]>
Commit | Line | Data |
---|---|---|
5e13499c CR |
1 | %!PS-Adobe-2.0 |
2 | %%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software | |
3 | %%Title: bashref.dvi | |
4 | %%Pages: 154 | |
5 | %%PageOrder: Ascend | |
6 | %%BoundingBox: 0 0 612 792 | |
7 | %%EndComments | |
8 | %DVIPSWebPage: (www.radicaleye.com) | |
9 | %DVIPSCommandLine: dvips -D 600 -t letter -o bashref.ps bashref.dvi | |
10 | %DVIPSParameters: dpi=600, compressed | |
11 | %DVIPSSource: TeX output 2003.12.31:1247 | |
12 | %%BeginProcSet: texc.pro | |
13 | %! | |
14 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
15 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
16 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
17 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
18 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
19 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
20 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
21 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
22 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
23 | N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin | |
24 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array | |
25 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 | |
26 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N | |
27 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
28 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
29 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
30 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
31 | 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 | |
32 | 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx | |
33 | 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx | |
34 | sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ | |
35 | rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp | |
36 | gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B | |
37 | /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ | |
38 | /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ | |
39 | A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy | |
40 | get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} | |
41 | ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp | |
42 | fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 | |
43 | {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add | |
44 | chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ | |
45 | 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} | |
46 | forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
47 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put | |
48 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
49 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
50 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
51 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
52 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
53 | 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 | |
54 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N | |
55 | /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ | |
56 | /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) | |
57 | (LaserWriter 16/600)]{A length product length le{A length product exch 0 | |
58 | exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse | |
59 | end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask | |
60 | grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} | |
61 | imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round | |
62 | exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto | |
63 | fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p | |
64 | delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} | |
65 | B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ | |
66 | p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S | |
67 | rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
68 | ||
69 | %%EndProcSet | |
70 | TeXDict begin 40258431 52099146 1000 600 600 (bashref.dvi) | |
71 | @start | |
72 | %DVIPSBitmapFont: Fa cmtt12 14.4 2 | |
73 | /Fa 2 126 df<EE1FFC923801FFFE150F153F5D92B5FC4A14FC4AEBF8004A138003FCC7 | |
74 | FC4A5A5DB3A9141F4A5A147F903803FFC0013F5B007FB5C8FCB55A5C14F014FC806C7FD8 | |
75 | 003F7F01037F9038007FE0143F6E7E140FB3A9816E7EEDFF806E13F86EEBFFFC6E14FE81 | |
76 | 81150F15019238001FFC2F5D79D23E>123 D<EA3FF048B47EB512F014FC80806C80D800 | |
77 | 1F7F01017FEB003F6E7E140FB3A9816E7E81913803FFC06E13FC6EEBFFFC6F13FE81150F | |
78 | 153F5D92B512FC4AEBFC004A13C04A48C7FC5D4A5A5DB3A9141F4A5AEB01FF011F5B007F | |
79 | B55AB6C8FC5C5C14F06C1380D83FF0C9FC2F5D79D23E>125 D E | |
80 | %EndDVIPSBitmapFont | |
81 | %DVIPSBitmapFont: Fb cmr9 9 54 | |
82 | /Fb 54 123 df<EC1FE0ECFFFC903803F01E90390FC00780EB1F8090393F000FC0017E13 | |
83 | 1F5BA2485AED0F8092C7FCA9ED0FC0B7FCA33901F8001F150FB3A6486CEB1FE0267FFFC1 | |
84 | B5FCA328357FB42B>12 D<123C127EB4FCA21380A2127F123D1201A412031300A25A1206 | |
85 | 120E120C121C5A5A126009177A8715>44 D<EB0FE0EB7FFCEBF83E3903E00F803907C007 | |
86 | C0EB8003000F14E0391F0001F0A24814F8A2003E1300007E14FCA500FE14FEB2007E14FC | |
87 | A56CEB01F8A36C14F0A2390F8003E03907C007C0A23903E00F803900F83E00EB7FFCEB0F | |
88 | E01F347DB126>48 D<13075B5B137FEA07FFB5FC13BFEAF83F1200B3B3A2497E007FB512 | |
89 | 80A319327AB126>I<EB3FC0EBFFF0000313FC380F80FF391E007F80001CEB3FC048EB1F | |
90 | E048130F15F00060130712FC6C14F87E1403A3007E1307123CC7FC15F0A2140F15E0EC1F | |
91 | C0A2EC3F801500147E5C495A5C495A495A495A49C7FC133E133C4913185B485A48481330 | |
92 | 485A48C7FC001C1470001FB512F05A5AB612E0A31D327CB126>I<EB1FE0EBFFFC4813FF | |
93 | 3907E03F80390F001FC0001EEB0FE0001CEB07F0123F018013F8140313C01380A2381F00 | |
94 | 07C7FC15F0A2EC0FE015C0141FEC3F80EC7E00EB01F8EB7FE014FCEB003FEC1FC0EC0FE0 | |
95 | EC07F015F8140315FC140115FEA3127EB4FCA415FC48130312780070EB07F86C14F0003C | |
96 | 130F001FEB1FE0390FE03F800003B51200C613FCEB1FE01F347DB126>I<EC01C0A21403 | |
97 | 1407A2140F141FA2143F147F146F14CF1301EB038F140F1307130E130C131C1338133013 | |
98 | 7013E013C0EA0180120313001206120E120C5A123812305A12E0B71280A3C7380FC000A9 | |
99 | 4A7E0107B51280A321337EB226>I<000C14C0380FC00F90B5128015005C5C14F014C0D8 | |
100 | 0C18C7FC90C8FCA9EB0FC0EB7FF8EBF07C380FC03F9038001F80EC0FC0120E000CEB07E0 | |
101 | A2C713F01403A215F8A41218127E12FEA315F0140712F8006014E01270EC0FC06C131F00 | |
102 | 3C14806CEB7F00380F80FE3807FFF8000113E038003F801D347CB126>I<14FE903807FF | |
103 | 80011F13E090383F00F0017C13703901F801F8EBF003EA03E01207EA0FC0EC01F04848C7 | |
104 | FCA248C8FCA35A127EEB07F0EB1FFC38FE381F9038700F809038E007C039FFC003E00180 | |
105 | 13F0EC01F8130015FC1400A24814FEA5127EA4127F6C14FCA26C1301018013F8000F14F0 | |
106 | EBC0030007EB07E03903E00FC03901F81F806CB51200EB3FFCEB0FE01F347DB126>I<12 | |
107 | 30123C003FB6FCA34814FEA215FC0070C7123800601430157015E04814C01401EC0380C7 | |
108 | EA07001406140E5C141814385CA25CA2495A1303A3495AA2130FA3131F91C7FCA25BA55B | |
109 | A9131C20347CB126>I<EB0FE0EB7FFC90B5FC3903F01F803907C007C0390F0003E0000E | |
110 | EB01F0001E1300001C14F8003C1478A3123EA2003F14F86D13F0EBC001D81FF013E09038 | |
111 | F803C0390FFE07803907FF0F006C13DE6C13F87EEB3FFE8001F713C0D803E313E0D80780 | |
112 | 13F0390F007FF8001E131F003EEB07FC003C1303481301EC007E12F848143EA2151EA37E | |
113 | 153C1278007C14787E6C14F0390F8003E03907F01FC00001B5120038007FFCEB1FE01F34 | |
114 | 7DB126>I<EB0FE0EB7FF8EBFFFE3803F83F3907E00F80390FC007C0D81F8013E0EC03F0 | |
115 | EA3F0048EB01F8127EA200FE14FC1400A415FEA5007E1301A2127F7E1403EA1F80000F13 | |
116 | 073807C00E3803E01C3801F03838007FF090381FC0FC90C7FC1401A215F8A215F0140300 | |
117 | 1F14E0383F800715C0140FEC1F809038003F00001C137E381F01FC380FFFF0000313C0C6 | |
118 | 90C7FC1F347DB126>I<15E0A34A7EA24A7EA34A7EA3EC0DFE140CA2EC187FA34A6C7EA2 | |
119 | 02707FEC601FA202E07FECC00FA2D901807F1507A249486C7EA301066D7EA2010E80010F | |
120 | B5FCA249800118C77EA24981163FA2496E7EA3496E7EA20001821607487ED81FF04A7ED8 | |
121 | FFFE49B512E0A333367DB53A>65 D<B7FC16E016F83A03FC0003FE0001EC00FFEE7F80EE | |
122 | 3FC0161F17E0160F17F0A617E0161F17C0EE3F80EE7F0016FEED03FC90B612F05E9039FC | |
123 | 0007FCED00FEEE3F80EE1FC0EE0FE017F0160717F8160317FCA617F81607A2EE0FF0EE1F | |
124 | E0163FEE7FC00003913803FF00B75A16F816C02E337DB236>I<B77E16F016FE3A01FE00 | |
125 | 01FF00009138003FC0EE0FE0707E707E707E707E177E177FEF3F80A2EF1FC0A3EF0FE0A4 | |
126 | 18F0AA18E0A3171F18C0A21880173F18005F17FE5F4C5AEE07F04C5AEE3FC000014AB45A | |
127 | B748C7FC16F8168034337EB23B>68 D<B81280A3D803FCC7FC0001151FEE07C01603A216 | |
128 | 01A21600A41760150CA31700A2151CA2153C15FC90B5FCA3EBFC00153C151CA2150CA592 | |
129 | C8FCAB487EB512FEA32B337DB232>70 D<DA03FE130C91393FFF801C91B512E0903A03FE | |
130 | 01F83C903A0FF0003C7CD91FC0EB0EFCD97F80130701FEC7120348481401000315005B48 | |
131 | 48157C485A173C485A171C123F5B007F160CA390C9FC4893C7FCAA0303B512E07E7F9239 | |
132 | 0003FE00705A123F7F121FA26C7E7F12076C7E7F6C6C14036C7E6D6C1307D91FC0EB0E7C | |
133 | D90FF0EB1C3CD903FEEBF81C0100B5EAF00C023F01C0C7FCDA03FEC8FC33377CB43C>I< | |
134 | B5D8FE03B512F8A3000190C73807FC006C486E5AB390B7FCA349C71203B3A3486C4A7EB5 | |
135 | D8FE03B512F8A335337EB23A>I<B512FEA3000113006C5AB3B3A7487EB512FEA317337E | |
136 | B21C>I<B512FEA3D803FEC9FC6C5AB3A9EE0180A416031700A45EA25E5E5E5E16FE0003 | |
137 | 1407B7FCA329337DB230>76 D<D8FFFC923801FFF86D5DA20003EFFE00D801BFED06FCA3 | |
138 | D99F80140CA2D98FC01418A3D987E01430A2D983F01460A3D981F814C0A3D980FCEB0180 | |
139 | A2027EEB0300A36E1306A26E6C5AA36E6C5AA36E6C5AA26E6C5AA36E6C5AA3913800FD80 | |
140 | A2037FC7FCA3486C133ED80FF04B7EB5011C90387FFFF8A33D337CB246>I<D8FFFE9138 | |
141 | 1FFFF87F80C6030013006E143CD9DFE01418EBCFF0A2EBC7F8EBC3FCA2EBC1FEEBC0FF6E | |
142 | 7EA26E7E6E7EA26E7E6E7E6E7EA26E7E6E7EA2ED7F80ED3FC0ED1FE0A2ED0FF0ED07F8A2 | |
143 | ED03FCED01FEED00FFA2EE7F98EE3FD8A2EE1FF8160F1607A216031601A2486C1400D807 | |
144 | F81578B500C01438A2171835337EB23A>I<EC07FC91387FFFC0903901FC07F0903907E0 | |
145 | 00FCD90F80133E013FC76C7E017E6E7E496E7E48486E7E48486E7EA248486E7E000F8249 | |
146 | 157E001F167FA24848ED3F80A2007F17C0A290C9121FA24817E0AB6C17C06D153FA3003F | |
147 | 17806D157FA2001F17006D5D000F5E6C6C4A5AA26C6C4A5A00015E6C6C4A5A017E4A5A6D | |
148 | 4A5AD91FC0017FC7FCD907E013FC903901FC07F09039007FFFC0DA07FCC8FC33377CB43C | |
149 | >I<B612FEEDFFC016F03A03FC0007FC0001EC00FE167FEE3F80EE1FC017E0160FA217F0 | |
150 | A617E0A2EE1FC0A2EE3F80EE7F0016FEED07F890B65A168001FCC9FCB3A2487EB512F8A3 | |
151 | 2C337DB234>I<B612FCEDFF8016F03A01FE0007FC0000EC01FEED007F707E707E83160F | |
152 | 83A65FA24C5AA24C5A047EC7FC4B5AED0FF090B612C093C8FC9039FE001FC0ED07F06F7E | |
153 | 6F7E150082167E167FA583A5180C17C0A2043F131C486C1618B500FEEB1FE0040F133893 | |
154 | 3807F070C93801FFE09338003F8036357EB239>82 D<90381FE00390387FFC0748B5FC39 | |
155 | 07F01FCF390F8003FF48C7FC003E80814880A200788000F880A46C80A27E92C7FC127F13 | |
156 | C0EA3FF013FF6C13F06C13FF6C14C06C14F0C680013F7F01037F9038003FFF1403020013 | |
157 | 80157F153FED1FC0150F12C0A21507A37EA26CEC0F80A26C15006C5C6C143E6C147E01C0 | |
158 | 5B39F1FC03F800E0B512E0011F138026C003FEC7FC22377CB42B>I<B500FE90381FFFF8 | |
159 | A3000190C813006C48153C1718B3AF1738017F1530A217706D6C1460011F15E06E495A01 | |
160 | 0F14036D6C495A6D6C49C7FCD901FC131E6DB413FC91383FFFF0020F13C0020190C8FC35 | |
161 | 357EB23A>85 D<267FFFFC90B512C0A3000101E090381FF80026007F80EB0FC0013F6E5A | |
162 | 6E91C7FC6D6C130E010F140C6E5B6D6C133801035C6E13606D6C13E06D6C485A5EDA7F83 | |
163 | C8FCEC3FC715C6EC1FECEC0FFC5D14076E7EA26E7E815C6F7E9138063FC0140E4A6C7E91 | |
164 | 38180FF0EC380702707F91386003FCECC0010101804A6C7E49C77E4981010E6E7E010C6E | |
165 | 7E131C496E7E01786E7E13FCD807FEEC1FFEB56C90B512F8A335337EB23A>88 | |
166 | D<EB7F803803FFF0380F80FC381C003E003F133F6D6C7E6E7EA26E7EEA1F00C7FCA4EB01 | |
167 | FF131FEBFF873803FC07EA0FF0EA1FC0EA3F80127F13004815C05AA3140FA26C131F6C13 | |
168 | 3B3A3F8071F180391FC1E1FF2607FFC013003900FE003C22237DA126>97 | |
169 | D<EA03F012FFA312071203AEEC3F80ECFFE09038F3C0F89038F7007E01FE7F49EB1F8049 | |
170 | EB0FC05BED07E016F0A2150316F8AA16F0150716E0A2ED0FC07F6DEB1F8001ECEB3F0001 | |
171 | CF137C90388381F8903801FFE0C76CC7FC25357EB32B>I<EB07F8EB3FFF9038FC07C039 | |
172 | 01F000E03903E003F03807C007120FEA1F80123F90380003E04890C7FCA2127E12FEAA12 | |
173 | 7FA26C14187F001F14386D1330000F14706C6C13E03903F001C03900FC0F8090383FFE00 | |
174 | EB07F01D237EA122>I<153FEC0FFFA3EC007F81AEEB07F0EB3FFCEBFC0F3901F003BF39 | |
175 | 07E001FF48487E48487F8148C7FCA25A127E12FEAA127E127FA27E6C6C5BA26C6C5B6C6C | |
176 | 4813803A03F007BFFC3900F81E3FEB3FFCD90FE0130026357DB32B>I<EB0FE0EB7FFCEB | |
177 | F83F3903F00F80D807E013C0390FC007E0381F800315F0EA3F0014014814F8127EA212FE | |
178 | A2B6FCA248C8FCA5127E127FA26C1418A26C6C1338000F14306D13706C6C13E03901F003 | |
179 | C03900FC0F00EB3FFEEB07F01D237EA122>I<EB01FCEB07FF90381F078090383E0FC0EB | |
180 | 7C1F13FCEA01F8A20003EB070049C7FCACB512F0A3D803F0C7FCB3A7487E387FFFE0A31A | |
181 | 357FB417>I<151F90391FC07F809039FFF8E3C03901F07FC73907E03F033A0FC01F8380 | |
182 | 9039800F8000001F80EB00074880A66C5CEB800F000F5CEBC01F6C6C48C7FCEBF07C380E | |
183 | FFF8380C1FC0001CC9FCA3121EA2121F380FFFFEECFFC06C14F06C14FC4880381F000100 | |
184 | 3EEB007F4880ED1F8048140FA56C141F007C15006C143E6C5C390FC001F83903F007E0C6 | |
185 | B51280D91FFCC7FC22337EA126>I<EA03F012FFA312071203AEEC1FC0EC7FF09038F1E0 | |
186 | FC9038F3807C9038F7007E13FE497FA25BA25BB3486CEB7F80B538C7FFFCA326347EB32B | |
187 | >I<EA0780EA0FC0EA1FE0A4EA0FC0EA0780C7FCAAEA07E012FFA3120F1207B3A6EA0FF0 | |
188 | B5FCA310337EB215>I<EB03C0EB07E0EB0FF0A4EB07E0EB03C090C7FCAAEB03F013FFA3 | |
189 | 13071303B3B01238127C00FE13E0130714C0130F007C138038381F00EA1FFCEA07F01443 | |
190 | 84B217>I<EA03F012FFA312071203AF913803FFE0A36E1300EC00F8EC01E05D4A5A020F | |
191 | C7FC141C5C5C14F0EBF3F8EBF7FC13FEEBFC7EEBF87F496C7E141F6E7E8114076E7E8114 | |
192 | 016E7E81486CEBFF80B500C313F0A324347EB329>I<EA07E012FFA3120F1207B3B3A7EA | |
193 | 0FF0B5FCA310347EB315>I<2703F01FE013FF00FF90267FF80313C0903BF1E07C0F03E0 | |
194 | 903BF3803E1C01F02807F7003F387FD803FE1470496D486C7EA2495CA2495CB3486C496C | |
195 | 487EB53BC7FFFE3FFFF0A33C217EA041>I<3903F01FC000FFEB7FF09038F1E0FC9038F3 | |
196 | 807C3907F7007EEA03FE497FA25BA25BB3486CEB7F80B538C7FFFCA326217EA02B>I<EB | |
197 | 07F0EB3FFE9038FC1F803901F007C03903C001E000078048486C7E48C7127CA248147E00 | |
198 | 3E143E007E143FA300FE1580A8007E1500A36C147EA26C147C6D13FC6C6C485A00075C39 | |
199 | 03F007E03900FC1F80D93FFEC7FCEB07F021237EA126>I<3903F03F8000FFEBFFE09038 | |
200 | F3C0F89038F7007ED807FE7F6C48EB1F804914C049130F16E0ED07F0A3ED03F8A9150716 | |
201 | F0A216E0150F16C06D131F6DEB3F80160001FF13FC9038F381F89038F1FFE0D9F07FC7FC | |
202 | 91C8FCAA487EB512C0A325307EA02B>I<903807F00390383FFC07EBFC0F3901F8038F38 | |
203 | 07E001000F14DF48486CB4FC497F123F90C77E5AA25A5AA9127FA36C6C5B121F6D5B000F | |
204 | 5B3907E003BF3903F0073F3800F81EEB3FF8EB0FE090C7FCAAED7F8091380FFFFCA32630 | |
205 | 7DA029>I<3803E07C38FFE1FF9038E38F809038E71FC0EA07EEEA03ECA29038FC0F8049 | |
206 | C7FCA35BB2487EB512E0A31A217FA01E>I<EBFF06000713CE381F00FE003C133E48131E | |
207 | 140E5A1406A27EA200FE90C7FC6C7EEA7FFC383FFFC014F0000F7F6C7FC67FEB0FFF1300 | |
208 | EC3F8000C0131F140F6C1307A37E15006C5B6C130E6C5B38F7807838E1FFE038C07F8019 | |
209 | 237EA11E>I<1330A51370A313F0A21201A212031207381FFFFEB5FCA23803F000AF1403 | |
210 | A814073801F806A23800FC0EEB7E1CEB1FF8EB07E0182F7FAD1E>I<D803F0133F00FFEB | |
211 | 0FFFA30007EB007F000380B35DA35D12016D4813800000903803BFFC90387E073FEB1FFE | |
212 | D907F8130026227EA02B>I<B5EBFFF0A3D80FF0EB3F800007EC1F000003140E150C6D13 | |
213 | 1C00011418A26C6C5BA26D1370017E1360137F6D5BA290381F8180A214C3010F90C7FCA2 | |
214 | EB07E6A214FE6D5AA26D5AA36D5AA2146024217E9F29>I<B53A1FFF81FFF0A33C07F801 | |
215 | FC003F8001F049EB1E0000030100141C816C6C017C1318A26D017E1338000002FE1330A2 | |
216 | 90267E01FF5B159F168090263F030F5BA216C0903A1F8607C180A202C613E390260FCC03 | |
217 | 90C7FCA2D907FC13F6ECF80116FE6D486C5AA36D481378A36D48133034217F9F37>I<B5 | |
218 | 3801FFF8A32603FE0013806C48EB7C0000001478017E1370017F5B90383F81C090381F83 | |
219 | 80D90FC3C7FCEB07E614FE6D5A6D5A6D7E80805B9038039F809038071FC09038060FE0EB | |
220 | 0C0790381C03F0496C7E01707FEBF000000180000FECFF8026FFFC0313FCA326207F9F29 | |
221 | >I<3A7FFF807FF8A33A07F8001FC00003EC0F800001EC070015066C6C5BA26D131C017E | |
222 | 1318A26D5BA2EC8070011F1360ECC0E0010F5BA2903807E180A214F3010390C7FC14FBEB | |
223 | 01FEA26D5AA31478A21430A25CA214E05CA2495A1278D8FC03C8FCA21306130EEA701CEA | |
224 | 7838EA1FF0EA0FC025307F9F29>I<003FB512F0A2EB000F003C14E00038EB1FC00030EB | |
225 | 3F800070137F1500006013FE495A13035CC6485A495AA2495A495A49C7FC153013FE485A | |
226 | 12035B48481370485A001F14604913E0485A387F000348130F90B5FCA21C207E9F22>I | |
227 | E | |
228 | %EndDVIPSBitmapFont | |
229 | %DVIPSBitmapFont: Fc cmti9 9 1 | |
230 | /Fc 1 47 df<121C127F12FFA412FE12380808778718>46 D E | |
231 | %EndDVIPSBitmapFont | |
232 | %DVIPSBitmapFont: Fd cmsltt10 9 18 | |
233 | /Fd 18 122 df<007FB512F0B612F815FCA215F86C14F01E06789927>45 | |
234 | D<147E903803FF804913C0011F13E04913F0EB7F879038FE01F8EBF800484813FC000314 | |
235 | 7C49137E4848133EA2485AA248C7FCA2123EA45AA500FC147C5AA215FC15F8A26CEB01F0 | |
236 | A2007C130315E01407007EEB0FC015806C131FEC3F00381F807EEBC1FC6CB45A6C5B6C5B | |
237 | 6C1380D8007EC7FC1F3079AE27>48 D<1438147C14FC14F8130113031307130F133F3803 | |
238 | FFF05A13FD13F913E3EA000314E0A41307A214C0A4130FA21480A4131FA21400A45BA213 | |
239 | 3EA3387FFFFEB6FCA36C13FE182F77AE27>I<D9FF80EB3FC0486DEB7FE016FFA26C4A13 | |
240 | C0D91EE0EBDE00013EEB03FE16BE013C14BCED073CA2150F90397CF00E7C151E0178EB1C | |
241 | 78153C15381578D9F87013F8EC78F001F05CEC79E0A215C00001EB7BC1EC3B81D9E03F5B | |
242 | 1501A2143E0003EB1C031400495CA400071407A2495CA3D87FF0EB7FF0A200FF14FFA26C | |
243 | 486D5A2B2E7FAD27>77 D<EB7FF83801FFFE00076D7E8148809038F01FF0EBE0036C486C | |
244 | 7EEA0180C8FC140114FF011F5B90B5FC1203120F481383387FF00301805BEAFE005A5A14 | |
245 | 07A24A5A6C133F38FF01FF90B6FC6C15807E000F01E313003803FE0021207A9F27>97 | |
246 | D<EB03FE90380FFF80013F13E090B512F04814F83903FE03FC3807F800EA0FE04848137E | |
247 | 5B48C7123EA2127E007FB512FEA4B612FC00FCC8FCA2127C127E1578007F14F8383F8001 | |
248 | EBC003391FF80FF06CB512E06C14C0000114806CEBFE00EB1FF01F207A9F27>101 | |
249 | D<EBFFC05AA37E1307130FA25CA4131FA2EC07F8EC1FFEEC7FFF91B512804914C0ECFC1F | |
250 | ECE00FECC0071480140049130F137E1680137CA301FC131FA2491400A400015CA249133E | |
251 | A33A7FFF87FFF0B500CF13F8A36C018713F0252E7FAD27>104 D<143814FE1301A46D5A | |
252 | 147891C7FCA73803FFF0487FA37EEA00015CA41303A25CA41307A25CA4130FA25CA3007F | |
253 | B512C0B612E0A315C01B2F79AE27>I<90B5FC5AA37EEB001F5CA2143EA4147EA2147CA4 | |
254 | 14FCA25CA41301A25CA41303A25CA41307A25CA3007FB512F8B612FCA36C14F81E2E7BAD | |
255 | 27>108 D<3A03F0FC07E03A07FBFE1FF090B5EA3FF8EDFFFCA2C690388FFC7C9039FE07 | |
256 | F03C01FC13E001F813C0A23A01F00F807CA2167801E01300A300034913F8A2D9C01E13F0 | |
257 | A40007EB3E01A2D9803C13E0A33A7FF0FF87FCD8FFF9EBCFFEA3D87FF1EB8FFC2720809F | |
258 | 27>I<3903FE07F83907FF1FFEEC7FFF91B5128016C039003FFC1FECE00FECC007148014 | |
259 | 0049130F137E1680137CA301FC131FA2491400A400015CA249133EA33A7FFF87FFF0B500 | |
260 | CF13F8A36C018713F025207F9F27>I<EB01FCEB0FFF013F13C090B512E04814F03903FC | |
261 | 0FF83807F003390FE000FC1380001F147C48C7127E003E143EA25AA400FC147CA215FC00 | |
262 | 7C14F81401007EEB03F0A26CEB0FE09038801FC0391FE07F8090B512006C5B6C13F80001 | |
263 | 5B38007F801F207A9F27>I<3A07FF803FC0489038C1FFF002C713F802CF13FC6C90B5FC | |
264 | D8000F13E3ED03F89138FC01F09138F800604A1300495A5CA25CA291C8FC5BA2133EA413 | |
265 | 7EA2137CA3B6FCA526207D9F27>114 D<903807FF1C013F13FE90B5FC5A1207EBFC0139 | |
266 | 0FE000FC49137C5BA2153801E01300EA07FEEBFFF8000113FF6C6C13C0010F13E0903800 | |
267 | 7FF0EC03F8001C1301003EEB00FC157C007E14FC127FEC01F8EB80039038E01FF090B5FC | |
268 | B612C0158000F8EBFE0038703FF01F207B9F27>I<131E133FA2133EA4137EA2007FB512 | |
269 | F0B612F8A36C14F0D800FCC7FC5BA41201A25BA41203A25BA2EC01E015F01403A2EC07E0 | |
270 | 140F9038F83FC090B5128015006C5B38007FF8EB1FC01D2979A827>I<397FC00FF839FF | |
271 | E01FFCA4000713004913F8A4000F1301A2018013F0A4001F1303A2010013E0A314075A14 | |
272 | 0F003EEB1FC0003F133FEB80FF90B512FE6C14FFA2000713EF0001EB07FE20207A9F27> | |
273 | I<3A03FFE07FF848ECFFFCA36C15F83A001F003E006D6C5A01075BECC1F0903803E3E05D | |
274 | 903801F7806DB4C7FC5C147C143C147C14FE1301EB03CF9038078F80EB0F07011E7FEB3E | |
275 | 03496C7E01F87F3801F0003A7FFC07FFC0486C4813E0A201FC14C0007F7F26207E9F27> | |
276 | 120 D<3A01FFE01FFF486D5AA39138E01FFE3A001E0003C0A2011FEB0780A26DEB0F00A2 | |
277 | 151E148001075BA25DA26E5A1303ECC1E0A2ECC3C0EB01E3ECE780A202EFC7FC130014FE | |
278 | A25CA2147814F85C13015C13035C130700085BEA7E0F49C8FCEAFE3EEAF8FEB45A5B6C5A | |
279 | EA3FC06CC9FC28317F9F27>I E | |
280 | %EndDVIPSBitmapFont | |
281 | %DVIPSBitmapFont: Fe cmtt9 9 81 | |
282 | /Fe 81 127 df<123C127E12FFAF127EAE123C1200A7123C127E12FFA4127E123C082F71 | |
283 | AE27>33 D<90383C03C090387E07E0A7EBFE0F01FC13C0A2007FB512FEB7FCA4003F14FE | |
284 | 3901F81F80AC003FB512FEB7FCA46C14FE3903F03F00A200075BEBE07EA73803C03C202E | |
285 | 7DAD27>35 D<EB0380497EA5EB1FF0EBFFFE0003EBFF804814C0001F14E09038E7DFF039 | |
286 | 3F87C7F8387E07C3007C13C100FCEBC0FC12F814C1A300FCEBC0F800FE1470007F140013 | |
287 | 87EA3FFF7E6C13F86C13FE6CEBFF80C614C0010F13E06D13F014CFECC3F814C10038EBC0 | |
288 | FC127C00FE147CA412FC00FE14F8007E13C1007FEBC3F0383F87C79038F7FFE06CB512C0 | |
289 | 6C1480000314006C13FC38003FE0EB07C0A56D5A1E3A7CB327>I<131FEB7FC0497E5A80 | |
290 | EA03F1EBE1F8EA07E013C0A513C15C9039C3F1FF80D9E3E113C03803E7E3EBEFC101FF14 | |
291 | 80913881F800EC01F0EA01FEEBFC0301F85B00031307D807FC5B120F381FFE0FD83FBE5B | |
292 | EB3F1FD87E1F90C7FC149F38FC0FBF14FE1307ECFC020103EB0F80EB01F8A238FE03FC38 | |
293 | 7E07FE397F1FFF9F6CB61200149F6CEB0FFE390FFC03FC3903F000F822307EAE27>38 | |
294 | D<120FEA1FC0123F13E0A213F0121F120F1201A4120313E01207EA0FC0A2EA3F80EA7F00 | |
295 | 5A5A12F812700C1773AD27>I<EB01C0EB03E0130F131FEB3FC0EB7F80EBFE00485A5B12 | |
296 | 03485A5B485AA2485AA248C7FCA3127EA45AAC127EA47EA36C7EA26C7EA26C7E7F6C7E12 | |
297 | 017F6C7EEB7F80EB3FC0EB1FE0130F1303EB01C0133A73B327>I<127012F812FE7E6C7E | |
298 | 6C7EEA0FE06C7E12037F6C7E1200137EA27FA2EB1F80A3EB0FC0A4EB07E0ACEB0FC0A4EB | |
299 | 1F80A3EB3F00A2137EA25B1201485A5B1207485AEA3FC0485A48C7FC5A12F81270133A7A | |
300 | B327>I<130F497EA60078EB81E000FEEB87F000FF138FEBDFBF6CB512E06C14C0000F14 | |
301 | 00000313FCC613F0A2000313FC000F13FF003F14C04814E039FFDFBFF0EB1F8F00FE1387 | |
302 | 0078EB81E00000EB8000A66DC7FC1C207BA627>I<120FEA3FC013E0EA7FF0A213F8A212 | |
303 | 3FA2120F120113F01203EA07E0121FEA7FC0EAFF8013005A12700D14738927>44 | |
304 | D<007FB512F8B612FCA46C14F81E067C9927>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E | |
305 | 000A0A728927>I<1538157C15FCA2140115F8140315F0140715E0140F15C0141F158014 | |
306 | 3F1500A25C147E14FE5C13015C13035C13075C130F5CA2131F5C133F91C7FC5B137E13FE | |
307 | 5B12015B12035BA212075B120F5B121F5B123F90C8FC5A127E12FE5AA25A12781E3A7CB3 | |
308 | 27>I<EB07E0EB3FFC497E90B5FC4814803903FC3FC03907F00FE0390FE007F0EBC00339 | |
309 | 1F8001F8A248C712FCA2003E147C007E147EA3007C143E00FC143FAC007E147EA46C14FC | |
310 | A2EB8001001F14F8EBC003000F14F0EBE0073907F00FE03903FC3FC06CB512806C14006D | |
311 | 5A6D5AEB07E020307DAE27>I<130E131FA25B5BA25B5A5A127FB5FCA213BFEA7E3F1200 | |
312 | B3AA003FB512805A15C01580A21A2F79AE27>I<EB3FE03801FFF84813FE000FEBFF8048 | |
313 | 14C0393FE07FE0EB800F397F0007F0007EEB03F800FE13015A6C14FC1400A3127CC8FCA2 | |
314 | 140115F8A2140315F01407EC0FE0EC1FC0143FEC7F80ECFF00495A495A495A495A495A49 | |
315 | 5A495A01FEC7FC485AD807F81378484813FC485A485A48B5FCB6FCA36C14F81E2F7CAE27 | |
316 | >I<EB1FF8EBFFFE0003EBFF80000F14C015E0391FF01FF0393FC007F8EB800115FC1400 | |
317 | A26CC7FC1204C8FC140115F81403EC07F0140FEC3FE090381FFFC0491380A215E06D13F0 | |
318 | 9038001FF8EC03FC1401EC00FE157E157F153FA21238127C12FEA2157F48147E6C14FE00 | |
319 | 7FEB01FCEB8003393FF01FF86CB512F06C14E000031480C6EBFE00EB1FF820307DAE27> | |
320 | I<EC3F804A7EA214FF5BA2EB03F7EB07E7A2EB0FC71487131FEB3F07A2137E13FCA2EA01 | |
321 | F813F01203EA07E0A2EA0FC0EA1F80A2EA3F00123E127E5AB7128016C0A36C1580C73807 | |
322 | C000A849B5FC491480A36D1400222F7EAE27>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E | |
323 | 00C7FCAC121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A20729F27>58 | |
324 | D<120FEA3FC0A2EA7FE0A4EA3FC0A2EA0F00C7FCAC120FEA3F8013C0127F13E0A3123FA2 | |
325 | 120F120713C0120FA2EA3F80EA7F005A5A12F812700B2A739F27>I<153815FC14011407 | |
326 | 140FEC3FF8EC7FE0ECFFC001031300495AEB1FF8495A495A3801FF804890C7FCEA0FFC48 | |
327 | 5AEA7FF0EAFFC05BA27FEA7FF0EA1FF86C7EEA03FF6C7F38007FE06D7E6D7EEB07FE6D7E | |
328 | 010013C0EC7FE0EC3FF8EC0FFC14071401140015381E287CAA27>I<127012FC7E6C7E7F | |
329 | EA7FF0EA1FF86C7EEA03FF6C7F38007FE06D7E6D7EEB07FE6D7E010013C0EC7FE0EC3FF8 | |
330 | EC0FFC1407A2140FEC3FF8EC7FE0ECFFC001031300495AEB1FF8495A495A3801FF804890 | |
331 | C7FCEA0FFC485AEA7FF0EAFFC05B48C8FC5A12701E287CAA27>62 | |
332 | D<EBFFF8000313FF000F14C0003F14E04814F09038C01FF839FF0003FC4813011400A214 | |
333 | 01007C1303C7EA0FF8EC1FF0EC7FE0ECFFC0491300EB03FC495A5C495A5C131F5CA76DC7 | |
334 | FC90C8FCA7130F497E497EA46D5A6DC7FC1E2E7CAD27>I<EB01FE903807FF80011F13C0 | |
335 | 017F13E090B512F048EB03F83803FC013907F000FC390FE01F7C9038C07FFE381F80FF13 | |
336 | 01485A393E07F1FF007E13E0397C0FC07FEC803FA2EAFC1F00F8EB001FA800FCEB803FD8 | |
337 | 7C0F133EA2ECC07E397E07E0FC003E13F1393F03FFF86C6C13F0018013E0390FC07FC090 | |
338 | 38E01F1E3907F0003FD803FC137F3901FF03FF6CEBFFFE6D13FC011F13F0010713C00101 | |
339 | 1300202E7DAD27>I<EB03F0497EA2497EA4143CEB1F3EA5EB3F3FA3EB3E1FA2017E7FA4 | |
340 | 496C7EA548486C7EA390B5FCA24880A3EBF003A248486C7EA4000F803A7FFC0FFF8000FF | |
341 | 15C06D5A497E007F1580222F7EAE27>I<007FB5FCB612C08115F87E3907E003FCEC00FE | |
342 | 157E157F81A6157EA25D1403EC0FF890B55A15C015F081819038E000FE157FED3F80151F | |
343 | A2ED0FC0A6151F1680153FED7F004A5A007FB55AB65A5D15E06C1480222E7FAD27>I<90 | |
344 | 3803F80E90381FFE1F90383FFFBF90B6FC5A3803FE0F3807F803497E48487E485A49137F | |
345 | A248C7123FA25A127E151E150012FE5AAA7E127EA2151E007F143F7EA26C7E157F6D137E | |
346 | 6C6C13FE3907F001FCEBF8033903FE0FF86CB512F06C14E0013F13C06D1300EB03F82030 | |
347 | 7DAE27>I<387FFFFC14FFB612C06C80813907E00FF81407EC01FC6E7EA2157E157F8116 | |
348 | 80151FA316C0150FABED1F80A3153F1600A25D15FEA24A5A4A5A140F007FB55A5DB65A6C | |
349 | 91C7FC14FC222E7FAD27>I<007FB61280B712C0A37E3907E0000FA6ED078092C7FCA4EC | |
350 | 07804A7EA390B5FCA5EBE00FA36E5A91C8FCA4ED03C0ED07E0A7007FB6FCB7FCA36C15C0 | |
351 | 232E7FAD27>I<007FB61280B712C0A37E3907E0000FA6ED078092C7FCA4EC07804A7EA3 | |
352 | 90B5FCA5EBE00FA36E5A91C8FCAC387FFF80B57EA36C5B222E7EAD27>I<903807F03890 | |
353 | 381FFC7C90387FFFFC90B5FC5A3803FC1F3807F00F380FE007EBC003001F13011380123F | |
354 | 90C7FCA2127EA2157892C7FC5AA8EC1FFF4A1380A3007E6D1300EC00FCA36C1301A21380 | |
355 | 121FEBC003120FEBE0073807F00F3803FC1F6CB5FC7EEB7FFE90381FFC78D907F0C7FC21 | |
356 | 307DAE27>I<3A7FFE07FFE0B54813F0A36C486C13E03A07E0007E00AF90B512FEA59038 | |
357 | E0007EB03A7FFE07FFE0B54813F0A36C486C13E0242E7FAD27>I<007FB512E0B612F0A3 | |
358 | 6C14E039001F8000B3B2007FB512E0B612F0A36C14E01C2E7BAD27>I<3A7FFC07FF8016 | |
359 | C0486C5A6C487E16803A07C001F80014035D4A5A4A5A141F5D4AC7FC147E14FE5CEBC1F8 | |
360 | EBC3F013C75CEBCFF0EBDFF813FF8013FEEBFC7E143EEBF83F497E01E07F140F01C07F14 | |
361 | 07811403816E7EA26E7E157C157E3A7FFC01FFC016E0486C5A6C487E16C0232E7FAD27> | |
362 | 75 D<387FFFC080B5FC7E5CD803F0C8FCB3AAED0780ED0FC0A7007FB6FCA2B7FC7E1680 | |
363 | 222E7FAD27>I<D87FE0EB7FE0486CEBFFF0A26D5A007F15E0000F150001B813DFEBBC03 | |
364 | A3EBBE07019E139FA3EB9F0FA2018F131FA2149FA2EB879EA4EB839C14FCA3EB81F8A2EB | |
365 | 80F01400AAD87FF0EBFFE0486C4813F0A36C486C13E0242E7FAD27>I<3A7FF003FFE048 | |
366 | 6C4813F0A213FC007F6D13E000079038003E0013DEA313CFA3148013C714C0A213C314E0 | |
367 | A213C114F0A3EBC0F8A31478147CA2143C143EA2141E141F140FA3EC07BEA3EC03FEEA7F | |
368 | FCEAFFFE1401A26C486C5A242E7FAD27>I<EBFFFC0007EBFF80001F14E0A24814F0EBC0 | |
369 | 0F397F8007F8EB0003007E1301A348EB00FCB3A76C1301007E14F8A3007F1303EB800739 | |
370 | 3FE01FF090B5FC6C14E0A200071480C6EBFC001E307CAE27>I<007FB5FCB612E081816C | |
371 | 803907E003FEEC00FF81ED3F80151F16C0150FA6151F1680153FED7F005DEC03FE90B55A | |
372 | 5D5D5D92C7FC01E0C8FCADEA7FFEB5FCA36C5A222E7FAD27>I<387FFFF0B512FE6E7E81 | |
373 | 6C803907E01FF014076E7E1401811400A514015D14034A5A141F90B55A5D5DA281EBE01F | |
374 | 6E7E14076E7EA816F0EDF1F8A4397FFE01FBB5EBFFF08016E06C48EB7FC0C8EA1F00252F | |
375 | 7FAD27>82 D<90387FC0E03901FFF1F0000713FF5A5AEA3FE0EB801F387F000F007E1307 | |
376 | 12FE5A1403A3EC01E06C90C7FC127E127FEA3FC013F86CB47E6C13F86C13FE6CEBFF80C6 | |
377 | 14C0010F13E0010013F0140FEC07F81403140115FC1400127812FCA46CEB01F8A26C1303 | |
378 | 90388007F09038F01FE090B5FC15C0150000F85B38701FF81E307CAE27>I<007FB61280 | |
379 | B712C0A439FC03F00FA60078EC0780000091C7FCB3AB90B512C04880A36C5C222E7EAD27 | |
380 | >I<3A7FFE01FFF8B54813FCA36C486C13F83A07E0001F80B3AB6D133F00031500A26D5B | |
381 | 0001147E6D13FE6C6C485A90387F87F814FF6D5B010F13C06D5BD901FEC7FC262F80AD27 | |
382 | >I<3A7FFC03FFE06D5A00FF15F0007F15E0497E3A07E0007E00A46C6C5BA4EBF8010001 | |
383 | 5CA46C6C485AA490387E07E0A56D485AA4011F5B149FA3010F90C7FCA5EB07FEA46D5AA2 | |
384 | 6D5A242F7FAD27>I<D87FE0EB7FE0486CEBFFF0A36C48EB7FE0001FC7EA0F80A76C6CEB | |
385 | 1F00A614F0EB81F83907C3FC3EA4149CEBC79EA30003143CA301E7137CEBEF9FA2140FA2 | |
386 | 00011478A49038FE07F8A300005CA2EBFC0390387801E0242F7FAD27>I<393FFC1FFE38 | |
387 | 7FFE3F815D383FFC1F3903F00FE001F85B1201EBFC1F00005CEBFE3F017E90C7FCEB7F7F | |
388 | EB3F7E14FE6D5AA26D5AA26D5AA21303130780130F80131F80EB3F7E147F497E017E7F14 | |
389 | 1F01FC7F140FD801F87F14071203496C7E120701E07F3A7FFC0FFF8000FF15C06D5A497E | |
390 | 007F1580222E7EAD27>I<3A7FFC03FFE06D5A00FF15F0007F15E0497E3A07F000FE0000 | |
391 | 035CEBF80100015CA2EBFC0300005CEBFE07017E5BA26D485AA290381F9F80A3010F90C7 | |
392 | FCA2EB07FEA26D5AA26D5AAF90381FFF80497FA36D5B242E7FAD27>I<003FB512FE4814 | |
393 | FFA4007EC712FEEC01FCA2EC03F8EC07F0A2003CEB0FE0C7EA1FC0A2EC3F80EC7F00A214 | |
394 | FE5C1301495A5C1307495A5C131F495A91C7FC5B13FEA2485A4848131E153F485A485AA2 | |
395 | 485A485AA248C7FCB7FCA46C14FE202E7DAD27>I<387FFFF0B512F8A314F000FCC7FCB3 | |
396 | B3ACB512F014F8A36C13F0153A71B327>I<387FFFF0B512F8A37EEA0001B3B3ACEA7FFF | |
397 | B5FCA36C13F0153A7EB327>93 D<131C137E3801FF80000713E0001F13F84813FC38FFE7 | |
398 | FF13C3130000FC133F0078131E180B79AD27>I<007FB512F8B612FCA46C14F81E067C7E | |
399 | 27>I<13E0EA01F01207120F13E0EA1FC0EA3F00A2127E127C12FC5AA4B4FC138013C012 | |
400 | 7FA2123F1380EA0F000C1773B227>I<3803FFC0000F13F04813FC4813FF811380EC1FC0 | |
401 | 381F000F000480C71207A2EB0FFF137F0003B5FC120F5A383FFC07EA7FC0130012FE5AA4 | |
402 | 6C130F007F131FEBC0FF6CB612806C15C07E000313F1C69038807F8022207C9F27>I<EA | |
403 | 7FE0487EA3127F1203A914FF01F313C090B512F08181EC81FE49C67E49EB3F8049131F16 | |
404 | C049130FA216E01507A6150F16C07F151F6DEB3F80157F6DEBFF009038FF83FEECFFFC5D | |
405 | 5D01F313C02601E0FEC7FC232E7FAD27>I<EB0FFF017F13C048B512E04814F05A380FF8 | |
406 | 07EA1FE0393FC003E0903880008048C8FC127EA212FE5AA67E127EA2007F14F0393F8001 | |
407 | F813C0381FE003390FF80FF06CB5FC6C14E06C14C06C6C1300EB0FF81D207B9F27>I<EC | |
408 | 3FF04A7EA3143F1401A9EB0FE1EB7FFD48B5FC5A5A380FF83F381FE00F383FC007EB8003 | |
409 | EA7F00007E1301A212FE5AA67E007E1303A2127F6C1307EB800F381FE01F380FF03F6CB6 | |
410 | 12C06C15E06C13FD38007FF9D91FE013C0232E7EAD27>I<EB0FF8EB3FFE90B512800003 | |
411 | 14C04814E0390FFC0FF0391FE003F8EBC001D83F8013FC48C7FC127E157E12FEB612FEA4 | |
412 | 15FC00FCC8FC7E127E127F6C143C6D137E6C7E01F013FE390FFC07FC6CB5FC000114F86C | |
413 | 14F0013F13C0903807FE001F207D9F27>I<EC1FF0ECFFF84913FC4913FE5BEB0FF014C0 | |
414 | 011F137CEC8000A6007FB512F0B612F8A36C14F039001F8000B3A4003FB512C04814E0A3 | |
415 | 6C14C01F2E7EAD27>I<153F90391FC0FF80D97FF313C048B612E05A4814EF390FF07F87 | |
416 | 3A1FC01FC3C0EDC000EB800F48486C7EA66C6C485AEBC01FA2390FF07F8090B5C7FC5C48 | |
417 | 5BEB7FF0EB1FC090C9FCA27F6CB5FC15E015F84814FE4880EB8001007EC7EA3F80007C14 | |
418 | 0F00FC15C0481407A46C140F007C1580007F143F6C6CEB7F009038F807FF6CB55A000714 | |
419 | F86C5CC614C0D90FFCC7FC23337EA027>I<EA7FE0487EA3127F1203A9147F9038F1FFC0 | |
420 | 01F713F090B5FC8114C1EC01FCEBFE005B5BA25BB03A7FFF83FFE0B500C713F0A36C0183 | |
421 | 13E0242E7FAD27>I<130F497E497EA46D5A6DC7FC90C8FCA7383FFF80487FA37EEA000F | |
422 | B3A4007FB512F0B6FC15F815F07E1D2F7BAE27>I<143C147E14FFA4147E143C1400A738 | |
423 | 01FFFE4813FFA37EC7123FB3B0147E1238007C13FE38FE01FC1303B512F814F06C13E06C | |
424 | 13803807FE0018407CAE27>I<EA7FE07F12FF127FA21201A991383FFFC04A13E0A36E13 | |
425 | C0913803F8004A5A4A5A4A5A4A5A02FFC7FCEBF1FEEBF3FCEBF7F8EBFFFC8080143F496C | |
426 | 7E496C7E01F87FEBF0076E7E6E7E816E7E157E3A7FFFC1FFF002C313F8B512E36C13C316 | |
427 | F0252E80AD27>I<387FFF80B57EA37EEA000FB3B2007FB512F8B612FCA36C14F81E2E7C | |
428 | AD27>I<397F07C01F3AFF9FF07FC09039FFF9FFE091B57E7E3A0FFC7FF1F89038F03FC0 | |
429 | 01E0138001C01300A3EB803EB03A7FF0FFC3FF486C01E3138001F913E701F813E36C4801 | |
430 | C313002920819F27>I<387FE07F39FFF1FFC001F713F090B5FC6C80000313C1EC01FCEB | |
431 | FE005B5BA25BB03A7FFF83FFE0B500C713F0A36C018313E024207F9F27>I<EB1FE0EB7F | |
432 | F83801FFFE487F481480390FF03FC0391FC00FE0393F8007F0EB00034814F8007E1301A2 | |
433 | 48EB00FCA76C1301007E14F8A2007F1303393F8007F0A2391FE01FE0390FF03FC06CB512 | |
434 | 806C14006C5B38007FF8EB1FE01E207C9F27>I<387FE0FFD8FFF313C090B512F0816C80 | |
435 | 0003EB81FE49C67E49EB3F8049131F16C049130FA216E01507A6150F16C07F151F6DEB3F | |
436 | 80157F6DEBFF009038FF83FEECFFFC5D5D01F313C0D9F0FEC7FC91C8FCAC387FFF80B57E | |
437 | A36C5B23317F9F27>I<90380FF03C90383FFE7E90B5FC000314FE5A380FFC1F381FE007 | |
438 | EBC003383F800148C7FC127EA200FE147E5AA67E007E14FEA2007F1301EA3F80EBC00338 | |
439 | 1FE007380FF81F6CB5FC7E6C147E38007FFCEB0FF090C7FCAC91381FFFF8A24A13FC6E13 | |
440 | F8A226317E9F27>I<397FFC03FC39FFFE0FFF023F13804A13C0007F90B5FC39007FFE1F | |
441 | 14F89138F00F809138E002004AC7FC5CA291C8FCA2137EAD007FB57EB67EA36C5C22207E | |
442 | 9F27>I<9038FFF3800007EBFFC0121F5A5AEB803F38FC000F5AA2EC07806C90C7FCEA7F | |
443 | 8013FC383FFFF06C13FC000713FF00011480D8000F13C09038003FE014070078EB03F000 | |
444 | FC1301A27E14036CEB07E0EBE01F90B512C01580150000FB13FC38707FF01C207B9F27> | |
445 | I<133C137EA8007FB512F0B612F8A36C14F0D8007EC7FCAE1518157EA415FE6D13FC1483 | |
446 | ECFFF86D13F06D13E0010313C0010013001F297EA827>I<397FE01FF8486C487EA3007F | |
447 | 131F00031300B21401A21403EBFC0F6CB612E016F07EEB3FFE90390FF87FE024207F9F27 | |
448 | >I<3A7FFC0FFF80486C4813C0A36C486C13803A07C000F800EBE00100035CA2EBF00300 | |
449 | 015CA2EBF80700005CA390387C0F80A36D48C7FCA3EB3F3FEB1F3EA214FE6D5AA36D5AA2 | |
450 | 6D5A22207E9F27>I<3A7FFE07FFE000FF15F06D5A497E007F15E03A0F80001F00A36D5B | |
451 | 0007143EA414F0EBC1F83903E3FC7CA4EBE79EA200011478A301F713F8A2EBFF0F6C5CA3 | |
452 | EBFE0790387C03E024207F9F27>I<393FFC1FFF486C5A168016006C487E3901F807E06C | |
453 | 6C485A4A5A017E90C7FC6D5AEB1F7E5C6D5A13076D5A5C80497E130F497E143EEB3E3FEB | |
454 | 7E1F90387C0F8001F87F00016D7E3803F0033A7FFE1FFF80A2B54813C06C486C1380A222 | |
455 | 207E9F27>I<3A7FFC0FFF80486C4813C0A36C486C13803A07E000F800000313015D13F0 | |
456 | 0001130301F85B1200A26D485A137CA290387E0F80133EA2011F90C7FC5CA2130F149E14 | |
457 | BE130714FC1303A25C1301A25CA213035CA213075C1208EA3E0F007F5B131FD87E7FC8FC | |
458 | EA7FFE6C5A5B6C5AEA07C022317E9F27>I<001FB512FE4814FFA490380001FEEC03FCEC | |
459 | 07F8EC0FF0001EEB1FE0C7EA3FC0EC7F80ECFF00495A495A495AEB1FE0495A495A49C7FC | |
460 | 485A4848131E4848133F485A485A485A485AB7FCA46C14FE20207E9F27>I<EC07F8EC3F | |
461 | FC14FF130315F8903807FE00EB0FF05C5CB0131FEB7F80EA3FFFB5C7FC5BA27F003F7FEA | |
462 | 007FEB1FC0130FB08080EB07FE903803FFF815FC1300143FEC07F81E3A7CB327>I<EA7F | |
463 | 80EAFFF013FC13FF7E00017F38003FC0131F130FB080EB07F8ECFFF06D13FC7FA25B4913 | |
464 | F0ECF800EB0FE05CB0131F133F48B45A007F90C7FCB5FC13FC13F0EA7F801E3A7CB327> | |
465 | 125 D<3901F003803903FC07C0000F130F381FFE1F393FFF7F80397FBFFF0038FE1FFE48 | |
466 | 6C5A00F813F0387003E01A0A7AAD27>I E | |
467 | %EndDVIPSBitmapFont | |
468 | %DVIPSBitmapFont: Ff cmr8 8 26 | |
469 | /Ff 26 118 df<123C127EB4FCA21380A2127F123D1201A312031300A25A1206120E5A5A | |
470 | 5A126009157AAD14>39 D<B512C0A412047F9018>45 D<130C133C137CEA03FC12FFEAFC | |
471 | 7C1200B3B113FE387FFFFEA2172C7AAB23>49 D<4A7E4A7EA34A7EA24A7EA3EC1BF81419 | |
472 | A2EC30FCA2EC70FEEC607EA24A7EA349486C7EA2010380EC000FA201066D7EA3496D7EA2 | |
473 | 011FB57EA29038180001496D7EA349147EA201E0147F4980A20001ED1F801203000716C0 | |
474 | D80FF0EC3FE0D8FFFC0103B5FCA2302F7EAE35>65 D<B612FCEDFF803A03F8000FC00001 | |
475 | EC03F06F7E6F7E82167E167FA6167E16FE5E4B5A4B5AED0FE0ED7F8090B6C7FC16E09039 | |
476 | F80003F0ED01FC6F7E167F821780161F17C0A61780163F17005E16FEED03FC0003EC0FF0 | |
477 | B712C04BC7FC2A2D7DAC32>I<DA1FF013C09138FFFE01903903F00F8390390F8001E301 | |
478 | 3FC71277017C143F4848141F4848140F48481407A248481403121F491401123F90C8FC48 | |
479 | 1500A300FE1600AB127F17C0A27E7F001F15016D1580120F6C6C1403EE07006C6C14066C | |
480 | 6C140ED8007C5C013F147890390F8001E0903903F00FC0902600FFFEC7FCEC1FF02A2F7C | |
481 | AD33>I<B612F815FF3A03F8001FE00001EC03F0ED00F8167E82EE1F80160F17C0EE07E0 | |
482 | A2EE03F0A217F81601A317FCAA17F8A3EE03F0A217E0160717C0160FEE1F80EE3F00167E | |
483 | 5EED03F00003EC1FE0B7128003F8C7FC2E2D7DAC36>I<B712FEA23903F800010001EC00 | |
484 | 3E828282A282A3178016011518A293C7FCA31538157815F890B5FCA2EBF8001578153815 | |
485 | 18A21760A392C712C0A4160117801603A21607160F163F0003913801FF00B8FCA22B2D7E | |
486 | AC30>I<B712FCA23903F800030001EC007C163E161E160EA21606A3160716031518A216 | |
487 | 00A31538157815F890B5FCA2EBF800157815381518A592C7FCAB487EB512F8A2282D7EAC | |
488 | 2E>I<B512F8A2D803FCC8FC6C5AB3A7160CA41618A41638A2167816F81501ED07F00003 | |
489 | 141FB7FCA2262D7EAC2C>76 D<B612FCEDFF803A03F8000FE00001EC03F0ED00F882167E | |
490 | 167F821780A617005E167E5E5EED03F0ED0FE090B6128003FCC7FC01F8C9FCB2487EB512 | |
491 | F0A2292D7EAC30>80 D<B612C015FC3903F8007F0001EC0FC06F7E6F7E6F7E82150082A5 | |
492 | 5E15015E4B5A4B5A4B5A037FC7FC90B512FC15F09038F800FC153E6F7E150F826F7EA582 | |
493 | A5170316F815031707486C903801FC0EB539F000FE1CEE3FF8C9EA07E0302E7DAC34>82 | |
494 | D<90383F80303901FFF0703807C07C390F000EF0001E13074813034813011400127000F0 | |
495 | 1470A315307EA26C1400127E127FEA3FE013FE381FFFE06C13FC6C13FF00011480D8003F | |
496 | 13E013039038003FF0EC07F81401140015FC157C12C0153CA37EA215787E6C14706C14F0 | |
497 | 6CEB01E039F78003C039E3F00F0038E07FFE38C00FF01E2F7CAD27>I<007FB712F8A290 | |
498 | 39000FC003007C150000701638A200601618A200E0161CA248160CA5C71500B3A94A7E01 | |
499 | 1FB512E0A22E2D7EAC33>I<EAFFE0A3EAE000B3B3B3A7EAFFE0A30B4379B114>91 | |
500 | D<13FF000713C0380F01F0381C00F8003F137C80A2143F001E7FC7FCA4EB07FF137F3801 | |
501 | FE1FEA07F0EA1FC0EA3F80EA7F00127E00FE14065AA3143F7E007E137F007FEBEF8C391F | |
502 | 83C7FC390FFF03F83901FC01E01F207D9E23>97 D<EB1FE0EB7FFC3801F01E3803E00739 | |
503 | 07C01F80EA0F80EA1F005A003EEB0F00007E90C7FCA2127C12FCA9127EA215C07E6C1301 | |
504 | 01801380380FC0033907E007003801F03E38007FF8EB1FC01A207E9E1F>99 | |
505 | D<EB1F80EBFFF03803E0783807C03E380F801E381F001FEC0F80123E007E130715C0127C | |
506 | 12FCA3B6FCA200FCC8FCA5127EA2003E14C0123F6C1301390F80038001C013003803E00F | |
507 | 3801F03C38007FF8EB1FC01A207E9E1F>101 D<130FEB1F80EB3FC0A4EB1F80EB0F0090 | |
508 | C7FCA8EB07C013FFA2130F1307B3AD1230127838FC0F80A21400485AEA783EEA3FF8EA07 | |
509 | E0123C83AD16>106 D<EA07C012FFA2120F1207ADEC1FFEA2EC0FF0EC07C05D020EC7FC | |
510 | 5C5C5C5CEBC3C013C7EBCFE0EBDFF013F9EBF0F8497EEBC07E143E80816E7E14076E7E81 | |
511 | 6E7E486C487E3AFFFE07FF80A2212E7EAD25>I<3807C0FE39FFC3FF809038C703E0390F | |
512 | DE01F0EA07F8496C7EA25BA25BB2486C487E3AFFFE1FFFC0A2221E7E9D27>110 | |
513 | D<3807C0FE39FFC7FF809038CF03E0390FDC01F03907F800FC49137E49133E49133FED1F | |
514 | 80A3ED0FC0A8151F1680A2ED3F00A26D137E6D137C5D9038FC01F09038CE07E09038C7FF | |
515 | 80D9C1FCC7FC01C0C8FCA9487EEAFFFEA2222B7E9D27>112 D<380781F838FF87FEEB8E | |
516 | 3FEA0F9CEA07B813B0EBF01EEBE000A45BB0487EB5FCA2181E7E9D1C>114 | |
517 | D<3801FE183807FFB8381E01F8EA3C00481378481338A21418A27E7EB41300EA7FF06CB4 | |
518 | FC6C13C06C13F0000113F838001FFC130138C0007E143EA26C131EA27EA26C133CA26C13 | |
519 | 7838FF01F038E3FFC000C0130017207E9E1C>I<1360A413E0A312011203A21207121FB5 | |
520 | 12F0A23803E000AF1418A714383801F03014703800F860EB3FE0EB0F80152A7FA81B>I< | |
521 | D807C013F800FF131FA2000F130100071300B21401A314033803E007EC0EFC3A01F81CFF | |
522 | C038007FF890391FE0F800221F7E9D27>I E | |
523 | %EndDVIPSBitmapFont | |
524 | %DVIPSBitmapFont: Fg cmsy9 9 2 | |
525 | /Fg 2 106 df<EB0180EB03C01307A21480130FA2EB1F00A2131E133EA25BA2137813F8 | |
526 | A2485AA25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2127812F8A41278127CA2 | |
527 | 7EA2121E121FA26C7EA212077FA26C7EA212017FA26C7EA21378137CA27FA2131E131FA2 | |
528 | EB0F80A2130714C0A21303EB0180124A79B71E>104 D<126012F07EA21278127CA27EA2 | |
529 | 121E121FA26C7EA212077FA26C7EA212017FA26C7EA21378137CA27FA2131E131FA2EB0F | |
530 | 80A2130714C0A41480130FA2EB1F00A2131E133EA25BA2137813F8A2485AA25B1203A248 | |
531 | 5AA25B120FA248C7FCA2121E123EA25AA2127812F8A25A1260124A7CB71E>I | |
532 | E | |
533 | %EndDVIPSBitmapFont | |
534 | %DVIPSBitmapFont: Fh cmcsc10 12 9 | |
535 | /Fh 9 121 df<160C161E163EA2163C167CA2167816F8A216F01501A2ED03E0A216C015 | |
536 | 07A21680150FA216005DA2153EA2153C157CA2157815F8A25D1401A24A5AA25D1407A25D | |
537 | 140FA292C7FC5CA2143EA2143C147CA2147814F8A2495AA25C1303A25C1307A25C130FA2 | |
538 | 49C8FCA2131E133EA2133C137CA2137813F8A2485AA25B1203A25B1207A25B120FA248C9 | |
539 | FCA2121E123EA2123C127CA2127812F8A25A1260276479CA37>47 | |
540 | D<B7FC16F016FC3A03FE0003FF6C489038007F80EE1FE0707E707E707E1601707E177FA2 | |
541 | 1880173F18C0A2EF1FE0A418F0AA18E0A4EF3FC0A21880177F180017FE16015F4C5AEE0F | |
542 | F04C5AEE7FC0486CD903FFC7FCB712FC16F093C8FC34337BB23E>100 | |
543 | D<DA03FF1303021FEBE00791B5EAF80F0103903800FE1FD90FF8EB1F3FD91FE0EB07BFD9 | |
544 | 7F806DB4FC49C77E484880484881484881A2484881121F4981123F5BA2007F82A25B00FF | |
545 | 93C7FCAA4BB512F86C7EA2DB00011380003F6F1300837F121F7F120F6C7E7F12036C7E6C | |
546 | 6C5DEB7FC0D91FE05BD90FF8EB07DF903A03FF803F8F01009038FFFE07021FEBF8030203 | |
547 | 0180C7FC35357BB340>103 D<B512F8A33803FE006C5AB3B3A7487EB512F8A315337BB2 | |
548 | 1E>105 D<EC07FF023F13E0903901FE03FC903907F0007FD90FC0EB1F80D93F80EB0FE0 | |
549 | 49C76C7E01FE6E7E48486E7E48486E7E4848157FA24848ED3F80001F17C0A24848ED1FE0 | |
550 | A3007F17F049150FA300FF17F8AA007F17F06D151FA2003F17E0A26D153F001F17C0A26C | |
551 | 6CED7F80000717006D5D00035E6C6C4A5A6C6C4A5A017F4A5A6D6C495AD90FC0EB1F80D9 | |
552 | 07F0017FC7FC903901FE03FC9039003FFFE0020790C8FC35357BB33F>111 | |
553 | D<B7FC16F016FC3A03FE0003FF6C489038007F80EE3FC0EE1FE0EE0FF0A2EE07F8A217FC | |
554 | A617F8A2EE0FF0A2EE1FE0EE3FC0EEFF00ED03FE90B612F816C001FCC9FCB3A2487EB512 | |
555 | F8A32E337BB238>I<90390FF0018090387FFE0348B512873907F00FEF390FC001FF48C7 | |
556 | FC003E143F151F5A150F5A1507A36C1403A27E6C91C7FC6C7E7FEA3FF8EBFF806C13FC6C | |
557 | EBFFC06C14F06C80C614FE011F7F01031480D9001F13C014019138003FE0151F150FED07 | |
558 | F0150312E01501A37EA216E06C1403A26CEC07C06CEC0F806C6CEB1F0001E0133ED8FBFE | |
559 | 13FC00F0B55AD8E01F13E0D8C00390C7FC24357BB32E>115 D<B500F890383FFFE0A3D8 | |
560 | 03FEC7000713006C48EC01FC705A1770B3AE000016F06D5DA2017E1401017F4A5A7F6D6C | |
561 | 495A6E49C7FC6D6C131ED903F0137C903901FE03F89039007FFFE0021F1380DA03FCC8FC | |
562 | 33347BB23D>117 D<267FFFF890383FFFF0A3000101E0010F13006C49EB07F8017F5D01 | |
563 | 3F15C06D6C5C6D6C49C7FC160E6D6C131E6D6C5B6D6C133816786D6C5B91387F81E0023F | |
564 | 5B15C391381FE7806EB4C8FC5D14076E5A6E7EA26E7E4A7FA24A7F9138079FE091380F0F | |
565 | F0140E91381E07F84A6C7E4A6C7E14709138F000FF49486D7E4948133F4A8001076E7E49 | |
566 | C76C7E131E013E6E7E017E6E7E01FE81000182D80FFF4A1380B500C0011F13FEA337337D | |
567 | B23D>120 D E | |
568 | %EndDVIPSBitmapFont | |
569 | %DVIPSBitmapFont: Fi cmtt12 13.14 8 | |
570 | /Fi 8 116 df<003FB712804816C0B812E0A46C16C06C16802B087AA438>45 | |
571 | D<91397FC003FC903A01FFF01FFF0107D9FC7F1380011F90B612C05B5B90B8FC48903AC0 | |
572 | 7FFE1F80913A001FF00F0048486D6CC7FC49130748486D7E491301000F81491300A76D13 | |
573 | 0100075D6D13036C6C495A6D130F6C6C495AECC07F91B55A5E485D93C8FCD807F713FC01 | |
574 | E113F09038E07FC091CAFCA27F12037F6D7E6CB612C06C15FC4815FF4816C048824882D8 | |
575 | 1FF8C76C7ED83FE0EC07FC0180EC01FE48C9FC177F007E8200FE178048161FA66C163F00 | |
576 | 7FEE7F006D5D6C6C4A5A01F01407D81FFEEC3FFC3B0FFFE003FFF86C90B65A6C5EC61680 | |
577 | 013F4AC7FC010F14F8010314E09026003FFEC8FC324A7DAF38>103 | |
578 | D<EA3FFE487EB5FCA37E7EC67EACED7FC0913801FFF8020713FE021F7F4A805C91B67EED | |
579 | C07F9139FE001FE002F8130F4A805C16075C5CA391C7FCB3A6273FFFFE03B512E0486D48 | |
580 | 14F0B6008F14F8A36C020714F06C496C14E035437FC238>I<14F0497E497E497EA46D5A | |
581 | 6D5A6D5A91C8FCAB383FFFFC487FB5FCA37E7EC7FCB3AF007FB612F0B712F816FCA316F8 | |
582 | 6C15F0264476C338>I<387FFFFEB6FCA57EC77EB3B3B1007FB7FCB81280A56C16002943 | |
583 | 79C238>108 D<ED7FC03A3FFE01FFF8267FFF0713FEB5001F7F4A805C6C90B67E6CECC0 | |
584 | 7F3B007FFE001FE002F8130F4A805C16075C5CA391C7FCB3A6273FFFFE03B512E0486D48 | |
585 | 14F0B6008F14F8A36C020714F06C496C14E035307FAF38>110 D<EC7FC0903803FFF801 | |
586 | 0F13FE497F017F14C090B67E4881489038C07FF8489038001FFC01FC130748486D7E4913 | |
587 | 0148486D7E4980003F168049143F007F16C090C8121FA300FEED0FE0A96C151FA26C16C0 | |
588 | A26D143FA26C6CEC7F80A26C6CECFF006D5B6C6C495A6D13076CB4EB1FFC6C9038C07FF8 | |
589 | 6C90B55A6C5D6D5C6D5C010F49C7FC010313F89038007FC02B327AB038>I<903907FF80 | |
590 | F0017FEBF1F848B512FD000714FF5A5A5AEBFC00D87FE0131F0180130F48C71207481403 | |
591 | A5007FEC01F001C090C7FCEA3FF013FE381FFFF86CEBFFC0000314F8C614FF013F148001 | |
592 | 0714E0D9003F13F0020013F8ED0FFC1503003CEC01FE007E140000FE15FF167F7EA37F6D | |
593 | 14FF16FE01F013036DEB07FC01FF137F91B512F816F016E04815C0D8FC3F1400010F13FC | |
594 | D8780113E0283278B038>115 D E | |
595 | %EndDVIPSBitmapFont | |
596 | %DVIPSBitmapFont: Fj cmsltt10 10.95 50 | |
597 | /Fj 50 122 df<137C13FE487E1480A214C0A3EA007F130F131F1480A3133F14005B137E | |
598 | 13FE485A1203485AEA1FF0485AB45A5B90C7FC127C1238121D6BB730>39 | |
599 | D<140F4A7EA2143FA492C7FCD8078014783A0FC07F01FCD81FF0130701F8130F9038FE7E | |
600 | 3F01FFEBFFF86C90B512F0000315C0C615006D13FC011F13E001071380011F13E0017F13 | |
601 | F848B512FE000780001F15C0267FFDFB13E0EBF1F8D8FFC1137F0183133FD87E03EB0FC0 | |
602 | 0078EC0780000049C7FCA21307A45C6D5A262777AE30>42 D<007FB612E0B712F016F8A3 | |
603 | 16F06C15E02507769E30>45 D<EC07F8EC1FFEEC7FFF49B512C04914E04914F090380FF8 | |
604 | 1F90391FE00FF890383FC00790397F8003FC9038FF00014914FE48481300485A16FF4848 | |
605 | 147FA2485AA2485AA25B123FA348C8FCA500FE15FEA4ED01FCA3ED03F8A215076C15F015 | |
606 | 0F6C15E0151F6D14C0ED3F80003F147F6DEBFF004A5A381FE0036D485A390FFC1FF86CB5 | |
607 | 5A6C5C6C14806C91C7FCEB7FFCEB0FE0283A78B830>48 D<EC03C0EC07E0A2140F141FA2 | |
608 | 143FEC7FC014FF1303130F90B5FC5A48148014BFEBFE3FEA01F8C7FC147F1500A55C5CA5 | |
609 | 13015CA513035CA513075CA5130F5CA2007FB512F8B612FCA46C14F81E3976B830>I<EC | |
610 | 07FC91383FFF8091B512E0010314F84980011F8090393FF80FFF90267FE0011380EC8000 | |
611 | 49C7EA3FC05B0001151F4915E01203160FA349141F1201D800E015C090C8FC163F178016 | |
612 | 7F17005E4B5A15034B5A5EED1FF04B5A4B5A4B5A4A90C7FC4A5AEC0FFC4A5AEC3FE0ECFF | |
613 | C0495B4990C8FCEB07FCEB1FF8495AEB7FC0495A000390C712F0D807FC497E48481303EA | |
614 | 3FF048B6FCB7FCA35E6C5D2B397AB830>I<EC07FE91387FFFC049B512F0010780498049 | |
615 | 8090393FFC03FFECE000D97F80EB7F80163FA391C7FCA2131C90C8FC167F17005E4B5A4B | |
616 | 5A1507ED1FF8EDFFF091B55A495C93C7FC82826D809138003FF0ED07F86F7E15016F7EA2 | |
617 | 8282A3121C007E5D007F5D5A15015E4814034B5A6C140F6C6CEB3FF001E0495A3A3FFC03 | |
618 | FFC06CB65A6C92C7FC6C14FC000114F06C6C13C0D90FFEC8FC293A7AB830>I<1378EA01 | |
619 | FE487E5A1480A25A14007E5B6C5AEA00F090C7FCAFEA0F80EA3FC0487E7F12FFA45B127F | |
620 | 6C5A6CC7FC11276DA630>58 D<ED1F80ED7FC08215FFA25CA3EC03F7A2140715E7A2140F | |
621 | 15C7A2141F1587143FA2ED07F0147FA214FEA3EB01FCA3EB03F8A2EB07F0A3EB0FE0A249 | |
622 | B5FCA2825BA25BEC0003A213FEA3485AA212035BD83FFFEB3FFF486D481380B56CB512C0 | |
623 | A26C496C13806C496C13002A397DB830>65 D<913903FC01E091391FFF81F0027F13E391 | |
624 | B512F7010314FF5B49130790261FF80113E049487ED97FC0137F495A91C7123F485A4848 | |
625 | 15C0A2485A5B120F5B001FED1F80491500003F92C7FC5BA3127F90CAFCA45A5AA716F86C | |
626 | 4A7EA26C14035EA26D1307003F5D6D130F001F4A5A6D133F6C6C495A6D495A2607FF0790 | |
627 | C7FC6CEBFFFE6C5C6C5C6D13E0011F1380D907FCC8FC2C3A78B830>67 | |
628 | D<013FB512E04914FC90B67EEEFF806D15C07F902607F00013E0EE3FF0161FEE0FF81607 | |
629 | 010F15FC4A1303A2160117FEA2011F14005CA5133F5CA5017FEC01FC91C7FCA3EE03F8A2 | |
630 | 5B49EC07F0A2160F17E0161F000116C049143FEE7F80EEFF005D4B5A00034A5A49EB1FF8 | |
631 | ED7FF0007FB65AB75A5E4BC7FC15F86C14C02F387EB730>I<013FB7FC49168090B812C0 | |
632 | A27F7FD903F8C7EA3F80A4177F13074A150083171E94C7FCA2130F5CED01E04B7E821507 | |
633 | 131F91B55AA55B9138800FE0A46F5A017F90C9FC91CAFCA417F0494A7E491403A4160712 | |
634 | 01495DA2003FB7FC5AB8FCA26C5E6C5E32387EB730>I<013FB7FC49168090B812C0A27F | |
635 | 7FD903F8C7EA3F80A4177F13074A150083171E94C7FCA2130F5CA2ED01E04B7E4B7E131F | |
636 | 02C05B91B5FCA45B5EEC800FA35E017F6D5A91CAFCA55B5BA512015BA2387FFFF0B57E80 | |
637 | A25C6C5B32387DB730>I<903B7FFF801FFFE090B56C4813F003E014F8A203C014F06D49 | |
638 | 6C13E0903B07F00001FC00A41603130F4A5CA41607131F4A5CA4160F133F91B65AA55B91 | |
639 | C7EA1FC0A4163F5B495DA4167F12014992C7FCA45E1203495CA23B7FFF801FFFE0B56C48 | |
640 | 7FA46C496C5B35387EB730>72 D<013FB612804915C0A46D158090260007F0C7FCA5140F | |
641 | 5DA5141F5DA5143F5DA5147F92C8FCA55C5CA513015CA513035CA2003FB6FC4881B77EA2 | |
642 | 6C5D6C92C7FC2A3879B730>I<0203B512F04A14F8A46E14F091390001FC00A41503A25E | |
643 | A41507A25EA4150FA25EA4151FA25EA4153FA25EA4157FA293C7FC123E127F5D6D5B38FF | |
644 | 00014A5A6C13079038E03FF86CB55A5D6C5C000791C8FC6C13FC38007FE02D3979B730> | |
645 | I<90387FFFF890B57EA46D5BD903F8C8FCA513075CA5130F5CA5131F5CA5133F5CA5137F | |
646 | 91C9FCA4EE03C049EC07E049140FA4161F12014915C0A2007FB7FCB8FCA317806C16002B | |
647 | 387DB730>76 D<D93FF8ECFFE0496C4913F0496C4913F8A2017F4A13F0013F16E0010F91 | |
648 | 380FFE0002DE147E02DF131FA2EE3EFE131F029FEB7EFC167C16FC16F8ED80F9013F1381 | |
649 | 021FEBF1F8158316E1EC0F8716C3137F017E018F5B1683159F160316079038FE07BE01FC | |
650 | 01FE5B15FCA215F8160F0001EB03F09026F801E05B91C7FCA3161F1203495DA4163F1207 | |
651 | 4992C7FCA2D87FFC903803FFE0486C497FA46C486D5B35387EB730>I<D97FFC90383FFF | |
652 | 80496C4913C06E15E0A218C06D6E13800107913803F000ECEF80A31607130F02CF5C15C0 | |
653 | 14C7A2160F131F02875C15E0A30283131F133F02035C15F0A3163FEB7F01017E92C7FC15 | |
654 | F8A35EEBFE0049147EA315FC16FE0001147C495CA4157D0003143D495C153FEA7FFFB512 | |
655 | 80A2151F5E6C496C5A33387DB730>I<013FB512FC4914FF90B712C017E06D15F06D15F8 | |
656 | 903A03F8003FFC160FEE03FE1601A20107EC00FF5CA2177FA3010F15FE5CA2160117FC16 | |
657 | 03011FEC07F84A130FEE1FF0EE7FE0923801FFC091B612804915005E16F816E093C7FC02 | |
658 | 80C8FC137F91C9FCA55B5BA512015BA2383FFFC0487FB57EA26C5B6C5B30387EB730>80 | |
659 | D<017FB57E90B612F016FC82826D1580902607F00113C09238007FE0163F161FEE0FF013 | |
660 | 0F4A1307A5011FEC0FE05CEE1FC0163FEE7F8016FF013F010313009138800FFE91B55A5E | |
661 | 16E05E4980829138001FF815076F7E15015B5BA500011403495CA2177817FCEEF9FE0003 | |
662 | 16FC4914F1A2267FFF8013FBB500C0EBFFF817F0816F13E06C49EB7FC0C9EA3F002F397E | |
663 | B730>82 D<001FB712E04816F017F8A35A903A001FC007F0A4160F48133F48028013E000 | |
664 | 7E1507003CED03C0C791C7FCA2147F92C8FCA55C5CA513015CA513035CA513075CA5130F | |
665 | 5CA20007B57E48804880A26C5C6C5C2D3877B730>84 D<903A1FFF80FFFC4901C113FE49 | |
666 | 01E313FFA26D01C113FE6D018013FC903A01FE003F80EE7F005E6D6C5B15014B5A91387F | |
667 | 83F8158791383F8FF0EDCFE015DF021F5BEDFF80A26E90C7FC5DA26E5AA25DA3140F4A7E | |
668 | A2143F4A7EA214FE01017F4A7EEB03F882903807F03F130F02E07F90381FC01F133F0280 | |
669 | 7F90387F000F5B498000011407485AD83FFFEB3FFF486D481380B590B512C0A26C6E1380 | |
670 | 6C496C130030387DB730>88 D<1278127C12FEA27EA27EA27FA2123F7FA2121F7FA2120F | |
671 | A27FA212077FA212037FA21201A27FA212007FA27F80A2133FA280A2131F80A2130F80A2 | |
672 | 130780A21303A280A2130180A2130080A280A21580A2143F15C0A2141FA3140FEC07801A | |
673 | 4771BE30>92 D<003FB612F05AB712F8A36C15F07E25077C7D30>95 | |
674 | D<903803FF80011F13F0017F13FC90B57E4880488149C67F49133F48486D7E0003140F5B | |
675 | C65A90C77FA25EA2EC3FFF0107B5FC133F90B6FC1203485D48EBE01F381FFE00EA3FF0D8 | |
676 | 7FC0133F5B48C75B5AA2157FA215FF6C4990C7FCEB8007267FE07F13FE90B7FC6C16806C | |
677 | 14BF6C020F130000039038F803FEC601C0C8FC292A79A830>97 D<EA3FF8487E487EA212 | |
678 | 7F123FEA01FCA512035BA4EC1FF00007EBFFFC01F313FF01F7148090B612C016E09138F0 | |
679 | 3FF048EB800F9039FE0007F85B49EB03FC4913015B121F5B16FE1500A21501003F15FC5B | |
680 | A3150316F8127F1507ED0FF0A2ED1FE06DEB3FC000FF147F6DEBFF80D9F00313009038FC | |
681 | 1FFE90B55A5D485C486C13C0D8781F90C7FC380007F8273977B730>I<EC1FFC91B51280 | |
682 | 010314C0010F14E04914F0137F9039FFF00FF848EB8007489038000FF0D807FC13074914 | |
683 | E04848EB01C0484890C7FCA2485A5B127F90C9FCA35A5AA77E6CEC0F806D131FED3FC06C | |
684 | 6C14806D137FD81FF8EBFF00380FFE0390B55A6C5C00015C6C14E0013F1380D907FCC7FC | |
685 | 252A77A830>I<ED07FF4B13804B13C0A281819238003F80A4167FA21700A491387FC0FF | |
686 | 903803FFF0010FEBFCFE4913FE017F13FF90B6FC48EBE07F48EB001F48486D5A49130748 | |
687 | 481303485A5B485A495C127FA290C7FC15075A485DA4150FA25E151F6C143F7E157F6D13 | |
688 | FF6C6C485BEBE007261FF81F13FF6CB71280A26C14BF0001141F6CD9FC0F1300D91FE0C8 | |
689 | FC2A397AB730>I<EC1FE0ECFFFC010313FF010F1480013F14C04914E09039FFF03FF048 | |
690 | EB800F3A03FE0007F8484813035B485A4848EB01FC5B123F5B127F90C7FC90B6FCA2B712 | |
691 | F8A316F048C9FCA37E7EED03C06DEB07E0003FEC0FF07F6C6CEB1FE06DEB7FC0390FFE03 | |
692 | FF6CB612806C15006C14FC6C6C5B011F13E0010390C7FC262A79A830>I<EEFF80030713 | |
693 | E0031F13F0157F92B512F85C4AEB07F0EC07FC03F813E091390FF001C04BC7FCA2141F5D | |
694 | A548B612FE48815AA36C5DC7D87F80C7FC92C8FCA55C5CA513015CA513035CA513075CA2 | |
695 | 007FB512FEB7FCA46C5C2D397CB830>I<913907F801FE913A3FFF0FFF804A13BF49B712 | |
696 | C05B5B90260FFC0FEB1F8090271FF007F8130049486C6CC7FCECC001EB7F801400A25B5B | |
697 | A315034B5A7F6D495A9138803FE090383FE0FF49B55A90B65A93C8FC4814FC01F913F090 | |
698 | 38F87F80000390CAFC5BA27F120190B512FCEDFF8016E04815F8488148813A1FF00007FF | |
699 | D83FC01300498048C86C7E007E151F12FE5AA2163F94C7FC5E5E6C4A5AD87F80EB07FC6D | |
700 | 131F3A3FFC01FFF86CB612E06C5D6C92C8FC000114FC6C6C13F0010F90C9FC323E7EA730 | |
701 | >I<EB3FF8497E497EA2137F133FEB01FCA513035CA4ED0FF00107EB7FFE02F1B5FC02F7 | |
702 | 148091B6FC17C0EDF03F499038801FE015004A130F14F8A24A131F494814C0A25CA3163F | |
703 | 133F4A1480A4167F137F91C71300A45E5B495CA23B7FFFF81FFFF8B56C4813FC5DA2816C | |
704 | 496C13F82E387FB730>I<15E0EC03F8140781A35D6E5A6E5A91C8FCA990B512C048805A | |
705 | A27E7EEB001F5DA5143F5DA5147F92C7FCA55C5CA513015CA2007FB61280B712C016E0A2 | |
706 | 16C06C1580233979B830>I<163816FE150116FFA316FEED00FC16781600A991B512F049 | |
707 | 14F8A47FEC000716F0A4150FA216E0A4151FA216C0A4153FA21680A4157FA21600A45DA2 | |
708 | 5DA414015DA414035D1407003C5C007E130FB4495A4A5A14FF90B55A92C7FC6C5B6C13F8 | |
709 | 6C13E000071380284E7EB830>I<EB3FF8497E80A3133FEB00FCA513015CA5010390380F | |
710 | FFFE4A487F1880A218006F5B0107010013804A4890C7FCED03FC4B5AED1FF04B5A010FEB | |
711 | 7F804A48C8FCECC3FEECC7FCECCFF8ECDFFCEB1FFF814A7E4A7E02F87FECE03F49486C7E | |
712 | 02807FEC000F6F7E8215034980017E13016F7E3B3FFFF80FFFF0486D487FB56C5AA26C49 | |
713 | 7E6C496C5B31387FB730>I<90383FFFF8497F81A37F90380001FCA514035DA514075DA5 | |
714 | 140F5DA5141F5DA5143F5DA5147F92C7FCA55C5CA2003FB612F04815F8B712FCA26C15F8 | |
715 | 6C15F026387BB730>I<913903F001F83B01FF0FFC07FE489039BFFE1FFF91B5007F1380 | |
716 | 93B5FC18C06C9039FC3FFE1F3B003FF81FFC0F02E013F002C013E0A2028013C09139003F | |
717 | 801F491680A2017E1400A401FE49133F49017E1400A5000102FE5B4949137EA500030101 | |
718 | 14FE01F0495BA23C3FFE07FF03FF80486C48018713C0B5009F01CF13E0A26C010F018713 | |
719 | C06C486C01031380332881A730>I<ED0FF03A01FFE07FFE4801F1B5FC4801F7148091B6 | |
720 | FC6C16C06CECF03FD8000F9038801FE015004A130F14F8A24A131F494814C0A25CA3163F | |
721 | 133F4A1480A4167F137F91C71300A45E5B495CA23B7FFFF81FFFF8B56C4813FC5DA2816C | |
722 | 496C13F82E287FA730>I<EC1FE0ECFFFC010313FF010F14804914E0137F9039FFE07FF0 | |
723 | 489038800FF83903FE000749EB03FC48481301484814FE491300485A123F5B167F48C8FC | |
724 | A300FE15FEA4150116FCA26CEC03F8150716F06C6C130FED1FE06DEB3FC06C6C137F3A1F | |
725 | F001FF80D9FC0713006CB55A6C14F86C5C6C14C06C6C90C7FCEB0FF8282A79A830>I<ED | |
726 | 03FE903A3FFC1FFF8090267FFE7F13E001FF90B57E91B67E6D816D9038FE07FE0101EBF0 | |
727 | 019238C000FF5D92C7EA7F804A143F5C13035C18C0171FA2173F010716805CA3177F1800 | |
728 | 130F5F4C5AA24C5A6E495A011F140F6E495A6EEB7FE09139FF83FFC092B55A94C7FCD93F | |
729 | DF5B028F13F8028313E0028090C8FC92C9FC137FA291CAFCA45BA25BA4387FFFF0B57E80 | |
730 | A25C6C5B323C82A730>I<91383FE00F903A01FFF81F800107EBFE3F011F13FF4914FF5B | |
731 | 9038FFF03F48EB800F48496C1300D807FC7F48487F5B485A48487F5E5B127F90C8FC1501 | |
732 | 5A485DA41503A25E6C1407150F6C141F7F6C6C133FEDFFF0381FF001EBFC0F6CB6FC7E6C | |
733 | 14EF6CEC8FE039007FFE0FEB0FF090C7FC151F5EA5153F5EA591381FFFFE4A7F5CA2806E | |
734 | 5B293C7AA730>I<EE3FE03B01FFFC01FFF848D9FE0F13FC485C037F13FE6C91B5FC6C90 | |
735 | B512E1D80001EC01FC15FC9238F000704B13005D5D4990C8FC5CA25CA25C13075CA5130F | |
736 | 5CA5131F5CA2007FB512FCB67EA46C5C2F287DA730>I<91387FF838903903FFFE7C011F | |
737 | EBFFFC5B5B90B6FC48EBC01F3903FC0007491303484814F85BA3ED01F06D90C7FCEA03FE | |
738 | EBFFF06CEBFF806C14F06D13FC011F13FF01071480D9007F13C0020113E0EC001F001FEC | |
739 | 0FF06D1307003F1403A27FA21507486CEB0FE0151F6DEB3FC09039FC03FF8090B6FC1600 | |
740 | B612FC00FC5C013F13E0267807FEC7FC262A79A830>I<EB03C0497E80A3130F5CA5003F | |
741 | B612E04815F0B7FCA36C15E026003FC0C7FC5CA5137F91C8FCA55B5BA50001EC0F8049EB | |
742 | 1FC0A3153F1680157F15FF6D4813009038FF07FE6CEBFFFC5D6D5B6D5B010F1380D903FC | |
743 | C7FC243378B130>I<D83FFCEB3FFC486C497E00FF14FFA2007F147F003F143F00011401 | |
744 | 495CA415031203495CA415071207495CA4150F120F495CA3151F153F001F147F4B5A000F | |
745 | 5BD9F80F13FF90B712807EA26C149FC6D9FE0F1300D93FF0C8FC29287AA630>I<3B3FFF | |
746 | C07FFF80486DB512C0B515E0A26C16C06C496C13803B03F00007F0006D5C150F00015D15 | |
747 | 1F5E153F6D91C7FC5D0000147E15FE5D140101FE5BA290387E03F0A24A5AA24A5A137F4A | |
748 | 5A133F4AC8FCA2147E14FE5C131F5CA25C6D5A2B2778A630>I<3B3FFFC01FFFE0486D48 | |
749 | 13F0B515F8A26C16F06C496C13E0D807E0C7EA7E00A35EA34B5AA34B5A143E147F4A485A | |
750 | 13E1A249495A158FEBC7EF9138CF9F8014DF13CF029F90C7FC15BFEBDF8FEC0FBEA201FE | |
751 | 13FE5D13FCA25D496C5A3903E003E02D2779A630>I<903AFFFE07FFF0486D4813F84816 | |
752 | FCA26C16F86C496C13F0903A07F001FC006D6C485A6D6C485A4B5A6D6C485A4B5ADA7F7F | |
753 | C7FC157EEC3FFE6E5A5D6E5A5DA24A7E143F4A7EA2ECFCFCEB01F8903803F07E903807E0 | |
754 | 7F49487E011F8090383F801FD97F007F01FE6D7E263FFFC0B5FC4801E11480B515C0A26C | |
755 | 16806C01C014002E277DA630>I<90B53801FFFE4802837F481780A26C17006C02015B90 | |
756 | 3A07E0001FC05F163F6E91C7FCA20103147EA25E804B5A13014B5AA26E485AA20100495A | |
757 | A24B5AA2027E90C8FC5D153E157E157C143E5D143F5DA26E5AA25DA25DA2143F92C9FC5C | |
758 | 147E14FE5C1301003C5B387E03F0EAFF07495A48485AEB7F80B5FC91CAFC13FC6C5AEA3F | |
759 | E0EA1F80313C7EA630>I E | |
760 | %EndDVIPSBitmapFont | |
761 | %DVIPSBitmapFont: Fk cmbx12 13.14 64 | |
762 | /Fk 64 122 df<922607FFE0EB1FF892B5D8FC01B5FC0207DAFF071480021F039F14C091 | |
763 | 3D7FFE007FFFF83FE0DAFFF0011F9038E07FF00103018049018013F84990C748EB00FF49 | |
764 | 484A5A495A4A5D495AF27FF0017F5E4A027FEC3FE0053FEC0F80051F91C7FCADBB12E0A5 | |
765 | 26007FF0C7D81FFCC8FCB3B3A2007FB5D8F01FB512FEA54D4D7ECC48>11 | |
766 | D<923803FFE092B512FC020714FF021F81027F9038007FC0DAFFF0EB0FE0010301C08049 | |
767 | 90C7EA3FF84948147F4A81494814FF495AA2137F5CA2715A715A715AEF078094C8FCA8EF | |
768 | 07FCB9FCA526007FF0C7123F171FB3B3003FB5D8E00FB512F8A53D4D7ECC44>I<EA07E0 | |
769 | EA1FF8487E487E7FB5FC1480A314C0A27EA27EEA1FFBEA07E3EA0003A213071480A2130F | |
770 | A214005B131E133E5BA25B485A485A1207485A485A001EC7FC120C122577CB22>39 | |
771 | D<EA07E0EA1FF0487E487E7FB5FCA31480A37EA27E7EEA07E7EA0007A2130F1400A35B13 | |
772 | 1E133E133C137C137813F8485AA2485A485A485A48C7FC121E120C1125778F22>44 | |
773 | D<B7FCAA200A7F9C29>I<EA07E0EA1FF8EA3FFCEA7FFEA2B5FCA6EA7FFEA2EA3FFCEA1F | |
774 | F8EA07E01010778F22>I<15F014011407141F147FEB03FF137FB6FCA313FC1380C7FCB3 | |
775 | B3B2007FB712E0A52B4777C63D>49 D<ECFFF80107EBFF80013F14F090B612FC48814801 | |
776 | 01EBFF802707F8003F13C0D80FE0010F13E0D81F806D13F0003F80D87FF06D13F86D15FC | |
777 | 6D7F00FF16FE6D147FA217FF82A36C5A6C5A6C5A6C5AC95A17FEA3EEFFFCA24B13F817F0 | |
778 | 5D17E04B13C017804B13004B5A4B5A5EED7FE04B5A4A5B4A90C7FCEC07FC4A5A4A5A4B13 | |
779 | 1FEC3F804AC7FC14FE4948143E495AEB07E0495A4948147E49C8FC017E15FE90B7FC4816 | |
780 | FC5A5A5A5A5A5AB8FC17F8A430477AC63D>I<EC3FFE0103B512E0010F14FC013F14FF90 | |
781 | 267FE01F7F9026FF000713E0D801FC6D7FD803F07F486C6D7FD80FFE817F486D80167FA3 | |
782 | 805C16FF7E91C75B6C5A6C5AD80020495B90C75C5D5F4B5B5F031F90C7FCED3FFC4AB45A | |
783 | 49B512E0168016E016FC90C7EA3FFF030713C06F7F6F7F6F7F83707E83A2701380A318C0 | |
784 | EA07E0EA1FF8487E487EA2B5FCA31880A25E491600127F494A5A6C485D01E05B001F4A5B | |
785 | D80FFC495B2707FFC03F13C06C90B65AC64BC7FC013F14F8010714E09026007FFEC8FC32 | |
786 | 487BC63D>I<EE07E0160FA2161F163F167F16FFA25D5D5DA25D5D5DA2157D15FDEC01F9 | |
787 | 15F1EC03E11407EC0FC1EC1F811501143F147E14FC14F8EB01F01303EB07E014C0EB0F80 | |
788 | 131FEB3F00133E5B13FC485A485A5B1207485A485A90C7FC123E127E5AB912FCA5C80003 | |
789 | EBE000AD023FB612FCA536487DC73D>I<D8038015E001E0140301FC143F9039FFE003FF | |
790 | 91B612C017801700A25E5E16F05E5E93C7FC15FC15F001E790C8FC01E0C9FCAAEC1FFC01 | |
791 | E1B512C001E714F001EF14FC9039FFE01FFFDA0007138001FC6D13C001F06D13E04915F0 | |
792 | 497F17F8C913FC167F17FEA417FFA3EA0FC0EA3FF0487EA2487EA317FEA34914FF6C4815 | |
793 | FC5B018015F86CC74813F07F6C6C4913E0D80FF04913C0D807FC011F13806CB46CB51200 | |
794 | 6C90B512FC6C5D013F14C0010F91C7FC010113F030487AC63D>I<ED7FF8913807FFFE02 | |
795 | 1F6D7E027F80903A01FFF01FE0010790388003F04948486C7E49486D7ED93FF013074948 | |
796 | 130F01FF4A7E4849133F5C5A4890C7FCA25A705A48486E5A705A003F92C8FCA3485AA215 | |
797 | 20913807FFE0021F13FC00FF497F4A6D7EDAFC017F9026FDF0007F4A6D7ED9FFC06D7E4A | |
798 | 6D7E8391C7FC8382491680A318C05BA3127FA6123FA27F001F1780A3000F4B1300A26C6C | |
799 | 5DA26C6D495A6C6D5C6C6D495A6D6C48485A90263FFC075B6DB65A6D4AC7FC01035C0100 | |
800 | 14F0020F90C8FC32487BC63D>I<121F7F7F13FE90B812E0A45A18C0188018005F5FA25F | |
801 | 485E90C8EA07E0007E4B5A5F007C151F4CC7FC167E5E485D15014B5A4B5AC8485A4B5AA2 | |
802 | 4BC8FC157EA25D1401A24A5A1407A24A5AA2141FA24A5AA2147FA314FFA3495BA45BA55B | |
803 | AA6D5BA26D90C9FCEB007C334B79C93D>I<EC1FFF49B512F0010714FC011F14FF90263F | |
804 | F00713C049C77F01FCEC3FF04848EC0FF848481407000782491403000F821601A2121F7F | |
805 | A27F13FE6D140302C05C14F002FC495A6C6D130FDAFF805B9238E01FE06C6E485A9238FC | |
806 | FF806C91B5C7FC6C15FC6C5D7F6D14FE6D806D15C06D81011F81017F81D9FFDF80481307 | |
807 | 2603FE018048486C804848133F4848010F1480003F8049130148486D6C13C0161F824848 | |
808 | 140382A282A2177FA218807F127FEFFF007F6C6C4A5AA2D81FFC4A5A6C6CEC0FF86C6C6C | |
809 | EB3FF06C9039F003FFE06C90B612806C6C92C7FC011F14FC010714E09026003FFEC8FC32 | |
810 | 487BC63D>I<EC1FFE49B512C0010F14F04914FC90397FFC0FFE903AFFE003FF804849C6 | |
811 | 7F48496D7E4890C7FC486F7E484881161F003F825B007F82A28300FF81A31880A518C0A4 | |
812 | 5E127FA3003F5D7F121F5E120F6C6C91B5FC6C90388001EF6CEBC0036C9038E00FCF6DB5 | |
813 | 128F011F140F010701FE1480010113F8903800010091C7FCA24C1300A3D803F85D487E48 | |
814 | 7E486C4A5AA25F4C5AA24C5A49495B6C485D49010790C7FC01E0495AD807F8EB3FFC6CB4 | |
815 | 48B45A6C90B55A6C15C06D91C8FC011F13FC010313C032487BC63D>I<EA07E0EA1FF8EA | |
816 | 3FFCEA7FFEA2B5FCA6EA7FFEA2EA3FFCEA1FF8EA07E0C7FCB0EA07E0EA1FF8EA3FFCEA7F | |
817 | FEA2B5FCA6EA7FFEA2EA3FFCEA1FF8EA07E0103077AF22>I<903803FFF8013FEBFF8090 | |
818 | B612E0000315F8489038007FFCD80FF0EB1FFED81FC0EB07FF48C71480D87FC015C06D7F | |
819 | 486C15E07FA66C5A6C484913C06C5A0007C7481380C8FC4B13004B5AED7FF84B5A16C04A | |
820 | 5B4A90C7FC15FC4A5A5D140F5D4A5AA25D4AC8FCA3143EAB143C91C9FCA9147E49B47E49 | |
821 | 7F497FA2497FA66D5BA26D5B6D5BD9007EC8FC2B4D79CC3A>63 D<EE01F8A24C7EA34C7E | |
822 | A24C7EA34C7FA24C7FA34C7FA293B57EA34B8016F303038016E316E103078016C0030F80 | |
823 | 5E83031F814C7E4B81153E83037E81037C7F03FC815D830201824B7F0203825D83020782 | |
824 | 4B7F020F825D84021F8392B8FC4A83A34A83027CC8120F02FC835C840101844A81010384 | |
825 | 5C840107844A81010F845C85011F85496C82B600C091B712F0A5544D7CCC5D>65 | |
826 | D<B912F0F0FF8019F019FC19FFD8001F0180C780061F7F727F727F727F727FA2727FA219 | |
827 | 7F86A84F5AA2626062604E5B4E5B4E1380067F90C7FC943803FFFC92B712F0198019F019 | |
828 | FC0380C7383FFF80060F7F060313F0727F727F737E86851B80851BC0A21BE0A48561A41B | |
829 | C0A2611B80611B0096B5FC4E5B4E5B060F5B067F5BBB12C097C7FC19FC19F04EC8FC4B4B | |
830 | 7CCA57>I<93261FFF80EB01C00307B500F81303033F02FE13074AB7EA800F0207EEE01F | |
831 | 021F903AFE007FF83F027F01E0903807FC7F91B5C73801FEFF010301FCEC007F4901F081 | |
832 | 4901C0150F4949814990C97E494882495A48498248197F5C48193F5C48191F5C48190FA2 | |
833 | 485BA21A075AA391CDFCA2B5FCAD7EA280F207C0A27EA36C7F1A0F6C1A80806C191F6E18 | |
834 | 006C61806C197E6C6D177C6D6C17FC6D6C4C5A6D6D4B5A6D6D4B5A6D01F0ED1FC06D01FC | |
835 | 4B5A010001FF03FFC7FC6E01E0EB07FE021F01FEEB3FFC020790B612F0020116C0DA003F | |
836 | 92C8FC030714F8DB001F13804A4D79CB59>I<B912F0F0FF8019F019FC19FFD8001F9026 | |
837 | 80000114C0DD001F7F060713F806017F726C7E737E737F737F737F8587737F8587A2747E | |
