89EEEB9E2F9CFC6BCDFD9 | |
3426 | A438C1097D5253E49DC0DE5B6E8F976AE8894914BF8CAB5236C8A3BB2A437CE6 | |
3427 | 374D96AFC592F1238357817E1F2836EA763A3C0DEA2DD3F7D758BA61307C21F4 | |
3428 | 796A18638504797DD9A5131EC48DB0D23FC9A3E069B2FECA5B36A2260C6FED2E | |
3429 | 6EBDE3AED119EDFA96B837C56202ADF7F7747291A43CDDED6EB7DB5B9373CB78 | |
3430 | F6FA0B92BB2C17AD8DA549E878D8DEA681028539E5E2A223E2F9BA4CA09A6FF4 | |
3431 | EA195F1EAE62CC33F2282888962B9032D1C83EC4EDD832866A472426EBA6080A | |
3432 | 75E02F39CE0421C5C06B9D593022C23D675D7BE879FCE0B20A9CBB394F9D3815 | |
3433 | 9C847518BB8DDBF3A89D699C1FA84E704B02BC85D61ADA5E548CD8DBE269A3E7 | |
3434 | 03626A0FEE75E116F95B5D31C73BC852C5FDCF524542BFD9D05D8EB4B2A114E0 | |
3435 | C2FFCE282CBD87D82C1D4E64772B0492068B139B1795E287899CED7791EF5C8F | |
3436 | E77391C51552FF08DAA85BC8B9896CB5C792C3E1C4D44E3CAC1EAEC02E4B986F | |
3437 | E5059463613DD3643F8DCE2264FA66D712A0DACCF86DDAB315393219F5EBD18E | |
3438 | E220AD61CE3C67664615A5F9734421152382E8EA9CBED8269ACFFC37873BA329 | |
3439 | 20649A6F684D31BF37194952496E8B962B75B83CEDE72F0DAAB761120B710677 | |
3440 | F3AECF2A67F512F7C423B1DA012D0D0D44F009346C4953447950F514731830D1 | |
3441 | 59D01BFF4511CD0257D5ECC2CC4A859E0ED92627F659547C8F137DC0F49F06D6 | |
3442 | 02F624EEBDBC779FBECB1816A88F02B3565A9C3D42E919F755F3D80F6FAB681B | |
3443 | 585B5A49F62581EDE1D1DF1906007A8926932FE74FA2A94B92026DE9D678EA3B | |
3444 | ABC3C2EE5A3757317AD5F5CD361A511F4019CAF77C46C8FFE4615CD6CFDF7F8C | |
3445 | 8CD06F1A2DDBD3BBA03FBBF8DCC898EE71E7D19CDE66971150359310D0BB68B8 | |
3446 | 65F3E41D34C8D063A71C27B6C0F27753A9E35D291477858E5B734D72C40C4573 | |
3447 | 203C5529340CB56BC00EA0E02B3DB54173E6480D29D957E6735146163980F0A8 | |
3448 | CA4086192E6095F411939DD3FF19854F8F58B39A23D3ABA22BEAE05C4B6B6845 | |
3449 | 98968C08559A037DE955F77359FC39249C1149BC4634D10DAABB086A23D9A37A | |
3450 | 73A61EAB63BE3B1A8D8E76ED94E731169E892B469056757EC885D8AC4FF50E5C | |
3451 | 1D80EFE20E40E26006953C53D765B3BCB4C5396646DB3AEF01F939BD163ADD87 | |
3452 | FEB1E55A73722A0866DEC922EFF8B06AFDF2FC742EB1CA422822BB378310A994 | |
3453 | 794062BE62D5BC4D44C25655C902F4FB4FA63CE21E095E4DF3723CFE7D2D961F | |
3454 | 10A715B194ED855942588BDA460A28F1B5D849A34D85756CC8CE874E2384AD9F | |
3455 | 3A1C348996EA94927BCE9715A8B229C0D7FCC2C07592052796D7BAE23DF895DA | |
3456 | 1CF991E912EAC97601FD79F35616A1F23D82647BCB49C360740CF010CA4E8ADF | |
3457 | 97A9CAC032D12919CC167CA4C2E6C60EBB4AB87C8F2BDF71E28E91A9BC96056F | |
3458 | 5D905902AE964E5336CFDACC8C5CFC5607D75CA5F364AB8E9A65FD372BF15FA9 | |
3459 | 0CE1519CD7DBF31F92D2A078754E4BF90F3121F6F698DEC238404EDDD4EEA153 | |
3460 | 0335941E4EB8F08DE0104FD8633BE277E9ED26FC65D28FC1D604D8504B2F788A | |
3461 | 11E2206ACE8AB33D14CE9D4CFC917008D44AFA2B1877C3D42455593889867784 | |
3462 | 7CE696EABDEF95872F065DAFEFAC253F367D47127CE76FCB85BBF0684DD1663C | |
3463 | 876E68EC35B21593A10EA5553311880B8EF744014CD1ACFC067FDFD46978BA23 | |
3464 | C86FBA05CEB66E67621680BEE0ABF82364D4E3235A20033437C6B84A71FB34E6 | |
3465 | F8A160AC477A1302B4F98D00FDDB2A35ED9B315700669D9D8A3D254F786316AF | |
3466 | 882CAC6555A766281A0836CD45D8CD8245CA69729260D54C11DB43032A0FAC0B | |
3467 | 05869ED0A432CEF854FE665BACB0F780C9123B4DA1E1895F8717DDE4A58BD3FD | |
3468 | D214195066D4587463E839EDF667E475BC04EEDAEC41422AC9BC27C238E88318 | |
3469 | 7DFFED5D04AAFB1F63AC651B1A4113B7CE9838ABAF75632EDA8B5EE0C8474678 | |
3470 | 58898AD595ACD99029DC34EB4BADE834C04444941C3D8280B93951A9E8554EF9 | |
3471 | 5F0FAA218DD8224B94807CE2D8DF7E4A5E2B28C44A551DB0708B5D6D5F000B96 | |
3472 | 0422A8E953233296B6E5EA698921F1EEEBDF0C5CC72263663895940B4C1EA28E | |
3473 | E0E3AF21698D5430D6495E32E0D5F5E538EF835FBCF4A96DAD8F011B145584EF | |
3474 | 1C33809372DF602D1FB3D80A4EAB65897F672642E4317926DF178BAB6F9851C7 | |
3475 | 63613B3DB11FF07F9C7582592B620C7767D005D7B0C28AF2D309E6CAC222055F | |
3476 | 2C20A58AC1B407641B483D571B9E959A3AE0DEF316EFF7A4514D5313C47AAFBE | |
3477 | 82CC583BEB32F20E4C3A5650B58812EF357B68F26882D30A6BBEBDE64E2FD910 | |
3478 | AB8D974CE5C968C7D34390529F4714A9F1D2373DB1D912D418225932541FB250 | |
3479 | 9C74346749DE9C5662B1C40437E783A78A283AD6EF43B2C111DEFBEECEB17ED7 | |
3480 | 3630AE404B310F1148C82F4969A794D945CA5E1C18F39BB6F9C46EDC8BC3C88B | |
3481 | FAC2116B2338E1AF9C975ECC8474BCA351E3FDF89ED4352FF6A3D6C7EF7A7BDC | |
3482 | DD4B2DA9E7C77F8A6623B670963D2B9B9A80F8445E17B85194AD45E02FF10484 | |
3483 | 85E0A700BDE9F574487F9494B424646D48999EA67D469A22B9CB72123F31EA5E | |
3484 | 51C07370BFB1C5EDB4ADE75E7111A0116C212920F1362353BF58F33D7E8EE680 | |
3485 | DBF8085B46AFC40ED9FFD7AE756CB267D0F321FDB71F2DD35FBD3003E91E2758 | |
3486 | 3DED65748BE5CD0D2D244E8FA187749FED44ED0C71056AD954FCF656DE28E70B | |
3487 | 93A79EB4D7BD59E92911EC64EA794732A79B9908B7C6DD42C99BDF07AAA06E07 | |
3488 | 5CD6497C489BC56B09E44D22D0FE69521A9BA20ACBFDAB8EE718625711BF479E | |
3489 | 512FEC4A8F9EC7CF66D4CC44E2D0EA1235BF17C3D0AD6859385CECA3D4A640B0 | |
3490 | 762D325D3A449BF7115CE8469A493C494721D6636BCB9C55ACF1D0F3489E5534 | |
3491 | 4A76A8F3E3AD6252D8CBD3EDFDAC890A7B497286241AFE35B2261B66018A1523 | |
3492 | 4B9FD31AE07A6CCA6B91A176BC38BC03F97D71F80270E14B83B012FA5270B7B4 | |
3493 | 73F889DED2D4BFB24536E495F96BDF408E3840AF1567E9960A4F22F0B749749B | |
3494 | C156336BD7F349F2F82CE54B459462CB7C9846CC090E752DCDC871FF0873076E | |
3495 | 8885B0AEF490DB0C9FA98A8FDF84EDFD52AB0F992EEB236A79FB8FB52718EBA6 | |
3496 | E0D586512F81079D468A75336540163B966670B437304F3272CF6E49252662C6 | |
3497 | 419E8B2B14D240A1DB0CF6EF14E024F9D8C6882F865D7E007B46DB65E2E6AB1A | |
3498 | 22C5F096B255E91CABA7C441A3149FFB4E19BA97E5D43779C2A80208E279A91E | |
3499 | 8B8A281C079B819BBB6A5B1A62F34D59B7223D9FBB5F5E96F0D9AFEBD3CE3D57 | |
3500 | A4C4D2345776FCA140EA95242C8AF1EE7B93D2676209B750ABFCFC8CAF50F578 | |
3501 | 4C364CF8BC46839A4379624D56B7B917743E9D6A284E7B315D461ED66B262413 | |
3502 | A9AE1741C633A92061DF92AAF78A18586CDCA41248C586F7D272378F9CA76980 | |
3503 | 202A391CC9FD46794140F06CC75AF2F4986D690939E083CDF9B96D066B1EC8F3 | |
3504 | DE3B68AC8FAB84970B1A199B3F3AA5BE27ED8119F306CC5F26230C16E9D9FB31 | |
3505 | 1EE9D3F5175E4D4D7A8A2945000C37BC73816AEDE6F2AC0F09B788C9988BA69B | |
3506 | 82CF336482F490F05725696EB080E460FC03B3E28C1B3613C8E5FE3DEA048D97 | |
3507 | 4AC72C9955FDE282FA8C8385B30E3A7EFE247B48B370DCB439FA721BED19AF4C | |
3508 | FDC3D3543A25A4E0273419B6CDD7209FB336C1542BA56257E5D31B70529C12D7 | |
3509 | 524617868F4F3B49799322EDF504750D1BAAE307ABC4843704B64ED8AD4996B7 | |
3510 | 5193CEA660390527734BF1448AC09998E70FF15BD70F8B6388B0A987CBC783FC | |
3511 | 990F7A5EA016EBC024F12BC9812C7C4DD6E991DB89415A49D0B265E453732F4D | |
3512 | 2B6BB50E995E719B00DEBE74E7D1E291A739C4EAB39B5A61763DDB65BDA6E1C9 | |
3513 | 17C49BF1A76546BE0EDAAA17310AB2D01BDF059B066263C8FFBDA53281C882DA | |
3514 | E2DA35ECE5B4454C8031DBECD8675B60E54261A7D1F70560C6D8CBAB436EF058 | |
3515 | 5A0189426AF00AD7EB43FBD13976D8D769ED2639ACBF613A308C941CDB5A632F | |
3516 | F76E14224909A8E7E45B9B5A47BDC9B7B3E3616AEC4DEEAF2899A59B6E144802 | |
3517 | 534109EB0E3ECD270E417B2E9CD8D27DE637AC798ED5CCF791061297A0B218A6 | |
3518 | 1188C03BAC8DD8DD783BBBF8C4C9AE98E8F1EFC4684CA4BEE6D533458BB229ED | |
3519 | 4E31392DC4591DF2D2D07632EBEC0A5FA2C4508C1FD48D56EE871EAF4A84AC07 | |
3520 | A1E34CA2CD81ED369043998A23DD01301D41C582963F07EC3417F09ABF45844E | |
3521 | A74F386BA813F0AC462FE268407B9D2A8813FFCA604C342CE82493DAF631B2B3 | |
3522 | B6D3E9F3398761C4B958569F0D833D27973B07F9DA9D84AC512C284844C04866 | |
3523 | 74A325E4ED894F640B8F802097B7C6C4F04BBBC8A7BC6EAECC60EBBF4E676A30 | |
3524 | 4A5D0DE4AB45D0C913CCEEB8032D1946A35928BFB0FD76AE324E7E3CEB5B99C9 | |
3525 | 0A0A6EBAA6F6D8E4292F9C5408D3859CFDEBFC9413032FA1A6E194C5F616A3D6 | |
3526 | FB0FEB8966534CCC9E6D67DFCA105E8994810D8EE414DAFC80B8A95CAFA254CA | |
3527 | CCAA72B84130B5E485529013A35040074072A8A63B2F4384D976BBFA0A743C5A | |
3528 | 0A079A2CD15E598801AD121303CC37A2FD3942776FD1AA0805BED2B646D4D1CD | |
3529 | 9DE65CB859735EDC177C5A4D1A54C3E8BE7A91BCA91AB93A9DACAC90204CC207 | |
3530 | 8432E95B2C47654DA02EC1664566E2137860F16F798E0A1EFFC819F4304B0FE2 | |
3531 | AA54AFE0AF6CC26D417B0CC9E3F5F6B9BD6DDDE6A2D7FC4C840E4AEF73452D16 | |
3532 | 241FF01413DF2125BA3563B3A49EECC8EC4D0BF06283B3C8242F362A546E71B6 | |
3533 | 21F3C6DA63882992A14E295926387D66EA6D9F296455276D4FEF0CDC706FBC25 | |
3534 | 57169AAF546A1BC72114A3A6DC3A1A76CE001962D771C267864A987188BF6087 | |
3535 | 183573E3E9DED10D7023965D29F19C8950B6B9B83E680010995360E54911AAAB | |
3536 | 44D07524518EE59F58E49485E885F56FF2CF8D30FC5779770685C305AEC4262C | |
3537 | B8C0C194C26F5E122DF5E4153316C971460C3B3B336C1B72 | |
c302751c CR |
3538 | 0000000000000000000000000000000000000000000000000000000000000000 |
3539 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3540 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3541 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3542 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3543 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3544 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3545 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3546 | cleartomark | |
45c0f7f8 | 3547 | {restore}if |
c302751c CR |
3548 | %%EndFont |
3549 | %%BeginFont: CMBX12 | |
45c0f7f8 CR |
3550 | %!PS-AdobeFont-1.0: CMBX12 003.002 |
3551 | %%Title: CMBX12 | |
3552 | %Version: 003.002 | |
3553 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
3554 | %%Creator: David M. Jones | |
3555 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
3556 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMBX12. | |
3557 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
3558 | % This license is in the accompanying file OFL.txt, and is also | |
3559 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
3560 | %%EndComments | |
3561 | FontDirectory/CMBX12 known{/CMBX12 findfont dup/UniqueID known{dup | |
3562 | /UniqueID get 5000769 eq exch/FontType get 1 eq and}{pop false}ifelse | |
3563 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 3564 | 11 dict begin |
45c0f7f8 CR |
3565 | /FontType 1 def |
3566 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
3567 | /FontName /CMBX12 def | |
3568 | /FontBBox {-53 -251 1139 750 }readonly def | |
3569 | /UniqueID 5000769 def | |
3570 | /PaintType 0 def | |
3571 | /FontInfo 9 dict dup begin | |
3572 | /version (003.002) readonly def | |
3573 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMBX12.) readonly def | |
c302751c CR |
3574 | /FullName (CMBX12) readonly def |
3575 | /FamilyName (Computer Modern) readonly def | |
3576 | /Weight (Bold) readonly def | |
3577 | /ItalicAngle 0 def | |
3578 | /isFixedPitch false def | |
45c0f7f8 CR |
3579 | /UnderlinePosition -100 def |
3580 | /UnderlineThickness 50 def | |
c302751c | 3581 | end readonly def |
c302751c CR |
3582 | /Encoding 256 array |
3583 | 0 1 255 {1 index exch /.notdef put} for | |
3584 | dup 11 /ff put | |
3585 | dup 12 /fi put | |
3586 | dup 33 /exclam put | |
3587 | dup 35 /numbersign put | |
3588 | dup 36 /dollar put | |
3589 | dup 39 /quoteright put | |
3590 | dup 42 /asterisk put | |
3591 | dup 44 /comma put | |
3592 | dup 45 /hyphen put | |
3593 | dup 46 /period put | |
3594 | dup 48 /zero put | |
3595 | dup 49 /one put | |
3596 | dup 50 /two put | |
3597 | dup 51 /three put | |
3598 | dup 52 /four put | |
3599 | dup 53 /five put | |
3600 | dup 54 /six put | |
3601 | dup 55 /seven put | |
3602 | dup 56 /eight put | |
3603 | dup 57 /nine put | |
3604 | dup 58 /colon put | |
3605 | dup 63 /question put | |
3606 | dup 64 /at put | |
3607 | dup 65 /A put | |
3608 | dup 66 /B put | |
3609 | dup 67 /C put | |
3610 | dup 68 /D put | |
3611 | dup 69 /E put | |
3612 | dup 70 /F put | |
3613 | dup 71 /G put | |
3614 | dup 72 /H put | |
3615 | dup 73 /I put | |
3616 | dup 74 /J put | |
3617 | dup 75 /K put | |
3618 | dup 76 /L put | |
3619 | dup 77 /M put | |
3620 | dup 78 /N put | |
3621 | dup 79 /O put | |
3622 | dup 80 /P put | |
3623 | dup 81 /Q put | |
3624 | dup 82 /R put | |
3625 | dup 83 /S put | |
3626 | dup 84 /T put | |
3627 | dup 85 /U put | |
3628 | dup 86 /V put | |
3629 | dup 87 /W put | |
3630 | dup 88 /X put | |
3631 | dup 89 /Y put | |
3632 | dup 91 /bracketleft put | |
3633 | dup 93 /bracketright put | |
3634 | dup 96 /quoteleft put | |
3635 | dup 97 /a put | |
3636 | dup 98 /b put | |
3637 | dup 99 /c put | |
3638 | dup 100 /d put | |
3639 | dup 101 /e put | |
3640 | dup 102 /f put | |
3641 | dup 103 /g put | |
3642 | dup 104 /h put | |
3643 | dup 105 /i put | |
3644 | dup 106 /j put | |
3645 | dup 107 /k put | |
3646 | dup 108 /l put | |
3647 | dup 109 /m put | |
3648 | dup 110 /n put | |
3649 | dup 111 /o put | |
3650 | dup 112 /p put | |
3651 | dup 113 /q put | |
3652 | dup 114 /r put | |
3653 | dup 115 /s put | |
3654 | dup 116 /t put | |
3655 | dup 117 /u put | |
3656 | dup 118 /v put | |
3657 | dup 119 /w put | |
3658 | dup 120 /x put | |
3659 | dup 121 /y put | |
3660 | readonly def | |
c302751c CR |
3661 | currentdict end |
3662 | currentfile eexec | |
45c0f7f8 CR |
3663 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
3664 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
3665 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
3666 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
3667 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
3668 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
3669 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2D43A151FEE81296FBE | |
3670 | 0CF37DF6A338C826464BA5198991445EC4BE80971DB687336AE8F74B516E333D | |
3671 | 2D8AB74D362C559AAE6ACFAE49AEEF4F52E28C869222C1301D041E7A0BC1B608 | |
3672 | 1BF728EF9E98F3A12EB2714E7F16B14E055FE1FA0EEFB058860ACADEDA9D0E4C | |
3673 | 42E3C6F1E4869471BFAA3760175F3FBD842755A9D7847EBF605F18293B42F557 | |
3674 | FBE2715002669091BB033E1AAD657532F34F7C66E4F04D63ABB07E6CB9D9AEAE | |
3675 | 78EDE8B79DD9BC87A1FF445EAA05B5572BB880E69F4DE1F82D7F0E9980AB0C18 | |
3676 | 22C448B0B1722D3CC33C56FF287CECB80658B3AF5E7675BE82CEFF3DAD5942EE | |
3677 | A03C955FF979E41E54BCFB5316A9AB8945C403A73180D0961416EC9C92F49811 | |
3678 | 4B91BC4C788392994587517718521E416D469F69952149FF7F9224377EBA1065 | |
3679 | 4A727BF806A112A7B45B0A1BA1D5A23683960575368D9EAC8C04753BF7465AF7 | |
3680 | 95F25C258C63E4FDFFD0B412FD381946AA38C0B961652BCEC30322C47BF4755D | |
3681 | 9F91880688AF066E32FFB22E1A52DE741307AD3ED830D6BAA1D1F562919666DC | |
3682 | 5E8FD9862AC8600B0AE0BC7FC779252AAC57248744ACC8A8AAFA836BCF09B0DF | |
3683 | 9253DFBB1CB77EA8A59D42D1B18FF25E9AED72FA62FEC3F126F030F5D7DED9C3 | |
3684 | CF60FE890BA4A48E39E687BFFAEAB96AE542A6387F6624486037C8924002A511 | |
3685 | BEE5FBFD780AC1D4BEC3FBC47A930BAD0280D444259528B6C565DE11DE36BB65 | |
3686 | 9BADC55C1EDA1A80458E98896D782DFB5C137897419602809F9BF8CA39F00C68 | |
3687 | EFB9E076FB324C2963F23CBFED28B9EF70EAA4E4B903225D1F199A7162AB239A | |
3688 | D92D71C18B1B682D04C6A48926275BCB16D413B2A0E953E1257E0B12D8B717CE | |
3689 | 2EC84CFBC046A4338A69F454A469B12118E562B4F56C5FFB3CA5D357513E6FFE | |
3690 | 947A564B229C7FD873057D5C7CDF03E958294A1003B37D8DF565A70A00A3734B | |
3691 | 0138AE5277D383D10C2BD853EF806D3CCDC47739F0E374A3DF3B63638B949ED6 | |
3692 | 4EC25869DC1C0B1F4DBDFFCC97382841D8F10F3635C792139A1EC462FDBA379C | |
3693 | BE0990CA2E70FE73137AFBBF30CA54954D7E7377CC50BDD780DDD4C7FDC77AD2 | |
3694 | F3EB1169F14A0041F18160F43C24FAF556DB5D621709FBC544CE55424F7446D4 | |
3695 | 6AC07A51C8CD5161AB0AD5084A96FB35D77F1CA155147DEF8D7A590EA6939514 | |
3696 | D4A226588295CE0007BA8A550895511C8D80BBE5CDFB8A50D249C3BDCA974415 | |
3697 | F5557914A9B805782F399E4078DDB6264F1A49A9A5BA45E284A5196E9828EBA8 | |
3698 | 481D357B8D9E6ECA631A6204439FDFACE7D7E6A2392726107CB7D2517CD19A24 | |
3699 | FBE592C119626DB221BBB635B6EB84845C16A9585282E34958B961F4A543AF9D | |
3700 | 419B6A9105BF185FC767712D923437BE08A9C0EB92AB6792DBDC671029B6FCA6 | |
3701 | 7F717FCE379C0F3B51C6CF042A762ED04898FBB4B0105C3C4ADDDC18C51BAA3B | |
3702 | 70A93666669547081D9246732CFF74C83EE90DA17F5B4F8BAF47FE4D81590988 | |
3703 | 2858C9B96071341FA0A0D23BDD4947FC9BC2297913CFBD4FD6CA4303AB3179AE | |
3704 | 0203F1BD502065F90CE9BEA3B52DAFE4A29446082EA0E6B1D7AF1F31D0AD02CC | |
3705 | 9A7FACE2CA86E5FE0F6A425B28A5940ECA306891CECDB3CFC7A5BBC76B5D9E8A | |
3706 | C754379ADE80B4D72CE493010317BF21A0CF4A0A55C1246218839DCA3F4D626D | |
3707 | 1F4161D38F54AD5142C1CEE95C61D8BB10FAD4B772F4955777AFDE8AE5A837C2 | |
3708 | A2BBB11D0BF5DA2E63D0B75ED421DBA9C789B281B01846B65DC572BA69591969 | |
3709 | 21265DB722AE86BD8CAA3D887C975A617ACEDDFB7AAB341F47532AC0F354A530 | |
3710 | 7662C089DA3939588774FFA16FC4A52555DED6D6F51DE718BF5F345C23C90198 | |
3711 | 17B77CB8B5D53A5CE7A79F3E286B6A59F3F6178AC8BF15C0A15C1A8A95D03B60 | |
3712 | 30EBE53DE328CE085CD9A1D49C69AA299C5B58B24334A546F6E274C1B534DC8F | |
3713 | 3289553F560C2F81E413ADB92FA0E7DD1C2F39D5FD268EBA97AB7335ECF28257 | |
3714 | 96B4EADB7D0778706CB41C7E9C882760E7670936774A1088FFB2011115FDADB3 | |
3715 | B69EBD5108760762521C25C968C3E282DC3400001AC8FB1EA27FF643E3025950 | |
3716 | 1D617BB8BB321281708E496277E11DD3AE0023DA9F25AD06B39C7CF527FED27B | |
3717 | 57397E88D3DF70EE4FCCEFC8A0927D6B05517E571B3E70ECC99F3CBA32CCD4DE | |
3718 | B8BF22626B6C94FE65598A88AB90D238461EBD9A098DADEA4091AF1CDD7560EC | |
3719 | 8E1B9BC2321686E1759E6B8A270C8CB4A254F7368039602EAEAB86ED21CDED91 | |
3720 | 8F2DB9889F46981C494C7EAF5E819B91C129F0740B8002B510014985E5791F59 | |
3721 | B16879CC6521D8E9F1C4C1890AC85A78022BE614BEFF318AB2616F0C3F02405E | |
3722 | BB425D1555472A2642BA7686E431DC3FB8A1688B76660D9957C3FDE8D58109AC | |
3723 | 21B1234C9DDF3F0FAF93BCF7B2F88A001F23162E1A13E5E9118D51B485B70A91 | |
3724 | D0CBC39CF44413FD8686D9030782DAB58064F5B987E0402AF5B264B17BD31BD4 | |
3725 | FDF63951BECD73ACA6138854EF35B062D01F33073850D9C09A818828C581241F | |
3726 | A625AB3638081DD0F00F946BE5450D38489CECEA4E66B4D85CC8AE0157E2AEE4 | |
3727 | A22A9313829F24D573101D84CC1784D1CED7DFAD5DD966601370C6CCBB723082 | |
3728 | A86BBAF0A5D867D0D2E3CA16E14E5109A29EF02649C47E12E88B3B397D65CACA | |
3729 | DEB9940B92100744D686066F8250FF30E5F13D81428EE238A2E4E07ACE0F5C38 | |
3730 | 7D79D4A336D0D26AF9C2B84088ED8ECDF94A1E3FADB45AFDAB46CAD6FF950B0F | |
3731 | 07AA2CDF82374DA76C56D29C80138841EB13F0D02ADD32F88B23E282ECC845F9 | |
3732 | BB9AAECE9CDC644AC2D49577A92307A83A99434F6493156DF25DBF0FCF2EC21E | |
3733 | 8C50A312C3D19E0609C0038554CF4FEF3ACEB7A833FD54B06EF0D617C2971C89 | |
3734 | E4C06075B09B84A4F78A82152B9A9C540B1D881313C2C74F20ED064A9606EC2C | |
3735 | B56D7BB4797F1EEF4A9B13579CCF311FA4A4DFA62D80FDB7F535CC6526D1AAE5 | |
3736 | 45C008EAF024B48C377522F74D939A475970533E645B1BFA81997549AFF26F67 | |
3737 | 2AAE6C2EFA357DB3B525276EF330905688777057F4E4CBF584520A534A8587E5 | |
3738 | 5A8360891E75A15205E8ADAC4A4E5A6E27D0C4A7D492216E4BC023AB027F37AF | |
3739 | A8DC7579BA50204D5F45A51460C5BD8A5A7F87668CA6451137F2F59E117BBE28 | |
3740 | 5C40820882A5546FA76F0CF49F8A6EC445F0647CC3227C400F56E7E9B84A6975 | |
3741 | E85E243CC1666DBAFF4E07EEAF3AF71BDACB30DAEA792F2B8504CAB071544F01 | |
3742 | 5D66243D529C479D276FE22F7E275D9E7FA9C6EECA18716B2F213916E32C1D94 | |
3743 | 6E32397B41AC6779543218E506569E3544803BBF9B404A983EBA62A494187B30 | |
3744 | 8D3DFA4E1237A2E5E08224A60492C09ADAD8775B7CDB830520829BA164209ACB | |
3745 | BCDEB2D574CEBFB7AE4BE72DF4EB1945FEF2458761AD8DCC0D378AEB7DA002C6 | |
3746 | 9C14A665DAAA532B0ABA98D7BFB5A6151FF6703385AF7AE8FD315A492FCCDBCB | |
3747 | B825707F9566B3B4943A3C61C3DEFDC31A843A2D67AB06891F3E110DD8C73D3B | |
3748 | B5E4151B51D9F13905D7D94DB9ABBFCAF35F43B6EEE256B1A80ED6D1739D8D5E | |
3749 | 8C767F6F0E8704C5345D028A2A6DAFD9BB7AA048B8B895FE9423A7ACE858BADD | |
3750 | 595CB074A128DAFE08FDFFD6BDAC0114159A702FDCBF8013804B0CAEAD7AF38E | |
3751 | FAF086A3248AD4FCA1401A85AE2F72E3E6956DC0996FE8ADB18F89B14A208A15 | |
3752 | 13F81AF73D0DB72F78C4DA634ADE3C73756CAE6AF2E149C26316DFD93370BE1A | |
3753 | FB4A79F77A67C07CB0A53C78367F21661D4AFE9E27328E077B522B50FD9AE2E3 | |
3754 | DA087BE481515B5DD7BF894A96A84A6C78874100505B7DDE1D22EFCE8D58B3AB | |
3755 | 313AB5495F72E2CA4E6AE22C0CB854302B9990372F1661D9F0A517F90686F248 | |
3756 | C5643008B3D29F7296E5C8FD4049886662EFDD4106E17C879F5D41CE84F87E89 | |
3757 | F6A3117C968B95A35940CC29C43E1E0DEF51C1E46B676301F40D59615C3F73DD | |
3758 | DE37B72FF7105DB84227DA5241583272AB1C3CD97AE11C1EE98FFDB5E5F44844 | |
3759 | 8FC41BEA5C54B26341AFF6830D9D0A5A2901B0653D8BD0746838194D240FF753 | |
3760 | E99750D3383373F453723D86BE97B571B8B84D8696089B5CFDD53E6C562A2197 | |
3761 | A8C4FB0CC690C27761A816B441029D3D306245052E0C41B53025D8CB7267CFE3 | |
3762 | C17FDFE348E765326F91AEB700CC49162DF748171214252CBC821493DD01AA20 | |
3763 | 417D66DF47EBEFFF3E9BB2B0A2BE7D9B8C68BD570FC2EB0FA54CECC318F04C43 | |
3764 | 19598BDE93F2F13DC7847354C99059AB20593EE51E94F9D4E9241869D605AAF4 | |
3765 | 9D9B5FD88C3798A039A67993C5EC68B6326B132E647F67EACCA7F7AE7F718D85 | |
3766 | 12666E90D7C73EF210E344964A38228B236679A2B18F5E081234CAA2458F8D83 | |
3767 | 3F0CA308D19663CB12EB904076EF88E556407C33C9380A6A3D68A9EFE65387C1 | |
3768 | A1BCD2D26DFD2AC0881EC30E81C0A4E76C244A2BD822EE88C4A60B480D107E68 | |
3769 | 90E419A1F512E865BA922A7830909BC2611A80931CB2E9344529586726614D94 | |
3770 | 3AC5200FB9FF68AD9686506C5EFA8788C0AD0251AFE7F95E84683380CDB421C5 | |
3771 | B1A783B6D5F3A6BD1BC1C14B363DB01C87C0796DCDD5BECF41A1A9F43183CF6B | |
3772 | 82C2AE49F0BFDC5DEF7729F2E638EE6EA9E4D059EB9BB1B992AD8C82D501A550 | |
3773 | 1BF73CBBFE740179B54E193E84A55DCD61B343C1852780FFB44248FC9426AC94 | |
3774 | AA2B3FE20FBA30F6C4D1E0FF3EDCDD8C0F57CCB50CDB0EFE2E04A8927E239C1D | |
3775 | 9B026C7929BB48461D4D695FFC766C8A0E545B1BCC2AA068D1865333108E7985 | |
3776 | 2D93F9B00EA0A90939D0D3840D59B6CC0CE2C147B2E1A9A4F14270FE3ACF51D5 | |
3777 | 99F7349106165AD627CBBB0ABA01ECC6D3A14C1DC1ED23A9DB9865BB4396C51A | |
3778 | 31ECD001EAC94B33C34E29C5611148EF3E55DD61813470B8F3CE32564C749414 | |
3779 | 3C93C77EA5A3538A0B5AE3FC4DA32813B06772E0E48E25BB39F3F6FDCC077E86 | |
3780 | F86FA50E18FD19EB2F37311CE87F18F3BC85CE7FD71CA92D5C3264E34E04A2E5 | |
3781 | 70C79D99F54D6C6D9D527AE45EBB48411221134587D2253E7C8ED7658EDCA34E | |
3782 | 5E768DD14E0200470F73C44D006CE8CB35DE1CA3EC10ADC668B0662A7774C891 | |
3783 | 84EC95A31DD872F0728D9F65CA80940080E04630BE4DEC77A2C49E3913C39978 | |
3784 | BF145F8832AF2C4385EBCDB15F9D32C22CBA0CF950877717D6F1591D7C0B8047 | |
3785 | 8C9BFCB16AF7124ED83137695F3D69228DB633053208C29E0ABA1B06A7FB3EE7 | |
3786 | 5625CB44927E2DA6E038A6E62DEBDA2D96A03177982D8FA33BAAF4426E05F4B7 | |
3787 | 9C1748B3FF7691F9888E7FF864A10B9DF761A41E6B5CFAD2BDD7E1C4924AC97B | |
3788 | F4B352705316DD1A58637CC12D71C18A5CA691AB2AA8F171590EC24582B1123E | |
3789 | 94D4DC587D8F99E18A711776BF4013C96446BFECFEE4C809EA94B169088024DE | |
3790 | 0CBD20199A915AA406F0BD5F3D63D1467C49B4691AEBBB35ED6624F2D7BB74BC | |
3791 | E80FD92B9FD04DD9C2BE9B6FD29EC7EC07FAB447511C61DD299C783BC09AE2A4 | |
3792 | 7B3CBCA6A20C6631D06D0B2E2482A50612BB7C29B7E7D0A205EB0E8436702581 | |
3793 | 596BC996ABD58CD8D5BAAE4B1478195CAFF98FE0141287296C4EFB8D2E7A8442 | |
3794 | F0A3AA9F9264329982532295A176BA1867EF732BBAC49AF485D9D0F7130F617E | |
3795 | 7F7DEEF935874D55A22240F8EDE4F247D5F73481373A392D40A8076BD91079E1 | |
3796 | 1CE5998BA13D48D56B49A92B4A18430E316405D2E2E391B496A1934671FF1785 | |
3797 | AF42BA3B2D14B8E04014437FD194455C50289DFBA61B5C377BCBDADA48E82DEE | |
3798 | 4E70EF5E9DC03064907BCB8BE4D59DE069FB0C0CB140DA54708E630767313F9F | |
3799 | 744594AD8A499CFEF733E640A11FD74E46A749F9C7D18D49251BF85C6EB4668D | |
3800 | 67598C31A8F90922FEAEAD4B83B6E7184567DC798E4BA1C4C9B3461A478D63CA | |
3801 | 054F13B502DACB674EB49D6BB935E5EC82BF99FDA7D47C581AD7F940DF4FC6FA | |
3802 | 6C6D25D647033AC69505F0CAC58DE99087F365531A6283CB89CB644688963C3B | |
3803 | 8B2203A94294E58739EF23C7803630A1F9121D62BE1977DE2F41687C8CAF87FE | |
3804 | CBD7AD3B98E0D95C8C6E1A7CCB0E09465AA874DC90A0F5DB2C5E7C130297FD39 | |
3805 | EFE63B0350B5139D09E6864D22C3F1150B29196E40EEF9723E71158B7ECFB8E4 | |
3806 | C426FEDCD439420B7F1C251FADA347C9A2C49738B5A17922E1EA93CA7B125B76 | |
3807 | 57449EAA9C1D591CAD327D0E98EF2D44D614EE9ED49DD31ACAC0B956620B6BA5 | |
3808 | 5BF6D08CA7541059D5ED2EF00AE2EE95488F5645BF6837D9241C0D3959B7580F | |
3809 | C9ECB2BCF3E65C07D52EC9CFB21C11CD4C883E44C173214C900C44D2E1E43DD1 | |
3810 | CE8DFE3DA93C38B548BC4EC46FF91F30CFB97525E1FD4E77686433B20BABF8D2 | |
3811 | 848C1CDF1BCF185CFD7A81D2D4BB826E837E2AF35CFC4F419F698DB0C43E9F9C | |
3812 | B0FB628AC9A3CBE9B1FF4A067016E70333E78B32AB2D89C483834B31F5808FDB | |
3813 | 77492E099F1504DABCA5722C7860CDCEDB2DDEB512FFCC7D287F4945FD711F28 | |
3814 | 87BC3D36173566B81FC2C1290C717A09697DAC6072408E20926D39270121CE58 | |
3815 | 3EF97CE12EDD7F87F2C8CFE36C3C0400869C0D813B71C425343EE0CDF717BDD8 | |
3816 | 409D5297D0F8F7FDEB0257C0A391F5635E0DB1116058942FF3E7C94D5F2873A7 | |
3817 | A3B0ADAFC3835AF2BE474E6741319BC6695FB37F59AEE388F81F6E66F910000B | |
3818 | 72E6BA7531B4378CEFEEDC79CCF4947BA1703823B5AB4F4AD73D9615C66C489D | |
3819 | 99D68E49C9BF765B7FC547BAB9640D51D5A7A2396507AB5A4DFF3D14F52422CD | |
3820 | 8FCFEAA06A56C6C7FFCD29C9A7A59DDD2A909A9363FE5F1E9629616D25ED38CB | |
3821 | E754C059E4379318CC491C3B1A90128693AC53F80F8210FAEA7EE638902A7D3C | |
3822 | 82B95B3F5AE340EC1B648DBB9FB679D6E80B7F426D8671FE7136D97F51E2D2F3 | |
3823 | C9CE9183E4061CA40091A2A70DBB9ECBB19CE3F65ADD0FB346B54BAB182E2CD0 | |
3824 | EAF4C0F402C25573FB344EA771B297BEB615FCD0595172E84ED2A62FF8962634 | |
3825 | 23C19076C2A9ECEED5135994EB397303A9619C76DC55E032DA83FBA441BD484A | |
3826 | 59F70A5110A8927F6239A14D4E223E189A5462E4A92EAEFFA4B961A2A32B320F | |
3827 | C2B4E8C1821FA67A655B5042C15E4DE1FB3652B55078DB123573C4E986B19DB0 | |
3828 | 1C5131F3DFAB271C30A5476B4A19D8FC922E31879C34BAED94C07A4841B8209C | |
3829 | 403369FB8E842610D1EB4662B6171A4465FD0E819964F62EC5B0ADC92F08CF90 | |
3830 | 1DE0B410FFBAD16F6D355E8AD72CCF67961EDB6CDA82398021007C2D0462E893 | |
3831 | 75EB0710AE4A6CDD15077C9DEFC5774EF4A657734D703CE42174259B58E5277E | |
3832 | 0DF26BF59AF8D1A3E7DC12E3C12AA4B67CF35B19962F6950C2020B698D971B35 | |
3833 | 82FF84E72F72FBB0C54A112BADBAE6C4CAA358BDE6A705AB59332C3850CA3D25 | |
3834 | C7564499BC1319121CE0D93218210C68080AFF33420E3CB3A48BF9EB66BC07C8 | |
3835 | A79D8CD8E78C200FF7CFA3DAED0B9E87E6141C88B436D8FCBA50AC195FCBB9BC | |
3836 | 9512B95FE3A37FFAAB39850FCEBD4D50A243EA416E73F53B4B00F3B6EAE0CA06 | |
3837 | 0693AFFF8191C1AD2A5129C8A8DDDD492F8EC8B7B93CCD6D4F240785E515C128 | |
3838 | D7AC38F14C1FF204DB89A8805F8D737644DED6E8EC6A58365DFAC56200AA22A9 | |
3839 | 8F20DE1C232DE4E818CB9D2D3330ADFD72C1B5146849142B447900FDB1DA01E5 | |
3840 | C1BD63FB69472D782C659F7862671FEDEEAED3617266DBD34AC593EF6F483D5D | |
3841 | AE56A502F9E66041D58C14FD6E83DEDA7DBA041726D78EFCF51152DE72B51F2B | |
3842 | B65060004FC8F67755EBA2F10A2D3E496FA3BC3B664ED03F496AC074B7425C21 | |
3843 | 18FE971025F8553EDFEFBDA53A475B36DBAB73D08985749FD3B0F0C32108EF87 | |
3844 | BE0C8DA94598691F774407E4D36D336BC9883D0FBB46C8D8F786780BC5EACB9A | |
3845 | 0875E368521C0D91FEFF40A3E10837B4D590E004A9E766ED62BB3DD2E2AF78CC | |
3846 | 29F6C250577DF1B0AD91FFC3E1EA731CF4249F91143B7224DC344849D03139B1 | |
3847 | D53B4AD7FF13D2A79C2C38E0D09590B499936C87E9D0D71B2B06D74B7A1D388B | |
3848 | 5A56C9FF8C4D4EC2F469549C5E2F62303BFFAC463C9C30FF7F2B77E7671C5CDF | |
3849 | EE067A2E64F5A763104D3EA3320E15C45999E0A4D002EE072875ADAC6F228DFE | |
3850 | 893664E7C2CCD757F6DFB1ACAA9F5922492B573B6536B34F3B931B8C1C761E00 | |
3851 | BDEF6A0D88FB24D30FF643DE610795E1730133715D14FDCA813C62188C66D7D1 | |
3852 | 2CE172CFC1203106790E648D9A19213A88589F54603BE7A45DD5AFD1BECB8C59 | |
3853 | A9F476D3D6856884E41B17FB36AA81CB3DE0F664F06B5C8BC3FD00F170165DF4 | |
3854 | 889A551DAF6B144FCB5EC9D9A64C261A7BFFB3FF437B2C44E06EC1D1D83451AB | |
3855 | 97BBD3AD1A2D1032BD4E945842F0C8A23866E08FF7DEC3675C07595EC2307447 | |
3856 | 3CE67B718147E3D776CDFF0685A731C4F0BCA79545E43068CFCC09A82A5DCC8C | |
3857 | 606574A06D7DF8359C48409FE7BE5CDE96693BF7C2E3D4639862BEC53B7F923E | |
3858 | 2836D719FF300DB7BEDB63B8149568A399DF4275649C7AB9BCD283495FFC6780 | |
3859 | 3CC50EC4E1151DA66D84C9F307610E4F730DAF2F2DF8F8E439972ED85601FDB6 | |
3860 | 2782E8BD391CC137B1D312EC502600FC4AEBEB3E438FFAA650E3F1F6C25588D5 | |
3861 | 36450EFEFE7F3E6CC4CD5FFAE2F3CEDD1559688B4DCCAE69CD2A847B1CC974F7 | |
3862 | 6C568DF48D75D0D11864E5ADE1D20B7E4585C4321128B78F7BE81CC38F950CA1 | |
3863 | 162F144299376A02E01B4E04080EDF9711500FB1A1CBE15332A077D520F2DB73 | |
3864 | 5B47B5E59B33994208A8B682B0C3A48A8D1E9CA8676EDE942E6130A33DDD190A | |
3865 | BCB3204E45FBD8481CC715AF34A75DE6BA280CFE20A0EE7E1A01F06D7C77CE6B | |
3866 | 895327E48DCC3268E195050B3E81E4410A4A62FA96E8C92A9190B64464B7D104 | |
3867 | 2AFB0E928C533C47F423C6E41B2B6CA3F0F6BD56955DC422CCA330A232066BF7 | |
3868 | 1C09643DC9D0A688023BF4933D7BE3266539A2A7E1E51F96A583D8E7CAD7C192 | |
3869 | 36CC8514A6B341DBFA654CD1E3866BAAED9024B8D4C9AFC0805138DD44D68D62 | |
3870 | 27D0CCC6D97413117CEEF0499C9E1D820D93A614D5A158FFEF907AF77FB23E1B | |
3871 | 9881AB2CE9037AAB8558683DDE74FD02593BD0A59E1D9F11ED12B34C0E15836A | |
3872 | 6F063CB303679A49D028C52CE197F69A620E4054441ADCCE4C1B2D4ACD25F8BC | |
3873 | B8D20F29E18C74F789750764CB16C741D4239CDAAA659F69B3219AB6A537BD2B | |
3874 | C0EC072CD7070960633C7EA0214098B92C469ED2E6E2D0467F292A7576279E04 | |
3875 | 9ADD778FE4D73CB746DDDFD809DD4C2A40653FD3B7643C87DD94CA2BB16003D1 | |
3876 | 5ADCF434E15BD8F9506F64F68F17EDF5F24C719A8B84B3CDCEF3ED3F8E25C75B | |
3877 | 2D9D56BC22C5FF4C2A6FC16A1DF3228E32F2B62FA250CCA81C4513E8968B1C2D | |
3878 | 242415A38B1BE1BD30904A5DCFFFFF3577501AE02EA02DA6CE507732008080C7 | |
3879 | 8C427E4C252CF2D7CFC476A734654458B182E44DE3DD178761B278E4662A2D7D | |
3880 | 7D287DE451DE57F219B3B872C7C07948C25FEDD32A3813D1C8C47AEA450E0DC6 | |
3881 | 3A179A44C384AD922AD1E8DA4DF9AEE5FB1C3E7D88248702670687F7E9CFB36F | |
3882 | A8F6A6F66B7FCAA56F52E47B7DD596A86CDE4F302ED174F13FDBCF81EF5DD164 | |
3883 | 91C9F2E77B1FE04F904A98F7BC72CF4DF640D57B1E20460301D0B62575692453 | |
3884 | 27038F9EFD54BF477CECCC8DA952826C7858E8DDC9AB99D68D39F7EF3FFAAFE6 | |
3885 | EDCA0C5AD947C49D081B86A9E8D599E4AA1F29F9A5E12729EA9C8B30D168C8DC | |
3886 | 770959A26A93B77BFE36E7B97F37B0F1DA44A560B0A8DD2815D792F53349D73B | |
3887 | B0436F5C2C1E9DCE30516D78945CF14AD2E006C6F5143C4A290EAC550F0A356B | |
3888 | E6C348DEA586569912BF890CF73E5E2E3B6F31244CCAE55EA1169676A9AFA1B3 | |
3889 | D28FEB69F21D1FB36276552FF8F5119A7D7DDE2BB0F050F9AD7730713674E97C | |
3890 | 072B31C82D87E636C2819271DF0192C54CA34AEFEC6E3D7F59044869C7C27475 | |
3891 | 90CA1490EFFD86A04781A5197DEBBE90BA3E4D9650E9ED3DA8B3D61371141BF4 | |
3892 | AE162139FE195FAB276299FC72496CA55F56323E47C00623021CE7EBB72F5BF0 | |
3893 | 9CFCF5AB81B6873996D75DAF2BE4FDAE42A6C289E03D1D64CD8376433E9D2582 | |
3894 | 7CB2CCCF4A6D1FAE25EEEEB25C568AEDFE24C3A6A57B1D6556C832DF6CCEED62 | |
3895 | 9E913D086F01E175A76A0CF1DBB354826553B27C8433BA50FD295B8B7CB93B13 | |
3896 | 91E0E8F33CB9D72DBEE55542C62E32E2EA89BBC3605B91AC2A7BBCADD0AC2F00 | |
3897 | 2C623690C4915364E7BC42C98C1EE89DFA5DB1E9A335BE485F96D92A848E9F10 | |
3898 | 89BBAF93A8E72D348FFA253BD462B72B758BDB662F4E15812A4C483B640BAD7A | |
3899 | 8CD2629F86FD17FF5747F0CE48858AB5CB6C58EF16229D5C89D5E90517CCF7FB | |
3900 | B57BE70961108A92685EF820D772BCCE4080F4A4DAB3F3764D74004F20049CB2 | |
3901 | 17C72F41938E9013DA041A36FC5D81ABC8C471ED2E99A1A1D6BC6E81E7576F4E | |
3902 | E17E9A7972C98F04DECC1E06852A0BD94A47915FA2568956B452F41062D65FBE | |
3903 | 27E5F48DB02DED360369D8DDA6BB5D84467F95CD27D3042905A06644A9271C6B | |
3904 | 6069539FB9E381CF5CF253186228D4F534D3BA1B51994762630F09BFC03B3C3E | |
3905 | 26FB2B18E271BB7E446A1C6F1AE51E589BD103B43617B6098829DD7E5797CF19 | |
3906 | 8E3B0F301B2962F17E6C9847F9DF9A3C6ACE96AED712A4A1BFECC614C008E495 | |
3907 | 3DD983BBEFB2AC681B61AE3D35108D69FE45A058CA246CD4C278AC6ADAF97AF1 | |
3908 | E71673F9CD8792155124F3E0886811B8FFBB9521AAB27436783643CD3445599E | |
3909 | 4E05811C063E64A0319693AD31194A72AA14DE7887AACE76B5B79639FFA6B2BA | |
3910 | 3EE708EF87537D04522C2508E457478DF29A5FA639906F6712869F8A7F2FB909 | |
3911 | A6F86722E5C2A53932B8494F88B4AA346E5319667AC6B70F3C41E6275BAB9A8A | |
3912 | F7197FFC71B8E00DAF27B784F6958DF7346D49A1CFC43BC041B3834E6377D3D0 | |
3913 | F4A5CA68EEA2769626A006C47B869D2B92C4137265C07BE5C6D9E8CB8A489609 | |
3914 | 52482A139C5D1C72D5BB08345799F1D13A232623C9834901B95FCABD7677E198 | |
3915 | 13D8AA82574FF22B68C1E47D22A8F6ED06E3C372A108DB2BD20A3E2112F447C9 | |
3916 | C948E0E053BD36116F0C79989B27D82D5117BF48412C2305124AD94CBDDDA5DE | |
3917 | 8BC10CA15DEB62E0E8799B16C8C7E3194681D462D591847BC15A4A2CFF981950 | |
3918 | 3C97C031DEE6104907479B3B4C8CB3037376D6D00786E54F63D19E02AB3A6331 | |
3919 | 3EECF0FBA366A61A7B68DD53D24E331A9590206D9E23B64C1645A3A7A5792D40 | |
3920 | 70000B430C1E25C85F05DBDD502D0293BA3AE9AC0EDD494087DB5CBD3E0B2C48 | |
3921 | 3BF4FD5E8D95CD6A1E707574AB3BACA6AFBD8DAE27ACA904FDB334A9573CF3D9 | |
3922 | 1ED5F66F4B96E8FA8551BA6509B3E52DD718CBE7C190DE5EDE513D685D4BFE0C | |
3923 | 85E18A5699FB9B359E7ADF5F65B28ABF8D4BB095B9A2549409CF607CB2B9BE56 | |
3924 | CD37BC0B909F493DBE1BB95ECA87BA37154CF67405F6E25C28A183545F26AEF7 | |
3925 | 96D75AC79E4694D4F67A22EDEDA7B8A24E0D6BDD2DF4BD5E2BA3602308503AEA | |
3926 | 28115B77E3025710FE88C441BBB0F09D8F6808F59B13B4EFF54C4625875B7292 | |
3927 | A8C7E43407D31C15471DD41AEA02C0D39F73C7142858342720F40D18CE901B24 | |
3928 | CA0A530B7E9A488BCA947CE70040FDCB3EADDBE2A8039927613927249287216D | |
3929 | 2E5B1CB2BB6E6A917A9C5DB5186B6AC77383B360C349DD1797A070FA5022E18D | |
3930 | EC6099E2C76FC6C14518AA866E37D6A05F6B164DB5289973A4AB9FFE11FD48F6 | |
3931 | 531E5D841B0F43D110BFE88D06D9774D944B8F07B3DDE66FD9AFEC8405889FC1 | |
3932 | B0D18BE78E554227EF73BD53E20353221E75D035CD1642E497932F736AF7CBB6 | |
3933 | 71C094AA316C1488008B3A459B56E466C2C6B9E7A05B9E0BC438605D7CD8D883 | |
3934 | 28C6D87F000E0ACA3D7484848584D55D60377BF3D6C02485B08B6D0F8998DA5B | |
3935 | EB9AFF49D304731CFE336B17C268DF694B5FC6B99D03CCA8C7915C78E6BE01C7 | |
3936 | 324F5E4CEF5CC6F279E846666D2EBB052FBDD15F0849EC9E35D3F32A58AF87EF | |
3937 | 7C6FCC7CE42C2F4E1654278AA7893FB455FD727EF6EA9A7B37F7F9BDA17906A8 | |
3938 | C6BD0588D0AB6932531980DEFD016725AA5C65F0CF127B1B965B3E1E6C5FFB86 | |
3939 | D8B5639369EFDF32CD7E547AB383F9AAFE30935CD4635671450F538ABBC457F3 | |
3940 | 2390D28E8208A66CC46F04AC44BF3DB7CBD94638119E5B68AAD689A51B454240 | |
3941 | A85EDAA394DDCC4B0984104CF71ED8432BEF69CD862893BC4BB9451D145ACB59 | |
3942 | 6DEFFB3551F8D067760EAB1505D443685B10B4A956ED200770E1E1D4ECE6743E | |
3943 | 8C26B70C9DA49836C35F469F9C7D8D84BAF741B671CE6F0E5A3EB017FEE30E4D | |
3944 | B5524CAEBF2BAD987F4B290901D18F2F161BA5B3618371A6C868C959B2BD579A | |
3945 | 22650599481CE05481F6BE5D44D88F8BF0930352194D4750F33D78CE18E25E23 | |
3946 | FF68409C8490F178872BFB6EB3E3DB658CE5CBC41841BD57806BC959A06192C0 | |
3947 | D722C50E5BC87A595BD38404E5454CF9063FC6C757576EA0E47949F7C160C9FF | |
3948 | 8E89C687E711204BA3855B7056616E31EAA6414205853F7EEB9171C0D57BF449 | |
3949 | 6EB9A52AE09088C5AD3BCAFDC49B4C922625599E97A88CB1FD6C5D3EE390D872 | |
3950 | EF6F0852A19BEFDFE8699DAE598CBA83ED71BDF8ACDB7DCE67A2F512B8A2F891 | |
3951 | 80E5962373CC39A50AC13A99E765FD6F5C7BF7ECAA4AB8A0A2837E4EEA7F6781 | |
3952 | FEAB66191F472F0552782C1CE5D058F8AC80E242E443E084E7BFB0E3063A391B | |
3953 | D4F256883DD600AFD75210D6AB126857D2794B4B20A303571E8FBA672BF78617 | |
3954 | F598256A9A74C06E420CF03AB9F93BC569F6B53736A32D712692396E3D05B7CB | |
3955 | D604C5E77F1D996AD7E5FD58831FB56CF74904D2C502AB61888D497A67871043 | |
3956 | E67680FFA11CA19668280E8318969BC0D79C9D4BA43BE7B2523B22938E33247F | |
3957 | 23B0C9A7D3B14DCADC575DFEB95EB33B95E9801A236E82A8AA7EED0A2C9DC58C | |
3958 | DAA4A7A40A1967713983AC17055B310E4720B34DA6D4097264CB4A6E65DA5F72 | |
3959 | 1DF86D980BEDE79B702DDC3E600E966210F711E747B22C9C9BDA17F6EC4E9C24 | |
3960 | 7982AEB524484C9A2D33E4DD8D7CEAA4CBDE41445FA9968C78343A6D85627359 | |
3961 | 94BD1CEEA272964682FE4783A590D8BF311925F76FF21D6C4F181E254D46FDB9 | |
3962 | 586F664560D3474A39BE0044ECD5E069B97CC19EC81118B6845EC92D167A0117 | |
3963 | 84E5213875025198BD7065B0160239A20735A2D993684ADAFE681C096B28DE5F | |
3964 | 6915B01D680C091A7A2F6B6EACB8B1930385DAB37E7B10E10030D8C1037827BA | |
3965 | 99215103EFB40DF5748762823D7A006A10FC7E3247A9C80C5AF60387DD6E78A6 | |
3966 | 288FEFFFCC7FE7E0E164B7E83D10292CCC22DA046600E9D64624D7825D9317B2 | |
3967 | E53FF8D6A23177DCE71242540D4A3B2D522A402E464B78B856EB040D0AAC5E5C | |
3968 | 5253777D4FBDCB87B70DC83E7C6D03D9374A19B5A234BB225CCC905DE3DFBB96 | |
3969 | 48A8A0CBBF6381026897C53837A79B3BD921FFF51FCC20F6FDB005BF4F9B707A | |
3970 | D0F4D97311EBF32F746AF9641AC06F8A858209EC9294AB9EDFF667FF9341F3E0 | |
3971 | E70B6BF2A7326DB1D78527D30C040C8F8FD582183A937021BAAFAFB493829E49 | |
3972 | A381C62843B4E058EAD501971684555C8D0266CF5271A919238CED1B967D7FEC | |
3973 | BF62D634F01960DA58503433F0264EA735D9BB9B5236A0E2AC257B0B9F87D424 | |
3974 | 17C8E51AD1D0F180CBCCE2D25FB2DB840F13E95B589E2ACE8D28DEE5FBF906D3 | |
3975 | A91357986244140CC4C01D0FC5BB7D74D01E28C1C230927194257DD387AAB4B2 | |
3976 | F4AD3443F07E9AC489FBA01A4B71EA0AE60D578FF7E5D6DFFC11F704A5B24ED0 | |
3977 | 8415507E53F4ABA42EDF5A75E74976115F48D42DC59FDB47B7E5C3C84D07C221 | |
3978 | 9B3D804A3B987B85B88AD29C86B3AA6DE4137F8B0E403FE0E0483A873071EBD0 | |
3979 | A9951B3DE925AC92E57939FE4CE0BE11DA975A8DF214E53CDDCBA5E9E8911EBB | |
3980 | B11CA565493EC47B74B2EB88396CCA83433CEBFE8683A72ADC56EE3F0434B948 | |
3981 | 86D8C9D149DF468FB602C3C61210B20F904C2016F7E9224536468B34E00A9C7C | |
3982 | 0EC3FC06075E5D8472761E935F83A5E0D35D7BC8748ECCA928A9F10AAD8B4BAC | |
3983 | AE006BA206462352C6E1C3EC96D7FFF2425A73976E3954BFD43018F97C58F013 | |
3984 | 1199DAD9E97021E026955E8E1C6CFDCC641007032631113BD07996623EB31685 | |
3985 | 4963BDCF8C324D7A5FDC85E54B4CBCAE58D82F08B6ABF76AD6D3A85917118099 | |
3986 | E0FEE836292EB04F89259B12F92881A9E2664609BAC293E43FD0554E0D0C1959 | |
3987 | C53120573628D96FDDDFC7164CC014BD753C8318D20550A14C8D7B0DAFA9E24E | |
3988 | 94DAFDD818407AB99EEF38F1AA32323404FB6EE025C4C1DA4E6441BFDA568A2C | |
3989 | 96FA853B52F0A0F42BB5047D9AEB4221EFF4D016C17C52ADFF34495DC648770B | |
3990 | F929820673FD4AFA144B077D0E6FDD5FBE3CED5E873474244988A065B66745E6 | |
3991 | ADD5AE225FA11766E0FC6650F0643DB7788A9FB8DEE0DC9E1636046B5DD23AF1 | |
3992 | 3B9A9C0FC4A956DFAD610EC24ADA15E5D8A27FC0F2B6B3CA37962EACBCFF5488 | |
3993 | 6F89E9AA065F71EFB0F8F445B777F10CAD08EBE6CF3AEEDA0A9C434BC4D66C6D | |
3994 | FBF410B1522C7F40E6F44B5F4CD5C4E3A391C7947C9E2CE6B79EE0A640FD9826 | |
3995 | 484EA383A96339A15AFA274700425559A2A185CB0FB31CEA643513D898FF681B | |
3996 | 85BF1910887B4EBE8BC4B8B0C1E298FADCD5C79E19F1607DBD8DDC10C2147533 | |
3997 | 425093D1CF3858DEA8C29F3B551AA10E86F5CA78C24D9DC2FEAF0CEF9A6B52CE | |
3998 | A4031CE32323765A01755D375CC665FFC65D6327A7147417B8DB659D76C3D1F4 | |
3999 | A6084EE40D9A0BA85A7CF164AF3DCFF32AADFC1D7F4962484B0CB57431B5DC14 | |
4000 | 0F907A5F582D325023B65EDA9AD1C5FEE939D24196218BAE0B2FC16830282E19 | |
4001 | 2BE9B8B64DA766E087DE77010BDA7D31EDE219C0E252A5E2724FE786C3BE4AB8 | |
4002 | E48EFC6047C2B133ADBE43E82B57F0640FF5DAAADC39A30FC98D3CB62020BFAD | |
4003 | 05545B25851322FBEFB027B1FA4C4CAB2BB4B52E001724460CC0C359F9737A31 | |
4004 | 1C9253EAFC50DF77B6F3C9C251ED271AE30CC51CC479BE5DE2D6290F8DB508D1 | |
4005 | E92E80DE84FA2BD7B21D3504502F9F64B63388D5120C8851AAEE7FE878482D57 | |
4006 | 461E0CA6D2E694948CFDDBCCA5C1451C0E5DDBDCBF5DAADE4101561A983BEDCF | |
4007 | 6BF9E92F8941C5890CB026850C1588AD1938185F1DEE52D54D5BE98BA4C62782 | |
4008 | FA273E9FBE8B6B15B99C0C9824C4A4F82A24DB38BCDD2F09288D68D6A6588BAE | |
4009 | D66378287202D4B40CEB5C230765C6A3F5BF0979801937F7C85766A0AB8B4F08 | |
4010 | 3CEDE7401BD3F4C041C5A5F23B755F68C67EAD6A8401F96AE9D0D4CC5164F59D | |
4011 | EAF9044AE89B1864AD6792A34BF3F791E06549FABCBE386A158F5A2BB5B808D1 | |
4012 | E0DE5172FE5E8AC13195D474E67818FDC9E7257DF85702616C0AE0E4E60590A4 | |
4013 | A75DF1ACF5F07C298BD3A676A15FF2A64742568A9CCFF589ED8CC2121633B0B2 | |
4014 | 9067BAC92D6F69D94904F00A413F524B9DFD59F05711B396BABA68178A3E8D01 | |
4015 | 7368F3D3C8A694B5B30B67DDEDEDC62F92C0D53C04516AAD0B51EBE3AF5BF2CA | |
4016 | 11C4DEDBD1E9FE0E65E11B73863967A4FF7FCC6C805A5AB76F3B8C0D7687EE34 | |
4017 | 8E0573514D99E5E5FD2FE200E99AFA016421485BC2835BE20121EA9426BDFE04 | |
4018 | DC57E62AC2FFED33C6A6D75A6A5CDFD69BFA0185D2F45E0A5BBC3EDE2C6ACB80 | |
4019 | 4C9536DE1D4297B5D18C965EB2E513AAADAC9F56BA5D7456C9C557E21201FE55 | |
4020 | 60DAB1D95F9AF5D7D123A50706761F6F4E0FA550CE6C67FC6DB317D037A508B8 | |
4021 | 23648D896B485F3B1D0C21299E99AC2D54A279A959270024BCCF547455750888 | |
4022 | CFE3F656AFCA7817A2A86115C807D7AD8455772D62C8975D09663901691A5EF7 | |
4023 | CBC370191EB4945FE3BCFAD6F6E5094ED6C544F720406E7E30892656BCA1F589 | |
4024 | B7BFB3402A10CD20671DF4824222E405FA06F72DA04A475C869F2907B7497C4E | |
4025 | 1C0879145DC7E0AC8413B23CA86BCE45C225748465F03D4628708ACC998C1BB5 | |
4026 | ED5962F199A94FDB5768A8DDDAC5BC5DBCED6A7849D9097E6602EDC167812A98 | |
4027 | BADB3063B34C7A1D8202EC31DBF15477C73283958F3A0C5E947D84BA220A54CC | |
4028 | 7E3600EA6C15D9ACA14F1C4CAE13FB4A126C67801AC73AD4958A3CBBA7030C01 | |
4029 | 2DBC955150F4247A6F82D061D8D3D7A77F3645BC597B16D0C08AAB3AAA12BBFB | |
4030 | CADA03B79492676550934B0A5F491D407EF0D3DFDD12327A35BE575B12763352 | |
4031 | 4E5C3171406350CB2E77F72C1BF871F1E65954A19A5BD59757942DB2C1014E12 | |
4032 | FB86F381FB40978404A2E05896093B000800C0FF8436C84F3AA47E80322E9E46 | |
4033 | 89300072A5EC1FF1FBB85A9CC559A58F0219D7D7A40F9F93B0A0F62B31299F7F | |
4034 | 6C1EF2CDA9DBAB5F82E14EB2E4C286A8B15DEFC4CBB85926CF5EE3A7655B9CA4 | |
4035 | 744FBB0EB5EC121722886F942DCCDBA5432CFA52BF760352A9DC228E6EEEB359 | |
4036 | E32A03072BDE96D8504EE3A1E74E2623CC0E8F930CE82A6A17ED091B4E9F3966 | |
4037 | F9082F6010B20E22E9016B0659EAE874B03E0521BD0B22810B2F447B8868AF10 | |
4038 | F4352DA9A3CBDAA1D36350E172B774720BA0C018801309AED630564CEF742E80 | |
4039 | F8475A0CC1DDC16FD131C7F3021D70F47B5AD9060625B29E4FB610C3BEAB90A2 | |
4040 | 290016C6D048114093613F9BEA595DF4BDAA2B8ADCB510A72F0E92CEC708A79F | |
4041 | 093BD179C6478BA462B62A31BF9E8D0991ACDCC144FDFFD440C62168707C6E69 | |
4042 | 1A4D410BD213D45532ED4E3AF0359A49AD90DFA148C8AAAE58935EF481769D1D | |
4043 | 2773E93E4333DFF0672105E768D0870A027C129212CF9D780024C75F237CFB5E | |
4044 | C765E6AC6279BB5FC9D436F7F328F85D6925F825A96F601259AEC22BF5EF10BE | |
4045 | D524C90F3D5B3C74396CECEE20FA22F4D5AAE8ED4624DD1678A05DC8B21C0FF3 | |
4046 | 9BACDB7CF12A45D7D2FA8A13EDE7FBA91DC7DC770E56C7CB864D43CF01543F45 | |
4047 | F586BFB542B22944AB25D731CB4C56BA9ADFF295F50A18717CB682E547ED8FA2 | |
4048 | 3D533B5B371F089189572755F5A01AAAE6D3FEAA723195ECC0C069FCEBC750FF | |
4049 | AD34DCB8DA37C92BE80252D8B8A506C1B5ABF3C47E75A8E58A672E398718076C | |
4050 | FDB2F75F6723A762FD3DA0D1BBE6ED287FB5B0C6CF877C6DA06759B0718045EC | |
4051 | 6080920A2030ED955A71DA3BB874EE58B69AD9919F7885FDB4CAB1DC001DD665 | |
4052 | F01A562B146E56E0A0270D634D9E3CAA9A11B19163A99D286095A6AD809F25CB | |
4053 | 64913FB20266BAD050EF759CDEFFEFAC30A8FD0D4A3E9CB280F6AD012CB348B4 | |
4054 | 09AA0CD23750C2C9F7AD23D5DDD514DA96D63ABC3F2E073B64561BA02B8DFD46 | |
4055 | 6CB1A691B18370A6ED126233DBC4DCA6C81B455543BD707EF9D6B960765E3ED3 | |
4056 | A8912C207B1F4B76B22CECF203FE5756F8E613316776687A1B2C9AE9BDBFDF7A | |
4057 | 8A6AE77368F6E1C1591D07307ADBFD680165B2016C180D063F9A0612B5D1A914 | |
4058 | 6D44D00620F06CBFADFF7FEE004AD00DDA1BB5C299BE9A6016B87D7324077A72 | |
4059 | 5D176F4D024FE46308F0A45FE917E2E387635A8A1AD20041745E7DCD7E2F7314 | |
4060 | EF96142758CD4486AC3CD516917B7A6D53050650FE39D0EB0BB07493A4C1773A | |
4061 | 7AAA2FFB92EF05411F7989071E752ABA3806D8C89FF04CE537DAEC5D156B619C | |
4062 | F01278070941EA7B4DDB11367BB5658FB8DA26B02BB41644FC3204F286987256 | |
4063 | 83013544C5ABA11A0C0D6CC2BF268B4A606C321BF1A16C2D125EDB73F00F9E29 | |
4064 | 8B3BB482BB62DCC0127B7D3B1F978FB1D172DA3EF0453243B0E67EF48AD4DB84 | |
4065 | BDB1BDB9CD752B76B601BFBA81C8F868BF2F7EF4FAF1C9CB5F410F5031CA8A72 | |
4066 | 53B5654189EC484C69624D013B0873F4DE118088581BD133DA02CAACB6634959 | |
4067 | 6FA9B9D491BCA7AD51003523945170B2E64CF903DA6F10E8A85DE4E9E2478B9D | |
4068 | E473A5E9CB0AAC3754A3972C52A3833DA7EB7ED200C9F02AA109D20419534B31 | |
4069 | 9C929D78239285C590029052BEE1CA289893CB3DC1F49DC0101316188C1DB0C7 | |
4070 | 1BBFC04FAE0BB6829E67E8E1DBCDD71AB69E4B9A16BD8A76B696B5CA6772133C | |
4071 | 00F32E0CFC02553AEB9AB020822602693C0712256A1A1A77BDBA2C4D27819034 | |
4072 | 5770C08C182BC28BB50F177A14CA722EDEEA74CA7AB052E05B1743EFDDC0412B | |
4073 | E5B114D19A9BB159D65452AF62A986E2EC6C02AAAAFC22C7CB8322A597E967B3 | |
4074 | 4F9F25791BBF622D81FC25F7ACA0C21B882E857520EC45408020F8B7CC84B383 | |
4075 | 2E7E8252C4A2E605D3279854F4B234473F86E859B59885219182B165B4BE71F1 | |
4076 | 62B8FE89EE84D0C67E5608FF13D1DF4A1C7E4932463EB52AB14B0F791CC5E9F5 | |
4077 | E7566B48AF01177AE5A97F43E1D9CAEBB84D15F40618BC14CBE056225060A42D | |
4078 | 9BCB36A6E4AB567E41FE6D99245BDF931E9AA819CABC224E8B94D9F24DA95973 | |
4079 | 3702A9D78B00AB41E5E2EBE2765AE1A2233A08EA6B795DC6DDBF0E5BCC0BC0F0 | |
4080 | EEF78760C3BB3B66936D74BA33BFE63F72DC5B14BBB0F899EBBE4F8614FADA4E | |
4081 | 26A12088CA3A7B0E6EFD496CA7B5395A59E27594EACD67A74339C39F2E7D3524 | |
4082 | B0B4907AE836B1A62831EA329DFD8FB498FB960E23C7735165D75C50D499C4D9 | |
4083 | F1460B2E3078A257827BE42E99F1BF3DB9696906E36BECBC21CA9403118BBC25 | |
4084 | E1E41431E92BD7F40D3EA271BFB74D25909155C60AD3A7C5AFF5DB16AB60C907 | |
4085 | 7FF407EE593FB3ED2D7C82791934893A0A382C943995C10941A4F57818B0FA37 | |
4086 | 94F1D12BC888B668ABD18640DA55CE3AE0C07B11C545B02C79938CD01CE6685E | |
4087 | A1D82862F6973E1AA906E0EBEA21BC5784716F79CD807A0AB4375DB46CBC22FF | |
4088 | 03CEF91E01F794B548A817C626B0B7F5A510700931FDAF466136460A8ABD7E35 | |
4089 | 58D5113BDE7030BA6FABD3CEFC98C07E4E56214170B6B58C2B92D410EB7A049F | |
4090 | A0027095A87C13F84F9D1B789628ECC22611535A23787B3118BC413AA46FF8BC | |
4091 | 2378CF05B2886237F22409C4FD5FC3BC8FC0D247FAFD3F73DD37F62A92EBC32E | |
4092 | CD6C3F9D09CDCB3B455DD9905962A808B2ACBF86EFC1B77BD668B6562266607F | |
4093 | F84C42D7C3BB8224E20618D4FC975CFBC61230B85865CCC59C7F7A7A46DDD97D | |
4094 | A4D76FAA3F4EEAA36FD20430C153A633AF5ECEE95CAE75D3C4A0AE7AA2E91DAE | |
4095 | 6FAE64A1585B6906E0F51D8FB108F425882A033464895E879631D70694D4080E | |
4096 | EF0AC2337DE4DB985D1A66A9716387EE1605F1848A2E2C71F09159C13CD2D9E7 | |
4097 | 56C43A3DA0BFEFB8ED79E897F297B11920DBC344941749293958C56278E16754 | |
4098 | A45F267B2421183F7499C8983A6C5A8075EE9B820C2410E29BD160F6C00078D5 | |
4099 | C57D0198325AAF84EA41FD60BE2CF64566DC31B50420669DB80F9EB84D9FA360 | |
4100 | 045509F2726CA70F8F8A18BF2F02AF5D4B2E27180FFC326909F3596E5C5271AD | |
4101 | 22BA29D31D37175E3A8983E560AE31E3210B0A87B6B8432152F396825A2ECDDB | |
4102 | 969544A94C3EAEB537EA22F8D02BC113133C561CD552946C398E4C37B12A33CA | |
4103 | 803AB7A78F848B11BEC667E28E72963011287E34A58A963CB4E73054BB88032A | |
4104 | 65265C86BDA8E879CCE3D48BDDBDBC7098DE7756EBF98F2363DAD31A4DA2A12D | |
4105 | A81C0CC381A6FB4CF4B46CD904DD543689B6AAC6720AF3A851AF9AA4E7C0F166 | |
4106 | 8A3864F51DD2F5670C45023B5D330757A71C90E22BCB8651EC73A7FAA2721A8B | |
4107 | 92D26022B2C0297F04E90EB871D7AB7BD236CD1FCD25D48FCA2F8073CBB233ED | |
4108 | EB6244F2C7E4EB68590795EC2F8E5D8D02FD827460718EAE728E773D9F3EDF14 | |
4109 | 7EE7BE7ED28BBF203568F778F70888E6805044EA720F47A7B4E963C62F4F465C | |
4110 | 76EEB76BC36D165A70DA25A9AB083F9446D8BC197E400706016A12EF34CEA55F | |
4111 | 9D63D9620F6FC71CEED862683B2F01F9E0CD353CE5D95A6B4E07469433717DA0 | |
4112 | F179C3A6B4DA0A7A9CFD05BFB6C7814A9B66D4376DA678D4A391DE59690C0215 | |
4113 | 19DD54B38A7B7F046EDC03A7092C6B9913FDC1C3E23C785F6A755DC9476E9125 | |
4114 | DB971B22C4D4CCF0C23A93ED8798A3D5260A5C206B5CF4F4A9471FCB6C925A65 | |
4115 | 1A610E5F6CE6A8ABFA5497E76BB5B2FD852627C64A12FA088045039C37946EE7 | |
4116 | 494CFBE9613A15827FDDD365DB6E0CB24B528DE8BFE5D804FDC47A9BEAA07421 | |
4117 | 8E48EB0119A67946992405F2F7834B19EB802A7FFD94612C9E66F56F9455DF6F | |
4118 | 06D1108DEBC8EC112D608EC57D3F7023781A70A34E826C349B934665E6B3A77F | |
4119 | 3D610B3E9876392A43F5CFF2FD3CB5B9C1BBA338C764512418B9B0738B55990B | |
4120 | 0F633141C2E4E79D4F3AAE449AED503D376EA16343F55419D48E812F7E4F1F52 | |
4121 | 519F4B923C1382E5084D0B185D1249EC6206D1648A35B17F8EF45A3328BFC6DD | |
4122 | 2D8EC3994EFAC71D8C5413543A3CDD3656EEC958799AC24DF9C3DCD59409D215 | |
4123 | 39786030FADBCE8B9D90AE1B9A9B9674F50384052998E9A5258C382E3A4F29D6 | |
4124 | A1A251890CF5BFD1C7438525CB38C600AB59D6E2C27203A25238F741C61E954A | |
4125 | B25A33D747CA6C00CBF5AED2D8FFF33DFEDC3CD717FCCE69865252EFD6B17ED1 | |
4126 | 344533B87F933F3AEBD58364047CAF7DBF95DDEE6133D009D10D6E402AAC8494 | |
4127 | 3DA2C3BD728272EC1CFF3397A20B217141DEDEEEC34F178AEE64D457FFCBE41C | |
4128 | AEFD8FD08A3B1E9F7CEFB2D60717407BC472ABAED13B8FC42A702A14C4042E0D | |
4129 | FEA2E3343169845E02356B6286BCC4772275B033D105B4FDE6651D7B2CDA05D6 | |
4130 | 62F7C17BCB390205A0EE730A146DE3FBDED3C1ED9A01CACF9341582BA552F758 | |
4131 | 4E38CC004A94AF909859E4E40B81067E3622034248D1477267D19350E5E56243 | |
4132 | E31E69A878D41845DF38B9B9429F58E13EBA1215D2AAC277A801667300140156 | |
4133 | 0F1AE36E437E4AFD755518688DB56F51A998749B5F50FE5A5265D659B164766B | |
4134 | CE9AD79E5BC01C8DDA3562E988648CEDC78F95BEE4CC95F5E387F1D41B1EE495 | |
4135 | 8C477265138359138022BE90D007E03261524F741FC1D53C224CFB4EB090BBA2 | |
4136 | AB1E1F22B39BB4F3088CEC582DF10F267CCBE6B2C0FA16453965BF9A04DC454F | |
4137 | 548F744F5C2E7328CA2A005561DFC19F2ABE6141C96A74F99820DE87B06F6135 | |
4138 | F16BF169C41F1E1496E10B4AC47B7A045C8D4FA164C5FD8FE86821785372D177 | |
4139 | 427D628FF391F13125C2C714274E595B4EE6CBD53278E0DC5E6E0073BB2211D6 | |
4140 | 671240041CD12443B683098F666EBE4C61D648F8B6AD2BC361136AC9FA7B1868 | |
4141 | CF3F5A24C6A5AA1FB2CDD2E3F7A0F2D50C235ABAA9E6F4E1A7084AE328CEEE01 | |
4142 | B698AB0DE731A8E7CB1F9AD9B2BEA94F79A5C2DE587C394A8F5CBB5ED7B20653 | |
4143 | 02F978EB0A5F6BAF1683EED4CD35036DC43BCF4F124DD07DCE3D76C75C95D758 | |
4144 | 5634E03C6C367549CF51ACA9DF68966B38EC2B19ACDD381B1D66BAD5FE899A85 | |
4145 | 594081D43574F92D2FA71B96F59E69018B02FAC6511BA8F0F8C727FF023D3803 | |
4146 | 474EC2023D0F9DAEAFF4BF17483CDCD2C48FBE9FAD0F48789846911C6779A481 | |
4147 | FFBD8074568DD1B1084365F88695B9956639F38BDDBDC3103EF19C3FC0053F18 | |
4148 | EB179042215E7B09FF4773D5C56AA8CE4B46860DFFC7BEDAB48C001FB9F20749 | |
4149 | 6BE32B9C4A83E6838F32475034C09D7351F08E97760494B4C39B9BBE31859E8C | |
4150 | 77FB4E70BFE87E14C5D471DA9D3F5D4134615B1620EDC80A5494191237801B14 | |
4151 | 0F866977D48B5C8AB9E71EA6161CE4DCBE65FE7078137568EB63164A0141CD3E | |
4152 | 7432852F0CBF1B4A2A9D3FFC03E9D310BC2DA4AD6C8A957254B76F1A32C3DE5F | |
4153 | C9F297C301297304284F9D5E0B1C42AE850660D86A3A808845F6FD3DA6A7EB68 | |
4154 | 54B571F078B7A63AE4A3695F9CB247D4DDF7921A48573D0977F17AE74DDF4214 | |
4155 | 6EF545E53B5D9E04FD92F0B0F816CC85F9C9A987E2812B8CA402BBA64B259AA9 | |
4156 | A66C05382D696C42432B591B54E94128513E39F1758F4215CDED5C7F5DC100AB | |
4157 | 16C35A213C7F1C83E429BD0143178516D5A77E3CFD0400CDBCA7CAF1854C2CFE | |
4158 | 495A2D12E7BAD84D7D5088AC5B8E9D830A7D6129DFF9B1B6D82064C122B613CE | |
4159 | 4BAEE07A2A119AA496625517002C82391B38DD6E2B494E9381FD69FD90516D26 | |
4160 | 512589EA62F1EDE7329705BA58C67A882D8788D481A5CFE3F56DDC27094E1DEA | |
4161 | F65EBCEF92D4A24002D8BEBB38B258D2B483DDB994D7AFEC0A79160B27A887D3 | |
4162 | 50FD6DDE0AAFE2CDC07E95FA975656AF0C1771AB7204CCD49C97A142C3303317 | |
4163 | A7915465EB8E52E3158120D9E62E7CB5F0C73D6DE8CB8348CB132DFDCF45FF08 | |
4164 | 2D5DC1FBE95C988C90DB8497C3737D1E4680AFD5CA2CC98139583F6A07836DD6 | |
4165 | 382B84D038C33124CFBDF80DC1CBD1BFF5BEC8F82F027F4F41E19A0B222B4DF7 | |
4166 | 2DB96842A001074E5703AE78792BE8CF1759F3AD4785D68D884460EAD63886C8 | |
4167 | CBB32CE7417DC6482B7694874140728E9211FE130ED7AD5C1FFE481E76A7BEC8 | |
4168 | 6D8F82C0A13B89EDDC15D719BBC481ADF1AA24A4052018799BC08D26B62B21F8 | |
4169 | 3F4D37CBE73AAF9112895317E4E3D39865F683997ACED55E866729066D351C4D | |
4170 | 6306D05333785D2C737FFB560BA4146B13D03F01B1EA45059B8891624EBF7F66 | |
4171 | BE574A7712C9E9CCF3CDCA645F07D74E194D3209E7F4ED938BB378E5FDEC9FE7 | |
4172 | 05398DBD8EE62434A4E57266D554395F8749A1A12AC33D0E70B8F93F56A41630 | |
4173 | D5F0C387207D16B5FB04AE79578959416D53736319008C76BF6BC13EFDF0DF0B | |
4174 | D088706A73843497EFD4DA15059814F5AA43EBEE5D0646A28654E1695F8958AE | |
4175 | F13209ED4EFF6F14F51DF927BB713774E61CF74E638D6442FD59F6BCFB7062D0 | |
4176 | 5986C27671428E45ACDDB6C1A06E8C90F4CDFFBE60A7115351356C5B4772ED0A | |
4177 | 8427F065D3E86BBD9DF604190F15325632FB03D1369DF2442C3F60E80CAAC7F7 | |
4178 | 76ED39BDC600791D956694419242018831F607239610CFA7EDD2669BCC66DBD0 | |
4179 | 7968732B94C613230264C67D42D18B4F1F33608DC9CCB3D3E22620FADEEDCBA3 | |
4180 | 49E6898235E7E6C0FE05910834C2A9C48E181F73EC7B016DB43FEDB7C81DC72B | |
4181 | E73F7F6C07518D9C5CE6ED62D94CDDDB6B49EE05860480625E63E1B212F60BE2 | |
4182 | 8D9D5A371BD0D3DA1F23BB59674510D0D1252F70330F964345F63683615CB959 | |
4183 | 6AF85AB38B389E75A402B41AC02397DB6563E5789F07B1A1D6834C796A9884E7 | |
4184 | 4A23CF00041C4A307CBED62CC5B56187A237007DB3C9A4E84E4BBD097B776EAF | |
4185 | 854B977DB99888F2AA7ACA75291FDF4D36DFEFB4E3D8395CD7E15FA4F2F0D949 | |
4186 | 498352685B5B744D667CFAE48D2F865C67354A8BD4D808D72B07C0771E95E000 | |
4187 | 3D648274AB79350D70A4D046AA5DC76686C82719F3688667B57C1912F6CC6066 | |
4188 | 88FA20D211F3BCD27653626F3C3FADFC10DE826CC1812F61020E3E85C284FAA5 | |
4189 | 142369B6D225D322A075DE50BE48C3686CF72E9839B0105815196E197D9FD183 | |
4190 | B3BCD30D53C8D8B8A5002E56B7B5B768CEF6DAC28ABDDBA13B2415E4C3619F39 | |
4191 | A841B058700CD22F4F058EE7DA3681D16C129BB3D4B876E702C0FB1DBC053E33 | |
4192 | 564183AEDAC340519E7983D2C074C12448AE5C9D50C2FB1F6353EBDDC099C567 | |
4193 | B2902DB6B7C05D5529A7B7B8F89AB0B83B7BF1D8A9139D6F191100FF23C86373 | |
4194 | F9E06C0CD0AED60A2CADB1BECAC35C0E37F938394E3C83DB71023EF8301965CD | |
4195 | 327D4C9A236703C05F7496DDAAA01B0745D5368FF6137F1C51F5AE0579715E0F | |
4196 | 56AFD7BAF3887D05769E6C0E5E5B962354D939802E7CB3129B2A1B9F86EADE5B | |
4197 | 216A148911C4BE95FD0F5BA036748FFE9F810116BACAF70E9B571E061165F49B | |
4198 | 74E068D5329E920B325D42552FED5126EC257A964130E56C9503A7EACC531482 | |
4199 | B532E015CA121D94941865163689D05AB0AE79687F4C6A4D213728433FF95965 | |
4200 | 69CD7244212530C7A163305709371CB3821CF527A83DD1594D51332E8942ADBB | |
4201 | 8B22D55C9F63B59B66F944A4264CB480236C83FBAACF3E77484362CF09DD12B5 | |
4202 | E55A29C4A1CE24D9145DF8682818B1C5DB1F3D70A99664FD7F33A275E322FD10 | |
4203 | 59D4CEFABAB45387B2CDC780EB726F45FD16DAE62132D4319CA9078436B45189 | |
4204 | D9BF390C72215E3D1A9B57D0BEBF0FB25838159286AF53F4A0FF1BB61653B4B5 | |
4205 | CF8251590DFCC8BFFC6D79746F475DC891530E75F3B3999C8278A829D80770B2 | |
4206 | 77D55F5C0C060BA1C3A8B20D299BF1DD89EB5C92A526B388C153DAC5C109BFEC | |
4207 | FF54697ED1AEA20335E9D5C2352287212817068B0B2404E5E6BE6909BA17189D | |
4208 | 58B1E3AB0CA4AF9629DCFA97E5F279CEE27629FB59CF681A2440713EB50276EF | |
4209 | FE30CDB9F23A1ED2C6DE399D1A86C21DB7ABE963745A5CFBB8832511CD1580C3 | |
4210 | D4434A14A16C862CEA36005A4104D40EFCCF25F9DE081B9709B3B101604BC0AC | |
4211 | AAD9AD8C88298D4B8CFE6C8FBBDF876BE5AF40F73F7C7BAED2774547F030AAE5 | |
4212 | E84C09B6D8231066F7B1E8E306E3803852CE65B67F611076BB8DB49A5AB12FB2 | |
4213 | 9B2BAD84E95B8D9074C8E7CCD4C2FD95B8EA6A3511CCC529A6DABFC12F4F4892 | |
4214 | 597A7D6D1348A3855E3ED2404DA0A105D137F3BA9F2BDA1DE79018969EAC833E | |
4215 | 7035C6FF4046077874DB2D158888E051BFFC2EB60EB35DC494FDB1E5A4F825BD | |
4216 | 4B695F05A1BDF37AFAFED3AE93B40B242C5532869CF7A75CEFB11F0B22140D71 | |
4217 | 5568AC13715DDF6F7034D0501F92290FC246DA690EA1E403CD33099A76D7069F | |
4218 | 040E63A630A7EE329167A44965F6FC50EA11A7590CDAD389A0BB807C96236441 | |
4219 | D599B6C264069276F20CEF00A35C43C238B0080D59CBC6779491734701544DF6 | |
4220 | D2D68850784A887E362B3564E1F777361E9E40D80A9EE7248EB692401F485D62 | |
4221 | BA41DDF265E185A35B6A36808A6495F7314BE12B4C07860A86AA784D8C46779B | |
4222 | 61A43D0307283298AA7312C6D45939C9425CB48DCAB45BBB8224F78B3BB58B1A | |
4223 | 13B7C333AC9BA3EC1F4614C4BBD08093FECBBDFB7A88BB37EA47551D87E0BDBD | |
4224 | 80652ECCF25174F6D07D849B45EB1AB793D68FF878A470F393F2CC61D0A5C60A | |
4225 | D3F78CDF9A6B7CE32A5ECEF01C7C9CE19FB8CCBC908E9240D752DED90D2F3B3D | |
4226 | 6C542EB12D5ABB5470ECA1C0EF709CFA6D1361FD237B0A4F39FA9C32221F7198 | |
4227 | 6C40B4A6BEE3B6989CFD72702E263411B7ACF3541CDA7A2B5A9E03D83E2596E0 | |
4228 | C20470481A590A6C8078D60E5343D8692B404B60663A2368416516FCEE2F7E49 | |
4229 | 50E80359B85C250A343B88387F32EF38D6C2DB2B3F3BF16B3A848CF5AC13F992 | |
4230 | 8E24B3EDA7C7BAEC90FE62B118A170AC576C451A143257215666A3F3FD2A2F3E | |
4231 | AA0EE89068F3074423D07C14FA407DB6259CE9677D4607127B49E486130913E6 | |
4232 | 90F71078F052BF0F1D08768693BDD7F34EFED92FCEF87FBFC9F4BDADD8118ED9 | |
4233 | F13DAD900F57A2391895F8F93562848005A0FE8D9F7C90F959D80614B5C56169 | |
4234 | C5AC0EDB28B9019D9695E0A4FA21538C014D0CE7A2F0A98FE71133F4F09213F7 | |
4235 | 858AB9FB2C26698BDFC8009A30CEA60F8C640251ABC3451A3F2D873027288C91 | |
4236 | D493BBE6D66E8ED0405708C11B5C0A74B4764303E8818AC807CA1A3170A68336 | |
4237 | 1DC31D6E08284C49EEDB866A0AB7EDFEE1F09B2B85B67F2A35B0F13C36488B22 | |
4238 | 08A68D1726F6CBE076BA95EE4D286E4DF8B5DC70C67B894694AF20FB5C1A45D8 | |
4239 | E5BE1F026B17022D2684820F2BF0084F23D4F48DE1264281550FF7376ADF1CBD | |
4240 | 423F1F8D80EC764C6FE3BBBCCFD97EBEFC4FF8C09D1B7BD07DB426BA3F09FBEF | |
4241 | 2F3F3E3C8323953868625B0E5FC562ECC736D6DFB5C2AE5B2AA8EFA304DD5A0E | |
4242 | DAD0FFD27FC061A6A5BF0D3305216799F438AD1BFD5A0B971D21F6C0052607BF | |
4243 | 0244F5E90CB800FFDAE0582D2B8F49C5E8DCDCB7607B094545157E42171DD390 | |
4244 | 087DC5FC53A5A1D4A42BF444A796B76693E499C550729123BEE8A0CD5C1E4F85 | |
4245 | FE01AE5671E324A15B384AA5015358C4F22E0E54722B12C8E070FEEA8FCA1CF4 | |
4246 | 5333EC677B24AB1F4049C2F7D8A629DFF3479FB7C024E2E6333D06E7A27DDC6F | |
4247 | 476CFD6B7BC429783D9759C5D49EBBCE336023835673FF54C920806C58AE6D8D | |
4248 | 4C9414DFD0733F9DE8209A4E8E17191FD3E9C059959458A0498BBA6DF9E338AD | |
4249 | AD9038A6BD01B3429C9487A2F2ABC7124CB390338396702DA0671FE52416505E | |
4250 | E84D8792E101F35FC124E95B0FCE7C21E7F93CD9D5970CD526ED575570A1846D | |
4251 | D257AF9E8AA4C46A9EBAEABE45F872144185BD2F8B3365533B7618950F3C8AF5 | |
4252 | 5B8824421D3ECE207F62A006ECCBFD233B4D40A97C58C48193A663A309477E0F | |
4253 | 88536891252680A07CA46706F9504F263D6D9AA1A207A0E2867C88632D833052 | |
4254 | 0E8D1105F75CFAE57A32601D97EF8B95965B490F303950EF8E8D07ADE6756DCC | |
4255 | CC8F246FDBBCDF16322301435235984E762EDF9FDD17B0A69A6A09125DEF7107 | |
4256 | BA0E6569B40B61174A161D420BD200639FE9627B4D4D910F264690B0B2B50A78 | |
4257 | A60863D47AB4B245DCEB5992396C11DE333AEAFCDFB7DE5695F4A06E800C6414 | |
4258 | 43EE404F68E6655190B9484EAB0FFE8A2B6CBADCA45A947AFFC66D5510184A40 | |
4259 | 2A0CDD5E00B2E91D338E33F3C732E674F52A996C1970D05437E051981120AAB5 | |
4260 | 1898395502D6A47076DF3EA7E9871AB0F24167E2A6D602C832BAB91A62486C99 | |
4261 | 8178A5C102066585374632FDD192991E310877CAA8DFB4579CC515BED8023300 | |
4262 | AC1547A49DFA38CEF13A21A0FB373CA97810A4362B1827265E4F8FFD8CA96382 | |
4263 | D1604610DDB80598FCD5BDD78E0EF43F1801ECBFB1C6605A4C16DED8A81B2C87 | |
4264 | C6C544B8E538A41E490633E3C7F469B6E46480255ABB9B58969A9E3F3DF31BCC | |
4265 | 08B5FB55484CA43C8678C67D8C4B471351E59C1F18C81344FE527C59AAE7B342 | |
4266 | 1AAF33C3EB428B9674C352131778FFDFCF2E7B1B830AAA153F952CA65BD64387 | |
4267 | 3659AB4B7983D36503140115D81DF0C1372BF518597A8A32E62FF986C32433D5 | |
4268 | 7BA33BC468C9AF03C47E6614E137EDA88014D8298E0202BE747D31FEC89E240D | |
4269 | 6921685A5955C7EB87CDAF6AF80FFBB4AFBBA869D5DD9DA5FD8831A5AF75E1A1 | |
4270 | CF521601C5B480445D91AAA779EFB79A3D2A204B2668E60A6EA6AF2ABE5E0082 | |
4271 | 747F8433F61E9A88675BD8BABBC02AEF296B52FC4BB0ECE30A8B4B5D72982C5B | |
4272 | 70EF4305D2FE7C0C6B16E52F7A2EE235725B0E81BDADBA4C8943EB2CAC86D4BD | |
4273 | 425CC9F3965D0C8666AB59AC55FC90BB9191DDFF43BB6E76 | |
c302751c CR |
4274 | 0000000000000000000000000000000000000000000000000000000000000000 |
4275 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4276 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4277 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4278 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4279 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4280 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4281 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4282 | cleartomark | |
45c0f7f8 | 4283 | {restore}if |
c302751c CR |
4284 | %%EndFont |
4285 | %%BeginFont: CMTI10 | |
45c0f7f8 CR |
4286 | %!PS-AdobeFont-1.0: CMTI10 003.002 |
4287 | %%Title: CMTI10 | |
4288 | %Version: 003.002 | |
4289 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
4290 | %%Creator: David M. Jones | |
4291 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
4292 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTI10. | |
4293 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
4294 | % This license is in the accompanying file OFL.txt, and is also | |
4295 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
4296 | %%EndComments | |
4297 | FontDirectory/CMTI10 known{/CMTI10 findfont dup/UniqueID known{dup | |
4298 | /UniqueID get 5000828 eq exch/FontType get 1 eq and}{pop false}ifelse | |
4299 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 4300 | 11 dict begin |
45c0f7f8 CR |
4301 | /FontType 1 def |
4302 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
4303 | /FontName /CMTI10 def | |
4304 | /FontBBox {-35 -250 1124 750 }readonly def | |
4305 | /UniqueID 5000828 def | |
4306 | /PaintType 0 def | |
4307 | /FontInfo 9 dict dup begin | |
4308 | /version (003.002) readonly def | |
4309 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTI10.) readonly def | |
c302751c CR |
4310 | /FullName (CMTI10) readonly def |
4311 | /FamilyName (Computer Modern) readonly def | |
4312 | /Weight (Medium) readonly def | |
4313 | /ItalicAngle -14.04 def | |
4314 | /isFixedPitch false def | |
45c0f7f8 CR |
4315 | /UnderlinePosition -100 def |
4316 | /UnderlineThickness 50 def | |
c302751c | 4317 | end readonly def |
c302751c CR |
4318 | /Encoding 256 array |
4319 | 0 1 255 {1 index exch /.notdef put} for | |
4320 | dup 12 /fi put | |
4321 | dup 45 /hyphen put | |
4322 | dup 97 /a put | |
4323 | dup 99 /c put | |
4324 | dup 100 /d put | |
4325 | dup 101 /e put | |
4326 | dup 103 /g put | |
4327 | dup 105 /i put | |
4328 | dup 108 /l put | |
4329 | dup 109 /m put | |
4330 | dup 110 /n put | |
4331 | dup 111 /o put | |
4332 | dup 112 /p put | |
4333 | dup 114 /r put | |
4334 | dup 115 /s put | |
4335 | dup 116 /t put | |
4336 | dup 118 /v put | |
4337 | dup 120 /x put | |
4338 | readonly def | |
c302751c CR |
4339 | currentdict end |
4340 | currentfile eexec | |
45c0f7f8 CR |
4341 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
4342 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
4343 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
4344 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
4345 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
4346 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
4347 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1B57C5FD29DA32D34C95E | |
4348 | 2AB2ADB3F60EEB0600C8ADE15A2380DE10AC5AAD585FBD13097B1A7E8E210D4A | |
4349 | EE96785449E07F0C8EBC2EC5EFBFD0897DFDC15E5BFAC9584D8DE95C5AB288CD | |
4350 | 8AD8B9BEF0B8E5F887B3B0B331542FC8184DCCB753DB6ACEEF98B85756B988DF | |
4351 | CAF1AE0DBE7D37D5F44A2E760AAE3A5197C27B15E32275A64946C3E4D0476FD2 | |
4352 | 7FDE148C788DD2106F7C825E270588AC05B57E625AB17BDD02306F9E5FC851DC | |
4353 | 32A5A6EDC43C770A71419B2C0C8074EF3F222C8A2097CD81A91F333A521B3A09 | |
4354 | 482A4FE1CB231CE344AD126AA284C3280AAC3AD162CF0EE241BFB4C8F20502FF | |
4355 | 118507F5D1B5FD898571015E73E5CF2281085072E00D401F6F59761EEC3E8381 | |
4356 | 1F26F75DB66C504AB6BABA87D121B1E7040A07AA2FE01F80DBC246CC03C4B2DC | |
4357 | C2A715980C52B7F96BC1A78FCC7F4F52EEED5F705E08FC1E5BBFCAD121FA88AA | |
4358 | 8EBE58172C162AF409DBB0728F14923ED02A65EA24E5D52B6AD07777455A70A4 | |
4359 | 61833D3789C719BA92E901232599767E423D5AD9C807670BE0E7B5CFF8256A20 | |
4360 | C7BF7214FFE0342809570F5966A2C43E784F35015D9040BA34FEAB6A6F089504 | |
4361 | 3A40A9E9D711A2721D3F4998371430FB3C94BFC619559B97D49627BB630F4B70 | |
4362 | 9D0A8FE4E916235335C3962F3CFDB04C4A3CF714DB5E260F4E66FFF2F27CEF2A | |
4363 | D4AA26BBCAED23B8BDC98F8F453BA27AD7758537561E766B82DC3032E92A9EB0 | |
4364 | 125D98A22C5466AF069BF72A9BFA052A8628FEC6A6AD0B711DFFEDE3AA2D7CE8 | |
4365 | 34EA487038EF50F953B8B4471CBA6FC3C53877EC1BC94582B1123EDF44B4056A | |
4366 | 30F49394BDE22CDAD7F01951C7013D26979277D18EFA594E8F4F2B5E615187D9 | |
4367 | 39E842EC28461B9ABA52020A127D2CB9002A673A435B13C10602EEFDBBA6BD49 | |
4368 | 9DDEAB9E68D655443A5C2492BA061C1391A51592BA8C353A6F6A0708E8860184 | |
4369 | 2B5D031D2CAB87D618E9F6F7A0BF3F66B3FD5A25BB91F7F1F5F99CFF56EFF4FF | |
4370 | 0A35C55658001ED2E97B26C869292F6274D433A5443179DBB8EE987196306348 | |
4371 | 3F9E87C6422AFFDD30080C9AC4EE7FE5E2DCBFEE4974331F4AAE479FD8806D4D | |
4372 | 9C2B85FC69EB0453AD827A1E767E5C484BDFBF5C8D6E2B3C96298B390F22D757 | |
4373 | 802643A79D5E29CF3AEDF0E12CFBECA4663444FC87F2027571DBA9ECF688BF28 | |
4374 | FF0DDB3AEDBA0FB28447CB4B5D5205F40C1E7A525FD7373392EEFFD910AC82D0 | |
4375 | 98E71660A1B3227C4A2592F3E853CA4CDF64DF19A52582E167234F4036FAAAB9 | |
4376 | 5446BE102DE2BF43E82F0112C2A20F15A3F92C6571AC761665A905362C4F8BDF | |
4377 | AC8705519C99862CD9C0D75113C4AB5FBB83C880E46B82715B5628890D9103AD | |
4378 | A2329638B95D93C4DECDC5E6C588C9D5183EE6FC28FAF9825F02DCA567306D93 | |
4379 | 5440987A81B51EE7291107A08F201C609FEF91A8F0587E8B13D4BAF74A5A6815 | |
4380 | DE9E4441F46AF8E1DDDFA2D611C889614040B144A5EC064DEE4638C04EAB2E37 | |
4381 | 4CA8F50FB8C4D65BB296DCCCD39F1F554CFBED96670A91F515CA10EF896874BC | |
4382 | 8EF48C6447752C70FF5A06F928DB55586354076773BFF7E94C4C3A7A1C1F421B | |
4383 | A9B4E3936EC26E0C19BBBFC90F021E877F54B62108F6DD1C7F6D5B8E64FC9362 | |
4384 | E173F01BF2904B7E5A08B3543611562C2714099DE7D4FA330DB148B560A9601F | |
4385 | 42A84452811CE213DCE782A0D7809CFD954D6BC1EBF2BA4D1B18F50FA8174C96 | |
4386 | 3E0120E266AD5DDB40B3F6798AC28CDC5C3C4BC34583528F5B5DC8A222B80B59 | |
4387 | A3A93DC715D061EC6915E6E6E21A25425C25E8747C60F170D61047108826F96F | |
4388 | 7830E220C108B441B6EA3198E33C49BAD8D43086E49F5A2BC7958A1A8CD011C4 | |
4389 | 49045193394696EC3DDD0BE084E8F2E9F0B9496F035C0DEC1CE11409DF566428 | |
4390 | D50043CFF5CDD1092F6E0807E660B68163BCA738E8D98FC6EE3F713164CD204C | |
4391 | 0BA84FFF4F33F47BC31750B448603D7ADB9AE92FA91AEBBBEC0DCD66980E6955 | |
4392 | CEB425ED07115B24E40F53B29B9D840842EAC691B4F591F866DF27556474B485 | |
4393 | 1C6F53DD72499847109B16C7093984A6B8487D4F3870DD517945CD90E648C1BB | |
4394 | 8A6861E540FCF9D75B984B5009B5CC760CBE297042C240DD624111670B703388 | |
4395 | 6FE6FC0E89C6B4C88F51DFF3913D0CC1FB4770C8CBEADD4B86393605C0B6C468 | |
4396 | 83CA5594754411B6FC331EF56D7CD6D247FAE42E966583C29239A8F862348D29 | |
4397 | 60B177984B6B957E733DB4D275015691D91443BBB13C2DA96097A29733CDB284 | |
4398 | 42F89C85A7A743338C9DD3BBC4EE53F695E5163E6E1ABE5791ABF100B198B9B2 | |
4399 | 1C21E2FA2FB4AFE7F9BB2D381260CDD3A2CC05BF513AA1E80ED69FA27BC5ED5A | |
4400 | 21445BF00BC2F997B356D94AF13736C6D3B0613EB6F4CD96A685FEB672661DCA | |
4401 | 206105EDC3CA07900676EB2FAB37F48D2E8207BDE1463894DA3C5B1488AC1EE9 | |
4402 | D39DAF691648048F5D7A384B8927F8DA2BE3602669F71D80686E427F395134E7 | |
4403 | 7ADCC611BA91AD4B7A0237213C60CF2C905359C90795230344FC3C50A22BD44B | |
4404 | 55B2044792509F50F5C21F53D9F9E9F063ADBED3AB99E2613B23334FE8DF70B4 | |
4405 | 6120F2EDF69F50BE793EE145B9FF9C73179DE640FC2ACEB5C6617F918CEEB762 | |
4406 | 4CD81E665B2E544864D13230B058717B207D3CC5D6647D5343DB4D0356082392 | |
4407 | 871EFFA896631A7E0D6477942B632074A9A4EF7B09D4701B1639BAAB4E03A40E | |
4408 | 9B54A7A4F845CD63F88831EBFA4FB847847CB98F3455CB5957F2E0A0F5623645 | |
4409 | DBB5C5564C7F8B117D6E27E65C0F3EA81AE67B4AE4B201E7C4FB0A8364FE53F5 | |
4410 | 41A7CE8F834C2C4B322809B353A5E63BBA7BF3B7DC1A85EA700BD287C2BD3FC8 | |
4411 | 2832B0BB4695FC937FF5EF06FCD87DCE6DE793C2B1EE10E6450352C17726155F | |
4412 | 220D550B1759E15AB2C1D5968E52C8080CD280E99D3CCC0E80C2EF8BBFD96001 | |
4413 | A226FEED7311EFB4B67F424B557A877379A15BCA54780F0CD2CCA00400B9B39D | |
4414 | 981C6B552AFD2506D1B23618FA9AE6D8143CD7198A8482CB416CCE62B992347F | |
4415 | 337D505A4078713BBD91E5535BD58EF0351EBDCD749CC24D4AD39F8CECD7D6C8 | |
4416 | 139756680A4C03A58B3374CEC658D30160AE4863A3938A891BB59CBE02BB451B | |
4417 | 1BA4B2B6E68AB61DEB85F95E3C909B8B66E220B9F18280161C279F10F7093CDC | |
4418 | 100A53D542F071CC0A5AF834DC1D18738F5DD62A5573E884E1FFD22BD810828A | |
4419 | 1EA47F8218C15A2E97CBC609927DA3CC2B802EA4A0D7EB57627C135E3B065905 | |
4420 | F97597D818A2C5CC6F328AD25AD11FA50F1E4FE637980B7474D6F85A521892FB | |
4421 | 72989AABEBE02A2D0EFE88A6F67AC29F5D8DDFEDAAF465C439983C6B84389FF7 | |
4422 | A6434462BEB7B07DBE4BBA61ACD4A60C55B5C0AAE527DE381DFECA2E6BAFDC8D | |
4423 | 310364ECB42CAFF72BA93C067B2F02D1CA7C34AE7CDC46787A0E234C8BE8A928 | |
4424 | 7A6F3DDE0338FAD532A9886E8E3525B85DD39364AB03EC4C0DD25DC179CC1989 | |
4425 | 1BE232E387E857C78332D834679195E10F1E7B87B7966DA3B2238F53D1E13FE2 | |
4426 | 8F55ED6A92A750C7250C9B91E29796621E7E9520373214D7DA81B2875A986D33 | |
4427 | 80382AFF6DE1F829F048E57664D9C4ACE91E4684A51023943A4964AB5657D610 | |
4428 | 3A5405EFD4CFD1EBA684243E15093C9667797BB47617B66054EE02C41FFEC45C | |
4429 | C1BAE8AD56B00D323FCB1D2744F061FA16E161988741A319B1564E04BA210996 | |
4430 | 4F9F02A3268CABE450D166A763F5284954564A1C86B76544C5F5ACDFE0D758DB | |
4431 | 865A1CFCF9FE8CD5F9C3B2998C56468FD52DF8EE60C6935A3D221EAEC7714E3B | |
4432 | 301371C7DDA0B03A2416238F2B47BAD3A2C5021C886DF51C695AF9C87A864B48 | |
4433 | 3BB3FE0B355EED5454B59B25A0D8A1B8CBD356C24F64D9B55E16C30C011365C9 | |
4434 | 1E0380753BA3EDC0868788D5F50B9353D0227BCEE1BE36998B2622C0759BD66B | |
4435 | E4444250589F9CEDE766D8B940770CB6B89503E925B35C00CBEC2873D2DC4A29 | |
4436 | 0823FB7A3717B69A7DEDBAAECC067949932728E89BEECAA91DE3AF9BF070B9C0 | |
4437 | 30EEFA8C0A55C8388CAA2F0515915C98E67FA095BB98967D14B0DCAFA9622E4E | |
4438 | 2E0EBFC768D80585ACDF28D8A5C2B6EE2FE7AAF62FFB90F569F84A0903996DF0 | |
4439 | C1D5723366C436E4088F3E2BB9B47F9789052A71CF5C49908CDC1DDA194BFB89 | |
4440 | 14D7E3D7D4D72A150FD6FFD8303E9DE5A97A71B808B8BDF2AE466F31BF5D7A4A | |
4441 | 44F81230BBE2B456A221E2F72A8B59F8FEA8D31F8A005A5BD93B9F49CFDC3DCC | |
4442 | CE2B67090460F632271C7157BDC2F05BC2749FD562FC28682A616A52D1B67654 | |
4443 | DF78B7843A9EC26A7DE2EB168F874904C2915B97534B2D4D9F74A9573A771D34 | |
4444 | 9F7BC855E8F794621BF6AD471BCC347E2DF5F620F5C209E33A4CBF1EA85AEA87 | |
4445 | 4492A77342DD33EF615FF34037D660B713C908786D9022051B825226545827A3 | |
4446 | 2AD1B05D654DB6E6D261B4E8AF0933AD1F0FCFC7201E1A7C1B4199F160C38676 | |
4447 | 21ABA2DDF1CEB655B3EC3226E0B122976EEA998F7A5241F062E54AD1DFD6ED26 | |
4448 | 47C99A439E0AE95415059179867CDD3F0FF751F3141309F40E00A6C7C28433E4 | |
4449 | F649BCD5DAA64177580E05C495EE7BCBCC5FBF104DAF360CC2711386655B26F9 | |
4450 | D349D887EEB32ADE595241560FD5924A1745A22E6A01DB9C285EF14596EBFF0F | |
4451 | 03F36EB2E0A7C3864F819EF7B0855121292D49482F046A55CD7271FE03F02EA5 | |
4452 | 886864D9D8EC22A68C23089EAEFFF03DED6484D8C341861EF8B6FD3C5BDF5AC8 | |
4453 | 352DA4E13A1E30D0CB71E090E9CFB9AB2CAFD0CA7C34AE7D8E3B2EB4666834BD | |
4454 | 9CCD1AC2108348AFEF6071796F4BB2FFA4A67ED917E76A109FA2DC2A30D744A0 | |
4455 | 9AE653A748C1D18FB52595D84E87F1C1FB6B2F32667FE203262C66627AEFFED3 | |
4456 | 92B23861E5EB238BB4EDCE09DAE1C65BAFC198CDD1B45D42CDF93E16BB82D35F | |
4457 | 821E9E49067E966AFAB2AB52928F8DD6359984071FC37AA652FB834A09E5BD93 | |
4458 | 3AFAE161140E74C6531E413E8FBBFC42BFE8A464B71EB1D8CAA93B33D7BCC3B0 | |
4459 | 47C7EEFCD3E9FCF26FF9441DD9BDE68D77AD7251C06BBB9A2103049E8827CAF0 | |
4460 | F26BEF33F656A690235DEEC623CC519AFA82DE2AE16FB99F780FD7D8290DA40B | |
4461 | 9B604AEF36B529FD184239E7D50561A07428D28E51B55546590A1AEAD4B7F2B1 | |
4462 | AB8C5B9022C1FA03E33F8F409B24911AB8BFCF6EF4A8E415263C789F89063E71 | |
4463 | C0910DC20347469380B7FC1EEB87D4CED7F4A361E58B61C91AFCABA35C03F978 | |
4464 | B9FB5257C31657EE48504C355CE893FE3C553274C641DBC4004F5D5B879CC5ED | |
4465 | D3F21F867F6DF054127067DE86189F0B59A1B90FDABCDFEE61423609D888EEFD | |
4466 | F4A1367129962110C651D9481CEDDB8C5C2576A59AED64E95F7ED042AEAE2F7E | |
4467 | 81AC0C408E593DC30DCAC334EDE9EE27D932B98F040DDCD195D6155607DD2038 | |
4468 | 970EB78221A94C52BD4F0EAC65F1FC10E5DAA93C17266F351669CAE56F42B68C | |
4469 | 6D01E1EA03AE554D63CE76D800FDD9CFD89F80A241EAEFF7EDFA41794EA25CE7 | |
4470 | 97BD5028464D2CD45B53834B4AEF8BF0B9E7C6ECDEACEC887E8790A47A93F668 | |
4471 | A9095E5FA1116A122C0E5B74E2226C654D3187C6CFD8807917820423DA3EC1DE | |
4472 | AA020EEEF2280C44A15209EE2F3FC1776875308CEAD38571E7BF889F287E4594 | |
4473 | 971A83605E0B4169D4A23EE790515223DF8724054EDAD905F57918FC0BC64F96 | |
4474 | 514B4BF7DC9BA79E763C22C977FB6146B10D26FEA1BAA7BAF21312F78D1625A7 | |
4475 | 8E242D743471DB5821408AB786E4A7EA9D35E30E85533C617689F95758FB2C7C | |
4476 | 392E759C299DCCE36689686DE0C4DCE32649493650BA194A6208C5EAB670B170 | |
4477 | 3F2C70BF0EF0E3BE2FB0A79224FF4ECECD6BB3388C6D06867A0E5E3DB93C1B2F | |
4478 | 464C23E44D3132E7D4086E3B59B1D13F49EB4772DEDF8EDC4F603217233FB7BE | |
4479 | C13C28648E9AA51D53F11FB896839F97AEDD8834BCA53CB0021AE91FD8E95E2E | |
4480 | F8A094093AF556B9639F508A401542B06821FF9DE1A745FE9AC5CACD5E8E1053 | |
4481 | 911442FC15CA5333751ABFE2C617D38FA1DC332BFEF44AE569DC631C93EC54D6 | |
4482 | 261583A695F5A392867A57F59B741EFCD2DCFECBC55D1EA5F2317601C9DFE9ED | |
4483 | D1EA466210FFA905A8F85BD58B98991BEA58DFD1CDED5C9B086D42CCE632DADA | |
4484 | 147941917B879139E016B0DDEB8446BA017FC8EE5A354533D667B0835F5D027D | |
4485 | C2D580C16B80B3D05CC92C0465CAE077729F0A15B2DAFC89DCD349B3F81D0516 | |
4486 | C65526EB5C10E45A8A85D716EE35FB9AB201FD7C89ADE5AD925A174169DA20FB | |
4487 | 61E96C73A143DF964C20589EF24A0FCFE6195317F2FA0D2249C0D8E649C3D9AD | |
4488 | FF13332EA2E4C9CD36D8443EC8F027B61CEF92C6A6B72DD4ACBACC16E429A9A3 | |
4489 | F5F29C1631360E32F8C1C93ACB22F810B86D2969A7480F486F62F8488BEEC74C | |
4490 | 2C1AF13BB92BC578E8CD30BEA6BC8CB68ED730F54CED0167605FA76AD7B7E88C | |
4491 | 7AE7688E598F91C471BD65A542E96D64B1EAF19FB4F1234308C48C2DC86E2193 | |
4492 | 11ABDB4C6189C6F201627C693691A86DD07FF55C30FDB3F72381E09C6080FD7C | |
4493 | 9182762E5001E30F52A216E0B71E4D2D4E2F3B20F95DF3A11FDB2D2B5B5FAA66 | |
4494 | C46226D5E0C77066349770514E5675550FAC9394FB27CD2C2F974F1FD58C04A3 | |
4495 | 1EF53A8AB3B2202CCA1CEFA66228E1480A0709436C44BD3319C40CF888AE4692 | |
4496 | 5DBBB52B15CF3A518F627F672135A24D5DB9B2EBEF04C860AECF231EBB5A3BF5 | |
4497 | 6DCCD5E72FE4B6DD29E896691868A7DE4120AD06AC573F5608B8449B38E71CA0 | |
4498 | EB5CDA3F942482EA7973661170F81DC88D54DD5B92323F46F833DFA757107E9E | |
4499 | F62A47CC50FAA1B68ED535C3E0E1073532A05ED339C8D70B3B9864808ABACD23 | |
4500 | AA95E9FDA43D54C66A675FA074E0A5B8777D3C07850A09087F36852B5351F35D | |
4501 | 8BC4DDFCA35CF29CD5E3DE118A741FAC4DED36847F2E2C6CFE08669301722D94 | |
4502 | 376F540982958074E7F1383C409652F6C99DA39FE90B38221E75BC1ECB93ABF6 | |
4503 | B00F410A0C5651DB418566AB350FDA1789AFD88286AF3BCB42B98386F7BC144B | |
4504 | 02DEB8940D20A6B3062F0C4244EABC50923390064F1D027A8BACC3DE45156E56 | |
4505 | 4A942D1B87F1C4A76B0D4D6801AE792CCAE3009BF25368B31B6AD5476FBD3BFF | |
4506 | 9759EF463EF5E78E10B7BF64005B2ABE0E8813950A08A1808587A98E0021D0DD | |
4507 | 751AD515E8278F1A0759E85D8A084490BBB0F8206484AA36388B1013643D3198 | |
4508 | 3509078847BDAE08E76FA5BF3E3A73C323CE093DCC148E3C02C2DE1E26C94D5A | |
4509 | 40EC8308ECB02FF7DD04EC1005A2A0DC74D4E587F10A3EF349E828F69FD38962 | |
4510 | 2F0C74D5DAB3ED6CC9F97008ACCE74C086A503948DEF1AAF58FC8BEC703CD360 | |
4511 | D32098A56AC776B1BD08442052A2A4EF6C8798F7CDC102AF1A2009657254762A | |
4512 | 0793F79A39DCD6ADBAA5EC84A7ED6018BBE727E5D477893D84F157074B24C13E | |
4513 | 8D4881C7DF8ADC13EBA0D89745EF93B7616EC5355600BB0D2B630AABA3CF2946 | |
4514 | AFFD0B2B724EF0F28393F2034B2E69DA5061426805353EB4D80E20739BC4C510 | |
4515 | 6C45275B8261DCBA10DE1D104B12F46ACD230977EE7D7D1D35D2814139E38C4B | |
4516 | CA6937CCFA653349B1EF64A98457F7B4B5D8F2978F16ECCEF7054905863AA46E | |
4517 | DD524CB33459220C71E9EFA7845A3A760A507B3D3ABC525B35930B613710A13D | |
4518 | 098832C58EBBC8B0CA6AD516E6385792C59220331D0922A1F6F838A8DE13C337 | |
4519 | 900462F952EABBDC2EB1FBF94A66186C177501453CD3FE3582073DD86F04406B | |
4520 | 41B6AEB440DA475E13240445D46726A6D45185D56BAB8807CEC8A8F7CE1AD149 | |
4521 | 7CE2E1BB5DE4E5B9592241DD136479A65905FD0062C91DFF7349874BFEA5D9EA | |
4522 | 2F610ADB9AE7757B2307A1BB9D6797D9F9C4844A59841C7C7682105E23A374BC | |
4523 | A91885E7410F56F60C29AB8B417E2D6092F8BB70A2DD5DEDD4BA1077D7CC62FD | |
4524 | EA43428C6F79C332342E15F75B08A1ED360B3511F823E75AD49BA7AE63B19238 | |
4525 | 2AFE8FAC2715E2FDC895E95036D23127557837506A3B542B0E4651CE2B89C252 | |
4526 | 31EE8ADC26E2C04E8E30A9CA12F066CE01953BE7867171FF6C7E834742C36C3B | |
4527 | 58E74E4B482CB85FD4D24DB03D753F260A585D552CDC9E1941446F2F5B45FF24 | |
4528 | 2DA4932B973139F328E7E92828B900BFD398B6F41DAA0D6861C66AA7F5E3299C | |
4529 | 87A5925CE0E0F9E09AAE0792954A1F2C0AAA8288DEEFFE579E38A3CE8A943EB4 | |
4530 | 55322A87C1634074EBEC25F724DC1BCC1BC10458CA6C4395659B0DB6B612C151 | |
4531 | 557CC669D8DC37769E59A5AC6BF061C79FEE265DBB59520EB8FFEA273601D1E8 | |
4532 | 2984B8AE31AE343F37D03E2BF97DC48AFE50BB6138C7B9F9B5E28672A37BD8F5 | |
4533 | 8F8C98DC43DB22C6537028798198E2D3B0453ED72487267D653DD50F1BBBDA92 | |
4534 | 833A987A95FC1F275B90B581B4BB62B6863A4CFAE37F715EDF3EA5A33679FEB6 | |
4535 | 4847ABB4B3D170C275B9F1AC3156D731198DACE0B051674E85B758500AC9FBEE | |
4536 | ECC75EBBD85F8D62AAA328FB09C6526F853077AEF7EFBFC2B6A29D6D508B1E19 | |
4537 | EAFA4C67EEE44045B9F15B9762B3DDF5CE5C18B23A5C2F73A1F6DF7F8679AB78 | |
4538 | 843AA41FD2A7DC02B45B729EB76C66A89F5F76E5C4A0C0563B1EC5E75D72EE35 | |
4539 | A7F1FC89216B60D82F6F2B8DBE85E4FF4D63712C689E696F60B52AB622C2A4F9 | |
4540 | 37C380775EDB72638D3F81F61D8D74C76D813DDFFF35ABD9A502F2BC7FF65754 | |
4541 | 2A8660A5A53E0CDC2E8A95B6E33CA153EB711DC796D313C8183D707D3F0E3EE8 | |
4542 | BA65E0FCE3F1C07F3D93F77056688B5496AE35A6BA0B59619DE78640A8C3F7D9 | |
4543 | 7DC5E94894E1E63A7D80600B945B1CCA50F1B85F57673C6CE09EFC4E229D4635 | |
4544 | 48AB466118D273BAF7C1B52A067A88C00EBFA7FCB378F1575BC0145F294E6F7F | |
4545 | 8007602C6560476FA20BDB91831B22404DB1C4C167594B1216C25226D262FEC6 | |
4546 | F5D0DBAC4B8D743C669CFF2068CB9BCD2DAE8CD6EE1B33BBF7514C4E5EA79D46 | |
4547 | 11AAEEA72B791C22A1822E686F3858E95A37D9CEF904EDEC7EBFB0E60995CF64 | |
4548 | 57CF0EAAE6D4925126349DE06E101868BED82BB51E911852E6780772912570AF | |
4549 | CD5690C6DA70110DD9903BAA3BAD581D206571D1E57712C75D112254C7A3DC8C | |
4550 | 892B66CA346EE682E7D910343C1CCD07465D9E49489839BEDA6174FB2E0DB935 | |
4551 | 2D2CBA6B67ADDA1BAA6A51690A10C819692C9BD35BDC689F9DEFEA78BFE79C47 | |
4552 | C9CCFB3D04D20F1D3E0B73498FC0BDC50A3BA6DDB3FAB9458803BB26487C1397 | |
4553 | 511717CA3493A7590E27B34C2E2E1BE2ED884CAFD5F7C185CD6EDA68951673D6 | |
4554 | 384E6CD12944F86D178E73C8D78D9048A5B1E2FCB489E723F8178F842B362BC9 | |
4555 | F3E4D511B369670908B2C8087AA29F8B592B8AF7018311C0F12A8D45A3625096 | |
4556 | D4C88B19890571C60821F38310685F8DEE7A7A5D209265986F92AAF11143DC85 | |
4557 | F435BC210621851001B6A402E3A07D0F204A3B0D75DA3CD7FF6637D1F434B962 | |
4558 | F404DB3C6BC318EF517AA0836A975C5196976250B5D6B21DF528FB47181F5279 | |
4559 | E1EEBBA0F344D7EABE71904B5C1DB0FD07694C469085D50DF4990E294334E785 | |
4560 | 5E5BCC4ADCD38685147CE535B23F3027AAC01A0D65AC751D9CA289B4A8906A64 | |
4561 | 165427976FE6FD699442196B0C247C960C9086AB2E440885D2C32FFC5FC7105F | |
4562 | 6C40A76A1968AADBBAD6F3C21FBC076F4F67DE62E1CECD38BE03720FFA886743 | |
4563 | 846FFD2005F85371FFB9C962AE2D88586DC9DA2F98996DF8572551C3D49E1ED4 | |
4564 | 41248FA76E07B2A5CB9C3451247F60C7AA164ED895CD6290427E828A7FB72F71 | |
4565 | 7CC249C92A012C0FE99FC07EE7E084E190CCCB95E66A39EAFA7934598C69F04C | |
4566 | 68B2C68DF99ADB347AB05F1905B8704A51FBF9471FB20CCD3CC87EF9FD75DDDE | |
4567 | 125EA68997DDE4174DFA0ADA2664E7209E4EA1B460CBDFA79D033D33FA9C5075 | |
4568 | DB424689F927F06ADB87DF0C3F4600ADC9CDB197E41430047247E7645A0AAFFE | |
4569 | 750AA1A154498C0B5371ADB099C1E273DE2E367DDE7ADEC2CAF9406A67585AB0 | |
4570 | D39F051BC556A8E569AB9EA4E69557A1DFCB8CD459403A616821AC61E35DE1E9 | |
4571 | 2673435E5969EE48F3B9F9777E5F70C682FB7C10E6E7FAC5F5732C9EC2DEFD5F | |
4572 | 9A28572ACC62C108861AB22894979195B88E6A08A533629295A58643F854BC9E | |
4573 | 082F9073AC94EE08DC1CFC626DE4D341D7994178E708D4D8226897B54CC2B4DE | |
4574 | B37D5BEDC430404177977EEEFD7201713AC45FE927D4FBA0F2613A2FBCF890C1 | |
4575 | 908E1DBCCD277E78E42363374E103BBD6C3DAD925A9422469648B9D8BE7391F6 | |
4576 | B448994EA40AF3A3EA7E6E938D0F93B9EBB4E09B5D2E8D9ABF1F4AAEE8A0A304 | |
4577 | EDBA6DF569ECD449FF362660B11DE8A13A71C6C8186273C7417C4572DDD8B993 | |
4578 | C96289B16223B271D026929B2CB9D3AB7A3511F09C6F303A7006705482E9AEF4 | |
4579 | FC76BC1B1FD42095857751315F5B06701E774FF08920342667E99EBBF5A19210 | |
4580 | 9AAEDC8033E06007AA89BEFA5A1616095A8E90C999BC3EB266879EDE7D1218F1 | |
4581 | 3CB238D180C463AAF853E315CA564247B6E029D8200B9DB7B13EAE09264A5DD1 | |
4582 | 4A080EAEDA74C7FD21BB208FD8EBEC1D650C0AE392C67D65C1773A68F2CA313C | |
4583 | 15FE2E4A0B6E7DA9CE391BF6D854431F0EEB550A818B6B95EFE6F72504AF5CE9 | |
4584 | 73DC8E3326E2E57F4031688F10D1C272D41AB40B7EBA371ED357E67C31DBFDA0 | |
4585 | B8412EDBFBC2B6F26FD7331BC965DDFB1A4A17B72BB94338283A8D9139B9816F | |
4586 | D13C12E07B69E9FBD0C5FA9B1DAC2E51324695102DAAFA746D969E5F64980707 | |
4587 | 228DA50443B2917FF685F5872D782CA265734036B7A7D75588C638AB9687D34D | |
4588 | D0221C0B3EB0A8DFE91598F07CE2C35E1C4E01E26D0358841EDADA02D3844B26 | |
4589 | C39D492C480244124F422EFE57D38DD912EC98582F05C74B4ED83BE81C363376 | |
4590 | B816F23D10C5C8CA831E1351F3BF914B07F638FA5712A1E05E3B751E756296C9 | |
4591 | 2FF074FFC22CFC383804A92057155C4E43FA4990734C83257E810F3C2A62F42C | |
4592 | B5328A41BE80C23F49479EF84BA8D13BF3A45EC435781B9480659A4D58041190 | |
4593 | 3DA62807723CDF1EE71EFA22BB67887DA88EB20DDC0D1A36A75C06BBA651DE67 | |
4594 | 651BB57824E4F5264DEAA04927D2A29730B7293E08FE3FAE5FF493EDDC0F2232 | |
4595 | 9476F3CA26707E823808329390EC9D8913AAC2D8DF2A6B5673E1A0F4E7E67C9A | |
4596 | D006E7DD429BCC550DF7323DAB781F82A837C83C80DDB8970CE699153576ABD7 | |
4597 | 4BA82C753C82F19E30B853DD086DB119C48ADA56C39352E3C6B1FA232390BA3D | |
4598 | 02482A6B845C324593FF845A572E1F026941AE3DDBFF83E8230FD5214B631EDC | |
4599 | 69E178C52B5FB4BFF0C89B756E759147596D038850F0A468B20163093F8BADE8 | |
4600 | FB0F718C66D82C41A29EBEC417DE0B72C4F8E746EEEA33F2BFC0063E2514456D | |
4601 | 6EC34CA68E1C667D47FB582C3A259AF4D0859C68AAC0E5F89CC91A1F508CE835 | |
4602 | E29B7860E6484F8B0D75C1635A32FDE55F119C8222A5D00D9C45930C9F5C97BE | |
4603 | A28EFB48BEF95ABD910E66CBC4C34AF6299A84CA55F780A013E8B3DBC4E57F2A | |
4604 | 1EEE358D24775DEC537CEE09212EB3208E497330427706696335F03BA50BD193 | |
4605 | E022E668C6602731D51102FB7BBBF43A630BC428FCE711882EFE6E7739DC10BB | |
4606 | 63B60272DE6FE4841F7728EA80F871F1648E3478DA71BF29F66FC3565AC3C632 | |
4607 | AEDBCCDDA048A807FCB6CC497A1CA11C6E802C1ABEC3BD80E116A648531484F1 | |
4608 | 722E3EDA1EAF6DFF1D3CBB1759C4AEF33A300E7770B8A24F7EAD130B31A0AEF6 | |
4609 | 26C369A8DDD409A1343BB66DB2B2F7882FD168C008D5721B3EF2DE8B56EA35D9 | |
4610 | 2E456FCEF55927D78D20A99B96EE83A25BAD4DB679511BF4E27E552F871612C9 | |
4611 | 6B8C2D5BAF77B648C654AE0D9E6402998E07906B58984B94987216AB9EDB2699 | |
4612 | E0EDFB6AD08E25F2575E1B93157F2F6A0D215ADCE1D21AFB6E4DCA3635E2D4B7 | |
4613 | 825A4EAF8568D1A2ED4D6E8C9C6DBFC08D259001EEA83D3ED9A416435A79B56B | |
4614 | 3F7B0AE9A5781694E22FC68152BB68409B61B9A59CC8D58CE1EA9C0DBB329554 | |
4615 | 44E4D85F3A4BFCF8AD90771A203FEBD6EE00D118EA5833C96F1BC0CAABFE69FB | |
4616 | 0BCC46E7A3280E16976D86722168F695FB6422734512954A97AA0BA8AF8155ED | |
4617 | 2434100023E1FFCC504AFFEF6C2F70B1F2506E53648271DDCB82754F9775C323 | |
4618 | B77590E86374A9B01FD57FBDD3F3BF8D61CACB66909E6C95C81BA7B083913635 | |
4619 | 30C7C0BB9EB7310F23D2991BC6D5CFA9A35AAD04B14CC5540A16C9BE0094A8DB | |
4620 | 058B1DC4D5744C8F89257A04B1D8544C1405D8FA71A780E92D767A170C269668 | |
4621 | 202ABE3126680D93532C2EB8EC3A140D604C79906C626AB0185669AF9A425CAA | |
4622 | 465C3DD47810CBA44AD7E2BFCA99FCDA98EB641608032051AC5CC30329C28536 | |
4623 | F5637FC7E371BEFE11320FDB5B6530E513CB14122289CEFA88A97733E4F888D1 | |
4624 | 23030714F61091B5ADFFE84E3505E32C347EE1D624AE666E8BC6F416F78CF6F5 | |
4625 | 96FE5D12F574F8114C71A10596847A8BA0B03DEDB6AC72F218129B223F422908 | |
4626 | 138A916F2605142D5EFF5F4BDA5627E59DAAE09A674B7D5BCECDD63BF5E7C119 | |
4627 | 410A36161335A18A93891CABC830833D1FAC47B7A85BC9EA27BCE6F727E7D35B | |
4628 | 348918F512C3BF7769C185A277BA930170AAAC6708F04F00C47251D2679DB455 | |
4629 | F9BB928838F148C1AFEA1C56AA779C54948B9DC0E827706834D9469825FEB644 | |
4630 | 6AF843E71E44D0380311A3A6D9B7543A6A24B475BEB483D63BAC1B9421211570 | |
4631 | FF9BEA65E81FDAAF0E00A1555B0A69C8355143DA9B547BD1AED32120C58AFA09 | |
4632 | AC34163ACFBFE0E00D57A5ECC73E522AF84A2EE0C9655C6AE6E67BF4473CD8A7 | |
4633 | E7F95AB4EEB4AF83ADF597547CDE2426F200FB8824E2A826356096B962F31B98 | |
4634 | AB1B27FD681C1F67EC07FFEE7240F704E925E62749E2D2C7CD85C61F14B8A03A | |
4635 | 666339793934155EB270C0C7B58AB8DF6C52B72038257BE0CDDD9B2A484DC97E | |
4636 | 862C67F7AEE273480192980A5BCD8CCDDB87CBED18899B09B0A485FB4A1FB061 | |
4637 | 79A918589500995F12211C3E636FD1A7F6F746A231E42C80152EE4E2C1E65FC4 | |
4638 | 4075CD6B10A7183C711573498FC034C82A5B66EED4F921646F8A9AC989F7C655 | |
4639 | BC0C74049D81A3AA11FFC20CD823BBBEB6E58FED16B9AC143EF2E2981BCB5605 | |
4640 | 71C71C8BE4112AF04B3D2D9C46F948C8E3862AAF882871C3A05CF720DB14ABBD | |
4641 | B0B2A5C41E35DA879B3109E31226C317CE405C2186F54D710AA503B8EC76BE1D | |
4642 | BABDC05B316D5382568D4938C7D462B3009A648BDC22C640CE6E891375DC26F2 | |
4643 | A7B36C4F4DBF909B2858AD23DB71783204AFA075488322462A92F0E6739E0A28 | |
4644 | 486BD3BC19B3665275ABE63BA5B31936B0097A08717141505568962BBD257511 | |
4645 | B714C52EE8CA7A37B3C0322B7F5A5690BE2FB23AA9FB322107CA58B4CA4032BD | |
4646 | 2026815102CD4688655FACF599739F8C10EE5890AB65B167C5FC0C8F855EF2E5 | |
4647 | 0B3F95EDE6BED4CC277CBFD004B7D13734F605E1B929204850434638F7244B70 | |
4648 | 176FDEDEEED09D16703108DF3041687BE3EF06ECC78CA7BD028A24676753F889 | |
4649 | 32E2B027250023B80E514BCE566E9CAB8F8B516544EED082741972528E2D9D94 | |
4650 | 29D8F03449066FA4412350A5549767945AF5E678BCBE884532DA8C66A612465F | |
4651 | 4E2D1CA7353C2F7E0418E1C989026583844702D344900E05FB45FED3401FBED1 | |
4652 | F63830D700F1EC2F4AED4EF8D077EB9903AE3E1AEC126EF9A03AC25D5FB37CD1 | |
4653 | 8CAD9A29B803EE39CD78AEA670E2304EFDF0B9E52537DF6BDDD44022F0C00895 | |
4654 | 6EDCCFCCD3430853617597EFDC25E915E4F977F9910D640FB088085A96E7FB59 | |
4655 | 3570E01A50A7D4903E01C398B5F461BF23638812C245AAE2F5DE500FD2D44E57 | |
4656 | 336BDD4B538C081BBFDEE78D8FC75A19F204A15C2E18BBE879BEC3F675663D3B | |
4657 | 73124D4FE6BB1AA1E6E5D6FAB878B479523CC51E4E734AA090DC70DF610CE359 | |
4658 | 8357A2C4842AEC553871063A9127C952AC9A64FE3891CD4D0879B41CAAA2FF8B | |
4659 | 0F4336BE27DC0C179FF91D867FAB89D05E382EC85C2DD1E1BFB4B66C6EF9AB3A | |
4660 | 7A7FA0285EF3B67A1249BBB1493AAA17E355690753D2978D937FA5373D195D9C | |
4661 | 9F2A3F7F6F71BB04BC47EFC7D24F11DAAFA20FEBBE5098976E8C002629C7A5D0 | |
4662 | 4BC339B70105CEF46994F8780AB84FD47367F996418E00BE7002 | |
c302751c CR |
4663 | 0000000000000000000000000000000000000000000000000000000000000000 |
4664 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4665 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4666 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4667 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4668 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4669 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4670 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4671 | cleartomark | |
45c0f7f8 | 4672 | {restore}if |
c302751c CR |
4673 | %%EndFont |
4674 | %%BeginFont: CMMI10 | |
45c0f7f8 CR |
4675 | %!PS-AdobeFont-1.0: CMMI10 003.002 |
4676 | %%Title: CMMI10 | |
4677 | %Version: 003.002 | |
4678 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
4679 | %%Creator: David M. Jones | |
4680 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
4681 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI10. | |
4682 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
4683 | % This license is in the accompanying file OFL.txt, and is also | |
4684 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
4685 | %%EndComments | |
4686 | FontDirectory/CMMI10 known{/CMMI10 findfont dup/UniqueID known{dup | |
4687 | /UniqueID get 5087385 eq exch/FontType get 1 eq and}{pop false}ifelse | |
4688 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 4689 | 11 dict begin |
45c0f7f8 CR |
4690 | /FontType 1 def |
4691 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
4692 | /FontName /CMMI10 def | |
4693 | /FontBBox {-32 -250 1048 750 }readonly def | |
4694 | /UniqueID 5087385 def | |
4695 | /PaintType 0 def | |
4696 | /FontInfo 10 dict dup begin | |
4697 | /version (003.002) readonly def | |
4698 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI10.) readonly def | |
c302751c CR |
4699 | /FullName (CMMI10) readonly def |
4700 | /FamilyName (Computer Modern) readonly def | |
4701 | /Weight (Medium) readonly def | |
4702 | /ItalicAngle -14.04 def | |
4703 | /isFixedPitch false def | |
45c0f7f8 CR |
4704 | /UnderlinePosition -100 def |
4705 | /UnderlineThickness 50 def | |
4706 | /ascent 750 def | |
c302751c | 4707 | end readonly def |
c302751c CR |
4708 | /Encoding 256 array |
4709 | 0 1 255 {1 index exch /.notdef put} for | |
4710 | dup 58 /period put | |
4711 | readonly def | |
c302751c CR |
4712 | currentdict end |
4713 | currentfile eexec | |
45c0f7f8 CR |
4714 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
4715 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
4716 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
4717 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
4718 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
4719 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
4720 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBC7878DFBD546AC2 | |
4721 | 1EF6CC527FEEA044B7C8E686367E920F575AD585387358FFF41BCB212922791C | |
4722 | 7B0BD3BED7C6D8F3D9D52D0F181CD4D164E75851D04F64309D810A0DEA1E257B | |
4723 | 0D7633CEFE93FEF9D2FB7901453A46F8ACA007358D904E0189AE7B7221545085 | |
4724 | EDD3D5A3CEACD6023861F13C8A345A68115425E94B8FDCCEC1255454EC3E7A37 | |
4725 | 404F6C00A3BCCF851B929D4FE66B6D8FD1C0C80130541609759F18EF07BCD133 | |
4726 | 78CBC4A0D8A796A2574260C6A952CA73D9EB5C28356F5C90D1A59DC788762BFF | |
4727 | A1B6F0614958D09751C0DB2309406F6B4489125B31C5DD365B2F140CB5E42CEE | |
4728 | 88BE11C7176E6BBC90D24E40956279FBDC9D89A6C4A1F4D27EC57F496602FBC4 | |
4729 | C854143903A53EF1188D117C49F8B6F2498B4698C25F2C5E8D8BD833206F88FC | |
4730 | BD5B495EB993A26B6055BD0BBA2B3DDFD462C39E022D4A1760C845EA448DED88 | |
4731 | 98C44BAAB85CD0423E00154C4741240EB3A2290B67144A4C80C88BE3D59AD760 | |
4732 | E553DAC4E8BA00B06398B1D0DFE96FB89449D4AE18CE8B27AFE75D2B84EFDB44 | |
4733 | 143FD887F8FB364D000651912E40B0BAEDDA5AD57A3BC0E411E1AD908C77DCE3 | |
4734 | 981985F98E258A9BB3A1B845FC4A21BCC54559E51BC0E6C22F0C38540F8C9490 | |
4735 | 88A0E23EA504FA79F8960CC9D58611C519D3ACDC63FB2FBCAE6674357D7F2285 | |
4736 | 4BCC9F54D3DA421D744D3A341DA3B494BB526C0734E1A8FC71501745399F7683 | |
4737 | FD17EC3044419A88C3979FD2ABA5B0130907B145A8462AAF0A9B511D2C8A7C7F | |
4738 | 347FF6AC057E6512902BFD2918E2CD31DE615F5D643764E900B60287670AE18F | |
4739 | FDE15545D8BC69591A8CBBB275AFFC9B14BD68DF0AAB32268FB84844D4DBC7BB | |
4740 | C591C1AC5102C50A9C7BAAA848DA88B0519F0F5F0813BF055CF0E3C86F633A04 | |
4741 | B779D2E8E656DB1E09A66A85FE21CA8BA5523F472A229E83F2C4E91ABA46C733 | |
4742 | F3C7B5775B06C97782BC225C46385BEBDC61572458EFC5CF4190AB7A9C1C92DA | |
4743 | 29F84BAACF552089195966E3AD9E57CC914D20B6962BE80429A16D4DF1ECAA66 | |
4744 | 36C4343FADF0B2B48F12E2EB8443C4AA29D00949255F3968617F98B8ABD4CC12 | |
4745 | 048B838EE243A21AC808BD295195E4AE9027005F52258BFCA915C8D9AED9A2C0 | |
4746 | 80814F79CF943FBE3594C530A22A92E11BE80FCEC1684C4F56712D5846B0749C | |
4747 | 9B54A979B315222F209DEE72583B03093EC38F7C5B9F9BCB21DBE8EDDAE9BE8B | |
4748 | 75ACE6B12A31083AC8348EC84D1D29D2297A266284B7E9734E207DAF59A25F4E | |
4749 | 4AA38509E993C5394FED76E6A2F25462685C4C86C6E8CFC9863338EC1428BDFC | |
4750 | 74616BB1BC8948B0ED4C87C15B4405F3A7796F9DB3798FFFE8BD0A94E834817B | |
4751 | D5E9812E308D0CC920470A6F2CD088FCB80462BF7CB3F039A7DF3DAF5B2B5355 | |
4752 | E083A385CD2EAF0FC181E40E96DD7E9AB9EF5C7E6866A13B8A54718E950FE097 | |
4753 | EF0951A357114F18CE9933D28B3A77AA71E3CE884661F13284BCED5D5FD1A86D | |
4754 | 543E588FF473DC2CF9A4DC312500135F29C2D0174B32018C8DBD40EF9A232883 | |
4755 | 710A1F2AB2CD11312300ACDF789A9B7B93D2035D81D1C84984D92D78A53A00C6 | |
4756 | EDA94B24BBAC1AD17774A4E07E6F74ABD90415965616AD540C8ECD8C3A44EE4F | |
4757 | 7F4F6BB6238C5062D63FA59B7BF08BE93FAEA70A2AB08FBEAAF7DBF56B95FD93 | |
4758 | 03CA406543BA6C9527D0DF01F5108D31A51778A5EB1C93F27B72B46146A353A2 | |
4759 | 01CACBC829603B9989A87CF64528682CCBA0562A8165B185C58A5C6BB72F5E89 | |
4760 | 500ACCAAB8ECEFBB2640E99EAEEC4EA979AA793D013D61D8ACF8784FF8D9398F | |
4761 | F6A252A709324FB39509F0B3A4E725E82F53543383C6765BE556CC897C758208 | |
4762 | AA3AD37B0406E4A79F8F0A6C1983FC73E71CD858C0DB66ED66D5D992978614EE | |
4763 | 1EA91EBE191E082EBA1FC040AF19A2202575C2EBEB8058833E3520FA03D2F915 | |
4764 | 85C1ED337E457B9FEEB0C6EF2735EFDA6E0D05FA641BCF698AC6B97751E8306C | |
4765 | 4DF00A39B8581FF53DB8F8525FDB196D85950906CCB59B8EF171349AA3B567B1 | |
4766 | 6A00819947A995FB383C3C1709C9A2C113B2E40BB832B7D4A0FBA0B16A2C455F | |
4767 | 55809CC425C403E9668DC66BE45B71A81C332FD4DB279D22A2959962304A8F18 | |
4768 | 085893DAC61317D24A8F198FDAB95F3B86F0AFD35047B868A9A17037A2829A02 | |
4769 | BAB042F75F349E197A7EED41984C2859754CAFD0251439921C248B463B516951 | |
4770 | 2E1322C80D73F9CBCAA63A585450275AC2492E4D3FB78E800F788254DB5E610D | |
4771 | CF788DF5C70FF99892BCDF16133E34B24B77C8F097F546B87C603DDB8998B66E | |
4772 | BACB68BA27462AF54AA405682EC96D701F0D474DECD5F95CA2102DF639EB169E | |
4773 | D518162C2BAE45FF698B6DE15FC6E7DE48C336C40A670FD26952A6BAB09115E1 | |
4774 | 991F0073419F2CC2A1C08BE91096936AA0C37E4ED3CCCEE235476074B8FF1125 | |
4775 | 6BDE3701F85532D8BB64CCC927CC335281C95EA689706F0AC717DC2CF680C754 | |
4776 | E5EFD7FA4BB8880B2B727A964C876D4A223069D4E6001771F0E23EAD2A4BBC80 | |
4777 | E76675297B2EF05F52BF4E71B3EE2BE3048CF088C79540113C66AE98B2FD3CB1 | |
4778 | B0741A215FD070882C52765009D7D711DAA2508F19AE7DDA15229A856AC49BC3 | |
4779 | 4DDF40814FF96500E4B9B02D412E94623C5FDCC76C0FB8E42DF56A904FE49D65 | |
4780 | 1DA7C53901B2EA71AB658A464D3ABDE27D9DB8D9E0B48F64E61A2495AD5D8DAB | |
4781 | B5E72424AD017DF37964AF911BD7FA21A5EB4775DC8E95EF0C0EB856B00D89D7 | |
4782 | 8172A1DE8530767D317B8256103E53CFB877E10686A04F5A08F8DC58D843DEBA | |
4783 | FD5F40597588663D103689F6EB3EB14D06E18C8078F2538B43E712DF491FC5C6 | |
4784 | AF639256C8C6134B64D560D8476DEA6329D995E46CC4BC78841C59E73648B47E | |
4785 | BFA7DE0846422F738454AE77E822A083405289247BD7C478BE4974F742CD6051 | |
4786 | E99FBB1D1B3FBABFEE855174734EE45E87D0AADF32B1283B911162A9955847FD | |
4787 | 38944D70584FAA6B1A7191C5C134B73F98EB632B69E2F0C0F94156787C34C8A3 | |
4788 | 7622A029D58F9626B74F8A8A1F3803E0BC20E0EADEB1E99B70F1BD9F980FB751 | |
4789 | 2A842843DE42EB142A84D5D3138629AE9EAF6F3479C423E8829C8816FA6EFA27 | |
4790 | DCE5580E65AA9854B1C64163DC318420CD993C15BFD76A8BA1182860A6B03D6D | |
4791 | 22B8CF43CFE6C8AB27C64842E239CAE707D3086BADDE1D7C94E3BC96319470D6 | |
4792 | 8D26915C575CFDD03271D6BB9DE86A0EB6EEA6E768B224A626C62A9AB48A6EDB | |
4793 | 44F70BB5AF991CDF9736D65933E81CC57A78F623F33EC9AF535F2F25FA4EEC90 | |
4794 | D50DB7E87F31E971A75A33A301CA6013EEC5A4E179D695B33DADF2C98364434A | |
4795 | 42926776000B610E17524162253F6FA638D6581C18F99EA0BD1D2E24D2424ADF | |
4796 | C05010D08192485153DD03930C7BF45237593E484F9851E6D464FA10FECA5D9E | |
4797 | 0C8CCC97DE029030900CDBB491C5CF226DBF903CFE7735D939C3FDF3A20B70CE | |
4798 | 66579B28B99313FEE914E295388C7BC8E055A2E54EA3A8206D3C8F4F7C0BA5E6 | |
4799 | E519419FD8CE215F7B8E9BEC604A9E3FE272A0328A24E31997C8A91E0946BCF1 | |
4800 | 6943A97CBED2AB9FC636B49828BBB8B89E0BBC2653796431224895ABA5DAC41E | |
4801 | 1854BD9764E86147FD7624F736F40DE3B7582EDDFD15C2BDE3F22B5A54D7DF10 | |
4802 | B87A1301CE85CFC061689A890A321412A13314AE96DCD3EDA75035FDD8F4AB9B | |
4803 | 897A2C68263A68457032C469987970648BA2D88B1C5375DFEAA35A917B8A952E | |
4804 | EE670427942AEDB3CB599C5746180E392837D371E15D860620ABDB6AA7772C40 | |
4805 | A5E346661673ACA530BE3D8E3FFB895E5DA3DC23B1B43C080C77F7E47847F0F3 | |
4806 | F3AA5CA9E4BF75FC5EBD18D19F21A7DAA3B11CABC6E4070A15F7DBC8B05EB6AA | |
4807 | A02EF1B078EB66D61D6AFE41DA9B36FE7EC9EF94D1EA26282A9871E2CACB3126 | |
4808 | 2AD49C2D9B50A6E47D8F2CCAD50992D1B430979A45FD9E76182A19964BB2A1F6 | |
4809 | 51779A2B258DC1DF4C2F3074621286831F3848AC152DDD2BA561E6586ADA88D3 | |
4810 | 598A2CE2CD048F027CE0008B828BD915887D7785341E8305DF2346ADB76BE99F | |
4811 | 87B02173BDC334E9221C8DF54114A6B24C1C5340299512FA6C8C51AB4C8778CE | |
4812 | 178CEF531C6D1B5FF0A1BE8EFF767F959BD4C345C52699A29A17B2A230842BF6 | |
4813 | 4B011217D6D24EDAC3F6D53482786F1CA33169B90ECD499407D37CE9B70DDF78 | |
4814 | 7B7547B32952535BA9ACD1E244447AE3FCED3AF28717083CF9590A09780984D6 | |
4815 | AF0743C82AE4FB3E2BB2856A4153A3967A023FFC35382D6C22D84A924900B6A6 | |
4816 | 3DDD400E6D2418DA6C27F2FA34C075C902B89EBAE658B3C9A18EEE449DA5A379 | |
4817 | 337DE95CB7AB3F0970CF1A5D8FAD8090E495570FDFB2FBBA79244780D8035547 | |
4818 | C5A55BB21A2270F724BF5D442CDC5BB9F09BE0CAE59B1C2270F0BDACE698F2C5 | |
4819 | DE8F66BFB9634904B161F5BA2B1950048300D69BABD312D58D89C4ED527AF7BA | |
4820 | 7DA2478EDC2CDEE3473DD8A8ED9D891CD1FC21F23013228BB3281B71FCE959BD | |
4821 | 6F8E9059D682A7FCC5265A0620992D4FA8D78377EB34CE3ECA070EE3707239BC | |
4822 | 98907DB0120CE42ABA32CF97127E28382BDDFD685674279F588D4F951216C355 | |
4823 | 821361790F64C2CC720DE97E8ECB57326C43EE47367628E05769E106868B54F4 | |
4824 | C33C9951908DF6FC4F5ED2C7787BD8FA591BBB3E9C6C1DA94CC5E38D9B20C886 | |
4825 | 7D237572FF46DD896A4D6163408EA6CEFAC398EE041EAE29D577E75326CA17A6 | |
4826 | B072D47A7B13EC441CE6DAA042ECD02134CBFA6809A435050413817193DAEB16 | |
4827 | A5882C8AEA44BCF36E74E9ECCDFE7E19FF5A5DD7A94E5AB4F8702C3DA7F42325 | |
4828 | 23C808670A0490F5B373DADE40814FF9650241D3D69C91FBC5ECE728F827D9BF | |
4829 | C928602E05477903449E079164CA39859C4BCA60C579F490AA455F82B5050BB3 | |
4830 | 969AFB478E0D4A257B3356EA3CD62051FCE6C6B1929CFF85BFDF166BEF658E10 | |
4831 | 3A55E007F38EBBB248B3F0B8ED1925106B499B762E45113AE1AC9DE09644C84B | |
4832 | 9C08034B297314EE69BC32DB6E7D7FB9913CE5AC17E7335979E9DCCE2BAB3725 | |
4833 | 1976155551F9706A576FE0E3ADCCF72C87683291528ECB749CB0ED291966E239 | |
4834 | B5E3630676BD409E08F85BC1AEC9A2D4135376284A96EA24431243BD6FE8B966 | |
4835 | 95F11A4BB53F392E0AEFEA623064FF8A7002367B0A515635CB2D2DDFB9B4A8D7 | |
4836 | FE721754E81BBA548848A235B91AD4E4F7DB19CCE2F61D277FC00AB956EB93BE | |
4837 | 44AB4970CA56BF59506C94ED160FB1E25D3DF2988A532BDB787BFB8539D22986 | |
4838 | FDC378AC31444E63C4727FEE121A43751043849E6DCAC5B59D0FC703AAFBBFD4 | |
4839 | E8B7C268F21615AD02CE9DABEFA27B5FE6A6441B619539CAB1F810F1263447AA | |
4840 | 633F5DAF483752EF1A0421740E3A811D2D2898CBF53E7F686C9223FD7235F02D | |
4841 | 6F90D2D48CC20AB87778DE3C6FB335E0F0EC20B5DC5B65223FE117526DE2C72F | |
4842 | FE839DF93CB2A7D66CD900CB325F891E311BEC932F703FB4FEFA29DB8B9C88DD | |
4843 | 375EC71B3D58C7BC59ADA91971A3BDA1ADEA629CE6CC92BD542CDDFAA7706FB2 | |
4844 | 6CDDE2DF07E56D6741916AE8E8744339816F3E6C38062747AA9FDA2A2678A6B7 | |
4845 | EFEA870AA3A4D71B25EE3013EAB1DBA34401B867C7A41AE51E0421D41D3BB83C | |
4846 | E120C8FEABA6E5DEC53A689C21426D4BBCB68CB37568761C360E6D4E3596FB7D | |
4847 | F4DEC7918E58C0293D12D6DDA7E9DCDAAD7C939F55CD1BC4A228B31E9A904156 | |
4848 | DA6B40B08E6ACE674618B768DD681C772A3E55FE096CF949CF3B0460ABDCD891 | |
4849 | D17B37B355B29AB5137899C036F31DA026244FA25FB798FBE5105BDA29F46538 | |
4850 | D3D3AC1001A7BCECE64DE94FFE6C354166A0F97256137BDFA07F6E22A3D1D2F4 | |
4851 | 9588DBAE95E895BC5E64DDCBBAA8D0A22C229B42CB717FC711E7E9DF793DF80B | |
4852 | 9F14754585A3C7E17F37B32924B9F9870DA8635E3E18BD1DCD81EDF01834D9C6 | |
4853 | B33F23C956C2FCBFA47D84422F583459D827D1E120B97694D12F1F54D02379C0 | |
4854 | D288F7104F3FFCF4F76E3494F4ACBD1BE3A15543CC680924C78A473F8E311ADF | |
4855 | 8FE00A04C6C393DE61AD3EDA5BC031E2353076A2489391B52632387CA28A7B93 | |
4856 | FBB065A6EF3658AE80B1ADA47E9B2539E73A71FA75645F85ED8ECC257FB4CF26 | |
4857 | B6C912DE9D0F9899E70BECCB934AD32CF49A093371A9F73DE6255EBC39DE1E7F | |
4858 | 00D0CBDABD4D0383977E694890E71FBE5C376BE5F3A80C28987417504F515C50 | |
4859 | 909F3D31178BB9B1D085BE514F71B910A9085BD6122DDC72A150BFE266920E49 | |
4860 | 5661BCB4BAB51D6DEFE32B616963DBD989FCDD1637B294CE4E288655FBEFA1BF | |
4861 | 7F25BBF8CF17C2D5FD161A7C2CC9CC7490D9BF15A1D35B3BFA43ADE256E88BDA | |
4862 | BD490D92907C57BAC408A575EC84D6AEE070148C7C9A91C03B09FDBD792E8FF0 | |
4863 | C0B886AAD2EDD86541E5E579359D40E3AC312ACD3D8FD49F71BD533DDF8859B1 | |
4864 | BAF17F1884E331DD07CEEF93B71D492AEBAADF7A263450A7A72210CE630A0D37 | |
4865 | BF024BDC09ACC882816B8C22C62AE38A3A8D0F6EBC2B1B2C0B8161A8B076DD5D | |
4866 | 4B779C0788546BB4CF57332230D237856B00D79C28A7C01D11F44B7304F69075 | |
4867 | 94B97A745DA43D1BE561372CE611C345A843834E46AD9DDB16CABCD3FA33D6F1 | |
4868 | F6B5C0497F5EE5400B305CDC16A7EC286AA4D45D0EEBB9DA06AC9C5294D68EC9 | |
4869 | E4DC3CA2B92CE8FC0526184A86EDC7AB34D67E60AC12D9CA8FD300235EC968BA | |
4870 | 92C6FBDA47572BC5600F25249F60AD287CBDAE980E747FCBE7EE5CD323E733F0 | |
4871 | 63553B494D3DDEB9CC1480B5C3BB79A28E419AA65B18CB297AB383419E890E2A | |
4872 | CE6F98C9900CCB4675280A10CF060B8D220DDA1BE55DFA65715EABCC1AFAA271 | |
4873 | B1F8732341613E17B231231A0D24D4D7FC198AE04D89A99C4536217769C6FBD9 | |
4874 | 5EE24A6302F97438F7C0E311C878F674B4477A5ADA3952CDE4055AC408B8174E | |
4875 | 86F8FB797646DFFFE0ECA25D1BAB9A9F71F3926D3D85AA63E7A8C931D71E79E0 | |
4876 | AF1EAC26FADE468F4FF7F3861D14C10E3BE1F9EAFD6D3A544E8108D5DAB5B180 | |
4877 | 3950C74818BC8AF4758A108F462EF1826647A49667F5E482038C54716856D9BC | |
4878 | 35F29922846D2148F92F943E951D7438C73D6A60459A8003174036C64E1629CD | |
4879 | 155D47FD04B03C023AD67CD5A70C98AB556EEAB8C48169706E5B352F6505D580 | |
4880 | AC945171BFE62E81F8F500438AC3B64D857BA5BC54C2C4BBB237F8FA51296255 | |
4881 | E66A92A61FE13FDE781D393557EB72CEBAD86511035F775FAC39A0479CCD400F | |
4882 | 226709118F887F47CC2ECC8F79816D4A945B2845F50AFD62D8C9A9BBF4739496 | |
4883 | 9E644BC9F7B04803B7EE75A09EAE94365F6F374B4FCEB0B506C76297564B9B6B | |
4884 | 8B812BC3A33929AA94692572B010E6210AEAA312BDFC88BF302244AB9D587A9B | |
4885 | 919823FD01DE12438D960944D1977800FEB49E638C32E5B188B1CA033E0C37EE | |
4886 | A142F746367888AA119535F0CCAF7EAA461B790EB089D2D6962E28A398439BB7 | |
4887 | 9C9943654D7A2D765B46BC0DD1F915327F369162E1BA1BA83110B93F442905E0 | |
4888 | 523BFF5E279508A98568CD5CFD18FABBE9D17265A9081E7BF64155A2CE3C0DF7 | |
4889 | 88D00671AD65654709589BAD7EA65BBA811387ABA5CA0BC3F66D3D48597A0D1D | |
4890 | 2C268375DF47CCF62166262AE4840AB03BF49BE67A05EF66328EC729F03CA5FF | |
4891 | AD3937FC053E223303565DC771ACF32E63DFB96D5030E787961D72D02C195C66 | |
4892 | B48E9AF0309DC169CFE8D16E2818DA94693A18F027DEA0D916672480464F7E22 | |
4893 | CA6E431FE38D3FC019BDD229E064B72C545C61C6EA55984565CCA88ACB01F744 | |
4894 | 3B4593CC8944C70F30925FB48A16342CC26D444F54CA15E5A624C4A2DAA2AEF8 | |
4895 | 404145BBA339F2A2D6FC2F3ECE54387761CA1213C8D56FF96E37C6147CA44B84 | |
4896 | 262EA87E7CC10D931E6B5B80D7F09813498497AA84ACB4AC69BC6C8481ED2953 | |
4897 | 084F560D7B1CF90555E69BD2AF7C5D944E8E3506165014652462BE1BC81CA341 | |
4898 | E1B0725159D36DA0FFF3577D1DEBC5D91AE683FB0384 | |
c302751c CR |
4899 | 0000000000000000000000000000000000000000000000000000000000000000 |
4900 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4901 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4902 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4903 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4904 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4905 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4906 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4907 | cleartomark | |
45c0f7f8 | 4908 | {restore}if |
c302751c CR |
4909 | %%EndFont |
4910 | %%BeginFont: CMMI12 | |
45c0f7f8 CR |
4911 | %!PS-AdobeFont-1.0: CMMI12 003.002 |
4912 | %%Title: CMMI12 | |
4913 | %Version: 003.002 | |
4914 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
4915 | %%Creator: David M. Jones | |
4916 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
4917 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI12. | |
4918 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
4919 | % This license is in the accompanying file OFL.txt, and is also | |
4920 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
4921 | %%EndComments | |
4922 | FontDirectory/CMMI12 known{/CMMI12 findfont dup/UniqueID known{dup | |
4923 | /UniqueID get 5087386 eq exch/FontType get 1 eq and}{pop false}ifelse | |
4924 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 4925 | 11 dict begin |
45c0f7f8 CR |
4926 | /FontType 1 def |
4927 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
4928 | /FontName /CMMI12 def | |
4929 | /FontBBox {-31 -250 1026 750 }readonly def | |
4930 | /UniqueID 5087386 def | |
4931 | /PaintType 0 def | |
4932 | /FontInfo 10 dict dup begin | |
4933 | /version (003.002) readonly def | |
4934 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI12.) readonly def | |
c302751c CR |
4935 | /FullName (CMMI12) readonly def |
4936 | /FamilyName (Computer Modern) readonly def | |
4937 | /Weight (Medium) readonly def | |
4938 | /ItalicAngle -14.04 def | |
4939 | /isFixedPitch false def | |
45c0f7f8 CR |
4940 | /UnderlinePosition -100 def |
4941 | /UnderlineThickness 50 def | |
4942 | /ascent 750 def | |
c302751c | 4943 | end readonly def |
c302751c CR |
4944 | /Encoding 256 array |
4945 | 0 1 255 {1 index exch /.notdef put} for | |
4946 | dup 58 /period put | |
4947 | readonly def | |
c302751c CR |
4948 | currentdict end |
4949 | currentfile eexec | |
45c0f7f8 CR |
4950 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
4951 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
4952 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
4953 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
4954 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
4955 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
4956 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBFE3573BF464E2BE | |
4957 | 882A715BE109B49A15C32F62CF5C10257E5EA12C24F72137EB63297C28625AC3 | |
4958 | 2274038691582D6D75FE8F895A0813982793297E49CC9B54053BA2ABD429156A | |
4959 | 7FFCD7B19DAA44E2107720921B74185AE507AC33141819511A6AC20BC20FB541 | |
4960 | 0B5AAEC5743673E9E39C1976D5E6EB4E4D8E2B31BEA302E5AF1B2FBCEC6D9E69 | |
4961 | 987970648B9276232093695D55A806D87648B1749CB537E78BB08AA83A5001F7 | |
4962 | 609CD1D17FFA1043EB3807AF0B596AF38C91A9675E2A53196FEF45849C95F7DC | |
4963 | 182A5EC0EC4435A8A4B6E1CDBF9A5AF457564EA72BF85228EB6FD244F2511F5A | |
4964 | CA9B71A65D53CC06EF5F7EC3A85106139A4D312378BC22183C09A229577B793A | |
4965 | 1B7422611C03E84BF809F46C62CE52D3AE29CE01C32B202ACDAA5B72733EB0AE | |
4966 | C31D7EF7BA88D2D14F85313F7A8B9B7A5B124B03AB923744D336C969E5CE304D | |
4967 | 3AD977A46664479EDEFB69F113024E761C05FA48A54072DF9E12C2F352ACB3E6 | |
4968 | D04F6EEFFDE209E7FA3DA22E5B1D1409461F4286B7F4F8251B44E5CB7805762E | |
4969 | E129FF4A06A7458F3191926B1CAF70E32C6571AD2DC07C34FF62840896F4D200 | |
4970 | 761B1A7FA356526D1E3AB4C542AF13623BAEB9F61B1BEEF79A9205B1FEFDAE24 | |
4971 | 8799D516A9ACC30BC0139C63C9A0523E9D5439213B67D490C96F902958779B8F | |
4972 | 68BD8E9FDDCE8A3A2E35877DB6C94B7612382ED8F218EB1157D2ADD090A2448D | |
4973 | 10B99FBC9211C5629ED1C61C74FE93041E5AA03EA4AC3FFDA00C2B6E719CFAA4 | |
4974 | 262FE17F66804A6B54D3669836EE4367D2A2991580C5564463C973CA0DA38AC6 | |
4975 | 922716E13B4A807B50304B8826CEFEAA47C305FC07EB2AF25FA7945797237B16 | |
4976 | 56CDE17AB0834F5C97E0CC5741B061C6FF3A8DD1A79B9A173B66A6A750538E26 | |
4977 | 32FBC92E75BA15CFFE22A7302F47908547007402569158F62C29BA2956534FEA | |
4978 | 7DACF1E507AC309DAE8C325F2A6023D2FBD81EF42146BFCE6A16A6310A650460 | |
4979 | 7B07BB7647C8760FADDF0DBBCD3DA6CC4645D1732DB3A22D8B76E1D2D48E4D4A | |
4980 | 46F4BEB80CE65F3517283A1AE08391FD1C10ED452133706BC6725AABC80107FD | |
4981 | 754A8BA47B0281D479F052CE26A723EFFACB79B213041A536542AB334769A2BF | |
4982 | 88505D82C498ABDD5A73EB539530F47CAC52825D16A969C8BB56D4A7F2830B8F | |
4983 | CB63B92B576E7BD922A4B25E634751F8A3B7C4EBAFCB373EDC8B8281B1D1371A | |
4984 | 7844E9AD990CFF09F0D7ED73A5CF873D2D5C9E8A9923CFA31E1A4B4CCCC40760 | |
4985 | 8B3AC8FC3C88BC08BD7407725281BB879A1A822D94997826418F1B89D303F2C0 | |
4986 | BE7A0102E6F529630CBF1BC5BF3E4578C164A3DDE45E62A957EF3FB7F0FBBA6B | |
4987 | CA1E79A1ED195B6A11CFB345B663C5E72FA55D80476F604F6C4257B51686AE25 | |
4988 | 8F7D159FE605DDA0AC74BAA5034F29FFFD403070013C6E2D8EF6A0990D91173B | |
4989 | D5A3AEB98B64E412991505C3CB7C2CDE13C091FEB3DFBCAF30C4C19511102300 | |
4990 | 135BD5D444BB55692013F52056908DFAB2ABFACE81A58423ACEC59344CEF7D4A | |
4991 | C5A3EFFFFF70759BC3E593D878281225060B97D1BEE6B26EED90571FEAFA1812 | |
4992 | 1115C0EEC892F5DE6FDD68321A0B3F10A2D771B79BD85476AF6018472A499A86 | |
4993 | 07D64CFF4550866AFE590C471C80EB12CB3A989A60BC7BED39097C12D9286E39 | |
4994 | 14C7952C4C64820B4DE44A1827B7B0B535244E93FDB80036D6332F90F95B472D | |
4995 | 7031E7E3819E881BD0313CFA112EB3AAE943C99C47635CCA7E34DC0306C04E5D | |
4996 | 2E9F60FF037EB11602BE74E8E6B711392E866E3E55D988F7C856417A2B9C186D | |
4997 | 639819B4786D039B77F8578EF63C088FF28BD08D8353031445C8498A8F445BC3 | |
4998 | D08923D32AC04BF3CAFEFCCC1E77EA894F4E846F47EF62D6841B8D8576FEAE8F | |
4999 | 90044626869D04D61D64D56E8C51AF8C18D6CC3FEF3B6C4F7D56FE3260354948 | |
5000 | 10104F69B117FB8269292579A7D52FED688C663B643D8D99F13956612271073E | |
5001 | 1A337AED059B7A93819A28CDF01569CBEB51069D22ADAE25C47355560F402B2E | |
5002 | 8C9900DA82B79C64497C8494F42FABE5AC41791C2010D98FB7E593C744F250DC | |
5003 | D837DB0EAA4F75D0016970F3AE8359878A08CF9A697A06C5EA945819151265B9 | |
5004 | 1A12122B98F79185DF852257BB4798E7DC03712EA6ED34F6E6AE1476788DBC33 | |
5005 | 9229FADB8D581BE1A63F596698DBD6DB98A092F67197A4FD4A50B648F2691875 | |
5006 | EE2495D6BB310078F516785A0CEC7EB6E8305FDBAEB1D15690409FE32DD9CFAE | |
5007 | DBD3866FB63EBCAAB73E3E4BE5D7F3AA44793938AAF3F8341683F0790F1D46A3 | |
5008 | 60CE083F9BEDDA22E0639A92393960F86602216FA51E2754BC2F4CD0BDECE3D8 | |
5009 | FFAB7E0E49613DD4956C9A10AEA798BDA1F756C755BEC12147ADECAB0FB73B7D | |
5010 | 203A11D84DD2AB5AA98FD38C1C2573570FD49A4924A94A106D2A7D850E793608 | |
5011 | FB135853E8C4204441CDBE697FD0CB330B1C3596F32D2BCBF263237EAB362D09 | |
5012 | DA6F531B40384DC91F30674760CA7B64BA1968F6A7FC9EBEF431A1AFC5E76D7F | |
5013 | 2D44DCB7F61C7F6B16196B3E8B47343F572DBA8B8B21B43E35BB6B2DD5C7982D | |
5014 | 244FD4304D254D6CCB5E8CF70E77F50812F41A988EEB3B26BF0F6F69BBA18077 | |
5015 | 31134B5A5823D10FEF6201D045AEE7A24E0F25376E9FC66340C56C05F6CD810B | |
5016 | 724D85CC4BB8D789834A447CBBA159565D08BA5793D8599035BB5063271518E8 | |
5017 | F6C50E7DCE71B1D186270DDC860C6DC0CD506010EB5B1FDF6BE47A9A18CC15D7 | |
5018 | D657E58BED9EECAD5CE5D49F63139A39BC52C6584BB2C3264D51BD584B40F8EA | |
5019 | AFCD8B83F548594386EB2B05CE803105E84931DC6E7A1398073D48E130E0D907 | |
5020 | CD0F1ECC3254EDF5D4DDBF44415DC9BA66C673820CDB0FDF033D59BE2B5EFCEF | |
5021 | 01FF9D33EDC88F8D522E07F1689D024DBCD09A16A63519E1764C8630FF36058D | |
5022 | CFC07027E0ECDA01E0E85B166C613B22F587B4D355EB018BA93E92A36007B4DA | |
5023 | 287FF5A91F7D8A0EDF5554ACCF45AC8066E88865C5692E63EB99CAC81367B605 | |
5024 | 8E6C19EB98EBFE0D2D161B447B9A70CDD1122C7B78A413369016E6D8481E2AE9 | |
5025 | 9AA97B5DD0ACC9B0820F7742CEB2F46F89F3E2092621969A88DC0156B4F941A1 | |
5026 | 6BF1546D4B136657C47B082A8A35FE96016BAF3D9679B8C32EDDD6AE6DF3BFB5 | |
5027 | 7854074FA019707FC22BFA82299E72ADF9A980AE29A8E2434277E58B01F6B03C | |
5028 | 192E1E25DADD49F6E3F69799AE62B56E00B60A031BF8721DB8B2CB6D4A4C15CA | |
5029 | AB1FDE010AB7DC0DDED977389B101B8E53A949222FAA126656E02817DD32B0D4 | |
5030 | A49516CEC2B97EA7C78FD66229B044EB92F502384BCC6CCDFFF995EABE3BB7A9 | |
5031 | 50D5D1AED861E7D3BA8D333026C673C5762712E763E59261426044583D789C67 | |
5032 | A606B96F97663F92BF104CE02FBFDFC521EC0D6670B7D4F85A229F51426DE912 | |
5033 | 3B729C4A535FB7C88D0A5E78074751B58885DD6BDD2DD9E9C83F105E8CF63DDF | |
5034 | CA7DB39D0319CA7CC2E73F42747F007574DE25AE1538B4D493D22D0D5F0F80C6 | |
5035 | 5F6FA3937C8391DE2F0116F81DB2DB0EF751EC838A7F85F163A6F48804E84B96 | |
5036 | 8D715EF25B7E2A5CAECC558D80F421052A1D698F3B8452AC27E30A4E6226E3CE | |
5037 | 084C8A83ADA0818A110923CF7AC7AD4CB92AE4ABBE0A9EC1FF935FD02774C1F7 | |
5038 | 92A278E513012AD17722A23C55EF82E18F8847B5CCE47F4FE3EC508BA563F7B2 | |
5039 | AE56C94285A18DED4D432FB0CEFC05A20BC17DDF9FF919C724810A8ED7358A27 | |
5040 | 97EC93C1A13C443A91947FE1F6F528EA7B628917FA7E554A1D7B31ED46C5ABCF | |
5041 | 92BA57961C8876DB4041305EBB029B03D8351D5E2819FF87E97ED214D8F1CEF5 | |
5042 | 7F7668DDE223721C0B810F4A4AC81CA4EAC86EAE546E1B15D91E626FB9A31824 | |
5043 | 5BFF17C4E79FD56ADBF6DBF01BAF6453A81EBDCB38A5FC0FD0FF0646B3B0D199 | |
5044 | 13E2E59A1B5CAB6DE5329BE389BA0E2A2AB55CA40B711ED746C24F1E48892E76 | |
5045 | 6DACF7DA163CDC90CF076763008E7A899870CDED5A80758E6177BE6B93B07EB1 | |
5046 | 5800A3BF7B9AAC3FA825CE594EF5B7546B181375FA8F37608DF17856D2F8EBD5 | |
5047 | 6030A9E6F6BEAF224AD2AEF76D03B023E2FCB922CB8E3C6816AABB61FE6E4F83 | |
5048 | F21B4935102C860ECA03DBEFCA461F0E5B93E5A8D18440BCF7D1D6252A24CB6E | |
5049 | A64FDAC8B67C4888519AA368D9C4A8C08C7155DF5BACD75C5196C571C3C456C4 | |
5050 | 7CE8D90215FA6EE8CDD72C48740F7F5930EC3632DB63A9C8D2DA125088C0F05A | |
5051 | 9FC83D16B7F53163F4EB6FF372C6C3115F1E68EB35967D11126EDEDF0BF80817 | |
5052 | E68A698183B3EB0A207DB43786E1B9D289359D75AD5E465328CAA90E712C2962 | |
5053 | AE2A466173F2FF30EB535A6054BB0B875DC8552C16B49DF17CF84D98D35497BD | |
5054 | F55E273FCBB0C735899529A69990E09149FBD2DDE64B7FA8D50AE83925DF03C8 | |
5055 | 0B63EA158FBABB12A028803DA4B9DD6C48C0FEC469C4E730729F4BB420D5B003 | |
5056 | 1918B4AE9CF35CFD31E8E62A44C0484E3D00143BF1D330235E821E5CFEAB4D31 | |
5057 | 7CB4604DB1F310457FCF9075A3527279644D908DE847CCD00B6F50DBDEF91D3E | |
5058 | 38238CAF550FDCABA2C3A46237218DCC5A09AFAF69997E1EBDA7EFE6FC99ECC8 | |
5059 | 5D4AFD5EE35FE2346BE79B499EC8EC436868154A947D13BC02C780EBA4B9E64F | |
5060 | 3026F1BF5DC1F8D64FEA1281EA40B4BC355638A3A59BD9055BCBB232FA45EA0B | |
5061 | B405131B64F105814019BC55466EE78E9E9ABB62DB30EA452F7EFD7196C76A85 | |
5062 | 15B2CFCD89922CADC0F392B0C54A231F3999AEFB53C24EB0C63B0C8A1A1ABB6B | |
5063 | AAB2F93E5ECC7AB90EADA320E918106BAAFC1F8C425C617639984629018BA674 | |
5064 | 6FF4F338AC43E23BC3740542911C058D43A49A11CB3A0CC8E3088BB5BA6048D6 | |
5065 | CC2AD250DE956BFBE83BB24C945C20D9C22E7105983F284EF478F9B68BFB0322 | |
5066 | EEB7D62802CBAAEFF1C2332159DCC7243EA40CE15C734EA905E04C476B178B82 | |
5067 | A08ABCB0B86A7330C75E62EE7844C9E22DDB013ADDF20AFE08122EE1B930A81D | |
5068 | 806A0F8CC584CB7FF5F56F9B35E5FF78FD93E7E4A40C64537464EAA275FE88F4 | |
5069 | 461FC6A467C8A69B9A9FBC10D44AC1B753D313A8E7D97F5FAEB60F82855658D1 | |
5070 | 4DCEE043C8FCDFD8A29DD091F3BA55874A458B2B8989F35055C72FC411382361 | |
5071 | 9AADC717E602B48D7C9521D3971A6F7EB19D539445DDE9EFBC5B58FA9E5E426C | |
5072 | 172C45CDA24985FC4632287FC3B15849DEB56F5A061993AB10A6BC59868534E6 | |
5073 | 69888175053108B77E4978D971B4EC57224C0F93EEA4C15AE92254140A94704E | |
5074 | ED5666FC06C5341F643F779CC88A9E81891565C63B6F7F6286E664F4E0A48690 | |
5075 | 356DC96F1B98026C563700772485B83BFA06435D4E0793EF822F423C93FBACA0 | |
5076 | E5D889D2B76771C6F0EE997A5DB43C2F6921132890406E3C33F6F159B14C5D78 | |
5077 | 7C151BDFFDD02B697315F191B5490073EB418A4FF2A398C68D44F0CD1B87CF9C | |
5078 | B52F12728B72F94D752D23151196A256908135C87991E508B8906CE2539DCA8A | |
5079 | 31F86809C8C6C18A09F6129BD7CDC6B37E76B648788056851F22BD3E3B5772FF | |
5080 | EC01D822B57FFDB3BAE624F05531292641FD6A7E3666152D18F6C653048DD7D7 | |
5081 | 98A942C840C4A0FA662F260B21C64214152BB86F03662A330109C5AC0A5EBA30 | |
5082 | C6201F558858130703DF76AF4FBBEE069BDE45C0D9467077D85FFED4F9BA9C61 | |
5083 | AED87D67CDCA453A6528AC5BA153E1039D9CCC556CEA5CBB542265FF54A1B208 | |
5084 | E0E13740E7E7C26AA00AEE909F8F3ADC2726081A744D8EF6BB711BF5F611A900 | |
5085 | 76F91C26A338DA13A7160A9F42410CCEB3190000D963D036FDA05A29F598EF40 | |
5086 | 8FAE6F8E7E6F50C99C3304A573501C13A00023085F057DF331E3354CBE65D573 | |
5087 | CAE73BF15B3B96B502E0AAF2B4A86237E98A997AAEFFF4227D5A26E8972C48E7 | |
5088 | 761F430733E6EF8AB2D903C17FAFBFA21C25F8A0AC157D397BF3CC1AE7598F0A | |
5089 | 2BE4FB46B29443CE57F41FD5F91122E9D86F903E94D5B55E2BB95949C156D138 | |
5090 | 89883BEFD634311F9280C7F028DCA6408D3A682DF5B55B9F7ABF08F019190F60 | |
5091 | D39E4F0E80F0594235B09A5320109638B938633A2C196E4ED2B43DCD8643C3CF | |
5092 | C6123B076B7F73352F906D96FDE0FBF50CCCA432712C574D5857838BAC30B485 | |
5093 | D25024EB254A7EFE57D1DF0892C275CDB3DF77602F0FED0FAEBC644BCACA04B8 | |
5094 | B424DB125E487794CAB36E01B5E1A26F5E1E97A739AA36D77A12F5B45338EB39 | |
5095 | AF36CEBDED55DCBFCF497FD475FC6BAB5530AD6153C6BD982564EE8712185F1F | |
5096 | D5EA7ADF4104661168A01994C1FD773A50C8AD6A3E4D332E4D59521BB8BBC6C3 | |
5097 | 866EB4AC3EA4532477E6CBF6BBF0860031C3B916AA25E3492670EA67F55CF4FD | |
5098 | 207C684A0DDB6F4AD21B2909CBA71BCE2E762012B0927BA72367A6AE0AF87F73 | |
5099 | 756C9BC85E4EDE35317E2CCCD138C02C7A8013AFDC1A48C3A4BB8EF257BDEEA7 | |
5100 | 60E012F54D12D31D18DC59D5E526F12567B8688B4B67E16B56713870300016BD | |
5101 | A3B9DA87FDC865246AF8E94316799110D86B1DDADB8A673402D4226C519C058A | |
5102 | 1D1E5A5778584FC28AF12819B1924060BC4F54B1054EA6AB0149E04B8C4302D4 | |
5103 | A56D8A347EB5D3D2A0E12CF7E35059BDB53D9FF6BD25F6D9619BC4669CFC1048 | |
5104 | C6C9978B8751B840F27D82A69075832BE59F55C1737CBB1220FB8FF691FDBDF3 | |
5105 | 03BD7D225A9372AC221C38245E48320E1CCF898D9EEDD678E5B8C65B7F588321 | |
5106 | 1A3953EEB9B39EA9A8CB72DB08C3E9234DFFF5FDF9DF804C021D57E97DA7622B | |
5107 | 97F4CB6E0EB640E0DC9EA15C5193F92A3A7565F4C7A4C9CC327F7CD2C44900AE | |
5108 | D9E76FFE62FC37FA376E77131B566AE67C3E09DA80F198BBB995EE8FA47EEDB8 | |
5109 | 4B467C6C7DB8AEA745CF8C56B8BE56534E9C56FCB2B7006426DFE93D728FA4CF | |
5110 | 94F131C549814E54ECE7C914C5FE8E4961D3437CE7475D03534B62650F551D97 | |
5111 | 201C794AA877445DBEB11C85ADF6119B05360700F8CEDE4766E3A1D7A35CDDC7 | |
5112 | 9ABF7C619E3868A39D1852DBE1EEAF5D7898C78323873AC005542B68C43C5000 | |
5113 | CC58F675EB595F87C879694751494676465891E8A897158B481F11A171CCBBD7 | |
5114 | 29603F00210CFD7FF31FE3D273933ECC34AFBCC4108D9B76D9ECE63EA06CF939 | |
5115 | 4799092A54A749DACB82C1424E9879672C8BC084C360014C9C1B6D5D65C68AED | |
5116 | 66CE329C3AD712C0A36BE7EF03FDF339CAA2E0336D387A693B1DFAB5D5164E31 | |
5117 | 14755A158168962C9B399F8F1DF3FF5060D7464D5071058C30C572A2BC7DEE53 | |
5118 | 84BD7614A4BEC4C84E18CF7EC81C811724463BD46CECA5FB57B0F55EAE20CC74 | |
5119 | 6AD815D1897B037C197D2456797B992C20C70B663BF99FE28C513B4E221C8E12 | |
5120 | 49779F8C0AE8517048ADDF7CDF0D698E3EFE60071C4997B7F5EF12B6CB65390C | |
5121 | 224F13FBB99FFC034C0710F05019899689B6D3350BBA65C7CE7C2AB03D81B9A5 | |
5122 | 5F3D65E4D462DAB189006669F7390A78A1B8908A4C913B15DB8827DFF15BB9A4 | |
5123 | A6037DDB643103B937257A7DAB025F09D53FBBC2BCB6B0BCD8D56B2B2784E498 | |
5124 | 1F6CF8470DCC892AD0CFE11578718948BABF9C1427084643B66BB9181094E29D | |
5125 | 5FBE37708E1D8A6B7518A96876844CB66954227A7A6AF28DD075A462526DD5D6 | |
5126 | 40EECC56FA366106E55C7068997B54B7F0D03AC1AD45D28C67C7ECA99DBEDB1C | |
5127 | E18A79C353113E2E05B837E703278B202112B1C69E42A69D64B62F0E7D8F7E5B | |
5128 | C1F93F0F99EC20EF312046F4B0CD7DAB31E422070B629A7FA96583CF3F1519CD | |
5129 | CF08806F40ACD7BB5C960F21E9DA7FB3C72CBA0801ADE83DF738A4EC94F2977D | |
5130 | 2B95A166BA4AE28CAD1E37FBBF49D342CDB4DF615E2C5F3076313AC517C350DE | |
5131 | 710F5D52DE31DF69864D29DABF14234DF13904BA4333B0D714EEA55CDD79DE45 | |
5132 | FF5D64259C877191547076B1C7684CD252C0337BD9DF66CDC5DBAA4F3102F2E8 | |
5133 | FE48385C55727B80D11F3BE0B7568AA9356FB2B180A6B1392D620DED02F0B736 | |
5134 | 5F4399FB9D32DFBC8ED942AD311C82250DA8BFE98D65 | |
c302751c CR |
5135 | 0000000000000000000000000000000000000000000000000000000000000000 |
5136 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5137 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5138 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5139 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5140 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5141 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5142 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5143 | cleartomark | |
45c0f7f8 | 5144 | {restore}if |
c302751c CR |
5145 | %%EndFont |
5146 | %%BeginFont: CMSY10 | |
45c0f7f8 CR |
5147 | %!PS-AdobeFont-1.0: CMSY10 003.002 |
5148 | %%Title: CMSY10 | |
5149 | %Version: 003.002 | |
5150 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5151 | %%Creator: David M. Jones | |
5152 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5153 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSY10. | |
5154 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5155 | % This license is in the accompanying file OFL.txt, and is also | |
5156 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5157 | %%EndComments | |
5158 | FontDirectory/CMSY10 known{/CMSY10 findfont dup/UniqueID known{dup | |
5159 | /UniqueID get 5096651 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5160 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5161 | 11 dict begin |
45c0f7f8 CR |
5162 | /FontType 1 def |
5163 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5164 | /FontName /CMSY10 def | |
5165 | /FontBBox {-29 -960 1116 775 }readonly def | |
5166 | /UniqueID 5096651 def | |
5167 | /PaintType 0 def | |
5168 | /FontInfo 9 dict dup begin | |
5169 | /version (003.002) readonly def | |
5170 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSY10.) readonly def | |
c302751c CR |
5171 | /FullName (CMSY10) readonly def |
5172 | /FamilyName (Computer Modern) readonly def | |
5173 | /Weight (Medium) readonly def | |
45c0f7f8 | 5174 | /ItalicAngle -14.04 def |
c302751c | 5175 | /isFixedPitch false def |
45c0f7f8 CR |
5176 | /UnderlinePosition -100 def |
5177 | /UnderlineThickness 50 def | |
c302751c | 5178 | end readonly def |
c302751c CR |
5179 | /Encoding 256 array |
5180 | 0 1 255 {1 index exch /.notdef put} for | |
5181 | dup 0 /minus put | |
5182 | dup 13 /circlecopyrt put | |
5183 | dup 15 /bullet put | |
5184 | dup 33 /arrowright put | |
5185 | dup 55 /mapsto put | |
5186 | readonly def | |
c302751c CR |
5187 | currentdict end |
5188 | currentfile eexec | |
45c0f7f8 CR |
5189 | D9D66F633B846AB284BCF8B0411B772DE5CD06DFE1BE899059C588357426D7A0 |
5190 | 7B684C079A47D271426064AD18CB9750D8A986D1D67C1B2AEEF8CE785CC19C81 | |
5191 | DE96489F740045C5E342F02DA1C9F9F3C167651E646F1A67CF379789E311EF91 | |
5192 | 511D0F605B045B279357D6FC8537C233E7AEE6A4FDBE73E75A39EB206D20A6F6 | |
5193 | 1021961B748D419EBEEB028B592124E174CA595C108E12725B9875544955CFFD | |
5194 | 028B698EF742BC8C19F979E35B8E99CADDDDC89CC6C59733F2A24BC3AF36AD86 | |
5195 | 1319147A4A219ECB92D0D9F6228B51A97C29547000FCC8A581BE543D73F1FED4 | |
5196 | 3D08C53693138003C01E1D216B185179E1856E2A05AA6C66AABB68B7E4409021 | |
5197 | 91AA9D8E4C5FBBDA55F1BB6BC679EABA06BE9795DB920A6343CE934B04D75DF2 | |
5198 | E0C30B8FD2E475FE0D66D4AA65821864C7DD6AC9939A04094EEA832EAD33DB7A | |
5199 | 11EE8D595FB0E543D0E80D31D584B97879B3C7B4A85CC6358A41342D70AD0B97 | |
5200 | C14123421FE8A7D131FB0D03900B392FDA0ABAFC25E946D2251F150EC595E857 | |
5201 | D17AE424DB76B431366086F377B2A0EEFD3909E3FA35E51886FC318989C1EF20 | |
5202 | B6F5990F1D39C22127F0A47BC8461F3AFDF87D9BDA4B6C1D1CFD7513F1E3C3D3 | |
5203 | 93BEF764AA832316343F9FE869A720E4AA87AE76FA87A833BBC5892DE05B867F | |
5204 | 10FA225E233BCFA9BB51F46A6DF22ADCEACC01C3CD1F54C9AEFA25E92EFAC00D | |
5205 | 7E2BA427C25483BA42A199F4D2E43DFCE79A7156F7417ACF78E41FCA91E6C9EF | |
5206 | B933450D851B73A6AB6AEA7EE4C710CB5C14270D1674FA334686653793FCB31B | |
5207 | 491E870D3C2BC654D2C1DE463EC9BA29D7371AA1078800EF93D3F66263A2EBBB | |
5208 | F5723697BF7448BD0D2E301544BECF497FD475B85DFEF52AF4F8F8BE445CABE6 | |
5209 | 019318806D10C5952157FF8F8286C1EE701545C8F60EFA854EAE66835A2046A6 | |
5210 | 915D395F1E0366EFE0C0391583FE001FF16D82A2E2DA5F57754A2C6F69306E36 | |
5211 | 356ECF8EFC3F1188AD6FCD2427E0580C97A5B69B4E0E09B85EEDE142F5ADD2F0 | |
5212 | 5DE51D6DB72B127412A0D57106C19CA493048A4F815129ABE767D51715B1515D | |
5213 | 9C21067CB5BC88741B7298C83EAE36A866DFA87D8981F179B1C31292F56BBB64 | |
5214 | 3C430779468AAF07C8A8B4934E1E775FE3F35186BD1FA6EE3689C1C750678AF1 | |
5215 | FBF9B23195A124C5C991FE670AC0C86FD39D2B07B9A319E74EFD498B45820252 | |
5216 | 720ECDF7294F7B0B137CEB86D33BFCEB8606985A3260FD669E461C8BE94216C5 | |
5217 | D434FD8854F44EE66E5A289A9F9E32BC36AF645D53F96652602BAED418C8D726 | |
5218 | BD04A1B4617551FE4DEF54083D414F7DCE004E6BB2DC9C2EF7CE232B254BA2C5 | |
5219 | 7DCBD36C2072ED46FF711F121A701E2284BF1B718B3164382B8F453D68FA0377 | |
5220 | DFE106503B8401D4DB87F5402A3AC9A442FA060B0610A9524D530C7157C26B56 | |
5221 | AC970FCC1D5655FFFFA39246E6420CF97D08ADFB7B05822679BD40C638DDF0E7 | |
5222 | A97BFE8918B611A145AC965C203F1428812F9D340AF499B3A915B22BE798594E | |
5223 | 0F520109FC81E452180AE45B170FF999C5FC2761C6CECD8742A5A6FC97F16743 | |
5224 | AD4EFCC6572A6D3F3E4E330C5CB2FF6FEA48A5B64DD3DBE943BD9918D4A18E18 | |
5225 | CBCF598AEFBB6AB3CD2CBC9BFD6099272F6543F3E532E0E21E614BD2880B1023 | |
5226 | 0AC234CB705827BF016DB84E00E8C255FDEFA0101A842929540B7B4AA8A089BD | |
5227 | 5EFF05B72356B6BC3727817823B5CDBB1B963103000D7F2A4E2A1472FC3E614B | |
5228 | 5CBCB6D6D784023173DEFEBFA8F9ED87EC1A0A9EE98CA59CFC964CF943DC683F | |
5229 | E9E00DA718C4425A705A69D99988EC6F152525C790912C2E46A2381A569424AB | |
5230 | 54DF4798BC2D7E7A361E7991641D4B756CE2A7FF4A2848927092C59C2C4B8809 | |
5231 | E13AB84FB6B111E680D7FB9F2FFC2C5C66B0B501E4447C2E46C10E2F6124476F | |
5232 | A140C404CFE2DC9E0199BF61E035CEB481D438139A9630934E541D261FFD2906 | |
5233 | 4CAD99E20655FA746AFB81EDBB5601F5FD6B1D6832A01D585E2C55053F6A7378 | |
5234 | 4DAACCAC7608DBDADAAE732D66B3E7F87E79756337C1A961E53A4651BE7C77F4 | |
5235 | 038B89C87F650C54A2A90EB7F1D525BB353F33318551EE8D84A6A83C718EA5A4 | |
5236 | B2AC0F7306B1E095819B87015A90CA3ED739B09061782C28CDB36BA4BD5E5308 | |
5237 | 5CBB70414E4112193DAC4A1FA30996327230D1E021F3CD8115E12D239D93FFDC | |
5238 | B645910EB29E40D830E7BAF2DB255FD7C4E776557BB38157917D993EAC245837 | |
5239 | A3B515147043574157B8342D829C7228CCEA843ABC89D1785A9672A5923FC4CD | |
5240 | 2F3FF27E6FCACF84E2D3136CA2C0FD3EF1EE7354CD04C38B5FB874553646ED2D | |
5241 | CEDF7E362EADD04B18051F20A8FB0DE18E152385B9D05F98A3A7EF177824E246 | |
5242 | 455ABE69E2F700EB78185CCFC07E3B4C6FA301112528D977367D30D0D5D59EDE | |
5243 | FAEB706DDC970A9E296236C725B2B55B09B9C336B8E23CBA5FB8692D56F33B03 | |
5244 | 16294E5FC7FAA42E96395A57CE51CA8DDD77442F142E2E576B778373FB31C81C | |
5245 | 16840BB422CA827E30A81829648BDF1CA36700EA32AD888D097C1FE0A05B2D9F | |
5246 | 483AEE40269DF09AF0D1AD3DF80C45DDC59C2A03FBB661C79B87853737C6D352 | |
5247 | 67626B657321B16198DBD6DB98A092F17878AE4698121E1006E53D6F9B0A3BE2 | |
5248 | 3FB68828EF854A0CDBAA68B37ABCA6AD4A3D809AAF0BAB1697A81FE59C98C472 | |
5249 | 1E33CD70A75A22C249DD11D76C2575ED3370A25892A16D2FD569CDA70C130770 | |
5250 | 93F493C7D47D6F9A5424A7A542BAD726BFC3AB225DCEBBE6AC4BE006F8C7C0EA | |
5251 | 051424B08305BF2D951AB2986AAFEA04E078CA79B399585BFF0F1ADCED02E15B | |
5252 | 8765EB6BF6A8E4D0901EFF2C3AA104924EAD9637A35D877E0C51A3C37DA78CD4 | |
5253 | 8643C8CE6DCDDE3F116A6C2390F948E5371BEB5AD2E87B41C5F01FB5C196C436 | |
5254 | 6E256A88D082E3F46E4EFFBF605B2EFF1E9D9AD5EE4DDC323A137CD9451EDEE0 | |
5255 | 06F7D82898D71FAF2362C0FCF1F726F97F820305B7CE20728CA08C63575083A7 | |
5256 | 84BA28B7DE2B916432475510E274C12FFD1660A717F51DACFDF0A102D85224E0 | |
5257 | D6DB607BB72569ABB8A7BC6A10354CBBC01732EFE35B72062DF269CB25EA3DE6 | |
5258 | DC603B04C90C5912D2C38D7A5ACDCDD3F6F116D884F0D8C528F69D5D47BA20DB | |
5259 | 0A9E585C7D8CC3C324FE8A1DF150279F7E8FB43BDB720E624E5E9918032C02CD | |
5260 | 8020636AE5C38DA2484B7F4B34163E0D0A561B43B80E97746DC05C871AB620EC | |
5261 | C5D47101ECED4A7E25F291184BEF8B80024AA7BB456C1B83A907652B331DEA34 | |
5262 | 754226C39C6889EBEEFDAD081E01EF8FE47751987667836FDE4C8BB8A3FD4406 | |
5263 | 1E643B4EA37BD370734D1A2DB17C2F4B74B4ED75098B433601F75A88C9A37A05 | |
5264 | CCB157EF6E32023BFA33973F3E655A4D58289136996FCFA61EEABD70791B6523 | |
5265 | 1FF5DE71AB8A17038923118A5EED8D59C4C58D246FFA9BB26472346B40C8741F | |
5266 | 153D19CAFF20DD2A86C6DB89154A630FB1761929FC3F0448EE2F089C1C953E02 | |
5267 | 905BA8DE75D101A982A611056C4B237596C10951DD98BAB838B742D3CF7DE718 | |
5268 | 617DB72E5268583223E37E029D1C8FD3F1D21690151F76B76C52C725CA135CA2 | |
5269 | 8666553E863CE188BFC9B99AF56AC2DB5BFEBEB12FB563D00244EB89E478657A | |
5270 | 98AF2E1223C1ABC25A4500E8119B86EB3C26B8A2F3505A3E5610F89B7C34E278 | |
5271 | 53FA0A54A7F46D84A35EFEC36AE660A9E3C37EE3864106702DE5AF6C45ABF64B | |
5272 | 888A4A51323138CE77DB935576FE6B4824B6942DF80625098CE1B5B32B234F1D | |
5273 | 052A9D6039697118A9D793793775D8729D8574A2E74D7109C7B7E23BC5E2E87A | |
5274 | CA8E019203952A4892544E1AD3D4EDD22971611358AB230E9A2ABDF00A288501 | |
5275 | A01B67C42B33F6B78C39562DB50F4663B922D9BE0D8A150311AE44B83C1F129F | |
5276 | 07337323E9A23211EE58E16043E127C6F9574019179F5635648A011266677B56 | |
5277 | B5D0201A4E1470B952A1579B57AB2329CD4C615395023C653F784D36B5EE3672 | |
5278 | 10D191F29EA508CE84763CA4CE7C2C5229E38E241255A5CABCD6C7CBAED901A2 | |
5279 | CA53B5E24111921CDDF83578D33D463D70EDACA0E470D8F592303FB6BFD68B4D | |
5280 | 3F3BE2D7C5EC8BBF10C90111A33E205F2649B56E8443F6FAA6C721C66575AE12 | |
5281 | D4C40F1F46CF9E9DA675AB5D5840D938780CD9E4AD6736ECBEB6A4397613586F | |
5282 | 849B51048AC5F9405E03E14540A5E5582F61CDCDB57EDDF95A8C6705F433EE16 | |
5283 | 648F098C03DED8A2AD94AE3DE202D629B9422ABB031318D48F2C85F9DBFA17BE | |
5284 | 84708AA3B6C9F81F4508F7A5CB7B6646AB8722ECF817877B77D473F577556DAA | |
5285 | 2BA0ABACFCF5DEA7498C47328E873019A956FBB250FD9D8885D21D368FA70CBD | |
5286 | 2709D2DA44EE7A9869963EAB48789541906DE49FAE785ECE1F18A22C7E7ED204 | |
5287 | 9768896B78E9EB7A2BD6EEC1B26083940656ECD689D92942CC8AF05CBF82AED0 | |
5288 | B45A7DF4DD7AA6526FB597322560B9ED3087A65B5EEF1371C328A021411BFE3B | |
5289 | D9B5088B2F1AAE381FFED52D2D1E02CD0DA78683E3B06171CBE94BE9760005D7 | |
5290 | 135893D7CC2DB097F6AC664D9594CF1C650F84DA80D2EDE04802DBA33CE3DAFE | |
5291 | EB7A37E8AEFA4FDA6252FF21E8673DD98E67124D5DBC7BACF361E57077B71939 | |
5292 | C1D1FB923E4E35C075CD1BCBE0E80DAEA1320D55B43EAB45D9B26C366B278782 | |
5293 | 7519FDC482D98839BF0DF2E7C3A56A1C1A3FC0E57A75CA414F6536C1FE8EB7A0 | |
5294 | 4ADFEE3BEDA0F53BE8CF5F64230784A797133E8CD46BCCB3BF38BCE38A73CCE2 | |
5295 | 9E073ADE792F7128231DDD1F63E6156ADB2609C200837C2E8A2D93D2A7BC9171 | |
5296 | 050C709A71E44E32B1B03C92EB5CF1D3BAB1C38E027DC4ED9AED633D98CD7486 | |
5297 | 3F773ACF8AE332631CF2ABE6D606607593FE862ADE31803964E3F4DC3CE3A271 | |
5298 | C76BDD95C87CDB3B87BC26FC7A16D567EEC62E6FF0D471B4853DB8A94D4CACF8 | |
5299 | 843824F818083F10E88D52FC4253E8203292CB40F1414AE7E51DD7347007C342 | |
5300 | CD70E8E9F2D2A13D71213B841DDEAAB208AD9EA644591C15DEB084165F9DF24B | |
5301 | B91D3BBEEC2E34E38EF16A0C3F00700A7BDCBBFED2EC0D09601AD6538288DB50 | |
5302 | 3478B051B5E16B604A0341FE621A58718D960D699D3FAD284310DCF54EB13175 | |
5303 | 19A75A539EE98E804AEA24689D3540F0F12951A3C01FACCE9A7BAF4D0DAFA946 | |
5304 | FF65A4D2A4C39969607272C6886F44E90ABE27CA3A1F12A29D9B32E60E8E34F0 | |
5305 | 17C5FE43D0E69A99A922D98909B2BBCD145E59A5E7F5426B3988F73B09A525F6 | |
5306 | 8BD4915663C1301323180E760BE81CB874B020FDA3AE63340E4261E4F3E4949B | |
5307 | CC0966BDC4426190BE9F5D77F76A72AD925662E5FE1CEF9CCAB68F0BD33DA003 | |
5308 | F11EB91AC4502FBD6AE48DA0F9D07C35B96B103E379B8A83A05FE728F1716194 | |
5309 | 1F650F75BEBADB2E3810388F3E2DC7B19F1BA9E32925F2FD9F19F4E8701F3E4E | |
5310 | 4069125D7C401144740691E7A460021A47B1E27997FC1DDABEC5BD0EE0B20194 | |
5311 | 2D579C7D6727AA124083242BDA46D8E116E2751C5F298851A62B60AEBE82A929 | |
5312 | 9B9F2492BA35690D1EFD16215B8EF14E7A3803B93C28FA41D971B05B6AF3B593 | |
5313 | E74AD1E68A5FCE12A86E63B78BFEA87D3949FD164F12277A4688BE96356791CB | |
5314 | 8671C49365608F3EDECC109321AF92B4C29CAF073DA3A7D73E913D0D83FAC5EB | |
5315 | BD884D4C686056404DAAAD6F82F94F803FA1FB0DD8908D1DF08FB87A8BB83027 | |
5316 | 04DE0CBB1C6FEB6B517FBD7CF065120079E608CE41893C2BC96A347826CCDFD5 | |
5317 | C69E161217F2127A59F1A6F22037641613F191F22D5B4CDCBCC2EE5615623404 | |
5318 | ABA7BE6C5FE475481615B2AC1A2412E54688DD21E44CC9AF5F16E634AFCA389C | |
5319 | 4D740B7B51BB141BFAD1080E7C726C1606A28ED492E6BDE9F800EFACD1513909 | |
5320 | 84E98CEB6A0B7A2A6F3E1D1DCC3B2552795E0932673E59ECC56DDD37A1D52BA6 | |
5321 | C3F0E905978AB568941A163F4CE3AAB5C5B16F86016EC47BA6F3F7AAAA77C3B6 | |
5322 | 09C8C3ABDB6D514A76ECD37C37AA88B5860630B3406B494F7725975596F84777 | |
5323 | D9CF48686EC9C5DBCC1D78513F591C7C10AB9D153B3D41426B7BF668B0D04503 | |
5324 | 56BCB686258462C1DC61095724B9F3312316262FD7C1AEC6E54DE7E5A7BD8EFF | |
5325 | 035299B8FD8A4A7B0F51404F4A760F4D8B4C0FB7A32FA4B2383AB6E9C78FDEDB | |
5326 | FE6A5788D38A6701B123630C2A6D820A684166FBBC83DB17069494FBD411B333 | |
5327 | CB37E2491C5BD035A33867A6D3A3D420CC31ACF43AA07182CAAE67E40EC63663 | |
5328 | B678F71D4C6E0EC3A0AAF904CD3AA66E0DE5E3CDE049E94249B39A1C06E3CE9A | |
5329 | F974B2484BB2CDA14282B9511E505B3C89F9C802218AE40D1A7541335C5736DD | |
5330 | CD565D4B9F4CC78F3A393737EDB4FBD0DA299E21CCFEBA5478EEF013F0552A8B | |
5331 | 0BB11FF46CCDB784E8BDCF730A16363E66572049E42C695886EAB42A9AD9094C | |
5332 | B635DF4B5B9BD9B9AE8455DFA3EEFC77653190F9A8B1E93B7281C2A21EA7DDA9 | |
5333 | 33484745BDF7E3DD63C7AC66C286C9A5A698A5E4D7A91710B7FF943FB23609B6 | |
5334 | 4B442F83CB795788FAB5E9CF3F75D5487DA26170E4561C7941C910B088C3B86D | |
5335 | F844B0F340CF82786A3FCF347048463EBD2006281A816627065DDA6CD4D3AC5E | |
5336 | 2024BC96C7D896381BBB567951E7A1F29D4E95351298B000D29E5F3D0448CB5A | |
5337 | CFDAE1BADE9403B90371C3A07D208948AFA022A69C519434B6813086ADF518D5 | |
5338 | 88E0B92072A44BA1B3EBB630A13B7AB90992E85B6D67361C8D96F3E0D826FF37 | |
5339 | 17B67E4B1EB7BADFD98D7F4FD17BECE740ADF13C141EBF0A91CB105DABB32FE0 | |
5340 | 55086D56A0D358841D15FD349E6B95512E4EDF4C430216FF85C2ABE995E4B40A | |
5341 | A6044CC8820AD885C07E052B3F91C2E9A1D163BFFD210F7BE95B923E2500DB50 | |
5342 | 2075106DB541C267BD450B25B670CE80BCD068D4DBFF2D82634175B61FBD3BC3 | |
5343 | 406131F44C7D6F18D375D1F2270829DDF29DC14DBB58A30AC193245D18DE91F8 | |
5344 | AB88AB548D8138605BB5A50073295534E314366E26665AE70482B890E4101D6B | |
5345 | 60E4F3B37ABCA1346DAAE8FDB8DD9C832EFF3E73BA470E2BACE7B8515CB43388 | |
5346 | C27AF99FF9322175CF8D4947E6B3846AFF5163E972156847F58A66660EC8A3A6 | |
5347 | 5FB47C9F637B4CBB4C73B6A080B0CF6FD1E9665E92032540570FFCC747C67C50 | |
5348 | 822811AADC404BC7ECD1673E8AA6C3A2F1D82F39430B58C29145E2F1B679C46E | |
5349 | 94EDC711883F1E4EA84117A54757E8895A40401A26E1437B39A2F65CAADD6E02 | |
5350 | D71FA8AF7453668DC613F326A3344F74AD7AC67569AF399385500ABDA5EDD3BA | |
5351 | 343CC5EDD4B558467626850E752B9959FEF1454E53E7A3DCBC2255AD8F6AB4FE | |
5352 | 894455118A61C58840CB68A925ACCAD75CEACE863D806916228F0614191A1CD5 | |
5353 | DC9BAE256018615AA3725834519449B0A88B4F396654E74099C007930ADB1327 | |
5354 | DD119BF799FE3B0B223E1EDA04FE2DA7A1C879143E1C33B6C6344F4BA033AD6F | |
5355 | 8E88C33DEF1977796B454BAB2494C930F492A518E8198C708A75FFEF8C49C324 | |
5356 | A718AB59B889DED521229E741FFE53F98EBE88B0405AD523254FD3FA4BBE96DA | |
5357 | DA1C27C1C979A0DD4E61C3B1F4C4DE01E42F1C4435EECFC02D97994BC8AF5270 | |
5358 | E7CB1458D76ED0229C5FFB4A23B8716018F9050970895D51722CDE8F2EA3D947 | |
5359 | DFF374D84915D5C5D16463A6FFCD079D1ED416C4347BF831FF0C4ADFB61295DC | |
5360 | 4D5785BB0852BF472CFC97EC174491CAF961AB90629F055E75DAA6D9898E8653 | |
5361 | 5BCF379816CAE46FEA62E7BE8E9B953466E51828172C4DBD0E1BBAD1CE28B5B1 | |
5362 | 02B3E36403BE80B49A47446A6677FCED438F01D60EB10F478C89528FA337D0D8 | |
5363 | 88D3FC123C076507ACDAF783A9A6E24ED73BF24B6E0F11C13E532DE5F70B15A0 | |
5364 | 657F5ED27D204449A841ED19E01432CFFE928E921321113780D036D34F2797DE | |
5365 | D4459CFD15BB117B5C9745EF3CD2B296D91FAD48C80B136D94476967E255F808 | |
5366 | AD2B5D522ADEC64176833756510391815A1D4A8DA1D0AEE7CAD36A1D161889F2 | |
5367 | 3347D5B6BC503300FDDD48F594F391D5FB42C42113C538E707C16EE24A3F375E | |
5368 | 7C506E8F49CE50FF9DEF3B4A4C1BEB3848EAA3477349833BA22D2A9012287D8B | |
5369 | A8C4CB4307A1188ACC0E6E9338E1559BE5FAFF381BD82A6C71C267409468B3C0 | |
5370 | 2C1A29F4281D565836EAE57F680490FEA4A952FF64C8CD11C377C294DCD1EC25 | |
5371 | CEFB2B6DCE959D0208F85B6E32E9B44FD455F9B134A5306D95EA29F37BB8B86D | |
5372 | 9E592159338E1293F449380E13C21AE42E6D6952083BFD432F72DFB7B6F9257F | |
5373 | 5784C683A6E9ACD72334E0EA8060A81E14EE32300055040E24B49810DFA1468D | |
5374 | A962DE1D1AEE09B49109257898F155A63A83D514996DCD2F96BC0F52796267DD | |
5375 | DA6229F5E9024F78B02154C27EFDB9B6E09B131C9E9E4DB41A0FAEDD93A05512 | |
5376 | A919AC8869C09FC929682B51174D816B85DADE28C00F6391429BA98327848AA8 | |
5377 | C52FEFEBB2296BB78F06BC1950A8E0405EDBA2D8C51F1F607E73F5A2173E5469 | |
5378 | BEB7918844D450B652DCFBC4C0D0C4AC2AD678B7165AA8F053B717C1D417ECF2 | |
5379 | 3A2909E864E503059135C05EA8F7CF185DA45CE17FA40B4076ABDD8B167B6F02 | |
5380 | 3C8962F09CE07257495ECE5357F755C48E49F4385DB5CE4FBACA3AD4D18E39B8 | |
5381 | F7057F4BF581ED26ADAEE218CE130B0CCCA0C7B273E51D7F314F53EC8EC84100 | |
5382 | 8292750A37A4D4551A5C2A65D2382DB0941409D83FE1005752BAD1980307F153 | |
5383 | BD7C92FC12AEBC7C04839FD7F01BC85F0880DB22FE524204FB924445B6B3DF6E | |
5384 | 1B657353086539BF4E60909524FFC4CCFBC8E0139F65F53ACF3EEC572C673CD0 | |
5385 | 64AB1C29253049B26888A322E0FFCF7DF8871F701CAF5BE7B509E090C43B4755 | |
5386 | B100C929D5A8A4B9646E8EB39F2E705006AD23EEC58E0E1CD0C18A346D8ED66B | |
5387 | D0D2E215F637D25EC4F05C449FF8E25250211635C9D5121EE0D51E712B7A8699 | |
5388 | 19E96ED8451ECBE97A7197337C65CCB44FA2522EF6735BFB60CD053EFAC10381 | |
5389 | C70053C2DB3B6DB8DAD720DA6DA25069131FD9759EC2182D1B649AE67FE4181D | |
5390 | B223BA15F5FEB0BBA498F9993F6A9C8DB9088DFACF064ECCB56FC4951EC8F9 | |
c302751c CR |
5391 | 0000000000000000000000000000000000000000000000000000000000000000 |
5392 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5393 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5394 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5395 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5396 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5397 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5398 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5399 | cleartomark | |
45c0f7f8 | 5400 | {restore}if |
c302751c CR |
5401 | %%EndFont |
5402 | %%BeginFont: CMSL10 | |
45c0f7f8 CR |
5403 | %!PS-AdobeFont-1.0: CMSL10 003.002 |
5404 | %%Title: CMSL10 | |
5405 | %Version: 003.002 | |
5406 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5407 | %%Creator: David M. Jones | |
5408 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5409 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSL10. | |
5410 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5411 | % This license is in the accompanying file OFL.txt, and is also | |
5412 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5413 | %%EndComments | |
5414 | FontDirectory/CMSL10 known{/CMSL10 findfont dup/UniqueID known{dup | |
5415 | /UniqueID get 5000798 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5416 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5417 | 11 dict begin |
45c0f7f8 CR |
5418 | /FontType 1 def |
5419 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5420 | /FontName /CMSL10 def | |
5421 | /FontBBox {-62 -250 1123 750 }readonly def | |
5422 | /UniqueID 5000798 def | |
5423 | /PaintType 0 def | |
5424 | /FontInfo 9 dict dup begin | |
5425 | /version (003.002) readonly def | |
5426 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSL10.) readonly def | |
c302751c CR |
5427 | /FullName (CMSL10) readonly def |
5428 | /FamilyName (Computer Modern) readonly def | |
5429 | /Weight (Medium) readonly def | |
5430 | /ItalicAngle -9.46 def | |
5431 | /isFixedPitch false def | |
45c0f7f8 CR |
5432 | /UnderlinePosition -100 def |
5433 | /UnderlineThickness 50 def | |
c302751c | 5434 | end readonly def |
c302751c CR |
5435 | /Encoding 256 array |
5436 | 0 1 255 {1 index exch /.notdef put} for | |
5437 | dup 11 /ff put | |
5438 | dup 12 /fi put | |
5439 | dup 14 /ffi put | |
45c0f7f8 | 5440 | dup 36 /dollar put |
c302751c CR |
5441 | dup 45 /hyphen put |
5442 | dup 49 /one put | |
5443 | dup 50 /two put | |
5444 | dup 51 /three put | |
5445 | dup 65 /A put | |
5446 | dup 66 /B put | |
5447 | dup 67 /C put | |
5448 | dup 68 /D put | |
5449 | dup 69 /E put | |
5450 | dup 70 /F put | |
5451 | dup 71 /G put | |
5452 | dup 72 /H put | |
5453 | dup 73 /I put | |
5454 | dup 75 /K put | |
5455 | dup 76 /L put | |
5456 | dup 77 /M put | |
5457 | dup 78 /N put | |
5458 | dup 79 /O put | |
5459 | dup 80 /P put | |
5460 | dup 82 /R put | |
5461 | dup 83 /S put | |
5462 | dup 84 /T put | |
5463 | dup 85 /U put | |
5464 | dup 87 /W put | |
5465 | dup 88 /X put | |
45c0f7f8 | 5466 | dup 89 /Y put |
c302751c CR |
5467 | dup 97 /a put |
5468 | dup 98 /b put | |
5469 | dup 99 /c put | |
5470 | dup 100 /d put | |
5471 | dup 101 /e put | |
5472 | dup 102 /f put | |
5473 | dup 103 /g put | |
5474 | dup 104 /h put | |
5475 | dup 105 /i put | |
5476 | dup 106 /j put | |
5477 | dup 107 /k put | |
5478 | dup 108 /l put | |
5479 | dup 109 /m put | |
5480 | dup 110 /n put | |
5481 | dup 111 /o put | |
5482 | dup 112 /p put | |
5483 | dup 113 /q put | |
5484 | dup 114 /r put | |
5485 | dup 115 /s put | |
5486 | dup 116 /t put | |
5487 | dup 117 /u put | |
5488 | dup 118 /v put | |
5489 | dup 119 /w put | |
5490 | dup 120 /x put | |
5491 | dup 121 /y put | |
5492 | readonly def | |
c302751c CR |
5493 | currentdict end |
5494 | currentfile eexec | |
45c0f7f8 CR |
5495 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
5496 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
5497 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
5498 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
5499 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
5500 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
5501 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1BA6FC8D4362C3CE32E0D | |
5502 | DCE118A7394CB72B56624142B74A3863C1D054C7CB14F89CBAFF08A4162FC384 | |
5503 | 7FEDA760DD8E09028C461D7C8C765390E13667DD233EA2E20063634941F668C0 | |
5504 | C14657504A30C0C298F341B0EC9D1247E084CC760B7D4F27874744CDC5D76814 | |
5505 | 25E2367955EA15B0B5CD2C4A0B21F3653FCC70D32D6AC6E28FB470EB246D6ED5 | |
5506 | 7872201EF784EE43930DC4801FC99043C93D789F5ED9A09946EC104C430B5581 | |
5507 | 299CB76590919D5538B16837F966CF6B213D6E40238F55B4E0F715DBD2A8B8B8 | |
5508 | 80A4B633D128EB01BB783569E827F83AF61665C0510C7EA8E6FC89A30B0BC0EB | |
5509 | 5A53E5E67EF62D8855F6606E421BD351916549C569C7368AAFB714E22A023584 | |
5510 | 8B1D6B52FC6F635E44058690002C6BA02CEC21C54CC8875B408A8BB84F445894 | |
5511 | 5D6B3E4841CA20AF852A660FE9C832F773691DC6F7197FF3DEAEE97418A5ED2F | |
5512 | F2AE65300416227CD3BB03C29003C770CD7D2A7A2E4C1DCA193651C2CDDBF93B | |
5513 | 966938788694BFB562AB0010268955FC3555E5984CCAB0A9B7590C77C9BC713E | |
5514 | A29E5BD7193A4E971D1752DDD0F0AA4648E7E87BBCE66A1E836C715C408B07A5 | |
5515 | 9EB56BEFD4596706CF839BA4CFA90CAD4038C1E006B51913279A2C31FBEE5BD4 | |
5516 | A7D74F9103CE6124F5B439CB860987DF44FE17EF88EF1BF62C67060D25696BCD | |
5517 | 94ADF08F04E349CEBDF9D3389D870D94CC05E393B3F4362A13A6A672EE5E8F5A | |
5518 | DFE7046AFE3EBAEA58FFEBA4A47BF61F92E2003756DA643CCF2C9DFCCAB62669 | |
5519 | E3C2A18D690B64D907F50BCA155A85E47C3A6954C6FF7ACA36D8DFCE777B7929 | |
5520 | 5F5D5F787B9C247ABF13D6D7B4A8F06BA25CCB342F8A5071325CDA86AD71BA23 | |
5521 | 8A9695C7D1D50D0AAC267AB7CDBA7AAF46A264B7B081B7E79AD937FEE4969FD5 | |
5522 | 155A99E652461EFFB4BD010E5885631E2B2497D6B8C43CE77D7D47FE201DD46E | |
5523 | 4482FFDCE150A1183C22C004A0AF0E1F42AA6804E038E1DFC8B0A3CE26B52038 | |
5524 | 44D2E7F759DA5C252489E5525963D68BC27C82247BEB18818C7D4CF0BC5CC97D | |
5525 | 8C701034B8DF798DD4CE36C3F8B1FD40B2DA14EA75583852875031AF8C909EE0 | |
5526 | 04495FDCD04B05A5EFEBA56A8CAC1F57F1B8AB91FB25C81CD51EE69D6E0F52CC | |
5527 | A0E12CF7E3187D67DF71A599FFD895FAA7BF80E2E6B96592BE77AE96905BAF0F | |
5528 | F547355A36C443797DDA7C414AA606CF9153E03450B77D1BA4088D739DF55F07 | |
5529 | 111B9E11AF37F45B6EDE6D7AC126E05886A57C83886DA87761BE600DEECD1344 | |
5530 | 8A82BD652BE7ABFE6A0F50ED7C6F4EE12CDFD80CA7A5518692F267C51C3FE76C | |
5531 | 567BB8DDBE09A2AF901F79AD02B435287CB8057B3D5EE6655071F67B00438728 | |
5532 | C4C3EBD648BAF650993AFE5E2B29074A99ED0FB725D9B8CE8B0292B08A280214 | |
5533 | C3AF252BEEAD30C88F72E322FAC3E9D78A1038F5DFC41F7BF1AE3744A0677094 | |
5534 | 51B77C2D630B67853FE5E975A395C06A4D4DA744040B272C2B88D8B7ED3A2C01 | |
5535 | 66F503C9DFD3C7DDAC865900D2A4F2CDF517F449851DB1963468D0266D7A3E58 | |
5536 | 9F6B2A1843E6444274F16A9930302DACD8D2BC4588765099A86BCCD8A31DF0E6 | |
5537 | 2853114DFF2D19F812F19AE6C2E419D7AC1BC024D1195074FD0C6717BFB389A4 | |
5538 | 4D5428E7BB2E4F9E9FDEDED7BDCBDD3460805AEA0B5F6460C2FDF19273CE5BA7 | |
5539 | 5D3AAE0DB94C6AFA8339646191C23B0149E7CBF136FC4C844E025A38935DF256 | |
5540 | 0A0A6466A45EE8B9B23B6A055856FB084F87C73BA28F1883E3B184CD813C72F9 | |
5541 | 233B78CA4E125ABD26F29B92CD9DF39D6FDC2A217E2B6B45D9B0A4D536790A5D | |
5542 | BC0903069565A442FA7466414D948AC432C6B75D8D0E1DBB217CA3DC38A52DEF | |
5543 | 62E9D5AE9E753956C13819D93148C7683BE4F71B80BC066D8C19FC807FB1C086 | |
5544 | B49215DCF56A91A42089F0D063B9981925691F7DDE3237403AC714F5CC3ACA88 | |
5545 | DB2F1DD205578C00472FD70C8BA4F752E3923ACF3164D442A6B639902ED060D0 | |
5546 | C5777BC20F9A3BDA60FA3BC986C38136FBD2E8F910E32EF36377C9CC187F4AFA | |
5547 | CCEC423DB925B378522B748BDF12D523804CABA83CB5A7ED69FAB9AAB75EE8FC | |
5548 | 38D9866E3754C4E2F2B9AEFA804044D878DED0E114EA0E9682FCF38F6628E63D | |
5549 | FE1C1B5615E54FAE8684566EDC4B616F76EEFD6207E0386F06D3BFFA26425F24 | |
5550 | 303CC7C8A8D7021E7D09B202616988287838C3DBCE3179B4FB5C726E603A47F2 | |
5551 | 8248CB508F327D1291CF3F08F7C88298DC2D0F778D24304EFCF6E074182BF5B1 | |
5552 | 8E6551811FD6991971692108E289B61053D6DCBA2925B3903E8916EBD09D97A2 | |
5553 | C6D08E89DE4C0CDF7185E1E00DF456B249F0BFC686E04FDAAD2772DC2C39DD53 | |
5554 | 9C23A41471267F53A87E5C2B8CBCDB66CE0B9844BC506428E6150B48D2FA6363 | |
5555 | 4FDB2CEDFBAE0B7DBCE4D83E29B2955F8966272CB865EDB360C8A8C19EC62A29 | |
5556 | 03066483E4083524A1E8D80FE3867BC1AA91753C26ACBE8489AB0E3330206212 | |
5557 | 93E07ED473DBF457EB8489E66FB4B8ED8A9EA8911CF9308CFE3E6D6F36810EE8 | |
5558 | 91CCB11BD548617B2C683C354452B9229E7C9E68828BBEC324420DF7C188CCE0 | |
5559 | FBB514547553A7E9B38AC265783891F42DA472388569C8E7594F7E8810895A27 | |
5560 | 06E456902A8D9F65CA808F1FD475D011C4572F8A654BA01D67942226A663D179 | |
5561 | 95149FFF41A9F55AE84EEB9A6A39C017D7E4FD6EFEEE7FF3CE847CDB064A4954 | |
5562 | 9DCD273B810E0F259501BA4003A3EC1ABA6E13D24C0B57FF82D6DF077833B6A2 | |
5563 | 7EA54801BA81DB961C261689C0887FAD83771E55D3D137AFBB21779397E11972 | |
5564 | 6C6CA922F45AFA5C0526863A5AD8B9C0775CCBA17FFD37A44CED4710884DBC31 | |
5565 | 5C9D3F5441595B86CF7CA2EEE42AE87896E9E60EBF5F35C2B7FDBF9A9CDAE262 | |
5566 | 3F48396F0F741E9DDF1D4FEF75E68AFB020D06CC29B3A7B2ED819D1AABC12B91 | |
5567 | CA2A65F1AFDDA2F3FB322E0268DBBA024663E49EFF076455338FE31A16B04EC1 | |
5568 | 797EAB0B49AFFB906A0690A1E8E2F5314773E1CCFFF43E6FB3875AC907F0C5D0 | |
5569 | DCB9BCC127014D472463560CA0CB1C2CE614D94177C7A52A5B089316689C8112 | |
5570 | CA57E35D716D956DBF9013B1E5B9626456B1433C8C15FA906458F957133B9E19 | |
5571 | 8D46DC3AC015F7602538C2AE3927C6DDBACF38E59220C2F5AF36B68DE9117C51 | |
5572 | 04CF7DF32B1AF55B87D1D8A5F4BCFEC66F63B32B6548DEDA3AAB06C5310E4757 | |
5573 | 78AFF947DA22809B360FE535506A554DDDE5A6F2411246653710ECE5CD3185BE | |
5574 | 730520A766C47E1ED01890059882BE1432586864E1A86A7F586438C8DD35C00F | |
5575 | 021A741ED47E0F16DB6070ED0C50038632CA4AC2975578A8372A080CC0447C79 | |
5576 | CEABDF2BCD5E78564247B0F0025F556DA8FB62125227849EACFB724A4AE3EF57 | |
5577 | 90C07A5B27D2E59425F56BF8AD84C5F5310FEB1BC73D536339FC2E6A5BE2DAFD | |
5578 | 97FC835E0D52F680F80ACA37DB498AACF152B9B44626CD89E3302C3EE1623EE0 | |
5579 | F998FA78305960AAB9F483F731F5F67A8C963C23DB8E48FB804EF8B86FAFE7F9 | |
5580 | 4C09641915FA7E3930AC922682313408BC1607C76751CEEAFD660206A39CF394 | |
5581 | 40ABE2A313AB7D5FD6444E219DC5C26734D322BA268D330AC17959A390D6C8E7 | |
5582 | 3A155095BDD66516DAD5D65519A7FB871ECDA77061EFB21F359158B4470EF79B | |
5583 | 362C35C06B85C9A9505C8361939C6AC013F2CFE8EEF46FD8CB4452AAB3EF1FA7 | |
5584 | DC066557BADC2ADDDF7DDC2A0E1DD4A357E27A2073427EACF9B9035DA5272136 | |
5585 | 7DF37E26D96ED4B2ACD60596E039BCB15E259C72FEB3344E3EEE3D4F17DF4233 | |
5586 | 04C1416BCADE80BD483DD8C9AF979E1C7D50C4CF015870703F88B92C4FE46AB8 | |
5587 | DE6717B55C460C805B391B84333097E116F4A51F631FAFAB34CFC925BEE8B72B | |
5588 | C9FD5F5A79D8F2295FBFAE649DC6AB47794AC7D73431FFE5BE992F2B5AC67049 | |
5589 | B5208251C0E442385A9FACF25E3A98D7F5D4C2A1ABDC600AABE84769CA83350F | |
5590 | 9B87F71CEAD3600E02FF9AC03C1B5C21C84F911511A0CF0111BAC7605EE31229 | |
5591 | 3C526A79D943D92E1CC3C38ABE82D560CFD4172F318030852A5FCC0534B8B3FE | |
5592 | D7365987C8B48A072907B26CDC2108130A33233E8E0BB5FDF14FB55098A10EA2 | |
5593 | B51AD9EFB119F82B08D256D396D3263FBD9DBF172D43A90ACD1A31F3E89E8571 | |
5594 | 74BE98B9560E2CD661A2F93C69FEA3FF26B00772AE2C2C24B98D3D122EA2AA8A | |
5595 | 44652CCDF4EF4F01CA7D62A976E23E8A86291F43BFAF38FD9C325E70F9C36CB5 | |
5596 | A181DAD30156E98339E6A0498D3420B7BB3B4E651A9090D4A17604AE386273A8 | |
5597 | 3D4AE8CC18345E6E19DF06BA848F203F74B161D6A8882991CBA7385F308696A1 | |
5598 | BEEB0130D938A764B98A2001A38489B1334025EA848CA44A116D64926D460D64 | |
5599 | 01159E77EA7ED9ECE7BA77635BE564A4ED89315BDFF54ACE6AA1A26591D13CD4 | |
5600 | 6D6425CA7933769B842192858D10998509396829263290A3A7CFEBBDA3EE6CDD | |
5601 | DF1E492AECDFF7941B53573F01F623CA0A5ECC9D05A3D0954F7AE8CE94AC3B2A | |
5602 | CD4E27519B2E16F033EB732AA024BBAF74626DB55DC74B1FDDB07FAE98B4AC5C | |
5603 | 683CFD8744F361838D343B657EBF52DEEE7AEA7565C5BEEFE455DDDBC4DCCA7D | |
5604 | 87D6D769C5ECCF14118A14A85A86865777C8E28F953160D5E82844AE54D541DF | |
5605 | 550D5F1519E183E0C42BE88F0458CE8087F2CD4B1B49A8E9E3D127C4A4CB74A6 | |
5606 | 2E73BF4CC317781D03FF04BC36AC0E4AF99E2ACAD20F6F8029DE8A035DAB40DB | |
5607 | 17D237850BCDD05931FF4B0FE2D0B79EC5A88FE0236271CCB075BD194AA25AFB | |
5608 | 3FB93A5206F61A14602E4EB6F1C31C654527CE0C02D04314DF9AFD710D0EBB9E | |
5609 | F8721B97F5FB18E27507E1F800B5509A58A1A8296C72B7B73F99B6CFE42E9C2F | |
5610 | B63B3555475E562672645CD374BCDE937A9B05A157FB3E74C8297507253E957B | |
5611 | 1A9DC421946734CEFA3D5EE357DAC7E9DE17A5BDDEF6B2D2A740BC58128FC514 | |
5612 | 61154664412BA1C05209EC992A77B7CA45AB7C0EEBF590A5B5652866008CDEF7 | |
5613 | 124A3003AE6A7CF9DF3C72750CBD281358CD2FF25B162B78CBB971DB3477F8D2 | |
5614 | ECA3EE9CBC90323B2C236E375337EA0848CD7CB5781A2B0A42DE7E4D99DB2746 | |
5615 | 0B26796CEE129D23C76794B7CE21C13C7D4A998B752C8CF43A4821B736EBE246 | |
5616 | D2A2BD7BA3351FBCD1B0A501EC1EAABE60D06DA2FE39BE1F0AD629769FDDC933 | |
5617 | F9D02F9686EC8C2D7455C26AF4DD3F6860B2289E3A30E1C254AD17D731CB73B2 | |
5618 | BF4DFE90CAEECE3ED0CD3FB4C8F4C7BE1C056AB4E9B95781A8968E3CC1010003 | |
5619 | 75DFBC4AB9F6B27C5A9AD88D94441A8ADF09EB275E5F0E5E6F3BFEA0FA8C308A | |
5620 | 8593ABA0645ECA8FDC3F0E264B35D4B0DDB86B93CD8A047FC409E18196B501C3 | |
5621 | B003622999C47BAC04FD1ABD8AD359C977766E9643EF3BD6385306B08EE3E13E | |
5622 | 7DA5A06AE33D17A3D574C6390DB6E9429754B210F0C349C359559C7EAA2350BD | |
5623 | F61D4D8A92B1AF697BC620FA0351E67E0D9F41A95A47EE0BF210C2C48691901F | |
5624 | F905F65693DCB85BE412F097480F6A7266AE0A928729DA0F691CBFFF3B276EA7 | |
5625 | 322BCD2206D96E3DAFDFB992CA8F2955F0E8B882729DFF840569D12E4DA1775E | |
5626 | 523AA734552AAB6F2F16B89B39F1A3FF0E07EA08D13E612F201716C67F327017 | |
5627 | 6C041760DA30374434808273062C1FFA2C47B3FB578807BC26537F542040FF77 | |
5628 | 66C995EF3E8B08B09FCD3EE89C30F157158A739606D2CEAA26694A4F1CEA6633 | |
5629 | B54933141CB85C60AB262E2D4E824A3B85C2BEF810DD774F296AB37D0BAE7182 | |
5630 | 5648CD18556ACB124246A75474B232D712C2358908B5D9A76F82C626BFDE01A1 | |
5631 | 093B8FA6AA0B32F2CDEF737B28BC0448FF816DDB5812131DA0DD5979D77C3838 | |
5632 | B978CC3F6778A4BFCE9A7087EFB19749285AE4C92B99A6649DA349A2E0889D72 | |
5633 | 6D4FC664522F06C8C4D86D30BA43ED4E42211217D01636A4E17E2A132D26F394 | |
5634 | EC34EA12D84594AED9C6CDBBC0908860F39B240FA7D7B3003DB10322498691CF | |
5635 | A294C0FC7ACC0BAD1EED3E9D60AAE3F7429695892D1A21CEBF062C6129B33966 | |
5636 | 8B2EF6E932F9891DE6028B81C5E9B23278D35B7F0D83989BCBA25E20E9D503DE | |
5637 | 144DC485F09A4EFA1268AC5E4B551C5B2F1D51E9B9B9C0FEE585204F869D0BE0 | |
5638 | 7287D7570A12940A47C1F51AC6134F03B415C30E147C49F89228855D093EE55F | |
5639 | 172711F37776E97A99CC4B36E2F10713E36FB279FD3FA5A0EB9F3938F42E2BB9 | |
5640 | 254EB8F0C0F30391735019E02BFDA21D9813C6A22279B898EAF01AA892B14DC6 | |
5641 | 5912B9275167AB46EBC420836CC1A5F38A4EB47C039A7BCA62BC3FCE4199FC71 | |
5642 | 011DD6E5FFA0F3D7F04AC02AF91B9249B9F993AE346572329DA852115BEF8460 | |
5643 | B94690E790003586F473F37EAB5AC2922F5F663EE2C3C0C336A8DB71650631AC | |
5644 | 0A923A389AC911CB215EC2EC7D50CF8AEFD59EBFFA53A9F1FFB7E6215F17093E | |
5645 | 3975F186FE23BB5FA5474C11408FABD223E1E6F62035B5A5C1AEFD8899F00FFB | |
5646 | E729C2D5FD551E80716CEA4E8281660286A802AAE8D5834F37F2EAC46297E57E | |
5647 | 993B09251DD7789D3467417E393B7DEABD06676B96241B0E43ED1A1A9FC3B12E | |
5648 | 0D34B2B0792B79AA648FE9450C3B209FB6D7D91F50C52A5DAB0BC81A8B698BD9 | |
5649 | 18946EFF691912D7348D48FE68CD876FC6F71F81165D0C3272DA1A992308D9E0 | |
5650 | ED6D0A4DAD679AF495F62B78D462B463BD4A40931172290C615B3B3B6B47E45F | |
5651 | CEBB85E0A6AB6832067CA6D403C239530D07F199788AA4DD52553836851C5228 | |
5652 | 1072406F6D7323A334E7A7FCA588897C4FBA6D4F7DEB65525EFB74E539C988C3 | |
5653 | A685A98752F7198E77E456A545F0D23A1BEF81EF58B02D289CF980A3F17BEC8A | |
5654 | 6F83DD90C4A917EB0E5E2B444A608E2E9D2FF80620E16AC1D7775C0A10C1299B | |
5655 | BEE0E1AB24C50647E5CA1DA65CFF3B2C295F0644CA7826E1DC6FADEA93D66A20 | |
5656 | DE852F20AD224D28DB900519EB1569837139C833F24B799F7EBE3FDC14235323 | |
5657 | 1D0BCD4991C861F38DF413A5A5588B73AEC3BBFDB885CE17BB3E97B4E6A79761 | |
5658 | 93EC8418C2BC4725CD61B5E30C07352F647C3FD50083878C13CFAC241DDCB082 | |
5659 | E53703D182068727F9EB6FACEC25F6D901D7309ED7370867E34E267519E22D62 | |
5660 | 4FC7093448BD0D6B1C43D318A3E14C92032325C132AE0FF7ED707E1FA4A955FB | |
5661 | F5224BE0045CB14ECC321D0F333FE24EEFCC504F7C756451D7693C3E6CA87526 | |
5662 | 4912E1B6DB935BDE76FBFAFCA4ED473F1D2618812CFF25A6859C626A216603C1 | |
5663 | 361BE3E071FCFEC2D4BF2FEBDE07DBD56A1BFF8303901168FA06488BA6B76F36 | |
5664 | 95B0A90D7724E9ADB567C2ADC65CF3482CF47FD1D16F70AA19A97D0F9EFC611C | |
5665 | AEA5E1ACCDA7FB2DF05E9480936281484BC329F0B771775E73F7FD72FE3F45F0 | |
5666 | 50ADBD03932B38F37A8F0A66B2F739EA3AC8811C8F514E68C5643E4AFF485C81 | |
5667 | 88475A523D7FCCA5C8809BD49846C77795A38DC6406082000236A4D2628B5932 | |
5668 | AB7916D44EC2210CB941B1455867E510E9D8A0B83CB645BCABDCDBFCD51A4E12 | |
5669 | 60CFFEF0CCA548F654037D01CD631FC4E1F97B4F65DA9AE79D99F13A726E93DC | |
5670 | BBB027B7D175FD17A704C4668F6F8428262959DACA9F8C687C923CFA053804C9 | |
5671 | 9B2005FA7E0F07D81E52A9A37AD5CEBA8EA63929093ED0DAB9F7C99C82A50E6C | |
5672 | 6440387049A0C359218F5268C9A28F581783BB9D29E08772D7252FAFA6739687 | |
5673 | 22570150178893C418531769CB3D96F799BF1C6415820F96B6EFAB5344E82796 | |
5674 | 38A0DF66609F5EA332C1065274EC93027D264B84B52AA8AD82E13E2A41AED340 | |
5675 | B240D1888CB89FBB748FD10B214773D466A44AA2AF44371CA8B9A4450DA76EDC | |
5676 | 0167B4015A270B9983B89EFFA023A3DFFDE181B90C51D70557B0844362B0652A | |
5677 | 6345C6EC83DFEFE099455232455943718297254186940D6305C96EE2B9E3E7C9 | |
5678 | A622D25E0471AC31A8ED3AF8897BD19E322CFC3BD3860D8A0634081D9AF53A9D | |
5679 | 84F4ED39D8127CBCAF9AD48E9CBD10A67A2CD0CF93D61B0BF1E2891D2AD55EBF | |
5680 | BDB97272CA757A9CCD663C5D1ED29126E043EAB4F519600668E40B42C1718DD2 | |
5681 | 9D086A3420DEA89DD96902516ABBA71A38376246D78B0488F4850D72804D1A84 | |
5682 | D61E9804E47E73119C5AE8144D1BD069CE4B157BD6DE62A7C43AEB27CEC8588F | |
5683 | C546C7CFEAD9C51EC92E59A7B33704CADEE056CCE43FEDC3C14FBA6875D6E281 | |
5684 | 3B5374BE5ABB5C085CBDA1FF0D2BD2E3CD9890F62CCD6C427D29ED3C2CFA33B2 | |
5685 | 73F9437BD9EDCA614345A2BCB9B2937AB6BDA5B408F535633D3B78AA2A892E9E | |
5686 | 851F5E4D7054EC7A8ADAE1244EF76CBB3EABA6CE8B6EB9288E1B57212F741BC0 | |
5687 | 07EB07C171F36E9672816D141F5E40E6935900AFD41188CFF85C864F84B81AB0 | |
5688 | 413C098E72442AAE73F699FA4811F06F9C8A03C0A4A5B8B74C88D13801B34113 | |
5689 | 2BD61F85D168A9FB0A23B11F90FE4A740912048BA970748408F395E19B3AE4CB | |
5690 | F232FB3EABCCA4FC2F961B0BD034F0C142F5215E62295C34798EF992284784A6 | |
5691 | BEA185F9E46F4766669260FFCA1F748B14B56C6C05B665EFBE19287D8C10E00A | |
5692 | 5E4AEAB154DFC2C08F8CBCBB65C487E756C42C9377128BFDCD5BDBCF68986D0F | |
5693 | 402F66A2F55F64D3DDD69A44A4B6D0964C22090EDA45EB395A0D72E6FDFA7BCC | |
5694 | CD9B442CC990910F5C1ABE26CEE4CA55C31569997D1D9738E12F9E380A8D3DE9 | |
5695 | 62FB2F46E2D56C65B8838E990C4C29814DF2464B0D1C6E88863921561E2BE1E9 | |
5696 | FDD38F95CBFE5A26A7B7F0C2187D9E8A792FF4C5931286F536FDD8F040AE04D3 | |
5697 | 43ECF370D828B3343EAC87F012C3ADEA73D21F6C5C59B3A3EFFC865AE2BDE6EC | |
5698 | 611A0690B67D1B8783E8919A0E918B563022159DCCEAD8A3E18599270FADE1C0 | |
5699 | 27598F8CC5DB789C79FBC16773142C55AD5123CA84CC45991FB2D8E791AD9C83 | |
5700 | B83FCF65D10C09AA378F9B6073A3F06F92B45708381B1A94C3E93303E437D4DE | |
5701 | 630D303C6E343D0B432677EBBAC7848CFD111E32142FFBBABB807B5B495C0850 | |
5702 | 62414AFE6CD465399332C31F09531DB82F59F7A4952A34A8A34367320C8935EA | |
5703 | C23010068C8DDF84C17ECED87AA40CE9B25C71F7BC54EFAAD4C81D4071447332 | |
5704 | E21DBB38912A9CE1F9531BB375AE6BE97290555DCD05A4B8CFAC25D75D2C05EE | |
5705 | 526E8D3FC01F630F8BEAEB7237C23DBAF001732A61CB6542047E7F4F67B84B08 | |
5706 | 86301FB08F5165D83AE95A202052AD70D6165C59312690AEA5D2961A2E2F7E79 | |
5707 | 2D72801DDE06D1C373D5B6CABCE14D24B17586944C519A4E8B3B2D52D1D04E4D | |
5708 | C52135711CBB4785C8939B786DEDC0D20F7D6E3632DA7508E6CA7EB6692BE40D | |
5709 | 09B37924B6D916AEC3584A9A9D7D9EA7A13CB363BE472697E0D8360BBBBF18BC | |
5710 | 00754B53C745B6C60EF626A24F7A1623CB37565FE62F3EEF1DBACE087C68C58C | |
5711 | D9D8B5C22A89AF3D515D29013F2431D87078ECF64C4E34F5A6201D95AC8BEE98 | |
5712 | 97D51A81C00F141231F715219BE4556032015EC5AEB3BC80E2C45B851457F737 | |
5713 | 07D57A983C2A5EDD5A3200AAA2914B0A6EE10FFE5838C128D11D198D6383C9B5 | |
5714 | 35DD8BAC8B34FE2F144C4F45DFCAA147F985D4FE0C950AAD41D869661D30061C | |
5715 | 97E4CC2B930CA125B352FBF456C15DF55F55C8ED8FFA3FBECE2F4B032BC2F834 | |
5716 | 716F2F6004F06DC5F062792F471E948279C96F6AD0388B341C515FE857766334 | |
5717 | BF61CFA252C404A81C235BA25EE78EF1B4676CDA4DB27B0868539EFBC958ACA7 | |
5718 | D9CFF8F3084C18D114F78390C2B6699E88C4C4CB0318B9BB99CD448BA1FC600E | |
5719 | 8D6E9C8EDD6B89A8A5728D171DFB5DE6FAFFF2591847BC3A000C13DCCECFB31F | |