838 | A38786A21C80A51CC0A586A462A51C80A51C00A26263A2631AFF636163614F5B634F5B07 | |
839 | 3F90C7FC4F5A4F5A06035B061F5B4DB512C0BBC8FC19FC19F0198006F0C9FC524B7CCA5E | |
840 | >I<BB12C0A486D8000F01E0C77E18071801F0007F193F191F190F1907861903A31901A3 | |
841 | EF0F80A2737EA497C7FC171FA2173F177F17FF160392B6FCA5EDE0031600177F173F171F | |
842 | A2050FEC0F80A3F21F00A494C8FC621A3EA21A7EA31AFE6219011903A21907190FF13FF8 | |
843 | 19FF1803183FBBFCA262A3494A7CC951>I<BBFCA41A80D8001F01C0C7FC181F18038484 | |
844 | 197F193F191F1AC0190FA31907A4171FF103E0A496C7FCA25FA25F5F5E160792B6FCA5ED | |
845 | C0071601828383A283A794C9FCB1B8FCA5434A7CC94D>I<93261FFF80EB01C00307B500 | |
846 | F81303033F02FE13074AB7EA800F0207EEE01F021F903AFE007FF83F027F01E0903807FC | |
847 | 7F91B5C73801FEFF010301FCEC007F4901F0814901C0150F4949814990C97E494882495A | |
848 | 48498248197F5C48193F5C48191F5C48190FA2485BA21A075AA391CEFCA2B5FCAD7E050F | |
849 | B712C080A37E94C7001FEBC000807EA27E807E807E806C7F7E6D7E6D7E6D7F6D01E05D6D | |
850 | 6D5D6D13FC010001FF4AB5FC6E01E0EB07F9021F01FFEB3FF0020791B5EAE07F0201EEC0 | |
851 | 1FDA003FED0007030702F81301DB001F018090C8FC524D79CB60>I<B7D8FC01B712FCA5 | |
852 | D8001F01C0C8001FEBC000B3AA92B9FCA503C0C8121FB3AEB7D8FC01B712FCA5564B7BCA | |
853 | 60>I<B712FEA5D8000FEBE000B3B3B3ABB712FEA5274B7DCA2E>I<B700F8027FB512F0A5 | |
854 | D8001F01C0C9EBC00074C7FCF101FE4F5A4F5AF10FE04F5A4F5A4FC8FCF001FE4E5A4E5A | |
855 | F00FE04E5A4E5A4EC9FCEF01FE4D5A4D5AEF0FE04D5A4D5A4DCAFCEE01FE16034C7E4C7F | |
856 | 5E4C7F93B57E03C18015C303C780DBCFE77FDBDFC37FEDFF8104017F4B6C804B7F4B6D7F | |
857 | 03E0814B6D7F8385717F717F83857180727F8486727F8486727F727F84867280737F8587 | |
858 | 737F87B700F8010FB612FCA5564B7CCA60>75 D<B8FCA5D8001F01C0C9FCB3B3A4193EA4 | |
859 | 197E197CA519FCA31801A2F003F8A21807180F181F183F187FEF01FF1707173FBA12F0A5 | |
860 | 3F4B7BCA4A>I<B600E04DB612806F5FA26F5FA2D8001F09FCC7FC6FEF0F7FA2DABFFE17 | |
861 | 1EA2DA9FFF173CA3028F6D1678A202876D16F0A202836DED01E0A302816DED03C0A20280 | |
862 | 6DED0780A26F6CED0F00A36F6C151EA26F6C5DA26F6D5CA26F6D5CA36F6D495AA26F6D49 | |
863 | 5AA26F6D495AA3706C49C7FCA2706C131EA2706C5BA3706D5AA2706D5AA270EBE1E0A370 | |
864 | EBF3C0A270EBFF80A27190C8FCA2715AA3715AA2715A497EB600F06D480103B71280A371 | |
865 | 5A715A694B7BCA74>I<B600E092B612FC8181A281D8001F6D9239001FE0006F705A82A2 | |
866 | 8202BF7F029F7FA2028F7F02877F02837F8214810280806F7F6F7F83816F7F6F7F6F7F83 | |
867 | 816F80707F707F8482707F707F707FA2707F7014807113C019E0837113F07113F87113FC | |
868 | 19FE837113FF71148F7213CF1AEF847213FF8484A284848485A2858585A285858585497E | |
869 | B600F8167F1A3F1A1F1A0FA2564B7BCA60>I<EEFFF8031FEBFFC04AB612FC020715FF02 | |
870 | 1FD9C01F13C091277FFE000313F0902601FFF09038007FFC49496E7E490180EC0FFF4990 | |
871 | C86C7F49486F7F49486F7F017F8449486F7F4849707EA24849707E4885A24849701380A2 | |
872 | 481AC04A82A2481AE0A34890CA6C13F0A5B519F8AE6C1AF0A26E5EA36C1AE0A26E5E6C1A | |
873 | C0A26C1A806E5E6C1A006E5E6C616E16FF6C616C6D4B5B6D6C4B5B6E5D6D6D4A5B6D6D4A | |
874 | 5B01076D4A90C7FC6D01F8ECFFFE6D01FE01035B9028007FFFC01F13F0021F90B612C002 | |
875 | 0793C8FC020115FCDA001F14C0030101FCC9FC4D4D79CB5C>I<B912C018FCF0FF8019F0 | |
876 | 85D8001F902680000713FE05007F063F1380060F13C07213E01AF0841AF8A27213FCA31A | |
877 | FEA81AFCA34E13F8A21AF0601AE04E13C0063F138095B51200050713FC92B75A19E096C7 | |
878 | FC18F803C0CAFCB3ABB712FCA5474B7BCA54>I<EEFFF8031FEBFFC04AB612FC020715FF | |
879 | 021FD9C01F13C091277FFE000313F0902601FFF09038007FFC49496E7E490180EC0FFF49 | |
880 | 90C86C7F49486F7F49486F7F49486F7F01FF844849707E4A163F48854849707EA2481A80 | |
881 | 4A82481AC0A291CA7E481AE0A3481AF0A24983A300FF1AF8AE007F1AF0A36D5FA26C1AE0 | |
882 | A36C6D4C13C0A26C1A80A26C6D4C1300EE1FC06C6DD97FF0495A923801FFFC6C6D486D49 | |
883 | 5A6C912607F07F5CD97FF8903AC00F80FFF0913AFC0F8007C1D93FFE010001C35BD91FFF | |
884 | DA03E75B0107018F6DB5C7FC6D01EF5D6DD9FF805C6D6C01C014F0021FD9F01F13C00207 | |
885 | 90B6C8FC02014B1408DA001F6E141C03019038FC7F8092C87F726C133C73137C9638FC03 | |
886 | FC96B5FC1BF884A37214F0A37214E0A27214C0721480721400735A735AF10FF04E6179CB | |
887 | 5C>I<B9FC18F8F0FF8019E019F8D8000F9026C0000713FE9439007FFF80061F7F727F72 | |
888 | 7F727F84868684A286A862A24E5BA2624E5B4E5B4E5B4E5B95B5C8FC050713FC92B712F0 | |
889 | 198006FCC9FC18FF9226C0003F13C0050713F0717F717F717F187F85727FA28486A786A7 | |
890 | 1C3E86A28474137E72157C726D13FCB700FC6D9038FE01F872EBFF8373EBFFF0071F14E0 | |
891 | 07031480CD383FFE00574C7CCA5C>I<DA7FFCEB01C00103B5EAC003011FECF00749ECFC | |
892 | 0F90B7121F48D9E00F13BF4890C713FFD807FC141F4848804848140382484880177F485A | |
893 | 173F171F12FFA2170F7FA217077F7F7F6D92C7FC6D7E6C13F014FF15F86CECFF8016F86C | |
894 | 15FF6C16C0836C826C826C826C82013F816D1680010716C01300020F15E01400030714F0 | |
895 | ED007F160F16037013F882177F127800F8163FA3171FA27E18F0A27EA26CEE3FE07F18C0 | |
896 | 01E0157F6DEDFF8001FC160001FF140302E0EB0FFED97FFEEB3FFC486CB612F0D8FC0F5D | |
897 | D8F803158048C66C49C7FC48010313F0354D79CB44>I<003FBB12C0A5DA80019038FC00 | |
898 | 1FD9FC001601D87FF09438007FE001C0183F49181F90C7170FA2007E1907A3007C1903A5 | |
899 | 00FC1AF0481901A5C894C7FCB3B3A749B812FCA54C4A7CC955>I<B700F8023FB512F8A5 | |
900 | D8001F01C0C9380FE000745AB3B3AD6D180F63811A1F6D96C7FC626D7F1A7E6D7F6D606E | |
901 | 6C4B5A6E6CED07F06E6C4B5A6E01C0EC3FC06E01F049B45A020101FF011F90C8FC6E91B5 | |
902 | 5A033F15F8030715E0030092C9FC040713F0554C7CCA5E>I<B7D8E007B791B612C0A5D8 | |
903 | 003F0180C7000101FCC9387F80006F7070C7FC6D70183EA26F70167E6D71177C876F1BFC | |
904 | 6D715F6F831E016D656F4B6D14036D65876F92B515076D656F4A8007F3160F6E64700103 | |
905 | 6E141F6E04E194C8FCA27001076E5C6E04C0163E8770010F177E6E4C6C157C70011F814F | |
906 | 6C15FC6E637049EDC0016E033E6D5D1CE070017E16036E037C6D5D7001FC15F04E6D1407 | |
907 | 6E63DCFF01EEF80F6F4A6D5DA20583EEFC1F6F4A6D92C9FC1CFE05C75F6F4A6D143E05EF | |
908 | 16FF4E6E137E6F197C05FF17FC6F91C86C5BA36F496F5BA24D816F61A26F496F5BA37048 | |
909 | 6F5BA370486F90CAFCA24D81041F5FA27048167C7A4C7ECA7F>87 | |
910 | D<B700F84AB6FCA5D8001F01F0C93803FC006F705A6D4E5A6D6D4C5A816D4E5A6D6D4C5A | |
911 | 826D4EC7FC6E6D5D70157E6E5F6E7F704A5A6E4C5A6E7F704A5A6E4C5A6E7F71495A6E4C | |
912 | C8FC6F7F71137E6F5D6F7F71485A6F4A5A6F13FC71485A6F4A5A6F13FFF09F806F02BFC9 | |
913 | FC7013FF60705B8260705B8260B3A7037FB612FEA5584B7ECA5D>89 | |
914 | D<130C131E137E5B485A5B485A485A485AA248C7FC121E123E123C127CA21278A212F85A | |
915 | A2EAF1F8EAF7FEB5FC1480A214C0A27EA37E14807E6C13006C5AEA01F8122579CB22>96 | |
916 | D<ECFFFC010FEBFFC0017F14F090B612FC489038803FFF2703FC00077F486C6D7F486C6D | |
917 | 7F6E7E83707EA3707E6C90C7FC6C5A6C5AC9FCA4ED1FFF021FB5FC49B6FC130F013FEBC0 | |
918 | 3F9038FFFE00000313F04813C04890C7FC485A485AA2485AA2485AA4167FA26D14FF007F | |
919 | 15EF6D01017F6C6C903907CFFF806C6CD90F8F13FE6C9038E07F076C9038FFFE0300014A | |
920 | 7ED8003F9038F0007F0103018090C7FC37337CB13C>I<EB7FC0B5FCA512037EB3A2ED0F | |
921 | FF037F13F002C1B512FC02C714FF9126CFF80F7F9126FFC00113E092C76C7E02FC6E7E4A | |
922 | 6E7E5C4A6E7E84831980A219C083A319E0AC19C0A25F1980A34D1300606E141F606E4A5A | |
923 | 6E4A5A02BF4A5A91261F80035B9027FE0FF01F5B496CB548C7FC496C14F849C614E0C8D8 | |
924 | 0FFEC8FC3B4D7CCB44>I<91380FFF8091B512F8010314FF010F158090263FFE0013C0D9 | |
925 | 7FF8EB1FE0D9FFE0EB3FF04849EB7FF8484913FF4890C7FC5A5B121F5B003FED7FF0EE3F | |
926 | E0007FED1FC093C7FC5BA212FFAC127F7FA2123FA26D153E121F6D157E6C167C6C6D14FC | |
927 | 6C16F86C6D13036C01F0EB07F0D97FFCEB1FE06DB4EBFFC0010F90B5120001035C010014 | |
928 | F0020F13802F337CB137>I<EF1FF0EE3FFFA51600177FB3A2EC0FFF91B512E0010314F8 | |
929 | 010F14FE013FEB01FF903A7FF8003FFFD9FFE0130F48497F48497F4890C77E4881485AA2 | |
930 | 485AA3127F5BA212FFAC127FA37F123FA2121F7F000F5D6C6C5C5E6C6D5B6C01E0497F6C | |
931 | 6D017FEBFFE090393FFE03FE6DB512F801075C010114C09027001FFC00EBC0003B4D7CCB | |
932 | 44>I<EC0FFF91B512F0010314FC010F14FF90263FFE077F90267FF0007F4948EB3FE048 | |
933 | 01806D7E48824890C76C7E4848140783485A003F6F7EA3485A701380A312FFA290B8FCA4 | |
934 | 01F8CAFCA5127FA27FA2123FA26C6CED0F80A2000F161F6C6C16006E5C6C6D147E6C6D5C | |
935 | 6C6D495AD97FFCEB07F0903A1FFF803FE06D90B55A010392C7FCD9007F13FC020713C031 | |
936 | 337DB138>I<ED7FE0913807FFFC021F7F027F7F902601FFE0138049018113C0902607FE | |
937 | 0113E049485A14F8131FEB3FF0A26F13C0EB7FE06F1380EE3E0093C7FCADB77EA526007F | |
938 | F0C8FCB3B3A2003FB512F8A52B4D7DCC26>I<DA7FFCEB0FF00103B538807FF8011F9138 | |
939 | F1FFFC4991B512FE90267FF01F13F32701FFC007138348EB0001A248486DEBC1FC000FEE | |
940 | E0F849027F1300A2001F82A8000F5EA26D14FF00075E6C6C495BA26CD9C00790C7FC6C90 | |
941 | 38F01FFC4890B55A5ED803C314809026C07FFCC8FC000790CAFCA47FA27F13FC90B612FC | |
942 | EEFFC06C16F817FE6C8218806C17C06D16E00003B812F0120FD81FFCC7000F13F8D83FF0 | |
943 | 140049153F4848ED1FFC00FF160F491507A56D150F007F17F86D151F6C6CED3FF06C6CED | |
944 | 7FE0D80FFE913801FFC06C6C6C010713806C01F8017F1300C690B612FC013F15F0010715 | |
945 | 80D9003F01F0C7FC37487DB03D>I<EB7FC0B5FCA512037EB3A2923801FFC0030F13F803 | |
946 | 3F13FE4B7F9126C1FE077F9126C3F0037F9138C7C001DACF8080150002DE7F02FC81A25C | |
947 | A25CA35CB3A9B6D8C07FEBFFE0A53B4C7BCB44>I<13FCEA03FF487F487FA2487FA66C5B | |
948 | A26C5B6C90C7FCEA00FC90C8FCACEB7FC0B5FCA512037EB3B3B61280A5194D7BCC22>I< | |
949 | EB7FC0B5FCA512037EB3A393383FFFFEA5040390C7FC17FCEE0FF04C5A4C5A4C5A04FEC8 | |
950 | FCED03FC4B5A4B5AED1FC0ED7F804BC9FC14C102C37F14CF02DF7F91B57E825C4A6C7E02 | |
951 | F87F4A6C7E9138C01FFF81836F7F6F7F816F7F83707E163F707E83707F707F84B6D8803F | |
952 | EBFF80A5394C7CCB41>107 D<EB7FC0B5FCA512037EB3B3B3AAB61280A5194C7BCB22>I< | |
953 | 90287FC001FFE0EC7FF8B5010F01FC0103B5FC033F6D010F804B6D6C4814E0DBFE079026 | |
954 | C03F817F9126C3F0019138FC007F0003D9C7E0DAE1F8806CDA8000D9F1E06D7E02CFC7EB | |
955 | F3C002DE91267FF780131F02FC03FFC77FA24A5DA24A5DA34A5DB3A9B6D8C03FB5D8F00F | |
956 | B512FCA55E317BB067>I<903A7FC001FFC0B5010F13F8033F13FE4B7F9126C1FE077F91 | |
957 | 26C3F0037F00039038C7C0016CD9CF8080150002DE7F02FC81A25CA25CA35CB3A9B6D8C0 | |
958 | 7FEBFFE0A53B317BB044>I<913807FF80027F13F80103B6FC010F15C090261FFE017F90 | |
959 | 3A7FF0003FF8D9FFC0EB0FFC48496D7E4890C76C7E4817804980000F17C048486E13E0A2 | |
960 | 003F17F049157FA2007F17F8A400FF17FCAB007F17F8A36C6CEDFFF0A3001F17E06D5C00 | |
961 | 0F17C06C6C4A13806C17006C6D495A6C01E0EB1FFC6D6C495A903A3FFE01FFF0010FB612 | |
962 | C0010392C7FCD9007F13F80207138036337DB13D>I<90397FC00FFFB5017F13F002C1B5 | |
963 | 12FC02C714FF9126CFF80F7F9126FFC00313E0000391C77F6C01FC6E7E4A6E7E5C4A6E7E | |
964 | 848319808319C0A47113E0AC4D13C0A319805FA219004D5A804D5A6E4A5A6E4A5A02FF49 | |
965 | 5BDB80075B9126EFF01F5B02E7B548C7FC02E314F802E014E0DB0FFEC8FC92CAFCAFB612 | |
966 | C0A53B467CB044>I<DA0FFE14F091B5EAC0010103ECF003010F14F8013F903801FC0790 | |
967 | 3A7FFC007E0FD9FFF0131F4849EB0F9F4849EB07FF485B4890C77E82485A003F81A25B00 | |
968 | 7F167FA3485AAC6C7EA4123F6D15FF121F6D5C6C5D6C7F5E6C6D5B6C6D133F6C01F813FE | |
969 | 90393FFE03FC6DB55A010714E00100148091381FFC0091C8FCAF047FEBFFE0A53B467CB0 | |
970 | 41>I<9039FF803FE0B5EBFFF8028113FE02837FDA87E11380EC8F830003D99F0713C06C | |
971 | 139E14BCA214F8A24A6C13806F13004A6C5A93C7FCA45CB3A7B612E0A52A317CB032>I< | |
972 | 90390FFF8070017FEBF1F048B6FC1207380FFC01391FE0003F4848130F491307127F90C7 | |
973 | 12035A1501A27FA213E06D90C7FC13FE387FFFF0ECFFC015F06C14FC6C14FF6C15806C15 | |
974 | C06C15E0C615F0013F14F8010714FCEB007F14019138003FFE150F0078140700F81403A2 | |
975 | 6C1401A37E16FC6C14036D14F87F6DEB07F001F8EB1FE001FFEBFFC091B51280D8FC7F14 | |
976 | 00D8F81F13FCD8E00313C027337CB130>I<14F8A61301A41303A21307A2130FA2131F13 | |
977 | 3F137F13FF1203000F90B512F0B7FCA426007FF8C7FCB3A6167CAA013F14F880A290391F | |
978 | FE01F0010F1303903907FF87E06DEBFFC06D14806D6C1300EC0FFC26467EC430>I<D97F | |
979 | E0EC3FF0B5EC7FFFA5000315016C81B3AB5EA25EA25E7E6EEB0F7F017F021E7F6E017CEB | |
980 | FFE090393FFE01F86DB512F0010714E0010114C09027003FFE00EBC0003B327BB044>I< | |
981 | B66C90B512C0A5000101E0C73807F0006E5D6C5F6E140F017F5E80171F013F93C7FC6E5C | |
982 | 011F153E6E147E6D157C6F13FC6D5DEDC001A26D01E05B16036D5DEDF0076D5DEDF80F02 | |
983 | 7F5CEDFC1F023F91C8FC15FE5E021F133EEDFF7E6E137C16FC6E5BA26E5BA36E5BA26E5B | |
984 | A26F5AA26FC9FCA23A317DAF41>I<B60081B500FC90387FFFF0A500019026E000030180 | |
985 | 903803FC006E715A6C6F5E6E6F1303017F61A26E496D1307013F616E6F130F011F4A5EA2 | |
986 | 6E6F131F6D4A93C7FCDD9FFC5B6DD9801F153E170F03C06E137E6D023F157C93383E07FF | |
987 | DBE07E15FC6DDA7C035C03F015816D02FC5D4C7E03F815C3DA7FF95E9226FDF00013E7DA | |
988 | 3FFF5E4C137F19FF6E5F4C7FA26E496D90C8FCA26E5E93C7120FA26E486E5AA202015E4B | |
989 | 1403A26E486E5A54317EAF59>I<B6D88007B512C0A526007FFCC7387F8000013F037EC7 | |
990 | FC6E14FE6D6C495A6D6D485A6D6D485A6D01E05B4C5A6D6D485A6DEBF83F6E6C48C8FC91 | |
991 | 383FFEFE6E6C5A5E6E5B6E5B806E7FA26E7F82824A7F5C4A80DA0FE77FDA1FC37FDA3F81 | |
992 | 7F4AC67F147E4A6D7E49486D7E01036E7E49486D7F49487F49488149486D7F017F6E7FB5 | |
993 | 00F8011FEBFFF0A53C307EAF41>I<007FB500C090387FFFE0A5C601F0C73803F8006E5D | |
994 | 017F5E6E1407013F5E6E140F011F5E6E141FA26D6D91C7FC5F6D153E6F137E6D157C6F13 | |
995 | FC6D5DEDF0016D5DEDF803027F5C15FC1607DA3FFE5B160F021F5CEDFF1F6E91C8FC16BF | |
996 | 6E13BE16FE6E5BA36E5BA26E5BA26F5AA26F5AA26F5AA393C9FC5D153E157E157CD81F80 | |
997 | 13FC486C5B387FE001D8FFF05B14035D14074A5A49485A007F49CAFCEBC07E383F81FC6C | |
998 | B45A6C5B6C13C0C648CBFC3B467EAF41>I E | |
999 | %EndDVIPSBitmapFont | |
1000 | %DVIPSBitmapFont: Fl cmcsc10 10.95 23 | |
1001 | /Fl 23 121 df<B6FCA618067E9622>45 D<166016F01501A216E01503A216C01507A216 | |
1002 | 80150FA2ED1F00A2151E153EA2153C157CA25DA25D1401A25D1403A25D1407A24A5AA292 | |
1003 | C7FC5CA2141E143EA25CA2147814F8A25C1301A25C1303A2495AA25C130FA291C8FC5BA2 | |
1004 | 133EA2133C137CA2137813F8A25B1201A2485AA25B1207A25B120FA248C9FCA2121E123E | |
1005 | A2123C127CA2127812F8A25A1260245B7AC332>47 D<EB07FC90383FFF8090B512E03903 | |
1006 | F01FF83907C007FC390F0001FE001E6D7E001C1580003CEC7FC05AED3FE01270B4FC6DEB | |
1007 | 1FF07FA56C5A6CC7FC120CC813E0153FA216C0157F168015FF16004A5A5D4A5A4A5A5D4A | |
1008 | 5A4A5A4AC7FC147E147C5C495A495A495A495A49C71270133E133C5B4914E0485A485A48 | |
1009 | 5A48C7120148B6FCA25A4815C0B7FCA3243D7ABC32>50 D<EC01E0A24A7EA34A7EA34A7E | |
1010 | A24A7E141CA2EC3CFFEC387FA24A6C7EA34A6C7EA2010180ECC00FA249486C7EA349486C | |
1011 | 7EA24980010E1301010FB5FC4980A2011CC7FC49147FA20178810170143FA201F0814914 | |
1012 | 1F1201486C811207486CEC3FF8D8FFFE49B512C0A332317DB038>97 | |
1013 | D<B612FEEDFFC016F03A03FC0007F86C48EB01FE1500167F1780163F17C0A61780167F17 | |
1014 | 0016FE4B5AED07F0ED7FE090B6128016F09039F80001FC6F7EEE7F80163FEE1FC017E016 | |
1015 | 0F17F0A617E0161FA2EE3FC0EE7F80923801FF00486CEB07FEB712F85E93C7FC2C2F7CAE | |
1016 | 35>I<DA0FF81330DA7FFF13700103B5EAC0F090390FFC03F190391FE000F9D97F80133F | |
1017 | 01FEC7121F4848140F48481407485A000F1503491401121F491400123F5B127F1770A248 | |
1018 | C9FC1700AA6C6C1570A3123F6D15F0121F6D15E0000F15016D15C0000715036C6C15806C | |
1019 | 6C14076C6CEC0F00D97F80133ED91FE05B90390FFC03F00103B55AD9007F1380DA0FF8C7 | |
1020 | FC2C317BAF36>I<B612FCEDFFC016F03A03FE000FF86C48EB01FEED007FEE3F80EE1FC0 | |
1021 | EE0FE0EE07F0160317F8160117FCA2EE00FEA417FFAA17FEA3EE01FCA3EE03F817F01607 | |
1022 | EE0FE017C0EE3F80EE7F00ED01FE486CEB0FFCB712F016C04BC7FC302F7CAE39>I<B8FC | |
1023 | A33903FE00016C489038003F80161F160F1607A21603A317C0ED1C01A393C7FCA2153CA2 | |
1024 | 15FC90B5FCA3EBFC00153CA2151CA21770A392C712E0A41601A2EE03C0A21607160F161F | |
1025 | 486C14FFB81280A32C2F7CAE33>I<B712FEA33903FE00036C48EB007F828282A282A3EE | |
1026 | 0380A21538A293C7FCA31578A2EC01F890B5FCA3EBFC01EC0078A21538A592C8FCAA487E | |
1027 | B512FCA3292F7CAE31>I<DA0FF81360DAFFFE13E00103EBFF8190390FF807E390393FC0 | |
1028 | 00F34948137F01FEC7123F4848141F4848140F48481407120F491403485A003F1501A25B | |
1029 | 007F1500A348C9FC1700A8031FB5FCA26C7E9238001FF0EE0FE0123F7FA26C7E120F7F12 | |
1030 | 076C7E6C7E6C6C141FD97F80133FD93FE0137B90390FFC03F10103B512E00100EC8060DA | |
1031 | 0FFCC7FC30317BAF3A>I<B5D8F81FB5FCA3D803FEC7EA7FC06C48EC3F80B190B7FCA301 | |
1032 | FCC7123FB3486CEC7FC0B5D8F81FB5FCA3302F7CAE38>I<B512F8A33803FE006C5AB3B3 | |
1033 | A3487EB512F8A3152F7DAE1B>I<90383FFFFCA39038007FC0EC3F80B3AD1218127EB4FC | |
1034 | A3EC7F005A007C137E007813FE383C01F8381F03F03807FFC0C648C7FC1E307CAE27>I< | |
1035 | B512FCA3D803FEC8FC6C5AB3A7160EA4161CA4163CA2167C16FC1501ED03F8486C131FB7 | |
1036 | FCA3272F7CAE2F>108 D<D8FFFE923807FFF0A3D803FF92380FFC006C5FD9DF80141DA3 | |
1037 | D9CFC01439A2D9C7E01471A3D9C3F014E1A2D9C1F8EB01C1A3D9C0FCEB0381A2027EEB07 | |
1038 | 01A36E130EA291381F801CA391380FC038A2913807E070A3913803F0E0A3913801F9C0A2 | |
1039 | 913800FF80A3486CEB7F00487E486C013E497EB5008091B512F0A2151C3C2F7CAE44>I< | |
1040 | D8FFFC49B5FC7F7F00019138001FF06EEB0FE06EEB07C0EE0380EBDFE0EBCFF013C780EB | |
1041 | C3FC13C180EBC0FF801580EC3FC0EC1FE0A2EC0FF0EC07F8A2EC03FCEC01FE140015FFED | |
1042 | 7F83153F16C3ED1FE3ED0FF3A2ED07FBED03FFA28181A2167F163F486C141F487E486C14 | |
1043 | 0FB56C1307A21603302F7CAE38>I<EC1FF891B5FC903907F00FE090390FC003F0013FC7 | |
1044 | 12FC017E147E49804848EC1F804848EC0FC04848EC07E0000F16F0491403001F16F84914 | |
1045 | 01003F16FCA2007F16FE90C9FCA34816FFAA6C6CEC01FEA3003F16FCA26D1403001F16F8 | |
1046 | 6C6CEC07F0A26C6CEC0FE0000316C06C6CEC1F806C6CEC3F00017E147E6D5C90390FC003 | |
1047 | F0903907F00FE00100B5C7FCEC1FF830317BAF3A>I<B612FCEDFF8016E03A03FE000FF8 | |
1048 | 6C48EB03FCED00FE167FA2EE3F80A217C0A61780A2EE7F00A216FEED03F8ED0FF090B612 | |
1049 | C093C7FC01FCC9FCB2487EB512F8A32A2F7CAE33>I<B612E015FE6F7E3A03FE003FE06C | |
1050 | 48EB07F8ED01FC6F7EA2828283A594C7FC5E5E4B5A4B5A4B5AED3FC090B500FEC8FC5D90 | |
1051 | 38FC007FED1F806F7E826F7EA26F7EA582A4EF01C016FEA21501486CED0380B538F800FF | |
1052 | 93383F8700EE1FFEC9EA03F832307CAE37>114 D<90383FC00C9038FFF81C0003EBFE3C | |
1053 | 390FE03FFC381F8007EB0003003E1301481300157C5A153CA36C141CA27E6C14006C7E13 | |
1054 | E013FE383FFFE06C13FE6CEBFF806C14E0000114F06C6C13F8010F13FC1300EC07FE1401 | |
1055 | 1400157F153F12E0151FA37EA2151E6C143E6C143C6C147C6C14F89038C001F039FBF807 | |
1056 | E000F1B512C0D8E07F130038C007FC20317BAF2A>I<007FB712F8A39039801FF0073A7E | |
1057 | 000FE00000781678A20070163800F0163CA348161CA5C71500B3A8EC3FF8011FB512F0A3 | |
1058 | 2E2E7CAD36>I<B5D8F801B5FCA3D803FEC7EA1FF06C48EC0FE0EE07C0EE0380B3AB1607 | |
1059 | 6C6C1500A2017E5C017F141E6D141C6D6C133C6D6C5B6D6C485A903903FC07E00100B512 | |
1060 | 80DA3FFEC7FCEC07F830307CAE38>I<3B7FFFF001FFFEA30003D9C00013E0C649EB7F80 | |
1061 | 017F027EC7FC167C6D6C13786D6C5B6D6C5B15016D6C485AD903FC5B15076D6C48C8FC90 | |
1062 | 3800FF1EEC7F9C15BCEC3FF86E5AA2140F6E7E14034A7E4A7EEC1EFF141C91383C7F804A | |
1063 | 6C7E14709138F01FE049486C7E49486C7E148001076D7E49486C7E130E011E6D7E496E7E | |
1064 | 017C6E7E13FC000382D80FFEEC7FF8B549B512C0A3322F7DAE38>120 | |
1065 | D E | |
1066 | %EndDVIPSBitmapFont | |
1067 | %DVIPSBitmapFont: Fm cmti10 10.95 18 | |
1068 | /Fm 18 121 df<933807FF80043F13E09338FE00F8DB01F0133EDB07E0130E4B48131F4C | |
1069 | 137F031F14FF4BC7FCA218FE157E1878180015FE5DA31401A25DA414030103B712F0A218 | |
1070 | E0903A0003F000070207140F4B14C0A3171F020F15805DA2173F1800141F5D5F177EA214 | |
1071 | 3F92C712FE5FA34A1301027EECF81CA3160302FEECF03C4A1538A21878187013014A0101 | |
1072 | 13F018E0933800F1C0EF7F804948EC1F0094C7FCA35C1307A2001E5B127F130F00FF5BA2 | |
1073 | 49CAFC12FEEAF81EEA703CEA7878EA1FF0EA07C0385383BF33>12 | |
1074 | D<120FEA3FC0127FA212FFA31380EA7F00123C0A0A77891C>46 D<147E49B47E903907C1 | |
1075 | C38090391F80EFC090383F00FF017E137F4914804848133F485AA248481400120F5B001F | |
1076 | 5C157E485AA215FE007F5C90C7FCA21401485C5AA21403EDF0385AA21407EDE078020F13 | |
1077 | 70127C021F13F0007E013F13E0003E137FECF3E1261F01E313C03A0F8781E3803A03FF00 | |
1078 | FF00D800FC133E252977A72E>97 D<EC1FC0ECFFF0903803F03C903807C01E90381F800E | |
1079 | 90383F000F017E133F4913FF485A485A000714FE5B000F14FC48481300A2485AA3127F90 | |
1080 | C8FCA35A5AA6481403007E1407150F151E003E143C15786C14F0EC03E0390F800F803903 | |
1081 | E07E003801FFF838003FC0202977A72A>99 D<EE3F80ED1FFF1700A2ED007FA2167EA216 | |
1082 | FEA25EA21501A25EA21503A25EA21507A25E147E903801FF8F903807C1CF90391F80EFC0 | |
1083 | 90383F00FF017E137F5B48486D5A485AA2485A000F92C7FC5B001F5CA24848137EA215FE | |
1084 | 127F90C75AA214015A485CA2140316384814F0A21407167891380FE070127C021F13F000 | |
1085 | 7E013F5B003E137FECF3E1261F01E35B3A0F8781E3802703FF00FFC7FCD800FC133E2940 | |
1086 | 77BE2E>I<EC3F80903801FFE0903807E0F890381F803CEB3E0001FC131E485A485A1207 | |
1087 | 4848133E49133C121F4848137C15F8EC03F0397F000FE0ECFF809038FFFC00B512C048C8 | |
1088 | FCA45AA61506150E151E007C143C15786C14F0EC01E06CEB07C0390F801F003807C0FC38 | |
1089 | 01FFF038007F801F2976A72A>I<EC03F0EC0FFC91383E0E1C9138FC077E903901F003FE | |
1090 | 1303903807E001D90FC013FCEB1F80A2EB3F004914F8137E01FE1303A2484814F0A21507 | |
1091 | 12034914E0A2150F12074914C0A2151FA216805B153F1203ED7F006D5BA200015B000049 | |
1092 | 5A9038F80F7E90387C1EFEEB1FF8903807E0FC90C7FC1401A25DA21403A25D001C130700 | |
1093 | 7F5C48130F5D4A5A4AC7FC48137E00F85B387C03F0381FFFC0D803FEC8FC273B7CA72A> | |
1094 | 103 D<1478EB01FCA21303A314F8EB00E01400AD137C48B4FC38038F80EA0707000E13C0 | |
1095 | 121E121CEA3C0F1238A2EA781F00701380A2EAF03F140012005B137E13FE5BA212015BA2 | |
1096 | 12035B1438120713E0000F1378EBC070A214F0EB80E0A2EB81C01383148038078700EA03 | |
1097 | FEEA00F8163E79BC1C>105 D<EB07F0EA03FF14E0A2EA000FA214C0A2131FA21480A213 | |
1098 | 3FA21400A25BA2137EA213FEA25BA21201A25BA21203A25BA21207A25BA2120FA25BA212 | |
1099 | 1FA25BA2123FA290C7FCA25A1307127EA2EAFE0F130E12FCA2131E131CA2EA7C381378EA | |
1100 | 3C70EA1FE0EA0780144079BE17>108 D<D801F0D93F80137F3D07FC01FFE003FFC03D0F | |
1101 | 3E07C1F80F83F03D0E1F0F00FC1E01F8001E011C90387C3800001C49D97E707F003C01F0 | |
1102 | 5C0038157F4A5C26783FC05C12704A91C7FC91C7127E00F003FE1301494A5CEA007EA203 | |
1103 | 01140301FE5F495CA203031407000160495C180F03075D0003051F13E0494A1480A2030F | |
1104 | EC3F810007F001C0495CA2031F91383E0380120F494AEC0700A2033F150E001FEF1E1C49 | |
1105 | 91C7EA0FF80007C7000EEC03E0432979A74A>I<D801F0EB3F803A07FC01FFE03A0F3E07 | |
1106 | C1F83A0E1F0F00FC001E011C137C001C49137E003C13F012385C38783FC012705C91C7FC | |
1107 | 00F015FE495CEA007EA2150101FE5C5BA2150300015D5B15075E0003020F13704914C0A2 | |
1108 | 031F13F00007ED80E05B1681EE01C0120F49EC0380A2EE0700001FEC0F0E49EB07FC0007 | |
1109 | C7EA01F02C2979A733>I<EC1FC0ECFFF8903803F07C90380FC01FEB1F8090393F000F80 | |
1110 | 017E14C0491307484814E0485A12075B000F15F0485AA2485AA2ED0FE0127F90C7FCA215 | |
1111 | 1F4815C05AA2ED3F80A2ED7F00A248147E007C5C007E13015D4A5A003E495A6C495A4A5A | |
1112 | 260F803EC7FC3807C0FC3801FFF038003F80242977A72E>I<903903E001F890390FF807 | |
1113 | FE903A1E7C1E0F80903A1C3E3C07C0013C137801389038E003E0EB783F017001C013F0ED | |
1114 | 80019038F07F0001E015F8147E1603000113FEA2C75AA20101140717F05CA20103140F17 | |
1115 | E05CA20107EC1FC0A24A1480163F010F15005E167E5E131F4B5A6E485A4B5A90393FB80F | |
1116 | 80DA9C1FC7FCEC0FFCEC03E049C9FCA2137EA213FEA25BA21201A25BA21203A2387FFFE0 | |
1117 | B5FCA22D3A80A72E>I<D801F013FC3A07FC07FF803A0F3E0F03C0260E1F1C13E0001EEB | |
1118 | 380F001C1370003CEBE01F123814C0D8783F14C00070903880070092C7FC91C8FC12F05B | |
1119 | EA007EA313FE5BA312015BA312035BA312075BA3120F5BA3121F5B0007C9FC232979A726 | |
1120 | >114 D<EC7F80903801FFE0903807C0F890381F003C013E131C013C131E017C133E4913 | |
1121 | 7E15FEA2000114FCA215706D13007FEBFFC014FC6C13FF15806D13C06D13E0010F13F013 | |
1122 | 00140F14071403120C123F387F80011403D8FF0013E0A300FCEB07C000F0EB0F80127000 | |
1123 | 78EB1F006C133C381F01F83807FFE0C690C7FC1F297AA725>I<EB01C0EB03F01307A25C | |
1124 | A2130FA25CA2131FA25CA2133FA291C7FCA2007FB51280B6FC1500D8007EC7FC13FEA25B | |
1125 | A21201A25BA21203A25BA21207A25BA2120FA25BA2121F141C1380A2003F133C1438EB00 | |
1126 | 78147014F05C495AEA1F03495A6C48C7FCEA07FCEA01F0193A78B81E>I<017CEB01C048 | |
1127 | B4EB07F038038F80EA0707000E01C013F8121E001C1403EA3C0F0038EC01F0A2D8781F13 | |
1128 | 0000705BA2EAF03F91C712E012005B017E130116C013FE5B1503000115805BA2ED070012 | |
1129 | 03495B150EA25DA25D1578000114706D5B0000495A6D485AD97E0FC7FCEB1FFEEB03F025 | |
1130 | 2979A72A>118 D<903903F001F890390FFC07FE90393C1E0E0F9026780F1C138001F0EB | |
1131 | B83FD801E013F89039C007F07FEA0380000714E0D9000F140048151C000E4AC7FCA2001E | |
1132 | 131FA2C75BA2143F92C8FCA35C147EA314FE4A131CA30101143C001E1538003F491378D8 | |
1133 | 7F811470018314F000FF5D9039077801C039FE0F7C033A7C0E3C078027783C1E1EC7FC39 | |
1134 | 1FF80FFC3907E003F029297CA72A>120 D E | |
1135 | %EndDVIPSBitmapFont | |
1136 | %DVIPSBitmapFont: Fn cmbxti10 14.4 1 | |
1137 | /Fn 1 47 df<13FCEA03FF000F13804813C05AA25AA2B5FCA31480A214006C5A6C5A6C5A | |
1138 | EA0FE0121271912B>46 D E | |
1139 | %EndDVIPSBitmapFont | |
1140 | %DVIPSBitmapFont: Fo cmbx12 17.28 52 | |
1141 | /Fo 52 122 df<94267FFF80903801FFE0043FB500F0013F13FC4BB6D8FC01B57E030FDB | |
1142 | FF0FECFF80037F04BF15C04AB5D8E00390B5008113E04A01FCC76CEBFC03020F01F091B5 | |
1143 | D8F00713F04A01C04914E04A90C7484A4813F84A4817804A485C49491700495B62495B76 | |
1144 | 13F04970496D13E04B7213C0726F138072EE3E009AC7FCB0BD12FEA6D8000F01E0C849C9 | |
1145 | FCB3B3B0003FB6D8F803B712E0A665657DE45E>11 D<94387FFF80041FB512F04BB612FC | |
1146 | 030F81037F6F7E4AB5D8E0077F4A49C76C7E020F01F0EC1FF04A01C0147F4A90C8487E4A | |
1147 | 485C4A484A7F49495C495BA2495B4E7F49705B5DA3725B725B725B735A96C9FCAB0503B5 | |
1148 | 12FEBBFCA6D8000F01E0C7120184B3B3AF003FB6D8F803B71280A651657DE45A>I<ED0F | |
1149 | FF4AB512F8020F14FF023F15C091B712F049D9FC037F0107D9F00013FE4901C0EB3FFF49 | |
1150 | 90C7000F7F49486E7F017F8349486E7F4A80488448496E7FA248844A157F4884A3481980 | |
1151 | A34819C04A81A34819E0A7B518F0B3A86C19E0A76C19C0A26E5DA26C1980A36C1900A36C | |
1152 | 6D4B5AA26C60A26C6D4A5B6C606E5C6D6C4A5B6D6C4A5B6D6D495B6D6D4990C7FC6D01F0 | |
1153 | EBFFFE6DD9FC035B010090B612F0023F15C0020F92C8FC020114F8DA001F138044607ADD | |
1154 | 51>48 D<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007C7FCB3 | |
1155 | B3B3B3007FB91280A6395E74DD51>I<913801FFF8021FEBFFC091B612F8010315FF010F | |
1156 | 16C0013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F86E148048 | |
1157 | 486E14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380A219FFA2 | |
1158 | 83A36C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D13E0A294 | |
1159 | B512C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B13804B90 | |
1160 | C8FC4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC7F8092C9 | |
1161 | FC02FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A5A5A5A5A | |
1162 | BAFCA219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F0010FD9C01F | |
1163 | 13FC90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0486D826E | |
1164 | 806E82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A614C91C7FC | |
1165 | 604C5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F817FF91C7 | |
1166 | 003F13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A31AC0EA03 | |
1167 | FCEA0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485BD81FF85F | |
1168 | 000F5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90B65A011F | |
1169 | 16F0010716C001014BC8FCD9001F14F0020149C9FC426079DD51>I<F01F804E7E187F18 | |
1170 | FFA25F5F5F5FA25F5F5FA294B5FC5E5E5EA25E5EEE3FBFEE7F3FA216FEED01FCED03F8ED | |
1171 | 07F0A2ED0FE0ED1FC0ED3F8016005D15FE4A5A4A5AA24A5A4A5A4A5A4A5AA24AC7FC14FE | |
1172 | 495A5C1303495A495A495A5C133F49C8FC13FE485AA2485A485A485A5B121F485A48C9FC | |
1173 | 12FEBCFCA6CA6CEBC000B1037FB8FCA6485E7CDD51>I<01C0EE01C0D801F8160F01FF16 | |
1174 | 7F02F0EC07FFDAFF8090B5FC92B7128019006060606060606095C7FC17FC5F17E0178004 | |
1175 | FCC8FC16E09026FC3FFCC9FC91CBFCADED3FFE0203B512F0020F14FE023F6E7E91B712E0 | |
1176 | 01FDD9E00F7F9027FFFE00037F02F801007F02E06EB4FC02806E138091C8FC496F13C049 | |
1177 | 17E07113F0EA00F090C914F8A219FC83A219FEA419FFA3EA03F0EA0FFC487E487E487FA2 | |
1178 | B57EA319FEA35C4D13FC6C90C8FC5B4917F8EA3FF001804B13F06D17E0001F5E6C6C17C0 | |
1179 | 6D4B1380D807FC92B512006C6C4A5B6C6C6C01075B6C01E0011F5BD97FFE90B55A6DB712 | |
1180 | C0010F93C7FC6D15FC010115F0D9003F1480020301F0C8FC406078DD51>I<EE1FFF0303 | |
1181 | B512E0031F14F892B612FE0203814AD9FC037F021F9039C0007FC04A90C7EA1FE0DAFFFC | |
1182 | 6E7E494914074949EC7FF8494914FF49495B4949497F4990C7FC495D5C13FF485BA25A4A | |
1183 | 6E5B5A715B48496E5B725A4894C8FCA35AA35C48913801FFE0030F13FE033F6D7E4B14E0 | |
1184 | 92B612F89126E1FE037FB53AE3F0007FFEDAE7E06D7EDAEFC06D7F4B6D7F02FFC76C7F4A | |
1185 | 82717F4A82A2854A8085A24A1780A54A17C0A37EA77EA47E6E1780A27EA21A007E4D5B7E | |
1186 | 6E5E7E6E5E6C4C5B6D7E013F4B5B6D6C4A5B6D01C0495B6D6D90B5C7FC6DD9FC0713FC6D | |
1187 | 90B65A6D5E023F15C0020F92C8FC020114F8DA001F1380426079DD51>I<EA07E0120F7F | |
1188 | 13FCEBFFFC91B912F8A45AA21AF01AE01AC01A801A00A248606161616101E0C9123F0180 | |
1189 | 4C5A48CA485A4D90C7FC60007E4C5A17074D5A4D5A4D5A485F4D5A17FF4C90C8FCC9485A | |
1190 | 5F4C5A160F4C5A5F163F4C5A16FF5F5D94C9FC5D5D5E150FA24B5AA2153FA24B5AA215FF | |
1191 | A34A5BA25CA35CA44A5BA45CA65CAD6E5BA26E5BDA03FECAFC6E5A456377E051>I<9238 | |
1192 | 3FFF800203B512FC021FECFF80027F15E049B712F849D9F0077F010F90C76C7ED91FFCEC | |
1193 | 1FFFD93FF06E7F494802037F494882717F484980854890C9127FA24884183FA25A80A380 | |
1194 | 806E157F6E5E14FE6E7E6F4A5A6C14F003FC495B03FF495B6C1580DCE0075B6CDBF80F90 | |
1195 | C7FC9338FE1FFE6C9238FF7FF84D5A6D16C06D5E6D4BC8FC6D6F7E6D16E00101826D16FC | |
1196 | 023F814A8149B87E010783498390263FFE3F8190267FFC0F819026FFF003814849C6FC48 | |
1197 | 496D804849131F4890C7000780160148486E1580003F163F49150F007F7014C049150171 | |
1198 | 7E8400FF835B8484A384A21A80A27F007F1900607F003F606D160F001F606D4C5A6C6D15 | |
1199 | 3F6C6D4B5A6C01F04B5A6C01FC02035B6C01FF021F5B6D9027F001FFFEC7FC6D90B65A01 | |
1200 | 0F16F001035E010093C8FC020F14F8DA007F90C9FC426079DD51>I<ED3FFF0207B512F0 | |
1201 | 023F14FC91B7FC010316C049D9F8077F49D9C00113F8013F496C6C7E4948C76C7E49486E | |
1202 | 7E4884484980717F4849825A48707F855A5C855A8583A2B583A41A80A71AC0A35F7EA46C | |
1203 | 5EA27E6E5C7EA26C5E6C7F6C5E6C6D147D6D6C14FD6D6CEB01F96D90388003F16D9038F0 | |
1204 | 1FE16D90B500C11480010115816D6C1401021F13FC020113E091C8FC1A00A25FA261A3D9 | |
1205 | FF805E487F486D4A5B487FA2486D5E5F61615F614A4A90C7FC4D5A6C5B4A4A5A4A01035B | |
1206 | D803FCC7485B6C6C021F13C0D9FFC0017F5B6CD9F803B5C8FC6DB612FC6D5D010F15E001 | |
1207 | 0392C9FC010014F8020F1380426079DD51>I<F00FE04E7EA24E7EA34E7EA24E7EA34D7F | |
1208 | A24D80A24D80A34D80A24D80A34D80A2DD7FBF7FA2181F05FF8017FE04016D7FA24D7E04 | |
1209 | 038217F804076D80A24D7E040F8217E0041F6D80A24D7F043F825F047F6E7FA294C77E4C | |
1210 | 825E03016F7FA24C800303845E03076F80A24C80030F845E031F6F80A24C81033F845E03 | |
1211 | 7F707F93B9FCA292BA7EA24A85A203FCC912070203865D020771805D86020F864B82021F | |
1212 | 865D87023F864B83027F8692CBFC874A864A840101875C496C728090381FFFC0B700E092 | |
1213 | B812FEA66F647BE37A>65 D<BB12F0F2FF801BF81BFEF3FFC088D800010280C7000114F8 | |
1214 | DF003F7F080F13FF74807480867480757FA2757FA28987A289A965A26365A2515BA298B5 | |
1215 | 5A505C505C5091C7FC505B505B087F13F00703B512C096B6C8FC93B812F81BC01BF8F3FF | |
1216 | 801CE00480C8001F13F8080713FE08016D7E7480757F757F757F89757F89871E80871EC0 | |
1217 | A41EE087A663A21EC0A3631E80A2511400A2515B515B6398B55A505C08075C081F5C97B6 | |
1218 | C7FCBD5A1CF81CE099C8FC1BF898C9FC63627AE173>I<4DB5ED03C0057F02F014070407 | |
1219 | B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F033F9127F8007FFE13FF92B6 | |
1220 | C73807FF814A02F0020113C3020702C09138007FE74A91C9001FB5FC023F01FC16074A01 | |
1221 | F08291B54882490280824991CB7E49498449498449498449865D49498490B5FC484A84A2 | |
1222 | 484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C7FCA25CA3B5FCB07EA380A27E | |
1223 | A2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E1A00A26C6E616D1BFE6D7F6F4E5A | |
1224 | 7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A6E6DEFFF806E01FC4C90C7FC020F | |
1225 | 01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF913803FFE0033F02F8013F1380030F | |
1226 | 91B648C8FC030117F86F6C16E004071680DC007F02F8C9FC050191CAFC626677E375>I< | |
1227 | BB12E0F2FF801BF01BFE757E1CF0D800010280C7000780DF007F13FE080F6D7E08018074 | |
1228 | 80093F7F090F13FC757F757F877580767F8A88767F8A888AA2767FA28A881F80A37614C0 | |
1229 | A41FE0A5881FF0B05214E0A51FC0A4521480A31F006466A2525BA2525BA2525B666499B5 | |
1230 | 5A515C5191C7FC515B515B515B097F5B50B512C008075C083F91C8FC0707B512FCBD12F0 | |
1231 | 1CC051C9FC1BF81B8008E0CAFC6C627AE17C>I<BD12FCA488A2D8000102C0C71201F100 | |
1232 | 0F1A01F2007F1B3F1B0F1B07757EA28787A288A3F43F80A31C1FA3197EA3F40FC0A499C7 | |
1233 | FC19FEA31801A218031807181F18FF93B6FCA6EEC000181F180718031801A21800A21D7E | |
1234 | 197EA21DFCA696C812011DF8A31C03A3F407F0A31C0FA21C1F1C3F1DE01C7F1CFF63631B | |
1235 | 0F093F13C098B5FC1A0797B6FCBEFCA31D80A35F617AE06A>I<BD12E0A41CF0A2D80001 | |
1236 | 02C0C71207F1003F1A0F1A031A001B7F1B3FF31FF81B0FA21B07A21B03A21B011CFCA31B | |
1237 | 00A419FCA21C7EA41C00A21801A31803A21807180F183FEF01FF93B6FCA6EEC001EF003F | |
1238 | 180F18071803A21801A31800A896C9FCB3A5B912F8A657617AE065>I<B96C90B91280A6 | |
1239 | D8000102C0C9000102C0C7FCB3B3A293BBFCA604C0C91201B3B3A6B96C90B91280A67162 | |
1240 | 7AE17E>72 D<B912E0A6C702E0C7FCB3B3B3B3AEB912E0A633627CE13C>I<020FB812F0 | |
1241 | A691C70001EC8000B3B3B3ACEA03FCEA0FFF487F487F487FA2B57EA45E96C7FCA36C4949 | |
1242 | 5B604A5B6C90C75C6C484A5B01F84A5BD80FFE4A5B6C6C6C90B55A0001D9F80749C8FC6C | |
1243 | 90B65A013F15F0010F15C001014AC9FCD9001F13C044647CE153>I<B912F8A6D8000102 | |
1244 | C0CBFCB3B3B1F307E0A5F30FC0A61B1FA31B3F1C80A21B7FA21BFFA262A2626250130062 | |
1245 | 62624FB5FC1907191F4EB6FCBDFC63A553627AE161>76 D<B700C0083FB612F070627097 | |
1246 | B7FCA37061D800010DF8C7FC70F103EFA202FD6DF107CFA202FC6DF10F8FA36F6DF01F0F | |
1247 | A26F6D183EA26F6D187CA26F6D18F8A36F6DEF01F0A26F6DEF03E0A26F6DEF07C0A26F6D | |
1248 | EF0F80A3706DEE1F00A2706D163EA2706D5EA2706D5EA3706D4B5AA2706D4B5AA2706D4B | |
1249 | 5AA2706D4B5AA3716D4AC7FCA2716D143EA2716D5CA2716D5CA3716D495AA2716D495AA2 | |
1250 | 716D495AA2716D495AA3726D48C8FCA272EBC03EA2726D5AA2726D5AA372EBF9F0A272EB | |
1251 | FFE0A2725CA2725CA37390C9FCA2735AA2735A90381FFFC0B700F86E480207B812F0A373 | |
1252 | 5AA2735A8C627AE199>I<BB7E1AFCF2FFC01BF81BFE757ED800010280C7001F80070114 | |
1253 | F0736C7F081F7F747F747F7414807414C0A27414E0A21DF0A27513F8A41DFCA91DF8A498 | |
1254 | B512F0A21DE0A25014C01D8062501400505B505B087F5B4FB512E0071F5C93B9C7FC1BFC | |
1255 | 1BF01B8008F0C8FC04C0CCFCB3B3A2B97EA65E627AE16E>80 D<BA12F8F1FFE01AFEF2FF | |
1256 | C01BF01BFED800010280C76C7F070714C0070014F0747F081F7F747F747F7480A2748089 | |
1257 | A37480A389A865A3505CA265A2505C9AC9FC505B505B505B087F5B4FB55A0707148096B5 | |
1258 | 48CAFC93B812F81BC050CBFC621AFF932680000314C0DE007F7F071F13F8737F737F737F | |
1259 | 73808885888688A2747FA688A688A676140FF71F80A374801F3F86771400745E746E5BB9 | |
1260 | 6E6E5B746E485A75EBFE07091F90B55A090715E009015DCF003F91C7FC0A0013FC71647A | |
1261 | E178>82 D<DBFFFCEC01E0020FD9FFE01303027F02FC130749B7130F0107EEC01F011F16 | |
1262 | F049D9C007EBF83F4948C7383FFE7FD9FFF8020FB5FC4801E014014849804849153F91C9 | |
1263 | 7E484882001F834982003F83845B007F187FA2193FA200FF181FA27F190FA27FA26D1707 | |
1264 | 8080806C01F893C7FC80ECFF8015F86CECFFC016FC6CEDFFE017FE6CEEFFE018F86C17FE | |
1265 | 6C717E6C846C846D17F86D836D836D8313036D18806D6C17C0020F17E01401DA000F16F0 | |
1266 | 1500040715F8EE007F1703050014FC183F84060713FE84A2007C8300FC83A2197FA3193F | |
1267 | 7EA31AFC7EA27F1AF86D177F7F1AF06D17FF6D18E06D5E01FF18C06E4B138002E04B1300 | |
1268 | 02F84B5A02FFED3FFC01CF01E0ECFFF8018301FF010F5B010191B65A6D6C5E48011F93C7 | |
1269 | FC48010315FC48D9003F14E048020149C8FC476677E35A>I<001FBEFCA64849C79126E0 | |
1270 | 000F148002E0180091C8171F498601F81A0349864986A2491B7FA2491B3F007F1DC090C9 | |
1271 | 181FA4007E1C0FA600FE1DE0481C07A5CA95C7FCB3B3B3A3021FBAFCA663617AE070>I< | |
1272 | B96C023FB612FEA6D8000102C0CA0007EBF000E2007FC7FCB3B3B3AA656D63A2821C0180 | |
1273 | 6570170380525A6E7F6E4F5A70171F6E626E6D4D5A6E6D177F525A6E6E030390C8FC033F | |
1274 | 01E04B5A6F6DED1FFC6F01FCED7FF80303D9FF80903803FFE06F02F8017F5B6F6C90B7C9 | |
1275 | FC041F5E040716F8040016C0050F4ACAFCDD003F13C06F647AE17C>I<B800FC047FB612 | |
1276 | E0A6D800070280CB6CEB80006D6EDE07FCC7FC666D6E611D0F6D6E611D1FA26E6D611D3F | |
1277 | 6E6D611D7F6E6D96C8FC65A26E6D4D5AA26E6E5F1C036E6E5F1C076E6E5F1C0FA26E6E5F | |
1278 | 1C1F6F6D5F1C3F6F6D5F1C7FA26F6D4CC9FCA26F6D5E1B016F6E5D1B03A26F6E4A5AA26F | |
1279 | 6E5D1B0F6F6E5D1B1F706D5D1B3FA2706D5D1B7F706D92CAFC63706D5C1A01A2706E485A | |
1280 | A27002C05B1A077002E05B1A0F7002F05B1A1FA27101F85B1A3F7101FC5B1A7F7101FE90 | |
1281 | CBFC62A2716D5AA2715CA2715CA3715CA2715CA2725BA2725BA37290CCFCA2725AA2725A | |
1282 | A2725A73637DE17A>I<B800F8011FB80203B7FCA6D8000F91C9000102E0CAEBFE006D72 | |
1283 | F20FF07072715A230F6D73627072171F6D6A708277173F6D7397C7FC70846B6E72197E70 | |
1284 | 7217FE6E726170855118016E6870731503636E68704C6E15076E68718451180F6EDE7E7F | |
1285 | 607172151F6E06FE61714B7E08016F153F6E4E6C95C8FC71840803616F4D6C177E710207 | |
1286 | 6F15FE6F66714B7E080F7013016F4D6C5F7185081F18036F4D6C5F71023F7013076F94C7 | |
1287 | 5F728450180F6F047E6E5E7272131F1AFE6F4C6E5EDEE00171133F6F4C6E93C9FC06F084 | |
1288 | 070361704B6E157E06F87213FE1907704B6E5DDEFC0F1881704B6E5D06FE19C1071F18C3 | |
1289 | 704B6E5DDEFF3F18E7706407BFC9FC07FF18FF704A705CA3704A705CA27099CAFC4F82A2 | |
1290 | 7149705BA37149705BA27149705BA37149705BA37190CB5BA27148725AA37148725A7148 | |
1291 | 72CBFCA0637DE1A7>I<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE | |
1292 | 001F7FD97FE001077FD9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7F | |
1293 | A26C5B6D5AEB1FC090C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE00 | |
1294 | 4913F048B512C04891C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D | |
1295 | 7F6EEB01F96C6DD903F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E | |
1296 | 6C6C4B7E011F02FC130F010302F001011400D9001F90CBFC49437CC14E>97 | |
1297 | D<903807FF80B6FCA6C6FC7F7FB3A8EFFFF8040FEBFF80047F14F00381B612FC038715FF | |
1298 | 038F010014C0DBBFF0011F7FDBFFC001077F93C76C7F4B02007F03F8824B6F7E4B6F1380 | |
1299 | 4B17C0851BE0A27313F0A21BF8A37313FCA41BFEAE1BFCA44F13F8A31BF0A24F13E0A24F | |
1300 | 13C06F17804F1300816F4B5A6F4A5B4AB402075B4A6C6C495B9126F83FE0013F13C09127 | |
1301 | F00FFC03B55A4A6CB648C7FCDAC00115F84A6C15E091C7001F91C8FC90C8000313E04F65 | |
1302 | 7BE35A>I<92380FFFF04AB67E020F15F0023F15FC91B77E01039039FE001FFF4901F801 | |
1303 | 0113804901E0010713C04901804913E0017F90C7FC49484A13F0A2485B485B5A5C5A7113 | |
1304 | E0485B7113C048701380943800FE0095C7FC485BA4B5FCAE7EA280A27EA2806C18FCA26C | |
1305 | 6D150119F87E6C6D15036EED07F06C18E06C6D150F6D6DEC1FC06D01E0EC7F806D6DECFF | |
1306 | 00010701FCEB03FE6D9039FFC03FFC010091B512F0023F5D020F1580020102FCC7FCDA00 | |
1307 | 0F13C03E437BC148>I<F17FF8050FB5FCA6EF000F8484B3A892380FFF804AB512F8020F | |
1308 | 14FE023FECFF8391B712E301039138807FF3499039F8000FFB011F01E00103B5FC494913 | |
1309 | 004990C87E49488148498148834A815A485BA2485BA25AA3485BA4B5FCAE7EA46C7FA37E | |
1310 | A26C7FA26C5F806C5F6C6D5D6C6D5D017F93B5FC6D6C6C0103806D6D49806D01F0D91FF7 | |
1311 | EBFFFE6D9039FE01FFE7010190B612876D6CECFE07021F14F8020314E09127003FFE00EC | |
1312 | C0004F657BE35A>I<92380FFFC04AB512FC020FECFF80023F15E091B712F80103D9FE03 | |
1313 | 7F499039F0007FFF011F01C0011F7F49496D7F4990C76C7F49486E7F48498048844A8048 | |
1314 | 84485B727E5A5C48717EA35A5C721380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27E | |
1315 | A27E6E160FF11F806C183F6C7FF17F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E0 | |
1316 | 4A5A6D6DEC3FE0010301FC49B45A6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0 | |
1317 | 020092C8FC030713F041437CC14A>I<EE3FFC0307B51280033F14C04AB612F0020715F8 | |
1318 | 4A9038F03FFC4AEB807F913A7FFE00FFFE4A5A4B4813FF4913F05B4913E0A24913C0A270 | |
1319 | 13FE4949EB7FFCEF3FF8EF1FF0EF07C094C7FCB0B812C0A6D8001F01C0C8FCB3B3B0007F | |
1320 | B612FCA638657CE431>I<F107F8DB7FFEEC3FFE020FB5D8F001B5FC027FDAFE03148049 | |
1321 | B7128F49DCDFFD13C0010FD9F00FEBFFC149D9800114014990C7EBFC0349486E6C7E4948 | |
1322 | EC3FFF48496E018113800780130048F0C03E97C7FC48496E7FA34884A96C60A36C6D4A5B | |
1323 | A26C60A26C6D4A90C8FC6D6C4A5A6D6C4A5A6D6D485BDBF00F5B4990B612C060D97C7F4A | |
1324 | C9FCD9FC0F14F09126007FFECAFC92CCFC1201A47FA27F8014F091B77E18FE6CEFFFC019 | |
1325 | F06D17FC19FF6D846D846D846D84013F8490BAFC0003854801E0C712014890C9000F7F48 | |
1326 | 4816014848EE007F4848717E8512FF5B85A56D5F007F616D173F003F616D177F6C6C4D5A | |
1327 | 6C01C003035B6C6D4B5B6C01F8031F5BC601FF92B5C7FC6D01F8011F5B011F90B712F801 | |
1328 | 0717E0010094C8FC020F15F0DA003F01FCC9FC4A607CC151>I<903807FF80B6FCA6C6FC | |
1329 | 7F7FB3A8EF1FFF94B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FDB83 | |
1330 | F86D7FDB87F07FDB8FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8 | |
1331 | F007B71280A651647BE35A>I<EB0FE0EB3FF8497E48B5FCA24880A24880A76C5CA26C91 | |
1332 | C7FCA238007FFC6D5AEB0FE090C9FCAF903807FF80007FB5FCA6C6FC7F7FB3B3AEB712C0 | |
1333 | A622657BE42C>I<ED01FCED07FF4B1380033F13E0A24B13F0A292B512F8A76F13F0A26F | |
1334 | 13E0A2030F13806F1300ED01FC92C8FCAFEEFFF8021FB5FCA6EC000F8181B3B3B3AAEA07 | |
1335 | F0EA1FFC487E487EB56C4813F0A317E05D17C05D17806C4948130049495A6C48495A261F | |
1336 | FE0313F06CB65A6C158000014AC7FC6C6C13F8010713802D8288E431>I<903807FF80B6 | |
1337 | FCA6C6FC7F7FB3B3B3B3ADB712E0A623647BE32C>108 D<902607FF80D91FFFEEFFF8B6 | |
1338 | 91B500F00207EBFF80040702FC023F14E0041F02FF91B612F84C6F488193267FE07F6D48 | |
1339 | 01037F922781FE001F9027E00FF0007FC6DA83F86D9026F01FC06D7F6DD987F06D4A487F | |
1340 | 6DD98FC0DBF87EC7804C6D027C80039FC76E488203BEEEFDF003BC6E4A8003FC04FF834B | |
1341 | 5FA24B5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB612FCA67E417BC087>I<902607 | |
1342 | FF80EB1FFFB691B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FC6DA83 | |
1343 | F86D7F6DD987F07F6DD98FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2 | |
1344 | B7D8F007B71280A651417BC05A>I<923807FFE092B6FC020715E0021F15F8027F15FE49 | |
1345 | 4848C66C6C7E010701F0010F13E04901C001037F49496D7F4990C87F49486F7E49486F7E | |
1346 | 48496F13804819C04A814819E048496F13F0A24819F8A348496F13FCA34819FEA4B518FF | |
1347 | AD6C19FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19E06C6D4B13C0A26C6D4B13806C | |
1348 | 6D4B13006D6C4B5A6D6D495B6D6D495B010701F0010F13E06D01FE017F5B010090B7C7FC | |
1349 | 023F15FC020715E0020092C8FC030713E048437CC151>I<902607FF80EBFFF8B6010FEB | |
1350 | FF80047F14F00381B612FC038715FF038F010114C09227BFF0003F7FC6DAFFC0010F7F6D | |
1351 | 91C76C7F6D496E7F03F86E7F4B6E7F4B17804B6F13C0A27313E0A27313F0A21BF885A21B | |
1352 | FCA3851BFEAE4F13FCA41BF861A21BF0611BE0611BC06F92B512801B006F5C6F4A5B6F4A | |
1353 | 5B03FF4A5B70495B04E0017F13C09226CFFC03B55A03C7B648C7FC03C115F803C015E004 | |
1354 | 1F91C8FC040313E093CBFCB3A3B712F0A64F5D7BC05A>I<D90FFFEB0FFCB690383FFF80 | |
1355 | 93B512E04B14F04B14F8923907FC7FFC92390FE0FFFEC6EC1F806DD93F0113FF6D133E15 | |
1356 | 7E157C15F8A215F07013FEA24BEB7FFCEF3FF8EF0FE04B90C7FCA55DB3B0B712F8A63841 | |
1357 | 7BC042>114 D<913A3FFF8007800107B5EAF81F011FECFE7F017F91B5FC48B8FC48EBE0 | |
1358 | 014890C7121FD80FFC1407D81FF0801600485A007F167F49153FA212FF171FA27F7F7F6D | |
1359 | 92C7FC13FF14E014FF6C14F8EDFFC06C15FC16FF6C16C06C16F06C826C826C826C82013F | |
1360 | 1680010F16C01303D9007F15E0020315F0EC001F1500041F13F81607007C150100FC8117 | |
1361 | 7F6C163FA2171F7EA26D16F0A27F173F6D16E06D157F6D16C001FEEDFF806D0203130002 | |
1362 | C0EB0FFE02FCEB7FFC01DFB65A010F5DD8FE0315C026F8007F49C7FC48010F13E035437B | |
1363 | C140>I<EC07E0A6140FA5141FA3143FA2147FA214FF5BA25B5B5B5B137F48B5FC000F91 | |
1364 | B512FEB8FCA5D8001F01E0C8FCB3AFEF0FC0AC171F6D6D1480A2173F6D16006F5B6D6D13 | |
1365 | 7E6D6D5B6DEBFF836EEBFFF86E5C020F14C002035C9126003FFCC7FC325C7DDA3F>I<90 | |
1366 | 2607FFC0ED3FFEB60207B5FCA6C6EE00076D826D82B3B3A260A360A2607F60183E6D6D14 | |
1367 | 7E4E7F6D6D4948806D6DD907F0ECFF806D01FFEB3FE06D91B55A6E1500021F5C020314F8 | |
1368 | DA003F018002F0C7FC51427BC05A>I<B700C00103B512FCA6C66C01C0C8381FFE006D6D | |
1369 | ED07F0A26D6D5E190F6D6D5E191F6D606F153F6D95C7FC6F5DA26D6D157E19FE6D6E5C18 | |
1370 | 016E5E7013036E5E701307A26E6D5C180F6E6D5C181F6E6D5C183F6E93C8FC705BA26E6D | |
1371 | 13FEA26E6E5A17816FEBC1F817C36F5C17E76F5C17FFA26F5CA26F5CA26F91C9FCA26F5B | |
1372 | A36F5BA2705AA2705AA2705AA2705A4E417DBF55>I<007FB600C0017FB512F8A6D8001F | |
1373 | 01F8C70007EBF0006D040190C7FC6D6D5D6D6D4A5A6D6D4A5A70495A6D4C5A6E7F6E6D49 | |
1374 | 5A6E6D495A7049C8FC6E4A5A6E6D485A6E6D485A6E13FFEF8FF06EEC9FE06FEBFFC06F5C | |
1375 | 6F91C9FC5F6F5B816F7F6F7F8481707F8493B57E4B805D4B80DB0FF37FDB1FE17F04C080 | |
1376 | 153F4B486C7F4B486C7F4A486D7F4A486D7F4A5A4B6D7F020F6E7F4A486D7F4A486D804A | |
1377 | 5A4AC86C7F49486F7F4A6F7F0107707FEB3FFFB600F049B7FCA650407EBF55>120 | |
1378 | D<B700C00103B512FCA6D8003F01C0C8381FFE006FED07F0A26D6D5E190F6D6D5E191F6D | |
1379 | 6D5E193F6D95C7FC6F5D6D177E6F15FEA26D6E495AA26E6D5C18036E6D5C18076E5E7013 | |
1380 | 0F6E5E70131FA26E6D495AA26E6D91C8FC606E6D137E18FE6E5D17816F5C17C3A26FEBE7 | |
1381 | F0A26FEBF7E017FF6F5CA26F5CA26F91C9FCA36F5BA26F5BA2705AA2705AA2705AA35FA2 | |
1382 | 5F163F94CAFC5E167E16FED807E05CD81FF81301487E486C495AA2B5495AA24B5A5E151F | |
1383 | 4B5A6C4849CBFC15FEEBFC01393FF807FC391FF03FF06CB55A6C5C6C91CCFCC613FCEB1F | |
1384 | E04E5D7DBF55>I E | |
1385 | %EndDVIPSBitmapFont | |
1386 | %DVIPSBitmapFont: Fp cmsy10 10.95 5 | |
1387 | /Fp 5 56 df<007FB812F8B912FCA26C17F83604789847>0 D<EE7FFE0307B512E0033F | |
1388 | 14FC92B7FC0203D9C00313C0DA0FFCC7EA3FF0DA3FE0EC07FCDA7F80EC01FED901FEC9EA | |
1389 | 7F80D903F8EE1FC0D907E0EE07E04948707E4948707E49CB7E017E187E498449844848F0 | |
1390 | 0F8000031AC04918074848F003E0A24848F001F0A248CD12F8A2001E1A78003E1A7CA200 | |
1391 | 3C1A3C007C1A3EA200781A1EA300F81A1FA2481A0FAB6C1A1FA200781A1EA3007C1A3EA2 | |
1392 | 003C1A3C003E1A7CA2001E1A78001F1AF8A26C6CF001F0A26C6CF003E0A26C6CF007C06D | |
1393 | 180F00011A806C6CF01F006D60017E187E6D606D6C4C5A6D6C4C5A6D6C4C5AD903F8EE1F | |
1394 | C0D901FEEE7F809026007F80DA01FEC7FCDA3FE0EC07FCDA0FFCEC3FF0913B03FFC003FF | |
1395 | C0020090B6C8FC033F14FC030714E09226007FFEC9FC50557BC05B>13 | |
1396 | D<EB0FFCEB3FFF90B512C0000314F04880488048804880A2481580A3B712C0AA6C1580A3 | |
1397 | 6C1500A26C5C6C5C6C5C6C5CC614C0013F90C7FCEB0FFC22227BA72D>15 | |
1398 | D<19301978A2197C193CA2193E191EA2191F737EA2737E737EA2737E737E1A7C1A7EF21F | |
1399 | 80F20FC0F207F0007FBB12FCBDFCA26C1AFCCDEA07F0F20FC0F21F80F27E001A7C624F5A | |
1400 | 4F5AA24F5A4F5AA24FC7FC191EA2193E193CA2197C1978A2193050307BAE5B>33 | |
1401 | D<126012F0AE12FC12FEA212FC12F0AE126007227BA700>55 D E | |
1402 | %EndDVIPSBitmapFont | |
1403 | %DVIPSBitmapFont: Fq cmsl10 10.95 54 | |
1404 | /Fq 54 122 df<9339FFC003F8030F9038F01FFE923A3FC07C7E0F923BFE001FF81F80DA | |
1405 | 03F890383FF07F4A48D9FFE013C0EC1FE04A4848EBC0FF03804A1380DA7F00157F4A9238 | |
1406 | 003E004A6D91C7FC8301015D4A5CA4160113034A5CA416030007B812FCA3290007F00003 | |
1407 | F8C8FCA21607130F4A5CA4160F131F4A5CA4161F133F4A5CA4163F137F91C75BA4167F5B | |
1408 | 4992C9FCA31201486C49487EB5D8F83F13FF5DA242407EBF35>11 | |
1409 | D<EEFF80030F13F092383FC0789238FE001CDA03F8130E4A48133FDA1FE013FF4A5A4B5A | |
1410 | EC7F005C5CEE00FE010115784A1400A513035CA4EE01FC0003B7FC17F8A23A0007F0000F | |
1411 | 1607A2130F4A14F0A4160F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F | |
1412 | 5B491500A31201486C903801FF80B5D8F83F13FCA25D30407EBF33>I<DCFF80EB7FC003 | |
1413 | 0F9039E007FFF8923B3F80781FE03C923BFE003C7F000EDA03F8D91FFC7F4A484948EB1F | |
1414 | 80DA1FE0D9FFF0137F4A48485B03804A13FFDA7F005C5C4A92C7FCF27F0001016E153C4A | |
1415 | 4A91C7FCA5010314014A5CA41AFE0003BAFC62A23D0007F00003F800071903A2010F1407 | |
1416 | 4A4A5CA41907011F140F4A4A5CA4190F013F141F4A4A5CA4191F017F143F91C7495CA419 | |
1417 | 3F49147F4992C75BA31201486C49486CEBFFC0B5D8F83FD9FC1F13FE605D49407EBF4C> | |
1418 | 14 D<140E141E143EA4143CA3000FEC01E03A1F803803F001C0130F01F0EB1FE0D807F8 | |
1419 | EB7FC03A01FC70FE003900FE73F890383F77E090380FFF80D903FEC7FCEB00F0EB03FCEB | |
1420 | 1FFF90387EEFC03901FCE7F03907F0E3FC391FE0E1FF3A7F81E07F80903801C03F00FC14 | |
1421 | 1F0078EC0F00D8200390C7FC1200A31307A35C91C8FC242774C32D>42 | |
1422 | D<007FB5FCA2B512FEA418067C961E>45 D<157015F014011407143F903803FFE0137FEB | |
1423 | FFCFEBF80F1300141F15C0A5143F1580A5147F1500A55C5CA513015CA513035CA513075C | |
1424 | A5130F5CA3131F497EB612F8A31D3D78BC2D>49 D<EC01FE91380FFFE0023F13F89138FC | |
1425 | 07FC903901E001FE903907C000FF49C7EA7F80011E15C0163F4915E05B0170141F13FF80 | |
1426 | A35A163FA26C90C7FC137E0118EC7FC090C8FCEEFF80A24B1300A24B5A5E4B5A4B5A4B5A | |
1427 | 5E4B5A4BC7FC15FEEC01F84A5A4A5A4A5A4AC8FC143E5C5CEB01E04948130E49485B49C7 | |
1428 | FC131E495C13705B48485C484814F0000FB6FC5A485D5AB7FC5EA22B3D7CBC2D>I<EC07 | |
1429 | FC91383FFF809138F80FE0903903C007F09039078003FC90380F0001011C14FE013C14FF | |
1430 | 137F1480EBFFC0A31480A291380003FE137E90C7FCED07FC16F8150F16F0ED1FE016C0ED | |
1431 | 3F80ED7E005DEC07F0903803FF8015F090380001FC6E7EED7F80ED3FC0A2ED1FE016F0A3 | |
1432 | 16F8A4120EEA3F80486C133F16F012FFA216E0157F5B48C7EAFFC000F015800070491300 | |
1433 | 12786C495A003EEB07F86C495A390FE03FE00003B51280C649C7FCEB1FE0283F7ABC2D> | |
1434 | I<17E016011603831607A2160FA2161F83163FA2167F167716F7EEE7FCED01E316C31503 | |
1435 | 16831507EE03FEED0F01150E151E151C153C03387FED7800157015F05D4A4880177F4A5A | |
1436 | A24AC7FCA2020E81173F5C021FB6FC5CA20270C7EA3FE0171F5CA2495AA2494881170F49 | |
1437 | C8FCA2130EA24982013C1507A2137CD801FE4B7E2607FF80EC3FFEB500F00107B512FC19 | |
1438 | F85E3E417DC044>65 D<013FB7FC18E018FC903B007FE00007FE6E48903801FF80943800 | |
1439 | 7FC05DF03FE0F01FF0A3027F16F892C8FCA54A16F04A153F19E0187F19C0F0FF8001014B | |
1440 | 13004A4A5A4D5AEF1FF04D5ADC03FFC7FC49B612F8EFFF8002F8C7EA3FE0EF0FF0EF07FC | |
1441 | 717E010715014A81711380A319C0130F5CA5011F4B13805C19005F601707013F4B5A4A4A | |
1442 | 5A4D5A4D5A017F913801FF8001FF020F90C7FCB812FC17F094C8FC3D3E7DBD40>I<DCFF | |
1443 | C01338030F01F01378037F01FC13F0913A01FF803F01913A07FC000781DA1FE0EB03C3DA | |
1444 | 7FC0EB01E74AC812FF4948ED7FE0D907FC153F495A4948151F495A4948150F494816C018 | |
1445 | 074890C9FC485AA2485A000F1880491603121FA248481607A295C7FC485AA412FF5BA75B | |
1446 | A2181C183C1838A27F007F1778187018F0003F5F6D150160001F16036C6C4B5A95C7FC6C | |
1447 | 6C5D6C6C151E6C6C5D6C6C15F86D6C495A6D6CEB07C0D91FF0EB1F80D907FE01FEC8FC01 | |
1448 | 01B512F86D6C13E0DA07FEC9FC3D4276BF42>I<013FB7FC18E018F8903B007FF0000FFE | |
1449 | 6E48EB01FF9438007FC04B6E7E180F85727E727E147F4B6E7EA2727EA302FF178092C9FC | |
1450 | A54918C05CA41A8013034A5DA41A0013074A5DA261A24E5A130F4A5E180F61181F61011F | |
1451 | 4C5A5C4E5A4EC7FC4D5A4D5A013F4B5A4A4A5AEF3FE0EF7F80017F4A48C8FC01FFEC1FFC | |
1452 | B812F0178004FCC9FC423E7DBD45>I<013FB812F8A39026007FF0C7127F6E48140F1803 | |
1453 | 4B14011800A31978147F4B1570A502FF147092C7FCA3190017F0495D4A1301A21607161F | |
1454 | 91B6FC495DA29138FC003F160F1607160301075D5CA219E0180119C0010FEC07004A90C7 | |
1455 | 12031980A218071900011F5E5C181EA2183E183C013F167C4A15FC4D5A1707017F151F01 | |
1456 | FF4AB45AB9FCA2603D3E7DBD3E>I<013FB812E0A3903A007FF000016E48EB003F180F4B | |
1457 | 14071803A31801147F4B15C0A514FF92C71270A395C7FC17F0495D5C160116031607161F | |
1458 | 49B65AA39138FC003F160F160701075D4A1303A5010F4AC8FC5C93C9FCA4131F5CA5133F | |
1459 | 5CA3137FEBFFF0B612F8A33B3E7DBD3B>I<4BB46C1370031F01F013F0037F9038FC01E0 | |
1460 | 913A03FF807E03913A0FF8000F83DA1FE0EB07C7DA7F80EB01EF4AC812FFD903FE16C049 | |
1461 | 48157F4948153F495A4948151F495A4948168091C9120F5A485AA2485A000F1800498212 | |
1462 | 1FA248485EA295C7FC485AA412FF5BA6043FB512E05BA29339001FFC00715AA2607F127F | |
1463 | A2171F123F6D5EA2121F7F000F163F6C7E6C6C4B5A7F6C6C15FF6C6DEB01EFD93FC0EB07 | |
1464 | C7D91FF0EB1F87D907FE9038FE03800101B5EAF8016D6C01E0C8FCDA07FEC9FC3C4276BF | |
1465 | 47>I<013FB5D8F807B6FC04F015FEA29026007FF0C7380FFE006E486E5AA24B5DA4180F | |
1466 | 147F4B5DA4181F14FF92C85BA4183F5B4A5EA491B8FC5B6102FCC8127FA318FF13074A93 | |
1467 | C7FCA45F130F4A5DA41703131F4A5DA41707133F4A5DA3017F150F496C4A7EB6D8E01FB5 | |
1468 | 12FC6115C0483E7DBD44>I<011FB512FC5BA29039003FF8006E5AA25DA5143F5DA5147F | |
1469 | 5DA514FF92C7FCA55B5CA513035CA513075CA5130F5CA5131F5CA3133F497E007FB512F0 | |
1470 | A2B6FC263E7EBD21>I<013FB500F8010FB5FC4C5BA29026007FF0C7000313E06E486E13 | |
1471 | 0019FC4B15F04E5A4E5A4E5A061EC7FC027F5D4B5C4D5A4D5AEF07804DC8FC02FF141E92 | |
1472 | C7127C5FEE01E04C5A4C5A49021FC9FC4A5B5E4C7E5D03077F01035B9139FC1F3FE0153C | |
1473 | 4B6C7E15F09139FFE00FF84913C092380007FC5C4A6D7E5C707E130F4A6D7F84177F717E | |
1474 | A2011F6F7E5C717EA2717EA2013F6F7E5C84A2017F83496C4A13E0B600E0017F13FFA24B | |
1475 | 90B6FC483E7DBD47>75 D<013FB512FEA25E9026007FF8C8FCEC3FE0A25DA5147F5DA514 | |
1476 | FF92C9FCA55B5CA513035CA513075CA21838A21870130F5CA218E0A3011F15014A15C017 | |
1477 | 03A21707EF0F80013F151F4A143F177FEFFF00017F140301FF143FB9FC5FA2353E7DBD39 | |
1478 | >I<90263FFFF093381FFFF85013F0629026007FF8EFF000023F4D5AA2023B933801DFC0 | |
1479 | A2DA39FCED039FA2F1073F14790271040E5BEC70FE191C19381A7F02F01670DAE07F94C7 | |
1480 | FC19E0A2F001C06201016D6C495A02C05FF00700A2180E6F6C14010103161C028003385B | |
1481 | A218706F7EF0E00313070200DA01C05BA2923907F00380A294380700075B010E902603F8 | |
1482 | 0E5C5FA25F190F011E6D6C5A011C605FA2EEFDC0DB00FF141F013C5D013860013C92C7FC | |
1483 | 017C5C01FE027E143F2607FF80017C4A7EB500FC037FB512E004785E4A1338553E7CBD53 | |
1484 | >I<90263FFFE0023FB5FC6F16FEA29026003FF8020313C0021F030013004A6C157C023B | |
1485 | 163C6F15381439810238167802787FDA707F157082153F82031F15F002F07FDAE00F5D82 | |
1486 | 15078203031401010180DAC0015D82811780047F1303010315C04A013F5C17E0161F17F0 | |
1487 | 040F1307010715F891C7000791C7FC17FC160317FE04015B4915FF010E6E130E188E177F | |
1488 | 18CEEF3FDE011E16FE011C6F5AA2170FA21707133C01386F5A133C017C150113FE2607FF | |
1489 | 801400B512FC18705C483E7DBD44>I<923803FF80031F13F09238FE01FE913903F0003F | |
1490 | DA0FC0EB1FC0DA3F80EB07E0027EC76C7E49486E7E49488149486E7E4948157F495A013F | |
1491 | 17804948ED3FC049C9FCA24848EE1FE012035B000718F05B120FA2485A19F8123F5BA212 | |
1492 | 7FA219F04848163FA5F07FE0A35BF0FFC0A219805F19007F4D5A127F4D5A60003F160F6D | |
1493 | 5E001F4C5A4D5A6C6C4B5A95C7FC6C6C15FE00034B5A6C6C4A5A6C6C4A5A017FEC1FC06D | |
1494 | 6C495AD90FE001FEC8FC903903F807F80100B512C0DA0FFCC9FC3D4276BF47>I<013FB6 | |
1495 | 12FEEFFFE018F8903B007FF0000FFC6E48EB01FF7113804BEC7FC0183F19E0F01FF0A214 | |
1496 | 7F5D19F8A402FFED3FF092C8FCA219E0A2F07FC05B4AEDFF8019004D5A4D5AEF0FF80103 | |
1497 | ED3FE04A903801FF8091B648C7FC17F002FCCAFCA213075CA5130F5CA5131F5CA5133F5C | |
1498 | A3137F497EB612E0A25D3D3E7DBD3E>I<013FB612F017FF18E0903B007FF0003FF86E48 | |
1499 | EB07FCEF01FE4B6D7EF07F8019C0183F19E0147F4B15F0A502FFED7FE092C8FCA219C0F0 | |
1500 | FF80A2494B13004A5D4D5AEF0FF04D5AEF7F800103DA07FEC7FC91B612F017809139FC00 | |
1501 | 07E0EE03F8EE00FC0107814A147F717EA284A2130F5CA484011F157F5CA41902013F1707 | |
1502 | 5CA2F0F00F017F170E496C143FB600E0011F131C94380FF83C4B01071378CA3801FFE094 | |
1503 | 38003F8040407DBD43>82 D<9238FF80070207EBE00F021FEBF81E91387F00FE02FCEB1F | |
1504 | 3ED903F0EB0FFE49481307494813034AEB01FC49C7FC491400133E137E177C491578A57F | |
1505 | 1770A26D1500808080EB7FFEECFFE06D13FEEDFFC06D14F06D14FC010380010080143F02 | |
1506 | 031480DA003F13C015031500EE7FE0163F161FA2160F121CA31607160F003C16C0A31780 | |
1507 | 003E151F1700007E5D007F153E6D5C16FC01E0495AD87DF0495AD8FCFCEB0FC03AF87F80 | |
1508 | 3F8027F01FFFFEC7FCD8E00713F839C0007FC030427BBF33>I<0007B912F0A33C0FFE00 | |
1509 | 0FF8003F01F0160F01C04A13034848160190C7FC121EF000E048141F5E1238A212781270 | |
1510 | 153F5E5AA3C81600157F5EA515FF93C9FCA55C5DA514035DA514075DA5140F5DA3141FEC | |
1511 | 7FFC0003B7FCA33C3D76BC42>I<B600E090B512FC4B15F8A2000101C0C7000F13006C49 | |
1512 | EC03FCEF01F091C9FC60A317015A495EA417031203495EA4170712074993C7FCA45F120F | |
1513 | 49150EA4171E121F49151CA4173C123F491538A31778177017F05F001F15015F16036D4A | |
1514 | 5A000F93C8FC5E6C6C141E6C6C5C000115F86C6C495A017FEB07C090393FC03F8090260F | |
1515 | FFFEC9FC010313F89038007FC03E4073BD44>I<B6017FB5D88007B512804A1A00A20007 | |
1516 | 01C0010101E0C713F06C90C80180EC3FC06C48735A99C7FC057F150E1B1E6D191C6C1A3C | |
1517 | 1B3805FF15787214705E636EEB03BF017F4E5AEE073F505A040E7F051F4AC8FC161C6E17 | |
1518 | 0E013F143862167804706D5BEEF00F04E05D90381FE00104C015F003035E0480140106F8 | |
1519 | 5B9226070007130302F05F010F010E150797C9FC5D190E4BEB03FC616E5A01075F5D61DA | |
1520 | F9C014FE05015BECFB8002FF6F5A7F92C75CA24A93CAFC835C606D5A605C604A15781870 | |
1521 | 594074BD5D>87 D<010FB500F090B512F85B5FD9003F902680003F1300DA0FFEC7EA1FF8 | |
1522 | 4BEC0FE00207168096C7FC6E6C141E181C6E6C143C606E6D5B4D5ADB7FC05B4D5A92383F | |
1523 | E0074DC8FC92381FF01E171C6F6C5A5F923807FCF0EEFDE06FB45A5F6F90C9FCA26F7FA2 | |
1524 | 707EA216FF4B7FED03DF9238079FF0ED0F1F92380E0FF8151C92383C07FC15784B6C7EEC | |
1525 | 01E04B6C7EEC038002076D7F4AC7FC021E6E7E5C02386E7E5C02F06E7E495A49486E7E13 | |
1526 | 0749486E7E497E017F4B7E2603FFF091383FFF80007F01FC49B512FEB55CA2453E7EBD44 | |
1527 | >I<EC7FC0903803FFF890380FC07E90383E003F496D7E01FF6D7E82A248140782A26C5A | |
1528 | 137890C7120FA25EA2EC03FF147F903807FF1FEB1FE0D97F805B3801FE00EA03F8485A48 | |
1529 | 48133F485A003F5D49EC81C048C7FCA2157F48ED03804814FFA2007F5B913903BF070090 | |
1530 | 3880073F3A3FC00E1F8E260FE03C13FC3A03FFF00FF83A007FC003E02A2A7CA82D>97 | |
1531 | D<EB3F80EA1FFFA3C6FC137FA291C9FCA55B5BA512015BA4EC07F80003EB3FFF9039F8F8 | |
1532 | 0FC09039FBE003E09039FF8001F891C77E5B4848147E49147F5B821780A2120F5B17C0A3 | |
1533 | 167F001F16805BA4EEFF00123F5B4B5AA24B5A5E007F4A5AA24B5A6D495A4BC7FCD87CE0 | |
1534 | 137E39F87001F839F03C07E039E00FFF80260003FCC8FC2A4077BE33>I<EC1FF0ECFFFE | |
1535 | 903903F01F8090390FC003C0D93F0013E0017E130F49131F000115F04848EB3FE0485AA2 | |
1536 | 4848EB1FC0001FEC0F004990C7FC123FA2485AA412FF90C9FCA96CEC0380150716006C6C | |
1537 | 5B151E001F5C6C6C5B6C6C5B6C6C485A3901F80F8026007FFEC7FCEB0FF0242A7AA828> | |
1538 | I<EE03F8ED01FFA3ED000F1607A217F0A4160FA217E0A4161FA217C0A491380FF03FECFF | |
1539 | FC902603F81F138090390FC007BF90391F8003FF90387E0001497F0001157F4848150048 | |
1540 | 5A120F5B001F5D485A5E5B127FA2150112FF90C75BA41503A25EA37E1507A26C4A5A7F00 | |
1541 | 1F141F6C6C133F6C6CEBFFF83B03F001EFFFC03900F80F8F90383FFE0FD90FF0EBE0002D | |
1542 | 407ABE33>I<EC3FE0903801FFF8903807E07E90380F801F90393F000F80017E14C049EB | |
1543 | 07E0485A12034848EB03F0485AA2121F5B123FA248481307A290B6FCA2D8FF80C8FC90C9 | |
1544 | FCA87EED01C015036C15806D1307001FEC0F006D131E000F5C6C6C5B6C6C485A3900FC07 | |
1545 | C0D93FFFC7FCEB07F8242A7BA828>I<ED07F0ED3FFCEDFC1E913803F03F4A48B4FC4A48 | |
1546 | 1380141FEC3F81DA7F0113008102FE137C93C7FCA213015CA513035CA50007B512F8A326 | |
1547 | 0007F0C8FCA3130F5CA5131F5CA5133F5CA5137F91C9FCA55B5BA4EA03FF007F13FEB5FC | |
1548 | A229407DBF1C>I<177C913907F803FE91393FFE0F8F9139FC0F9C3F903901F007F89039 | |
1549 | 07E003E0D90FC013F0011F903801F80C02801400133FD97F007FA315035B495CA3017E49 | |
1550 | 5A5E150F6D5C6D495A90263F803EC7FCECC0FC903871FFF09038E07F8091C9FC485AA47F | |
1551 | A27F90B512F8EDFF806C15E016F86D8048B6FC3A07E0000FFED80F801300003FC8127F00 | |
1552 | 3E815A00FC815AA25E163EA25E6C15FC007C4A5A6C4A5A6CEC0FC0D80FC0013FC7FC3903 | |
1553 | F801FCC6B512F0010F90C8FC303D7FA82D>I<147FEB3FFFA313017FA25CA513015CA513 | |
1554 | 035CA4ED07F80107EB1FFF9139F0781FC09138F1E00F9139F38007E0ECF70002FE14F049 | |
1555 | 5A5CA25CA24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B4915 | |
1556 | 00A300015D486C491380B5D8F87F13FCA32E3F7DBE33>I<1478EB01FE130314FFA25B14 | |
1557 | FE130314FCEB00F01400ACEB03F8EA01FF14F0A2EA001F130FA314E0A5131F14C0A5133F | |
1558 | 1480A5137F1400A55B5BA4EA03FF007F13F0A2B5FC183E7DBD1A>I<ED0780ED1FE0153F | |
1559 | 16F0157FA216E0153F16C0ED0F0092C7FCACED7F80EC3FFF1600A2140180A35DA41401A2 | |
1560 | 5DA41403A25DA41407A25DA4140FA25DA4141FA25DA4143F5DA4121E267F807FC7FCA200 | |
1561 | FF137E14FE5CEB01F8495A387C07E0383C0FC0D80FFFC8FCEA03F8245187BD1C>I<147F | |
1562 | EB3FFFA313017FA25CA513015CA513035CA501070103B5FC02F014FEA26F13F06F1380EE | |
1563 | FE00010F14F84A485AED03C04B5A031FC7FC153E011F13784A5AECC3E0ECC7F0ECCFF814 | |
1564 | FF497F14F9ECE1FE14C04A7E4A7E4980017E133F82151F82150F01FE8049130782A20001 | |
1565 | 81486C49B4FCB5D8F03F13F04B13E0A2303F7EBE30>I<143FEB1FFF5BA213017FA214FE | |
1566 | A5130114FCA5130314F8A5130714F0A5130F14E0A5131F14C0A5133F1480A5137F1400A5 | |
1567 | 5B5BA4EA03FF007F13F8A2B5FC183F7DBE1A>I<902707F007F8EB03FCD803FFD91FFF90 | |
1568 | 380FFF80913CE0781FC03C0FE09126E1E00FEBF0073E001FE38007E1C003F090260FE700 | |
1569 | EBE38002EEDAF70013F802FC14FE02D85C14F84A5CA24A5C011F020F14074A4A14F0A501 | |
1570 | 3F021F140F4A4A14E0A5017F023F141F91C74914C0A549027F143F4992C71380A300014B | |
1571 | 147F486C496DEBFFC0B5D8F87FD9FC3F13FEA347287DA74C>I<903907F007F8D803FFEB | |
1572 | 1FFF9139E0781FC09138E1E00F3B001FE38007E090380FE70002EE14F014FC14D814F85C | |
1573 | A24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B491500A30001 | |
1574 | 5D486C491380B5D8F87F13FCA32E287DA733>I<EC0FF0ECFFFE903903F01F8090390FC0 | |
1575 | 07C049C66C7E013E6D7E01FC6D7E48488049147C0003157E485A000F157F5B121FA2485A | |
1576 | A2007F1680A2170048C85AA54B5AA25E5A6C4A5A7E4B5A5E6C140F6C6C5C4B5A6C6C013E | |
1577 | C7FC6C6C5B6C6C485A3900FC0FE090383FFF80D90FF8C8FC292A7BA82D>I<91387F01FE | |
1578 | 903A7FFF0FFFC09139FE3E03F09238F801F8903A03FFE000FE6D49137F4B7F92C713804A | |
1579 | 15C04A141FA218E0A20103150F5C18F0A3171F010716E05CA3173F18C0130F4A147F1880 | |
1580 | A2EFFF004C5A011F5D16034C5A6E495AEE1FC06E495AD93FDC017EC7FC91388F01F89138 | |
1581 | 83FFE0028090C8FC92C9FC137FA291CAFCA45BA25BA31201487EB512F8A3343A81A733> | |
1582 | I<91390FE003C0DAFFFC1380903903F81E0790390FE0070F90391F80038FD97F0013DF01 | |
1583 | FE13014848903800FF00485A1207485A8248485C123F495CA2485AA2150112FF90C75BA4 | |
1584 | 1503A25EA37E15077F003F4A5A151F6C6C133F6C6C137F000714FF3903F003CF3A00FC0F | |
1585 | 8FE090383FFE0FEB0FF090C7FC151F5EA5153F5EA4157F4B7E023F13FEA32A3A7AA730> | |
1586 | I<903907F01F80D803FFEB7FE09138E1E1F09138E387F839001FE707EB0FE614EE02FC13 | |
1587 | F002D813E09138F801804AC7FCA25C131FA25CA4133F5CA5137F91C8FCA55B5BA3120148 | |
1588 | 7EB512FEA325287EA724>I<9138FF81C0010713E390381F807F90397C003F8049131F48 | |
1589 | 48130F5B00031407A248481400A27FA27F6D90C7FCEBFF8014FC6C13FF6C14C015F06C6C | |
1590 | 7F011F7F13079038007FFE1403140100381300157EA2123C153E157E007C147CA2007E14 | |
1591 | 7815F8007F495A4A5A486C485A26F9E01FC7FC38E0FFFC38C01FE0222A7DA824>I<EB03 | |
1592 | 80A4130791C7FCA25BA25BA2133EA2137E13FE12011207001FB512C0B6FCA2D801FCC7FC | |
1593 | A312035BA512075BA5120F5BA41407001F130E13C0A4141E141C1380A26D5AA2000F5B14 | |
1594 | F03807E1E03801FF80D8007EC7FC1A3978B723>I<01FE147F00FFEC7FFF4914FEA20007 | |
1595 | 140300031401A34914FCA4150312074914F8A41507120F4914F0A4150F121F4914E0A215 | |
1596 | 1FA3153F4914C0157F15FFEC01DF3A0FC003BFE09138073FFF3803F01E3801FFF826003F | |
1597 | E01380282977A733>I<B539E007FFF05D17E02707FE000313006C48EB01FC6F5A5E0001 | |
1598 | 4A5A5EA24B5A6D1307000092C7FC5D150E6D5B7F5DA25D1480013F5B14815D14C3011F5B | |
1599 | 02C7C8FCA214CE14EEEB0FFCA25CA26D5A5CA25CA26D5A2C2878A630>I<B500C3B53803 | |
1600 | FFFCA204FE14F8290FFE003FE00013C0D807F86D48EB7F000003173E183C150F18386D5E | |
1601 | 0001141F705B153F4D5A15776D4B5A0000ECE7F04DC7FCEC01C3170E9038FF0383017F5D | |
1602 | 91380703F85FEC0E01021E5CD93F9C14F002BC6D5A02B813FDDAF8005B4A13FF5F6D5A94 | |
1603 | C8FC5C4A137E167C6DC7FC1678010E14383E2878A642>I<48B539C07FFFC0A33C000FFE | |
1604 | 003FF8006D48EB1FE0010315800101023EC7FC6E133C01005C027F5B6F5A91383F81C0ED | |
1605 | C380DA1FC7C8FC15EFEC0FFE6E5A5D140381A24A7E140FEC1E7F023C7FEC383F02707FEC | |
1606 | E01F010180903803C00F49486C7ED90F007F491303017E80D801FE80D807FF497EB5D880 | |
1607 | 3F13F8A332277FA630>I<90B539E007FFF05E18E0902707FE000313006D48EB01FC705A | |
1608 | 5F01014A5A5F16036E5C0100140794C7FC160E805E805E1678ED8070023F13F05EED81C0 | |
1609 | 15C191381FC38015C793C8FC15EF15EEEC0FFCA25DA26E5AA25DA26E5A5DA24AC9FC5C14 | |
1610 | 0E141E141C5C121C003F5B5A485B495A130300FE5B4848CAFCEA701EEA783CEA3FF0EA0F | |
1611 | C0343A80A630>I E | |
1612 | %EndDVIPSBitmapFont | |
1613 | %DVIPSBitmapFont: Fr cmbx12 14.4 73 | |
1614 | /Fr 73 122 df<922601FFFC903801FFE0033F9026FF801F13F84AB6D8E07F13FE020F03 | |
1615 | F9B6FC023FD9C00FB500C0138091277FFC0003D9FE0113C0902601FFE049495A49494949 | |
1616 | 4813E04990C714F049484A13E0495A19C0495A7413C0017F17804A6E6E1380719138007E | |
1617 | 007192C7FCAEBCFCA526007FF8C7000301C0C8FCB3B3A7007FB5D8F803B612F0A553547D | |
1618 | D34E>11 D<EEFFFC031FEBFF804AB612E0020781021F9038C00FF8913A7FFE0003FCDAFF | |
1619 | F0EB00FE4949EB03FF4901805B4990C7487F49485CA2495A4D7F013F6F5B5CA37190C7FC | |
1620 | 715AEF01F894C9FCA90403B512C0BAFCA526003FFCC7120783B3B3A6003FB5D8FC03B612 | |
1621 | C0A542547DD34B>I<EA07F0EA1FFC487E487EA2B51280A86C1300A86C5AA86C5AA86C5A | |
1622 | A86C5AA76C5AA5C8FCAAEA07F0487EEA3FFE487EA2B51280A76C1300A26C5AEA0FF86C5A | |
1623 | 115474D329>33 D<DD03E0EC0F80A24D6C4A7EA2050F153FA24E5DA2051F157FA24E92C8 | |
1624 | FC053F5DA24E5CA2057F1401A295C75BA24D1403A24D5D04011507A24D5DA20403150FA2 | |
1625 | 4D5D0407151FA24D5DA2040F153FA24D5D007FBEFCA2BF1280A36C1D006C64C96CC7D801 | |
1626 | FCC9FC4C1403A24C5D03011507A24C5DA20303150FA24C5D0307151FA24C5DA2030F153F | |
1627 | A24C5D031F157FA24C92CAFC003FBD12FE4888BF1280A36C1D00A2C848C7D803F8CAFC02 | |
1628 | 011507A24B5D0203150FA24B5DA20207151FA24B5D020F153FA24B5DA2021F157FA24B92 | |
1629 | CBFC023F5DA24B5CA2027F1401A292C75B4A1403A24A5DA201011507A24A5DA26D486E5A | |
1630 | A2616A79D270>35 D<15F8A691380FFF8091B512F8010714FF011F15C049819026FFF8F8 | |
1631 | 13F84801C0EB0FFC2603FE00EB03FE4848EC00FF49153F4848ED1F804848ED0FC0A24848 | |
1632 | ED07E0A24848157FEFFFF05EA200FF5DA37FA27F7013E06D6E13C06DED7F806DED1E006C | |
1633 | B492C7FC14C014F86C13FF81EDFFC06C15F86C15FE826C16C06C826C826C826D816D8113 | |
1634 | 0F01038101001680141F020115C08003F814E0163F160F82040113F0D81FE080487E486C | |
1635 | 157FA2486C153FA2171FA44916E05B6C5A1380007EC7EC3FC0A26C1780177F6C6CEDFF00 | |
1636 | 7F6C6C4A5AD807F84A5A6C6CEC0FF82601FF80EB3FF06C9039F8F9FFE06DB65A011F92C7 | |
1637 | FC010714FC010114F0D9001F90C8FCEC00F8A6346179D943>I<EC01E0EC07F84A7EA66E | |
1638 | 5AA200041608001F163ED83FC015FFD87FE04A13806D6C485AD8FFF84A13C0D87FFE021F | |
1639 | 138001FF5C02835B6C01C390B51200000FD9F1E313FC0001D9F9E713E027003FFDEF90C7 | |
1640 | FC0107B512F8010114E0D9003F90C8FCEC07F8EC3FFF49B512E0010714F890393FFDEFFF | |
1641 | 2701FFF9E713E0000FD9F1E313FC003FD9C3F013FF4801836D138002037F01FE80D8FFF8 | |
1642 | 020713C0D87FF06E138049486C7ED83FC06E1300D81F00153E00041608C792C7FCA24A7E | |
1643 | A66E5AEC01E0323578D943>42 D<EA07F0EA1FF8487E487E7FB5FC1480A314C0A37EA27E | |
1644 | 7EEA07F3EA0003A213071480A3130F1400A25B131E133E133C137C5BA2485A485A485A48 | |
1645 | 5A48C7FC121E120C1228769025>44 D<B712F0AB240B7F9F2D>I<EA07F0487E487E487E | |
1646 | 487EB51280A76C13006C5A6C5A6C5A6C5A1111769025>I<913803FFC0023F13FC91B6FC | |
1647 | 010315C0010F018113F0903A1FFC003FF849486D7E49486D7E49486D7E48496D13804849 | |
1648 | 6D13C0A24817E04890C813F0A34817F8A24817FC49157FA3007F17FEA600FF17FFB3A500 | |
1649 | 7F17FEA6003F17FCA26D15FFA26C17F8A36C17F0A26C6D4913E0A26C6D4913C06C17806E | |
1650 | 5B6C6D4913006D6C495AD91FFCEB3FF8903A0FFF81FFF06D90B55A01011580D9003F01FC | |
1651 | C7FC020313C0384F7BCD43>48 D<157815FC14031407141F14FF130F0007B5FCB6FCA214 | |
1652 | 7F13F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>I<EC3FFE0103B512E0010F14 | |
1653 | FC013F14FF90B712C048D9C07F7F2703FE000F13F8D807F801037FD80FE06D7F48486D7F | |
1654 | 48488001F01680486C6E13C07F486C6E13E07FA27013F0A56C5AA26C5AEA0FF0EA03C0C9 | |
1655 | 14E05EA218C05E1880A24C13005F4C5A4B5B5F4B5B5F4B5B4B90C7FC4B5A5E4B5AED7FE0 | |
1656 | 4B5A4A5B4A48C8FC4A5A5D4A48EB01F04A5AEC3F804AC7FC02FEEC03E0495A495A495A49 | |
1657 | 5AD91F80140749C8FC013E150F017FB7FC90B812C05A5A5A5A5A5A5AB9FC1880A4344E79 | |
1658 | CD43>I<91380FFFC091B512FC0107ECFF80011F15E090263FF8077F9026FF800113FC48 | |
1659 | 48C76C7ED803F86E7E491680D807FC8048B416C080486D15E0A4805CA36C17C06C5B6C90 | |
1660 | C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B5BDBFFFEC7FC91B512F816E0 | |
1661 | 16FCEEFF80DA000713E0030113F89238007FFE707E7013807013C018E07013F0A218F8A2 | |
1662 | 7013FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FCA25E18F891C7FC6C17F0495C | |
1663 | 6C4816E001F04A13C06C484A1380D80FF84A13006CB44A5A6CD9F0075BC690B612F06D5D | |
1664 | 011F1580010302FCC7FCD9001F1380374F7ACD43>I<177C17FEA2160116031607160FA2 | |
1665 | 161F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C15FCEC01F815F0EC03E01407 | |
1666 | EC0FC01580EC1F005C147E147C5C1301495A495A5C495A131F49C7FC133E5B13FC485A5B | |
1667 | 485A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7FCAF020FB712C0A53A4F7CCE | |
1668 | 43>I<D80380150ED807E0157E01FEEC03FED9FFF0137F91B65A5F5F5F5F5F94C7FC5E5E | |
1669 | 16F016C093C8FC15F801E190C9FC01E0CAFCABEC0FFF027F13F001E3B512FE01E76E7E90 | |
1670 | 26FFF8077FDAC0017F49C713F8496E7E49143F4981496E7E6C481680C9FC18C08218E0A4 | |
1671 | 18F0A3EA0FE0487E487E487E487EA418E0A35B6C484A13C05B491680003EC85A003F1700 | |
1672 | 6C6C4A5A6D5D6C6C4A5AD807F8495BD803FE01075B2701FFC03F5B6C90B65A013F4AC7FC | |
1673 | 6D14F8010314C09026007FF8C8FC344F79CD43>I<ED0FFF92B512E0020780021F14FC91 | |
1674 | 397FFE03FE903A01FFF0007F4901C0EB3F804990C7121F4948EC7FC0494814FF49484913 | |
1675 | E049485B01FF5C485BA2485B5AA2486F13C04A6D1380486F1300177E94C7FC5AA291CAFC | |
1676 | 5AA21508913801FFF8020713FFB54814C04A14F04AC66C7E023C6D7E4A6D7E4A6D7E7013 | |
1677 | 804A15C0A24A15E07013F05C18F8A491C714FCA37EA67EA46C17F880A27E18F06C5D18E0 | |
1678 | 6C6D15C07E6E4913806C6D15006D6C495A6D6CEB7FFC6DB448485A6D90B55A010315C001 | |
1679 | 0092C7FC023F13FC020713C0364F7ACD43>I<121F7F7FEBFF8091B81280A45A19006060 | |
1680 | 60A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F4C5A160F4C5A484B5A4C5A94 | |
1681 | C8FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FFA24A90C9FCA25C5D1407A214 | |
1682 | 0FA25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC06E5A395279D043>I<913807 | |
1683 | FFC0027F13FC0103B67E010F15E090261FFC0113F8903A3FE0003FFCD97F80EB0FFE49C7 | |
1684 | 6C7E48488048486E1380000717C04980120F18E0177FA2121F7FA27F7F6E14FF02E015C0 | |
1685 | 14F802FE4913806C7FDBC00313009238F007FE6C02F85B9238FE1FF86C9138FFBFF06CED | |
1686 | FFE017806C4BC7FC6D806D81010F15E06D81010115FC010781011F81491680EBFFE74801 | |
1687 | 8115C048D9007F14E04848011F14F048487F48481303030014F8484880161F4848020713 | |
1688 | FC1601824848157F173FA2171FA2170FA218F8A27F007F17F06D151FA26C6CED3FE0001F | |
1689 | 17C06D157F6C6CEDFF806C6C6C010313006C01E0EB0FFE6C01FCEBFFFC6C6CB612F06D5D | |
1690 | 010F1580010102FCC7FCD9000F13C0364F7ACD43>I<91380FFF8091B512F8010314FE01 | |
1691 | 0F6E7E4901037F90267FF8007F4948EB3FF048496D7E484980486F7E484980824817805A | |
1692 | 91C714C05A7013E0A218F0B5FCA318F8A618FCA46C5DA37EA25E6C7F6C5DA26C5D6C7F6C | |
1693 | 6D137B6C6D13F390387FF803011FB512E36D14C30103028313F89039007FFE03EC004015 | |
1694 | 00A218F05EA3D801F816E0487E486C16C0487E486D491380A218005E5F4C5A91C7FC6C48 | |
1695 | 4A5A494A5A49495B6C48495BD803FC010F5B9027FF807FFEC7FC6C90B55A6C6C14F06D14 | |
1696 | C0010F49C8FC010013F0364F7ACD43>I<EA07F0487E487E487E487EB51280A76C13006C | |
1697 | 5A6C5A6C5A6C5AC8FCB3EA07F0487E487E487E487EB51280A76C13006C5A6C5A6C5A6C5A | |
1698 | 113576B425>I<91B5FC010F14F8017F14FF90B712C00003D9C00F7F2707FC00017FD80F | |
1699 | E06D7F48486E7E48C87FD87FE06E7E7F7F486C1680A66C5A18006C485C6C5AC9485A5F4B | |
1700 | 5B4B5B4B5B4B5B4B90C7FC16FC4B5A4B5A16C04B5A93C8FC4A5A5D14035D5D14075DA25D | |
1701 | 140FA25DAB91CAFCAAEC1FC04A7EECFFF8497FA2497FA76D5BA26D5BEC3FE06E5A315479 | |
1702 | D340>63 D<933807FFF84BB612E0030F15FC037FEDFF80912801FFFC000F13E002070180 | |
1703 | 9038007FF8DA1FF8C8EA07FEDA7FE0923801FF80DAFF806F6C7E4948CAEA1FE0D903F8EF | |
1704 | 07F0D907E0EF01F84948717E4948187E49CC7E017E737E49912601FFC06E7E4848021F01 | |
1705 | FC6E7E4991B61403000302036F804848499026C07FE06D7E49011F9026000FF01300000F | |
1706 | DA3FFCD903F8804949486D6C147C001F4A48D9007E147E494849023E143EF13FFE484949 | |
1707 | 6E6C133F003E49855E007E491A80007C92C8150FA25CA200FC1CC04849481807AD6C6D7E | |
1708 | 127C1D806E190FA2007E81003E7F82003F6D1A006C6D6D4A5CA26D6C6D4A143E000F6E6C | |
1709 | 49B5FC6D6D6C496E5A00076EB4010F5D6D01079026C07FE713C36C6C6D90B50083EBFFF0 | |
1710 | 0001020003005C6D021F01FC013F13806C6C020101C0D907FEC7FC017E91CDFC7F6D7E6D | |
1711 | 7E6D7ED903F8F17FC0D901FEF003FF6D6C6C171FDA7FE04CB51200DA1FF8041F13F89126 | |
1712 | 07FF800203B512C0020101FC49B500FCC7FC6E6CB812E0030F04FCC8FC03011680DB0007 | |
1713 | 0280C9FC5A5579D369>I<171F4D7E4D7EA24D7EA34C7FA24C7FA34C7FA34C7FA24C7FA3 | |
1714 | 4C8083047F80167E8304FE804C7E03018116F8830303814C7E03078116E083030F814C7E | |
1715 | 031F81168083033F8293C77E4B82157E8403FE824B800201835D840203834B800207835D | |
1716 | 844AB87EA24A83A3DA3F80C88092C97E4A84A2027E8202FE844A82010185A24A82010385 | |
1717 | 4A82010785A24A82010F855C011F717FEBFFFCB600F8020FB712E0A55B547BD366>I<BA | |
1718 | 12C019FEF1FFC01AF01AFCD8000701F0C7000313FFDE007F7F737F070F7F737F87858785 | |
1719 | 8785A287A84F5BA263616361634F5B4F5B077F90C7FC4E485A060713F892B812E097C8FC | |
1720 | 861AF003F0C7000313FE9539003FFF80070F13E0737F07017F87737F747E1C807413C0A2 | |
1721 | 7413E0A31CF0A386A362A31CE0A2621CC0A250138097B5FC1C004F5B19074F5B073F13F0 | |
1722 | 4EB55ABC128098C7FC1AF81AC007F8C8FC54527CD160>I<932601FFFCEC01C0047FD9FF | |
1723 | C013030307B600F81307033F03FE131F92B8EA803F0203DAE003EBC07F020F01FCC7383F | |
1724 | F0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901F8824949824949824949824949 | |
1725 | 824990CA7E494883A2484983485B1B7F485B481A3FA24849181FA3485B1B0FA25AA298C7 | |
1726 | FC5CA2B5FCAE7EA280A2F307C07EA36C7FA21B0F6C6D1980A26C1A1F6C7F1C006C6D606C | |
1727 | 6D187EA26D6C606D6D4C5A6D6D16036D6D4C5A6D6D4C5A6D01FC4C5A6D6DEE7F806D6C6C | |
1728 | 6C4BC7FC6E01E0EC07FE020F01FEEC1FF80203903AFFE001FFF0020091B612C0033F93C8 | |
1729 | FC030715FCDB007F14E0040101FCC9FC525479D261>I<BA7E19FCF1FF801AF01AFCD800 | |
1730 | 0701F0C7000F13FF060014C0071F7F070713F807017F737F747E747F747F86747F747F88 | |
1731 | 86888688A2757EA31D8087A21DC0A51DE0A387A963A31DC0A51D80A2631D00A3515AA264 | |
1732 | 6264505B6264505B505B5090C7FCF2FFFE4F5B07075B071F5B96B512C0060F91C8FCBB5A | |
1733 | 1AF01AC007FCC9FC19805B527CD167>I<BC1280A5D8000701F8C7000114C0F0001F1907 | |
1734 | 1901851A7F1A3F1A1FA2F20FE0A21A07A31A03A318F81BF01A01A497C7FC1701A3170317 | |
1735 | 07170F177F92B6FCA59238F8007F170F170717031701A317001B3EA31B7CA395C8FCA21B | |
1736 | FCA21BF8A21A01A31A031BF01A071A0FA21A1F1A3FF27FE0F101FF1907191F0603B5FCBC | |
1737 | FCA21BC0A34F517CD058>I<BB12FEA5D8000701F8C700077FF0007F191F190785858586 | |
1738 | 861B80A21A1FA31A0FA41BC006F81307A497C7FCA31701A317031707170F177F92B6FCA5 | |
1739 | 9238F8007F170F170717031701A31700A795C9FCB3B812F8A54A517CD055>I<932601FF | |
1740 | FCEC01C0047FD9FFC013030307B600F81307033F03FE131F92B8EA803F0203DAE003EBC0 | |
1741 | 7F020F01FCC7383FF0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901F882494982 | |
1742 | 4949824949824949824990CA7E494883A2484983485B1B7F485B481A3FA24849181FA348 | |
1743 | 5B1B0FA25AA298C8FC5CA2B5FCAE6C057FB712E0A280A36C94C7003FEBC000A36C7FA36C | |
1744 | 7FA27E6C7FA26C7F6C7FA26D7E6D7F6D7F6D6D5E6D7F6D01FC93B5FC6D13FF6D6C6D5C6E | |
1745 | 01F0EC07FB020F01FEEC1FF10203903AFFF001FFE0020091B6EAC07F033FEE001F030703 | |
1746 | FC1307DB007F02E01301040149CAFC5B5479D26A>I<B8D8C003B8FCA5D8000701F8C900 | |
1747 | 1FEBE000B3AE92BAFCA503F8C9121FB3B1B8D8C003B8FCA560527CD169>I<B812C0A5D8 | |
1748 | 000701F8C7FCB3B3B3B2B812C0A52A527CD132>I<027FB71280A591C76C90C7FCB3B3B3 | |
1749 | EA07F0EA1FFC487E487EA2B57EA44C5AA34A485B7E49495BD83FF8495BD81FE05DD80FFC | |
1750 | 011F5B2707FF807F90C8FC000190B512FC6C6C14F0011F14C0010101F8C9FC39537DD145 | |
1751 | >I<B800C091B612F8A5D8000701F8C90003EBF8009738007F8051C7FC505AF203F8F20F | |
1752 | F0505A505A505A50C8FCF101FCF107F84F5A4F5A4F5A4F5A07FEC9FCF003FC4E5A4E5A4E | |
1753 | 5A4E5A4E5ADD01FECAFC4D5A4D5A4D5A4D7E173F4D7E4C487E4C7F5E4C804C804C80EEFF | |
1754 | 7F9226F9FE3F7FDBFBFC809226FFF81F7F4C7EDCC0077F0480804C7E4B6D804B6D804B82 | |
1755 | 84727F727F8684727F727F8784728087737F85737F87737F85737F88857380747F888697 | |
1756 | B512FCB800C0013FECFFFEA55F527CD169>I<B812F8A5D8000701F8CAFCB3B3A91A7CA4 | |
1757 | 1AFC1AF8A51901A31903A219071AF0190FA2191F193F197F19FF180360183F4DB5FCBB12 | |
1758 | E0A546527CD151>I<B600FC073FB512FE6F61A26F96B6FCA2D80007F5C00070EF01EFA2 | |
1759 | 02EF6DEF03CFA202E76DEF078FA202E36DEF0F0FA202E16D171EA302E06D173CA26F6C17 | |
1760 | 78A26F6C17F0A26F6DED01E0A26F6DED03C0A36F6DED0780A26F6DED0F00A26F6D151EA2 | |
1761 | 6F6D5DA3706C5DA2706C5DA2706D495AA2706D495AA2706D495AA3706D49C7FCA2706D13 | |
1762 | 1EA2706D5BA2716C5BA3716C5BA271EB81E0A271EBC3C0A271EBE780A27101FFC8FCA371 | |
1763 | 5BA2715BA2725AA2725AA2D93FFC6F5AB74DB712FEA2725AA2725A77527CD180>I<B600 | |
1764 | FC93B7FC8181A282D800076E9239003FFC0070EE07E08282A28202EF7F02E77F02E380A2 | |
1765 | 02E18002E0806F7F6F7F6F7FA26F7F6F7F6F806F80A26F80707F707F707F707FA2707F70 | |
1766 | 80708070808583717F717F717F717FA27114807114C07114E07213F07213F8A27213FC72 | |
1767 | 13FE7213FF721487A27214C77214E77313F77313FF85A285858585A28586868686A28686 | |
1768 | 8686A2D93FFC187FB7173F1B1F1B0F1B07755A60527CD169>I<93380FFFC00303B6FC03 | |
1769 | 1F15E092B712FC0203D9FC0013FF020F01C0010F13C0023F90C7000313F0DA7FFC02007F | |
1770 | 494848ED7FFE4901E0ED1FFF49496F7F49496F7F4990C96C7F49854948707F4948707FA2 | |
1771 | 4849717E48864A83481B804A83481BC0A2481BE04A83A2481BF0A348497113F8A5B51AFC | |
1772 | AF6C1BF86E5FA46C1BF0A26E5F6C1BE0A36C6D4D13C0A26C6D4D1380A26C1B006C6D4D5A | |
1773 | 6E5E6C626D6C4C5B6D6D4B5B6D6D4B5B6D6D4B5B6D6D4B5B6D6D4B90C7FC6D6D4B5A6D01 | |
1774 | FF02035B023F01E0011F13F0020F01FC90B512C0020390B7C8FC020016FC031F15E00303 | |
1775 | 92C9FCDB001F13E0565479D265>I<BAFC19F819FF1AE086D8000701F0C7001F13FC0601 | |
1776 | 13FF726C13807313C0070F13E01BF0857313F81BFCA27313FEA41BFFA81BFEA31BFC61A2 | |
1777 | 1BF84F13F04F13E0614F13C04F13004E485A061F5B92B812F01AC04FC7FC19E003F8CBFC | |
1778 | B3AEB812C0A550527CD15C>I<93380FFFC00303B6FC031F15E092B712FC0203D9FC0013 | |
1779 | FF020F01C0010F13C0023F90C7000313F0DA7FFC02007F902601FFF0ED3FFE49496F7E49 | |
1780 | 496F7F49496F7F4990C96C7F4948707F4948707F01FF854A177F48864849717EA2484971 | |
1781 | 1380A2481BC04A83481BE0A24A83481BF0A3481BF8A291CB7EA3B51AFCAF6C1BF8A26E5F | |
1782 | A36C1BF0A36C6D4D13E0A36C1BC06E5F6C1B806E5F6CDB01FE16006C6D902607FF80495A | |
1783 | 4C13E06C6D013F6D495A017F91267F03F85C6D6C90277C00FC015B6D6C49D97E035B6D01 | |
1784 | 806E485B6D6D48D91F8F5B6D01E0039F90C7FC6D01F06EB45A6DD9FCF85DDA3FFF6E13F0 | |
1785 | 020F6D4913C0020301FF90B5C8FC020091B512FC031F180C0303181EDB001FEBE3FE93C7 | |
1786 | EA01FF74133E74137E7413FEF2F8077290B5FC1CFCA285A21CF8A2851CF07314E0A27314 | |
1787 | C0731480731400735B9638007FF8F21FE0576A79D265>I<B912F0F0FF8019F819FF1AC0 | |
1788 | D8000701F0C714F0060F7F060113FE727F737F737F85737F87A2737FA387A863A2616363 | |
1789 | A24F5B4F5B4F90C8FC4F5A06035B060F13F095B512C092B8C9FC19F819E019F89226F000 | |
1790 | 0313FE9439007FFF80727F727F727F727F727F8684A28684A787A71D1C75133EA3857513 | |
1791 | 7E73157C7513FC731401B86C6D9038F803F807039038FE07F07390B512E0736C14C0080F | |
1792 | 1400CEEA7FFC5F537CD164>I<91260FFF80130791B500F85B010702FF5B011FEDC03F49 | |
1793 | EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5FC4848C87E48488149150F001F82 | |
1794 | 4981123F4981007F82A28412FF84A27FA26D82A27F7F6D93C7FC14C06C13F014FF15F86C | |
1795 | ECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C836C836D826D82010F821303010082 | |
1796 | 021F16801400030F15C0ED007F040714E01600173F050F13F08383A200788200F882A318 | |
1797 | 7FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D5D01FC4B5A01FF4B5A02C04A5A02 | |
1798 | F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7FC48C66C14FC48010F14F048D900 | |
1799 | 7F90C8FC3C5479D24B>I<003FBC1280A59126C0003F9038C0007F49C71607D87FF80601 | |
1800 | 13C001E08449197F49193F90C8171FA2007E1A0FA3007C1A07A500FC1BE0481A03A6C994 | |
1801 | C7FCB3B3AC91B912F0A553517BD05E>I<B800C00103B612FCA5D8000701F8CAEBF000F3 | |
1802 | 1F80B3B3B11B3FA26D97C7FC81637F1B7E6D6D17FE505A6E7E505A6E6D15076E4D5A6E6D | |
1803 | 4B5A6E6D4B5A6E01F84B5A6E6DDA03FFC8FC6E6CB46CEB0FFE6F9039F001FFF8030F90B6 | |
1804 | 5A030316C0DB007F92C9FC040F14F8DC007F13805E537CD167>I<B700FE031FB512FEA5 | |
1805 | D8001F01F0CA383FFE00F307F06D626F170F6D62811B1F6D6D601B3F6D97C7FC6F5F6D19 | |
1806 | 7E821BFE6E6D5E1A016E6D5E1A036E60701507A26E6D5E1A0F6E6D5E1A1F6E6070153FA2 | |
1807 | 6E6D93C8FC626E6E147E1AFE6F5E711301A26F6D5C19036F6D5C19076F5E71130FA26F6D | |
1808 | 5C191F6F6D5C193F6F93C9FC715BA26FEC807E19FE706D5A18C1705C18E3705C18F318F7 | |
1809 | 70EBFFE0A2705CA2705CA37091CAFCA2705BA2715AA3715AA2715AA2715A715A5F537DD1 | |
1810 | 66>I<B700FC017FB600FE91B612F0A5D8003F01C0C8001F01E0C9EBF8006F71EE0FC06D | |
1811 | 7161876F1C1F6D7196C7FC6F8373606D1E3E6F836D7160876F1CFC6D666F4B801F016D66 | |
1812 | 704A806E525A88704A17076E059F5F70021F80080F160F6E6570023F806EDC3E074CC8FC | |
1813 | 8870027E5F6EDC7C03163E7002FC804F6C167E6E1C7C700101814F6C16FC6E745B700103 | |
1814 | 17016E4C6D5D060716C00580496D14036F63DDC00F16E04F6D14076F07F05BDDE01F170F | |
1815 | 6F92C76C5D1DF8DDF03E6E141F6F98C9FCDDF87E16FC067C6E5C6FF1FE3EDDFCFC177E6F | |
1816 | 4A6E147C1DFFDDFFF06E14FC6F62A24E816F62A270496F5BA24E817061A295C97E7061A2 | |
1817 | 70487090CAFCA37048705AA24D1601040360A27048705A84537DD18B>I<003FB7D88003 | |
1818 | B7FCA5D8000749C8000701F8C7FC6D6D9238007F806D6E93C8FC7015FE6D17016E6D5D70 | |
1819 | 4A5A6E16076E6D4A5A6E6D5D4F5A6E6D143F6E6D4A5A7191C9FC6E16FE6EECC00171485A | |
1820 | 6F5D6F6D485A6FEBF80F71485A6F5D6F6D485AEFFF7F6F4ACAFC6F5C6F5CA2705B705B84 | |
1821 | 82707F707FA2707F7080855E4C80855E4C80DC3FCF7F058F7FEE7F074C6C7FDB01FE814C | |
1822 | 7E4B486C8003076E7F4B48814C7F4B486D7F033F824C7F4BC76C7F4B6E7F4A5A4B6E804A | |
1823 | 486E800207844A48814B6F7F4A4883023F824A486F7F92C96C7F02FE8401018301037180 | |
1824 | 90263FFFC084B76C0103B712F8A55D527CD166>I<B8030FB61280A5D8000F01FCCA003F | |
1825 | 90C7FC6FEF07F86D6D606D4F5A826D6E4C5A6D4F5A826E6D4CC8FC6E18FE826E6D4B5A6E | |
1826 | 4D5A826E6D4B5A6E4D5A836E6E4A5A6E4D5A836F6D4AC9FC6F5E715C6F6D495A6F150371 | |
1827 | 5C6F6D495A6F150F06805B6F6E485A6F153F06E05B706D48CAFC705C725A70EBFDFC7013 | |
1828 | FF61705C82705C6182715B96CBFCB3AA030FB712F8A561527ED166>I<B512F0A748C7FC | |
1829 | B3B3B3B3B3B0B512F0A7147872D925>91 D<B512F8A7EA0003B3B3B3B3B3B0B5FCA71578 | |
1830 | 7ED925>93 D<EC7FFF0107B512F0013F14FE90B77E48D9E00F7F2703FE000113F0486C6D | |
1831 | 7F6EEB3FFC48826E131F83707FA36C496D7FA26C90C7FC6C5AC9FCA6037FB5FC020FB6FC | |
1832 | 91B7FC01071487013FEBF0074913803901FFFC004813F0485B485B485B4890C7FC5A5BA2 | |
1833 | 485AA45EA26D5C007F151D163D6C6C02797F6C6D01F113F86C9026C003E1EBFFE06C9026 | |
1834 | F81FC014F06C90B5487EC6ED001F011F01FC010713E0010101E090C8FC3C387CB641>97 | |
1835 | D<EB3FF0B5FCA51203C6FCB3A4923801FFE0030F13FE033FEBFFC092B612F002F301017F | |
1836 | 913AF7F8003FFEDAFFE0EB0FFF03806D7F92C76C7F4A6E7F4A824A6E7FA2727EA285A285 | |
1837 | 84A31A80AC1A00A44E5AA36118FF616E4A5BA26E4A5B6E4A5B6F495BDACFC04990C7FCDA | |
1838 | 87F0EB7FFC913A03FE03FFF849C6B612E0496D148049011F01FCC8FC90C7000313C04154 | |
1839 | 7BD24B>I<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE0001 | |
1840 | FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F1300705A48 | |
1841 | 92C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC | |
1842 | 3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49C7FC | |
1843 | 020113E033387CB63C>I<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13FC91 | |
1844 | B6FC010315C7010F9038E03FE74990380007F7D97FFC0101B5FC49487F4849143F484980 | |
1845 | 485B83485B5A91C8FC5AA3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C | |
1846 | 6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9 | |
1847 | 003F13F8020301C049C7FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C04901 | |
1848 | 817F903A3FFC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C0488191 | |
1849 | C7FC4817E0A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01 | |
1850 | F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE | |
1851 | 903A0FFFC03FF8010390B55A010015C0021F49C7FC020113F034387CB63D>I<ED3FFC02 | |
1852 | 03B5FC020F14C0023F14E09139FFF81FF0499038C03FF849EB807F49903800FFFC495A49 | |
1853 | 5AA2495AA2EE7FF8495AEE3FF0EE0FC093C7FCAEB712E0A526007FF8C8FCB3B3A7007FB5 | |
1854 | 12FEA52E547CD329>I<DA3FFF14FF0103B5D8F00713C0010FDAFC1F13E0013FECFF7F90 | |
1855 | 267FFC0F9038FF9FF09026FFE001EBF83F48496C13E0484990387FF01F4890C7D83FF813 | |
1856 | E0489338FC0FC0F0078048486E6CC7FCA2003F82A9001F5EA26C6C4A5AA26C5E6C6D495A | |
1857 | 6C6D495A6C6D485BDAFC0F5B4890B6C8FCD803EF14FC01C314F02607C03F90C9FC91CBFC | |
1858 | A2120FA37FA213F813FE90B7FC6C16F817FF18C06C836C836C836D828448B9FC12074848 | |
1859 | C700031480D81FF8EC003F4848150748486F13C083485A83A56D5D007F18806D5D003F18 | |
1860 | 006C6C4B5AD80FFEED1FFC6C6C6CEC7FF86C01E049485A6C01FE011F5B6C6CB71280010F | |
1861 | 03FCC7FC010115E0D9000F01FCC8FC3C4F7CB543>I<EB3FF0B5FCA51203C6FCB3A4EE1F | |
1862 | FC93B512C0030314F0030F8092391FE07FFC92393F001FFE037C8003F07FDAF1E081ECF3 | |
1863 | C0DAF7807F8502FFC7FC5CA25CA45CB3ACB6D8F807B612C0A542537BD24B>I<137F497E | |
1864 | 000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3 | |
1865 | A6B612E0A51B547BD325>I<157FEDFF80020313E04A13F0A24A13F8A76E13F0A26E13E0 | |
1866 | 02001380ED7F0092C7FCADED1FF891B5FCA51401EC007FB3B3B1EA0780EA1FE0487E487E | |
1867 | 486C13FF16F0A216E05C16C04A13806C4848130049485A003F495A000FB512F06C5C0001 | |
1868 | 148026001FFCC7FC256C87D329>I<EB3FF0B5FCA51203C6FCB3A54CB512F8A59339003F | |
1869 | FE00EF1FF0EF3FC04D5A4DC7FCEE03FEEE07F84C5A4C5AEE7FC04CC8FC4B5A4B5AED0FF8 | |
1870 | ED1FE04B7E4B7EECF1FF02F37F02F77F91B6FC83159F030F7F02FE80DAF8077F4A7E6F7F | |
1871 | 6F7F83707E82707F84707F707F82707F84707F177F717E4D13C0B6D8F003B6FCA540537C | |
1872 | D247>I<EB3FF0B5FCA512017EB3B3B3B1B612F0A51C537BD225>I<D93FF0D91FFCEDFFE0 | |
1873 | B591B500C0010713FE030302F0011F6D7E030F6E017F8092271FE07FFCD9FF037F922A3F | |
1874 | 001FFE01F8007F0003027C9126FF03E080C602F06DD90780137FDAF1E0038FC77FDAF3C0 | |
1875 | 159EDAF7806D01BC143F07FC8102FFC75C4A5EA24A5EA44A5EB3ACB6D8F807B6D8C03FB5 | |
1876 | 12FEA567367BB570>I<D93FF0EB1FFCB591B512C0030314F0030F8092391FE07FFC9239 | |
1877 | 3F001FFE0003027C80C602F07FDAF1E081ECF3C0DAF7807F8502FFC7FC5CA25CA45CB3AC | |
1878 | B6D8F807B612C0A542367BB54B>I<913801FFE0021F13FE91B612C0010315F0010F9038 | |
1879 | 807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C8 | |
1880 | 6C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA2 | |
1881 | 6C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF80 | |
1882 | 7FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F | |
1883 | 13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F | |
1884 | 92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F61 | |
1885 | 6E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F14 | |
1886 | 80031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380F | |
1887 | FF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF | |
1888 | 150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114 | |
1889 | D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980 | |
1890 | 127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C | |
1891 | 816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00 | |
1892 | F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF | |
1893 | C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414 | |
1894 | FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE | |
1895 | 07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203 | |
1896 | 13802A4D7ECB34>I<D93FF8913801FFC0B50207B5FCA50003ED001FC61607B3AE5FA35F | |
1897 | A2017F5D173B177B6D6C14F3DC01E313F06D6CD907C3EBFFC0903A0FFFC03F836D90B512 | |
1898 | 03010114FE6D6C13F8020701E091C7FC42377BB54B>I<B600F00107B5FCA5000101F8C8 | |
1899 | EA7FE06C6DED3F00A2017F163E6E157E013F167C6E15FC6D5E6F13016D5E8117036D5E6F | |
1900 | 13076D5E6F130F6D5E6F131F6D93C7FC815F6E6C133E177E023F147C6F13FC6E5C16816E | |
1901 | 5C16C3A26EEBE3E016E76E5C16FF6E5CA26E91C8FCA26F5AA36F5AA26F5AA26F5AA26F5A | |
1902 | 6F5A40367DB447>I<B6D8E07FB5D8C003B512C0A5000101F0C701F0C7381FF8006E027F | |
1903 | ED07E06C715DA26E023F150F017F705DA26E181F013F4B6C92C7FC6E606D70143E94B5FC | |
1904 | 6F177E6D4A6E137C03C001F315FC6D715B160303E001E114016D020702E05B03F013C06D | |
1905 | 71485A160F03F8D9807F13076D05F85B93381F003F03FC160F027F4902FC5BDBFE3E011F | |
1906 | 131F023F04FE90C8FC167EDBFF7C010F5B6E01FCECFF3E4C6D137E6E5FA24C7F6E5F4C7F | |
1907 | 6E5FA24C7F6E5F4C147FA26E5F93C8123F6F5EA2033E6FC9FC5A367DB461>I<007FB500 | |
1908 | F090387FFFFEA5C66C48C7000F90C7FC6D6CEC07F86D6D5C6D6D495A6D4B5A6F495A6D6D | |
1909 | 91C8FC6D6D137E6D6D5B91387FFE014C5A6E6C485A6EEB8FE06EEBCFC06EEBFF806E91C9 | |
1910 | FCA26E5B6E5B6F7E6F7EA26F7F834B7F4B7F92B5FCDA01FD7F03F87F4A486C7E4A486C7E | |
1911 | 020F7FDA1FC0804A486C7F4A486C7F02FE6D7F4A6D7F495A49486D7F01076F7E49486E7E | |
1912 | 49486E7FEBFFF0B500FE49B612C0A542357EB447>I<B600F00107B5FCA5C601F8C8EA7F | |
1913 | E06EED3F00A26D6C153E187E013F167C6E15FC6D5E6F13016D5E6F13036D5E8117076D6D | |
1914 | 5C170F6D6D5C171F6D93C7FC6F5B027F143E6F137E023F147C6F13FCA26E6D5A16816EEB | |
1915 | C1F016C36E5C16E76E5C16FF6E5CA26E91C8FCA36F5AA26F5AA26F5AA26F5AA26F5AA35E | |
1916 | 150F5E151F93C9FC5DD81FC0133E486C137E486C137C486C13FC5D14015D14034A5A6C48 | |
1917 | 485A49485A263FC07FCAFCEB81FE6CB45A6C13F000035BC690CBFC404D7DB447>I | |
1918 | E | |
1919 | %EndDVIPSBitmapFont | |
1920 | %DVIPSBitmapFont: Fs cmtt10 10.95 93 | |
1921 | /Fs 93 127 df<121C127FEAFF80B3EA7F00B2123EC7FCA8121C127FA2EAFF80A3EA7F00 | |
1922 | A2121C09396DB830>33 D<00101304007C131F00FEEB3F80A26C137FA248133FB2007E14 | |
1923 | 00007C7F003C131E00101304191C75B830>I<903907C007C0A2496C487EA8011F131FA2 | |
1924 | 02C05BA3007FB7FCA2B81280A36C16006C5D3A007F807F80A2020090C7FCA9495BA2003F | |
1925 | 90B512FE4881B81280A36C1600A22701FC01FCC7FCA300031303A201F85BA76C486C5AA2 | |
1926 | 29387DB730>I<1438147C14FCA4EB03FF011F13E090B512FC4880000780481580261FFE | |
1927 | FD13C09039F0FC3FE0D83FC0131FD87F80EB0FF001001307007E15F800FE14035A1507A3 | |
1928 | 6CEC03F0A2007F91C7FC138013C0EA3FF0EA1FFE13FF6C13FF6C14E0000114F86C6C7F01 | |
1929 | 1F7F01037F0100148002FD13C09138FC7FE0151FED0FF015070018EC03F8127E1501B4FC | |
1930 | A35AA26CEC03F07E01801307ED0FE0D83FC0131F01F0EB7FC0D81FFEB512806CB612006C | |
1931 | 5C6C5CC614F0013F13C0D907FEC7FCEB00FCA5147C143825477BBE30>I<D803C0EB01E0 | |
1932 | D80FF01303486C497E487E150F487ED87E7E495AEAFE7F5E486C133FA25E157FA24BC7FC | |
1933 | 6C5A5D387E7E01EA7FFED83FFC5B1403EA1FF86C48485AEA03C0C75B140FA25D141FA24A | |
1934 | 5AA25D147FA292C8FC5CA2495AA25C1303A25C1307A290390FF001E0ED07F84A487E011F | |
1935 | 497EA24A487E133F163F90267F807F1380ED7E1F14005BA25B1201A24848EB7F3F033F13 | |
1936 | 004914FF12076F5A5B6F5A6C486D5A0001EC01E029477DBE30>I<EB07E0EB1FF8497E13 | |
1937 | 7F497E803801FC7F497E810003131F13F0A6143F92C8FC91387F0FFF9026F87E1F138000 | |
1938 | 0113FEEBF9FC13FB4A6C1300D9FFF013C06C13E0151F02C05BEB7F809038FF003F4892C7 | |
1939 | FC485C48EB807E5A15FE391FDFC0FC383F8FE014E1397F07F1F8EB03F300FEEBFBF0EB01 | |
1940 | FF5D7FEDC006027F130F91393F801F8015C06C137F6CEBFFE049EBF83F018701FC130026 | |
1941 | 3FFFFBB5FC6C01F15B14E06C9038C03FFC00039038001FF8D801FCEB07E0293A7DB830> | |
1942 | I<EA07C0EA0FF0EA1FF8A213FCA213FE120F1207EA007EA513FE13FCA2120113F81203EA | |
1943 | 07F0120FEA1FE0127FEAFFC013801300127C12380F1D70B730>I<141E147F14FF5BEB03 | |
1944 | FEEB07FCEB0FF0EB1FE0EB3FC0EB7F80EBFF00485A5B12035B485A120F5BA2485AA2123F | |
1945 | 5BA2127F90C7FCA412FEAD127FA47F123FA27F121FA26C7EA27F12076C7E7F12017F6C7E | |
1946 | EB7F80EB3FC0EB1FE0EB0FF0EB07FCEB03FEEB01FF7F147F141E184771BE30>I<127812 | |
1947 | FE7E7F6C7E6C7EEA0FF06C7E6C7E6C7E6C7EEB7F80133F14C0131FEB0FE014F01307A2EB | |
1948 | 03F8A214FC1301A214FE1300A4147FAD14FEA4130114FCA2130314F8A2EB07F0A2130F14 | |
1949 | E0EB1FC0133F1480137FEBFF00485A485A485A485AEA3FE0485A485A90C7FC5A12781847 | |
1950 | 78BE30>I<14E0497E497EA60038EC0380007EEC0FC0D8FF83EB3FE001C3137F9038F3F9 | |
1951 | FF267FFBFB13C06CB61280000FECFE00000314F86C5C6C6C13C0011F90C7FC017F13C048 | |
1952 | B512F04880000F14FE003FECFF80267FFBFB13C026FFF3F913E09038C3F87F0183133FD8 | |
1953 | 7E03EB0FC00038EC0380000091C7FCA66D5A6D5A23277AAE30>I<143EA2147FAF007FB7 | |
1954 | FCA2B81280A36C1600A2C76CC8FCAF143EA229297DAF30>I<EA03E0EA0FF0EA1FF813FC | |
1955 | EA3FFEA213FFA27EA27E1203EA007FA2137E13FEEA01FC1203EA07F8EA3FF0127FEAFFE0 | |
1956 | EA7F801300123C1019708B30>I<007FB612F0A2B712F8A36C15F0A225077B9E30>I<120F | |
1957 | EA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C0C6E8B30>I<16F01501ED03F8A2 | |
1958 | 1507A2ED0FF0A2ED1FE0A2ED3FC0A2ED7F80A2EDFF00A24A5AA25D1403A24A5AA24A5AA2 | |
1959 | 4A5AA24A5AA24A5AA24AC7FCA2495AA25C1303A2495AA2495AA2495AA2495AA2495AA249 | |
1960 | C8FCA2485AA25B1203A2485AA2485AA2485AA2485AA2485AA248C9FCA25AA2127CA22547 | |
1961 | 7BBE30>I<14FE903807FFC0497F013F13F8497F90B57E48EB83FF4848C6138049137F48 | |
1962 | 48EB3FC04848EB1FE049130F001F15F0491307A24848EB03F8A290C712014815FCA400FE | |
1963 | EC00FEAD6C14016C15FCA36D1303003F15F8A26D1307001F15F0A26D130F6C6CEB1FE0A2 | |
1964 | 6C6CEB3FC06C6CEB7F806D13FF2601FF8313006CEBFFFE6D5B6D5B010F13E06D5BD900FE | |
1965 | C7FC273A7CB830>I<EB03C0497EA2130FA2131FA2133F137F13FF1203123FB5FCA213EF | |
1966 | 138FEA7E0F1200B3B0003FB512F84814FCB612FEA26C14FC6C14F81F3977B830>I<EB07 | |
1967 | FC90383FFFC090B512F00003804814FE4880261FF80F1380263FE00113C09038C0007F48 | |
1968 | 48EB3FE090C7121FED0FF04814075A6C15F81503A3127E1218C8FCA2150716F0150F16E0 | |
1969 | 151F16C0153FED7F8015FF4A13005DEC07FC4A5A4A5A4A5A4A5A4A5A4990C7FC495A495A | |
1970 | EB0FF0EB3FE0495A495A4890C8FC4848EB01F04848EB03F8485AEA1FE048B6FCB7FCA37E | |
1971 | 6C15F025397BB830>I<EB03FF013F13E090B512F84814FE4880481580260FFE0113C090 | |
1972 | 38F0007F4848EB1FE0150F16F01507A26C5A6C5AC8FC150F16E0A2151FED3FC0157FEDFF | |
1973 | 8002071300903807FFFE495B5D8115FF6D1480D9000113C09138003FE0ED1FF0ED07F815 | |
1974 | 0316FC150116FE1500A21218127EB4FCA2150116FC4814036C15F86C6C13076DEB1FF0D8 | |
1975 | 3FF0133F3A1FFE01FFE06CB612C06C15806CECFE00C65C013F13F001031380273A7CB830 | |
1976 | >I<EC03FC4A7E140F141FA2143F147F157E14FEA2EB01FCEB03F8A2EB07F0A2EB0FE0EB | |
1977 | 1FC0A2EB3F80A2EB7F0013FEA2485A485AA2485AA2485A485AA2485AA248C7FC12FEB8FC | |
1978 | 1780A46C1600C8007EC7FCAA91387FFFFE91B6FCA46E5B29397DB830>I<000FB6128048 | |
1979 | 15C05AA316800180C8FCAEEB83FF019F13C090B512F015FC8181D9FE0313809039F0007F | |
1980 | C049133F0180EB1FE06CC7120F000E15F0C81207A216F81503A31218127EA2B4FC150716 | |
1981 | F048140F6C15E06C141F6DEB3FC06D137F3A3FE001FF80261FFC0F13006CB55A6C5C6C5C | |
1982 | 6C14E06C6C1380D90FFCC7FC25397BB730>I<EC0FF8EC7FFF49B51280010714E0131F49 | |
1983 | 14F090387FF80F9039FFC007F84813803803FE005B485A4848EB03F0ED01E0484890C7FC | |
1984 | 5B123F5BA2127FEB000C903803FFE0010F13F8D8FF3F13FE48B6FCB7128016C09039FE00 | |
1985 | 7FE001F8EB1FF001E0130F49EB07F849EB03FCA290C7120116FE1500A37EA46C7E15016D | |
1986 | 14FC121F6D1303000FEC07F86D130F6C6CEB1FF06DEB3FE03A03FF81FFC06C90B512806C | |
1987 | 15006D5B011F13F8010713E001011380273A7CB830>I<127CB712FC16FEA416FC48C7EA | |
1988 | 0FF816F0ED1FE0007CEC3FC0C8EA7F80EDFF00A24A5A4A5A5D14075D140F5D4A5AA24A5A | |
1989 | A24AC7FCA25C5C13015CA213035CA213075CA4495AA6131F5CA96D5A6DC8FC273A7CB830 | |
1990 | >I<49B4FC011F13F0017F13FC90B57E0003ECFF804815C048010113E03A1FF8003FF049 | |
1991 | 131FD83FC0EB07F8A24848EB03FC90C71201A56D1303003F15F86D13076C6CEB0FF06C6C | |
1992 | EB1FE0D807FCEB7FC03A03FF83FF806C90B512006C6C13FC011F13F0497F90B512FE4880 | |
1993 | 2607FE0013C0D80FF8EB3FE0D81FE0EB0FF04848EB07F8491303007F15FC90C712014815 | |
1994 | FE481400A66C14016C15FC6D1303003F15F86D1307D81FF0EB1FF06D133F3A0FFF01FFE0 | |
1995 | 6C90B512C06C1580C6ECFE006D5B011F13F0010190C7FC273A7CB830>I<49B4FC010F13 | |
1996 | E0013F13F890B57E4880488048010113803A0FFC007FC0D81FF0EB3FE04848131F49EB0F | |
1997 | F048481307A290C7EA03F85A4815FC1501A416FEA37E7E6D1303A26C6C13076C6C130F6D | |
1998 | 133FD80FFC13FF6CB6FC7E6C14FE6C14F9013FEBE1FC010F138190380060011400ED03F8 | |
1999 | A2150716F0150F000F15E0486C131F486CEB3FC0157FEDFF804A1300EC07FE391FF01FFC | |
2000 | 90B55A6C5C6C5C6C1480C649C7FCEB3FF0273A7CB830>I<120FEA3FC0EA7FE0A2EAFFF0 | |
2001 | A4EA7FE0A2EA3FC0EA0F00C7FCAF120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F | |
2002 | 000C276EA630>I<EA03C0EA0FF0EA1FF8A2EA3FFCA4EA1FF8A2EA0FF0EA03C0C7FCAFEA | |
2003 | 03C0EA0FF0121F13F8123F13FCA3121FA2120F12031200120113F8120313F01207EA1FE0 | |
2004 | 123FEA7FC0EAFF80EA7F00127E12380E3470A630>I<16F01503ED07F8151F157FEDFFF0 | |
2005 | 14034A13C0021F138091383FFE00ECFFF8495B010713C0495BD93FFEC7FC495A3801FFF0 | |
2006 | 485B000F13804890C8FCEA7FFC5BEAFFE05B7FEA7FF87FEA1FFF6C7F000313E06C7F3800 | |
2007 | 7FFC6D7E90380FFF806D7F010113F06D7FEC3FFE91381FFF80020713C06E13F01400ED7F | |
2008 | F8151F1507ED03F01500252F7BB230>I<007FB7FCA2B81280A36C16006C5DCBFCA7003F | |
2009 | B612FE4881B81280A36C1600A229157DA530>I<1278127EB4FC13C07FEA7FF813FEEA1F | |
2010 | FF6C13C000037F6C13F86C6C7EEB1FFF6D7F010313E06D7F9038007FFC6E7E91380FFF80 | |
2011 | 6E13C0020113F080ED3FF8151F153FEDFFF05C020713C04A138091383FFE004A5A903801 | |
2012 | FFF0495B010F13804990C7FCEB7FFC48485A4813E0000F5B4890C8FCEA7FFE13F8EAFFE0 | |
2013 | 5B90C9FC127E1278252F7BB230>I<EB1FFE90B512E0000314F8000F14FE488048158026 | |
2014 | 7FF80313C09038C0007F48C7121F16E0150FA3127E151F0018EC7FC0C812FF020313804A | |
2015 | 13004A5AEC1FF84A5AEC7FC04A5A92C7FC495AA2495A5CA213075CA86D5A90C9FCA8EB01 | |
2016 | C0EB07F0A2497EA36D5AA2EB01C023397AB830>I<EC1FE0ECFFF8010313FE010F7F4914 | |
2017 | 804914C090397FF03FE09038FF800F4890380007F0D803FC13033A07F801FBF89038F007 | |
2018 | FF380FE01F4A13FCEA1FC0495A003FEBFF0F903800FE07903901FC03FE007FEBF801EA7E | |
2019 | 03ECF000A2EAFE0700FC49137EAA00FE6D13FED87E0314FCA2ECF801D87F0114F8003FEB | |
2020 | FC03903900FE07F0903880FF0F001F90387FFFE06D6C13C0EA0FE06E13803A07F007FE00 | |
2021 | 9038F801F86C6CC7127C6CB414FE6CEB800390387FF01F6DB512FC6D14F86D14E0010314 | |
2022 | C00100EBFE00EC1FF0273A7CB830>I<147F4A7EA2497FA4497F14F7A401077F14E3A301 | |
2023 | 0F7FA314C1A2011F7FA490383F80FEA590387F007FA4498049133F90B6FCA34881A39038 | |
2024 | FC001F00038149130FA4000781491307A2D87FFFEB7FFFB56CB51280A46C496C13002939 | |
2025 | 7DB830>I<007FB512F0B612FE6F7E82826C813A03F8001FF815076F7E1501A26F7EA615 | |
2026 | 015EA24B5A1507ED1FF0ED7FE090B65A5E4BC7FC6F7E16E0829039F8000FF8ED03FC6F7E | |
2027 | 1500167FA3EE3F80A6167F1700A25E4B5A1503ED1FFC007FB6FCB75A5E16C05E6C02FCC7 | |
2028 | FC29387EB730>I<91387F803C903903FFF03E49EBFC7E011F13FE49EBFFFE5B9038FFE0 | |
2029 | 7F48EB801F3903FE000F484813075B48481303A2484813015B123F491300A2127F90C8FC | |
2030 | 167C16005A5AAC7E7EA2167C6D14FE123FA27F121F6D13016C6C14FCA26C6CEB03F86D13 | |
2031 | 076C6CEB0FF03901FF801F6C9038E07FE06DB512C06D14806D1400010713FC6D13F09038 | |
2032 | 007FC0273A7CB830>I<003FB512E04814FCB67E6F7E6C816C813A03F8007FF0ED1FF815 | |
2033 | 0F6F7E6F7E15016F7EA2EE7F80A2163F17C0161FA4EE0FE0AC161F17C0A3163F1780A216 | |
2034 | 7F17005E4B5A15034B5A150F4B5AED7FF0003FB65A485DB75A93C7FC6C14FC6C14E02B38 | |
2035 | 7FB730>I<007FB7FCB81280A47ED803F8C7123FA8EE1F0093C7FCA4157C15FEA490B5FC | |
2036 | A6EBF800A4157C92C8FCA5EE07C0EE0FE0A9007FB7FCB8FCA46C16C02B387EB730>I<00 | |
2037 | 3FB712804816C0B8FCA27E7ED801FCC7121FA8EE0F8093C7FCA5153E157FA490B6FCA690 | |
2038 | 38FC007FA4153E92C8FCAE383FFFF8487FB5FCA27E6C5B2A387EB730>I<02FF13F00103 | |
2039 | EBC0F8010F13F1013F13FD4913FF90B6FC4813C1EC007F4848133F4848131F49130F485A | |
2040 | 491307121F5B123F491303A2127F90C7FC6F5A92C8FC5A5AA892B5FC4A14805CA26C7F6C | |
2041 | 6D1400ED03F8A27F003F1407A27F121F6D130F120F7F6C6C131FA2D803FE133F6C6C137F | |
2042 | ECC1FF6C90B5FC7F6D13FB010F13F30103EBC1F0010090C8FC293A7DB830>I<3B3FFF80 | |
2043 | 0FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E0D803F8C7EAFE00B290B6FCA6 | |
2044 | 01F8C7FCB3A23B3FFF800FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E02D38 | |
2045 | 7FB730>I<007FB6FCB71280A46C1500260007F0C7FCB3B3A8007FB6FCB71280A46C1500 | |
2046 | 213879B730>I<D83FFF90380FFF80486D4813C0B56C5AA26C497E6C496C1380D803F090 | |
2047 | 3803F8004B5A4B5A151F4B5A5E4BC7FC15FE14014A5A5D4A5A4A5A141F5D4A5A4AC8FC5C | |
2048 | 13F18101F37F13F790B57E14EFECC7F01483EC03F8140101FE7F496C7E5B157F497F8215 | |
2049 | 1F82150F826F7EA26F7E1501821500D83FFF903803FFC0486D4813E0B56C5AA26C497E6C | |
2050 | 496C13C02B387FB730>75 D<383FFFF8487FB57EA26C5B6C5BD801FCC9FCB3B0EE0F80EE | |
2051 | 1FC0A9003FB7FC5AB8FCA27E6C16802A387EB730>I<D83FF8ECFFE0486C4913F0486C49 | |
2052 | 13F8A2007F16F06C6C4913E00007160001EF14BFEC800FA39039E7C01F3FA4ECE03F01E3 | |
2053 | 133EA2ECF07EA201E1137CA2ECF8FCA201E013F8A214FDEC7DF0A3147FEC3FE0A3EC1FC0 | |
2054 | A2EC070091C7FCADD83FFC903801FFE0486C4913F0B54913F8A26C486D13F06C486D13E0 | |
2055 | 2D387FB730>I<D83FFC90381FFF80486C4913C0B54913E0A26C6D6C13C06C6E13800003 | |
2056 | 913801F800EBF7C0A3EBF3E0A314F013F1A214F8A213F014FCA2147C147EA2143E143FA2 | |
2057 | 141FA21581A2140F15C1A2140715E1A2140315F1A21401A215F91400A3157DA3153FEA3F | |
2058 | FF481380B5EAC01FA26CEB800F6C496C5A2B387EB730>I<90383FFFE048B512FC000714 | |
2059 | FF4815804815C04815E0EBF80001E0133FD87F80EB0FF0A290C71207A44815F8481403B3 | |
2060 | A96C1407A26C15F0A36D130FA26D131F6C6CEB3FE001F813FF90B6FC6C15C06C15806C15 | |
2061 | 00000114FCD8003F13E0253A7BB830>I<007FB512F0B612FE6F7E16E0826C813903F800 | |
2062 | 3FED0FFCED03FE15016F7EA2821780163FA6167F17005EA24B5A1503ED0FFCED3FF890B6 | |
2063 | FC5E5E16804BC7FC15F001F8C9FCB0387FFFC0B57EA46C5B29387EB730>I<90383FFFE0 | |
2064 | 48B512FC000714FF4815804815C04815E0EBF80001E0133F4848EB1FF049130F90C71207 | |
2065 | A44815F8481403B3A8147E14FE6CEBFF076C15F0EC7F87A2EC3FC7018013CF9038C01FFF | |
2066 | D83FE014E0EBF80F90B6FC6C15C06C15806C1500000114FCD8003F7FEB00016E7EA21680 | |
2067 | 157F16C0153F16E0151F16F0150FED07E025467BB830>I<003FB57E4814F0B612FC15FF | |
2068 | 6C816C812603F8017F9138003FF0151F6F7E15071503821501A515035E1507150F4B5A15 | |
2069 | 3F4AB45A90B65A5E93C7FC5D8182D9F8007FED3FE0151F150F821507A817F8EEF1FCA53A | |
2070 | 3FFF8003FB4801C0EBFFF8B56C7E17F06C496C13E06C49EB7FC0C9EA1F002E397FB730> | |
2071 | I<90390FF803C0D97FFF13E048B512C74814F74814FF5A381FF80F383FE001497E484813 | |
2072 | 7F90C7123F5A48141FA2150FA37EED07C06C91C7FC7F7FEA3FF0EA1FFEEBFFF06C13FF6C | |
2073 | 14E0000114F86C80011F13FF01031480D9003F13C014019138007FE0151FED0FF0A2ED07 | |
2074 | F8A2007C140312FEA56C140716F07F6DEB0FE06D131F01F8EB3FC001FF13FF91B5128016 | |
2075 | 0000FD5CD8FC7F13F8D8F81F5BD878011380253A7BB830>I<003FB712C04816E0B8FCA4 | |
2076 | 3AFE003F800FA8007CED07C0C791C7FCB3B1011FB5FC4980A46D91C7FC2B387EB730>I< | |
2077 | 3B7FFFC007FFFCB56C4813FEA46C496C13FCD803F8C7EA3F80B3B16D147F00011600A36C | |
2078 | 6C14FE6D13016D5CEC800390393FE00FF890391FF83FF06DB55A6D5C6D5C6D91C7FC9038 | |
2079 | 007FFCEC1FF02F3980B730>I<D87FFE90380FFFC0B54913E06E5AA24A7E6C486D13C0D8 | |
2080 | 07F0903801FC00A26D130300035DA46C6C495AA46C6C495AA46D131F6D5CA3EC803F013F | |
2081 | 5CA46D6C48C7FCA490380FE0FEA401075B14F1A301035BA314FB01015BA314FFA26D5BA4 | |
2082 | 6E5A6E5A2B397EB730>I<D83FFC903801FFE0486C4913F000FF16F8A2007F16F06C486D | |
2083 | 13E0D81FC09038001FC0000F1680A76D143F00071600A7000390380F803E9039F01FC07E | |
2084 | EC3FE0A3EC7FF0A2147D0001157CA29039F8FDF8FCA314F8A300005D01F913FCA2ECF07C | |
2085 | A201FD137DA2017D5CECE03DA3017F133FA2ECC01FA2013F5CA2EC800F6D486C5A2D397F | |
2086 | B730>I<3A3FFF01FFF84801837F02C77FA202835B6C01015B3A01FC007F806D91C7FC00 | |
2087 | 005C6D5BEB7F01EC81FCEB3F8314C3011F5B14E7010F5B14FF6D5BA26D5BA26D5BA26D90 | |
2088 | C8FCA4497FA2497FA2815B81EB0FE781EB1FC381EB3F8181EB7F0081497F49800001143F | |
2089 | 49800003141F49800007140FD87FFEEB7FFFB590B5128080A25C6C486D130029387DB730 | |
2090 | >I<D87FFF90381FFFC0B56C4813E0A46C496C13C0D803F8903803F8006D1307A26C6C49 | |
2091 | 5AA26C6C5C151F6D5CEC803F013F5CECC07F011F91C7FCA290380FE0FEA214F101075BA2 | |
2092 | 903803FBF8A201015B14FF6D5BA26E5AA36E5AB1903803FFF8497F497FA26D5B6D5B2B38 | |
2093 | 7EB730>I<001FB612FC4815FE5AA490C7EA03FCED07F816F0150FED1FE016C0153FED7F | |
2094 | 80003E1500C85A4A5A5D14034A5A5D140F4A5A5D143F4A5A92C7FC5C495A5C1303495A5C | |
2095 | 130F495A5C133F495A91C8FC5B4848147C4914FE1203485A5B120F485A5B123F485A90B6 | |
2096 | FCB7FCA46C15FC27387CB730>I<007FB5FCB61280A4150048C8FCB3B3B3A5B6FC1580A4 | |
2097 | 6C140019476DBE30>I<127CA212FEA27EA26C7EA26C7EA26C7EA26C7EA26C7EA26C7EA2 | |
2098 | 12017FA26C7EA26D7EA26D7EA26D7EA26D7EA26D7EA26D7EA2130180A26D7EA26E7EA26E | |
2099 | 7EA26E7EA26E7EA26E7EA26E7EA2140181A26E7EA2ED7F80A2ED3FC0A2ED1FE0A2ED0FF0 | |
2100 | A2ED07F8A21503A2ED01F0150025477BBE30>I<007FB5FCB61280A47EC7123FB3B3B3A5 | |
2101 | 007FB5FCB6FCA46C140019477DBE30>I<1307EB1FC0EB7FF0497E000313FE000FEBFF80 | |
2102 | 003F14E0D87FFD13F039FFF07FF8EBC01FEB800F38FE0003007CEB01F00010EB00401D0E | |
2103 | 77B730>I<007FB612F0A2B712F8A36C15F0A225077B7D30>I<1338137CEA01FE12031207 | |
2104 | EA0FFC13F0EA1FE013C0EA3F8013005A127EA212FE5AA5EAFFC013E013F0127FA2123FA2 | |
2105 | EA1FE0EA07C00F1D70BE30>I<EB7FF80003B5FC4814C04880488048809038E01FFC9038 | |
2106 | C003FE14016E7E6C487F6CC77FC8123FA491B5FC130F137F48B6FC12075A48EB803F383F | |
2107 | F800EA7FE0138048C7FC5AA4157F7E6C6C13FFEBC003263FF01FEBFF8090B712C07E6C14 | |
2108 | EF000314876CD9FE01138026003FE0C8FC2A2A7BA830>I<EA3FFC487E12FFA2127F123F | |
2109 | 1200AAEC03FE91381FFF80027F13E091B57E90B612FC82ECFE079138F001FF4A6C13804A | |
2110 | 137F4AEB3FC091C7121F17E049140FA217F01607A8160FA217E07F161F6EEB3FC0A26EEB | |
2111 | 7F806E13FFDAF00313009138FC0FFE91B55A5E495CD97E7F13C0D93C1F90C7FC90380003 | |
2112 | FC2C3980B730>I<ECFFE0010713FC011F7F017F7F90B612804815C048EB807F3907FC00 | |
2113 | 3F485A485A49EB1F804848EB0F004990C7FC127F90C9FCA25A5AA87E7EA27F003FEC07C0 | |
2114 | 6DEB0FE06C7E6D131F6C6C14C0D807FE133F9039FFC0FF806C90B5FCC615006D5B011F13 | |
2115 | F801075B01011380232A7AA830>I<913801FFE04A7F5CA28080EC0007AAEB03FE90381F | |
2116 | FF874913E790B6FC5A5A481303380FFC00D81FF0133F49131F485A150F4848130790C7FC | |
2117 | A25AA25AA87E6C140FA27F003F141F6D133F6C7E6D137F390FF801FF2607FE07EBFFC06C | |
2118 | B712E06C16F06C14F76D01C713E0011F010313C0D907FCC8FC2C397DB730>I<49B4FC01 | |
2119 | 0713E0011F13F8017F7F90B57E488048018113803A07FC007FC04848133FD81FE0EB1FE0 | |
2120 | 150F484814F0491307127F90C7FCED03F85A5AB7FCA516F048C9FC7E7EA27F003FEC01F0 | |
2121 | 6DEB03F86C7E6C7E6D1307D807FEEB1FF03A03FFC07FE06C90B5FC6C15C0013F14806DEB | |
2122 | FE00010713F8010013C0252A7CA830>I<EDFF80020713E0021F13F05C4A13F891B5FC49 | |
2123 | 1387903803FE079138FC03F0903907F800C04A1300A8003FB612C04815E0B7FCA36C15C0 | |
2124 | 260007F0C7FCB3A9003FB512FE4880B71280A26C15006C5C25397DB830>I<D903FC13FF | |
2125 | 90261FFF8713C04913DF90B712E05A5A2607FE07138F903AF801FE07C048486C6CC7FCA2 | |
2126 | 497F001F8149133FA56D137F000F92C7FC6D5BA26C6C485AEBFE0790B55A5D485C15C001 | |
2127 | DF5BD9C3FCC8FC01C0C9FCA37F7F6CB512F015FF6C15C04815F0488148813A3FE0001FFE | |
2128 | 0180130148C8127F007E8100FE168048151FA56C153F007FED7F006D5C6C6C495A01F013 | |
2129 | 076CB4EB7FFC6C90B55A6C5D000115C06C6C91C7FC011F13FC010113C02B3E7DA730>I< | |
2130 | EA3FFC487E12FFA2127F123F1200AAEC01FE91380FFF80023F13E091B57E90B67EA29138 | |
2131 | FE07FCECF8039138E001FE14C0EC8000A291C7FCA25BB3A23B3FFFF81FFFF8486D4813FC | |
2132 | B500FE14FEA26C01FC14FC6C496C13F82F3880B730>I<14E0EB03F8A2497EA36D5AA2EB | |
2133 | 00E091C8FCA9381FFFF8487F5AA27E7EEA0001B3A9003FB612C04815E0B7FCA27E6C15C0 | |
2134 | 23397AB830>I<EC01C0EC07F0A2EC0FF8A3EC07F0A2EC01C091C7FCA990B512F04814F8 | |
2135 | A47EEB0003B3B3A5EC07F0A2123C007EEB0FE0B4131FEC3FC0147F90B512806C14005C6C | |
2136 | 5B000F13F0000313C01D4E7CB830>I<EA7FF8487EA4127F1200AB0203B512804A14C017 | |
2137 | E0A217C06E14809139001FE0004B5A4B5A4BC7FC4A5A4A5AEC0FF84A5A4A5A4A5A4A5A01 | |
2138 | FD7F90B57E8114F7ECE3F8ECC1FCEC81FEEC00FF497F496D7E6F7E826F7E15076F7E6F7E | |
2139 | 3B7FFFF81FFFE0B56C4813F017F8A217F06C496C13E02D387FB730>I<387FFFF8B57EA4 | |
2140 | 7EEA0001B3B3A8007FB612F0B712F8A46C15F025387BB730>I<02FC137E3B7FC3FF01FF | |
2141 | 80D8FFEF01877F90B500CF7F15DF92B57E6C010F13872607FE07EB03F801FC13FE9039F8 | |
2142 | 03FC01A201F013F8A301E013F0B3A23C7FFE0FFF07FF80B548018F13C0A46C486C010713 | |
2143 | 80322881A730>I<EC01FE3A3FFC0FFF80267FFE3F13E000FF90B57E90B67E7E6C9038FE | |
2144 | 07FCC6EBF8039138E001FE14C0EC8000A291C7FCA25BB3A23B3FFFF81FFFF8486D4813FC | |
2145 | B500FE14FEA26C01FC14FC6C496C13F82F2880A730>I<49B4FC010F13E0013F13F8497F | |
2146 | 90B57E0003ECFF8014013A07FC007FC04848EB3FE0D81FE0EB0FF0A24848EB07F8491303 | |
2147 | 007F15FC90C71201A300FEEC00FEA86C14016C15FCA26D1303003F15F86D13076D130F6C | |
2148 | 6CEB1FF06C6CEB3FE06D137F3A07FF01FFC06C90B512806C15006C6C13FC6D5B010F13E0 | |
2149 | 010190C7FC272A7CA830>I<EC03FE3A3FFC1FFF80267FFE7F13E000FF90B57E90B612FC | |
2150 | 6C816CEBFE07C69038F001FF4A6C13804A137F4AEB3FC091C7121F17E049140FA217F016 | |
2151 | 07A8160FA217E07F161F6EEB3FC0A26EEB7F806E13FFDAF00313009138FC0FFE91B55A5E | |
2152 | 495C6E13C0021F90C7FCEC03FC91C9FCAD383FFFF8487FB57EA26C5B6C5B2C3C80A730> | |
2153 | I<49B413F8010FEBC1FC013F13F14913FD48B6FC5A481381390FFC007F49131F4848130F | |
2154 | 491307485A491303127F90C7FC15015A5AA77E7E15037FA26C6C1307150F6C6C131F6C6C | |
2155 | 133F01FC137F3907FF01FF6C90B5FC6C14FD6C14F9013F13F1010F13C1903803FE0190C7 | |
2156 | FCAD92B512F84A14FCA46E14F82E3C7DA730>I<ED07F83A3FFF803FFF486DB51280B512 | |
2157 | C302CF14C06C13DF6C9038FFFC3FD8001F13E09238801F809238000F004A90C7FC5C5C5C | |
2158 | A25CA45CAF003FB512FC4880B7FCA26C5C6C5C2A287EA730>I<90381FFC1E48B5129F00 | |
2159 | 0714FF5A5A5A387FF007EB800100FEC7FC4880A46C143E007F91C7FC13E06CB4FC6C13FC | |
2160 | 6CEBFF806C14E0000114F86C6C7F01037F9038000FFF02001380007C147F00FEEC1FC0A2 | |
2161 | 150F7EA27F151F6DEB3F806D137F9039FC03FF0090B6FC5D5D00FC14F0D8F83F13C02678 | |
2162 | 0FFEC7FC222A79A830>I<EB0780497E131FA9003FB612E04815F0B7FCA36C15E026001F | |
2163 | C0C7FCB216F8ED01FCA5ECE003010FEB07F814F09138FC1FF06DB512E06D14C016806D14 | |
2164 | 009038007FFCEC1FF026337EB130>I<D83FFCEB3FFC486C497E00FF14FFA2007F147F00 | |
2165 | 3F143F00001400B3A41501A2150315076D130F903A7FC07FFFF891B612FC6D15FE7F6D49 | |
2166 | 13FC6D9038F87FF8010001C0C7FC2F2880A630>I<3B3FFFC07FFF80486DB512C0B515E0 | |
2167 | A26C16C06C496C13803B01F80003F000A26D130700005DA26D130F017E5CA2017F131F6D | |
2168 | 5CA2EC803F011F91C7FCA26E5A010F137EA2ECE0FE01075BA214F101035BA3903801FBF0 | |
2169 | A314FF6D5BA36E5A6E5A2B277EA630>I<3B3FFFC01FFFE0486D4813F0B515F8A26C16F0 | |
2170 | 6C496C13E0D807E0C7EA3F00A26D5C0003157EA56D14FE00015DEC0F80EC1FC0EC3FE0A3 | |
2171 | 3A00FC7FF1F8A2147DA2ECFDF9017C5C14F8A3017E13FBA290393FF07FE0A3ECE03FA201 | |
2172 | 1F5C90390F800F802D277FA630>I<3A3FFF81FFFC4801C37FB580A26C5D6C01815BC648 | |
2173 | C66CC7FC137FEC80FE90383F81FC90381FC3F8EB0FE3ECE7F06DB45A6D5B7F6D5B92C8FC | |
2174 | 147E147F5C497F81903803F7E0EB07E790380FE3F0ECC1F890381F81FC90383F80FE9038 | |
2175 | 7F007E017E137F01FE6D7E48486D7E267FFF80B5FCB500C1148014E3A214C16C01801400 | |
2176 | 29277DA630>I<3B3FFFC07FFF80486DB512C0B515E0A26C16C06C496C13803B01FC0003 | |
2177 | F000A2000014076D5C137E150F017F5C7F151FD91F805BA214C0010F49C7FCA214E00107 | |
2178 | 137EA2EB03F0157C15FCEB01F85DA2EB00F9ECFDF0147D147FA26E5AA36E5AA35DA2143F | |
2179 | 92C8FCA25C147EA2000F13FE486C5AEA3FC1EBC3F81387EB8FF0EBFFE06C5B5C6C90C9FC | |
2180 | 6C5AEA01F02B3C7EA630>I<001FB612FC4815FE5AA316FC90C7EA0FF8ED1FF0ED3FE0ED | |
2181 | 7FC0EDFF80003E491300C7485A4A5A4A5A4A5A4A5A4A5A4A5A4990C7FC495A495A495A49 | |
2182 | 5A495A495A4948133E4890C7127F485A485A485A485A485A48B7FCB8FCA46C15FE28277D | |
2183 | A630>I<ED3FF0913803FFF8140F5C147F16F09138FFF00092C7FC495A5CB3A21303495A | |
2184 | 133F383FFFF0B55A5C91C8FC14C080003F7F38003FF813076D7E1301B3A2806D7E15F091 | |
2185 | 387FFFF016F8141F8014039138003FF025477BBE30>I<127CA212FEB3B3B3AD127CA207 | |
2186 | 476CBE30>I<EA7FE0EAFFFE6D7E8014F07EC66C7E13076D7E1301B3A2806D7E15E09138 | |
2187 | 7FFFE06E13F8801407141F5C4A13E09138FFE00092C7FC495A5CB3A21303495A137F387F | |
2188 | FFF0B5FC14C05C49C8FCEA7FE025477BBE30>I<017C133848B4137C48EB80FE4813C148 | |
2189 | 13C348EBEFFC397FEFFFF0D8FF8713E0010713C0486C1380D87C0113003838007C1F0C78 | |
2190 | B730>I E | |
2191 | %EndDVIPSBitmapFont | |
2192 | %DVIPSBitmapFont: Ft cmr10 10.95 86 | |
2193 | /Ft 86 125 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907 | |
2194 | F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7 | |
2195 | FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11 | |
2196 | D<EC03FE91383FFF809138FE03E0903903F800F0D90FE013384948137C90393F8001FE90 | |
2197 | 387F00035B5BA2485A6F5AED007093C7FCAA16FEB7FCA33901FC000315011500B3AC486C | |
2198 | 497EB5D8F87F13FCA32E407EBF33>I<EC03FF023F13EE9138FE01FEEB03F090380FE003 | |
2199 | EB1FC0EB3F80EB7F005B5B150148481300AEB7FCA3D801FCC7FCB3AE486C497EB5D8F87F | |
2200 | 13FCA32E407EBF33>I<DA03FE49B4FC91273FFF801F13C0913BFE03E07F01F0903C03F0 | |
2201 | 00F1FC0078D90FE0D97FF0131C49484948133E4948484913FF494848495A5B491500A248 | |
2202 | 485C03016E5A0300153896C7FCAA197FBBFCA3D801FCC738FE00018485B3AC486C496CEC | |
2203 | FF80B5D8F87FD9FC3F13FEA347407EBF4C>I<121EEA7F80EAFFC0A9EA7F80ACEA3F00AC | |
2204 | 121EAB120CC7FCA8121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A4179C019>33 | |
2205 | D<001E130F397F803FC000FF137F01C013E0A201E013F0A3007F133F391E600F30000013 | |
2206 | 00A401E01370491360A3000114E04913C00003130101001380481303000EEB070048130E | |
2207 | 0018130C0038131C003013181C1C7DBE2D>I<14E0A4EB07FC90383FFF8090B512E03901 | |
2208 | F8E3F03903E0E0FCD807C0133CD80F807FD81F007F003E80003C1580007C140316C00078 | |
2209 | 141F00F8143F157FA47EED3F806CEC0E0092C7FC127F138013C0EA3FF013FEEA1FFF6C13 | |
2210 | FC6C13FF6C14C06C806C6C13F8011F7F130301007FECE7FF14E102E01380157F153FED1F | |
2211 | C0A2003E140F127FD8FF801307A5130000FC158000F0140F1270007815005D6C141E153E | |
2212 | 6C5C6C5C3907C0E1F03903F8EFE0C6B51280D93FFEC7FCEB0FF8EB00E0A422497BC32D> | |
2213 | 36 D<013F1603D9FFC04B7E2601E0E0150F2607C070151F48486C4BC7FC023E157E4848 | |
2214 | 6C15FE48D90FC0EB03FC003ED90EF0EB0FF8DA0F3F13FD007E903A070FFFF1F0007C0200 | |
2215 | EB03E0160000FC6D6C495A170F604DC8FC5F173E5F17FC5F4C5A1603007CD907005B4C5A | |
2216 | 007E150F003E495C020E49C9FC003F5D6C49133E260F803C5B023813FC6C6C485B3A01E0 | |
2217 | E001F03800FFC090273F0003E0133F90C70007ECFFC09339C001E0E0923A0F8007C07003 | |
2218 | 1F49487E0400143C033E90381F001C037E497F037C133E4B150F0201027E7F4B137C4A5A | |
2219 | 020702FCEB03805D4A5A141F92C7FC143E147E147C5CA2495A0103037CEB07005C494814 | |
2220 | 7E010F033E5B4A160E49C8123F496F5B013E92380F803C49173801FC6F6C5A49923801E0 | |
2221 | E0496FB45A0160043FC7FC41497BC34C>I<121EEA7F8012FF13C0A213E0A3127FEA1E60 | |
2222 | 1200A413E013C0A312011380120313005A120E5A1218123812300B1C79BE19>39 | |
2223 | D<1430147014E0EB01C0EB03801307EB0F00131E133E133C5B13F85B12015B1203A2485A | |
2224 | A2120F5BA2121F90C7FCA25AA3123E127EA6127C12FCB2127C127EA6123E123FA37EA27F | |
2225 | 120FA27F1207A26C7EA212017F12007F13787F133E131E7FEB07801303EB01C0EB00E014 | |
2226 | 701430145A77C323>I<12C07E12707E7E121E7E6C7E7F12036C7E7F12007F1378137CA2 | |
2227 | 7FA2133F7FA21480130FA214C0A3130714E0A6130314F0B214E01307A614C0130FA31480 | |
2228 | A2131F1400A25B133EA25BA2137813F85B12015B485A12075B48C7FC121E121C5A5A5A5A | |
2229 | 145A7BC323>I<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113 | |
2230 | 80120313005A120E5A1218123812300B1C798919>44 D<B512FEA617067F961E>I<121E | |
2231 | EA7F80A2EAFFC0A4EA7F80A2EA1E000A0A798919>I<ED0180ED03C01507A21680150FA2 | |
2232 | 16005DA2151E153EA2153C157CA2157815F8A25D1401A25D1403A25D1407A25D140FA24A | |
2233 | C7FCA2141E143EA2143C147CA2147814F8A25C1301A25C1303A25C1307A25C130FA291C8 | |
2234 | FC5BA2131E133EA25BA2137813F8A25B1201A25B1203A25B1207A25B120FA290C9FC5AA2 | |
2235 | 121E123EA2123C127CA2127812F8A25A1260225B7BC32D>I<EB01FE90380FFFC090383F | |
2236 | 03F090387C00F849137C48487F48487F4848EB0F80A2000F15C04848EB07E0A3003F15F0 | |
2237 | A290C712034815F8A64815FCB3A26C15F8A56C6CEB07F0A3001F15E0A36C6CEB0FC0A26C | |
2238 | 6CEB1F80000315006C6C133E6C6C5B017C5B90383F03F090380FFFC0D901FEC7FC263F7D | |
2239 | BC2D>I<EB01C013031307131F137FEA07FFB5FC139FEAF81F1200B3B3ACEB7FF0B612F8 | |
2240 | A31D3D78BC2D>I<EB07FC90383FFF8090B512E03903F01FF83907C007FC390F0001FE00 | |
2241 | 1E6D7E001C1580003CEC7FC05AED3FE01270B4FC6DEB1FF07FA56C5A6CC7FC120CC813E0 | |
2242 | 153FA216C0157F168015FF16004A5A5D4A5A4A5A5D4A5A4A5A4AC7FC147E147C5C495A49 | |
2243 | 5A495A495A49C71270133E133C5B4914E0485A485A485A48C7120148B6FCA25A4815C0B7 | |
2244 | FCA3243D7CBC2D>I<EB07FC90383FFF809038F80FE03901E003F839078001FCD80F007F | |
2245 | 000E6D7E001E1580D81F80137F486C14C07FA27F5BA2121F6C5AC8138015FF1600A24A5A | |
2246 | A24A5A5DEC07E04A5A023FC7FCEB1FFCECFF809038000FE0EC07F86E7E6E7E6E7E1680ED | |
2247 | 7FC0A216E0153FA216F0A2120C123F487E487EA316E0A249137F6CC713C01278EDFF807E | |
2248 | 6C4913006C495A3907C007FC3903F80FF0C6B55A013F1380D907F8C7FC243F7CBC2D>I< | |
2249 | 150E151E153EA2157EA215FE1401A21403EC077E1406140E141CA214381470A214E0EB01 | |
2250 | C0A2EB0380EB0700A2130E5BA25B5BA25B5B1201485A90C7FC5A120E120C121C5AA25A5A | |
2251 | B8FCA3C8EAFE00AC4A7E49B6FCA3283E7EBD2D>I<00061403D80780131F01F813FE90B5 | |
2252 | FC5D5D5D15C092C7FC14FCEB3FE090C9FCACEB01FE90380FFF8090383E03E090387001F8 | |
2253 | 496C7E49137E497F90C713800006141FC813C0A216E0150FA316F0A3120C127F7F12FFA4 | |
2254 | 16E090C7121F12FC007015C012780038EC3F80123C6CEC7F00001F14FE6C6C485A6C6C48 | |
2255 | 5A3903F80FE0C6B55A013F90C7FCEB07F8243F7CBC2D>I<EC1FE0ECFFF8903803F03E90 | |
2256 | 380FC00F90391F000780133E017EEB1FC049133F4848137F12035B12074848EB3F80ED1F | |
2257 | 00001F91C7FC5BA2123FA3485AA214FE903887FF8039FF8F07E090389C01F09038B800FC | |
2258 | 01B0137E13F0497F16804914C0A2ED1FE0A34914F0A5127FA6123F6D14E0A2121FED3FC0 | |
2259 | A26C6C1480A20007EC7F006C6C137E6C6C5B6C6C485A90387E07F06DB45A010F1380D903 | |
2260 | FCC7FC243F7CBC2D>I<1238123C123F90B612FCA316F85A16F016E00078C712010070EC | |
2261 | 03C0ED078016005D48141E151C153C5DC8127015F04A5A5D14034A5A92C7FC5C141EA25C | |
2262 | A2147C147814F8A213015C1303A31307A3130F5CA2131FA6133FAA6D5A0107C8FC26407B | |
2263 | BD2D>I<EB03FC90381FFF8090387C07E09038F001F83901E0007C48487F48487F48C7FC | |
2264 | ED0F80121E16C0003E1407A4123FA26DEB0F807F6C6C131F6D140001FC133E6C6C5B9038 | |
2265 | FF80786C6D5A6CEBF3E06CEBFF806C91C7FC133F6D13C06D7F013F13F801787F48486C7E | |
2266 | 3903E01FFF48486C1380260F800313C048487E489038007FE0003E143F007E141F007CEC | |
2267 | 0FF01507481403A31501A46C15E0007C1403A2007E15C06C14076CEC0F806DEB1F006C6C | |
2268 | 133ED807F05B3901FC03F86CB512E0011F1380D903FCC7FC243F7CBC2D>I<EB03FCEB1F | |
2269 | FF90387E07C09038FC03F048486C7E48486C7E4848137C000F147E4848137F81003F1580 | |
2270 | 5B007F15C0A2151F12FF16E0A516F0A5127F153FA36C7EA2001F147F120F6C6C13FF6D13 | |
2271 | DF000313013900F8039F90387E0F1FD91FFE13E0EB07F090C7FCA2ED3FC0A41680157FD8 | |
2272 | 0F801400487E486C13FEA24A5A5D49485AEB8007391E000FE0001F495A260FC07FC7FC38 | |
2273 | 03FFFE6C13F838003FC0243F7CBC2D>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FC | |
2274 | B3121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A2779A619>I<121EEA7F80A2EAFFC0A4EA | |
2275 | 7F80A2EA1E00C7FCB3121E127FEAFF80A213C0A4127F121E1200A412011380A312031300 | |
2276 | 5A1206120E120C121C5A1230A20A3979A619>I<007FB912E0BA12F0A26C18E0CDFCAE00 | |
2277 | 7FB912E0BA12F0A26C18E03C167BA147>61 D<EB1FF890B5FC3903E01FC0390F0007F000 | |
2278 | 1EEB03F848EB01FC4814FE140000FE14FF7E7FA46CC7FC123EC7EA01FEA2EC03FCEC07F8 | |
2279 | 15F0EC0FC0EC1F80EC3F00143E5C147814F85C13015CA2495AA25CAB91C7FC90C8FCA8EB | |
2280 | 0780EB1FE0A2497EA46D5AA2EB078020407BBF2B>63 D<15074B7EA34B7EA34B7EA34B7E | |
2281 | A34B7E15E7A2913801C7FC15C3A291380381FEA34AC67EA3020E6D7EA34A6D7EA34A6D7E | |
2282 | A34A6D7EA34A6D7EA349486D7E91B6FCA249819138800001A249C87EA24982010E157FA2 | |
2283 | 011E82011C153FA2013C820138151FA2017882170F13FC00034C7ED80FFF4B7EB500F001 | |
2284 | 0FB512F8A33D417DC044>65 D<B712FCEEFF8017F00001903980000FF86C6CC7EA03FE70 | |
2285 | 7E701380EF7FC0EF3FE0A2EF1FF0A218F8A3170F171FA318F0A2EF3FE0177F18C0EFFF80 | |
2286 | 4C1300EE03FCEE0FF8EE7FE091B6C7FC17E091C7EA07FCEE01FE933800FF80EF7FC0EF3F | |
2287 | E0EF1FF018F8170F18FC1707A218FEA718FC170FA2EF1FF818F0173FEF7FE0EFFFC00403 | |
2288 | 138048486C90380FFE00B85A17E094C7FC373E7DBD40>I<DB3FF01306912603FFFE130E | |
2289 | 020F9038FF801E913A3FF007E03E9139FF8000F8D903FEC7EA7C7ED907F8EC1EFE494814 | |
2290 | 0FD93FE0140749481403495A91C812014848150012034848167E5B000F173EA24848161E | |
2291 | A2123F5B180E127FA349160012FFAC127F7F180EA2123FA27F001F171E181C6C7EA20007 | |
2292 | 173C6D16386C6C1678000117706C6C16F06EEC01E06D6C15C06D6C1403D90FF0EC07806D | |
2293 | 6CEC1F00D903FE143E902600FF8013F891393FF007F0020FB512C0020391C7FC9138003F | |
2294 | F037427BBF42>I<B712FCEEFF8017E000019039C0001FF86C6C48EB03FEEE00FF717E71 | |
2295 | 7EEF0FE084717E717E170184717EA21980187F19C0A3F03FE0A519F0AB19E0A5F07FC0A2 | |
2296 | 1980A218FF19004D5AA24D5A6017074D5A4D5AEF7FC04DC7FCEE03FE48486CEB1FF8B85A | |
2297 | 178004FCC8FC3C3E7DBD45>I<B912E0A300019038C000016C6C48EB001FEF0FF01703A2 | |
2298 | 17011700A31870A418381638A41800A21678A216F81501150791B5FCA3EC800715011500 | |
2299 | 1678A21638A2180EA3181C93C7FCA4183C1838A21878A318F8EF01F0A21707170F173F48 | |
2300 | 486CEB03FFB912E0A3373E7DBD3E>I<B91280A300019038C000036C6C48EB007FEF1FC0 | |
2301 | 170F1707A21703A31701A4EF00E0A21638A31800A31678A216F81501150791B5FCA3EC80 | |
2302 | 07150115001678A21638A693C8FCAF3801FFE0B612F0A3333E7DBD3B>I<DB3FE0130C91 | |
2303 | 2603FFFE131C021F9038FF803C913A7FF00FC07C9139FF0001F0D903FC90380078FC4948 | |
2304 | 143DD91FE0141F4948140F4948140701FF15034890C8FC491501485A000716005B000F17 | |
2305 | 7C5B001F173CA2485AA2181C127FA25B95C7FC12FFAB041FB512F0127FA26D9139000FFE | |
2306 | 00EF03FC123FA27F121FA26C7EA212077F12036C7E7F6C7F6D6C14076D7E6D6C140FD907 | |
2307 | F8141ED903FEEC3C7C902600FF80EBF83C913A7FF007F01C021FB5EAC00C020391C8FC91 | |
2308 | 38003FF03C427BBF47>I<B6D8C01FB512F8A3000101E0C7383FFC0026007F80EC0FF0B3 | |
2309 | A691B7FCA30280C7120FB3A92601FFE0EC3FFCB6D8C01FB512F8A33D3E7DBD44>I<B612 | |
2310 | F0A3C6EBF000EB3FC0B3B3B2EBFFF0B612F0A31C3E7EBD21>I<011FB512FCA3D9000713 | |
2311 | 006E5A1401B3B3A6123FEA7F80EAFFC0A44A5A1380D87F005B007C130700385C003C495A | |
2312 | 6C495A6C495A2603E07EC7FC3800FFF8EB3FC026407CBD2F>I<B600C090387FFFFCA300 | |
2313 | 0101E0C7000F138026007F80913807FE0018F818E0604D5A4DC7FC173E5F5F4C5A4C5A4C | |
2314 | 5A4C5A4CC8FC163E5E5E4B5A4B5AED07804B7E151F4B7E4B7E15FF913881EFF8913883C7 | |
2315 | FCEC878791388F03FE91389E01FF14BCDAF8007F4A6D7E5C4A6D7E4A6D7EA2707E707EA2 | |
2316 | 707E707EA2707F717E84173F717E717EA2717E848419802601FFE04A13C0B600C090B6FC | |
2317 | A3403E7DBD47>I<B612F8A3000101E0C9FC38007F80B3B0EF0380A517071800A45FA35F | |
2318 | A25F5F5F4C5A160748486C133FB8FCA3313E7DBD39>I<B500C093B512C0A300016D4BEB | |
2319 | E000D8007F1880D977F0ED03BFA3D973F8ED073FA3D971FC150EA2D970FE151CA3027F15 | |
2320 | 38A36E6C1470A36E6C14E0A26E6CEB01C0A36E6CEB0380A36E6CEB0700A26E6C130EA36E | |
2321 | 6C5BA3037F5BA26F6C5AA36F6C5AA392380FE1C0A3923807F380A26FB4C7FCA36F5AA213 | |
2322 | F8486C6D5AD807FFEFFFE0B500F80178017FEBFFC0A34A3E7CBD53>I<B56C91B512F880 | |
2323 | 80D8007F030713006EEC01FC6E6E5A1870EB77FCEB73FEA2EB71FF01707FA26E7E6E7EA2 | |
2324 | 6E7E6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA26F7E6F7EA26F7E6F1380A2 | |
2325 | EE7FC0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013F0A2177F173FA2171F17 | |
2326 | 0FA2170701F81503487ED807FF1501B500F81400A218703D3E7DBD44>I<ED7FE0913807 | |
2327 | FFFE91391FC03F8091397E0007E04948EB03F8D907F0EB00FE4948147F49486E7E49486E | |
2328 | 7E49C86C7E01FE6F7E00018349150300038348486F7EA248486F7EA2001F188049167F00 | |
2329 | 3F18C0A3007F18E049163FA300FF18F0AC007F18E06D167FA4003F18C0A26C6CEEFF80A3 | |
2330 | 6C6C4B1300A26C6C4B5A00035F6D150700015F6C6C4B5A6D5E6D6C4A5A6D6C4A5A6D6C4A | |
2331 | C7FC6D6C14FED901FCEB03F8D9007FEB0FE091391FC03F80912607FFFEC8FC9138007FE0 | |
2332 | 3C427BBF47>I<B712F8EEFF8017E000019039C0003FF86C6C48EB07FCEE01FE707EEF7F | |
2333 | 80EF3FC018E0A2EF1FF0A218F8A818F0A2EF3FE0A218C0EF7F80EFFF004C5AEE07FCEE3F | |
2334 | F091B612C04CC7FC0280C9FCB3A73801FFE0B612C0A3353E7DBD3E>I<ED7FE0913807FF | |
2335 | FE91391FC03F8091397F000FE0D901FCEB03F8D907F0EB00FE4948147F49486E7E49486E | |
2336 | 7E49C86C7E498248486F7E49150300038348486F7EA2000F834981001F1880A24848EE7F | |
2337 | C0A3007F18E0A249163FA200FF18F0AC007F18E0A26D167FA3003F18C0A26C6CEEFF80A3 | |
2338 | 000F18006D5D0007DA0F805B6C6C90393FE003FCED70706C6C496C485A6C6C48486C485A | |
2339 | 017FD9800E5BD93F819038061FC0D91FC19038073F80D90FE14AC7FCD907F1EB03FE9026 | |
2340 | 01FDC013F8903A007EE007E091271FF03FC013180207B5FC9139007FE1E0DB0001143883 | |
2341 | 711378A2706C13F0EFFF0318FFA27113E0A37113C0711380711300715AEF01F83D527BBF | |
2342 | 47>I<B712C016FCEEFF800001D9C00013E06C6C48EB1FF0EE07FCEE01FE707E84717EA2 | |
2343 | 717EA284A760177F606017FF95C7FCEE01FCEE07F8EE1FE0EEFF8091B500FCC8FC16F091 | |
2344 | 388001FCED003FEE1FC0707E707E83160383160183A383A484A4F0C004190EA28218E005 | |
2345 | 7F131E2601FFE0161CB600C0EB3FF094381FF83805071370CA3801FFE09438003F803F40 | |
2346 | 7DBD43>I<D907FC131890391FFF8038017FEBE0783901FC03F83A03F0007CF8D807C013 | |
2347 | 3F4848130F001F140748C7FC003E1403007E1401A2007C140012FC1678A46C1538A27EA2 | |
2348 | 6C6C14007F7FEA3FF8EBFF806C13F86CEBFF806C14F06C14FC6C14FF6C15C0013F14E001 | |
2349 | 0714F0EB007F020713F89138007FFC150FED07FE15031501ED00FFA200E0157FA3163FA2 | |
2350 | 7EA3163E7E167E6C157C6C15FC6C15F86D13016DEB03F06DEB07E0D8F9FCEB0FC03AF07F | |
2351 | 803F8090391FFFFE00D8E00713F839C0007FC028427BBF33>I<003FB91280A3903AF000 | |
2352 | 7FE001018090393FC0003F48C7ED1FC0007E1707127C00781703A300701701A548EF00E0 | |
2353 | A5C81600B3B14B7E4B7E0107B612FEA33B3D7DBC42>I<B600C090B512F8A3000101E0C7 | |
2354 | 0007130026007F80EC01FC715A1870B3B3A4013F16F06E5DA21701011F5E80010F15036E | |
2355 | 4A5A010793C7FC6D6C5C6D6C141E6D6C5C027F14F86E6C485A91390FF00FE00203B51280 | |
2356 | 020049C8FCED1FF03D407DBD44>I<B691380FFFFEA3000301E0020113E06C0180913800 | |
2357 | 7F806CEF3F00017F163E181C6E153C013F1638A26E1578011F1670A26D6C5DA26E140101 | |
2358 | 075EA26E140301035EA26D6C4AC7FCA2806D150EA26F131E027F141CA26F133C023F1438 | |
2359 | A26E6C5BA26F13F0020F5CA2EDF80102075CA26E6C485AA2EDFE07020191C8FCA26F5A6E | |
2360 | 130EA2ED7F9CA216DCED3FF8A36F5AA36F5AA26F5AA36F5A3F407EBD44>I<B500FE017F | |
2361 | B5D88007B5FCA3000301C0010101E0C713F86C90C849EC3FE07148EC0F807E7215006E14 | |
2362 | 3F017F190E84A26D6C60A24D7E6D6C60A2EFE7F86D6C60A2933801C3FC6E18F001076104 | |
2363 | 037F6E0281140101036104077F17006D6C4D5AA2040EEB7F806D6C4DC7FCA24CEB3FC0DA | |
2364 | 7F80160EA24CEB1FE003C0161E023F171C047814F0DBE070010F133C021F173804F014F8 | |
2365 | 4C1307DA0FF05EA2DBF1C0EB03FCDA07F95EA2DBFB80EB01FEDA03FF6F5AA293C8FCA26E | |
2366 | 5FA24B157F020094C8FCA24B81037C153EA20378151E0338151C58407EBD5D>I<007FB5 | |
2367 | D8C003B512E0A3C649C7EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E6D6C141C6D | |
2368 | 6C143C5F6D6C14706D6D13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC020F5BEDF8 | |
2369 | 1E913807FC1C163C6E6C5A913801FF7016F06E5B6F5AA26F7E6F7EA28282153FED3BFEED | |
2370 | 71FF15F103E07F913801C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C6D7E02386D | |
2371 | 7E14784A6D7E4A6D7F130149486E7E4A6E7E130749C86C7E496F7E497ED9FFC04A7E0007 | |
2372 | 6DEC7FFFB500FC0103B512FEA33F3E7EBD44>I<B66C0103B51280A3000101F0C8EBF800 | |
2373 | 6C6C48ED3FC0725A013F041EC7FC6D7E606D6C15386D6C1578606D6C5D6E14016D5E6D6D | |
2374 | 1303606E6C49C8FC6E6C5B170E6E6C131E171C6E6C5B6E6C137817706E6C13F06F5B6E13 | |
2375 | 016EEB83C05FED7FC7DB3FE7C9FC16EFED1FFE5E150F6F5AB3A4ED1FFC020FB512FCA341 | |
2376 | 3E7FBD44>I<003FB712F8A391C7EA1FF013F801E0EC3FE00180EC7FC090C8FC003EEDFF | |
2377 | 80A2003C4A1300007C4A5A12784B5A4B5AA200704A5AA24B5A4B5AA2C8485A4A90C7FCA2 | |
2378 | 4A5A4A5AA24A5AA24A5A4A5AA24A5A4A5AA24990C8FCA2495A4948141CA2495A495AA249 | |
2379 | 5A495A173C495AA24890C8FC485A1778485A484815F8A24848140116034848140F484814 | |
2380 | 3FED01FFB8FCA32E3E7BBD38>I<EAFFFCA4EAF000B3B3B3B3ABEAFFFCA40E5B77C319>I< | |
2381 | 486C13C00003130101001380481303000EEB070048130E0018130C0038131C0030131800 | |
2382 | 70133800601330A300E01370481360A400CFEB678039FFC07FE001E013F0A3007F133FA2 | |
2383 | 003F131F01C013E0390F0007801C1C73BE2D>I<EAFFFCA4EA003CB3B3B3B3ABEAFFFCA4 | |
2384 | 0E5B7FC319>I<EA0180120313005A120E5A12181238123012701260A312E05AA412CFEA | |
2385 | FFC013E0A3127FA2123F13C0EA0F000B1C7ABE19>96 D<EB0FF8EBFFFE3903F01F803907 | |
2386 | 8007E0000F6D7E9038E001F8D81FF07F6E7EA3157F6C5AEA0380C8FCA4EC1FFF0103B5FC | |
2387 | 90381FF87FEB7F803801FC00EA07F8EA0FE0485A485AA248C7FCEE038012FEA315FFA300 | |
2388 | 7F5BEC03BF3B3F80071F8700261FC00E13CF3A07F03C0FFE3A01FFF807FC3A003FC001F0 | |
2389 | 292A7DA82D>I<EA01FC12FFA3120712031201B1EC03FC91381FFF8091387C07E09039FD | |
2390 | E001F09039FFC000FC4A137E91C77E49158049141F17C0EE0FE0A217F0A2160717F8AA17 | |
2391 | F0A2160FA217E0161F17C06D1580EE3F006D5C6E13FE9039F3C001F89039F1E003F09039 | |
2392 | E0780FC09026C03FFFC7FCC7EA07F82D407EBE33>I<49B4FC010F13E090383F00F8017C | |
2393 | 131E4848131F4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290C9 | |
2394 | FC5AAB6C7EA3003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C6C | |
2395 | 137890383F01F090380FFFC0D901FEC7FC222A7DA828>I<ED01FC15FFA3150715031501 | |
2396 | B114FF010713E190381F80F990387E003D49131FD803F81307485A49130348481301121F | |
2397 | 123F5B127FA290C7FCA25AAA7E7FA2123FA26C7E000F14037F000714076C6C497E6C6C49 | |
2398 | 7ED8007C017913F890383F01F190380FFFC1903A01FE01FC002D407DBE33>I<EB01FE90 | |
2399 | 380FFFC090383F03F09038FC01F848486C7E4848137E48487F000F158049131F001F15C0 | |
2400 | 4848130FA2127F16E090C7FCA25AA290B6FCA290C9FCA67EA27F123F16E06C7E1501000F | |
2401 | 15C06C6C13036DEB07806C6C1400C66C131E017E5B90381F80F8903807FFE0010090C7FC | |
2402 | 232A7EA828>I<EC1FC0EC7FF8903801F83C903807E07E90380FC0FFEB1FC1EB3F811401 | |
2403 | 137FEC00FE01FE137C1500AEB6FCA3C648C7FCB3AE487E007F13FFA320407EBF1C>I<16 | |
2404 | 7C903903F801FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC06 | |
2405 | 00000F6EC7FC49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E03903 | |
2406 | FE0FC026071FFFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15E0 | |
2407 | 6C810003813A0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E15 | |
2408 | 7E6C5D6C6C495A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D7E | |
2409 | A82D>I<EA01FC12FFA3120712031201B1EC01FE913807FFC091381E07E091387803F091 | |
2410 | 38E001F8D9FDC07F148001FF6D7E91C7FCA25BA25BB3A6486C497EB5D8F87F13FCA32E3F | |
2411 | 7DBE33>I<EA01E0EA07F8A2487EA46C5AA2EA01E0C8FCACEA01FC127FA3120712031201 | |
2412 | B3AC487EB512F0A3143E7DBD1A>I<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC14 | |
2413 | 7FEB7FFFA313017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03F0 | |
2414 | 381E07C0380FFF803801FC00185185BD1C>I<EA01FC12FFA3120712031201B292B51280 | |
2415 | A392383FFC0016E0168093C7FC153C5D5D4A5AEC07C04A5A4AC8FC143E147F4A7E13FD90 | |
2416 | 38FFDFC0EC9FE0140F496C7E01FC7F496C7E1401816E7E81826F7E151F826F7EA282486C | |
2417 | 14FEB539F07FFFE0A32B3F7EBE30>I<EA01FC12FFA3120712031201B3B3B1487EB512F8 | |
2418 | A3153F7DBE1A>I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B78 | |
2419 | 03F03C01F80007903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91C7 | |
2420 | 5B13FF4992C7FCA2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>I< | |
2421 | 3901F801FE00FF903807FFC091381E07E091387803F000079038E001F82603F9C07F0001 | |
2422 | 138001FB6D7E91C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14FF | |
2423 | 010713E090381F81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F15 | |
2424 | F04848EB01F8A2003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F86C | |