5720 | 80E8557AB9586C7CB752567976B37A15864DBDA05F351E1AD2F00E189333D6BD | |
5721 | 3D8E880D5D1F31CF7BB3B25E022E8573C793214EA5E14DC072575AA1BE228161 | |
5722 | 4DFE7FC5DA3B83989C5F8E34499FE38B207087920C05B9C751881FF3E318B983 | |
5723 | E57668B0BEDC0EE65124E54B6BE2FB43A9830CDB6EA7223EE30430E30058F810 | |
5724 | B5152374B67D02E99FBA4723F16CF050CB70020A82E751E9C16B919FFC6554F1 | |
5725 | 82369842B999BE1595E11A9C1F0DBAF00DEBB5BDF0BC981B23DB0697A5B3558D | |
5726 | F0DAA2D51A8FB076400ACEB1CADF9CC13C800D1612C7BA59CD5168902073C1A6 | |
5727 | 716B688DA36DA4C5403720AF9E3E6933AA5DCBC2BDAE05632A7EC657EBAB1D00 | |
5728 | BE4C9EA6949B7C0624D8A91E222FF527FEBA591DADD15D5C59CD03CA45D8A979 | |
5729 | 61930D5170A2E632D36C86B9CBA7EF15BC54A46B403265A9DF6CB857C08AF874 | |
5730 | 94C3AF5A85B879E1CAD1E0FDD918080E728CEF9BCDCFA875B5D9B5227E94048C | |
5731 | 22118CF8A1E4313BB479ACD1A5B5E1FC14B80E3C06B6987F68FB859723E630CD | |
5732 | FAA39F1A25EE5B478A12F5AF5A9E2491091973C006BBA3E809918848079E60A7 | |
5733 | 6314440053FFD14774525692906B36AE11C40F17D20774DA2F424F423A2828D5 | |
5734 | 7135275954BD3A103E9D68288A8A324A6C1AE63BC97D9ECFA3E2D1E91BC2EE32 | |
5735 | 4B218763EA9C46BBA09707530E69493A6B643683A7C43F1176C77692A86D2787 | |
5736 | 3DB5CFBA9F53B4DB6620EED927E8BEB4B725A0FF8122DDDFDA59B95B1306F6AB | |
5737 | 0CFF502AA203E760E7159DC582E5BABA39248FF8EC069122064F0D40D3FF483B | |
5738 | 525ADBB43AF82778C1A26510FA6C2E73AAD336E68947397508C8FE81F2322B73 | |
5739 | 718C399346B2BF42D46072CF63B3A7D6C4FA410C0525C2DF70FE865C1D12D4C1 | |
5740 | 69E528AB0A8BF1C61903FA24888017B5DE1B8D5A4132270A485ACC08B109822D | |
5741 | 471E22CCF28A06164E2F3CFF86E5F7C3BCB087785E1158F9CE0CCEC51BF2ACDC | |
5742 | D431759C3DF7FE039C3E194601CDDF2ACFC42FD307D6CC64BE965EB537BE75F1 | |
5743 | BDDC0AD02741E2E7BCB988447FBB0BD7D1A24ECB72BDBEE0ED384FEF10FB68CE | |
5744 | FEFF5BE54A711CC313189AA94C08461D859C634FB7CF9A944CC133AA277B3FE3 | |
5745 | 744C1D7BF781B5AE532EF94B0C6E59A099FD4750B34AA3D21576335C6FA34F24 | |
5746 | 080790E2AE616AAE91089F79DC1DD85278C68771A0C2EE5BDF570C6FC29711C7 | |
5747 | 71DD9E47A51D0CF7844B823CE234BEC1A67C423D40E1AEBD4E10023E0AED1BA9 | |
5748 | 15F8406C71B2405586B14982FF67C0BF19AA3F5809CB7818E884F1226193836A | |
5749 | EBD100D8344BBC0F3B7309A22711C62BBAB7ABB83CF388EDFB644CA2E1F63B51 | |
5750 | 6C4418A2BCECC2C521F63130B1093ED58BF1C4B17D277E7C0D6BE880ED948C01 | |
5751 | CEEBD14357BEBEFD9BFF50DB11688064AA022E403ADBE0F3A1D175D99F47DA8A | |
5752 | A298B37DC0E4EF26F6FBE6F0181EC32FCC617F0F0F7FCE59454944BF33A0654A | |
5753 | FFFA4B16D9566E8AF012A5EEDDC241837EF30BA237A052A29FF31BFD938020D6 | |
5754 | F8F88FFC2AB3F51A5A4AC1B51FD5AFB8623F6D366DD3C53CA083B76D133DEBFB | |
5755 | 6442D33C33C64672CA891432FC08B5CCDAB44DC16FF903D026E87415CBBBFC2E | |
5756 | 1F84CA3B74E90527B035721A5145592E5EE73035E101F1EE789BB718979BFCE3 | |
5757 | 21D5AF8FCBEC06AE33BE5FF2EFE2A538B3D8D78ADB9942863056D794A789EB84 | |
5758 | FAE60B893A74856F9FDFF8FD649864A95086AAF4B551FED22B8708780E3A1776 | |
5759 | F54D5F83F8C6DC3168AE622A5CB333B047153CD8DB16FF8ED31CA739212F05BA | |
5760 | 15458406AE04B0AC0E3B8C376E85B26A53A45BEDD3414AF0046716E880BC8F49 | |
5761 | FADD67DB0A73EC5451BE32C6AABEA4177EDF61CDA10BF9706B0A18CEE54014AD | |
5762 | 54041C1E1DF467EC691875C7CB9EA5BA445F464764FEB5D6684256D768F67305 | |
5763 | DB889995DD3B0B84EF3545C0904CB99A21B605EACAAA13413C46FD9B6B0C3EDD | |
5764 | 6930AF54B3B4D3751B05812D77EB5F0B99E2A18FBFCCEFDC74ACDD0A59880CC7 | |
5765 | 9025DABC5C1A0AF97CFF68B0F65C19D32AE169987E39B1AEC88E89C28C0F4EA3 | |
5766 | C379D03425CF7E9008AF081E1680E1D1B3B4A068EBB1AB725D1C24331FDC2AB5 | |
5767 | 983AC6C5B608E61C492E11D1A08C1871A24E407B166857B6E5EB3F4CF6AE0DAC | |
5768 | FD766B7EE269E87E344B5342E6C658EAE51CE68F64609920CF1DAF9A2FADD675 | |
5769 | DDD8951B97C27CDCF682CB07F0EB32C1B0D71DC4A6CB1D74ABFD498CA23F76AA | |
5770 | 0EA1724E3EC3F33B5094C5969B1167135C74176845772181E53EBADA8C5AAB98 | |
5771 | A50EF967B6D55E56EDC4067A037C3E269B657E95256D0210A1331230AD71A2BD | |
5772 | 29159DFB83F16176F06D712C1B91218EBAA7CA27BFAB7A014D11BCB7F3585624 | |
5773 | 4C61150E171129C9153F69418AF18C2097AE0EBD6F1A10107AC686015927839E | |
5774 | 59B5AF1AD6CC228A21B8C88D5C9BB8AAF7A9EAE7B8DFEEF739B47EE01DDF4F0E | |
5775 | AAC98F602B5D9EED62C5C14A3B096FAB12271925E2EAC474B639AC68B59E7E3B | |
5776 | 105EE619ECF7B5D2EC27AFC980FECFD03F15837AC33EC34BABC80BB272BA01A1 | |
5777 | 7A763E8486FAA442F98763FD422144D4B610C23A0B460C1587016900EF6124A8 | |
5778 | 841CE18AA9EDE85982A3CCB4A203BB56B9D2BCB9F3A6A3E9AC4B9B8590B8F438 | |
5779 | 0229DBA7BD72555563AB8EB849632D4442AEBED6BE2B2F0F373546E85A338AB8 | |
5780 | A17BD2F7EED1B7778D644B657E18C1C1570AB799EFF5FC8695CAF006EB2C3034 | |
5781 | 761D21EF9B792C37320C3C66D01D5F050A29A89B8E893C9E22A19FA9CCBCE253 | |
5782 | 00672E2C7079A96F9A72885367636AC728359F160C4AF206734A5FF17082E35F | |
5783 | 1EF04C973CA52D9795A3ACD3E865E5BE84A694D7CF101DF989D48DC305028741 | |
5784 | 36B1EDCF7A6F30062498F9DFB7DD07A0A20EDD3AF9DB9C1EB12F289DCB3F7A1C | |
5785 | ADE17E4F411555C392EC27EB92D37F17E889C04C6A3EE36EF2755E3BC3A21BBA | |
5786 | 501B0F5148473551742CE2A9F456405184EF74B756CBB71AE18E211D72050FDD | |
5787 | 579DBD19E284FE4191D62F9E5BC35C744AE1D8472B63D0FAB644BB4E223D0A9F | |
5788 | 27EFDFF7D0230DBFFC9C22E541E420EF4BFF45014B8E174B569902C2380DBF33 | |
5789 | 96D005F475B2391192E3EE41C91CE713782C22624E9FF035D0DF084B35E1EDE8 | |
5790 | 4EC4F1755DFD8FE72E5A8F81FA23EABF01D8B0983FF79A16CCB95933732DADB5 | |
5791 | EF98ACA177B134A0A2874BC22EB50026EDBA66B350E3DF615DD680496B279855 | |
5792 | 8D2B2CF2F460C513DA005FEAC147E50B3B053E1A203A838BEEFF5A546B18E0AB | |
5793 | 15013AFD17CADB5FA14AFB411049319DF94ACB8893156E0EE05FAFB652FFA59E | |
5794 | D9F20FC90928AF11F00E3A4E38BCAFBF527135893ADA49812190D9378D6DB84D | |
5795 | 427A858D59AB195FAAC899AAB072F73E5A4BF09CD1740E8BAB3C99BCA591CE2D | |
5796 | 1A710BA8A4CD6D52869DFF24FE1DE8B0DC4D03CBD3E93DC82272B9ABD55F2994 | |
5797 | 7BF140C75055AAC5F8A2DC88DFE109B4BE3A517C2328FBEEC63EFF2343BC6EB3 | |
5798 | AC76FBDA635D1FB5E5E1B1192170404638574AA6B853CE5754DC39B70FDEFF66 | |
5799 | 5210762882DA4D3A26E805DA6DC5E7782DBD151C134693049E588EE3D2A30AA0 | |
5800 | E4A9E6CDC59CD0904F736D347BBEA83EE9ADBE638ADDA4AF005BE0425D9A3822 | |
5801 | 4920250EFAF9855F453F77397D3FB7CCFA4B10C4B169012E5CC526D7FE566257 | |
5802 | 67510AADA4364C65B66D96B340863ADD1812E67C1546E10D8E432DD78EAFFB8F | |
5803 | E436467E4E87BDE4790B067F80964AA216C9A354E1408AB59574C9D5A46954EF | |
5804 | DBDD56A7DCB563ECC047364194561EA8080CE6F14D7A3F0DA6D57B3D9671E978 | |
5805 | 31CB2BE5459ADAFA7F213C2EBE2D948EA7898D48639C4A24BC60F6AD1AC3F8CB | |
5806 | 4D36227EA9D3EB060B5FF68DE43F18072BF0DA71448DA46597F230D79D085B55 | |
5807 | F97B8A2967C792588907EDE6AA1FE70AAD86032EB24116D96919FB6F0FE946A2 | |
5808 | 716FA12EA3B15DF39437B5DB2E627C0E83F3DF887C9A370C8AADFDEC540F244F | |
5809 | 34A2B4B4BA121EE04B41128D2D1AF474B036854668FC63FA454ED14DE952AEB2 | |
5810 | 84013B603E6BF0AC2A1538CB1F60B3C3CE3C02C2DC4A419407CD06E8FC67ED6B | |
5811 | 7D12ABD600C3852C81E7AA446F19F839B70CFA30AFF1E072CA40906701A1E542 | |
5812 | 582A014C16344EFF319F224AD16B666B9B25350CC6A59CA288380AB0F4035906 | |
5813 | 404766221028408B8656018FF58382C66E5C7D9DBC2D01DB71EE62B4C36166DA | |
5814 | 3498A6081A5AF38AD72998F0AB52C0D1DC259CE3F0ED58EE4F43B4EB1BF59315 | |
5815 | 12281E294BDBCFB0F25DFBBEF42359B466D505FF31C5391F69E8055880933D0A | |
5816 | 179FA9A5BAB7575EE1732A8CB76ABDFDCE7DD91FE97F696BCE7E8CC84F44F0D9 | |
5817 | C0F1711D0459D2E54B76E5A6B35DF9550955948FF59E41E967DD998DB34F1BFD | |
5818 | E07C89F68B7F2E5FF620EEDEC4D37321A84CDD143B8D7E44D7AD03F79F3E8B4D | |
5819 | 6348A085B6DA6D3C2CBDD4212BC14582DDCB41201C73DB1C8171B1894AF67CD0 | |
5820 | 3BEAA93DA7D275C8B2D7F486E99170573BC3D6E888AABB7C02339CFF69D76A85 | |
5821 | 715278BD548FD6B5E2241D23E713F50D34CD3837D6E7F0BDA5075C430A7887D1 | |
5822 | 77D4E7E232F1FB709F731989F2063E5BE08DFC04EA814202F0F9D5B5CAE36B56 | |
5823 | 6DEAF5CD38F91AB31673E6D46E074F459B0C65F1768A8340021D5A50700C40BF | |
5824 | 51A1FD83AADA2EA4B903E4DF720A0419FC63635BE0E1DC687CEFC13F219B239B | |
5825 | 12970FE2D6388770D9F56F350AEB60D24100B78946D4BC5E8690ACA54B98BB9D | |
5826 | C935F20381BBAC9BCA8B77F52A69E49BD194052400B65D64866BCD2CD7031F25 | |
5827 | 8A6D6E4E1BBAA961E2C39A9D8673AB8FA5BA524EA688089A5F31492EF7981758 | |
5828 | E3DE0BEEBD5CC18A8B7D91C792325B075A85EC2F2CC09CF762FDE800C20380F4 | |
5829 | 77DED0E1905736BD38600E0401EDC644B70E8C3E8B34411DB6B40DD0C8C0F779 | |
5830 | F3530D58109B179FE9D1D064BD723AECBB7C82956FD9F47D62540C508530117D | |
5831 | 1F195CF0C2AB5D81A97F5BEEE4E60A3926FE6449E23D67CFB715C654C0B47F0F | |
5832 | 17550F495AB4C7C1470F5D6DEABCC2D5A4B9D422098D187EC5B1433D03647498 | |
5833 | 9667C6A173A41E4CEE7D3667ACE15751D5840AF244C96928AA59E958CC8C19FC | |
5834 | 95868F6996004E3CFCFCC59D61FBAF4F8278BABFA9F9EC9B672DBE998E25CFDD | |
5835 | A52C2D3958D62237D55D4928B418DACFFD2DE02F710020BFC1BD9BC0C019C3CF | |
5836 | FC6372916A1DC3DD2A6AFE6BECC7D34A6B58C579A695BA1D8BA1F9711E91379F | |
5837 | 592D78B64C9A009633EAEDBDB476C234044D645767EA3DF04D25F752696436B7 | |
5838 | 118F7ED3E2B73C505D7442A202D5AA400C0B3D9BCB495E48D2534609B86FA998 | |
5839 | 360CF9CA9BCAFB990581CB8F6CC246BD55D6BA07E03A8FDEEE7A25B1E3BB0645 | |
5840 | 82572E5215699F0401E541C1C5FB16DC064EA87F4EEB1850EF903C8D1133F9EB | |
5841 | 1E899672E831D350602FC66835C3C995DCEEE601B89AE1EEA5E01A2C15F4D2C9 | |
5842 | C35A90D264252CE6CEC4173C755B0EAAB5CA0C23E94FDC51CF6B8A3FDA920D50 | |
5843 | C34C6FEBEBF9176592B92E987ABB379629B5013C0089894685BD105CF229B425 | |
5844 | C354E08E843E6551A6836C0430A9E34E15CED78789D6841E2DA5253940AF5F10 | |
5845 | 360797C0C20FC9D82F853B2D4AF9CC18B4B6D1E61E47C650FBD3E395BDFC2375 | |
5846 | F3AF6948C04ED687BB1D6DA3FCBF4F2C6926856F9485672B56F59E5FB9AE4F74 | |
5847 | 1C1999238416C67ACB86794BF25561C77702AE5F9A3077C6894EA723E00ADD28 | |
5848 | 4E285ECB59450A1F94E45B046AD2F77A1FEEF5BA9433AA042B24644AFFF58866 | |
5849 | 804F7F2CCA77DC987AE17BDC837F4DDC7AC3004FE0B00BD708E2DD07E2714D93 | |
5850 | D698625F8328EB8F86F71732BF7040FA8E7727BDA3C270643138CD384FC16309 | |
5851 | CBA870113EC28A04A20152834F199856D0E04515D49887F483D44EBEAC7E1994 | |
5852 | D3C6E843585D6305ADBE6901E18E87C460067F1F031071ABED1A009E9B0FBF4E | |
5853 | B87D284384D6AD08DA31510B16D5117854791D2043B72D2BD75B01498F39830E | |
5854 | F7F9777470C09DEF6E753F4D4870993A277E1D36FB6FEF59F420353A12FE332D | |
5855 | 9F6F3A90EE80D53E09A4CE5B0B536E8B0B14830B7EFB7A8DB96A93BD1A0D6E7B | |
5856 | CD854AF2702522BFCCA27B8E371D21AB9602287FEABFFB05147896D03D720102 | |
5857 | 36D803A558FC4F1A0418F7CB3A98649DDD38A4D21B77E9754D9323FA0C35CE75 | |
5858 | DAA162AB12C8615AC12078618CFAFE605F466DCF5E517C1FC1B3CA2C23C42727 | |
5859 | F071228A6CEBF60012903F1FD7E3A2C7F93A1CF288E455409902EAE77603EF87 | |
5860 | 5E5A49289362BF1999B6EB8120E0CA820A2649F3D888254C5F22CE8A54FC1DB3 | |
5861 | 68ACD680FDE53856AEEC5AC008C174ED336E1F956994F7BF005EADEE04C52F53 | |
5862 | 6DD46A4817350935C37B5634DC24BF911FE058CF8EBB74189EC0060F197FF7C3 | |
5863 | 9F004E412431A09FA22E99B7A6298F73C7ABEACC9807FD4E1D4580CF56705ADA | |
5864 | E7BD5B8F8532892CC79581D55D774759FA7C1F8858689CD775C2E6028E47AB45 | |
5865 | 20401618BA6A14B985BB2D00197AEEC01A1A04D7B33F838968C1100BCF62D9D3 | |
5866 | 5B89707A5752EB4C32B9E805E6264133157479AC4F096D08BA5F01C58702C23E | |
5867 | A4E280839C9B63F068C7F4EC39BEF9410F127E35CC066AC28B6DAD6FCB243CA1 | |
5868 | 5DBAEA735CD73185E76B8278D263E844B024B3E1D05DCB1AA5DBB4DA2BFD2B22 | |
5869 | 0FADBBA22340237147EC4FE2D5E97521E17753AEC595AFD878191CE9CF1DE450 | |
5870 | B12C48C31049B8EB43BA1B1636201BCCD946F2E8C4A74AB23AF272C95CE8BDEA | |
5871 | 1116F66F1BA60ED34FEBE61B65847667A7163A96483D7A8A60DE2BCC1D439629 | |
5872 | E70C3432D1B0ED0F8BD1F595585888862CDB7F4C227AC35B445C5AF50326B369 | |
5873 | CE5593207C521F603AEA3FCE58BE21470EC25F606F7E9416D49A8A00121A6031 | |
5874 | 9C08CA3E066EB66FA70ED1D68AD32787FE77D15992763947E6F6E6F4E5A14EEE | |
5875 | FEF8643ED893289DB4D5E45A302541B8F78D29382784725D35C02CF0066313A1 | |
5876 | 15D3C00FEB599E41B247AF657EBE1FF3F88C43393EAA23896151089C293FA6E7 | |
5877 | 02416A26F3C46E49A2351504713DD82CE60ACF7ADF116DA5384A55ECACAAC9BE | |
5878 | 9220DB0C8DC13C2BCD47C100DEC2F9A878D20739CC4005B9A69522CAE7D480EA | |
5879 | EBC5938EF248034B1E4BAF12E0309D3DCBE7242DF7BAA2C2F1BCFAB7B376291C | |
5880 | F728C73266953C04F5274C4929ECA698EE964D962B089A425A89229B1F59BDDA | |
5881 | BDBF790662A1B78316D0502FFAF723DCEA6C4526BC2C68039CA17FAEB77CD909 | |
5882 | AAE997704460993A0EDAED2518F9956043CD6CC674B85C8B06D73620133C9690 | |
5883 | 26A093ED8917947CCD0CB4DA209CA2D4DB19F66FC0B7F8B55399BA8CDFA85E1E | |
5884 | 9B295B0977EF82E3125560A202638BF07220024661AF477CF2BDB32A9F6A2EC0 | |
5885 | 8534A0EAA0101BFCD5397DF554C14B7DF85F8E173970A4099D73B312B1C1C64E | |
5886 | E09E439165E8087500C044C617089619B462D3E09157197B3E35FD6AE9DFB70C | |
5887 | 9928384E43A2032BA2186A888CD9E426EC59E505AD8ECC90990869382DD9132F | |
5888 | 0CFE89E5EE73A2CC8E65AB5E6D509F3725741665D646C60357EA99A376EE1D1E | |
5889 | 0F9479CC3B1D592FFBCBE052F6C6AB914230801106BB771FF09AC9F73DB3DC07 | |
5890 | F3E5330F86280CAB68F0D26F448B7AED2E44F8D8CAC1536CF672D1BAA7ACB086 | |
5891 | 8711B8242AAE1ED1A2945532731D32158A1EE5F192C4F27BEB362B186F2E2786 | |
5892 | 6360FAA5F8D2D72101F75796D185BAF4A7BF923C74782753CA1251E4D75079F1 | |
5893 | A07D015A63C87A405AA749238FAF652F24338E7E3E32A5A2FCA7F1C344E5321A | |
5894 | 24DC502BFA41A5B241199FA167D8DCCD6570340A83AC31BD2B046CCA44A1DC53 | |
5895 | BA463B01AFE1DBE9B5F3BC22314E9FA436D00C8D9BA8ECAC9AB7E8180A33BF91 | |
5896 | 5A60F7C027C1AFE423C51D5BDF33F43D6C6A9C581AFF5432BD034B4644968AD4 | |
5897 | FF172B9C1A6B500FAF1ABD6284C05E71C1BB2A50E93581569ED5A8D371DDCA2E | |
5898 | B18A789B6227085501ABDE417919E5D7E3863C74CDCD88136F34F88DC53DCA47 | |
5899 | A6A779FA80A454BF955967E90D6DBC449987036A434F06A2E612BFFF3E053DCC | |
5900 | 04BDA563040846FA7D94695769E92E56F6109D71F0702524E5C3CE6BAA123AEA | |
5901 | 6FD0054543CAB42E143476D9C8B19DD80DBCA9D45840D42A0E8F354F52CAA988 | |
5902 | 9F0371B2C9D82C83DDB46A5C9B83D627F2EF25E148ACE4BA9329ABD4442E5B36 | |
5903 | 2B790FB5D59CFAD7B6769B5BF27161D8AD5E88A1082373E80F2EF8818C23F3C0 | |
5904 | 2B1F47B71D7FBE3D47043762A7AFC377268F41FC2CA3366934EF192B3FAD6668 | |
5905 | 28FE2514C19A900B0F83E0CE6EE4621E2FE6AD09AD35B89C8E69B3A861092CB3 | |
5906 | 64A2E3C360FE5C7461BAA66AEC3DAFECAAF46CCA9722E7450E091DF3D17C41D2 | |
5907 | 83EFFF157E3F053CD14111553676219260AEB7439B2985C3D642A2555876A53E | |
5908 | 1C3F6F93D7B292D1A584F9E4773B59F7E39D9D04628802DCAA3354B3075D7D97 | |
5909 | 82C165BFB5066B1DBE509EF960086D475AD7C33B2F857D7C0A3217DD97434C00 | |
5910 | D435D7EDB3FF496A717FD8222F2B9A1473D306E9002A38771383FD29722AC603 | |
5911 | 2BD2D10FBBDBAC88927E878220C7921DD383BE2942320C71F8B9057762D4ED0A | |
5912 | F16F57298A4782B4FE75008820C9B2A7535EB83369BFC2E3821E11C32D089A18 | |
5913 | 1A40D47BEE120B6E63D44132EFAFEEB602C23588A670DB785B4EE6FB8756C95D | |
5914 | FE75FE8B85BFCDAB7DEA7C2665BE899FE7010CBD9C60D31049C2D5235373C1A6 | |
5915 | 8F70394EE86AAE1BA85549C46CD98912749CF0A49BC5D927CF6988FD1EFDFD90 | |
5916 | 4C70E5FF9AA9AA7D964BFEEAC0328C6F5A9C5A9F00D710BA01E9325FD23F5E98 | |
5917 | F8E869F8442934B1A897D7C4CF6A13A56D54719B330078ACB45D65383BE58481 | |
5918 | AC7208E3CD87ACEC8FCA9CDB522812F3CF5A5F6FA9DEABE2948ED00D1BA0BB9C | |
5919 | A984FE9223EBB5D5E52EC7F1FF80C06625133F1E12882BBC4A22A1DE05091CC0 | |
5920 | 0B013566315B21015859B0A922ED03CE9F0DAFBF7A6D752C7E4EE8F4E753A713 | |
5921 | F088598D303F8C401500858C654BA366C201FD4B3EC3404FE2D61B4066057E51 | |
5922 | ED430C0F8020168A00E93E06E01AFC8CC05988F4A5EB65938A22BC10743671FD | |
5923 | 6CD52F2B0375E4F8DB82D17796367E2F2365868CC0E4595BEAE95D6E73D6F95E | |
5924 | EEAB862E561051FA2EA5540C513A5E6599C69EFC32B63BA1B23D9F8EC0258E29 | |
5925 | C51821FC7DC72CE525624618BCDE47C84DC9F61B0E9530C375FA638886796FB0 | |
5926 | DC2DF53BE1587965EC0C97BF57E98ED32DEE592C0CA69E34E030CFFFEE1E8B31 | |
5927 | F5C2AFBE0B9946CA0B41C32F4A42F9DADCF7FE2E55CE270DB08CA9244120B179 | |
5928 | 34E035F257841AEF8D2659784650FF246A523FC52AB4605B892A0C701CD78600 | |
5929 | FA29F31119C2AA8A08048B5B957B37CBAA2094C53550206CEF14AF8FC57D4BDD | |
5930 | 30288150A48052E32EEE82C80E38C8034EA02BBCCB02CB190D3452F6C6E92C9D | |
5931 | 9BE6FF73ADB9C8F51FC56A7F1C5A966A77B34BF5D5B48055E8DD755096E189B5 | |
5932 | 4E9A773B4D03EFE2AFF92C778DB38C591F0DEA98545BA731EF5163BC166E12C5 | |
5933 | 3F74A65A87A71E8CFA0E551E1B9B79C9F47364ECA2388084D5E0C2390405214D | |
5934 | 16BF93799F784A28492111BFEAB73D207A5DAB194BBA8E6427C4741796B63C5B | |
5935 | 5EF0E5BB7AEC728118AC72322530EE9FFE593B71852B076E5C3E52308803A02F | |
5936 | 89AFFADA22BC9C5E5DE81EEBD93F70BEE93DCA8A83BC6D1ADE07BE429E9C94C6 | |
5937 | F8ADB3FE1B31738A6E148E7BB2944195E664E5A74E5D6F3AD091677C50C919B7 | |
5938 | 324299D1A051780C08BC1C32269312C57DD44AA61685431806F17C066F93C970 | |
5939 | 1F67C1588D8E9E15D20C96F0266F8F7F1261DD35D11B92E18284FB1D83AA921D | |
5940 | 24188F3B2C8335AE975357028E30EEF6FD91DCAE19C3EB4FD36E1DC5B5C9AB96 | |
5941 | D72681B96A81F5EDD3642EA6C9CB7D65C0B04628A5A5832891321EB6A080792B | |
5942 | 3A57E947C6C6CE3556383C4131A085D81C5FF3516B6338857F8D7963BA42D4A3 | |
5943 | 816D63166B57E70D9E275F05CCF5919E1CB15A2DD757AA5118FBA9B3454C1094 | |
5944 | 6960691D063422AB4BB71491053A4B1293029A9D307A9940597623232E373604 | |
5945 | 5B365E68972536817FAD6D590BFF8B5F19D748BE0403BC64F6FD7C3A8A5CB2FD | |
5946 | D0C2DDD8202F905F6EE01C9BEA5865DA0E68233F184434292DCADC66A404F796 | |
5947 | FEB71BFCF087EABAA056B0FB567CEEC00E85DECD779075103091C44E7AD3E7FD | |
5948 | 0D7B18DCE3946DBA885ADD22CABFBB47588D111992E20057CA71F240B88B3ED4 | |
5949 | 058D7C83279FE4DEAC1C822A4C0D5AF43A97DCA6A29852F34DD5709E4CE03E9E | |
5950 | 2080BB90AF3A845CE39A5F5FB1D24080F31FDCD26A227FEEBEC6F8A2A13A2296 | |
5951 | EFA3CDC852DB5A8678C969845598DF444C10AFD0FF18080EEC2A13C17FF30122 | |
5952 | 331A5E73C4F075E19311776028E01F54A494C40EDB20E5DA4F995D87F325A138 | |
5953 | D069D50F77D634426FC04C4DE02CA8D6154942B587D548EE2133DA53B5307B3C | |
5954 | 7ED4E64D6733C4DC319565B74BAF0091D8911E6313BA564CA9EACC704FAA5A18 | |
5955 | D952BF57B0EC7799B33B9442969D7C8794A56DCDD7E1041F444C097D066B00C6 | |
5956 | E7FFB707994F6473DD7B0E1200C1BD3CE10DB17B4E701ADECE2CA65DE6FDE1A0 | |
5957 | 9EAC8E966D343B09D315111A456678D6ACAFF94DCEB84484530BF052B75F238E | |
5958 | 32C56C810FFD6D33872781212C84B0A1D6E452BCE38CFED98645E3C44C05E17D | |
5959 | DF021AA5DE04C401E607AADA5E1BB9DA018834D8D6527977F20E278C0579D6A8 | |
5960 | 5C2D22FC7033F0ED5353BCA7EF8CE6155B669A6156C297AE90BB0C4174918585 | |
5961 | 3ED25684FBBE845B6BC899BB76C2467E13A0AA652AEDBC355519E7D65F3B2366 | |
5962 | F395697B46E7BB33C14DE94ABFA168269F1807A35CFD925EAEF89D0F6BB279DA | |
5963 | DFF6A18E24BEA29D3AA8C2DAB29D10D004E0C6B020709B0184EF73DE001E330B | |
5964 | 24DF627427DE20AD6993B04EC3D323FE213C0E99A7AAF0D54F52859893FBAEED | |
5965 | 6EAC75FD753B15A17C5E190F6E33640A81C67E710B5D9210211C909B4DE49855 | |
5966 | 090E103916C6C3BE89B5FEBC82D7B40075DBAC8CACC63C48CD6500EC35FA7121 | |
5967 | A38B98734722031C4F5B380278CAA1262A777142DF88CC3E0F7271E42835870D | |
5968 | F02CAB44AD19B66B96D3172312B63046F57BAE8E87174ADBA8C1A6575E00288D | |
5969 | C8804FD0FABEB3B4FED2DE5CF2369087F7A11F99F40E0E90B41838F9C75A9D3E | |
5970 | 7DC3E47C447AE759544633BC1127FF091371A7768C418BE59074D6AF12381AD4 | |
5971 | 881615B9E47991FB5692A390C73B99350A84F951ED7324295DDA3003A07CF6A6 | |
5972 | DA64A1D1210424232DF319970A65252F36C395ED6A6898C418F7BCA6CB248E91 | |
5973 | A19E9558B13BC087A6ABCD25056948E30828F36288FA5BCF2CFC445AA0FB13B2 | |
5974 | 1353F3403FD894747B2186F9A3851CA5704B036B7B2A19E67DB0408F7661508E | |
5975 | E98BF576EF31BC5259F86F768558F21CD785941605505AD1EF0AC7CB431685D0 | |
5976 | 4AEC2297CC7A520B01CAAE0B19692D487815CE5E427F632E1F66388597588292 | |
5977 | 1C10AABA5C8DD8AAA59054688A8D8D43514CB35403DF0E1B80A44B4B3DB3910F | |
5978 | 2E07D4488E903267366F29D22DF959A9EDCAAE0F0F344D5444F34F0FB95A642A | |
5979 | E79F213BE986046F80FE75653C42F21DD771EFB1ED519E82408D1FCE4ACD67D7 | |
5980 | B3F7A197BFF7EAB09EE0CCEEEF9F047BF8BDF6002E585358333006CE5CCD24C0 | |
5981 | C778765C94AE918BAB1ECD4FA9E6A21FF83C9996A618FE97AABC4389B2B984A1 | |
5982 | F7E52F38F14FB54CD9B0D393A36CBC21804D2C5B17D2157D0765EDAC469D7DDA | |
5983 | 23451DA653AE64F37F9BED8625BA3ED6DB78E2794F0AF48EA2973A5982DF1648 | |
5984 | A1563869E824551CF7C04C635AD5775B4003E406C8C5A8B55139B17C622F539C | |
5985 | A107C14E0064D6A981CEF5F28759268B7090127F6FA3B78CAC4C17EFD023240B | |
5986 | 91051243141ED22491E2833B829EF3D7EE6201538D1ECC9D440B3BF24233851D | |
5987 | 0B2C290501E251DB76EE9CDA65E1BAB5A873C1630447AC33F0088C0EF6728AA6 | |
5988 | 766A5D4527F8616DCE633079F46C8544B973322FA44F74DF1399DFD605B6D3FD | |
5989 | DEA0A819004E897133D75A1356597D4AEF99AFD9F17C86E340373678C84BF7EF | |
5990 | 13BFD5BF50AD1A48265CE603B1ECE2CA3586008A965FE985F52A5A15163012CB | |
5991 | 0CF0E25CED742A023FE72C6BB3C55D9C176601E9CCA867AE8AF8DC221DE6D65B | |
5992 | 769292B48547DC9DEF57429FD0A7EDB9F5557BEFA857D34FE38EF2080079B69C | |
5993 | 10DDD6521498B1174A0F616A4E0297F0E315B4BEDDE29E992A0F569896F8F806 | |
5994 | DC2FEB8870611268462F7B81E4AFE52F0A33BCC65C7689DAD41CFA6C44C2C982 | |
5995 | DB346DF0CBD58E019B1F185A837C00D87866CF35D10C7DD5C90AA95F63B0801D | |
5996 | 4A8202076FA80C87EE9EF56669D7D75F2910DE386A2D7914A939583C52D4ED67 | |
5997 | F1A3FAF35D6199D7B1C5B0C25AB1297CBA2A7ADB118EA8FB645644B1D9F70D9A | |
5998 | 3257C601EE91BE7173EFBE8493F1000F7BB8090308AACC86530D4FFF655D78E6 | |
5999 | 802C5A60E1C1334AEB26233A2C95DB11F42F21A79830699157AC8FC580FF86F1 | |
6000 | F94B9CAC3BF3058BFC86A3817DE8E54F71FA09AF16455BB4D58C96D57670E9D3 | |
6001 | 3A251C750D85053287C44F7BC1725194791DE14138B8914FC229BFB6B693F0D4 | |
6002 | 4E86E91B99E53CC40088D6B395AED705747F43B7BEB98CAAED14FC94DEF17972 | |
6003 | A0F12C2C4A6203161C169DDB2AA3194148609BE6A37168951051E3C8C9031BC4 | |
6004 | 9573690664AE6E78BC4E9790AF23A37A92F6725D7F0A06D91B80D995B4CEB72F | |
6005 | B5887565E3715B6D6AC3B62D24DC1DD36E52717CEE3A1CD240831D8C0D2B1C8D | |
6006 | 5DA96C5A37BBDFF48285E2AB64404C1F3ED269C20B549E5B6985DFFBD152981D | |
6007 | 4BB8B235350A0B36F5A2AC7C88BA130E2E71207ABCF3FB7F60303328C483B3BD | |
6008 | 2E39A770F50F9E6CBA363EBE74636981C3F804D9933C42EA25B16F0961B1E427 | |
6009 | F26DCE8C25BE416430166A5659B1BBB06BC5192FEA829B945620B5C72F808482 | |
6010 | 1084CA85E59825BD5B961C372B3188E10E45D0C8CB31F3A72E7B47324E8109F7 | |
6011 | D5A73F45DFB330B1273E0B6421DD67656B7FA37F2949BF7695004A1EBB2B6646 | |
6012 | D64BF5A7E3CA481968C9F5CAAAB44567FE9E5FE4203254DA6D354953FC00263E | |
6013 | 3CBEA82739CB8F073EA6BA466E81961DD2141DA3C6620325FCA6EB955AFEFF83 | |
6014 | 6DE6F1BC65812A43B68C9831BE67F674EE78809145E3B818F9DF5D4AB6F2A339 | |
6015 | 5FD5152BA40F1DE2D561E28C696F86470F9D93241948D564D2F9A5A84051CA91 | |
6016 | 5E99FB9A73A09D3B84998BD436DE6BE94AE85C4E65922DAE9883F6D8E2FC8F91 | |
6017 | 12E6298288601F1E6EA6C9A93D0A985BF65C0861D5F4F1470A4F30677BA419B1 | |
6018 | D98B8F673224634255CC0B3EDA46B1A72B853B0ED55DE900E2073B6A9AB65885 | |
6019 | 98D731267AA62704BF53EBED4EF0EC1BC81712BFFDE2620B6E8F1D924BBE43D6 | |
6020 | 64947E9827909840F6F0FD6361CBAF7F72CA364C76AC3E0B1BDB7F27909A3395 | |
6021 | 5215F7BB7A39E8DBCF953A18DD14E54F6DBCAC487F6C4899BD0C5FED5014E146 | |
6022 | 7B9930C0395C1641D031A33A39022FDC4ED1CF31B8BC6C8B7DBE166CB80248C5 | |
6023 | 8FE45DAB0A4848457AE5368362ED57B222CEB65D46DE4A5A6866C2F7BFF30391 | |
6024 | 4967A00EC64DB287BAF019F439CC48FC535BCAF9F1E8AB6B2828EB44FA2FDE65 | |
6025 | A72708D358223373F20A7C1E871C67466255FCA992024119A3C63DD3ABD834C4 | |
6026 | 696FCDB385EF7E68BCE76E49E3173B8350912414A44DDBF69E0DE351BA3B8BD0 | |
6027 | C5EE604DA4111C627D027142E63BFC1AE0CDEE2D9AD330368522AAE431F3EA44 | |
6028 | 4F91038D8AE32888943CA50CCEED4DA6995FA0486531B9CB50522E2272E0AAF8 | |
6029 | 1221DA607DD7169606DDEA719306B8E60956BEF41830F63CE6D4D85F6DDDCA39 | |
6030 | 06915E39263AA9F03BCBFCD120D1ED5D75FA2A30856068063CAFB48F7B8BF2D0 | |
6031 | 87E661579B919468FFDF37B5A85DC4D84CE5E477C8F8D3FAD10D0608E64E1E0D | |
6032 | 197FCE624D68F400B620B145AB330DACACCFB93EC1F3BB4F53FCA4334C2DEA36 | |
6033 | 50F71BD0D49817FC80DBF7309FBAF89D48EC8FDD76B750426250031431D5D29A | |
6034 | 8B762225F03D13289DB062EFE903C9605F44100B1B1CC43569775621EFBFEB7E | |
6035 | E5F28CE733E8A32324DC64F354F60F82D46A5EC2076C9140A18B823C7709D2BA | |
6036 | C6DB5B9B90E587D89DAF0F9D0A160BB475CC46487C0041D6A590FB028822AA22 | |
6037 | A23B650C640F8451063808CC90FE32D3F4C8F78FA86D8899A261E0D7CCBF0DBC | |
6038 | 7E21CB68D12D79D889DB06B0B035136BA48C69430C5B515E8667E4FEEDED2477 | |
6039 | A894DF2D489727CCA1D940685D22BED725AFB3340C92C9B5F33E6B8FE5FC7E3E | |
6040 | E807CB781E2093B59BD41EDBB9A5C12756A3AE9F79E23AC2674FF955EE0DB1BF | |
6041 | 67C81DFB9521BAF79E65B604CE4CF37AC60AA5C51E94213139C100E53F983786 | |
6042 | 72F4EDBBEA94565C5949FE2600696843111B48B62C637BE86B852897CCBBE453 | |
6043 | D55FBE2173FF842B20873B56C3D5977EB3D8390CACFC84710222765847BEBEE5 | |
6044 | EB746A8B1D4CFC12BDDC719ECFB31E17131C8576E783BC1F2685B6237C3EE905 | |
6045 | 6B28EA218F4D640EF9A5169EF6C7FF9C83EA55D0E99BFAF239853A72559ED38E | |
6046 | 9E001A519712A1DF46CA6F3E38D7DC2079C6536CD632F679E82AF88D938ECB6E | |
6047 | ECC80F0A00362F88F790D571562D26039AC0B1AD914EA87DFC74BD6A05E41038 | |
6048 | 7286CAAB30AF6A10F424DE7CFACB6C4DB413FAE8B01503431AA5404855E73A27 | |
6049 | 63D5278E57075E50239E18B353F64153B2C0C29A6F80B845105332B0AB21909D | |
6050 | D417D315C739ED4830D7F1E878058D21272E043C692F9238FAAE9F420CED97ED | |
6051 | F3A2D0684A0023E9A35257D9BFEAB2D413A1D91E0D769F086FA09E6317313182 | |
6052 | 5730A6012CB634012F0EE5B988A3DC36CF543F96AC644BA5BE97E1DBAFA138EF | |
6053 | 2DE7C186DD7C8B6D47198195FD69F188D32DFABC2A189E255C057A4306D00C6D | |
6054 | CC87D77F145235C2EC89B8A39E9C0E0EDAAC16555D22A47145E45B8E0169A126 | |
6055 | DD517FEF75B15F61B8A6FB03EA062CB6193D838C279BF2919DA1DB93DB6E5E2A | |
6056 | 1503CB67E0EA17C89E7881E9BB1113EC74609BF9F73128727E9AE03B2B4EB91F | |
6057 | 8C3F67B17670CE45004ED93C1EAC580C84A5F887B5BE940B420F3794336B4501 | |
6058 | 4BEDC83C00F5CA99262EF27A49C8400FB3BF90A1F58CCA6F4F63E8B485706581 | |
6059 | 49F6960F4CE9A68E0C495DA28496F321A94C890C139184859D60692EB5F3A3C8 | |
6060 | 7E4381B5BABF2E3E35D2ED937EAB01ED6B62DB0B437A2D0AB5AFEFF8C3CAC5D8 | |
6061 | EDAA67101A4D7DF305F88A1FF091247A44C258EDFEFECFDFC8580EE1257A75EA | |
6062 | 0420EDE731D79F08D0F5859C843BA6709C3323CB47B86E9282FD53F41446E001 | |
6063 | 3674EC094A33E51AAAA7A0E888FAF86EF287E75694712B89AD5D1B9A234B0211 | |
6064 | 242BD1BD761FB5BB30913AC4C52D135FDA462334E73332394B4665DE09B0DD32 | |
6065 | 6CB361EFDD4D30012531BAAA37DE7CE9EAE257C4C57DCE7BD9169878A3A64516 | |
6066 | 00D8B818EDF2A20F4B7B0C4CFF9011173BAC73709F3121395765E4833DE7C48C | |
6067 | 062DB0D3B1044656A412265C4EC94BED0E7B0E369183EE5EDA14B52CD2B490F1 | |
6068 | 5328EFA614DA2C12BB8B7605E83FD14414307E654F802F8390F4114990C7ED1C | |
6069 | 893231A96CB55233BEBB3B7DFD381142A66D04A91B1B39826406FB4AA0785DE0 | |
6070 | E85B5100B99F11DD2B015EC225308A5C8927AF66B0A4A02DD48E0B77D42FB9F7 | |
6071 | BE310C090C90F38D9F9C788DCC34FCA9515B816E43498C74D0C8AA69E41A4253 | |
6072 | 74AEAFF24FC876F6E6F459D6B91DC0A673946445F700CB4447FEBA15D35C6191 | |
6073 | 1D38C5BC7D0CF053BEBAC67375554290C0CFDF4C58157B88570C5E4BEB483235 | |
6074 | 8F5C62F11561330A09B42A581220097D11AD82066F4C71A4EC61EB4E237C9B4F | |
6075 | 497499E7F583FD2ECC6F0E11DA8EF48C304338638683190586FEAA67786DA37B | |
6076 | D1D97ADB91C03394F167B611CBE2F140431CE9CF68AC0BC836AA47F58C03CE9E | |
6077 | C704744A7AFA967D39A723FD75A732A14D97F87045199A988358737EF81B6542 | |
6078 | 551DDAEE7C9617FD7A5C7200F06381E5F98EE1ABD3ED6D6675CD3E42DB5C3E13 | |
6079 | 1E | |
c302751c CR |
6080 | 0000000000000000000000000000000000000000000000000000000000000000 |
6081 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6082 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6083 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6084 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6085 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6086 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6087 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6088 | cleartomark | |
45c0f7f8 | 6089 | {restore}if |
c302751c CR |
6090 | %%EndFont |
6091 | %%BeginFont: CMTT10 | |
45c0f7f8 CR |
6092 | %!PS-AdobeFont-1.0: CMTT10 003.002 |
6093 | %%Title: CMTT10 | |
6094 | %Version: 003.002 | |
6095 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
6096 | %%Creator: David M. Jones | |
6097 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
6098 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT10. | |
6099 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
6100 | % This license is in the accompanying file OFL.txt, and is also | |
6101 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
6102 | %%EndComments | |
6103 | FontDirectory/CMTT10 known{/CMTT10 findfont dup/UniqueID known{dup | |
6104 | /UniqueID get 5000832 eq exch/FontType get 1 eq and}{pop false}ifelse | |
6105 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 6106 | 11 dict begin |
45c0f7f8 CR |
6107 | /FontType 1 def |
6108 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
6109 | /FontName /CMTT10 def | |
6110 | /FontBBox {-4 -233 537 696 }readonly def | |
6111 | /UniqueID 5000832 def | |
6112 | /PaintType 0 def | |
6113 | /FontInfo 9 dict dup begin | |
6114 | /version (003.002) readonly def | |
6115 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT10.) readonly def | |
c302751c CR |
6116 | /FullName (CMTT10) readonly def |
6117 | /FamilyName (Computer Modern) readonly def | |
6118 | /Weight (Medium) readonly def | |
6119 | /ItalicAngle 0 def | |
6120 | /isFixedPitch true def | |
45c0f7f8 CR |
6121 | /UnderlinePosition -100 def |
6122 | /UnderlineThickness 50 def | |
c302751c | 6123 | end readonly def |
c302751c CR |
6124 | /Encoding 256 array |
6125 | 0 1 255 {1 index exch /.notdef put} for | |
6126 | dup 33 /exclam put | |
6127 | dup 34 /quotedbl put | |
6128 | dup 35 /numbersign put | |
6129 | dup 36 /dollar put | |
6130 | dup 37 /percent put | |
6131 | dup 38 /ampersand put | |
6132 | dup 39 /quoteright put | |
6133 | dup 40 /parenleft put | |
6134 | dup 41 /parenright put | |
6135 | dup 42 /asterisk put | |
6136 | dup 43 /plus put | |
6137 | dup 44 /comma put | |
6138 | dup 45 /hyphen put | |
6139 | dup 46 /period put | |
6140 | dup 47 /slash put | |
6141 | dup 48 /zero put | |
6142 | dup 49 /one put | |
6143 | dup 50 /two put | |
6144 | dup 51 /three put | |
6145 | dup 52 /four put | |
6146 | dup 53 /five put | |
6147 | dup 54 /six put | |
6148 | dup 55 /seven put | |
6149 | dup 56 /eight put | |
6150 | dup 57 /nine put | |
6151 | dup 58 /colon put | |
6152 | dup 59 /semicolon put | |
6153 | dup 60 /less put | |
6154 | dup 61 /equal put | |
6155 | dup 62 /greater put | |
6156 | dup 63 /question put | |
6157 | dup 64 /at put | |
6158 | dup 65 /A put | |
6159 | dup 66 /B put | |
6160 | dup 67 /C put | |
6161 | dup 68 /D put | |
6162 | dup 69 /E put | |
6163 | dup 70 /F put | |
6164 | dup 71 /G put | |
6165 | dup 72 /H put | |
6166 | dup 73 /I put | |
6167 | dup 75 /K put | |
6168 | dup 76 /L put | |
6169 | dup 77 /M put | |
6170 | dup 78 /N put | |
6171 | dup 79 /O put | |
6172 | dup 80 /P put | |
6173 | dup 81 /Q put | |
6174 | dup 82 /R put | |
6175 | dup 83 /S put | |
6176 | dup 84 /T put | |
6177 | dup 85 /U put | |
6178 | dup 86 /V put | |
6179 | dup 87 /W put | |
6180 | dup 88 /X put | |
6181 | dup 89 /Y put | |
6182 | dup 90 /Z put | |
6183 | dup 91 /bracketleft put | |
6184 | dup 92 /backslash put | |
6185 | dup 93 /bracketright put | |
6186 | dup 94 /asciicircum put | |
6187 | dup 95 /underscore put | |
6188 | dup 96 /quoteleft put | |
6189 | dup 97 /a put | |
6190 | dup 98 /b put | |
6191 | dup 99 /c put | |
6192 | dup 100 /d put | |
6193 | dup 101 /e put | |
6194 | dup 102 /f put | |
6195 | dup 103 /g put | |
6196 | dup 104 /h put | |
6197 | dup 105 /i put | |
6198 | dup 106 /j put | |
6199 | dup 107 /k put | |
6200 | dup 108 /l put | |
6201 | dup 109 /m put | |
6202 | dup 110 /n put | |
6203 | dup 111 /o put | |
6204 | dup 112 /p put | |
6205 | dup 113 /q put | |
6206 | dup 114 /r put | |
6207 | dup 115 /s put | |
6208 | dup 116 /t put | |
6209 | dup 117 /u put | |
6210 | dup 118 /v put | |
6211 | dup 119 /w put | |
6212 | dup 120 /x put | |
6213 | dup 121 /y put | |
6214 | dup 122 /z put | |
6215 | dup 123 /braceleft put | |
6216 | dup 124 /bar put | |
6217 | dup 125 /braceright put | |
6218 | dup 126 /asciitilde put | |
6219 | readonly def | |
c302751c CR |
6220 | currentdict end |
6221 | currentfile eexec | |
45c0f7f8 CR |
6222 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
6223 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
6224 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
6225 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
6226 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
6227 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
6228 | C01924195A181D03F5054A93B71E5065F8D92FE23794DDF2E5ECEBA191DB82B3 | |
6229 | 7A69521B0C4D40495B5D9CE7A3AF33D17EE69979B82B715BAD8A5904C5DE0260 | |
6230 | 6C15950CCF6E188A0CDF841EB68E5A2F88253E382140F87C87E55C9EA93B8C89 | |
6231 | 14A36CDF630D6BE7CD36DBDCE22B21778E8648B97B7EC6742EB5114BDF0454B0 | |
6232 | 0EA7B1FE236C84C0E5308C871F67B973892890557AA12E00B2C20C71F516C397 | |
6233 | 3F3BBD14A1D0149CA064391056E45E9470FC7F6F556ABC82653B3C8049AB5CF4 | |
6234 | BA83C8F2158C236B2FFD4208846013BAF4165E8BB8D334C8FF2E8D74AF5DAB2F | |
6235 | D44788869B08399421AAA900ECC6A2D594641C121660D4B5F512938994C18DD0 | |
6236 | FCD9B008F68F0351D21ED735B2740CB1E0C1CCD25EB548C35B844601D98828DB | |
6237 | 556F71D07E081A593FF12DAF83676492A0FFE16E95717A07082B43A966C1EE8F | |
6238 | 8A59E1255E1705C43A23CF29A5E4A6547C93F1680A870EE7BAD8CF74D838CD5E | |
6239 | F806911D8FE4262ED8E7F5BC58B92C9C6D74F8AD45FBB021EC7E97393018B9DB | |
6240 | B1B84E7B243ADB05ADD3F1DB3692ADC5D47FEC7DF93080669E63281F1576B673 | |
6241 | 125EDF08016664BE73364F65389F7C3B66623AD1754ECBEF9E5CE6948D933787 | |
6242 | A5674279ACB2EBECD3B4E6361419AB32028A27670C9F3E18B746A10B00AF6D77 | |
6243 | 4EC00E3BE521C02A99AE5BAA98F793EB1228952BE67934B91472E01AF7B816BC | |
6244 | 56D7F19F631A1927846D800C107B1E9CBFF9D2DD513B4A8CE2E0DFD77B1ED178 | |
6245 | E43FA7052765E9FAF89989D490D8FEF6C536EC0D4AE27A74F474B98DA9E6B92F | |
6246 | 15E063DB260571979A5DE2423920CE1F59F56EB11E00E3BB9D466A8263E1E385 | |
6247 | 2014BEFDA8D1EA3EDA04BE32AEE6CD15C5C010A1DF7F705A2C0C18E87C8DCCE9 | |
6248 | 05D9163181CBA56C0FAC8C06A2990554C8E759D076B01BBEADE3B5FB8B551390 | |
6249 | 6C8E4A2A1C6E7D9C708614626F3770C0AB7DD2027469C77975C27576065862AD | |
6250 | 04E5E50CEBE907E3E991FA0C627302C0E207B4D5992BEBAB5853AD1C0D271728 | |
6251 | C76F40A79392ACCA7358F948AC65DC823CFDA59E1FF69CEBB6B7EC3CF21669E4 | |
6252 | 70D999508F9C49E2D9F8818CA53C977D93E15FBBBAF75B1E84F0BA62BCC4BAFA | |
6253 | 4EEC82D804C8A8C0210F3E5E258BB1F6921AF02BA9861BAD5C3D5FC8CEFABA8A | |
6254 | A607E547B802096F7AEB09FBA99C83C9A494B94408DD607CA6561A6E6660C473 | |
6255 | 62CF8D35F31D052F6C6C8138A8E1430CBA7EA6973D6D510C1A06B3FBD79D9364 | |
6256 | 240C1A00272DA44B89A9FE8D5BF36DC1B5EBB4A78ADBE9C5EDB485F093D9517D | |
6257 | 69E1AC9A8E6C9D7C324E3797CFEAD9A18E82E03F69B2CED7D5DDCD1A218BF2E2 | |
6258 | ED2293AE999FE2A4B5213A10083EE0407BCF8007670B8C737EAB30311C868D84 | |
6259 | 121149ACB4A27F3ED6C0C181C98AAAF51B105F264B5672D7F745131ABAB5BEA4 | |
6260 | 0C9B43C0DD9116D6DC61F90BE72018F290D26D5E9D341055CAF09C9F45333CDB | |
6261 | D45B7954271767F638EEC499F7B53C2CC5774EA7A7F024C4CABFB93D9CB1856A | |
6262 | 0C671A4ECA7C62EA5242648A84E7F3AFB9547A0AFC29593CFCE6D8B873A78157 | |
6263 | D337CABD291431C0A2CE1F37E0CD7340567AC206FF98E4B5A6410F70F750451C | |
6264 | 550EFB54AA259A1B236CA9CB730D2CEF125EC65D959441F7CC9768F777B44844 | |
6265 | CC9842A307C72B740680ACBBF6AA35FA7A94825069BF7696ED81A371A9E5475A | |
6266 | 9D997F2DFAD339AADF797F7E03E654234455AC3D17702A420EE0A597BA31BDE4 | |
6267 | FEB8DBA7C61D311CC90441A620164DC22DC2D373973EF84CC553453AB1B3337F | |
6268 | 7B39983B8DFFB3A9425F119B45C1CD37A76F905777B3154CA6200792F1759D06 | |
6269 | E017890F4041A385F2238E3C48B6C8EE6F5258463FDBFF7AC762F6C4363926D6 | |
6270 | 50F004D473B7B7F73CA686B559C2885F1AA761653C727A77D73431E9D110E76A | |
6271 | 2E55C68CD50F43997C9B2FC4710F8C8540909829E215678E63BB8363C4B8AF05 | |
6272 | 9986102BB36580D9CA95CD216B7C321822CB41B2E0422CD077F3B55E0246FDB2 | |
6273 | 44D5976F67296B5B0BE4B06F6E43535C21164E6C5089C3E9BA2D6B30888C57DE | |
6274 | 49DC8D9D46C0D5EDC47ACF2C03B72DE3B69512508539019B759280BABEA12BC9 | |
6275 | 385308A0395C4CD33182A10A5A229743379C2075D82D8BFCE4A66E1AA087A091 | |
6276 | 8F5372684FA5037D1B92D50CD9CB4F50AD4F8EE7D51F1C9E63C721CB5B9BD011 | |
6277 | 6F0A8DD4FDCD2B008F223A1036D90F0F3B252487DE7898F9AFBB3A9D9CD49E0C | |
6278 | EF4ADAD5155A98D2125ED5A3D3907F67301649519419F33CD942E8DDEAC1BDA0 | |
6279 | E90C431B198F646766A8FA9F8D1561B57E126EF604838C0C1966655CF31FB7EB | |
6280 | C8CCC434FC1C96046D38203E1791EC824A3D7AED85C029288D4608CA7668A2BE | |
6281 | 484C99639F121845B22EEFCE0A3B808261921AA042AE19E641769E91277BEC29 | |
6282 | 4594082CCB3058F90FAC4A700A8A827ACA00FCF574ABC8EB7DBCECD97F2B22C0 | |
6283 | 0AA19E8739B81AF8C6F621D69B8E6F29BAE233FBA655A0AF5BDFD7F5C6B9167C | |
6284 | 6BC7AB693D45EF2AD999F5DA3CEFA39BA48A17EE6D9F2C4DAB91AE3F0044DC3F | |
6285 | 5D5506CE4675AA928B0092D6F173644F91295216D8BBB14CDDE0AD524A4D545C | |
6286 | 1B5E284A3BF0396664081CFB4F186A84A0D24D61E82F4767C1E55A0642720CF3 | |
6287 | 909FA1AB8EAB78030B59BEA067DEDBD2F1D0340E790AB2777DB18248521934A8 | |
6288 | BB38A58B7F633DEA4291B0D5D13E9A882C974697CC6D3B49E030C94EA29B5506 | |
6289 | CC29C44D01B4751B453A46A9F6BF3BF135AE87A4CE232AF57B66578310DE41E0 | |
6290 | 2A6AC422117F1963C4D7CC306BD25A6E724E51921779F22F029733122E23E2F0 | |
6291 | CB340008813ABB104380C80A492B3FC6D0BB07CB8D8409E9576891EF6E5C9D08 | |
6292 | EB8320DFA31BAFFBD336D0C2BBC3D3B2D30368B9860768FC080D30569C7F7811 | |
6293 | 0EBEDA2962476113625EEB555490B8CE4C5F99D74ED10F738C61854CFF8B41C6 | |
6294 | 9402E56BE8856144A1A05D0B05F4CB7EF728B2F4F5A439F18C3B68CEFA41E59A | |
6295 | D8308ADC92EC1289DC84CF48D2CDEFF509A145BF945E1E00D552D329EBD2A7C4 | |
6296 | 21D58082CC8FA790E981F4AC8EAB99950678FD3A7DA3DF13778681B208DD71A0 | |
6297 | 7C3CBD0664B37C9EDC6B601D79A2C51FB54DAEE849F93209793849104E722D3F | |
6298 | 52DFAF7047EEEDDFE744787A5801E4AC2C3D58EC5DDC15FCEE03990C53B0C57A | |
6299 | FC54F125A04C8E4A0ADAA725808C587E7DAFB9F784FA2875689979D316DC22BD | |
6300 | AA36B306A1ABCF907B63C6476737B746099973CAEA8C1E2C5C41F27E0F7DE8D7 | |
6301 | F0D942E34E92F43FE902653D4D2EBB6F3B9F7928B1550A82AF234D45D028F429 | |
6302 | 067652BD3D391BF423AE72B9CB1E8D91E898161BE3A7849D456A861A2046711E | |
6303 | E934DC59442AE7D81661CE8EF727D8D7DDC0270E937E40F896AEAE6171661431 | |
6304 | C1025C53172F9D366834BA0054FBFD84503FBAE328B6FDEA180F8EA35B1DA937 | |
6305 | 5CC3B8F00C206908C2FFFFA6A7AC6915D15EA44BDCF29E2BFCFD4A849535F19B | |
6306 | 0D307C696BE8205C7D84B9C77F02EF27D911056EDBB4080E4D3ED72788666CAD | |
6307 | CD91B0ECE27A177DB23320A7FA9C31408B4D02D2A4B1CC6DDE1A6CAC3D8EC1EC | |
6308 | 2226EC98E51046D1EC26FA20EE62D24747D83CF4941DCE5CCEEC0DBE387149CD | |
6309 | E05B19FFCAFC0D117F9A3E60DCD4C815228D98EF95EB559AD0ACC0D50FFDF714 | |
6310 | 56C3C812EA5ADBB013BBD956A7C4CC0ED7D3E25D5C9AF5E626F18297F75D4957 | |
6311 | F5B0B33379114B903FE98BCF35C3FF76FEE1D9AEB711F2962276531F7380EE3F | |
6312 | E368720E0292A170A15C5539B1FC7BB954EE2624B504CB8C805B8D31AC38307F | |
6313 | 0513606F09211AE64DAC447693B2A0AD15E9A64C34F5A911ECD0ABCA90E9791D | |
6314 | 67C6BD202B0858EF96E7722305B8AC02B01AB1706CC6AE875A8DDD15EE349046 | |
6315 | EAA65005E7866B506EDFB7A5A2AFD5C9E9DCC821A79EE9C1EA2C7BBA32A40BC7 | |
6316 | CEC26DB1AC473C8C3960ACEC581B37D6569E8C8C42950BAB7930B65E1570E3F8 | |
6317 | 9A7FA719F1DCFDA45A3BF2AAB32C9A93BA3552608A61C623DE59BCB346E87EF5 | |
6318 | 9CF025A87803161221C5C1C6F6B3403712C76E9D755C7BD68D7F2DC03C14CDF0 | |
6319 | C1BBED1D648B905B4B17037B7263C1EA7A7F06FAAC4E09E08483A8D714C19861 | |
6320 | 327CD9C32DDF850302DD6DDE24912D00C22ECDF3CDFB18FA831A41A7488EC203 | |
6321 | F564CFE30D506F0829A96D35A7E09C3DCD107D589B627A15B55C5D6649126BEC | |
6322 | 60B88C55ECCBB4E680265D9EAB4CE22965D3B1AF759B01ACB0D0E6C92B6B4EFD | |
6323 | A81E6A648708979487FC591CF09631310D46891423F4EC159A73E30D8DD147A4 | |
6324 | B0EACF6D45D18CD16CEB8176F03ABCB41F2234747B9733C8FAF34AE5D43D3BA5 | |
6325 | 0CE0FACFC9B087F84FB6C68678BC6E76022B1526D6E5B3A48EC1A110BD75F45F | |
6326 | 1C4DC6D39F254976453F57DF873B7D635C80C42026DE020E5BAFE0DA0D54D1E1 | |
6327 | DC634D2621BA184347E5252F645A6A1DB7657C48124186F0E4C644077457C24D | |
6328 | 55753C651A9A7B6349867641464B515B821349C795A645420508673B93750D0C | |
6329 | 7A3B33EB1F09782033742AE8F3A23FC02284E6C03818FADD1731361542E3FA3E | |
6330 | 75B8D52B668C3E18A4AE967D0FC3157083D952AFB8144D549E69EAAC51C279C5 | |
6331 | E5D88A0D9D53013DFFB4352A1598FF84DCDE6FA32FC377306B9B92C0F96EE149 | |
6332 | 8CD55E7B2445B86CCA7A547FA732D52D59025129FD8C6333AC0DF4F0CFF6287E | |
6333 | F2036D5DBBB3B91B92F12FEBE0B61A313A4DB5A9CF0BB3DDB781A56FEBFFACCB | |
6334 | 8CB9D1D3DBDBC4CB6AAE6769E470582403CB920630221B68BCB625CD4605FA8F | |
6335 | D3D5B7A1A28D15E44B38E92E906C138E72C15B86F64C38E23BF0440052A8C914 | |
6336 | 54397F49DBED99D0AF7CEA3B0A05FF37C2D7EAE1412567E6776333237C31E3C0 | |
6337 | 49949EC8BFD6E0F6446CE2D4DCD2C1524A288818CC5D159BF8463A847AE4A2B9 | |
6338 | CC8C58F822804B81B13BF4F2DEB6229C4F51F093075581791D02C36A13B855A0 | |
6339 | 34900AA7CD4F1A797652656FE3A8425A38F421C4CC0ACA1CDD44FA6B31219276 | |
6340 | 1CDE1CD63D6A58CE705CB56CCA1260F9B86E989019071563A9B4C274A87558CA | |
6341 | 6EF1660D574EDA276801F0057740E2C3B80D253D697736484D892CE1AB128B8A | |
6342 | DECD69712F5E70E895FBAA927E8194D792A04AB6CE205E04E38A433BBB793FB4 | |
6343 | E8BBC4279D58A223C6673D909D6AFECD246E66A52F4CB35E5931D24C828489BD | |
6344 | 4ECAF621A220D8ECF702BEB01C4FC7510197D3F6D15321EC87175ADBA6434ECD | |
6345 | 2B5A306E91375CAD22CD94301763E4A8B981472890422C5488FCD523C9CB17DC | |
6346 | ED22FBF12D5F7525D0D6BCFE8CE85B0DFB1D6F989C267FFBA0A996D309E4A934 | |
6347 | 3DB54A9D29C88B9D55D7300DA3D46419256C5A07A2A529A8DE8BD1727281F5FE | |
6348 | 97033D861E0531B14E811378EC1AF1CC7EE9BA2B07D935843D3053F673979F8C | |
6349 | FAFD59D555B56CE338F606747238B22BD62C42BB7238FEA335678D474A643570 | |
6350 | A9E7B4970E8C541CE9DBC7BF70ED7BA33639D6744A18379455029E934C95E2EF | |
6351 | 639C4848CE9A0879B51649FAB023A71782444B451F92A34CB8A124270CCF86D4 | |
6352 | D18EEF5C1D2B2A29012613851C49F50702D63BACF95EE2AB4D72B375E0A62615 | |
6353 | E0991E130A67ECBA9E05329B740708F1CB148724C3A6E5E3AEC1F88EBCA398D2 | |
6354 | 1CA8827C977D72734310233176D1AE26C55CF2CEACA62223315C28FCF6305C7E | |
6355 | A22414D4739A059F552F1F9372CCCA5FED4F9AC987942848EB498900269511F3 | |
6356 | F408CBEA0659B954F5F1B18AE4FB270213646F9B28AE4439D2BA2D3E0AAAA780 | |
6357 | 5E530E4EFC8A060EB979E12191044509DA0C14397AFF949E12DC970658D5EAF5 | |
6358 | 4EA963F5BC1407A32F3837CA6A24B7F3D60EB8E6222B702E25ED903F9D21AE50 | |
6359 | 664A095009BDEAF4B78DAF94E5A55D48366CABF07791A1684B2F54EA69070844 | |
6360 | 4F031AF8DF416C2D3679F8BA038B0DC9DD0400CA6B34667BCBBC07E62C1668A8 | |
6361 | 35A8C57C9048A7227E672E89681B54D662079A189A9E96A3CA96D8DD10189B04 | |
6362 | 1DA49BA2729F1CA585B1BD5C467295285D52E47CA904235A1A3E48EFAE9EB6F6 | |
6363 | 01374125CE89D53C276858668CF45D2F092DDCAA52418E0BB94C2B8266B4D88A | |
6364 | 5D911507BB1DDA3D8F6E7C14A91CA11AE799EC42E993098E18CADA70BD2A1D82 | |
6365 | 2C39326C6E3F9E84CD9758B9AE43D79BF99E6A0CD713E95B3D9B7DB90D127DE0 | |
6366 | DAFEBF850CAAACBD860B5DEF2082F1ADA64B44B193C4A1417BE221FDCA36456C | |
6367 | BE5934C8CE3ED55AE3A11697C2D682B7D0F72D48976451D205783BE25DBD2507 | |
6368 | 39C14FFB4BB828DFD187104F38A7F11D5F0698C11E8C1D4F107CACE573FDC4B1 | |
6369 | C56FDAE47024D6FD16A2FEABB434CA320300FC4B6C1B6CA08F76C60B7C08A665 | |
6370 | 99F404DBA8A2A1EB18EF6750E4EC186E31561A3F080BA6562967546715859481 | |
6371 | 7BA782940F5C5D06626D6F6A412CA7C13820EC7C1DF23E15E5829F698CF617BE | |
6372 | D940523E4EE4ADECEC48C24297DBAD528BA1DCE7AC335A1D15D55415B108EFC8 | |
6373 | 6D45030D27B3EA63B2B4CD771DBE66AE0218ABB1153D4B7482289D1313CEF184 | |
6374 | 5C960B1E3C3C953912CC6F4521D1E15636C1545EEE457EFB87B88C9E43CC2F38 | |
6375 | 6BC4BC96969F4FF28ABB06F4454C01CEF1B6DC538F1E832FC1666D977E5A881B | |
6376 | F72F1B4C7DD4BE167A5535F1163A0706F9A0B26400178DF8A128FB5EBE6A7B81 | |
6377 | E478AD183EC06622B591337B9F1872AAEA356F4FC67EE767B34CB5A4D90702D9 | |
6378 | 39FB846947F4096FB3DCF16EC81455164783BA0B5D723060DAFF411B68307E81 | |
6379 | 7BEA1D9A47A5AA3D648E618C83C60F060029E6EC4D46B045FA7415BAB2AD0AA5 | |
6380 | ED9C729C24136F6AF61E6409C0B5CA760B16225641E268A68CFB8260BBEAFC77 | |
6381 | 6626EBD97195E77CAB425CFB0096D805D9EE699E41680D095AE9FA10122A7882 | |
6382 | 2F00F495C9EB2102DF0D3E61833BC0A2E468C5CF7AB430FDB7C0BE3DF2C0D230 | |
6383 | 1580BAA25D65F599378D873165482A1FBB224AEA89C6BCCFBDBA42AE1C5DCF41 | |
6384 | 06969F585CD3B737D1388D6359F5468D88FCD2279BDB270F6A858FB7D2ABDEFE | |
6385 | 5EE8FB79FA437F8F50237B92C307B73B0DCB808D07A9C3255CB9B3B17039CE5A | |
6386 | 288103D05D132863FB522A02CEE3839EF9AF7F07D99732F0B8B384745369FB3E | |
6387 | 7901166478F4A16076A1504C5E98D17408494E270BBF4470ED12B4332422679F | |
6388 | 759F1D93984D7E506D16950DB6C2682FE1379EFFA6F6C95DD71F6E55BE3EF6AF | |
6389 | E0CB25388EEB436E6527806FC75484133F6E561DEB979D5C1FFEFDAF2A6D964E | |
6390 | 03BAE0BD593C2992AD84569C81050F7A793C5263E50C2F50B98C4CC703EAE17A | |
6391 | 6AEDAACE312DAFAF5278D125B6EFC5587484F61DAFF46B87B7C9B1EEDECA4859 | |
6392 | 314A9A9E2248467DE1E54D90DD671660B9040B3E0DD982260822177EFD757266 | |
6393 | 74A16C83A7FB168016A320D3DF3BD7726F1F4EC90EE5DFE810C96B099FD4368D | |
6394 | 906AE4699049EFD37E8EF058D4B97BF71106445AADD4FC6E90615A0066823A36 | |
6395 | 673B8DE32322BBE861AE251226B4385AB28702831270DBD25D666FBB0AD7B96E | |
6396 | A44E891EA1EAF0F87013AFC982E33D67A28E96E0C9CB99B9E4192536830D9901 | |
6397 | 931A8CAFA41289633B20BA3BD7AA3414B6DA8D57CCF2FBE39920CC06361F075B | |
6398 | CC40335DB9A0071CFF77F6B7BB47F3100DBDC9C4A58C2B81EC99E8E966AF3390 | |
6399 | E3FBCC28BA1D79961C8A1584266454DF772FBA99664D74D4A89FC82FFEDFCFE1 | |
6400 | 4C9E4A04291E803D142E37E7ACA66AB279378F2F192FFB2B5BBAD18B95F03136 | |
6401 | 2CB594A3D6D3F8576B90A6C4DAD6D6C8EE07AF682F925F01D0B26CBA347C03BE | |
6402 | F3B0585CF4539FDC66915E22117078CC94D621F31DCB3E021998A5D6EE94CA4B | |
6403 | E214D07517283D56973D8E4367392BF6C1150DEBF459D141AE0941C1C8C5CFBE | |
6404 | E735D796E365A1B0F60BB4CF2801EAFE4889EE5F338D3C4885368281B3C95CCE | |
6405 | 251C28A90D318A8A0384439B38D63B94757252062EA44E88509FDD2E75FAAB71 | |
6406 | 7329622828B2785C1A8B26351BC74237A6BF99216652ACBD4CCF54CFC8AC72A6 | |
6407 | 46342F1E32D4318E7E27C7B2DAC943B3E72C472FC6F1DDA8684AA922516A672C | |
6408 | E969C047E318B5E3B1270C1BEB1C4071A15BC81B29B268C679B41FC5E381BE33 | |
6409 | DD95F0D68118CBB60C521E5CB2BA46A10E50E9238163713290DF6DD8A27D3813 | |
6410 | F871C07E725D4518013D9A84CEC96782541E5580E33C2EBCDB18F08EB4655A46 | |
6411 | 507A8526DB26C854928B81FD502B0CCE4A68943C12078F57C10F4E85FBEE1025 | |
6412 | 46D925B8B3B447D4920410FEEB9844FABE985F9228FDD9F58392F2F3BD650E49 | |
6413 | 2E3AD5A14984874DF4572816931885CE8A448EC95BBF40DDF4F85653AD90A88C | |
6414 | C4A879C0C7596E61997B972E8A55E57B17F802C738E5C7A8FBF6424F8B131B23 | |
6415 | CEE3EA3747DB066246C250EAD335A76FA166ABF75120CECB59076AB31A51F176 | |
6416 | 57176CBE8C802A97B0542A5CFD6D5E6D7EC848B923012E45D9F065BFFA0D03E6 | |
6417 | 788B68BA4DE51DA37994948F859D41C28BA939C3A82BFDB44DA585AE80B8CD7B | |
6418 | A6EEA79B70BFB4864E06F06A9751BD2D2A209D150D7135E0A25D67263EDD2A7C | |
6419 | C63B5B76ADB05D44BD5BC0BB3EBCE2E74E1AE5F7DE07A59D90C932DAA2553505 | |
6420 | 27F2AFC05F7CEB39E1C7E54F69FB0BBB069959F2FBD11709F8E81F6E7CA06DBA | |
6421 | 1CBDD8E7A78487462596DA288B50B295E46F4C3D9BA862688C68859734B232A7 | |
6422 | 4B371D2BD786924F186524765E789EEAA30B20C069322D42C893A30BF1BD2C46 | |
6423 | F8F3732DDFE80B8FC1789239345944D8B457824FD80D11184E73FBA30EB80A9F | |
6424 | 2FD466826D4E666E3A835B98A1D4AE5D17053A6A648E26E77BD08F9A3E02956A | |
6425 | AE82C4929E9666F539079846527D0E326FE7CBBF86E3722BA3E53F8A5121080B | |
6426 | ACF8D3C67A2A1DF624B9DB92105D3C833F5A6ECEC108E026E1D3D968967A1447 | |
6427 | 15CEFDD09123D56606134BC3449404ADAB1330C9238DE48F3CDFBC91EB86D7B3 | |
6428 | 8B85B5BA97376A0673E434DBFF19798EA90BFBD94493E2D21976F8106FC0C276 | |
6429 | C81C9B9F7D4A68120DDA56FC6EC65FFA40DB78A60A05EC270A106DEEBD2CB92B | |
6430 | F0622BD2B1D43771DF39AAD3ECB655F317AB483F7290C148690903AAA636583C | |
6431 | 99DE3DBA99EFE20773D3D8DDD816A28D7BD8881DE570BAF5C7A30679179E1214 | |
6432 | FCFED81605FE56AEA21C1894167F93D648B474352A65C0756F812F97AB435ADD | |
6433 | 22C031A21714A626DE35308AC51CD676DB1748DD2773532294FA77CFB2AAFD32 | |
6434 | A72BB7A045F12B4934A768F89217233DBBD69B900B28492A26713CA5D61A9042 | |
6435 | A982CB071F1F875718FAC168E4E275860DB6369B8114E1BDD4801110B62C3E3E | |
6436 | CF140554C826967A99F4E9726526E87D57BF845CE38E33893E5F9788769B6A4B | |
6437 | A4577C38C8D45AF2EDC9F4FA7DD9979AB8E14FF5D8956233AB4C02982BE8E561 | |
6438 | C63B7BC314793F634DB6F086E1A60D9FC3B69D3A7C20A99FBF3CB028CDBCEB60 | |
6439 | E803C8DC3C5F0CCAC030905E72BBAC052520CB0E40E23B46B2150DE67F61E4B1 | |
6440 | 8C4D55904B7F90DDE4A4A78B11AE1009DE46DA396791B1C0EA63FB6897FDFA0F | |
6441 | 42474042E7E9B06A703A7C6E672AC6705506F3C0B6861BC85CEBB9DC9BCFDE0D | |
6442 | 43F5248CD7CAD4B89835BACABBCE6C791BC35FE7211E775C009844FC75CBF6CA | |
6443 | DA6A6B7B488270BFAFFA3E9950914CB0F88C8AB7CDEFD2FDE11ADA7073037EF3 | |
6444 | 1A5CEEE37090F3A56D06FBC70597907A26498593783878C02722ECFD5D65903C | |
6445 | 7D421CAFA78924DD27756853568535B02533C3393183D6E30DA6ED4BD6582E09 | |
6446 | A5A4B4404EC452E91CB44515AC6124EBADAAE8A98D8A95E7D14DA39951EBC461 | |
6447 | D426490071462F246794023DE1BDC04AB0F1834D50F748C3C60A07E1FB8EF400 | |
6448 | 78DBAB90B59500BD1232A872ED51928329CC8F06E83164FBB2D0B24222223EE5 | |
6449 | 992241E8E00D5DCCD6DB9A8E2325ADBE12FC8512AC127BBEABDA739672C1644B | |
6450 | 554850CD75724E6779A7E76424CAF89E9455860E0AE2679231F4A535C0ED4336 | |
6451 | 313717D6F7A4A4DA833847A1BCFC7BF99234FA645F2B85C9A9AAF7108931E3CB | |
6452 | 077A9C571E57B0D7EFD92B56C3AA4FCEC0BCAA96005E649AE8012366BE6E62CD | |
6453 | 9E742F8F45AE4C96BCD73AD80AFB6F061D629ABEAEC3018CFF45E41F46751953 | |
6454 | 44E490B1355DC49C1E10BF343307263584091D122ABB1E3892E532B6DBAA105F | |
6455 | CD48375C112331EC5DB49E4D4CE2D126C9274B21E678E5E3EAAD4EA0CAAA29A7 | |
6456 | 86FD8819217B195EC6E40AF23ABCD71156656DAD38C931C8730715A2773DC44C | |
6457 | 4DEF14D92C2A054739F27D7EF349A0EB76D952BD9BA169B4F85C09D80984D232 | |
6458 | 2CB4A3812BDE539DC79E2EDC7C221739D16B10246A5F57151C210878556D4176 | |
6459 | 31EFF3AB6C4D78C4F0DF81692B3C9BDE4F85242BF0E84BACBFA39688BB222A81 | |
6460 | E85E9CB332868ED5B64E140C66E242B97A90C13B6DFBC3D285A49BA9D4BA1A47 | |
6461 | 64D83577FFB50BF974D953F42A249ADF9AC228CC4D8E82213FD463BC757AFF26 | |
6462 | DF4D1678FBCD55AFD5FB3014C0380B2F8CA9D6400DF2AA041580A6FA5694ADBA | |
6463 | 674286F00E531693DB28F7C996D5A66F80AAAF53001EDFBC065C72FA5BE3F114 | |
6464 | 1FA3354376AEF7374AE1D0A8E9B06C58FD029922164DC9FA09343FB6652232E2 | |
6465 | 2EE34C662F0092BE479D739ACE775C6F589775DD768B736F7391B9AEBDE7F760 | |
6466 | 727702E145CF749DC457B2E98A36C52416107B1E59084B5F777B61511B8D17AC | |
6467 | 88386A7933CAF852CA23FE179B67DF8DCF15800755605847ECC0FD77873727FC | |
6468 | 1AF2BA8BC75D30E26C40913771E528724FD7C5DE284A8B58AE55A5C48AF26AC8 | |
6469 | 02E155B8FCD6755D8F7F5A6F1AE66E4D24A13567B6463B18E65972BD75ABF732 | |
6470 | FB41F87A62FECE9A50C697BCEA1E3B3DF1E3DC961DCA598220CC746326F85F83 | |
6471 | 72E803A4E69106EC5BCA01139F92171DBF9964BBEC8D3370039623CA1F927CBF | |
6472 | FE7DA71B04B4321EB4D3FCB27F8404994CC7DE5F26AB8FC019A203D6DF2F449D | |
6473 | 85A4F103F7604986A1AC1F7D05D239E728FD6AD1DB5024B0A0542130D2B0E7EA | |
6474 | 4432F910F9FD75568F5732EAC95F7A87CEBC359949C26595741533E952327791 | |
6475 | 87E42DF84E1064E1BDD3F5A6455087B8E9C783AB9ABBCAF032E9FA32C27ED7E6 | |
6476 | CA7E3D1D76CD1905166090BD81A85485B9B4E976DB2E19A8E62EFB795FD6298C | |
6477 | 9ADA57D5BDA2FEBB227F0EFEC59E4B51E06B8358006F9D79C1EFE92510D6046B | |
6478 | 6AFEEDC793137DE622A8B3F5C9E3B21F29A98A589D9CEE75E348FD4D206415CE | |
6479 | 508AB95A7496236AF1F6F5ED6B3ADFBAF1E35B51484F9B1E0C11C5AEAB9336F5 | |
6480 | A8861ACE1EC74C4A145A64E4FC8F6BEB3A16B021AFF4AEDA59B06326A8D7FCB3 | |
6481 | 3B75F9729BFB7EEEDA8A1774728C80AED40BC35D42045E5CEEBBBEFAD2566CB1 | |
6482 | AD69A9A972826DF0F2303BB232367E611C115E8955DC97779B1AF269B84574C0 | |
6483 | 9D816C88BAE3AACA6428CFC648FCF0869AD9236591E3B8FA326BD2EDE7F97286 | |
6484 | 511C75F4EE4F7B4DA33BA2CE7F778D92AE7C1B4844CAB3ED8FCA285454D78469 | |
6485 | 1639D24729E8002E4507A114407DF51543CF7DFFDB7E05ADB2D36E139F2DBACF | |
6486 | D90AF274AFB3E5AB5B38918A28EDFCF6EACA78248BEFDC2FAC0E041AD35B130F | |
6487 | 8A91E20251CE976680FCE3F8B65B33118EF7C138CA1260D3CA855C94FCC02CC2 | |
6488 | B29C94A3FFD38056ACE512DE680DA29D97BCFC35FB2A85057E484FC9F72C9A7D | |
6489 | 08AFAFCA705335C6E9AEDAFA97D884E0E463E79D8AB45DDF86C56EC922283C4B | |
6490 | 777EAABC0D57BEE30D4D47FFA16FEAE2FA972E36516480E1FCAFFA5CE692B7E8 | |
6491 | 8F887C5AE573B96643F10BC62FAFA4BC6CD04F5353C0D40CBCEFBBA4DE7B8960 | |
6492 | 352E7F6497C9C4489779028934084522336B5E5DF6FF84A78158ED5035FFFC9F | |
6493 | F199AFD543D5D81C0155F3EE0E7F6FAF7898F7F26941D417F7AB37703FE67D37 | |
6494 | C263078FDC85C5430CF379E657FF9ADA0C00DBD605386F5494459C63D4AC057B | |
6495 | 2E061B06E17B54AEF38A9EB401FD4C76C6755F2AB651473DA2F19E28C89229E3 | |
6496 | FD385D8559EFFEEE5D0CEF127A8A6CF9017459466E0FAC341DE1994C03A0CA5A | |
6497 | 799CCD03DD2B41A05F7B36493638AAF8D7CD380E03726B0A18B02A46A0BCA027 | |
6498 | 9BF16ED75AE0494C36161ED2C22DD7036FBBA2E319106B9A56FECC732B87E2F2 | |
6499 | 596167125221D42DE9D4435DAD321F878FDA68B9E72DBC2E31178621327BAC50 | |
6500 | 72148C123D4C8568DE822169839906B9F0ACAF3B4DCEB9352C8A9E246A9A5EA7 | |
6501 | 31E04981D0A53F44B6905704CFFB9F0463518C02538DEF2DBDABE936D1213FBB | |
6502 | FCD28F833C5872057CAA92536B8E8EBA129745E2E2B5A9F07086A1212D466785 | |
6503 | EE640432A0E47C91CCFF3FED5669C8ABC2B43551AD04E7A2FEE2F3C16511F7D4 | |
6504 | 048A8207351E83AD32A72360A2DB1AA8F78C5D2630D770F5E13D5C49BE166475 | |
6505 | 79483B2F7FEBC1D73B04E0E5D9B8243DBEF7E5D201D9F644B150A230B5CF9B90 | |
6506 | CA34BB8474BCF408E37757B8CE5B33FE7400A68C70F542C7E2A22B8C0AB1EF9F | |
6507 | 2BBA7A646A4C872C43C0A748F078AA98A13E882085B460050CB3F5B09B62EC01 | |
6508 | AB87AF8DFCA6823ED6CF8426EC115C5E4DA335FE416E1D37311B7FD56793CCA0 | |
6509 | BF90B579B0FD4E4E1D0A26FB0C1D490D99CF4994693630FA343960E15AFFC596 | |
6510 | 49BB7297BFB82FD56BBCB36DC1597F94A157AEDFC53419BA867CC02C26464BC0 | |
6511 | 2875127C688DA6902567716A908153DB4CBF710CDBCE50AB98E0CCF1DF5CC571 | |
6512 | 00027F6582CF6AB4E584436471D3C8DA2D780E5B02A9B1717364899D51EC679D | |
6513 | CF5F4A4981EDC24F710E892772E4F891AD02B7B98A113FB1AD2B5A51046693A4 | |
6514 | 19D03A75A3140C19791C85A0DDD173BB3618E9498CDDC8696CCA6EF81729AD1E | |
6515 | EFE4F3D6242E1766A3079371D1D1833841F46F04F2F8029D8C1943F6986A95E4 | |
6516 | 9E77806F221CECAFB3EAE0F979DADC5D2E4715BFB5C64245CBD2300E59030B99 | |
6517 | 0885F08417E1A0C57C3746230F9EF4E968C0F41F67706BDA2E983012BF317612 | |
6518 | 38E9C0178F027EDA0E679F306AF71F0D8985C712C4B4BBBFC57A86AE052CC2FE | |
6519 | 5C1BDFD948801509ADFD4FF9FA7A25E30D6CCC7C7E418EEAB34C4ECC6AC8FADA | |
6520 | 637B5CC70136EA5A57B727EB11075755A7840215CE2B9939BBB6C3A7E22DE42E | |
6521 | B3725C1AD0BEE0A54C0B57CB93E6A20E319E2FE4515D80D09972E0A742D20DE0 | |
6522 | 55117C1B9F3C181456406FCA70A7E3B757A813F7CF9E3562EB8CAE1CFB65DAA2 | |
6523 | B384C17AE103C20851906846AA4AA5EEE5EE989F292D42B11EB4C4FC057EE4BB | |
6524 | B09A4D81E8AF0CE1C851B2E328E977207A6989F13F7FF039A4E295507CF0A53F | |
6525 | 10A345A516EDB7C5FD5763CC27543452249D229BC22099C6FC1DFCC07A35144C | |
6526 | 6267BE8D5BDCE57F9C7C65F6A64A74DC2207C8601231477DD57BC8259B26C683 | |
6527 | 22FD4DBF0E3BD814E31C9E194CE2EB212268A249216DB084226802B79DC72AAB | |
6528 | FAC4ED3AF6BC51E2D9A1D5A37F5124BEBB1E0B010C34A1B7FBCED45414AD2285 | |
6529 | 43BE684BC7BB56C5036D182AFECC061F749522456B4DCD80E3315F48E7E8AB98 | |
6530 | 40C4FBDE71DA957C8FD860C4AB02C97578BC8299EF448A526CFC585F27EA14E8 | |
6531 | 88F9928CBF87C8E46F69100F0CB43E2720B0BC8DCA50D59FEFBB84383B4036A3 | |
6532 | 0ED89F67B433AB4BF686487194107C63BF989A80D761EF3FB20146A0A496E5E9 | |
6533 | 26375866581146F3537156051C61F82AA5C68B6E8418297DDA7704EA50262775 | |
6534 | B96E1E1D7643370288780188ABCF25B9B23BBE408EC5DE254F51469D5FB06FF6 | |
6535 | 2EA926F94CF1730E014F34822ED267643B773B7CADF967D431B6F3DDC998E56A | |
6536 | 243880E9F772F3BAB3702C19C5DC92ACF864D6A771783E178F4A7BFBAD36008A | |
6537 | F0A61C5B437A69E31235DDA9898B4B081F1176C197C0834CAA25FDC9BEB696AA | |
6538 | 8ABD1FDBE17E30070690EDA533E2EBC19180DCE4CA8146D6657BDDB765DDFB21 | |
6539 | D0CDB86912E49DB109F66DBB9226E297945BCE9073E724EBABB58E42AD94CDA4 | |
6540 | C9DAEC40F79F3A3D36777B18C61DC9D22EC351324FAC3426917C893E36C8D953 | |
6541 | 4ACFACA05F8764BC61A17F6B40D3A97177B97CF88C2B0023ECB3F29F9CB347DC | |
6542 | E686012FB31904DCA042679776108D9D611EEE971D341ABCEACBD0866DA21DCC | |
6543 | 270D3DBBBC9CD438F4F651B58D1405A82960CA991CF690B8B564033154645D8D | |
6544 | ED5E4E059D9DFAF3A5C2BA1C1AFE1B865901C8D117262CAB210A3C7A03443544 | |
6545 | E22EA5577AEF1378A9A4528592F32A8AEBCB1CB6A7E4948FF78C6FD230A5892B | |
6546 | D8953ED89392929FB91C042D31E7E8A4912FC701E722D7FAF0308625B3B748F2 | |
6547 | 26DE427383236E131022A95395C72B3DEBB139C81811582FA4E9C7F970FA605D | |
6548 | C8DBB3ED8B141428ACE6DF426B2567B10C5D68A4060F25D5D64BA262101CF5C3 | |
6549 | 4B7948CDEB6CAC66FFFA0F1795C5F3174F7D319D252DC2D22BD08FAB54CEA742 | |
6550 | 64C0C6B94BDF182DC0942C0C82E82A0B04654A7C2E6BE685EC3DAF1D5FE48790 | |
6551 | DA815DBBD0A176BB4D4424ED7F893B4CED54C2EF94D73CBB154E547CD33D874A | |
6552 | E754A17AD1F10C23BC5FA4E709330A10A73C93B843D8CD8A65D5A4241B35CD19 | |
6553 | 938F2BA2FA95551F0C2FEF1CB8B056D9A9120F7607BD4C497762C577B66B2DF6 | |
6554 | 8F3F661EBD7F3E73E3A0032790ED80F774423A026F8ADE2FA82129E1FF27DB3A | |
6555 | 1B6E603479668FD783735606F7AC6BE9D65C17F7ECCA3B622C13F0FC95F8259D | |
6556 | DA4801A7EE18656AAC3D730CF2E17FCE8657AD6289850DC06E897A759F7B53CA | |
6557 | 502E764B07FDDBE6E99D25ECF1600D6646622334871C57133A8AFD03FBBC2368 | |
6558 | 1BCDABFA9FF4C4A9EF150045F694A3AA487BE461BDD2BF1BBB38BBC365837063 | |
6559 | 70963C7C1E7E4809797F4E497DBF6D5A90A71D6E89BEEDD5D16B31ADCAD67A81 | |
6560 | A9A3085B4CA7BD93E1A9591BD4A7C88FF930EE7A131C5F3338817D88AE31813A | |
6561 | C09D5E7120AFA6565B0A647A40CA94B78F20905B7110FE44A90794F7F0CD63DB | |
6562 | E99675C781255B7BA257CEB14DFDF9C13A02701B0FE41C6A6F50CC62C028A3BA | |
6563 | E9A918549B7F9F206DA0909F2009CC87BBB565F281F24D0ACBCB71F12709DB31 | |
6564 | 5D355415D97F66DB25CAC37E90BEDB51F2FA97E0A61EF85E845F702D0B3AF935 | |
6565 | 14F3EB201323209D76C7C5970AEFCE4225FFB4A1477B177BB52332AA0539291B | |
6566 | 9B8004F23CE4E055F7AB6D6F2A8E74C2994306A407A4FC831D1C887C42FFD0DF | |
6567 | EF07891681C7F4AA914AECC427057A8D73261E25F82DC3EEE7295C0870E91523 | |
6568 | E15187584B32B8F8B0F2E9BF4E67E5A2858F00B0C59DA1B1B59B00374C6C6AD9 | |
6569 | 741E0998EE0DCC6F5ACD1925CC40807D5B66E971CDCFA4651BBF2490FADD15EF | |
6570 | C8A7EA3ECD078D34D875C3EC5EDAB74AC0DCA00F2329184455C24C97EB0AD4C5 | |
6571 | 40B8E4AA2CE6E7816580F9DBCDAE7F01AF0533397CD37C401D4841B60CB976EB | |
6572 | E3093FC863F368C85AECE6E6CF7D9ADABDF628D9806C1269A0EE06FEC90948E5 | |
6573 | CBE40C0A2C72E08D9AD94F07470692D571F595E465CB32BF486AE9C3971B6F7B | |
6574 | FBBDE2699E1FC9DACB156D880DA379262A98C6708A9850FF8EE36C35FF636E46 | |
6575 | D8D00FB3550786C1D73E6B91F9B35D6998F33BC953E0C8AFF996F4C707F8DBAA | |
6576 | AFD76432E45605D5E703C2569856A0BD8C8ACB29BCAC87F1A72F859D20205328 | |
6577 | 6272929343C1CBCB053D7E19AEC4B2EFAA765B2002F43E7F62ED5281C94ABDAE | |
6578 | 750B2C88B3801559FC6DF0D66E55952FD67AD41718D49D35DBF2B7CCBC1E755E | |
6579 | 800ABB45EA4D7547756CE9E6D3AE0B80D8D97D681DFFCF4D5D5330F0FD6AA729 | |
6580 | 5BCB1475F18E9612197D6F5F7C7AE8FB931C242993D385AAE7829391D370819A | |
6581 | 496B9518C6F913E666C27F0896C7684AA1DB1A335C7B50762B4F8445D45C907B | |
6582 | 9E30F7FD84E403DACCB0A8DFF2940312386C315FFA700B0E42242EEE04042E2A | |
6583 | 3F4840E719A42FAC426870CC20DF083537010550A6B43A02A330D92CE15222FB | |
6584 | BE6A9F6EFA44F7987224533983D96BD2E1E536437F89E2E43884AE09FF5C7902 | |
6585 | A284704F78AC067C332EA207F53CAB61ED51EF3FE79A9B7A373C3DF72A4F3A5D | |
6586 | 67B4F60BB470E5D093FD880AD32809160E550CC1EE67E01CFA80318C03E6FDAD | |
6587 | A8E744FEA593E2761C60D2CE83F3F6D3A2B203739C62A69D4E271FA12372C45F | |
6588 | 6C378E4CC21B9B0CBFCF43233562E4BD4D52F7A634D1F0493F8DE445D140EA4A | |
6589 | D3956E9971263B7C3CAEC8AC83E541D58F52E00C1C80EBD9A31F0A9D17FA2D63 | |
6590 | E5E0D22CA28D51E39A055C40AB769EF224AEFE2AF714E322FDCB9770EB00686B | |
6591 | 208AAEE2160D059DEED823FF4F9769359C183A6A6398F9E4ED55397F02C68FB1 | |
6592 | 016CB495A0599DED25BF1006343DF9AB7C3BAEBD1EB2F99F4FCB07E84AD2D959 | |
6593 | D1D573B89C220DAD815D9EBA41CEF4D664630082DB97645AEA6779A8F0D7765E | |
6594 | B76A4B8B429CF95F22474EEF2FF1C792DD525E50E1EE0A1ECD78570970B62293 | |
6595 | 43DBE6E9B97585B754AEFE28E960B5F8B3F549EC7F168FFFC5EBB52C7CDDACCB | |
6596 | DF9E1FD89F2F8CEE44285E79724FDDFED021AAD2025006239EE5CA8543B86200 | |
6597 | C7E8522668B07608615F6F102E295003B1B89264810A2BFC3DAFECFF126B1807 | |
6598 | 2388839274203BEEC2B319C7F263ABBE6B181FECB5FDB9516E8F0456B6A1BEAD | |
6599 | 7F45DB0F95F4943B2ACF52CB30DFDC6EC936A6292DC2AD0BD67164900CECF3DC | |
6600 | 097528073246A88607DDEE1DE4BCFC298892F3B73E897734D7001A466170F60E | |
6601 | 5F2948ED36A6AC13975086A2D68B6CD8B033CD14C1B85EEE4AD3679D74DEB998 | |
6602 | AF62D045BF1102FB3927E5B9078F8AF93A0ADDF1937276C423CD346F30D17D3C | |
6603 | C57CE052053EC21A2991D063B157FD535850DD63E55890427BC2C883785DFBA2 | |
6604 | 436BDED247251001AB1AE56EA19880B88B3F1BFA6C232876E6C002E9EA850700 | |
6605 | 517C80537C27033737A162B10B179624F869FEC056F339D5A292E6E945E7BB31 | |
6606 | A271CA30990B4AA5874CAD851C1154275BBA868EDA5D156F4663E2D436DE6DD2 | |
6607 | 74E6579AB19EC803927046D9130BD9E735D64248A6FA78F1DD6B51DF0B1DD553 | |
6608 | 316D96795355878C426BDA09F052D54880E5F3E5C1F29786DA0A8084D81A5849 | |
6609 | B2A301BFF171446EEB4DAECAF40D8C4F6C489BEA6C592F8257E68C514180756D | |
6610 | A13569A03827561348B73584D69626B3175247018DB9DFAA9E989E55C97F9A32 | |
6611 | B02423EA16FADA78FE1E3C56EF4122C640EB8D77C5E957B5E425A2FBFD173423 | |
6612 | E8AA1758A91E1B5B85D174D7DA1F11B3AA76761346D2464BDBA290435A6DA50C | |
6613 | 1F14E14FE29396C918E3E4C388E93D1C3F7A7161FC61DFA1543D4CA86B6A3A5D | |
6614 | B64FC69BADC3F3E0F7DA2AA5FD6C39700C2CB8A6C823D2620D39FBB0B507003B | |
6615 | 6D28C8D67F57C019DE3D8A4B6BD01CF0B305163BB1229F470AAD7436D13C326C | |
6616 | 5D205B4C818D0F765E2B9FDDE26B033D1060EBEEAD6E5C49EC8C6F395B54C259 | |
6617 | 4E24E89DB787773423E358A1C64C3FDEE4CCBAAC4AC652012A0CD7269A062643 | |
6618 | 0F52A1BD1DEE9401B5835752C48CD0B705476B00458D31E70599761C793987D1 | |
6619 | 1A14288D5EB2C9452C2C4524202A40A8C773AA8A3B9D10ABFF457478532B2C58 | |
6620 | 0DA8776E116853B77D1A8EE320C87B23A693BB5D3E77A9C419772675690DD75C | |
6621 | 7AC5BC3ACF97BB11C70C0261EB5DECD96577D755B03EECBC66B3B8FAFAD87950 | |
6622 | 94AA617A40E4CFE88939F28D0D36C5C6FB5B4F6E4321BDBF12DCD428BDEC76DC | |
6623 | 192AD968A9699084DBFFA3FE06D5F79D336DD6CFCA4C9E1F427A29DB1F4F0492 | |
6624 | A29F5F052310D455E8AE1847083B70EE57C4799FF4B470655D855B8298FD3694 | |
6625 | 66E00CF5D04415601598C0ABD6802FA0DC4C12965546076E46C2DE87467CCC8D | |
6626 | F9ED9FE429CDE1DB2AFE61363327B4D11F46C678B59E74F8F09D8B9C14C48004 | |
6627 | CEC93F33A4A6906CD71B2414C05B3599E4D1FC1EB839D4B5E5968711359D3BB2 | |
6628 | 8E6E262896409C7EE86DF7A8CF1DCA1EDCB2BE723CAAF5B1D7DC94F093864855 | |
6629 | 7FB08EF776FDCF9DD8342ECB7F7B307542880A7C04D3BD09D65BE13F80E36120 | |
6630 | 24BBE4C422F1CC0DC956CE53261B903ABA0E0CF1CB0AA8895C0DA8127DE3DC9D | |
6631 | 4B491926B5408AC8D29D2FE62CC3CEF548C0A57A1DA202EAEA8F4584D8B64E49 | |
6632 | A3D11A48600CC0913B744180AFB6873BE72DCDFF8EA2203E34082E011C87C3F8 | |
6633 | EE91457705ED0BD4E2C193B7E818B50DDDD734F2BA1B876D262C39D94B0FC27F | |
6634 | 0B5A87423EAE91BDAB38BE457EB0309D05FA5E458109305C03295FC39B0D06BD | |
6635 | BFA2B4520DD610E12C3AF842A94296108FB67495B300991C3491F0983B5A0403 | |
6636 | 68A8D19218D9429EE400C3B91DDE2A9F163684D9F28120B584FEC88628EAA60F | |
6637 | 79F5988BE7BE31153A675BC7B344E7F62CE85E8850361D1996D57E71690472BB | |
6638 | 8055755DE965D795E6D2424F7D76AE7F249AEF4BFD75103B2CE4D62FECCD2FAE | |
6639 | 3702A57A3320C54D19D5015ABA5AF39B237C53D38DBD80773C0B9D6406574BFA | |
6640 | 48BA4EE71769AD140E202D24D9F1691BA072E1AF182FD6DC06C2FD25E3437E38 | |
6641 | ED1D0033E77D2B188F3A84EAE17787110EC5462EF5CD0FEBBE5CE39976B5CDA4 | |
6642 | 8206BE5EB8A06C7698C5E6A45EC7F59CAD3D6ED3AC19FABF3D29C9AEBEFDD74A | |
6643 | 6B7261D349FE509BD769D9A24B16C276C917F0CBE8B25FFE19BF8528E1C46D38 | |
6644 | 3738E3CEE8170E3EE323A464A3C8FF30B3DAD0BE87518E008E37F60DB471E3EC | |
6645 | 110E9B8AAA5C875AF759126B39B90A8E7BCB25FA3EFA783AF7B069AED1887A19 | |
6646 | 6A75C799940E5352C34A93F125DE82A7387CFDD7073A28C1026C9E06A1D8163B | |
6647 | E66DC3BAAEBBDF96B7B3143B9414AB45643D022294C2AF8C87EBFF1276EF991B | |
6648 | 7A1C720C1A7CFD392F211A190A530A19012EB117670AFAE4CF700048D901A5BE | |
6649 | 074F9B05AA555FA4ED6D0A92C08E4B795279F9BE48887886B5121DDD857E8A86 | |
6650 | A2885B9A672C72BAB990E0AF6DCCC769A7E18E65A86B3E1482D8297FD98E0510 | |
6651 | 30B27AFCB9B261771A1AFC298F96E272E779A8B6AB6B03410ECE32B7B69369C7 | |
6652 | 5597FDD08BF2E6CA29E093428DBB0BC53C64E5ECBF216111AC90E82822E7604B | |
6653 | A9AF479BE9FD2FB2ED27EBF4027C22357DB27A5A6FBC6B14607DC26F95A81BA5 | |
6654 | 1737D6C406B19857FFF2903F966DCD56BB73B06F5F74C917517DF95D8D5E5108 | |
6655 | 350AB839CBDFD7D1F3C687D0B6B576FFE108AE8708B967C29F9840A0D6784789 | |
6656 | DDD7A0D76E92082162603CC916ADAD75BB205E7C9B7A72D286C5411F3771EB6B | |
6657 | 9F9022BB24AC9EE7700907280F52862F1D542605F3D3AB06679252DB9A8A4E41 | |
6658 | FD9740AE35473A9FD025F364B863DDD063AF91A114EB529A38F28C4B4551E276 | |
6659 | F76C254669B81BD3CA8479F0C7208AFE5A1927F2AB12FBEC47FE0BF9AC3DBF3C | |
6660 | 340DC67125FA0D65B245260B32FB74F90CCA6D327874BDB6C252614C75425F20 | |
6661 | 2AD8C9ADD15733715B9281DB9D73C66B9664491416643C04165C64F5939CA73F | |
6662 | F8D7652592F391E59B82EF0BEDA9DC7F42713005E4AEAA1111EAB4E74BD99119 | |
6663 | D86490DEE3DA6C021B36D7AFDF9EEDBB1E3253176EF0607469E0982034AF57A8 | |
6664 | 83F024DD4B42B99BBA110514E52498F6BE463B3053DF5114F2D6644FA27702D3 | |
6665 | 15DB327F632E3750171BDAD75F0B7D2A84267C712132373A2FE740BB086D53B5 | |
6666 | C3E9A68583159E46FE46ED3B645B0FD505D206E09D438052E27B75EFE7F5D83F | |
6667 | BC153E4BAD47FF241AD46BE13605E1840C5C2CE3492C29EA5FFF5550AA3986E4 | |
6668 | FF28A404908C88269D821EB2FBB193DC311750F6163D75872603A254B949C756 | |
6669 | CB97829F0BE3AD796D52969E483A0A53CA650CFB9AD57E0F4DED89C7746341EB | |
6670 | 3D3333F06556BC61BABC3553C7B0D83DDC5B3BFDC77DBD9B6DE41680DD6439E9 | |
6671 | 4C9FA49DF62830C86E7A4B1CBD37F2794EB6DAFC3F1676697392A6A635E626DD | |
6672 | 3A3BC9E2378C152F9895178C694596191B37BE3DD8C0FF34C82C386289EBD7CC | |
6673 | B63139A3243F193EA10211A8E390B4C4046663CEC373928556F5CC99FE094ED2 | |
6674 | 841DDF013CAA6CA5C48CD9382CB776964B38BC24BB009DF203DB81D4EE3A4463 | |
6675 | C5F2BD876E0C9B9B226FF39C0CE6E67589A38388A02A81D3DEA72CC031BB8B2F | |
6676 | 66C481F00167DC0BEEE6740A78D736F429B44B82A3B01ED2127052646DB442FC | |
6677 | C1EC78B100F11D42512810F26EEABFFDEE3E46DD584FCC2194896F7BB5670634 | |
6678 | 480771223C1E2641A253CE2490AD75591FD94F19B2DBA95F0CD64EE4BA03D3B2 | |
6679 | BB0C7A6437B610004CA4F1B914D9075051F7CBB6CDA305F6337307F317CC05C7 | |
6680 | 8BA5A409ED6D915263680852670F8A474AB0646ACF77FA3AC35332DFE2B00CEA | |
6681 | FA99D25DAC950B173DB84ACD9DD99AB23973390FE32E384C6003FEB9A4D3FB1A | |
6682 | CA17FE87AD558921F203432EC00D0BD9E0294A0364048A9743516F46EAC01B7A | |
6683 | AF23DACE21FC2D26692D8F1A85F1B0AA8156D6360B322724C4804FAE55DFA814 | |
6684 | ACCE2F8508335CD775539E7931007A73DFDEEF7695487B10BB0D95FCA66D0F53 | |
6685 | 6E86DD15234A025709C4F7DD08761711D05655EAD8122D8BA2F7177E820B48C2 | |
6686 | 5EC82CD16644832ADF374ACF193975B4635FB374451D0AED47030807CFDCF240 | |
6687 | 783160D79230AAC1F2E5066F09C327ACE24CA2D712D08749FC63C3D8EDADCE22 | |
6688 | B81A7E03350AE88F30BE8222B6954ED0D2910AECBA460EC21BB032C4D5DC1B12 | |
6689 | 39F1EB91215B384CDE3F1FBDABA298E37D4460D0B07B0493053444AC73654815 | |
6690 | 376ADD2F64BDE78BF59CD75D93A3A3BC730562E9A1F2A730A2F766AA19DE458F | |
6691 | 06DD501B215E0C2070CD64DDE13E99719671FA4809FBCB6623E206253081A50F | |
6692 | 5329F16F1B0F0F69276852A7A0AC023A821B8E7880F9D7AE5DA74D0483AACB4F | |
6693 | FF09D975ABF439500ADEADA4990CA29A50D82C0A7704F11DDE0C9C8E4DA21382 | |
6694 | C4F7289719D9A4A44BF2735CCAA2BCA698A5FAEC9A3BCCDDA1C88CCE18510733 | |
6695 | 5A88B88A193C9DF15ACD00F20A965C11DD8A35CE316EF3E4716AB3FB4EC6288A | |
6696 | 91C0F824FC9933315C9A71CA786C9305A9A30F407777F0AEA7D341D1D9605378 | |
6697 | 72CF445A4A2E3666C0075E2F9AAC3F452811EF7E60E6C04F37F3808FE8BD39F2 | |
6698 | 346F5E25757E3ED2232F1B9B4DADF83DA45F7F302809251973F705CF71E34C18 | |
6699 | 7C452C4B5D29E0CB74CD6EA67637FFF0E9D9B211FF96E04FFFE9A27BE5E13BF6 | |
6700 | B51EF214FF4F0A58C5D5734E6BCB0ECD419AE3CF79AB67D1B3EAE70FC1E83691 | |
6701 | 095D0C370C9CF847C2A914F0B810124D763A972464C5F2C1F69914A8672D46EE | |
6702 | 30F9EFFA7E9628D667E5DB582C123160BF28E77DBBD77598F14A32DD74F67032 | |
6703 | B4A0537D0FF938CC61BB0F9798B600FFB1AD7AE6AEE67E0FC6557FC3FBAA1E4E | |
6704 | C793B0D207EE0395913818CB2446E9B82B880537C1625C70ACBC87F97CEA8C77 | |
6705 | 82E6229E1734F80FBF8477F062F3836FA9DCF83A4BA49703FE3DCB5F2CF6266F | |
6706 | 4480EDFA91B1D98FAB8BE14DA6E84B9D58B46DE5D034734496474241F59317F4 | |
6707 | 4AE4AFFABA7CA3FA149A26CF5050B83BDCB1C56B529900AA20EE6098D135E65E | |
6708 | 61026EF0852D497B3799DA044CB378332924CA360A1C62E24B5A0628813829AF | |
6709 | A1236DD728559DAA01188D6EBBF3CEF983C5201904D03A46B62A41E9C5F494DB | |
6710 | 135F6B62BD5F3745625E96E1B401848BFD935AD1FE128507866FB807693E8376 | |
6711 | 634F1B39763087EE7E454069D5CED93DAE8BE9D1366669A152968E2DF13EFA54 | |
6712 | D1A631CCCA33D914CC1DA8C0DF8ECE2FABD18641FFB43BB5E82DD0A56CC20DCC | |
6713 | 64EC0A7A04709085C80C2A1477CF85A29D0C11F204CEA455072DFBA6F5F5C693 | |
6714 | CB2B56EA189926EB51E92D2B5D89F25AB94E1F7FA208916FFE89601B616B41EB | |
6715 | EFA70F4C8CFC3FAD1D056E4076E8CDC2C3058A2B35B34FA0A29A2ED3746060AD | |
6716 | 1A6B6988B1B0986DE495FDE9A8C45119DA7EC756E1C83C89842C8744AC4B80DC | |
6717 | 264792E2E8D5AE4120BC57C170C742EEB0EAE8C9C4537AE432654DA4DF89FD45 | |
6718 | AE0DBDD92D0DDFA0C90C4FB90FD5A7ABB522A193117153CF578A584447FCD674 | |
6719 | 548ECB9250DA4669DDC8CDBEBBA49999F2519DE29B0CE693DEB2F420D4B0CE02 | |
6720 | D9AA3C2C15A6DC98495E1EA54C7670482E2B1034B91692285AC47EFD6271659E | |
6721 | 400D6D7DC137A904647FD092B1B4D59170F1EED8E29FCD584FEA2C77642AB839 | |
6722 | 0A44403D75504E8DDF1BDBBA6B51B7F9F64B63676B6FBDE514701B9333312126 | |
6723 | 4D8AC19B638254A4BFDEACA80AB2CBC4DD12AB48BC34771E210FB576FA0DE013 | |
6724 | 5C49E765028D57C056BD7C14E6941B0A92A2073CA3CCA67E9A18F18BE4934550 | |
6725 | EFB984B486B9036B8E3221F63D8642E2C71E6547A8E4B25FC3EC3C42D27DFD85 | |
6726 | E85F2D08C69CDCF3174A09E363E92A8B3D75BFD57CA37144D5267BA4D1750988 | |
6727 | 8FA3A9B9100838AA7DFFA97C5E4D2516F5649CA756C97C5A3D500A60D2AC5039 | |
6728 | 812B603639C2E3CE36F26CC0AFCB385A5BBD582E7BD1B5920F67DBAF9ABF9EE5 | |
6729 | FCF66EECB566DD87F0618AB73199C230034DE379CAC1F6BD17526305D6B6ECD5 | |
6730 | 8C5C57FA76FA775B2A25C7F5C83C27A1F4C71DCA93487469004EDFF855A156C0 | |
6731 | 8C8EE1972CEB91B9292F5619118F7DA38B1FCDD069D71D0DAE61BE55AF0E255B | |
6732 | 3B8D2DE974592BCA7D92F0DE92538C74A801CF16A424621627BEE5BEC2CC5E68 | |
6733 | 9B88BE0ADDB7C8125F7C35D74A52779C6D5D87143506EAB799765589617D08F3 | |
6734 | 1305B15752D134A97F7D872CF330F4B3BB62946570C5EA7DB77612DF9B7F91E9 | |
6735 | 22321623627FEC40FA04FDC1AA21DECC7AE531510375D6F68A68C6B8BD649A67 | |
6736 | A3E24B30E04ACC2171A510DCD77F7688E2ABD7D3346BD84E8363BCDB2EABBE0E | |
6737 | 5BC87A595CE80F977190EF06D3D0BE12DA50EA0C33D25617A9DA8940967906B5 | |
6738 | F5317F4CDCE1DCC7ED48B4AC4DA131EBCCD11F7D241551AF8A2A723A5C634EAC | |
6739 | 575113186D3B83F8B6E2E50796481B6CA50D440D5B20C5206A85F539FB7D52B8 | |
6740 | B831EF10B784D195BF7EFF05A9125A3B90CE131D84ADBBE6E47AAC2FBE51DDDF | |
6741 | 1286C0DCCA8343F7803FCB25CD690EF9FB49C1C3B91BB7FCE5D330C781744502 | |
6742 | AE46FEC050B4C695101F3B86ACE09D502572DFF5F8534DBE6DEAE838B4000712 | |
6743 | 4B21697BA3FCDCCB3B858251438F05B3EA1F8CABC08A502C5324D1315214E7DA | |
6744 | 6B62576C10E6EE9A69FDB9D424FE1C7BC32CF37EE9EFC42B9F6726C486762574 | |
6745 | 03913F9B3F5A20B1EFA8D4E072EA2F641D7AF64403C4EC76E3A81185B976499D | |
6746 | C78FAD546598AB094B628942EBA51C11FD572264BFC7B0E97A1715D7443F29EB | |
6747 | 7BB4E6848383836F99850E22316C73B76B0E6848008B832E49B7373A94DADEE4 | |
6748 | E7EB32C428F531FFA2067E3316A47C08068D93E27525A9A2A915CD9F204AB4DE | |
6749 | 01EF65ECE8167C184DFA747930AA322FC136DE0D412E99E6F37ACF87A788141B | |
6750 | 3043A3B0D20DDE8C2137EF0DA77A899A581A51AC4CD5A1031F84BD428D0A17A9 | |
6751 | 989877277917D07CB806DF051C23F1AB0049FBDE843B34CFC9DEC4147D97759E | |
6752 | 983C395F0C9DC2832139DFDE0455002BEBC392E7617156400301F76441347A3E | |
6753 | E94D2FB65A31DA189BCC3CE94AFC1613B546D424A36EB2F83F3444DDAB0F03A0 | |
6754 | F3C270A9B8BC62465F46D83929DB7F0240E52CAC458194BFD50645F825D0C41C | |
6755 | 773B1D6757625906C7643BDCE990E24467C011ACDAF6D4A26A62D71FAF1F475C | |
6756 | F14CA4D545E9E4F80BB01F3AC573D046DA7356FB9884CAE3A29DC357BC8CB255 | |
6757 | E5108AB355F0E087902C9BB458DCE8F341F1AEB79E468EE9A45855FE037780E7 | |
6758 | 9EA9ADC1CFA141A3F976DFEF51A428D237F234BF5C694DAD4CCF2AE84FFAB574 | |
6759 | A25C1FBA2F38110C305D962420A310FE93301B8677478BDBBBDC518B8C94E819 | |
6760 | 26BD2529D0EBF0E770CB3A1E107440D135848D2F90CE8F37693EDAF6071B79F4 | |
6761 | FEA5ABF4D9F2DC67F2468F2BDA3FA968EED4CAF8D7A22CB28AA43804F72F56B9 | |
6762 | 545DBD0E3F27DD5617329305CD8577AF38CD4C472CB181CF3DBEA07CD42C6C1C | |
6763 | 51E819286FFFC75E38F5EFF96C763F51A31A78B0848CF56DE1A2CBE2F39B0C41 | |
6764 | FC7C0D42D48D6C75516316B27F6C34AE6D5F5873233914790ECE044C014E9796 | |
6765 | 20E200F53FC51ABFEC15C1E08D36E9A4DA7E58DAC014E2C0627EE8ACC6AD021A | |
6766 | D2E2C431ACE954602EB99D4584250637F807507A17DA18521B6820E066058B09 | |
6767 | 8C2B4609FDEA9E02007A097F833C7A9854D74B38DC81016759DD8FC6F98071FE | |
6768 | 620AFA1A8DE5AA974C281A1DEC9C8B866E7E350BE5EF3C7C53F82280790CF239 | |
6769 | C847E4C7F74BCEBED8BCC57D4C01BC4394F0E9EC5AD01852B3B06B93A477A1AB | |
6770 | AA97B588415A03C1984B0C9619C899DFD4766A2CE91CD6A65120E07756100696 | |
6771 | 297345CACCE1551A2CB549077A292B73ECD47C3A098049BC49F2125BBF004DAA | |
6772 | 8827C407B06A07E5F39CC17843FE876FB2DC6CA2ADC0A4D8812901FC82913ECF | |
6773 | BD04C66B3647B7A698B4BC6C2F136C04AF4792F10C31231F2A04E4B55538CC17 | |
6774 | AFE4B47BA2F575BB4E7E222E9F6A4F904F11CBBC6DF6C2F3C15DCF268A39D6AB | |
6775 | DEB9D091EFE6ECD5DF61ED23E570D484A6AFD5F8D34B7D484F76F150D3D97EBE | |
6776 | 5E91D7A458FAB380BE167E7F2FAAC82BC2C7F3C14BDFD06D9665F5AB2CE34800 | |
6777 | E779AC43B70E22199D3BC4A2A14EFD5D20AF12D8CC26BCE54762ECCA9D9F5FDE | |
6778 | 84B43104575B2D6533FD3BD245AAAA4B82314EAEC2E6E566EB32AE367D2F2BBE | |
6779 | 8F6DF9D63F56693D701E259ED828A3E27561A5901B87F606AADBEDDD7E846AC1 | |
6780 | F07D1ACCEC90CF6AB18114A140FE4BC918EDC9B06284B40E2C82D4BE3C1EAB92 | |
6781 | E2E2F0DE115737561F7ACA173B81C9AF7EFCD6797BC1AE6366646C8F1ADC38A9 | |
6782 | F1928933BFB6AB474FA81D8C006AA11B76461ED98DB4DCB95D7772E3D15C2A29 | |
6783 | F116DF0437225E8EA1FC5C3997633CD63539069F7788AAB84BC9FA8A1A61316D | |
6784 | 2C0F07D2914A61B0418912B276561540BE5DBC1F7A20241E85ED95BB775E16D4 | |
6785 | 1F22262C8128967F53031EBA86D0A2184DEB01D51D4F7E15BADE50B7DE246C05 | |
6786 | 38B9B49D264A4B29A372FCBF57323308C71A0E14748850B56D51BB932B1DCAA3 | |
6787 | A1469E84536A42B0D8B55A0292C8050D6CD1BFDCC4D287B15082801EA40AB8DE | |
6788 | CD8628D0E1252DBC57333D74841246D7A6392F158EAA9FD5BC6CB2E535DDBEAB | |
6789 | F16FF32617952596187203D41342DF7FC1E0CAEA2EE8F012236DAB0208A626E4 | |
6790 | 5FC5EC819580727F7890BF2B114523A3006CFE3B67F19419A009826C635C4B2C | |
6791 | 10CED88293D753A6FC63C5C17A424E911169E316DAC022EE37A5F93A6D7BB446 | |
6792 | 5402EDB1F758FFCCBE83F7842CF09E84DAC17CC8A5D0521CDBCA8B320D90F24F | |
6793 | 32AA9B86DAFD068FB0D234C94EC0889134DCCF83F8B0C89F67D660EC4D6E2B34 | |
6794 | D4CC5E094049ACFA09767E7C0AFD789767D0660825FC94878BFCA40105597194 | |
6795 | BDF88A8636D180BAFEF635601218B47E1242497D1E90E7A0F1098FE4161E6C7D | |
6796 | D1E920DBECEDE54FD9D8EA40E25881F0E31C3FECCA22ED507DF496122D25AF56 | |
6797 | E6E690952EC746BE46F4D228D54C634B04D036DD33252E5A5B6309E559EB9CF9 | |
6798 | DD17101EF262D5FEBE9C207007A2E7F3BCCCE3243333F0A79C1779E727414D60 | |
6799 | B451BDC14BA3FFCBB9D49641DE51BE92C7D136C2C910559A6EE106DC05CB4890 | |
6800 | 322BC12FD592C4789FD8368DFB7827A67FF8FADE351646D0B4B35F74A924E229 | |
6801 | DDCBE1B5D24D049CBD4424B123B6AAE7F5AF8AEEC7F862431541F6B755A272CE | |
6802 | 177CAB058D297A35041646435664056644B2422B2CB890080C3BEC3C52C6363C | |
6803 | B843F24977C482C7A37CF18DEDE4E8FECB280E86263BBB5BD413A9BE19329817 | |
6804 | EC424B1AEEEF713A52D68143AF0DC2B02F293425F041A616D148ABED9E7FA7A0 | |
6805 | AE99B5762A52E38BE8E7148EF22808632CBDEA8613948D8E3D576580FA3F4B3E | |
6806 | 0B5F9E1B240BC7D0744FB1D121E3231994DEDE24B919A72869C15B839DDD9917 | |
6807 | D3BF2466E673B142E4B527B17893D3405603E1271E2D005A6318DC98CFA3D25C | |
6808 | 3A7B59A16B1D6C5C31F267B964E951DFDB1143F8D9005E378A3D4F5B072911CC | |
6809 | 814C191A806A989BC176544E45BA9A5CB16281394572CC6275A96865BEAB6F9D | |
6810 | 06DD94701FB30DEAC86652473C182379F43877528F28AB0B5FD9669347003055 | |
6811 | 2E6169601690053E00E18BE7FA7143DA61EA74326BE8122E56485E65B0572821 | |
6812 | BBE05576C1D9706EE219A8377338E93DFFFEE5E37E6054412A9B875A092C948C | |
6813 | C4663F161AEBAFBB964859E9056D42B76A806A2B1C435318459E272DD51339B6 | |
6814 | B16BC73787ADF1D7A2CD630CA98F8B6C479693BA427D7096E83AAC35B6D1CCAE | |
6815 | B5879B03B706C6AA3FC1A1D180315A2252DE59C45E9429E107D7A73A645AB182 | |
6816 | 6FCD53B44907874A1B286BC50D9051160CBFB374856E59C961C376C3B553454B | |
6817 | 108BC5FFAC60EB8C7426A70A1FFC2CE80D8989A3EEC43A9AD51771D48884BB32 | |
6818 | 1749E328FDCCD4FDD104E80EB6813FB98D83139791DD2A2C9ED7A70BC458DB09 | |
6819 | 5D73B21DAF0FFC110324B8F2BC145FA61962C5D78B4D6C8D014D6938AF09F36A | |
6820 | 2A3E5634A140A1A525BFCAA00616AA1D8195A8A68E4260B8ADDDF789B131C074 | |
6821 | 01EF325E06AEA94A459CE1F51F312C3C19142528AC941551F324BE2653BBCF38 | |
6822 | 46DDC6BDF7EF77D68C32F4DE7D8604E63A632AB2108086C77B94DC31D926D1E7 | |
6823 | 1D3653D8B35CC5AC431368B7B2D7C3A565FEE9D9B2E366F265A627FE7B4378C4 | |
6824 | 81A0C4DBDDE6F7DD940F08764D307A5B09097320431AA76A41C4ADE92C260588 | |
6825 | 522B197B802DC488FA2169BC2E13AE36A98591E1673C1CAC29B4E0E15D2227E7 | |
6826 | 80928CA4C060FECE89B014C3FB6A42313FC438E448DDD73CB66ADEF1FACF2E2A | |
6827 | 4601F76ECFF658D97BC22C765C0B1B04B03EE08A41E2C778A8E5954CABE7B386 | |
6828 | BFC2DC7C60E720BAB2B1A726D8AF4933355F21731FD7C930F31720C1E16F6C01 | |
6829 | C0C8B6747961B605CDFFB02FD6D6A7758B1097AA1D47C6DA9DBF0F87E55672AD | |
6830 | FE93D17DA6FE7B2E3A5360C5BF0C3F4715165CC6748BC95CFA74D4AD57B481B9 | |
6831 | 3784040A6B1BB028CA9F69B6AE52CFF8FF3FD169FDE1A85B52651D99B4042E72 | |
6832 | D5E952BD9F976EFA21C935F2ECBF5C8D4D8BA0AA97DD1458650F6DB9C80B3B21 | |
6833 | F60761C150944567DE98E9DED3BB831A57DE2A5C8CC4417D0D02BF24EB09C2A7 | |
6834 | B8262EFB223FDEDB45E75E2559190060C676B43721B5894EA52440AAAF72B77D | |
6835 | 42138ABF062B92255DCE006EC18492D4CC0CA6FE753E8851305B967B4B01D481 | |
6836 | 85D8A1B78CAEBEB99ED44E5BD7B0CD242B46F8C3C4B1DCE6B103497A89D0C48A | |
6837 | FCA2DDB3CBEF2CC076673FE28DD397F4975BF03EABF542C8ECAE8311822A6564 | |
6838 | 14C20DE022F9AFBF672B31D124F96E2475073E6B53F8032685A45AC7181B0158 | |
6839 | A6FDBF2DFCC9D842D42E098BC02AEFABA6D571821604BBDC389E80931BC8A767 | |
6840 | A92DC7CE49EDDC3C89521CD3AF5AEFF121EAA27B74A37BF043B1AC045A0D9A38 | |
6841 | 8767D85D15DBF0F5ABC495207AA3AD05BE201642206044F470EFDF4A8D52C050 | |
6842 | D600F04B97ACED3F7FC8A56E7640A6A4AAAE1816F3A77D887A378AA0B130B509 | |
6843 | 72A8ADBD5808E9BBB7F83216D995EC74FD168D5A3D171AB9C52A0E21169172A2 | |
6844 | 9C680D926D2327A314835700D399CE25A8311D22D1127B43CB8A9D900133C4D1 | |
6845 | CA1F71C4331F37DBE7F26650B4D512C5E192635CD8CF4C560AB5BFFE0671424D | |
6846 | 456BA00271A643AA2477DAB650F682D89B932BEBB5A66EBC9072A469EE78E0B3 | |
6847 | 86F58B1BA76F31B978C167A0E5CE18889C4DA968CEF94EFA70060960E1D53535 | |
6848 | 17230FC0C8AA0E878AD3D6E306533800DB46BF785219872DBCAAEC33A236A8AA | |
6849 | E86D9C9316CEE8D75888217824D56420EF7AFE70E18C6AC6E7E71161373D574A | |
6850 | D399548B201868F2D1B2DEC136ECFEFE25C307630331F2F893FE36E0CCC8113F | |
6851 | 9D7A6DE87881BC713E6B438F1E804B2C6F00DAA4FF0A33F2B051EE2655BD8583 | |
6852 | 9AA5BB2F7A4AD400F34963FA1BD28D5AB933EAE84C047D636122BE431DB097BC | |
6853 | 85D7CB6C30B09333A567F7DFC0A0482E4373512294562297BACC2F53E2BF1718 | |
6854 | 4E23AA470CB1879235832D66846522B8EC1536E17172B8DA9DEB14877C9405D4 | |
6855 | 531E548E8ACEBE66D41992C0D0A25CE7FE2641DC2F06A1399C864A7C1155DDD4 | |
6856 | 20A2D292688E6426B147572C2CD3706C96C22C977A4A6C4A30A54C7DDD50DCB9 | |
6857 | 7BBC5C0B744CD85DF88166B916C0F1909A38742C6BCB58045C4223B70F4B3BAD | |
6858 | 74EBBE8395A3F64A14D6838554EB6AB7CE417DD7448EBB4F3EE10B13B454C4EA | |
6859 | 949AF16A87E72ED21159408171A4847199C5E403FADCC67D0FFA5A58452ADC67 | |
6860 | FC3C597826B20BD85A1AC7BFA715531D99DDA5155185E3FBF29DDF559A103F75 | |
6861 | 538AC8CC0B4C4041288E89B387F6ABE04F90E8CEB2099293D1DC4FE00647C80C | |
6862 | 5DBE532282708D050BC6A226F45DBC314D109554BB25CF04770ED4874EED1B1F | |
6863 | E18E006F254BB4297C435B416A9AFC6FC51568D89317BCDD9885E2D1ED15F4F7 | |
6864 | AF253B5FAEE5CC44BF9D860982B7F4706C8B8018E6488E337B773A4A7AAF9998 | |
6865 | 6796B30721736F7AB66CE22EBEF616FE5847929A2E08D64DA7E912F4CA899F73 | |
6866 | 6A0A1F1F2163886A7C5E6999D98AB9708EADE2030050B2D05AEF0AA9447F8698 | |
6867 | 7C191DD81DB9131D0DC19BB7CD0CD9A60AEBBA3FAD203CA51B6FECB75EC91C14 | |
6868 | EE75CBB49420594C7B9A56EDE29343B5D1817AFF27B71F0BF2B8D59D8198C2B7 | |
6869 | A9F4091A085C973412051D6ACCD3F0B37D502D8FE193CD5E42769D1F497847CF | |
6870 | B986233F0DE24FE2F4ED03BFA105DD04182887D3C6CB827A1D5B00170B8DFA5E | |
6871 | EB1BE4FEEACCC82A5BB4BCE2C8320CBCF6EEBFC955025F3980763F51170EA440 | |
6872 | C2144AD36893326E5A3DC214AF59FF505E8168593AB9543FC6690F0D63262FBB | |
6873 | 978B833906430E5D2DC99D729D1CCE7A0A91725537BCF91DFBF8073EEE494A2B | |
6874 | E38F1AA3D81C602D05FAD3CA3A8A5A7E1F0A7F7CA736B561F3C29275E68D01E1 | |
6875 | FA253D089243988C475ABF8077C71DD93F1414E69FAEE565F42C863C61BE554B | |
6876 | 44C92919D78D898E70510D9EA1FCAB702FD53337263606A777A001224390AA6C | |
6877 | D8CA04FE8F34D61F03E083D0A050EA3985ED026479142A7184494C615A7AC675 | |
6878 | 97B6196C56F2034850A77938B7585B18AEEA2D249E41D25302DFF2416FCADC13 | |
6879 | E69030FD907778821C66F93220A31991386640AC2315A5B7DB80B4AE91A6A4D7 | |
6880 | 8BC19E632295CFECA8D65B4045C5A7614852CD48686A27D61F6DC6ED6120D30D | |
6881 | 92C97F4D0B5135823FA4A59DFB7633 | |
c302751c CR |
6882 | 0000000000000000000000000000000000000000000000000000000000000000 |
6883 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6884 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6885 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6886 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6887 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6888 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6889 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6890 | cleartomark | |
45c0f7f8 | 6891 | {restore}if |
c302751c | 6892 | %%EndFont |
37c41ab1 | 6893 | TeXDict begin 40258431 52099146 1000 600 600 (bashref.dvi) |
d3ad40de CR |
6894 | @start /Fa 130[62 1[62 123[{}2 119.552 /CMTT12 rf /Fb |
6895 | 133[34 41 41 55 41 43 30 30 30 41 43 38 43 64 21 41 23 | |
c2a47ea9 CR |
6896 | 21 43 38 23 34 43 34 43 38 8[58 4[43 57 1[52 60 58 70 |
6897 | 3[28 58 3[59 1[54 58 7[38 38 38 38 38 38 38 38 38 38 | |
c302751c CR |
6898 | 3[21 31[43 12[{}50 74.7198 /CMR9 rf /Fc 197[21 58[{}1 |
6899 | 74.7198 /CMMI9 rf /Fd 134[39 39 2[39 39 39 39 2[39 39 | |
c2a47ea9 CR |
6900 | 39 39 2[39 39 2[39 3[39 19[39 27[39 39 2[39 45[{}18 74.7198 |
6901 | /CMSLTT10 rf /Fe 129[39 39 1[39 39 39 39 39 39 39 39 | |
37c41ab1 | 6902 | 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 |
c2a47ea9 CR |
6903 | 39 39 39 39 39 1[39 39 39 39 39 39 39 39 39 39 1[39 39 |
6904 | 39 39 39 39 1[39 39 39 39 39 39 39 39 39 39 39 39 1[39 | |
6905 | 39 39 5[39 39 39 39 39 39 39 39 39 1[39 39 39 39 39 1[39 | |
c302751c CR |
6906 | 39 1[39 33[{}81 74.7198 /CMTT9 rf /Ff 167[62 3[60 46 |
6907 | 2[57 1[62 76 52 1[43 1[62 65 54 1[63 60 67[{}13 83.022 | |
6908 | /CMR10 rf /Fg 135[67 2[67 1[50 2[61 69 5[33 1[70 2[68 | |
6909 | 52[60 47[{}9 109.174 /CMCSC10 rf /Fh 140[56 3[56 56 1[56 | |
6910 | 2[56 56 56 57[56 45[{}8 109.091 /CMTT12 rf /Fi 134[48 | |
d3ad40de | 6911 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
c302751c CR |
6912 | 48 48 48 48 48 48 1[48 2[48 3[48 3[48 1[48 1[48 1[48 |
6913 | 48 48 1[48 48 48 1[48 48 48 48 1[48 6[48 6[48 48 48 48 | |
9f178efb CR |
6914 | 2[48 5[48 39[{}49 90.9091 /CMSLTT10 rf /Fj 134[65 65 |
6915 | 89 65 68 48 48 50 65 68 61 68 102 34 65 1[34 68 61 37 | |
6916 | 56 68 55 68 60 34 6[93 1[127 1[94 85 68 92 92 84 92 96 | |
6917 | 116 74 96 1[46 96 96 77 81 94 89 87 93 1[58 5[61 61 61 | |
6918 | 61 61 61 61 61 61 61 1[34 41 34 4[34 26[68 72 11[{}64 | |
c302751c CR |
6919 | 109.091 /CMBX12 rf /Fk 135[42 1[42 1[30 37 38 1[46 46 |
6920 | 51 74 23 2[28 1[42 1[42 46 42 1[46 51[33 32[51 12[{}18 | |
6921 | 90.9091 /CMTI10 rf /Fl 135[56 2[56 1[42 55 1[51 58 56 | |
6922 | 68 47 2[27 1[58 49 51 57 54 53 56 46[50 2[50 1[34 45[{}20 | |
6923 | 90.9091 /CMCSC10 rf /Fm 197[25 58[{}1 90.9091 /CMMI10 | |
6924 | rf /Fn 197[33 58[{}1 119.552 /CMMI12 rf /Fo 134[85 85 | |
6925 | 1[85 90 63 64 66 1[90 81 90 134 45 1[49 45 90 81 49 74 | |
6926 | 90 72 90 78 10[122 124 112 90 120 3[126 153 97 1[83 60 | |
6927 | 126 127 101 106 124 117 115 122 7[81 81 81 81 81 81 81 | |
6928 | 81 81 81 35[90 94 11[{}52 143.462 /CMBX12 rf /Fp 200[0 | |
6929 | 21[91 17[45 1[91 12[71{}5 90.9091 /CMSY10 rf /Fq 134[48 | |
6930 | 48 66 48 51 35 36 36 48 51 45 51 76 25 48 28 25 51 45 | |
45c0f7f8 CR |
6931 | 28 40 51 40 51 45 7[68 68 93 1[68 66 51 67 1[62 71 68 |
6932 | 83 57 71 1[33 68 71 59 62 69 66 64 68 13[45 45 45 3[30 | |
6933 | 8[45 21[76 1[51 53 11[{}55 90.9091 /CMSL10 rf /Fr 134[71 | |
122f603c CR |
6934 | 71 97 71 75 52 53 55 1[75 67 75 112 37 71 41 37 75 67 |
6935 | 41 61 75 60 75 65 3[37 1[37 1[102 102 139 102 103 94 | |
6936 | 75 100 101 92 101 105 128 81 105 69 50 105 106 85 88 | |
6937 | 103 97 96 102 105 64 4[37 67 67 67 67 67 67 67 67 67 | |
6938 | 67 1[37 45 37 1[67 5[67 112 1[41 20[75 78 11[{}73 119.552 | |
6939 | /CMBX12 rf /Fs 129[48 48 48 48 48 48 48 48 48 48 48 48 | |
258e3d46 | 6940 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
37c41ab1 | 6941 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
122f603c | 6942 | 48 48 48 48 1[48 48 48 48 48 48 48 48 48 48 48 48 48 |
37c41ab1 | 6943 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
122f603c CR |
6944 | 48 48 48 48 48 48 48 48 48 48 33[{}93 90.9091 /CMTT10 |
6945 | rf /Ft 131[91 45 40 48 48 66 48 51 35 36 36 48 51 45 | |
6946 | 51 76 25 48 28 25 51 45 28 40 51 40 51 45 25 2[25 45 | |
6947 | 25 56 68 68 93 68 68 66 51 67 71 62 71 68 83 57 71 47 | |
6948 | 33 68 71 59 62 69 66 64 68 1[43 1[71 1[25 25 45 45 45 | |
9f178efb CR |
6949 | 45 45 45 45 45 45 45 45 25 30 25 1[45 35 35 25 71 76 |
6950 | 45 1[45 25 18[76 51 51 53 11[{}89 90.9091 /CMR10 rf /Fu | |
122f603c CR |
6951 | 138[108 1[76 79 3[108 1[54 3[108 1[59 88 1[86 1[94 14[144 |
6952 | 4[184 10[138 66[{}13 172.154 /CMBX12 rf end | |
5e13499c CR |
6953 | %%EndProlog |
6954 | %%BeginSetup | |
6955 | %%Feature: *Resolution 600dpi | |
6956 | TeXDict begin | |
6957 | %%BeginPaperSize: Letter | |
45c0f7f8 CR |
6958 | /setpagedevice where |
6959 | { pop << /PageSize [612 792] >> setpagedevice } | |
6960 | { /letter where { pop letter } if } | |
6961 | ifelse | |
5e13499c | 6962 | %%EndPaperSize |
37c41ab1 | 6963 | end |
5e13499c CR |
6964 | %%EndSetup |
6965 | %%Page: 1 1 | |
37c41ab1 CR |
6966 | TeXDict begin 1 0 bop 150 1318 a Fu(Bash)64 b(Reference)j(Man)-5 |
6967 | b(ual)p 150 1385 3600 34 v 2361 1481 a Ft(Reference)31 | |
9ec5ed66 | 6968 | b(Do)s(cumen)m(tation)i(for)d(Bash)2428 1589 y(Edition)h(4.2,)g(for)f |
9f178efb | 6969 | Fs(Bash)g Ft(V)-8 b(ersion)31 b(4.2.)3367 1697 y(July)f(2012)150 |
abe2eb5b CR |
6970 | 4935 y Fr(Chet)45 b(Ramey)-11 b(,)46 b(Case)g(W)-11 b(estern)46 |
6971 | b(Reserv)l(e)g(Univ)l(ersit)l(y)150 5068 y(Brian)f(F)-11 | |
6972 | b(o)l(x,)45 b(F)-11 b(ree)45 b(Soft)l(w)l(are)h(F)-11 | |
602bb739 | 6973 | b(oundation)p 150 5141 3600 17 v eop end |
5e13499c | 6974 | %%Page: 2 2 |
9f178efb | 6975 | TeXDict begin 2 1 bop 150 3352 a Ft(This)35 b(text)h(is)g(a)g(brief)f |
37c41ab1 | 6976 | (description)h(of)f(the)h(features)g(that)g(are)g(presen)m(t)g(in)f |
aaf6036e CR |
6977 | (the)h(Bash)f(shell)h(\(v)m(ersion)150 3462 y(4.2,)c(14)f(July)f |
6978 | (2012\).)150 3597 y(This)35 b(is)h(Edition)g(4.2,)j(last)d(up)s(dated)f | |
6979 | (14)i(July)e(2012,)k(of)d Fq(The)g(GNU)g(Bash)g(Reference)h(Man)m(ual)p | |
6980 | Ft(,)h(for)150 3706 y Fs(Bash)p Ft(,)29 b(V)-8 b(ersion)31 | |
6981 | b(4.2.)150 3841 y(Cop)m(yrigh)m(t)602 3838 y(c)577 3841 | |
6982 | y Fp(\015)f Ft(1988{2012)35 b(F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 | |
6983 | b(oundation,)31 b(Inc.)150 3975 y(P)m(ermission)h(is)h(gran)m(ted)g(to) | |
6984 | f(mak)m(e)i(and)d(distribute)h(v)m(erbatim)h(copies)g(of)f(this)g(man)m | |
6985 | (ual)h(pro)m(vided)f(the)150 4085 y(cop)m(yrigh)m(t)g(notice)f(and)f | |
6986 | (this)g(p)s(ermission)g(notice)h(are)g(preserv)m(ed)f(on)h(all)g | |
6987 | (copies.)390 4219 y(P)m(ermission)21 b(is)f(gran)m(ted)h(to)g(cop)m(y) | |
6988 | -8 b(,)24 b(distribute)c(and/or)h(mo)s(dify)e(this)i(do)s(cumen)m(t)f | |
6989 | (under)f(the)390 4329 y(terms)25 b(of)h(the)f(GNU)h(F)-8 | |
6990 | b(ree)27 b(Do)s(cumen)m(tation)g(License,)g(V)-8 b(ersion)26 | |
6991 | b(1.3)g(or)f(an)m(y)h(later)g(v)m(ersion)390 4438 y(published)43 | |
6992 | b(b)m(y)h(the)h(F)-8 b(ree)46 b(Soft)m(w)m(are)g(F)-8 | |
6993 | b(oundation;)53 b(with)44 b(no)g(In)m(v)-5 b(arian)m(t)46 | |
6994 | b(Sections,)j(no)390 4548 y(F)-8 b(ron)m(t-Co)m(v)m(er)31 | |
6995 | b(T)-8 b(exts,)30 b(and)f(no)f(Bac)m(k-Co)m(v)m(er)k(T)-8 | |
9f178efb CR |
6996 | b(exts.)41 b(A)29 b(cop)m(y)h(of)f(the)g(license)h(is)f(included)390 |
6997 | 4658 y(in)h(the)h(section)g(en)m(titled)h(\\GNU)f(F)-8 | |
6998 | b(ree)32 b(Do)s(cumen)m(tation)g(License".)150 4902 y(Published)d(b)m | |
6999 | (y)h(the)h(F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 b(oundation)150 | |
7000 | 5011 y(59)31 b(T)-8 b(emple)31 b(Place,)h(Suite)e(330,)150 | |
7001 | 5121 y(Boston,)i(MA)e(02111-1307)150 5230 y(USA)p eop | |
7002 | end | |
5e13499c | 7003 | %%Page: -1 3 |
37c41ab1 CR |
7004 | TeXDict begin -1 2 bop 3725 -116 a Ft(i)150 299 y Fo(T)-13 |
7005 | b(able)53 b(of)h(Con)l(ten)l(ts)150 641 y Fr(1)135 b(In)l(tro)t | |
c302751c CR |
7006 | (duction)13 b Fn(:)19 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g |
7007 | (:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
7008 | g(:)h(:)f(:)h(:)f(:)h(:)57 b Fr(1)275 778 y Ft(1.1)92 | |
7009 | b(What)31 b(is)f(Bash?)22 b Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7010 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7011 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7012 | (:)f(:)g(:)h(:)f(:)52 b Ft(1)275 888 y(1.2)92 b(What)31 | |
7013 | b(is)f(a)h(shell?)13 b Fm(:)j(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7014 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7015 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7016 | (:)g(:)44 b Ft(1)150 1130 y Fr(2)135 b(De\014nitions)13 | |
7017 | b Fn(:)20 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7018 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7019 | f(:)h(:)f(:)h(:)f(:)57 b Fr(3)150 1400 y(3)135 b(Basic)45 | |
7020 | b(Shell)g(F)-11 b(eatures)27 b Fn(:)21 b(:)e(:)g(:)h(:)f(:)h(:)f(:)h(:) | |
7021 | f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h | |
7022 | (:)f(:)72 b Fr(5)275 1537 y Ft(3.1)92 b(Shell)30 b(Syn)m(tax)25 | |
7023 | b Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7024 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7025 | f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)55 | |
7026 | b Ft(5)399 1646 y(3.1.1)93 b(Shell)30 b(Op)s(eration)c | |
7027 | Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7028 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7029 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)56 b Ft(5)399 1756 | |
7030 | y(3.1.2)93 b(Quoting)15 b Fm(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7031 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7032 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7033 | g(:)h(:)f(:)h(:)f(:)45 b Ft(6)524 1866 y(3.1.2.1)93 b(Escap)s(e)30 | |
7034 | b(Character)11 b Fm(:)16 b(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7035 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7036 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)41 b Ft(6)524 1975 y(3.1.2.2)93 | |
7037 | b(Single)31 b(Quotes)d Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7038 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7039 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)58 b Ft(6)524 | |
7040 | 2085 y(3.1.2.3)93 b(Double)31 b(Quotes)26 b Fm(:)16 b(:)f(:)h(:)f(:)g | |
7041 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7042 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)56 | |
7043 | b Ft(6)524 2194 y(3.1.2.4)93 b(ANSI-C)30 b(Quoting)d | |
7044 | Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7045 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7046 | f(:)g(:)h(:)57 b Ft(6)524 2304 y(3.1.2.5)93 b(Lo)s(cale-Sp)s(eci\014c) | |
7047 | 32 b(T)-8 b(ranslation)8 b Fm(:)16 b(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7048 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7049 | (:)38 b Ft(7)399 2413 y(3.1.3)93 b(Commen)m(ts)26 b Fm(:)15 | |
7050 | b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7051 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7052 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)56 b | |
7053 | Ft(7)275 2523 y(3.2)92 b(Shell)30 b(Commands)21 b Fm(:)14 | |
7054 | b(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7055 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
220537f2 | 7056 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)51 b Ft(8)399 |
c302751c CR |
7057 | 2633 y(3.2.1)93 b(Simple)30 b(Commands)c Fm(:)15 b(:)h(:)f(:)h(:)f(:)g |
7058 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7059 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)57 | |
7060 | b Ft(8)399 2742 y(3.2.2)93 b(Pip)s(elines)18 b Fm(:)d(:)g(:)h(:)f(:)g | |
7061 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7062 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7063 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)48 b Ft(8)399 | |
7064 | 2852 y(3.2.3)93 b(Lists)30 b(of)h(Commands)15 b Fm(:)f(:)h(:)h(:)f(:)g | |
7065 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) | |
7066 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)45 | |
220537f2 | 7067 | b Ft(9)399 2961 y(3.2.4)93 b(Comp)s(ound)28 b(Commands)22 |
c302751c CR |
7068 | b Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7069 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7070 | f(:)g(:)54 b Ft(9)524 3071 y(3.2.4.1)93 b(Lo)s(oping)30 | |
220537f2 CR |
7071 | b(Constructs)8 b Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7072 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7073 | f(:)h(:)f(:)g(:)38 b Ft(10)524 3181 y(3.2.4.2)93 b(Conditional)31 | |
c302751c CR |
7074 | b(Constructs)18 b Fm(:)d(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7075 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)47 | |
7076 | b Ft(10)524 3290 y(3.2.4.3)93 b(Grouping)30 b(Commands)15 | |
7077 | b Fm(:)f(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7078 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)45 | |
45c0f7f8 | 7079 | b Ft(14)399 3400 y(3.2.5)93 b(Copro)s(cesses)18 b Fm(:)d(:)g(:)h(:)f(:) |
c302751c CR |
7080 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7081 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
45c0f7f8 | 7082 | h(:)f(:)g(:)h(:)f(:)h(:)47 b Ft(15)399 3509 y(3.2.6)93 |
220537f2 CR |
7083 | b(GNU)31 b(P)m(arallel)c Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7084 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7085 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)55 | |
45c0f7f8 | 7086 | b Ft(15)275 3619 y(3.3)92 b(Shell)30 b(F)-8 b(unctions)29 |
220537f2 CR |
7087 | b Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7088 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7089 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)58 | |
45c0f7f8 | 7090 | b Ft(16)275 3729 y(3.4)92 b(Shell)30 b(P)m(arameters)17 |
220537f2 CR |
7091 | b Fm(:)f(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7092 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
45c0f7f8 | 7093 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)46 b Ft(18)399 |
220537f2 | 7094 | 3838 y(3.4.1)93 b(P)m(ositional)32 b(P)m(arameters)20 |
c302751c CR |
7095 | b Fm(:)d(:)f(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7096 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7097 | (:)f(:)50 b Ft(19)399 3948 y(3.4.2)93 b(Sp)s(ecial)30 |
c302751c CR |
7098 | b(P)m(arameters)16 b Fm(:)h(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h |
7099 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
45c0f7f8 | 7100 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)46 b Ft(19)275 4057 |
c302751c CR |
7101 | y(3.5)92 b(Shell)30 b(Expansions)17 b Fm(:)d(:)h(:)h(:)f(:)h(:)f(:)g(:) |
7102 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7103 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
45c0f7f8 | 7104 | f(:)g(:)h(:)46 b Ft(20)399 4167 y(3.5.1)93 b(Brace)31 |
c302751c CR |
7105 | b(Expansion)21 b Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7106 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7107 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)50 b Ft(21)399 |
220537f2 | 7108 | 4276 y(3.5.2)93 b(Tilde)30 b(Expansion)10 b Fm(:)15 b(:)h(:)f(:)g(:)h |
c302751c CR |
7109 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7110 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
45c0f7f8 | 7111 | (:)f(:)40 b Ft(21)399 4386 y(3.5.3)93 b(Shell)30 b(P)m(arameter)i |
c302751c CR |
7112 | (Expansion)18 b Fm(:)d(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7113 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) | |
45c0f7f8 | 7114 | 48 b Ft(22)399 4496 y(3.5.4)93 b(Command)29 b(Substitution)12 |
c302751c CR |
7115 | b Fm(:)j(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7116 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
9f178efb | 7117 | (:)42 b Ft(27)399 4605 y(3.5.5)93 b(Arithmetic)31 b(Expansion)19 |
c302751c CR |
7118 | b Fm(:)c(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7119 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
9f178efb | 7120 | (:)h(:)48 b Ft(28)399 4715 y(3.5.6)93 b(Pro)s(cess)30 |
c302751c CR |
7121 | b(Substitution)d Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7122 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7123 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)57 b Ft(28)399 4824 y(3.5.7)93 |
c302751c CR |
7124 | b(W)-8 b(ord)31 b(Splitting)20 b Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7125 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7126 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)49 | |
9f178efb | 7127 | b Ft(28)399 4934 y(3.5.8)93 b(Filename)32 b(Expansion)13 |
c302751c CR |
7128 | b Fm(:)i(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7129 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
9f178efb | 7130 | (:)f(:)h(:)f(:)43 b Ft(29)524 5044 y(3.5.8.1)93 b(P)m(attern)31 |
c302751c CR |
7131 | b(Matc)m(hing)d Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7132 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7133 | h(:)f(:)g(:)h(:)f(:)56 b Ft(29)399 5153 y(3.5.9)93 b(Quote)31 |
c302751c CR |
7134 | b(Remo)m(v)-5 b(al)9 b Fm(:)17 b(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7135 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7136 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)39 | |
9f178efb | 7137 | b Ft(30)275 5263 y(3.6)92 b(Redirections)26 b Fm(:)15 |
c302751c CR |
7138 | b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7139 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7140 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)55 | |
9f178efb | 7141 | b Ft(31)p eop end |
5e13499c | 7142 | %%Page: -2 4 |
37c41ab1 | 7143 | TeXDict begin -2 3 bop 150 -116 a Ft(ii)2612 b(Bash)31 |
220537f2 CR |
7144 | b(Reference)g(Man)m(ual)399 83 y(3.6.1)93 b(Redirecting)31 |
7145 | b(Input)23 b Fm(:)14 b(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7146 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7147 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)52 b Ft(32)399 193 |
220537f2 | 7148 | y(3.6.2)93 b(Redirecting)31 b(Output)26 b Fm(:)15 b(:)h(:)f(:)g(:)h(:)f |
c302751c | 7149 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
220537f2 | 7150 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)56 |
9f178efb | 7151 | b Ft(32)399 302 y(3.6.3)93 b(App)s(ending)28 b(Redirected)k(Output)12 |
220537f2 | 7152 | b Fm(:)h(:)j(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
9f178efb | 7153 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)41 b Ft(32)399 |
220537f2 | 7154 | 412 y(3.6.4)93 b(Redirecting)31 b(Standard)e(Output)h(and)f(Standard)h |
9f178efb | 7155 | (Error)d Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)58 b Ft(32)399 |
220537f2 CR |
7156 | 521 y(3.6.5)93 b(App)s(ending)28 b(Standard)i(Output)f(and)h(Standard)f |
7157 | (Error)19 b Fm(:)14 b(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)48 | |
9f178efb | 7158 | b Ft(33)399 631 y(3.6.6)93 b(Here)31 b(Do)s(cumen)m(ts)c |
220537f2 CR |
7159 | Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7160 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7161 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)56 b Ft(33)399 741 y(3.6.7)93 |
220537f2 CR |
7162 | b(Here)31 b(Strings)c Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7163 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7164 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)58 | |
9f178efb | 7165 | b Ft(33)399 850 y(3.6.8)93 b(Duplicating)32 b(File)f(Descriptors)16 |
c302751c CR |
7166 | b Fm(:)g(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
7167 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)46 | |
9f178efb | 7168 | b Ft(33)399 960 y(3.6.9)93 b(Mo)m(ving)32 b(File)f(Descriptors)19 |
c302751c CR |
7169 | b Fm(:)d(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7170 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)49 | |
9f178efb | 7171 | b Ft(34)399 1069 y(3.6.10)93 b(Op)s(ening)29 b(File)j(Descriptors)f |
220537f2 | 7172 | (for)f(Reading)h(and)f(W)-8 b(riting)19 b Fm(:)e(:)e(:)h(:)f(:)h(:)f(:) |
9f178efb | 7173 | 49 b Ft(34)275 1179 y(3.7)92 b(Executing)31 b(Commands)17 |
c302751c CR |
7174 | b Fm(:)d(:)h(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7175 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
9f178efb | 7176 | (:)h(:)f(:)g(:)h(:)f(:)h(:)46 b Ft(34)399 1289 y(3.7.1)93 |
c302751c CR |
7177 | b(Simple)30 b(Command)f(Expansion)23 b Fm(:)15 b(:)g(:)h(:)f(:)g(:)h(:) |
7178 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
9f178efb | 7179 | (:)g(:)h(:)f(:)h(:)52 b Ft(34)399 1398 y(3.7.2)93 b(Command)29 |
c302751c CR |
7180 | b(Searc)m(h)i(and)f(Execution)d Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7181 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)56 | |
9f178efb | 7182 | b Ft(35)399 1508 y(3.7.3)93 b(Command)29 b(Execution)i(En)m(vironmen)m |
c302751c | 7183 | (t)8 b Fm(:)16 b(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
9f178efb | 7184 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)38 b Ft(36)399 1617 |
c302751c CR |
7185 | y(3.7.4)93 b(En)m(vironmen)m(t)18 b Fm(:)d(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7186 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7187 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
9f178efb | 7188 | (:)h(:)47 b Ft(37)399 1727 y(3.7.5)93 b(Exit)31 b(Status)c |
c302751c CR |
7189 | Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7190 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7191 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)57 b | |
9f178efb | 7192 | Ft(37)399 1836 y(3.7.6)93 b(Signals)15 b Fm(:)g(:)g(:)h(:)f(:)h(:)f(:)g |
c302751c CR |
7193 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7194 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7195 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)44 b Ft(38)275 1946 |
c302751c CR |
7196 | y(3.8)92 b(Shell)30 b(Scripts)23 b Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7197 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7198 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7199 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)53 b Ft(38)150 2188 y Fr(4)135 |
c302751c CR |
7200 | b(Shell)45 b(Builtin)g(Commands)22 b Fn(:)e(:)g(:)f(:)h(:)f(:)h(:)f(:)g |
7201 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)67 | |
9f178efb | 7202 | b Fr(41)275 2325 y Ft(4.1)92 b(Bourne)30 b(Shell)g(Builtins)e |
c302751c CR |
7203 | Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7204 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7205 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)57 b Ft(41)275 2435 y(4.2)92 |
c302751c CR |
7206 | b(Bash)30 b(Builtin)h(Commands)24 b Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g |
7207 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7208 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)54 | |
9f178efb | 7209 | b Ft(48)275 2545 y(4.3)92 b(Mo)s(difying)30 b(Shell)g(Beha)m(vior)9 |
c302751c CR |
7210 | b Fm(:)17 b(:)f(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7211 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7212 | h(:)f(:)h(:)f(:)39 b Ft(58)399 2654 y(4.3.1)93 b(The)30 |
c302751c CR |
7213 | b(Set)g(Builtin)c Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7214 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7215 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)55 b | |
9f178efb | 7216 | Ft(58)399 2764 y(4.3.2)93 b(The)30 b(Shopt)f(Builtin)13 |
c302751c CR |
7217 | b Fm(:)j(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
7218 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
9f178efb | 7219 | (:)h(:)f(:)h(:)f(:)g(:)43 b Ft(62)275 2873 y(4.4)92 b(Sp)s(ecial)30 |
c302751c CR |
7220 | b(Builtins)21 b Fm(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7221 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
7222 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)50 | |
9f178efb | 7223 | b Ft(67)150 3116 y Fr(5)135 b(Shell)45 b(V)-11 b(ariables)19 |
c302751c CR |
7224 | b Fn(:)h(:)g(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) |
7225 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)64 | |
9f178efb | 7226 | b Fr(69)275 3253 y Ft(5.1)92 b(Bourne)30 b(Shell)g(V)-8 |
c302751c CR |
7227 | b(ariables)22 b Fm(:)16 b(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7228 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7229 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)51 b Ft(69)275 |
220537f2 | 7230 | 3362 y(5.2)92 b(Bash)30 b(V)-8 b(ariables)16 b Fm(:)h(:)f(:)f(:)h(:)f |
c302751c CR |
7231 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7232 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
9f178efb | 7233 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)46 b Ft(69)150 3605 y |
c302751c CR |
7234 | Fr(6)135 b(Bash)44 b(F)-11 b(eatures)13 b Fn(:)20 b(:)g(:)f(:)g(:)h(:)f |
7235 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7236 | f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)58 b Fr(79)275 |
220537f2 | 7237 | 3742 y Ft(6.1)92 b(In)m(v)m(oking)31 b(Bash)d Fm(:)16 |
c302751c CR |
7238 | b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7239 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7240 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)58 b | |
9f178efb | 7241 | Ft(79)275 3851 y(6.2)92 b(Bash)30 b(Startup)g(Files)20 |
c302751c CR |
7242 | b Fm(:)c(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7243 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
9f178efb | 7244 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)49 b Ft(81)275 |
220537f2 | 7245 | 3961 y(6.3)92 b(In)m(teractiv)m(e)32 b(Shells)11 b Fm(:)16 |
c302751c CR |
7246 | b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7247 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7248 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)41 b Ft(82)399 |
220537f2 | 7249 | 4071 y(6.3.1)93 b(What)31 b(is)f(an)h(In)m(teractiv)m(e)h(Shell?)17 |
c302751c CR |
7250 | b Fm(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7251 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)47 b | |
9f178efb | 7252 | Ft(83)399 4180 y(6.3.2)93 b(Is)30 b(this)g(Shell)g(In)m(teractiv)m(e?) |
c302751c CR |
7253 | 14 b Fm(:)k(:)e(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7254 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7255 | 44 b Ft(83)399 4290 y(6.3.3)93 b(In)m(teractiv)m(e)33 |
c302751c CR |
7256 | b(Shell)d(Beha)m(vior)23 b Fm(:)17 b(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7257 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
9f178efb | 7258 | (:)g(:)h(:)f(:)h(:)52 b Ft(83)275 4399 y(6.4)92 b(Bash)30 |
c302751c CR |
7259 | b(Conditional)h(Expressions)22 b Fm(:)14 b(:)i(:)f(:)g(:)h(:)f(:)h(:)f |
7260 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7261 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)51 b Ft(84)275 4509 y(6.5)92 |
c302751c CR |
7262 | b(Shell)30 b(Arithmetic)c Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7263 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7264 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
9f178efb | 7265 | (:)55 b Ft(86)275 4619 y(6.6)92 b(Aliases)12 b Fm(:)k(:)g(:)f(:)h(:)f |
c302751c CR |
7266 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) |
7267 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7268 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)42 | |
9f178efb | 7269 | b Ft(87)275 4728 y(6.7)92 b(Arra)m(ys)17 b Fm(:)e(:)h(:)f(:)h(:)f(:)g |
c302751c CR |
7270 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
7271 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7272 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)47 | |
9f178efb | 7273 | b Ft(88)275 4838 y(6.8)92 b(The)29 b(Directory)j(Stac)m(k)e |
c302751c CR |
7274 | Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7275 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7276 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)58 b Ft(89)399 4947 y(6.8.1)93 |
c302751c CR |
7277 | b(Directory)32 b(Stac)m(k)f(Builtins)14 b Fm(:)i(:)g(:)f(:)g(:)h(:)f(:) |
7278 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
9f178efb | 7279 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)44 b Ft(89)275 |
220537f2 | 7280 | 5057 y(6.9)92 b(Con)m(trolling)31 b(the)g(Prompt)24 b |
c302751c CR |
7281 | Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7282 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7283 | g(:)h(:)f(:)h(:)f(:)54 b Ft(91)275 5166 y(6.10)92 b(The)30 |
c302751c CR |
7284 | b(Restricted)h(Shell)23 b Fm(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7285 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7286 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)53 | |
9f178efb | 7287 | b Ft(92)275 5276 y(6.11)92 b(Bash)31 b(POSIX)e(Mo)s(de)9 |
c302751c CR |
7288 | b Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7289 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7290 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 b Ft(92)p eop |
c302751c | 7291 | end |
8e1a6eaa | 7292 | %%Page: -3 5 |
c302751c CR |
7293 | TeXDict begin -3 4 bop 3674 -116 a Ft(iii)150 83 y Fr(7)135 |
7294 | b(Job)45 b(Con)l(trol)24 b Fn(:)c(:)g(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
7295 | (:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7296 | f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)69 b Fr(97)275 220 y |
c302751c CR |
7297 | Ft(7.1)92 b(Job)30 b(Con)m(trol)h(Basics)17 b Fm(:)f(:)g(:)f(:)h(:)f(:) |
7298 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7299 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7300 | g(:)h(:)f(:)47 b Ft(97)275 330 y(7.2)92 b(Job)30 b(Con)m(trol)h |
c302751c CR |
7301 | (Builtins)25 b Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7302 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
9f178efb CR |
7303 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)55 b Ft(98)275 |
7304 | 439 y(7.3)92 b(Job)30 b(Con)m(trol)h(V)-8 b(ariables)17 | |
7305 | b Fm(:)f(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7306 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7307 | (:)h(:)f(:)h(:)f(:)g(:)47 b Ft(100)150 657 y Fr(8)135 | |
7308 | b(Command)45 b(Line)g(Editing)19 b Fn(:)i(:)e(:)h(:)f(:)h(:)f(:)g(:)h | |
7309 | (:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)63 | |
7310 | b Fr(101)275 794 y Ft(8.1)92 b(In)m(tro)s(duction)30 | |
7311 | b(to)h(Line)f(Editing)24 b Fm(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
74d0116b | 7312 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
9f178efb CR |
7313 | (:)g(:)h(:)f(:)h(:)f(:)54 b Ft(101)275 904 y(8.2)92 b(Readline)31 |
7314 | b(In)m(teraction)c Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7315 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7316 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)56 b Ft(101)399 | |
7317 | 1013 y(8.2.1)93 b(Readline)31 b(Bare)g(Essen)m(tials)26 | |
7318 | b Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7319 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)55 | |
7320 | b Ft(102)399 1123 y(8.2.2)93 b(Readline)31 b(Mo)m(v)m(emen)m(t)i | |
7321 | (Commands)24 b Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7322 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)55 b | |
7323 | Ft(102)399 1233 y(8.2.3)93 b(Readline)31 b(Killing)g(Commands)16 | |
7324 | b Fm(:)f(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7325 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)46 b | |
7326 | Ft(103)399 1342 y(8.2.4)93 b(Readline)31 b(Argumen)m(ts)9 | |
7327 | b Fm(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7328 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7329 | g(:)h(:)f(:)39 b Ft(103)399 1452 y(8.2.5)93 b(Searc)m(hing)31 | |
7330 | b(for)f(Commands)f(in)h(the)h(History)c Fm(:)15 b(:)h(:)f(:)h(:)f(:)g | |
7331 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)57 b Ft(103)275 | |
7332 | 1561 y(8.3)92 b(Readline)31 b(Init)f(File)20 b Fm(:)d(:)e(:)h(:)f(:)g | |
7333 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7334 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7335 | (:)h(:)f(:)h(:)50 b Ft(104)399 1671 y(8.3.1)93 b(Readline)31 | |
7336 | b(Init)f(File)i(Syn)m(tax)12 b Fm(:)k(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7337 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7338 | f(:)g(:)h(:)f(:)h(:)42 b Ft(104)399 1781 y(8.3.2)93 b(Conditional)31 | |
7339 | b(Init)f(Constructs)25 b Fm(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7340 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7341 | g(:)56 b Ft(111)399 1890 y(8.3.3)93 b(Sample)30 b(Init)g(File)12 | |
c302751c CR |
7342 | b Fm(:)17 b(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7343 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7344 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)42 b Ft(112)275 2000 y(8.4)92 |
c302751c CR |
7345 | b(Bindable)30 b(Readline)h(Commands)11 b Fm(:)k(:)g(:)g(:)h(:)f(:)h(:)f |
7346 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7347 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)41 b Ft(115)399 2109 y(8.4.1)93 |
c302751c CR |
7348 | b(Commands)29 b(F)-8 b(or)31 b(Mo)m(ving)e Fm(:)16 b(:)f(:)h(:)f(:)g(:) |
7349 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7350 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)58 b Ft(115)399 |
45c0f7f8 | 7351 | 2219 y(8.4.2)93 b(Commands)29 b(F)-8 b(or)31 b(Manipulating)g(The)f |
c302751c | 7352 | (History)17 b Fm(:)g(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
9f178efb | 7353 | h(:)47 b Ft(116)399 2328 y(8.4.3)93 b(Commands)29 b(F)-8 |
c302751c CR |
7354 | b(or)31 b(Changing)f(T)-8 b(ext)21 b Fm(:)c(:)e(:)h(:)f(:)h(:)f(:)g(:)h |
7355 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
9f178efb | 7356 | 51 b Ft(117)399 2438 y(8.4.4)93 b(Killing)31 b(And)e(Y)-8 |
c302751c CR |
7357 | b(anking)22 b Fm(:)17 b(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7358 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
9f178efb | 7359 | f(:)g(:)h(:)f(:)h(:)52 b Ft(118)399 2548 y(8.4.5)93 b(Sp)s(ecifying)30 |
c302751c CR |
7360 | b(Numeric)g(Argumen)m(ts)17 b Fm(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7361 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)47 | |
9f178efb | 7362 | b Ft(119)399 2657 y(8.4.6)93 b(Letting)31 b(Readline)g(T)m(yp)s(e)f(F) |
c302751c CR |
7363 | -8 b(or)31 b(Y)-8 b(ou)12 b Fm(:)k(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7364 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)42 | |
9f178efb | 7365 | b Ft(120)399 2767 y(8.4.7)93 b(Keyb)s(oard)29 b(Macros)21 |
c302751c CR |
7366 | b Fm(:)16 b(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7367 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7368 | h(:)f(:)h(:)f(:)g(:)51 b Ft(121)399 2876 y(8.4.8)93 b(Some)30 |
c302751c CR |
7369 | b(Miscellaneous)j(Commands)24 b Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7370 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)55 | |
9f178efb | 7371 | b Ft(122)275 2986 y(8.5)92 b(Readline)31 b(vi)f(Mo)s(de)20 |
c302751c CR |
7372 | b Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7373 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7374 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)50 b Ft(124)275 |
45c0f7f8 | 7375 | 3096 y(8.6)92 b(Programmable)30 b(Completion)16 b Fm(:)g(:)f(:)h(:)f(:) |
c302751c CR |
7376 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7377 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)46 | |
9f178efb | 7378 | b Ft(124)275 3205 y(8.7)92 b(Programmable)30 b(Completion)h(Builtins)c |
c302751c | 7379 | Fm(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
9f178efb | 7380 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)56 b Ft(126)275 |
45c0f7f8 CR |
7381 | 3315 y(8.8)92 b(A)30 b(Programmable)h(Completion)g(Example)20 |
7382 | b Fm(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7383 | (:)f(:)g(:)h(:)f(:)h(:)f(:)50 b Ft(130)150 3533 y Fr(9)135 |
45c0f7f8 CR |
7384 | b(Using)45 b(History)h(In)l(teractiv)l(ely)39 b Fn(:)19 |
7385 | b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)80 | |
9f178efb | 7386 | b Fr(133)275 3670 y Ft(9.1)92 b(Bash)30 b(History)h(F)-8 |
c302751c CR |
7387 | b(acilities)21 b Fm(:)d(:)e(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7388 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7389 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)51 b Ft(133)275 3779 |
c302751c CR |
7390 | y(9.2)92 b(Bash)30 b(History)h(Builtins)19 b Fm(:)d(:)g(:)f(:)g(:)h(:)f |
7391 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7392 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)49 | |
9f178efb | 7393 | b Ft(133)275 3889 y(9.3)92 b(History)31 b(Expansion)21 |
c302751c CR |
7394 | b Fm(:)15 b(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7395 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7396 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)52 b Ft(135)399 3999 |
c302751c CR |
7397 | y(9.3.1)93 b(Ev)m(en)m(t)31 b(Designators)10 b Fm(:)18 |
7398 | b(:)d(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7399 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7400 | h(:)f(:)h(:)40 b Ft(136)399 4108 y(9.3.2)93 b(W)-8 b(ord)31 |
c302751c CR |
7401 | b(Designators)17 b Fm(:)g(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7402 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7403 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)47 b Ft(136)399 4218 |
c302751c CR |
7404 | y(9.3.3)93 b(Mo)s(di\014ers)26 b Fm(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7405 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7406 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7407 | (:)f(:)g(:)h(:)57 b Ft(137)150 4436 y Fr(10)135 b(Installing)46 |
c302751c CR |
7408 | b(Bash)24 b Fn(:)c(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7409 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)68 | |
9f178efb | 7410 | b Fr(139)275 4573 y Ft(10.1)92 b(Basic)32 b(Installation)20 |
c302751c CR |
7411 | b Fm(:)d(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7412 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
9f178efb | 7413 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)50 b Ft(139)275 4682 |
c302751c CR |
7414 | y(10.2)92 b(Compilers)30 b(and)g(Options)8 b Fm(:)15 |
7415 | b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7416 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7417 | f(:)h(:)38 b Ft(140)275 4792 y(10.3)92 b(Compiling)30 |
c302751c CR |
7418 | b(F)-8 b(or)32 b(Multiple)f(Arc)m(hitectures)21 b Fm(:)c(:)e(:)h(:)f(:) |
7419 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
9f178efb | 7420 | (:)52 b Ft(140)275 4902 y(10.4)92 b(Installation)32 b(Names)13 |
c302751c CR |
7421 | b Fm(:)j(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7422 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7423 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)43 b Ft(140)275 5011 y(10.5)92 |
c302751c CR |
7424 | b(Sp)s(ecifying)30 b(the)g(System)h(T)m(yp)s(e)12 b Fm(:)j(:)g(:)h(:)f |
7425 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7426 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)42 b Ft(140)275 |
45c0f7f8 | 7427 | 5121 y(10.6)92 b(Sharing)30 b(Defaults)15 b Fm(:)i(:)e(:)g(:)h(:)f(:)h |
c302751c CR |
7428 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7429 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
9f178efb | 7430 | (:)f(:)g(:)46 b Ft(141)275 5230 y(10.7)92 b(Op)s(eration)30 |
c302751c CR |
7431 | b(Con)m(trols)24 b Fm(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7432 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
9f178efb | 7433 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)54 b Ft(141)275 |
45c0f7f8 | 7434 | 5340 y(10.8)92 b(Optional)31 b(F)-8 b(eatures)10 b Fm(:)17 |
c302751c CR |
7435 | b(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7436 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7437 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)40 b Ft(141)p eop end |
8e1a6eaa CR |
7438 | %%Page: -4 6 |
7439 | TeXDict begin -4 5 bop 150 -116 a Ft(iv)2589 b(Bash)31 | |
c302751c CR |
7440 | b(Reference)g(Man)m(ual)150 83 y Fr(App)t(endix)44 b(A)160 |
7441 | b(Rep)t(orting)46 b(Bugs)35 b Fn(:)20 b(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f | |
9f178efb | 7442 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)80 b Fr(147)150 353 y(App)t(endix)44 |
c302751c CR |
7443 | b(B)166 b(Ma)7 b(jor)45 b(Di\013erences)i(F)-11 b(rom)44 |
7444 | b(The)419 486 y(Bourne)g(Shell)35 b Fn(:)19 b(:)h(:)f(:)g(:)h(:)f(:)h | |
7445 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
9f178efb | 7446 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)78 b Fr(149)275 623 y Ft(B.1)92 |
c302751c CR |
7447 | b(Implemen)m(tation)31 b(Di\013erences)h(F)-8 b(rom)31 |
7448 | b(The)e(SVR4.2)j(Shell)13 b Fm(:)i(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)43 | |
9f178efb | 7449 | b Ft(153)150 865 y Fr(App)t(endix)h(C)165 b(GNU)45 b(F)-11 |
c302751c CR |
7450 | b(ree)45 b(Do)t(cumen)l(tation)h(License)439 998 y Fn(:)19 |
7451 | b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7452 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7453 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)64 b Fr(155)150 |
c302751c CR |
7454 | 1268 y(App)t(endix)44 b(D)159 b(Indexes)15 b Fn(:)20 |
7455 | b(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
9f178efb | 7456 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)59 b Fr(163)275 1405 |
c302751c CR |
7457 | y Ft(D.1)92 b(Index)29 b(of)i(Shell)f(Builtin)h(Commands)16 |
7458 | b Fm(:)e(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
9f178efb | 7459 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)46 b Ft(163)275 |
c302751c CR |
7460 | 1514 y(D.2)92 b(Index)29 b(of)i(Shell)f(Reserv)m(ed)h(W)-8 |
7461 | b(ords)12 b Fm(:)j(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7462 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)42 | |
9f178efb | 7463 | b Ft(164)275 1624 y(D.3)92 b(P)m(arameter)31 b(and)f(V)-8 |
c302751c CR |
7464 | b(ariable)32 b(Index)20 b Fm(:)14 b(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7465 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7466 | f(:)h(:)f(:)50 b Ft(164)275 1733 y(D.4)92 b(F)-8 b(unction)31 |
c302751c CR |
7467 | b(Index)16 b Fm(:)f(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7468 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7469 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)47 | |
9f178efb | 7470 | b Ft(166)275 1843 y(D.5)92 b(Concept)30 b(Index)d Fm(:)15 |
c302751c CR |
7471 | b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7472 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
9f178efb | 7473 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)57 b Ft(168)p |
c302751c | 7474 | eop end |
5e13499c | 7475 | %%Page: 1 7 |
37c41ab1 CR |
7476 | TeXDict begin 1 6 bop 150 -116 a Ft(Chapter)30 b(1:)41 |
7477 | b(In)m(tro)s(duction)2592 b(1)150 299 y Fo(1)80 b(In)l(tro)t(duction) | |
c302751c CR |
7478 | 150 602 y Fr(1.1)68 b(What)45 b(is)g(Bash?)150 762 y |
7479 | Ft(Bash)38 b(is)g(the)g(shell,)i(or)d(command)h(language)h(in)m | |
7480 | (terpreter,)h(for)e(the)g Fl(gnu)f Ft(op)s(erating)h(system.)63 | |
7481 | b(The)150 871 y(name)33 b(is)g(an)g(acron)m(ym)g(for)g(the)g(`)p | |
5e13499c | 7482 | Fs(Bourne-Again)27 b(SHell)p Ft(',)32 b(a)i(pun)d(on)i(Stephen)f |
c302751c | 7483 | (Bourne,)h(the)g(author)150 981 y(of)f(the)f(direct)h(ancestor)h(of)e |
37c41ab1 | 7484 | (the)h(curren)m(t)f(Unix)g(shell)h Fs(sh)p Ft(,)f(whic)m(h)g(app)s |
c302751c | 7485 | (eared)g(in)g(the)h(Sev)m(en)m(th)g(Edition)150 1091 |
37c41ab1 | 7486 | y(Bell)g(Labs)e(Researc)m(h)h(v)m(ersion)g(of)f(Unix.)275 |
c302751c | 7487 | 1220 y(Bash)f(is)g(largely)i(compatible)f(with)f Fs(sh)g |
37c41ab1 | 7488 | Ft(and)g(incorp)s(orates)g(useful)g(features)g(from)g(the)g(Korn)g |
c302751c | 7489 | (shell)150 1330 y Fs(ksh)37 b Ft(and)h(the)g(C)g(shell)g |
37c41ab1 CR |
7490 | Fs(csh)p Ft(.)64 b(It)38 b(is)g(in)m(tended)g(to)h(b)s(e)f(a)g |
7491 | (conforman)m(t)h(implemen)m(tation)h(of)e(the)g Fl(ieee)150 | |
c302751c | 7492 | 1439 y(posix)c Ft(Shell)g(and)g(T)-8 b(o)s(ols)35 b(p)s(ortion)f(of)g |
ac18b312 | 7493 | (the)h Fl(ieee)f(posix)f Ft(sp)s(eci\014cation)j(\()p |
c302751c | 7494 | Fl(ieee)e Ft(Standard)f(1003.1\).)56 b(It)150 1549 y(o\013ers)31 |
ac18b312 CR |
7495 | b(functional)f(impro)m(v)m(emen)m(ts)i(o)m(v)m(er)g Fs(sh)d |
7496 | Ft(for)i(b)s(oth)e(in)m(teractiv)m(e)k(and)d(programming)g(use.)275 | |
c302751c | 7497 | 1679 y(While)h(the)g Fl(gnu)f Ft(op)s(erating)h(system)g(pro)m(vides)f |
37c41ab1 | 7498 | (other)h(shells,)g(including)f(a)h(v)m(ersion)g(of)g |
c302751c | 7499 | Fs(csh)p Ft(,)f(Bash)150 1788 y(is)j(the)h(default)f(shell.)49 |
37c41ab1 CR |
7500 | b(Lik)m(e)34 b(other)g Fl(gnu)f Ft(soft)m(w)m(are,)i(Bash)f(is)f(quite) |
7501 | h(p)s(ortable.)49 b(It)33 b(curren)m(tly)g(runs)f(on)150 | |
c302751c | 7502 | 1898 y(nearly)c(ev)m(ery)g(v)m(ersion)g(of)f(Unix)h(and)e(a)i(few)f |
37c41ab1 | 7503 | (other)h(op)s(erating)g(systems)f Fp(\000)g Ft(indep)s(enden)m |
c302751c | 7504 | (tly-supp)s(orted)150 2008 y(p)s(orts)j(exist)h(for)f |
37c41ab1 | 7505 | Fl(ms-dos)p Ft(,)f Fl(os/2)p Ft(,)i(and)f(Windo)m(ws)g(platforms.)150 |
c302751c CR |
7506 | 2231 y Fr(1.2)68 b(What)45 b(is)g(a)h(shell?)150 2390 |
7507 | y Ft(A)m(t)32 b(its)f(base,)h(a)f(shell)g(is)h(simply)e(a)h(macro)h | |
7508 | (pro)s(cessor)f(that)g(executes)i(commands.)42 b(The)30 | |
7509 | b(term)h(macro)150 2500 y(pro)s(cessor)25 b(means)g(functionalit)m(y)i | |
7510 | (where)d(text)j(and)d(sym)m(b)s(ols)h(are)h(expanded)e(to)i(create)h | |
7511 | (larger)f(expres-)150 2609 y(sions.)275 2739 y(A)34 b(Unix)h(shell)g | |
7512 | (is)f(b)s(oth)g(a)h(command)g(in)m(terpreter)g(and)f(a)h(programming)f | |
7513 | (language.)55 b(As)35 b(a)g(com-)150 2848 y(mand)30 b(in)m(terpreter,)i | |
37c41ab1 CR |
7514 | (the)g(shell)f(pro)m(vides)g(the)h(user)e(in)m(terface)j(to)f(the)f |
7515 | (ric)m(h)h(set)g(of)f Fl(gnu)g Ft(utilities.)44 b(The)150 | |
c302751c | 7516 | 2958 y(programming)30 b(language)h(features)f(allo)m(w)h(these)g |
d3ad40de | 7517 | (utilities)g(to)g(b)s(e)e(com)m(bined.)41 b(Files)31 |
c302751c | 7518 | b(con)m(taining)g(com-)150 3068 y(mands)e(can)i(b)s(e)e(created,)j(and) |
37c41ab1 | 7519 | d(b)s(ecome)i(commands)f(themselv)m(es.)42 b(These)30 |
c302751c | 7520 | b(new)f(commands)h(ha)m(v)m(e)i(the)150 3177 y(same)f(status)h(as)f |
37c41ab1 CR |
7521 | (system)g(commands)g(in)g(directories)h(suc)m(h)f(as)g(`)p |
7522 | Fs(/bin)p Ft(',)g(allo)m(wing)i(users)d(or)h(groups)f(to)150 | |
c302751c CR |
7523 | 3287 y(establish)h(custom)f(en)m(vironmen)m(ts)h(to)g(automate)h(their) |
7524 | f(common)f(tasks.)275 3417 y(Shells)j(ma)m(y)h(b)s(e)f(used)g(in)m | |
37c41ab1 CR |
7525 | (teractiv)m(ely)k(or)d(non-in)m(teractiv)m(ely)-8 b(.)54 |
7526 | b(In)33 b(in)m(teractiv)m(e)j(mo)s(de,)f(they)e(accept)150 | |
c302751c | 7527 | 3526 y(input)21 b(t)m(yp)s(ed)h(from)g(the)h(k)m(eyb)s(oard.)37 |
37c41ab1 | 7528 | b(When)22 b(executing)i(non-in)m(teractiv)m(ely)-8 b(,)27 |
c302751c CR |
7529 | b(shells)c(execute)g(commands)150 3636 y(read)30 b(from)g(a)h(\014le.) |
7530 | 275 3765 y(A)41 b(shell)g(allo)m(ws)h(execution)h(of)e | |
37c41ab1 | 7531 | Fl(gnu)g Ft(commands,)i(b)s(oth)e(sync)m(hronously)f(and)h(async)m |
c302751c | 7532 | (hronously)-8 b(.)150 3875 y(The)29 b(shell)g(w)m(aits)i(for)e(sync)m |
d3ad40de | 7533 | (hronous)f(commands)h(to)h(complete)h(b)s(efore)e(accepting)i(more)e |
c302751c | 7534 | (input;)g(asyn-)150 3985 y(c)m(hronous)22 b(commands)h(con)m(tin)m(ue)h |
37c41ab1 | 7535 | (to)f(execute)h(in)e(parallel)i(with)f(the)f(shell)h(while)g(it)g |
c302751c | 7536 | (reads)g(and)f(executes)150 4094 y(additional)35 b(commands.)50 |
37c41ab1 | 7537 | b(The)33 b Fq(redirection)h Ft(constructs)g(p)s(ermit)f(\014ne-grained) |
c302751c | 7538 | g(con)m(trol)i(of)f(the)g(input)150 4204 y(and)40 b(output)f(of)i |
37c41ab1 CR |
7539 | (those)f(commands.)70 b(Moreo)m(v)m(er,)45 b(the)c(shell)f(allo)m(ws)h |
7540 | (con)m(trol)h(o)m(v)m(er)g(the)e(con)m(ten)m(ts)i(of)150 | |
c302751c | 7541 | 4313 y(commands')30 b(en)m(vironmen)m(ts.)275 4443 y(Shells)k(also)i |
37c41ab1 CR |
7542 | (pro)m(vide)g(a)f(small)h(set)f(of)g(built-in)g(commands)g(\()p |
7543 | Fq(builtins)t Ft(\))g(implemen)m(ting)h(function-)150 | |
c302751c | 7544 | 4553 y(alit)m(y)i(imp)s(ossible)e(or)g(incon)m(v)m(enien)m(t)j(to)e |
37c41ab1 | 7545 | (obtain)g(via)g(separate)g(utilities.)61 b(F)-8 b(or)37 |
c302751c | 7546 | b(example,)i Fs(cd)p Ft(,)e Fs(break)p Ft(,)150 4662 |
74d0116b CR |
7547 | y Fs(continue)p Ft(,)28 b(and)i Fs(exec)f Ft(cannot)i(b)s(e)f(implemen) |
7548 | m(ted)h(outside)g(of)f(the)h(shell)f(b)s(ecause)h(they)f(directly)h | |
7549 | (ma-)150 4772 y(nipulate)d(the)g(shell)g(itself.)41 b(The)27 | |
7550 | b Fs(history)p Ft(,)g Fs(getopts)p Ft(,)f Fs(kill)p Ft(,)i(or)g | |
7551 | Fs(pwd)f Ft(builtins,)h(among)g(others,)h(could)150 4881 | |
7552 | y(b)s(e)34 b(implemen)m(ted)g(in)g(separate)h(utilities,)i(but)d(they)g | |
7553 | (are)g(more)h(con)m(v)m(enien)m(t)h(to)f(use)f(as)g(builtin)g(com-)150 | |
7554 | 4991 y(mands.)40 b(All)31 b(of)f(the)h(shell)f(builtins)g(are)h | |
7555 | (describ)s(ed)e(in)h(subsequen)m(t)g(sections.)275 5121 | |
7556 | y(While)39 b(executing)h(commands)e(is)g(essen)m(tial,)43 | |
c302751c CR |
7557 | b(most)c(of)g(the)g(p)s(o)m(w)m(er)f(\(and)g(complexit)m(y\))j(of)e |
7558 | (shells)150 5230 y(is)34 b(due)f(to)i(their)f(em)m(b)s(edded)f | |
7559 | (programming)h(languages.)52 b(Lik)m(e)35 b(an)m(y)f(high-lev)m(el)i | |
7560 | (language,)h(the)d(shell)150 5340 y(pro)m(vides)c(v)-5 | |
7561 | b(ariables,)32 b(\015o)m(w)e(con)m(trol)i(constructs,)f(quoting,)g(and) | |
7562 | f(functions.)p eop end | |
5e13499c | 7563 | %%Page: 2 8 |
37c41ab1 | 7564 | TeXDict begin 2 7 bop 150 -116 a Ft(2)2617 b(Bash)31 |
c302751c CR |
7565 | b(Reference)g(Man)m(ual)275 299 y(Shells)21 b(o\013er)i(features)f |
7566 | (geared)h(sp)s(eci\014cally)g(for)f(in)m(teractiv)m(e)j(use)d(rather)g | |
7567 | (than)g(to)h(augmen)m(t)g(the)f(pro-)150 408 y(gramming)32 | |
7568 | b(language.)48 b(These)32 b(in)m(teractiv)m(e)j(features)d(include)g | |
7569 | (job)g(con)m(trol,)j(command)c(line)i(editing,)150 518 | |
7570 | y(command)d(history)g(and)g(aliases.)42 b(Eac)m(h)31 | |
37c41ab1 CR |
7571 | b(of)g(these)g(features)f(is)h(describ)s(ed)e(in)h(this)g(man)m(ual.)p |
7572 | eop end | |
5e13499c | 7573 | %%Page: 3 9 |
37c41ab1 | 7574 | TeXDict begin 3 8 bop 150 -116 a Ft(Chapter)30 b(2:)41 |
c302751c CR |
7575 | b(De\014nitions)2662 b(3)150 299 y Fo(2)80 b(De\014nitions)150 |
7576 | 552 y Ft(These)30 b(de\014nitions)g(are)h(used)e(throughout)h(the)h | |
7577 | (remainder)f(of)g(this)h(man)m(ual.)150 720 y Fs(POSIX)240 | |
ac18b312 CR |
7578 | b Ft(A)27 b(family)g(of)g(op)s(en)f(system)g(standards)g(based)g(on)h |
7579 | (Unix.)39 b(Bash)27 b(is)g(primarily)f(concerned)630 | |
a9fac3b2 CR |
7580 | 830 y(with)k(the)h(Shell)f(and)g(Utilities)i(p)s(ortion)e(of)h(the)f |
7581 | Fl(posix)g Ft(1003.1)j(standard.)150 995 y Fs(blank)240 | |
7582 | b Ft(A)30 b(space)h(or)g(tab)f(c)m(haracter.)150 1161 | |
ac18b312 CR |
7583 | y Fs(builtin)144 b Ft(A)35 b(command)g(that)g(is)g(implemen)m(ted)g(in) |
7584 | m(ternally)h(b)m(y)f(the)g(shell)g(itself,)i(rather)d(than)h(b)m(y)630 | |
a9fac3b2 CR |
7585 | 1271 y(an)30 b(executable)i(program)e(somewhere)h(in)f(the)g(\014le)h |
7586 | (system.)150 1436 y Fs(control)d(operator)630 1546 y | |
3d4e09aa CR |
7587 | Ft(A)20 b Fs(token)f Ft(that)i(p)s(erforms)e(a)i(con)m(trol)g |
7588 | (function.)37 b(It)21 b(is)f(a)h Fs(newline)d Ft(or)j(one)f(of)h(the)f | |
a9fac3b2 | 7589 | (follo)m(wing:)630 1655 y(`)p Fs(||)p Ft(',)31 b(`)p |
3d4e09aa | 7590 | Fs(&&)p Ft(',)f(`)p Fs(&)p Ft(',)h(`)p Fs(;)p Ft(',)g(`)p |
ed35cb4a | 7591 | Fs(;;)p Ft(',)f(`)p Fs(|)p Ft(',)h(`)p Fs(|&)p Ft(',)f(`)p |
a9fac3b2 CR |
7592 | Fs(\()p Ft(',)h(or)g(`)p Fs(\))p Ft('.)150 1821 y Fs(exit)e(status)630 |
7593 | 1931 y Ft(The)f(v)-5 b(alue)29 b(returned)e(b)m(y)h(a)h(command)f(to)h | |
ed35cb4a | 7594 | (its)g(caller.)41 b(The)28 b(v)-5 b(alue)29 b(is)f(restricted)h(to)h |
a9fac3b2 CR |
7595 | (eigh)m(t)630 2040 y(bits,)h(so)f(the)h(maxim)m(um)f(v)-5 |
7596 | b(alue)31 b(is)f(255.)150 2206 y Fs(field)240 b Ft(A)27 | |
ed35cb4a | 7597 | b(unit)g(of)g(text)h(that)g(is)f(the)g(result)g(of)g(one)h(of)f(the)g |
a9fac3b2 | 7598 | (shell)g(expansions.)40 b(After)27 b(expansion,)630 2315 |
ed35cb4a | 7599 | y(when)e(executing)h(a)g(command,)h(the)f(resulting)f(\014elds)g(are)h |
a9fac3b2 CR |
7600 | (used)f(as)h(the)g(command)f(name)630 2425 y(and)30 b(argumen)m(ts.)150 |
7601 | 2591 y Fs(filename)96 b Ft(A)30 b(string)h(of)f(c)m(haracters)i(used)e | |
7602 | (to)h(iden)m(tify)g(a)f(\014le.)150 2756 y Fs(job)336 | |
ed35cb4a CR |
7603 | b Ft(A)31 b(set)h(of)f(pro)s(cesses)g(comprising)g(a)g(pip)s(eline,)g |
7604 | (and)g(an)m(y)g(pro)s(cesses)g(descended)g(from)f(it,)630 | |
a9fac3b2 CR |
7605 | 2866 y(that)h(are)g(all)g(in)f(the)h(same)f(pro)s(cess)g(group.)150 |
7606 | 3031 y Fs(job)f(control)630 3141 y Ft(A)22 b(mec)m(hanism)g(b)m(y)f | |
ed35cb4a | 7607 | (whic)m(h)h(users)f(can)h(selectiv)m(ely)i(stop)e(\(susp)s(end\))e(and) |
a9fac3b2 CR |
7608 | h(restart)i(\(resume\))630 3251 y(execution)32 b(of)e(pro)s(cesses.)150 |
7609 | 3416 y Fs(metacharacter)630 3526 y Ft(A)25 b(c)m(haracter)i(that,)g | |
ed35cb4a | 7610 | (when)d(unquoted,)i(separates)g(w)m(ords.)38 b(A)26 b(metac)m(haracter) |
a9fac3b2 | 7611 | i(is)d(a)g Fs(blank)630 3635 y Ft(or)30 b(one)h(of)g(the)f(follo)m |
ed35cb4a CR |
7612 | (wing)i(c)m(haracters:)42 b(`)p Fs(|)p Ft(',)31 b(`)p |
7613 | Fs(&)p Ft(',)g(`)p Fs(;)p Ft(',)g(`)p Fs(\()p Ft(',)f(`)p | |
7614 | Fs(\))p Ft(',)h(`)p Fs(<)p Ft(',)g(or)f(`)p Fs(>)p Ft('.)150 | |
a9fac3b2 | 7615 | 3801 y Fs(name)288 b Ft(A)37 b Fs(word)f Ft(consisting)i(solely)h(of)e |
ed35cb4a | 7616 | (letters,)j(n)m(um)m(b)s(ers,)e(and)f(underscores,)h(and)f(b)s |
a9fac3b2 | 7617 | (eginning)630 3910 y(with)23 b(a)g(letter)h(or)f(underscore.)38 |
ed35cb4a | 7618 | b Fs(Name)p Ft(s)22 b(are)h(used)f(as)i(shell)f(v)-5 |
a9fac3b2 | 7619 | b(ariable)24 b(and)e(function)h(names.)630 4020 y(Also)31 |
ed35cb4a | 7620 | b(referred)f(to)h(as)f(an)h Fs(identifier)p Ft(.)150 |
a9fac3b2 | 7621 | 4186 y Fs(operator)96 b Ft(A)38 b Fs(control)28 b(operator)36 |
ed35cb4a | 7622 | b Ft(or)h(a)i Fs(redirection)27 b(operator)p Ft(.)61 |
9f178efb | 7623 | b(See)38 b(Section)g(3.6)h([Redirec-)630 4295 y(tions],)f(page)f(31,)i |
a9fac3b2 CR |
7624 | (for)d(a)g(list)h(of)f(redirection)h(op)s(erators.)58 |
7625 | b(Op)s(erators)35 b(con)m(tain)j(at)f(least)630 4405 | |
7626 | y(one)31 b(unquoted)e Fs(metacharacter)p Ft(.)150 4570 | |
7627 | y Fs(process)f(group)630 4680 y Ft(A)i(collection)k(of)c(related)h(pro) | |
7628 | s(cesses)g(eac)m(h)g(ha)m(ving)g(the)g(same)f(pro)s(cess)g(group)g | |
7629 | Fl(id)p Ft(.)150 4846 y Fs(process)e(group)h(ID)630 4955 | |
ed35cb4a CR |
7630 | y Ft(A)h(unique)g(iden)m(ti\014er)h(that)f(represen)m(ts)h(a)g |
7631 | Fs(process)d(group)h Ft(during)g(its)i(lifetime.)150 | |
a9fac3b2 | 7632 | 5121 y Fs(reserved)d(word)630 5230 y Ft(A)h Fs(word)e |
ed35cb4a CR |
7633 | Ft(that)i(has)f(a)h(sp)s(ecial)g(meaning)f(to)h(the)g(shell.)40 |
7634 | b(Most)30 b(reserv)m(ed)e(w)m(ords)g(in)m(tro)s(duce)630 | |
a9fac3b2 CR |
7635 | 5340 y(shell)j(\015o)m(w)f(con)m(trol)i(constructs,)f(suc)m(h)f(as)g |
7636 | Fs(for)g Ft(and)g Fs(while)p Ft(.)p eop end | |
5e13499c | 7637 | %%Page: 4 10 |
37c41ab1 | 7638 | TeXDict begin 4 9 bop 150 -116 a Ft(4)2617 b(Bash)31 |
a9fac3b2 CR |
7639 | b(Reference)g(Man)m(ual)150 299 y Fs(return)e(status)630 |
7640 | 408 y Ft(A)h(synon)m(ym)g(for)g Fs(exit)g(status)p Ft(.)150 | |
7641 | 568 y Fs(signal)192 b Ft(A)40 b(mec)m(hanism)h(b)m(y)e(whic)m(h)h(a)h | |
7642 | (pro)s(cess)e(ma)m(y)i(b)s(e)e(noti\014ed)h(b)m(y)g(the)h(k)m(ernel)f | |
7643 | (of)g(an)g(ev)m(en)m(t)630 677 y(o)s(ccurring)30 b(in)g(the)h(system.) | |
7644 | 150 837 y Fs(special)d(builtin)630 946 y Ft(A)j(shell)f(builtin)g | |
7645 | (command)h(that)g(has)f(b)s(een)g(classi\014ed)h(as)g(sp)s(ecial)g(b)m | |
7646 | (y)f(the)h Fl(posix)f Ft(stan-)630 1056 y(dard.)150 1215 | |
7647 | y Fs(token)240 b Ft(A)38 b(sequence)h(of)f(c)m(haracters)h(considered)f | |
7648 | (a)h(single)g(unit)e(b)m(y)h(the)h(shell.)64 b(It)38 | |
7649 | b(is)g(either)h(a)630 1325 y Fs(word)29 b Ft(or)i(an)f | |
7650 | Fs(operator)p Ft(.)150 1484 y Fs(word)288 b Ft(A)28 b(sequence)g(of)g | |
7651 | (c)m(haracters)h(treated)g(as)f(a)g(unit)f(b)m(y)h(the)g(shell.)40 | |
7652 | b(W)-8 b(ords)28 b(ma)m(y)g(not)g(include)630 1594 y(unquoted)i | |
7653 | Fs(metacharacters)p Ft(.)p eop end | |
5e13499c | 7654 | %%Page: 5 11 |
37c41ab1 CR |
7655 | TeXDict begin 5 10 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
7656 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(5)150 299 | |
c302751c CR |
7657 | y Fo(3)80 b(Basic)54 b(Shell)e(F)-13 b(eatures)150 603 |
7658 | y Ft(Bash)21 b(is)g(an)f(acron)m(ym)i(for)e(`)p Fs(Bourne-Again)27 | |
7659 | b(SHell)p Ft('.)37 b(The)20 b(Bourne)g(shell)h(is)g(the)g(traditional)h | |
7660 | (Unix)f(shell)150 712 y(originally)h(written)f(b)m(y)f(Stephen)g | |
7661 | (Bourne.)38 b(All)21 b(of)g(the)g(Bourne)f(shell)h(builtin)f(commands)g | |
7662 | (are)i(a)m(v)-5 b(ailable)150 822 y(in)26 b(Bash,)h(The)f(rules)f(for)h | |
7663 | (ev)-5 b(aluation)28 b(and)d(quoting)h(are)h(tak)m(en)g(from)f(the)g | |
7664 | Fl(posix)f Ft(sp)s(eci\014cation)i(for)f(the)150 931 | |
7665 | y(`standard')k(Unix)g(shell.)275 1089 y(This)h(c)m(hapter)i(brie\015y)e | |
7666 | (summarizes)h(the)h(shell's)f(`building)g(blo)s(c)m(ks':)45 | |
7667 | b(commands,)32 b(con)m(trol)i(struc-)150 1199 y(tures,)k(shell)e | |
7668 | (functions,)h(shell)g Fk(p)-5 b(ar)g(ameters)p Ft(,)41 | |
7669 | b(shell)36 b(expansions,)i Fk(r)-5 b(e)g(dir)g(e)g(ctions)p | |
7670 | Ft(,)40 b(whic)m(h)c(are)h(a)f(w)m(a)m(y)h(to)150 1308 | |
7671 | y(direct)31 b(input)e(and)h(output)g(from)g(and)g(to)h(named)f | |
7672 | (\014les,)g(and)g(ho)m(w)g(the)h(shell)g(executes)g(commands.)150 | |
7673 | 1576 y Fr(3.1)68 b(Shell)45 b(Syn)l(tax)150 1735 y Ft(When)40 | |
7674 | b(the)h(shell)g(reads)f(input,)i(it)f(pro)s(ceeds)f(through)g(a)h | |
7675 | (sequence)g(of)g(op)s(erations.)71 b(If)40 b(the)h(input)150 | |
7676 | 1845 y(indicates)31 b(the)f(b)s(eginning)f(of)h(a)g(commen)m(t,)h(the)f | |
7677 | (shell)g(ignores)g(the)g(commen)m(t)h(sym)m(b)s(ol)f(\(`)p | |
7678 | Fs(#)p Ft('\),)h(and)e(the)150 1954 y(rest)i(of)f(that)h(line.)275 | |
7679 | 2112 y(Otherwise,)h(roughly)f(sp)s(eaking,)i(the)f(shell)g(reads)g(its) | |
7680 | g(input)f(and)h(divides)f(the)i(input)e(in)m(to)h(w)m(ords)150 | |
7681 | 2222 y(and)23 b(op)s(erators,)j(emplo)m(ying)e(the)g(quoting)h(rules)e | |
37c41ab1 | 7682 | (to)h(select)i(whic)m(h)d(meanings)h(to)h(assign)f(v)-5 |
c302751c CR |
7683 | b(arious)23 b(w)m(ords)150 2331 y(and)30 b(c)m(haracters.)275 |
7684 | 2489 y(The)38 b(shell)h(then)f(parses)g(these)h(tok)m(ens)h(in)m(to)f | |
37c41ab1 | 7685 | (commands)g(and)f(other)h(constructs,)i(remo)m(v)m(es)f(the)150 |
c302751c | 7686 | 2598 y(sp)s(ecial)31 b(meaning)f(of)g(certain)h(w)m(ords)f(or)g(c)m |
37c41ab1 | 7687 | (haracters,)i(expands)d(others,)h(redirects)h(input)e(and)g(output)150 |
c302751c | 7688 | 2708 y(as)d(needed,)g(executes)g(the)g(sp)s(eci\014ed)e(command,)j(w)m |
37c41ab1 | 7689 | (aits)f(for)f(the)g(command's)g(exit)i(status,)f(and)f(mak)m(es)150 |
c302751c | 7690 | 2818 y(that)31 b(exit)g(status)g(a)m(v)-5 b(ailable)33 |
37c41ab1 | 7691 | b(for)d(further)f(insp)s(ection)h(or)h(pro)s(cessing.)150 |
c302751c CR |
7692 | 3040 y Fj(3.1.1)63 b(Shell)41 b(Op)s(eration)150 3187 |
7693 | y Ft(The)c(follo)m(wing)h(is)f(a)h(brief)e(description)i(of)f(the)g | |
7694 | (shell's)h(op)s(eration)f(when)f(it)i(reads)f(and)f(executes)j(a)150 | |
7695 | 3297 y(command.)h(Basically)-8 b(,)34 b(the)c(shell)h(do)s(es)f(the)h | |
7696 | (follo)m(wing:)199 3454 y(1.)61 b(Reads)42 b(its)h(input)e(from)h(a)g | |
9f178efb | 7697 | (\014le)h(\(see)g(Section)g(3.8)g([Shell)f(Scripts],)j(page)e(38\),)k |
c302751c | 7698 | (from)41 b(a)i(string)330 3564 y(supplied)26 b(as)i(an)f(argumen)m(t)g |
37c41ab1 | 7699 | (to)h(the)g(`)p Fs(-c)p Ft(')f(in)m(v)m(o)s(cation)i(option)f(\(see)g |
9f178efb | 7700 | (Section)h(6.1)f([In)m(v)m(oking)g(Bash],)330 3673 y(page)j(79\),)h(or) |
c302751c | 7701 | e(from)g(the)h(user's)f(terminal.)199 3820 y(2.)61 b(Breaks)43 |
37c41ab1 | 7702 | b(the)g(input)f(in)m(to)h(w)m(ords)f(and)g(op)s(erators,)k(ob)s(eying)d |
c302751c | 7703 | (the)g(quoting)g(rules)f(describ)s(ed)f(in)330 3929 y(Section)27 |
37c41ab1 | 7704 | b(3.1.2)i([Quoting],)f(page)f(6.)40 b(These)26 b(tok)m(ens)i(are)f |
5e13499c | 7705 | (separated)g(b)m(y)f Fs(metacharacters)p Ft(.)36 b(Alias)330 |
c302751c | 7706 | 4039 y(expansion)30 b(is)h(p)s(erformed)d(b)m(y)j(this)f(step)g(\(see)i |
9f178efb | 7707 | (Section)f(6.6)g([Aliases],)i(page)e(87\).)199 4185 y(3.)61 |
37c41ab1 CR |
7708 | b(P)m(arses)35 b(the)g(tok)m(ens)g(in)m(to)h(simple)e(and)g(comp)s |
7709 | (ound)f(commands)h(\(see)h(Section)h(3.2)f([Shell)g(Com-)330 | |
220537f2 | 7710 | 4294 y(mands],)30 b(page)h(8\).)199 4441 y(4.)61 b(P)m(erforms)40 |
37c41ab1 | 7711 | b(the)h(v)-5 b(arious)40 b(shell)h(expansions)f(\(see)h(Section)g(3.5)g |
45c0f7f8 | 7712 | ([Shell)g(Expansions],)h(page)f(20\),)330 4550 y(breaking)35 |
37c41ab1 | 7713 | b(the)g(expanded)g(tok)m(ens)h(in)m(to)g(lists)f(of)g(\014lenames)h |
c302751c | 7714 | (\(see)g(Section)f(3.5.8)i([Filename)g(Ex-)330 4660 y(pansion],)30 |
9f178efb | 7715 | b(page)h(29\))h(and)e(commands)g(and)g(argumen)m(ts.)199 |
c302751c | 7716 | 4806 y(5.)61 b(P)m(erforms)36 b(an)m(y)i(necessary)f(redirections)g |
9f178efb | 7717 | (\(see)h(Section)f(3.6)h([Redirections],)i(page)e(31\))g(and)e(re-)330 |
c302751c CR |
7718 | 4915 y(mo)m(v)m(es)c(the)e(redirection)h(op)s(erators)g(and)f(their)g |
7719 | (op)s(erands)f(from)h(the)h(argumen)m(t)f(list.)199 5062 | |
37c41ab1 | 7720 | y(6.)61 b(Executes)31 b(the)g(command)f(\(see)h(Section)g(3.7)h |
9f178efb | 7721 | ([Executing)f(Commands],)f(page)h(34\).)199 5208 y(7.)61 |
37c41ab1 CR |
7722 | b(Optionally)40 b(w)m(aits)g(for)f(the)g(command)g(to)h(complete)g(and) |
7723 | f(collects)i(its)f(exit)g(status)f(\(see)h(Sec-)330 5317 | |
9f178efb | 7724 | y(tion)31 b(3.7.5)h([Exit)f(Status],)g(page)g(37\).)p |
37c41ab1 | 7725 | eop end |
5e13499c | 7726 | %%Page: 6 12 |
37c41ab1 | 7727 | TeXDict begin 6 11 bop 150 -116 a Ft(6)2617 b(Bash)31 |
c302751c CR |
7728 | b(Reference)g(Man)m(ual)150 299 y Fj(3.1.2)63 b(Quoting)150 |
7729 | 446 y Ft(Quoting)32 b(is)h(used)e(to)i(remo)m(v)m(e)h(the)e(sp)s(ecial) | |
7730 | h(meaning)f(of)h(certain)g(c)m(haracters)g(or)f(w)m(ords)g(to)h(the)f | |
7731 | (shell.)150 555 y(Quoting)c(can)f(b)s(e)g(used)f(to)j(disable)e(sp)s | |
37c41ab1 | 7732 | (ecial)h(treatmen)m(t)h(for)e(sp)s(ecial)h(c)m(haracters,)i(to)e(prev)m |
c302751c | 7733 | (en)m(t)g(reserv)m(ed)150 665 y(w)m(ords)i(from)g(b)s(eing)g |
37c41ab1 | 7734 | (recognized)h(as)g(suc)m(h,)f(and)g(to)h(prev)m(en)m(t)g(parameter)g |
984a1947 | 7735 | (expansion.)275 793 y(Eac)m(h)22 b(of)g(the)g(shell)g(metac)m |
37c41ab1 | 7736 | (haracters)i(\(see)f(Chapter)e(2)i([De\014nitions],)h(page)f(3\))g(has) |
984a1947 | 7737 | e(sp)s(ecial)i(meaning)150 902 y(to)40 b(the)g(shell)f(and)g(m)m(ust)g |
37c41ab1 | 7738 | (b)s(e)g(quoted)g(if)h(it)g(is)f(to)h(represen)m(t)g(itself.)68 |
984a1947 | 7739 | b(When)39 b(the)h(command)f(history)150 1012 y(expansion)i(facilities)j |
01ed5ba4 | 7740 | (are)e(b)s(eing)f(used)g(\(see)h(Section)h(9.3)f([History)h(In)m |
9f178efb | 7741 | (teraction],)j(page)c(135\),)47 b(the)150 1122 y Fq(history)30 |
01ed5ba4 CR |
7742 | b(expansion)h Ft(c)m(haracter,)h(usually)f(`)p Fs(!)p |
7743 | Ft(',)g(m)m(ust)f(b)s(e)g(quoted)h(to)g(prev)m(en)m(t)g(history)g | |
984a1947 | 7744 | (expansion.)41 b(See)150 1231 y(Section)22 b(9.1)g([Bash)f(History)h(F) |
9f178efb | 7745 | -8 b(acilities],)26 b(page)c(133,)j(for)20 b(more)h(details)h |
984a1947 | 7746 | (concerning)g(history)f(expansion.)275 1359 y(There)36 |
c302751c CR |
7747 | b(are)i(three)f(quoting)g(mec)m(hanisms:)55 b(the)37 |
7748 | b Fq(escap)s(e)h(c)m(haracter)7 b Ft(,)40 b(single)d(quotes,)j(and)c | |
984a1947 CR |
7749 | (double)150 1469 y(quotes.)150 1655 y Fj(3.1.2.1)63 b(Escap)s(e)41 |
7750 | b(Character)150 1802 y Ft(A)36 b(non-quoted)f(bac)m(kslash)h(`)p | |
c302751c CR |
7751 | Fs(\\)p Ft(')g(is)f(the)h(Bash)g(escap)s(e)f(c)m(haracter.)58 |
7752 | b(It)36 b(preserv)m(es)f(the)h(literal)h(v)-5 b(alue)36 | |
984a1947 | 7753 | b(of)150 1911 y(the)27 b(next)g(c)m(haracter)h(that)f(follo)m(ws,)i |
c302751c | 7754 | (with)d(the)h(exception)g(of)g Fs(newline)p Ft(.)38 b(If)26 |
984a1947 | 7755 | b(a)h Fs(\\newline)d Ft(pair)i(app)s(ears,)150 2021 y(and)k(the)h(bac)m |
01ed5ba4 CR |
7756 | (kslash)g(itself)g(is)g(not)g(quoted,)g(the)f Fs(\\newline)f |
7757 | Ft(is)h(treated)i(as)f(a)g(line)g(con)m(tin)m(uation)h(\(that)150 | |
984a1947 CR |
7758 | 2131 y(is,)f(it)g(is)f(remo)m(v)m(ed)h(from)f(the)h(input)e(stream)i |
7759 | (and)f(e\013ectiv)m(ely)j(ignored\).)150 2317 y Fj(3.1.2.2)63 | |
7760 | b(Single)42 b(Quotes)150 2464 y Ft(Enclosing)24 b(c)m(haracters)h(in)e | |
c302751c CR |
7761 | (single)h(quotes)g(\(`)p Fs(')p Ft('\))g(preserv)m(es)g(the)f(literal)i |
7762 | (v)-5 b(alue)24 b(of)g(eac)m(h)g(c)m(haracter)h(within)150 | |
984a1947 | 7763 | 2573 y(the)31 b(quotes.)42 b(A)31 b(single)h(quote)f(ma)m(y)g(not)g(o)s |
c302751c | 7764 | (ccur)g(b)s(et)m(w)m(een)g(single)h(quotes,)f(ev)m(en)h(when)d |
984a1947 CR |
7765 | (preceded)i(b)m(y)g(a)150 2683 y(bac)m(kslash.)150 2869 |
7766 | y Fj(3.1.2.3)63 b(Double)42 b(Quotes)150 3016 y Ft(Enclosing)24 | |
c302751c CR |
7767 | b(c)m(haracters)h(in)f(double)f(quotes)h(\(`)p Fs(")p |
7768 | Ft('\))g(preserv)m(es)g(the)g(literal)h(v)-5 b(alue)24 | |
984a1947 | 7769 | b(of)g(all)g(c)m(haracters)h(within)150 3125 y(the)34 |
c302751c CR |
7770 | b(quotes,)h(with)f(the)g(exception)h(of)f(`)p Fs($)p |
7771 | Ft(',)h(`)p Fs(`)p Ft(',)g(`)p Fs(\\)p Ft(',)g(and,)f(when)f(history)g | |
984a1947 | 7772 | (expansion)h(is)g(enabled,)h(`)p Fs(!)p Ft('.)150 3235 |
c302751c CR |
7773 | y(The)25 b(c)m(haracters)h(`)p Fs($)p Ft(')g(and)f(`)p |
7774 | Fs(`)p Ft(')g(retain)h(their)f(sp)s(ecial)h(meaning)f(within)g(double)g | |
984a1947 | 7775 | (quotes)h(\(see)g(Section)g(3.5)150 3345 y([Shell)j(Expansions],)g |
45c0f7f8 | 7776 | (page)h(20\).)41 b(The)28 b(bac)m(kslash)i(retains)f(its)h(sp)s(ecial)f |
984a1947 | 7777 | (meaning)g(only)g(when)f(follo)m(w)m(ed)150 3454 y(b)m(y)41 |
c302751c CR |
7778 | b(one)f(of)h(the)g(follo)m(wing)h(c)m(haracters:)63 b(`)p |
7779 | Fs($)p Ft(',)43 b(`)p Fs(`)p Ft(',)h(`)p Fs(")p Ft(',)g(`)p | |
7780 | Fs(\\)p Ft(',)f(or)e Fs(newline)p Ft(.)69 b(Within)41 | |
984a1947 | 7781 | b(double)f(quotes,)150 3564 y(bac)m(kslashes)25 b(that)h(are)f(follo)m |
c302751c | 7782 | (w)m(ed)h(b)m(y)e(one)h(of)g(these)g(c)m(haracters)h(are)f(remo)m(v)m |
984a1947 | 7783 | (ed.)40 b(Bac)m(kslashes)26 b(preceding)150 3673 y(c)m(haracters)35 |
c302751c CR |
7784 | b(without)e(a)h(sp)s(ecial)f(meaning)h(are)f(left)h(unmo)s(di\014ed.)47 |
7785 | b(A)34 b(double)f(quote)g(ma)m(y)h(b)s(e)f(quoted)150 | |
984a1947 | 7786 | 3783 y(within)h(double)h(quotes)g(b)m(y)g(preceding)g(it)g(with)g(a)g |
c302751c | 7787 | (bac)m(kslash.)55 b(If)35 b(enabled,)h(history)f(expansion)g(will)150 |
984a1947 | 7788 | 3892 y(b)s(e)f(p)s(erformed)g(unless)g(an)h(`)p Fs(!)p |
c302751c | 7789 | Ft(')g(app)s(earing)f(in)h(double)f(quotes)i(is)f(escap)s(ed)g(using)f |
984a1947 | 7790 | (a)h(bac)m(kslash.)55 b(The)150 4002 y(bac)m(kslash)31 |
c302751c | 7791 | b(preceding)f(the)h(`)p Fs(!)p Ft(')f(is)h(not)g(remo)m(v)m(ed.)275 |
984a1947 | 7792 | 4130 y(The)41 b(sp)s(ecial)h(parameters)f(`)p Fs(*)p |
c302751c | 7793 | Ft(')h(and)f(`)p Fs(@)p Ft(')h(ha)m(v)m(e)g(sp)s(ecial)g(meaning)g |
984a1947 | 7794 | (when)f(in)g(double)g(quotes)h(\(see)150 4240 y(Section)31 |
45c0f7f8 | 7795 | b(3.5.3)h([Shell)f(P)m(arameter)h(Expansion],)e(page)h(22\).)150 |
984a1947 | 7796 | 4426 y Fj(3.1.2.4)63 b(ANSI-C)40 b(Quoting)150 4573 y |
c302751c CR |
7797 | Ft(W)-8 b(ords)41 b(of)h(the)f(form)g Fs($')p Fi(string)11 |
7798 | b Fs(')38 b Ft(are)k(treated)g(sp)s(ecially)-8 b(.)75 | |
7799 | b(The)41 b(w)m(ord)g(expands)f(to)i Fq(string)8 b Ft(,)44 | |
984a1947 | 7800 | b(with)150 4682 y(bac)m(kslash-escap)s(ed)g(c)m(haracters)h(replaced)f |
c302751c | 7801 | (as)g(sp)s(eci\014ed)f(b)m(y)g(the)g(ANSI)g(C)g(standard.)79 |
984a1947 CR |
7802 | b(Bac)m(kslash)150 4792 y(escap)s(e)31 b(sequences,)g(if)f(presen)m(t,) |
7803 | h(are)g(deco)s(ded)f(as)g(follo)m(ws:)150 4938 y Fs(\\a)384 | |
7804 | b Ft(alert)31 b(\(b)s(ell\))150 5084 y Fs(\\b)384 b Ft(bac)m(kspace)150 | |
7805 | 5230 y Fs(\\e)150 5340 y(\\E)g Ft(an)30 b(escap)s(e)h(c)m(haracter)h | |
7806 | (\(not)f(ANSI)f(C\))p eop end | |
5e13499c | 7807 | %%Page: 7 13 |
37c41ab1 CR |
7808 | TeXDict begin 7 12 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
7809 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(7)150 299 | |
220537f2 CR |
7810 | y Fs(\\f)384 b Ft(form)30 b(feed)150 488 y Fs(\\n)384 |
7811 | b Ft(newline)150 678 y Fs(\\r)g Ft(carriage)32 b(return)150 | |
7812 | 868 y Fs(\\t)384 b Ft(horizon)m(tal)32 b(tab)150 1057 | |
7813 | y Fs(\\v)384 b Ft(v)m(ertical)32 b(tab)150 1247 y Fs(\\\\)384 | |
7814 | b Ft(bac)m(kslash)150 1436 y Fs(\\')g Ft(single)31 b(quote)150 | |
7815 | 1626 y Fs(\\")384 b Ft(double)30 b(quote)150 1816 y Fs(\\)p | |
984a1947 CR |
7816 | Fi(nnn)288 b Ft(the)31 b(eigh)m(t-bit)h(c)m(haracter)g(whose)e(v)-5 |
7817 | b(alue)31 b(is)f(the)h(o)s(ctal)g(v)-5 b(alue)31 b Fq(nnn)e | |
220537f2 | 7818 | Ft(\(one)i(to)g(three)g(digits\))150 2005 y Fs(\\x)p |
984a1947 CR |
7819 | Fi(HH)288 b Ft(the)36 b(eigh)m(t-bit)i(c)m(haracter)f(whose)f(v)-5 |
7820 | b(alue)36 b(is)g(the)g(hexadecimal)h(v)-5 b(alue)36 b | |
220537f2 CR |
7821 | Fq(HH)46 b Ft(\(one)37 b(or)f(t)m(w)m(o)630 2115 y(hex)30 |
7822 | b(digits\))150 2304 y Fs(\\u)p Fi(HHHH)192 b Ft(the)33 | |
7823 | b(Unico)s(de)f(\(ISO/IEC)g(10646\))j(c)m(haracter)f(whose)e(v)-5 | |
7824 | b(alue)33 b(is)g(the)g(hexadecimal)g(v)-5 b(alue)630 | |
7825 | 2414 y Fq(HHHH)41 b Ft(\(one)31 b(to)g(four)f(hex)g(digits\))150 | |
7826 | 2604 y Fs(\\U)p Fi(HHHHHHHH)630 2713 y Ft(the)j(Unico)s(de)f(\(ISO/IEC) | |
7827 | g(10646\))j(c)m(haracter)f(whose)e(v)-5 b(alue)33 b(is)g(the)g | |
7828 | (hexadecimal)g(v)-5 b(alue)630 2823 y Fq(HHHHHHHH)42 | |
7829 | b Ft(\(one)31 b(to)g(eigh)m(t)g(hex)g(digits\))150 3012 | |
7830 | y Fs(\\c)p Fi(x)336 b Ft(a)31 b(con)m(trol-)p Fq(x)38 | |
7831 | b Ft(c)m(haracter)150 3217 y(The)30 b(expanded)f(result)i(is)f | |
984a1947 | 7832 | (single-quoted,)i(as)f(if)f(the)g(dollar)h(sign)g(had)e(not)i(b)s(een)f |
220537f2 CR |
7833 | (presen)m(t.)150 3446 y Fj(3.1.2.5)63 b(Lo)s(cale-Sp)s(eci\014c)41 |
7834 | b(T)-10 b(ranslation)150 3593 y Ft(A)28 b(double-quoted)g(string)f | |
984a1947 CR |
7835 | (preceded)h(b)m(y)f(a)h(dollar)h(sign)e(\(`)p Fs($)p |
7836 | Ft('\))i(will)f(cause)g(the)g(string)g(to)g(b)s(e)f(translated)150 | |
220537f2 | 7837 | 3703 y(according)f(to)f(the)g(curren)m(t)g(lo)s(cale.)41 |
984a1947 CR |
7838 | b(If)24 b(the)h(curren)m(t)g(lo)s(cale)h(is)f Fs(C)g |
7839 | Ft(or)g Fs(POSIX)p Ft(,)f(the)h(dollar)h(sign)f(is)g(ignored.)150 | |
220537f2 CR |
7840 | 3813 y(If)30 b(the)g(string)h(is)f(translated)h(and)f(replaced,)h(the)g |
7841 | (replacemen)m(t)h(is)e(double-quoted.)275 3977 y(Some)20 | |
984a1947 CR |
7842 | b(systems)h(use)f(the)h(message)h(catalog)h(selected)f(b)m(y)f(the)g |
7843 | Fs(LC_MESSAGES)c Ft(shell)k(v)-5 b(ariable.)39 b(Others)150 | |
220537f2 | 7844 | 4087 y(create)g(the)e(name)g(of)g(the)g(message)h(catalog)i(from)d(the) |
984a1947 | 7845 | g(v)-5 b(alue)37 b(of)g(the)h Fs(TEXTDOMAIN)c Ft(shell)j(v)-5 |
220537f2 | 7846 | b(ariable,)150 4196 y(p)s(ossibly)31 b(adding)g(a)g(su\016x)g(of)h(`)p |
984a1947 CR |
7847 | Fs(.mo)p Ft('.)43 b(If)31 b(y)m(ou)h(use)f(the)h Fs(TEXTDOMAIN)c |
7848 | Ft(v)-5 b(ariable,)33 b(y)m(ou)f(ma)m(y)g(need)f(to)h(set)150 | |
220537f2 | 7849 | 4306 y(the)22 b Fs(TEXTDOMAINDIR)d Ft(v)-5 b(ariable)23 |
984a1947 | 7850 | b(to)g(the)f(lo)s(cation)i(of)e(the)h(message)g(catalog)i(\014les.)38 |
220537f2 | 7851 | b(Still)23 b(others)f(use)g(b)s(oth)150 4416 y(v)-5 b(ariables)31 |
37c41ab1 | 7852 | b(in)f(this)g(fashion:)41 b Fs(TEXTDOMAINDIR)p Ft(/)p |
220537f2 CR |
7853 | Fs(LC_MESSAGES)p Ft(/LC)p 2528 4416 28 4 v 34 w(MESSA)m(GES/)p |
7854 | Fs(TEXTDOMAIN)p Ft(.mo.)150 4645 y Fj(3.1.3)63 b(Commen)m(ts)150 | |
7855 | 4792 y Ft(In)21 b(a)i(non-in)m(teractiv)m(e)h(shell,)g(or)e(an)g(in)m | |
c302751c | 7856 | (teractiv)m(e)j(shell)d(in)g(whic)m(h)g(the)g Fs(interactive_comments) |
220537f2 | 7857 | 16 b Ft(option)150 4902 y(to)40 b(the)f Fs(shopt)e Ft(builtin)h(is)h |
c302751c | 7858 | (enabled)g(\(see)h(Section)g(4.3.2)g([The)f(Shopt)f(Builtin],)k(page)e |
9f178efb | 7859 | (62\),)i(a)d(w)m(ord)150 5011 y(b)s(eginning)26 b(with)g(`)p |
c302751c CR |
7860 | Fs(#)p Ft(')g(causes)h(that)f(w)m(ord)g(and)g(all)h(remaining)g(c)m |
7861 | (haracters)g(on)f(that)h(line)g(to)g(b)s(e)f(ignored.)150 | |
220537f2 | 7862 | 5121 y(An)43 b(in)m(teractiv)m(e)j(shell)e(without)f(the)g |
c302751c | 7863 | Fs(interactive_comments)38 b Ft(option)44 b(enabled)f(do)s(es)g(not)g |
220537f2 | 7864 | (allo)m(w)150 5230 y(commen)m(ts.)56 b(The)34 b Fs |
c302751c | 7865 | (interactive_comments)c Ft(option)35 b(is)g(on)g(b)m(y)g(default)g(in)g |
220537f2 | 7866 | (in)m(teractiv)m(e)j(shells.)55 b(See)150 5340 y(Section)30 |
9f178efb | 7867 | b(6.3)f([In)m(teractiv)m(e)j(Shells],)d(page)h(82,)g(for)e(a)i |
220537f2 CR |
7868 | (description)e(of)h(what)g(mak)m(es)h(a)f(shell)g(in)m(teractiv)m(e.)p |
7869 | eop end | |
c302751c CR |
7870 | %%Page: 8 14 |
7871 | TeXDict begin 8 13 bop 150 -116 a Ft(8)2617 b(Bash)31 | |
220537f2 CR |
7872 | b(Reference)g(Man)m(ual)150 299 y Fr(3.2)68 b(Shell)45 |
7873 | b(Commands)150 458 y Ft(A)d(simple)g(shell)g(command)f(suc)m(h)h(as)g | |
7874 | Fs(echo)29 b(a)h(b)g(c)41 b Ft(consists)i(of)f(the)f(command)h(itself)h | |
7875 | (follo)m(w)m(ed)g(b)m(y)150 568 y(argumen)m(ts,)31 b(separated)g(b)m(y) | |
9ec5ed66 | 7876 | f(spaces.)275 714 y(More)h(complex)h(shell)f(commands)g(are)g(comp)s |
220537f2 | 7877 | (osed)g(of)g(simple)g(commands)g(arranged)g(together)h(in)150 |
9ec5ed66 | 7878 | 824 y(a)f(v)-5 b(ariet)m(y)32 b(of)f(w)m(a)m(ys:)41 b(in)31 |
220537f2 | 7879 | b(a)g(pip)s(eline)f(in)g(whic)m(h)g(the)h(output)f(of)h(one)f(command)h |
9ec5ed66 | 7880 | (b)s(ecomes)f(the)h(input)f(of)150 933 y(a)h(second,)f(in)h(a)f(lo)s |
220537f2 | 7881 | (op)h(or)f(conditional)i(construct,)f(or)f(in)g(some)h(other)g |
9ec5ed66 CR |
7882 | (grouping.)150 1144 y Fj(3.2.1)63 b(Simple)41 b(Commands)150 |
7883 | 1291 y Ft(A)29 b(simple)f(command)g(is)h(the)g(kind)e(of)i(command)f | |
220537f2 | 7884 | (encoun)m(tered)h(most)g(often.)40 b(It's)29 b(just)f(a)h(sequence)g |
9ec5ed66 | 7885 | (of)150 1401 y(w)m(ords)22 b(separated)i(b)m(y)e Fs(blank)p |