2425 | 6CEB03F0A26C6CEB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFFF0 | |
2426 | 010090C7FC282A7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F03A | |
2427 | 07FFC001FC6C496C7E6C90C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0 | |
2428 | A4EE1FE0A2EE3FC06D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA | |
2429 | 3FFFC7FCEC07F891C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F | |
2430 | 80F090397F00387C01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485A | |
2431 | A448C7FCAA6C7EA36C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E13799038 | |
2432 | 3F81F190380FFFC1903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E0 | |
2433 | 00FFEB1FF8EC787CECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35B | |
2434 | B3A5487EB512FEA31F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E13 | |
2435 | 07003C1303127C0078130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F | |
2436 | 6C1480000114C0D8003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F0 | |
2437 | 7E14016C14E06CEB03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<13 | |
2438 | 1CA6133CA4137CA213FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912 | |
2439 | 009038FE01C0A2EB7F03013F138090381F8700EB07FEEB01F81B397EB723>I<D801FC14 | |
2440 | FE00FF147FA3000714030003140100011400B3A51501A31503120015076DEB06FF017E01 | |
2441 | 0E13806D4913FC90381FC078903807FFE00100903880FE002E297DA733>I<B539E00FFF | |
2442 | E0A32707FE000313006C48EB00FC5E00015D7F00005DA26D13016D5CA26D6C485AA2ECC0 | |
2443 | 07011F91C7FCA290380FE00EA2ECF01E0107131CA26D6C5AA2ECFC7801011370A2ECFEF0 | |
2444 | 01005BA2EC7FC0A36E5AA26EC8FCA3140E2B287EA630>I<B53BC3FFFE03FFF8A3290FFE | |
2445 | 003FE00013C06C486D48EB3F806C4817006D010F141E00016F131C15076D163C00004A6C | |
2446 | 1338A2017F5E4B7E151DD93F805DED3DFC1538D91FC04A5AED78FE9238707E03D90FE001 | |
2447 | 7F5BEDE03F02F0140701070387C7FC9138F1C01F02F9148F010315CE9138FB800F02FF14 | |
2448 | DE6D15FCED00076D5DA24A1303027E5CA2027C1301023C5C023813003D287EA642>I<B5 | |
2449 | 39F01FFFE0A30003D9C00F1300C690388007F8D97F0013E002805BD93FC05B011F49C7FC | |
2450 | 90380FE00EECF01E6D6C5A01035B6D6C5A6E5AEB00FF6E5A6E5A81141F814A7E81147BEC | |
2451 | F1FC903801E1FEECC0FF01037F49486C7ED90F007F011E6D7E013E130F496D7E01FC8048 | |
2452 | 6C80000F4A7EB539803FFFF8A32D277FA630>I<B539E00FFFE0A32707FE000313006C48 | |
2453 | EB01FC6F5A00015D7F00005DA2017F495AA2EC8003013F5CA26D6C48C7FCA26E5A010F13 | |
2454 | 0EA26D6C5AA2ECF83C01031338A26D6C5AA2ECFEF001005BA2EC7FC0A36E5AA36EC8FCA2 | |
2455 | 140EA2141E141C143C1438A2147800181370127EB45BA2495AA248485AD87E07C9FCEA78 | |
2456 | 0EEA3C3CEA1FF8EA07E02B3A7EA630>I<001FB61280A2EBE0000180140049485A001E49 | |
2457 | 5A121C4A5A003C495A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90 | |
2458 | 393FC00380A2EB7F80EBFF005A5B484813071207491400485A48485BA248485B4848137F | |
2459 | 00FF495A90B6FCA221277EA628>I<BE12C0A25A0280985B>124 D | |
2460 | E | |
2461 | %EndDVIPSBitmapFont | |
2462 | %DVIPSBitmapFont: Fu cmbx12 20.736 13 | |
2463 | /Fu 13 118 df<BDFC1CFEF4FFC01DF81DFF1EC01EF08AC7003F49C9000F14FE09018075 | |
2464 | 6C800A1F807680768076807680A27680A2777FA2208089A320C0A289A565A32080A35314 | |
2465 | 00A29AB55AA2525C6764525C525C525C525C5249C7FC51B55A090714F0093F14C00807B6 | |
2466 | C8FC93BA12F81DC0651DFCF5FF801EF04CCA14FC0A3F13FF0A0F800A0314E076807614FC | |
2467 | 777F777F2080897714C020E0A27714F0A220F88920FCA47714FEA96520FCA45314F8A265 | |
2468 | 20F06520E05314C0659AB61280521500525C1C0F5214F899B65A09075DC05A9CC7FC1EFC | |
2469 | 1EF01EC053C8FC1DE00AF8C9FC777679F58A>66 D<B800C051B8128071637163A37163A2 | |
2470 | 7163C7003F57C8FC71F33FBFA203EF6DF37F3FA303E76E1AFEA203E36EF101FCA203E16E | |
2471 | F103F8A203E06EF107F0A3706DF10FE0A2706DF11FC0A2706DF13F80A2706DF17F00A370 | |
2472 | 6E18FEA2706E4D5AA2706E4D5AA3706E4D5AA2716D4D5AA2716D4D5AA2716D4D5AA3716D | |
2473 | 4DC7FCA2716E16FEA2716E4B5AA2716E4B5AA3716E4B5AA2726D4B5AA2726D4B5AA3726D | |
2474 | 4B5AA2726D4BC8FCA2726E14FEA2726E495AA3726E495AA2726E495AA2736D495AA2736D | |
2475 | 495AA3736D495AA2736D49C9FCA273EC80FEA2F481FC7314C1A273ECE3F8A273ECF7F0A2 | |
2476 | 74EBFFE0A3745CA2745CA27491CAFCA2745BA3745BA2902603FFFE705BB800F897BA1280 | |
2477 | 745BA2755AA3755A755AA97679F5B8>77 D<BC7E1BFF1CF01CFF1DC01DF81DFE777EC700 | |
2478 | 3F91C8000715E0E0003F80090714FC090180756C7F7680768076807680A276808B888BA3 | |
2479 | 7680A38CAA9DC8FCA3525CA267A2525C676467525C525C5291C9FC99B512FC515C090F5C | |
2480 | 097F14C0080FB6CAFC94B912FC1DE09ACBFC1CF81CFE767E94C8003F14E0080780080114 | |
2481 | FC746C7F757F7580758075807580A275808A87A28A888AA78BA78BA779147E22FFA288A2 | |
2482 | 8B765E22FE76802103766E14FCBA00C06E6E1307766EEB0FF876ED801F779138E07FF00B | |
2483 | 1F91B512E00B0716C00B011680E3003FECFE00D1000714F8E4000F13E088787AF590>82 | |
2484 | D<92383FFFF80207B612E0027F15FC49B87E010717E0011F83499026F0007F13FC4948C7 | |
2485 | 000F7F90B502036D7E486E6D806F6D80727F486E6E7F8486727FA28684A26C5C72806C5C | |
2486 | 6D90C8FC6D5AEB0FF8EB03E090CAFCA70507B6FC041FB7FC0303B8FC157F0203B9FC021F | |
2487 | ECFE0391B612800103ECF800010F14C04991C7FC017F13FC90B512F04814C0485C4891C8 | |
2488 | FC485B5A485B5C5A5CA2B5FC5CA360A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A48 | |
2489 | 14FC6C6ED90FF0ECFFFC6C02E090263FE07F14FE00019139FC03FFC06C91B6487E013F4B | |
2490 | 487E010F4B1307010303F01301D9003F0280D9003F13FC020101F8CBFC57507ACE5E>97 | |
2491 | D<93383FFFF00307B612C0033F15F84AB712FE0207707E021F17E0027F8391B526FC001F | |
2492 | 7F010302C001037F4991C7487F49495C495B4901F04A7F5B90B55A485CA2485C4891C8FC | |
2493 | A248715B5C48715B725B4A6F5B489438007FC0071FC7FC96C8FC5AA25CA3B5FCAF7E80A4 | |
2494 | 7E80A27E806CF11F80F23FC06C6E167FA26C6EEEFF80816C606C6E17006D6D4B5A6D6D15 | |
2495 | 076D6D4B5A6D6D6C4A5A6D02E0EC7FF06D02F849485A01009126FF801F5B6E91B6C7FC02 | |
2496 | 1F5E020716F8020116E06E6C1580030702FCC8FCDB003F13804A507ACE56>99 | |
2497 | D<93387FFF80030FB512FC037FECFF804AB712E0020716F8021F16FE027FD9F8077F49B5 | |
2498 | D8C000804991C7003F13E04901FC020F7F49496E7F49498049496E7F49496E7F90B55A48 | |
2499 | 727E92C914804884485B1BC048841BE0485BA27313F05AA25C5AA21BF885A2B5FCA391BA | |
2500 | FCA41BF002F8CCFCA67EA3807EA47E806CF103F0F207F86C7F1A0F6C6E17F06C191F6F17 | |
2501 | E06C6E163F6D6DEE7FC06D6D16FF6D6D4B13806D6D4B13006D6D6CEC0FFE6D02E0EC3FFC | |
2502 | 6D02F8ECFFF86D9126FFC00F5B023F91B65A020F178002034CC7FC020016F8031F15E003 | |
2503 | 0392C8FCDB000F13E04D507BCE58>101 D<EF7FFE040FB512C093B612F0030715FC031F | |
2504 | 814B8192B5D8F01F13800203DA803F13C04A9026FC007F13E04A4990B5FC4A5B4A494814 | |
2505 | F04A13C091B51280A2491400A2495BA27114E05B4B6E13C0721380721300F007FC95C8FC | |
2506 | B3B912C0A8D8000749CAFCB3B3B3A7007FB712FCA844797AF83B>I<903801FFFCB6FCA8 | |
2507 | C67E131F7FB3AD95380FFFE095B512FE05036E7E050F15E0053F15F84D81932701FFF01F | |
2508 | 7F4CD900077FDC07FC6D80DC0FF06D80DC1FC07F4C48824CC8FC047E6F7F5EEDFDF85E03 | |
2509 | FF707F5EA25EA25EA293C9FCA45DB3B3A6B8D8E003B81280A8617879F76C>104 | |
2510 | D<903801FFFCB6FCA8C67E131F7FB3B3B3B3B3ABB812C0A82A7879F735>108 | |
2511 | D<902601FFF891380FFFE0B692B512FE05036E7E050F15E0053F15F84D81932701FFF01F | |
2512 | 7F4CD900077FDC07FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC047E6F7F5E | |
2513 | EDF9F85E03FB707F5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A8614E79CD6C | |
2514 | >110 D<902601FFF8EB07FEB691383FFFC094B512F00403804C14FE4C8093261FFC3F13 | |
2515 | 8093263FE07F13C0DC7F80B5FCC66C5D011FDAFE0114E06DEBF9FC16F815FB16F016E015 | |
2516 | FF16C07114C05E72138095381FFE0093C76C5AF001E095C8FCA25DA65DB3B3A2B812F8A8 | |
2517 | 434E7ACD4F>114 D<912603FFFCEB0780027F9039FFE00FC00103B6EAF83F010FEDFEFF | |
2518 | 013F92B5FC49EB000F2601FFF01300480180143F4890C8120F4848814848814981123F83 | |
2519 | 485A187FA212FF6D163FA37F7F6DEE1F8002C092C7FC14F014FEECFFF06CECFF8016FEEE | |
2520 | FFE06C16FC6C16FF18C06C836C17F86C836C836C83013F17806D17C0010717E0010117F0 | |
2521 | EB003F020716F8EC001F030015FC1607EE007F051F13FE1707007E82B482836D167FA218 | |
2522 | 3F7F181FA27F19FC7FA26D163F6D17F86D167F19F06D16FF6E4A13E002E04A13C06E4A13 | |
2523 | 8002FE023F1300913AFFC003FFFE01E790B65A01C316F0018016C026FE003F92C7FC4801 | |
2524 | 0714F80070D9007F90C8FC3F507ACE4C>I<DAFFFE933803FFF8B60303B6FCA8C66CEE00 | |
2525 | 01011F717E6D84B3B3A862A497B5FCA261A2616D5F1ADF6F150F6DEF1F9F073F806D6EDA | |
2526 | 7F1F13FF6D6ED901FEEDFF8070EB07FC023F01FEEB3FF86E90B612F06E16C00203168002 | |
2527 | 00EDFE00031F14F80300028003C0C7FC614F79CD6C>117 D E | |
2528 | %EndDVIPSBitmapFont | |
2529 | end | |
2530 | %%EndProlog | |
2531 | %%BeginSetup | |
2532 | %%Feature: *Resolution 600dpi | |
2533 | TeXDict begin | |
2534 | %%BeginPaperSize: Letter | |
2535 | letter | |
2536 | %%EndPaperSize | |
2537 | ||
2538 | %%EndSetup | |
2539 | %%Page: 1 1 | |
2540 | 1 0 bop 150 1318 a Fu(Bash)64 b(Reference)j(Man)-5 b(ual)p | |
2541 | 150 1385 3600 34 v 2361 1481 a Ft(Reference)31 b(Do)s(cumen)m(tation)h | |
2542 | (for)e(Bash)2181 1589 y(Edition)e(3.0,)k(for)e Fs(Bash)f | |
2543 | Ft(V)-8 b(ersion)30 b(3.0-alpha.)3139 1697 y(No)m(v)m(em)m(b)s(er)h | |
2544 | (2003)150 4935 y Fr(Chet)45 b(Ramey)-11 b(,)46 b(Case)g(W)-11 | |
2545 | b(estern)46 b(Reserv)l(e)g(Univ)l(ersit)l(y)150 5068 | |
2546 | y(Brian)f(F)-11 b(o)l(x,)45 b(F)-11 b(ree)45 b(Soft)l(w)l(are)h(F)-11 | |
2547 | b(oundation)p 150 5141 3600 17 v eop | |
2548 | %%Page: 2 2 | |
2549 | 2 1 bop 150 2889 a Ft(This)34 b(text)i(is)f(a)h(brief)e(description)g | |
2550 | (of)h(the)h(features)g(that)g(are)g(presen)m(t)g(in)e(the)i(Bash)f | |
2551 | (shell)f(\(v)m(ersion)150 2999 y(3.0-alpha,)d(13)g(No)m(v)m(em)m(b)s | |
2552 | (er)h(2003\).)150 3133 y(This)c(is)i(Edition)e(3.0,)j(last)f(up)s | |
2553 | (dated)f(13)i(No)m(v)m(em)m(b)s(er)h(2003,)g(of)e Fq(The)g(GNU)h(Bash)f | |
2554 | (Reference)h(Man)m(ual)p Ft(,)150 3243 y(for)f Fs(Bash)p | |
2555 | Ft(,)g(V)-8 b(ersion)30 b(3.0-alpha.)150 3377 y(Cop)m(yrigh)m(t)602 | |
2556 | 3374 y(c)577 3377 y Fp(\015)g Ft(1988-2003)k(F)-8 b(ree)32 | |
2557 | b(Soft)m(w)m(are)f(F)-8 b(oundation,)31 b(Inc.)150 3512 | |
2558 | y(P)m(ermission)f(is)i(gran)m(ted)h(to)f(mak)m(e)i(and)d(distribute)f | |
2559 | (v)m(erbatim)i(copies)g(of)g(this)f(man)m(ual)h(pro)m(vided)f(the)150 | |
2560 | 3621 y(cop)m(yrigh)m(t)g(notice)f(and)g(this)f(p)s(ermission)f(notice)i | |
2561 | (are)h(preserv)m(ed)f(on)h(all)e(copies.)390 3756 y(P)m(ermission)k(is) | |
2562 | i(gran)m(ted)g(to)h(cop)m(y)-8 b(,)38 b(distribute)33 | |
2563 | b(and/or)i(mo)s(dify)e(this)h(do)s(cumen)m(t)h(under)390 | |
2564 | 3866 y(the)j(terms)g(of)g(the)g(GNU)h(F)-8 b(ree)39 b(Do)s(cumen)m | |
2565 | (tation)g(License,)g(V)-8 b(ersion)38 b(1.1)h(or)f(an)m(y)g(later)390 | |
2566 | 3975 y(v)m(ersion)27 b(published)c(b)m(y)28 b(the)f(F)-8 | |
2567 | b(ree)29 b(Soft)m(w)m(are)f(F)-8 b(oundation;)29 b(with)d(no)h(In)m(v) | |
2568 | -5 b(arian)m(t)27 b(Sections,)390 4085 y(with)i(the)i(F)-8 | |
2569 | b(ron)m(t-Co)m(v)m(er)33 b(texts)e(b)s(eing)f(\\A)h(GNU)g(Man)m(ual,")g | |
2570 | (and)f(with)f(the)i(Bac)m(k-Co)m(v)m(er)390 4194 y(T)-8 | |
2571 | b(exts)33 b(as)g(in)e(\(a\))i(b)s(elo)m(w.)46 b(A)33 | |
2572 | b(cop)m(y)g(of)f(the)h(license)e(is)h(included)d(in)i(the)i(section)f | |
2573 | (en)m(titled)390 4304 y(\\GNU)f(F)-8 b(ree)32 b(Do)s(cumen)m(tation)f | |
2574 | (License.")390 4438 y(\(a\))39 b(The)f(FSF's)g(Bac)m(k-Co)m(v)m(er)j(T) | |
2575 | -8 b(ext)39 b(is:)55 b(\\Y)-8 b(ou)39 b(ha)m(v)m(e)g(freedom)f(to)h | |
2576 | (cop)m(y)f(and)g(mo)s(dify)390 4548 y(this)31 b(GNU)j(Man)m(ual,)f(lik) | |
2577 | m(e)f(GNU)h(soft)m(w)m(are.)49 b(Copies)31 b(published)e(b)m(y)j(the)h | |
2578 | (F)-8 b(ree)34 b(Soft)m(w)m(are)390 4658 y(F)-8 b(oundation)30 | |
2579 | b(raise)g(funds)e(for)j(GNU)g(dev)m(elopmen)m(t.")150 | |
2580 | 4902 y(Published)c(b)m(y)j(the)h(F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 | |
2581 | b(oundation)150 5011 y(59)31 b(T)-8 b(emple)30 b(Place,)h(Suite)e(330,) | |
2582 | 150 5121 y(Boston,)j(MA)e(02111-1307)150 5230 y(USA)p | |
2583 | eop | |
2584 | %%Page: -1 3 | |
2585 | -1 2 bop 3725 -116 a Ft(i)150 299 y Fo(T)-13 b(able)54 | |
2586 | b(of)g(Con)l(ten)l(ts)150 641 y Fr(1)135 b(In)l(tro)t(duction)15 | |
2587 | b Fn(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f | |
2588 | (.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)60 | |
2589 | b Fr(1)449 778 y Ft(1.1)92 b(What)31 b(is)e(Bash?)21 | |
2590 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2591 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2592 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 b Ft(1)449 888 y(1.2)92 | |
2593 | b(What)31 b(is)e(a)i(shell?)14 b Fm(.)f(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2594 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2595 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 | |
2596 | b Ft(1)150 1130 y Fr(2)135 b(De\014nitions)37 b Fn(.)19 | |
2597 | b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h | |
2598 | (.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)81 | |
2599 | b Fr(3)150 1400 y(3)135 b(Basic)45 b(Shell)g(F)-11 b(eatures)12 | |
2600 | b Fn(.)20 b(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f | |
2601 | (.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)57 b Fr(5)449 1537 y Ft(3.1)92 | |
2602 | b(Shell)28 b(Syn)m(tax)22 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2603 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2604 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 | |
2605 | b Ft(5)748 1646 y(3.1.1)93 b(Shell)28 b(Op)s(eration)10 | |
2606 | b Fm(.)k(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2607 | g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 | |
2608 | b Ft(5)748 1756 y(3.1.2)93 b(Quoting)10 b Fm(.)k(.)h(.)g(.)g(.)g(.)g(.) | |
2609 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g | |
2610 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 | |
2611 | b Ft(5)1047 1866 y(3.1.2.1)93 b(Escap)s(e)30 b(Character)24 | |
2612 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
2613 | (.)g(.)g(.)g(.)g(.)g(.)53 b Ft(6)1047 1975 y(3.1.2.2)93 | |
2614 | b(Single)29 b(Quotes)15 b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.) | |
2615 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 | |
2616 | b Ft(6)1047 2085 y(3.1.2.3)93 b(Double)30 b(Quotes)15 | |
2617 | b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2618 | g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)44 b Ft(6)1047 2194 y(3.1.2.4)93 | |
2619 | b(ANSI-C)30 b(Quoting)18 b Fm(.)c(.)h(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
2620 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 | |
2621 | b Ft(6)1047 2304 y(3.1.2.5)93 b(Lo)s(cale-Sp)s(eci\014c)30 | |
2622 | b(T)-8 b(ranslation)11 b Fm(.)j(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2623 | (.)g(.)g(.)41 b Ft(7)748 2413 y(3.1.3)93 b(Commen)m(ts)25 | |
2624 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2625 | (.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2626 | g(.)g(.)g(.)55 b Ft(7)449 2523 y(3.2)92 b(Shell)28 b(Commands)23 | |
2627 | b Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g | |
2628 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2629 | g(.)g(.)g(.)g(.)g(.)g(.)53 b Ft(7)748 2633 y(3.2.1)93 | |
2630 | b(Simple)28 b(Commands)15 b Fm(.)f(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2631 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2632 | g(.)g(.)45 b Ft(8)748 2742 y(3.2.2)93 b(Pip)s(elines)14 | |
2633 | b Fm(.)e(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2634 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
2635 | (.)g(.)g(.)g(.)g(.)44 b Ft(8)748 2852 y(3.2.3)93 b(Lists)29 | |
2636 | b(of)i(Commands)23 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2637 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2638 | 54 b Ft(8)748 2961 y(3.2.4)93 b(Comp)s(ound)28 b(Commands)17 | |
2639 | b Fm(.)d(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2640 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 b Ft(9)1047 3071 | |
2641 | y(3.2.4.1)93 b(Lo)s(oping)29 b(Constructs)d Fm(.)15 b(.)g(.)g(.)g(.)g | |
2642 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 | |
2643 | b Ft(9)1047 3181 y(3.2.4.2)93 b(Conditional)28 b(Constructs)18 | |
2644 | b Fm(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 | |
2645 | b Ft(10)1047 3290 y(3.2.4.3)93 b(Grouping)29 b(Commands)13 | |
2646 | b Fm(.)h(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2647 | g(.)42 b Ft(13)449 3400 y(3.3)92 b(Shell)28 b(F)-8 b(unctions)8 | |
2648 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g | |
2649 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2650 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 b Ft(13)449 3509 y(3.4)92 | |
2651 | b(Shell)28 b(P)m(arameters)20 b Fm(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2652 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2653 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 b | |
2654 | Ft(14)748 3619 y(3.4.1)93 b(P)m(ositional)29 b(P)m(arameters)14 | |
2655 | b Fm(.)i(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.) | |
2656 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)43 b Ft(15)748 3729 | |
2657 | y(3.4.2)93 b(Sp)s(ecial)28 b(P)m(arameters)h Fm(.)15 | |
2658 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2659 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)57 b Ft(15)449 | |
2660 | 3838 y(3.5)92 b(Shell)28 b(Expansions)20 b Fm(.)13 b(.)i(.)g(.)g(.)g(.) | |
2661 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
2662 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 | |
2663 | b Ft(16)748 3948 y(3.5.1)93 b(Brace)31 b(Expansion)d | |
2664 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2665 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)58 | |
2666 | b Ft(17)748 4057 y(3.5.2)93 b(Tilde)28 b(Expansion)17 | |
2667 | b Fm(.)d(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2668 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 | |
2669 | b Ft(17)748 4167 y(3.5.3)93 b(Shell)28 b(P)m(arameter)j(Expansion)18 | |
2670 | b Fm(.)c(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2671 | h(.)f(.)g(.)g(.)47 b Ft(18)748 4276 y(3.5.4)93 b(Command)29 | |
2672 | b(Substitution)d Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2673 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(21)748 | |
2674 | 4386 y(3.5.5)93 b(Arithmetic)29 b(Expansion)12 b Fm(.)i(.)h(.)g(.)g(.)g | |
2675 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2676 | g(.)g(.)g(.)42 b Ft(21)748 4496 y(3.5.6)93 b(Pro)s(cess)30 | |
2677 | b(Substitution)19 b Fm(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2678 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 | |
2679 | b Ft(21)748 4605 y(3.5.7)93 b(W)-8 b(ord)30 b(Splitting)23 | |
2680 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2681 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 | |
2682 | b Ft(22)748 4715 y(3.5.8)93 b(Filename)29 b(Expansion)24 | |
2683 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2684 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Ft(22)1047 | |
2685 | 4824 y(3.5.8.1)93 b(P)m(attern)31 b(Matc)m(hing)20 b | |
2686 | Fm(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
2687 | (.)g(.)g(.)g(.)49 b Ft(23)748 4934 y(3.5.9)93 b(Quote)30 | |
2688 | b(Remo)m(v)-5 b(al)15 b Fm(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2689 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
2690 | g(.)g(.)g(.)44 b Ft(24)449 5044 y(3.6)92 b(Redirections)22 | |
2691 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g | |
2692 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2693 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Ft(24)748 5153 | |
2694 | y(3.6.1)93 b(Redirecting)29 b(Input)11 b Fm(.)j(.)h(.)g(.)g(.)g(.)g(.)g | |
2695 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2696 | g(.)h(.)f(.)g(.)g(.)40 b Ft(25)748 5263 y(3.6.2)93 b(Redirecting)29 | |
2697 | b(Output)18 b Fm(.)13 b(.)i(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2698 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 | |
2699 | b Ft(25)p eop | |
2700 | %%Page: -2 4 | |
2701 | -2 3 bop 150 -116 a Ft(ii)2610 b(Bash)31 b(Reference)g(Man)m(ual)748 | |
2702 | 83 y(3.6.3)93 b(App)s(ending)27 b(Redirected)j(Output)16 | |
2703 | b Fm(.)e(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2704 | g(.)45 b Ft(26)748 193 y(3.6.4)93 b(Redirecting)29 b(Standard)g(Output) | |
2705 | g(and)h(Standard)f(Error)954 302 y Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
2706 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2707 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2708 | g(.)g(.)g(.)g(.)g(.)54 b Ft(26)748 412 y(3.6.5)93 b(Here)30 | |
2709 | b(Do)s(cumen)m(ts)13 b Fm(.)k(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2710 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2711 | g(.)g(.)43 b Ft(26)748 521 y(3.6.6)93 b(Here)30 b(Strings)10 | |
2712 | b Fm(.)k(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2713 | g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2714 | (.)39 b Ft(26)748 631 y(3.6.7)93 b(Duplicating)28 b(File)i(Descriptors) | |
2715 | 17 b Fm(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2716 | (.)g(.)g(.)g(.)47 b Ft(27)748 741 y(3.6.8)93 b(Mo)m(ving)30 | |
2717 | b(File)g(Descriptors)15 b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2718 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)44 | |
2719 | b Ft(27)748 850 y(3.6.9)93 b(Op)s(ening)28 b(File)h(Descriptors)h(for)g | |
2720 | (Reading)g(and)g(W)-8 b(riting)954 960 y Fm(.)16 b(.)f(.)g(.)g(.)g(.)g | |
2721 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2722 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
2723 | (.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Ft(27)449 1069 y(3.7)92 | |
2724 | b(Executing)30 b(Commands)25 b Fm(.)15 b(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.) | |
2725 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2726 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 b Ft(27)748 1179 y(3.7.1)93 | |
2727 | b(Simple)28 b(Command)h(Expansion)24 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.) | |
2728 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b | |
2729 | Ft(27)748 1289 y(3.7.2)93 b(Command)29 b(Searc)m(h)i(and)e(Execution)13 | |
2730 | b Fm(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)42 | |
2731 | b Ft(28)748 1398 y(3.7.3)93 b(Command)29 b(Execution)h(En)m(vironmen)m | |
2732 | (t)18 b Fm(.)c(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 | |
2733 | b Ft(29)748 1508 y(3.7.4)93 b(En)m(vironmen)m(t)21 b | |
2734 | Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2735 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2736 | 50 b Ft(30)748 1617 y(3.7.5)93 b(Exit)29 b(Status)8 b | |
2737 | Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2738 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
2739 | f(.)g(.)37 b Ft(30)748 1727 y(3.7.6)93 b(Signals)10 b | |
2740 | Fm(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2741 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2742 | g(.)g(.)g(.)g(.)g(.)39 b Ft(31)449 1836 y(3.8)92 b(Shell)28 | |
2743 | b(Scripts)21 b Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2744 | g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2745 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 | |
2746 | b Ft(31)150 2079 y Fr(4)135 b(Shell)45 b(Builtin)g(Commands)38 | |
2747 | b Fn(.)19 b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h | |
2748 | (.)f(.)82 b Fr(33)449 2216 y Ft(4.1)92 b(Bourne)30 b(Shell)e(Builtins) | |
2749 | 16 b Fm(.)c(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
2750 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2751 | g(.)45 b Ft(33)449 2325 y(4.2)92 b(Bash)30 b(Builtin)e(Commands)17 | |
2752 | b Fm(.)d(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
2753 | f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)46 | |
2754 | b Ft(39)449 2435 y(4.3)92 b(The)30 b(Set)g(Builtin)22 | |
2755 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2756 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2757 | g(.)g(.)g(.)g(.)g(.)g(.)53 b Ft(50)449 2545 y(4.4)92 | |
2758 | b(Sp)s(ecial)29 b(Builtins)22 b Fm(.)12 b(.)j(.)g(.)g(.)g(.)g(.)g(.)h | |
2759 | (.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2760 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 | |
2761 | b Ft(53)150 2787 y Fr(5)135 b(Shell)45 b(V)-11 b(ariables)10 | |
2762 | b Fn(.)21 b(.)e(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f | |
2763 | (.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)55 b Fr(55)449 | |
2764 | 2924 y Ft(5.1)92 b(Bourne)30 b(Shell)e(V)-8 b(ariables)11 | |
2765 | b Fm(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2766 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 | |
2767 | b Ft(55)449 3034 y(5.2)92 b(Bash)30 b(V)-8 b(ariables)17 | |
2768 | b Fm(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2769 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
2770 | (.)g(.)g(.)g(.)g(.)g(.)g(.)46 b Ft(55)150 3276 y Fr(6)135 | |
2771 | b(Bash)44 b(F)-11 b(eatures)31 b Fn(.)20 b(.)f(.)g(.)h(.)f(.)h(.)f(.)h | |
2772 | (.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.) | |
2773 | g(.)h(.)75 b Fr(63)449 3413 y Ft(6.1)92 b(In)m(v)m(oking)30 | |
2774 | b(Bash)f Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2775 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2776 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(63)449 3523 | |
2777 | y(6.2)92 b(Bash)30 b(Startup)g(Files)24 b Fm(.)15 b(.)g(.)h(.)f(.)g(.)g | |
2778 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2779 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 | |
2780 | b Ft(65)449 3632 y(6.3)92 b(In)m(teractiv)m(e)32 b(Shells)14 | |
2781 | b Fm(.)f(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2782 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g | |
2783 | (.)g(.)g(.)g(.)g(.)43 b Ft(67)748 3742 y(6.3.1)93 b(What)31 | |
2784 | b(is)e(an)h(In)m(teractiv)m(e)i(Shell?)20 b Fm(.)13 b(.)i(.)g(.)g(.)g | |
2785 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 | |
2786 | b Ft(67)748 3851 y(6.3.2)93 b(Is)30 b(this)f(Shell)f(In)m(teractiv)m | |
2787 | (e?)10 b Fm(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2788 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Ft(67)748 | |
2789 | 3961 y(6.3.3)93 b(In)m(teractiv)m(e)31 b(Shell)e(Beha)m(vior)22 | |
2790 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2791 | (.)g(.)g(.)g(.)g(.)g(.)51 b Ft(67)449 4071 y(6.4)92 b(Bash)30 | |
2792 | b(Conditional)e(Expressions)20 b Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g | |
2793 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
2794 | f(.)49 b Ft(68)449 4180 y(6.5)92 b(Shell)28 b(Arithmetic)f | |
2795 | Fm(.)15 b(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2796 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2797 | g(.)g(.)h(.)f(.)g(.)57 b Ft(70)449 4290 y(6.6)92 b(Aliases)23 | |
2798 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2799 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2800 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 | |
2801 | b Ft(71)449 4399 y(6.7)92 b(Arra)m(ys)29 b Fm(.)15 b(.)g(.)g(.)g(.)g(.) | |
2802 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2803 | (.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2804 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(72)449 4509 y(6.8)92 | |
2805 | b(The)30 b(Directory)h(Stac)m(k)15 b Fm(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
2806 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
2807 | f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 b Ft(73)748 | |
2808 | 4619 y(6.8.1)93 b(Directory)30 b(Stac)m(k)i(Builtins)10 | |
2809 | b Fm(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2810 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Ft(73)449 4728 y(6.9)92 | |
2811 | b(Con)m(trolling)28 b(the)j(Prompt)15 b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2812 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2813 | g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)44 b Ft(74)449 4838 y(6.10)92 | |
2814 | b(The)30 b(Restricted)h(Shell)11 b Fm(.)i(.)i(.)g(.)g(.)g(.)g(.)g(.)g | |
2815 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2816 | g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)40 b Ft(76)449 4947 | |
2817 | y(6.11)92 b(Bash)31 b(POSIX)e(Mo)s(de)16 b Fm(.)f(.)g(.)g(.)g(.)g(.)g | |
2818 | (.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2819 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b | |
2820 | Ft(76)p eop | |
2821 | %%Page: -3 5 | |
2822 | -3 4 bop 3674 -116 a Ft(iii)150 83 y Fr(7)135 b(Job)45 | |
2823 | b(Con)l(trol)32 b Fn(.)20 b(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h | |
2824 | (.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.) | |
2825 | 76 b Fr(79)449 220 y Ft(7.1)92 b(Job)30 b(Con)m(trol)g(Basics)23 | |
2826 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2827 | (.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2828 | g(.)g(.)g(.)52 b Ft(79)449 330 y(7.2)92 b(Job)30 b(Con)m(trol)g | |
2829 | (Builtins)12 b Fm(.)g(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2830 | (.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2831 | g(.)g(.)g(.)g(.)g(.)41 b Ft(80)449 439 y(7.3)92 b(Job)30 | |
2832 | b(Con)m(trol)g(V)-8 b(ariables)28 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g | |
2833 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2834 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(81)150 682 | |
2835 | y Fr(8)135 b(Command)45 b(Line)g(Editing)38 b Fn(.)19 | |
2836 | b(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h | |
2837 | (.)81 b Fr(83)449 819 y Ft(8.1)92 b(In)m(tro)s(duction)29 | |
2838 | b(to)i(Line)e(Editing)22 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
2839 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2840 | (.)53 b Ft(83)449 928 y(8.2)92 b(Readline)29 b(In)m(teraction)15 | |
2841 | b Fm(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2842 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g | |
2843 | (.)g(.)44 b Ft(83)748 1038 y(8.2.1)93 b(Readline)29 b(Bare)i(Essen)m | |
2844 | (tials)23 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2845 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Ft(83)748 | |
2846 | 1147 y(8.2.2)93 b(Readline)29 b(Mo)m(v)m(emen)m(t)j(Commands)13 | |
2847 | b Fm(.)h(.)h(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2848 | 42 b Ft(84)748 1257 y(8.2.3)93 b(Readline)29 b(Killing)e(Commands)20 | |
2849 | b Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2850 | (.)g(.)g(.)g(.)50 b Ft(84)748 1367 y(8.2.4)93 b(Readline)29 | |
2851 | b(Argumen)m(ts)23 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g | |
2852 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 | |
2853 | b Ft(85)748 1476 y(8.2.5)93 b(Searc)m(hing)29 b(for)i(Commands)e(in)g | |
2854 | (the)h(History)25 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 | |
2855 | b Ft(85)449 1586 y(8.3)92 b(Readline)29 b(Init)g(File)e | |
2856 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2857 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
2858 | g(.)g(.)g(.)g(.)56 b Ft(86)748 1695 y(8.3.1)93 b(Readline)29 | |
2859 | b(Init)g(File)g(Syn)m(tax)12 b Fm(.)k(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2860 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)41 | |
2861 | b Ft(86)748 1805 y(8.3.2)93 b(Conditional)27 b(Init)j(Constructs)f | |
2862 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2863 | (.)g(.)g(.)g(.)59 b Ft(91)748 1914 y(8.3.3)93 b(Sample)29 | |
2864 | b(Init)g(File)21 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2865 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2866 | (.)g(.)51 b Ft(92)449 2024 y(8.4)92 b(Bindable)29 b(Readline)g | |
2867 | (Commands)12 b Fm(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2868 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)41 | |
2869 | b Ft(95)748 2134 y(8.4.1)93 b(Commands)29 b(F)-8 b(or)31 | |
2870 | b(Mo)m(ving)c Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2871 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 b Ft(95)748 | |
2872 | 2243 y(8.4.2)93 b(Commands)29 b(F)-8 b(or)31 b(Manipulating)d(The)i | |
2873 | (History)18 b Fm(.)d(.)g(.)g(.)g(.)g(.)g(.)47 b Ft(95)748 | |
2874 | 2353 y(8.4.3)93 b(Commands)29 b(F)-8 b(or)31 b(Changing)e(T)-8 | |
2875 | b(ext)30 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2876 | g(.)h(.)f(.)58 b Ft(96)748 2462 y(8.4.4)93 b(Killing)27 | |
2877 | b(And)i(Y)-8 b(anking)17 b Fm(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2878 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)46 | |
2879 | b Ft(98)748 2572 y(8.4.5)93 b(Sp)s(ecifying)27 b(Numeric)j(Argumen)m | |
2880 | (ts)25 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2881 | (.)g(.)g(.)54 b Ft(98)748 2682 y(8.4.6)93 b(Letting)30 | |
2882 | b(Readline)f(T)m(yp)s(e)h(F)-8 b(or)31 b(Y)-8 b(ou)19 | |
2883 | b Fm(.)d(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2884 | 49 b Ft(99)748 2791 y(8.4.7)93 b(Keyb)s(oard)29 b(Macros)10 | |
2885 | b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2886 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 | |
2887 | b Ft(100)748 2901 y(8.4.8)93 b(Some)30 b(Miscellaneous)f(Commands)12 | |
2888 | b Fm(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)42 | |
2889 | b Ft(101)449 3010 y(8.5)92 b(Readline)29 b(vi)g(Mo)s(de)d | |
2890 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2891 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2892 | g(.)g(.)g(.)55 b Ft(103)449 3120 y(8.6)92 b(Programmable)30 | |
2893 | b(Completion)12 b Fm(.)h(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2894 | g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)41 | |
2895 | b Ft(103)449 3230 y(8.7)92 b(Programmable)30 b(Completion)f(Builtins)12 | |
2896 | b Fm(.)g(.)j(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2897 | g(.)g(.)g(.)g(.)42 b Ft(105)150 3472 y Fr(9)135 b(Using)45 | |
2898 | b(History)h(In)l(teractiv)l(ely)14 b Fn(.)22 b(.)d(.)h(.)f(.)g(.)h(.)f | |
2899 | (.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)58 b Fr(109)449 3609 y | |
2900 | Ft(9.1)92 b(Bash)30 b(History)g(F)-8 b(acilities)11 b | |
2901 | Fm(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f | |
2902 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)41 | |
2903 | b Ft(109)449 3719 y(9.2)92 b(Bash)30 b(History)g(Builtins)9 | |
2904 | b Fm(.)k(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2905 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)38 | |
2906 | b Ft(109)449 3828 y(9.3)92 b(History)30 b(Expansion)d | |
2907 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2908 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2909 | g(.)g(.)58 b Ft(111)748 3938 y(9.3.1)93 b(Ev)m(en)m(t)31 | |
2910 | b(Designators)21 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2911 | g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 | |
2912 | b Ft(111)748 4047 y(9.3.2)93 b(W)-8 b(ord)30 b(Designators)f | |
2913 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
2914 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(112)748 | |
2915 | 4157 y(9.3.3)93 b(Mo)s(di\014ers)26 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g | |
2916 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2917 | g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)57 b Ft(113)150 | |
2918 | 4399 y Fr(10)135 b(Installing)46 b(Bash)30 b Fn(.)20 | |
2919 | b(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f | |
2920 | (.)h(.)f(.)g(.)h(.)f(.)h(.)74 b Fr(115)449 4536 y Ft(10.1)92 | |
2921 | b(Basic)31 b(Installation)26 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2922 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
2923 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)57 b Ft(115)449 | |
2924 | 4646 y(10.2)92 b(Compilers)28 b(and)i(Options)22 b Fm(.)14 | |
2925 | b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2926 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)51 | |
2927 | b Ft(115)449 4755 y(10.3)92 b(Compiling)28 b(F)-8 b(or)31 | |
2928 | b(Multiple)d(Arc)m(hitectures)12 b Fm(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2929 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)41 b Ft(116)449 | |
2930 | 4865 y(10.4)92 b(Installation)29 b(Names)22 b Fm(.)16 | |
2931 | b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2932 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)51 | |
2933 | b Ft(116)449 4975 y(10.5)92 b(Sp)s(ecifying)28 b(the)j(System)f(T)m(yp) | |
2934 | s(e)11 b Fm(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2935 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)41 b Ft(116)449 | |
2936 | 5084 y(10.6)92 b(Sharing)29 b(Defaults)21 b Fm(.)15 b(.)g(.)g(.)g(.)g | |
2937 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2938 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 | |
2939 | b Ft(117)449 5194 y(10.7)92 b(Op)s(eration)29 b(Con)m(trols)12 | |
2940 | b Fm(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2941 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
2942 | (.)41 b Ft(117)449 5303 y(10.8)92 b(Optional)29 b(F)-8 | |
2943 | b(eatures)17 b Fm(.)g(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2944 | (.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
2945 | g(.)g(.)g(.)g(.)g(.)47 b Ft(117)p eop | |
2946 | %%Page: -4 6 | |
2947 | -4 5 bop 150 -116 a Ft(iv)2588 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
2948 | 83 y Fr(App)t(endix)44 b(A)99 b(Rep)t(orting)46 b(Bugs)12 | |
2949 | b Fn(.)20 b(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.) | |
2950 | 56 b Fr(123)150 353 y(App)t(endix)44 b(B)105 b(Ma)7 b(jor)46 | |
2951 | b(Di\013erences)g(F)-11 b(rom)45 b(The)f(Bourne)419 486 | |
2952 | y(Shell)17 b Fn(.)j(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g | |
2953 | (.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.) | |
2954 | f(.)h(.)f(.)61 b Fr(125)449 623 y Ft(B.1)92 b(Implemen)m(tation)29 | |
2955 | b(Di\013erences)i(F)-8 b(rom)31 b(The)f(SVR4.2)h(Shell)21 | |
2956 | b Fm(.)13 b(.)i(.)g(.)g(.)50 b Ft(129)150 865 y Fr(App)t(endix)44 | |
2957 | b(C)104 b(Cop)l(ying)46 b(This)e(Man)l(ual)27 b Fn(.)20 | |
2958 | b(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)71 b Fr(131)449 1002 | |
2959 | y Ft(C.1)91 b(GNU)31 b(F)-8 b(ree)32 b(Do)s(cumen)m(tation)f(License)26 | |
2960 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f | |
2961 | (.)g(.)g(.)g(.)g(.)56 b Ft(131)748 1112 y(C.1.1)92 b(ADDENDUM:)32 | |
2962 | b(Ho)m(w)f(to)h(use)e(this)f(License)h(for)g(y)m(our)930 | |
2963 | 1221 y(do)s(cumen)m(ts)c Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
2964 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.) | |
2965 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 b Ft(137)150 1464 | |
2966 | y Fr(Index)45 b(of)g(Shell)g(Builtin)h(Commands)27 b | |
2967 | Fn(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)71 | |
2968 | b Fr(139)150 1733 y(Index)45 b(of)g(Shell)g(Reserv)l(ed)h(W)-11 | |
2969 | b(ords)41 b Fn(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h | |
2970 | (.)85 b Fr(141)150 2003 y(P)l(arameter)47 b(and)d(V)-11 | |
2971 | b(ariable)46 b(Index)27 b Fn(.)19 b(.)g(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h | |
2972 | (.)f(.)h(.)f(.)g(.)71 b Fr(143)150 2273 y(F)-11 b(unction)44 | |
2973 | b(Index)36 b Fn(.)19 b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h | |
2974 | (.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)80 | |
2975 | b Fr(145)150 2543 y(Concept)45 b(Index)18 b Fn(.)i(.)f(.)h(.)f(.)g(.)h | |
2976 | (.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.) | |
2977 | h(.)f(.)g(.)h(.)f(.)h(.)62 b Fr(147)p eop | |
2978 | %%Page: 1 7 | |
2979 | 1 6 bop 150 -116 a Ft(Chapter)30 b(1:)41 b(In)m(tro)s(duction)2591 | |
2980 | b(1)150 299 y Fo(1)80 b(In)l(tro)t(duction)150 675 y | |
2981 | Fr(1.1)68 b(What)45 b(is)g(Bash?)275 923 y Ft(Bash)29 | |
2982 | b(is)g(the)g(shell,)g(or)g(command)g(language)h(in)m(terpreter,)g(for)f | |
2983 | (the)h Fl(gnu)f Ft(op)s(erating)g(system.)40 b(The)150 | |
2984 | 1033 y(name)33 b(is)f(an)h(acron)m(ym)g(for)g(the)g(`)p | |
2985 | Fs(Bourne-Again)27 b(SHell)p Ft(',)32 b(a)i(pun)d(on)i(Stephen)f | |
2986 | (Bourne,)h(the)g(author)150 1142 y(of)f(the)f(direct)g(ancestor)i(of)e | |
2987 | (the)h(curren)m(t)f(Unix)f(shell)g Fs(sh)p Ft(,)h(whic)m(h)f(app)s | |
2988 | (eared)h(in)f(the)i(Sev)m(en)m(th)g(Edition)150 1252 | |
2989 | y(Bell)e(Labs)g(Researc)m(h)h(v)m(ersion)f(of)g(Unix.)275 | |
2990 | 1391 y(Bash)f(is)f(largely)h(compatible)f(with)g Fs(sh)h | |
2991 | Ft(and)g(incorp)s(orates)f(useful)g(features)h(from)g(the)g(Korn)g | |
2992 | (shell)150 1500 y Fs(ksh)37 b Ft(and)h(the)g(C)g(shell)e | |
2993 | Fs(csh)p Ft(.)64 b(It)38 b(is)f(in)m(tended)g(to)i(b)s(e)f(a)g | |
2994 | (conforman)m(t)h(implemen)m(tation)e(of)h(the)g Fl(ieee)150 | |
2995 | 1610 y(posix)44 b Ft(Shell)f(and)i(T)-8 b(o)s(ols)45 | |
2996 | b(sp)s(eci\014cation)e(\()p Fl(ieee)i Ft(W)-8 b(orking)46 | |
2997 | b(Group)e(1003.2\).)88 b(It)45 b(o\013ers)h(functional)150 | |
2998 | 1719 y(impro)m(v)m(emen)m(ts)31 b(o)m(v)m(er)g Fs(sh)f | |
2999 | Ft(for)g(b)s(oth)g(in)m(teractiv)m(e)h(and)f(programming)f(use.)275 | |
3000 | 1858 y(While)g(the)i Fl(gnu)f Ft(op)s(erating)g(system)h(pro)m(vides)e | |
3001 | (other)i(shells,)e(including)e(a)k(v)m(ersion)f(of)h | |
3002 | Fs(csh)p Ft(,)f(Bash)150 1968 y(is)i(the)i(default)e(shell.)47 | |
3003 | b(Lik)m(e)33 b(other)h Fl(gnu)f Ft(soft)m(w)m(are,)i(Bash)f(is)e(quite) | |
3004 | h(p)s(ortable.)48 b(It)33 b(curren)m(tly)f(runs)g(on)150 | |
3005 | 2077 y(nearly)27 b(ev)m(ery)h(v)m(ersion)f(of)g(Unix)g(and)f(a)i(few)f | |
3006 | (other)h(op)s(erating)f(systems)g Fp(\000)g Ft(indep)s(enden)m | |
3007 | (tly-supp)s(orted)150 2187 y(p)s(orts)j(exist)g(for)g | |
3008 | Fl(ms-dos)p Ft(,)f Fl(os/2)p Ft(,)i(and)f(Windo)m(ws)f(platforms.)150 | |
3009 | 2455 y Fr(1.2)68 b(What)45 b(is)g(a)h(shell?)275 2703 | |
3010 | y Ft(A)m(t)41 b(its)e(base,)k(a)e(shell)d(is)h(simply)f(a)j(macro)f | |
3011 | (pro)s(cessor)g(that)h(executes)g(commands.)70 b(The)40 | |
3012 | b(term)150 2813 y(macro)29 b(pro)s(cessor)f(means)g(functionalit)m(y)f | |
3013 | (where)h(text)i(and)e(sym)m(b)s(ols)f(are)h(expanded)g(to)h(create)h | |
3014 | (larger)150 2922 y(expressions.)275 3061 y(A)k(Unix)g(shell)f(is)g(b)s | |
3015 | (oth)h(a)h(command)g(in)m(terpreter)f(and)g(a)h(programming)e | |
3016 | (language.)54 b(As)35 b(a)g(com-)150 3170 y(mand)30 b(in)m(terpreter,)h | |
3017 | (the)h(shell)d(pro)m(vides)h(the)i(user)e(in)m(terface)i(to)g(the)f | |
3018 | (ric)m(h)g(set)h(of)f Fl(gnu)g Ft(utilities.)40 b(The)150 | |
3019 | 3280 y(programming)25 b(language)i(features)g(allo)m(w)f(these)h | |
3020 | (utilitites)d(to)j(b)s(e)f(com)m(bined.)39 b(Files)25 | |
3021 | b(con)m(taining)h(com-)150 3390 y(mands)j(can)i(b)s(e)e(created,)j(and) | |
3022 | d(b)s(ecome)i(commands)f(themselv)m(es.)41 b(These)30 | |
3023 | b(new)f(commands)h(ha)m(v)m(e)i(the)150 3499 y(same)f(status)h(as)f | |
3024 | (system)g(commands)g(in)f(directories)g(suc)m(h)h(as)g(`)p | |
3025 | Fs(/bin)p Ft(',)g(allo)m(wing)f(users)g(or)h(groups)f(to)150 | |
3026 | 3609 y(establish)f(custom)h(en)m(vironmen)m(ts)g(to)h(automate)h(their) | |
3027 | e(common)g(tasks.)275 3748 y(Shells)h(ma)m(y)j(b)s(e)f(used)g(in)m | |
3028 | (teractiv)m(ely)h(or)g(non-in)m(teractiv)m(ely)-8 b(.)51 | |
3029 | b(In)33 b(in)m(teractiv)m(e)h(mo)s(de,)h(they)e(accept)150 | |
3030 | 3857 y(input)20 b(t)m(yp)s(ed)i(from)g(the)h(k)m(eyb)s(oard.)37 | |
3031 | b(When)22 b(executing)h(non-in)m(teractiv)m(ely)-8 b(,)24 | |
3032 | b(shells)d(execute)i(commands)150 3967 y(read)30 b(from)g(a)h(\014le.) | |
3033 | 275 4105 y(A)41 b(shell)e(allo)m(ws)h(execution)i(of)f | |
3034 | Fl(gnu)g Ft(commands,)i(b)s(oth)e(sync)m(hronously)e(and)i(async)m | |
3035 | (hronously)-8 b(.)150 4215 y(The)29 b(shell)e(w)m(aits)j(for)f(sync)m | |
3036 | (hronous)f(commands)h(to)h(complete)g(b)s(efore)f(accepting)g(more)h | |
3037 | (input;)e(asyn-)150 4325 y(c)m(hronous)22 b(commands)h(con)m(tin)m(ue)g | |
3038 | (to)g(execute)h(in)d(parallel)g(with)h(the)g(shell)f(while)g(it)h | |
3039 | (reads)h(and)f(executes)150 4434 y(additional)32 b(commands.)50 | |
3040 | b(The)33 b Fq(redirection)f Ft(constructs)i(p)s(ermit)e(\014ne-grained) | |
3041 | g(con)m(trol)i(of)g(the)g(input)150 4544 y(and)40 b(output)f(of)i | |
3042 | (those)f(commands.)70 b(Moreo)m(v)m(er,)45 b(the)c(shell)d(allo)m(ws)h | |
3043 | (con)m(trol)i(o)m(v)m(er)h(the)e(con)m(ten)m(ts)i(of)150 | |
3044 | 4653 y(commands')30 b(en)m(vironmen)m(ts.)275 4792 y(Shells)i(also)j | |
3045 | (pro)m(vide)g(a)g(small)f(set)h(of)g(built-in)d(commands)j(\()p | |
3046 | Fq(builtins)t Ft(\))d(implemen)m(ting)h(function-)150 | |
3047 | 4902 y(alit)m(y)j(imp)s(ossible)d(or)j(incon)m(v)m(enien)m(t)h(to)g | |
3048 | (obtain)f(via)g(separate)h(utilities.)57 b(F)-8 b(or)37 | |
3049 | b(example,)h Fs(cd)p Ft(,)f Fs(break)p Ft(,)150 5011 | |
3050 | y Fs(continue)p Ft(,)43 b(and)f Fs(exec)p Ft(\))g(cannot)h(b)s(e)e | |
3051 | (implemen)m(ted)g(outside)h(of)g(the)h(shell)d(b)s(ecause)j(they)f | |
3052 | (directly)150 5121 y(manipulate)35 b(the)i(shell)d(itself.)59 | |
3053 | b(The)36 b Fs(history)p Ft(,)g Fs(getopts)p Ft(,)g Fs(kill)p | |
3054 | Ft(,)h(or)g Fs(pwd)f Ft(builtins,)e(among)k(others,)150 | |
3055 | 5230 y(could)32 b(b)s(e)g(implemen)m(ted)f(in)h(separate)h(utilities,)e | |
3056 | (but)h(they)h(are)h(more)f(con)m(v)m(enien)m(t)g(to)h(use)e(as)h | |
3057 | (builtin)150 5340 y(commands.)40 b(All)29 b(of)i(the)f(shell)f | |
3058 | (builtins)e(are)k(describ)s(ed)d(in)h(subsequen)m(t)h(sections.)p | |
3059 | eop | |
3060 | %%Page: 2 8 | |
3061 | 2 7 bop 150 -116 a Ft(2)2617 b(Bash)31 b(Reference)g(Man)m(ual)275 | |
3062 | 299 y(While)37 b(executing)i(commands)f(is)f(essen)m(tial,)k(most)e(of) | |
3063 | g(the)g(p)s(o)m(w)m(er)f(\(and)g(complexit)m(y\))h(of)g(shells)150 | |
3064 | 408 y(is)33 b(due)g(to)i(their)e(em)m(b)s(edded)g(programming)g | |
3065 | (languages.)51 b(Lik)m(e)34 b(an)m(y)g(high-lev)m(el)f(language,)j(the) | |
3066 | e(shell)150 518 y(pro)m(vides)29 b(v)-5 b(ariables,)30 | |
3067 | b(\015o)m(w)g(con)m(trol)h(constructs,)g(quoting,)f(and)g(functions.) | |
3068 | 275 653 y(Shells)19 b(o\013er)k(features)f(geared)h(sp)s(eci\014cally)d | |
3069 | (for)i(in)m(teractiv)m(e)h(use)f(rather)g(than)g(to)h(augmen)m(t)g(the) | |
3070 | f(pro-)150 762 y(gramming)31 b(language.)47 b(These)32 | |
3071 | b(in)m(teractiv)m(e)h(features)f(include)e(job)i(con)m(trol,)i(command) | |
3072 | d(line)g(editing,)150 872 y(command)f(history)f(and)h(aliases.)40 | |
3073 | b(Eac)m(h)31 b(of)g(these)g(features)f(is)g(describ)s(ed)e(in)h(this)g | |
3074 | (man)m(ual.)p eop | |
3075 | %%Page: 3 9 | |
3076 | 3 8 bop 150 -116 a Ft(Chapter)30 b(2:)41 b(De\014nitions)2660 | |
3077 | b(3)150 299 y Fo(2)80 b(De\014nitions)275 527 y Ft(These)30 | |
3078 | b(de\014nitions)e(are)i(used)g(throughout)g(the)g(remainder)f(of)i | |
3079 | (this)e(man)m(ual.)150 684 y Fs(POSIX)240 b Ft(A)41 b(family)e(of)i(op) | |
3080 | s(en)g(system)g(standards)f(based)g(on)h(Unix.)71 b(Bash)41 | |
3081 | b(is)f(concerned)h(with)630 794 y Fl(posix)30 b Ft(1003.2,)j(the)d | |
3082 | (Shell)f(and)g(T)-8 b(o)s(ols)30 b(Standard.)150 950 | |
3083 | y Fs(blank)240 b Ft(A)30 b(space)h(or)g(tab)f(c)m(haracter.)150 | |
3084 | 1107 y Fs(builtin)144 b Ft(A)35 b(command)g(that)g(is)f(implemen)m(ted) | |
3085 | f(in)m(ternally)g(b)m(y)i(the)g(shell)e(itself,)i(rather)f(than)h(b)m | |
3086 | (y)630 1217 y(an)30 b(executable)h(program)f(somewhere)h(in)e(the)h | |
3087 | (\014le)g(system.)150 1374 y Fs(control)e(operator)630 | |
3088 | 1484 y Ft(A)c Fs(word)e Ft(that)i(p)s(erforms)f(a)h(con)m(trol)g | |
3089 | (function.)37 b(It)24 b(is)e(a)i Fs(newline)e Ft(or)i(one)g(of)f(the)h | |
3090 | (follo)m(wing:)630 1593 y(`)p Fs(||)p Ft(',)31 b(`)p | |
3091 | Fs(&&)p Ft(',)f(`)p Fs(&)p Ft(',)h(`)p Fs(;)p Ft(',)g(`)p | |
3092 | Fs(;;)p Ft(',)f(`)p Fs(|)p Ft(',)h(`)p Fs(\()p Ft(',)g(or)f(`)p | |
3093 | Fs(\))p Ft('.)150 1750 y Fs(exit)f(status)630 1860 y | |
3094 | Ft(The)f(v)-5 b(alue)28 b(returned)f(b)m(y)h(a)h(command)f(to)h(its)f | |
3095 | (caller.)39 b(The)28 b(v)-5 b(alue)28 b(is)f(restricted)h(to)i(eigh)m | |
3096 | (t)630 1969 y(bits,)g(so)g(the)h(maxim)m(um)e(v)-5 b(alue)30 | |
3097 | b(is)f(255.)150 2126 y Fs(field)240 b Ft(A)27 b(unit)f(of)h(text)h | |
3098 | (that)g(is)e(the)h(result)f(of)h(one)h(of)f(the)g(shell)e(expansions.) | |
3099 | 39 b(After)27 b(expansion,)630 2236 y(when)e(executing)g(a)h(command,)h | |
3100 | (the)f(resulting)d(\014elds)h(are)i(used)f(as)h(the)g(command)f(name) | |
3101 | 630 2346 y(and)30 b(argumen)m(ts.)150 2503 y Fs(filename)96 | |
3102 | b Ft(A)30 b(string)g(of)g(c)m(haracters)i(used)e(to)h(iden)m(tify)e(a)h | |
3103 | (\014le.)150 2659 y Fs(job)336 b Ft(A)31 b(set)h(of)f(pro)s(cesses)g | |
3104 | (comprising)e(a)i(pip)s(eline,)d(and)j(an)m(y)g(pro)s(cesses)g | |
3105 | (descended)g(from)f(it,)630 2769 y(that)h(are)g(all)e(in)g(the)i(same)f | |
3106 | (pro)s(cess)g(group.)150 2926 y Fs(job)f(control)630 | |
3107 | 3036 y Ft(A)22 b(mec)m(hanism)f(b)m(y)g(whic)m(h)g(users)g(can)h | |
3108 | (selectiv)m(ely)f(stop)h(\(susp)s(end\))e(and)h(restart)i(\(resume\)) | |
3109 | 630 3145 y(execution)31 b(of)f(pro)s(cesses.)150 3302 | |
3110 | y Fs(metacharacter)630 3412 y Ft(A)25 b(c)m(haracter)i(that,)g(when)d | |
3111 | (unquoted,)i(separates)g(w)m(ords.)38 b(A)26 b(metac)m(haracter)i(is)c | |
3112 | (a)h Fs(blank)630 3521 y Ft(or)30 b(one)h(of)g(the)f(follo)m(wing)f(c)m | |
3113 | (haracters:)42 b(`)p Fs(|)p Ft(',)31 b(`)p Fs(&)p Ft(',)g(`)p | |
3114 | Fs(;)p Ft(',)g(`)p Fs(\()p Ft(',)f(`)p Fs(\))p Ft(',)h(`)p | |
3115 | Fs(<)p Ft(',)g(or)f(`)p Fs(>)p Ft('.)150 3678 y Fs(name)288 | |
3116 | b Ft(A)37 b Fs(word)f Ft(consisting)g(solely)h(of)g(letters,)i(n)m(um)m | |
3117 | (b)s(ers,)f(and)f(underscores,)h(and)f(b)s(eginning)630 | |
3118 | 3788 y(with)22 b(a)h(letter)g(or)g(underscore.)38 b Fs(Name)p | |
3119 | Ft(s)22 b(are)h(used)f(as)i(shell)d(v)-5 b(ariable)22 | |
3120 | b(and)g(function)g(names.)630 3898 y(Also)30 b(referred)g(to)h(as)f(an) | |
3121 | h Fs(identifier)p Ft(.)150 4055 y Fs(operator)96 b Ft(A)38 | |
3122 | b Fs(control)28 b(operator)36 b Ft(or)h(a)i Fs(redirection)27 | |
3123 | b(operator)p Ft(.)61 b(See)38 b(Section)f(3.6)i([Redirec-)630 | |
3124 | 4164 y(tions],)30 b(page)h(24,)h(for)e(a)h(list)e(of)h(redirection)f | |
3125 | (op)s(erators.)150 4321 y Fs(process)f(group)630 4431 | |
3126 | y Ft(A)i(collection)h(of)f(related)g(pro)s(cesses)h(eac)m(h)g(ha)m | |
3127 | (ving)f(the)h(same)f(pro)s(cess)g(group)g Fl(id)p Ft(.)150 | |
3128 | 4588 y Fs(process)e(group)h(ID)630 4697 y Ft(A)h(unique)f(iden)m(tifer) | |
3129 | g(that)i(represen)m(ts)f(a)h Fs(process)d(group)h Ft(during)f(its)i | |
3130 | (lifetime.)150 4854 y Fs(reserved)e(word)630 4964 y Ft(A)h | |
3131 | Fs(word)e Ft(that)i(has)f(a)h(sp)s(ecial)e(meaning)g(to)i(the)g(shell.) | |
3132 | 38 b(Most)30 b(reserv)m(ed)e(w)m(ords)g(in)m(tro)s(duce)630 | |
3133 | 5073 y(shell)h(\015o)m(w)h(con)m(trol)h(constructs,)g(suc)m(h)f(as)g | |
3134 | Fs(for)g Ft(and)g Fs(while)p Ft(.)150 5230 y Fs(return)f(status)630 | |
3135 | 5340 y Ft(A)h(synon)m(ym)g(for)g Fs(exit)g(status)p Ft(.)p | |
3136 | eop | |
3137 | %%Page: 4 10 | |
3138 | 4 9 bop 150 -116 a Ft(4)2617 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
3139 | 299 y Fs(signal)192 b Ft(A)40 b(mec)m(hanism)g(b)m(y)f(whic)m(h)g(a)i | |
3140 | (pro)s(cess)e(ma)m(y)i(b)s(e)e(noti\014ed)g(b)m(y)h(the)h(k)m(ernel)e | |
3141 | (of)h(an)g(ev)m(en)m(t)630 408 y(o)s(ccurring)29 b(in)g(the)i(system.) | |
3142 | 150 568 y Fs(special)d(builtin)630 677 y Ft(A)e(shell)f(builtin)e | |
3143 | (command)j(that)h(has)f(b)s(een)f(classi\014ed)g(as)h(sp)s(ecial)f(b)m | |
3144 | (y)h(the)h Fl(posix)e Ft(1003.2)630 787 y(standard.)150 | |
3145 | 946 y Fs(token)240 b Ft(A)38 b(sequence)h(of)f(c)m(haracters)h | |
3146 | (considered)e(a)i(single)e(unit)f(b)m(y)i(the)h(shell.)62 | |
3147 | b(It)38 b(is)f(either)h(a)630 1056 y Fs(word)29 b Ft(or)i(an)f | |
3148 | Fs(operator)p Ft(.)150 1215 y Fs(word)288 b Ft(A)30 b | |
3149 | Fs(token)f Ft(that)i(is)f(not)g(an)h Fs(operator)p Ft(.)p | |
3150 | eop | |
3151 | %%Page: 5 11 | |
3152 | 5 10 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
3153 | b(Shell)d(F)-8 b(eatures)2292 b(5)150 299 y Fo(3)80 b(Basic)55 | |
3154 | b(Shell)f(F)-13 b(eatures)275 544 y Ft(Bash)27 b(is)f(an)h(acron)m(ym)h | |
3155 | (for)f(`)p Fs(Bourne-Again)g(SHell)p Ft('.)39 b(The)26 | |
3156 | b(Bourne)h(shell)f(is)g(the)h(traditional)f(Unix)150 | |
3157 | 653 y(shell)32 b(originally)f(written)h(b)m(y)h(Stephen)g(Bourne.)50 | |
3158 | b(All)32 b(of)i(the)f(Bourne)h(shell)d(builtin)f(commands)k(are)150 | |
3159 | 763 y(a)m(v)-5 b(ailable)29 b(in)e(Bash,)j(The)f(rules)f(for)h(ev)-5 | |
3160 | b(aluation)29 b(and)f(quoting)h(are)g(tak)m(en)i(from)d(the)i | |
3161 | Fl(posix)e Ft(sp)s(eci\014ca-)150 872 y(tion)i(for)g(the)h(`standard')f | |
3162 | (Unix)f(shell.)275 1010 y(This)h(c)m(hapter)j(brie\015y)d(summarizes)h | |
3163 | (the)i(shell's)d(`building)f(blo)s(c)m(ks':)44 b(commands,)32 | |
3164 | b(con)m(trol)h(struc-)150 1120 y(tures,)38 b(shell)c(functions,)i | |
3165 | (shell)f Fm(p)-5 b(ar)g(ameters)p Ft(,)41 b(shell)34 | |
3166 | b(expansions,)j Fm(r)-5 b(e)g(dir)g(e)g(ctions)p Ft(,)40 | |
3167 | b(whic)m(h)35 b(are)i(a)f(w)m(a)m(y)h(to)150 1230 y(direct)30 | |
3168 | b(input)e(and)i(output)g(from)g(and)g(to)h(named)f(\014les,)f(and)h(ho) | |
3169 | m(w)g(the)h(shell)e(executes)i(commands.)150 1496 y Fr(3.1)68 | |
3170 | b(Shell)45 b(Syn)l(tax)275 1744 y Ft(When)32 b(the)h(shell)e(reads)i | |
3171 | (input,)f(it)g(pro)s(ceeds)g(through)h(a)g(sequence)g(of)g(op)s | |
3172 | (erations.)47 b(If)33 b(the)g(input)150 1853 y(indicates)c(the)h(b)s | |
3173 | (eginning)d(of)j(a)g(commen)m(t,)h(the)f(shell)e(ignores)h(the)h | |
3174 | (commen)m(t)h(sym)m(b)s(ol)e(\(`)p Fs(#)p Ft('\),)i(and)e(the)150 | |
3175 | 1963 y(rest)i(of)f(that)h(line.)275 2101 y(Otherwise,)g(roughly)f(sp)s | |
3176 | (eaking,)i(the)g(shell)e(reads)i(its)f(input)f(and)i(divides)d(the)k | |
3177 | (input)d(in)m(to)h(w)m(ords)150 2210 y(and)23 b(op)s(erators,)j(emplo)m | |
3178 | (ying)c(the)i(quoting)g(rules)e(to)i(select)h(whic)m(h)d(meanings)h(to) | |
3179 | i(assign)e(v)-5 b(arious)22 b(w)m(ords)150 2320 y(and)30 | |
3180 | b(c)m(haracters.)275 2458 y(The)38 b(shell)f(then)h(parses)g(these)h | |
3181 | (tok)m(ens)h(in)m(to)e(commands)h(and)f(other)h(constructs,)i(remo)m(v) | |
3182 | m(es)f(the)150 2568 y(sp)s(ecial)29 b(meaning)g(of)h(certain)g(w)m | |
3183 | (ords)g(or)g(c)m(haracters,)i(expands)d(others,)h(redirects)g(input)e | |
3184 | (and)h(output)150 2677 y(as)d(needed,)g(executes)g(the)g(sp)s | |
3185 | (eci\014ed)d(command,)k(w)m(aits)e(for)g(the)g(command's)g(exit)h | |
3186 | (status,)g(and)f(mak)m(es)150 2787 y(that)31 b(exit)f(status)h(a)m(v)-5 | |
3187 | b(ailable)30 b(for)g(further)f(insp)s(ection)f(or)j(pro)s(cessing.)150 | |
3188 | 3018 y Fk(3.1.1)63 b(Shell)41 b(Op)s(eration)275 3266 | |
3189 | y Ft(The)28 b(follo)m(wing)f(is)h(a)h(brief)e(description)g(of)i(the)g | |
3190 | (shell's)e(op)s(eration)i(when)e(it)i(reads)f(and)g(executes)j(a)150 | |
3191 | 3375 y(command.)40 b(Basically)-8 b(,)31 b(the)f(shell)f(do)s(es)h(the) | |
3192 | h(follo)m(wing:)199 3513 y(1.)61 b(Reads)42 b(its)g(input)e(from)i(a)g | |
3193 | (\014le)g(\(see)h(Section)f(3.8)h([Shell)d(Scripts],)k(page)f(31\),)k | |
3194 | (from)41 b(a)i(string)330 3623 y(supplied)24 b(as)k(an)f(argumen)m(t)g | |
3195 | (to)h(the)g(`)p Fs(-c)p Ft(')f(in)m(v)m(o)s(cation)g(option)g(\(see)h | |
3196 | (Section)g(6.1)g([In)m(v)m(oking)f(Bash],)330 3732 y(page)k(63\),)h(or) | |
3197 | e(from)g(the)h(user's)f(terminal.)199 3869 y(2.)61 b(Breaks)43 | |
3198 | b(the)g(input)e(in)m(to)h(w)m(ords)g(and)g(op)s(erators,)k(ob)s(eying)c | |
3199 | (the)h(quoting)f(rules)f(describ)s(ed)f(in)330 3978 y(Section)26 | |
3200 | b(3.1.2)j([Quoting],)e(page)g(6.)40 b(These)26 b(tok)m(ens)i(are)f | |
3201 | (separated)g(b)m(y)f Fs(metacharacters)p Ft(.)36 b(Alias)330 | |
3202 | 4088 y(expansion)29 b(is)h(p)s(erformed)e(b)m(y)j(this)e(step)h(\(see)i | |
3203 | (Section)e(6.6)h([Aliases],)g(page)g(71\).)199 4224 y(3.)61 | |
3204 | b(P)m(arses)35 b(the)g(tok)m(ens)g(in)m(to)g(simple)d(and)i(comp)s | |
3205 | (ound)f(commands)h(\(see)h(Section)g(3.2)g([Shell)e(Com-)330 | |
3206 | 4334 y(mands],)d(page)h(8\).)199 4470 y(4.)61 b(P)m(erforms)40 | |
3207 | b(the)h(v)-5 b(arious)39 b(shell)g(expansions)g(\(see)i(Section)f(3.5)h | |
3208 | ([Shell)e(Expansions],)i(page)g(16\),)330 4580 y(breaking)34 | |
3209 | b(the)h(expanded)g(tok)m(ens)h(in)m(to)f(lists)e(of)i(\014lenames)g | |
3210 | (\(see)h(Section)e(3.5.8)j([Filename)e(Ex-)330 4689 y(pansion],)29 | |
3211 | b(page)i(22\))h(and)e(commands)g(and)g(argumen)m(ts.)199 | |
3212 | 4826 y(5.)61 b(P)m(erforms)36 b(an)m(y)i(necessary)f(redirections)e | |
3213 | (\(see)j(Section)e(3.6)i([Redirections],)g(page)g(24\))g(and)e(re-)330 | |
3214 | 4935 y(mo)m(v)m(es)c(the)e(redirection)f(op)s(erators)i(and)f(their)f | |
3215 | (op)s(erands)g(from)h(the)h(argumen)m(t)f(list.)199 5071 | |
3216 | y(6.)61 b(Executes)31 b(the)g(command)f(\(see)h(Section)f(3.7)i | |
3217 | ([Executing)e(Commands],)g(page)h(28\).)199 5208 y(7.)61 | |
3218 | b(Optionally)37 b(w)m(aits)i(for)g(the)g(command)g(to)h(complete)f(and) | |
3219 | g(collects)g(its)g(exit)g(status)g(\(see)h(Sec-)330 5317 | |
3220 | y(tion)30 b(3.7.5)i([Exit)e(Status],)h(page)g(30\).)p | |
3221 | eop | |
3222 | %%Page: 6 12 | |
3223 | 6 11 bop 150 -116 a Ft(6)2617 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
3224 | 299 y Fk(3.1.2)63 b(Quoting)275 543 y Ft(Quoting)23 b(is)g(used)g(to)h | |
3225 | (remo)m(v)m(e)i(the)e(sp)s(ecial)e(meaning)h(of)h(certain)g(c)m | |
3226 | (haracters)i(or)d(w)m(ords)h(to)g(the)g(shell.)150 653 | |
3227 | y(Quoting)j(can)g(b)s(e)g(used)f(to)j(disable)c(sp)s(ecial)h(treatmen)m | |
3228 | (t)j(for)e(sp)s(ecial)f(c)m(haracters,)k(to)e(prev)m(en)m(t)g(reserv)m | |
3229 | (ed)150 762 y(w)m(ords)i(from)g(b)s(eing)f(recognized)h(as)h(suc)m(h,)f | |
3230 | (and)g(to)h(prev)m(en)m(t)g(parameter)g(expansion.)275 | |
3231 | 897 y(Eac)m(h)22 b(of)g(the)g(shell)e(metac)m(haracters)k(\(see)f | |
3232 | (Chapter)e(2)i([De\014nitions],)f(page)h(3\))g(has)e(sp)s(ecial)g | |
3233 | (meaning)150 1006 y(to)40 b(the)g(shell)d(and)i(m)m(ust)g(b)s(e)g | |
3234 | (quoted)g(if)g(it)g(is)f(to)i(represen)m(t)g(itself.)66 | |
3235 | b(When)39 b(the)h(command)f(history)150 1116 y(expansion)e(facilities)g | |
3236 | (are)h(b)s(eing)f(used,)j(the)e Fq(history)g(expansion)f | |
3237 | Ft(c)m(haracter,)42 b(usually)36 b(`)p Fs(!)p Ft(',)k(m)m(ust)f(b)s(e) | |
3238 | 150 1225 y(quoted)27 b(to)g(prev)m(en)m(t)g(history)e(expansion.)38 | |
3239 | b(See)27 b(Section)f(9.1)i([Bash)e(History)g(F)-8 b(acilities],)27 | |
3240 | b(page)g(109,)i(for)150 1335 y(more)i(details)e(concerning)h(history)f | |
3241 | (expansion.)275 1469 y(There)37 b(are)h(three)f(quoting)g(mec)m | |
3242 | (hanisms:)55 b(the)38 b Fq(escap)s(e)g(c)m(haracter)p | |
3243 | Ft(,)j(single)36 b(quotes,)k(and)d(double)150 1579 y(quotes.)150 | |
3244 | 1803 y Fk(3.1.2.1)63 b(Escap)s(e)41 b(Character)275 2047 | |
3245 | y Ft(A)27 b(non-quoted)g(bac)m(kslash)g(`)p Fs(\\)p Ft(')g(is)f(the)i | |
3246 | (Bash)f(escap)s(e)g(c)m(haracter.)42 b(It)27 b(preserv)m(es)g(the)g | |
3247 | (literal)f(v)-5 b(alue)27 b(of)150 2157 y(the)g(next)g(c)m(haracter)h | |
3248 | (that)f(follo)m(ws,)g(with)e(the)i(exception)f(of)h Fs(newline)p | |
3249 | Ft(.)38 b(If)26 b(a)h Fs(\\newline)d Ft(pair)h(app)s(ears,)150 | |
3250 | 2267 y(and)30 b(the)h(bac)m(kslash)f(itself)f(is)h(not)h(quoted,)g(the) | |
3251 | f Fs(\\newline)f Ft(is)g(treated)j(as)f(a)g(line)e(con)m(tin)m(uation)h | |
3252 | (\(that)150 2376 y(is,)g(it)g(is)f(remo)m(v)m(ed)i(from)f(the)h(input)d | |
3253 | (stream)j(and)f(e\013ectiv)m(ely)h(ignored\).)150 2600 | |
3254 | y Fk(3.1.2.2)63 b(Single)42 b(Quotes)275 2844 y Ft(Enclosing)34 | |
3255 | b(c)m(haracters)k(in)c(single)h(quotes)i(\(`)p Fs(')p | |
3256 | Ft('\))f(preserv)m(es)h(the)f(literal)e(v)-5 b(alue)36 | |
3257 | b(of)g(eac)m(h)h(c)m(haracter)150 2954 y(within)22 b(the)j(quotes.)39 | |
3258 | b(A)25 b(single)f(quote)h(ma)m(y)g(not)g(o)s(ccur)g(b)s(et)m(w)m(een)g | |
3259 | (single)f(quotes,)i(ev)m(en)g(when)d(preceded)150 3064 | |
3260 | y(b)m(y)30 b(a)h(bac)m(kslash.)150 3288 y Fk(3.1.2.3)63 | |
3261 | b(Double)42 b(Quotes)275 3532 y Ft(Enclosing)34 b(c)m(haracters)k(in)d | |
3262 | (double)g(quotes)i(\(`)p Fs(")p Ft('\))g(preserv)m(es)f(the)g(literal)f | |
3263 | (v)-5 b(alue)36 b(of)g(all)f(c)m(haracters)150 3641 y(within)30 | |
3264 | b(the)j(quotes,)h(with)d(the)i(exception)g(of)f(`)p Fs($)p | |
3265 | Ft(',)i(`)p Fs(`)p Ft(',)f(and)f(`)p Fs(\\)p Ft('.)48 | |
3266 | b(The)32 b(c)m(haracters)i(`)p Fs($)p Ft(')f(and)f(`)p | |
3267 | Fs(`)p Ft(')g(retain)150 3751 y(their)j(sp)s(ecial)g(meaning)h(within)e | |
3268 | (double)h(quotes)i(\(see)g(Section)f(3.5)h([Shell)e(Expansions],)h | |
3269 | (page)h(16\).)150 3861 y(The)30 b(bac)m(kslash)g(retains)f(its)h(sp)s | |
3270 | (ecial)f(meaning)g(only)h(when)f(follo)m(w)m(ed)h(b)m(y)g(one)h(of)f | |
3271 | (the)h(follo)m(wing)d(c)m(har-)150 3970 y(acters:)54 | |
3272 | b(`)p Fs($)p Ft(',)39 b(`)p Fs(`)p Ft(',)g(`)p Fs(")p | |
3273 | Ft(',)g(`)p Fs(\\)p Ft(',)f(or)f Fs(newline)p Ft(.)58 | |
3274 | b(Within)35 b(double)g(quotes,)k(bac)m(kslashes)e(that)g(are)g(follo)m | |
3275 | (w)m(ed)150 4080 y(b)m(y)28 b(one)g(of)g(these)g(c)m(haracters)i(are)e | |
3276 | (remo)m(v)m(ed.)41 b(Bac)m(kslashes)29 b(preceding)e(c)m(haracters)i | |
3277 | (without)e(a)h(sp)s(ecial)150 4189 y(meaning)i(are)i(left)e(unmo)s | |
3278 | (di\014ed.)40 b(A)31 b(double)f(quote)h(ma)m(y)h(b)s(e)e(quoted)i | |
3279 | (within)c(double)i(quotes)h(b)m(y)g(pre-)150 4299 y(ceding)k(it)g(with) | |
3280 | f(a)i(bac)m(kslash.)55 b(When)36 b(command)f(history)f(is)h(b)s(eing)f | |
3281 | (used,)i(the)f(double)f(quote)i(ma)m(y)150 4408 y(not)31 | |
3282 | b(b)s(e)e(used)h(to)h(quote)g(the)g(history)e(expansion)g(c)m | |
3283 | (haracter.)275 4543 y(The)41 b(sp)s(ecial)f(parameters)h(`)p | |
3284 | Fs(*)p Ft(')h(and)f(`)p Fs(@)p Ft(')h(ha)m(v)m(e)g(sp)s(ecial)e | |
3285 | (meaning)h(when)g(in)f(double)g(quotes)i(\(see)150 4653 | |
3286 | y(Section)30 b(3.5.3)i([Shell)d(P)m(arameter)j(Expansion],)d(page)i | |
3287 | (18\).)150 4877 y Fk(3.1.2.4)63 b(ANSI-C)40 b(Quoting)275 | |
3288 | 5121 y Ft(W)-8 b(ords)33 b(of)h(the)g(form)f Fs($')p | |
3289 | Fj(string)11 b Fs(')31 b Ft(are)j(treated)g(sp)s(ecially)-8 | |
3290 | b(.)49 b(The)33 b(w)m(ord)g(expands)g(to)i Fq(string)p | |
3291 | Ft(,)e(with)150 5230 y(bac)m(kslash-escap)s(ed)43 b(c)m(haracters)i | |
3292 | (replaced)e(as)h(sp)s(eci\014ed)e(b)m(y)h(the)g(ANSI)g(C)g(standard.)79 | |
3293 | b(Bac)m(kslash)150 5340 y(escap)s(e)31 b(sequences,)g(if)e(presen)m(t,) | |
3294 | i(are)g(deco)s(ded)f(as)g(follo)m(ws:)p eop | |
3295 | %%Page: 7 13 | |
3296 | 7 12 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
3297 | b(Shell)d(F)-8 b(eatures)2292 b(7)150 299 y Fs(\\a)384 | |
3298 | b Ft(alert)30 b(\(b)s(ell\))150 487 y Fs(\\b)384 b Ft(bac)m(kspace)150 | |
3299 | 675 y Fs(\\e)g Ft(an)30 b(escap)s(e)h(c)m(haracter)h(\(not)f(ANSI)f | |
3300 | (C\))150 862 y Fs(\\f)384 b Ft(form)30 b(feed)150 1050 | |
3301 | y Fs(\\n)384 b Ft(newline)150 1238 y Fs(\\r)g Ft(carriage)31 | |
3302 | b(return)150 1426 y Fs(\\t)384 b Ft(horizon)m(tal)30 | |
3303 | b(tab)150 1614 y Fs(\\v)384 b Ft(v)m(ertical)30 b(tab)150 | |
3304 | 1802 y Fs(\\\\)384 b Ft(bac)m(kslash)150 1989 y Fs(\\')g | |
3305 | Ft(single)29 b(quote)150 2177 y Fs(\\)p Fj(nnn)288 b | |
3306 | Ft(the)31 b(eigh)m(t-bit)f(c)m(haracter)i(whose)e(v)-5 | |
3307 | b(alue)30 b(is)f(the)i(o)s(ctal)f(v)-5 b(alue)30 b Fq(nnn)f | |
3308 | Ft(\(one)i(to)g(three)g(digits\))150 2365 y Fs(\\x)p | |
3309 | Fj(HH)288 b Ft(the)36 b(eigh)m(t-bit)g(c)m(haracter)h(whose)f(v)-5 | |
3310 | b(alue)35 b(is)g(the)h(hexadecimal)f(v)-5 b(alue)35 b | |
3311 | Fq(HH)46 b Ft(\(one)37 b(or)f(t)m(w)m(o)630 2475 y(hex)30 | |
3312 | b(digits\))150 2662 y Fs(\\c)p Fj(x)336 b Ft(a)31 b(con)m(trol-)p | |
3313 | Fq(x)37 b Ft(c)m(haracter)150 2865 y(The)30 b(expanded)f(result)h(is)f | |
3314 | (single-quoted,)h(as)h(if)e(the)h(dollar)f(sign)h(had)f(not)i(b)s(een)f | |
3315 | (presen)m(t.)150 3146 y Fk(3.1.2.5)63 b(Lo)s(cale-Sp)s(eci\014c)41 | |
3316 | b(T)-10 b(ranslation)275 3418 y Ft(A)30 b(double-quoted)g(string)f | |
3317 | (preceded)h(b)m(y)h(a)g(dollar)e(sign)g(\(`)p Fs($)p | |
3318 | Ft('\))j(will)27 b(cause)32 b(the)e(string)g(to)h(b)s(e)f(trans-)150 | |
3319 | 3528 y(lated)i(according)g(to)h(the)f(curren)m(t)g(lo)s(cale.)45 | |
3320 | b(If)32 b(the)g(curren)m(t)g(lo)s(cale)g(is)f Fs(C)h | |
3321 | Ft(or)g Fs(POSIX)p Ft(,)f(the)h(dollar)f(sign)g(is)150 | |
3322 | 3637 y(ignored.)40 b(If)30 b(the)g(string)g(is)f(translated)h(and)g | |
3323 | (replaced,)g(the)h(replacemen)m(t)f(is)g(double-quoted.)275 | |
3324 | 3800 y(Some)20 b(systems)h(use)f(the)h(message)h(catalog)g(selected)f | |
3325 | (b)m(y)g(the)g Fs(LC_MESSAGES)c Ft(shell)i(v)-5 b(ariable.)37 | |
3326 | b(Others)150 3910 y(create)i(the)e(name)g(of)g(the)g(message)h(catalog) | |
3327 | h(from)e(the)g(v)-5 b(alue)36 b(of)h(the)h Fs(TEXTDOMAIN)c | |
3328 | Ft(shell)h(v)-5 b(ariable,)150 4019 y(p)s(ossibly)29 | |
3329 | b(adding)h(a)h(su\016x)g(of)h(`)p Fs(.mo)p Ft('.)43 b(If)31 | |
3330 | b(y)m(ou)h(use)f(the)h Fs(TEXTDOMAIN)c Ft(v)-5 b(ariable,)31 | |
3331 | b(y)m(ou)h(ma)m(y)g(need)f(to)h(set)150 4129 y(the)22 | |
3332 | b Fs(TEXTDOMAINDIR)d Ft(v)-5 b(ariable)21 b(to)i(the)f(lo)s(cation)g | |
3333 | (of)g(the)h(message)g(catalog)h(\014les.)37 b(Still)20 | |
3334 | b(others)i(use)g(b)s(oth)150 4238 y(v)-5 b(ariables)29 | |
3335 | b(in)g(this)g(fashion:)40 b Fs(TEXTDOMAINDIR)p Ft(/)p | |
3336 | Fs(LC_MESSAGES)p Ft(/LC)p 2528 4238 28 4 v 34 w(MESSA)m(GES/)p | |
3337 | Fs(TEXTDOMAIN)p Ft(.mo.)150 4520 y Fk(3.1.3)63 b(Commen)m(ts)275 | |
3338 | 4792 y Ft(In)34 b(a)j(non-in)m(teractiv)m(e)f(shell,)f(or)h(an)f(in)m | |
3339 | (teractiv)m(e)i(shell)d(in)g(whic)m(h)h(the)g Fs(interactive_comments) | |
3340 | 150 4902 y Ft(option)i(to)h(the)f Fs(shopt)f Ft(builtin)e(is)i(enabled) | |
3341 | g(\(see)i(Section)g(4.2)g([Bash)f(Builtins],)g(page)h(39\),)j(a)c(w)m | |
3342 | (ord)150 5011 y(b)s(eginning)24 b(with)h(`)p Fs(#)p Ft(')h(causes)h | |
3343 | (that)f(w)m(ord)g(and)g(all)f(remaining)g(c)m(haracters)i(on)f(that)h | |
3344 | (line)e(to)i(b)s(e)f(ignored.)150 5121 y(An)43 b(in)m(teractiv)m(e)h | |
3345 | (shell)e(without)g(the)h Fs(interactive_comments)38 b | |
3346 | Ft(option)43 b(enabled)f(do)s(es)h(not)g(allo)m(w)150 | |
3347 | 5230 y(commen)m(ts.)56 b(The)34 b Fs(interactive_comments)c | |
3348 | Ft(option)k(is)g(on)h(b)m(y)g(default)f(in)g(in)m(teractiv)m(e)i | |
3349 | (shells.)53 b(See)150 5340 y(Section)29 b(6.3)g([In)m(teractiv)m(e)i | |
3350 | (Shells],)c(page)j(67,)g(for)e(a)i(description)c(of)j(what)g(mak)m(es)h | |
3351 | (a)f(shell)e(in)m(teractiv)m(e.)p eop | |
3352 | %%Page: 8 14 | |
3353 | 8 13 bop 150 -116 a Ft(8)2617 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
3354 | 299 y Fr(3.2)68 b(Shell)45 b(Commands)275 553 y Ft(A)32 | |
3355 | b(simple)e(shell)g(command)i(suc)m(h)g(as)h Fs(echo)c(a)h(b)g(c)i | |
3356 | Ft(consists)f(of)i(the)f(command)g(itself)f(follo)m(w)m(ed)h(b)m(y)150 | |
3357 | 663 y(argumen)m(ts,)f(separated)g(b)m(y)f(spaces.)275 | |
3358 | 808 y(More)h(complex)g(shell)e(commands)i(are)g(comp)s(osed)g(of)g | |
3359 | (simple)e(commands)i(arranged)g(together)h(in)150 917 | |
3360 | y(a)f(v)-5 b(ariet)m(y)31 b(of)g(w)m(a)m(ys:)41 b(in)30 | |
3361 | b(a)h(pip)s(eline)c(in)i(whic)m(h)g(the)i(output)f(of)h(one)f(command)h | |
3362 | (b)s(ecomes)f(the)h(input)e(of)150 1027 y(a)i(second,)f(in)g(a)g(lo)s | |
3363 | (op)g(or)g(conditional)f(construct,)i(or)f(in)f(some)i(other)g | |
3364 | (grouping.)150 1272 y Fk(3.2.1)63 b(Simple)40 b(Commands)275 | |
3365 | 1526 y Ft(A)26 b(simple)f(command)i(is)e(the)i(kind)e(of)i(command)g | |
3366 | (encoun)m(tered)g(most)g(often.)40 b(It's)27 b(just)f(a)i(sequence)150 | |
3367 | 1636 y(of)f(w)m(ords)f(separated)h(b)m(y)g Fs(blank)p | |
3368 | Ft(s,)f(terminated)g(b)m(y)h(one)g(of)g(the)g(shell's)e(con)m(trol)i | |
3369 | (op)s(erators)g(\(see)h(Chap-)150 1745 y(ter)34 b(2)g([De\014nitions],) | |
3370 | g(page)h(3\).)51 b(The)34 b(\014rst)f(w)m(ord)g(generally)g(sp)s | |
3371 | (eci\014es)f(a)j(command)e(to)i(b)s(e)e(executed,)150 | |
3372 | 1855 y(with)c(the)i(rest)f(of)h(the)f(w)m(ords)g(b)s(eing)f(that)i | |
3373 | (command's)f(argumen)m(ts.)275 2000 y(The)h(return)h(status)g(\(see)i | |
3374 | (Section)e(3.7.5)i([Exit)e(Status],)i(page)f(30\))g(of)g(a)g(simple)d | |
3375 | (command)i(is)g(its)150 2109 y(exit)37 b(status)g(as)g(pro)m(vided)e(b) | |
3376 | m(y)i(the)g Fl(posix)f Ft(1003.1)j Fs(waitpid)c Ft(function,)i(or)g | |
3377 | (128)p Fs(+)p Fq(n)g Ft(if)f(the)h(command)150 2219 y(w)m(as)31 | |
3378 | b(terminated)f(b)m(y)g(signal)f Fq(n)p Ft(.)150 2463 | |
3379 | y Fk(3.2.2)63 b(Pip)s(elines)275 2718 y Ft(A)30 b Fs(pipeline)e | |
3380 | Ft(is)i(a)g(sequence)h(of)g(simple)d(commands)i(separated)h(b)m(y)f(`)p | |
3381 | Fs(|)p Ft('.)275 2863 y(The)f(format)i(for)f(a)h(pip)s(eline)c(is)390 | |
3382 | 3007 y Fs([time)46 b([-p]])h([!])g Fj(command1)56 b Fs([|)47 | |
3383 | b Fj(command2)56 b Fs(...)o(])150 3152 y Ft(The)36 b(output)h(of)g(eac) | |
3384 | m(h)h(command)e(in)g(the)h(pip)s(eline)c(is)j(connected)i(via)e(a)h | |
3385 | (pip)s(e)e(to)j(the)f(input)e(of)i(the)150 3262 y(next)31 | |
3386 | b(command.)40 b(That)30 b(is,)g(eac)m(h)i(command)e(reads)g(the)g | |
3387 | (previous)f(command's)h(output.)275 3407 y(The)36 b(reserv)m(ed)g(w)m | |
3388 | (ord)g Fs(time)g Ft(causes)h(timing)e(statistics)h(to)h(b)s(e)f(prin)m | |
3389 | (ted)f(for)h(the)h(pip)s(eline)c(once)k(it)150 3516 y(\014nishes.)50 | |
3390 | b(The)34 b(statistics)g(curren)m(tly)f(consist)h(of)g(elapsed)g(\(w)m | |
3391 | (all-clo)s(c)m(k\))g(time)g(and)g(user)f(and)h(system)150 | |
3392 | 3626 y(time)h(consumed)g(b)m(y)g(the)h(command's)f(execution.)56 | |
3393 | b(The)35 b(`)p Fs(-p)p Ft(')h(option)e(c)m(hanges)j(the)f(output)f | |
3394 | (format)150 3735 y(to)i(that)f(sp)s(eci\014ed)e(b)m(y)i | |
3395 | Fl(posix)p Ft(.)57 b(The)35 b Fs(TIMEFORMAT)e Ft(v)-5 | |
3396 | b(ariable)35 b(ma)m(y)i(b)s(e)e(set)h(to)h(a)f(format)g(string)f(that) | |
3397 | 150 3845 y(sp)s(eci\014es)28 b(ho)m(w)h(the)g(timing)e(information)h | |
3398 | (should)e(b)s(e)j(displa)m(y)m(ed.)39 b(See)29 b(Section)g(5.2)h([Bash) | |
3399 | f(V)-8 b(ariables],)150 3955 y(page)29 b(55,)h(for)e(a)g(description)f | |
3400 | (of)h(the)g(a)m(v)-5 b(ailable)28 b(formats.)40 b(The)28 | |
3401 | b(use)g(of)g Fs(time)f Ft(as)i(a)f(reserv)m(ed)h(w)m(ord)f(p)s(er-)150 | |
3402 | 4064 y(mits)f(the)h(timing)e(of)i(shell)e(builtins,)f(shell)h | |
3403 | (functions,)h(and)g(pip)s(elines.)37 b(An)27 b(external)h | |
3404 | Fs(time)e Ft(command)150 4174 y(cannot)31 b(time)f(these)h(easily)-8 | |
3405 | b(.)275 4318 y(If)24 b(the)h(pip)s(eline)d(is)i(not)h(executed)h(async) | |
3406 | m(hronously)e(\(see)i(Section)f(3.2.3)i([Lists],)f(page)f(9\),)i(the)f | |
3407 | (shell)150 4428 y(w)m(aits)k(for)g(all)g(commands)g(in)f(the)h(pip)s | |
3408 | (eline)d(to)k(complete.)275 4573 y(Eac)m(h)25 b(command)g(in)f(a)h(pip) | |
3409 | s(eline)d(is)i(executed)i(in)e(its)g(o)m(wn)i(subshell)c(\(see)k | |
3410 | (Section)f(3.7.3)i([Command)150 4682 y(Execution)35 b(En)m(vironmen)m | |
3411 | (t],)i(page)f(29\).)58 b(The)36 b(exit)f(status)h(of)g(a)g(pip)s(eline) | |
3412 | d(is)h(the)i(exit)g(status)g(of)g(the)150 4792 y(last)31 | |
3413 | b(command)g(in)f(the)h(pip)s(eline,)d(unless)i(the)h | |
3414 | Fs(pipefail)e Ft(option)i(is)f(enabled)g(\(see)i(Section)f(4.3)h([The) | |
3415 | 150 4902 y(Set)i(Builtin],)g(page)h(50\).)53 b(If)34 | |
3416 | b Fs(pipefail)e Ft(is)h(enabled,)h(the)h(pip)s(eline's)c(return)i | |
3417 | (status)h(is)g(the)g(v)-5 b(alue)34 b(of)150 5011 y(the)e(last)g | |
3418 | (\(righ)m(tmost\))h(command)f(to)h(exit)f(with)e(a)j(non-zero)f | |
3419 | (status,)h(or)f(zero)h(if)e(all)g(commands)h(exit)150 | |
3420 | 5121 y(successfully)-8 b(.)65 b(If)38 b(the)h(reserv)m(ed)g(w)m(ord)g | |
3421 | (`)p Fs(!)p Ft(')g(precedes)g(the)g(pip)s(eline,)e(the)j(exit)e(status) | |
3422 | h(is)f(the)h(logical)150 5230 y(negation)g(of)g(the)f(exit)h(status)g | |
3423 | (as)f(describ)s(ed)f(ab)s(o)m(v)m(e.)66 b(The)38 b(shell)f(w)m(aits)i | |
3424 | (for)f(all)f(commands)i(in)e(the)150 5340 y(pip)s(eline)27 | |
3425 | b(to)k(terminate)f(b)s(efore)g(returning)f(a)i(v)-5 b(alue.)p | |
3426 | eop | |
3427 | %%Page: 9 15 | |
3428 | 9 14 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
3429 | b(Shell)d(F)-8 b(eatures)2292 b(9)150 299 y Fk(3.2.3)63 | |
3430 | b(Lists)41 b(of)g(Commands)275 547 y Ft(A)29 b Fs(list)f | |
3431 | Ft(is)h(a)g(sequence)h(of)g(one)f(or)h(more)f(pip)s(elines)d(separated) | |
3432 | k(b)m(y)f(one)h(of)f(the)h(op)s(erators)g(`)p Fs(;)p | |
3433 | Ft(',)g(`)p Fs(&)p Ft(',)150 657 y(`)p Fs(&&)p Ft(',)h(or)f(`)p | |
3434 | Fs(||)p Ft(',)g(and)g(optionally)f(terminated)h(b)m(y)g(one)h(of)f(`)p | |
3435 | Fs(;)p Ft(',)h(`)p Fs(&)p Ft(',)g(or)f(a)h Fs(newline)p | |
3436 | Ft(.)275 795 y(Of)23 b(these)h(list)e(op)s(erators,)k(`)p | |
3437 | Fs(&&)p Ft(')d(and)g(`)p Fs(||)p Ft(')h(ha)m(v)m(e)h(equal)e | |
3438 | (precedence,)j(follo)m(w)m(ed)d(b)m(y)h(`)p Fs(;)p Ft(')g(and)f(`)p | |
3439 | Fs(&)p Ft(',)i(whic)m(h)150 905 y(ha)m(v)m(e)32 b(equal)d(precedence.) | |
3440 | 275 1044 y(A)g(sequence)h(of)g(one)g(or)g(more)g(newlines)d(ma)m(y)j | |
3441 | (app)s(ear)f(in)g(a)h Fs(list)e Ft(to)j(delimit)c(commands,)j(equiv-) | |
3442 | 150 1153 y(alen)m(t)h(to)g(a)g(semicolon.)275 1292 y(If)c(a)h(command)f | |
3443 | (is)g(terminated)g(b)m(y)h(the)g(con)m(trol)g(op)s(erator)g(`)p | |
3444 | Fs(&)p Ft(',)h(the)e(shell)f(executes)j(the)f(command)150 | |
3445 | 1401 y(async)m(hronously)f(in)h(a)h(subshell.)37 b(This)27 | |
3446 | b(is)h(kno)m(wn)g(as)h(executing)g(the)g(command)g(in)e(the)i | |
3447 | Fq(bac)m(kground)p Ft(.)150 1511 y(The)f(shell)f(do)s(es)h(not)h(w)m | |
3448 | (ait)f(for)g(the)h(command)f(to)i(\014nish,)c(and)i(the)h(return)e | |
3449 | (status)i(is)f(0)h(\(true\).)40 b(When)150 1621 y(job)g(con)m(trol)g | |
3450 | (is)g(not)g(activ)m(e)h(\(see)g(Chapter)f(7)h([Job)f(Con)m(trol],)i | |
3451 | (page)f(79\),)j(the)d(standard)e(input)f(for)150 1730 | |
3452 | y(async)m(hronous)43 b(commands,)k(in)c(the)g(absence)i(of)f(an)m(y)g | |
3453 | (explicit)e(redirections,)k(is)c(redirected)h(from)150 | |
3454 | 1840 y Fs(/dev/null)p Ft(.)275 1979 y(Commands)19 b(separated)j(b)m(y)f | |
3455 | (a)g(`)p Fs(;)p Ft(')g(are)h(executed)g(sequen)m(tially;)h(the)e(shell) | |
3456 | e(w)m(aits)i(for)g(eac)m(h)h(command)150 2088 y(to)31 | |
3457 | b(terminate)g(in)e(turn.)39 b(The)30 b(return)f(status)i(is)e(the)i | |
3458 | (exit)f(status)h(of)g(the)f(last)g(command)g(executed.)275 | |
3459 | 2227 y(The)f(con)m(trol)i(op)s(erators)f(`)p Fs(&&)p | |
3460 | Ft(')g(and)g(`)p Fs(||)p Ft(')g(denote)h Fl(and)e Ft(lists)g(and)h | |
3461 | Fl(or)f Ft(lists,)g(resp)s(ectiv)m(ely)-8 b(.)41 b(An)30 | |
3462 | b Fl(and)150 2336 y Ft(list)f(has)h(the)h(form)390 2475 | |
3463 | y Fj(command1)56 b Fs(&&)47 b Fj(command2)150 2614 y | |
3464 | Fq(command2)38 b Ft(is)29 b(executed)j(if,)d(and)h(only)f(if,)h | |
3465 | Fq(command1)38 b Ft(returns)29 b(an)h(exit)g(status)h(of)g(zero.)275 | |
3466 | 2752 y(An)f Fl(or)f Ft(list)g(has)h(the)h(form)390 2891 | |
3467 | y Fj(command1)56 b Fs(||)47 b Fj(command2)150 3030 y | |
3468 | Fq(command2)38 b Ft(is)29 b(executed)j(if,)d(and)h(only)f(if,)h | |
3469 | Fq(command1)38 b Ft(returns)29 b(a)i(non-zero)g(exit)f(status.)275 | |
3470 | 3168 y(The)i(return)g(status)i(of)f Fl(and)f Ft(and)h | |
3471 | Fl(or)f Ft(lists)g(is)g(the)h(exit)g(status)h(of)f(the)g(last)g | |
3472 | (command)g(executed)150 3278 y(in)c(the)i(list.)150 3510 | |
3473 | y Fk(3.2.4)63 b(Comp)s(ound)41 b(Commands)275 3759 y | |
3474 | Ft(Comp)s(ound)f(commands)i(are)h(the)g(shell)e(programming)g | |
3475 | (constructs.)77 b(Eac)m(h)44 b(construct)e(b)s(egins)150 | |
3476 | 3868 y(with)c(a)h(reserv)m(ed)g(w)m(ord)f(or)h(con)m(trol)g(op)s | |
3477 | (erator)g(and)g(is)f(terminated)g(b)m(y)h(a)g(corresp)s(onding)e | |
3478 | (reserv)m(ed)150 3978 y(w)m(ord)42 b(or)h(op)s(erator.)77 | |
3479 | b(An)m(y)42 b(redirections)f(\(see)j(Section)e(3.6)i([Redirections],)h | |
3480 | (page)e(24\))g(asso)s(ciated)150 4087 y(with)25 b(a)h(comp)s(ound)f | |
3481 | (command)h(apply)f(to)i(all)e(commands)h(within)d(that)k(comp)s(ound)e | |
3482 | (command)h(unless)150 4197 y(explicitly)i(o)m(v)m(erridden.)275 | |
3483 | 4336 y(Bash)45 b(pro)m(vides)g(lo)s(oping)f(constructs,)49 | |
3484 | b(conditional)44 b(commands,)50 b(and)44 b(mec)m(hanisms)h(to)h(group) | |
3485 | 150 4445 y(commands)30 b(and)g(execute)i(them)e(as)g(a)h(unit.)150 | |
3486 | 4678 y Fk(3.2.4.1)63 b(Lo)s(oping)43 b(Constructs)275 | |
3487 | 4926 y Ft(Bash)30 b(supp)s(orts)f(the)h(follo)m(wing)f(lo)s(oping)g | |
3488 | (constructs.)275 5065 y(Note)35 b(that)f(wherev)m(er)g(a)g(`)p | |
3489 | Fs(;)p Ft(')g(app)s(ears)f(in)g(the)h(description)e(of)i(a)g(command's) | |
3490 | g(syn)m(tax,)i(it)d(ma)m(y)i(b)s(e)150 5174 y(replaced)30 | |
3491 | b(with)f(one)i(or)f(more)g(newlines.)150 5340 y Fs(until)240 | |
3492 | b Ft(The)30 b(syn)m(tax)h(of)f(the)h Fs(until)e Ft(command)h(is:)p | |
3493 | eop | |
3494 | %%Page: 10 16 | |
3495 | 10 15 bop 150 -116 a Ft(10)2572 b(Bash)31 b(Reference)g(Man)m(ual)870 | |
3496 | 299 y Fs(until)46 b Fj(test-commands)11 b Fs(;)44 b(do)j | |
3497 | Fj(consequent-commands)11 b Fs(;)42 b(done)630 434 y | |
3498 | Ft(Execute)g Fq(consequen)m(t-commands)k Ft(as)41 b(long)g(as)g | |
3499 | Fq(test-commands)46 b Ft(has)41 b(an)g(exit)g(status)630 | |
3500 | 543 y(whic)m(h)c(is)h(not)h(zero.)67 b(The)38 b(return)f(status)j(is)d | |
3501 | (the)i(exit)g(status)g(of)g(the)g(last)f(command)630 | |
3502 | 653 y(executed)31 b(in)e Fq(consequen)m(t-commands)p | |
3503 | Ft(,)j(or)e(zero)h(if)f(none)g(w)m(as)h(executed.)150 | |
3504 | 813 y Fs(while)240 b Ft(The)30 b(syn)m(tax)h(of)f(the)h | |
3505 | Fs(while)e Ft(command)h(is:)870 948 y Fs(while)46 b Fj(test-commands)11 | |
3506 | b Fs(;)44 b(do)j Fj(consequent-commands)11 b Fs(;)42 | |
3507 | b(done)630 1083 y Ft(Execute)g Fq(consequen)m(t-commands)k | |
3508 | Ft(as)41 b(long)g(as)g Fq(test-commands)46 b Ft(has)41 | |
3509 | b(an)g(exit)g(status)630 1193 y(of)34 b(zero.)53 b(The)34 | |
3510 | b(return)f(status)h(is)g(the)g(exit)g(status)h(of)f(the)g(last)g | |
3511 | (command)g(executed)h(in)630 1302 y Fq(consequen)m(t-commands)p | |
3512 | Ft(,)c(or)g(zero)g(if)e(none)h(w)m(as)h(executed.)150 | |
3513 | 1463 y Fs(for)336 b Ft(The)30 b(syn)m(tax)h(of)f(the)h | |
3514 | Fs(for)e Ft(command)i(is:)870 1598 y Fs(for)47 b Fj(name)57 | |
3515 | b Fs([in)47 b Fj(words)57 b Fs(...)o(];)47 b(do)g Fj(commands)11 | |
3516 | b Fs(;)45 b(done)630 1733 y Ft(Expand)31 b Fq(w)m(ords)p | |
3517 | Ft(,)j(and)e(execute)i Fq(commands)i Ft(once)d(for)g(eac)m(h)h(mem)m(b) | |
3518 | s(er)e(in)f(the)i(resultan)m(t)630 1842 y(list,)27 b(with)g | |
3519 | Fq(name)33 b Ft(b)s(ound)26 b(to)j(the)f(curren)m(t)g(mem)m(b)s(er.)40 | |
3520 | b(If)27 b(`)p Fs(in)j Fj(words)11 b Ft(')27 b(is)g(not)h(presen)m(t,)h | |
3521 | (the)630 1952 y Fs(for)g Ft(command)g(executes)i(the)e | |
3522 | Fq(commands)k Ft(once)d(for)f(eac)m(h)i(p)s(ositional)c(parameter)j | |
3523 | (that)630 2061 y(is)c(set,)i(as)f(if)f(`)p Fs(in)k("$@")p | |
3524 | Ft(')c(had)g(b)s(een)g(sp)s(eci\014ed)f(\(see)j(Section)e(3.4.2)j([Sp)s | |
3525 | (ecial)c(P)m(arameters],)630 2171 y(page)e(15\).)39 b(The)21 | |
3526 | b(return)g(status)h(is)f(the)h(exit)g(status)g(of)g(the)g(last)f | |
3527 | (command)h(that)g(executes.)630 2281 y(If)i(there)h(are)h(no)e(items)h | |
3528 | (in)e(the)i(expansion)f(of)h Fq(w)m(ords)p Ft(,)h(no)f(commands)f(are)h | |
3529 | (executed,)j(and)630 2390 y(the)j(return)e(status)i(is)e(zero.)630 | |
3530 | 2525 y(An)h(alternate)h(form)f(of)h(the)f Fs(for)g Ft(command)g(is)f | |
3531 | (also)h(supp)s(orted:)870 2660 y Fs(for)47 b(\(\()g Fj(expr1)57 | |
3532 | b Fs(;)47 b Fj(expr2)57 b Fs(;)48 b Fj(expr3)57 b Fs(\)\))47 | |
3533 | b(;)g(do)g Fj(commands)57 b Fs(;)47 b(done)630 2795 y | |
3534 | Ft(First,)37 b(the)g(arithmetic)f(expression)f Fq(expr1)43 | |
3535 | b Ft(is)35 b(ev)-5 b(aluated)37 b(according)f(to)h(the)g(rules)e(de-) | |
3536 | 630 2905 y(scrib)s(ed)40 b(b)s(elo)m(w)h(\(see)i(Section)f(6.5)h | |
3537 | ([Shell)e(Arithmetic],)j(page)f(70\).)77 b(The)42 b(arithmetic)630 | |
3538 | 3014 y(expression)32 b Fq(expr2)41 b Ft(is)33 b(then)g(ev)-5 | |
3539 | b(aluated)34 b(rep)s(eatedly)f(un)m(til)f(it)h(ev)-5 | |
3540 | b(aluates)34 b(to)h(zero.)51 b(Eac)m(h)630 3124 y(time)22 | |
3541 | b Fq(expr2)30 b Ft(ev)-5 b(aluates)24 b(to)f(a)g(non-zero)h(v)-5 | |
3542 | b(alue,)24 b Fq(commands)i Ft(are)d(executed)g(and)g(the)g(arith-)630 | |
3543 | 3233 y(metic)28 b(expression)f Fq(expr3)36 b Ft(is)27 | |
3544 | b(ev)-5 b(aluated.)40 b(If)28 b(an)m(y)h(expression)e(is)g(omitted,)i | |
3545 | (it)f(b)s(eha)m(v)m(es)h(as)630 3343 y(if)h(it)h(ev)-5 | |
3546 | b(aluates)31 b(to)h(1.)44 b(The)30 b(return)g(v)-5 b(alue)31 | |
3547 | b(is)f(the)h(exit)g(status)h(of)f(the)g(last)g(command)g(in)630 | |
3548 | 3453 y Fq(list)g Ft(that)g(is)e(executed,)j(or)e(false)g(if)g(an)m(y)g | |
3549 | (of)h(the)f(expressions)f(is)h(in)m(v)-5 b(alid.)275 | |
3550 | 3613 y(The)26 b Fs(break)g Ft(and)h Fs(continue)e Ft(builtins)f(\(see)k | |
3551 | (Section)g(4.1)g([Bourne)g(Shell)d(Builtins],)h(page)i(33\))g(ma)m(y) | |
3552 | 150 3723 y(b)s(e)i(used)f(to)i(con)m(trol)g(lo)s(op)f(execution.)150 | |
3553 | 3949 y Fk(3.2.4.2)63 b(Conditional)42 b(Constructs)150 | |
3554 | 4193 y Fs(if)384 b Ft(The)30 b(syn)m(tax)h(of)f(the)h | |
3555 | Fs(if)f Ft(command)g(is:)870 4328 y Fs(if)47 b Fj(test-commands)11 | |
3556 | b Fs(;)44 b(then)965 4438 y Fj(consequent-commands)11 | |
3557 | b Fs(;)870 4547 y([elif)46 b Fj(more-test-commands)11 | |
3558 | b Fs(;)42 b(then)965 4657 y Fj(more-consequents)11 b | |
3559 | Fs(;])870 4767 y([else)46 b Fj(alternate-consequents)11 | |
3560 | b Fs(;])870 4876 y(fi)630 5011 y Ft(The)53 b Fq(test-commands)58 | |
3561 | b Ft(list)52 b(is)h(executed,)60 b(and)53 b(if)f(its)h(return)f(status) | |
3562 | i(is)e(zero,)61 b(the)630 5121 y Fq(consequen)m(t-commands)44 | |
3563 | b Ft(list)39 b(is)g(executed.)70 b(If)40 b Fq(test-commands)k | |
3564 | Ft(returns)39 b(a)h(non-zero)630 5230 y(status,)45 b(eac)m(h)e | |
3565 | Fs(elif)d Ft(list)g(is)h(executed)i(in)d(turn,)k(and)d(if)f(its)h(exit) | |
3566 | h(status)g(is)e(zero,)46 b(the)630 5340 y(corresp)s(onding)36 | |
3567 | b Fq(more-consequen)m(ts)42 b Ft(is)37 b(executed)h(and)f(the)h | |
3568 | (command)g(completes.)62 b(If)p eop | |
3569 | %%Page: 11 17 | |
3570 | 11 16 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
3571 | b(Shell)d(F)-8 b(eatures)2246 b(11)630 299 y(`)p Fs(else)29 | |
3572 | b Fj(alternate-consequents)11 b Ft(')23 b(is)29 b(presen)m(t,)g(and)g | |
3573 | (the)g(\014nal)f(command)g(in)g(the)h(\014nal)630 408 | |
3574 | y Fs(if)44 b Ft(or)g Fs(elif)f Ft(clause)h(has)g(a)h(non-zero)g(exit)f | |
3575 | (status,)k(then)c Fq(alternate-consequen)m(ts)50 b Ft(is)630 | |
3576 | 518 y(executed.)55 b(The)34 b(return)g(status)h(is)e(the)i(exit)g | |
3577 | (status)g(of)g(the)g(last)f(command)h(executed,)630 628 | |
3578 | y(or)30 b(zero)i(if)d(no)h(condition)f(tested)i(true.)150 | |
3579 | 784 y Fs(case)288 b Ft(The)30 b(syn)m(tax)h(of)f(the)h | |
3580 | Fs(case)e Ft(command)h(is:)870 917 y Fs(case)47 b Fj(word)57 | |
3581 | b Fs(in)47 b([)g([\(])g Fj(pattern)57 b Fs([|)47 b Fj(pattern)11 | |
3582 | b Fs(]...)l(\))48 b Fj(command-list)55 b Fs(;;]...)46 | |
3583 | b(esac)630 1050 y(case)34 b Ft(will)e(selectiv)m(ely)i(execute)i(the)f | |
3584 | Fq(command-list)h Ft(corresp)s(onding)c(to)k(the)e(\014rst)g | |
3585 | Fq(pat-)630 1160 y(tern)40 b Ft(that)i(matc)m(hes)g Fq(w)m(ord)p | |
3586 | Ft(.)71 b(The)40 b(`)p Fs(|)p Ft(')h(is)f(used)g(to)h(separate)h(m)m | |
3587 | (ultiple)c(patterns,)44 b(and)630 1270 y(the)31 b(`)p | |
3588 | Fs(\))p Ft(')h(op)s(erator)f(terminates)g(a)h(pattern)f(list.)42 | |
3589 | b(A)31 b(list)f(of)i(patterns)f(and)f(an)h(asso)s(ciated)630 | |
3590 | 1379 y(command-list)e(is)g(kno)m(wn)h(as)g(a)h Fq(clause)p | |
3591 | Ft(.)40 b(Eac)m(h)31 b(clause)f(m)m(ust)g(b)s(e)f(terminated)h(with)f | |
3592 | (`)p Fs(;;)p Ft('.)630 1489 y(The)e Fq(w)m(ord)j Ft(undergo)s(es)d | |
3593 | (tilde)f(expansion,)h(parameter)g(expansion,)g(command)h(substitu-)630 | |
3594 | 1598 y(tion,)38 b(arithmetic)e(expansion,)h(and)g(quote)g(remo)m(v)-5 | |
3595 | b(al)37 b(b)s(efore)f(matc)m(hing)h(is)f(attempted.)630 | |
3596 | 1708 y(Eac)m(h)e Fq(pattern)f Ft(undergo)s(es)g(tilde)f(expansion,)h | |
3597 | (parameter)h(expansion,)f(command)g(sub-)630 1817 y(stitution,)c(and)h | |
3598 | (arithmetic)g(expansion.)630 1951 y(There)g(ma)m(y)g(b)s(e)f(an)h | |
3599 | (arbitrary)f(n)m(um)m(b)s(er)g(of)h Fs(case)f Ft(clauses,)h(eac)m(h)h | |
3600 | (terminated)f(b)m(y)f(a)i(`)p Fs(;;)p Ft('.)630 2060 | |
3601 | y(The)f(\014rst)f(pattern)i(that)g(matc)m(hes)g(determines)f(the)g | |
3602 | (command-list)g(that)h(is)e(executed.)630 2193 y(Here)35 | |
3603 | b(is)f(an)h(example)g(using)e Fs(case)h Ft(in)f(a)i(script)f(that)i | |
3604 | (could)e(b)s(e)g(used)g(to)h(describ)s(e)f(one)630 2303 | |
3605 | y(in)m(teresting)c(feature)h(of)f(an)g(animal:)870 2436 | |
3606 | y Fs(echo)47 b(-n)g("Enter)f(the)h(name)f(of)i(an)f(animal:)f(")870 | |
3607 | 2545 y(read)h(ANIMAL)870 2655 y(echo)g(-n)g("The)f($ANIMAL)g(has)h(") | |
3608 | 870 2765 y(case)g($ANIMAL)e(in)965 2874 y(horse)i(|)g(dog)g(|)h(cat\))e | |
3609 | (echo)h(-n)g("four";;)965 2984 y(man)g(|)h(kangaroo)d(\))j(echo)e(-n)i | |
3610 | ("two";;)965 3093 y(*\))g(echo)e(-n)h("an)g(unknown)f(number)g(of";;) | |
3611 | 870 3203 y(esac)870 3313 y(echo)h(")g(legs.")630 3446 | |
3612 | y Ft(The)26 b(return)f(status)h(is)f(zero)i(if)e(no)h | |
3613 | Fq(pattern)g Ft(is)f(matc)m(hed.)40 b(Otherwise,)26 b(the)h(return)e | |
3614 | (status)630 3555 y(is)k(the)i(exit)f(status)h(of)f(the)h | |
3615 | Fq(command-list)g Ft(executed.)150 3712 y Fs(select)630 | |
3616 | 3845 y Ft(The)i Fs(select)f Ft(construct)i(allo)m(ws)f(the)h(easy)g | |
3617 | (generation)g(of)f(men)m(us.)50 b(It)34 b(has)f(almost)h(the)630 | |
3618 | 3954 y(same)d(syn)m(tax)g(as)f(the)h Fs(for)e Ft(command:)870 | |
3619 | 4088 y Fs(select)46 b Fj(name)57 b Fs([in)47 b Fj(words)57 | |
3620 | b Fs(...)o(];)47 b(do)h Fj(commands)11 b Fs(;)44 b(done)630 | |
3621 | 4221 y Ft(The)d(list)g(of)g(w)m(ords)h(follo)m(wing)e | |
3622 | Fs(in)h Ft(is)g(expanded,)j(generating)e(a)g(list)e(of)i(items.)74 | |
3623 | b(The)630 4330 y(set)41 b(of)f(expanded)f(w)m(ords)g(is)h(prin)m(ted)e | |
3624 | (on)i(the)g(standard)f(error)h(output)g(stream,)j(eac)m(h)630 | |
3625 | 4440 y(preceded)30 b(b)m(y)g(a)h(n)m(um)m(b)s(er.)40 | |
3626 | b(If)29 b(the)i(`)p Fs(in)f Fj(words)11 b Ft(')29 b(is)g(omitted,)i | |
3627 | (the)f(p)s(ositional)f(parameters)630 4549 y(are)24 b(prin)m(ted,)f(as) | |
3628 | h(if)e(`)p Fs(in)30 b("$@")p Ft(')23 b(had)f(b)s(een)h(sp)s(ecifed.)37 | |
3629 | b(The)23 b Fs(PS3)f Ft(prompt)h(is)f(then)h(displa)m(y)m(ed)630 | |
3630 | 4659 y(and)38 b(a)h(line)e(is)g(read)i(from)f(the)h(standard)e(input.) | |
3631 | 64 b(If)38 b(the)h(line)e(consists)h(of)g(a)h(n)m(um)m(b)s(er)630 | |
3632 | 4769 y(corresp)s(onding)32 b(to)j(one)f(of)g(the)g(displa)m(y)m(ed)f(w) | |
3633 | m(ords,)h(then)g(the)g(v)-5 b(alue)33 b(of)i Fq(name)k | |
3634 | Ft(is)33 b(set)h(to)630 4878 y(that)g(w)m(ord.)49 b(If)32 | |
3635 | b(the)i(line)d(is)i(empt)m(y)-8 b(,)35 b(the)e(w)m(ords)g(and)f(prompt) | |
3636 | h(are)g(displa)m(y)m(ed)f(again.)49 b(If)630 4988 y Fs(EOF)23 | |
3637 | b Ft(is)f(read,)k(the)d Fs(select)f Ft(command)i(completes.)39 | |
3638 | b(An)m(y)23 b(other)h(v)-5 b(alue)23 b(read)h(causes)g | |
3639 | Fq(name)630 5097 y Ft(to)31 b(b)s(e)f(set)h(to)g(n)m(ull.)39 | |
3640 | b(The)29 b(line)g(read)h(is)g(sa)m(v)m(ed)h(in)e(the)i(v)-5 | |
3641 | b(ariable)29 b Fs(REPLY)p Ft(.)630 5230 y(The)42 b Fq(commands)j | |
3642 | Ft(are)d(executed)h(after)g(eac)m(h)g(selection)f(un)m(til)e(a)j | |
3643 | Fs(break)d Ft(command)i(is)630 5340 y(executed,)32 b(at)f(whic)m(h)e(p) | |
3644 | s(oin)m(t)g(the)i Fs(select)d Ft(command)i(completes.)p | |
3645 | eop | |
3646 | %%Page: 12 18 | |
3647 | 12 17 bop 150 -116 a Ft(12)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
3648 | 299 y(Here)39 b(is)f(an)h(example)g(that)g(allo)m(ws)g(the)g(user)f(to) | |
3649 | i(pic)m(k)e(a)h(\014lename)g(from)f(the)h(curren)m(t)630 | |
3650 | 408 y(directory)-8 b(,)31 b(and)e(displa)m(ys)g(the)h(name)h(and)f | |
3651 | (index)e(of)j(the)g(\014le)e(selected.)870 542 y Fs(select)46 | |
3652 | b(fname)g(in)i(*;)870 651 y(do)870 761 y(echo)f(you)g(picked)f($fname)g | |
3653 | (\\\($REPLY\\\))870 870 y(break;)870 980 y(done)150 1136 | |
3654 | y(\(\(...)o(\)\))870 1270 y(\(\()h Fj(expression)56 b | |
3655 | Fs(\)\))630 1403 y Ft(The)33 b(arithmetic)g Fq(expression)g | |
3656 | Ft(is)f(ev)-5 b(aluated)34 b(according)g(to)g(the)g(rules)e(describ)s | |
3657 | (ed)g(b)s(elo)m(w)630 1512 y(\(see)k(Section)e(6.5)i([Shell)d | |
3658 | (Arithmetic],)i(page)h(70\).)55 b(If)34 b(the)h(v)-5 | |
3659 | b(alue)34 b(of)h(the)g(expression)f(is)630 1622 y(non-zero,)27 | |
3660 | b(the)f(return)e(status)i(is)f(0;)i(otherwise)e(the)h(return)e(status)i | |
3661 | (is)f(1.)39 b(This)24 b(is)g(exactly)630 1731 y(equiv)-5 | |
3662 | b(alen)m(t)30 b(to)870 1864 y Fs(let)47 b(")p Fj(expression)11 | |
3663 | b Fs(")630 1998 y Ft(See)25 b(Section)g(4.2)i([Bash)e(Builtins],)f | |
3664 | (page)i(39,)i(for)c(a)i(full)d(description)g(of)i(the)h | |
3665 | Fs(let)e Ft(builtin.)150 2154 y Fs([[...)o(]])870 2287 | |
3666 | y([[)47 b Fj(expression)56 b Fs(]])630 2420 y Ft(Return)25 | |
3667 | b(a)h(status)f(of)h(0)g(or)g(1)g(dep)s(ending)d(on)i(the)h(ev)-5 | |
3668 | b(aluation)25 b(of)g(the)h(conditional)e(expres-)630 | |
3669 | 2530 y(sion)29 b Fq(expression)p Ft(.)40 b(Expressions)28 | |
3670 | b(are)j(comp)s(osed)f(of)g(the)h(primaries)d(describ)s(ed)g(b)s(elo)m | |
3671 | (w)h(in)630 2639 y(Section)35 b(6.4)i([Bash)f(Conditional)d | |
3672 | (Expressions],)j(page)g(69.)57 b(W)-8 b(ord)36 b(splitting)e(and)h | |
3673 | (\014le-)630 2749 y(name)24 b(expansion)g(are)h(not)f(p)s(erformed)f | |
3674 | (on)h(the)h(w)m(ords)f(b)s(et)m(w)m(een)h(the)g(`)p Fs([[)p | |
3675 | Ft(')f(and)g(`)p Fs(]])p Ft(';)i(tilde)630 2859 y(expansion,)k | |
3676 | (parameter)h(and)f(v)-5 b(ariable)29 b(expansion,)h(arithmetic)f | |
3677 | (expansion,)h(command)630 2968 y(substitution,)38 b(pro)s(cess)h | |
3678 | (substitution,)f(and)g(quote)h(remo)m(v)-5 b(al)39 b(are)g(p)s | |
3679 | (erformed.)63 b(Condi-)630 3078 y(tional)30 b(op)s(erators)g(suc)m(h)g | |
3680 | (as)h(`)p Fs(-f)p Ft(')f(m)m(ust)g(b)s(e)g(unquoted)g(to)h(b)s(e)e | |
3681 | (recognized)i(as)g(primaries.)630 3211 y(When)22 b(the)h(`)p | |
3682 | Fs(==)p Ft(')f(and)g(`)p Fs(!=)p Ft(')g(op)s(erators)h(are)g(used,)g | |
3683 | (the)g(string)e(to)j(the)e(righ)m(t)g(of)h(the)g(op)s(erator)630 | |
3684 | 3320 y(is)30 b(considered)g(a)i(pattern)f(and)g(matc)m(hed)h(according) | |
3685 | f(to)h(the)g(rules)e(describ)s(ed)f(b)s(elo)m(w)h(in)630 | |
3686 | 3430 y(Section)g(3.5.8.1)j([P)m(attern)e(Matc)m(hing],)h(page)f(23.)41 | |
3687 | b(The)30 b(return)f(v)-5 b(alue)30 b(is)f(0)h(if)g(the)g(string)630 | |
3688 | 3540 y(matc)m(hes)c(or)f(do)s(es)g(not)h(matc)m(h)f(the)h(pattern,)g | |
3689 | (resp)s(ectiv)m(ely)-8 b(,)26 b(and)f(1)h(otherwise.)38 | |
3690 | b(An)m(y)25 b(part)630 3649 y(of)31 b(the)f(pattern)h(ma)m(y)g(b)s(e)e | |
3691 | (quoted)i(to)g(force)g(it)f(to)h(b)s(e)f(matc)m(hed)h(as)f(a)h(string.) | |
3692 | 630 3782 y(An)i(additional)f(binary)g(op)s(erator,)j(`)p | |
3693 | Fs(=~)p Ft(',)g(is)e(a)m(v)-5 b(ailable,)34 b(with)e(the)i(same)g | |
3694 | (precedence)h(as)630 3892 y(`)p Fs(==)p Ft(')29 b(and)f(`)p | |
3695 | Fs(!=)p Ft('.)40 b(When)29 b(it)f(is)g(used,)g(the)h(string)f(to)i(the) | |
3696 | e(righ)m(t)h(of)g(the)g(op)s(erator)g(is)f(consid-)630 | |
3697 | 4001 y(ered)34 b(an)g(extended)g(regular)f(expression)g(and)g(matc)m | |
3698 | (hed)i(accordingly)e(\(as)h(in)f Fm(r)-5 b(e)g(gex)11 | |
3699 | b Ft(3\)\).)630 4111 y(The)39 b(return)f(v)-5 b(alue)39 | |
3700 | b(is)f(0)i(if)e(the)h(string)g(matc)m(hes)h(the)f(pattern,)j(and)d(1)h | |
3701 | (otherwise.)66 b(If)630 4221 y(the)26 b(regular)f(expression)g(is)g | |
3702 | (syn)m(tactically)h(incorrect,)h(the)f(conditional)e(expression's)h | |
3703 | (re-)630 4330 y(turn)35 b(v)-5 b(alue)36 b(is)f(2.)59 | |
3704 | b(If)36 b(the)g(shell)f(option)g Fs(nocaseglob)f Ft(\(see)j(the)g | |
3705 | (description)d(of)i Fs(shopt)630 4440 y Ft(in)42 b(Section)h(4.2)h | |
3706 | ([Bash)f(Builtins],)h(page)g(39\))g(is)e(enabled,)j(the)f(matc)m(h)f | |
3707 | (is)f(p)s(erformed)630 4549 y(without)d(regard)h(to)h(the)f(case)h(of)g | |
3708 | (alphab)s(etic)d(c)m(haracters.)72 b(Substrings)37 b(matc)m(hed)k(b)m | |
3709 | (y)630 4659 y(paren)m(thesized)i(sub)s(expressions)e(within)h(the)i | |
3710 | (regular)f(expression)g(are)h(sa)m(v)m(ed)h(in)e(the)630 | |
3711 | 4769 y(arra)m(y)38 b(v)-5 b(ariable)36 b Fs(BASH_REMATCH)p | |
3712 | Ft(.)59 b(The)36 b(elemen)m(t)i(of)g Fs(BASH_REMATCH)c | |
3713 | Ft(with)i(index)g(0)i(is)630 4878 y(the)c(p)s(ortion)e(of)i(the)f | |
3714 | (string)g(matc)m(hing)g(the)h(en)m(tire)g(regular)e(expression.)49 | |
3715 | b(The)33 b(elemen)m(t)630 4988 y(of)39 b Fs(BASH_REMATCH)c | |
3716 | Ft(with)i(index)g Fq(n)g Ft(is)h(the)g(p)s(ortion)f(of)i(the)f(string)g | |
3717 | (matc)m(hing)g(the)h Fq(n)p Ft(th)630 5097 y(paren)m(thesized)30 | |
3718 | b(sub)s(expression.)630 5230 y(Expressions)22 b(ma)m(y)i(b)s(e)e(com)m | |
3719 | (bined)h(using)f(the)i(follo)m(wing)e(op)s(erators,)j(listed)d(in)g | |
3720 | (decreasing)630 5340 y(order)30 b(of)g(precedence:)p | |
3721 | eop | |
3722 | %%Page: 13 19 | |
3723 | 13 18 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
3724 | b(Shell)d(F)-8 b(eatures)2246 b(13)630 299 y Fs(\()30 | |
3725 | b Fj(expression)38 b Fs(\))1110 408 y Ft(Returns)30 b(the)h(v)-5 | |
3726 | b(alue)30 b(of)h Fq(expression)p Ft(.)41 b(This)29 b(ma)m(y)j(b)s(e)e | |
3727 | (used)g(to)i(o)m(v)m(erride)f(the)1110 518 y(normal)e(precedence)i(of)g | |
3728 | (op)s(erators.)630 667 y Fs(!)f Fj(expression)1110 776 | |
3729 | y Ft(T)-8 b(rue)30 b(if)f Fq(expression)g Ft(is)h(false.)630 | |
3730 | 925 y Fj(expression1)38 b Fs(&&)30 b Fj(expression2)1110 | |
3731 | 1034 y Ft(T)-8 b(rue)30 b(if)f(b)s(oth)h Fq(expression1)37 | |
3732 | b Ft(and)29 b Fq(expression2)37 b Ft(are)31 b(true.)630 | |
3733 | 1183 y Fj(expression1)38 b Fs(||)30 b Fj(expression2)1110 | |
3734 | 1292 y Ft(T)-8 b(rue)30 b(if)f(either)h Fq(expression1)37 | |
3735 | b Ft(or)30 b Fq(expression2)37 b Ft(is)29 b(true.)630 | |
3736 | 1441 y(The)c Fs(&&)g Ft(and)g Fs(||)f Ft(op)s(erators)i(do)f(not)h(ev) | |
3737 | -5 b(aluate)26 b Fq(expression2)32 b Ft(if)25 b(the)g(v)-5 | |
3738 | b(alue)25 b(of)h Fq(expression1)630 1550 y Ft(is)j(su\016cien)m(t)h(to) | |
3739 | h(determine)f(the)g(return)g(v)-5 b(alue)30 b(of)g(the)h(en)m(tire)f | |
3740 | (conditional)f(expression.)150 1758 y Fk(3.2.4.3)63 b(Grouping)43 | |
3741 | b(Commands)275 1997 y Ft(Bash)22 b(pro)m(vides)f(t)m(w)m(o)i(w)m(a)m | |
3742 | (ys)g(to)g(group)f(a)g(list)f(of)h(commands)g(to)g(b)s(e)g(executed)h | |
3743 | (as)f(a)h(unit.)36 b(When)22 b(com-)150 2106 y(mands)30 | |
3744 | b(are)i(group)s(ed,)f(redirections)f(ma)m(y)i(b)s(e)e(applied)g(to)i | |
3745 | (the)f(en)m(tire)g(command)h(list.)42 b(F)-8 b(or)32 | |
3746 | b(example,)150 2216 y(the)f(output)f(of)g(all)f(the)i(commands)f(in)f | |
3747 | (the)i(list)e(ma)m(y)i(b)s(e)e(redirected)h(to)h(a)g(single)e(stream.) | |
3748 | 150 2364 y Fs(\(\))870 2494 y(\()47 b Fj(list)58 b Fs(\))630 | |
3749 | 2623 y Ft(Placing)28 b(a)h(list)e(of)i(commands)f(b)s(et)m(w)m(een)i | |
3750 | (paren)m(theses)e(causes)i(a)f(subshell)c(en)m(vironmen)m(t)630 | |
3751 | 2732 y(to)31 b(b)s(e)e(created)j(\(see)f(Section)f(3.7.3)i([Command)d | |
3752 | (Execution)h(En)m(vironmen)m(t],)g(page)g(29\),)630 2842 | |
3753 | y(and)d(eac)m(h)i(of)e(the)h(commands)f(in)f Fq(list)i | |
3754 | Ft(to)h(b)s(e)e(executed)h(in)e(that)i(subshell.)37 b(Since)27 | |
3755 | b(the)g Fq(list)630 2951 y Ft(is)h(executed)h(in)e(a)i(subshell,)e(v)-5 | |
3756 | b(ariable)27 b(assignmen)m(ts)h(do)h(not)g(remain)e(in)g(e\013ect)k | |
3757 | (after)e(the)630 3061 y(subshell)e(completes.)150 3209 | |
3758 | y Fs({})870 3338 y({)47 b Fj(list)11 b Fs(;)46 b(})630 | |
3759 | 3467 y Ft(Placing)28 b(a)i(list)e(of)i(commands)f(b)s(et)m(w)m(een)h | |
3760 | (curly)e(braces)h(causes)h(the)f(list)f(to)i(b)s(e)f(executed)630 | |
3761 | 3577 y(in)c(the)i(curren)m(t)g(shell)d(con)m(text.)42 | |
3762 | b(No)27 b(subshell)d(is)h(created.)41 b(The)26 b(semicolon)g(\(or)h | |
3763 | (newline\))630 3687 y(follo)m(wing)i Fq(list)i Ft(is)e(required.)275 | |
3764 | 3835 y(In)j(addition)f(to)i(the)g(creation)h(of)f(a)g(subshell,)e | |
3765 | (there)i(is)f(a)h(subtle)e(di\013erence)i(b)s(et)m(w)m(een)g(these)h(t) | |
3766 | m(w)m(o)150 3945 y(constructs)43 b(due)f(to)h(historical)e(reasons.)77 | |
3767 | b(The)42 b(braces)h(are)g Fs(reserved)28 b(words)p Ft(,)45 | |
3768 | b(so)d(they)h(m)m(ust)g(b)s(e)150 4054 y(separated)33 | |
3769 | b(from)f(the)g Fq(list)i Ft(b)m(y)e Fs(blank)p Ft(s.)45 | |
3770 | b(The)32 b(paren)m(theses)h(are)g Fs(operators)p Ft(,)d(and)i(are)h | |
3771 | (recognized)g(as)150 4164 y(separate)e(tok)m(ens)h(b)m(y)e(the)h(shell) | |
3772 | d(ev)m(en)j(if)e(they)i(are)g(not)f(separated)h(from)f(the)h | |
3773 | Fq(list)g Ft(b)m(y)f(whitespace.)275 4293 y(The)f(exit)i(status)f(of)h | |
3774 | (b)s(oth)f(of)g(these)h(constructs)g(is)e(the)i(exit)f(status)g(of)h | |
3775 | Fq(list)p Ft(.)150 4534 y Fr(3.3)68 b(Shell)45 b(F)-11 | |
3776 | b(unctions)275 4773 y Ft(Shell)25 b(functions)h(are)h(a)h(w)m(a)m(y)g | |
3777 | (to)g(group)f(commands)g(for)g(later)h(execution)f(using)f(a)i(single)e | |
3778 | (name)h(for)150 4882 y(the)35 b(group.)55 b(They)35 b(are)g(executed)h | |
3779 | (just)f(lik)m(e)f(a)i Fs(")p Ft(regular)p Fs(")e Ft(command.)54 | |
3780 | b(When)35 b(the)h(name)f(of)g(a)h(shell)150 4992 y(function)i(is)g | |
3781 | (used)g(as)h(a)h(simple)d(command)i(name,)i(the)e(list)f(of)h(commands) | |
3782 | g(asso)s(ciated)h(with)d(that)150 5101 y(function)24 | |
3783 | b(name)i(is)f(executed.)40 b(Shell)23 b(functions)h(are)j(executed)f | |
3784 | (in)e(the)i(curren)m(t)g(shell)e(con)m(text;)29 b(no)c(new)150 | |
3785 | 5211 y(pro)s(cess)30 b(is)f(created)j(to)f(in)m(terpret)f(them.)275 | |
3786 | 5340 y(F)-8 b(unctions)29 b(are)i(declared)f(using)f(this)g(syn)m(tax:) | |
3787 | p eop | |
3788 | %%Page: 14 20 | |
3789 | 14 19 bop 150 -116 a Ft(14)2572 b(Bash)31 b(Reference)g(Man)m(ual)390 | |
3790 | 299 y Fs([)47 b(function)f(])h Fj(name)58 b Fs(\(\))47 | |
3791 | b Fj(compound-command)54 b Fs([)47 b Fj(redirections)55 | |
3792 | b Fs(])275 450 y Ft(This)30 b(de\014nes)i(a)h(shell)e(function)h(named) | |
3793 | g Fq(name)p Ft(.)48 b(The)32 b(reserv)m(ed)h(w)m(ord)f | |
3794 | Fs(function)f Ft(is)g(optional.)47 b(If)150 559 y(the)39 | |
3795 | b Fs(function)f Ft(reserv)m(ed)h(w)m(ord)g(is)f(supplied,)h(the)g | |
3796 | (paren)m(theses)h(are)f(optional.)67 b(The)39 b Fq(b)s(o)s(dy)45 | |
3797 | b Ft(of)40 b(the)150 669 y(function)g(is)h(the)h(comp)s(ound)e(command) | |
3798 | h Fq(comp)s(ound-command)j Ft(\(see)e(Section)g(3.2.4)h([Comp)s(ound) | |
3799 | 150 778 y(Commands],)33 b(page)g(9\).)48 b(That)33 b(command)g(is)e | |
3800 | (usually)g(a)i Fq(list)g Ft(enclosed)f(b)s(et)m(w)m(een)i | |
3801 | Fs({)e Ft(and)g Fs(})p Ft(,)h(but)f(ma)m(y)150 888 y(b)s(e)27 | |
3802 | b(an)m(y)h(comp)s(ound)e(command)h(listed)f(ab)s(o)m(v)m(e.)41 | |
3803 | b Fq(comp)s(ound-command)30 b Ft(is)d(executed)h(whenev)m(er)g | |
3804 | Fq(name)150 998 y Ft(is)36 b(sp)s(eci\014ed)g(as)h(the)h(name)f(of)g(a) | |
3805 | h(command.)61 b(An)m(y)37 b(redirections)f(\(see)i(Section)f(3.6)h | |
3806 | ([Redirections],)150 1107 y(page)31 b(24\))h(asso)s(ciated)f(with)e | |
3807 | (the)h(shell)f(function)g(are)i(p)s(erformed)d(when)i(the)g(function)f | |
3808 | (is)h(executed.)275 1258 y(The)c(exit)h(status)h(of)f(a)h(function)e | |
3809 | (de\014nition)f(is)h(zero)i(unless)e(a)h(syn)m(tax)h(error)f(o)s(ccurs) | |
3810 | g(or)g(a)h(readonly)150 1367 y(function)j(with)f(the)j(same)f(name)g | |
3811 | (already)g(exists.)45 b(When)32 b(executed,)h(the)f(exit)g(status)h(of) | |
3812 | f(a)g(function)150 1477 y(is)d(the)i(exit)f(status)h(of)f(the)h(last)f | |
3813 | (command)g(executed)i(in)d(the)h(b)s(o)s(dy)-8 b(.)275 | |
3814 | 1628 y(Note)22 b(that)f(for)f(historical)f(reasons,)k(in)d(the)h(most)g | |
3815 | (common)g(usage)g(the)g(curly)e(braces)i(that)g(surround)150 | |
3816 | 1737 y(the)38 b(b)s(o)s(dy)d(of)j(the)f(function)f(m)m(ust)h(b)s(e)g | |
3817 | (separated)h(from)f(the)g(b)s(o)s(dy)f(b)m(y)h Fs(blank)p | |
3818 | Ft(s)f(or)h(newlines.)60 b(This)150 1847 y(is)37 b(b)s(ecause)h(the)h | |
3819 | (braces)f(are)h(reserv)m(ed)f(w)m(ords)g(and)f(are)i(only)e(recognized) | |
3820 | i(as)f(suc)m(h)g(when)f(they)i(are)150 1956 y(separated)e(b)m(y)g | |
3821 | (whitespace.)60 b(Also,)38 b(when)e(using)f(the)i(braces,)i(the)e | |
3822 | Fq(list)h Ft(m)m(ust)e(b)s(e)g(terminated)h(b)m(y)g(a)150 | |
3823 | 2066 y(semicolon,)30 b(a)h(`)p Fs(&)p Ft(',)f(or)h(a)g(newline.)275 | |
3824 | 2217 y(When)h(a)i(function)e(is)g(executed,)j(the)e(argumen)m(ts)h(to)g | |
3825 | (the)f(function)f(b)s(ecome)h(the)h(p)s(ositional)d(pa-)150 | |
3826 | 2326 y(rameters)42 b(during)d(its)i(execution)h(\(see)g(Section)f | |
3827 | (3.4.1)i([P)m(ositional)e(P)m(arameters],)46 b(page)c(15\).)75 | |
3828 | b(The)150 2436 y(sp)s(ecial)35 b(parameter)h(`)p Fs(#)p | |
3829 | Ft(')g(that)h(expands)e(to)i(the)f(n)m(um)m(b)s(er)f(of)h(p)s | |
3830 | (ositional)e(parameters)i(is)f(up)s(dated)g(to)150 2545 | |
3831 | y(re\015ect)28 b(the)g(c)m(hange.)41 b(P)m(ositional)27 | |
3832 | b(parameter)h Fs(0)f Ft(is)f(unc)m(hanged.)40 b(The)27 | |
3833 | b(\014rst)g(elemen)m(t)h(of)f(the)h Fs(FUNCNAME)150 2655 | |
3834 | y Ft(v)-5 b(ariable)25 b(is)h(set)h(to)h(the)f(name)f(of)h(the)g | |
3835 | (function)e(while)g(the)i(function)e(is)h(executing.)39 | |
3836 | b(All)26 b(other)h(asp)s(ects)150 2765 y(of)32 b(the)g(shell)e | |
3837 | (execution)j(en)m(vironmen)m(t)e(are)i(iden)m(tical)d(b)s(et)m(w)m(een) | |
3838 | j(a)f(function)f(and)g(its)h(caller)f(with)g(the)150 | |
3839 | 2874 y(exception)25 b(that)h(the)f Fs(DEBUG)f Ft(trap)h(b)s(elo)m(w\))g | |
3840 | (is)f(not)i(inherited)c(unless)i(the)h(function)f(has)h(b)s(een)g(giv)m | |
3841 | (en)g(the)150 2984 y Fs(trace)36 b Ft(attribute)g(using)g(the)h | |
3842 | Fs(declare)e Ft(builtin)e(or)k(the)g Fs(-o)30 b(functrace)35 | |
3843 | b Ft(option)h(has)h(b)s(een)f(enabled)150 3093 y(with)c(the)h | |
3844 | Fs(set)g Ft(builtin,)e(\(in)h(whic)m(h)g(case)i(all)e(functions)g | |
3845 | (inherit)f(the)j Fs(DEBUG)e Ft(trap\).)49 b(See)34 b(Section)f(4.1)150 | |
3846 | 3203 y([Bourne)d(Shell)f(Builtins],)f(page)j(33,)g(for)g(the)f | |
3847 | (description)f(of)h(the)h Fs(trap)e Ft(builtin.)275 3354 | |
3848 | y(If)37 b(the)g(builtin)d(command)k Fs(return)d Ft(is)i(executed)h(in)f | |
3849 | (a)h(function,)g(the)f(function)g(completes)h(and)150 | |
3850 | 3463 y(execution)24 b(resumes)f(with)g(the)h(next)g(command)f(after)i | |
3851 | (the)f(function)e(call.)38 b(An)m(y)24 b(command)f(asso)s(ciated)150 | |
3852 | 3573 y(with)35 b(the)i Fs(RETURN)d Ft(trap)i(is)g(executed)h(b)s(efore) | |
3853 | f(execution)h(resumes.)57 b(When)37 b(a)f(function)f(completes,)150 | |
3854 | 3682 y(the)i(v)-5 b(alues)37 b(of)g(the)g(p)s(ositional)e(parameters)i | |
3855 | (and)g(the)g(sp)s(ecial)f(parameter)h(`)p Fs(#)p Ft(')g(are)h(restored) | |
3856 | f(to)h(the)150 3792 y(v)-5 b(alues)25 b(they)g(had)g(prior)e(to)j(the)g | |
3857 | (function's)e(execution.)39 b(If)25 b(a)h(n)m(umeric)e(argumen)m(t)i | |
3858 | (is)e(giv)m(en)h(to)h Fs(return)p Ft(,)150 3902 y(that)j(is)f(the)g | |
3859 | (function's)g(return)f(status;)j(otherwise)e(the)g(function's)g(return) | |
3860 | f(status)i(is)e(the)i(exit)g(status)150 4011 y(of)i(the)f(last)g | |
3861 | (command)g(executed)i(b)s(efore)e(the)g Fs(return)p Ft(.)275 | |
3862 | 4162 y(V)-8 b(ariables)29 b(lo)s(cal)g(to)h(the)g(function)e(ma)m(y)j | |
3863 | (b)s(e)e(declared)g(with)f(the)i Fs(local)f Ft(builtin.)37 | |
3864 | b(These)29 b(v)-5 b(ariables)150 4271 y(are)31 b(visible)d(only)h(to)i | |
3865 | (the)g(function)e(and)h(the)g(commands)g(it)g(in)m(v)m(ok)m(es.)275 | |
3866 | 4422 y(F)-8 b(unction)37 b(names)g(and)g(de\014nitions)e(ma)m(y)k(b)s | |
3867 | (e)e(listed)f(with)g(the)i(`)p Fs(-f)p Ft(')f(option)g(to)i(the)e | |
3868 | Fs(declare)f Ft(or)150 4532 y Fs(typeset)d Ft(builtin)e(commands)k | |
3869 | (\(see)h(Section)f(4.2)h([Bash)f(Builtins],)f(page)i(39\).)55 | |
3870 | b(The)35 b(`)p Fs(-F)p Ft(')g(option)f(to)150 4641 y | |
3871 | Fs(declare)g Ft(or)i Fs(typeset)e Ft(will)f(list)i(the)h(function)f | |
3872 | (names)h(only)f(\(and)h(optionally)e(the)i(source)g(\014le)g(and)150 | |
3873 | 4751 y(line)31 b(n)m(um)m(b)s(er,)i(if)e(the)i Fs(extdebug)e | |
3874 | Ft(shell)g(option)h(is)g(enabled\).)48 b(F)-8 b(unctions)32 | |
3875 | b(ma)m(y)i(b)s(e)e(exp)s(orted)g(so)h(that)150 4861 y(subshells)d | |
3876 | (automatically)k(ha)m(v)m(e)g(them)g(de\014ned)e(with)g(the)h(`)p | |
3877 | Fs(-f)p Ft(')h(option)f(to)h(the)f Fs(export)f Ft(builtin)e(\(see)150 | |
3878 | 4970 y(Section)i(4.1)h([Bourne)f(Shell)e(Builtins],)h(page)i(33\).)47 | |
3879 | b(Note)33 b(that)g(shell)d(functions)h(and)g(v)-5 b(ariables)31 | |
3880 | b(with)150 5080 y(the)f(same)g(name)g(ma)m(y)g(result)f(in)g(m)m | |
3881 | (ultiple)e(iden)m(tically-named)h(en)m(tries)i(in)e(the)i(en)m | |
3882 | (vironmen)m(t)f(passed)150 5189 y(to)i(the)g(shell's)d(c)m(hildren.)39 | |
3883 | b(Care)30 b(should)f(b)s(e)g(tak)m(en)j(in)d(cases)i(where)f(this)f(ma) | |
3884 | m(y)i(cause)g(a)g(problem.)275 5340 y(F)-8 b(unctions)29 | |
3885 | b(ma)m(y)i(b)s(e)f(recursiv)m(e.)40 b(No)31 b(limit)d(is)i(placed)g(on) | |
3886 | g(the)g(n)m(um)m(b)s(er)g(of)g(recursiv)m(e)g(calls.)p | |
3887 | eop | |
3888 | %%Page: 15 21 | |
3889 | 15 20 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
3890 | b(Shell)d(F)-8 b(eatures)2246 b(15)150 299 y Fr(3.4)68 | |
3891 | b(Shell)45 b(P)l(arameters)275 544 y Ft(A)32 b Fq(parameter)40 | |
3892 | b Ft(is)31 b(an)i(en)m(tit)m(y)g(that)g(stores)g(v)-5 | |
3893 | b(alues.)47 b(It)33 b(can)g(b)s(e)e(a)i Fs(name)p Ft(,)g(a)g(n)m(um)m | |
3894 | (b)s(er,)f(or)g(one)h(of)g(the)150 654 y(sp)s(ecial)g(c)m(haracters)j | |
3895 | (listed)e(b)s(elo)m(w.)52 b(A)35 b Fq(v)-5 b(ariable)39 | |
3896 | b Ft(is)33 b(a)i(parameter)h(denoted)e(b)m(y)h(a)g Fs(name)p | |
3897 | Ft(.)52 b(A)35 b(v)-5 b(ariable)150 764 y(has)29 b(a)h | |
3898 | Fq(v)-5 b(alue)34 b Ft(and)28 b(zero)j(or)e(more)g Fq(attributes)p | |
3899 | Ft(.)40 b(A)m(ttributes)29 b(are)h(assigned)f(using)f(the)h | |
3900 | Fs(declare)e Ft(builtin)150 873 y(command)22 b(\(see)h(the)f | |
3901 | (description)e(of)i(the)g Fs(declare)f Ft(builtin)d(in)j(Section)h(4.2) | |
3902 | h([Bash)f(Builtins],)g(page)g(39\).)275 1009 y(A)28 b(parameter)h(is)f | |
3903 | (set)h(if)e(it)h(has)g(b)s(een)g(assigned)g(a)h(v)-5 | |
3904 | b(alue.)39 b(The)28 b(n)m(ull)f(string)g(is)h(a)h(v)-5 | |
3905 | b(alid)26 b(v)-5 b(alue.)40 b(Once)150 1119 y(a)31 b(v)-5 | |
3906 | b(ariable)29 b(is)g(set,)j(it)d(ma)m(y)i(b)s(e)f(unset)g(only)g(b)m(y)g | |
3907 | (using)f(the)h Fs(unset)f Ft(builtin)e(command.)275 1254 | |
3908 | y(A)j(v)-5 b(ariable)29 b(ma)m(y)i(b)s(e)f(assigned)f(to)j(b)m(y)e(a)h | |
3909 | (statemen)m(t)h(of)e(the)h(form)390 1390 y Fj(name)11 | |
3910 | b Fs(=[)p Fj(value)g Fs(])150 1526 y Ft(If)34 b Fq(v)-5 | |
3911 | b(alue)39 b Ft(is)34 b(not)h(giv)m(en,)g(the)g(v)-5 b(ariable)33 | |
3912 | b(is)h(assigned)g(the)g(n)m(ull)f(string.)52 b(All)33 | |
3913 | b Fq(v)-5 b(alue)5 b Ft(s)34 b(undergo)g(tilde)f(ex-)150 | |
3914 | 1636 y(pansion,)i(parameter)g(and)f(v)-5 b(ariable)34 | |
3915 | b(expansion,)g(command)h(substitution,)f(arithmetic)g(expansion,)150 | |
3916 | 1745 y(and)40 b(quote)h(remo)m(v)-5 b(al)41 b(\(detailed)g(b)s(elo)m | |
3917 | (w\).)71 b(If)40 b(the)h(v)-5 b(ariable)39 b(has)i(its)f | |
3918 | Fs(integer)f Ft(attribute)h(set,)k(then)150 1855 y Fq(v)-5 | |
3919 | b(alue)37 b Ft(is)32 b(ev)-5 b(aluated)33 b(as)g(an)g(arithmetic)f | |
3920 | (expression)g(ev)m(en)i(if)d(the)i Fs($\(\(...)o(\)\))f | |
3921 | Ft(expansion)g(is)g(not)h(used)150 1965 y(\(see)e(Section)f(3.5.5)j | |
3922 | ([Arithmetic)c(Expansion],)g(page)i(21\).)42 b(W)-8 b(ord)31 | |
3923 | b(splitting)d(is)i(not)g(p)s(erformed,)f(with)150 2074 | |
3924 | y(the)35 b(exception)g(of)g Fs("$@")f Ft(as)h(explained)e(b)s(elo)m(w.) | |
3925 | 53 b(Filename)34 b(expansion)g(is)g(not)h(p)s(erformed.)53 | |
3926 | b(Assign-)150 2184 y(men)m(t)33 b(statemen)m(ts)h(ma)m(y)f(also)f(app)s | |
3927 | (ear)g(as)g(argumen)m(ts)h(to)g(the)g Fs(alias)p Ft(,)e | |
3928 | Fs(declare)p Ft(,)g Fs(typeset)p Ft(,)g Fs(export)p Ft(,)150 | |
3929 | 2293 y Fs(readonly)p Ft(,)d(and)i Fs(local)f Ft(builtin)e(commands.)150 | |
3930 | 2520 y Fk(3.4.1)63 b(P)m(ositional)41 b(P)m(arameters)275 | |
3931 | 2766 y Ft(A)36 b Fq(p)s(ositional)f(parameter)44 b Ft(is)36 | |
3932 | b(a)h(parameter)g(denoted)g(b)m(y)g(one)g(or)g(more)g(digits,)g(other)g | |
3933 | (than)g(the)150 2875 y(single)i(digit)f Fs(0)p Ft(.)69 | |
3934 | b(P)m(ositional)39 b(parameters)i(are)f(assigned)f(from)h(the)g | |
3935 | (shell's)e(argumen)m(ts)i(when)f(it)h(is)150 2985 y(in)m(v)m(ok)m(ed,)f | |
3936 | (and)e(ma)m(y)g(b)s(e)g(reassigned)f(using)f(the)j Fs(set)e | |
3937 | Ft(builtin)d(command.)61 b(P)m(ositional)36 b(parameter)h | |
3938 | Fs(N)150 3094 y Ft(ma)m(y)27 b(b)s(e)g(referenced)f(as)h | |
3939 | Fs(${N})p Ft(,)g(or)g(as)g Fs($N)f Ft(when)g Fs(N)g Ft(consists)h(of)g | |
3940 | (a)g(single)e(digit.)39 b(P)m(ositional)26 b(parameters)150 | |
3941 | 3204 y(ma)m(y)32 b(not)f(b)s(e)g(assigned)g(to)h(with)e(assignmen)m(t)h | |
3942 | (statemen)m(ts.)45 b(The)30 b Fs(set)h Ft(and)g Fs(shift)e | |
3943 | Ft(builtins)f(are)k(used)150 3314 y(to)h(set)f(and)f(unset)h(them)g | |
3944 | (\(see)h(Chapter)e(4)h([Shell)e(Builtin)g(Commands],)h(page)i(33\).)47 | |
3945 | b(The)31 b(p)s(ositional)150 3423 y(parameters)24 b(are)g(temp)s | |
3946 | (orarily)e(replaced)i(when)e(a)j(shell)d(function)g(is)h(executed)i | |
3947 | (\(see)f(Section)g(3.3)h([Shell)150 3533 y(F)-8 b(unctions],)30 | |
3948 | b(page)i(13\).)275 3669 y(When)27 b(a)i(p)s(ositional)d(parameter)j | |
3949 | (consisting)d(of)j(more)f(than)g(a)g(single)f(digit)g(is)g(expanded,)h | |
3950 | (it)g(m)m(ust)150 3778 y(b)s(e)i(enclosed)g(in)f(braces.)150 | |
3951 | 4005 y Fk(3.4.2)63 b(Sp)s(ecial)41 b(P)m(arameters)275 | |
3952 | 4251 y Ft(The)27 b(shell)f(treats)j(sev)m(eral)f(parameters)h(sp)s | |
3953 | (ecially)-8 b(.)38 b(These)28 b(parameters)g(ma)m(y)g(only)f(b)s(e)h | |
3954 | (referenced;)150 4360 y(assignmen)m(t)i(to)h(them)g(is)e(not)i(allo)m | |
3955 | (w)m(ed.)150 4522 y Fs(*)432 b Ft(Expands)29 b(to)h(the)h(p)s | |
3956 | (ositional)c(parameters,)k(starting)f(from)f(one.)41 | |
3957 | b(When)30 b(the)g(expansion)630 4631 y(o)s(ccurs)e(within)d(double)i | |
3958 | (quotes,)i(it)f(expands)f(to)i(a)f(single)f(w)m(ord)h(with)f(the)h(v)-5 | |
3959 | b(alue)28 b(of)g(eac)m(h)630 4741 y(parameter)i(separated)g(b)m(y)f | |
3960 | (the)g(\014rst)g(c)m(haracter)i(of)e(the)h Fs(IFS)e Ft(sp)s(ecial)g(v) | |
3961 | -5 b(ariable.)39 b(That)30 b(is,)630 4850 y Fs("$*")h | |
3962 | Ft(is)h(equiv)-5 b(alen)m(t)31 b(to)j Fs("$1)p Fj(c)11 | |
3963 | b Fs($2)p Fj(c)g Fs(...)l(")p Ft(,)33 b(where)f Fq(c)38 | |
3964 | b Ft(is)31 b(the)i(\014rst)e(c)m(haracter)j(of)f(the)f(v)-5 | |
3965 | b(alue)630 4960 y(of)30 b(the)g Fs(IFS)g Ft(v)-5 b(ariable.)39 | |
3966 | b(If)30 b Fs(IFS)f Ft(is)g(unset,)h(the)g(parameters)g(are)h(separated) | |
3967 | f(b)m(y)g(spaces.)41 b(If)630 5070 y Fs(IFS)29 b Ft(is)h(n)m(ull,)e | |
3968 | (the)j(parameters)g(are)f(joined)g(without)f(in)m(terv)m(ening)h | |
3969 | (separators.)150 5230 y Fs(@)432 b Ft(Expands)39 b(to)i(the)g(p)s | |
3970 | (ositional)d(parameters,)44 b(starting)c(from)g(one.)71 | |
3971 | b(When)40 b(the)h(expan-)630 5340 y(sion)30 b(o)s(ccurs)h(within)d | |
3972 | (double)i(quotes,)i(eac)m(h)g(parameter)g(expands)e(to)i(a)f(separate)h | |
3973 | (w)m(ord.)p eop | |
3974 | %%Page: 16 22 | |
3975 | 16 21 bop 150 -116 a Ft(16)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
3976 | 299 y(That)38 b(is,)i Fs("$@")d Ft(is)h(equiv)-5 b(alen)m(t)38 | |
3977 | b(to)h Fs("$1")29 b("$2")g(...)o Ft(.)65 b(When)38 b(there)h(are)g(no)f | |
3978 | (p)s(ositional)630 408 y(parameters,)31 b Fs("$@")e Ft(and)h | |
3979 | Fs($@)g Ft(expand)f(to)i(nothing)f(\(i.e.,)h(they)f(are)h(remo)m(v)m | |
3980 | (ed\).)150 568 y Fs(#)432 b Ft(Expands)29 b(to)i(the)g(n)m(um)m(b)s(er) | |
3981 | e(of)h(p)s(ositional)e(parameters)j(in)e(decimal.)150 | |
3982 | 727 y Fs(?)432 b Ft(Expands)29 b(to)i(the)g(exit)f(status)h(of)f(the)h | |
3983 | (most)f(recen)m(tly)h(executed)g(foreground)f(pip)s(eline.)150 | |
3984 | 886 y Fs(-)432 b Ft(\(A)31 b(h)m(yphen.\))42 b(Expands)30 | |
3985 | b(to)h(the)g(curren)m(t)g(option)g(\015ags)g(as)g(sp)s(eci\014ed)e(up)s | |
3986 | (on)h(in)m(v)m(o)s(cation,)630 996 y(b)m(y)35 b(the)h | |
3987 | Fs(set)e Ft(builtin)e(command,)k(or)g(those)g(set)f(b)m(y)h(the)f | |
3988 | (shell)f(itself)g(\(suc)m(h)h(as)h(the)f(`)p Fs(-i)p | |
3989 | Ft(')630 1105 y(option\).)150 1264 y Fs($)432 b Ft(Expands)39 | |
3990 | b(to)j(the)f(pro)s(cess)f Fl(id)h Ft(of)g(the)g(shell.)71 | |
3991 | b(In)40 b(a)h Fs(\(\))f Ft(subshell,)h(it)f(expands)g(to)i(the)630 | |
3992 | 1374 y(pro)s(cess)30 b Fl(id)g Ft(of)h(the)g(in)m(v)m(oking)e(shell,)g | |
3993 | (not)i(the)f(subshell.)150 1533 y Fs(!)432 b Ft(Expands)39 | |
3994 | b(to)i(the)g(pro)s(cess)e Fl(id)i Ft(of)f(the)h(most)g(recen)m(tly)f | |
3995 | (executed)h(bac)m(kground)g(\(asyn-)630 1643 y(c)m(hronous\))30 | |
3996 | b(command.)150 1802 y Fs(0)432 b Ft(Expands)20 b(to)j(the)f(name)g(of)g | |
3997 | (the)g(shell)e(or)h(shell)f(script.)37 b(This)20 b(is)h(set)h(at)h | |
3998 | (shell)d(initialization.)630 1911 y(If)44 b(Bash)g(is)f(in)m(v)m(ok)m | |
3999 | (ed)i(with)e(a)h(\014le)f(of)i(commands)e(\(see)j(Section)e(3.8)h | |
4000 | ([Shell)d(Scripts],)630 2021 y(page)d(31\),)i Fs($0)d | |
4001 | Ft(is)f(set)h(to)h(the)f(name)g(of)g(that)h(\014le.)63 | |
4002 | b(If)37 b(Bash)i(is)e(started)h(with)f(the)h(`)p Fs(-c)p | |
4003 | Ft(')630 2131 y(option)h(\(see)h(Section)g(6.1)g([In)m(v)m(oking)g | |
4004 | (Bash],)i(page)e(63\),)j(then)d Fs($0)e Ft(is)h(set)h(to)g(the)g | |
4005 | (\014rst)630 2240 y(argumen)m(t)31 b(after)g(the)g(string)f(to)h(b)s(e) | |
4006 | f(executed,)i(if)e(one)h(is)e(presen)m(t.)42 b(Otherwise,)30 | |
4007 | b(it)g(is)f(set)630 2350 y(to)i(the)g(\014lename)e(used)h(to)h(in)m(v)m | |
4008 | (ok)m(e)g(Bash,)g(as)g(giv)m(en)f(b)m(y)g(argumen)m(t)h(zero.)150 | |
4009 | 2509 y Fs(_)432 b Ft(\(An)34 b(underscore.\))50 b(A)m(t)34 | |
4010 | b(shell)e(startup,)j(set)f(to)g(the)g(absolute)f(\014lename)g(of)h(the) | |
4011 | g(shell)e(or)630 2619 y(shell)j(script)i(b)s(eing)e(executed)j(as)g | |
4012 | (passed)f(in)f(the)h(argumen)m(t)h(list.)60 b(Subsequen)m(tly)-8 | |
4013 | b(,)37 b(ex-)630 2728 y(pands)f(to)i(the)g(last)f(argumen)m(t)h(to)h | |
4014 | (the)e(previous)f(command,)j(after)f(expansion.)61 b(Also)630 | |
4015 | 2838 y(set)30 b(to)f(the)h(full)c(pathname)j(of)h(eac)m(h)g(command)f | |
4016 | (executed)h(and)e(placed)h(in)e(the)j(en)m(viron-)630 | |
4017 | 2947 y(men)m(t)37 b(exp)s(orted)f(to)h(that)h(command.)58 | |
4018 | b(When)37 b(c)m(hec)m(king)g(mail,)g(this)e(parameter)i(holds)630 | |
4019 | 3057 y(the)31 b(name)f(of)h(the)f(mail)f(\014le.)150 | |
4020 | 3314 y Fr(3.5)68 b(Shell)45 b(Expansions)275 3558 y Ft(Expansion)28 | |
4021 | b(is)h(p)s(erformed)f(on)i(the)g(command)g(line)e(after)j(it)e(has)h(b) | |
4022 | s(een)f(split)f(in)m(to)i Fs(token)p Ft(s.)39 b(There)150 | |
4023 | 3667 y(are)31 b(sev)m(en)g(kinds)d(of)j(expansion)e(p)s(erformed:)225 | |
4024 | 3802 y Fp(\017)60 b Ft(brace)31 b(expansion)225 3936 | |
4025 | y Fp(\017)60 b Ft(tilde)29 b(expansion)225 4071 y Fp(\017)60 | |
4026 | b Ft(parameter)31 b(and)f(v)-5 b(ariable)29 b(expansion)225 | |
4027 | 4205 y Fp(\017)60 b Ft(command)30 b(substitution)225 | |
4028 | 4339 y Fp(\017)60 b Ft(arithmetic)30 b(expansion)225 | |
4029 | 4474 y Fp(\017)60 b Ft(w)m(ord)30 b(splitting)225 4608 | |
4030 | y Fp(\017)60 b Ft(\014lename)30 b(expansion)275 4767 | |
4031 | y(The)j(order)g(of)h(expansions)f(is:)46 b(brace)34 b(expansion,)g | |
4032 | (tilde)f(expansion,)g(parameter,)j(v)-5 b(ariable,)34 | |
4033 | b(and)150 4877 y(arithmetic)44 b(expansion)g(and)h(command)f | |
4034 | (substitution)f(\(done)i(in)f(a)h(left-to-righ)m(t)h(fashion\),)i(w)m | |
4035 | (ord)150 4986 y(splitting,)28 b(and)i(\014lename)g(expansion.)275 | |
4036 | 5121 y(On)42 b(systems)h(that)h(can)g(supp)s(ort)e(it,)k(there)e(is)e | |
4037 | (an)i(additional)d(expansion)h(a)m(v)-5 b(ailable:)66 | |
4038 | b Fq(pro)s(cess)150 5230 y(substitution)p Ft(.)59 b(This)35 | |
4039 | b(is)h(p)s(erformed)g(at)i(the)f(same)h(time)e(as)i(parameter,)h(v)-5 | |
4040 | b(ariable,)38 b(and)f(arithmetic)150 5340 y(expansion)29 | |
4041 | b(and)h(command)g(substitution.)p eop | |
4042 | %%Page: 17 23 | |
4043 | 17 22 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4044 | b(Shell)d(F)-8 b(eatures)2246 b(17)275 299 y(Only)34 | |
4045 | b(brace)j(expansion,)g(w)m(ord)f(splitting,)g(and)g(\014lename)f | |
4046 | (expansion)g(can)i(c)m(hange)h(the)e(n)m(um)m(b)s(er)150 | |
4047 | 408 y(of)h(w)m(ords)f(of)g(the)h(expansion;)h(other)f(expansions)e | |
4048 | (expand)h(a)h(single)e(w)m(ord)h(to)h(a)g(single)e(w)m(ord.)58 | |
4049 | b(The)150 518 y(only)31 b(exceptions)i(to)g(this)e(are)i(the)f | |
4050 | (expansions)f(of)i Fs("$@")e Ft(\(see)i(Section)f(3.4.2)i([Sp)s(ecial)d | |
4051 | (P)m(arameters],)150 628 y(page)g(15\))h(and)d Fs("${)p | |
4052 | Fj(name)11 b Fs([@]}")27 b Ft(\(see)k(Section)g(6.7)g([Arra)m(ys],)g | |
4053 | (page)g(72\).)275 787 y(After)41 b(all)g(expansions,)i | |
4054 | Fs(quote)29 b(removal)40 b Ft(\(see)i(Section)g(3.5.9)h([Quote)f(Remo)m | |
4055 | (v)-5 b(al],)46 b(page)c(24\))h(is)150 897 y(p)s(erformed.)150 | |
4056 | 1172 y Fk(3.5.1)63 b(Brace)40 b(Expansion)275 1441 y | |
4057 | Ft(Brace)21 b(expansion)f(is)g(a)h(mec)m(hanism)f(b)m(y)h(whic)m(h)e | |
4058 | (arbitrary)h(strings)f(ma)m(y)j(b)s(e)e(generated.)38 | |
4059 | b(This)19 b(mec)m(h-)150 1551 y(anism)34 b(is)h(similar)d(to)k | |
4060 | Fq(\014lename)f(expansion)f Ft(\(see)j(Section)e(3.5.8)i([Filename)e | |
4061 | (Expansion],)g(page)h(22\),)150 1660 y(but)31 b(the)h(\014le)f(names)g | |
4062 | (generated)i(need)f(not)g(exist.)44 b(P)m(atterns)33 | |
4063 | b(to)f(b)s(e)f(brace)h(expanded)f(tak)m(e)i(the)f(form)150 | |
4064 | 1770 y(of)26 b(an)f(optional)f Fq(pream)m(ble)p Ft(,)i(follo)m(w)m(ed)f | |
4065 | (b)m(y)h(either)f(a)g(series)g(of)h(comma-separated)h(strings)d(or)h(a) | |
4066 | h(sequnce)150 1879 y(expression)35 b(b)s(et)m(w)m(een)h(a)h(pair)d(of)j | |
4067 | (braces,)g(follo)m(w)m(ed)f(b)m(y)g(an)g(optional)f Fq(p)s(ostscript)p | |
4068 | Ft(.)56 b(The)36 b(pream)m(ble)f(is)150 1989 y(pre\014xed)28 | |
4069 | b(to)h(eac)m(h)h(string)e(con)m(tained)h(within)d(the)j(braces,)g(and)g | |
4070 | (the)g(p)s(ostscript)e(is)h(then)g(app)s(ended)f(to)150 | |
4071 | 2099 y(eac)m(h)32 b(resulting)c(string,)i(expanding)e(left)j(to)g(righ) | |
4072 | m(t.)275 2258 y(Brace)37 b(expansions)e(ma)m(y)i(b)s(e)f(nested.)59 | |
4073 | b(The)36 b(results)f(of)i(eac)m(h)g(expanded)f(string)f(are)i(not)g | |
4074 | (sorted;)150 2368 y(left)30 b(to)h(righ)m(t)f(order)g(is)f(preserv)m | |
4075 | (ed.)41 b(F)-8 b(or)31 b(example,)390 2528 y Fs(bash$)46 | |
4076 | b(echo)h(a{d,c,b}e)390 2637 y(ade)g(ace)g(abe)275 2797 | |
4077 | y Ft(A)24 b(sequence)h(expression)f(tak)m(es)i(the)f(form)f | |
4078 | Fs({)p Fj(x)p Fs(..)p Fj(y)11 b Fs(})p Ft(,)23 b(where)i | |
4079 | Fq(x)30 b Ft(and)24 b Fq(y)33 b Ft(are)25 b(either)f(in)m(tegers)h(or)f | |
4080 | (single)150 2907 y(c)m(haracters.)43 b(When)30 b(in)m(tegers)h(are)g | |
4081 | (supplied,)c(the)k(expression)e(expands)h(to)h(eac)m(h)h(n)m(um)m(b)s | |
4082 | (er)d(b)s(et)m(w)m(een)i Fq(x)150 3016 y Ft(and)i Fq(y)p | |
4083 | Ft(,)i(inclusiv)m(e.)50 b(When)34 b(c)m(haracters)h(are)f(supplied,)e | |
4084 | (the)j(expression)d(expands)h(to)i(eac)m(h)g(c)m(haracter)150 | |
4085 | 3126 y(lexicographically)28 b(b)s(et)m(w)m(een)j Fq(x)37 | |
4086 | b Ft(and)30 b Fq(y)p Ft(,)h(inclusiv)m(e.)39 b(Note)31 | |
4087 | b(that)g(b)s(oth)f Fq(x)37 b Ft(and)30 b Fq(y)38 b Ft(m)m(ust)30 | |
4088 | b(b)s(e)g(of)h(the)g(same)150 3235 y(t)m(yp)s(e.)275 | |
4089 | 3395 y(Brace)36 b(expansion)f(is)f(p)s(erformed)g(b)s(efore)h(an)m(y)h | |
4090 | (other)g(expansions,)g(and)f(an)m(y)g(c)m(haracters)i(sp)s(ecial)150 | |
4091 | 3505 y(to)32 b(other)g(expansions)f(are)h(preserv)m(ed)f(in)g(the)g | |
4092 | (result.)44 b(It)32 b(is)f(strictly)f(textual.)45 b(Bash)32 | |
4093 | b(do)s(es)f(not)h(apply)150 3614 y(an)m(y)27 b(syn)m(tactic)h(in)m | |
4094 | (terpretation)f(to)h(the)f(con)m(text)i(of)e(the)g(expansion)f(or)h | |
4095 | (the)h(text)g(b)s(et)m(w)m(een)f(the)h(braces.)150 3724 | |
4096 | y(T)-8 b(o)37 b(a)m(v)m(oid)f(con\015icts)g(with)f(parameter)i | |
4097 | (expansion,)f(the)h(string)e(`)p Fs(${)p Ft(')h(is)f(not)h(considered)f | |
4098 | (eligible)f(for)150 3833 y(brace)d(expansion.)275 3993 | |
4099 | y(A)e(correctly-formed)h(brace)g(expansion)e(m)m(ust)i(con)m(tain)g | |
4100 | (unquoted)f(op)s(ening)f(and)h(closing)g(braces,)150 | |
4101 | 4103 y(and)j(at)i(least)f(one)g(unquoted)g(comma)g(or)g(a)h(v)-5 | |
4102 | b(alid)31 b(sequence)i(expression.)47 b(An)m(y)33 b(incorrectly)f | |
4103 | (formed)150 4212 y(brace)f(expansion)e(is)g(left)h(unc)m(hanged.)275 | |
4104 | 4372 y(A)25 b Fs({)g Ft(or)g(`)p Fs(,)p Ft(')g(ma)m(y)h(b)s(e)f(quoted) | |
4105 | g(with)f(a)i(bac)m(kslash)e(to)i(prev)m(en)m(t)g(its)f(b)s(eing)f | |
4106 | (considered)g(part)h(of)g(a)h(brace)150 4482 y(expression.)50 | |
4107 | b(T)-8 b(o)34 b(a)m(v)m(oid)h(con\015icts)e(with)g(parameter)h | |
4108 | (expansion,)g(the)g(string)f(`)p Fs(${)p Ft(')h(is)f(not)h(considered) | |
4109 | 150 4591 y(eligible)28 b(for)i(brace)h(expansion.)275 | |
4110 | 4751 y(This)e(construct)i(is)f(t)m(ypically)g(used)g(as)h(shorthand)f | |
4111 | (when)g(the)h(common)g(pre\014x)f(of)h(the)g(strings)f(to)150 | |
4112 | 4861 y(b)s(e)g(generated)h(is)f(longer)g(than)g(in)f(the)h(ab)s(o)m(v)m | |
4113 | (e)i(example:)390 5020 y Fs(mkdir)46 b(/usr/local/src/bash/{old,n)o | |
4114 | (ew,)o(dist)o(,bug)o(s})275 5180 y Ft(or)390 5340 y Fs(chown)g(root)h | |
4115 | (/usr/{ucb/{ex,edit},lib/)o({ex?)o(.?*,)o(how)o(_ex})o(})p | |
4116 | eop | |
4117 | %%Page: 18 24 | |
4118 | 18 23 bop 150 -116 a Ft(18)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
4119 | 299 y Fk(3.5.2)63 b(Tilde)41 b(Expansion)275 541 y Ft(If)i(a)i(w)m(ord) | |
4120 | e(b)s(egins)g(with)f(an)i(unquoted)f(tilde)g(c)m(haracter)j(\(`)p | |
4121 | Fs(~)p Ft('\),)i(all)43 b(of)i(the)f(c)m(haracters)h(up)e(to)150 | |
4122 | 651 y(the)35 b(\014rst)f(unquoted)f(slash)h(\(or)h(all)e(c)m | |
4123 | (haracters,)k(if)d(there)h(is)e(no)i(unquoted)e(slash\))h(are)h | |
4124 | (considered)f(a)150 760 y Fq(tilde-pre\014x)p Ft(.)53 | |
4125 | b(If)35 b(none)g(of)g(the)g(c)m(haracters)i(in)c(the)j(tilde-pre\014x)d | |
4126 | (are)i(quoted,)i(the)e(c)m(haracters)i(in)d(the)150 870 | |
4127 | y(tilde-pre\014x)25 b(follo)m(wing)g(the)i(tilde)f(are)h(treated)h(as)f | |
4128 | (a)g(p)s(ossible)d Fq(login)i(name)p Ft(.)39 b(If)27 | |
4129 | b(this)e(login)h(name)h(is)f(the)150 979 y(n)m(ull)j(string,)i(the)g | |
4130 | (tilde)f(is)h(replaced)g(with)f(the)h(v)-5 b(alue)31 | |
4131 | b(of)g(the)h Fs(HOME)e Ft(shell)f(v)-5 b(ariable.)43 | |
4132 | b(If)31 b Fs(HOME)f Ft(is)g(unset,)150 1089 y(the)37 | |
4133 | b(home)f(directory)g(of)h(the)f(user)g(executing)h(the)g(shell)d(is)i | |
4134 | (substituted)f(instead.)58 b(Otherwise,)37 b(the)150 | |
4135 | 1198 y(tilde-pre\014x)28 b(is)i(replaced)g(with)f(the)h(home)h | |
4136 | (directory)f(asso)s(ciated)g(with)f(the)i(sp)s(eci\014ed)e(login)g | |
4137 | (name.)275 1331 y(If)j(the)h(tilde-pre\014x)d(is)i(`)p | |
4138 | Fs(~+)p Ft(',)h(the)g(v)-5 b(alue)32 b(of)h(the)g(shell)e(v)-5 | |
4139 | b(ariable)32 b Fs(PWD)f Ft(replaces)i(the)g(tilde-pre\014x.)45 | |
4140 | b(If)150 1441 y(the)31 b(tilde-pre\014x)d(is)h(`)p Fs(~-)p | |
4141 | Ft(',)i(the)f(v)-5 b(alue)30 b(of)h(the)f(shell)f(v)-5 | |
4142 | b(ariable)29 b Fs(OLDPWD)p Ft(,)g(if)g(it)h(is)g(set,)h(is)e | |
4143 | (substituted.)275 1573 y(If)g(the)h(c)m(haracters)h(follo)m(wing)e(the) | |
4144 | h(tilde)e(in)h(the)h(tilde-pre\014x)e(consist)h(of)h(a)h(n)m(um)m(b)s | |
4145 | (er)d Fq(N)p Ft(,)j(optionally)150 1683 y(pre\014xed)22 | |
4146 | b(b)m(y)h(a)h(`)p Fs(+)p Ft(')f(or)h(a)f(`)p Fs(-)p Ft(',)j(the)d | |
4147 | (tilde-pre\014x)e(is)i(replaced)f(with)g(the)i(corresp)s(onding)d | |
4148 | (elemen)m(t)j(from)f(the)150 1792 y(directory)35 b(stac)m(k,)j(as)e(it) | |
4149 | f(w)m(ould)f(b)s(e)h(displa)m(y)m(ed)f(b)m(y)i(the)f | |
4150 | Fs(dirs)g Ft(builtin)d(in)m(v)m(ok)m(ed)k(with)e(the)h(c)m(haracters) | |
4151 | 150 1902 y(follo)m(wing)i(tilde)g(in)h(the)g(tilde-pre\014x)f(as)i(an)f | |
4152 | (argumen)m(t)h(\(see)h(Section)e(6.8)i([The)e(Directory)h(Stac)m(k],) | |
4153 | 150 2011 y(page)d(73\).)57 b(If)35 b(the)g(tilde-pre\014x,)g(sans)g | |
4154 | (the)h(tilde,)f(consists)g(of)h(a)f(n)m(um)m(b)s(er)f(without)h(a)g | |
4155 | (leading)f(`)p Fs(+)p Ft(')i(or)150 2121 y(`)p Fs(-)p | |
4156 | Ft(',)31 b(`)p Fs(+)p Ft(')f(is)g(assumed.)275 2253 y(If)f(the)i(login) | |
4157 | e(name)i(is)e(in)m(v)-5 b(alid,)28 b(or)j(the)f(tilde)f(expansion)g | |
4158 | (fails,)h(the)g(w)m(ord)g(is)g(left)g(unc)m(hanged.)275 | |
4159 | 2386 y(Eac)m(h)f(v)-5 b(ariable)29 b(assignmen)m(t)g(is)f(c)m(hec)m(k)m | |
4160 | (ed)j(for)e(unquoted)g(tilde-pre\014xes)e(immediately)h(follo)m(wing)g | |
4161 | (a)150 2495 y(`)p Fs(:)p Ft(')j(or)f(`)p Fs(=)p Ft('.)42 | |
4162 | b(In)30 b(these)h(cases,)h(tilde)d(expansion)h(is)f(also)i(p)s | |
4163 | (erformed.)40 b(Consequen)m(tly)-8 b(,)30 b(one)h(ma)m(y)h(use)e | |
4164 | (\014le)150 2605 y(names)f(with)e(tildes)g(in)g(assignmen)m(ts)i(to)g | |
4165 | Fs(PATH)p Ft(,)f Fs(MAILPATH)p Ft(,)f(and)h Fs(CDPATH)p | |
4166 | Ft(,)f(and)h(the)h(shell)e(assigns)h(the)150 2715 y(expanded)i(v)-5 | |
4167 | b(alue.)275 2847 y(The)29 b(follo)m(wing)g(table)i(sho)m(ws)f(ho)m(w)g | |
4168 | (Bash)h(treats)g(unquoted)e(tilde-pre\014xes:)150 3002 | |
4169 | y Fs(~)432 b Ft(The)30 b(v)-5 b(alue)30 b(of)g Fs($HOME)150 | |
4170 | 3158 y(~/foo)240 b Ft(`)p Fs($HOME/foo)p Ft(')150 3313 | |
4171 | y Fs(~fred/foo)630 3423 y Ft(The)30 b(sub)s(directory)e | |
4172 | Fs(foo)i Ft(of)g(the)h(home)f(directory)g(of)h(the)f(user)g | |
4173 | Fs(fred)150 3578 y(~+/foo)192 b Ft(`)p Fs($PWD/foo)p | |
4174 | Ft(')150 3733 y Fs(~-/foo)g Ft(`)p Fs(${OLDPWD-'~-'}/foo)p | |
4175 | Ft(')150 3889 y Fs(~)p Fj(N)384 b Ft(The)30 b(string)f(that)i(w)m(ould) | |
4176 | e(b)s(e)h(displa)m(y)m(ed)f(b)m(y)h(`)p Fs(dirs)g(+)p | |
4177 | Fj(N)11 b Ft(')150 4044 y Fs(~+)p Fj(N)336 b Ft(The)30 | |
4178 | b(string)f(that)i(w)m(ould)e(b)s(e)h(displa)m(y)m(ed)f(b)m(y)h(`)p | |
4179 | Fs(dirs)g(+)p Fj(N)11 b Ft(')150 4199 y Fs(~-)p Fj(N)336 | |
4180 | b Ft(The)30 b(string)f(that)i(w)m(ould)e(b)s(e)h(displa)m(y)m(ed)f(b)m | |
4181 | (y)h(`)p Fs(dirs)g(-)p Fj(N)11 b Ft(')150 4418 y Fk(3.5.3)63 | |
4182 | b(Shell)41 b(P)m(arameter)e(Expansion)275 4660 y Ft(The)26 | |
4183 | b(`)p Fs($)p Ft(')i(c)m(haracter)h(in)m(tro)s(duces)d(parameter)i | |
4184 | (expansion,)f(command)g(substitution,)f(or)i(arithmetic)150 | |
4185 | 4769 y(expansion.)37 b(The)22 b(parameter)h(name)f(or)g(sym)m(b)s(ol)g | |
4186 | (to)h(b)s(e)e(expanded)h(ma)m(y)h(b)s(e)f(enclosed)g(in)f(braces,)j | |
4187 | (whic)m(h)150 4879 y(are)31 b(optional)e(but)h(serv)m(e)h(to)h(protect) | |
4188 | f(the)g(v)-5 b(ariable)29 b(to)i(b)s(e)f(expanded)g(from)g(c)m | |
4189 | (haracters)i(immediately)150 4988 y(follo)m(wing)d(it)h(whic)m(h)f | |
4190 | (could)g(b)s(e)h(in)m(terpreted)g(as)g(part)h(of)f(the)h(name.)275 | |
4191 | 5121 y(When)44 b(braces)i(are)f(used,)j(the)e(matc)m(hing)f(ending)f | |
4192 | (brace)h(is)f(the)h(\014rst)g(`)p Fs(})p Ft(')g(not)g(escap)s(ed)h(b)m | |
4193 | (y)f(a)150 5230 y(bac)m(kslash)39 b(or)g(within)e(a)i(quoted)g(string,) | |
4194 | i(and)d(not)i(within)c(an)j(em)m(b)s(edded)f(arithmetic)h(expansion,) | |
4195 | 150 5340 y(command)30 b(substitution,)e(or)j(parameter)g(expansion.)p | |
4196 | eop | |
4197 | %%Page: 19 25 | |
4198 | 19 24 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4199 | b(Shell)d(F)-8 b(eatures)2246 b(19)275 299 y(The)40 b(basic)g(form)h | |
4200 | (of)g(parameter)h(expansion)d(is)h($)p Fs({)p Fq(parameter)7 | |
4201 | b Fs(})p Ft(.)73 b(The)40 b(v)-5 b(alue)41 b(of)g Fq(parameter)48 | |
4202 | b Ft(is)150 408 y(substituted.)42 b(The)31 b(braces)g(are)h(required)d | |
4203 | (when)i Fq(parameter)38 b Ft(is)30 b(a)i(p)s(ositional)d(parameter)j | |
4204 | (with)e(more)150 518 y(than)i(one)g(digit,)g(or)g(when)g | |
4205 | Fq(parameter)39 b Ft(is)31 b(follo)m(w)m(ed)h(b)m(y)g(a)h(c)m(haracter) | |
4206 | h(that)e(is)g(not)g(to)h(b)s(e)f(in)m(terpreted)150 628 | |
4207 | y(as)f(part)f(of)g(its)g(name.)275 772 y(If)c(the)i(\014rst)f(c)m | |
4208 | (haracter)i(of)e Fq(parameter)35 b Ft(is)26 b(an)h(exclamation)h(p)s | |
4209 | (oin)m(t,)f(a)h(lev)m(el)f(of)g(v)-5 b(ariable)27 b(indirection)150 | |
4210 | 882 y(is)37 b(in)m(tro)s(duced.)61 b(Bash)38 b(uses)f(the)h(v)-5 | |
4211 | b(alue)37 b(of)h(the)g(v)-5 b(ariable)37 b(formed)g(from)g(the)h(rest)g | |
4212 | (of)g Fq(parameter)45 b Ft(as)150 991 y(the)32 b(name)h(of)f(the)h(v)-5 | |
4213 | b(ariable;)32 b(this)f(v)-5 b(ariable)31 b(is)h(then)g(expanded)f(and)h | |
4214 | (that)h(v)-5 b(alue)31 b(is)h(used)f(in)g(the)i(rest)150 | |
4215 | 1101 y(of)h(the)f(substitution,)g(rather)g(than)g(the)h(v)-5 | |
4216 | b(alue)33 b(of)h Fq(parameter)40 b Ft(itself.)49 b(This)32 | |
4217 | b(is)g(kno)m(wn)h(as)h Fs(indirect)150 1210 y(expansion)p | |
4218 | Ft(.)81 b(The)44 b(exceptions)g(to)i(this)d(are)i(the)g(expansions)e | |
4219 | (of)i($)p Fs({)p Ft(!)p Fq(pre\014x*)8 b Fs(})43 b Ft(and)h($)p | |
4220 | Fs({)p Ft(!)p Fq(name)5 b Ft([)p Fs(@)p Ft(])p Fs(})150 | |
4221 | 1320 y Ft(describ)s(ed)27 b(b)s(elo)m(w.)40 b(The)28 | |
4222 | b(exclamation)h(p)s(oin)m(t)g(m)m(ust)g(immediately)e(follo)m(w)h(the)i | |
4223 | (left)e(brace)i(in)e(order)g(to)150 1430 y(in)m(tro)s(duce)h | |
4224 | (indirection.)275 1574 y(In)39 b(eac)m(h)i(of)g(the)f(cases)h(b)s(elo)m | |
4225 | (w,)h Fq(w)m(ord)i Ft(is)39 b(sub)5 b(ject)40 b(to)h(tilde)d | |
4226 | (expansion,)k(parameter)f(expansion,)150 1684 y(command)30 | |