220537f2 | 7886 | Ft(s,)i(terminated)f(b)m(y)g(one)g(of)g(the)g(shell's)g(con)m(trol)h |
9ec5ed66 | 7887 | (op)s(erators)f(\(see)h(Chapter)f(2)150 1510 y([De\014nitions],)37 |
220537f2 | 7888 | b(page)e(3\).)54 b(The)35 b(\014rst)e(w)m(ord)i(generally)g(sp)s |
c302751c | 7889 | (eci\014es)g(a)g(command)f(to)h(b)s(e)f(executed,)j(with)150 |
9ec5ed66 CR |
7890 | 1620 y(the)31 b(rest)f(of)h(the)f(w)m(ords)g(b)s(eing)g(that)h |
7891 | (command's)f(argumen)m(ts.)275 1766 y(The)h(return)h(status)g(\(see)i | |
9f178efb | 7892 | (Section)f(3.7.5)h([Exit)f(Status],)h(page)f(37\))g(of)g(a)g(simple)f |
9ec5ed66 | 7893 | (command)g(is)h(its)150 1876 y(exit)38 b(status)f(as)g(pro)m(vided)f(b) |
37c41ab1 | 7894 | m(y)h(the)g Fl(posix)f Ft(1003.1)j Fs(waitpid)c Ft(function,)j(or)f |
9ec5ed66 CR |
7895 | (128)p Fs(+)p Fq(n)g Ft(if)g(the)g(command)150 1986 y(w)m(as)31 |
7896 | b(terminated)g(b)m(y)f(signal)h Fq(n)p Ft(.)150 2197 | |
7897 | y Fj(3.2.2)63 b(Pip)s(elines)150 2343 y Ft(A)35 b Fs(pipeline)e | |
c302751c | 7898 | Ft(is)j(a)f(sequence)h(of)f(simple)g(commands)g(separated)h(b)m(y)f |
9ec5ed66 CR |
7899 | (one)g(of)h(the)f(con)m(trol)i(op)s(erators)150 2453 |
7900 | y(`)p Fs(|)p Ft(')31 b(or)f(`)p Fs(|&)p Ft('.)275 2599 | |
7901 | y(The)f(format)i(for)f(a)h(pip)s(eline)f(is)390 2746 | |
c302751c | 7902 | y Fs([time)46 b([-p]])h([!])g Fi(command1)56 b Fs([)47 |
122f603c CR |
7903 | b(|)h(or)f(|&)g Fi(command2)56 b Fs(])47 b(...)150 2892 |
7904 | y Ft(The)25 b(output)f(of)i(eac)m(h)g(command)f(in)f(the)i(pip)s(eline) | |
7905 | e(is)i(connected)g(via)f(a)h(pip)s(e)e(to)i(the)f(input)f(of)h(the)h | |
9ec5ed66 | 7906 | (next)150 3001 y(command.)40 b(That)29 b(is,)h(eac)m(h)h(command)e |
c302751c | 7907 | (reads)g(the)h(previous)f(command's)g(output.)40 b(This)29 |
9ec5ed66 | 7908 | b(connection)150 3111 y(is)h(p)s(erformed)f(b)s(efore)h(an)m(y)h |
c302751c | 7909 | (redirections)g(sp)s(eci\014ed)f(b)m(y)g(the)g(command.)275 |
122f603c CR |
7910 | 3257 y(If)h(`)p Fs(|&)p Ft(')h(is)g(used,)f Fq(command1)7 |
7911 | b Ft('s)33 b(standard)e(output)g(and)h(standard)f(error)g(are)i | |
7912 | (connected)f(to)h Fq(com-)150 3367 y(mand2)7 b Ft('s)27 | |
7913 | b(standard)f(input)h(through)f(the)h(pip)s(e;)h(it)g(is)f(shorthand)f | |
7914 | (for)h Fs(2>&1)i(|)p Ft(.)39 b(This)26 b(implicit)j(redirec-)150 | |
7915 | 3477 y(tion)i(of)f(the)h(standard)f(error)f(is)i(p)s(erformed)e(after)i | |
7916 | (an)m(y)f(redirections)h(sp)s(eci\014ed)f(b)m(y)g(the)h(command.)275 | |
7917 | 3623 y(The)36 b(reserv)m(ed)g(w)m(ord)g Fs(time)g Ft(causes)h(timing)g | |
7918 | (statistics)h(to)f(b)s(e)f(prin)m(ted)g(for)g(the)h(pip)s(eline)f(once) | |
7919 | h(it)150 3732 y(\014nishes.)51 b(The)34 b(statistics)i(curren)m(tly)e | |
7920 | (consist)h(of)f(elapsed)h(\(w)m(all-clo)s(c)m(k\))i(time)e(and)f(user)f | |
7921 | (and)h(system)150 3842 y(time)28 b(consumed)e(b)m(y)h(the)h(command's)f | |
9ec5ed66 CR |
7922 | (execution.)40 b(The)27 b(`)p Fs(-p)p Ft(')g(option)h(c)m(hanges)g(the) |
7923 | f(output)g(format)g(to)150 3952 y(that)34 b(sp)s(eci\014ed)e(b)m(y)h | |
7924 | Fl(posix)p Ft(.)49 b(When)33 b(the)g(shell)g(is)h(in)e | |
7925 | Fl(posix)h Ft(mo)s(de)g(\(see)h(Section)g(6.11)g([Bash)g(POSIX)150 | |
9f178efb | 7926 | 4061 y(Mo)s(de],)40 b(page)f(92\),)i(it)d(do)s(es)f(not)h(recognize)i |
9ec5ed66 CR |
7927 | Fs(time)c Ft(as)i(a)g(reserv)m(ed)g(w)m(ord)f(if)h(the)g(next)g(tok)m |
7928 | (en)g(b)s(egins)150 4171 y(with)33 b(a)g(`)p Fs(-)p Ft('.)49 | |
7929 | b(The)33 b Fs(TIMEFORMAT)d Ft(v)-5 b(ariable)34 b(ma)m(y)g(b)s(e)f(set) | |
7930 | g(to)h(a)g(format)f(string)g(that)h(sp)s(eci\014es)f(ho)m(w)g(the)150 | |
7931 | 4280 y(timing)38 b(information)g(should)e(b)s(e)h(displa)m(y)m(ed.)62 | |
7932 | b(See)38 b(Section)g(5.2)g([Bash)g(V)-8 b(ariables],)41 | |
9f178efb | 7933 | b(page)d(69,)i(for)e(a)150 4390 y(description)27 b(of)g(the)h(a)m(v)-5 |
9ec5ed66 CR |
7934 | b(ailable)29 b(formats.)40 b(The)26 b(use)h(of)g Fs(time)f |
7935 | Ft(as)i(a)f(reserv)m(ed)g(w)m(ord)g(p)s(ermits)f(the)h(timing)150 | |
7936 | 4499 y(of)38 b(shell)g(builtins,)i(shell)e(functions,)i(and)d(pip)s | |
7937 | (elines.)63 b(An)38 b(external)h Fs(time)e Ft(command)h(cannot)g(time) | |
7938 | 150 4609 y(these)31 b(easily)-8 b(.)275 4755 y(When)29 | |
7939 | b(the)h(shell)h(is)f(in)f Fl(posix)g Ft(mo)s(de)h(\(see)h(Section)f | |
9f178efb | 7940 | (6.11)i([Bash)e(POSIX)f(Mo)s(de],)i(page)g(92\),)g Fs(time)150 |
9ec5ed66 CR |
7941 | 4865 y Ft(ma)m(y)26 b(b)s(e)f(follo)m(w)m(ed)j(b)m(y)d(a)h(newline.)39 |
7942 | b(In)25 b(this)h(case,)i(the)d(shell)h(displa)m(ys)g(the)g(total)h | |
7943 | (user)e(and)g(system)h(time)150 4975 y(consumed)33 b(b)m(y)h(the)h | |
7944 | (shell)f(and)f(its)i(c)m(hildren.)51 b(The)34 b Fs(TIMEFORMAT)d | |
7945 | Ft(v)-5 b(ariable)35 b(ma)m(y)g(b)s(e)e(used)g(to)i(sp)s(ecify)150 | |
7946 | 5084 y(the)c(format)f(of)h(the)f(time)h(information.)275 | |
7947 | 5230 y(If)24 b(the)h(pip)s(eline)g(is)g(not)g(executed)h(async)m | |
7948 | (hronously)f(\(see)h(Section)g(3.2.3)h([Lists],)g(page)e(9\),)i(the)f | |
7949 | (shell)150 5340 y(w)m(aits)31 b(for)f(all)i(commands)e(in)g(the)g(pip)s | |
7950 | (eline)g(to)h(complete.)p eop end | |
220537f2 CR |
7951 | %%Page: 9 15 |
7952 | TeXDict begin 9 14 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9ec5ed66 CR |
7953 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(9)275 299 |
7954 | y(Eac)m(h)25 b(command)g(in)g(a)g(pip)s(eline)g(is)g(executed)h(in)f | |
7955 | (its)g(o)m(wn)h(subshell)e(\(see)i(Section)g(3.7.3)h([Command)150 | |
9f178efb | 7956 | 408 y(Execution)36 b(En)m(vironmen)m(t],)i(page)e(36\).)58 |
9ec5ed66 CR |
7957 | b(The)36 b(exit)g(status)g(of)g(a)g(pip)s(eline)g(is)f(the)h(exit)h |
7958 | (status)f(of)g(the)150 518 y(last)27 b(command)f(in)f(the)i(pip)s | |
7959 | (eline,)f(unless)g(the)g Fs(pipefail)e Ft(option)i(is)g(enabled)g | |
7960 | (\(see)h(Section)g(4.3.1)h([The)150 628 y(Set)34 b(Builtin],)j(page)e | |
9f178efb | 7961 | (58\).)53 b(If)34 b Fs(pipefail)e Ft(is)i(enabled,)h(the)g(pip)s |
9ec5ed66 CR |
7962 | (eline's)f(return)f(status)h(is)h(the)f(v)-5 b(alue)35 |
7963 | b(of)150 737 y(the)d(last)h(\(righ)m(tmost\))h(command)e(to)h(exit)g | |
7964 | (with)e(a)i(non-zero)f(status,)h(or)f(zero)h(if)f(all)h(commands)f | |
7965 | (exit)150 847 y(successfully)-8 b(.)67 b(If)38 b(the)h(reserv)m(ed)g(w) | |
7966 | m(ord)g(`)p Fs(!)p Ft(')g(precedes)g(the)g(pip)s(eline,)h(the)g(exit)f | |
7967 | (status)g(is)g(the)g(logical)150 956 y(negation)h(of)f(the)f(exit)i | |
7968 | (status)f(as)f(describ)s(ed)g(ab)s(o)m(v)m(e.)66 b(The)38 | |
7969 | b(shell)h(w)m(aits)h(for)e(all)h(commands)g(in)f(the)150 | |
7970 | 1066 y(pip)s(eline)30 b(to)h(terminate)g(b)s(efore)f(returning)g(a)h(v) | |
74d0116b CR |
7971 | -5 b(alue.)150 1262 y Fj(3.2.3)63 b(Lists)41 b(of)h(Commands)150 |
7972 | 1409 y Ft(A)37 b Fs(list)e Ft(is)i(a)g(sequence)g(of)g(one)g(or)f(more) | |
220537f2 | 7973 | h(pip)s(elines)f(separated)h(b)m(y)g(one)g(of)f(the)h(op)s(erators)g(`) |
74d0116b | 7974 | p Fs(;)p Ft(',)i(`)p Fs(&)p Ft(',)150 1518 y(`)p Fs(&&)p |
c302751c CR |
7975 | Ft(',)31 b(or)f(`)p Fs(||)p Ft(',)g(and)g(optionally)i(terminated)f(b)m |
7976 | (y)f(one)h(of)f(`)p Fs(;)p Ft(',)h(`)p Fs(&)p Ft(',)g(or)f(a)h | |
74d0116b | 7977 | Fs(newline)p Ft(.)275 1651 y(Of)23 b(these)h(list)g(op)s(erators,)i(`)p |
37c41ab1 CR |
7978 | Fs(&&)p Ft(')d(and)g(`)p Fs(||)p Ft(')h(ha)m(v)m(e)h(equal)f |
7979 | (precedence,)i(follo)m(w)m(ed)f(b)m(y)f(`)p Fs(;)p Ft(')g(and)f(`)p | |
74d0116b CR |
7980 | Fs(&)p Ft(',)i(whic)m(h)150 1761 y(ha)m(v)m(e)32 b(equal)e(precedence.) |
7981 | 275 1893 y(A)f(sequence)h(of)g(one)g(or)g(more)g(newlines)f(ma)m(y)h | |
220537f2 | 7982 | (app)s(ear)f(in)h(a)g Fs(list)e Ft(to)j(delimit)f(commands,)g(equiv-) |
74d0116b | 7983 | 150 2003 y(alen)m(t)i(to)f(a)g(semicolon.)275 2136 y(If)c(a)h(command)f |
220537f2 | 7984 | (is)h(terminated)g(b)m(y)g(the)g(con)m(trol)h(op)s(erator)f(`)p |
37c41ab1 | 7985 | Fs(&)p Ft(',)h(the)e(shell)h(executes)h(the)f(command)150 |
74d0116b | 7986 | 2245 y(async)m(hronously)g(in)g(a)h(subshell.)39 b(This)28 |
c302751c | 7987 | b(is)g(kno)m(wn)g(as)h(executing)h(the)e(command)h(in)f(the)g |
74d0116b | 7988 | Fq(bac)m(kground)t Ft(.)150 2355 y(The)g(shell)h(do)s(es)f(not)h(w)m |
37c41ab1 | 7989 | (ait)g(for)f(the)h(command)f(to)i(\014nish,)d(and)h(the)h(return)e |
74d0116b | 7990 | (status)i(is)g(0)g(\(true\).)40 b(When)150 2464 y(job)g(con)m(trol)h |
220537f2 | 7991 | (is)g(not)f(activ)m(e)i(\(see)f(Chapter)f(7)h([Job)f(Con)m(trol],)j |
9f178efb | 7992 | (page)e(97\),)j(the)d(standard)e(input)g(for)150 2574 |
220537f2 CR |
7993 | y(async)m(hronous)k(commands,)k(in)d(the)f(absence)i(of)f(an)m(y)g |
7994 | (explicit)h(redirections,)j(is)43 b(redirected)h(from)150 | |
74d0116b | 7995 | 2684 y Fs(/dev/null)p Ft(.)275 2816 y(Commands)19 b(separated)j(b)m(y)f |
220537f2 | 7996 | (a)g(`)p Fs(;)p Ft(')g(are)h(executed)g(sequen)m(tially;)k(the)21 |
74d0116b | 7997 | b(shell)g(w)m(aits)h(for)f(eac)m(h)h(command)150 2926 |
37c41ab1 CR |
7998 | y(to)31 b(terminate)h(in)e(turn.)39 b(The)30 b(return)f(status)i(is)f |
7999 | (the)h(exit)g(status)g(of)g(the)f(last)h(command)f(executed.)275 | |
74d0116b | 8000 | 3059 y Fl(and)g Ft(and)h Fl(or)g Ft(lists)h(are)g(sequences)f(of)h(one) |
6a8fd0ed | 8001 | g(or)f(more)h(pip)s(elines)e(separated)i(b)m(y)g(the)f(con)m(trol)i(op) |
74d0116b | 8002 | s(er-)150 3168 y(ators)e(`)p Fs(&&)p Ft(')f(and)g(`)p |
6a8fd0ed CR |
8003 | Fs(||)p Ft(',)h(resp)s(ectiv)m(ely)-8 b(.)42 b Fl(and)30 |
8004 | b Ft(and)f Fl(or)h Ft(lists)h(are)g(executed)g(with)f(left)h(asso)s | |
74d0116b CR |
8005 | (ciativit)m(y)-8 b(.)275 3301 y(An)30 b Fl(and)f Ft(list)i(has)f(the)h |
8006 | (form)390 3434 y Fi(command1)56 b Fs(&&)47 b Fi(command2)150 | |
8007 | 3566 y Fq(command2)38 b Ft(is)30 b(executed)i(if,)e(and)g(only)g(if,)h | |
37c41ab1 | 8008 | Fq(command1)38 b Ft(returns)29 b(an)h(exit)h(status)g(of)g(zero.)275 |
74d0116b CR |
8009 | 3699 y(An)f Fl(or)f Ft(list)i(has)f(the)h(form)390 3832 |
8010 | y Fi(command1)56 b Fs(||)47 b Fi(command2)150 3965 y | |
37c41ab1 CR |
8011 | Fq(command2)38 b Ft(is)30 b(executed)i(if,)e(and)g(only)g(if,)h |
8012 | Fq(command1)38 b Ft(returns)29 b(a)i(non-zero)g(exit)g(status.)275 | |
74d0116b | 8013 | 4097 y(The)h(return)g(status)i(of)f Fl(and)f Ft(and)h |
37c41ab1 | 8014 | Fl(or)f Ft(lists)i(is)f(the)g(exit)h(status)g(of)f(the)g(last)h |
74d0116b CR |
8015 | (command)f(executed)150 4207 y(in)d(the)h(list.)150 4403 |
8016 | y Fj(3.2.4)63 b(Comp)s(ound)42 b(Commands)150 4550 y | |
c302751c CR |
8017 | Ft(Comp)s(ound)32 b(commands)j(are)g(the)g(shell)g(programming)f |
8018 | (constructs.)54 b(Eac)m(h)35 b(construct)g(b)s(egins)f(with)150 | |
74d0116b | 8019 | 4659 y(a)k(reserv)m(ed)f(w)m(ord)h(or)f(con)m(trol)i(op)s(erator)f(and) |
c302751c | 8020 | f(is)g(terminated)h(b)m(y)f(a)h(corresp)s(onding)f(reserv)m(ed)g(w)m |
74d0116b | 8021 | (ord)150 4769 y(or)44 b(op)s(erator.)81 b(An)m(y)44 b(redirections)g |
9f178efb | 8022 | (\(see)h(Section)g(3.6)g([Redirections],)j(page)d(31\))g(asso)s(ciated) |
74d0116b | 8023 | g(with)150 4878 y(a)g(comp)s(ound)e(command)i(apply)f(to)h(all)h |
c302751c | 8024 | (commands)e(within)g(that)h(comp)s(ound)e(command)i(unless)150 |
74d0116b CR |
8025 | 4988 y(explicitly)32 b(o)m(v)m(erridden.)275 5121 y(In)20 |
8026 | b(most)h(cases)g(a)g(list)h(of)f(commands)f(in)g(a)h(comp)s(ound)f | |
8027 | (command's)g(description)h(ma)m(y)g(b)s(e)f(separated)150 | |
8028 | 5230 y(from)30 b(the)h(rest)g(of)g(the)g(command)g(b)m(y)f(one)h(or)g | |
8029 | (more)g(newlines,)g(and)f(ma)m(y)i(b)s(e)e(follo)m(w)m(ed)i(b)m(y)f(a)g | |
8030 | (newline)150 5340 y(in)f(place)h(of)g(a)g(semicolon.)p | |
8031 | eop end | |
5e13499c | 8032 | %%Page: 10 16 |
37c41ab1 | 8033 | TeXDict begin 10 15 bop 150 -116 a Ft(10)2572 b(Bash)31 |
74d0116b CR |
8034 | b(Reference)g(Man)m(ual)275 299 y(Bash)45 b(pro)m(vides)h(lo)s(oping)g |
8035 | (constructs,)j(conditional)e(commands,)j(and)44 b(mec)m(hanisms)i(to)g | |
8036 | (group)150 408 y(commands)30 b(and)g(execute)i(them)e(as)g(a)h(unit.) | |
8037 | 150 609 y Fj(3.2.4.1)63 b(Lo)s(oping)43 b(Constructs)150 | |
8038 | 756 y Ft(Bash)31 b(supp)s(orts)d(the)j(follo)m(wing)g(lo)s(oping)g | |
8039 | (constructs.)275 891 y(Note)k(that)f(wherev)m(er)g(a)g(`)p | |
220537f2 | 8040 | Fs(;)p Ft(')g(app)s(ears)f(in)h(the)g(description)g(of)g(a)g(command's) |
74d0116b CR |
8041 | g(syn)m(tax,)i(it)e(ma)m(y)h(b)s(e)150 1001 y(replaced)c(with)f(one)h |
8042 | (or)f(more)g(newlines.)150 1162 y Fs(until)240 b Ft(The)30 | |
220537f2 | 8043 | b(syn)m(tax)h(of)f(the)h Fs(until)e Ft(command)h(is:)870 |
74d0116b CR |
8044 | 1297 y Fs(until)46 b Fi(test-commands)11 b Fs(;)44 b(do)j |
8045 | Fi(consequent-commands)11 b Fs(;)42 b(done)630 1432 y | |
220537f2 CR |
8046 | Ft(Execute)g Fq(consequen)m(t-commands)k Ft(as)41 b(long)h(as)f |
8047 | Fq(test-commands)46 b Ft(has)41 b(an)g(exit)h(status)630 | |
74d0116b | 8048 | 1542 y(whic)m(h)c(is)h(not)g(zero.)67 b(The)38 b(return)g(status)h(is)f |
220537f2 | 8049 | (the)h(exit)h(status)f(of)g(the)g(last)g(command)630 |
74d0116b | 8050 | 1651 y(executed)31 b(in)f Fq(consequen)m(t-commands)t |
220537f2 | 8051 | Ft(,)h(or)g(zero)g(if)f(none)h(w)m(as)f(executed.)150 |
74d0116b CR |
8052 | 1812 y Fs(while)240 b Ft(The)30 b(syn)m(tax)h(of)f(the)h |
8053 | Fs(while)e Ft(command)h(is:)870 1947 y Fs(while)46 b | |
220537f2 | 8054 | Fi(test-commands)11 b Fs(;)44 b(do)j Fi(consequent-commands)11 |
74d0116b | 8055 | b Fs(;)42 b(done)630 2082 y Ft(Execute)g Fq(consequen)m(t-commands)k |
220537f2 | 8056 | Ft(as)41 b(long)h(as)f Fq(test-commands)46 b Ft(has)41 |
74d0116b | 8057 | b(an)g(exit)h(status)630 2192 y(of)34 b(zero.)53 b(The)34 |
220537f2 | 8058 | b(return)f(status)h(is)h(the)f(exit)h(status)g(of)f(the)g(last)h |
74d0116b | 8059 | (command)f(executed)h(in)630 2301 y Fq(consequen)m(t-commands)t |
37c41ab1 | 8060 | Ft(,)c(or)g(zero)g(if)f(none)g(w)m(as)h(executed.)150 |
74d0116b CR |
8061 | 2462 y Fs(for)336 b Ft(The)30 b(syn)m(tax)h(of)f(the)h |
8062 | Fs(for)e Ft(command)i(is:)870 2597 y Fs(for)47 b Fi(name)57 | |
4a8bb13f | 8063 | b Fs([)48 b([in)e([)p Fi(words)57 b Fs(...)o(])48 b(])f(;)h(])f(do)g |
74d0116b | 8064 | Fi(commands)11 b Fs(;)45 b(done)630 2732 y Ft(Expand)31 |
4a8bb13f CR |
8065 | b Fq(w)m(ords)t Ft(,)i(and)e(execute)j Fq(commands)i |
8066 | Ft(once)d(for)f(eac)m(h)i(mem)m(b)s(er)e(in)g(the)g(resultan)m(t)630 | |
74d0116b | 8067 | 2841 y(list,)d(with)f Fq(name)33 b Ft(b)s(ound)26 b(to)j(the)f(curren)m |
4a8bb13f | 8068 | (t)g(mem)m(b)s(er.)40 b(If)27 b(`)p Fs(in)j Fi(words)11 |
74d0116b | 8069 | b Ft(')27 b(is)h(not)g(presen)m(t,)h(the)630 2951 y Fs(for)g |
4a8bb13f | 8070 | Ft(command)g(executes)i(the)e Fq(commands)k Ft(once)d(for)f(eac)m(h)i |
74d0116b | 8071 | (p)s(ositional)f(parameter)g(that)630 3060 y(is)d(set,)h(as)f(if)g(`)p |
4a8bb13f | 8072 | Fs(in)j("$@")p Ft(')c(had)g(b)s(een)g(sp)s(eci\014ed)g(\(see)i(Section) |
45c0f7f8 | 8073 | f(3.4.2)i([Sp)s(ecial)e(P)m(arameters],)630 3170 y(page)c(19\).)39 |
4a8bb13f | 8074 | b(The)21 b(return)g(status)h(is)g(the)g(exit)h(status)f(of)g(the)g |
74d0116b | 8075 | (last)g(command)g(that)g(executes.)630 3280 y(If)37 b(there)h(are)g(no) |
4a8bb13f | 8076 | g(items)g(in)g(the)g(expansion)g(of)f Fq(w)m(ords)t Ft(,)j(no)d |
74d0116b CR |
8077 | (commands)h(are)g(executed,)630 3389 y(and)30 b(the)g(return)g(status)g |
8078 | (is)h(zero.)630 3524 y(An)f(alternate)i(form)e(of)h(the)f | |
8079 | Fs(for)g Ft(command)g(is)g(also)h(supp)s(orted:)870 3659 | |
c302751c CR |
8080 | y Fs(for)47 b(\(\()g Fi(expr1)57 b Fs(;)47 b Fi(expr2)57 |
8081 | b Fs(;)48 b Fi(expr3)57 b Fs(\)\))47 b(;)g(do)g Fi(commands)57 | |
74d0116b | 8082 | b Fs(;)47 b(done)630 3794 y Ft(First,)38 b(the)f(arithmetic)h |
c302751c | 8083 | (expression)e Fq(expr1)43 b Ft(is)36 b(ev)-5 b(aluated)38 |
74d0116b | 8084 | b(according)f(to)g(the)g(rules)f(de-)630 3904 y(scrib)s(ed)41 |
c302751c | 8085 | b(b)s(elo)m(w)h(\(see)h(Section)g(6.5)g([Shell)g(Arithmetic],)j(page)d |
9f178efb | 8086 | (86\).)77 b(The)42 b(arithmetic)630 4014 y(expression)33 |
c302751c CR |
8087 | b Fq(expr2)41 b Ft(is)34 b(then)f(ev)-5 b(aluated)35 |
8088 | b(rep)s(eatedly)f(un)m(til)g(it)g(ev)-5 b(aluates)35 | |
74d0116b | 8089 | b(to)g(zero.)51 b(Eac)m(h)630 4123 y(time)23 b Fq(expr2)30 |
c302751c CR |
8090 | b Ft(ev)-5 b(aluates)25 b(to)e(a)g(non-zero)h(v)-5 b(alue,)25 |
8091 | b Fq(commands)h Ft(are)d(executed)g(and)g(the)g(arith-)630 | |
74d0116b | 8092 | 4233 y(metic)29 b(expression)f Fq(expr3)36 b Ft(is)28 |
37c41ab1 | 8093 | b(ev)-5 b(aluated.)41 b(If)28 b(an)m(y)h(expression)f(is)g(omitted,)i |
74d0116b | 8094 | (it)f(b)s(eha)m(v)m(es)g(as)630 4342 y(if)i(it)h(ev)-5 |
37c41ab1 CR |
8095 | b(aluates)32 b(to)g(1.)44 b(The)30 b(return)g(v)-5 b(alue)32 |
8096 | b(is)f(the)g(exit)h(status)g(of)f(the)g(last)h(command)f(in)630 | |
74d0116b | 8097 | 4452 y Fq(commands)j Ft(that)d(is)f(executed,)i(or)e(false)h(if)f(an)m |
9ec5ed66 | 8098 | (y)h(of)g(the)f(expressions)g(is)h(in)m(v)-5 b(alid.)275 |
74d0116b | 8099 | 4613 y(The)26 b Fs(break)g Ft(and)h Fs(continue)e Ft(builtins)i(\(see)h |
9f178efb | 8100 | (Section)h(4.1)f([Bourne)g(Shell)f(Builtins],)i(page)f(41\))g(ma)m(y) |
74d0116b CR |
8101 | 150 4723 y(b)s(e)i(used)f(to)i(con)m(trol)h(lo)s(op)f(execution.)150 |
8102 | 4923 y Fj(3.2.4.2)63 b(Conditional)42 b(Constructs)150 | |
8103 | 5095 y Fs(if)384 b Ft(The)30 b(syn)m(tax)h(of)f(the)h | |
8104 | Fs(if)f Ft(command)g(is:)870 5230 y Fs(if)47 b Fi(test-commands)11 | |
8105 | b Fs(;)44 b(then)965 5340 y Fi(consequent-commands)11 | |
8106 | b Fs(;)p eop end | |
220537f2 CR |
8107 | %%Page: 11 17 |
8108 | TeXDict begin 11 16 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
8109 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(11)870 299 | |
74d0116b CR |
8110 | y Fs([elif)46 b Fi(more-test-commands)11 b Fs(;)42 b(then)965 |
8111 | 408 y Fi(more-consequents)11 b Fs(;])870 518 y([else)46 | |
8112 | b Fi(alternate-consequents)11 b Fs(;])870 628 y(fi)630 | |
9f178efb | 8113 | 757 y Ft(The)53 b Fq(test-commands)58 b Ft(list)c(is)g(executed,)60 |
74d0116b | 8114 | b(and)53 b(if)g(its)h(return)e(status)i(is)f(zero,)61 |
9f178efb | 8115 | b(the)630 867 y Fq(consequen)m(t-commands)44 b Ft(list)d(is)f |
220537f2 | 8116 | (executed.)70 b(If)40 b Fq(test-commands)k Ft(returns)39 |
9f178efb | 8117 | b(a)h(non-zero)630 976 y(status,)45 b(eac)m(h)e Fs(elif)d |
220537f2 | 8118 | Ft(list)i(is)g(executed)h(in)e(turn,)j(and)d(if)g(its)h(exit)h(status)f |
9f178efb | 8119 | (is)f(zero,)46 b(the)630 1086 y(corresp)s(onding)37 b |
220537f2 | 8120 | Fq(more-consequen)m(ts)42 b Ft(is)c(executed)g(and)f(the)h(command)g |
9f178efb | 8121 | (completes.)63 b(If)630 1196 y(`)p Fs(else)29 b Fi |
ed35cb4a | 8122 | (alternate-consequents)11 b Ft(')23 b(is)30 b(presen)m(t,)f(and)g(the)g |
9f178efb | 8123 | (\014nal)g(command)f(in)h(the)g(\014nal)630 1305 y Fs(if)44 |
ed35cb4a | 8124 | b Ft(or)g Fs(elif)f Ft(clause)i(has)f(a)h(non-zero)g(exit)g(status,)j |
9f178efb | 8125 | (then)c Fq(alternate-consequen)m(ts)51 b Ft(is)630 1415 |
ed35cb4a | 8126 | y(executed.)k(The)34 b(return)g(status)h(is)f(the)h(exit)h(status)f(of) |
9f178efb CR |
8127 | g(the)g(last)g(command)g(executed,)630 1524 y(or)30 b(zero)i(if)e(no)g |
8128 | (condition)h(tested)g(true.)150 1674 y Fs(case)288 b | |
ed35cb4a | 8129 | Ft(The)30 b(syn)m(tax)h(of)f(the)h Fs(case)e Ft(command)h(is:)870 |
9f178efb | 8130 | 1803 y Fs(case)47 b Fi(word)57 b Fs(in)47 b([)g([\(])g |
c302751c | 8131 | Fi(pattern)57 b Fs([|)47 b Fi(pattern)11 b Fs(]...)l(\))48 |
9f178efb | 8132 | b Fi(command-list)55 b Fs(;;]...)46 b(esac)630 1933 y(case)20 |
ed35cb4a CR |
8133 | b Ft(will)i(selectiv)m(ely)j(execute)e(the)e Fq(command-list)k |
8134 | Ft(corresp)s(onding)20 b(to)i(the)g(\014rst)f Fq(pattern)630 | |
9f178efb | 8135 | 2042 y Ft(that)42 b(matc)m(hes)g Fq(w)m(ord)t Ft(.)71 |
c302751c | 8136 | b(If)41 b(the)g(shell)g(option)g Fs(nocasematch)d Ft(\(see)k(the)f |
9f178efb CR |
8137 | (description)g(of)630 2152 y Fs(shopt)34 b Ft(in)h(Section)h(4.3.2)h |
8138 | ([The)e(Shopt)f(Builtin],)k(page)e(62\))g(is)g(enabled,)g(the)g(matc)m | |
8139 | (h)g(is)630 2262 y(p)s(erformed)29 b(without)i(regard)g(to)g(the)g | |
220537f2 | 8140 | (case)h(of)f(alphab)s(etic)g(c)m(haracters.)44 b(The)30 |
9f178efb | 8141 | b(`)p Fs(|)p Ft(')h(is)g(used)630 2371 y(to)e(separate)g(m)m(ultiple)g |
220537f2 | 8142 | (patterns,)g(and)e(the)i(`)p Fs(\))p Ft(')f(op)s(erator)g(terminates)h |
9f178efb | 8143 | (a)g(pattern)f(list.)41 b(A)630 2481 y(list)31 b(of)g(patterns)f(and)g |
220537f2 | 8144 | (an)g(asso)s(ciated)i(command-list)f(is)f(kno)m(wn)g(as)h(a)g |
9f178efb | 8145 | Fq(clause)5 b Ft(.)630 2610 y(Eac)m(h)42 b(clause)g(m)m(ust)f(b)s(e)g |
220537f2 CR |
8146 | (terminated)h(with)e(`)p Fs(;;)p Ft(',)45 b(`)p Fs(;&)p |
8147 | Ft(',)f(or)d(`)p Fs(;;&)p Ft('.)73 b(The)41 b Fq(w)m(ord)j | |
9f178efb | 8148 | Ft(under-)630 2720 y(go)s(es)35 b(tilde)f(expansion,)h(parameter)g |
220537f2 | 8149 | (expansion,)g(command)f(substitution,)h(arithmetic)630 |
9f178efb | 8150 | 2829 y(expansion,)47 b(and)d(quote)g(remo)m(v)-5 b(al)45 |
220537f2 | 8151 | b(b)s(efore)f(matc)m(hing)h(is)f(attempted.)82 b(Eac)m(h)45 |
9f178efb | 8152 | b Fq(pattern)630 2939 y Ft(undergo)s(es)38 b(tilde)h(expansion,)i |
220537f2 | 8153 | (parameter)e(expansion,)i(command)d(substitution,)j(and)630 |
9f178efb | 8154 | 3049 y(arithmetic)32 b(expansion.)630 3178 y(There)e(ma)m(y)g(b)s(e)f |
220537f2 | 8155 | (an)h(arbitrary)g(n)m(um)m(b)s(er)f(of)h Fs(case)f Ft(clauses,)i(eac)m |
9f178efb | 8156 | (h)g(terminated)g(b)m(y)e(a)i(`)p Fs(;;)p Ft(',)630 3288 |
220537f2 CR |
8157 | y(`)p Fs(;&)p Ft(',)c(or)e(`)p Fs(;;&)p Ft('.)39 b(The)25 |
8158 | b(\014rst)g(pattern)h(that)g(matc)m(hes)h(determines)e(the)h | |
9f178efb CR |
8159 | (command-list)g(that)630 3397 y(is)35 b(executed.)55 |
8160 | b(It's)35 b(a)g(common)g(idiom)g(to)g(use)g(`)p Fs(*)p | |
8161 | Ft(')g(as)g(the)g(\014nal)f(pattern)h(to)h(de\014ne)e(the)630 | |
8162 | 3507 y(default)d(case,)g(since)g(that)g(pattern)f(will)h(alw)m(a)m(ys)h | |
8163 | (matc)m(h.)630 3636 y(Here)j(is)g(an)g(example)h(using)e | |
8164 | Fs(case)g Ft(in)g(a)h(script)g(that)h(could)f(b)s(e)f(used)g(to)h | |
8165 | (describ)s(e)g(one)630 3746 y(in)m(teresting)d(feature)f(of)f(an)g | |
8166 | (animal:)870 3875 y Fs(echo)47 b(-n)g("Enter)f(the)h(name)f(of)i(an)f | |
8167 | (animal:)f(")870 3985 y(read)h(ANIMAL)870 4095 y(echo)g(-n)g("The)f | |
8168 | ($ANIMAL)g(has)h(")870 4204 y(case)g($ANIMAL)e(in)965 | |
8169 | 4314 y(horse)i(|)g(dog)g(|)h(cat\))e(echo)h(-n)g("four";;)965 | |
8170 | 4423 y(man)g(|)h(kangaroo)d(\))j(echo)e(-n)i("two";;)965 | |
8171 | 4533 y(*\))g(echo)e(-n)h("an)g(unknown)f(number)g(of";;)870 | |
8172 | 4643 y(esac)870 4752 y(echo)h(")g(legs.")630 4902 y Ft(If)25 | |
8173 | b(the)h(`)p Fs(;;)p Ft(')g(op)s(erator)g(is)g(used,)g(no)g(subsequen)m | |
8174 | (t)f(matc)m(hes)i(are)f(attempted)h(after)g(the)f(\014rst)630 | |
8175 | 5011 y(pattern)g(matc)m(h.)40 b(Using)26 b(`)p Fs(;&)p | |
8176 | Ft(')f(in)h(place)g(of)g(`)p Fs(;;)p Ft(')g(causes)g(execution)h(to)f | |
8177 | (con)m(tin)m(ue)h(with)f(the)630 5121 y Fq(command-list)39 | |
8178 | b Ft(asso)s(ciated)f(with)e(the)g(next)g(clause,)j(if)d(an)m(y)-8 | |
8179 | b(.)59 b(Using)37 b(`)p Fs(;;&)p Ft(')f(in)g(place)h(of)630 | |
8180 | 5230 y(`)p Fs(;;)p Ft(')30 b(causes)g(the)g(shell)g(to)g(test)h(the)f | |
8181 | (patterns)g(in)f(the)h(next)g(clause,)h(if)e(an)m(y)-8 | |
74d0116b CR |
8182 | b(,)31 b(and)f(execute)630 5340 y(an)m(y)h(asso)s(ciated)h |
8183 | Fq(command-list)h Ft(on)d(a)h(successful)f(matc)m(h.)p | |
220537f2 CR |
8184 | eop end |
8185 | %%Page: 12 18 | |
8186 | TeXDict begin 12 17 bop 150 -116 a Ft(12)2572 b(Bash)31 | |
74d0116b CR |
8187 | b(Reference)g(Man)m(ual)630 299 y(The)26 b(return)f(status)h(is)g(zero) |
8188 | h(if)f(no)g Fq(pattern)g Ft(is)g(matc)m(hed.)40 b(Otherwise,)27 | |
8189 | b(the)g(return)e(status)630 408 y(is)30 b(the)h(exit)g(status)g(of)f | |
8190 | (the)h Fq(command-list)i Ft(executed.)150 564 y Fs(select)630 | |
8191 | 697 y Ft(The)g Fs(select)f Ft(construct)i(allo)m(ws)h(the)f(easy)g | |
8192 | (generation)h(of)e(men)m(us.)50 b(It)34 b(has)f(almost)i(the)630 | |
8193 | 806 y(same)c(syn)m(tax)g(as)f(the)h Fs(for)e Ft(command:)870 | |
8194 | 939 y Fs(select)46 b Fi(name)57 b Fs([in)47 b Fi(words)57 | |
8195 | b Fs(...)o(];)47 b(do)h Fi(commands)11 b Fs(;)44 b(done)630 | |
8196 | 1072 y Ft(The)d(list)i(of)e(w)m(ords)h(follo)m(wing)h | |
8197 | Fs(in)e Ft(is)h(expanded,)i(generating)f(a)f(list)g(of)g(items.)75 | |
8198 | b(The)630 1181 y(set)41 b(of)f(expanded)f(w)m(ords)g(is)i(prin)m(ted)e | |
8199 | (on)h(the)g(standard)f(error)h(output)g(stream,)j(eac)m(h)630 | |
8200 | 1291 y(preceded)30 b(b)m(y)g(a)h(n)m(um)m(b)s(er.)40 | |
c302751c | 8201 | b(If)29 b(the)i(`)p Fs(in)f Fi(words)11 b Ft(')29 b(is)h(omitted,)i |
74d0116b | 8202 | (the)e(p)s(ositional)i(parameters)630 1401 y(are)22 b(prin)m(ted,)h(as) |
d3ad40de CR |
8203 | f(if)f(`)p Fs(in)30 b("$@")p Ft(')21 b(had)g(b)s(een)f(sp)s(eci\014ed.) |
8204 | 37 b(The)21 b Fs(PS3)g Ft(prompt)g(is)g(then)g(displa)m(y)m(ed)630 | |
74d0116b | 8205 | 1510 y(and)38 b(a)h(line)g(is)f(read)h(from)f(the)h(standard)e(input.) |
37c41ab1 | 8206 | 65 b(If)38 b(the)h(line)g(consists)g(of)f(a)h(n)m(um)m(b)s(er)630 |
74d0116b | 8207 | 1620 y(corresp)s(onding)33 b(to)i(one)f(of)g(the)g(displa)m(y)m(ed)h(w) |
37c41ab1 | 8208 | m(ords,)f(then)g(the)g(v)-5 b(alue)34 b(of)h Fq(name)k |
74d0116b | 8209 | Ft(is)34 b(set)g(to)630 1729 y(that)g(w)m(ord.)49 b(If)32 |
37c41ab1 | 8210 | b(the)i(line)f(is)h(empt)m(y)-8 b(,)35 b(the)e(w)m(ords)g(and)f(prompt) |
74d0116b | 8211 | h(are)g(displa)m(y)m(ed)h(again.)50 b(If)630 1839 y Fs(EOF)23 |
37c41ab1 CR |
8212 | b Ft(is)g(read,)j(the)d Fs(select)f Ft(command)i(completes.)40 |
8213 | b(An)m(y)23 b(other)h(v)-5 b(alue)24 b(read)g(causes)g | |
74d0116b | 8214 | Fq(name)630 1948 y Ft(to)31 b(b)s(e)f(set)h(to)g(n)m(ull.)41 |
37c41ab1 | 8215 | b(The)29 b(line)i(read)f(is)h(sa)m(v)m(ed)g(in)f(the)h(v)-5 |
74d0116b | 8216 | b(ariable)31 b Fs(REPLY)p Ft(.)630 2081 y(The)42 b Fq(commands)j |
9d2b70f0 | 8217 | Ft(are)d(executed)h(after)g(eac)m(h)g(selection)h(un)m(til)e(a)h |
74d0116b | 8218 | Fs(break)d Ft(command)i(is)630 2191 y(executed,)32 b(at)f(whic)m(h)f(p) |
220537f2 | 8219 | s(oin)m(t)g(the)h Fs(select)d Ft(command)i(completes.)630 |
74d0116b | 8220 | 2323 y(Here)39 b(is)g(an)g(example)h(that)f(allo)m(ws)i(the)e(user)f |
220537f2 | 8221 | (to)i(pic)m(k)f(a)g(\014lename)h(from)e(the)h(curren)m(t)630 |
74d0116b CR |
8222 | 2433 y(directory)-8 b(,)32 b(and)d(displa)m(ys)i(the)f(name)h(and)f |
8223 | (index)f(of)i(the)g(\014le)f(selected.)870 2566 y Fs(select)46 | |
8224 | b(fname)g(in)i(*;)870 2675 y(do)870 2785 y(echo)f(you)g(picked)f | |
8225 | ($fname)g(\\\($REPLY\\\))870 2894 y(break;)870 3004 y(done)150 | |
8226 | 3160 y(\(\(...)o(\)\))870 3292 y(\(\()h Fi(expression)56 | |
8227 | b Fs(\)\))630 3425 y Ft(The)33 b(arithmetic)i Fq(expression)f | |
220537f2 | 8228 | Ft(is)f(ev)-5 b(aluated)35 b(according)g(to)f(the)g(rules)f(describ)s |
74d0116b | 8229 | (ed)g(b)s(elo)m(w)630 3535 y(\(see)j(Section)f(6.5)h([Shell)f |
9f178efb | 8230 | (Arithmetic],)i(page)f(86\).)55 b(If)34 b(the)h(v)-5 |
74d0116b | 8231 | b(alue)35 b(of)g(the)g(expression)g(is)630 3644 y(non-zero,)27 |
220537f2 | 8232 | b(the)f(return)e(status)i(is)g(0;)h(otherwise)f(the)g(return)e(status)i |
74d0116b CR |
8233 | (is)g(1.)39 b(This)25 b(is)g(exactly)630 3754 y(equiv)-5 |
8234 | b(alen)m(t)32 b(to)870 3886 y Fs(let)47 b(")p Fi(expression)11 | |
8235 | b Fs(")630 4019 y Ft(See)25 b(Section)h(4.2)h([Bash)e(Builtins],)i | |
9f178efb | 8236 | (page)f(48,)i(for)c(a)i(full)f(description)g(of)g(the)h |
74d0116b CR |
8237 | Fs(let)e Ft(builtin.)150 4175 y Fs([[...)o(]])870 4308 |
8238 | y([[)47 b Fi(expression)56 b Fs(]])630 4440 y Ft(Return)25 | |
37c41ab1 CR |
8239 | b(a)h(status)f(of)h(0)g(or)g(1)g(dep)s(ending)e(on)h(the)h(ev)-5 |
8240 | b(aluation)27 b(of)e(the)h(conditional)h(expres-)630 | |
74d0116b | 8241 | 4550 y(sion)j Fq(expression)p Ft(.)41 b(Expressions)29 |
37c41ab1 | 8242 | b(are)i(comp)s(osed)f(of)g(the)h(primaries)f(describ)s(ed)f(b)s(elo)m |
74d0116b | 8243 | (w)h(in)630 4659 y(Section)36 b(6.4)h([Bash)f(Conditional)g |
9f178efb | 8244 | (Expressions],)h(page)f(84.)57 b(W)-8 b(ord)36 b(splitting)h(and)e |
74d0116b | 8245 | (\014le-)630 4769 y(name)24 b(expansion)h(are)g(not)f(p)s(erformed)f |
5e13499c | 8246 | (on)h(the)h(w)m(ords)f(b)s(et)m(w)m(een)h(the)g(`)p Fs([[)p |
74d0116b | 8247 | Ft(')f(and)g(`)p Fs(]])p Ft(';)i(tilde)630 4879 y(expansion,)31 |
37c41ab1 | 8248 | b(parameter)g(and)f(v)-5 b(ariable)31 b(expansion,)g(arithmetic)g |
74d0116b | 8249 | (expansion,)g(command)630 4988 y(substitution,)40 b(pro)s(cess)f |
37c41ab1 | 8250 | (substitution,)h(and)e(quote)h(remo)m(v)-5 b(al)40 b(are)f(p)s |
74d0116b | 8251 | (erformed.)63 b(Condi-)630 5098 y(tional)32 b(op)s(erators)e(suc)m(h)g |
5e13499c | 8252 | (as)h(`)p Fs(-f)p Ft(')f(m)m(ust)g(b)s(e)g(unquoted)g(to)h(b)s(e)e |
74d0116b | 8253 | (recognized)j(as)f(primaries.)630 5230 y(When)g(used)f(with)g(`)p |
54a1fa7c CR |
8254 | Fs([[)p Ft(',)i(the)f(`)p Fs(<)p Ft(')g(and)f(`)p Fs(>)p |
8255 | Ft(')h(op)s(erators)g(sort)h(lexicographically)h(using)e(the)630 | |
74d0116b | 8256 | 5340 y(curren)m(t)f(lo)s(cale.)p eop end |
220537f2 CR |
8257 | %%Page: 13 19 |
8258 | TeXDict begin 13 18 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
8259 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(13)630 299 | |
74d0116b CR |
8260 | y(When)22 b(the)h(`)p Fs(==)p Ft(')f(and)g(`)p Fs(!=)p |
8261 | Ft(')g(op)s(erators)h(are)g(used,)g(the)g(string)f(to)i(the)e(righ)m(t) | |
8262 | h(of)g(the)g(op)s(erator)630 408 y(is)31 b(considered)g(a)h(pattern)f | |
8263 | (and)g(matc)m(hed)h(according)g(to)g(the)g(rules)f(describ)s(ed)f(b)s | |
8264 | (elo)m(w)h(in)630 518 y(Section)37 b(3.5.8.1)i([P)m(attern)e(Matc)m | |
9f178efb | 8265 | (hing],)j(page)c(29.)59 b(If)36 b(the)g(shell)g(option)h |
74d0116b CR |
8266 | Fs(nocasematch)630 628 y Ft(\(see)42 b(the)f(description)g(of)h |
8267 | Fs(shopt)d Ft(in)i(Section)h(4.3.2)h([The)e(Shopt)f(Builtin],)45 | |
9f178efb | 8268 | b(page)d(62\))630 737 y(is)e(enabled,)i(the)e(matc)m(h)h(is)e(p)s |
74d0116b CR |
8269 | (erformed)g(without)g(regard)h(to)h(the)f(case)g(of)g(alphab)s(etic)630 |
8270 | 847 y(c)m(haracters.)h(The)28 b(return)e(v)-5 b(alue)28 | |
8271 | b(is)g(0)g(if)g(the)g(string)g(matc)m(hes)h(\(`)p Fs(==)p | |
8272 | Ft('\))f(or)g(do)s(es)f(not)h(matc)m(h)630 956 y(\(`)p | |
8273 | Fs(!=)p Ft('\)the)33 b(pattern,)g(and)f(1)g(otherwise.)47 | |
8274 | b(An)m(y)32 b(part)g(of)h(the)f(pattern)g(ma)m(y)h(b)s(e)f(quoted)g(to) | |
8275 | 630 1066 y(force)f(the)g(quoted)f(p)s(ortion)g(to)h(b)s(e)f(matc)m(hed) | |
45c0f7f8 | 8276 | h(as)g(a)f(string.)630 1207 y(An)j(additional)i(binary)e(op)s(erator,)i |
74d0116b | 8277 | (`)p Fs(=~)p Ft(',)g(is)f(a)m(v)-5 b(ailable,)37 b(with)c(the)h(same)g |
45c0f7f8 | 8278 | (precedence)h(as)630 1316 y(`)p Fs(==)p Ft(')29 b(and)f(`)p |
74d0116b CR |
8279 | Fs(!=)p Ft('.)40 b(When)29 b(it)g(is)g(used,)f(the)h(string)g(to)h(the) |
8280 | e(righ)m(t)i(of)f(the)g(op)s(erator)g(is)g(consid-)630 | |
45c0f7f8 | 8281 | 1426 y(ered)34 b(an)g(extended)g(regular)g(expression)g(and)f(matc)m |
74d0116b | 8282 | (hed)i(accordingly)g(\(as)f(in)g Fk(r)-5 b(e)g(gex)11 |
45c0f7f8 | 8283 | b Ft(3\)\).)630 1536 y(The)29 b(return)f(v)-5 b(alue)30 |
d3ad40de | 8284 | b(is)g(0)g(if)f(the)h(string)g(matc)m(hes)g(the)g(pattern,)g(and)f(1)h |
45c0f7f8 | 8285 | (otherwise.)41 b(If)29 b(the)630 1645 y(regular)e(expression)g(is)h |
d3ad40de | 8286 | (syn)m(tactically)i(incorrect,)f(the)e(conditional)i(expression's)e |
45c0f7f8 | 8287 | (return)630 1755 y(v)-5 b(alue)40 b(is)g(2.)68 b(If)39 |
d3ad40de | 8288 | b(the)h(shell)f(option)h Fs(nocasematch)d Ft(\(see)j(the)g(description) |
45c0f7f8 | 8289 | g(of)f Fs(shopt)f Ft(in)630 1864 y(Section)32 b(4.3.2)g([The)f(Shopt)f |
9f178efb | 8290 | (Builtin],)i(page)g(62\))g(is)f(enabled,)g(the)g(matc)m(h)h(is)e(p)s |
45c0f7f8 | 8291 | (erformed)630 1974 y(without)36 b(regard)g(to)h(the)f(case)h(of)f |
3d4e09aa | 8292 | (alphab)s(etic)h(c)m(haracters.)59 b(An)m(y)36 b(part)g(of)h(the)f |
45c0f7f8 CR |
8293 | (pattern)630 2084 y(ma)m(y)31 b(b)s(e)f(quoted)h(to)g(force)g(the)g |
8294 | (quoted)g(p)s(ortion)f(to)h(b)s(e)f(matc)m(hed)h(as)g(a)g(string.)41 | |
8295 | b(Brac)m(k)m(et)630 2193 y(expressions)27 b(in)f(regular)i(expressions) | |
8296 | e(m)m(ust)h(b)s(e)g(treated)h(carefully)-8 b(,)29 b(since)e(normal)g | |
8297 | (quot-)630 2303 y(ing)38 b(c)m(haracters)h(lose)f(their)g(meanings)f(b) | |
8298 | s(et)m(w)m(een)h(brac)m(k)m(ets.)64 b(If)37 b(the)h(pattern)f(is)h | |
8299 | (stored)630 2412 y(in)33 b(a)i(shell)f(v)-5 b(ariable,)35 | |
8300 | b(quoting)f(the)g(v)-5 b(ariable)35 b(expansion)e(forces)i(the)f(en)m | |
8301 | (tire)g(pattern)g(to)630 2522 y(b)s(e)h(matc)m(hed)i(as)f(a)g(string.) | |
8302 | 56 b(Substrings)34 b(matc)m(hed)j(b)m(y)f(paren)m(thesized)g(sub)s | |
8303 | (expressions)630 2632 y(within)k(the)g(regular)g(expression)g(are)g(sa) | |
8304 | m(v)m(ed)i(in)d(the)i(arra)m(y)f(v)-5 b(ariable)41 b | |
8305 | Fs(BASH_REMATCH)p Ft(.)630 2741 y(The)30 b(elemen)m(t)i(of)e | |
8306 | Fs(BASH_REMATCH)d Ft(with)j(index)g(0)h(is)g(the)f(p)s(ortion)g(of)h | |
8307 | (the)f(string)h(matc)m(h-)630 2851 y(ing)j(the)g(en)m(tire)g(regular)g | |
8308 | (expression.)50 b(The)34 b(elemen)m(t)h(of)f Fs(BASH_REMATCH)c | |
8309 | Ft(with)j(index)g Fq(n)630 2960 y Ft(is)d(the)h(p)s(ortion)f(of)g(the)h | |
8310 | (string)f(matc)m(hing)i(the)e Fq(n)p Ft(th)g(paren)m(thesized)h(sub)s | |
8311 | (expression.)630 3101 y(F)-8 b(or)28 b(example,)h(the)e(follo)m(wing)i | |
8312 | (will)e(matc)m(h)h(a)g(line)f(\(stored)h(in)e(the)i(shell)f(v)-5 | |
8313 | b(ariable)28 b Fq(line)5 b Ft(\))28 b(if)630 3211 y(there)22 | |
8314 | b(is)g(a)h(sequence)f(of)h(c)m(haracters)g(in)f(the)g(v)-5 | |
8315 | b(alue)23 b(consisting)g(of)f(an)m(y)h(n)m(um)m(b)s(er,)f(including)630 | |
8316 | 3320 y(zero,)31 b(of)g(space)g(c)m(haracters,)h(zero)f(or)g(one)f | |
8317 | (instances)h(of)g(`)p Fs(a)p Ft(',)f(then)g(a)h(`)p Fs(b)p | |
8318 | Ft(':)870 3461 y Fs([[)47 b($line)g(=~)g([[:space:]]*\(a\)?b)c(]])630 | |
8319 | 3602 y Ft(That)24 b(means)g(v)-5 b(alues)24 b(lik)m(e)h(`)p | |
8320 | Fs(aab)p Ft(')e(and)h(`)30 b Fs(aaaaaab)p Ft(')22 b(will)i(matc)m(h,)j | |
8321 | (as)d(will)g(a)g(line)g(con)m(taining)630 3712 y(a)31 | |
8322 | b(`)p Fs(b)p Ft(')f(an)m(ywhere)h(in)f(its)g(v)-5 b(alue.)630 | |
8323 | 3853 y(Storing)31 b(the)g(regular)g(expression)f(in)h(a)g(shell)g(v)-5 | |
8324 | b(ariable)31 b(is)g(often)g(a)g(useful)f(w)m(a)m(y)i(to)f(a)m(v)m(oid) | |
8325 | 630 3962 y(problems)f(with)g(quoting)h(c)m(haracters)i(that)e(are)g(sp) | |
8326 | s(ecial)g(to)h(the)f(shell.)41 b(It)31 b(is)g(sometimes)630 | |
8327 | 4072 y(di\016cult)24 b(to)h(sp)s(ecify)f(a)h(regular)g(expression)f | |
8328 | (literally)i(without)f(using)e(quotes,)k(or)d(to)h(k)m(eep)630 | |
8329 | 4181 y(trac)m(k)33 b(of)g(the)f(quoting)g(used)g(b)m(y)g(regular)g | |
8330 | (expressions)g(while)g(pa)m(ying)h(atten)m(tion)h(to)f(the)630 | |
8331 | 4291 y(shell's)25 b(quote)g(remo)m(v)-5 b(al.)40 b(Using)25 | |
8332 | b(a)g(shell)g(v)-5 b(ariable)26 b(to)f(store)g(the)g(pattern)g | |
8333 | (decreases)g(these)630 4401 y(problems.)40 b(F)-8 b(or)31 | |
8334 | b(example,)g(the)g(follo)m(wing)h(is)e(equiv)-5 b(alen)m(t)32 | |
8335 | b(to)f(the)g(ab)s(o)m(v)m(e:)870 4542 y Fs(pattern='[[:space:]]*\(a\))o | |
8336 | (?b')870 4651 y([[)47 b($line)g(=~)g($pattern)e(]])630 | |
8337 | 4792 y Ft(If)28 b(y)m(ou)h(w)m(an)m(t)g(to)g(matc)m(h)h(a)e(c)m | |
8338 | (haracter)j(that's)e(sp)s(ecial)g(to)g(the)g(regular)f(expression)g | |
8339 | (gram-)630 4902 y(mar,)g(it)g(has)g(to)g(b)s(e)f(quoted)h(to)g(remo)m | |
8340 | (v)m(e)h(its)f(sp)s(ecial)g(meaning.)40 b(This)27 b(means)g(that)h(in)g | |
8341 | (the)630 5011 y(pattern)e(`)p Fs(xxx.txt)p Ft(',)g(the)h(`)p | |
8342 | Fs(.)p Ft(')f(matc)m(hes)i(an)m(y)e(c)m(haracter)i(in)e(the)h(string)f | |
8343 | (\(its)h(usual)f(regular)630 5121 y(expression)g(meaning\),)i(but)e(in) | |
8344 | g(the)h(pattern)f(`)p Fs("xxx.txt")p Ft(')f(it)i(can)g(only)f(matc)m(h) | |
8345 | i(a)e(literal)630 5230 y(`)p Fs(.)p Ft('.)56 b(Shell)35 | |
8346 | b(programmers)f(should)h(tak)m(e)i(sp)s(ecial)e(care)i(with)e(bac)m | |
8347 | (kslashes,)i(since)f(bac)m(k-)630 5340 y(slashes)27 b(are)g(used)f(b)s | |
8348 | (oth)g(b)m(y)h(the)f(shell)h(and)f(regular)h(expressions)g(to)g(remo)m | |
8349 | (v)m(e)h(the)f(sp)s(ecial)p eop end | |
8350 | %%Page: 14 20 | |
8351 | TeXDict begin 14 19 bop 150 -116 a Ft(14)2572 b(Bash)31 | |
8352 | b(Reference)g(Man)m(ual)630 299 y(meaning)d(from)f(the)h(follo)m(wing)i | |
8353 | (c)m(haracter.)41 b(The)27 b(follo)m(wing)j(t)m(w)m(o)f(sets)f(of)g | |
8354 | (commands)g(are)630 408 y Fk(not)40 b Ft(equiv)-5 b(alen)m(t:)870 | |
8355 | 544 y Fs(pattern='\\.')870 764 y([[)47 b(.)h(=~)f($pattern)e(]])870 | |
8356 | 873 y([[)i(.)h(=~)f(\\.)g(]])870 1092 y([[)g(.)h(=~)f("$pattern")e(]]) | |
8357 | 870 1202 y([[)i(.)h(=~)f('\\.')f(]])630 1338 y Ft(The)28 | |
8358 | b(\014rst)h(t)m(w)m(o)h(matc)m(hes)g(will)f(succeed,)h(but)f(the)g | |
8359 | (second)g(t)m(w)m(o)h(will)f(not,)h(b)s(ecause)f(in)g(the)630 | |
8360 | 1447 y(second)39 b(t)m(w)m(o)i(the)e(bac)m(kslash)h(will)f(b)s(e)g | |
8361 | (part)g(of)g(the)h(pattern)f(to)h(b)s(e)e(matc)m(hed.)68 | |
8362 | b(In)39 b(the)630 1557 y(\014rst)31 b(t)m(w)m(o)h(examples,)h(the)e | |
8363 | (bac)m(kslash)h(remo)m(v)m(es)h(the)f(sp)s(ecial)g(meaning)f(from)g(`)p | |
8364 | Fs(.)p Ft(',)h(so)g(the)630 1667 y(literal)f(`)p Fs(.)p | |
8365 | Ft(')e(matc)m(hes.)42 b(If)28 b(the)i(string)f(in)g(the)g(\014rst)g | |
8366 | (examples)g(w)m(ere)h(an)m(ything)g(other)f(than)630 | |
8367 | 1776 y(`)p Fs(.)p Ft(',)g(sa)m(y)g(`)p Fs(a)p Ft(',)g(the)f(pattern)g | |
8368 | (w)m(ould)g(not)h(matc)m(h,)h(b)s(ecause)e(the)g(quoted)g(`)p | |
8369 | Fs(.)p Ft(')h(in)e(the)i(pattern)630 1886 y(loses)i(its)g(sp)s(ecial)g | |
8370 | (meaning)f(of)h(matc)m(hing)g(an)m(y)g(single)g(c)m(haracter.)630 | |
8371 | 2022 y(Expressions)23 b(ma)m(y)h(b)s(e)e(com)m(bined)i(using)f(the)h | |
8372 | (follo)m(wing)h(op)s(erators,)g(listed)f(in)f(decreasing)630 | |
8373 | 2131 y(order)30 b(of)g(precedence:)630 2293 y Fs(\()g | |
8374 | Fi(expression)38 b Fs(\))1110 2403 y Ft(Returns)30 b(the)h(v)-5 | |
8375 | b(alue)31 b(of)g Fq(expression)p Ft(.)42 b(This)30 b(ma)m(y)i(b)s(e)e | |
8376 | (used)g(to)i(o)m(v)m(erride)g(the)1110 2513 y(normal)e(precedence)h(of) | |
8377 | g(op)s(erators.)630 2675 y Fs(!)f Fi(expression)1110 | |
8378 | 2784 y Ft(T)-8 b(rue)30 b(if)g Fq(expression)g Ft(is)h(false.)630 | |
8379 | 2947 y Fi(expression1)38 b Fs(&&)30 b Fi(expression2)1110 | |
8380 | 3056 y Ft(T)-8 b(rue)30 b(if)g(b)s(oth)g Fq(expression1)38 | |
8381 | b Ft(and)29 b Fq(expression2)38 b Ft(are)31 b(true.)630 | |
8382 | 3218 y Fi(expression1)38 b Fs(||)30 b Fi(expression2)1110 | |
8383 | 3328 y Ft(T)-8 b(rue)30 b(if)g(either)h Fq(expression1)38 | |
8384 | b Ft(or)30 b Fq(expression2)38 b Ft(is)30 b(true.)630 | |
8385 | 3490 y(The)25 b Fs(&&)g Ft(and)g Fs(||)f Ft(op)s(erators)i(do)f(not)h | |
8386 | (ev)-5 b(aluate)27 b Fq(expression2)33 b Ft(if)26 b(the)f(v)-5 | |
8387 | b(alue)26 b(of)g Fq(expression1)630 3600 y Ft(is)k(su\016cien)m(t)h(to) | |
8388 | g(determine)g(the)f(return)g(v)-5 b(alue)31 b(of)f(the)h(en)m(tire)g | |
8389 | (conditional)h(expression.)150 3802 y Fj(3.2.4.3)63 b(Grouping)43 | |
8390 | b(Commands)150 3949 y Ft(Bash)30 b(pro)m(vides)g(t)m(w)m(o)h(w)m(a)m | |
122f603c | 8391 | (ys)f(to)h(group)e(a)h(list)g(of)g(commands)f(to)i(b)s(e)e(executed)h |
45c0f7f8 | 8392 | (as)g(a)h(unit.)40 b(When)29 b(com-)150 4058 y(mands)h(are)i(group)s |
122f603c | 8393 | (ed,)f(redirections)h(ma)m(y)g(b)s(e)e(applied)i(to)g(the)f(en)m(tire)h |
45c0f7f8 | 8394 | (command)g(list.)44 b(F)-8 b(or)32 b(example,)150 4168 |
122f603c | 8395 | y(the)f(output)f(of)g(all)h(the)g(commands)f(in)g(the)h(list)g(ma)m(y)g |
45c0f7f8 CR |
8396 | (b)s(e)e(redirected)i(to)g(a)g(single)g(stream.)150 4332 |
8397 | y Fs(\(\))870 4468 y(\()47 b Fi(list)58 b Fs(\))630 4603 | |
8398 | y Ft(Placing)30 b(a)f(list)g(of)g(commands)f(b)s(et)m(w)m(een)i(paren)m | |
8399 | (theses)e(causes)i(a)f(subshell)e(en)m(vironmen)m(t)630 | |
8400 | 4713 y(to)k(b)s(e)e(created)j(\(see)f(Section)g(3.7.3)h([Command)d | |
9f178efb | 8401 | (Execution)i(En)m(vironmen)m(t],)g(page)f(36\),)630 4823 |
45c0f7f8 | 8402 | y(and)d(eac)m(h)i(of)e(the)h(commands)f(in)g Fq(list)j |
122f603c | 8403 | Ft(to)f(b)s(e)e(executed)h(in)f(that)h(subshell.)39 b(Since)28 |
45c0f7f8 | 8404 | b(the)f Fq(list)630 4932 y Ft(is)i(executed)g(in)f(a)h(subshell,)g(v)-5 |
122f603c | 8405 | b(ariable)29 b(assignmen)m(ts)g(do)g(not)g(remain)f(in)g(e\013ect)j |
45c0f7f8 CR |
8406 | (after)e(the)630 5042 y(subshell)g(completes.)150 5204 |
8407 | y Fs({})870 5340 y({)47 b Fi(list)11 b Fs(;)46 b(})p | |
8408 | eop end | |
8409 | %%Page: 15 21 | |
8410 | TeXDict begin 15 20 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
8411 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(15)630 299 | |
8412 | y(Placing)30 b(a)g(list)g(of)g(commands)f(b)s(et)m(w)m(een)h(curly)f | |
8413 | (braces)g(causes)h(the)f(list)h(to)g(b)s(e)f(executed)630 | |
8414 | 408 y(in)d(the)h(curren)m(t)g(shell)f(con)m(text.)42 | |
74d0116b | 8415 | b(No)27 b(subshell)f(is)g(created.)41 b(The)26 b(semicolon)i(\(or)f |
45c0f7f8 | 8416 | (newline\))630 518 y(follo)m(wing)32 b Fq(list)h Ft(is)d(required.)275 |
9f178efb | 8417 | 674 y(In)44 b(addition)h(to)h(the)f(creation)i(of)e(a)g(subshell,)j |
74d0116b | 8418 | (there)e(is)f(a)g(subtle)g(di\013erence)h(b)s(et)m(w)m(een)f(these)150 |
9f178efb | 8419 | 784 y(t)m(w)m(o)c(constructs)e(due)g(to)g(historical)i(reasons.)67 |
74d0116b | 8420 | b(The)39 b(braces)g(are)h Fs(reserved)28 b(words)p Ft(,)40 |
9f178efb | 8421 | b(so)g(they)f(m)m(ust)150 893 y(b)s(e)d(separated)h(from)f(the)g |
74d0116b | 8422 | Fq(list)j Ft(b)m(y)e Fs(blank)p Ft(s)e(or)h(other)h(shell)f(metac)m |
9f178efb | 8423 | (haracters.)62 b(The)36 b(paren)m(theses)h(are)150 1003 |
74d0116b CR |
8424 | y Fs(operators)p Ft(,)23 b(and)h(are)g(recognized)i(as)e(separate)i |
8425 | (tok)m(ens)f(b)m(y)f(the)g(shell)h(ev)m(en)g(if)f(they)g(are)h(not)f | |
9f178efb CR |
8426 | (separated)150 1112 y(from)30 b(the)g Fq(list)j Ft(b)m(y)e(whitespace.) |
8427 | 275 1245 y(The)e(exit)j(status)e(of)h(b)s(oth)f(of)g(these)h | |
74d0116b | 8428 | (constructs)g(is)f(the)h(exit)g(status)f(of)h Fq(list)r |
9f178efb | 8429 | Ft(.)150 1441 y Fj(3.2.5)63 b(Copro)s(cesses)150 1588 |
74d0116b CR |
8430 | y Ft(A)37 b Fs(coprocess)c Ft(is)k(a)g(shell)f(command)h(preceded)f(b)m |
8431 | (y)g(the)h Fs(coproc)d Ft(reserv)m(ed)j(w)m(ord.)59 b(A)36 | |
9f178efb | 8432 | b(copro)s(cess)h(is)150 1697 y(executed)g(async)m(hronously)g(in)f(a)h |
74d0116b | 8433 | (subshell,)g(as)g(if)g(the)f(command)h(had)f(b)s(een)f(terminated)i |
9f178efb | 8434 | (with)g(the)150 1807 y(`)p Fs(&)p Ft(')d(con)m(trol)h(op)s(erator,)g |
74d0116b | 8435 | (with)f(a)g(t)m(w)m(o-w)m(a)m(y)i(pip)s(e)d(established)h(b)s(et)m(w)m |
9f178efb CR |
8436 | (een)h(the)f(executing)h(shell)f(and)f(the)150 1916 y(copro)s(cess.)275 |
8437 | 2049 y(The)c(format)i(for)f(a)h(copro)s(cess)g(is:)390 | |
8438 | 2182 y Fs(coproc)46 b([)p Fi(NAME)11 b Fs(])46 b Fi(command)56 | |
8439 | b Fs([)p Fi(redirections)11 b Fs(])150 2315 y Ft(This)41 | |
e1e48bba CR |
8440 | b(creates)i(a)g(copro)s(cess)f(named)f Fq(NAME)5 b Ft(.)43 |
8441 | b(If)f Fq(NAME)47 b Ft(is)42 b(not)g(supplied,)i(the)e(default)g(name)g | |
9f178efb | 8442 | (is)150 2424 y Fq(COPR)m(OC)8 b Ft(.)22 b Fq(NAME)29 |
e1e48bba CR |
8443 | b Ft(m)m(ust)23 b(not)g(b)s(e)g(supplied)e(if)i Fq(command)k |
8444 | Ft(is)c(a)g(simple)g(command)g(\(see)h(Section)g(3.2.1)150 | |
9f178efb | 8445 | 2534 y([Simple)39 b(Commands],)h(page)g(8\);)k(otherwise,)e(it)d(is)g |
c302751c | 8446 | (in)m(terpreted)h(as)f(the)g(\014rst)f(w)m(ord)h(of)g(the)g(simple)150 |
9f178efb | 8447 | 2643 y(command.)275 2776 y(When)j(the)i(copro)s(cess)f(is)g(executed,) |
122f603c | 8448 | 48 b(the)43 b(shell)g(creates)i(an)e(arra)m(y)g(v)-5 |
9f178efb CR |
8449 | b(ariable)44 b(\(see)g(Section)g(6.7)150 2886 y([Arra)m(ys],)32 |
8450 | b(page)g(88\))h(named)e Fs(NAME)f Ft(in)h(the)h(con)m(text)h(of)e(the)h | |
122f603c | 8451 | (executing)g(shell.)44 b(The)31 b(standard)f(output)150 |
9f178efb | 8452 | 2995 y(of)g Fq(command)j Ft(is)d(connected)g(via)g(a)g(pip)s(e)f(to)i |
122f603c | 8453 | (a)f(\014le)g(descriptor)f(in)g(the)h(executing)h(shell,)f(and)g(that)g |
9f178efb | 8454 | (\014le)150 3105 y(descriptor)i(is)f(assigned)h(to)g |
122f603c CR |
8455 | Fs(NAME)p Ft([0].)45 b(The)31 b(standard)g(input)f(of)i |
8456 | Fq(command)j Ft(is)d(connected)h(via)f(a)g(pip)s(e)150 | |
9f178efb | 8457 | 3215 y(to)39 b(a)g(\014le)f(descriptor)g(in)g(the)g(executing)i(shell,) |
122f603c | 8458 | g(and)e(that)h(\014le)f(descriptor)g(is)g(assigned)h(to)g |
9f178efb | 8459 | Fs(NAME)p Ft([1].)150 3324 y(This)31 b(pip)s(e)g(is)h(established)g(b)s |
122f603c | 8460 | (efore)g(an)m(y)g(redirections)g(sp)s(eci\014ed)g(b)m(y)f(the)i |
9f178efb CR |
8461 | (command)e(\(see)i(Section)g(3.6)150 3434 y([Redirections],)25 |
8462 | b(page)e(31\).)39 b(The)21 b(\014le)h(descriptors)g(can)g(b)s(e)f | |
8e1a6eaa | 8463 | (utilized)i(as)f(argumen)m(ts)h(to)f(shell)g(commands)150 |
9f178efb CR |
8464 | 3543 y(and)33 b(redirections)g(using)g(standard)f(w)m(ord)h |
8465 | (expansions.)49 b(The)33 b(\014le)g(descriptors)g(are)g(not)h(a)m(v)-5 | |
8466 | b(ailable)35 b(in)150 3653 y(subshells.)275 3786 y(The)27 | |
8467 | b(pro)s(cess)h(ID)h(of)f(the)h(shell)f(spa)m(wned)g(to)h(execute)h(the) | |
8468 | e(copro)s(cess)h(is)f(a)m(v)-5 b(ailable)31 b(as)d(the)h(v)-5 | |
8469 | b(alue)29 b(of)150 3895 y(the)k(v)-5 b(ariable)33 b Fs(NAME)p | |
8470 | 850 3895 28 4 v 39 w Ft(PID.)g(The)f Fs(wait)f Ft(builtin)h(command)g | |
8471 | (ma)m(y)h(b)s(e)f(used)g(to)h(w)m(ait)h(for)e(the)h(copro)s(cess)150 | |
8472 | 4005 y(to)e(terminate.)275 4138 y(The)e(return)h(status)g(of)h(a)g | |
8473 | (copro)s(cess)f(is)h(the)f(exit)i(status)e(of)h Fq(command)t | |
8474 | Ft(.)150 4333 y Fj(3.2.6)63 b(GNU)41 b(P)m(arallel)150 | |
8475 | 4480 y Ft(GNU)36 b(P)m(arallel,)k(as)c(its)g(name)g(suggests,)i(can)e | |
220537f2 | 8476 | (b)s(e)f(used)g(to)h(build)f(and)g(run)g(commands)g(in)h(parallel.)150 |
9f178efb | 8477 | 4590 y(Y)-8 b(ou)41 b(ma)m(y)g(run)e(the)h(same)h(command)f(with)g |
220537f2 | 8478 | (di\013eren)m(t)h(argumen)m(ts,)j(whether)39 b(they)i(are)g |
9f178efb CR |
8479 | (\014lenames,)150 4699 y(usernames,)30 b(hostnames,)h(or)f(lines)h |
8480 | (read)f(from)g(\014les.)275 4832 y(F)-8 b(or)33 b(a)g(complete)h | |
45c0f7f8 | 8481 | (description,)g(refer)e(to)i(the)f(GNU)g(P)m(arallel)i(do)s(cumen)m |
9f178efb CR |
8482 | (tation.)48 b(A)33 b(few)f(examples)150 4942 y(should)d(pro)m(vide)i(a) |
8483 | g(brief)e(in)m(tro)s(duction)i(to)g(its)g(use.)275 5075 | |
45c0f7f8 CR |
8484 | y(F)-8 b(or)31 b(example,)g(it)g(is)f(easy)h(to)g(pre\014x)f(eac)m(h)h |
8485 | (line)g(in)f(a)h(text)g(\014le)g(with)f(a)g(sp)s(eci\014ed)g(string:) | |
9f178efb CR |
8486 | 390 5207 y Fs(cat)47 b(file)g(|)g(parallel)f(-k)h(echo)f(prefix_string) |
8487 | 150 5340 y Ft(The)30 b(`)p Fs(-k)p Ft(')g(option)h(is)f(required)g(to)h | |
8488 | (preserv)m(e)g(the)f(lines')h(order.)p eop end | |
45c0f7f8 CR |
8489 | %%Page: 16 22 |
8490 | TeXDict begin 16 21 bop 150 -116 a Ft(16)2572 b(Bash)31 | |
9f178efb CR |
8491 | b(Reference)g(Man)m(ual)275 299 y(Similarly)-8 b(,)31 |
8492 | b(y)m(ou)g(can)f(app)s(end)f(a)i(sp)s(eci\014ed)e(string)i(to)g(eac)m | |
8493 | (h)g(line)g(in)f(a)h(text)g(\014le:)390 431 y Fs(cat)47 | |
8494 | b(file)g(|)g(parallel)f(-k)h(echo)f({})i(append_string)275 | |
8495 | 563 y Ft(Y)-8 b(ou)34 b(can)g(use)f(P)m(arallel)j(to)e(mo)m(v)m(e)h | |
8496 | (\014les)f(from)f(the)h(curren)m(t)f(directory)h(when)f(the)h(n)m(um)m | |
8497 | (b)s(er)e(of)i(\014les)150 672 y(is)c(to)s(o)i(large)f(to)g(pro)s(cess) | |
8498 | f(with)g(one)h Fs(mv)f Ft(in)m(v)m(o)s(cation:)390 804 | |
8499 | y Fs(ls)47 b(|)h(parallel)d(mv)i({})h(destdir)275 936 | |
8500 | y Ft(As)35 b(y)m(ou)h(can)f(see,)j(the)d Fs({})g Ft(is)g(replaced)h | |
8501 | (with)f(eac)m(h)i(line)f(read)f(from)g(standard)f(input.)55 | |
8502 | b(This)35 b(will)150 1046 y(run)f(as)h(man)m(y)g Fs(mv)g | |
8503 | Ft(commands)g(as)g(there)h(are)f(\014les)g(in)g(the)h(curren)m(t)f | |
8504 | (directory)-8 b(.)56 b(Y)-8 b(ou)35 b(can)h(em)m(ulate)h(a)150 | |
8505 | 1155 y(parallel)31 b Fs(xargs)e Ft(b)m(y)i(adding)f(the)g(`)p | |
8506 | Fs(-X)p Ft(')g(option:)390 1287 y Fs(ls)47 b(|)h(parallel)d(-X)i(mv)h | |
8507 | ({})f(destdir)275 1419 y Ft(GNU)31 b(P)m(arallel)i(can)e(replace)h | |
220537f2 | 8508 | (certain)g(common)g(idioms)f(that)g(op)s(erate)h(on)f(lines)g(read)g |
9f178efb CR |
8509 | (from)f(a)i(\014le)150 1528 y(\(in)e(this)h(case,)g(\014lenames\):)390 |
8510 | 1660 y Fs(for)47 b(x)g(in)h($\(cat)e(list\);)g(do)390 | |
8511 | 1770 y(do-something1)e($x)j(config-$x)390 1879 y(do-something2)d(<)k | |
8512 | ($x)390 1989 y(done)f(|)g(process-output)150 2121 y Ft(with)30 | |
220537f2 | 8513 | b(a)h(more)f(compact)i(syn)m(tax)f(reminiscen)m(t)g(of)g(lam)m(b)s |
9f178efb | 8514 | (das:)390 2253 y Fs(cat)47 b(list)g(|)g(parallel)f("do-something1)d({}) |
220537f2 | 8515 | 48 b(config-{})d(;)i(do-something2)e(<)i({}")g(|)g(process-output)275 |
9f178efb | 8516 | 2385 y Ft(P)m(arallel)31 b(pro)m(vides)e(a)h(built-in)g(mec)m(hanism)g |
220537f2 | 8517 | (to)g(remo)m(v)m(e)h(\014lename)e(extensions,)i(whic)m(h)e(lends)g |
9f178efb CR |
8518 | (itself)150 2494 y(to)i(batc)m(h)g(\014le)g(transformations)f(or)g |
8519 | (renaming:)390 2626 y Fs(ls)47 b(*.gz)g(|)g(parallel)f(-j+0)g("zcat)h | |
8520 | ({})g(|)g(bzip2)g(>{.}.bz2)e(&&)j(rm)f({}")150 2758 y | |
220537f2 CR |
8521 | Ft(This)28 b(will)i(recompress)e(all)i(\014les)f(in)g(the)g(curren)m(t) |
8522 | g(directory)g(with)g(names)g(ending)f(in)h(.gz)h(using)f(bzip2,)150 | |
9f178efb CR |
8523 | 2868 y(running)g(one)h(job)g(p)s(er)g(CPU)g(\(-j)p Fs(+)p |
8524 | Ft(0\))h(in)f(parallel.)275 2999 y(If)24 b(a)i(command)f(generates)h | |
220537f2 | 8525 | (output,)g(y)m(ou)g(ma)m(y)f(w)m(an)m(t)h(to)g(preserv)m(e)g(the)f |
9f178efb CR |
8526 | (input)f(order)h(in)g(the)g(output.)150 3109 y(F)-8 b(or)31 |
8527 | b(instance,)g(the)g(follo)m(wing)h(command)390 3241 y | |
220537f2 CR |
8528 | Fs({)47 b(echo)g(foss.org.my)e(;)i(echo)g(debian.org;)e(echo)h |
8529 | (freenetproject.org;)d(})k(|)h(parallel)d(traceroute)150 | |
9f178efb | 8530 | 3373 y Ft(will)28 b(displa)m(y)g(as)f(output)g(the)h(traceroute)h(in)m |
220537f2 | 8531 | (v)m(o)s(cation)h(that)e(\014nishes)e(\014rst.)39 b(Using)28 |
9f178efb CR |
8532 | b(the)g(`)p Fs(-k)p Ft(')f(option,)i(as)150 3482 y(w)m(e)i(sa)m(w)g(ab) |
8533 | s(o)m(v)m(e)390 3614 y Fs({)47 b(echo)g(foss.org.my)e(;)i(echo)g | |
220537f2 | 8534 | (debian.org;)e(echo)h(freenetproject.org;)d(})k(|)h(parallel)d(-k)i |
9f178efb | 8535 | (traceroute)150 3746 y Ft(will)31 b(ensure)e(that)i(the)g(output)f(of)g |
220537f2 | 8536 | Fs(traceroute)e(foss.org.my)f Ft(is)k(displa)m(y)m(ed)g(\014rst.)150 |
9f178efb | 8537 | 3973 y Fr(3.3)68 b(Shell)45 b(F)-11 b(unctions)150 4133 |
220537f2 | 8538 | y Ft(Shell)35 b(functions)h(are)g(a)g(w)m(a)m(y)g(to)h(group)e |
c302751c | 8539 | (commands)g(for)h(later)g(execution)h(using)e(a)h(single)g(name)g(for) |
9f178efb | 8540 | 150 4242 y(the)f(group.)55 b(They)35 b(are)g(executed)h(just)f(lik)m(e) |
c302751c | 8541 | h(a)g Fs(")p Ft(regular)p Fs(")f Ft(command.)54 b(When)35 |
9f178efb | 8542 | b(the)h(name)f(of)g(a)h(shell)150 4352 y(function)j(is)g(used)f(as)h(a) |
ed35cb4a | 8543 | h(simple)f(command)g(name,)i(the)e(list)h(of)f(commands)g(asso)s |
9f178efb | 8544 | (ciated)i(with)d(that)150 4461 y(function)25 b(name)h(is)g(executed.)40 |
ed35cb4a | 8545 | b(Shell)25 b(functions)g(are)i(executed)f(in)f(the)h(curren)m(t)g |
9f178efb CR |
8546 | (shell)g(con)m(text;)j(no)c(new)150 4571 y(pro)s(cess)30 |
8547 | b(is)g(created)i(to)f(in)m(terpret)g(them.)275 4703 y(F)-8 | |
45c0f7f8 | 8548 | b(unctions)30 b(are)h(declared)g(using)f(this)g(syn)m(tax:)390 |
9f178efb CR |
8549 | 4835 y Fi(name)57 b Fs(\(\))47 b Fi(compound-command)54 |
8550 | b Fs([)48 b Fi(redirections)55 b Fs(])275 4967 y Ft(or)390 | |
8551 | 5099 y Fs(function)46 b Fi(name)57 b Fs([\(\)])46 b Fi | |
45c0f7f8 | 8552 | (compound-command)54 b Fs([)48 b Fi(redirections)55 b |
9f178efb | 8553 | Fs(])275 5230 y Ft(This)31 b(de\014nes)h(a)g(shell)h(function)f(named)g |
45c0f7f8 | 8554 | Fq(name)5 b Ft(.)47 b(The)32 b(reserv)m(ed)h(w)m(ord)f |
9f178efb | 8555 | Fs(function)e Ft(is)i(optional.)48 b(If)150 5340 y(the)39 |
9ec5ed66 CR |
8556 | b Fs(function)f Ft(reserv)m(ed)h(w)m(ord)g(is)g(supplied,)i(the)e |
8557 | (paren)m(theses)h(are)f(optional.)69 b(The)39 b Fq(b)s(o)s(dy)45 | |
9f178efb | 8558 | b Ft(of)40 b(the)p eop end |
45c0f7f8 CR |
8559 | %%Page: 17 23 |
8560 | TeXDict begin 17 22 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
8561 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(17)150 299 | |
9f178efb CR |
8562 | y(function)41 b(is)h(the)g(comp)s(ound)e(command)h Fq(comp)s |
8563 | (ound-command)j Ft(\(see)e(Section)h(3.2.4)g([Comp)s(ound)150 | |
8564 | 408 y(Commands],)33 b(page)g(9\).)48 b(That)33 b(command)g(is)f | |
8565 | (usually)h(a)g Fq(list)i Ft(enclosed)e(b)s(et)m(w)m(een)h | |
8566 | Fs({)e Ft(and)g Fs(})p Ft(,)h(but)f(ma)m(y)150 518 y(b)s(e)27 | |
9ec5ed66 CR |
8567 | b(an)m(y)h(comp)s(ound)e(command)h(listed)h(ab)s(o)m(v)m(e.)41 |
8568 | b Fq(comp)s(ound-command)30 b Ft(is)e(executed)g(whenev)m(er)g | |
9f178efb | 8569 | Fq(name)150 628 y Ft(is)j(sp)s(eci\014ed)f(as)g(the)h(name)g(of)g(a)g |
122f603c | 8570 | (command.)41 b(When)31 b(the)f(shell)h(is)g(in)f Fl(posix)g |
9f178efb CR |
8571 | Ft(mo)s(de)g(\(see)i(Section)f(6.11)150 737 y([Bash)36 |
8572 | b(POSIX)f(Mo)s(de],)j(page)e(92\),)j Fq(name)i Ft(ma)m(y)36 | |
122f603c | 8573 | b(not)h(b)s(e)e(the)h(same)g(as)g(one)g(of)g(the)g(sp)s(ecial)h |
9f178efb CR |
8574 | (builtins)150 847 y(\(see)24 b(Section)g(4.4)g([Sp)s(ecial)g |
8575 | (Builtins],)h(page)f(67\).)40 b(An)m(y)23 b(redirections)h(\(see)g | |
8576 | (Section)g(3.6)g([Redirections],)150 956 y(page)31 b(31\))h(asso)s | |
122f603c | 8577 | (ciated)g(with)e(the)g(shell)h(function)f(are)h(p)s(erformed)d(when)i |
9f178efb | 8578 | (the)g(function)g(is)h(executed.)275 1090 y(A)41 b(function)f |
122f603c CR |
8579 | (de\014nition)h(ma)m(y)g(b)s(e)g(deleted)g(using)g(the)g(`)p |
8580 | Fs(-f)p Ft(')g(option)g(to)h(the)f Fs(unset)e Ft(builtin)i(\(see)150 | |
9f178efb CR |
8581 | 1200 y(Section)31 b(4.1)h([Bourne)e(Shell)g(Builtins],)h(page)h(41\).) |
8582 | 275 1334 y(The)26 b(exit)i(status)g(of)f(a)h(function)f(de\014nition)g | |
122f603c | 8583 | (is)g(zero)h(unless)f(a)g(syn)m(tax)h(error)f(o)s(ccurs)g(or)g(a)h |
9f178efb | 8584 | (readonly)150 1443 y(function)k(with)f(the)i(same)f(name)g(already)h |
122f603c | 8585 | (exists.)46 b(When)32 b(executed,)h(the)f(exit)h(status)g(of)f(a)g |
9f178efb | 8586 | (function)150 1553 y(is)e(the)h(exit)g(status)g(of)f(the)h(last)g |
122f603c | 8587 | (command)f(executed)i(in)e(the)g(b)s(o)s(dy)-8 b(.)275 |
9f178efb | 8588 | 1687 y(Note)22 b(that)f(for)f(historical)i(reasons,)h(in)e(the)g(most)g |
122f603c | 8589 | (common)g(usage)g(the)g(curly)f(braces)h(that)g(surround)150 |
9f178efb | 8590 | 1797 y(the)38 b(b)s(o)s(dy)d(of)j(the)f(function)g(m)m(ust)g(b)s(e)g |
122f603c | 8591 | (separated)h(from)f(the)g(b)s(o)s(dy)f(b)m(y)h Fs(blank)p |
9f178efb | 8592 | Ft(s)f(or)h(newlines.)62 b(This)150 1906 y(is)38 b(b)s(ecause)g(the)h |
122f603c | 8593 | (braces)f(are)h(reserv)m(ed)f(w)m(ords)g(and)f(are)i(only)f(recognized) |
9f178efb | 8594 | i(as)e(suc)m(h)g(when)f(they)i(are)150 2016 y(separated)26 |
122f603c | 8595 | b(from)f(the)h(command)f(list)i(b)m(y)e(whitespace)h(or)g(another)g |
9f178efb | 8596 | (shell)g(metac)m(haracter.)41 b(Also,)28 b(when)150 2125 |
122f603c CR |
8597 | y(using)i(the)g(braces,)h(the)g Fq(list)i Ft(m)m(ust)d(b)s(e)g |
8598 | (terminated)h(b)m(y)f(a)h(semicolon,)h(a)e(`)p Fs(&)p | |
9f178efb | 8599 | Ft(',)h(or)g(a)f(newline.)275 2259 y(When)i(a)i(function)f(is)g |
122f603c | 8600 | (executed,)i(the)e(argumen)m(ts)h(to)g(the)f(function)g(b)s(ecome)g |
9f178efb | 8601 | (the)h(p)s(ositional)g(pa-)150 2369 y(rameters)42 b(during)e(its)i |
ac18b312 | 8602 | (execution)h(\(see)f(Section)g(3.4.1)h([P)m(ositional)h(P)m |
9f178efb | 8603 | (arameters],)i(page)c(19\).)75 b(The)150 2478 y(sp)s(ecial)37 |
ac18b312 CR |
8604 | b(parameter)f(`)p Fs(#)p Ft(')g(that)h(expands)e(to)i(the)f(n)m(um)m(b) |
8605 | s(er)f(of)h(p)s(ositional)h(parameters)f(is)g(up)s(dated)f(to)150 | |
9f178efb | 8606 | 2588 y(re\015ect)h(the)f(c)m(hange.)56 b(Sp)s(ecial)35 |
ac18b312 | 8607 | b(parameter)h Fs(0)f Ft(is)g(unc)m(hanged.)54 b(The)35 |
9f178efb | 8608 | b(\014rst)f(elemen)m(t)j(of)e(the)g Fs(FUNCNAME)150 2698 |
4a8bb13f CR |
8609 | y Ft(v)-5 b(ariable)31 b(is)g(set)f(to)i(the)e(name)h(of)f(the)h |
8610 | (function)f(while)g(the)h(function)f(is)g(executing.)275 | |
9f178efb | 8611 | 2832 y(All)25 b(other)g(asp)s(ects)g(of)g(the)g(shell)g(execution)h(en) |
4a8bb13f | 8612 | m(vironmen)m(t)g(are)f(iden)m(tical)h(b)s(et)m(w)m(een)g(a)f(function)g |
9f178efb | 8613 | (and)150 2941 y(its)35 b(caller)i(with)d(these)i(exceptions:)50 |
4a8bb13f | 8614 | b(the)36 b Fs(DEBUG)d Ft(and)h Fs(RETURN)g Ft(traps)g(are)i(not)f |
9f178efb | 8615 | (inherited)f(unless)h(the)150 3051 y(function)26 b(has)g(b)s(een)f(giv) |
4a8bb13f CR |
8616 | m(en)i(the)g Fs(trace)d Ft(attribute)j(using)f(the)g |
8617 | Fs(declare)e Ft(builtin)i(or)g(the)h Fs(-o)i(functrace)150 | |
9f178efb | 8618 | 3160 y Ft(option)f(has)e(b)s(een)h(enabled)g(with)g(the)g |
4a8bb13f | 8619 | Fs(set)f Ft(builtin,)i(\(in)f(whic)m(h)f(case)j(all)f(functions)e |
9f178efb | 8620 | (inherit)h(the)g Fs(DEBUG)150 3270 y Ft(and)33 b Fs(RETURN)f |
4a8bb13f CR |
8621 | Ft(traps\),)j(and)e(the)h Fs(ERR)f Ft(trap)h(is)g(not)g(inherited)f |
8622 | (unless)g(the)h Fs(-o)c(errtrace)h Ft(shell)j(option)150 | |
9f178efb CR |
8623 | 3380 y(has)h(b)s(een)f(enabled.)55 b(See)35 b(Section)h(4.1)g([Bourne)f |
8624 | (Shell)g(Builtins],)i(page)f(41,)i(for)c(the)i(description)f(of)150 | |
8625 | 3489 y(the)c Fs(trap)e Ft(builtin.)275 3623 y(The)38 | |
220537f2 CR |
8626 | b Fs(FUNCNEST)f Ft(v)-5 b(ariable,)42 b(if)d(set)h(to)g(a)g(n)m(umeric) |
8627 | f(v)-5 b(alue)39 b(greater)h(than)f(0,)j(de\014nes)d(a)g(maxim)m(um)150 | |
9f178efb | 8628 | 3733 y(function)24 b(nesting)h(lev)m(el.)40 b(F)-8 b(unction)25 |
220537f2 | 8629 | b(in)m(v)m(o)s(cations)i(that)e(exceed)g(the)g(limit)g(cause)g(the)g |
9f178efb CR |
8630 | (en)m(tire)g(command)150 3842 y(to)31 b(ab)s(ort.)275 |
8631 | 3976 y(If)37 b(the)g(builtin)g(command)h Fs(return)d | |
220537f2 | 8632 | Ft(is)j(executed)g(in)g(a)g(function,)h(the)e(function)h(completes)h |
9f178efb | 8633 | (and)150 4086 y(execution)25 b(resumes)e(with)h(the)g(next)g(command)f |
220537f2 | 8634 | (after)i(the)f(function)f(call.)40 b(An)m(y)24 b(command)f(asso)s |
9f178efb | 8635 | (ciated)150 4195 y(with)36 b(the)h Fs(RETURN)d Ft(trap)i(is)h(executed) |
220537f2 | 8636 | g(b)s(efore)f(execution)i(resumes.)57 b(When)37 b(a)f(function)g |
9f178efb | 8637 | (completes,)150 4305 y(the)h(v)-5 b(alues)38 b(of)f(the)g(p)s |
220537f2 | 8638 | (ositional)h(parameters)f(and)g(the)g(sp)s(ecial)h(parameter)f(`)p |
9f178efb | 8639 | Fs(#)p Ft(')g(are)h(restored)f(to)h(the)150 4415 y(v)-5 |
220537f2 CR |
8640 | b(alues)26 b(they)f(had)g(prior)f(to)i(the)g(function's)f(execution.)40 |
8641 | b(If)25 b(a)h(n)m(umeric)f(argumen)m(t)h(is)f(giv)m(en)h(to)g | |
9f178efb | 8642 | Fs(return)p Ft(,)150 4524 y(that)j(is)g(the)f(function's)h(return)e |
220537f2 | 8643 | (status;)j(otherwise)f(the)f(function's)h(return)e(status)i(is)f(the)h |
9f178efb CR |
8644 | (exit)h(status)150 4634 y(of)h(the)f(last)h(command)f(executed)i(b)s |
8645 | (efore)e(the)g Fs(return)p Ft(.)275 4768 y(V)-8 b(ariables)31 | |
45c0f7f8 CR |
8646 | b(lo)s(cal)g(to)f(the)g(function)f(ma)m(y)i(b)s(e)e(declared)h(with)f |
8647 | (the)h Fs(local)f Ft(builtin.)40 b(These)29 b(v)-5 b(ariables)150 | |
9f178efb CR |
8648 | 4877 y(are)31 b(visible)g(only)f(to)h(the)g(function)f(and)g(the)g |
8649 | (commands)g(it)h(in)m(v)m(ok)m(es.)275 5011 y(F)-8 b(unction)47 | |
45c0f7f8 CR |
8650 | b(names)g(and)f(de\014nitions)g(ma)m(y)h(b)s(e)f(listed)i(with)e(the)h |
8651 | (`)p Fs(-f)p Ft(')f(option)i(to)f(the)g Fs(declare)150 | |
9f178efb CR |
8652 | 5121 y Ft(\()p Fs(typeset)p Ft(\))39 b(builtin)i(command)f(\(see)i |
8653 | (Section)f(4.2)h([Bash)f(Builtins],)j(page)d(48\).)73 | |
8654 | b(The)40 b(`)p Fs(-F)p Ft(')g(option)150 5230 y(to)29 | |
122f603c CR |
8655 | b Fs(declare)d Ft(or)i Fs(typeset)f Ft(will)h(list)h(the)f(function)g |
8656 | (names)h(only)f(\(and)g(optionally)h(the)g(source)f(\014le)h(and)150 | |
9f178efb | 8657 | 5340 y(line)k(n)m(um)m(b)s(er,)g(if)f(the)h Fs(extdebug)e |
37c41ab1 | 8658 | Ft(shell)i(option)g(is)g(enabled\).)49 b(F)-8 b(unctions)33 |
9f178efb | 8659 | b(ma)m(y)h(b)s(e)e(exp)s(orted)g(so)h(that)p eop end |
45c0f7f8 CR |
8660 | %%Page: 18 24 |
8661 | TeXDict begin 18 23 bop 150 -116 a Ft(18)2572 b(Bash)31 | |
9f178efb CR |
8662 | b(Reference)g(Man)m(ual)150 299 y(subshells)h(automatically)37 |
8663 | b(ha)m(v)m(e)d(them)g(de\014ned)e(with)h(the)g(`)p Fs(-f)p | |
8664 | Ft(')h(option)g(to)g(the)f Fs(export)f Ft(builtin)h(\(see)150 | |
8665 | 408 y(Section)g(4.1)g([Bourne)f(Shell)g(Builtins],)i(page)f(41\).)47 | |
8666 | b(Note)33 b(that)g(shell)f(functions)g(and)f(v)-5 b(ariables)33 | |
8667 | b(with)150 518 y(the)d(same)g(name)g(ma)m(y)g(result)g(in)g(m)m | |
8668 | (ultiple)g(iden)m(tically-named)i(en)m(tries)f(in)e(the)h(en)m | |
8669 | (vironmen)m(t)g(passed)150 628 y(to)h(the)g(shell's)f(c)m(hildren.)41 | |
8670 | b(Care)30 b(should)g(b)s(e)f(tak)m(en)j(in)e(cases)h(where)f(this)g(ma) | |
8671 | m(y)h(cause)g(a)g(problem.)275 760 y(F)-8 b(unctions)33 | |
8672 | b(ma)m(y)g(b)s(e)g(recursiv)m(e.)48 b(The)32 b Fs(FUNCNEST)f | |
8673 | Ft(v)-5 b(ariable)34 b(ma)m(y)f(b)s(e)f(used)g(to)i(limit)g(the)f | |
8674 | (depth)f(of)150 870 y(the)27 b(function)f(call)i(stac)m(k)h(and)d | |
8675 | (restrict)h(the)g(n)m(um)m(b)s(er)f(of)h(function)f(in)m(v)m(o)s | |
8676 | (cations.)42 b(By)27 b(default,)g(no)g(limit)150 979 | |
8677 | y(is)j(placed)h(on)g(the)f(n)m(um)m(b)s(er)f(of)i(recursiv)m(e)f | |
8678 | (calls.)150 1208 y Fr(3.4)68 b(Shell)45 b(P)l(arameters)150 | |
8679 | 1367 y Ft(A)23 b Fq(parameter)31 b Ft(is)23 b(an)g(en)m(tit)m(y)i(that) | |
9ec5ed66 CR |
8680 | f(stores)g(v)-5 b(alues.)39 b(It)23 b(can)h(b)s(e)f(a)g |
8681 | Fs(name)p Ft(,)h(a)g(n)m(um)m(b)s(er,)f(or)h(one)f(of)h(the)f(sp)s | |
9f178efb | 8682 | (ecial)150 1477 y(c)m(haracters)i(listed)f(b)s(elo)m(w.)39 |
9ec5ed66 CR |
8683 | b(A)24 b Fq(v)-5 b(ariable)29 b Ft(is)24 b(a)g(parameter)g(denoted)f(b) |
8684 | m(y)h(a)g Fs(name)p Ft(.)37 b(A)24 b(v)-5 b(ariable)24 | |
9f178efb | 8685 | b(has)f(a)h Fq(v)-5 b(alue)150 1586 y Ft(and)33 b(zero)i(or)e(more)h |
c302751c | 8686 | Fq(attributes)t Ft(.)51 b(A)m(ttributes)34 b(are)g(assigned)g(using)f |
9f178efb | 8687 | (the)h Fs(declare)e Ft(builtin)h(command)150 1696 y(\(see)e(the)g |
c302751c | 8688 | (description)f(of)h(the)f Fs(declare)f Ft(builtin)h(in)g(Section)h(4.2) |
9f178efb | 8689 | g([Bash)g(Builtins],)g(page)g(48\).)275 1828 y(A)d(parameter)h(is)g |
c302751c CR |
8690 | (set)g(if)f(it)h(has)f(b)s(een)g(assigned)h(a)g(v)-5 |
8691 | b(alue.)40 b(The)28 b(n)m(ull)h(string)f(is)h(a)g(v)-5 | |
9f178efb | 8692 | b(alid)28 b(v)-5 b(alue.)41 b(Once)150 1938 y(a)31 b(v)-5 |
c302751c | 8693 | b(ariable)31 b(is)f(set,)i(it)e(ma)m(y)h(b)s(e)f(unset)g(only)h(b)m(y)f |
9f178efb | 8694 | (using)g(the)g Fs(unset)f Ft(builtin)h(command.)275 2070 |
c302751c | 8695 | y(A)g(v)-5 b(ariable)31 b(ma)m(y)g(b)s(e)f(assigned)g(to)i(b)m(y)e(a)h |
9f178efb CR |
8696 | (statemen)m(t)h(of)e(the)h(form)390 2203 y Fi(name)11 |
8697 | b Fs(=[)p Fi(value)g Fs(])150 2335 y Ft(If)34 b Fq(v)-5 | |
220537f2 | 8698 | b(alue)40 b Ft(is)35 b(not)g(giv)m(en,)h(the)f(v)-5 b(ariable)35 |
e1e48bba CR |
8699 | b(is)g(assigned)g(the)f(n)m(ull)h(string.)53 b(All)35 |
8700 | b Fq(v)-5 b(alue)5 b Ft(s)35 b(undergo)f(tilde)h(ex-)150 | |
9f178efb | 8701 | 2445 y(pansion,)h(parameter)f(and)f(v)-5 b(ariable)36 |
e1e48bba | 8702 | b(expansion,)f(command)g(substitution,)h(arithmetic)g(expansion,)150 |
9f178efb | 8703 | 2554 y(and)k(quote)h(remo)m(v)-5 b(al)42 b(\(detailed)h(b)s(elo)m(w\).) |
e1e48bba | 8704 | 72 b(If)40 b(the)h(v)-5 b(ariable)41 b(has)g(its)g Fs(integer)e |
9f178efb | 8705 | Ft(attribute)i(set,)j(then)150 2664 y Fq(v)-5 b(alue)38 |
e1e48bba CR |
8706 | b Ft(is)33 b(ev)-5 b(aluated)34 b(as)f(an)g(arithmetic)h(expression)f |
8707 | (ev)m(en)h(if)e(the)h Fs($\(\(...)o(\)\))f Ft(expansion)h(is)g(not)g | |
9f178efb CR |
8708 | (used)150 2774 y(\(see)e(Section)g(3.5.5)i([Arithmetic)e(Expansion],)f |
8709 | (page)h(28\).)42 b(W)-8 b(ord)31 b(splitting)g(is)g(not)f(p)s | |
8710 | (erformed,)f(with)150 2883 y(the)35 b(exception)h(of)f | |
e1e48bba CR |
8711 | Fs("$@")f Ft(as)h(explained)g(b)s(elo)m(w.)54 b(Filename)36 |
8712 | b(expansion)f(is)g(not)g(p)s(erformed.)53 b(Assign-)150 | |
9f178efb | 8713 | 2993 y(men)m(t)33 b(statemen)m(ts)h(ma)m(y)f(also)g(app)s(ear)f(as)g |
e1e48bba | 8714 | (argumen)m(ts)h(to)g(the)g Fs(alias)p Ft(,)e Fs(declare)p |
9f178efb | 8715 | Ft(,)g Fs(typeset)p Ft(,)g Fs(export)p Ft(,)150 3102 |
122f603c CR |
8716 | y Fs(readonly)p Ft(,)41 b(and)f Fs(local)f Ft(builtin)h(commands.)71 |
8717 | b(When)40 b(in)h Fl(posix)e Ft(mo)s(de)i(\(see)g(Section)g(6.11)i | |
9f178efb | 8718 | ([Bash)150 3212 y(POSIX)36 b(Mo)s(de],)k(page)e(92\),)i(these)e |
122f603c | 8719 | (builtins)f(ma)m(y)h(app)s(ear)e(in)h(a)h(command)f(after)h(one)f(or)h |
9f178efb | 8720 | (more)f(in-)150 3322 y(stances)31 b(of)g(the)f Fs(command)f |
122f603c | 8721 | Ft(builtin)h(and)f(retain)i(these)g(assignmen)m(t)g(statemen)m(t)h |
9f178efb | 8722 | (prop)s(erties.)275 3454 y(In)d(the)h(con)m(text)i(where)d(an)h |
122f603c CR |
8723 | (assignmen)m(t)h(statemen)m(t)h(is)e(assigning)g(a)h(v)-5 |
8724 | b(alue)30 b(to)h(a)f(shell)g(v)-5 b(ariable)31 b(or)150 | |
9f178efb CR |
8725 | 3564 y(arra)m(y)f(index)g(\(see)h(Section)g(6.7)g([Arra)m(ys],)g(page)g |
8726 | (88\),)g(the)f(`)p Fs(+=)p Ft(')g(op)s(erator)g(can)h(b)s(e)e(used)g | |
8727 | (to)i(app)s(end)d(to)150 3673 y(or)36 b(add)g(to)h(the)f(v)-5 | |
122f603c CR |
8728 | b(ariable's)37 b(previous)f(v)-5 b(alue.)59 b(When)36 |
8729 | b(`)p Fs(+=)p Ft(')g(is)g(applied)g(to)h(a)g(v)-5 b(ariable)37 | |
9f178efb | 8730 | b(for)f(whic)m(h)g(the)150 3783 y Fq(in)m(teger)46 b |
122f603c | 8731 | Ft(attribute)38 b(has)f(b)s(een)g(set,)k Fq(v)-5 b(alue)43 |
e05be32d | 8732 | b Ft(is)38 b(ev)-5 b(aluated)39 b(as)f(an)f(arithmetic)i(expression)f |
9f178efb | 8733 | (and)f(added)150 3892 y(to)f(the)f(v)-5 b(ariable's)36 |
e05be32d CR |
8734 | b(curren)m(t)f(v)-5 b(alue,)37 b(whic)m(h)e(is)g(also)h(ev)-5 |
8735 | b(aluated.)56 b(When)35 b(`)p Fs(+=)p Ft(')g(is)h(applied)f(to)g(an)g | |
9f178efb CR |
8736 | (arra)m(y)150 4002 y(v)-5 b(ariable)26 b(using)e(comp)s(ound)f |
8737 | (assignmen)m(t)j(\(see)f(Section)h(6.7)f([Arra)m(ys],)i(page)f(88\),)h | |
8738 | (the)e(v)-5 b(ariable's)25 b(v)-5 b(alue)150 4112 y(is)32 | |
e05be32d CR |
8739 | b(not)f(unset)h(\(as)g(it)g(is)f(when)g(using)g(`)p Fs(=)p |
8740 | Ft('\),)i(and)e(new)g(v)-5 b(alues)32 b(are)g(app)s(ended)d(to)k(the)f | |
9f178efb | 8741 | (arra)m(y)g(b)s(eginning)150 4221 y(at)27 b(one)f(greater)i(than)e(the) |
e05be32d | 8742 | g(arra)m(y's)h(maxim)m(um)f(index)g(\(for)g(indexed)g(arra)m(ys\),)i |
9f178efb | 8743 | (or)e(added)g(as)g(additional)150 4331 y(k)m(ey-v)-5 |
e05be32d CR |
8744 | b(alue)35 b(pairs)e(in)g(an)g(asso)s(ciativ)m(e)j(arra)m(y)-8 |
8745 | b(.)51 b(When)33 b(applied)g(to)h(a)g(string-v)-5 b(alued)34 | |
8746 | b(v)-5 b(ariable,)35 b Fq(v)-5 b(alue)39 b Ft(is)150 | |
9f178efb CR |
8747 | 4440 y(expanded)30 b(and)f(app)s(ended)g(to)i(the)g(v)-5 |
8748 | b(ariable's)31 b(v)-5 b(alue.)275 4573 y(A)37 b(v)-5 | |
8749 | b(ariable)38 b(can)g(b)s(e)f(assigned)h(the)f Fq(nameref)55 | |
8750 | b Ft(attribute)38 b(using)f(the)h(`)p Fs(-n)p Ft(')f(option)h(to)g(the) | |
8751 | g Fs(\\)p Ft(fBde-)150 4682 y(clare)p Fs(\\)p Ft(fP)44 | |
8752 | b(or)f Fs(\\)p Ft(fBlo)s(cal)p Fs(\\)p Ft(fP)h(builtin)e(commands)h | |
8753 | (\(see)h(Section)h(4.2)f([Bash)g(Builtins],)j(page)d(48\))g(to)150 | |
8754 | 4792 y(create)36 b(a)e Fq(nameref)17 b Ft(,)35 b(or)f(a)h(reference)f | |
8755 | (to)h(another)f(v)-5 b(ariable.)53 b(This)33 b(allo)m(ws)i(v)-5 | |
8756 | b(ariables)35 b(to)f(b)s(e)g(manipu-)150 4902 y(lated)d(indirectly)-8 | |
8757 | b(.)43 b(Whenev)m(er)31 b(the)g(nameref)f(v)-5 b(ariable)32 | |
8758 | b(is)e(referenced)h(or)f(assigned)h(to,)h(the)e(op)s(eration)150 | |
8759 | 5011 y(is)i(actually)h(p)s(erformed)d(on)i(the)g(v)-5 | |
8760 | b(ariable)33 b(sp)s(eci\014ed)e(b)m(y)g(the)h(nameref)g(v)-5 | |
8761 | b(ariable's)33 b(v)-5 b(alue.)45 b(A)32 b(nameref)150 | |
8762 | 5121 y(is)h(commonly)g(used)e(within)h(shell)h(functions)f(to)h(refer)f | |
8763 | (to)i(a)f(v)-5 b(ariable)33 b(whose)f(name)h(is)f(passed)g(as)h(an)150 | |
8764 | 5230 y(argumen)m(t)g(to)g(the)g(function.)46 b(F)-8 b(or)33 | |
8765 | b(instance,)h(if)e(a)h(v)-5 b(ariable)33 b(name)g(is)f(passed)g(to)h(a) | |
8766 | g(shell)g(function)f(as)150 5340 y(its)f(\014rst)e(argumen)m(t,)i | |
8767 | (running)p eop end | |
8768 | %%Page: 19 25 | |
8769 | TeXDict begin 19 24 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
8770 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(19)390 299 | |
8771 | y Fs(declare)46 b(-n)h(ref=$1)150 425 y Ft(inside)31 | |
8772 | b(the)h(function)f(creates)i(a)g(nameref)e(v)-5 b(ariable)32 | |
8773 | b Fq(ref)49 b Ft(whose)32 b(v)-5 b(alue)32 b(is)g(the)f(v)-5 | |
8774 | b(ariable)33 b(name)e(passed)150 535 y(as)42 b(the)g(\014rst)f(argumen) | |
8775 | m(t.)74 b(References)43 b(and)e(assignmen)m(ts)h(to)g | |
8776 | Fq(ref)59 b Ft(are)42 b(treated)h(as)f(references)g(and)150 | |
8777 | 644 y(assignmen)m(ts)31 b(to)g(the)g(v)-5 b(ariable)31 | |
8778 | b(whose)f(name)g(w)m(as)h(passed)f(as)h Fs($1)p Ft(.)275 | |
8779 | 771 y(If)38 b(the)i(con)m(trol)g(v)-5 b(ariable)40 b(in)f(a)g | |
8780 | Fs(for)g Ft(lo)s(op)g(has)g(the)g(nameref)g(attribute,)k(the)c(list)h | |
8781 | (of)f(w)m(ords)g(can)150 880 y(b)s(e)c(a)i(list)f(of)g(shell)h(v)-5 | |
8782 | b(ariables,)38 b(and)d(a)h(name)g(reference)h(will)f(b)s(e)f | |
8783 | (established)i(for)e(eac)m(h)j(w)m(ord)d(in)h(the)150 | |
8784 | 990 y(list,)30 b(in)f(turn,)g(when)f(the)i(lo)s(op)f(is)g(executed.)41 | |
8785 | b(Arra)m(y)30 b(v)-5 b(ariables)30 b(cannot)g(b)s(e)e(giv)m(en)i(the)g | |
8786 | (`)p Fs(-n)p Ft(')f(attribute.)150 1099 y(Ho)m(w)m(ev)m(er,)39 | |
8787 | b(nameref)d(v)-5 b(ariables)36 b(can)g(reference)g(arra)m(y)g(v)-5 | |
8788 | b(ariables)37 b(and)e(subscripted)f(arra)m(y)i(v)-5 b(ariables.)150 | |
8789 | 1209 y(Namerefs)32 b(can)h(b)s(e)e(unset)h(using)f(the)h(`)p | |
8790 | Fs(-n)p Ft(')g(option)h(to)g(the)f Fs(unset)e Ft(builtin)i(\(see)h | |
8791 | (Section)g(4.1)g([Bourne)150 1319 y(Shell)43 b(Builtins],)j(page)e | |
8792 | (41\).)79 b(Otherwise,)45 b(if)e Fs(unset)e Ft(is)i(executed)h(with)e | |
8793 | (the)h(name)g(of)g(a)g(nameref)150 1428 y(v)-5 b(ariable)31 | |
8794 | b(as)g(an)f(argumen)m(t,)h(the)g(v)-5 b(ariable)31 b(referenced)f(b)m | |
8795 | (y)g(the)h(nameref)f(v)-5 b(ariable)31 b(will)g(b)s(e)f(unset.)150 | |
8796 | 1611 y Fj(3.4.1)63 b(P)m(ositional)41 b(P)m(arameters)150 | |
8797 | 1758 y Ft(A)28 b Fq(p)s(ositional)h(parameter)35 b Ft(is)28 | |
8798 | b(a)g(parameter)g(denoted)g(b)m(y)g(one)g(or)g(more)g(digits,)h(other)g | |
8799 | (than)e(the)h(single)150 1868 y(digit)34 b Fs(0)p Ft(.)48 | |
8800 | b(P)m(ositional)36 b(parameters)d(are)g(assigned)h(from)e(the)i | |
8801 | (shell's)f(argumen)m(ts)g(when)f(it)i(is)f(in)m(v)m(ok)m(ed,)150 | |
8802 | 1977 y(and)38 b(ma)m(y)i(b)s(e)e(reassigned)i(using)e(the)h | |
8803 | Fs(set)g Ft(builtin)f(command.)67 b(P)m(ositional)41 | |
8804 | b(parameter)e Fs(N)g Ft(ma)m(y)h(b)s(e)150 2087 y(referenced)34 | |
122f603c CR |
8805 | b(as)h Fs(${N})p Ft(,)g(or)f(as)h Fs($N)e Ft(when)h Fs(N)g |
8806 | Ft(consists)h(of)f(a)h(single)g(digit.)54 b(P)m(ositional)37 | |
9f178efb | 8807 | b(parameters)d(ma)m(y)150 2196 y(not)j(b)s(e)f(assigned)h(to)g(with)f |
122f603c CR |
8808 | (assignmen)m(t)i(statemen)m(ts.)61 b(The)36 b Fs(set)g |
8809 | Ft(and)g Fs(shift)f Ft(builtins)h(are)h(used)f(to)150 | |
9f178efb CR |
8810 | 2306 y(set)k(and)f(unset)f(them)i(\(see)g(Chapter)f(4)g([Shell)h |
8811 | (Builtin)g(Commands],)h(page)f(41\).)68 b(The)39 b(p)s(ositional)150 | |
8812 | 2416 y(parameters)44 b(are)g(temp)s(orarily)g(replaced)h(when)e(a)h | |
8813 | (shell)g(function)g(is)g(executed)g(\(see)h(Section)g(3.3)150 | |
8814 | 2525 y([Shell)30 b(F)-8 b(unctions],)32 b(page)f(16\).)275 | |
8815 | 2651 y(When)c(a)i(p)s(ositional)g(parameter)g(consisting)f(of)h(more)f | |
74d0116b | 8816 | (than)g(a)g(single)h(digit)g(is)f(expanded,)g(it)h(m)m(ust)150 |
9f178efb CR |
8817 | 2761 y(b)s(e)h(enclosed)h(in)f(braces.)150 2944 y Fj(3.4.2)63 |
8818 | b(Sp)s(ecial)41 b(P)m(arameters)150 3091 y Ft(The)d(shell)g(treats)h | |
74d0116b CR |
8819 | (sev)m(eral)g(parameters)f(sp)s(ecially)-8 b(.)65 b(These)38 |
8820 | b(parameters)h(ma)m(y)f(only)g(b)s(e)g(referenced;)150 | |
9f178efb CR |
8821 | 3200 y(assignmen)m(t)31 b(to)g(them)g(is)f(not)h(allo)m(w)m(ed.)150 |
8822 | 3343 y Fs(*)432 b Ft(Expands)29 b(to)h(the)h(p)s(ositional)f | |
74d0116b | 8823 | (parameters,)h(starting)g(from)e(one.)41 b(When)30 b(the)g(expansion) |
9f178efb | 8824 | 630 3453 y(o)s(ccurs)e(within)f(double)h(quotes,)h(it)g(expands)e(to)i |
74d0116b | 8825 | (a)f(single)h(w)m(ord)f(with)g(the)g(v)-5 b(alue)29 b(of)f(eac)m(h)630 |
9f178efb | 8826 | 3563 y(parameter)i(separated)g(b)m(y)f(the)g(\014rst)g(c)m(haracter)i |
74d0116b | 8827 | (of)e(the)h Fs(IFS)e Ft(sp)s(ecial)i(v)-5 b(ariable.)41 |
9f178efb | 8828 | b(That)30 b(is,)630 3672 y Fs("$*")h Ft(is)i(equiv)-5 |
74d0116b CR |
8829 | b(alen)m(t)33 b(to)h Fs("$1)p Fi(c)11 b Fs($2)p Fi(c)g |
8830 | Fs(...)l(")p Ft(,)33 b(where)f Fq(c)38 b Ft(is)32 b(the)h(\014rst)e(c)m | |
9f178efb | 8831 | (haracter)j(of)f(the)f(v)-5 b(alue)630 3782 y(of)30 b(the)g |
74d0116b CR |
8832 | Fs(IFS)g Ft(v)-5 b(ariable.)41 b(If)30 b Fs(IFS)f Ft(is)h(unset,)g(the) |
8833 | g(parameters)g(are)h(separated)f(b)m(y)g(spaces.)41 b(If)630 | |
9f178efb CR |
8834 | 3891 y Fs(IFS)29 b Ft(is)i(n)m(ull,)f(the)h(parameters)g(are)f(joined)h |
8835 | (without)f(in)m(terv)m(ening)i(separators.)150 4034 y | |
74d0116b CR |
8836 | Fs(@)432 b Ft(Expands)29 b(to)h(the)h(p)s(ositional)f(parameters,)h |
8837 | (starting)g(from)e(one.)41 b(When)30 b(the)g(expansion)630 | |
9f178efb | 8838 | 4144 y(o)s(ccurs)c(within)g(double)f(quotes,)j(eac)m(h)f(parameter)g |
74d0116b | 8839 | (expands)e(to)i(a)g(separate)g(w)m(ord.)39 b(That)630 |
9f178efb | 8840 | 4253 y(is,)29 b Fs("$@")e Ft(is)i(equiv)-5 b(alen)m(t)30 |
74d0116b | 8841 | b(to)f Fs("$1")g("$2")h(...)o Ft(.)40 b(If)28 b(the)g(double-quoted)h |
9f178efb | 8842 | (expansion)f(o)s(ccurs)630 4363 y(within)d(a)h(w)m(ord,)g(the)g |
74d0116b | 8843 | (expansion)f(of)h(the)g(\014rst)f(parameter)h(is)f(joined)h(with)f(the) |
9f178efb | 8844 | h(b)s(eginning)630 4473 y(part)f(of)g(the)g(original)g(w)m(ord,)h(and)e |
74d0116b | 8845 | (the)h(expansion)g(of)g(the)g(last)h(parameter)f(is)g(joined)f(with)630 |
9f178efb | 8846 | 4582 y(the)37 b(last)g(part)g(of)f(the)h(original)h(w)m(ord.)59 |
e1e48bba | 8847 | b(When)36 b(there)h(are)g(no)f(p)s(ositional)h(parameters,)630 |
9f178efb CR |
8848 | 4692 y Fs("$@")29 b Ft(and)h Fs($@)g Ft(expand)f(to)j(nothing)e |
8849 | (\(i.e.,)i(they)e(are)h(remo)m(v)m(ed\).)150 4835 y Fs(#)432 | |
220537f2 | 8850 | b Ft(Expands)29 b(to)i(the)g(n)m(um)m(b)s(er)e(of)h(p)s(ositional)h |
9f178efb | 8851 | (parameters)g(in)f(decimal.)150 4978 y Fs(?)432 b Ft(Expands)29 |
e1e48bba | 8852 | b(to)i(the)g(exit)g(status)g(of)f(the)h(most)f(recen)m(tly)i(executed)f |
9f178efb | 8853 | (foreground)f(pip)s(eline.)150 5121 y Fs(-)432 b Ft(\(A)31 |
e1e48bba CR |
8854 | b(h)m(yphen.\))42 b(Expands)30 b(to)h(the)g(curren)m(t)g(option)h |
8855 | (\015ags)f(as)g(sp)s(eci\014ed)f(up)s(on)g(in)m(v)m(o)s(cation,)630 | |
9f178efb | 8856 | 5230 y(b)m(y)35 b(the)h Fs(set)e Ft(builtin)h(command,)h(or)g(those)g |
e1e48bba | 8857 | (set)f(b)m(y)h(the)f(shell)h(itself)g(\(suc)m(h)f(as)h(the)f(`)p |
9f178efb CR |
8858 | Fs(-i)p Ft(')630 5340 y(option\).)p eop end |
8859 | %%Page: 20 26 | |
8860 | TeXDict begin 20 25 bop 150 -116 a Ft(20)2572 b(Bash)31 | |
8861 | b(Reference)g(Man)m(ual)150 299 y Fs($)432 b Ft(Expands)39 | |
8862 | b(to)j(the)f(pro)s(cess)f Fl(id)h Ft(of)g(the)g(shell.)73 | |
8863 | b(In)40 b(a)h Fs(\(\))f Ft(subshell,)j(it)e(expands)f(to)i(the)630 | |
8864 | 408 y(pro)s(cess)30 b Fl(id)g Ft(of)h(the)g(in)m(v)m(oking)g(shell,)g | |
8865 | (not)g(the)f(subshell.)150 596 y Fs(!)432 b Ft(Expands)39 | |
8e1a6eaa | 8866 | b(to)i(the)g(pro)s(cess)e Fl(id)i Ft(of)f(the)h(most)g(recen)m(tly)g |
9f178efb CR |
8867 | (executed)g(bac)m(kground)g(\(asyn-)630 706 y(c)m(hronous\))30 |
8868 | b(command.)150 893 y Fs(0)432 b Ft(Expands)20 b(to)j(the)f(name)g(of)g | |
8e1a6eaa | 8869 | (the)g(shell)g(or)f(shell)h(script.)38 b(This)21 b(is)h(set)g(at)h |
9f178efb | 8870 | (shell)f(initialization.)630 1003 y(If)44 b(Bash)g(is)g(in)m(v)m(ok)m |
8e1a6eaa | 8871 | (ed)i(with)e(a)g(\014le)g(of)h(commands)e(\(see)j(Section)f(3.8)g |
9f178efb | 8872 | ([Shell)f(Scripts],)630 1112 y(page)39 b(38\),)i Fs($0)d |
8e1a6eaa CR |
8873 | Ft(is)g(set)g(to)h(the)f(name)g(of)g(that)h(\014le.)64 |
8874 | b(If)37 b(Bash)i(is)f(started)g(with)g(the)g(`)p Fs(-c)p | |
9f178efb CR |
8875 | Ft(')630 1222 y(option)i(\(see)g(Section)h(6.1)f([In)m(v)m(oking)h |
8876 | (Bash],)h(page)e(79\),)j(then)d Fs($0)e Ft(is)i(set)g(to)g(the)g | |
8877 | (\014rst)630 1331 y(argumen)m(t)31 b(after)g(the)g(string)g(to)g(b)s(e) | |
8e1a6eaa | 8878 | f(executed,)i(if)f(one)g(is)f(presen)m(t.)42 b(Otherwise,)31 |
9f178efb | 8879 | b(it)g(is)f(set)630 1441 y(to)h(the)g(\014lename)f(used)g(to)h(in)m(v)m |
45c0f7f8 | 8880 | (ok)m(e)h(Bash,)f(as)g(giv)m(en)g(b)m(y)f(argumen)m(t)h(zero.)150 |
9f178efb | 8881 | 1629 y Fs(_)432 b Ft(\(An)27 b(underscore.\))39 b(A)m(t)29 |
8e1a6eaa | 8882 | b(shell)e(startup,)h(set)f(to)h(the)g(absolute)g(pathname)f(used)f(to)i |
9f178efb | 8883 | (in)m(v)m(ok)m(e)630 1738 y(the)22 b(shell)g(or)g(shell)g(script)f(b)s |
8e1a6eaa | 8884 | (eing)h(executed)h(as)f(passed)f(in)g(the)h(en)m(vironmen)m(t)h(or)e |
9f178efb | 8885 | (argumen)m(t)630 1848 y(list.)72 b(Subsequen)m(tly)-8 |
8e1a6eaa | 8886 | b(,)43 b(expands)c(to)j(the)e(last)i(argumen)m(t)f(to)g(the)g(previous) |
9f178efb | 8887 | f(command,)630 1957 y(after)35 b(expansion.)54 b(Also)36 |
8e1a6eaa | 8888 | b(set)f(to)h(the)f(full)f(pathname)h(used)f(to)h(in)m(v)m(ok)m(e)i(eac) |
9f178efb | 8889 | m(h)f(command)630 2067 y(executed)42 b(and)e(placed)i(in)e(the)h(en)m |
122f603c | 8890 | (vironmen)m(t)h(exp)s(orted)f(to)g(that)h(command.)72 |
9f178efb CR |
8891 | b(When)630 2176 y(c)m(hec)m(king)32 b(mail,)f(this)g(parameter)g(holds) |
8892 | e(the)i(name)f(of)h(the)g(mail)g(\014le.)150 2451 y Fr(3.5)68 | |
8893 | b(Shell)45 b(Expansions)150 2610 y Ft(Expansion)27 b(is)i(p)s(erformed) | |
8894 | d(on)i(the)g(command)g(line)h(after)f(it)h(has)f(b)s(een)f(split)h(in)m | |
8895 | (to)i Fs(token)p Ft(s.)38 b(There)28 b(are)150 2720 y(sev)m(en)j(kinds) | |
8896 | e(of)i(expansion)f(p)s(erformed:)225 2883 y Fp(\017)60 | |
8897 | b Ft(brace)31 b(expansion)225 3031 y Fp(\017)60 b Ft(tilde)31 | |
8898 | b(expansion)225 3180 y Fp(\017)60 b Ft(parameter)31 b(and)f(v)-5 | |
8899 | b(ariable)31 b(expansion)225 3328 y Fp(\017)60 b Ft(command)30 | |
8900 | b(substitution)225 3477 y Fp(\017)60 b Ft(arithmetic)32 | |
8901 | b(expansion)225 3625 y Fp(\017)60 b Ft(w)m(ord)30 b(splitting)225 | |
8902 | 3774 y Fp(\017)60 b Ft(\014lename)31 b(expansion)275 | |
8903 | 3975 y(The)i(order)g(of)h(expansions)g(is:)47 b(brace)34 | |
8904 | b(expansion,)h(tilde)g(expansion,)f(parameter,)i(v)-5 | |
8905 | b(ariable,)36 b(and)150 4085 y(arithmetic)46 b(expansion)f(and)g | |
8906 | (command)f(substitution)h(\(done)g(in)g(a)g(left-to-righ)m(t)j | |
8907 | (fashion\),)h(w)m(ord)150 4195 y(splitting,)31 b(and)f(\014lename)h | |
8908 | (expansion.)275 4357 y(On)42 b(systems)h(that)h(can)g(supp)s(ort)e(it,) | |
8909 | 47 b(there)d(is)f(an)h(additional)g(expansion)f(a)m(v)-5 | |
8910 | b(ailable:)69 b Fq(pro)s(cess)150 4467 y(substitution)p | |
37c41ab1 CR |
8911 | Ft(.)61 b(This)36 b(is)h(p)s(erformed)f(at)i(the)f(same)h(time)f(as)h |
8912 | (parameter,)h(v)-5 b(ariable,)40 b(and)d(arithmetic)150 | |
9f178efb CR |
8913 | 4576 y(expansion)30 b(and)g(command)g(substitution.)275 |
8914 | 4739 y(Only)35 b(brace)i(expansion,)h(w)m(ord)e(splitting,)j(and)d | |
220537f2 | 8915 | (\014lename)g(expansion)g(can)h(c)m(hange)h(the)e(n)m(um)m(b)s(er)150 |
9f178efb | 8916 | 4849 y(of)h(w)m(ords)f(of)g(the)h(expansion;)i(other)e(expansions)f |
220537f2 | 8917 | (expand)g(a)h(single)g(w)m(ord)f(to)h(a)g(single)g(w)m(ord.)58 |
9f178efb | 8918 | b(The)150 4958 y(only)32 b(exceptions)i(to)f(this)f(are)h(the)f |
e1e48bba | 8919 | (expansions)g(of)h Fs("$@")e Ft(\(see)i(Section)g(3.4.2)h([Sp)s(ecial)f |
9f178efb | 8920 | (P)m(arameters],)150 5068 y(page)e(19\))h(and)d Fs("${)p |
e1e48bba | 8921 | Fi(name)11 b Fs([@]}")27 b Ft(\(see)k(Section)h(6.7)f([Arra)m(ys],)g |
9f178efb | 8922 | (page)g(88\).)275 5230 y(After)41 b(all)i(expansions,)h |
4a8bb13f | 8923 | Fs(quote)29 b(removal)40 b Ft(\(see)i(Section)h(3.5.9)g([Quote)f(Remo)m |
9f178efb CR |
8924 | (v)-5 b(al],)47 b(page)42 b(30\))h(is)150 5340 y(p)s(erformed.)p |
8925 | eop end | |
8926 | %%Page: 21 27 | |
8927 | TeXDict begin 21 26 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
8928 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(21)150 299 | |
8929 | y Fj(3.5.1)63 b(Brace)40 b(Expansion)150 446 y Ft(Brace)32 | |
8930 | b(expansion)f(is)f(a)i(mec)m(hanism)f(b)m(y)f(whic)m(h)h(arbitrary)f | |
8931 | (strings)h(ma)m(y)g(b)s(e)f(generated.)43 b(This)30 b(mec)m(h-)150 | |
8932 | 555 y(anism)35 b(is)h(similar)f(to)h Fq(\014lename)g(expansion)f | |
8933 | Ft(\(see)i(Section)f(3.5.8)h([Filename)g(Expansion],)f(page)g(29\),)150 | |
8934 | 665 y(but)26 b(the)h(\014lenames)g(generated)h(need)f(not)g(exist.)40 | |
8935 | b(P)m(atterns)28 b(to)f(b)s(e)g(brace)g(expanded)f(tak)m(e)i(the)f | |
8936 | (form)g(of)150 775 y(an)i(optional)i Fq(pream)m(ble)5 | |
8937 | b Ft(,)30 b(follo)m(w)m(ed)i(b)m(y)d(either)h(a)g(series)g(of)g | |
8938 | (comma-separated)h(strings)e(or)h(a)g(sequence)150 884 | |
8939 | y(expression)36 b(b)s(et)m(w)m(een)g(a)g(pair)g(of)g(braces,)i(follo)m | |
8940 | (w)m(ed)f(b)m(y)f(an)g(optional)h Fq(p)s(ostscript)r | |
8941 | Ft(.)56 b(The)36 b(pream)m(ble)g(is)150 994 y(pre\014xed)28 | |
122f603c CR |
8942 | b(to)h(eac)m(h)h(string)f(con)m(tained)h(within)e(the)h(braces,)g(and)g |
8943 | (the)g(p)s(ostscript)f(is)h(then)f(app)s(ended)f(to)150 | |
9f178efb CR |
8944 | 1103 y(eac)m(h)32 b(resulting)e(string,)h(expanding)e(left)j(to)f(righ) |
8945 | m(t.)275 1240 y(Brace)37 b(expansions)f(ma)m(y)h(b)s(e)f(nested.)59 | |
37c41ab1 | 8946 | b(The)36 b(results)g(of)h(eac)m(h)g(expanded)f(string)g(are)h(not)g |
9f178efb CR |
8947 | (sorted;)150 1350 y(left)31 b(to)g(righ)m(t)g(order)f(is)g(preserv)m |
8948 | (ed.)41 b(F)-8 b(or)31 b(example,)390 1486 y Fs(bash$)46 | |
8949 | b(echo)h(a{d,c,b}e)390 1596 y(ade)g(ace)g(abe)275 1733 | |
45c0f7f8 CR |
8950 | y Ft(A)20 b(sequence)h(expression)g(tak)m(es)h(the)f(form)f |
8951 | Fs({)p Fi(x)11 b Fs(..)p Fi(y)g Fs([..)p Fi(incr)g Fs(]})p | |
8952 | Ft(,)18 b(where)i Fq(x)27 b Ft(and)20 b Fq(y)28 b Ft(are)22 | |
9f178efb | 8953 | b(either)f(in)m(tegers)150 1842 y(or)42 b(single)h(c)m(haracters,)j |
45c0f7f8 | 8954 | (and)c Fq(incr)7 b Ft(,)44 b(an)e(optional)h(incremen)m(t,)j(is)c(an)g |
9f178efb | 8955 | (in)m(teger.)77 b(When)41 b(in)m(tegers)j(are)150 1952 |
45c0f7f8 CR |
8956 | y(supplied,)e(the)f(expression)g(expands)f(to)h(eac)m(h)h(n)m(um)m(b)s |
8957 | (er)e(b)s(et)m(w)m(een)h Fq(x)47 b Ft(and)40 b Fq(y)8 | |
9f178efb | 8958 | b Ft(,)44 b(inclusiv)m(e.)73 b(Supplied)150 2062 y(in)m(tegers)33 |
45c0f7f8 CR |
8959 | b(ma)m(y)e(b)s(e)g(pre\014xed)f(with)h(`)p Fs(0)p Ft(')h(to)g(force)g |
8960 | (eac)m(h)g(term)g(to)g(ha)m(v)m(e)g(the)g(same)g(width.)42 | |
9f178efb | 8961 | b(When)31 b(either)150 2171 y Fq(x)43 b Ft(or)36 b Fq(y)44 |
45c0f7f8 CR |
8962 | b Ft(b)s(egins)36 b(with)g(a)h(zero,)i(the)e(shell)g(attempts)g(to)g |
8963 | (force)g(all)h(generated)f(terms)g(to)g(con)m(tain)h(the)150 | |
9f178efb | 8964 | 2281 y(same)e(n)m(um)m(b)s(er)e(of)i(digits,)i(zero-padding)d(where)h |
45c0f7f8 | 8965 | (necessary)-8 b(.)57 b(When)35 b(c)m(haracters)i(are)f(supplied,)g(the) |
9f178efb | 8966 | 150 2390 y(expression)h(expands)f(to)i(eac)m(h)g(c)m(haracter)g |
45c0f7f8 | 8967 | (lexicographically)i(b)s(et)m(w)m(een)e Fq(x)43 b Ft(and)37 |
9f178efb | 8968 | b Fq(y)8 b Ft(,)38 b(inclusiv)m(e.)62 b(Note)150 2500 |
45c0f7f8 CR |
8969 | y(that)30 b(b)s(oth)e Fq(x)35 b Ft(and)28 b Fq(y)37 b |
8970 | Ft(m)m(ust)29 b(b)s(e)f(of)h(the)g(same)g(t)m(yp)s(e.)41 | |
74d0116b | 8971 | b(When)28 b(the)i(incremen)m(t)f(is)g(supplied,)f(it)i(is)f(used)f(as) |
9f178efb | 8972 | 150 2610 y(the)j(di\013erence)f(b)s(et)m(w)m(een)h(eac)m(h)h(term.)41 |
74d0116b | 8973 | b(The)30 b(default)g(incremen)m(t)h(is)g(1)f(or)h(-1)g(as)f |
9f178efb | 8974 | (appropriate.)275 2746 y(Brace)36 b(expansion)g(is)f(p)s(erformed)f(b)s |
9ec5ed66 | 8975 | (efore)h(an)m(y)h(other)g(expansions,)h(and)e(an)m(y)g(c)m(haracters)i |
9f178efb CR |
8976 | (sp)s(ecial)150 2856 y(to)32 b(other)g(expansions)g(are)g(preserv)m(ed) |
8977 | f(in)h(the)f(result.)45 b(It)32 b(is)g(strictly)g(textual.)46 | |
8978 | b(Bash)32 b(do)s(es)f(not)h(apply)150 2965 y(an)m(y)27 | |
9ec5ed66 CR |
8979 | b(syn)m(tactic)i(in)m(terpretation)g(to)f(the)f(con)m(text)i(of)e(the)g |
8980 | (expansion)g(or)g(the)h(text)g(b)s(et)m(w)m(een)f(the)h(braces.)150 | |
9f178efb | 8981 | 3075 y(T)-8 b(o)37 b(a)m(v)m(oid)g(con\015icts)g(with)f(parameter)h |
9ec5ed66 | 8982 | (expansion,)g(the)g(string)f(`)p Fs(${)p Ft(')g(is)g(not)g(considered)g |
9f178efb CR |
8983 | (eligible)i(for)150 3185 y(brace)31 b(expansion.)275 |
8984 | 3321 y(A)e(correctly-formed)i(brace)f(expansion)f(m)m(ust)h(con)m(tain) | |
8985 | h(unquoted)e(op)s(ening)g(and)g(closing)i(braces,)150 | |
8986 | 3431 y(and)h(at)i(least)g(one)f(unquoted)g(comma)g(or)g(a)h(v)-5 | |
9ec5ed66 | 8987 | b(alid)33 b(sequence)g(expression.)48 b(An)m(y)33 b(incorrectly)h |
9f178efb CR |
8988 | (formed)150 3541 y(brace)d(expansion)f(is)g(left)h(unc)m(hanged.)275 |
8989 | 3677 y(A)25 b Fs({)g Ft(or)g(`)p Fs(,)p Ft(')g(ma)m(y)h(b)s(e)f(quoted) | |
9ec5ed66 | 8990 | g(with)g(a)h(bac)m(kslash)f(to)h(prev)m(en)m(t)g(its)g(b)s(eing)f |
9f178efb | 8991 | (considered)g(part)g(of)g(a)h(brace)150 3787 y(expression.)51 |
9ec5ed66 CR |
8992 | b(T)-8 b(o)34 b(a)m(v)m(oid)i(con\015icts)e(with)g(parameter)g |
8993 | (expansion,)h(the)f(string)g(`)p Fs(${)p Ft(')g(is)g(not)g(considered) | |
9f178efb | 8994 | 150 3897 y(eligible)e(for)e(brace)h(expansion.)275 4033 |
9ec5ed66 CR |
8995 | y(This)f(construct)h(is)g(t)m(ypically)i(used)d(as)h(shorthand)f(when)g |
8996 | (the)h(common)g(pre\014x)f(of)h(the)g(strings)g(to)150 | |
9f178efb CR |
8997 | 4143 y(b)s(e)f(generated)h(is)g(longer)g(than)f(in)g(the)g(ab)s(o)m(v)m |
8998 | (e)i(example:)390 4280 y Fs(mkdir)46 b(/usr/local/src/bash/{old,n)o | |
8999 | (ew,)o(dist)o(,bug)o(s})275 4416 y Ft(or)390 4553 y Fs(chown)g(root)h | |
9ec5ed66 | 9000 | (/usr/{ucb/{ex,edit},lib/)o({ex?)o(.?*,)o(how)o(_ex})o(})150 |
9f178efb | 9001 | 4755 y Fj(3.5.2)63 b(Tilde)41 b(Expansion)150 4902 y |
9ec5ed66 CR |
9002 | Ft(If)29 b(a)h(w)m(ord)g(b)s(egins)f(with)g(an)h(unquoted)f(tilde)h(c)m |
9003 | (haracter)h(\(`)p Fs(~)p Ft('\),)g(all)g(of)f(the)g(c)m(haracters)h(up) | |
9f178efb | 9004 | d(to)j(the)f(\014rst)150 5011 y(unquoted)23 b(slash)h(\(or)h(all)g(c)m |
9ec5ed66 | 9005 | (haracters,)i(if)d(there)g(is)h(no)f(unquoted)f(slash\))h(are)h |
9f178efb | 9006 | (considered)f(a)g Fq(tilde-pre\014x)6 b Ft(.)150 5121 |
9ec5ed66 CR |
9007 | y(If)38 b(none)g(of)g(the)h(c)m(haracters)g(in)f(the)h(tilde-pre\014x)f |
9008 | (are)h(quoted,)h(the)f(c)m(haracters)h(in)d(the)i(tilde-pre\014x)150 | |
9f178efb | 9009 | 5230 y(follo)m(wing)28 b(the)f(tilde)g(are)g(treated)h(as)f(a)g(p)s |
9ec5ed66 | 9010 | (ossible)f Fq(login)i(name)5 b Ft(.)40 b(If)26 b(this)g(login)i(name)f |
9f178efb | 9011 | (is)f(the)h(n)m(ull)g(string,)150 5340 y(the)35 b(tilde)g(is)g |
9ec5ed66 CR |
9012 | (replaced)g(with)f(the)h(v)-5 b(alue)35 b(of)g(the)g |
9013 | Fs(HOME)e Ft(shell)i(v)-5 b(ariable.)54 b(If)34 b Fs(HOME)g | |
9f178efb CR |
9014 | Ft(is)h(unset,)g(the)g(home)p eop end |
9015 | %%Page: 22 28 | |
9016 | TeXDict begin 22 27 bop 150 -116 a Ft(22)2572 b(Bash)31 | |
9017 | b(Reference)g(Man)m(ual)150 299 y(directory)i(of)g(the)f(user)g | |
9ec5ed66 | 9018 | (executing)i(the)e(shell)h(is)f(substituted)g(instead.)47 |
9f178efb CR |
9019 | b(Otherwise,)33 b(the)g(tilde-pre\014x)150 408 y(is)d(replaced)h(with)f |
9020 | (the)h(home)f(directory)h(asso)s(ciated)h(with)e(the)h(sp)s(eci\014ed)e | |
9021 | (login)j(name.)275 545 y(If)g(the)h(tilde-pre\014x)f(is)h(`)p | |
9ec5ed66 CR |
9022 | Fs(~+)p Ft(',)g(the)g(v)-5 b(alue)33 b(of)g(the)g(shell)g(v)-5 |
9023 | b(ariable)34 b Fs(PWD)d Ft(replaces)j(the)f(tilde-pre\014x.)47 | |
9f178efb | 9024 | b(If)150 655 y(the)31 b(tilde-pre\014x)f(is)g(`)p Fs(~-)p |
9ec5ed66 CR |
9025 | Ft(',)h(the)f(v)-5 b(alue)31 b(of)g(the)f(shell)h(v)-5 |
9026 | b(ariable)31 b Fs(OLDPWD)p Ft(,)e(if)h(it)h(is)g(set,)g(is)f | |
9f178efb CR |
9027 | (substituted.)275 792 y(If)e(the)i(c)m(haracters)g(follo)m(wing)h(the)e |
9028 | (tilde)h(in)f(the)g(tilde-pre\014x)h(consist)f(of)h(a)f(n)m(um)m(b)s | |
9029 | (er)f Fq(N)10 b Ft(,)30 b(optionally)150 901 y(pre\014xed)22 | |
8e1a6eaa CR |
9030 | b(b)m(y)h(a)h(`)p Fs(+)p Ft(')f(or)h(a)f(`)p Fs(-)p Ft(',)j(the)d |
9031 | (tilde-pre\014x)g(is)h(replaced)f(with)g(the)h(corresp)s(onding)e | |
9f178efb | 9032 | (elemen)m(t)j(from)e(the)150 1011 y(directory)36 b(stac)m(k,)i(as)e(it) |
8e1a6eaa CR |
9033 | g(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m(y)g(the)f |
9034 | Fs(dirs)g Ft(builtin)g(in)m(v)m(ok)m(ed)i(with)e(the)g(c)m(haracters) | |
9f178efb | 9035 | 150 1121 y(follo)m(wing)40 b(tilde)f(in)g(the)f(tilde-pre\014x)h(as)g |
8e1a6eaa | 9036 | (an)f(argumen)m(t)h(\(see)h(Section)f(6.8)h([The)e(Directory)i(Stac)m |
9f178efb | 9037 | (k],)150 1230 y(page)c(89\).)57 b(If)35 b(the)g(tilde-pre\014x,)i(sans) |
8e1a6eaa | 9038 | e(the)h(tilde,)h(consists)f(of)g(a)f(n)m(um)m(b)s(er)f(without)i(a)f |
9f178efb CR |
9039 | (leading)h(`)p Fs(+)p Ft(')g(or)150 1340 y(`)p Fs(-)p |
9040 | Ft(',)31 b(`)p Fs(+)p Ft(')f(is)h(assumed.)275 1477 y(If)e(the)i(login) | |
8e1a6eaa CR |
9041 | g(name)g(is)f(in)m(v)-5 b(alid,)31 b(or)g(the)f(tilde)h(expansion)f |
9042 | (fails,)i(the)e(w)m(ord)g(is)h(left)g(unc)m(hanged.)275 | |
9f178efb | 9043 | 1614 y(Eac)m(h)38 b(v)-5 b(ariable)38 b(assignmen)m(t)h(is)e(c)m(hec)m |
8e1a6eaa | 9044 | (k)m(ed)j(for)d(unquoted)g(tilde-pre\014xes)h(immediately)g(follo)m |
9f178efb | 9045 | (wing)150 1723 y(a)d(`)p Fs(:)p Ft(')g(or)g(the)g(\014rst)f(`)p |
8e1a6eaa CR |
9046 | Fs(=)p Ft('.)54 b(In)34 b(these)h(cases,)i(tilde)e(expansion)g(is)g |
9047 | (also)h(p)s(erformed.)52 b(Consequen)m(tly)-8 b(,)37 | |
9f178efb | 9048 | b(one)150 1833 y(ma)m(y)29 b(use)e(\014lenames)h(with)g(tildes)g(in)g |
45c0f7f8 CR |
9049 | (assignmen)m(ts)g(to)h Fs(PATH)p Ft(,)f Fs(MAILPATH)p |
9050 | Ft(,)e(and)h Fs(CDPATH)p Ft(,)g(and)h(the)g(shell)150 | |
9f178efb | 9051 | 1942 y(assigns)j(the)f(expanded)g(v)-5 b(alue.)275 2079 |
45c0f7f8 | 9052 | y(The)29 b(follo)m(wing)j(table)g(sho)m(ws)e(ho)m(w)g(Bash)h(treats)g |
9f178efb CR |
9053 | (unquoted)e(tilde-pre\014xes:)150 2242 y Fs(~)432 b Ft(The)30 |
9054 | b(v)-5 b(alue)31 b(of)f Fs($HOME)150 2404 y(~/foo)240 | |
9055 | b Ft(`)p Fs($HOME/foo)p Ft(')150 2566 y Fs(~fred/foo)630 | |
9056 | 2676 y Ft(The)30 b(sub)s(directory)f Fs(foo)h Ft(of)g(the)h(home)f | |
9057 | (directory)h(of)g(the)f(user)g Fs(fred)150 2837 y(~+/foo)192 | |
9058 | b Ft(`)p Fs($PWD/foo)p Ft(')150 2999 y Fs(~-/foo)g Ft(`)p | |
9059 | Fs(${OLDPWD-'~-'}/foo)p Ft(')150 3161 y Fs(~)p Fi(N)384 | |
122f603c | 9060 | b Ft(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m |
9f178efb CR |
9061 | (y)f(`)p Fs(dirs)g(+)p Fi(N)11 b Ft(')150 3323 y Fs(~+)p |
9062 | Fi(N)336 b Ft(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m | |
9063 | (ed)h(b)m(y)f(`)p Fs(dirs)g(+)p Fi(N)11 b Ft(')150 3485 | |
9064 | y Fs(~-)p Fi(N)336 b Ft(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g | |
9065 | (displa)m(y)m(ed)h(b)m(y)f(`)p Fs(dirs)g(-)p Fi(N)11 | |
9066 | b Ft(')150 3686 y Fj(3.5.3)63 b(Shell)41 b(P)m(arameter)f(Expansion)150 | |
9067 | 3833 y Ft(The)g(`)p Fs($)p Ft(')h(c)m(haracter)i(in)m(tro)s(duces)d | |
9068 | (parameter)h(expansion,)j(command)d(substitution,)i(or)e(arithmetic)150 | |
9069 | 3943 y(expansion.)d(The)22 b(parameter)h(name)f(or)g(sym)m(b)s(ol)h(to) | |
9070 | g(b)s(e)e(expanded)h(ma)m(y)h(b)s(e)f(enclosed)h(in)f(braces,)i(whic)m | |
9071 | (h)150 4053 y(are)31 b(optional)g(but)f(serv)m(e)h(to)h(protect)f(the)g | |
9072 | (v)-5 b(ariable)31 b(to)g(b)s(e)f(expanded)g(from)g(c)m(haracters)i | |
9073 | (immediately)150 4162 y(follo)m(wing)g(it)f(whic)m(h)f(could)g(b)s(e)g | |
9074 | (in)m(terpreted)h(as)f(part)h(of)f(the)h(name.)275 4299 | |
c302751c CR |
9075 | y(When)44 b(braces)i(are)f(used,)j(the)e(matc)m(hing)g(ending)f(brace)g |
9076 | (is)g(the)g(\014rst)g(`)p Fs(})p Ft(')g(not)g(escap)s(ed)h(b)m(y)f(a) | |
9f178efb | 9077 | 150 4409 y(bac)m(kslash)40 b(or)f(within)g(a)g(quoted)g(string,)j(and)c |
c302751c | 9078 | (not)i(within)e(an)h(em)m(b)s(edded)f(arithmetic)j(expansion,)150 |
9f178efb CR |
9079 | 4518 y(command)30 b(substitution,)g(or)h(parameter)g(expansion.)275 |
9080 | 4655 y(The)40 b(basic)h(form)g(of)g(parameter)h(expansion)e(is)h($)p | |
37c41ab1 | 9081 | Fs({)p Fq(parameter)7 b Fs(})p Ft(.)73 b(The)40 b(v)-5 |
9f178efb CR |
9082 | b(alue)42 b(of)f Fq(parameter)48 b Ft(is)150 4765 y(substituted.)43 |
9083 | b(The)31 b Fq(parameter)39 b Ft(is)31 b(a)h(shell)f(parameter)h(as)g | |
9084 | (describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g(3.4)h([Shell)150 | |
9085 | 4874 y(P)m(arameters],)e(page)f(18\))h(or)e(an)g(arra)m(y)h(reference)f | |
9086 | (\(see)i(Section)f(6.7)g([Arra)m(ys],)g(page)g(88\).)42 | |
9087 | b(The)29 b(braces)150 4984 y(are)j(required)g(when)f | |
9088 | Fq(parameter)39 b Ft(is)32 b(a)h(p)s(ositional)f(parameter)h(with)f | |
9089 | (more)g(than)g(one)g(digit,)i(or)e(when)150 5093 y Fq(parameter)37 | |
9090 | b Ft(is)31 b(follo)m(w)m(ed)h(b)m(y)e(a)h(c)m(haracter)h(that)f(is)f | |
9091 | (not)h(to)g(b)s(e)f(in)m(terpreted)g(as)h(part)f(of)h(its)f(name.)275 | |
9092 | 5230 y(If)36 b(the)h(\014rst)f(c)m(haracter)i(of)f Fq(parameter)44 | |
9093 | b Ft(is)37 b(an)f(exclamation)j(p)s(oin)m(t)e(\(!\),)i(it)f(in)m(tro)s | |
9094 | (duces)e(a)h(lev)m(el)i(of)150 5340 y(v)-5 b(ariable)31 | |
9095 | b(indirection.)41 b(Bash)30 b(uses)f(the)h(v)-5 b(alue)31 | |
9096 | b(of)f(the)g(v)-5 b(ariable)30 b(formed)g(from)f(the)h(rest)g(of)g | |
9097 | Fq(parameter)p eop end | |
45c0f7f8 CR |
9098 | %%Page: 23 29 |
9099 | TeXDict begin 23 28 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9100 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(23)150 299 | |
9f178efb CR |
9101 | y(as)26 b(the)g(name)g(of)g(the)h(v)-5 b(ariable;)28 |
9102 | b(this)e(v)-5 b(ariable)27 b(is)f(then)f(expanded)g(and)h(that)g(v)-5 | |
9103 | b(alue)27 b(is)f(used)f(in)h(the)g(rest)150 408 y(of)34 | |
9104 | b(the)f(substitution,)i(rather)e(than)g(the)h(v)-5 b(alue)34 | |
9105 | b(of)g Fq(parameter)40 b Ft(itself.)51 b(This)33 b(is)g(kno)m(wn)g(as)h | |
9106 | Fs(indirect)150 518 y(expansion)p Ft(.)81 b(The)44 b(exceptions)i(to)f | |
9107 | (this)g(are)g(the)g(expansions)f(of)h($)p Fs({)p Ft(!)p | |
9108 | Fq(pre\014x)6 b Ft(*)p Fs(})44 b Ft(and)g($)p Fs({)p | |
9109 | Ft(!)p Fq(name)5 b Ft([)p Fs(@)p Ft(])p Fs(})150 628 | |
9110 | y Ft(describ)s(ed)28 b(b)s(elo)m(w.)41 b(The)28 b(exclamation)j(p)s | |
9111 | (oin)m(t)f(m)m(ust)f(immediately)h(follo)m(w)g(the)g(left)f(brace)h(in) | |
9112 | f(order)f(to)150 737 y(in)m(tro)s(duce)i(indirection.)275 | |
9113 | 870 y(In)39 b(eac)m(h)i(of)g(the)f(cases)h(b)s(elo)m(w,)i | |
9114 | Fq(w)m(ord)h Ft(is)c(sub)5 b(ject)40 b(to)h(tilde)f(expansion,)j | |
9115 | (parameter)e(expansion,)150 980 y(command)30 b(substitution,)g(and)g | |
9116 | (arithmetic)i(expansion.)275 1113 y(When)h(not)h(p)s(erforming)e | |
9117 | (substring)h(expansion,)h(using)g(the)f(form)h(describ)s(ed)e(b)s(elo)m | |
9118 | (w)i(\(e.g.,)i(`)p Fs(:-)p Ft('\),)150 1223 y(Bash)d(tests)h(for)e(a)i | |
9119 | (parameter)f(that)h(is)e(unset)h(or)g(n)m(ull.)48 b(Omitting)33 | |
9120 | b(the)h(colon)f(results)g(in)g(a)g(test)h(only)150 1332 | |
9121 | y(for)c(a)i(parameter)f(that)g(is)g(unset.)41 b(Put)31 | |
9122 | b(another)f(w)m(a)m(y)-8 b(,)33 b(if)e(the)f(colon)i(is)f(included,)f | |
9123 | (the)h(op)s(erator)g(tests)150 1442 y(for)36 b(b)s(oth)g | |
9124 | Fq(parameter)7 b Ft('s)37 b(existence)h(and)e(that)i(its)f(v)-5 | |
9125 | b(alue)37 b(is)g(not)f(n)m(ull;)k(if)d(the)g(colon)h(is)e(omitted,)k | |
9126 | (the)150 1551 y(op)s(erator)31 b(tests)g(only)f(for)g(existence.)150 | |
9127 | 1708 y Fs(${)p Fi(parameter)11 b Fs(:)p Fp(\000)p Fi(word)g | |
9128 | Fs(})630 1817 y Ft(If)30 b Fq(parameter)37 b Ft(is)30 | |
9129 | b(unset)g(or)h(n)m(ull,)f(the)h(expansion)f(of)g Fq(w)m(ord)k | |
9130 | Ft(is)c(substituted.)40 b(Otherwise,)630 1927 y(the)31 | |
9131 | b(v)-5 b(alue)30 b(of)h Fq(parameter)37 b Ft(is)31 b(substituted.)150 | |
9132 | 2084 y Fs(${)p Fi(parameter)11 b Fs(:=)p Fi(word)g Fs(})630 | |
9133 | 2193 y Ft(If)32 b Fq(parameter)40 b Ft(is)32 b(unset)g(or)h(n)m(ull,)g | |
9134 | (the)f(expansion)h(of)f Fq(w)m(ord)k Ft(is)d(assigned)f(to)i | |
9135 | Fq(parameter)7 b Ft(.)630 2303 y(The)30 b(v)-5 b(alue)32 | |
9136 | b(of)f Fq(parameter)38 b Ft(is)31 b(then)g(substituted.)42 | |
9137 | b(P)m(ositional)33 b(parameters)e(and)f(sp)s(ecial)630 | |
9138 | 2412 y(parameters)h(ma)m(y)g(not)f(b)s(e)g(assigned)h(to)g(in)f(this)g | |
9139 | (w)m(a)m(y)-8 b(.)150 2569 y Fs(${)p Fi(parameter)11 | |
9140 | b Fs(:?)p Fi(word)g Fs(})630 2679 y Ft(If)26 b Fq(parameter)33 | |
9141 | b Ft(is)26 b(n)m(ull)g(or)g(unset,)h(the)f(expansion)g(of)g | |
9142 | Fq(w)m(ord)k Ft(\(or)c(a)h(message)g(to)g(that)f(e\013ect)630 | |
9143 | 2788 y(if)i Fq(w)m(ord)j Ft(is)d(not)g(presen)m(t\))h(is)f(written)g | |
9144 | (to)h(the)f(standard)f(error)h(and)f(the)h(shell,)h(if)f(it)h(is)f(not) | |
9145 | 630 2898 y(in)m(teractiv)m(e,)33 b(exits.)42 b(Otherwise,)30 | |
9146 | b(the)h(v)-5 b(alue)31 b(of)f Fq(parameter)38 b Ft(is)30 | |
9147 | b(substituted.)150 3054 y Fs(${)p Fi(parameter)11 b Fs(:+)p | |
9148 | Fi(word)g Fs(})630 3164 y Ft(If)35 b Fq(parameter)42 | |
122f603c | 9149 | b Ft(is)36 b(n)m(ull)f(or)h(unset,)g(nothing)g(is)f(substituted,)i |
9f178efb CR |
9150 | (otherwise)e(the)h(expansion)630 3273 y(of)31 b Fq(w)m(ord)i |
9151 | Ft(is)e(substituted.)150 3430 y Fs(${)p Fi(parameter)11 | |
9152 | b Fs(:)p Fi(offset)g Fs(})150 3540 y(${)p Fi(parameter)g | |
c302751c | 9153 | Fs(:)p Fi(offset)g Fs(:)p Fi(le)o(ngt)o(h)g Fs(})630 |
9f178efb CR |
9154 | 3649 y Ft(This)30 b(is)h(referred)f(to)h(as)g(Substring)f(Expansion.)41 |
9155 | b(It)31 b(expands)f(to)h(up)f(to)h Fq(length)g Ft(c)m(harac-)630 | |
9156 | 3759 y(ters)k(of)g(the)g(v)-5 b(alue)35 b(of)h Fq(parameter)41 | |
9157 | b Ft(starting)36 b(at)g(the)f(c)m(haracter)h(sp)s(eci\014ed)e(b)m(y)h | |
9158 | Fq(o\013set)r Ft(.)55 b(If)630 3868 y Fq(parameter)32 | |
9159 | b Ft(is)26 b(`)p Fs(@)p Ft(',)g(an)f(indexed)g(arra)m(y)h(subscripted)e | |
9160 | (b)m(y)h(`)p Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)g(or)g(an)f(asso)s | |
9161 | (ciativ)m(e)j(ar-)630 3978 y(ra)m(y)g(name,)h(the)f(results)g(di\013er) | |
9162 | g(as)g(describ)s(ed)f(b)s(elo)m(w.)40 b(If)28 b Fq(length)g | |
9163 | Ft(is)g(omitted,)i(it)f(expands)630 4088 y(to)e(the)g(substring)f(of)g | |
9164 | (the)h(v)-5 b(alue)27 b(of)g Fq(parameter)33 b Ft(starting)28 | |
9165 | b(at)f(the)g(c)m(haracter)h(sp)s(eci\014ed)e(b)m(y)630 | |
9166 | 4197 y Fq(o\013set)37 b Ft(and)d(extending)g(to)h(the)f(end)g(of)g(the) | |
9167 | g(v)-5 b(alue.)53 b Fq(length)34 b Ft(and)g Fq(o\013set)j | |
9168 | Ft(are)e(arithmetic)630 4307 y(expressions)30 b(\(see)h(Section)g(6.5)h | |
9169 | ([Shell)e(Arithmetic],)i(page)f(86\).)630 4440 y(If)39 | |
9170 | b Fq(o\013set)k Ft(ev)-5 b(aluates)41 b(to)f(a)g(n)m(um)m(b)s(er)f | |
9171 | (less)h(than)f(zero,)k(the)d(v)-5 b(alue)40 b(is)g(used)e(as)i(an)g | |
9172 | (o\013set)630 4549 y(in)33 b(c)m(haracters)i(from)d(the)i(end)e(of)i | |
9173 | (the)f(v)-5 b(alue)34 b(of)f Fq(parameter)7 b Ft(.)49 | |
9174 | b(If)33 b Fq(length)h Ft(ev)-5 b(aluates)35 b(to)f(a)630 | |
9175 | 4659 y(n)m(um)m(b)s(er)23 b(less)h(than)g(zero,)j(it)d(is)h(in)m | |
9176 | (terpreted)f(as)g(an)h(o\013set)g(in)f(c)m(haracters)h(from)f(the)g | |
9177 | (end)g(of)630 4769 y(the)31 b(v)-5 b(alue)31 b(of)g Fq(parameter)38 | |
9178 | b Ft(rather)30 b(than)h(a)g(n)m(um)m(b)s(er)f(of)g(c)m(haracters,)j | |
9179 | (and)d(the)h(expansion)630 4878 y(is)39 b(the)g(c)m(haracters)i(b)s(et) | |
9180 | m(w)m(een)f Fq(o\013set)i Ft(and)c(that)i(result.)67 | |
9181 | b(Note)40 b(that)g(a)g(negativ)m(e)h(o\013set)630 4988 | |
9182 | y(m)m(ust)27 b(b)s(e)g(separated)g(from)g(the)g(colon)i(b)m(y)e(at)h | |
9183 | (least)g(one)f(space)h(to)g(a)m(v)m(oid)h(b)s(eing)e(confused)630 | |
9184 | 5097 y(with)j(the)h(`)p Fs(:-)p Ft(')f(expansion.)630 | |
9185 | 5230 y(Here)43 b(are)g(some)f(examples)h(illustrating)g(substring)f | |
9186 | (expansion)g(on)g(parameters)h(and)630 5340 y(subscripted)29 | |
9187 | b(arra)m(ys:)p eop end | |
9188 | %%Page: 24 30 | |
9189 | TeXDict begin 24 29 bop 150 -116 a Ft(24)2572 b(Bash)31 | |
9190 | b(Reference)g(Man)m(ual)630 299 y Fs($)47 b(string=01234567890abcdefgh) | |
9191 | 630 408 y($)g(echo)g(${string:7})630 518 y(7890abcdefgh)630 | |
9192 | 628 y($)g(echo)g(${string:7:0})630 847 y($)g(echo)g(${string:7:2})630 | |
9193 | 956 y(78)630 1066 y($)g(echo)g(${string:7:-2})630 1176 | |
9194 | y(7890abcdef)630 1285 y($)g(echo)g(${string:)e(-7})630 | |
9195 | 1395 y(bcdefgh)630 1504 y($)i(echo)g(${string:)e(-7:0})630 | |
9196 | 1724 y($)i(echo)g(${string:)e(-7:2})630 1833 y(bc)630 | |
9197 | 1943 y($)i(echo)g(${string:)e(-7:-2})630 2052 y(bcdef)630 | |
9198 | 2162 y($)i(set)g(--)h(01234567890abcdefgh)630 2271 y($)f(echo)g(${1:7}) | |
9199 | 630 2381 y(7890abcdefgh)630 2491 y($)g(echo)g(${1:7:0})630 | |
9200 | 2710 y($)g(echo)g(${1:7:2})630 2819 y(78)630 2929 y($)g(echo)g | |
9201 | (${1:7:-2})630 3039 y(7890abcdef)630 3148 y($)g(echo)g(${1:)g(-7})630 | |
9202 | 3258 y(bcdefgh)630 3367 y($)g(echo)g(${1:)g(-7:0})630 | |
9203 | 3587 y($)g(echo)g(${1:)g(-7:2})630 3696 y(bc)630 3806 | |
9204 | y($)g(echo)g(${1:)g(-7:-2})630 3915 y(bcdef)630 4025 | |
9205 | y($)g(array[0]=01234567890abcdef)o(gh)630 4134 y($)g(echo)g | |
9206 | (${array[0]:7})630 4244 y(7890abcdefgh)630 4354 y($)g(echo)g | |
9207 | (${array[0]:7:0})630 4573 y($)g(echo)g(${array[0]:7:2})630 | |
9208 | 4682 y(78)630 4792 y($)g(echo)g(${array[0]:7:-2})630 | |
9209 | 4902 y(7890abcdef)630 5011 y($)g(echo)g(${array[0]:)e(-7})630 | |
9210 | 5121 y(bcdefgh)630 5230 y($)i(echo)g(${array[0]:)e(-7:0})p | |
9211 | eop end | |
9212 | %%Page: 25 31 | |
9213 | TeXDict begin 25 30 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9214 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(25)630 299 | |
9215 | y Fs($)47 b(echo)g(${array[0]:)e(-7:2})630 408 y(bc)630 | |
9216 | 518 y($)i(echo)g(${array[0]:)e(-7:-2})630 628 y(bcdef)630 | |
9217 | 756 y Ft(If)22 b Fq(parameter)30 b Ft(is)23 b(`)p Fs(@)p | |
9218 | Ft(',)i(the)e(result)f(is)h Fq(length)g Ft(p)s(ositional)h(parameters)f | |
9219 | (b)s(eginning)f(at)i Fq(o\013set)r Ft(.)630 865 y(A)36 | |
9220 | b(negativ)m(e)j Fq(o\013set)g Ft(is)e(tak)m(en)g(relativ)m(e)i(to)e | |
9221 | (one)g(greater)g(than)f(the)h(greatest)h(p)s(ositional)630 | |
9222 | 975 y(parameter,)29 b(so)f(an)g(o\013set)h(of)f(-1)g(ev)-5 | |
9223 | b(aluates)30 b(to)e(the)g(last)h(p)s(ositional)g(parameter.)40 | |
9224 | b(It)28 b(is)g(an)630 1084 y(expansion)i(error)g(if)h | |
9225 | Fq(length)f Ft(ev)-5 b(aluates)32 b(to)f(a)g(n)m(um)m(b)s(er)e(less)i | |
9226 | (than)f(zero.)630 1212 y(The)i(follo)m(wing)i(examples)f(illustrate)h | |
9227 | (substring)d(expansion)i(using)f(p)s(ositional)h(param-)630 | |
9228 | 1322 y(eters:)630 1450 y Fs($)47 b(set)g(--)h(1)f(2)g(3)h(4)f(5)h(6)f | |
9229 | (7)h(8)f(9)h(0)f(a)h(b)f(c)g(d)h(e)f(f)h(g)f(h)630 1559 | |
9230 | y($)g(echo)g(${@:7})630 1669 y(7)g(8)h(9)f(0)h(a)f(b)h(c)f(d)h(e)f(f)h | |
9231 | (g)f(h)630 1778 y($)g(echo)g(${@:7:0})630 1998 y($)g(echo)g(${@:7:2}) | |
9232 | 630 2107 y(7)g(8)630 2217 y($)g(echo)g(${@:7:-2})630 | |
9233 | 2326 y(bash:)f(-2:)h(substring)f(expression)f(<)i(0)630 | |
9234 | 2436 y($)g(echo)g(${@:)g(-7:2})630 2545 y(b)g(c)630 2655 | |
9235 | y($)g(echo)g(${@:0})630 2765 y(./bash)f(1)i(2)f(3)g(4)h(5)f(6)h(7)f(8)h | |
9236 | (9)f(0)h(a)f(b)h(c)f(d)g(e)h(f)f(g)h(h)630 2874 y($)f(echo)g(${@:0:2}) | |
9237 | 630 2984 y(./bash)f(1)630 3093 y($)h(echo)g(${@:)g(-7:0})630 | |
9238 | 3331 y Ft(If)36 b Fq(parameter)43 b Ft(is)36 b(an)g(indexed)g(arra)m(y) | |
9239 | g(name)g(subscripted)f(b)m(y)h(`)p Fs(@)p Ft(')g(or)h(`)p | |
9240 | Fs(*)p Ft(',)h(the)e(result)g(is)630 3440 y(the)h Fq(length)g | |
7d92f73f CR |
9241 | Ft(mem)m(b)s(ers)f(of)h(the)g(arra)m(y)g(b)s(eginning)f(with)h |
9242 | Fs(${)p Fi(parameter)11 b Fs([)p Fi(offset)g Fs(])o(})p | |
9f178efb | 9243 | Ft(.)54 b(A)630 3550 y(negativ)m(e)33 b Fq(o\013set)g |
7d92f73f | 9244 | Ft(is)e(tak)m(en)h(relativ)m(e)g(to)g(one)f(greater)g(than)g(the)f |
9f178efb CR |
9245 | (maxim)m(um)h(index)f(of)h(the)630 3660 y(sp)s(eci\014ed)38 |
9246 | b(arra)m(y)-8 b(.)65 b(It)38 b(is)g(an)h(expansion)f(error)f(if)i | |
9247 | Fq(length)f Ft(ev)-5 b(aluates)40 b(to)f(a)g(n)m(um)m(b)s(er)e(less)630 | |
9248 | 3769 y(than)30 b(zero.)630 3897 y(These)23 b(examples)i(sho)m(w)e(ho)m | |
9249 | (w)h(y)m(ou)g(can)g(use)f(substring)f(expansion)i(with)f(indexed)g | |
9250 | (arra)m(ys:)630 4025 y Fs($)47 b(array=\(0)f(1)h(2)h(3)f(4)h(5)f(6)h(7) | |
9251 | f(8)h(9)f(0)h(a)f(b)g(c)h(d)f(e)h(f)f(g)h(h\))630 4134 | |
9252 | y($)f(echo)g(${array[@]:7})630 4244 y(7)g(8)h(9)f(0)h(a)f(b)h(c)f(d)h | |
9253 | (e)f(f)h(g)f(h)630 4354 y($)g(echo)g(${array[@]:7:2})630 | |
9254 | 4463 y(7)g(8)630 4573 y($)g(echo)g(${array[@]:)e(-7:2})630 | |
9255 | 4682 y(b)i(c)630 4792 y($)g(echo)g(${array[@]:)e(-7:-2})630 | |
9256 | 4902 y(bash:)h(-2:)h(substring)f(expression)f(<)i(0)630 | |
9257 | 5011 y($)g(echo)g(${array[@]:0})630 5121 y(0)g(1)h(2)f(3)h(4)f(5)h(6)f | |
9258 | (7)h(8)f(9)h(0)f(a)g(b)h(c)f(d)h(e)f(f)h(g)f(h)630 5230 | |
9259 | y($)g(echo)g(${array[@]:0:2})630 5340 y(0)g(1)p eop end | |
9260 | %%Page: 26 32 | |
9261 | TeXDict begin 26 31 bop 150 -116 a Ft(26)2572 b(Bash)31 | |
9262 | b(Reference)g(Man)m(ual)630 299 y Fs($)47 b(echo)g(${array[@]:)e(-7:0}) | |
9263 | 630 536 y Ft(Substring)25 b(expansion)g(applied)h(to)h(an)f(asso)s | |
9264 | (ciativ)m(e)j(arra)m(y)d(pro)s(duces)f(unde\014ned)f(results.)630 | |
9265 | 664 y(Substring)32 b(indexing)i(is)f(zero-based)i(unless)e(the)h(p)s | |
9266 | (ositional)g(parameters)g(are)g(used,)g(in)630 774 y(whic)m(h)29 | |
9267 | b(case)i(the)f(indexing)g(starts)g(at)g(1)g(b)m(y)g(default.)41 | |
9268 | b(If)29 b Fq(o\013set)k Ft(is)d(0,)g(and)f(the)h(p)s(ositional)630 | |
9269 | 883 y(parameters)h(are)f(used,)g Fs($@)g Ft(is)g(pre\014xed)g(to)h(the) | |
9270 | f(list.)150 1029 y Fs(${!)p Fi(prefix)11 b Fs(*})150 | |
9271 | 1139 y(${!)p Fi(prefix)g Fs(@})630 1249 y Ft(Expands)23 | |
220537f2 CR |
9272 | b(to)i(the)g(names)f(of)h(v)-5 b(ariables)25 b(whose)f(names)g(b)s |
9273 | (egin)g(with)g Fq(pre\014x)6 b Ft(,)25 b(separated)g(b)m(y)630 | |
9f178efb | 9274 | 1358 y(the)k(\014rst)f(c)m(haracter)j(of)e(the)g Fs(IFS)f |
4a8bb13f | 9275 | Ft(sp)s(ecial)i(v)-5 b(ariable.)41 b(When)29 b(`)p Fs(@)p |
9f178efb | 9276 | Ft(')g(is)g(used)f(and)h(the)g(expan-)630 1468 y(sion)35 |
4a8bb13f CR |
9277 | b(app)s(ears)g(within)f(double)h(quotes,)i(eac)m(h)f(v)-5 |
9278 | b(ariable)36 b(name)f(expands)g(to)g(a)h(separate)630 | |
9f178efb CR |
9279 | 1577 y(w)m(ord.)150 1724 y Fs(${!)p Fi(name)11 b Fs([@]})150 |
9280 | 1833 y(${!)p Fi(name)g Fs([*]})630 1943 y Ft(If)26 b | |
d3ad40de CR |
9281 | Fq(name)32 b Ft(is)27 b(an)f(arra)m(y)h(v)-5 b(ariable,)29 |
9282 | b(expands)d(to)h(the)g(list)g(of)g(arra)m(y)g(indices)g(\(k)m(eys\))h | |
9f178efb | 9283 | (assigned)630 2052 y(in)c Fq(name)5 b Ft(.)39 b(If)23 |
c302751c CR |
9284 | b Fq(name)30 b Ft(is)24 b(not)g(an)g(arra)m(y)-8 b(,)27 |
9285 | b(expands)c(to)i(0)f(if)h Fq(name)k Ft(is)24 b(set)h(and)e(n)m(ull)h | |
9f178efb | 9286 | (otherwise.)630 2162 y(When)39 b(`)p Fs(@)p Ft(')h(is)f(used)g(and)f |
45c0f7f8 | 9287 | (the)i(expansion)f(app)s(ears)g(within)f(double)h(quotes,)k(eac)m(h)d |
9f178efb CR |
9288 | (k)m(ey)630 2271 y(expands)30 b(to)h(a)f(separate)i(w)m(ord.)150 |
9289 | 2418 y Fs(${#)p Fi(parameter)11 b Fs(})630 2527 y Ft(The)40 | |
122f603c CR |
9290 | b(length)g(in)g(c)m(haracters)i(of)e(the)h(expanded)e(v)-5 |
9291 | b(alue)41 b(of)f Fq(parameter)47 b Ft(is)40 b(substituted.)630 | |
9f178efb | 9292 | 2637 y(If)i Fq(parameter)50 b Ft(is)43 b(`)p Fs(*)p Ft(')g(or)g(`)p |
122f603c | 9293 | Fs(@)p Ft(',)k(the)c(v)-5 b(alue)43 b(substituted)f(is)h(the)g(n)m(um)m |
9f178efb | 9294 | (b)s(er)f(of)h(p)s(ositional)630 2746 y(parameters.)i(If)32 |
122f603c CR |
9295 | b Fq(parameter)38 b Ft(is)32 b(an)g(arra)m(y)g(name)g(subscripted)f(b)m |
9296 | (y)g(`)p Fs(*)p Ft(')h(or)g(`)p Fs(@)p Ft(',)g(the)g(v)-5 | |
9f178efb CR |
9297 | b(alue)630 2856 y(substituted)30 b(is)g(the)h(n)m(um)m(b)s(er)e(of)h |
9298 | (elemen)m(ts)i(in)e(the)h(arra)m(y)-8 b(.)150 3002 y | |
9299 | Fs(${)p Fi(parameter)11 b Fs(#)p Fi(word)g Fs(})150 3112 | |
9300 | y(${)p Fi(parameter)g Fs(##)p Fi(word)g Fs(})630 3221 | |
9301 | y Ft(The)31 b Fq(w)m(ord)k Ft(is)d(expanded)f(to)i(pro)s(duce)e(a)h | |
9302 | (pattern)g(just)f(as)i(in)e(\014lename)h(expansion)g(\(see)630 | |
9303 | 3331 y(Section)k(3.5.8)h([Filename)g(Expansion],)g(page)f(29\).)56 | |
9304 | b(If)35 b(the)h(pattern)f(matc)m(hes)i(the)e(b)s(e-)630 | |
9305 | 3440 y(ginning)g(of)g(the)g(expanded)f(v)-5 b(alue)36 | |
9306 | b(of)f Fq(parameter)7 b Ft(,)36 b(then)f(the)g(result)g(of)g(the)g | |
9307 | (expansion)630 3550 y(is)28 b(the)g(expanded)e(v)-5 b(alue)28 | |
9308 | b(of)g Fq(parameter)35 b Ft(with)27 b(the)h(shortest)g(matc)m(hing)h | |
9309 | (pattern)f(\(the)g(`)p Fs(#)p Ft(')630 3660 y(case\))e(or)f(the)g | |
9310 | (longest)g(matc)m(hing)h(pattern)f(\(the)g(`)p Fs(##)p | |
9ec5ed66 | 9311 | Ft(')g(case\))h(deleted.)39 b(If)24 b Fq(parameter)32 |
9f178efb | 9312 | b Ft(is)25 b(`)p Fs(@)p Ft(')630 3769 y(or)j(`)p Fs(*)p |
9ec5ed66 CR |
9313 | Ft(',)i(the)e(pattern)h(remo)m(v)-5 b(al)29 b(op)s(eration)g(is)f |
9314 | (applied)h(to)g(eac)m(h)g(p)s(ositional)g(parameter)g(in)630 | |
9f178efb | 9315 | 3879 y(turn,)i(and)g(the)h(expansion)g(is)g(the)g(resultan)m(t)g(list.) |
9ec5ed66 | 9316 | 45 b(If)32 b Fq(parameter)38 b Ft(is)32 b(an)g(arra)m(y)g(v)-5 |
9f178efb | 9317 | b(ariable)630 3988 y(subscripted)39 b(with)g(`)p Fs(@)p |
9ec5ed66 CR |
9318 | Ft(')h(or)g(`)p Fs(*)p Ft(',)j(the)d(pattern)h(remo)m(v)-5 |
9319 | b(al)41 b(op)s(eration)f(is)g(applied)g(to)h(eac)m(h)630 | |
9f178efb CR |
9320 | 4098 y(mem)m(b)s(er)30 b(of)g(the)h(arra)m(y)g(in)f(turn,)f(and)h(the)h |
9321 | (expansion)f(is)g(the)h(resultan)m(t)g(list.)150 4244 | |
c302751c | 9322 | y Fs(${)p Fi(parameter)11 b Fs(\045)p Fi(word)g Fs(})150 |
9f178efb CR |
9323 | 4354 y(${)p Fi(parameter)g Fs(\045\045)p Fi(word)g Fs(})630 |
9324 | 4463 y Ft(The)35 b Fq(w)m(ord)k Ft(is)c(expanded)g(to)h(pro)s(duce)e(a) | |
7d92f73f | 9325 | i(pattern)f(just)g(as)h(in)f(\014lename)h(expansion.)55 |
9f178efb | 9326 | b(If)630 4573 y(the)43 b(pattern)f(matc)m(hes)i(a)e(trailing)i(p)s |
c302751c | 9327 | (ortion)e(of)g(the)h(expanded)e(v)-5 b(alue)43 b(of)g |
9f178efb | 9328 | Fq(parameter)7 b Ft(,)630 4682 y(then)39 b(the)g(result)g(of)h(the)f |
37c41ab1 | 9329 | (expansion)g(is)h(the)f(v)-5 b(alue)40 b(of)f Fq(parameter)46 |
9f178efb | 9330 | b Ft(with)39 b(the)h(shortest)630 4792 y(matc)m(hing)31 |
37c41ab1 | 9331 | b(pattern)e(\(the)h(`)p Fs(\045)p Ft(')g(case\))h(or)e(the)h(longest)h |
9d2b70f0 | 9332 | (matc)m(hing)f(pattern)g(\(the)g(`)p Fs(\045\045)p Ft(')g(case\))630 |
9f178efb | 9333 | 4902 y(deleted.)49 b(If)32 b Fq(parameter)40 b Ft(is)33 |
9d2b70f0 | 9334 | b(`)p Fs(@)p Ft(')g(or)g(`)p Fs(*)p Ft(',)h(the)f(pattern)g(remo)m(v)-5 |
9f178efb | 9335 | b(al)34 b(op)s(eration)g(is)f(applied)f(to)630 5011 y(eac)m(h)38 |
eb2bb562 | 9336 | b(p)s(ositional)g(parameter)g(in)f(turn,)h(and)e(the)h(expansion)g(is)h |
9f178efb | 9337 | (the)f(resultan)m(t)h(list.)61 b(If)630 5121 y Fq(parameter)38 |
eb2bb562 CR |
9338 | b Ft(is)32 b(an)f(arra)m(y)h(v)-5 b(ariable)32 b(subscripted)e(with)h |
9339 | (`)p Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)g(the)f(pattern)h(remo)m(v)-5 | |
9f178efb | 9340 | b(al)630 5230 y(op)s(eration)30 b(is)g(applied)f(to)i(eac)m(h)g(mem)m |
220537f2 | 9341 | (b)s(er)e(of)h(the)g(arra)m(y)g(in)f(turn,)g(and)g(the)h(expansion)g |
9f178efb CR |
9342 | (is)630 5340 y(the)h(resultan)m(t)g(list.)p eop end |
9343 | %%Page: 27 33 | |
9344 | TeXDict begin 27 32 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9345 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(27)150 299 | |
9346 | y Fs(${)p Fi(parameter)11 b Fs(/)p Fi(pattern)g Fs(/)p | |
9347 | Fi(s)o(tri)o(ng)f Fs(})630 408 y Ft(The)37 b Fq(pattern)g | |
e1e48bba | 9348 | Ft(is)g(expanded)g(to)h(pro)s(duce)e(a)h(pattern)g(just)g(as)h(in)e |
9f178efb | 9349 | (\014lename)i(expansion.)630 518 y Fq(P)m(arameter)46 |
e1e48bba CR |
9350 | b Ft(is)38 b(expanded)f(and)g(the)i(longest)g(matc)m(h)g(of)f |
9351 | Fq(pattern)g Ft(against)h(its)f(v)-5 b(alue)39 b(is)630 | |
9f178efb | 9352 | 628 y(replaced)33 b(with)f Fq(string)8 b Ft(.)47 b(If)33 |
e1e48bba | 9353 | b Fq(pattern)f Ft(b)s(egins)g(with)h(`)p Fs(/)p Ft(',)g(all)h(matc)m |
9f178efb | 9354 | (hes)f(of)g Fq(pattern)g Ft(are)g(re-)630 737 y(placed)27 |
e1e48bba CR |
9355 | b(with)f Fq(string)8 b Ft(.)40 b(Normally)27 b(only)g(the)g(\014rst)f |
9356 | (matc)m(h)h(is)g(replaced.)40 b(If)26 b Fq(pattern)g | |
9f178efb | 9357 | Ft(b)s(egins)630 847 y(with)33 b(`)p Fs(#)p Ft(',)i(it)f(m)m(ust)f |
e1e48bba | 9358 | (matc)m(h)i(at)f(the)g(b)s(eginning)f(of)g(the)h(expanded)f(v)-5 |
9f178efb | 9359 | b(alue)34 b(of)g Fq(parameter)7 b Ft(.)630 956 y(If)34 |
e1e48bba CR |
9360 | b Fq(pattern)g Ft(b)s(egins)g(with)g(`)p Fs(\045)p Ft(',)h(it)g(m)m |
9361 | (ust)f(matc)m(h)h(at)g(the)f(end)g(of)g(the)h(expanded)e(v)-5 | |
9f178efb | 9362 | b(alue)35 b(of)630 1066 y Fq(parameter)7 b Ft(.)40 b(If)29 |
e1e48bba CR |
9363 | b Fq(string)36 b Ft(is)29 b(n)m(ull,)h(matc)m(hes)g(of)f |
9364 | Fq(pattern)g Ft(are)g(deleted)h(and)e(the)h Fs(/)f Ft(follo)m(wing)630 | |
9f178efb | 9365 | 1176 y Fq(pattern)34 b Ft(ma)m(y)g(b)s(e)f(omitted.)51 |
e1e48bba CR |
9366 | b(If)33 b Fq(parameter)41 b Ft(is)33 b(`)p Fs(@)p Ft(')h(or)g(`)p |
9367 | Fs(*)p Ft(',)g(the)g(substitution)f(op)s(eration)630 | |
9f178efb | 9368 | 1285 y(is)38 b(applied)g(to)g(eac)m(h)h(p)s(ositional)g(parameter)f(in) |
e1e48bba | 9369 | g(turn,)h(and)e(the)h(expansion)g(is)g(the)g(re-)630 |
9f178efb | 9370 | 1395 y(sultan)m(t)f(list.)59 b(If)36 b Fq(parameter)43 |
4a8bb13f | 9371 | b Ft(is)36 b(an)g(arra)m(y)h(v)-5 b(ariable)37 b(subscripted)e(with)h |
9f178efb | 9372 | (`)p Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)h(the)630 1504 |
4a8bb13f CR |
9373 | y(substitution)30 b(op)s(eration)h(is)f(applied)g(to)h(eac)m(h)g(mem)m |
9374 | (b)s(er)f(of)g(the)h(arra)m(y)g(in)f(turn,)f(and)h(the)630 | |
9f178efb CR |
9375 | 1614 y(expansion)g(is)h(the)f(resultan)m(t)h(list.)150 |
9376 | 1793 y Fs(${)p Fi(parameter)11 b Fs(^)p Fi(pattern)g | |
9377 | Fs(})150 1903 y(${)p Fi(parameter)g Fs(^^)p Fi(pattern)g | |
9378 | Fs(})150 2012 y(${)p Fi(parameter)g Fs(,)p Fi(pattern)g | |
9379 | Fs(})150 2122 y(${)p Fi(parameter)g Fs(,,)p Fi(pattern)g | |
9380 | Fs(})630 2231 y Ft(This)35 b(expansion)h(mo)s(di\014es)f(the)h(case)h | |
45c0f7f8 | 9381 | (of)f(alphab)s(etic)h(c)m(haracters)g(in)f Fq(parameter)7 |
9f178efb | 9382 | b Ft(.)57 b(The)630 2341 y Fq(pattern)33 b Ft(is)g(expanded)e(to)j(pro) |
45c0f7f8 | 9383 | s(duce)d(a)j(pattern)e(just)g(as)h(in)g(\014lename)g(expansion.)47 |
9f178efb | 9384 | b(Eac)m(h)630 2450 y(c)m(haracter)32 b(in)e(the)g(expanded)f(v)-5 |
45c0f7f8 | 9385 | b(alue)31 b(of)f Fq(parameter)37 b Ft(is)30 b(tested)h(against)h |
9f178efb | 9386 | Fq(pattern)p Ft(,)e(and,)g(if)630 2560 y(it)j(matc)m(hes)h(the)g |
45c0f7f8 | 9387 | (pattern,)f(its)h(case)g(is)f(con)m(v)m(erted.)49 b(The)33 |
9f178efb CR |
9388 | b(pattern)g(should)f(not)h(attempt)630 2670 y(to)f(matc)m(h)g(more)f |
9389 | (than)g(one)g(c)m(haracter.)44 b(The)30 b(`)p Fs(^)p | |
9390 | Ft(')i(op)s(erator)f(con)m(v)m(erts)h(lo)m(w)m(ercase)i(letters)630 | |
9391 | 2779 y(matc)m(hing)i Fq(pattern)f Ft(to)h(upp)s(ercase;)h(the)e(`)p | |
9392 | Fs(,)p Ft(')g(op)s(erator)g(con)m(v)m(erts)i(matc)m(hing)f(upp)s | |
9393 | (ercase)630 2889 y(letters)e(to)f(lo)m(w)m(ercase.)50 | |
9394 | b(The)32 b(`)p Fs(^^)p Ft(')h(and)f(`)p Fs(,,)p Ft(')g(expansions)h | |
9395 | (con)m(v)m(ert)h(eac)m(h)g(matc)m(hed)f(c)m(har-)630 | |
9396 | 2998 y(acter)c(in)f(the)h(expanded)e(v)-5 b(alue;)30 | |
9397 | b(the)e(`)p Fs(^)p Ft(')g(and)g(`)p Fs(,)p Ft(')g(expansions)g(matc)m | |
9398 | (h)h(and)f(con)m(v)m(ert)i(only)630 3108 y(the)37 b(\014rst)g(c)m | |
9399 | (haracter)i(in)e(the)g(expanded)g(v)-5 b(alue.)61 b(If)37 | |
9400 | b Fq(pattern)g Ft(is)h(omitted,)i(it)e(is)f(treated)630 | |
9401 | 3218 y(lik)m(e)h(a)f(`)p Fs(?)p Ft(',)i(whic)m(h)d(matc)m(hes)i(ev)m | |
9402 | (ery)f(c)m(haracter.)61 b(If)37 b Fq(parameter)43 b Ft(is)37 | |
9403 | b(`)p Fs(@)p Ft(')g(or)f(`)p Fs(*)p Ft(',)j(the)e(case)630 | |
9404 | 3327 y(mo)s(di\014cation)29 b(op)s(eration)f(is)g(applied)g(to)h(eac)m | |
9405 | (h)h(p)s(ositional)f(parameter)f(in)g(turn,)g(and)g(the)630 | |
9406 | 3437 y(expansion)38 b(is)g(the)g(resultan)m(t)h(list.)65 | |
9407 | b(If)37 b Fq(parameter)46 b Ft(is)38 b(an)g(arra)m(y)g(v)-5 | |
9408 | b(ariable)39 b(subscripted)630 3546 y(with)26 b(`)p Fs(@)p | |
9409 | Ft(')f(or)h(`)p Fs(*)p Ft(',)h(the)f(case)h(mo)s(di\014cation)f(op)s | |
9410 | (eration)h(is)e(applied)h(to)h(eac)m(h)g(mem)m(b)s(er)e(of)h(the)630 | |
9411 | 3656 y(arra)m(y)31 b(in)f(turn,)f(and)h(the)h(expansion)f(is)g(the)h | |
9412 | (resultan)m(t)g(list.)150 3875 y Fj(3.5.4)63 b(Command)41 | |
9413 | b(Substitution)150 4022 y Ft(Command)f(substitution)h(allo)m(ws)i(the)e | |
9414 | (output)g(of)h(a)f(command)g(to)h(replace)g(the)g(command)f(itself.)150 | |
9415 | 4131 y(Command)29 b(substitution)h(o)s(ccurs)h(when)e(a)i(command)f(is) | |
9416 | g(enclosed)h(as)g(follo)m(ws:)390 4285 y Fs($\()p Fi(command)11 | |
9417 | b Fs(\))150 4439 y Ft(or)390 4593 y Fs(`)p Fi(command)g | |
9418 | Fs(`)150 4748 y Ft(Bash)45 b(p)s(erforms)f(the)h(expansion)f(b)m(y)h | |
c302751c | 9419 | (executing)i Fq(command)h Ft(and)c(replacing)i(the)f(command)g(sub-)150 |
9f178efb | 9420 | 4857 y(stitution)c(with)f(the)g(standard)g(output)g(of)g(the)g |
ed35cb4a | 9421 | (command,)j(with)d(an)m(y)h(trailing)g(newlines)f(deleted.)150 |
9f178efb | 9422 | 4967 y(Em)m(b)s(edded)30 b(newlines)h(are)h(not)f(deleted,)i(but)e |
ed35cb4a | 9423 | (they)g(ma)m(y)h(b)s(e)f(remo)m(v)m(ed)i(during)d(w)m(ord)h(splitting.) |
9f178efb | 9424 | 44 b(The)150 5076 y(command)21 b(substitution)g Fs($\(cat)29 |
c302751c | 9425 | b Fi(file)11 b Fs(\))20 b Ft(can)i(b)s(e)f(replaced)g(b)m(y)h(the)g |
d3ad40de | 9426 | (equiv)-5 b(alen)m(t)22 b(but)f(faster)h Fs($\(<)30 b |
9f178efb | 9427 | Fi(file)11 b Fs(\))p Ft(.)275 5230 y(When)33 b(the)i(old-st)m(yle)h |
ed35cb4a | 9428 | (bac)m(kquote)f(form)f(of)g(substitution)g(is)g(used,)h(bac)m(kslash)f |
9f178efb | 9429 | (retains)h(its)f(literal)150 5340 y(meaning)k(except)h(when)e(follo)m |
d3ad40de CR |
9430 | (w)m(ed)j(b)m(y)e(`)p Fs($)p Ft(',)j(`)p Fs(`)p Ft(',)f(or)e(`)p |
9431 | Fs(\\)p Ft('.)64 b(The)38 b(\014rst)f(bac)m(kquote)j(not)e(preceded)g | |
9f178efb CR |
9432 | (b)m(y)g(a)p eop end |
9433 | %%Page: 28 34 | |
9434 | TeXDict begin 28 33 bop 150 -116 a Ft(28)2572 b(Bash)31 | |
9435 | b(Reference)g(Man)m(ual)150 299 y(bac)m(kslash)41 b(terminates)g(the)f | |
9436 | (command)g(substitution.)69 b(When)40 b(using)g(the)g | |
9437 | Fs($\()p Fi(command)11 b Fs(\))37 b Ft(form,)42 b(all)150 | |
9438 | 408 y(c)m(haracters)32 b(b)s(et)m(w)m(een)f(the)f(paren)m(theses)h(mak) | |
9439 | m(e)g(up)f(the)g(command;)h(none)f(are)h(treated)g(sp)s(ecially)-8 | |
9440 | b(.)275 543 y(Command)22 b(substitutions)g(ma)m(y)i(b)s(e)e(nested.)39 | |
220537f2 | 9441 | b(T)-8 b(o)23 b(nest)g(when)f(using)h(the)g(bac)m(kquoted)h(form,)g |
9f178efb CR |
9442 | (escap)s(e)150 653 y(the)31 b(inner)e(bac)m(kquotes)j(with)e(bac)m |
9443 | (kslashes.)275 787 y(If)e(the)i(substitution)e(app)s(ears)h(within)g | |
220537f2 | 9444 | (double)f(quotes,)i(w)m(ord)f(splitting)h(and)f(\014lename)g(expansion) |
9f178efb CR |
9445 | 150 897 y(are)i(not)f(p)s(erformed)f(on)h(the)h(results.)150 |
9446 | 1096 y Fj(3.5.5)63 b(Arithmetic)40 b(Expansion)150 1243 | |
4a8bb13f CR |
9447 | y Ft(Arithmetic)25 b(expansion)g(allo)m(ws)g(the)g(ev)-5 |
9448 | b(aluation)26 b(of)f(an)f(arithmetic)i(expression)e(and)g(the)g | |
9f178efb CR |
9449 | (substitution)150 1353 y(of)31 b(the)f(result.)41 b(The)30 |
9450 | b(format)g(for)g(arithmetic)i(expansion)e(is:)390 1488 | |
9451 | y Fs($\(\()47 b Fi(expression)55 b Fs(\)\))275 1622 y | |
4a8bb13f CR |
9452 | Ft(The)33 b(expression)g(is)h(treated)g(as)g(if)g(it)g(w)m(ere)g |
9453 | (within)f(double)h(quotes,)h(but)e(a)h(double)f(quote)h(inside)150 | |
9f178efb | 9454 | 1732 y(the)27 b(paren)m(theses)g(is)g(not)g(treated)h(sp)s(ecially)-8 |
4a8bb13f | 9455 | b(.)41 b(All)27 b(tok)m(ens)h(in)e(the)h(expression)g(undergo)f |
9f178efb | 9456 | (parameter)h(ex-)150 1841 y(pansion,)h(command)f(substitution,)h(and)f |
4a8bb13f | 9457 | (quote)i(remo)m(v)-5 b(al.)41 b(Arithmetic)28 b(expansions)g(ma)m(y)g |
9f178efb | 9458 | (b)s(e)f(nested.)275 1976 y(The)34 b(ev)-5 b(aluation)37 |
45c0f7f8 | 9459 | b(is)f(p)s(erformed)e(according)i(to)g(the)g(rules)f(listed)h(b)s(elo)m |
9f178efb CR |
9460 | (w)g(\(see)g(Section)g(6.5)h([Shell)150 2086 y(Arithmetic],)32 |
9461 | b(page)f(86\).)42 b(If)30 b(the)h(expression)f(is)g(in)m(v)-5 | |
45c0f7f8 | 9462 | b(alid,)32 b(Bash)e(prin)m(ts)g(a)h(message)g(indicating)h(failure)150 |
9f178efb CR |
9463 | 2195 y(to)f(the)g(standard)e(error)h(and)g(no)g(substitution)g(o)s |
9464 | (ccurs.)150 2395 y Fj(3.5.6)63 b(Pro)s(cess)42 b(Substitution)150 | |
9465 | 2542 y Ft(Pro)s(cess)i(substitution)g(is)g(supp)s(orted)f(on)h(systems) | |
45c0f7f8 | 9466 | g(that)h(supp)s(ort)d(named)i(pip)s(es)f(\()p Fl(fif)n(o)p |
9f178efb | 9467 | Ft(s\))i(or)f(the)150 2651 y(`)p Fs(/dev/fd)p Ft(')29 |
45c0f7f8 | 9468 | b(metho)s(d)h(of)g(naming)g(op)s(en)g(\014les.)41 b(It)30 |
9f178efb CR |
9469 | b(tak)m(es)i(the)f(form)f(of)390 2786 y Fs(<\()p Fi(list)11 |
9470 | b Fs(\))150 2921 y Ft(or)390 3055 y Fs(>\()p Fi(list)g | |
9471 | Fs(\))150 3190 y Ft(The)23 b(pro)s(cess)g Fq(list)j Ft(is)d(run)f(with) | |
9472 | h(its)h(input)f(or)g(output)g(connected)h(to)h(a)e Fl(fif)n(o)g | |
45c0f7f8 | 9473 | Ft(or)h(some)g(\014le)f(in)g(`)p Fs(/dev/fd)p Ft('.)150 |
9f178efb | 9474 | 3300 y(The)28 b(name)h(of)g(this)f(\014le)h(is)g(passed)f(as)h(an)f |
45c0f7f8 | 9475 | (argumen)m(t)h(to)h(the)f(curren)m(t)f(command)h(as)f(the)h(result)g |
9f178efb | 9476 | (of)g(the)150 3409 y(expansion.)40 b(If)28 b(the)h Fs(>\()p |
45c0f7f8 CR |
9477 | Fi(list)11 b Fs(\))26 b Ft(form)h(is)i(used,)f(writing)h(to)g(the)f |
9478 | (\014le)h(will)g(pro)m(vide)f(input)g(for)g Fq(list)r | |
9f178efb | 9479 | Ft(.)41 b(If)28 b(the)150 3519 y Fs(<\()p Fi(list)11 |
37c41ab1 CR |
9480 | b Fs(\))23 b Ft(form)h(is)i(used,)f(the)h(\014le)f(passed)g(as)g(an)g |
9481 | (argumen)m(t)h(should)e(b)s(e)h(read)g(to)h(obtain)g(the)f(output)g(of) | |
9f178efb | 9482 | 150 3628 y Fq(list)r Ft(.)41 b(Note)31 b(that)f(no)f(space)h(ma)m(y)g |
c302751c CR |
9483 | (app)s(ear)f(b)s(et)m(w)m(een)h(the)g Fs(<)f Ft(or)h |
9484 | Fs(>)f Ft(and)g(the)g(left)h(paren)m(thesis,)h(otherwise)150 | |
9f178efb CR |
9485 | 3738 y(the)g(construct)f(w)m(ould)g(b)s(e)g(in)m(terpreted)h(as)f(a)h |
9486 | (redirection.)275 3873 y(When)36 b(a)m(v)-5 b(ailable,)40 | |
c302751c | 9487 | b(pro)s(cess)c(substitution)h(is)f(p)s(erformed)f(sim)m(ultaneously)i |
9f178efb | 9488 | (with)g(parameter)g(and)150 3982 y(v)-5 b(ariable)31 |
c302751c | 9489 | b(expansion,)g(command)f(substitution,)g(and)g(arithmetic)i(expansion.) |
9f178efb CR |
9490 | 150 4182 y Fj(3.5.7)63 b(W)-10 b(ord)41 b(Splitting)150 |
9491 | 4329 y Ft(The)30 b(shell)h(scans)g(the)g(results)f(of)h(parameter)g | |
c302751c | 9492 | (expansion,)g(command)g(substitution,)g(and)f(arithmetic)150 |
9f178efb CR |
9493 | 4438 y(expansion)g(that)h(did)f(not)g(o)s(ccur)h(within)e(double)h |
9494 | (quotes)h(for)f(w)m(ord)g(splitting.)275 4573 y(The)43 | |
c302751c CR |
9495 | b(shell)h(treats)h(eac)m(h)h(c)m(haracter)f(of)g Fs($IFS)e |
9496 | Ft(as)h(a)g(delimiter,)49 b(and)43 b(splits)h(the)h(results)e(of)i(the) | |
9f178efb | 9497 | 150 4682 y(other)40 b(expansions)f(in)m(to)i(w)m(ords)e(on)h(these)g(c) |
9ec5ed66 | 9498 | m(haracters.)70 b(If)39 b Fs(IFS)g Ft(is)h(unset,)i(or)d(its)h(v)-5 |
9f178efb | 9499 | b(alue)40 b(is)g(exactly)150 4792 y Fs(<space><tab><newline>)p |
c302751c CR |
9500 | Ft(,)26 b(the)32 b(default,)g(then)f(sequences)h(of)62 |
9501 | b Fs(<space>)p Ft(,)30 b Fs(<tab>)p Ft(,)h(and)f Fs(<newline>)150 | |
9f178efb | 9502 | 4902 y Ft(at)39 b(the)f(b)s(eginning)g(and)f(end)h(of)g(the)h(results)f |
c302751c | 9503 | (of)g(the)g(previous)g(expansions)g(are)g(ignored,)j(and)d(an)m(y)150 |
9f178efb | 9504 | 5011 y(sequence)31 b(of)g Fs(IFS)f Ft(c)m(haracters)j(not)e(at)g(the)g |
c302751c | 9505 | (b)s(eginning)g(or)f(end)h(serv)m(es)g(to)h(delimit)f(w)m(ords.)42 |
9f178efb | 9506 | b(If)30 b Fs(IFS)g Ft(has)150 5121 y(a)g(v)-5 b(alue)30 |
c302751c CR |
9507 | b(other)g(than)g(the)g(default,)g(then)f(sequences)h(of)g(the)g |
9508 | (whitespace)g(c)m(haracters)h Fs(space)e Ft(and)g Fs(tab)150 | |
9f178efb | 9509 | 5230 y Ft(are)36 b(ignored)g(at)g(the)g(b)s(eginning)f(and)g(end)g(of)h |
c302751c | 9510 | (the)g(w)m(ord,)h(as)f(long)g(as)g(the)g(whitespace)h(c)m(haracter)g |
9f178efb | 9511 | (is)150 5340 y(in)f(the)g(v)-5 b(alue)36 b(of)g Fs(IFS)f |
c302751c CR |
9512 | Ft(\(an)h Fs(IFS)f Ft(whitespace)h(c)m(haracter\).)60 |
9513 | b(An)m(y)35 b(c)m(haracter)j(in)d Fs(IFS)g Ft(that)i(is)f(not)g | |
9f178efb CR |
9514 | Fs(IFS)p eop end |
9515 | %%Page: 29 35 | |
9516 | TeXDict begin 29 34 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9517 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(29)150 299 | |
9518 | y(whitespace,)27 b(along)f(with)f(an)m(y)g(adjacen)m(t)h | |
9519 | Fs(IFS)e Ft(whitespace)i(c)m(haracters,)i(delimits)e(a)f(\014eld.)38 | |
9520 | b(A)26 b(sequence)150 408 y(of)35 b Fs(IFS)f Ft(whitespace)h(c)m | |
220537f2 CR |
9521 | (haracters)i(is)d(also)i(treated)g(as)f(a)g(delimiter.)55 |
9522 | b(If)34 b(the)h(v)-5 b(alue)35 b(of)g Fs(IFS)f Ft(is)h(n)m(ull,)h(no) | |
9f178efb | 9523 | 150 518 y(w)m(ord)30 b(splitting)h(o)s(ccurs.)275 648 |
220537f2 CR |
9524 | y(Explicit)44 b(n)m(ull)f(argumen)m(ts)g(\()p Fs("")g |
9525 | Ft(or)h Fs('')p Ft(\))f(are)g(retained.)80 b(Unquoted)43 | |
9f178efb | 9526 | b(implicit)h(n)m(ull)f(argumen)m(ts,)150 758 y(resulting)24 |
e1e48bba CR |
9527 | b(from)f(the)g(expansion)g(of)h(parameters)g(that)g(ha)m(v)m(e)h(no)e |
9528 | (v)-5 b(alues,)25 b(are)f(remo)m(v)m(ed.)40 b(If)23 b(a)g(parameter)150 | |
9f178efb CR |
9529 | 867 y(with)30 b(no)g(v)-5 b(alue)31 b(is)g(expanded)e(within)h(double)g |
9530 | (quotes,)h(a)g(n)m(ull)f(argumen)m(t)h(results)f(and)g(is)g(retained.) | |
9531 | 275 997 y(Note)h(that)g(if)g(no)f(expansion)g(o)s(ccurs,)g(no)h | |
9532 | (splitting)g(is)f(p)s(erformed.)150 1187 y Fj(3.5.8)63 | |
9533 | b(Filename)41 b(Expansion)150 1334 y Ft(After)26 b(w)m(ord)g | |
e1e48bba CR |
9534 | (splitting,)i(unless)d(the)i(`)p Fs(-f)p Ft(')f(option)g(has)g(b)s(een) |
9535 | f(set)i(\(see)g(Section)g(4.3.1)h([The)e(Set)g(Builtin],)150 | |
9f178efb | 9536 | 1444 y(page)h(58\),)i(Bash)d(scans)h(eac)m(h)h(w)m(ord)e(for)g(the)h(c) |
e1e48bba CR |
9537 | m(haracters)g(`)p Fs(*)p Ft(',)h(`)p Fs(?)p Ft(',)g(and)e(`)p |
9538 | Fs([)p Ft('.)39 b(If)26 b(one)h(of)g(these)f(c)m(haracters)150 | |
9f178efb | 9539 | 1553 y(app)s(ears,)h(then)f(the)h(w)m(ord)f(is)h(regarded)g(as)g(a)g |
e1e48bba | 9540 | Fq(pattern)p Ft(,)g(and)g(replaced)g(with)f(an)h(alphab)s(etically)h |
9f178efb | 9541 | (sorted)150 1663 y(list)k(of)f(\014lenames)g(matc)m(hing)h(the)f |
122f603c | 9542 | (pattern)g(\(see)h(Section)f(3.5.8.1)j([P)m(attern)e(Matc)m(hing],)h |
9f178efb | 9543 | (page)f(29\).)43 b(If)150 1772 y(no)26 b(matc)m(hing)i(\014lenames)e |
122f603c | 9544 | (are)h(found,)f(and)g(the)h(shell)f(option)h Fs(nullglob)d |
9f178efb | 9545 | Ft(is)j(disabled,)g(the)g(w)m(ord)f(is)g(left)150 1882 |
122f603c CR |
9546 | y(unc)m(hanged.)40 b(If)30 b(the)g Fs(nullglob)e Ft(option)i(is)h(set,) |
9547 | f(and)g(no)g(matc)m(hes)h(are)g(found,)e(the)h(w)m(ord)g(is)g(remo)m(v) | |
9f178efb | 9548 | m(ed.)150 1991 y(If)i(the)g Fs(failglob)e Ft(shell)i(option)h(is)f |
45c0f7f8 | 9549 | (set,)h(and)f(no)g(matc)m(hes)h(are)g(found,)e(an)h(error)g(message)h |
9f178efb | 9550 | (is)f(prin)m(ted)150 2101 y(and)e(the)g(command)g(is)h(not)f(executed.) |
45c0f7f8 | 9551 | 42 b(If)30 b(the)g(shell)h(option)g Fs(nocaseglob)c Ft(is)k(enabled,)f |
9f178efb | 9552 | (the)h(matc)m(h)g(is)150 2211 y(p)s(erformed)e(without)h(regard)h(to)g |
45c0f7f8 | 9553 | (the)f(case)i(of)e(alphab)s(etic)h(c)m(haracters.)275 |
9f178efb | 9554 | 2341 y(When)23 b(a)h(pattern)f(is)h(used)f(for)g(\014lename)h |
45c0f7f8 | 9555 | (expansion,)h(the)e(c)m(haracter)i(`)p Fs(.)p Ft(')f(at)g(the)g(start)g |
9f178efb | 9556 | (of)g(a)g(\014lename)150 2450 y(or)f(immediately)i(follo)m(wing)g(a)f |
45c0f7f8 CR |
9557 | (slash)f(m)m(ust)h(b)s(e)f(matc)m(hed)h(explicitly)-8 |
9558 | b(,)27 b(unless)c(the)g(shell)h(option)g Fs(dotglob)150 | |
9f178efb | 9559 | 2560 y Ft(is)33 b(set.)51 b(When)33 b(matc)m(hing)h(a)g(\014lename,)h |
45c0f7f8 | 9560 | (the)e(slash)h(c)m(haracter)h(m)m(ust)e(alw)m(a)m(ys)i(b)s(e)e(matc)m |
9f178efb | 9561 | (hed)h(explicitly)-8 b(.)150 2669 y(In)30 b(other)g(cases,)i(the)e(`)p |
45c0f7f8 | 9562 | Fs(.)p Ft(')h(c)m(haracter)h(is)e(not)h(treated)g(sp)s(ecially)-8 |
9f178efb CR |
9563 | b(.)275 2799 y(See)28 b(the)g(description)g(of)g Fs(shopt)e |
9564 | Ft(in)i(Section)g(4.3.2)i([The)e(Shopt)f(Builtin],)i(page)g(62,)g(for)f | |
9565 | (a)g(descrip-)150 2909 y(tion)j(of)f(the)h Fs(nocaseglob)p | |
9566 | Ft(,)d Fs(nullglob)p Ft(,)g Fs(failglob)p Ft(,)h(and)g | |
9567 | Fs(dotglob)g Ft(options.)275 3039 y(The)j Fs(GLOBIGNORE)f | |
9568 | Ft(shell)i(v)-5 b(ariable)34 b(ma)m(y)g(b)s(e)f(used)f(to)i(restrict)g | |
9569 | (the)g(set)f(of)h(\014lenames)f(matc)m(hing)i(a)150 3148 | |
9570 | y(pattern.)k(If)25 b Fs(GLOBIGNORE)e Ft(is)j(set,)h(eac)m(h)g(matc)m | |
9571 | (hing)g(\014lename)f(that)g(also)h(matc)m(hes)f(one)g(of)g(the)g | |
9572 | (patterns)150 3258 y(in)33 b Fs(GLOBIGNORE)d Ft(is)j(remo)m(v)m(ed)h | |
9573 | (from)e(the)i(list)f(of)g(matc)m(hes.)50 b(The)33 b(\014lenames)g(`)p | |
9574 | Fs(.)p Ft(')g(and)f(`)p Fs(..)p Ft(')h(are)g(alw)m(a)m(ys)150 | |
9575 | 3367 y(ignored)g(when)e Fs(GLOBIGNORE)f Ft(is)j(set)g(and)f(not)h(n)m | |
9576 | (ull.)48 b(Ho)m(w)m(ev)m(er,)35 b(setting)f Fs(GLOBIGNORE)c | |
9577 | Ft(to)j(a)g(non-n)m(ull)150 3477 y(v)-5 b(alue)34 b(has)f(the)h | |
9578 | (e\013ect)h(of)f(enabling)g(the)g Fs(dotglob)e Ft(shell)h(option,)j(so) | |
9579 | e(all)g(other)g(\014lenames)g(b)s(eginning)150 3587 y(with)43 | |
9580 | b(a)h(`)p Fs(.)p Ft(')f(will)h(matc)m(h.)80 b(T)-8 b(o)44 | |
9581 | b(get)h(the)e(old)h(b)s(eha)m(vior)f(of)h(ignoring)f(\014lenames)h(b)s | |
9582 | (eginning)f(with)g(a)150 3696 y(`)p Fs(.)p Ft(',)c(mak)m(e)g(`)p | |
9583 | Fs(.*)p Ft(')e(one)g(of)g(the)h(patterns)f(in)g Fs(GLOBIGNORE)p | |
9584 | Ft(.)58 b(The)37 b Fs(dotglob)e Ft(option)j(is)f(disabled)g(when)150 | |
9585 | 3806 y Fs(GLOBIGNORE)28 b Ft(is)i(unset.)150 3996 y Fj(3.5.8.1)63 | |
9586 | b(P)m(attern)40 b(Matc)m(hing)150 4143 y Ft(An)m(y)24 | |
9587 | b(c)m(haracter)h(that)f(app)s(ears)f(in)g(a)h(pattern,)i(other)e(than)f | |
9588 | (the)h(sp)s(ecial)g(pattern)g(c)m(haracters)h(describ)s(ed)150 | |
9589 | 4252 y(b)s(elo)m(w,)31 b(matc)m(hes)g(itself.)42 b(The)29 | |
9590 | b Fl(nul)h Ft(c)m(haracter)i(ma)m(y)e(not)h(o)s(ccur)f(in)g(a)h | |
9591 | (pattern.)40 b(A)31 b(bac)m(kslash)g(escap)s(es)150 4362 | |
9592 | y(the)38 b(follo)m(wing)g(c)m(haracter;)43 b(the)37 b(escaping)i(bac)m | |
9593 | (kslash)e(is)h(discarded)f(when)f(matc)m(hing.)63 b(The)36 | |
9594 | b(sp)s(ecial)150 4471 y(pattern)30 b(c)m(haracters)i(m)m(ust)f(b)s(e)e | |
9595 | (quoted)i(if)f(they)h(are)f(to)i(b)s(e)d(matc)m(hed)i(literally)-8 | |
9596 | b(.)275 4601 y(The)29 b(sp)s(ecial)i(pattern)g(c)m(haracters)h(ha)m(v)m | |
9597 | (e)f(the)g(follo)m(wing)h(meanings:)150 4751 y Fs(*)432 | |
9598 | b Ft(Matc)m(hes)31 b(an)m(y)e(string,)h(including)f(the)g(n)m(ull)g | |
9599 | (string.)41 b(When)29 b(the)g Fs(globstar)e Ft(shell)i(option)630 | |
9600 | 4861 y(is)37 b(enabled,)h(and)e(`)p Fs(*)p Ft(')h(is)g(used)f(in)g(a)h | |
9ec5ed66 | 9601 | (\014lename)g(expansion)g(con)m(text,)j(t)m(w)m(o)e(adjacen)m(t)g(`)p |
9f178efb | 9602 | Fs(*)p Ft('s)630 4971 y(used)f(as)g(a)h(single)g(pattern)g(will)f(matc) |
9ec5ed66 | 9603 | m(h)i(all)f(\014les)f(and)g(zero)h(or)g(more)f(directories)i(and)630 |
9f178efb | 9604 | 5080 y(sub)s(directories.)g(If)25 b(follo)m(w)m(ed)j(b)m(y)e(a)g(`)p |
ed35cb4a | 9605 | Fs(/)p Ft(',)h(t)m(w)m(o)g(adjacen)m(t)h(`)p Fs(*)p Ft('s)e(will)g |
9f178efb CR |
9606 | (matc)m(h)h(only)f(directories)630 5190 y(and)k(sub)s(directories.)150 |
9607 | 5340 y Fs(?)432 b Ft(Matc)m(hes)32 b(an)m(y)f(single)g(c)m(haracter.)p | |
9608 | eop end | |
9609 | %%Page: 30 36 | |
9610 | TeXDict begin 30 35 bop 150 -116 a Ft(30)2572 b(Bash)31 | |
9611 | b(Reference)g(Man)m(ual)150 299 y Fs([...)o(])241 b Ft(Matc)m(hes)27 | |
9612 | b(an)m(y)e(one)g(of)g(the)g(enclosed)g(c)m(haracters.)41 | |
9613 | b(A)25 b(pair)f(of)h(c)m(haracters)i(separated)e(b)m(y)g(a)630 | |
9614 | 408 y(h)m(yphen)i(denotes)h(a)g Fq(range)g(expression)p | |
9615 | Ft(;)g(an)m(y)h(c)m(haracter)g(that)f(sorts)g(b)s(et)m(w)m(een)g(those) | |
9616 | h(t)m(w)m(o)630 518 y(c)m(haracters,)f(inclusiv)m(e,)f(using)d(the)h | |
9617 | (curren)m(t)f(lo)s(cale's)j(collating)g(sequence)e(and)f(c)m(haracter) | |
9618 | 630 628 y(set,)31 b(is)f(matc)m(hed.)42 b(If)30 b(the)g(\014rst)g(c)m | |
9619 | (haracter)i(follo)m(wing)g(the)e(`)p Fs([)p Ft(')h(is)f(a)h(`)p | |
9620 | Fs(!)p Ft(')f(or)g(a)h(`)p Fs(^)p Ft(')g(then)f(an)m(y)630 | |
9621 | 737 y(c)m(haracter)c(not)f(enclosed)g(is)g(matc)m(hed.)40 | |
9622 | b(A)25 b(`)p Fp(\000)p Ft(')f(ma)m(y)i(b)s(e)e(matc)m(hed)h(b)m(y)f | |
9623 | (including)h(it)g(as)g(the)630 847 y(\014rst)32 b(or)h(last)h(c)m | |
9624 | (haracter)h(in)e(the)g(set.)50 b(A)33 b(`)p Fs(])p Ft(')g(ma)m(y)h(b)s | |
9625 | (e)e(matc)m(hed)i(b)m(y)f(including)g(it)g(as)h(the)630 | |
9626 | 956 y(\014rst)25 b(c)m(haracter)i(in)e(the)h(set.)40 | |
9627 | b(The)25 b(sorting)h(order)f(of)h(c)m(haracters)h(in)f(range)g | |
9628 | (expressions)f(is)630 1066 y(determined)h(b)m(y)h(the)g(curren)m(t)f | |
9629 | (lo)s(cale)j(and)d(the)h(v)-5 b(alues)27 b(of)g(the)g | |
9630 | Fs(LC_COLLATE)d Ft(and)i Fs(LC_ALL)630 1176 y Ft(shell)31 | |
9631 | b(v)-5 b(ariables,)31 b(if)f(set.)630 1303 y(F)-8 b(or)34 | |
74d0116b CR |
9632 | b(example,)g(in)f(the)g(default)g(C)f(lo)s(cale,)k(`)p |
9633 | Fs([a-dx-z])p Ft(')31 b(is)i(equiv)-5 b(alen)m(t)34 b(to)g(`)p | |
9f178efb | 9634 | Fs([abcdxyz])p Ft('.)630 1413 y(Man)m(y)68 b(lo)s(cales)h(sort)f(c)m |
74d0116b | 9635 | (haracters)h(in)e(dictionary)i(order,)76 b(and)67 b(in)g(these)h(lo)s |
9f178efb | 9636 | (cales)630 1522 y(`)p Fs([a-dx-z])p Ft(')36 b(is)i(t)m(ypically)i(not)e |
74d0116b | 9637 | (equiv)-5 b(alen)m(t)39 b(to)g(`)p Fs([abcdxyz])p Ft(';)g(it)g(migh)m |
9f178efb | 9638 | (t)f(b)s(e)f(equiv)-5 b(alen)m(t)630 1632 y(to)34 b(`)p |
74d0116b CR |
9639 | Fs([aBbCcDdxXyYz])p Ft(',)c(for)j(example.)49 b(T)-8 |
9640 | b(o)33 b(obtain)h(the)f(traditional)h(in)m(terpretation)h(of)630 | |
9f178efb | 9641 | 1742 y(ranges)e(in)f(brac)m(k)m(et)i(expressions,)g(y)m(ou)f(can)g |
45c0f7f8 | 9642 | (force)g(the)g(use)f(of)h(the)g(C)f(lo)s(cale)i(b)m(y)f(setting)630 |
9f178efb | 9643 | 1851 y(the)c Fs(LC_COLLATE)e Ft(or)i Fs(LC_ALL)f Ft(en)m(vironmen)m(t)i |
74d0116b | 9644 | (v)-5 b(ariable)30 b(to)g(the)f(v)-5 b(alue)30 b(`)p |
9f178efb CR |
9645 | Fs(C)p Ft(',)g(or)f(enable)h(the)630 1961 y Fs(globasciiranges)c |
9646 | Ft(shell)31 b(option.)630 2088 y(Within)23 b(`)p Fs([)p | |
74d0116b CR |
9647 | Ft(')h(and)e(`)p Fs(])p Ft(',)j Fq(c)m(haracter)g(classes)j |
9648 | Ft(can)c(b)s(e)e(sp)s(eci\014ed)h(using)f(the)i(syn)m(tax)f | |
9f178efb | 9649 | Fs([:)p Fq(class)t Fs(:])p Ft(,)630 2198 y(where)30 b |
74d0116b | 9650 | Fq(class)35 b Ft(is)30 b(one)h(of)f(the)h(follo)m(wing)h(classes)f |
9f178efb | 9651 | (de\014ned)e(in)h(the)h Fl(posix)f Ft(standard:)870 2326 |
74d0116b | 9652 | y Fs(alnum)142 b(alpha)g(ascii)f(blank)h(cntrl)g(digit)g(graph)g(lower) |
9f178efb CR |
9653 | 870 2435 y(print)g(punct)g(space)f(upper)h(word)190 b(xdigit)630 |
9654 | 2563 y Ft(A)42 b(c)m(haracter)h(class)f(matc)m(hes)h(an)m(y)f(c)m | |
74d0116b | 9655 | (haracter)h(b)s(elonging)f(to)g(that)g(class.)75 b(The)41 |
9f178efb | 9656 | b Fs(word)630 2672 y Ft(c)m(haracter)32 b(class)f(matc)m(hes)h |
4a8bb13f | 9657 | (letters,)f(digits,)h(and)d(the)i(c)m(haracter)h(`)p |
9f178efb CR |
9658 | Fs(_)p Ft('.)630 2800 y(Within)25 b(`)p Fs([)p Ft(')f(and)g(`)p |
9659 | Fs(])p Ft(',)i(an)e Fq(equiv)-5 b(alence)26 b(class)j | |
9660 | Ft(can)24 b(b)s(e)g(sp)s(eci\014ed)g(using)g(the)g(syn)m(tax)h | |
9661 | Fs([=)p Fq(c)6 b Fs(=])p Ft(,)630 2910 y(whic)m(h)29 | |
122f603c | 9662 | b(matc)m(hes)i(all)f(c)m(haracters)h(with)e(the)h(same)g(collation)h(w) |
9f178efb CR |
9663 | m(eigh)m(t)g(\(as)f(de\014ned)e(b)m(y)i(the)630 3019 |
9664 | y(curren)m(t)g(lo)s(cale\))j(as)d(the)h(c)m(haracter)h | |
9665 | Fq(c)6 b Ft(.)630 3147 y(Within)21 b(`)p Fs([)p Ft(')h(and)e(`)p | |
9666 | Fs(])p Ft(',)j(the)f(syn)m(tax)f Fs([.)p Fq(sym)m(b)s(ol)t | |
9667 | Fs(.])f Ft(matc)m(hes)i(the)f(collating)j(sym)m(b)s(ol)c | |
9668 | Fq(sym)m(b)s(ol)t Ft(.)275 3293 y(If)29 b(the)g Fs(extglob)f | |
9669 | Ft(shell)h(option)h(is)g(enabled)f(using)g(the)h Fs(shopt)e | |
9670 | Ft(builtin,)h(sev)m(eral)i(extended)f(pattern)150 3402 | |
9671 | y(matc)m(hing)37 b(op)s(erators)e(are)h(recognized.)58 | |
9672 | b(In)35 b(the)g(follo)m(wing)i(description,)g(a)f Fq(pattern-list)j | |
9673 | Ft(is)d(a)g(list)g(of)150 3512 y(one)d(or)f(more)h(patterns)f | |
9674 | (separated)h(b)m(y)f(a)h(`)p Fs(|)p Ft('.)47 b(Comp)s(osite)33 | |
9675 | b(patterns)f(ma)m(y)i(b)s(e)d(formed)h(using)g(one)h(or)150 | |
9676 | 3621 y(more)e(of)f(the)h(follo)m(wing)g(sub-patterns:)150 | |
9677 | 3767 y Fs(?\()p Fi(pattern-list)11 b Fs(\))630 3877 y | |
74d0116b | 9678 | Ft(Matc)m(hes)32 b(zero)f(or)g(one)f(o)s(ccurrence)h(of)f(the)h(giv)m |
9f178efb CR |
9679 | (en)g(patterns.)150 4022 y Fs(*\()p Fi(pattern-list)11 |
9680 | b Fs(\))630 4132 y Ft(Matc)m(hes)32 b(zero)f(or)g(more)f(o)s | |
9681 | (ccurrences)h(of)f(the)h(giv)m(en)g(patterns.)150 4278 | |
9682 | y Fs(+\()p Fi(pattern-list)11 b Fs(\))630 4387 y Ft(Matc)m(hes)32 | |
74d0116b | 9683 | b(one)f(or)f(more)h(o)s(ccurrences)f(of)h(the)f(giv)m(en)i(patterns.) |
9f178efb | 9684 | 150 4533 y Fs(@\()p Fi(pattern-list)11 b Fs(\))630 4643 |
74d0116b | 9685 | y Ft(Matc)m(hes)32 b(one)f(of)f(the)h(giv)m(en)g(patterns.)150 |
9f178efb | 9686 | 4788 y Fs(!\()p Fi(pattern-list)11 b Fs(\))630 4898 y |
74d0116b | 9687 | Ft(Matc)m(hes)32 b(an)m(ything)f(except)g(one)g(of)f(the)h(giv)m(en)g |
9f178efb CR |
9688 | (patterns.)150 5083 y Fj(3.5.9)63 b(Quote)41 b(Remo)m(v)-7 |
9689 | b(al)150 5230 y Ft(After)32 b(the)g(preceding)g(expansions,)h(all)f | |
c302751c CR |
9690 | (unquoted)f(o)s(ccurrences)h(of)g(the)h(c)m(haracters)g(`)p |
9691 | Fs(\\)p Ft(',)g(`)p Fs(')p Ft(',)f(and)g(`)p Fs(")p Ft(')150 | |
9f178efb CR |
9692 | 5340 y(that)f(did)f(not)g(result)g(from)g(one)h(of)g(the)f(ab)s(o)m(v)m |
9693 | (e)i(expansions)e(are)h(remo)m(v)m(ed.)p eop end | |
9694 | %%Page: 31 37 | |
9695 | TeXDict begin 31 36 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9696 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(31)150 299 | |
9697 | y Fr(3.6)68 b(Redirections)150 458 y Ft(Before)32 b(a)f(command)f(is)h | |
9698 | (executed,)h(its)f(input)e(and)h(output)h(ma)m(y)g(b)s(e)f | |
9699 | Fq(redirected)k Ft(using)c(a)i(sp)s(ecial)f(no-)150 568 | |
9700 | y(tation)d(in)m(terpreted)f(b)m(y)f(the)h(shell.)40 b(Redirection)27 | |
9701 | b(allo)m(ws)h(commands')f(\014le)f(handles)g(to)i(b)s(e)e(duplicated,) | |
9702 | 150 677 y(op)s(ened,)i(closed,)i(made)e(to)h(refer)f(to)h(di\013eren)m | |
9703 | (t)f(\014les,)h(and)f(can)g(c)m(hange)h(the)g(\014les)f(the)g(command)g | |
9704 | (reads)150 787 y(from)39 b(and)g(writes)h(to.)69 b(Redirection)40 | |
abe2eb5b | 9705 | b(ma)m(y)g(also)h(b)s(e)e(used)g(to)h(mo)s(dify)f(\014le)g(handles)g |
9f178efb | 9706 | (in)g(the)h(curren)m(t)150 897 y(shell)e(execution)h(en)m(vironmen)m |
abe2eb5b | 9707 | (t.)65 b(The)37 b(follo)m(wing)j(redirection)f(op)s(erators)f(ma)m(y)g |
9f178efb | 9708 | (precede)h(or)f(app)s(ear)150 1006 y(an)m(ywhere)30 b(within)f(a)h |
abe2eb5b | 9709 | (simple)f(command)h(or)f(ma)m(y)i(follo)m(w)g(a)f(command.)40 |
9f178efb | 9710 | b(Redirections)30 b(are)g(pro)s(cessed)150 1116 y(in)g(the)h(order)f |
abe2eb5b | 9711 | (they)g(app)s(ear,)g(from)g(left)h(to)g(righ)m(t.)275 |
9f178efb | 9712 | 1260 y(Eac)m(h)45 b(redirection)h(that)f(ma)m(y)h(b)s(e)e(preceded)g(b) |
a8fd3f3e | 9713 | m(y)h(a)h(\014le)f(descriptor)f(n)m(um)m(b)s(er)g(ma)m(y)h(instead)h(b) |
9f178efb | 9714 | s(e)150 1369 y(preceded)41 b(b)m(y)g(a)g(w)m(ord)g(of)g(the)g(form)g |
a8fd3f3e | 9715 | Fs({)p Fq(v)-5 b(arname)5 b Fs(})p Ft(.)72 b(In)40 b(this)h(case,)k |
9f178efb | 9716 | (for)c(eac)m(h)h(redirection)g(op)s(erator)150 1479 y(except)30 |
a8fd3f3e CR |
9717 | b Fs(>)p Ft(&-)f(and)f Fs(<)p Ft(&-,)h(the)g(shell)g(will)h(allo)s |
9718 | (cate)h(a)e(\014le)h(descriptor)e(greater)j(than)d(10)i(and)e(assign)i | |
9f178efb | 9719 | (it)f(to)150 1588 y Fs({)p Fq(v)-5 b(arname)5 b Fs(})p |
e1e48bba CR |
9720 | Ft(.)42 b(If)31 b Fs(>)p Ft(&-)f(or)h Fs(<)p Ft(&-)g(is)g(preceded)g(b) |
9721 | m(y)g Fs({)p Fq(v)-5 b(arname)5 b Fs(})p Ft(,)31 b(the)g(v)-5 | |
9722 | b(alue)31 b(of)g Fq(v)-5 b(arname)37 b Ft(de\014nes)30 | |
9f178efb CR |
9723 | b(the)h(\014le)150 1698 y(descriptor)f(to)h(close.)275 |
9724 | 1842 y(In)c(the)i(follo)m(wing)h(descriptions,)g(if)e(the)h(\014le)g | |
45c0f7f8 | 9725 | (descriptor)f(n)m(um)m(b)s(er)g(is)g(omitted,)i(and)f(the)f(\014rst)g |
9f178efb | 9726 | (c)m(har-)150 1951 y(acter)42 b(of)f(the)g(redirection)g(op)s(erator)g |
45c0f7f8 | 9727 | (is)g(`)p Fs(<)p Ft(',)i(the)e(redirection)g(refers)g(to)g(the)g |
9f178efb | 9728 | (standard)f(input)f(\(\014le)150 2061 y(descriptor)33 |
45c0f7f8 CR |
9729 | b(0\).)49 b(If)33 b(the)g(\014rst)f(c)m(haracter)i(of)g(the)f |
9730 | (redirection)g(op)s(erator)h(is)f(`)p Fs(>)p Ft(',)h(the)f(redirection) | |
9f178efb CR |
9731 | g(refers)150 2170 y(to)e(the)g(standard)e(output)h(\(\014le)h |
9732 | (descriptor)f(1\).)275 2314 y(The)h(w)m(ord)h(follo)m(wing)i(the)f | |
45c0f7f8 | 9733 | (redirection)g(op)s(erator)f(in)g(the)h(follo)m(wing)h(descriptions,)f |
9f178efb | 9734 | (unless)e(other-)150 2424 y(wise)21 b(noted,)i(is)e(sub)5 |
45c0f7f8 | 9735 | b(jected)21 b(to)h(brace)f(expansion,)i(tilde)f(expansion,)h(parameter) |
9f178efb CR |
9736 | e(expansion,)i(command)150 2533 y(substitution,)31 b(arithmetic)h |
9737 | (expansion,)f(quote)h(remo)m(v)-5 b(al,)33 b(\014lename)e(expansion,)g | |
9738 | (and)f(w)m(ord)h(splitting.)150 2643 y(If)f(it)h(expands)e(to)i(more)g | |
9739 | (than)f(one)h(w)m(ord,)f(Bash)h(rep)s(orts)e(an)h(error.)275 | |
9740 | 2787 y(Note)h(that)g(the)g(order)f(of)g(redirections)h(is)g | |
9741 | (signi\014can)m(t.)41 b(F)-8 b(or)31 b(example,)h(the)e(command)390 | |
9742 | 2931 y Fs(ls)47 b(>)h Fi(dirlist)56 b Fs(2>&1)150 3074 | |
9743 | y Ft(directs)28 b(b)s(oth)f(standard)g(output)g(\(\014le)h(descriptor)f | |
9744 | (1\))i(and)e(standard)f(error)i(\(\014le)g(descriptor)f(2\))h(to)h(the) | |
9745 | 150 3184 y(\014le)h Fq(dirlist)r Ft(,)h(while)f(the)h(command)390 | |
9746 | 3328 y Fs(ls)47 b(2>&1)g(>)g Fi(dirlist)150 3471 y Ft(directs)28 | |
9747 | b(only)f(the)g(standard)g(output)g(to)h(\014le)f Fq(dirlist)r | |
9748 | Ft(,)h(b)s(ecause)g(the)f(standard)g(error)g(w)m(as)g(made)h(a)f(cop)m | |
9749 | (y)150 3581 y(of)k(the)f(standard)g(output)g(b)s(efore)g(the)g | |
9750 | (standard)g(output)g(w)m(as)g(redirected)h(to)g Fq(dirlist)r | |
9751 | Ft(.)275 3725 y(Bash)26 b(handles)f(sev)m(eral)j(\014lenames)e(sp)s | |
9752 | (ecially)h(when)f(they)g(are)g(used)g(in)g(redirections,)i(as)e | |
9753 | (describ)s(ed)150 3834 y(in)k(the)h(follo)m(wing)g(table:)150 | |
9754 | 4008 y Fs(/dev/fd/)p Fi(fd)630 4117 y Ft(If)f Fq(fd)j | |
9755 | Ft(is)d(a)h(v)-5 b(alid)31 b(in)m(teger,)h(\014le)e(descriptor)h | |
9756 | Fq(fd)i Ft(is)d(duplicated.)150 4286 y Fs(/dev/stdin)630 | |
9757 | 4396 y Ft(File)i(descriptor)e(0)h(is)f(duplicated.)150 | |
9758 | 4564 y Fs(/dev/stdout)630 4674 y Ft(File)i(descriptor)e(1)h(is)f | |
9759 | (duplicated.)150 4843 y Fs(/dev/stderr)630 4952 y Ft(File)i(descriptor) | |
9760 | e(2)h(is)f(duplicated.)150 5121 y Fs(/dev/tcp/)p Fi(host)11 | |
9761 | b Fs(/)p Fi(port)630 5230 y Ft(If)41 b Fq(host)i Ft(is)f(a)g(v)-5 | |
abe2eb5b | 9762 | b(alid)41 b(hostname)h(or)f(In)m(ternet)h(address,)i(and)c |
9f178efb CR |
9763 | Fq(p)s(ort)j Ft(is)f(an)f(in)m(teger)i(p)s(ort)630 5340 |
9764 | y(n)m(um)m(b)s(er)23 b(or)i(service)h(name,)g(Bash)f(attempts)h(to)f | |
9765 | (op)s(en)f(the)h(corresp)s(onding)f(TCP)g(so)s(c)m(k)m(et.)p | |
9766 | eop end | |
9767 | %%Page: 32 38 | |
9768 | TeXDict begin 32 37 bop 150 -116 a Ft(32)2572 b(Bash)31 | |
9769 | b(Reference)g(Man)m(ual)150 299 y Fs(/dev/udp/)p Fi(host)11 | |
9770 | b Fs(/)p Fi(port)630 408 y Ft(If)41 b Fq(host)i Ft(is)f(a)g(v)-5 | |
220537f2 | 9771 | b(alid)41 b(hostname)h(or)f(In)m(ternet)h(address,)i(and)c |
9f178efb CR |
9772 | Fq(p)s(ort)j Ft(is)f(an)f(in)m(teger)i(p)s(ort)630 518 |
9773 | y(n)m(um)m(b)s(er)23 b(or)h(service)h(name,)h(Bash)e(attempts)h(to)g | |
9774 | (op)s(en)f(the)g(corresp)s(onding)f(UDP)i(so)s(c)m(k)m(et.)275 | |
9775 | 695 y(A)30 b(failure)h(to)g(op)s(en)e(or)i(create)h(a)e(\014le)h | |
9776 | (causes)g(the)f(redirection)h(to)g(fail.)275 841 y(Redirections)f | |
9777 | (using)e(\014le)i(descriptors)f(greater)h(than)f(9)h(should)e(b)s(e)h | |
9778 | (used)f(with)h(care,)h(as)g(they)f(ma)m(y)150 950 y(con\015ict)i(with)f | |
9779 | (\014le)h(descriptors)f(the)g(shell)h(uses)f(in)m(ternally)-8 | |
9780 | b(.)150 1161 y Fj(3.6.1)63 b(Redirecting)40 b(Input)150 | |
9781 | 1308 y Ft(Redirection)35 b(of)f(input)f(causes)i(the)f(\014le)g(whose)g | |
9782 | (name)g(results)g(from)g(the)g(expansion)g(of)g Fq(w)m(ord)k | |
9783 | Ft(to)d(b)s(e)150 1418 y(op)s(ened)d(for)g(reading)g(on)g(\014le)h | |
9784 | (descriptor)f Fs(n)p Ft(,)h(or)f(the)g(standard)g(input)f(\(\014le)i | |
9785 | (descriptor)f(0\))h(if)f Fs(n)g Ft(is)h(not)150 1527 | |
9786 | y(sp)s(eci\014ed.)275 1674 y(The)c(general)j(format)e(for)h | |
9787 | (redirecting)g(input)e(is:)390 1820 y Fs([)p Fi(n)11 | |
9788 | b Fs(]<)p Fi(word)150 2030 y Fj(3.6.2)63 b(Redirecting)40 | |
9789 | b(Output)150 2177 y Ft(Redirection)31 b(of)g(output)f(causes)h(the)f | |
45c0f7f8 | 9790 | (\014le)h(whose)f(name)g(results)h(from)e(the)i(expansion)f(of)h |
9f178efb | 9791 | Fq(w)m(ord)i Ft(to)f(b)s(e)150 2287 y(op)s(ened)d(for)g(writing)g(on)g |
45c0f7f8 CR |
9792 | (\014le)h(descriptor)f Fq(n)p Ft(,)g(or)g(the)h(standard)e(output)h |
9793 | (\(\014le)h(descriptor)f(1\))h(if)g Fq(n)e Ft(is)i(not)150 | |
9f178efb | 9794 | 2397 y(sp)s(eci\014ed.)40 b(If)30 b(the)g(\014le)h(do)s(es)f(not)h |
45c0f7f8 | 9795 | (exist)g(it)g(is)f(created;)i(if)e(it)h(do)s(es)f(exist)h(it)g(is)g |
9f178efb CR |
9796 | (truncated)f(to)h(zero)g(size.)275 2543 y(The)e(general)j(format)e(for) |
9797 | h(redirecting)g(output)f(is:)390 2689 y Fs([)p Fi(n)11 | |
9798 | b Fs(]>[|])p Fi(word)275 2835 y Ft(If)30 b(the)h(redirection)g(op)s | |
abe2eb5b CR |
9799 | (erator)g(is)g(`)p Fs(>)p Ft(',)g(and)f(the)h Fs(noclobber)d |
9800 | Ft(option)j(to)g(the)g Fs(set)f Ft(builtin)g(has)h(b)s(een)150 | |
9f178efb | 9801 | 2944 y(enabled,)i(the)f(redirection)h(will)f(fail)h(if)f(the)g(\014le)g |
abe2eb5b | 9802 | (whose)g(name)g(results)g(from)g(the)g(expansion)g(of)g |
9f178efb | 9803 | Fq(w)m(ord)150 3054 y Ft(exists)f(and)f(is)g(a)h(regular)g(\014le.)41 |
37c41ab1 CR |
9804 | b(If)30 b(the)h(redirection)g(op)s(erator)g(is)f(`)p |
9805 | Fs(>|)p Ft(',)h(or)f(the)h(redirection)g(op)s(erator)g(is)150 | |
9f178efb | 9806 | 3164 y(`)p Fs(>)p Ft(')36 b(and)f(the)g Fs(noclobber)e |
37c41ab1 | 9807 | Ft(option)j(is)g(not)g(enabled,)h(the)e(redirection)h(is)g(attempted)g |
9f178efb CR |
9808 | (ev)m(en)h(if)e(the)h(\014le)150 3273 y(named)30 b(b)m(y)g |
9809 | Fq(w)m(ord)k Ft(exists.)150 3484 y Fj(3.6.3)63 b(App)s(ending)42 | |
9810 | b(Redirected)e(Output)150 3631 y Ft(Redirection)23 b(of)e(output)h(in)f | |
74d0116b | 9811 | (this)h(fashion)f(causes)h(the)g(\014le)g(whose)f(name)h(results)f |
9f178efb | 9812 | (from)g(the)h(expansion)g(of)150 3741 y Fq(w)m(ord)28 |
74d0116b CR |
9813 | b Ft(to)e(b)s(e)e(op)s(ened)g(for)h(app)s(ending)e(on)i(\014le)g |
9814 | (descriptor)g Fq(n)p Ft(,)g(or)g(the)g(standard)f(output)h(\(\014le)g | |
9f178efb | 9815 | (descriptor)150 3850 y(1\))31 b(if)f Fq(n)g Ft(is)h(not)f(sp)s |
74d0116b | 9816 | (eci\014ed.)40 b(If)30 b(the)h(\014le)f(do)s(es)g(not)h(exist)g(it)g |
9f178efb CR |
9817 | (is)f(created.)275 3996 y(The)f(general)j(format)e(for)h(app)s(ending)e |
9818 | (output)h(is:)390 4142 y Fs([)p Fi(n)11 b Fs(]>>)p Fi(word)150 | |
9819 | 4353 y Fj(3.6.4)63 b(Redirecting)40 b(Standard)h(Output)g(and)g | |
9820 | (Standard)g(Error)150 4500 y Ft(This)33 b(construct)i(allo)m(ws)g(b)s | |
9ec5ed66 | 9821 | (oth)f(the)g(standard)g(output)f(\(\014le)i(descriptor)f(1\))h(and)f |
9f178efb | 9822 | (the)g(standard)f(error)150 4610 y(output)d(\(\014le)h(descriptor)f |
74d0116b | 9823 | (2\))h(to)g(b)s(e)f(redirected)h(to)g(the)f(\014le)h(whose)f(name)h(is) |
9f178efb | 9824 | f(the)g(expansion)h(of)f Fq(w)m(ord)t Ft(.)275 4756 y(There)f(are)i(t)m |
74d0116b | 9825 | (w)m(o)h(formats)e(for)h(redirecting)g(standard)e(output)h(and)g |
9f178efb CR |
9826 | (standard)f(error:)390 4902 y Fs(&>)p Fi(word)150 5048 |
9827 | y Ft(and)390 5194 y Fs(>&)p Fi(word)150 5340 y Ft(Of)h(the)g(t)m(w)m(o) | |
74d0116b | 9828 | i(forms,)e(the)h(\014rst)e(is)i(preferred.)39 b(This)30 |
9f178efb | 9829 | b(is)g(seman)m(tically)j(equiv)-5 b(alen)m(t)32 b(to)p |
abe2eb5b | 9830 | eop end |
9f178efb CR |
9831 | %%Page: 33 39 |
9832 | TeXDict begin 33 38 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9833 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(33)390 299 | |
9834 | y Fs(>)p Fi(word)57 b Fs(2>&1)275 445 y Ft(When)41 b(using)g(the)h | |
9835 | (second)f(form,)k Fq(w)m(ord)f Ft(ma)m(y)e(not)g(expand)f(to)h(a)g(n)m | |
9836 | (um)m(b)s(er)f(or)g(`)p Fs(-)p Ft('.)75 b(If)41 b(it)h(do)s(es,)150 | |
9837 | 554 y(other)27 b(redirection)g(op)s(erators)f(apply)h(\(see)g | |
9838 | (Duplicating)h(File)f(Descriptors)h(b)s(elo)m(w\))f(for)f(compatibilit) | |
9839 | m(y)150 664 y(reasons.)150 874 y Fj(3.6.5)63 b(App)s(ending)42 | |
9840 | b(Standard)f(Output)g(and)g(Standard)g(Error)150 1021 | |
9841 | y Ft(This)33 b(construct)i(allo)m(ws)g(b)s(oth)f(the)g(standard)g | |
9842 | (output)f(\(\014le)i(descriptor)f(1\))h(and)f(the)g(standard)f(error) | |
9843 | 150 1131 y(output)d(\(\014le)h(descriptor)f(2\))h(to)g(b)s(e)f(app)s | |
9844 | (ended)f(to)i(the)f(\014le)h(whose)f(name)g(is)h(the)f(expansion)h(of)f | |
9845 | Fq(w)m(ord)t Ft(.)275 1276 y(The)f(format)i(for)f(app)s(ending)f | |
9846 | (standard)h(output)g(and)f(standard)h(error)g(is:)390 | |
9847 | 1422 y Fs(&>>)p Fi(word)150 1568 y Ft(This)g(is)g(seman)m(tically)j | |
9848 | (equiv)-5 b(alen)m(t)32 b(to)390 1714 y Fs(>>)p Fi(word)57 | |
9849 | b Fs(2>&1)275 1859 y Ft(\(see)31 b(Duplicating)h(File)f(Descriptors)g | |
9850 | (b)s(elo)m(w\).)150 2070 y Fj(3.6.6)63 b(Here)41 b(Do)s(cumen)m(ts)150 | |
9851 | 2217 y Ft(This)c(t)m(yp)s(e)h(of)f(redirection)i(instructs)e(the)h | |
9852 | (shell)f(to)i(read)e(input)g(from)g(the)h(curren)m(t)f(source)h(un)m | |
9853 | (til)g(a)150 2326 y(line)31 b(con)m(taining)g(only)g | |
9854 | Fq(w)m(ord)i Ft(\(with)d(no)h(trailing)g(blanks\))f(is)g(seen.)41 | |
9855 | b(All)31 b(of)f(the)h(lines)f(read)g(up)f(to)i(that)150 | |
9856 | 2436 y(p)s(oin)m(t)f(are)h(then)f(used)g(as)g(the)h(standard)f(input)f | |
9857 | (for)h(a)h(command.)275 2582 y(The)e(format)i(of)g(here-do)s(cumen)m | |
9858 | (ts)f(is:)390 2727 y Fs(<<[)p Fp(\000)p Fs(])p Fi(word)772 | |
9859 | 2837 y(here-document)390 2946 y(delimiter)275 3092 y | |
9860 | Ft(No)i(parameter)h(and)f(v)-5 b(ariable)32 b(expansion,)h(command)f | |
9861 | (substitution,)h(arithmetic)g(expansion,)g(or)150 3202 | |
9862 | y(\014lename)38 b(expansion)f(is)h(p)s(erformed)e(on)h | |
9863 | Fq(w)m(ord)t Ft(.)62 b(If)37 b(an)m(y)h(c)m(haracters)h(in)e | |
9864 | Fq(w)m(ord)k Ft(are)d(quoted,)i(the)e Fq(de-)150 3311 | |
9865 | y(limiter)h Ft(is)32 b(the)g(result)g(of)g(quote)g(remo)m(v)-5 | |
278286c9 | 9866 | b(al)33 b(on)f Fq(w)m(ord)t Ft(,)g(and)f(the)h(lines)g(in)g(the)g |
9f178efb | 9867 | (here-do)s(cumen)m(t)f(are)i(not)150 3421 y(expanded.)71 |
278286c9 CR |
9868 | b(If)40 b Fq(w)m(ord)k Ft(is)d(unquoted,)h(all)g(lines)f(of)g(the)f |
9869 | (here-do)s(cumen)m(t)h(are)g(sub)5 b(jected)41 b(to)g(param-)150 | |
9f178efb CR |
9870 | 3531 y(eter)c(expansion,)i(command)d(substitution,)i(and)e(arithmetic)i |
9871 | (expansion,)g(the)f(c)m(haracter)i(sequence)150 3640 | |
278286c9 CR |
9872 | y Fs(\\newline)28 b Ft(is)j(ignored,)f(and)g(`)p Fs(\\)p |
9873 | Ft(')h(m)m(ust)f(b)s(e)g(used)f(to)i(quote)g(the)g(c)m(haracters)h(`)p | |
9874 | Fs(\\)p Ft(',)e(`)p Fs($)p Ft(',)h(and)f(`)p Fs(`)p Ft('.)275 | |
9f178efb | 9875 | 3786 y(If)21 b(the)i(redirection)g(op)s(erator)g(is)f(`)p |
278286c9 | 9876 | Fs(<<-)p Ft(',)i(then)e(all)h(leading)g(tab)g(c)m(haracters)h(are)e |
9f178efb | 9877 | (stripp)s(ed)f(from)h(input)150 3895 y(lines)33 b(and)e(the)i(line)g |
74d0116b CR |
9878 | (con)m(taining)h Fq(delimiter)7 b Ft(.)47 b(This)31 b(allo)m(ws)j |
9879 | (here-do)s(cumen)m(ts)f(within)e(shell)i(scripts)f(to)150 | |
9f178efb CR |
9880 | 4005 y(b)s(e)e(inden)m(ted)g(in)g(a)h(natural)f(fashion.)150 |
9881 | 4215 y Fj(3.6.7)63 b(Here)41 b(Strings)150 4362 y Ft(A)30 | |
74d0116b | 9882 | b(v)-5 b(arian)m(t)32 b(of)e(here)h(do)s(cumen)m(ts,)f(the)g(format)h |
9f178efb | 9883 | (is:)390 4508 y Fs(<<<)47 b Fi(word)275 4654 y Ft(The)21 |
122f603c CR |
9884 | b Fq(w)m(ord)k Ft(undergo)s(es)c(brace)h(expansion,)i(tilde)e |
9885 | (expansion,)i(parameter)e(and)f(v)-5 b(ariable)23 b(expansion,)150 | |
9f178efb | 9886 | 4763 y(command)j(substitution,)g(arithmetic)i(expansion,)f(and)e(quote) |
278286c9 | 9887 | i(remo)m(v)-5 b(al.)40 b(P)m(athname)27 b(expansion)f(and)150 |
9f178efb | 9888 | 4873 y(w)m(ord)j(splitting)i(are)f(not)g(p)s(erformed.)39 |
122f603c | 9889 | b(The)29 b(result)h(is)g(supplied)e(as)i(a)h(single)f(string)g(to)g |
9f178efb CR |
9890 | (the)g(command)150 4983 y(on)g(its)h(standard)f(input.)150 |
9891 | 5193 y Fj(3.6.8)63 b(Duplicating)41 b(File)g(Descriptors)150 | |
9892 | 5340 y Ft(The)30 b(redirection)h(op)s(erator)p eop end | |
9893 | %%Page: 34 40 | |
9894 | TeXDict begin 34 39 bop 150 -116 a Ft(34)2572 b(Bash)31 | |
9895 | b(Reference)g(Man)m(ual)390 299 y Fs([)p Fi(n)11 b Fs(]<&)p | |
9896 | Fi(word)150 433 y Ft(is)35 b(used)e(to)j(duplicate)f(input)f(\014le)g | |
9897 | (descriptors.)53 b(If)34 b Fq(w)m(ord)k Ft(expands)c(to)h(one)g(or)g | |
9898 | (more)g(digits,)h(the)f(\014le)150 543 y(descriptor)e(denoted)h(b)m(y)g | |
220537f2 CR |
9899 | Fq(n)f Ft(is)g(made)h(to)g(b)s(e)f(a)h(cop)m(y)g(of)g(that)g(\014le)g |
9900 | (descriptor.)50 b(If)33 b(the)h(digits)g(in)f Fq(w)m(ord)150 | |
9f178efb | 9901 | 653 y Ft(do)c(not)h(sp)s(ecify)f(a)h(\014le)f(descriptor)g(op)s(en)g |
220537f2 | 9902 | (for)g(input,)g(a)h(redirection)g(error)f(o)s(ccurs.)40 |
9f178efb | 9903 | b(If)29 b Fq(w)m(ord)j Ft(ev)-5 b(aluates)150 762 y(to)31 |
220537f2 CR |
9904 | b(`)p Fs(-)p Ft(',)g(\014le)g(descriptor)g Fq(n)f Ft(is)g(closed.)43 |
9905 | b(If)30 b Fq(n)g Ft(is)g(not)h(sp)s(eci\014ed,)f(the)h(standard)f | |
9f178efb CR |
9906 | (input)g(\(\014le)h(descriptor)f(0\))150 872 y(is)g(used.)275 |
9907 | 1006 y(The)f(op)s(erator)390 1141 y Fs([)p Fi(n)11 b | |
9908 | Fs(]>&)p Fi(word)150 1275 y Ft(is)40 b(used)g(similarly)h(to)g | |
220537f2 CR |
9909 | (duplicate)f(output)g(\014le)h(descriptors.)70 b(If)40 |
9910 | b Fq(n)f Ft(is)i(not)f(sp)s(eci\014ed,)i(the)f(standard)150 | |
9f178efb | 9911 | 1385 y(output)30 b(\(\014le)g(descriptor)g(1\))h(is)f(used.)39 |
d3ad40de | 9912 | b(If)30 b(the)g(digits)h(in)e Fq(w)m(ord)34 b Ft(do)29 |
220537f2 | 9913 | b(not)i(sp)s(ecify)e(a)i(\014le)f(descriptor)g(op)s(en)150 |
9f178efb | 9914 | 1494 y(for)35 b(output,)h(a)g(redirection)g(error)e(o)s(ccurs.)55 |
77638cbf CR |
9915 | b(If)35 b Fq(w)m(ord)j Ft(ev)-5 b(aluates)37 b(to)f(`)p |
9916 | Fs(-)p Ft(',)h(\014le)e(descriptor)g Fq(n)g Ft(is)g(closed.)150 | |
9f178efb | 9917 | 1604 y(As)f(a)g(sp)s(ecial)h(case,)h(if)e Fq(n)f Ft(is)h(omitted,)i |
77638cbf | 9918 | (and)e Fq(w)m(ord)j Ft(do)s(es)d(not)g(expand)f(to)i(one)f(or)g(more)g |
9f178efb | 9919 | (digits)h(or)f(`)p Fs(-)p Ft(',)150 1713 y(the)d(standard)e(output)h |
77638cbf | 9920 | (and)g(standard)f(error)h(are)h(redirected)g(as)g(describ)s(ed)e |
9f178efb CR |
9921 | (previously)-8 b(.)150 1913 y Fj(3.6.9)63 b(Mo)m(ving)41 |
9922 | b(File)h(Descriptors)150 2060 y Ft(The)30 b(redirection)h(op)s(erator) | |
9923 | 390 2194 y Fs([)p Fi(n)11 b Fs(]<&)p Fi(digit)g Fs(-)150 | |
9924 | 2328 y Ft(mo)m(v)m(es)33 b(the)f(\014le)g(descriptor)f | |
45c0f7f8 | 9925 | Fq(digit)k Ft(to)d(\014le)g(descriptor)g Fq(n)p Ft(,)f(or)h(the)g |
9f178efb | 9926 | (standard)f(input)f(\(\014le)j(descriptor)e(0\))150 2438 |
45c0f7f8 CR |
9927 | y(if)f Fq(n)g Ft(is)h(not)f(sp)s(eci\014ed.)40 b Fq(digit)33 |
9928 | b Ft(is)e(closed)g(after)g(b)s(eing)f(duplicated)g(to)h | |
9f178efb CR |
9929 | Fq(n)p Ft(.)275 2572 y(Similarly)-8 b(,)31 b(the)f(redirection)h(op)s |
9930 | (erator)390 2707 y Fs([)p Fi(n)11 b Fs(]>&)p Fi(digit)g | |
9931 | Fs(-)150 2841 y Ft(mo)m(v)m(es)29 b(the)g(\014le)f(descriptor)f | |
abe2eb5b CR |
9932 | Fq(digit)k Ft(to)e(\014le)f(descriptor)g Fq(n)p Ft(,)g(or)g(the)g |
9933 | (standard)f(output)h(\(\014le)g(descriptor)g(1\))150 | |
9f178efb CR |
9934 | 2951 y(if)i Fq(n)g Ft(is)h(not)f(sp)s(eci\014ed.)150 |
9935 | 3150 y Fj(3.6.10)63 b(Op)s(ening)42 b(File)g(Descriptors)g(for)g | |
9936 | (Reading)e(and)h(W)-10 b(riting)150 3297 y Ft(The)30 | |
9937 | b(redirection)h(op)s(erator)390 3432 y Fs([)p Fi(n)11 | |
9938 | b Fs(]<>)p Fi(word)150 3566 y Ft(causes)39 b(the)g(\014le)g(whose)g | |
abe2eb5b | 9939 | (name)g(is)g(the)g(expansion)g(of)g Fq(w)m(ord)j Ft(to)d(b)s(e)g(op)s |
9f178efb | 9940 | (ened)f(for)g(b)s(oth)h(reading)g(and)150 3676 y(writing)33 |
abe2eb5b CR |
9941 | b(on)f(\014le)h(descriptor)f Fq(n)p Ft(,)h(or)g(on)f(\014le)h |
9942 | (descriptor)g(0)g(if)f Fq(n)g Ft(is)h(not)g(sp)s(eci\014ed.)47 | |
9f178efb CR |
9943 | b(If)32 b(the)h(\014le)f(do)s(es)h(not)150 3785 y(exist,)e(it)g(is)g |
9944 | (created.)150 4018 y Fr(3.7)68 b(Executing)46 b(Commands)150 | |
9945 | 4242 y Fj(3.7.1)63 b(Simple)41 b(Command)h(Expansion)150 | |
9946 | 4389 y Ft(When)33 b(a)g(simple)g(command)g(is)g(executed,)h(the)g | |
abe2eb5b | 9947 | (shell)f(p)s(erforms)e(the)i(follo)m(wing)i(expansions,)e(assign-)150 |
9f178efb CR |
9948 | 4498 y(men)m(ts,)e(and)f(redirections,)h(from)f(left)h(to)g(righ)m(t.) |
9949 | 199 4633 y(1.)61 b(The)38 b(w)m(ords)f(that)i(the)g(parser)e(has)h | |
122f603c | 9950 | (mark)m(ed)g(as)h(v)-5 b(ariable)39 b(assignmen)m(ts)g(\(those)g |
9f178efb | 9951 | (preceding)f(the)330 4742 y(command)30 b(name\))h(and)f(redirections)h |
122f603c | 9952 | (are)f(sa)m(v)m(ed)i(for)e(later)h(pro)s(cessing.)199 |
9f178efb | 9953 | 4877 y(2.)61 b(The)39 b(w)m(ords)g(that)i(are)f(not)g(v)-5 |
122f603c | 9954 | b(ariable)40 b(assignmen)m(ts)h(or)e(redirections)i(are)f(expanded)f |
9f178efb | 9955 | (\(see)h(Sec-)330 4986 y(tion)d(3.5)i([Shell)e(Expansions],)h(page)g |
45c0f7f8 | 9956 | (20\).)61 b(If)37 b(an)m(y)g(w)m(ords)f(remain)h(after)h(expansion,)h |
9f178efb | 9957 | (the)e(\014rst)330 5096 y(w)m(ord)31 b(is)g(tak)m(en)h(to)g(b)s(e)f |
122f603c | 9958 | (the)g(name)h(of)f(the)h(command)f(and)f(the)i(remaining)f(w)m(ords)g |
9f178efb | 9959 | (are)g(the)h(argu-)330 5206 y(men)m(ts.)199 5340 y(3.)61 |
122f603c | 9960 | b(Redirections)25 b(are)f(p)s(erformed)f(as)h(describ)s(ed)f(ab)s(o)m |
9f178efb CR |
9961 | (v)m(e)i(\(see)g(Section)g(3.6)g([Redirections],)i(page)d(31\).)p |
9962 | eop end | |
9963 | %%Page: 35 41 | |
9964 | TeXDict begin 35 40 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
9965 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(35)199 299 | |
9966 | y(4.)61 b(The)25 b(text)h(after)f(the)g(`)p Fs(=)p Ft(')h(in)e(eac)m(h) | |
9967 | j(v)-5 b(ariable)25 b(assignmen)m(t)h(undergo)s(es)e(tilde)i | |
9968 | (expansion,)g(parameter)330 408 y(expansion,)49 b(command)d | |
9969 | (substitution,)j(arithmetic)d(expansion,)k(and)45 b(quote)h(remo)m(v)-5 | |
9970 | b(al)46 b(b)s(efore)330 518 y(b)s(eing)30 b(assigned)h(to)g(the)f(v)-5 | |
9971 | b(ariable.)275 686 y(If)32 b(no)i(command)f(name)g(results,)h(the)g(v) | |
9972 | -5 b(ariable)34 b(assignmen)m(ts)g(a\013ect)h(the)f(curren)m(t)f(shell) | |
9973 | h(en)m(viron-)150 795 y(men)m(t.)39 b(Otherwise,)27 b(the)e(v)-5 | |
9974 | b(ariables)26 b(are)g(added)f(to)h(the)f(en)m(vironmen)m(t)h(of)g(the)f | |
9975 | (executed)h(command)g(and)150 905 y(do)35 b(not)f(a\013ect)j(the)d | |
9976 | (curren)m(t)h(shell)g(en)m(vironmen)m(t.)54 b(If)34 b(an)m(y)h(of)g | |
9977 | (the)f(assignmen)m(ts)i(attempts)f(to)h(assign)150 1015 | |
9978 | y(a)j(v)-5 b(alue)39 b(to)g(a)g(readonly)f(v)-5 b(ariable,)42 | |
9979 | b(an)c(error)g(o)s(ccurs,)j(and)c(the)i(command)f(exits)h(with)g(a)f | |
9980 | (non-zero)150 1124 y(status.)275 1264 y(If)33 b(no)g(command)g(name)h | |
9981 | (results,)g(redirections)g(are)g(p)s(erformed,)f(but)g(do)h(not)f | |
9982 | (a\013ect)i(the)f(curren)m(t)150 1374 y(shell)d(en)m(vironmen)m(t.)41 | |
122f603c | 9983 | b(A)30 b(redirection)h(error)f(causes)h(the)g(command)f(to)h(exit)g |
9f178efb | 9984 | (with)f(a)h(non-zero)g(status.)275 1514 y(If)26 b(there)i(is)f(a)h |
122f603c | 9985 | (command)f(name)h(left)g(after)g(expansion,)g(execution)h(pro)s(ceeds)e |
9f178efb | 9986 | (as)g(describ)s(ed)f(b)s(elo)m(w.)150 1623 y(Otherwise,)39 |
122f603c | 9987 | b(the)e(command)g(exits.)62 b(If)37 b(one)g(of)g(the)h(expansions)f |
9f178efb | 9988 | (con)m(tained)h(a)g(command)f(substitu-)150 1733 y(tion,)i(the)d(exit)h |
122f603c | 9989 | (status)g(of)f(the)h(command)f(is)h(the)f(exit)h(status)g(of)f(the)h |
9f178efb | 9990 | (last)g(command)f(substitution)150 1843 y(p)s(erformed.)55 |
122f603c | 9991 | b(If)35 b(there)g(w)m(ere)h(no)g(command)f(substitutions,)i(the)e |
9f178efb CR |
9992 | (command)h(exits)g(with)f(a)h(status)g(of)150 1952 y(zero.)150 |
9993 | 2157 y Fj(3.7.2)63 b(Command)41 b(Searc)m(h)f(and)h(Execution)150 | |
9994 | 2304 y Ft(After)i(a)h(command)f(has)g(b)s(een)f(split)h(in)m(to)h(w)m | |
abe2eb5b | 9995 | (ords,)j(if)c(it)g(results)g(in)g(a)h(simple)f(command)g(and)f(an)150 |
9f178efb CR |
9996 | 2414 y(optional)32 b(list)f(of)f(argumen)m(ts,)h(the)g(follo)m(wing)g |
9997 | (actions)h(are)f(tak)m(en.)199 2554 y(1.)61 b(If)24 b(the)g(command)g | |
abe2eb5b | 9998 | (name)g(con)m(tains)i(no)e(slashes,)i(the)e(shell)h(attempts)g(to)g(lo) |
9f178efb | 9999 | s(cate)h(it.)39 b(If)24 b(there)g(exists)330 2663 y(a)h(shell)g |
abe2eb5b CR |
10000 | (function)f(b)m(y)g(that)h(name,)h(that)f(function)f(is)h(in)m(v)m(ok)m |
10001 | (ed)h(as)e(describ)s(ed)g(in)g(Section)h(3.3)h([Shell)330 | |
9f178efb | 10002 | 2773 y(F)-8 b(unctions],)31 b(page)h(16.)199 2910 y(2.)61 |
abe2eb5b CR |
10003 | b(If)41 b(the)g(name)h(do)s(es)f(not)g(matc)m(h)i(a)e(function,)j(the)e |
10004 | (shell)f(searc)m(hes)i(for)e(it)h(in)f(the)g(list)h(of)g(shell)330 | |
9f178efb CR |
10005 | 3020 y(builtins.)e(If)30 b(a)h(matc)m(h)g(is)f(found,)g(that)h(builtin) |
10006 | f(is)g(in)m(v)m(ok)m(ed.)199 3157 y(3.)61 b(If)40 b(the)g(name)h(is)f | |
abe2eb5b | 10007 | (neither)h(a)f(shell)h(function)f(nor)g(a)g(builtin,)j(and)d(con)m |
9f178efb | 10008 | (tains)h(no)g(slashes,)i(Bash)330 3267 y(searc)m(hes)c(eac)m(h)g |
abe2eb5b | 10009 | (elemen)m(t)g(of)g Fs($PATH)d Ft(for)i(a)g(directory)h(con)m(taining)g |
9f178efb | 10010 | (an)f(executable)h(\014le)f(b)m(y)g(that)330 3376 y(name.)56 |
abe2eb5b | 10011 | b(Bash)36 b(uses)f(a)h(hash)e(table)j(to)f(remem)m(b)s(er)f(the)h(full) |
9f178efb | 10012 | f(pathnames)g(of)h(executable)h(\014les)e(to)330 3486 |
74d0116b CR |
10013 | y(a)m(v)m(oid)e(m)m(ultiple)f Fs(PATH)f Ft(searc)m(hes)i(\(see)f(the)g |
10014 | (description)g(of)f Fs(hash)g Ft(in)g(Section)i(4.1)f([Bourne)g(Shell) | |
9f178efb | 10015 | 330 3595 y(Builtins],)37 b(page)f(41\).)55 b(A)35 b(full)g(searc)m(h)g |
74d0116b | 10016 | (of)g(the)g(directories)h(in)f Fs($PATH)e Ft(is)i(p)s(erformed)f(only)h |
9f178efb | 10017 | (if)g(the)330 3705 y(command)24 b(is)h(not)g(found)e(in)i(the)g(hash)f |
74d0116b | 10018 | (table.)39 b(If)25 b(the)f(searc)m(h)i(is)e(unsuccessful,)h(the)g |
9f178efb | 10019 | (shell)g(searc)m(hes)330 3815 y(for)e(a)h(de\014ned)e(shell)h(function) |
122f603c | 10020 | h(named)e Fs(command_not_found_handle)p Ft(.)32 b(If)23 |
9f178efb | 10021 | b(that)h(function)f(exists,)330 3924 y(it)32 b(is)f(in)m(v)m(ok)m(ed)i |
74d0116b | 10022 | (with)e(the)h(original)g(command)f(and)g(the)h(original)g(command's)f |
9f178efb | 10023 | (argumen)m(ts)h(as)g(its)330 4034 y(argumen)m(ts,)h(and)e(the)i |
f6da9f85 | 10024 | (function's)e(exit)i(status)g(b)s(ecomes)f(the)g(exit)h(status)f(of)h |
9f178efb | 10025 | (the)f(shell.)46 b(If)31 b(that)330 4143 y(function)g(is)g(not)g |
f6da9f85 | 10026 | (de\014ned,)f(the)i(shell)f(prin)m(ts)f(an)h(error)g(message)h(and)f |
9f178efb CR |
10027 | (returns)e(an)i(exit)h(status)g(of)330 4253 y(127.)199 |
10028 | 4390 y(4.)61 b(If)33 b(the)g(searc)m(h)h(is)g(successful,)g(or)f(if)g | |
f6da9f85 | 10029 | (the)h(command)f(name)g(con)m(tains)i(one)f(or)f(more)g(slashes,)i(the) |
9f178efb | 10030 | 330 4500 y(shell)g(executes)h(the)f(named)f(program)g(in)h(a)g |
74d0116b | 10031 | (separate)h(execution)f(en)m(vironmen)m(t.)55 b(Argumen)m(t)35 |
9f178efb | 10032 | b(0)330 4609 y(is)30 b(set)h(to)h(the)e(name)h(giv)m(en,)g(and)f(the)h |
eb2bb562 | 10033 | (remaining)f(argumen)m(ts)h(to)g(the)g(command)f(are)h(set)g(to)g(the) |
9f178efb CR |
10034 | 330 4719 y(argumen)m(ts)g(supplied,)e(if)h(an)m(y)-8 |
10035 | b(.)199 4856 y(5.)61 b(If)35 b(this)h(execution)h(fails)f(b)s(ecause)g | |
74d0116b | 10036 | (the)f(\014le)h(is)g(not)g(in)f(executable)j(format,)f(and)e(the)h |
9f178efb | 10037 | (\014le)g(is)g(not)330 4966 y(a)d(directory)-8 b(,)34 |
74d0116b CR |
10038 | b(it)f(is)g(assumed)e(to)j(b)s(e)d(a)i Fq(shell)g(script)h |
10039 | Ft(and)e(the)h(shell)f(executes)i(it)f(as)g(describ)s(ed)e(in)330 | |
9f178efb CR |
10040 | 5075 y(Section)g(3.8)h([Shell)e(Scripts],)g(page)i(38.)199 |
10041 | 5213 y(6.)61 b(If)38 b(the)h(command)f(w)m(as)h(not)g(b)s(egun)e(async) | |
74d0116b | 10042 | m(hronously)-8 b(,)42 b(the)c(shell)h(w)m(aits)h(for)e(the)h(command)f |
9f178efb CR |
10043 | (to)330 5322 y(complete)32 b(and)e(collects)i(its)f(exit)g(status.)p |
10044 | eop end | |
10045 | %%Page: 36 42 | |
10046 | TeXDict begin 36 41 bop 150 -116 a Ft(36)2572 b(Bash)31 | |
10047 | b(Reference)g(Man)m(ual)150 299 y Fj(3.7.3)63 b(Command)41 | |
10048 | b(Execution)f(En)m(vironmen)m(t)150 446 y Ft(The)30 b(shell)g(has)h(an) | |
10049 | f Fq(execution)h(en)m(vironmen)m(t)r Ft(,)h(whic)m(h)e(consists)h(of)f | |
10050 | (the)h(follo)m(wing:)225 579 y Fp(\017)60 b Ft(op)s(en)32 | |
10051 | b(\014les)g(inherited)g(b)m(y)h(the)f(shell)h(at)g(in)m(v)m(o)s | |
10052 | (cation,)j(as)c(mo)s(di\014ed)g(b)m(y)g(redirections)h(supplied)e(to) | |
10053 | 330 688 y(the)g Fs(exec)e Ft(builtin)225 821 y Fp(\017)60 | |
10054 | b Ft(the)28 b(curren)m(t)g(w)m(orking)h(directory)g(as)f(set)h(b)m(y)f | |
10055 | Fs(cd)p Ft(,)g Fs(pushd)p Ft(,)g(or)g Fs(popd)p Ft(,)g(or)g(inherited)g | |
10056 | (b)m(y)g(the)h(shell)f(at)330 931 y(in)m(v)m(o)s(cation)225 | |
10057 | 1063 y Fp(\017)60 b Ft(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)g | |
10058 | (as)h(set)g(b)m(y)f Fs(umask)f Ft(or)h(inherited)g(from)g(the)h | |
10059 | (shell's)f(paren)m(t)225 1196 y Fp(\017)60 b Ft(curren)m(t)30 | |
10060 | b(traps)g(set)h(b)m(y)f Fs(trap)225 1329 y Fp(\017)60 | |
10061 | b Ft(shell)30 b(parameters)f(that)h(are)g(set)g(b)m(y)g(v)-5 | |
10062 | b(ariable)30 b(assignmen)m(t)g(or)g(with)f Fs(set)f Ft(or)i(inherited)f | |
10063 | (from)g(the)330 1439 y(shell's)i(paren)m(t)f(in)g(the)h(en)m(vironmen)m | |
10064 | (t)225 1571 y Fp(\017)60 b Ft(shell)44 b(functions)f(de\014ned)f | |
10065 | (during)h(execution)i(or)e(inherited)h(from)f(the)h(shell's)g(paren)m | |
10066 | (t)f(in)h(the)330 1681 y(en)m(vironmen)m(t)225 1814 y | |
10067 | Fp(\017)60 b Ft(options)33 b(enabled)g(at)h(in)m(v)m(o)s(cation)h | |
10068 | (\(either)f(b)m(y)f(default)g(or)g(with)g(command-line)g(argumen)m | |
10069 | (ts\))h(or)330 1923 y(b)m(y)c Fs(set)225 2056 y Fp(\017)60 | |
10070 | b Ft(options)31 b(enabled)f(b)m(y)g Fs(shopt)f Ft(\(see)j(Section)f | |
10071 | (4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g(62\))225 2189 | |
10072 | y Fp(\017)60 b Ft(shell)31 b(aliases)g(de\014ned)f(with)g | |
10073 | Fs(alias)f Ft(\(see)i(Section)g(6.6)h([Aliases],)g(page)f(87\))225 | |
10074 | 2322 y Fp(\017)60 b Ft(v)-5 b(arious)50 b(pro)s(cess)f | |
9d2b70f0 | 10075 | Fl(id)p Ft(s,)55 b(including)49 b(those)i(of)e(bac)m(kground)h(jobs)f |
9f178efb | 10076 | (\(see)i(Section)g(3.2.3)g([Lists],)330 2431 y(page)31 |
220537f2 | 10077 | b(9\),)g(the)g(v)-5 b(alue)31 b(of)f Fs($$)p Ft(,)g(and)g(the)h(v)-5 |
9f178efb | 10078 | b(alue)31 b(of)f Fs($PPID)275 2587 y Ft(When)k(a)g(simple)h(command)f |
abe2eb5b | 10079 | (other)g(than)g(a)h(builtin)f(or)g(shell)h(function)f(is)g(to)h(b)s(e)f |
9f178efb CR |
10080 | (executed,)i(it)f(is)150 2697 y(in)m(v)m(ok)m(ed)25 b(in)f(a)g |
10081 | (separate)h(execution)g(en)m(vironmen)m(t)g(that)f(consists)g(of)h(the) | |
10082 | f(follo)m(wing.)40 b(Unless)24 b(otherwise)150 2807 y(noted,)31 | |
a8fd3f3e | 10083 | b(the)f(v)-5 b(alues)31 b(are)g(inherited)f(from)g(the)g(shell.)225 |
9f178efb | 10084 | 2939 y Fp(\017)60 b Ft(the)31 b(shell's)h(op)s(en)e(\014les,)i(plus)e |
4a8bb13f | 10085 | (an)m(y)h(mo)s(di\014cations)h(and)e(additions)h(sp)s(eci\014ed)g(b)m |
9f178efb | 10086 | (y)g(redirections)g(to)330 3049 y(the)g(command)225 3182 |
74d0116b | 10087 | y Fp(\017)60 b Ft(the)31 b(curren)m(t)f(w)m(orking)g(directory)225 |
9f178efb CR |
10088 | 3315 y Fp(\017)60 b Ft(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)225 |
10089 | 3447 y Fp(\017)60 b Ft(shell)32 b(v)-5 b(ariables)33 | |
122f603c | 10090 | b(and)e(functions)h(mark)m(ed)g(for)g(exp)s(ort,)g(along)h(with)f(v)-5 |
9f178efb | 10091 | b(ariables)32 b(exp)s(orted)g(for)g(the)330 3557 y(command,)e(passed)g |
122f603c | 10092 | (in)g(the)h(en)m(vironmen)m(t)g(\(see)g(Section)g(3.7.4)i([En)m |
9f178efb | 10093 | (vironmen)m(t],)e(page)g(37\))225 3690 y Fp(\017)60 b |
122f603c CR |
10094 | Ft(traps)31 b(caugh)m(t)h(b)m(y)f(the)g(shell)h(are)f(reset)h(to)g(the) |
10095 | f(v)-5 b(alues)32 b(inherited)e(from)h(the)g(shell's)h(paren)m(t,)g | |
9f178efb CR |
10096 | (and)330 3799 y(traps)e(ignored)h(b)m(y)f(the)g(shell)h(are)g(ignored) |
10097 | 275 3955 y(A)41 b(command)g(in)m(v)m(ok)m(ed)i(in)e(this)h(separate)g | |
122f603c | 10098 | (en)m(vironmen)m(t)g(cannot)g(a\013ect)h(the)f(shell's)g(execution)150 |
9f178efb | 10099 | 4065 y(en)m(vironmen)m(t.)275 4198 y(Command)35 b(substitution,)j |
122f603c | 10100 | (commands)e(group)s(ed)f(with)i(paren)m(theses,)h(and)e(async)m |
9f178efb | 10101 | (hronous)g(com-)150 4307 y(mands)c(are)h(in)m(v)m(ok)m(ed)i(in)d(a)i |
122f603c | 10102 | (subshell)e(en)m(vironmen)m(t)h(that)h(is)f(a)g(duplicate)h(of)f(the)g |
9f178efb | 10103 | (shell)g(en)m(vironmen)m(t,)150 4417 y(except)i(that)g(traps)f(caugh)m |
122f603c CR |
10104 | (t)h(b)m(y)f(the)h(shell)f(are)g(reset)h(to)g(the)f(v)-5 |
10105 | b(alues)35 b(that)g(the)f(shell)h(inherited)e(from)150 | |
9f178efb | 10106 | 4526 y(its)g(paren)m(t)f(at)h(in)m(v)m(o)s(cation.)49 |
122f603c | 10107 | b(Builtin)32 b(commands)g(that)h(are)g(in)m(v)m(ok)m(ed)h(as)e(part)g |
9f178efb | 10108 | (of)h(a)f(pip)s(eline)g(are)h(also)150 4636 y(executed)41 |
122f603c CR |
10109 | b(in)f(a)h(subshell)e(en)m(vironmen)m(t.)72 b(Changes)40 |
10110 | b(made)g(to)h(the)g(subshell)e(en)m(vironmen)m(t)i(cannot)150 | |
9f178efb CR |
10111 | 4746 y(a\013ect)32 b(the)f(shell's)f(execution)i(en)m(vironmen)m(t.)275 |
10112 | 4878 y(Subshells)24 b(spa)m(wned)h(to)i(execute)g(command)f | |
db31fb26 | 10113 | (substitutions)g(inherit)g(the)g(v)-5 b(alue)26 b(of)g(the)h(`)p |
9f178efb | 10114 | Fs(-e)p Ft(')e(option)150 4988 y(from)20 b(the)h(paren)m(t)g(shell.)37 |
db31fb26 | 10115 | b(When)21 b(not)f(in)h Fl(posix)f Ft(mo)s(de,)i(Bash)f(clears)g(the)g |
9ec5ed66 | 10116 | (`)p Fs(-e)p Ft(')f(option)h(in)g(suc)m(h)f(subshells.)275 |
9f178efb | 10117 | 5121 y(If)38 b(a)h(command)f(is)g(follo)m(w)m(ed)j(b)m(y)d(a)h(`)p |
db31fb26 | 10118 | Fs(&)p Ft(')g(and)f(job)g(con)m(trol)i(is)e(not)h(activ)m(e,)k(the)c |
9f178efb | 10119 | (default)g(standard)150 5230 y(input)e(for)g(the)h(command)f(is)h(the)g |
db31fb26 | 10120 | (empt)m(y)g(\014le)f(`)p Fs(/dev/null)p Ft('.)61 b(Otherwise,)39 |
9f178efb | 10121 | b(the)f(in)m(v)m(ok)m(ed)h(command)150 5340 y(inherits)30 |
db31fb26 | 10122 | b(the)h(\014le)f(descriptors)g(of)h(the)f(calling)i(shell)f(as)f(mo)s |
9f178efb CR |
10123 | (di\014ed)g(b)m(y)g(redirections.)p eop end |
10124 | %%Page: 37 43 | |
10125 | TeXDict begin 37 42 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
10126 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(37)150 299 | |
10127 | y Fj(3.7.4)63 b(En)m(vironmen)m(t)150 446 y Ft(When)28 | |
10128 | b(a)i(program)e(is)h(in)m(v)m(ok)m(ed)h(it)f(is)g(giv)m(en)g(an)g(arra) | |
10129 | m(y)g(of)g(strings)f(called)i(the)f Fq(en)m(vironmen)m(t)r | |
10130 | Ft(.)41 b(This)28 b(is)h(a)150 555 y(list)i(of)g(name-v)-5 | |
10131 | b(alue)31 b(pairs,)f(of)h(the)f(form)g Fs(name=value)p | |
10132 | Ft(.)275 717 y(Bash)39 b(pro)m(vides)g(sev)m(eral)i(w)m(a)m(ys)g(to)f | |
10133 | (manipulate)f(the)h(en)m(vironmen)m(t.)69 b(On)38 b(in)m(v)m(o)s | |
10134 | (cation,)44 b(the)c(shell)150 826 y(scans)g(its)h(o)m(wn)f(en)m | |
10135 | (vironmen)m(t)h(and)f(creates)i(a)f(parameter)f(for)g(eac)m(h)i(name)e | |
10136 | (found,)i(automatically)150 936 y(marking)26 b(it)g(for)g | |
10137 | Fq(exp)s(ort)h Ft(to)g(c)m(hild)f(pro)s(cesses.)39 b(Executed)26 | |
10138 | b(commands)g(inherit)g(the)g(en)m(vironmen)m(t.)39 b(The)150 | |
10139 | 1046 y Fs(export)c Ft(and)i(`)p Fs(declare)29 b(-x)p | |
10140 | Ft(')36 b(commands)h(allo)m(w)i(parameters)e(and)g(functions)g(to)h(b)s | |
10141 | (e)e(added)h(to)h(and)150 1155 y(deleted)21 b(from)f(the)h(en)m | |
10142 | (vironmen)m(t.)38 b(If)20 b(the)h(v)-5 b(alue)21 b(of)g(a)g(parameter)g | |
10143 | (in)f(the)g(en)m(vironmen)m(t)i(is)e(mo)s(di\014ed,)i(the)150 | |
10144 | 1265 y(new)31 b(v)-5 b(alue)32 b(b)s(ecomes)f(part)h(of)f(the)h(en)m | |
10145 | (vironmen)m(t,)g(replacing)h(the)e(old.)44 b(The)31 b(en)m(vironmen)m | |
10146 | (t)h(inherited)150 1374 y(b)m(y)f(an)m(y)g(executed)h(command)f | |
10147 | (consists)g(of)g(the)g(shell's)h(initial)g(en)m(vironmen)m(t,)g(whose)f | |
10148 | (v)-5 b(alues)31 b(ma)m(y)h(b)s(e)150 1484 y(mo)s(di\014ed)26 | |
220537f2 CR |
10149 | b(in)g(the)h(shell,)h(less)f(an)m(y)g(pairs)f(remo)m(v)m(ed)i(b)m(y)f |
10150 | (the)g Fs(unset)e Ft(and)h(`)p Fs(export)j(-n)p Ft(')e(commands,)g | |
9f178efb CR |
10151 | (plus)150 1594 y(an)m(y)k(additions)f(via)h(the)g Fs(export)d |
10152 | Ft(and)i(`)p Fs(declare)f(-x)p Ft(')h(commands.)275 1755 | |
220537f2 CR |
10153 | y(The)j(en)m(vironmen)m(t)i(for)f(an)m(y)g(simple)h(command)f(or)g |
10154 | (function)g(ma)m(y)g(b)s(e)g(augmen)m(ted)h(temp)s(orarily)150 | |
9f178efb | 10155 | 1865 y(b)m(y)c(pre\014xing)e(it)i(with)g(parameter)g(assignmen)m(ts,)h |
220537f2 | 10156 | (as)e(describ)s(ed)g(in)g(Section)i(3.4)g([Shell)e(P)m(arameters],)150 |
9f178efb | 10157 | 1974 y(page)g(18.)41 b(These)29 b(assignmen)m(t)i(statemen)m(ts)g |
220537f2 | 10158 | (a\013ect)f(only)g(the)f(en)m(vironmen)m(t)h(seen)g(b)m(y)f(that)h |
9f178efb CR |
10159 | (command.)275 2135 y(If)d(the)h(`)p Fs(-k)p Ft(')g(option)g(is)g(set)g |
10160 | (\(see)h(Section)f(4.3.1)i([The)e(Set)g(Builtin],)h(page)f(58\),)i | |
10161 | (then)e(all)g(parameter)150 2245 y(assignmen)m(ts)i(are)g(placed)h(in)e | |
10162 | (the)h(en)m(vironmen)m(t)g(for)g(a)g(command,)f(not)h(just)f(those)i | |
10163 | (that)f(precede)g(the)150 2355 y(command)g(name.)275 | |
10164 | 2516 y(When)h(Bash)h(in)m(v)m(ok)m(es)i(an)e(external)h(command,)f(the) | |
10165 | g(v)-5 b(ariable)33 b(`)p Fs($_)p Ft(')f(is)g(set)h(to)f(the)g(full)g | |
10166 | (pathname)150 2626 y(of)f(the)f(command)g(and)g(passed)g(to)h(that)g | |
10167 | (command)f(in)g(its)h(en)m(vironmen)m(t.)150 2852 y Fj(3.7.5)63 | |
10168 | b(Exit)40 b(Status)150 2999 y Ft(The)26 b(exit)h(status)f(of)g(an)g | |
45c0f7f8 | 10169 | (executed)h(command)f(is)g(the)h(v)-5 b(alue)26 b(returned)f(b)m(y)h |
9f178efb | 10170 | (the)g Fq(w)m(aitpid)k Ft(system)d(call)g(or)150 3108 |
45c0f7f8 CR |
10171 | y(equiv)-5 b(alen)m(t)33 b(function.)45 b(Exit)32 b(statuses)g(fall)g |
10172 | (b)s(et)m(w)m(een)h(0)f(and)f(255,)i(though,)f(as)g(explained)g(b)s | |
9f178efb | 10173 | (elo)m(w,)h(the)150 3218 y(shell)i(ma)m(y)g(use)f(v)-5 |
45c0f7f8 CR |
10174 | b(alues)35 b(ab)s(o)m(v)m(e)g(125)h(sp)s(ecially)-8 b(.)54 |
10175 | b(Exit)35 b(statuses)g(from)f(shell)h(builtins)f(and)f(comp)s(ound)150 | |
9f178efb | 10176 | 3328 y(commands)j(are)g(also)h(limited)g(to)g(this)f(range.)58 |
45c0f7f8 | 10177 | b(Under)36 b(certain)h(circumstances,)h(the)e(shell)h(will)f(use)150 |
9f178efb CR |
10178 | 3437 y(sp)s(ecial)31 b(v)-5 b(alues)31 b(to)g(indicate)g(sp)s(eci\014c) |
10179 | f(failure)h(mo)s(des.)275 3599 y(F)-8 b(or)32 b(the)g(shell's)g(purp)s | |
45c0f7f8 | 10180 | (oses,)e(a)j(command)e(whic)m(h)h(exits)g(with)g(a)g(zero)g(exit)h |
9f178efb | 10181 | (status)f(has)f(succeeded.)150 3708 y(A)e(non-zero)h(exit)g(status)g |
45c0f7f8 | 10182 | (indicates)g(failure.)40 b(This)28 b(seemingly)i(coun)m(ter-in)m |
9f178efb | 10183 | (tuitiv)m(e)i(sc)m(heme)e(is)f(used)g(so)150 3818 y(there)34 |
45c0f7f8 CR |
10184 | b(is)g(one)g(w)m(ell-de\014ned)g(w)m(a)m(y)g(to)h(indicate)g(success)f |
10185 | (and)f(a)h(v)-5 b(ariet)m(y)35 b(of)f(w)m(a)m(ys)h(to)f(indicate)h(v)-5 | |
9f178efb | 10186 | b(arious)150 3927 y(failure)37 b(mo)s(des.)61 b(When)37 |
45c0f7f8 | 10187 | b(a)g(command)g(terminates)h(on)f(a)g(fatal)i(signal)f(whose)f(n)m(um)m |
9f178efb | 10188 | (b)s(er)e(is)i Fq(N)10 b Ft(,)38 b(Bash)150 4037 y(uses)30 |
45c0f7f8 | 10189 | b(the)g(v)-5 b(alue)31 b(128)p Fs(+)p Fq(N)42 b Ft(as)30 |
9f178efb | 10190 | b(the)h(exit)g(status.)275 4198 y(If)k(a)h(command)g(is)g(not)g(found,) |
45c0f7f8 | 10191 | g(the)g(c)m(hild)h(pro)s(cess)e(created)i(to)g(execute)g(it)g(returns)d |
9f178efb | 10192 | (a)j(status)f(of)150 4308 y(127.)42 b(If)30 b(a)h(command)f(is)g(found) |
45c0f7f8 | 10193 | f(but)h(is)g(not)h(executable,)h(the)f(return)e(status)i(is)f(126.)275 |
9f178efb | 10194 | 4469 y(If)i(a)i(command)f(fails)g(b)s(ecause)g(of)h(an)f(error)f |
74d0116b | 10195 | (during)g(expansion)h(or)g(redirection,)i(the)f(exit)g(status)150 |
9f178efb | 10196 | 4579 y(is)c(greater)i(than)e(zero.)275 4740 y(The)38 |
74d0116b | 10197 | b(exit)h(status)g(is)g(used)f(b)m(y)g(the)h(Bash)g(conditional)h |
9f178efb | 10198 | (commands)e(\(see)h(Section)h(3.2.4.2)h([Con-)150 4850 |
74d0116b CR |
10199 | y(ditional)i(Constructs],)h(page)f(10\))g(and)e(some)i(of)f(the)g(list) |
10200 | g(constructs)g(\(see)h(Section)f(3.2.3)i([Lists],)150 | |
9f178efb | 10201 | 4959 y(page)31 b(9\).)275 5121 y(All)40 b(of)g(the)h(Bash)f(builtins)f |
37c41ab1 | 10202 | (return)g(an)h(exit)h(status)g(of)f(zero)h(if)f(they)g(succeed)g(and)g |
9f178efb | 10203 | (a)g(non-zero)150 5230 y(status)34 b(on)f(failure,)i(so)f(they)g(ma)m |
9ec5ed66 | 10204 | (y)g(b)s(e)f(used)g(b)m(y)g(the)h(conditional)h(and)e(list)h |
9f178efb CR |
10205 | (constructs.)50 b(All)35 b(builtins)150 5340 y(return)29 |
10206 | b(an)i(exit)g(status)g(of)f(2)h(to)g(indicate)g(incorrect)h(usage.)p | |
abe2eb5b | 10207 | eop end |
9f178efb CR |
10208 | %%Page: 38 44 |
10209 | TeXDict begin 38 43 bop 150 -116 a Ft(38)2572 b(Bash)31 | |
10210 | b(Reference)g(Man)m(ual)150 299 y Fj(3.7.6)63 b(Signals)150 | |
10211 | 446 y Ft(When)36 b(Bash)g(is)h(in)m(teractiv)m(e,)j(in)c(the)h(absence) | |
10212 | f(of)h(an)m(y)f(traps,)i(it)e(ignores)h Fs(SIGTERM)d | |
10213 | Ft(\(so)j(that)g(`)p Fs(kill)150 555 y(0)p Ft(')c(do)s(es)g(not)g(kill) | |
10214 | g(an)g(in)m(teractiv)m(e)j(shell\),)f(and)d Fs(SIGINT)f | |
10215 | Ft(is)i(caugh)m(t)h(and)f(handled)f(\(so)h(that)h(the)f | |
10216 | Fs(wait)150 665 y Ft(builtin)24 b(is)h(in)m(terruptible\).)39 | |
10217 | b(When)24 b(Bash)g(receiv)m(es)j(a)d Fs(SIGINT)p Ft(,)h(it)g(breaks)f | |
10218 | (out)h(of)f(an)m(y)h(executing)h(lo)s(ops.)150 775 y(In)31 | |
10219 | b(all)h(cases,)h(Bash)f(ignores)g Fs(SIGQUIT)p Ft(.)42 | |
10220 | b(If)32 b(job)f(con)m(trol)i(is)e(in)h(e\013ect)h(\(see)f(Chapter)f(7)h | |
10221 | ([Job)g(Con)m(trol],)150 884 y(page)f(97\),)h(Bash)e(ignores)h | |
10222 | Fs(SIGTTIN)p Ft(,)e Fs(SIGTTOU)p Ft(,)g(and)g Fs(SIGTSTP)p | |
10223 | Ft(.)275 1026 y(Non-builtin)i(commands)g(started)g(b)m(y)g(Bash)h(ha)m | |
10224 | (v)m(e)g(signal)g(handlers)e(set)i(to)g(the)g(v)-5 b(alues)31 | |
10225 | b(inherited)150 1136 y(b)m(y)37 b(the)h(shell)g(from)f(its)h(paren)m | |
10226 | (t.)62 b(When)38 b(job)f(con)m(trol)i(is)e(not)h(in)f(e\013ect,)k | |
10227 | (async)m(hronous)c(commands)150 1246 y(ignore)f Fs(SIGINT)e | |
10228 | Ft(and)h Fs(SIGQUIT)e Ft(in)j(addition)f(to)i(these)f(inherited)f | |
10229 | (handlers.)55 b(Commands)35 b(run)f(as)i(a)150 1355 y(result)27 | |
10230 | b(of)h(command)f(substitution)h(ignore)g(the)g(k)m(eyb)s | |
10231 | (oard-generated)g(job)g(con)m(trol)h(signals)f Fs(SIGTTIN)p | |
10232 | Ft(,)150 1465 y Fs(SIGTTOU)p Ft(,)h(and)g Fs(SIGTSTP)p | |
10233 | Ft(.)275 1607 y(The)h(shell)i(exits)g(b)m(y)f(default)g(up)s(on)f | |
10234 | (receipt)i(of)f(a)h Fs(SIGHUP)p Ft(.)42 b(Before)32 b(exiting,)h(an)e | |
10235 | (in)m(teractiv)m(e)j(shell)150 1717 y(resends)41 b(the)i | |
10236 | Fs(SIGHUP)e Ft(to)i(all)g(jobs,)i(running)c(or)h(stopp)s(ed.)76 | |
10237 | b(Stopp)s(ed)41 b(jobs)h(are)h(sen)m(t)g Fs(SIGCONT)d | |
10238 | Ft(to)150 1826 y(ensure)32 b(that)h(they)g(receiv)m(e)i(the)e | |
10239 | Fs(SIGHUP)p Ft(.)47 b(T)-8 b(o)33 b(prev)m(en)m(t)g(the)g(shell)g(from) | |
10240 | g(sending)f(the)h Fs(SIGHUP)e Ft(signal)150 1936 y(to)i(a)g(particular) | |
10241 | g(job,)g(it)g(should)f(b)s(e)g(remo)m(v)m(ed)h(from)g(the)f(jobs)g | |
10242 | (table)i(with)e(the)h Fs(disown)e Ft(builtin)h(\(see)150 | |
10243 | 2045 y(Section)f(7.2)g([Job)f(Con)m(trol)h(Builtins],)g(page)g(98\))h | |
10244 | (or)e(mark)m(ed)g(to)h(not)f(receiv)m(e)i Fs(SIGHUP)d | |
10245 | Ft(using)h Fs(disown)150 2155 y(-h)p Ft(.)275 2297 y(If)38 | |
10246 | b(the)h Fs(huponexit)e Ft(shell)i(option)g(has)g(b)s(een)f(set)i(with)f | |
10247 | Fs(shopt)e Ft(\(see)j(Section)g(4.3.2)h([The)e(Shopt)150 | |
10248 | 2407 y(Builtin],)31 b(page)g(62\),)h(Bash)f(sends)e(a)i | |
10249 | Fs(SIGHUP)e Ft(to)i(all)g(jobs)f(when)f(an)i(in)m(teractiv)m(e)i(login) | |
10250 | e(shell)g(exits.)275 2549 y(If)38 b(Bash)h(is)g(w)m(aiting)h(for)f(a)g | |
10251 | (command)f(to)i(complete)g(and)e(receiv)m(es)j(a)e(signal)h(for)e(whic) | |
10252 | m(h)h(a)g(trap)150 2659 y(has)c(b)s(een)f(set,)i(the)f(trap)g(will)g | |
10253 | (not)g(b)s(e)f(executed)i(un)m(til)f(the)g(command)f(completes.)55 | |
10254 | b(When)35 b(Bash)g(is)150 2768 y(w)m(aiting)j(for)f(an)g(async)m | |
220537f2 | 10255 | (hronous)g(command)g(via)h(the)f Fs(wait)f Ft(builtin,)i(the)g |
9f178efb CR |
10256 | (reception)g(of)f(a)g(signal)h(for)150 2878 y(whic)m(h)d(a)g(trap)g |
10257 | (has)g(b)s(een)f(set)h(will)h(cause)f(the)g Fs(wait)f | |
10258 | Ft(builtin)h(to)g(return)f(immediately)i(with)f(an)g(exit)150 | |
10259 | 2987 y(status)c(greater)g(than)f(128,)i(immediately)g(after)f(whic)m(h) | |
10260 | f(the)h(trap)f(is)g(executed.)150 3231 y Fr(3.8)68 b(Shell)45 | |
10261 | b(Scripts)150 3391 y Ft(A)30 b(shell)f(script)h(is)f(a)h(text)h(\014le) | |
10262 | f(con)m(taining)h(shell)f(commands.)40 b(When)29 b(suc)m(h)g(a)h | |
10263 | (\014le)g(is)f(used)g(as)h(the)g(\014rst)150 3500 y(non-option)i | |
10264 | (argumen)m(t)h(when)e(in)m(v)m(oking)i(Bash,)g(and)e(neither)h(the)g(`) | |
10265 | p Fs(-c)p Ft(')g(nor)g(`)p Fs(-s)p Ft(')g(option)g(is)g(supplied)150 | |
10266 | 3610 y(\(see)25 b(Section)h(6.1)f([In)m(v)m(oking)h(Bash],)g(page)f | |
10267 | (79\),)i(Bash)e(reads)f(and)g(executes)i(commands)e(from)g(the)h | |
10268 | (\014le,)150 3720 y(then)32 b(exits.)46 b(This)32 b(mo)s(de)f(of)i(op)s | |
122f603c | 10269 | (eration)f(creates)i(a)e(non-in)m(teractiv)m(e)j(shell.)46 |
9f178efb | 10270 | b(The)31 b(shell)i(\014rst)e(searc)m(hes)150 3829 y(for)d(the)g(\014le) |
122f603c CR |
10271 | g(in)g(the)g(curren)m(t)f(directory)-8 b(,)30 b(and)d(lo)s(oks)i(in)e |
10272 | (the)i(directories)g(in)e Fs($PATH)g Ft(if)h(not)g(found)e(there.)275 | |
9f178efb | 10273 | 3971 y(When)34 b(Bash)h(runs)e(a)i(shell)g(script,)g(it)h(sets)f(the)f |
122f603c | 10274 | (sp)s(ecial)i(parameter)f Fs(0)f Ft(to)h(the)g(name)g(of)g(the)g |
9f178efb | 10275 | (\014le,)150 4081 y(rather)k(than)g(the)h(name)f(of)h(the)f(shell,)j |
122f603c | 10276 | (and)d(the)h(p)s(ositional)g(parameters)f(are)h(set)g(to)g(the)g |
9f178efb | 10277 | (remain-)150 4191 y(ing)f(argumen)m(ts,)j(if)d(an)m(y)g(are)g(giv)m |
122f603c | 10278 | (en.)67 b(If)39 b(no)g(additional)g(argumen)m(ts)h(are)f(supplied,)h |
9f178efb CR |
10279 | (the)f(p)s(ositional)150 4300 y(parameters)31 b(are)f(unset.)275 |
10280 | 4442 y(A)39 b(shell)h(script)f(ma)m(y)h(b)s(e)f(made)h(executable)h(b)m | |
9ec5ed66 | 10281 | (y)e(using)g(the)h Fs(chmod)e Ft(command)h(to)h(turn)e(on)i(the)150 |
9f178efb | 10282 | 4552 y(execute)j(bit.)73 b(When)41 b(Bash)g(\014nds)e(suc)m(h)i(a)h |
9ec5ed66 | 10283 | (\014le)f(while)g(searc)m(hing)h(the)f Fs($PATH)f Ft(for)h(a)h |
9f178efb CR |
10284 | (command,)h(it)150 4662 y(spa)m(wns)30 b(a)g(subshell)g(to)h(execute)h |
10285 | (it.)41 b(In)30 b(other)g(w)m(ords,)g(executing)390 4804 | |
10286 | y Fs(filename)46 b Fi(arguments)150 4946 y Ft(is)30 b(equiv)-5 | |
10287 | b(alen)m(t)32 b(to)f(executing)390 5088 y Fs(bash)47 | |
10288 | b(filename)e Fi(arguments)150 5230 y Ft(if)30 b Fs(filename)d | |
9ec5ed66 CR |
10289 | Ft(is)j(an)f(executable)j(shell)e(script.)40 b(This)29 |
10290 | b(subshell)g(reinitializes)i(itself,)g(so)f(that)h(the)e(e\013ect)150 | |
9f178efb | 10291 | 5340 y(is)36 b(as)h(if)g(a)f(new)g(shell)h(had)f(b)s(een)g(in)m(v)m(ok) |
9ec5ed66 | 10292 | m(ed)h(to)h(in)m(terpret)e(the)h(script,)h(with)e(the)h(exception)h |
9f178efb CR |
10293 | (that)f(the)p eop end |
10294 | %%Page: 39 45 | |
10295 | TeXDict begin 39 44 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
10296 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(39)150 299 | |
10297 | y(lo)s(cations)25 b(of)g(commands)e(remem)m(b)s(ered)h(b)m(y)g(the)g | |
10298 | (paren)m(t)g(\(see)h(the)f(description)g(of)g Fs(hash)f | |
10299 | Ft(in)h(Section)h(4.1)150 408 y([Bourne)30 b(Shell)h(Builtins],)g(page) | |
10300 | g(41\))h(are)e(retained)h(b)m(y)f(the)h(c)m(hild.)275 | |
10301 | 543 y(Most)36 b(v)m(ersions)g(of)g(Unix)f(mak)m(e)h(this)g(a)g(part)f | |
10302 | (of)h(the)g(op)s(erating)g(system's)f(command)h(execution)150 | |
10303 | 653 y(mec)m(hanism.)50 b(If)33 b(the)g(\014rst)g(line)h(of)f(a)h | |
9ec5ed66 | 10304 | (script)f(b)s(egins)g(with)g(the)g(t)m(w)m(o)i(c)m(haracters)g(`)p |
9f178efb | 10305 | Fs(#!)p Ft(',)f(the)g(remainder)150 762 y(of)d(the)g(line)h(sp)s |
9ec5ed66 CR |
10306 | (eci\014es)e(an)h(in)m(terpreter)g(for)g(the)g(program.)43 |
10307 | b(Th)m(us,)30 b(y)m(ou)h(can)h(sp)s(ecify)e(Bash,)i Fs(awk)p | |
9f178efb | 10308 | Ft(,)e(P)m(erl,)150 872 y(or)g(some)h(other)g(in)m(terpreter)g(and)e |
9ec5ed66 | 10309 | (write)i(the)f(rest)h(of)g(the)f(script)g(\014le)h(in)f(that)h |
9f178efb | 10310 | (language.)275 1006 y(The)40 b(argumen)m(ts)h(to)g(the)g(in)m |
09767ff0 | 10311 | (terpreter)g(consist)g(of)g(a)g(single)h(optional)f(argumen)m(t)h |
9f178efb | 10312 | (follo)m(wing)g(the)150 1116 y(in)m(terpreter)33 b(name)h(on)f(the)g |
29d25b54 | 10313 | (\014rst)f(line)i(of)f(the)g(script)g(\014le,)h(follo)m(w)m(ed)h(b)m(y) |
9f178efb | 10314 | e(the)g(name)g(of)g(the)h(script)f(\014le,)150 1225 y(follo)m(w)m(ed)g |
29d25b54 CR |
10315 | (b)m(y)f(the)f(rest)h(of)g(the)f(argumen)m(ts.)45 b(Bash)31 |
10316 | b(will)h(p)s(erform)e(this)i(action)h(on)e(op)s(erating)h(systems)150 | |
9f178efb | 10317 | 1335 y(that)24 b(do)g(not)f(handle)g(it)h(themselv)m(es.)40 |
37c41ab1 | 10318 | b(Note)25 b(that)f(some)g(older)g(v)m(ersions)f(of)h(Unix)f(limit)i |
9f178efb CR |
10319 | (the)f(in)m(terpreter)150 1445 y(name)30 b(and)g(argumen)m(t)h(to)g(a)g |
10320 | (maxim)m(um)f(of)h(32)g(c)m(haracters.)275 1579 y(Bash)h(scripts)g | |
220537f2 | 10321 | (often)g(b)s(egin)g(with)g Fs(#!)e(/bin/bash)g Ft(\(assuming)i(that)h |
9f178efb | 10322 | (Bash)f(has)g(b)s(een)f(installed)i(in)150 1689 y(`)p |
220537f2 CR |
10323 | Fs(/bin)p Ft('\),)25 b(since)e(this)g(ensures)f(that)i(Bash)f(will)h(b) |
10324 | s(e)e(used)h(to)h(in)m(terpret)f(the)g(script,)i(ev)m(en)f(if)f(it)h | |
9f178efb | 10325 | (is)f(executed)150 1798 y(under)29 b(another)h(shell.)p |
220537f2 | 10326 | eop end |
9f178efb CR |
10327 | %%Page: 40 46 |
10328 | TeXDict begin 40 45 bop eop end | |
10329 | %%Page: 41 47 | |
10330 | TeXDict begin 41 46 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
10331 | b(Shell)30 b(Builtin)h(Commands)2069 b(41)150 299 y Fo(4)80 | |
c302751c CR |
10332 | b(Shell)53 b(Builtin)f(Commands)150 541 y Ft(Builtin)34 |
10333 | b(commands)f(are)h(con)m(tained)g(within)f(the)h(shell)g(itself.)50 | |
10334 | b(When)34 b(the)f(name)h(of)f(a)h(builtin)f(com-)150 | |
10335 | 651 y(mand)26 b(is)i(used)e(as)i(the)g(\014rst)e(w)m(ord)h(of)h(a)f | |
37c41ab1 | 10336 | (simple)h(command)f(\(see)h(Section)g(3.2.1)h([Simple)f(Commands],)150 |
c302751c | 10337 | 760 y(page)21 b(8\),)j(the)d(shell)g(executes)h(the)f(command)f |
37c41ab1 | 10338 | (directly)-8 b(,)24 b(without)d(in)m(v)m(oking)h(another)f(program.)37 |
c302751c | 10339 | b(Builtin)150 870 y(commands)f(are)h(necessary)g(to)g(implemen)m(t)g |
37c41ab1 | 10340 | (functionalit)m(y)h(imp)s(ossible)e(or)h(incon)m(v)m(enien)m(t)h(to)f |
c302751c CR |
10341 | (obtain)150 979 y(with)30 b(separate)h(utilities.)275 |
10342 | 1117 y(This)c(section)j(brie\015y)e(describ)s(es)g(the)h(builtins)f | |
ac18b312 | 10343 | (whic)m(h)g(Bash)h(inherits)f(from)g(the)h(Bourne)g(Shell,)g(as)150 |
c302751c | 10344 | 1226 y(w)m(ell)i(as)g(the)g(builtin)e(commands)h(whic)m(h)h(are)f |
ac18b312 | 10345 | (unique)g(to)h(or)f(ha)m(v)m(e)i(b)s(een)d(extended)i(in)f(Bash.)275 |
c302751c | 10346 | 1363 y(Sev)m(eral)45 b(builtin)e(commands)h(are)h(describ)s(ed)e(in)h |
ac18b312 | 10347 | (other)g(c)m(hapters:)69 b(builtin)43 b(commands)h(whic)m(h)150 |
c302751c | 10348 | 1473 y(pro)m(vide)23 b(the)h(Bash)f(in)m(terface)i(to)f(the)g(job)f |
37c41ab1 | 10349 | (con)m(trol)i(facilities)g(\(see)f(Section)h(7.2)f([Job)f(Con)m(trol)h |
9f178efb | 10350 | (Builtins],)150 1583 y(page)40 b(98\),)j(the)c(directory)h(stac)m(k)g |
37c41ab1 | 10351 | (\(see)g(Section)g(6.8.1)h([Directory)g(Stac)m(k)f(Builtins],)i(page)e |
9f178efb CR |
10352 | (89\),)j(the)150 1692 y(command)23 b(history)h(\(see)g(Section)g(9.2)h |
10353 | ([Bash)f(History)g(Builtins],)h(page)g(133\),)h(and)d(the)h | |
c302751c | 10354 | (programmable)150 1802 y(completion)32 b(facilities)g(\(see)g(Section)f |
9f178efb | 10355 | (8.7)g([Programmable)g(Completion)g(Builtins],)g(page)h(126\).)275 |
c302751c CR |
10356 | 1939 y(Man)m(y)f(of)f(the)h(builtins)e(ha)m(v)m(e)j(b)s(een)e(extended) |
10357 | g(b)m(y)g Fl(posix)g Ft(or)g(Bash.)275 2076 y(Unless)39 | |
6932f7f5 | 10358 | b(otherwise)h(noted,)i(eac)m(h)f(builtin)e(command)g(do)s(cumen)m(ted)g |
c302751c | 10359 | (as)h(accepting)h(options)f(pre-)150 2186 y(ceded)33 |
6932f7f5 CR |
10360 | b(b)m(y)h(`)p Fs(-)p Ft(')f(accepts)i(`)p Fs(--)p Ft(')e(to)h(signify)f |
10361 | (the)h(end)e(of)i(the)f(options.)50 b(The)33 b Fs(:)p | |
10362 | Ft(,)h Fs(true)p Ft(,)f Fs(false)p Ft(,)f(and)h Fs(test)150 | |
c302751c | 10363 | 2295 y Ft(builtins)i(do)g(not)h(accept)g(options)g(and)f(do)g(not)h |
6932f7f5 CR |
10364 | (treat)g(`)p Fs(--)p Ft(')f(sp)s(ecially)-8 b(.)57 b(The)35 |
10365 | b Fs(exit)p Ft(,)h Fs(logout)p Ft(,)f Fs(break)p Ft(,)150 | |
c302751c | 10366 | 2405 y Fs(continue)p Ft(,)29 b Fs(let)p Ft(,)i(and)g |
6932f7f5 | 10367 | Fs(shift)f Ft(builtins)g(accept)j(and)e(pro)s(cess)g(argumen)m(ts)g(b)s |
c302751c | 10368 | (eginning)g(with)g(`)p Fs(-)p Ft(')g(with-)150 2515 y(out)f(requiring)f |
6932f7f5 CR |
10369 | (`)p Fs(--)p Ft('.)41 b(Other)29 b(builtins)h(that)g(accept)h(argumen)m |
10370 | (ts)f(but)g(are)g(not)g(sp)s(eci\014ed)f(as)h(accepting)150 | |
c302751c | 10371 | 2624 y(options)25 b(in)m(terpret)f(argumen)m(ts)h(b)s(eginning)e(with)h |
6932f7f5 | 10372 | (`)p Fs(-)p Ft(')h(as)f(in)m(v)-5 b(alid)25 b(options)g(and)e(require)h |
c302751c CR |
10373 | (`)p Fs(--)p Ft(')g(to)h(prev)m(en)m(t)150 2734 y(this)30 |
10374 | b(in)m(terpretation.)150 2970 y Fr(4.1)68 b(Bourne)45 | |
10375 | b(Shell)g(Builtins)150 3130 y Ft(The)22 b(follo)m(wing)j(shell)d | |
10376 | (builtin)h(commands)f(are)h(inherited)g(from)f(the)h(Bourne)g(Shell.)38 | |
10377 | b(These)22 b(commands)150 3239 y(are)31 b(implemen)m(ted)g(as)f(sp)s | |
10378 | (eci\014ed)g(b)m(y)g(the)h Fl(posix)e Ft(standard.)150 | |
10379 | 3403 y Fs(:)h Ft(\(a)h(colon\))870 3512 y Fs(:)47 b([)p | |
10380 | Fi(arguments)11 b Fs(])630 3648 y Ft(Do)43 b(nothing)f(b)s(ey)m(ond)g | |
6932f7f5 | 10381 | (expanding)f Fq(argumen)m(ts)46 b Ft(and)c(p)s(erforming)f |
c302751c CR |
10382 | (redirections.)76 b(The)630 3758 y(return)29 b(status)i(is)f(zero.)150 |
10383 | 3920 y Fs(.)g Ft(\(a)h(p)s(erio)s(d\))870 4029 y Fs(.)47 | |
10384 | b Fi(filename)57 b Fs([)p Fi(arguments)11 b Fs(])630 | |
10385 | 4165 y Ft(Read)34 b(and)f(execute)i(commands)e(from)g(the)h | |
37c41ab1 | 10386 | Fq(\014lename)39 b Ft(argumen)m(t)34 b(in)f(the)h(curren)m(t)g(shell) |
c302751c | 10387 | 630 4275 y(con)m(text.)45 b(If)31 b Fq(\014lename)37 |
37c41ab1 CR |
10388 | b Ft(do)s(es)31 b(not)g(con)m(tain)i(a)e(slash,)h(the)g |
10389 | Fs(PATH)e Ft(v)-5 b(ariable)32 b(is)f(used)f(to)i(\014nd)630 | |
c302751c CR |
10390 | 4384 y Fq(\014lename)5 b Ft(.)51 b(When)34 b(Bash)g(is)g(not)g(in)f |
10391 | Fl(posix)g Ft(mo)s(de,)i(the)f(curren)m(t)f(directory)i(is)e(searc)m | |
10392 | (hed)630 4494 y(if)e Fq(\014lename)36 b Ft(is)31 b(not)h(found)d(in)i | |
5e13499c | 10393 | Fs($PATH)p Ft(.)41 b(If)31 b(an)m(y)g Fq(argumen)m(ts)k |
c302751c | 10394 | Ft(are)c(supplied,)f(they)i(b)s(ecome)630 4604 y(the)e(p)s(ositional)h |
37c41ab1 | 10395 | (parameters)g(when)e Fq(\014lename)35 b Ft(is)30 b(executed.)42 |
c302751c | 10396 | b(Otherwise)30 b(the)g(p)s(ositional)630 4713 y(parameters)43 |
37c41ab1 | 10397 | b(are)h(unc)m(hanged.)79 b(The)42 b(return)g(status)i(is)f(the)g(exit)h |
c302751c | 10398 | (status)g(of)f(the)g(last)630 4823 y(command)37 b(executed,)k(or)c |
37c41ab1 | 10399 | (zero)h(if)g(no)f(commands)g(are)h(executed.)63 b(If)36 |
c302751c | 10400 | b Fq(\014lename)43 b Ft(is)38 b(not)630 4932 y(found,)22 |
37c41ab1 CR |
10401 | b(or)f(cannot)g(b)s(e)f(read,)j(the)e(return)f(status)h(is)g(non-zero.) |
10402 | 38 b(This)20 b(builtin)h(is)f(equiv)-5 b(alen)m(t)630 | |
c302751c CR |
10403 | 5042 y(to)31 b Fs(source)p Ft(.)150 5204 y Fs(break)870 |
10404 | 5340 y(break)46 b([)p Fi(n)11 b Fs(])p eop end | |
9f178efb CR |
10405 | %%Page: 42 48 |
10406 | TeXDict begin 42 47 bop 150 -116 a Ft(42)2572 b(Bash)31 | |
c302751c CR |
10407 | b(Reference)g(Man)m(ual)630 299 y(Exit)45 b(from)f(a)g |
10408 | Fs(for)p Ft(,)k Fs(while)p Ft(,)e Fs(until)p Ft(,)h(or)d | |
10409 | Fs(select)f Ft(lo)s(op.)83 b(If)44 b Fq(n)g Ft(is)g(supplied,)j(the)e | |
10410 | Fq(n)p Ft(th)630 408 y(enclosing)c(lo)s(op)f(is)h(exited.)70 | |
6932f7f5 | 10411 | b Fq(n)40 b Ft(m)m(ust)g(b)s(e)f(greater)j(than)d(or)i(equal)f(to)h(1.) |
c302751c | 10412 | 70 b(The)40 b(return)630 518 y(status)31 b(is)f(zero)h(unless)f |
6932f7f5 | 10413 | Fq(n)g Ft(is)g(not)h(greater)g(than)g(or)f(equal)h(to)g(1.)150 |
45c0f7f8 CR |
10414 | 677 y Fs(cd)870 812 y(cd)47 b([-L|[-P)f([-e]]])g([)p |
10415 | Fi(directory)11 b Fs(])630 946 y Ft(Change)26 b(the)g(curren)m(t)g(w)m | |
10416 | (orking)g(directory)h(to)f Fq(directory)8 b Ft(.)40 b(If)25 | |
10417 | b Fq(directory)35 b Ft(is)26 b(not)g(supplied,)630 1056 | |
10418 | y(the)g(v)-5 b(alue)26 b(of)f(the)h Fs(HOME)e Ft(shell)i(v)-5 | |
10419 | b(ariable)26 b(is)g(used.)38 b(An)m(y)25 b(additional)i(argumen)m(ts)e | |
10420 | (follo)m(wing)630 1166 y Fq(directory)39 b Ft(are)31 | |
10421 | b(ignored.)41 b(If)30 b(the)h(shell)g(v)-5 b(ariable)31 | |
10422 | b Fs(CDPATH)e Ft(exists,)i(it)g(is)g(used)f(as)g(a)h(searc)m(h)630 | |
10423 | 1275 y(path:)39 b(eac)m(h)28 b(directory)g(name)f(in)g | |
10424 | Fs(CDPATH)e Ft(is)j(searc)m(hed)f(for)g Fq(directory)8 | |
10425 | b Ft(,)29 b(with)e(alternativ)m(e)630 1385 y(directory)k(names)g(in)f | |
10426 | Fs(CDPATH)f Ft(separated)j(b)m(y)e(a)h(colon)h(\(`)p | |
10427 | Fs(:)p Ft('\).)43 b(If)30 b Fq(directory)39 b Ft(b)s(egins)30 | |
10428 | b(with)630 1494 y(a)h(slash,)f Fs(CDPATH)f Ft(is)h(not)h(used.)630 | |
10429 | 1629 y(The)c(`)p Fs(-P)p Ft(')h(option)g(means)g(to)h(not)f(follo)m(w)h | |
10430 | (sym)m(b)s(olic)f(links:)39 b(sym)m(b)s(olic)28 b(links)g(are)g(resolv) | |
10431 | m(ed)630 1738 y(while)41 b Fs(cd)f Ft(is)h(tra)m(v)m(ersing)h | |
10432 | Fq(directory)49 b Ft(and)40 b(b)s(efore)g(pro)s(cessing)h(an)f | |
10433 | (instance)i(of)f(`)p Fs(..)p Ft(')f(in)630 1848 y Fq(directory)8 | |
10434 | b Ft(.)630 1983 y(By)30 b(default,)g(or)g(when)f(the)h(`)p | |
10435 | Fs(-L)p Ft(')f(option)i(is)f(supplied,)e(sym)m(b)s(olic)j(links)e(in)g | |
10436 | Fq(directory)39 b Ft(are)630 2092 y(resolv)m(ed)31 b(after)g | |
10437 | Fs(cd)f Ft(pro)s(cesses)g(an)g(instance)h(of)g(`)p Fs(..)p | |
10438 | Ft(')f(in)g Fq(directory)8 b Ft(.)630 2227 y(If)34 b(`)p | |
10439 | Fs(..)p Ft(')g(app)s(ears)g(in)g Fq(directory)8 b Ft(,)36 | |
10440 | b(it)e(is)h(pro)s(cessed)f(b)m(y)g(remo)m(ving)h(the)g(immediately)g | |
10441 | (pre-)630 2336 y(ceding)c(pathname)f(comp)s(onen)m(t,)h(bac)m(k)g(to)g | |
10442 | (a)g(slash)f(or)h(the)f(b)s(eginning)g(of)g Fq(directory)8 | |
10443 | b Ft(.)630 2471 y(If)25 b(the)g(`)p Fs(-e)p Ft(')g(option)h(is)f | |
10444 | (supplied)f(with)g(`)p Fs(-P)p Ft(')h(and)g(the)g(curren)m(t)g(w)m | |
10445 | (orking)h(directory)f(cannot)630 2580 y(b)s(e)37 b(successfully)g | |
10446 | (determined)g(after)i(a)e(successful)h(directory)g(c)m(hange,)i | |
10447 | Fs(cd)d Ft(will)h(return)630 2690 y(an)28 b(unsuccessful)f(status.)41 | |
10448 | b(If)28 b Fq(directory)36 b Ft(is)29 b(`)p Fs(-)p Ft(',)g(it)g(is)f | |
10449 | (con)m(v)m(erted)i(to)f Fs($OLDPWD)e Ft(b)s(efore)h(the)630 | |
10450 | 2800 y(directory)j(c)m(hange)g(is)g(attempted.)630 2934 | |
10451 | y(If)i(a)h(non-empt)m(y)g(directory)g(name)f(from)g Fs(CDPATH)f | |
10452 | Ft(is)h(used,)h(or)g(if)f(`)p Fs(-)p Ft(')h(is)f(the)h(\014rst)f(argu-) | |
10453 | 630 3044 y(men)m(t,)28 b(and)e(the)h(directory)g(c)m(hange)h(is)f | |
10454 | (successful,)h(the)f(absolute)g(pathname)g(of)f(the)h(new)630 | |
10455 | 3153 y(w)m(orking)k(directory)g(is)f(written)g(to)i(the)e(standard)g | |
10456 | (output.)630 3288 y(The)f(return)g(status)h(is)f(zero)i(if)e(the)h | |
122f603c | 10457 | (directory)g(is)g(successfully)g(c)m(hanged,)g(non-zero)g(oth-)630 |
45c0f7f8 CR |
10458 | 3397 y(erwise.)150 3557 y Fs(continue)870 3691 y(continue)46 |
10459 | b([)p Fi(n)11 b Fs(])630 3826 y Ft(Resume)32 b(the)g(next)g(iteration)i | |
37c41ab1 | 10460 | (of)e(an)g(enclosing)h Fs(for)p Ft(,)f Fs(while)p Ft(,)f |
45c0f7f8 | 10461 | Fs(until)p Ft(,)g(or)h Fs(select)f Ft(lo)s(op.)630 3935 |
37c41ab1 CR |
10462 | y(If)f Fq(n)h Ft(is)g(supplied,)e(the)j(execution)g(of)f(the)g |
10463 | Fq(n)p Ft(th)f(enclosing)i(lo)s(op)f(is)f(resumed.)42 | |
45c0f7f8 | 10464 | b Fq(n)30 b Ft(m)m(ust)h(b)s(e)630 4045 y(greater)39 |
37c41ab1 | 10465 | b(than)f(or)g(equal)g(to)h(1.)63 b(The)38 b(return)e(status)j(is)e |
45c0f7f8 CR |
10466 | (zero)i(unless)e Fq(n)h Ft(is)g(not)g(greater)630 4154 |
10467 | y(than)30 b(or)g(equal)h(to)g(1.)150 4314 y Fs(eval)870 | |
10468 | 4448 y(eval)47 b([)p Fi(arguments)11 b Fs(])630 4583 | |
37c41ab1 | 10469 | y Ft(The)25 b(argumen)m(ts)h(are)g(concatenated)i(together)f(in)m(to)f |
45c0f7f8 | 10470 | (a)g(single)h(command,)f(whic)m(h)g(is)f(then)630 4692 |
37c41ab1 CR |
10471 | y(read)35 b(and)g(executed,)j(and)d(its)h(exit)g(status)g(returned)e |
10472 | (as)h(the)h(exit)g(status)g(of)g Fs(eval)p Ft(.)54 b(If)630 | |
45c0f7f8 | 10473 | 4802 y(there)31 b(are)f(no)h(argumen)m(ts)f(or)h(only)f(empt)m(y)h |
37c41ab1 | 10474 | (argumen)m(ts,)g(the)f(return)g(status)g(is)h(zero.)150 |
45c0f7f8 | 10475 | 4961 y Fs(exec)870 5096 y(exec)47 b([-cl])f([-a)h Fi(name)11 |
c302751c | 10476 | b Fs(])46 b([)p Fi(command)56 b Fs([)p Fi(arguments)11 |
45c0f7f8 | 10477 | b Fs(]])630 5230 y Ft(If)36 b Fq(command)k Ft(is)c(supplied,)h(it)g |
d3ad40de | 10478 | (replaces)h(the)e(shell)h(without)f(creating)i(a)f(new)f(pro)s(cess.) |
45c0f7f8 CR |
10479 | 630 5340 y(If)h(the)g(`)p Fs(-l)p Ft(')g(option)h(is)f(supplied,)g(the) |
10480 | h(shell)f(places)h(a)g(dash)e(at)i(the)f(b)s(eginning)f(of)i(the)p | |
10481 | eop end | |
9f178efb CR |
10482 | %%Page: 43 49 |
10483 | TeXDict begin 43 48 bop 150 -116 a Ft(Chapter)30 b(4:)h(Shell)f | |
10484 | (Builtin)h(Commands)2079 b(43)630 299 y(zeroth)36 b(argumen)m(t)g | |
45c0f7f8 CR |
10485 | (passed)f(to)h Fq(command)t Ft(.)56 b(This)34 b(is)i(what)f(the)h |
10486 | Fs(login)e Ft(program)h(do)s(es.)630 408 y(The)e(`)p | |
10487 | Fs(-c)p Ft(')h(option)g(causes)g Fq(command)j Ft(to)e(b)s(e)e(executed) | |
10488 | i(with)e(an)h(empt)m(y)g(en)m(vironmen)m(t.)630 518 y(If)d(`)p | |
10489 | Fs(-a)p Ft(')g(is)h(supplied,)f(the)g(shell)h(passes)f | |
10490 | Fq(name)37 b Ft(as)31 b(the)h(zeroth)g(argumen)m(t)g(to)g | |
10491 | Fq(command)t Ft(.)630 628 y(If)g Fq(command)j Ft(cannot)e(b)s(e)f | |
10492 | (executed)h(for)f(some)g(reason,)h(a)g(non-in)m(teractiv)m(e)i(shell)d | |
10493 | (exits,)630 737 y(unless)27 b(the)g Fs(execfail)e Ft(shell)i(option)h | |
10494 | (is)f(enabled.)40 b(In)27 b(that)g(case,)j(it)d(returns)f(failure.)40 | |
10495 | b(An)630 847 y(in)m(teractiv)m(e)d(shell)d(returns)f(failure)h(if)g | |
10496 | (the)g(\014le)g(cannot)g(b)s(e)g(executed.)52 b(If)33 | |
10497 | b(no)h Fq(command)630 956 y Ft(is)27 b(sp)s(eci\014ed,)g(redirections)h | |
10498 | (ma)m(y)f(b)s(e)g(used)f(to)i(a\013ect)g(the)f(curren)m(t)g(shell)g(en) | |
10499 | m(vironmen)m(t.)40 b(If)630 1066 y(there)34 b(are)h(no)f(redirection)h | |
10500 | (errors,)g(the)f(return)f(status)i(is)f(zero;)j(otherwise)e(the)f | |
10501 | (return)630 1176 y(status)d(is)f(non-zero.)150 1348 y | |
10502 | Fs(exit)870 1489 y(exit)47 b([)p Fi(n)11 b Fs(])630 1630 | |
10503 | y Ft(Exit)30 b(the)g(shell,)h(returning)d(a)j(status)f(of)g | |
10504 | Fq(n)f Ft(to)h(the)g(shell's)g(paren)m(t.)41 b(If)30 | |
10505 | b Fq(n)f Ft(is)h(omitted,)h(the)630 1739 y(exit)c(status)g(is)g(that)g | |
10506 | (of)g(the)g(last)g(command)f(executed.)41 b(An)m(y)26 | |
10507 | b(trap)h(on)f Fs(EXIT)f Ft(is)i(executed)630 1849 y(b)s(efore)j(the)h | |
10508 | (shell)f(terminates.)150 2021 y Fs(export)870 2162 y(export)46 | |
c302751c | 10509 | b([-fn])g([-p])h([)p Fi(name)11 b Fs([=)p Fi(value)g |
45c0f7f8 | 10510 | Fs(]])630 2303 y Ft(Mark)40 b(eac)m(h)h Fq(name)k Ft(to)40 |
c302751c | 10511 | b(b)s(e)f(passed)g(to)i(c)m(hild)f(pro)s(cesses)f(in)g(the)h(en)m |
45c0f7f8 | 10512 | (vironmen)m(t.)70 b(If)39 b(the)630 2412 y(`)p Fs(-f)p |
6932f7f5 CR |
10513 | Ft(')29 b(option)h(is)g(supplied,)f(the)g Fq(name)5 b |
10514 | Ft(s)30 b(refer)f(to)h(shell)g(functions;)f(otherwise)h(the)g(names)630 | |
45c0f7f8 | 10515 | 2522 y(refer)36 b(to)i(shell)e(v)-5 b(ariables.)60 b(The)36 |
6932f7f5 | 10516 | b(`)p Fs(-n)p Ft(')h(option)g(means)f(to)h(no)g(longer)g(mark)f(eac)m |
45c0f7f8 | 10517 | (h)i Fq(name)630 2632 y Ft(for)h(exp)s(ort.)65 b(If)39 |
6932f7f5 CR |
10518 | b(no)g Fq(names)j Ft(are)d(supplied,)h(or)f(if)g(the)g(`)p |
10519 | Fs(-p)p Ft(')g(option)g(is)g(giv)m(en,)j(a)d(list)h(of)630 | |
45c0f7f8 | 10520 | 2741 y(names)27 b(of)h(all)h(exp)s(orted)e(v)-5 b(ariables)28 |
122f603c | 10521 | b(is)g(displa)m(y)m(ed.)40 b(The)27 b(`)p Fs(-p)p Ft(')g(option)h |
45c0f7f8 | 10522 | (displa)m(ys)g(output)f(in)630 2851 y(a)32 b(form)e(that)i(ma)m(y)g(b)s |
122f603c CR |
10523 | (e)e(reused)h(as)g(input.)43 b(If)30 b(a)i(v)-5 b(ariable)32 |
10524 | b(name)f(is)g(follo)m(w)m(ed)i(b)m(y)e(=)p Fq(v)-5 b(alue)5 | |
45c0f7f8 | 10525 | b Ft(,)630 2960 y(the)31 b(v)-5 b(alue)30 b(of)h(the)g(v)-5 |
122f603c | 10526 | b(ariable)31 b(is)f(set)h(to)g Fq(v)-5 b(alue)5 b Ft(.)630 |
45c0f7f8 | 10527 | 3101 y(The)29 b(return)e(status)j(is)f(zero)h(unless)e(an)h(in)m(v)-5 |
122f603c | 10528 | b(alid)29 b(option)h(is)f(supplied,)f(one)i(of)f(the)g(names)630 |
45c0f7f8 | 10529 | 3211 y(is)h(not)h(a)f(v)-5 b(alid)31 b(shell)f(v)-5 b(ariable)31 |
122f603c | 10530 | b(name,)f(or)h(`)p Fs(-f)p Ft(')f(is)g(supplied)f(with)g(a)i(name)f |
45c0f7f8 CR |
10531 | (that)h(is)f(not)h(a)630 3320 y(shell)g(function.)150 |
10532 | 3493 y Fs(getopts)870 3634 y(getopts)46 b Fi(optstring)56 | |
10533 | b(name)h Fs([)p Fi(args)11 b Fs(])630 3774 y(getopts)28 | |
122f603c | 10534 | b Ft(is)i(used)g(b)m(y)g(shell)g(scripts)g(to)g(parse)g(p)s(ositional)h |
45c0f7f8 | 10535 | (parameters.)41 b Fq(optstring)d Ft(con-)630 3884 y(tains)k(the)g |
122f603c CR |
10536 | (option)f(c)m(haracters)i(to)g(b)s(e)d(recognized;)49 |
10537 | b(if)42 b(a)f(c)m(haracter)j(is)d(follo)m(w)m(ed)i(b)m(y)f(a)630 | |
45c0f7f8 | 10538 | 3994 y(colon,)33 b(the)f(option)g(is)g(exp)s(ected)g(to)h(ha)m(v)m(e)g |
122f603c | 10539 | (an)e(argumen)m(t,)i(whic)m(h)f(should)e(b)s(e)h(separated)630 |
45c0f7f8 | 10540 | 4103 y(from)40 b(it)g(b)m(y)g(whitespace.)70 b(The)40 |
122f603c | 10541 | b(colon)h(\(`)p Fs(:)p Ft('\))g(and)e(question)h(mark)g(\(`)p |
45c0f7f8 | 10542 | Fs(?)p Ft('\))h(ma)m(y)f(not)h(b)s(e)630 4213 y(used)d(as)g(option)h(c) |
37c41ab1 | 10543 | m(haracters.)67 b(Eac)m(h)39 b(time)g(it)g(is)f(in)m(v)m(ok)m(ed,)k |
45c0f7f8 | 10544 | Fs(getopts)37 b Ft(places)i(the)g(next)630 4322 y(option)29 |
c302751c CR |
10545 | b(in)f(the)g(shell)h(v)-5 b(ariable)29 b Fq(name)5 b |
10546 | Ft(,)29 b(initializing)h Fq(name)k Ft(if)28 b(it)h(do)s(es)f(not)g | |
45c0f7f8 | 10547 | (exist,)i(and)e(the)630 4432 y(index)33 b(of)g(the)h(next)f(argumen)m |
c302751c | 10548 | (t)h(to)g(b)s(e)e(pro)s(cessed)h(in)m(to)h(the)g(v)-5 |
45c0f7f8 | 10549 | b(ariable)34 b Fs(OPTIND)p Ft(.)48 b Fs(OPTIND)630 4542 |
c302751c CR |
10550 | y Ft(is)41 b(initialized)i(to)f(1)f(eac)m(h)h(time)g(the)f(shell)g(or)g |
10551 | (a)g(shell)g(script)g(is)g(in)m(v)m(ok)m(ed.)74 b(When)41 | |
45c0f7f8 | 10552 | b(an)630 4651 y(option)36 b(requires)e(an)h(argumen)m(t,)i |
c302751c | 10553 | Fs(getopts)c Ft(places)j(that)g(argumen)m(t)g(in)m(to)g(the)f(v)-5 |
45c0f7f8 | 10554 | b(ariable)630 4761 y Fs(OPTARG)p Ft(.)55 b(The)35 b(shell)g(do)s(es)h |
c302751c | 10555 | (not)g(reset)g Fs(OPTIND)e Ft(automatically;)41 b(it)36 |
45c0f7f8 | 10556 | b(m)m(ust)f(b)s(e)g(man)m(ually)630 4870 y(reset)i(b)s(et)m(w)m(een)g |
c302751c | 10557 | (m)m(ultiple)h(calls)f(to)g Fs(getopts)e Ft(within)h(the)h(same)g |
45c0f7f8 | 10558 | (shell)f(in)m(v)m(o)s(cation)j(if)e(a)630 4980 y(new)30 |
37c41ab1 | 10559 | b(set)h(of)f(parameters)h(is)f(to)i(b)s(e)d(used.)630 |
45c0f7f8 | 10560 | 5121 y(When)41 b(the)h(end)e(of)i(options)g(is)f(encoun)m(tered,)k |
37c41ab1 | 10561 | Fs(getopts)39 b Ft(exits)j(with)f(a)h(return)e(v)-5 b(alue)630 |
45c0f7f8 | 10562 | 5230 y(greater)32 b(than)e(zero.)41 b Fs(OPTIND)29 b |
37c41ab1 | 10563 | Ft(is)h(set)h(to)g(the)g(index)f(of)g(the)h(\014rst)f(non-option)g |
45c0f7f8 CR |
10564 | (argumen)m(t,)630 5340 y(and)g Fq(name)35 b Ft(is)c(set)g(to)g(`)p |
10565 | Fs(?)p Ft('.)p eop end | |
9f178efb CR |
10566 | %%Page: 44 50 |
10567 | TeXDict begin 44 49 bop 150 -116 a Ft(44)2572 b(Bash)31 | |
45c0f7f8 CR |
10568 | b(Reference)g(Man)m(ual)630 299 y Fs(getopts)c Ft(normally)j(parses)e |
10569 | (the)i(p)s(ositional)g(parameters,)g(but)e(if)i(more)f(argumen)m(ts)h | |
10570 | (are)630 408 y(giv)m(en)h(in)f Fq(args)t Ft(,)h Fs(getopts)e | |
10571 | Ft(parses)g(those)i(instead.)630 540 y Fs(getopts)h Ft(can)h(rep)s(ort) | |
10572 | g(errors)g(in)h(t)m(w)m(o)h(w)m(a)m(ys.)51 b(If)33 b(the)h(\014rst)e(c) | |
10573 | m(haracter)k(of)d Fq(optstring)42 b Ft(is)34 b(a)630 | |
10574 | 650 y(colon,)g Fq(silen)m(t)h Ft(error)d(rep)s(orting)f(is)i(used.)45 | |
10575 | b(In)31 b(normal)h(op)s(eration,)h(diagnostic)h(messages)630 | |
10576 | 759 y(are)c(prin)m(ted)e(when)g(in)m(v)-5 b(alid)30 b(options)g(or)f | |
10577 | (missing)g(option)g(argumen)m(ts)h(are)f(encoun)m(tered.)630 | |
10578 | 869 y(If)34 b(the)g(v)-5 b(ariable)35 b Fs(OPTERR)d Ft(is)i(set)h(to)f | |
10579 | (0,)i(no)e(error)g(messages)h(will)f(b)s(e)f(displa)m(y)m(ed,)j(ev)m | |
10580 | (en)f(if)630 978 y(the)c(\014rst)e(c)m(haracter)j(of)f | |
10581 | Fs(optstring)d Ft(is)i(not)h(a)f(colon.)630 1110 y(If)39 | |
10582 | b(an)h(in)m(v)-5 b(alid)41 b(option)f(is)g(seen,)i Fs(getopts)c | |
10583 | Ft(places)j(`)p Fs(?)p Ft(')f(in)m(to)h Fq(name)k Ft(and,)d(if)e(not)g | |
10584 | (silen)m(t,)630 1219 y(prin)m(ts)f(an)h(error)f(message)h(and)f(unsets) | |
10585 | g Fs(OPTARG)p Ft(.)67 b(If)39 b Fs(getopts)f Ft(is)i(silen)m(t,)j(the)c | |
10586 | (option)630 1329 y(c)m(haracter)32 b(found)d(is)h(placed)h(in)f | |
10587 | Fs(OPTARG)f Ft(and)h(no)g(diagnostic)i(message)f(is)g(prin)m(ted.)630 | |
10588 | 1461 y(If)c(a)g(required)f(argumen)m(t)i(is)f(not)g(found,)g(and)f | |
10589 | Fs(getopts)f Ft(is)i(not)h(silen)m(t,)h(a)e(question)g(mark)630 | |
10590 | 1570 y(\(`)p Fs(?)p Ft('\))35 b(is)g(placed)g(in)g Fq(name)5 | |
10591 | b Ft(,)36 b Fs(OPTARG)d Ft(is)h(unset,)i(and)e(a)h(diagnostic)h | |
10592 | (message)f(is)g(prin)m(ted.)630 1680 y(If)e Fs(getopts)f | |
10593 | Ft(is)h(silen)m(t,)j(then)d(a)i(colon)f(\(`)p Fs(:)p | |
10594 | Ft('\))h(is)e(placed)h(in)g Fq(name)k Ft(and)33 b Fs(OPTARG)f | |
10595 | Ft(is)i(set)g(to)630 1789 y(the)d(option)f(c)m(haracter)i(found.)150 | |
10596 | 1943 y Fs(hash)870 2074 y(hash)47 b([-r])f([-p)h Fi(filename)11 | |
10597 | b Fs(])45 b([-dt])h([)p Fi(name)11 b Fs(])630 2206 y | |
10598 | Ft(Eac)m(h)32 b(time)g Fs(hash)e Ft(is)h(in)m(v)m(ok)m(ed,)j(it)d | |
10599 | (remem)m(b)s(ers)g(the)g(full)g(pathnames)g(of)h(the)f(commands)630 | |
10600 | 2315 y(sp)s(eci\014ed)i(as)i Fq(name)k Ft(argumen)m(ts,)c(so)g(they)f | |
122f603c | 10601 | (need)g(not)g(b)s(e)f(searc)m(hed)i(for)f(on)g(subsequen)m(t)630 |
45c0f7f8 CR |
10602 | 2425 y(in)m(v)m(o)s(cations.)79 b(The)41 b(commands)h(are)h(found)e(b)m |
10603 | (y)h(searc)m(hing)i(through)d(the)i(directories)630 2534 | |
67362c60 CR |
10604 | y(listed)33 b(in)g Fs($PATH)p Ft(.)47 b(An)m(y)33 b(previously-remem)m |
10605 | (b)s(ered)f(pathname)h(is)g(discarded.)48 b(The)32 b(`)p | |
45c0f7f8 | 10606 | Fs(-p)p Ft(')630 2644 y(option)i(inhibits)e(the)i(path)f(searc)m(h,)i |
67362c60 | 10607 | (and)e Fq(\014lename)38 b Ft(is)c(used)e(as)i(the)f(lo)s(cation)i(of)f |
45c0f7f8 | 10608 | Fq(name)5 b Ft(.)630 2754 y(The)35 b(`)p Fs(-r)p Ft(')g(option)g |
67362c60 | 10609 | (causes)h(the)g(shell)f(to)h(forget)g(all)g(remem)m(b)s(ered)f(lo)s |
45c0f7f8 | 10610 | (cations.)56 b(The)35 b(`)p Fs(-d)p Ft(')630 2863 y(option)c(causes)f |
67362c60 | 10611 | (the)g(shell)h(to)f(forget)i(the)e(remem)m(b)s(ered)f(lo)s(cation)j(of) |
45c0f7f8 | 10612 | e(eac)m(h)h Fq(name)5 b Ft(.)41 b(If)30 b(the)630 2973 |
67362c60 CR |
10613 | y(`)p Fs(-t)p Ft(')35 b(option)h(is)g(supplied,)f(the)h(full)f |
10614 | (pathname)g(to)i(whic)m(h)e(eac)m(h)h Fq(name)41 b Ft(corresp)s(onds)34 | |
45c0f7f8 | 10615 | b(is)630 3082 y(prin)m(ted.)39 b(If)26 b(m)m(ultiple)h |
67362c60 CR |
10616 | Fq(name)32 b Ft(argumen)m(ts)27 b(are)g(supplied)e(with)h(`)p |
10617 | Fs(-t)p Ft(')g(the)h Fq(name)32 b Ft(is)26 b(prin)m(ted)630 | |
45c0f7f8 | 10618 | 3192 y(b)s(efore)f(the)h(hashed)e(full)h(pathname.)39 |
67362c60 | 10619 | b(The)25 b(`)p Fs(-l)p Ft(')h(option)f(causes)h(output)f(to)i(b)s(e)d |
45c0f7f8 | 10620 | (displa)m(y)m(ed)630 3302 y(in)31 b(a)g(format)h(that)f(ma)m(y)h(b)s(e) |
67362c60 | 10621 | f(reused)f(as)h(input.)42 b(If)31 b(no)g(argumen)m(ts)h(are)f(giv)m |
45c0f7f8 | 10622 | (en,)i(or)e(if)g(only)630 3411 y(`)p Fs(-l)p Ft(')44 |
67362c60 | 10623 | b(is)f(supplied,)j(information)e(ab)s(out)g(remem)m(b)s(ered)f |
45c0f7f8 | 10624 | (commands)g(is)h(prin)m(ted.)80 b(The)630 3521 y(return)25 |
67362c60 CR |
10625 | b(status)h(is)f(zero)i(unless)e(a)h Fq(name)31 b Ft(is)26 |
10626 | b(not)g(found)e(or)i(an)g(in)m(v)-5 b(alid)26 b(option)g(is)g | |
45c0f7f8 CR |
10627 | (supplied.)150 3674 y Fs(pwd)870 3806 y(pwd)47 b([-LP])630 |
10628 | 3937 y Ft(Prin)m(t)24 b(the)h(absolute)g(pathname)g(of)f(the)h(curren)m | |
67362c60 | 10629 | (t)f(w)m(orking)h(directory)-8 b(.)40 b(If)23 b(the)i(`)p |
45c0f7f8 | 10630 | Fs(-P)p Ft(')f(option)630 4047 y(is)36 b(supplied,)f(the)h(pathname)f |
67362c60 | 10631 | (prin)m(ted)g(will)h(not)g(con)m(tain)h(sym)m(b)s(olic)f(links.)55 |
45c0f7f8 | 10632 | b(If)35 b(the)h(`)p Fs(-L)p Ft(')630 4156 y(option)44 |
67362c60 | 10633 | b(is)g(supplied,)i(the)e(pathname)f(prin)m(ted)h(ma)m(y)g(con)m(tain)h |
45c0f7f8 | 10634 | (sym)m(b)s(olic)f(links.)80 b(The)630 4266 y(return)26 |
67362c60 | 10635 | b(status)h(is)h(zero)g(unless)e(an)h(error)g(is)g(encoun)m(tered)g |
45c0f7f8 | 10636 | (while)h(determining)f(the)g(name)630 4376 y(of)k(the)f(curren)m(t)g |
67362c60 | 10637 | (directory)h(or)f(an)h(in)m(v)-5 b(alid)31 b(option)g(is)f(supplied.) |
45c0f7f8 CR |
10638 | 150 4529 y Fs(readonly)870 4661 y(readonly)46 b([-aAf])g([-p])g([)p |
10639 | Fi(name)11 b Fs([=)p Fi(value)g Fs(]])43 b(...)630 4792 | |
67362c60 CR |
10640 | y Ft(Mark)24 b(eac)m(h)h Fq(name)k Ft(as)24 b(readonly)-8 |
10641 | b(.)39 b(The)24 b(v)-5 b(alues)24 b(of)g(these)g(names)g(ma)m(y)g(not)g | |
45c0f7f8 | 10642 | (b)s(e)g(c)m(hanged)g(b)m(y)630 4902 y(subsequen)m(t)e(assignmen)m(t.) |
67362c60 | 10643 | 39 b(If)22 b(the)h(`)p Fs(-f)p Ft(')f(option)i(is)e(supplied,)h(eac)m |
45c0f7f8 | 10644 | (h)h Fq(name)k Ft(refers)22 b(to)i(a)f(shell)630 5011 |
67362c60 | 10645 | y(function.)39 b(The)26 b(`)p Fs(-a)p Ft(')h(option)g(means)g(eac)m(h)h |
09767ff0 | 10646 | Fq(name)k Ft(refers)26 b(to)i(an)e(indexed)h(arra)m(y)g(v)-5 |
45c0f7f8 | 10647 | b(ariable;)630 5121 y(the)26 b(`)p Fs(-A)p Ft(')g(option)h(means)f(eac) |
d9e1f41e | 10648 | m(h)h Fq(name)32 b Ft(refers)25 b(to)i(an)f(asso)s(ciativ)m(e)j(arra)m |
45c0f7f8 | 10649 | (y)e(v)-5 b(ariable.)40 b(If)26 b(b)s(oth)630 5230 y(options)h(are)g |
d9e1f41e CR |
10650 | (supplied,)f(`)p Fs(-A)p Ft(')g(tak)m(es)i(precedence.)40 |
10651 | b(If)26 b(no)h Fq(name)32 b Ft(argumen)m(ts)26 b(are)h(giv)m(en,)i(or) | |
45c0f7f8 | 10652 | 630 5340 y(if)h(the)h(`)p Fs(-p)p Ft(')f(option)h(is)g(supplied,)e(a)i |
d9e1f41e | 10653 | (list)g(of)g(all)g(readonly)f(names)h(is)f(prin)m(ted.)41 |
45c0f7f8 | 10654 | b(The)30 b(other)p eop end |
9f178efb CR |
10655 | %%Page: 45 51 |
10656 | TeXDict begin 45 50 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
10657 | b(Shell)30 b(Builtin)h(Commands)2069 b(45)630 299 y(options)36 | |
45c0f7f8 CR |
10658 | b(ma)m(y)g(b)s(e)g(used)f(to)h(restrict)h(the)f(output)f(to)h(a)h |
10659 | (subset)e(of)h(the)g(set)g(of)g(readonly)630 408 y(names.)63 | |
10660 | b(The)37 b(`)p Fs(-p)p Ft(')h(option)g(causes)g(output)f(to)i(b)s(e)e | |
10661 | (displa)m(y)m(ed)h(in)g(a)g(format)g(that)g(ma)m(y)630 | |
10662 | 518 y(b)s(e)32 b(reused)h(as)g(input.)48 b(If)33 b(a)g(v)-5 | |
10663 | b(ariable)34 b(name)f(is)h(follo)m(w)m(ed)g(b)m(y)f(=)p | |
10664 | Fq(v)-5 b(alue)5 b Ft(,)35 b(the)e(v)-5 b(alue)33 b(of)h(the)630 | |
10665 | 628 y(v)-5 b(ariable)38 b(is)f(set)h(to)g Fq(v)-5 b(alue)5 | |
10666 | b Ft(.)62 b(The)37 b(return)f(status)h(is)h(zero)g(unless)e(an)h(in)m | |
10667 | (v)-5 b(alid)38 b(option)g(is)630 737 y(supplied,)f(one)g(of)g(the)g | |
10668 | Fq(name)42 b Ft(argumen)m(ts)37 b(is)g(not)g(a)g(v)-5 | |
10669 | b(alid)37 b(shell)g(v)-5 b(ariable)38 b(or)e(function)630 | |
10670 | 847 y(name,)31 b(or)f(the)h(`)p Fs(-f)p Ft(')f(option)h(is)f(supplied)f | |
10671 | (with)h(a)h(name)f(that)h(is)g(not)f(a)h(shell)g(function.)150 | |
10672 | 1000 y Fs(return)870 1132 y(return)46 b([)p Fi(n)11 b | |
10673 | Fs(])630 1263 y Ft(Cause)37 b(a)g(shell)h(function)f(to)g(stop)h | |
10674 | (executing)g(and)e(return)h(the)g(v)-5 b(alue)37 b Fq(n)g | |
10675 | Ft(to)h(its)f(caller.)630 1373 y(If)h Fq(n)h Ft(is)g(not)g(supplied,)h | |
10676 | (the)f(return)e(v)-5 b(alue)40 b(is)f(the)g(exit)g(status)g(of)g(the)g | |
10677 | (last)h(command)630 1482 y(executed)35 b(in)f(the)h(function.)53 | |
10678 | b Fs(return)33 b Ft(ma)m(y)i(also)g(b)s(e)f(used)f(to)j(terminate)f | |
10679 | (execution)h(of)630 1592 y(a)e(script)g(b)s(eing)g(executed)g(with)g | |
10680 | (the)g Fs(.)g Ft(\()p Fs(source)p Ft(\))f(builtin,)h(returning)f | |
10681 | (either)i Fq(n)e Ft(or)h(the)630 1702 y(exit)j(status)f(of)g(the)g | |
10682 | (last)h(command)e(executed)i(within)e(the)h(script)g(as)g(the)g(exit)h | |
10683 | (status)630 1811 y(of)i(the)g(script.)65 b(If)38 b Fq(n)g | |
10684 | Ft(is)h(supplied,)h(the)f(return)e(v)-5 b(alue)39 b(is)g(its)g(least)h | |
10685 | (signi\014can)m(t)g(8)f(bits.)630 1921 y(An)m(y)g(command)f(asso)s | |
10686 | (ciated)j(with)d(the)h Fs(RETURN)e Ft(trap)i(is)g(executed)g(b)s(efore) | |
10687 | g(execution)630 2030 y(resumes)29 b(after)h(the)g(function)g(or)g | |
10688 | (script.)40 b(The)29 b(return)g(status)h(is)g(non-zero)g(if)g | |
10689 | Fs(return)e Ft(is)630 2140 y(supplied)h(a)i(non-n)m(umeric)g(argumen)m | |
10690 | (t)g(or)f(is)h(used)f(outside)h(a)g(function)f(and)g(not)h(during)630 | |
10691 | 2250 y(the)g(execution)g(of)g(a)f(script)h(b)m(y)f Fs(.)g | |
10692 | Ft(or)g Fs(source)p Ft(.)150 2403 y Fs(shift)870 2534 | |
10693 | y(shift)46 b([)p Fi(n)11 b Fs(])630 2666 y Ft(Shift)41 | |
122f603c CR |
10694 | b(the)g(p)s(ositional)h(parameters)g(to)g(the)f(left)h(b)m(y)g |
10695 | Fq(n)p Ft(.)73 b(The)40 b(p)s(ositional)j(parameters)630 | |
45c0f7f8 | 10696 | 2776 y(from)34 b Fq(n)p Fs(+)p Ft(1)39 b(.)22 b(.)h(.)45 |
67362c60 CR |
10697 | b Fs($#)34 b Ft(are)g(renamed)g(to)h Fs($1)k Ft(.)22 |
10698 | b(.)g(.)46 b Fs($#)p Ft(-)p Fq(n)p Ft(.)51 b(P)m(arameters)36 | |
45c0f7f8 | 10699 | b(represen)m(ted)e(b)m(y)g(the)630 2885 y(n)m(um)m(b)s(ers)25 |
67362c60 | 10700 | b Fs($#)i Ft(to)g Fs($#)p Ft(-)p Fq(n)p Fs(+)p Ft(1)g(are)g(unset.)39 |
6932f7f5 | 10701 | b Fq(n)26 b Ft(m)m(ust)h(b)s(e)f(a)i(non-negativ)m(e)h(n)m(um)m(b)s(er) |
45c0f7f8 | 10702 | c(less)i(than)g(or)630 2995 y(equal)33 b(to)h Fs($#)p |
6932f7f5 CR |
10703 | Ft(.)47 b(If)33 b Fq(n)f Ft(is)h(zero)g(or)g(greater)h(than)f |
10704 | Fs($#)p Ft(,)g(the)g(p)s(ositional)g(parameters)g(are)h(not)630 | |
45c0f7f8 | 10705 | 3104 y(c)m(hanged.)48 b(If)32 b Fq(n)g Ft(is)h(not)f(supplied,)h(it)g |
09767ff0 | 10706 | (is)f(assumed)g(to)h(b)s(e)f(1.)48 b(The)32 b(return)g(status)h(is)f |
45c0f7f8 | 10707 | (zero)630 3214 y(unless)e Fq(n)f Ft(is)i(greater)g(than)g |
09767ff0 | 10708 | Fs($#)e Ft(or)i(less)f(than)h(zero,)g(non-zero)g(otherwise.)150 |
45c0f7f8 CR |
10709 | 3367 y Fs(test[B)150 3477 y([)870 3608 y(test)47 b Fi(expr)630 |
10710 | 3740 y Ft(Ev)-5 b(aluate)43 b(a)f(conditional)h(expression)f | |
122f603c | 10711 | Fq(expr)48 b Ft(and)41 b(return)g(a)h(status)g(of)g(0)g(\(true\))h(or)f |
45c0f7f8 | 10712 | (1)630 3850 y(\(false\).)g(Eac)m(h)31 b(op)s(erator)f(and)f(op)s(erand) |
122f603c | 10713 | g(m)m(ust)h(b)s(e)f(a)i(separate)g(argumen)m(t.)41 b(Expressions)630 |
45c0f7f8 | 10714 | 3959 y(are)26 b(comp)s(osed)f(of)g(the)h(primaries)f(describ)s(ed)f(b)s |
122f603c | 10715 | (elo)m(w)h(in)g(Section)h(6.4)h([Bash)e(Conditional)630 |
9f178efb | 10716 | 4069 y(Expressions],)39 b(page)g(84.)64 b Fs(test)37 |
122f603c | 10717 | b Ft(do)s(es)g(not)h(accept)i(an)m(y)e(options,)i(nor)e(do)s(es)f(it)h |
45c0f7f8 | 10718 | (accept)630 4178 y(and)30 b(ignore)h(an)f(argumen)m(t)h(of)f(`)p |
122f603c | 10719 | Fs(--)p Ft(')h(as)f(signifying)h(the)f(end)g(of)h(options.)630 |
45c0f7f8 | 10720 | 4310 y(When)f(the)h Fs([)f Ft(form)g(is)g(used,)g(the)g(last)i(argumen) |
122f603c | 10721 | m(t)e(to)i(the)e(command)g(m)m(ust)h(b)s(e)e(a)i Fs(])p |
45c0f7f8 | 10722 | Ft(.)630 4441 y(Expressions)23 b(ma)m(y)h(b)s(e)e(com)m(bined)i(using)f |
122f603c | 10723 | (the)h(follo)m(wing)h(op)s(erators,)g(listed)f(in)f(decreasing)630 |
45c0f7f8 | 10724 | 4551 y(order)30 b(of)h(precedence.)43 b(The)30 b(ev)-5 |
d7f49990 | 10725 | b(aluation)33 b(dep)s(ends)28 b(on)j(the)g(n)m(um)m(b)s(er)f(of)h |
45c0f7f8 | 10726 | (argumen)m(ts;)g(see)630 4661 y(b)s(elo)m(w.)41 b(Op)s(erator)30 |
510e20a2 | 10727 | b(precedence)h(is)f(used)g(when)f(there)i(are)f(\014v)m(e)h(or)f(more)h |
45c0f7f8 CR |
10728 | (argumen)m(ts.)630 4814 y Fs(!)f Fi(expr)210 b Ft(T)-8 |
10729 | b(rue)30 b(if)g Fq(expr)37 b Ft(is)30 b(false.)630 4967 | |
510e20a2 CR |
10730 | y Fs(\()g Fi(expr)40 b Fs(\))122 b Ft(Returns)23 b(the)h(v)-5 |
10731 | b(alue)24 b(of)g Fq(expr)7 b Ft(.)37 b(This)23 b(ma)m(y)i(b)s(e)e(used) | |
45c0f7f8 CR |
10732 | g(to)h(o)m(v)m(erride)h(the)f(normal)1110 5077 y(precedence)31 |
10733 | b(of)f(op)s(erators.)630 5230 y Fi(expr1)39 b Fs(-a)30 | |
10734 | b Fi(expr2)1110 5340 y Ft(T)-8 b(rue)30 b(if)g(b)s(oth)g | |
10735 | Fq(expr1)37 b Ft(and)30 b Fq(expr2)38 b Ft(are)30 b(true.)p | |
122f603c | 10736 | eop end |
9f178efb CR |
10737 | %%Page: 46 52 |
10738 | TeXDict begin 46 51 bop 150 -116 a Ft(46)2572 b(Bash)31 | |
45c0f7f8 CR |
10739 | b(Reference)g(Man)m(ual)630 299 y Fi(expr1)39 b Fs(-o)30 |
10740 | b Fi(expr2)1110 408 y Ft(T)-8 b(rue)30 b(if)g(either)h | |
10741 | Fq(expr1)38 b Ft(or)30 b Fq(expr2)37 b Ft(is)31 b(true.)630 | |
10742 | 568 y(The)37 b Fs(test)f Ft(and)g Fs([)h Ft(builtins)g(ev)-5 | |
10743 | b(aluate)39 b(conditional)f(expressions)f(using)g(a)g(set)h(of)f(rules) | |
10744 | 630 677 y(based)30 b(on)g(the)h(n)m(um)m(b)s(er)e(of)h(argumen)m(ts.) | |
10745 | 630 837 y(0)h(argumen)m(ts)1110 946 y(The)f(expression)g(is)g(false.) | |
10746 | 630 1106 y(1)h(argumen)m(t)1110 1215 y(The)f(expression)g(is)g(true)h | |
10747 | (if)f(and)g(only)g(if)h(the)f(argumen)m(t)h(is)f(not)h(n)m(ull.)630 | |
10748 | 1375 y(2)g(argumen)m(ts)1110 1484 y(If)f(the)h(\014rst)f(argumen)m(t)h | |
10749 | (is)g(`)p Fs(!)p Ft(',)g(the)g(expression)g(is)g(true)f(if)h(and)f | |
10750 | (only)h(if)g(the)1110 1594 y(second)j(argumen)m(t)f(is)h(n)m(ull.)50 | |
10751 | b(If)33 b(the)h(\014rst)e(argumen)m(t)i(is)g(one)g(of)f(the)h(unary) | |
10752 | 1110 1704 y(conditional)42 b(op)s(erators)f(\(see)g(Section)h(6.4)f | |
10753 | ([Bash)g(Conditional)g(Expres-)1110 1813 y(sions],)34 | |
9f178efb | 10754 | b(page)f(84\),)i(the)e(expression)f(is)h(true)g(if)g(the)g(unary)e |
45c0f7f8 CR |
10755 | (test)j(is)f(true.)47 b(If)1110 1923 y(the)33 b(\014rst)g(argumen)m(t)h |
10756 | (is)f(not)g(a)h(v)-5 b(alid)34 b(unary)e(op)s(erator,)i(the)g | |
10757 | (expression)f(is)1110 2032 y(false.)630 2192 y(3)e(argumen)m(ts)1110 | |
10758 | 2301 y(The)44 b(follo)m(wing)i(conditions)f(are)g(applied)f(in)g(the)g | |
10759 | (order)g(listed.)84 b(If)44 b(the)1110 2411 y(second)f(argumen)m(t)g | |
10760 | (is)g(one)g(of)g(the)g(binary)f(conditional)i(op)s(erators)f(\(see)1110 | |
10761 | 2521 y(Section)h(6.4)g([Bash)g(Conditional)g(Expressions],)i(page)e | |
9f178efb | 10762 | (84\),)k(the)43 b(result)1110 2630 y(of)h(the)h(expression)f(is)g(the)g |
510e20a2 | 10763 | (result)g(of)h(the)f(binary)g(test)h(using)e(the)i(\014rst)1110 |
45c0f7f8 | 10764 | 2740 y(and)31 b(third)g(argumen)m(ts)i(as)f(op)s(erands.)44 |
510e20a2 | 10765 | b(The)31 b(`)p Fs(-a)p Ft(')h(and)g(`)p Fs(-o)p Ft(')f(op)s(erators)i |
45c0f7f8 CR |
10766 | (are)1110 2849 y(considered)25 b(binary)g(op)s(erators)g(when)f(there)i |
10767 | (are)f(three)h(argumen)m(ts.)39 b(If)25 b(the)1110 2959 | |
510e20a2 CR |
10768 | y(\014rst)j(argumen)m(t)h(is)g(`)p Fs(!)p Ft(',)h(the)f(v)-5 |
10769 | b(alue)29 b(is)g(the)g(negation)i(of)e(the)g(t)m(w)m(o-argumen)m(t)1110 | |
45c0f7f8 CR |
10770 | 3068 y(test)38 b(using)f(the)g(second)g(and)g(third)f(argumen)m(ts.)61 |
10771 | b(If)37 b(the)g(\014rst)f(argumen)m(t)1110 3178 y(is)j(exactly)i(`)p | |
510e20a2 | 10772 | Fs(\()p Ft(')f(and)f(the)g(third)g(argumen)m(t)h(is)f(exactly)i(`)p |
45c0f7f8 | 10773 | Fs(\))p Ft(',)h(the)e(result)f(is)1110 3288 y(the)46 |
510e20a2 | 10774 | b(one-argumen)m(t)g(test)h(of)f(the)f(second)h(argumen)m(t.)86 |
45c0f7f8 CR |
10775 | b(Otherwise,)50 b(the)1110 3397 y(expression)30 b(is)h(false.)630 |
10776 | 3557 y(4)g(argumen)m(ts)1110 3666 y(If)h(the)i(\014rst)e(argumen)m(t)h | |
510e20a2 | 10777 | (is)g(`)p Fs(!)p Ft(',)h(the)f(result)g(is)g(the)g(negation)h(of)f(the) |
45c0f7f8 CR |
10778 | g(three-)1110 3776 y(argumen)m(t)h(expression)f(comp)s(osed)h(of)f(the) |
10779 | h(remaining)g(argumen)m(ts.)50 b(Oth-)1110 3885 y(erwise,)34 | |
510e20a2 | 10780 | b(the)f(expression)g(is)g(parsed)g(and)f(ev)-5 b(aluated)34 |
45c0f7f8 CR |
10781 | b(according)h(to)e(prece-)1110 3995 y(dence)e(using)e(the)i(rules)f |
10782 | (listed)h(ab)s(o)m(v)m(e.)630 4154 y(5)g(or)f(more)h(argumen)m(ts)1110 | |
10783 | 4264 y(The)43 b(expression)f(is)i(parsed)e(and)g(ev)-5 | |
10784 | b(aluated)45 b(according)f(to)f(precedence)1110 4374 | |
54a1fa7c | 10785 | y(using)30 b(the)g(rules)g(listed)h(ab)s(o)m(v)m(e.)630 |
45c0f7f8 | 10786 | 4533 y(When)40 b(used)f(with)g Fs(test)g Ft(or)h(`)p |
54a1fa7c | 10787 | Fs([)p Ft(',)j(the)d(`)p Fs(<)p Ft(')g(and)f(`)p Fs(>)p |
45c0f7f8 CR |
10788 | Ft(')h(op)s(erators)g(sort)g(lexicographically)630 4643 |
10789 | y(using)30 b(ASCI)s(I)f(ordering.)150 4802 y Fs(times)870 | |
10790 | 4936 y(times)630 5071 y Ft(Prin)m(t)37 b(out)h(the)g(user)e(and)h | |
54a1fa7c | 10791 | (system)g(times)h(used)f(b)m(y)g(the)h(shell)f(and)g(its)h(c)m |
45c0f7f8 CR |
10792 | (hildren.)61 b(The)630 5181 y(return)29 b(status)i(is)f(zero.)150 |
10793 | 5340 y Fs(trap)p eop end | |
9f178efb CR |
10794 | %%Page: 47 53 |
10795 | TeXDict begin 47 52 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
10796 | b(Shell)30 b(Builtin)h(Commands)2069 b(47)870 299 y Fs(trap)47 | |
45c0f7f8 CR |
10797 | b([-lp])f([)p Fi(arg)11 b Fs(])46 b([)p Fi(sigspec)56 |
10798 | b Fs(...)o(])630 427 y Ft(The)43 b(commands)f(in)h Fq(arg)51 | |
10799 | b Ft(are)44 b(to)g(b)s(e)e(read)h(and)g(executed)h(when)e(the)h(shell)g | |
10800 | (receiv)m(es)630 536 y(signal)36 b Fq(sigsp)s(ec)6 b | |
10801 | Ft(.)55 b(If)35 b Fq(arg)44 b Ft(is)35 b(absen)m(t)h(\(and)f(there)g | |
10802 | (is)g(a)h(single)g Fq(sigsp)s(ec)6 b Ft(\))35 b(or)h(equal)f(to)i(`)p | |
10803 | Fs(-)p Ft(',)630 646 y(eac)m(h)28 b(sp)s(eci\014ed)e(signal's)h(disp)s | |
10804 | (osition)f(is)h(reset)g(to)g(the)g(v)-5 b(alue)27 b(it)g(had)f(when)f | |
10805 | (the)i(shell)g(w)m(as)630 756 y(started.)63 b(If)37 b | |
10806 | Fq(arg)46 b Ft(is)37 b(the)h(n)m(ull)g(string,)h(then)e(the)h(signal)h | |
10807 | (sp)s(eci\014ed)d(b)m(y)i(eac)m(h)h Fq(sigsp)s(ec)k Ft(is)630 | |
10808 | 865 y(ignored)36 b(b)m(y)g(the)g(shell)g(and)g(commands)f(it)i(in)m(v)m | |
10809 | (ok)m(es.)59 b(If)35 b Fq(arg)45 b Ft(is)36 b(not)g(presen)m(t)g(and)f | |
10810 | (`)p Fs(-p)p Ft(')630 975 y(has)e(b)s(een)g(supplied,)f(the)i(shell)f | |
10811 | (displa)m(ys)h(the)f(trap)g(commands)g(asso)s(ciated)i(with)e(eac)m(h) | |
10812 | 630 1084 y Fq(sigsp)s(ec)6 b Ft(.)40 b(If)28 b(no)g(argumen)m(ts)h(are) | |
10813 | g(supplied,)f(or)g(only)h(`)p Fs(-p)p Ft(')f(is)g(giv)m(en,)i | |
10814 | Fs(trap)e Ft(prin)m(ts)g(the)g(list)630 1194 y(of)g(commands)f(asso)s | |
10815 | (ciated)i(with)f(eac)m(h)h(signal)f(n)m(um)m(b)s(er)e(in)i(a)g(form)f | |
10816 | (that)h(ma)m(y)h(b)s(e)e(reused)630 1303 y(as)34 b(shell)g(input.)51 | |
10817 | b(The)33 b(`)p Fs(-l)p Ft(')h(option)g(causes)h(the)f(shell)g(to)h | |
10818 | (prin)m(t)e(a)i(list)f(of)g(signal)h(names)630 1413 y(and)j(their)h | |
10819 | (corresp)s(onding)f(n)m(um)m(b)s(ers.)65 b(Eac)m(h)39 | |
10820 | b Fq(sigsp)s(ec)45 b Ft(is)39 b(either)g(a)g(signal)h(name)f(or)g(a)630 | |
10821 | 1523 y(signal)27 b(n)m(um)m(b)s(er.)39 b(Signal)27 b(names)f(are)h | |
10822 | (case)h(insensitiv)m(e)g(and)e(the)g Fs(SIG)g Ft(pre\014x)g(is)h | |
10823 | (optional.)630 1650 y(If)35 b(a)g Fq(sigsp)s(ec)41 b | |
10824 | Ft(is)35 b Fs(0)g Ft(or)g Fs(EXIT)p Ft(,)g Fq(arg)43 | |
10825 | b Ft(is)35 b(executed)h(when)e(the)h(shell)h(exits.)55 | |
10826 | b(If)35 b(a)g Fq(sigsp)s(ec)41 b Ft(is)630 1760 y Fs(DEBUG)p | |
4a8bb13f CR |
10827 | Ft(,)32 b(the)g(command)g Fq(arg)40 b Ft(is)33 b(executed)g(b)s(efore)f |
10828 | (ev)m(ery)h(simple)f(command,)h Fs(for)e Ft(com-)630 | |
45c0f7f8 CR |
10829 | 1870 y(mand,)d Fs(case)g Ft(command,)h Fs(select)e Ft(command,)i(ev)m |
10830 | (ery)h(arithmetic)g Fs(for)d Ft(command,)j(and)630 1979 | |
4a8bb13f CR |
10831 | y(b)s(efore)22 b(the)g(\014rst)f(command)h(executes)i(in)e(a)g(shell)h |
10832 | (function.)37 b(Refer)22 b(to)h(the)g(description)f(of)630 | |
45c0f7f8 | 10833 | 2089 y(the)i Fs(extdebug)d Ft(option)j(to)h(the)f Fs(shopt)e |
122f603c | 10834 | Ft(builtin)h(\(see)i(Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)630 |
9f178efb | 10835 | 2198 y(page)33 b(62\))g(for)f(details)h(of)f(its)h(e\013ect)g(on)f(the) |
122f603c | 10836 | g Fs(DEBUG)f Ft(trap.)46 b(If)31 b(a)i Fq(sigsp)s(ec)38 |
45c0f7f8 | 10837 | b Ft(is)32 b Fs(RETURN)p Ft(,)f(the)630 2308 y(command)h |
54a1fa7c | 10838 | Fq(arg)41 b Ft(is)33 b(executed)g(eac)m(h)h(time)f(a)g(shell)g |
45c0f7f8 | 10839 | (function)g(or)f(a)h(script)g(executed)g(with)630 2418 |
54a1fa7c | 10840 | y(the)e Fs(.)f Ft(or)g Fs(source)f Ft(builtins)g(\014nishes)h |
45c0f7f8 | 10841 | (executing.)630 2545 y(If)g(a)i Fq(sigsp)s(ec)k Ft(is)31 |
54a1fa7c | 10842 | b Fs(ERR)p Ft(,)f(the)h(command)g Fq(arg)39 b Ft(is)31 |
45c0f7f8 | 10843 | b(executed)g(whenev)m(er)g(a)g(simple)g(command)630 2655 |
54a1fa7c CR |
10844 | y(has)k(a)h(non-zero)h(exit)f(status,)i(sub)5 b(ject)35 |
10845 | b(to)h(the)g(follo)m(wing)h(conditions.)57 b(The)35 b | |
45c0f7f8 | 10846 | Fs(ERR)g Ft(trap)630 2765 y(is)30 b(not)f(executed)i(if)e(the)h(failed) |
122f603c | 10847 | g(command)g(is)f(part)h(of)f(the)h(command)f(list)i(immediately)630 |
45c0f7f8 | 10848 | 2874 y(follo)m(wing)47 b(an)d Fs(until)g Ft(or)h Fs(while)f |
54a1fa7c | 10849 | Ft(k)m(eyw)m(ord,)49 b(part)c(of)g(the)h(test)g(follo)m(wing)g(the)f |
45c0f7f8 | 10850 | Fs(if)g Ft(or)630 2984 y Fs(elif)d Ft(reserv)m(ed)i(w)m(ords,)j(part)c |
54a1fa7c | 10851 | (of)h(a)g(command)f(executed)i(in)e(a)h Fs(&&)f Ft(or)h |
45c0f7f8 | 10852 | Fs(||)f Ft(list,)k(or)d(if)630 3093 y(the)c(command's)g(return)f |
54a1fa7c | 10853 | (status)h(is)g(b)s(eing)f(in)m(v)m(erted)i(using)f Fs(!)p |
45c0f7f8 | 10854 | Ft(.)68 b(These)40 b(are)g(the)h(same)630 3203 y(conditions)31 |
54a1fa7c | 10855 | b(ob)s(ey)m(ed)f(b)m(y)h(the)f Fs(errexit)f Ft(option.)630 |
45c0f7f8 | 10856 | 3331 y(Signals)37 b(ignored)f(up)s(on)f(en)m(try)i(to)g(the)f(shell)h |
54a1fa7c | 10857 | (cannot)g(b)s(e)f(trapp)s(ed)f(or)h(reset.)59 b(T)-8 |
45c0f7f8 | 10858 | b(rapp)s(ed)630 3440 y(signals)28 b(that)f(are)h(not)f(b)s(eing)g |
54a1fa7c | 10859 | (ignored)g(are)g(reset)h(to)g(their)f(original)h(v)-5 |
45c0f7f8 CR |
10860 | b(alues)28 b(in)e(a)i(subshell)630 3550 y(or)i(subshell)g(en)m |
10861 | (vironmen)m(t)h(when)e(one)i(is)f(created.)630 3678 y(The)g(return)f | |
67362c60 CR |
10862 | (status)i(is)f(zero)h(unless)f(a)h Fq(sigsp)s(ec)36 b |
10863 | Ft(do)s(es)30 b(not)h(sp)s(ecify)f(a)g(v)-5 b(alid)31 | |
45c0f7f8 CR |
10864 | b(signal.)150 3824 y Fs(umask)870 3952 y(umask)46 b([-p])h([-S])g([)p |
10865 | Fi(mode)11 b Fs(])630 4080 y Ft(Set)29 b(the)h(shell)f(pro)s(cess's)g | |
c302751c CR |
10866 | (\014le)g(creation)h(mask)f(to)h Fq(mo)s(de)5 b Ft(.)40 |
10867 | b(If)28 b Fq(mo)s(de)34 b Ft(b)s(egins)29 b(with)f(a)i(digit,)630 | |
45c0f7f8 | 10868 | 4189 y(it)e(is)f(in)m(terpreted)g(as)g(an)g(o)s(ctal)i(n)m(um)m(b)s |
6932f7f5 | 10869 | (er;)e(if)g(not,)h(it)g(is)f(in)m(terpreted)g(as)g(a)h(sym)m(b)s(olic)f |
45c0f7f8 | 10870 | (mo)s(de)630 4299 y(mask)i(similar)g(to)g(that)h(accepted)g(b)m(y)f |
6932f7f5 | 10871 | (the)g Fs(chmod)e Ft(command.)40 b(If)28 b Fq(mo)s(de)34 |
45c0f7f8 | 10872 | b Ft(is)28 b(omitted,)j(the)630 4408 y(curren)m(t)36 |
6932f7f5 CR |
10873 | b(v)-5 b(alue)36 b(of)g(the)h(mask)f(is)g(prin)m(ted.)57 |
10874 | b(If)35 b(the)h(`)p Fs(-S)p Ft(')g(option)h(is)f(supplied)f(without)h | |
45c0f7f8 | 10875 | (a)630 4518 y Fq(mo)s(de)k Ft(argumen)m(t,)d(the)e(mask)g(is)g(prin)m |
6932f7f5 | 10876 | (ted)g(in)g(a)h(sym)m(b)s(olic)f(format.)55 b(If)35 b(the)g(`)p |
45c0f7f8 | 10877 | Fs(-p)p Ft(')g(option)630 4628 y(is)f(supplied,)f(and)g |
1c72c0cd | 10878 | Fq(mo)s(de)38 b Ft(is)33 b(omitted,)j(the)e(output)f(is)g(in)h(a)g |
45c0f7f8 | 10879 | (form)f(that)h(ma)m(y)g(b)s(e)f(reused)630 4737 y(as)e(input.)41 |
1c72c0cd | 10880 | b(The)31 b(return)f(status)h(is)g(zero)h(if)e(the)h(mo)s(de)g(is)g |
45c0f7f8 | 10881 | (successfully)g(c)m(hanged)g(or)g(if)g(no)630 4847 y |
1c72c0cd | 10882 | Fq(mo)s(de)k Ft(argumen)m(t)c(is)f(supplied,)g(and)f(non-zero)i |
45c0f7f8 | 10883 | (otherwise.)630 4975 y(Note)38 b(that)e(when)g(the)g(mo)s(de)g(is)g(in) |
1c72c0cd | 10884 | m(terpreted)h(as)f(an)g(o)s(ctal)i(n)m(um)m(b)s(er,)e(eac)m(h)i(n)m(um) |
45c0f7f8 | 10885 | m(b)s(er)d(of)630 5084 y(the)f(umask)g(is)h(subtracted)f(from)f |
37c41ab1 | 10886 | Fs(7)p Ft(.)53 b(Th)m(us,)34 b(a)h(umask)e(of)i Fs(022)e |
45c0f7f8 CR |
10887 | Ft(results)h(in)g(p)s(ermissions)630 5194 y(of)d Fs(755)p |
10888 | Ft(.)150 5340 y Fs(unset)p eop end | |
9f178efb CR |
10889 | %%Page: 48 54 |
10890 | TeXDict begin 48 53 bop 150 -116 a Ft(48)2572 b(Bash)31 | |
10891 | b(Reference)g(Man)m(ual)870 299 y Fs(unset)46 b([-fnv])g([)p | |
10892 | Fi(name)11 b Fs(])630 426 y Ft(Remo)m(v)m(e)32 b(eac)m(h)g(v)-5 | |
122f603c CR |
10893 | b(ariable)32 b(or)e(function)h Fq(name)5 b Ft(.)42 b(If)30 |
10894 | b(the)h(`)p Fs(-v)p Ft(')f(option)h(is)g(giv)m(en,)h(eac)m(h)g | |
9f178efb | 10895 | Fq(name)630 536 y Ft(refers)20 b(to)i(a)f(shell)g(v)-5 |
122f603c CR |
10896 | b(ariable)21 b(and)g(that)g(v)-5 b(ariable)22 b(is)e(rem)m(v)m(o)m(v)m |
10897 | (ed.)40 b(If)20 b(the)h(`)p Fs(-f)p Ft(')g(option)g(is)g(giv)m(en,)630 | |
9f178efb | 10898 | 645 y(the)37 b Fq(name)5 b Ft(s)37 b(refer)f(to)i(shell)f(functions,)h |
122f603c | 10899 | (and)e(the)h(function)g(de\014nition)f(is)h(remo)m(v)m(ed.)61 |
9f178efb CR |
10900 | b(If)630 755 y(the)30 b(`)p Fs(-n)p Ft(')f(option)h(is)g(supplied,)e |
10901 | (and)h Fq(name)35 b Ft(is)30 b(a)g(v)-5 b(ariable)30 | |
10902 | b(with)f(the)h Fq(nameref)47 b Ft(attribute,)630 864 | |
10903 | y Fq(name)39 b Ft(will)33 b(b)s(e)g(unset)g(rather)h(than)f(the)g(v)-5 | |
10904 | b(ariable)35 b(it)f(references.)50 b(`)p Fs(-n)p Ft(')33 | |
10905 | b(has)h(no)f(e\013ect)i(if)630 974 y(the)h(`)p Fs(-f)p | |
10906 | Ft(')g(option)h(is)f(supplied.)56 b(If)36 b(no)g(options)g(are)g | |
10907 | (supplied,)h(eac)m(h)g Fq(name)k Ft(refers)36 b(to)h(a)630 | |
10908 | 1084 y(v)-5 b(ariable;)37 b(if)d(there)g(is)g(no)g(v)-5 | |
10909 | b(ariable)34 b(b)m(y)g(that)h(name,)g(an)m(y)f(function)g(with)f(that)i | |
10910 | (name)f(is)630 1193 y(unset.)46 b(Readonly)33 b(v)-5 | |
10911 | b(ariables)33 b(and)e(functions)h(ma)m(y)h(not)g(b)s(e)e(unset.)47 | |
10912 | b(The)31 b(return)h(status)630 1303 y(is)e(zero)i(unless)d(a)i | |
10913 | Fq(name)36 b Ft(is)30 b(readonly)-8 b(.)150 1520 y Fr(4.2)68 | |
10914 | b(Bash)45 b(Builtin)g(Commands)150 1680 y Ft(This)c(section)h(describ)s | |
10915 | (es)f(builtin)f(commands)h(whic)m(h)g(are)h(unique)e(to)j(or)e(ha)m(v)m | |
10916 | (e)h(b)s(een)f(extended)g(in)150 1789 y(Bash.)g(Some)30 | |
10917 | b(of)h(these)g(commands)f(are)g(sp)s(eci\014ed)g(in)g(the)h | |
10918 | Fl(posix)e Ft(standard.)150 1934 y Fs(alias)870 2061 | |
10919 | y(alias)46 b([-p])h([)p Fi(name)11 b Fs([=)p Fi(value)g | |
10920 | Fs(])43 b(...)o(])630 2188 y Ft(Without)h(argumen)m(ts)f(or)g(with)g | |
45c0f7f8 | 10921 | (the)h(`)p Fs(-p)p Ft(')f(option,)k Fs(alias)41 b Ft(prin)m(ts)i(the)g |
9f178efb | 10922 | (list)h(of)f(aliases)630 2298 y(on)36 b(the)g(standard)f(output)h(in)f |
45c0f7f8 | 10923 | (a)i(form)e(that)i(allo)m(ws)g(them)f(to)g(b)s(e)g(reused)f(as)h |
9f178efb | 10924 | (input.)56 b(If)630 2407 y(argumen)m(ts)29 b(are)g(supplied,)f(an)h |
45c0f7f8 | 10925 | (alias)h(is)f(de\014ned)e(for)i(eac)m(h)h Fq(name)k Ft(whose)28 |
9f178efb | 10926 | b Fq(v)-5 b(alue)35 b Ft(is)29 b(giv)m(en.)630 2517 y(If)39 |
74d0116b CR |
10927 | b(no)h Fq(v)-5 b(alue)45 b Ft(is)40 b(giv)m(en,)j(the)d(name)f(and)g(v) |
10928 | -5 b(alue)40 b(of)g(the)g(alias)h(is)f(prin)m(ted.)68 | |
9f178efb CR |
10929 | b(Aliases)41 b(are)630 2627 y(describ)s(ed)29 b(in)h(Section)i(6.6)f |
10930 | ([Aliases],)h(page)f(87.)150 2771 y Fs(bind)870 2898 | |
45c0f7f8 | 10931 | y(bind)47 b([-m)g Fi(keymap)11 b Fs(])45 b([-lpsvPSVX])870 |
9f178efb | 10932 | 3008 y(bind)i([-m)g Fi(keymap)11 b Fs(])45 b([-q)i Fi(function)11 |
122f603c | 10933 | b Fs(])45 b([-u)h Fi(function)11 b Fs(])45 b([-r)i Fi(keyseq)11 |
9f178efb CR |
10934 | b Fs(])870 3118 y(bind)47 b([-m)g Fi(keymap)11 b Fs(])45 |
10935 | b(-f)i Fi(filename)870 3227 y Fs(bind)g([-m)g Fi(keymap)11 | |
10936 | b Fs(])45 b(-x)i Fi(keyseq:shell-command)870 3337 y Fs(bind)g([-m)g | |
4a8bb13f | 10937 | Fi(keymap)11 b Fs(])45 b Fi(keyseq:function-name)870 |
9f178efb CR |
10938 | 3446 y Fs(bind)i Fi(readline-command)630 3573 y Ft(Displa)m(y)22 |
10939 | b(curren)m(t)f(Readline)h(\(see)f(Chapter)g(8)g([Command)f(Line)h | |
10940 | (Editing],)j(page)e(101\))g(k)m(ey)630 3683 y(and)36 | |
10941 | b(function)g(bindings,)i(bind)d(a)i(k)m(ey)g(sequence)g(to)h(a)f | |
10942 | (Readline)g(function)f(or)h(macro,)630 3793 y(or)44 b(set)h(a)g | |
10943 | (Readline)f(v)-5 b(ariable.)83 b(Eac)m(h)45 b(non-option)g(argumen)m(t) | |
10944 | f(is)g(a)h(command)f(as)g(it)630 3902 y(w)m(ould)e(app)s(ear)f(in)h(a)h | |
10945 | (Readline)g(initialization)i(\014le)d(\(see)h(Section)g(8.3)g | |
10946 | ([Readline)g(Init)630 4012 y(File],)c(page)d(104\),)j(but)c(eac)m(h)h | |
10947 | (binding)f(or)g(command)h(m)m(ust)f(b)s(e)g(passed)g(as)h(a)g(separate) | |
10948 | 630 4121 y(argumen)m(t;)31 b(e.g.,)h(`)p Fs | |
10949 | ("\\C-x\\C-r":re-read-init-f)o(ile)p Ft('.)630 4249 y(Options,)e(if)h | |
10950 | (supplied,)e(ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 | |
10951 | 4393 y Fs(-m)e Fi(keymap)1110 4503 y Ft(Use)54 b Fq(k)m(eymap)j | |
10952 | Ft(as)d(the)g(k)m(eymap)g(to)h(b)s(e)e(a\013ected)i(b)m(y)f(the)g | |
10953 | (subsequen)m(t)1110 4612 y(bindings.)46 b(Acceptable)34 | |
10954 | b Fq(k)m(eymap)i Ft(names)c(are)h Fs(emacs)p Ft(,)f Fs(emacs-standard)p | |
10955 | Ft(,)1110 4722 y Fs(emacs-meta)p Ft(,)99 b Fs(emacs-ctlx)p | |
10956 | Ft(,)f Fs(vi)p Ft(,)j Fs(vi-move)p Ft(,)f Fs(vi-command)p | |
10957 | Ft(,)f(and)1110 4832 y Fs(vi-insert)p Ft(.)64 b Fs(vi)38 | |
10958 | b Ft(is)h(equiv)-5 b(alen)m(t)41 b(to)e Fs(vi-command)p | |
10959 | Ft(;)i Fs(emacs)c Ft(is)i(equiv)-5 b(alen)m(t)1110 4941 | |
10960 | y(to)31 b Fs(emacs-standard)p Ft(.)630 5086 y Fs(-l)384 | |
10961 | b Ft(List)31 b(the)f(names)g(of)h(all)g(Readline)g(functions.)630 | |
10962 | 5230 y Fs(-p)384 b Ft(Displa)m(y)34 b(Readline)f(function)g(names)g | |
10963 | (and)f(bindings)f(in)i(suc)m(h)f(a)i(w)m(a)m(y)f(that)1110 | |
10964 | 5340 y(they)e(can)f(b)s(e)g(used)g(as)g(input)g(or)g(in)g(a)h(Readline) | |
10965 | g(initialization)i(\014le.)p eop end | |
10966 | %%Page: 49 55 | |
10967 | TeXDict begin 49 54 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
10968 | b(Shell)30 b(Builtin)h(Commands)2069 b(49)630 299 y Fs(-P)384 | |
10969 | b Ft(List)31 b(curren)m(t)f(Readline)h(function)f(names)g(and)g | |
10970 | (bindings.)630 458 y Fs(-v)384 b Ft(Displa)m(y)25 b(Readline)f(v)-5 | |
10971 | b(ariable)25 b(names)f(and)f(v)-5 b(alues)24 b(in)g(suc)m(h)f(a)i(w)m | |
10972 | (a)m(y)f(that)h(they)1110 568 y(can)31 b(b)s(e)e(used)h(as)h(input)e | |
10973 | (or)h(in)g(a)h(Readline)g(initialization)j(\014le.)630 | |
10974 | 727 y Fs(-V)384 b Ft(List)31 b(curren)m(t)f(Readline)h(v)-5 | |
10975 | b(ariable)31 b(names)f(and)g(v)-5 b(alues.)630 886 y | |
10976 | Fs(-s)384 b Ft(Displa)m(y)39 b(Readline)f(k)m(ey)g(sequences)f(b)s | |
10977 | (ound)f(to)i(macros)g(and)f(the)g(strings)1110 995 y(they)d(output)f | |
10978 | (in)h(suc)m(h)f(a)h(w)m(a)m(y)h(that)f(they)g(can)g(b)s(e)f(used)g(as)h | |
10979 | (input)e(or)i(in)g(a)1110 1105 y(Readline)d(initialization)i(\014le.) | |
10980 | 630 1264 y Fs(-S)384 b Ft(Displa)m(y)39 b(Readline)f(k)m(ey)g | |
45c0f7f8 | 10981 | (sequences)f(b)s(ound)f(to)i(macros)g(and)f(the)g(strings)1110 |
9f178efb CR |
10982 | 1374 y(they)31 b(output.)630 1533 y Fs(-f)f Fi(filename)1110 |
10983 | 1642 y Ft(Read)h(k)m(ey)g(bindings)e(from)h Fq(\014lename)5 | |
10984 | b Ft(.)630 1801 y Fs(-q)30 b Fi(function)1110 1911 y | |
10985 | Ft(Query)g(ab)s(out)g(whic)m(h)g(k)m(eys)h(in)m(v)m(ok)m(e)h(the)f | |
10986 | (named)f Fq(function)p Ft(.)630 2070 y Fs(-u)g Fi(function)1110 | |
10987 | 2180 y Ft(Un)m(bind)f(all)i(k)m(eys)g(b)s(ound)e(to)i(the)f(named)g | |
10988 | Fq(function)p Ft(.)630 2339 y Fs(-r)g Fi(keyseq)1110 | |
10989 | 2448 y Ft(Remo)m(v)m(e)i(an)m(y)f(curren)m(t)f(binding)f(for)h | |
10990 | Fq(k)m(eyseq)r Ft(.)630 2607 y Fs(-x)g Fi(keyseq:shell-command)1110 | |
10991 | 2717 y Ft(Cause)35 b Fq(shell-command)k Ft(to)d(b)s(e)f(executed)h | |
54a1fa7c | 10992 | (whenev)m(er)f Fq(k)m(eyseq)j Ft(is)d(en)m(tered.)1110 |
9f178efb CR |
10993 | 2826 y(When)46 b Fq(shell-command)k Ft(is)c(executed,)51 |
10994 | b(the)46 b(shell)g(sets)g(the)g Fs(READLINE_)1110 2936 | |
54a1fa7c | 10995 | y(LINE)37 b Ft(v)-5 b(ariable)38 b(to)g(the)g(con)m(ten)m(ts)i(of)e |
9f178efb | 10996 | (the)g(Readline)g(line)g(bu\013er)f(and)g(the)1110 3046 |
54a1fa7c | 10997 | y Fs(READLINE_POINT)e Ft(v)-5 b(ariable)39 b(to)h(the)e(curren)m(t)h |
9f178efb | 10998 | (lo)s(cation)h(of)f(the)g(insertion)1110 3155 y(p)s(oin)m(t.)59 |
54a1fa7c | 10999 | b(If)37 b(the)f(executed)i(command)e(c)m(hanges)i(the)f(v)-5 |
9f178efb | 11000 | b(alue)37 b(of)f Fs(READLINE_)1110 3265 y(LINE)29 b Ft(or)h |
54a1fa7c | 11001 | Fs(READLINE_POINT)p Ft(,)c(those)31 b(new)e(v)-5 b(alues)31 |
9f178efb CR |
11002 | b(will)f(b)s(e)f(re\015ected)i(in)f(the)1110 3374 y(editing)h(state.) |
11003 | 630 3534 y Fs(-X)384 b Ft(List)27 b(all)i(k)m(ey)f(sequences)f(b)s | |
45c0f7f8 | 11004 | (ound)e(to)j(shell)g(commands)e(and)h(the)g(asso)s(ciated)1110 |
9f178efb CR |
11005 | 3643 y(commands)j(in)g(a)h(format)g(that)f(can)h(b)s(e)f(reused)f(as)i |
11006 | (input.)630 3802 y(The)26 b(return)f(status)i(is)f(zero)i(unless)d(an)i | |
45c0f7f8 | 11007 | (in)m(v)-5 b(alid)27 b(option)g(is)f(supplied)f(or)i(an)f(error)g(o)s |
9f178efb CR |
11008 | (ccurs.)150 3961 y Fs(builtin)870 4096 y(builtin)46 b([)p |
11009 | Fi(shell-builtin)54 b Fs([)p Fi(args)11 b Fs(]])630 4230 | |
45c0f7f8 CR |
11010 | y Ft(Run)35 b(a)h(shell)h(builtin,)g(passing)f(it)g Fq(args)t |
11011 | Ft(,)i(and)e(return)f(its)h(exit)h(status.)58 b(This)36 | |
9f178efb | 11012 | b(is)g(useful)630 4340 y(when)29 b(de\014ning)h(a)g(shell)h(function)f |
45c0f7f8 | 11013 | (with)g(the)g(same)h(name)f(as)h(a)g(shell)f(builtin,)g(retaining)630 |
9f178efb | 11014 | 4449 y(the)k(functionalit)m(y)h(of)f(the)f(builtin)g(within)g(the)h |
45c0f7f8 | 11015 | (function.)50 b(The)33 b(return)g(status)h(is)f(non-)630 |
9f178efb CR |
11016 | 4559 y(zero)e(if)g Fq(shell-builtin)f Ft(is)g(not)h(a)g(shell)f |
11017 | (builtin)g(command.)150 4718 y Fs(caller)870 4852 y(caller)46 | |
11018 | b([)p Fi(expr)11 b Fs(])630 4986 y Ft(Returns)34 b(the)g(con)m(text)j | |
45c0f7f8 | 11019 | (of)e(an)m(y)g(activ)m(e)i(subroutine)c(call)j(\(a)f(shell)g(function)f |
9f178efb CR |
11020 | (or)h(a)g(script)630 5096 y(executed)c(with)f(the)h Fs(.)f |
11021 | Ft(or)g Fs(source)f Ft(builtins\).)630 5230 y(Without)45 | |
45c0f7f8 CR |
11022 | b Fq(expr)7 b Ft(,)46 b Fs(caller)d Ft(displa)m(ys)h(the)g(line)g(n)m |
11023 | (um)m(b)s(er)f(and)g(source)h(\014lename)h(of)f(the)630 | |
9f178efb | 11024 | 5340 y(curren)m(t)35 b(subroutine)f(call.)56 b(If)35 |
45c0f7f8 | 11025 | b(a)h(non-negativ)m(e)h(in)m(teger)g(is)e(supplied)f(as)h |
9f178efb CR |
11026 | Fq(expr)7 b Ft(,)36 b Fs(caller)p eop end |
11027 | %%Page: 50 56 | |
11028 | TeXDict begin 50 55 bop 150 -116 a Ft(50)2572 b(Bash)31 | |
11029 | b(Reference)g(Man)m(ual)630 299 y(displa)m(ys)41 b(the)f(line)h(n)m(um) | |
11030 | m(b)s(er,)h(subroutine)d(name,)44 b(and)c(source)g(\014le)h(corresp)s | |
11031 | (onding)e(to)630 408 y(that)c(p)s(osition)g(in)f(the)h(curren)m(t)f | |
11032 | (execution)i(call)g(stac)m(k.)54 b(This)34 b(extra)h(information)g(ma)m | |
11033 | (y)630 518 y(b)s(e)30 b(used,)g(for)g(example,)h(to)g(prin)m(t)f(a)h | |
11034 | (stac)m(k)h(trace.)42 b(The)29 b(curren)m(t)i(frame)f(is)g(frame)h(0.) | |
11035 | 630 653 y(The)e(return)f(v)-5 b(alue)29 b(is)h(0)f(unless)g(the)g | |
11036 | (shell)g(is)h(not)f(executing)h(a)g(subroutine)e(call)i(or)g | |
11037 | Fq(expr)630 763 y Ft(do)s(es)g(not)h(corresp)s(ond)e(to)i(a)g(v)-5 | |
37c41ab1 | 11038 | b(alid)30 b(p)s(osition)h(in)f(the)g(call)i(stac)m(k.)150 |
9f178efb CR |
11039 | 924 y Fs(command)870 1060 y(command)46 b([-pVv])g Fi(command)56 |
11040 | b Fs([)p Fi(arguments)g Fs(...)o(])630 1195 y Ft(Runs)31 | |
c302751c | 11041 | b Fq(command)36 b Ft(with)d Fq(argumen)m(ts)j Ft(ignoring)d(an)m(y)g |
9f178efb | 11042 | (shell)g(function)f(named)g Fq(command)t Ft(.)630 1305 |
37c41ab1 | 11043 | y(Only)39 b(shell)i(builtin)e(commands)h(or)g(commands)f(found)g(b)m(y) |
9f178efb | 11044 | h(searc)m(hing)h(the)f Fs(PATH)f Ft(are)630 1414 y(executed.)g(If)23 |
37c41ab1 CR |
11045 | b(there)h(is)f(a)h(shell)f(function)g(named)g Fs(ls)p |
11046 | Ft(,)i(running)c(`)p Fs(command)29 b(ls)p Ft(')23 b(within)g(the)630 | |
9f178efb | 11047 | 1524 y(function)33 b(will)g(execute)i(the)f(external)g(command)f |
37c41ab1 | 11048 | Fs(ls)f Ft(instead)i(of)f(calling)i(the)e(function)630 |
9f178efb | 11049 | 1633 y(recursiv)m(ely)-8 b(.)84 b(The)44 b(`)p Fs(-p)p |
37c41ab1 | 11050 | Ft(')h(option)g(means)f(to)h(use)g(a)f(default)h(v)-5 |
9f178efb | 11051 | b(alue)45 b(for)f Fs(PATH)g Ft(that)h(is)630 1743 y(guaran)m(teed)35 |
37c41ab1 | 11052 | b(to)f(\014nd)e(all)j(of)f(the)g(standard)f(utilities.)52 |
9f178efb | 11053 | b(The)33 b(return)g(status)h(in)f(this)h(case)630 1852 |
45c0f7f8 CR |
11054 | y(is)29 b(127)g(if)g Fq(command)j Ft(cannot)d(b)s(e)e(found)h(or)g(an)g |
11055 | (error)h(o)s(ccurred,)f(and)g(the)h(exit)g(status)g(of)630 | |
9f178efb | 11056 | 1962 y Fq(command)34 b Ft(otherwise.)630 2097 y(If)25 |
45c0f7f8 CR |
11057 | b(either)g(the)h(`)p Fs(-V)p Ft(')f(or)g(`)p Fs(-v)p |
11058 | Ft(')g(option)g(is)g(supplied,)h(a)f(description)g(of)h | |
9f178efb | 11059 | Fq(command)i Ft(is)d(prin)m(ted.)630 2207 y(The)i(`)p |
37c41ab1 | 11060 | Fs(-v)p Ft(')h(option)h(causes)f(a)h(single)f(w)m(ord)g(indicating)h |
9f178efb | 11061 | (the)f(command)g(or)g(\014le)g(name)g(used)630 2317 y(to)36 |
37c41ab1 CR |
11062 | b(in)m(v)m(ok)m(e)g Fq(command)j Ft(to)c(b)s(e)g(displa)m(y)m(ed;)j |
11063 | (the)d(`)p Fs(-V)p Ft(')g(option)g(pro)s(duces)e(a)j(more)f(v)m(erb)s | |
9f178efb | 11064 | (ose)630 2426 y(description.)61 b(In)36 b(this)h(case,)j(the)e(return)e |
37c41ab1 | 11065 | (status)h(is)g(zero)h(if)f Fq(command)k Ft(is)c(found,)h(and)630 |
9f178efb CR |
11066 | 2536 y(non-zero)31 b(if)f(not.)150 2697 y Fs(declare)870 |
11067 | 2832 y(declare)46 b([-aAfFgilnrtux])d([-p])k([)p Fi(name)11 | |
11068 | b Fs([=)p Fi(value)g Fs(])43 b(...)o(])630 2968 y Ft(Declare)29 | |
54a1fa7c CR |
11069 | b(v)-5 b(ariables)28 b(and)e(giv)m(e)j(them)e(attributes.)40 |
11070 | b(If)27 b(no)g Fq(name)5 b Ft(s)27 b(are)h(giv)m(en,)h(then)e(displa)m | |
9f178efb CR |
11071 | (y)630 3077 y(the)k(v)-5 b(alues)30 b(of)h(v)-5 b(ariables)31 |
11072 | b(instead.)630 3213 y(The)c(`)p Fs(-p)p Ft(')h(option)g(will)g(displa)m | |
54a1fa7c CR |
11073 | (y)g(the)g(attributes)g(and)g(v)-5 b(alues)28 b(of)g(eac)m(h)h |
11074 | Fq(name)5 b Ft(.)40 b(When)27 b(`)p Fs(-p)p Ft(')630 | |
9f178efb CR |
11075 | 3322 y(is)j(used)g(with)g Fq(name)36 b Ft(argumen)m(ts,)31 |
11076 | b(additional)g(options)f(are)h(ignored.)630 3458 y(When)36 | |
54a1fa7c CR |
11077 | b(`)p Fs(-p)p Ft(')f(is)h(supplied)f(without)h Fq(name)41 |
11078 | b Ft(argumen)m(ts,)d Fs(declare)c Ft(will)i(displa)m(y)g(the)g(at-)630 | |
9f178efb | 11079 | 3567 y(tributes)31 b(and)f(v)-5 b(alues)31 b(of)g(all)h(v)-5 |
54a1fa7c | 11080 | b(ariables)31 b(ha)m(ving)h(the)f(attributes)g(sp)s(eci\014ed)f(b)m(y)h |
9f178efb | 11081 | (the)g(addi-)630 3677 y(tional)h(options.)41 b(If)30 |
54a1fa7c | 11082 | b(no)g(other)h(options)g(are)g(supplied)e(with)h(`)p |
67362c60 | 11083 | Fs(-p)p Ft(',)g Fs(declare)f Ft(will)i(displa)m(y)630 |
9f178efb | 11084 | 3786 y(the)f(attributes)g(and)e(v)-5 b(alues)30 b(of)g(all)g(shell)g(v) |
67362c60 | 11085 | -5 b(ariables.)41 b(The)29 b(`)p Fs(-f)p Ft(')g(option)h(will)g |
9f178efb CR |
11086 | (restrict)g(the)630 3896 y(displa)m(y)h(to)g(shell)f(functions.)630 |
11087 | 4031 y(The)36 b(`)p Fs(-F)p Ft(')h(option)g(inhibits)f(the)h(displa)m | |
67362c60 | 11088 | (y)g(of)g(function)g(de\014nitions;)i(only)e(the)g(function)630 |
9f178efb | 11089 | 4141 y(name)30 b(and)f(attributes)i(are)f(prin)m(ted.)40 |
6932f7f5 | 11090 | b(If)30 b(the)g Fs(extdebug)e Ft(shell)i(option)g(is)g(enabled)g(using) |
9f178efb CR |
11091 | 630 4251 y Fs(shopt)24 b Ft(\(see)i(Section)g(4.3.2)i([The)d(Shopt)f |
11092 | (Builtin],)k(page)e(62\),)i(the)d(source)h(\014le)f(name)h(and)630 | |
11093 | 4360 y(line)38 b(n)m(um)m(b)s(er)e(where)i(the)g(function)f(is)h | |
09767ff0 | 11094 | (de\014ned)e(are)i(displa)m(y)m(ed)h(as)e(w)m(ell.)64 |
9f178efb CR |
11095 | b(`)p Fs(-F)p Ft(')38 b(implies)630 4470 y(`)p Fs(-f)p |
11096 | Ft('.)630 4605 y(The)32 b(`)p Fs(-g)p Ft(')h(option)g(forces)g(v)-5 | |
220537f2 | 11097 | b(ariables)33 b(to)h(b)s(e)e(created)h(or)g(mo)s(di\014ed)e(at)j(the)f |
9f178efb | 11098 | (global)h(scop)s(e,)630 4715 y(ev)m(en)k(when)e Fs(declare)f |
d9e1f41e | 11099 | Ft(is)j(executed)g(in)f(a)g(shell)h(function.)61 b(It)37 |
9f178efb CR |
11100 | b(is)g(ignored)h(in)f(all)h(other)630 4824 y(cases.)630 |
11101 | 4960 y(The)27 b(follo)m(wing)h(options)g(can)f(b)s(e)g(used)f(to)i | |
d9e1f41e | 11102 | (restrict)g(output)e(to)i(v)-5 b(ariables)28 b(with)f(the)g(sp)s(ec-) |
9f178efb | 11103 | 630 5069 y(i\014ed)j(attributes)h(or)f(to)h(giv)m(e)h(v)-5 |
45c0f7f8 | 11104 | b(ariables)31 b(attributes:)630 5230 y Fs(-a)384 b Ft(Eac)m(h)36 |
d9e1f41e CR |
11105 | b Fq(name)k Ft(is)34 b(an)h(indexed)g(arra)m(y)g(v)-5 |
11106 | b(ariable)36 b(\(see)f(Section)h(6.7)g([Arra)m(ys],)1110 | |
9f178efb CR |
11107 | 5340 y(page)31 b(88\).)p eop end |
11108 | %%Page: 51 57 | |
11109 | TeXDict begin 51 56 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
11110 | b(Shell)30 b(Builtin)h(Commands)2069 b(51)630 299 y Fs(-A)384 | |
45c0f7f8 CR |
11111 | b Ft(Eac)m(h)24 b Fq(name)k Ft(is)23 b(an)g(asso)s(ciativ)m(e)j(arra)m |
11112 | (y)e(v)-5 b(ariable)24 b(\(see)g(Section)g(6.7)g([Arra)m(ys],)1110 | |
9f178efb CR |
11113 | 408 y(page)31 b(88\).)630 566 y Fs(-f)384 b Ft(Use)31 |
11114 | b(function)f(names)g(only)-8 b(.)630 723 y Fs(-i)384 | |
09767ff0 CR |
11115 | b Ft(The)36 b(v)-5 b(ariable)37 b(is)f(to)h(b)s(e)f(treated)h(as)g(an)f |
11116 | (in)m(teger;)41 b(arithmetic)c(ev)-5 b(aluation)1110 | |
9f178efb CR |
11117 | 833 y(\(see)29 b(Section)f(6.5)h([Shell)f(Arithmetic],)i(page)e(86\))h |
11118 | (is)f(p)s(erformed)e(when)h(the)1110 942 y(v)-5 b(ariable)31 | |
11119 | b(is)g(assigned)f(a)h(v)-5 b(alue.)630 1099 y Fs(-l)384 | |
8e1a6eaa CR |
11120 | b Ft(When)26 b(the)g(v)-5 b(ariable)27 b(is)f(assigned)g(a)g(v)-5 |
11121 | b(alue,)28 b(all)f(upp)s(er-case)e(c)m(haracters)j(are)1110 | |
9f178efb CR |
11122 | 1209 y(con)m(v)m(erted)k(to)f(lo)m(w)m(er-case.)43 b(The)30 |
11123 | b(upp)s(er-case)g(attribute)h(is)g(disabled.)630 1366 | |
11124 | y Fs(-n)384 b Ft(Giv)m(e)28 b(eac)m(h)g Fq(name)k Ft(the)27 | |
11125 | b Fq(nameref)44 b Ft(attribute,)28 b(making)f(it)h(a)f(name)f | |
11126 | (reference)1110 1476 y(to)32 b(another)g(v)-5 b(ariable.)46 | |
11127 | b(That)31 b(other)h(v)-5 b(ariable)33 b(is)f(de\014ned)e(b)m(y)i(the)g | |
11128 | (v)-5 b(alue)32 b(of)1110 1585 y Fq(name)5 b Ft(.)39 | |
11129 | b(All)25 b(references)f(and)g(assignmen)m(ts)h(to)g Fq(name)5 | |
11130 | b Ft(,)26 b(except)f(for)f(c)m(hanging)1110 1695 y(the)38 | |
11131 | b(`)p Fs(-n)p Ft(')f(attribute)h(itself,)i(are)e(p)s(erformed)e(on)h | |
11132 | (the)h(v)-5 b(ariable)38 b(referenced)1110 1805 y(b)m(y)j | |
11133 | Fq(name)5 b Ft('s)41 b(v)-5 b(alue.)74 b(The)41 b(`)p | |
11134 | Fs(-n)p Ft(')g(attribute)g(cannot)h(b)s(e)f(applied)g(to)g(arra)m(y) | |
11135 | 1110 1914 y(v)-5 b(ariables.)630 2071 y Fs(-r)384 b Ft(Mak)m(e)25 | |
11136 | b Fq(name)5 b Ft(s)23 b(readonly)-8 b(.)39 b(These)24 | |
11137 | b(names)f(cannot)h(then)f(b)s(e)g(assigned)h(v)-5 b(alues)1110 | |
11138 | 2181 y(b)m(y)30 b(subsequen)m(t)g(assignmen)m(t)h(statemen)m(ts)h(or)f | |
11139 | (unset.)630 2338 y Fs(-t)384 b Ft(Giv)m(e)33 b(eac)m(h)h | |
11140 | Fq(name)j Ft(the)32 b Fs(trace)f Ft(attribute.)46 b(T)-8 | |
11141 | b(raced)32 b(functions)g(inherit)g(the)1110 2448 y Fs(DEBUG)26 | |
11142 | b Ft(and)h Fs(RETURN)f Ft(traps)h(from)g(the)h(calling)h(shell.)40 | |
11143 | b(The)27 b(trace)i(attribute)1110 2557 y(has)h(no)g(sp)s(ecial)h | |
11144 | (meaning)g(for)f(v)-5 b(ariables.)630 2715 y Fs(-u)384 | |
11145 | b Ft(When)28 b(the)h(v)-5 b(ariable)29 b(is)f(assigned)h(a)f(v)-5 | |
11146 | b(alue,)30 b(all)f(lo)m(w)m(er-case)i(c)m(haracters)f(are)1110 | |
11147 | 2824 y(con)m(v)m(erted)i(to)f(upp)s(er-case.)40 b(The)30 | |
11148 | b(lo)m(w)m(er-case)j(attribute)e(is)g(disabled.)630 2981 | |
122f603c CR |
11149 | y Fs(-x)384 b Ft(Mark)30 b(eac)m(h)h Fq(name)k Ft(for)29 |
11150 | b(exp)s(ort)h(to)g(subsequen)m(t)f(commands)h(via)g(the)g(en)m(vi-)1110 | |
9f178efb | 11151 | 3091 y(ronmen)m(t.)630 3248 y(Using)e(`)p Fs(+)p Ft(')h(instead)f(of)g |
45c0f7f8 | 11152 | (`)p Fs(-)p Ft(')g(turns)f(o\013)i(the)f(attribute)h(instead,)g(with)f |
9f178efb | 11153 | (the)g(exceptions)h(that)630 3358 y(`)p Fs(+a)p Ft(')h(ma)m(y)h(not)f |
45c0f7f8 CR |
11154 | (b)s(e)f(used)g(to)i(destro)m(y)g(an)f(arra)m(y)g(v)-5 |
11155 | b(ariable)31 b(and)f(`)p Fs(+r)p Ft(')g(will)g(not)g(remo)m(v)m(e)i | |
9f178efb | 11156 | (the)630 3467 y(readonly)e(attribute.)41 b(When)30 b(used)f(in)g(a)h |
45c0f7f8 | 11157 | (function,)g Fs(declare)e Ft(mak)m(es)j(eac)m(h)f Fq(name)35 |
9f178efb | 11158 | b Ft(lo)s(cal,)630 3577 y(as)30 b(with)g(the)h Fs(local)e |
45c0f7f8 | 11159 | Ft(command,)h(unless)f(the)i(`)p Fs(-g)p Ft(')f(option)g(is)h(used.)40 |
9f178efb | 11160 | b(If)29 b(a)i(v)-5 b(ariable)31 b(name)630 3687 y(is)f(follo)m(w)m(ed)i |
45c0f7f8 CR |
11161 | (b)m(y)f(=)p Fq(v)-5 b(alue)5 b Ft(,)31 b(the)f(v)-5 |
11162 | b(alue)31 b(of)g(the)f(v)-5 b(ariable)31 b(is)g(set)g(to)g | |
9f178efb | 11163 | Fq(v)-5 b(alue)5 b Ft(.)630 3820 y(The)35 b(return)f(status)i(is)g |
45c0f7f8 | 11164 | (zero)g(unless)f(an)g(in)m(v)-5 b(alid)36 b(option)g(is)g(encoun)m |
9f178efb | 11165 | (tered,)h(an)f(attempt)630 3930 y(is)c(made)g(to)g(de\014ne)f(a)h |
45c0f7f8 | 11166 | (function)g(using)f(`)p Fs(-f)f(foo=bar)p Ft(',)h(an)h(attempt)g(is)g |
9f178efb | 11167 | (made)g(to)h(assign)630 4039 y(a)42 b(v)-5 b(alue)43 |
45c0f7f8 | 11168 | b(to)g(a)f(readonly)g(v)-5 b(ariable,)47 b(an)42 b(attempt)h(is)f(made) |
9f178efb | 11169 | g(to)h(assign)f(a)h(v)-5 b(alue)42 b(to)h(an)630 4149 |
45c0f7f8 CR |
11170 | y(arra)m(y)30 b(v)-5 b(ariable)30 b(without)g(using)e(the)i(comp)s |
11171 | (ound)e(assignmen)m(t)i(syn)m(tax)g(\(see)h(Section)f(6.7)630 | |
9f178efb | 11172 | 4258 y([Arra)m(ys],)47 b(page)c(88\),)48 b(one)43 b(of)g(the)g |
45c0f7f8 | 11173 | Fq(names)k Ft(is)c(not)g(a)g(v)-5 b(alid)43 b(shell)g(v)-5 |
9f178efb | 11174 | b(ariable)44 b(name,)i(an)630 4368 y(attempt)28 b(is)f(made)h(to)f |
45c0f7f8 | 11175 | (turn)f(o\013)i(readonly)f(status)g(for)g(a)h(readonly)f(v)-5 |
9f178efb | 11176 | b(ariable,)29 b(an)e(attempt)630 4478 y(is)h(made)h(to)g(turn)e(o\013)i |
45c0f7f8 | 11177 | (arra)m(y)f(status)h(for)f(an)g(arra)m(y)h(v)-5 b(ariable,)30 |
9f178efb | 11178 | b(or)e(an)g(attempt)i(is)e(made)g(to)630 4587 y(displa)m(y)j(a)f |
45c0f7f8 | 11179 | (non-existen)m(t)i(function)e(with)g(`)p Fs(-f)p Ft('.)150 |
9f178efb CR |
11180 | 4744 y Fs(echo)870 4878 y(echo)47 b([-neE])f([)p Fi(arg)57 |
11181 | b Fs(...)o(])630 5011 y Ft(Output)31 b(the)i Fq(arg)8 | |
45c0f7f8 | 11182 | b Ft(s,)33 b(separated)g(b)m(y)g(spaces,)g(terminated)g(with)f(a)h |
9f178efb | 11183 | (newline.)47 b(The)32 b(return)630 5121 y(status)27 b(is)g(0)h(unless)e |
45c0f7f8 CR |
11184 | (a)i(write)f(error)f(o)s(ccurs.)40 b(If)26 b(`)p Fs(-n)p |
11185 | Ft(')h(is)g(sp)s(eci\014ed,)h(the)f(trailing)h(newline)f(is)630 | |
9f178efb | 11186 | 5230 y(suppressed.)37 b(If)24 b(the)g(`)p Fs(-e)p Ft(')h(option)g(is)f |
45c0f7f8 | 11187 | (giv)m(en,)j(in)m(terpretation)f(of)e(the)h(follo)m(wing)h(bac)m |
9f178efb | 11188 | (kslash-)630 5340 y(escap)s(ed)38 b(c)m(haracters)i(is)f(enabled.)65 |
45c0f7f8 | 11189 | b(The)38 b(`)p Fs(-E)p Ft(')g(option)h(disables)f(the)h(in)m |
9f178efb CR |
11190 | (terpretation)h(of)p eop end |
11191 | %%Page: 52 58 | |
11192 | TeXDict begin 52 57 bop 150 -116 a Ft(52)2572 b(Bash)31 | |
11193 | b(Reference)g(Man)m(ual)630 299 y(these)c(escap)s(e)g(c)m(haracters,)i | |
45c0f7f8 | 11194 | (ev)m(en)e(on)g(systems)f(where)g(they)h(are)g(in)m(terpreted)g(b)m(y)f |
9f178efb CR |
11195 | (default.)630 408 y(The)32 b Fs(xpg_echo)f Ft(shell)i(option)g(ma)m(y)h |
11196 | (b)s(e)e(used)g(to)h(dynamically)h(determine)f(whether)f(or)630 | |
11197 | 518 y(not)h Fs(echo)f Ft(expands)g(these)h(escap)s(e)h(c)m(haracters)g | |
74d0116b | 11198 | (b)m(y)f(default.)48 b Fs(echo)32 b Ft(do)s(es)g(not)i(in)m(terpret)630 |
9f178efb CR |
11199 | 628 y(`)p Fs(--)p Ft(')c(to)h(mean)g(the)f(end)g(of)h(options.)630 |
11200 | 759 y Fs(echo)e Ft(in)m(terprets)i(the)f(follo)m(wing)i(escap)s(e)f | |
11201 | (sequences:)630 913 y Fs(\\a)384 b Ft(alert)31 b(\(b)s(ell\))630 | |
11202 | 1066 y Fs(\\b)384 b Ft(bac)m(kspace)630 1219 y Fs(\\c)g | |
11203 | Ft(suppress)28 b(further)h(output)630 1373 y Fs(\\e)630 | |
11204 | 1482 y(\\E)384 b Ft(escap)s(e)630 1636 y Fs(\\f)g Ft(form)30 | |
11205 | b(feed)630 1789 y Fs(\\n)384 b Ft(new)30 b(line)630 1943 | |
11206 | y Fs(\\r)384 b Ft(carriage)32 b(return)630 2096 y Fs(\\t)384 | |
11207 | b Ft(horizon)m(tal)32 b(tab)630 2250 y Fs(\\v)384 b Ft(v)m(ertical)32 | |
11208 | b(tab)630 2403 y Fs(\\\\)384 b Ft(bac)m(kslash)630 2556 | |
11209 | y Fs(\\0)p Fi(nnn)240 b Ft(the)32 b(eigh)m(t-bit)i(c)m(haracter)g | |
11210 | (whose)e(v)-5 b(alue)33 b(is)f(the)g(o)s(ctal)i(v)-5 | |
11211 | b(alue)32 b Fq(nnn)f Ft(\(zero)i(to)1110 2666 y(three)e(o)s(ctal)g | |
11212 | (digits\))630 2819 y Fs(\\x)p Fi(HH)288 b Ft(the)40 b(eigh)m(t-bit)h(c) | |
11213 | m(haracter)g(whose)e(v)-5 b(alue)39 b(is)h(the)f(hexadecimal)i(v)-5 | |
11214 | b(alue)40 b Fq(HH)1110 2929 y Ft(\(one)31 b(or)f(t)m(w)m(o)i(hex)e | |
11215 | (digits\))630 3082 y Fs(\\u)p Fi(HHHH)192 b Ft(the)41 | |
45c0f7f8 | 11216 | b(Unico)s(de)g(\(ISO/IEC)f(10646\))j(c)m(haracter)g(whose)e(v)-5 |
9f178efb | 11217 | b(alue)41 b(is)g(the)g(hex-)1110 3192 y(adecimal)32 b(v)-5 |
45c0f7f8 | 11218 | b(alue)31 b Fq(HHHH)41 b Ft(\(one)31 b(to)g(four)e(hex)h(digits\))630 |
9f178efb | 11219 | 3345 y Fs(\\U)p Fi(HHHHHHHH)1110 3455 y Ft(the)41 b(Unico)s(de)g |
45c0f7f8 | 11220 | (\(ISO/IEC)f(10646\))j(c)m(haracter)g(whose)e(v)-5 b(alue)41 |
9f178efb | 11221 | b(is)g(the)g(hex-)1110 3565 y(adecimal)32 b(v)-5 b(alue)31 |
45c0f7f8 | 11222 | b Fq(HHHHHHHH)41 b Ft(\(one)31 b(to)g(eigh)m(t)h(hex)e(digits\))150 |
9f178efb | 11223 | 3718 y Fs(enable)870 3850 y(enable)46 b([-a])h([-dnps])f([-f)g |
45c0f7f8 | 11224 | Fi(filename)11 b Fs(])45 b([)p Fi(name)57 b Fs(...)o(])630 |
9f178efb | 11225 | 3981 y Ft(Enable)36 b(and)f(disable)h(builtin)g(shell)g(commands.)56 |
9ec5ed66 | 11226 | b(Disabling)37 b(a)g(builtin)e(allo)m(ws)i(a)f(disk)630 |
9f178efb CR |
11227 | 4091 y(command)e(whic)m(h)g(has)g(the)g(same)h(name)f(as)h(a)f(shell)h |
11228 | (builtin)e(to)i(b)s(e)f(executed)h(without)630 4200 y(sp)s(ecifying)27 | |
9ec5ed66 | 11229 | b(a)g(full)g(pathname,)g(ev)m(en)h(though)f(the)g(shell)g(normally)g |
9f178efb | 11230 | (searc)m(hes)h(for)f(builtins)630 4310 y(b)s(efore)32 |
9ec5ed66 CR |
11231 | b(disk)f(commands.)46 b(If)31 b(`)p Fs(-n)p Ft(')h(is)g(used,)g(the)g |
11232 | Fq(name)5 b Ft(s)32 b(b)s(ecome)h(disabled.)45 b(Otherwise)630 | |
9f178efb | 11233 | 4419 y Fq(name)5 b Ft(s)44 b(are)h(enabled.)82 b(F)-8 |
9ec5ed66 | 11234 | b(or)45 b(example,)k(to)c(use)f(the)g Fs(test)f Ft(binary)h(found)f |
9f178efb | 11235 | (via)h Fs($PATH)630 4529 y Ft(instead)31 b(of)f(the)h(shell)f(builtin)g |
9ec5ed66 | 11236 | (v)m(ersion,)h(t)m(yp)s(e)g(`)p Fs(enable)e(-n)h(test)p |
9f178efb | 11237 | Ft('.)630 4661 y(If)42 b(the)h(`)p Fs(-p)p Ft(')f(option)h(is)f |
9ec5ed66 | 11238 | (supplied,)j(or)d(no)h Fq(name)k Ft(argumen)m(ts)c(app)s(ear,)i(a)e |
9f178efb | 11239 | (list)g(of)g(shell)630 4770 y(builtins)37 b(is)h(prin)m(ted.)63 |
9ec5ed66 | 11240 | b(With)38 b(no)f(other)h(argumen)m(ts,)j(the)d(list)g(consists)g(of)g |
9f178efb | 11241 | (all)h(enabled)630 4880 y(shell)33 b(builtins.)46 b(The)32 |
9ec5ed66 | 11242 | b(`)p Fs(-a)p Ft(')h(option)g(means)f(to)i(list)f(eac)m(h)h(builtin)e |
9f178efb CR |
11243 | (with)g(an)g(indication)i(of)630 4989 y(whether)c(or)g(not)h(it)g(is)f |
11244 | (enabled.)630 5121 y(The)40 b(`)p Fs(-f)p Ft(')g(option)g(means)g(to)h | |
9ec5ed66 | 11245 | (load)g(the)f(new)f(builtin)h(command)g Fq(name)45 b |
9f178efb | 11246 | Ft(from)40 b(shared)630 5230 y(ob)5 b(ject)26 b Fq(\014lename)5 |
9ec5ed66 | 11247 | b Ft(,)28 b(on)d(systems)h(that)g(supp)s(ort)e(dynamic)h(loading.)40 |
9f178efb | 11248 | b(The)25 b(`)p Fs(-d)p Ft(')h(option)g(will)630 5340 |
9ec5ed66 | 11249 | y(delete)32 b(a)e(builtin)g(loaded)h(with)f(`)p Fs(-f)p |
9f178efb CR |
11250 | Ft('.)p eop end |
11251 | %%Page: 53 59 | |
11252 | TeXDict begin 53 58 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
11253 | b(Shell)30 b(Builtin)h(Commands)2069 b(53)630 299 y(If)31 | |
11254 | b(there)g(are)g(no)g(options,)h(a)f(list)h(of)f(the)g(shell)g(builtins) | |
11255 | g(is)g(displa)m(y)m(ed.)43 b(The)31 b(`)p Fs(-s)p Ft(')f(option)630 | |
11256 | 408 y(restricts)f Fs(enable)e Ft(to)i(the)f Fl(posix)g | |
11257 | Ft(sp)s(ecial)h(builtins.)40 b(If)27 b(`)p Fs(-s)p Ft(')i(is)f(used)g | |
11258 | (with)g(`)p Fs(-f)p Ft(',)h(the)f(new)630 518 y(builtin)i(b)s(ecomes)h | |
11259 | (a)f(sp)s(ecial)h(builtin)f(\(see)i(Section)f(4.4)g([Sp)s(ecial)g | |
11260 | (Builtins],)g(page)g(67\).)630 650 y(The)26 b(return)f(status)h(is)g | |
11261 | (zero)h(unless)e(a)i Fq(name)k Ft(is)26 b(not)g(a)h(shell)f(builtin)g | |
11262 | (or)g(there)g(is)g(an)g(error)630 760 y(loading)31 b(a)g(new)f(builtin) | |
11263 | g(from)g(a)g(shared)g(ob)5 b(ject.)150 915 y Fs(help)870 | |
11264 | 1047 y(help)47 b([-dms])f([)p Fi(pattern)11 b Fs(])630 | |
11265 | 1179 y Ft(Displa)m(y)40 b(helpful)e(information)h(ab)s(out)g(builtin)f | |
11266 | (commands.)66 b(If)38 b Fq(pattern)h Ft(is)g(sp)s(eci\014ed,)630 | |
11267 | 1288 y Fs(help)28 b Ft(giv)m(es)i(detailed)g(help)e(on)h(all)h | |
11268 | (commands)e(matc)m(hing)i Fq(pattern)p Ft(,)g(otherwise)f(a)g(list)h | |
11269 | (of)630 1398 y(the)h(builtins)e(is)i(prin)m(ted.)630 | |
11270 | 1530 y(Options,)f(if)h(supplied,)e(ha)m(v)m(e)i(the)g(follo)m(wing)h | |
11271 | (meanings:)630 1685 y Fs(-d)384 b Ft(Displa)m(y)32 b(a)e(short)g | |
11272 | (description)h(of)f(eac)m(h)i Fq(pattern)630 1840 y Fs(-m)384 | |
11273 | b Ft(Displa)m(y)32 b(the)e(description)g(of)h(eac)m(h)h | |
11274 | Fq(pattern)e Ft(in)g(a)h(manpage-lik)m(e)h(format)630 | |
11275 | 1994 y Fs(-s)384 b Ft(Displa)m(y)32 b(only)e(a)h(short)f(usage)h | |
11276 | (synopsis)e(for)i(eac)m(h)g Fq(pattern)630 2149 y Ft(The)f(return)f | |
11277 | (status)i(is)f(zero)h(unless)f(no)g(command)h(matc)m(hes)g | |
11278 | Fq(pattern)p Ft(.)150 2304 y Fs(let)870 2436 y(let)47 | |
11279 | b Fi(expression)55 b Fs([)p Fi(expression)h Fs(...)o(])630 | |
11280 | 2568 y Ft(The)41 b Fs(let)g Ft(builtin)g(allo)m(ws)i(arithmetic)f(to)h | |
11281 | (b)s(e)d(p)s(erformed)g(on)i(shell)g(v)-5 b(ariables.)74 | |
11282 | b(Eac)m(h)630 2678 y Fq(expression)31 b Ft(is)g(ev)-5 | |
11283 | b(aluated)32 b(according)f(to)h(the)f(rules)g(giv)m(en)h(b)s(elo)m(w)f | |
11284 | (in)f(Section)i(6.5)g([Shell)630 2787 y(Arithmetic],)51 | |
11285 | b(page)46 b(86.)87 b(If)45 b(the)g(last)h Fq(expression)g | |
11286 | Ft(ev)-5 b(aluates)47 b(to)f(0,)k Fs(let)44 b Ft(returns)g(1;)630 | |
11287 | 2897 y(otherwise)31 b(0)g(is)f(returned.)150 3051 y Fs(local)870 | |
11288 | 3184 y(local)46 b([)p Fi(option)11 b Fs(])45 b Fi(name)11 | |
11289 | b Fs([=)p Fi(value)g Fs(])44 b(...)630 3316 y Ft(F)-8 | |
11290 | b(or)26 b(eac)m(h)h(argumen)m(t,)g(a)e(lo)s(cal)i(v)-5 | |
122f603c | 11291 | b(ariable)26 b(named)f Fq(name)31 b Ft(is)25 b(created,)j(and)d |
9f178efb | 11292 | (assigned)g Fq(v)-5 b(alue)5 b Ft(.)630 3425 y(The)37 |
122f603c CR |
11293 | b Fq(option)h Ft(can)f(b)s(e)g(an)m(y)h(of)f(the)h(options)g(accepted)g |
11294 | (b)m(y)g Fs(declare)p Ft(.)59 b Fs(local)36 b Ft(can)i(only)630 | |
9f178efb | 11295 | 3535 y(b)s(e)j(used)h(within)f(a)i(function;)48 b(it)42 |
122f603c | 11296 | b(mak)m(es)h(the)f(v)-5 b(ariable)43 b Fq(name)48 b Ft(ha)m(v)m(e)43 |
9f178efb | 11297 | b(a)f(visible)h(scop)s(e)630 3645 y(restricted)c(to)g(that)g(function)f |
122f603c | 11298 | (and)f(its)i(c)m(hildren.)64 b(The)38 b(return)f(status)h(is)h(zero)g |
9f178efb | 11299 | (unless)630 3754 y Fs(local)g Ft(is)h(used)g(outside)g(a)h(function,)h |
122f603c | 11300 | (an)e(in)m(v)-5 b(alid)41 b Fq(name)46 b Ft(is)40 b(supplied,)i(or)e |
9f178efb CR |
11301 | Fq(name)45 b Ft(is)c(a)630 3864 y(readonly)30 b(v)-5 |
11302 | b(ariable.)150 4018 y Fs(logout)870 4151 y(logout)46 | |
11303 | b([)p Fi(n)11 b Fs(])630 4283 y Ft(Exit)31 b(a)g(login)g(shell,)g | |
122f603c | 11304 | (returning)e(a)i(status)g(of)f Fq(n)g Ft(to)h(the)g(shell's)f(paren)m |
9f178efb | 11305 | (t.)150 4437 y Fs(mapfile)870 4570 y(mapfile)46 b([-n)h |
122f603c CR |
11306 | Fi(count)11 b Fs(])45 b([-O)i Fi(origin)11 b Fs(])46 |
11307 | b([-s)g Fi(count)11 b Fs(])46 b([-t])h([-u)g Fi(fd)11 | |
9f178efb | 11308 | b Fs(])1061 4679 y([-C)47 b Fi(callback)11 b Fs(])45 |
122f603c | 11309 | b([-c)i Fi(quantum)11 b Fs(])45 b([)p Fi(array)11 b Fs(])630 |
9f178efb | 11310 | 4811 y Ft(Read)37 b(lines)g(from)f(the)h(standard)f(input)g(in)m(to)h |
122f603c | 11311 | (the)g(indexed)f(arra)m(y)i(v)-5 b(ariable)37 b Fq(arra)m(y)8 |
9f178efb | 11312 | b Ft(,)39 b(or)630 4921 y(from)c(\014le)h(descriptor)g |
122f603c | 11313 | Fq(fd)j Ft(if)d(the)g(`)p Fs(-u)p Ft(')g(option)g(is)g(supplied.)56 |
e6062848 | 11314 | b(The)35 b(v)-5 b(ariable)37 b Fs(MAPFILE)d Ft(is)630 |
9f178efb | 11315 | 5031 y(the)d(default)f Fq(arra)m(y)8 b Ft(.)41 b(Options,)30 |
e6062848 | 11316 | b(if)h(supplied,)e(ha)m(v)m(e)j(the)e(follo)m(wing)i(meanings:)630 |
9f178efb | 11317 | 5185 y Fs(-n)384 b Ft(Cop)m(y)30 b(at)h(most)g Fq(coun)m(t)i |
e6062848 | 11318 | Ft(lines.)41 b(If)30 b Fq(coun)m(t)j Ft(is)d(0,)h(all)h(lines)e(are)h |
9f178efb | 11319 | (copied.)630 5340 y Fs(-O)384 b Ft(Begin)31 b(assigning)g(to)g |
e6062848 | 11320 | Fq(arra)m(y)39 b Ft(at)31 b(index)f Fq(origin)p Ft(.)41 |
9f178efb CR |
11321 | b(The)30 b(default)h(index)f(is)g(0.)p eop end |
11322 | %%Page: 54 60 | |
11323 | TeXDict begin 54 59 bop 150 -116 a Ft(54)2572 b(Bash)31 | |
11324 | b(Reference)g(Man)m(ual)630 299 y Fs(-s)384 b Ft(Discard)31 | |
11325 | b(the)f(\014rst)g Fq(coun)m(t)j Ft(lines)e(read.)630 | |
11326 | 451 y Fs(-t)384 b Ft(Remo)m(v)m(e)32 b(a)f(trailing)g(newline)g(from)f | |
11327 | (eac)m(h)h(line)g(read.)630 602 y Fs(-u)384 b Ft(Read)31 | |
6932f7f5 | 11328 | b(lines)f(from)g(\014le)h(descriptor)f Fq(fd)j Ft(instead)e(of)f(the)h |
9f178efb | 11329 | (standard)e(input.)630 754 y Fs(-C)384 b Ft(Ev)-5 b(aluate)43 |
6932f7f5 CR |
11330 | b Fq(callbac)m(k)49 b Ft(eac)m(h)42 b(time)g Fq(quan)m(tum)p |
11331 | Ft(P)f(lines)h(are)f(read.)74 b(The)41 b(`)p Fs(-c)p | |
9f178efb CR |
11332 | Ft(')1110 864 y(option)31 b(sp)s(eci\014es)f Fq(quan)m(tum)p |
11333 | Ft(.)630 1015 y Fs(-c)384 b Ft(Sp)s(ecify)30 b(the)g(n)m(um)m(b)s(er)f | |
11334 | (of)i(lines)f(read)h(b)s(et)m(w)m(een)g(eac)m(h)g(call)h(to)f | |
11335 | Fq(callbac)m(k)6 b Ft(.)630 1167 y(If)36 b(`)p Fs(-C)p | |
11336 | Ft(')g(is)h(sp)s(eci\014ed)f(without)g(`)p Fs(-c)p Ft(',)i(the)f | |
11337 | (default)f(quan)m(tum)g(is)h(5000.)61 b(When)36 b Fq(callbac)m(k)630 | |
11338 | 1277 y Ft(is)e(ev)-5 b(aluated,)36 b(it)f(is)f(supplied)f(the)h(index)f | |
11339 | (of)h(the)h(next)f(arra)m(y)g(elemen)m(t)i(to)e(b)s(e)g(assigned)630 | |
11340 | 1386 y(and)f(the)g(line)h(to)f(b)s(e)g(assigned)g(to)h(that)g(elemen)m | |
11341 | (t)h(as)e(additional)h(argumen)m(ts.)50 b Fq(callbac)m(k)630 | |
11342 | 1496 y Ft(is)30 b(ev)-5 b(aluated)32 b(after)f(the)f(line)h(is)g(read)f | |
11343 | (but)g(b)s(efore)f(the)i(arra)m(y)g(elemen)m(t)h(is)e(assigned.)630 | |
11344 | 1627 y(If)25 b(not)g(supplied)f(with)h(an)g(explicit)i(origin,)g | |
11345 | Fs(mapfile)c Ft(will)j(clear)g Fq(arra)m(y)34 b Ft(b)s(efore)24 | |
11346 | b(assigning)630 1736 y(to)31 b(it.)630 1867 y Fs(mapfile)41 | |
11347 | b Ft(returns)g(successfully)i(unless)e(an)i(in)m(v)-5 | |
11348 | b(alid)43 b(option)g(or)g(option)g(argumen)m(t)g(is)630 | |
11349 | 1976 y(supplied,)29 b Fq(arra)m(y)39 b Ft(is)30 b(in)m(v)-5 | |
11350 | b(alid)31 b(or)g(unassignable,)f(or)h Fq(arra)m(y)38 | |
11351 | b Ft(is)31 b(not)f(an)h(indexed)e(arra)m(y)-8 b(.)150 | |
11352 | 2128 y Fs(printf)870 2259 y(printf)46 b([-v)h Fi(var)11 | |
11353 | b Fs(])46 b Fi(format)57 b Fs([)p Fi(arguments)11 b Fs(])630 | |
11354 | 2390 y Ft(W)-8 b(rite)27 b(the)g(formatted)f Fq(argumen)m(ts)k | |
11355 | Ft(to)d(the)f(standard)f(output)h(under)e(the)i(con)m(trol)i(of)e(the) | |
11356 | 630 2499 y Fq(format)r Ft(.)57 b(The)35 b(`)p Fs(-v)p | |
11357 | Ft(')h(option)g(causes)g(the)g(output)g(to)g(b)s(e)f(assigned)h(to)h | |
11358 | (the)e(v)-5 b(ariable)37 b Fq(v)-5 b(ar)630 2609 y Ft(rather)30 | |
11359 | b(than)g(b)s(eing)g(prin)m(ted)g(to)h(the)g(standard)e(output.)630 | |
11360 | 2739 y(The)36 b Fq(format)i Ft(is)f(a)f(c)m(haracter)i(string)e(whic)m | |
11361 | (h)g(con)m(tains)i(three)e(t)m(yp)s(es)g(of)h(ob)5 b(jects:)53 | |
11362 | b(plain)630 2849 y(c)m(haracters,)41 b(whic)m(h)c(are)h(simply)e | |
11363 | (copied)i(to)g(standard)f(output,)i(c)m(haracter)g(escap)s(e)e(se-)630 | |
11364 | 2959 y(quences,)g(whic)m(h)f(are)g(con)m(v)m(erted)h(and)f(copied)g(to) | |
11365 | g(the)g(standard)f(output,)i(and)f(format)630 3068 y(sp)s | |
11366 | (eci\014cations,)i(eac)m(h)g(of)e(whic)m(h)g(causes)g(prin)m(ting)g(of) | |
11367 | g(the)h(next)f(successiv)m(e)h Fq(argumen)m(t)r Ft(.)630 | |
11368 | 3178 y(In)24 b(addition)h(to)g(the)g(standard)f Fs(printf\(1\))e | |
11369 | Ft(formats,)27 b Fs(printf)c Ft(in)m(terprets)i(the)f(follo)m(wing)630 | |
11370 | 3287 y(extensions:)630 3439 y Fs(\045b)384 b Ft(Causes)30 | |
11371 | b Fs(printf)e Ft(to)j(expand)f(bac)m(kslash)h(escap)s(e)f(sequences)h | |
11372 | (in)f(the)g(corre-)1110 3549 y(sp)s(onding)19 b Fq(argumen)m(t)r | |
11373 | Ft(,)k(except)f(that)f(`)p Fs(\\c)p Ft(')g(terminates)h(output,)g(bac)m | |
11374 | (kslashes)1110 3658 y(in)27 b(`)p Fs(\\')p Ft(',)h(`)p | |
11375 | Fs(\\")p Ft(',)g(and)f(`)p Fs(\\?)p Ft(')g(are)h(not)f(remo)m(v)m(ed,)j | |
11376 | (and)c(o)s(ctal)j(escap)s(es)f(b)s(eginning)1110 3768 | |
11377 | y(with)i(`)p Fs(\\0)p Ft(')g(ma)m(y)h(con)m(tain)h(up)d(to)i(four)f | |
11378 | (digits.)630 3920 y Fs(\045q)384 b Ft(Causes)32 b Fs(printf)e | |
11379 | Ft(to)i(output)g(the)g(corresp)s(onding)f Fq(argumen)m(t)j | |
11380 | Ft(in)d(a)i(format)1110 4029 y(that)e(can)g(b)s(e)e(reused)h(as)h | |
11381 | (shell)f(input.)630 4181 y Fs(\045\()p Fi(datefmt)11 | |
11382 | b Fs(\)T)1110 4290 y Ft(Causes)29 b Fs(printf)e Ft(to)j(output)f(the)g | |
11383 | (date-time)i(string)e(resulting)h(from)e(using)1110 4400 | |
11384 | y Fq(datefm)m(t)45 b Ft(as)d(a)g(format)g(string)g(for)g | |
9ec5ed66 | 11385 | Fs(strftime)p Ft(\(3\).)74 b(The)41 b(corresp)s(onding)1110 |
9f178efb CR |
11386 | 4510 y Fq(argumen)m(t)h Ft(is)e(an)g(in)m(teger)i(represen)m(ting)e |
11387 | (the)g(n)m(um)m(b)s(er)f(of)h(seconds)g(since)1110 4619 | |
9ec5ed66 CR |
11388 | y(the)24 b(ep)s(o)s(c)m(h.)38 b(Tw)m(o)24 b(sp)s(ecial)h(argumen)m(t)f |
11389 | (v)-5 b(alues)24 b(ma)m(y)h(b)s(e)e(used:)36 b(-1)25 | |
9f178efb | 11390 | b(represen)m(ts)1110 4729 y(the)30 b(curren)m(t)g(time,)h(and)e(-2)i |
9ec5ed66 | 11391 | (represen)m(ts)f(the)g(time)h(the)f(shell)g(w)m(as)g(in)m(v)m(ok)m(ed.) |
9f178efb | 11392 | 630 4881 y(Argumen)m(ts)e(to)h(non-string)e(format)i(sp)s(eci\014ers)e |
9ec5ed66 | 11393 | (are)h(treated)h(as)g(C)e(language)j(constan)m(ts,)630 |
9f178efb | 11394 | 4990 y(except)22 b(that)g(a)g(leading)g(plus)e(or)h(min)m(us)f(sign)i |
9ec5ed66 | 11395 | (is)f(allo)m(w)m(ed,)k(and)c(if)g(the)g(leading)h(c)m(haracter)h(is)630 |
9f178efb | 11396 | 5100 y(a)i(single)g(or)f(double)h(quote,)h(the)f(v)-5 |
220537f2 | 11397 | b(alue)25 b(is)f(the)h(ASCI)s(I)e(v)-5 b(alue)25 b(of)f(the)h(follo)m |
9f178efb | 11398 | (wing)h(c)m(haracter.)630 5230 y(The)31 b Fq(format)i |
220537f2 CR |
11399 | Ft(is)e(reused)f(as)i(necessary)f(to)h(consume)f(all)h(of)f(the)g |
11400 | Fq(argumen)m(ts)t Ft(.)43 b(If)31 b(the)g Fq(for-)630 | |
9f178efb CR |
11401 | 5340 y(mat)d Ft(requires)e(more)g Fq(argumen)m(ts)k Ft(than)25 |
11402 | b(are)i(supplied,)e(the)h(extra)h(format)f(sp)s(eci\014cations)p | |
11403 | eop end | |
11404 | %%Page: 55 61 | |
11405 | TeXDict begin 55 60 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
11406 | b(Shell)30 b(Builtin)h(Commands)2069 b(55)630 299 y(b)s(eha)m(v)m(e)29 | |
11407 | b(as)g(if)f(a)h(zero)g(v)-5 b(alue)29 b(or)g(n)m(ull)f(string,)h(as)g | |
11408 | (appropriate,)g(had)f(b)s(een)g(supplied.)38 b(The)630 | |
11409 | 408 y(return)29 b(v)-5 b(alue)31 b(is)g(zero)g(on)f(success,)h | |
11410 | (non-zero)g(on)f(failure.)150 564 y Fs(read)870 697 y(read)47 | |
11411 | b([-ers])f([-a)h Fi(aname)11 b Fs(])45 b([-d)i Fi(delim)11 | |
11412 | b Fs(])46 b([-i)h Fi(text)11 b Fs(])46 b([-n)g Fi(nchars)11 | |
11413 | b Fs(])1061 806 y([-N)47 b Fi(nchars)11 b Fs(])45 b([-p)i | |
11414 | Fi(prompt)11 b Fs(])45 b([-t)i Fi(timeout)11 b Fs(])45 | |
11415 | b([-u)i Fi(fd)11 b Fs(])47 b([)p Fi(name)57 b Fs(...)o(])630 | |
11416 | 939 y Ft(One)26 b(line)h(is)g(read)f(from)h(the)f(standard)g(input,)h | |
11417 | (or)g(from)f(the)h(\014le)f(descriptor)h Fq(fd)i Ft(supplied)630 | |
11418 | 1049 y(as)37 b(an)g(argumen)m(t)h(to)f(the)h(`)p Fs(-u)p | |
11419 | Ft(')e(option,)k(and)c(the)i(\014rst)e(w)m(ord)g(is)h(assigned)h(to)f | |
11420 | (the)h(\014rst)630 1158 y Fq(name)5 b Ft(,)28 b(the)g(second)g(w)m(ord) | |
11421 | f(to)h(the)f(second)h Fq(name)5 b Ft(,)28 b(and)f(so)h(on,)g(with)f | |
11422 | (lefto)m(v)m(er)j(w)m(ords)d(and)630 1268 y(their)h(in)m(terv)m(ening)g | |
11423 | (separators)g(assigned)g(to)h(the)e(last)i Fq(name)5 | |
11424 | b Ft(.)40 b(If)27 b(there)h(are)g(few)m(er)f(w)m(ords)630 | |
11425 | 1377 y(read)44 b(from)f(the)g(input)g(stream)h(than)g(names,)j(the)c | |
11426 | (remaining)h(names)g(are)g(assigned)630 1487 y(empt)m(y)31 | |
11427 | b(v)-5 b(alues.)41 b(The)30 b(c)m(haracters)i(in)e(the)h(v)-5 | |
eb0b2ad8 | 11428 | b(alue)31 b(of)g(the)f Fs(IFS)g Ft(v)-5 b(ariable)31 |
9f178efb | 11429 | b(are)g(used)f(to)h(split)630 1597 y(the)37 b(line)h(in)m(to)g(w)m |
eb0b2ad8 CR |
11430 | (ords.)61 b(The)36 b(bac)m(kslash)i(c)m(haracter)h(`)p |
11431 | Fs(\\)p Ft(')e(ma)m(y)h(b)s(e)f(used)f(to)i(remo)m(v)m(e)h(an)m(y)630 | |
9f178efb | 11432 | 1706 y(sp)s(ecial)h(meaning)g(for)f(the)g(next)h(c)m(haracter)h(read)e |
6932f7f5 | 11433 | (and)g(for)g(line)h(con)m(tin)m(uation.)69 b(If)39 b(no)630 |
9f178efb | 11434 | 1816 y(names)28 b(are)h(supplied,)f(the)g(line)h(read)g(is)f(assigned)h |
6932f7f5 | 11435 | (to)g(the)f(v)-5 b(ariable)29 b Fs(REPLY)p Ft(.)39 b(The)28 |
9f178efb | 11436 | b(return)630 1925 y(co)s(de)e(is)g(zero,)h(unless)e(end-of-\014le)h(is) |
220537f2 | 11437 | g(encoun)m(tered,)h Fs(read)e Ft(times)h(out)g(\(in)g(whic)m(h)f(case)i |
9f178efb | 11438 | (the)630 2035 y(return)g(co)s(de)h(is)g(greater)i(than)e(128\),)i(a)e |
45c0f7f8 | 11439 | (v)-5 b(ariable)29 b(assignmen)m(t)g(error)f(\(suc)m(h)g(as)g |
9f178efb | 11440 | (assigning)630 2145 y(to)38 b(a)f(readonly)g(v)-5 b(ariable\))38 |
45c0f7f8 | 11441 | b(o)s(ccurs,)h(or)e(an)g(in)m(v)-5 b(alid)38 b(\014le)f(descriptor)g |
9f178efb CR |
11442 | (is)g(supplied)e(as)j(the)630 2254 y(argumen)m(t)31 b(to)g(`)p |
11443 | Fs(-u)p Ft('.)630 2387 y(Options,)f(if)h(supplied,)e(ha)m(v)m(e)i(the)g | |
11444 | (follo)m(wing)h(meanings:)630 2543 y Fs(-a)e Fi(aname)114 | |
45c0f7f8 | 11445 | b Ft(The)34 b(w)m(ords)f(are)i(assigned)f(to)h(sequen)m(tial)h(indices) |
9f178efb | 11446 | e(of)g(the)g(arra)m(y)h(v)-5 b(ariable)1110 2652 y Fq(aname)5 |
45c0f7f8 | 11447 | b Ft(,)29 b(starting)g(at)f(0.)40 b(All)29 b(elemen)m(ts)g(are)f(remo)m |
9f178efb | 11448 | (v)m(ed)h(from)e Fq(aname)33 b Ft(b)s(efore)1110 2762 |
45c0f7f8 | 11449 | y(the)e(assignmen)m(t.)41 b(Other)30 b Fq(name)36 b Ft(argumen)m(ts)30 |
9f178efb | 11450 | b(are)h(ignored.)630 2917 y Fs(-d)f Fi(delim)114 b Ft(The)41 |
45c0f7f8 | 11451 | b(\014rst)h(c)m(haracter)h(of)f Fq(delim)g Ft(is)g(used)g(to)g |
9f178efb CR |
11452 | (terminate)h(the)f(input)f(line,)1110 3027 y(rather)30 |
11453 | b(than)g(newline.)630 3183 y Fs(-e)384 b Ft(Readline)46 | |
11454 | b(\(see)g(Chapter)e(8)h([Command)f(Line)h(Editing],)50 | |
11455 | b(page)45 b(101\))i(is)1110 3292 y(used)37 b(to)i(obtain)g(the)f(line.) | |
11456 | 65 b(Readline)39 b(uses)e(the)i(curren)m(t)f(\(or)g(default,)j(if)1110 | |
11457 | 3402 y(line)31 b(editing)g(w)m(as)f(not)h(previously)f(activ)m(e\))j | |
11458 | (editing)e(settings.)630 3558 y Fs(-i)f Fi(text)162 b | |
11459 | Ft(If)36 b(Readline)i(is)f(b)s(eing)g(used)f(to)h(read)g(the)g(line,)j | |
11460 | Fq(text)f Ft(is)e(placed)h(in)m(to)g(the)1110 3667 y(editing)31 | |
11461 | b(bu\013er)e(b)s(efore)h(editing)h(b)s(egins.)630 3823 | |
11462 | y Fs(-n)f Fi(nchars)1110 3933 y Fs(read)38 b Ft(returns)f(after)j | |
67362c60 | 11463 | (reading)f Fq(nc)m(hars)j Ft(c)m(haracters)e(rather)f(than)g(w)m |
9f178efb CR |
11464 | (aiting)1110 4042 y(for)g(a)h(complete)h(line)f(of)f(input,)i(but)e |
11465 | (honor)g(a)h(delimiter)g(if)f(few)m(er)h(than)1110 4152 | |
67362c60 | 11466 | y Fq(nc)m(hars)34 b Ft(c)m(haracters)e(are)e(read)h(b)s(efore)f(the)g |
9f178efb | 11467 | (delimiter.)630 4308 y Fs(-N)g Fi(nchars)1110 4417 y |
67362c60 CR |
11468 | Fs(read)39 b Ft(returns)f(after)j(reading)e(exactly)j |
11469 | Fq(nc)m(hars)h Ft(c)m(haracters)f(rather)d(than)1110 | |
9f178efb CR |
11470 | 4527 y(w)m(aiting)32 b(for)f(a)g(complete)i(line)e(of)g(input,)g |
11471 | (unless)f(EOF)h(is)g(encoun)m(tered)g(or)1110 4636 y | |
67362c60 | 11472 | Fs(read)f Ft(times)i(out.)43 b(Delimiter)33 b(c)m(haracters)f(encoun)m |
9f178efb | 11473 | (tered)g(in)f(the)g(input)g(are)1110 4746 y(not)g(treated)h(sp)s |
67362c60 | 11474 | (ecially)g(and)f(do)f(not)i(cause)f Fs(read)f Ft(to)i(return)e(un)m |
9f178efb CR |
11475 | (til)h Fq(nc)m(hars)1110 4855 y Ft(c)m(haracters)h(are)f(read.)630 |
11476 | 5011 y Fs(-p)f Fi(prompt)1110 5121 y Ft(Displa)m(y)38 | |
c302751c | 11477 | b Fq(prompt)r Ft(,)f(without)g(a)f(trailing)i(newline,)g(b)s(efore)e |
9f178efb | 11478 | (attempting)i(to)1110 5230 y(read)f(an)m(y)h(input.)60 |
a9fac3b2 | 11479 | b(The)37 b(prompt)g(is)g(displa)m(y)m(ed)h(only)f(if)g(input)g(is)g |
9f178efb CR |
11480 | (coming)1110 5340 y(from)30 b(a)h(terminal.)p eop end |
11481 | %%Page: 56 62 | |
11482 | TeXDict begin 56 61 bop 150 -116 a Ft(56)2572 b(Bash)31 | |
11483 | b(Reference)g(Man)m(ual)630 299 y Fs(-r)384 b Ft(If)21 | |
11484 | b(this)h(option)g(is)f(giv)m(en,)k(bac)m(kslash)d(do)s(es)f(not)h(act)h | |
11485 | (as)f(an)f(escap)s(e)h(c)m(haracter.)1110 408 y(The)30 | |
11486 | b(bac)m(kslash)i(is)f(considered)g(to)h(b)s(e)e(part)h(of)g(the)g | |
11487 | (line.)43 b(In)30 b(particular,)i(a)1110 518 y(bac)m(kslash-newline)f | |
11488 | (pair)f(ma)m(y)h(not)g(b)s(e)f(used)f(as)i(a)g(line)f(con)m(tin)m | |
11489 | (uation.)630 675 y Fs(-s)384 b Ft(Silen)m(t)28 b(mo)s(de.)40 | |
11490 | b(If)27 b(input)f(is)i(coming)g(from)f(a)h(terminal,)h(c)m(haracters)g | |
11491 | (are)f(not)1110 785 y(ec)m(ho)s(ed.)630 942 y Fs(-t)i | |
11492 | Fi(timeout)1110 1052 y Ft(Cause)23 b Fs(read)f Ft(to)i(time)f(out)h | |
11493 | (and)e(return)g(failure)h(if)g(a)h(complete)g(line)g(of)f(input)1110 | |
11494 | 1161 y(is)44 b(not)f(read)h(within)e Fq(timeout)47 b | |
11495 | Ft(seconds.)80 b Fq(timeout)46 b Ft(ma)m(y)e(b)s(e)f(a)h(decimal)1110 | |
11496 | 1271 y(n)m(um)m(b)s(er)26 b(with)h(a)h(fractional)h(p)s(ortion)d(follo) | |
11497 | m(wing)j(the)f(decimal)g(p)s(oin)m(t.)40 b(This)1110 | |
11498 | 1380 y(option)g(is)g(only)g(e\013ectiv)m(e)j(if)c Fs(read)g | |
11499 | Ft(is)h(reading)g(input)f(from)g(a)h(terminal,)1110 1490 | |
45c0f7f8 | 11500 | y(pip)s(e,)25 b(or)e(other)i(sp)s(ecial)f(\014le;)i(it)f(has)e(no)h |
9f178efb | 11501 | (e\013ect)h(when)e(reading)h(from)g(regular)1110 1600 |
122f603c CR |
11502 | y(\014les.)80 b(If)43 b Fq(timeout)j Ft(is)d(0,)48 b |
11503 | Fs(read)42 b Ft(returns)g(immediately)-8 b(,)48 b(without)c(trying)1110 | |
9f178efb CR |
11504 | 1709 y(to)i(read)f(and)f(data.)85 b(The)44 b(exit)i(status)g(is)f(0)g |
11505 | (if)g(input)f(is)h(a)m(v)-5 b(ailable)47 b(on)1110 1819 | |
122f603c | 11506 | y(the)32 b(sp)s(eci\014ed)f(\014le)h(descriptor,)g(non-zero)g |
9f178efb | 11507 | (otherwise.)45 b(The)31 b(exit)i(status)f(is)1110 1928 |
122f603c | 11508 | y(greater)g(than)e(128)h(if)g(the)f(timeout)i(is)e(exceeded.)630 |
9f178efb CR |
11509 | 2086 y Fs(-u)g Fi(fd)258 b Ft(Read)31 b(input)e(from)h(\014le)g |
11510 | (descriptor)h Fq(fd)t Ft(.)150 2243 y Fs(readarray)870 | |
11511 | 2352 y(readarray)45 b([-n)i Fi(count)11 b Fs(])46 b([-O)h | |
eb0b2ad8 | 11512 | Fi(origin)11 b Fs(])45 b([-s)i Fi(count)11 b Fs(])46 |
9f178efb | 11513 | b([-t])g([-u)h Fi(fd)11 b Fs(])1061 2462 y([-C)47 b Fi(callback)11 |
122f603c | 11514 | b Fs(])45 b([-c)i Fi(quantum)11 b Fs(])45 b([)p Fi(array)11 |
9f178efb | 11515 | b Fs(])630 2595 y Ft(Read)37 b(lines)g(from)f(the)h(standard)f(input)g |
122f603c | 11516 | (in)m(to)h(the)g(indexed)f(arra)m(y)i(v)-5 b(ariable)37 |
9f178efb | 11517 | b Fq(arra)m(y)8 b Ft(,)39 b(or)630 2705 y(from)30 b(\014le)g |
122f603c | 11518 | (descriptor)h Fq(fd)i Ft(if)d(the)h(`)p Fs(-u)p Ft(')f(option)h(is)f |
9f178efb CR |
11519 | (supplied.)630 2838 y(A)g(synon)m(ym)g(for)g Fs(mapfile)p |
11520 | Ft(.)150 2996 y Fs(source)870 3129 y(source)46 b Fi(filename)630 | |
11521 | 3263 y Ft(A)30 b(synon)m(ym)g(for)g Fs(.)g Ft(\(see)i(Section)f(4.1)g | |
11522 | ([Bourne)g(Shell)f(Builtins],)h(page)g(41\).)150 3420 | |
11523 | y Fs(type)870 3553 y(type)47 b([-afptP])e([)p Fi(name)57 | |
11524 | b Fs(...)o(])630 3687 y Ft(F)-8 b(or)41 b(eac)m(h)h Fq(name)5 | |
45c0f7f8 | 11525 | b Ft(,)44 b(indicate)e(ho)m(w)f(it)g(w)m(ould)f(b)s(e)g(in)m(terpreted) |
9f178efb | 11526 | h(if)g(used)f(as)h(a)g(command)630 3796 y(name.)630 3930 |
45c0f7f8 | 11527 | y(If)d(the)g(`)p Fs(-t)p Ft(')g(option)g(is)g(used,)i |
09767ff0 | 11528 | Fs(type)d Ft(prin)m(ts)g(a)i(single)f(w)m(ord)g(whic)m(h)g(is)g(one)g |
9f178efb | 11529 | (of)h(`)p Fs(alias)p Ft(',)630 4039 y(`)p Fs(function)p |
09767ff0 CR |
11530 | Ft(',)32 b(`)p Fs(builtin)p Ft(',)g(`)p Fs(file)p Ft(')g(or)h(`)p |
11531 | Fs(keyword)p Ft(',)f(if)h Fq(name)38 b Ft(is)33 b(an)f(alias,)j(shell)e | |
9f178efb | 11532 | (function,)630 4149 y(shell)i(builtin,)g(disk)g(\014le,)h(or)e(shell)h |
db31fb26 | 11533 | (reserv)m(ed)g(w)m(ord,)h(resp)s(ectiv)m(ely)-8 b(.)55 |
9f178efb | 11534 | b(If)34 b(the)h Fq(name)40 b Ft(is)35 b(not)630 4258 |
db31fb26 | 11535 | y(found,)29 b(then)h(nothing)h(is)f(prin)m(ted,)g(and)g |
9f178efb | 11536 | Fs(type)f Ft(returns)g(a)i(failure)g(status.)630 4392 |
67362c60 CR |
11537 | y(If)39 b(the)g(`)p Fs(-p)p Ft(')g(option)h(is)f(used,)i |
11538 | Fs(type)d Ft(either)h(returns)f(the)i(name)f(of)g(the)g(disk)g(\014le)g | |
9f178efb | 11539 | (that)630 4501 y(w)m(ould)30 b(b)s(e)g(executed,)h(or)g(nothing)f(if)g |
67362c60 | 11540 | (`)p Fs(-t)p Ft(')h(w)m(ould)f(not)g(return)g(`)p Fs(file)p |
9f178efb | 11541 | Ft('.)630 4635 y(The)23 b(`)p Fs(-P)p Ft(')g(option)h(forces)g(a)g |
67362c60 CR |
11542 | (path)f(searc)m(h)h(for)f(eac)m(h)h Fq(name)5 b Ft(,)26 |
11543 | b(ev)m(en)e(if)f(`)p Fs(-t)p Ft(')g(w)m(ould)g(not)h(return)630 | |
9f178efb | 11544 | 4744 y(`)p Fs(file)p Ft('.)630 4878 y(If)41 b(a)h(command)f(is)h |
122f603c | 11545 | (hashed,)i(`)p Fs(-p)p Ft(')d(and)g(`)p Fs(-P)p Ft(')g(prin)m(t)g(the)h |
9f178efb | 11546 | (hashed)f(v)-5 b(alue,)45 b(whic)m(h)c(is)h(not)630 4987 |
122f603c | 11547 | y(necessarily)31 b(the)g(\014le)f(that)h(app)s(ears)f(\014rst)g(in)g |
9f178efb | 11548 | Fs($PATH)p Ft(.)630 5121 y(If)36 b(the)h(`)p Fs(-a)p |
122f603c | 11549 | Ft(')g(option)g(is)g(used,)g Fs(type)f Ft(returns)f(all)j(of)f(the)g |
9f178efb | 11550 | (places)g(that)g(con)m(tain)h(an)f(exe-)630 5230 y(cutable)d(named)f |
122f603c CR |
11551 | Fq(\014le)5 b Ft(.)49 b(This)32 b(includes)h(aliases)i(and)d |
11552 | (functions,)i(if)f(and)f(only)i(if)f(the)g(`)p Fs(-p)p | |
9f178efb CR |
11553 | Ft(')630 5340 y(option)e(is)f(not)h(also)g(used.)p eop |
11554 | end | |
11555 | %%Page: 57 63 | |
11556 | TeXDict begin 57 62 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
11557 | b(Shell)30 b(Builtin)h(Commands)2069 b(57)630 299 y(If)26 | |
11558 | b(the)h(`)p Fs(-f)p Ft(')g(option)g(is)g(used,)g Fs(type)e | |
11559 | Ft(do)s(es)i(not)g(attempt)g(to)h(\014nd)d(shell)i(functions,)g(as)g | |
11560 | (with)630 408 y(the)k Fs(command)d Ft(builtin.)630 543 | |
11561 | y(The)j(return)f(status)h(is)g(zero)h(if)f(all)h(of)f(the)h | |
11562 | Fq(names)i Ft(are)e(found,)e(non-zero)i(if)f(an)m(y)g(are)h(not)630 | |
11563 | 652 y(found.)150 811 y Fs(typeset)870 945 y(typeset)46 | |
11564 | b([-afFgrxilnrtux])d([-p])k([)p Fi(name)11 b Fs([=)p | |
11565 | Fi(value)g Fs(])43 b(...)o(])630 1079 y Ft(The)31 b Fs(typeset)e | |
45c0f7f8 | 11566 | Ft(command)i(is)g(supplied)f(for)h(compatibilit)m(y)i(with)e(the)g |
9f178efb CR |
11567 | (Korn)f(shell.)44 b(It)31 b(is)630 1189 y(a)g(synon)m(ym)f(for)g(the)g |
11568 | Fs(declare)f Ft(builtin)h(command.)150 1348 y Fs(ulimit)870 | |
11569 | 1482 y(ulimit)46 b([-abcdefilmnpqrstuvxHST])41 b([)p | |
11570 | Fi(limit)11 b Fs(])630 1616 y(ulimit)25 b Ft(pro)m(vides)h(con)m(trol)i | |
11571 | (o)m(v)m(er)g(the)f(resources)f(a)m(v)-5 b(ailable)29 | |
11572 | b(to)e(pro)s(cesses)f(started)h(b)m(y)g(the)630 1726 | |
11573 | y(shell,)i(on)f(systems)g(that)h(allo)m(w)h(suc)m(h)e(con)m(trol.)41 | |
11574 | b(If)28 b(an)g(option)h(is)f(giv)m(en,)i(it)e(is)h(in)m(terpreted)630 | |
11575 | 1835 y(as)i(follo)m(ws:)630 1994 y Fs(-S)384 b Ft(Change)30 | |
11576 | b(and)g(rep)s(ort)g(the)g(soft)h(limit)g(asso)s(ciated)h(with)e(a)h | |
11577 | (resource.)630 2153 y Fs(-H)384 b Ft(Change)30 b(and)g(rep)s(ort)g(the) | |
11578 | g(hard)g(limit)h(asso)s(ciated)h(with)e(a)h(resource.)630 | |
11579 | 2312 y Fs(-a)384 b Ft(All)31 b(curren)m(t)f(limits)h(are)g(rep)s | |
11580 | (orted.)630 2471 y Fs(-b)384 b Ft(The)30 b(maxim)m(um)g(so)s(c)m(k)m | |
11581 | (et)i(bu\013er)e(size.)630 2629 y Fs(-c)384 b Ft(The)30 | |
11582 | b(maxim)m(um)g(size)h(of)g(core)g(\014les)f(created.)630 | |
11583 | 2788 y Fs(-d)384 b Ft(The)30 b(maxim)m(um)g(size)h(of)g(a)g(pro)s | |
11584 | (cess's)f(data)h(segmen)m(t.)630 2947 y Fs(-e)384 b Ft(The)30 | |
11585 | b(maxim)m(um)g(sc)m(heduling)h(priorit)m(y)f(\()p Fs(")p | |
11586 | Ft(nice)p Fs(")p Ft(\).)630 3106 y Fs(-f)384 b Ft(The)30 | |
11587 | b(maxim)m(um)g(size)h(of)g(\014les)f(written)h(b)m(y)f(the)g(shell)h | |
11588 | (and)f(its)h(c)m(hildren.)630 3264 y Fs(-i)384 b Ft(The)30 | |
11589 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(p)s(ending)e(signals.)630 | |
11590 | 3423 y Fs(-l)384 b Ft(The)30 b(maxim)m(um)g(size)h(that)g(ma)m(y)g(b)s | |
11591 | (e)f(lo)s(c)m(k)m(ed)i(in)m(to)f(memory)-8 b(.)630 3582 | |
11592 | y Fs(-m)384 b Ft(The)36 b(maxim)m(um)g(residen)m(t)h(set)g(size)g | |
11593 | (\(man)m(y)g(systems)f(do)h(not)f(honor)g(this)1110 3692 | |
11594 | y(limit\).)630 3850 y Fs(-n)384 b Ft(The)38 b(maxim)m(um)h(n)m(um)m(b)s | |
11595 | (er)e(of)i(op)s(en)f(\014le)h(descriptors)g(\(most)g(systems)g(do)1110 | |
11596 | 3960 y(not)31 b(allo)m(w)g(this)g(v)-5 b(alue)31 b(to)g(b)s(e)e(set\).) | |
11597 | 630 4119 y Fs(-p)384 b Ft(The)30 b(pip)s(e)f(bu\013er)h(size.)630 | |
11598 | 4278 y Fs(-q)384 b Ft(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(b)m | |
11599 | (ytes)g(in)f(POSIX)f(message)j(queues.)630 4436 y Fs(-r)384 | |
11600 | b Ft(The)30 b(maxim)m(um)g(real-time)i(sc)m(heduling)f(priorit)m(y)-8 | |
11601 | b(.)630 4595 y Fs(-s)384 b Ft(The)30 b(maxim)m(um)g(stac)m(k)i(size.) | |
11602 | 630 4754 y Fs(-t)384 b Ft(The)30 b(maxim)m(um)g(amoun)m(t)h(of)f(cpu)g | |
11603 | (time)h(in)f(seconds.)630 4913 y Fs(-u)384 b Ft(The)30 | |
11604 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(pro)s(cesses)f(a)m(v)-5 | |
11605 | b(ailable)33 b(to)e(a)f(single)i(user.)630 5072 y Fs(-v)384 | |
11606 | b Ft(The)41 b(maxim)m(um)h(amoun)m(t)g(of)h(virtual)f(memory)g(a)m(v)-5 | |
11607 | b(ailable)44 b(to)e(the)g(shell,)1110 5181 y(and,)30 | |
11608 | b(on)g(some)h(systems,)g(to)g(its)g(c)m(hildren.)630 | |
11609 | 5340 y Fs(-x)384 b Ft(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i | |
11610 | (\014le)f(lo)s(c)m(ks.)p eop end | |
11611 | %%Page: 58 64 | |
11612 | TeXDict begin 58 63 bop 150 -116 a Ft(58)2572 b(Bash)31 | |
11613 | b(Reference)g(Man)m(ual)630 299 y Fs(-T)384 b Ft(The)30 | |
11614 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(threads.)630 462 | |
122f603c CR |
11615 | y(If)i Fq(limit)k Ft(is)d(giv)m(en,)h(and)f(the)f(`)p |
11616 | Fs(-a)p Ft(')h(option)g(is)g(not)g(used,)g Fq(limit)j | |
9f178efb | 11617 | Ft(is)c(the)h(new)g(v)-5 b(alue)34 b(of)g(the)630 572 |
122f603c CR |
11618 | y(sp)s(eci\014ed)f(resource.)51 b(The)34 b(sp)s(ecial)g |
11619 | Fq(limit)j Ft(v)-5 b(alues)34 b Fs(hard)p Ft(,)g Fs(soft)p | |
9f178efb CR |
11620 | Ft(,)g(and)f Fs(unlimited)e Ft(stand)630 681 y(for)h(the)g(curren)m(t)g |
11621 | (hard)f(limit,)i(the)g(curren)m(t)f(soft)g(limit,)h(and)f(no)g(limit,)h | |
11622 | (resp)s(ectiv)m(ely)-8 b(.)48 b(A)630 791 y(hard)24 b(limit)i(cannot)g | |
11623 | (b)s(e)e(increased)h(b)m(y)g(a)h(non-ro)s(ot)f(user)f(once)i(it)g(is)f | |
11624 | (set;)j(a)d(soft)g(limit)h(ma)m(y)630 901 y(b)s(e)37 | |
11625 | b(increased)h(up)e(to)j(the)f(v)-5 b(alue)38 b(of)f(the)h(hard)f | |
11626 | (limit.)63 b(Otherwise,)39 b(the)f(curren)m(t)f(v)-5 | |
11627 | b(alue)630 1010 y(of)36 b(the)f(soft)h(limit)h(for)e(the)g(sp)s | |
11628 | (eci\014ed)g(resource)h(is)f(prin)m(ted,)i(unless)e(the)h(`)p | |
11629 | Fs(-H)p Ft(')f(option)h(is)630 1120 y(supplied.)j(When)28 | |
122f603c CR |
11630 | b(setting)h(new)f(limits,)h(if)f(neither)h(`)p Fs(-H)p |
11631 | Ft(')f(nor)f(`)p Fs(-S)p Ft(')h(is)h(supplied,)e(b)s(oth)h(the)630 | |
9f178efb | 11632 | 1229 y(hard)g(and)h(soft)h(limits)g(are)g(set.)41 b(If)29 |
122f603c | 11633 | b(no)g(option)h(is)f(giv)m(en,)i(then)e(`)p Fs(-f)p Ft(')h(is)f |
9f178efb | 11634 | (assumed.)40 b(V)-8 b(alues)630 1339 y(are)38 b(in)f(1024-b)m(yte)k |
122f603c CR |
11635 | (incremen)m(ts,)f(except)e(for)g(`)p Fs(-t)p Ft(',)h(whic)m(h)e(is)h |
11636 | (in)f(seconds;)42 b(`)p Fs(-p)p Ft(',)d(whic)m(h)630 | |
9f178efb CR |
11637 | 1449 y(is)33 b(in)f(units)g(of)h(512-b)m(yte)i(blo)s(c)m(ks;)g(and)d(`) |
11638 | p Fs(-T)p Ft(',)i(`)p Fs(-b)p Ft(',)f(`)p Fs(-n)p Ft(')g(and)f(`)p | |
11639 | Fs(-u)p Ft(',)h(whic)m(h)g(are)g(unscaled)630 1558 y(v)-5 | |
11640 | b(alues.)630 1695 y(The)34 b(return)g(status)h(is)f(zero)i(unless)e(an) | |
122f603c | 11641 | g(in)m(v)-5 b(alid)36 b(option)f(or)f(argumen)m(t)i(is)e(supplied,)h |
9f178efb CR |
11642 | (or)630 1804 y(an)30 b(error)g(o)s(ccurs)g(while)h(setting)g(a)g(new)f |
11643 | (limit.)150 1968 y Fs(unalias)870 2104 y(unalias)46 b([-a])g([)p | |
11644 | Fi(name)57 b Fs(...)47 b(])630 2241 y Ft(Remo)m(v)m(e)39 | |
eb0b2ad8 CR |
11645 | b(eac)m(h)f Fq(name)k Ft(from)36 b(the)h(list)h(of)f(aliases.)61 |
11646 | b(If)36 b(`)p Fs(-a)p Ft(')h(is)g(supplied,)h(all)f(aliases)i(are)630 | |
9f178efb CR |
11647 | 2350 y(remo)m(v)m(ed.)j(Aliases)31 b(are)g(describ)s(ed)e(in)h(Section) |
11648 | i(6.6)f([Aliases],)h(page)f(87.)150 2589 y Fr(4.3)68 | |
11649 | b(Mo)t(difying)45 b(Shell)g(Beha)l(vior)150 2813 y Fj(4.3.1)63 | |
11650 | b(The)41 b(Set)g(Builtin)150 2960 y Ft(This)35 b(builtin)h(is)g(so)g | |
45c0f7f8 | 11651 | (complicated)i(that)f(it)f(deserv)m(es)h(its)f(o)m(wn)g(section.)59 |
9ec5ed66 | 11652 | b Fs(set)35 b Ft(allo)m(ws)j(y)m(ou)e(to)h(c)m(hange)150 |
9f178efb | 11653 | 3069 y(the)c(v)-5 b(alues)34 b(of)f(shell)g(options)h(and)e(set)i(the)f |
9ec5ed66 | 11654 | (p)s(ositional)h(parameters,)h(or)e(to)h(displa)m(y)f(the)g(names)h |
9f178efb CR |
11655 | (and)150 3179 y(v)-5 b(alues)31 b(of)f(shell)h(v)-5 b(ariables.)150 |
11656 | 3344 y Fs(set)870 3481 y(set)47 b([--abefhkmnptuvxBCEHPT])41 | |
e05be32d | 11657 | b([-o)47 b Fi(option-name)11 b Fs(])44 b([)p Fi(argument)56 |
9f178efb | 11658 | b Fs(...)o(])870 3590 y(set)47 b([+abefhkmnptuvxBCEHPT])42 |
e05be32d | 11659 | b([+o)47 b Fi(option-name)11 b Fs(])43 b([)p Fi(argument)56 |
9f178efb | 11660 | b Fs(...)o(])630 3727 y Ft(If)22 b(no)h(options)g(or)g(argumen)m(ts)g |
54cdd75a | 11661 | (are)g(supplied,)g Fs(set)f Ft(displa)m(ys)g(the)h(names)g(and)f(v)-5 |
9f178efb | 11662 | b(alues)23 b(of)g(all)630 3837 y(shell)j(v)-5 b(ariables)27 |
54cdd75a | 11663 | b(and)e(functions,)h(sorted)g(according)h(to)g(the)f(curren)m(t)f(lo)s |
9f178efb | 11664 | (cale,)k(in)c(a)i(format)630 3946 y(that)i(ma)m(y)h(b)s(e)e(reused)g |
9ec5ed66 | 11665 | (as)h(input)f(for)h(setting)h(or)e(resetting)i(the)f(curren)m(tly-set)h |
9f178efb | 11666 | (v)-5 b(ariables.)630 4056 y(Read-only)37 b(v)-5 b(ariables)37 |
54cdd75a | 11667 | b(cannot)h(b)s(e)e(reset.)59 b(In)36 b Fl(posix)g Ft(mo)s(de,)i(only)f |
9f178efb CR |
11668 | (shell)f(v)-5 b(ariables)38 b(are)630 4165 y(listed.)630 |
11669 | 4302 y(When)29 b(options)g(are)g(supplied,)f(they)h(set)h(or)f(unset)f | |
54cdd75a | 11670 | (shell)h(attributes.)41 b(Options,)29 b(if)g(sp)s(ec-)630 |
9f178efb CR |
11671 | 4411 y(i\014ed,)h(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
11672 | 4575 y Fs(-a)384 b Ft(Mark)32 b(v)-5 b(ariables)33 b(and)e(function)h | |
67362c60 | 11673 | (whic)m(h)g(are)g(mo)s(di\014ed)f(or)h(created)h(for)f(ex-)1110 |
9f178efb CR |
11674 | 4684 y(p)s(ort)e(to)h(the)f(en)m(vironmen)m(t)h(of)g(subsequen)m(t)f |
11675 | (commands.)630 4848 y Fs(-b)384 b Ft(Cause)44 b(the)h(status)g(of)f | |
67362c60 | 11676 | (terminated)h(bac)m(kground)g(jobs)f(to)h(b)s(e)f(rep)s(orted)1110 |
9f178efb CR |
11677 | 4957 y(immediately)-8 b(,)30 b(rather)d(than)f(b)s(efore)h(prin)m(ting) |
11678 | g(the)g(next)g(primary)g(prompt.)630 5121 y Fs(-e)384 | |
67362c60 | 11679 | b Ft(Exit)65 b(immediately)g(if)f(a)h(pip)s(eline)e(\(see)i(Section)g |
9f178efb | 11680 | (3.2.2)h([Pip)s(elines],)1110 5230 y(page)56 b(8\),)62 |
67362c60 | 11681 | b(whic)m(h)55 b(ma)m(y)h(consist)f(of)h(a)f(single)h(simple)f(command)g |
9f178efb CR |
11682 | (\(see)1110 5340 y(Section)30 b(3.2.1)i([Simple)d(Commands],)g(page)h |
11683 | (8\),)h(a)f(list)g(\(see)h(Section)f(3.2.3)p eop end | |
11684 | %%Page: 59 65 | |
11685 | TeXDict begin 59 64 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
11686 | b(Shell)30 b(Builtin)h(Commands)2069 b(59)1110 299 y([Lists],)66 | |
11687 | b(page)59 b(9\),)67 b(or)58 b(a)h(comp)s(ound)e(command)h(\(see)h | |
11688 | (Section)g(3.2.4)1110 408 y([Comp)s(ound)67 b(Commands],)77 | |
11689 | b(page)69 b(9\))g(returns)e(a)i(non-zero)g(status.)1110 | |
11690 | 518 y(The)41 b(shell)g(do)s(es)g(not)g(exit)h(if)f(the)h(command)f | |
11691 | (that)h(fails)f(is)g(part)g(of)h(the)1110 628 y(command)g(list)h | |
122f603c | 11692 | (immediately)g(follo)m(wing)g(a)g Fs(while)e Ft(or)h |
9f178efb CR |
11693 | Fs(until)e Ft(k)m(eyw)m(ord,)1110 737 y(part)61 b(of)g(the)g(test)h(in) |
11694 | e(an)h Fs(if)f Ft(statemen)m(t,)71 b(part)61 b(of)g(an)m(y)g(command) | |
11695 | 1110 847 y(executed)50 b(in)e(a)h Fs(&&)f Ft(or)h Fs(||)f | |
11696 | Ft(list)h(except)g(the)g(command)g(follo)m(wing)h(the)1110 | |
11697 | 956 y(\014nal)37 b Fs(&&)g Ft(or)g Fs(||)p Ft(,)h(an)m(y)g(command)f | |
11698 | (in)g(a)g(pip)s(eline)g(but)g(the)g(last,)j(or)e(if)f(the)1110 | |
11699 | 1066 y(command's)c(return)f(status)h(is)g(b)s(eing)g(in)m(v)m(erted)h | |
11700 | (with)e Fs(!)p Ft(.)48 b(If)33 b(a)g(comp)s(ound)1110 | |
11701 | 1176 y(command)g(other)g(than)f(a)i(subshell)d(returns)h(a)h(non-zero)h | |
11702 | (status)f(b)s(ecause)1110 1285 y(a)g(command)f(failed)h(while)f(`)p | |
11703 | Fs(-e)p Ft(')h(w)m(as)f(b)s(eing)g(ignored,)h(the)g(shell)g(do)s(es)f | |
11704 | (not)1110 1395 y(exit.)42 b(A)30 b(trap)g(on)h Fs(ERR)p | |
11705 | Ft(,)e(if)i(set,)g(is)f(executed)i(b)s(efore)e(the)g(shell)h(exits.) | |
aaf6036e CR |
11706 | 1110 1532 y(This)f(option)h(applies)f(to)h(the)g(shell)g(en)m(vironmen) |
11707 | m(t)g(and)f(eac)m(h)h(subshell)f(en-)1110 1641 y(vironmen)m(t)j | |
9f178efb | 11708 | (separately)i(\(see)f(Section)g(3.7.3)h([Command)d(Execution)i(En-)1110 |
aaf6036e CR |
11709 | 1751 y(vironmen)m(t],)i(page)f(36\),)i(and)d(ma)m(y)h(cause)f |
11710 | (subshells)g(to)h(exit)g(b)s(efore)f(exe-)1110 1861 y(cuting)d(all)g | |
11711 | (the)g(commands)f(in)g(the)g(subshell.)1110 1998 y(If)c(a)g(shell)h | |
11712 | (function)e(executes)j(in)e(a)g(con)m(text)i(where)e(`)p | |
11713 | Fs(-e)p Ft(')g(is)g(b)s(eing)g(ignored,)1110 2107 y(ev)m(en)j(if)f(`)p | |
11714 | Fs(-e)p Ft(')g(is)g(set,)h(none)f(of)g(the)g(commands)g(executed)h | |
11715 | (within)e(the)i(func-)1110 2217 y(tion)38 b(b)s(o)s(dy)e(will)i(b)s(e)e | |
11716 | (a\013ected)j(b)m(y)f(the)f(`)p Fs(-e)p Ft(')h(setting.)63 | |
11717 | b(If)37 b(a)h(shell)f(function)1110 2326 y(sets)i(`)p | |
11718 | Fs(-e)p Ft(')f(while)h(executing)g(in)f(a)h(con)m(text)i(where)d(`)p | |
11719 | Fs(-e)p Ft(')g(is)g(ignored,)j(that)1110 2436 y(setting)35 | |
11720 | b(will)f(not)g(ha)m(v)m(e)h(an)m(y)f(e\013ect)h(un)m(til)f(the)g | |
11721 | (command)f(con)m(taining)j(the)1110 2545 y(function)30 | |
11722 | b(call)i(completes.)630 2710 y Fs(-f)384 b Ft(Disable)31 | |
11723 | b(\014lename)g(expansion)f(\(globbing\).)630 2874 y Fs(-h)384 | |
11724 | b Ft(Lo)s(cate)33 b(and)e(remem)m(b)s(er)h(\(hash\))g(commands)f(as)h | |
11725 | (they)g(are)g(lo)s(ok)m(ed)h(up)e(for)1110 2984 y(execution.)42 | |
11726 | b(This)29 b(option)i(is)g(enabled)f(b)m(y)g(default.)630 | |
11727 | 3148 y Fs(-k)384 b Ft(All)34 b(argumen)m(ts)g(in)f(the)h(form)f(of)g | |
11728 | (assignmen)m(t)h(statemen)m(ts)i(are)d(placed)h(in)1110 | |
11729 | 3258 y(the)k(en)m(vironmen)m(t)g(for)g(a)g(command,)h(not)f(just)f | |
11730 | (those)i(that)f(precede)g(the)1110 3367 y(command)30 | |
11731 | b(name.)630 3532 y Fs(-m)384 b Ft(Job)32 b(con)m(trol)h(is)f(enabled)g | |
9f178efb | 11732 | (\(see)h(Chapter)f(7)g([Job)g(Con)m(trol],)i(page)e(97\).)47 |
aaf6036e | 11733 | b(All)1110 3641 y(pro)s(cesses)27 b(run)f(in)i(a)g(separate)g(pro)s |
45c0f7f8 | 11734 | (cess)f(group.)40 b(When)27 b(a)h(bac)m(kground)f(job)1110 |
aaf6036e CR |
11735 | 3751 y(completes,)32 b(the)f(shell)f(prin)m(ts)g(a)h(line)f(con)m |
11736 | (taining)i(its)f(exit)g(status.)630 3915 y Fs(-n)384 | |
45c0f7f8 | 11737 | b Ft(Read)21 b(commands)f(but)g(do)h(not)g(execute)h(them;)i(this)d(ma) |
aaf6036e | 11738 | m(y)g(b)s(e)f(used)g(to)h(c)m(hec)m(k)1110 4025 y(a)42 |
45c0f7f8 | 11739 | b(script)g(for)g(syn)m(tax)g(errors.)75 b(This)41 b(option)h(is)g |
aaf6036e CR |
11740 | (ignored)g(b)m(y)g(in)m(teractiv)m(e)1110 4134 y(shells.)630 |
11741 | 4299 y Fs(-o)30 b Fi(option-name)1110 4408 y Ft(Set)h(the)f(option)h | |
45c0f7f8 | 11742 | (corresp)s(onding)e(to)i Fq(option-name)5 b Ft(:)1110 |
aaf6036e CR |
11743 | 4573 y Fs(allexport)1590 4682 y Ft(Same)30 b(as)h Fs(-a)p |
11744 | Ft(.)1110 4847 y Fs(braceexpand)1590 4956 y Ft(Same)f(as)h | |
11745 | Fs(-B)p Ft(.)1110 5121 y Fs(emacs)240 b Ft(Use)25 b(an)f | |
45c0f7f8 | 11746 | Fs(emacs)p Ft(-st)m(yle)h(line)f(editing)h(in)m(terface)h(\(see)g |
aaf6036e CR |
11747 | (Chapter)e(8)1590 5230 y([Command)33 b(Line)g(Editing],)h(page)h |
11748 | (101\).)51 b(This)32 b(also)i(a\013ects)1590 5340 y(the)d(editing)g(in) | |
11749 | m(terface)h(used)d(for)h Fs(read)f(-e)p Ft(.)p eop end | |
9f178efb CR |
11750 | %%Page: 60 66 |
11751 | TeXDict begin 60 65 bop 150 -116 a Ft(60)2572 b(Bash)31 | |
aaf6036e CR |
11752 | b(Reference)g(Man)m(ual)1110 299 y Fs(errexit)144 b Ft(Same)30 |
11753 | b(as)h Fs(-e)p Ft(.)1110 461 y Fs(errtrace)96 b Ft(Same)30 | |
11754 | b(as)h Fs(-E)p Ft(.)1110 622 y Fs(functrace)1590 732 | |
11755 | y Ft(Same)f(as)h Fs(-T)p Ft(.)1110 894 y Fs(hashall)144 | |
11756 | b Ft(Same)30 b(as)h Fs(-h)p Ft(.)1110 1056 y Fs(histexpand)1590 | |
11757 | 1165 y Ft(Same)f(as)h Fs(-H)p Ft(.)1110 1327 y Fs(history)144 | |
9f178efb | 11758 | b Ft(Enable)39 b(command)g(history)-8 b(,)42 b(as)d(describ)s(ed)f(in)h |
aaf6036e CR |
11759 | (Section)h(9.1)1590 1437 y([Bash)d(History)g(F)-8 b(acilities],)41 |
11760 | b(page)c(133.)60 b(This)36 b(option)h(is)f(on)1590 1546 | |
9f178efb | 11761 | y(b)m(y)30 b(default)h(in)f(in)m(teractiv)m(e)j(shells.)1110 |
aaf6036e CR |
11762 | 1708 y Fs(ignoreeof)1590 1817 y Ft(An)d(in)m(teractiv)m(e)j(shell)e |
11763 | (will)g(not)f(exit)h(up)s(on)e(reading)i(EOF.)1110 1979 | |
9f178efb | 11764 | y Fs(keyword)144 b Ft(Same)30 b(as)h Fs(-k)p Ft(.)1110 |
aaf6036e CR |
11765 | 2141 y Fs(monitor)144 b Ft(Same)30 b(as)h Fs(-m)p Ft(.)1110 |
11766 | 2303 y Fs(noclobber)1590 2412 y Ft(Same)f(as)h Fs(-C)p | |
11767 | Ft(.)1110 2574 y Fs(noexec)192 b Ft(Same)30 b(as)h Fs(-n)p | |
11768 | Ft(.)1110 2736 y Fs(noglob)192 b Ft(Same)30 b(as)h Fs(-f)p | |
11769 | Ft(.)1110 2898 y Fs(nolog)240 b Ft(Curren)m(tly)30 b(ignored.)1110 | |
11770 | 3059 y Fs(notify)192 b Ft(Same)30 b(as)h Fs(-b)p Ft(.)1110 | |
11771 | 3221 y Fs(nounset)144 b Ft(Same)30 b(as)h Fs(-u)p Ft(.)1110 | |
11772 | 3383 y Fs(onecmd)192 b Ft(Same)30 b(as)h Fs(-t)p Ft(.)1110 | |
11773 | 3545 y Fs(physical)96 b Ft(Same)30 b(as)h Fs(-P)p Ft(.)1110 | |
11774 | 3707 y Fs(pipefail)96 b Ft(If)44 b(set,)k(the)d(return)e(v)-5 | |
9f178efb | 11775 | b(alue)45 b(of)f(a)h(pip)s(eline)e(is)i(the)f(v)-5 b(alue)45 |
aaf6036e CR |
11776 | b(of)1590 3816 y(the)33 b(last)h(\(righ)m(tmost\))h(command)e(to)h |
11777 | (exit)g(with)f(a)g(non-zero)1590 3926 y(status,)28 b(or)f(zero)g(if)f | |
9f178efb | 11778 | (all)i(commands)e(in)g(the)h(pip)s(eline)f(exit)i(suc-)1590 |
aaf6036e CR |
11779 | 4035 y(cessfully)-8 b(.)41 b(This)30 b(option)h(is)f(disabled)g(b)m(y)h |
11780 | (default.)1110 4197 y Fs(posix)240 b Ft(Change)30 b(the)g(b)s(eha)m | |
9f178efb | 11781 | (vior)h(of)f(Bash)g(where)g(the)g(default)h(op)s(era-)1590 |
aaf6036e CR |
11782 | 4307 y(tion)25 b(di\013ers)f(from)g(the)h Fl(posix)f |
11783 | Ft(standard)f(to)i(matc)m(h)h(the)f(stan-)1590 4416 y(dard)32 | |
9f178efb | 11784 | b(\(see)i(Section)g(6.11)h([Bash)e(POSIX)f(Mo)s(de],)j(page)e(92\).) |
aaf6036e CR |
11785 | 1590 4526 y(This)k(is)g(in)m(tended)g(to)h(mak)m(e)g(Bash)g(b)s(eha)m |
11786 | (v)m(e)g(as)g(a)f(strict)h(su-)1590 4635 y(p)s(erset)30 | |
11787 | b(of)h(that)f(standard.)1110 4797 y Fs(privileged)1590 | |
11788 | 4907 y Ft(Same)g(as)h Fs(-p)p Ft(.)1110 5069 y Fs(verbose)144 | |
11789 | b Ft(Same)30 b(as)h Fs(-v)p Ft(.)1110 5230 y Fs(vi)384 | |
9f178efb | 11790 | b Ft(Use)36 b(a)g Fs(vi)p Ft(-st)m(yle)g(line)g(editing)g(in)m |
aaf6036e | 11791 | (terface.)58 b(This)35 b(also)h(a\013ects)1590 5340 y(the)31 |
9f178efb | 11792 | b(editing)g(in)m(terface)h(used)d(for)h Fs(read)f(-e)p |
aaf6036e | 11793 | Ft(.)p eop end |
9f178efb CR |
11794 | %%Page: 61 67 |
11795 | TeXDict begin 61 66 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
aaf6036e CR |
11796 | b(Shell)30 b(Builtin)h(Commands)2069 b(61)1110 299 y |
11797 | Fs(xtrace)192 b Ft(Same)30 b(as)h Fs(-x)p Ft(.)630 458 | |
11798 | y Fs(-p)384 b Ft(T)-8 b(urn)33 b(on)h(privileged)h(mo)s(de.)51 | |
11799 | b(In)34 b(this)g(mo)s(de,)h(the)f Fs($BASH_ENV)e Ft(and)h | |
11800 | Fs($ENV)1110 568 y Ft(\014les)23 b(are)h(not)f(pro)s(cessed,)h(shell)g | |
11801 | (functions)e(are)i(not)f(inherited)g(from)f(the)i(en-)1110 | |
11802 | 677 y(vironmen)m(t,)h(and)e(the)g Fs(SHELLOPTS)p Ft(,)f | |
11803 | Fs(BASHOPTS)p Ft(,)h Fs(CDPATH)e Ft(and)i Fs(GLOBIGNORE)1110 | |
11804 | 787 y Ft(v)-5 b(ariables,)23 b(if)e(they)g(app)s(ear)f(in)g(the)h(en)m | |
11805 | (vironmen)m(t,)i(are)e(ignored.)38 b(If)20 b(the)h(shell)1110 | |
11806 | 897 y(is)37 b(started)h(with)f(the)g(e\013ectiv)m(e)j(user)d(\(group\)) | |
11807 | g(id)g(not)g(equal)h(to)g(the)f(real)1110 1006 y(user)d(\(group\))g | |
11808 | (id,)i(and)e(the)g(`)p Fs(-p)p Ft(')g(option)h(is)g(not)f(supplied,)h | |
11809 | (these)g(actions)1110 1116 y(are)d(tak)m(en)i(and)d(the)h(e\013ectiv)m | |
11810 | (e)j(user)c(id)h(is)g(set)h(to)f(the)h(real)f(user)g(id.)45 | |
11811 | b(If)32 b(the)1110 1225 y(`)p Fs(-p)p Ft(')e(option)i(is)e(supplied)g | |
122f603c | 11812 | (at)h(startup,)f(the)h(e\013ectiv)m(e)i(user)d(id)h(is)f(not)h(reset.) |
aaf6036e | 11813 | 1110 1335 y(T)-8 b(urning)35 b(this)i(option)g(o\013)g(causes)g(the)g |
9ec5ed66 | 11814 | (e\013ectiv)m(e)i(user)d(and)g(group)g(ids)g(to)1110 |
aaf6036e CR |
11815 | 1445 y(b)s(e)30 b(set)h(to)g(the)f(real)h(user)f(and)g(group)g(ids.)630 |
11816 | 1604 y Fs(-t)384 b Ft(Exit)31 b(after)g(reading)f(and)g(executing)h | |
11817 | (one)g(command.)630 1763 y Fs(-u)384 b Ft(T)-8 b(reat)25 | |
11818 | b(unset)e(v)-5 b(ariables)25 b(and)e(parameters)h(other)h(than)e(the)h | |
11819 | (sp)s(ecial)h(param-)1110 1873 y(eters)35 b(`)p Fs(@)p | |
11820 | Ft(')f(or)g(`)p Fs(*)p Ft(')h(as)f(an)g(error)g(when)f(p)s(erforming)g | |
11821 | (parameter)i(expansion.)1110 1983 y(An)28 b(error)h(message)g(will)g(b) | |
11822 | s(e)f(written)h(to)h(the)e(standard)g(error,)h(and)f(a)h(non-)1110 | |
11823 | 2092 y(in)m(teractiv)m(e)k(shell)e(will)g(exit.)630 2252 | |
9f178efb | 11824 | y Fs(-v)384 b Ft(Prin)m(t)30 b(shell)h(input)e(lines)i(as)g(they)f(are) |
aaf6036e | 11825 | h(read.)630 2411 y Fs(-x)384 b Ft(Prin)m(t)21 b(a)h(trace)h(of)f |
9f178efb | 11826 | (simple)f(commands,)i Fs(for)e Ft(commands,)i Fs(case)d |
aaf6036e | 11827 | Ft(commands,)1110 2521 y Fs(select)29 b Ft(commands,)j(and)e |
9ec5ed66 | 11828 | (arithmetic)j Fs(for)d Ft(commands)h(and)f(their)i(argu-)1110 |
aaf6036e CR |
11829 | 2630 y(men)m(ts)h(or)f(asso)s(ciated)i(w)m(ord)e(lists)h(after)g(they)f |
11830 | (are)h(expanded)f(and)f(b)s(efore)1110 2740 y(they)i(are)g(executed.)49 | |
eb0b2ad8 | 11831 | b(The)32 b(v)-5 b(alue)33 b(of)g(the)g Fs(PS4)f Ft(v)-5 |
aaf6036e | 11832 | b(ariable)34 b(is)f(expanded)f(and)1110 2849 y(the)24 |
eb0b2ad8 | 11833 | b(resultan)m(t)h(v)-5 b(alue)24 b(is)g(prin)m(ted)g(b)s(efore)f(the)h |
aaf6036e CR |
11834 | (command)g(and)f(its)i(expanded)1110 2959 y(argumen)m(ts.)630 |
11835 | 3118 y Fs(-B)384 b Ft(The)41 b(shell)g(will)g(p)s(erform)f(brace)h | |
11836 | (expansion)g(\(see)h(Section)g(3.5.1)g([Brace)1110 3228 | |
9f178efb | 11837 | y(Expansion],)30 b(page)h(21\).)42 b(This)30 b(option)h(is)f(on)g(b)m |
aaf6036e | 11838 | (y)h(default.)630 3387 y Fs(-C)384 b Ft(Prev)m(en)m(t)25 |
45c0f7f8 CR |
11839 | b(output)e(redirection)h(using)f(`)p Fs(>)p Ft(',)i(`)p |
11840 | Fs(>&)p Ft(',)g(and)e(`)p Fs(<>)p Ft(')g(from)h(o)m(v)m(erwriting)1110 | |
aaf6036e | 11841 | 3497 y(existing)31 b(\014les.)630 3656 y Fs(-E)384 b |
45c0f7f8 | 11842 | Ft(If)39 b(set,)j(an)m(y)e(trap)f(on)g Fs(ERR)g Ft(is)g(inherited)g(b)m |
aaf6036e | 11843 | (y)g(shell)h(functions,)h(command)1110 3766 y(substitutions,)35 |
45c0f7f8 | 11844 | b(and)e(commands)g(executed)i(in)f(a)g(subshell)f(en)m(vironmen)m(t.) |
aaf6036e CR |
11845 | 1110 3875 y(The)d Fs(ERR)f Ft(trap)i(is)f(normally)h(not)f(inherited)g |
11846 | (in)g(suc)m(h)g(cases.)630 4035 y Fs(-H)384 b Ft(Enable)38 | |
45c0f7f8 | 11847 | b(`)p Fs(!)p Ft(')h(st)m(yle)h(history)e(substitution)g(\(see)h |
aaf6036e | 11848 | (Section)h(9.3)f([History)g(In-)1110 4144 y(teraction],)g(page)d |
9f178efb | 11849 | (135\).)57 b(This)34 b(option)i(is)f(on)g(b)m(y)h(default)f(for)g(in)m |
aaf6036e | 11850 | (teractiv)m(e)1110 4254 y(shells.)630 4413 y Fs(-P)384 |
45c0f7f8 | 11851 | b Ft(If)39 b(set,)j(do)d(not)g(resolv)m(e)i(sym)m(b)s(olic)e(links)g |
aaf6036e | 11852 | (when)f(p)s(erforming)g(commands)1110 4523 y(suc)m(h)29 |
45c0f7f8 | 11853 | b(as)h Fs(cd)f Ft(whic)m(h)g(c)m(hange)h(the)g(curren)m(t)f(directory) |
aaf6036e | 11854 | -8 b(.)42 b(The)28 b(ph)m(ysical)j(direc-)1110 4633 y(tory)j(is)g(used) |
45c0f7f8 | 11855 | f(instead.)52 b(By)34 b(default,)h(Bash)f(follo)m(ws)h(the)f(logical)i |
aaf6036e | 11856 | (c)m(hain)f(of)1110 4742 y(directories)j(when)d(p)s(erforming)h |
45c0f7f8 | 11857 | (commands)g(whic)m(h)g(c)m(hange)i(the)f(curren)m(t)1110 |
aaf6036e | 11858 | 4852 y(directory)-8 b(.)1110 4986 y(F)g(or)31 b(example,)g(if)f(`)p |
45c0f7f8 | 11859 | Fs(/usr/sys)p Ft(')e(is)i(a)g(sym)m(b)s(olic)h(link)f(to)g(`)p |
aaf6036e CR |
11860 | Fs(/usr/local/sys)p Ft(')1110 5096 y(then:)1350 5230 |
11861 | y Fs($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 5340 y(/usr/sys)p | |
122f603c | 11862 | eop end |
9f178efb CR |
11863 | %%Page: 62 68 |
11864 | TeXDict begin 62 67 bop 150 -116 a Ft(62)2572 b(Bash)31 | |
aaf6036e CR |
11865 | b(Reference)g(Man)m(ual)1350 299 y Fs($)47 b(cd)h(..;)f(pwd)1350 |
11866 | 408 y(/usr)1110 540 y Ft(If)30 b Fs(set)f(-P)h Ft(is)h(on,)f(then:)1350 | |
11867 | 672 y Fs($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 782 | |
11868 | y(/usr/local/sys)1350 891 y($)g(cd)h(..;)f(pwd)1350 1001 | |
11869 | y(/usr/local)630 1155 y(-T)384 b Ft(If)34 b(set,)j(an)m(y)e(trap)g(on)g | |
11870 | Fs(DEBUG)e Ft(and)i Fs(RETURN)e Ft(are)i(inherited)g(b)m(y)f(shell)i | |
11871 | (func-)1110 1265 y(tions,)k(command)d(substitutions,)h(and)f(commands)g | |
11872 | (executed)h(in)f(a)h(sub-)1110 1374 y(shell)33 b(en)m(vironmen)m(t.)49 | |
11873 | b(The)32 b Fs(DEBUG)g Ft(and)g Fs(RETURN)f Ft(traps)h(are)i(normally)f | |
11874 | (not)1110 1484 y(inherited)d(in)g(suc)m(h)g(cases.)630 | |
11875 | 1638 y Fs(--)384 b Ft(If)31 b(no)h(argumen)m(ts)f(follo)m(w)i(this)f | |
11876 | (option,)g(then)f(the)h(p)s(ositional)h(parameters)1110 | |
11877 | 1748 y(are)h(unset.)49 b(Otherwise,)34 b(the)g(p)s(ositional)g | |
11878 | (parameters)g(are)g(set)g(to)g(the)g Fq(ar-)1110 1857 | |
11879 | y(gumen)m(ts)t Ft(,)d(ev)m(en)g(if)f(some)h(of)f(them)h(b)s(egin)f | |
11880 | (with)g(a)g(`)p Fs(-)p Ft('.)630 2012 y Fs(-)432 b Ft(Signal)45 | |
11881 | b(the)g(end)f(of)h(options,)k(cause)c(all)h(remaining)e | |
11882 | Fq(argumen)m(ts)49 b Ft(to)d(b)s(e)1110 2121 y(assigned)38 | |
11883 | b(to)h(the)f(p)s(ositional)h(parameters.)65 b(The)37 | |
11884 | b(`)p Fs(-x)p Ft(')h(and)g(`)p Fs(-v)p Ft(')g(options)1110 | |
11885 | 2231 y(are)25 b(turned)e(o\013.)40 b(If)24 b(there)h(are)g(no)f | |
9f178efb | 11886 | (argumen)m(ts,)i(the)f(p)s(ositional)h(parameters)1110 |
aaf6036e | 11887 | 2340 y(remain)k(unc)m(hanged.)630 2495 y(Using)d(`)p |
9f178efb CR |
11888 | Fs(+)p Ft(')h(rather)f(than)g(`)p Fs(-)p Ft(')g(causes)h(these)f |
11889 | (options)h(to)g(b)s(e)e(turned)g(o\013.)40 b(The)27 b(options)h(can)630 | |
aaf6036e | 11890 | 2604 y(also)36 b(b)s(e)f(used)f(up)s(on)g(in)m(v)m(o)s(cation)j(of)e |
9f178efb | 11891 | (the)g(shell.)56 b(The)34 b(curren)m(t)h(set)h(of)f(options)h(ma)m(y)g |
aaf6036e | 11892 | (b)s(e)630 2714 y(found)29 b(in)h Fs($-)p Ft(.)630 2846 |
9f178efb | 11893 | y(The)43 b(remaining)h(N)f Fq(argumen)m(ts)48 b Ft(are)c(p)s(ositional) |
aaf6036e | 11894 | g(parameters)g(and)f(are)h(assigned,)j(in)630 2955 y(order,)30 |
ed35cb4a CR |
11895 | b(to)h Fs($1)p Ft(,)f Fs($2)p Ft(,)36 b(.)22 b(.)g(.)42 |
11896 | b Fs($N)p Ft(.)e(The)30 b(sp)s(ecial)h(parameter)g Fs(#)f | |
aaf6036e | 11897 | Ft(is)g(set)h(to)g(N.)630 3087 y(The)f(return)f(status)i(is)f(alw)m(a)m |
ed35cb4a | 11898 | (ys)i(zero)f(unless)f(an)g(in)m(v)-5 b(alid)31 b(option)g(is)f |
aaf6036e CR |