4227 | b(substitution,)e(and)i(arithmetic)g(expansion.)275 1828 | |
4228 | y(When)j(not)g(p)s(erforming)e(substring)g(expansion,)j(Bash)f(tests)h | |
4229 | (for)f(a)h(parameter)g(that)g(is)e(unset)h(or)150 1938 | |
4230 | y(n)m(ull;)j(omitting)e(the)h(colon)g(results)f(in)g(a)i(test)g(only)e | |
4231 | (for)h(a)g(parameter)h(that)f(is)g(unset.)54 b(Put)35 | |
4232 | b(another)150 2047 y(w)m(a)m(y)-8 b(,)31 b(if)d(the)h(colon)g(is)f | |
4233 | (included,)e(the)j(op)s(erator)h(tests)f(for)g(b)s(oth)f(existence)h | |
4234 | (and)g(that)g(the)g(v)-5 b(alue)29 b(is)f(not)150 2157 | |
4235 | y(n)m(ull;)h(if)g(the)h(colon)h(is)e(omitted,)i(the)f(op)s(erator)h | |
4236 | (tests)g(only)f(for)g(existence.)150 2331 y Fs(${)p Fj(parameter)11 | |
4237 | b Fs(:)p Fp(\000)p Fj(word)g Fs(})630 2441 y Ft(If)30 | |
4238 | b Fq(parameter)37 b Ft(is)29 b(unset)h(or)h(n)m(ull,)d(the)j(expansion) | |
4239 | e(of)h Fq(w)m(ord)k Ft(is)29 b(substituted.)39 b(Otherwise,)630 | |
4240 | 2550 y(the)31 b(v)-5 b(alue)29 b(of)i Fq(parameter)37 | |
4241 | b Ft(is)30 b(substituted.)150 2720 y Fs(${)p Fj(parameter)11 | |
4242 | b Fs(:=)p Fj(word)g Fs(})630 2829 y Ft(If)33 b Fq(parameter)40 | |
4243 | b Ft(is)32 b(unset)g(or)h(n)m(ull,)f(the)h(expansion)f(of)h | |
4244 | Fq(w)m(ord)j Ft(is)c(assigned)g(to)i Fq(parameter)p Ft(.)630 | |
4245 | 2939 y(The)c(v)-5 b(alue)31 b(of)g Fq(parameter)38 b | |
4246 | Ft(is)30 b(then)h(substituted.)41 b(P)m(ositional)30 | |
4247 | b(parameters)h(and)f(sp)s(ecial)630 3049 y(parameters)h(ma)m(y)g(not)f | |
4248 | (b)s(e)g(assigned)g(to)h(in)e(this)g(w)m(a)m(y)-8 b(.)150 | |
4249 | 3218 y Fs(${)p Fj(parameter)11 b Fs(:?)p Fj(word)g Fs(})630 | |
4250 | 3328 y Ft(If)26 b Fq(parameter)33 b Ft(is)25 b(n)m(ull)f(or)i(unset,)h | |
4251 | (the)f(expansion)f(of)h Fq(w)m(ord)k Ft(\(or)c(a)h(message)g(to)g(that) | |
4252 | f(e\013ect)630 3437 y(if)h Fq(w)m(ord)k Ft(is)c(not)h(presen)m(t\))h | |
4253 | (is)e(written)g(to)i(the)f(standard)f(error)h(and)f(the)h(shell,)f(if)g | |
4254 | (it)h(is)f(not)630 3547 y(in)m(teractiv)m(e,)k(exits.)41 | |
4255 | b(Otherwise,)29 b(the)i(v)-5 b(alue)30 b(of)g Fq(parameter)38 | |
4256 | b Ft(is)29 b(substituted.)150 3716 y Fs(${)p Fj(parameter)11 | |
4257 | b Fs(:+)p Fj(word)g Fs(})630 3826 y Ft(If)35 b Fq(parameter)42 | |
4258 | b Ft(is)35 b(n)m(ull)e(or)j(unset,)g(nothing)f(is)f(substituted,)i | |
4259 | (otherwise)e(the)i(expansion)630 3935 y(of)31 b Fq(w)m(ord)i | |
4260 | Ft(is)d(substituted.)150 4105 y Fs(${)p Fj(parameter)11 | |
4261 | b Fs(:)p Fj(offset)g Fs(})150 4214 y(${)p Fj(parameter)g | |
4262 | Fs(:)p Fj(offset)g Fs(:)p Fj(le)o(ngt)o(h)g Fs(})630 | |
4263 | 4324 y Ft(Expands)44 b(to)i(up)e(to)i Fq(length)f Ft(c)m(haracters)i | |
4264 | (of)e Fq(parameter)53 b Ft(starting)45 b(at)h(the)f(c)m(haracter)630 | |
4265 | 4433 y(sp)s(eci\014ed)29 b(b)m(y)i Fq(o\013set)p Ft(.)42 | |
4266 | b(If)31 b Fq(length)f Ft(is)g(omitted,)h(expands)f(to)h(the)g | |
4267 | (substring)e(of)h Fq(parameter)630 4543 y Ft(starting)37 | |
4268 | b(at)h(the)f(c)m(haracter)i(sp)s(eci\014ed)d(b)m(y)h | |
4269 | Fq(o\013set)p Ft(.)62 b Fq(length)37 b Ft(and)g Fq(o\013set)j | |
4270 | Ft(are)e(arithmetic)630 4653 y(expressions)29 b(\(see)j(Section)f(6.5)h | |
4271 | ([Shell)d(Arithmetic],)h(page)i(70\).)43 b(This)29 b(is)h(referred)g | |
4272 | (to)i(as)630 4762 y(Substring)c(Expansion.)630 4902 y | |
4273 | Fq(length)f Ft(m)m(ust)h(ev)-5 b(aluate)28 b(to)g(a)h(n)m(um)m(b)s(er)d | |
4274 | (greater)j(than)e(or)h(equal)f(to)i(zero.)40 b(If)27 | |
4275 | b Fq(o\013set)k Ft(ev)-5 b(alu-)630 5011 y(ates)24 b(to)h(a)e(n)m(um)m | |
4276 | (b)s(er)f(less)h(than)g(zero,)j(the)e(v)-5 b(alue)23 | |
4277 | b(is)f(used)h(as)g(an)h(o\013set)g(from)f(the)g(end)g(of)h(the)630 | |
4278 | 5121 y(v)-5 b(alue)21 b(of)g Fq(parameter)p Ft(.)38 b(If)21 | |
4279 | b Fq(parameter)28 b Ft(is)20 b(`)p Fs(@)p Ft(',)j(the)f(result)e(is)g | |
4280 | Fq(length)h Ft(p)s(ositional)e(parameters)630 5230 y(b)s(eginning)25 | |
4281 | b(at)k Fq(o\013set)p Ft(.)41 b(If)28 b Fq(parameter)35 | |
4282 | b Ft(is)27 b(an)h(arra)m(y)h(name)f(indexed)e(b)m(y)i(`)p | |
4283 | Fs(@)p Ft(')g(or)g(`)p Fs(*)p Ft(',)h(the)g(re-)630 5340 | |
4284 | y(sult)20 b(is)h(the)g Fq(length)g Ft(mem)m(b)s(ers)g(of)g(the)h(arra)m | |
4285 | (y)f(b)s(eginning)e(with)h Fs(${)p Fj(parameter)11 b | |
4286 | Fs([)p Fj(offset)g Fs(]})p Ft(.)p eop | |
4287 | %%Page: 20 26 | |
4288 | 20 25 bop 150 -116 a Ft(20)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
4289 | 299 y(Substring)g(indexing)h(is)g(zero-based)j(unless)d(the)i(p)s | |
4290 | (ositional)d(parameters)j(are)g(used,)g(in)630 408 y(whic)m(h)29 | |
4291 | b(case)j(the)e(indexing)e(starts)j(at)g(1.)150 573 y | |
4292 | Fs(${!)p Fj(prefix)11 b Fs(*})150 682 y(${!)p Fj(prefix)g | |
4293 | Fs(@})630 792 y Ft(Expands)34 b(to)j(the)f(names)g(of)g(v)-5 | |
4294 | b(ariables)35 b(whose)g(names)h(b)s(egin)e(with)h Fq(pre\014x)p | |
4295 | Ft(,)h(separated)630 902 y(b)m(y)30 b(the)h(\014rst)e(c)m(haracter)j | |
4296 | (of)f(the)g Fs(IFS)e Ft(sp)s(ecial)g(v)-5 b(ariable.)150 | |
4297 | 1066 y Fs(${!)p Fj(name)11 b Fs([@]})150 1176 y(${!)p | |
4298 | Fj(name)g Fs([*]})630 1285 y Ft(If)26 b Fq(name)32 b | |
4299 | Ft(is)26 b(an)g(arra)m(y)h(v)-5 b(ariable,)27 b(expands)f(to)h(the)g | |
4300 | (list)e(of)i(arra)m(y)g(indices)e(\(k)m(eys\))j(assigned)630 | |
4301 | 1395 y(in)23 b Fq(name)p Ft(.)39 b(If)24 b Fq(name)30 | |
4302 | b Ft(is)23 b(not)i(an)f(arra)m(y)-8 b(,)27 b(expands)c(to)j(0)f(if)e | |
4303 | Fq(name)30 b Ft(is)23 b(set)i(and)f(n)m(ull)e(otherwise.)630 | |
4304 | 1504 y(When)39 b(`)p Fs(@)p Ft(')h(is)e(used)h(and)f(the)i(expansion)e | |
4305 | (app)s(ears)h(within)d(double)i(quotes,)43 b(eac)m(h)d(k)m(ey)630 | |
4306 | 1614 y(expands)30 b(to)h(a)f(separate)i(w)m(ord.)150 | |
4307 | 1778 y Fs(${#)p Fj(parameter)11 b Fs(})630 1888 y Ft(The)40 | |
4308 | b(length)f(in)g(c)m(haracters)j(of)e(the)h(expanded)e(v)-5 | |
4309 | b(alue)40 b(of)g Fq(parameter)47 b Ft(is)39 b(substituted.)630 | |
4310 | 1998 y(If)j Fq(parameter)50 b Ft(is)42 b(`)p Fs(*)p Ft(')h(or)g(`)p | |
4311 | Fs(@)p Ft(',)k(the)c(v)-5 b(alue)42 b(substituted)f(is)h(the)h(n)m(um)m | |
4312 | (b)s(er)f(of)h(p)s(ositional)630 2107 y(parameters.)i(If)32 | |
4313 | b Fq(parameter)38 b Ft(is)31 b(an)h(arra)m(y)g(name)g(subscripted)e(b)m | |
4314 | (y)h(`)p Fs(*)p Ft(')h(or)g(`)p Fs(@)p Ft(',)g(the)g(v)-5 | |
4315 | b(alue)630 2217 y(substituted)29 b(is)g(the)i(n)m(um)m(b)s(er)e(of)h | |
4316 | (elemen)m(ts)h(in)e(the)i(arra)m(y)-8 b(.)150 2381 y | |
4317 | Fs(${)p Fj(parameter)11 b Fs(#)p Fj(word)g Fs(})150 2491 | |
4318 | y(${)p Fj(parameter)g Fs(##)p Fj(word)g Fs(})630 2600 | |
4319 | y Ft(The)31 b Fq(w)m(ord)k Ft(is)c(expanded)g(to)i(pro)s(duce)e(a)h | |
4320 | (pattern)g(just)f(as)i(in)d(\014lename)h(expansion)g(\(see)630 | |
4321 | 2710 y(Section)k(3.5.8)i([Filename)e(Expansion],)h(page)g(22\).)56 | |
4322 | b(If)35 b(the)h(pattern)f(matc)m(hes)i(the)e(b)s(e-)630 | |
4323 | 2819 y(ginning)26 b(of)i(the)h(expanded)e(v)-5 b(alue)28 | |
4324 | b(of)g Fq(parameter)p Ft(,)h(then)f(the)g(result)f(of)i(the)f | |
4325 | (expansion)f(is)630 2929 y(the)36 b(expanded)f(v)-5 b(alue)35 | |
4326 | b(of)h Fq(parameter)43 b Ft(with)34 b(the)i(shortest)g(matc)m(hing)g | |
4327 | (pattern)g(\(the)g(`)p Fs(#)p Ft(')630 3039 y(case\))26 | |
4328 | b(or)f(the)g(longest)f(matc)m(hing)h(pattern)g(\(the)g(`)p | |
4329 | Fs(##)p Ft(')g(case\))h(deleted.)38 b(If)24 b Fq(parameter)32 | |
4330 | b Ft(is)24 b(`)p Fs(@)p Ft(')630 3148 y(or)k(`)p Fs(*)p | |
4331 | Ft(',)i(the)e(pattern)h(remo)m(v)-5 b(al)28 b(op)s(eration)g(is)f | |
4332 | (applied)g(to)i(eac)m(h)g(p)s(ositional)d(parameter)j(in)630 | |
4333 | 3258 y(turn,)i(and)g(the)h(expansion)f(is)g(the)h(resultan)m(t)f(list.) | |
4334 | 43 b(If)32 b Fq(parameter)38 b Ft(is)31 b(an)h(arra)m(y)g(v)-5 | |
4335 | b(ariable)630 3367 y(subscripted)38 b(with)g(`)p Fs(@)p | |
4336 | Ft(')i(or)g(`)p Fs(*)p Ft(',)j(the)d(pattern)h(remo)m(v)-5 | |
4337 | b(al)40 b(op)s(eration)f(is)g(applied)f(to)j(eac)m(h)630 | |
4338 | 3477 y(mem)m(b)s(er)30 b(of)g(the)h(arra)m(y)g(in)e(turn,)g(and)h(the)h | |
4339 | (expansion)e(is)g(the)i(resultan)m(t)f(list.)150 3641 | |
4340 | y Fs(${)p Fj(parameter)11 b Fs(\045)p Fj(word)g Fs(})150 | |
4341 | 3751 y(${)p Fj(parameter)g Fs(\045\045)p Fj(word)g Fs(})630 | |
4342 | 3861 y Ft(The)35 b Fq(w)m(ord)k Ft(is)34 b(expanded)h(to)h(pro)s(duce)e | |
4343 | (a)i(pattern)f(just)g(as)h(in)e(\014lename)h(expansion.)54 | |
4344 | b(If)630 3970 y(the)43 b(pattern)g(matc)m(hes)h(a)g(trailing)d(p)s | |
4345 | (ortion)g(of)i(the)g(expanded)g(v)-5 b(alue)42 b(of)h | |
4346 | Fq(parameter)p Ft(,)630 4080 y(then)c(the)g(result)f(of)i(the)f | |
4347 | (expansion)f(is)h(the)g(v)-5 b(alue)39 b(of)g Fq(parameter)46 | |
4348 | b Ft(with)38 b(the)i(shortest)630 4189 y(matc)m(hing)30 | |
4349 | b(pattern)f(\(the)h(`)p Fs(\045)p Ft(')g(case\))h(or)e(the)h(longest)g | |
4350 | (matc)m(hing)f(pattern)h(\(the)g(`)p Fs(\045\045)p Ft(')g(case\))630 | |
4351 | 4299 y(deleted.)48 b(If)32 b Fq(parameter)40 b Ft(is)32 | |
4352 | b(`)p Fs(@)p Ft(')h(or)g(`)p Fs(*)p Ft(',)h(the)f(pattern)g(remo)m(v)-5 | |
4353 | b(al)33 b(op)s(eration)g(is)f(applied)e(to)630 4408 y(eac)m(h)38 | |
4354 | b(p)s(ositional)d(parameter)j(in)e(turn,)i(and)e(the)h(expansion)f(is)h | |
4355 | (the)g(resultan)m(t)g(list.)59 b(If)630 4518 y Fq(parameter)38 | |
4356 | b Ft(is)31 b(an)g(arra)m(y)h(v)-5 b(ariable)30 b(subscripted)f(with)h | |
4357 | (`)p Fs(@)p Ft(')h(or)h(`)p Fs(*)p Ft(',)g(the)f(pattern)h(remo)m(v)-5 | |
4358 | b(al)630 4628 y(op)s(eration)29 b(is)g(applied)e(to)k(eac)m(h)g(mem)m | |
4359 | (b)s(er)e(of)h(the)g(arra)m(y)g(in)e(turn,)h(and)g(the)h(expansion)f | |
4360 | (is)630 4737 y(the)i(resultan)m(t)f(list.)150 4902 y | |
4361 | Fs(${)p Fj(parameter)11 b Fs(/)p Fj(pattern)g Fs(/)p | |
4362 | Fj(s)o(tri)o(ng)f Fs(})150 5011 y(${)p Fj(parameter)h | |
4363 | Fs(//)p Fj(pattern)g Fs(/)o Fj(str)o(ing)f Fs(})630 5121 | |
4364 | y Ft(The)37 b Fq(pattern)g Ft(is)f(expanded)h(to)h(pro)s(duce)e(a)h | |
4365 | (pattern)g(just)g(as)h(in)d(\014lename)i(expansion.)630 | |
4366 | 5230 y Fq(P)m(arameter)46 b Ft(is)37 b(expanded)g(and)g(the)i(longest)f | |
4367 | (matc)m(h)h(of)f Fq(pattern)g Ft(against)g(its)f(v)-5 | |
4368 | b(alue)38 b(is)630 5340 y(replaced)e(with)f Fq(string)p | |
4369 | Ft(.)57 b(In)35 b(the)i(\014rst)e(form,)j(only)d(the)i(\014rst)e(matc)m | |
4370 | (h)i(is)f(replaced.)57 b(The)p eop | |
4371 | %%Page: 21 27 | |
4372 | 21 26 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4373 | b(Shell)d(F)-8 b(eatures)2246 b(21)630 299 y(second)26 | |
4374 | b(form)g(causes)h(all)e(matc)m(hes)i(of)g Fq(pattern)f | |
4375 | Ft(to)h(b)s(e)f(replaced)g(with)f Fq(string)p Ft(.)38 | |
4376 | b(If)26 b Fq(pattern)630 408 y Ft(b)s(egins)34 b(with)g(`)p | |
4377 | Fs(#)p Ft(',)j(it)e(m)m(ust)g(matc)m(h)h(at)g(the)g(b)s(eginning)d(of)i | |
4378 | (the)h(expanded)e(v)-5 b(alue)35 b(of)h Fq(pa-)630 518 | |
4379 | y(rameter)p Ft(.)45 b(If)32 b Fq(pattern)g Ft(b)s(egins)e(with)g(`)p | |
4380 | Fs(\045)p Ft(',)j(it)e(m)m(ust)h(matc)m(h)g(at)h(the)f(end)f(of)h(the)g | |
4381 | (expanded)630 628 y(v)-5 b(alue)32 b(of)h Fq(parameter)p | |
4382 | Ft(.)47 b(If)32 b Fq(string)39 b Ft(is)32 b(n)m(ull,)f(matc)m(hes)i(of) | |
4383 | g Fq(pattern)g Ft(are)g(deleted)f(and)g(the)g Fs(/)630 | |
4384 | 737 y Ft(follo)m(wing)i Fq(pattern)h Ft(ma)m(y)h(b)s(e)e(omitted.)55 | |
4385 | b(If)35 b Fq(parameter)42 b Ft(is)35 b(`)p Fs(@)p Ft(')g(or)g(`)p | |
4386 | Fs(*)p Ft(',)i(the)e(substitution)630 847 y(op)s(eration)29 | |
4387 | b(is)f(applied)f(to)j(eac)m(h)g(p)s(ositional)d(parameter)j(in)d(turn,) | |
4388 | i(and)g(the)g(expansion)f(is)630 956 y(the)j(resultan)m(t)g(list.)43 | |
4389 | b(If)30 b Fq(parameter)39 b Ft(is)30 b(an)h(arra)m(y)h(v)-5 | |
4390 | b(ariable)30 b(subscripted)f(with)h(`)p Fs(@)p Ft(')h(or)h(`)p | |
4391 | Fs(*)p Ft(',)630 1066 y(the)e(substitution)e(op)s(eration)i(is)f | |
4392 | (applied)f(to)j(eac)m(h)h(mem)m(b)s(er)e(of)g(the)g(arra)m(y)h(in)e | |
4393 | (turn,)h(and)630 1176 y(the)h(expansion)e(is)g(the)i(resultan)m(t)f | |
4394 | (list.)150 1443 y Fk(3.5.4)63 b(Command)39 b(Substitution)275 | |
4395 | 1709 y Ft(Command)29 b(substitution)g(allo)m(ws)h(the)h(output)g(of)g | |
4396 | (a)g(command)g(to)g(replace)g(the)g(command)g(itself.)150 | |
4397 | 1819 y(Command)e(substitution)f(o)s(ccurs)j(when)e(a)i(command)f(is)f | |
4398 | (enclosed)h(as)h(follo)m(ws:)390 1975 y Fs($\()p Fj(command)11 | |
4399 | b Fs(\))150 2131 y Ft(or)390 2288 y Fs(`)p Fj(command)g | |
4400 | Fs(`)150 2444 y Ft(Bash)45 b(p)s(erforms)f(the)h(expansion)e(b)m(y)i | |
4401 | (executing)h Fq(command)i Ft(and)c(replacing)g(the)h(command)g(sub-)150 | |
4402 | 2554 y(stitution)39 b(with)g(the)h(standard)g(output)g(of)g(the)g | |
4403 | (command,)j(with)c(an)m(y)i(trailing)d(newlines)g(deleted.)150 | |
4404 | 2663 y(Em)m(b)s(edded)30 b(newlines)f(are)j(not)f(deleted,)h(but)f | |
4405 | (they)g(ma)m(y)h(b)s(e)f(remo)m(v)m(ed)i(during)c(w)m(ord)i(splitting.) | |
4406 | 41 b(The)150 2773 y(command)21 b(substitution)e Fs($\(cat)29 | |
4407 | b Fj(file)11 b Fs(\))20 b Ft(can)i(b)s(e)f(replaced)f(b)m(y)i(the)g | |
4408 | (equiv)-5 b(alen)m(t)20 b(but)h(faster)h Fs($\(<)30 b | |
4409 | Fj(file)11 b Fs(\))p Ft(.)275 2929 y(When)33 b(the)i(old-st)m(yle)f | |
4410 | (bac)m(kquote)h(form)f(of)g(substitution)e(is)h(used,)i(bac)m(kslash)e | |
4411 | (retains)h(its)f(literal)150 3039 y(meaning)k(except)i(when)e(follo)m | |
4412 | (w)m(ed)h(b)m(y)g(`)p Fs($)p Ft(',)j(`)p Fs(`)p Ft(',)f(or)e(`)p | |
4413 | Fs(\\)p Ft('.)64 b(The)38 b(\014rst)f(bac)m(kquote)j(not)e(preceded)g | |
4414 | (b)m(y)g(a)150 3148 y(bac)m(kslash)i(terminates)g(the)g(command)g | |
4415 | (substitution.)67 b(When)40 b(using)f(the)h Fs($\()p | |
4416 | Fj(command)11 b Fs(\))37 b Ft(form,)42 b(all)150 3258 | |
4417 | y(c)m(haracters)32 b(b)s(et)m(w)m(een)f(the)f(paren)m(theses)h(mak)m(e) | |
4418 | g(up)f(the)g(command;)h(none)f(are)h(treated)g(sp)s(ecially)-8 | |
4419 | b(.)275 3414 y(Command)22 b(substitutions)e(ma)m(y)k(b)s(e)e(nested.)39 | |
4420 | b(T)-8 b(o)23 b(nest)g(when)f(using)g(the)h(bac)m(kquoted)h(form,)g | |
4421 | (escap)s(e)150 3524 y(the)31 b(inner)d(bac)m(kquotes)k(with)d(bac)m | |
4422 | (kslashes.)275 3680 y(If)f(the)i(substitution)c(app)s(ears)j(within)e | |
4423 | (double)g(quotes,)j(w)m(ord)f(splitting)e(and)i(\014lename)f(expansion) | |
4424 | 150 3790 y(are)j(not)f(p)s(erformed)f(on)h(the)h(results.)150 | |
4425 | 4057 y Fk(3.5.5)63 b(Arithmetic)39 b(Expansion)275 4323 | |
4426 | y Ft(Arithmetic)31 b(expansion)g(allo)m(ws)h(the)g(ev)-5 | |
4427 | b(aluation)32 b(of)h(an)f(arithmetic)g(expression)f(and)h(the)g | |
4428 | (substi-)150 4433 y(tution)e(of)g(the)h(result.)39 b(The)30 | |
4429 | b(format)h(for)f(arithmetic)g(expansion)f(is:)390 4589 | |
4430 | y Fs($\(\()47 b Fj(expression)55 b Fs(\)\))275 4745 y | |
4431 | Ft(The)33 b(expression)f(is)h(treated)h(as)g(if)f(it)g(w)m(ere)h | |
4432 | (within)d(double)i(quotes,)i(but)e(a)h(double)e(quote)i(inside)150 | |
4433 | 4855 y(the)27 b(paren)m(theses)g(is)f(not)h(treated)h(sp)s(ecially)-8 | |
4434 | b(.)38 b(All)25 b(tok)m(ens)j(in)d(the)i(expression)f(undergo)g | |
4435 | (parameter)h(ex-)150 4965 y(pansion,)g(command)g(substitution,)f(and)h | |
4436 | (quote)i(remo)m(v)-5 b(al.)40 b(Arithmetic)26 b(expansions)h(ma)m(y)h | |
4437 | (b)s(e)f(nested.)275 5121 y(The)34 b(ev)-5 b(aluation)35 | |
4438 | b(is)g(p)s(erformed)f(according)h(to)h(the)g(rules)e(listed)g(b)s(elo)m | |
4439 | (w)h(\(see)h(Section)f(6.5)i([Shell)150 5230 y(Arithmetic],)30 | |
4440 | b(page)h(70\).)42 b(If)30 b(the)h(expression)e(is)g(in)m(v)-5 | |
4441 | b(alid,)29 b(Bash)h(prin)m(ts)f(a)i(message)g(indicating)e(failure)150 | |
4442 | 5340 y(to)i(the)g(standard)e(error)h(and)g(no)g(substitution)e(o)s | |
4443 | (ccurs.)p eop | |
4444 | %%Page: 22 28 | |
4445 | 22 27 bop 150 -116 a Ft(22)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
4446 | 299 y Fk(3.5.6)63 b(Pro)s(cess)42 b(Substitution)275 | |
4447 | 539 y Ft(Pro)s(cess)33 b(substitution)f(is)h(supp)s(orted)f(on)h | |
4448 | (systems)h(that)h(supp)s(ort)d(named)h(pip)s(es)f(\()p | |
4449 | Fl(fif)n(o)p Ft(s\))i(or)g(the)150 649 y(`)p Fs(/dev/fd)p | |
4450 | Ft(')29 b(metho)s(d)h(of)g(naming)f(op)s(en)h(\014les.)40 | |
4451 | b(It)30 b(tak)m(es)i(the)f(form)f(of)390 779 y Fs(<\()p | |
4452 | Fj(list)11 b Fs(\))150 910 y Ft(or)390 1041 y Fs(>\()p | |
4453 | Fj(list)g Fs(\))150 1171 y Ft(The)23 b(pro)s(cess)g Fq(list)h | |
4454 | Ft(is)e(run)g(with)g(its)h(input)f(or)h(output)g(connected)h(to)h(a)e | |
4455 | Fl(fif)n(o)g Ft(or)h(some)g(\014le)e(in)g(`)p Fs(/dev/fd)p | |
4456 | Ft('.)150 1281 y(The)28 b(name)h(of)g(this)e(\014le)h(is)g(passed)g(as) | |
4457 | h(an)f(argumen)m(t)h(to)h(the)f(curren)m(t)f(command)h(as)f(the)h | |
4458 | (result)f(of)h(the)150 1391 y(expansion.)39 b(If)28 b(the)h | |
4459 | Fs(>\()p Fj(list)11 b Fs(\))26 b Ft(form)i(is)g(used,)g(writing)f(to)i | |
4460 | (the)g(\014le)e(will)f(pro)m(vide)i(input)f(for)h Fq(list)p | |
4461 | Ft(.)39 b(If)28 b(the)150 1500 y Fs(<\()p Fj(list)11 | |
4462 | b Fs(\))23 b Ft(form)h(is)h(used,)g(the)h(\014le)e(passed)h(as)g(an)g | |
4463 | (argumen)m(t)h(should)d(b)s(e)i(read)g(to)h(obtain)f(the)g(output)g(of) | |
4464 | 150 1610 y Fq(list)p Ft(.)39 b(Note)31 b(that)f(no)g(space)g(ma)m(y)g | |
4465 | (app)s(ear)f(b)s(et)m(w)m(een)h(the)g Fs(<)f Ft(or)h | |
4466 | Fs(>)f Ft(and)g(the)h(left)f(paren)m(thesis,)h(otherwise)150 | |
4467 | 1719 y(the)h(construct)f(w)m(ould)f(b)s(e)h(in)m(terpreted)g(as)g(a)h | |
4468 | (redirection.)275 1850 y(When)36 b(a)m(v)-5 b(ailable,)37 | |
4469 | b(pro)s(cess)f(substitution)f(is)g(p)s(erformed)g(sim)m(ultaneously)f | |
4470 | (with)i(parameter)h(and)150 1960 y(v)-5 b(ariable)29 | |
4471 | b(expansion,)h(command)g(substitution,)e(and)i(arithmetic)g(expansion.) | |
4472 | 150 2172 y Fk(3.5.7)63 b(W)-10 b(ord)41 b(Splitting)275 | |
4473 | 2413 y Ft(The)35 b(shell)g(scans)h(the)g(results)f(of)h(parameter)h | |
4474 | (expansion,)g(command)e(substitution,)h(and)g(arith-)150 | |
4475 | 2522 y(metic)30 b(expansion)g(that)h(did)d(not)j(o)s(ccur)f(within)e | |
4476 | (double)h(quotes)i(for)f(w)m(ord)g(splitting.)275 2653 | |
4477 | y(The)43 b(shell)f(treats)j(eac)m(h)h(c)m(haracter)f(of)g | |
4478 | Fs($IFS)e Ft(as)h(a)g(delimiter,)i(and)d(splits)f(the)j(results)d(of)j | |
4479 | (the)150 2763 y(other)40 b(expansions)e(in)m(to)i(w)m(ords)f(on)h | |
4480 | (these)g(c)m(haracters.)70 b(If)39 b Fs(IFS)g Ft(is)g(unset,)j(or)d | |
4481 | (its)g(v)-5 b(alue)39 b(is)g(exactly)150 2872 y Fs | |
4482 | (<space><tab><newline>)p Ft(,)20 b(the)25 b(default,)g(then)f(an)m(y)g | |
4483 | (sequence)h(of)g Fs(IFS)e Ft(c)m(haracters)j(serv)m(es)f(to)g(delimit) | |
4484 | 150 2982 y(w)m(ords.)38 b(If)21 b Fs(IFS)h Ft(has)g(a)h(v)-5 | |
4485 | b(alue)22 b(other)g(than)h(the)f(default,)i(then)e(sequences)g(of)h | |
4486 | (the)f(whitespace)g(c)m(haracters)150 3091 y Fs(space)k | |
4487 | Ft(and)h Fs(tab)g Ft(are)h(ignored)f(at)i(the)f(b)s(eginning)d(and)i | |
4488 | (end)g(of)h(the)g(w)m(ord,)g(as)g(long)f(as)h(the)g(whitespace)150 | |
4489 | 3201 y(c)m(haracter)34 b(is)e(in)f(the)i(v)-5 b(alue)32 | |
4490 | b(of)g Fs(IFS)g Ft(\(an)h Fs(IFS)e Ft(whitespace)i(c)m(haracter\).)49 | |
4491 | b(An)m(y)32 b(c)m(haracter)i(in)e Fs(IFS)f Ft(that)150 | |
4492 | 3311 y(is)e(not)i Fs(IFS)f Ft(whitespace,)g(along)g(with)f(an)m(y)i | |
4493 | (adjacen)m(t)h Fs(IFS)d Ft(whitespace)h(c)m(haracters,)i(delimits)c(a)j | |
4494 | (\014eld.)150 3420 y(A)h(sequence)h(of)f Fs(IFS)f Ft(whitespace)h(c)m | |
4495 | (haracters)i(is)d(also)h(treated)h(as)g(a)f(delimiter.)44 | |
4496 | b(If)32 b(the)g(v)-5 b(alue)32 b(of)g Fs(IFS)150 3530 | |
4497 | y Ft(is)d(n)m(ull,)g(no)h(w)m(ord)g(splitting)e(o)s(ccurs.)275 | |
4498 | 3660 y(Explicit)41 b(n)m(ull)g(argumen)m(ts)i(\()p Fs("")g | |
4499 | Ft(or)h Fs('')p Ft(\))f(are)g(retained.)79 b(Unquoted)43 | |
4500 | b(implicit)d(n)m(ull)h(argumen)m(ts,)150 3770 y(resulting)22 | |
4501 | b(from)h(the)g(expansion)f(of)i(parameters)g(that)g(ha)m(v)m(e)h(no)e | |
4502 | (v)-5 b(alues,)24 b(are)g(remo)m(v)m(ed.)40 b(If)23 b(a)g(parameter)150 | |
4503 | 3880 y(with)29 b(no)h(v)-5 b(alue)30 b(is)g(expanded)f(within)f(double) | |
4504 | h(quotes,)i(a)g(n)m(ull)d(argumen)m(t)j(results)e(and)h(is)f(retained.) | |
4505 | 275 4010 y(Note)i(that)g(if)f(no)g(expansion)f(o)s(ccurs,)h(no)h | |
4506 | (splitting)d(is)h(p)s(erformed.)150 4223 y Fk(3.5.8)63 | |
4507 | b(Filename)40 b(Expansion)275 4463 y Ft(After)22 b(w)m(ord)g | |
4508 | (splitting,)g(unless)f(the)i(`)p Fs(-f)p Ft(')f(option)g(has)g(b)s(een) | |
4509 | g(set)h(\(see)g(Section)g(4.3)g([The)f(Set)h(Builtin],)150 | |
4510 | 4573 y(page)k(50\),)i(Bash)d(scans)h(eac)m(h)h(w)m(ord)e(for)g(the)h(c) | |
4511 | m(haracters)g(`)p Fs(*)p Ft(',)h(`)p Fs(?)p Ft(',)g(and)e(`)p | |
4512 | Fs([)p Ft('.)39 b(If)26 b(one)h(of)g(these)f(c)m(haracters)150 | |
4513 | 4682 y(app)s(ears,)h(then)f(the)h(w)m(ord)f(is)g(regarded)h(as)g(a)g | |
4514 | Fq(pattern)p Ft(,)g(and)g(replaced)f(with)f(an)i(alphab)s(etically)d | |
4515 | (sorted)150 4792 y(list)30 b(of)i(\014le)f(names)h(matc)m(hing)g(the)g | |
4516 | (pattern.)45 b(If)32 b(no)f(matc)m(hing)h(\014le)f(names)h(are)g | |
4517 | (found,)f(and)h(the)g(shell)150 4902 y(option)27 b Fs(nullglob)f | |
4518 | Ft(is)h(disabled,)g(the)h(w)m(ord)g(is)f(left)g(unc)m(hanged.)40 | |
4519 | b(If)28 b(the)g Fs(nullglob)e Ft(option)h(is)g(set,)j(and)150 | |
4520 | 5011 y(no)38 b(matc)m(hes)h(are)f(found,)h(the)f(w)m(ord)f(is)g(remo)m | |
4521 | (v)m(ed.)65 b(If)37 b(the)h Fs(failglob)e Ft(shell)g(option)h(is)g | |
4522 | (set,)k(and)c(no)150 5121 y(matc)m(hes)f(are)g(found,)f(an)g(error)f | |
4523 | (message)j(is)d(prin)m(ted)f(and)i(the)g(command)g(is)f(not)h | |
4524 | (executed.)56 b(If)35 b(the)150 5230 y(shell)c(option)i | |
4525 | Fs(nocaseglob)d Ft(is)i(enabled,)h(the)h(matc)m(h)g(is)e(p)s(erformed)f | |
4526 | (without)h(regard)h(to)h(the)g(case)g(of)150 5340 y(alphab)s(etic)29 | |
4527 | b(c)m(haracters.)p eop | |
4528 | %%Page: 23 29 | |
4529 | 23 28 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4530 | b(Shell)d(F)-8 b(eatures)2246 b(23)275 299 y(When)21 | |
4531 | b(a)i(pattern)f(is)f(used)h(for)f(\014lename)h(generation,)i(the)e(c)m | |
4532 | (haracter)i(`)p Fs(.)p Ft(')e(at)h(the)f(start)h(of)f(a)h(\014lename) | |
4533 | 150 408 y(or)g(immediately)f(follo)m(wing)g(a)i(slash)e(m)m(ust)i(b)s | |
4534 | (e)f(matc)m(hed)h(explicitly)-8 b(,)23 b(unless)f(the)h(shell)f(option) | |
4535 | h Fs(dotglob)150 518 y Ft(is)30 b(set.)45 b(When)31 b(matc)m(hing)g(a)h | |
4536 | (\014le)e(name,)i(the)g(slash)e(c)m(haracter)j(m)m(ust)e(alw)m(a)m(ys)h | |
4537 | (b)s(e)f(matc)m(hed)h(explicitly)-8 b(.)150 628 y(In)30 | |
4538 | b(other)g(cases,)i(the)e(`)p Fs(.)p Ft(')h(c)m(haracter)h(is)d(not)i | |
4539 | (treated)g(sp)s(ecially)-8 b(.)275 772 y(See)30 b(the)g(description)d | |
4540 | (of)j Fs(shopt)f Ft(in)f(Section)i(4.2)h([Bash)f(Builtins],)e(page)i | |
4541 | (39,)h(for)f(a)g(description)e(of)150 882 y(the)j Fs(nocaseglob)p | |
4542 | Ft(,)c Fs(nullglob)p Ft(,)i Fs(failglob)p Ft(,)f(and)i | |
4543 | Fs(dotglob)e Ft(options.)275 1026 y(The)k Fs(GLOBIGNORE)f | |
4544 | Ft(shell)g(v)-5 b(ariable)32 b(ma)m(y)i(b)s(e)f(used)f(to)i(restrict)f | |
4545 | (the)h(set)f(of)h(\014lenames)e(matc)m(hing)i(a)150 1136 | |
4546 | y(pattern.)39 b(If)25 b Fs(GLOBIGNORE)e Ft(is)i(set,)i(eac)m(h)g(matc)m | |
4547 | (hing)f(\014lename)f(that)h(also)g(matc)m(hes)g(one)g(of)g(the)g | |
4548 | (patterns)150 1245 y(in)32 b Fs(GLOBIGNORE)e Ft(is)i(remo)m(v)m(ed)i | |
4549 | (from)e(the)i(list)d(of)i(matc)m(hes.)50 b(The)33 b(\014lenames)f(`)p | |
4550 | Fs(.)p Ft(')h(and)f(`)p Fs(..)p Ft(')h(are)g(alw)m(a)m(ys)150 | |
4551 | 1355 y(ignored)f(when)f Fs(GLOBIGNORE)f Ft(is)i(set)h(and)f(not)h(n)m | |
4552 | (ull.)46 b(Ho)m(w)m(ev)m(er,)35 b(setting)e Fs(GLOBIGNORE)d | |
4553 | Ft(to)j(a)g(non-n)m(ull)150 1465 y(v)-5 b(alue)33 b(has)g(the)h | |
4554 | (e\013ect)h(of)f(enabling)e(the)i Fs(dotglob)e Ft(shell)f(option,)k(so) | |
4555 | f(all)e(other)i(\014lenames)f(b)s(eginning)150 1574 y(with)42 | |
4556 | b(a)i(`)p Fs(.)p Ft(')f(will)e(matc)m(h.)80 b(T)-8 b(o)44 | |
4557 | b(get)h(the)e(old)g(b)s(eha)m(vior)f(of)i(ignoring)d(\014lenames)i(b)s | |
4558 | (eginning)e(with)h(a)150 1684 y(`)p Fs(.)p Ft(',)d(mak)m(e)g(`)p | |
4559 | Fs(.*)p Ft(')e(one)g(of)g(the)h(patterns)f(in)f Fs(GLOBIGNORE)p | |
4560 | Ft(.)58 b(The)37 b Fs(dotglob)e Ft(option)i(is)f(disabled)f(when)150 | |
4561 | 1793 y Fs(GLOBIGNORE)28 b Ft(is)h(unset.)150 2037 y Fk(3.5.8.1)63 | |
4562 | b(P)m(attern)40 b(Matc)m(hing)275 2291 y Ft(An)m(y)33 | |
4563 | b(c)m(haracter)i(that)f(app)s(ears)f(in)f(a)i(pattern,)g(other)g(than)f | |
4564 | (the)g(sp)s(ecial)f(pattern)i(c)m(haracters)h(de-)150 | |
4565 | 2401 y(scrib)s(ed)29 b(b)s(elo)m(w,)h(matc)m(hes)i(itself.)41 | |
4566 | b(The)31 b Fl(nul)f Ft(c)m(haracter)i(ma)m(y)f(not)h(o)s(ccur)e(in)g(a) | |
4567 | h(pattern.)42 b(A)31 b(bac)m(kslash)150 2511 y(escap)s(es)36 | |
4568 | b(the)f(follo)m(wing)f(c)m(haracter;)40 b(the)c(escaping)f(bac)m | |
4569 | (kslash)g(is)f(discarded)g(when)h(matc)m(hing.)55 b(The)150 | |
4570 | 2620 y(sp)s(ecial)29 b(pattern)h(c)m(haracters)i(m)m(ust)f(b)s(e)e | |
4571 | (quoted)i(if)e(they)i(are)f(to)i(b)s(e)d(matc)m(hed)i(literally)-8 | |
4572 | b(.)275 2765 y(The)29 b(sp)s(ecial)g(pattern)i(c)m(haracters)h(ha)m(v)m | |
4573 | (e)f(the)g(follo)m(wing)e(meanings:)150 2939 y Fs(*)432 | |
4574 | b Ft(Matc)m(hes)32 b(an)m(y)f(string,)e(including)e(the)k(n)m(ull)d | |
4575 | (string.)150 3108 y Fs(?)432 b Ft(Matc)m(hes)32 b(an)m(y)f(single)e(c)m | |
4576 | (haracter.)150 3278 y Fs([...)o(])241 b Ft(Matc)m(hes)27 | |
4577 | b(an)m(y)e(one)g(of)g(the)g(enclosed)f(c)m(haracters.)41 | |
4578 | b(A)25 b(pair)e(of)i(c)m(haracters)i(separated)e(b)m(y)g(a)630 | |
4579 | 3387 y(h)m(yphen)i(denotes)h(a)g Fq(range)g(expression)p | |
4580 | Ft(;)f(an)m(y)i(c)m(haracter)g(that)f(sorts)g(b)s(et)m(w)m(een)g(those) | |
4581 | h(t)m(w)m(o)630 3497 y(c)m(haracters,)f(inclusiv)m(e,)c(using)f(the)i | |
4582 | (curren)m(t)f(lo)s(cale's)h(collating)f(sequence)h(and)f(c)m(haracter) | |
4583 | 630 3606 y(set,)31 b(is)e(matc)m(hed.)42 b(If)30 b(the)g(\014rst)g(c)m | |
4584 | (haracter)i(follo)m(wing)d(the)h(`)p Fs([)p Ft(')h(is)e(a)i(`)p | |
4585 | Fs(!)p Ft(')f(or)g(a)h(`)p Fs(^)p Ft(')g(then)f(an)m(y)630 | |
4586 | 3716 y(c)m(haracter)c(not)f(enclosed)f(is)g(matc)m(hed.)40 | |
4587 | b(A)25 b(`)p Fp(\000)p Ft(')f(ma)m(y)i(b)s(e)e(matc)m(hed)h(b)m(y)f | |
4588 | (including)e(it)i(as)h(the)630 3826 y(\014rst)32 b(or)h(last)g(c)m | |
4589 | (haracter)i(in)d(the)h(set.)50 b(A)33 b(`)p Fs(])p Ft(')g(ma)m(y)h(b)s | |
4590 | (e)e(matc)m(hed)i(b)m(y)f(including)d(it)i(as)i(the)630 | |
4591 | 3935 y(\014rst)25 b(c)m(haracter)i(in)d(the)i(set.)40 | |
4592 | b(The)25 b(sorting)g(order)g(of)h(c)m(haracters)h(in)e(range)h | |
4593 | (expressions)e(is)630 4045 y(determined)e(b)m(y)h(the)g(curren)m(t)f | |
4594 | (lo)s(cale)h(and)g(the)g(v)-5 b(alue)22 b(of)h(the)h | |
4595 | Fs(LC_COLLATE)c Ft(shell)h(v)-5 b(ariable,)630 4154 y(if)29 | |
4596 | b(set.)630 4294 y(F)-8 b(or)34 b(example,)f(in)f(the)h(default)f(C)g | |
4597 | (lo)s(cale,)i(`)p Fs([a-dx-z])p Ft(')d(is)h(equiv)-5 | |
4598 | b(alen)m(t)32 b(to)i(`)p Fs([abcdxyz])p Ft('.)630 4403 | |
4599 | y(Man)m(y)68 b(lo)s(cales)f(sort)h(c)m(haracters)h(in)d(dictionary)h | |
4600 | (order,)76 b(and)67 b(in)f(these)i(lo)s(cales)630 4513 | |
4601 | y(`)p Fs([a-dx-z])p Ft(')36 b(is)h(t)m(ypically)g(not)h(equiv)-5 | |
4602 | b(alen)m(t)37 b(to)i(`)p Fs([abcdxyz])p Ft(';)g(it)f(migh)m(t)f(b)s(e)g | |
4603 | (equiv)-5 b(alen)m(t)630 4623 y(to)34 b(`)p Fs([aBbCcDdxXyYz])p | |
4604 | Ft(',)c(for)j(example.)48 b(T)-8 b(o)33 b(obtain)g(the)g(traditional)e | |
4605 | (in)m(terpretation)i(of)630 4732 y(ranges)g(in)e(brac)m(k)m(et)j | |
4606 | (expressions,)f(y)m(ou)g(can)g(force)g(the)g(use)f(of)h(the)g(C)f(lo)s | |
4607 | (cale)g(b)m(y)h(setting)630 4842 y(the)e Fs(LC_COLLATE)c | |
4608 | Ft(or)k Fs(LC_ALL)d Ft(en)m(vironmen)m(t)i(v)-5 b(ariable)29 | |
4609 | b(to)i(the)g(v)-5 b(alue)30 b(`)p Fs(C)p Ft('.)630 4981 | |
4610 | y(Within)21 b(`)p Fs([)p Ft(')j(and)e(`)p Fs(])p Ft(',)j | |
4611 | Fq(c)m(haracter)g(classes)i Ft(can)d(b)s(e)e(sp)s(eci\014ed)g(using)f | |
4612 | (the)j(syn)m(tax)f Fs([:)p Fq(class)t Fs(:])p Ft(,)630 | |
4613 | 5091 y(where)j Fq(class)k Ft(is)c(one)h(of)g(the)g(follo)m(wing)e | |
4614 | (classes)i(de\014ned)e(in)h(the)g Fl(posix)g Ft(1003.2)k(standard:)870 | |
4615 | 5230 y Fs(alnum)142 b(alpha)g(ascii)f(blank)h(cntrl)g(digit)g(graph)g | |
4616 | (lower)870 5340 y(print)g(punct)g(space)f(upper)h(word)190 | |
4617 | b(xdigit)p eop | |
4618 | %%Page: 24 30 | |
4619 | 24 29 bop 150 -116 a Ft(24)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
4620 | 299 y(A)42 b(c)m(haracter)h(class)e(matc)m(hes)i(an)m(y)f(c)m(haracter) | |
4621 | h(b)s(elonging)d(to)i(that)g(class.)74 b(The)41 b Fs(word)630 | |
4622 | 408 y Ft(c)m(haracter)32 b(class)e(matc)m(hes)i(letters,)e(digits,)g | |
4623 | (and)f(the)i(c)m(haracter)h(`)p Fs(_)p Ft('.)630 544 | |
4624 | y(Within)23 b(`)p Fs([)p Ft(')h(and)g(`)p Fs(])p Ft(',)i(an)e | |
4625 | Fq(equiv)-5 b(alence)24 b(class)k Ft(can)c(b)s(e)g(sp)s(eci\014ed)f | |
4626 | (using)g(the)h(syn)m(tax)h Fs([=)p Fq(c)6 b Fs(=])p Ft(,)630 | |
4627 | 653 y(whic)m(h)28 b(matc)m(hes)j(all)d(c)m(haracters)j(with)d(the)i | |
4628 | (same)g(collation)e(w)m(eigh)m(t)i(\(as)g(de\014ned)e(b)m(y)i(the)630 | |
4629 | 763 y(curren)m(t)g(lo)s(cale\))h(as)f(the)h(c)m(haracter)h | |
4630 | Fq(c)p Ft(.)630 898 y(Within)20 b(`)p Fs([)p Ft(')h(and)g(`)p | |
4631 | Fs(])p Ft(',)j(the)d(syn)m(tax)h Fs([.)p Fq(sym)m(b)s(ol)t | |
4632 | Fs(.])d Ft(matc)m(hes)j(the)g(collating)f(sym)m(b)s(ol)f | |
4633 | Fq(sym)m(b)s(ol)p Ft(.)275 1061 y(If)29 b(the)g Fs(extglob)f | |
4634 | Ft(shell)f(option)i(is)g(enabled)f(using)g(the)i Fs(shopt)e | |
4635 | Ft(builtin,)e(sev)m(eral)k(extended)g(pattern)150 1170 | |
4636 | y(matc)m(hing)36 b(op)s(erators)f(are)h(recognized.)57 | |
4637 | b(In)35 b(the)g(follo)m(wing)f(description,)h(a)h Fq(pattern-list)h | |
4638 | Ft(is)e(a)h(list)e(of)150 1280 y(one)f(or)f(more)h(patterns)f | |
4639 | (separated)h(b)m(y)f(a)h(`)p Fs(|)p Ft('.)47 b(Comp)s(osite)32 | |
4640 | b(patterns)g(ma)m(y)i(b)s(e)d(formed)h(using)f(one)i(or)150 | |
4641 | 1389 y(more)e(of)f(the)h(follo)m(wing)d(sub-patterns:)150 | |
4642 | 1551 y Fs(?\()p Fj(pattern-list)11 b Fs(\))630 1661 y | |
4643 | Ft(Matc)m(hes)32 b(zero)f(or)g(one)f(o)s(ccurrence)h(of)f(the)h(giv)m | |
4644 | (en)f(patterns.)150 1822 y Fs(*\()p Fj(pattern-list)11 | |
4645 | b Fs(\))630 1932 y Ft(Matc)m(hes)32 b(zero)f(or)g(more)f(o)s | |
4646 | (ccurrences)h(of)f(the)h(giv)m(en)f(patterns.)150 2093 | |
4647 | y Fs(+\()p Fj(pattern-list)11 b Fs(\))630 2203 y Ft(Matc)m(hes)32 | |
4648 | b(one)f(or)f(more)h(o)s(ccurrences)f(of)h(the)f(giv)m(en)h(patterns.) | |
4649 | 150 2364 y Fs(@\()p Fj(pattern-list)11 b Fs(\))630 2473 | |
4650 | y Ft(Matc)m(hes)32 b(exactly)f(one)g(of)f(the)h(giv)m(en)f(patterns.) | |
4651 | 150 2635 y Fs(!\()p Fj(pattern-list)11 b Fs(\))630 2744 | |
4652 | y Ft(Matc)m(hes)32 b(an)m(ything)e(except)h(one)g(of)f(the)h(giv)m(en)f | |
4653 | (patterns.)150 2972 y Fk(3.5.9)63 b(Quote)41 b(Remo)m(v)-7 | |
4654 | b(al)275 3218 y Ft(After)32 b(the)h(preceding)e(expansions,)h(all)f | |
4655 | (unquoted)h(o)s(ccurrences)g(of)h(the)f(c)m(haracters)i(`)p | |
4656 | Fs(\\)p Ft(',)f(`)p Fs(')p Ft(',)h(and)150 3327 y(`)p | |
4657 | Fs(")p Ft(')d(that)g(did)d(not)j(result)e(from)h(one)h(of)f(the)h(ab)s | |
4658 | (o)m(v)m(e)g(expansions)e(are)i(remo)m(v)m(ed.)150 3589 | |
4659 | y Fr(3.6)68 b(Redirections)275 3835 y Ft(Before)33 b(a)h(command)e(is)g | |
4660 | (executed,)j(its)d(input)f(and)i(output)f(ma)m(y)i(b)s(e)e | |
4661 | Fq(redirected)k Ft(using)31 b(a)i(sp)s(ecial)150 3945 | |
4662 | y(notation)f(in)m(terpreted)g(b)m(y)g(the)g(shell.)44 | |
4663 | b(Redirection)31 b(ma)m(y)i(also)f(b)s(e)g(used)f(to)i(op)s(en)e(and)h | |
4664 | (close)g(\014les)f(for)150 4054 y(the)i(curren)m(t)g(shell)e(execution) | |
4665 | i(en)m(vironmen)m(t.)48 b(The)33 b(follo)m(wing)e(redirection)h(op)s | |
4666 | (erators)h(ma)m(y)h(precede)150 4164 y(or)29 b(app)s(ear)g(an)m(ywhere) | |
4667 | g(within)e(a)j(simple)d(command)i(or)h(ma)m(y)g(follo)m(w)e(a)i | |
4668 | (command.)40 b(Redirections)29 b(are)150 4274 y(pro)s(cessed)h(in)f | |
4669 | (the)h(order)g(they)h(app)s(ear,)f(from)g(left)g(to)h(righ)m(t.)275 | |
4670 | 4410 y(In)c(the)i(follo)m(wing)e(descriptions,)h(if)f(the)i(\014le)f | |
4671 | (descriptor)f(n)m(um)m(b)s(er)h(is)f(omitted,)i(and)g(the)f(\014rst)g | |
4672 | (c)m(har-)150 4519 y(acter)42 b(of)f(the)g(redirection)e(op)s(erator)i | |
4673 | (is)f(`)p Fs(<)p Ft(',)j(the)e(redirection)e(refers)i(to)g(the)g | |
4674 | (standard)f(input)e(\(\014le)150 4629 y(descriptor)32 | |
4675 | b(0\).)49 b(If)33 b(the)g(\014rst)f(c)m(haracter)i(of)g(the)f | |
4676 | (redirection)e(op)s(erator)j(is)e(`)p Fs(>)p Ft(',)i(the)f(redirection) | |
4677 | e(refers)150 4739 y(to)g(the)g(standard)e(output)h(\(\014le)g | |
4678 | (descriptor)f(1\).)275 4875 y(The)i(w)m(ord)h(follo)m(wing)f(the)i | |
4679 | (redirection)e(op)s(erator)h(in)f(the)i(follo)m(wing)e(descriptions,)g | |
4680 | (unless)f(other-)150 4984 y(wise)20 b(noted,)j(is)d(sub)5 | |
4681 | b(jected)21 b(to)h(brace)f(expansion,)h(tilde)e(expansion,)i(parameter) | |
4682 | f(expansion,)h(command)150 5094 y(substitution,)29 b(arithmetic)h | |
4683 | (expansion,)g(quote)i(remo)m(v)-5 b(al,)32 b(\014lename)e(expansion,)g | |
4684 | (and)g(w)m(ord)h(splitting.)150 5204 y(If)f(it)g(expands)f(to)i(more)g | |
4685 | (than)f(one)h(w)m(ord,)f(Bash)h(rep)s(orts)e(an)h(error.)275 | |
4686 | 5340 y(Note)h(that)g(the)g(order)f(of)g(redirections)f(is)h | |
4687 | (signi\014can)m(t.)39 b(F)-8 b(or)31 b(example,)g(the)f(command)p | |
4688 | eop | |
4689 | %%Page: 25 31 | |
4690 | 25 30 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4691 | b(Shell)d(F)-8 b(eatures)2246 b(25)390 299 y Fs(ls)47 | |
4692 | b(>)h Fj(dirlist)56 b Fs(2>&1)150 437 y Ft(directs)27 | |
4693 | b(b)s(oth)g(standard)g(output)g(\(\014le)g(descriptor)f(1\))j(and)e | |
4694 | (standard)f(error)i(\(\014le)f(descriptor)f(2\))i(to)h(the)150 | |
4695 | 547 y(\014le)g Fq(dirlist)p Ft(,)f(while)g(the)j(command)390 | |
4696 | 685 y Fs(ls)47 b(2>&1)g(>)g Fj(dirlist)150 823 y Ft(directs)33 | |
4697 | b(only)g(the)g(standard)g(output)g(to)h(\014le)f Fq(dirlist)p | |
4698 | Ft(,)f(b)s(ecause)h(the)h(standard)f(error)g(w)m(as)h(duplicated)150 | |
4699 | 932 y(as)d(standard)e(output)h(b)s(efore)g(the)h(standard)e(output)h(w) | |
4700 | m(as)h(redirected)f(to)h Fq(dirlist)p Ft(.)275 1070 y(Bash)26 | |
4701 | b(handles)e(sev)m(eral)j(\014lenames)e(sp)s(ecially)f(when)i(they)g | |
4702 | (are)g(used)g(in)f(redirections,)h(as)g(describ)s(ed)150 | |
4703 | 1180 y(in)j(the)i(follo)m(wing)d(table:)150 1345 y Fs(/dev/fd/)p | |
4704 | Fj(fd)630 1454 y Ft(If)i Fq(fd)j Ft(is)c(a)i(v)-5 b(alid)29 | |
4705 | b(in)m(teger,)i(\014le)e(descriptor)h Fq(fd)j Ft(is)c(duplicated.)150 | |
4706 | 1617 y Fs(/dev/stdin)630 1727 y Ft(File)h(descriptor)f(0)i(is)e | |
4707 | (duplicated.)150 1890 y Fs(/dev/stdout)630 1999 y Ft(File)h(descriptor) | |
4708 | f(1)i(is)e(duplicated.)150 2162 y Fs(/dev/stderr)630 | |
4709 | 2272 y Ft(File)h(descriptor)f(2)i(is)e(duplicated.)150 | |
4710 | 2435 y Fs(/dev/tcp/)p Fj(host)11 b Fs(/)p Fj(port)630 | |
4711 | 2544 y Ft(If)41 b Fq(host)i Ft(is)e(a)h(v)-5 b(alid)39 | |
4712 | b(hostname)j(or)f(In)m(ternet)h(address,)i(and)c Fq(p)s(ort)j | |
4713 | Ft(is)e(an)g(in)m(teger)h(p)s(ort)630 2654 y(n)m(um)m(b)s(er)i(or)h | |
4714 | (service)g(name,)k(Bash)c(attempts)h(to)g(op)s(en)f(a)g(TCP)g | |
4715 | (connection)g(to)h(the)630 2764 y(corresp)s(onding)28 | |
4716 | b(so)s(c)m(k)m(et.)150 2927 y Fs(/dev/udp/)p Fj(host)11 | |
4717 | b Fs(/)p Fj(port)630 3036 y Ft(If)41 b Fq(host)i Ft(is)e(a)h(v)-5 | |
4718 | b(alid)39 b(hostname)j(or)f(In)m(ternet)h(address,)i(and)c | |
4719 | Fq(p)s(ort)j Ft(is)e(an)g(in)m(teger)h(p)s(ort)630 3146 | |
4720 | y(n)m(um)m(b)s(er)h(or)i(service)f(name,)49 b(Bash)c(attempts)g(to)h | |
4721 | (op)s(en)e(a)h(UDP)g(connection)f(to)i(the)630 3255 y(corresp)s(onding) | |
4722 | 28 b(so)s(c)m(k)m(et.)275 3420 y(A)i(failure)f(to)i(op)s(en)e(or)i | |
4723 | (create)h(a)e(\014le)g(causes)h(the)f(redirection)f(to)i(fail.)150 | |
4724 | 3651 y Fk(3.6.1)63 b(Redirecting)40 b(Input)275 3899 | |
4725 | y Ft(Redirection)33 b(of)h(input)f(causes)h(the)h(\014le)e(whose)h | |
4726 | (name)h(results)e(from)h(the)g(expansion)f(of)i Fq(w)m(ord)i | |
4727 | Ft(to)150 4009 y(b)s(e)d(op)s(ened)g(for)g(reading)f(on)i(\014le)e | |
4728 | (descriptor)h Fs(n)p Ft(,)h(or)g(the)f(standard)g(input)f(\(\014le)h | |
4729 | (descriptor)f(0\))i(if)f Fs(n)g Ft(is)150 4118 y(not)d(sp)s(eci\014ed.) | |
4730 | 275 4256 y(The)e(general)i(format)f(for)h(redirecting)e(input)f(is:)390 | |
4731 | 4394 y Fs([)p Fj(n)11 b Fs(]<)p Fj(word)150 4626 y Fk(3.6.2)63 | |
4732 | b(Redirecting)40 b(Output)275 4873 y Ft(Redirection)29 | |
4733 | b(of)h(output)g(causes)h(the)g(\014le)e(whose)h(name)h(results)e(from)g | |
4734 | (the)i(expansion)e(of)i Fq(w)m(ord)i Ft(to)150 4983 y(b)s(e)e(op)s | |
4735 | (ened)g(for)g(writing)f(on)h(\014le)g(descriptor)f Fq(n)p | |
4736 | Ft(,)i(or)f(the)h(standard)f(output)g(\(\014le)g(descriptor)f(1\))i(if) | |
4737 | f Fq(n)g Ft(is)150 5092 y(not)j(sp)s(eci\014ed.)49 b(If)33 | |
4738 | b(the)h(\014le)f(do)s(es)g(not)h(exist)f(it)g(is)g(created;)k(if)32 | |
4739 | b(it)h(do)s(es)h(exist)f(it)g(is)g(truncated)h(to)g(zero)150 | |
4740 | 5202 y(size.)275 5340 y(The)29 b(general)i(format)f(for)h(redirecting)e | |
4741 | (output)h(is:)p eop | |
4742 | %%Page: 26 32 | |
4743 | 26 31 bop 150 -116 a Ft(26)2572 b(Bash)31 b(Reference)g(Man)m(ual)390 | |
4744 | 299 y Fs([)p Fj(n)11 b Fs(]>[|])p Fj(word)275 426 y Ft(If)30 | |
4745 | b(the)h(redirection)e(op)s(erator)i(is)f(`)p Fs(>)p Ft(',)h(and)f(the)h | |
4746 | Fs(noclobber)d Ft(option)i(to)h(the)g Fs(set)f Ft(builtin)d(has)k(b)s | |
4747 | (een)150 535 y(enabled,)h(the)g(redirection)f(will)e(fail)i(if)g(the)h | |
4748 | (\014le)f(whose)h(name)g(results)f(from)h(the)g(expansion)f(of)h | |
4749 | Fq(w)m(ord)150 645 y Ft(exists)e(and)g(is)f(a)i(regular)f(\014le.)40 | |
4750 | b(If)30 b(the)h(redirection)e(op)s(erator)i(is)e(`)p | |
4751 | Fs(>|)p Ft(',)i(or)f(the)h(redirection)e(op)s(erator)i(is)150 | |
4752 | 754 y(`)p Fs(>)p Ft(')36 b(and)f(the)g Fs(noclobber)e | |
4753 | Ft(option)i(is)g(not)h(enabled,)g(the)f(redirection)f(is)h(attempted)h | |
4754 | (ev)m(en)h(if)d(the)i(\014le)150 864 y(named)30 b(b)m(y)g | |
4755 | Fq(w)m(ord)k Ft(exists.)150 1065 y Fk(3.6.3)63 b(App)s(ending)42 | |
4756 | b(Redirected)e(Output)275 1301 y Ft(Redirection)27 b(of)i(output)f(in)f | |
4757 | (this)h(fashion)f(causes)i(the)g(\014le)f(whose)g(name)h(results)e | |
4758 | (from)h(the)h(expan-)150 1411 y(sion)k(of)g Fq(w)m(ord)k | |
4759 | Ft(to)e(b)s(e)e(op)s(ened)g(for)g(app)s(ending)e(on)j(\014le)e | |
4760 | (descriptor)h Fq(n)p Ft(,)h(or)g(the)f(standard)g(output)g(\(\014le)150 | |
4761 | 1520 y(descriptor)c(1\))i(if)f Fq(n)g Ft(is)f(not)i(sp)s(eci\014ed.)39 | |
4762 | b(If)29 b(the)i(\014le)e(do)s(es)i(not)f(exist)g(it)g(is)g(created.)275 | |
4763 | 1647 y(The)f(general)i(format)f(for)h(app)s(ending)d(output)i(is:)390 | |
4764 | 1774 y Fs([)p Fj(n)11 b Fs(]>>)p Fj(word)150 1975 y Fk(3.6.4)63 | |
4765 | b(Redirecting)40 b(Standard)h(Output)g(and)g(Standard)g(Error)275 | |
4766 | 2211 y Ft(Bash)31 b(allo)m(ws)f(b)s(oth)g(the)h(standard)g(output)f | |
4767 | (\(\014le)h(descriptor)e(1\))j(and)e(the)i(standard)e(error)g(output) | |
4768 | 150 2320 y(\(\014le)c(descriptor)g(2\))i(to)f(b)s(e)g(redirected)f(to)i | |
4769 | (the)f(\014le)f(whose)g(name)h(is)f(the)h(expansion)f(of)h | |
4770 | Fq(w)m(ord)j Ft(with)c(this)150 2430 y(construct.)275 | |
4771 | 2557 y(There)j(are)i(t)m(w)m(o)h(formats)e(for)h(redirecting)e | |
4772 | (standard)g(output)h(and)g(standard)f(error:)390 2684 | |
4773 | y Fs(&>)p Fj(word)150 2810 y Ft(and)390 2937 y Fs(>&)p | |
4774 | Fj(word)150 3064 y Ft(Of)h(the)g(t)m(w)m(o)i(forms,)e(the)h(\014rst)e | |
4775 | (is)h(preferred.)39 b(This)29 b(is)g(seman)m(tically)h(equiv)-5 | |
4776 | b(alen)m(t)30 b(to)390 3190 y Fs(>)p Fj(word)57 b Fs(2>&1)150 | |
4777 | 3391 y Fk(3.6.5)63 b(Here)41 b(Do)s(cumen)m(ts)275 3628 | |
4778 | y Ft(This)27 b(t)m(yp)s(e)i(of)h(redirection)e(instructs)g(the)h(shell) | |
4779 | f(to)i(read)f(input)e(from)i(the)g(curren)m(t)h(source)f(un)m(til)f(a) | |
4780 | 150 3737 y(line)h(con)m(taining)g(only)h Fq(w)m(ord)j | |
4781 | Ft(\(with)c(no)i(trailing)d(blanks\))h(is)g(seen.)41 | |
4782 | b(All)29 b(of)h(the)h(lines)d(read)i(up)f(to)i(that)150 | |
4783 | 3847 y(p)s(oin)m(t)e(are)i(then)f(used)g(as)g(the)h(standard)f(input)e | |
4784 | (for)i(a)h(command.)275 3973 y(The)e(format)i(of)g(here-do)s(cumen)m | |
4785 | (ts)f(is:)390 4100 y Fs(<<[)p Fp(\000)p Fs(])p Fj(word)772 | |
4786 | 4210 y(here-document)390 4319 y(delimiter)275 4446 y | |
4787 | Ft(No)j(parameter)h(expansion,)f(command)g(substitution,)f(arithmetic)h | |
4788 | (expansion,)g(or)g(\014lename)f(ex-)150 4556 y(pansion)i(is)g(p)s | |
4789 | (erformed)f(on)i Fq(w)m(ord)p Ft(.)55 b(If)34 b(an)m(y)i(c)m(haracters) | |
4790 | g(in)e Fq(w)m(ord)k Ft(are)d(quoted,)i(the)e Fq(delimiter)40 | |
4791 | b Ft(is)34 b(the)150 4665 y(result)39 b(of)i(quote)g(remo)m(v)-5 | |
4792 | b(al)41 b(on)f Fq(w)m(ord)p Ft(,)j(and)d(the)g(lines)f(in)g(the)i | |
4793 | (here-do)s(cumen)m(t)f(are)h(not)f(expanded.)150 4775 | |
4794 | y(If)32 b Fq(w)m(ord)k Ft(is)c(unquoted,)g(all)g(lines)f(of)h(the)h | |
4795 | (here-do)s(cumen)m(t)g(are)g(sub)5 b(jected)32 b(to)i(parameter)f | |
4796 | (expansion,)150 4884 y(command)25 b(substitution,)e(and)i(arithmetic)f | |
4797 | (expansion.)38 b(In)24 b(the)h(latter)g(case,)i(the)e(c)m(haracter)i | |
4798 | (sequence)150 4994 y Fs(\\newline)h Ft(is)i(ignored,)f(and)h(`)p | |
4799 | Fs(\\)p Ft(')h(m)m(ust)f(b)s(e)g(used)f(to)i(quote)g(the)g(c)m | |
4800 | (haracters)h(`)p Fs(\\)p Ft(',)e(`)p Fs($)p Ft(',)h(and)f(`)p | |
4801 | Fs(`)p Ft('.)275 5121 y(If)21 b(the)i(redirection)e(op)s(erator)i(is)e | |
4802 | (`)p Fs(<<-)p Ft(',)j(then)e(all)f(leading)g(tab)i(c)m(haracters)h(are) | |
4803 | e(stripp)s(ed)e(from)i(input)150 5230 y(lines)31 b(and)h(the)h(line)f | |
4804 | (con)m(taining)g Fq(delimiter)p Ft(.)46 b(This)31 b(allo)m(ws)h | |
4805 | (here-do)s(cumen)m(ts)h(within)d(shell)i(scripts)f(to)150 | |
4806 | 5340 y(b)s(e)f(inden)m(ted)f(in)g(a)i(natural)e(fashion.)p | |
4807 | eop | |
4808 | %%Page: 27 33 | |
4809 | 27 32 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4810 | b(Shell)d(F)-8 b(eatures)2246 b(27)150 299 y Fk(3.6.6)63 | |
4811 | b(Here)41 b(Strings)275 551 y Ft(A)30 b(v)-5 b(arian)m(t)30 | |
4812 | b(of)h(here)f(do)s(cumen)m(ts,)g(the)h(format)g(is:)390 | |
4813 | 694 y Fs(<<<)47 b Fj(word)275 836 y Ft(The)29 b Fq(w)m(ord)34 | |
4814 | b Ft(is)29 b(expanded)h(and)g(supplied)d(to)k(the)f(command)h(on)f(its) | |
4815 | g(standard)f(input.)150 1077 y Fk(3.6.7)63 b(Duplicating)41 | |
4816 | b(File)g(Descriptors)275 1329 y Ft(The)29 b(redirection)g(op)s(erator) | |
4817 | 390 1471 y Fs([)p Fj(n)11 b Fs(]<&)p Fj(word)150 1614 | |
4818 | y Ft(is)34 b(used)f(to)j(duplicate)d(input)g(\014le)g(descriptors.)52 | |
4819 | b(If)34 b Fq(w)m(ord)k Ft(expands)c(to)h(one)g(or)g(more)g(digits,)f | |
4820 | (the)h(\014le)150 1724 y(descriptor)d(denoted)i(b)m(y)g | |
4821 | Fq(n)f Ft(is)f(made)i(to)g(b)s(e)f(a)h(cop)m(y)g(of)g(that)g(\014le)f | |
4822 | (descriptor.)49 b(If)33 b(the)h(digits)e(in)g Fq(w)m(ord)150 | |
4823 | 1833 y Ft(do)d(not)h(sp)s(ecify)e(a)i(\014le)e(descriptor)g(op)s(en)h | |
4824 | (for)g(input,)f(a)i(redirection)e(error)h(o)s(ccurs.)40 | |
4825 | b(If)29 b Fq(w)m(ord)j Ft(ev)-5 b(aluates)150 1943 y(to)31 | |
4826 | b(`)p Fs(-)p Ft(',)g(\014le)f(descriptor)g Fq(n)g Ft(is)f(closed.)42 | |
4827 | b(If)30 b Fq(n)g Ft(is)f(not)i(sp)s(eci\014ed,)e(the)i(standard)f | |
4828 | (input)f(\(\014le)h(descriptor)f(0\))150 2052 y(is)g(used.)275 | |
4829 | 2195 y(The)g(op)s(erator)390 2337 y Fs([)p Fj(n)11 b | |
4830 | Fs(]>&)p Fj(word)150 2480 y Ft(is)39 b(used)h(similarly)d(to)k | |
4831 | (duplicate)d(output)i(\014le)g(descriptors.)69 b(If)40 | |
4832 | b Fq(n)f Ft(is)h(not)g(sp)s(eci\014ed,)h(the)g(standard)150 | |
4833 | 2590 y(output)30 b(\(\014le)f(descriptor)g(1\))i(is)e(used.)39 | |
4834 | b(If)30 b(the)g(digits)f(in)f Fq(w)m(ord)34 b Ft(do)29 | |
4835 | b(not)i(sp)s(ecify)d(a)j(\014le)e(descriptor)g(op)s(en)150 | |
4836 | 2699 y(for)38 b(output,)i(a)e(redirection)f(error)h(o)s(ccurs.)63 | |
4837 | b(As)38 b(a)h(sp)s(ecial)d(case,)42 b(if)37 b Fq(n)g | |
4838 | Ft(is)g(omitted,)k(and)c Fq(w)m(ord)k Ft(do)s(es)150 | |
4839 | 2809 y(not)28 b(expand)f(to)i(one)f(or)f(more)h(digits,)g(the)g | |
4840 | (standard)e(output)i(and)f(standard)g(error)g(are)i(redirected)e(as)150 | |
4841 | 2918 y(describ)s(ed)h(previously)-8 b(.)150 3159 y Fk(3.6.8)63 | |
4842 | b(Mo)m(ving)41 b(File)h(Descriptors)275 3411 y Ft(The)29 | |
4843 | b(redirection)g(op)s(erator)390 3554 y Fs([)p Fj(n)11 | |
4844 | b Fs(]<&)p Fj(digit)p Fs(-)150 3696 y Ft(mo)m(v)m(es)33 | |
4845 | b(the)f(\014le)f(descriptor)f Fq(digit)j Ft(to)f(\014le)f(descriptor)g | |
4846 | Fq(n)p Ft(,)g(or)h(the)g(standard)f(input)e(\(\014le)j(descriptor)e | |
4847 | (0\))150 3806 y(if)f Fq(n)h Ft(is)g(not)g(sp)s(eci\014ed.)39 | |
4848 | b Fq(digit)31 b Ft(is)f(closed)g(after)h(b)s(eing)e(duplicated)f(to)j | |
4849 | Fq(n)p Ft(.)275 3948 y(Similarly)-8 b(,)27 b(the)j(redirection)f(op)s | |
4850 | (erator)390 4091 y Fs([)p Fj(n)11 b Fs(]>&)p Fj(digit)p | |
4851 | Fs(-)150 4233 y Ft(mo)m(v)m(es)29 b(the)g(\014le)e(descriptor)f | |
4852 | Fq(digit)j Ft(to)g(\014le)e(descriptor)g Fq(n)p Ft(,)h(or)g(the)g | |
4853 | (standard)f(output)h(\(\014le)f(descriptor)g(1\))150 | |
4854 | 4343 y(if)i Fq(n)h Ft(is)g(not)g(sp)s(eci\014ed.)150 | |
4855 | 4583 y Fk(3.6.9)63 b(Op)s(ening)42 b(File)f(Descriptors)h(for)f | |
4856 | (Reading)g(and)g(W)-10 b(riting)275 4836 y Ft(The)29 | |
4857 | b(redirection)g(op)s(erator)390 4978 y Fs([)p Fj(n)11 | |
4858 | b Fs(]<>)p Fj(word)150 5121 y Ft(causes)39 b(the)g(\014le)f(whose)h | |
4859 | (name)g(is)f(the)h(expansion)f(of)h Fq(w)m(ord)j Ft(to)d(b)s(e)g(op)s | |
4860 | (ened)f(for)g(b)s(oth)h(reading)f(and)150 5230 y(writing)31 | |
4861 | b(on)h(\014le)g(descriptor)f Fq(n)p Ft(,)i(or)g(on)f(\014le)g | |
4862 | (descriptor)g(0)h(if)e Fq(n)h Ft(is)g(not)h(sp)s(eci\014ed.)46 | |
4863 | b(If)32 b(the)h(\014le)e(do)s(es)i(not)150 5340 y(exist,)d(it)g(is)g | |
4864 | (created.)p eop | |
4865 | %%Page: 28 34 | |
4866 | 28 33 bop 150 -116 a Ft(28)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
4867 | 299 y Fr(3.7)68 b(Executing)46 b(Commands)150 632 y Fk(3.7.1)63 | |
4868 | b(Simple)40 b(Command)g(Expansion)275 876 y Ft(When)35 | |
4869 | b(a)h(simple)d(command)j(is)e(executed,)k(the)e(shell)e(p)s(erforms)g | |
4870 | (the)i(follo)m(wing)e(expansions,)h(as-)150 985 y(signmen)m(ts,)30 | |
4871 | b(and)g(redirections,)f(from)h(left)g(to)h(righ)m(t.)199 | |
4872 | 1119 y(1.)61 b(The)38 b(w)m(ords)f(that)i(the)g(parser)e(has)h(mark)m | |
4873 | (ed)g(as)h(v)-5 b(ariable)37 b(assignmen)m(ts)h(\(those)h(preceding)e | |
4874 | (the)330 1229 y(command)30 b(name\))h(and)f(redirections)f(are)h(sa)m | |
4875 | (v)m(ed)i(for)e(later)g(pro)s(cessing.)199 1363 y(2.)61 | |
4876 | b(The)39 b(w)m(ords)g(that)i(are)f(not)g(v)-5 b(ariable)38 | |
4877 | b(assignmen)m(ts)i(or)f(redirections)g(are)h(expanded)f(\(see)h(Sec-) | |
4878 | 330 1473 y(tion)c(3.5)j([Shell)c(Expansions],)i(page)h(16\).)61 | |
4879 | b(If)37 b(an)m(y)g(w)m(ords)f(remain)g(after)i(expansion,)g(the)f | |
4880 | (\014rst)330 1582 y(w)m(ord)31 b(is)f(tak)m(en)i(to)g(b)s(e)f(the)g | |
4881 | (name)h(of)f(the)h(command)f(and)f(the)i(remaining)d(w)m(ords)i(are)g | |
4882 | (the)h(argu-)330 1692 y(men)m(ts.)199 1826 y(3.)61 b(Redirections)23 | |
4883 | b(are)h(p)s(erformed)f(as)h(describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)g | |
4884 | (Section)f(3.6)h([Redirections],)g(page)f(24\).)199 1961 | |
4885 | y(4.)61 b(The)25 b(text)h(after)f(the)g(`)p Fs(=)p Ft(')h(in)d(eac)m(h) | |
4886 | k(v)-5 b(ariable)23 b(assignmen)m(t)i(undergo)s(es)f(tilde)g | |
4887 | (expansion,)h(parameter)330 2070 y(expansion,)48 b(command)e | |
4888 | (substitution,)h(arithmetic)d(expansion,)49 b(and)c(quote)h(remo)m(v)-5 | |
4889 | b(al)45 b(b)s(efore)330 2180 y(b)s(eing)29 b(assigned)h(to)h(the)f(v)-5 | |
4890 | b(ariable.)275 2339 y(If)32 b(no)i(command)f(name)g(results,)g(the)h(v) | |
4891 | -5 b(ariable)32 b(assignmen)m(ts)h(a\013ect)i(the)f(curren)m(t)f(shell) | |
4892 | f(en)m(viron-)150 2448 y(men)m(t.)39 b(Otherwise,)26 | |
4893 | b(the)f(v)-5 b(ariables)24 b(are)i(added)f(to)h(the)f(en)m(vironmen)m | |
4894 | (t)g(of)h(the)f(executed)h(command)g(and)150 2558 y(do)35 | |
4895 | b(not)f(a\013ect)j(the)d(curren)m(t)h(shell)e(en)m(vironmen)m(t.)53 | |
4896 | b(If)34 b(an)m(y)h(of)g(the)f(assignmen)m(ts)h(attempts)g(to)h(assign) | |
4897 | 150 2667 y(a)j(v)-5 b(alue)38 b(to)h(a)g(readonly)e(v)-5 | |
4898 | b(ariable,)40 b(an)e(error)g(o)s(ccurs,)j(and)c(the)i(command)f(exits)g | |
4899 | (with)g(a)g(non-zero)150 2777 y(status.)275 2911 y(If)33 | |
4900 | b(no)g(command)g(name)h(results,)f(redirections)f(are)i(p)s(erformed,)f | |
4901 | (but)g(do)h(not)f(a\013ect)i(the)f(curren)m(t)150 3021 | |
4902 | y(shell)29 b(en)m(vironmen)m(t.)40 b(A)30 b(redirection)f(error)h | |
4903 | (causes)h(the)g(command)f(to)h(exit)f(with)f(a)i(non-zero)g(status.)275 | |
4904 | 3155 y(If)26 b(there)i(is)e(a)i(command)f(name)h(left)f(after)h | |
4905 | (expansion,)f(execution)h(pro)s(ceeds)f(as)g(describ)s(ed)e(b)s(elo)m | |
4906 | (w.)150 3265 y(Otherwise,)38 b(the)f(command)g(exits.)61 | |
4907 | b(If)37 b(one)g(of)g(the)h(expansions)e(con)m(tained)h(a)h(command)f | |
4908 | (substitu-)150 3374 y(tion,)h(the)e(exit)g(status)h(of)f(the)h(command) | |
4909 | f(is)g(the)g(exit)g(status)h(of)f(the)h(last)f(command)g(substitution) | |
4910 | 150 3484 y(p)s(erformed.)55 b(If)35 b(there)g(w)m(ere)h(no)g(command)f | |
4911 | (substitutions,)g(the)g(command)h(exits)f(with)f(a)i(status)g(of)150 | |
4912 | 3593 y(zero.)150 3817 y Fk(3.7.2)63 b(Command)39 b(Searc)m(h)h(and)h | |
4913 | (Execution)275 4061 y Ft(After)35 b(a)h(command)f(has)h(b)s(een)e | |
4914 | (split)g(in)m(to)h(w)m(ords,)i(if)d(it)h(results)g(in)f(a)i(simple)d | |
4915 | (command)i(and)g(an)150 4170 y(optional)30 b(list)f(of)h(argumen)m(ts,) | |
4916 | h(the)g(follo)m(wing)d(actions)j(are)g(tak)m(en.)199 | |
4917 | 4304 y(1.)61 b(If)24 b(the)g(command)g(name)g(con)m(tains)h(no)f | |
4918 | (slashes,)h(the)f(shell)f(attempts)i(to)g(lo)s(cate)g(it.)38 | |
4919 | b(If)24 b(there)g(exists)330 4414 y(a)h(shell)e(function)g(b)m(y)h | |
4920 | (that)h(name,)h(that)f(function)e(is)h(in)m(v)m(ok)m(ed)h(as)f(describ) | |
4921 | s(ed)f(in)g(Section)h(3.3)i([Shell)330 4524 y(F)-8 b(unctions],)30 | |
4922 | b(page)i(13.)199 4658 y(2.)61 b(If)41 b(the)g(name)h(do)s(es)f(not)g | |
4923 | (matc)m(h)i(a)e(function,)i(the)f(shell)d(searc)m(hes)k(for)e(it)g(in)f | |
4924 | (the)h(list)f(of)i(shell)330 4767 y(builtins.)37 b(If)30 | |
4925 | b(a)h(matc)m(h)g(is)e(found,)h(that)h(builtin)c(is)i(in)m(v)m(ok)m(ed.) | |
4926 | 199 4902 y(3.)61 b(If)40 b(the)g(name)h(is)e(neither)h(a)g(shell)f | |
4927 | (function)g(nor)h(a)g(builtin,)g(and)g(con)m(tains)g(no)h(slashes,)h | |
4928 | (Bash)330 5011 y(searc)m(hes)d(eac)m(h)g(elemen)m(t)f(of)h | |
4929 | Fs($PATH)d Ft(for)i(a)g(directory)g(con)m(taining)f(an)h(executable)g | |
4930 | (\014le)f(b)m(y)h(that)330 5121 y(name.)56 b(Bash)36 | |
4931 | b(uses)f(a)h(hash)e(table)i(to)g(remem)m(b)s(er)f(the)h(full)d | |
4932 | (pathnames)i(of)h(executable)g(\014les)e(to)330 5230 | |
4933 | y(a)m(v)m(oid)e(m)m(ultiple)d Fs(PATH)i Ft(searc)m(hes)i(\(see)f(the)g | |
4934 | (description)e(of)h Fs(hash)g Ft(in)f(Section)i(4.1)g([Bourne)g(Shell) | |
4935 | 330 5340 y(Builtins],)i(page)i(33\).)55 b(A)35 b(full)e(searc)m(h)i(of) | |
4936 | g(the)g(directories)f(in)g Fs($PATH)f Ft(is)h(p)s(erformed)g(only)g(if) | |
4937 | g(the)p eop | |
4938 | %%Page: 29 35 | |
4939 | 29 34 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
4940 | b(Shell)d(F)-8 b(eatures)2246 b(29)330 299 y(command)31 | |
4941 | b(is)f(not)h(found)f(in)f(the)j(hash)e(table.)42 b(If)31 | |
4942 | b(the)g(searc)m(h)h(is)e(unsuccessful,)f(the)i(shell)e(prin)m(ts)330 | |
4943 | 408 y(an)h(error)g(message)i(and)e(returns)f(an)h(exit)g(status)h(of)f | |
4944 | (127.)199 544 y(4.)61 b(If)33 b(the)g(searc)m(h)h(is)f(successful,)g | |
4945 | (or)g(if)f(the)i(command)f(name)g(con)m(tains)h(one)g(or)f(more)g | |
4946 | (slashes,)h(the)330 653 y(shell)f(executes)j(the)f(named)f(program)g | |
4947 | (in)g(a)h(separate)h(execution)e(en)m(vironmen)m(t.)54 | |
4948 | b(Argumen)m(t)35 b(0)330 763 y(is)29 b(set)i(to)h(the)e(name)h(giv)m | |
4949 | (en,)f(and)g(the)h(remaining)d(argumen)m(ts)j(to)g(the)g(command)f(are) | |
4950 | h(set)g(to)g(the)330 872 y(argumen)m(ts)g(supplied,)c(if)i(an)m(y)-8 | |
4951 | b(.)199 1008 y(5.)61 b(If)35 b(this)g(execution)h(fails)e(b)s(ecause)i | |
4952 | (the)f(\014le)g(is)g(not)h(in)e(executable)j(format,)g(and)e(the)h | |
4953 | (\014le)f(is)g(not)330 1117 y(a)e(directory)-8 b(,)33 | |
4954 | b(it)f(is)g(assumed)f(to)j(b)s(e)d(a)i Fq(shell)e(script)i | |
4955 | Ft(and)f(the)h(shell)d(executes)k(it)e(as)h(describ)s(ed)d(in)330 | |
4956 | 1227 y(Section)g(3.8)i([Shell)c(Scripts],)h(page)j(31.)199 | |
4957 | 1362 y(6.)61 b(If)38 b(the)h(command)f(w)m(as)h(not)g(b)s(egun)e(async) | |
4958 | m(hronously)-8 b(,)41 b(the)d(shell)f(w)m(aits)i(for)f(the)h(command)f | |
4959 | (to)330 1472 y(complete)31 b(and)f(collects)g(its)g(exit)g(status.)150 | |
4960 | 1698 y Fk(3.7.3)63 b(Command)39 b(Execution)h(En)m(vironmen)m(t)275 | |
4961 | 1944 y Ft(The)29 b(shell)g(has)h(an)g Fq(execution)h(en)m(vironmen)m(t) | |
4962 | p Ft(,)f(whic)m(h)f(consists)h(of)h(the)f(follo)m(wing:)225 | |
4963 | 2080 y Fp(\017)60 b Ft(op)s(en)32 b(\014les)f(inherited)f(b)m(y)j(the)f | |
4964 | (shell)f(at)i(in)m(v)m(o)s(cation,)h(as)e(mo)s(di\014ed)f(b)m(y)h | |
4965 | (redirections)f(supplied)e(to)330 2189 y(the)i Fs(exec)e | |
4966 | Ft(builtin)225 2325 y Fp(\017)60 b Ft(the)28 b(curren)m(t)g(w)m(orking) | |
4967 | g(directory)g(as)g(set)h(b)m(y)f Fs(cd)p Ft(,)g Fs(pushd)p | |
4968 | Ft(,)g(or)g Fs(popd)p Ft(,)g(or)g(inherited)e(b)m(y)i(the)h(shell)d(at) | |
4969 | 330 2434 y(in)m(v)m(o)s(cation)225 2569 y Fp(\017)60 | |
4970 | b Ft(the)31 b(\014le)e(creation)i(mo)s(de)f(mask)g(as)h(set)g(b)m(y)f | |
4971 | Fs(umask)f Ft(or)h(inherited)e(from)i(the)h(shell's)d(paren)m(t)225 | |
4972 | 2705 y Fp(\017)60 b Ft(curren)m(t)30 b(traps)g(set)h(b)m(y)f | |
4973 | Fs(trap)225 2840 y Fp(\017)60 b Ft(shell)28 b(parameters)h(that)h(are)g | |
4974 | (set)g(b)m(y)g(v)-5 b(ariable)28 b(assignmen)m(t)h(or)h(with)e | |
4975 | Fs(set)g Ft(or)i(inherited)d(from)i(the)330 2949 y(shell's)g(paren)m(t) | |
4976 | h(in)f(the)i(en)m(vironmen)m(t)225 3084 y Fp(\017)60 | |
4977 | b Ft(shell)42 b(functions)g(de\014ned)g(during)g(execution)i(or)f | |
4978 | (inherited)f(from)h(the)h(shell's)e(paren)m(t)h(in)g(the)330 | |
4979 | 3194 y(en)m(vironmen)m(t)225 3329 y Fp(\017)60 b Ft(options)32 | |
4980 | b(enabled)g(at)i(in)m(v)m(o)s(cation)f(\(either)g(b)m(y)g(default)f(or) | |
4981 | h(with)f(command-line)f(argumen)m(ts\))j(or)330 3439 | |
4982 | y(b)m(y)c Fs(set)225 3574 y Fp(\017)60 b Ft(options)30 | |
4983 | b(enabled)f(b)m(y)h Fs(shopt)225 3709 y Fp(\017)60 b | |
4984 | Ft(shell)29 b(aliases)g(de\014ned)h(with)f Fs(alias)g | |
4985 | Ft(\(see)i(Section)f(6.6)i([Aliases],)e(page)h(71\))225 | |
4986 | 3844 y Fp(\017)60 b Ft(v)-5 b(arious)49 b(pro)s(cess)g | |
4987 | Fl(id)p Ft(s,)55 b(including)46 b(those)51 b(of)e(bac)m(kground)h(jobs) | |
4988 | f(\(see)i(Section)f(3.2.3)h([Lists],)330 3954 y(page)31 | |
4989 | b(9\),)g(the)g(v)-5 b(alue)30 b(of)g Fs($$)p Ft(,)g(and)g(the)h(v)-5 | |
4990 | b(alue)30 b(of)g Fs($PPID)275 4115 y Ft(When)k(a)g(simple)f(command)h | |
4991 | (other)g(than)g(a)h(builtin)c(or)j(shell)f(function)g(is)g(to)i(b)s(e)f | |
4992 | (executed,)i(it)e(is)150 4225 y(in)m(v)m(ok)m(ed)24 b(in)f(a)h | |
4993 | (separate)h(execution)f(en)m(vironmen)m(t)g(that)g(consists)f(of)i(the) | |
4994 | f(follo)m(wing.)37 b(Unless)23 b(otherwise)150 4335 y(noted,)31 | |
4995 | b(the)f(v)-5 b(alues)30 b(are)h(inherited)d(from)i(the)g(shell.)225 | |
4996 | 4470 y Fp(\017)60 b Ft(the)31 b(shell's)f(op)s(en)g(\014les,)h(plus)e | |
4997 | (an)m(y)i(mo)s(di\014cations)f(and)g(additions)f(sp)s(eci\014ed)h(b)m | |
4998 | (y)h(redirections)e(to)330 4580 y(the)i(command)225 4715 | |
4999 | y Fp(\017)60 b Ft(the)31 b(curren)m(t)f(w)m(orking)f(directory)225 | |
5000 | 4850 y Fp(\017)60 b Ft(the)31 b(\014le)e(creation)i(mo)s(de)f(mask)225 | |
5001 | 4986 y Fp(\017)60 b Ft(shell)30 b(v)-5 b(ariables)31 | |
5002 | b(and)g(functions)g(mark)m(ed)h(for)g(exp)s(ort,)g(along)g(with)f(v)-5 | |
5003 | b(ariables)30 b(exp)s(orted)i(for)g(the)330 5095 y(command,)e(passed)g | |
5004 | (in)f(the)i(en)m(vironmen)m(t)f(\(see)h(Section)f(3.7.4)j([En)m | |
5005 | (vironmen)m(t],)d(page)h(30\))225 5230 y Fp(\017)60 b | |
5006 | Ft(traps)31 b(caugh)m(t)h(b)m(y)f(the)g(shell)f(are)h(reset)h(to)g(the) | |
5007 | f(v)-5 b(alues)31 b(inherited)d(from)j(the)g(shell's)f(paren)m(t,)i | |
5008 | (and)330 5340 y(traps)e(ignored)g(b)m(y)g(the)g(shell)f(are)i(ignored)p | |
5009 | eop | |
5010 | %%Page: 30 36 | |
5011 | 30 35 bop 150 -116 a Ft(30)2572 b(Bash)31 b(Reference)g(Man)m(ual)275 | |
5012 | 299 y(A)41 b(command)g(in)m(v)m(ok)m(ed)h(in)e(this)h(separate)h(en)m | |
5013 | (vironmen)m(t)f(cannot)h(a\013ect)h(the)f(shell's)e(execution)150 | |
5014 | 408 y(en)m(vironmen)m(t.)275 540 y(Command)35 b(substitution,)h | |
5015 | (commands)g(group)s(ed)f(with)h(paren)m(theses,)i(and)e(async)m | |
5016 | (hronous)g(com-)150 650 y(mands)c(are)h(in)m(v)m(ok)m(ed)h(in)d(a)j | |
5017 | (subshell)c(en)m(vironmen)m(t)i(that)i(is)e(a)h(duplicate)f(of)h(the)g | |
5018 | (shell)e(en)m(vironmen)m(t,)150 760 y(except)k(that)g(traps)f(caugh)m | |
5019 | (t)h(b)m(y)f(the)h(shell)d(are)i(reset)h(to)g(the)f(v)-5 | |
5020 | b(alues)34 b(that)h(the)f(shell)f(inherited)e(from)150 | |
5021 | 869 y(its)h(paren)m(t)g(at)h(in)m(v)m(o)s(cation.)47 | |
5022 | b(Builtin)29 b(commands)j(that)h(are)g(in)m(v)m(ok)m(ed)g(as)f(part)g | |
5023 | (of)h(a)f(pip)s(eline)d(are)k(also)150 979 y(executed)41 | |
5024 | b(in)e(a)i(subshell)c(en)m(vironmen)m(t.)71 b(Changes)40 | |
5025 | b(made)g(to)h(the)g(subshell)c(en)m(vironmen)m(t)j(cannot)150 | |
5026 | 1088 y(a\013ect)32 b(the)f(shell's)d(execution)j(en)m(vironmen)m(t.)275 | |
5027 | 1220 y(If)38 b(a)h(command)f(is)f(follo)m(w)m(ed)i(b)m(y)f(a)h(`)p | |
5028 | Fs(&)p Ft(')g(and)f(job)g(con)m(trol)h(is)e(not)i(activ)m(e,)j(the)d | |
5029 | (default)f(standard)150 1330 y(input)e(for)h(the)h(command)f(is)g(the)h | |
5030 | (empt)m(y)g(\014le)e(`)p Fs(/dev/null)p Ft('.)61 b(Otherwise,)38 | |
5031 | b(the)g(in)m(v)m(ok)m(ed)g(command)150 1440 y(inherits)28 | |
5032 | b(the)j(\014le)e(descriptors)g(of)i(the)f(calling)f(shell)g(as)h(mo)s | |
5033 | (di\014ed)f(b)m(y)h(redirections.)150 1656 y Fk(3.7.4)63 | |
5034 | b(En)m(vironmen)m(t)275 1898 y Ft(When)31 b(a)g(program)h(is)e(in)m(v)m | |
5035 | (ok)m(ed)i(it)f(is)f(giv)m(en)h(an)h(arra)m(y)g(of)f(strings)f(called)h | |
5036 | (the)g Fq(en)m(vironmen)m(t)p Ft(.)44 b(This)150 2007 | |
5037 | y(is)29 b(a)i(list)e(of)i(name-v)-5 b(alue)30 b(pairs,)f(of)i(the)f | |
5038 | (form)g Fs(name=value)p Ft(.)275 2139 y(Bash)39 b(pro)m(vides)f(sev)m | |
5039 | (eral)i(w)m(a)m(ys)h(to)f(manipulate)d(the)j(en)m(vironmen)m(t.)68 | |
5040 | b(On)38 b(in)m(v)m(o)s(cation,)k(the)e(shell)150 2249 | |
5041 | y(scans)g(its)g(o)m(wn)g(en)m(vironmen)m(t)g(and)g(creates)i(a)f | |
5042 | (parameter)f(for)g(eac)m(h)i(name)e(found,)i(automatically)150 | |
5043 | 2359 y(marking)25 b(it)g(for)h Fq(exp)s(ort)h Ft(to)g(c)m(hild)d(pro)s | |
5044 | (cesses.)39 b(Executed)26 b(commands)g(inherit)e(the)i(en)m(vironmen)m | |
5045 | (t.)38 b(The)150 2468 y Fs(export)d Ft(and)i(`)p Fs(declare)29 | |
5046 | b(-x)p Ft(')36 b(commands)h(allo)m(w)g(parameters)g(and)g(functions)f | |
5047 | (to)i(b)s(e)e(added)h(to)h(and)150 2578 y(deleted)20 | |
5048 | b(from)g(the)h(en)m(vironmen)m(t.)37 b(If)20 b(the)h(v)-5 | |
5049 | b(alue)20 b(of)h(a)g(parameter)g(in)e(the)h(en)m(vironmen)m(t)h(is)e | |
5050 | (mo)s(di\014ed,)i(the)150 2687 y(new)31 b(v)-5 b(alue)31 | |
5051 | b(b)s(ecomes)g(part)h(of)f(the)h(en)m(vironmen)m(t,)f(replacing)g(the)g | |
5052 | (old.)43 b(The)31 b(en)m(vironmen)m(t)g(inherited)150 | |
5053 | 2797 y(b)m(y)g(an)m(y)g(executed)h(command)f(consists)f(of)h(the)g | |
5054 | (shell's)f(initial)e(en)m(vironmen)m(t,)j(whose)g(v)-5 | |
5055 | b(alues)30 b(ma)m(y)i(b)s(e)150 2907 y(mo)s(di\014ed)25 | |
5056 | b(in)g(the)i(shell,)f(less)g(an)m(y)h(pairs)e(remo)m(v)m(ed)j(b)m(y)f | |
5057 | (the)g Fs(unset)e Ft(and)h(`)p Fs(export)j(-n)p Ft(')e(commands,)g | |
5058 | (plus)150 3016 y(an)m(y)k(additions)d(via)i(the)h Fs(export)d | |
5059 | Ft(and)i(`)p Fs(declare)f(-x)p Ft(')h(commands.)275 3148 | |
5060 | y(The)j(en)m(vironmen)m(t)h(for)g(an)m(y)g(simple)f(command)h(or)g | |
5061 | (function)f(ma)m(y)h(b)s(e)g(augmen)m(ted)h(temp)s(orarily)150 | |
5062 | 3258 y(b)m(y)c(pre\014xing)d(it)i(with)g(parameter)h(assignmen)m(ts,)g | |
5063 | (as)f(describ)s(ed)f(in)g(Section)i(3.4)h([Shell)c(P)m(arameters],)150 | |
5064 | 3367 y(page)i(15.)41 b(These)29 b(assignmen)m(t)h(statemen)m(ts)h | |
5065 | (a\013ect)f(only)f(the)g(en)m(vironmen)m(t)g(seen)h(b)m(y)f(that)h | |
5066 | (command.)275 3499 y(If)h(the)i(`)p Fs(-k)p Ft(')f(option)g(is)f(set)i | |
5067 | (\(see)g(Section)f(4.3)h([The)f(Set)h(Builtin],)d(page)j(50\),)h(then)e | |
5068 | (all)f(parameter)150 3609 y(assignmen)m(ts)e(are)h(placed)g(in)e(the)i | |
5069 | (en)m(vironmen)m(t)f(for)h(a)g(command,)f(not)h(just)f(those)i(that)f | |
5070 | (precede)g(the)150 3719 y(command)g(name.)275 3851 y(When)f(Bash)h(in)m | |
5071 | (v)m(ok)m(es)h(an)f(external)f(command,)h(the)g(v)-5 | |
5072 | b(ariable)29 b(`)p Fs($_)p Ft(')h(is)f(set)h(to)h(the)f(full)d(path)j | |
5073 | (name)150 3960 y(of)h(the)f(command)g(and)g(passed)g(to)h(that)g | |
5074 | (command)f(in)f(its)h(en)m(vironmen)m(t.)150 4177 y Fk(3.7.5)63 | |
5075 | b(Exit)40 b(Status)275 4418 y Ft(F)-8 b(or)32 b(the)g(shell's)e(purp)s | |
5076 | (oses,)g(a)j(command)e(whic)m(h)g(exits)g(with)g(a)h(zero)g(exit)g | |
5077 | (status)g(has)f(succeeded.)150 4528 y(A)e(non-zero)h(exit)f(status)h | |
5078 | (indicates)e(failure.)38 b(This)27 b(seemingly)h(coun)m(ter-in)m | |
5079 | (tuitiv)m(e)h(sc)m(heme)h(is)e(used)h(so)150 4638 y(there)34 | |
5080 | b(is)f(one)h(w)m(ell-de\014ned)e(w)m(a)m(y)i(to)h(indicate)e(success)h | |
5081 | (and)f(a)h(v)-5 b(ariet)m(y)34 b(of)g(w)m(a)m(ys)h(to)f(indicate)f(v)-5 | |
5082 | b(arious)150 4747 y(failure)36 b(mo)s(des.)62 b(When)38 | |
5083 | b(a)g(command)f(terminates)h(on)f(a)i(fatal)f(signal)e(whose)i(n)m(um)m | |
5084 | (b)s(er)e(is)h Fq(N)p Ft(,)h(Bash)150 4857 y(uses)30 | |
5085 | b(the)g(v)-5 b(alue)30 b(128)p Fs(+)p Fq(N)42 b Ft(as)30 | |
5086 | b(the)h(exit)f(status.)275 4989 y(If)35 b(a)h(command)g(is)f(not)h | |
5087 | (found,)g(the)g(c)m(hild)f(pro)s(cess)g(created)i(to)g(execute)g(it)f | |
5088 | (returns)e(a)j(status)f(of)150 5098 y(127.)42 b(If)30 | |
5089 | b(a)h(command)f(is)f(found)g(but)h(is)f(not)i(executable,)g(the)g | |
5090 | (return)e(status)i(is)e(126.)275 5230 y(If)j(a)i(command)f(fails)e(b)s | |
5091 | (ecause)i(of)h(an)f(error)f(during)f(expansion)h(or)h(redirection,)g | |
5092 | (the)h(exit)f(status)150 5340 y(is)c(greater)j(than)e(zero.)p | |
5093 | eop | |
5094 | %%Page: 31 37 | |
5095 | 31 36 bop 150 -116 a Ft(Chapter)30 b(3:)41 b(Basic)31 | |
5096 | b(Shell)d(F)-8 b(eatures)2246 b(31)275 299 y(The)38 b(exit)g(status)h | |
5097 | (is)f(used)g(b)m(y)g(the)h(Bash)g(conditional)e(commands)h(\(see)h | |
5098 | (Section)g(3.2.4.2)i([Con-)150 408 y(ditional)f(Constructs],)k(page)f | |
5099 | (10\))g(and)e(some)i(of)f(the)g(list)e(constructs)i(\(see)h(Section)e | |
5100 | (3.2.3)j([Lists],)150 518 y(page)31 b(9\).)275 651 y(All)38 | |
5101 | b(of)i(the)h(Bash)f(builtins)c(return)j(an)h(exit)g(status)h(of)f(zero) | |
5102 | h(if)e(they)h(succeed)g(and)g(a)g(non-zero)150 760 y(status)34 | |
5103 | b(on)f(failure,)g(so)h(they)g(ma)m(y)g(b)s(e)f(used)g(b)m(y)g(the)h | |
5104 | (conditional)e(and)h(list)f(constructs.)50 b(All)33 b(builtins)150 | |
5105 | 870 y(return)c(an)i(exit)f(status)h(of)f(2)h(to)g(indicate)e(incorrect) | |
5106 | i(usage.)150 1089 y Fk(3.7.6)63 b(Signals)275 1332 y | |
5107 | Ft(When)27 b(Bash)h(is)g(in)m(teractiv)m(e,)h(in)e(the)h(absence)h(of)f | |
5108 | (an)m(y)g(traps,)h(it)e(ignores)h Fs(SIGTERM)e Ft(\(so)i(that)h(`)p | |
5109 | Fs(kill)150 1441 y(0)p Ft(')k(do)s(es)g(not)g(kill)d(an)j(in)m | |
5110 | (teractiv)m(e)h(shell\),)f(and)f Fs(SIGINT)f Ft(is)h(caugh)m(t)i(and)f | |
5111 | (handled)e(\(so)i(that)h(the)f Fs(wait)150 1551 y Ft(builtin)21 | |
5112 | b(is)j(in)m(terruptible\).)36 b(When)24 b(Bash)g(receiv)m(es)i(a)e | |
5113 | Fs(SIGINT)p Ft(,)h(it)f(breaks)g(out)h(of)f(an)m(y)h(executing)g(lo)s | |
5114 | (ops.)150 1660 y(In)31 b(all)f(cases,)j(Bash)f(ignores)f | |
5115 | Fs(SIGQUIT)p Ft(.)42 b(If)32 b(job)f(con)m(trol)h(is)e(in)h(e\013ect)i | |
5116 | (\(see)f(Chapter)f(7)h([Job)g(Con)m(trol],)150 1770 y(page)f(79\),)h | |
5117 | (Bash)e(ignores)g Fs(SIGTTIN)p Ft(,)f Fs(SIGTTOU)p Ft(,)g(and)g | |
5118 | Fs(SIGTSTP)p Ft(.)275 1903 y(Non-builtin)f(commands)j(started)g(b)m(y)g | |