11899 | (supplied.)150 3281 y Fj(4.3.2)63 b(The)41 b(Shopt)h(Builtin)150 |
11900 | 3428 y Ft(This)30 b(builtin)g(allo)m(ws)h(y)m(ou)g(to)g(c)m(hange)h | |
45c0f7f8 | 11901 | (additional)f(shell)f(optional)i(b)s(eha)m(vior.)150 |
aaf6036e CR |
11902 | 3583 y Fs(shopt)870 3714 y(shopt)46 b([-pqsu])g([-o])h([)p |
11903 | Fi(optname)56 b Fs(...)o(])630 3846 y Ft(T)-8 b(oggle)47 | |
ed35cb4a CR |
11904 | b(the)d(v)-5 b(alues)45 b(of)g(v)-5 b(ariables)45 b(con)m(trolling)i |
11905 | (optional)f(shell)e(b)s(eha)m(vior.)84 b(With)45 b(no)630 | |
aaf6036e | 11906 | 3956 y(options,)32 b(or)f(with)g(the)g(`)p Fs(-p)p Ft(')g(option,)h(a)g |
ed35cb4a | 11907 | (list)f(of)h(all)g(settable)g(options)g(is)f(displa)m(y)m(ed,)h(with) |
aaf6036e | 11908 | 630 4066 y(an)i(indication)i(of)f(whether)f(or)g(not)h(eac)m(h)h(is)e |
ed35cb4a | 11909 | (set.)54 b(The)34 b(`)p Fs(-p)p Ft(')h(option)g(causes)g(output)f(to) |
aaf6036e | 11910 | 630 4175 y(b)s(e)i(displa)m(y)m(ed)h(in)e(a)i(form)f(that)h(ma)m(y)g(b) |
122f603c | 11911 | s(e)e(reused)h(as)g(input.)58 b(Other)36 b(options)g(ha)m(v)m(e)i(the) |
aaf6036e | 11912 | 630 4285 y(follo)m(wing)32 b(meanings:)630 4439 y Fs(-s)384 |
c302751c | 11913 | b Ft(Enable)30 b(\(set\))i(eac)m(h)f Fq(optname)5 b Ft(.)630 |
aaf6036e CR |
11914 | 4593 y Fs(-u)384 b Ft(Disable)31 b(\(unset\))g(eac)m(h)h |
11915 | Fq(optname)5 b Ft(.)630 4747 y Fs(-q)384 b Ft(Suppresses)28 | |
67362c60 | 11916 | b(normal)h(output;)h(the)g(return)e(status)i(indicates)h(whether)e(the) |
aaf6036e | 11917 | 1110 4857 y Fq(optname)37 b Ft(is)31 b(set)h(or)f(unset.)43 |
67362c60 | 11918 | b(If)31 b(m)m(ultiple)h Fq(optname)37 b Ft(argumen)m(ts)31 |
aaf6036e | 11919 | b(are)h(giv)m(en)1110 4967 y(with)43 b(`)p Fs(-q)p Ft(',)j(the)d |
9ec5ed66 | 11920 | (return)f(status)h(is)g(zero)h(if)f(all)g Fq(optnames)k |
aaf6036e CR |
11921 | Ft(are)d(enabled;)1110 5076 y(non-zero)31 b(otherwise.)630 |
11922 | 5230 y Fs(-o)384 b Ft(Restricts)28 b(the)g(v)-5 b(alues)28 | |
9ec5ed66 | 11923 | b(of)f Fq(optname)33 b Ft(to)c(b)s(e)d(those)i(de\014ned)f(for)g(the)g |
aaf6036e | 11924 | (`)p Fs(-o)p Ft(')h(op-)1110 5340 y(tion)23 b(to)h(the)f |
9ec5ed66 | 11925 | Fs(set)f Ft(builtin)h(\(see)g(Section)h(4.3.1)h([The)d(Set)i(Builtin],) |
aaf6036e | 11926 | h(page)e(58\).)p eop end |
9f178efb CR |
11927 | %%Page: 63 69 |
11928 | TeXDict begin 63 68 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
aaf6036e CR |
11929 | b(Shell)30 b(Builtin)h(Commands)2069 b(63)630 299 y(If)40 |
11930 | b(either)g(`)p Fs(-s)p Ft(')g(or)g(`)p Fs(-u)p Ft(')g(is)g(used)g(with) | |
11931 | g(no)g Fq(optname)45 b Ft(argumen)m(ts,)e Fs(shopt)c | |
11932 | Ft(sho)m(ws)h(only)630 408 y(those)31 b(options)g(whic)m(h)f(are)g(set) | |
11933 | h(or)g(unset,)f(resp)s(ectiv)m(ely)-8 b(.)630 553 y(Unless)30 | |
11934 | b(otherwise)h(noted,)g(the)g Fs(shopt)d Ft(options)j(are)g(disabled)f | |
11935 | (\(o\013)7 b(\))32 b(b)m(y)e(default.)630 697 y(The)d(return)f(status)i | |
11936 | (when)f(listing)h(options)g(is)f(zero)i(if)e(all)i Fq(optnames)i | |
11937 | Ft(are)d(enabled,)g(non-)630 806 y(zero)40 b(otherwise.)66 | |
11938 | b(When)39 b(setting)h(or)f(unsetting)g(options,)i(the)e(return)f | |
11939 | (status)h(is)g(zero)630 916 y(unless)30 b(an)g Fq(optname)36 | |
11940 | b Ft(is)30 b(not)h(a)g(v)-5 b(alid)30 b(shell)h(option.)630 | |
11941 | 1060 y(The)f(list)h(of)f Fs(shopt)f Ft(options)i(is:)630 | |
11942 | 1239 y Fs(autocd)192 b Ft(If)27 b(set,)h(a)g(command)f(name)g(that)h | |
11943 | (is)f(the)g(name)g(of)h(a)f(directory)h(is)f(executed)1110 | |
11944 | 1349 y(as)j(if)f(it)h(w)m(ere)f(the)h(argumen)m(t)g(to)g(the)f | |
11945 | Fs(cd)g Ft(command.)40 b(This)29 b(option)g(is)h(only)1110 | |
11946 | 1458 y(used)g(b)m(y)g(in)m(teractiv)m(e)j(shells.)630 | |
11947 | 1637 y Fs(cdable_vars)1110 1747 y Ft(If)h(this)h(is)g(set,)i(an)e | |
11948 | (argumen)m(t)g(to)h(the)f Fs(cd)f Ft(builtin)h(command)f(that)i(is)f | |
11949 | (not)1110 1856 y(a)c(directory)g(is)g(assumed)f(to)h(b)s(e)f(the)h | |
9f178efb | 11950 | (name)f(of)h(a)g(v)-5 b(ariable)31 b(whose)g(v)-5 b(alue)31 |
aaf6036e CR |
11951 | b(is)1110 1966 y(the)g(directory)f(to)i(c)m(hange)f(to.)630 |
11952 | 2145 y Fs(cdspell)144 b Ft(If)27 b(set,)h(minor)f(errors)f(in)h(the)g | |
9f178efb | 11953 | (sp)s(elling)h(of)f(a)g(directory)h(comp)s(onen)m(t)f(in)g(a)h |
aaf6036e | 11954 | Fs(cd)1110 2254 y Ft(command)i(will)h(b)s(e)f(corrected.)43 |
9f178efb | 11955 | b(The)30 b(errors)g(c)m(hec)m(k)m(ed)j(for)d(are)h(transp)s(osed)1110 |
aaf6036e | 11956 | 2364 y(c)m(haracters,)46 b(a)c(missing)f(c)m(haracter,)47 |
8e1a6eaa | 11957 | b(and)40 b(a)i(c)m(haracter)h(to)s(o)g(man)m(y)-8 b(.)74 |
aaf6036e CR |
11958 | b(If)42 b(a)1110 2473 y(correction)25 b(is)e(found,)g(the)h(corrected)g |
11959 | (path)f(is)g(prin)m(ted,)h(and)f(the)g(command)1110 2583 | |
220537f2 | 11960 | y(pro)s(ceeds.)40 b(This)30 b(option)h(is)f(only)h(used)e(b)m(y)h(in)m |
aaf6036e CR |
11961 | (teractiv)m(e)k(shells.)630 2762 y Fs(checkhash)1110 |
11962 | 2871 y Ft(If)29 b(this)h(is)g(set,)g(Bash)g(c)m(hec)m(ks)h(that)g(a)f | |
11963 | (command)f(found)g(in)g(the)h(hash)f(table)1110 2981 | |
220537f2 | 11964 | y(exists)k(b)s(efore)f(trying)h(to)h(execute)g(it.)48 |
aaf6036e | 11965 | b(If)32 b(a)h(hashed)e(command)i(no)f(longer)1110 3091 |
45c0f7f8 | 11966 | y(exists,)f(a)g(normal)f(path)g(searc)m(h)h(is)g(p)s(erformed.)630 |
aaf6036e | 11967 | 3269 y Fs(checkjobs)1110 3379 y Ft(If)d(set,)i(Bash)e(lists)h(the)g |
45c0f7f8 | 11968 | (status)g(of)f(an)m(y)h(stopp)s(ed)f(and)g(running)e(jobs)i(b)s(efore) |
aaf6036e | 11969 | 1110 3488 y(exiting)42 b(an)f(in)m(teractiv)m(e)j(shell.)72 |
45c0f7f8 | 11970 | b(If)41 b(an)m(y)g(jobs)f(are)i(running,)g(this)f(causes)1110 |
aaf6036e CR |
11971 | 3598 y(the)30 b(exit)g(to)g(b)s(e)f(deferred)g(un)m(til)h(a)f(second)h |
11972 | (exit)g(is)g(attempted)h(without)e(an)1110 3708 y(in)m(terv)m(ening)j | |
9f178efb | 11973 | (command)e(\(see)h(Chapter)f(7)h([Job)f(Con)m(trol],)i(page)f(97\).)42 |
aaf6036e CR |
11974 | b(The)1110 3817 y(shell)31 b(alw)m(a)m(ys)g(p)s(ostp)s(ones)f(exiting)h |
11975 | (if)g(an)m(y)f(jobs)g(are)h(stopp)s(ed.)630 3996 y Fs(checkwinsize)1110 | |
11976 | 4106 y Ft(If)41 b(set,)k(Bash)c(c)m(hec)m(ks)i(the)f(windo)m(w)e(size)j | |
11977 | (after)f(eac)m(h)g(command)f(and,)j(if)1110 4215 y(necessary)-8 | |
122f603c | 11978 | b(,)31 b(up)s(dates)f(the)g(v)-5 b(alues)31 b(of)g Fs(LINES)e |
aaf6036e | 11979 | Ft(and)g Fs(COLUMNS)p Ft(.)630 4394 y Fs(cmdhist)144 |
122f603c | 11980 | b Ft(If)33 b(set,)j(Bash)e(attempts)h(to)g(sa)m(v)m(e)g(all)g(lines)f |
aaf6036e | 11981 | (of)g(a)h(m)m(ultiple-line)g(command)1110 4504 y(in)c(the)g(same)g |
122f603c | 11982 | (history)g(en)m(try)-8 b(.)42 b(This)30 b(allo)m(ws)i(easy)g |
aaf6036e CR |
11983 | (re-editing)g(of)f(m)m(ulti-line)1110 4613 y(commands.)630 |
11984 | 4792 y Fs(compat31)96 b Ft(If)27 b(set,)i(Bash)e(c)m(hanges)i(its)f(b)s | |
122f603c | 11985 | (eha)m(vior)f(to)i(that)f(of)f(v)m(ersion)h(3.1)h(with)e(resp)s(ect) |
aaf6036e CR |
11986 | 1110 4902 y(to)39 b(quoted)f(argumen)m(ts)g(to)h(the)f(conditional)h |
11987 | (command's)f(`)p Fs(=~)p Ft(')g(op)s(erator)1110 5011 | |
abe2eb5b | 11988 | y(and)i(with)f(resp)s(ect)i(to)g(lo)s(cale-sp)s(eci\014c)h(string)e |
aaf6036e | 11989 | (comparison)g(when)f(using)1110 5121 y(the)25 b(`)p Fs([[)p |
abe2eb5b CR |
11990 | Ft(')f(conditional)h(command's)g(`)p Fs(<)p Ft(')f(and)g(`)p |
11991 | Fs(>)p Ft(')g(op)s(erators.)39 b(Bash)25 b(v)m(ersions)1110 | |
aaf6036e CR |
11992 | 5230 y(prior)31 b(to)h(bash-4.1)g(use)g(ASCI)s(I)e(collation)j(and)e |
11993 | (strcmp\(3\);)i(bash-4.1)g(and)1110 5340 y(later)e(use)f(the)h(curren)m | |
11994 | (t)f(lo)s(cale's)i(collation)h(sequence)e(and)f(strcoll\(3\).)p | |
9f178efb CR |
11995 | eop end |
11996 | %%Page: 64 70 | |
11997 | TeXDict begin 64 69 bop 150 -116 a Ft(64)2572 b(Bash)31 | |
aaf6036e CR |
11998 | b(Reference)g(Man)m(ual)630 299 y Fs(compat32)96 b Ft(If)27 |
11999 | b(set,)i(Bash)e(c)m(hanges)i(its)f(b)s(eha)m(vior)f(to)i(that)f(of)f(v) | |
12000 | m(ersion)h(3.2)h(with)e(resp)s(ect)1110 408 y(to)h(lo)s(cale-sp)s | |
12001 | (eci\014c)g(string)f(comparison)g(when)f(using)g(the)h(`)p | |
12002 | Fs([[)p Ft(')g(conditional)1110 518 y(command's)j(`)p | |
12003 | Fs(<)p Ft(')h(and)f(`)p Fs(>)p Ft(')g(op)s(erators)h(\(see)g(previous)f | |
12004 | (item\).)630 669 y Fs(compat40)96 b Ft(If)27 b(set,)i(Bash)e(c)m | |
12005 | (hanges)i(its)f(b)s(eha)m(vior)f(to)i(that)f(of)f(v)m(ersion)h(4.0)h | |
12006 | (with)e(resp)s(ect)1110 778 y(to)h(lo)s(cale-sp)s(eci\014c)g(string)f | |
12007 | (comparison)g(when)f(using)g(the)h(`)p Fs([[)p Ft(')g(conditional)1110 | |
12008 | 888 y(command's)h(`)p Fs(<)p Ft(')h(and)f(`)p Fs(>)p | |
12009 | Ft(')h(op)s(erators)f(\(see)i(description)e(of)h Fs(compat31)p | |
12010 | Ft(\))e(and)1110 998 y(the)38 b(e\013ect)i(of)e(in)m(terrupting)f(a)i | |
12011 | (command)e(list.)64 b(Bash)38 b(v)m(ersions)h(4.0)g(and)1110 | |
12012 | 1107 y(later)24 b(in)m(terrupt)f(the)g(list)h(as)g(if)f(the)h(shell)f | |
12013 | (receiv)m(ed)i(the)e(in)m(terrupt;)i(previous)1110 1217 | |
12014 | y(v)m(ersions)31 b(con)m(tin)m(ue)g(with)f(the)h(next)g(command)f(in)g | |
12015 | (the)g(list.)630 1367 y Fs(compat41)96 b Ft(If)27 b(set,)i(Bash,)g | |
12016 | (when)e(in)g(p)s(osix)g(mo)s(de,)h(treats)h(a)f(single)g(quote)h(in)e | |
12017 | (a)h(double-)1110 1477 y(quoted)46 b(parameter)h(expansion)f(as)g(a)h | |
12018 | (sp)s(ecial)f(c)m(haracter.)90 b(The)45 b(single)1110 | |
12019 | 1587 y(quotes)34 b(m)m(ust)g(matc)m(h)h(\(an)f(ev)m(en)h(n)m(um)m(b)s | |
12020 | (er\))e(and)g(the)h(c)m(haracters)h(b)s(et)m(w)m(een)1110 | |
12021 | 1696 y(the)40 b(single)g(quotes)g(are)g(considered)g(quoted.)69 | |
12022 | b(This)38 b(is)i(the)g(b)s(eha)m(vior)g(of)1110 1806 | |
12023 | y Fl(posix)f Ft(mo)s(de)g(through)g(v)m(ersion)h(4.1.)69 | |
abe2eb5b | 12024 | b(The)39 b(default)g(Bash)h(b)s(eha)m(vior)g(re-)1110 |
aaf6036e CR |
12025 | 1915 y(mains)30 b(as)h(in)f(previous)g(v)m(ersions.)630 |
12026 | 2066 y Fs(complete_fullquote)1110 2176 y Ft(If)h(set,)g(Bash)h(quotes)f | |
abe2eb5b | 12027 | (all)h(shell)f(metac)m(haracters)i(in)e(\014lenames)g(and)g(direc-)1110 |
aaf6036e CR |
12028 | 2285 y(tory)g(names)f(when)g(p)s(erforming)f(completion.)43 |
12029 | b(If)30 b(not)h(set,)g(Bash)g(remo)m(v)m(es)1110 2395 | |
abe2eb5b | 12030 | y(metac)m(haracters)40 b(suc)m(h)d(as)h(the)g(dollar)g(sign)g(from)f |
aaf6036e | 12031 | (the)h(set)g(of)f(c)m(haracters)1110 2504 y(that)f(will)g(b)s(e)f |
abe2eb5b | 12032 | (quoted)g(in)g(completed)i(\014lenames)e(when)f(these)i(metac)m(har-) |
aaf6036e | 12033 | 1110 2614 y(acters)29 b(app)s(ear)e(in)g(shell)h(v)-5 |
abe2eb5b | 12034 | b(ariable)28 b(references)g(in)f(w)m(ords)g(to)i(b)s(e)e(completed.) |
aaf6036e | 12035 | 1110 2724 y(This)k(means)i(that)g(dollar)f(signs)g(in)g(v)-5 |
122f603c | 12036 | b(ariable)33 b(names)g(that)f(expand)g(to)h(di-)1110 |
aaf6036e CR |
12037 | 2833 y(rectories)28 b(will)g(not)f(b)s(e)f(quoted;)j(ho)m(w)m(ev)m(er,) |
12038 | g(an)m(y)e(dollar)h(signs)f(app)s(earing)f(in)1110 2943 | |
122f603c CR |
12039 | y(\014lenames)j(will)h(not)f(b)s(e)g(quoted,)h(either.)41 |
12040 | b(This)28 b(is)i(activ)m(e)h(only)e(when)g(bash)1110 | |
aaf6036e CR |
12041 | 3052 y(is)39 b(using)f(bac)m(kslashes)i(to)g(quote)g(completed)f |
12042 | (\014lenames.)67 b(This)38 b(v)-5 b(ariable)1110 3162 | |
122f603c | 12043 | y(is)41 b(set)g(b)m(y)g(default,)j(whic)m(h)c(is)h(the)g(default)g |
aaf6036e CR |
12044 | (Bash)g(b)s(eha)m(vior)g(in)g(v)m(ersions)1110 3271 y(through)30 |
12045 | b(4.2.)630 3422 y Fs(direxpand)1110 3532 y Ft(If)k(set,)i(Bash)f | |
122f603c | 12046 | (replaces)g(directory)g(names)g(with)f(the)g(results)h(of)f(w)m(ord)g |
aaf6036e CR |
12047 | (ex-)1110 3641 y(pansion)k(when)g(p)s(erforming)f(\014lename)i |
12048 | (completion.)67 b(This)38 b(c)m(hanges)i(the)1110 3751 | |
45c0f7f8 | 12049 | y(con)m(ten)m(ts)29 b(of)e(the)g(readline)h(editing)g(bu\013er.)38 |
aaf6036e | 12050 | b(If)27 b(not)g(set,)i(Bash)e(attempts)h(to)1110 3861 |
45c0f7f8 | 12051 | y(preserv)m(e)j(what)f(the)g(user)g(t)m(yp)s(ed.)630 |
aaf6036e | 12052 | 4011 y Fs(dirspell)96 b Ft(If)26 b(set,)i(Bash)f(attempts)g(sp)s |
45c0f7f8 | 12053 | (elling)g(correction)g(on)g(directory)g(names)f(during)1110 |
aaf6036e CR |
12054 | 4121 y(w)m(ord)36 b(completion)h(if)f(the)g(directory)g(name)g |
12055 | (initially)h(supplied)e(do)s(es)h(not)1110 4230 y(exist.)630 | |
12056 | 4381 y Fs(dotglob)144 b Ft(If)27 b(set,)i(Bash)f(includes)g | |
45c0f7f8 | 12057 | (\014lenames)g(b)s(eginning)f(with)g(a)h(`.')41 b(in)27 |
aaf6036e CR |
12058 | b(the)h(results)g(of)1110 4491 y(\014lename)j(expansion.)630 |
12059 | 4641 y Fs(execfail)96 b Ft(If)24 b(this)h(is)f(set,)j(a)e(non-in)m | |
45c0f7f8 | 12060 | (teractiv)m(e)i(shell)e(will)f(not)h(exit)h(if)e(it)h(cannot)h(execute) |
aaf6036e | 12061 | 1110 4751 y(the)i(\014le)g(sp)s(eci\014ed)g(as)g(an)g(argumen)m(t)g(to) |
45c0f7f8 | 12062 | h(the)f Fs(exec)f Ft(builtin)h(command.)39 b(An)1110 |
aaf6036e CR |
12063 | 4861 y(in)m(teractiv)m(e)33 b(shell)e(do)s(es)f(not)g(exit)i(if)e |
12064 | Fs(exec)f Ft(fails.)630 5011 y Fs(expand_aliases)1110 | |
12065 | 5121 y Ft(If)j(set,)h(aliases)g(are)g(expanded)e(as)h(describ)s(ed)f(b) | |
12066 | s(elo)m(w)h(under)f(Aliases,)i(Sec-)1110 5230 y(tion)38 | |
9f178efb | 12067 | b(6.6)h([Aliases],)j(page)d(87.)64 b(This)37 b(option)h(is)g(enabled)g |
aaf6036e CR |
12068 | (b)m(y)g(default)g(for)1110 5340 y(in)m(teractiv)m(e)33 |
12069 | b(shells.)p eop end | |
9f178efb CR |
12070 | %%Page: 65 71 |
12071 | TeXDict begin 65 70 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
aaf6036e CR |
12072 | b(Shell)30 b(Builtin)h(Commands)2069 b(65)630 299 y Fs(extdebug)96 |
12073 | b Ft(If)30 b(set,)h(b)s(eha)m(vior)g(in)m(tended)f(for)g(use)g(b)m(y)g | |
12074 | (debuggers)g(is)h(enabled:)1159 433 y(1.)61 b(The)32 | |
12075 | b(`)p Fs(-F)p Ft(')g(option)h(to)g(the)g Fs(declare)d | |
12076 | Ft(builtin)i(\(see)i(Section)f(4.2)h([Bash)1290 542 y(Builtins],)29 | |
12077 | b(page)g(48\))g(displa)m(ys)f(the)g(source)h(\014le)f(name)g(and)f | |
12078 | (line)h(n)m(um-)1290 652 y(b)s(er)h(corresp)s(onding)g(to)i(eac)m(h)g | |
12079 | (function)f(name)g(supplied)f(as)i(an)f(argu-)1290 762 | |
12080 | y(men)m(t.)1159 896 y(2.)61 b(If)20 b(the)h(command)g(run)e(b)m(y)i | |
12081 | (the)f Fs(DEBUG)g Ft(trap)g(returns)g(a)h(non-zero)g(v)-5 | |
12082 | b(alue,)1290 1005 y(the)31 b(next)f(command)g(is)h(skipp)s(ed)e(and)g | |
12083 | (not)i(executed.)1159 1139 y(3.)61 b(If)37 b(the)g(command)g(run)f(b)m | |
12084 | (y)i(the)f Fs(DEBUG)f Ft(trap)h(returns)f(a)i(v)-5 b(alue)38 | |
12085 | b(of)f(2,)1290 1249 y(and)c(the)g(shell)h(is)f(executing)i(in)e(a)h | |
12086 | (subroutine)e(\(a)i(shell)g(function)f(or)1290 1358 y(a)h(shell)h | |
12087 | (script)f(executed)h(b)m(y)f(the)g Fs(.)g Ft(or)g Fs(source)e | |
12088 | Ft(builtins\),)j(a)g(call)g(to)1290 1468 y Fs(return)29 | |
12089 | b Ft(is)h(sim)m(ulated.)1159 1602 y(4.)61 b Fs(BASH_ARGC)34 | |
12090 | b Ft(and)i Fs(BASH_ARGV)e Ft(are)j(up)s(dated)e(as)h(describ)s(ed)g(in) | |
12091 | g(their)1290 1711 y(descriptions)30 b(\(see)i(Section)f(5.2)g([Bash)g | |
12092 | (V)-8 b(ariables],)32 b(page)f(69\).)1159 1845 y(5.)61 | |
12093 | b(F)-8 b(unction)57 b(tracing)g(is)g(enabled:)93 b(command)56 | |
12094 | b(substitution,)63 b(shell)1290 1955 y(functions,)30 | |
12095 | b(and)f(subshells)g(in)m(v)m(ok)m(ed)j(with)d Fs(\()h | |
12096 | Fi(command)39 b Fs(\))30 b Ft(inherit)g(the)1290 2064 | |
12097 | y Fs(DEBUG)f Ft(and)h Fs(RETURN)e Ft(traps.)1159 2198 | |
12098 | y(6.)61 b(Error)41 b(tracing)i(is)f(enabled:)63 b(command)42 | |
12099 | b(substitution,)i(shell)f(func-)1290 2308 y(tions,)30 | |
12100 | b(and)f(subshells)g(in)m(v)m(ok)m(ed)i(with)e Fs(\()h | |
12101 | Fi(command)39 b Fs(\))29 b Ft(inherit)g(the)h Fs(ERR)1290 | |
12102 | 2418 y Ft(trap.)630 2576 y Fs(extglob)144 b Ft(If)26 | |
12103 | b(set,)i(the)f(extended)f(pattern)h(matc)m(hing)g(features)g(describ)s | |
12104 | (ed)e(ab)s(o)m(v)m(e)j(\(see)1110 2685 y(Section)j(3.5.8.1)i([P)m | |
12105 | (attern)f(Matc)m(hing],)g(page)f(29\))h(are)f(enabled.)630 | |
12106 | 2844 y Fs(extquote)96 b Ft(If)49 b(set,)54 b Fs($')p | |
9ec5ed66 CR |
12107 | Fi(string)11 b Fs(')46 b Ft(and)j Fs($")p Fi(string)11 |
12108 | b Fs(")46 b Ft(quoting)k(is)f(p)s(erformed)e(within)1110 | |
aaf6036e CR |
12109 | 2953 y Fs(${)p Fi(parameter)11 b Fs(})30 b Ft(expansions)j(enclosed)h |
12110 | (in)g(double)f(quotes.)51 b(This)32 b(option)1110 3063 | |
12111 | y(is)e(enabled)h(b)m(y)f(default.)630 3221 y Fs(failglob)96 | |
9ec5ed66 | 12112 | b Ft(If)36 b(set,)j(patterns)d(whic)m(h)g(fail)h(to)h(matc)m(h)f |
aaf6036e CR |
12113 | (\014lenames)f(during)g(\014lename)g(ex-)1110 3331 y(pansion)30 |
12114 | b(result)g(in)g(an)g(expansion)h(error.)630 3489 y Fs(force_fignore) | |
12115 | 1110 3599 y Ft(If)43 b(set,)k(the)d(su\016xes)f(sp)s(eci\014ed)f(b)m(y) | |
9ec5ed66 | 12116 | i(the)f Fs(FIGNORE)f Ft(shell)h(v)-5 b(ariable)44 b(cause)1110 |
aaf6036e CR |
12117 | 3708 y(w)m(ords)31 b(to)h(b)s(e)f(ignored)h(when)f(p)s(erforming)f(w)m |
12118 | (ord)h(completion)i(ev)m(en)f(if)g(the)1110 3818 y(ignored)37 | |
122f603c | 12119 | b(w)m(ords)g(are)g(the)h(only)f(p)s(ossible)g(completions.)62 |
aaf6036e | 12120 | b(See)37 b(Section)h(5.2)1110 3927 y([Bash)24 b(V)-8 |
9f178efb | 12121 | b(ariables],)27 b(page)e(69,)h(for)d(a)h(description)g(of)g |
aaf6036e CR |
12122 | Fs(FIGNORE)p Ft(.)37 b(This)22 b(option)1110 4037 y(is)30 |
12123 | b(enabled)h(b)m(y)f(default.)630 4195 y Fs(globasciiranges)1110 | |
12124 | 4305 y Ft(If)87 b(set,)104 b(range)88 b(expressions)f(used)g(in)h | |
12125 | (pattern)g(matc)m(hing)h(\(see)1110 4415 y(Section)43 | |
9f178efb | 12126 | b(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)j(page)c(29\))h(b)s(eha)m(v)m |
aaf6036e | 12127 | (e)f(as)f(if)h(in)f(the)1110 4524 y(traditional)h(C)e(lo)s(cale)i(when) |
45c0f7f8 | 12128 | e(p)s(erforming)f(comparisons.)75 b(That)41 b(is,)k(the)1110 |
aaf6036e | 12129 | 4634 y(curren)m(t)31 b(lo)s(cale's)i(collating)g(sequence)e(is)g(not)h |
45c0f7f8 | 12130 | (tak)m(en)g(in)m(to)g(accoun)m(t,)h(so)e(`)p Fs(b)p Ft(')1110 |
aaf6036e | 12131 | 4743 y(will)g(not)g(collate)i(b)s(et)m(w)m(een)e(`)p |
45c0f7f8 | 12132 | Fs(A)p Ft(')g(and)f(`)p Fs(B)p Ft(',)h(and)f(upp)s(er-case)g(and)g(lo)m |
aaf6036e CR |
12133 | (w)m(er-case)1110 4853 y(ASCI)s(I)f(c)m(haracters)j(will)e(collate)j |
12134 | (together.)630 5011 y Fs(globstar)96 b Ft(If)38 b(set,)j(the)e(pattern) | |
45c0f7f8 | 12135 | f(`)p Fs(**)p Ft(')h(used)e(in)i(a)f(\014lename)h(expansion)f(con)m |
aaf6036e | 12136 | (text)j(will)1110 5121 y(matc)m(h)36 b(all)g(\014les)f(and)f(zero)i(or) |
45c0f7f8 | 12137 | f(more)g(directories)h(and)e(sub)s(directories.)54 b(If)1110 |
aaf6036e | 12138 | 5230 y(the)30 b(pattern)g(is)g(follo)m(w)m(ed)i(b)m(y)d(a)i(`)p |
122f603c | 12139 | Fs(/)p Ft(',)f(only)g(directories)h(and)f(sub)s(directories)1110 |
aaf6036e | 12140 | 5340 y(matc)m(h.)p eop end |
9f178efb CR |
12141 | %%Page: 66 72 |
12142 | TeXDict begin 66 71 bop 150 -116 a Ft(66)2572 b(Bash)31 | |
aaf6036e CR |
12143 | b(Reference)g(Man)m(ual)630 299 y Fs(gnu_errfmt)1110 |
12144 | 408 y Ft(If)k(set,)j(shell)e(error)g(messages)g(are)h(written)e(in)h | |
12145 | (the)g(standard)f Fl(gnu)g Ft(error)1110 518 y(message)c(format.)630 | |
12146 | 667 y Fs(histappend)1110 777 y Ft(If)c(set,)j(the)e(history)g(list)g | |
12147 | (is)g(app)s(ended)e(to)j(the)f(\014le)g(named)f(b)m(y)h(the)g(v)-5 | |
12148 | b(alue)29 b(of)1110 887 y(the)d Fs(HISTFILE)d Ft(v)-5 | |
12149 | b(ariable)26 b(when)e(the)h(shell)h(exits,)h(rather)e(than)h(o)m(v)m | |
12150 | (erwriting)1110 996 y(the)31 b(\014le.)630 1146 y Fs(histreedit)1110 | |
12151 | 1255 y Ft(If)i(set,)h(and)f(Readline)h(is)f(b)s(eing)g(used,)g(a)g | |
12152 | (user)g(is)g(giv)m(en)h(the)g(opp)s(ortunit)m(y)1110 | |
12153 | 1365 y(to)d(re-edit)g(a)g(failed)g(history)f(substitution.)630 | |
12154 | 1514 y Fs(histverify)1110 1624 y Ft(If)35 b(set,)i(and)e(Readline)h(is) | |
12155 | f(b)s(eing)g(used,)h(the)f(results)g(of)g(history)h(substitu-)1110 | |
12156 | 1733 y(tion)h(are)g(not)g(immediately)h(passed)e(to)h(the)g(shell)g | |
12157 | (parser.)59 b(Instead,)38 b(the)1110 1843 y(resulting)i(line)f(is)h | |
12158 | (loaded)g(in)m(to)g(the)g(Readline)g(editing)g(bu\013er,)h(allo)m(wing) | |
12159 | 1110 1953 y(further)29 b(mo)s(di\014cation.)630 2102 | |
12160 | y Fs(hostcomplete)1110 2212 y Ft(If)38 b(set,)j(and)c(Readline)i(is)f | |
12161 | (b)s(eing)g(used,)h(Bash)g(will)f(attempt)h(to)g(p)s(erform)1110 | |
12162 | 2321 y(hostname)d(completion)h(when)e(a)h(w)m(ord)f(con)m(taining)i(a)f | |
12163 | (`)p Fs(@)p Ft(')g(is)g(b)s(eing)f(com-)1110 2431 y(pleted)g(\(see)h | |
12164 | (Section)f(8.4.6)i([Commands)d(F)-8 b(or)36 b(Completion],)g(page)g | |
12165 | (120\).)1110 2540 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.) | |
12166 | 630 2690 y Fs(huponexit)1110 2800 y Ft(If)i(set,)i(Bash)f(will)h(send)d | |
9ec5ed66 | 12167 | Fs(SIGHUP)h Ft(to)h(all)h(jobs)e(when)g(an)g(in)m(teractiv)m(e)k(login) |
aaf6036e CR |
12168 | 1110 2909 y(shell)31 b(exits)g(\(see)g(Section)g(3.7.6)h([Signals],)g |
12169 | (page)f(38\).)630 3059 y Fs(interactive_comments)1110 | |
12170 | 3168 y Ft(Allo)m(w)c(a)g(w)m(ord)e(b)s(eginning)g(with)h(`)p | |
9ec5ed66 | 12171 | Fs(#)p Ft(')g(to)h(cause)f(that)h(w)m(ord)f(and)f(all)i(remain-)1110 |
aaf6036e | 12172 | 3278 y(ing)41 b(c)m(haracters)i(on)e(that)h(line)g(to)g(b)s(e)f |
9ec5ed66 | 12173 | (ignored)g(in)g(an)g(in)m(teractiv)m(e)j(shell.)1110 |
aaf6036e CR |
12174 | 3387 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.)630 |
12175 | 3537 y Fs(lastpipe)96 b Ft(If)24 b(set,)i(and)e(job)g(con)m(trol)i(is)f | |
45c0f7f8 | 12176 | (not)f(activ)m(e,)k(the)d(shell)f(runs)f(the)i(last)g(command)1110 |
aaf6036e CR |
12177 | 3646 y(of)37 b(a)h(pip)s(eline)e(not)h(executed)h(in)f(the)g(bac)m |
12178 | (kground)g(in)g(the)g(curren)m(t)g(shell)1110 3756 y(en)m(vironmen)m | |
12179 | (t.)630 3905 y Fs(lithist)144 b Ft(If)22 b(enabled,)i(and)d(the)h | |
45c0f7f8 | 12180 | Fs(cmdhist)e Ft(option)j(is)f(enabled,)i(m)m(ulti-line)f(commands)1110 |
aaf6036e CR |
12181 | 4015 y(are)28 b(sa)m(v)m(ed)h(to)g(the)f(history)g(with)f(em)m(b)s |
12182 | (edded)g(newlines)h(rather)g(than)f(using)1110 4125 y(semicolon)32 | |
12183 | b(separators)f(where)e(p)s(ossible.)630 4274 y Fs(login_shell)1110 | |
12184 | 4384 y Ft(The)35 b(shell)h(sets)g(this)f(option)h(if)g(it)g(is)f | |
45c0f7f8 | 12185 | (started)h(as)g(a)g(login)g(shell)g(\(see)g(Sec-)1110 |
aaf6036e | 12186 | 4493 y(tion)29 b(6.1)g([In)m(v)m(oking)h(Bash],)f(page)g(79\).)41 |
45c0f7f8 | 12187 | b(The)28 b(v)-5 b(alue)29 b(ma)m(y)g(not)f(b)s(e)g(c)m(hanged.)630 |
aaf6036e | 12188 | 4643 y Fs(mailwarn)96 b Ft(If)34 b(set,)i(and)e(a)h(\014le)g(that)g |
45c0f7f8 | 12189 | (Bash)f(is)h(c)m(hec)m(king)h(for)f(mail)g(has)f(b)s(een)g(accessed) |
aaf6036e | 12190 | 1110 4752 y(since)24 b(the)h(last)g(time)f(it)h(w)m(as)f(c)m(hec)m(k)m |
45c0f7f8 | 12191 | (ed,)k(the)c(message)h Fs("The)k(mail)h(in)f Fi(mail-)1110 |
aaf6036e CR |
12192 | 4862 y(file)40 b Fs(has)29 b(been)g(read")g Ft(is)i(displa)m(y)m(ed.) |
12193 | 630 5011 y Fs(no_empty_cmd_completion)1110 5121 y Ft(If)f(set,)g(and)g | |
122f603c | 12194 | (Readline)g(is)h(b)s(eing)e(used,)h(Bash)g(will)g(not)g(attempt)i(to)e |
aaf6036e | 12195 | (searc)m(h)1110 5230 y(the)25 b Fs(PATH)f Ft(for)h(p)s(ossible)f |
122f603c | 12196 | (completions)j(when)d(completion)i(is)f(attempted)h(on)1110 |
aaf6036e | 12197 | 5340 y(an)k(empt)m(y)h(line.)p eop end |
9f178efb CR |
12198 | %%Page: 67 73 |
12199 | TeXDict begin 67 72 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
aaf6036e CR |
12200 | b(Shell)30 b(Builtin)h(Commands)2069 b(67)630 299 y Fs(nocaseglob)1110 |
12201 | 408 y Ft(If)38 b(set,)k(Bash)d(matc)m(hes)g(\014lenames)g(in)f(a)h | |
12202 | (case-insensitiv)m(e)j(fashion)c(when)1110 518 y(p)s(erforming)29 | |
12203 | b(\014lename)i(expansion.)630 676 y Fs(nocasematch)1110 | |
12204 | 786 y Ft(If)42 b(set,)k(Bash)d(matc)m(hes)g(patterns)g(in)f(a)h | |
12205 | (case-insensitiv)m(e)i(fashion)d(when)1110 895 y(p)s(erforming)31 | |
12206 | b(matc)m(hing)i(while)f(executing)i Fs(case)d Ft(or)h | |
12207 | Fs([[)g Ft(conditional)h(com-)1110 1005 y(mands.)630 | |
12208 | 1163 y Fs(nullglob)96 b Ft(If)23 b(set,)j(Bash)e(allo)m(ws)g | |
12209 | (\014lename)g(patterns)g(whic)m(h)f(matc)m(h)h(no)g(\014les)f(to)i | |
12210 | (expand)1110 1273 y(to)31 b(a)g(n)m(ull)f(string,)h(rather)f(than)g | |
12211 | (themselv)m(es.)630 1431 y Fs(progcomp)96 b Ft(If)25 | |
12212 | b(set,)i(the)f(programmable)g(completion)g(facilities)i(\(see)f | |
12213 | (Section)f(8.6)h([Pro-)1110 1541 y(grammable)45 b(Completion],)k(page)c | |
12214 | (124\))h(are)f(enabled.)82 b(This)44 b(option)h(is)1110 | |
12215 | 1650 y(enabled)30 b(b)m(y)h(default.)630 1808 y Fs(promptvars)1110 | |
12216 | 1918 y Ft(If)50 b(set,)56 b(prompt)49 b(strings)h(undergo)g(parameter)h | |
12217 | (expansion,)k(command)1110 2028 y(substitution,)35 b(arithmetic)g | |
12218 | (expansion,)g(and)e(quote)i(remo)m(v)-5 b(al)35 b(after)f(b)s(eing)1110 | |
12219 | 2137 y(expanded)53 b(as)h(describ)s(ed)e(b)s(elo)m(w)i(\(see)h(Section) | |
12220 | f(6.9)h([Con)m(trolling)g(the)1110 2247 y(Prompt],)30 | |
12221 | b(page)h(91\).)42 b(This)30 b(option)h(is)f(enabled)h(b)m(y)f(default.) | |
12222 | 630 2405 y Fs(restricted_shell)1110 2515 y Ft(The)40 | |
12223 | b(shell)h(sets)g(this)g(option)g(if)g(it)h(is)e(started)i(in)e | |
12224 | (restricted)i(mo)s(de)e(\(see)1110 2624 y(Section)c(6.10)g([The)f | |
12225 | (Restricted)g(Shell],)i(page)e(92\).)56 b(The)34 b(v)-5 | |
12226 | b(alue)35 b(ma)m(y)h(not)1110 2734 y(b)s(e)c(c)m(hanged.)49 | |
12227 | b(This)32 b(is)h(not)h(reset)f(when)f(the)h(startup)g(\014les)f(are)i | |
12228 | (executed,)1110 2843 y(allo)m(wing)k(the)e(startup)f(\014les)h(to)g | |
12229 | (disco)m(v)m(er)h(whether)f(or)f(not)i(a)f(shell)g(is)g(re-)1110 | |
12230 | 2953 y(stricted.)630 3111 y Fs(shift_verbose)1110 3221 | |
12231 | y Ft(If)g(this)g(is)g(set,)j(the)d Fs(shift)f Ft(builtin)h(prin)m(ts)f | |
12232 | (an)h(error)g(message)i(when)d(the)1110 3330 y(shift)30 | |
12233 | b(coun)m(t)h(exceeds)g(the)g(n)m(um)m(b)s(er)e(of)h(p)s(ositional)i | |
12234 | (parameters.)630 3488 y Fs(sourcepath)1110 3598 y Ft(If)22 | |
12235 | b(set,)j(the)e Fs(source)e Ft(builtin)h(uses)g(the)h(v)-5 | |
12236 | b(alue)23 b(of)g Fs(PATH)e Ft(to)j(\014nd)d(the)h(directory)1110 | |
12237 | 3708 y(con)m(taining)29 b(the)e(\014le)h(supplied)e(as)h(an)g(argumen)m | |
12238 | (t.)40 b(This)27 b(option)h(is)f(enabled)1110 3817 y(b)m(y)j(default.) | |
12239 | 630 3975 y Fs(xpg_echo)96 b Ft(If)31 b(set,)h(the)g Fs(echo)e | |
7d92f73f | 12240 | Ft(builtin)h(expands)f(bac)m(kslash-escap)s(e)j(sequences)f(b)m(y)f |
aaf6036e | 12241 | (de-)1110 4085 y(fault.)630 4243 y(The)c(return)f(status)i(when)f |
67362c60 | 12242 | (listing)h(options)g(is)f(zero)i(if)e(all)i Fq(optnames)i |
aaf6036e | 12243 | Ft(are)d(enabled,)g(non-)630 4353 y(zero)40 b(otherwise.)66 |
67362c60 | 12244 | b(When)39 b(setting)h(or)f(unsetting)g(options,)i(the)e(return)f |
aaf6036e | 12245 | (status)h(is)g(zero)630 4462 y(unless)30 b(an)g Fq(optname)36 |
67362c60 | 12246 | b Ft(is)30 b(not)h(a)g(v)-5 b(alid)30 b(shell)h(option.)150 |
aaf6036e | 12247 | 4694 y Fr(4.4)68 b(Sp)t(ecial)45 b(Builtins)150 4853 |
7d92f73f | 12248 | y Ft(F)-8 b(or)35 b(historical)h(reasons,)g(the)e Fl(posix)g |
67362c60 | 12249 | Ft(standard)f(has)i(classi\014ed)f(sev)m(eral)i(builtin)e(commands)g |
aaf6036e | 12250 | (as)h Fk(sp)-5 b(e-)150 4963 y(cial)p Ft(.)47 b(When)33 |
67362c60 CR |
12251 | b(Bash)f(is)h(executing)g(in)f Fl(posix)g Ft(mo)s(de,)h(the)g(sp)s |
12252 | (ecial)g(builtins)e(di\013er)i(from)f(other)g(builtin)150 | |
aaf6036e | 12253 | 5072 y(commands)e(in)g(three)h(resp)s(ects:)199 5206 |
67362c60 | 12254 | y(1.)61 b(Sp)s(ecial)31 b(builtins)e(are)i(found)e(b)s(efore)h(shell)h |
aaf6036e | 12255 | (functions)f(during)f(command)h(lo)s(okup.)199 5340 y(2.)61 |
c302751c | 12256 | b(If)30 b(a)h(sp)s(ecial)g(builtin)f(returns)f(an)h(error)g(status,)h |
aaf6036e | 12257 | (a)g(non-in)m(teractiv)m(e)i(shell)d(exits.)p eop end |
9f178efb | 12258 | %%Page: 68 74 |
aaf6036e CR |
12259 | TeXDict begin 68 73 bop 150 -116 a Ft(68)2572 b(Bash)31 |
12260 | b(Reference)g(Man)m(ual)199 299 y(3.)61 b(Assignmen)m(t)30 | |
12261 | b(statemen)m(ts)h(preceding)f(the)f(command)g(sta)m(y)i(in)e(e\013ect)i | |
12262 | (in)e(the)h(shell)f(en)m(vironmen)m(t)330 408 y(after)i(the)f(command)h | |
12263 | (completes.)275 568 y(When)36 b(Bash)g(is)h(not)f(executing)i(in)e | |
12264 | Fl(posix)f Ft(mo)s(de,)j(these)f(builtins)f(b)s(eha)m(v)m(e)h(no)f | |
12265 | (di\013eren)m(tly)h(than)150 677 y(the)31 b(rest)f(of)h(the)f(Bash)h | |
12266 | (builtin)e(commands.)41 b(The)30 b(Bash)g Fl(posix)g | |
12267 | Ft(mo)s(de)g(is)g(describ)s(ed)f(in)h(Section)h(6.11)150 | |
12268 | 787 y([Bash)g(POSIX)e(Mo)s(de],)i(page)g(92.)275 922 | |
12269 | y(These)f(are)g(the)h Fl(posix)f Ft(sp)s(ecial)h(builtins:)390 | |
12270 | 1056 y Fs(break)46 b(:)i(.)f(continue)f(eval)g(exec)h(exit)g(export)f | |
12271 | (readonly)f(return)h(set)390 1166 y(shift)g(trap)h(unset)p | |
12272 | eop end | |
9f178efb CR |
12273 | %%Page: 69 75 |
12274 | TeXDict begin 69 74 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
12275 | b(Shell)30 b(V)-8 b(ariables)2459 b(69)150 299 y Fo(5)80 | |
e05be32d | 12276 | b(Shell)53 b(V)-13 b(ariables)150 541 y Ft(This)21 b(c)m(hapter)i |
c302751c CR |
12277 | (describ)s(es)e(the)i(shell)f(v)-5 b(ariables)23 b(that)f(Bash)h(uses.) |
12278 | 37 b(Bash)23 b(automatically)h(assigns)f(default)150 | |
e05be32d CR |
12279 | 651 y(v)-5 b(alues)31 b(to)g(a)g(n)m(um)m(b)s(er)e(of)h(v)-5 |
12280 | b(ariables.)150 888 y Fr(5.1)68 b(Bourne)45 b(Shell)g(V)-11 | |
12281 | b(ariables)150 1047 y Ft(Bash)30 b(uses)g(certain)h(shell)g(v)-5 | |
c302751c | 12282 | b(ariables)31 b(in)f(the)g(same)h(w)m(a)m(y)g(as)g(the)f(Bourne)g |
e05be32d | 12283 | (shell.)41 b(In)30 b(some)g(cases,)i(Bash)150 1157 y(assigns)f(a)f |
c302751c | 12284 | (default)h(v)-5 b(alue)31 b(to)g(the)f(v)-5 b(ariable.)150 |
e05be32d | 12285 | 1320 y Fs(CDPATH)192 b Ft(A)39 b(colon-separated)i(list)e(of)g |
c302751c | 12286 | (directories)h(used)f(as)g(a)g(searc)m(h)h(path)e(for)h(the)g |
e05be32d | 12287 | Fs(cd)f Ft(builtin)630 1430 y(command.)150 1592 y Fs(HOME)288 |
37c41ab1 CR |
12288 | b Ft(The)23 b(curren)m(t)h(user's)f(home)g(directory;)k(the)d(default)g |
12289 | (for)f(the)h Fs(cd)f Ft(builtin)g(command.)38 b(The)630 | |
e05be32d | 12290 | 1702 y(v)-5 b(alue)37 b(of)f(this)g(v)-5 b(ariable)37 |
37c41ab1 | 12291 | b(is)g(also)g(used)e(b)m(y)h(tilde)h(expansion)f(\(see)i(Section)f |
45c0f7f8 | 12292 | (3.5.2)h([Tilde)630 1811 y(Expansion],)30 b(page)h(21\).)150 |
e05be32d | 12293 | 1973 y Fs(IFS)336 b Ft(A)25 b(list)i(of)e(c)m(haracters)i(that)f |
37c41ab1 | 12294 | (separate)g(\014elds;)h(used)e(when)f(the)i(shell)f(splits)h(w)m(ords)e |
e05be32d CR |
12295 | (as)i(part)630 2083 y(of)31 b(expansion.)150 2245 y Fs(MAIL)288 |
12296 | b Ft(If)44 b(this)g(parameter)h(is)g(set)g(to)g(a)f(\014lename)h(or)f | |
12297 | (directory)h(name)g(and)f(the)g Fs(MAILPATH)630 2355 | |
12298 | y Ft(v)-5 b(ariable)32 b(is)e(not)h(set,)h(Bash)f(informs)f(the)h(user) | |
12299 | f(of)h(the)g(arriv)-5 b(al)31 b(of)g(mail)g(in)g(the)g(sp)s(eci\014ed) | |
12300 | 630 2464 y(\014le)f(or)h(Maildir-format)g(directory)-8 | |
12301 | b(.)150 2627 y Fs(MAILPATH)96 b Ft(A)33 b(colon-separated)i(list)f(of)f | |
37c41ab1 | 12302 | (\014lenames)h(whic)m(h)f(the)g(shell)g(p)s(erio)s(dically)h(c)m(hec)m |
e05be32d | 12303 | (ks)g(for)f(new)630 2736 y(mail.)60 b(Eac)m(h)37 b(list)g(en)m(try)g |
37c41ab1 | 12304 | (can)g(sp)s(ecify)f(the)h(message)h(that)f(is)g(prin)m(ted)f(when)f |
122f603c CR |
12305 | (new)h(mail)630 2846 y(arriv)m(es)31 b(in)g(the)g(mail)g(\014le)g(b)m |
12306 | (y)g(separating)h(the)f(\014lename)g(from)f(the)h(message)h(with)e(a)i | |
12307 | (`)p Fs(?)p Ft('.)630 2955 y(When)g(used)f(in)h(the)g(text)i(of)e(the)g | |
12308 | (message,)i Fs($_)e Ft(expands)f(to)i(the)f(name)g(of)h(the)f(curren)m | |
12309 | (t)630 3065 y(mail)f(\014le.)150 3227 y Fs(OPTARG)192 | |
37c41ab1 | 12310 | b Ft(The)30 b(v)-5 b(alue)31 b(of)f(the)h(last)g(option)g(argumen)m(t)g |
5e13499c | 12311 | (pro)s(cessed)f(b)m(y)g(the)g Fs(getopts)f Ft(builtin.)150 |
e05be32d | 12312 | 3389 y Fs(OPTIND)192 b Ft(The)30 b(index)g(of)g(the)h(last)g(option)g |
37c41ab1 | 12313 | (argumen)m(t)g(pro)s(cessed)f(b)m(y)g(the)g Fs(getopts)f |
e05be32d | 12314 | Ft(builtin.)150 3552 y Fs(PATH)288 b Ft(A)32 b(colon-separated)i(list)f |
37c41ab1 | 12315 | (of)f(directories)h(in)e(whic)m(h)h(the)g(shell)g(lo)s(oks)h(for)f |
e05be32d | 12316 | (commands.)45 b(A)630 3661 y(zero-length)e(\(n)m(ull\))g(directory)f |
37c41ab1 | 12317 | (name)g(in)g(the)g(v)-5 b(alue)42 b(of)g Fs(PATH)f Ft(indicates)i(the)f |
e05be32d | 12318 | (curren)m(t)630 3771 y(directory)-8 b(.)49 b(A)33 b(n)m(ull)f |
37c41ab1 | 12319 | (directory)i(name)e(ma)m(y)i(app)s(ear)e(as)h(t)m(w)m(o)h(adjacen)m(t)g |
e05be32d CR |
12320 | (colons,)g(or)f(as)g(an)630 3880 y(initial)f(or)e(trailing)h(colon.)150 |
12321 | 4042 y Fs(PS1)336 b Ft(The)35 b(primary)f(prompt)h(string.)55 | |
37c41ab1 | 12322 | b(The)35 b(default)h(v)-5 b(alue)35 b(is)h(`)p Fs(\\s-\\v\\$)28 |
122f603c | 12323 | b Ft('.)56 b(See)36 b(Section)g(6.9)630 4152 y([Con)m(trolling)42 |
9f178efb | 12324 | b(the)e(Prompt],)j(page)e(91,)j(for)c(the)g(complete)i(list)f(of)f |
122f603c CR |
12325 | (escap)s(e)h(sequences)630 4262 y(that)31 b(are)g(expanded)e(b)s(efore) |
12326 | h Fs(PS1)g Ft(is)g(displa)m(y)m(ed.)150 4424 y Fs(PS2)336 | |
37c41ab1 CR |
12327 | b Ft(The)30 b(secondary)g(prompt)g(string.)41 b(The)29 |
12328 | b(default)i(v)-5 b(alue)31 b(is)f(`)p Fs(>)g Ft('.)150 | |
e05be32d | 12329 | 4661 y Fr(5.2)68 b(Bash)45 b(V)-11 b(ariables)150 4820 |
c302751c CR |
12330 | y Ft(These)45 b(v)-5 b(ariables)46 b(are)g(set)g(or)f(used)f(b)m(y)h |
12331 | (Bash,)50 b(but)44 b(other)i(shells)f(do)h(not)f(normally)h(treat)g | |
e05be32d | 12332 | (them)150 4929 y(sp)s(ecially)-8 b(.)275 5067 y(A)24 |
c302751c CR |
12333 | b(few)g(v)-5 b(ariables)24 b(used)g(b)m(y)f(Bash)i(are)f(describ)s(ed)f |
12334 | (in)h(di\013eren)m(t)g(c)m(hapters:)38 b(v)-5 b(ariables)25 | |
e05be32d | 12335 | b(for)f(con)m(trolling)150 5176 y(the)31 b(job)f(con)m(trol)h |
37c41ab1 | 12336 | (facilities)i(\(see)e(Section)g(7.3)h([Job)e(Con)m(trol)h(V)-8 |
9f178efb | 12337 | b(ariables],)32 b(page)g(100\).)150 5340 y Fs(BASH)288 |
37c41ab1 CR |
12338 | b Ft(The)30 b(full)g(pathname)g(used)g(to)h(execute)h(the)e(curren)m(t) |
12339 | g(instance)h(of)g(Bash.)p eop end | |
9f178efb CR |
12340 | %%Page: 70 76 |
12341 | TeXDict begin 70 75 bop 150 -116 a Ft(70)2572 b(Bash)31 | |
8f714a7c CR |
12342 | b(Reference)g(Man)m(ual)150 299 y Fs(BASHOPTS)96 b Ft(A)31 |
12343 | b(colon-separated)h(list)f(of)g(enabled)f(shell)h(options.)41 | |
12344 | b(Eac)m(h)31 b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 | |
12345 | b(alid)630 408 y(argumen)m(t)33 b(for)g(the)f(`)p Fs(-s)p | |
12346 | Ft(')h(option)g(to)g(the)g Fs(shopt)e Ft(builtin)i(command)f(\(see)i | |
9f178efb | 12347 | (Section)f(4.3.2)630 518 y([The)j(Shopt)g(Builtin],)i(page)f(62\).)60 |
8f714a7c CR |
12348 | b(The)36 b(options)h(app)s(earing)f(in)g Fs(BASHOPTS)e |
12349 | Ft(are)i(those)630 628 y(rep)s(orted)e(as)h(`)p Fs(on)p | |
12350 | Ft(')f(b)m(y)h(`)p Fs(shopt)p Ft('.)53 b(If)34 b(this)g(v)-5 | |
12351 | b(ariable)36 b(is)f(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)630 | |
12352 | 737 y(starts)25 b(up,)f(eac)m(h)i(shell)e(option)h(in)e(the)i(list)g | |
12353 | (will)f(b)s(e)g(enabled)g(b)s(efore)g(reading)g(an)m(y)g(startup)630 | |
12354 | 847 y(\014les.)41 b(This)29 b(v)-5 b(ariable)31 b(is)g(readonly)-8 | |
e05be32d CR |
12355 | b(.)150 998 y Fs(BASHPID)144 b Ft(Expands)35 b(to)i(the)f(pro)s(cess)f |
12356 | (ID)i(of)f(the)g(curren)m(t)g(Bash)g(pro)s(cess.)58 b(This)35 | |
12357 | b(di\013ers)h(from)g Fs($$)630 1107 y Ft(under)31 b(certain)j | |
8f714a7c CR |
12358 | (circumstances,)h(suc)m(h)e(as)g(subshells)f(that)i(do)f(not)g(require) |
12359 | g(Bash)g(to)h(b)s(e)630 1217 y(re-initialized.)150 1367 | |
12360 | y Fs(BASH_ALIASES)630 1477 y Ft(An)40 b(asso)s(ciativ)m(e)j(arra)m(y)d | |
12361 | (v)-5 b(ariable)41 b(whose)f(mem)m(b)s(ers)f(corresp)s(ond)g(to)i(the)f | |
e05be32d CR |
12362 | (in)m(ternal)h(list)630 1587 y(of)c(aliases)h(as)f(main)m(tained)g(b)m |
12363 | (y)g(the)g Fs(alias)e Ft(builtin.)59 b(\(see)37 b(Section)h(4.1)f | |
9f178efb | 12364 | ([Bourne)g(Shell)630 1696 y(Builtins],)f(page)e(41\).)53 |
e05be32d CR |
12365 | b(Elemen)m(ts)35 b(added)e(to)i(this)e(arra)m(y)i(app)s(ear)e(in)h(the) |
12366 | g(alias)h(list;)i(un-)630 1806 y(setting)31 b(arra)m(y)g(elemen)m(ts)h | |
12367 | (cause)f(aliases)h(to)f(b)s(e)f(remo)m(v)m(ed)h(from)f(the)h(alias)g | |
12368 | (list.)150 1956 y Fs(BASH_ARGC)630 2066 y Ft(An)f(arra)m(y)h(v)-5 | |
09767ff0 | 12369 | b(ariable)31 b(whose)f(v)-5 b(alues)31 b(are)g(the)f(n)m(um)m(b)s(er)g |
8f714a7c | 12370 | (of)g(parameters)h(in)f(eac)m(h)h(frame)g(of)630 2176 |
09767ff0 | 12371 | y(the)26 b(curren)m(t)f(bash)g(execution)i(call)g(stac)m(k.)41 |
d3ad40de | 12372 | b(The)25 b(n)m(um)m(b)s(er)g(of)h(parameters)g(to)g(the)g(curren)m(t) |
8f714a7c | 12373 | 630 2285 y(subroutine)i(\(shell)i(function)g(or)f(script)g(executed)i |
d3ad40de | 12374 | (with)e Fs(.)g Ft(or)h Fs(source)p Ft(\))e(is)h(at)h(the)g(top)g(of)630 |
8f714a7c | 12375 | 2395 y(the)37 b(stac)m(k.)63 b(When)37 b(a)h(subroutine)e(is)h |
d3ad40de | 12376 | (executed,)j(the)e(n)m(um)m(b)s(er)d(of)j(parameters)f(passed)630 |
8f714a7c | 12377 | 2504 y(is)g(pushed)f(on)m(to)i Fs(BASH_ARGC)p Ft(.)59 |
d3ad40de | 12378 | b(The)37 b(shell)g(sets)h Fs(BASH_ARGC)c Ft(only)k(when)e(in)h |
8f714a7c | 12379 | (extended)630 2614 y(debugging)23 b(mo)s(de)f(\(see)h(Section)g(4.3.2)i |
9f178efb | 12380 | ([The)d(Shopt)g(Builtin],)j(page)e(62)h(for)e(a)h(description)630 |
8f714a7c CR |
12381 | 2724 y(of)31 b(the)f Fs(extdebug)e Ft(option)j(to)g(the)g |
12382 | Fs(shopt)e Ft(builtin\).)150 2874 y Fs(BASH_ARGV)630 | |
12383 | 2984 y Ft(An)24 b(arra)m(y)g(v)-5 b(ariable)25 b(con)m(taining)h(all)f | |
9d2b70f0 | 12384 | (of)f(the)h(parameters)f(in)g(the)g(curren)m(t)g(bash)g(execution)630 |
8f714a7c | 12385 | 3093 y(call)35 b(stac)m(k.)53 b(The)34 b(\014nal)g(parameter)g(of)g |
37c41ab1 | 12386 | (the)g(last)h(subroutine)e(call)i(is)f(at)h(the)f(top)h(of)f(the)630 |
8f714a7c | 12387 | 3203 y(stac)m(k;)28 b(the)c(\014rst)f(parameter)i(of)f(the)g(initial)i |
37c41ab1 | 12388 | (call)f(is)f(at)h(the)f(b)s(ottom.)39 b(When)24 b(a)g(subroutine)630 |
8f714a7c | 12389 | 3313 y(is)40 b(executed,)j(the)d(parameters)h(supplied)d(are)i(pushed)f |
9d2b70f0 | 12390 | (on)m(to)i Fs(BASH_ARGV)p Ft(.)66 b(The)40 b(shell)630 |
8f714a7c | 12391 | 3422 y(sets)28 b Fs(BASH_ARGV)e Ft(only)i(when)f(in)h(extended)g |
d3ad40de | 12392 | (debugging)g(mo)s(de)g(\(see)h(Section)f(4.3.2)i([The)630 |
9f178efb | 12393 | 3532 y(Shopt)i(Builtin],)h(page)g(62)g(for)f(a)h(description)f(of)h |
d3ad40de | 12394 | (the)f Fs(extdebug)e Ft(option)j(to)g(the)f Fs(shopt)630 |
8f714a7c | 12395 | 3641 y Ft(builtin\).)150 3792 y Fs(BASH_CMDS)630 3902 |
09767ff0 CR |
12396 | y Ft(An)i(asso)s(ciativ)m(e)i(arra)m(y)f(v)-5 b(ariable)35 |
12397 | b(whose)f(mem)m(b)s(ers)f(corresp)s(ond)g(to)i(the)f(in)m(ternal)h | |
8f714a7c | 12398 | (hash)630 4011 y(table)c(of)g(commands)f(as)g(main)m(tained)h(b)m(y)g |
09767ff0 | 12399 | (the)f Fs(hash)f Ft(builtin)h(\(see)h(Section)g(4.1)h([Bourne)630 |
9f178efb | 12400 | 4121 y(Shell)23 b(Builtins],)j(page)e(41\).)40 b(Elemen)m(ts)24 |
09767ff0 | 12401 | b(added)e(to)j(this)e(arra)m(y)h(app)s(ear)e(in)i(the)f(hash)g(table;) |
8f714a7c | 12402 | 630 4230 y(unsetting)30 b(arra)m(y)h(elemen)m(ts)h(cause)f(commands)f |
09767ff0 | 12403 | (to)h(b)s(e)f(remo)m(v)m(ed)h(from)f(the)h(hash)e(table.)150 |
8f714a7c | 12404 | 4381 y Fs(BASH_COMMAND)630 4491 y Ft(The)39 b(command)h(curren)m(tly)g |
09767ff0 | 12405 | (b)s(eing)f(executed)i(or)e(ab)s(out)h(to)g(b)s(e)f(executed,)44 |
8f714a7c | 12406 | b(unless)39 b(the)630 4600 y(shell)g(is)g(executing)g(a)g(command)g(as) |
09767ff0 | 12407 | g(the)f(result)h(of)g(a)g(trap,)i(in)d(whic)m(h)g(case)i(it)f(is)g(the) |
8f714a7c CR |
12408 | 630 4710 y(command)30 b(executing)i(at)f(the)f(time)h(of)g(the)g(trap.) |
12409 | 150 4861 y Fs(BASH_ENV)96 b Ft(If)28 b(this)g(v)-5 b(ariable)30 | |
37c41ab1 | 12410 | b(is)e(set)h(when)f(Bash)g(is)h(in)m(v)m(ok)m(ed)h(to)f(execute)h(a)e |
8f714a7c | 12411 | (shell)h(script,)g(its)g(v)-5 b(alue)29 b(is)630 4970 |
37c41ab1 | 12412 | y(expanded)k(and)h(used)g(as)g(the)h(name)f(of)g(a)h(startup)f(\014le)g |
8f714a7c | 12413 | (to)h(read)f(b)s(efore)g(executing)i(the)630 5080 y(script.)41 |
9f178efb | 12414 | b(See)30 b(Section)h(6.2)h([Bash)f(Startup)e(Files],)j(page)f(81.)150 |
8f714a7c CR |
12415 | 5230 y Fs(BASH_EXECUTION_STRING)630 5340 y Ft(The)f(command)g(argumen)m |
12416 | (t)h(to)g(the)g(`)p Fs(-c)p Ft(')f(in)m(v)m(o)s(cation)i(option.)p | |
09767ff0 | 12417 | eop end |
9f178efb CR |
12418 | %%Page: 71 77 |
12419 | TeXDict begin 71 76 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
12420 | b(Shell)30 b(V)-8 b(ariables)2459 b(71)150 299 y Fs(BASH_LINENO)630 | |
9ec5ed66 CR |
12421 | 408 y Ft(An)62 b(arra)m(y)i(v)-5 b(ariable)63 b(whose)g(mem)m(b)s(ers)e |
12422 | (are)j(the)e(line)h(n)m(um)m(b)s(ers)f(in)g(source)h(\014les)630 | |
12423 | 518 y(where)46 b(eac)m(h)i(corresp)s(onding)e(mem)m(b)s(er)f(of)i | |
12424 | Fq(FUNCNAME)53 b Ft(w)m(as)47 b(in)m(v)m(ok)m(ed.)91 | |
12425 | b Fs(${BASH_)630 628 y(LINENO[$i]})39 b Ft(is)i(the)h(line)g(n)m(um)m | |
12426 | (b)s(er)e(in)i(the)f(source)h(\014le)g(\()p Fs(${BASH_SOURCE[$i+1]})p | |
12427 | Ft(\))630 737 y(where)d Fs(${FUNCNAME[$i]})c Ft(w)m(as)k(called)i(\(or) | |
12428 | e Fs(${BASH_LINENO[$i-1]})34 b Ft(if)39 b(referenced)630 | |
12429 | 847 y(within)30 b(another)g(shell)h(function\).)41 b(Use)31 | |
12430 | b Fs(LINENO)d Ft(to)j(obtain)g(the)g(curren)m(t)f(line)h(n)m(um)m(b)s | |
12431 | (er.)150 1002 y Fs(BASH_REMATCH)630 1112 y Ft(An)43 b(arra)m(y)i(v)-5 | |
8f714a7c | 12432 | b(ariable)44 b(whose)g(mem)m(b)s(ers)f(are)h(assigned)g(b)m(y)f(the)h |
9ec5ed66 | 12433 | (`)p Fs(=~)p Ft(')g(binary)f(op)s(erator)630 1221 y(to)37 |
8f714a7c | 12434 | b(the)f Fs([[)g Ft(conditional)i(command)e(\(see)h(Section)g(3.2.4.2)i |
9ec5ed66 | 12435 | ([Conditional)e(Constructs],)630 1331 y(page)e(10\).)52 |
8f714a7c | 12436 | b(The)33 b(elemen)m(t)j(with)d(index)g(0)i(is)f(the)g(p)s(ortion)f(of)h |
9ec5ed66 | 12437 | (the)g(string)g(matc)m(hing)h(the)630 1440 y(en)m(tire)29 |
8f714a7c CR |
12438 | b(regular)f(expression.)40 b(The)27 b(elemen)m(t)j(with)d(index)h |
12439 | Fq(n)f Ft(is)h(the)g(p)s(ortion)g(of)g(the)g(string)630 | |
9ec5ed66 | 12440 | 1550 y(matc)m(hing)j(the)g Fq(n)p Ft(th)f(paren)m(thesized)h(sub)s |
8f714a7c | 12441 | (expression.)39 b(This)29 b(v)-5 b(ariable)31 b(is)g(read-only)-8 |
9ec5ed66 CR |
12442 | b(.)150 1705 y Fs(BASH_SOURCE)630 1815 y Ft(An)40 b(arra)m(y)h(v)-5 |
12443 | b(ariable)41 b(whose)f(mem)m(b)s(ers)g(are)h(the)g(source)f | |
12444 | (\014lenames)h(where)f(the)g(corre-)630 1924 y(sp)s(onding)27 | |
12445 | b(shell)i(function)f(names)g(in)g(the)h Fs(FUNCNAME)d | |
12446 | Ft(arra)m(y)j(v)-5 b(ariable)30 b(are)f(de\014ned.)38 | |
12447 | b(The)630 2034 y(shell)26 b(function)g Fs(${FUNCNAME[$i]})c | |
12448 | Ft(is)k(de\014ned)f(in)g(the)h(\014le)h Fs(${BASH_SOURCE[$i]})21 | |
12449 | b Ft(and)630 2144 y(called)32 b(from)d Fs(${BASH_SOURCE[$i+1]})150 | |
f6da9f85 CR |
12450 | 2299 y(BASH_SUBSHELL)630 2408 y Ft(Incremen)m(ted)24 |
12451 | b(b)m(y)f(one)h(within)f(eac)m(h)i(subshell)d(or)i(subshell)e(en)m | |
12452 | (vironmen)m(t)i(when)f(the)h(shell)630 2518 y(b)s(egins)30 | |
12453 | b(executing)h(in)f(that)h(en)m(vironmen)m(t.)42 b(The)30 | |
12454 | b(initial)h(v)-5 b(alue)31 b(is)f(0.)150 2673 y Fs(BASH_VERSINFO)630 | |
12455 | 2783 y Ft(A)36 b(readonly)g(arra)m(y)g(v)-5 b(ariable)37 | |
9f178efb | 12456 | b(\(see)f(Section)h(6.7)g([Arra)m(ys],)h(page)e(88\))h(whose)f(mem)m(b) |
f6da9f85 CR |
12457 | s(ers)630 2892 y(hold)c(v)m(ersion)h(information)f(for)g(this)g |
12458 | (instance)h(of)g(Bash.)46 b(The)32 b(v)-5 b(alues)32 | |
12459 | b(assigned)h(to)g(the)630 3002 y(arra)m(y)e(mem)m(b)s(ers)e(are)i(as)g | |
12460 | (follo)m(ws:)630 3157 y Fs(BASH_VERSINFO[0])1110 3267 | |
12461 | y Ft(The)f(ma)5 b(jor)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
12462 | Fq(release)5 b Ft(\).)630 3422 y Fs(BASH_VERSINFO[1])1110 | |
12463 | 3532 y Ft(The)30 b(minor)g(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
12464 | Fq(v)m(ersion)p Ft(\).)630 3687 y Fs(BASH_VERSINFO[2])1110 | |
12465 | 3797 y Ft(The)f(patc)m(h)h(lev)m(el.)630 3952 y Fs(BASH_VERSINFO[3]) | |
12466 | 1110 4061 y Ft(The)f(build)f(v)m(ersion.)630 4217 y Fs | |
12467 | (BASH_VERSINFO[4])1110 4326 y Ft(The)h(release)i(status)e(\(e.g.,)j | |
12468 | Fq(b)s(eta1)7 b Ft(\).)630 4482 y Fs(BASH_VERSINFO[5])1110 | |
12469 | 4591 y Ft(The)30 b(v)-5 b(alue)31 b(of)f Fs(MACHTYPE)p | |
12470 | Ft(.)150 4746 y Fs(BASH_VERSION)630 4856 y Ft(The)g(v)m(ersion)h(n)m | |
12471 | (um)m(b)s(er)e(of)h(the)h(curren)m(t)f(instance)h(of)g(Bash.)150 | |
12472 | 5011 y Fs(BASH_XTRACEFD)630 5121 y Ft(If)f(set)h(to)h(an)e(in)m(teger)i | |
8f714a7c | 12473 | (corresp)s(onding)e(to)h(a)g(v)-5 b(alid)31 b(\014le)g(descriptor,)g |
9ec5ed66 | 12474 | (Bash)g(will)g(write)g(the)630 5230 y(trace)37 b(output)f(generated)h |
8f714a7c | 12475 | (when)f(`)p Fs(set)29 b(-x)p Ft(')36 b(is)g(enabled)h(to)g(that)f |
9ec5ed66 | 12476 | (\014le)h(descriptor.)58 b(This)630 5340 y(allo)m(ws)29 |
8f714a7c | 12477 | b(tracing)h(output)d(to)i(b)s(e)f(separated)g(from)g(diagnostic)h(and)f |
9ec5ed66 | 12478 | (error)f(messages.)41 b(The)p eop end |
9f178efb CR |
12479 | %%Page: 72 78 |
12480 | TeXDict begin 72 77 bop 150 -116 a Ft(72)2572 b(Bash)31 | |
9ec5ed66 CR |
12481 | b(Reference)g(Man)m(ual)630 299 y(\014le)g(descriptor)f(is)h(closed)g |
12482 | (when)f Fs(BASH_XTRACEFD)d Ft(is)k(unset)f(or)g(assigned)h(a)g(new)f(v) | |
12483 | -5 b(alue.)630 408 y(Unsetting)45 b Fs(BASH_XTRACEFD)40 | |
8f714a7c | 12484 | b Ft(or)k(assigning)g(it)g(the)g(empt)m(y)h(string)e(causes)i(the)f |
9ec5ed66 | 12485 | (trace)630 518 y(output)33 b(to)i(b)s(e)d(sen)m(t)j(to)f(the)g |
8f714a7c | 12486 | (standard)e(error.)50 b(Note)35 b(that)g(setting)f Fs(BASH_XTRACEFD)c |
9ec5ed66 | 12487 | Ft(to)630 628 y(2)39 b(\(the)h(standard)e(error)g(\014le)h |
8f714a7c | 12488 | (descriptor\))h(and)e(then)h(unsetting)g(it)g(will)g(result)g(in)g(the) |
9ec5ed66 | 12489 | 630 737 y(standard)30 b(error)g(b)s(eing)f(closed.)150 |
74d0116b CR |
12490 | 902 y Fs(COLUMNS)144 b Ft(Used)40 b(b)m(y)g(the)g Fs(select)e |
12491 | Ft(command)i(to)g(determine)g(the)g(terminal)h(width)e(when)g(prin)m | |
12492 | (t-)630 1011 y(ing)34 b(selection)i(lists.)53 b(Automatically)37 | |
12493 | b(set)e(b)m(y)f(an)g(in)m(teractiv)m(e)j(shell)d(up)s(on)f(receipt)i | |
12494 | (of)g(a)630 1121 y Fs(SIGWINCH)p Ft(.)150 1285 y Fs(COMP_CWORD)630 | |
12495 | 1395 y Ft(An)j(index)g(in)m(to)h Fs(${COMP_WORDS})c Ft(of)k(the)g(w)m | |
12496 | (ord)f(con)m(taining)i(the)e(curren)m(t)g(cursor)g(p)s(o-)630 | |
12497 | 1504 y(sition.)72 b(This)40 b(v)-5 b(ariable)41 b(is)f(a)m(v)-5 | |
12498 | b(ailable)43 b(only)e(in)f(shell)h(functions)f(in)m(v)m(ok)m(ed)i(b)m | |
12499 | (y)e(the)h(pro-)630 1614 y(grammable)36 b(completion)g(facilities)i | |
12500 | (\(see)e(Section)g(8.6)g([Programmable)g(Completion],)630 | |
9f178efb | 12501 | 1724 y(page)31 b(124\).)150 1888 y Fs(COMP_LINE)630 1998 |
74d0116b CR |
12502 | y Ft(The)38 b(curren)m(t)h(command)f(line.)66 b(This)37 |
12503 | b(v)-5 b(ariable)40 b(is)f(a)m(v)-5 b(ailable)41 b(only)d(in)h(shell)f | |
12504 | (functions)630 2107 y(and)25 b(external)h(commands)f(in)m(v)m(ok)m(ed)h | |
12505 | (b)m(y)f(the)h(programmable)f(completion)i(facilities)g(\(see)630 | |
9f178efb | 12506 | 2217 y(Section)k(8.6)h([Programmable)f(Completion],)g(page)g(124\).)150 |
74d0116b | 12507 | 2381 y Fs(COMP_POINT)630 2491 y Ft(The)25 b(index)g(of)h(the)g(curren)m |
37c41ab1 | 12508 | (t)f(cursor)g(p)s(osition)h(relativ)m(e)i(to)e(the)g(b)s(eginning)f(of) |
74d0116b | 12509 | g(the)h(curren)m(t)630 2600 y(command.)40 b(If)27 b(the)h(curren)m(t)g |
37c41ab1 | 12510 | (cursor)g(p)s(osition)g(is)g(at)g(the)g(end)g(of)g(the)g(curren)m(t)g |
74d0116b | 12511 | (command,)630 2710 y(the)i(v)-5 b(alue)30 b(of)g(this)g(v)-5 |
37c41ab1 CR |
12512 | b(ariable)31 b(is)f(equal)g(to)h Fs(${#COMP_LINE})p Ft(.)37 |
12513 | b(This)29 b(v)-5 b(ariable)31 b(is)f(a)m(v)-5 b(ailable)630 | |
74d0116b CR |
12514 | 2819 y(only)36 b(in)f(shell)h(functions)f(and)g(external)h(commands)g |
12515 | (in)m(v)m(ok)m(ed)h(b)m(y)e(the)h(programmable)630 2929 | |
37c41ab1 | 12516 | y(completion)c(facilities)g(\(see)g(Section)f(8.6)g([Programmable)g |
9f178efb | 12517 | (Completion],)h(page)f(124\).)150 3093 y Fs(COMP_TYPE)630 |
74d0116b | 12518 | 3203 y Ft(Set)c(to)h(an)f(in)m(teger)h(v)-5 b(alue)28 |
d3ad40de | 12519 | b(corresp)s(onding)e(to)h(the)h(t)m(yp)s(e)f(of)g(completion)h |
74d0116b | 12520 | (attempted)g(that)630 3313 y(caused)e(a)g(completion)i(function)d(to)i |
c302751c | 12521 | (b)s(e)e(called:)40 b Fq(T)-8 b(AB)5 b Ft(,)27 b(for)f(normal)g |
74d0116b | 12522 | (completion,)i(`)p Fs(?)p Ft(',)f(for)630 3422 y(listing)35 |
09767ff0 CR |
12523 | b(completions)h(after)f(successiv)m(e)g(tabs,)h(`)p Fs(!)p |
12524 | Ft(',)g(for)e(listing)h(alternativ)m(es)i(on)d(partial)630 | |
74d0116b | 12525 | 3532 y(w)m(ord)22 b(completion,)k(`)p Fs(@)p Ft(',)f(to)e(list)g |
09767ff0 | 12526 | (completions)h(if)f(the)g(w)m(ord)f(is)h(not)g(unmo)s(di\014ed,)f(or)h |
74d0116b | 12527 | (`)p Fs(\045)p Ft(',)h(for)630 3641 y(men)m(u)i(completion.)41 |
09767ff0 CR |
12528 | b(This)25 b(v)-5 b(ariable)27 b(is)g(a)m(v)-5 b(ailable)28 |
12529 | b(only)f(in)f(shell)g(functions)g(and)g(external)630 | |
74d0116b | 12530 | 3751 y(commands)32 b(in)m(v)m(ok)m(ed)i(b)m(y)e(the)g(programmable)h |
09767ff0 | 12531 | (completion)g(facilities)i(\(see)e(Section)g(8.6)630 |
9f178efb | 12532 | 3861 y([Programmable)e(Completion],)h(page)f(124\).)150 |
74d0116b | 12533 | 4025 y Fs(COMP_KEY)96 b Ft(The)29 b(k)m(ey)i(\(or)g(\014nal)e(k)m(ey)i |
d3ad40de | 12534 | (of)f(a)g(k)m(ey)h(sequence\))g(used)e(to)i(in)m(v)m(ok)m(e)h(the)e |
74d0116b CR |
12535 | (curren)m(t)g(completion)630 4134 y(function.)150 4299 |
12536 | y Fs(COMP_WORDBREAKS)630 4408 y Ft(The)f(set)i(of)e(c)m(haracters)j | |
d3ad40de | 12537 | (that)e(the)g(Readline)g(library)g(treats)g(as)g(w)m(ord)g(separators)g |
74d0116b | 12538 | (when)630 4518 y(p)s(erforming)i(w)m(ord)h(completion.)51 |
d3ad40de | 12539 | b(If)33 b Fs(COMP_WORDBREAKS)c Ft(is)34 b(unset,)g(it)f(loses)i(its)e |
74d0116b | 12540 | (sp)s(ecial)630 4628 y(prop)s(erties,)d(ev)m(en)h(if)f(it)h(is)g |
8f714a7c CR |
12541 | (subsequen)m(tly)f(reset.)150 4792 y Fs(COMP_WORDS)630 |
12542 | 4902 y Ft(An)36 b(arra)m(y)g(v)-5 b(ariable)37 b(consisting)g(of)f(the) | |
d3ad40de | 12543 | g(individual)f(w)m(ords)h(in)f(the)h(curren)m(t)g(command)630 |
8f714a7c | 12544 | 5011 y(line.)94 b(The)47 b(line)i(is)f(split)g(in)m(to)h(w)m(ords)e(as) |
6932f7f5 | 12545 | h(Readline)h(w)m(ould)f(split)g(it,)53 b(using)47 b Fs(COMP_)630 |
8f714a7c | 12546 | 5121 y(WORDBREAKS)34 b Ft(as)i(describ)s(ed)g(ab)s(o)m(v)m(e.)60 |
6932f7f5 | 12547 | b(This)36 b(v)-5 b(ariable)37 b(is)f(a)m(v)-5 b(ailable)39 |
8f714a7c | 12548 | b(only)e(in)f(shell)h(func-)630 5230 y(tions)32 b(in)m(v)m(ok)m(ed)i(b) |
6932f7f5 | 12549 | m(y)d(the)i(programmable)f(completion)h(facilities)h(\(see)f(Section)g |
9f178efb | 12550 | (8.6)g([Pro-)630 5340 y(grammable)e(Completion],)g(page)g(124\).)p |
6932f7f5 | 12551 | eop end |
9f178efb CR |
12552 | %%Page: 73 79 |
12553 | TeXDict begin 73 78 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
12554 | b(Shell)30 b(V)-8 b(ariables)2459 b(73)150 299 y Fs(COMPREPLY)630 | |
8f714a7c CR |
12555 | 408 y Ft(An)37 b(arra)m(y)h(v)-5 b(ariable)38 b(from)f(whic)m(h)g(Bash) |
12556 | g(reads)g(the)h(p)s(ossible)e(completions)j(generated)630 | |
12557 | 518 y(b)m(y)33 b(a)g(shell)h(function)f(in)m(v)m(ok)m(ed)h(b)m(y)f(the) | |
12558 | g(programmable)h(completion)g(facilit)m(y)h(\(see)f(Sec-)630 | |
9f178efb | 12559 | 628 y(tion)g(8.6)g([Programmable)g(Completion],)h(page)f(124\).)51 |
45c0f7f8 CR |
12560 | b(Eac)m(h)34 b(arra)m(y)g(elemen)m(t)h(con)m(tains)630 |
12561 | 737 y(one)c(p)s(ossible)f(completion.)150 889 y Fs(COPROC)192 | |
12562 | b Ft(An)27 b(arra)m(y)g(v)-5 b(ariable)28 b(created)g(to)f(hold)g(the)g | |
12563 | (\014le)g(descriptors)g(for)g(output)f(from)h(and)f(input)630 | |
12564 | 998 y(to)31 b(an)f(unnamed)f(copro)s(cess)i(\(see)g(Section)h(3.2.5)g | |
12565 | ([Copro)s(cesses],)f(page)g(15\).)150 1149 y Fs(DIRSTACK)96 | |
12566 | b Ft(An)26 b(arra)m(y)h(v)-5 b(ariable)28 b(con)m(taining)g(the)f | |
12567 | (curren)m(t)f(con)m(ten)m(ts)j(of)e(the)f(directory)i(stac)m(k.)41 | |
12568 | b(Direc-)630 1259 y(tories)33 b(app)s(ear)f(in)g(the)h(stac)m(k)h(in)e | |
12569 | (the)h(order)f(they)h(are)g(displa)m(y)m(ed)g(b)m(y)f(the)h | |
12570 | Fs(dirs)e Ft(builtin.)630 1369 y(Assigning)f(to)h(mem)m(b)s(ers)f(of)g | |
12571 | (this)g(arra)m(y)g(v)-5 b(ariable)31 b(ma)m(y)g(b)s(e)e(used)h(to)h(mo) | |
12572 | s(dify)e(directories)630 1478 y(already)41 b(in)f(the)h(stac)m(k,)k | |
12573 | (but)40 b(the)h Fs(pushd)e Ft(and)h Fs(popd)f Ft(builtins)h(m)m(ust)h | |
12574 | (b)s(e)e(used)h(to)i(add)630 1588 y(and)37 b(remo)m(v)m(e)h | |
12575 | (directories.)63 b(Assignmen)m(t)37 b(to)h(this)f(v)-5 | |
12576 | b(ariable)38 b(will)g(not)f(c)m(hange)i(the)e(cur-)630 | |
12577 | 1697 y(ren)m(t)c(directory)-8 b(.)47 b(If)32 b Fs(DIRSTACK)e | |
12578 | Ft(is)i(unset,)g(it)h(loses)g(its)g(sp)s(ecial)g(prop)s(erties,)f(ev)m | |
12579 | (en)h(if)f(it)h(is)630 1807 y(subsequen)m(tly)d(reset.)150 | |
12580 | 1958 y Fs(EMACS)240 b Ft(If)31 b(Bash)h(\014nds)d(this)j(v)-5 | |
12581 | b(ariable)32 b(in)f(the)h(en)m(vironmen)m(t)g(when)e(the)i(shell)f | |
12582 | (starts)h(with)f(v)-5 b(alue)630 2068 y(`)p Fs(t)p Ft(',)36 | |
12583 | b(it)f(assumes)f(that)h(the)g(shell)f(is)h(running)e(in)h(an)g(Emacs)h | |
12584 | (shell)g(bu\013er)e(and)h(disables)630 2178 y(line)d(editing.)150 | |
12585 | 2329 y Fs(ENV)336 b Ft(Similar)35 b(to)g Fs(BASH_ENV)p | |
12586 | Ft(;)h(used)e(when)g(the)h(shell)g(is)g(in)m(v)m(ok)m(ed)h(in)e | |
12587 | Fl(posix)h Ft(Mo)s(de)g(\(see)g(Sec-)630 2438 y(tion)c(6.11)h([Bash)f | |
9f178efb | 12588 | (POSIX)e(Mo)s(de],)i(page)g(92\).)150 2590 y Fs(EUID)288 |
45c0f7f8 CR |
12589 | b Ft(The)30 b(n)m(umeric)g(e\013ectiv)m(e)j(user)d(id)g(of)g(the)h |
12590 | (curren)m(t)f(user.)40 b(This)30 b(v)-5 b(ariable)31 | |
12591 | b(is)f(readonly)-8 b(.)150 2741 y Fs(FCEDIT)192 b Ft(The)30 | |
12592 | b(editor)h(used)e(as)i(a)g(default)f(b)m(y)h(the)f(`)p | |
37c41ab1 | 12593 | Fs(-e)p Ft(')g(option)h(to)g(the)g Fs(fc)f Ft(builtin)g(command.)150 |
45c0f7f8 | 12594 | 2892 y Fs(FIGNORE)144 b Ft(A)35 b(colon-separated)i(list)f(of)g |
37c41ab1 | 12595 | (su\016xes)e(to)i(ignore)g(when)e(p)s(erforming)g(\014lename)i(comple-) |
45c0f7f8 | 12596 | 630 3002 y(tion.)k(A)27 b(\014lename)g(whose)f(su\016x)g(matc)m(hes)i |
122f603c | 12597 | (one)f(of)g(the)g(en)m(tries)g(in)g Fs(FIGNORE)d Ft(is)j(excluded)630 |
45c0f7f8 | 12598 | 3112 y(from)j(the)g(list)h(of)g(matc)m(hed)g(\014lenames.)41 |
122f603c | 12599 | b(A)30 b(sample)h(v)-5 b(alue)31 b(is)f(`)p Fs(.o:~)p |
45c0f7f8 | 12600 | Ft(')150 3263 y Fs(FUNCNAME)96 b Ft(An)35 b(arra)m(y)i(v)-5 |
37c41ab1 | 12601 | b(ariable)36 b(con)m(taining)h(the)f(names)g(of)g(all)g(shell)g |
45c0f7f8 | 12602 | (functions)g(curren)m(tly)f(in)h(the)630 3373 y(execution)g(call)h |
37c41ab1 | 12603 | (stac)m(k.)57 b(The)34 b(elemen)m(t)j(with)e(index)g(0)h(is)f(the)g |
45c0f7f8 | 12604 | (name)h(of)f(an)m(y)h(curren)m(tly-)630 3482 y(executing)f(shell)f |
9ec5ed66 | 12605 | (function.)51 b(The)34 b(b)s(ottom-most)h(elemen)m(t)g(\(the)g(one)f |
45c0f7f8 | 12606 | (with)g(the)g(highest)630 3592 y(index\))e(is)h Fs("main")p |
9ec5ed66 | 12607 | Ft(.)44 b(This)32 b(v)-5 b(ariable)33 b(exists)g(only)g(when)e(a)i |
45c0f7f8 | 12608 | (shell)f(function)g(is)g(executing.)630 3701 y(Assignmen)m(ts)23 |
9ec5ed66 | 12609 | b(to)h Fs(FUNCNAME)c Ft(ha)m(v)m(e)k(no)f(e\013ect)h(and)e(return)g(an) |
45c0f7f8 | 12610 | g(error)g(status.)39 b(If)22 b Fs(FUNCNAME)630 3811 y |
9ec5ed66 CR |
12611 | Ft(is)30 b(unset,)h(it)g(loses)g(its)f(sp)s(ecial)h(prop)s(erties,)f |
12612 | (ev)m(en)h(if)g(it)g(is)f(subsequen)m(tly)g(reset.)630 | |
45c0f7f8 | 12613 | 3941 y(This)h(v)-5 b(ariable)32 b(can)f(b)s(e)g(used)g(with)g |
9ec5ed66 | 12614 | Fs(BASH_LINENO)d Ft(and)j Fs(BASH_SOURCE)p Ft(.)40 b(Eac)m(h)32 |
45c0f7f8 | 12615 | b(elemen)m(t)630 4051 y(of)g Fs(FUNCNAME)d Ft(has)j(corresp)s(onding)e |
9ec5ed66 | 12616 | (elemen)m(ts)j(in)f Fs(BASH_LINENO)c Ft(and)k Fs(BASH_SOURCE)c |
45c0f7f8 | 12617 | Ft(to)630 4161 y(describ)s(e)39 b(the)h(call)h(stac)m(k.)70 |
9ec5ed66 | 12618 | b(F)-8 b(or)41 b(instance,)i Fs(${FUNCNAME[$i]})35 b |
45c0f7f8 | 12619 | Ft(w)m(as)41 b(called)f(from)g(the)630 4270 y(\014le)27 |
9ec5ed66 CR |
12620 | b Fs(${BASH_SOURCE[$i+1]})21 b Ft(at)27 b(line)h(n)m(um)m(b)s(er)d |
12621 | Fs(${BASH_LINENO[$i]})p Ft(.)34 b(The)27 b Fs(caller)630 | |
45c0f7f8 CR |
12622 | 4380 y Ft(builtin)j(displa)m(ys)g(the)h(curren)m(t)f(call)i(stac)m(k)g |
12623 | (using)d(this)i(information.)150 4531 y Fs(FUNCNEST)96 | |
9ec5ed66 CR |
12624 | b Ft(If)34 b(set)i(to)f(a)h(n)m(umeric)e(v)-5 b(alue)36 |
12625 | b(greater)g(than)e(0,)j(de\014nes)d(a)h(maxim)m(um)g(function)g | |
45c0f7f8 | 12626 | (nesting)630 4641 y(lev)m(el.)42 b(F)-8 b(unction)29 |
9ec5ed66 | 12627 | b(in)m(v)m(o)s(cations)h(that)f(exceed)h(this)e(nesting)h(lev)m(el)h |
45c0f7f8 | 12628 | (will)f(cause)g(the)f(curren)m(t)630 4750 y(command)i(to)h(ab)s(ort.) |
9ec5ed66 CR |
12629 | 150 4902 y Fs(GLOBIGNORE)630 5011 y Ft(A)38 b(colon-separated)i(list)f |
12630 | (of)f(patterns)g(de\014ning)f(the)h(set)g(of)h(\014lenames)f(to)g(b)s | |
12631 | (e)g(ignored)630 5121 y(b)m(y)31 b(\014lename)g(expansion.)43 | |
12632 | b(If)31 b(a)h(\014lename)f(matc)m(hed)h(b)m(y)f(a)g(\014lename)h | |
12633 | (expansion)f(pattern)630 5230 y(also)i(matc)m(hes)g(one)f(of)g(the)g | |
12634 | (patterns)g(in)f Fs(GLOBIGNORE)p Ft(,)f(it)i(is)g(remo)m(v)m(ed)h(from) | |
12635 | e(the)h(list)h(of)630 5340 y(matc)m(hes.)p eop end | |
9f178efb CR |
12636 | %%Page: 74 80 |
12637 | TeXDict begin 74 79 bop 150 -116 a Ft(74)2572 b(Bash)31 | |
9ec5ed66 CR |
12638 | b(Reference)g(Man)m(ual)150 299 y Fs(GROUPS)192 b Ft(An)36 |
12639 | b(arra)m(y)g(v)-5 b(ariable)37 b(con)m(taining)g(the)f(list)h(of)f | |
12640 | (groups)g(of)g(whic)m(h)f(the)i(curren)m(t)e(user)h(is)g(a)630 | |
12641 | 408 y(mem)m(b)s(er.)47 b(Assignmen)m(ts)33 b(to)g Fs(GROUPS)e | |
12642 | Ft(ha)m(v)m(e)j(no)f(e\013ect)h(and)e(return)g(an)g(error)g(status.)48 | |
12643 | b(If)630 518 y Fs(GROUPS)29 b Ft(is)h(unset,)g(it)h(loses)g(its)g(sp)s | |
12644 | (ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f | |
12645 | (reset.)150 682 y Fs(histchars)630 792 y Ft(Up)c(to)g(three)g(c)m | |
12646 | (haracters)i(whic)m(h)d(con)m(trol)j(history)d(expansion,)i(quic)m(k)g | |
12647 | (substitution,)g(and)630 902 y(tok)m(enization)k(\(see)f(Section)f(9.3) | |
9f178efb | 12648 | h([History)f(In)m(teraction],)i(page)f(135\).)41 b(The)29 |
9ec5ed66 CR |
12649 | b(\014rst)e(c)m(harac-)630 1011 y(ter)j(is)f(the)g Fq(history)g |
12650 | (expansion)g Ft(c)m(haracter,)j(that)e(is,)f(the)h(c)m(haracter)h(whic) | |
12651 | m(h)d(signi\014es)i(the)630 1121 y(start)25 b(of)f(a)h(history)f | |
12652 | (expansion,)i(normally)e(`)p Fs(!)p Ft('.)39 b(The)24 | |
12653 | b(second)g(c)m(haracter)i(is)e(the)g(c)m(haracter)630 | |
12654 | 1230 y(whic)m(h)36 b(signi\014es)g(`quic)m(k)h(substitution')f(when)f | |
12655 | (seen)h(as)g(the)g(\014rst)f(c)m(haracter)j(on)e(a)g(line,)630 | |
12656 | 1340 y(normally)27 b(`)p Fs(^)p Ft('.)39 b(The)26 b(optional)i(third)d | |
12657 | (c)m(haracter)j(is)e(the)h(c)m(haracter)h(whic)m(h)e(indicates)h(that) | |
12658 | 630 1450 y(the)34 b(remainder)f(of)h(the)g(line)g(is)f(a)h(commen)m(t)h | |
12659 | (when)e(found)f(as)i(the)g(\014rst)f(c)m(haracter)i(of)f(a)630 | |
12660 | 1559 y(w)m(ord,)i(usually)f(`)p Fs(#)p Ft('.)55 b(The)34 | |
12661 | b(history)h(commen)m(t)h(c)m(haracter)h(causes)e(history)g | |
12662 | (substitution)630 1669 y(to)27 b(b)s(e)f(skipp)s(ed)f(for)i(the)f | |
12663 | (remaining)h(w)m(ords)f(on)h(the)f(line.)40 b(It)27 b(do)s(es)f(not)h | |
12664 | (necessarily)g(cause)630 1778 y(the)k(shell)f(parser)g(to)h(treat)g | |
12665 | (the)g(rest)g(of)f(the)h(line)f(as)h(a)g(commen)m(t.)150 | |
12666 | 1943 y Fs(HISTCMD)144 b Ft(The)35 b(history)h(n)m(um)m(b)s(er,)g(or)f | |
12667 | (index)g(in)h(the)g(history)f(list,)j(of)e(the)g(curren)m(t)f(command.) | |
12668 | 56 b(If)630 2052 y Fs(HISTCMD)28 b Ft(is)h(unset,)h(it)g(loses)h(its)f | |
12669 | (sp)s(ecial)g(prop)s(erties,)g(ev)m(en)g(if)g(it)g(is)g(subsequen)m | |
12670 | (tly)f(reset.)150 2217 y Fs(HISTCONTROL)630 2326 y Ft(A)40 | |
12671 | b(colon-separated)i(list)f(of)f(v)-5 b(alues)40 b(con)m(trolling)i(ho)m | |
12672 | (w)e(commands)g(are)h(sa)m(v)m(ed)g(on)f(the)630 2436 | |
12673 | y(history)29 b(list.)41 b(If)28 b(the)h(list)h(of)f(v)-5 | |
12674 | b(alues)29 b(includes)f(`)p Fs(ignorespace)p Ft(',)f(lines)i(whic)m(h)g | |
12675 | (b)s(egin)f(with)630 2545 y(a)39 b(space)g(c)m(haracter)i(are)e(not)g | |
12676 | (sa)m(v)m(ed)g(in)g(the)g(history)f(list.)66 b(A)39 b(v)-5 | |
12677 | b(alue)39 b(of)g(`)p Fs(ignoredups)p Ft(')630 2655 y(causes)34 | |
12678 | b(lines)h(whic)m(h)f(matc)m(h)h(the)f(previous)f(history)h(en)m(try)h | |
12679 | (to)g(not)f(b)s(e)f(sa)m(v)m(ed.)53 b(A)34 b(v)-5 b(alue)630 | |
12680 | 2765 y(of)32 b(`)p Fs(ignoreboth)p Ft(')d(is)j(shorthand)e(for)i(`)p | |
12681 | Fs(ignorespace)p Ft(')d(and)i(`)p Fs(ignoredups)p Ft('.)42 | |
12682 | b(A)32 b(v)-5 b(alue)32 b(of)630 2874 y(`)p Fs(erasedups)p | |
12683 | Ft(')f(causes)i(all)h(previous)f(lines)g(matc)m(hing)h(the)f(curren)m | |
12684 | (t)g(line)g(to)h(b)s(e)e(remo)m(v)m(ed)630 2984 y(from)42 | |
12685 | b(the)h(history)f(list)i(b)s(efore)e(that)h(line)g(is)g(sa)m(v)m(ed.)78 | |
12686 | b(An)m(y)43 b(v)-5 b(alue)43 b(not)g(in)f(the)h(ab)s(o)m(v)m(e)630 | |
12687 | 3093 y(list)35 b(is)g(ignored.)53 b(If)34 b Fs(HISTCONTROL)e | |
12688 | Ft(is)i(unset,)i(or)e(do)s(es)h(not)g(include)f(a)h(v)-5 | |
12689 | b(alid)35 b(v)-5 b(alue,)36 b(all)630 3203 y(lines)30 | |
37c41ab1 CR |
12690 | b(read)g(b)m(y)g(the)g(shell)g(parser)g(are)g(sa)m(v)m(ed)h(on)f(the)g |
12691 | (history)g(list,)h(sub)5 b(ject)30 b(to)g(the)g(v)-5 | |
9ec5ed66 | 12692 | b(alue)630 3313 y(of)42 b Fs(HISTIGNORE)p Ft(.)73 b(The)42 |
37c41ab1 | 12693 | b(second)g(and)g(subsequen)m(t)f(lines)h(of)h(a)f(m)m(ulti-line)h(comp) |
9ec5ed66 | 12694 | s(ound)630 3422 y(command)33 b(are)h(not)g(tested,)i(and)d(are)h(added) |
8f714a7c | 12695 | f(to)h(the)g(history)g(regardless)g(of)g(the)f(v)-5 b(alue)630 |
9ec5ed66 | 12696 | 3532 y(of)31 b Fs(HISTCONTROL)p Ft(.)150 3696 y Fs(HISTFILE)96 |
8f714a7c CR |
12697 | b Ft(The)27 b(name)h(of)g(the)g(\014le)g(to)h(whic)m(h)f(the)g(command) |
12698 | f(history)h(is)g(sa)m(v)m(ed.)41 b(The)27 b(default)h(v)-5 | |
9ec5ed66 CR |
12699 | b(alue)630 3806 y(is)30 b(`)p Fs(~/.bash_history)p Ft('.)150 |
12700 | 3970 y Fs(HISTFILESIZE)630 4080 y Ft(The)c(maxim)m(um)f(n)m(um)m(b)s | |
8f714a7c | 12701 | (er)g(of)h(lines)h(con)m(tained)g(in)f(the)g(history)g(\014le.)39 |
45c0f7f8 CR |
12702 | b(When)26 b(this)g(v)-5 b(ariable)630 4189 y(is)25 b(assigned)h(a)g(v) |
12703 | -5 b(alue,)27 b(the)f(history)f(\014le)h(is)f(truncated,)i(if)e | |
12704 | (necessary)-8 b(,)28 b(to)e(con)m(tain)g(no)g(more)630 | |
12705 | 4299 y(than)37 b(that)h(n)m(um)m(b)s(er)d(of)j(lines)f(b)m(y)g(remo)m | |
12706 | (ving)h(the)f(oldest)h(en)m(tries.)62 b(The)37 b(history)g(\014le)g(is) | |
12707 | 630 4408 y(also)i(truncated)f(to)h(this)e(size)i(after)g(writing)f(it)g | |
9f178efb CR |
12708 | (when)f(a)h(shell)h(exits.)64 b(If)37 b(the)h(v)-5 b(alue)39 |
12709 | b(is)630 4518 y(0,)g(the)e(history)f(\014le)h(is)g(truncated)f(to)i | |
12710 | (zero)f(size.)60 b(Non-n)m(umeric)37 b(v)-5 b(alues)37 | |
12711 | b(and)f(n)m(umeric)630 4628 y(v)-5 b(alues)31 b(less)f(than)g(zero)h | |
12712 | (inhibit)f(truncation.)41 b(The)29 b(shell)i(sets)f(the)h(default)f(v) | |
12713 | -5 b(alue)31 b(to)g(the)630 4737 y(v)-5 b(alue)31 b(of)f | |
12714 | Fs(HISTSIZE)f Ft(after)h(reading)h(an)m(y)g(startup)f(\014les.)150 | |
45c0f7f8 | 12715 | 4902 y Fs(HISTIGNORE)630 5011 y Ft(A)j(colon-separated)h(list)f(of)g |
09767ff0 | 12716 | (patterns)f(used)g(to)h(decide)g(whic)m(h)f(command)g(lines)h(should) |
45c0f7f8 | 12717 | 630 5121 y(b)s(e)f(sa)m(v)m(ed)h(on)g(the)f(history)h(list.)47 |
09767ff0 | 12718 | b(Eac)m(h)33 b(pattern)g(is)f(anc)m(hored)h(at)g(the)f(b)s(eginning)g |
45c0f7f8 | 12719 | (of)h(the)630 5230 y(line)43 b(and)e(m)m(ust)h(matc)m(h)h(the)g |
09767ff0 | 12720 | (complete)h(line)e(\(no)h(implicit)g(`)p Fs(*)p Ft(')f(is)g(app)s |
45c0f7f8 | 12721 | (ended\).)75 b(Eac)m(h)630 5340 y(pattern)42 b(is)g(tested)g(against)h |
09767ff0 | 12722 | (the)f(line)g(after)g(the)g(c)m(hec)m(ks)h(sp)s(eci\014ed)e(b)m(y)h |
45c0f7f8 | 12723 | Fs(HISTCONTROL)p eop end |
9f178efb CR |
12724 | %%Page: 75 81 |
12725 | TeXDict begin 75 80 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
12726 | b(Shell)30 b(V)-8 b(ariables)2459 b(75)630 299 y(are)37 | |
45c0f7f8 CR |
12727 | b(applied.)59 b(In)36 b(addition)h(to)g(the)g(normal)g(shell)f(pattern) |
12728 | h(matc)m(hing)h(c)m(haracters,)i(`)p Fs(&)p Ft(')630 | |
12729 | 408 y(matc)m(hes)d(the)f(previous)g(history)g(line.)57 | |
12730 | b(`)p Fs(&)p Ft(')36 b(ma)m(y)h(b)s(e)e(escap)s(ed)h(using)g(a)g(bac)m | |
12731 | (kslash;)k(the)630 518 y(bac)m(kslash)34 b(is)g(remo)m(v)m(ed)h(b)s | |
12732 | (efore)e(attempting)i(a)g(matc)m(h.)51 b(The)34 b(second)f(and)h | |
12733 | (subsequen)m(t)630 628 y(lines)e(of)h(a)g(m)m(ulti-line)g(comp)s(ound)e | |
12734 | (command)h(are)h(not)f(tested,)i(and)e(are)g(added)g(to)h(the)630 | |
12735 | 737 y(history)d(regardless)h(of)g(the)f(v)-5 b(alue)31 | |
12736 | b(of)g Fs(HISTIGNORE)p Ft(.)630 876 y Fs(HISTIGNORE)20 | |
37c41ab1 CR |
12737 | b Ft(subsumes)g(the)j(function)f(of)h Fs(HISTCONTROL)p |
12738 | Ft(.)35 b(A)23 b(pattern)f(of)h(`)p Fs(&)p Ft(')g(is)f(iden)m(tical)630 | |
45c0f7f8 | 12739 | 985 y(to)k Fs(ignoredups)p Ft(,)e(and)h(a)h(pattern)g(of)f(`)p |
37c41ab1 | 12740 | Fs([)31 b(]*)p Ft(')25 b(is)h(iden)m(tical)h(to)f Fs(ignorespace)p |
45c0f7f8 | 12741 | Ft(.)36 b(Com)m(bining)630 1095 y(these)30 b(t)m(w)m(o)h(patterns,)f |
37c41ab1 | 12742 | (separating)g(them)g(with)f(a)h(colon,)h(pro)m(vides)e(the)h |
45c0f7f8 CR |
12743 | (functionalit)m(y)h(of)630 1204 y Fs(ignoreboth)p Ft(.)150 |
12744 | 1372 y Fs(HISTSIZE)96 b Ft(The)37 b(maxim)m(um)g(n)m(um)m(b)s(er)e(of)j | |
12745 | (commands)f(to)g(remem)m(b)s(er)g(on)g(the)g(history)g(list.)62 | |
12746 | b(If)37 b(the)630 1481 y(v)-5 b(alue)26 b(is)g(0,)i(commands)d(are)h | |
12747 | (not)h(sa)m(v)m(ed)g(in)e(the)h(history)g(list.)40 b(Numeric)26 | |
12748 | b(v)-5 b(alues)26 b(less)g(than)630 1591 y(zero)i(result)e(in)h(ev)m | |
12749 | (ery)g(command)g(b)s(eing)f(sa)m(v)m(ed)i(on)f(the)g(history)f(list)i | |
12750 | (\(there)f(is)g(no)g(limit\).)630 1700 y(The)j(shell)g(sets)h(the)g | |
12751 | (default)f(v)-5 b(alue)31 b(to)g(500)h(after)f(reading)f(an)m(y)h | |
12752 | (startup)f(\014les.)150 1868 y Fs(HISTTIMEFORMAT)630 | |
12753 | 1977 y Ft(If)44 b(this)g(v)-5 b(ariable)45 b(is)f(set)g(and)g(not)g(n)m | |
12754 | (ull,)k(its)d(v)-5 b(alue)44 b(is)g(used)g(as)g(a)h(format)f(string)g | |
12755 | (for)630 2087 y Fq(strftime)c Ft(to)35 b(prin)m(t)f(the)h(time)g(stamp) | |
12756 | f(asso)s(ciated)i(with)f(eac)m(h)g(history)g(en)m(try)f(displa)m(y)m | |
12757 | (ed)630 2196 y(b)m(y)g(the)f Fs(history)f Ft(builtin.)50 | |
12758 | b(If)33 b(this)h(v)-5 b(ariable)34 b(is)g(set,)h(time)f(stamps)g(are)g | |
12759 | (written)f(to)i(the)630 2306 y(history)26 b(\014le)g(so)g(they)g(ma)m | |
12760 | (y)h(b)s(e)e(preserv)m(ed)g(across)i(shell)f(sessions.)39 | |
12761 | b(This)25 b(uses)h(the)g(history)630 2416 y(commen)m(t)31 | |
12762 | b(c)m(haracter)h(to)f(distinguish)f(timestamps)h(from)f(other)g | |
12763 | (history)h(lines.)150 2583 y Fs(HOSTFILE)96 b Ft(Con)m(tains)39 | |
12764 | b(the)f(name)g(of)h(a)g(\014le)f(in)g(the)g(same)h(format)g(as)f(`)p | |
12765 | Fs(/etc/hosts)p Ft(')e(that)j(should)630 2693 y(b)s(e)i(read)h(when)f | |
12766 | (the)i(shell)f(needs)f(to)i(complete)h(a)e(hostname.)76 | |
12767 | b(The)42 b(list)g(of)g(p)s(ossible)630 2802 y(hostname)26 | |
12768 | b(completions)g(ma)m(y)h(b)s(e)d(c)m(hanged)j(while)e(the)h(shell)g(is) | |
12769 | f(running;)h(the)g(next)f(time)630 2912 y(hostname)37 | |
12770 | b(completion)i(is)e(attempted)h(after)g(the)f(v)-5 b(alue)37 | |
12771 | b(is)h(c)m(hanged,)h(Bash)e(adds)g(the)630 3021 y(con)m(ten)m(ts)43 | |
12772 | b(of)f(the)f(new)g(\014le)h(to)g(the)f(existing)i(list.)74 | |
12773 | b(If)41 b Fs(HOSTFILE)e Ft(is)i(set,)k(but)c(has)g(no)630 | |
12774 | 3131 y(v)-5 b(alue,)29 b(or)e(do)s(es)h(not)g(name)f(a)h(readable)g | |
12775 | (\014le,)h(Bash)f(attempts)g(to)g(read)g(`)p Fs(/etc/hosts)p | |
12776 | Ft(')d(to)630 3240 y(obtain)j(the)g(list)h(of)f(p)s(ossible)f(hostname) | |
12777 | h(completions.)41 b(When)28 b Fs(HOSTFILE)e Ft(is)i(unset,)g(the)630 | |
12778 | 3350 y(hostname)j(list)g(is)f(cleared.)150 3517 y Fs(HOSTNAME)96 | |
12779 | b Ft(The)30 b(name)g(of)h(the)f(curren)m(t)h(host.)150 | |
12780 | 3685 y Fs(HOSTTYPE)96 b Ft(A)30 b(string)h(describing)f(the)g(mac)m | |
12781 | (hine)h(Bash)g(is)f(running)f(on.)150 3852 y Fs(IGNOREEOF)630 | |
12782 | 3961 y Ft(Con)m(trols)e(the)h(action)g(of)f(the)g(shell)g(on)g(receipt) | |
8f714a7c | 12783 | h(of)f(an)g Fs(EOF)f Ft(c)m(haracter)i(as)g(the)f(sole)h(input.)630 |
45c0f7f8 | 12784 | 4071 y(If)i(set,)i(the)f(v)-5 b(alue)32 b(denotes)f(the)g(n)m(um)m(b)s |
8f714a7c | 12785 | (er)f(of)h(consecutiv)m(e)i Fs(EOF)d Ft(c)m(haracters)i(that)f(can)h(b) |
45c0f7f8 | 12786 | s(e)630 4181 y(read)40 b(as)f(the)h(\014rst)f(c)m(haracter)i(on)f(an)f |
8f714a7c | 12787 | (input)g(line)h(b)s(efore)f(the)h(shell)g(will)g(exit.)70 |
45c0f7f8 | 12788 | b(If)39 b(the)630 4290 y(v)-5 b(ariable)38 b(exists)f(but)f(do)s(es)g |
3eb2d94a | 12789 | (not)h(ha)m(v)m(e)h(a)g(n)m(umeric)e(v)-5 b(alue)37 b(\(or)h(has)e(no)h |
45c0f7f8 | 12790 | (v)-5 b(alue\))37 b(then)g(the)630 4400 y(default)31 |
8f714a7c CR |
12791 | b(is)g(10.)43 b(If)30 b(the)h(v)-5 b(ariable)31 b(do)s(es)g(not)g |
12792 | (exist,)h(then)e Fs(EOF)g Ft(signi\014es)h(the)g(end)f(of)h(input)630 | |
45c0f7f8 CR |
12793 | 4509 y(to)g(the)g(shell.)41 b(This)29 b(is)i(only)f(in)g(e\013ect)i |
12794 | (for)e(in)m(teractiv)m(e)j(shells.)150 4677 y Fs(INPUTRC)144 | |
37c41ab1 | 12795 | b Ft(The)68 b(name)h(of)f(the)h(Readline)g(initialization)j(\014le,)78 |
45c0f7f8 CR |
12796 | b(o)m(v)m(erriding)69 b(the)g(default)g(of)630 4786 y(`)p |
12797 | Fs(~/.inputrc)p Ft('.)150 4954 y Fs(LANG)288 b Ft(Used)28 | |
37c41ab1 | 12798 | b(to)h(determine)f(the)g(lo)s(cale)h(category)h(for)e(an)m(y)h |
45c0f7f8 | 12799 | (category)h(not)e(sp)s(eci\014cally)g(selected)630 5063 |
37c41ab1 | 12800 | y(with)i(a)h(v)-5 b(ariable)31 b(starting)g(with)f Fs(LC_)p |
45c0f7f8 | 12801 | Ft(.)150 5230 y Fs(LC_ALL)192 b Ft(This)28 b(v)-5 b(ariable)29 |
09767ff0 CR |
12802 | b(o)m(v)m(errides)h(the)f(v)-5 b(alue)29 b(of)g Fs(LANG)f |
12803 | Ft(and)g(an)m(y)h(other)g Fs(LC_)f Ft(v)-5 b(ariable)29 | |
45c0f7f8 CR |
12804 | b(sp)s(ecifying)630 5340 y(a)i(lo)s(cale)h(category)-8 |
12805 | b(.)p eop end | |
9f178efb CR |
12806 | %%Page: 76 82 |
12807 | TeXDict begin 76 81 bop 150 -116 a Ft(76)2572 b(Bash)31 | |
45c0f7f8 CR |
12808 | b(Reference)g(Man)m(ual)150 299 y Fs(LC_COLLATE)630 408 |
12809 | y Ft(This)37 b(v)-5 b(ariable)38 b(determines)g(the)g(collation)i | |
12810 | (order)d(used)g(when)f(sorting)i(the)g(results)g(of)630 | |
12811 | 518 y(\014lename)e(expansion,)i(and)e(determines)g(the)h(b)s(eha)m | |
12812 | (vior)f(of)g(range)h(expressions,)h(equiv-)630 628 y(alence)e(classes,) | |
12813 | h(and)e(collating)i(sequences)e(within)f(\014lename)h(expansion)g(and)f | |
12814 | (pattern)630 737 y(matc)m(hing)d(\(see)h(Section)f(3.5.8)h([Filename)g | |
9f178efb | 12815 | (Expansion],)e(page)h(29\).)150 894 y Fs(LC_CTYPE)96 |
45c0f7f8 CR |
12816 | b Ft(This)36 b(v)-5 b(ariable)37 b(determines)f(the)h(in)m |
12817 | (terpretation)h(of)f(c)m(haracters)h(and)e(the)g(b)s(eha)m(vior)h(of) | |
12818 | 630 1003 y(c)m(haracter)46 b(classes)g(within)e(\014lename)h(expansion) | |
12819 | g(and)f(pattern)h(matc)m(hing)h(\(see)f(Sec-)630 1113 | |
9f178efb | 12820 | y(tion)31 b(3.5.8)h([Filename)g(Expansion],)e(page)h(29\).)150 |
45c0f7f8 | 12821 | 1270 y Fs(LC_MESSAGES)630 1379 y Ft(This)25 b(v)-5 b(ariable)27 |
9ec5ed66 | 12822 | b(determines)f(the)g(lo)s(cale)i(used)d(to)i(translate)g(double-quoted) |
45c0f7f8 | 12823 | f(strings)g(pre-)630 1489 y(ceded)31 b(b)m(y)f(a)h(`)p |
9ec5ed66 | 12824 | Fs($)p Ft(')f(\(see)h(Section)h(3.1.2.5)g([Lo)s(cale)g(T)-8 |
45c0f7f8 CR |
12825 | b(ranslation],)32 b(page)f(7\).)150 1645 y Fs(LC_NUMERIC)630 |
12826 | 1755 y Ft(This)f(v)-5 b(ariable)31 b(determines)f(the)h(lo)s(cale)h | |
9ec5ed66 | 12827 | (category)g(used)e(for)g(n)m(um)m(b)s(er)f(formatting.)150 |
45c0f7f8 | 12828 | 1911 y Fs(LINENO)192 b Ft(The)30 b(line)h(n)m(um)m(b)s(er)e(in)h(the)g |
9ec5ed66 | 12829 | (script)h(or)f(shell)g(function)h(curren)m(tly)f(executing.)150 |
45c0f7f8 | 12830 | 2068 y Fs(LINES)240 b Ft(Used)22 b(b)m(y)f(the)h Fs(select)e |
74d0116b | 12831 | Ft(command)h(to)h(determine)g(the)g(column)f(length)i(for)e(prin)m |
45c0f7f8 | 12832 | (ting)g(selec-)630 2178 y(tion)26 b(lists.)40 b(Automatically)29 |
74d0116b | 12833 | b(set)d(b)m(y)g(an)g(in)m(teractiv)m(e)j(shell)d(up)s(on)f(receipt)h |
45c0f7f8 | 12834 | (of)h(a)f Fs(SIGWINCH)p Ft(.)150 2334 y Fs(MACHTYPE)96 |
74d0116b CR |
12835 | b Ft(A)26 b(string)g(that)h(fully)f(describ)s(es)f(the)h(system)g(t)m |
12836 | (yp)s(e)h(on)f(whic)m(h)f(Bash)i(is)f(executing,)i(in)e(the)630 | |
45c0f7f8 CR |
12837 | 2444 y(standard)k Fl(gnu)g Fq(cpu-compan)m(y-system)h |
12838 | Ft(format.)150 2600 y Fs(MAILCHECK)630 2710 y Ft(Ho)m(w)d(often)g(\(in) | |
5cdaaf76 | 12839 | g(seconds\))g(that)g(the)f(shell)h(should)f(c)m(hec)m(k)i(for)e(mail)h |
45c0f7f8 | 12840 | (in)f(the)h(\014les)g(sp)s(eci\014ed)630 2819 y(in)i(the)h |
5cdaaf76 CR |
12841 | Fs(MAILPATH)e Ft(or)i Fs(MAIL)e Ft(v)-5 b(ariables.)43 |
12842 | b(The)30 b(default)h(is)f(60)i(seconds.)42 b(When)30 | |
45c0f7f8 | 12843 | b(it)h(is)g(time)630 2929 y(to)37 b(c)m(hec)m(k)h(for)e(mail,)j(the)e |
5cdaaf76 | 12844 | (shell)f(do)s(es)g(so)h(b)s(efore)f(displa)m(ying)h(the)f(primary)g |
45c0f7f8 | 12845 | (prompt.)57 b(If)630 3039 y(this)37 b(v)-5 b(ariable)38 |
9d2b70f0 | 12846 | b(is)f(unset,)h(or)f(set)h(to)g(a)f(v)-5 b(alue)38 b(that)f(is)g(not)h |
45c0f7f8 | 12847 | (a)f(n)m(um)m(b)s(er)f(greater)i(than)f(or)630 3148 y(equal)31 |
9d2b70f0 | 12848 | b(to)g(zero,)g(the)g(shell)g(disables)f(mail)h(c)m(hec)m(king.)150 |
45c0f7f8 | 12849 | 3305 y Fs(MAPFILE)144 b Ft(An)35 b(arra)m(y)h(v)-5 b(ariable)36 |
5cdaaf76 | 12850 | b(created)g(to)h(hold)e(the)g(text)i(read)e(b)m(y)g(the)h |
45c0f7f8 CR |
12851 | Fs(mapfile)d Ft(builtin)i(when)630 3414 y(no)30 b(v)-5 |
12852 | b(ariable)31 b(name)g(is)f(supplied.)150 3571 y Fs(OLDPWD)192 | |
5cdaaf76 | 12853 | b Ft(The)30 b(previous)g(w)m(orking)g(directory)h(as)g(set)g(b)m(y)f |
45c0f7f8 | 12854 | (the)h Fs(cd)e Ft(builtin.)150 3727 y Fs(OPTERR)192 b |
5cdaaf76 CR |
12855 | Ft(If)35 b(set)i(to)f(the)h(v)-5 b(alue)36 b(1,)i(Bash)e(displa)m(ys)g |
12856 | (error)f(messages)i(generated)g(b)m(y)f(the)g Fs(getopts)630 | |
45c0f7f8 | 12857 | 3837 y Ft(builtin)30 b(command.)150 3994 y Fs(OSTYPE)192 |
5cdaaf76 | 12858 | b Ft(A)30 b(string)h(describing)f(the)g(op)s(erating)h(system)g(Bash)f |
45c0f7f8 | 12859 | (is)h(running)d(on.)150 4150 y Fs(PIPESTATUS)630 4260 |
5cdaaf76 | 12860 | y Ft(An)23 b(arra)m(y)h(v)-5 b(ariable)24 b(\(see)h(Section)f(6.7)h |
9f178efb | 12861 | ([Arra)m(ys],)g(page)f(88\))h(con)m(taining)g(a)f(list)g(of)g(exit)g |
45c0f7f8 | 12862 | (sta-)630 4369 y(tus)h(v)-5 b(alues)27 b(from)e(the)h(pro)s(cesses)g |
5cdaaf76 | 12863 | (in)f(the)h(most-recen)m(tly-executed)j(foreground)c(pip)s(eline)630 |
45c0f7f8 CR |
12864 | 4479 y(\(whic)m(h)30 b(ma)m(y)h(con)m(tain)h(only)f(a)f(single)h |
12865 | (command\).)150 4635 y Fs(POSIXLY_CORRECT)630 4745 y | |
122f603c CR |
12866 | Ft(If)h(this)g(v)-5 b(ariable)34 b(is)e(in)g(the)h(en)m(vironmen)m(t)g |
12867 | (when)e(Bash)i(starts,)g(the)g(shell)g(en)m(ters)g Fl(posix)630 | |
45c0f7f8 | 12868 | 4855 y Ft(mo)s(de)22 b(\(see)h(Section)g(6.11)h([Bash)e(POSIX)f(Mo)s |
9f178efb | 12869 | (de],)k(page)e(92\))g(b)s(efore)f(reading)g(the)g(startup)630 |
45c0f7f8 | 12870 | 4964 y(\014les,)32 b(as)f(if)h(the)f(`)p Fs(--posix)p |
09767ff0 | 12871 | Ft(')f(in)m(v)m(o)s(cation)j(option)f(had)f(b)s(een)g(supplied.)42 |
45c0f7f8 | 12872 | b(If)31 b(it)h(is)f(set)h(while)630 5074 y(the)f(shell)f(is)h(running,) |
122f603c | 12873 | d(Bash)j(enables)g Fl(posix)e Ft(mo)s(de,)h(as)h(if)f(the)h(command)870 |
45c0f7f8 CR |
12874 | 5207 y Fs(set)47 b(-o)g(posix)630 5340 y Ft(had)30 b(b)s(een)f |
12875 | (executed.)p eop end | |
9f178efb CR |
12876 | %%Page: 77 83 |
12877 | TeXDict begin 77 82 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
12878 | b(Shell)30 b(V)-8 b(ariables)2459 b(77)150 299 y Fs(PPID)288 | |
45c0f7f8 CR |
12879 | b Ft(The)30 b(pro)s(cess)g Fl(id)g Ft(of)h(the)f(shell's)h(paren)m(t)g |
12880 | (pro)s(cess.)40 b(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 | |
12881 | b(.)150 451 y Fs(PROMPT_COMMAND)630 560 y Ft(If)32 b(set,)h(the)f(v)-5 | |
12882 | b(alue)33 b(is)f(in)m(terpreted)g(as)g(a)h(command)f(to)h(execute)g(b)s | |
12883 | (efore)f(the)g(prin)m(ting)g(of)630 670 y(eac)m(h)g(primary)d(prompt)g | |
12884 | (\()p Fs($PS1)p Ft(\).)150 822 y Fs(PROMPT_DIRTRIM)630 | |
12885 | 931 y Ft(If)e(set)g(to)h(a)g(n)m(um)m(b)s(er)e(greater)i(than)f(zero,)i | |
12886 | (the)e(v)-5 b(alue)28 b(is)f(used)g(as)g(the)h(n)m(um)m(b)s(er)e(of)h | |
12887 | (trailing)630 1041 y(directory)35 b(comp)s(onen)m(ts)g(to)h(retain)f | |
12888 | (when)f(expanding)g(the)h Fs(\\w)f Ft(and)g Fs(\\W)g | |
12889 | Ft(prompt)g(string)630 1150 y(escap)s(es)21 b(\(see)h(Section)f(6.9)h | |
9f178efb | 12890 | ([Con)m(trolling)g(the)f(Prompt],)h(page)f(91\).)39 b(Characters)21 |
45c0f7f8 CR |
12891 | b(remo)m(v)m(ed)630 1260 y(are)31 b(replaced)g(with)f(an)g(ellipsis.) |
12892 | 150 1412 y Fs(PS3)336 b Ft(The)34 b(v)-5 b(alue)35 b(of)f(this)g(v)-5 | |
12893 | b(ariable)35 b(is)g(used)e(as)i(the)f(prompt)g(for)g(the)g | |
12894 | Fs(select)f Ft(command.)52 b(If)630 1521 y(this)30 b(v)-5 | |
12895 | b(ariable)31 b(is)g(not)f(set,)i(the)e Fs(select)f Ft(command)h | |
12896 | (prompts)f(with)h(`)p Fs(#?)g Ft(')150 1673 y Fs(PS4)336 | |
12897 | b Ft(The)20 b(v)-5 b(alue)22 b(is)e(the)h(prompt)f(prin)m(ted)h(b)s | |
12898 | (efore)f(the)h(command)g(line)g(is)g(ec)m(ho)s(ed)g(when)f(the)h(`)p | |
12899 | Fs(-x)p Ft(')630 1783 y(option)32 b(is)f(set)h(\(see)g(Section)h(4.3.1) | |
9f178efb | 12900 | g([The)e(Set)g(Builtin],)i(page)f(58\).)45 b(The)31 b(\014rst)f(c)m |
45c0f7f8 CR |
12901 | (haracter)630 1892 y(of)k Fs(PS4)g Ft(is)g(replicated)i(m)m(ultiple)f |
12902 | (times,)h(as)e(necessary)-8 b(,)37 b(to)e(indicate)g(m)m(ultiple)g(lev) | |
12903 | m(els)h(of)630 2002 y(indirection.)41 b(The)30 b(default)h(is)f(`)p | |
12904 | Fs(+)g Ft('.)150 2153 y Fs(PWD)336 b Ft(The)30 b(curren)m(t)g(w)m | |
37c41ab1 | 12905 | (orking)h(directory)g(as)f(set)h(b)m(y)f(the)h Fs(cd)f |
45c0f7f8 | 12906 | Ft(builtin.)150 2305 y Fs(RANDOM)192 b Ft(Eac)m(h)30 |
220537f2 | 12907 | b(time)g(this)f(parameter)g(is)g(referenced,)h(a)f(random)g(in)m(teger) |
45c0f7f8 | 12908 | h(b)s(et)m(w)m(een)g(0)f(and)g(32767)630 2415 y(is)i(generated.)43 |
37c41ab1 CR |
12909 | b(Assigning)31 b(a)g(v)-5 b(alue)31 b(to)g(this)g(v)-5 |
12910 | b(ariable)31 b(seeds)g(the)g(random)f(n)m(um)m(b)s(er)f(gen-)630 | |
45c0f7f8 | 12911 | 2524 y(erator.)150 2676 y Fs(READLINE_LINE)630 2786 y |
5cdaaf76 CR |
12912 | Ft(The)e(con)m(ten)m(ts)i(of)f(the)g(Readline)g(line)g(bu\013er,)f(for) |
12913 | h(use)f(with)g(`)p Fs(bind)j(-x)p Ft(')d(\(see)h(Section)h(4.2)630 | |
9f178efb | 12914 | 2895 y([Bash)i(Builtins],)g(page)g(48\).)150 3047 y Fs(READLINE_POINT) |
45c0f7f8 | 12915 | 630 3157 y Ft(The)23 b(p)s(osition)g(of)g(the)h(insertion)f(p)s(oin)m |
5cdaaf76 | 12916 | (t)g(in)g(the)g(Readline)h(line)f(bu\013er,)h(for)f(use)g(with)g(`)p |
45c0f7f8 | 12917 | Fs(bind)630 3266 y(-x)p Ft(')30 b(\(see)h(Section)h(4.2)f([Bash)g |
9f178efb | 12918 | (Builtins],)g(page)g(48\).)150 3418 y Fs(REPLY)240 b |
5cdaaf76 | 12919 | Ft(The)30 b(default)g(v)-5 b(ariable)32 b(for)e(the)g |
45c0f7f8 | 12920 | Fs(read)g Ft(builtin.)150 3570 y Fs(SECONDS)144 b Ft(This)40 |
5cdaaf76 CR |
12921 | b(v)-5 b(ariable)41 b(expands)f(to)h(the)g(n)m(um)m(b)s(er)e(of)i |
12922 | (seconds)g(since)g(the)f(shell)h(w)m(as)g(started.)630 | |
45c0f7f8 | 12923 | 3679 y(Assignmen)m(t)i(to)g(this)g(v)-5 b(ariable)43 |
5cdaaf76 | 12924 | b(resets)g(the)g(coun)m(t)g(to)g(the)g(v)-5 b(alue)43 |
45c0f7f8 | 12925 | b(assigned,)j(and)c(the)630 3789 y(expanded)35 b(v)-5 |
5cdaaf76 | 12926 | b(alue)36 b(b)s(ecomes)h(the)f(v)-5 b(alue)36 b(assigned)g(plus)f(the)h |
45c0f7f8 CR |
12927 | (n)m(um)m(b)s(er)f(of)h(seconds)g(since)630 3898 y(the)31 |
12928 | b(assignmen)m(t.)150 4050 y Fs(SHELL)240 b Ft(The)29 | |
5cdaaf76 CR |
12929 | b(full)h(pathname)g(to)h(the)f(shell)g(is)g(k)m(ept)g(in)g(this)g(en)m |
12930 | (vironmen)m(t)g(v)-5 b(ariable.)42 b(If)29 b(it)i(is)f(not)630 | |
45c0f7f8 | 12931 | 4160 y(set)36 b(when)f(the)h(shell)g(starts,)i(Bash)e(assigns)h(to)f |
5cdaaf76 | 12932 | (it)h(the)f(full)f(pathname)h(of)g(the)g(curren)m(t)630 |
45c0f7f8 CR |
12933 | 4269 y(user's)30 b(login)h(shell.)150 4421 y Fs(SHELLOPTS)630 |
12934 | 4531 y Ft(A)g(colon-separated)h(list)f(of)g(enabled)f(shell)h(options.) | |
37c41ab1 | 12935 | 41 b(Eac)m(h)31 b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 |
45c0f7f8 | 12936 | b(alid)630 4640 y(argumen)m(t)24 b(for)f(the)h(`)p Fs(-o)p |
d3ad40de | 12937 | Ft(')f(option)h(to)g(the)g Fs(set)f Ft(builtin)g(command)g(\(see)i |
9f178efb | 12938 | (Section)f(4.3.1)h([The)630 4750 y(Set)k(Builtin],)h(page)f(58\).)42 |
8f714a7c | 12939 | b(The)28 b(options)h(app)s(earing)f(in)g Fs(SHELLOPTS)e |
45c0f7f8 | 12940 | Ft(are)j(those)h(rep)s(orted)630 4859 y(as)g(`)p Fs(on)p |
8f714a7c CR |
12941 | Ft(')f(b)m(y)h(`)p Fs(set)g(-o)p Ft('.)40 b(If)29 b(this)h(v)-5 |
12942 | b(ariable)30 b(is)g(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)h | |
45c0f7f8 | 12943 | (starts)g(up,)630 4969 y(eac)m(h)41 b(shell)e(option)h(in)f(the)h(list) |
8f714a7c | 12944 | g(will)f(b)s(e)g(enabled)h(b)s(efore)f(reading)g(an)m(y)h(startup)f |
45c0f7f8 CR |
12945 | (\014les.)630 5079 y(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 |
12946 | b(.)150 5230 y Fs(SHLVL)240 b Ft(Incremen)m(ted)21 b(b)m(y)g(one)g(eac) | |
8f714a7c | 12947 | m(h)h(time)f(a)h(new)e(instance)h(of)g(Bash)g(is)g(started.)38 |
45c0f7f8 CR |
12948 | b(This)20 b(is)h(in)m(tended)630 5340 y(to)31 b(b)s(e)f(a)h(coun)m(t)g |
12949 | (of)f(ho)m(w)h(deeply)f(y)m(our)g(Bash)h(shells)f(are)h(nested.)p | |
12950 | eop end | |
9f178efb CR |
12951 | %%Page: 78 84 |
12952 | TeXDict begin 78 83 bop 150 -116 a Ft(78)2572 b(Bash)31 | |
45c0f7f8 CR |
12953 | b(Reference)g(Man)m(ual)150 299 y Fs(TIMEFORMAT)630 408 |
12954 | y Ft(The)f(v)-5 b(alue)32 b(of)f(this)g(parameter)g(is)g(used)f(as)h(a) | |
12955 | g(format)h(string)f(sp)s(ecifying)f(ho)m(w)h(the)g(tim-)630 | |
12956 | 518 y(ing)37 b(information)f(for)h(pip)s(elines)f(pre\014xed)f(with)h | |
12957 | (the)h Fs(time)e Ft(reserv)m(ed)i(w)m(ord)f(should)g(b)s(e)630 | |
12958 | 628 y(displa)m(y)m(ed.)k(The)27 b(`)p Fs(\045)p Ft(')h(c)m(haracter)h | |
12959 | (in)m(tro)s(duces)e(an)h(escap)s(e)g(sequence)g(that)g(is)f(expanded)g | |
12960 | (to)630 737 y(a)37 b(time)g(v)-5 b(alue)36 b(or)h(other)f(information.) | |
12961 | 59 b(The)36 b(escap)s(e)g(sequences)h(and)e(their)i(meanings)630 | |
12962 | 847 y(are)31 b(as)f(follo)m(ws;)i(the)f(braces)f(denote)h(optional)h(p) | |
12963 | s(ortions.)630 1006 y Fs(\045\045)384 b Ft(A)30 b(literal)i(`)p | |
12964 | Fs(\045)p Ft('.)630 1166 y Fs(\045[)p Fi(p)11 b Fs(][l]R)85 | |
12965 | b Ft(The)30 b(elapsed)h(time)g(in)f(seconds.)630 1325 | |
12966 | y Fs(\045[)p Fi(p)11 b Fs(][l]U)85 b Ft(The)30 b(n)m(um)m(b)s(er)f(of)h | |
12967 | (CPU)g(seconds)h(sp)s(en)m(t)f(in)g(user)f(mo)s(de.)630 | |
12968 | 1484 y Fs(\045[)p Fi(p)11 b Fs(][l]S)85 b Ft(The)30 b(n)m(um)m(b)s(er)f | |
12969 | (of)h(CPU)g(seconds)h(sp)s(en)m(t)f(in)g(system)g(mo)s(de.)630 | |
12970 | 1644 y Fs(\045P)384 b Ft(The)30 b(CPU)g(p)s(ercen)m(tage,)i(computed)e | |
12971 | (as)h(\(\045U)f Fs(+)g Ft(\045S\))g(/)h(\045R.)630 1803 | |
220537f2 CR |
12972 | y(The)23 b(optional)j Fq(p)g Ft(is)e(a)g(digit)h(sp)s(ecifying)e(the)h |
12973 | (precision,)i(the)e(n)m(um)m(b)s(er)f(of)h(fractional)h(digits)630 | |
45c0f7f8 | 12974 | 1913 y(after)36 b(a)f(decimal)i(p)s(oin)m(t.)55 b(A)35 |
220537f2 | 12975 | b(v)-5 b(alue)36 b(of)f(0)h(causes)g(no)f(decimal)h(p)s(oin)m(t)f(or)h |
45c0f7f8 | 12976 | (fraction)g(to)g(b)s(e)630 2022 y(output.)48 b(A)m(t)34 |
220537f2 | 12977 | b(most)f(three)g(places)h(after)f(the)g(decimal)h(p)s(oin)m(t)f(ma)m(y) |
45c0f7f8 | 12978 | h(b)s(e)e(sp)s(eci\014ed;)i(v)-5 b(alues)630 2132 y(of)31 |
220537f2 CR |
12979 | b Fq(p)h Ft(greater)g(than)e(3)h(are)f(c)m(hanged)h(to)g(3.)42 |
12980 | b(If)29 b Fq(p)k Ft(is)d(not)h(sp)s(eci\014ed,)f(the)h(v)-5 | |
45c0f7f8 | 12981 | b(alue)30 b(3)h(is)g(used.)630 2267 y(The)54 b(optional)h |
220537f2 | 12982 | Fs(l)f Ft(sp)s(eci\014es)g(a)h(longer)f(format,)61 b(including)54 |
45c0f7f8 | 12983 | b(min)m(utes,)61 b(of)54 b(the)g(form)630 2376 y Fq(MM)10 |
220537f2 CR |
12984 | b Ft(m)p Fq(SS)5 b Ft(.)p Fq(FF)i Ft(s.)102 b(The)50 |
12985 | b(v)-5 b(alue)51 b(of)g Fq(p)i Ft(determines)e(whether)f(or)h(not)f | |
45c0f7f8 | 12986 | (the)h(fraction)h(is)630 2486 y(included.)630 2620 y(If)30 |
220537f2 | 12987 | b(this)g(v)-5 b(ariable)31 b(is)g(not)f(set,)i(Bash)e(acts)h(as)g(if)f |
45c0f7f8 | 12988 | (it)h(had)f(the)h(v)-5 b(alue)870 2755 y Fs |
5e13499c | 12989 | ($'\\nreal\\t\0453lR\\nuser\\t\0453)o(lU\\n)o(sys\\)o(t\0453)o(lS')630 |
45c0f7f8 | 12990 | 2889 y Ft(If)37 b(the)g(v)-5 b(alue)38 b(is)f(n)m(ull,)i(no)f(timing)f |
37c41ab1 | 12991 | (information)h(is)f(displa)m(y)m(ed.)62 b(A)37 b(trailing)i(newline)e |
45c0f7f8 CR |
12992 | (is)630 2999 y(added)30 b(when)f(the)i(format)f(string)h(is)f(displa)m |
12993 | (y)m(ed.)150 3158 y Fs(TMOUT)240 b Ft(If)22 b(set)h(to)g(a)g(v)-5 | |
37c41ab1 | 12994 | b(alue)23 b(greater)h(than)e(zero,)j Fs(TMOUT)d Ft(is)g(treated)i(as)e |
45c0f7f8 | 12995 | (the)h(default)g(timeout)g(for)g(the)630 3268 y Fs(read)31 |
37c41ab1 | 12996 | b Ft(builtin)h(\(see)h(Section)f(4.2)i([Bash)e(Builtins],)h(page)g |
9f178efb | 12997 | (48\).)47 b(The)32 b Fs(select)e Ft(command)630 3377 |
37c41ab1 | 12998 | y(\(see)f(Section)h(3.2.4.2)g([Conditional)g(Constructs],)e(page)i |
45c0f7f8 | 12999 | (10\))f(terminates)g(if)g(input)e(do)s(es)630 3487 y(not)k(arriv)m(e)g |
37c41ab1 | 13000 | (after)g Fs(TMOUT)e Ft(seconds)h(when)f(input)h(is)g(coming)h(from)f(a) |
9f178efb CR |
13001 | h(terminal.)630 3621 y(In)40 b(an)h(in)m(teractiv)m(e)i(shell,)h(the)d |
13002 | (v)-5 b(alue)41 b(is)g(in)m(terpreted)g(as)f(the)h(n)m(um)m(b)s(er)f | |
13003 | (of)h(seconds)f(to)630 3731 y(w)m(ait)28 b(for)e(a)g(line)h(of)g(input) | |
13004 | e(after)i(issuing)f(the)h(primary)e(prompt.)39 b(Bash)26 | |
13005 | b(terminates)h(after)630 3841 y(w)m(aiting)32 b(for)e(that)h(n)m(um)m | |
13006 | (b)s(er)e(of)h(seconds)h(if)f(a)h(complete)h(line)e(of)h(input)e(do)s | |
13007 | (es)h(not)h(arriv)m(e.)150 4000 y Fs(TMPDIR)192 b Ft(If)39 | |
13008 | b(set,)j(Bash)e(uses)f(its)h(v)-5 b(alue)40 b(as)f(the)h(name)f(of)h(a) | |
13009 | g(directory)g(in)f(whic)m(h)g(Bash)h(creates)630 4110 | |
13010 | y(temp)s(orary)30 b(\014les)g(for)g(the)h(shell's)g(use.)150 | |
13011 | 4269 y Fs(UID)336 b Ft(The)30 b(n)m(umeric)g(real)h(user)f(id)g(of)g | |
13012 | (the)h(curren)m(t)f(user.)40 b(This)30 b(v)-5 b(ariable)31 | |
13013 | b(is)f(readonly)-8 b(.)p eop end | |
13014 | %%Page: 79 85 | |
13015 | TeXDict begin 79 84 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13016 | b(Bash)30 b(F)-8 b(eatures)2484 b(79)150 299 y Fo(6)80 | |
122f603c CR |
13017 | b(Bash)54 b(F)-13 b(eatures)150 524 y Ft(This)30 b(c)m(hapter)h |
13018 | (describ)s(es)e(features)i(unique)e(to)i(Bash.)150 752 | |
13019 | y Fr(6.1)68 b(In)l(v)l(oking)46 b(Bash)390 912 y Fs(bash)h([long-opt])e | |
13020 | ([-ir])h([-abefhkmnptuvxdBCDHP])c([-o)47 b Fi(option)11 | |
13021 | b Fs(])45 b([-O)i Fi(shopt_option)11 b Fs(])44 b([)p | |
13022 | Fi(ar-)390 1021 y(gument)57 b Fs(...)o(])390 1131 y(bash)47 | |
13023 | b([long-opt])e([-abefhkmnptuvxdBCDHP])c([-o)47 b Fi(option)11 | |
13024 | b Fs(])46 b([-O)g Fi(shopt_option)11 b Fs(])44 b(-c)j | |
13025 | Fi(string)57 b Fs([)p Fi(ar-)390 1240 y(gument)g Fs(...)o(])390 | |
13026 | 1350 y(bash)47 b([long-opt])e(-s)i([-abefhkmnptuvxdBCDHP])42 | |
c302751c | 13027 | b([-o)k Fi(option)11 b Fs(])46 b([-O)h Fi(shopt_option)11 |
eb0b2ad8 CR |
13028 | b Fs(])43 b([)p Fi(ar-)390 1460 y(gument)57 b Fs(...)o(])275 |
13029 | 1592 y Ft(All)31 b(of)g(the)f(single-c)m(haracter)k(options)d(used)f | |
13030 | (with)g(the)h Fs(set)f Ft(builtin)g(\(see)h(Section)h(4.3.1)g([The)f | |
9f178efb | 13031 | (Set)150 1702 y(Builtin],)45 b(page)c(58\))i(can)e(b)s(e)f(used)h(as)g |
eb0b2ad8 CR |
13032 | (options)g(when)f(the)i(shell)f(is)g(in)m(v)m(ok)m(ed.)74 |
13033 | b(In)41 b(addition,)j(there)150 1811 y(are)38 b(sev)m(eral)h(m)m | |
13034 | (ulti-c)m(haracter)h(options)d(that)h(y)m(ou)g(can)g(use.)61 | |
13035 | b(These)38 b(options)f(m)m(ust)h(app)s(ear)e(on)i(the)150 | |
13036 | 1921 y(command)30 b(line)h(b)s(efore)f(the)g(single-c)m(haracter)j | |
13037 | (options)e(to)g(b)s(e)f(recognized.)150 2076 y Fs(--debugger)630 | |
13038 | 2186 y Ft(Arrange)j(for)g(the)g(debugger)g(pro\014le)g(to)h(b)s(e)e | |
37c41ab1 | 13039 | (executed)i(b)s(efore)f(the)g(shell)g(starts.)49 b(T)-8 |
eb0b2ad8 | 13040 | b(urns)630 2296 y(on)37 b(extended)g(debugging)g(mo)s(de)g(\(see)h |
9f178efb | 13041 | (Section)g(4.3.2)g([The)f(Shopt)g(Builtin],)i(page)f(62)630 |
eb0b2ad8 CR |
13042 | 2405 y(for)30 b(a)h(description)f(of)h(the)f Fs(extdebug)f |
13043 | Ft(option)h(to)h(the)g Fs(shopt)e Ft(builtin\).)150 2561 | |
13044 | y Fs(--dump-po-strings)630 2670 y Ft(A)37 b(list)g(of)f(all)i | |
d3ad40de | 13045 | (double-quoted)e(strings)g(preceded)g(b)m(y)h(`)p Fs($)p |
eb0b2ad8 | 13046 | Ft(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 2780 |
d3ad40de CR |
13047 | y(output)24 b(in)h(the)g Fl(gnu)f Fs(gettext)f Ft(PO)i(\(p)s(ortable)g |
13048 | (ob)5 b(ject\))26 b(\014le)f(format.)39 b(Equiv)-5 b(alen)m(t)26 | |
eb0b2ad8 CR |
13049 | b(to)f(`)p Fs(-D)p Ft(')630 2890 y(except)31 b(for)f(the)h(output)f |
13050 | (format.)150 3045 y Fs(--dump-strings)630 3155 y Ft(Equiv)-5 | |
13051 | b(alen)m(t)31 b(to)g(`)p Fs(-D)p Ft('.)150 3310 y Fs(--help)192 | |
d3ad40de | 13052 | b Ft(Displa)m(y)32 b(a)e(usage)h(message)h(on)e(standard)g(output)g |
eb0b2ad8 CR |
13053 | (and)f(exit)j(successfully)-8 b(.)150 3466 y Fs(--init-file)27 |
13054 | b Fi(filename)150 3576 y Fs(--rcfile)h Fi(filename)630 | |
13055 | 3685 y Ft(Execute)42 b(commands)f(from)f Fq(\014lename)47 | |
d3ad40de | 13056 | b Ft(\(instead)42 b(of)f(`)p Fs(~/.bashrc)p Ft('\))e(in)i(an)g(in)m |
eb0b2ad8 | 13057 | (teractiv)m(e)630 3795 y(shell.)150 3950 y Fs(--login)144 |
d3ad40de | 13058 | b Ft(Equiv)-5 b(alen)m(t)31 b(to)g(`)p Fs(-l)p Ft('.)150 |
eb0b2ad8 | 13059 | 4106 y Fs(--noediting)630 4216 y Ft(Do)h(not)e(use)h(the)g |
d3ad40de | 13060 | Fl(gnu)f Ft(Readline)i(library)e(\(see)h(Chapter)g(8)g([Command)f(Line) |
9f178efb CR |
13061 | g(Editing],)630 4325 y(page)h(101\))h(to)f(read)g(command)f(lines)g |
13062 | (when)g(the)g(shell)h(is)f(in)m(teractiv)m(e.)150 4481 | |
13063 | y Fs(--noprofile)630 4590 y Ft(Don't)i(load)f(the)g(system-wide)g | |
37c41ab1 | 13064 | (startup)f(\014le)g(`)p Fs(/etc/profile)p Ft(')e(or)j(an)m(y)g(of)g |
eb0b2ad8 | 13065 | (the)f(p)s(ersonal)630 4700 y(initialization)g(\014les)d(`)p |
37c41ab1 | 13066 | Fs(~/.bash_profile)p Ft(',)e(`)p Fs(~/.bash_login)p Ft(',)g(or)i(`)p |
eb0b2ad8 CR |
13067 | Fs(~/.profile)p Ft(')e(when)630 4810 y(Bash)31 b(is)f(in)m(v)m(ok)m(ed) |
13068 | i(as)e(a)h(login)g(shell.)150 4965 y Fs(--norc)192 b | |
37c41ab1 CR |
13069 | Ft(Don't)31 b(read)g(the)f(`)p Fs(~/.bashrc)p Ft(')f(initialization)k |
13070 | (\014le)d(in)g(an)h(in)m(teractiv)m(e)i(shell.)41 b(This)30 | |
eb0b2ad8 CR |
13071 | b(is)g(on)630 5075 y(b)m(y)g(default)h(if)f(the)h(shell)f(is)h(in)m(v)m |
13072 | (ok)m(ed)h(as)e Fs(sh)p Ft(.)150 5230 y Fs(--posix)144 | |
13073 | b Ft(Change)24 b(the)h(b)s(eha)m(vior)f(of)g(Bash)h(where)e(the)i | |
13074 | (default)f(op)s(eration)h(di\013ers)f(from)f(the)i Fl(posix)630 | |
13075 | 5340 y Ft(standard)35 b(to)h(matc)m(h)g(the)g(standard.)55 | |
13076 | b(This)35 b(is)h(in)m(tended)f(to)h(mak)m(e)h(Bash)f(b)s(eha)m(v)m(e)g | |
13077 | (as)g(a)p eop end | |
9f178efb CR |
13078 | %%Page: 80 86 |
13079 | TeXDict begin 80 85 bop 150 -116 a Ft(80)2572 b(Bash)31 | |
eb0b2ad8 CR |
13080 | b(Reference)g(Man)m(ual)630 299 y(strict)26 b(sup)s(erset)e(of)h(that)g |
13081 | (standard.)38 b(See)26 b(Section)f(6.11)i([Bash)e(POSIX)f(Mo)s(de],)j | |
9f178efb | 13082 | (page)f(92,)630 408 y(for)k(a)h(description)f(of)h(the)f(Bash)h |
45c0f7f8 CR |
13083 | Fl(posix)f Ft(mo)s(de.)150 572 y Fs(--restricted)630 |
13084 | 682 y Ft(Mak)m(e)54 b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h | |
13085 | (Section)g(6.10)h([The)d(Restricted)j(Shell],)630 792 | |
9f178efb | 13086 | y(page)31 b(92\).)150 956 y Fs(--verbose)630 1065 y Ft(Equiv)-5 |
eb0b2ad8 | 13087 | b(alen)m(t)31 b(to)g(`)p Fs(-v)p Ft('.)41 b(Prin)m(t)30 |
45c0f7f8 CR |
13088 | b(shell)h(input)e(lines)i(as)g(they're)f(read.)150 1229 |
13089 | y Fs(--version)630 1339 y Ft(Sho)m(w)e(v)m(ersion)g(information)g(for)g | |
eb0b2ad8 | 13090 | (this)g(instance)h(of)f(Bash)g(on)g(the)g(standard)f(output)h(and)630 |
45c0f7f8 | 13091 | 1448 y(exit)j(successfully)-8 b(.)275 1615 y(There)28 |
eb0b2ad8 CR |
13092 | b(are)i(sev)m(eral)g(single-c)m(haracter)i(options)d(that)h(ma)m(y)g(b) |
13093 | s(e)e(supplied)g(at)i(in)m(v)m(o)s(cation)h(whic)m(h)e(are)150 | |
45c0f7f8 CR |
13094 | 1724 y(not)i(a)m(v)-5 b(ailable)32 b(with)e(the)h Fs(set)e |
13095 | Ft(builtin.)150 1891 y Fs(-c)384 b Ft(Read)44 b(and)e(execute)j | |
13096 | (commands)e(from)g(the)g(\014rst)g(non-option)h Fq(argumen)m(t)h | |
13097 | Ft(after)f(pro-)630 2000 y(cessing)37 b(the)g(options,)i(then)d(exit.) | |
13098 | 61 b(An)m(y)37 b(remaining)f(argumen)m(ts)h(are)g(assigned)g(to)h(the) | |
13099 | 630 2110 y(p)s(ositional)31 b(parameters,)g(starting)g(with)f | |
13100 | Fs($0)p Ft(.)150 2274 y Fs(-i)384 b Ft(F)-8 b(orce)22 | |
eb0b2ad8 CR |
13101 | b(the)g(shell)f(to)g(run)f(in)m(teractiv)m(ely)-8 b(.)41 |
13102 | b(In)m(teractiv)m(e)23 b(shells)e(are)h(describ)s(ed)d(in)i(Section)h | |
9f178efb | 13103 | (6.3)630 2383 y([In)m(teractiv)m(e)33 b(Shells],)e(page)g(82.)150 |
45c0f7f8 | 13104 | 2547 y Fs(-l)384 b Ft(Mak)m(e)33 b(this)e(shell)h(act)g(as)g(if)f(it)h |
eb0b2ad8 | 13105 | (had)f(b)s(een)f(directly)i(in)m(v)m(ok)m(ed)h(b)m(y)f(login.)44 |
45c0f7f8 | 13106 | b(When)31 b(the)h(shell)630 2657 y(is)37 b(in)m(teractiv)m(e,)43 |
eb0b2ad8 CR |
13107 | b(this)37 b(is)g(equiv)-5 b(alen)m(t)39 b(to)f(starting)h(a)e(login)i |
13108 | (shell)e(with)g(`)p Fs(exec)30 b(-l)g(bash)p Ft('.)630 | |
45c0f7f8 | 13109 | 2767 y(When)h(the)g(shell)h(is)f(not)g(in)m(teractiv)m(e,)k(the)c |
eb0b2ad8 | 13110 | (login)h(shell)g(startup)f(\014les)g(will)g(b)s(e)g(executed.)630 |
45c0f7f8 | 13111 | 2876 y(`)p Fs(exec)e(bash)h(-l)p Ft(')43 b(or)h(`)p Fs(exec)29 |
eb0b2ad8 | 13112 | b(bash)g(--login)p Ft(')42 b(will)i(replace)h(the)f(curren)m(t)f(shell) |
45c0f7f8 | 13113 | h(with)g(a)630 2986 y(Bash)26 b(login)g(shell.)39 b(See)26 |
9f178efb | 13114 | b(Section)g(6.2)h([Bash)e(Startup)g(Files],)j(page)e(81,)i(for)d(a)h |
45c0f7f8 CR |
13115 | (description)630 3095 y(of)31 b(the)f(sp)s(ecial)h(b)s(eha)m(vior)g(of) |
13116 | f(a)h(login)g(shell.)150 3259 y Fs(-r)384 b Ft(Mak)m(e)54 | |
37c41ab1 | 13117 | b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h(Section)g(6.10)h([The) |
9f178efb | 13118 | d(Restricted)j(Shell],)630 3369 y(page)31 b(92\).)150 |
45c0f7f8 | 13119 | 3533 y Fs(-s)384 b Ft(If)24 b(this)h(option)h(is)f(presen)m(t,)h(or)f |
eb0b2ad8 | 13120 | (if)g(no)f(argumen)m(ts)i(remain)e(after)i(option)f(pro)s(cessing,)h |
45c0f7f8 | 13121 | (then)630 3642 y(commands)i(are)h(read)g(from)f(the)h(standard)f |
eb0b2ad8 | 13122 | (input.)39 b(This)28 b(option)h(allo)m(ws)h(the)f(p)s(ositional)630 |
45c0f7f8 CR |
13123 | 3752 y(parameters)i(to)g(b)s(e)f(set)g(when)g(in)m(v)m(oking)h(an)g(in) |
13124 | m(teractiv)m(e)i(shell.)150 3916 y Fs(-D)384 b Ft(A)37 | |
37c41ab1 CR |
13125 | b(list)g(of)f(all)i(double-quoted)e(strings)g(preceded)g(b)m(y)h(`)p |
13126 | Fs($)p Ft(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 | |
45c0f7f8 CR |
13127 | 4026 y(output.)63 b(These)38 b(are)g(the)g(strings)g(that)h(are)f(sub)5 |
13128 | b(ject)38 b(to)h(language)g(translation)g(when)630 4135 | |
eb2bb562 CR |
13129 | y(the)e(curren)m(t)g(lo)s(cale)h(is)f(not)g Fs(C)g Ft(or)f |
13130 | Fs(POSIX)g Ft(\(see)h(Section)h(3.1.2.5)h([Lo)s(cale)g(T)-8 | |
45c0f7f8 | 13131 | b(ranslation],)630 4245 y(page)31 b(7\).)42 b(This)29 |
37c41ab1 | 13132 | b(implies)i(the)f(`)p Fs(-n)p Ft(')h(option;)g(no)f(commands)g(will)h |
45c0f7f8 CR |
13133 | (b)s(e)e(executed.)150 4409 y Fs([-+]O)g([)p Fi(shopt_option)11 |
13134 | b Fs(])630 4518 y Fq(shopt)p 854 4518 28 4 v 40 w(option)44 | |
37c41ab1 | 13135 | b Ft(is)g(one)h(of)f(the)g(shell)h(options)f(accepted)h(b)m(y)f(the)h |
45c0f7f8 | 13136 | Fs(shopt)d Ft(builtin)i(\(see)630 4628 y(Section)28 b(4.3.2)g([The)f |
9f178efb | 13137 | (Shopt)f(Builtin],)i(page)f(62\).)41 b(If)26 b Fq(shopt)p |
45c0f7f8 CR |
13138 | 2690 4628 V 40 w(option)h Ft(is)g(presen)m(t,)h(`)p Fs(-O)p |
13139 | Ft(')f(sets)630 4738 y(the)40 b(v)-5 b(alue)40 b(of)f(that)h(option;)45 | |
d3ad40de | 13140 | b(`)p Fs(+O)p Ft(')40 b(unsets)e(it.)69 b(If)39 b Fq(shopt)p |
45c0f7f8 CR |
13141 | 2631 4738 V 40 w(option)h Ft(is)f(not)h(supplied,)h(the)630 |
13142 | 4847 y(names)e(and)g(v)-5 b(alues)40 b(of)g(the)g(shell)f(options)h | |
d3ad40de | 13143 | (accepted)h(b)m(y)e Fs(shopt)f Ft(are)i(prin)m(ted)f(on)h(the)630 |
45c0f7f8 | 13144 | 4957 y(standard)33 b(output.)50 b(If)33 b(the)h(in)m(v)m(o)s(cation)i |
d3ad40de | 13145 | (option)e(is)g(`)p Fs(+O)p Ft(',)g(the)g(output)f(is)h(displa)m(y)m(ed) |
45c0f7f8 | 13146 | g(in)g(a)630 5066 y(format)d(that)g(ma)m(y)g(b)s(e)e(reused)h(as)h |
eb0b2ad8 CR |
13147 | (input.)150 5230 y Fs(--)384 b Ft(A)38 b Fs(--)g Ft(signals)g(the)h |
13148 | (end)e(of)i(options)f(and)g(disables)g(further)f(option)h(pro)s | |
13149 | (cessing.)64 b(An)m(y)630 5340 y(argumen)m(ts)31 b(after)g(the)f | |
13150 | Fs(--)g Ft(are)h(treated)g(as)g(\014lenames)f(and)g(argumen)m(ts.)p | |
13151 | eop end | |
9f178efb CR |
13152 | %%Page: 81 87 |
13153 | TeXDict begin 81 86 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13154 | b(Bash)30 b(F)-8 b(eatures)2484 b(81)275 299 y(A)27 b | |
eb0b2ad8 CR |
13155 | Fk(lo)-5 b(gin)35 b Ft(shell)27 b(is)g(one)h(whose)f(\014rst)f(c)m |
13156 | (haracter)j(of)e(argumen)m(t)h(zero)f(is)h(`)p Fs(-)p | |
13157 | Ft(',)g(or)f(one)g(in)m(v)m(ok)m(ed)i(with)e(the)150 | |
13158 | 408 y(`)p Fs(--login)p Ft(')i(option.)275 546 y(An)24 | |
13159 | b Fk(inter)-5 b(active)33 b Ft(shell)25 b(is)g(one)g(started)g(without) | |
13160 | g(non-option)h(argumen)m(ts,)g(unless)f(`)p Fs(-s)p Ft(')f(is)h(sp)s | |
13161 | (eci\014ed,)150 656 y(without)43 b(sp)s(ecifying)f(the)i(`)p | |
13162 | Fs(-c)p Ft(')e(option,)47 b(and)42 b(whose)h(input)f(and)g(output)g | |
13163 | (are)h(b)s(oth)g(connected)g(to)150 766 y(terminals)22 | |
13164 | b(\(as)h(determined)f(b)m(y)g Fs(isatty\(3\))p Ft(\),)f(or)i(one)f | |
13165 | (started)g(with)g(the)g(`)p Fs(-i)p Ft(')g(option.)39 | |
13166 | b(See)22 b(Section)h(6.3)150 875 y([In)m(teractiv)m(e)33 | |
9f178efb | 13167 | b(Shells],)e(page)g(82,)g(for)f(more)h(information.)275 |
eb0b2ad8 CR |
13168 | 1013 y(If)38 b(argumen)m(ts)h(remain)g(after)g(option)h(pro)s(cessing,) |
13169 | h(and)d(neither)h(the)g(`)p Fs(-c)p Ft(')f(nor)h(the)g(`)p | |
13170 | Fs(-s)p Ft(')f(option)150 1123 y(has)33 b(b)s(een)g(supplied,)h(the)g | |
13171 | (\014rst)e(argumen)m(t)j(is)e(assumed)g(to)h(b)s(e)f(the)h(name)g(of)g | |
13172 | (a)g(\014le)g(con)m(taining)h(shell)150 1232 y(commands)30 | |
9f178efb | 13173 | b(\(see)g(Section)h(3.8)g([Shell)f(Scripts],)g(page)h(38\).)41 |
eb0b2ad8 CR |
13174 | b(When)30 b(Bash)g(is)g(in)m(v)m(ok)m(ed)i(in)d(this)h(fashion,)150 |
13175 | 1342 y Fs($0)37 b Ft(is)g(set)h(to)h(the)e(name)h(of)f(the)h(\014le,)i | |
13176 | (and)c(the)i(p)s(ositional)g(parameters)g(are)g(set)g(to)g(the)g | |
13177 | (remaining)150 1451 y(argumen)m(ts.)h(Bash)26 b(reads)f(and)g(executes) | |
13178 | h(commands)f(from)g(this)g(\014le,)i(then)e(exits.)40 | |
13179 | b(Bash's)25 b(exit)i(status)150 1561 y(is)f(the)h(exit)h(status)e(of)h | |
13180 | (the)g(last)g(command)f(executed)h(in)g(the)f(script.)40 | |
13181 | b(If)26 b(no)g(commands)g(are)h(executed,)150 1671 y(the)k(exit)g | |
13182 | (status)g(is)f(0.)150 1908 y Fr(6.2)68 b(Bash)45 b(Startup)g(Files)150 | |
13183 | 2068 y Ft(This)23 b(section)j(describ)s(es)d(ho)m(w)i(Bash)f(executes)h | |
c302751c | 13184 | (its)g(startup)f(\014les.)38 b(If)24 b(an)m(y)h(of)f(the)h(\014les)f |
122f603c CR |
13185 | (exist)h(but)e(cannot)150 2177 y(b)s(e)29 b(read,)i(Bash)f(rep)s(orts)f |
13186 | (an)h(error.)40 b(Tildes)30 b(are)g(expanded)f(in)h(\014lenames)g(as)g | |
13187 | (describ)s(ed)f(ab)s(o)m(v)m(e)i(under)150 2287 y(Tilde)f(Expansion)g | |
45c0f7f8 | 13188 | (\(see)h(Section)h(3.5.2)g([Tilde)e(Expansion],)h(page)g(21\).)275 |
122f603c | 13189 | 2425 y(In)m(teractiv)m(e)h(shells)f(are)g(describ)s(ed)e(in)h(Section)h |
9f178efb | 13190 | (6.3)h([In)m(teractiv)m(e)h(Shells],)d(page)h(82.)150 |
122f603c CR |
13191 | 2627 y Fj(In)m(v)m(ok)m(ed)40 b(as)h(an)f(in)m(teractiv)m(e)f(login)j |
13192 | (shell,)g(or)g(with)e(`)p Fh(--login)p Fj(')150 2774 | |
13193 | y Ft(When)c(Bash)f(is)h(in)m(v)m(ok)m(ed)h(as)f(an)g(in)m(teractiv)m(e) | |
13194 | j(login)d(shell,)i(or)e(as)g(a)g(non-in)m(teractiv)m(e)i(shell)e(with)g | |
13195 | (the)150 2884 y(`)p Fs(--login)p Ft(')j(option,)k(it)e(\014rst)e(reads) | |
13196 | h(and)g(executes)h(commands)f(from)f(the)i(\014le)f(`)p | |
13197 | Fs(/etc/profile)p Ft(',)g(if)150 2993 y(that)35 b(\014le)g(exists.)55 | |
c302751c CR |
13198 | b(After)35 b(reading)g(that)g(\014le,)h(it)g(lo)s(oks)f(for)f(`)p |
13199 | Fs(~/.bash_profile)p Ft(',)f(`)p Fs(~/.bash_login)p Ft(',)150 | |
eb0b2ad8 | 13200 | 3103 y(and)28 b(`)p Fs(~/.profile)p Ft(',)f(in)i(that)g(order,)g(and)f |
c302751c | 13201 | (reads)g(and)h(executes)h(commands)e(from)g(the)h(\014rst)f(one)h(that) |
eb0b2ad8 | 13202 | 150 3213 y(exists)i(and)e(is)h(readable.)41 b(The)30 |
c302751c | 13203 | b(`)p Fs(--noprofile)p Ft(')d(option)k(ma)m(y)f(b)s(e)g(used)f(when)g |
eb0b2ad8 CR |
13204 | (the)h(shell)h(is)f(started)g(to)150 3322 y(inhibit)g(this)g(b)s(eha)m |
13205 | (vior.)275 3460 y(When)72 b(a)i(login)g(shell)f(exits,)85 | |
c302751c | 13206 | b(Bash)73 b(reads)g(and)g(executes)h(commands)f(from)g(the)g(\014le)150 |
eb0b2ad8 CR |
13207 | 3570 y(`)p Fs(~/.bash_logout)p Ft(',)27 b(if)k(it)f(exists.)150 |
13208 | 3772 y Fj(In)m(v)m(ok)m(ed)40 b(as)h(an)f(in)m(teractiv)m(e)f | |
13209 | (non-login)k(shell)150 3919 y Ft(When)g(an)h(in)m(teractiv)m(e)i(shell) | |
c302751c | 13210 | e(that)g(is)f(not)h(a)g(login)g(shell)g(is)f(started,)48 |
eb0b2ad8 | 13211 | b(Bash)c(reads)f(and)g(executes)150 4029 y(commands)24 |
c302751c CR |
13212 | b(from)f(`)p Fs(~/.bashrc)p Ft(',)h(if)g(that)g(\014le)g(exists.)40 |
13213 | b(This)23 b(ma)m(y)i(b)s(e)e(inhibited)g(b)m(y)h(using)g(the)g(`)p | |
eb0b2ad8 | 13214 | Fs(--norc)p Ft(')150 4138 y(option.)52 b(The)33 b(`)p |
c302751c | 13215 | Fs(--rcfile)28 b Fi(file)11 b Ft(')33 b(option)h(will)g(force)h(Bash)f |
eb0b2ad8 | 13216 | (to)h(read)e(and)h(execute)h(commands)e(from)150 4248 |
c302751c | 13217 | y Fq(\014le)j Ft(instead)30 b(of)h(`)p Fs(~/.bashrc)p |
eb0b2ad8 | 13218 | Ft('.)275 4386 y(So,)f(t)m(ypically)-8 b(,)33 b(y)m(our)d(`)p |
c302751c | 13219 | Fs(~/.bash_profile)p Ft(')d(con)m(tains)32 b(the)e(line)390 |
eb0b2ad8 CR |
13220 | 4524 y Fs(if)47 b([)h(-f)f(~/.bashrc)e(];)i(then)g(.)g(~/.bashrc;)e(fi) |
13221 | 150 4662 y Ft(after)31 b(\(or)g(b)s(efore\))f(an)m(y)h(login-sp)s | |
13222 | (eci\014c)g(initializations.)150 4864 y Fj(In)m(v)m(ok)m(ed)40 | |
13223 | b(non-in)m(teractiv)m(ely)150 5011 y Ft(When)33 b(Bash)g(is)g(started)h | |
c302751c | 13224 | (non-in)m(teractiv)m(ely)-8 b(,)37 b(to)d(run)e(a)h(shell)h(script,)g |
eb0b2ad8 | 13225 | (for)f(example,)i(it)e(lo)s(oks)h(for)f(the)150 5121 |
c302751c CR |
13226 | y(v)-5 b(ariable)35 b Fs(BASH_ENV)d Ft(in)i(the)h(en)m(vironmen)m(t,)h |
13227 | (expands)e(its)g(v)-5 b(alue)35 b(if)g(it)g(app)s(ears)e(there,)j(and)e | |
eb0b2ad8 CR |
13228 | (uses)g(the)150 5230 y(expanded)c(v)-5 b(alue)30 b(as)h(the)g(name)f |
13229 | (of)h(a)f(\014le)h(to)g(read)f(and)g(execute.)42 b(Bash)31 | |
13230 | b(b)s(eha)m(v)m(es)g(as)g(if)f(the)g(follo)m(wing)150 | |
13231 | 5340 y(command)g(w)m(ere)h(executed:)p eop end | |
9f178efb CR |
13232 | %%Page: 82 88 |
13233 | TeXDict begin 82 87 bop 150 -116 a Ft(82)2572 b(Bash)31 | |
eb0b2ad8 CR |
13234 | b(Reference)g(Man)m(ual)390 299 y Fs(if)47 b([)h(-n)f("$BASH_ENV")e(];) |
13235 | i(then)f(.)i("$BASH_ENV";)c(fi)150 461 y Ft(but)30 b(the)g(v)-5 | |
13236 | b(alue)31 b(of)g(the)f Fs(PATH)f Ft(v)-5 b(ariable)32 | |
122f603c | 13237 | b(is)e(not)h(used)e(to)i(searc)m(h)g(for)f(the)h(\014lename.)275 |
eb0b2ad8 CR |
13238 | 622 y(As)38 b(noted)h(ab)s(o)m(v)m(e,)j(if)c(a)h(non-in)m(teractiv)m(e) |
13239 | i(shell)e(is)g(in)m(v)m(ok)m(ed)h(with)e(the)g(`)p Fs(--login)p | |
13240 | Ft(')g(option,)j(Bash)150 732 y(attempts)31 b(to)g(read)g(and)e | |
13241 | (execute)j(commands)e(from)g(the)h(login)g(shell)g(startup)e(\014les.) | |
13242 | 150 958 y Fj(In)m(v)m(ok)m(ed)40 b(with)g(name)h Fh(sh)150 | |
13243 | 1105 y Ft(If)c(Bash)g(is)g(in)m(v)m(ok)m(ed)i(with)e(the)g(name)g | |
13244 | Fs(sh)p Ft(,)i(it)f(tries)f(to)h(mimic)g(the)f(startup)g(b)s(eha)m | |
13245 | (vior)g(of)h(historical)150 1215 y(v)m(ersions)31 b(of)f | |
13246 | Fs(sh)g Ft(as)h(closely)h(as)e(p)s(ossible,)g(while)h(conforming)f(to)h | |
13247 | (the)g Fl(posix)e Ft(standard)h(as)h(w)m(ell.)275 1376 | |
13248 | y(When)50 b(in)m(v)m(ok)m(ed)j(as)f(an)f(in)m(teractiv)m(e)j(login)e | |
13249 | (shell,)57 b(or)51 b(as)g(a)h(non-in)m(teractiv)m(e)h(shell)f(with)f | |
13250 | (the)150 1486 y(`)p Fs(--login)p Ft(')39 b(option,)k(it)e(\014rst)e | |
13251 | (attempts)i(to)g(read)f(and)g(execute)h(commands)f(from)g(`)p | |
13252 | Fs(/etc/profile)p Ft(')150 1596 y(and)d(`)p Fs(~/.profile)p | |
13253 | Ft(',)g(in)g(that)h(order.)62 b(The)37 b(`)p Fs(--noprofile)p | |
13254 | Ft(')e(option)j(ma)m(y)g(b)s(e)f(used)g(to)h(inhibit)f(this)150 | |
13255 | 1705 y(b)s(eha)m(vior.)82 b(When)44 b(in)m(v)m(ok)m(ed)h(as)g(an)f(in)m | |
13256 | (teractiv)m(e)j(shell)d(with)g(the)g(name)g Fs(sh)p Ft(,)j(Bash)d(lo)s | |
13257 | (oks)h(for)f(the)150 1815 y(v)-5 b(ariable)37 b Fs(ENV)p | |
13258 | Ft(,)g(expands)e(its)i(v)-5 b(alue)36 b(if)g(it)h(is)f(de\014ned,)h | |
13259 | (and)e(uses)h(the)g(expanded)g(v)-5 b(alue)36 b(as)h(the)f(name)150 | |
13260 | 1924 y(of)i(a)h(\014le)g(to)g(read)f(and)g(execute.)66 | |
13261 | b(Since)38 b(a)h(shell)f(in)m(v)m(ok)m(ed)i(as)f Fs(sh)e | |
13262 | Ft(do)s(es)h(not)h(attempt)g(to)g(read)g(and)150 2034 | |
13263 | y(execute)i(commands)e(from)g(an)m(y)h(other)g(startup)f(\014les,)j | |
13264 | (the)e(`)p Fs(--rcfile)p Ft(')d(option)j(has)g(no)f(e\013ect.)70 | |
13265 | b(A)150 2143 y(non-in)m(teractiv)m(e)32 b(shell)d(in)m(v)m(ok)m(ed)h | |
37c41ab1 | 13266 | (with)f(the)g(name)g Fs(sh)f Ft(do)s(es)g(not)i(attempt)g(to)f(read)g |
eb0b2ad8 | 13267 | (an)m(y)g(other)g(startup)150 2253 y(\014les.)275 2415 |
37c41ab1 CR |
13268 | y(When)h(in)m(v)m(ok)m(ed)h(as)g Fs(sh)p Ft(,)f(Bash)h(en)m(ters)g |
13269 | Fl(posix)e Ft(mo)s(de)h(after)h(the)g(startup)f(\014les)g(are)h(read.) | |
eb0b2ad8 CR |
13270 | 150 2641 y Fj(In)m(v)m(ok)m(ed)40 b(in)h Fg(posix)g Fj(mo)s(de)150 |
13271 | 2788 y Ft(When)25 b(Bash)g(is)h(started)f(in)g Fl(posix)g | |
c302751c | 13272 | Ft(mo)s(de,)h(as)f(with)g(the)h(`)p Fs(--posix)p Ft(')d(command)i(line) |
eb0b2ad8 | 13273 | h(option,)h(it)f(follo)m(ws)150 2898 y(the)e Fl(posix)f |
c302751c CR |
13274 | Ft(standard)h(for)f(startup)h(\014les.)38 b(In)24 b(this)g(mo)s(de,)h |
13275 | (in)m(teractiv)m(e)i(shells)d(expand)f(the)h Fs(ENV)f | |
eb0b2ad8 | 13276 | Ft(v)-5 b(ariable)150 3007 y(and)30 b(commands)g(are)g(read)h(and)e |
c302751c | 13277 | (executed)j(from)d(the)i(\014le)f(whose)g(name)h(is)f(the)h(expanded)e |
eb0b2ad8 CR |
13278 | (v)-5 b(alue.)41 b(No)150 3117 y(other)31 b(startup)f(\014les)g(are)h |
13279 | (read.)150 3343 y Fj(In)m(v)m(ok)m(ed)40 b(b)m(y)g(remote)h(shell)h | |
13280 | (daemon)150 3490 y Ft(Bash)36 b(attempts)h(to)g(determine)f(when)f(it)i | |
c302751c | 13281 | (is)f(b)s(eing)g(run)e(with)i(its)g(standard)g(input)f(connected)i(to)g |
e05be32d CR |
13282 | (a)150 3600 y(net)m(w)m(ork)h(connection,)j(as)c(when)g(executed)h(b)m |
13283 | (y)f(the)h(remote)g(shell)g(daemon,)h(usually)e Fs(rshd)p | |
13284 | Ft(,)h(or)g(the)150 3709 y(secure)c(shell)f(daemon)h | |
13285 | Fs(sshd)p Ft(.)49 b(If)33 b(Bash)g(determines)h(it)g(is)f(b)s(eing)g | |
13286 | (run)f(in)i(this)f(fashion,)h(it)g(reads)g(and)150 3819 | |
13287 | y(executes)42 b(commands)e(from)g(`)p Fs(~/.bashrc)p | |
13288 | Ft(',)h(if)g(that)g(\014le)f(exists)i(and)e(is)g(readable.)72 | |
13289 | b(It)40 b(will)h(not)g(do)150 3929 y(this)35 b(if)g(in)m(v)m(ok)m(ed)i | |
13290 | (as)f Fs(sh)p Ft(.)55 b(The)34 b(`)p Fs(--norc)p Ft(')g(option)i(ma)m | |
13291 | (y)g(b)s(e)f(used)f(to)i(inhibit)f(this)g(b)s(eha)m(vior,)i(and)e(the) | |
13292 | 150 4038 y(`)p Fs(--rcfile)p Ft(')25 b(option)i(ma)m(y)g(b)s(e)f(used)g | |
13293 | (to)i(force)f(another)g(\014le)g(to)g(b)s(e)f(read,)i(but)e | |
13294 | Fs(rshd)f Ft(do)s(es)i(not)g(generally)150 4148 y(in)m(v)m(ok)m(e)32 | |
13295 | b(the)f(shell)f(with)h(those)f(options)h(or)f(allo)m(w)i(them)f(to)g(b) | |
13296 | s(e)e(sp)s(eci\014ed.)150 4374 y Fj(In)m(v)m(ok)m(ed)40 | |
13297 | b(with)g(unequal)h(e\013ectiv)m(e)e(and)i(real)g Fg(uid/gid)p | |
122f603c CR |
13298 | Fj(s)150 4521 y Ft(If)24 b(Bash)h(is)f(started)h(with)f(the)h |
13299 | (e\013ectiv)m(e)i(user)d(\(group\))h(id)f(not)g(equal)h(to)h(the)e | |
13300 | (real)h(user)f(\(group\))h(id,)h(and)150 4631 y(the)35 | |
13301 | b(`)p Fs(-p)p Ft(')g(option)h(is)f(not)g(supplied,)h(no)f(startup)f | |
13302 | (\014les)h(are)h(read,)g(shell)g(functions)e(are)i(not)f(inherited)150 | |
eb0b2ad8 | 13303 | 4740 y(from)41 b(the)g(en)m(vironmen)m(t,)j(the)d Fs(SHELLOPTS)p |
8f714a7c | 13304 | Ft(,)h Fs(BASHOPTS)p Ft(,)g Fs(CDPATH)p Ft(,)g(and)e |
eb0b2ad8 | 13305 | Fs(GLOBIGNORE)e Ft(v)-5 b(ariables,)45 b(if)150 4850 |
8f714a7c CR |
13306 | y(they)28 b(app)s(ear)f(in)h(the)g(en)m(vironmen)m(t,)i(are)e(ignored,) |
13307 | h(and)e(the)h(e\013ectiv)m(e)j(user)c(id)h(is)g(set)g(to)h(the)f(real)h | |
122f603c CR |
13308 | (user)150 4959 y(id.)54 b(If)35 b(the)g(`)p Fs(-p)p Ft(')g(option)g(is) |
13309 | g(supplied)f(at)h(in)m(v)m(o)s(cation,)k(the)c(startup)g(b)s(eha)m | |
13310 | (vior)g(is)g(the)g(same,)h(but)f(the)150 5069 y(e\013ectiv)m(e)e(user)d | |
13311 | (id)g(is)g(not)h(reset.)150 5342 y Fr(6.3)68 b(In)l(teractiv)l(e)47 | |
eb0b2ad8 | 13312 | b(Shells)p eop end |
9f178efb CR |
13313 | %%Page: 83 89 |
13314 | TeXDict begin 83 88 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13315 | b(Bash)30 b(F)-8 b(eatures)2484 b(83)150 299 y Fj(6.3.1)63 | |
c302751c | 13316 | b(What)40 b(is)h(an)g(In)m(teractiv)m(e)e(Shell?)150 |
eb0b2ad8 | 13317 | 446 y Ft(An)c(in)m(teractiv)m(e)k(shell)d(is)g(one)g(started)g(without) |
c302751c | 13318 | f(non-option)h(argumen)m(ts,)i(unless)d(`)p Fs(-s)p Ft(')h(is)f(sp)s |
eb0b2ad8 | 13319 | (eci\014ed,)150 555 y(without)f(sp)s(ecifying)h(the)f(`)p |
c302751c | 13320 | Fs(-c)p Ft(')g(option,)j(and)c(whose)h(input)g(and)g(error)g(output)g |
eb0b2ad8 | 13321 | (are)g(b)s(oth)g(connected)150 665 y(to)d(terminals)g(\(as)g |
c302751c | 13322 | (determined)f(b)m(y)g Fs(isatty\(3\))p Ft(\),)f(or)h(one)h(started)f |
eb0b2ad8 CR |
13323 | (with)g(the)h(`)p Fs(-i)p Ft(')f(option.)275 797 y(An)g(in)m(teractiv)m |
13324 | (e)j(shell)d(generally)i(reads)e(from)g(and)g(writes)g(to)h(a)g(user's) | |
13325 | f(terminal.)275 929 y(The)e(`)p Fs(-s)p Ft(')i(in)m(v)m(o)s(cation)h | |
13326 | (option)f(ma)m(y)g(b)s(e)f(used)f(to)i(set)g(the)g(p)s(ositional)g | |
13327 | (parameters)f(when)g(an)g(in)m(ter-)150 1038 y(activ)m(e)k(shell)d(is)h | |
13328 | (started.)150 1232 y Fj(6.3.2)63 b(Is)41 b(this)g(Shell)g(In)m | |
13329 | (teractiv)m(e?)150 1379 y Ft(T)-8 b(o)30 b(determine)g(within)f(a)h | |
13330 | (startup)g(script)f(whether)g(or)h(not)g(Bash)g(is)g(running)e(in)m | |
13331 | (teractiv)m(ely)-8 b(,)33 b(test)e(the)150 1489 y(v)-5 | |
13332 | b(alue)30 b(of)g(the)f(`)p Fs(-)p Ft(')h(sp)s(ecial)g(parameter.)41 | |
13333 | b(It)29 b(con)m(tains)i Fs(i)e Ft(when)g(the)g(shell)h(is)f(in)m | |
13334 | (teractiv)m(e.)44 b(F)-8 b(or)30 b(example:)390 1621 | |
13335 | y Fs(case)47 b("$-")f(in)390 1730 y(*i*\))h(echo)f(This)h(shell)f(is)h | |
13336 | (interactive)e(;;)390 1840 y(*\))i(echo)g(This)f(shell)h(is)g(not)g | |
13337 | (interactive)e(;;)390 1949 y(esac)275 2081 y Ft(Alternativ)m(ely)-8 | |
13338 | b(,)28 b(startup)23 b(scripts)h(ma)m(y)g(examine)g(the)g(v)-5 | |
37c41ab1 | 13339 | b(ariable)25 b Fs(PS1)p Ft(;)g(it)g(is)e(unset)h(in)f(non-in)m |
eb0b2ad8 CR |
13340 | (teractiv)m(e)150 2191 y(shells,)31 b(and)e(set)i(in)f(in)m(teractiv)m |
13341 | (e)k(shells.)40 b(Th)m(us:)390 2323 y Fs(if)47 b([)h(-z)f("$PS1")f(];)h | |
13342 | (then)772 2432 y(echo)f(This)h(shell)f(is)i(not)f(interactive)390 | |
13343 | 2542 y(else)772 2651 y(echo)f(This)h(shell)f(is)i(interactive)390 | |
13344 | 2761 y(fi)150 2955 y Fj(6.3.3)63 b(In)m(teractiv)m(e)38 | |
13345 | b(Shell)k(Beha)m(vior)150 3102 y Ft(When)30 b(the)h(shell)f(is)h | |
c302751c | 13346 | (running)d(in)m(teractiv)m(ely)-8 b(,)34 b(it)d(c)m(hanges)h(its)f(b)s |
eb0b2ad8 | 13347 | (eha)m(vior)f(in)g(sev)m(eral)i(w)m(a)m(ys.)199 3234 |
37c41ab1 CR |
13348 | y(1.)61 b(Startup)37 b(\014les)g(are)h(read)f(and)g(executed)h(as)f |
13349 | (describ)s(ed)g(in)g(Section)h(6.2)g([Bash)g(Startup)e(Files],)330 | |
9f178efb CR |
13350 | 3343 y(page)31 b(81.)199 3475 y(2.)61 b(Job)35 b(Con)m(trol)g(\(see)h |
13351 | (Chapter)f(7)g([Job)g(Con)m(trol],)i(page)f(97\))g(is)f(enabled)g(b)m | |
eb0b2ad8 | 13352 | (y)g(default.)55 b(When)34 b(job)330 3585 y(con)m(trol)h(is)f(in)f |
37c41ab1 | 13353 | (e\013ect,)k(Bash)d(ignores)g(the)g(k)m(eyb)s(oard-generated)h(job)e |
eb0b2ad8 CR |
13354 | (con)m(trol)i(signals)g Fs(SIGTTIN)p Ft(,)330 3694 y |
13355 | Fs(SIGTTOU)p Ft(,)29 b(and)g Fs(SIGTSTP)p Ft(.)199 3826 | |
c302751c CR |
13356 | y(3.)61 b(Bash)39 b(expands)f(and)g(displa)m(ys)h Fs(PS1)f |
13357 | Ft(b)s(efore)h(reading)g(the)g(\014rst)f(line)h(of)g(a)g(command,)i | |
eb0b2ad8 | 13358 | (and)d(ex-)330 3936 y(pands)30 b(and)g(displa)m(ys)h |
37c41ab1 | 13359 | Fs(PS2)e Ft(b)s(efore)i(reading)g(the)g(second)f(and)h(subsequen)m(t)f |
eb0b2ad8 CR |
13360 | (lines)h(of)g(a)g(m)m(ulti-line)330 4045 y(command.)199 |
13361 | 4177 y(4.)61 b(Bash)26 b(executes)i(the)e(v)-5 b(alue)27 | |
37c41ab1 | 13362 | b(of)f(the)h Fs(PROMPT_COMMAND)22 b Ft(v)-5 b(ariable)27 |
eb0b2ad8 | 13363 | b(as)g(a)f(command)g(b)s(efore)g(prin)m(ting)330 4287 |
37c41ab1 | 13364 | y(the)31 b(primary)e(prompt,)h Fs($PS1)f Ft(\(see)i(Section)g(5.2)h |
9f178efb CR |
13365 | ([Bash)f(V)-8 b(ariables],)32 b(page)f(69\).)199 4419 |
13366 | y(5.)61 b(Readline)27 b(\(see)g(Chapter)e(8)h([Command)g(Line)g | |
13367 | (Editing],)h(page)g(101\))g(is)f(used)g(to)g(read)g(commands)330 | |
13368 | 4528 y(from)k(the)g(user's)g(terminal.)199 4660 y(6.)61 | |
37c41ab1 CR |
13369 | b(Bash)36 b(insp)s(ects)g(the)h(v)-5 b(alue)37 b(of)f(the)g |
13370 | Fs(ignoreeof)e Ft(option)j(to)g Fs(set)29 b(-o)36 b Ft(instead)h(of)f | |
eb0b2ad8 | 13371 | (exiting)i(imme-)330 4770 y(diately)f(when)e(it)i(receiv)m(es)h(an)e |
37c41ab1 | 13372 | Fs(EOF)f Ft(on)h(its)g(standard)f(input)g(when)h(reading)g(a)g(command) |
eb0b2ad8 | 13373 | g(\(see)330 4879 y(Section)31 b(4.3.1)h([The)e(Set)h(Builtin],)g(page)g |
9f178efb CR |
13374 | (58\).)199 5011 y(7.)61 b(Command)43 b(history)h(\(see)h(Section)g(9.1) |
13375 | g([Bash)f(History)h(F)-8 b(acilities],)51 b(page)45 b(133\))h(and)d | |
13376 | (history)330 5121 y(expansion)h(\(see)i(Section)f(9.3)h([History)g(In)m | |
13377 | (teraction],)k(page)45 b(135\))h(are)f(enabled)g(b)m(y)f(default.)330 | |
13378 | 5230 y(Bash)28 b(will)g(sa)m(v)m(e)h(the)f(command)f(history)h(to)g | |
13379 | (the)g(\014le)g(named)f(b)m(y)h Fs($HISTFILE)d Ft(when)h(a)i(shell)g | |
13380 | (with)330 5340 y(history)i(enabled)h(exits.)p eop end | |
13381 | %%Page: 84 90 | |
13382 | TeXDict begin 84 89 bop 150 -116 a Ft(84)2572 b(Bash)31 | |
eb0b2ad8 | 13383 | b(Reference)g(Man)m(ual)199 299 y(8.)61 b(Alias)31 b(expansion)g(\(see) |
9f178efb | 13384 | g(Section)g(6.6)g([Aliases],)i(page)e(87\))h(is)e(p)s(erformed)f(b)m(y) |
eb0b2ad8 CR |
13385 | h(default.)199 431 y(9.)61 b(In)24 b(the)g(absence)h(of)f(an)m(y)h |
13386 | (traps,)g(Bash)g(ignores)f Fs(SIGTERM)f Ft(\(see)i(Section)g(3.7.6)h | |
9f178efb | 13387 | ([Signals],)g(page)f(38\).)154 563 y(10.)61 b(In)26 b(the)h(absence)h |
eb0b2ad8 | 13388 | (of)f(an)m(y)g(traps,)g Fs(SIGINT)e Ft(is)i(caugh)m(t)h(and)f(handled)e |
9f178efb | 13389 | (\(\(see)k(Section)e(3.7.6)i([Signals],)330 672 y(page)i(38\).)42 |
37c41ab1 | 13390 | b Fs(SIGINT)29 b Ft(will)h(in)m(terrupt)g(some)h(shell)g(builtins.)154 |
eb0b2ad8 | 13391 | 804 y(11.)61 b(An)40 b(in)m(teractiv)m(e)j(login)e(shell)g(sends)e(a)i |
37c41ab1 | 13392 | Fs(SIGHUP)d Ft(to)j(all)g(jobs)f(on)g(exit)h(if)g(the)f |
eb0b2ad8 | 13393 | Fs(huponexit)e Ft(shell)330 914 y(option)31 b(has)f(b)s(een)g(enabled)g |
9f178efb | 13394 | (\(see)h(Section)g(3.7.6)i([Signals],)e(page)g(38\).)154 |
eb0b2ad8 | 13395 | 1046 y(12.)61 b(The)26 b(`)p Fs(-n)p Ft(')f(in)m(v)m(o)s(cation)k |
d3ad40de CR |
13396 | (option)d(is)g(ignored,)h(and)f(`)p Fs(set)k(-n)p Ft(')25 |
13397 | b(has)h(no)g(e\013ect)i(\(see)e(Section)h(4.3.1)h([The)330 | |
9f178efb | 13398 | 1155 y(Set)j(Builtin],)g(page)g(58\).)154 1287 y(13.)61 |
d3ad40de CR |
13399 | b(Bash)32 b(will)g(c)m(hec)m(k)i(for)e(mail)g(p)s(erio)s(dically)-8 |
13400 | b(,)34 b(dep)s(ending)c(on)i(the)g(v)-5 b(alues)32 b(of)g(the)h | |
eb0b2ad8 | 13401 | Fs(MAIL)p Ft(,)e Fs(MAILPATH)p Ft(,)330 1397 y(and)f |
d3ad40de | 13402 | Fs(MAILCHECK)e Ft(shell)i(v)-5 b(ariables)31 b(\(see)h(Section)f(5.2)g |
9f178efb | 13403 | ([Bash)g(V)-8 b(ariables],)32 b(page)f(69\).)154 1528 |
d3ad40de CR |
13404 | y(14.)61 b(Expansion)32 b(errors)h(due)f(to)i(references)f(to)h(un)m(b) |
13405 | s(ound)c(shell)j(v)-5 b(ariables)34 b(after)g(`)p Fs(set)29 | |
eb0b2ad8 | 13406 | b(-u)p Ft(')k(has)g(b)s(een)330 1638 y(enabled)d(will)h(not)g(cause)g |
d3ad40de | 13407 | (the)f(shell)h(to)g(exit)g(\(see)g(Section)h(4.3.1)g([The)e(Set)h |
9f178efb | 13408 | (Builtin],)g(page)g(58\).)154 1770 y(15.)61 b(The)48 |
d3ad40de CR |
13409 | b(shell)h(will)f(not)h(exit)g(on)g(expansion)f(errors)g(caused)g(b)m(y) |
13410 | h Fq(v)-5 b(ar)54 b Ft(b)s(eing)48 b(unset)g(or)h(n)m(ull)f(in)330 | |
eb0b2ad8 | 13411 | 1879 y Fs(${)p Fi(var)11 b Fs(:?)p Fi(word)g Fs(})26 |
d3ad40de | 13412 | b Ft(expansions)k(\(see)h(Section)h(3.5.3)g([Shell)e(P)m(arameter)i |
45c0f7f8 | 13413 | (Expansion],)e(page)h(22\).)154 2011 y(16.)61 b(Redirection)31 |
d3ad40de | 13414 | b(errors)f(encoun)m(tered)h(b)m(y)f(shell)h(builtins)f(will)g(not)h |
eb0b2ad8 | 13415 | (cause)g(the)f(shell)h(to)g(exit.)154 2143 y(17.)61 b(When)26 |
d3ad40de CR |
13416 | b(running)f(in)i Fl(posix)e Ft(mo)s(de,)j(a)f(sp)s(ecial)g(builtin)f |
13417 | (returning)g(an)g(error)h(status)g(will)g(not)f(cause)330 | |
eb0b2ad8 | 13418 | 2253 y(the)31 b(shell)f(to)h(exit)h(\(see)f(Section)g(6.11)h([Bash)f |
9f178efb | 13419 | (POSIX)e(Mo)s(de],)i(page)g(92\).)154 2385 y(18.)61 b(A)34 |
d3ad40de CR |
13420 | b(failed)g Fs(exec)f Ft(will)h(not)g(cause)g(the)g(shell)g(to)g(exit)h |
13421 | (\(see)f(Section)h(4.1)g([Bourne)f(Shell)f(Builtins],)330 | |
9f178efb | 13422 | 2494 y(page)e(41\).)154 2626 y(19.)61 b(P)m(arser)31 |
37c41ab1 | 13423 | b(syn)m(tax)f(errors)g(will)h(not)g(cause)g(the)f(shell)h(to)g(exit.) |
eb0b2ad8 | 13424 | 154 2758 y(20.)61 b(Simple)21 b(sp)s(elling)h(correction)g(for)g |
37c41ab1 | 13425 | (directory)g(argumen)m(ts)f(to)i(the)e Fs(cd)g Ft(builtin)g(is)h |
eb0b2ad8 | 13426 | (enabled)f(b)m(y)h(default)330 2868 y(\(see)35 b(the)g(description)f |
d3ad40de | 13427 | (of)h(the)f Fs(cdspell)f Ft(option)h(to)i(the)e Fs(shopt)f |
eb0b2ad8 | 13428 | Ft(builtin)h(in)g(Section)h(4.3.2)h([The)330 2977 y(Shopt)30 |
9f178efb | 13429 | b(Builtin],)h(page)g(62\).)154 3109 y(21.)61 b(The)42 |
d3ad40de CR |
13430 | b(shell)h(will)g(c)m(hec)m(k)h(the)f(v)-5 b(alue)43 b(of)f(the)h |
13431 | Fs(TMOUT)e Ft(v)-5 b(ariable)44 b(and)e(exit)h(if)g(a)g(command)f(is)h | |
eb0b2ad8 | 13432 | (not)330 3219 y(read)30 b(within)g(the)g(sp)s(eci\014ed)f(n)m(um)m(b)s |
d3ad40de | 13433 | (er)g(of)i(seconds)f(after)g(prin)m(ting)g Fs($PS1)f |
eb0b2ad8 | 13434 | Ft(\(see)i(Section)g(5.2)h([Bash)330 3328 y(V)-8 b(ariables],)32 |
9f178efb | 13435 | b(page)f(69\).)150 3555 y Fr(6.4)68 b(Bash)45 b(Conditional)h |
eb0b2ad8 | 13436 | (Expressions)150 3715 y Ft(Conditional)26 b(expressions)g(are)g(used)f |
c302751c | 13437 | (b)m(y)g(the)h Fs([[)f Ft(comp)s(ound)g(command)g(and)g(the)h |
eb0b2ad8 CR |
13438 | Fs(test)f Ft(and)g Fs([)g Ft(builtin)150 3824 y(commands.)275 |
13439 | 3956 y(Expressions)32 b(ma)m(y)h(b)s(e)g(unary)f(or)h(binary)-8 | |
c302751c | 13440 | b(.)48 b(Unary)33 b(expressions)f(are)i(often)f(used)f(to)i(examine)g |
eb0b2ad8 | 13441 | (the)150 4066 y(status)26 b(of)g(a)h(\014le.)39 b(There)26 |
c302751c | 13442 | b(are)g(string)g(op)s(erators)g(and)g(n)m(umeric)f(comparison)i(op)s |
eb0b2ad8 | 13443 | (erators)f(as)g(w)m(ell.)40 b(If)26 b(the)150 4175 y |
c302751c CR |
13444 | Fq(\014le)38 b Ft(argumen)m(t)c(to)f(one)h(of)f(the)g(primaries)g(is)g |
13445 | (of)g(the)g(form)g(`)p Fs(/dev/fd/)p Fi(N)11 b Ft(',)31 | |
eb0b2ad8 | 13446 | b(then)i(\014le)g(descriptor)g Fq(N)43 b Ft(is)150 4285 |
c302751c CR |
13447 | y(c)m(hec)m(k)m(ed.)e(If)26 b(the)g Fq(\014le)31 b Ft(argumen)m(t)26 |
13448 | b(to)h(one)f(of)g(the)h(primaries)e(is)h(one)g(of)g(`)p | |
13449 | Fs(/dev/stdin)p Ft(',)f(`)p Fs(/dev/stdout)p Ft(',)150 | |
eb0b2ad8 | 13450 | 4395 y(or)30 b(`)p Fs(/dev/stderr)p Ft(',)e(\014le)j(descriptor)f(0,)h |
c302751c | 13451 | (1,)g(or)g(2,)g(resp)s(ectiv)m(ely)-8 b(,)32 b(is)e(c)m(hec)m(k)m(ed.) |
54a1fa7c CR |
13452 | 275 4526 y(When)j(used)g(with)h(`)p Fs([[)p Ft(',)h(the)f(`)p |
13453 | Fs(<)p Ft(')g(and)f(`)p Fs(>)p Ft(')h(op)s(erators)g(sort)g | |
13454 | (lexicographically)j(using)c(the)h(curren)m(t)150 4636 | |
13455 | y(lo)s(cale.)42 b(The)30 b Fs(test)f Ft(command)i(uses)f(ASCI)s(I)e | |
13456 | (ordering.)275 4768 y(Unless)44 b(otherwise)h(sp)s(eci\014ed,)j | |
e6062848 | 13457 | (primaries)c(that)h(op)s(erate)g(on)g(\014les)f(follo)m(w)i(sym)m(b)s |
eb0b2ad8 | 13458 | (olic)f(links)g(and)150 4878 y(op)s(erate)31 b(on)f(the)h(target)h(of)e |
e6062848 | 13459 | (the)h(link,)f(rather)h(than)f(the)g(link)h(itself.)150 |
eb0b2ad8 CR |
13460 | 5032 y Fs(-a)f Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g |
13461 | Fq(\014le)36 b Ft(exists.)150 5186 y Fs(-b)30 b Fi(file)162 | |
13462 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 | |
13463 | b(and)f(is)g(a)h(blo)s(c)m(k)g(sp)s(ecial)g(\014le.)150 | |
13464 | 5340 y Fs(-c)f Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g | |
13465 | Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(a)h(c)m(haracter)h(sp)s(ecial) | |
13466 | f(\014le.)p eop end | |
9f178efb CR |
13467 | %%Page: 85 91 |
13468 | TeXDict begin 85 90 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13469 | b(Bash)30 b(F)-8 b(eatures)2484 b(85)150 299 y Fs(-d)30 | |
c302751c | 13470 | b Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 |
8f714a7c | 13471 | b Ft(exists)31 b(and)f(is)g(a)h(directory)-8 b(.)150 |
220537f2 CR |
13472 | 463 y Fs(-e)30 b Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g |
13473 | Fq(\014le)36 b Ft(exists.)150 628 y Fs(-f)30 b Fi(file)162 | |
37c41ab1 | 13474 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 |
220537f2 | 13475 | b(and)f(is)g(a)h(regular)f(\014le.)150 792 y Fs(-g)g |
8f714a7c CR |
13476 | Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b |
13477 | Ft(exists)31 b(and)f(its)g(set-group-id)h(bit)g(is)f(set.)150 | |
220537f2 | 13478 | 956 y Fs(-h)g Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 |
eb0b2ad8 | 13479 | b Ft(exists)31 b(and)f(is)g(a)h(sym)m(b)s(olic)g(link.)150 |
220537f2 | 13480 | 1121 y Fs(-k)f Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g |
8f714a7c | 13481 | Fq(\014le)36 b Ft(exists)31 b(and)f(its)g Fs(")p Ft(stic)m(ky)p |
220537f2 | 13482 | Fs(")h Ft(bit)g(is)f(set.)150 1285 y Fs(-p)g Fi(file)162 |
37c41ab1 | 13483 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 |
220537f2 | 13484 | b(and)f(is)g(a)h(named)f(pip)s(e)f(\(FIF)m(O\).)150 1450 |
8f714a7c | 13485 | y Fs(-r)h Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 |
220537f2 | 13486 | b Ft(exists)31 b(and)f(is)g(readable.)150 1614 y Fs(-s)g |
8f714a7c CR |
13487 | Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b |
13488 | Ft(exists)31 b(and)f(has)g(a)g(size)i(greater)f(than)f(zero.)150 | |
220537f2 | 13489 | 1778 y Fs(-t)g Fi(fd)258 b Ft(T)-8 b(rue)30 b(if)g(\014le)h(descriptor) |
8f714a7c | 13490 | f Fq(fd)j Ft(is)e(op)s(en)e(and)h(refers)g(to)h(a)g(terminal.)150 |
220537f2 | 13491 | 1943 y Fs(-u)f Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g |
8f714a7c | 13492 | Fq(\014le)36 b Ft(exists)31 b(and)f(its)g(set-user-id)h(bit)f(is)h |
220537f2 | 13493 | (set.)150 2107 y Fs(-w)f Fi(file)162 b Ft(T)-8 b(rue)30 |
8f714a7c | 13494 | b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(writable.)150 |
220537f2 | 13495 | 2271 y Fs(-x)g Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g |
8f714a7c | 13496 | Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(executable.)150 |
220537f2 | 13497 | 2436 y Fs(-G)g Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g |
37c41ab1 | 13498 | Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(o)m(wned)g(b)m(y)h(the)f |
220537f2 | 13499 | (e\013ectiv)m(e)j(group)d(id.)150 2600 y Fs(-L)g Fi(file)162 |
37c41ab1 | 13500 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 |
220537f2 | 13501 | b(and)f(is)g(a)h(sym)m(b)s(olic)g(link.)150 2765 y Fs(-N)f |
5cdaaf76 CR |
13502 | Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b |
13503 | Ft(exists)31 b(and)f(has)g(b)s(een)f(mo)s(di\014ed)h(since)g(it)h(w)m | |
220537f2 | 13504 | (as)g(last)g(read.)150 2929 y Fs(-O)f Fi(file)162 b Ft(T)-8 |
5cdaaf76 | 13505 | b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(o)m(wned)g(b)m |
220537f2 | 13506 | (y)h(the)f(e\013ectiv)m(e)j(user)d(id.)150 3093 y Fs(-S)g |
5cdaaf76 | 13507 | Fi(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b |
220537f2 CR |
13508 | Ft(exists)31 b(and)f(is)g(a)h(so)s(c)m(k)m(et.)150 3258 |
13509 | y Fi(file1)39 b Fs(-ef)30 b Fi(file2)630 3367 y Ft(T)-8 | |
5cdaaf76 CR |
13510 | b(rue)30 b(if)g Fq(\014le1)38 b Ft(and)30 b Fq(\014le2)38 |
13511 | b Ft(refer)30 b(to)i(the)e(same)h(device)g(and)f(ino)s(de)g(n)m(um)m(b) | |
220537f2 CR |
13512 | s(ers.)150 3532 y Fi(file1)39 b Fs(-nt)30 b Fi(file2)630 |
13513 | 3641 y Ft(T)-8 b(rue)23 b(if)g Fq(\014le1)31 b Ft(is)24 | |
5cdaaf76 CR |
13514 | b(new)m(er)f(\(according)i(to)f(mo)s(di\014cation)g(date\))g(than)g |
13515 | Fq(\014le2)7 b Ft(,)25 b(or)f(if)f Fq(\014le1)31 b Ft(exists)630 | |
220537f2 CR |
13516 | 3751 y(and)f Fq(\014le2)38 b Ft(do)s(es)30 b(not.)150 |
13517 | 3915 y Fi(file1)39 b Fs(-ot)30 b Fi(file2)630 4025 y | |
5cdaaf76 CR |
13518 | Ft(T)-8 b(rue)30 b(if)g Fq(\014le1)38 b Ft(is)31 b(older)f(than)g |
13519 | Fq(\014le2)7 b Ft(,)32 b(or)e(if)h Fq(\014le2)38 b Ft(exists)31 | |
220537f2 CR |
13520 | b(and)e Fq(\014le1)39 b Ft(do)s(es)30 b(not.)150 4189 |
13521 | y Fs(-o)g Fi(optname)630 4299 y Ft(T)-8 b(rue)41 b(if)g(the)g(shell)h | |
13522 | (option)f Fq(optname)47 b Ft(is)41 b(enabled.)73 b(The)41 | |
13523 | b(list)h(of)f(options)h(app)s(ears)e(in)630 4408 y(the)30 | |
13524 | b(description)f(of)h(the)g(`)p Fs(-o)p Ft(')f(option)h(to)h(the)e | |
13525 | Fs(set)g Ft(builtin)g(\(see)i(Section)f(4.3.1)h([The)f(Set)630 | |
9f178efb | 13526 | 4518 y(Builtin],)h(page)g(58\).)150 4682 y Fs(-v)f Fi(varname)630 |
220537f2 CR |
13527 | 4792 y Ft(T)-8 b(rue)30 b(if)g(the)h(shell)f(v)-5 b(ariable)32 |
13528 | b Fq(v)-5 b(arname)35 b Ft(is)30 b(set)h(\(has)g(b)s(een)e(assigned)i | |
13529 | (a)g(v)-5 b(alue\).)150 4956 y Fs(-z)30 b Fi(string)630 | |
13530 | 5066 y Ft(T)-8 b(rue)30 b(if)g(the)h(length)g(of)f Fq(string)38 | |
13531 | b Ft(is)31 b(zero.)150 5230 y Fs(-n)f Fi(string)150 5340 | |
5cdaaf76 | 13532 | y(string)192 b Ft(T)-8 b(rue)30 b(if)g(the)h(length)g(of)f |
220537f2 | 13533 | Fq(string)38 b Ft(is)31 b(non-zero.)p eop end |
9f178efb CR |
13534 | %%Page: 86 92 |
13535 | TeXDict begin 86 91 bop 150 -116 a Ft(86)2572 b(Bash)31 | |
220537f2 CR |
13536 | b(Reference)g(Man)m(ual)150 299 y Fi(string1)39 b Fs(==)30 |
13537 | b Fi(string2)150 408 y(string1)39 b Fs(=)30 b Fi(string2)630 | |
13538 | 518 y Ft(T)-8 b(rue)35 b(if)h(the)g(strings)g(are)g(equal.)58 | |
13539 | b(`)p Fs(=)p Ft(')36 b(should)f(b)s(e)g(used)g(with)h(the)g | |
13540 | Fs(test)f Ft(command)g(for)630 628 y Fl(posix)30 b Ft(conformance.)150 | |
13541 | 790 y Fi(string1)39 b Fs(!=)30 b Fi(string2)630 899 y | |
13542 | Ft(T)-8 b(rue)30 b(if)g(the)h(strings)f(are)h(not)f(equal.)150 | |
13543 | 1061 y Fi(string1)39 b Fs(<)30 b Fi(string2)630 1171 | |
13544 | y Ft(T)-8 b(rue)30 b(if)g Fq(string1)38 b Ft(sorts)31 | |
8f714a7c | 13545 | b(b)s(efore)f Fq(string2)38 b Ft(lexicographically)-8 |
220537f2 CR |
13546 | b(.)150 1333 y Fi(string1)39 b Fs(>)30 b Fi(string2)630 |
13547 | 1442 y Ft(T)-8 b(rue)30 b(if)g Fq(string1)38 b Ft(sorts)31 | |
4a8bb13f | 13548 | b(after)g Fq(string2)38 b Ft(lexicographically)-8 b(.)150 |
220537f2 | 13549 | 1604 y Fi(arg1)40 b Fs(OP)29 b Fi(arg2)630 1714 y Fs(OP)k |
37c41ab1 CR |
13550 | Ft(is)h(one)g(of)h(`)p Fs(-eq)p Ft(',)f(`)p Fs(-ne)p |
13551 | Ft(',)h(`)p Fs(-lt)p Ft(',)g(`)p Fs(-le)p Ft(',)f(`)p | |
5e13499c | 13552 | Fs(-gt)p Ft(',)h(or)f(`)p Fs(-ge)p Ft('.)51 b(These)34 |
220537f2 | 13553 | b(arithmetic)h(binary)630 1823 y(op)s(erators)h(return)e(true)i(if)f |
37c41ab1 | 13554 | Fq(arg1)44 b Ft(is)36 b(equal)g(to,)i(not)e(equal)g(to,)i(less)e(than,) |
220537f2 | 13555 | h(less)f(than)f(or)630 1933 y(equal)28 b(to,)h(greater)g(than,)f(or)f |
c302751c CR |
13556 | (greater)i(than)e(or)h(equal)g(to)g Fq(arg2)7 b Ft(,)30 |
13557 | b(resp)s(ectiv)m(ely)-8 b(.)41 b Fq(Arg1)36 b Ft(and)630 | |
220537f2 CR |
13558 | 2043 y Fq(arg2)j Ft(ma)m(y)30 b(b)s(e)g(p)s(ositiv)m(e)i(or)e(negativ)m |
13559 | (e)j(in)m(tegers.)150 2279 y Fr(6.5)68 b(Shell)45 b(Arithmetic)150 | |
13560 | 2438 y Ft(The)35 b(shell)g(allo)m(ws)i(arithmetic)f(expressions)f(to)h | |
c302751c | 13561 | (b)s(e)f(ev)-5 b(aluated,)38 b(as)d(one)h(of)f(the)h(shell)f |
220537f2 | 13562 | (expansions)g(or)150 2548 y(b)m(y)30 b(the)h Fs(let)e |
c302751c | 13563 | Ft(and)h(the)h(`)p Fs(-i)p Ft(')f(option)h(to)g(the)f |
220537f2 | 13564 | Fs(declare)f Ft(builtins.)275 2685 y(Ev)-5 b(aluation)27 |
37c41ab1 CR |
13565 | b(is)g(done)f(in)g(\014xed-width)g(in)m(tegers)i(with)e(no)h(c)m(hec)m |
13566 | (k)h(for)e(o)m(v)m(er\015o)m(w,)j(though)d(division)h(b)m(y)150 | |
220537f2 | 13567 | 2795 y(0)g(is)g(trapp)s(ed)f(and)h(\015agged)g(as)h(an)f(error.)39 |
37c41ab1 | 13568 | b(The)26 b(op)s(erators)h(and)g(their)g(precedence,)h(asso)s(ciativit)m |
220537f2 | 13569 | (y)-8 b(,)32 b(and)150 2904 y(v)-5 b(alues)35 b(are)h(the)f(same)g(as)h |
37c41ab1 | 13570 | (in)e(the)h(C)g(language.)56 b(The)35 b(follo)m(wing)h(list)g(of)f(op)s |
220537f2 | 13571 | (erators)g(is)g(group)s(ed)f(in)m(to)150 3014 y(lev)m(els)27 |
37c41ab1 CR |
13572 | b(of)f(equal-precedence)i(op)s(erators.)39 b(The)25 b(lev)m(els)j(are)e |
13573 | (listed)h(in)e(order)h(of)g(decreasing)g(precedence.)150 | |
220537f2 | 13574 | 3177 y Fi(id)11 b Fs(++)29 b Fi(id)11 b Fs(--)630 3287 |
c302751c | 13575 | y Ft(v)-5 b(ariable)31 b(p)s(ost-incremen)m(t)g(and)f(p)s(ost-decremen) |
220537f2 | 13576 | m(t)150 3449 y Fs(++)p Fi(id)40 b Fs(--)p Fi(id)630 3558 |
37c41ab1 | 13577 | y Ft(v)-5 b(ariable)31 b(pre-incremen)m(t)g(and)f(pre-decremen)m(t)150 |
220537f2 CR |
13578 | 3720 y Fs(-)g(+)354 b Ft(unary)29 b(min)m(us)h(and)g(plus)150 |
13579 | 3882 y Fs(!)g(~)354 b Ft(logical)33 b(and)d(bit)m(wise)h(negation)150 | |
13580 | 4044 y Fs(**)384 b Ft(exp)s(onen)m(tiation)150 4206 y | |
c302751c | 13581 | Fs(*)30 b(/)g(\045)276 b Ft(m)m(ultiplication,)33 b(division,)d |
220537f2 CR |
13582 | (remainder)150 4368 y Fs(+)g(-)354 b Ft(addition,)31 |
13583 | b(subtraction)150 4530 y Fs(<<)f(>>)258 b Ft(left)31 | |
13584 | b(and)f(righ)m(t)h(bit)m(wise)g(shifts)150 4692 y Fs(<=)f(>=)g(<)g(>) | |
13585 | 102 b Ft(comparison)150 4854 y Fs(==)30 b(!=)258 b Ft(equalit)m(y)32 | |
13586 | b(and)e(inequalit)m(y)150 5016 y Fs(&)432 b Ft(bit)m(wise)31 | |
13587 | b(AND)150 5178 y Fs(^)432 b Ft(bit)m(wise)31 b(exclusiv)m(e)h(OR)150 | |
13588 | 5340 y Fs(|)432 b Ft(bit)m(wise)31 b(OR)p eop end | |
9f178efb CR |
13589 | %%Page: 87 93 |
13590 | TeXDict begin 87 92 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13591 | b(Bash)30 b(F)-8 b(eatures)2484 b(87)150 299 y Fs(&&)384 | |
220537f2 CR |
13592 | b Ft(logical)33 b(AND)150 446 y Fs(||)384 b Ft(logical)33 |
13593 | b(OR)150 592 y Fs(expr)c(?)h(expr)f(:)h(expr)630 702 | |
13594 | y Ft(conditional)i(op)s(erator)150 849 y Fs(=)e(*=)g(/=)g(\045=)f(+=)h | |
13595 | (-=)g(<<=)f(>>=)h(&=)g(^=)f(|=)630 958 y Ft(assignmen)m(t)150 | |
13596 | 1105 y Fs(expr1)g(,)h(expr2)630 1214 y Ft(comma)275 1361 | |
13597 | y(Shell)38 b(v)-5 b(ariables)39 b(are)g(allo)m(w)m(ed)i(as)e(op)s | |
13598 | (erands;)i(parameter)e(expansion)g(is)f(p)s(erformed)g(b)s(efore)g(the) | |
13599 | 150 1471 y(expression)g(is)g(ev)-5 b(aluated.)66 b(Within)38 | |
13600 | b(an)h(expression,)h(shell)e(v)-5 b(ariables)39 b(ma)m(y)g(also)g(b)s | |
13601 | (e)f(referenced)g(b)m(y)150 1580 y(name)31 b(without)f(using)g(the)h | |
13602 | (parameter)g(expansion)f(syn)m(tax.)42 b(A)31 b(shell)f(v)-5 | |
13603 | b(ariable)32 b(that)f(is)f(n)m(ull)h(or)f(unset)150 1690 | |
13604 | y(ev)-5 b(aluates)41 b(to)f(0)g(when)e(referenced)h(b)m(y)g(name)h | |
13605 | (without)f(using)g(the)g(parameter)h(expansion)f(syn)m(tax.)150 | |
13606 | 1800 y(The)c(v)-5 b(alue)37 b(of)f(a)h(v)-5 b(ariable)36 | |
13607 | b(is)g(ev)-5 b(aluated)38 b(as)e(an)g(arithmetic)h(expression)f(when)f | |
13608 | (it)h(is)g(referenced,)i(or)150 1909 y(when)31 b(a)i(v)-5 | |
13609 | b(ariable)33 b(whic)m(h)f(has)g(b)s(een)f(giv)m(en)j(the)e | |
13610 | Fq(in)m(teger)40 b Ft(attribute)33 b(using)f(`)p Fs(declare)d(-i)p | |
e05be32d CR |
13611 | Ft(')i(is)i(assigned)150 2019 y(a)j(v)-5 b(alue.)58 b(A)36 |
13612 | b(n)m(ull)f(v)-5 b(alue)37 b(ev)-5 b(aluates)37 b(to)g(0.)57 | |
13613 | b(A)36 b(shell)g(v)-5 b(ariable)37 b(need)e(not)h(ha)m(v)m(e)h(its)f | |
13614 | Fq(in)m(teger)44 b Ft(attribute)150 2128 y(turned)29 | |
13615 | b(on)h(to)i(b)s(e)d(used)h(in)g(an)g(expression.)275 | |
13616 | 2256 y(Constan)m(ts)41 b(with)g(a)h(leading)f(0)h(are)g(in)m(terpreted) | |
13617 | f(as)g(o)s(ctal)i(n)m(um)m(b)s(ers.)72 b(A)41 b(leading)h(`)p | |
13618 | Fs(0x)p Ft(')f(or)g(`)p Fs(0X)p Ft(')150 2366 y(denotes)31 | |
13619 | b(hexadecimal.)42 b(Otherwise,)30 b(n)m(um)m(b)s(ers)f(tak)m(e)j(the)f | |
13620 | (form)f([)p Fq(base)5 b Fs(#)p Ft(])p Fq(n)p Ft(,)31 | |
13621 | b(where)f(the)g(optional)i Fq(base)150 2476 y Ft(is)d(a)h(decimal)g(n)m | |
13622 | (um)m(b)s(er)e(b)s(et)m(w)m(een)h(2)h(and)e(64)i(represen)m(ting)g(the) | |
13623 | f(arithmetic)i(base,)e(and)g Fq(n)g Ft(is)g(a)g(n)m(um)m(b)s(er)150 | |
abe2eb5b CR |
13624 | 2585 y(in)e(that)h(base.)40 b(If)26 b Fq(base)5 b Fs(#)27 |
13625 | b Ft(is)h(omitted,)h(then)e(base)g(10)h(is)f(used.)39 | |
13626 | b(When)27 b(sp)s(ecifying)g Fq(n)p Ft(,)h(he)f(digits)h(greater)150 | |
13627 | 2695 y(than)33 b(9)h(are)g(represen)m(ted)g(b)m(y)f(the)h(lo)m(w)m | |
13628 | (ercase)i(letters,)g(the)d(upp)s(ercase)g(letters,)j(`)p | |
13629 | Fs(@)p Ft(',)e(and)f(`)p Fs(_)p Ft(',)i(in)e(that)150 | |
13630 | 2804 y(order.)69 b(If)39 b Fq(base)45 b Ft(is)40 b(less)g(than)g(or)f | |
13631 | (equal)i(to)f(36,)k(lo)m(w)m(ercase)e(and)d(upp)s(ercase)g(letters)i | |
13632 | (ma)m(y)g(b)s(e)e(used)150 2914 y(in)m(terc)m(hangeably)32 | |
13633 | b(to)f(represen)m(t)g(n)m(um)m(b)s(ers)e(b)s(et)m(w)m(een)i(10)g(and)f | |
13634 | (35.)275 3042 y(Op)s(erators)44 b(are)h(ev)-5 b(aluated)46 | |
13635 | b(in)f(order)f(of)h(precedence.)85 b(Sub-expressions)44 | |
13636 | b(in)g(paren)m(theses)i(are)150 3152 y(ev)-5 b(aluated)32 | |
13637 | b(\014rst)d(and)h(ma)m(y)h(o)m(v)m(erride)g(the)g(precedence)g(rules)f | |
13638 | (ab)s(o)m(v)m(e.)150 3371 y Fr(6.6)68 b(Aliases)150 3531 | |
13639 | y Fq(Aliases)41 b Ft(allo)m(w)d(a)f(string)f(to)h(b)s(e)f(substituted)g | |
13640 | (for)g(a)g(w)m(ord)g(when)g(it)h(is)f(used)f(as)i(the)g(\014rst)e(w)m | |
13641 | (ord)h(of)h(a)150 3640 y(simple)32 b(command.)45 b(The)31 | |
13642 | b(shell)i(main)m(tains)f(a)h(list)f(of)g(aliases)i(that)e(ma)m(y)h(b)s | |
13643 | (e)e(set)h(and)g(unset)f(with)h(the)150 3750 y Fs(alias)d | |
13644 | Ft(and)h Fs(unalias)e Ft(builtin)i(commands.)275 3878 | |
13645 | y(The)f(\014rst)f(w)m(ord)i(of)f(eac)m(h)i(simple)f(command,)g(if)f | |
13646 | (unquoted,)g(is)h(c)m(hec)m(k)m(ed)h(to)g(see)f(if)g(it)g(has)f(an)g | |
13647 | (alias.)150 3988 y(If)24 b(so,)i(that)g(w)m(ord)e(is)h(replaced)g(b)m | |
13648 | (y)f(the)h(text)h(of)e(the)h(alias.)40 b(The)24 b(c)m(haracters)i(`)p | |
13649 | Fs(/)p Ft(',)h(`)p Fs($)p Ft(',)f(`)p Fs(`)p Ft(',)g(`)p | |
13650 | Fs(=)p Ft(')f(and)f(an)m(y)h(of)150 4097 y(the)e(shell)g(metac)m | |
13651 | (haracters)i(or)e(quoting)g(c)m(haracters)h(listed)g(ab)s(o)m(v)m(e)g | |
13652 | (ma)m(y)f(not)g(app)s(ear)f(in)h(an)g(alias)h(name.)150 | |
13653 | 4207 y(The)e(replacemen)m(t)h(text)g(ma)m(y)g(con)m(tain)h(an)m(y)e(v) | |
13654 | -5 b(alid)23 b(shell)f(input,)h(including)f(shell)g(metac)m(haracters.) | |
13655 | 40 b(The)150 4317 y(\014rst)35 b(w)m(ord)g(of)h(the)g(replacemen)m(t)i | |
13656 | (text)e(is)g(tested)h(for)e(aliases,)k(but)c(a)h(w)m(ord)g(that)g(is)g | |
13657 | (iden)m(tical)i(to)e(an)150 4426 y(alias)c(b)s(eing)f(expanded)f(is)h | |
13658 | (not)g(expanded)f(a)h(second)g(time.)43 b(This)30 b(means)h(that)g(one) | |
13659 | g(ma)m(y)h(alias)g Fs(ls)e Ft(to)150 4536 y Fs("ls)f(-F")p | |
13660 | Ft(,)f(for)f(instance,)i(and)d(Bash)i(do)s(es)f(not)h(try)f(to)h | |
13661 | (recursiv)m(ely)g(expand)e(the)i(replacemen)m(t)h(text.)40 | |
13662 | b(If)150 4645 y(the)31 b(last)h(c)m(haracter)g(of)f(the)g(alias)h(v)-5 | |
13663 | b(alue)31 b(is)g(a)g Fq(blank)6 b Ft(,)30 b(then)h(the)g(next)g | |
13664 | (command)f(w)m(ord)h(follo)m(wing)h(the)150 4755 y(alias)g(is)e(also)h | |
13665 | (c)m(hec)m(k)m(ed)i(for)d(alias)h(expansion.)275 4883 | |
13666 | y(Aliases)e(are)f(created)i(and)d(listed)i(with)f(the)g | |
122f603c | 13667 | Fs(alias)f Ft(command,)h(and)g(remo)m(v)m(ed)h(with)f(the)g |
220537f2 | 13668 | Fs(unalias)150 4993 y Ft(command.)275 5121 y(There)44 |
37c41ab1 CR |
13669 | b(is)h(no)g(mec)m(hanism)g(for)f(using)h(argumen)m(ts)g(in)f(the)h |
13670 | (replacemen)m(t)i(text,)i(as)d(in)e Fs(csh)p Ft(.)83 | |
220537f2 | 13671 | b(If)150 5230 y(argumen)m(ts)37 b(are)h(needed,)g(a)g(shell)f(function) |
37c41ab1 | 13672 | f(should)g(b)s(e)h(used)f(\(see)i(Section)g(3.3)g([Shell)f(F)-8 |
45c0f7f8 | 13673 | b(unctions],)150 5340 y(page)31 b(16\).)p eop end |
9f178efb CR |
13674 | %%Page: 88 94 |
13675 | TeXDict begin 88 93 bop 150 -116 a Ft(88)2572 b(Bash)31 | |
220537f2 CR |
13676 | b(Reference)g(Man)m(ual)275 299 y(Aliases)i(are)h(not)e(expanded)g |
13677 | (when)g(the)h(shell)g(is)g(not)g(in)m(teractiv)m(e,)j(unless)c(the)h | |
13678 | Fs(expand_aliases)150 408 y Ft(shell)e(option)f(is)h(set)g(using)f | |
13679 | Fs(shopt)f Ft(\(see)i(Section)g(4.3.2)h([The)e(Shopt)g(Builtin],)h | |
9f178efb | 13680 | (page)g(62\).)275 548 y(The)38 b(rules)h(concerning)h(the)f |
220537f2 | 13681 | (de\014nition)g(and)g(use)g(of)g(aliases)i(are)e(somewhat)h(confusing.) |
9f178efb | 13682 | 67 b(Bash)150 657 y(alw)m(a)m(ys)42 b(reads)f(at)h(least)g(one)f |
220537f2 | 13683 | (complete)i(line)e(of)g(input)f(b)s(efore)h(executing)h(an)m(y)f(of)g |
9f178efb | 13684 | (the)g(commands)150 767 y(on)h(that)h(line.)77 b(Aliases)44 |
220537f2 | 13685 | b(are)e(expanded)g(when)f(a)i(command)f(is)g(read,)k(not)c(when)g(it)g |
9f178efb | 13686 | (is)h(executed.)150 877 y(Therefore,)f(an)e(alias)h(de\014nition)e(app) |
220537f2 | 13687 | s(earing)h(on)f(the)h(same)h(line)f(as)g(another)g(command)f(do)s(es)h |
9f178efb | 13688 | (not)150 986 y(tak)m(e)31 b(e\013ect)f(un)m(til)g(the)f(next)g(line)h |
220537f2 | 13689 | (of)f(input)f(is)h(read.)41 b(The)28 b(commands)h(follo)m(wing)i(the)e |
9f178efb | 13690 | (alias)h(de\014nition)150 1096 y(on)d(that)h(line)f(are)h(not)f |
220537f2 CR |
13691 | (a\013ected)i(b)m(y)e(the)g(new)g(alias.)41 b(This)26 |
13692 | b(b)s(eha)m(vior)h(is)g(also)h(an)f(issue)g(when)f(functions)150 | |
9f178efb | 13693 | 1205 y(are)d(executed.)39 b(Aliases)24 b(are)f(expanded)f(when)f(a)i |
220537f2 | 13694 | (function)g(de\014nition)f(is)h(read,)h(not)f(when)e(the)i(function)150 |
9f178efb | 13695 | 1315 y(is)i(executed,)j(b)s(ecause)d(a)h(function)f(de\014nition)f(is)i |
220537f2 | 13696 | (itself)g(a)f(comp)s(ound)f(command.)39 b(As)25 b(a)h(consequence,)150 |
9f178efb | 13697 | 1425 y(aliases)36 b(de\014ned)d(in)h(a)g(function)g(are)h(not)f(a)m(v) |
220537f2 | 13698 | -5 b(ailable)37 b(un)m(til)d(after)h(that)g(function)f(is)g(executed.) |
9f178efb | 13699 | 53 b(T)-8 b(o)35 b(b)s(e)150 1534 y(safe,)41 b(alw)m(a)m(ys)f(put)d |
220537f2 | 13700 | (alias)j(de\014nitions)e(on)g(a)h(separate)g(line,)i(and)d(do)g(not)g |
9f178efb CR |
13701 | (use)g Fs(alias)f Ft(in)h(comp)s(ound)150 1644 y(commands.)275 |
13702 | 1783 y(F)-8 b(or)31 b(almost)g(ev)m(ery)g(purp)s(ose,)e(shell)i | |
220537f2 | 13703 | (functions)f(are)g(preferred)g(o)m(v)m(er)h(aliases.)150 |
9f178efb | 13704 | 2023 y Fr(6.7)68 b(Arra)l(ys)150 2182 y Ft(Bash)33 b(pro)m(vides)g |
220537f2 | 13705 | (one-dimensional)g(indexed)f(and)h(asso)s(ciativ)m(e)i(arra)m(y)e(v)-5 |
c302751c | 13706 | b(ariables.)49 b(An)m(y)33 b(v)-5 b(ariable)33 b(ma)m(y)150 |
9f178efb | 13707 | 2292 y(b)s(e)e(used)h(as)g(an)g(indexed)f(arra)m(y;)j(the)e |
c302751c | 13708 | Fs(declare)e Ft(builtin)h(will)i(explicitly)g(declare)g(an)f(arra)m(y) |
9f178efb | 13709 | -8 b(.)46 b(There)32 b(is)150 2402 y(no)h(maxim)m(um)g(limit)h(on)f |
c302751c | 13710 | (the)g(size)h(of)g(an)f(arra)m(y)-8 b(,)35 b(nor)d(an)m(y)i(requiremen) |
9f178efb | 13711 | m(t)f(that)h(mem)m(b)s(ers)e(b)s(e)g(indexed)150 2511 |
c302751c CR |
13712 | y(or)26 b(assigned)h(con)m(tiguously)-8 b(.)41 b(Indexed)25 |
13713 | b(arra)m(ys)i(are)f(referenced)g(using)g(in)m(tegers)i(\(including)e | |
9f178efb CR |
13714 | (arithmetic)150 2621 y(expressions)38 b(\(see)h(Section)g(6.5)h([Shell) |
13715 | e(Arithmetic],)k(page)d(86\)\))h(and)d(are)i(zero-based;)k(asso)s | |
13716 | (ciativ)m(e)150 2730 y(arra)m(ys)37 b(use)f(arbitrary)g(strings.)59 | |
13717 | b(Unless)36 b(otherwise)h(noted,)h(indexed)e(arra)m(y)h(indices)f(m)m | |
13718 | (ust)g(b)s(e)g(non-)150 2840 y(negativ)m(e)d(in)m(tegers.)275 | |
13719 | 2979 y(An)26 b(indexed)h(arra)m(y)h(is)f(created)h(automatically)j(if)c | |
d9e1f41e | 13720 | (an)m(y)g(v)-5 b(ariable)28 b(is)g(assigned)f(to)h(using)f(the)g(syn)m |
9f178efb CR |
13721 | (tax)390 3119 y Fi(name)11 b Fs([)p Fi(subscript)g Fs(]=)p |
13722 | Fi(value)150 3258 y Ft(The)34 b Fq(subscript)h Ft(is)g(treated)g(as)g | |
f6da9f85 CR |
13723 | (an)f(arithmetic)i(expression)e(that)h(m)m(ust)g(ev)-5 |
13724 | b(aluate)36 b(to)f(a)g(n)m(um)m(b)s(er.)51 b(T)-8 b(o)150 | |
9f178efb CR |
13725 | 3368 y(explicitly)32 b(declare)f(an)g(arra)m(y)-8 b(,)31 |
13726 | b(use)390 3507 y Fs(declare)46 b(-a)h Fi(name)150 3647 | |
13727 | y Ft(The)30 b(syn)m(tax)390 3786 y Fs(declare)46 b(-a)h | |
13728 | Fi(name)11 b Fs([)p Fi(subscript)g Fs(])150 3926 y Ft(is)30 | |
122f603c | 13729 | b(also)i(accepted;)g(the)e Fq(subscript)h Ft(is)g(ignored.)150 |
9f178efb CR |
13730 | 4065 y(Asso)s(ciativ)m(e)i(arra)m(ys)d(are)h(created)h(using)390 |
13731 | 4204 y Fs(declare)46 b(-A)h Fi(name)11 b Fs(.)275 4344 | |
f6da9f85 CR |
13732 | y Ft(A)m(ttributes)46 b(ma)m(y)h(b)s(e)e(sp)s(eci\014ed)g(for)h(an)g |
13733 | (arra)m(y)g(v)-5 b(ariable)47 b(using)e(the)h Fs(declare)e | |
9f178efb | 13734 | Ft(and)h Fs(readonly)150 4453 y Ft(builtins.)40 b(Eac)m(h)31 |
f6da9f85 | 13735 | b(attribute)g(applies)g(to)g(all)g(mem)m(b)s(ers)f(of)g(an)h(arra)m(y) |
9f178efb CR |
13736 | -8 b(.)275 4593 y(Arra)m(ys)30 b(are)h(assigned)f(to)h(using)f(comp)s |
13737 | (ound)f(assignmen)m(ts)i(of)g(the)f(form)390 4732 y Fi(name)11 | |
122f603c | 13738 | b Fs(=\()p Fi(value1)54 b(value2)j Fs(...)47 b(\))150 |
9f178efb | 13739 | 4872 y Ft(where)37 b(eac)m(h)i Fq(v)-5 b(alue)42 b Ft(is)c(of)g(the)f |
122f603c CR |
13740 | (form)g Fs([)p Fi(subscript)11 b Fs(]=)p Fq(string)d |
13741 | Ft(.)58 b(Indexed)36 b(arra)m(y)i(assignmen)m(ts)g(do)g(not)150 | |
9f178efb | 13742 | 4981 y(require)30 b(an)m(ything)h(but)f Fq(string)8 b |
122f603c | 13743 | Ft(.)41 b(When)30 b(assigning)h(to)g(indexed)f(arra)m(ys,)h(if)f(the)h |
9f178efb | 13744 | (optional)h(subscript)d(is)150 5091 y(supplied,)j(that)h(index)f(is)h |
122f603c | 13745 | (assigned)g(to;)h(otherwise)f(the)g(index)f(of)h(the)g(elemen)m(t)h |
9f178efb | 13746 | (assigned)f(is)f(the)h(last)150 5201 y(index)d(assigned)h(to)g(b)m(y)f |
122f603c | 13747 | (the)g(statemen)m(t)j(plus)c(one.)41 b(Indexing)30 b(starts)h(at)g |
9f178efb CR |
13748 | (zero.)275 5340 y(When)f(assigning)h(to)g(an)f(asso)s(ciativ)m(e)j |
13749 | (arra)m(y)-8 b(,)32 b(the)e(subscript)f(is)i(required.)p | |
122f603c | 13750 | eop end |
9f178efb CR |
13751 | %%Page: 89 95 |
13752 | TeXDict begin 89 94 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13753 | b(Bash)30 b(F)-8 b(eatures)2484 b(89)275 299 y(This)30 | |
13754 | b(syn)m(tax)j(is)e(also)i(accepted)g(b)m(y)f(the)f Fs(declare)f | |
13755 | Ft(builtin.)44 b(Individual)31 b(arra)m(y)h(elemen)m(ts)h(ma)m(y)g(b)s | |
13756 | (e)150 408 y(assigned)e(to)g(using)f(the)g Fi(name)11 | |
13757 | b Fs([)p Fi(subscript)g Fs(]=)p Fi(value)34 b Ft(syn)m(tax)d(in)m(tro)s | |
13758 | (duced)f(ab)s(o)m(v)m(e.)275 538 y(An)m(y)c(elemen)m(t)i(of)e(an)g | |
13759 | (arra)m(y)h(ma)m(y)g(b)s(e)f(referenced)g(using)g Fs(${)p | |
13760 | Fi(name)11 b Fs([)p Fi(subscript)g Fs(]})p Ft(.)33 b(The)26 | |
13761 | b(braces)h(are)150 648 y(required)h(to)j(a)m(v)m(oid)f(con\015icts)g | |
13762 | (with)f(the)h(shell's)f(\014lename)h(expansion)f(op)s(erators.)41 | |
13763 | b(If)28 b(the)i Fq(subscript)g Ft(is)150 757 y(`)p Fs(@)p | |
13764 | Ft(')f(or)g(`)p Fs(*)p Ft(',)g(the)g(w)m(ord)g(expands)f(to)i(all)f | |
13765 | (mem)m(b)s(ers)f(of)h(the)g(arra)m(y)h Fq(name)5 b Ft(.)40 | |
13766 | b(These)29 b(subscripts)e(di\013er)i(only)150 867 y(when)35 | |
13767 | b(the)h(w)m(ord)f(app)s(ears)g(within)g(double)h(quotes.)57 | |
13768 | b(If)36 b(the)g(w)m(ord)f(is)h(double-quoted,)h Fs(${)p | |
13769 | Fi(name)11 b Fs([*]})150 976 y Ft(expands)25 b(to)h(a)g(single)h(w)m | |
122f603c CR |
13770 | (ord)e(with)g(the)h(v)-5 b(alue)26 b(of)g(eac)m(h)h(arra)m(y)f(mem)m(b) |
13771 | s(er)f(separated)h(b)m(y)g(the)f(\014rst)g(c)m(harac-)150 | |
9f178efb | 13772 | 1086 y(ter)j(of)f(the)h Fs(IFS)e Ft(v)-5 b(ariable,)29 |
122f603c CR |
13773 | b(and)e Fs(${)p Fi(name)11 b Fs([@]})24 b Ft(expands)i(eac)m(h)i |
13774 | (elemen)m(t)h(of)f Fq(name)k Ft(to)c(a)g(separate)g(w)m(ord.)150 | |
9f178efb | 13775 | 1195 y(When)j(there)h(are)g(no)f(arra)m(y)h(mem)m(b)s(ers,)g |
122f603c | 13776 | Fs(${)p Fi(name)11 b Fs([@]})28 b Ft(expands)j(to)h(nothing.)44 |
9f178efb | 13777 | b(If)31 b(the)h(double-quoted)150 1305 y(expansion)39 |
c302751c | 13778 | b(o)s(ccurs)h(within)f(a)h(w)m(ord,)i(the)d(expansion)h(of)g(the)f |
9f178efb | 13779 | (\014rst)g(parameter)h(is)g(joined)f(with)h(the)150 1415 |
122f603c CR |
13780 | y(b)s(eginning)29 b(part)g(of)h(the)f(original)i(w)m(ord,)e(and)g(the)h |
13781 | (expansion)f(of)h(the)f(last)i(parameter)e(is)h(joined)f(with)150 | |
9f178efb | 13782 | 1524 y(the)g(last)h(part)f(of)g(the)g(original)h(w)m(ord.)40 |
122f603c | 13783 | b(This)28 b(is)h(analogous)h(to)f(the)h(expansion)e(of)h(the)g(sp)s |
9f178efb | 13784 | (ecial)h(param-)150 1634 y(eters)35 b(`)p Fs(@)p Ft(')g(and)e(`)p |
122f603c CR |
13785 | Fs(*)p Ft('.)54 b Fs(${#)p Fi(name)11 b Fs([)p Fi(subscript)g |
13786 | Fs(]})28 b Ft(expands)33 b(to)j(the)e(length)h(of)g Fs(${)p | |
9f178efb | 13787 | Fi(name)11 b Fs([)p Fi(subscript)g Fs(]})p Ft(.)150 1743 |
122f603c CR |
13788 | y(If)30 b Fq(subscript)i Ft(is)f(`)p Fs(@)p Ft(')f(or)h(`)p |
13789 | Fs(*)p Ft(',)g(the)g(expansion)g(is)g(the)g(n)m(um)m(b)s(er)e(of)i | |
13790 | (elemen)m(ts)h(in)f(the)g(arra)m(y)-8 b(.)42 b(Referencing)150 | |
9f178efb | 13791 | 1853 y(an)33 b(arra)m(y)g(v)-5 b(ariable)34 b(without)f(a)h(subscript)e |
122f603c | 13792 | (is)h(equiv)-5 b(alen)m(t)34 b(to)g(referencing)f(with)g(a)g(subscript) |
9f178efb | 13793 | f(of)h(0.)49 b(If)150 1963 y(the)33 b Fq(subscript)h |
122f603c CR |
13794 | Ft(used)e(to)h(reference)h(an)f(elemen)m(t)h(of)f(an)g(indexed)f(arra)m |
13795 | (y)i(ev)-5 b(aluates)34 b(to)g(a)f(n)m(um)m(b)s(er)f(less)150 | |
9f178efb | 13796 | 2072 y(than)j(zero,)i(it)f(is)f(used)g(as)g(an)g(o\013set)h(from)f(one) |
122f603c | 13797 | h(greater)g(than)f(the)g(arra)m(y's)h(maxim)m(um)f(index)g(\(so)h(a)150 |
9f178efb CR |
13798 | 2182 y(sub)s(cript)29 b(of)h(-1)h(refers)f(to)h(the)g(last)g(elemen)m |
13799 | (t)h(of)f(the)f(arra)m(y\).)275 2311 y(An)35 b(arra)m(y)i(v)-5 | |
122f603c CR |
13800 | b(ariable)37 b(is)g(considered)f(set)h(if)f(a)h(subscript)e(has)h(b)s |
13801 | (een)g(assigned)g(a)h(v)-5 b(alue.)59 b(The)36 b(n)m(ull)150 | |
9f178efb CR |
13802 | 2421 y(string)30 b(is)h(a)g(v)-5 b(alid)30 b(v)-5 b(alue.)275 |
13803 | 2550 y(The)23 b Fs(unset)f Ft(builtin)i(is)g(used)f(to)i(destro)m(y)f | |
122f603c | 13804 | (arra)m(ys.)39 b Fs(unset)29 b Fi(name)11 b Fs([)p Fi(subscript)g |
9f178efb | 13805 | Fs(])19 b Ft(destro)m(ys)24 b(the)g(arra)m(y)150 2660 |
122f603c CR |
13806 | y(elemen)m(t)35 b(at)g(index)f Fq(subscript)r Ft(.)50 |
13807 | b(Care)34 b(m)m(ust)f(b)s(e)h(tak)m(en)h(to)f(a)m(v)m(oid)i(un)m(w)m | |
9f178efb | 13808 | (an)m(ted)e(side)g(e\013ects)h(caused)f(b)m(y)150 2769 |
122f603c CR |
13809 | y(\014lename)42 b(expansion.)73 b Fs(unset)29 b Fi(name)11 |
13810 | b Ft(,)43 b(where)e Fq(name)46 b Ft(is)c(an)f(arra)m(y)-8 | |
13811 | b(,)45 b(remo)m(v)m(es)e(the)f(en)m(tire)g(arra)m(y)-8 | |
9f178efb | 13812 | b(.)75 b(A)150 2879 y(subscript)29 b(of)i(`)p Fs(*)p |
1c72c0cd | 13813 | Ft(')f(or)h(`)p Fs(@)p Ft(')f(also)h(remo)m(v)m(es)h(the)f(en)m(tire)g |
9f178efb | 13814 | (arra)m(y)-8 b(.)275 3008 y(The)41 b Fs(declare)p Ft(,)i |
09767ff0 CR |
13815 | Fs(local)p Ft(,)h(and)d Fs(readonly)f Ft(builtins)h(eac)m(h)j(accept)f |
13816 | (a)f(`)p Fs(-a)p Ft(')g(option)h(to)f(sp)s(ecify)g(an)150 | |
9f178efb | 13817 | 3118 y(indexed)25 b(arra)m(y)h(and)e(a)i(`)p Fs(-A)p |
d9e1f41e CR |
13818 | Ft(')f(option)h(to)g(sp)s(ecify)f(an)g(asso)s(ciativ)m(e)j(arra)m(y)-8 |
13819 | b(.)40 b(If)25 b(b)s(oth)g(options)g(are)h(supplied,)150 | |
9f178efb | 13820 | 3228 y(`)p Fs(-A)p Ft(')k(tak)m(es)i(precedence.)41 b(The)30 |
d9e1f41e | 13821 | b Fs(read)f Ft(builtin)g(accepts)j(a)e(`)p Fs(-a)p Ft(')g(option)h(to)g |
9f178efb | 13822 | (assign)g(a)f(list)h(of)f(w)m(ords)g(read)150 3337 y(from)40 |
d9e1f41e CR |
13823 | b(the)g(standard)f(input)h(to)h(an)f(arra)m(y)-8 b(,)44 |
13824 | b(and)39 b(can)i(read)f(v)-5 b(alues)40 b(from)g(the)g(standard)g | |
9f178efb | 13825 | (input)f(in)m(to)150 3447 y(individual)26 b(arra)m(y)h(elemen)m(ts.)41 |
d9e1f41e CR |
13826 | b(The)26 b Fs(set)f Ft(and)h Fs(declare)f Ft(builtins)g(displa)m(y)i |
13827 | (arra)m(y)g(v)-5 b(alues)27 b(in)f(a)h(w)m(a)m(y)g(that)150 | |
9f178efb CR |
13828 | 3556 y(allo)m(ws)32 b(them)e(to)h(b)s(e)f(reused)f(as)i(input.)150 |
13829 | 3779 y Fr(6.8)68 b(The)45 b(Directory)g(Stac)l(k)150 | |
13830 | 3938 y Ft(The)21 b(directory)h(stac)m(k)h(is)e(a)h(list)g(of)f(recen)m | |
c302751c | 13831 | (tly-visited)j(directories.)39 b(The)20 b Fs(pushd)g |
9f178efb | 13832 | Ft(builtin)h(adds)g(directories)150 4048 y(to)42 b(the)f(stac)m(k)i(as) |
c302751c CR |
13833 | e(it)h(c)m(hanges)g(the)f(curren)m(t)g(directory)-8 b(,)45 |
13834 | b(and)40 b(the)i Fs(popd)e Ft(builtin)g(remo)m(v)m(es)j(sp)s(eci\014ed) | |
9f178efb | 13835 | 150 4157 y(directories)29 b(from)f(the)h(stac)m(k)h(and)d(c)m(hanges)j |
c302751c | 13836 | (the)e(curren)m(t)g(directory)h(to)g(the)g(directory)f(remo)m(v)m(ed.) |
9f178efb CR |
13837 | 41 b(The)150 4267 y Fs(dirs)29 b Ft(builtin)h(displa)m(ys)h(the)f(con)m |
13838 | (ten)m(ts)i(of)f(the)f(directory)h(stac)m(k.)275 4396 | |
c302751c CR |
13839 | y(The)k(con)m(ten)m(ts)i(of)f(the)h(directory)f(stac)m(k)h(are)f(also)h |
13840 | (visible)g(as)f(the)g(v)-5 b(alue)36 b(of)g(the)g Fs(DIRSTACK)e | |
9f178efb CR |
13841 | Ft(shell)150 4506 y(v)-5 b(ariable.)150 4695 y Fj(6.8.1)63 |
13842 | b(Directory)40 b(Stac)m(k)g(Builtins)150 4862 y Fs(dirs)870 | |
13843 | 4991 y(dirs)47 b([-clpv])e([+)p Fi(N)58 b Fs(|)47 b(-)p | |
13844 | Fi(N)11 b Fs(])630 5121 y Ft(Displa)m(y)35 b(the)f(list)g(of)g(curren)m | |
122f603c | 13845 | (tly)g(remem)m(b)s(ered)f(directories.)51 b(Directories)36 |
9f178efb | 13846 | b(are)e(added)f(to)630 5230 y(the)28 b(list)h(with)f(the)g |
c302751c | 13847 | Fs(pushd)f Ft(command;)i(the)f Fs(popd)f Ft(command)h(remo)m(v)m(es)h |
9f178efb CR |
13848 | (directories)g(from)630 5340 y(the)i(list.)p eop end |
13849 | %%Page: 90 96 | |
13850 | TeXDict begin 90 95 bop 150 -116 a Ft(90)2572 b(Bash)31 | |
13851 | b(Reference)g(Man)m(ual)630 299 y Fs(-c)384 b Ft(Clears)31 | |
13852 | b(the)f(directory)h(stac)m(k)h(b)m(y)e(deleting)h(all)h(of)e(the)h | |
13853 | (elemen)m(ts.)630 469 y Fs(-l)384 b Ft(Pro)s(duces)31 | |
122f603c | 13854 | b(a)h(listing)h(using)e(full)h(pathnames;)h(the)f(default)g(listing)h |
9f178efb CR |
13855 | (format)1110 579 y(uses)d(a)h(tilde)g(to)g(denote)g(the)f(home)h |
13856 | (directory)-8 b(.)630 749 y Fs(-p)384 b Ft(Causes)30 | |
122f603c | 13857 | b Fs(dirs)f Ft(to)i(prin)m(t)f(the)h(directory)g(stac)m(k)h(with)e(one) |
9f178efb | 13858 | g(en)m(try)h(p)s(er)e(line.)630 919 y Fs(-v)384 b Ft(Causes)36 |
122f603c | 13859 | b Fs(dirs)f Ft(to)i(prin)m(t)f(the)g(directory)h(stac)m(k)h(with)e(one) |
9f178efb | 13860 | h(en)m(try)f(p)s(er)f(line,)1110 1028 y(pre\014xing)30 |
122f603c | 13861 | b(eac)m(h)h(en)m(try)g(with)f(its)h(index)e(in)i(the)f(stac)m(k.)630 |
9f178efb | 13862 | 1199 y Fs(+)p Fi(N)384 b Ft(Displa)m(ys)23 b(the)f Fq(N)10 |
122f603c | 13863 | b Ft(th)21 b(directory)h(\(coun)m(ting)h(from)e(the)h(left)g(of)g(the)g |
9f178efb | 13864 | (list)g(prin)m(ted)1110 1308 y(b)m(y)30 b Fs(dirs)f Ft(when)h(in)m(v)m |
122f603c | 13865 | (ok)m(ed)i(without)e(options\),)h(starting)g(with)g(zero.)630 |
9f178efb | 13866 | 1478 y Fs(-)p Fi(N)384 b Ft(Displa)m(ys)47 b(the)g Fq(N)10 |
122f603c | 13867 | b Ft(th)46 b(directory)h(\(coun)m(ting)g(from)f(the)g(righ)m(t)h(of)g |
9f178efb | 13868 | (the)f(list)1110 1588 y(prin)m(ted)25 b(b)m(y)g Fs(dirs)g |
122f603c | 13869 | Ft(when)f(in)m(v)m(ok)m(ed)j(without)f(options\),)h(starting)g(with)e |
9f178efb CR |
13870 | (zero.)150 1758 y Fs(popd)870 1898 y(popd)47 b([-n])f([+)p |
13871 | Fi(N)58 b Fs(|)47 b(-)p Fi(N)11 b Fs(])630 2038 y Ft(Remo)m(v)m(e)26 | |
122f603c CR |
13872 | b(the)e(top)g(en)m(try)h(from)e(the)h(directory)h(stac)m(k,)i(and)c |
13873 | Fs(cd)h Ft(to)h(the)f(new)f(top)i(directory)-8 b(.)630 | |
9f178efb | 13874 | 2147 y(When)32 b(no)g(argumen)m(ts)h(are)g(giv)m(en,)h |
122f603c | 13875 | Fs(popd)d Ft(remo)m(v)m(es)j(the)f(top)f(directory)h(from)f(the)g(stac) |
9f178efb | 13876 | m(k)630 2257 y(and)f(p)s(erforms)e(a)j Fs(cd)f Ft(to)h(the)f(new)g(top) |
122f603c | 13877 | h(directory)-8 b(.)44 b(The)31 b(elemen)m(ts)i(are)e(n)m(um)m(b)s(ered) |