5119 | (Bash)h(ha)m(v)m(e)g(signal)e(handlers)f(set)j(to)g(the)g(v)-5 | |
5120 | b(alues)30 b(inherited)150 2012 y(b)m(y)37 b(the)h(shell)e(from)h(its)g | |
5121 | (paren)m(t.)62 b(When)38 b(job)f(con)m(trol)h(is)e(not)i(in)e | |
5122 | (e\013ect,)41 b(async)m(hronous)c(commands)150 2122 y(ignore)e | |
5123 | Fs(SIGINT)f Ft(and)h Fs(SIGQUIT)e Ft(in)i(addition)e(to)k(these)f | |
5124 | (inherited)d(handlers.)54 b(Commands)35 b(run)f(as)i(a)150 | |
5125 | 2232 y(result)26 b(of)i(command)f(substitution)f(ignore)h(the)h(k)m | |
5126 | (eyb)s(oard-generated)g(job)g(con)m(trol)g(signals)e | |
5127 | Fs(SIGTTIN)p Ft(,)150 2341 y Fs(SIGTTOU)p Ft(,)j(and)g | |
5128 | Fs(SIGTSTP)p Ft(.)275 2474 y(The)h(shell)g(exits)h(b)m(y)g(default)f | |
5129 | (up)s(on)g(receipt)h(of)g(a)h Fs(SIGHUP)p Ft(.)42 b(Before)32 | |
5130 | b(exiting,)f(an)g(in)m(teractiv)m(e)h(shell)150 2584 | |
5131 | y(resends)41 b(the)i Fs(SIGHUP)e Ft(to)i(all)e(jobs,)k(running)40 | |
5132 | b(or)i(stopp)s(ed.)76 b(Stopp)s(ed)41 b(jobs)h(are)h(sen)m(t)g | |
5133 | Fs(SIGCONT)d Ft(to)150 2693 y(ensure)32 b(that)h(they)g(receiv)m(e)h | |
5134 | (the)f Fs(SIGHUP)p Ft(.)47 b(T)-8 b(o)33 b(prev)m(en)m(t)g(the)g(shell) | |
5135 | e(from)i(sending)e(the)i Fs(SIGHUP)e Ft(signal)150 2803 | |
5136 | y(to)i(a)g(particular)e(job,)i(it)f(should)f(b)s(e)h(remo)m(v)m(ed)h | |
5137 | (from)g(the)f(jobs)g(table)h(with)e(the)i Fs(disown)e | |
5138 | Ft(builtin)e(\(see)150 2912 y(Section)h(7.2)h([Job)f(Con)m(trol)g | |
5139 | (Builtins],)e(page)j(80\))h(or)e(mark)m(ed)g(to)h(not)f(receiv)m(e)h | |
5140 | Fs(SIGHUP)e Ft(using)g Fs(disown)150 3022 y(-h)p Ft(.)275 | |
5141 | 3155 y(If)i(the)h Fs(huponexit)d Ft(shell)i(option)g(has)h(b)s(een)f | |
5142 | (set)h(with)f Fs(shopt)f Ft(\(see)j(Section)f(4.2)h([Bash)f(Builtins],) | |
5143 | 150 3264 y(page)f(39\),)h(Bash)e(sends)g(a)h Fs(SIGHUP)d | |
5144 | Ft(to)j(all)f(jobs)g(when)f(an)h(in)m(teractiv)m(e)h(login)f(shell)e | |
5145 | (exits.)275 3397 y(If)38 b(Bash)h(is)f(w)m(aiting)g(for)h(a)g(command)f | |
5146 | (to)i(complete)f(and)f(receiv)m(es)i(a)f(signal)f(for)g(whic)m(h)g(a)h | |
5147 | (trap)150 3507 y(has)c(b)s(een)f(set,)i(the)f(trap)g(will)d(not)j(b)s | |
5148 | (e)f(executed)i(un)m(til)d(the)i(command)f(completes.)54 | |
5149 | b(When)35 b(Bash)g(is)150 3616 y(w)m(aiting)h(for)h(an)g(async)m | |
5150 | (hronous)g(command)g(via)g(the)g Fs(wait)f Ft(builtin,)f(the)j | |
5151 | (reception)f(of)g(a)g(signal)f(for)150 3726 y(whic)m(h)e(a)h(trap)g | |
5152 | (has)g(b)s(een)f(set)h(will)e(cause)i(the)g Fs(wait)f | |
5153 | Ft(builtin)e(to)j(return)f(immediately)f(with)h(an)h(exit)150 | |
5154 | 3836 y(status)c(greater)g(than)f(128,)i(immediately)d(after)i(whic)m(h) | |
5155 | e(the)i(trap)f(is)f(executed.)150 4088 y Fr(3.8)68 b(Shell)45 | |
5156 | b(Scripts)275 4330 y Ft(A)c(shell)f(script)h(is)g(a)h(text)h(\014le)e | |
5157 | (con)m(taining)g(shell)f(commands.)75 b(When)41 b(suc)m(h)h(a)g(\014le) | |
5158 | f(is)g(used)g(as)150 4440 y(the)33 b(\014rst)f(non-option)g(argumen)m | |
5159 | (t)i(when)e(in)m(v)m(oking)g(Bash,)i(and)e(neither)g(the)h(`)p | |
5160 | Fs(-c)p Ft(')g(nor)g(`)p Fs(-s)p Ft(')f(option)h(is)150 | |
5161 | 4550 y(supplied)i(\(see)40 b(Section)f(6.1)g([In)m(v)m(oking)g(Bash],)i | |
5162 | (page)f(63\),)i(Bash)d(reads)f(and)g(executes)i(commands)150 | |
5163 | 4659 y(from)31 b(the)h(\014le,)g(then)f(exits.)45 b(This)30 | |
5164 | b(mo)s(de)h(of)h(op)s(eration)g(creates)h(a)f(non-in)m(teractiv)m(e)g | |
5165 | (shell.)43 b(The)32 b(shell)150 4769 y(\014rst)26 b(searc)m(hes)h(for)f | |
5166 | (the)g(\014le)g(in)f(the)h(curren)m(t)h(directory)-8 | |
5167 | b(,)27 b(and)f(lo)s(oks)f(in)h(the)g(directories)f(in)g | |
5168 | Fs($PATH)g Ft(if)h(not)150 4878 y(found)j(there.)275 | |
5169 | 5011 y(When)34 b(Bash)h(runs)e(a)i(shell)e(script,)h(it)h(sets)g(the)f | |
5170 | (sp)s(ecial)g(parameter)h Fs(0)f Ft(to)h(the)g(name)g(of)g(the)g | |
5171 | (\014le,)150 5121 y(rather)k(than)g(the)h(name)f(of)h(the)f(shell,)h | |
5172 | (and)f(the)h(p)s(ositional)d(parameters)i(are)h(set)g(to)g(the)g | |
5173 | (remain-)150 5230 y(ing)e(argumen)m(ts,)k(if)c(an)m(y)h(are)g(giv)m | |
5174 | (en.)66 b(If)39 b(no)g(additional)d(argumen)m(ts)k(are)f(supplied,)f | |
5175 | (the)h(p)s(ositional)150 5340 y(parameters)31 b(are)f(unset.)p | |
5176 | eop | |
5177 | %%Page: 32 38 | |
5178 | 32 37 bop 150 -116 a Ft(32)2572 b(Bash)31 b(Reference)g(Man)m(ual)275 | |
5179 | 299 y(A)39 b(shell)f(script)g(ma)m(y)i(b)s(e)f(made)h(executable)g(b)m | |
5180 | (y)f(using)f(the)i Fs(chmod)e Ft(command)h(to)h(turn)e(on)i(the)150 | |
5181 | 408 y(execute)j(bit.)72 b(When)41 b(Bash)g(\014nds)e(suc)m(h)i(a)h | |
5182 | (\014le)e(while)f(searc)m(hing)i(the)g Fs($PATH)f Ft(for)h(a)h | |
5183 | (command,)h(it)150 518 y(spa)m(wns)30 b(a)g(subshell)e(to)j(execute)h | |
5184 | (it.)40 b(In)30 b(other)g(w)m(ords,)g(executing)390 653 | |
5185 | y Fs(filename)46 b Fj(arguments)150 787 y Ft(is)29 b(equiv)-5 | |
5186 | b(alen)m(t)30 b(to)h(executing)390 922 y Fs(bash)47 b(filename)e | |
5187 | Fj(arguments)150 1056 y Ft(if)29 b Fs(filename)e Ft(is)i(an)g | |
5188 | (executable)i(shell)d(script.)39 b(This)28 b(subshell)f(reinitializes)f | |
5189 | (itself,)j(so)h(that)h(the)e(e\013ect)150 1166 y(is)35 | |
5190 | b(as)i(if)f(a)g(new)g(shell)f(had)h(b)s(een)g(in)m(v)m(ok)m(ed)g(to)i | |
5191 | (in)m(terpret)d(the)i(script,)g(with)e(the)i(exception)g(that)g(the)150 | |
5192 | 1275 y(lo)s(cations)23 b(of)i(commands)e(remem)m(b)s(ered)h(b)m(y)g | |
5193 | (the)g(paren)m(t)g(\(see)h(the)f(description)e(of)i Fs(hash)f | |
5194 | Ft(in)g(Section)h(4.1)150 1385 y([Bourne)30 b(Shell)f(Builtins],)f | |
5195 | (page)j(33\))h(are)e(retained)g(b)m(y)g(the)h(c)m(hild.)275 | |
5196 | 1519 y(Most)36 b(v)m(ersions)f(of)h(Unix)e(mak)m(e)i(this)f(a)h(part)f | |
5197 | (of)h(the)g(op)s(erating)f(system's)g(command)h(execution)150 | |
5198 | 1629 y(mec)m(hanism.)49 b(If)33 b(the)g(\014rst)g(line)f(of)h(a)h | |
5199 | (script)e(b)s(egins)g(with)g(the)h(t)m(w)m(o)i(c)m(haracters)g(`)p | |
5200 | Fs(#!)p Ft(',)f(the)g(remainder)150 1738 y(of)d(the)g(line)f(sp)s | |
5201 | (eci\014es)f(an)i(in)m(terpreter)f(for)h(the)g(program.)43 | |
5202 | b(Th)m(us,)30 b(y)m(ou)h(can)h(sp)s(ecify)d(Bash,)j Fs(awk)p | |
5203 | Ft(,)e(P)m(erl,)150 1848 y(or)g(some)h(other)g(in)m(terpreter)f(and)f | |
5204 | (write)h(the)g(rest)h(of)g(the)f(script)f(\014le)h(in)f(that)i | |
5205 | (language.)275 1983 y(The)40 b(argumen)m(ts)h(to)g(the)g(in)m | |
5206 | (terpreter)f(consist)g(of)h(a)g(single)f(optional)f(argumen)m(t)j | |
5207 | (follo)m(wing)d(the)150 2092 y(in)m(terpreter)32 b(name)i(on)f(the)g | |
5208 | (\014rst)f(line)g(of)h(the)g(script)f(\014le,)h(follo)m(w)m(ed)g(b)m(y) | |
5209 | g(the)g(name)g(of)g(the)h(script)e(\014le,)150 2202 y(follo)m(w)m(ed)f | |
5210 | (b)m(y)h(the)f(rest)h(of)g(the)f(argumen)m(ts.)45 b(Bash)31 | |
5211 | b(will)e(p)s(erform)h(this)h(action)h(on)f(op)s(erating)g(systems)150 | |
5212 | 2311 y(that)24 b(do)g(not)f(handle)f(it)h(themselv)m(es.)39 | |
5213 | b(Note)25 b(that)f(some)g(older)f(v)m(ersions)f(of)i(Unix)e(limit)g | |
5214 | (the)i(in)m(terpreter)150 2421 y(name)30 b(and)g(argumen)m(t)h(to)g(a)g | |
5215 | (maxim)m(um)e(of)i(32)g(c)m(haracters.)275 2555 y(Bash)h(scripts)f | |
5216 | (often)h(b)s(egin)f(with)g Fs(#!)f(/bin/bash)g Ft(\(assuming)h(that)i | |
5217 | (Bash)f(has)g(b)s(een)f(installed)f(in)150 2665 y(`)p | |
5218 | Fs(/bin)p Ft('\),)25 b(since)d(this)g(ensures)g(that)i(Bash)f(will)e(b) | |
5219 | s(e)h(used)h(to)h(in)m(terpret)e(the)h(script,)h(ev)m(en)g(if)e(it)h | |
5220 | (is)f(executed)150 2775 y(under)29 b(another)h(shell.)p | |
5221 | eop | |
5222 | %%Page: 33 39 | |
5223 | 33 38 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
5224 | b(Builtin)g(Commands)2069 b(33)150 299 y Fo(4)80 b(Shell)55 | |
5225 | b(Builtin)g(Commands)275 572 y Ft(Builtin)22 b(commands)i(are)h(con)m | |
5226 | (tained)g(within)d(the)j(shell)e(itself.)38 b(When)24 | |
5227 | b(the)h(name)g(of)g(a)g(builtin)c(com-)150 681 y(mand)26 | |
5228 | b(is)h(used)f(as)i(the)g(\014rst)e(w)m(ord)h(of)h(a)f(simple)f(command) | |
5229 | h(\(see)h(Section)f(3.2.1)i([Simple)d(Commands],)150 | |
5230 | 791 y(page)21 b(8\),)j(the)d(shell)e(executes)j(the)f(command)f | |
5231 | (directly)-8 b(,)22 b(without)e(in)m(v)m(oking)g(another)h(program.)37 | |
5232 | b(Builtin)150 900 y(commands)f(are)h(necessary)g(to)g(implemen)m(t)e | |
5233 | (functionalit)m(y)g(imp)s(ossible)e(or)k(incon)m(v)m(enien)m(t)f(to)h | |
5234 | (obtain)150 1010 y(with)29 b(separate)i(utilities.)275 | |
5235 | 1157 y(This)i(section)i(brie\015y)f(the)h(builtins)d(whic)m(h)i(Bash)h | |
5236 | (inherits)e(from)i(the)g(Bourne)g(Shell,)g(as)g(w)m(ell)g(as)150 | |
5237 | 1267 y(the)c(builtin)26 b(commands)k(whic)m(h)g(are)g(unique)f(to)i(or) | |
5238 | f(ha)m(v)m(e)i(b)s(een)e(extended)g(in)f(Bash.)275 1414 | |
5239 | y(Sev)m(eral)44 b(builtin)c(commands)k(are)h(describ)s(ed)d(in)h(other) | |
5240 | h(c)m(hapters:)69 b(builtin)40 b(commands)k(whic)m(h)150 | |
5241 | 1524 y(pro)m(vide)22 b(the)i(Bash)f(in)m(terface)h(to)g(the)g(job)f | |
5242 | (con)m(trol)h(facilities)d(\(see)j(Section)g(7.2)g([Job)f(Con)m(trol)g | |
5243 | (Builtins],)150 1633 y(page)40 b(80\),)j(the)c(directory)g(stac)m(k)h | |
5244 | (\(see)g(Section)f(6.8.1)i([Directory)f(Stac)m(k)g(Builtins],)f(page)h | |
5245 | (73\),)j(the)150 1743 y(command)23 b(history)g(\(see)h(Section)f(9.2)i | |
5246 | ([Bash)f(History)f(Builtins],)f(page)j(109\),)h(and)d(the)h | |
5247 | (programmable)150 1853 y(completion)30 b(facilities)e(\(see)k(Section)e | |
5248 | (8.7)h([Programmable)f(Completion)f(Builtins],)f(page)k(105\).)275 | |
5249 | 2000 y(Man)m(y)f(of)f(the)h(builtins)26 b(ha)m(v)m(e)32 | |
5250 | b(b)s(een)e(extended)g(b)m(y)g Fl(posix)g Ft(or)g(Bash.)150 | |
5251 | 2290 y Fr(4.1)68 b(Bourne)45 b(Shell)g(Builtins)275 2546 | |
5252 | y Ft(The)31 b(follo)m(wing)f(shell)f(builtin)g(commands)i(are)h | |
5253 | (inherited)d(from)i(the)h(Bourne)f(Shell.)43 b(These)31 | |
5254 | b(com-)150 2656 y(mands)e(are)i(implemen)m(ted)e(as)i(sp)s(eci\014ed)d | |
5255 | (b)m(y)j(the)f Fl(posix)g Ft(1003.2)j(standard.)150 2835 | |
5256 | y Fs(:)d Ft(\(a)h(colon\))870 2944 y Fs(:)47 b([)p Fj(arguments)11 | |
5257 | b Fs(])630 3085 y Ft(Do)43 b(nothing)e(b)s(ey)m(ond)h(expanding)e | |
5258 | Fq(argumen)m(ts)46 b Ft(and)c(p)s(erforming)e(redirections.)74 | |
5259 | b(The)630 3195 y(return)29 b(status)i(is)e(zero.)150 | |
5260 | 3367 y Fs(.)h Ft(\(a)h(p)s(erio)s(d\))870 3477 y Fs(.)47 | |
5261 | b Fj(filename)57 b Fs([)p Fj(arguments)11 b Fs(])630 | |
5262 | 3618 y Ft(Read)34 b(and)f(execute)i(commands)e(from)g(the)h | |
5263 | Fq(\014lename)k Ft(argumen)m(t)c(in)e(the)i(curren)m(t)g(shell)630 | |
5264 | 3727 y(con)m(text.)45 b(If)31 b Fq(\014lename)36 b Ft(do)s(es)31 | |
5265 | b(not)g(con)m(tain)h(a)f(slash,)g(the)h Fs(PATH)e Ft(v)-5 | |
5266 | b(ariable)30 b(is)g(used)g(to)i(\014nd)630 3837 y Fq(\014lename)p | |
5267 | Ft(.)51 b(When)34 b(Bash)g(is)g(not)g(in)f Fl(posix)g | |
5268 | Ft(mo)s(de,)i(the)g(curren)m(t)f(directory)f(is)g(searc)m(hed)630 | |
5269 | 3946 y(if)d Fq(\014lename)35 b Ft(is)30 b(not)i(found)d(in)h | |
5270 | Fs($PATH)p Ft(.)41 b(If)31 b(an)m(y)g Fq(argumen)m(ts)k | |
5271 | Ft(are)c(supplied,)d(they)k(b)s(ecome)630 4056 y(the)e(p)s(ositional)e | |
5272 | (parameters)j(when)e Fq(\014lename)34 b Ft(is)29 b(executed.)42 | |
5273 | b(Otherwise)29 b(the)h(p)s(ositional)630 4166 y(parameters)43 | |
5274 | b(are)h(unc)m(hanged.)79 b(The)42 b(return)g(status)i(is)e(the)h(exit)g | |
5275 | (status)h(of)f(the)g(last)630 4275 y(command)37 b(executed,)k(or)c | |
5276 | (zero)h(if)f(no)g(commands)g(are)h(executed.)63 b(If)36 | |
5277 | b Fq(\014lename)42 b Ft(is)37 b(not)630 4385 y(found,)22 | |
5278 | b(or)f(cannot)g(b)s(e)f(read,)j(the)e(return)f(status)h(is)f(non-zero.) | |
5279 | 38 b(This)19 b(builtin)f(is)h(equiv)-5 b(alen)m(t)630 | |
5280 | 4494 y(to)31 b Fs(source)p Ft(.)150 4667 y Fs(break)870 | |
5281 | 4808 y(break)46 b([)p Fj(n)11 b Fs(])630 4949 y Ft(Exit)44 | |
5282 | b(from)g(a)g Fs(for)p Ft(,)k Fs(while)p Ft(,)e Fs(until)p | |
5283 | Ft(,)h(or)d Fs(select)f Ft(lo)s(op.)82 b(If)44 b Fq(n)g | |
5284 | Ft(is)f(supplied,)i(the)g Fq(n)p Ft(th)630 5058 y(enclosing)39 | |
5285 | b(lo)s(op)g(is)h(exited.)69 b Fq(n)40 b Ft(m)m(ust)g(b)s(e)f(greater)j | |
5286 | (than)d(or)i(equal)e(to)i(1.)70 b(The)40 b(return)630 | |
5287 | 5168 y(status)31 b(is)e(zero)i(unless)e Fq(n)h Ft(is)f(not)i(greater)g | |
5288 | (than)g(or)f(equal)g(to)h(1.)150 5340 y Fs(cd)p eop | |
5289 | %%Page: 34 40 | |
5290 | 34 39 bop 150 -116 a Ft(34)2572 b(Bash)31 b(Reference)g(Man)m(ual)870 | |
5291 | 299 y Fs(cd)47 b([-L|-P])f([)p Fj(directory)11 b Fs(])630 | |
5292 | 431 y Ft(Change)37 b(the)g(curren)m(t)f(w)m(orking)h(directory)f(to)i | |
5293 | Fq(directory)p Ft(.)59 b(If)37 b Fq(directory)44 b Ft(is)36 | |
5294 | b(not)h(giv)m(en,)630 541 y(the)31 b(v)-5 b(alue)30 b(of)h(the)g | |
5295 | Fs(HOME)e Ft(shell)g(v)-5 b(ariable)30 b(is)g(used.)40 | |
5296 | b(If)31 b(the)g(shell)e(v)-5 b(ariable)29 b Fs(CDPATH)g | |
5297 | Ft(exists,)630 650 y(it)e(is)f(used)g(as)h(a)h(searc)m(h)f(path.)40 | |
5298 | b(If)26 b Fq(directory)34 b Ft(b)s(egins)26 b(with)g(a)h(slash,)g | |
5299 | Fs(CDPATH)e Ft(is)h(not)h(used.)630 783 y(The)h(`)p Fs(-P)p | |
5300 | Ft(')h(option)f(means)g(to)h(not)g(follo)m(w)f(sym)m(b)s(olic)f(links;) | |
5301 | g(sym)m(b)s(olic)g(links)f(are)j(follo)m(w)m(ed)630 892 | |
5302 | y(b)m(y)23 b(default)g(or)h(with)e(the)i(`)p Fs(-L)p | |
5303 | Ft(')f(option.)38 b(If)23 b Fq(directory)31 b Ft(is)22 | |
5304 | b(`)p Fs(-)p Ft(',)k(it)d(is)f(equiv)-5 b(alen)m(t)23 | |
5305 | b(to)i Fs($OLDPWD)p Ft(.)630 1025 y(If)33 b(a)h(non-empt)m(y)g | |
5306 | (directory)f(name)g(from)g Fs(CDPATH)f Ft(is)g(used,)i(or)g(if)e(`)p | |
5307 | Fs(-)p Ft(')i(is)e(the)i(\014rst)f(argu-)630 1134 y(men)m(t,)28 | |
5308 | b(and)e(the)h(directory)f(c)m(hange)i(is)e(successful,)h(the)g | |
5309 | (absolute)f(pathname)h(of)f(the)h(new)630 1244 y(w)m(orking)j | |
5310 | (directory)g(is)f(written)g(to)j(the)e(standard)g(output.)630 | |
5311 | 1377 y(The)f(return)g(status)h(is)e(zero)j(if)d(the)i(directory)f(is)g | |
5312 | (successfully)f(c)m(hanged,)i(non-zero)g(oth-)630 1486 | |
5313 | y(erwise.)150 1641 y Fs(continue)870 1774 y(continue)46 | |
5314 | b([)p Fj(n)11 b Fs(])630 1906 y Ft(Resume)32 b(the)g(next)g(iteration)g | |
5315 | (of)g(an)g(enclosing)f Fs(for)p Ft(,)h Fs(while)p Ft(,)f | |
5316 | Fs(until)p Ft(,)g(or)h Fs(select)f Ft(lo)s(op.)630 2016 | |
5317 | y(If)f Fq(n)h Ft(is)f(supplied,)d(the)32 b(execution)f(of)g(the)g | |
5318 | Fq(n)p Ft(th)f(enclosing)g(lo)s(op)g(is)f(resumed.)42 | |
5319 | b Fq(n)30 b Ft(m)m(ust)h(b)s(e)630 2125 y(greater)39 | |
5320 | b(than)f(or)g(equal)f(to)i(1.)63 b(The)38 b(return)e(status)j(is)d | |
5321 | (zero)j(unless)d Fq(n)i Ft(is)f(not)h(greater)630 2235 | |
5322 | y(than)30 b(or)g(equal)g(to)h(1.)150 2390 y Fs(eval)870 | |
5323 | 2523 y(eval)47 b([)p Fj(arguments)11 b Fs(])630 2655 | |
5324 | y Ft(The)25 b(argumen)m(ts)h(are)g(concatenated)i(together)f(in)m(to)e | |
5325 | (a)h(single)f(command,)h(whic)m(h)f(is)f(then)630 2765 | |
5326 | y(read)35 b(and)g(executed,)j(and)d(its)g(exit)g(status)h(returned)e | |
5327 | (as)h(the)h(exit)f(status)h(of)g Fs(eval)p Ft(.)54 b(If)630 | |
5328 | 2874 y(there)31 b(are)f(no)h(argumen)m(ts)f(or)h(only)e(empt)m(y)i | |
5329 | (argumen)m(ts,)g(the)f(return)g(status)g(is)g(zero.)150 | |
5330 | 3029 y Fs(exec)870 3162 y(exec)47 b([-cl])f([-a)h Fj(name)11 | |
5331 | b Fs(])46 b([)p Fj(command)56 b Fs([)p Fj(arguments)11 | |
5332 | b Fs(]])630 3294 y Ft(If)28 b Fq(command)j Ft(is)d(supplied,)d(it)j | |
5333 | (replaces)g(the)g(shell)f(without)g(creating)i(a)f(new)g(pro)s(cess.)39 | |
5334 | b(If)630 3404 y(the)25 b(`)p Fs(-l)p Ft(')f(option)h(is)e(supplied,)g | |
5335 | (the)i(shell)e(places)h(a)h(dash)f(at)i(the)f(b)s(eginning)d(of)i(the)h | |
5336 | (zeroth)630 3513 y(arg)h(passed)f(to)h Fq(command)p Ft(.)39 | |
5337 | b(This)23 b(is)i(what)g(the)h Fs(login)d Ft(program)j(do)s(es.)38 | |
5338 | b(The)25 b(`)p Fs(-c)p Ft(')g(option)630 3623 y(causes)g | |
5339 | Fq(command)i Ft(to)e(b)s(e)f(executed)h(with)e(an)h(empt)m(y)h(en)m | |
5340 | (vironmen)m(t.)38 b(If)24 b(`)p Fs(-a)p Ft(')g(is)f(supplied,)630 | |
5341 | 3733 y(the)32 b(shell)e(passes)i Fq(name)37 b Ft(as)c(the)f(zeroth)h | |
5342 | (argumen)m(t)f(to)h Fq(command)p Ft(.)45 b(If)32 b(no)g | |
5343 | Fq(command)j Ft(is)630 3842 y(sp)s(eci\014ed,)f(redirections)f(ma)m(y)i | |
5344 | (b)s(e)f(used)f(to)i(a\013ect)h(the)f(curren)m(t)f(shell)f(en)m | |
5345 | (vironmen)m(t.)52 b(If)630 3952 y(there)34 b(are)h(no)f(redirection)f | |
5346 | (errors,)i(the)f(return)f(status)i(is)e(zero;)k(otherwise)d(the)g | |
5347 | (return)630 4061 y(status)d(is)e(non-zero.)150 4217 y | |
5348 | Fs(exit)870 4349 y(exit)47 b([)p Fj(n)11 b Fs(])630 4482 | |
5349 | y Ft(Exit)29 b(the)h(shell,)f(returning)e(a)k(status)f(of)g | |
5350 | Fq(n)f Ft(to)h(the)g(shell's)e(paren)m(t.)41 b(If)30 | |
5351 | b Fq(n)f Ft(is)g(omitted,)h(the)630 4591 y(exit)c(status)h(is)f(that)h | |
5352 | (of)g(the)g(last)f(command)g(executed.)41 b(An)m(y)26 | |
5353 | b(trap)h(on)f Fs(EXIT)f Ft(is)h(executed)630 4701 y(b)s(efore)k(the)h | |
5354 | (shell)d(terminates.)150 4856 y Fs(export)870 4988 y(export)46 | |
5355 | b([-fn])g([-p])h([)p Fj(name)11 b Fs([=)p Fj(value)g | |
5356 | Fs(]])630 5121 y Ft(Mark)40 b(eac)m(h)h Fq(name)k Ft(to)40 | |
5357 | b(b)s(e)f(passed)g(to)i(c)m(hild)d(pro)s(cesses)h(in)f(the)i(en)m | |
5358 | (vironmen)m(t.)69 b(If)39 b(the)630 5230 y(`)p Fs(-f)p | |
5359 | Ft(')29 b(option)g(is)g(supplied,)e(the)i Fq(name)5 b | |
5360 | Ft(s)30 b(refer)f(to)h(shell)e(functions;)g(otherwise)h(the)h(names)630 | |
5361 | 5340 y(refer)36 b(to)i(shell)c(v)-5 b(ariables.)58 b(The)36 | |
5362 | b(`)p Fs(-n)p Ft(')h(option)f(means)g(to)h(no)g(longer)f(mark)g(eac)m | |
5363 | (h)i Fq(name)p eop | |
5364 | %%Page: 35 41 | |
5365 | 35 40 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
5366 | b(Builtin)g(Commands)2069 b(35)630 299 y(for)39 b(exp)s(ort.)65 | |
5367 | b(If)39 b(no)g Fq(names)j Ft(are)d(supplied,)f(or)h(if)f(the)h(`)p | |
5368 | Fs(-p)p Ft(')g(option)f(is)g(giv)m(en,)j(a)e(list)f(of)630 | |
5369 | 408 y(exp)s(orted)e(names)h(is)e(displa)m(y)m(ed.)58 | |
5370 | b(The)37 b(`)p Fs(-p)p Ft(')f(option)g(displa)m(ys)f(output)h(in)f(a)i | |
5371 | (form)f(that)630 518 y(ma)m(y)c(b)s(e)e(reused)g(as)i(input.)41 | |
5372 | b(If)30 b(a)i(v)-5 b(ariable)29 b(name)j(is)e(follo)m(w)m(ed)g(b)m(y)h | |
5373 | (=)p Fq(v)-5 b(alue)p Ft(,)31 b(the)g(v)-5 b(alue)31 | |
5374 | b(of)630 628 y(the)g(v)-5 b(ariable)29 b(is)g(set)i(to)g | |
5375 | Fq(v)-5 b(alue)p Ft(.)630 761 y(The)29 b(return)e(status)j(is)e(zero)i | |
5376 | (unless)d(an)i(in)m(v)-5 b(alid)26 b(option)j(is)f(supplied,)e(one)k | |
5377 | (of)f(the)g(names)630 870 y(is)g(not)i(a)f(v)-5 b(alid)29 | |
5378 | b(shell)f(v)-5 b(ariable)29 b(name,)h(or)h(`)p Fs(-f)p | |
5379 | Ft(')f(is)f(supplied)e(with)h(a)j(name)f(that)h(is)e(not)i(a)630 | |
5380 | 980 y(shell)e(function.)150 1136 y Fs(getopts)870 1270 | |
5381 | y(getopts)46 b Fj(optstring)56 b(name)h Fs([)p Fj(args)11 | |
5382 | b Fs(])630 1403 y(getopts)28 b Ft(is)h(used)h(b)m(y)g(shell)e(scripts)h | |
5383 | (to)h(parse)g(p)s(ositional)e(parameters.)41 b Fq(optstring)c | |
5384 | Ft(con-)630 1512 y(tains)k(the)h(option)e(c)m(haracters)j(to)g(b)s(e)d | |
5385 | (recognized;)48 b(if)41 b(a)g(c)m(haracter)j(is)c(follo)m(w)m(ed)h(b)m | |
5386 | (y)h(a)630 1622 y(colon,)32 b(the)g(option)f(is)g(exp)s(ected)h(to)h | |
5387 | (ha)m(v)m(e)g(an)e(argumen)m(t,)i(whic)m(h)e(should)e(b)s(e)i | |
5388 | (separated)630 1731 y(from)37 b(it)g(b)m(y)g(white)g(space.)63 | |
5389 | b(The)37 b(colon)g(\(`)p Fs(:)p Ft('\))i(and)d(question)h(mark)g(\(`)p | |
5390 | Fs(?)p Ft('\))i(ma)m(y)f(not)g(b)s(e)630 1841 y(used)g(as)g(option)g(c) | |
5391 | m(haracters.)67 b(Eac)m(h)39 b(time)f(it)g(is)f(in)m(v)m(ok)m(ed,)k | |
5392 | Fs(getopts)c Ft(places)h(the)h(next)630 1951 y(option)28 | |
5393 | b(in)f(the)i(shell)e(v)-5 b(ariable)28 b Fq(name)p Ft(,)h(initializing) | |
5394 | c Fq(name)34 b Ft(if)27 b(it)h(do)s(es)h(not)g(exist,)g(and)f(the)630 | |
5395 | 2060 y(index)k(of)h(the)h(next)f(argumen)m(t)h(to)g(b)s(e)e(pro)s | |
5396 | (cessed)h(in)m(to)g(the)h(v)-5 b(ariable)32 b Fs(OPTIND)p | |
5397 | Ft(.)48 b Fs(OPTIND)630 2170 y Ft(is)40 b(initialized)e(to)k(1)f(eac)m | |
5398 | (h)h(time)f(the)g(shell)e(or)i(a)g(shell)e(script)h(is)g(in)m(v)m(ok)m | |
5399 | (ed.)73 b(When)41 b(an)630 2279 y(option)35 b(requires)e(an)i(argumen)m | |
5400 | (t,)i Fs(getopts)c Ft(places)i(that)h(argumen)m(t)g(in)m(to)f(the)g(v) | |
5401 | -5 b(ariable)630 2389 y Fs(OPTARG)p Ft(.)55 b(The)35 | |
5402 | b(shell)e(do)s(es)j(not)g(reset)g Fs(OPTIND)e Ft(automatically;)k(it)d | |
5403 | (m)m(ust)g(b)s(e)g(man)m(ually)630 2498 y(reset)i(b)s(et)m(w)m(een)g(m) | |
5404 | m(ultiple)e(calls)g(to)i Fs(getopts)e Ft(within)f(the)j(same)g(shell)d | |
5405 | (in)m(v)m(o)s(cation)j(if)f(a)630 2608 y(new)30 b(set)h(of)f | |
5406 | (parameters)h(is)e(to)j(b)s(e)d(used.)630 2741 y(When)41 | |
5407 | b(the)h(end)e(of)i(options)f(is)f(encoun)m(tered,)45 | |
5408 | b Fs(getopts)39 b Ft(exits)i(with)f(a)i(return)e(v)-5 | |
5409 | b(alue)630 2851 y(greater)32 b(than)e(zero.)41 b Fs(OPTIND)29 | |
5410 | b Ft(is)g(set)i(to)g(the)g(index)e(of)h(the)h(\014rst)f(non-option)f | |
5411 | (argumen)m(t,)630 2960 y(and)h Fs(name)f Ft(is)g(set)i(to)g(`)p | |
5412 | Fs(?)p Ft('.)630 3093 y Fs(getopts)c Ft(normally)h(parses)g(the)i(p)s | |
5413 | (ositional)d(parameters,)j(but)e(if)h(more)g(argumen)m(ts)h(are)630 | |
5414 | 3203 y(giv)m(en)g(in)f Fq(args)p Ft(,)i Fs(getopts)e | |
5415 | Ft(parses)h(those)h(instead.)630 3336 y Fs(getopts)h | |
5416 | Ft(can)h(rep)s(ort)g(errors)g(in)g(t)m(w)m(o)i(w)m(a)m(ys.)51 | |
5417 | b(If)33 b(the)h(\014rst)e(c)m(haracter)k(of)d Fq(optstring)41 | |
5418 | b Ft(is)33 b(a)630 3446 y(colon,)i Fq(silen)m(t)h Ft(error)d(rep)s | |
5419 | (orting)g(is)h(used.)51 b(In)33 b(normal)h(op)s(eration)f(diagnostic)h | |
5420 | (messages)630 3555 y(are)c(prin)m(ted)d(when)h(in)m(v)-5 | |
5421 | b(alid)27 b(options)i(or)g(missing)e(option)h(argumen)m(ts)i(are)f | |
5422 | (encoun)m(tered.)630 3665 y(If)34 b(the)g(v)-5 b(ariable)33 | |
5423 | b Fs(OPTERR)f Ft(is)h(set)i(to)f(0,)i(no)e(error)g(messages)h(will)c(b) | |
5424 | s(e)i(displa)m(y)m(ed,)h(ev)m(en)h(if)630 3774 y(the)c(\014rst)e(c)m | |
5425 | (haracter)j(of)f Fs(optstring)d Ft(is)h(not)i(a)f(colon.)630 | |
5426 | 3907 y(If)39 b(an)h(in)m(v)-5 b(alid)38 b(option)h(is)g(seen,)j | |
5427 | Fs(getopts)c Ft(places)i(`)p Fs(?)p Ft(')g(in)m(to)g | |
5428 | Fq(name)45 b Ft(and,)d(if)d(not)h(silen)m(t,)630 4017 | |
5429 | y(prin)m(ts)e(an)i(error)f(message)h(and)f(unsets)g Fs(OPTARG)p | |
5430 | Ft(.)67 b(If)39 b Fs(getopts)f Ft(is)h(silen)m(t,)i(the)e(option)630 | |
5431 | 4127 y(c)m(haracter)32 b(found)d(is)g(placed)h(in)f Fs(OPTARG)g | |
5432 | Ft(and)h(no)g(diagnostic)g(message)h(is)f(prin)m(ted.)630 | |
5433 | 4260 y(If)d(a)g(required)e(argumen)m(t)j(is)e(not)h(found,)g(and)f | |
5434 | Fs(getopts)f Ft(is)h(not)i(silen)m(t,)f(a)g(question)f(mark)630 | |
5435 | 4369 y(\(`)p Fs(?)p Ft('\))i(is)f(placed)g(in)f Fq(name)p | |
5436 | Ft(,)i Fs(OPTARG)e Ft(is)g(unset,)i(and)f(a)g(diagnostic)g(message)i | |
5437 | (is)d(prin)m(ted.)38 b(If)630 4479 y Fs(getopts)28 b | |
5438 | Ft(is)g(silen)m(t,)h(then)g(a)h(colon)g(\(`)p Fs(:)p | |
5439 | Ft('\))g(is)f(placed)g(in)f Fq(name)35 b Ft(and)29 b | |
5440 | Fs(OPTARG)f Ft(is)g(set)i(to)h(the)630 4589 y(option)f(c)m(haracter)i | |
5441 | (found.)150 4745 y Fs(hash)870 4878 y(hash)47 b([-'r])f([-p)h | |
5442 | Fj(filename)11 b Fs(])45 b([-dt])h([)p Fj(name)11 b Fs(])630 | |
5443 | 5011 y Ft(Remem)m(b)s(er)36 b(the)g(full)e(pathnames)i(of)g(commands)g | |
5444 | (sp)s(eci\014ed)f(as)h Fq(name)41 b Ft(argumen)m(ts,)e(so)630 | |
5445 | 5121 y(they)34 b(need)h(not)f(b)s(e)g(searc)m(hed)h(for)f(on)g | |
5446 | (subsequen)m(t)f(in)m(v)m(o)s(cations.)53 b(The)34 b(commands)g(are)630 | |
5447 | 5230 y(found)39 b(b)m(y)i(searc)m(hing)f(through)g(the)h(directories)e | |
5448 | (listed)g(in)g Fs($PATH)p Ft(.)70 b(The)40 b(`)p Fs(-p)p | |
5449 | Ft(')g(option)630 5340 y(inhibits)35 b(the)k(path)g(searc)m(h,)j(and)c | |
5450 | Fq(\014lename)43 b Ft(is)38 b(used)g(as)i(the)f(lo)s(cation)f(of)h | |
5451 | Fq(name)p Ft(.)66 b(The)p eop | |
5452 | %%Page: 36 42 | |
5453 | 36 41 bop 150 -116 a Ft(36)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
5454 | 299 y(`)p Fs(-r)p Ft(')d(option)f(causes)h(the)g(shell)f(to)h(forget)h | |
5455 | (all)e(remem)m(b)s(ered)g(lo)s(cations.)39 b(The)28 b(`)p | |
5456 | Fs(-d)p Ft(')f(option)630 408 y(causes)38 b(the)g(shell)e(to)i(forget)g | |
5457 | (the)g(remem)m(b)s(ered)f(lo)s(cation)g(of)h(eac)m(h)h | |
5458 | Fq(name)p Ft(.)62 b(If)37 b(the)h(`)p Fs(-t)p Ft(')630 | |
5459 | 518 y(option)21 b(is)g(supplied,)f(the)i(full)d(pathname)j(to)g(whic)m | |
5460 | (h)f(eac)m(h)h Fq(name)27 b Ft(corresp)s(onds)20 b(is)h(prin)m(ted.)630 | |
5461 | 628 y(If)33 b(m)m(ultiple)e Fq(name)38 b Ft(argumen)m(ts)c(are)f | |
5462 | (supplied)d(with)i(`)p Fs(-t)p Ft(')h(the)h Fq(name)k | |
5463 | Ft(is)33 b(prin)m(ted)e(b)s(efore)630 737 y(the)i(hashed)f(full)e | |
5464 | (pathname.)48 b(The)32 b(`)p Fs(-l)p Ft(')h(option)f(causes)h(output)f | |
5465 | (to)i(b)s(e)e(displa)m(y)m(ed)f(in)h(a)630 847 y(format)g(that)g(ma)m | |
5466 | (y)g(b)s(e)f(reused)g(as)g(input.)42 b(If)31 b(no)h(argumen)m(ts)g(are) | |
5467 | f(giv)m(en,)i(or)e(if)f(only)h(`)p Fs(-l)p Ft(')630 956 | |
5468 | y(is)j(supplied,)e(information)h(ab)s(out)i(remem)m(b)s(ered)f | |
5469 | (commands)g(is)g(prin)m(ted.)52 b(The)34 b(return)630 | |
5470 | 1066 y(status)d(is)e(zero)i(unless)e(a)i Fq(name)k Ft(is)30 | |
5471 | b(not)g(found)f(or)i(an)f(in)m(v)-5 b(alid)28 b(option)i(is)f | |
5472 | (supplied.)150 1217 y Fs(pwd)870 1347 y(pwd)47 b([-LP])630 | |
5473 | 1477 y Ft(Prin)m(t)23 b(the)i(absolute)f(pathname)h(of)f(the)h(curren)m | |
5474 | (t)f(w)m(orking)g(directory)-8 b(.)39 b(If)23 b(the)i(`)p | |
5475 | Fs(-P)p Ft(')f(option)630 1587 y(is)35 b(supplied,)e(the)j(pathname)f | |
5476 | (prin)m(ted)f(will)f(not)j(con)m(tain)g(sym)m(b)s(olic)e(links.)53 | |
5477 | b(If)35 b(the)h(`)p Fs(-L)p Ft(')630 1696 y(option)43 | |
5478 | b(is)g(supplied,)h(the)g(pathname)f(prin)m(ted)g(ma)m(y)h(con)m(tain)g | |
5479 | (sym)m(b)s(olic)e(links.)78 b(The)630 1806 y(return)26 | |
5480 | b(status)h(is)g(zero)h(unless)d(an)i(error)g(is)f(encoun)m(tered)h | |
5481 | (while)f(determining)f(the)i(name)630 1915 y(of)k(the)f(curren)m(t)g | |
5482 | (directory)g(or)g(an)h(in)m(v)-5 b(alid)28 b(option)i(is)f(supplied.) | |
5483 | 150 2066 y Fs(readonly)870 2196 y(readonly)46 b([-apf])g([)p | |
5484 | Fj(name)11 b Fs([=)p Fj(value)g Fs(]])43 b(...)630 2326 | |
5485 | y Ft(Mark)24 b(eac)m(h)h Fq(name)k Ft(as)24 b(readonly)-8 | |
5486 | b(.)38 b(The)24 b(v)-5 b(alues)23 b(of)h(these)g(names)g(ma)m(y)g(not)g | |
5487 | (b)s(e)g(c)m(hanged)g(b)m(y)630 2436 y(subsequen)m(t)e(assignmen)m(t.) | |
5488 | 38 b(If)22 b(the)h(`)p Fs(-f)p Ft(')f(option)h(is)e(supplied,)g(eac)m | |
5489 | (h)j Fq(name)k Ft(refers)22 b(to)i(a)f(shell)630 2545 | |
5490 | y(function.)51 b(The)34 b(`)p Fs(-a)p Ft(')g(option)g(means)h(eac)m(h)g | |
5491 | Fq(name)40 b Ft(refers)33 b(to)j(an)e(arra)m(y)h(v)-5 | |
5492 | b(ariable.)51 b(If)34 b(no)630 2655 y Fq(name)d Ft(argumen)m(ts)26 | |
5493 | b(are)g(giv)m(en,)h(or)e(if)g(the)h(`)p Fs(-p)p Ft(')f(option)g(is)g | |
5494 | (supplied,)e(a)j(list)f(of)g(all)g(readonly)630 2765 | |
5495 | y(names)37 b(is)f(prin)m(ted.)58 b(The)37 b(`)p Fs(-p)p | |
5496 | Ft(')f(option)h(causes)g(output)g(to)g(b)s(e)f(displa)m(y)m(ed)g(in)f | |
5497 | (a)j(format)630 2874 y(that)25 b(ma)m(y)g(b)s(e)f(reused)g(as)h(input.) | |
5498 | 37 b(If)24 b(a)h(v)-5 b(ariable)23 b(name)i(is)f(follo)m(w)m(ed)g(b)m | |
5499 | (y)g(=)p Fq(v)-5 b(alue)p Ft(,)26 b(the)e(v)-5 b(alue)630 | |
5500 | 2984 y(of)27 b(the)g(v)-5 b(ariable)25 b(is)h(set)h(to)g | |
5501 | Fq(v)-5 b(alue)p Ft(.)39 b(The)26 b(return)g(status)h(is)e(zero)j | |
5502 | (unless)d(an)h(in)m(v)-5 b(alid)24 b(option)630 3093 | |
5503 | y(is)29 b(supplied,)e(one)j(of)g(the)g Fq(name)35 b Ft(argumen)m(ts)30 | |
5504 | b(is)f(not)h(a)g(v)-5 b(alid)29 b(shell)f(v)-5 b(ariable)28 | |
5505 | b(or)i(function)630 3203 y(name,)h(or)f(the)h(`)p Fs(-f)p | |
5506 | Ft(')f(option)g(is)f(supplied)e(with)i(a)i(name)f(that)h(is)f(not)g(a)h | |
5507 | (shell)e(function.)150 3354 y Fs(return)870 3484 y(return)46 | |
5508 | b([)p Fj(n)11 b Fs(])630 3614 y Ft(Cause)30 b(a)g(shell)e(function)h | |
5509 | (to)i(exit)e(with)g(the)h(return)f(v)-5 b(alue)30 b Fq(n)p | |
5510 | Ft(.)40 b(If)29 b Fq(n)h Ft(is)f(not)h(supplied,)d(the)630 | |
5511 | 3724 y(return)35 b(v)-5 b(alue)36 b(is)f(the)h(exit)g(status)g(of)h | |
5512 | (the)f(last)g(command)g(executed)h(in)e(the)h(function.)630 | |
5513 | 3833 y(This)20 b(ma)m(y)j(also)f(b)s(e)f(used)g(to)i(terminate)f | |
5514 | (execution)g(of)g(a)h(script)e(b)s(eing)f(executed)j(with)e(the)630 | |
5515 | 3943 y Fs(.)27 b Ft(\(or)g Fs(source)p Ft(\))f(builtin,)f(returning)g | |
5516 | (either)h Fq(n)h Ft(or)g(the)g(exit)g(status)h(of)f(the)g(last)g | |
5517 | (command)630 4052 y(executed)46 b(within)d(the)i(script)f(as)i(the)f | |
5518 | (exit)g(status)h(of)f(the)h(script.)84 b(An)m(y)45 b(command)630 | |
5519 | 4162 y(asso)s(ciated)29 b(with)e(the)h Fs(RETURN)f Ft(trap)h(is)f | |
5520 | (executed)i(b)s(efore)f(execution)g(resumes)g(after)h(the)630 | |
5521 | 4271 y(function)37 b(or)g(script.)62 b(The)38 b(return)e(status)i(is)f | |
5522 | (non-zero)i(if)d Fs(return)h Ft(is)f(used)h(outside)h(a)630 | |
5523 | 4381 y(function)29 b(and)h(not)g(during)f(the)h(execution)h(of)f(a)h | |
5524 | (script)e(b)m(y)i Fs(.)f Ft(or)g Fs(source)p Ft(.)150 | |
5525 | 4532 y Fs(shift)870 4662 y(shift)46 b([)p Fj(n)11 b Fs(])630 | |
5526 | 4792 y Ft(Shift)40 b(the)h(p)s(ositional)e(parameters)j(to)g(the)f | |
5527 | (left)g(b)m(y)h Fq(n)p Ft(.)73 b(The)40 b(p)s(ositional)g(parameters) | |
5528 | 630 4902 y(from)27 b Fq(n)p Fs(+)p Ft(1)33 b(.)22 b(.)g(.)39 | |
5529 | b Fs($#)27 b Ft(are)g(renamed)g(to)i Fs($1)j Ft(.)22 | |
5530 | b(.)h(.)38 b Fs($#)p Ft(-)p Fq(n)p Fs(+)p Ft(1.)h(P)m(arameters)29 | |
5531 | b(represen)m(ted)e(b)m(y)h(the)630 5011 y(n)m(um)m(b)s(ers)34 | |
5532 | b Fs($#)h Ft(to)h Fq(n)p Fs(+)p Ft(1)f(are)g(unset.)55 | |
5533 | b Fq(n)35 b Ft(m)m(ust)g(b)s(e)g(a)h(non-negativ)m(e)g(n)m(um)m(b)s(er) | |
5534 | e(less)h(than)g(or)630 5121 y(equal)d(to)i Fs($#)p Ft(.)47 | |
5535 | b(If)33 b Fq(n)f Ft(is)g(zero)h(or)g(greater)h(than)f | |
5536 | Fs($#)p Ft(,)g(the)g(p)s(ositional)d(parameters)j(are)h(not)630 | |
5537 | 5230 y(c)m(hanged.)48 b(If)32 b Fq(n)g Ft(is)g(not)g(supplied,)f(it)h | |
5538 | (is)f(assumed)h(to)h(b)s(e)f(1.)48 b(The)32 b(return)g(status)h(is)e | |
5539 | (zero)630 5340 y(unless)e Fq(n)g Ft(is)h(greater)h(than)g | |
5540 | Fs($#)e Ft(or)i(less)e(than)i(zero,)g(non-zero)g(otherwise.)p | |
5541 | eop | |
5542 | %%Page: 37 43 | |
5543 | 37 42 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
5544 | b(Builtin)g(Commands)2069 b(37)150 299 y Fs(test)150 | |
5545 | 408 y([)432 b Ft(Ev)-5 b(aluate)31 b(a)g(conditional)e(expression)g | |
5546 | Fq(expr)p Ft(.)41 b(Eac)m(h)31 b(op)s(erator)g(and)f(op)s(erand)g(m)m | |
5547 | (ust)h(b)s(e)f(a)630 518 y(separate)d(argumen)m(t.)40 | |
5548 | b(Expressions)24 b(are)j(comp)s(osed)e(of)i(the)f(primaries)e(describ)s | |
5549 | (ed)g(b)s(elo)m(w)630 628 y(in)29 b(Section)h(6.4)i([Bash)e | |
5550 | (Conditional)e(Expressions],)h(page)j(69.)630 762 y(When)e(the)h | |
5551 | Fs([)f Ft(form)g(is)f(used,)h(the)g(last)h(argumen)m(t)f(to)i(the)e | |
5552 | (command)g(m)m(ust)h(b)s(e)e(a)i Fs(])p Ft(.)630 897 | |
5553 | y(Expressions)22 b(ma)m(y)i(b)s(e)e(com)m(bined)h(using)f(the)i(follo)m | |
5554 | (wing)e(op)s(erators,)j(listed)d(in)g(decreasing)630 | |
5555 | 1006 y(order)30 b(of)g(precedence.)630 1166 y Fs(!)g | |
5556 | Fj(expr)210 b Ft(T)-8 b(rue)30 b(if)f Fq(expr)37 b Ft(is)29 | |
5557 | b(false.)630 1325 y Fs(\()h Fj(expr)40 b Fs(\))122 b | |
5558 | Ft(Returns)23 b(the)i(v)-5 b(alue)24 b(of)g Fq(expr)p | |
5559 | Ft(.)38 b(This)23 b(ma)m(y)i(b)s(e)e(used)h(to)h(o)m(v)m(erride)f(the)h | |
5560 | (normal)1110 1435 y(precedence)31 b(of)f(op)s(erators.)630 | |
5561 | 1594 y Fj(expr1)39 b Fs(-a)30 b Fj(expr2)1110 1704 y | |
5562 | Ft(T)-8 b(rue)30 b(if)f(b)s(oth)h Fq(expr1)37 b Ft(and)30 | |
5563 | b Fq(expr2)38 b Ft(are)30 b(true.)630 1863 y Fj(expr1)39 | |
5564 | b Fs(-o)30 b Fj(expr2)1110 1973 y Ft(T)-8 b(rue)30 b(if)f(either)h | |
5565 | Fq(expr1)38 b Ft(or)30 b Fq(expr2)37 b Ft(is)30 b(true.)630 | |
5566 | 2132 y(The)37 b Fs(test)f Ft(and)g Fs([)h Ft(builtins)d(ev)-5 | |
5567 | b(aluate)38 b(conditional)d(expressions)h(using)g(a)h(set)h(of)f(rules) | |
5568 | 630 2242 y(based)30 b(on)g(the)h(n)m(um)m(b)s(er)e(of)h(argumen)m(ts.) | |
5569 | 630 2401 y(0)h(argumen)m(ts)1110 2511 y(The)f(expression)f(is)g(false.) | |
5570 | 630 2670 y(1)i(argumen)m(t)1110 2780 y(The)f(expression)f(is)g(true)i | |
5571 | (if)e(and)h(only)f(if)h(the)g(argumen)m(t)h(is)e(not)i(n)m(ull.)630 | |
5572 | 2939 y(2)g(argumen)m(ts)1110 3049 y(If)f(the)h(\014rst)f(argumen)m(t)h | |
5573 | (is)f(`)p Fs(!)p Ft(',)h(the)g(expression)f(is)g(true)g(if)g(and)g | |
5574 | (only)g(if)g(the)1110 3158 y(second)k(argumen)m(t)f(is)g(n)m(ull.)48 | |
5575 | b(If)33 b(the)h(\014rst)e(argumen)m(t)i(is)f(one)h(of)f(the)h(unary) | |
5576 | 1110 3268 y(conditional)39 b(op)s(erators)i(\(see)g(Section)g(6.4)g | |
5577 | ([Bash)g(Conditional)d(Expres-)1110 3377 y(sions],)33 | |
5578 | b(page)g(69\),)i(the)e(expression)e(is)h(true)h(if)f(the)h(unary)e | |
5579 | (test)j(is)e(true.)47 b(If)1110 3487 y(the)33 b(\014rst)g(argumen)m(t)h | |
5580 | (is)e(not)h(a)h(v)-5 b(alid)32 b(unary)g(op)s(erator,)i(the)g | |
5581 | (expression)e(is)1110 3597 y(false.)630 3756 y(3)f(argumen)m(ts)1110 | |
5582 | 3866 y(If)k(the)g(second)g(argumen)m(t)g(is)f(one)i(of)f(the)g(binary)e | |
5583 | (conditional)h(op)s(erators)1110 3975 y(\(see)23 b(Section)f(6.4)g | |
5584 | ([Bash)h(Conditional)c(Expressions],)j(page)h(69\),)i(the)d(result)1110 | |
5585 | 4085 y(of)44 b(the)h(expression)e(is)g(the)h(result)f(of)i(the)f | |
5586 | (binary)f(test)i(using)d(the)j(\014rst)1110 4194 y(and)33 | |
5587 | b(third)f(argumen)m(ts)i(as)g(op)s(erands.)50 b(If)33 | |
5588 | b(the)h(\014rst)g(argumen)m(t)g(is)f(`)p Fs(!)p Ft(',)i(the)1110 | |
5589 | 4304 y(v)-5 b(alue)24 b(is)g(the)h(negation)g(of)g(the)g(t)m(w)m | |
5590 | (o-argumen)m(t)i(test)f(using)d(the)i(second)g(and)1110 | |
5591 | 4413 y(third)31 b(argumen)m(ts.)47 b(If)33 b(the)f(\014rst)g(argumen)m | |
5592 | (t)h(is)f(exactly)h(`)p Fs(\()p Ft(')g(and)f(the)h(third)1110 | |
5593 | 4523 y(argumen)m(t)h(is)f(exactly)h(`)p Fs(\))p Ft(',)h(the)f(result)e | |
5594 | (is)h(the)h(one-argumen)m(t)g(test)h(of)f(the)1110 4633 | |
5595 | y(second)d(argumen)m(t.)45 b(Otherwise,)30 b(the)i(expression)e(is)g | |
5596 | (false.)43 b(The)31 b(`)p Fs(-a)p Ft(')h(and)1110 4742 | |
5597 | y(`)p Fs(-o)p Ft(')e(op)s(erators)h(are)g(considered)e(binary)f(op)s | |
5598 | (erators)j(in)e(this)g(case.)630 4902 y(4)i(argumen)m(ts)1110 | |
5599 | 5011 y(If)h(the)i(\014rst)e(argumen)m(t)h(is)f(`)p Fs(!)p | |
5600 | Ft(',)i(the)f(result)f(is)g(the)h(negation)g(of)g(the)g(three-)1110 | |
5601 | 5121 y(argumen)m(t)h(expression)e(comp)s(osed)i(of)f(the)h(remaining)e | |
5602 | (argumen)m(ts.)50 b(Oth-)1110 5230 y(erwise,)33 b(the)g(expression)f | |
5603 | (is)g(parsed)h(and)f(ev)-5 b(aluated)33 b(according)h(to)f(prece-)1110 | |
5604 | 5340 y(dence)e(using)d(the)j(rules)e(listed)g(ab)s(o)m(v)m(e.)p | |
5605 | eop | |
5606 | %%Page: 38 44 | |
5607 | 38 43 bop 150 -116 a Ft(38)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
5608 | 299 y(5)g(or)f(more)h(argumen)m(ts)1110 408 y(The)43 | |
5609 | b(expression)e(is)i(parsed)f(and)g(ev)-5 b(aluated)44 | |
5610 | b(according)f(to)g(precedence)1110 518 y(using)29 b(the)h(rules)f | |
5611 | (listed)g(ab)s(o)m(v)m(e.)150 671 y Fs(times)870 803 | |
5612 | y(times)630 934 y Ft(Prin)m(t)36 b(out)i(the)g(user)e(and)h(system)g | |
5613 | (times)g(used)g(b)m(y)g(the)h(shell)d(and)i(its)g(c)m(hildren.)59 | |
5614 | b(The)630 1044 y(return)29 b(status)i(is)e(zero.)150 | |
5615 | 1198 y Fs(trap)870 1329 y(trap)47 b([-lp])f([)p Fj(arg)11 | |
5616 | b Fs(])46 b([)p Fj(sigspec)56 b Fs(...)o(])630 1461 y | |
5617 | Ft(The)43 b(commands)f(in)g Fq(arg)51 b Ft(are)44 b(to)g(b)s(e)e(read)h | |
5618 | (and)g(executed)h(when)e(the)h(shell)e(receiv)m(es)630 | |
5619 | 1570 y(signal)31 b Fq(sigsp)s(ec)p Ft(.)46 b(If)32 b | |
5620 | Fq(arg)40 b Ft(is)32 b(absen)m(t)g(or)h(equal)f(to)h(`)p | |
5621 | Fs(-)p Ft(',)g(all)e(sp)s(eci\014ed)g(signals)g(are)h(reset)h(to)630 | |
5622 | 1680 y(the)g(v)-5 b(alues)33 b(they)g(had)g(when)f(the)h(shell)f(w)m | |
5623 | (as)h(started.)50 b(If)32 b Fq(arg)42 b Ft(is)32 b(the)h(n)m(ull)e | |
5624 | (string,)i(then)630 1789 y(the)38 b(signal)g(sp)s(eci\014ed)e(b)m(y)i | |
5625 | (eac)m(h)i Fq(sigsp)s(ec)j Ft(is)37 b(ignored)h(b)m(y)g(the)g(shell)f | |
5626 | (and)g(commands)h(it)630 1899 y(in)m(v)m(ok)m(es.)j(If)30 | |
5627 | b Fq(arg)38 b Ft(is)29 b(not)h(presen)m(t)g(and)g(`)p | |
5628 | Fs(-p)p Ft(')f(has)h(b)s(een)f(supplied,)e(the)k(shell)d(displa)m(ys)g | |
5629 | (the)630 2008 y(trap)j(commands)g(asso)s(ciated)g(with)f(eac)m(h)i | |
5630 | Fq(sigsp)s(ec)p Ft(.)42 b(If)31 b(no)g(argumen)m(ts)g(are)h(supplied,)c | |
5631 | (or)630 2118 y(only)f(`)p Fs(-p)p Ft(')i(is)e(giv)m(en,)i | |
5632 | Fs(trap)e Ft(prin)m(ts)g(the)i(list)d(of)j(commands)f(asso)s(ciated)h | |
5633 | (with)e(eac)m(h)i(signal)630 2228 y(n)m(um)m(b)s(er)c(in)g(a)i(form)f | |
5634 | (that)h(ma)m(y)g(b)s(e)f(reused)f(as)i(shell)d(input.)38 | |
5635 | b(The)26 b(`)p Fs(-l)p Ft(')g(option)g(causes)h(the)630 | |
5636 | 2337 y(shell)i(to)i(prin)m(t)e(a)h(list)f(of)i(signal)e(names)h(and)g | |
5637 | (their)g(corresp)s(onding)e(n)m(um)m(b)s(ers.)630 2469 | |
5638 | y(Eac)m(h)33 b Fq(sigsp)s(ec)38 b Ft(is)31 b(either)h(a)h(signal)f | |
5639 | (name)g(suc)m(h)g(as)h Fs(SIGINT)e Ft(\(with)h(or)g(without)g(the)h | |
5640 | Fs(SIG)630 2578 y Ft(pre\014x\))40 b(or)g(a)h(signal)e(n)m(um)m(b)s | |
5641 | (er.)69 b(If)40 b(a)h Fq(sigsp)s(ec)k Ft(is)39 b Fs(0)h | |
5642 | Ft(or)h Fs(EXIT)p Ft(,)h Fq(arg)48 b Ft(is)40 b(executed)h(when)630 | |
5643 | 2688 y(the)i(shell)f(exits.)79 b(If)42 b(a)i Fq(sigsp)s(ec)k | |
5644 | Ft(is)42 b Fs(DEBUG)p Ft(,)j(the)f(command)f Fq(arg)51 | |
5645 | b Ft(is)42 b(executed)i(b)s(efore)630 2798 y(ev)m(ery)21 | |
5646 | b(simple)d(command,)23 b Fs(for)c Ft(command,)k Fs(case)c | |
5647 | Ft(command,)j Fs(select)d Ft(command,)j(ev)m(ery)630 | |
5648 | 2907 y(arithmetic)42 b Fs(for)g Ft(command,)k(and)c(b)s(efore)g(the)h | |
5649 | (\014rst)f(command)g(executes)i(in)e(a)h(shell)630 3017 | |
5650 | y(function.)50 b(Refer)33 b(to)i(the)f(description)e(of)i(the)g | |
5651 | Fs(extglob)d Ft(option)j(to)g(the)g Fs(shopt)e Ft(builtin)630 | |
5652 | 3126 y(\(see)i(Section)f(4.2)h([Bash)g(Builtins],)e(page)i(39\))g(for)f | |
5653 | (details)f(of)i(its)e(e\013ect)j(on)e(the)g Fs(DEBUG)630 | |
5654 | 3236 y Ft(trap.)77 b(If)43 b(a)g Fq(sigsp)s(ec)k Ft(is)42 | |
5655 | b Fs(ERR)p Ft(,)j(the)e(command)f Fq(arg)51 b Ft(is)42 | |
5656 | b(executed)h(whenev)m(er)g(a)g(simple)630 3345 y(command)33 | |
5657 | b(has)f(a)h(non-zero)g(exit)g(status,)h(sub)5 b(ject)33 | |
5658 | b(to)g(the)g(follo)m(wing)e(conditions.)46 b(The)630 | |
5659 | 3455 y Fs(ERR)39 b Ft(trap)h(is)f(not)i(executed)g(if)e(the)h(failed)f | |
5660 | (command)h(is)f(part)h(of)g(the)g(command)g(list)630 | |
5661 | 3565 y(immediately)c(follo)m(wing)g(an)i Fs(until)e Ft(or)i | |
5662 | Fs(while)e Ft(k)m(eyw)m(ord,)k(part)d(of)h(the)g(test)h(in)d(an)i | |
5663 | Fs(if)630 3674 y Ft(statemen)m(t,)h(part)c(of)g(a)h Fs(&&)f | |
5664 | Ft(or)g Fs(||)g Ft(list,)g(or)g(if)g(the)g(command's)g(return)f(status) | |
5665 | i(is)e(b)s(eing)630 3784 y(in)m(v)m(erted)26 b(using)f | |
5666 | Fs(!)p Ft(.)39 b(These)26 b(are)g(the)h(same)f(conditions)f(ob)s(ey)m | |
5667 | (ed)h(b)m(y)h(the)f Fs(errexit)e Ft(option.)630 3893 | |
5668 | y(If)29 b(a)g Fq(sigsp)s(ec)34 b Ft(is)29 b Fs(RETURN)p | |
5669 | Ft(,)f(the)h(command)g Fq(arg)37 b Ft(is)29 b(executed)h(eac)m(h)g | |
5670 | (time)f(a)h(shell)d(function)630 4003 y(or)j(a)h(script)e(executed)j | |
5671 | (with)d(the)h Fs(.)g Ft(or)h Fs(source)d Ft(builtins)f(\014nishes)h | |
5672 | (executing.)630 4134 y(Signals)35 b(ignored)g(up)s(on)g(en)m(try)i(to)g | |
5673 | (the)f(shell)f(cannot)i(b)s(e)f(trapp)s(ed)f(or)h(reset.)59 | |
5674 | b(T)-8 b(rapp)s(ed)630 4244 y(signals)29 b(are)i(reset)g(to)g(their)e | |
5675 | (original)g(v)-5 b(alues)29 b(in)g(a)i(c)m(hild)e(pro)s(cess)h(when)f | |
5676 | (it)h(is)g(created.)630 4376 y(The)g(return)f(status)i(is)e(zero)i | |
5677 | (unless)e(a)i Fq(sigsp)s(ec)k Ft(do)s(es)30 b(not)h(sp)s(ecify)e(a)h(v) | |
5678 | -5 b(alid)29 b(signal.)150 4529 y Fs(umask)870 4661 y(umask)46 | |
5679 | b([-p])h([-S])g([)p Fj(mode)11 b Fs(])630 4792 y Ft(Set)30 | |
5680 | b(the)f(shell)f(pro)s(cess's)h(\014le)g(creation)g(mask)h(to)g | |
5681 | Fq(mo)s(de)p Ft(.)40 b(If)29 b Fq(mo)s(de)34 b Ft(b)s(egins)28 | |
5682 | b(with)g(a)i(digit,)630 4902 y(it)d(is)f(in)m(terpreted)g(as)h(an)g(o)s | |
5683 | (ctal)h(n)m(um)m(b)s(er;)f(if)f(not,)i(it)f(is)f(in)m(terpreted)g(as)h | |
5684 | (a)h(sym)m(b)s(olic)d(mo)s(de)630 5011 y(mask)k(similar)d(to)j(that)h | |
5685 | (accepted)g(b)m(y)f(the)g Fs(chmod)e Ft(command.)40 b(If)28 | |
5686 | b Fq(mo)s(de)34 b Ft(is)27 b(omitted,)j(the)630 5121 | |
5687 | y(curren)m(t)36 b(v)-5 b(alue)35 b(of)h(the)h(mask)f(is)f(prin)m(ted.) | |
5688 | 56 b(If)35 b(the)h(`)p Fs(-S)p Ft(')g(option)g(is)f(supplied)e(without) | |
5689 | i(a)630 5230 y Fq(mo)s(de)40 b Ft(argumen)m(t,)d(the)e(mask)g(is)f | |
5690 | (prin)m(ted)g(in)g(a)i(sym)m(b)s(olic)d(format.)55 b(If)35 | |
5691 | b(the)g(`)p Fs(-p)p Ft(')g(option)630 5340 y(is)e(supplied,)e(and)i | |
5692 | Fq(mo)s(de)38 b Ft(is)32 b(omitted,)j(the)f(output)f(is)f(in)h(a)h | |
5693 | (form)f(that)h(ma)m(y)g(b)s(e)f(reused)p eop | |
5694 | %%Page: 39 45 | |
5695 | 39 44 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
5696 | b(Builtin)g(Commands)2069 b(39)630 299 y(as)31 b(input.)40 | |
5697 | b(The)31 b(return)f(status)h(is)f(zero)i(if)d(the)i(mo)s(de)g(is)f | |
5698 | (successfully)f(c)m(hanged)i(or)g(if)f(no)630 408 y Fq(mo)s(de)35 | |
5699 | b Ft(argumen)m(t)c(is)e(supplied,)f(and)h(non-zero)i(otherwise.)630 | |
5700 | 537 y(Note)38 b(that)e(when)g(the)g(mo)s(de)g(is)f(in)m(terpreted)h(as) | |
5701 | g(an)g(o)s(ctal)h(n)m(um)m(b)s(er,)f(eac)m(h)i(n)m(um)m(b)s(er)d(of)630 | |
5702 | 647 y(the)f(umask)g(is)g(subtracted)g(from)f Fs(7)p Ft(.)53 | |
5703 | b(Th)m(us,)34 b(a)h(umask)e(of)i Fs(022)e Ft(results)g(in)g(p)s | |
5704 | (ermissions)630 756 y(of)e Fs(755)p Ft(.)150 905 y Fs(unset)870 | |
5705 | 1033 y(unset)46 b([-fv])h([)p Fj(name)11 b Fs(])630 1162 | |
5706 | y Ft(Eac)m(h)34 b(v)-5 b(ariable)31 b(or)i(function)f | |
5707 | Fq(name)38 b Ft(is)32 b(remo)m(v)m(ed.)50 b(If)32 b(no)h(options)g(are) | |
5708 | g(supplied,)e(or)i(the)630 1272 y(`)p Fs(-v)p Ft(')h(option)g(is)g(giv) | |
5709 | m(en,)h(eac)m(h)h Fq(name)k Ft(refers)34 b(to)h(a)g(shell)d(v)-5 | |
5710 | b(ariable.)52 b(If)34 b(the)h(`)p Fs(-f)p Ft(')f(option)g(is)630 | |
5711 | 1381 y(giv)m(en,)26 b(the)e Fq(name)5 b Ft(s)25 b(refer)f(to)h(shell)e | |
5712 | (functions,)h(and)g(the)g(function)f(de\014nition)f(is)i(remo)m(v)m | |
5713 | (ed.)630 1491 y(Readonly)31 b(v)-5 b(ariables)31 b(and)h(functions)e | |
5714 | (ma)m(y)j(not)f(b)s(e)g(unset.)45 b(The)32 b(return)f(status)h(is)f | |
5715 | (zero)630 1600 y(unless)e(a)h Fq(name)36 b Ft(is)29 b(readonly)-8 | |
5716 | b(.)150 1841 y Fr(4.2)68 b(Bash)45 b(Builtin)g(Commands)275 | |
5717 | 2079 y Ft(This)29 b(section)j(describ)s(es)e(builtin)f(commands)i(whic) | |
5718 | m(h)f(are)j(unique)c(to)k(or)f(ha)m(v)m(e)h(b)s(een)e(extended)g(in)150 | |
5719 | 2189 y(Bash.)41 b(Some)30 b(of)h(these)g(commands)f(are)g(sp)s | |
5720 | (eci\014ed)f(in)g(the)i Fl(posix)e Ft(1003.2)k(standard.)150 | |
5721 | 2337 y Fs(alias)870 2466 y(alias)46 b([-p])h([)p Fj(name)11 | |
5722 | b Fs([=)p Fj(value)g Fs(])43 b(...)o(])630 2594 y Ft(Without)g(argumen) | |
5723 | m(ts)g(or)g(with)f(the)i(`)p Fs(-p)p Ft(')f(option,)j | |
5724 | Fs(alias)41 b Ft(prin)m(ts)h(the)h(list)f(of)h(aliases)630 | |
5725 | 2704 y(on)36 b(the)g(standard)f(output)h(in)e(a)j(form)e(that)i(allo)m | |
5726 | (ws)e(them)h(to)g(b)s(e)g(reused)f(as)h(input.)55 b(If)630 | |
5727 | 2814 y(argumen)m(ts)29 b(are)g(supplied,)d(an)j(alias)f(is)g(de\014ned) | |
5728 | f(for)i(eac)m(h)h Fq(name)k Ft(whose)28 b Fq(v)-5 b(alue)34 | |
5729 | b Ft(is)28 b(giv)m(en.)630 2923 y(If)39 b(no)h Fq(v)-5 | |
5730 | b(alue)44 b Ft(is)39 b(giv)m(en,)j(the)e(name)f(and)g(v)-5 | |
5731 | b(alue)39 b(of)h(the)g(alias)f(is)g(prin)m(ted.)67 b(Aliases)39 | |
5732 | b(are)630 3033 y(describ)s(ed)28 b(in)h(Section)i(6.6)g([Aliases],)f | |
5733 | (page)h(71.)150 3181 y Fs(bind)870 3310 y(bind)47 b([-m)g | |
5734 | Fj(keymap)11 b Fs(])45 b([-lpsvPSV])870 3419 y(bind)i([-m)g | |
5735 | Fj(keymap)11 b Fs(])45 b([-q)i Fj(function)11 b Fs(])45 | |
5736 | b([-u)h Fj(function)11 b Fs(])45 b([-r)i Fj(keyseq)11 | |
5737 | b Fs(])870 3529 y(bind)47 b([-m)g Fj(keymap)11 b Fs(])45 | |
5738 | b(-f)i Fj(filename)870 3638 y Fs(bind)g([-m)g Fj(keymap)11 | |
5739 | b Fs(])45 b(-x)i Fj(keyseq:shell-command)870 3748 y Fs(bind)g([-m)g | |
5740 | Fj(keymap)11 b Fs(])45 b Fj(keyseq:function-name)870 | |
5741 | 3858 y Fs(bind)i Fj(readline-command)630 3986 y Ft(Displa)m(y)24 | |
5742 | b(curren)m(t)h(Readline)f(\(see)i(Chapter)f(8)g([Command)g(Line)f | |
5743 | (Editing],)h(page)h(83\))g(k)m(ey)630 4096 y(and)36 b(function)f | |
5744 | (bindings,)h(bind)e(a)j(k)m(ey)g(sequence)g(to)h(a)f(Readline)e | |
5745 | (function)g(or)i(macro,)630 4206 y(or)44 b(set)h(a)g(Readline)d(v)-5 | |
5746 | b(ariable.)81 b(Eac)m(h)45 b(non-option)f(argumen)m(t)g(is)f(a)i | |
5747 | (command)f(as)g(it)630 4315 y(w)m(ould)34 b(app)s(ear)g(in)f(a)j(a)f | |
5748 | (Readline)e(initialization)f(\014le)i(\(see)i(Section)e(8.3)i | |
5749 | ([Readline)e(Init)630 4425 y(File],)41 b(page)e(86\),)k(but)38 | |
5750 | b(eac)m(h)i(binding)c(or)j(command)g(m)m(ust)g(b)s(e)f(passed)g(as)i(a) | |
5751 | f(separate)630 4534 y(argumen)m(t;)d(e.g.,)f(`)p Fs | |
5752 | ("\\C-x\\C-r":re-read-init-fi)o(le)p Ft('.)43 b(Options,)33 | |
5753 | b(if)g(supplied,)e(ha)m(v)m(e)630 4644 y(the)g(follo)m(wing)d | |
5754 | (meanings:)630 4792 y Fs(-m)i Fj(keymap)1110 4902 y Ft(Use)54 | |
5755 | b Fq(k)m(eymap)j Ft(as)d(the)g(k)m(eymap)g(to)h(b)s(e)e(a\013ected)i(b) | |
5756 | m(y)f(the)g(subsequen)m(t)1110 5011 y(bindings.)44 b(Acceptable)33 | |
5757 | b Fq(k)m(eymap)j Ft(names)c(are)h Fs(emacs)p Ft(,)f Fs(emacs-standard)p | |
5758 | Ft(,)1110 5121 y Fs(emacs-meta)p Ft(,)99 b Fs(emacs-ctlx)p | |
5759 | Ft(,)f Fs(vi)p Ft(,)j Fs(vi-move)p Ft(,)f Fs(vi-command)p | |
5760 | Ft(,)f(and)1110 5230 y Fs(vi-insert)p Ft(.)64 b Fs(vi)38 | |
5761 | b Ft(is)g(equiv)-5 b(alen)m(t)39 b(to)g Fs(vi-command)p | |
5762 | Ft(;)i Fs(emacs)c Ft(is)h(equiv)-5 b(alen)m(t)1110 5340 | |
5763 | y(to)31 b Fs(emacs-standard)p Ft(.)p eop | |
5764 | %%Page: 40 46 | |
5765 | 40 45 bop 150 -116 a Ft(40)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
5766 | 299 y Fs(-l)384 b Ft(List)30 b(the)g(names)g(of)h(all)e(Readline)g | |
5767 | (functions.)630 454 y Fs(-p)384 b Ft(Displa)m(y)32 b(Readline)f | |
5768 | (function)h(names)h(and)f(bindings)d(in)j(suc)m(h)g(a)i(w)m(a)m(y)f | |
5769 | (that)1110 563 y(they)e(can)f(b)s(e)g(used)g(as)g(input)f(or)h(in)f(a)i | |
5770 | (Readline)e(initialization)e(\014le.)630 718 y Fs(-P)384 | |
5771 | b Ft(List)30 b(curren)m(t)g(Readline)f(function)g(names)h(and)g | |
5772 | (bindings.)630 873 y Fs(-v)384 b Ft(Displa)m(y)23 b(Readline)f(v)-5 | |
5773 | b(ariable)23 b(names)h(and)f(v)-5 b(alues)23 b(in)g(suc)m(h)g(a)i(w)m | |
5774 | (a)m(y)f(that)h(they)1110 982 y(can)31 b(b)s(e)e(used)h(as)h(input)d | |
5775 | (or)i(in)f(a)i(Readline)e(initialization)f(\014le.)630 | |
5776 | 1137 y Fs(-V)384 b Ft(List)30 b(curren)m(t)g(Readline)f(v)-5 | |
5777 | b(ariable)29 b(names)h(and)g(v)-5 b(alues.)630 1292 y | |
5778 | Fs(-s)384 b Ft(Displa)m(y)37 b(Readline)f(k)m(ey)i(sequences)f(b)s | |
5779 | (ound)f(to)i(macros)g(and)f(the)g(strings)1110 1401 y(they)d(output)f | |
5780 | (in)g(suc)m(h)g(a)h(w)m(a)m(y)h(that)f(they)g(can)g(b)s(e)f(used)g(as)h | |
5781 | (input)d(or)j(in)f(a)1110 1511 y(Readline)c(initialization)e(\014le.) | |
5782 | 630 1666 y Fs(-S)384 b Ft(Displa)m(y)37 b(Readline)f(k)m(ey)i | |
5783 | (sequences)f(b)s(ound)f(to)i(macros)g(and)f(the)g(strings)1110 | |
5784 | 1775 y(they)31 b(output.)630 1930 y Fs(-f)f Fj(filename)1110 | |
5785 | 2039 y Ft(Read)h(k)m(ey)g(bindings)c(from)j Fq(\014lename)p | |
5786 | Ft(.)630 2194 y Fs(-q)g Fj(function)1110 2304 y Ft(Query)g(ab)s(out)g | |
5787 | (whic)m(h)f(k)m(eys)i(in)m(v)m(ok)m(e)g(the)g(named)f | |
5788 | Fq(function)p Ft(.)630 2458 y Fs(-u)g Fj(function)1110 | |
5789 | 2568 y Ft(Un)m(bind)e(all)h(k)m(eys)i(b)s(ound)e(to)i(the)f(named)g | |
5790 | Fq(function)p Ft(.)630 2723 y Fs(-r)g Fj(keyseq)1110 | |
5791 | 2832 y Ft(Remo)m(v)m(e)i(an)m(y)f(curren)m(t)f(binding)d(for)j | |
5792 | Fq(k)m(eyseq)p Ft(.)630 2987 y Fs(-x)g Fj(keyseq:shell-command)1110 | |
5793 | 3097 y Ft(Cause)g Fq(shell-command)i Ft(to)g(b)s(e)d(executed)j(whenev) | |
5794 | m(er)e Fq(k)m(eyseq)j Ft(is)d(en)m(tered.)630 3251 y(The)c(return)f | |
5795 | (status)i(is)e(zero)j(unless)c(an)j(in)m(v)-5 b(alid)24 | |
5796 | b(option)i(is)f(supplied)e(or)k(an)f(error)g(o)s(ccurs.)150 | |
5797 | 3406 y Fs(builtin)870 3538 y(builtin)46 b([)p Fj(shell-builtin)54 | |
5798 | b Fs([)p Fj(args)11 b Fs(]])630 3670 y Ft(Run)35 b(a)i(shell)d | |
5799 | (builtin,)h(passing)g(it)h Fq(args)p Ft(,)i(and)e(return)f(its)h(exit)g | |
5800 | (status.)59 b(This)34 b(is)i(useful)630 3780 y(when)29 | |
5801 | b(de\014ning)g(a)h(shell)f(function)g(with)g(the)h(same)h(name)f(as)h | |
5802 | (a)g(shell)d(builtin,)f(retaining)630 3890 y(the)34 b(functionalit)m(y) | |
5803 | e(of)i(the)f(builtin)d(within)h(the)j(function.)49 b(The)33 | |
5804 | b(return)g(status)h(is)e(non-)630 3999 y(zero)f(if)f | |
5805 | Fq(shell-builtin)25 b Ft(is)k(not)i(a)g(shell)d(builtin)f(command.)150 | |
5806 | 4154 y Fs(caller)870 4286 y(caller)46 b([)p Fj(expr)11 | |
5807 | b Fs(])630 4418 y Ft(Returns)34 b(the)g(con)m(text)j(of)e(an)m(y)g | |
5808 | (activ)m(e)h(subroutine)c(call)i(\(a)h(shell)e(function)g(or)i(a)g | |
5809 | (script)630 4528 y(executed)c(with)e(the)i Fs(.)f Ft(or)g | |
5810 | Fs(source)f Ft(builtins\).)630 4660 y(Without)44 b Fq(expr)p | |
5811 | Ft(,)k Fs(caller)43 b Ft(displa)m(ys)g(the)h(line)f(n)m(um)m(b)s(er)h | |
5812 | (and)g(source)g(\014lename)g(of)h(the)630 4769 y(curren)m(t)35 | |
5813 | b(subroutine)f(call.)56 b(If)35 b(a)h(non-negativ)m(e)h(in)m(teger)f | |
5814 | (is)f(supplied)d(as)k Fq(expr)p Ft(,)h Fs(caller)630 | |
5815 | 4879 y Ft(displa)m(ys)i(the)h(line)f(n)m(um)m(b)s(er,)j(subroutine)c | |
5816 | (name,)44 b(and)c(source)g(\014le)g(corresp)s(onding)e(to)630 | |
5817 | 4989 y(that)d(p)s(osition)e(in)g(the)i(curren)m(t)f(execution)h(call)f | |
5818 | (stac)m(k.)54 b(This)33 b(extra)i(information)e(ma)m(y)630 | |
5819 | 5098 y(b)s(e)d(used,)g(for)g(example,)g(to)h(prin)m(t)e(a)i(stac)m(k)h | |
5820 | (trace.)42 b(The)29 b(curren)m(t)i(frame)f(is)f(frame)i(0.)630 | |
5821 | 5230 y(The)e(return)f(v)-5 b(alue)28 b(is)h(0)g(unless)f(the)h(shell)e | |
5822 | (is)i(not)g(executing)g(a)h(subroutine)d(call)h(or)i | |
5823 | Fq(expr)630 5340 y Ft(do)s(es)g(not)h(corresp)s(ond)e(to)i(a)g(v)-5 | |
5824 | b(alid)28 b(p)s(osition)h(in)g(the)h(call)g(stac)m(k.)p | |
5825 | eop | |
5826 | %%Page: 41 47 | |
5827 | 41 46 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
5828 | b(Builtin)g(Commands)2069 b(41)150 299 y Fs(command)870 | |
5829 | 433 y(command)46 b([-pVv])g Fj(command)56 b Fs([)p Fj(arguments)g | |
5830 | Fs(...)o(])630 568 y Ft(Runs)32 b Fq(command)k Ft(with)c | |
5831 | Fq(argumen)m(ts)37 b Ft(ignoring)31 b(an)m(y)i(shell)f(function)f | |
5832 | (named)i Fq(command)p Ft(.)630 677 y(Only)38 b(shell)h(builtin)d | |
5833 | (commands)k(or)g(commands)f(found)g(b)m(y)h(searc)m(hing)g(the)g | |
5834 | Fs(PATH)f Ft(are)630 787 y(executed.)g(If)23 b(there)h(is)e(a)i(shell)d | |
5835 | (function)h(named)h Fs(ls)p Ft(,)i(running)20 b(`)p Fs(command)29 | |
5836 | b(ls)p Ft(')23 b(within)e(the)630 897 y(function)32 b(will)e(execute)35 | |
5837 | b(the)f(external)f(command)g Fs(ls)f Ft(instead)h(of)g(calling)f(the)h | |
5838 | (function)630 1006 y(recursiv)m(ely)-8 b(.)82 b(The)44 | |
5839 | b(`)p Fs(-p)p Ft(')h(option)f(means)g(to)h(use)g(a)f(default)g(v)-5 | |
5840 | b(alue)44 b(for)g Fs(PATH)g Ft(that)h(is)630 1116 y(guaran)m(teed)35 | |
5841 | b(to)f(\014nd)e(all)h(of)h(the)g(standard)f(utilities.)48 | |
5842 | b(The)33 b(return)g(status)h(in)e(this)h(case)630 1225 | |
5843 | y(is)28 b(127)h(if)f Fq(command)k Ft(cannot)d(b)s(e)e(found)h(or)g(an)g | |
5844 | (error)h(o)s(ccurred,)f(and)g(the)h(exit)f(status)h(of)630 | |
5845 | 1335 y Fq(command)34 b Ft(otherwise.)630 1469 y(If)25 | |
5846 | b(either)f(the)i(`)p Fs(-V)p Ft(')f(or)g(`)p Fs(-v)p | |
5847 | Ft(')g(option)f(is)g(supplied,)g(a)h(description)e(of)j | |
5848 | Fq(command)i Ft(is)c(prin)m(ted.)630 1579 y(The)j(`)p | |
5849 | Fs(-v)p Ft(')h(option)g(causes)g(a)h(single)d(w)m(ord)i(indicating)e | |
5850 | (the)i(command)g(or)g(\014le)f(name)h(used)630 1689 y(to)36 | |
5851 | b(in)m(v)m(ok)m(e)f Fq(command)k Ft(to)c(b)s(e)g(displa)m(y)m(ed;)h | |
5852 | (the)f(`)p Fs(-V)p Ft(')g(option)f(pro)s(duces)f(a)j(more)f(v)m(erb)s | |
5853 | (ose)630 1798 y(description.)59 b(In)36 b(this)g(case,)k(the)e(return)e | |
5854 | (status)h(is)f(zero)i(if)e Fq(command)41 b Ft(is)36 b(found,)i(and)630 | |
5855 | 1908 y(non-zero)31 b(if)e(not.)150 2067 y Fs(declare)870 | |
5856 | 2202 y(declare)46 b([-afFirtx])f([-p])h([)p Fj(name)11 | |
5857 | b Fs([=)p Fj(value)g Fs(])44 b(...)o(])630 2336 y Ft(Declare)28 | |
5858 | b(v)-5 b(ariables)26 b(and)g(giv)m(e)i(them)f(attributes.)39 | |
5859 | b(If)27 b(no)g Fq(name)5 b Ft(s)27 b(are)h(giv)m(en,)g(then)f(displa)m | |
5860 | (y)630 2446 y(the)k(v)-5 b(alues)29 b(of)i(v)-5 b(ariables)29 | |
5861 | b(instead.)630 2580 y(The)f(`)p Fs(-p)p Ft(')g(option)f(will)f(displa)m | |
5862 | (y)g(the)j(attributes)e(and)h(v)-5 b(alues)27 b(of)i(eac)m(h)g | |
5863 | Fq(name)p Ft(.)40 b(When)28 b(`)p Fs(-p)p Ft(')630 2690 | |
5864 | y(is)j(used,)h(additional)e(options)h(are)i(ignored.)45 | |
5865 | b(The)31 b(`)p Fs(-F)p Ft(')h(option)g(inhibits)c(the)k(displa)m(y)f | |
5866 | (of)630 2800 y(function)g(de\014nitions;)g(only)h(the)g(function)f | |
5867 | (name)i(and)f(attributes)g(are)g(prin)m(ted.)46 b(If)32 | |
5868 | b(the)630 2909 y Fs(extdebug)e Ft(shell)h(option)h(is)g(enabled)f | |
5869 | (using)g Fs(shopt)h Ft(\(see)h(Section)f(4.2)i([Bash)f(Builtins],)630 | |
5870 | 3019 y(page)k(39\),)h(the)e(source)g(\014le)f(name)h(and)g(line)e(n)m | |
5871 | (um)m(b)s(er)g(where)i(the)g(function)e(is)h(de\014ned)630 | |
5872 | 3128 y(are)g(displa)m(y)m(ed)f(as)h(w)m(ell.)53 b(`)p | |
5873 | Fs(-F)p Ft(')34 b(implies)e(`)p Fs(-f)p Ft('.)54 b(The)35 | |
5874 | b(follo)m(wing)e(options)h(can)h(b)s(e)f(used)g(to)630 | |
5875 | 3238 y(restrict)40 b(output)h(to)g(v)-5 b(ariables)40 | |
5876 | b(with)f(the)i(sp)s(eci\014ed)e(attributes)h(or)h(to)g(giv)m(e)g(v)-5 | |
5877 | b(ariables)630 3347 y(attributes:)630 3507 y Fs(-a)384 | |
5878 | b Ft(Eac)m(h)30 b Fq(name)k Ft(is)28 b(an)h(arra)m(y)h(v)-5 | |
5879 | b(ariable)28 b(\(see)i(Section)f(6.7)h([Arra)m(ys],)h(page)e(72\).)630 | |
5880 | 3666 y Fs(-f)384 b Ft(Use)31 b(function)e(names)h(only)-8 | |
5881 | b(.)630 3826 y Fs(-i)384 b Ft(The)36 b(v)-5 b(ariable)35 | |
5882 | b(is)g(to)i(b)s(e)f(treated)h(as)g(an)f(in)m(teger;)k(arithmetic)35 | |
5883 | b(ev)-5 b(aluation)1110 3935 y(\(see)29 b(Section)e(6.5)i([Shell)d | |
5884 | (Arithmetic],)i(page)g(70\))h(is)e(p)s(erformed)f(when)h(the)1110 | |
5885 | 4045 y(v)-5 b(ariable)29 b(is)h(assigned)f(a)i(v)-5 b(alue.)630 | |
5886 | 4204 y Fs(-r)384 b Ft(Mak)m(e)25 b Fq(name)5 b Ft(s)23 | |
5887 | b(readonly)-8 b(.)38 b(These)24 b(names)f(cannot)h(then)f(b)s(e)g | |
5888 | (assigned)g(v)-5 b(alues)1110 4314 y(b)m(y)30 b(subsequen)m(t)g | |
5889 | (assignmen)m(t)g(statemen)m(ts)i(or)f(unset.)630 4473 | |
5890 | y Fs(-t)384 b Ft(Giv)m(e)32 b(eac)m(h)i Fq(name)j Ft(the)32 | |
5891 | b Fs(trace)f Ft(attribute.)45 b(T)-8 b(raced)32 b(functions)f(inherit)f | |
5892 | (the)1110 4583 y Fs(DEBUG)21 b Ft(trap)h(from)h(the)f(calling)f(shell.) | |
5893 | 37 b(The)22 b(trace)h(attribute)g(has)f(no)g(sp)s(ecial)1110 | |
5894 | 4692 y(meaning)30 b(for)g(v)-5 b(ariables.)630 4852 y | |
5895 | Fs(-x)384 b Ft(Mark)30 b(eac)m(h)h Fq(name)k Ft(for)29 | |
5896 | b(exp)s(ort)h(to)g(subsequen)m(t)f(commands)h(via)f(the)h(en)m(vi-)1110 | |
5897 | 4961 y(ronmen)m(t.)630 5121 y(Using)24 b(`)p Fs(+)p Ft(')h(instead)g | |
5898 | (of)g(`)p Fs(-)p Ft(')g(turns)f(o\013)h(the)g(attribute)g(instead.)38 | |
5899 | b(When)25 b(used)f(in)g(a)h(function,)630 5230 y Fs(declare)37 | |
5900 | b Ft(mak)m(es)i(eac)m(h)h Fq(name)k Ft(lo)s(cal,)d(as)d(with)g(the)h | |
5901 | Fs(local)e Ft(command.)66 b(If)38 b(a)h(v)-5 b(ariable)630 | |
5902 | 5340 y(name)30 b(is)g(follo)m(w)m(ed)g(b)m(y)g(=)p Fq(v)-5 | |
5903 | b(alue)p Ft(,)30 b(the)g(v)-5 b(alue)30 b(of)h(the)f(v)-5 | |
5904 | b(ariable)30 b(is)f(set)i(to)g Fq(v)-5 b(alue)p Ft(.)p | |
5905 | eop | |
5906 | %%Page: 42 48 | |
5907 | 42 47 bop 150 -116 a Ft(42)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
5908 | 299 y(The)k(return)f(status)i(is)f(zero)h(unless)e(an)h(in)m(v)-5 | |
5909 | b(alid)33 b(option)i(is)g(encoun)m(tered,)i(an)f(attempt)630 | |
5910 | 408 y(is)31 b(made)h(to)g(de\014ne)f(a)h(function)f(using)f(`)p | |
5911 | Fs(-f)g(foo=bar)p Ft(',)h(an)h(attempt)g(is)f(made)h(to)h(assign)630 | |
5912 | 518 y(a)42 b(v)-5 b(alue)42 b(to)h(a)f(readonly)f(v)-5 | |
5913 | b(ariable,)45 b(an)d(attempt)h(is)e(made)h(to)h(assign)e(a)i(v)-5 | |
5914 | b(alue)41 b(to)i(an)630 628 y(arra)m(y)30 b(v)-5 b(ariable)28 | |
5915 | b(without)h(using)e(the)j(comp)s(ound)e(assignmen)m(t)h(syn)m(tax)h | |
5916 | (\(see)h(Section)e(6.7)630 737 y([Arra)m(ys],)47 b(page)c(72\),)48 | |
5917 | b(one)43 b(of)g(the)g Fq(names)k Ft(is)42 b(not)h(a)g(v)-5 | |
5918 | b(alid)41 b(shell)g(v)-5 b(ariable)42 b(name,)k(an)630 | |
5919 | 847 y(attempt)28 b(is)e(made)i(to)f(turn)f(o\013)i(readonly)e(status)h | |
5920 | (for)g(a)h(readonly)e(v)-5 b(ariable,)27 b(an)g(attempt)630 | |
5921 | 956 y(is)g(made)i(to)g(turn)e(o\013)i(arra)m(y)f(status)h(for)f(an)g | |
5922 | (arra)m(y)h(v)-5 b(ariable,)28 b(or)g(an)g(attempt)i(is)d(made)h(to)630 | |
5923 | 1066 y(displa)m(y)h(a)h(non-existen)m(t)h(function)e(with)g(`)p | |
5924 | Fs(-f)p Ft('.)150 1227 y Fs(echo)870 1363 y(echo)47 b([-neE])f([)p | |
5925 | Fj(arg)57 b Fs(...)o(])630 1498 y Ft(Output)31 b(the)i | |
5926 | Fq(arg)8 b Ft(s,)33 b(separated)g(b)m(y)g(spaces,)g(terminated)f(with)f | |
5927 | (a)i(newline.)45 b(The)32 b(return)630 1608 y(status)f(is)f(alw)m(a)m | |
5928 | (ys)h(0.)41 b(If)31 b(`)p Fs(-n)p Ft(')f(is)g(sp)s(eci\014ed,)f(the)i | |
5929 | (trailing)d(newline)h(is)g(suppressed.)40 b(If)30 b(the)630 | |
5930 | 1717 y(`)p Fs(-e)p Ft(')23 b(option)h(is)e(giv)m(en,)j(in)m | |
5931 | (terpretation)e(of)h(the)g(follo)m(wing)e(bac)m(kslash-escap)s(ed)h(c)m | |
5932 | (haracters)630 1827 y(is)32 b(enabled.)47 b(The)32 b(`)p | |
5933 | Fs(-E)p Ft(')h(option)f(disables)f(the)i(in)m(terpretation)f(of)h | |
5934 | (these)g(escap)s(e)g(c)m(harac-)630 1936 y(ters,)42 b(ev)m(en)f(on)e | |
5935 | (systems)h(where)f(they)h(are)g(in)m(terpreted)f(b)m(y)h(default.)68 | |
5936 | b(The)39 b Fs(xpg_echo)630 2046 y Ft(shell)d(option)i(ma)m(y)h(b)s(e)e | |
5937 | (used)h(to)h(dynamically)d(determine)h(whether)h(or)g(not)g | |
5938 | Fs(echo)f Ft(ex-)630 2155 y(pands)30 b(these)h(escap)s(e)h(c)m | |
5939 | (haracters)g(b)m(y)f(default.)42 b Fs(echo)30 b Ft(in)m(terprets)h(the) | |
5940 | g(follo)m(wing)e(escap)s(e)630 2265 y(sequences:)630 | |
5941 | 2426 y Fs(\\a)384 b Ft(alert)30 b(\(b)s(ell\))630 2587 | |
5942 | y Fs(\\b)384 b Ft(bac)m(kspace)630 2749 y Fs(\\c)g Ft(suppress)28 | |
5943 | b(trailing)h(newline)630 2910 y Fs(\\e)384 b Ft(escap)s(e)630 | |
5944 | 3071 y Fs(\\f)g Ft(form)30 b(feed)630 3232 y Fs(\\n)384 | |
5945 | b Ft(new)30 b(line)630 3393 y Fs(\\r)384 b Ft(carriage)31 | |
5946 | b(return)630 3554 y Fs(\\t)384 b Ft(horizon)m(tal)30 | |
5947 | b(tab)630 3715 y Fs(\\v)384 b Ft(v)m(ertical)30 b(tab)630 | |
5948 | 3877 y Fs(\\\\)384 b Ft(bac)m(kslash)630 4038 y Fs(\\0)p | |
5949 | Fj(nnn)240 b Ft(the)32 b(eigh)m(t-bit)g(c)m(haracter)i(whose)e(v)-5 | |
5950 | b(alue)32 b(is)f(the)h(o)s(ctal)h(v)-5 b(alue)31 b Fq(nnn)g | |
5951 | Ft(\(zero)i(to)1110 4147 y(three)e(o)s(ctal)f(digits\))630 | |
5952 | 4309 y Fs(\\)p Fj(nnn)288 b Ft(the)35 b(eigh)m(t-bit)f(c)m(haracter)i | |
5953 | (whose)e(v)-5 b(alue)34 b(is)g(the)g(o)s(ctal)h(v)-5 | |
5954 | b(alue)34 b Fq(nnn)f Ft(\(one)i(to)1110 4418 y(three)c(o)s(ctal)f | |
5955 | (digits\))630 4579 y Fs(\\x)p Fj(HH)288 b Ft(the)40 b(eigh)m(t-bit)f(c) | |
5956 | m(haracter)i(whose)e(v)-5 b(alue)38 b(is)h(the)g(hexadecimal)g(v)-5 | |
5957 | b(alue)39 b Fq(HH)1110 4689 y Ft(\(one)31 b(or)f(t)m(w)m(o)i(hex)e | |
5958 | (digits\))150 4850 y Fs(enable)870 4985 y(enable)46 b([-n])h([-p])f | |
5959 | ([-f)h Fj(filename)11 b Fs(])45 b([-ads])h([)p Fj(name)57 | |
5960 | b Fs(...)o(])630 5121 y Ft(Enable)35 b(and)g(disable)f(builtin)f(shell) | |
5961 | h(commands.)56 b(Disabling)34 b(a)j(builtin)32 b(allo)m(ws)j(a)h(disk) | |
5962 | 630 5230 y(command)e(whic)m(h)f(has)h(the)g(same)h(name)f(as)h(a)f | |
5963 | (shell)f(builtin)d(to)35 b(b)s(e)f(executed)h(without)630 | |
5964 | 5340 y(sp)s(ecifying)25 b(a)i(full)e(pathname,)i(ev)m(en)h(though)f | |
5965 | (the)g(shell)e(normally)g(searc)m(hes)j(for)f(builtins)p | |
5966 | eop | |
5967 | %%Page: 43 49 | |
5968 | 43 48 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
5969 | b(Builtin)g(Commands)2069 b(43)630 299 y(b)s(efore)32 | |
5970 | b(disk)e(commands.)46 b(If)31 b(`)p Fs(-n)p Ft(')h(is)f(used,)h(the)g | |
5971 | Fq(name)5 b Ft(s)32 b(b)s(ecome)h(disabled.)43 b(Otherwise)630 | |
5972 | 408 y Fq(name)5 b Ft(s)44 b(are)h(enabled.)81 b(F)-8 | |
5973 | b(or)45 b(example,)j(to)d(use)f(the)g Fs(test)f Ft(binary)g(found)g | |
5974 | (via)g Fs($PATH)630 518 y Ft(instead)30 b(of)g(the)h(shell)d(builtin)f | |
5975 | (v)m(ersion,)j(t)m(yp)s(e)h(`)p Fs(enable)e(-n)h(test)p | |
5976 | Ft('.)630 656 y(If)42 b(the)h(`)p Fs(-p)p Ft(')f(option)g(is)f | |
5977 | (supplied,)i(or)f(no)h Fq(name)k Ft(argumen)m(ts)c(app)s(ear,)i(a)e | |
5978 | (list)e(of)i(shell)630 766 y(builtins)34 b(is)j(prin)m(ted.)62 | |
5979 | b(With)37 b(no)g(other)h(argumen)m(ts,)j(the)d(list)e(consists)h(of)h | |
5980 | (all)f(enabled)630 875 y(shell)31 b(builtins.)43 b(The)32 | |
5981 | b(`)p Fs(-a)p Ft(')h(option)f(means)g(to)i(list)d(eac)m(h)j(builtin)29 | |
5982 | b(with)i(an)h(indication)f(of)630 985 y(whether)f(or)g(not)h(it)f(is)f | |
5983 | (enabled.)630 1123 y(The)40 b(`)p Fs(-f)p Ft(')g(option)f(means)h(to)h | |
5984 | (load)f(the)g(new)f(builtin)e(command)j Fq(name)45 b | |
5985 | Ft(from)40 b(shared)630 1233 y(ob)5 b(ject)27 b Fq(\014lename)p | |
5986 | Ft(,)f(on)g(systems)g(that)h(supp)s(ort)d(dynamic)h(loading.)38 | |
5987 | b(The)26 b(`)p Fs(-d)p Ft(')g(option)g(will)630 1342 | |
5988 | y(delete)31 b(a)f(builtin)d(loaded)j(with)f(`)p Fs(-f)p | |
5989 | Ft('.)630 1481 y(If)i(there)g(are)g(no)g(options,)g(a)g(list)f(of)h | |
5990 | (the)g(shell)e(builtins)f(is)i(displa)m(y)m(ed.)41 b(The)31 | |
5991 | b(`)p Fs(-s)p Ft(')f(option)630 1590 y(restricts)e Fs(enable)f | |
5992 | Ft(to)i(the)f Fl(posix)g Ft(sp)s(ecial)f(builtins.)37 | |
5993 | b(If)27 b(`)p Fs(-s)p Ft(')i(is)e(used)h(with)f(`)p Fs(-f)p | |
5994 | Ft(',)i(the)f(new)630 1700 y(builtin)f(b)s(ecomes)k(a)f(sp)s(ecial)f | |
5995 | (builtin)e(\(see)32 b(Section)e(4.4)h([Sp)s(ecial)e(Builtins],)f(page)j | |
5996 | (53\).)630 1838 y(The)26 b(return)f(status)h(is)f(zero)i(unless)d(a)j | |
5997 | Fq(name)k Ft(is)25 b(not)h(a)h(shell)d(builtin)f(or)j(there)g(is)f(an)h | |
5998 | (error)630 1947 y(loading)j(a)i(new)f(builtin)d(from)j(a)g(shared)g(ob) | |
5999 | 5 b(ject.)150 2114 y Fs(help)870 2252 y(help)47 b([-s])f([)p | |
6000 | Fj(pattern)11 b Fs(])630 2391 y Ft(Displa)m(y)38 b(helpful)e | |
6001 | (information)h(ab)s(out)i(builtin)c(commands.)66 b(If)38 | |
6002 | b Fq(pattern)h Ft(is)f(sp)s(eci\014ed,)630 2500 y Fs(help)28 | |
6003 | b Ft(giv)m(es)h(detailed)f(help)f(on)i(all)f(commands)g(matc)m(hing)h | |
6004 | Fq(pattern)p Ft(,)h(otherwise)e(a)h(list)f(of)630 2610 | |
6005 | y(the)36 b(builtins)c(is)j(prin)m(ted.)55 b(The)35 b(`)p | |
6006 | Fs(-s)p Ft(')h(option)f(restricts)g(the)h(information)e(displa)m(y)m | |
6007 | (ed)g(to)630 2719 y(a)e(short)g(usage)h(synopsis.)43 | |
6008 | b(The)32 b(return)f(status)h(is)f(zero)i(unless)d(no)i(command)g(matc)m | |
6009 | (hes)630 2829 y Fq(pattern)p Ft(.)150 2996 y Fs(let)870 | |
6010 | 3134 y(let)47 b Fj(expression)55 b Fs([)p Fj(expression)11 | |
6011 | b Fs(])630 3272 y Ft(The)41 b Fs(let)g Ft(builtin)d(allo)m(ws)j | |
6012 | (arithmetic)f(to)j(b)s(e)d(p)s(erformed)g(on)i(shell)e(v)-5 | |
6013 | b(ariables.)72 b(Eac)m(h)630 3382 y Fq(expression)30 | |
6014 | b Ft(is)g(ev)-5 b(aluated)31 b(according)f(to)i(the)f(rules)f(giv)m(en) | |
6015 | h(b)s(elo)m(w)f(in)f(Section)i(6.5)h([Shell)630 3491 | |