9f178efb | 13878 | f(from)630 2366 y(0)j(starting)g(at)g(the)f(\014rst)g(directory)g |
122f603c | 13879 | (listed)h(with)f Fs(dirs)p Ft(;)g(that)h(is,)g Fs(popd)e |
9f178efb CR |
13880 | Ft(is)i(equiv)-5 b(alen)m(t)33 b(to)630 2476 y Fs(popd)c(+0)p |
13881 | Ft(.)630 2646 y Fs(-n)384 b Ft(Suppresses)27 b(the)j(normal)g(c)m | |
122f603c | 13882 | (hange)g(of)g(directory)g(when)e(remo)m(ving)j(directo-)1110 |
9f178efb CR |
13883 | 2756 y(ries)f(from)g(the)h(stac)m(k,)h(so)f(that)g(only)f(the)h(stac)m |
13884 | (k)g(is)g(manipulated.)630 2926 y Fs(+)p Fi(N)384 b Ft(Remo)m(v)m(es)22 | |
122f603c | 13885 | b(the)f Fq(N)10 b Ft(th)20 b(directory)g(\(coun)m(ting)i(from)e(the)g |
9f178efb CR |
13886 | (left)h(of)g(the)f(list)h(prin)m(ted)1110 3036 y(b)m(y)30 |
13887 | b Fs(dirs)p Ft(\),)g(starting)h(with)f(zero.)630 3206 | |
122f603c CR |
13888 | y Fs(-)p Fi(N)384 b Ft(Remo)m(v)m(es)46 b(the)g Fq(N)10 |
13889 | b Ft(th)44 b(directory)h(\(coun)m(ting)h(from)f(the)g(righ)m(t)g(of)g | |
9f178efb CR |
13890 | (the)g(list)1110 3315 y(prin)m(ted)30 b(b)m(y)g Fs(dirs)p |
13891 | Ft(\),)g(starting)h(with)f(zero.)150 3485 y Fs(pushd)870 | |
13892 | 3625 y(pushd)46 b([-n])h([+)p Fi(N)57 b Fs(|)48 b Fi(-N)58 | |
13893 | b Fs(|)47 b Fi(dir)11 b Fs(])630 3765 y Ft(Sa)m(v)m(e)29 | |
122f603c CR |
13894 | b(the)f(curren)m(t)g(directory)g(on)g(the)g(top)g(of)g(the)g(directory) |
13895 | h(stac)m(k)g(and)e(then)h Fs(cd)f Ft(to)i Fq(dir)7 b | |
9f178efb | 13896 | Ft(.)630 3875 y(With)31 b(no)f(argumen)m(ts,)h Fs(pushd)e |
122f603c | 13897 | Ft(exc)m(hanges)j(the)e(top)h(t)m(w)m(o)h(directories.)630 |
9f178efb CR |
13898 | 4045 y Fs(-n)384 b Ft(Suppresses)26 b(the)i(normal)h(c)m(hange)g(of)f |
13899 | (directory)h(when)e(adding)h(directories)1110 4154 y(to)j(the)g(stac)m | |
122f603c | 13900 | (k,)h(so)e(that)h(only)g(the)f(stac)m(k)i(is)f(manipulated.)630 |
9f178efb | 13901 | 4325 y Fs(+)p Fi(N)384 b Ft(Brings)29 b(the)f Fq(N)10 |
122f603c | 13902 | b Ft(th)29 b(directory)g(\(coun)m(ting)h(from)e(the)g(left)i(of)e(the)h |
9f178efb | 13903 | (list)g(prin)m(ted)1110 4434 y(b)m(y)34 b Fs(dirs)p Ft(,)g(starting)h |
122f603c | 13904 | (with)f(zero\))i(to)f(the)f(top)g(of)h(the)f(list)h(b)m(y)f(rotating)i |
9f178efb | 13905 | (the)1110 4544 y(stac)m(k.)630 4714 y Fs(-)p Fi(N)384 |
122f603c CR |
13906 | b Ft(Brings)23 b(the)g Fq(N)10 b Ft(th)23 b(directory)h(\(coun)m(ting)g |
13907 | (from)e(the)i(righ)m(t)f(of)g(the)h(list)f(prin)m(ted)1110 | |
9f178efb | 13908 | 4823 y(b)m(y)34 b Fs(dirs)p Ft(,)g(starting)h(with)f(zero\))i(to)f(the) |
c302751c | 13909 | f(top)g(of)h(the)f(list)h(b)m(y)f(rotating)i(the)1110 |
9f178efb | 13910 | 4933 y(stac)m(k.)630 5103 y Fi(dir)336 b Ft(Mak)m(es)31 |
122f603c CR |
13911 | b(the)g(curren)m(t)f(w)m(orking)g(directory)g(b)s(e)g(the)g(top)g(of)g |
13912 | (the)h(stac)m(k,)h(mak-)1110 5213 y(ing)39 b(it)g(the)g(new)f(curren)m | |
13913 | (t)g(directory)h(as)g(if)g(it)g(had)f(b)s(een)g(supplied)f(as)i(an)1110 | |
13914 | 5322 y(argumen)m(t)31 b(to)g(the)f Fs(cd)g Ft(builtin.)p | |
13915 | eop end | |
9f178efb CR |
13916 | %%Page: 91 97 |
13917 | TeXDict begin 91 96 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
13918 | b(Bash)30 b(F)-8 b(eatures)2484 b(91)150 299 y Fr(6.9)68 | |
122f603c CR |
13919 | b(Con)l(trolling)47 b(the)e(Prompt)150 458 y Ft(The)24 |
13920 | b(v)-5 b(alue)24 b(of)h(the)f(v)-5 b(ariable)25 b Fs(PROMPT_COMMAND)20 | |
c302751c | 13921 | b Ft(is)25 b(examined)f(just)g(b)s(efore)f(Bash)i(prin)m(ts)e(eac)m(h)j |
122f603c | 13922 | (primary)150 568 y(prompt.)39 b(If)28 b Fs(PROMPT_COMMAND)d |
c302751c CR |
13923 | Ft(is)j(set)h(and)f(has)g(a)h(non-n)m(ull)f(v)-5 b(alue,)29 |
13924 | b(then)f(the)h(v)-5 b(alue)29 b(is)f(executed)i(just)150 | |
122f603c CR |
13925 | 677 y(as)h(if)f(it)h(had)f(b)s(een)f(t)m(yp)s(ed)h(on)h(the)f(command)g |
13926 | (line.)275 812 y(In)d(addition,)j(the)f(follo)m(wing)h(table)f(describ) | |
13927 | s(es)f(the)h(sp)s(ecial)g(c)m(haracters)h(whic)m(h)f(can)f(app)s(ear)g | |
13928 | (in)h(the)150 921 y(prompt)g(v)-5 b(ariables)32 b Fs(PS1)d | |
13929 | Ft(to)i Fs(PS4)p Ft(:)150 1081 y Fs(\\a)384 b Ft(A)30 | |
13930 | b(b)s(ell)h(c)m(haracter.)150 1240 y Fs(\\d)384 b Ft(The)30 | |
13931 | b(date,)h(in)f Fs(")p Ft(W)-8 b(eekda)m(y)32 b(Mon)m(th)f(Date)p | |
13932 | Fs(")h Ft(format)f(\(e.g.,)h Fs(")p Ft(T)-8 b(ue)30 b(Ma)m(y)h(26)p | |
13933 | Fs(")p Ft(\).)150 1399 y Fs(\\D{)p Fi(format)11 b Fs(})630 | |
13934 | 1509 y Ft(The)27 b Fq(format)i Ft(is)f(passed)e(to)i | |
13935 | Fs(strftime)p Ft(\(3\))f(and)f(the)i(result)f(is)g(inserted)g(in)m(to)h | |
13936 | (the)g(prompt)630 1618 y(string;)42 b(an)d(empt)m(y)f | |
13937 | Fq(format)j Ft(results)d(in)g(a)h(lo)s(cale-sp)s(eci\014c)h(time)f | |
13938 | (represen)m(tation.)65 b(The)630 1728 y(braces)31 b(are)f(required.)150 | |
13939 | 1887 y Fs(\\e)384 b Ft(An)30 b(escap)s(e)h(c)m(haracter.)150 | |
13940 | 2046 y Fs(\\h)384 b Ft(The)30 b(hostname,)h(up)e(to)i(the)g(\014rst)e | |
13941 | (`.'.)150 2205 y Fs(\\H)384 b Ft(The)30 b(hostname.)150 | |
13942 | 2365 y Fs(\\j)384 b Ft(The)30 b(n)m(um)m(b)s(er)f(of)h(jobs)g(curren)m | |
13943 | (tly)h(managed)g(b)m(y)f(the)g(shell.)150 2524 y Fs(\\l)384 | |
8f714a7c | 13944 | b Ft(The)30 b(basename)h(of)f(the)h(shell's)f(terminal)h(device)g |
122f603c CR |
13945 | (name.)150 2683 y Fs(\\n)384 b Ft(A)30 b(newline.)150 |
13946 | 2842 y Fs(\\r)384 b Ft(A)30 b(carriage)i(return.)150 | |
13947 | 3001 y Fs(\\s)384 b Ft(The)22 b(name)g(of)h(the)f(shell,)i(the)f | |
8f714a7c | 13948 | (basename)f(of)h Fs($0)f Ft(\(the)g(p)s(ortion)g(follo)m(wing)i(the)f |
122f603c CR |
13949 | (\014nal)e(slash\).)150 3161 y Fs(\\t)384 b Ft(The)30 |
13950 | b(time,)h(in)f(24-hour)h(HH:MM:SS)g(format.)150 3320 | |
8f714a7c | 13951 | y Fs(\\T)384 b Ft(The)30 b(time,)h(in)f(12-hour)h(HH:MM:SS)g(format.) |
122f603c CR |
13952 | 150 3479 y Fs(\\@)384 b Ft(The)30 b(time,)h(in)f(12-hour)h(am/pm)f |
13953 | (format.)150 3638 y Fs(\\A)384 b Ft(The)30 b(time,)h(in)f(24-hour)h | |
13954 | (HH:MM)g(format.)150 3798 y Fs(\\u)384 b Ft(The)30 b(username)g(of)g | |
13955 | (the)h(curren)m(t)f(user.)150 3957 y Fs(\\v)384 b Ft(The)30 | |
13956 | b(v)m(ersion)h(of)f(Bash)h(\(e.g.,)h(2.00\))150 4116 | |
8f714a7c | 13957 | y Fs(\\V)384 b Ft(The)30 b(release)i(of)e(Bash,)h(v)m(ersion)g |
122f603c | 13958 | Fs(+)f Ft(patc)m(hlev)m(el)i(\(e.g.,)h(2.00.0\))150 4275 |
8f714a7c CR |
13959 | y Fs(\\w)384 b Ft(The)34 b(curren)m(t)h(w)m(orking)g(directory)-8 |
13960 | b(,)37 b(with)e Fs($HOME)e Ft(abbreviated)j(with)e(a)h(tilde)h(\(uses)f | |
122f603c CR |
13961 | (the)630 4385 y Fs($PROMPT_DIRTRIM)26 b Ft(v)-5 b(ariable\).)150 |
13962 | 4544 y Fs(\\W)384 b Ft(The)30 b(basename)h(of)f Fs($PWD)p | |
8f714a7c | 13963 | Ft(,)g(with)g Fs($HOME)f Ft(abbreviated)h(with)g(a)h(tilde.)150 |
122f603c CR |
13964 | 4703 y Fs(\\!)384 b Ft(The)30 b(history)g(n)m(um)m(b)s(er)f(of)i(this)f |
13965 | (command.)150 4862 y Fs(\\#)384 b Ft(The)30 b(command)g(n)m(um)m(b)s | |
13966 | (er)f(of)i(this)f(command.)150 5022 y Fs(\\$)384 b Ft(If)30 | |
8f714a7c | 13967 | b(the)g(e\013ectiv)m(e)j(uid)d(is)g(0,)h Fs(#)p Ft(,)g(otherwise)g |
122f603c | 13968 | Fs($)p Ft(.)150 5181 y Fs(\\)p Fi(nnn)288 b Ft(The)30 |
8f714a7c | 13969 | b(c)m(haracter)i(whose)e(ASCI)s(I)f(co)s(de)h(is)h(the)f(o)s(ctal)i(v) |
122f603c CR |
13970 | -5 b(alue)31 b Fq(nnn)p Ft(.)150 5340 y Fs(\\\\)384 b |
13971 | Ft(A)30 b(bac)m(kslash.)p eop end | |
9f178efb CR |
13972 | %%Page: 92 98 |
13973 | TeXDict begin 92 97 bop 150 -116 a Ft(92)2572 b(Bash)31 | |
122f603c CR |
13974 | b(Reference)g(Man)m(ual)150 299 y Fs(\\[)384 b Ft(Begin)38 |
13975 | b(a)f(sequence)g(of)g(non-prin)m(ting)g(c)m(haracters.)61 | |
13976 | b(This)36 b(could)h(b)s(e)g(used)f(to)h(em)m(b)s(ed)g(a)630 | |
13977 | 408 y(terminal)31 b(con)m(trol)h(sequence)e(in)m(to)i(the)e(prompt.)150 | |
13978 | 557 y Fs(\\])384 b Ft(End)29 b(a)i(sequence)g(of)f(non-prin)m(ting)g(c) | |
13979 | m(haracters.)275 705 y(The)25 b(command)h(n)m(um)m(b)s(er)f(and)h(the)g | |
13980 | (history)g(n)m(um)m(b)s(er)f(are)i(usually)f(di\013eren)m(t:)39 | |
13981 | b(the)26 b(history)g(n)m(um)m(b)s(er)150 814 y(of)h(a)f(command)h(is)f | |
13982 | (its)h(p)s(osition)f(in)g(the)h(history)f(list,)i(whic)m(h)f(ma)m(y)g | |
13983 | (include)f(commands)g(restored)g(from)150 924 y(the)39 | |
7d92f73f | 13984 | b(history)h(\014le)f(\(see)h(Section)g(9.1)h([Bash)e(History)h(F)-8 |
9f178efb | 13985 | b(acilities],)45 b(page)40 b(133\),)j(while)d(the)f(command)150 |
122f603c | 13986 | 1034 y(n)m(um)m(b)s(er)j(is)h(the)h(p)s(osition)f(in)g(the)g(sequence)h |
7d92f73f | 13987 | (of)f(commands)g(executed)h(during)e(the)i(curren)m(t)f(shell)150 |
122f603c | 13988 | 1143 y(session.)275 1272 y(After)35 b(the)g(string)g(is)g(deco)s(ded,)h |
7d92f73f | 13989 | (it)f(is)g(expanded)f(via)i(parameter)f(expansion,)i(command)d(substi-) |
122f603c CR |
13990 | 150 1382 y(tution,)k(arithmetic)f(expansion,)g(and)e(quote)h(remo)m(v) |
13991 | -5 b(al,)39 b(sub)5 b(ject)35 b(to)i(the)f(v)-5 b(alue)36 | |
13992 | b(of)g(the)g Fs(promptvars)150 1491 y Ft(shell)31 b(option)f(\(see)i | |
9f178efb | 13993 | (Section)f(4.2)g([Bash)g(Builtins],)g(page)g(48\).)150 |
122f603c | 13994 | 1713 y Fr(6.10)68 b(The)45 b(Restricted)h(Shell)150 1872 |
220537f2 CR |
13995 | y Ft(If)27 b(Bash)h(is)g(started)g(with)g(the)g(name)g |
13996 | Fs(rbash)p Ft(,)f(or)g(the)h(`)p Fs(--restricted)p Ft(')d(or)j(`)p | |
122f603c | 13997 | Fs(-r)p Ft(')g(option)g(is)g(supplied)e(at)150 1982 y(in)m(v)m(o)s |
220537f2 | 13998 | (cation,)k(the)d(shell)g(b)s(ecomes)h(restricted.)40 |
c302751c | 13999 | b(A)27 b(restricted)h(shell)f(is)g(used)f(to)i(set)f(up)f(an)h(en)m |
122f603c | 14000 | (vironmen)m(t)150 2091 y(more)g(con)m(trolled)i(than)e(the)g(standard)g |
c302751c | 14001 | (shell.)40 b(A)27 b(restricted)h(shell)f(b)s(eha)m(v)m(es)h(iden)m |
122f603c | 14002 | (tically)h(to)f Fs(bash)e Ft(with)150 2201 y(the)31 b(exception)g(that) |
220537f2 | 14003 | g(the)g(follo)m(wing)h(are)e(disallo)m(w)m(ed)i(or)e(not)h(p)s |
122f603c CR |
14004 | (erformed:)225 2330 y Fp(\017)60 b Ft(Changing)30 b(directories)h(with) |
14005 | g(the)f Fs(cd)g Ft(builtin.)225 2459 y Fp(\017)60 b Ft(Setting)31 | |
37c41ab1 | 14006 | b(or)f(unsetting)h(the)g(v)-5 b(alues)30 b(of)h(the)f |
5e13499c | 14007 | Fs(SHELL)p Ft(,)g Fs(PATH)p Ft(,)f Fs(ENV)p Ft(,)h(or)g |
122f603c | 14008 | Fs(BASH_ENV)e Ft(v)-5 b(ariables.)225 2587 y Fp(\017)60 |
37c41ab1 | 14009 | b Ft(Sp)s(ecifying)30 b(command)g(names)g(con)m(taining)i(slashes.)225 |
122f603c | 14010 | 2716 y Fp(\017)60 b Ft(Sp)s(ecifying)30 b(a)h(\014lename)f(con)m |
37c41ab1 | 14011 | (taining)i(a)f(slash)f(as)h(an)f(argumen)m(t)h(to)g(the)f |
122f603c | 14012 | Fs(.)h Ft(builtin)e(command.)225 2845 y Fp(\017)60 b |
37c41ab1 CR |
14013 | Ft(Sp)s(ecifying)28 b(a)i(\014lename)f(con)m(taining)h(a)g(slash)e(as)h |
14014 | (an)g(argumen)m(t)h(to)f(the)g(`)p Fs(-p)p Ft(')g(option)g(to)h(the)f | |
122f603c | 14015 | Fs(hash)330 2955 y Ft(builtin)h(command.)225 3084 y Fp(\017)60 |
37c41ab1 | 14016 | b Ft(Imp)s(orting)30 b(function)g(de\014nitions)g(from)f(the)i(shell)g |
122f603c | 14017 | (en)m(vironmen)m(t)g(at)g(startup.)225 3213 y Fp(\017)60 |
37c41ab1 CR |
14018 | b Ft(P)m(arsing)31 b(the)f(v)-5 b(alue)31 b(of)g Fs(SHELLOPTS)d |
14019 | Ft(from)h(the)i(shell)g(en)m(vironmen)m(t)g(at)g(startup.)225 | |
122f603c | 14020 | 3342 y Fp(\017)60 b Ft(Redirecting)31 b(output)f(using)g(the)h(`)p |
37c41ab1 CR |
14021 | Fs(>)p Ft(',)g(`)p Fs(>|)p Ft(',)f(`)p Fs(<>)p Ft(',)h(`)p |
14022 | Fs(>&)p Ft(',)f(`)p Fs(&>)p Ft(',)h(and)e(`)p Fs(>>)p | |
122f603c | 14023 | Ft(')i(redirection)g(op)s(erators.)225 3470 y Fp(\017)60 |
37c41ab1 | 14024 | b Ft(Using)31 b(the)f Fs(exec)f Ft(builtin)h(to)h(replace)h(the)e |
122f603c | 14025 | (shell)h(with)f(another)h(command.)225 3599 y Fp(\017)60 |
37c41ab1 CR |
14026 | b Ft(Adding)40 b(or)h(deleting)h(builtin)e(commands)h(with)f(the)h(`)p |
14027 | Fs(-f)p Ft(')g(and)f(`)p Fs(-d)p Ft(')h(options)g(to)h(the)f | |
122f603c | 14028 | Fs(enable)330 3709 y Ft(builtin.)225 3838 y Fp(\017)60 |
37c41ab1 | 14029 | b Ft(Using)31 b(the)f Fs(enable)f Ft(builtin)h(command)g(to)h(enable)g |
122f603c | 14030 | (disabled)f(shell)g(builtins.)225 3967 y Fp(\017)60 b |
37c41ab1 | 14031 | Ft(Sp)s(ecifying)30 b(the)g(`)p Fs(-p)p Ft(')h(option)g(to)g(the)f |
122f603c | 14032 | Fs(command)f Ft(builtin.)225 4096 y Fp(\017)60 b Ft(T)-8 |
c302751c | 14033 | b(urning)29 b(o\013)i(restricted)g(mo)s(de)f(with)g(`)p |
09767ff0 | 14034 | Fs(set)g(+r)p Ft(')g(or)g(`)p Fs(set)g(+o)g(restricted)p |
122f603c CR |
14035 | Ft('.)275 4244 y(These)g(restrictions)h(are)g(enforced)f(after)h(an)m |
14036 | (y)g(startup)f(\014les)g(are)h(read.)275 4373 y(When)j(a)i(command)e | |
c302751c | 14037 | (that)i(is)f(found)f(to)h(b)s(e)g(a)g(shell)g(script)g(is)g(executed)h |
122f603c | 14038 | (\(see)g(Section)g(3.8)g([Shell)150 4482 y(Scripts],)25 |
9f178efb | 14039 | b(page)e(38\),)j Fs(rbash)c Ft(turns)g(o\013)i(an)m(y)f(restrictions)h |
c302751c | 14040 | (in)f(the)g(shell)h(spa)m(wned)e(to)i(execute)g(the)g(script.)150 |
122f603c | 14041 | 4704 y Fr(6.11)68 b(Bash)45 b(POSIX)f(Mo)t(de)150 4863 |
c302751c CR |
14042 | y Ft(Starting)34 b(Bash)f(with)g(the)g(`)p Fs(--posix)p |
14043 | Ft(')f(command-line)i(option)g(or)f(executing)h(`)p Fs(set)c(-o)g | |
122f603c | 14044 | (posix)p Ft(')i(while)150 4973 y(Bash)26 b(is)g(running)e(will)j(cause) |
c302751c | 14045 | f(Bash)g(to)h(conform)f(more)g(closely)h(to)g(the)f Fl(posix)f |
122f603c | 14046 | Ft(standard)g(b)m(y)h(c)m(hanging)150 5082 y(the)31 b(b)s(eha)m(vior)f |
c302751c CR |
14047 | (to)h(matc)m(h)g(that)g(sp)s(eci\014ed)f(b)m(y)g Fl(posix)g |
14048 | Ft(in)g(areas)h(where)f(the)h(Bash)f(default)h(di\013ers.)275 | |
122f603c | 14049 | 5211 y(When)f(in)m(v)m(ok)m(ed)h(as)g Fs(sh)p Ft(,)f(Bash)h(en)m(ters)g |
c302751c | 14050 | Fl(posix)e Ft(mo)s(de)h(after)h(reading)g(the)f(startup)g(\014les.)275 |
122f603c CR |
14051 | 5340 y(The)f(follo)m(wing)j(list)f(is)g(what's)f(c)m(hanged)h(when)e(`) |
14052 | p Fl(posix)h Ft(mo)s(de')h(is)f(in)g(e\013ect:)p eop | |
14053 | end | |
9f178efb CR |
14054 | %%Page: 93 99 |
14055 | TeXDict begin 93 98 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
14056 | b(Bash)30 b(F)-8 b(eatures)2484 b(93)199 299 y(1.)61 | |
122f603c CR |
14057 | b(When)28 b(a)i(command)e(in)g(the)h(hash)f(table)i(no)e(longer)h |
14058 | (exists,)h(Bash)f(will)g(re-searc)m(h)h Fs($PATH)d Ft(to)i(\014nd)330 | |
14059 | 408 y(the)i(new)e(lo)s(cation.)43 b(This)29 b(is)i(also)g(a)m(v)-5 | |
14060 | b(ailable)33 b(with)d(`)p Fs(shopt)f(-s)h(checkhash)p | |
14061 | Ft('.)199 544 y(2.)61 b(The)42 b(message)h(prin)m(ted)e(b)m(y)h(the)g | |
14062 | (job)g(con)m(trol)i(co)s(de)e(and)f(builtins)h(when)f(a)h(job)g(exits)h | |
14063 | (with)f(a)330 654 y(non-zero)31 b(status)g(is)f(`Done\(status\)'.)199 | |
14064 | 789 y(3.)61 b(The)40 b(message)h(prin)m(ted)f(b)m(y)g(the)h(job)f(con)m | |
7d92f73f | 14065 | (trol)h(co)s(de)g(and)f(builtins)f(when)h(a)g(job)g(is)h(stopp)s(ed)e |
122f603c | 14066 | (is)330 899 y(`Stopp)s(ed\()p Fq(signame)5 b Ft(\)',)31 |
7d92f73f | 14067 | b(where)f Fq(signame)36 b Ft(is,)31 b(for)f(example,)h |
122f603c | 14068 | Fs(SIGTSTP)p Ft(.)199 1035 y(4.)61 b(The)27 b Fs(bg)g |
7d92f73f | 14069 | Ft(builtin)g(uses)g(the)h(required)f(format)h(to)g(describ)s(e)f(eac)m |
122f603c | 14070 | (h)i(job)e(placed)h(in)f(the)h(bac)m(kground,)330 1144 |
7d92f73f CR |
14071 | y(whic)m(h)h(do)s(es)g(not)g(include)g(an)g(indication)h(of)f(whether)f |
14072 | (the)h(job)g(is)g(the)h(curren)m(t)e(or)h(previous)g(job.)199 | |
122f603c | 14073 | 1280 y(5.)61 b(Reserv)m(ed)40 b(w)m(ords)g(app)s(earing)f(in)h(a)g(con) |
7d92f73f | 14074 | m(text)i(where)d(reserv)m(ed)h(w)m(ords)f(are)i(recognized)g(do)f(not) |
122f603c | 14075 | 330 1390 y(undergo)30 b(alias)h(expansion.)199 1525 y(6.)61 |
7d92f73f CR |
14076 | b(The)38 b Fl(posix)h Fs(PS1)f Ft(and)g Fs(PS2)g Ft(expansions)g(of)i |
14077 | (`)p Fs(!)p Ft(')f(to)g(the)g(history)g(n)m(um)m(b)s(er)f(and)g(`)p | |
122f603c | 14078 | Fs(!!)p Ft(')h(to)g(`)p Fs(!)p Ft(')h(are)330 1635 y(enabled,)26 |
ac18b312 CR |
14079 | b(and)f(parameter)g(expansion)g(is)g(p)s(erformed)e(on)i(the)g(v)-5 |
14080 | b(alues)25 b(of)g Fs(PS1)f Ft(and)h Fs(PS2)f Ft(regardless)330 | |
122f603c CR |
14081 | 1744 y(of)31 b(the)f(setting)i(of)e(the)h Fs(promptvars)c |
14082 | Ft(option.)199 1880 y(7.)61 b(The)30 b Fl(posix)g Ft(startup)f(\014les) | |
220537f2 | 14083 | i(are)g(executed)g(\()p Fs($ENV)p Ft(\))f(rather)g(than)g(the)h(normal) |
122f603c | 14084 | f(Bash)g(\014les.)199 2016 y(8.)61 b(Tilde)30 b(expansion)g(is)f(only)h |
ac18b312 | 14085 | (p)s(erformed)f(on)h(assignmen)m(ts)g(preceding)g(a)g(command)g(name,)g |
122f603c CR |
14086 | (rather)330 2125 y(than)g(on)g(all)i(assignmen)m(t)f(statemen)m(ts)h |
14087 | (on)e(the)h(line.)199 2261 y(9.)61 b(The)31 b Fs(command)e | |
14088 | Ft(builtin)i(do)s(es)g(not)h(prev)m(en)m(t)f(builtins)g(that)h(tak)m(e) | |
14089 | h(assignmen)m(t)f(statemen)m(ts)h(as)f(ar-)330 2371 y(gumen)m(ts)j | |
14090 | (from)g(expanding)f(them)h(as)g(assignmen)m(t)h(statemen)m(ts;)j(when) | |
14091 | 34 b(not)h(in)f(POSIX)g(mo)s(de,)330 2480 y(assignmen)m(t)42 | |
14092 | b(builtins)e(lose)h(their)g(assignmen)m(t)h(statemen)m(t)h(expansion)d | |
14093 | (prop)s(erties)g(when)g(pre-)330 2590 y(ceded)31 b(b)m(y)f | |
14094 | Fs(command)p Ft(.)154 2725 y(10.)61 b(The)30 b(default)g(history)h | |
220537f2 CR |
14095 | (\014le)f(is)h(`)p Fs(~/.sh_history)p Ft(')c(\(this)k(is)f(the)g |
14096 | (default)h(v)-5 b(alue)31 b(of)f Fs($HISTFILE)p Ft(\).)154 | |
122f603c | 14097 | 2861 y(11.)61 b(The)23 b(output)f(of)i(`)p Fs(kill)29 |
220537f2 | 14098 | b(-l)p Ft(')23 b(prin)m(ts)f(all)i(the)g(signal)f(names)g(on)g(a)h |
122f603c | 14099 | (single)g(line,)h(separated)e(b)m(y)g(spaces,)330 2971 |
220537f2 | 14100 | y(without)30 b(the)h(`)p Fs(SIG)p Ft(')f(pre\014x.)154 |
122f603c | 14101 | 3106 y(12.)61 b(The)30 b Fs(kill)f Ft(builtin)h(do)s(es)g(not)h(accept) |
220537f2 | 14102 | h(signal)f(names)f(with)g(a)h(`)p Fs(SIG)p Ft(')f(pre\014x.)154 |
122f603c | 14103 | 3242 y(13.)61 b(Non-in)m(teractiv)m(e)34 b(shells)c(exit)h(if)g |
220537f2 | 14104 | Fq(\014lename)k Ft(in)30 b Fs(.)g Fq(\014lename)36 b |
122f603c | 14105 | Ft(is)31 b(not)f(found.)154 3378 y(14.)61 b(Non-in)m(teractiv)m(e)41 |
220537f2 | 14106 | b(shells)d(exit)h(if)f(a)g(syn)m(tax)g(error)g(in)f(an)h(arithmetic)h |
122f603c CR |
14107 | (expansion)f(results)f(in)h(an)330 3487 y(in)m(v)-5 b(alid)31 |
14108 | b(expression.)154 3623 y(15.)61 b(Non-in)m(teractiv)m(e)27 | |
220537f2 CR |
14109 | b(shells)c(exit)i(if)e(there)h(is)f(a)h(syn)m(tax)g(error)f(in)g(a)h |
14110 | (script)f(read)g(with)h(the)f Fs(.)g Ft(or)h Fs(source)330 | |
122f603c CR |
14111 | 3733 y Ft(builtins,)30 b(or)g(in)g(a)h(string)g(pro)s(cessed)e(b)m(y)i |
14112 | (the)f Fs(eval)f Ft(builtin.)154 3868 y(16.)61 b(Redirection)25 | |
220537f2 | 14113 | b(op)s(erators)f(do)g(not)g(p)s(erform)f(\014lename)h(expansion)g(on)g |
122f603c CR |
14114 | (the)g(w)m(ord)f(in)h(the)g(redirection)330 3978 y(unless)30 |
14115 | b(the)g(shell)h(is)f(in)m(teractiv)m(e.)154 4114 y(17.)61 | |
220537f2 CR |
14116 | b(Redirection)31 b(op)s(erators)g(do)f(not)h(p)s(erform)e(w)m(ord)h |
14117 | (splitting)h(on)f(the)h(w)m(ord)f(in)g(the)g(redirection.)154 | |
122f603c | 14118 | 4249 y(18.)61 b(F)-8 b(unction)35 b(names)g(m)m(ust)f(b)s(e)g(v)-5 |
eb0b2ad8 | 14119 | b(alid)35 b(shell)f Fs(name)p Ft(s.)52 b(That)34 b(is,)i(they)f(ma)m(y) |
122f603c | 14120 | g(not)g(con)m(tain)g(c)m(haracters)330 4359 y(other)e(than)g(letters,)h |
eb0b2ad8 | 14121 | (digits,)h(and)d(underscores,)h(and)f(ma)m(y)h(not)g(start)h(with)e(a)h |
122f603c | 14122 | (digit.)49 b(Declaring)330 4468 y(a)31 b(function)f(with)g(an)g(in)m(v) |
eb0b2ad8 | 14123 | -5 b(alid)31 b(name)g(causes)f(a)h(fatal)h(syn)m(tax)f(error)f(in)g |
122f603c CR |
14124 | (non-in)m(teractiv)m(e)j(shells.)154 4604 y(19.)61 b(F)-8 |
14125 | b(unction)31 b(names)f(ma)m(y)h(not)g(b)s(e)f(the)g(same)h(as)g(one)f | |
14126 | (of)h(the)f Fl(posix)g Ft(sp)s(ecial)h(builtins.)154 | |
14127 | 4740 y(20.)61 b Fl(posix)30 b Ft(sp)s(ecial)h(builtins)e(are)i(found)e | |
14128 | (b)s(efore)h(shell)h(functions)f(during)f(command)h(lo)s(okup.)154 | |
14129 | 4876 y(21.)61 b(The)29 b Fs(time)g Ft(reserv)m(ed)h(w)m(ord)g(ma)m(y)g | |
220537f2 | 14130 | (b)s(e)g(used)f(b)m(y)h(itself)g(as)g(a)h(command.)40 |
122f603c | 14131 | b(When)30 b(used)f(in)g(this)h(w)m(a)m(y)-8 b(,)330 4985 |
220537f2 CR |
14132 | y(it)33 b(displa)m(ys)g(timing)g(statistics)h(for)e(the)h(shell)g(and)f |
14133 | (its)g(completed)i(c)m(hildren.)47 b(The)32 b Fs(TIMEFORMAT)330 | |
122f603c CR |
14134 | 5095 y Ft(v)-5 b(ariable)31 b(con)m(trols)h(the)e(format)h(of)g(the)f |
14135 | (timing)h(information.)154 5230 y(22.)61 b(When)33 b(parsing)f(and)g | |
220537f2 CR |
14136 | (expanding)g(a)i($)p Fs({)6 b Ft(.)22 b(.)g(.)11 b Fs(})33 |
14137 | b Ft(expansion)f(that)i(app)s(ears)e(within)g(double)g(quotes,)330 | |
122f603c CR |
14138 | 5340 y(single)42 b(quotes)g(are)g(no)g(longer)g(sp)s(ecial)g(and)f |
14139 | (cannot)i(b)s(e)e(used)g(to)h(quote)g(a)g(closing)h(brace)f(or)p | |
14140 | eop end | |
9f178efb CR |
14141 | %%Page: 94 100 |
14142 | TeXDict begin 94 99 bop 150 -116 a Ft(94)2572 b(Bash)31 | |
122f603c CR |
14143 | b(Reference)g(Man)m(ual)330 299 y(other)g(sp)s(ecial)h(c)m(haracter,)i |
14144 | (unless)c(the)i(op)s(erator)f(is)g(one)h(of)f(those)h(de\014ned)e(to)i | |
14145 | (p)s(erform)e(pattern)330 408 y(remo)m(v)-5 b(al.)42 | |
14146 | b(In)30 b(this)g(case,)i(they)e(do)g(not)h(ha)m(v)m(e)h(to)f(app)s(ear) | |
14147 | e(as)i(matc)m(hed)g(pairs.)154 542 y(23.)61 b(The)29 | |
14148 | b(parser)g(do)s(es)g(not)h(recognize)h Fs(time)d Ft(as)i(a)g(reserv)m | |
14149 | (ed)f(w)m(ord)g(if)h(the)f(next)h(tok)m(en)h(b)s(egins)d(with)i(a)330 | |
14150 | 652 y(`)p Fs(-)p Ft('.)154 786 y(24.)61 b(If)24 b(a)g | |
14151 | Fl(posix)g Ft(sp)s(ecial)h(builtin)f(returns)f(an)h(error)g(status,)i | |
14152 | (a)e(non-in)m(teractiv)m(e)j(shell)e(exits.)39 b(The)24 | |
14153 | b(fatal)330 896 y(errors)30 b(are)h(those)f(listed)h(in)f(the)h | |
14154 | Fl(posix)e Ft(standard,)h(and)g(include)g(things)g(lik)m(e)i(passing)e | |
14155 | (incorrect)330 1005 y(options,)43 b(redirection)d(errors,)i(v)-5 | |
14156 | b(ariable)41 b(assignmen)m(t)g(errors)e(for)g(assignmen)m(ts)i | |
14157 | (preceding)f(the)330 1115 y(command)30 b(name,)h(and)f(so)g(on.)154 | |
14158 | 1249 y(25.)61 b(A)31 b(non-in)m(teractiv)m(e)j(shell)d(exits)h(with)e | |
14159 | (an)h(error)g(status)g(if)g(a)g(v)-5 b(ariable)32 b(assignmen)m(t)g | |
14160 | (error)e(o)s(ccurs)330 1358 y(when)38 b(no)h(command)g(name)g(follo)m | |
14161 | (ws)i(the)e(assignmen)m(t)h(statemen)m(ts.)69 b(A)39 | |
14162 | b(v)-5 b(ariable)40 b(assignmen)m(t)330 1468 y(error)30 | |
14163 | b(o)s(ccurs,)g(for)g(example,)i(when)d(trying)i(to)g(assign)f(a)h(v)-5 | |
14164 | b(alue)31 b(to)g(a)g(readonly)f(v)-5 b(ariable.)154 1602 | |
14165 | y(26.)61 b(A)28 b(non-in)m(teractiv)m(e)j(shell)e(exists)f(with)g(an)g | |
14166 | (error)g(status)h(if)f(a)g(v)-5 b(ariable)29 b(assignmen)m(t)g(error)f | |
14167 | (o)s(ccurs)330 1711 y(in)i(an)g(assignmen)m(t)i(statemen)m(t)g | |
14168 | (preceding)e(a)h(sp)s(ecial)g(builtin,)f(but)g(not)g(with)h(an)m(y)f | |
14169 | (other)h(simple)330 1821 y(command.)154 1955 y(27.)61 | |
14170 | b(A)43 b(non-in)m(teractiv)m(e)i(shell)e(exits)h(with)f(an)f(error)h | |
14171 | (status)g(if)g(the)g(iteration)h(v)-5 b(ariable)44 b(in)f(a)g | |
14172 | Fs(for)330 2064 y Ft(statemen)m(t)32 b(or)f(the)f(selection)i(v)-5 | |
14173 | b(ariable)32 b(in)e(a)g Fs(select)f Ft(statemen)m(t)j(is)f(a)f | |
14174 | (readonly)h(v)-5 b(ariable.)154 2198 y(28.)61 b(Pro)s(cess)30 | |
14175 | b(substitution)g(is)h(not)f(a)m(v)-5 b(ailable.)154 2332 | |
14176 | y(29.)61 b(While)32 b(v)-5 b(ariable)32 b(indirection)f(is)g(a)m(v)-5 | |
14177 | b(ailable,)34 b(it)d(ma)m(y)h(not)f(b)s(e)g(applied)g(to)g(the)h(`)p | |
74d0116b | 14178 | Fs(#)p Ft(')f(and)f(`)p Fs(?)p Ft(')h(sp)s(ecial)330 |
122f603c | 14179 | 2442 y(parameters.)154 2576 y(30.)61 b(Assignmen)m(t)23 |
ac18b312 | 14180 | b(statemen)m(ts)h(preceding)e Fl(posix)f Ft(sp)s(ecial)i(builtins)f(p)s |
122f603c CR |
14181 | (ersist)g(in)f(the)i(shell)f(en)m(vironmen)m(t)330 2685 |
14182 | y(after)31 b(the)f(builtin)g(completes.)154 2819 y(31.)61 | |
eb0b2ad8 CR |
14183 | b(Assignmen)m(t)35 b(statemen)m(ts)h(preceding)f(shell)f(function)g |
14184 | (calls)i(p)s(ersist)e(in)g(the)h(shell)f(en)m(vironmen)m(t)330 | |
122f603c | 14185 | 2929 y(after)d(the)f(function)h(returns,)e(as)i(if)f(a)h |
eb0b2ad8 | 14186 | Fl(posix)e Ft(sp)s(ecial)i(builtin)f(command)g(had)g(b)s(een)g |
122f603c | 14187 | (executed.)154 3063 y(32.)61 b(The)38 b Fs(export)f Ft(and)g |
eb0b2ad8 | 14188 | Fs(readonly)f Ft(builtin)i(commands)g(displa)m(y)h(their)f(output)g(in) |
122f603c CR |
14189 | g(the)h(format)g(re-)330 3173 y(quired)30 b(b)m(y)g Fl(posix)p |
14190 | Ft(.)154 3306 y(33.)61 b(The)30 b Fs(trap)f Ft(builtin)h(displa)m(ys)g | |
eb0b2ad8 | 14191 | (signal)i(names)e(without)g(the)h(leading)g Fs(SIG)p |
122f603c | 14192 | Ft(.)154 3440 y(34.)61 b(The)39 b Fs(trap)e Ft(builtin)i(do)s(esn't)g |
eb0b2ad8 | 14193 | (c)m(hec)m(k)h(the)g(\014rst)e(argumen)m(t)i(for)e(a)i(p)s(ossible)e |
122f603c | 14194 | (signal)i(sp)s(eci\014cation)330 3550 y(and)30 b(rev)m(ert)i(the)e |
eb0b2ad8 | 14195 | (signal)i(handling)e(to)h(the)g(original)h(disp)s(osition)e(if)h(it)g |
122f603c | 14196 | (is,)g(unless)f(that)h(argumen)m(t)330 3660 y(consists)e(solely)g(of)g |
220537f2 | 14197 | (digits)g(and)f(is)g(a)h(v)-5 b(alid)29 b(signal)g(n)m(um)m(b)s(er.)38 |
eb0b2ad8 | 14198 | b(If)28 b(users)g(w)m(an)m(t)h(to)g(reset)g(the)g(handler)330 |
122f603c | 14199 | 3769 y(for)h(a)g(giv)m(en)h(signal)g(to)f(the)h(original)g(disp)s |
37c41ab1 | 14200 | (osition,)f(they)g(should)f(use)h(`)p Fs(-)p Ft(')g(as)g(the)g(\014rst) |
122f603c | 14201 | f(argumen)m(t.)154 3903 y(35.)61 b(The)21 b Fs(.)h Ft(and)f |
37c41ab1 CR |
14202 | Fs(source)f Ft(builtins)h(do)g(not)h(searc)m(h)h(the)f(curren)m(t)f |
14203 | (directory)h(for)g(the)g(\014lename)f(argumen)m(t)330 | |
122f603c CR |
14204 | 4013 y(if)30 b(it)h(is)g(not)f(found)f(b)m(y)i(searc)m(hing)g |
14205 | Fs(PATH)p Ft(.)154 4147 y(36.)61 b(Subshells)20 b(spa)m(wned)h(to)h | |
37c41ab1 CR |
14206 | (execute)g(command)g(substitutions)f(inherit)g(the)g(v)-5 |
14207 | b(alue)22 b(of)g(the)f(`)p Fs(-e)p Ft(')g(option)330 | |
122f603c | 14208 | 4256 y(from)34 b(the)h(paren)m(t)g(shell.)55 b(When)34 |
37c41ab1 | 14209 | b(not)i(in)e Fl(posix)g Ft(mo)s(de,)i(Bash)f(clears)h(the)f(`)p |
122f603c CR |
14210 | Fs(-e)p Ft(')f(option)i(in)e(suc)m(h)330 4366 y(subshells.)154 |
14211 | 4500 y(37.)61 b(Alias)31 b(expansion)g(is)f(alw)m(a)m(ys)i(enabled,)e | |
14212 | (ev)m(en)i(in)e(non-in)m(teractiv)m(e)j(shells.)154 4634 | |
14213 | y(38.)61 b(When)43 b(the)g Fs(alias)f Ft(builtin)g(displa)m(ys)i(alias) | |
37c41ab1 | 14214 | g(de\014nitions,)i(it)d(do)s(es)g(not)g(displa)m(y)h(them)f(with)g(a) |
122f603c CR |
14215 | 330 4743 y(leading)31 b(`)p Fs(alias)e Ft(')i(unless)f(the)g(`)p |
14216 | Fs(-p)p Ft(')g(option)h(is)g(supplied.)154 4877 y(39.)61 | |
37c41ab1 CR |
14217 | b(When)40 b(the)g Fs(set)f Ft(builtin)h(is)g(in)m(v)m(ok)m(ed)h |
14218 | (without)f(options,)j(it)e(do)s(es)f(not)g(displa)m(y)g(shell)g | |
122f603c CR |
14219 | (function)330 4987 y(names)30 b(and)g(de\014nitions.)154 |
14220 | 5121 y(40.)61 b(When)36 b(the)g Fs(set)g Ft(builtin)g(is)g(in)m(v)m(ok) | |
37c41ab1 | 14221 | m(ed)i(without)e(options,)i(it)f(displa)m(ys)f(v)-5 b(ariable)37 |
122f603c | 14222 | b(v)-5 b(alues)37 b(without)330 5230 y(quotes,)26 b(unless)d(they)i |
37c41ab1 | 14223 | (con)m(tain)g(shell)f(metac)m(haracters,)k(ev)m(en)d(if)f(the)g(result) |
122f603c CR |
14224 | g(con)m(tains)i(nonprin)m(ting)330 5340 y(c)m(haracters.)p |
14225 | eop end | |
9f178efb CR |
14226 | %%Page: 95 101 |
14227 | TeXDict begin 95 100 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
14228 | b(Bash)30 b(F)-8 b(eatures)2484 b(95)154 299 y(41.)61 | |
122f603c CR |
14229 | b(When)35 b(the)g Fs(cd)f Ft(builtin)h(is)g(in)m(v)m(ok)m(ed)i(in)d |
14230 | Fq(logical)41 b Ft(mo)s(de,)36 b(and)f(the)g(pathname)g(constructed)g | |
14231 | (from)330 408 y Fs($PWD)i Ft(and)h(the)h(directory)f(name)h(supplied)e | |
14232 | (as)i(an)f(argumen)m(t)h(do)s(es)f(not)g(refer)h(to)g(an)f(existing)330 | |
14233 | 518 y(directory)-8 b(,)32 b Fs(cd)d Ft(will)i(fail)g(instead)g(of)f | |
14234 | (falling)h(bac)m(k)h(to)f Fq(ph)m(ysical)j Ft(mo)s(de.)154 | |
14235 | 653 y(42.)61 b(The)36 b Fs(pwd)f Ft(builtin)h(v)m(eri\014es)h(that)g | |
14236 | (the)f(v)-5 b(alue)37 b(it)g(prin)m(ts)e(is)i(the)f(same)h(as)f(the)h | |
14237 | (curren)m(t)f(directory)-8 b(,)330 762 y(ev)m(en)31 b(if)f(it)h(is)g | |
14238 | (not)f(ask)m(ed)h(to)g(c)m(hec)m(k)h(the)f(\014le)f(system)h(with)f | |
14239 | (the)h(`)p Fs(-P)p Ft(')f(option.)154 897 y(43.)61 b(When)35 | |
14240 | b(listing)g(the)g(history)-8 b(,)36 b(the)f Fs(fc)g Ft(builtin)f(do)s | |
14241 | (es)g(not)h(include)g(an)f(indication)i(of)f(whether)f(or)330 | |
14242 | 1006 y(not)d(a)f(history)h(en)m(try)f(has)g(b)s(een)g(mo)s(di\014ed.) | |
14243 | 154 1141 y(44.)61 b(The)30 b(default)g(editor)h(used)f(b)m(y)g | |
14244 | Fs(fc)g Ft(is)g Fs(ed)p Ft(.)154 1275 y(45.)61 b(The)37 | |
14245 | b Fs(type)g Ft(and)g Fs(command)f Ft(builtins)i(will)g(not)g(rep)s(ort) | |
14246 | f(a)i(non-executable)g(\014le)f(as)g(ha)m(ving)h(b)s(een)330 | |
14247 | 1385 y(found,)26 b(though)h(the)g(shell)g(will)g(attempt)h(to)g | |
14248 | (execute)g(suc)m(h)f(a)g(\014le)g(if)g(it)g(is)g(the)g(only)g(so-named) | |
14249 | g(\014le)330 1494 y(found)i(in)h Fs($PATH)p Ft(.)154 | |
14250 | 1629 y(46.)61 b(The)33 b Fs(vi)f Ft(editing)i(mo)s(de)f(will)g(in)m(v)m | |
14251 | (ok)m(e)i(the)e Fs(vi)g Ft(editor)h(directly)f(when)f(the)i(`)p | |
14252 | Fs(v)p Ft(')f(command)g(is)g(run,)330 1738 y(instead)e(of)f(c)m(hec)m | |
14253 | (king)i Fs($VISUAL)d Ft(and)g Fs($EDITOR)p Ft(.)154 1873 | |
14254 | y(47.)61 b(When)41 b(the)g Fs(xpg_echo)e Ft(option)i(is)g(enabled,)j | |
14255 | (Bash)d(do)s(es)g(not)g(attempt)h(to)g(in)m(terpret)f(an)m(y)h(ar-)330 | |
14256 | 1983 y(gumen)m(ts)35 b(to)g Fs(echo)e Ft(as)i(options.)54 | |
1c72c0cd | 14257 | b(Eac)m(h)35 b(argumen)m(t)g(is)f(displa)m(y)m(ed,)j(after)e(escap)s(e) |
122f603c CR |
14258 | g(c)m(haracters)h(are)330 2092 y(con)m(v)m(erted.)154 |
14259 | 2227 y(48.)61 b(The)30 b Fs(ulimit)f Ft(builtin)g(uses)h(a)h(blo)s(c)m | |
09767ff0 | 14260 | (k)g(size)g(of)g(512)g(b)m(ytes)g(for)f(the)h(`)p Fs(-c)p |
122f603c | 14261 | Ft(')f(and)g(`)p Fs(-f)p Ft(')g(options.)154 2361 y(49.)61 |
e1e48bba CR |
14262 | b(The)39 b(arriv)-5 b(al)41 b(of)f Fs(SIGCHLD)e Ft(when)h(a)h(trap)g |
14263 | (is)g(set)h(on)f Fs(SIGCHLD)e Ft(do)s(es)h(not)h(in)m(terrupt)g(the)g | |
122f603c | 14264 | Fs(wait)330 2471 y Ft(builtin)c(and)h(cause)g(it)h(to)f(return)f |
e1e48bba | 14265 | (immediately)-8 b(.)62 b(The)37 b(trap)f(command)h(is)g(run)e(once)j |
abe2eb5b CR |
14266 | (for)f(eac)m(h)330 2580 y(c)m(hild)31 b(that)g(exits.)154 |
14267 | 2715 y(50.)61 b(The)27 b Fs(read)f Ft(builtin)g(ma)m(y)i(b)s(e)e(in)m | |
14268 | (terrupted)h(b)m(y)g(a)h(signal)f(for)g(whic)m(h)g(a)h(trap)f(has)g(b)s | |
14269 | (een)f(set.)40 b(If)27 b(Bash)330 2824 y(receiv)m(es)41 | |
14270 | b(a)f(trapp)s(ed)e(signal)i(while)f(executing)h Fs(read)p | |
14271 | Ft(,)h(the)e(trap)h(handler)e(executes)i(and)f Fs(read)330 | |
14272 | 2934 y Ft(returns)29 b(an)h(exit)i(status)e(greater)i(than)e(128.)275 | |
14273 | 3093 y(There)k(is)g(other)h Fl(posix)f Ft(b)s(eha)m(vior)h(that)g(Bash) | |
eb0b2ad8 | 14274 | g(do)s(es)f(not)h(implemen)m(t)g(b)m(y)g(default)f(ev)m(en)i(when)d(in) |
abe2eb5b CR |
14275 | 150 3203 y Fl(posix)d Ft(mo)s(de.)40 b(Sp)s(eci\014cally:)199 |
14276 | 3337 y(1.)61 b(The)30 b Fs(fc)f Ft(builtin)h(c)m(hec)m(ks)i | |
e6062848 | 14277 | Fs($EDITOR)c Ft(as)j(a)f(program)g(to)h(edit)g(history)f(en)m(tries)h |
abe2eb5b | 14278 | (if)f Fs(FCEDIT)f Ft(is)h(unset,)330 3447 y(rather)g(than)g(defaulting) |
eb0b2ad8 | 14279 | h(directly)g(to)g Fs(ed)p Ft(.)40 b Fs(fc)30 b Ft(uses)g |
abe2eb5b | 14280 | Fs(ed)g Ft(if)g Fs(EDITOR)f Ft(is)h(unset.)199 3582 y(2.)61 |
e6062848 CR |
14281 | b(As)29 b(noted)g(ab)s(o)m(v)m(e,)i(Bash)e(requires)g(the)g |
14282 | Fs(xpg_echo)e Ft(option)j(to)g(b)s(e)e(enabled)h(for)g(the)g | |
abe2eb5b CR |
14283 | Fs(echo)f Ft(builtin)330 3691 y(to)j(b)s(e)f(fully)g(conforman)m(t.)275 |
14284 | 3851 y(Bash)66 b(can)h(b)s(e)f(con\014gured)g(to)i(b)s(e)e | |
220537f2 | 14285 | Fl(posix)p Ft(-conforman)m(t)h(b)m(y)f(default,)77 b(b)m(y)66 |
abe2eb5b | 14286 | b(sp)s(ecifying)h(the)150 3960 y(`)p Fs(--enable-strict-posix-def)o |
220537f2 | 14287 | (ault)o Ft(')i(to)76 b Fs(configure)c Ft(when)i(building)g(\(see)i |
abe2eb5b | 14288 | (Section)f(10.8)150 4070 y([Optional)31 b(F)-8 b(eatures],)32 |
9f178efb CR |
14289 | b(page)f(141\).)p eop end |
14290 | %%Page: 96 102 | |
14291 | TeXDict begin 96 101 bop eop end | |
14292 | %%Page: 97 103 | |
14293 | TeXDict begin 97 102 bop 150 -116 a Ft(Chapter)30 b(7:)41 | |
14294 | b(Job)30 b(Con)m(trol)2571 b(97)150 299 y Fo(7)80 b(Job)54 | |
c302751c CR |
14295 | b(Con)l(trol)150 521 y Ft(This)25 b(c)m(hapter)i(discusses)f(what)g |
14296 | (job)f(con)m(trol)j(is,)f(ho)m(w)f(it)h(w)m(orks,)g(and)f(ho)m(w)g | |
14297 | (Bash)g(allo)m(ws)h(y)m(ou)g(to)g(access)150 631 y(its)k(facilities.) | |
14298 | 150 858 y Fr(7.1)68 b(Job)45 b(Con)l(trol)h(Basics)150 | |
14299 | 1018 y Ft(Job)27 b(con)m(trol)i(refers)e(to)h(the)g(abilit)m(y)h(to)f | |
14300 | (selectiv)m(ely)j(stop)c(\(susp)s(end\))f(the)i(execution)h(of)e(pro)s | |
14301 | (cesses)h(and)150 1127 y(con)m(tin)m(ue)38 b(\(resume\))g(their)f | |
14302 | (execution)h(at)g(a)g(later)g(p)s(oin)m(t.)61 b(A)37 | |
14303 | b(user)g(t)m(ypically)i(emplo)m(ys)f(this)f(facilit)m(y)150 | |
14304 | 1237 y(via)27 b(an)e(in)m(teractiv)m(e)k(in)m(terface)f(supplied)d | |
14305 | (join)m(tly)h(b)m(y)g(the)h(op)s(erating)f(system)g(k)m(ernel's)h | |
14306 | (terminal)f(driv)m(er)150 1347 y(and)k(Bash.)275 1479 | |
14307 | y(The)23 b(shell)i(asso)s(ciates)h(a)f Fq(job)h Ft(with)e(eac)m(h)i | |
14308 | (pip)s(eline.)38 b(It)25 b(k)m(eeps)f(a)h(table)h(of)e(curren)m(tly)h | |
14309 | (executing)g(jobs,)150 1588 y(whic)m(h)33 b(ma)m(y)i(b)s(e)e(listed)h | |
14310 | (with)f(the)h Fs(jobs)f Ft(command.)50 b(When)33 b(Bash)h(starts)g(a)g | |
14311 | (job)g(async)m(hronously)-8 b(,)34 b(it)150 1698 y(prin)m(ts)c(a)h | |
14312 | (line)f(that)h(lo)s(oks)g(lik)m(e:)390 1830 y Fs([1])47 | |
14313 | b(25647)150 1962 y Ft(indicating)34 b(that)g(this)f(job)g(is)g(job)g(n) | |
14314 | m(um)m(b)s(er)f(1)i(and)f(that)g(the)h(pro)s(cess)f Fl(id)g | |
14315 | Ft(of)g(the)h(last)g(pro)s(cess)f(in)g(the)150 2072 y(pip)s(eline)42 | |
14316 | b(asso)s(ciated)i(with)e(this)g(job)g(is)h(25647.)78 | |
14317 | b(All)43 b(of)g(the)g(pro)s(cesses)f(in)g(a)h(single)g(pip)s(eline)f | |
14318 | (are)150 2181 y(mem)m(b)s(ers)30 b(of)g(the)h(same)f(job.)41 | |
14319 | b(Bash)30 b(uses)g(the)h Fq(job)h Ft(abstraction)f(as)g(the)g(basis)f | |
14320 | (for)g(job)g(con)m(trol.)275 2313 y(T)-8 b(o)23 b(facilitate)j(the)d | |
14321 | (implemen)m(tation)i(of)f(the)f(user)f(in)m(terface)j(to)f(job)f(con)m | |
14322 | (trol,)j(the)d(op)s(erating)h(system)150 2423 y(main)m(tains)j(the)f | |
14323 | (notion)h(of)f(a)g(curren)m(t)g(terminal)g(pro)s(cess)g(group)g | |
14324 | Fl(id)p Ft(.)39 b(Mem)m(b)s(ers)26 b(of)g(this)g(pro)s(cess)f(group)150 | |
14325 | 2533 y(\(pro)s(cesses)h(whose)g(pro)s(cess)g(group)g | |
37c41ab1 | 14326 | Fl(id)g Ft(is)h(equal)g(to)g(the)f(curren)m(t)g(terminal)h(pro)s(cess)f |
c302751c | 14327 | (group)f Fl(id)p Ft(\))i(receiv)m(e)150 2642 y(k)m(eyb)s |
37c41ab1 CR |
14328 | (oard-generated)22 b(signals)g(suc)m(h)e(as)h Fs(SIGINT)p |
14329 | Ft(.)36 b(These)21 b(pro)s(cesses)g(are)g(said)g(to)g(b)s(e)g(in)f(the) | |
c302751c | 14330 | h(foreground.)150 2752 y(Bac)m(kground)38 b(pro)s(cesses)f(are)h(those) |
37c41ab1 | 14331 | g(whose)f(pro)s(cess)g(group)g Fl(id)h Ft(di\013ers)f(from)g(the)g |
c302751c | 14332 | (terminal's;)42 b(suc)m(h)150 2861 y(pro)s(cesses)24 |
37c41ab1 CR |
14333 | b(are)g(imm)m(une)g(to)g(k)m(eyb)s(oard-generated)h(signals.)40 |
14334 | b(Only)23 b(foreground)g(pro)s(cesses)h(are)g(allo)m(w)m(ed)150 | |
c302751c | 14335 | 2971 y(to)g(read)e(from)h(or,)h(if)f(the)g(user)f(so)i(sp)s(eci\014es)e |
602bb739 | 14336 | (with)h Fs(stty)29 b(tostop)p Ft(,)23 b(write)g(to)g(the)h(terminal.)38 |
c302751c | 14337 | b(Bac)m(kground)150 3081 y(pro)s(cesses)27 b(whic)m(h)g(attempt)h(to)f |
602bb739 | 14338 | (read)g(from)g(\(write)g(to)h(when)e Fs(stty)j(tostop)d |
c302751c | 14339 | Ft(is)h(in)f(e\013ect\))j(the)e(terminal)150 3190 y(are)32 |
602bb739 CR |
14340 | b(sen)m(t)g(a)g Fs(SIGTTIN)e Ft(\()p Fs(SIGTTOU)p Ft(\))g(signal)i(b)m |
14341 | (y)g(the)g(k)m(ernel's)g(terminal)g(driv)m(er,)g(whic)m(h,)g(unless)f | |
c302751c CR |
14342 | (caugh)m(t,)150 3300 y(susp)s(ends)d(the)i(pro)s(cess.)275 |
14343 | 3432 y(If)k(the)i(op)s(erating)g(system)f(on)h(whic)m(h)f(Bash)g(is)h | |
602bb739 | 14344 | (running)d(supp)s(orts)h(job)h(con)m(trol,)j(Bash)e(con)m(tains)150 |
c302751c | 14345 | 3541 y(facilities)30 b(to)f(use)f(it.)40 b(T)m(yping)28 |
602bb739 CR |
14346 | b(the)g Fq(susp)s(end)h Ft(c)m(haracter)h(\(t)m(ypically)g(`)p |
14347 | Fs(^Z)p Ft(',)f(Con)m(trol-Z\))g(while)f(a)g(pro)s(cess)150 | |
c302751c | 14348 | 3651 y(is)42 b(running)f(causes)i(that)g(pro)s(cess)f(to)h(b)s(e)f |
602bb739 | 14349 | (stopp)s(ed)f(and)h(returns)f(con)m(trol)j(to)f(Bash.)77 |
c302751c | 14350 | b(T)m(yping)42 b(the)150 3761 y Fq(dela)m(y)m(ed)k(susp)s(end)f |
602bb739 CR |
14351 | Ft(c)m(haracter)h(\(t)m(ypically)g(`)p Fs(^Y)p Ft(',)i(Con)m(trol-Y\))e |
14352 | (causes)e(the)h(pro)s(cess)e(to)i(b)s(e)f(stopp)s(ed)150 | |
c302751c | 14353 | 3870 y(when)26 b(it)i(attempts)h(to)f(read)f(input)g(from)f(the)i |
602bb739 | 14354 | (terminal,)h(and)e(con)m(trol)h(to)g(b)s(e)f(returned)f(to)j(Bash.)39 |
c302751c | 14355 | b(The)150 3980 y(user)e(then)g(manipulates)h(the)g(state)h(of)f(this)f |
602bb739 | 14356 | (job,)j(using)d(the)h Fs(bg)f Ft(command)g(to)h(con)m(tin)m(ue)h(it)f |
c302751c | 14357 | (in)g(the)150 4089 y(bac)m(kground,)g(the)f Fs(fg)g Ft(command)f(to)i |
602bb739 | 14358 | (con)m(tin)m(ue)g(it)f(in)f(the)h(foreground,)h(or)f(the)g |
c302751c | 14359 | Fs(kill)f Ft(command)g(to)150 4199 y(kill)27 b(it.)40 |
602bb739 CR |
14360 | b(A)27 b(`)p Fs(^Z)p Ft(')g(tak)m(es)h(e\013ect)g(immediately)-8 |
14361 | b(,)29 b(and)d(has)h(the)f(additional)i(side)e(e\013ect)j(of)d(causing) | |
c302751c CR |
14362 | h(p)s(ending)150 4309 y(output)j(and)g(t)m(yp)s(eahead)h(to)g(b)s(e)e |
14363 | (discarded.)275 4441 y(There)j(are)g(a)h(n)m(um)m(b)s(er)e(of)i(w)m(a)m | |
602bb739 | 14364 | (ys)g(to)h(refer)e(to)h(a)g(job)f(in)g(the)h(shell.)47 |
5e13499c | 14365 | b(The)32 b(c)m(haracter)i(`)p Fs(\045)p Ft(')f(in)m(tro)s(duces)150 |
c302751c CR |
14366 | 4550 y(a)e(job)f(sp)s(eci\014cation)h(\()p Fq(jobsp)s(ec)6 |
14367 | b Ft(\).)275 4682 y(Job)31 b(n)m(um)m(b)s(er)f Fs(n)h | |
a9fac3b2 | 14368 | Ft(ma)m(y)h(b)s(e)f(referred)g(to)h(as)g(`)p Fs(\045n)p |
37c41ab1 CR |
14369 | Ft('.)44 b(The)31 b(sym)m(b)s(ols)g(`)p Fs(\045\045)p |
14370 | Ft(')h(and)f(`)p Fs(\045+)p Ft(')g(refer)h(to)g(the)g(shell's)150 | |
c302751c | 14371 | 4792 y(notion)k(of)f(the)g(curren)m(t)g(job,)h(whic)m(h)f(is)g(the)g |
eb2bb562 | 14372 | (last)h(job)f(stopp)s(ed)f(while)h(it)h(w)m(as)g(in)e(the)i(foreground) |
c302751c | 14373 | e(or)150 4902 y(started)27 b(in)g(the)g(bac)m(kground.)40 |
eb2bb562 | 14374 | b(A)27 b(single)g(`)p Fs(\045)p Ft(')g(\(with)g(no)g(accompan)m(ying)i |
c302751c | 14375 | (job)d(sp)s(eci\014cation\))i(also)g(refers)150 5011 |
09767ff0 CR |
14376 | y(to)k(the)e(curren)m(t)h(job.)42 b(The)30 b(previous)g(job)h(ma)m(y)g |
14377 | (b)s(e)f(referenced)h(using)f(`)p Fs(\045-)p Ft('.)42 | |
c302751c | 14378 | b(If)30 b(there)h(is)g(only)g(a)g(single)150 5121 y(job,)g(`)p |
09767ff0 CR |
14379 | Fs(\045+)p Ft(')g(and)f(`)p Fs(\045-)p Ft(')h(can)h(b)s(oth)e(b)s(e)g |
14380 | (used)h(to)g(refer)g(to)h(that)g(job.)42 b(In)30 b(output)h(p)s | |
c302751c CR |
14381 | (ertaining)g(to)g(jobs)g(\(e.g.,)150 5230 y(the)39 b(output)f(of)g(the) |
14382 | h Fs(jobs)e Ft(command\),)k(the)d(curren)m(t)h(job)f(is)g(alw)m(a)m(ys) | |
14383 | i(\015agged)f(with)f(a)h(`)p Fs(+)p Ft(',)i(and)d(the)150 | |
14384 | 5340 y(previous)30 b(job)g(with)g(a)h(`)p Fs(-)p Ft('.)p | |
14385 | eop end | |
9f178efb CR |
14386 | %%Page: 98 104 |
14387 | TeXDict begin 98 103 bop 150 -116 a Ft(98)2572 b(Bash)31 | |
c302751c CR |
14388 | b(Reference)g(Man)m(ual)275 299 y(A)38 b(job)g(ma)m(y)h(also)g(b)s(e)f |
14389 | (referred)f(to)j(using)d(a)i(pre\014x)e(of)i(the)f(name)h(used)e(to)i | |
14390 | (start)g(it,)i(or)e(using)f(a)150 408 y(substring)29 | |
14391 | b(that)i(app)s(ears)f(in)g(its)h(command)f(line.)41 b(F)-8 | |
14392 | b(or)31 b(example,)g(`)p Fs(\045ce)p Ft(')f(refers)g(to)h(a)g(stopp)s | |
14393 | (ed)e Fs(ce)h Ft(job.)150 518 y(Using)d(`)p Fs(\045?ce)p | |
14394 | Ft(',)g(on)f(the)h(other)g(hand,)g(refers)f(to)h(an)m(y)g(job)g(con)m | |
14395 | (taining)h(the)f(string)f(`)p Fs(ce)p Ft(')h(in)f(its)h(command)150 | |
14396 | 628 y(line.)41 b(If)30 b(the)h(pre\014x)e(or)h(substring)f(matc)m(hes)j | |
14397 | (more)e(than)h(one)f(job,)h(Bash)f(rep)s(orts)g(an)g(error.)275 | |
14398 | 762 y(Simply)g(naming)h(a)g(job)g(can)g(b)s(e)f(used)h(to)g(bring)f(it) | |
14399 | i(in)m(to)g(the)f(foreground:)41 b(`)p Fs(\0451)p Ft(')31 | |
14400 | b(is)g(a)h(synon)m(ym)e(for)150 871 y(`)p Fs(fg)g(\0451)p | |
37c41ab1 CR |
14401 | Ft(',)i(bringing)f(job)g(1)g(from)g(the)h(bac)m(kground)f(in)m(to)i |
14402 | (the)e(foreground.)44 b(Similarly)-8 b(,)32 b(`)p Fs(\0451)e(&)p | |
c302751c CR |
14403 | Ft(')i(resumes)150 981 y(job)e(1)h(in)f(the)g(bac)m(kground,)h(equiv)-5 |
14404 | b(alen)m(t)32 b(to)f(`)p Fs(bg)f(\0451)p Ft(')275 1115 | |
14405 | y(The)g(shell)i(learns)f(immediately)i(whenev)m(er)e(a)h(job)f(c)m | |
37c41ab1 | 14406 | (hanges)h(state.)45 b(Normally)-8 b(,)33 b(Bash)e(w)m(aits)i(un)m(til) |
c302751c | 14407 | 150 1224 y(it)25 b(is)g(ab)s(out)f(to)i(prin)m(t)e(a)h(prompt)f(b)s |
37c41ab1 | 14408 | (efore)g(rep)s(orting)h(c)m(hanges)g(in)g(a)g(job's)f(status)h(so)g(as) |
c302751c | 14409 | g(to)g(not)g(in)m(terrupt)150 1334 y(an)m(y)g(other)g(output.)39 |
37c41ab1 CR |
14410 | b(If)24 b(the)i(`)p Fs(-b)p Ft(')e(option)i(to)f(the)g |
14411 | Fs(set)f Ft(builtin)h(is)g(enabled,)h(Bash)f(rep)s(orts)f(suc)m(h)h(c)m | |
c302751c | 14412 | (hanges)150 1443 y(immediately)g(\(see)g(Section)g(4.3.1)g([The)f(Set)g |
9f178efb | 14413 | (Builtin],)i(page)f(58\).)40 b(An)m(y)24 b(trap)f(on)h |
c302751c CR |
14414 | Fs(SIGCHLD)e Ft(is)i(executed)150 1553 y(for)30 b(eac)m(h)i(c)m(hild)e |
14415 | (pro)s(cess)g(that)h(exits.)275 1687 y(If)25 b(an)h(attempt)h(to)g | |
d3ad40de | 14416 | (exit)g(Bash)f(is)h(made)f(while)g(jobs)f(are)i(stopp)s(ed,)f(\(or)h |
c302751c | 14417 | (running,)e(if)h(the)g Fs(checkjobs)150 1796 y Ft(option)e(is)f |
d3ad40de | 14418 | (enabled)h({)g(see)g(Section)g(4.3.2)h([The)e(Shopt)g(Builtin],)j(page) |
9f178efb | 14419 | e(62\),)i(the)e(shell)f(prin)m(ts)g(a)h(w)m(arning)150 |
c302751c | 14420 | 1906 y(message,)k(and)c(if)i(the)f Fs(checkjobs)e Ft(option)j(is)f |
d3ad40de | 14421 | (enabled,)i(lists)e(the)h(jobs)f(and)f(their)i(statuses.)39 |
c302751c | 14422 | b(The)25 b Fs(jobs)150 2016 y Ft(command)36 b(ma)m(y)h(then)f(b)s(e)f |
d3ad40de | 14423 | (used)g(to)i(insp)s(ect)f(their)g(status.)59 b(If)36 |
c302751c | 14424 | b(a)g(second)g(attempt)i(to)f(exit)g(is)f(made)150 2125 |
d3ad40de CR |
14425 | y(without)e(an)f(in)m(terv)m(ening)i(command,)f(Bash)g(do)s(es)f(not)h |
14426 | (prin)m(t)g(another)f(w)m(arning,)i(and)e(an)m(y)h(stopp)s(ed)150 | |
c302751c CR |
14427 | 2235 y(jobs)c(are)h(terminated.)150 2466 y Fr(7.2)68 |
14428 | b(Job)45 b(Con)l(trol)h(Builtins)150 2650 y Fs(bg)870 | |
14429 | 2784 y(bg)h([)p Fi(jobspec)56 b Fs(...)o(])630 2918 y | |
d3ad40de CR |
14430 | Ft(Resume)24 b(eac)m(h)h(susp)s(ended)d(job)i Fq(jobsp)s(ec)29 |
14431 | b Ft(in)24 b(the)g(bac)m(kground,)h(as)g(if)f(it)h(had)e(b)s(een)g | |
c302751c | 14432 | (started)630 3027 y(with)32 b(`)p Fs(&)p Ft('.)45 b(If)31 |
d3ad40de | 14433 | b Fq(jobsp)s(ec)37 b Ft(is)32 b(not)g(supplied,)f(the)h(curren)m(t)g |
c302751c | 14434 | (job)f(is)h(used.)45 b(The)31 b(return)g(status)630 3137 |
d3ad40de | 14435 | y(is)i(zero)g(unless)f(it)h(is)g(run)e(when)h(job)g(con)m(trol)i(is)f |
c302751c | 14436 | (not)g(enabled,)h(or,)f(when)f(run)f(with)h(job)630 3246 |
d3ad40de CR |
14437 | y(con)m(trol)h(enabled,)g(an)m(y)f Fq(jobsp)s(ec)37 b |
14438 | Ft(w)m(as)32 b(not)g(found)f(or)g(sp)s(eci\014es)h(a)g(job)g(that)g(w)m | |
c302751c CR |
14439 | (as)g(started)630 3356 y(without)e(job)g(con)m(trol.)150 |
14440 | 3514 y Fs(fg)870 3648 y(fg)47 b([)p Fi(jobspec)11 b Fs(])630 | |
14441 | 3782 y Ft(Resume)43 b(the)g(job)g Fq(jobsp)s(ec)48 b | |
d3ad40de | 14442 | Ft(in)43 b(the)g(foreground)g(and)f(mak)m(e)j(it)e(the)h(curren)m(t)f |
c302751c | 14443 | (job.)78 b(If)630 3891 y Fq(jobsp)s(ec)41 b Ft(is)c(not)f(supplied,)h |
37c41ab1 | 14444 | (the)f(curren)m(t)h(job)f(is)g(used.)58 b(The)36 b(return)f(status)h |
c302751c | 14445 | (is)h(that)g(of)630 4001 y(the)d(command)g(placed)h(in)m(to)g(the)f |
37c41ab1 | 14446 | (foreground,)g(or)g(non-zero)h(if)f(run)f(when)g(job)g(con)m(trol)630 |
c302751c | 14447 | 4111 y(is)i(disabled)g(or,)i(when)d(run)g(with)h(job)g(con)m(trol)h |
37c41ab1 | 14448 | (enabled,)h Fq(jobsp)s(ec)j Ft(do)s(es)35 b(not)h(sp)s(ecify)f(a)630 |
c302751c | 14449 | 4220 y(v)-5 b(alid)31 b(job)f(or)g Fq(jobsp)s(ec)35 b |
37c41ab1 | 14450 | Ft(sp)s(eci\014es)30 b(a)h(job)f(that)h(w)m(as)g(started)g(without)f |
c302751c CR |
14451 | (job)g(con)m(trol.)150 4378 y Fs(jobs)870 4512 y(jobs)47 |
14452 | b([-lnprs])e([)p Fi(jobspec)11 b Fs(])870 4622 y(jobs)47 | |
14453 | b(-x)g Fi(command)56 b Fs([)p Fi(arguments)11 b Fs(])630 | |
14454 | 4756 y Ft(The)30 b(\014rst)f(form)h(lists)h(the)g(activ)m(e)h(jobs.)41 | |
37c41ab1 | 14455 | b(The)30 b(options)g(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
c302751c CR |
14456 | 4914 y Fs(-l)384 b Ft(List)31 b(pro)s(cess)f Fl(id)p |
14457 | Ft(s)g(in)g(addition)h(to)g(the)f(normal)h(information.)630 | |
14458 | 5072 y Fs(-n)384 b Ft(Displa)m(y)26 b(information)f(only)h(ab)s(out)e | |
14459 | (jobs)h(that)g(ha)m(v)m(e)i(c)m(hanged)e(status)h(since)1110 | |
14460 | 5182 y(the)31 b(user)e(w)m(as)i(last)g(noti\014ed)f(of)h(their)f | |
14461 | (status.)630 5340 y Fs(-p)384 b Ft(List)31 b(only)f(the)h(pro)s(cess)f | |
14462 | Fl(id)g Ft(of)h(the)f(job's)g(pro)s(cess)g(group)g(leader.)p | |
602bb739 | 14463 | eop end |
9f178efb CR |
14464 | %%Page: 99 105 |
14465 | TeXDict begin 99 104 bop 150 -116 a Ft(Chapter)30 b(7:)41 | |
14466 | b(Job)30 b(Con)m(trol)2571 b(99)630 299 y Fs(-r)384 b | |
122f603c CR |
14467 | Ft(Displa)m(y)32 b(only)e(running)f(jobs.)630 447 y Fs(-s)384 |
14468 | b Ft(Displa)m(y)32 b(only)e(stopp)s(ed)f(jobs.)630 594 | |
14469 | y(If)23 b Fq(jobsp)s(ec)28 b Ft(is)c(giv)m(en,)i(output)d(is)h | |
d3ad40de | 14470 | (restricted)g(to)g(information)g(ab)s(out)f(that)h(job.)39 |
122f603c CR |
14471 | b(If)23 b Fq(jobsp)s(ec)630 704 y Ft(is)30 b(not)h(supplied,)e(the)i |
14472 | (status)g(of)f(all)h(jobs)f(is)h(listed.)630 833 y(If)g(the)g(`)p | |
d3ad40de CR |
14473 | Fs(-x)p Ft(')g(option)h(is)f(supplied,)g Fs(jobs)f Ft(replaces)i(an)m |
14474 | (y)f Fq(jobsp)s(ec)37 b Ft(found)29 b(in)i Fq(command)k | |
122f603c | 14475 | Ft(or)630 942 y Fq(argumen)m(ts)41 b Ft(with)36 b(the)i(corresp)s |
c302751c | 14476 | (onding)d(pro)s(cess)i(group)f Fl(id)p Ft(,)j(and)d(executes)i |
122f603c CR |
14477 | Fq(command)t Ft(,)630 1052 y(passing)30 b(it)h Fq(argumen)m(t)r |
14478 | Ft(s,)g(returning)f(its)g(exit)i(status.)150 1199 y Fs(kill)870 | |
14479 | 1328 y(kill)47 b([-s)g Fi(sigspec)11 b Fs(])45 b([-n)i | |
c302751c | 14480 | Fi(signum)11 b Fs(])45 b([-)p Fi(sigspec)11 b Fs(])44 |
122f603c CR |
14481 | b Fi(jobspec)57 b Fs(or)47 b Fi(pid)870 1438 y Fs(kill)g(-l)g([)p |
14482 | Fi(exit_status)11 b Fs(])630 1566 y Ft(Send)22 b(a)i(signal)g(sp)s | |
d3ad40de CR |
14483 | (eci\014ed)f(b)m(y)g Fq(sigsp)s(ec)29 b Ft(or)24 b Fq(sign)m(um)f |
14484 | Ft(to)h(the)g(pro)s(cess)f(named)g(b)m(y)g(job)g(sp)s(eci\014-)630 | |
122f603c | 14485 | 1676 y(cation)j Fq(jobsp)s(ec)k Ft(or)25 b(pro)s(cess)g |
c302751c CR |
14486 | Fl(id)g Fq(pid)t Ft(.)38 b Fq(sigsp)s(ec)31 b Ft(is)25 |
14487 | b(either)g(a)h(case-insensitiv)m(e)h(signal)f(name)630 | |
122f603c | 14488 | 1785 y(suc)m(h)k(as)h Fs(SIGINT)d Ft(\(with)j(or)f(without)h(the)f |
d3ad40de | 14489 | Fs(SIG)g Ft(pre\014x\))f(or)i(a)f(signal)h(n)m(um)m(b)s(er;)f |
122f603c | 14490 | Fq(sign)m(um)g Ft(is)630 1895 y(a)i(signal)g(n)m(um)m(b)s(er.)43 |
d3ad40de CR |
14491 | b(If)31 b Fq(sigsp)s(ec)37 b Ft(and)31 b Fq(sign)m(um)g |
14492 | Ft(are)h(not)f(presen)m(t,)h Fs(SIGTERM)e Ft(is)h(used.)43 | |
122f603c | 14493 | b(The)630 2005 y(`)p Fs(-l)p Ft(')34 b(option)g(lists)h(the)f(signal)h |
d3ad40de | 14494 | (names.)51 b(If)33 b(an)m(y)i(argumen)m(ts)f(are)g(supplied)f(when)g(`) |
122f603c | 14495 | p Fs(-l)p Ft(')h(is)630 2114 y(giv)m(en,)e(the)g(names)e(of)i(the)f |
37c41ab1 | 14496 | (signals)g(corresp)s(onding)f(to)i(the)f(argumen)m(ts)g(are)h(listed,)g |
122f603c CR |
14497 | (and)630 2224 y(the)c(return)f(status)h(is)g(zero.)41 |
14498 | b Fq(exit)p 1796 2224 28 4 v 41 w(status)32 b Ft(is)c(a)g(n)m(um)m(b)s | |
37c41ab1 | 14499 | (er)f(sp)s(ecifying)g(a)i(signal)f(n)m(um)m(b)s(er)f(or)630 |
122f603c | 14500 | 2333 y(the)35 b(exit)h(status)f(of)g(a)g(pro)s(cess)g(terminated)g(b)m |
37c41ab1 | 14501 | (y)g(a)g(signal.)55 b(The)34 b(return)g(status)h(is)g(zero)630 |
122f603c | 14502 | 2443 y(if)c(at)h(least)g(one)g(signal)f(w)m(as)h(successfully)f(sen)m |
37c41ab1 | 14503 | (t,)h(or)f(non-zero)h(if)f(an)g(error)f(o)s(ccurs)h(or)g(an)630 |
122f603c CR |
14504 | 2553 y(in)m(v)-5 b(alid)31 b(option)g(is)f(encoun)m(tered.)150 |
14505 | 2700 y Fs(wait)870 2829 y(wait)47 b([)p Fi(jobspec)56 | |
14506 | b Fs(or)47 b Fi(pid)57 b Fs(...)o(])630 2958 y Ft(W)-8 | |
14507 | b(ait)28 b(un)m(til)f(the)f(c)m(hild)h(pro)s(cess)f(sp)s(eci\014ed)g(b) | |
14508 | m(y)g(eac)m(h)h(pro)s(cess)f Fl(id)h Fq(pid)i Ft(or)d(job)g(sp)s | |
14509 | (eci\014cation)630 3067 y Fq(jobsp)s(ec)40 b Ft(exits)35 | |
eb2bb562 | 14510 | b(and)f(return)g(the)g(exit)i(status)f(of)g(the)g(last)g(command)f(w)m |
122f603c | 14511 | (aited)i(for.)53 b(If)35 b(a)630 3177 y(job)g(sp)s(ec)f(is)h(giv)m(en,) |
eb2bb562 | 14512 | i(all)f(pro)s(cesses)f(in)f(the)h(job)g(are)g(w)m(aited)h(for.)54 |
122f603c | 14513 | b(If)35 b(no)f(argumen)m(ts)i(are)630 3286 y(giv)m(en,)d(all)f(curren)m |
37c41ab1 | 14514 | (tly)f(activ)m(e)i(c)m(hild)f(pro)s(cesses)f(are)g(w)m(aited)h(for,)g |
122f603c | 14515 | (and)e(the)i(return)e(status)630 3396 y(is)h(zero.)44 |
37c41ab1 CR |
14516 | b(If)30 b(neither)h Fq(jobsp)s(ec)36 b Ft(nor)31 b Fq(pid)i |
14517 | Ft(sp)s(eci\014es)e(an)g(activ)m(e)i(c)m(hild)f(pro)s(cess)e(of)h(the)g | |
122f603c CR |
14518 | (shell,)630 3506 y(the)g(return)e(status)i(is)f(127.)150 |
14519 | 3653 y Fs(disown)870 3782 y(disown)46 b([-ar])g([-h])h([)p | |
14520 | Fi(jobspec)56 b Fs(...)o(])630 3911 y Ft(Without)30 b(options,)f(remo)m | |
14521 | (v)m(e)i(eac)m(h)f Fq(jobsp)s(ec)k Ft(from)28 b(the)h(table)h(of)f | |
14522 | (activ)m(e)i(jobs.)40 b(If)28 b(the)h(`)p Fs(-h)p Ft(')630 | |
14523 | 4020 y(option)36 b(is)f(giv)m(en,)i(the)f(job)f(is)g(not)g(remo)m(v)m | |
14524 | (ed)h(from)f(the)g(table,)j(but)c(is)i(mark)m(ed)f(so)g(that)630 | |
14525 | 4130 y Fs(SIGHUP)e Ft(is)j(not)f(sen)m(t)h(to)g(the)f(job)g(if)g(the)g | |
14526 | (shell)h(receiv)m(es)h(a)e Fs(SIGHUP)p Ft(.)54 b(If)34 | |
14527 | b Fq(jobsp)s(ec)40 b Ft(is)c(not)630 4239 y(presen)m(t,)27 | |
14528 | b(and)f(neither)g(the)g(`)p Fs(-a)p Ft(')g(nor)g(`)p | |
14529 | Fs(-r)p Ft(')g(option)h(is)f(supplied,)g(the)g(curren)m(t)g(job)g(is)g | |
14530 | (used.)630 4349 y(If)i(no)g Fq(jobsp)s(ec)33 b Ft(is)28 | |
14531 | b(supplied,)f(the)i(`)p Fs(-a)p Ft(')f(option)g(means)h(to)f(remo)m(v)m | |
14532 | (e)i(or)e(mark)g(all)h(jobs;)g(the)630 4458 y(`)p Fs(-r)p | |
14533 | Ft(')h(option)h(without)f(a)h Fq(jobsp)s(ec)k Ft(argumen)m(t)c | |
14534 | (restricts)g(op)s(eration)g(to)g(running)e(jobs.)150 | |
14535 | 4606 y Fs(suspend)870 4735 y(suspend)46 b([-f])630 4864 | |
14536 | y Ft(Susp)s(end)31 b(the)i(execution)h(of)g(this)f(shell)g(un)m(til)h | |
14537 | (it)g(receiv)m(es)h(a)e Fs(SIGCONT)f Ft(signal.)50 b(A)33 | |
14538 | b(login)630 4973 y(shell)24 b(cannot)h(b)s(e)e(susp)s(ended;)h(the)g(`) | |
14539 | p Fs(-f)p Ft(')g(option)g(can)h(b)s(e)e(used)g(to)i(o)m(v)m(erride)g | |
14540 | (this)f(and)f(force)630 5083 y(the)31 b(susp)s(ension.)275 | |
14541 | 5230 y(When)f(job)f(con)m(trol)j(is)e(not)h(activ)m(e,)i(the)d | |
14542 | Fs(kill)f Ft(and)h Fs(wait)f Ft(builtins)g(do)h(not)h(accept)h | |
14543 | Fq(jobsp)s(ec)j Ft(argu-)150 5340 y(men)m(ts.)41 b(They)30 | |
14544 | b(m)m(ust)g(b)s(e)g(supplied)f(pro)s(cess)h Fl(id)p Ft(s.)p | |
14545 | eop end | |
9f178efb CR |
14546 | %%Page: 100 106 |
14547 | TeXDict begin 100 105 bop 150 -116 a Ft(100)2527 b(Bash)31 | |
122f603c CR |
14548 | b(Reference)g(Man)m(ual)150 299 y Fr(7.3)68 b(Job)45 |
14549 | b(Con)l(trol)h(V)-11 b(ariables)150 483 y Fs(auto_resume)630 | |
14550 | 593 y Ft(This)31 b(v)-5 b(ariable)32 b(con)m(trols)g(ho)m(w)g(the)f | |
14551 | (shell)h(in)m(teracts)h(with)e(the)h(user)e(and)h(job)g(con)m(trol.)45 | |
14552 | b(If)630 702 y(this)28 b(v)-5 b(ariable)30 b(exists)f(then)f(single)h | |
c302751c | 14553 | (w)m(ord)f(simple)h(commands)f(without)g(redirections)i(are)630 |
122f603c | 14554 | 812 y(treated)h(as)g(candidates)f(for)g(resumption)g(of)g(an)g |
c302751c | 14555 | (existing)h(job.)41 b(There)29 b(is)h(no)h(am)m(biguit)m(y)630 |
122f603c | 14556 | 922 y(allo)m(w)m(ed;)f(if)d(there)g(is)g(more)g(than)f(one)h(job)g(b)s |
c302751c | 14557 | (eginning)f(with)g(the)h(string)g(t)m(yp)s(ed,)g(then)g(the)630 |
122f603c | 14558 | 1031 y(most)j(recen)m(tly)h(accessed)f(job)f(will)h(b)s(e)f(selected.) |
c302751c | 14559 | 42 b(The)29 b(name)g(of)h(a)g(stopp)s(ed)e(job,)i(in)f(this)630 |
122f603c | 14560 | 1141 y(con)m(text,)h(is)e(the)g(command)g(line)g(used)f(to)h(start)g |
c302751c | 14561 | (it.)41 b(If)27 b(this)h(v)-5 b(ariable)28 b(is)g(set)g(to)h(the)e(v)-5 |
122f603c | 14562 | b(alue)630 1250 y(`)p Fs(exact)p Ft(',)33 b(the)g(string)g(supplied)f |
37c41ab1 | 14563 | (m)m(ust)h(matc)m(h)g(the)h(name)f(of)g(a)g(stopp)s(ed)f(job)h |
122f603c | 14564 | (exactly;)j(if)630 1360 y(set)29 b(to)h(`)p Fs(substring)p |
37c41ab1 | 14565 | Ft(',)d(the)i(string)g(supplied)e(needs)i(to)g(matc)m(h)h(a)f |
122f603c | 14566 | (substring)f(of)h(the)g(name)630 1469 y(of)38 b(a)f(stopp)s(ed)g(job.) |
37c41ab1 CR |
14567 | 62 b(The)37 b(`)p Fs(substring)p Ft(')e(v)-5 b(alue)38 |
14568 | b(pro)m(vides)f(functionalit)m(y)i(analogous)g(to)630 | |
122f603c | 14569 | 1579 y(the)f(`)p Fs(\045?)p Ft(')f(job)h Fl(id)f Ft(\(see)i(Section)f |
9f178efb | 14570 | (7.1)h([Job)f(Con)m(trol)g(Basics],)j(page)d(97\).)64 |
122f603c | 14571 | b(If)37 b(set)h(to)h(an)m(y)630 1689 y(other)32 b(v)-5 |
37c41ab1 | 14572 | b(alue,)32 b(the)g(supplied)e(string)i(m)m(ust)f(b)s(e)g(a)h(pre\014x)f |
122f603c | 14573 | (of)h(a)g(stopp)s(ed)e(job's)i(name;)g(this)630 1798 |
37c41ab1 CR |
14574 | y(pro)m(vides)e(functionalit)m(y)i(analogous)g(to)f(the)g(`)p |
14575 | Fs(\045)p Ft(')f(job)g Fl(id)p Ft(.)p eop end | |
9f178efb CR |
14576 | %%Page: 101 107 |
14577 | TeXDict begin 101 106 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
14578 | b(Command)29 b(Line)i(Editing)2062 b(101)150 299 y Fo(8)80 | |
c302751c CR |
14579 | b(Command)54 b(Line)f(Editing)150 640 y Ft(This)28 b(c)m(hapter)i |
14580 | (describ)s(es)e(the)h(basic)g(features)h(of)f(the)g Fl(gnu)f | |
14581 | Ft(command)h(line)g(editing)h(in)m(terface.)42 b(Com-)150 | |
14582 | 749 y(mand)c(line)i(editing)f(is)g(pro)m(vided)g(b)m(y)g(the)g | |
14583 | (Readline)h(library)-8 b(,)41 b(whic)m(h)e(is)g(used)f(b)m(y)h(sev)m | |
14584 | (eral)h(di\013eren)m(t)150 859 y(programs,)34 b(including)e(Bash.)49 | |
14585 | b(Command)32 b(line)i(editing)f(is)g(enabled)g(b)m(y)g(default)g(when)f | |
14586 | (using)h(an)g(in-)150 969 y(teractiv)m(e)c(shell,)f(unless)e(the)h(`)p | |
14587 | Fs(--noediting)p Ft(')d(option)k(is)e(supplied)g(at)h(shell)g(in)m(v)m | |
14588 | (o)s(cation.)42 b(Line)26 b(editing)150 1078 y(is)i(also)h(used)e(when) | |
14589 | h(using)f(the)h(`)p Fs(-e)p Ft(')g(option)h(to)g(the)f | |
14590 | Fs(read)f Ft(builtin)h(command)f(\(see)i(Section)g(4.2)h([Bash)150 | |
9f178efb | 14591 | 1188 y(Builtins],)36 b(page)f(48\).)52 b(By)35 b(default,)g(the)f(line) |
e05be32d CR |
14592 | h(editing)f(commands)g(are)h(similar)f(to)h(those)f(of)g(Emacs.)150 |
14593 | 1297 y(A)h(vi-st)m(yle)h(line)f(editing)g(in)m(terface)h(is)e(also)i(a) | |
c302751c CR |
14594 | m(v)-5 b(ailable.)55 b(Line)34 b(editing)h(can)g(b)s(e)f(enabled)g(at)h |
14595 | (an)m(y)g(time)150 1407 y(using)28 b(the)i(`)p Fs(-o)g(emacs)p | |
14596 | Ft(')d(or)i(`)p Fs(-o)h(vi)p Ft(')f(options)g(to)h(the)f | |
14597 | Fs(set)f Ft(builtin)h(command)g(\(see)h(Section)f(4.3.1)i([The)150 | |
9f178efb | 14598 | 1517 y(Set)g(Builtin],)g(page)g(58\),)h(or)e(disabled)g(using)g(the)h |
c302751c CR |
14599 | (`)p Fs(+o)f(emacs)p Ft(')f(or)h(`)p Fs(+o)g(vi)p Ft(')g(options)h(to)g |
14600 | Fs(set)p Ft(.)150 1802 y Fr(8.1)68 b(In)l(tro)t(duction)45 | |
14601 | b(to)g(Line)h(Editing)150 1962 y Ft(The)30 b(follo)m(wing)i(paragraphs) | |
14602 | d(describ)s(e)h(the)h(notation)g(used)f(to)h(represen)m(t)f(k)m | |
14603 | (eystrok)m(es.)275 2132 y(The)35 b(text)i Fi(C-k)f Ft(is)g(read)g(as)h | |
14604 | (`Con)m(trol-K')g(and)f(describ)s(es)f(the)h(c)m(haracter)i(pro)s | |
14605 | (duced)d(when)g(the)h Fs(k)150 2242 y Ft(k)m(ey)31 b(is)g(pressed)e | |
14606 | (while)h(the)h(Con)m(trol)g(k)m(ey)g(is)g(depressed.)275 | |
14607 | 2412 y(The)g(text)i Fi(M-k)e Ft(is)h(read)f(as)i(`Meta-K')g(and)f | |
14608 | (describ)s(es)f(the)h(c)m(haracter)h(pro)s(duced)e(when)f(the)i(Meta) | |
14609 | 150 2521 y(k)m(ey)i(\(if)f(y)m(ou)h(ha)m(v)m(e)g(one\))g(is)f | |
14610 | (depressed,)g(and)f(the)h Fs(k)g Ft(k)m(ey)h(is)f(pressed.)48 | |
14611 | b(The)32 b(Meta)j(k)m(ey)e(is)h(lab)s(eled)f Fs(ALT)150 | |
14612 | 2631 y Ft(on)c(man)m(y)h(k)m(eyb)s(oards.)40 b(On)29 | |
14613 | b(k)m(eyb)s(oards)g(with)h(t)m(w)m(o)h(k)m(eys)f(lab)s(eled)g | |
14614 | Fs(ALT)e Ft(\(usually)i(to)g(either)g(side)g(of)g(the)150 | |
14615 | 2740 y(space)h(bar\),)f(the)g Fs(ALT)f Ft(on)h(the)g(left)h(side)f(is)g | |
14616 | (generally)h(set)f(to)h(w)m(ork)f(as)g(a)h(Meta)g(k)m(ey)-8 | |
14617 | b(.)42 b(The)29 b Fs(ALT)g Ft(k)m(ey)i(on)150 2850 y(the)c(righ)m(t)h | |
14618 | (ma)m(y)g(also)g(b)s(e)f(con\014gured)f(to)i(w)m(ork)f(as)h(a)f(Meta)i | |
14619 | (k)m(ey)f(or)f(ma)m(y)h(b)s(e)e(con\014gured)h(as)g(some)h(other)150 | |
14620 | 2960 y(mo)s(di\014er,)i(suc)m(h)g(as)g(a)h(Comp)s(ose)f(k)m(ey)h(for)f | |
14621 | (t)m(yping)h(accen)m(ted)h(c)m(haracters.)275 3130 y(If)23 | |
14622 | b(y)m(ou)i(do)f(not)h(ha)m(v)m(e)h(a)f(Meta)g(or)g Fs(ALT)e | |
14623 | Ft(k)m(ey)-8 b(,)27 b(or)e(another)f(k)m(ey)i(w)m(orking)e(as)h(a)g | |
14624 | (Meta)h(k)m(ey)-8 b(,)27 b(the)d(iden)m(tical)150 3239 | |
14625 | y(k)m(eystrok)m(e)30 b(can)f(b)s(e)f(generated)h(b)m(y)g(t)m(yping)g | |
14626 | Fs(ESC)e Fk(\014rst)p Ft(,)j(and)e(then)g(t)m(yping)h | |
14627 | Fs(k)p Ft(.)40 b(Either)28 b(pro)s(cess)g(is)g(kno)m(wn)150 | |
14628 | 3349 y(as)j Fq(metafying)39 b Ft(the)30 b Fs(k)g Ft(k)m(ey)-8 | |
14629 | b(.)275 3519 y(The)39 b(text)j Fi(M-C-k)d Ft(is)h(read)g(as)h | |
14630 | (`Meta-Con)m(trol-k')j(and)39 b(describ)s(es)h(the)g(c)m(haracter)i | |
14631 | (pro)s(duced)d(b)m(y)150 3629 y Fq(metafying)g Fi(C-k)p | |
14632 | Ft(.)275 3799 y(In)c(addition,)j(sev)m(eral)f(k)m(eys)g(ha)m(v)m(e)g | |
14633 | (their)f(o)m(wn)g(names.)58 b(Sp)s(eci\014cally)-8 b(,)38 | |
14634 | b Fs(DEL)p Ft(,)f Fs(ESC)p Ft(,)g Fs(LFD)p Ft(,)g Fs(SPC)p | |
14635 | Ft(,)g Fs(RET)p Ft(,)150 3908 y(and)d Fs(TAB)f Ft(all)j(stand)e(for)g | |
14636 | (themselv)m(es)i(when)d(seen)i(in)f(this)g(text,)j(or)d(in)h(an)f(init) | |
74d0116b | 14637 | h(\014le)f(\(see)i(Section)f(8.3)150 4018 y([Readline)f(Init)g(File],)i |
9f178efb | 14638 | (page)e(104\).)52 b(If)33 b(y)m(our)g(k)m(eyb)s(oard)h(lac)m(ks)g(a)g |
74d0116b CR |
14639 | Fs(LFD)f Ft(k)m(ey)-8 b(,)36 b(t)m(yping)e Fs(C-j)e Ft(will)i(pro)s |
14640 | (duce)150 4128 y(the)d(desired)e(c)m(haracter.)43 b(The)30 | |
14641 | b Fs(RET)f Ft(k)m(ey)i(ma)m(y)g(b)s(e)f(lab)s(eled)h | |
14642 | Fs(Return)d Ft(or)j Fs(Enter)d Ft(on)j(some)g(k)m(eyb)s(oards.)150 | |
c302751c CR |
14643 | 4413 y Fr(8.2)68 b(Readline)47 b(In)l(teraction)150 4573 |
14644 | y Ft(Often)32 b(during)g(an)g(in)m(teractiv)m(e)j(session)e(y)m(ou)g(t) | |
14645 | m(yp)s(e)g(in)f(a)h(long)g(line)g(of)f(text,)j(only)d(to)i(notice)g | |
14646 | (that)f(the)150 4682 y(\014rst)f(w)m(ord)g(on)g(the)g(line)h(is)g | |
37c41ab1 | 14647 | (missp)s(elled.)46 b(The)32 b(Readline)h(library)f(giv)m(es)h(y)m(ou)g |
a9fac3b2 | 14648 | (a)g(set)g(of)f(commands)g(for)150 4792 y(manipulating)e(the)g(text)h |
37c41ab1 CR |
14649 | (as)f(y)m(ou)g(t)m(yp)s(e)g(it)g(in,)g(allo)m(wing)h(y)m(ou)f(to)h |
14650 | (just)e(\014x)g(y)m(our)h(t)m(yp)s(o,)g(and)g(not)g(forcing)150 | |
a9fac3b2 | 14651 | 4902 y(y)m(ou)e(to)h(ret)m(yp)s(e)g(the)f(ma)5 b(jorit)m(y)29 |
37c41ab1 | 14652 | b(of)f(the)h(line.)40 b(Using)28 b(these)h(editing)g(commands,)f(y)m |
a9fac3b2 | 14653 | (ou)h(mo)m(v)m(e)g(the)g(cursor)150 5011 y(to)35 b(the)f(place)i(that)e |
37c41ab1 | 14654 | (needs)g(correction,)j(and)d(delete)h(or)f(insert)h(the)f(text)h(of)g |
c302751c CR |
14655 | (the)f(corrections.)54 b(Then,)150 5121 y(when)24 b(y)m(ou)h(are)g |
14656 | (satis\014ed)g(with)g(the)g(line,)i(y)m(ou)e(simply)f(press)g | |
14657 | Fs(RET)p Ft(.)39 b(Y)-8 b(ou)25 b(do)g(not)g(ha)m(v)m(e)h(to)g(b)s(e)e | |
14658 | (at)h(the)h(end)150 5230 y(of)33 b(the)h(line)g(to)g(press)e | |
14659 | Fs(RET)p Ft(;)i(the)g(en)m(tire)g(line)f(is)h(accepted)g(regardless)g | |
14660 | (of)f(the)h(lo)s(cation)h(of)e(the)h(cursor)150 5340 | |
14661 | y(within)c(the)g(line.)p eop end | |
9f178efb CR |
14662 | %%Page: 102 108 |
14663 | TeXDict begin 102 107 bop 150 -116 a Ft(102)2527 b(Bash)31 | |
c302751c CR |
14664 | b(Reference)g(Man)m(ual)150 299 y Fj(8.2.1)63 b(Readline)40 |
14665 | b(Bare)h(Essen)m(tials)150 446 y Ft(In)31 b(order)h(to)h(en)m(ter)g(c)m | |
14666 | (haracters)g(in)m(to)g(the)g(line,)g(simply)e(t)m(yp)s(e)i(them.)46 | |
14667 | b(The)31 b(t)m(yp)s(ed)h(c)m(haracter)i(app)s(ears)150 | |
14668 | 555 y(where)e(the)h(cursor)e(w)m(as,)j(and)e(then)g(the)h(cursor)e(mo)m | |
14669 | (v)m(es)j(one)f(space)g(to)g(the)g(righ)m(t.)47 b(If)32 | |
14670 | b(y)m(ou)h(mist)m(yp)s(e)g(a)150 665 y(c)m(haracter,)f(y)m(ou)f(can)g | |
14671 | (use)f(y)m(our)g(erase)h(c)m(haracter)h(to)f(bac)m(k)g(up)f(and)f | |
14672 | (delete)j(the)f(mist)m(yp)s(ed)e(c)m(haracter.)275 806 | |
a9fac3b2 CR |
14673 | y(Sometimes)i(y)m(ou)g(ma)m(y)h(mist)m(yp)s(e)e(a)i(c)m(haracter,)g |
14674 | (and)e(not)i(notice)g(the)f(error)f(un)m(til)h(y)m(ou)g(ha)m(v)m(e)h(t) | |
c302751c | 14675 | m(yp)s(ed)150 916 y(sev)m(eral)e(other)f(c)m(haracters.)42 |
a9fac3b2 | 14676 | b(In)28 b(that)i(case,)g(y)m(ou)f(can)g(t)m(yp)s(e)h |
c302751c CR |
14677 | Fi(C-b)d Ft(to)j(mo)m(v)m(e)g(the)f(cursor)g(to)g(the)g(left,)i(and)150 |
14678 | 1026 y(then)f(correct)i(y)m(our)e(mistak)m(e.)42 b(Afterw)m(ards,)31 | |
37c41ab1 | 14679 | b(y)m(ou)f(can)h(mo)m(v)m(e)h(the)e(cursor)g(to)h(the)g(righ)m(t)g |
c302751c | 14680 | (with)f Fi(C-f)p Ft(.)275 1167 y(When)i(y)m(ou)h(add)f(text)h(in)f(the) |
a9fac3b2 | 14681 | h(middle)f(of)h(a)g(line,)h(y)m(ou)e(will)h(notice)h(that)f(c)m |
c302751c | 14682 | (haracters)h(to)g(the)e(righ)m(t)150 1277 y(of)d(the)g(cursor)f(are)h |
5e13499c | 14683 | (`pushed)e(o)m(v)m(er')j(to)g(mak)m(e)f(ro)s(om)g(for)f(the)h(text)h |
37c41ab1 | 14684 | (that)f(y)m(ou)g(ha)m(v)m(e)h(inserted.)40 b(Lik)m(ewise,)150 |
c302751c | 14685 | 1386 y(when)d(y)m(ou)g(delete)i(text)g(b)s(ehind)c(the)j(cursor,)h(c)m |
37c41ab1 | 14686 | (haracters)g(to)f(the)g(righ)m(t)g(of)g(the)g(cursor)e(are)i(`pulled) |
c302751c | 14687 | 150 1496 y(bac)m(k')24 b(to)f(\014ll)g(in)f(the)h(blank)f(space)i |
37c41ab1 | 14688 | (created)f(b)m(y)g(the)g(remo)m(v)-5 b(al)24 b(of)f(the)g(text.)39 |
c302751c | 14689 | b(A)23 b(list)g(of)g(the)g(bare)f(essen)m(tials)150 1605 |
37c41ab1 | 14690 | y(for)30 b(editing)h(the)g(text)g(of)g(an)f(input)f(line)i(follo)m(ws.) |
c302751c CR |
14691 | 150 1775 y Fi(C-b)336 b Ft(Mo)m(v)m(e)32 b(bac)m(k)g(one)e(c)m |
14692 | (haracter.)150 1941 y Fi(C-f)336 b Ft(Mo)m(v)m(e)32 b(forw)m(ard)e(one) | |
14693 | h(c)m(haracter.)150 2108 y Fs(DEL)e Ft(or)i Fs(Backspace)630 | |
14694 | 2217 y Ft(Delete)i(the)d(c)m(haracter)i(to)f(the)g(left)g(of)f(the)h | |
14695 | (cursor.)150 2384 y Fi(C-d)336 b Ft(Delete)33 b(the)d(c)m(haracter)i | |
14696 | (underneath)d(the)i(cursor.)150 2550 y(Prin)m(ting)g(c)m(haracters)630 | |
14697 | 2660 y(Insert)f(the)g(c)m(haracter)i(in)m(to)g(the)e(line)h(at)g(the)g | |
14698 | (cursor.)150 2826 y Fi(C-_)e Ft(or)i Fi(C-x)e(C-u)630 | |
14699 | 2936 y Ft(Undo)k(the)h(last)g(editing)g(command.)50 b(Y)-8 | |
14700 | b(ou)34 b(can)f(undo)g(all)h(the)f(w)m(a)m(y)i(bac)m(k)f(to)g(an)g | |
14701 | (empt)m(y)630 3045 y(line.)150 3215 y(\(Dep)s(ending)29 | |
14702 | b(on)h(y)m(our)f(con\014guration,)i(the)e Fs(Backspace)e | |
14703 | Ft(k)m(ey)k(b)s(e)d(set)j(to)f(delete)h(the)e(c)m(haracter)i(to)g(the) | |
14704 | 150 3324 y(left)37 b(of)f(the)h(cursor)e(and)h(the)g | |
14705 | Fs(DEL)g Ft(k)m(ey)h(set)f(to)h(delete)h(the)e(c)m(haracter)i | |
14706 | (underneath)d(the)h(cursor,)i(lik)m(e)150 3434 y Fi(C-d)p | |
14707 | Ft(,)30 b(rather)g(than)g(the)h(c)m(haracter)h(to)f(the)f(left)h(of)g | |
14708 | (the)f(cursor.\))150 3640 y Fj(8.2.2)63 b(Readline)40 | |
14709 | b(Mo)m(v)m(emen)m(t)h(Commands)150 3787 y Ft(The)27 b(ab)s(o)m(v)m(e)i | |
14710 | (table)g(describ)s(es)e(the)g(most)i(basic)f(k)m(eystrok)m(es)h(that)f | |
14711 | (y)m(ou)g(need)g(in)f(order)g(to)i(do)e(editing)i(of)150 | |
14712 | 3897 y(the)k(input)f(line.)49 b(F)-8 b(or)34 b(y)m(our)f(con)m(v)m | |
14713 | (enience,)j(man)m(y)d(other)g(commands)f(ha)m(v)m(e)j(b)s(een)d(added)g | |
14714 | (in)h(addition)150 4006 y(to)j Fi(C-b)p Ft(,)f Fi(C-f)p | |
14715 | Ft(,)g Fi(C-d)p Ft(,)h(and)e Fs(DEL)p Ft(.)54 b(Here)35 | |
14716 | b(are)g(some)h(commands)e(for)h(mo)m(ving)h(more)f(rapidly)f(ab)s(out)h | |
14717 | (the)150 4116 y(line.)150 4286 y Fi(C-a)336 b Ft(Mo)m(v)m(e)32 | |
14718 | b(to)g(the)e(start)h(of)g(the)f(line.)150 4452 y Fi(C-e)336 | |
14719 | b Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
14720 | 4618 y Fi(M-f)336 b Ft(Mo)m(v)m(e)32 b(forw)m(ard)e(a)h(w)m(ord,)f | |
14721 | (where)g(a)h(w)m(ord)f(is)g(comp)s(osed)g(of)h(letters)h(and)d(digits.) | |
14722 | 150 4785 y Fi(M-b)336 b Ft(Mo)m(v)m(e)32 b(bac)m(kw)m(ard)f(a)g(w)m | |
14723 | (ord.)150 4951 y Fi(C-l)336 b Ft(Clear)31 b(the)f(screen,)h(reprin)m | |
14724 | (ting)f(the)h(curren)m(t)f(line)h(at)g(the)f(top.)275 | |
14725 | 5121 y(Notice)c(ho)m(w)f Fi(C-f)e Ft(mo)m(v)m(es)j(forw)m(ard)e(a)h(c)m | |
14726 | (haracter,)j(while)d Fi(M-f)e Ft(mo)m(v)m(es)j(forw)m(ard)e(a)h(w)m | |
37c41ab1 CR |
14727 | (ord.)39 b(It)24 b(is)h(a)g(lo)s(ose)150 5230 y(con)m(v)m(en)m(tion)32 |
14728 | b(that)f(con)m(trol)g(k)m(eystrok)m(es)h(op)s(erate)e(on)g(c)m | |
14729 | (haracters)h(while)f(meta)h(k)m(eystrok)m(es)h(op)s(erate)e(on)150 | |
14730 | 5340 y(w)m(ords.)p eop end | |
9f178efb CR |
14731 | %%Page: 103 109 |
14732 | TeXDict begin 103 108 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
14733 | b(Command)29 b(Line)i(Editing)2062 b(103)150 299 y Fj(8.2.3)63 | |
c302751c CR |
14734 | b(Readline)40 b(Killing)i(Commands)150 446 y Fq(Killing)35 |
14735 | b Ft(text)28 b(means)e(to)h(delete)h(the)f(text)g(from)g(the)f(line,)i | |
14736 | (but)e(to)h(sa)m(v)m(e)h(it)g(a)m(w)m(a)m(y)g(for)e(later)i(use,)f | |
14737 | (usually)150 555 y(b)m(y)g Fq(y)m(anking)35 b Ft(\(re-inserting\))28 | |
14738 | b(it)g(bac)m(k)f(in)m(to)h(the)f(line.)40 b(\(`Cut')27 | |
14739 | b(and)g(`paste')h(are)f(more)g(recen)m(t)h(jargon)f(for)150 | |
14740 | 665 y(`kill')32 b(and)d(`y)m(ank'.\))275 801 y(If)g(the)i(description)f | |
14741 | (for)g(a)h(command)f(sa)m(ys)g(that)h(it)g(`kills')g(text,)h(then)e(y)m | |
14742 | (ou)g(can)h(b)s(e)e(sure)h(that)h(y)m(ou)150 911 y(can)g(get)g(the)g | |
14743 | (text)g(bac)m(k)g(in)f(a)h(di\013eren)m(t)g(\(or)g(the)f(same\))h | |
14744 | (place)h(later.)275 1047 y(When)23 b(y)m(ou)g(use)g(a)h(kill)g | |
14745 | (command,)g(the)g(text)g(is)f(sa)m(v)m(ed)i(in)e(a)g | |
14746 | Fq(kill-ring)p Ft(.)39 b(An)m(y)24 b(n)m(um)m(b)s(er)e(of)h(consecutiv) | |
14747 | m(e)150 1157 y(kills)31 b(sa)m(v)m(e)i(all)f(of)f(the)g(killed)h(text)g | |
37c41ab1 | 14748 | (together,)g(so)g(that)f(when)f(y)m(ou)h(y)m(ank)h(it)f(bac)m(k,)h(y)m |
c302751c | 14749 | (ou)g(get)g(it)f(all.)43 b(The)150 1267 y(kill)33 b(ring)f(is)g(not)h |
37c41ab1 CR |
14750 | (line)g(sp)s(eci\014c;)g(the)g(text)g(that)g(y)m(ou)g(killed)f(on)h(a)f |
14751 | (previously)g(t)m(yp)s(ed)h(line)f(is)h(a)m(v)-5 b(ailable)150 | |
c302751c CR |
14752 | 1376 y(to)31 b(b)s(e)f(y)m(ank)m(ed)h(bac)m(k)g(later,)h(when)d(y)m(ou) |
14753 | i(are)g(t)m(yping)f(another)h(line.)275 1513 y(Here)f(is)h(the)f(list)h | |
14754 | (of)g(commands)f(for)g(killing)h(text.)150 1675 y Fi(C-k)336 | |
37c41ab1 | 14755 | b Ft(Kill)31 b(the)f(text)i(from)e(the)g(curren)m(t)g(cursor)g(p)s |
c302751c CR |
14756 | (osition)h(to)g(the)f(end)g(of)g(the)h(line.)150 1836 |
14757 | y Fi(M-d)336 b Ft(Kill)27 b(from)f(the)g(cursor)g(to)h(the)f(end)g(of)h | |
37c41ab1 | 14758 | (the)f(curren)m(t)g(w)m(ord,)h(or,)h(if)e(b)s(et)m(w)m(een)h(w)m(ords,) |
c302751c | 14759 | g(to)g(the)630 1946 y(end)j(of)g(the)h(next)f(w)m(ord.)41 |
37c41ab1 | 14760 | b(W)-8 b(ord)30 b(b)s(oundaries)f(are)i(the)g(same)f(as)h(those)g(used) |
c302751c CR |
14761 | f(b)m(y)g Fi(M-f)p Ft(.)150 2107 y Fi(M-DEL)240 b Ft(Kill)31 |
14762 | b(from)f(the)h(cursor)f(the)g(start)h(of)g(the)g(curren)m(t)f(w)m(ord,) | |
14763 | h(or,)f(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)i(the)630 | |
14764 | 2217 y(start)39 b(of)f(the)h(previous)f(w)m(ord.)64 b(W)-8 | |
14765 | b(ord)39 b(b)s(oundaries)e(are)i(the)f(same)h(as)g(those)f(used)g(b)m | |
14766 | (y)630 2326 y Fi(M-b)p Ft(.)150 2487 y Fi(C-w)336 b Ft(Kill)35 | |
14767 | b(from)g(the)g(cursor)f(to)i(the)f(previous)g(whitespace.)55 | |
14768 | b(This)34 b(is)h(di\013eren)m(t)h(than)e Fi(M-DEL)630 | |
14769 | 2597 y Ft(b)s(ecause)c(the)h(w)m(ord)f(b)s(oundaries)f(di\013er.)275 | |
14770 | 2759 y(Here)42 b(is)f(ho)m(w)h(to)g Fq(y)m(ank)47 b Ft(the)42 | |
14771 | b(text)g(bac)m(k)h(in)m(to)f(the)g(line.)74 b(Y)-8 b(anking)43 | |
14772 | b(means)e(to)h(cop)m(y)h(the)e(most-)150 2869 y(recen)m(tly-killed)33 | |
14773 | b(text)e(from)f(the)g(kill)i(bu\013er.)150 3031 y Fi(C-y)336 | |
14774 | b Ft(Y)-8 b(ank)31 b(the)f(most)h(recen)m(tly)h(killed)f(text)g(bac)m | |
14775 | (k)g(in)m(to)h(the)e(bu\013er)g(at)h(the)f(cursor.)150 | |
14776 | 3192 y Fi(M-y)336 b Ft(Rotate)36 b(the)f(kill-ring,)i(and)d(y)m(ank)h | |
14777 | (the)f(new)g(top.)54 b(Y)-8 b(ou)35 b(can)g(only)f(do)h(this)f(if)h | |
14778 | (the)g(prior)630 3302 y(command)30 b(is)h Fi(C-y)e Ft(or)h | |
14779 | Fi(M-y)p Ft(.)150 3503 y Fj(8.2.4)63 b(Readline)40 b(Argumen)m(ts)150 | |
14780 | 3650 y Ft(Y)-8 b(ou)40 b(can)f(pass)g(n)m(umeric)f(argumen)m(ts)i(to)f | |
14781 | (Readline)h(commands.)67 b(Sometimes)39 b(the)g(argumen)m(t)h(acts)150 | |
14782 | 3760 y(as)g(a)h(rep)s(eat)f(coun)m(t,)j(other)e(times)f(it)h(is)f(the)g | |
14783 | Fk(sign)47 b Ft(of)41 b(the)f(argumen)m(t)g(that)h(is)f(signi\014can)m | |
14784 | (t.)71 b(If)40 b(y)m(ou)150 3869 y(pass)33 b(a)h(negativ)m(e)i(argumen) | |
37c41ab1 | 14785 | m(t)e(to)g(a)g(command)f(whic)m(h)g(normally)h(acts)g(in)f(a)h(forw)m |
c302751c | 14786 | (ard)f(direction,)i(that)150 3979 y(command)g(will)h(act)g(in)f(a)h |
37c41ab1 | 14787 | (bac)m(kw)m(ard)f(direction.)57 b(F)-8 b(or)36 b(example,)h(to)f(kill)g |
c302751c | 14788 | (text)g(bac)m(k)g(to)g(the)g(start)g(of)150 4088 y(the)31 |
37c41ab1 | 14789 | b(line,)g(y)m(ou)f(migh)m(t)h(t)m(yp)s(e)g(`)p Fs(M--)f(C-k)p |
c302751c | 14790 | Ft('.)275 4225 y(The)d(general)i(w)m(a)m(y)h(to)e(pass)g(n)m(umeric)g |
37c41ab1 | 14791 | (argumen)m(ts)h(to)g(a)f(command)g(is)g(to)h(t)m(yp)s(e)f(meta)i |
c302751c | 14792 | (digits)e(b)s(efore)150 4334 y(the)j(command.)42 b(If)30 |
37c41ab1 CR |
14793 | b(the)h(\014rst)f(`digit')i(t)m(yp)s(ed)f(is)g(a)g(min)m(us)f(sign)h |
14794 | (\(`)p Fs(-)p Ft('\),)h(then)f(the)g(sign)f(of)h(the)g(argumen)m(t)150 | |
c302751c | 14795 | 4444 y(will)39 b(b)s(e)e(negativ)m(e.)66 b(Once)38 b(y)m(ou)h(ha)m(v)m |
37c41ab1 | 14796 | (e)g(t)m(yp)s(ed)f(one)h(meta)g(digit)g(to)f(get)i(the)e(argumen)m(t)h |
c302751c | 14797 | (started,)i(y)m(ou)150 4554 y(can)29 b(t)m(yp)s(e)g(the)g(remainder)f |
37c41ab1 | 14798 | (of)h(the)g(digits,)h(and)f(then)f(the)h(command.)40 |
c302751c CR |
14799 | b(F)-8 b(or)30 b(example,)g(to)f(giv)m(e)i(the)e Fi(C-d)150 |
14800 | 4663 y Ft(command)37 b(an)g(argumen)m(t)h(of)g(10,)i(y)m(ou)e(could)f | |
37c41ab1 | 14801 | (t)m(yp)s(e)h(`)p Fs(M-1)29 b(0)h(C-d)p Ft(',)39 b(whic)m(h)e(will)h |
c302751c CR |
14802 | (delete)h(the)e(next)h(ten)150 4773 y(c)m(haracters)32 |
14803 | b(on)e(the)h(input)e(line.)150 4974 y Fj(8.2.5)63 b(Searc)m(hing)40 | |
14804 | b(for)i(Commands)g(in)f(the)g(History)150 5121 y Ft(Readline)35 | |
14805 | b(pro)m(vides)f(commands)g(for)g(searc)m(hing)h(through)e(the)i | |
14806 | (command)f(history)g(\(see)h(Section)g(9.1)150 5230 y([Bash)i(History)h | |
9f178efb | 14807 | (F)-8 b(acilities],)42 b(page)37 b(133\))i(for)d(lines)h(con)m(taining) |
c302751c CR |
14808 | i(a)e(sp)s(eci\014ed)f(string.)60 b(There)36 b(are)i(t)m(w)m(o)150 |
14809 | 5340 y(searc)m(h)31 b(mo)s(des:)40 b Fq(incremen)m(tal)35 | |
14810 | b Ft(and)30 b Fq(non-incremen)m(tal)p Ft(.)p eop end | |
9f178efb CR |
14811 | %%Page: 104 110 |
14812 | TeXDict begin 104 109 bop 150 -116 a Ft(104)2527 b(Bash)31 | |
c302751c CR |
14813 | b(Reference)g(Man)m(ual)275 299 y(Incremen)m(tal)26 b(searc)m(hes)h(b)s |
14814 | (egin)e(b)s(efore)g(the)h(user)f(has)h(\014nished)e(t)m(yping)i(the)g | |
14815 | (searc)m(h)g(string.)39 b(As)26 b(eac)m(h)150 408 y(c)m(haracter)37 | |
14816 | b(of)e(the)h(searc)m(h)g(string)f(is)h(t)m(yp)s(ed,)g(Readline)g | |
14817 | (displa)m(ys)g(the)f(next)h(en)m(try)g(from)e(the)i(history)150 | |
14818 | 518 y(matc)m(hing)25 b(the)f(string)g(t)m(yp)s(ed)g(so)g(far.)39 | |
14819 | b(An)23 b(incremen)m(tal)j(searc)m(h)e(requires)g(only)g(as)g(man)m(y)g | |
14820 | (c)m(haracters)i(as)150 628 y(needed)i(to)i(\014nd)d(the)i(desired)f | |
14821 | (history)h(en)m(try)-8 b(.)41 b(T)-8 b(o)29 b(searc)m(h)h(bac)m(kw)m | |
14822 | (ard)f(in)f(the)h(history)g(for)f(a)i(particular)150 | |
14823 | 737 y(string,)g(t)m(yp)s(e)f Fi(C-r)p Ft(.)40 b(T)m(yping)29 | |
14824 | b Fi(C-s)g Ft(searc)m(hes)h(forw)m(ard)f(through)g(the)g(history)-8 | |
14825 | b(.)41 b(The)29 b(c)m(haracters)i(presen)m(t)150 847 | |
14826 | y(in)38 b(the)g(v)-5 b(alue)38 b(of)g(the)g Fs(isearch-terminators)33 | |
14827 | b Ft(v)-5 b(ariable)39 b(are)f(used)f(to)i(terminate)g(an)f(incremen)m | |
14828 | (tal)150 956 y(searc)m(h.)71 b(If)40 b(that)h(v)-5 b(ariable)41 | |
14829 | b(has)f(not)h(b)s(een)e(assigned)i(a)f(v)-5 b(alue,)44 | |
14830 | b(the)c Fs(ESC)g Ft(and)f Fi(C-J)h Ft(c)m(haracters)i(will)150 | |
14831 | 1066 y(terminate)h(an)g(incremen)m(tal)g(searc)m(h.)78 | |
14832 | b Fi(C-g)41 b Ft(will)i(ab)s(ort)f(an)g(incremen)m(tal)i(searc)m(h)f | |
14833 | (and)f(restore)h(the)150 1176 y(original)30 b(line.)41 | |
37c41ab1 | 14834 | b(When)28 b(the)h(searc)m(h)h(is)f(terminated,)h(the)f(history)g(en)m |
c302751c CR |
14835 | (try)g(con)m(taining)h(the)f(searc)m(h)h(string)150 1285 |
14836 | y(b)s(ecomes)h(the)f(curren)m(t)g(line.)275 1428 y(T)-8 | |
37c41ab1 | 14837 | b(o)31 b(\014nd)e(other)j(matc)m(hing)g(en)m(tries)g(in)e(the)h |
c302751c CR |
14838 | (history)g(list,)h(t)m(yp)s(e)g Fi(C-r)e Ft(or)h Fi(C-s)f |
14839 | Ft(as)h(appropriate.)43 b(This)150 1537 y(will)26 b(searc)m(h)h(bac)m | |
37c41ab1 CR |
14840 | (kw)m(ard)g(or)f(forw)m(ard)g(in)f(the)i(history)f(for)g(the)g(next)g |
14841 | (en)m(try)h(matc)m(hing)g(the)f(searc)m(h)h(string)150 | |
c302751c | 14842 | 1647 y(t)m(yp)s(ed)37 b(so)h(far.)63 b(An)m(y)38 b(other)f(k)m(ey)i |
37c41ab1 | 14843 | (sequence)f(b)s(ound)e(to)i(a)g(Readline)h(command)e(will)h(terminate)h |
c302751c CR |
14844 | (the)150 1757 y(searc)m(h)26 b(and)f(execute)i(that)f(command.)39 |
14845 | b(F)-8 b(or)26 b(instance,)h(a)f Fs(RET)f Ft(will)g(terminate)i(the)f | |
14846 | (searc)m(h)g(and)e(accept)150 1866 y(the)30 b(line,)g(thereb)m(y)f | |
14847 | (executing)i(the)e(command)g(from)g(the)h(history)f(list.)41 | |
14848 | b(A)29 b(mo)m(v)m(emen)m(t)j(command)d(will)150 1976 | |
14849 | y(terminate)i(the)g(searc)m(h,)g(mak)m(e)h(the)e(last)h(line)g(found)e | |
14850 | (the)i(curren)m(t)f(line,)h(and)f(b)s(egin)g(editing.)275 | |
14851 | 2119 y(Readline)35 b(remem)m(b)s(ers)f(the)h(last)h(incremen)m(tal)g | |
14852 | (searc)m(h)f(string.)54 b(If)34 b(t)m(w)m(o)j Fi(C-r)p | |
14853 | Ft(s)c(are)i(t)m(yp)s(ed)g(without)150 2228 y(an)m(y)i(in)m(terv)m | |
14854 | (ening)g(c)m(haracters)h(de\014ning)e(a)h(new)f(searc)m(h)h(string,)h | |
14855 | (an)m(y)f(remem)m(b)s(ered)e(searc)m(h)i(string)g(is)150 | |
14856 | 2338 y(used.)275 2480 y(Non-incremen)m(tal)48 b(searc)m(hes)g(read)e | |
14857 | (the)h(en)m(tire)h(searc)m(h)f(string)g(b)s(efore)f(starting)h(to)h | |
14858 | (searc)m(h)f(for)150 2590 y(matc)m(hing)d(history)e(lines.)78 | |
14859 | b(The)42 b(searc)m(h)h(string)g(ma)m(y)g(b)s(e)f(t)m(yp)s(ed)g(b)m(y)g | |
14860 | (the)h(user)f(or)h(b)s(e)f(part)g(of)h(the)150 2700 y(con)m(ten)m(ts)32 | |
14861 | b(of)f(the)f(curren)m(t)g(line.)150 2944 y Fr(8.3)68 | |
14862 | b(Readline)47 b(Init)e(File)150 3104 y Ft(Although)f(the)g(Readline)g | |
14863 | (library)f(comes)i(with)e(a)h(set)h(of)f(Emacs-lik)m(e)h(k)m | |
14864 | (eybindings)f(installed)g(b)m(y)150 3213 y(default,)26 | |
14865 | b(it)g(is)e(p)s(ossible)h(to)g(use)f(a)i(di\013eren)m(t)f(set)g(of)g(k) | |
14866 | m(eybindings.)38 b(An)m(y)25 b(user)f(can)h(customize)h(programs)150 | |
14867 | 3323 y(that)45 b(use)f(Readline)h(b)m(y)f(putting)g(commands)g(in)g(an) | |
14868 | g Fq(inputrc)49 b Ft(\014le,)g(con)m(v)m(en)m(tionally)e(in)d(his)g | |
14869 | (home)150 3433 y(directory)-8 b(.)59 b(The)35 b(name)i(of)f(this)g | |
14870 | (\014le)g(is)g(tak)m(en)h(from)f(the)g(v)-5 b(alue)37 | |
14871 | b(of)f(the)g(shell)h(v)-5 b(ariable)36 b Fs(INPUTRC)p | |
14872 | Ft(.)56 b(If)150 3542 y(that)33 b(v)-5 b(ariable)33 b(is)g(unset,)f | |
14873 | (the)h(default)f(is)h(`)p Fs(~/.inputrc)p Ft('.)44 b(If)32 | |
14874 | b(that)h(\014le)f(do)s(es)g(not)h(exist)g(or)g(cannot)g(b)s(e)150 | |
14875 | 3652 y(read,)e(the)f(ultimate)i(default)e(is)h(`)p Fs(/etc/inputrc)p | |
14876 | Ft('.)275 3794 y(When)e(a)h(program)f(whic)m(h)h(uses)f(the)h(Readline) | |
14877 | g(library)f(starts)h(up,)f(the)h(init)g(\014le)f(is)h(read,)g(and)f | |
14878 | (the)150 3904 y(k)m(ey)i(bindings)e(are)i(set.)275 4047 | |
14879 | y(In)26 b(addition,)i(the)f Fs(C-x)i(C-r)d Ft(command)h(re-reads)g | |
37c41ab1 | 14880 | (this)f(init)h(\014le,)h(th)m(us)f(incorp)s(orating)g(an)m(y)g(c)m |
c302751c CR |
14881 | (hanges)150 4156 y(that)k(y)m(ou)g(migh)m(t)g(ha)m(v)m(e)g(made)g(to)g |
14882 | (it.)150 4364 y Fj(8.3.1)63 b(Readline)40 b(Init)h(File)g(Syn)m(tax)150 | |
14883 | 4511 y Ft(There)f(are)i(only)f(a)g(few)g(basic)g(constructs)h(allo)m(w) | |
14884 | m(ed)h(in)d(the)h(Readline)h(init)f(\014le.)73 b(Blank)41 | |
14885 | b(lines)h(are)150 4620 y(ignored.)72 b(Lines)41 b(b)s(eginning)f(with)h | |
37c41ab1 | 14886 | (a)g(`)p Fs(#)p Ft(')g(are)h(commen)m(ts.)73 b(Lines)41 |
c302751c CR |
14887 | b(b)s(eginning)f(with)g(a)i(`)p Fs($)p Ft(')f(indicate)150 |
14888 | 4730 y(conditional)e(constructs)f(\(see)g(Section)h(8.3.2)g | |
9f178efb | 14889 | ([Conditional)g(Init)e(Constructs],)j(page)e(111\).)64 |
c302751c CR |
14890 | b(Other)150 4839 y(lines)31 b(denote)g(v)-5 b(ariable)31 |
14891 | b(settings)g(and)f(k)m(ey)h(bindings.)150 5011 y(V)-8 | |
14892 | b(ariable)32 b(Settings)630 5121 y(Y)-8 b(ou)41 b(can)g(mo)s(dify)e | |
14893 | (the)i(run-time)f(b)s(eha)m(vior)g(of)h(Readline)g(b)m(y)f(altering)h | |
14894 | (the)g(v)-5 b(alues)41 b(of)630 5230 y(v)-5 b(ariables)34 | |
14895 | b(in)f(Readline)i(using)e(the)g Fs(set)g Ft(command)g(within)g(the)h | |
14896 | (init)g(\014le.)50 b(The)33 b(syn)m(tax)630 5340 y(is)d(simple:)p | |
37c41ab1 | 14897 | eop end |
9f178efb CR |
14898 | %%Page: 105 111 |
14899 | TeXDict begin 105 110 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
14900 | b(Command)29 b(Line)i(Editing)2062 b(105)870 299 y Fs(set)47 | |
eb0b2ad8 | 14901 | b Fi(variable)56 b(value)630 436 y Ft(Here,)29 b(for)e(example,)h(is)g |
c302751c | 14902 | (ho)m(w)f(to)h(c)m(hange)g(from)f(the)g(default)h(Emacs-lik)m(e)h(k)m |
eb0b2ad8 CR |
14903 | (ey)f(binding)e(to)630 545 y(use)k Fs(vi)g Ft(line)h(editing)g |
14904 | (commands:)870 682 y Fs(set)47 b(editing-mode)d(vi)630 | |
14905 | 819 y Ft(V)-8 b(ariable)36 b(names)f(and)g(v)-5 b(alues,)36 | |
c302751c | 14906 | b(where)f(appropriate,)h(are)g(recognized)g(without)f(regard)630 |
eb0b2ad8 CR |
14907 | 929 y(to)c(case.)42 b(Unrecognized)31 b(v)-5 b(ariable)31 |
14908 | b(names)g(are)f(ignored.)630 1066 y(Bo)s(olean)c(v)-5 | |
1c72c0cd CR |
14909 | b(ariables)26 b(\(those)g(that)g(can)f(b)s(e)f(set)i(to)g(on)f(or)g |
14910 | (o\013)7 b(\))25 b(are)h(set)f(to)h(on)f(if)g(the)g(v)-5 | |
eb0b2ad8 | 14911 | b(alue)26 b(is)630 1176 y(n)m(ull)e(or)g(empt)m(y)-8 |
1c72c0cd CR |
14912 | b(,)27 b Fq(on)d Ft(\(case-insensitiv)m(e\),)29 b(or)24 |
14913 | b(1.)39 b(An)m(y)25 b(other)f(v)-5 b(alue)25 b(results)f(in)g(the)g(v) | |
eb0b2ad8 CR |
14914 | -5 b(ariable)630 1285 y(b)s(eing)30 b(set)h(to)g(o\013.)630 |
14915 | 1422 y(The)37 b Fs(bind)30 b(-V)37 b Ft(command)g(lists)i(the)f(curren) | |
1c72c0cd | 14916 | m(t)f(Readline)i(v)-5 b(ariable)38 b(names)g(and)f(v)-5 |
eb0b2ad8 | 14917 | b(alues.)630 1532 y(See)31 b(Section)g(4.2)g([Bash)g(Builtins],)g(page) |
9f178efb | 14918 | g(48.)630 1669 y(A)f(great)i(deal)f(of)g(run-time)f(b)s(eha)m(vior)g |
1c72c0cd | 14919 | (is)g(c)m(hangeable)j(with)d(the)g(follo)m(wing)i(v)-5 |
eb0b2ad8 | 14920 | b(ariables.)630 1833 y Fs(bell-style)1110 1943 y Ft(Con)m(trols)44 |
1c72c0cd | 14921 | b(what)g(happ)s(ens)e(when)h(Readline)i(w)m(an)m(ts)f(to)h(ring)e(the)h |
eb0b2ad8 | 14922 | (termi-)1110 2052 y(nal)37 b(b)s(ell.)61 b(If)37 b(set)h(to)g(`)p |
37c41ab1 | 14923 | Fs(none)p Ft(',)g(Readline)g(nev)m(er)g(rings)e(the)i(b)s(ell.)61 |
eb0b2ad8 | 14924 | b(If)36 b(set)i(to)1110 2162 y(`)p Fs(visible)p Ft(',)32 |
37c41ab1 | 14925 | b(Readline)i(uses)f(a)g(visible)g(b)s(ell)g(if)g(one)g(is)g(a)m(v)-5 |
eb0b2ad8 | 14926 | b(ailable.)51 b(If)33 b(set)g(to)1110 2271 y(`)p Fs(audible)p |
37c41ab1 | 14927 | Ft(')j(\(the)i(default\),)i(Readline)e(attempts)g(to)h(ring)e(the)g |
eb0b2ad8 CR |
14928 | (terminal's)1110 2381 y(b)s(ell.)630 2545 y Fs(bind-tty-special-chars) |
14929 | 1110 2655 y Ft(If)45 b(set)h(to)f(`)p Fs(on)p Ft(',)50 | |
eb2bb562 | 14930 | b(Readline)45 b(attempts)i(to)f(bind)d(the)j(con)m(trol)g(c)m |
eb0b2ad8 | 14931 | (haracters)1110 2765 y(treated)36 b(sp)s(ecially)h(b)m(y)e(the)h(k)m |
eb2bb562 | 14932 | (ernel's)g(terminal)g(driv)m(er)f(to)h(their)f(Readline)1110 |
abe2eb5b CR |
14933 | 2874 y(equiv)-5 b(alen)m(ts.)630 3039 y Fs(colored-stats)1110 |
14934 | 3148 y Ft(If)26 b(set)h(to)g(`)p Fs(on)p Ft(',)h(Readline)f(displa)m | |
14935 | (ys)g(p)s(ossible)f(completions)h(using)f(di\013eren)m(t)1110 | |
14936 | 3258 y(colors)40 b(to)g(indicate)g(their)f(\014le)h(t)m(yp)s(e.)67 | |
14937 | b(The)38 b(color)j(de\014nitions)d(are)i(tak)m(en)1110 | |
14938 | 3367 y(from)24 b(the)h(v)-5 b(alue)25 b(of)g(the)g Fs(LS_COLORS)d | |
14939 | Ft(en)m(vironmen)m(t)j(v)-5 b(ariable.)40 b(The)24 b(default)1110 | |
14940 | 3477 y(is)30 b(`)p Fs(off)p Ft('.)630 3641 y Fs(comment-begin)1110 | |
14941 | 3751 y Ft(The)f(string)g(to)h(insert)f(at)h(the)f(b)s(eginning)g(of)g | |
14942 | (the)h(line)f(when)f(the)i Fs(insert-)1110 3861 y(comment)e | |
37c41ab1 | 14943 | Ft(command)j(is)f(executed.)42 b(The)29 b(default)i(v)-5 |
abe2eb5b CR |
14944 | b(alue)31 b(is)f Fs("#")p Ft(.)630 4025 y Fs(completion-display-width) |
14945 | 1110 4134 y Ft(The)41 b(n)m(um)m(b)s(er)f(of)i(screen)g(columns)f(used) | |
14946 | g(to)h(displa)m(y)g(p)s(ossible)f(matc)m(hes)1110 4244 | |
eb0b2ad8 CR |
14947 | y(when)28 b(p)s(erforming)g(completion.)41 b(The)29 b(v)-5 |
14948 | b(alue)29 b(is)g(ignored)g(if)g(it)h(is)f(less)g(than)1110 | |
abe2eb5b | 14949 | 4354 y(0)e(or)f(greater)h(than)f(the)g(terminal)h(screen)f(width.)39 |
eb0b2ad8 | 14950 | b(A)26 b(v)-5 b(alue)27 b(of)f(0)h(will)f(cause)1110 |
abe2eb5b | 14951 | 4463 y(matc)m(hes)32 b(to)f(b)s(e)e(displa)m(y)m(ed)i(one)g(p)s(er)e |
eb0b2ad8 | 14952 | (line.)41 b(The)30 b(default)h(v)-5 b(alue)31 b(is)f(-1.)630 |
abe2eb5b | 14953 | 4628 y Fs(completion-ignore-case)1110 4737 y Ft(If)d(set)h(to)g(`)p |
eb0b2ad8 | 14954 | Fs(on)p Ft(',)g(Readline)g(p)s(erforms)e(\014lename)h(matc)m(hing)i |
abe2eb5b | 14955 | (and)e(completion)1110 4847 y(in)j(a)h(case-insensitiv)m(e)i(fashion.) |
eb0b2ad8 | 14956 | 40 b(The)30 b(default)h(v)-5 b(alue)30 b(is)h(`)p Fs(off)p |
abe2eb5b | 14957 | Ft('.)630 5011 y Fs(completion-map-case)1110 5121 y Ft(If)22 |
220537f2 | 14958 | b(set)g(to)h(`)p Fs(on)p Ft(',)h(and)e Fq(completion-ignore-case)31 |
abe2eb5b | 14959 | b Ft(is)22 b(enabled,)i(Readline)f(treats)1110 5230 y(h)m(yphens)29 |
220537f2 CR |
14960 | b(\(`)p Fs(-)p Ft('\))j(and)e(underscores)g(\(`)p Fs(_)p |
14961 | Ft('\))i(as)f(equiv)-5 b(alen)m(t)32 b(when)e(p)s(erforming)1110 | |
abe2eb5b CR |
14962 | 5340 y(case-insensitiv)m(e)j(\014lename)d(matc)m(hing)i(and)e |
14963 | (completion.)p eop end | |
9f178efb CR |
14964 | %%Page: 106 112 |
14965 | TeXDict begin 106 111 bop 150 -116 a Ft(106)2527 b(Bash)31 | |
abe2eb5b CR |
14966 | b(Reference)g(Man)m(ual)630 299 y Fs(completion-prefix-displa)o(y-le)o |
14967 | (ngth)1110 408 y Ft(The)g(length)g(in)g(c)m(haracters)i(of)f(the)f | |
14968 | (common)h(pre\014x)e(of)h(a)h(list)g(of)f(p)s(ossible)1110 | |
14969 | 518 y(completions)g(that)f(is)g(displa)m(y)m(ed)g(without)g(mo)s | |
14970 | (di\014cation.)41 b(When)29 b(set)h(to)h(a)1110 628 y(v)-5 | |
14971 | b(alue)26 b(greater)h(than)e(zero,)j(common)e(pre\014xes)e(longer)j | |
14972 | (than)e(this)g(v)-5 b(alue)27 b(are)1110 737 y(replaced)k(with)f(an)g | |
14973 | (ellipsis)h(when)e(displa)m(ying)i(p)s(ossible)f(completions.)630 | |
14974 | 902 y Fs(completion-query-items)1110 1011 y Ft(The)c(n)m(um)m(b)s(er)f | |
14975 | (of)h(p)s(ossible)g(completions)h(that)g(determines)f(when)f(the)i | |
14976 | (user)1110 1121 y(is)i(ask)m(ed)h(whether)f(the)h(list)g(of)f(p)s | |
14977 | (ossibilities)h(should)e(b)s(e)h(displa)m(y)m(ed.)41 | |
14978 | b(If)29 b(the)1110 1230 y(n)m(um)m(b)s(er)d(of)h(p)s(ossible)f | |
14979 | (completions)i(is)f(greater)h(than)e(this)h(v)-5 b(alue,)28 | |
14980 | b(Readline)1110 1340 y(will)f(ask)g(the)f(user)g(whether)g(or)g(not)h | |
14981 | (he)f(wishes)g(to)i(view)e(them;)i(otherwise,)1110 1450 | |
14982 | y(they)d(are)f(simply)g(listed.)40 b(This)23 b(v)-5 b(ariable)25 | |
14983 | b(m)m(ust)g(b)s(e)e(set)i(to)g(an)g(in)m(teger)g(v)-5 | |
14984 | b(alue)1110 1559 y(greater)26 b(than)f(or)f(equal)i(to)f(0.)40 | |
ed35cb4a | 14985 | b(A)24 b(negativ)m(e)j(v)-5 b(alue)26 b(means)e(Readline)i(should)1110 |
abe2eb5b CR |
14986 | 1669 y(nev)m(er)31 b(ask.)41 b(The)29 b(default)i(limit)g(is)g |
14987 | Fs(100)p Ft(.)630 1833 y Fs(convert-meta)1110 1943 y | |
220537f2 CR |
14988 | Ft(If)22 b(set)g(to)h(`)p Fs(on)p Ft(',)h(Readline)f(will)f(con)m(v)m |
14989 | (ert)i(c)m(haracters)f(with)f(the)g(eigh)m(th)h(bit)f(set)1110 | |
abe2eb5b | 14990 | 2052 y(to)33 b(an)e Fl(asci)r(i)h Ft(k)m(ey)h(sequence)f(b)m(y)g |
c302751c | 14991 | (stripping)f(the)h(eigh)m(th)h(bit)f(and)f(pre\014xing)1110 |
abe2eb5b CR |
14992 | 2162 y(an)24 b Fs(ESC)g Ft(c)m(haracter,)j(con)m(v)m(erting)f(them)f |
14993 | (to)g(a)g(meta-pre\014xed)f(k)m(ey)h(sequence.)1110 2271 | |
eb0b2ad8 | 14994 | y(The)30 b(default)g(v)-5 b(alue)31 b(is)g(`)p Fs(on)p |
abe2eb5b | 14995 | Ft('.)630 2436 y Fs(disable-completion)1110 2545 y Ft(If)36 |
eb0b2ad8 | 14996 | b(set)h(to)h(`)p Fs(On)p Ft(',)g(Readline)f(will)g(inhibit)f(w)m(ord)h |
abe2eb5b | 14997 | (completion.)60 b(Completion)1110 2655 y(c)m(haracters)28 |
eb0b2ad8 | 14998 | b(will)e(b)s(e)f(inserted)h(in)m(to)h(the)g(line)f(as)g(if)g(they)h |
abe2eb5b | 14999 | (had)e(b)s(een)g(mapp)s(ed)1110 2765 y(to)31 b Fs(self-insert)p |
eb0b2ad8 | 15000 | Ft(.)38 b(The)30 b(default)g(is)h(`)p Fs(off)p Ft('.)630 |
abe2eb5b | 15001 | 2929 y Fs(editing-mode)1110 3039 y Ft(The)d Fs(editing-mode)e |
eb0b2ad8 | 15002 | Ft(v)-5 b(ariable)29 b(con)m(trols)h(whic)m(h)e(default)h(set)h(of)e(k) |
abe2eb5b | 15003 | m(ey)i(bind-)1110 3148 y(ings)25 b(is)g(used.)38 b(By)26 |
eb0b2ad8 | 15004 | b(default,)g(Readline)g(starts)f(up)f(in)h(Emacs)g(editing)h(mo)s(de,) |
abe2eb5b | 15005 | 1110 3258 y(where)j(the)g(k)m(eystrok)m(es)i(are)e(most)h(similar)f(to) |
eb0b2ad8 | 15006 | h(Emacs.)40 b(This)29 b(v)-5 b(ariable)30 b(can)1110 |
abe2eb5b CR |
15007 | 3367 y(b)s(e)g(set)h(to)g(either)g(`)p Fs(emacs)p Ft(')e(or)h(`)p |
15008 | Fs(vi)p Ft('.)630 3532 y Fs(echo-control-characters)1110 | |
15009 | 3641 y Ft(When)g(set)h(to)g(`)p Fs(on)p Ft(',)f(on)g(op)s(erating)h | |
15010 | (systems)f(that)h(indicate)g(they)g(supp)s(ort)1110 3751 | |
eb0b2ad8 | 15011 | y(it,)i(readline)e(ec)m(ho)s(es)i(a)f(c)m(haracter)h(corresp)s(onding)d |
abe2eb5b CR |
15012 | (to)j(a)f(signal)g(generated)1110 3861 y(from)e(the)g(k)m(eyb)s(oard.) |
15013 | 41 b(The)30 b(default)g(is)h(`)p Fs(on)p Ft('.)630 4025 | |
15014 | y Fs(enable-keypad)1110 4134 y Ft(When)23 b(set)h(to)g(`)p | |
eb0b2ad8 | 15015 | Fs(on)p Ft(',)h(Readline)f(will)g(try)f(to)h(enable)g(the)f |
abe2eb5b | 15016 | (application)i(k)m(eypad)1110 4244 y(when)h(it)h(is)f(called.)41 |
eb0b2ad8 | 15017 | b(Some)27 b(systems)f(need)h(this)f(to)h(enable)g(the)g(arro)m(w)g(k)m |
abe2eb5b CR |
15018 | (eys.)1110 4354 y(The)j(default)g(is)h(`)p Fs(off)p Ft('.)630 |
15019 | 4518 y Fs(enable-meta-key)1110 4628 y Ft(When)40 b(set)g(to)g(`)p | |
eb0b2ad8 | 15020 | Fs(on)p Ft(',)j(Readline)d(will)g(try)g(to)g(enable)g(an)m(y)g(meta)h |
abe2eb5b | 15021 | (mo)s(di\014er)1110 4737 y(k)m(ey)i(the)e(terminal)i(claims)f(to)h |
eb0b2ad8 | 15022 | (supp)s(ort)d(when)h(it)h(is)g(called.)76 b(On)41 b(man)m(y)1110 |
abe2eb5b CR |
15023 | 4847 y(terminals,)c(the)e(meta)h(k)m(ey)g(is)f(used)g(to)h(send)e(eigh) |
15024 | m(t-bit)j(c)m(haracters.)56 b(The)1110 4956 y(default)31 | |
15025 | b(is)f(`)p Fs(on)p Ft('.)630 5121 y Fs(expand-tilde)1110 | |
15026 | 5230 y Ft(If)d(set)h(to)h(`)p Fs(on)p Ft(',)f(tilde)g(expansion)g(is)f | |
15027 | (p)s(erformed)f(when)h(Readline)h(attempts)1110 5340 | |
eb0b2ad8 | 15028 | y(w)m(ord)i(completion.)42 b(The)30 b(default)g(is)h(`)p |
abe2eb5b | 15029 | Fs(off)p Ft('.)p eop end |
9f178efb CR |
15030 | %%Page: 107 113 |
15031 | TeXDict begin 107 112 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15032 | b(Command)29 b(Line)i(Editing)2062 b(107)630 299 y Fs | |
abe2eb5b CR |
15033 | (history-preserve-point)1110 408 y Ft(If)41 b(set)h(to)h(`)p |
15034 | Fs(on)p Ft(',)i(the)c(history)h(co)s(de)g(attempts)h(to)f(place)h(the)f | |
15035 | (p)s(oin)m(t)f(\(the)1110 518 y(curren)m(t)35 b(cursor)g(p)s(osition\)) | |
15036 | g(at)h(the)g(same)f(lo)s(cation)i(on)e(eac)m(h)h(history)g(line)1110 | |
15037 | 628 y(retriev)m(ed)h(with)f Fs(previous-history)c Ft(or)37 | |
15038 | b Fs(next-history)p Ft(.)55 b(The)36 b(default)1110 737 | |
278286c9 CR |
15039 | y(is)30 b(`)p Fs(off)p Ft('.)630 920 y Fs(history-size)1110 |
15040 | 1029 y Ft(Set)39 b(the)g(maxim)m(um)g(n)m(um)m(b)s(er)f(of)h(history)g | |
15041 | (en)m(tries)h(sa)m(v)m(ed)g(in)f(the)g(history)1110 1139 | |
220537f2 CR |
15042 | y(list.)53 b(If)34 b(set)h(to)g(zero,)i(the)d(n)m(um)m(b)s(er)g(of)g |
15043 | (en)m(tries)h(in)f(the)h(history)f(list)h(is)g(not)1110 | |
278286c9 CR |
15044 | 1249 y(limited.)630 1431 y Fs(horizontal-scroll-mode)1110 |
15045 | 1541 y Ft(This)g(v)-5 b(ariable)37 b(can)f(b)s(e)f(set)h(to)h(either)f | |
220537f2 | 15046 | (`)p Fs(on)p Ft(')g(or)g(`)p Fs(off)p Ft('.)57 b(Setting)36 |
278286c9 | 15047 | b(it)g(to)h(`)p Fs(on)p Ft(')1110 1650 y(means)26 b(that)h(the)f(text)h |
eb0b2ad8 | 15048 | (of)g(the)f(lines)g(b)s(eing)g(edited)h(will)f(scroll)h(horizon)m |
278286c9 CR |
15049 | (tally)1110 1760 y(on)32 b(a)g(single)g(screen)g(line)g(when)e(they)i |
15050 | (are)g(longer)h(than)e(the)h(width)f(of)h(the)1110 1870 | |
eb0b2ad8 | 15051 | y(screen,)27 b(instead)g(of)f(wrapping)f(on)m(to)i(a)f(new)g(screen)g |
278286c9 | 15052 | (line.)39 b(By)27 b(default,)g(this)1110 1979 y(v)-5 |
220537f2 | 15053 | b(ariable)31 b(is)g(set)f(to)i(`)p Fs(off)p Ft('.)630 |
278286c9 | 15054 | 2162 y Fs(input-meta)1110 2271 y Ft(If)f(set)g(to)h(`)p |
220537f2 | 15055 | Fs(on)p Ft(',)g(Readline)g(will)f(enable)h(eigh)m(t-bit)h(input)d(\(it) |
278286c9 | 15056 | i(will)f(not)h(clear)1110 2381 y(the)40 b(eigh)m(th)g(bit)g(in)f(the)h |
220537f2 | 15057 | (c)m(haracters)h(it)f(reads\),)j(regardless)c(of)h(what)g(the)1110 |
278286c9 | 15058 | 2491 y(terminal)g(claims)h(it)g(can)f(supp)s(ort.)68 |
220537f2 | 15059 | b(The)39 b(default)h(v)-5 b(alue)40 b(is)g(`)p Fs(off)p |
278286c9 CR |
15060 | Ft('.)69 b(The)1110 2600 y(name)30 b Fs(meta-flag)e Ft(is)j(a)f(synon)m |
15061 | (ym)g(for)g(this)h(v)-5 b(ariable.)630 2783 y Fs(isearch-terminators) | |
15062 | 1110 2892 y Ft(The)51 b(string)h(of)g(c)m(haracters)h(that)f(should)e | |
15063 | (terminate)j(an)f(incremen)m(tal)1110 3002 y(searc)m(h)25 | |
220537f2 | 15064 | b(without)g(subsequen)m(tly)g(executing)h(the)f(c)m(haracter)h(as)f(a)g |
9f178efb CR |
15065 | (command)1110 3112 y(\(see)38 b(Section)g(8.2.5)h([Searc)m(hing],)h |
15066 | (page)e(103\).)62 b(If)37 b(this)g(v)-5 b(ariable)38 | |
15067 | b(has)f(not)1110 3221 y(b)s(een)e(giv)m(en)h(a)g(v)-5 | |
15068 | b(alue,)37 b(the)f(c)m(haracters)h Fs(ESC)d Ft(and)h | |
15069 | Fi(C-J)g Ft(will)h(terminate)g(an)1110 3331 y(incremen)m(tal)c(searc)m | |
15070 | (h.)630 3513 y Fs(keymap)192 b Ft(Sets)39 b(Readline's)g(idea)h(of)f | |
15071 | (the)g(curren)m(t)f(k)m(eymap)h(for)g(k)m(ey)g(binding)f(com-)1110 | |
15072 | 3623 y(mands.)81 b(Acceptable)47 b Fs(keymap)42 b Ft(names)i(are)h | |
15073 | Fs(emacs)p Ft(,)i Fs(emacs-standard)p Ft(,)1110 3733 | |
15074 | y Fs(emacs-meta)p Ft(,)99 b Fs(emacs-ctlx)p Ft(,)f Fs(vi)p | |
15075 | Ft(,)j Fs(vi-move)p Ft(,)f Fs(vi-command)p Ft(,)f(and)1110 | |
15076 | 3842 y Fs(vi-insert)p Ft(.)64 b Fs(vi)38 b Ft(is)h(equiv)-5 | |
15077 | b(alen)m(t)41 b(to)e Fs(vi-command)p Ft(;)i Fs(emacs)c | |
15078 | Ft(is)i(equiv)-5 b(alen)m(t)1110 3952 y(to)33 b Fs(emacs-standard)p | |
15079 | Ft(.)41 b(The)31 b(default)h(v)-5 b(alue)32 b(is)g Fs(emacs)p | |
15080 | Ft(.)44 b(The)31 b(v)-5 b(alue)33 b(of)f(the)1110 4061 | |
15081 | y Fs(editing-mode)27 b Ft(v)-5 b(ariable)31 b(also)h(a\013ects)f(the)g | |
15082 | (default)f(k)m(eymap.)630 4244 y Fs(keyseq-timeout)1110 | |
15083 | 4354 y Ft(Sp)s(eci\014es)25 b(the)g(duration)g(Readline)h(will)g(w)m | |
15084 | (ait)g(for)g(a)f(c)m(haracter)i(when)e(read-)1110 4463 | |
15085 | y(ing)30 b(an)g(am)m(biguous)g(k)m(ey)h(sequence)f(\(one)g(that)h(can)f | |
15086 | (form)g(a)g(complete)h(k)m(ey)1110 4573 y(sequence)24 | |
15087 | b(using)f(the)h(input)f(read)g(so)h(far,)h(or)f(can)g(tak)m(e)h | |
15088 | (additional)g(input)d(to)1110 4682 y(complete)31 b(a)e(longer)h(k)m(ey) | |
15089 | g(sequence\).)41 b(If)28 b(no)h(input)g(is)g(receiv)m(ed)h(within)f | |
15090 | (the)1110 4792 y(timeout,)34 b(Readline)g(will)f(use)f(the)h(shorter)f | |
15091 | (but)g(complete)i(k)m(ey)f(sequence.)1110 4902 y(The)25 | |
15092 | b(v)-5 b(alue)26 b(is)f(sp)s(eci\014ed)f(in)h(milliseconds,)j(so)d(a)h | |
15093 | (v)-5 b(alue)26 b(of)f(1000)i(means)e(that)1110 5011 | |
15094 | y(Readline)e(will)g(w)m(ait)g(one)g(second)f(for)g(additional)i(input.) | |
15095 | 37 b(If)22 b(this)g(v)-5 b(ariable)23 b(is)1110 5121 | |
15096 | y(set)28 b(to)h(a)f(v)-5 b(alue)29 b(less)f(than)g(or)f(equal)i(to)f | |
15097 | (zero,)i(or)e(to)g(a)h(non-n)m(umeric)e(v)-5 b(alue,)1110 | |
15098 | 5230 y(Readline)30 b(will)f(w)m(ait)i(un)m(til)e(another)h(k)m(ey)g(is) | |
15099 | f(pressed)g(to)h(decide)f(whic)m(h)g(k)m(ey)1110 5340 | |
15100 | y(sequence)i(to)g(complete.)42 b(The)30 b(default)g(v)-5 | |
278286c9 | 15101 | b(alue)31 b(is)g Fs(500)p Ft(.)p eop end |
9f178efb CR |
15102 | %%Page: 108 114 |
15103 | TeXDict begin 108 113 bop 150 -116 a Ft(108)2527 b(Bash)31 | |
278286c9 CR |
15104 | b(Reference)g(Man)m(ual)630 299 y Fs(mark-directories)1110 |
15105 | 408 y Ft(If)38 b(set)g(to)h(`)p Fs(on)p Ft(',)i(completed)e(directory)f | |
15106 | (names)g(ha)m(v)m(e)i(a)e(slash)g(app)s(ended.)1110 518 | |
15107 | y(The)30 b(default)g(is)h(`)p Fs(on)p Ft('.)630 676 y | |
15108 | Fs(mark-modified-lines)1110 786 y Ft(This)k(v)-5 b(ariable,)38 | |
15109 | b(when)d(set)h(to)h(`)p Fs(on)p Ft(',)g(causes)g(Readline)f(to)h | |
15110 | (displa)m(y)f(an)f(as-)1110 896 y(terisk)f(\(`)p Fs(*)p | |
15111 | Ft('\))h(at)f(the)g(start)g(of)g(history)g(lines)g(whic)m(h)f(ha)m(v)m | |
15112 | (e)i(b)s(een)e(mo)s(di\014ed.)1110 1005 y(This)d(v)-5 | |
15113 | b(ariable)31 b(is)f(`)p Fs(off)p Ft(')g(b)m(y)g(default.)630 | |
15114 | 1163 y Fs(mark-symlinked-directori)o(es)1110 1273 y Ft(If)44 | |
15115 | b(set)h(to)h(`)p Fs(on)p Ft(',)i(completed)e(names)f(whic)m(h)f(are)h | |
15116 | (sym)m(b)s(olic)g(links)g(to)g(di-)1110 1383 y(rectories)j(ha)m(v)m(e)f | |
15117 | (a)g(slash)f(app)s(ended)e(\(sub)5 b(ject)47 b(to)g(the)f(v)-5 | |
15118 | b(alue)47 b(of)f Fs(mark-)1110 1492 y(directories)p Ft(\).)38 | |
15119 | b(The)30 b(default)g(is)h(`)p Fs(off)p Ft('.)630 1650 | |
15120 | y Fs(match-hidden-files)1110 1760 y Ft(This)21 b(v)-5 | |
15121 | b(ariable,)25 b(when)d(set)g(to)h(`)p Fs(on)p Ft(',)h(causes)f | |
15122 | (Readline)g(to)g(matc)m(h)g(\014les)f(whose)1110 1870 | |
15123 | y(names)44 b(b)s(egin)g(with)g(a)g(`)p Fs(.)p Ft(')g(\(hidden)f | |
15124 | (\014les\))i(when)e(p)s(erforming)g(\014lename)1110 1979 | |
15125 | y(completion.)75 b(If)41 b(set)g(to)h(`)p Fs(off)p Ft(',)i(the)e | |
15126 | (leading)g(`)p Fs(.)p Ft(')f(m)m(ust)g(b)s(e)g(supplied)f(b)m(y)1110 | |
15127 | 2089 y(the)34 b(user)g(in)g(the)g(\014lename)g(to)h(b)s(e)f(completed.) | |
15128 | 53 b(This)33 b(v)-5 b(ariable)35 b(is)f(`)p Fs(on)p Ft(')g(b)m(y)1110 | |
15129 | 2198 y(default.)630 2357 y Fs(menu-complete-display-pr)o(efix)1110 | |
15130 | 2466 y Ft(If)f(set)h(to)g(`)p Fs(on)p Ft(',)h(men)m(u)e(completion)i | |
15131 | (displa)m(ys)e(the)h(common)g(pre\014x)e(of)i(the)1110 | |
15132 | 2576 y(list)k(of)g(p)s(ossible)f(completions)i(\(whic)m(h)e(ma)m(y)h(b) | |
15133 | s(e)f(empt)m(y\))i(b)s(efore)e(cycling)1110 2685 y(through)30 | |
15134 | b(the)g(list.)42 b(The)29 b(default)i(is)f(`)p Fs(off)p | |
15135 | Ft('.)630 2844 y Fs(output-meta)1110 2953 y Ft(If)35 | |
15136 | b(set)h(to)g(`)p Fs(on)p Ft(',)h(Readline)f(will)g(displa)m(y)f(c)m | |
15137 | (haracters)i(with)e(the)h(eigh)m(th)g(bit)1110 3063 y(set)h(directly)g | |
15138 | (rather)f(than)g(as)h(a)g(meta-pre\014xed)f(escap)s(e)h(sequence.)59 | |
15139 | b(The)1110 3173 y(default)31 b(is)f(`)p Fs(off)p Ft('.)630 | |
15140 | 3331 y Fs(page-completions)1110 3440 y Ft(If)j(set)i(to)f(`)p | |
15141 | Fs(on)p Ft(',)h(Readline)g(uses)e(an)h(in)m(ternal)h | |
15142 | Fs(more)p Ft(-lik)m(e)f(pager)g(to)h(displa)m(y)1110 | |
15143 | 3550 y(a)e(screenful)f(of)g(p)s(ossible)g(completions)i(at)f(a)g(time.) | |
eb0b2ad8 | 15144 | 47 b(This)31 b(v)-5 b(ariable)34 b(is)e(`)p Fs(on)p Ft(')1110 |
278286c9 CR |
15145 | 3660 y(b)m(y)e(default.)630 3818 y Fs(print-completions-horizo)o(ntal)o |
15146 | (ly)1110 3927 y Ft(If)23 b(set)i(to)g(`)p Fs(on)p Ft(',)g(Readline)g | |
37c41ab1 | 15147 | (will)f(displa)m(y)g(completions)h(with)f(matc)m(hes)h(sorted)1110 |
278286c9 CR |
15148 | 4037 y(horizon)m(tally)45 b(in)e(alphab)s(etical)i(order,)i(rather)c |
15149 | (than)g(do)m(wn)g(the)h(screen.)1110 4147 y(The)30 b(default)g(is)h(`)p | |
15150 | Fs(off)p Ft('.)630 4305 y Fs(revert-all-at-newline)1110 | |
15151 | 4415 y Ft(If)e(set)h(to)g(`)p Fs(on)p Ft(',)g(Readline)g(will)g(undo)f | |
a8fd3f3e | 15152 | (all)h(c)m(hanges)h(to)f(history)g(lines)f(b)s(efore)1110 |
278286c9 CR |
15153 | 4524 y(returning)f(when)f Fs(accept-line)f Ft(is)j(executed.)41 |
15154 | b(By)29 b(default,)g(history)g(lines)1110 4634 y(ma)m(y)42 | |
a8fd3f3e | 15155 | b(b)s(e)g(mo)s(di\014ed)e(and)h(retain)i(individual)e(undo)g(lists)h |
278286c9 CR |
15156 | (across)g(calls)h(to)1110 4743 y Fs(readline)p Ft(.)38 |
15157 | b(The)30 b(default)h(is)f(`)p Fs(off)p Ft('.)630 4902 | |
15158 | y Fs(show-all-if-ambiguous)1110 5011 y Ft(This)f(alters)i(the)f | |
a8fd3f3e | 15159 | (default)g(b)s(eha)m(vior)g(of)g(the)h(completion)g(functions.)40 |
278286c9 | 15160 | b(If)29 b(set)1110 5121 y(to)f(`)p Fs(on)p Ft(',)g(w)m(ords)f(whic)m(h) |
a8fd3f3e | 15161 | g(ha)m(v)m(e)i(more)f(than)f(one)h(p)s(ossible)f(completion)h(cause) |
278286c9 CR |
15162 | 1110 5230 y(the)39 b(matc)m(hes)h(to)g(b)s(e)e(listed)h(immediately)i |
15163 | (instead)e(of)g(ringing)g(the)g(b)s(ell.)1110 5340 y(The)30 | |
15164 | b(default)g(v)-5 b(alue)31 b(is)g(`)p Fs(off)p Ft('.)p | |
abe2eb5b | 15165 | eop end |
9f178efb CR |
15166 | %%Page: 109 115 |
15167 | TeXDict begin 109 114 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15168 | b(Command)29 b(Line)i(Editing)2062 b(109)630 299 y Fs | |
278286c9 CR |
15169 | (show-all-if-unmodified)1110 408 y Ft(This)38 b(alters)h(the)g(default) |
15170 | g(b)s(eha)m(vior)g(of)f(the)h(completion)h(functions)e(in)h(a)1110 | |
15171 | 518 y(fashion)25 b(similar)g(to)h Fq(sho)m(w-all-if-am)m(biguous)t | |
15172 | Ft(.)41 b(If)24 b(set)i(to)f(`)p Fs(on)p Ft(',)i(w)m(ords)d(whic)m(h) | |
15173 | 1110 628 y(ha)m(v)m(e)32 b(more)f(than)f(one)i(p)s(ossible)e | |
15174 | (completion)i(without)f(an)m(y)g(p)s(ossible)f(par-)1110 | |
15175 | 737 y(tial)43 b(completion)h(\(the)f(p)s(ossible)f(completions)h(don't) | |
15176 | f(share)g(a)h(common)1110 847 y(pre\014x\))30 b(cause)g(the)h(matc)m | |
15177 | (hes)g(to)g(b)s(e)f(listed)g(immediately)i(instead)e(of)h(ring-)1110 | |
15178 | 956 y(ing)g(the)f(b)s(ell.)41 b(The)30 b(default)g(v)-5 | |
15179 | b(alue)31 b(is)f(`)p Fs(off)p Ft('.)630 1117 y Fs(skip-completed-text) | |
15180 | 1110 1226 y Ft(If)i(set)i(to)f(`)p Fs(on)p Ft(',)h(this)f(alters)g(the) | |
15181 | g(default)g(completion)h(b)s(eha)m(vior)f(when)f(in-)1110 | |
15182 | 1336 y(serting)d(a)h(single)g(matc)m(h)f(in)m(to)h(the)g(line.)40 | |
15183 | b(It's)30 b(only)f(activ)m(e)i(when)d(p)s(erform-)1110 | |
15184 | 1445 y(ing)35 b(completion)h(in)e(the)h(middle)f(of)h(a)f(w)m(ord.)53 | |
15185 | b(If)35 b(enabled,)g(readline)g(do)s(es)1110 1555 y(not)41 | |
abe2eb5b | 15186 | b(insert)f(c)m(haracters)i(from)e(the)h(completion)h(that)f(matc)m(h)g |
278286c9 CR |
15187 | (c)m(haracters)1110 1665 y(after)c(p)s(oin)m(t)g(in)g(the)g(w)m(ord)f |
15188 | (b)s(eing)g(completed,)k(so)d(p)s(ortions)f(of)h(the)g(w)m(ord)1110 | |
15189 | 1774 y(follo)m(wing)c(the)f(cursor)f(are)h(not)g(duplicated.)45 | |
abe2eb5b | 15190 | b(F)-8 b(or)32 b(instance,)h(if)f(this)f(is)h(en-)1110 |
278286c9 CR |
15191 | 1884 y(abled,)43 b(attempting)f(completion)g(when)d(the)i(cursor)f(is)g |
15192 | (after)h(the)g(`)p Fs(e)p Ft(')f(in)1110 1993 y(`)p Fs(Makefile)p | |
abe2eb5b | 15193 | Ft(')c(will)i(result)f(in)g(`)p Fs(Makefile)p Ft(')f(rather)h(than)h(`) |
278286c9 | 15194 | p Fs(Makefilefile)p Ft(',)1110 2103 y(assuming)d(there)g(is)h(a)f |
abe2eb5b | 15195 | (single)h(p)s(ossible)f(completion.)56 b(The)35 b(default)g(v)-5 |
278286c9 CR |
15196 | b(alue)1110 2212 y(is)30 b(`)p Fs(off)p Ft('.)630 2373 |
15197 | y Fs(visible-stats)1110 2482 y Ft(If)h(set)i(to)f(`)p | |
abe2eb5b | 15198 | Fs(on)p Ft(',)h(a)f(c)m(haracter)i(denoting)e(a)g(\014le's)g(t)m(yp)s |
278286c9 | 15199 | (e)g(is)g(app)s(ended)e(to)j(the)1110 2592 y(\014lename)e(when)e |
abe2eb5b | 15200 | (listing)i(p)s(ossible)f(completions.)42 b(The)30 b(default)g(is)h(`)p |
278286c9 | 15201 | Fs(off)p Ft('.)150 2752 y(Key)f(Bindings)630 2862 y(The)41 |
abe2eb5b CR |
15202 | b(syn)m(tax)i(for)f(con)m(trolling)h(k)m(ey)g(bindings)e(in)h(the)g |
15203 | (init)g(\014le)g(is)g(simple.)75 b(First)43 b(y)m(ou)630 | |
278286c9 | 15204 | 2971 y(need)27 b(to)i(\014nd)d(the)i(name)f(of)h(the)g(command)f(that)i |
abe2eb5b | 15205 | (y)m(ou)f(w)m(an)m(t)g(to)g(c)m(hange.)41 b(The)27 b(follo)m(wing)630 |
278286c9 | 15206 | 3081 y(sections)37 b(con)m(tain)g(tables)g(of)f(the)g(command)f(name,)j |
abe2eb5b | 15207 | (the)e(default)g(k)m(eybinding,)h(if)f(an)m(y)-8 b(,)630 |
278286c9 CR |
15208 | 3190 y(and)30 b(a)h(short)f(description)g(of)h(what)f(the)g(command)h |
15209 | (do)s(es.)630 3325 y(Once)36 b(y)m(ou)g(kno)m(w)g(the)g(name)g(of)g | |
abe2eb5b | 15210 | (the)g(command,)h(simply)f(place)h(on)e(a)i(line)f(in)g(the)g(init)630 |
278286c9 | 15211 | 3435 y(\014le)e(the)g(name)f(of)h(the)g(k)m(ey)g(y)m(ou)g(wish)f(to)h |
abe2eb5b | 15212 | (bind)f(the)h(command)f(to,)i(a)f(colon,)i(and)d(then)630 |
278286c9 | 15213 | 3544 y(the)f(name)h(of)f(the)g(command.)46 b(There)32 |
220537f2 | 15214 | b(can)g(b)s(e)g(no)g(space)g(b)s(et)m(w)m(een)h(the)f(k)m(ey)h(name)g |
278286c9 | 15215 | (and)630 3654 y(the)41 b(colon)h({)f(that)g(will)g(b)s(e)g(in)m |
220537f2 | 15216 | (terpreted)g(as)g(part)f(of)h(the)g(k)m(ey)h(name.)72 |
278286c9 | 15217 | b(The)40 b(name)h(of)630 3764 y(the)35 b(k)m(ey)g(can)g(b)s(e)f |
eb0b2ad8 | 15218 | (expressed)f(in)i(di\013eren)m(t)g(w)m(a)m(ys,)h(dep)s(ending)d(on)h |
278286c9 CR |
15219 | (what)h(y)m(ou)g(\014nd)e(most)630 3873 y(comfortable.)630 |
15220 | 4008 y(In)i(addition)h(to)h(command)f(names,)i(readline)e(allo)m(ws)h | |
220537f2 | 15221 | (k)m(eys)g(to)g(b)s(e)e(b)s(ound)f(to)j(a)f(string)630 |
278286c9 CR |
15222 | 4118 y(that)31 b(is)f(inserted)h(when)e(the)i(k)m(ey)g(is)f(pressed)g |
15223 | (\(a)h Fq(macro)5 b Ft(\).)630 4253 y(The)42 b Fs(bind)30 | |
220537f2 | 15224 | b(-p)42 b Ft(command)h(displa)m(ys)g(Readline)g(function)g(names)g(and) |
278286c9 | 15225 | f(bindings)g(in)h(a)630 4362 y(format)37 b(that)h(can)f(put)f(directly) |
220537f2 | 15226 | i(in)m(to)g(an)f(initialization)j(\014le.)60 b(See)38 |
9f178efb | 15227 | b(Section)f(4.2)i([Bash)630 4472 y(Builtins],)31 b(page)g(48.)630 |
278286c9 CR |
15228 | 4632 y Fq(k)m(eyname)5 b Ft(:)42 b Fq(function-name)35 |
15229 | b Ft(or)c Fq(macro)1110 4741 y(k)m(eyname)k Ft(is)29 | |
eb0b2ad8 | 15230 | b(the)f(name)h(of)g(a)g(k)m(ey)h(sp)s(elled)e(out)h(in)g(English.)39 |
278286c9 CR |
15231 | b(F)-8 b(or)30 b(example:)1350 4876 y Fs(Control-u:)45 |
15232 | b(universal-argument)1350 4986 y(Meta-Rubout:)f(backward-kill-word)1350 | |
15233 | 5096 y(Control-o:)h(">)i(output")1110 5230 y Ft(In)38 | |
eb0b2ad8 | 15234 | b(the)h(ab)s(o)m(v)m(e)h(example,)h Fi(C-u)d Ft(is)h(b)s(ound)d(to)k |
278286c9 | 15235 | (the)e(function)h Fs(universal-)1110 5340 y(argument)p |
eb0b2ad8 | 15236 | Ft(,)f Fi(M-DEL)e Ft(is)i(b)s(ound)e(to)i(the)g(function)g |
278286c9 | 15237 | Fs(backward-kill-word)p Ft(,)p eop end |
9f178efb CR |
15238 | %%Page: 110 116 |
15239 | TeXDict begin 110 115 bop 150 -116 a Ft(110)2527 b(Bash)31 | |
278286c9 | 15240 | b(Reference)g(Man)m(ual)1110 299 y(and)38 b Fi(C-o)g |
eb0b2ad8 | 15241 | Ft(is)h(b)s(ound)e(to)j(run)d(the)j(macro)f(expressed)g(on)f(the)i |
278286c9 CR |
15242 | (righ)m(t)f(hand)1110 408 y(side)30 b(\(that)i(is,)e(to)h(insert)g(the) |
15243 | f(text)i(`)p Fs(>)e(output)p Ft(')f(in)m(to)i(the)g(line\).)1110 | |
15244 | 543 y(A)37 b(n)m(um)m(b)s(er)f(of)h(sym)m(b)s(olic)g(c)m(haracter)i | |
15245 | (names)e(are)g(recognized)h(while)f(pro-)1110 653 y(cessing)22 | |
eb0b2ad8 CR |
15246 | b(this)g(k)m(ey)g(binding)e(syn)m(tax:)37 b Fq(DEL)p |
15247 | Ft(,)22 b Fq(ESC)8 b Ft(,)20 b Fq(ESCAPE)5 b Ft(,)21 | |
278286c9 | 15248 | b Fq(LFD)5 b Ft(,)22 b Fq(NEW-)1110 763 y(LINE)5 b Ft(,)31 |
eb0b2ad8 CR |
15249 | b Fq(RET)7 b Ft(,)29 b Fq(RETURN)10 b Ft(,)30 b Fq(R)m(UBOUT)7 |
15250 | b Ft(,)31 b Fq(SP)-8 b(A)m(CE)5 b Ft(,)31 b Fq(SPC)8 | |
278286c9 | 15251 | b Ft(,)29 b(and)h Fq(T)-8 b(AB)5 b Ft(.)630 923 y Fs(")p |
eb0b2ad8 | 15252 | Fq(k)m(eyseq)r Fs(")p Ft(:)41 b Fq(function-name)36 b |
278286c9 | 15253 | Ft(or)30 b Fq(macro)1110 1032 y(k)m(eyseq)k Ft(di\013ers)d(from)f |
ed35cb4a | 15254 | Fq(k)m(eyname)37 b Ft(ab)s(o)m(v)m(e)32 b(in)f(that)h(strings)f |
278286c9 | 15255 | (denoting)g(an)g(en-)1110 1142 y(tire)j(k)m(ey)h(sequence)f(can)g(b)s |
a8fd3f3e | 15256 | (e)f(sp)s(eci\014ed,)h(b)m(y)f(placing)i(the)f(k)m(ey)g(sequence)g(in) |
278286c9 | 15257 | 1110 1251 y(double)29 b(quotes.)41 b(Some)29 b Fl(gnu)h |
a8fd3f3e | 15258 | Ft(Emacs)f(st)m(yle)i(k)m(ey)f(escap)s(es)g(can)g(b)s(e)f(used,)g(as) |
278286c9 CR |
15259 | 1110 1361 y(in)k(the)h(follo)m(wing)i(example,)f(but)e(the)h(sp)s |
15260 | (ecial)h(c)m(haracter)g(names)f(are)g(not)1110 1471 y(recognized.)1350 | |
15261 | 1606 y Fs("\\C-u":)46 b(universal-argument)1350 1715 | |
15262 | y("\\C-x\\C-r":)f(re-read-init-file)1350 1825 y("\\e[11~":)g("Function) | |
15263 | h(Key)g(1")1110 1960 y Ft(In)64 b(the)g(ab)s(o)m(v)m(e)i(example,)74 | |
15264 | b Fi(C-u)64 b Ft(is)g(again)i(b)s(ound)c(to)k(the)e(function)1110 | |
15265 | 2069 y Fs(universal-argument)39 b Ft(\(just)k(as)h(it)g(w)m(as)g(in)g | |
15266 | (the)f(\014rst)g(example\),)49 b(`)p Fi(C-x)1110 2179 | |
15267 | y(C-r)p Ft(')30 b(is)g(b)s(ound)e(to)j(the)g(function)f | |
15268 | Fs(re-read-init-file)p Ft(,)c(and)j(`)p Fs(ESC)h([)g(1)g(1)1110 | |
15269 | 2288 y(~)p Ft(')g(is)h(b)s(ound)d(to)j(insert)f(the)h(text)g(`)p | |
15270 | Fs(Function)e(Key)g(1)p Ft('.)630 2449 y(The)g(follo)m(wing)i | |
e05be32d | 15271 | Fl(gnu)f Ft(Emacs)g(st)m(yle)h(escap)s(e)f(sequences)g(are)g(a)m(v)-5 |
278286c9 CR |
15272 | b(ailable)32 b(when)d(sp)s(ecifying)630 2558 y(k)m(ey)i(sequences:)630 |
15273 | 2718 y Fi(\\C-)336 b Ft(con)m(trol)32 b(pre\014x)630 | |
15274 | 2878 y Fi(\\M-)336 b Ft(meta)31 b(pre\014x)630 3039 y | |
abe2eb5b | 15275 | Fi(\\e)384 b Ft(an)30 b(escap)s(e)h(c)m(haracter)630 |
278286c9 | 15276 | 3199 y Fi(\\\\)384 b Ft(bac)m(kslash)630 3359 y Fi(\\)p |
abe2eb5b | 15277 | Fs(")g(")p Ft(,)30 b(a)h(double)f(quotation)i(mark)630 |
278286c9 CR |
15278 | 3519 y Fi(\\')384 b Fs(')p Ft(,)30 b(a)h(single)g(quote)g(or)f(ap)s |
15279 | (ostrophe)630 3679 y(In)d(addition)h(to)g(the)g Fl(gnu)f | |
abe2eb5b | 15280 | Ft(Emacs)h(st)m(yle)h(escap)s(e)f(sequences,)h(a)f(second)f(set)h(of)g |
278286c9 CR |
15281 | (bac)m(kslash)630 3789 y(escap)s(es)j(is)f(a)m(v)-5 b(ailable:)630 |
15282 | 3949 y Fs(\\a)384 b Ft(alert)31 b(\(b)s(ell\))630 4109 | |
15283 | y Fs(\\b)384 b Ft(bac)m(kspace)630 4269 y Fs(\\d)g Ft(delete)630 | |
15284 | 4430 y Fs(\\f)g Ft(form)30 b(feed)630 4590 y Fs(\\n)384 | |
15285 | b Ft(newline)630 4750 y Fs(\\r)g Ft(carriage)32 b(return)630 | |
15286 | 4910 y Fs(\\t)384 b Ft(horizon)m(tal)32 b(tab)630 5070 | |
15287 | y Fs(\\v)384 b Ft(v)m(ertical)32 b(tab)630 5230 y Fs(\\)p | |
eb0b2ad8 CR |
15288 | Fi(nnn)288 b Ft(the)35 b(eigh)m(t-bit)h(c)m(haracter)g(whose)e(v)-5 |
15289 | b(alue)35 b(is)g(the)f(o)s(ctal)i(v)-5 b(alue)35 b Fq(nnn)e | |
278286c9 | 15290 | Ft(\(one)i(to)1110 5340 y(three)c(digits\))p eop end |
9f178efb CR |
15291 | %%Page: 111 117 |
15292 | TeXDict begin 111 116 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15293 | b(Command)29 b(Line)i(Editing)2062 b(111)630 299 y Fs(\\x)p | |
278286c9 CR |
15294 | Fi(HH)288 b Ft(the)40 b(eigh)m(t-bit)h(c)m(haracter)g(whose)e(v)-5 |
15295 | b(alue)39 b(is)h(the)f(hexadecimal)i(v)-5 b(alue)40 b | |
15296 | Fq(HH)1110 408 y Ft(\(one)31 b(or)f(t)m(w)m(o)i(hex)e(digits\))630 | |
15297 | 565 y(When)37 b(en)m(tering)h(the)g(text)g(of)g(a)g(macro,)i(single)e | |
eb0b2ad8 | 15298 | (or)f(double)g(quotes)h(m)m(ust)f(b)s(e)g(used)f(to)630 |
278286c9 | 15299 | 675 y(indicate)23 b(a)e(macro)h(de\014nition.)38 b(Unquoted)21 |
eb0b2ad8 | 15300 | b(text)i(is)e(assumed)g(to)h(b)s(e)f(a)h(function)f(name.)38 |
278286c9 | 15301 | b(In)630 784 y(the)22 b(macro)f(b)s(o)s(dy)-8 b(,)23 |
eb0b2ad8 | 15302 | b(the)e(bac)m(kslash)h(escap)s(es)g(describ)s(ed)e(ab)s(o)m(v)m(e)j |
278286c9 | 15303 | (are)e(expanded.)37 b(Bac)m(kslash)630 894 y(will)j(quote)h(an)m(y)f |
eb0b2ad8 | 15304 | (other)g(c)m(haracter)i(in)d(the)i(macro)f(text,)k(including)39 |
37c41ab1 | 15305 | b(`)p Fs(")p Ft(')h(and)g(`)p Fs(')p Ft('.)69 b(F)-8 |
278286c9 | 15306 | b(or)630 1003 y(example,)28 b(the)e(follo)m(wing)h(binding)d(will)i |
c302751c | 15307 | (mak)m(e)h(`)p Fi(C-x)j Fs(\\)p Ft(')c(insert)f(a)h(single)h(`)p |
278286c9 CR |
15308 | Fs(\\)p Ft(')f(in)m(to)g(the)g(line:)870 1137 y Fs("\\C-x\\\\":)45 |
15309 | b("\\\\")150 1333 y Fj(8.3.2)63 b(Conditional)41 b(Init)g(Constructs) | |
15310 | 150 1480 y Ft(Readline)c(implemen)m(ts)g(a)h(facilit)m(y)g(similar)f | |
15311 | (in)g(spirit)f(to)i(the)f(conditional)h(compilation)g(features)f(of)150 | |
15312 | 1590 y(the)31 b(C)f(prepro)s(cessor)g(whic)m(h)g(allo)m(ws)i(k)m(ey)g | |
15313 | (bindings)d(and)h(v)-5 b(ariable)32 b(settings)f(to)h(b)s(e)e(p)s | |
15314 | (erformed)f(as)i(the)150 1699 y(result)f(of)h(tests.)41 | |
15315 | b(There)30 b(are)h(four)f(parser)f(directiv)m(es)j(used.)150 | |
15316 | 1856 y Fs($if)336 b Ft(The)31 b Fs($if)f Ft(construct)i(allo)m(ws)h | |
15317 | (bindings)d(to)i(b)s(e)e(made)i(based)f(on)g(the)g(editing)h(mo)s(de,)g | |
15318 | (the)630 1966 y(terminal)39 b(b)s(eing)e(used,)j(or)e(the)g | |
15319 | (application)h(using)f(Readline.)64 b(The)38 b(text)h(of)f(the)g(test) | |
15320 | 630 2075 y(extends)30 b(to)h(the)g(end)f(of)g(the)h(line;)g(no)f(c)m | |
15321 | (haracters)i(are)f(required)e(to)i(isolate)i(it.)630 | |
15322 | 2232 y Fs(mode)288 b Ft(The)20 b Fs(mode=)g Ft(form)g(of)h(the)g | |
15323 | Fs($if)f Ft(directiv)m(e)j(is)e(used)f(to)h(test)h(whether)e(Readline) | |
15324 | 1110 2341 y(is)29 b(in)h Fs(emacs)e Ft(or)h Fs(vi)g Ft(mo)s(de.)40 | |
e05be32d | 15325 | b(This)29 b(ma)m(y)h(b)s(e)e(used)h(in)g(conjunction)h(with)f(the)1110 |
278286c9 CR |
15326 | 2451 y(`)p Fs(set)h(keymap)p Ft(')c(command,)i(for)f(instance,)i(to)f |
15327 | (set)g(bindings)f(in)g(the)h Fs(emacs-)1110 2561 y(standard)23 | |
e05be32d | 15328 | b Ft(and)h Fs(emacs-ctlx)f Ft(k)m(eymaps)i(only)g(if)g(Readline)h(is)f |
278286c9 CR |
15329 | (starting)h(out)1110 2670 y(in)k Fs(emacs)f Ft(mo)s(de.)630 |
15330 | 2827 y Fs(term)288 b Ft(The)26 b Fs(term=)g Ft(form)g(ma)m(y)i(b)s(e)e | |
e05be32d | 15331 | (used)g(to)i(include)f(terminal-sp)s(eci\014c)g(k)m(ey)h(bind-)1110 |
278286c9 CR |
15332 | 2936 y(ings,)38 b(p)s(erhaps)c(to)j(bind)e(the)h(k)m(ey)h(sequences)f |
15333 | (output)g(b)m(y)g(the)g(terminal's)1110 3046 y(function)24 | |
d3ad40de | 15334 | b(k)m(eys.)39 b(The)23 b(w)m(ord)h(on)f(the)i(righ)m(t)f(side)g(of)g |
278286c9 | 15335 | (the)g(`)p Fs(=)p Ft(')g(is)g(tested)h(against)1110 3156 |
d3ad40de | 15336 | y(b)s(oth)k(the)h(full)g(name)g(of)g(the)g(terminal)h(and)e(the)i(p)s |
278286c9 | 15337 | (ortion)e(of)h(the)g(terminal)1110 3265 y(name)k(b)s(efore)f(the)g |
d3ad40de CR |
15338 | (\014rst)g(`)p Fs(-)p Ft('.)50 b(This)33 b(allo)m(ws)i |
15339 | Fs(sun)e Ft(to)h(matc)m(h)g(b)s(oth)f Fs(sun)g Ft(and)1110 | |
278286c9 CR |
15340 | 3375 y Fs(sun-cmd)p Ft(,)c(for)h(instance.)630 3531 y |
15341 | Fs(application)1110 3641 y Ft(The)21 b Fq(application)j | |
220537f2 | 15342 | Ft(construct)e(is)g(used)f(to)i(include)f(application-sp)s(eci\014c)h |
278286c9 | 15343 | (set-)1110 3751 y(tings.)39 b(Eac)m(h)26 b(program)e(using)g(the)h |
220537f2 | 15344 | (Readline)g(library)g(sets)g(the)g Fq(application)1110 |
278286c9 | 15345 | 3860 y(name)5 b Ft(,)25 b(and)d(y)m(ou)h(can)g(test)h(for)e(a)h |
220537f2 | 15346 | (particular)h(v)-5 b(alue.)38 b(This)22 b(could)h(b)s(e)f(used)g(to) |
278286c9 | 15347 | 1110 3970 y(bind)32 b(k)m(ey)h(sequences)g(to)h(functions)e(useful)g |
220537f2 | 15348 | (for)h(a)g(sp)s(eci\014c)f(program.)48 b(F)-8 b(or)1110 |
278286c9 CR |
15349 | 4079 y(instance,)35 b(the)e(follo)m(wing)h(command)f(adds)f(a)i(k)m(ey) |
15350 | f(sequence)h(that)f(quotes)1110 4189 y(the)e(curren)m(t)f(or)g | |
15351 | (previous)g(w)m(ord)g(in)g(Bash:)1350 4322 y Fs($if)47 | |
15352 | b(Bash)1350 4432 y(#)g(Quote)g(the)g(current)f(or)h(previous)e(word) | |
15353 | 1350 4541 y("\\C-xq":)h("\\eb\\"\\ef\\"")1350 4651 y($endif)150 | |
15354 | 4807 y($endif)192 b Ft(This)29 b(command,)i(as)f(seen)h(in)f(the)g | |
220537f2 | 15355 | (previous)g(example,)h(terminates)g(an)g Fs($if)e Ft(command.)150 |
278286c9 | 15356 | 4964 y Fs($else)240 b Ft(Commands)29 b(in)h(this)h(branc)m(h)e(of)i |
220537f2 | 15357 | (the)f Fs($if)g Ft(directiv)m(e)i(are)f(executed)g(if)f(the)h(test)g |
278286c9 | 15358 | (fails.)150 5121 y Fs($include)96 b Ft(This)43 b(directiv)m(e)i(tak)m |
220537f2 | 15359 | (es)g(a)e(single)i(\014lename)e(as)h(an)f(argumen)m(t)h(and)f(reads)g |
278286c9 | 15360 | (commands)630 5230 y(and)38 b(bindings)f(from)h(that)i(\014le.)65 |
37c41ab1 | 15361 | b(F)-8 b(or)39 b(example,)j(the)d(follo)m(wing)h(directiv)m(e)g(reads)e |
278286c9 | 15362 | (from)630 5340 y(`)p Fs(/etc/inputrc)p Ft(':)p eop end |
9f178efb CR |
15363 | %%Page: 112 118 |
15364 | TeXDict begin 112 117 bop 150 -116 a Ft(112)2527 b(Bash)31 | |
278286c9 CR |
15365 | b(Reference)g(Man)m(ual)870 299 y Fs($include)46 b(/etc/inputrc)150 |
15366 | 498 y Fj(8.3.3)63 b(Sample)41 b(Init)g(File)150 645 y | |
15367 | Ft(Here)27 b(is)f(an)h(example)g(of)f(an)h Fq(inputrc)k | |
15368 | Ft(\014le.)39 b(This)26 b(illustrates)h(k)m(ey)h(binding,)e(v)-5 | |
15369 | b(ariable)27 b(assignmen)m(t,)i(and)150 755 y(conditional)j(syn)m(tax.) | |
15370 | p eop end | |
9f178efb CR |
15371 | %%Page: 113 119 |
15372 | TeXDict begin 113 118 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15373 | b(Command)29 b(Line)i(Editing)2062 b(113)390 408 y Fs(#)47 | |
278286c9 CR |
15374 | b(This)g(file)g(controls)e(the)i(behaviour)e(of)j(line)e(input)h |
15375 | (editing)e(for)390 518 y(#)i(programs)f(that)h(use)g(the)f(GNU)h | |
15376 | (Readline)f(library.)93 b(Existing)390 628 y(#)47 b(programs)f(include) | |
15377 | g(FTP,)g(Bash,)h(and)g(GDB.)390 737 y(#)390 847 y(#)g(You)g(can)g | |
15378 | (re-read)f(the)h(inputrc)f(file)g(with)h(C-x)g(C-r.)390 | |
15379 | 956 y(#)g(Lines)g(beginning)e(with)i('#')g(are)g(comments.)390 | |
15380 | 1066 y(#)390 1176 y(#)g(First,)g(include)e(any)i(systemwide)e(bindings) | |
15381 | h(and)h(variable)390 1285 y(#)g(assignments)e(from)i(/etc/Inputrc)390 | |
15382 | 1395 y($include)f(/etc/Inputrc)390 1614 y(#)390 1724 | |
15383 | y(#)h(Set)g(various)f(bindings)g(for)h(emacs)f(mode.)390 | |
15384 | 1943 y(set)h(editing-mode)d(emacs)390 2162 y($if)j(mode=emacs)390 | |
5e13499c CR |
15385 | 2381 y(Meta-Control-h:)91 b(backward-kill-word)43 b(Text)k(after)f(the) |
15386 | h(function)f(name)g(is)h(ignored)390 2600 y(#)390 2710 | |
15387 | y(#)g(Arrow)g(keys)f(in)i(keypad)e(mode)390 2819 y(#)390 | |
15388 | 2929 y(#"\\M-OD":)379 b(backward-char)390 3039 y(#"\\M-OC":)g | |
15389 | (forward-char)390 3148 y(#"\\M-OA":)g(previous-history)390 | |
15390 | 3258 y(#"\\M-OB":)g(next-history)390 3367 y(#)390 3477 | |
15391 | y(#)47 b(Arrow)g(keys)f(in)i(ANSI)e(mode)390 3587 y(#)390 | |
15392 | 3696 y("\\M-[D":)380 b(backward-char)390 3806 y("\\M-[C":)g | |
15393 | (forward-char)390 3915 y("\\M-[A":)g(previous-history)390 | |
15394 | 4025 y("\\M-[B":)g(next-history)390 4134 y(#)390 4244 | |
15395 | y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(keypad)f(mode)390 | |
15396 | 4354 y(#)390 4463 y(#"\\M-\\C-OD":)331 b(backward-char)390 | |
15397 | 4573 y(#"\\M-\\C-OC":)g(forward-char)390 4682 y(#"\\M-\\C-OA":)g | |
15398 | (previous-history)390 4792 y(#"\\M-\\C-OB":)g(next-history)390 | |
15399 | 4902 y(#)390 5011 y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(ANSI)g(mode) | |
15400 | 390 5121 y(#)390 5230 y(#"\\M-\\C-[D":)331 b(backward-char)390 | |
37c41ab1 | 15401 | 5340 y(#"\\M-\\C-[C":)g(forward-char)p eop end |
9f178efb CR |
15402 | %%Page: 114 120 |
15403 | TeXDict begin 114 119 bop 150 -116 a Ft(114)2527 b(Bash)31 | |
278286c9 CR |
15404 | b(Reference)g(Man)m(ual)390 299 y Fs(#"\\M-\\C-[A":)331 |
15405 | b(previous-history)390 408 y(#"\\M-\\C-[B":)g(next-history)390 | |
37c41ab1 CR |
15406 | 628 y(C-q:)47 b(quoted-insert)390 847 y($endif)390 1066 |
15407 | y(#)g(An)h(old-style)d(binding.)93 b(This)47 b(happens)f(to)h(be)g(the) | |
15408 | g(default.)390 1176 y(TAB:)g(complete)390 1395 y(#)g(Macros)g(that)f | |
15409 | (are)h(convenient)e(for)i(shell)f(interaction)390 1504 | |
15410 | y($if)h(Bash)390 1614 y(#)g(edit)g(the)g(path)390 1724 | |
15411 | y("\\C-xp":)f("PATH=${PATH}\\e\\C-e\\C-a)o(\\ef)o(\\C-f)o(")390 | |
15412 | 1833 y(#)h(prepare)f(to)h(type)g(a)h(quoted)e(word)g(--)390 | |
5e13499c CR |
15413 | 1943 y(#)h(insert)g(open)f(and)h(close)f(double)h(quotes)390 |
15414 | 2052 y(#)g(and)g(move)g(to)g(just)g(after)f(the)h(open)g(quote)390 | |
15415 | 2162 y("\\C-x\\"":)e("\\"\\"\\C-b")390 2271 y(#)i(insert)g(a)g | |
15416 | (backslash)e(\(testing)h(backslash)f(escapes)390 2381 | |
15417 | y(#)i(in)h(sequences)d(and)i(macros\))390 2491 y("\\C-x\\\\":)e("\\\\") | |
15418 | 390 2600 y(#)i(Quote)g(the)g(current)f(or)h(previous)e(word)390 | |
15419 | 2710 y("\\C-xq":)h("\\eb\\"\\ef\\"")390 2819 y(#)h(Add)g(a)h(binding)e | |
15420 | (to)h(refresh)f(the)h(line,)f(which)g(is)h(unbound)390 | |
15421 | 2929 y("\\C-xr":)f(redraw-current-line)390 3039 y(#)h(Edit)g(variable)f | |
15422 | (on)h(current)f(line.)390 3148 y("\\M-\\C-v":)f | |
15423 | ("\\C-a\\C-k$\\C-y\\M-\\C-e\\C-)o(a\\C-)o(y=")390 3258 | |
15424 | y($endif)390 3477 y(#)i(use)g(a)h(visible)e(bell)g(if)h(one)g(is)h | |
15425 | (available)390 3587 y(set)f(bell-style)e(visible)390 | |
15426 | 3806 y(#)i(don't)g(strip)f(characters)f(to)i(7)h(bits)e(when)h(reading) | |
15427 | 390 3915 y(set)g(input-meta)e(on)390 4134 y(#)i(allow)g(iso-latin1)e | |
15428 | (characters)g(to)i(be)g(inserted)f(rather)390 4244 y(#)h(than)g | |
15429 | (converted)e(to)j(prefix-meta)c(sequences)390 4354 y(set)j | |
15430 | (convert-meta)d(off)390 4573 y(#)j(display)f(characters)f(with)i(the)g | |
15431 | (eighth)f(bit)h(set)g(directly)390 4682 y(#)g(rather)g(than)f(as)h | |
15432 | (meta-prefixed)e(characters)390 4792 y(set)i(output-meta)e(on)390 | |
15433 | 5011 y(#)i(if)h(there)e(are)h(more)g(than)f(150)h(possible)f | |
15434 | (completions)e(for)390 5121 y(#)j(a)h(word,)e(ask)h(the)g(user)g(if)g | |
15435 | (he)g(wants)f(to)i(see)f(all)f(of)i(them)390 5230 y(set)f | |
37c41ab1 | 15436 | (completion-query-items)42 b(150)p eop end |
9f178efb CR |
15437 | %%Page: 115 121 |
15438 | TeXDict begin 115 120 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15439 | b(Command)29 b(Line)i(Editing)2062 b(115)390 299 y Fs(#)47 | |
278286c9 | 15440 | b(For)g(FTP)390 408 y($if)g(Ftp)390 518 y("\\C-xg":)f("get)g(\\M-?")390 |
5e13499c | 15441 | 628 y("\\C-xt":)g("put)g(\\M-?")390 737 y("\\M-.":)g(yank-last-arg)390 |
c302751c CR |
15442 | 847 y($endif)150 1075 y Fr(8.4)68 b(Bindable)45 b(Readline)i(Commands) |
15443 | 150 1235 y Ft(This)32 b(section)h(describ)s(es)f(Readline)h(commands)f | |
15444 | (that)h(ma)m(y)h(b)s(e)d(b)s(ound)g(to)i(k)m(ey)g(sequences.)48 | |
15445 | b(Y)-8 b(ou)33 b(can)150 1344 y(list)40 b(y)m(our)f(k)m(ey)i(bindings)d | |
15446 | (b)m(y)h(executing)i Fs(bind)29 b(-P)39 b Ft(or,)j(for)d(a)h(more)g | |
15447 | (terse)g(format,)i(suitable)e(for)f(an)150 1454 y Fq(inputrc)34 | |
37c41ab1 | 15448 | b Ft(\014le,)29 b Fs(bind)g(-p)p Ft(.)40 b(\(See)30 b(Section)f(4.2)h |
9f178efb | 15449 | ([Bash)g(Builtins],)g(page)g(48.\))41 b(Command)28 b(names)h(without) |
c302751c CR |
15450 | 150 1563 y(an)h(accompan)m(ying)i(k)m(ey)f(sequence)g(are)g(un)m(b)s |
15451 | (ound)d(b)m(y)i(default.)275 1696 y(In)25 b(the)h(follo)m(wing)i | |
37c41ab1 CR |
15452 | (descriptions,)f Fq(p)s(oin)m(t)h Ft(refers)e(to)h(the)f(curren)m(t)g |
15453 | (cursor)g(p)s(osition,)h(and)f Fq(mark)31 b Ft(refers)150 | |
c302751c | 15454 | 1805 y(to)40 b(a)f(cursor)f(p)s(osition)h(sa)m(v)m(ed)h(b)m(y)f(the)g |
5e13499c | 15455 | Fs(set-mark)d Ft(command.)66 b(The)38 b(text)i(b)s(et)m(w)m(een)g(the)f |
c302751c CR |
15456 | (p)s(oin)m(t)g(and)150 1915 y(mark)30 b(is)h(referred)e(to)i(as)g(the)f |
15457 | Fq(region)p Ft(.)150 2110 y Fj(8.4.1)63 b(Commands)42 | |
15458 | b(F)-10 b(or)41 b(Mo)m(ving)150 2280 y Fs(beginning-of-line)26 | |
15459 | b(\(C-a\))630 2390 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f | |
15460 | (curren)m(t)g(line.)150 2545 y Fs(end-of-line)d(\(C-e\))630 | |
15461 | 2655 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
15462 | 2810 y Fs(forward-char)c(\(C-f\))630 2920 y Ft(Mo)m(v)m(e)32 | |
15463 | b(forw)m(ard)e(a)h(c)m(haracter.)150 3075 y Fs(backward-char)c(\(C-b\)) | |
15464 | 630 3185 y Ft(Mo)m(v)m(e)32 b(bac)m(k)g(a)e(c)m(haracter.)150 | |
15465 | 3340 y Fs(forward-word)d(\(M-f\))630 3450 y Ft(Mo)m(v)m(e)32 | |
5e13499c | 15466 | b(forw)m(ard)e(to)h(the)f(end)g(of)g(the)h(next)f(w)m(ord.)41 |
37c41ab1 | 15467 | b(W)-8 b(ords)30 b(are)h(comp)s(osed)f(of)g(letters)i(and)630 |
c302751c CR |
15468 | 3559 y(digits.)150 3715 y Fs(backward-word)27 b(\(M-b\))630 |
15469 | 3824 y Ft(Mo)m(v)m(e)36 b(bac)m(k)e(to)g(the)g(start)g(of)g(the)g | |
37c41ab1 | 15470 | (curren)m(t)f(or)g(previous)g(w)m(ord.)50 b(W)-8 b(ords)34 |
c302751c CR |
15471 | b(are)g(comp)s(osed)630 3934 y(of)d(letters)g(and)f(digits.)150 |
15472 | 4089 y Fs(shell-forward-word)25 b(\(\))630 4199 y Ft(Mo)m(v)m(e)30 | |
a9fac3b2 CR |
15473 | b(forw)m(ard)e(to)h(the)f(end)f(of)h(the)h(next)f(w)m(ord.)40 |
15474 | b(W)-8 b(ords)28 b(are)g(delimited)h(b)m(y)f(non-quoted)630 | |
c302751c CR |
15475 | 4308 y(shell)j(metac)m(haracters.)150 4464 y Fs(shell-backward-word)25 |
15476 | b(\(\))630 4573 y Ft(Mo)m(v)m(e)37 b(bac)m(k)e(to)h(the)f(start)g(of)g | |
a9fac3b2 | 15477 | (the)g(curren)m(t)g(or)f(previous)h(w)m(ord.)53 b(W)-8 |
c302751c CR |
15478 | b(ords)35 b(are)g(delimited)630 4683 y(b)m(y)30 b(non-quoted)h(shell)f |
15479 | (metac)m(haracters.)150 4838 y Fs(clear-screen)d(\(C-l\))630 | |
15480 | 4948 y Ft(Clear)g(the)g(screen)f(and)h(redra)m(w)f(the)h(curren)m(t)f | |
a9fac3b2 | 15481 | (line,)i(lea)m(ving)g(the)f(curren)m(t)g(line)g(at)g(the)g(top)630 |
c302751c CR |
15482 | 5057 y(of)k(the)f(screen.)150 5213 y Fs(redraw-current-line)25 |
15483 | b(\(\))630 5322 y Ft(Refresh)30 b(the)g(curren)m(t)h(line.)41 | |
15484 | b(By)30 b(default,)h(this)f(is)h(un)m(b)s(ound.)p eop | |
15485 | end | |
9f178efb CR |
15486 | %%Page: 116 122 |
15487 | TeXDict begin 116 121 bop 150 -116 a Ft(116)2527 b(Bash)31 | |
278286c9 CR |
15488 | b(Reference)g(Man)m(ual)150 299 y Fj(8.4.2)63 b(Commands)42 |
15489 | b(F)-10 b(or)41 b(Manipulating)h(The)f(History)150 473 | |
15490 | y Fs(accept-line)27 b(\(Newline)h(or)i(Return\))630 582 | |
15491 | y Ft(Accept)25 b(the)e(line)h(regardless)g(of)f(where)g(the)h(cursor)e | |
15492 | (is.)39 b(If)23 b(this)g(line)h(is)f(non-empt)m(y)-8 | |
c302751c CR |
15493 | b(,)26 b(add)c(it)630 692 y(to)27 b(the)f(history)g(list)h(according)g |
15494 | (to)g(the)f(setting)i(of)e(the)g Fs(HISTCONTROL)d Ft(and)j | |
15495 | Fs(HISTIGNORE)630 802 y Ft(v)-5 b(ariables.)42 b(If)30 | |
15496 | b(this)h(line)g(is)g(a)g(mo)s(di\014ed)e(history)i(line,)g(then)f | |
15497 | (restore)i(the)f(history)f(line)h(to)630 911 y(its)g(original)g(state.) | |
15498 | 150 1075 y Fs(previous-history)26 b(\(C-p\))630 1184 | |
15499 | y Ft(Mo)m(v)m(e)32 b(`bac)m(k')g(through)e(the)g(history)h(list,)g | |
15500 | (fetc)m(hing)g(the)g(previous)f(command.)150 1348 y Fs(next-history)d | |
15501 | (\(C-n\))630 1457 y Ft(Mo)m(v)m(e)32 b(`forw)m(ard')f(through)e(the)i | |
15502 | (history)f(list,)i(fetc)m(hing)f(the)g(next)f(command.)150 | |
15503 | 1621 y Fs(beginning-of-history)25 b(\(M-<\))630 1730 | |
15504 | y Ft(Mo)m(v)m(e)32 b(to)g(the)e(\014rst)g(line)g(in)h(the)f(history)-8 | |
15505 | b(.)150 1894 y Fs(end-of-history)26 b(\(M->\))630 2004 | |
15506 | y Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(input)e(history)-8 | |
15507 | b(,)31 b(i.e.,)h(the)f(line)f(curren)m(tly)h(b)s(eing)f(en)m(tered.)150 | |
15508 | 2167 y Fs(reverse-search-history)24 b(\(C-r\))630 2277 | |
15509 | y Ft(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g(the)f(curren)m(t)g | |
15510 | (line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g(his-)630 | |
15511 | 2386 y(tory)g(as)f(necessary)-8 b(.)42 b(This)29 b(is)i(an)f(incremen)m | |
15512 | (tal)i(searc)m(h.)150 2550 y Fs(forward-search-history)24 | |
15513 | b(\(C-s\))630 2659 y Ft(Searc)m(h)30 b(forw)m(ard)f(starting)h(at)g | |
15514 | (the)g(curren)m(t)f(line)h(and)f(mo)m(ving)h(`do)m(wn')f(through)g(the) | |
15515 | h(the)630 2769 y(history)g(as)h(necessary)-8 b(.)41 b(This)30 | |
15516 | b(is)g(an)h(incremen)m(tal)g(searc)m(h.)150 2932 y Fs | |
15517 | (non-incremental-reverse-)o(sear)o(ch-h)o(ist)o(ory)24 | |
15518 | b(\(M-p\))630 3042 y Ft(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g | |
37c41ab1 | 15519 | (the)f(curren)m(t)g(line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g |
c302751c | 15520 | (his-)630 3152 y(tory)36 b(as)g(necessary)h(using)e(a)i(non-incremen)m |
37c41ab1 | 15521 | (tal)g(searc)m(h)f(for)g(a)g(string)g(supplied)f(b)m(y)h(the)630 |
c302751c CR |
15522 | 3261 y(user.)150 3425 y Fs(non-incremental-forward-)o(sear)o(ch-h)o |
15523 | (ist)o(ory)24 b(\(M-n\))630 3534 y Ft(Searc)m(h)30 b(forw)m(ard)f | |
37c41ab1 | 15524 | (starting)h(at)g(the)g(curren)m(t)f(line)h(and)f(mo)m(ving)h(`do)m(wn') |
c302751c | 15525 | f(through)g(the)h(the)630 3644 y(history)d(as)f(necessary)i(using)e(a)h |
37c41ab1 | 15526 | (non-incremen)m(tal)g(searc)m(h)h(for)e(a)h(string)g(supplied)e(b)m(y)i |
c302751c CR |
15527 | (the)630 3754 y(user.)150 3917 y Fs(history-search-forward)d(\(\))630 |
15528 | 4027 y Ft(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i(history)f(for)g | |
37c41ab1 | 15529 | (the)h(string)f(of)h(c)m(haracters)h(b)s(et)m(w)m(een)f(the)630 |
74d0116b CR |
15530 | 4136 y(start)36 b(of)h(the)f(curren)m(t)f(line)i(and)e(the)h(p)s(oin)m |
15531 | (t.)58 b(The)35 b(searc)m(h)i(string)e(m)m(ust)h(matc)m(h)h(at)g(the) | |
15532 | 630 4246 y(b)s(eginning)32 b(of)g(a)h(history)g(line.)47 | |
15533 | b(This)32 b(is)h(a)f(non-incremen)m(tal)i(searc)m(h.)48 | |
15534 | b(By)33 b(default,)g(this)630 4355 y(command)d(is)h(un)m(b)s(ound.)150 | |
15535 | 4519 y Fs(history-search-backward)24 b(\(\))630 4629 | |
37c41ab1 CR |
15536 | y Ft(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f(the)h(history)g(for)g |
15537 | (the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m(een)g(the)630 | |
74d0116b CR |
15538 | 4738 y(start)g(of)h(the)f(curren)m(t)f(line)i(and)e(the)h(p)s(oin)m(t.) |
15539 | 58 b(The)35 b(searc)m(h)i(string)e(m)m(ust)h(matc)m(h)h(at)g(the)630 | |
15540 | 4848 y(b)s(eginning)32 b(of)g(a)h(history)g(line.)47 | |
15541 | b(This)32 b(is)h(a)f(non-incremen)m(tal)i(searc)m(h.)48 | |
15542 | b(By)33 b(default,)g(this)630 4957 y(command)d(is)h(un)m(b)s(ound.)150 | |
15543 | 5121 y Fs(history-substr-search-fo)o(rwar)o(d)24 b(\(\))630 | |
15544 | 5230 y Ft(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i(history)f(for)g | |
15545 | (the)h(string)f(of)h(c)m(haracters)h(b)s(et)m(w)m(een)f(the)630 | |
15546 | 5340 y(start)29 b(of)g(the)g(curren)m(t)g(line)g(and)f(the)h(p)s(oin)m | |
15547 | (t.)40 b(The)29 b(searc)m(h)g(string)g(ma)m(y)g(matc)m(h)h(an)m(ywhere) | |
15548 | p eop end | |
9f178efb CR |
15549 | %%Page: 117 123 |
15550 | TeXDict begin 117 122 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15551 | b(Command)29 b(Line)i(Editing)2062 b(117)630 299 y(in)32 | |
278286c9 CR |
15552 | b(a)h(history)g(line.)47 b(This)32 b(is)g(a)h(non-incremen)m(tal)h |
15553 | (searc)m(h.)47 b(By)33 b(default,)h(this)e(command)630 | |
15554 | 408 y(is)e(un)m(b)s(ound.)150 586 y Fs(history-substr-search-ba)o(ckwa) | |
15555 | o(rd)24 b(\(\))630 696 y Ft(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f | |
15556 | (the)h(history)g(for)g(the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m | |
15557 | (een)g(the)630 806 y(start)29 b(of)g(the)g(curren)m(t)g(line)g(and)f | |
15558 | (the)h(p)s(oin)m(t.)40 b(The)29 b(searc)m(h)g(string)g(ma)m(y)g(matc)m | |
15559 | (h)h(an)m(ywhere)630 915 y(in)i(a)h(history)g(line.)47 | |
74d0116b | 15560 | b(This)32 b(is)g(a)h(non-incremen)m(tal)h(searc)m(h.)47 |
278286c9 CR |
15561 | b(By)33 b(default,)h(this)e(command)630 1025 y(is)e(un)m(b)s(ound.)150 |
15562 | 1203 y Fs(yank-nth-arg)d(\(M-C-y\))630 1312 y Ft(Insert)37 | |
15563 | b(the)g(\014rst)f(argumen)m(t)i(to)f(the)h(previous)e(command)h | |
15564 | (\(usually)g(the)g(second)g(w)m(ord)630 1422 y(on)32 | |
15565 | b(the)g(previous)f(line\))i(at)f(p)s(oin)m(t.)46 b(With)32 | |
15566 | b(an)g(argumen)m(t)g Fq(n)p Ft(,)g(insert)g(the)g Fq(n)p | |
15567 | Ft(th)f(w)m(ord)g(from)630 1531 y(the)k(previous)f(command)h(\(the)g(w) | |
15568 | m(ords)g(in)f(the)h(previous)g(command)f(b)s(egin)h(with)f(w)m(ord)630 | |
15569 | 1641 y(0\).)69 b(A)40 b(negativ)m(e)h(argumen)m(t)f(inserts)g(the)f | |
15570 | Fq(n)p Ft(th)g(w)m(ord)g(from)g(the)h(end)f(of)h(the)f(previous)630 | |
15571 | 1750 y(command.)48 b(Once)33 b(the)g(argumen)m(t)h Fq(n)e | |
15572 | Ft(is)h(computed,)h(the)f(argumen)m(t)g(is)g(extracted)i(as)e(if)630 | |
15573 | 1860 y(the)e(`)p Fs(!)p Fi(n)11 b Ft(')29 b(history)i(expansion)f(had)g | |
15574 | (b)s(een)f(sp)s(eci\014ed.)150 2038 y Fs(yank-last-arg)e(\(M-.)i(or)h | |
15575 | (M-_\))630 2148 y Ft(Insert)k(last)i(argumen)m(t)g(to)g(the)f(previous) | |
15576 | f(command)h(\(the)h(last)f(w)m(ord)g(of)g(the)g(previous)630 | |
15577 | 2257 y(history)e(en)m(try\).)51 b(With)34 b(a)g(n)m(umeric)g(argumen)m | |
15578 | (t,)h(b)s(eha)m(v)m(e)f(exactly)h(lik)m(e)g Fs(yank-nth-arg)p | |
15579 | Ft(.)630 2367 y(Successiv)m(e)26 b(calls)g(to)f Fs(yank-last-arg)c | |
15580 | Ft(mo)m(v)m(e)27 b(bac)m(k)e(through)f(the)h(history)g(list,)i | |
15581 | (inserting)630 2476 y(the)c(last)g(w)m(ord)f(\(or)h(the)g(w)m(ord)f(sp) | |
15582 | s(eci\014ed)g(b)m(y)g(the)h(argumen)m(t)g(to)g(the)g(\014rst)f(call\))i | |
15583 | (of)f(eac)m(h)h(line)630 2586 y(in)36 b(turn.)58 b(An)m(y)36 | |
15584 | b(n)m(umeric)h(argumen)m(t)f(supplied)g(to)h(these)g(successiv)m(e)g | |
15585 | (calls)h(determines)630 2695 y(the)d(direction)g(to)h(mo)m(v)m(e)g | |
15586 | (through)e(the)h(history)-8 b(.)54 b(A)35 b(negativ)m(e)i(argumen)m(t)e | |
15587 | (switc)m(hes)h(the)630 2805 y(direction)23 b(through)g(the)g(history)f | |
15588 | (\(bac)m(k)i(or)f(forw)m(ard\).)38 b(The)22 b(history)h(expansion)g | |
15589 | (facilities)630 2915 y(are)28 b(used)f(to)h(extract)h(the)f(last)g | |
15590 | (argumen)m(t,)h(as)e(if)h(the)g(`)p Fs(!$)p Ft(')f(history)g(expansion) | |
15591 | h(had)f(b)s(een)630 3024 y(sp)s(eci\014ed.)150 3242 y | |
15592 | Fj(8.4.3)63 b(Commands)42 b(F)-10 b(or)41 b(Changing)g(T)-10 | |
15593 | b(ext)150 3423 y Fs(delete-char)27 b(\(C-d\))630 3533 | |
15594 | y Ft(Delete)41 b(the)e(c)m(haracter)i(at)e(p)s(oin)m(t.)66 | |
15595 | b(If)39 b(p)s(oin)m(t)f(is)h(at)h(the)f(b)s(eginning)f(of)h(the)g | |
15596 | (line,)j(there)630 3642 y(are)37 b(no)g(c)m(haracters)i(in)d(the)i | |
eb2bb562 | 15597 | (line,)h(and)d(the)h(last)h(c)m(haracter)h(t)m(yp)s(ed)e(w)m(as)g(not)g |
74d0116b CR |
15598 | (b)s(ound)e(to)630 3752 y Fs(delete-char)p Ft(,)28 b(then)i(return)f |
15599 | Fl(eof)p Ft(.)150 3930 y Fs(backward-delete-char)c(\(Rubout\))630 | |
15600 | 4039 y Ft(Delete)32 b(the)f(c)m(haracter)g(b)s(ehind)e(the)h(cursor.)40 | |
37c41ab1 | 15601 | b(A)30 b(n)m(umeric)g(argumen)m(t)h(means)f(to)h(kill)g(the)630 |
74d0116b CR |
15602 | 4149 y(c)m(haracters)h(instead)e(of)h(deleting)g(them.)150 |
15603 | 4327 y Fs(forward-backward-delete-)o(char)24 b(\(\))630 | |
15604 | 4436 y Ft(Delete)40 b(the)f(c)m(haracter)h(under)c(the)j(cursor,)h | |
37c41ab1 | 15605 | (unless)d(the)i(cursor)e(is)h(at)h(the)g(end)e(of)i(the)630 |
74d0116b | 15606 | 4546 y(line,)33 b(in)e(whic)m(h)g(case)i(the)f(c)m(haracter)h(b)s |
37c41ab1 | 15607 | (ehind)d(the)i(cursor)f(is)g(deleted.)46 b(By)32 b(default,)g(this)630 |
74d0116b CR |
15608 | 4655 y(is)e(not)h(b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 |
15609 | 4833 y Fs(quoted-insert)27 b(\(C-q)i(or)h(C-v\))630 4943 | |
37c41ab1 CR |
15610 | y Ft(Add)j(the)i(next)f(c)m(haracter)i(t)m(yp)s(ed)e(to)h(the)f(line)h |
15611 | (v)m(erbatim.)53 b(This)33 b(is)i(ho)m(w)f(to)h(insert)f(k)m(ey)630 | |
74d0116b CR |
15612 | 5053 y(sequences)d(lik)m(e)g Fi(C-q)p Ft(,)f(for)g(example.)150 |
15613 | 5230 y Fs(self-insert)d(\(a,)j(b,)g(A,)f(1,)h(!,)g(...)o(\))630 | |
15614 | 5340 y Ft(Insert)g(y)m(ourself.)p eop end | |
9f178efb CR |
15615 | %%Page: 118 124 |
15616 | TeXDict begin 118 123 bop 150 -116 a Ft(118)2527 b(Bash)31 | |
278286c9 CR |
15617 | b(Reference)g(Man)m(ual)150 299 y Fs(transpose-chars)26 |
15618 | b(\(C-t\))630 408 y Ft(Drag)33 b(the)f(c)m(haracter)h(b)s(efore)f(the)g | |
15619 | (cursor)f(forw)m(ard)h(o)m(v)m(er)h(the)f(c)m(haracter)i(at)e(the)g | |
15620 | (cursor,)630 518 y(mo)m(ving)k(the)g(cursor)f(forw)m(ard)g(as)g(w)m | |
15621 | (ell.)57 b(If)35 b(the)h(insertion)g(p)s(oin)m(t)f(is)g(at)i(the)e(end) | |
15622 | g(of)h(the)630 628 y(line,)24 b(then)e(this)g(transp)s(oses)f(the)h | |
15623 | (last)h(t)m(w)m(o)g(c)m(haracters)g(of)f(the)h(line.)38 | |
74d0116b CR |
15624 | b(Negativ)m(e)25 b(argumen)m(ts)630 737 y(ha)m(v)m(e)32 |
15625 | b(no)e(e\013ect.)150 907 y Fs(transpose-words)c(\(M-t\))630 | |
15626 | 1016 y Ft(Drag)33 b(the)g(w)m(ord)f(b)s(efore)g(p)s(oin)m(t)g(past)g | |
37c41ab1 | 15627 | (the)h(w)m(ord)f(after)g(p)s(oin)m(t,)i(mo)m(ving)f(p)s(oin)m(t)f(past) |
74d0116b | 15628 | g(that)630 1126 y(w)m(ord)c(as)h(w)m(ell.)41 b(If)27 |
37c41ab1 | 15629 | b(the)i(insertion)f(p)s(oin)m(t)h(is)f(at)h(the)g(end)e(of)i(the)f |
74d0116b CR |
15630 | (line,)i(this)e(transp)s(oses)g(the)630 1236 y(last)j(t)m(w)m(o)h(w)m |
15631 | (ords)e(on)g(the)h(line.)150 1405 y Fs(upcase-word)c(\(M-u\))630 | |
15632 | 1515 y Ft(Upp)s(ercase)32 b(the)g(curren)m(t)g(\(or)g(follo)m(wing\))i | |
37c41ab1 | 15633 | (w)m(ord.)45 b(With)32 b(a)g(negativ)m(e)j(argumen)m(t,)e(upp)s(er-)630 |
74d0116b CR |
15634 | 1624 y(case)e(the)g(previous)f(w)m(ord,)g(but)g(do)g(not)h(mo)m(v)m(e)h |
15635 | (the)e(cursor.)150 1794 y Fs(downcase-word)d(\(M-l\))630 | |
15636 | 1904 y Ft(Lo)m(w)m(ercase)c(the)f(curren)m(t)f(\(or)h(follo)m(wing\))i | |
15637 | (w)m(ord.)37 b(With)22 b(a)g(negativ)m(e)i(argumen)m(t,)g(lo)m(w)m | |
15638 | (ercase)630 2013 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f(mo)m | |
15639 | (v)m(e)i(the)f(cursor.)150 2183 y Fs(capitalize-word)26 | |
15640 | b(\(M-c\))630 2292 y Ft(Capitalize)d(the)f(curren)m(t)f(\(or)g(follo)m | |
510e20a2 | 15641 | (wing\))i(w)m(ord.)38 b(With)21 b(a)h(negativ)m(e)h(argumen)m(t,)h |
74d0116b CR |
15642 | (capitalize)630 2402 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f |
15643 | (mo)m(v)m(e)i(the)f(cursor.)150 2571 y Fs(overwrite-mode)26 | |
15644 | b(\(\))630 2681 y Ft(T)-8 b(oggle)35 b(o)m(v)m(erwrite)g(mo)s(de.)48 | |
a9fac3b2 | 15645 | b(With)33 b(an)g(explicit)h(p)s(ositiv)m(e)g(n)m(umeric)f(argumen)m(t,) |
74d0116b | 15646 | h(switc)m(hes)630 2791 y(to)22 b(o)m(v)m(erwrite)i(mo)s(de.)37 |
a9fac3b2 | 15647 | b(With)22 b(an)g(explicit)h(non-p)s(ositiv)m(e)f(n)m(umeric)g(argumen)m |
74d0116b | 15648 | (t,)i(switc)m(hes)e(to)630 2900 y(insert)30 b(mo)s(de.)41 |
a9fac3b2 | 15649 | b(This)30 b(command)h(a\013ects)h(only)e Fs(emacs)f Ft(mo)s(de;)i |
74d0116b | 15650 | Fs(vi)f Ft(mo)s(de)g(do)s(es)g(o)m(v)m(erwrite)630 3010 |
a9fac3b2 CR |
15651 | y(di\013eren)m(tly)-8 b(.)42 b(Eac)m(h)31 b(call)h(to)f |
15652 | Fs(readline\(\))c Ft(starts)k(in)f(insert)g(mo)s(de.)630 | |
74d0116b | 15653 | 3149 y(In)e(o)m(v)m(erwrite)j(mo)s(de,)e(c)m(haracters)i(b)s(ound)c(to) |
a9fac3b2 | 15654 | j Fs(self-insert)c Ft(replace)k(the)g(text)g(at)g(p)s(oin)m(t)630 |
74d0116b | 15655 | 3259 y(rather)41 b(than)h(pushing)e(the)i(text)g(to)g(the)g(righ)m(t.) |
a9fac3b2 | 15656 | 75 b(Characters)42 b(b)s(ound)d(to)j Fs(backward-)630 |
74d0116b CR |
15657 | 3369 y(delete-char)27 b Ft(replace)32 b(the)e(c)m(haracter)i(b)s(efore) |
15658 | e(p)s(oin)m(t)h(with)f(a)g(space.)630 3508 y(By)h(default,)f(this)h | |
15659 | (command)f(is)g(un)m(b)s(ound.)150 3718 y Fj(8.4.4)63 | |
15660 | b(Killing)42 b(And)e(Y)-10 b(anking)150 3895 y Fs(kill-line)28 | |
15661 | b(\(C-k\))630 4004 y Ft(Kill)j(the)f(text)i(from)e(p)s(oin)m(t)g(to)h | |
15662 | (the)g(end)e(of)i(the)f(line.)150 4174 y Fs(backward-kill-line)25 | |
15663 | b(\(C-x)30 b(Rubout\))630 4283 y Ft(Kill)h(bac)m(kw)m(ard)g(to)g(the)f | |
15664 | (b)s(eginning)g(of)g(the)h(line.)150 4453 y Fs(unix-line-discard)26 | |
15665 | b(\(C-u\))630 4562 y Ft(Kill)31 b(bac)m(kw)m(ard)g(from)e(the)i(cursor) | |
eb2bb562 | 15666 | f(to)h(the)f(b)s(eginning)g(of)h(the)f(curren)m(t)g(line.)150 |
74d0116b | 15667 | 4732 y Fs(kill-whole-line)c(\(\))630 4842 y Ft(Kill)37 |
eb2bb562 CR |
15668 | b(all)g(c)m(haracters)h(on)f(the)f(curren)m(t)h(line,)h(no)f(matter)g |
15669 | (where)f(p)s(oin)m(t)h(is.)59 b(By)36 b(default,)630 | |
74d0116b CR |
15670 | 4951 y(this)30 b(is)h(un)m(b)s(ound.)150 5121 y Fs(kill-word)d(\(M-d\)) |
15671 | 630 5230 y Ft(Kill)i(from)f(p)s(oin)m(t)g(to)h(the)g(end)e(of)i(the)f | |
37c41ab1 | 15672 | (curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)h |
74d0116b | 15673 | (the)g(end)630 5340 y(of)h(the)f(next)h(w)m(ord.)40 b(W)-8 |
37c41ab1 | 15674 | b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f Fs(forward-word)p |
74d0116b | 15675 | Ft(.)p eop end |
9f178efb CR |
15676 | %%Page: 119 125 |
15677 | TeXDict begin 119 124 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15678 | b(Command)29 b(Line)i(Editing)2062 b(119)150 299 y Fs | |
278286c9 CR |
15679 | (backward-kill-word)25 b(\(M-DEL\))630 408 y Ft(Kill)k(the)g(w)m(ord)g |
15680 | (b)s(ehind)e(p)s(oin)m(t.)40 b(W)-8 b(ord)29 b(b)s(oundaries)f(are)h | |
15681 | (the)g(same)g(as)g Fs(backward-word)p Ft(.)150 569 y | |
15682 | Fs(shell-kill-word)d(\(\))630 679 y Ft(Kill)k(from)f(p)s(oin)m(t)g(to)h | |
15683 | (the)g(end)e(of)i(the)f(curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m(w)m | |
15684 | (een)g(w)m(ords,)f(to)h(the)g(end)630 788 y(of)h(the)f(next)h(w)m(ord.) | |
15685 | 40 b(W)-8 b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f | |
15686 | Fs(shell-forward-word)p Ft(.)150 949 y Fs(shell-backward-kill-word)24 | |
74d0116b | 15687 | b(\(\))630 1059 y Ft(Kill)e(the)h(w)m(ord)e(b)s(ehind)g(p)s(oin)m(t.)38 |
a9fac3b2 | 15688 | b(W)-8 b(ord)22 b(b)s(oundaries)f(are)h(the)g(same)h(as)f |
74d0116b CR |
15689 | Fs(shell-backward-)630 1168 y(word)p Ft(.)150 1329 y |
15690 | Fs(unix-word-rubout)k(\(C-w\))630 1438 y Ft(Kill)32 b(the)g(w)m(ord)f | |
a9fac3b2 | 15691 | (b)s(ehind)f(p)s(oin)m(t,)i(using)f(white)h(space)g(as)g(a)g(w)m(ord)f |
74d0116b CR |
15692 | (b)s(oundary)-8 b(.)43 b(The)31 b(killed)630 1548 y(text)g(is)g(sa)m(v) |
15693 | m(ed)g(on)g(the)f(kill-ring.)150 1709 y Fs(unix-filename-rubout)25 | |
15694 | b(\(\))630 1818 y Ft(Kill)37 b(the)f(w)m(ord)g(b)s(ehind)f(p)s(oin)m | |
15695 | (t,)j(using)e(white)g(space)h(and)f(the)g(slash)g(c)m(haracter)i(as)f | |
15696 | (the)630 1928 y(w)m(ord)30 b(b)s(oundaries.)39 b(The)30 | |
15697 | b(killed)h(text)g(is)g(sa)m(v)m(ed)g(on)g(the)f(kill-ring.)150 | |
15698 | 2089 y Fs(delete-horizontal-space)24 b(\(\))630 2198 | |
15699 | y Ft(Delete)33 b(all)e(spaces)g(and)e(tabs)i(around)e(p)s(oin)m(t.)41 | |
15700 | b(By)31 b(default,)f(this)h(is)f(un)m(b)s(ound.)150 2359 | |
15701 | y Fs(kill-region)d(\(\))630 2469 y Ft(Kill)k(the)f(text)i(in)e(the)g | |
510e20a2 | 15702 | (curren)m(t)h(region.)41 b(By)31 b(default,)f(this)h(command)f(is)g(un) |
74d0116b CR |
15703 | m(b)s(ound.)150 2629 y Fs(copy-region-as-kill)25 b(\(\))630 |
15704 | 2739 y Ft(Cop)m(y)34 b(the)g(text)h(in)f(the)g(region)g(to)h(the)f | |
510e20a2 | 15705 | (kill)h(bu\013er,)f(so)g(it)h(can)f(b)s(e)f(y)m(ank)m(ed)i(righ)m(t)f |
74d0116b CR |
15706 | (a)m(w)m(a)m(y)-8 b(.)630 2848 y(By)31 b(default,)f(this)h(command)f |
15707 | (is)g(un)m(b)s(ound.)150 3009 y Fs(copy-backward-word)25 | |
15708 | b(\(\))630 3119 y Ft(Cop)m(y)38 b(the)h(w)m(ord)f(b)s(efore)g(p)s(oin)m | |
510e20a2 | 15709 | (t)g(to)i(the)e(kill)h(bu\013er.)64 b(The)38 b(w)m(ord)g(b)s(oundaries) |
74d0116b | 15710 | f(are)i(the)630 3228 y(same)31 b(as)f Fs(backward-word)p |
510e20a2 | 15711 | Ft(.)38 b(By)30 b(default,)h(this)f(command)g(is)h(un)m(b)s(ound.)150 |
74d0116b | 15712 | 3389 y Fs(copy-forward-word)26 b(\(\))630 3499 y Ft(Cop)m(y)31 |
37c41ab1 CR |
15713 | b(the)g(w)m(ord)g(follo)m(wing)h(p)s(oin)m(t)f(to)h(the)f(kill)h |
15714 | (bu\013er.)42 b(The)30 b(w)m(ord)h(b)s(oundaries)e(are)j(the)630 | |
74d0116b | 15715 | 3608 y(same)f(as)f Fs(forward-word)p Ft(.)38 b(By)30 |
a9fac3b2 | 15716 | b(default,)h(this)g(command)f(is)g(un)m(b)s(ound.)150 |
74d0116b | 15717 | 3769 y Fs(yank)f(\(C-y\))630 3878 y Ft(Y)-8 b(ank)31 |
a9fac3b2 | 15718 | b(the)f(top)h(of)g(the)f(kill)h(ring)f(in)m(to)i(the)e(bu\013er)g(at)h |
74d0116b | 15719 | (p)s(oin)m(t.)150 4039 y Fs(yank-pop)d(\(M-y\))630 4149 |
a9fac3b2 CR |
15720 | y Ft(Rotate)36 b(the)f(kill-ring,)i(and)d(y)m(ank)h(the)f(new)g(top.)54 |
15721 | b(Y)-8 b(ou)35 b(can)g(only)f(do)h(this)f(if)h(the)g(prior)630 | |
74d0116b CR |
15722 | 4258 y(command)30 b(is)h Fs(yank)e Ft(or)h Fs(yank-pop)p |
15723 | Ft(.)150 4459 y Fj(8.4.5)63 b(Sp)s(ecifying)42 b(Numeric)f(Argumen)m | |
15724 | (ts)150 4631 y Fs(digit-argument)26 b(\()p Fi(M-0)p Fs(,)j | |
15725 | Fi(M-1)p Fs(,)h(...)f Fi(M--)p Fs(\))630 4741 y Ft(Add)d(this)h(digit)g | |
ed35cb4a | 15726 | (to)h(the)f(argumen)m(t)g(already)h(accum)m(ulating,)h(or)e(start)h(a)f |
74d0116b CR |
15727 | (new)f(argumen)m(t.)630 4851 y Fi(M--)j Ft(starts)i(a)g(negativ)m(e)i |
15728 | (argumen)m(t.)150 5011 y Fs(universal-argument)25 b(\(\))630 | |
15729 | 5121 y Ft(This)g(is)g(another)h(w)m(a)m(y)g(to)h(sp)s(ecify)e(an)g | |
37c41ab1 | 15730 | (argumen)m(t.)40 b(If)25 b(this)g(command)h(is)f(follo)m(w)m(ed)i(b)m |
74d0116b | 15731 | (y)f(one)630 5230 y(or)k(more)f(digits,)i(optionally)g(with)e(a)h |
37c41ab1 | 15732 | (leading)h(min)m(us)e(sign,)h(those)g(digits)g(de\014ne)f(the)h(ar-)630 |
74d0116b CR |
15733 | 5340 y(gumen)m(t.)41 b(If)28 b(the)i(command)f(is)g(follo)m(w)m(ed)h(b) |
15734 | m(y)f(digits,)i(executing)f Fs(universal-argument)p eop | |
15735 | end | |
9f178efb CR |
15736 | %%Page: 120 126 |
15737 | TeXDict begin 120 125 bop 150 -116 a Ft(120)2527 b(Bash)31 | |
278286c9 CR |
15738 | b(Reference)g(Man)m(ual)630 299 y(again)i(ends)e(the)h(n)m(umeric)f |
15739 | (argumen)m(t,)i(but)e(is)h(otherwise)g(ignored.)45 b(As)32 | |
15740 | b(a)g(sp)s(ecial)h(case,)630 408 y(if)g(this)g(command)f(is)h | |
15741 | (immediately)h(follo)m(w)m(ed)h(b)m(y)d(a)h(c)m(haracter)i(that)e(is)g | |
15742 | (neither)g(a)g(digit)630 518 y(or)28 b(min)m(us)f(sign,)i(the)f | |
15743 | (argumen)m(t)g(coun)m(t)h(for)e(the)i(next)f(command)f(is)h(m)m | |
15744 | (ultiplied)h(b)m(y)e(four.)630 628 y(The)37 b(argumen)m(t)h(coun)m(t)f | |
15745 | (is)h(initially)h(one,)g(so)f(executing)g(this)f(function)g(the)h | |
15746 | (\014rst)e(time)630 737 y(mak)m(es)d(the)e(argumen)m(t)i(coun)m(t)f | |
15747 | (four,)f(a)i(second)e(time)i(mak)m(es)f(the)g(argumen)m(t)g(coun)m(t)h | |
15748 | (six-)630 847 y(teen,)e(and)f(so)h(on.)40 b(By)31 b(default,)g(this)f | |
15749 | (is)g(not)h(b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 1052 | |
15750 | y Fj(8.4.6)63 b(Letting)40 b(Readline)h(T)m(yp)s(e)g(F)-10 | |
15751 | b(or)42 b(Y)-10 b(ou)150 1226 y Fs(complete)28 b(\(TAB\))630 | |
74d0116b | 15752 | 1336 y Ft(A)m(ttempt)c(to)f(p)s(erform)e(completion)j(on)f(the)g(text)g |
c302751c | 15753 | (b)s(efore)f(p)s(oin)m(t.)39 b(The)22 b(actual)i(completion)630 |
74d0116b | 15754 | 1445 y(p)s(erformed)33 b(is)h(application-sp)s(eci\014c.)53 |
c302751c | 15755 | b(Bash)35 b(attempts)g(completion)g(treating)h(the)e(text)630 |
74d0116b | 15756 | 1555 y(as)39 b(a)h(v)-5 b(ariable)39 b(\(if)h(the)f(text)h(b)s(egins)e |
c302751c | 15757 | (with)h(`)p Fs($)p Ft('\),)j(username)c(\(if)i(the)f(text)h(b)s(egins)e |
74d0116b | 15758 | (with)630 1665 y(`)p Fs(~)p Ft('\),)31 b(hostname)f(\(if)g(the)g(text)h |
c302751c | 15759 | (b)s(egins)e(with)h(`)p Fs(@)p Ft('\),)h(or)f(command)f(\(including)h |
74d0116b CR |
15760 | (aliases)i(and)630 1774 y(functions\))j(in)f(turn.)53 |
15761 | b(If)34 b(none)g(of)h(these)h(pro)s(duces)d(a)i(matc)m(h,)i(\014lename) | |
15762 | e(completion)h(is)630 1884 y(attempted.)150 2049 y Fs | |
15763 | (possible-completions)25 b(\(M-?\))630 2158 y Ft(List)35 | |
15764 | b(the)g(p)s(ossible)f(completions)i(of)e(the)h(text)h(b)s(efore)e(p)s | |
15765 | (oin)m(t.)54 b(When)34 b(displa)m(ying)h(com-)630 2268 | |
15766 | y(pletions,)f(Readline)f(sets)f(the)h(n)m(um)m(b)s(er)e(of)i(columns)f | |
15767 | (used)f(for)i(displa)m(y)f(to)h(the)g(v)-5 b(alue)33 | |
15768 | b(of)630 2378 y Fs(completion-display-width)o Ft(,)g(the)j(v)-5 | |
15769 | b(alue)37 b(of)g(the)f(en)m(vironmen)m(t)h(v)-5 b(ariable)38 | |
15770 | b Fs(COLUMNS)p Ft(,)630 2487 y(or)30 b(the)h(screen)f(width,)g(in)g | |
15771 | (that)h(order.)150 2652 y Fs(insert-completions)25 b(\(M-*\))630 | |
15772 | 2762 y Ft(Insert)30 b(all)h(completions)h(of)f(the)g(text)g(b)s(efore)f | |
15773 | (p)s(oin)m(t)h(that)g(w)m(ould)f(ha)m(v)m(e)i(b)s(een)e(generated)630 | |
15774 | 2871 y(b)m(y)g Fs(possible-completions)p Ft(.)150 3036 | |
15775 | y Fs(menu-complete)d(\(\))630 3146 y Ft(Similar)d(to)g | |
eb0b2ad8 | 15776 | Fs(complete)p Ft(,)f(but)h(replaces)g(the)g(w)m(ord)g(to)g(b)s(e)f |
74d0116b | 15777 | (completed)i(with)e(a)i(single)f(matc)m(h)630 3255 y(from)37 |
eb0b2ad8 | 15778 | b(the)h(list)h(of)f(p)s(ossible)f(completions.)64 b(Rep)s(eated)39 |
74d0116b | 15779 | b(execution)g(of)f Fs(menu-complete)630 3365 y Ft(steps)i(through)g |
eb0b2ad8 | 15780 | (the)g(list)h(of)f(p)s(ossible)g(completions,)k(inserting)c(eac)m(h)i |
74d0116b | 15781 | (matc)m(h)f(in)f(turn.)630 3475 y(A)m(t)e(the)f(end)f(of)h(the)g(list)g |
eb0b2ad8 | 15782 | (of)g(completions,)i(the)e(b)s(ell)g(is)g(rung)f(\(sub)5 |
74d0116b | 15783 | b(ject)36 b(to)i(the)f(setting)630 3584 y(of)f Fs(bell-style)p |
eb0b2ad8 CR |
15784 | Ft(\))e(and)h(the)h(original)i(text)f(is)f(restored.)57 |
15785 | b(An)36 b(argumen)m(t)h(of)f Fq(n)f Ft(mo)m(v)m(es)i | |
74d0116b | 15786 | Fq(n)630 3694 y Ft(p)s(ositions)e(forw)m(ard)f(in)g(the)h(list)h(of)e |
a9fac3b2 | 15787 | (matc)m(hes;)39 b(a)c(negativ)m(e)i(argumen)m(t)e(ma)m(y)g(b)s(e)f |
74d0116b | 15788 | (used)g(to)630 3803 y(mo)m(v)m(e)40 b(bac)m(kw)m(ard)e(through)g(the)g |
a9fac3b2 | 15789 | (list.)65 b(This)38 b(command)g(is)g(in)m(tended)g(to)h(b)s(e)f(b)s |
74d0116b CR |
15790 | (ound)e(to)630 3913 y Fs(TAB)p Ft(,)30 b(but)f(is)i(un)m(b)s(ound)d(b)m |
15791 | (y)i(default.)150 4078 y Fs(menu-complete-backward)24 | |
15792 | b(\(\))630 4188 y Ft(Iden)m(tical)36 b(to)g Fs(menu-complete)p | |
3eb2d94a | 15793 | Ft(,)d(but)h(mo)m(v)m(es)j(bac)m(kw)m(ard)e(through)f(the)i(list)f(of)g |
74d0116b | 15794 | (p)s(ossible)630 4297 y(completions,)d(as)e(if)h Fs(menu-complete)26 |
3eb2d94a | 15795 | b Ft(had)k(b)s(een)g(giv)m(en)h(a)g(negativ)m(e)i(argumen)m(t.)150 |
74d0116b | 15796 | 4462 y Fs(delete-char-or-list)25 b(\(\))630 4572 y Ft(Deletes)k(the)e |
3eb2d94a | 15797 | (c)m(haracter)h(under)e(the)h(cursor)f(if)h(not)g(at)g(the)g(b)s |
74d0116b | 15798 | (eginning)g(or)f(end)h(of)g(the)g(line)630 4681 y(\(lik)m(e)k |
3eb2d94a CR |
15799 | Fs(delete-char)p Ft(\).)37 b(If)29 b(at)h(the)f(end)f(of)i(the)f(line,) |
15800 | h(b)s(eha)m(v)m(es)g(iden)m(tically)h(to)e Fs(possible-)630 | |
74d0116b CR |
15801 | 4791 y(completions)p Ft(.)38 b(This)29 b(command)h(is)h(un)m(b)s(ound)d |
15802 | (b)m(y)i(default.)150 4956 y Fs(complete-filename)c(\(M-/\))630 | |
15803 | 5065 y Ft(A)m(ttempt)32 b(\014lename)e(completion)i(on)e(the)h(text)g | |
15804 | (b)s(efore)f(p)s(oin)m(t.)150 5230 y Fs(possible-filename-comple)o | |
15805 | (tion)o(s)24 b(\(C-x)30 b(/\))630 5340 y Ft(List)f(the)g(p)s(ossible)f | |
3eb2d94a | 15806 | (completions)h(of)g(the)g(text)g(b)s(efore)g(p)s(oin)m(t,)g(treating)h |
74d0116b | 15807 | (it)f(as)g(a)f(\014lename.)p eop end |
9f178efb CR |
15808 | %%Page: 121 127 |
15809 | TeXDict begin 121 126 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15810 | b(Command)29 b(Line)i(Editing)2062 b(121)150 299 y Fs | |
278286c9 CR |
15811 | (complete-username)26 b(\(M-~\))630 408 y Ft(A)m(ttempt)32 |
15812 | b(completion)f(on)g(the)f(text)i(b)s(efore)e(p)s(oin)m(t,)g(treating)i | |
15813 | (it)f(as)f(a)h(username.)150 569 y Fs(possible-username-comple)o(tion)o | |
15814 | (s)24 b(\(C-x)30 b(~\))630 679 y Ft(List)25 b(the)g(p)s(ossible)g | |
15815 | (completions)h(of)f(the)g(text)h(b)s(efore)f(p)s(oin)m(t,)h(treating)g | |
15816 | (it)g(as)f(a)g(username.)150 839 y Fs(complete-variable)h(\(M-$\))630 | |
45c0f7f8 | 15817 | 949 y Ft(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i(b)s(efore)e(p)s |
74d0116b | 15818 | (oin)m(t,)g(treating)i(it)f(as)f(a)h(shell)g(v)-5 b(ariable.)150 |
45c0f7f8 CR |
15819 | 1110 y Fs(possible-variable-comple)o(tion)o(s)24 b(\(C-x)30 |
15820 | b($\))630 1219 y Ft(List)42 b(the)g(p)s(ossible)g(completions)h(of)f | |
37c41ab1 | 15821 | (the)g(text)h(b)s(efore)e(p)s(oin)m(t,)46 b(treating)d(it)f(as)g(a)h |
45c0f7f8 CR |
15822 | (shell)630 1329 y(v)-5 b(ariable.)150 1490 y Fs(complete-hostname)26 |
15823 | b(\(M-@\))630 1599 y Ft(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i | |
74d0116b | 15824 | (b)s(efore)e(p)s(oin)m(t,)g(treating)i(it)f(as)f(a)h(hostname.)150 |
45c0f7f8 CR |
15825 | 1760 y Fs(possible-hostname-comple)o(tion)o(s)24 b(\(C-x)30 |
15826 | b(@\))630 1869 y Ft(List)25 b(the)g(p)s(ossible)f(completions)h(of)g | |
74d0116b | 15827 | (the)g(text)g(b)s(efore)g(p)s(oin)m(t,)h(treating)g(it)f(as)f(a)h |
45c0f7f8 CR |
15828 | (hostname.)150 2030 y Fs(complete-command)h(\(M-!\))630 |
15829 | 2140 y Ft(A)m(ttempt)32 b(completion)g(on)f(the)g(text)h(b)s(efore)e(p) | |
74d0116b | 15830 | s(oin)m(t,)h(treating)h(it)g(as)f(a)g(command)g(name.)630 |
45c0f7f8 CR |
15831 | 2249 y(Command)46 b(completion)i(attempts)g(to)f(matc)m(h)h(the)f(text) |
15832 | h(against)g(aliases,)53 b(reserv)m(ed)630 2359 y(w)m(ords,)36 | |
510e20a2 | 15833 | b(shell)g(functions,)h(shell)e(builtins,)i(and)e(\014nally)g |
45c0f7f8 CR |
15834 | (executable)i(\014lenames,)g(in)e(that)630 2469 y(order.)150 |
15835 | 2629 y Fs(possible-command-complet)o(ions)24 b(\(C-x)29 | |
15836 | b(!\))630 2739 y Ft(List)d(the)h(p)s(ossible)f(completions)h(of)f(the)h | |
510e20a2 | 15837 | (text)g(b)s(efore)f(p)s(oin)m(t,)h(treating)g(it)g(as)g(a)f(command)630 |
45c0f7f8 CR |
15838 | 2848 y(name.)150 3009 y Fs(dynamic-complete-history)e(\(M-TAB\))630 |
15839 | 3119 y Ft(A)m(ttempt)31 b(completion)h(on)e(the)g(text)h(b)s(efore)f(p) | |
510e20a2 | 15840 | s(oin)m(t,)g(comparing)h(the)f(text)h(against)h(lines)630 |
45c0f7f8 CR |
15841 | 3228 y(from)e(the)g(history)h(list)g(for)f(p)s(ossible)g(completion)i |
15842 | (matc)m(hes.)150 3389 y Fs(dabbrev-expand)26 b(\(\))630 | |
15843 | 3499 y Ft(A)m(ttempt)i(men)m(u)e(completion)i(on)f(the)g(text)g(b)s | |
510e20a2 | 15844 | (efore)f(p)s(oin)m(t,)i(comparing)f(the)g(text)h(against)630 |
45c0f7f8 CR |
15845 | 3608 y(lines)j(from)e(the)i(history)f(list)h(for)g(p)s(ossible)e |
15846 | (completion)j(matc)m(hes.)150 3769 y Fs(complete-into-braces)25 | |
15847 | b(\(M-{\))630 3878 y Ft(P)m(erform)f(\014lename)f(completion)i(and)f | |
3eb2d94a | 15848 | (insert)f(the)h(list)g(of)g(p)s(ossible)f(completions)i(enclosed)630 |
45c0f7f8 | 15849 | 3988 y(within)34 b(braces)h(so)f(the)h(list)g(is)g(a)m(v)-5 |
3eb2d94a | 15850 | b(ailable)37 b(to)e(the)g(shell)g(\(see)g(Section)h(3.5.1)g([Brace)g |
9f178efb | 15851 | (Ex-)630 4098 y(pansion],)30 b(page)h(21\).)150 4298 |
45c0f7f8 CR |
15852 | y Fj(8.4.7)63 b(Keyb)s(oard)41 b(Macros)150 4471 y Fs(start-kbd-macro) |
15853 | 26 b(\(C-x)j(\(\))630 4580 y Ft(Begin)i(sa)m(ving)h(the)e(c)m | |
3eb2d94a | 15854 | (haracters)i(t)m(yp)s(ed)e(in)m(to)h(the)g(curren)m(t)f(k)m(eyb)s(oard) |
45c0f7f8 CR |
15855 | g(macro.)150 4741 y Fs(end-kbd-macro)d(\(C-x)i(\)\))630 |
15856 | 4851 y Ft(Stop)e(sa)m(ving)h(the)g(c)m(haracters)g(t)m(yp)s(ed)f(in)m | |
3eb2d94a | 15857 | (to)i(the)e(curren)m(t)g(k)m(eyb)s(oard)g(macro)h(and)f(sa)m(v)m(e)i |
45c0f7f8 CR |
15858 | (the)630 4960 y(de\014nition.)150 5121 y Fs(call-last-kbd-macro)c |
15859 | (\(C-x)k(e\))630 5230 y Ft(Re-execute)37 b(the)e(last)h(k)m(eyb)s(oard) | |
3eb2d94a | 15860 | f(macro)h(de\014ned,)f(b)m(y)h(making)f(the)g(c)m(haracters)i(in)e(the) |
45c0f7f8 | 15861 | 630 5340 y(macro)c(app)s(ear)f(as)g(if)h(t)m(yp)s(ed)f(at)h(the)f(k)m |
74d0116b | 15862 | (eyb)s(oard.)p eop end |
9f178efb CR |
15863 | %%Page: 122 128 |
15864 | TeXDict begin 122 127 bop 150 -116 a Ft(122)2527 b(Bash)31 | |
278286c9 CR |
15865 | b(Reference)g(Man)m(ual)150 299 y Fs(print-last-kbd-macro)25 |
15866 | b(\(\))630 408 y Ft(Prin)m(t)30 b(the)h(last)g(k)m(eb)s(oard)f(macro)h | |
15867 | (de\014ned)e(in)i(a)f(format)h(suitable)g(for)f(the)h | |
15868 | Fq(inputrc)k Ft(\014le.)150 604 y Fj(8.4.8)63 b(Some)41 | |
15869 | b(Miscellaneous)i(Commands)150 774 y Fs(re-read-init-file)26 | |
15870 | b(\(C-x)j(C-r\))630 884 y Ft(Read)22 b(in)g(the)g(con)m(ten)m(ts)h(of)f | |
15871 | (the)g Fq(inputrc)27 b Ft(\014le,)d(and)d(incorp)s(orate)h(an)m(y)h | |
15872 | (bindings)d(or)i(v)-5 b(ariable)630 994 y(assignmen)m(ts)31 | |
15873 | b(found)e(there.)150 1150 y Fs(abort)g(\(C-g\))630 1259 | |
15874 | y Ft(Ab)s(ort)d(the)h(curren)m(t)f(editing)h(command)f(and)g(ring)h | |
15875 | (the)f(terminal's)h(b)s(ell)g(\(sub)5 b(ject)26 b(to)i(the)630 | |
15876 | 1369 y(setting)j(of)g Fs(bell-style)p Ft(\).)150 1525 | |
15877 | y Fs(do-uppercase-version)25 b(\(M-a,)k(M-b,)g(M-)p Fi(x)11 | |
15878 | b Fs(,)29 b(...)o(\))630 1634 y Ft(If)e(the)h(meta\014ed)g(c)m | |
37c41ab1 | 15879 | (haracter)h Fq(x)34 b Ft(is)28 b(lo)m(w)m(ercase,)i(run)d(the)g |
45c0f7f8 CR |
15880 | (command)h(that)g(is)g(b)s(ound)d(to)k(the)630 1744 y(corresp)s(onding) |
15881 | g(upp)s(ercase)h(c)m(haracter.)150 1900 y Fs(prefix-meta)d(\(ESC\))630 | |
15882 | 2010 y Ft(Metafy)39 b(the)e(next)h(c)m(haracter)h(t)m(yp)s(ed.)62 | |
74d0116b | 15883 | b(This)37 b(is)g(for)h(k)m(eyb)s(oards)f(without)g(a)h(meta)g(k)m(ey)-8 |
45c0f7f8 CR |
15884 | b(.)630 2119 y(T)m(yping)30 b(`)p Fs(ESC)g(f)p Ft(')g(is)h(equiv)-5 |
15885 | b(alen)m(t)31 b(to)g(t)m(yping)g Fi(M-f)p Ft(.)150 2275 | |
15886 | y Fs(undo)e(\(C-_)g(or)h(C-x)g(C-u\))630 2385 y Ft(Incremen)m(tal)h | |
74d0116b | 15887 | (undo,)f(separately)h(remem)m(b)s(ered)f(for)g(eac)m(h)i(line.)150 |
45c0f7f8 | 15888 | 2541 y Fs(revert-line)27 b(\(M-r\))630 2650 y Ft(Undo)33 |
74d0116b CR |
15889 | b(all)h(c)m(hanges)g(made)f(to)h(this)f(line.)49 b(This)32 |
15890 | b(is)h(lik)m(e)i(executing)f(the)f Fs(undo)f Ft(command)630 | |
45c0f7f8 CR |
15891 | 2760 y(enough)e(times)h(to)g(get)h(bac)m(k)f(to)g(the)f(b)s(eginning.) |
15892 | 150 2916 y Fs(tilde-expand)d(\(M-&\))630 3026 y Ft(P)m(erform)j(tilde)h | |
15893 | (expansion)g(on)f(the)g(curren)m(t)h(w)m(ord.)150 3182 | |
15894 | y Fs(set-mark)d(\(C-@\))630 3291 y Ft(Set)33 b(the)g(mark)f(to)i(the)f | |
74d0116b | 15895 | (p)s(oin)m(t.)48 b(If)32 b(a)h(n)m(umeric)g(argumen)m(t)g(is)g |
45c0f7f8 CR |
15896 | (supplied,)f(the)h(mark)g(is)f(set)630 3401 y(to)f(that)g(p)s(osition.) |
15897 | 150 3557 y Fs(exchange-point-and-mark)24 b(\(C-x)29 b(C-x\))630 | |
15898 | 3666 y Ft(Sw)m(ap)i(the)g(p)s(oin)m(t)g(with)g(the)g(mark.)43 | |
74d0116b | 15899 | b(The)31 b(curren)m(t)g(cursor)f(p)s(osition)i(is)f(set)h(to)f(the)h |
45c0f7f8 CR |
15900 | (sa)m(v)m(ed)630 3776 y(p)s(osition,)f(and)e(the)i(old)g(cursor)e(p)s |
15901 | (osition)i(is)f(sa)m(v)m(ed)i(as)e(the)h(mark.)150 3932 | |
15902 | y Fs(character-search)26 b(\(C-]\))630 4042 y Ft(A)f(c)m(haracter)h(is) | |
74d0116b | 15903 | f(read)g(and)f(p)s(oin)m(t)h(is)g(mo)m(v)m(ed)h(to)g(the)f(next)g(o)s |
45c0f7f8 | 15904 | (ccurrence)g(of)g(that)g(c)m(haracter.)630 4151 y(A)30 |
37c41ab1 | 15905 | b(negativ)m(e)j(coun)m(t)e(searc)m(hes)g(for)f(previous)g(o)s |
45c0f7f8 CR |
15906 | (ccurrences.)150 4307 y Fs(character-search-backwar)o(d)24 |
15907 | b(\(M-C-]\))630 4417 y Ft(A)45 b(c)m(haracter)h(is)f(read)g(and)f(p)s | |
a9fac3b2 | 15908 | (oin)m(t)h(is)g(mo)m(v)m(ed)h(to)f(the)g(previous)f(o)s(ccurrence)h(of) |
45c0f7f8 | 15909 | g(that)630 4526 y(c)m(haracter.)d(A)31 b(negativ)m(e)h(coun)m(t)f |
a9fac3b2 | 15910 | (searc)m(hes)h(for)e(subsequen)m(t)f(o)s(ccurrences.)150 |
45c0f7f8 | 15911 | 4682 y Fs(skip-csi-sequence)d(\(\))630 4792 y Ft(Read)i(enough)f(c)m |
8f714a7c | 15912 | (haracters)h(to)g(consume)f(a)h(m)m(ulti-k)m(ey)h(sequence)f(suc)m(h)f |
45c0f7f8 | 15913 | (as)g(those)h(de\014ned)630 4902 y(for)37 b(k)m(eys)h(lik)m(e)g(Home)g |
8f714a7c | 15914 | (and)f(End.)60 b(Suc)m(h)37 b(sequences)g(b)s(egin)g(with)g(a)h(Con)m |
45c0f7f8 | 15915 | (trol)g(Sequence)630 5011 y(Indicator)f(\(CSI\),)f(usually)h(ESC-[.)59 |
8f714a7c | 15916 | b(If)36 b(this)g(sequence)h(is)g(b)s(ound)d(to)k Fs("\\)p |
45c0f7f8 | 15917 | Ft(e[)p Fs(")p Ft(,)g(k)m(eys)f(pro-)630 5121 y(ducing)31 |
8f714a7c | 15918 | b(suc)m(h)h(sequences)g(will)h(ha)m(v)m(e)g(no)f(e\013ect)h(unless)e |
45c0f7f8 | 15919 | (explicitly)j(b)s(ound)c(to)i(a)h(readline)630 5230 y(command,)f |
8f714a7c | 15920 | (instead)g(of)g(inserting)g(stra)m(y)h(c)m(haracters)g(in)m(to)g(the)f |
45c0f7f8 CR |
15921 | (editing)h(bu\013er.)44 b(This)31 b(is)630 5340 y(un)m(b)s(ound)d(b)m |
15922 | (y)i(default,)h(but)f(usually)g(b)s(ound)e(to)j(ESC-[.)p | |
15923 | eop end | |
9f178efb CR |
15924 | %%Page: 123 129 |
15925 | TeXDict begin 123 128 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
15926 | b(Command)29 b(Line)i(Editing)2062 b(123)150 299 y Fs(insert-comment)26 | |
45c0f7f8 CR |
15927 | b(\(M-#\))630 408 y Ft(Without)36 b(a)g(n)m(umeric)g(argumen)m(t,)h |
15928 | (the)f(v)-5 b(alue)36 b(of)g(the)g Fs(comment-begin)c | |
15929 | Ft(v)-5 b(ariable)36 b(is)g(in-)630 518 y(serted)c(at)g(the)g(b)s | |
15930 | (eginning)f(of)h(the)f(curren)m(t)h(line.)45 b(If)31 | |
15931 | b(a)h(n)m(umeric)f(argumen)m(t)h(is)g(supplied,)630 628 | |
15932 | y(this)k(command)h(acts)g(as)g(a)g(toggle:)55 b(if)37 | |
15933 | b(the)f(c)m(haracters)i(at)g(the)e(b)s(eginning)g(of)h(the)g(line)630 | |
15934 | 737 y(do)30 b(not)h(matc)m(h)h(the)f(v)-5 b(alue)31 b(of)f | |
15935 | Fs(comment-begin)p Ft(,)e(the)i(v)-5 b(alue)31 b(is)g(inserted,)g | |
15936 | (otherwise)g(the)630 847 y(c)m(haracters)42 b(in)d Fs(comment-begin)e | |
15937 | Ft(are)j(deleted)h(from)f(the)g(b)s(eginning)g(of)g(the)g(line.)71 | |
15938 | b(In)630 956 y(either)37 b(case,)j(the)e(line)f(is)g(accepted)i(as)e | |
15939 | (if)g(a)g(newline)g(had)g(b)s(een)f(t)m(yp)s(ed.)60 b(The)37 | |
15940 | b(default)630 1066 y(v)-5 b(alue)32 b(of)g Fs(comment-begin)c | |
15941 | Ft(causes)k(this)f(command)h(to)g(mak)m(e)h(the)e(curren)m(t)h(line)g | |
15942 | (a)g(shell)630 1176 y(commen)m(t.)40 b(If)26 b(a)h(n)m(umeric)f | |
15943 | (argumen)m(t)h(causes)g(the)f(commen)m(t)i(c)m(haracter)g(to)f(b)s(e)f | |
15944 | (remo)m(v)m(ed,)630 1285 y(the)31 b(line)f(will)h(b)s(e)f(executed)h(b) | |
15945 | m(y)f(the)h(shell.)150 1443 y Fs(dump-functions)26 b(\(\))630 | |
15946 | 1553 y Ft(Prin)m(t)g(all)i(of)e(the)h(functions)f(and)g(their)g(k)m(ey) | |
15947 | h(bindings)e(to)j(the)e(Readline)h(output)f(stream.)630 | |
15948 | 1663 y(If)31 b(a)h(n)m(umeric)g(argumen)m(t)g(is)g(supplied,)f(the)h | |
74d0116b | 15949 | (output)f(is)h(formatted)g(in)f(suc)m(h)h(a)g(w)m(a)m(y)g(that)630 |
45c0f7f8 | 15950 | 1772 y(it)f(can)g(b)s(e)e(made)i(part)f(of)g(an)h Fq(inputrc)k |
74d0116b | 15951 | Ft(\014le.)41 b(This)29 b(command)h(is)h(un)m(b)s(ound)c(b)m(y)k |
45c0f7f8 CR |
15952 | (default.)150 1931 y Fs(dump-variables)26 b(\(\))630 |
15953 | 2040 y Ft(Prin)m(t)21 b(all)h(of)g(the)f(settable)i(v)-5 | |
15954 | b(ariables)22 b(and)f(their)g(v)-5 b(alues)22 b(to)g(the)f(Readline)h | |
15955 | (output)f(stream.)630 2150 y(If)31 b(a)h(n)m(umeric)g(argumen)m(t)g(is) | |
15956 | g(supplied,)f(the)h(output)f(is)h(formatted)g(in)f(suc)m(h)h(a)g(w)m(a) | |
15957 | m(y)g(that)630 2259 y(it)f(can)g(b)s(e)e(made)i(part)f(of)g(an)h | |
15958 | Fq(inputrc)k Ft(\014le.)41 b(This)29 b(command)h(is)h(un)m(b)s(ound)c | |
15959 | (b)m(y)k(default.)150 2418 y Fs(dump-macros)c(\(\))630 | |
15960 | 2527 y Ft(Prin)m(t)34 b(all)g(of)g(the)g(Readline)g(k)m(ey)h(sequences) | |
15961 | f(b)s(ound)e(to)i(macros)g(and)f(the)h(strings)g(they)630 | |
15962 | 2637 y(output.)53 b(If)35 b(a)g(n)m(umeric)f(argumen)m(t)i(is)e | |
eb0b2ad8 | 15963 | (supplied,)h(the)g(output)g(is)f(formatted)i(in)e(suc)m(h)h(a)630 |
45c0f7f8 | 15964 | 2746 y(w)m(a)m(y)c(that)g(it)f(can)g(b)s(e)g(made)g(part)f(of)i(an)e |
eb0b2ad8 | 15965 | Fq(inputrc)35 b Ft(\014le.)41 b(This)29 b(command)h(is)g(un)m(b)s(ound) |
45c0f7f8 CR |
15966 | d(b)m(y)630 2856 y(default.)150 3014 y Fs(glob-complete-word)e(\(M-g\)) |
15967 | 630 3124 y Ft(The)i(w)m(ord)h(b)s(efore)f(p)s(oin)m(t)h(is)g(treated)h | |
eb0b2ad8 | 15968 | (as)f(a)h(pattern)f(for)f(pathname)h(expansion,)g(with)g(an)630 |
45c0f7f8 | 15969 | 3233 y(asterisk)d(implicitly)h(app)s(ended.)37 b(This)23 |
a8fd3f3e | 15970 | b(pattern)i(is)f(used)g(to)h(generate)h(a)e(list)h(of)g(matc)m(hing)630 |
45c0f7f8 CR |
15971 | 3343 y(\014le)30 b(names)h(for)f(p)s(ossible)g(completions.)150 |
15972 | 3501 y Fs(glob-expand-word)c(\(C-x)j(*\))630 3611 y Ft(The)40 | |
a8fd3f3e | 15973 | b(w)m(ord)g(b)s(efore)g(p)s(oin)m(t)h(is)g(treated)g(as)g(a)g(pattern)g |
45c0f7f8 | 15974 | (for)f(pathname)g(expansion,)k(and)630 3720 y(the)c(list)g(of)f(matc)m |
a8fd3f3e | 15975 | (hing)i(\014le)e(names)g(is)h(inserted,)h(replacing)g(the)e(w)m(ord.)67 |
45c0f7f8 | 15976 | b(If)39 b(a)h(n)m(umeric)630 3830 y(argumen)m(t)31 b(is)f(supplied,)g |
a8fd3f3e | 15977 | (a)g(`)p Fs(*)p Ft(')h(is)f(app)s(ended)f(b)s(efore)h(pathname)g |
45c0f7f8 CR |
15978 | (expansion.)150 3988 y Fs(glob-list-expansions)25 b(\(C-x)k(g\))630 |
15979 | 4098 y Ft(The)k(list)h(of)f(expansions)g(that)h(w)m(ould)f(ha)m(v)m(e)h | |
a8fd3f3e | 15980 | (b)s(een)f(generated)h(b)m(y)f Fs(glob-expand-word)630 |
45c0f7f8 | 15981 | 4208 y Ft(is)h(displa)m(y)m(ed,)h(and)e(the)h(line)g(is)f(redra)m(wn.) |
a8fd3f3e | 15982 | 50 b(If)33 b(a)h(n)m(umeric)g(argumen)m(t)g(is)f(supplied,)h(a)g(`)p |
45c0f7f8 CR |
15983 | Fs(*)p Ft(')630 4317 y(is)c(app)s(ended)f(b)s(efore)h(pathname)g |
15984 | (expansion.)150 4475 y Fs(display-shell-version)25 b(\(C-x)k(C-v\))630 | |
15985 | 4585 y Ft(Displa)m(y)j(v)m(ersion)e(information)h(ab)s(out)f(the)h | |
15986 | (curren)m(t)f(instance)h(of)f(Bash.)150 4743 y Fs(shell-expand-line)c | |
15987 | (\(M-C-e\))630 4853 y Ft(Expand)34 b(the)h(line)h(as)g(the)f(shell)h | |
3eb2d94a | 15988 | (do)s(es.)55 b(This)34 b(p)s(erforms)g(alias)i(and)f(history)g |
45c0f7f8 | 15989 | (expansion)630 4963 y(as)f(w)m(ell)g(as)g(all)h(of)e(the)h(shell)g(w)m |
3eb2d94a | 15990 | (ord)f(expansions)g(\(see)i(Section)f(3.5)h([Shell)e(Expansions],)630 |
45c0f7f8 CR |
15991 | 5072 y(page)e(20\).)150 5230 y Fs(history-expand-line)25 |
15992 | b(\(M-^\))630 5340 y Ft(P)m(erform)30 b(history)h(expansion)f(on)g(the) | |
15993 | h(curren)m(t)f(line.)p eop end | |
9f178efb CR |
15994 | %%Page: 124 130 |
15995 | TeXDict begin 124 129 bop 150 -116 a Ft(124)2527 b(Bash)31 | |
278286c9 CR |
15996 | b(Reference)g(Man)m(ual)150 299 y Fs(magic-space)c(\(\))630 |
15997 | 408 y Ft(P)m(erform)c(history)g(expansion)g(on)g(the)g(curren)m(t)g | |
15998 | (line)g(and)g(insert)g(a)g(space)h(\(see)g(Section)g(9.3)630 | |
9f178efb | 15999 | 518 y([History)31 b(In)m(teraction],)i(page)e(135\).)150 |
45c0f7f8 | 16000 | 686 y Fs(alias-expand-line)26 b(\(\))630 796 y Ft(P)m(erform)i(alias)i |
74d0116b | 16001 | (expansion)e(on)g(the)h(curren)m(t)f(line)h(\(see)g(Section)g(6.6)h |
9f178efb | 16002 | ([Aliases],)g(page)f(87\).)150 964 y Fs(history-and-alias-expand)o |
45c0f7f8 CR |
16003 | (-lin)o(e)24 b(\(\))630 1074 y Ft(P)m(erform)30 b(history)h(and)e |
16004 | (alias)j(expansion)e(on)g(the)h(curren)m(t)f(line.)150 | |
16005 | 1242 y Fs(insert-last-argument)25 b(\(M-.)k(or)h(M-_\))630 | |
16006 | 1352 y Ft(A)g(synon)m(ym)g(for)g Fs(yank-last-arg)p Ft(.)150 | |
16007 | 1520 y Fs(operate-and-get-next)25 b(\(C-o\))630 1630 | |
74d0116b CR |
16008 | y Ft(Accept)42 b(the)e(curren)m(t)h(line)f(for)h(execution)g(and)f |
16009 | (fetc)m(h)i(the)e(next)h(line)g(relativ)m(e)i(to)e(the)630 | |
45c0f7f8 CR |
16010 | 1739 y(curren)m(t)30 b(line)h(from)f(the)g(history)h(for)f(editing.)41 |
16011 | b(An)m(y)31 b(argumen)m(t)f(is)h(ignored.)150 1908 y | |
16012 | Fs(edit-and-execute-command)24 b(\(C-xC-e\))630 2017 | |
74d0116b CR |
16013 | y Ft(In)m(v)m(ok)m(e)34 b(an)f(editor)g(on)g(the)g(curren)m(t)f |
16014 | (command)h(line,)h(and)e(execute)i(the)f(result)g(as)g(shell)630 | |
45c0f7f8 | 16015 | 2127 y(commands.)81 b(Bash)44 b(attempts)h(to)g(in)m(v)m(ok)m(e)h |
74d0116b | 16016 | Fs($VISUAL)p Ft(,)f Fs($EDITOR)p Ft(,)h(and)d Fs(emacs)g |
45c0f7f8 CR |
16017 | Ft(as)h(the)630 2236 y(editor,)31 b(in)f(that)h(order.)150 |
16018 | 2482 y Fr(8.5)68 b(Readline)47 b(vi)e(Mo)t(de)150 2642 | |
74d0116b CR |
16019 | y Ft(While)32 b(the)g(Readline)g(library)f(do)s(es)g(not)h(ha)m(v)m(e)h |
16020 | (a)f(full)f(set)h(of)g Fs(vi)f Ft(editing)h(functions,)f(it)h(do)s(es)g | |
45c0f7f8 | 16021 | (con)m(tain)150 2751 y(enough)i(to)h(allo)m(w)g(simple)f(editing)h(of)f |
74d0116b | 16022 | (the)g(line.)52 b(The)34 b(Readline)g Fs(vi)g Ft(mo)s(de)f(b)s(eha)m(v) |
45c0f7f8 CR |
16023 | m(es)i(as)f(sp)s(eci\014ed)f(in)150 2861 y(the)e Fl(posix)e |
16024 | Ft(standard.)275 3004 y(In)35 b(order)g(to)i(switc)m(h)f(in)m(teractiv) | |
74d0116b CR |
16025 | m(ely)j(b)s(et)m(w)m(een)d Fs(emacs)f Ft(and)g Fs(vi)g |
16026 | Ft(editing)h(mo)s(des,)h(use)f(the)g(`)p Fs(set)30 b(-o)150 | |
45c0f7f8 | 16027 | 3114 y(emacs)p Ft(')43 b(and)h(`)p Fs(set)30 b(-o)f(vi)p |
74d0116b | 16028 | Ft(')44 b(commands)g(\(see)i(Section)f(4.3.1)h([The)e(Set)h(Builtin],)j |
9f178efb | 16029 | (page)e(58\).)83 b(The)150 3223 y(Readline)31 b(default)g(is)f |
45c0f7f8 | 16030 | Fs(emacs)f Ft(mo)s(de.)275 3367 y(When)g(y)m(ou)i(en)m(ter)f(a)h(line)f |
74d0116b | 16031 | (in)g Fs(vi)f Ft(mo)s(de,)h(y)m(ou)h(are)f(already)h(placed)f(in)g |
45c0f7f8 | 16032 | (`insertion')g(mo)s(de,)g(as)h(if)f(y)m(ou)150 3476 y(had)f(t)m(yp)s |
74d0116b CR |
16033 | (ed)g(an)g(`)p Fs(i)p Ft('.)41 b(Pressing)29 b Fs(ESC)f |
16034 | Ft(switc)m(hes)i(y)m(ou)g(in)m(to)h(`command')e(mo)s(de,)h(where)e(y)m | |
45c0f7f8 | 16035 | (ou)i(can)g(edit)g(the)150 3586 y(text)35 b(of)f(the)g(line)g(with)f |
74d0116b | 16036 | (the)h(standard)f Fs(vi)g Ft(mo)m(v)m(emen)m(t)j(k)m(eys,)g(mo)m(v)m(e) |
45c0f7f8 | 16037 | f(to)f(previous)g(history)f(lines)h(with)150 3695 y(`)p |
74d0116b | 16038 | Fs(k)p Ft(')d(and)e(subsequen)m(t)h(lines)h(with)f(`)p |
45c0f7f8 CR |
16039 | Fs(j)p Ft(',)g(and)g(so)h(forth.)150 3941 y Fr(8.6)68 |
16040 | b(Programmable)47 b(Completion)150 4101 y Ft(When)25 | |
74d0116b | 16041 | b(w)m(ord)g(completion)i(is)f(attempted)g(for)g(an)f(argumen)m(t)h(to)g |
45c0f7f8 | 16042 | (a)g(command)f(for)h(whic)m(h)f(a)h(completion)150 4210 |
74d0116b CR |
16043 | y(sp)s(eci\014cation)40 b(\(a)h Fq(compsp)s(ec)6 b Ft(\))39 |
16044 | b(has)h(b)s(een)f(de\014ned)f(using)h(the)h Fs(complete)d | |
45c0f7f8 | 16045 | Ft(builtin)j(\(see)g(Section)h(8.7)150 4320 y([Programmable)h |
9f178efb | 16046 | (Completion)f(Builtins],)k(page)d(126\),)j(the)c(programmable)g |
45c0f7f8 CR |
16047 | (completion)i(facilities)150 4429 y(are)31 b(in)m(v)m(ok)m(ed.)275 |
16048 | 4573 y(First,)23 b(the)e(command)g(name)g(is)h(iden)m(ti\014ed.)37 | |
74d0116b | 16049 | b(If)21 b(a)g(compsp)s(ec)g(has)g(b)s(een)f(de\014ned)g(for)h(that)h |
45c0f7f8 | 16050 | (command,)150 4682 y(the)44 b(compsp)s(ec)g(is)g(used)f(to)h(generate)i |
74d0116b | 16051 | (the)e(list)g(of)g(p)s(ossible)g(completions)h(for)e(the)h(w)m(ord.)81 |
45c0f7f8 | 16052 | b(If)44 b(the)150 4792 y(command)36 b(w)m(ord)g(is)g(the)g(empt)m(y)h |
74d0116b | 16053 | (string)f(\(completion)i(attempted)f(at)g(the)g(b)s(eginning)e(of)h(an) |
45c0f7f8 | 16054 | h(empt)m(y)150 4902 y(line\),)28 b(an)m(y)e(compsp)s(ec)f(de\014ned)g |
74d0116b | 16055 | (with)g(the)h(`)p Fs(-E)p Ft(')f(option)i(to)f Fs(complete)e |
8f714a7c | 16056 | Ft(is)h(used.)39 b(If)25 b(the)h(command)f(w)m(ord)150 |
45c0f7f8 | 16057 | 5011 y(is)i(a)h(full)e(pathname,)i(a)g(compsp)s(ec)e(for)h(the)g(full)g |
8f714a7c | 16058 | (pathname)g(is)g(searc)m(hed)h(for)f(\014rst.)39 b(If)26 |
45c0f7f8 | 16059 | b(no)h(compsp)s(ec)g(is)150 5121 y(found)22 b(for)g(the)h(full)g |
8f714a7c | 16060 | (pathname,)h(an)f(attempt)h(is)f(made)g(to)g(\014nd)f(a)h(compsp)s(ec)f |
45c0f7f8 | 16061 | (for)h(the)g(p)s(ortion)f(follo)m(wing)150 5230 y(the)34 |
8f714a7c CR |
16062 | b(\014nal)g(slash.)53 b(If)34 b(those)g(searc)m(hes)i(do)e(not)g |
16063 | (result)h(in)f(a)g(compsp)s(ec,)h(an)m(y)g(compsp)s(ec)f(de\014ned)f | |
45c0f7f8 CR |
16064 | (with)150 5340 y(the)e(`)p Fs(-D)p Ft(')f(option)h(to)g |
16065 | Fs(complete)d Ft(is)i(used)g(as)g(the)h(default.)p eop | |
16066 | end | |
9f178efb CR |
16067 | %%Page: 125 131 |
16068 | TeXDict begin 125 130 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
16069 | b(Command)29 b(Line)i(Editing)2062 b(125)275 299 y(Once)34 | |
278286c9 CR |
16070 | b(a)g(compsp)s(ec)g(has)g(b)s(een)f(found,)h(it)h(is)f(used)f(to)i |
16071 | (generate)h(the)e(list)h(of)f(matc)m(hing)h(w)m(ords.)51 | |
16072 | b(If)150 408 y(a)37 b(compsp)s(ec)f(is)g(not)h(found,)f(the)h(default)f | |
16073 | (Bash)h(completion)g(describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g | |
16074 | (8.4.6)150 518 y([Commands)30 b(F)-8 b(or)31 b(Completion],)g(page)g | |
9f178efb | 16075 | (120\))h(is)f(p)s(erformed.)275 655 y(First,)g(the)g(actions)g(sp)s |
278286c9 CR |
16076 | (eci\014ed)f(b)m(y)h(the)f(compsp)s(ec)h(are)g(used.)40 |
16077 | b(Only)30 b(matc)m(hes)i(whic)m(h)e(are)h(pre\014xed)150 | |
16078 | 765 y(b)m(y)25 b(the)h(w)m(ord)f(b)s(eing)f(completed)j(are)e | |
16079 | (returned.)38 b(When)25 b(the)h(`)p Fs(-f)p Ft(')f(or)g(`)p | |
37c41ab1 | 16080 | Fs(-d)p Ft(')g(option)h(is)f(used)g(for)g(\014lename)150 |
45c0f7f8 | 16081 | 874 y(or)30 b(directory)h(name)f(completion,)i(the)e(shell)h(v)-5 |
37c41ab1 | 16082 | b(ariable)31 b Fs(FIGNORE)d Ft(is)i(used)f(to)i(\014lter)g(the)f(matc)m |
45c0f7f8 | 16083 | (hes.)42 b(See)150 984 y(Section)31 b(5.2)h([Bash)e(V)-8 |
9f178efb | 16084 | b(ariables],)33 b(page)e(69,)g(for)f(a)h(description)g(of)f |
45c0f7f8 CR |
16085 | Fs(FIGNORE)p Ft(.)275 1121 y(An)m(y)f(completions)h(sp)s(eci\014ed)f(b) |
16086 | m(y)g(a)h(\014lename)f(expansion)h(pattern)f(to)h(the)g(`)p | |
16087 | Fs(-G)p Ft(')f(option)h(are)f(gener-)150 1230 y(ated)h(next.)40 | |
5e13499c | 16088 | b(The)29 b(w)m(ords)g(generated)h(b)m(y)f(the)h(pattern)f(need)g(not)g |
37c41ab1 | 16089 | (matc)m(h)i(the)e(w)m(ord)g(b)s(eing)g(completed.)150 |
45c0f7f8 | 16090 | 1340 y(The)42 b Fs(GLOBIGNORE)d Ft(shell)k(v)-5 b(ariable)43 |
37c41ab1 | 16091 | b(is)f(not)h(used)e(to)i(\014lter)f(the)h(matc)m(hes,)j(but)c(the)g |
45c0f7f8 CR |
16092 | Fs(FIGNORE)f Ft(shell)150 1450 y(v)-5 b(ariable)31 b(is)g(used.)275 |
16093 | 1587 y(Next,)k(the)g(string)e(sp)s(eci\014ed)h(as)g(the)g(argumen)m(t)g | |
37c41ab1 | 16094 | (to)h(the)f(`)p Fs(-W)p Ft(')g(option)g(is)g(considered.)52 |
45c0f7f8 | 16095 | b(The)33 b(string)150 1696 y(is)g(\014rst)e(split)i(using)f(the)h(c)m |
37c41ab1 CR |
16096 | (haracters)h(in)e(the)h Fs(IFS)e Ft(sp)s(ecial)j(v)-5 |
16097 | b(ariable)33 b(as)g(delimiters.)48 b(Shell)32 b(quoting)h(is)150 | |
45c0f7f8 | 16098 | 1806 y(honored.)56 b(Eac)m(h)37 b(w)m(ord)e(is)h(then)f(expanded)g |
74d0116b | 16099 | (using)h(brace)g(expansion,)h(tilde)f(expansion,)h(parameter)150 |
45c0f7f8 | 16100 | 1915 y(and)44 b(v)-5 b(ariable)46 b(expansion,)j(command)44 |
74d0116b | 16101 | b(substitution,)49 b(and)44 b(arithmetic)i(expansion,)j(as)c(describ)s |
45c0f7f8 CR |
16102 | (ed)150 2025 y(ab)s(o)m(v)m(e)38 b(\(see)f(Section)h(3.5)g([Shell)e |
16103 | (Expansions],)i(page)f(20\).)61 b(The)36 b(results)h(are)g(split)f | |
16104 | (using)h(the)f(rules)150 2134 y(describ)s(ed)29 b(ab)s(o)m(v)m(e)i | |
9f178efb | 16105 | (\(see)f(Section)h(3.5.7)h([W)-8 b(ord)30 b(Splitting],)h(page)f(28\).) |
45c0f7f8 | 16106 | 42 b(The)30 b(results)f(of)h(the)g(expansion)150 2244 |
74d0116b CR |
16107 | y(are)f(pre\014x-matc)m(hed)h(against)g(the)f(w)m(ord)g(b)s(eing)f |
16108 | (completed,)j(and)d(the)i(matc)m(hing)g(w)m(ords)e(b)s(ecome)i(the)150 | |
45c0f7f8 | 16109 | 2354 y(p)s(ossible)g(completions.)275 2491 y(After)f(these)g(matc)m |
74d0116b | 16110 | (hes)i(ha)m(v)m(e)f(b)s(een)f(generated,)h(an)m(y)g(shell)f(function)g |
45c0f7f8 | 16111 | (or)g(command)g(sp)s(eci\014ed)f(with)150 2600 y(the)i(`)p |
510e20a2 CR |
16112 | Fs(-F)p Ft(')g(and)f(`)p Fs(-C)p Ft(')h(options)g(is)g(in)m(v)m(ok)m |
16113 | (ed.)41 b(When)30 b(the)g(command)g(or)f(function)h(is)g(in)m(v)m(ok)m | |
45c0f7f8 | 16114 | (ed,)h(the)f Fs(COMP_)150 2710 y(LINE)p Ft(,)42 b Fs(COMP_POINT)p |
510e20a2 CR |
16115 | Ft(,)d Fs(COMP_KEY)p Ft(,)i(and)e Fs(COMP_TYPE)f Ft(v)-5 |
16116 | b(ariables)41 b(are)f(assigned)g(v)-5 b(alues)41 b(as)f(describ)s(ed) | |
45c0f7f8 | 16117 | 150 2819 y(ab)s(o)m(v)m(e)34 b(\(see)g(Section)g(5.2)g([Bash)f(V)-8 |
9f178efb | 16118 | b(ariables],)36 b(page)d(69\).)50 b(If)33 b(a)g(shell)g(function)g(is)g |
45c0f7f8 CR |
16119 | (b)s(eing)f(in)m(v)m(ok)m(ed,)k(the)150 2929 y Fs(COMP_WORDS)j |
16120 | Ft(and)i Fs(COMP_CWORD)d Ft(v)-5 b(ariables)42 b(are)g(also)h(set.)74 | |
16121 | b(When)41 b(the)h(function)f(or)h(command)f(is)150 3039 | |
16122 | y(in)m(v)m(ok)m(ed,)c(the)e(\014rst)f(argumen)m(t)h(\($1\))h(is)e(the)h | |
16123 | (name)g(of)f(the)h(command)f(whose)h(argumen)m(ts)f(are)h(b)s(eing)150 | |
16124 | 3148 y(completed,)30 b(the)f(second)f(argumen)m(t)h(\($2\))h(is)f(the)g | |
16125 | (w)m(ord)f(b)s(eing)g(completed,)i(and)e(the)h(third)e(argumen)m(t)150 | |
16126 | 3258 y(\($3\))40 b(is)f(the)f(w)m(ord)h(preceding)f(the)h(w)m(ord)f(b)s | |
16127 | (eing)g(completed)i(on)e(the)h(curren)m(t)f(command)h(line.)65 | |
16128 | b(No)150 3367 y(\014ltering)33 b(of)h(the)f(generated)h(completions)g | |
16129 | (against)h(the)e(w)m(ord)g(b)s(eing)f(completed)i(is)g(p)s(erformed;)f | |
16130 | (the)150 3477 y(function)d(or)g(command)h(has)f(complete)i(freedom)e | |
16131 | (in)g(generating)h(the)g(matc)m(hes.)275 3614 y(An)m(y)g(function)h(sp) | |
eb0b2ad8 CR |
16132 | s(eci\014ed)f(with)g(`)p Fs(-F)p Ft(')h(is)g(in)m(v)m(ok)m(ed)h |
16133 | (\014rst.)44 b(The)31 b(function)h(ma)m(y)g(use)g(an)m(y)g(of)g(the)g | |
45c0f7f8 | 16134 | (shell)150 3724 y(facilities,)50 b(including)44 b(the)h |
eb0b2ad8 | 16135 | Fs(compgen)d Ft(and)i Fs(compopt)e Ft(builtins)i(describ)s(ed)f(b)s |
45c0f7f8 | 16136 | (elo)m(w)h(\(see)i(Section)f(8.7)150 3833 y([Programmable)31 |
9f178efb | 16137 | b(Completion)h(Builtins],)f(page)h(126\),)g(to)g(generate)g(the)f(matc) |
45c0f7f8 | 16138 | m(hes.)42 b(It)31 b(m)m(ust)g(put)f(the)150 3943 y(p)s(ossible)g |
eb0b2ad8 | 16139 | (completions)h(in)f(the)h Fs(COMPREPLY)d Ft(arra)m(y)j(v)-5 |
45c0f7f8 CR |
16140 | b(ariable,)31 b(one)g(p)s(er)e(arra)m(y)i(elemen)m(t.)275 |
16141 | 4080 y(Next,)23 b(an)m(y)e(command)f(sp)s(eci\014ed)g(with)g(the)h(`)p | |
16142 | Fs(-C)p Ft(')f(option)h(is)g(in)m(v)m(ok)m(ed)h(in)e(an)g(en)m | |
16143 | (vironmen)m(t)h(equiv)-5 b(alen)m(t)150 4189 y(to)26 | |
16144 | b(command)e(substitution.)39 b(It)25 b(should)f(prin)m(t)h(a)g(list)h | |
16145 | (of)f(completions,)i(one)e(p)s(er)f(line,)j(to)f(the)f(standard)150 | |
16146 | 4299 y(output.)40 b(Bac)m(kslash)32 b(ma)m(y)f(b)s(e)f(used)g(to)h | |
eb0b2ad8 | 16147 | (escap)s(e)g(a)f(newline,)h(if)f(necessary)-8 b(.)275 |
45c0f7f8 | 16148 | 4436 y(After)42 b(all)g(of)g(the)g(p)s(ossible)g(completions)h(are)f |
eb0b2ad8 | 16149 | (generated,)k(an)m(y)c(\014lter)g(sp)s(eci\014ed)f(with)h(the)g(`)p |
45c0f7f8 | 16150 | Fs(-X)p Ft(')150 4545 y(option)34 b(is)f(applied)g(to)h(the)f(list.)49 |
eb0b2ad8 | 16151 | b(The)33 b(\014lter)g(is)g(a)h(pattern)f(as)g(used)g(for)g(pathname)g |
45c0f7f8 | 16152 | (expansion;)h(a)g(`)p Fs(&)p Ft(')150 4655 y(in)39 b(the)g(pattern)g |
eb0b2ad8 CR |
16153 | (is)g(replaced)g(with)g(the)g(text)h(of)f(the)g(w)m(ord)g(b)s(eing)f |
16154 | (completed.)68 b(A)39 b(literal)h(`)p Fs(&)p Ft(')f(ma)m(y)150 | |
45c0f7f8 | 16155 | 4765 y(b)s(e)e(escap)s(ed)h(with)g(a)h(bac)m(kslash;)k(the)38 |
eb0b2ad8 | 16156 | b(bac)m(kslash)h(is)f(remo)m(v)m(ed)h(b)s(efore)e(attempting)j(a)e |
45c0f7f8 | 16157 | (matc)m(h.)65 b(An)m(y)150 4874 y(completion)35 b(that)g(matc)m(hes)g |
eb0b2ad8 | 16158 | (the)f(pattern)g(will)g(b)s(e)g(remo)m(v)m(ed)h(from)e(the)h(list.)53 |
45c0f7f8 | 16159 | b(A)34 b(leading)g(`)p Fs(!)p Ft(')h(negates)150 4984 |
eb0b2ad8 CR |
16160 | y(the)c(pattern;)f(in)g(this)h(case)g(an)m(y)g(completion)g(not)g(matc) |
16161 | m(hing)h(the)e(pattern)h(will)f(b)s(e)g(remo)m(v)m(ed.)275 | |
45c0f7f8 | 16162 | 5121 y(Finally)-8 b(,)33 b(an)m(y)f(pre\014x)f(and)g(su\016x)g(sp)s |
eb0b2ad8 CR |
16163 | (eci\014ed)g(with)h(the)g(`)p Fs(-P)p Ft(')f(and)g(`)p |
16164 | Fs(-S)p Ft(')h(options)g(are)g(added)f(to)i(eac)m(h)150 | |
45c0f7f8 | 16165 | 5230 y(mem)m(b)s(er)e(of)g(the)h(completion)h(list,)f(and)f(the)h |
37c41ab1 | 16166 | (result)f(is)h(returned)e(to)i(the)g(Readline)g(completion)h(co)s(de) |
45c0f7f8 | 16167 | 150 5340 y(as)e(the)f(list)h(of)g(p)s(ossible)f(completions.)p |
510e20a2 | 16168 | eop end |
9f178efb CR |
16169 | %%Page: 126 132 |
16170 | TeXDict begin 126 131 bop 150 -116 a Ft(126)2527 b(Bash)31 | |
278286c9 CR |
16171 | b(Reference)g(Man)m(ual)275 299 y(If)22 b(the)i(previously-applied)f |
16172 | (actions)i(do)e(not)h(generate)h(an)m(y)f(matc)m(hes,)i(and)d(the)g(`)p | |
16173 | Fs(-o)30 b(dirnames)p Ft(')22 b(op-)150 408 y(tion)29 | |
16174 | b(w)m(as)f(supplied)f(to)i Fs(complete)d Ft(when)h(the)h(compsp)s(ec)g | |
16175 | (w)m(as)g(de\014ned,)g(directory)g(name)h(completion)150 | |
16176 | 518 y(is)h(attempted.)275 654 y(If)g(the)i(`)p Fs(-o)e(plusdirs)p | |
16177 | Ft(')f(option)j(w)m(as)f(supplied)f(to)i Fs(complete)e | |
16178 | Ft(when)g(the)h(compsp)s(ec)g(w)m(as)h(de\014ned,)150 | |
16179 | 764 y(directory)k(name)f(completion)i(is)e(attempted)h(and)f(an)m(y)h | |
16180 | (matc)m(hes)g(are)g(added)f(to)h(the)f(results)g(of)h(the)150 | |
16181 | 873 y(other)31 b(actions.)275 1010 y(By)g(default,)i(if)e(a)h(compsp)s | |
16182 | (ec)f(is)h(found,)f(whatev)m(er)h(it)g(generates)h(is)e(returned)g(to)h | |
16183 | (the)g(completion)150 1119 y(co)s(de)21 b(as)g(the)g(full)g(set)g(of)g | |
16184 | (p)s(ossible)f(completions.)39 b(The)20 b(default)h(Bash)g(completions) | |
16185 | h(are)g(not)f(attempted,)150 1229 y(and)k(the)h(Readline)g(default)g | |
16186 | (of)g(\014lename)g(completion)h(is)f(disabled.)38 b(If)26 | |
16187 | b(the)g(`)p Fs(-o)k(bashdefault)p Ft(')22 b(option)150 | |
16188 | 1338 y(w)m(as)i(supplied)e(to)j Fs(complete)c Ft(when)i(the)g(compsp)s | |
16189 | (ec)h(w)m(as)g(de\014ned,)g(the)f(default)h(Bash)g(completions)h(are) | |
16190 | 150 1448 y(attempted)f(if)f(the)g(compsp)s(ec)g(generates)i(no)e(matc)m | |
16191 | (hes.)39 b(If)23 b(the)g(`)p Fs(-o)30 b(default)p Ft(')21 | |
16192 | b(option)j(w)m(as)f(supplied)f(to)150 1557 y Fs(complete)j | |
16193 | Ft(when)h(the)h(compsp)s(ec)f(w)m(as)i(de\014ned,)e(Readline's)i | |
16194 | (default)f(completion)h(will)f(b)s(e)f(p)s(erformed)150 | |
16195 | 1667 y(if)k(the)h(compsp)s(ec)f(\(and,)g(if)h(attempted,)g(the)g | |
16196 | (default)f(Bash)h(completions\))h(generate)g(no)e(matc)m(hes.)275 | |
16197 | 1803 y(When)20 b(a)i(compsp)s(ec)e(indicates)i(that)g(directory)g(name) | |
16198 | f(completion)h(is)f(desired,)i(the)e(programmable)150 | |
45c0f7f8 | 16199 | 1913 y(completion)31 b(functions)e(force)i(Readline)f(to)h(app)s(end)d |
74d0116b | 16200 | (a)i(slash)g(to)g(completed)h(names)e(whic)m(h)h(are)g(sym-)150 |
45c0f7f8 | 16201 | 2022 y(b)s(olic)40 b(links)g(to)h(directories,)j(sub)5 |
74d0116b | 16202 | b(ject)40 b(to)h(the)f(v)-5 b(alue)41 b(of)f(the)g Fq(mark-directories) |
45c0f7f8 | 16203 | 45 b Ft(Readline)c(v)-5 b(ariable,)150 2132 y(regardless)31 |
74d0116b | 16204 | b(of)f(the)h(setting)g(of)g(the)f Fq(mark-symlink)m(ed-directories)36 |
45c0f7f8 | 16205 | b Ft(Readline)31 b(v)-5 b(ariable.)275 2268 y(There)25 |
74d0116b CR |
16206 | b(is)i(some)g(supp)s(ort)e(for)h(dynamically)h(mo)s(difying)f |
16207 | (completions.)40 b(This)26 b(is)g(most)h(useful)f(when)150 | |
45c0f7f8 | 16208 | 2378 y(used)37 b(in)h(com)m(bination)h(with)e(a)i(default)f(completion) |
74d0116b | 16209 | h(sp)s(eci\014ed)e(with)h(`)p Fs(-D)p Ft('.)63 b(It's)38 |
45c0f7f8 | 16210 | b(p)s(ossible)f(for)h(shell)150 2487 y(functions)28 b(executed)h(as)f |
74d0116b | 16211 | (completion)i(handlers)d(to)i(indicate)g(that)g(completion)g(should)e |
45c0f7f8 | 16212 | (b)s(e)h(retried)g(b)m(y)150 2597 y(returning)j(an)i(exit)g(status)f |
74d0116b | 16213 | (of)h(124.)48 b(If)31 b(a)i(shell)f(function)g(returns)f(124,)k(and)c |
45c0f7f8 | 16214 | (c)m(hanges)j(the)e(compsp)s(ec)150 2707 y(asso)s(ciated)43 |
74d0116b | 16215 | b(with)e(the)g(command)g(on)g(whic)m(h)g(completion)i(is)e(b)s(eing)g |
45c0f7f8 | 16216 | (attempted)h(\(supplied)e(as)i(the)150 2816 y(\014rst)29 |
74d0116b CR |
16217 | b(argumen)m(t)h(when)e(the)i(function)f(is)g(executed\),)j |
16218 | (programmable)d(completion)i(restarts)f(from)f(the)150 | |
45c0f7f8 | 16219 | 2926 y(b)s(eginning,)e(with)g(an)h(attempt)g(to)g(\014nd)e(a)i(new)e |
74d0116b | 16220 | (compsp)s(ec)i(for)f(that)h(command.)39 b(This)27 b(allo)m(ws)h(a)g |
45c0f7f8 | 16221 | (set)g(of)150 3035 y(completions)33 b(to)f(b)s(e)g(built)f(dynamically) |
510e20a2 | 16222 | i(as)f(completion)h(is)f(attempted,)h(rather)f(than)f(b)s(eing)g |
45c0f7f8 | 16223 | (loaded)150 3145 y(all)g(at)g(once.)275 3281 y(F)-8 b(or)38 |
510e20a2 CR |
16224 | b(instance,)h(assuming)e(that)h(there)f(is)h(a)f(library)g(of)g(compsp) |
16225 | s(ecs,)i(eac)m(h)g(k)m(ept)e(in)g(a)h(\014le)f(corre-)150 | |
45c0f7f8 | 16226 | 3391 y(sp)s(onding)g(to)j(the)f(name)f(of)h(the)g(command,)i(the)e |
510e20a2 | 16227 | (follo)m(wing)h(default)f(completion)h(function)e(w)m(ould)150 |
45c0f7f8 CR |
16228 | 3500 y(load)31 b(completions)g(dynamically:)390 3636 |
16229 | y Fs(_completion_loader\(\))390 3746 y({)581 3856 y(.)47 | |
16230 | b("/etc/bash_completion.d/$1)o(.sh)o(")42 b(>/dev/null)j(2>&1)i(&&)g | |
16231 | (return)f(124)390 3965 y(})390 4075 y(complete)g(-D)h(-F)g | |
16232 | (_completion_loader)150 4310 y Fr(8.7)68 b(Programmable)47 | |
16233 | b(Completion)f(Builtins)150 4469 y Ft(Three)21 b(builtin)g(commands)f | |
16234 | (are)i(a)m(v)-5 b(ailable)24 b(to)e(manipulate)f(the)h(programmable)f | |
16235 | (completion)h(facilities:)150 4579 y(one)34 b(to)g(sp)s(ecify)f(ho)m(w) | |
16236 | h(the)f(argumen)m(ts)h(to)g(a)g(particular)g(command)f(are)h(to)g(b)s | |
16237 | (e)f(completed,)j(and)d(t)m(w)m(o)150 4688 y(to)e(mo)s(dify)f(the)g | |
16238 | (completion)i(as)e(it)h(is)g(happ)s(ening.)150 4850 y | |
16239 | Fs(compgen)870 4985 y(compgen)46 b([)p Fi(option)11 b | |
16240 | Fs(])45 b([)p Fi(word)11 b Fs(])630 5121 y Ft(Generate)27 | |
16241 | b(p)s(ossible)e(completion)i(matc)m(hes)g(for)e Fq(w)m(ord)k | |
16242 | Ft(according)e(to)f(the)g Fq(option)p Ft(s,)h(whic)m(h)630 | |
16243 | 5230 y(ma)m(y)h(b)s(e)f(an)m(y)h(option)g(accepted)h(b)m(y)e(the)h | |
16244 | Fs(complete)d Ft(builtin)j(with)f(the)h(exception)g(of)g(`)p | |
16245 | Fs(-p)p Ft(')630 5340 y(and)k(`)p Fs(-r)p Ft(',)i(and)e(write)h(the)g | |
16246 | (matc)m(hes)h(to)g(the)f(standard)f(output.)48 b(When)33 | |
16247 | b(using)f(the)h(`)p Fs(-F)p Ft(')p eop end | |
9f178efb CR |
16248 | %%Page: 127 133 |
16249 | TeXDict begin 127 132 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
16250 | b(Command)29 b(Line)i(Editing)2062 b(127)630 299 y(or)28 | |
278286c9 CR |
16251 | b(`)p Fs(-C)p Ft(')g(options,)h(the)f(v)-5 b(arious)29 |
16252 | b(shell)f(v)-5 b(ariables)29 b(set)f(b)m(y)g(the)g(programmable)h | |
16253 | (completion)630 408 y(facilities,)k(while)d(a)m(v)-5 | |
16254 | b(ailable,)33 b(will)e(not)g(ha)m(v)m(e)g(useful)f(v)-5 | |
16255 | b(alues.)630 552 y(The)34 b(matc)m(hes)h(will)g(b)s(e)f(generated)h(in) | |
16256 | f(the)h(same)g(w)m(a)m(y)g(as)g(if)f(the)h(programmable)f(com-)630 | |
16257 | 662 y(pletion)d(co)s(de)g(had)f(generated)i(them)e(directly)i(from)e(a) | |
16258 | h(completion)h(sp)s(eci\014cation)f(with)630 771 y(the)e(same)h | |
16259 | (\015ags.)40 b(If)29 b Fq(w)m(ord)j Ft(is)d(sp)s(eci\014ed,)g(only)g | |
16260 | (those)h(completions)g(matc)m(hing)g Fq(w)m(ord)j Ft(will)630 | |
16261 | 881 y(b)s(e)d(displa)m(y)m(ed.)630 1025 y(The)24 b(return)g(v)-5 | |
16262 | b(alue)25 b(is)g(true)f(unless)g(an)h(in)m(v)-5 b(alid)25 | |
16263 | b(option)g(is)g(supplied,)f(or)h(no)g(matc)m(hes)g(w)m(ere)630 | |
16264 | 1134 y(generated.)150 1313 y Fs(complete)870 1456 y(complete)46 | |
16265 | b([-abcdefgjksuv])d([-o)k Fi(comp-option)11 b Fs(])44 | |
16266 | b([-DE])i([-A)h Fi(action)11 b Fs(])46 b([-)870 1566 | |
16267 | y(G)h Fi(globpat)11 b Fs(])46 b([-W)g Fi(wordlist)11 | |
45c0f7f8 | 16268 | b Fs(])870 1676 y([-F)47 b Fi(function)11 b Fs(])45 b([-C)i |
3eb2d94a | 16269 | Fi(command)11 b Fs(])45 b([-X)i Fi(filterpat)11 b Fs(])870 |
45c0f7f8 | 16270 | 1785 y([-P)47 b Fi(prefix)11 b Fs(])45 b([-S)i Fi(suffix)11 |
3eb2d94a | 16271 | b Fs(])45 b Fi(name)58 b Fs([)p Fi(name)f Fs(...)o(])870 |
45c0f7f8 CR |
16272 | 1895 y(complete)46 b(-pr)g([-DE])h([)p Fi(name)57 b Fs(...)o(])630 |
16273 | 2039 y Ft(Sp)s(ecify)33 b(ho)m(w)h(argumen)m(ts)h(to)f(eac)m(h)i | |
74d0116b | 16274 | Fq(name)j Ft(should)33 b(b)s(e)g(completed.)53 b(If)33 |
45c0f7f8 | 16275 | b(the)i(`)p Fs(-p)p Ft(')e(option)630 2148 y(is)d(supplied,)e(or)i(if)g |
74d0116b | 16276 | (no)f(options)h(are)g(supplied,)f(existing)h(completion)h(sp)s |
45c0f7f8 | 16277 | (eci\014cations)g(are)630 2258 y(prin)m(ted)43 b(in)h(a)g(w)m(a)m(y)h |
3eb2d94a | 16278 | (that)f(allo)m(ws)h(them)f(to)g(b)s(e)g(reused)f(as)h(input.)80 |
45c0f7f8 | 16279 | b(The)43 b(`)p Fs(-r)p Ft(')g(option)630 2367 y(remo)m(v)m(es)29 |
3eb2d94a CR |
16280 | b(a)e(completion)i(sp)s(eci\014cation)e(for)g(eac)m(h)i |
16281 | Fq(name)5 b Ft(,)28 b(or,)g(if)f(no)g Fq(name)5 b Ft(s)27 | |
45c0f7f8 | 16282 | b(are)h(supplied,)630 2477 y(all)46 b(completion)h(sp)s |
74d0116b | 16283 | (eci\014cations.)87 b(The)45 b(`)p Fs(-D)p Ft(')h(option)g(indicates)g |
45c0f7f8 | 16284 | (that)g(the)g(remaining)630 2587 y(options)35 b(and)f(actions)h(should) |
74d0116b | 16285 | f(apply)g(to)h(the)g(\\default")g(command)f(completion;)k(that)630 |
45c0f7f8 CR |
16286 | 2696 y(is,)25 b(completion)g(attempted)g(on)e(a)h(command)f(for)g(whic) |
16287 | m(h)h(no)f(completion)i(has)e(previously)630 2806 y(b)s(een)28 | |
510e20a2 CR |
16288 | b(de\014ned.)39 b(The)27 b(`)p Fs(-E)p Ft(')i(option)g(indicates)g |
16289 | (that)g(the)g(remaining)f(options)h(and)f(actions)630 | |
45c0f7f8 CR |
16290 | 2915 y(should)i(apply)i(to)g(\\empt)m(y")g(command)g(completion;)h |
16291 | (that)f(is,)g(completion)h(attempted)630 3025 y(on)d(a)h(blank)f(line.) | |
16292 | 630 3169 y(The)f(pro)s(cess)g(of)h(applying)g(these)g(completion)g(sp)s | |
16293 | (eci\014cations)h(when)d(w)m(ord)i(completion)630 3278 | |
510e20a2 | 16294 | y(is)35 b(attempted)h(is)f(describ)s(ed)f(ab)s(o)m(v)m(e)j(\(see)f |
45c0f7f8 | 16295 | (Section)g(8.6)g([Programmable)g(Completion],)630 3388 |
9f178efb | 16296 | y(page)31 b(124\).)42 b(The)30 b(`)p Fs(-D)p Ft(')h(option)f(tak)m(es)i |
45c0f7f8 | 16297 | (precedence)f(o)m(v)m(er)h(`)p Fs(-E)p Ft('.)630 3532 |
510e20a2 CR |
16298 | y(Other)41 b(options,)46 b(if)41 b(sp)s(eci\014ed,)j(ha)m(v)m(e)f(the)f |
16299 | (follo)m(wing)i(meanings.)75 b(The)41 b(argumen)m(ts)h(to)630 | |
45c0f7f8 | 16300 | 3641 y(the)e(`)p Fs(-G)p Ft(',)j(`)p Fs(-W)p Ft(',)g(and)d(`)p |
8f714a7c CR |
16301 | Fs(-X)p Ft(')g(options)g(\(and,)j(if)d(necessary)-8 b(,)44 |
16302 | b(the)c(`)p Fs(-P)p Ft(')h(and)e(`)p Fs(-S)p Ft(')h(options\))630 | |
45c0f7f8 | 16303 | 3751 y(should)30 b(b)s(e)h(quoted)g(to)h(protect)g(them)f(from)g |
37c41ab1 | 16304 | (expansion)g(b)s(efore)g(the)g Fs(complete)e Ft(builtin)630 |
45c0f7f8 CR |
16305 | 3861 y(is)h(in)m(v)m(ok)m(ed.)630 4039 y Fs(-o)g Fi(comp-option)1110 |
16306 | 4148 y Ft(The)c Fq(comp-option)i Ft(con)m(trols)g(sev)m(eral)h(asp)s | |
37c41ab1 | 16307 | (ects)e(of)g(the)g(compsp)s(ec's)g(b)s(eha)m(v-)1110 |
45c0f7f8 | 16308 | 4258 y(ior)g(b)s(ey)m(ond)f(the)g(simple)h(generation)h(of)e |
37c41ab1 | 16309 | (completions.)41 b Fq(comp-option)27 b Ft(ma)m(y)1110 |
45c0f7f8 CR |
16310 | 4367 y(b)s(e)j(one)g(of:)1110 4545 y Fs(bashdefault)1590 |
16311 | 4655 y Ft(P)m(erform)d(the)h(rest)f(of)h(the)g(default)f(Bash)h | |
16312 | (completions)g(if)g(the)1590 4765 y(compsp)s(ec)i(generates)i(no)e | |
16313 | (matc)m(hes.)1110 4943 y Fs(default)144 b Ft(Use)22 b(Readline's)g | |
37c41ab1 | 16314 | (default)g(\014lename)g(completion)g(if)g(the)g(comp-)1590 |
45c0f7f8 CR |
16315 | 5052 y(sp)s(ec)30 b(generates)i(no)e(matc)m(hes.)1110 |
16316 | 5230 y Fs(dirnames)96 b Ft(P)m(erform)46 b(directory)g(name)h | |
16317 | (completion)g(if)f(the)g(compsp)s(ec)1590 5340 y(generates)32 | |
16318 | b(no)e(matc)m(hes.)p eop end | |
9f178efb CR |
16319 | %%Page: 128 134 |
16320 | TeXDict begin 128 133 bop 150 -116 a Ft(128)2527 b(Bash)31 | |
278286c9 | 16321 | b(Reference)g(Man)m(ual)1110 299 y Fs(filenames)1590 |
45c0f7f8 CR |
16322 | 408 y Ft(T)-8 b(ell)40 b(Readline)f(that)h(the)f(compsp)s(ec)f |
16323 | (generates)j(\014lenames,)1590 518 y(so)29 b(it)h(can)f(p)s(erform)f | |
16324 | (an)m(y)h(\014lename-sp)s(eci\014c)h(pro)s(cessing)e(\(lik)m(e)1590 | |
16325 | 628 y(adding)d(a)h(slash)f(to)h(directory)g(names)f(quoting)h(sp)s | |
16326 | (ecial)g(c)m(har-)1590 737 y(acters,)39 b(or)d(suppressing)f(trailing)i | |
16327 | (spaces\).)59 b(This)35 b(option)i(is)1590 847 y(in)m(tended)30 | |
3eb2d94a | 16328 | b(to)g(b)s(e)g(used)f(with)g(shell)i(functions)e(sp)s(eci\014ed)g(with) |
45c0f7f8 CR |
16329 | 1590 956 y(`)p Fs(-F)p Ft('.)1110 1115 y Fs(noquote)144 |
16330 | b Ft(T)-8 b(ell)28 b(Readline)g(not)g(to)g(quote)g(the)g(completed)g(w) | |
16331 | m(ords)f(if)h(they)1590 1224 y(are)j(\014lenames)f(\(quoting)h | |
16332 | (\014lenames)g(is)f(the)h(default\).)1110 1383 y Fs(nospace)144 | |
3eb2d94a | 16333 | b Ft(T)-8 b(ell)40 b(Readline)g(not)g(to)g(app)s(end)d(a)j(space)g |
45c0f7f8 CR |
16334 | (\(the)f(default\))h(to)1590 1492 y(w)m(ords)30 b(completed)h(at)g(the) |
16335 | g(end)f(of)g(the)h(line.)1110 1650 y Fs(plusdirs)96 b | |
16336 | Ft(After)30 b(an)m(y)h(matc)m(hes)g(de\014ned)d(b)m(y)i(the)g(compsp)s | |
16337 | (ec)g(are)g(gener-)1590 1760 y(ated,)g(directory)f(name)g(completion)i | |
16338 | (is)d(attempted)i(and)f(an)m(y)1590 1870 y(matc)m(hes)j(are)e(added)g | |
16339 | (to)h(the)g(results)f(of)g(the)h(other)g(actions.)630 | |
16340 | 2028 y Fs(-A)f Fi(action)1110 2138 y Ft(The)25 b Fq(action)h | |
a9fac3b2 | 16341 | Ft(ma)m(y)g(b)s(e)e(one)h(of)h(the)f(follo)m(wing)i(to)e(generate)i(a)e |
45c0f7f8 CR |
16342 | (list)h(of)f(p)s(ossible)1110 2247 y(completions:)1110 |
16343 | 2405 y Fs(alias)240 b Ft(Alias)31 b(names.)41 b(Ma)m(y)31 | |
74d0116b | 16344 | b(also)h(b)s(e)e(sp)s(eci\014ed)f(as)i(`)p Fs(-a)p Ft('.)1110 |
45c0f7f8 CR |
16345 | 2564 y Fs(arrayvar)96 b Ft(Arra)m(y)31 b(v)-5 b(ariable)31 |
16346 | b(names.)1110 2722 y Fs(binding)144 b Ft(Readline)30 | |
74d0116b | 16347 | b(k)m(ey)f(binding)f(names)h(\(see)h(Section)f(8.4)h([Bindable)1590 |
9f178efb | 16348 | 2832 y(Readline)h(Commands],)f(page)h(115\).)1110 2990 |
74d0116b | 16349 | y Fs(builtin)144 b Ft(Names)21 b(of)g(shell)f(builtin)h(commands.)37 |
45c0f7f8 CR |
16350 | b(Ma)m(y)21 b(also)h(b)s(e)e(sp)s(eci\014ed)1590 3099 |
16351 | y(as)31 b(`)p Fs(-b)p Ft('.)1110 3258 y Fs(command)144 | |
eb0b2ad8 | 16352 | b Ft(Command)29 b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s |
45c0f7f8 CR |
16353 | (eci\014ed)f(as)i(`)p Fs(-c)p Ft('.)1110 3416 y Fs(directory)1590 |
16354 | 3526 y Ft(Directory)h(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s | |
16355 | (eci\014ed)g(as)g(`)p Fs(-d)p Ft('.)1110 3684 y Fs(disabled)96 | |
a9fac3b2 | 16356 | b Ft(Names)31 b(of)g(disabled)f(shell)g(builtins.)1110 |
45c0f7f8 CR |
16357 | 3842 y Fs(enabled)144 b Ft(Names)31 b(of)g(enabled)f(shell)g(builtins.) |
16358 | 1110 4001 y Fs(export)192 b Ft(Names)34 b(of)f(exp)s(orted)f(shell)h(v) | |
a9fac3b2 | 16359 | -5 b(ariables.)49 b(Ma)m(y)35 b(also)e(b)s(e)g(sp)s(eci-)1590 |
45c0f7f8 | 16360 | 4110 y(\014ed)d(as)g(`)p Fs(-e)p Ft('.)1110 4268 y Fs(file)288 |
22e63b05 | 16361 | b Ft(File)32 b(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f |
45c0f7f8 CR |
16362 | (as)i(`)p Fs(-f)p Ft('.)1110 4427 y Fs(function)96 b |
16363 | Ft(Names)31 b(of)g(shell)f(functions.)1110 4585 y Fs(group)240 | |
22e63b05 | 16364 | b Ft(Group)30 b(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)g |
45c0f7f8 CR |
16365 | (as)g(`)p Fs(-g)p Ft('.)1110 4743 y Fs(helptopic)1590 |
16366 | 4853 y Ft(Help)37 b(topics)g(as)g(accepted)h(b)m(y)e(the)h | |
16367 | Fs(help)f Ft(builtin)g(\(see)h(Sec-)1590 4963 y(tion)31 | |
9f178efb | 16368 | b(4.2)g([Bash)g(Builtins],)g(page)g(48\).)1110 5121 y |
22e63b05 | 16369 | Fs(hostname)96 b Ft(Hostnames,)89 b(as)76 b(tak)m(en)h(from)f(the)g |
45c0f7f8 | 16370 | (\014le)h(sp)s(eci\014ed)e(b)m(y)1590 5230 y(the)55 b |
22e63b05 | 16371 | Fs(HOSTFILE)e Ft(shell)j(v)-5 b(ariable)56 b(\(see)g(Section)g(5.2)h |
9f178efb | 16372 | ([Bash)1590 5340 y(V)-8 b(ariables],)32 b(page)f(69\).)p |
45c0f7f8 | 16373 | eop end |
9f178efb CR |
16374 | %%Page: 129 135 |
16375 | TeXDict begin 129 134 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
16376 | b(Command)29 b(Line)i(Editing)2062 b(129)1110 299 y Fs(job)336 | |
278286c9 | 16377 | b Ft(Job)31 b(names,)h(if)g(job)f(con)m(trol)i(is)f(activ)m(e.)46 |
45c0f7f8 CR |
16378 | b(Ma)m(y)33 b(also)g(b)s(e)e(sp)s(eci-)1590 408 y(\014ed)f(as)g(`)p |
16379 | Fs(-j)p Ft('.)1110 577 y Fs(keyword)144 b Ft(Shell)30 | |
16380 | b(reserv)m(ed)h(w)m(ords.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s | |
16381 | (eci\014ed)f(as)i(`)p Fs(-k)p Ft('.)1110 745 y Fs(running)144 | |
16382 | b Ft(Names)31 b(of)g(running)d(jobs,)i(if)h(job)f(con)m(trol)h(is)g | |
16383 | (activ)m(e.)1110 913 y Fs(service)144 b Ft(Service)31 | |
16384 | b(names.)41 b(Ma)m(y)31 b(also)g(b)s(e)f(sp)s(eci\014ed)g(as)g(`)p | |
16385 | Fs(-s)p Ft('.)1110 1081 y Fs(setopt)192 b Ft(V)-8 b(alid)34 | |
16386 | b(argumen)m(ts)f(for)f(the)h(`)p Fs(-o)p Ft(')g(option)g(to)h(the)f | |
16387 | Fs(set)e Ft(builtin)1590 1190 y(\(see)g(Section)h(4.3.1)g([The)e(Set)g | |
9f178efb | 16388 | (Builtin],)i(page)f(58\).)1110 1358 y Fs(shopt)240 b |
45c0f7f8 CR |
16389 | Ft(Shell)40 b(option)g(names)g(as)g(accepted)i(b)m(y)e(the)g |
16390 | Fs(shopt)e Ft(builtin)1590 1468 y(\(see)31 b(Section)h(4.2)f([Bash)g | |
9f178efb | 16391 | (Builtins],)g(page)g(48\).)1110 1636 y Fs(signal)192 |
45c0f7f8 CR |
16392 | b Ft(Signal)31 b(names.)1110 1804 y Fs(stopped)144 b |
16393 | Ft(Names)31 b(of)g(stopp)s(ed)e(jobs,)h(if)g(job)g(con)m(trol)i(is)f | |
16394 | (activ)m(e.)1110 1972 y Fs(user)288 b Ft(User)30 b(names.)41 | |
16395 | b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i(`)p | |
16396 | Fs(-u)p Ft('.)1110 2140 y Fs(variable)96 b Ft(Names)36 | |
16397 | b(of)g(all)g(shell)g(v)-5 b(ariables.)56 b(Ma)m(y)37 | |
16398 | b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)1590 2250 y(`)p | |
16399 | Fs(-v)p Ft('.)630 2418 y Fs(-C)30 b Fi(command)1110 2527 | |
16400 | y Fq(command)35 b Ft(is)e(executed)g(in)e(a)i(subshell)e(en)m(vironmen) | |
16401 | m(t,)i(and)f(its)g(output)g(is)1110 2637 y(used)e(as)g(the)h(p)s | |
16402 | (ossible)f(completions.)630 2805 y Fs(-F)g Fi(function)1110 | |
16403 | 2914 y Ft(The)39 b(shell)g(function)g Fq(function)g Ft(is)g(executed)h | |
16404 | (in)f(the)g(curren)m(t)g(shell)g(en)m(vi-)1110 3024 y(ronmen)m(t.)72 | |
16405 | b(When)41 b(it)g(is)g(executed,)k($1)c(is)g(the)g(name)g(of)g(the)g | |
16406 | (command)1110 3134 y(whose)34 b(argumen)m(ts)h(are)g(b)s(eing)f | |
16407 | (completed,)j($2)e(is)f(the)h(w)m(ord)f(b)s(eing)g(com-)1110 | |
16408 | 3243 y(pleted,)44 b(and)c($3)i(is)e(the)h(w)m(ord)g(preceding)f(the)h | |
16409 | (w)m(ord)f(b)s(eing)h(completed,)1110 3353 y(as)g(describ)s(ed)f(ab)s | |
16410 | (o)m(v)m(e)i(\(see)g(Section)f(8.6)h([Programmable)g(Completion],)1110 | |
9f178efb | 16411 | 3462 y(page)30 b(124\).)42 b(When)29 b(it)h(\014nishes,)e(the)h(p)s |
45c0f7f8 CR |
16412 | (ossible)g(completions)h(are)g(retriev)m(ed)1110 3572 |
16413 | y(from)g(the)g(v)-5 b(alue)31 b(of)g(the)f Fs(COMPREPLY)e | |
16414 | Ft(arra)m(y)j(v)-5 b(ariable.)630 3740 y Fs(-G)30 b Fi(globpat)1110 | |
16415 | 3850 y Ft(The)39 b(\014lename)h(expansion)g(pattern)g | |
16416 | Fq(globpat)j Ft(is)d(expanded)f(to)h(generate)1110 3959 | |
16417 | y(the)31 b(p)s(ossible)e(completions.)630 4127 y Fs(-P)h | |
16418 | Fi(prefix)1110 4237 y Fq(pre\014x)39 b Ft(is)34 b(added)f(at)i(the)f(b) | |
16419 | s(eginning)f(of)i(eac)m(h)g(p)s(ossible)e(completion)i(after)1110 | |
16420 | 4346 y(all)c(other)g(options)g(ha)m(v)m(e)g(b)s(een)f(applied.)630 | |
16421 | 4514 y Fs(-S)g Fi(suffix)1110 4624 y Fq(su\016x)c Ft(is)20 | |
a8fd3f3e | 16422 | b(app)s(ended)f(to)i(eac)m(h)h(p)s(ossible)e(completion)i(after)f(all)g |
45c0f7f8 CR |
16423 | (other)g(options)1110 4734 y(ha)m(v)m(e)32 b(b)s(een)d(applied.)630 |
16424 | 4902 y Fs(-W)h Fi(wordlist)1110 5011 y Ft(The)24 b Fq(w)m(ordlist)k | |
5cdaaf76 | 16425 | Ft(is)d(split)g(using)f(the)h(c)m(haracters)i(in)d(the)i |
45c0f7f8 | 16426 | Fs(IFS)e Ft(sp)s(ecial)h(v)-5 b(ariable)1110 5121 y(as)36 |
5cdaaf76 | 16427 | b(delimiters,)i(and)e(eac)m(h)h(resultan)m(t)g(w)m(ord)e(is)h |
45c0f7f8 | 16428 | (expanded.)57 b(The)35 b(p)s(ossible)1110 5230 y(completions)c(are)e |
5cdaaf76 | 16429 | (the)h(mem)m(b)s(ers)f(of)g(the)h(resultan)m(t)g(list)g(whic)m(h)f |
45c0f7f8 CR |
16430 | (matc)m(h)i(the)1110 5340 y(w)m(ord)f(b)s(eing)g(completed.)p |
16431 | eop end | |
9f178efb CR |
16432 | %%Page: 130 136 |
16433 | TeXDict begin 130 135 bop 150 -116 a Ft(130)2527 b(Bash)31 | |
278286c9 CR |
16434 | b(Reference)g(Man)m(ual)630 299 y Fs(-X)f Fi(filterpat)1110 |
16435 | 408 y Fq(\014lterpat)d Ft(is)e(a)g(pattern)g(as)f(used)g(for)h | |
16436 | (\014lename)g(expansion.)38 b(It)25 b(is)g(applied)f(to)1110 | |
16437 | 518 y(the)30 b(list)f(of)h(p)s(ossible)f(completions)h(generated)h(b)m | |
16438 | (y)e(the)g(preceding)h(options)1110 628 y(and)d(argumen)m(ts,)i(and)e | |
16439 | (eac)m(h)i(completion)g(matc)m(hing)g Fq(\014lterpat)h | |
45c0f7f8 CR |
16440 | Ft(is)e(remo)m(v)m(ed)1110 737 y(from)i(the)h(list.)42 |
16441 | b(A)30 b(leading)i(`)p Fs(!)p Ft(')e(in)g Fq(\014lterpat)j | |
16442 | Ft(negates)f(the)f(pattern;)g(in)f(this)1110 847 y(case,)i(an)m(y)e | |
16443 | (completion)i(not)f(matc)m(hing)g Fq(\014lterpat)i Ft(is)d(remo)m(v)m | |
16444 | (ed.)630 1038 y(The)35 b(return)g(v)-5 b(alue)37 b(is)f(true)f(unless)h | |
16445 | (an)f(in)m(v)-5 b(alid)37 b(option)f(is)g(supplied,)g(an)g(option)h | |
16446 | (other)630 1147 y(than)31 b(`)p Fs(-p)p Ft(')g(or)g(`)p | |
16447 | Fs(-r)p Ft(')g(is)g(supplied)f(without)h(a)g Fq(name)37 | |
16448 | b Ft(argumen)m(t,)32 b(an)f(attempt)h(is)f(made)g(to)630 | |
16449 | 1257 y(remo)m(v)m(e)h(a)e(completion)i(sp)s(eci\014cation)f(for)f(a)h | |
16450 | Fq(name)k Ft(for)30 b(whic)m(h)g(no)g(sp)s(eci\014cation)h(exists,)630 | |
16451 | 1366 y(or)f(an)h(error)f(o)s(ccurs)g(adding)g(a)g(completion)i(sp)s | |
16452 | (eci\014cation.)150 1557 y Fs(compopt)870 1707 y(compopt)46 | |
3eb2d94a | 16453 | b([-o)h Fi(option)11 b Fs(])45 b([-DE])h([+o)h Fi(option)11 |
45c0f7f8 | 16454 | b Fs(])46 b([)p Fi(name)11 b Fs(])630 1858 y Ft(Mo)s(dify)33 |
c302751c CR |
16455 | b(completion)h(options)g(for)f(eac)m(h)h Fq(name)39 b |
16456 | Ft(according)34 b(to)g(the)f Fq(option)p Ft(s,)i(or)e(for)g(the)630 | |
45c0f7f8 | 16457 | 1967 y(curren)m(tly-executing)46 b(completion)f(if)f(no)f |
c302751c | 16458 | Fq(name)5 b Ft(s)44 b(are)h(supplied.)80 b(If)43 b(no)h |
45c0f7f8 | 16459 | Fq(option)p Ft(s)h(are)630 2077 y(giv)m(en,)30 b(displa)m(y)e(the)g |
c302751c | 16460 | (completion)h(options)g(for)e(eac)m(h)i Fq(name)34 b |
45c0f7f8 CR |
16461 | Ft(or)27 b(the)i(curren)m(t)e(completion.)630 2186 y(The)f(p)s(ossible) |
16462 | g(v)-5 b(alues)27 b(of)f Fq(option)h Ft(are)g(those)g(v)-5 | |
3eb2d94a | 16463 | b(alid)26 b(for)g(the)h Fs(complete)d Ft(builtin)i(describ)s(ed)630 |
45c0f7f8 | 16464 | 2296 y(ab)s(o)m(v)m(e.)40 b(The)23 b(`)p Fs(-D)p Ft(')i(option)f |
3eb2d94a | 16465 | (indicates)h(that)g(the)f(remaining)g(options)h(should)e(apply)h(to)h |
45c0f7f8 CR |
16466 | (the)630 2406 y(\\default")33 b(command)f(completion;)i(that)f(is,)g |
16467 | (completion)g(attempted)g(on)f(a)g(command)630 2515 y(for)c(whic)m(h)f | |
3eb2d94a CR |
16468 | (no)h(completion)h(has)f(previously)g(b)s(een)f(de\014ned.)38 |
16469 | b(The)28 b(`)p Fs(-E)p Ft(')g(option)g(indicates)630 | |
45c0f7f8 CR |
16470 | 2625 y(that)c(the)g(remaining)g(options)g(should)e(apply)h(to)i(\\empt) |
16471 | m(y")g(command)e(completion;)k(that)630 2734 y(is,)k(completion)g | |
16472 | (attempted)h(on)e(a)h(blank)f(line.)630 2885 y(The)g(`)p | |
8f714a7c | 16473 | Fs(-D)p Ft(')g(option)h(tak)m(es)h(precedence)f(o)m(v)m(er)g(`)p |
45c0f7f8 | 16474 | Fs(-E)p Ft('.)630 3035 y(The)23 b(return)g(v)-5 b(alue)25 |
74d0116b | 16475 | b(is)f(true)g(unless)f(an)h(in)m(v)-5 b(alid)24 b(option)h(is)f |
45c0f7f8 | 16476 | (supplied,)g(an)g(attempt)h(is)f(made)630 3144 y(to)32 |
74d0116b CR |
16477 | b(mo)s(dify)f(the)g(options)h(for)f(a)h Fq(name)k Ft(for)31 |
16478 | b(whic)m(h)g(no)g(completion)i(sp)s(eci\014cation)f(exists,)630 | |
45c0f7f8 CR |
16479 | 3254 y(or)e(an)h(output)f(error)g(o)s(ccurs.)150 3534 |
16480 | y Fr(8.8)68 b(A)44 b(Programmable)j(Completion)f(Example)150 | |
16481 | 3693 y Ft(The)37 b(most)g(common)g(w)m(a)m(y)i(to)e(obtain)h | |
16482 | (additional)g(completion)g(functionalit)m(y)h(b)s(ey)m(ond)d(the)i | |
16483 | (default)150 3803 y(actions)29 b Fs(complete)d Ft(and)i | |
16484 | Fs(compgen)e Ft(pro)m(vide)i(is)h(to)f(use)g(a)h(shell)f(function)g | |
16485 | (and)g(bind)e(it)j(to)g(a)g(particular)150 3912 y(command)h(using)g | |
16486 | Fs(complete)e(-F)p Ft(.)275 4078 y(The)j(follo)m(wing)j(function)e(pro) | |
16487 | m(vides)g(completions)i(for)e(the)g Fs(cd)g Ft(builtin.)46 | |
16488 | b(It)32 b(is)h(a)f(reasonably)h(go)s(o)s(d)150 4188 y(example)e(of)f | |
16489 | (what)g(shell)g(functions)g(m)m(ust)f(do)h(when)f(used)h(for)f | |
16490 | (completion.)42 b(This)29 b(function)h(uses)g(the)150 | |
16491 | 4297 y(w)m(ord)38 b(passsed)g(as)h Fs($2)g Ft(to)g(determine)g(the)g | |
16492 | (directory)g(name)g(to)g(complete.)67 b(Y)-8 b(ou)40 | |
16493 | b(can)f(also)g(use)g(the)150 4407 y Fs(COMP_WORDS)28 | |
16494 | b Ft(arra)m(y)i(v)-5 b(ariable;)32 b(the)e(curren)m(t)h(w)m(ord)f(is)g | |
16495 | (indexed)g(b)m(y)g(the)h Fs(COMP_CWORD)c Ft(v)-5 b(ariable.)275 | |
16496 | 4573 y(The)42 b(function)h(relies)h(on)e(the)i Fs(complete)c | |
16497 | Ft(and)j Fs(compgen)e Ft(builtins)h(to)i(do)f(m)m(uc)m(h)g(of)g(the)h | |
16498 | (w)m(ork,)150 4682 y(adding)25 b(only)h(the)g(things)g(that)g(the)g | |
16499 | (Bash)g Fs(cd)f Ft(do)s(es)g(b)s(ey)m(ond)g(accepting)j(basic)e | |
16500 | (directory)g(names:)38 b(tilde)150 4792 y(expansion)21 | |
16501 | b(\(see)h(Section)g(3.5.2)h([Tilde)e(Expansion],)i(page)e(21\),)k | |
16502 | (searc)m(hing)d(directories)g(in)f Fq($CDP)-8 b(A)g(TH)10 | |
16503 | b Ft(,)150 4902 y(whic)m(h)21 b(is)h(describ)s(ed)e(ab)s(o)m(v)m(e)j | |
9f178efb | 16504 | (\(see)f(Section)h(4.1)f([Bourne)g(Shell)f(Builtins],)j(page)e(41\),)j |
45c0f7f8 CR |
16505 | (and)c(basic)h(supp)s(ort)150 5011 y(for)31 b(the)h Fs(cdable_vars)d |
16506 | Ft(shell)i(option)h(\(see)h(Section)f(4.3.2)i([The)d(Shopt)g(Builtin],) | |
9f178efb | 16507 | i(page)f(62\).)46 b Fs(_comp_)150 5121 y(cd)30 b Ft(mo)s(di\014es)g |
45c0f7f8 CR |
16508 | (the)h(v)-5 b(alue)31 b(of)g Fq(IFS)36 b Ft(so)31 b(that)g(it)g(con)m |
16509 | (tains)h(only)f(a)g(newline)g(to)h(accommo)s(date)g(\014le)f(names)150 | |
16510 | 5230 y(con)m(taining)i(spaces)g(and)e(tabs)h({)g Fs(compgen)e | |
16511 | Ft(prin)m(ts)h(the)h(p)s(ossible)f(completions)i(it)g(generates)g(one)f | |
16512 | (p)s(er)150 5340 y(line.)p eop end | |
9f178efb CR |
16513 | %%Page: 131 137 |
16514 | TeXDict begin 131 136 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
16515 | b(Command)29 b(Line)i(Editing)2062 b(131)275 299 y(P)m(ossible)24 | |
278286c9 CR |
16516 | b(completions)h(go)g(in)m(to)g(the)f Fq(COMPREPL)-8 b(Y)36 |
16517 | b Ft(arra)m(y)24 b(v)-5 b(ariable,)26 b(one)e(completion)i(p)s(er)c | |
16518 | (arra)m(y)150 408 y(elemen)m(t.)42 b(The)30 b(programmable)g | |
16519 | (completion)i(system)e(retriev)m(es)h(the)g(completions)g(from)f(there) | |
16520 | g(when)150 518 y(the)h(function)f(returns.)390 737 y | |
16521 | Fs(#)47 b(A)h(completion)d(function)g(for)i(the)g(cd)g(builtin)390 | |
16522 | 847 y(#)g(based)g(on)g(the)g(cd)g(completion)e(function)h(from)g(the)h | |
16523 | (bash_completion)d(package)390 956 y(_comp_cd\(\))390 | |
16524 | 1066 y({)581 1176 y(local)i(IFS=$')g(\\t\\n')190 b(#)47 | |
16525 | b(normalize)f(IFS)581 1285 y(local)g(cur)h(_skipdot)f(_cdpath)581 | |
16526 | 1395 y(local)g(i)i(j)f(k)581 1614 y(#)g(Tilde)g(expansion,)e(with)h | |
16527 | (side)h(effect)f(of)h(expanding)f(tilde)g(to)h(full)g(pathname)581 | |
16528 | 1724 y(case)g("$2")f(in)581 1833 y(\\~*\))190 b(eval)46 | |
16529 | b(cur="$2")g(;;)581 1943 y(*\))286 b(cur=$2)46 b(;;)581 | |
16530 | 2052 y(esac)581 2271 y(#)h(no)h(cdpath)e(or)h(absolute)e(pathname)h(--) | |
16531 | h(straight)f(directory)f(completion)581 2381 y(if)i([[)g(-z)g | |
16532 | ("${CDPATH:-}")e(]])i(||)g([[)g("$cur")f(==)h(@\(./*|../*|/*\))d(]];)j | |
16533 | (then)772 2491 y(#)g(compgen)f(prints)g(paths)h(one)f(per)h(line;)g | |
16534 | (could)f(also)h(use)g(while)f(loop)772 2600 y(IFS=$'\\n')772 | |
16535 | 2710 y(COMPREPLY=\()f($\(compgen)g(-d)i(--)g("$cur"\))f(\))772 | |
16536 | 2819 y(IFS=$')g(\\t\\n')581 2929 y(#)h(CDPATH+directories)c(in)k(the)g | |
16537 | (current)f(directory)f(if)j(not)e(in)i(CDPATH)581 3039 | |
16538 | y(else)772 3148 y(IFS=$'\\n')772 3258 y(_skipdot=false)772 | |
16539 | 3367 y(#)f(preprocess)e(CDPATH)h(to)i(convert)d(null)i(directory)e | |
16540 | (names)i(to)g(.)772 3477 y(_cdpath=${CDPATH/#:/.:})772 | |
16541 | 3587 y(_cdpath=${_cdpath//::/:.)o(:})772 3696 y | |
45c0f7f8 CR |
16542 | (_cdpath=${_cdpath/\045:/:.})772 3806 y(for)g(i)g(in)g |
16543 | (${_cdpath//:/$'\\n'};)c(do)963 3915 y(if)k([[)g($i)g(-ef)g(.)h(]];)f | |
16544 | (then)f(_skipdot=true;)e(fi)963 4025 y(k="${#COMPREPLY[@]}")963 | |
16545 | 4134 y(for)j(j)g(in)g($\()g(compgen)f(-d)h(--)h("$i/$cur")d(\);)i(do) | |
16546 | 1154 4244 y(COMPREPLY[k++]=${j#$i/})375 b(#)48 b(cut)f(off)f(directory) | |
16547 | 963 4354 y(done)772 4463 y(done)772 4573 y($_skipdot)f(||)i | |
16548 | (COMPREPLY+=\()e($\(compgen)g(-d)i(--)g("$cur"\))f(\))772 | |
16549 | 4682 y(IFS=$')g(\\t\\n')581 4792 y(fi)581 5011 y(#)h(variable)f(names)g | |
16550 | (if)h(appropriate)e(shell)i(option)f(set)h(and)f(no)i(completions)581 | |
16551 | 5121 y(if)f(shopt)f(-q)i(cdable_vars)c(&&)k([[)f(${#COMPREPLY[@]})c | |
16552 | (-eq)k(0)g(]];)g(then)772 5230 y(COMPREPLY=\()e($\(compgen)g(-v)i(--)g | |
16553 | ("$cur"\))f(\))581 5340 y(fi)p eop end | |
9f178efb CR |
16554 | %%Page: 132 138 |
16555 | TeXDict begin 132 137 bop 150 -116 a Ft(132)2527 b(Bash)31 | |
278286c9 CR |
16556 | b(Reference)g(Man)m(ual)581 408 y Fs(return)46 b(0)390 |
16557 | 518 y(})275 653 y Ft(W)-8 b(e)31 b(install)g(the)g(completion)h | |
45c0f7f8 CR |
16558 | (function)e(using)f(the)i(`)p Fs(-F)p Ft(')f(option)h(to)g |
16559 | Fs(complete)p Ft(:)390 787 y Fs(#)47 b(Tell)g(readline)f(to)h(quote)f | |
16560 | (appropriate)f(and)i(append)f(slashes)g(to)h(directories;)390 | |
16561 | 897 y(#)g(use)g(the)g(bash)g(default)f(completion)f(for)i(other)f | |
16562 | (arguments)390 1006 y(complete)g(-o)h(filenames)e(-o)i(nospace)f(-o)h | |
16563 | (bashdefault)e(-F)i(_comp_cd)f(cd)150 1141 y Ft(Since)33 | |
16564 | b(w)m(e'd)g(lik)m(e)i(Bash)e(and)f(Readline)i(to)g(tak)m(e)g(care)g(of) | |
16565 | f(some)h(of)f(the)g(other)h(details)g(for)e(us,)i(w)m(e)f(use)150 | |
16566 | 1250 y(sev)m(eral)40 b(other)f(options)g(to)g(tell)h(Bash)f(and)f | |
16567 | (Readline)h(what)f(to)i(do.)65 b(The)38 b(`)p Fs(-o)30 | |
16568 | b(filenames)p Ft(')36 b(option)150 1360 y(tells)42 b(Readline)g(that)g | |
16569 | (the)f(p)s(ossible)g(completions)h(should)f(b)s(e)f(treated)i(as)g | |
16570 | (\014lenames,)i(and)d(quoted)150 1469 y(appropriately)-8 | |
16571 | b(.)53 b(That)34 b(option)h(will)g(also)g(cause)g(Readline)g(to)g(app)s | |
16572 | (end)e(a)h(slash)g(to)h(\014lenames)g(it)g(can)150 1579 | |
16573 | y(determine)i(are)g(directories)h(\(whic)m(h)g(is)f(wh)m(y)f(w)m(e)i | |
16574 | (migh)m(t)f(w)m(an)m(t)h(to)g(extend)f Fs(_comp_cd)e | |
16575 | Ft(to)i(app)s(end)f(a)150 1689 y(slash)23 b(if)g(w)m(e're)h(using)f | |
16576 | (directories)i(found)d(via)h Fq(CDP)-8 b(A)g(TH)10 b | |
16577 | Ft(:)25 b(Readline)f(can't)g(tell)g(those)g(completions)h(are)150 | |
16578 | 1798 y(directories\).)41 b(The)27 b(`)p Fs(-o)j(nospace)p | |
16579 | Ft(')c(option)i(tells)g(Readline)h(to)f(not)g(app)s(end)d(a)j(space)g | |
16580 | (c)m(haracter)h(to)g(the)150 1908 y(directory)c(name,)h(in)e(case)h(w)m | |
16581 | (e)g(w)m(an)m(t)g(to)g(app)s(end)e(to)i(it.)39 b(The)24 | |
16582 | b(`)p Fs(-o)30 b(bashdefault)p Ft(')21 b(option)k(brings)f(in)g(the)150 | |
16583 | 2017 y(rest)29 b(of)f(the)h Fs(")p Ft(Bash)f(default)p | |
16584 | Fs(")h Ft(completions)g({)g(p)s(ossible)f(completion)i(that)f(Bash)f | |
16585 | (adds)g(to)h(the)g(default)150 2127 y(Readline)40 b(set.)68 | |
16586 | b(These)39 b(include)g(things)g(lik)m(e)i(command)e(name)g(completion,) | |
16587 | 44 b(v)-5 b(ariable)40 b(completion)150 2237 y(for)i(w)m(ords)g(b)s | |
16588 | (eginning)f(with)h(`)p Fs({)p Ft(',)k(completions)e(con)m(taining)f | |
16589 | (pathname)g(expansion)f(patterns)g(\(see)150 2346 y(Section)31 | |
9f178efb | 16590 | b(3.5.8)h([Filename)g(Expansion],)e(page)i(29\),)f(and)f(so)h(on.)275 |
45c0f7f8 CR |
16591 | 2481 y(Once)39 b(installed)i(using)e Fs(complete)p Ft(,)h |
16592 | Fs(_comp_cd)d Ft(will)j(b)s(e)g(called)g(ev)m(ery)h(time)f(w)m(e)g | |
16593 | (attempt)h(w)m(ord)150 2590 y(completion)32 b(for)e(a)h | |
16594 | Fs(cd)e Ft(command.)275 2725 y(Man)m(y)34 b(more)g(examples)g({)g(an)g | |
16595 | (extensiv)m(e)h(collection)i(of)c(completions)i(for)f(most)g(of)g(the)g | |
16596 | (common)150 2834 y(GNU,)g(Unix,)h(and)d(Lin)m(ux)h(commands)g({)h(are)g | |
16597 | (a)m(v)-5 b(ailable)36 b(as)e(part)f(of)h(the)f(bash)p | |
16598 | 2943 2834 28 4 v 39 w(completion)i(pro)5 b(ject.)150 | |
16599 | 2944 y(This)46 b(is)g(installed)i(b)m(y)e(default)h(on)g(man)m(y)f | |
16600 | (GNU/Lin)m(ux)i(distributions.)88 b(Originally)47 b(written)g(b)m(y)150 | |
16601 | 3054 y(Ian)29 b(Macdonald,)i(the)f(pro)5 b(ject)31 b(no)m(w)e(liv)m(es) | |
16602 | i(at)g Fs(http://bash-completion.a)o(liot)o(h.d)o(ebia)o(n.or)o(g/)p | |
16603 | Ft(.)150 3163 y(There)f(are)h(p)s(orts)e(for)h(other)h(systems)f(suc)m | |
16604 | (h)g(as)h(Solaris)g(and)f(Mac)h(OS)f(X.)275 3298 y(An)54 | |
16605 | b(older)h(v)m(ersion)h(of)f(the)g(bash)p 1532 3298 V | |
16606 | 40 w(completion)h(pac)m(k)-5 b(age)57 b(is)e(distributed)f(with)h(bash) | |
16607 | f(in)h(the)150 3407 y(`)p Fs(examples/complete)p Ft(')26 | |
16608 | b(sub)s(directory)-8 b(.)p eop end | |
9f178efb CR |
16609 | %%Page: 133 139 |
16610 | TeXDict begin 133 138 bop 150 -116 a Ft(Chapter)30 b(9:)41 | |
16611 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(133)150 | |
c302751c | 16612 | 299 y Fo(9)80 b(Using)53 b(History)g(In)l(teractiv)l(ely)150 |
45c0f7f8 | 16613 | 543 y Ft(This)42 b(c)m(hapter)h(describ)s(es)f(ho)m(w)g(to)h(use)g(the) |
c302751c | 16614 | f Fl(gnu)h Ft(History)g(Library)e(in)m(teractiv)m(ely)-8 |
45c0f7f8 | 16615 | b(,)50 b(from)42 b(a)h(user's)150 653 y(standp)s(oin)m(t.)76 |
37c41ab1 CR |
16616 | b(It)42 b(should)f(b)s(e)h(considered)g(a)g(user's)g(guide.)76 |
16617 | b(F)-8 b(or)43 b(information)f(on)g(using)g(the)g Fl(gnu)150 | |
45c0f7f8 CR |
16618 | 762 y Ft(History)31 b(Library)f(in)g(other)g(programs,)g(see)h(the)g |
16619 | Fl(gnu)f Ft(Readline)h(Library)f(Man)m(ual.)150 1000 | |
c302751c | 16620 | y Fr(9.1)68 b(Bash)45 b(History)h(F)-11 b(acilities)150 |
45c0f7f8 | 16621 | 1159 y Ft(When)40 b(the)h(`)p Fs(-o)30 b(history)p Ft(')38 |
c302751c | 16622 | b(option)j(to)g(the)g Fs(set)e Ft(builtin)h(is)h(enabled)f(\(see)h |
45c0f7f8 | 16623 | (Section)g(4.3.1)i([The)d(Set)150 1269 y(Builtin],)32 |
9f178efb | 16624 | b(page)g(58\),)h(the)e(shell)h(pro)m(vides)f(access)h(to)g(the)f |
c302751c | 16625 | Fq(command)g(history)p Ft(,)h(the)f(list)h(of)f(commands)150 |
45c0f7f8 | 16626 | 1378 y(previously)h(t)m(yp)s(ed.)47 b(The)33 b(v)-5 b(alue)33 |
c302751c CR |
16627 | b(of)f(the)h Fs(HISTSIZE)e Ft(shell)h(v)-5 b(ariable)34 |
16628 | b(is)f(used)e(as)i(the)g(n)m(um)m(b)s(er)e(of)i(com-)150 | |
45c0f7f8 | 16629 | 1488 y(mands)i(to)i(sa)m(v)m(e)h(in)e(a)g(history)h(list.)58 |
c302751c | 16630 | b(The)36 b(text)h(of)g(the)f(last)h Fs($HISTSIZE)d Ft(commands)i |
45c0f7f8 | 16631 | (\(default)g(500\))150 1597 y(is)h(sa)m(v)m(ed.)61 b(The)36 |
c302751c | 16632 | b(shell)h(stores)h(eac)m(h)g(command)e(in)h(the)g(history)g(list)g |
45c0f7f8 | 16633 | (prior)f(to)i(parameter)f(and)f(v)-5 b(ari-)150 1707 |
c302751c CR |
16634 | y(able)33 b(expansion)g(but)f(after)h(history)f(expansion)h(is)g(p)s |
16635 | (erformed,)e(sub)5 b(ject)33 b(to)g(the)g(v)-5 b(alues)33 | |
45c0f7f8 CR |
16636 | b(of)g(the)g(shell)150 1817 y(v)-5 b(ariables)31 b Fs(HISTIGNORE)d |
16637 | Ft(and)h Fs(HISTCONTROL)p Ft(.)275 1954 y(When)g(the)g(shell)h(starts)g | |
37c41ab1 | 16638 | (up,)f(the)h(history)f(is)h(initialized)h(from)e(the)h(\014le)f(named)g |
45c0f7f8 | 16639 | (b)m(y)h(the)f Fs(HISTFILE)150 2064 y Ft(v)-5 b(ariable)21 |
37c41ab1 CR |
16640 | b(\(default)h(`)p Fs(~/.bash_history)p Ft('\).)34 b(The)20 |
16641 | b(\014le)h(named)f(b)m(y)h(the)g(v)-5 b(alue)21 b(of)g | |
45c0f7f8 | 16642 | Fs(HISTFILE)d Ft(is)j(truncated,)150 2174 y(if)42 b(necessary)-8 |
37c41ab1 CR |
16643 | b(,)45 b(to)e(con)m(tain)g(no)f(more)g(than)f(the)h(n)m(um)m(b)s(er)f |
16644 | (of)h(lines)g(sp)s(eci\014ed)f(b)m(y)h(the)g(v)-5 b(alue)42 | |
9f178efb CR |
16645 | b(of)g(the)150 2283 y Fs(HISTFILESIZE)28 b Ft(v)-5 b(ariable.)46 |
16646 | b(When)31 b(a)h(shell)g(with)g(history)f(enabled)h(exits,)h(the)f(last) | |
16647 | h Fs($HISTSIZE)c Ft(lines)150 2393 y(are)35 b(copied)g(from)g(the)g | |
16648 | (history)f(list)i(to)f(the)g(\014le)g(named)f(b)m(y)h | |
16649 | Fs($HISTFILE)p Ft(.)51 b(If)35 b(the)g Fs(histappend)d | |
16650 | Ft(shell)150 2502 y(option)26 b(is)g(set)g(\(see)h(Section)f(4.2)h | |
16651 | ([Bash)f(Builtins],)h(page)g(48\),)h(the)e(lines)g(are)g(app)s(ended)e | |
16652 | (to)i(the)g(history)150 2612 y(\014le,)36 b(otherwise)f(the)g(history)f | |
16653 | (\014le)h(is)f(o)m(v)m(erwritten.)55 b(If)34 b Fs(HISTFILE)e | |
16654 | Ft(is)j(unset,)g(or)g(if)f(the)h(history)f(\014le)h(is)150 | |
16655 | 2721 y(un)m(writable,)f(the)f(history)g(is)g(not)h(sa)m(v)m(ed.)49 | |
16656 | b(After)34 b(sa)m(ving)g(the)f(history)-8 b(,)34 b(the)g(history)f | |
16657 | (\014le)g(is)g(truncated)150 2831 y(to)g(con)m(tain)h(no)f(more)g(than) | |
16658 | f Fs($HISTFILESIZE)d Ft(lines.)48 b(If)33 b Fs(HISTFILESIZE)c | |
16659 | Ft(is)k(unset,)g(or)f(set)i(to)f(n)m(ull,)h(a)150 2941 | |
16660 | y(non-n)m(umeric)c(v)-5 b(alue,)31 b(or)f(a)h(n)m(umeric)f(v)-5 | |
16661 | b(alue)31 b(less)g(than)f(zero,)h(the)g(history)f(\014le)h(is)f(not)h | |
45c0f7f8 | 16662 | (truncated.)275 3078 y(If)g(the)h Fs(HISTTIMEFORMAT)d |
37c41ab1 | 16663 | Ft(is)j(set,)h(the)f(time)h(stamp)f(information)g(asso)s(ciated)i(with) |
45c0f7f8 | 16664 | e(eac)m(h)h(history)150 3188 y(en)m(try)d(is)h(written)f(to)h(the)f |
d3ad40de | 16665 | (history)h(\014le,)f(mark)m(ed)h(with)f(the)g(history)g(commen)m(t)h(c) |
45c0f7f8 | 16666 | m(haracter.)43 b(When)30 b(the)150 3298 y(history)22 |
d3ad40de CR |
16667 | b(\014le)h(is)g(read,)h(lines)f(b)s(eginning)e(with)i(the)f(history)h |
16668 | (commen)m(t)g(c)m(haracter)h(follo)m(w)m(ed)h(immediately)150 | |
45c0f7f8 CR |
16669 | 3407 y(b)m(y)30 b(a)h(digit)g(are)g(in)m(terpreted)g(as)f(timestamps)h |
16670 | (for)f(the)h(previous)f(history)g(line.)275 3545 y(The)19 | |
d3ad40de CR |
16671 | b(builtin)h(command)g Fs(fc)g Ft(ma)m(y)h(b)s(e)f(used)f(to)i(list)g |
16672 | (or)g(edit)g(and)e(re-execute)j(a)f(p)s(ortion)f(of)g(the)h(history)150 | |
45c0f7f8 | 16673 | 3655 y(list.)41 b(The)27 b Fs(history)f Ft(builtin)i(ma)m(y)h(b)s(e)e |
37c41ab1 | 16674 | (used)g(to)i(displa)m(y)g(or)f(mo)s(dify)f(the)h(history)g(list)h(and)f |
45c0f7f8 | 16675 | (manipulate)150 3764 y(the)j(history)g(\014le.)42 b(When)31 |
37c41ab1 | 16676 | b(using)f(command-line)h(editing,)h(searc)m(h)f(commands)g(are)g(a)m(v) |
45c0f7f8 | 16677 | -5 b(ailable)33 b(in)e(eac)m(h)150 3874 y(editing)45 |
37c41ab1 CR |
16678 | b(mo)s(de)g(that)g(pro)m(vide)g(access)h(to)f(the)g(history)f(list)i |
16679 | (\(see)f(Section)h(8.4.2)g([Commands)e(F)-8 b(or)150 | |
9f178efb | 16680 | 3983 y(History],)31 b(page)h(116\).)275 4121 y(The)47 |
37c41ab1 CR |
16681 | b(shell)i(allo)m(ws)h(con)m(trol)f(o)m(v)m(er)h(whic)m(h)e(commands)g |
16682 | (are)h(sa)m(v)m(ed)g(on)f(the)h(history)f(list.)95 b(The)150 | |
45c0f7f8 | 16683 | 4231 y Fs(HISTCONTROL)25 b Ft(and)j Fs(HISTIGNORE)e Ft(v)-5 |
37c41ab1 | 16684 | b(ariables)29 b(ma)m(y)h(b)s(e)d(set)j(to)f(cause)g(the)g(shell)f(to)i |
45c0f7f8 | 16685 | (sa)m(v)m(e)g(only)f(a)g(subset)150 4340 y(of)e(the)g(commands)f(en)m |
37c41ab1 | 16686 | (tered.)40 b(The)26 b Fs(cmdhist)f Ft(shell)i(option,)h(if)f(enabled,)g |
45c0f7f8 | 16687 | (causes)h(the)e(shell)h(to)h(attempt)150 4450 y(to)23 |
37c41ab1 CR |
16688 | b(sa)m(v)m(e)h(eac)m(h)f(line)g(of)f(a)h(m)m(ulti-line)g(command)f(in)g |
16689 | (the)h(same)f(history)g(en)m(try)-8 b(,)25 b(adding)d(semicolons)h | |
45c0f7f8 | 16690 | (where)150 4560 y(necessary)37 b(to)f(preserv)m(e)h(syn)m(tactic)h |
37c41ab1 | 16691 | (correctness.)58 b(The)36 b Fs(lithist)e Ft(shell)i(option)h(causes)g |
45c0f7f8 | 16692 | (the)f(shell)g(to)150 4669 y(sa)m(v)m(e)25 b(the)e(command)h(with)f(em) |
37c41ab1 | 16693 | m(b)s(edded)f(newlines)h(instead)h(of)f(semicolons.)40 |
45c0f7f8 | 16694 | b(The)23 b Fs(shopt)e Ft(builtin)i(is)h(used)150 4779 |
37c41ab1 | 16695 | y(to)31 b(set)g(these)g(options.)41 b(See)31 b(Section)g(4.2)g([Bash)g |
9f178efb | 16696 | (Builtins],)g(page)g(48,)h(for)e(a)h(description)f(of)h |
45c0f7f8 CR |
16697 | Fs(shopt)p Ft(.)150 5016 y Fr(9.2)68 b(Bash)45 b(History)h(Builtins)150 |
16698 | 5176 y Ft(Bash)31 b(pro)m(vides)f(t)m(w)m(o)i(builtin)e(commands)g | |
c302751c CR |
16699 | (whic)m(h)g(manipulate)g(the)h(history)f(list)h(and)f(history)g |
16700 | (\014le.)150 5340 y Fs(fc)p eop end | |
9f178efb CR |
16701 | %%Page: 134 140 |
16702 | TeXDict begin 134 139 bop 150 -116 a Ft(134)2527 b(Bash)31 | |
c302751c CR |
16703 | b(Reference)g(Man)m(ual)870 299 y Fs(fc)47 b([-e)g Fi(ename)11 |
16704 | b Fs(])46 b([-lnr])g([)p Fi(first)11 b Fs(])45 b([)p | |
16705 | Fi(last)11 b Fs(])870 408 y(fc)47 b(-s)g([)p Fi(pat)11 | |
16706 | b Fs(=)p Fi(rep)g Fs(])45 b([)p Fi(command)11 b Fs(])630 | |
122f603c CR |
16707 | 557 y Ft(The)22 b(\014rst)g(form)f(selects)j(a)f(range)g(of)f(commands) |
16708 | g(from)g Fq(\014rst)i Ft(to)f Fq(last)i Ft(from)d(the)h(history)f(list) | |
16709 | 630 667 y(and)i(displa)m(ys)h(or)g(edits)h(and)e(re-executes)j(them.)39 | |
16710 | b(Both)25 b Fq(\014rst)h Ft(and)f Fq(last)j Ft(ma)m(y)d(b)s(e)g(sp)s | |
16711 | (eci\014ed)630 776 y(as)31 b(a)g(string)f(\(to)i(lo)s(cate)h(the)d | |
16712 | (most)h(recen)m(t)h(command)f(b)s(eginning)e(with)i(that)g(string\))g | |
16713 | (or)630 886 y(as)d(a)g(n)m(um)m(b)s(er)f(\(an)h(index)f(in)m(to)i(the)f | |
16714 | (history)g(list,)h(where)e(a)h(negativ)m(e)i(n)m(um)m(b)s(er)d(is)h | |
16715 | (used)f(as)630 996 y(an)g(o\013set)i(from)e(the)h(curren)m(t)f(command) | |
16716 | h(n)m(um)m(b)s(er\).)39 b(If)27 b Fq(last)j Ft(is)e(not)f(sp)s | |
16717 | (eci\014ed)g(it)h(is)g(set)g(to)630 1105 y Fq(\014rst)r | |
16718 | Ft(.)47 b(If)32 b Fq(\014rst)i Ft(is)e(not)h(sp)s(eci\014ed)f(it)h(is)g | |
16719 | (set)g(to)h(the)e(previous)g(command)h(for)f(editing)i(and)630 | |
16720 | 1215 y Fp(\000)p Ft(16)g(for)g(listing.)51 b(If)34 b(the)f(`)p | |
16721 | Fs(-l)p Ft(')h(\015ag)g(is)g(giv)m(en,)i(the)d(commands)h(are)g(listed) | |
16722 | g(on)g(standard)630 1324 y(output.)40 b(The)29 b(`)p | |
16723 | Fs(-n)p Ft(')h(\015ag)g(suppresses)e(the)i(command)f(n)m(um)m(b)s(ers)g | |
16724 | (when)f(listing.)42 b(The)29 b(`)p Fs(-r)p Ft(')630 1434 | |
16725 | y(\015ag)35 b(rev)m(erses)f(the)h(order)e(of)i(the)f(listing.)53 | |
16726 | b(Otherwise,)35 b(the)f(editor)h(giv)m(en)g(b)m(y)f Fq(ename)40 | |
16727 | b Ft(is)630 1543 y(in)m(v)m(ok)m(ed)33 b(on)f(a)g(\014le)g(con)m | |
16728 | (taining)h(those)f(commands.)44 b(If)31 b Fq(ename)38 | |
16729 | b Ft(is)31 b(not)h(giv)m(en,)i(the)d(v)-5 b(alue)630 | |
16730 | 1653 y(of)29 b(the)g(follo)m(wing)i(v)-5 b(ariable)29 | |
16731 | b(expansion)g(is)g(used:)39 b Fs(${FCEDIT:-${EDITOR:-vi}})p | |
16732 | Ft(.)34 b(This)630 1763 y(sa)m(ys)g(to)g(use)f(the)h(v)-5 | |
16733 | b(alue)34 b(of)f(the)h Fs(FCEDIT)e Ft(v)-5 b(ariable)34 | |
16734 | b(if)f(set,)i(or)f(the)f(v)-5 b(alue)34 b(of)g(the)g | |
16735 | Fs(EDITOR)630 1872 y Ft(v)-5 b(ariable)40 b(if)e(that)i(is)f(set,)i(or) | |
16736 | e Fs(vi)f Ft(if)h(neither)g(is)g(set.)66 b(When)39 b(editing)g(is)g | |
16737 | (complete,)k(the)630 1982 y(edited)31 b(commands)f(are)g(ec)m(ho)s(ed)h | |
16738 | (and)f(executed.)630 2131 y(In)k(the)g(second)g(form,)h | |
16739 | Fq(command)j Ft(is)c(re-executed)i(after)f(eac)m(h)g(instance)g(of)f | |
16740 | Fq(pat)j Ft(in)d(the)630 2240 y(selected)e(command)e(is)h(replaced)g(b) | |
16741 | m(y)f Fq(rep)s Ft(.)40 b Fq(command)34 b Ft(is)c(in)m(tepreted)h(the)g | |
16742 | (same)g(as)g Fq(\014rst)630 2350 y Ft(ab)s(o)m(v)m(e.)630 | |
16743 | 2498 y(A)g(useful)f(alias)i(to)g(use)e(with)h(the)g Fs(fc)f | |
16744 | Ft(command)h(is)g Fs(r='fc)e(-s')p Ft(,)h(so)h(that)h(t)m(yping)f(`)p | |
16745 | Fs(r)f(cc)p Ft(')630 2608 y(runs)35 b(the)h(last)h(command)f(b)s | |
16746 | (eginning)g(with)g Fs(cc)f Ft(and)h(t)m(yping)g(`)p Fs(r)p | |
16747 | Ft(')h(re-executes)h(the)e(last)630 2718 y(command)30 | |
9f178efb | 16748 | b(\(see)h(Section)h(6.6)f([Aliases],)h(page)g(87\).)150 |
122f603c CR |
16749 | 2906 y Fs(history)870 3054 y(history)46 b([)p Fi(n)11 |
16750 | b Fs(])870 3164 y(history)46 b(-c)870 3273 y(history)g(-d)h | |
16751 | Fi(offset)870 3383 y Fs(history)f([-anrw])g([)p Fi(filename)11 | |
16752 | b Fs(])870 3493 y(history)46 b(-ps)h Fi(arg)630 3641 | |
37c41ab1 CR |
16753 | y Ft(With)26 b(no)g(options,)h(displa)m(y)f(the)g(history)g(list)g |
16754 | (with)f(line)h(n)m(um)m(b)s(ers.)38 b(Lines)26 b(pre\014xed)e(with)630 | |
122f603c | 16755 | 3751 y(a)35 b(`)p Fs(*)p Ft(')g(ha)m(v)m(e)h(b)s(een)e(mo)s(di\014ed.) |
37c41ab1 | 16756 | 53 b(An)34 b(argumen)m(t)h(of)g Fq(n)f Ft(lists)i(only)f(the)g(last)g |
122f603c | 16757 | Fq(n)f Ft(lines.)54 b(If)35 b(the)630 3861 y(shell)30 |
37c41ab1 CR |
16758 | b(v)-5 b(ariable)31 b Fs(HISTTIMEFORMAT)26 b Ft(is)k(set)h(and)e(not)i |
16759 | (n)m(ull,)f(it)h(is)f(used)f(as)h(a)h(format)f(string)630 | |
122f603c | 16760 | 3970 y(for)36 b Fq(strftime)41 b Ft(to)36 b(displa)m(y)g(the)g(time)h |
37c41ab1 | 16761 | (stamp)f(asso)s(ciated)h(with)f(eac)m(h)h(displa)m(y)m(ed)f(history)630 |
122f603c | 16762 | 4080 y(en)m(try)-8 b(.)47 b(No)33 b(in)m(terv)m(ening)g(blank)f(is)g |
37c41ab1 | 16763 | (prin)m(ted)g(b)s(et)m(w)m(een)h(the)g(formatted)f(time)h(stamp)g(and) |
122f603c CR |
16764 | 630 4189 y(the)e(history)f(line.)630 4338 y(Options,)g(if)h(supplied,)e |
16765 | (ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 4526 | |
37c41ab1 CR |
16766 | y Fs(-c)384 b Ft(Clear)23 b(the)g(history)g(list.)39 |
16767 | b(This)22 b(ma)m(y)i(b)s(e)e(com)m(bined)h(with)f(the)h(other)h | |
122f603c CR |
16768 | (options)1110 4635 y(to)31 b(replace)g(the)g(history)f(list)h |
16769 | (completely)-8 b(.)630 4823 y Fs(-d)30 b Fi(offset)1110 | |
16770 | 4933 y Ft(Delete)25 b(the)f(history)f(en)m(try)g(at)h(p)s(osition)f | |
c302751c | 16771 | Fq(o\013set)r Ft(.)39 b Fq(o\013set)26 b Ft(should)c(b)s(e)h(sp)s |
122f603c CR |
16772 | (eci\014ed)1110 5043 y(as)31 b(it)g(app)s(ears)e(when)h(the)g(history)g |
16773 | (is)h(displa)m(y)m(ed.)630 5230 y Fs(-a)384 b Ft(App)s(end)35 | |
c302751c | 16774 | b(the)i(new)g(history)g(lines)g(\(history)g(lines)g(en)m(tered)h(since) |
122f603c CR |
16775 | f(the)g(b)s(e-)1110 5340 y(ginning)30 b(of)h(the)f(curren)m(t)g(Bash)h |
16776 | (session\))g(to)g(the)g(history)f(\014le.)p eop end | |
9f178efb CR |
16777 | %%Page: 135 141 |
16778 | TeXDict begin 135 140 bop 150 -116 a Ft(Chapter)30 b(9:)41 | |
16779 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(135)630 | |
122f603c CR |
16780 | 299 y Fs(-n)384 b Ft(App)s(end)32 b(the)i(history)f(lines)h(not)g |
16781 | (already)g(read)g(from)f(the)h(history)f(\014le)h(to)1110 | |
16782 | 408 y(the)26 b(curren)m(t)f(history)g(list.)40 b(These)25 | |
16783 | b(are)h(lines)g(app)s(ended)e(to)i(the)f(history)h(\014le)1110 | |
16784 | 518 y(since)31 b(the)f(b)s(eginning)g(of)g(the)h(curren)m(t)f(Bash)h | |
16785 | (session.)630 690 y Fs(-r)384 b Ft(Read)31 b(the)f(history)g(\014le)h | |
16786 | (and)f(app)s(end)e(its)j(con)m(ten)m(ts)h(to)f(the)g(history)f(list.) | |
16787 | 630 863 y Fs(-w)384 b Ft(W)-8 b(rite)32 b(out)e(the)h(curren)m(t)f | |
16788 | (history)g(list)h(to)h(the)e(history)g(\014le.)630 1035 | |
16789 | y Fs(-p)384 b Ft(P)m(erform)31 b(history)f(substitution)h(on)f(the)h | |
16790 | Fq(arg)8 b Ft(s)31 b(and)f(displa)m(y)h(the)f(result)h(on)1110 | |
16791 | 1145 y(the)d(standard)f(output,)i(without)f(storing)g(the)g(results)g | |
16792 | (in)g(the)g(history)g(list.)630 1317 y Fs(-s)384 b Ft(The)30 | |
c302751c CR |
16793 | b Fq(arg)8 b Ft(s)30 b(are)h(added)f(to)h(the)f(end)g(of)h(the)f |
16794 | (history)h(list)g(as)f(a)h(single)g(en)m(try)-8 b(.)630 | |
122f603c | 16795 | 1489 y(When)24 b(an)m(y)h(of)f(the)h(`)p Fs(-w)p Ft(',)h(`)p |
c302751c CR |
16796 | Fs(-r)p Ft(',)f(`)p Fs(-a)p Ft(',)h(or)f(`)p Fs(-n)p |
16797 | Ft(')f(options)g(is)h(used,)g(if)f Fq(\014lename)30 b | |
122f603c | 16798 | Ft(is)24 b(giv)m(en,)j(then)630 1599 y(it)32 b(is)g(used)f(as)h(the)f |
37c41ab1 CR |
16799 | (history)h(\014le.)45 b(If)31 b(not,)h(then)g(the)f(v)-5 |
16800 | b(alue)32 b(of)g(the)g Fs(HISTFILE)d Ft(v)-5 b(ariable)33 | |
122f603c CR |
16801 | b(is)630 1709 y(used.)150 1961 y Fr(9.3)68 b(History)46 |
16802 | b(Expansion)150 2120 y Ft(The)f(History)h(library)e(pro)m(vides)i(a)f | |
c302751c | 16803 | (history)g(expansion)g(feature)h(that)g(is)f(similar)h(to)g(the)f |
122f603c | 16804 | (history)150 2230 y(expansion)g(pro)m(vided)f(b)m(y)h |
c302751c | 16805 | Fs(csh)p Ft(.)83 b(This)44 b(section)i(describ)s(es)e(the)h(syn)m(tax)h |
122f603c CR |
16806 | (used)e(to)i(manipulate)f(the)150 2339 y(history)30 b(information.)275 |
16807 | 2487 y(History)h(expansions)f(in)m(tro)s(duce)g(w)m(ords)g(from)g(the)h | |
c302751c | 16808 | (history)f(list)h(in)m(to)g(the)g(input)f(stream,)h(making)150 |
122f603c | 16809 | 2596 y(it)g(easy)g(to)g(rep)s(eat)g(commands,)f(insert)g(the)h(argumen) |
37c41ab1 | 16810 | m(ts)f(to)h(a)g(previous)f(command)g(in)m(to)i(the)e(curren)m(t)150 |
122f603c CR |
16811 | 2706 y(input)f(line,)i(or)g(\014x)f(errors)f(in)h(previous)g(commands)g |
16812 | (quic)m(kly)-8 b(.)275 2853 y(History)27 b(expansion)f(tak)m(es)i | |
37c41ab1 | 16813 | (place)f(in)f(t)m(w)m(o)i(parts.)39 b(The)26 b(\014rst)g(is)g(to)h |
122f603c | 16814 | (determine)g(whic)m(h)f(line)h(from)f(the)150 2963 y(history)i(list)g |
37c41ab1 CR |
16815 | (should)f(b)s(e)g(used)g(during)g(substitution.)39 b(The)27 |
16816 | b(second)h(is)g(to)h(select)g(p)s(ortions)e(of)h(that)h(line)150 | |
122f603c | 16817 | 3072 y(for)d(inclusion)f(in)m(to)i(the)f(curren)m(t)f(one.)40 |
37c41ab1 | 16818 | b(The)25 b(line)h(selected)h(from)f(the)g(history)f(is)h(called)h(the)f |
122f603c | 16819 | Fq(ev)m(en)m(t)p Ft(,)j(and)150 3182 y(the)21 b(p)s(ortions)g(of)g |
37c41ab1 CR |
16820 | (that)h(line)f(that)h(are)g(acted)g(up)s(on)e(are)h(called)h |
16821 | Fq(w)m(ords)p Ft(.)38 b(V)-8 b(arious)21 b Fq(mo)s(di\014ers)j | |
122f603c | 16822 | Ft(are)e(a)m(v)-5 b(ailable)150 3292 y(to)35 b(manipulate)f(the)g |
37c41ab1 | 16823 | (selected)i(w)m(ords.)51 b(The)33 b(line)h(is)g(brok)m(en)g(in)m(to)h |
122f603c | 16824 | (w)m(ords)e(in)h(the)g(same)h(fashion)e(that)150 3401 |
37c41ab1 CR |
16825 | y(Bash)i(do)s(es,)h(so)f(that)h(sev)m(eral)g(w)m(ords)e(surrounded)f(b) |
16826 | m(y)i(quotes)g(are)g(considered)g(one)g(w)m(ord.)54 b(History)150 | |
122f603c | 16827 | 3511 y(expansions)34 b(are)g(in)m(tro)s(duced)f(b)m(y)h(the)g(app)s |
37c41ab1 | 16828 | (earance)g(of)g(the)g(history)g(expansion)g(c)m(haracter,)i(whic)m(h)e |
122f603c | 16829 | (is)150 3620 y(`)p Fs(!)p Ft(')d(b)m(y)f(default.)41 |
37c41ab1 CR |
16830 | b(Only)29 b(`)p Fs(\\)p Ft(')i(and)f(`)p Fs(')p Ft(')g(ma)m(y)h(b)s(e)f |
16831 | (used)g(to)h(escap)s(e)g(the)f(history)g(expansion)h(c)m(haracter.)275 | |
122f603c | 16832 | 3768 y(Sev)m(eral)40 b(shell)g(options)g(settable)h(with)e(the)h |
37c41ab1 | 16833 | Fs(shopt)e Ft(builtin)h(\(see)h(Section)h(4.2)f([Bash)g(Builtins],)150 |
9f178efb | 16834 | 3877 y(page)32 b(48\))h(ma)m(y)f(b)s(e)f(used)g(to)i(tailor)g(the)e(b)s |
37c41ab1 | 16835 | (eha)m(vior)h(of)g(history)g(expansion.)44 b(If)31 b(the)h |
122f603c | 16836 | Fs(histverify)d Ft(shell)150 3987 y(option)39 b(is)f(enabled,)i(and)e |
37c41ab1 | 16837 | (Readline)g(is)h(b)s(eing)e(used,)j(history)e(substitutions)g(are)g |
122f603c | 16838 | (not)h(immediately)150 4097 y(passed)30 b(to)h(the)g(shell)g(parser.)40 |
37c41ab1 | 16839 | b(Instead,)30 b(the)h(expanded)f(line)h(is)f(reloaded)h(in)m(to)h(the)e |
122f603c | 16840 | (Readline)h(editing)150 4206 y(bu\013er)e(for)i(further)e(mo)s |
37c41ab1 | 16841 | (di\014cation.)41 b(If)30 b(Readline)h(is)f(b)s(eing)g(used,)g(and)g |
122f603c | 16842 | (the)g Fs(histreedit)e Ft(shell)i(option)150 4316 y(is)k(enabled,)h(a)g |
37c41ab1 | 16843 | (failed)g(history)f(expansion)g(will)g(b)s(e)g(reloaded)g(in)m(to)h |
122f603c | 16844 | (the)g(Readline)f(editing)h(bu\013er)e(for)150 4425 y(correction.)74 |
37c41ab1 CR |
16845 | b(The)41 b(`)p Fs(-p)p Ft(')g(option)g(to)h(the)f Fs(history)f |
16846 | Ft(builtin)g(command)h(ma)m(y)h(b)s(e)e(used)h(to)g(see)h(what)150 | |
122f603c | 16847 | 4535 y(a)c(history)g(expansion)f(will)h(do)f(b)s(efore)h(using)f(it.)63 |
37c41ab1 | 16848 | b(The)37 b(`)p Fs(-s)p Ft(')g(option)h(to)h(the)f Fs(history)d |
122f603c | 16849 | Ft(builtin)i(ma)m(y)150 4645 y(b)s(e)c(used)h(to)g(add)g(commands)f(to) |
37c41ab1 | 16850 | i(the)f(end)g(of)g(the)g(history)g(list)h(without)f(actually)i |
122f603c | 16851 | (executing)f(them,)150 4754 y(so)j(that)h(they)f(are)g(a)m(v)-5 |
37c41ab1 | 16852 | b(ailable)40 b(for)e(subsequen)m(t)f(recall.)65 b(This)37 |
122f603c CR |
16853 | b(is)h(most)g(useful)g(in)f(conjunction)h(with)150 4864 |
16854 | y(Readline.)275 5011 y(The)33 b(shell)h(allo)m(ws)h(con)m(trol)h(of)e | |
d3ad40de | 16855 | (the)g(v)-5 b(arious)34 b(c)m(haracters)h(used)f(b)m(y)f(the)h(history) |
122f603c | 16856 | g(expansion)g(mec)m(h-)150 5121 y(anism)h(with)g(the)g |
d3ad40de CR |
16857 | Fs(histchars)d Ft(v)-5 b(ariable,)38 b(as)d(explained)g(ab)s(o)m(v)m(e) |
16858 | i(\(see)f(Section)f(5.2)i([Bash)e(V)-8 b(ariables],)150 | |
9f178efb | 16859 | 5230 y(page)32 b(69\).)44 b(The)31 b(shell)g(uses)g(the)g(history)g |
d3ad40de | 16860 | (commen)m(t)i(c)m(haracter)f(to)g(mark)f(history)g(timestamps)h(when) |
122f603c | 16861 | 150 5340 y(writing)e(the)h(history)f(\014le.)p eop end |
9f178efb CR |
16862 | %%Page: 136 142 |
16863 | TeXDict begin 136 141 bop 150 -116 a Ft(136)2527 b(Bash)31 | |
122f603c CR |
16864 | b(Reference)g(Man)m(ual)150 299 y Fj(9.3.1)63 b(Ev)m(en)m(t)39 |
16865 | b(Designators)150 446 y Ft(An)32 b(ev)m(en)m(t)j(designator)e(is)g(a)g | |
16866 | (reference)g(to)h(a)f(command)f(line)h(en)m(try)g(in)g(the)g(history)g | |
16867 | (list.)48 b(Unless)33 b(the)150 555 y(reference)e(is)f(absolute,)i(ev)m | |
16868 | (en)m(ts)f(are)g(relativ)m(e)i(to)e(the)f(curren)m(t)g(p)s(osition)h | |
16869 | (in)f(the)h(history)f(list.)150 712 y Fs(!)432 b Ft(Start)34 | |
c302751c | 16870 | b(a)f(history)h(substitution,)g(except)g(when)f(follo)m(w)m(ed)i(b)m(y) |
122f603c | 16871 | e(a)h(space,)h(tab,)f(the)g(end)f(of)630 822 y(the)i(line,)g(`)p |
c302751c CR |
16872 | Fs(=)p Ft(')g(or)f(`)p Fs(\()p Ft(')h(\(when)e(the)i |
16873 | Fs(extglob)d Ft(shell)j(option)f(is)h(enabled)f(using)g(the)g | |
122f603c | 16874 | Fs(shopt)630 931 y Ft(builtin\).)150 1088 y Fs(!)p Fi(n)384 |
c302751c | 16875 | b Ft(Refer)30 b(to)i(command)e(line)g Fq(n)p Ft(.)150 |
122f603c CR |
16876 | 1245 y Fs(!-)p Fi(n)336 b Ft(Refer)30 b(to)i(the)e(command)g |
16877 | Fq(n)g Ft(lines)h(bac)m(k.)150 1401 y Fs(!!)384 b Ft(Refer)30 | |
c302751c | 16878 | b(to)i(the)e(previous)g(command.)40 b(This)30 b(is)g(a)h(synon)m(ym)f |
122f603c | 16879 | (for)g(`)p Fs(!-1)p Ft('.)150 1558 y Fs(!)p Fi(string)144 |
e05be32d CR |
16880 | b Ft(Refer)25 b(to)h(the)f(most)h(recen)m(t)g(command)f(preceding)g |
16881 | (the)g(curren)m(t)g(p)s(osition)g(in)g(the)g(history)630 | |
122f603c CR |
16882 | 1668 y(list)31 b(starting)g(with)f Fq(string)8 b Ft(.)150 |
16883 | 1824 y Fs(!?)p Fi(string)j Fs([?])630 1934 y Ft(Refer)25 | |
e05be32d | 16884 | b(to)h(the)f(most)h(recen)m(t)g(command)f(preceding)g(the)g(curren)m(t) |
122f603c | 16885 | g(p)s(osition)g(in)g(the)g(history)630 2044 y(list)32 |
e05be32d CR |
16886 | b(con)m(taining)h Fq(string)8 b Ft(.)43 b(The)31 b(trailing)h(`)p |
16887 | Fs(?)p Ft(')f(ma)m(y)h(b)s(e)f(omitted)h(if)f(the)h Fq(string)39 | |
122f603c CR |
16888 | b Ft(is)31 b(follo)m(w)m(ed)630 2153 y(immediately)h(b)m(y)e(a)h |
16889 | (newline.)150 2310 y Fs(^)p Fi(string1)11 b Fs(^)p Fi(string2)g | |
16890 | Fs(^)630 2420 y Ft(Quic)m(k)31 b(Substitution.)43 b(Rep)s(eat)31 | |
c302751c | 16891 | b(the)g(last)h(command,)g(replacing)f Fq(string1)39 b |
122f603c | 16892 | Ft(with)31 b Fq(string2)7 b Ft(.)630 2529 y(Equiv)-5 |
c302751c | 16893 | b(alen)m(t)31 b(to)g Fs(!!:s/)p Fi(string1)11 b Fs(/)p |
122f603c | 16894 | Fi(string2)g Fs(/)p Ft(.)150 2686 y Fs(!#)384 b Ft(The)30 |
c302751c | 16895 | b(en)m(tire)h(command)f(line)h(t)m(yp)s(ed)f(so)h(far.)150 |
122f603c CR |
16896 | 2882 y Fj(9.3.2)63 b(W)-10 b(ord)41 b(Designators)150 |
16897 | 3029 y Ft(W)-8 b(ord)27 b(designators)h(are)g(used)e(to)i(select)h | |
c302751c CR |
16898 | (desired)d(w)m(ords)h(from)f(the)i(ev)m(en)m(t.)41 b(A)27 |
16899 | b(`)p Fs(:)p Ft(')g(separates)h(the)f(ev)m(en)m(t)150 | |
122f603c | 16900 | 3139 y(sp)s(eci\014cation)38 b(from)e(the)h(w)m(ord)f(designator.)61 |
c302751c | 16901 | b(It)37 b(ma)m(y)h(b)s(e)e(omitted)i(if)e(the)h(w)m(ord)g(designator)g |
122f603c | 16902 | (b)s(egins)150 3248 y(with)30 b(a)g(`)p Fs(^)p Ft(',)g(`)p |
c302751c CR |
16903 | Fs($)p Ft(',)g(`)p Fs(*)p Ft(',)h(`)p Fs(-)p Ft(',)f(or)g(`)p |
16904 | Fs(\045)p Ft('.)41 b(W)-8 b(ords)30 b(are)g(n)m(um)m(b)s(ered)e(from)i | |
16905 | (the)g(b)s(eginning)f(of)h(the)g(line,)g(with)g(the)150 | |
122f603c | 16906 | 3358 y(\014rst)f(w)m(ord)f(b)s(eing)h(denoted)h(b)m(y)f(0)h(\(zero\).) |
c302751c | 16907 | 41 b(W)-8 b(ords)30 b(are)g(inserted)f(in)m(to)h(the)g(curren)m(t)f |
122f603c CR |
16908 | (line)g(separated)h(b)m(y)150 3468 y(single)h(spaces.)275 |
16909 | 3601 y(F)-8 b(or)31 b(example,)150 3758 y Fs(!!)384 b | |
c302751c CR |
16910 | Ft(designates)37 b(the)f(preceding)g(command.)57 b(When)35 |
16911 | b(y)m(ou)i(t)m(yp)s(e)f(this,)h(the)f(preceding)g(com-)630 | |
122f603c | 16912 | 3867 y(mand)30 b(is)g(rep)s(eated)g(in)g(toto.)150 4024 |
c302751c CR |
16913 | y Fs(!!:$)288 b Ft(designates)23 b(the)g(last)g(argumen)m(t)g(of)f(the) |
16914 | h(preceding)f(command.)38 b(This)22 b(ma)m(y)h(b)s(e)e(shortened)630 | |
122f603c | 16915 | 4133 y(to)31 b Fs(!$)p Ft(.)150 4290 y Fs(!fi:2)240 b |
c302751c | 16916 | Ft(designates)30 b(the)g(second)f(argumen)m(t)h(of)f(the)h(most)f |
122f603c CR |
16917 | (recen)m(t)i(command)e(starting)h(with)f(the)630 4400 |
16918 | y(letters)j Fs(fi)p Ft(.)275 4556 y(Here)e(are)h(the)g(w)m(ord)f | |
16919 | (designators:)150 4713 y Fs(0)g(\(zero\))114 b Ft(The)30 | |
c302751c | 16920 | b Fs(0)p Ft(th)g(w)m(ord.)40 b(F)-8 b(or)31 b(man)m(y)g(applications,)h |
122f603c CR |
16921 | (this)e(is)g(the)h(command)f(w)m(ord.)150 4870 y Fi(n)432 |
16922 | b Ft(The)30 b Fq(n)p Ft(th)g(w)m(ord.)150 5027 y Fs(^)432 | |
c302751c | 16923 | b Ft(The)30 b(\014rst)f(argumen)m(t;)j(that)f(is,)f(w)m(ord)g(1.)150 |
122f603c CR |
16924 | 5183 y Fs($)432 b Ft(The)30 b(last)h(argumen)m(t.)150 |
16925 | 5340 y Fs(\045)432 b Ft(The)30 b(w)m(ord)g(matc)m(hed)h(b)m(y)f(the)h | |
c302751c | 16926 | (most)g(recen)m(t)g(`)p Fs(?)p Fi(string)11 b Fs(?)p |
122f603c | 16927 | Ft(')28 b(searc)m(h.)p eop end |
9f178efb CR |
16928 | %%Page: 137 143 |
16929 | TeXDict begin 137 142 bop 150 -116 a Ft(Chapter)30 b(9:)41 | |
16930 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(137)150 | |
122f603c CR |
16931 | 299 y Fi(x)11 b Fs(-)p Fi(y)325 b Ft(A)30 b(range)h(of)g(w)m(ords;)f(`) |
16932 | p Fs(-)p Fi(y)11 b Ft(')30 b(abbreviates)h(`)p Fs(0-)p | |
16933 | Fi(y)11 b Ft('.)150 458 y Fs(*)432 b Ft(All)28 b(of)g(the)g(w)m(ords,)g | |
16934 | (except)h(the)e Fs(0)p Ft(th.)40 b(This)27 b(is)g(a)h(synon)m(ym)f(for) | |
16935 | h(`)p Fs(1-$)p Ft('.)39 b(It)28 b(is)g(not)g(an)f(error)630 | |
16936 | 568 y(to)j(use)g(`)p Fs(*)p Ft(')f(if)h(there)g(is)g(just)f(one)h(w)m | |
16937 | (ord)f(in)g(the)h(ev)m(en)m(t;)i(the)d(empt)m(y)i(string)e(is)h | |
16938 | (returned)e(in)630 677 y(that)j(case.)150 837 y Fi(x)11 | |
16939 | b Fs(*)373 b Ft(Abbreviates)31 b(`)p Fi(x)11 b Fs(-$)p | |
16940 | Ft(')150 996 y Fi(x)g Fs(-)373 b Ft(Abbreviates)31 b(`)p | |
16941 | Fi(x)11 b Fs(-$)p Ft(')29 b(lik)m(e)j(`)p Fi(x)11 b Fs(*)p | |
16942 | Ft(',)30 b(but)g(omits)h(the)f(last)h(w)m(ord.)275 1156 | |
16943 | y(If)i(a)h(w)m(ord)g(designator)g(is)g(supplied)f(without)h(an)g(ev)m | |
16944 | (en)m(t)h(sp)s(eci\014cation,)h(the)e(previous)f(command)150 | |
16945 | 1265 y(is)d(used)g(as)h(the)f(ev)m(en)m(t.)150 1465 y | |
16946 | Fj(9.3.3)63 b(Mo)s(di\014ers)150 1611 y Ft(After)29 b(the)g(optional)g | |
16947 | (w)m(ord)g(designator,)g(y)m(ou)g(can)g(add)f(a)h(sequence)g(of)g(one)g | |
16948 | (or)f(more)h(of)g(the)f(follo)m(wing)150 1721 y(mo)s(di\014ers,)h(eac)m | |
16949 | (h)j(preceded)e(b)m(y)g(a)h(`)p Fs(:)p Ft('.)150 1880 | |
16950 | y Fs(h)432 b Ft(Remo)m(v)m(e)32 b(a)f(trailing)g(pathname)g(comp)s | |
16951 | (onen)m(t,)g(lea)m(ving)h(only)e(the)h(head.)150 2040 | |
16952 | y Fs(t)432 b Ft(Remo)m(v)m(e)32 b(all)f(leading)h(pathname)e(comp)s | |
16953 | (onen)m(ts,)h(lea)m(ving)h(the)e(tail.)150 2199 y Fs(r)432 | |
16954 | b Ft(Remo)m(v)m(e)32 b(a)f(trailing)g(su\016x)f(of)g(the)h(form)f(`)p | |
16955 | Fs(.)p Fi(suffix)11 b Ft(',)28 b(lea)m(ving)33 b(the)d(basename.)150 | |
16956 | 2359 y Fs(e)432 b Ft(Remo)m(v)m(e)32 b(all)f(but)f(the)h(trailing)g | |
16957 | (su\016x.)150 2518 y Fs(p)432 b Ft(Prin)m(t)30 b(the)h(new)f(command)g | |
16958 | (but)g(do)g(not)g(execute)i(it.)150 2677 y Fs(q)432 b | |
c302751c | 16959 | Ft(Quote)31 b(the)f(substituted)g(w)m(ords,)g(escaping)h(further)e |
122f603c | 16960 | (substitutions.)150 2837 y Fs(x)432 b Ft(Quote)32 b(the)f(substituted)g |
c302751c | 16961 | (w)m(ords)f(as)i(with)f(`)p Fs(q)p Ft(',)h(but)e(break)h(in)m(to)i(w)m |
122f603c CR |
16962 | (ords)d(at)i(spaces,)h(tabs,)630 2946 y(and)d(newlines.)150 |
16963 | 3106 y Fs(s/)p Fi(old)11 b Fs(/)p Fi(new)g Fs(/)630 3215 | |
c302751c CR |
16964 | y Ft(Substitute)32 b Fq(new)40 b Ft(for)32 b(the)h(\014rst)f(o)s |
16965 | (ccurrence)h(of)f Fq(old)37 b Ft(in)32 b(the)h(ev)m(en)m(t)h(line.)48 | |
122f603c | 16966 | b(An)m(y)32 b(delimiter)630 3325 y(ma)m(y)25 b(b)s(e)g(used)f(in)g |
c302751c CR |
16967 | (place)i(of)f(`)p Fs(/)p Ft('.)39 b(The)24 b(delimiter)h(ma)m(y)h(b)s |
16968 | (e)e(quoted)h(in)f Fq(old)29 b Ft(and)24 b Fq(new)32 | |
122f603c | 16969 | b Ft(with)25 b(a)630 3435 y(single)j(bac)m(kslash.)40 |
c302751c CR |
16970 | b(If)27 b(`)p Fs(&)p Ft(')g(app)s(ears)g(in)g Fq(new)8 |
16971 | b Ft(,)27 b(it)h(is)f(replaced)h(b)m(y)f Fq(old)t Ft(.)39 | |
122f603c | 16972 | b(A)27 b(single)h(bac)m(kslash)630 3544 y(will)35 b(quote)g(the)g(`)p |
c302751c | 16973 | Fs(&)p Ft('.)54 b(The)34 b(\014nal)g(delimiter)i(is)e(optional)i(if)f |
122f603c CR |
16974 | (it)g(is)f(the)h(last)h(c)m(haracter)g(on)630 3654 y(the)31 |
16975 | b(input)e(line.)150 3813 y Fs(&)432 b Ft(Rep)s(eat)31 | |
16976 | b(the)f(previous)g(substitution.)150 3973 y Fs(g)150 | |
16977 | 4082 y(a)432 b Ft(Cause)38 b(c)m(hanges)i(to)f(b)s(e)f(applied)h(o)m(v) | |
c302751c | 16978 | m(er)h(the)f(en)m(tire)g(ev)m(en)m(t)h(line.)66 b(Used)39 |
122f603c | 16979 | b(in)f(conjunction)630 4192 y(with)30 b(`)p Fs(s)p Ft(',)h(as)f(in)h |
c302751c | 16980 | Fs(gs/)p Fi(old)11 b Fs(/)p Fi(new)g Fs(/)p Ft(,)26 b(or)k(with)h(`)p |
122f603c | 16981 | Fs(&)p Ft('.)150 4351 y Fs(G)432 b Ft(Apply)30 b(the)g(follo)m(wing)i |
c302751c CR |
16982 | (`)p Fs(s)p Ft(')f(mo)s(di\014er)e(once)i(to)g(eac)m(h)h(w)m(ord)e(in)g |
16983 | (the)g(ev)m(en)m(t.)p eop end | |
9f178efb CR |
16984 | %%Page: 138 144 |
16985 | TeXDict begin 138 143 bop eop end | |
16986 | %%Page: 139 145 | |
16987 | TeXDict begin 139 144 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
16988 | b(Installing)31 b(Bash)2356 b(139)150 299 y Fo(10)80 | |
c302751c CR |
16989 | b(Installing)52 b(Bash)150 556 y Ft(This)31 b(c)m(hapter)h(pro)m(vides) |
16990 | g(basic)g(instructions)f(for)g(installing)i(Bash)f(on)f(the)h(v)-5 | |
16991 | b(arious)31 b(supp)s(orted)f(plat-)150 665 y(forms.)40 | |
16992 | b(The)28 b(distribution)h(supp)s(orts)e(the)j Fl(gnu)f | |
16993 | Ft(op)s(erating)h(systems,)f(nearly)h(ev)m(ery)g(v)m(ersion)f(of)h | |
16994 | (Unix,)150 775 y(and)d(sev)m(eral)j(non-Unix)d(systems)h(suc)m(h)g(as)g | |
16995 | (BeOS)g(and)f(In)m(terix.)40 b(Other)28 b(indep)s(enden)m(t)e(p)s(orts) | |
16996 | h(exist)i(for)150 884 y Fl(ms-dos)p Ft(,)h Fl(os/2)p | |
16997 | Ft(,)g(and)g(Windo)m(ws)g(platforms.)150 1128 y Fr(10.1)68 | |
16998 | b(Basic)45 b(Installation)150 1288 y Ft(These)30 b(are)h(installation)h | |
16999 | (instructions)e(for)h(Bash.)275 1430 y(The)e(simplest)i(w)m(a)m(y)g(to) | |
17000 | g(compile)h(Bash)e(is:)199 1572 y(1.)61 b Fs(cd)38 b | |
17001 | Ft(to)h(the)f(directory)h(con)m(taining)h(the)f(source)f(co)s(de)h(and) | |
17002 | f(t)m(yp)s(e)g(`)p Fs(./configure)p Ft(')e(to)j(con\014gure)330 | |
17003 | 1681 y(Bash)c(for)f(y)m(our)h(system.)54 b(If)34 b(y)m(ou're)h(using)f | |
17004 | Fs(csh)g Ft(on)g(an)h(old)g(v)m(ersion)g(of)g(System)f(V,)h(y)m(ou)g | |
17005 | (migh)m(t)330 1791 y(need)21 b(to)g(t)m(yp)s(e)g(`)p | |
17006 | Fs(sh)30 b(./configure)p Ft(')18 b(instead)j(to)g(prev)m(en)m(t)h | |
17007 | Fs(csh)e Ft(from)g(trying)h(to)g(execute)h Fs(configure)330 | |
17008 | 1901 y Ft(itself.)330 2039 y(Running)30 b Fs(configure)f | |
17009 | Ft(tak)m(es)k(some)e(time.)45 b(While)32 b(running,)e(it)i(prin)m(ts)f | |
17010 | (messages)h(telling)h(whic)m(h)330 2149 y(features)e(it)g(is)f(c)m(hec) | |
17011 | m(king)i(for.)199 2287 y(2.)61 b(T)m(yp)s(e)30 b(`)p | |
17012 | Fs(make)p Ft(')g(to)h(compile)g(Bash)g(and)e(build)h(the)g | |
17013 | Fs(bashbug)f Ft(bug)g(rep)s(orting)h(script.)199 2425 | |
17014 | y(3.)61 b(Optionally)-8 b(,)32 b(t)m(yp)s(e)e(`)p Fs(make)g(tests)p | |
17015 | Ft(')f(to)i(run)e(the)h(Bash)h(test)g(suite.)199 2563 | |
17016 | y(4.)61 b(T)m(yp)s(e)36 b(`)p Fs(make)29 b(install)p | |
37c41ab1 CR |
17017 | Ft(')35 b(to)i(install)h Fs(bash)d Ft(and)h Fs(bashbug)p |
17018 | Ft(.)57 b(This)35 b(will)i(also)h(install)f(the)g(man)m(ual)330 | |
c302751c | 17019 | 2673 y(pages)31 b(and)f(Info)g(\014le.)275 2844 y(The)20 |
37c41ab1 CR |
17020 | b Fs(configure)f Ft(shell)i(script)g(attempts)h(to)g(guess)f(correct)i |
17021 | (v)-5 b(alues)21 b(for)g(v)-5 b(arious)21 b(system-dep)s(enden)m(t)150 | |
c302751c | 17022 | 2953 y(v)-5 b(ariables)44 b(used)f(during)g(compilation.)82 |
37c41ab1 | 17023 | b(It)43 b(uses)h(those)g(v)-5 b(alues)44 b(to)g(create)h(a)g(`)p |
c302751c | 17024 | Fs(Makefile)p Ft(')c(in)j(eac)m(h)150 3063 y(directory)25 |
37c41ab1 CR |
17025 | b(of)g(the)g(pac)m(k)-5 b(age)27 b(\(the)e(top)g(directory)-8 |
17026 | b(,)27 b(the)e(`)p Fs(builtins)p Ft(',)f(`)p Fs(doc)p | |
5e13499c | 17027 | Ft(',)i(and)e(`)p Fs(support)p Ft(')g(directories,)150 |
c302751c | 17028 | 3172 y(eac)m(h)32 b(directory)f(under)d(`)p Fs(lib)p |
37c41ab1 CR |
17029 | Ft(',)j(and)f(sev)m(eral)h(others\).)42 b(It)30 b(also)i(creates)f(a)g |
17030 | (`)p Fs(config.h)p Ft(')e(\014le)h(con)m(taining)150 | |
c302751c | 17031 | 3282 y(system-dep)s(enden)m(t)h(de\014nitions.)44 b(Finally)-8 |
37c41ab1 | 17032 | b(,)34 b(it)e(creates)h(a)f(shell)g(script)f(named)g |
c302751c | 17033 | Fs(config.status)d Ft(that)150 3392 y(y)m(ou)k(can)g(run)e(in)h(the)g |
37c41ab1 | 17034 | (future)g(to)h(recreate)h(the)f(curren)m(t)f(con\014guration,)h(a)g |
c302751c | 17035 | (\014le)g(`)p Fs(config.cache)p Ft(')c(that)150 3501 |
37c41ab1 CR |
17036 | y(sa)m(v)m(es)35 b(the)f(results)f(of)h(its)g(tests)h(to)f(sp)s(eed)f |
17037 | (up)g(recon\014guring,)h(and)f(a)h(\014le)g(`)p Fs(config.log)p | |
c302751c | 17038 | Ft(')d(con)m(taining)150 3611 y(compiler)25 b(output)g(\(useful)f |
37c41ab1 CR |
17039 | (mainly)h(for)g(debugging)f Fs(configure)p Ft(\).)37 |
17040 | b(If)24 b(at)i(some)f(p)s(oin)m(t)g(`)p Fs(config.cache)p | |
c302751c | 17041 | Ft(')150 3720 y(con)m(tains)32 b(results)e(y)m(ou)g(don't)h(w)m(an)m(t) |
37c41ab1 | 17042 | g(to)g(k)m(eep,)g(y)m(ou)g(ma)m(y)g(remo)m(v)m(e)h(or)e(edit)h(it.)275 |
c302751c | 17043 | 3862 y(T)-8 b(o)37 b(\014nd)f(out)i(more)f(ab)s(out)h(the)f(options)h |
37c41ab1 | 17044 | (and)f(argumen)m(ts)g(that)h(the)g Fs(configure)d Ft(script)i(under-) |
c302751c CR |
17045 | 150 3972 y(stands,)30 b(t)m(yp)s(e)390 4114 y Fs(bash-2.04$)45 |
17046 | b(./configure)g(--help)150 4256 y Ft(at)31 b(the)g(Bash)f(prompt)g(in)g | |
17047 | (y)m(our)g(Bash)h(source)f(directory)-8 b(.)275 4398 | |
37c41ab1 CR |
17048 | y(If)53 b(y)m(ou)h(need)f(to)i(do)e(un)m(usual)g(things)g(to)i(compile) |
17049 | g(Bash,)k(please)c(try)e(to)i(\014gure)e(out)h(ho)m(w)150 | |
c302751c | 17050 | 4508 y Fs(configure)47 b Ft(could)j(c)m(hec)m(k)h(whether)e(or)g(not)h |
37c41ab1 | 17051 | (to)h(do)e(them,)55 b(and)49 b(mail)h(di\013s)f(or)h(instructions)f(to) |
c302751c | 17052 | 150 4617 y Fs(bash-maintainers@gnu.org)24 b Ft(so)30 |
37c41ab1 | 17053 | b(they)h(can)g(b)s(e)e(considered)i(for)f(the)g(next)h(release.)275 |
c302751c | 17054 | 4760 y(The)24 b(\014le)i(`)p Fs(configure.in)p Ft(')c(is)k(used)e(to)j |
37c41ab1 | 17055 | (create)g Fs(configure)22 b Ft(b)m(y)k(a)g(program)f(called)h(Auto)s |
c302751c | 17056 | (conf.)39 b(Y)-8 b(ou)150 4869 y(only)31 b(need)f(`)p |
37c41ab1 CR |
17057 | Fs(configure.in)p Ft(')d(if)k(y)m(ou)f(w)m(an)m(t)i(to)f(c)m(hange)g |
17058 | (it)g(or)f(regenerate)i Fs(configure)c Ft(using)i(a)h(new)m(er)150 | |
c302751c | 17059 | 4979 y(v)m(ersion)25 b(of)f(Auto)s(conf.)39 b(If)24 b(y)m(ou)h(do)f |
37c41ab1 CR |
17060 | (this,)i(mak)m(e)f(sure)f(y)m(ou)h(are)f(using)g(Auto)s(conf)h(v)m |
17061 | (ersion)f(2.50)i(or)f(new)m(er.)275 5121 y(Y)-8 b(ou)29 | |
17062 | b(can)f(remo)m(v)m(e)i(the)f(program)g(binaries)f(and)g(ob)5 | |
17063 | b(ject)29 b(\014les)g(from)f(the)h(source)f(co)s(de)h(directory)g(b)m | |
17064 | (y)150 5230 y(t)m(yping)j(`)p Fs(make)d(clean)p Ft('.)42 | |
17065 | b(T)-8 b(o)32 b(also)g(remo)m(v)m(e)g(the)g(\014les)f(that)g | |
5e13499c | 17066 | Fs(configure)e Ft(created)j(\(so)g(y)m(ou)g(can)f(compile)150 |
37c41ab1 CR |
17067 | 5340 y(Bash)g(for)f(a)g(di\013eren)m(t)h(kind)f(of)g(computer\),)h(t)m |
17068 | (yp)s(e)g(`)p Fs(make)e(distclean)p Ft('.)p eop end | |
9f178efb CR |
17069 | %%Page: 140 146 |
17070 | TeXDict begin 140 145 bop 150 -116 a Ft(140)2527 b(Bash)31 | |
37c41ab1 | 17071 | b(Reference)g(Man)m(ual)150 299 y Fr(10.2)68 b(Compilers)46 |
c302751c CR |
17072 | b(and)f(Options)150 458 y Ft(Some)28 b(systems)h(require)f(un)m(usual)f |
17073 | (options)i(for)f(compilation)i(or)f(linking)f(that)h(the)g | |
17074 | Fs(configure)d Ft(script)150 568 y(do)s(es)32 b(not)g(kno)m(w)g(ab)s | |
17075 | (out.)44 b(Y)-8 b(ou)33 b(can)f(giv)m(e)h Fs(configure)d | |
17076 | Ft(initial)j(v)-5 b(alues)32 b(for)g(v)-5 b(ariables)32 | |
17077 | b(b)m(y)g(setting)h(them)150 677 y(in)k(the)g(en)m(vironmen)m(t.)62 | |
17078 | b(Using)38 b(a)f(Bourne-compatible)i(shell,)g(y)m(ou)f(can)g(do)f(that) | |
17079 | h(on)f(the)g(command)150 787 y(line)31 b(lik)m(e)g(this:)390 | |
17080 | 920 y Fs(CC=c89)46 b(CFLAGS=-O2)f(LIBS=-lposix)g(./configure)275 | |
17081 | 1053 y Ft(On)29 b(systems)h(that)h(ha)m(v)m(e)h(the)f | |
37c41ab1 | 17082 | Fs(env)e Ft(program,)h(y)m(ou)h(can)g(do)f(it)h(lik)m(e)h(this:)390 |
c302751c CR |
17083 | 1186 y Fs(env)47 b(CPPFLAGS=-I/usr/local/in)o(clud)o(e)42 |
17084 | b(LDFLAGS=-s)j(./configure)275 1318 y Ft(The)29 b(con\014guration)i | |
37c41ab1 | 17085 | (pro)s(cess)f(uses)g(GCC)g(to)h(build)e(Bash)i(if)f(it)h(is)g(a)m(v)-5 |
c302751c CR |
17086 | b(ailable.)150 1548 y Fr(10.3)68 b(Compiling)46 b(F)-11 |
17087 | b(or)45 b(Multiple)g(Arc)l(hitectures)150 1707 y Ft(Y)-8 | |
17088 | b(ou)27 b(can)g(compile)g(Bash)g(for)f(more)h(than)f(one)h(kind)f(of)g | |
17089 | (computer)h(at)g(the)g(same)g(time,)h(b)m(y)e(placing)i(the)150 | |
17090 | 1817 y(ob)5 b(ject)31 b(\014les)f(for)g(eac)m(h)i(arc)m(hitecture)f(in) | |
17091 | f(their)g(o)m(wn)h(directory)-8 b(.)41 b(T)-8 b(o)31 | |
17092 | b(do)f(this,)g(y)m(ou)h(m)m(ust)f(use)g(a)g(v)m(ersion)150 | |
17093 | 1926 y(of)25 b Fs(make)f Ft(that)h(supp)s(orts)f(the)h | |
17094 | Fs(VPATH)e Ft(v)-5 b(ariable,)27 b(suc)m(h)e(as)g(GNU)h | |
17095 | Fs(make)p Ft(.)37 b Fs(cd)25 b Ft(to)h(the)f(directory)g(where)g(y)m | |
17096 | (ou)150 2036 y(w)m(an)m(t)34 b(the)f(ob)5 b(ject)34 b(\014les)f(and)f | |
17097 | (executables)i(to)g(go)g(and)e(run)g(the)h Fs(configure)d | |
17098 | Ft(script)j(from)g(the)g(source)150 2145 y(directory)-8 | |
17099 | b(.)41 b(Y)-8 b(ou)27 b(ma)m(y)h(need)f(to)g(supply)f(the)h(`)p | |
17100 | Fs(--srcdir=PATH)p Ft(')d(argumen)m(t)k(to)g(tell)g Fs(configure)c | |
17101 | Ft(where)150 2255 y(the)36 b(source)g(\014les)f(are.)57 | |
17102 | b Fs(configure)33 b Ft(automatically)39 b(c)m(hec)m(ks)e(for)e(the)h | |
17103 | (source)g(co)s(de)f(in)h(the)f(directory)150 2364 y(that)c | |
17104 | Fs(configure)d Ft(is)i(in)g(and)g(in)g(`..'.)275 2497 | |
17105 | y(If)20 b(y)m(ou)h(ha)m(v)m(e)i(to)e(use)g(a)g Fs(make)f | |
5e13499c | 17106 | Ft(that)i(do)s(es)e(not)i(supp)s(orts)d(the)i Fs(VPATH)e |
37c41ab1 | 17107 | Ft(v)-5 b(ariable,)24 b(y)m(ou)e(can)f(compile)h(Bash)150 |
c302751c | 17108 | 2607 y(for)33 b(one)h(arc)m(hitecture)h(at)f(a)g(time)g(in)f(the)h |
37c41ab1 | 17109 | (source)g(co)s(de)f(directory)-8 b(.)51 b(After)34 b(y)m(ou)g(ha)m(v)m |
c302751c | 17110 | (e)h(installed)f(Bash)150 2716 y(for)c(one)h(arc)m(hitecture,)h(use)e |
37c41ab1 | 17111 | (`)p Fs(make)g(distclean)p Ft(')e(b)s(efore)i(recon\014guring)g(for)g |
c302751c | 17112 | (another)g(arc)m(hitecture.)275 2849 y(Alternativ)m(ely)-8 |
37c41ab1 CR |
17113 | b(,)26 b(if)21 b(y)m(our)h(system)g(supp)s(orts)d(sym)m(b)s(olic)j |
17114 | (links,)i(y)m(ou)e(can)g(use)f(the)h(`)p Fs(support/mkclone)p | |
c302751c | 17115 | Ft(')150 2959 y(script)h(to)h(create)g(a)f(build)f(tree)i(whic)m(h)f |
37c41ab1 | 17116 | (has)f(sym)m(b)s(olic)i(links)e(bac)m(k)i(to)g(eac)m(h)g(\014le)f(in)g |
c302751c | 17117 | (the)g(source)g(directory)-8 b(.)150 3068 y(Here's)41 |
37c41ab1 | 17118 | b(an)f(example)i(that)f(creates)h(a)e(build)g(directory)h(in)f(the)h |
c302751c | 17119 | (curren)m(t)f(directory)h(from)f(a)h(source)150 3178 |
37c41ab1 | 17120 | y(directory)31 b(`)p Fs(/usr/gnu/src/bash-2.0)p Ft(':)390 |
c302751c CR |
17121 | 3311 y Fs(bash)47 b(/usr/gnu/src/bash-2.0/s)o(uppo)o(rt/)o(mkcl)o(one) |
17122 | 41 b(-s)47 b(/usr/gnu/src/bash-2.0)42 b(.)150 3444 y | |
37c41ab1 CR |
17123 | Ft(The)c Fs(mkclone)e Ft(script)i(requires)g(Bash,)i(so)f(y)m(ou)f(m)m |
17124 | (ust)h(ha)m(v)m(e)g(already)g(built)f(Bash)g(for)g(at)h(least)h(one)150 | |
c302751c CR |
17125 | 3553 y(arc)m(hitecture)32 b(b)s(efore)e(y)m(ou)h(can)f(create)i(build)e |
17126 | (directories)h(for)f(other)h(arc)m(hitectures.)150 3782 | |
17127 | y Fr(10.4)68 b(Installation)47 b(Names)150 3942 y Ft(By)27 | |
17128 | b(default,)h(`)p Fs(make)i(install)p Ft(')25 b(will)j(install)g(in)m | |
17129 | (to)g(`)p Fs(/usr/local/bin)p Ft(',)c(`)p Fs(/usr/local/man)p | |
17130 | Ft(',)h(etc.)40 b(Y)-8 b(ou)150 4051 y(can)31 b(sp)s(ecify)f(an)h | |
37c41ab1 | 17131 | (installation)h(pre\014x)d(other)i(than)g(`)p Fs(/usr/local)p |
c302751c CR |
17132 | Ft(')d(b)m(y)i(giving)i Fs(configure)c Ft(the)i(option)150 |
17133 | 4161 y(`)p Fs(--prefix=)p Fi(PATH)11 b Ft(',)35 b(or)h(b)m(y)g(sp)s | |
17134 | (ecifying)g(a)h(v)-5 b(alue)37 b(for)f(the)h Fs(DESTDIR)d | |
17135 | Ft(`)p Fs(make)p Ft(')i(v)-5 b(ariable)37 b(when)f(running)150 | |
17136 | 4271 y(`)p Fs(make)29 b(install)p Ft('.)275 4403 y(Y)-8 | |
17137 | b(ou)71 b(can)h(sp)s(ecify)f(separate)h(installation)h(pre\014xes)d | |
17138 | (for)h(arc)m(hitecture-sp)s(eci\014c)i(\014les)f(and)150 | |
17139 | 4513 y(arc)m(hitecture-indep)s(enden)m(t)38 b(\014les.)62 | |
17140 | b(If)37 b(y)m(ou)h(giv)m(e)g Fs(configure)d Ft(the)j(option)g(`)p | |
17141 | Fs(--exec-prefix=)p Fi(PATH)11 b Ft(',)150 4623 y(`)p | |
17142 | Fs(make)29 b(install)p Ft(')63 b(will)h(use)f Fq(P)-8 | |
17143 | b(A)g(TH)75 b Ft(as)64 b(the)g(pre\014x)e(for)i(installing)h(programs)e | |
17144 | (and)h(libraries.)150 4732 y(Do)s(cumen)m(tation)32 b(and)e(other)h | |
17145 | (data)g(\014les)f(will)h(still)g(use)f(the)h(regular)f(pre\014x.)150 | |
17146 | 4961 y Fr(10.5)68 b(Sp)t(ecifying)45 b(the)g(System)h(T)l(yp)t(e)150 | |
17147 | 5121 y Ft(There)f(ma)m(y)g(b)s(e)f(some)i(features)f | |
17148 | Fs(configure)e Ft(can)i(not)g(\014gure)g(out)g(automatically)-8 | |
17149 | b(,)52 b(but)44 b(need)h(to)150 5230 y(determine)36 b(b)m(y)g(the)h(t)m | |
17150 | (yp)s(e)f(of)g(host)h(Bash)f(will)h(run)d(on.)58 b(Usually)37 | |
37c41ab1 | 17151 | b Fs(configure)d Ft(can)i(\014gure)g(that)g(out,)150 |
c302751c | 17152 | 5340 y(but)c(if)h(it)g(prin)m(ts)g(a)g(message)h(sa)m(ying)g(it)f(can)h |
d3ad40de | 17153 | (not)f(guess)g(the)g(host)g(t)m(yp)s(e,)h(giv)m(e)g(it)f(the)h(`)p |
c302751c | 17154 | Fs(--host=TYPE)p Ft(')p eop end |
9f178efb CR |
17155 | %%Page: 141 147 |
17156 | TeXDict begin 141 146 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
17157 | b(Installing)31 b(Bash)2356 b(141)150 299 y(option.)39 | |
c302751c CR |
17158 | b(`)p Fs(TYPE)p Ft(')25 b(can)g(either)g(b)s(e)g(a)g(short)g(name)g |
17159 | (for)g(the)g(system)g(t)m(yp)s(e,)h(suc)m(h)f(as)g(`)p | |
17160 | Fs(sun4)p Ft(',)h(or)f(a)g(canonical)150 408 y(name)30 | |
17161 | b(with)g(three)h(\014elds:)40 b(`)p Fs(CPU-COMPANY-SYSTEM)p | |
17162 | Ft(')26 b(\(e.g.,)32 b(`)p Fs(i386-unknown-freebsd4.2)p | |
17163 | Ft('\).)275 539 y(See)e(the)h(\014le)f(`)p Fs(support/config.sub)p | |
17164 | Ft(')c(for)k(the)h(p)s(ossible)f(v)-5 b(alues)30 b(of)h(eac)m(h)g | |
17165 | (\014eld.)150 764 y Fr(10.6)68 b(Sharing)45 b(Defaults)150 | |
17166 | 924 y Ft(If)d(y)m(ou)i(w)m(an)m(t)g(to)f(set)h(default)f(v)-5 | |
17167 | b(alues)43 b(for)g Fs(configure)d Ft(scripts)j(to)h(share,)i(y)m(ou)d | |
17168 | (can)g(create)i(a)e(site)150 1033 y(shell)48 b(script)f(called)i | |
17169 | Fs(config.site)44 b Ft(that)k(giv)m(es)h(default)f(v)-5 | |
17170 | b(alues)48 b(for)f(v)-5 b(ariables)48 b(lik)m(e)h Fs(CC)p | |
17171 | Ft(,)j Fs(cache_)150 1143 y(file)p Ft(,)43 b(and)e Fs(prefix)p | |
17172 | Ft(.)73 b Fs(configure)39 b Ft(lo)s(oks)j(for)f(`)p Fs | |
17173 | (PREFIX/share/config.site)p Ft(')35 b(if)42 b(it)g(exists,)j(then)150 | |
17174 | 1252 y(`)p Fs(PREFIX/etc/config.site)p Ft(')20 b(if)26 | |
17175 | b(it)g(exists.)40 b(Or,)26 b(y)m(ou)g(can)g(set)g(the)g | |
17176 | Fs(CONFIG_SITE)c Ft(en)m(vironmen)m(t)k(v)-5 b(ari-)150 | |
17177 | 1362 y(able)40 b(to)g(the)g(lo)s(cation)h(of)e(the)h(site)g(script.)67 | |
37c41ab1 | 17178 | b(A)40 b(w)m(arning:)58 b(the)40 b(Bash)g Fs(configure)c |
c302751c CR |
17179 | Ft(lo)s(oks)k(for)f(a)h(site)150 1472 y(script,)31 b(but)e(not)i(all)g |
17180 | Fs(configure)d Ft(scripts)i(do.)150 1697 y Fr(10.7)68 | |
17181 | b(Op)t(eration)46 b(Con)l(trols)150 1856 y Fs(configure)28 | |
17182 | b Ft(recognizes)k(the)e(follo)m(wing)i(options)f(to)g(con)m(trol)h(ho)m | |
17183 | (w)e(it)h(op)s(erates.)150 2008 y Fs(--cache-file=)p | |
17184 | Fi(file)630 2117 y Ft(Use)k(and)g(sa)m(v)m(e)h(the)f(results)g(of)g | |
37c41ab1 | 17185 | (the)h(tests)f(in)g Fq(\014le)40 b Ft(instead)35 b(of)h(`)p |
c302751c | 17186 | Fs(./config.cache)p Ft('.)51 b(Set)630 2227 y Fq(\014le)36 |
37c41ab1 | 17187 | b Ft(to)31 b(`)p Fs(/dev/null)p Ft(')d(to)j(disable)g(cac)m(hing,)h |
c302751c | 17188 | (for)e(debugging)g Fs(configure)p Ft(.)150 2379 y Fs(--help)192 |
37c41ab1 | 17189 | b Ft(Prin)m(t)30 b(a)h(summary)e(of)i(the)f(options)h(to)g |
c302751c CR |
17190 | Fs(configure)p Ft(,)d(and)i(exit.)150 2531 y Fs(--quiet)150 |
17191 | 2641 y(--silent)150 2750 y(-q)384 b Ft(Do)31 b(not)g(prin)m(t)f | |
37c41ab1 | 17192 | (messages)h(sa)m(ying)g(whic)m(h)g(c)m(hec)m(ks)g(are)g(b)s(eing)f |
c302751c CR |
17193 | (made.)150 2902 y Fs(--srcdir=)p Fi(dir)630 3012 y Ft(Lo)s(ok)i(for)f |
17194 | (the)h(Bash)g(source)f(co)s(de)h(in)f(directory)h Fq(dir)7 | |
17195 | b Ft(.)44 b(Usually)32 b Fs(configure)d Ft(can)i(deter-)630 | |
17196 | 3121 y(mine)f(that)h(directory)g(automatically)-8 b(.)150 | |
17197 | 3273 y Fs(--version)630 3383 y Ft(Prin)m(t)29 b(the)h(v)m(ersion)g(of)g | |
5e13499c | 17198 | (Auto)s(conf)f(used)g(to)h(generate)h(the)f Fs(configure)d |
c302751c | 17199 | Ft(script,)j(and)f(exit.)275 3535 y Fs(configure)34 b |
37c41ab1 | 17200 | Ft(also)k(accepts)g(some)g(other,)h(not)e(widely)g(used,)h(b)s |
c302751c | 17201 | (oilerplate)g(options.)61 b(`)p Fs(configure)150 3644 |
37c41ab1 | 17202 | y(--help)p Ft(')29 b(prin)m(ts)h(the)g(complete)i(list.)150 |
c302751c CR |
17203 | 3869 y Fr(10.8)68 b(Optional)46 b(F)-11 b(eatures)150 |
17204 | 4029 y Ft(The)24 b(Bash)g Fs(configure)e Ft(has)h(a)i(n)m(um)m(b)s(er)e | |
17205 | (of)h(`)p Fs(--enable-)p Fi(feature)11 b Ft(')20 b(options,)26 | |
17206 | b(where)d Fq(feature)30 b Ft(indicates)150 4138 y(an)f(optional)i(part) | |
17207 | e(of)g(Bash.)41 b(There)28 b(are)i(also)g(sev)m(eral)h(`)p | |
17208 | Fs(--with-)p Fi(package)11 b Ft(')25 b(options,)30 b(where)f | |
17209 | Fq(pac)m(k)-5 b(age)150 4248 y Ft(is)32 b(something)h(lik)m(e)h(`)p | |
17210 | Fs(bash-malloc)p Ft(')c(or)i(`)p Fs(purify)p Ft('.)45 | |
17211 | b(T)-8 b(o)33 b(turn)e(o\013)i(the)f(default)h(use)f(of)g(a)h(pac)m(k) | |
17212 | -5 b(age,)35 b(use)150 4357 y(`)p Fs(--without-)p Fi(package)11 | |
17213 | b Ft('.)36 b(T)-8 b(o)29 b(con\014gure)g(Bash)h(without)f(a)g(feature)h | |
17214 | (that)g(is)f(enabled)g(b)m(y)g(default,)h(use)150 4467 | |
17215 | y(`)p Fs(--disable-)p Fi(feature)11 b Ft('.)275 4598 | |
17216 | y(Here)21 b(is)g(a)g(complete)h(list)g(of)f(the)g(`)p | |
17217 | Fs(--enable-)p Ft(')e(and)h(`)p Fs(--with-)p Ft(')g(options)h(that)g | |
17218 | (the)g(Bash)g Fs(configure)150 4707 y Ft(recognizes.)150 | |
17219 | 4859 y Fs(--with-afs)630 4969 y Ft(De\014ne)31 b(if)f(y)m(ou)h(are)f | |
17220 | (using)g(the)h(Andrew)e(File)j(System)e(from)g(T)-8 b(ransarc.)150 | |
17221 | 5121 y Fs(--with-bash-malloc)630 5230 y Ft(Use)31 b(the)g(Bash)f(v)m | |
17222 | (ersion)i(of)e Fs(malloc)f Ft(in)h(the)h(directory)g(`)p | |
17223 | Fs(lib/malloc)p Ft('.)39 b(This)30 b(is)h(not)g(the)630 | |
17224 | 5340 y(same)h Fs(malloc)e Ft(that)j(app)s(ears)e(in)g | |
17225 | Fl(gnu)h Ft(lib)s(c,)g(but)f(an)h(older)f(v)m(ersion)i(originally)g | |
17226 | (deriv)m(ed)p eop end | |
9f178efb CR |
17227 | %%Page: 142 148 |
17228 | TeXDict begin 142 147 bop 150 -116 a Ft(142)2527 b(Bash)31 | |
c302751c | 17229 | b(Reference)g(Man)m(ual)630 299 y(from)h(the)h(4.2)g |
1c72c0cd CR |
17230 | Fl(bsd)f Fs(malloc)p Ft(.)45 b(This)31 b Fs(malloc)g |
17231 | Ft(is)i(v)m(ery)f(fast,)i(but)e(w)m(astes)h(some)g(space)g(on)630 | |
c302751c | 17232 | 408 y(eac)m(h)g(allo)s(cation.)48 b(This)31 b(option)i(is)f(enabled)g |
1c72c0cd | 17233 | (b)m(y)g(default.)46 b(The)31 b(`)p Fs(NOTES)p Ft(')g(\014le)h(con)m |
c302751c | 17234 | (tains)i(a)630 518 y(list)29 b(of)f(systems)f(for)h(whic)m(h)g(this)g |
1c72c0cd | 17235 | (should)e(b)s(e)i(turned)e(o\013,)j(and)f Fs(configure)d |
c302751c CR |
17236 | Ft(disables)j(this)630 628 y(option)j(automatically)i(for)d(a)h(n)m(um) |
17237 | m(b)s(er)e(of)i(systems.)150 798 y Fs(--with-curses)630 | |
17238 | 907 y Ft(Use)h(the)h(curses)e(library)h(instead)g(of)h(the)f(termcap)g | |
1c72c0cd | 17239 | (library)-8 b(.)46 b(This)32 b(should)f(b)s(e)g(supplied)630 |
c302751c CR |
17240 | 1017 y(if)f(y)m(our)h(system)f(has)g(an)h(inadequate)g(or)f(incomplete) |
17241 | i(termcap)e(database.)150 1187 y Fs(--with-gnu-malloc)630 | |
17242 | 1297 y Ft(A)g(synon)m(ym)g(for)g Fs(--with-bash-malloc)p | |
17243 | Ft(.)150 1467 y Fs(--with-installed-readlin)o(e[=)p Fi(P)o(REFI)o(X)11 | |
17244 | b Fs(])630 1576 y Ft(De\014ne)26 b(this)f(to)h(mak)m(e)h(Bash)f(link)f | |
1c72c0cd | 17245 | (with)g(a)h(lo)s(cally-installed)i(v)m(ersion)e(of)g(Readline)g(rather) |
c302751c | 17246 | 630 1686 y(than)38 b(the)h(v)m(ersion)g(in)g(`)p Fs(lib/readline)p |
1c72c0cd | 17247 | Ft('.)62 b(This)38 b(w)m(orks)h(only)f(with)h(Readline)g(5.0)h(and)630 |
c302751c | 17248 | 1796 y(later)29 b(v)m(ersions.)40 b(If)28 b Fq(PREFIX)37 |
37c41ab1 | 17249 | b Ft(is)28 b Fs(yes)f Ft(or)h(not)g(supplied,)f Fs(configure)f |
c302751c | 17250 | Ft(uses)h(the)h(v)-5 b(alues)29 b(of)630 1905 y(the)c(mak)m(e)g(v)-5 |
37c41ab1 CR |
17251 | b(ariables)25 b Fs(includedir)d Ft(and)h Fs(libdir)p |
17252 | Ft(,)h(whic)m(h)h(are)f(sub)s(directories)g(of)h Fs(prefix)630 | |
c302751c | 17253 | 2015 y Ft(b)m(y)32 b(default,)g(to)h(\014nd)d(the)i(installed)h(v)m |
37c41ab1 | 17254 | (ersion)f(of)g(Readline)h(if)f(it)g(is)g(not)g(in)g(the)g(standard)630 |
c302751c | 17255 | 2124 y(system)j(include)f(and)g(library)g(directories.)54 |
37c41ab1 | 17256 | b(If)34 b Fq(PREFIX)43 b Ft(is)35 b Fs(no)p Ft(,)g(Bash)f(links)h(with) |
c302751c | 17257 | f(the)630 2234 y(v)m(ersion)k(in)f(`)p Fs(lib/readline)p |
37c41ab1 | 17258 | Ft('.)58 b(If)37 b Fq(PREFIX)46 b Ft(is)38 b(set)g(to)g(an)m(y)f(other) |
c302751c | 17259 | h(v)-5 b(alue,)39 b Fs(configure)630 2344 y Ft(treats)27 |
37c41ab1 | 17260 | b(it)g(as)f(a)h(directory)g(pathname)f(and)f(lo)s(oks)i(for)f(the)g |
c302751c | 17261 | (installed)h(v)m(ersion)g(of)f(Readline)630 2453 y(in)34 |
37c41ab1 | 17262 | b(sub)s(directories)f(of)h(that)h(directory)g(\(include)f(\014les)g(in) |
5e13499c | 17263 | g Fq(PREFIX)9 b Ft(/)p Fs(include)32 b Ft(and)i(the)630 |
c302751c CR |
17264 | 2563 y(library)c(in)g Fq(PREFIX)9 b Ft(/)p Fs(lib)p Ft(\).)150 |
17265 | 2733 y Fs(--with-purify)630 2843 y Ft(De\014ne)23 b(this)g(to)h(use)f | |
37c41ab1 | 17266 | (the)g(Purify)f(memory)h(allo)s(cation)i(c)m(hec)m(k)m(er)g(from)e |
c302751c CR |
17267 | (Rational)i(Soft)m(w)m(are.)150 3013 y Fs(--enable-minimal-config)630 |
17268 | 3122 y Ft(This)e(pro)s(duces)f(a)i(shell)g(with)f(minimal)h(features,)h | |
37c41ab1 | 17269 | (close)g(to)f(the)g(historical)h(Bourne)e(shell.)275 |
c302751c | 17270 | 3298 y(There)g(are)i(sev)m(eral)g(`)p Fs(--enable-)p |
37c41ab1 | 17271 | Ft(')d(options)j(that)f(alter)h(ho)m(w)g(Bash)f(is)g(compiled)h(and)e |
c302751c CR |
17272 | (link)m(ed,)j(rather)150 3407 y(than)k(c)m(hanging)h(run-time)f |
17273 | (features.)150 3583 y Fs(--enable-largefile)630 3693 | |
37c41ab1 | 17274 | y Ft(Enable)76 b(supp)s(ort)f(for)h(large)h(\014les)f(\()p |
c302751c | 17275 | Fs(http://www.sas.com/standar)o(ds/l)o(arge)o(_)630 3802 |
37c41ab1 | 17276 | y(file/x_open.20Mar96.html)o Ft(\))23 b(if)28 b(the)g(op)s(erating)h |
c302751c | 17277 | (system)f(requires)g(sp)s(ecial)g(compiler)630 3912 y(options)45 |
37c41ab1 | 17278 | b(to)g(build)e(programs)h(whic)m(h)g(can)g(access)i(large)f(\014les.)82 |
c302751c | 17279 | b(This)44 b(is)g(enabled)g(b)m(y)630 4021 y(default,)31 |
37c41ab1 | 17280 | b(if)f(the)h(op)s(erating)g(system)f(pro)m(vides)g(large)i(\014le)e |
c302751c | 17281 | (supp)s(ort.)150 4191 y Fs(--enable-profiling)630 4301 |
37c41ab1 CR |
17282 | y Ft(This)h(builds)f(a)i(Bash)g(binary)f(that)h(pro)s(duces)e |
17283 | (pro\014ling)h(information)h(to)h(b)s(e)d(pro)s(cessed)630 | |
c302751c CR |
17284 | 4411 y(b)m(y)g Fs(gprof)f Ft(eac)m(h)j(time)f(it)g(is)f(executed.)150 |
17285 | 4581 y Fs(--enable-static-link)630 4690 y Ft(This)37 | |
17286 | b(causes)h(Bash)f(to)h(b)s(e)f(link)m(ed)h(statically)-8 | |
17287 | b(,)43 b(if)37 b Fs(gcc)g Ft(is)g(b)s(eing)g(used.)61 | |
17288 | b(This)37 b(could)h(b)s(e)630 4800 y(used)30 b(to)h(build)e(a)i(v)m | |
17289 | (ersion)g(to)g(use)f(as)g(ro)s(ot's)h(shell.)275 4976 | |
37c41ab1 CR |
17290 | y(The)f(`)p Fs(minimal-config)p Ft(')d(option)k(can)g(b)s(e)f(used)f |
17291 | (to)j(disable)e(all)i(of)f(the)f(follo)m(wing)i(options,)g(but)d(it)150 | |
c302751c CR |
17292 | 5085 y(is)h(pro)s(cessed)g(\014rst,)g(so)h(individual)f(options)g(ma)m |
17293 | (y)h(b)s(e)f(enabled)g(using)g(`)p Fs(enable-)p Fi(feature)11 | |
17294 | b Ft('.)275 5230 y(All)37 b(of)g(the)f(follo)m(wing)i(options)f(except) | |
17295 | h(for)e(`)p Fs(disabled-builtins)p Ft(')d(and)j(`)p Fs | |
17296 | (xpg-echo-default)p Ft(')150 5340 y(are)26 b(enabled)g(b)m(y)g | |
17297 | (default,)h(unless)f(the)g(op)s(erating)g(system)g(do)s(es)g(not)g(pro) | |
17298 | m(vide)g(the)g(necessary)g(supp)s(ort.)p eop end | |
9f178efb CR |
17299 | %%Page: 143 149 |
17300 | TeXDict begin 143 148 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
17301 | b(Installing)31 b(Bash)2356 b(143)150 299 y Fs(--enable-alias)630 | |
c302751c | 17302 | 408 y Ft(Allo)m(w)41 b(alias)g(expansion)f(and)f(include)g(the)h |
37c41ab1 | 17303 | Fs(alias)f Ft(and)g Fs(unalias)e Ft(builtins)j(\(see)g(Sec-)630 |
9f178efb | 17304 | 518 y(tion)31 b(6.6)g([Aliases],)i(page)e(87\).)150 692 |
c302751c | 17305 | y Fs(--enable-arith-for-comma)o(nd)630 801 y Ft(Include)21 |
37c41ab1 CR |
17306 | b(supp)s(ort)g(for)g(the)i(alternate)g(form)f(of)g(the)g |
17307 | Fs(for)f Ft(command)h(that)h(b)s(eha)m(v)m(es)f(lik)m(e)i(the)630 | |
c302751c | 17308 | 911 y(C)30 b(language)i Fs(for)d Ft(statemen)m(t)j(\(see)g(Section)f |
220537f2 | 17309 | (3.2.4.1)i([Lo)s(oping)d(Constructs],)h(page)g(10\).)150 |
c302751c | 17310 | 1084 y Fs(--enable-array-variables)630 1194 y Ft(Include)h(supp)s(ort)g |
37c41ab1 | 17311 | (for)h(one-dimensional)h(arra)m(y)f(shell)h(v)-5 b(ariables)33 |
9f178efb | 17312 | b(\(see)h(Section)g(6.7)h([Ar-)630 1303 y(ra)m(ys],)c(page)g(88\).)150 |
c302751c | 17313 | 1477 y Fs(--enable-bang-history)630 1587 y Ft(Include)36 |
37c41ab1 | 17314 | b(supp)s(ort)f(for)h Fs(csh)p Ft(-lik)m(e)h(history)g(substitution)f |
c302751c | 17315 | (\(see)h(Section)g(9.3)h([History)f(In-)630 1696 y(teraction],)c(page)e |
9f178efb | 17316 | (135\).)150 1870 y Fs(--enable-brace-expansion)630 1979 |
37c41ab1 | 17317 | y Ft(Include)40 b Fs(csh)p Ft(-lik)m(e)h(brace)f(expansion)g(\()h |
c302751c | 17318 | Fs(b{a,b}c)d Fp(7!)i Fs(bac)30 b(bbc)39 b Ft(\).)71 b(See)40 |
9f178efb | 17319 | b(Section)h(3.5.1)630 2089 y([Brace)32 b(Expansion],)e(page)h(21,)h |
c302751c CR |
17320 | (for)e(a)g(complete)i(description.)150 2262 y Fs |
17321 | (--enable-casemod-attribu)o(tes)630 2372 y Ft(Include)37 | |
09767ff0 | 17322 | b(supp)s(ort)g(for)g(case-mo)s(difying)i(attributes)g(in)e(the)h |
c302751c | 17323 | Fs(declare)e Ft(builtin)i(and)f(as-)630 2482 y(signmen)m(t)29 |
09767ff0 CR |
17324 | b(statemen)m(ts.)41 b(V)-8 b(ariables)30 b(with)e(the)g |
17325 | Fq(upp)s(ercase)k Ft(attribute,)e(for)e(example,)i(will)630 | |
c302751c CR |
17326 | 2591 y(ha)m(v)m(e)i(their)e(v)-5 b(alues)31 b(con)m(v)m(erted)h(to)f |
17327 | (upp)s(ercase)e(up)s(on)g(assignmen)m(t.)150 2765 y Fs | |
17328 | (--enable-casemod-expansi)o(on)630 2874 y Ft(Include)h(supp)s(ort)e | |
09767ff0 | 17329 | (for)i(case-mo)s(difying)i(w)m(ord)e(expansions.)150 |
c302751c | 17330 | 3048 y Fs(--enable-command-timing)630 3157 y Ft(Include)43 |
37c41ab1 | 17331 | b(supp)s(ort)f(for)h(recognizing)i Fs(time)e Ft(as)g(a)h(reserv)m(ed)g |
c302751c | 17332 | (w)m(ord)f(and)g(for)h(displa)m(ying)630 3267 y(timing)37 |
37c41ab1 CR |
17333 | b(statistics)h(for)e(the)g(pip)s(eline)g(follo)m(wing)i |
17334 | Fs(time)d Ft(\(see)i(Section)g(3.2.2)h([Pip)s(elines],)630 | |
c302751c | 17335 | 3377 y(page)24 b(8\).)39 b(This)23 b(allo)m(ws)h(pip)s(elines)f(as)h(w) |
37c41ab1 | 17336 | m(ell)g(as)g(shell)f(builtins)g(and)g(functions)g(to)h(b)s(e)e(timed.) |
c302751c | 17337 | 150 3550 y Fs(--enable-cond-command)630 3660 y Ft(Include)33 |
37c41ab1 | 17338 | b(supp)s(ort)f(for)i(the)g Fs([[)f Ft(conditional)i(command.)51 |
c302751c CR |
17339 | b(\(see)34 b(Section)h(3.2.4.2)h([Condi-)630 3769 y(tional)c |
17340 | (Constructs],)e(page)h(10\).)150 3943 y Fs(--enable-cond-regexp)630 | |
5cdaaf76 CR |
17341 | 4052 y Ft(Include)k(supp)s(ort)f(for)i(matc)m(hing)h |
17342 | Fl(posix)e Ft(regular)h(expressions)g(using)f(the)h(`)p | |
17343 | Fs(=~)p Ft(')g(binary)630 4162 y(op)s(erator)25 b(in)f(the)h | |
17344 | Fs([[)f Ft(conditional)h(command.)39 b(\(see)25 b(Section)h(3.2.4.2)h | |
17345 | ([Conditional)e(Con-)630 4271 y(structs],)31 b(page)g(10\).)150 | |
17346 | 4445 y Fs(--enable-coprocesses)630 4555 y Ft(Include)23 | |
17347 | b(supp)s(ort)f(for)i(copro)s(cesses)g(and)f(the)h Fs(coproc)e | |
17348 | Ft(reserv)m(ed)i(w)m(ord)g(\(see)h(Section)f(3.2.2)630 | |
17349 | 4664 y([Pip)s(elines],)31 b(page)g(8\).)150 4838 y Fs | |
17350 | (--enable-debugger)630 4947 y Ft(Include)f(supp)s(ort)e(for)i(the)h | |
c302751c CR |
17351 | (bash)f(debugger)g(\(distributed)g(separately\).)150 |
17352 | 5121 y Fs(--enable-directory-stack)630 5230 y Ft(Include)j(supp)s(ort)g | |
17353 | (for)h(a)g Fs(csh)p Ft(-lik)m(e)h(directory)f(stac)m(k)i(and)d(the)i | |
17354 | Fs(pushd)p Ft(,)f Fs(popd)p Ft(,)g(and)f Fs(dirs)630 | |
17355 | 5340 y Ft(builtins)d(\(see)h(Section)g(6.8)h([The)e(Directory)i(Stac)m | |
9f178efb CR |
17356 | (k],)g(page)f(89\).)p eop end |
17357 | %%Page: 144 150 | |
17358 | TeXDict begin 144 149 bop 150 -116 a Ft(144)2527 b(Bash)31 | |
c302751c CR |
17359 | b(Reference)g(Man)m(ual)150 299 y Fs(--enable-disabled-builti)o(ns)630 |
17360 | 408 y Ft(Allo)m(w)40 b(builtin)e(commands)g(to)h(b)s(e)f(in)m(v)m(ok)m | |
17361 | (ed)i(via)f(`)p Fs(builtin)29 b(xxx)p Ft(')37 b(ev)m(en)j(after)f | |
17362 | Fs(xxx)e Ft(has)630 518 y(b)s(een)31 b(disabled)g(using)g(`)p | |
37c41ab1 | 17363 | Fs(enable)d(-n)i(xxx)p Ft('.)43 b(See)32 b(Section)g(4.2)h([Bash)e |
9f178efb | 17364 | (Builtins],)i(page)f(48,)630 628 y(for)e(details)i(of)e(the)h |
09767ff0 | 17365 | Fs(builtin)d Ft(and)i Fs(enable)e Ft(builtin)i(commands.)150 |
8f714a7c | 17366 | 783 y Fs(--enable-dparen-arithmet)o(ic)630 892 y Ft(Include)42 |
09767ff0 | 17367 | b(supp)s(ort)f(for)h(the)h Fs(\(\(...)o(\)\))f Ft(command)g(\(see)i |
8f714a7c CR |
17368 | (Section)f(3.2.4.2)i([Conditional)630 1002 y(Constructs],)30 |
17369 | b(page)h(10\).)150 1157 y Fs(--enable-extended-glob)630 | |
17370 | 1267 y Ft(Include)40 b(supp)s(ort)e(for)i(the)h(extended)f(pattern)h | |
09767ff0 | 17371 | (matc)m(hing)g(features)g(describ)s(ed)e(ab)s(o)m(v)m(e)630 |
8f714a7c | 17372 | 1377 y(under)29 b(Section)i(3.5.8.1)i([P)m(attern)e(Matc)m(hing],)i |
9f178efb | 17373 | (page)e(29.)150 1532 y Fs(--enable-extended-glob-d)o(efau)o(lt)630 |
8f714a7c CR |
17374 | 1641 y Ft(Set)40 b(the)g(default)g(v)-5 b(alue)41 b(of)f(the)g |
17375 | Fq(extglob)j Ft(shell)d(option)g(describ)s(ed)f(ab)s(o)m(v)m(e)i(under) | |
17376 | d(Sec-)630 1751 y(tion)31 b(4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g | |
9f178efb | 17377 | (62)g(to)h(b)s(e)d(enabled.)150 1906 y Fs(--enable-help-builtin)630 |
8f714a7c CR |
17378 | 2016 y Ft(Include)24 b(the)h Fs(help)f Ft(builtin,)h(whic)m(h)g(displa) |
17379 | m(ys)f(help)h(on)f(shell)h(builtins)f(and)h(v)-5 b(ariables)25 | |
17380 | b(\(see)630 2125 y(Section)31 b(4.2)h([Bash)e(Builtins],)i(page)f | |
9f178efb | 17381 | (48\).)150 2281 y Fs(--enable-history)630 2390 y Ft(Include)e(command)g |
37c41ab1 | 17382 | (history)h(and)f(the)h Fs(fc)f Ft(and)g Fs(history)e |
8f714a7c | 17383 | Ft(builtin)j(commands)f(\(see)h(Sec-)630 2500 y(tion)h(9.1)g([Bash)g |
9f178efb | 17384 | (History)g(F)-8 b(acilities],)34 b(page)d(133\).)150 |
8f714a7c | 17385 | 2655 y Fs(--enable-job-control)630 2765 y Ft(This)e(enables)i(the)f |
37c41ab1 | 17386 | (job)g(con)m(trol)h(features)g(\(see)g(Chapter)f(7)g([Job)g(Con)m |
9f178efb | 17387 | (trol],)h(page)g(97\),)h(if)630 2874 y(the)f(op)s(erating)f(system)h |
8f714a7c CR |
17388 | (supp)s(orts)d(them.)150 3029 y Fs(--enable-multibyte)630 |
17389 | 3139 y Ft(This)h(enables)i(supp)s(ort)d(for)i(m)m(ultib)m(yte)h(c)m | |
37c41ab1 | 17390 | (haracters)g(if)f(the)g(op)s(erating)h(system)f(pro)m(vides)630 |
8f714a7c CR |
17391 | 3249 y(the)h(necessary)f(supp)s(ort.)150 3404 y Fs |
17392 | (--enable-net-redirection)o(s)630 3513 y Ft(This)21 b(enables)h(the)g | |
37c41ab1 | 17393 | (sp)s(ecial)h(handling)e(of)h(\014lenames)g(of)g(the)g(form)f |
8f714a7c | 17394 | Fs(/dev/tcp/)p Fi(host)11 b Fs(/)p Fi(port)630 3623 y |
c302751c | 17395 | Ft(and)29 b Fs(/dev/udp/)p Fi(host)11 b Fs(/)p Fi(port)34 |
37c41ab1 | 17396 | b Ft(when)28 b(used)g(in)h(redirections)h(\(see)g(Section)g(3.6)g |
9f178efb | 17397 | ([Redirec-)630 3733 y(tions],)h(page)g(31\).)150 3888 |
8f714a7c | 17398 | y Fs(--enable-process-substit)o(utio)o(n)630 3998 y Ft(This)49 |
37c41ab1 | 17399 | b(enables)i(pro)s(cess)f(substitution)g(\(see)h(Section)g(3.5.6)h([Pro) |
9f178efb | 17400 | s(cess)e(Substitution],)630 4107 y(page)31 b(28\))h(if)e(the)h(op)s |
37c41ab1 | 17401 | (erating)f(system)h(pro)m(vides)f(the)h(necessary)g(supp)s(ort.)150 |
8f714a7c | 17402 | 4262 y Fs(--enable-progcomp)630 4372 y Ft(Enable)d(the)g(programmable)g |
01ed5ba4 | 17403 | (completion)i(facilities)g(\(see)f(Section)g(8.6)g([Programmable)630 |
9f178efb | 17404 | 4482 y(Completion],)i(page)h(124\).)42 b(If)30 b(Readline)h(is)f(not)h |
01ed5ba4 | 17405 | (enabled,)f(this)h(option)g(has)f(no)g(e\013ect.)150 |
8f714a7c | 17406 | 4637 y Fs(--enable-prompt-string-d)o(ecod)o(ing)630 4746 |
122f603c CR |
17407 | y Ft(T)-8 b(urn)30 b(on)i(the)f(in)m(terpretation)i(of)f(a)g(n)m(um)m |
17408 | (b)s(er)e(of)i(bac)m(kslash-escap)s(ed)g(c)m(haracters)i(in)d(the)630 | |
17409 | 4856 y Fs($PS1)p Ft(,)36 b Fs($PS2)p Ft(,)g Fs($PS3)p | |
17410 | Ft(,)h(and)e Fs($PS4)f Ft(prompt)h(strings.)57 b(See)36 | |
17411 | b(Section)h(6.9)g([Con)m(trolling)g(the)630 4966 y(Prompt],)30 | |
9f178efb | 17412 | b(page)h(91,)h(for)e(a)h(complete)h(list)f(of)f(prompt)g(string)g |
8f714a7c CR |
17413 | (escap)s(e)h(sequences.)150 5121 y Fs(--enable-readline)630 |
17414 | 5230 y Ft(Include)d(supp)s(ort)f(for)h(command-line)h(editing)g(and)f | |
17415 | (history)g(with)g(the)h(Bash)g(v)m(ersion)g(of)630 5340 | |
8e1a6eaa | 17416 | y(the)i(Readline)g(library)f(\(see)h(Chapter)f(8)g([Command)g(Line)g |
9f178efb CR |
17417 | (Editing],)h(page)g(101\).)p eop end |
17418 | %%Page: 145 151 | |
17419 | TeXDict begin 145 150 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
17420 | b(Installing)31 b(Bash)2356 b(145)150 299 y Fs(--enable-restricted)630 | |
8f714a7c CR |
17421 | 408 y Ft(Include)41 b(supp)s(ort)f(for)i(a)g Fq(restricted)g(shell)p |
17422 | Ft(.)75 b(If)42 b(this)f(is)h(enabled,)j(Bash,)g(when)c(called)630 | |
17423 | 518 y(as)f Fs(rbash)p Ft(,)h(en)m(ters)f(a)g(restricted)h(mo)s(de.)68 | |
17424 | b(See)40 b(Section)h(6.10)g([The)f(Restricted)h(Shell],)630 | |
9f178efb | 17425 | 628 y(page)31 b(92,)h(for)e(a)g(description)h(of)f(restricted)h(mo)s |
54a1fa7c CR |
17426 | (de.)150 787 y Fs(--enable-select)630 897 y Ft(Include)25 |
17427 | b(the)h Fs(select)f Ft(comp)s(ound)f(command,)j(whic)m(h)e(allo)m(ws)j | |
17428 | (the)e(generation)h(of)f(simple)630 1006 y(men)m(us)k(\(see)h(Section)g | |
17429 | (3.2.4.2)i([Conditional)e(Constructs],)g(page)g(10\).)150 | |
17430 | 1166 y Fs(--enable-separate-helpfi)o(les)630 1275 y Ft(Use)h(external)h | |
8f714a7c CR |
17431 | (\014les)f(for)g(the)g(do)s(cumen)m(tation)h(displa)m(y)m(ed)f(b)m(y)g |
17432 | (the)g Fs(help)f Ft(builtin)h(instead)630 1385 y(of)f(storing)f(the)h | |
17433 | (text)g(in)m(ternally)-8 b(.)150 1544 y Fs(--enable-single-help-str)o | |
17434 | (ings)630 1654 y Ft(Store)40 b(the)g(text)h(displa)m(y)m(ed)g(b)m(y)e | |
17435 | (the)i Fs(help)d Ft(builtin)i(as)g(a)g(single)h(string)f(for)f(eac)m(h) | |
17436 | i(help)630 1763 y(topic.)54 b(This)33 b(aids)i(in)f(translating)h(the)g | |
17437 | (text)g(to)g(di\013eren)m(t)g(languages.)54 b(Y)-8 b(ou)35 | |
17438 | b(ma)m(y)g(need)630 1873 y(to)c(disable)g(this)f(if)g(y)m(our)h | |
17439 | (compiler)g(cannot)f(handle)g(v)m(ery)h(long)g(string)f(literals.)150 | |
17440 | 2032 y Fs(--enable-strict-posix-de)o(faul)o(t)630 2142 | |
17441 | y Ft(Mak)m(e)c(Bash)f Fl(posix)p Ft(-conforman)m(t)g(b)m(y)f(default)h | |
17442 | (\(see)g(Section)h(6.11)g([Bash)f(POSIX)e(Mo)s(de],)630 | |
9f178efb | 17443 | 2252 y(page)31 b(92\).)150 2411 y Fs(--enable-usg-echo-defaul)o(t)630 |
8f714a7c CR |
17444 | 2521 y Ft(A)f(synon)m(ym)g(for)g Fs(--enable-xpg-echo-default)p |
17445 | Ft(.)150 2680 y Fs(--enable-xpg-echo-defaul)o(t)630 2790 | |
1c72c0cd CR |
17446 | y Ft(Mak)m(e)c(the)f Fs(echo)e Ft(builtin)i(expand)f(bac)m |
17447 | (kslash-escap)s(ed)h(c)m(haracters)h(b)m(y)f(default,)h(without)630 | |
8f714a7c | 17448 | 2899 y(requiring)41 b(the)g(`)p Fs(-e)p Ft(')g(option.)73 |
1c72c0cd | 17449 | b(This)41 b(sets)g(the)g(default)h(v)-5 b(alue)41 b(of)h(the)f |
8f714a7c | 17450 | Fs(xpg_echo)e Ft(shell)630 3009 y(option)26 b(to)g Fs(on)p |
1c72c0cd CR |
17451 | Ft(,)g(whic)m(h)g(mak)m(es)g(the)g(Bash)g Fs(echo)e Ft(b)s(eha)m(v)m(e) |
17452 | i(more)g(lik)m(e)h(the)f(v)m(ersion)g(sp)s(eci\014ed)630 | |
8f714a7c | 17453 | 3118 y(in)41 b(the)h(Single)g(Unix)f(Sp)s(eci\014cation,)k(v)m(ersion)e |
1c72c0cd | 17454 | (3.)74 b(See)42 b(Section)g(4.2)h([Bash)f(Builtins],)630 |
9f178efb | 17455 | 3228 y(page)31 b(48,)h(for)e(a)g(description)h(of)f(the)h(escap)s(e)g |
8f714a7c | 17456 | (sequences)f(that)h Fs(echo)f Ft(recognizes.)275 3387 |
1c72c0cd | 17457 | y(The)23 b(\014le)i(`)p Fs(config-top.h)p Ft(')c(con)m(tains)26 |
37c41ab1 | 17458 | b(C)e(Prepro)s(cessor)g(`)p Fs(#define)p Ft(')e(statemen)m(ts)k(for)f |
8f714a7c | 17459 | (options)f(whic)m(h)150 3497 y(are)35 b(not)g(settable)i(from)d |
5e13499c | 17460 | Fs(configure)p Ft(.)51 b(Some)35 b(of)g(these)g(are)h(not)f(mean)m(t)g |
8f714a7c | 17461 | (to)h(b)s(e)e(c)m(hanged;)k(b)s(ew)m(are)d(of)150 3606 |
37c41ab1 CR |
17462 | y(the)h(consequences)g(if)f(y)m(ou)h(do.)55 b(Read)36 |
17463 | b(the)g(commen)m(ts)g(asso)s(ciated)h(with)e(eac)m(h)i(de\014nition)e | |
8f714a7c | 17464 | (for)g(more)150 3716 y(information)c(ab)s(out)f(its)h(e\013ect.)p |
37c41ab1 | 17465 | eop end |
9f178efb CR |
17466 | %%Page: 146 152 |
17467 | TeXDict begin 146 151 bop eop end | |
17468 | %%Page: 147 153 | |
17469 | TeXDict begin 147 152 bop 150 -116 a Ft(App)s(endix)29 | |
17470 | b(A:)h(Rep)s(orting)h(Bugs)2299 b(147)150 299 y Fo(App)t(endix)52 | |
c302751c CR |
17471 | b(A)81 b(Rep)t(orting)53 b(Bugs)150 533 y Ft(Please)33 |
17472 | b(rep)s(ort)e(all)h(bugs)f(y)m(ou)h(\014nd)e(in)i(Bash.)44 | |
17473 | b(But)32 b(\014rst,)g(y)m(ou)g(should)e(mak)m(e)j(sure)e(that)h(it)g | |
17474 | (really)h(is)f(a)150 643 y(bug,)d(and)g(that)h(it)g(app)s(ears)f(in)g | |
17475 | (the)h(latest)h(v)m(ersion)f(of)g(Bash.)40 b(The)29 b(latest)j(v)m | |
17476 | (ersion)e(of)f(Bash)h(is)f(alw)m(a)m(ys)150 752 y(a)m(v)-5 | |
4a8bb13f CR |
17477 | b(ailable)33 b(for)d(FTP)g(from)g Fs(ftp://ftp.gnu.org/pub/gn)o(u/ba)o |
17478 | (sh/)o Ft(.)275 887 y(Once)41 b(y)m(ou)g(ha)m(v)m(e)h(determined)f | |
17479 | (that)h(a)f(bug)g(actually)h(exists,)j(use)c(the)g Fs(bashbug)e | |
37c41ab1 CR |
17480 | Ft(command)i(to)150 996 y(submit)25 b(a)h(bug)g(rep)s(ort.)38 |
17481 | b(If)26 b(y)m(ou)g(ha)m(v)m(e)h(a)f(\014x,)h(y)m(ou)f(are)g(encouraged) | |
17482 | h(to)f(mail)h(that)f(as)g(w)m(ell!)40 b(Suggestions)150 | |
d3ad40de CR |
17483 | 1106 y(and)20 b(`philosophical')j(bug)d(rep)s(orts)g(ma)m(y)i(b)s(e)e |
17484 | (mailed)i(to)g Fs(bug-bash@gnu.org)17 b Ft(or)k(p)s(osted)f(to)i(the)f | |
37c41ab1 CR |
17485 | (Usenet)150 1215 y(newsgroup)29 b Fs(gnu.bash.bug)p Ft(.)275 |
17486 | 1350 y(All)i(bug)e(rep)s(orts)h(should)f(include:)225 | |
17487 | 1484 y Fp(\017)60 b Ft(The)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(of)h | |
17488 | (Bash.)225 1619 y Fp(\017)60 b Ft(The)30 b(hardw)m(are)g(and)g(op)s | |
17489 | (erating)g(system.)225 1753 y Fp(\017)60 b Ft(The)30 | |
17490 | b(compiler)h(used)e(to)i(compile)h(Bash.)225 1888 y Fp(\017)60 | |
17491 | b Ft(A)30 b(description)h(of)f(the)h(bug)f(b)s(eha)m(viour.)225 | |
17492 | 2022 y Fp(\017)60 b Ft(A)30 b(short)h(script)f(or)g(`recip)s(e')h(whic) | |
17493 | m(h)f(exercises)i(the)e(bug)g(and)g(ma)m(y)h(b)s(e)f(used)f(to)i(repro) | |
17494 | s(duce)e(it.)150 2182 y Fs(bashbug)d Ft(inserts)i(the)h(\014rst)f | |
17495 | (three)g(items)h(automatically)i(in)m(to)f(the)e(template)i(it)f(pro)m | |
17496 | (vides)f(for)g(\014ling)h(a)150 2291 y(bug)h(rep)s(ort.)275 | |
17497 | 2426 y(Please)h(send)f(all)h(rep)s(orts)f(concerning)g(this)h(man)m | |
6932f7f5 | 17498 | (ual)f(to)h Fs(chet.ramey@case.edu)p Ft(.)p eop end |
9f178efb CR |
17499 | %%Page: 148 154 |
17500 | TeXDict begin 148 153 bop eop end | |
17501 | %%Page: 149 155 | |
17502 | TeXDict begin 149 154 bop 150 -116 a Ft(App)s(endix)29 | |
37c41ab1 | 17503 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
9f178efb | 17504 | b(The)f(Bourne)g(Shell)1258 b(149)150 141 y Fo(App)t(endix)58 |
c302751c CR |
17505 | b(B)81 b(Ma)9 b(jor)54 b(Di\013erences)d(F)-13 b(rom)54 |
17506 | b(The)g(Bourne)1088 299 y(Shell)150 530 y Ft(Bash)26 | |
17507 | b(implemen)m(ts)h(essen)m(tially)g(the)g(same)f(grammar,)h(parameter)f | |
17508 | (and)g(v)-5 b(ariable)27 b(expansion,)g(redirec-)150 | |
17509 | 640 y(tion,)i(and)e(quoting)g(as)h(the)g(Bourne)f(Shell.)40 | |
17510 | b(Bash)27 b(uses)g(the)h Fl(posix)f Ft(standard)f(as)i(the)g(sp)s | |
17511 | (eci\014cation)g(of)150 749 y(ho)m(w)34 b(these)h(features)g(are)g(to)g | |
17512 | (b)s(e)f(implemen)m(ted.)53 b(There)34 b(are)h(some)g(di\013erences)g | |
17513 | (b)s(et)m(w)m(een)g(the)g(tradi-)150 859 y(tional)e(Bourne)e(shell)h | |
ac18b312 CR |
17514 | (and)f(Bash;)i(this)f(section)g(quic)m(kly)h(details)g(the)e |
17515 | (di\013erences)h(of)g(signi\014cance.)46 b(A)150 969 | |
17516 | y(n)m(um)m(b)s(er)24 b(of)h(these)h(di\013erences)f(are)h(explained)f | |
17517 | (in)g(greater)h(depth)f(in)g(previous)f(sections.)40 | |
17518 | b(This)25 b(section)150 1078 y(uses)33 b(the)i(v)m(ersion)f(of)g | |
17519 | Fs(sh)f Ft(included)g(in)h(SVR4.2)h(\(the)f(last)h(v)m(ersion)f(of)g | |
17520 | (the)g(historical)i(Bourne)d(shell\))150 1188 y(as)e(the)f(baseline)h | |
1c72c0cd CR |
17521 | (reference.)225 1322 y Fp(\017)60 b Ft(Bash)32 b(is)h |
17522 | Fl(posix)p Ft(-conforman)m(t,)g(ev)m(en)g(where)f(the)g | |
17523 | Fl(posix)g Ft(sp)s(eci\014cation)h(di\013ers)f(from)g(traditional)330 | |
17524 | 1431 y Fs(sh)e Ft(b)s(eha)m(vior)g(\(see)i(Section)f(6.11)h([Bash)e | |
9f178efb | 17525 | (POSIX)g(Mo)s(de],)h(page)g(92\).)225 1565 y Fp(\017)60 |
1c72c0cd CR |
17526 | b Ft(Bash)26 b(has)g(m)m(ulti-c)m(haracter)i(in)m(v)m(o)s(cation)g |
17527 | (options)f(\(see)f(Section)h(6.1)g([In)m(v)m(oking)g(Bash],)h(page)e | |
9f178efb CR |
17528 | (79\).)225 1699 y Fp(\017)60 b Ft(Bash)40 b(has)f(command-line)h |
17529 | (editing)g(\(see)h(Chapter)e(8)h([Command)f(Line)g(Editing],)k(page)d | |
17530 | (101\))330 1809 y(and)30 b(the)g Fs(bind)g Ft(builtin.)225 | |
1c72c0cd CR |
17531 | 1943 y Fp(\017)60 b Ft(Bash)46 b(pro)m(vides)g(a)g(programmable)g(w)m |
17532 | (ord)f(completion)i(mec)m(hanism)f(\(see)h(Section)g(8.6)g([Pro-)330 | |
9f178efb | 17533 | 2052 y(grammable)39 b(Completion],)i(page)e(124\),)i(and)d(builtin)g |
6a8fd0ed CR |
17534 | (commands)f Fs(complete)p Ft(,)h Fs(compgen)p Ft(,)h(and)330 |
17535 | 2162 y Fs(compopt)p Ft(,)29 b(to)i(manipulate)g(it.)225 | |
1c72c0cd | 17536 | 2296 y Fp(\017)60 b Ft(Bash)26 b(has)f(command)h(history)f(\(see)i |
37c41ab1 | 17537 | (Section)f(9.1)h([Bash)f(History)h(F)-8 b(acilities],)30 |
9f178efb | 17538 | b(page)c(133\))i(and)d(the)330 2405 y Fs(history)k Ft(and)h |
37c41ab1 CR |
17539 | Fs(fc)g Ft(builtins)g(to)h(manipulate)g(it.)42 b(The)30 |
17540 | b(Bash)h(history)g(list)g(main)m(tains)g(timestamp)330 | |
1c72c0cd | 17541 | 2515 y(information)g(and)e(uses)h(the)h(v)-5 b(alue)31 |
37c41ab1 | 17542 | b(of)f(the)h Fs(HISTTIMEFORMAT)26 b Ft(v)-5 b(ariable)32 |
1c72c0cd | 17543 | b(to)f(displa)m(y)f(it.)225 2649 y Fp(\017)60 b Ft(Bash)48 |
37c41ab1 | 17544 | b(implemen)m(ts)h Fs(csh)p Ft(-lik)m(e)g(history)f(expansion)g(\(see)h |
1c72c0cd | 17545 | (Section)g(9.3)h([History)f(In)m(teraction],)330 2759 |
9f178efb | 17546 | y(page)31 b(135\).)225 2892 y Fp(\017)60 b Ft(Bash)33 |
37c41ab1 | 17547 | b(has)g(one-dimensional)h(arra)m(y)f(v)-5 b(ariables)34 |
9f178efb | 17548 | b(\(see)g(Section)g(6.7)g([Arra)m(ys],)g(page)g(88\),)h(and)e(the)330 |
1c72c0cd | 17549 | 3002 y(appropriate)39 b(v)-5 b(ariable)40 b(expansions)f(and)g |
37c41ab1 | 17550 | (assignmen)m(t)h(syn)m(tax)g(to)g(use)f(them.)67 b(Sev)m(eral)40 |
1c72c0cd | 17551 | b(of)g(the)330 3112 y(Bash)32 b(builtins)f(tak)m(e)j(options)e(to)h |
37c41ab1 | 17552 | (act)g(on)e(arra)m(ys.)46 b(Bash)32 b(pro)m(vides)g(a)g(n)m(um)m(b)s |
1c72c0cd CR |
17553 | (er)f(of)h(built-in)f(arra)m(y)330 3221 y(v)-5 b(ariables.)225 |
17554 | 3355 y Fp(\017)60 b Ft(The)37 b Fs($'...)n(')g Ft(quoting)g(syn)m(tax,) | |
37c41ab1 | 17555 | j(whic)m(h)d(expands)f(ANSI-C)h(bac)m(kslash-escap)s(ed)h(c)m |
1c72c0cd | 17556 | (haracters)g(in)330 3465 y(the)26 b(text)h(b)s(et)m(w)m(een)g(the)g |
37c41ab1 | 17557 | (single)f(quotes,)i(is)e(supp)s(orted)f(\(see)i(Section)g(3.1.2.4)h |
1c72c0cd | 17558 | ([ANSI-C)e(Quoting],)330 3574 y(page)31 b(6\).)225 3708 |
37c41ab1 CR |
17559 | y Fp(\017)60 b Ft(Bash)69 b(supp)s(orts)e(the)i Fs($"...)n(")g |
17560 | Ft(quoting)g(syn)m(tax)g(to)h(do)e(lo)s(cale-sp)s(eci\014c)j | |
1c72c0cd | 17561 | (translation)f(of)330 3818 y(the)65 b(c)m(haracters)i(b)s(et)m(w)m(een) |
37c41ab1 | 17562 | f(the)f(double)g(quotes.)145 b(The)65 b(`)p Fs(-D)p Ft(',)74 |
1c72c0cd | 17563 | b(`)p Fs(--dump-strings)p Ft(',)d(and)330 3927 y(`)p |
37c41ab1 CR |
17564 | Fs(--dump-po-strings)p Ft(')27 b(in)m(v)m(o)s(cation)33 |
17565 | b(options)e(list)h(the)f(translatable)h(strings)f(found)f(in)h(a)g | |
1c72c0cd CR |
17566 | (script)330 4037 y(\(see)g(Section)h(3.1.2.5)g([Lo)s(cale)g(T)-8 |
17567 | b(ranslation],)32 b(page)f(7\).)225 4171 y Fp(\017)60 | |
37c41ab1 CR |
17568 | b Ft(Bash)44 b(implemen)m(ts)g(the)f Fs(!)h Ft(k)m(eyw)m(ord)g(to)g |
17569 | (negate)h(the)f(return)e(v)-5 b(alue)44 b(of)g(a)g(pip)s(eline)f(\(see) | |
1c72c0cd | 17570 | h(Sec-)330 4281 y(tion)33 b(3.2.2)i([Pip)s(elines],)f(page)g(8\).)49 |
37c41ab1 | 17571 | b(V)-8 b(ery)33 b(useful)f(when)g(an)h Fs(if)f Ft(statemen)m(t)j(needs) |
1c72c0cd CR |
17572 | d(to)i(act)g(only)f(if)330 4390 y(a)k(test)h(fails.)60 |
17573 | b(The)36 b(Bash)g(`)p Fs(-o)30 b(pipefail)p Ft(')35 b(option)i(to)h | |
17574 | Fs(set)d Ft(will)i(cause)g(a)g(pip)s(eline)g(to)g(return)f(a)330 | |
17575 | 4500 y(failure)31 b(status)f(if)h(an)m(y)f(command)g(fails.)225 | |
17576 | 4634 y Fp(\017)60 b Ft(Bash)34 b(has)g(the)g Fs(time)f | |
37c41ab1 | 17577 | Ft(reserv)m(ed)h(w)m(ord)g(and)f(command)h(timing)h(\(see)g(Section)g |
1c72c0cd | 17578 | (3.2.2)g([Pip)s(elines],)330 4743 y(page)g(8\).)52 b(The)33 |
37c41ab1 | 17579 | b(displa)m(y)i(of)f(the)g(timing)g(statistics)i(ma)m(y)f(b)s(e)e(con)m |
1c72c0cd CR |
17580 | (trolled)j(with)e(the)g Fs(TIMEFORMAT)330 4853 y Ft(v)-5 |
17581 | b(ariable.)225 4987 y Fp(\017)60 b Ft(Bash)23 b(implemen)m(ts)g(the)h | |
c302751c CR |
17582 | Fs(for)29 b(\(\()h Fi(expr1)39 b Fs(;)30 b Fi(expr2)40 |
17583 | b Fs(;)30 b Fi(expr3)39 b Fs(\)\))23 b Ft(arithmetic)h(for)e(command,)j | |
1c72c0cd | 17584 | (sim-)330 5096 y(ilar)31 b(to)g(the)g(C)f(language)h(\(see)h(Section)f |
220537f2 | 17585 | (3.2.4.1)i([Lo)s(oping)d(Constructs],)h(page)g(10\).)225 |
1c72c0cd | 17586 | 5230 y Fp(\017)60 b Ft(Bash)31 b(includes)f(the)g Fs(select)f |
37c41ab1 | 17587 | Ft(comp)s(ound)g(command,)i(whic)m(h)f(allo)m(ws)i(the)f(generation)g |
1c72c0cd CR |
17588 | (of)g(simple)330 5340 y(men)m(us)f(\(see)h(Section)g(3.2.4.2)i |
17589 | ([Conditional)e(Constructs],)g(page)g(10\).)p eop end | |
9f178efb CR |
17590 | %%Page: 150 156 |
17591 | TeXDict begin 150 155 bop 150 -116 a Ft(150)2527 b(Bash)31 | |
1c72c0cd CR |
17592 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(Bash)40 |
17593 | b(includes)g(the)g Fs([[)g Ft(comp)s(ound)e(command,)43 | |
17594 | b(whic)m(h)c(mak)m(es)i(conditional)h(testing)f(part)f(of)330 | |
17595 | 408 y(the)f(shell)g(grammar)g(\(see)h(Section)f(3.2.4.2)j([Conditional) | |
17596 | d(Constructs],)i(page)f(10\),)i(including)330 518 y(optional)32 | |
17597 | b(regular)e(expression)g(matc)m(hing.)225 653 y Fp(\017)60 | |
17598 | b Ft(Bash)31 b(pro)m(vides)f(optional)h(case-insensitiv)m(e)i(matc)m | |
17599 | (hing)f(for)e(the)g Fs(case)g Ft(and)f Fs([[)h Ft(constructs.)225 | |
17600 | 789 y Fp(\017)60 b Ft(Bash)27 b(includes)g(brace)h(expansion)f(\(see)h | |
9f178efb | 17601 | (Section)g(3.5.1)i([Brace)e(Expansion],)g(page)g(21\))h(and)d(tilde)330 |
1c72c0cd | 17602 | 898 y(expansion)k(\(see)i(Section)f(3.5.2)h([Tilde)f(Expansion],)f |
45c0f7f8 | 17603 | (page)h(21\).)225 1034 y Fp(\017)60 b Ft(Bash)24 b(implemen)m(ts)h |
1c72c0cd CR |
17604 | (command)e(aliases)j(and)d(the)i Fs(alias)d Ft(and)i |
17605 | Fs(unalias)e Ft(builtins)h(\(see)i(Section)g(6.6)330 | |
9f178efb | 17606 | 1143 y([Aliases],)32 b(page)f(87\).)225 1279 y Fp(\017)60 |
1c72c0cd CR |
17607 | b Ft(Bash)32 b(pro)m(vides)g(shell)g(arithmetic,)i(the)e |
17608 | Fs(\(\()g Ft(comp)s(ound)e(command)i(\(see)h(Section)f(3.2.4.2)j([Con-) | |
17609 | 330 1388 y(ditional)d(Constructs],)e(page)i(10\),)g(and)e(arithmetic)i | |
17610 | (expansion)e(\(see)i(Section)f(6.5)h([Shell)f(Arith-)330 | |
9f178efb | 17611 | 1498 y(metic],)h(page)f(86\).)225 1633 y Fp(\017)60 b |
37c41ab1 CR |
17612 | Ft(V)-8 b(ariables)31 b(presen)m(t)e(in)g(the)g(shell's)h(initial)g(en) |
17613 | m(vironmen)m(t)g(are)g(automatically)i(exp)s(orted)d(to)h(c)m(hild)330 | |
1c72c0cd | 17614 | 1743 y(pro)s(cesses.)38 b(The)23 b(Bourne)g(shell)g(do)s(es)g(not)g |
37c41ab1 | 17615 | (normally)g(do)g(this)g(unless)g(the)g(v)-5 b(ariables)24 |
1c72c0cd CR |
17616 | b(are)f(explicitly)330 1852 y(mark)m(ed)30 b(using)g(the)h |
17617 | Fs(export)e Ft(command.)225 1988 y Fp(\017)60 b Ft(Bash)26 | |
17618 | b(supp)s(orts)d(the)j(`)p Fs(+=)p Ft(')f(assignmen)m(t)i(op)s(erator,)g | |
17619 | (whic)m(h)e(app)s(ends)f(to)i(the)g(v)-5 b(alue)26 b(of)f(the)h(v)-5 | |
17620 | b(ariable)330 2097 y(named)30 b(on)g(the)h(left)g(hand)e(side.)225 | |
17621 | 2233 y Fp(\017)60 b Ft(Bash)36 b(includes)g(the)g Fl(posix)f | |
17622 | Ft(pattern)h(remo)m(v)-5 b(al)37 b(`)p Fs(\045)p Ft(',)h(`)p | |
17623 | Fs(#)p Ft(',)g(`)p Fs(\045\045)p Ft(')e(and)f(`)p Fs(##)p | |
17624 | Ft(')h(expansions)g(to)g(remo)m(v)m(e)330 2342 y(leading)f(or)f | |
17625 | (trailing)h(substrings)e(from)g(v)-5 b(ariable)35 b(v)-5 | |
17626 | b(alues)35 b(\(see)g(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
45c0f7f8 | 17627 | 2452 y(Expansion],)30 b(page)h(22\).)225 2587 y Fp(\017)60 |
1c72c0cd CR |
17628 | b Ft(The)46 b(expansion)g Fs(${#xx})p Ft(,)j(whic)m(h)d(returns)f(the)i |
17629 | (length)f(of)h Fs(${xx})p Ft(,)i(is)e(supp)s(orted)d(\(see)j(Sec-)330 | |
17630 | 2697 y(tion)31 b(3.5.3)h([Shell)f(P)m(arameter)g(Expansion],)f(page)i | |
45c0f7f8 | 17631 | (22\).)225 2832 y Fp(\017)60 b Ft(The)30 b(expansion)g |
1c72c0cd CR |
17632 | Fs(${var:)p Fq(o\013set)r Fs([:)p Fq(length)p Fs(]})p |
17633 | Ft(,)g(whic)m(h)g(expands)g(to)h(the)g(substring)e(of)i | |
17634 | Fs(var)p Ft('s)e(v)-5 b(alue)330 2942 y(of)43 b(length)g | |
c302751c CR |
17635 | Fq(length)p Ft(,)j(b)s(eginning)c(at)i Fq(o\013set)r |
17636 | Ft(,)j(is)42 b(presen)m(t)h(\(see)h(Section)f(3.5.3)i([Shell)e(P)m | |
45c0f7f8 | 17637 | (arameter)330 3051 y(Expansion],)30 b(page)h(22\).)225 |
1c72c0cd | 17638 | 3187 y Fp(\017)60 b Ft(The)21 b(expansion)f Fs(${var/[/])p |
5e13499c | 17639 | Fq(pattern)p Fs([/)p Fq(replacemen)m(t)r Fs(]})p Ft(,)i(whic)m(h)e |
1c72c0cd | 17640 | (matc)m(hes)j Fq(pattern)e Ft(and)f(replaces)330 3296 |
37c41ab1 CR |
17641 | y(it)29 b(with)e Fq(replacemen)m(t)32 b Ft(in)c(the)g(v)-5 |
17642 | b(alue)29 b(of)f Fs(var)p Ft(,)g(is)g(a)m(v)-5 b(ailable)31 | |
17643 | b(\(see)e(Section)f(3.5.3)i([Shell)f(P)m(arameter)330 | |
45c0f7f8 | 17644 | 3406 y(Expansion],)h(page)h(22\).)225 3541 y Fp(\017)60 |
9f178efb CR |
17645 | b Ft(The)32 b(expansion)g Fs(${!)p Fi(prefix)11 b Fs(*})29 |
17646 | b Ft(expansion,)j(whic)m(h)g(expands)g(to)h(the)f(names)g(of)h(all)g | |
17647 | (shell)f(v)-5 b(ari-)330 3651 y(ables)36 b(whose)f(names)h(b)s(egin)f | |
17648 | (with)g Fq(pre\014x)6 b Ft(,)36 b(is)g(a)m(v)-5 b(ailable)38 | |
17649 | b(\(see)e(Section)h(3.5.3)g([Shell)f(P)m(arameter)330 | |
45c0f7f8 | 17650 | 3761 y(Expansion],)30 b(page)h(22\).)225 3896 y Fp(\017)60 |
37c41ab1 CR |
17651 | b Ft(Bash)22 b(has)f Fq(indirect)j Ft(v)-5 b(ariable)22 |
17652 | b(expansion)g(using)f Fs(${!word})e Ft(\(see)k(Section)f(3.5.3)i | |
45c0f7f8 | 17653 | ([Shell)e(P)m(arameter)330 4006 y(Expansion],)30 b(page)h(22\).)225 |
1c72c0cd | 17654 | 4141 y Fp(\017)60 b Ft(Bash)31 b(can)f(expand)g(p)s(ositional)h |
37c41ab1 | 17655 | (parameters)g(b)s(ey)m(ond)e Fs($9)h Ft(using)g Fs(${)p |
c302751c | 17656 | Fi(num)11 b Fs(})p Ft(.)225 4276 y Fp(\017)60 b Ft(The)27 |
37c41ab1 CR |
17657 | b Fl(posix)g Fs($\(\))g Ft(form)g(of)h(command)g(substitution)f(is)h |
17658 | (implemen)m(ted)g(\(see)h(Section)f(3.5.4)i([Com-)330 | |
9f178efb | 17659 | 4386 y(mand)38 b(Substitution],)k(page)e(27\),)j(and)38 |
37c41ab1 | 17660 | b(preferred)g(to)i(the)g(Bourne)f(shell's)h Fs(``)e Ft(\(whic)m(h)i(is) |
1c72c0cd CR |
17661 | f(also)330 4495 y(implemen)m(ted)31 b(for)f(bac)m(kw)m(ards)h |
17662 | (compatibilit)m(y\).)225 4631 y Fp(\017)60 b Ft(Bash)31 | |
37c41ab1 | 17663 | b(has)f(pro)s(cess)g(substitution)g(\(see)h(Section)g(3.5.6)h([Pro)s |
9f178efb | 17664 | (cess)f(Substitution],)f(page)h(28\).)225 4766 y Fp(\017)60 |
37c41ab1 CR |
17665 | b Ft(Bash)55 b(automatically)j(assigns)e(v)-5 b(ariables)55 |
17666 | b(that)h(pro)m(vide)f(information)h(ab)s(out)f(the)g(curren)m(t)330 | |
1c72c0cd | 17667 | 4876 y(user)40 b(\()p Fs(UID)p Ft(,)i Fs(EUID)p Ft(,)g(and)e |
5e13499c CR |
17668 | Fs(GROUPS)p Ft(\),)h(the)g(curren)m(t)f(host)g(\()p Fs(HOSTTYPE)p |
17669 | Ft(,)h Fs(OSTYPE)p Ft(,)h Fs(MACHTYPE)p Ft(,)f(and)330 | |
1c72c0cd | 17670 | 4985 y Fs(HOSTNAME)p Ft(\),)55 b(and)c(the)g(instance)h(of)g(Bash)f |
37c41ab1 | 17671 | (that)h(is)f(running)f(\()p Fs(BASH)p Ft(,)56 b Fs(BASH_VERSION)p |
1c72c0cd | 17672 | Ft(,)e(and)330 5095 y Fs(BASH_VERSINFO)p Ft(\).)37 b(See)31 |
9f178efb | 17673 | b(Section)g(5.2)h([Bash)e(V)-8 b(ariables],)33 b(page)e(69,)g(for)f |
1c72c0cd | 17674 | (details.)225 5230 y Fp(\017)60 b Ft(The)44 b Fs(IFS)f |
37c41ab1 | 17675 | Ft(v)-5 b(ariable)45 b(is)f(used)f(to)i(split)f(only)g(the)g(results)g |
1c72c0cd | 17676 | (of)h(expansion,)i(not)d(all)h(w)m(ords)f(\(see)330 5340 |
9f178efb | 17677 | y(Section)29 b(3.5.7)h([W)-8 b(ord)29 b(Splitting],)h(page)f(28\).)41 |
1c72c0cd CR |
17678 | b(This)28 b(closes)h(a)g(longstanding)g(shell)f(securit)m(y)h(hole.)p |
17679 | eop end | |
9f178efb CR |
17680 | %%Page: 151 157 |
17681 | TeXDict begin 151 156 bop 150 -116 a Ft(App)s(endix)29 | |
37c41ab1 | 17682 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
9f178efb | 17683 | b(The)f(Bourne)g(Shell)1258 b(151)225 299 y Fp(\017)60 |
ac18b312 CR |
17684 | b Ft(Bash)38 b(implemen)m(ts)g(the)g(full)g(set)g(of)g |
17685 | Fl(posix)f Ft(\014lename)h(expansion)g(op)s(erators,)i(including)d | |
c302751c CR |
17686 | Fq(c)m(har-)330 408 y(acter)i(classes)t Ft(,)h Fq(equiv)-5 |
17687 | b(alence)39 b(classes)t Ft(,)h(and)d Fq(collating)j(sym)m(b)s(ols)g | |
17688 | Ft(\(see)f(Section)f(3.5.8)h([Filename)330 518 y(Expansion],)30 | |
9f178efb | 17689 | b(page)h(29\).)225 660 y Fp(\017)60 b Ft(Bash)35 b(implemen)m(ts)g |
ac18b312 CR |
17690 | (extended)g(pattern)g(matc)m(hing)h(features)f(when)f(the)h |
17691 | Fs(extglob)d Ft(shell)j(option)330 769 y(is)30 b(enabled)h(\(see)g | |
9f178efb | 17692 | (Section)g(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)g(page)f(29\).)225 |
ac18b312 CR |
17693 | 911 y Fp(\017)60 b Ft(It)22 b(is)g(p)s(ossible)g(to)h(ha)m(v)m(e)g(a)f |
17694 | (v)-5 b(ariable)23 b(and)f(a)g(function)g(with)g(the)g(same)g(name;)j | |
17695 | Fs(sh)d Ft(do)s(es)g(not)g(separate)330 1021 y(the)31 | |
17696 | b(t)m(w)m(o)g(name)g(spaces.)225 1163 y Fp(\017)60 b | |
17697 | Ft(Bash)30 b(functions)e(are)i(p)s(ermitted)f(to)h(ha)m(v)m(e)h(lo)s | |
17698 | (cal)g(v)-5 b(ariables)30 b(using)f(the)g Fs(local)f | |
17699 | Ft(builtin,)i(and)e(th)m(us)330 1272 y(useful)i(recursiv)m(e)g | |
17700 | (functions)g(ma)m(y)h(b)s(e)f(written)g(\(see)i(Section)f(4.2)g([Bash)g | |
9f178efb | 17701 | (Builtins],)g(page)h(48\).)225 1414 y Fp(\017)60 b Ft(V)-8 |
ac18b312 CR |
17702 | b(ariable)25 b(assignmen)m(ts)g(preceding)e(commands)h(a\013ect)h(only) |
17703 | f(that)g(command,)h(ev)m(en)f(builtins)g(and)330 1524 | |
17704 | y(functions)36 b(\(see)h(Section)g(3.7.4)h([En)m(vironmen)m(t],)h(page) | |
9f178efb | 17705 | e(37\).)60 b(In)35 b Fs(sh)p Ft(,)j(all)f(v)-5 b(ariable)37 |
ac18b312 CR |
17706 | b(assignmen)m(ts)330 1633 y(preceding)30 b(commands)g(are)h(global)h |
17707 | (unless)d(the)i(command)f(is)h(executed)g(from)f(the)g(\014le)h | |
17708 | (system.)225 1775 y Fp(\017)60 b Ft(Bash)44 b(p)s(erforms)e(\014lename) | |
17709 | i(expansion)f(on)h(\014lenames)g(sp)s(eci\014ed)f(as)h(op)s(erands)e | |
17710 | (to)j(input)e(and)330 1885 y(output)30 b(redirection)h(op)s(erators)g | |
9f178efb | 17711 | (\(see)g(Section)g(3.6)h([Redirections],)g(page)f(31\).)225 |
ac18b312 CR |
17712 | 2027 y Fp(\017)60 b Ft(Bash)29 b(con)m(tains)h(the)f(`)p |
17713 | Fs(<>)p Ft(')f(redirection)i(op)s(erator,)f(allo)m(wing)i(a)e(\014le)g | |
17714 | (to)g(b)s(e)f(op)s(ened)g(for)h(b)s(oth)f(read-)330 2136 | |
17715 | y(ing)35 b(and)f(writing,)i(and)e(the)h(`)p Fs(&>)p Ft(')g(redirection) | |
17716 | g(op)s(erator,)h(for)f(directing)g(standard)f(output)h(and)330 | |
17717 | 2246 y(standard)30 b(error)g(to)h(the)f(same)h(\014le)f(\(see)i | |
9f178efb | 17718 | (Section)f(3.6)g([Redirections],)h(page)g(31\).)225 2388 |
ac18b312 CR |
17719 | y Fp(\017)60 b Ft(Bash)21 b(includes)f(the)h(`)p Fs(<<<)p |
17720 | Ft(')g(redirection)g(op)s(erator,)i(allo)m(wing)g(a)e(string)f(to)i(b)s | |
17721 | (e)e(used)g(as)h(the)g(standard)330 2497 y(input)29 b(to)j(a)e | |
17722 | (command.)225 2639 y Fp(\017)60 b Ft(Bash)29 b(implemen)m(ts)h(the)f(`) | |
c302751c CR |
17723 | p Fs([n]<&)p Fi(word)11 b Ft(')26 b(and)j(`)p Fs([n]>&)p |
17724 | Fi(word)11 b Ft(')26 b(redirection)k(op)s(erators,)g(whic)m(h)e(mo)m(v) | |
ac18b312 CR |
17725 | m(e)330 2749 y(one)j(\014le)f(descriptor)g(to)h(another.)225 |
17726 | 2890 y Fp(\017)60 b Ft(Bash)25 b(treats)h(a)f(n)m(um)m(b)s(er)e(of)i | |
17727 | (\014lenames)g(sp)s(ecially)g(when)f(they)h(are)g(used)f(in)g | |
17728 | (redirection)i(op)s(erators)330 3000 y(\(see)31 b(Section)h(3.6)f | |
9f178efb | 17729 | ([Redirections],)h(page)f(31\).)225 3142 y Fp(\017)60 |
ac18b312 CR |
17730 | b Ft(Bash)33 b(can)f(op)s(en)g(net)m(w)m(ork)i(connections)f(to)h |
17731 | (arbitrary)e(mac)m(hines)h(and)f(services)h(with)f(the)h(redi-)330 | |
17732 | 3251 y(rection)e(op)s(erators)g(\(see)g(Section)g(3.6)h | |
9f178efb | 17733 | ([Redirections],)g(page)f(31\).)225 3393 y Fp(\017)60 |
37c41ab1 CR |
17734 | b Ft(The)29 b Fs(noclobber)e Ft(option)j(is)g(a)m(v)-5 |
17735 | b(ailable)32 b(to)e(a)m(v)m(oid)h(o)m(v)m(erwriting)g(existing)g | |
d3ad40de | 17736 | (\014les)e(with)h(output)f(redi-)330 3503 y(rection)39 |
9f178efb | 17737 | b(\(see)h(Section)f(4.3.1)h([The)e(Set)h(Builtin],)i(page)e(58\).)66 |
d3ad40de CR |
17738 | b(The)38 b(`)p Fs(>|)p Ft(')h(redirection)g(op)s(erator)330 |
17739 | 3612 y(ma)m(y)31 b(b)s(e)f(used)f(to)i(o)m(v)m(erride)h | |
17740 | Fs(noclobber)p Ft(.)225 3754 y Fp(\017)60 b Ft(The)34 | |
17741 | b(Bash)g Fs(cd)g Ft(and)f Fs(pwd)g Ft(builtins)h(\(see)h(Section)g(4.1) | |
9f178efb | 17742 | g([Bourne)g(Shell)f(Builtins],)h(page)g(41\))h(eac)m(h)330 |
d3ad40de CR |
17743 | 3864 y(tak)m(e)c(`)p Fs(-L)p Ft(')e(and)g(`)p Fs(-P)p |
17744 | Ft(')g(options)h(to)g(switc)m(h)g(b)s(et)m(w)m(een)g(logical)i(and)c | |
17745 | (ph)m(ysical)i(mo)s(des.)225 4006 y Fp(\017)60 b Ft(Bash)25 | |
17746 | b(allo)m(ws)h(a)g(function)e(to)i(o)m(v)m(erride)g(a)g(builtin)e(with)h | |
17747 | (the)g(same)g(name,)i(and)d(pro)m(vides)h(access)h(to)330 | |
17748 | 4115 y(that)34 b(builtin's)f(functionalit)m(y)h(within)f(the)g | |
17749 | (function)g(via)h(the)f Fs(builtin)f Ft(and)g Fs(command)g | |
17750 | Ft(builtins)330 4225 y(\(see)f(Section)h(4.2)f([Bash)g(Builtins],)g | |
9f178efb | 17751 | (page)g(48\).)225 4367 y Fp(\017)60 b Ft(The)35 b Fs(command)e |
d3ad40de CR |
17752 | Ft(builtin)i(allo)m(ws)i(selectiv)m(e)h(disabling)e(of)f(functions)g |
17753 | (when)g(command)g(lo)s(okup)g(is)330 4476 y(p)s(erformed)29 | |
9f178efb | 17754 | b(\(see)i(Section)g(4.2)h([Bash)f(Builtins],)g(page)g(48\).)225 |
d3ad40de CR |
17755 | 4618 y Fp(\017)60 b Ft(Individual)23 b(builtins)g(ma)m(y)i(b)s(e)e |
17756 | (enabled)h(or)g(disabled)g(using)f(the)h Fs(enable)f | |
17757 | Ft(builtin)g(\(see)i(Section)g(4.2)330 4728 y([Bash)31 | |
9f178efb | 17758 | b(Builtins],)g(page)g(48\).)225 4869 y Fp(\017)60 b Ft(The)26 |
d3ad40de CR |
17759 | b(Bash)h Fs(exec)e Ft(builtin)h(tak)m(es)i(additional)f(options)g(that) |
17760 | g(allo)m(w)h(users)d(to)j(con)m(trol)g(the)e(con)m(ten)m(ts)330 | |
17761 | 4979 y(of)35 b(the)f(en)m(vironmen)m(t)h(passed)f(to)h(the)g(executed)g | |
17762 | (command,)h(and)d(what)i(the)f(zeroth)h(argumen)m(t)330 | |
1c72c0cd | 17763 | 5089 y(to)c(the)g(command)f(is)g(to)h(b)s(e)f(\(see)h(Section)h(4.1)f |
9f178efb | 17764 | ([Bourne)f(Shell)h(Builtins],)g(page)g(41\).)225 5230 |
37c41ab1 CR |
17765 | y Fp(\017)60 b Ft(Shell)29 b(functions)g(ma)m(y)h(b)s(e)f(exp)s(orted)g |
17766 | (to)h(c)m(hildren)f(via)h(the)g(en)m(vironmen)m(t)g(using)f | |
1c72c0cd | 17767 | Fs(export)f(-f)h Ft(\(see)330 5340 y(Section)i(3.3)h([Shell)e(F)-8 |
45c0f7f8 | 17768 | b(unctions],)32 b(page)f(16\).)p eop end |
9f178efb CR |
17769 | %%Page: 152 158 |
17770 | TeXDict begin 152 157 bop 150 -116 a Ft(152)2527 b(Bash)31 | |
1c72c0cd CR |
17771 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(The)37 |
17772 | b(Bash)g Fs(export)p Ft(,)h Fs(readonly)p Ft(,)f(and)f | |
17773 | Fs(declare)g Ft(builtins)h(can)g(tak)m(e)i(a)f(`)p Fs(-f)p | |
17774 | Ft(')f(option)h(to)g(act)g(on)330 408 y(shell)26 b(functions,)g(a)h(`)p | |
17775 | Fs(-p)p Ft(')e(option)h(to)h(displa)m(y)f(v)-5 b(ariables)26 | |
17776 | b(with)g(v)-5 b(arious)25 b(attributes)i(set)f(in)f(a)i(format)330 | |
17777 | 518 y(that)g(can)f(b)s(e)f(used)h(as)g(shell)g(input,)h(a)f(`)p | |
17778 | Fs(-n)p Ft(')g(option)g(to)h(remo)m(v)m(e)h(v)-5 b(arious)26 | |
17779 | b(v)-5 b(ariable)27 b(attributes,)h(and)330 628 y(`)p | |
17780 | Fs(name=value)p Ft(')g(argumen)m(ts)j(to)g(set)g(v)-5 | |
37c41ab1 | 17781 | b(ariable)31 b(attributes)g(and)f(v)-5 b(alues)30 b(sim)m(ultaneously) |
1c72c0cd | 17782 | -8 b(.)225 765 y Fp(\017)60 b Ft(The)42 b(Bash)h Fs(hash)f |
37c41ab1 | 17783 | Ft(builtin)g(allo)m(ws)j(a)e(name)g(to)g(b)s(e)f(asso)s(ciated)j(with)d |
1c72c0cd | 17784 | (an)h(arbitrary)f(\014lename,)330 874 y(ev)m(en)30 b(when)e(that)h |
37c41ab1 CR |
17785 | (\014lename)g(cannot)h(b)s(e)e(found)g(b)m(y)h(searc)m(hing)g(the)g |
17786 | Fs($PATH)p Ft(,)g(using)f(`)p Fs(hash)h(-p)p Ft(')g(\(see)330 | |
9f178efb | 17787 | 984 y(Section)i(4.1)h([Bourne)e(Shell)g(Builtins],)h(page)h(41\).)225 |
1c72c0cd | 17788 | 1121 y Fp(\017)60 b Ft(Bash)27 b(includes)f(a)i Fs(help)d |
37c41ab1 | 17789 | Ft(builtin)i(for)f(quic)m(k)h(reference)h(to)f(shell)g(facilities)i |
9f178efb | 17790 | (\(see)f(Section)g(4.2)g([Bash)330 1230 y(Builtins],)j(page)g(48\).)225 |
1c72c0cd | 17791 | 1367 y Fp(\017)60 b Ft(The)42 b Fs(printf)g Ft(builtin)g(is)h(a)m(v)-5 |
37c41ab1 | 17792 | b(ailable)45 b(to)f(displa)m(y)f(formatted)g(output)g(\(see)h(Section)g |
9f178efb | 17793 | (4.2)g([Bash)330 1477 y(Builtins],)31 b(page)g(48\).)225 |
1c72c0cd | 17794 | 1614 y Fp(\017)60 b Ft(The)26 b(Bash)h Fs(read)f Ft(builtin)g(\(see)i |
9f178efb | 17795 | (Section)g(4.2)g([Bash)f(Builtins],)h(page)g(48\))g(will)f(read)g(a)g |
1c72c0cd | 17796 | (line)g(ending)330 1724 y(in)f(`)p Fs(\\)p Ft(')h(with)f(the)g(`)p |
37c41ab1 | 17797 | Fs(-r)p Ft(')h(option,)h(and)d(will)i(use)f(the)h Fs(REPLY)e |
1c72c0cd CR |
17798 | Ft(v)-5 b(ariable)27 b(as)g(a)f(default)h(if)f(no)h(non-option)330 |
17799 | 1833 y(argumen)m(ts)k(are)h(supplied.)42 b(The)30 b(Bash)i | |
17800 | Fs(read)e Ft(builtin)g(also)j(accepts)f(a)g(prompt)e(string)h(with)g | |
17801 | (the)330 1943 y(`)p Fs(-p)p Ft(')k(option)g(and)f(will)h(use)g | |
17802 | (Readline)g(to)h(obtain)f(the)g(line)g(when)f(giv)m(en)i(the)f(`)p | |
17803 | Fs(-e)p Ft(')g(option.)54 b(The)330 2052 y Fs(read)31 | |
37c41ab1 CR |
17804 | b Ft(builtin)h(also)i(has)e(additional)h(options)g(to)g(con)m(trol)h |
17805 | (input:)44 b(the)32 b(`)p Fs(-s)p Ft(')h(option)f(will)h(turn)f(o\013) | |
1c72c0cd CR |
17806 | 330 2162 y(ec)m(hoing)38 b(of)e(input)f(c)m(haracters)j(as)e(they)h |
17807 | (are)f(read,)i(the)e(`)p Fs(-t)p Ft(')g(option)h(will)g(allo)m(w)g | |
17808 | Fs(read)e Ft(to)i(time)330 2271 y(out)c(if)g(input)f(do)s(es)g(not)h | |
37c41ab1 CR |
17809 | (arriv)m(e)g(within)g(a)g(sp)s(eci\014ed)f(n)m(um)m(b)s(er)f(of)i |
17810 | (seconds,)h(the)f(`)p Fs(-n)p Ft(')f(option)i(will)330 | |
1c72c0cd | 17811 | 2381 y(allo)m(w)29 b(reading)e(only)h(a)g(sp)s(eci\014ed)e(n)m(um)m(b)s |
37c41ab1 | 17812 | (er)g(of)i(c)m(haracters)h(rather)e(than)g(a)h(full)f(line,)i(and)d |
1c72c0cd CR |
17813 | (the)i(`)p Fs(-d)p Ft(')330 2491 y(option)j(will)g(read)f(un)m(til)g(a) |
17814 | h(particular)g(c)m(haracter)h(rather)e(than)g(newline.)225 | |
17815 | 2628 y Fp(\017)60 b Ft(The)33 b Fs(return)e Ft(builtin)i(ma)m(y)g(b)s | |
37c41ab1 | 17816 | (e)g(used)f(to)i(ab)s(ort)f(execution)h(of)f(scripts)g(executed)h(with) |
1c72c0cd | 17817 | f(the)g Fs(.)g Ft(or)330 2737 y Fs(source)c Ft(builtins)g(\(see)j |
9f178efb | 17818 | (Section)f(4.1)g([Bourne)g(Shell)f(Builtins],)h(page)g(41\).)225 |
1c72c0cd | 17819 | 2874 y Fp(\017)60 b Ft(Bash)43 b(includes)g(the)g Fs(shopt)f |
37c41ab1 | 17820 | Ft(builtin,)k(for)d(\014ner)f(con)m(trol)j(of)e(shell)h(optional)g |
d3ad40de | 17821 | (capabilities)h(\(see)330 2984 y(Section)c(4.3.2)g([The)f(Shopt)f |
9f178efb | 17822 | (Builtin],)k(page)d(62\),)k(and)39 b(allo)m(ws)i(these)f(options)h(to)f |
d3ad40de CR |
17823 | (b)s(e)f(set)i(and)330 3093 y(unset)30 b(at)h(shell)g(in)m(v)m(o)s |
17824 | (cation)h(\(see)f(Section)h(6.1)f([In)m(v)m(oking)g(Bash],)g(page)h | |
9f178efb | 17825 | (79\).)225 3230 y Fp(\017)60 b Ft(Bash)45 b(has)f(m)m(uc)m(h)g(more)h |
d3ad40de CR |
17826 | (optional)h(b)s(eha)m(vior)e(con)m(trollable)j(with)e(the)f |
17827 | Fs(set)g Ft(builtin)g(\(see)h(Sec-)330 3340 y(tion)31 | |
9f178efb | 17828 | b(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(58\).)225 3477 |
122f603c CR |
17829 | y Fp(\017)60 b Ft(The)45 b(`)p Fs(-x)p Ft(')g(\(`)p Fs(xtrace)p |
17830 | Ft('\))g(option)h(displa)m(ys)g(commands)f(other)h(than)f(simple)h | |
17831 | (commands)f(when)330 3587 y(p)s(erforming)29 b(an)h(execution)i(trace)g | |
9f178efb | 17832 | (\(see)f(Section)g(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(58\).)225 |
d3ad40de | 17833 | 3724 y Fp(\017)60 b Ft(The)28 b Fs(test)g Ft(builtin)h(\(see)h(Section) |
9f178efb | 17834 | f(4.1)h([Bourne)f(Shell)g(Builtins],)h(page)g(41\))g(is)f(sligh)m(tly)h |
1c72c0cd | 17835 | (di\013eren)m(t,)330 3833 y(as)23 b(it)g(implemen)m(ts)f(the)h |
37c41ab1 | 17836 | Fl(posix)f Ft(algorithm,)j(whic)m(h)d(sp)s(eci\014es)g(the)h(b)s(eha)m |
1c72c0cd CR |
17837 | (vior)f(based)g(on)h(the)f(n)m(um)m(b)s(er)330 3943 y(of)31 |
17838 | b(argumen)m(ts.)225 4080 y Fp(\017)60 b Ft(Bash)31 b(includes)g(the)h | |
37c41ab1 | 17839 | Fs(caller)d Ft(builtin,)j(whic)m(h)f(displa)m(ys)g(the)g(con)m(text)i |
1c72c0cd | 17840 | (of)f(an)m(y)g(activ)m(e)h(subroutine)330 4189 y(call)28 |
37c41ab1 CR |
17841 | b(\(a)f(shell)f(function)h(or)f(a)h(script)f(executed)h(with)f(the)h |
17842 | Fs(.)f Ft(or)g Fs(source)f Ft(builtins\).)39 b(This)26 | |
1c72c0cd CR |
17843 | b(supp)s(orts)330 4299 y(the)31 b(bash)e(debugger.)225 |
17844 | 4436 y Fp(\017)60 b Ft(The)42 b Fs(trap)f Ft(builtin)h(\(see)i(Section) | |
9f178efb | 17845 | f(4.1)h([Bourne)e(Shell)g(Builtins],)47 b(page)c(41\))h(allo)m(ws)g(a)e |
1c72c0cd | 17846 | Fs(DEBUG)330 4545 y Ft(pseudo-signal)c(sp)s(eci\014cation,)i(similar)e |
37c41ab1 | 17847 | (to)g Fs(EXIT)p Ft(.)62 b(Commands)36 b(sp)s(eci\014ed)h(with)g(a)h |
1c72c0cd | 17848 | Fs(DEBUG)e Ft(trap)330 4655 y(are)k(executed)g(b)s(efore)f(ev)m(ery)h |
37c41ab1 | 17849 | (simple)f(command,)j Fs(for)c Ft(command,)k Fs(case)c |
1c72c0cd | 17850 | Ft(command,)k Fs(select)330 4765 y Ft(command,)35 b(ev)m(ery)g |
37c41ab1 | 17851 | (arithmetic)g Fs(for)e Ft(command,)i(and)f(b)s(efore)g(the)g(\014rst)f |
1c72c0cd | 17852 | (command)h(executes)h(in)330 4874 y(a)29 b(shell)g(function.)40 |
37c41ab1 | 17853 | b(The)28 b Fs(DEBUG)g Ft(trap)g(is)h(not)g(inherited)f(b)m(y)h(shell)g |
1c72c0cd | 17854 | (functions)f(unless)g(the)h(function)330 4984 y(has)35 |
37c41ab1 CR |
17855 | b(b)s(een)g(giv)m(en)i(the)f Fs(trace)e Ft(attribute)i(or)g(the)g |
17856 | Fs(functrace)d Ft(option)j(has)f(b)s(een)g(enabled)g(using)330 | |
1c72c0cd | 17857 | 5093 y(the)28 b Fs(shopt)e Ft(builtin.)39 b(The)27 b |
37c41ab1 | 17858 | Fs(extdebug)f Ft(shell)i(option)g(has)f(additional)h(e\013ects)h(on)f |
1c72c0cd | 17859 | (the)g Fs(DEBUG)e Ft(trap.)330 5230 y(The)21 b Fs(trap)e |
37c41ab1 | 17860 | Ft(builtin)i(\(see)h(Section)g(4.1)g([Bourne)f(Shell)g(Builtins],)j |
9f178efb | 17861 | (page)e(41\))g(allo)m(ws)g(an)f Fs(ERR)f Ft(pseudo-)330 |
1c72c0cd | 17862 | 5340 y(signal)30 b(sp)s(eci\014cation,)h(similar)f(to)g |
37c41ab1 | 17863 | Fs(EXIT)f Ft(and)g Fs(DEBUG)p Ft(.)39 b(Commands)28 b(sp)s(eci\014ed)h |
1c72c0cd | 17864 | (with)g(an)g Fs(ERR)g Ft(trap)p eop end |
9f178efb CR |
17865 | %%Page: 153 159 |
17866 | TeXDict begin 153 158 bop 150 -116 a Ft(App)s(endix)29 | |
1c72c0cd | 17867 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
9f178efb | 17868 | b(The)f(Bourne)g(Shell)1258 b(153)330 299 y(are)40 b(executed)g(after)g |
1c72c0cd CR |
17869 | (a)f(simple)h(command)f(fails,)j(with)d(a)h(few)f(exceptions.)68 |
17870 | b(The)39 b Fs(ERR)g Ft(trap)g(is)330 408 y(not)g(inherited)f(b)m(y)h | |
37c41ab1 CR |
17871 | (shell)g(functions)f(unless)g(the)h Fs(-o)29 b(errtrace)37 |
17872 | b Ft(option)i(to)g(the)g Fs(set)f Ft(builtin)g(is)330 | |
c302751c | 17873 | 518 y(enabled.)330 650 y(The)g Fs(trap)g Ft(builtin)h(\(see)g(Section)h |
9f178efb | 17874 | (4.1)g([Bourne)f(Shell)g(Builtins],)i(page)f(41\))g(allo)m(ws)g(a)g |
c302751c | 17875 | Fs(RETURN)330 760 y Ft(pseudo-signal)35 b(sp)s(eci\014cation,)j |
1c72c0cd | 17876 | (similar)d(to)h Fs(EXIT)e Ft(and)g Fs(DEBUG)p Ft(.)54 |
c302751c | 17877 | b(Commands)34 b(sp)s(eci\014ed)g(with)h(an)330 869 y |
1c72c0cd | 17878 | Fs(RETURN)k Ft(trap)i(are)g(executed)h(b)s(efore)e(execution)i(resumes) |
c302751c | 17879 | e(after)h(a)g(shell)g(function)g(or)g(a)g(shell)330 979 |
1c72c0cd | 17880 | y(script)36 b(executed)g(with)g Fs(.)f Ft(or)h Fs(source)e |
37c41ab1 | 17881 | Ft(returns.)56 b(The)35 b Fs(RETURN)f Ft(trap)i(is)g(not)g(inherited)f |
c302751c | 17882 | (b)m(y)h(shell)330 1088 y(functions)k(unless)h(the)g(function)f(has)h |
8fed3589 | 17883 | (b)s(een)f(giv)m(en)i(the)f Fs(trace)e Ft(attribute)j(or)e(the)h |
c302751c CR |
17884 | Fs(functrace)330 1198 y Ft(option)31 b(has)f(b)s(een)g(enabled)g(using) |
17885 | g(the)g Fs(shopt)f Ft(builtin.)225 1330 y Fp(\017)60 | |
37c41ab1 CR |
17886 | b Ft(The)30 b(Bash)g Fs(type)f Ft(builtin)h(is)g(more)g(extensiv)m(e)i |
17887 | (and)d(giv)m(es)j(more)e(information)h(ab)s(out)f(the)g(names)330 | |
c302751c | 17888 | 1440 y(it)h(\014nds)e(\(see)i(Section)g(4.2)h([Bash)e(Builtins],)i |
9f178efb | 17889 | (page)f(48\).)225 1571 y Fp(\017)60 b Ft(The)34 b(Bash)h |
37c41ab1 CR |
17890 | Fs(umask)e Ft(builtin)h(p)s(ermits)g(a)g(`)p Fs(-p)p |
17891 | Ft(')h(option)g(to)g(cause)g(the)g(output)f(to)h(b)s(e)f(displa)m(y)m | |
c302751c | 17892 | (ed)h(in)330 1681 y(the)g(form)g(of)g(a)h Fs(umask)e |
37c41ab1 | 17893 | Ft(command)h(that)g(ma)m(y)h(b)s(e)f(reused)f(as)h(input)g(\(see)h |
c302751c | 17894 | (Section)g(4.1)g([Bourne)330 1791 y(Shell)30 b(Builtins],)h(page)h |
9f178efb | 17895 | (41\).)225 1923 y Fp(\017)60 b Ft(Bash)34 b(implemen)m(ts)h(a)g |
1c72c0cd CR |
17896 | Fs(csh)p Ft(-lik)m(e)g(directory)f(stac)m(k,)j(and)d(pro)m(vides)g(the) |
17897 | g Fs(pushd)p Ft(,)g Fs(popd)p Ft(,)g(and)g Fs(dirs)330 | |
c302751c | 17898 | 2032 y Ft(builtins)g(to)i(manipulate)f(it)h(\(see)f(Section)h(6.8)g |
9f178efb | 17899 | ([The)f(Directory)h(Stac)m(k],)i(page)d(89\).)56 b(Bash)35 |
c302751c | 17900 | b(also)330 2142 y(mak)m(es)c(the)g(directory)g(stac)m(k)g(visible)g(as) |
1c72c0cd | 17901 | g(the)f(v)-5 b(alue)31 b(of)g(the)f Fs(DIRSTACK)f Ft(shell)h(v)-5 |
c302751c | 17902 | b(ariable.)225 2274 y Fp(\017)60 b Ft(Bash)28 b(in)m(terprets)h(sp)s |
1c72c0cd | 17903 | (ecial)g(bac)m(kslash-escap)s(ed)g(c)m(haracters)g(in)f(the)h(prompt)e |
c302751c | 17904 | (strings)h(when)f(in)m(ter-)330 2383 y(activ)m(e)33 b(\(see)e(Section)g |
9f178efb | 17905 | (6.9)h([Con)m(trolling)f(the)g(Prompt],)f(page)h(91\).)225 |
c302751c | 17906 | 2515 y Fp(\017)60 b Ft(The)46 b(Bash)h(restricted)g(mo)s(de)f(is)h |
1c72c0cd | 17907 | (more)f(useful)g(\(see)h(Section)h(6.10)g([The)e(Restricted)i(Shell],) |
9f178efb | 17908 | 330 2625 y(page)31 b(92\);)h(the)f(SVR4.2)g(shell)f(restricted)h(mo)s |
c302751c | 17909 | (de)f(is)h(to)s(o)g(limited.)225 2757 y Fp(\017)60 b |
1c72c0cd CR |
17910 | Ft(The)30 b Fs(disown)f Ft(builtin)h(can)h(remo)m(v)m(e)h(a)f(job)f |
17911 | (from)g(the)h(in)m(ternal)g(shell)g(job)f(table)i(\(see)f(Section)h | |
9f178efb | 17912 | (7.2)330 2866 y([Job)h(Con)m(trol)h(Builtins],)g(page)g(98\))h(or)e |
1c72c0cd | 17913 | (suppress)e(the)i(sending)g(of)g Fs(SIGHUP)e Ft(to)j(a)g(job)f(when)f |
c302751c CR |
17914 | (the)330 2976 y(shell)f(exits)g(as)f(the)h(result)f(of)h(a)f |
17915 | Fs(SIGHUP)p Ft(.)225 3108 y Fp(\017)60 b Ft(Bash)31 b(includes)f(a)g(n) | |
1c72c0cd | 17916 | m(um)m(b)s(er)f(of)i(features)g(to)g(supp)s(ort)d(a)j(separate)g |
c302751c | 17917 | (debugger)f(for)h(shell)f(scripts.)225 3240 y Fp(\017)60 |
1c72c0cd CR |
17918 | b Ft(The)28 b(SVR4.2)h(shell)f(has)g(t)m(w)m(o)i(privilege-related)g |
17919 | (builtins)e(\()p Fs(mldmode)e Ft(and)i Fs(priv)p Ft(\))f(not)i(presen)m | |
c302751c | 17920 | (t)f(in)330 3350 y(Bash.)225 3482 y Fp(\017)60 b Ft(Bash)31 |
1c72c0cd | 17921 | b(do)s(es)f(not)g(ha)m(v)m(e)i(the)e Fs(stop)g Ft(or)g |
c302751c | 17922 | Fs(newgrp)f Ft(builtins.)225 3613 y Fp(\017)60 b Ft(Bash)31 |
1c72c0cd | 17923 | b(do)s(es)f(not)g(use)g(the)h Fs(SHACCT)d Ft(v)-5 b(ariable)32 |
c302751c | 17924 | b(or)e(p)s(erform)f(shell)i(accoun)m(ting.)225 3745 y |
1c72c0cd CR |
17925 | Fp(\017)60 b Ft(The)30 b(SVR4.2)h Fs(sh)f Ft(uses)g(a)g |
17926 | Fs(TIMEOUT)f Ft(v)-5 b(ariable)31 b(lik)m(e)h(Bash)e(uses)g | |
c302751c | 17927 | Fs(TMOUT)p Ft(.)150 3900 y(More)h(features)g(unique)e(to)i(Bash)g(ma)m |
1c72c0cd | 17928 | (y)g(b)s(e)f(found)f(in)h(Chapter)f(6)i([Bash)g(F)-8 |
9f178efb | 17929 | b(eatures],)32 b(page)f(79.)150 4127 y Fr(B.1)67 b(Implemen)l(tation)48 |
c302751c CR |
17930 | b(Di\013erences)e(F)-11 b(rom)44 b(The)h(SVR4.2)g(Shell)150 |
17931 | 4287 y Ft(Since)33 b(Bash)h(is)f(a)g(completely)i(new)e(implemen)m | |
17932 | (tation,)j(it)e(do)s(es)e(not)i(su\013er)e(from)h(man)m(y)g(of)h(the)f | |
17933 | (limi-)150 4396 y(tations)f(of)e(the)h(SVR4.2)g(shell.)41 | |
17934 | b(F)-8 b(or)31 b(instance:)225 4528 y Fp(\017)60 b Ft(Bash)32 | |
37c41ab1 CR |
17935 | b(do)s(es)f(not)h(fork)f(a)h(subshell)e(when)h(redirecting)h(in)m(to)h |
17936 | (or)e(out)h(of)g(a)g(shell)f(con)m(trol)i(structure)330 | |
c302751c CR |
17937 | 4638 y(suc)m(h)d(as)h(an)f Fs(if)g Ft(or)g Fs(while)f |
17938 | Ft(statemen)m(t.)225 4770 y Fp(\017)60 b Ft(Bash)29 b(do)s(es)f(not)h | |
37c41ab1 | 17939 | (allo)m(w)h(un)m(balanced)f(quotes.)41 b(The)28 b(SVR4.2)h(shell)g |
c302751c | 17940 | (will)g(silen)m(tly)i(insert)d(a)h(needed)330 4879 y(closing)g(quote)g |
37c41ab1 CR |
17941 | (at)f Fs(EOF)f Ft(under)g(certain)h(circumstances.)41 |
17942 | b(This)27 b(can)h(b)s(e)g(the)g(cause)g(of)g(some)h(hard-)330 | |
c302751c | 17943 | 4989 y(to-\014nd)h(errors.)225 5121 y Fp(\017)60 b Ft(The)45 |
37c41ab1 | 17944 | b(SVR4.2)h(shell)f(uses)g(a)g(baro)s(que)g(memory)g(managemen)m(t)i(sc) |
1c72c0cd | 17945 | m(heme)e(based)g(on)g(trapping)330 5230 y Fs(SIGSEGV)p |
37c41ab1 CR |
17946 | Ft(.)57 b(If)35 b(the)i(shell)f(is)h(started)g(from)e(a)i(pro)s(cess)f |
17947 | (with)g Fs(SIGSEGV)e Ft(blo)s(c)m(k)m(ed)k(\(e.g.,)h(b)m(y)d(using)330 | |
1c72c0cd CR |
17948 | 5340 y(the)31 b Fs(system\(\))d Ft(C)i(library)g(function)g(call\),)i |
17949 | (it)f(misb)s(eha)m(v)m(es)g(badly)-8 b(.)p eop end | |
9f178efb CR |
17950 | %%Page: 154 160 |
17951 | TeXDict begin 154 159 bop 150 -116 a Ft(154)2527 b(Bash)31 | |
1c72c0cd CR |
17952 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(In)26 |
17953 | b(a)i(questionable)g(attempt)h(at)f(securit)m(y)-8 b(,)29 | |
17954 | b(the)e(SVR4.2)h(shell,)g(when)f(in)m(v)m(ok)m(ed)h(without)g(the)f(`)p | |
17955 | Fs(-p)p Ft(')330 408 y(option,)39 b(will)d(alter)i(its)e(real)h(and)f | |
17956 | (e\013ectiv)m(e)j Fl(uid)d Ft(and)g Fl(gid)h Ft(if)f(they)h(are)f(less) | |
17957 | h(than)f(some)h(magic)330 518 y(threshold)30 b(v)-5 b(alue,)31 | |
17958 | b(commonly)g(100.)42 b(This)29 b(can)i(lead)g(to)g(unexp)s(ected)f | |
17959 | (results.)225 653 y Fp(\017)60 b Ft(The)30 b(SVR4.2)h(shell)g(do)s(es)f | |
17960 | (not)g(allo)m(w)i(users)e(to)h(trap)f Fs(SIGSEGV)p Ft(,)f | |
17961 | Fs(SIGALRM)p Ft(,)f(or)j Fs(SIGCHLD)p Ft(.)225 787 y | |
17962 | Fp(\017)60 b Ft(The)34 b(SVR4.2)h(shell)g(do)s(es)g(not)f(allo)m(w)j | |
17963 | (the)d Fs(IFS)p Ft(,)h Fs(MAILCHECK)p Ft(,)f Fs(PATH)p | |
17964 | Ft(,)h Fs(PS1)p Ft(,)g(or)f Fs(PS2)g Ft(v)-5 b(ariables)35 | |
17965 | b(to)330 897 y(b)s(e)30 b(unset.)225 1031 y Fp(\017)60 | |
17966 | b Ft(The)30 b(SVR4.2)h(shell)g(treats)g(`)p Fs(^)p Ft(')f(as)h(the)g | |
17967 | (undo)s(cumen)m(ted)e(equiv)-5 b(alen)m(t)31 b(of)g(`)p | |
17968 | Fs(|)p Ft('.)225 1166 y Fp(\017)60 b Ft(Bash)37 b(allo)m(ws)h(m)m | |
17969 | (ultiple)f(option)g(argumen)m(ts)g(when)e(it)i(is)g(in)m(v)m(ok)m(ed)h | |
17970 | (\()p Fs(-x)30 b(-v)p Ft(\);)40 b(the)c(SVR4.2)i(shell)330 | |
17971 | 1275 y(allo)m(ws)c(only)f(one)g(option)g(argumen)m(t)g(\()p | |
37c41ab1 | 17972 | Fs(-xv)p Ft(\).)47 b(In)32 b(fact,)i(some)f(v)m(ersions)g(of)g(the)g |
1c72c0cd CR |
17973 | (shell)f(dump)f(core)330 1385 y(if)f(the)h(second)f(argumen)m(t)h(b)s |
17974 | (egins)f(with)g(a)h(`)p Fs(-)p Ft('.)225 1519 y Fp(\017)60 | |
ac18b312 CR |
17975 | b Ft(The)26 b(SVR4.2)i(shell)f(exits)g(a)g(script)g(if)g(an)m(y)g |
17976 | (builtin)f(fails;)j(Bash)e(exits)g(a)g(script)g(only)g(if)g(one)g(of)g | |
17977 | (the)330 1629 y Fl(posix)34 b Ft(sp)s(ecial)h(builtins)f(fails,)i(and)e | |
17978 | (only)h(for)f(certain)h(failures,)h(as)f(en)m(umerated)g(in)f(the)h | |
17979 | Fl(posix)330 1738 y Ft(standard.)225 1873 y Fp(\017)60 | |
17980 | b Ft(The)30 b(SVR4.2)h(shell)g(b)s(eha)m(v)m(es)f(di\013eren)m(tly)h | |
17981 | (when)f(in)m(v)m(ok)m(ed)i(as)e Fs(jsh)g Ft(\(it)h(turns)e(on)h(job)g | |
17982 | (con)m(trol\).)p eop end | |
9f178efb CR |
17983 | %%Page: 155 161 |
17984 | TeXDict begin 155 160 bop 150 -116 a Ft(App)s(endix)29 | |
c2a47ea9 | 17985 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
9f178efb | 17986 | b(155)150 299 y Fo(App)t(endix)52 b(C)81 b(GNU)54 b(F)-13 |
c302751c | 17987 | b(ree)53 b(Do)t(cumen)l(tation)e(License)1359 502 y Ft(V)-8 |
1231ac47 | 17988 | b(ersion)31 b(1.3,)g(3)g(No)m(v)m(em)m(b)s(er)h(2008)390 |
c2a47ea9 | 17989 | 635 y(Cop)m(yrigh)m(t)842 632 y(c)817 635 y Fp(\015)e |
1231ac47 CR |
17990 | Ft(2000,)j(2001,)f(2002,)g(2007,)h(2008)f(F)-8 b(ree)31 |
17991 | b(Soft)m(w)m(are)h(F)-8 b(oundation,)31 b(Inc.)390 745 | |
17992 | y Fs(http://fsf.org/)390 964 y Ft(Ev)m(ery)m(one)g(is)g(p)s(ermitted)f | |
17993 | (to)h(cop)m(y)g(and)f(distribute)g(v)m(erbatim)h(copies)390 | |
17994 | 1074 y(of)g(this)f(license)h(do)s(cumen)m(t,)g(but)e(c)m(hanging)j(it)f | |
17995 | (is)f(not)h(allo)m(w)m(ed.)199 1207 y(0.)61 b(PREAMBLE)330 | |
17996 | 1340 y(The)37 b(purp)s(ose)e(of)i(this)g(License)h(is)f(to)h(mak)m(e)g | |
17997 | (a)g(man)m(ual,)h(textb)s(o)s(ok,)h(or)d(other)g(functional)h(and)330 | |
c2a47ea9 | 17998 | 1450 y(useful)29 b(do)s(cumen)m(t)h Fq(free)36 b Ft(in)29 |
37c41ab1 | 17999 | b(the)i(sense)f(of)g(freedom:)41 b(to)31 b(assure)e(ev)m(ery)m(one)j |
c2a47ea9 | 18000 | (the)e(e\013ectiv)m(e)j(freedom)330 1559 y(to)f(cop)m(y)g(and)f |
37c41ab1 | 18001 | (redistribute)g(it,)h(with)g(or)f(without)g(mo)s(difying)g(it,)i |
c2a47ea9 | 18002 | (either)f(commercially)h(or)e(non-)330 1669 y(commercially)-8 |
37c41ab1 | 18003 | b(.)56 b(Secondarily)-8 b(,)36 b(this)f(License)g(preserv)m(es)g(for)f |
c2a47ea9 | 18004 | (the)h(author)f(and)g(publisher)f(a)i(w)m(a)m(y)330 1778 |
37c41ab1 CR |
18005 | y(to)i(get)g(credit)g(for)f(their)g(w)m(ork,)i(while)e(not)g(b)s(eing)g |
18006 | (considered)g(resp)s(onsible)f(for)h(mo)s(di\014cations)330 | |
c2a47ea9 | 18007 | 1888 y(made)30 b(b)m(y)h(others.)330 2021 y(This)22 b(License)i(is)f(a) |
37c41ab1 CR |
18008 | h(kind)e(of)i(\\cop)m(yleft",)j(whic)m(h)c(means)g(that)h(deriv)-5 |
18009 | b(ativ)m(e)24 b(w)m(orks)f(of)h(the)f(do)s(cumen)m(t)330 | |
c2a47ea9 | 18010 | 2131 y(m)m(ust)34 b(themselv)m(es)h(b)s(e)e(free)h(in)g(the)g(same)g |
37c41ab1 | 18011 | (sense.)51 b(It)34 b(complemen)m(ts)h(the)f(GNU)g(General)h(Public)330 |
c2a47ea9 CR |
18012 | 2240 y(License,)c(whic)m(h)f(is)h(a)f(cop)m(yleft)i(license)g(designed) |
18013 | e(for)g(free)h(soft)m(w)m(are.)330 2373 y(W)-8 b(e)31 | |
37c41ab1 CR |
18014 | b(ha)m(v)m(e)f(designed)g(this)f(License)h(in)f(order)g(to)i(use)e(it)h |
18015 | (for)f(man)m(uals)h(for)f(free)h(soft)m(w)m(are,)h(b)s(ecause)330 | |
c2a47ea9 | 18016 | 2483 y(free)42 b(soft)m(w)m(are)i(needs)e(free)g(do)s(cumen)m(tation:) |
37c41ab1 | 18017 | 65 b(a)42 b(free)h(program)f(should)f(come)i(with)f(man)m(uals)330 |
c2a47ea9 | 18018 | 2592 y(pro)m(viding)29 b(the)g(same)g(freedoms)f(that)i(the)f(soft)m(w) |
37c41ab1 | 18019 | m(are)h(do)s(es.)40 b(But)29 b(this)f(License)i(is)f(not)g(limited)g |
c2a47ea9 | 18020 | (to)330 2702 y(soft)m(w)m(are)j(man)m(uals;)f(it)g(can)g(b)s(e)f(used)g |
37c41ab1 | 18021 | (for)g(an)m(y)h(textual)h(w)m(ork,)f(regardless)g(of)g(sub)5 |
c2a47ea9 | 18022 | b(ject)30 b(matter)i(or)330 2812 y(whether)f(it)h(is)f(published)f(as)i |
37c41ab1 | 18023 | (a)f(prin)m(ted)g(b)s(o)s(ok.)44 b(W)-8 b(e)32 b(recommend)f(this)h |
c2a47ea9 CR |
18024 | (License)g(principally)f(for)330 2921 y(w)m(orks)f(whose)h(purp)s(ose)d |
18025 | (is)j(instruction)f(or)g(reference.)199 3054 y(1.)61 | |
18026 | b(APPLICABILITY)29 b(AND)j(DEFINITIONS)330 3187 y(This)39 | |
37c41ab1 | 18027 | b(License)i(applies)f(to)g(an)m(y)h(man)m(ual)f(or)g(other)g(w)m(ork,)i |
c2a47ea9 | 18028 | (in)e(an)m(y)g(medium,)i(that)e(con)m(tains)i(a)330 3297 |
37c41ab1 CR |
18029 | y(notice)h(placed)f(b)m(y)f(the)h(cop)m(yrigh)m(t)h(holder)e(sa)m(ying) |
18030 | h(it)g(can)g(b)s(e)f(distributed)f(under)g(the)i(terms)330 | |
c2a47ea9 | 18031 | 3407 y(of)c(this)f(License.)62 b(Suc)m(h)37 b(a)h(notice)h(gran)m(ts)f |
37c41ab1 | 18032 | (a)g(w)m(orld-wide,)h(ro)m(y)m(alt)m(y-free)i(license,)f(unlimited)d |
c2a47ea9 | 18033 | (in)330 3516 y(duration,)49 b(to)d(use)f(that)g(w)m(ork)h(under)d(the)j |
37c41ab1 | 18034 | (conditions)f(stated)h(herein.)85 b(The)45 b(\\Do)s(cumen)m(t",)330 |
c2a47ea9 | 18035 | 3626 y(b)s(elo)m(w,)29 b(refers)f(to)h(an)m(y)g(suc)m(h)f(man)m(ual)h |
37c41ab1 | 18036 | (or)f(w)m(ork.)40 b(An)m(y)29 b(mem)m(b)s(er)e(of)i(the)f(public)g(is)g |
c2a47ea9 | 18037 | (a)h(licensee,)i(and)330 3735 y(is)25 b(addressed)f(as)h(\\y)m(ou".)40 |
37c41ab1 CR |
18038 | b(Y)-8 b(ou)26 b(accept)g(the)f(license)h(if)f(y)m(ou)h(cop)m(y)-8 |
18039 | b(,)27 b(mo)s(dify)d(or)h(distribute)g(the)g(w)m(ork)330 | |
c2a47ea9 CR |
18040 | 3845 y(in)30 b(a)h(w)m(a)m(y)g(requiring)f(p)s(ermission)f(under)g(cop) |
18041 | m(yrigh)m(t)j(la)m(w.)330 3978 y(A)i(\\Mo)s(di\014ed)f(V)-8 | |
37c41ab1 | 18042 | b(ersion")35 b(of)f(the)g(Do)s(cumen)m(t)g(means)g(an)m(y)g(w)m(ork)f |
c2a47ea9 | 18043 | (con)m(taining)j(the)e(Do)s(cumen)m(t)g(or)330 4088 y(a)k(p)s(ortion)f |
37c41ab1 | 18044 | (of)h(it,)i(either)e(copied)g(v)m(erbatim,)i(or)d(with)h(mo)s |
c2a47ea9 CR |
18045 | (di\014cations)f(and/or)h(translated)g(in)m(to)330 4197 |
18046 | y(another)31 b(language.)330 4330 y(A)26 b(\\Secondary)g(Section")h(is) | |
37c41ab1 | 18047 | f(a)h(named)e(app)s(endix)f(or)i(a)h(fron)m(t-matter)g(section)g(of)f |
c2a47ea9 | 18048 | (the)g(Do)s(cumen)m(t)330 4440 y(that)c(deals)g(exclusiv)m(ely)h(with)e |
37c41ab1 | 18049 | (the)g(relationship)h(of)f(the)h(publishers)d(or)i(authors)g(of)h(the)f |
c2a47ea9 | 18050 | (Do)s(cumen)m(t)330 4549 y(to)38 b(the)f(Do)s(cumen)m(t's)i(o)m(v)m |
37c41ab1 | 18051 | (erall)g(sub)5 b(ject)37 b(\(or)h(to)g(related)g(matters\))g(and)f(con) |
c2a47ea9 | 18052 | m(tains)h(nothing)f(that)330 4659 y(could)j(fall)h(directly)g(within)f |
37c41ab1 CR |
18053 | (that)h(o)m(v)m(erall)i(sub)5 b(ject.)70 b(\(Th)m(us,)42 |
18054 | b(if)e(the)h(Do)s(cumen)m(t)g(is)f(in)g(part)h(a)330 | |
c2a47ea9 | 18055 | 4769 y(textb)s(o)s(ok)24 b(of)g(mathematics,)j(a)d(Secondary)f(Section) |
37c41ab1 | 18056 | h(ma)m(y)g(not)g(explain)g(an)m(y)g(mathematics.\))40 |
c2a47ea9 | 18057 | b(The)330 4878 y(relationship)28 b(could)f(b)s(e)g(a)g(matter)i(of)e |
37c41ab1 | 18058 | (historical)i(connection)f(with)f(the)h(sub)5 b(ject)27 |
c2a47ea9 | 18059 | b(or)g(with)g(related)330 4988 y(matters,)38 b(or)d(of)h(legal,)i |
37c41ab1 | 18060 | (commercial,)h(philosophical,)f(ethical)f(or)e(p)s(olitical)i(p)s |
c2a47ea9 | 18061 | (osition)f(regarding)330 5097 y(them.)330 5230 y(The)25 |
37c41ab1 CR |
18062 | b(\\In)m(v)-5 b(arian)m(t)27 b(Sections")g(are)f(certain)g(Secondary)g |
18063 | (Sections)g(whose)f(titles)i(are)f(designated,)i(as)330 | |
c2a47ea9 | 18064 | 5340 y(b)s(eing)e(those)h(of)g(In)m(v)-5 b(arian)m(t)27 |
37c41ab1 | 18065 | b(Sections,)i(in)d(the)h(notice)h(that)f(sa)m(ys)g(that)g(the)g(Do)s |
c2a47ea9 | 18066 | (cumen)m(t)g(is)g(released)p eop end |
9f178efb CR |
18067 | %%Page: 156 162 |
18068 | TeXDict begin 156 161 bop 150 -116 a Ft(156)2527 b(Bash)31 | |
c2a47ea9 | 18069 | b(Reference)g(Man)m(ual)330 299 y(under)26 b(this)i(License.)40 |
37c41ab1 | 18070 | b(If)27 b(a)h(section)h(do)s(es)f(not)f(\014t)h(the)g(ab)s(o)m(v)m(e)h |
c2a47ea9 | 18071 | (de\014nition)e(of)h(Secondary)f(then)h(it)g(is)330 408 |
37c41ab1 CR |
18072 | y(not)k(allo)m(w)m(ed)i(to)e(b)s(e)g(designated)g(as)g(In)m(v)-5 |
18073 | b(arian)m(t.)46 b(The)31 b(Do)s(cumen)m(t)i(ma)m(y)f(con)m(tain)i(zero) | |
c2a47ea9 | 18074 | e(In)m(v)-5 b(arian)m(t)330 518 y(Sections.)39 b(If)25 |
37c41ab1 CR |
18075 | b(the)f(Do)s(cumen)m(t)i(do)s(es)e(not)h(iden)m(tify)g(an)m(y)g(In)m(v) |
18076 | -5 b(arian)m(t)25 b(Sections)h(then)e(there)h(are)g(none.)330 | |
1231ac47 | 18077 | 669 y(The)36 b(\\Co)m(v)m(er)i(T)-8 b(exts")38 b(are)f(certain)g(short) |
c2a47ea9 | 18078 | g(passages)g(of)g(text)g(that)h(are)f(listed,)i(as)d(F)-8 |
1231ac47 | 18079 | b(ron)m(t-Co)m(v)m(er)330 778 y(T)g(exts)26 b(or)f(Bac)m(k-Co)m(v)m(er) |
c2a47ea9 | 18080 | j(T)-8 b(exts,)27 b(in)d(the)h(notice)i(that)e(sa)m(ys)h(that)g(the)f |
1231ac47 | 18081 | (Do)s(cumen)m(t)h(is)f(released)g(under)330 888 y(this)h(License.)40 |
c2a47ea9 CR |
18082 | b(A)25 b(F)-8 b(ron)m(t-Co)m(v)m(er)29 b(T)-8 b(ext)26 |
18083 | b(ma)m(y)h(b)s(e)e(at)i(most)f(5)g(w)m(ords,)g(and)g(a)g(Bac)m(k-Co)m | |
1231ac47 CR |
18084 | (v)m(er)j(T)-8 b(ext)26 b(ma)m(y)330 998 y(b)s(e)k(at)h(most)g(25)g(w)m |
18085 | (ords.)330 1148 y(A)36 b(\\T)-8 b(ransparen)m(t")36 b(cop)m(y)g(of)g | |
c2a47ea9 | 18086 | (the)f(Do)s(cumen)m(t)h(means)g(a)g(mac)m(hine-readable)h(cop)m(y)-8 |
1231ac47 | 18087 | b(,)38 b(represen)m(ted)330 1258 y(in)d(a)h(format)g(whose)g(sp)s |
37c41ab1 | 18088 | (eci\014cation)g(is)g(a)m(v)-5 b(ailable)38 b(to)f(the)f(general)g |
1231ac47 | 18089 | (public,)h(that)f(is)g(suitable)g(for)330 1367 y(revising)c(the)g(do)s |
37c41ab1 | 18090 | (cumen)m(t)f(straigh)m(tforw)m(ardly)i(with)e(generic)i(text)g(editors) |
1231ac47 | 18091 | f(or)f(\(for)h(images)h(com-)330 1477 y(p)s(osed)23 b(of)h(pixels\))g |
37c41ab1 | 18092 | (generic)h(pain)m(t)f(programs)g(or)f(\(for)h(dra)m(wings\))g(some)g |
1231ac47 | 18093 | (widely)g(a)m(v)-5 b(ailable)26 b(dra)m(wing)330 1587 |
37c41ab1 CR |
18094 | y(editor,)k(and)f(that)g(is)g(suitable)h(for)f(input)f(to)i(text)g |
18095 | (formatters)f(or)g(for)g(automatic)i(translation)f(to)330 | |
1231ac47 | 18096 | 1696 y(a)d(v)-5 b(ariet)m(y)28 b(of)f(formats)g(suitable)h(for)e(input) |
37c41ab1 | 18097 | g(to)i(text)g(formatters.)40 b(A)27 b(cop)m(y)g(made)g(in)g(an)g |
1231ac47 | 18098 | (otherwise)330 1806 y(T)-8 b(ransparen)m(t)37 b(\014le)h(format)g |
5e13499c | 18099 | (whose)f(markup,)i(or)e(absence)h(of)g(markup,)g(has)g(b)s(een)f |
1231ac47 | 18100 | (arranged)g(to)330 1915 y(th)m(w)m(art)27 b(or)g(discourage)g |
37c41ab1 | 18101 | (subsequen)m(t)f(mo)s(di\014cation)h(b)m(y)g(readers)f(is)g(not)h(T)-8 |
1231ac47 | 18102 | b(ransparen)m(t.)39 b(An)27 b(image)330 2025 y(format)35 |
37c41ab1 CR |
18103 | b(is)f(not)h(T)-8 b(ransparen)m(t)34 b(if)g(used)g(for)g(an)m(y)g |
18104 | (substan)m(tial)h(amoun)m(t)g(of)g(text.)53 b(A)35 b(cop)m(y)g(that)g | |
1231ac47 CR |
18105 | (is)330 2134 y(not)c(\\T)-8 b(ransparen)m(t")31 b(is)f(called)i |
18106 | (\\Opaque".)330 2285 y(Examples)53 b(of)g(suitable)h(formats)f(for)g(T) | |
37c41ab1 | 18107 | -8 b(ransparen)m(t)53 b(copies)h(include)f(plain)g Fl(asci)r(i)g |
c302751c CR |
18108 | Ft(without)330 2395 y(markup,)37 b(T)-8 b(exinfo)36 b(input)f(format,)j |
18109 | (LaT)1759 2414 y(E)1810 2395 y(X)e(input)f(format,)j | |
18110 | Ff(SGML)f Ft(or)f Ff(XML)g Ft(using)g(a)g(publicly)330 | |
18111 | 2504 y(a)m(v)-5 b(ailable)42 b Ff(DTD)p Ft(,)g(and)d | |
18112 | (standard-conforming)h(simple)g Ff(HTML)p Ft(,)g(P)m(ostScript)h(or)f | |
18113 | Ff(PDF)g Ft(designed)330 2614 y(for)e(h)m(uman)g(mo)s(di\014cation.)65 | |
18114 | b(Examples)38 b(of)h(transparen)m(t)f(image)i(formats)e(include)g | |
18115 | Ff(PNG)p Ft(,)h Ff(X)n(CF)330 2724 y Ft(and)h Ff(JPG)p | |
18116 | Ft(.)g(Opaque)h(formats)g(include)f(proprietary)g(formats)h(that)h(can) | |
18117 | f(b)s(e)f(read)g(and)h(edited)330 2833 y(only)54 b(b)m(y)f(proprietary) | |
18118 | h(w)m(ord)f(pro)s(cessors,)59 b Ff(SGML)54 b Ft(or)f | |
18119 | Ff(XML)h Ft(for)g(whic)m(h)f(the)h Ff(DTD)g Ft(and/or)330 | |
18120 | 2943 y(pro)s(cessing)61 b(to)s(ols)h(are)f(not)g(generally)i(a)m(v)-5 | |
18121 | b(ailable,)71 b(and)60 b(the)h(mac)m(hine-generated)j | |
18122 | Ff(HTML)p Ft(,)330 3052 y(P)m(ostScript)31 b(or)f Ff(PDF)h | |
18123 | Ft(pro)s(duced)d(b)m(y)j(some)f(w)m(ord)g(pro)s(cessors)g(for)g(output) | |
18124 | g(purp)s(oses)f(only)-8 b(.)330 3203 y(The)34 b(\\Title)h(P)m(age")i | |
18125 | (means,)e(for)f(a)h(prin)m(ted)f(b)s(o)s(ok,)h(the)f(title)i(page)f | |
18126 | (itself,)h(plus)e(suc)m(h)f(follo)m(wing)330 3313 y(pages)28 | |
18127 | b(as)g(are)g(needed)g(to)g(hold,)g(legibly)-8 b(,)30 | |
18128 | b(the)e(material)h(this)e(License)i(requires)e(to)h(app)s(ear)f(in)h | |
18129 | (the)330 3422 y(title)g(page.)40 b(F)-8 b(or)28 b(w)m(orks)e(in)g | |
18130 | (formats)h(whic)m(h)g(do)f(not)h(ha)m(v)m(e)h(an)m(y)e(title)j(page)e | |
18131 | (as)g(suc)m(h,)g(\\Title)h(P)m(age")330 3532 y(means)j(the)f(text)i | |
18132 | (near)e(the)h(most)g(prominen)m(t)g(app)s(earance)f(of)h(the)g(w)m | |
18133 | (ork's)g(title,)h(preceding)f(the)330 3641 y(b)s(eginning)f(of)g(the)h | |
18134 | (b)s(o)s(dy)e(of)h(the)h(text.)330 3792 y(The)j(\\publisher")g(means)h | |
18135 | (an)m(y)f(p)s(erson)g(or)h(en)m(tit)m(y)h(that)f(distributes)f(copies)i | |
18136 | (of)e(the)h(Do)s(cumen)m(t)330 3902 y(to)c(the)g(public.)330 | |
18137 | 4052 y(A)f(section)h(\\En)m(titled)g(XYZ")f(means)f(a)h(named)g | |
18138 | (subunit)e(of)h(the)h(Do)s(cumen)m(t)h(whose)e(title)i(either)330 | |
18139 | 4162 y(is)d(precisely)g(XYZ)g(or)f(con)m(tains)i(XYZ)f(in)f(paren)m | |
18140 | (theses)i(follo)m(wing)g(text)g(that)f(translates)h(XYZ)e(in)330 | |
18141 | 4271 y(another)e(language.)40 b(\(Here)26 b(XYZ)f(stands)f(for)h(a)g | |
18142 | (sp)s(eci\014c)g(section)h(name)f(men)m(tioned)h(b)s(elo)m(w,)g(suc)m | |
18143 | (h)330 4381 y(as)i(\\Ac)m(kno)m(wledgemen)m(ts",)33 b(\\Dedications",)e | |
18144 | (\\Endorsemen)m(ts",)e(or)f(\\History".\))42 b(T)-8 b(o)29 | |
18145 | b(\\Preserv)m(e)330 4491 y(the)34 b(Title")h(of)e(suc)m(h)h(a)g | |
18146 | (section)g(when)f(y)m(ou)h(mo)s(dify)e(the)i(Do)s(cumen)m(t)h(means)e | |
18147 | (that)h(it)g(remains)g(a)330 4600 y(section)e(\\En)m(titled)f(XYZ")g | |
18148 | (according)g(to)g(this)g(de\014nition.)330 4751 y(The)c(Do)s(cumen)m(t) | |
18149 | i(ma)m(y)f(include)f(W)-8 b(arran)m(t)m(y)30 b(Disclaimers)f(next)f(to) | |
18150 | g(the)g(notice)h(whic)m(h)e(states)i(that)330 4861 y(this)34 | |
18151 | b(License)g(applies)g(to)h(the)f(Do)s(cumen)m(t.)52 b(These)33 | |
18152 | b(W)-8 b(arran)m(t)m(y)36 b(Disclaimers)f(are)g(considered)e(to)330 | |
18153 | 4970 y(b)s(e)k(included)g(b)m(y)g(reference)h(in)g(this)f(License,)j | |
18154 | (but)d(only)h(as)g(regards)f(disclaiming)i(w)m(arran)m(ties:)330 | |
18155 | 5080 y(an)m(y)e(other)g(implication)i(that)e(these)g(W)-8 | |
18156 | b(arran)m(t)m(y)39 b(Disclaimers)f(ma)m(y)g(ha)m(v)m(e)g(is)f(v)m(oid)g | |
18157 | (and)f(has)h(no)330 5189 y(e\013ect)32 b(on)e(the)h(meaning)f(of)h | |
18158 | (this)f(License.)199 5340 y(2.)61 b(VERBA)-8 b(TIM)31 | |
18159 | b(COPYING)p eop end | |
9f178efb CR |
18160 | %%Page: 157 163 |
18161 | TeXDict begin 157 162 bop 150 -116 a Ft(App)s(endix)29 | |
c2a47ea9 | 18162 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
9f178efb | 18163 | b(157)330 299 y(Y)-8 b(ou)39 b(ma)m(y)f(cop)m(y)h(and)e(distribute)h |
1231ac47 CR |
18164 | (the)g(Do)s(cumen)m(t)h(in)f(an)m(y)g(medium,)h(either)g(commercially)h |
18165 | (or)330 408 y(noncommercially)-8 b(,)48 b(pro)m(vided)42 | |
18166 | b(that)h(this)f(License,)47 b(the)42 b(cop)m(yrigh)m(t)i(notices,)j | |
18167 | (and)42 b(the)h(license)330 518 y(notice)37 b(sa)m(ying)g(this)e | |
18168 | (License)i(applies)e(to)i(the)f(Do)s(cumen)m(t)g(are)g(repro)s(duced)e | |
18169 | (in)i(all)g(copies,)j(and)330 628 y(that)27 b(y)m(ou)g(add)f(no)h | |
18170 | (other)f(conditions)h(whatso)s(ev)m(er)h(to)f(those)g(of)g(this)f | |
18171 | (License.)40 b(Y)-8 b(ou)27 b(ma)m(y)g(not)g(use)330 | |
18172 | 737 y(tec)m(hnical)35 b(measures)d(to)i(obstruct)f(or)g(con)m(trol)h | |
18173 | (the)f(reading)g(or)g(further)e(cop)m(ying)j(of)f(the)g(copies)330 | |
18174 | 847 y(y)m(ou)25 b(mak)m(e)g(or)g(distribute.)38 b(Ho)m(w)m(ev)m(er,)28 | |
37c41ab1 | 18175 | b(y)m(ou)d(ma)m(y)g(accept)h(comp)s(ensation)f(in)f(exc)m(hange)j(for)d |
1231ac47 | 18176 | (copies.)330 956 y(If)32 b(y)m(ou)g(distribute)g(a)h(large)g(enough)f |
37c41ab1 | 18177 | (n)m(um)m(b)s(er)f(of)h(copies)h(y)m(ou)f(m)m(ust)h(also)g(follo)m(w)g |
1231ac47 | 18178 | (the)f(conditions)330 1066 y(in)e(section)i(3.)330 1200 |
37c41ab1 CR |
18179 | y(Y)-8 b(ou)21 b(ma)m(y)h(also)f(lend)g(copies,)i(under)d(the)h(same)g |
18180 | (conditions)g(stated)h(ab)s(o)m(v)m(e,)i(and)c(y)m(ou)h(ma)m(y)g | |
1231ac47 CR |
18181 | (publicly)330 1310 y(displa)m(y)31 b(copies.)199 1443 |
18182 | y(3.)61 b(COPYING)30 b(IN)g(QUANTITY)330 1577 y(If)25 | |
37c41ab1 CR |
18183 | b(y)m(ou)g(publish)f(prin)m(ted)g(copies)i(\(or)g(copies)g(in)f(media)g |
18184 | (that)h(commonly)g(ha)m(v)m(e)g(prin)m(ted)f(co)m(v)m(ers\))i(of)330 | |
1231ac47 | 18185 | 1687 y(the)32 b(Do)s(cumen)m(t,)h(n)m(um)m(b)s(ering)e(more)h(than)f |
37c41ab1 | 18186 | (100,)j(and)d(the)h(Do)s(cumen)m(t's)h(license)f(notice)h(requires)330 |
1231ac47 | 18187 | 1797 y(Co)m(v)m(er)i(T)-8 b(exts,)36 b(y)m(ou)f(m)m(ust)f(enclose)i |
37c41ab1 | 18188 | (the)e(copies)h(in)f(co)m(v)m(ers)i(that)f(carry)-8 b(,)36 |
1231ac47 | 18189 | b(clearly)f(and)f(legibly)-8 b(,)37 b(all)330 1906 y(these)j(Co)m(v)m |
37c41ab1 | 18190 | (er)g(T)-8 b(exts:)59 b(F)-8 b(ron)m(t-Co)m(v)m(er)41 |
5e13499c CR |
18191 | b(T)-8 b(exts)40 b(on)f(the)g(fron)m(t)g(co)m(v)m(er,)44 |
18192 | b(and)38 b(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts)40 b(on)330 | |
1231ac47 | 18193 | 2016 y(the)29 b(bac)m(k)h(co)m(v)m(er.)42 b(Both)30 b(co)m(v)m(ers)h(m) |
37c41ab1 | 18194 | m(ust)e(also)h(clearly)g(and)f(legibly)h(iden)m(tify)f(y)m(ou)h(as)f |
1231ac47 | 18195 | (the)h(publisher)330 2125 y(of)k(these)h(copies.)53 b(The)34 |
37c41ab1 | 18196 | b(fron)m(t)h(co)m(v)m(er)h(m)m(ust)e(presen)m(t)g(the)h(full)f(title)i |
1231ac47 | 18197 | (with)d(all)j(w)m(ords)d(of)i(the)f(title)330 2235 y(equally)e |
37c41ab1 CR |
18198 | (prominen)m(t)e(and)g(visible.)43 b(Y)-8 b(ou)31 b(ma)m(y)g(add)g |
18199 | (other)g(material)h(on)f(the)g(co)m(v)m(ers)h(in)e(addition.)330 | |
1231ac47 | 18200 | 2345 y(Cop)m(ying)36 b(with)g(c)m(hanges)h(limited)g(to)g(the)g(co)m(v) |
37c41ab1 | 18201 | m(ers,)i(as)d(long)h(as)g(they)f(preserv)m(e)g(the)h(title)g(of)g(the) |
1231ac47 | 18202 | 330 2454 y(Do)s(cumen)m(t)h(and)e(satisfy)i(these)f(conditions,)j(can)d |
37c41ab1 | 18203 | (b)s(e)g(treated)h(as)f(v)m(erbatim)h(cop)m(ying)g(in)f(other)330 |
1231ac47 | 18204 | 2564 y(resp)s(ects.)330 2698 y(If)32 b(the)h(required)f(texts)i(for)e |
37c41ab1 | 18205 | (either)h(co)m(v)m(er)i(are)e(to)s(o)g(v)m(oluminous)g(to)g(\014t)g |
1231ac47 | 18206 | (legibly)-8 b(,)35 b(y)m(ou)e(should)f(put)330 2807 y(the)h(\014rst)f |
37c41ab1 CR |
18207 | (ones)h(listed)g(\(as)h(man)m(y)f(as)g(\014t)g(reasonably\))g(on)g(the) |
18208 | g(actual)h(co)m(v)m(er,)h(and)e(con)m(tin)m(ue)h(the)330 | |
1231ac47 | 18209 | 2917 y(rest)d(on)m(to)g(adjacen)m(t)h(pages.)330 3051 |
37c41ab1 CR |
18210 | y(If)27 b(y)m(ou)g(publish)e(or)i(distribute)g(Opaque)f(copies)i(of)f |
18211 | (the)h(Do)s(cumen)m(t)f(n)m(um)m(b)s(ering)f(more)i(than)e(100,)330 | |
1231ac47 | 18212 | 3160 y(y)m(ou)i(m)m(ust)g(either)h(include)e(a)i(mac)m(hine-readable)g |
37c41ab1 | 18213 | (T)-8 b(ransparen)m(t)28 b(cop)m(y)h(along)g(with)e(eac)m(h)i(Opaque) |
1231ac47 | 18214 | 330 3270 y(cop)m(y)-8 b(,)38 b(or)d(state)h(in)f(or)g(with)g(eac)m(h)h |
37c41ab1 | 18215 | (Opaque)e(cop)m(y)i(a)g(computer-net)m(w)m(ork)g(lo)s(cation)h(from)d |
1231ac47 | 18216 | (whic)m(h)330 3380 y(the)24 b(general)i(net)m(w)m(ork-using)f(public)e |
37c41ab1 | 18217 | (has)h(access)i(to)f(do)m(wnload)f(using)g(public-standard)f(net)m(w)m |
1231ac47 | 18218 | (ork)330 3489 y(proto)s(cols)40 b(a)f(complete)h(T)-8 |
5e13499c | 18219 | b(ransparen)m(t)39 b(cop)m(y)g(of)g(the)h(Do)s(cumen)m(t,)i(free)d(of)g |
1231ac47 | 18220 | (added)f(material.)67 b(If)330 3599 y(y)m(ou)39 b(use)g(the)g(latter)h |
37c41ab1 | 18221 | (option,)h(y)m(ou)f(m)m(ust)e(tak)m(e)j(reasonably)e(pruden)m(t)e |
1231ac47 | 18222 | (steps,)k(when)d(y)m(ou)h(b)s(egin)330 3708 y(distribution)f(of)g |
37c41ab1 CR |
18223 | (Opaque)g(copies)h(in)e(quan)m(tit)m(y)-8 b(,)43 b(to)38 |
18224 | b(ensure)g(that)h(this)f(T)-8 b(ransparen)m(t)38 b(cop)m(y)h(will)330 | |
1231ac47 | 18225 | 3818 y(remain)30 b(th)m(us)g(accessible)i(at)f(the)f(stated)h(lo)s |
37c41ab1 | 18226 | (cation)h(un)m(til)e(at)h(least)h(one)e(y)m(ear)h(after)g(the)f(last)h |
1231ac47 | 18227 | (time)330 3927 y(y)m(ou)37 b(distribute)f(an)h(Opaque)f(cop)m(y)i |
37c41ab1 | 18228 | (\(directly)g(or)e(through)g(y)m(our)h(agen)m(ts)h(or)f(retailers\))h |
1231ac47 CR |
18229 | (of)f(that)330 4037 y(edition)31 b(to)g(the)g(public.)330 |
18230 | 4171 y(It)k(is)f(requested,)i(but)e(not)h(required,)g(that)g(y)m(ou)g | |
5e13499c | 18231 | (con)m(tact)h(the)f(authors)f(of)h(the)g(Do)s(cumen)m(t)g(w)m(ell)330 |
1231ac47 | 18232 | 4281 y(b)s(efore)28 b(redistributing)g(an)m(y)h(large)h(n)m(um)m(b)s |
37c41ab1 | 18233 | (er)d(of)i(copies,)h(to)f(giv)m(e)h(them)f(a)g(c)m(hance)h(to)f(pro)m |
1231ac47 CR |
18234 | (vide)g(y)m(ou)330 4390 y(with)h(an)g(up)s(dated)f(v)m(ersion)i(of)g |
18235 | (the)f(Do)s(cumen)m(t.)199 4524 y(4.)61 b(MODIFICA)-8 | |
18236 | b(TIONS)330 4658 y(Y)g(ou)26 b(ma)m(y)g(cop)m(y)g(and)f(distribute)g(a) | |
37c41ab1 | 18237 | h(Mo)s(di\014ed)f(V)-8 b(ersion)26 b(of)g(the)g(Do)s(cumen)m(t)g(under) |
1231ac47 | 18238 | e(the)h(conditions)330 4768 y(of)c(sections)h(2)g(and)e(3)h(ab)s(o)m(v) |
37c41ab1 | 18239 | m(e,)k(pro)m(vided)20 b(that)i(y)m(ou)f(release)i(the)e(Mo)s(di\014ed)f |
1231ac47 | 18240 | (V)-8 b(ersion)22 b(under)d(precisely)330 4877 y(this)29 |
37c41ab1 CR |
18241 | b(License,)h(with)f(the)g(Mo)s(di\014ed)f(V)-8 b(ersion)30 |
18242 | b(\014lling)f(the)g(role)h(of)f(the)g(Do)s(cumen)m(t,)h(th)m(us)f | |
1231ac47 | 18243 | (licensing)330 4987 y(distribution)k(and)h(mo)s(di\014cation)g(of)h |
37c41ab1 | 18244 | (the)f(Mo)s(di\014ed)f(V)-8 b(ersion)35 b(to)g(who)s(ev)m(er)f(p)s |
1231ac47 | 18245 | (ossesses)f(a)i(cop)m(y)g(of)330 5096 y(it.)41 b(In)30 |
37c41ab1 | 18246 | b(addition,)h(y)m(ou)f(m)m(ust)h(do)f(these)h(things)f(in)g(the)h(Mo)s |
1231ac47 | 18247 | (di\014ed)e(V)-8 b(ersion:)357 5230 y(A.)60 b(Use)33 |
c2a47ea9 CR |
18248 | b(in)f(the)h(Title)h(P)m(age)g(\(and)f(on)f(the)h(co)m(v)m(ers,)i(if)e |
18249 | (an)m(y\))g(a)g(title)h(distinct)f(from)g(that)g(of)g(the)510 | |
1231ac47 | 18250 | 5340 y(Do)s(cumen)m(t,)j(and)d(from)g(those)i(of)f(previous)f(v)m |
c2a47ea9 | 18251 | (ersions)h(\(whic)m(h)g(should,)g(if)g(there)g(w)m(ere)g(an)m(y)-8 |
1231ac47 | 18252 | b(,)p eop end |
9f178efb CR |
18253 | %%Page: 158 164 |
18254 | TeXDict begin 158 163 bop 150 -116 a Ft(158)2527 b(Bash)31 | |
1231ac47 CR |
18255 | b(Reference)g(Man)m(ual)510 299 y(b)s(e)g(listed)h(in)f(the)g(History)h |
18256 | (section)g(of)g(the)f(Do)s(cumen)m(t\).)45 b(Y)-8 b(ou)32 | |
18257 | b(ma)m(y)g(use)f(the)g(same)h(title)h(as)510 408 y(a)e(previous)f(v)m | |
18258 | (ersion)g(if)h(the)f(original)i(publisher)d(of)h(that)h(v)m(ersion)g | |
18259 | (giv)m(es)h(p)s(ermission.)360 545 y(B.)61 b(List)31 | |
18260 | b(on)f(the)h(Title)g(P)m(age,)i(as)d(authors,)h(one)g(or)f(more)h(p)s | |
18261 | (ersons)e(or)h(en)m(tities)j(resp)s(onsible)c(for)510 | |
18262 | 655 y(authorship)c(of)h(the)h(mo)s(di\014cations)f(in)g(the)g(Mo)s | |
18263 | (di\014ed)f(V)-8 b(ersion,)28 b(together)g(with)d(at)i(least)h(\014v)m | |
18264 | (e)510 765 y(of)c(the)g(principal)g(authors)f(of)i(the)f(Do)s(cumen)m | |
18265 | (t)g(\(all)h(of)g(its)f(principal)g(authors,)h(if)f(it)g(has)g(few)m | |
18266 | (er)510 874 y(than)30 b(\014v)m(e\),)h(unless)f(they)h(release)g(y)m | |
18267 | (ou)g(from)f(this)g(requiremen)m(t.)359 1011 y(C.)60 | |
18268 | b(State)32 b(on)e(the)h(Title)h(page)f(the)g(name)g(of)g(the)g | |
18269 | (publisher)e(of)i(the)g(Mo)s(di\014ed)f(V)-8 b(ersion,)32 | |
18270 | b(as)f(the)510 1121 y(publisher.)355 1258 y(D.)61 b(Preserv)m(e)31 | |
18271 | b(all)g(the)g(cop)m(yrigh)m(t)h(notices)f(of)g(the)f(Do)s(cumen)m(t.) | |
18272 | 363 1395 y(E.)60 b(Add)30 b(an)i(appropriate)f(cop)m(yrigh)m(t)i | |
18273 | (notice)f(for)g(y)m(our)f(mo)s(di\014cations)g(adjacen)m(t)i(to)f(the)g | |
18274 | (other)510 1504 y(cop)m(yrigh)m(t)g(notices.)365 1641 | |
18275 | y(F.)61 b(Include,)28 b(immediately)h(after)f(the)h(cop)m(yrigh)m(t)g | |
18276 | (notices,)h(a)e(license)h(notice)g(giving)g(the)f(public)510 | |
18277 | 1751 y(p)s(ermission)23 b(to)j(use)e(the)g(Mo)s(di\014ed)g(V)-8 | |
18278 | b(ersion)25 b(under)e(the)i(terms)f(of)h(this)f(License,)j(in)d(the)g | |
18279 | (form)510 1861 y(sho)m(wn)30 b(in)g(the)g(Addendum)f(b)s(elo)m(w.)353 | |
18280 | 1998 y(G.)61 b(Preserv)m(e)23 b(in)g(that)g(license)h(notice)g(the)f | |
37c41ab1 | 18281 | (full)g(lists)g(of)g(In)m(v)-5 b(arian)m(t)23 b(Sections)h(and)e |
1231ac47 CR |
18282 | (required)g(Co)m(v)m(er)510 2107 y(T)-8 b(exts)31 b(giv)m(en)g(in)f |
18283 | (the)h(Do)s(cumen)m(t's)g(license)h(notice.)357 2244 | |
37c41ab1 | 18284 | y(H.)60 b(Include)30 b(an)g(unaltered)g(cop)m(y)h(of)g(this)f(License.) |
1231ac47 | 18285 | 392 2381 y(I.)60 b(Preserv)m(e)33 b(the)f(section)h(En)m(titled)g |
37c41ab1 | 18286 | (\\History",)h(Preserv)m(e)f(its)f(Title,)i(and)d(add)h(to)h(it)f(an)g |
1231ac47 | 18287 | (item)510 2491 y(stating)d(at)g(least)g(the)g(title,)h(y)m(ear,)g(new)d |
37c41ab1 | 18288 | (authors,)i(and)e(publisher)f(of)j(the)f(Mo)s(di\014ed)f(V)-8 |
1231ac47 | 18289 | b(ersion)510 2600 y(as)32 b(giv)m(en)g(on)f(the)h(Title)g(P)m(age.)45 |
37c41ab1 | 18290 | b(If)31 b(there)h(is)f(no)g(section)i(En)m(titled)f(\\History")h(in)e |
1231ac47 | 18291 | (the)g(Do)s(cu-)510 2710 y(men)m(t,)37 b(create)f(one)f(stating)h(the)f |
37c41ab1 | 18292 | (title,)i(y)m(ear,)g(authors,)f(and)e(publisher)f(of)i(the)g(Do)s |
1231ac47 | 18293 | (cumen)m(t)510 2819 y(as)h(giv)m(en)h(on)f(its)h(Title)g(P)m(age,)i |
37c41ab1 | 18294 | (then)d(add)g(an)g(item)g(describing)g(the)g(Mo)s(di\014ed)g(V)-8 |
1231ac47 CR |
18295 | b(ersion)37 b(as)510 2929 y(stated)31 b(in)f(the)h(previous)f(sen)m |
18296 | (tence.)378 3066 y(J.)60 b(Preserv)m(e)33 b(the)g(net)m(w)m(ork)g(lo)s | |
37c41ab1 | 18297 | (cation,)i(if)d(an)m(y)-8 b(,)34 b(giv)m(en)f(in)g(the)f(Do)s(cumen)m |
1231ac47 | 18298 | (t)h(for)g(public)e(access)j(to)510 3176 y(a)e(T)-8 b(ransparen)m(t)30 |
37c41ab1 | 18299 | b(cop)m(y)i(of)g(the)f(Do)s(cumen)m(t,)h(and)f(lik)m(ewise)h(the)g(net) |
1231ac47 | 18300 | m(w)m(ork)g(lo)s(cations)g(giv)m(en)g(in)510 3285 y(the)g(Do)s(cumen)m |
37c41ab1 | 18301 | (t)g(for)g(previous)f(v)m(ersions)h(it)g(w)m(as)g(based)f(on.)45 |
1231ac47 | 18302 | b(These)31 b(ma)m(y)h(b)s(e)f(placed)h(in)g(the)510 3395 |
37c41ab1 CR |
18303 | y(\\History")27 b(section.)40 b(Y)-8 b(ou)25 b(ma)m(y)h(omit)g(a)f(net) |
18304 | m(w)m(ork)h(lo)s(cation)g(for)f(a)h(w)m(ork)f(that)g(w)m(as)h | |
1231ac47 | 18305 | (published)510 3504 y(at)36 b(least)h(four)e(y)m(ears)i(b)s(efore)e |
37c41ab1 | 18306 | (the)h(Do)s(cumen)m(t)h(itself,)h(or)d(if)h(the)g(original)h(publisher) |
1231ac47 CR |
18307 | d(of)i(the)510 3614 y(v)m(ersion)31 b(it)g(refers)f(to)h(giv)m(es)h(p)s |
18308 | (ermission.)354 3751 y(K.)60 b(F)-8 b(or)24 b(an)m(y)h(section)f(En)m | |
37c41ab1 | 18309 | (titled)h(\\Ac)m(kno)m(wledgemen)m(ts")i(or)d(\\Dedications",)k |
1231ac47 | 18310 | (Preserv)m(e)c(the)g(Title)510 3861 y(of)j(the)f(section,)j(and)d |
37c41ab1 | 18311 | (preserv)m(e)h(in)f(the)h(section)g(all)h(the)e(substance)h(and)f(tone) |
1231ac47 | 18312 | h(of)f(eac)m(h)i(of)f(the)510 3970 y(con)m(tributor)k(ac)m(kno)m |
37c41ab1 | 18313 | (wledgemen)m(ts)i(and/or)d(dedications)h(giv)m(en)h(therein.)368 |
1231ac47 | 18314 | 4107 y(L.)60 b(Preserv)m(e)36 b(all)g(the)g(In)m(v)-5 |
37c41ab1 | 18315 | b(arian)m(t)36 b(Sections)g(of)f(the)h(Do)s(cumen)m(t,)h(unaltered)f |
1231ac47 | 18316 | (in)f(their)g(text)i(and)510 4217 y(in)f(their)g(titles.)58 |
37c41ab1 CR |
18317 | b(Section)37 b(n)m(um)m(b)s(ers)d(or)i(the)g(equiv)-5 |
18318 | b(alen)m(t)38 b(are)e(not)g(considered)g(part)g(of)g(the)510 | |
1231ac47 | 18319 | 4326 y(section)c(titles.)341 4463 y(M.)61 b(Delete)33 |
37c41ab1 CR |
18320 | b(an)m(y)e(section)h(En)m(titled)f(\\Endorsemen)m(ts".)42 |
18321 | b(Suc)m(h)30 b(a)i(section)f(ma)m(y)h(not)f(b)s(e)f(included)510 | |
1231ac47 CR |
18322 | 4573 y(in)g(the)h(Mo)s(di\014ed)e(V)-8 b(ersion.)357 |
18323 | 4710 y(N.)60 b(Do)29 b(not)g(retitle)h(an)m(y)e(existing)i(section)f | |
37c41ab1 | 18324 | (to)g(b)s(e)f(En)m(titled)h(\\Endorsemen)m(ts")g(or)f(to)h(con\015ict)g |
1231ac47 CR |
18325 | (in)510 4819 y(title)j(with)e(an)m(y)h(In)m(v)-5 b(arian)m(t)31 |
18326 | b(Section.)354 4956 y(O.)60 b(Preserv)m(e)31 b(an)m(y)g(W)-8 | |
18327 | b(arran)m(t)m(y)32 b(Disclaimers.)330 5121 y(If)h(the)g(Mo)s(di\014ed)g | |
37c41ab1 | 18328 | (V)-8 b(ersion)34 b(includes)f(new)g(fron)m(t-matter)i(sections)f(or)f |
1231ac47 | 18329 | (app)s(endices)g(that)h(qualify)330 5230 y(as)28 b(Secondary)g |
37c41ab1 | 18330 | (Sections)g(and)f(con)m(tain)j(no)d(material)j(copied)e(from)f(the)h |
1231ac47 | 18331 | (Do)s(cumen)m(t,)i(y)m(ou)e(ma)m(y)g(at)330 5340 y(y)m(our)k(option)h |
c2a47ea9 | 18332 | (designate)h(some)e(or)h(all)g(of)f(these)h(sections)h(as)e(in)m(v)-5 |
1231ac47 | 18333 | b(arian)m(t.)48 b(T)-8 b(o)33 b(do)f(this,)h(add)f(their)p |
c2a47ea9 | 18334 | eop end |
9f178efb CR |
18335 | %%Page: 159 165 |
18336 | TeXDict begin 159 164 bop 150 -116 a Ft(App)s(endix)29 | |
c2a47ea9 | 18337 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
9f178efb | 18338 | b(159)330 299 y(titles)37 b(to)f(the)f(list)h(of)g(In)m(v)-5 |
1231ac47 CR |
18339 | b(arian)m(t)36 b(Sections)g(in)f(the)h(Mo)s(di\014ed)f(V)-8 |
18340 | b(ersion's)36 b(license)g(notice.)57 b(These)330 408 | |
18341 | y(titles)32 b(m)m(ust)e(b)s(e)g(distinct)h(from)e(an)m(y)i(other)g | |
18342 | (section)g(titles.)330 551 y(Y)-8 b(ou)43 b(ma)m(y)g(add)f(a)g(section) | |
18343 | i(En)m(titled)f(\\Endorsemen)m(ts",)j(pro)m(vided)c(it)h(con)m(tains)g | |
18344 | (nothing)g(but)330 661 y(endorsemen)m(ts)30 b(of)g(y)m(our)f(Mo)s | |
37c41ab1 | 18345 | (di\014ed)g(V)-8 b(ersion)31 b(b)m(y)e(v)-5 b(arious)30 |
1231ac47 | 18346 | b(parties|for)g(example,)g(statemen)m(ts)i(of)330 770 |
37c41ab1 CR |
18347 | y(p)s(eer)27 b(review)g(or)g(that)h(the)f(text)i(has)d(b)s(een)h(appro) |
18348 | m(v)m(ed)g(b)m(y)g(an)h(organization)h(as)e(the)h(authoritativ)m(e)330 | |
1231ac47 | 18349 | 880 y(de\014nition)i(of)h(a)f(standard.)330 1022 y(Y)-8 |
37c41ab1 CR |
18350 | b(ou)29 b(ma)m(y)g(add)e(a)i(passage)g(of)g(up)e(to)i(\014v)m(e)g(w)m |
18351 | (ords)e(as)i(a)g(F)-8 b(ron)m(t-Co)m(v)m(er)30 b(T)-8 | |
1231ac47 | 18352 | b(ext,)30 b(and)e(a)g(passage)i(of)e(up)330 1132 y(to)g(25)g(w)m(ords)e |
37c41ab1 CR |
18353 | (as)i(a)f(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext,)29 b(to)f(the)f(end)f(of)i |
18354 | (the)f(list)h(of)f(Co)m(v)m(er)h(T)-8 b(exts)27 b(in)g(the)h(Mo)s | |
1231ac47 | 18355 | (di\014ed)330 1241 y(V)-8 b(ersion.)58 b(Only)35 b(one)h(passage)h(of)f |
37c41ab1 | 18356 | (F)-8 b(ron)m(t-Co)m(v)m(er)38 b(T)-8 b(ext)36 b(and)g(one)g(of)g(Bac)m |
1231ac47 | 18357 | (k-Co)m(v)m(er)j(T)-8 b(ext)36 b(ma)m(y)h(b)s(e)330 1351 |
37c41ab1 CR |
18358 | y(added)27 b(b)m(y)g(\(or)h(through)f(arrangemen)m(ts)h(made)g(b)m(y\)) |
18359 | g(an)m(y)g(one)f(en)m(tit)m(y)-8 b(.)42 b(If)27 b(the)h(Do)s(cumen)m(t) | |
1231ac47 | 18360 | g(already)330 1461 y(includes)34 b(a)g(co)m(v)m(er)h(text)g(for)f(the)g |
37c41ab1 | 18361 | (same)h(co)m(v)m(er,)h(previously)e(added)f(b)m(y)h(y)m(ou)g(or)g(b)m |
1231ac47 | 18362 | (y)g(arrangemen)m(t)330 1570 y(made)h(b)m(y)g(the)h(same)f(en)m(tit)m |
37c41ab1 | 18363 | (y)i(y)m(ou)f(are)f(acting)i(on)e(b)s(ehalf)f(of,)j(y)m(ou)f(ma)m(y)g |
1231ac47 | 18364 | (not)f(add)g(another;)j(but)330 1680 y(y)m(ou)c(ma)m(y)h(replace)g(the) |
37c41ab1 | 18365 | f(old)g(one,)i(on)e(explicit)h(p)s(ermission)e(from)g(the)i(previous)e |
1231ac47 CR |
18366 | (publisher)f(that)330 1789 y(added)e(the)g(old)h(one.)330 |
18367 | 1932 y(The)25 b(author\(s\))h(and)f(publisher\(s\))f(of)i(the)f(Do)s | |
37c41ab1 | 18368 | (cumen)m(t)h(do)g(not)f(b)m(y)h(this)f(License)h(giv)m(e)h(p)s |
1231ac47 | 18369 | (ermission)330 2041 y(to)k(use)f(their)g(names)h(for)f(publicit)m(y)g |
37c41ab1 | 18370 | (for)h(or)f(to)h(assert)g(or)f(imply)g(endorsemen)m(t)g(of)h(an)m(y)g |
1231ac47 CR |
18371 | (Mo)s(di\014ed)330 2151 y(V)-8 b(ersion.)199 2293 y(5.)61 |
18372 | b(COMBINING)31 b(DOCUMENTS)330 2436 y(Y)-8 b(ou)39 b(ma)m(y)g(com)m | |
37c41ab1 | 18373 | (bine)h(the)f(Do)s(cumen)m(t)g(with)g(other)f(do)s(cumen)m(ts)h |
1231ac47 | 18374 | (released)g(under)f(this)g(License,)330 2545 y(under)f(the)h(terms)g |
37c41ab1 | 18375 | (de\014ned)f(in)h(section)h(4)g(ab)s(o)m(v)m(e)g(for)f(mo)s(di\014ed)f |
1231ac47 | 18376 | (v)m(ersions,)k(pro)m(vided)d(that)h(y)m(ou)330 2655 |
37c41ab1 CR |
18377 | y(include)25 b(in)g(the)g(com)m(bination)i(all)f(of)g(the)f(In)m(v)-5 |
18378 | b(arian)m(t)26 b(Sections)g(of)g(all)g(of)f(the)h(original)g(do)s | |
1231ac47 | 18379 | (cumen)m(ts,)330 2765 y(unmo)s(di\014ed,)g(and)g(list)h(them)g(all)g |
37c41ab1 | 18380 | (as)g(In)m(v)-5 b(arian)m(t)28 b(Sections)f(of)g(y)m(our)g(com)m(bined) |
1231ac47 | 18381 | g(w)m(ork)f(in)h(its)g(license)330 2874 y(notice,)32 |
37c41ab1 | 18382 | b(and)e(that)h(y)m(ou)f(preserv)m(e)h(all)g(their)g(W)-8 |
1231ac47 | 18383 | b(arran)m(t)m(y)32 b(Disclaimers.)330 3017 y(The)e(com)m(bined)g(w)m |
37c41ab1 | 18384 | (ork)h(need)e(only)i(con)m(tain)g(one)g(cop)m(y)g(of)f(this)g(License,) |
1231ac47 | 18385 | i(and)d(m)m(ultiple)i(iden)m(tical)330 3126 y(In)m(v)-5 |
37c41ab1 CR |
18386 | b(arian)m(t)33 b(Sections)g(ma)m(y)g(b)s(e)f(replaced)h(with)f(a)h |
18387 | (single)g(cop)m(y)-8 b(.)48 b(If)32 b(there)h(are)g(m)m(ultiple)g(In)m | |
1231ac47 | 18388 | (v)-5 b(arian)m(t)330 3236 y(Sections)27 b(with)g(the)g(same)g(name)g |
37c41ab1 | 18389 | (but)f(di\013eren)m(t)h(con)m(ten)m(ts,)i(mak)m(e)f(the)f(title)h(of)f |
1231ac47 | 18390 | (eac)m(h)h(suc)m(h)f(section)330 3345 y(unique)33 b(b)m(y)h(adding)f |
37c41ab1 | 18391 | (at)i(the)f(end)g(of)g(it,)h(in)f(paren)m(theses,)i(the)e(name)g(of)g |
1231ac47 | 18392 | (the)g(original)h(author)f(or)330 3455 y(publisher)23 |
37c41ab1 | 18393 | b(of)i(that)h(section)g(if)f(kno)m(wn,)h(or)f(else)h(a)f(unique)f(n)m |
5e13499c | 18394 | (um)m(b)s(er.)38 b(Mak)m(e)26 b(the)g(same)f(adjustmen)m(t)330 |
1231ac47 | 18395 | 3565 y(to)g(the)g(section)g(titles)h(in)e(the)h(list)g(of)f(In)m(v)-5 |
37c41ab1 | 18396 | b(arian)m(t)26 b(Sections)f(in)f(the)g(license)i(notice)g(of)e(the)h |
1231ac47 | 18397 | (com)m(bined)330 3674 y(w)m(ork.)330 3817 y(In)41 b(the)g(com)m |
37c41ab1 CR |
18398 | (bination,)46 b(y)m(ou)41 b(m)m(ust)g(com)m(bine)h(an)m(y)g(sections)g |
18399 | (En)m(titled)g(\\History")h(in)e(the)g(v)-5 b(ari-)330 | |
1231ac47 | 18400 | 3926 y(ous)32 b(original)h(do)s(cumen)m(ts,)g(forming)f(one)g(section)h |
37c41ab1 | 18401 | (En)m(titled)g(\\History";)i(lik)m(ewise)f(com)m(bine)f(an)m(y)330 |
1231ac47 | 18402 | 4036 y(sections)g(En)m(titled)f(\\Ac)m(kno)m(wledgemen)m(ts",)k(and)31 |
37c41ab1 | 18403 | b(an)m(y)h(sections)h(En)m(titled)g(\\Dedications".)47 |
1231ac47 CR |
18404 | b(Y)-8 b(ou)330 4145 y(m)m(ust)30 b(delete)i(all)f(sections)h(En)m |
18405 | (titled)f(\\Endorsemen)m(ts.")199 4288 y(6.)61 b(COLLECTIONS)28 | |
18406 | b(OF)i(DOCUMENTS)330 4430 y(Y)-8 b(ou)32 b(ma)m(y)h(mak)m(e)g(a)f | |
37c41ab1 | 18407 | (collection)i(consisting)f(of)f(the)g(Do)s(cumen)m(t)g(and)g(other)g |
1231ac47 | 18408 | (do)s(cumen)m(ts)f(released)330 4540 y(under)41 b(this)h(License,)k |
37c41ab1 | 18409 | (and)c(replace)h(the)g(individual)f(copies)h(of)f(this)g(License)h(in)f |
1231ac47 | 18410 | (the)h(v)-5 b(arious)330 4650 y(do)s(cumen)m(ts)42 b(with)g(a)h(single) |
37c41ab1 | 18411 | g(cop)m(y)h(that)f(is)f(included)g(in)g(the)h(collection,)48 |
1231ac47 | 18412 | b(pro)m(vided)42 b(that)i(y)m(ou)330 4759 y(follo)m(w)38 |
37c41ab1 CR |
18413 | b(the)g(rules)e(of)h(this)g(License)h(for)f(v)m(erbatim)h(cop)m(ying)g |
18414 | (of)f(eac)m(h)h(of)f(the)h(do)s(cumen)m(ts)e(in)h(all)330 | |
1231ac47 | 18415 | 4869 y(other)31 b(resp)s(ects.)330 5011 y(Y)-8 b(ou)32 |
37c41ab1 CR |
18416 | b(ma)m(y)g(extract)h(a)f(single)g(do)s(cumen)m(t)f(from)g(suc)m(h)g(a)h |
18417 | (collection,)i(and)d(distribute)g(it)h(individu-)330 | |
1231ac47 | 18418 | 5121 y(ally)k(under)d(this)i(License,)i(pro)m(vided)e(y)m(ou)g(insert)g |
37c41ab1 | 18419 | (a)g(cop)m(y)h(of)f(this)g(License)g(in)m(to)h(the)g(extracted)330 |
1231ac47 | 18420 | 5230 y(do)s(cumen)m(t,)d(and)f(follo)m(w)i(this)e(License)h(in)g(all)g |
37c41ab1 | 18421 | (other)g(resp)s(ects)f(regarding)h(v)m(erbatim)g(cop)m(ying)h(of)330 |
1231ac47 | 18422 | 5340 y(that)d(do)s(cumen)m(t.)p eop end |
9f178efb CR |
18423 | %%Page: 160 166 |
18424 | TeXDict begin 160 165 bop 150 -116 a Ft(160)2527 b(Bash)31 | |
1231ac47 CR |
18425 | b(Reference)g(Man)m(ual)199 299 y(7.)61 b(A)m(GGREGA)-8 |
18426 | b(TION)32 b(WITH)e(INDEPENDENT)h(W)m(ORKS)330 441 y(A)d(compilation)i | |
18427 | (of)e(the)g(Do)s(cumen)m(t)h(or)f(its)g(deriv)-5 b(ativ)m(es)30 | |
18428 | b(with)d(other)i(separate)g(and)e(indep)s(enden)m(t)330 | |
18429 | 551 y(do)s(cumen)m(ts)33 b(or)g(w)m(orks,)h(in)f(or)h(on)f(a)g(v)m | |
18430 | (olume)h(of)g(a)f(storage)i(or)e(distribution)g(medium,)g(is)h(called) | |
18431 | 330 661 y(an)c(\\aggregate")k(if)c(the)g(cop)m(yrigh)m(t)i(resulting)e | |
18432 | (from)f(the)i(compilation)g(is)f(not)h(used)e(to)i(limit)g(the)330 | |
18433 | 770 y(legal)d(righ)m(ts)f(of)g(the)g(compilation's)h(users)e(b)s(ey)m | |
18434 | (ond)g(what)g(the)h(individual)f(w)m(orks)g(p)s(ermit.)39 | |
18435 | b(When)330 880 y(the)g(Do)s(cumen)m(t)g(is)f(included)g(in)g(an)g | |
18436 | (aggregate,)44 b(this)38 b(License)h(do)s(es)f(not)h(apply)f(to)h(the)g | |
18437 | (other)330 989 y(w)m(orks)30 b(in)g(the)h(aggregate)i(whic)m(h)d(are)h | |
18438 | (not)g(themselv)m(es)g(deriv)-5 b(ativ)m(e)32 b(w)m(orks)f(of)f(the)h | |
18439 | (Do)s(cumen)m(t.)330 1132 y(If)22 b(the)h(Co)m(v)m(er)h(T)-8 | |
18440 | b(ext)23 b(requiremen)m(t)g(of)g(section)h(3)f(is)g(applicable)h(to)f | |
18441 | (these)h(copies)f(of)g(the)g(Do)s(cumen)m(t,)330 1241 | |
18442 | y(then)f(if)g(the)h(Do)s(cumen)m(t)g(is)g(less)f(than)g(one)h(half)f | |
18443 | (of)h(the)g(en)m(tire)g(aggregate,)k(the)c(Do)s(cumen)m(t's)g(Co)m(v)m | |
18444 | (er)330 1351 y(T)-8 b(exts)27 b(ma)m(y)g(b)s(e)f(placed)h(on)g(co)m(v)m | |
18445 | (ers)h(that)f(brac)m(k)m(et)h(the)f(Do)s(cumen)m(t)g(within)f(the)h | |
18446 | (aggregate,)j(or)d(the)330 1461 y(electronic)37 b(equiv)-5 | |
18447 | b(alen)m(t)36 b(of)g(co)m(v)m(ers)g(if)f(the)g(Do)s(cumen)m(t)h(is)f | |
18448 | (in)g(electronic)i(form.)54 b(Otherwise)35 b(they)330 | |
18449 | 1570 y(m)m(ust)30 b(app)s(ear)g(on)g(prin)m(ted)g(co)m(v)m(ers)i(that)f | |
18450 | (brac)m(k)m(et)h(the)f(whole)f(aggregate.)199 1713 y(8.)61 | |
18451 | b(TRANSLA)-8 b(TION)330 1855 y(T)g(ranslation)41 b(is)f(considered)f(a) | |
37c41ab1 | 18452 | i(kind)e(of)h(mo)s(di\014cation,)j(so)d(y)m(ou)g(ma)m(y)h(distribute)e |
1231ac47 | 18453 | (translations)330 1965 y(of)45 b(the)f(Do)s(cumen)m(t)h(under)e(the)h |
37c41ab1 | 18454 | (terms)h(of)f(section)i(4.)83 b(Replacing)45 b(In)m(v)-5 |
1231ac47 | 18455 | b(arian)m(t)45 b(Sections)g(with)330 2074 y(translations)h(requires)f |
37c41ab1 | 18456 | (sp)s(ecial)h(p)s(ermission)f(from)g(their)g(cop)m(yrigh)m(t)i |
1231ac47 | 18457 | (holders,)i(but)c(y)m(ou)g(ma)m(y)330 2184 y(include)24 |
37c41ab1 CR |
18458 | b(translations)i(of)e(some)h(or)g(all)g(In)m(v)-5 b(arian)m(t)25 |
18459 | b(Sections)g(in)f(addition)h(to)g(the)g(original)h(v)m(ersions)330 | |
1231ac47 | 18460 | 2293 y(of)32 b(these)f(In)m(v)-5 b(arian)m(t)33 b(Sections.)44 |
37c41ab1 | 18461 | b(Y)-8 b(ou)32 b(ma)m(y)g(include)f(a)h(translation)g(of)g(this)f |
1231ac47 | 18462 | (License,)i(and)d(all)j(the)330 2403 y(license)42 b(notices)g(in)f(the) |
37c41ab1 | 18463 | h(Do)s(cumen)m(t,)j(and)40 b(an)m(y)i(W)-8 b(arran)m(t)m(y)42 |
1231ac47 | 18464 | b(Disclaimers,)k(pro)m(vided)41 b(that)h(y)m(ou)330 2513 |
37c41ab1 CR |
18465 | y(also)f(include)f(the)g(original)h(English)f(v)m(ersion)g(of)g(this)g |
18466 | (License)h(and)e(the)h(original)h(v)m(ersions)g(of)330 | |
1231ac47 | 18467 | 2622 y(those)35 b(notices)g(and)e(disclaimers.)53 b(In)33 |
37c41ab1 | 18468 | b(case)i(of)g(a)f(disagreemen)m(t)h(b)s(et)m(w)m(een)g(the)f |
1231ac47 | 18469 | (translation)i(and)330 2732 y(the)f(original)i(v)m(ersion)e(of)h(this)f |
37c41ab1 | 18470 | (License)h(or)f(a)g(notice)i(or)e(disclaimer,)i(the)f(original)g(v)m |
1231ac47 | 18471 | (ersion)g(will)330 2841 y(prev)-5 b(ail.)330 2984 y(If)28 |
37c41ab1 CR |
18472 | b(a)h(section)h(in)e(the)h(Do)s(cumen)m(t)h(is)e(En)m(titled)i(\\Ac)m |
18473 | (kno)m(wledgemen)m(ts",)i(\\Dedications",)g(or)d(\\His-)330 | |
1231ac47 | 18474 | 3093 y(tory",)f(the)f(requiremen)m(t)f(\(section)i(4\))f(to)g(Preserv)m |
37c41ab1 | 18475 | (e)g(its)f(Title)i(\(section)f(1\))g(will)g(t)m(ypically)h(require)330 |
1231ac47 CR |
18476 | 3203 y(c)m(hanging)j(the)g(actual)h(title.)199 3345 y(9.)61 |
18477 | b(TERMINA)-8 b(TION)330 3488 y(Y)g(ou)30 b(ma)m(y)h(not)f(cop)m(y)-8 | |
37c41ab1 | 18478 | b(,)31 b(mo)s(dify)-8 b(,)30 b(sublicense,)g(or)g(distribute)f(the)h |
1231ac47 CR |
18479 | (Do)s(cumen)m(t)g(except)h(as)f(expressly)330 3598 y(pro)m(vided)38 |
18480 | b(under)f(this)i(License.)65 b(An)m(y)39 b(attempt)h(otherwise)f(to)g | |
18481 | (cop)m(y)-8 b(,)42 b(mo)s(dify)-8 b(,)40 b(sublicense,)h(or)330 | |
18482 | 3707 y(distribute)30 b(it)h(is)f(v)m(oid,)h(and)f(will)h(automatically) | |
18483 | i(terminate)f(y)m(our)e(righ)m(ts)h(under)e(this)h(License.)330 | |
18484 | 3850 y(Ho)m(w)m(ev)m(er,)35 b(if)e(y)m(ou)f(cease)i(all)f(violation)i | |
18485 | (of)d(this)g(License,)i(then)e(y)m(our)h(license)g(from)f(a)h | |
18486 | (particular)330 3959 y(cop)m(yrigh)m(t)k(holder)e(is)h(reinstated)h | |
18487 | (\(a\))f(pro)m(visionally)-8 b(,)39 b(unless)c(and)g(un)m(til)h(the)g | |
18488 | (cop)m(yrigh)m(t)h(holder)330 4069 y(explicitly)42 b(and)e(\014nally)h | |
18489 | (terminates)g(y)m(our)g(license,)j(and)c(\(b\))h(p)s(ermanen)m(tly)-8 | |
18490 | b(,)43 b(if)e(the)g(cop)m(yrigh)m(t)330 4178 y(holder)34 | |
18491 | b(fails)h(to)g(notify)g(y)m(ou)g(of)f(the)h(violation)h(b)m(y)e(some)h | |
18492 | (reasonable)g(means)g(prior)e(to)i(60)h(da)m(ys)330 4288 | |
18493 | y(after)31 b(the)f(cessation.)330 4430 y(Moreo)m(v)m(er,)k(y)m(our)d | |
18494 | (license)i(from)e(a)h(particular)f(cop)m(yrigh)m(t)i(holder)e(is)h | |
18495 | (reinstated)g(p)s(ermanen)m(tly)f(if)330 4540 y(the)d(cop)m(yrigh)m(t)h | |
18496 | (holder)f(noti\014es)g(y)m(ou)g(of)g(the)g(violation)h(b)m(y)f(some)g | |
18497 | (reasonable)h(means,)f(this)g(is)g(the)330 4650 y(\014rst)f(time)i(y)m | |
18498 | (ou)f(ha)m(v)m(e)h(receiv)m(ed)g(notice)g(of)f(violation)i(of)e(this)f | |
18499 | (License)i(\(for)f(an)m(y)g(w)m(ork\))g(from)f(that)330 | |
18500 | 4759 y(cop)m(yrigh)m(t)33 b(holder,)g(and)e(y)m(ou)h(cure)g(the)g | |
18501 | (violation)i(prior)d(to)i(30)f(da)m(ys)h(after)f(y)m(our)g(receipt)h | |
18502 | (of)f(the)330 4869 y(notice.)330 5011 y(T)-8 b(ermination)28 | |
18503 | b(of)g(y)m(our)f(righ)m(ts)h(under)e(this)i(section)g(do)s(es)f(not)h | |
18504 | (terminate)h(the)e(licenses)i(of)f(parties)330 5121 y(who)38 | |
18505 | b(ha)m(v)m(e)h(receiv)m(ed)h(copies)e(or)h(righ)m(ts)f(from)g(y)m(ou)g | |
18506 | (under)f(this)h(License.)64 b(If)38 b(y)m(our)g(righ)m(ts)h(ha)m(v)m(e) | |
18507 | 330 5230 y(b)s(een)25 b(terminated)i(and)e(not)h(p)s(ermanen)m(tly)g | |
18508 | (reinstated,)i(receipt)f(of)f(a)g(cop)m(y)h(of)f(some)h(or)f(all)h(of)f | |
18509 | (the)330 5340 y(same)31 b(material)h(do)s(es)e(not)g(giv)m(e)i(y)m(ou)f | |
18510 | (an)m(y)g(righ)m(ts)f(to)i(use)e(it.)p eop end | |
9f178efb CR |
18511 | %%Page: 161 167 |
18512 | TeXDict begin 161 166 bop 150 -116 a Ft(App)s(endix)29 | |
1231ac47 | 18513 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
9f178efb | 18514 | b(161)154 299 y(10.)61 b(FUTURE)30 b(REVISIONS)f(OF)i(THIS)e(LICENSE) |
1231ac47 CR |
18515 | 330 433 y(The)41 b(F)-8 b(ree)43 b(Soft)m(w)m(are)f(F)-8 |
18516 | b(oundation)43 b(ma)m(y)f(publish)e(new,)k(revised)d(v)m(ersions)h(of)g | |
18517 | (the)g(GNU)g(F)-8 b(ree)330 543 y(Do)s(cumen)m(tation)34 | |
18518 | b(License)e(from)g(time)h(to)g(time.)46 b(Suc)m(h)31 | |
18519 | b(new)h(v)m(ersions)g(will)h(b)s(e)e(similar)h(in)g(spirit)330 | |
18520 | 653 y(to)j(the)g(presen)m(t)f(v)m(ersion,)i(but)e(ma)m(y)h(di\013er)f | |
18521 | (in)g(detail)h(to)g(address)f(new)g(problems)f(or)i(concerns.)330 | |
18522 | 762 y(See)c Fs(http://www.gnu.org/copy)o(left)o(/)p Ft(.)330 | |
18523 | 897 y(Eac)m(h)f(v)m(ersion)g(of)g(the)f(License)h(is)g(giv)m(en)g(a)g | |
18524 | (distinguishing)f(v)m(ersion)h(n)m(um)m(b)s(er.)39 b(If)29 | |
18525 | b(the)g(Do)s(cumen)m(t)330 1006 y(sp)s(eci\014es)45 b(that)h(a)g | |
18526 | (particular)f(n)m(um)m(b)s(ered)f(v)m(ersion)i(of)f(this)g(License)h | |
18527 | (\\or)g(an)m(y)g(later)g(v)m(ersion")330 1116 y(applies)33 | |
18528 | b(to)g(it,)h(y)m(ou)e(ha)m(v)m(e)i(the)f(option)g(of)f(follo)m(wing)i | |
18529 | (the)f(terms)f(and)g(conditions)h(either)g(of)f(that)330 | |
18530 | 1225 y(sp)s(eci\014ed)37 b(v)m(ersion)i(or)e(of)h(an)m(y)h(later)g(v)m | |
37c41ab1 | 18531 | (ersion)f(that)g(has)g(b)s(een)f(published)f(\(not)j(as)f(a)g(draft\))g |
1231ac47 | 18532 | (b)m(y)330 1335 y(the)33 b(F)-8 b(ree)34 b(Soft)m(w)m(are)f(F)-8 |
37c41ab1 | 18533 | b(oundation.)49 b(If)32 b(the)h(Do)s(cumen)m(t)g(do)s(es)g(not)g(sp)s |
1231ac47 | 18534 | (ecify)f(a)h(v)m(ersion)g(n)m(um)m(b)s(er)f(of)330 1445 |
37c41ab1 CR |
18535 | y(this)i(License,)j(y)m(ou)d(ma)m(y)i(c)m(ho)s(ose)f(an)m(y)g(v)m |
18536 | (ersion)g(ev)m(er)g(published)e(\(not)i(as)g(a)f(draft\))h(b)m(y)f(the) | |
1231ac47 CR |
18537 | h(F)-8 b(ree)330 1554 y(Soft)m(w)m(are)33 b(F)-8 b(oundation.)46 |
18538 | b(If)32 b(the)g(Do)s(cumen)m(t)g(sp)s(eci\014es)g(that)g(a)h(pro)m(xy)f | |
18539 | (can)g(decide)g(whic)m(h)g(future)330 1664 y(v)m(ersions)h(of)g(this)f | |
18540 | (License)h(can)g(b)s(e)f(used,)g(that)i(pro)m(xy's)e(public)g(statemen) | |
18541 | m(t)i(of)f(acceptance)i(of)e(a)330 1773 y(v)m(ersion)e(p)s(ermanen)m | |
18542 | (tly)f(authorizes)h(y)m(ou)g(to)g(c)m(ho)s(ose)g(that)g(v)m(ersion)g | |
18543 | (for)f(the)h(Do)s(cumen)m(t.)154 1908 y(11.)61 b(RELICENSING)330 | |
18544 | 2042 y(\\Massiv)m(e)39 b(Multiauthor)f(Collab)s(oration)g(Site")h(\(or) | |
18545 | e(\\MMC)h(Site"\))h(means)e(an)m(y)h(W)-8 b(orld)37 b(Wide)330 | |
18546 | 2152 y(W)-8 b(eb)36 b(serv)m(er)g(that)h(publishes)d(cop)m(yrigh)m | |
18547 | (table)k(w)m(orks)e(and)f(also)i(pro)m(vides)e(prominen)m(t)h | |
18548 | (facilities)330 2262 y(for)27 b(an)m(yb)s(o)s(dy)g(to)h(edit)g(those)g | |
18549 | (w)m(orks.)39 b(A)28 b(public)f(wiki)h(that)g(an)m(yb)s(o)s(dy)e(can)i | |
18550 | (edit)g(is)f(an)h(example)g(of)330 2371 y(suc)m(h)33 | |
18551 | b(a)h(serv)m(er.)51 b(A)34 b(\\Massiv)m(e)i(Multiauthor)e(Collab)s | |
18552 | (oration")h(\(or)f(\\MMC"\))h(con)m(tained)g(in)f(the)330 | |
18553 | 2481 y(site)d(means)f(an)m(y)h(set)g(of)g(cop)m(yrigh)m(table)h(w)m | |
18554 | (orks)e(th)m(us)g(published)f(on)h(the)h(MMC)f(site.)330 | |
18555 | 2615 y(\\CC-BY-SA")36 b(means)f(the)g(Creativ)m(e)i(Commons)e(A)m | |
18556 | (ttribution-Share)g(Alik)m(e)i(3.0)f(license)g(pub-)330 | |
18557 | 2725 y(lished)27 b(b)m(y)f(Creativ)m(e)j(Commons)d(Corp)s(oration,)h(a) | |
18558 | g(not-for-pro\014t)g(corp)s(oration)h(with)e(a)h(principal)330 | |
18559 | 2834 y(place)g(of)f(business)e(in)i(San)f(F)-8 b(rancisco,)29 | |
18560 | b(California,)f(as)e(w)m(ell)h(as)f(future)f(cop)m(yleft)i(v)m(ersions) | |
18561 | f(of)g(that)330 2944 y(license)31 b(published)e(b)m(y)h(that)h(same)g | |
18562 | (organization.)330 3078 y(\\Incorp)s(orate")h(means)e(to)h(publish)e | |
18563 | (or)i(republish)e(a)i(Do)s(cumen)m(t,)g(in)g(whole)g(or)f(in)g(part,)h | |
18564 | (as)g(part)330 3188 y(of)g(another)f(Do)s(cumen)m(t.)330 | |
18565 | 3323 y(An)c(MMC)g(is)h(\\eligible)h(for)e(relicensing")h(if)g(it)f(is)h | |
18566 | (licensed)f(under)f(this)h(License,)i(and)e(if)g(all)h(w)m(orks)330 | |
18567 | 3432 y(that)43 b(w)m(ere)f(\014rst)f(published)f(under)h(this)h | |
18568 | (License)g(somewhere)g(other)g(than)g(this)g(MMC,)h(and)330 | |
18569 | 3542 y(subsequen)m(tly)34 b(incorp)s(orated)h(in)f(whole)h(or)g(in)f | |
18570 | (part)h(in)m(to)h(the)f(MMC,)g(\(1\))h(had)e(no)h(co)m(v)m(er)h(texts) | |
18571 | 330 3651 y(or)30 b(in)m(v)-5 b(arian)m(t)32 b(sections,)g(and)d(\(2\))j | |
18572 | (w)m(ere)f(th)m(us)f(incorp)s(orated)g(prior)g(to)h(No)m(v)m(em)m(b)s | |
18573 | (er)g(1,)g(2008.)330 3786 y(The)40 b(op)s(erator)h(of)g(an)f(MMC)h | |
18574 | (Site)g(ma)m(y)g(republish)e(an)h(MMC)h(con)m(tained)h(in)e(the)h(site) | |
18575 | g(under)330 3895 y(CC-BY-SA)30 b(on)g(the)h(same)f(site)h(at)g(an)m(y)g | |
18576 | (time)g(b)s(efore)e(August)h(1,)h(2009,)h(pro)m(vided)e(the)g(MMC)h(is) | |
18577 | 330 4005 y(eligible)h(for)e(relicensing.)p eop end | |
9f178efb CR |
18578 | %%Page: 162 168 |
18579 | TeXDict begin 162 167 bop 150 -116 a Ft(162)2527 b(Bash)31 | |
1231ac47 | 18580 | b(Reference)g(Man)m(ual)150 299 y Fr(ADDENDUM:)45 b(Ho)l(w)h(to)f(use)g |
c302751c CR |
18581 | (this)h(License)f(for)g(y)l(our)g(do)t(cumen)l(ts)150 |
18582 | 458 y Ft(T)-8 b(o)35 b(use)f(this)h(License)g(in)f(a)h(do)s(cumen)m(t)g | |
18583 | (y)m(ou)f(ha)m(v)m(e)i(written,)g(include)f(a)f(cop)m(y)i(of)f(the)f | |
18584 | (License)h(in)g(the)150 568 y(do)s(cumen)m(t)30 b(and)g(put)g(the)g | |
18585 | (follo)m(wing)i(cop)m(yrigh)m(t)g(and)e(license)h(notices)g(just)f | |
18586 | (after)h(the)g(title)h(page:)468 680 y Fe(Copyright)42 | |
18587 | b(\(C\))79 b Fd(year)88 b(your)40 b(name)9 b Fe(.)468 | |
18588 | 767 y(Permission)42 b(is)e(granted)g(to)g(copy,)h(distribute)g(and/or)g | |
18589 | (modify)f(this)g(document)468 854 y(under)h(the)f(terms)g(of)g(the)g | |
18590 | (GNU)g(Free)g(Documentation)i(License,)f(Version)g(1.3)468 | |
18591 | 941 y(or)f(any)g(later)g(version)h(published)h(by)d(the)h(Free)g | |
18592 | (Software)h(Foundation;)468 1029 y(with)g(no)e(Invariant)j(Sections,)f | |
18593 | (no)f(Front-Cover)h(Texts,)g(and)f(no)f(Back-Cover)468 | |
18594 | 1116 y(Texts.)80 b(A)40 b(copy)g(of)g(the)f(license)i(is)f(included)h | |
18595 | (in)f(the)g(section)g(entitled)h(``GNU)468 1203 y(Free)g(Documentation) | |
18596 | h(License''.)275 1337 y Ft(If)d(y)m(ou)h(ha)m(v)m(e)h(In)m(v)-5 | |
18597 | b(arian)m(t)41 b(Sections,)i(F)-8 b(ron)m(t-Co)m(v)m(er)42 | |
18598 | b(T)-8 b(exts)41 b(and)e(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts,)43 | |
18599 | b(replace)e(the)150 1447 y(\\with)6 b(.)22 b(.)g(.)12 | |
18600 | b(T)-8 b(exts.")41 b(line)31 b(with)f(this:)547 1559 | |
18601 | y Fe(with)40 b(the)g(Invariant)h(Sections)g(being)g Fd(list)f(their)g | |
18602 | (titles)9 b Fe(,)41 b(with)547 1646 y(the)f(Front-Cover)i(Texts)e | |
18603 | (being)g Fd(list)9 b Fe(,)40 b(and)g(with)g(the)g(Back-Cover)i(Texts) | |
18604 | 547 1733 y(being)e Fd(list)9 b Fe(.)275 1868 y Ft(If)34 | |
c2a47ea9 CR |
18605 | b(y)m(ou)i(ha)m(v)m(e)g(In)m(v)-5 b(arian)m(t)36 b(Sections)g(without)f |
18606 | (Co)m(v)m(er)h(T)-8 b(exts,)38 b(or)d(some)g(other)h(com)m(bination)g | |
c302751c CR |
18607 | (of)g(the)150 1978 y(three,)31 b(merge)g(those)g(t)m(w)m(o)g |
18608 | (alternativ)m(es)i(to)e(suit)f(the)h(situation.)275 2112 | |
c2a47ea9 CR |
18609 | y(If)23 b(y)m(our)h(do)s(cumen)m(t)f(con)m(tains)i(non)m(trivial)g |
18610 | (examples)g(of)f(program)f(co)s(de,)j(w)m(e)e(recommend)g(releasing)150 | |
c302751c | 18611 | 2222 y(these)44 b(examples)f(in)g(parallel)h(under)e(y)m(our)h(c)m |
c2a47ea9 | 18612 | (hoice)i(of)e(free)g(soft)m(w)m(are)h(license,)k(suc)m(h)43 |
c302751c | 18613 | b(as)g(the)g(GNU)150 2331 y(General)31 b(Public)f(License,)i(to)f(p)s |
c2a47ea9 CR |
18614 | (ermit)e(their)i(use)f(in)g(free)g(soft)m(w)m(are.)p |
18615 | eop end | |
9f178efb CR |
18616 | %%Page: 163 169 |
18617 | TeXDict begin 163 168 bop 150 -116 a Ft(App)s(endix)29 | |
18618 | b(D:)i(Indexes)2623 b(163)150 299 y Fo(App)t(endix)52 | |
c302751c CR |
18619 | b(D)81 b(Indexes)150 631 y Fr(D.1)68 b(Index)45 b(of)g(Shell)g(Builtin) |
18620 | g(Commands)150 868 y(.)150 984 y Fe(.)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g | |
18621 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
18622 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
9f178efb | 18623 | (:)h(:)f(:)g(:)g(:)39 b Fb(41)150 1218 y Fr(:)150 1335 |
c302751c CR |
18624 | y Fe(:)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
18625 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
18626 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)39 | |
9f178efb | 18627 | b Fb(41)150 1579 y Fr([)150 1695 y Fe([)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c CR |
18628 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18629 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
9f178efb | 18630 | (:)h(:)f(:)g(:)g(:)39 b Fb(45)150 1938 y Fr(A)150 2055 |
c302751c CR |
18631 | y Fe(alias)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18632 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 18633 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)46 b Fb(48)150 |
c302751c CR |
18634 | 2289 y Fr(B)150 2405 y Fe(bg)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18635 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
18636 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18637 | g(:)37 b Fb(98)150 2493 y Fe(bind)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:) |
c302751c CR |
18638 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18639 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18640 | 49 b Fb(48)150 2580 y Fe(break)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f |
c302751c CR |
18641 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
18642 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)46 | |
9f178efb | 18643 | b Fb(41)150 2668 y Fe(builtin)15 b Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g(:)g |
c302751c CR |
18644 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
18645 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 | |
9f178efb | 18646 | b Fb(49)150 2902 y Fr(C)150 3019 y Fe(caller)17 b Fc(:)e(:)e(:)g(:)g(:) |
c302751c CR |
18647 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18648 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 18649 | 43 b Fb(49)150 3106 y Fe(cd)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c CR |
18650 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18651 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
9f178efb | 18652 | (:)37 b Fb(42)150 3194 y Fe(command)15 b Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g |
c302751c CR |
18653 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
18654 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 | |
9f178efb | 18655 | b Fb(50)150 3281 y Fe(compgen)12 b Fc(:)j(:)e(:)g(:)h(:)f(:)g(:)g(:)g |
c302751c CR |
18656 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
18657 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)39 b | |
9f178efb | 18658 | Fb(126)150 3368 y Fe(complete)10 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)h(:) |
c302751c | 18659 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
9f178efb | 18660 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(127)150 |
c302751c CR |
18661 | 3456 y Fe(compopt)12 b Fc(:)j(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
18662 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 18663 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)39 b Fb(130)150 3543 |
c302751c CR |
18664 | y Fe(continue)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18665 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 18666 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 b Fb(42)150 3778 y |
c302751c CR |
18667 | Fr(D)150 3894 y Fe(declare)15 b Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18668 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
18669 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 b | |
9f178efb | 18670 | Fb(50)150 3982 y Fe(dirs)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18671 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
18672 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 18673 | b Fb(89)150 4069 y Fe(disown)17 b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:) |
c302751c CR |
18674 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
18675 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)43 | |
9f178efb | 18676 | b Fb(99)150 4303 y Fr(E)150 4420 y Fe(echo)23 b Fc(:)13 |
c302751c CR |
18677 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
18678 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 18679 | g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(51)150 4507 y Fe(enable)17 |
c302751c CR |
18680 | b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
18681 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 18682 | (:)g(:)g(:)g(:)g(:)h(:)43 b Fb(52)150 4595 y Fe(eval)23 |
c302751c CR |
18683 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18684 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18685 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(42)150 4682 y |
c302751c CR |
18686 | Fe(exec)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
18687 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
9f178efb | 18688 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(42)150 |
c302751c CR |
18689 | 4770 y Fe(exit)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
18690 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
18691 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 18692 | b Fb(43)150 4857 y Fe(export)17 b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:) |
c302751c CR |
18693 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
18694 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)43 | |
9f178efb | 18695 | b Fb(43)150 5110 y Fr(F)150 5227 y Fe(fc)8 b Fc(:)14 |
c302751c CR |
18696 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
18697 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
9f178efb | 18698 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)35 b Fb(133)150 5314 |
c302751c CR |
18699 | y Fe(fg)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
18700 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
18701 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)37 | |
9f178efb | 18702 | b Fb(98)2025 868 y Fr(G)2025 988 y Fe(getopts)15 b Fc(:)f(:)f(:)g(:)g |
c302751c CR |
18703 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18704 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)41 | |
9f178efb | 18705 | b Fb(43)2025 1250 y Fr(H)2025 1370 y Fe(hash)23 b Fc(:)13 |
c302751c CR |
18706 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18707 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18708 | h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(44)2025 1459 y Fe(help)23 |
c302751c CR |
18709 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
18710 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18711 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(53)2025 1549 |
c302751c CR |
18712 | y Fe(history)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
18713 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
9f178efb | 18714 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)39 b Fb(134)2025 1811 |
c302751c CR |
18715 | y Fr(J)2025 1931 y Fe(jobs)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
18716 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18717 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 18718 | b Fb(98)2025 2193 y Fr(K)2025 2313 y Fe(kill)23 b Fc(:)13 |
c302751c CR |
18719 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18720 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18721 | h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(99)2025 2557 y Fr(L)2025 |
c302751c CR |
18722 | 2677 y Fe(let)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
18723 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
18724 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 | |
9f178efb | 18725 | b Fb(53)2025 2766 y Fe(local)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
c302751c CR |
18726 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
18727 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 | |
9f178efb | 18728 | b Fb(53)2025 2856 y Fe(logout)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18729 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
18730 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 | |
9f178efb | 18731 | b Fb(53)2025 3118 y Fr(M)2025 3238 y Fe(mapfile)15 b |
c302751c CR |
18732 | Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
18733 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18734 | h(:)f(:)g(:)g(:)41 b Fb(53)2025 3500 y Fr(P)2025 3620 |
c302751c CR |
18735 | y Fe(popd)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
18736 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
9f178efb | 18737 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(90)2025 |
c302751c CR |
18738 | 3710 y Fe(printf)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18739 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
9f178efb | 18740 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 b Fb(54)2025 |
c302751c CR |
18741 | 3799 y Fe(pushd)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
18742 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18743 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b | |
9f178efb | 18744 | Fb(90)2025 3888 y Fe(pwd)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18745 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
18746 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 | |
9f178efb | 18747 | b Fb(44)2025 4150 y Fr(R)2025 4270 y Fe(read)23 b Fc(:)13 |
c302751c CR |
18748 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18749 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18750 | h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(55)2025 4360 y Fe(readarray)9 |
c302751c CR |
18751 | b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18752 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 18753 | f(:)g(:)g(:)36 b Fb(56)2025 4449 y Fe(readonly)12 b Fc(:)j(:)e(:)g(:)g |
c302751c CR |
18754 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
18755 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 | |
9f178efb | 18756 | b Fb(44)2025 4538 y Fe(return)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18757 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
18758 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 | |
9f178efb | 18759 | b Fb(45)2025 4782 y Fr(S)2025 4902 y Fe(set)8 b Fc(:)13 |
c302751c CR |
18760 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
18761 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 18762 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(58)2025 4991 |
c302751c CR |
18763 | y Fe(shift)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
18764 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18765 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b Fb(45)2025 |
c302751c CR |
18766 | 5080 y Fe(shopt)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
18767 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18768 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b | |
9f178efb | 18769 | Fb(62)2025 5169 y Fe(source)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18770 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18771 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 | |
9f178efb | 18772 | b Fb(56)2025 5259 y Fe(suspend)15 b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c CR |
18773 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
18774 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)41 | |
9f178efb CR |
18775 | b Fb(99)p eop end |
18776 | %%Page: 164 170 | |
18777 | TeXDict begin 164 169 bop 150 -116 a Ft(164)2527 b(Bash)31 | |
c302751c CR |
18778 | b(Reference)g(Man)m(ual)150 299 y Fr(T)150 428 y Fe(test)23 |
18779 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
18780 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18781 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(45)150 522 y |
c302751c CR |
18782 | Fe(times)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
18783 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 18784 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)46 b Fb(46)150 |
c302751c CR |
18785 | 616 y Fe(trap)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
18786 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
18787 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 18788 | b Fb(46)150 709 y Fe(type)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
c302751c CR |
18789 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
18790 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 18791 | b Fb(56)150 803 y Fe(typeset)15 b Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:) |
c302751c CR |
18792 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
18793 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 | |
9f178efb | 18794 | b Fb(57)2025 299 y Fr(U)2025 415 y Fe(ulimit)17 b Fc(:)d(:)g(:)f(:)g(:) |
c302751c CR |
18795 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
18796 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18797 | 44 b Fb(57)2025 502 y Fe(umask)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18798 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18799 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 | |
9f178efb | 18800 | b Fb(47)2025 590 y Fe(unalias)15 b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c CR |
18801 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
18802 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)41 | |
9f178efb | 18803 | b Fb(58)2025 677 y Fe(unset)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
c302751c CR |
18804 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
18805 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 | |
9f178efb | 18806 | b Fb(47)2025 910 y Fr(W)2025 1026 y Fe(wait)23 b Fc(:)13 |
c302751c CR |
18807 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18808 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18809 | h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(99)150 1259 y Fr(D.2)68 |
c302751c CR |
18810 | b(Index)45 b(of)g(Shell)g(Reserv)l(ed)h(W)-11 b(ords)150 |
18811 | 1495 y(!)150 1612 y Fe(!)15 b Fc(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
18812 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
18813 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
18814 | g(:)g(:)42 b Fb(8)150 1855 y Fr([)150 1971 y Fe([[)10 | |
18815 | b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
18816 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
18817 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(12)150 | |
18818 | 2220 y Fr(])150 2337 y Fe(]])10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
18819 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
18820 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
18821 | g(:)37 b Fb(12)150 2579 y Fa({)150 2695 y Fe({)13 b Fc(:)g(:)g(:)g(:)h | |
18822 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
18823 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
220537f2 | 18824 | (:)g(:)g(:)h(:)f(:)g(:)g(:)39 b Fb(14)150 2938 y Fa(})150 |
c302751c CR |
18825 | 3054 y Fe(})13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
18826 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
18827 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)39 | |
220537f2 | 18828 | b Fb(14)150 3296 y Fr(C)150 3412 y Fe(case)23 b Fc(:)13 |
c302751c CR |
18829 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
18830 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
220537f2 CR |
18831 | g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(11)150 3646 y Fr(D)150 |
18832 | 3762 y Fe(do)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18833 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
18834 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)37 | |
18835 | b Fb(10)150 3849 y Fe(done)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
18836 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
18837 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
18838 | b Fb(10)150 4083 y Fr(E)150 4199 y Fe(elif)23 b Fc(:)13 | |
c302751c CR |
18839 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
18840 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
18841 | g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(10)2025 1495 y Fe(else)23 | |
18842 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
18843 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18844 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(10)2025 1586 | |
18845 | y Fe(esac)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
18846 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
220537f2 | 18847 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(11)2025 |
c302751c CR |
18848 | 1838 y Fr(F)2025 1961 y Fe(fi)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
18849 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
18850 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
18851 | (:)g(:)37 b Fb(10)2025 2052 y Fe(for)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g | |
18852 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18853 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
18854 | (:)f(:)g(:)34 b Fb(10)2025 2143 y Fe(function)12 b Fc(:)j(:)e(:)g(:)g | |
18855 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
18856 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 | |
45c0f7f8 | 18857 | b Fb(16)2025 2394 y Fr(I)2025 2518 y Fe(if)10 b Fc(:)k(:)f(:)g(:)g(:)g |
c302751c CR |
18858 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
18859 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
18860 | (:)g(:)g(:)g(:)g(:)37 b Fb(10)2025 2608 y Fe(in)10 b | |
18861 | Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
18862 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
220537f2 | 18863 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)37 b Fb(11)2025 |
c302751c CR |
18864 | 2860 y Fr(S)2025 2983 y Fe(select)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g |
18865 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
18866 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 | |
74d0116b | 18867 | b Fb(12)2025 3235 y Fr(T)2025 3358 y Fe(then)23 b Fc(:)13 |
c302751c CR |
18868 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18869 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
18870 | h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(10)2025 3449 y Fe(time)7 | |
18871 | b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
18872 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18873 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)34 b Fb(8)2025 | |
220537f2 | 18874 | 3701 y Fr(U)2025 3824 y Fe(until)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g |
c302751c | 18875 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
220537f2 CR |
18876 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 |
18877 | b Fb(10)2025 4076 y Fr(W)2025 4199 y Fe(while)21 b Fc(:)13 | |
18878 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
18879 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
18880 | g(:)g(:)h(:)f(:)g(:)46 b Fb(10)150 4431 y Fr(D.3)68 b(P)l(arameter)47 | |
18881 | b(and)d(V)-11 b(ariable)46 b(Index)150 4668 y(!)150 4794 | |
18882 | y Fe(!)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
18883 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
18884 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)39 | |
9f178efb | 18885 | b Fb(20)150 5054 y Fr(#)150 5180 y Fe(#)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g |
220537f2 CR |
18886 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18887 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
45c0f7f8 | 18888 | (:)h(:)f(:)g(:)g(:)39 b Fb(19)2025 4668 y Fr($)2025 4794 |
220537f2 CR |
18889 | y Fe($)13 b Fc(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
18890 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
18891 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)39 | |
9f178efb | 18892 | b Fb(20)2025 5067 y Fr(*)2025 5192 y Fe(*)13 b Fc(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18893 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18894 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
45c0f7f8 | 18895 | (:)g(:)g(:)g(:)h(:)f(:)39 b Fb(19)p eop end |
9f178efb CR |
18896 | %%Page: 165 171 |
18897 | TeXDict begin 165 170 bop 150 -116 a Ft(App)s(endix)29 | |
18898 | b(D:)i(Indexes)2623 b(165)150 299 y Fr(-)150 415 y Fe(-)13 | |
c302751c CR |
18899 | b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18900 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
45c0f7f8 | 18901 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)39 b Fb(19)150 |
c302751c CR |
18902 | 649 y Fr(?)150 765 y Fe(?)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18903 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
18904 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
45c0f7f8 | 18905 | (:)g(:)39 b Fb(19)150 999 y Fr(@)150 1115 y Fe(@)13 b |
c302751c CR |
18906 | Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18907 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
45c0f7f8 | 18908 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)39 b Fb(19)p |
c302751c CR |
18909 | 159 1349 41 6 v 150 1465 a Fe(_)13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
18910 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
18911 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
9f178efb | 18912 | (:)g(:)g(:)39 b Fb(20)150 1699 y Fr(0)150 1815 y Fe(0)13 |
c302751c CR |
18913 | b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18914 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
9f178efb CR |
18915 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)39 b Fb(20)150 |
18916 | 2049 y Fr(A)150 2166 y Fe(auto_resume)22 b Fc(:)13 b(:)g(:)g(:)g(:)g(:) | |
18917 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
18918 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)46 b Fb(100)150 | |
c302751c CR |
18919 | 2409 y Fr(B)150 2525 y Fe(BASH)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g |
18920 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
18921 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 18922 | b Fb(69)150 2612 y Fe(BASH_ALIASES)22 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g |
c302751c | 18923 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 18924 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 b Fb(70)150 2700 |
c302751c CR |
18925 | y Fe(BASH_ARGC)9 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
18926 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
9f178efb | 18927 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b Fb(70)150 2787 y |
c302751c CR |
18928 | Fe(BASH_ARGV)9 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
18929 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18930 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b Fb(70)150 2874 y Fe(BASH_CMDS)9 |
c302751c CR |
18931 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
18932 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 18933 | g(:)g(:)g(:)36 b Fb(70)150 2962 y Fe(BASH_COMMAND)22 |
c302751c CR |
18934 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
18935 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 | |
9f178efb | 18936 | b Fb(70)150 3049 y Fe(BASH_ENV)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c CR |
18937 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18938 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 b | |
9f178efb | 18939 | Fb(70)150 3137 y Fe(BASH_EXECUTION_STRING)13 b Fc(:)18 |
c302751c | 18940 | b(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 18941 | g(:)g(:)g(:)h(:)f(:)39 b Fb(70)150 3224 y Fe(BASH_LINENO)24 |
c302751c CR |
18942 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
18943 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18944 | 48 b Fb(71)150 3311 y Fe(BASH_REMATCH)22 b Fc(:)13 b(:)g(:)g(:)g(:)g(:) |
c302751c | 18945 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb | 18946 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 b Fb(71)150 |
c302751c CR |
18947 | 3399 y Fe(BASH_SOURCE)24 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18948 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
9f178efb | 18949 | (:)h(:)f(:)g(:)g(:)g(:)g(:)48 b Fb(71)150 3486 y Fe(BASH_SUBSHELL)16 |
c302751c CR |
18950 | b Fc(:)g(:)e(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
18951 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)43 | |
9f178efb | 18952 | b Fb(71)150 3573 y Fe(BASH_VERSINFO)16 b Fc(:)g(:)e(:)f(:)g(:)g(:)g(:)g |
c302751c | 18953 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 18954 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)43 b Fb(71)150 3661 y Fe(BASH_VERSION)22 |
c302751c CR |
18955 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
18956 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 | |
9f178efb | 18957 | b Fb(71)150 3748 y Fe(BASH_XTRACEFD)16 b Fc(:)g(:)e(:)f(:)g(:)g(:)g(:)g |
c302751c | 18958 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 18959 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)43 b Fb(71)150 3835 y Fe(BASHOPTS)12 |
8f714a7c | 18960 | b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
c302751c | 18961 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 18962 | (:)g(:)h(:)f(:)38 b Fb(70)150 3923 y Fe(BASHPID)15 b |
8f714a7c CR |
18963 | Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18964 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 18965 | f(:)g(:)g(:)g(:)41 b Fb(70)150 4010 y Fe(bell-style)24 |
74d0116b CR |
18966 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18967 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18968 | 49 b Fb(105)150 4098 y Fe(bind-tty-special-chars)8 b |
74d0116b | 18969 | Fc(:)18 b(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
9f178efb | 18970 | (:)h(:)f(:)g(:)g(:)35 b Fb(105)150 4350 y Fr(C)150 4466 |
74d0116b CR |
18971 | y Fe(CDPATH)17 b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18972 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18973 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)43 b Fb(69)150 4554 |
abe2eb5b | 18974 | y Fe(colored-stats)14 b Fc(:)i(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
8f714a7c | 18975 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
9f178efb | 18976 | g(:)g(:)41 b Fb(105)150 4641 y Fe(COLUMNS)15 b Fc(:)f(:)f(:)h(:)f(:)g |
abe2eb5b CR |
18977 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
18978 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 | |
9f178efb | 18979 | b Fb(72)150 4728 y Fe(comment-begin)14 b Fc(:)i(:)d(:)h(:)f(:)g(:)g(:)g |
abe2eb5b | 18980 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 18981 | g(:)h(:)f(:)g(:)g(:)g(:)41 b Fb(105)150 4816 y Fe(COMP_CWORD)7 |
abe2eb5b CR |
18982 | b Fc(:)15 b(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
18983 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 18984 | f(:)g(:)33 b Fb(72)150 4903 y Fe(COMP_KEY)12 b Fc(:)j(:)e(:)g(:)g(:)g |
abe2eb5b CR |
18985 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18986 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 | |
9f178efb | 18987 | b Fb(72)150 4991 y Fe(COMP_LINE)9 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
18988 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
18989 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b | |
9f178efb | 18990 | Fb(72)150 5078 y Fe(COMP_POINT)7 b Fc(:)15 b(:)e(:)h(:)f(:)g(:)g(:)g(:) |
8f714a7c | 18991 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
9f178efb | 18992 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)33 b Fb(72)150 |
abe2eb5b | 18993 | 5165 y Fe(COMP_TYPE)9 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
8f714a7c | 18994 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 18995 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b Fb(72)150 5253 |
8f714a7c CR |
18996 | y Fe(COMP_WORDBREAKS)11 b Fc(:)17 b(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
18997 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 18998 | g(:)g(:)38 b Fb(72)150 5340 y Fe(COMP_WORDS)7 b Fc(:)15 |
8f714a7c CR |
18999 | b(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
19000 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19001 | 33 b Fb(72)2025 299 y Fe(completion-display-width)26 |
abe2eb5b | 19002 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb | 19003 | (:)g(:)47 b Fb(105)2025 387 y Fe(completion-ignore-case)8 |
220537f2 | 19004 | b Fc(:)18 b(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19005 | (:)g(:)g(:)g(:)h(:)f(:)35 b Fb(105)2025 474 y Fe(completion-map-case)16 |
74d0116b | 19006 | b Fc(:)h(:)c(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19007 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)43 b Fb(105)2025 562 y Fe |
74d0116b | 19008 | (completion-prefix-display-leng)q(th)17 b Fc(:)i(:)13 |
9f178efb | 19009 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)44 b Fb(106)2025 649 y Fe |
74d0116b CR |
19010 | (completion-query-items)8 b Fc(:)18 b(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19011 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)35 b | |
9f178efb | 19012 | Fb(106)2025 737 y Fe(COMPREPLY)9 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:) |
74d0116b | 19013 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19014 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 b Fb(73)2025 |
abe2eb5b | 19015 | 825 y Fe(convert-meta)17 b Fc(:)e(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
74d0116b | 19016 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
9f178efb | 19017 | g(:)g(:)g(:)g(:)44 b Fb(106)2025 912 y Fe(COPROC)17 b |
74d0116b CR |
19018 | Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
19019 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 19020 | g(:)g(:)g(:)g(:)g(:)44 b Fb(73)2025 1147 y Fr(D)2025 |
abe2eb5b | 19021 | 1264 y Fe(DIRSTACK)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
74d0116b | 19022 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19023 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b Fb(73)2025 1352 |
74d0116b CR |
19024 | y Fe(disable-completion)22 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
19025 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)45 | |
9f178efb | 19026 | b Fb(106)2025 1606 y Fr(E)2025 1723 y Fe(editing-mode)17 |
220537f2 CR |
19027 | b Fc(:)e(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19028 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 | |
9f178efb | 19029 | b Fb(106)2025 1810 y Fe(EMACS)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:) |
74d0116b CR |
19030 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
19031 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 | |
9f178efb | 19032 | b Fb(73)2025 1898 y Fe(enable-keypad)14 b Fc(:)i(:)d(:)g(:)g(:)h(:)f(:) |
74d0116b | 19033 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19034 | (:)g(:)g(:)g(:)h(:)f(:)g(:)41 b Fb(106)2025 1985 y Fe(ENV)8 |
74d0116b CR |
19035 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19036 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19037 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(73)2025 |
abe2eb5b | 19038 | 2073 y Fe(EUID)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
74d0116b CR |
19039 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19040 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 19041 | b Fb(73)2025 2161 y Fe(expand-tilde)17 b Fc(:)e(:)f(:)f(:)g(:)g(:)g(:)g |
5cdaaf76 | 19042 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 19043 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 b Fb(106)2025 2415 y Fr(F)2025 |
abe2eb5b | 19044 | 2531 y Fe(FCEDIT)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
220537f2 | 19045 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19046 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 b Fb(73)2025 |
abe2eb5b | 19047 | 2619 y Fe(FIGNORE)15 b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
74d0116b | 19048 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
9f178efb | 19049 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)41 b Fb(73)2025 |
abe2eb5b | 19050 | 2707 y Fe(FUNCNAME)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
220537f2 | 19051 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19052 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b Fb(73)2025 2794 |
74d0116b CR |
19053 | y Fe(FUNCNEST)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19054 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19055 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b Fb(73)2025 3029 |
abe2eb5b | 19056 | y Fr(G)2025 3146 y Fe(GLOBIGNORE)7 b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g |
74d0116b | 19057 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19058 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(73)2025 |
abe2eb5b | 19059 | 3234 y Fe(GROUPS)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
74d0116b | 19060 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19061 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 b Fb(74)2025 |
abe2eb5b | 19062 | 3469 y Fr(H)2025 3586 y Fe(histchars)9 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g |
74d0116b CR |
19063 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19064 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 | |
9f178efb | 19065 | b Fb(74)2025 3674 y Fe(HISTCMD)15 b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c CR |
19066 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19067 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)41 | |
9f178efb | 19068 | b Fb(74)2025 3761 y Fe(HISTCONTROL)24 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g |
c302751c | 19069 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19070 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)48 b Fb(74)2025 |
abe2eb5b | 19071 | 3849 y Fe(HISTFILE)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
c302751c | 19072 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19073 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b Fb(74)2025 3936 |
c302751c CR |
19074 | y Fe(HISTFILESIZE)21 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
19075 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
9f178efb | 19076 | (:)g(:)g(:)g(:)h(:)45 b Fb(74)2025 4024 y Fe(HISTIGNORE)7 |
c302751c CR |
19077 | b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
19078 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19079 | g(:)h(:)33 b Fb(74)2025 4112 y Fe(history-preserve-point)8 |
220537f2 | 19080 | b Fc(:)18 b(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19081 | (:)g(:)g(:)g(:)h(:)f(:)35 b Fb(107)2025 4199 y Fe(history-size)17 |
220537f2 CR |
19082 | b Fc(:)e(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19083 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 | |
9f178efb | 19084 | b Fb(107)2025 4287 y Fe(HISTSIZE)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:) |
220537f2 CR |
19085 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
19086 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 | |
9f178efb | 19087 | b Fb(75)2025 4375 y Fe(HISTTIMEFORMAT)14 b Fc(:)i(:)d(:)g(:)g(:)g(:)h |
220537f2 | 19088 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19089 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)40 b Fb(75)2025 4462 y Fe(HOME)23 |
c302751c CR |
19090 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19091 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19092 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(69)2025 4550 |
220537f2 CR |
19093 | y Fe(horizontal-scroll-mode)8 b Fc(:)18 b(:)13 b(:)h(:)f(:)g(:)g(:)g(:) |
19094 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)35 | |
9f178efb | 19095 | b Fb(107)2025 4637 y Fe(HOSTFILE)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:) |
220537f2 CR |
19096 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
19097 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 | |
9f178efb | 19098 | b Fb(75)2025 4725 y Fe(HOSTNAME)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:)f |
c302751c CR |
19099 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19100 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b | |
9f178efb | 19101 | Fb(75)2025 4813 y Fe(HOSTTYPE)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)g(:)h(:)f |
c302751c CR |
19102 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19103 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b | |
9f178efb | 19104 | Fb(75)2025 5048 y Fr(I)2025 5165 y Fe(IFS)8 b Fc(:)13 |
c302751c CR |
19105 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19106 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 19107 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(69)2025 5252 |
c302751c CR |
19108 | y Fe(IGNOREEOF)9 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
19109 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
9f178efb | 19110 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 b Fb(75)2025 5340 y |
220537f2 CR |
19111 | Fe(input-meta)24 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19112 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
9f178efb CR |
19113 | (:)g(:)g(:)g(:)g(:)49 b Fb(107)p eop end |
19114 | %%Page: 166 172 | |
19115 | TeXDict begin 166 171 bop 150 -116 a Ft(166)2527 b(Bash)31 | |
abe2eb5b CR |
19116 | b(Reference)g(Man)m(ual)150 299 y Fe(INPUTRC)15 b Fc(:)f(:)f(:)h(:)f(:) |
19117 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
19118 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 | |
9f178efb | 19119 | b Fb(75)150 386 y Fe(isearch-terminators)16 b Fc(:)h(:)d(:)f(:)g(:)g(:) |
abe2eb5b | 19120 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19121 | (:)43 b Fb(107)150 619 y Fr(K)150 736 y Fe(keymap)15 |
abe2eb5b CR |
19122 | b Fc(:)f(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
19123 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
9f178efb | 19124 | (:)g(:)g(:)g(:)g(:)42 b Fb(107)150 988 y Fr(L)150 1104 |
abe2eb5b CR |
19125 | y Fe(LANG)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
19126 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
9f178efb | 19127 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 b Fb(75)150 |
abe2eb5b | 19128 | 1191 y Fe(LC_ALL)17 b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
5cdaaf76 | 19129 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19130 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)43 b Fb(75)150 |
abe2eb5b CR |
19131 | 1278 y Fe(LC_COLLATE)7 b Fc(:)15 b(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19132 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 19133 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)33 b Fb(76)150 1366 y |
abe2eb5b CR |
19134 | Fe(LC_CTYPE)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19135 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19136 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 b Fb(76)150 1453 y Fe(LC_MESSAGES)13 |
abe2eb5b CR |
19137 | b Fc(:)j(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19138 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)40 | |
9f178efb | 19139 | b Fb(7,)26 b(76)150 1540 y Fe(LC_NUMERIC)7 b Fc(:)15 |
abe2eb5b CR |
19140 | b(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
19141 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19142 | 33 b Fb(76)150 1627 y Fe(LINENO)17 b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h |
abe2eb5b CR |
19143 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
19144 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)43 | |
9f178efb | 19145 | b Fb(76)150 1715 y Fe(LINES)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c CR |
19146 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
19147 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)46 | |
9f178efb | 19148 | b Fb(76)150 1948 y Fr(M)150 2064 y Fe(MACHTYPE)12 b Fc(:)j(:)e(:)g(:)g |
c302751c CR |
19149 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19150 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 | |
9f178efb | 19151 | b Fb(76)150 2151 y Fe(MAIL)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
c302751c CR |
19152 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19153 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 19154 | b Fb(69)150 2239 y Fe(MAILCHECK)9 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
19155 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
19156 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b | |
9f178efb | 19157 | Fb(76)150 2326 y Fe(MAILPATH)12 b Fc(:)j(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:) |
c302751c | 19158 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19159 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 b Fb(69)150 |
abe2eb5b | 19160 | 2413 y Fe(MAPFILE)15 b Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
5cdaaf76 | 19161 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
9f178efb | 19162 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 b Fb(76)150 |
abe2eb5b | 19163 | 2501 y Fe(mark-modified-lines)16 b Fc(:)h(:)d(:)f(:)g(:)g(:)g(:)g(:)g |
220537f2 | 19164 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)43 |
9f178efb | 19165 | b Fb(108)150 2588 y Fe(mark-symlinked-directories)16 |
220537f2 | 19166 | b Fc(:)i(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19167 | 42 b Fb(108)150 2675 y Fe(match-hidden-files)23 b Fc(:)13 |
220537f2 | 19168 | b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
9f178efb | 19169 | (:)g(:)g(:)g(:)h(:)f(:)g(:)45 b Fb(108)150 2762 y Fe |
e05be32d | 19170 | (menu-complete-display-prefix)11 b Fc(:)19 b(:)13 b(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19171 | (:)h(:)f(:)g(:)g(:)g(:)g(:)37 b Fb(108)150 2850 y Fe(meta-flag)7 |
220537f2 CR |
19172 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
19173 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 19174 | g(:)g(:)34 b Fb(107)150 3102 y Fr(O)150 3218 y Fe(OLDPWD)17 |
220537f2 CR |
19175 | b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19176 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19177 | (:)g(:)g(:)g(:)g(:)h(:)43 b Fb(76)150 3305 y Fe(OPTARG)17 |
220537f2 CR |
19178 | b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19179 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19180 | (:)g(:)g(:)g(:)g(:)h(:)43 b Fb(69)150 3392 y Fe(OPTERR)17 |
220537f2 CR |
19181 | b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19182 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19183 | (:)g(:)g(:)g(:)g(:)h(:)43 b Fb(76)150 3480 y Fe(OPTIND)17 |
220537f2 CR |
19184 | b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19185 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19186 | (:)g(:)g(:)g(:)g(:)h(:)43 b Fb(69)150 3567 y Fe(OSTYPE)17 |
220537f2 CR |
19187 | b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19188 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19189 | (:)g(:)g(:)g(:)g(:)h(:)43 b Fb(76)150 3654 y Fe(output-meta)22 |
220537f2 CR |
19190 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19191 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)46 | |
9f178efb | 19192 | b Fb(108)150 3906 y Fr(P)150 4022 y Fe(page-completions)7 |
220537f2 | 19193 | b Fc(:)16 b(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19194 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(108)150 |
abe2eb5b | 19195 | 4110 y Fe(PATH)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
220537f2 CR |
19196 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19197 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 19198 | b Fb(69)2025 299 y Fe(PIPESTATUS)7 b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g |
e05be32d | 19199 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19200 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(76)2025 |
abe2eb5b | 19201 | 387 y Fe(POSIXLY_CORRECT)11 b Fc(:)17 b(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
220537f2 | 19202 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
9f178efb | 19203 | g(:)g(:)g(:)38 b Fb(76)2025 475 y Fe(PPID)23 b Fc(:)13 |
220537f2 CR |
19204 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19205 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19206 | h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(77)2025 563 y Fe(PROMPT_COMMAND)14 |
220537f2 CR |
19207 | b Fc(:)i(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19208 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)40 | |
9f178efb | 19209 | b Fb(77)2025 651 y Fe(PROMPT_DIRTRIM)14 b Fc(:)i(:)d(:)g(:)g(:)g(:)h(:) |
220537f2 | 19210 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
9f178efb | 19211 | (:)g(:)g(:)g(:)g(:)h(:)f(:)40 b Fb(77)2025 738 y Fe(PS1)8 |
220537f2 CR |
19212 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19213 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19214 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(69)2025 |
abe2eb5b | 19215 | 826 y Fe(PS2)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
220537f2 CR |
19216 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
19217 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 | |
9f178efb | 19218 | b Fb(69)2025 914 y Fe(PS3)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
c302751c CR |
19219 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19220 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 | |
9f178efb | 19221 | b Fb(77)2025 1002 y Fe(PS4)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
220537f2 CR |
19222 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
19223 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19224 | 34 b Fb(77)2025 1090 y Fe(PWD)8 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
abe2eb5b CR |
19225 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
19226 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
9f178efb | 19227 | (:)34 b Fb(77)2025 1327 y Fr(R)2025 1444 y Fe(RANDOM)17 |
220537f2 CR |
19228 | b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19229 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
9f178efb | 19230 | (:)g(:)g(:)g(:)g(:)g(:)44 b Fb(77)2025 1532 y Fe(READLINE_LINE)16 |
220537f2 CR |
19231 | b Fc(:)g(:)d(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19232 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)43 | |
9f178efb | 19233 | b Fb(77)2025 1620 y Fe(READLINE_POINT)14 b Fc(:)i(:)d(:)g(:)g(:)g(:)h |
220537f2 | 19234 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19235 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)40 b Fb(77)2025 1708 y Fe(REPLY)21 |
220537f2 CR |
19236 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19237 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19238 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b Fb(77)2025 1796 y Fe |
220537f2 CR |
19239 | (revert-all-at-newline)11 b Fc(:)18 b(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:) |
19240 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)38 | |
9f178efb | 19241 | b Fb(108)2025 2032 y Fr(S)2025 2150 y Fe(SECONDS)15 b |
220537f2 | 19242 | Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
e1e48bba | 19243 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 19244 | h(:)f(:)g(:)g(:)41 b Fb(77)2025 2238 y Fe(SHELL)21 b |
220537f2 CR |
19245 | Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19246 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19247 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b Fb(77)2025 2326 y Fe(SHELLOPTS)9 |
220537f2 CR |
19248 | b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19249 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 19250 | f(:)g(:)g(:)36 b Fb(77)2025 2413 y Fe(SHLVL)21 b Fc(:)13 |
e1e48bba CR |
19251 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19252 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
9f178efb | 19253 | g(:)g(:)h(:)f(:)g(:)46 b Fb(77)2025 2501 y Fe(show-all-if-ambiguous)11 |
5cdaaf76 | 19254 | b Fc(:)18 b(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19255 | (:)h(:)f(:)g(:)g(:)g(:)g(:)38 b Fb(108)2025 2589 y Fe |
220537f2 CR |
19256 | (show-all-if-unmodified)8 b Fc(:)18 b(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19257 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)35 b | |
9f178efb | 19258 | Fb(109)2025 2677 y Fe(skip-completed-text)16 b Fc(:)h(:)c(:)g(:)h(:)f |
220537f2 | 19259 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
9f178efb | 19260 | g(:)43 b Fb(109)2025 2933 y Fr(T)2025 3050 y Fe(TEXTDOMAIN)9 |
220537f2 CR |
19261 | b Fc(:)15 b(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19262 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
abe2eb5b | 19263 | h(:)f(:)g(:)36 b Fb(7)2025 3138 y Fe(TEXTDOMAINDIR)21 |
220537f2 CR |
19264 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19265 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)46 | |
abe2eb5b | 19266 | b Fb(7)2025 3226 y Fe(TIMEFORMAT)7 b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g |
220537f2 | 19267 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19268 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(78)2025 |
abe2eb5b | 19269 | 3314 y Fe(TMOUT)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
5cdaaf76 CR |
19270 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19271 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b | |
9f178efb | 19272 | Fb(78)2025 3402 y Fe(TMPDIR)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
5cdaaf76 | 19273 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
220537f2 | 19274 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 |
9f178efb | 19275 | b Fb(78)2025 3638 y Fr(U)2025 3756 y Fe(UID)8 b Fc(:)13 |
220537f2 CR |
19276 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19277 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
9f178efb | 19278 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(78)2025 3992 |
abe2eb5b | 19279 | y Fr(V)2025 4110 y Fe(visible-stats)14 b Fc(:)i(:)d(:)g(:)g(:)h(:)f(:)g |
220537f2 | 19280 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19281 | g(:)g(:)g(:)h(:)f(:)g(:)41 b Fb(109)150 4342 y Fr(D.4)68 |
abe2eb5b | 19282 | b(F)-11 b(unction)44 b(Index)150 4579 y(A)150 4697 y |
220537f2 CR |
19283 | Fe(abort)27 b(\(C-g\))9 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19284 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19285 | h(:)f(:)g(:)g(:)g(:)g(:)36 b Fb(122)150 4786 y Fe(accept-line)28 |
220537f2 | 19286 | b(\(Newline)g(or)e(Return\))e Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19287 | (:)g(:)50 b Fb(116)150 4874 y Fe(alias-expand-line)29 |
220537f2 | 19288 | b(\(\))21 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
9f178efb | 19289 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)47 b Fb(124)150 |
abe2eb5b | 19290 | 5133 y Fr(B)150 5251 y Fe(backward-char)29 b(\(C-b\))23 |
220537f2 | 19291 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19292 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)49 b Fb(115)150 5340 y |
220537f2 | 19293 | Fe(backward-delete-char)30 b(\(Rubout\))14 b Fc(:)h(:)f(:)f(:)g(:)g(:)g |
9f178efb | 19294 | (:)g(:)g(:)h(:)f(:)g(:)g(:)41 b Fb(117)2025 4579 y Fe |
e05be32d | 19295 | (backward-kill-line)29 b(\(C-x)e(Rubout\))16 b Fc(:)f(:)e(:)g(:)g(:)g |
9f178efb | 19296 | (:)g(:)h(:)f(:)g(:)g(:)43 b Fb(118)2025 4670 y Fe(backward-kill-word)29 |
18d2df91 | 19297 | b(\(M-DEL\))24 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb | 19298 | (:)g(:)g(:)g(:)49 b Fb(119)2025 4761 y Fe(backward-word)28 |
18d2df91 | 19299 | b(\(M-b\))c Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
9f178efb | 19300 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)50 b Fb(115)2025 |
abe2eb5b | 19301 | 4852 y Fe(beginning-of-history)30 b(\(M-<\))23 b Fc(:)13 |
18d2df91 | 19302 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)49 |
9f178efb | 19303 | b Fb(116)2025 4943 y Fe(beginning-of-line)29 b(\(C-a\))13 |
220537f2 | 19304 | b Fc(:)h(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19305 | g(:)g(:)g(:)40 b Fb(115)2025 5216 y Fr(C)2025 5340 y |
220537f2 | 19306 | Fe(call-last-kbd-macro)30 b(\(C-x)c(e\))9 b Fc(:)14 b(:)f(:)g(:)g(:)h |
9f178efb | 19307 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)36 b Fb(121)p |
abe2eb5b | 19308 | eop end |
9f178efb CR |
19309 | %%Page: 167 173 |
19310 | TeXDict begin 167 172 bop 150 -116 a Ft(App)s(endix)29 | |
19311 | b(D:)i(Indexes)2623 b(167)150 299 y Fe(capitalize-word)29 | |
abe2eb5b | 19312 | b(\(M-c\))18 b Fc(:)c(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19313 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)44 b Fb(118)150 387 |
abe2eb5b CR |
19314 | y Fe(character-search)29 b(\(C-]\))15 b Fc(:)g(:)e(:)g(:)g(:)g(:)g(:)g |
19315 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)42 | |
9f178efb CR |
19316 | b Fb(122)150 475 y Fe(character-search-backward)31 b(\(M-C-]\))23 |
19317 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)48 b Fb(122)150 | |
abe2eb5b CR |
19318 | 564 y Fe(clear-screen)28 b(\(C-l\))8 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:) |
19319 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19320 | (:)g(:)35 b Fb(115)150 652 y Fe(complete)27 b(\(TAB\))20 |
abe2eb5b CR |
19321 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
19322 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 | |
9f178efb | 19323 | b Fb(120)150 740 y Fe(complete-command)29 b(\(M-!\))15 |
abe2eb5b | 19324 | b Fc(:)g(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19325 | g(:)g(:)g(:)g(:)42 b Fb(121)150 828 y Fe(complete-filename)29 |
abe2eb5b | 19326 | b(\(M-/\))13 b Fc(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
9f178efb | 19327 | (:)g(:)g(:)g(:)g(:)h(:)f(:)39 b Fb(120)150 917 y Fe(complete-hostname) |
abe2eb5b | 19328 | 29 b(\(M-@\))13 b Fc(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
9f178efb | 19329 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)39 b Fb(121)150 1005 y Fe |
5cdaaf76 | 19330 | (complete-into-braces)30 b(\(M-{\))23 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19331 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(121)150 |
abe2eb5b | 19332 | 1093 y Fe(complete-username)29 b(\(M-~\))13 b Fc(:)h(:)f(:)h(:)f(:)g(:) |
220537f2 | 19333 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)39 |
9f178efb | 19334 | b Fb(121)150 1181 y Fe(complete-variable)29 b(\(M-$\))13 |
5cdaaf76 | 19335 | b Fc(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 19336 | g(:)h(:)f(:)39 b Fb(121)150 1270 y Fe(copy-backward-word)30 |
5cdaaf76 | 19337 | b(\(\))18 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19338 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)44 b Fb(119)150 1358 |
a8fd3f3e CR |
19339 | y Fe(copy-forward-word)29 b(\(\))21 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g |
19340 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)47 | |
9f178efb | 19341 | b Fb(119)150 1446 y Fe(copy-region-as-kill)30 b(\(\))15 |
a8fd3f3e | 19342 | b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19343 | g(:)g(:)g(:)g(:)42 b Fb(119)150 1703 y Fr(D)150 1821 |
5cdaaf76 CR |
19344 | y Fe(dabbrev-expand)29 b(\(\))11 b Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
19345 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19346 | g(:)38 b Fb(121)150 1909 y Fe(delete-char)28 b(\(C-d\))11 |
c302751c | 19347 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19348 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(117)150 |
abe2eb5b | 19349 | 1998 y Fe(delete-char-or-list)30 b(\(\))15 b Fc(:)f(:)f(:)g(:)g(:)g(:)g |
c302751c | 19350 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)42 |
9f178efb | 19351 | b Fb(120)150 2086 y Fe(delete-horizontal-space)31 b(\(\))22 |
c302751c | 19352 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19353 | 49 b Fb(119)150 2174 y Fe(digit-argument)29 b(\()p Fd(M-0)p |
c302751c | 19354 | Fe(,)e Fd(M-1)p Fe(,)f(...)g Fd(M--)p Fe(\))d Fc(:)13 |
9f178efb | 19355 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)49 b Fb(119)150 2262 y Fe |
c302751c | 19356 | (display-shell-version)30 b(\(C-x)d(C-v\))16 b Fc(:)e(:)f(:)g(:)g(:)h |
9f178efb | 19357 | (:)f(:)g(:)g(:)g(:)g(:)43 b Fb(123)150 2351 y Fe(do-uppercase-version) |
c302751c | 19358 | 30 b(\(M-a,)d(M-b,)f(M-)p Fd(x)9 b Fe(,)27 b(...\))325 |
abe2eb5b | 19359 | 2438 y Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
c302751c | 19360 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19361 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)48 b Fb(122)150 2526 |
c302751c CR |
19362 | y Fe(downcase-word)29 b(\(M-l\))23 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g |
19363 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)49 | |
9f178efb | 19364 | b Fb(118)150 2614 y Fe(dump-functions)29 b(\(\))11 b |
c302751c | 19365 | Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19366 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(123)150 |
abe2eb5b | 19367 | 2702 y Fe(dump-macros)28 b(\(\))19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c | 19368 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19369 | g(:)g(:)h(:)f(:)g(:)45 b Fb(123)150 2791 y Fe(dump-variables)29 |
c302751c CR |
19370 | b(\(\))11 b Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19371 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)38 | |
9f178efb CR |
19372 | b Fb(123)150 2879 y Fe(dynamic-complete-history)31 b(\(M-TAB\))7 |
19373 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(121)150 | |
abe2eb5b | 19374 | 3136 y Fr(E)150 3254 y Fe(edit-and-execute-command)e(\(C-xC-e\))23 |
9f178efb | 19375 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)48 b Fb(124)150 |
abe2eb5b | 19376 | 3342 y Fe(end-kbd-macro)29 b(\(C-x)d(\)\))7 b Fc(:)14 |
c302751c | 19377 | b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19378 | (:)g(:)h(:)f(:)g(:)34 b Fb(121)150 3431 y Fe(end-of-history)29 |
c302751c | 19379 | b(\(M->\))21 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19380 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)47 b Fb(116)150 |
abe2eb5b | 19381 | 3519 y Fe(end-of-line)28 b(\(C-e\))11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g |
c302751c | 19382 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19383 | g(:)g(:)38 b Fb(115)150 3607 y Fe(exchange-point-and-mark)31 |
c302751c | 19384 | b(\(C-x)26 b(C-x\))11 b Fc(:)j(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)38 |
9f178efb | 19385 | b Fb(122)150 3864 y Fr(F)150 3982 y Fe(forward-backward-delete-char)32 |
c302751c | 19386 | b(\(\))9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 |
9f178efb | 19387 | b Fb(117)150 4071 y Fe(forward-char)28 b(\(C-f\))8 b |
c302751c | 19388 | Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
9f178efb | 19389 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(115)150 |
abe2eb5b | 19390 | 4159 y Fe(forward-search-history)c(\(C-s\))17 b Fc(:)d(:)f(:)g(:)g(:)g |
9f178efb | 19391 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)44 b Fb(116)150 4247 |
c302751c CR |
19392 | y Fe(forward-word)28 b(\(M-f\))8 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:)f(:) |
19393 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
9f178efb | 19394 | (:)35 b Fb(115)150 4494 y Fr(G)150 4612 y Fe(glob-complete-word)30 |
c302751c | 19395 | b(\(M-g\))10 b Fc(:)k(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19396 | (:)f(:)g(:)g(:)g(:)g(:)37 b Fb(123)150 4700 y Fe(glob-expand-word)29 |
c302751c | 19397 | b(\(C-x)e(*\))17 b Fc(:)c(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb | 19398 | (:)g(:)g(:)g(:)g(:)g(:)g(:)44 b Fb(123)150 4788 y Fe |
c302751c | 19399 | (glob-list-expansions)30 b(\(C-x)d(g\))7 b Fc(:)13 b(:)g(:)g(:)g(:)g(:) |
9f178efb | 19400 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(123)150 5045 |
abe2eb5b | 19401 | y Fr(H)150 5163 y Fe(history-and-alias-expand-line)f(\(\))7 |
9f178efb | 19402 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(124)150 |
abe2eb5b | 19403 | 5252 y Fe(history-expand-line)d(\(M-^\))8 b Fc(:)14 b(:)f(:)g(:)g(:)g |
c302751c | 19404 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 |
9f178efb | 19405 | b Fb(123)150 5340 y Fe(history-search-backward)d(\(\))22 |
c302751c | 19406 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19407 | 49 b Fb(116)2025 299 y Fe(history-search-forward)30 b(\(\))8 |
abe2eb5b | 19408 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
9f178efb CR |
19409 | (:)h(:)34 b Fb(116)2025 387 y Fe(history-substr-search-backward)e(\(\)) |
19410 | 22 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)48 b Fb(117)2025 | |
abe2eb5b | 19411 | 474 y Fe(history-substr-search-forward)32 b(\(\))7 b |
9f178efb | 19412 | Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)34 b Fb(116)2025 |
abe2eb5b | 19413 | 729 y Fr(I)2025 846 y Fe(insert-comment)29 b(\(M-#\))21 |
74d0116b | 19414 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19415 | (:)g(:)g(:)g(:)h(:)f(:)g(:)47 b Fb(123)2025 934 y Fe |
74d0116b | 19416 | (insert-completions)29 b(\(M-*\))10 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19417 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)37 b Fb(120)2025 |
abe2eb5b | 19418 | 1022 y Fe(insert-last-argument)30 b(\(M-.)c(or)g(M-_\))18 |
9f178efb | 19419 | b Fc(:)c(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)45 b Fb(124)2025 |
abe2eb5b | 19420 | 1277 y Fr(K)2025 1394 y Fe(kill-line)27 b(\(C-k\))16 |
18d2df91 CR |
19421 | b Fc(:)f(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19422 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)43 b | |
9f178efb | 19423 | Fb(118)2025 1482 y Fe(kill-region)28 b(\(\))19 b Fc(:)13 |
5cdaaf76 | 19424 | b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19425 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)45 b Fb(119)2025 |
abe2eb5b | 19426 | 1569 y Fe(kill-whole-line)29 b(\(\))8 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g |
5cdaaf76 | 19427 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
9f178efb | 19428 | f(:)g(:)35 b Fb(118)2025 1657 y Fe(kill-word)27 b(\(M-d\))16 |
5cdaaf76 CR |
19429 | b Fc(:)f(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19430 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)43 b | |
9f178efb | 19431 | Fb(118)2025 1901 y Fr(M)2025 2019 y Fe(magic-space)28 |
5cdaaf76 CR |
19432 | b(\(\))19 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19433 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)45 | |
9f178efb | 19434 | b Fb(124)2025 2106 y Fe(menu-complete)28 b(\(\))13 b |
5cdaaf76 | 19435 | Fc(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19436 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)40 b Fb(120)2025 |
abe2eb5b | 19437 | 2194 y Fe(menu-complete-backward)30 b(\(\))8 b Fc(:)13 |
5cdaaf76 | 19438 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)34 |
9f178efb | 19439 | b Fb(120)2025 2449 y Fr(N)2025 2566 y Fe(next-history)28 |
c302751c CR |
19440 | b(\(C-n\))8 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19441 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 | |
9f178efb | 19442 | b Fb(116)2025 2654 y Fe(non-incremental-forward-search)q(-hist)q(ory)d |
abe2eb5b | 19443 | (\(M-n\))2200 2741 y Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
c302751c CR |
19444 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19445 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)49 b | |
9f178efb | 19446 | Fb(116)2025 2829 y Fe(non-incremental-reverse-search)q(-hist)q(ory)32 |
abe2eb5b | 19447 | b(\(M-p\))2200 2916 y Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
c302751c CR |
19448 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19449 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)49 b | |
9f178efb | 19450 | Fb(116)2025 3152 y Fr(O)2025 3269 y Fe(operate-and-get-next)30 |
c302751c | 19451 | b(\(C-o\))23 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19452 | g(:)g(:)g(:)49 b Fb(124)2025 3357 y Fe(overwrite-mode)29 |
c302751c CR |
19453 | b(\(\))11 b Fc(:)i(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19454 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)38 | |
9f178efb | 19455 | b Fb(118)2025 3601 y Fr(P)2025 3718 y Fe(possible-command-completions) |
c302751c | 19456 | 32 b(\(C-x)26 b(!\))21 b Fc(:)13 b(:)g(:)h(:)f(:)47 b |
9f178efb | 19457 | Fb(121)2025 3806 y Fe(possible-completions)30 b(\(M-?\))23 |
c302751c | 19458 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb CR |
19459 | 49 b Fb(120)2025 3894 y Fe(possible-filename-completions)32 |
19460 | b(\(C-x)26 b(/\))18 b Fc(:)c(:)f(:)g(:)45 b Fb(120)2025 | |
abe2eb5b | 19461 | 3982 y Fe(possible-hostname-completions)32 b(\(C-x)26 |
9f178efb | 19462 | b(@\))18 b Fc(:)c(:)f(:)g(:)45 b Fb(121)2025 4070 y Fe |
c302751c | 19463 | (possible-username-completions)32 b(\(C-x)26 b(~\))18 |
9f178efb | 19464 | b Fc(:)c(:)f(:)g(:)45 b Fb(121)2025 4157 y Fe |
c302751c | 19465 | (possible-variable-completions)32 b(\(C-x)26 b($\))18 |
9f178efb | 19466 | b Fc(:)c(:)f(:)g(:)45 b Fb(121)2025 4245 y Fe(prefix-meta)28 |
c302751c CR |
19467 | b(\(ESC\))11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19468 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)38 | |
9f178efb | 19469 | b Fb(122)2025 4333 y Fe(previous-history)29 b(\(C-p\))15 |
c302751c | 19470 | b Fc(:)f(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 19471 | h(:)f(:)g(:)g(:)42 b Fb(116)2025 4421 y Fe(print-last-kbd-macro)30 |
45c0f7f8 | 19472 | b(\(\))13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
9f178efb | 19473 | (:)g(:)g(:)g(:)g(:)g(:)40 b Fb(122)2025 4675 y Fr(Q)2025 |
abe2eb5b | 19474 | 4793 y Fe(quoted-insert)28 b(\(C-q)f(or)f(C-v\))19 b |
45c0f7f8 | 19475 | Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19476 | (:)46 b Fb(117)2025 5047 y Fr(R)2025 5164 y Fe(re-read-init-file)29 |
c302751c | 19477 | b(\(C-x)e(C-r\))9 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19478 | (:)g(:)h(:)f(:)g(:)36 b Fb(122)2025 5252 y Fe(redraw-current-line)30 |
c302751c | 19479 | b(\(\))15 b Fc(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19480 | (:)g(:)g(:)h(:)f(:)g(:)g(:)42 b Fb(115)2025 5340 y Fe |
c302751c | 19481 | (reverse-search-history)30 b(\(C-r\))17 b Fc(:)e(:)e(:)g(:)g(:)g(:)g(:) |
9f178efb CR |
19482 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)44 b Fb(116)p eop end |
19483 | %%Page: 168 174 | |
19484 | TeXDict begin 168 173 bop 150 -116 a Ft(168)2527 b(Bash)31 | |
abe2eb5b CR |
19485 | b(Reference)g(Man)m(ual)150 299 y Fe(revert-line)d(\(M-r\))11 |
19486 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19487 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(122)150 |
abe2eb5b CR |
19488 | 540 y Fr(S)150 656 y Fe(self-insert)28 b(\(a,)e(b,)g(A,)g(1,)h(!,)f |
19489 | (...\))7 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 | |
9f178efb | 19490 | b Fb(117)150 743 y Fe(set-mark)27 b(\(C-@\))20 b Fc(:)13 |
abe2eb5b | 19491 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19492 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 b Fb(122)150 |
abe2eb5b CR |
19493 | 830 y Fe(shell-backward-kill-word)31 b(\(\))20 b Fc(:)13 |
19494 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 | |
9f178efb | 19495 | b Fb(119)150 917 y Fe(shell-backward-word)30 b(\(\))15 |
5cdaaf76 | 19496 | b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19497 | g(:)g(:)g(:)g(:)42 b Fb(115)150 1005 y Fe(shell-expand-line)29 |
5cdaaf76 | 19498 | b(\(M-C-e\))8 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19499 | (:)g(:)g(:)h(:)f(:)g(:)34 b Fb(123)150 1092 y Fe(shell-forward-word)c |
5cdaaf76 | 19500 | (\(\))18 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
9f178efb | 19501 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)44 b Fb(115)150 1179 |
abe2eb5b CR |
19502 | y Fe(shell-kill-word)29 b(\(\))8 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:) |
19503 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
9f178efb | 19504 | (:)35 b Fb(119)150 1266 y Fe(skip-csi-sequence)29 b(\(\))21 |
5cdaaf76 | 19505 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19506 | (:)g(:)h(:)f(:)g(:)g(:)g(:)47 b Fb(122)150 1353 y Fe(start-kbd-macro)29 |
5cdaaf76 | 19507 | b(\(C-x)e(\(\))19 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
9f178efb | 19508 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)46 b Fb(121)150 1594 |
abe2eb5b | 19509 | y Fr(T)150 1710 y Fe(tilde-expand)28 b(\(M-&\))8 b Fc(:)15 |
5cdaaf76 | 19510 | b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
9f178efb | 19511 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(122)150 1798 y |
5cdaaf76 CR |
19512 | Fe(transpose-chars)29 b(\(C-t\))18 b Fc(:)c(:)f(:)g(:)g(:)h(:)f(:)g(:)g |
19513 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)44 | |
9f178efb | 19514 | b Fb(118)2025 299 y Fe(transpose-words)29 b(\(M-t\))18 |
abe2eb5b | 19515 | b Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19516 | g(:)g(:)g(:)g(:)g(:)45 b Fb(118)2025 566 y Fr(U)2025 |
abe2eb5b | 19517 | 688 y Fe(undo)26 b(\(C-_)h(or)f(C-x)g(C-u\))c Fc(:)13 |
5cdaaf76 | 19518 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19519 | (:)h(:)f(:)g(:)g(:)48 b Fb(122)2025 778 y Fe(universal-argument)29 |
5cdaaf76 | 19520 | b(\(\))18 b Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19521 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)45 b Fb(119)2025 868 y |
5cdaaf76 CR |
19522 | Fe(unix-filename-rubout)30 b(\(\))13 b Fc(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19523 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)40 | |
9f178efb | 19524 | b Fb(119)2025 958 y Fe(unix-line-discard)29 b(\(C-u\))13 |
5cdaaf76 | 19525 | b Fc(:)h(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19526 | g(:)g(:)g(:)40 b Fb(118)2025 1048 y Fe(unix-word-rubout)29 |
5cdaaf76 | 19527 | b(\(C-w\))15 b Fc(:)f(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
9f178efb | 19528 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)42 b Fb(119)2025 1138 |
abe2eb5b CR |
19529 | y Fe(upcase-word)28 b(\(M-u\))11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g |
19530 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
9f178efb | 19531 | g(:)38 b Fb(118)2025 1405 y Fr(Y)2025 1527 y Fe(yank)26 |
abe2eb5b CR |
19532 | b(\(C-y\))12 b Fc(:)i(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19533 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
9f178efb | 19534 | g(:)g(:)g(:)g(:)39 b Fb(119)2025 1617 y Fe(yank-last-arg)28 |
abe2eb5b | 19535 | b(\(M-.)f(or)f(M-_\))19 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb | 19536 | (:)g(:)g(:)g(:)g(:)g(:)g(:)46 b Fb(117)2025 1707 y Fe(yank-nth-arg)28 |
abe2eb5b | 19537 | b(\(M-C-y\))22 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19538 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)47 b Fb(117)2025 |
abe2eb5b CR |
19539 | 1798 y Fe(yank-pop)27 b(\(M-y\))20 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f |
19540 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
9f178efb | 19541 | g(:)g(:)g(:)g(:)h(:)45 b Fb(119)150 2030 y Fr(D.5)68 |
abe2eb5b CR |
19542 | b(Concept)45 b(Index)150 2290 y(A)150 2408 y Fb(alias)27 |
19543 | b(expansion)18 b Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19544 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19545 | h(:)44 b Fb(87)150 2496 y(arithmetic)26 b(ev)l(aluation)16 |
abe2eb5b | 19546 | b Fc(:)e(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19547 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)43 b Fb(86)150 2584 |
abe2eb5b CR |
19548 | y(arithmetic)26 b(expansion)d Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
19549 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 19550 | b Fb(28)150 2672 y(arithmetic,)27 b(shell)17 b Fc(:)d(:)f(:)g(:)g(:)g |
abe2eb5b | 19551 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
9f178efb | 19552 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)43 b Fb(86)150 2760 y(arra)n(ys)15 |
abe2eb5b CR |
19553 | b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19554 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
9f178efb | 19555 | (:)g(:)g(:)g(:)g(:)h(:)f(:)41 b Fb(88)150 3015 y Fr(B)150 |
abe2eb5b CR |
19556 | 3133 y Fb(bac)n(kground)9 b Fc(:)j(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
19557 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19558 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(97)150 3221 y(Bash)26 |
abe2eb5b CR |
19559 | b(con\014guration)d Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19560 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)49 | |
9f178efb | 19561 | b Fb(139)150 3309 y(Bash)26 b(installation)c Fc(:)13 |
c302751c | 19562 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19563 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)46 b Fb(139)150 |
abe2eb5b CR |
19564 | 3397 y(Bourne)26 b(shell)13 b Fc(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19565 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19566 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)40 b Fb(5)150 3486 | |
19567 | y(brace)26 b(expansion)20 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19568 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
9f178efb | 19569 | g(:)g(:)g(:)g(:)47 b Fb(21)150 3574 y(builtin)9 b Fc(:)k(:)g(:)g(:)g(:) |
abe2eb5b CR |
19570 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19571 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19572 | g(:)g(:)36 b Fb(3)150 3812 y Fr(C)150 3930 y Fb(command)26 | |
9f178efb CR |
19573 | b(editing)13 b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19574 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)40 | |
19575 | b Fb(102)150 4018 y(command)26 b(execution)d Fc(:)13 | |
19576 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19577 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)49 b Fb(35)150 4106 | |
19578 | y(command)26 b(expansion)16 b Fc(:)d(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19579 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)42 | |
19580 | b Fb(34)150 4194 y(command)26 b(history)12 b Fc(:)h(:)g(:)g(:)g(:)g(:)h | |
19581 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19582 | g(:)g(:)g(:)g(:)g(:)39 b Fb(133)150 4282 y(command)26 | |
19583 | b(searc)n(h)10 b Fc(:)j(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19584 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19585 | 36 b Fb(35)150 4370 y(command)26 b(substitution)15 b | |
19586 | Fc(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19587 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)41 b Fb(27)150 4458 y(command)26 | |
19588 | b(timing)7 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19589 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19590 | g(:)34 b Fb(8)150 4547 y(commands,)26 b(comp)r(ound)18 | |
19591 | b Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19592 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 b Fb(9)150 4635 | |
19593 | y(commands,)26 b(conditional)d Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19594 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)48 | |
19595 | b Fb(10)150 4723 y(commands,)26 b(grouping)9 b Fc(:)14 | |
19596 | b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19597 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(14)150 4811 | |
19598 | y(commands,)26 b(lists)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19599 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19600 | (:)g(:)h(:)f(:)g(:)g(:)33 b Fb(9)150 4899 y(commands,)26 | |
19601 | b(lo)r(oping)16 b Fc(:)f(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19602 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)42 | |
19603 | b Fb(10)150 4987 y(commands,)26 b(pip)r(elines)12 b Fc(:)i(:)f(:)g(:)g | |
c302751c | 19604 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb CR |
19605 | g(:)g(:)g(:)g(:)g(:)g(:)39 b Fb(8)150 5076 y(commands,)26 |
19606 | b(shell)15 b Fc(:)f(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19607 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19608 | 42 b Fb(8)150 5164 y(commands,)26 b(simple)17 b Fc(:)d(:)g(:)f(:)g(:)g | |
19609 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19610 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)44 b Fb(8)150 5252 y(commen)n(ts,)26 | |
19611 | b(shell)7 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19612 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19613 | h(:)f(:)34 b Fb(7)150 5340 y(completion)27 b(builtins)15 | |
19614 | b Fc(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19615 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)42 b Fb(126)2025 | |
19616 | 2290 y(con\014guration)15 b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19617 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19618 | g(:)g(:)h(:)f(:)g(:)42 b Fb(139)2025 2380 y(con)n(trol)26 | |
19619 | b(op)r(erator)20 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
220537f2 | 19620 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb CR |
19621 | (:)g(:)h(:)46 b Fb(3)2025 2470 y(copro)r(cess)12 b Fc(:)i(:)f(:)g(:)h |
19622 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19623 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)38 | |
19624 | b Fb(15)2025 2733 y Fr(D)2025 2854 y Fb(directory)26 | |
19625 | b(stac)n(k)c Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19626 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19627 | g(:)49 b Fb(89)2025 3118 y Fr(E)2025 3239 y Fb(editing)26 | |
19628 | b(command)g(lines)11 b Fc(:)i(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19629 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)38 | |
19630 | b Fb(102)2025 3329 y(en)n(vironmen)n(t)12 b Fc(:)g(:)h(:)g(:)h(:)f(:)g | |
19631 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
19632 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)39 b Fb(37)2025 | |
19633 | 3419 y(ev)l(aluation,)26 b(arithmetic)e Fc(:)13 b(:)g(:)g(:)g(:)g(:)g | |
c302751c | 19634 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb CR |
19635 | g(:)49 b Fb(86)2025 3509 y(ev)n(en)n(t)24 b(designators)14 |
19636 | b Fc(:)h(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19637 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)41 b | |
19638 | Fb(136)2025 3599 y(execution)25 b(en)n(vironmen)n(t)11 | |
19639 | b Fc(:)i(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19640 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)37 b Fb(36)2025 3688 | |
19641 | y(exit)25 b(status)18 b Fc(:)c(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19642 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19643 | h(:)f(:)g(:)g(:)g(:)45 b Fb(3,)26 b(37)2025 3778 y(expansion)20 | |
19644 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
c302751c | 19645 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb CR |
19646 | g(:)g(:)g(:)47 b Fb(20)2025 3868 y(expansion,)26 b(arithmetic)12 |
19647 | b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
19648 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)38 b Fb(28)2025 3958 | |
19649 | y(expansion,)26 b(brace)10 b Fc(:)j(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
19650 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19651 | h(:)f(:)g(:)36 b Fb(21)2025 4048 y(expansion,)26 b(\014lename)12 | |
19652 | b Fc(:)h(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19653 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)38 b Fb(29)2025 | |
19654 | 4138 y(expansion,)26 b(parameter)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19655 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19656 | (:)40 b Fb(22)2025 4228 y(expansion,)26 b(pathname)18 | |
19657 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19658 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)45 b Fb(29)2025 | |
19659 | 4317 y(expansion,)26 b(tilde)8 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19660 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19661 | g(:)g(:)g(:)h(:)f(:)g(:)34 b Fb(21)2025 4407 y(expressions,)27 | |
19662 | b(arithmetic)7 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19663 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)34 | |
19664 | b Fb(86)2025 4497 y(expressions,)27 b(conditional)11 | |
19665 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
19666 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)38 b Fb(84)2025 4760 y Fr(F)2025 | |
19667 | 4882 y Fb(\014eld)15 b Fc(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
c302751c | 19668 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
9f178efb CR |
19669 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)42 |
19670 | b Fb(3)2025 4972 y(\014lename)15 b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
c302751c | 19671 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb CR |
19672 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)42 |
19673 | b Fb(3)2025 5062 y(\014lename)26 b(expansion)c Fc(:)14 | |
19674 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
19675 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)49 b Fb(29)2025 | |
19676 | 5151 y(foreground)23 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19677 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19678 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)49 b Fb(97)2025 5241 y(functions,)26 | |
19679 | b(shell)21 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19680 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19681 | g(:)47 b Fb(16)p eop end | |
19682 | %%Page: 169 175 | |
19683 | TeXDict begin 169 174 bop 150 -116 a Ft(App)s(endix)29 | |
19684 | b(D:)i(Indexes)2623 b(169)150 299 y Fr(H)150 415 y Fb(history)26 | |
abe2eb5b CR |
19685 | b(builtins)14 b Fc(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19686 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 19687 | 40 b Fb(133)150 502 y(history)26 b(ev)n(en)n(ts)18 b |
abe2eb5b CR |
19688 | Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
19689 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)46 | |
9f178efb | 19690 | b Fb(136)150 589 y(history)26 b(expansion)8 b Fc(:)13 |
abe2eb5b | 19691 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
9f178efb | 19692 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)35 b Fb(135)150 |
abe2eb5b | 19693 | 676 y(history)26 b(list)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
74d0116b | 19694 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
9f178efb | 19695 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)47 b Fb(133)150 764 y(History)-6 |
abe2eb5b CR |
19696 | b(,)26 b(ho)n(w)g(to)f(use)13 b Fc(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19697 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb | 19698 | 39 b Fb(132)150 1013 y Fr(I)150 1129 y Fb(iden)n(ti\014er)22 |
abe2eb5b CR |
19699 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
19700 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19701 | g(:)g(:)g(:)g(:)g(:)50 b Fb(3)150 1216 y(initialization)28 | |
19702 | b(\014le,)e(readline)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
9f178efb | 19703 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(104)150 |
abe2eb5b CR |
19704 | 1304 y(installation)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19705 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
9f178efb CR |
19706 | f(:)g(:)g(:)g(:)g(:)g(:)40 b Fb(139)150 1391 y(in)n(teraction,)27 |
19707 | b(readline)18 b Fc(:)c(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
19708 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)45 | |
19709 | b Fb(101)150 1478 y(in)n(teractiv)n(e)26 b(shell)14 b | |
abe2eb5b | 19710 | Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb CR |
19711 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)41 b Fb(81,)26 |
19712 | b(82)150 1565 y(in)n(ternationalization)14 b Fc(:)h(:)f(:)f(:)g(:)g(:)g | |
abe2eb5b CR |
19713 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19714 | g(:)h(:)f(:)g(:)g(:)41 b Fb(7)150 1798 y Fr(J)150 1914 | |
19715 | y Fb(job)16 b Fc(:)e(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19716 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19717 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)43 | |
19718 | b Fb(3)150 2001 y(job)26 b(con)n(trol)13 b Fc(:)h(:)f(:)g(:)g(:)h(:)f | |
c302751c | 19719 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
abe2eb5b | 19720 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)40 b Fb(3,)26 |
9f178efb CR |
19721 | b(97)150 2251 y Fr(K)150 2367 y Fb(kill)g(ring)19 b Fc(:)13 |
19722 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
19723 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
19724 | f(:)g(:)45 b Fb(103)150 2454 y(killing)27 b(text)17 b | |
19725 | Fc(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
abe2eb5b | 19726 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
9f178efb | 19727 | 44 b Fb(103)150 2704 y Fr(L)150 2820 y Fb(lo)r(calization)14 |
abe2eb5b CR |
19728 | b Fc(:)i(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19729 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19730 | (:)f(:)g(:)41 b Fb(7)150 2907 y(login)27 b(shell)17 b | |
19731 | Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
5cdaaf76 | 19732 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
9f178efb | 19733 | g(:)g(:)44 b Fb(81)150 3156 y Fr(M)150 3272 y Fb(matc)n(hing,)26 |
abe2eb5b CR |
19734 | b(pattern)20 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
19735 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)47 | |
9f178efb | 19736 | b Fb(29)150 3360 y(metac)n(haracter)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)g |
abe2eb5b CR |
19737 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
19738 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)45 b Fb(3)150 3592 | |
19739 | y Fr(N)150 3708 y Fb(name)13 b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
19740 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
19741 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)40 | |
19742 | b Fb(3)150 3796 y(nativ)n(e)25 b(languages)13 b Fc(:)i(:)e(:)g(:)h(:)f | |
5cdaaf76 | 19743 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
abe2eb5b | 19744 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)40 b Fb(7)150 3883 |
9f178efb CR |
19745 | y(notation,)27 b(readline)7 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
19746 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
19747 | g(:)h(:)33 b Fb(102)150 4132 y Fr(O)150 4248 y Fb(op)r(erator,)27 | |
c302751c CR |
19748 | b(shell)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
19749 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
abe2eb5b | 19750 | g(:)g(:)43 b Fb(3)150 4498 y Fr(P)150 4614 y Fb(parameter)26 |
c302751c CR |
19751 | b(expansion)7 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
19752 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)34 | |
abe2eb5b | 19753 | b Fb(22)150 4701 y(parameters)17 b Fc(:)d(:)f(:)g(:)h(:)f(:)g(:)g(:)g |
c302751c | 19754 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
45c0f7f8 | 19755 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)43 b Fb(18)150 |
abe2eb5b | 19756 | 4788 y(parameters,)27 b(p)r(ositional)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g |
c302751c | 19757 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19758 | g(:)44 b Fb(19)150 4876 y(parameters,)27 b(sp)r(ecial)18 |
c302751c | 19759 | b Fc(:)c(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
45c0f7f8 | 19760 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)44 b Fb(19)150 |
abe2eb5b | 19761 | 4963 y(pathname)25 b(expansion)12 b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
c302751c | 19762 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
9f178efb | 19763 | g(:)38 b Fb(29)150 5050 y(pattern)25 b(matc)n(hing)14 |
c302751c CR |
19764 | b Fc(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19765 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)40 | |
9f178efb | 19766 | b Fb(29)2025 299 y(pip)r(eline)23 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g |
abe2eb5b CR |
19767 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
19768 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)50 | |
19769 | b Fb(8)2025 386 y(POSIX)17 b Fc(:)12 b(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
19770 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
19771 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)44 | |
19772 | b Fb(3)2025 474 y(POSIX)24 b(Mo)r(de)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)g(:) | |
18d2df91 | 19773 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
9f178efb | 19774 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)37 b Fb(92)2025 |
abe2eb5b | 19775 | 562 y(pro)r(cess)26 b(group)9 b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g |
74d0116b | 19776 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
abe2eb5b | 19777 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(3)2025 649 |
74d0116b CR |
19778 | y(pro)r(cess)26 b(group)g(ID)21 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19779 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
abe2eb5b | 19780 | f(:)g(:)g(:)g(:)g(:)49 b Fb(3)2025 737 y(pro)r(cess)26 |
74d0116b CR |
19781 | b(substitution)c Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
19782 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)48 | |
9f178efb | 19783 | b Fb(28)2025 824 y(programmable)27 b(completion)20 b |
74d0116b | 19784 | Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19785 | (:)g(:)h(:)f(:)46 b Fb(124)2025 912 y(prompting)11 b |
74d0116b CR |
19786 | Fc(:)i(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19787 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19788 | g(:)g(:)38 b Fb(91)2025 1163 y Fr(Q)2025 1280 y Fb(quoting)10 |
74d0116b CR |
19789 | b Fc(:)j(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
19790 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
abe2eb5b | 19791 | (:)g(:)g(:)g(:)h(:)f(:)g(:)37 b Fb(6)2025 1368 y(quoting,)26 |
74d0116b | 19792 | b(ANSI)13 b Fc(:)e(:)j(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
18d2df91 | 19793 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
abe2eb5b | 19794 | h(:)f(:)40 b Fb(6)2025 1619 y Fr(R)2025 1736 y Fb(Readline,)26 |
9f178efb CR |
19795 | b(ho)n(w)g(to)g(use)c Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19796 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)49 | |
19797 | b Fb(100)2025 1824 y(redirection)7 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g | |
74d0116b CR |
19798 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19799 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)33 b | |
9f178efb | 19800 | Fb(31)2025 1911 y(reserv)n(ed)25 b(w)n(ord)7 b Fc(:)14 |
74d0116b CR |
19801 | b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19802 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)34 | |
abe2eb5b | 19803 | b Fb(3)2025 1999 y(restricted)26 b(shell)8 b Fc(:)14 |
74d0116b CR |
19804 | b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19805 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)35 | |
9f178efb | 19806 | b Fb(92)2025 2086 y(return)25 b(status)c Fc(:)13 b(:)h(:)f(:)g(:)g(:)g |
74d0116b CR |
19807 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
19808 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)48 b Fb(4)2025 | |
abe2eb5b | 19809 | 2321 y Fr(S)2025 2438 y Fb(shell)26 b(arithmetic)11 b |
74d0116b CR |
19810 | Fc(:)j(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19811 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)37 | |
9f178efb | 19812 | b Fb(86)2025 2526 y(shell)26 b(function)12 b Fc(:)h(:)g(:)h(:)f(:)g(:)g |
74d0116b | 19813 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
45c0f7f8 | 19814 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)38 b Fb(16)2025 |
abe2eb5b | 19815 | 2613 y(shell)26 b(script)c Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
74d0116b | 19816 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
9f178efb | 19817 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)48 b Fb(38)2025 2701 |
74d0116b CR |
19818 | y(shell)26 b(v)l(ariable)18 b Fc(:)c(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
19819 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
abe2eb5b | 19820 | (:)h(:)f(:)g(:)g(:)g(:)g(:)45 b Fb(18)2025 2788 y(shell,)26 |
74d0116b CR |
19821 | b(in)n(teractiv)n(e)14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
19822 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
9f178efb | 19823 | g(:)h(:)40 b Fb(82)2025 2876 y(signal)7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h |
74d0116b CR |
19824 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19825 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
abe2eb5b | 19826 | (:)g(:)34 b Fb(4)2025 2964 y(signal)27 b(handling)17 |
74d0116b CR |
19827 | b Fc(:)c(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
19828 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)44 | |
9f178efb | 19829 | b Fb(38)2025 3051 y(sp)r(ecial)27 b(builtin)10 b Fc(:)j(:)g(:)g(:)g(:)g |
74d0116b | 19830 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
9f178efb | 19831 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(4,)26 b(67)2025 |
abe2eb5b | 19832 | 3139 y(startup)f(\014les)d Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
74d0116b | 19833 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
9f178efb | 19834 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)48 b Fb(81)2025 3226 y(susp)r(ending)25 |
74d0116b CR |
19835 | b(jobs)6 b Fc(:)14 b(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
19836 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
9f178efb | 19837 | (:)33 b Fb(97)2025 3478 y Fr(T)2025 3595 y Fb(tilde)26 |
74d0116b CR |
19838 | b(expansion)18 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
19839 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
abe2eb5b | 19840 | g(:)g(:)45 b Fb(21)2025 3682 y(tok)n(en)11 b Fc(:)h(:)i(:)f(:)g(:)g(:)g |
74d0116b | 19841 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
c302751c | 19842 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
abe2eb5b | 19843 | (:)g(:)38 b Fb(4)2025 3770 y(translation,)27 b(nativ)n(e)e(languages)13 |
c302751c | 19844 | b Fc(:)i(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
abe2eb5b | 19845 | g(:)g(:)g(:)40 b Fb(7)2025 4021 y Fr(V)2025 4138 y Fb(v)l(ariable,)26 |
c302751c CR |
19846 | b(shell)8 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
19847 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
abe2eb5b | 19848 | f(:)g(:)g(:)34 b Fb(18)2025 4226 y(v)l(ariables,)27 b(readline)18 |
74d0116b | 19849 | b Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
9f178efb | 19850 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)45 b Fb(105)2025 |
abe2eb5b | 19851 | 4477 y Fr(W)2025 4594 y Fb(w)n(ord)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h |
74d0116b CR |
19852 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
19853 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
abe2eb5b | 19854 | (:)g(:)48 b Fb(4)2025 4682 y(w)n(ord)26 b(splitting)21 |
74d0116b CR |
19855 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
19856 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)47 | |
9f178efb CR |
19857 | b Fb(28)2025 4933 y Fr(Y)2025 5050 y Fb(y)n(anking)25 |
19858 | b(text)7 b Fc(:)12 b(:)h(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
19859 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
19860 | (:)g(:)g(:)34 b Fb(103)p eop end | |
19861 | %%Page: 170 176 | |
19862 | TeXDict begin 170 175 bop eop end | |
5e13499c | 19863 | %%Trailer |
37c41ab1 | 19864 | |
5e13499c CR |
19865 | userdict /end-hook known{end-hook}if |
19866 | %%EOF |