6016 | y(Arithmetic],)49 b(page)d(70.)87 b(If)45 b(the)g(last)g | |
6017 | Fq(expression)g Ft(ev)-5 b(aluates)46 b(to)g(0,)k Fs(let)44 | |
6018 | b Ft(returns)g(1;)630 3601 y(otherwise)30 b(0)h(is)e(returned.)150 | |
6019 | 3768 y Fs(local)870 3906 y(local)46 b([)p Fj(option)11 | |
6020 | b Fs(])45 b Fj(name)11 b Fs([=)p Fj(value)g Fs(])44 b(...)630 | |
6021 | 4044 y Ft(F)-8 b(or)27 b(eac)m(h)g(argumen)m(t,)g(a)f(lo)s(cal)f(v)-5 | |
6022 | b(ariable)25 b(named)g Fq(name)31 b Ft(is)25 b(created,)j(and)d | |
6023 | (assigned)g Fq(v)-5 b(alue)p Ft(.)630 4154 y(The)37 b | |
6024 | Fq(option)g Ft(can)g(b)s(e)g(an)m(y)h(of)f(the)h(options)f(accepted)h | |
6025 | (b)m(y)g Fs(declare)p Ft(.)59 b Fs(local)36 b Ft(can)i(only)630 | |
6026 | 4263 y(b)s(e)j(used)h(within)d(a)k(function;)k(it)41 | |
6027 | b(mak)m(es)i(the)f(v)-5 b(ariable)41 b Fq(name)48 b Ft(ha)m(v)m(e)43 | |
6028 | b(a)f(visible)e(scop)s(e)630 4373 y(restricted)e(to)h(that)g(function)e | |
6029 | (and)g(its)h(c)m(hildren.)62 b(The)38 b(return)f(status)h(is)g(zero)h | |
6030 | (unless)630 4482 y Fs(local)g Ft(is)g(used)h(outside)f(a)i(function,)g | |
6031 | (an)f(in)m(v)-5 b(alid)38 b Fq(name)46 b Ft(is)39 b(supplied,)h(or)g | |
6032 | Fq(name)45 b Ft(is)40 b(a)630 4592 y(readonly)29 b(v)-5 | |
6033 | b(ariable.)150 4759 y Fs(logout)870 4897 y(logout)46 | |
6034 | b([)p Fj(n)11 b Fs(])630 5035 y Ft(Exit)30 b(a)h(login)e(shell,)g | |
6035 | (returning)f(a)j(status)g(of)f Fq(n)g Ft(to)h(the)g(shell's)d(paren)m | |
6036 | (t.)150 5202 y Fs(printf)870 5340 y(printf)46 b Fj(format)57 | |
6037 | b Fs([)p Fj(arguments)11 b Fs(])p eop | |
6038 | %%Page: 44 50 | |
6039 | 44 49 bop 150 -116 a Ft(44)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
6040 | 299 y(W)-8 b(rite)26 b(the)h(formatted)f Fq(argumen)m(ts)k | |
6041 | Ft(to)d(the)f(standard)f(output)h(under)e(the)i(con)m(trol)h(of)f(the) | |
6042 | 630 408 y Fq(format)p Ft(.)41 b(The)28 b Fq(format)j | |
6043 | Ft(is)d(a)h(c)m(haracter)i(string)c(whic)m(h)h(con)m(tains)h(three)g(t) | |
6044 | m(yp)s(es)g(of)g(ob)5 b(jects:)630 518 y(plain)26 b(c)m(haracters,)31 | |
6045 | b(whic)m(h)c(are)i(simply)d(copied)i(to)i(standard)d(output,)i(c)m | |
6046 | (haracter)h(escap)s(e)630 628 y(sequences,)g(whic)m(h)e(are)h(con)m(v)m | |
6047 | (erted)i(and)d(copied)h(to)g(the)h(standard)e(output,)h(and)g(format) | |
6048 | 630 737 y(sp)s(eci\014cations,)37 b(eac)m(h)g(of)g(whic)m(h)e(causes)h | |
6049 | (prin)m(ting)e(of)j(the)f(next)h(successiv)m(e)f Fq(argumen)m(t)p | |
6050 | Ft(.)630 847 y(In)31 b(addition)f(to)j(the)e(standard)g | |
6051 | Fs(printf\(1\))f Ft(formats,)i(`)p Fs(\045b)p Ft(')g(causes)g | |
6052 | Fs(printf)e Ft(to)j(expand)630 956 y(bac)m(kslash)38 | |
6053 | b(escap)s(e)h(sequences)f(in)g(the)g(corresp)s(onding)e | |
6054 | Fq(argumen)m(t)p Ft(,)41 b(\(except)f(that)f(`)p Fs(\\c)p | |
6055 | Ft(')630 1066 y(terminates)k(output,)k(bac)m(kslashes)c(in)f(`)p | |
6056 | Fs(\\')p Ft(',)47 b(`)p Fs(\\")p Ft(',)g(and)c(`)p Fs(\\?)p | |
6057 | Ft(')g(are)h(not)g(remo)m(v)m(ed,)k(and)630 1176 y(o)s(ctal)24 | |
6058 | b(escap)s(es)g(b)s(eginning)d(with)h(`)p Fs(\\0)p Ft(')i(ma)m(y)g(con)m | |
6059 | (tain)g(up)f(to)h(four)f(digits\),)h(and)f(`)p Fs(\045q)p | |
6060 | Ft(')h(causes)630 1285 y Fs(printf)31 b Ft(to)i(output)f(the)h(corresp) | |
6061 | s(onding)e Fq(argumen)m(t)k Ft(in)c(a)i(format)g(that)g(can)g(b)s(e)f | |
6062 | (reused)630 1395 y(as)f(shell)d(input.)630 1526 y(The)j | |
6063 | Fq(format)i Ft(is)e(reused)f(as)i(necessary)f(to)i(consume)e(all)f(of)h | |
6064 | (the)h Fq(argumen)m(ts)p Ft(.)44 b(If)30 b(the)i Fq(for-)630 | |
6065 | 1636 y(mat)c Ft(requires)d(more)h Fq(argumen)m(ts)k Ft(than)25 | |
6066 | b(are)i(supplied,)c(the)j(extra)h(format)f(sp)s(eci\014cations)630 | |
6067 | 1745 y(b)s(eha)m(v)m(e)j(as)g(if)e(a)i(zero)g(v)-5 b(alue)28 | |
6068 | b(or)h(n)m(ull)d(string,)i(as)h(appropriate,)f(had)g(b)s(een)g | |
6069 | (supplied.)36 b(The)630 1855 y(return)29 b(v)-5 b(alue)30 | |
6070 | b(is)g(zero)h(on)f(success,)h(non-zero)g(on)f(failure.)150 | |
6071 | 2008 y Fs(read)870 2140 y(read)47 b([-ers])f([-a)h Fj(aname)11 | |
6072 | b Fs(])45 b([-d)i Fj(delim)11 b Fs(])46 b([-n)h Fj(nchars)11 | |
6073 | b Fs(])45 b([-p)i Fj(prompt)11 b Fs(])45 b([-t)i Fj(time-)870 | |
6074 | 2250 y(out)11 b Fs(])46 b([-u)h Fj(fd)11 b Fs(])46 b([)p | |
6075 | Fj(name)57 b Fs(...])630 2381 y Ft(One)26 b(line)f(is)h(read)g(from)h | |
6076 | (the)f(standard)g(input,)g(or)h(from)f(the)h(\014le)e(descriptor)h | |
6077 | Fq(fd)j Ft(supplied)630 2491 y(as)37 b(an)g(argumen)m(t)h(to)f(the)h(`) | |
6078 | p Fs(-u)p Ft(')e(option,)j(and)d(the)i(\014rst)e(w)m(ord)g(is)g | |
6079 | (assigned)h(to)g(the)h(\014rst)630 2600 y Fq(name)p Ft(,)29 | |
6080 | b(the)f(second)h(w)m(ord)e(to)i(the)g(second)f Fq(name)p | |
6081 | Ft(,)h(and)e(so)i(on,)g(with)e(lefto)m(v)m(er)i(w)m(ords)f(and)630 | |
6082 | 2710 y(their)f(in)m(terv)m(ening)g(separators)i(assigned)e(to)i(the)f | |
6083 | (last)g Fq(name)p Ft(.)40 b(If)27 b(there)i(are)f(few)m(er)g(w)m(ords) | |
6084 | 630 2819 y(read)44 b(from)f(the)g(input)f(stream)i(than)g(names,)j(the) | |
6085 | c(remaining)f(names)i(are)g(assigned)630 2929 y(empt)m(y)31 | |
6086 | b(v)-5 b(alues.)40 b(The)30 b(c)m(haracters)i(in)d(the)i(v)-5 | |
6087 | b(alue)30 b(of)h(the)f Fs(IFS)g Ft(v)-5 b(ariable)29 | |
6088 | b(are)i(used)f(to)h(split)630 3039 y(the)37 b(line)f(in)m(to)h(w)m | |
6089 | (ords.)61 b(The)36 b(bac)m(kslash)h(c)m(haracter)i(`)p | |
6090 | Fs(\\)p Ft(')e(ma)m(y)h(b)s(e)f(used)f(to)i(remo)m(v)m(e)h(an)m(y)630 | |
6091 | 3148 y(sp)s(ecial)f(meaning)h(for)g(the)g(next)h(c)m(haracter)h(read)e | |
6092 | (and)g(for)g(line)f(con)m(tin)m(uation.)67 b(If)39 b(no)630 | |
6093 | 3258 y(names)28 b(are)h(supplied,)d(the)i(line)f(read)i(is)e(assigned)h | |
6094 | (to)h(the)f(v)-5 b(ariable)27 b Fs(REPLY)p Ft(.)39 b(The)28 | |
6095 | b(return)630 3367 y(co)s(de)i(is)e(zero,)j(unless)d(end-of-\014le)h(is) | |
6096 | f(encoun)m(tered,)i Fs(read)f Ft(times)g(out,)h(or)f(an)h(in)m(v)-5 | |
6097 | b(alid)27 b(\014le)630 3477 y(descriptor)34 b(is)h(supplied)d(as)k(the) | |
6098 | f(argumen)m(t)h(to)g(`)p Fs(-u)p Ft('.)56 b(Options,)36 | |
6099 | b(if)e(supplied,)g(ha)m(v)m(e)j(the)630 3587 y(follo)m(wing)29 | |
6100 | b(meanings:)630 3740 y Fs(-a)h Fj(aname)114 b Ft(The)34 | |
6101 | b(w)m(ords)f(are)i(assigned)e(to)i(sequen)m(tial)f(indices)e(of)i(the)g | |
6102 | (arra)m(y)h(v)-5 b(ariable)1110 3850 y Fq(aname)p Ft(,)29 | |
6103 | b(starting)g(at)g(0.)40 b(All)27 b(elemen)m(ts)i(are)f(remo)m(v)m(ed)i | |
6104 | (from)d Fq(aname)34 b Ft(b)s(efore)1110 3959 y(the)d(assignmen)m(t.)40 | |
6105 | b(Other)30 b Fq(name)36 b Ft(argumen)m(ts)30 b(are)h(ignored.)630 | |
6106 | 4113 y Fs(-d)f Fj(delim)114 b Ft(The)41 b(\014rst)h(c)m(haracter)h(of)f | |
6107 | Fq(delim)e Ft(is)h(used)h(to)g(terminate)g(the)g(input)e(line,)1110 | |
6108 | 4222 y(rather)30 b(than)g(newline.)630 4376 y Fs(-e)384 | |
6109 | b Ft(Readline)26 b(\(see)j(Chapter)e(8)h([Command)f(Line)f(Editing],)h | |
6110 | (page)h(83\))h(is)e(used)1110 4485 y(to)k(obtain)f(the)h(line.)630 | |
6111 | 4639 y Fs(-n)f Fj(nchars)1110 4748 y Fs(read)38 b Ft(returns)f(after)j | |
6112 | (reading)e Fq(nc)m(hars)k Ft(c)m(haracters)e(rather)f(than)g(w)m | |
6113 | (aiting)1110 4858 y(for)30 b(a)h(complete)g(line)d(of)j(input.)630 | |
6114 | 5011 y Fs(-p)f Fj(prompt)1110 5121 y Ft(Displa)m(y)36 | |
6115 | b Fq(prompt)p Ft(,)i(without)d(a)i(trailing)e(newline,)i(b)s(efore)f | |
6116 | (attempting)h(to)1110 5230 y(read)g(an)m(y)h(input.)59 | |
6117 | b(The)37 b(prompt)g(is)f(displa)m(y)m(ed)g(only)g(if)g(input)g(is)g | |
6118 | (coming)1110 5340 y(from)30 b(a)h(terminal.)p eop | |
6119 | %%Page: 45 51 | |
6120 | 45 50 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
6121 | b(Builtin)g(Commands)2069 b(45)630 299 y Fs(-r)384 b | |
6122 | Ft(If)21 b(this)g(option)g(is)f(giv)m(en,)k(bac)m(kslash)d(do)s(es)g | |
6123 | (not)h(act)h(as)f(an)f(escap)s(e)h(c)m(haracter.)1110 | |
6124 | 408 y(The)30 b(bac)m(kslash)h(is)f(considered)g(to)i(b)s(e)e(part)h(of) | |
6125 | g(the)g(line.)41 b(In)30 b(particular,)g(a)1110 518 y(bac)m | |
6126 | (kslash-newline)e(pair)h(ma)m(y)i(not)g(b)s(e)f(used)f(as)i(a)g(line)d | |
6127 | (con)m(tin)m(uation.)630 676 y Fs(-s)384 b Ft(Silen)m(t)26 | |
6128 | b(mo)s(de.)40 b(If)27 b(input)e(is)i(coming)g(from)g(a)h(terminal,)f(c) | |
6129 | m(haracters)i(are)f(not)1110 786 y(ec)m(ho)s(ed.)630 | |
6130 | 944 y Fs(-t)i Fj(timeout)1110 1054 y Ft(Cause)42 b Fs(read)g | |
6131 | Ft(to)h(time)g(out)g(and)f(return)f(failure)g(if)h(a)h(complete)g(line) | |
6132 | e(of)1110 1163 y(input)25 b(is)h(not)i(read)f(within)d | |
6133 | Fq(timeout)29 b Ft(seconds.)40 b(This)25 b(option)i(has)f(no)h | |
6134 | (e\013ect)1110 1273 y(if)i Fs(read)h Ft(is)f(not)i(reading)e(input)f | |
6135 | (from)i(the)h(terminal)e(or)h(a)h(pip)s(e.)630 1431 y | |
6136 | Fs(-u)f Fj(fd)258 b Ft(Read)31 b(input)d(from)i(\014le)f(descriptor)h | |
6137 | Fq(fd)p Ft(.)150 1590 y Fs(shopt)870 1724 y(shopt)46 | |
6138 | b([-pqsu])g([-o])h([)p Fj(optname)56 b Fs(...)o(])630 | |
6139 | 1857 y Ft(T)-8 b(oggle)46 b(the)e(v)-5 b(alues)44 b(of)h(v)-5 | |
6140 | b(ariables)43 b(con)m(trolling)h(optional)g(shell)e(b)s(eha)m(vior.)83 | |
6141 | b(With)44 b(no)630 1967 y(options,)31 b(or)g(with)f(the)h(`)p | |
6142 | Fs(-p)p Ft(')g(option,)g(a)h(list)d(of)j(all)e(settable)h(options)g(is) | |
6143 | f(displa)m(y)m(ed,)g(with)630 2077 y(an)k(indication)f(of)i(whether)f | |
6144 | (or)g(not)h(eac)m(h)h(is)d(set.)54 b(The)34 b(`)p Fs(-p)p | |
6145 | Ft(')h(option)f(causes)h(output)f(to)630 2186 y(b)s(e)i(displa)m(y)m | |
6146 | (ed)f(in)f(a)j(form)f(that)h(ma)m(y)g(b)s(e)e(reused)h(as)g(input.)57 | |
6147 | b(Other)36 b(options)f(ha)m(v)m(e)j(the)630 2296 y(follo)m(wing)29 | |
6148 | b(meanings:)630 2454 y Fs(-s)384 b Ft(Enable)29 b(\(set\))j(eac)m(h)f | |
6149 | Fq(optname)p Ft(.)630 2612 y Fs(-u)384 b Ft(Disable)29 | |
6150 | b(\(unset\))i(eac)m(h)h Fq(optname)p Ft(.)630 2771 y | |
6151 | Fs(-q)384 b Ft(Suppresses)28 b(normal)g(output;)i(the)g(return)e | |
6152 | (status)i(indicates)f(whether)g(the)1110 2880 y Fq(optname)37 | |
6153 | b Ft(is)30 b(set)i(or)f(unset.)43 b(If)31 b(m)m(ultiple)e | |
6154 | Fq(optname)37 b Ft(argumen)m(ts)31 b(are)h(giv)m(en)1110 | |
6155 | 2990 y(with)42 b(`)p Fs(-q)p Ft(',)k(the)d(return)f(status)h(is)f(zero) | |
6156 | i(if)e(all)f Fq(optnames)47 b Ft(are)d(enabled;)1110 | |
6157 | 3099 y(non-zero)31 b(otherwise.)630 3258 y Fs(-o)384 | |
6158 | b Ft(Restricts)41 b(the)h(v)-5 b(alues)41 b(of)g Fq(optname)47 | |
6159 | b Ft(to)42 b(b)s(e)f(those)h(de\014ned)e(for)h(the)h(`)p | |
6160 | Fs(-o)p Ft(')1110 3367 y(option)20 b(to)i(the)f Fs(set)f | |
6161 | Ft(builtin)d(\(see)22 b(Section)e(4.3)i([The)e(Set)h(Builtin],)g(page)g | |
6162 | (50\).)630 3526 y(If)29 b(either)h(`)p Fs(-s)p Ft(')g(or)g(`)p | |
6163 | Fs(-u)p Ft(')f(is)g(used)h(with)e(no)i Fq(optname)35 | |
6164 | b Ft(argumen)m(ts,)c(the)f(displa)m(y)e(is)h(limited)630 | |
6165 | 3635 y(to)i(those)g(options)f(whic)m(h)f(are)i(set)f(or)h(unset,)f | |
6166 | (resp)s(ectiv)m(ely)-8 b(.)630 3769 y(Unless)29 b(otherwise)h(noted,)h | |
6167 | (the)g Fs(shopt)d Ft(options)i(are)h(disabled)d(\(o\013)7 | |
6168 | b(\))32 b(b)m(y)e(default.)630 3903 y(The)d(return)f(status)i(when)f | |
6169 | (listing)e(options)i(is)f(zero)j(if)d(all)h Fq(optnames)k | |
6170 | Ft(are)d(enabled,)f(non-)630 4013 y(zero)40 b(otherwise.)65 | |
6171 | b(When)39 b(setting)g(or)g(unsetting)f(options,)i(the)f(return)f | |
6172 | (status)h(is)f(zero)630 4122 y(unless)29 b(an)h Fq(optname)36 | |
6173 | b Ft(is)29 b(not)i(a)g(v)-5 b(alid)28 b(shell)h(option.)630 | |
6174 | 4256 y(The)h(list)f(of)h Fs(shopt)f Ft(options)h(is:)630 | |
6175 | 4415 y Fs(cdable_vars)1110 4524 y Ft(If)k(this)g(is)g(set,)j(an)e | |
6176 | (argumen)m(t)g(to)h(the)f Fs(cd)f Ft(builtin)e(command)i(that)i(is)e | |
6177 | (not)1110 4634 y(a)d(directory)f(is)g(assumed)g(to)h(b)s(e)f(the)h | |
6178 | (name)f(of)h(a)g(v)-5 b(ariable)29 b(whose)i(v)-5 b(alue)30 | |
6179 | b(is)1110 4743 y(the)h(directory)e(to)j(c)m(hange)f(to.)630 | |
6180 | 4902 y Fs(cdspell)144 b Ft(If)27 b(set,)h(minor)e(errors)g(in)g(the)h | |
6181 | (sp)s(elling)e(of)i(a)g(directory)g(comp)s(onen)m(t)g(in)f(a)i | |
6182 | Fs(cd)1110 5011 y Ft(command)i(will)e(b)s(e)i(corrected.)43 | |
6183 | b(The)30 b(errors)g(c)m(hec)m(k)m(ed)j(for)d(are)h(transp)s(osed)1110 | |
6184 | 5121 y(c)m(haracters,)46 b(a)c(missing)d(c)m(haracter,)47 | |
6185 | b(and)40 b(a)i(c)m(haracter)h(to)s(o)g(man)m(y)-8 b(.)74 | |
6186 | b(If)42 b(a)1110 5230 y(correction)24 b(is)e(found,)h(the)h(corrected)g | |
6187 | (path)f(is)f(prin)m(ted,)h(and)g(the)g(command)1110 5340 | |
6188 | y(pro)s(ceeds.)40 b(This)29 b(option)h(is)f(only)h(used)f(b)m(y)h(in)m | |
6189 | (teractiv)m(e)i(shells.)p eop | |
6190 | %%Page: 46 52 | |
6191 | 46 51 bop 150 -116 a Ft(46)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
6192 | 299 y Fs(checkhash)1110 408 y Ft(If)e(this)g(is)g(set,)h(Bash)g(c)m | |
6193 | (hec)m(ks)h(that)g(a)f(command)f(found)g(in)f(the)i(hash)f(table)1110 | |
6194 | 518 y(exists)j(b)s(efore)g(trying)g(to)i(execute)g(it.)47 | |
6195 | b(If)32 b(a)h(hashed)e(command)i(no)f(longer)1110 628 | |
6196 | y(exists,)e(a)h(normal)e(path)h(searc)m(h)h(is)f(p)s(erformed.)630 | |
6197 | 775 y Fs(checkwinsize)1110 885 y Ft(If)41 b(set,)k(Bash)c(c)m(hec)m(ks) | |
6198 | i(the)f(windo)m(w)d(size)j(after)g(eac)m(h)g(command)f(and,)j(if)1110 | |
6199 | 995 y(necessary)-8 b(,)31 b(up)s(dates)f(the)g(v)-5 b(alues)30 | |
6200 | b(of)h Fs(LINES)e Ft(and)g Fs(COLUMNS)p Ft(.)630 1142 | |
6201 | y Fs(cmdhist)144 b Ft(If)33 b(set,)j(Bash)e(attempts)h(to)g(sa)m(v)m(e) | |
6202 | g(all)e(lines)f(of)i(a)h(m)m(ultiple-line)30 b(command)1110 | |
6203 | 1252 y(in)g(the)h(same)g(history)f(en)m(try)-8 b(.)42 | |
6204 | b(This)29 b(allo)m(ws)h(easy)i(re-editing)e(of)h(m)m(ulti-line)1110 | |
6205 | 1361 y(commands.)630 1509 y Fs(dotglob)144 b Ft(If)27 | |
6206 | b(set,)i(Bash)f(includes)e(\014lenames)h(b)s(eginning)e(with)h(a)i(`.') | |
6207 | 41 b(in)26 b(the)i(results)f(of)1110 1619 y(\014lename)j(expansion.)630 | |
6208 | 1766 y Fs(execfail)96 b Ft(If)24 b(this)g(is)f(set,)k(a)e(non-in)m | |
6209 | (teractiv)m(e)g(shell)e(will)e(not)k(exit)g(if)e(it)h(cannot)i(execute) | |
6210 | 1110 1876 y(the)i(\014le)f(sp)s(eci\014ed)g(as)h(an)g(argumen)m(t)g(to) | |
6211 | h(the)f Fs(exec)f Ft(builtin)e(command.)39 b(An)1110 | |
6212 | 1986 y(in)m(teractiv)m(e)31 b(shell)e(do)s(es)h(not)g(exit)h(if)e | |
6213 | Fs(exec)g Ft(fails.)630 2133 y Fs(expand_aliases)1110 | |
6214 | 2243 y Ft(If)j(set,)h(aliases)e(are)i(expanded)e(as)h(describ)s(ed)e(b) | |
6215 | s(elo)m(w)h(under)g(Aliases,)g(Sec-)1110 2352 y(tion)37 | |
6216 | b(6.6)i([Aliases],)h(page)f(71.)64 b(This)36 b(option)h(is)g(enabled)g | |
6217 | (b)m(y)h(default)f(for)1110 2462 y(in)m(teractiv)m(e)31 | |
6218 | b(shells.)630 2610 y Fs(extdebug)96 b Ft(If)30 b(set,)h(b)s(eha)m(vior) | |
6219 | f(in)m(tended)f(for)h(use)g(b)m(y)g(debuggers)g(is)g(enabled:)1159 | |
6220 | 2738 y(1.)61 b(The)32 b(`)p Fs(-F)p Ft(')g(option)g(to)h(the)g | |
6221 | Fs(declare)d Ft(builtin)f(\(see)34 b(Section)e(4.2)i([Bash)1290 | |
6222 | 2848 y(Builtins],)26 b(page)j(39\))g(displa)m(ys)d(the)i(source)h | |
6223 | (\014le)e(name)h(and)f(line)f(n)m(um-)1290 2958 y(b)s(er)j(corresp)s | |
6224 | (onding)f(to)j(eac)m(h)g(function)e(name)h(supplied)d(as)k(an)f(argu-) | |
6225 | 1290 3067 y(men)m(t.)1159 3196 y(2.)61 b(If)20 b(the)h(command)g(run)e | |
6226 | (b)m(y)i(the)f Fs(DEBUG)g Ft(trap)g(returns)g(a)h(non-zero)g(v)-5 | |
6227 | b(alue,)1290 3305 y(the)31 b(next)f(command)g(is)g(skipp)s(ed)e(and)h | |
6228 | (not)i(executed.)1159 3434 y(3.)61 b(If)37 b(the)g(command)g(run)f(b)m | |
6229 | (y)i(the)f Fs(DEBUG)f Ft(trap)h(returns)f(a)i(v)-5 b(alue)37 | |
6230 | b(of)g(2,)1290 3544 y(and)c(the)g(shell)f(is)g(executing)i(in)e(a)i | |
6231 | (subroutine)d(\(a)j(shell)e(function)g(or)1290 3653 y(a)i(shell)f | |
6232 | (script)g(executed)i(b)m(y)f(the)g Fs(.)g Ft(or)g Fs(source)e | |
6233 | Ft(builtins\),)g(a)j(call)e(to)1290 3763 y Fs(return)c | |
6234 | Ft(is)g(sim)m(ulated.)630 3911 y Fs(extglob)144 b Ft(If)26 | |
6235 | b(set,)i(the)f(extended)f(pattern)h(matc)m(hing)f(features)h(describ)s | |
6236 | (ed)d(ab)s(o)m(v)m(e)k(\(see)1110 4020 y(Section)i(3.5.8.1)j([P)m | |
6237 | (attern)f(Matc)m(hing],)f(page)g(23\))h(are)f(enabled.)630 | |
6238 | 4168 y Fs(extquote)96 b Ft(If)49 b(set,)54 b Fs($')p | |
6239 | Fj(string)11 b Fs(')46 b Ft(and)j Fs($")p Fj(string)11 | |
6240 | b Fs(")46 b Ft(quoting)j(is)f(p)s(erformed)f(within)1110 | |
6241 | 4277 y Fs(${)p Fj(parameter)11 b Fs(})30 b Ft(expansions)i(enclosed)h | |
6242 | (in)g(double)f(quotes.)51 b(This)31 b(option)1110 4387 | |
6243 | y(is)e(enabled)h(b)m(y)g(default.)630 4535 y Fs(failglob)96 | |
6244 | b Ft(If)30 b(set,)g(patterns)g(whic)m(h)f(fail)g(to)i(matc)m(h)g | |
6245 | (\014lenames)e(during)e(pathname)j(ex-)1110 4644 y(pansion)f(result)g | |
6246 | (in)g(an)h(expansion)g(error.)630 4792 y Fs(force_fignore)1110 | |
6247 | 4902 y Ft(If)43 b(set,)k(the)d(su\016xes)f(sp)s(eci\014ed)e(b)m(y)j | |
6248 | (the)f Fs(FIGNORE)f Ft(shell)f(v)-5 b(ariable)42 b(cause)1110 | |
6249 | 5011 y(w)m(ords)31 b(to)h(b)s(e)f(ignored)g(when)g(p)s(erforming)e(w)m | |
6250 | (ord)i(completion)g(ev)m(en)h(if)f(the)1110 5121 y(ignored)36 | |
6251 | b(w)m(ords)h(are)g(the)h(only)e(p)s(ossible)f(completions.)60 | |
6252 | b(See)37 b(Section)g(5.2)1110 5230 y([Bash)24 b(V)-8 | |
6253 | b(ariables],)25 b(page)g(55,)h(for)d(a)h(description)e(of)i | |
6254 | Fs(FIGNORE)p Ft(.)37 b(This)21 b(option)1110 5340 y(is)29 | |
6255 | b(enabled)h(b)m(y)g(default.)p eop | |
6256 | %%Page: 47 53 | |
6257 | 47 52 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
6258 | b(Builtin)g(Commands)2069 b(47)630 299 y Fs(gnu_errfmt)1110 | |
6259 | 408 y Ft(If)35 b(set,)j(shell)c(error)i(messages)g(are)h(written)d(in)h | |
6260 | (the)h(standard)f Fl(gnu)g Ft(error)1110 518 y(message)c(format.)630 | |
6261 | 667 y Fs(histappend)1110 777 y Ft(If)c(set,)j(the)e(history)f(list)f | |
6262 | (is)h(app)s(ended)f(to)j(the)f(\014le)f(named)g(b)m(y)h(the)g(v)-5 | |
6263 | b(alue)28 b(of)1110 887 y(the)e Fs(HISTFILE)d Ft(v)-5 | |
6264 | b(ariable)24 b(when)g(the)h(shell)f(exits,)i(rather)f(than)h(o)m(v)m | |
6265 | (erwriting)1110 996 y(the)31 b(\014le.)630 1146 y Fs(histreedit)1110 | |
6266 | 1255 y Ft(If)i(set,)h(and)f(Readline)f(is)g(b)s(eing)g(used,)h(a)g | |
6267 | (user)g(is)f(giv)m(en)h(the)h(opp)s(ortunit)m(y)1110 | |
6268 | 1365 y(to)d(re-edit)f(a)h(failed)e(history)g(substitution.)630 | |
6269 | 1514 y Fs(histverify)1110 1624 y Ft(If)35 b(set,)i(and)e(Readline)f(is) | |
6270 | g(b)s(eing)g(used,)i(the)f(results)f(of)h(history)g(substitu-)1110 | |
6271 | 1733 y(tion)h(are)h(not)g(immediately)e(passed)h(to)h(the)g(shell)e | |
6272 | (parser.)59 b(Instead,)38 b(the)1110 1843 y(resulting)g(line)f(is)i | |
6273 | (loaded)g(in)m(to)g(the)h(Readline)e(editing)g(bu\013er,)j(allo)m(wing) | |
6274 | 1110 1953 y(further)29 b(mo)s(di\014cation.)630 2102 | |
6275 | y Fs(hostcomplete)1110 2212 y Ft(If)38 b(set,)j(and)c(Readline)g(is)g | |
6276 | (b)s(eing)g(used,)i(Bash)g(will)c(attempt)k(to)g(p)s(erform)1110 | |
6277 | 2321 y(hostname)d(completion)f(when)g(a)h(w)m(ord)f(con)m(taining)g(a)h | |
6278 | (`)p Fs(@)p Ft(')g(is)f(b)s(eing)f(com-)1110 2431 y(pleted)40 | |
6279 | b(\(see)h(Section)f(8.4.6)i([Commands)e(F)-8 b(or)41 | |
6280 | b(Completion],)g(page)g(99\).)1110 2540 y(This)29 b(option)g(is)h | |
6281 | (enabled)f(b)m(y)h(default.)630 2690 y Fs(huponexit)1110 | |
6282 | 2800 y Ft(If)i(set,)i(Bash)f(will)e(send)g Fs(SIGHUP)h | |
6283 | Ft(to)h(all)f(jobs)g(when)g(an)g(in)m(teractiv)m(e)i(login)1110 | |
6284 | 2909 y(shell)29 b(exits)h(\(see)h(Section)f(3.7.6)i([Signals],)e(page)h | |
6285 | (31\).)630 3059 y Fs(interactive_comments)1110 3168 y | |
6286 | Ft(Allo)m(w)25 b(a)i(w)m(ord)e(b)s(eginning)e(with)i(`)p | |
6287 | Fs(#)p Ft(')h(to)h(cause)f(that)h(w)m(ord)f(and)f(all)g(remain-)1110 | |
6288 | 3278 y(ing)40 b(c)m(haracters)j(on)e(that)h(line)e(to)i(b)s(e)f | |
6289 | (ignored)f(in)g(an)h(in)m(teractiv)m(e)h(shell.)1110 | |
6290 | 3387 y(This)29 b(option)g(is)h(enabled)f(b)m(y)h(default.)630 | |
6291 | 3537 y Fs(lithist)144 b Ft(If)22 b(enabled,)h(and)e(the)h | |
6292 | Fs(cmdhist)e Ft(option)i(is)f(enabled,)i(m)m(ulti-line)c(commands)1110 | |
6293 | 3646 y(are)28 b(sa)m(v)m(ed)h(to)g(the)f(history)f(with)f(em)m(b)s | |
6294 | (edded)h(newlines)f(rather)i(than)f(using)1110 3756 y(semicolon)j | |
6295 | (separators)h(where)e(p)s(ossible.)630 3905 y Fs(login_shell)1110 | |
6296 | 4015 y Ft(The)35 b(shell)f(sets)i(this)e(option)h(if)g(it)g(is)f | |
6297 | (started)i(as)g(a)g(login)e(shell)g(\(see)i(Sec-)1110 | |
6298 | 4125 y(tion)28 b(6.1)h([In)m(v)m(oking)g(Bash],)g(page)g(63\).)41 | |
6299 | b(The)28 b(v)-5 b(alue)28 b(ma)m(y)h(not)f(b)s(e)g(c)m(hanged.)630 | |
6300 | 4274 y Fs(mailwarn)96 b Ft(If)34 b(set,)i(and)e(a)h(\014le)f(that)h | |
6301 | (Bash)f(is)g(c)m(hec)m(king)h(for)g(mail)e(has)h(b)s(een)g(accessed) | |
6302 | 1110 4384 y(since)23 b(the)i(last)f(time)f(it)h(w)m(as)g(c)m(hec)m(k)m | |
6303 | (ed,)k(the)c(message)h Fs("The)k(mail)h(in)f Fj(mail-)1110 | |
6304 | 4493 y(file)40 b Fs(has)29 b(been)g(read")g Ft(is)h(displa)m(y)m(ed.) | |
6305 | 630 4643 y Fs(no_empty_cmd_completion)1110 4752 y Ft(If)g(set,)g(and)g | |
6306 | (Readline)e(is)i(b)s(eing)e(used,)i(Bash)g(will)d(not)j(attempt)i(to)e | |
6307 | (searc)m(h)1110 4862 y(the)25 b Fs(PATH)f Ft(for)h(p)s(ossible)d | |
6308 | (completions)j(when)f(completion)g(is)g(attempted)i(on)1110 | |
6309 | 4971 y(an)k(empt)m(y)h(line.)630 5121 y Fs(nocaseglob)1110 | |
6310 | 5230 y Ft(If)38 b(set,)k(Bash)d(matc)m(hes)g(\014lenames)f(in)f(a)i | |
6311 | (case-insensitiv)m(e)g(fashion)e(when)1110 5340 y(p)s(erforming)28 | |
6312 | b(\014lename)i(expansion.)p eop | |
6313 | %%Page: 48 54 | |
6314 | 48 53 bop 150 -116 a Ft(48)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
6315 | 299 y Fs(nullglob)96 b Ft(If)23 b(set,)j(Bash)e(allo)m(ws)e(\014lename) | |
6316 | h(patterns)h(whic)m(h)e(matc)m(h)i(no)g(\014les)e(to)j(expand)1110 | |
6317 | 408 y(to)31 b(a)g(n)m(ull)d(string,)i(rather)g(than)g(themselv)m(es.) | |
6318 | 630 573 y Fs(progcomp)96 b Ft(If)25 b(set,)i(the)f(programmable)f | |
6319 | (completion)f(facilities)g(\(see)j(Section)e(8.6)i([Pro-)1110 | |
6320 | 682 y(grammable)44 b(Completion],)j(page)e(103\))h(are)f(enabled.)81 | |
6321 | b(This)43 b(option)h(is)1110 792 y(enabled)29 b(b)m(y)i(default.)630 | |
6322 | 956 y Fs(promptvars)1110 1066 y Ft(If)24 b(set,)i(prompt)d(strings)g | |
6323 | (undergo)g(parameter)i(expansion,)f(command)g(sub-)1110 | |
6324 | 1176 y(stitution,)32 b(arithmetic)f(expansion,)h(and)f(quote)i(remo)m | |
6325 | (v)-5 b(al)32 b(after)h(b)s(eing)d(ex-)1110 1285 y(panded)39 | |
6326 | b(as)i(describ)s(ed)d(b)s(elo)m(w)i(\(see)h(Section)f(6.9)h([Prin)m | |
6327 | (ting)e(a)i(Prompt],)1110 1395 y(page)31 b(75\).)42 b(This)29 | |
6328 | b(option)g(is)h(enabled)f(b)m(y)h(default.)630 1559 y | |
6329 | Fs(restricted_shell)1110 1669 y Ft(The)40 b(shell)f(sets)i(this)f | |
6330 | (option)g(if)g(it)h(is)e(started)j(in)d(restricted)i(mo)s(de)f(\(see) | |
6331 | 1110 1778 y(Section)35 b(6.10)h([The)f(Restricted)f(Shell],)h(page)g | |
6332 | (76\).)56 b(The)34 b(v)-5 b(alue)34 b(ma)m(y)i(not)1110 | |
6333 | 1888 y(b)s(e)c(c)m(hanged.)49 b(This)31 b(is)h(not)i(reset)f(when)f | |
6334 | (the)h(startup)g(\014les)e(are)j(executed,)1110 1998 | |
6335 | y(allo)m(wing)h(the)h(startup)f(\014les)g(to)h(disco)m(v)m(er)g | |
6336 | (whether)g(or)f(not)i(a)f(shell)e(is)h(re-)1110 2107 | |
6337 | y(stricted.)630 2271 y Fs(shift_verbose)1110 2381 y Ft(If)h(this)f(is)g | |
6338 | (set,)k(the)d Fs(shift)f Ft(builtin)e(prin)m(ts)h(an)i(error)g(message) | |
6339 | i(when)d(the)1110 2491 y(shift)29 b(coun)m(t)i(exceeds)g(the)g(n)m(um)m | |
6340 | (b)s(er)e(of)h(p)s(ositional)f(parameters.)630 2655 y | |
6341 | Fs(sourcepath)1110 2765 y Ft(If)22 b(set,)j(the)e Fs(source)e | |
6342 | Ft(builtin)e(uses)j(the)h(v)-5 b(alue)22 b(of)h Fs(PATH)e | |
6343 | Ft(to)j(\014nd)d(the)h(directory)1110 2874 y(con)m(taining)27 | |
6344 | b(the)g(\014le)g(supplied)d(as)j(an)g(argumen)m(t.)40 | |
6345 | b(This)26 b(option)h(is)f(enabled)1110 2984 y(b)m(y)k(default.)630 | |
6346 | 3148 y Fs(xpg_echo)96 b Ft(If)31 b(set,)h(the)g Fs(echo)e | |
6347 | Ft(builtin)e(expands)i(bac)m(kslash-escap)s(e)i(sequences)g(b)m(y)f | |
6348 | (de-)1110 3258 y(fault.)630 3422 y(The)c(return)f(status)i(when)f | |
6349 | (listing)e(options)i(is)f(zero)j(if)d(all)h Fq(optnames)k | |
6350 | Ft(are)d(enabled,)f(non-)630 3532 y(zero)40 b(otherwise.)65 | |
6351 | b(When)39 b(setting)g(or)g(unsetting)f(options,)i(the)f(return)f | |
6352 | (status)h(is)f(zero)630 3641 y(unless)29 b(an)h Fq(optname)36 | |
6353 | b Ft(is)29 b(not)i(a)g(v)-5 b(alid)28 b(shell)h(option.)150 | |
6354 | 3806 y Fs(source)870 3943 y(source)46 b Fj(filename)630 | |
6355 | 4080 y Ft(A)30 b(synon)m(ym)g(for)g Fs(.)g Ft(\(see)i(Section)e(4.1)h | |
6356 | ([Bourne)g(Shell)d(Builtins],)g(page)j(33\).)150 4244 | |
6357 | y Fs(type)870 4381 y(type)47 b([-afptP])e([)p Fj(name)57 | |
6358 | b Fs(...)o(])630 4518 y Ft(F)-8 b(or)42 b(eac)m(h)g Fq(name)p | |
6359 | Ft(,)i(indicate)c(ho)m(w)i(it)e(w)m(ould)g(b)s(e)h(in)m(terpreted)f(if) | |
6360 | g(used)g(as)i(a)f(command)630 4628 y(name.)630 4765 y(If)d(the)g(`)p | |
6361 | Fs(-t)p Ft(')g(option)f(is)g(used,)j Fs(type)d Ft(prin)m(ts)f(a)j | |
6362 | (single)d(w)m(ord)i(whic)m(h)f(is)g(one)h(of)h(`)p Fs(alias)p | |
6363 | Ft(',)630 4874 y(`)p Fs(function)p Ft(',)32 b(`)p Fs(builtin)p | |
6364 | Ft(',)g(`)p Fs(file)p Ft(')g(or)h(`)p Fs(keyword)p Ft(',)f(if)g | |
6365 | Fq(name)38 b Ft(is)32 b(an)g(alias,)h(shell)e(function,)630 | |
6366 | 4984 y(shell)i(builtin,)f(disk)i(\014le,)h(or)f(shell)f(reserv)m(ed)i | |
6367 | (w)m(ord,)h(resp)s(ectiv)m(ely)-8 b(.)53 b(If)34 b(the)h | |
6368 | Fq(name)40 b Ft(is)34 b(not)630 5093 y(found,)29 b(then)h(nothing)g(is) | |
6369 | f(prin)m(ted,)g(and)h Fs(type)f Ft(returns)g(a)i(failure)e(status.)630 | |
6370 | 5230 y(If)39 b(the)g(`)p Fs(-p)p Ft(')g(option)g(is)f(used,)j | |
6371 | Fs(type)d Ft(either)g(returns)g(the)i(name)f(of)g(the)g(disk)f(\014le)g | |
6372 | (that)630 5340 y(w)m(ould)29 b(b)s(e)h(executed,)h(or)g(nothing)e(if)g | |
6373 | (`)p Fs(-t)p Ft(')i(w)m(ould)e(not)h(return)g(`)p Fs(file)p | |
6374 | Ft('.)p eop | |
6375 | %%Page: 49 55 | |
6376 | 49 54 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
6377 | b(Builtin)g(Commands)2069 b(49)630 299 y(The)23 b(`)p | |
6378 | Fs(-P)p Ft(')h(option)f(forces)h(a)g(path)g(searc)m(h)g(for)g(eac)m(h)g | |
6379 | Fq(name)p Ft(,)i(ev)m(en)e(if)f(`)p Fs(-t)p Ft(')h(w)m(ould)e(not)i | |
6380 | (return)630 408 y(`)p Fs(file)p Ft('.)630 542 y(If)34 | |
6381 | b(a)i(command)e(is)g(hashed,)h(`)p Fs(-p)p Ft(')g(and)f(`)p | |
6382 | Fs(-P)p Ft(')h(prin)m(t)e(the)i(hashed)f(v)-5 b(alue,)36 | |
6383 | b(not)f(necessarily)630 651 y(the)c(\014le)e(that)i(app)s(ears)f | |
6384 | (\014rst)f(in)g Fs($PATH)p Ft(.)630 784 y(If)36 b(the)h(`)p | |
6385 | Fs(-a)p Ft(')g(option)f(is)g(used,)h Fs(type)f Ft(returns)f(all)h(of)h | |
6386 | (the)g(places)f(that)h(con)m(tain)g(an)g(exe-)630 894 | |
6387 | y(cutable)c(named)g Fq(\014le)p Ft(.)49 b(This)32 b(includes)f(aliases) | |
6388 | i(and)g(functions,)g(if)f(and)h(only)g(if)f(the)i(`)p | |
6389 | Fs(-p)p Ft(')630 1003 y(option)c(is)f(not)i(also)f(used.)630 | |
6390 | 1136 y(If)c(the)h(`)p Fs(-f)p Ft(')g(option)f(is)g(used,)h | |
6391 | Fs(type)e Ft(do)s(es)i(not)g(attempt)g(to)h(\014nd)d(shell)g | |
6392 | (functions,)h(as)h(with)630 1246 y(the)k Fs(command)d | |
6393 | Ft(builtin.)630 1379 y(The)35 b(return)g(status)h(is)f(zero)h(if)f(an)m | |
6394 | (y)h(of)g(the)g Fq(names)k Ft(are)c(found,)g(non-zero)g(if)f(none)h | |
6395 | (are)630 1489 y(found.)150 1645 y Fs(typeset)870 1778 | |
6396 | y(typeset)46 b([-afFrxi])f([-p])i([)p Fj(name)11 b Fs([=)p | |
6397 | Fj(value)g Fs(])43 b(...)o(])630 1911 y Ft(The)29 b Fs(typeset)f | |
6398 | Ft(command)h(is)f(supplied)f(for)i(compatibilit)m(y)f(with)g(the)i | |
6399 | (Korn)e(shell;)h(ho)m(w-)630 2021 y(ev)m(er,)i(it)f(has)g(b)s(een)g | |
6400 | (deprecated)h(in)e(fa)m(v)m(or)j(of)e(the)h Fs(declare)d | |
6401 | Ft(builtin)f(command.)150 2178 y Fs(ulimit)870 2311 y(ulimit)46 | |
6402 | b([-acdflmnpstuvSH])d([)p Fj(limit)11 b Fs(])630 2444 | |
6403 | y(ulimit)25 b Ft(pro)m(vides)g(con)m(trol)i(o)m(v)m(er)h(the)f | |
6404 | (resources)f(a)m(v)-5 b(ailable)26 b(to)h(pro)s(cesses)f(started)h(b)m | |
6405 | (y)g(the)630 2553 y(shell,)g(on)h(systems)g(that)h(allo)m(w)f(suc)m(h)g | |
6406 | (con)m(trol.)40 b(If)28 b(an)g(option)g(is)f(giv)m(en,)i(it)e(is)h(in)m | |
6407 | (terpreted)630 2663 y(as)j(follo)m(ws:)630 2819 y Fs(-S)384 | |
6408 | b Ft(Change)30 b(and)g(rep)s(ort)g(the)g(soft)h(limit)d(asso)s(ciated)j | |
6409 | (with)e(a)i(resource.)630 2976 y Fs(-H)384 b Ft(Change)30 | |
6410 | b(and)g(rep)s(ort)g(the)g(hard)g(limit)e(asso)s(ciated)j(with)e(a)i | |
6411 | (resource.)630 3133 y Fs(-a)384 b Ft(All)29 b(curren)m(t)h(limits)e | |
6412 | (are)j(rep)s(orted.)630 3289 y Fs(-c)384 b Ft(The)30 | |
6413 | b(maxim)m(um)f(size)h(of)h(core)g(\014les)e(created.)630 | |
6414 | 3446 y Fs(-d)384 b Ft(The)30 b(maxim)m(um)f(size)h(of)h(a)g(pro)s | |
6415 | (cess's)f(data)h(segmen)m(t.)630 3602 y Fs(-f)384 b Ft(The)30 | |
6416 | b(maxim)m(um)f(size)h(of)h(\014les)e(created)j(b)m(y)e(the)g(shell.)630 | |
6417 | 3759 y Fs(-l)384 b Ft(The)30 b(maxim)m(um)f(size)h(that)h(ma)m(y)g(b)s | |
6418 | (e)f(lo)s(c)m(k)m(ed)h(in)m(to)f(memory)-8 b(.)630 3915 | |
6419 | y Fs(-m)384 b Ft(The)30 b(maxim)m(um)f(residen)m(t)h(set)h(size.)630 | |
6420 | 4072 y Fs(-n)384 b Ft(The)30 b(maxim)m(um)f(n)m(um)m(b)s(er)g(of)i(op)s | |
6421 | (en)e(\014le)h(descriptors.)630 4228 y Fs(-p)384 b Ft(The)30 | |
6422 | b(pip)s(e)e(bu\013er)i(size.)630 4385 y Fs(-s)384 b Ft(The)30 | |
6423 | b(maxim)m(um)f(stac)m(k)j(size.)630 4542 y Fs(-t)384 | |
6424 | b Ft(The)30 b(maxim)m(um)f(amoun)m(t)i(of)f(cpu)g(time)g(in)f(seconds.) | |
6425 | 630 4698 y Fs(-u)384 b Ft(The)30 b(maxim)m(um)f(n)m(um)m(b)s(er)g(of)i | |
6426 | (pro)s(cesses)f(a)m(v)-5 b(ailable)30 b(to)h(a)f(single)g(user.)630 | |
6427 | 4855 y Fs(-v)384 b Ft(The)29 b(maxim)m(um)g(amoun)m(t)h(of)g(virtual)e | |
6428 | (memory)i(a)m(v)-5 b(ailable)29 b(to)h(the)g(pro)s(cess.)630 | |
6429 | 5011 y(If)j Fq(limit)g Ft(is)g(giv)m(en,)h(it)f(is)g(the)h(new)f(v)-5 | |
6430 | b(alue)33 b(of)g(the)h(sp)s(eci\014ed)e(resource;)j(the)f(sp)s(ecial)e | |
6431 | Fq(limit)630 5121 y Ft(v)-5 b(alues)26 b Fs(hard)p Ft(,)h | |
6432 | Fs(soft)p Ft(,)g(and)g Fs(unlimited)d Ft(stand)j(for)g(the)g(curren)m | |
6433 | (t)g(hard)f(limit,)g(the)h(curren)m(t)630 5230 y(soft)35 | |
6434 | b(limit,)f(and)h(no)f(limit,)g(resp)s(ectiv)m(ely)-8 | |
6435 | b(.)54 b(Otherwise,)35 b(the)g(curren)m(t)g(v)-5 b(alue)34 | |
6436 | b(of)h(the)h(soft)630 5340 y(limit)i(for)i(the)h(sp)s(eci\014ed)e | |
6437 | (resource)i(is)e(prin)m(ted,)j(unless)d(the)h(`)p Fs(-H)p | |
6438 | Ft(')h(option)e(is)h(supplied.)p eop | |
6439 | %%Page: 50 56 | |
6440 | 50 55 bop 150 -116 a Ft(50)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
6441 | 299 y(When)e(setting)g(new)f(limits,)f(if)h(neither)g(`)p | |
6442 | Fs(-H)p Ft(')g(nor)h(`)p Fs(-S)p Ft(')f(is)g(supplied,)f(b)s(oth)h(the) | |
6443 | h(hard)f(and)630 408 y(soft)37 b(limits)d(are)j(set.)60 | |
6444 | b(If)36 b(no)g(option)g(is)g(giv)m(en,)i(then)e(`)p Fs(-f)p | |
6445 | Ft(')h(is)e(assumed.)59 b(V)-8 b(alues)36 b(are)h(in)630 | |
6446 | 518 y(1024-b)m(yte)27 b(incremen)m(ts,)f(except)f(for)f(`)p | |
6447 | Fs(-t)p Ft(',)i(whic)m(h)d(is)h(in)f(seconds,)j(`)p Fs(-p)p | |
6448 | Ft(',)g(whic)m(h)d(is)g(in)h(units)630 628 y(of)31 b(512-b)m(yte)h(blo) | |
6449 | s(c)m(ks,)e(and)g(`)p Fs(-n)p Ft(')g(and)g(`)p Fs(-u)p | |
6450 | Ft(',)h(whic)m(h)e(are)h(unscaled)g(v)-5 b(alues.)630 | |
6451 | 757 y(The)34 b(return)g(status)h(is)e(zero)j(unless)d(an)h(in)m(v)-5 | |
6452 | b(alid)33 b(option)h(or)g(argumen)m(t)i(is)d(supplied,)g(or)630 | |
6453 | 866 y(an)d(error)g(o)s(ccurs)g(while)f(setting)h(a)h(new)f(limit.)150 | |
6454 | 1015 y Fs(unalias)870 1144 y(unalias)46 b([-a])g([)p | |
6455 | Fj(name)57 b Fs(...)47 b(])630 1273 y Ft(Remo)m(v)m(e)39 | |
6456 | b(eac)m(h)f Fq(name)k Ft(from)36 b(the)h(list)f(of)h(aliases.)59 | |
6457 | b(If)36 b(`)p Fs(-a)p Ft(')h(is)f(supplied,)g(all)f(aliases)i(are)630 | |
6458 | 1383 y(remo)m(v)m(ed.)42 b(Aliases)29 b(are)i(describ)s(ed)d(in)h | |
6459 | (Section)i(6.6)g([Aliases],)f(page)h(71.)150 1624 y Fr(4.3)68 | |
6460 | b(The)45 b(Set)g(Builtin)275 1862 y Ft(This)28 b(builtin)f(is)i(so)i | |
6461 | (complicated)f(that)h(it)f(deserv)m(es)h(its)f(o)m(wn)g(section.)150 | |
6462 | 2011 y Fs(set)870 2140 y(set)47 b([--abefhkmnptuvxBCHP])42 | |
6463 | b([-o)47 b Fj(option)11 b Fs(])45 b([)p Fj(argument)56 | |
6464 | b Fs(...)o(])630 2269 y Ft(If)31 b(no)h(options)g(or)f(argumen)m(ts)i | |
6465 | (are)f(supplied,)d Fs(set)i Ft(displa)m(ys)f(the)i(names)g(and)g(v)-5 | |
6466 | b(alues)31 b(of)630 2379 y(all)39 b(shell)f(v)-5 b(ariables)38 | |
6467 | b(and)h(functions,)i(sorted)f(according)f(to)i(the)f(curren)m(t)f(lo)s | |
6468 | (cale,)j(in)d(a)630 2488 y(format)31 b(that)g(ma)m(y)g(b)s(e)e(reused)h | |
6469 | (as)h(input.)630 2617 y(When)e(options)f(are)h(supplied,)d(they)j(set)h | |
6470 | (or)f(unset)f(shell)f(attributes.)40 b(Options,)28 b(if)g(sp)s(ec-)630 | |
6471 | 2727 y(i\014ed,)h(ha)m(v)m(e)j(the)e(follo)m(wing)f(meanings:)630 | |
6472 | 2875 y Fs(-a)384 b Ft(Mark)32 b(v)-5 b(ariables)31 b(and)g(function)g | |
6473 | (whic)m(h)g(are)h(mo)s(di\014ed)e(or)i(created)h(for)f(ex-)1110 | |
6474 | 2985 y(p)s(ort)e(to)h(the)f(en)m(vironmen)m(t)g(of)h(subsequen)m(t)f | |
6475 | (commands.)630 3134 y Fs(-b)384 b Ft(Cause)44 b(the)h(status)g(of)f | |
6476 | (terminated)g(bac)m(kground)h(jobs)f(to)h(b)s(e)f(rep)s(orted)1110 | |
6477 | 3243 y(immediately)-8 b(,)27 b(rather)g(than)f(b)s(efore)h(prin)m(ting) | |
6478 | e(the)i(next)g(primary)f(prompt.)630 3392 y Fs(-e)384 | |
6479 | b Ft(Exit)36 b(immediately)f(if)g(a)i(simple)d(command)i(\(see)i | |
6480 | (Section)e(3.2.1)i([Simple)1110 3501 y(Commands],)31 | |
6481 | b(page)i(8\))f(exits)f(with)g(a)h(non-zero)g(status,)g(unless)e(the)i | |
6482 | (com-)1110 3611 y(mand)f(that)h(fails)f(is)g(part)g(of)h(the)g(command) | |
6483 | g(list)e(immediately)g(follo)m(wing)1110 3720 y(a)41 | |
6484 | b Fs(while)d Ft(or)j Fs(until)e Ft(k)m(eyw)m(ord,)k(part)d(of)g(the)h | |
6485 | (test)g(in)e(an)h Fs(if)g Ft(statemen)m(t,)1110 3830 | |
6486 | y(part)33 b(of)h(a)g Fs(&&)f Ft(or)g Fs(||)g Ft(list,)g(or)g(if)g(the)g | |
6487 | (command's)h(return)e(status)i(is)e(b)s(eing)1110 3940 | |
6488 | y(in)m(v)m(erted)e(using)e Fs(!)p Ft(.)40 b(A)30 b(trap)f(on)h | |
6489 | Fs(ERR)p Ft(,)f(if)g(set,)h(is)f(executed)i(b)s(efore)e(the)h(shell) | |
6490 | 1110 4049 y(exits.)630 4198 y Fs(-f)384 b Ft(Disable)29 | |
6491 | b(\014le)h(name)g(generation)h(\(globbing\).)630 4346 | |
6492 | y Fs(-h)384 b Ft(Lo)s(cate)33 b(and)e(remem)m(b)s(er)h(\(hash\))g | |
6493 | (commands)f(as)h(they)g(are)g(lo)s(ok)m(ed)g(up)f(for)1110 | |
6494 | 4456 y(execution.)41 b(This)28 b(option)i(is)g(enabled)f(b)m(y)h | |
6495 | (default.)630 4605 y Fs(-k)384 b Ft(All)32 b(argumen)m(ts)i(in)e(the)i | |
6496 | (form)f(of)g(assignmen)m(t)g(statemen)m(ts)j(are)d(placed)g(in)1110 | |
6497 | 4714 y(the)38 b(en)m(vironmen)m(t)f(for)h(a)g(command,)h(not)f(just)f | |
6498 | (those)i(that)f(precede)g(the)1110 4824 y(command)30 | |
6499 | b(name.)630 4972 y Fs(-m)384 b Ft(Job)30 b(con)m(trol)h(is)e(enabled)h | |
6500 | (\(see)h(Chapter)f(7)g([Job)h(Con)m(trol],)f(page)h(79\).)630 | |
6501 | 5121 y Fs(-n)384 b Ft(Read)21 b(commands)f(but)g(do)h(not)g(execute)h | |
6502 | (them;)i(this)c(ma)m(y)h(b)s(e)f(used)g(to)h(c)m(hec)m(k)1110 | |
6503 | 5230 y(a)42 b(script)f(for)h(syn)m(tax)g(errors.)75 b(This)40 | |
6504 | b(option)h(is)g(ignored)g(b)m(y)h(in)m(teractiv)m(e)1110 | |
6505 | 5340 y(shells.)p eop | |
6506 | %%Page: 51 57 | |
6507 | 51 56 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
6508 | b(Builtin)g(Commands)2069 b(51)630 299 y Fs(-o)30 b Fj(option-name)1110 | |
6509 | 408 y Ft(Set)h(the)f(option)g(corresp)s(onding)e(to)j | |
6510 | Fq(option-name)5 b Ft(:)1110 581 y Fs(allexport)1590 | |
6511 | 690 y Ft(Same)30 b(as)h Fs(-a)p Ft(.)1110 862 y Fs(braceexpand)1590 | |
6512 | 972 y Ft(Same)f(as)h Fs(-B)p Ft(.)1110 1144 y Fs(emacs)240 | |
6513 | b Ft(Use)25 b(an)f Fs(emacs)p Ft(-st)m(yle)g(line)e(editing)h(in)m | |
6514 | (terface)i(\(see)h(Chapter)e(8)1590 1254 y([Command)30 | |
6515 | b(Line)f(Editing],)g(page)i(83\).)1110 1426 y Fs(errexit)144 | |
6516 | b Ft(Same)30 b(as)h Fs(-e)p Ft(.)1110 1598 y Fs(errtrace)96 | |
6517 | b Ft(Same)30 b(as)h Fs(-E)p Ft(.)1110 1771 y Fs(functrace)1590 | |
6518 | 1880 y Ft(Same)f(as)h Fs(-T)p Ft(.)1110 2052 y Fs(hashall)144 | |
6519 | b Ft(Same)30 b(as)h Fs(-h)p Ft(.)1110 2225 y Fs(histexpand)1590 | |
6520 | 2334 y Ft(Same)f(as)h Fs(-H)p Ft(.)1110 2506 y Fs(history)144 | |
6521 | b Ft(Enable)38 b(command)h(history)-8 b(,)41 b(as)e(describ)s(ed)e(in)h | |
6522 | (Section)h(9.1)1590 2616 y([Bash)e(History)f(F)-8 b(acilities],)37 | |
6523 | b(page)g(109.)60 b(This)35 b(option)h(is)f(on)1590 2725 | |
6524 | y(b)m(y)30 b(default)g(in)f(in)m(teractiv)m(e)i(shells.)1110 | |
6525 | 2898 y Fs(ignoreeof)1590 3007 y Ft(An)f(in)m(teractiv)m(e)h(shell)e | |
6526 | (will)f(not)i(exit)g(up)s(on)f(reading)h(EOF.)1110 3180 | |
6527 | y Fs(keyword)144 b Ft(Same)30 b(as)h Fs(-k)p Ft(.)1110 | |
6528 | 3352 y Fs(monitor)144 b Ft(Same)30 b(as)h Fs(-m)p Ft(.)1110 | |
6529 | 3524 y Fs(noclobber)1590 3634 y Ft(Same)f(as)h Fs(-C)p | |
6530 | Ft(.)1110 3806 y Fs(noexec)192 b Ft(Same)30 b(as)h Fs(-n)p | |
6531 | Ft(.)1110 3978 y Fs(noglob)192 b Ft(Same)30 b(as)h Fs(-f)p | |
6532 | Ft(.)1110 4150 y Fs(nolog)240 b Ft(Curren)m(tly)29 b(ignored.)1110 | |
6533 | 4322 y Fs(notify)192 b Ft(Same)30 b(as)h Fs(-b)p Ft(.)1110 | |
6534 | 4495 y Fs(nounset)144 b Ft(Same)30 b(as)h Fs(-u)p Ft(.)1110 | |
6535 | 4667 y Fs(onecmd)192 b Ft(Same)30 b(as)h Fs(-t)p Ft(.)1110 | |
6536 | 4839 y Fs(physical)96 b Ft(Same)30 b(as)h Fs(-P)p Ft(.)1110 | |
6537 | 5011 y Fs(pipefail)96 b Ft(If)44 b(set,)k(the)d(return)e(v)-5 | |
6538 | b(alue)44 b(of)g(a)h(pip)s(eline)40 b(is)k(the)g(v)-5 | |
6539 | b(alue)44 b(of)1590 5121 y(the)33 b(last)g(\(righ)m(tmost\))h(command)f | |
6540 | (to)h(exit)f(with)f(a)h(non-zero)1590 5230 y(status,)28 | |
6541 | b(or)f(zero)g(if)e(all)h(commands)g(in)f(the)i(pip)s(eline)c(exit)k | |
6542 | (suc-)1590 5340 y(cessfully)-8 b(.)39 b(This)29 b(option)h(is)f | |
6543 | (disabled)f(b)m(y)j(default.)p eop | |
6544 | %%Page: 52 58 | |
6545 | 52 57 bop 150 -116 a Ft(52)2572 b(Bash)31 b(Reference)g(Man)m(ual)1110 | |
6546 | 299 y Fs(posix)240 b Ft(Change)36 b(the)g(b)s(eha)m(vior)f(of)h(Bash)g | |
6547 | (where)f(the)h(default)f(op)s(er-)1590 408 y(ation)c(di\013ers)e(from)h | |
6548 | (the)h Fl(posix)f Ft(1003.2)k(standard)c(to)h(matc)m(h)1590 | |
6549 | 518 y(the)44 b(standard)f(\(see)h(Section)g(6.11)h([Bash)f(POSIX)e(Mo)s | |
6550 | (de],)1590 628 y(page)35 b(76\).)55 b(This)33 b(is)g(in)m(tended)h(to)h | |
6551 | (mak)m(e)h(Bash)e(b)s(eha)m(v)m(e)i(as)f(a)1590 737 y(strict)30 | |
6552 | b(sup)s(erset)f(of)i(that)g(standard.)1110 906 y Fs(privileged)1590 | |
6553 | 1015 y Ft(Same)f(as)h Fs(-p)p Ft(.)1110 1184 y Fs(verbose)144 | |
6554 | b Ft(Same)30 b(as)h Fs(-v)p Ft(.)1110 1353 y Fs(vi)384 | |
6555 | b Ft(Use)31 b(a)g Fs(vi)p Ft(-st)m(yle)f(line)f(editing)g(in)m | |
6556 | (terface.)1110 1521 y Fs(xtrace)192 b Ft(Same)30 b(as)h | |
6557 | Fs(-x)p Ft(.)630 1690 y Fs(-p)384 b Ft(T)-8 b(urn)33 | |
6558 | b(on)h(privileged)e(mo)s(de.)51 b(In)34 b(this)f(mo)s(de,)i(the)f | |
6559 | Fs($BASH_ENV)e Ft(and)h Fs($ENV)1110 1799 y Ft(\014les)j(are)i(not)g | |
6560 | (pro)s(cessed,)h(shell)d(functions)g(are)i(not)f(inherited)f(from)h | |
6561 | (the)1110 1909 y(en)m(vironmen)m(t,)e(and)e(the)h Fs(SHELLOPTS)e | |
6562 | Ft(v)-5 b(ariable,)33 b(if)g(it)h(app)s(ears)f(in)g(the)h(en-)1110 | |
6563 | 2019 y(vironmen)m(t,)c(is)f(ignored.)40 b(If)29 b(the)i(shell)d(is)h | |
6564 | (started)i(with)e(the)h(e\013ectiv)m(e)i(user)1110 2128 | |
6565 | y(\(group\))e(id)f(not)h(equal)g(to)g(the)g(real)g(user)f(\(group\))i | |
6566 | (id,)e(and)g(the)h Fs(-p)f Ft(option)1110 2238 y(is)39 | |
6567 | b(not)h(supplied,)g(these)g(actions)h(are)f(tak)m(en)h(and)f(the)g | |
6568 | (e\013ectiv)m(e)i(user)d(id)1110 2347 y(is)c(set)i(to)h(the)e(real)g | |
6569 | (user)g(id.)57 b(If)36 b(the)h Fs(-p)f Ft(option)f(is)h(supplied)d(at)k | |
6570 | (startup,)1110 2457 y(the)29 b(e\013ectiv)m(e)i(user)e(id)f(is)g(not)i | |
6571 | (reset.)40 b(T)-8 b(urning)28 b(this)g(option)g(o\013)i(causes)g(the) | |
6572 | 1110 2567 y(e\013ectiv)m(e)d(user)e(and)g(group)g(ids)g(to)h(b)s(e)f | |
6573 | (set)h(to)h(the)f(real)f(user)g(and)g(group)g(ids.)630 | |
6574 | 2735 y Fs(-t)384 b Ft(Exit)30 b(after)h(reading)e(and)h(executing)g | |
6575 | (one)h(command.)630 2904 y Fs(-u)384 b Ft(T)-8 b(reat)38 | |
6576 | b(unset)e(v)-5 b(ariables)35 b(as)j(an)e(error)h(when)e(p)s(erforming)g | |
6577 | (parameter)i(ex-)1110 3013 y(pansion.)57 b(An)36 b(error)f(message)j | |
6578 | (will)33 b(b)s(e)j(written)f(to)i(the)g(standard)e(error,)1110 | |
6579 | 3123 y(and)30 b(a)h(non-in)m(teractiv)m(e)g(shell)d(will)g(exit.)630 | |
6580 | 3292 y Fs(-v)384 b Ft(Prin)m(t)29 b(shell)g(input)f(lines)h(as)i(they)f | |
6581 | (are)h(read.)630 3460 y Fs(-x)384 b Ft(Prin)m(t)81 b(a)i(trace)h(of)e | |
6582 | (simple)e(commands,)96 b Fs(\\)p Ft(fBfor)p Fs(\\)p Ft(fP)81 | |
6583 | b(commands,)1110 3570 y Fs(\\)p Ft(fBcase)p Fs(\\)p Ft(fP)50 | |
6584 | b(commands,)55 b Fs(\\)p Ft(fBselect)p Fs(\\)p Ft(fP)50 | |
6585 | b(commands,)55 b(and)50 b(arithmetic)1110 3679 y Fs(\\)p | |
6586 | Ft(fBfor)p Fs(\\)p Ft(fP)31 b(commands)g(and)g(their)g(argumen)m(ts)h | |
6587 | (or)f(asso)s(ciated)h(w)m(ord)f(lists)1110 3789 y(after)k(they)g(are)g | |
6588 | (expanded)f(and)h(b)s(efore)f(they)h(are)g(executed.)55 | |
6589 | b(The)34 b(v)-5 b(alue)1110 3898 y(of)34 b(the)g Fs(PS4)f | |
6590 | Ft(v)-5 b(ariable)33 b(is)g(expanded)h(and)f(the)h(resultan)m(t)g(v)-5 | |
6591 | b(alue)33 b(is)g(prin)m(ted)1110 4008 y(b)s(efore)d(the)h(command)f | |
6592 | (and)f(its)h(expanded)g(argumen)m(ts.)630 4177 y Fs(-B)384 | |
6593 | b Ft(The)41 b(shell)e(will)f(p)s(erform)i(brace)h(expansion)f(\(see)i | |
6594 | (Section)f(3.5.1)h([Brace)1110 4286 y(Expansion],)29 | |
6595 | b(page)i(17\).)42 b(This)29 b(option)h(is)f(on)h(b)m(y)h(default.)630 | |
6596 | 4455 y Fs(-C)384 b Ft(Prev)m(en)m(t)25 b(output)e(redirection)f(using)g | |
6597 | (`)p Fs(>)p Ft(',)j(`)p Fs(>&)p Ft(',)g(and)e(`)p Fs(<>)p | |
6598 | Ft(')g(from)h(o)m(v)m(erwriting)1110 4564 y(existing)29 | |
6599 | b(\014les.)630 4733 y Fs(-E)384 b Ft(If)39 b(set,)j(an)m(y)e(trap)f(on) | |
6600 | g Fs(ERR)g Ft(is)f(inherited)f(b)m(y)i(shell)f(functions,)i(command) | |
6601 | 1110 4843 y(substitutions,)33 b(and)g(commands)g(executed)i(in)e(a)h | |
6602 | (subshell)d(en)m(vironmen)m(t.)1110 4952 y(The)f Fs(ERR)f | |
6603 | Ft(trap)i(is)e(normally)g(not)h(inherited)e(in)h(suc)m(h)h(cases.)630 | |
6604 | 5121 y Fs(-H)384 b Ft(Enable)37 b(`)p Fs(!)p Ft(')i(st)m(yle)g(history) | |
6605 | e(substitution)f(\(see)j(Section)g(9.3)g([History)f(In-)1110 | |
6606 | 5230 y(teraction],)g(page)e(111\).)57 b(This)33 b(option)i(is)f(on)h(b) | |
6607 | m(y)h(default)e(for)h(in)m(teractiv)m(e)1110 5340 y(shells.)p | |
6608 | eop | |
6609 | %%Page: 53 59 | |
6610 | 53 58 bop 150 -116 a Ft(Chapter)30 b(4:)41 b(Shell)28 | |
6611 | b(Builtin)g(Commands)2069 b(53)630 299 y Fs(-P)384 b | |
6612 | Ft(If)43 b(set,)k(do)c(not)g(follo)m(w)f(sym)m(b)s(olic)g(links)e(when) | |
6613 | i(p)s(erforming)f(commands)1110 408 y(suc)m(h)29 b(as)h | |
6614 | Fs(cd)f Ft(whic)m(h)f(c)m(hange)i(the)g(curren)m(t)f(directory)-8 | |
6615 | b(.)41 b(The)28 b(ph)m(ysical)h(direc-)1110 518 y(tory)34 | |
6616 | b(is)f(used)g(instead.)51 b(By)34 b(default,)g(Bash)g(follo)m(ws)f(the) | |
6617 | h(logical)f(c)m(hain)h(of)1110 628 y(directories)i(when)f(p)s | |
6618 | (erforming)g(commands)h(whic)m(h)f(c)m(hange)j(the)f(curren)m(t)1110 | |
6619 | 737 y(directory)-8 b(.)1110 874 y(F)g(or)31 b(example,)f(if)f(`)p | |
6620 | Fs(/usr/sys)p Ft(')f(is)h(a)h(sym)m(b)s(olic)f(link)f(to)i(`)p | |
6621 | Fs(/usr/local/sys)p Ft(')1110 984 y(then:)1350 1121 y | |
6622 | Fs($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 1230 y(/usr/sys)1350 | |
6623 | 1340 y($)g(cd)h(..;)f(pwd)1350 1449 y(/usr)1110 1586 | |
6624 | y Ft(If)30 b Fs(set)f(-P)h Ft(is)g(on,)g(then:)1350 1723 | |
6625 | y Fs($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 1833 y(/usr/local/sys) | |
6626 | 1350 1943 y($)g(cd)h(..;)f(pwd)1350 2052 y(/usr/local)630 | |
6627 | 2216 y(-T)384 b Ft(If)31 b(set,)h(an)m(y)f(trap)g(on)g | |
6628 | Fs(DEBUG)e Ft(is)h(inherited)f(b)m(y)i(shell)e(functions,)h(command) | |
6629 | 1110 2326 y(substitutions,)j(and)g(commands)g(executed)i(in)e(a)h | |
6630 | (subshell)d(en)m(vironmen)m(t.)1110 2436 y(The)f Fs(DEBUG)f | |
6631 | Ft(trap)h(is)f(normally)g(not)i(inherited)d(in)h(suc)m(h)h(cases.)630 | |
6632 | 2600 y Fs(--)384 b Ft(If)31 b(no)h(argumen)m(ts)f(follo)m(w)g(this)g | |
6633 | (option,)g(then)g(the)h(p)s(ositional)e(parameters)1110 | |
6634 | 2710 y(are)k(unset.)49 b(Otherwise,)33 b(the)h(p)s(ositional)d | |
6635 | (parameters)j(are)g(set)g(to)g(the)g Fq(ar-)1110 2819 | |
6636 | y(gumen)m(ts)p Ft(,)d(ev)m(en)g(if)e(some)i(of)g(them)f(b)s(egin)f | |
6637 | (with)g(a)i(`)p Fs(-)p Ft('.)630 2983 y Fs(-)432 b Ft(Signal)43 | |
6638 | b(the)i(end)f(of)h(options,)j(cause)d(all)f(remaining)e | |
6639 | Fq(argumen)m(ts)49 b Ft(to)d(b)s(e)1110 3093 y(assigned)37 | |
6640 | b(to)i(the)f(p)s(ositional)e(parameters.)65 b(The)37 | |
6641 | b(`)p Fs(-x)p Ft(')h(and)g(`)p Fs(-v)p Ft(')g(options)1110 | |
6642 | 3203 y(are)25 b(turned)e(o\013.)40 b(If)24 b(there)h(are)g(no)f | |
6643 | (argumen)m(ts,)i(the)f(p)s(ositional)e(parameters)1110 | |
6644 | 3312 y(remain)29 b(unc)m(hanged.)630 3477 y(Using)d(`)p | |
6645 | Fs(+)p Ft(')i(rather)f(than)g(`)p Fs(-)p Ft(')g(causes)h(these)f | |
6646 | (options)g(to)h(b)s(e)e(turned)g(o\013.)40 b(The)27 b(options)g(can)630 | |
6647 | 3586 y(also)35 b(b)s(e)g(used)f(up)s(on)g(in)m(v)m(o)s(cation)h(of)g | |
6648 | (the)g(shell.)54 b(The)34 b(curren)m(t)h(set)h(of)f(options)g(ma)m(y)h | |
6649 | (b)s(e)630 3696 y(found)29 b(in)g Fs($-)p Ft(.)630 3833 | |
6650 | y(The)43 b(remaining)f(N)h Fq(argumen)m(ts)48 b Ft(are)c(p)s(ositional) | |
6651 | d(parameters)j(and)f(are)h(assigned,)i(in)630 3942 y(order,)30 | |
6652 | b(to)h Fs($1)p Ft(,)f Fs($2)p Ft(,)36 b(.)22 b(.)g(.)42 | |
6653 | b Fs($N)p Ft(.)e(The)30 b(sp)s(ecial)f(parameter)i Fs(#)f | |
6654 | Ft(is)f(set)i(to)g(N.)630 4079 y(The)f(return)f(status)i(is)e(alw)m(a)m | |
6655 | (ys)i(zero)g(unless)e(an)h(in)m(v)-5 b(alid)28 b(option)i(is)f | |
6656 | (supplied.)150 4349 y Fr(4.4)68 b(Sp)t(ecial)45 b(Builtins)275 | |
6657 | 4598 y Ft(F)-8 b(or)25 b(historical)e(reasons,)j(the)e | |
6658 | Fl(posix)g Ft(1003.2)j(standard)d(has)g(classi\014ed)f(sev)m(eral)i | |
6659 | (builtin)c(commands)150 4707 y(as)37 b Fm(sp)-5 b(e)g(cial)p | |
6660 | Ft(.)60 b(When)36 b(Bash)h(is)f(executing)g(in)f Fl(posix)h | |
6661 | Ft(mo)s(de,)i(the)f(sp)s(ecial)e(builtins)d(di\013er)k(from)g(other)150 | |
6662 | 4817 y(builtin)27 b(commands)j(in)f(three)i(resp)s(ects:)199 | |
6663 | 4956 y(1.)61 b(Sp)s(ecial)29 b(builtins)d(are)31 b(found)e(b)s(efore)h | |
6664 | (shell)f(functions)g(during)f(command)i(lo)s(okup.)199 | |
6665 | 5093 y(2.)61 b(If)30 b(a)h(sp)s(ecial)e(builtin)e(returns)i(an)h(error) | |
6666 | g(status,)h(a)g(non-in)m(teractiv)m(e)g(shell)d(exits.)199 | |
6667 | 5230 y(3.)61 b(Assignmen)m(t)29 b(statemen)m(ts)i(preceding)e(the)g | |
6668 | (command)g(sta)m(y)i(in)d(e\013ect)j(in)d(the)i(shell)d(en)m(vironmen)m | |
6669 | (t)330 5340 y(after)k(the)f(command)h(completes.)p eop | |
6670 | %%Page: 54 60 | |
6671 | 54 59 bop 150 -116 a Ft(54)2572 b(Bash)31 b(Reference)g(Man)m(ual)275 | |
6672 | 299 y(When)36 b(Bash)g(is)g(not)g(executing)h(in)e Fl(posix)g | |
6673 | Ft(mo)s(de,)j(these)f(builtins)c(b)s(eha)m(v)m(e)k(no)f(di\013eren)m | |
6674 | (tly)f(than)150 408 y(the)c(rest)f(of)h(the)f(Bash)h(builtin)26 | |
6675 | b(commands.)41 b(The)30 b(Bash)g Fl(posix)g Ft(mo)s(de)g(is)f(describ)s | |
6676 | (ed)f(in)h(Section)h(6.11)150 518 y([Bash)h(POSIX)e(Mo)s(de],)i(page)g | |
6677 | (76.)275 653 y(These)f(are)g(the)h Fl(posix)f Ft(sp)s(ecial)f | |
6678 | (builtins:)390 787 y Fs(break)46 b(:)i(.)f(continue)f(eval)g(exec)h | |
6679 | (exit)g(export)f(readonly)f(return)h(set)390 897 y(shift)g(trap)h | |
6680 | (unset)p eop | |
6681 | %%Page: 55 61 | |
6682 | 55 60 bop 150 -116 a Ft(Chapter)30 b(5:)41 b(Shell)28 | |
6683 | b(V)-8 b(ariables)2457 b(55)150 299 y Fo(5)80 b(Shell)55 | |
6684 | b(V)-13 b(ariables)275 525 y Ft(This)35 b(c)m(hapter)j(describ)s(es)d | |
6685 | (the)i(shell)e(v)-5 b(ariables)36 b(that)i(Bash)f(uses.)61 | |
6686 | b(Bash)37 b(automatically)g(assigns)150 635 y(default)30 | |
6687 | b(v)-5 b(alues)29 b(to)i(a)g(n)m(um)m(b)s(er)e(of)i(v)-5 | |
6688 | b(ariables.)150 887 y Fr(5.1)68 b(Bourne)45 b(Shell)g(V)-11 | |
6689 | b(ariables)275 1130 y Ft(Bash)36 b(uses)g(certain)g(shell)e(v)-5 | |
6690 | b(ariables)35 b(in)g(the)i(same)g(w)m(a)m(y)g(as)f(the)h(Bourne)f | |
6691 | (shell.)57 b(In)35 b(some)i(cases,)150 1240 y(Bash)31 | |
6692 | b(assigns)e(a)i(default)e(v)-5 b(alue)30 b(to)h(the)g(v)-5 | |
6693 | b(ariable.)150 1396 y Fs(CDPATH)192 b Ft(A)39 b(colon-separated)h(list) | |
6694 | d(of)i(directories)f(used)h(as)g(a)g(searc)m(h)h(path)e(for)h(the)g | |
6695 | Fs(cd)f Ft(builtin)630 1505 y(command.)150 1662 y Fs(HOME)288 | |
6696 | b Ft(The)23 b(curren)m(t)h(user's)f(home)g(directory;)j(the)e(default)f | |
6697 | (for)g(the)h Fs(cd)f Ft(builtin)d(command.)38 b(The)630 | |
6698 | 1771 y(v)-5 b(alue)36 b(of)g(this)f(v)-5 b(ariable)35 | |
6699 | b(is)h(also)g(used)f(b)m(y)h(tilde)f(expansion)g(\(see)j(Section)e | |
6700 | (3.5.2)i([Tilde)630 1881 y(Expansion],)29 b(page)i(18\).)150 | |
6701 | 2037 y Fs(IFS)336 b Ft(A)25 b(list)g(of)g(c)m(haracters)i(that)f | |
6702 | (separate)g(\014elds;)g(used)f(when)f(the)i(shell)d(splits)h(w)m(ords)g | |
6703 | (as)i(part)630 2147 y(of)31 b(expansion.)150 2303 y Fs(MAIL)288 | |
6704 | b Ft(If)26 b(this)e(parameter)j(is)e(set)h(to)h(a)g(\014lename)e(and)g | |
6705 | (the)h Fs(MAILPATH)e Ft(v)-5 b(ariable)25 b(is)g(not)h(set,)i(Bash)630 | |
6706 | 2413 y(informs)h(the)h(user)g(of)g(the)h(arriv)-5 b(al)29 | |
6707 | b(of)h(mail)f(in)g(the)i(sp)s(eci\014ed)e(\014le.)150 | |
6708 | 2569 y Fs(MAILPATH)96 b Ft(A)33 b(colon-separated)h(list)e(of)h | |
6709 | (\014lenames)g(whic)m(h)f(the)h(shell)e(p)s(erio)s(dically)f(c)m(hec)m | |
6710 | (ks)k(for)f(new)630 2678 y(mail.)58 b(Eac)m(h)37 b(list)e(en)m(try)i | |
6711 | (can)g(sp)s(ecify)e(the)i(message)h(that)f(is)f(prin)m(ted)f(when)g | |
6712 | (new)h(mail)630 2788 y(arriv)m(es)28 b(in)g(the)h(mail)e(\014le)h(b)m | |
6713 | (y)h(separating)f(the)h(\014le)f(name)h(from)f(the)h(message)h(with)d | |
6714 | (a)j(`)p Fs(?)p Ft('.)630 2898 y(When)i(used)f(in)g(the)h(text)i(of)e | |
6715 | (the)g(message,)i Fs($_)e Ft(expands)f(to)i(the)f(name)g(of)h(the)f | |
6716 | (curren)m(t)630 3007 y(mail)d(\014le.)150 3163 y Fs(OPTARG)192 | |
6717 | b Ft(The)30 b(v)-5 b(alue)30 b(of)g(the)h(last)f(option)g(argumen)m(t)h | |
6718 | (pro)s(cessed)f(b)m(y)g(the)g Fs(getopts)f Ft(builtin.)150 | |
6719 | 3320 y Fs(OPTIND)192 b Ft(The)30 b(index)f(of)h(the)h(last)f(option)g | |
6720 | (argumen)m(t)h(pro)s(cessed)f(b)m(y)g(the)g Fs(getopts)f | |
6721 | Ft(builtin.)150 3476 y Fs(PATH)288 b Ft(A)32 b(colon-separated)h(list)e | |
6722 | (of)h(directories)f(in)f(whic)m(h)h(the)h(shell)e(lo)s(oks)i(for)g | |
6723 | (commands.)45 b(A)630 3586 y(zero-length)d(\(n)m(ull\))f(directory)g | |
6724 | (name)h(in)f(the)h(v)-5 b(alue)41 b(of)h Fs(PATH)f Ft(indicates)g(the)h | |
6725 | (curren)m(t)630 3695 y(directory)-8 b(.)48 b(A)33 b(n)m(ull)d | |
6726 | (directory)j(name)f(ma)m(y)i(app)s(ear)e(as)h(t)m(w)m(o)h(adjacen)m(t)g | |
6727 | (colons,)f(or)g(as)g(an)630 3805 y(initial)28 b(or)i(trailing)e(colon.) | |
6728 | 150 3961 y Fs(PS1)336 b Ft(The)35 b(primary)e(prompt)i(string.)54 | |
6729 | b(The)35 b(default)g(v)-5 b(alue)34 b(is)h(`)p Fs(\\s-\\v\\$)28 | |
6730 | b Ft('.)56 b(See)36 b(Section)f(6.9)630 4071 y([Prin)m(ting)26 | |
6731 | b(a)i(Prompt],)g(page)h(75,)g(for)e(the)h(complete)g(list)f(of)g(escap) | |
6732 | s(e)h(sequences)g(that)h(are)630 4180 y(expanded)h(b)s(efore)g | |
6733 | Fs(PS1)f Ft(is)g(displa)m(y)m(ed.)150 4336 y Fs(PS2)336 | |
6734 | b Ft(The)30 b(secondary)g(prompt)g(string.)40 b(The)29 | |
6735 | b(default)h(v)-5 b(alue)30 b(is)f(`)p Fs(>)h Ft('.)150 | |
6736 | 4589 y Fr(5.2)68 b(Bash)45 b(V)-11 b(ariables)275 4832 | |
6737 | y Ft(These)36 b(v)-5 b(ariables)36 b(are)i(set)f(or)h(used)e(b)m(y)h | |
6738 | (Bash,)i(but)d(other)i(shells)d(do)i(not)g(normally)f(treat)i(them)150 | |
6739 | 4941 y(sp)s(ecially)-8 b(.)275 5074 y(A)24 b(few)g(v)-5 | |
6740 | b(ariables)22 b(used)i(b)m(y)f(Bash)i(are)f(describ)s(ed)e(in)h | |
6741 | (di\013eren)m(t)g(c)m(hapters:)38 b(v)-5 b(ariables)23 | |
6742 | b(for)h(con)m(trolling)150 5184 y(the)31 b(job)f(con)m(trol)g | |
6743 | (facilities)f(\(see)i(Section)f(7.3)i([Job)e(Con)m(trol)g(V)-8 | |
6744 | b(ariables],)30 b(page)i(82\).)150 5340 y Fs(BASH)288 | |
6745 | b Ft(The)30 b(full)e(pathname)i(used)g(to)h(execute)h(the)e(curren)m(t) | |
6746 | g(instance)g(of)h(Bash.)p eop | |
6747 | %%Page: 56 62 | |
6748 | 56 61 bop 150 -116 a Ft(56)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
6749 | 299 y Fs(BASH_ARGC)630 408 y Ft(An)f(arra)m(y)h(v)-5 | |
6750 | b(ariable)29 b(whose)h(v)-5 b(alues)30 b(are)h(the)f(n)m(um)m(b)s(er)f | |
6751 | (of)i(parameters)g(in)e(eac)m(h)i(frame)g(of)630 518 | |
6752 | y(the)26 b(curren)m(t)f(bash)g(execution)h(call)f(stac)m(k.)41 | |
6753 | b(The)25 b(n)m(um)m(b)s(er)g(of)h(parameters)g(to)g(the)g(curren)m(t) | |
6754 | 630 628 y(subroutine)h(\(shell)h(function)h(or)g(script)f(executed)j | |
6755 | (with)d Fs(.)h Ft(or)h Fs(source)p Ft(\))e(is)g(at)i(the)g(top)g(of)630 | |
6756 | 737 y(the)h(stac)m(k.)42 b(When)30 b(a)g(subroutine)f(is)g(executed,)i | |
6757 | (the)g(n)m(um)m(b)s(er)e(of)h(parameters)h(passed)f(is)630 | |
6758 | 847 y(pushed)f(on)m(to)i Fs(BASH_ARGC)p Ft(.)150 1017 | |
6759 | y Fs(BASH_ARGV)630 1127 y Ft(An)24 b(arra)m(y)g(v)-5 | |
6760 | b(ariable)23 b(con)m(taining)h(all)f(of)h(the)h(parameters)f(in)f(the)h | |
6761 | (curren)m(t)g(bash)g(execution)630 1236 y(call)33 b(stac)m(k.)53 | |
6762 | b(The)34 b(\014nal)f(parameter)h(of)g(the)g(last)g(subroutine)e(call)h | |
6763 | (is)g(at)i(the)f(top)h(of)f(the)630 1346 y(stac)m(k;)28 | |
6764 | b(the)c(\014rst)f(parameter)i(of)f(the)g(initial)e(call)h(is)g(at)i | |
6765 | (the)f(b)s(ottom.)39 b(When)24 b(a)g(subroutine)630 1456 | |
6766 | y(is)29 b(executed,)j(the)e(parameters)h(supplied)c(are)k(pushed)e(on)m | |
6767 | (to)i Fs(BASH_ARGV)p Ft(.)150 1626 y Fs(BASH_COMMAND)630 | |
6768 | 1736 y Ft(The)39 b(command)h(curren)m(tly)f(b)s(eing)f(executed)j(or)e | |
6769 | (ab)s(out)h(to)g(b)s(e)f(executed,)44 b(unless)38 b(the)630 | |
6770 | 1845 y(shell)f(is)h(executing)g(a)h(command)g(as)g(the)f(result)g(of)h | |
6771 | (a)g(trap,)i(in)c(whic)m(h)g(case)j(it)e(is)g(the)630 | |
6772 | 1955 y(command)30 b(executing)h(at)g(the)f(time)g(of)h(the)g(trap.)150 | |
6773 | 2125 y Fs(BASH_ENV)96 b Ft(If)28 b(this)f(v)-5 b(ariable)28 | |
6774 | b(is)f(set)i(when)f(Bash)g(is)g(in)m(v)m(ok)m(ed)h(to)g(execute)h(a)e | |
6775 | (shell)f(script,)h(its)g(v)-5 b(alue)28 b(is)630 2235 | |
6776 | y(expanded)33 b(and)h(used)g(as)g(the)h(name)f(of)g(a)h(startup)f | |
6777 | (\014le)f(to)i(read)f(b)s(efore)g(executing)h(the)630 | |
6778 | 2345 y(script.)40 b(See)30 b(Section)g(6.2)i([Bash)f(Startup)e(Files],) | |
6779 | h(page)h(65.)150 2515 y Fs(BASH_EXECUTION_STRING)630 | |
6780 | 2625 y Ft(The)f(command)g(argumen)m(t)h(to)g(the)g(`)p | |
6781 | Fs(-c)p Ft(')f(in)m(v)m(o)s(cation)g(option.)150 2795 | |
6782 | y Fs(BASH_LINENO)630 2905 y Ft(An)38 b(arra)m(y)h(v)-5 | |
6783 | b(ariable)37 b(whose)i(mem)m(b)s(ers)e(are)i(the)g(line)e(n)m(um)m(b)s | |
6784 | (ers)g(in)g(source)i(\014les)e(corre-)630 3014 y(sp)s(onding)h(to)j | |
6785 | (eac)m(h)g(mem)m(b)s(er)e(of)i Fq(FUNCNAME)p Ft(.)g Fs | |
6786 | (${BASH_LINENO[$i]})35 b Ft(is)k(the)i(line)630 3124 | |
6787 | y(n)m(um)m(b)s(er)34 b(in)f(the)i(source)g(\014le)f(where)g | |
6788 | Fs(${FUNCNAME[$i)27 b(+)j(1]})k Ft(w)m(as)h(called.)54 | |
6789 | b(The)34 b(corre-)630 3233 y(sp)s(onding)d(source)j(\014le)f(name)h(is) | |
6790 | f Fs(${BASH_SOURCE[$i)26 b(+)k(1]})p Ft(.)50 b(Use)35 | |
6791 | b Fs(LINENO)d Ft(to)i(obtain)630 3343 y(the)d(curren)m(t)f(line)e(n)m | |
6792 | (um)m(b)s(er.)150 3513 y Fs(BASH_REMATCH)630 3623 y Ft(An)43 | |
6793 | b(arra)m(y)i(v)-5 b(ariable)42 b(whose)i(mem)m(b)s(ers)f(are)h | |
6794 | (assigned)f(b)m(y)g(the)h(`)p Fs(=~)p Ft(')g(binary)e(op)s(erator)630 | |
6795 | 3733 y(to)37 b(the)f Fs([[)g Ft(conditional)f(command)h(\(see)h | |
6796 | (Section)f(3.2.4.2)j([Conditional)34 b(Constructs],)630 | |
6797 | 3842 y(page)h(10\).)52 b(The)33 b(elemen)m(t)i(with)d(index)g(0)j(is)e | |
6798 | (the)h(p)s(ortion)e(of)i(the)g(string)f(matc)m(hing)h(the)630 | |
6799 | 3952 y(en)m(tire)28 b(regular)f(expression.)39 b(The)27 | |
6800 | b(elemen)m(t)i(with)d(index)h Fq(n)g Ft(is)g(the)h(p)s(ortion)f(of)h | |
6801 | (the)g(string)630 4061 y(matc)m(hing)i(the)h Fq(n)p Ft(th)f(paren)m | |
6802 | (thesized)g(sub)s(expression.)38 b(This)28 b(v)-5 b(ariable)29 | |
6803 | b(is)h(read-only)-8 b(.)150 4232 y Fs(BASH_SOURCE)630 | |
6804 | 4341 y Ft(An)24 b(arra)m(y)h(v)-5 b(ariable)24 b(whose)g(mem)m(b)s(ers) | |
6805 | g(are)h(the)g(source)f(\014lenames)g(corresp)s(onding)e(to)k(the)630 | |
6806 | 4451 y(elemen)m(ts)31 b(in)e(the)h Fs(FUNCNAME)e Ft(arra)m(y)j(v)-5 | |
6807 | b(ariable.)150 4622 y Fs(BASH_SUBSHELL)630 4731 y Ft(Incremen)m(ted)34 | |
6808 | b(b)m(y)h(one)f(eac)m(h)i(time)e(a)g(subshell)e(or)i(subshell)d(en)m | |
6809 | (vironmen)m(t)j(is)f(spa)m(wned.)630 4841 y(The)d(initial)d(v)-5 | |
6810 | b(alue)30 b(is)g(0.)150 5011 y Fs(BASH_VERSINFO)630 5121 | |
6811 | y Ft(A)36 b(readonly)f(arra)m(y)h(v)-5 b(ariable)35 b(\(see)h(Section)g | |
6812 | (6.7)h([Arra)m(ys],)h(page)e(72\))h(whose)f(mem)m(b)s(ers)630 | |
6813 | 5230 y(hold)31 b(v)m(ersion)h(information)e(for)i(this)f(instance)h(of) | |
6814 | h(Bash.)46 b(The)32 b(v)-5 b(alues)31 b(assigned)h(to)h(the)630 | |
6815 | 5340 y(arra)m(y)e(mem)m(b)s(ers)e(are)i(as)g(follo)m(ws:)p | |
6816 | eop | |
6817 | %%Page: 57 63 | |
6818 | 57 62 bop 150 -116 a Ft(Chapter)30 b(5:)41 b(Shell)28 | |
6819 | b(V)-8 b(ariables)2457 b(57)630 299 y Fs(BASH_VERSINFO[0])1110 | |
6820 | 408 y Ft(The)30 b(ma)5 b(jor)30 b(v)m(ersion)g(n)m(um)m(b)s(er)f(\(the) | |
6821 | i Fq(release)5 b Ft(\).)630 582 y Fs(BASH_VERSINFO[1])1110 | |
6822 | 692 y Ft(The)30 b(minor)f(v)m(ersion)h(n)m(um)m(b)s(er)f(\(the)i | |
6823 | Fq(v)m(ersion)p Ft(\).)630 865 y Fs(BASH_VERSINFO[2])1110 | |
6824 | 975 y Ft(The)f(patc)m(h)h(lev)m(el.)630 1148 y Fs(BASH_VERSINFO[3])1110 | |
6825 | 1258 y Ft(The)f(build)d(v)m(ersion.)630 1431 y Fs(BASH_VERSINFO[4])1110 | |
6826 | 1541 y Ft(The)j(release)h(status)f(\(e.g.,)j Fq(b)s(eta1)7 | |
6827 | b Ft(\).)630 1714 y Fs(BASH_VERSINFO[5])1110 1824 y Ft(The)30 | |
6828 | b(v)-5 b(alue)30 b(of)g Fs(MACHTYPE)p Ft(.)150 1998 y | |
6829 | Fs(BASH_VERSION)630 2107 y Ft(The)g(v)m(ersion)g(n)m(um)m(b)s(er)f(of)h | |
6830 | (the)h(curren)m(t)f(instance)g(of)h(Bash.)150 2281 y | |
6831 | Fs(COLUMNS)144 b Ft(Used)36 b(b)m(y)h(the)f Fs(select)f | |
6832 | Ft(builtin)e(command)k(to)g(determine)e(the)i(terminal)e(width)g(when) | |
6833 | 630 2390 y(prin)m(ting)28 b(selection)i(lists.)40 b(Automatically)30 | |
6834 | b(set)h(up)s(on)d(receipt)j(of)f(a)h Fs(SIGWINCH)p Ft(.)150 | |
6835 | 2564 y Fs(COMP_CWORD)630 2673 y Ft(An)38 b(index)f(in)m(to)h | |
6836 | Fs(${COMP_WORDS})d Ft(of)k(the)g(w)m(ord)f(con)m(taining)g(the)g | |
6837 | (curren)m(t)g(cursor)g(p)s(o-)630 2783 y(sition.)70 b(This)39 | |
6838 | b(v)-5 b(ariable)39 b(is)g(a)m(v)-5 b(ailable)40 b(only)g(in)f(shell)g | |
6839 | (functions)g(in)m(v)m(ok)m(ed)i(b)m(y)f(the)h(pro-)630 | |
6840 | 2892 y(grammable)35 b(completion)f(facilities)g(\(see)i(Section)f(8.6)h | |
6841 | ([Programmable)f(Completion],)630 3002 y(page)c(103\).)150 | |
6842 | 3176 y Fs(COMP_LINE)630 3285 y Ft(The)38 b(curren)m(t)h(command)f | |
6843 | (line.)64 b(This)36 b(v)-5 b(ariable)38 b(is)g(a)m(v)-5 | |
6844 | b(ailable)38 b(only)f(in)h(shell)e(functions)630 3395 | |
6845 | y(and)25 b(external)g(commands)g(in)m(v)m(ok)m(ed)g(b)m(y)g(the)h | |
6846 | (programmable)e(completion)h(facilities)e(\(see)630 3504 | |
6847 | y(Section)30 b(8.6)i([Programmable)e(Completion],)f(page)i(103\).)150 | |
6848 | 3678 y Fs(COMP_POINT)630 3787 y Ft(The)25 b(index)f(of)i(the)g(curren)m | |
6849 | (t)f(cursor)g(p)s(osition)f(relativ)m(e)i(to)g(the)g(b)s(eginning)d(of) | |
6850 | i(the)h(curren)m(t)630 3897 y(command.)40 b(If)27 b(the)h(curren)m(t)g | |
6851 | (cursor)g(p)s(osition)e(is)h(at)h(the)g(end)g(of)g(the)g(curren)m(t)g | |
6852 | (command,)630 4007 y(the)i(v)-5 b(alue)29 b(of)h(this)f(v)-5 | |
6853 | b(ariable)29 b(is)g(equal)g(to)i Fs(${#COMP_LINE})p Ft(.)37 | |
6854 | b(This)28 b(v)-5 b(ariable)29 b(is)g(a)m(v)-5 b(ailable)630 | |
6855 | 4116 y(only)35 b(in)f(shell)g(functions)g(and)h(external)g(commands)h | |
6856 | (in)m(v)m(ok)m(ed)g(b)m(y)f(the)h(programmable)630 4226 | |
6857 | y(completion)30 b(facilities)e(\(see)k(Section)e(8.6)h([Programmable)f | |
6858 | (Completion],)g(page)h(103\).)150 4399 y Fs(COMP_WORDBREAKS)630 | |
6859 | 4509 y Ft(The)e(set)i(of)e(c)m(haracters)j(that)e(the)g(Readline)e | |
6860 | (library)g(treats)i(as)g(w)m(ord)g(separators)g(when)630 | |
6861 | 4619 y(p)s(erforming)h(w)m(ord)i(completion.)49 b(If)33 | |
6862 | b Fs(COMP_WORDBREAKS)c Ft(is)k(unset,)h(it)e(loses)i(its)e(sp)s(ecial) | |
6863 | 630 4728 y(prop)s(erties,)d(ev)m(en)i(if)e(it)h(is)g(subsequen)m(tly)f | |
6864 | (reset.)150 4902 y Fs(COMP_WORDS)630 5011 y Ft(An)36 | |
6865 | b(arra)m(y)g(v)-5 b(ariable)35 b(consisting)g(of)h(the)g(individual)31 | |
6866 | b(w)m(ords)36 b(in)e(the)i(curren)m(t)g(command)630 5121 | |
6867 | y(line.)86 b(This)44 b(v)-5 b(ariable)45 b(is)g(a)m(v)-5 | |
6868 | b(ailable)45 b(only)g(in)g(shell)f(functions)h(in)m(v)m(ok)m(ed)h(b)m | |
6869 | (y)g(the)g(pro-)630 5230 y(grammable)35 b(completion)f(facilities)g | |
6870 | (\(see)i(Section)f(8.6)h([Programmable)f(Completion],)630 | |
6871 | 5340 y(page)c(103\).)p eop | |
6872 | %%Page: 58 64 | |
6873 | 58 63 bop 150 -116 a Ft(58)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
6874 | 299 y Fs(COMPREPLY)630 408 y Ft(An)37 b(arra)m(y)h(v)-5 | |
6875 | b(ariable)36 b(from)h(whic)m(h)f(Bash)h(reads)g(the)h(p)s(ossible)c | |
6876 | (completions)j(generated)630 518 y(b)m(y)c(a)g(shell)f(function)g(in)m | |
6877 | (v)m(ok)m(ed)h(b)m(y)g(the)g(programmable)g(completion)f(facilit)m(y)g | |
6878 | (\(see)i(Sec-)630 628 y(tion)c(8.6)h([Programmable)f(Completion],)g | |
6879 | (page)h(103\).)150 774 y Fs(DIRSTACK)96 b Ft(An)26 b(arra)m(y)h(v)-5 | |
6880 | b(ariable)26 b(con)m(taining)g(the)h(curren)m(t)f(con)m(ten)m(ts)j(of)e | |
6881 | (the)f(directory)h(stac)m(k.)41 b(Direc-)630 883 y(tories)32 | |
6882 | b(app)s(ear)g(in)f(the)i(stac)m(k)h(in)d(the)i(order)f(they)h(are)g | |
6883 | (displa)m(y)m(ed)e(b)m(y)h(the)h Fs(dirs)e Ft(builtin.)630 | |
6884 | 993 y(Assigning)d(to)j(mem)m(b)s(ers)f(of)g(this)f(arra)m(y)h(v)-5 | |
6885 | b(ariable)29 b(ma)m(y)i(b)s(e)e(used)h(to)h(mo)s(dify)d(directories)630 | |
6886 | 1103 y(already)40 b(in)f(the)i(stac)m(k,)k(but)40 b(the)h | |
6887 | Fs(pushd)e Ft(and)h Fs(popd)f Ft(builtins)e(m)m(ust)k(b)s(e)e(used)h | |
6888 | (to)i(add)630 1212 y(and)37 b(remo)m(v)m(e)h(directories.)61 | |
6889 | b(Assignmen)m(t)36 b(to)i(this)e(v)-5 b(ariable)36 b(will)f(not)i(c)m | |
6890 | (hange)i(the)e(cur-)630 1322 y(ren)m(t)c(directory)-8 | |
6891 | b(.)46 b(If)32 b Fs(DIRSTACK)e Ft(is)h(unset,)h(it)g(loses)g(its)g(sp)s | |
6892 | (ecial)f(prop)s(erties,)g(ev)m(en)i(if)e(it)h(is)630 | |
6893 | 1431 y(subsequen)m(tly)d(reset.)150 1577 y Fs(EMACS)240 | |
6894 | b Ft(If)31 b(Bash)h(\014nds)d(this)i(v)-5 b(ariable)30 | |
6895 | b(in)g(the)i(en)m(vironmen)m(t)f(when)f(the)i(shell)d(starts)j(with)e | |
6896 | (v)-5 b(alue)630 1687 y(`)p Fs(t)p Ft(',)38 b(it)d(assumes)h(that)g | |
6897 | (the)h(shell)d(is)h(running)e(in)i(an)h(emacs)g(shell)f(bu\013er)g(and) | |
6898 | g(disables)630 1797 y(line)29 b(editing.)150 1943 y Fs(EUID)288 | |
6899 | b Ft(The)30 b(n)m(umeric)f(e\013ectiv)m(e)j(user)e(id)f(of)h(the)h | |
6900 | (curren)m(t)f(user.)40 b(This)29 b(v)-5 b(ariable)29 | |
6901 | b(is)g(readonly)-8 b(.)150 2089 y Fs(FCEDIT)192 b Ft(The)30 | |
6902 | b(editor)g(used)f(as)i(a)g(default)e(b)m(y)i(the)f(`)p | |
6903 | Fs(-e)p Ft(')g(option)g(to)h(the)g Fs(fc)f Ft(builtin)d(command.)150 | |
6904 | 2235 y Fs(FIGNORE)144 b Ft(A)35 b(colon-separated)h(list)e(of)i | |
6905 | (su\016xes)e(to)i(ignore)f(when)f(p)s(erforming)f(\014lename)i(comple-) | |
6906 | 630 2345 y(tion.)j(A)25 b(\014le)f(name)h(whose)f(su\016x)g(matc)m(hes) | |
6907 | i(one)f(of)g(the)g(en)m(tries)f(in)g Fs(FIGNORE)e Ft(is)i(excluded)630 | |
6908 | 2454 y(from)30 b(the)g(list)f(of)i(matc)m(hed)g(\014le)f(names.)40 | |
6909 | b(A)31 b(sample)e(v)-5 b(alue)30 b(is)g(`)p Fs(.o:~)p | |
6910 | Ft(')150 2600 y Fs(FUNCNAME)96 b Ft(An)35 b(arra)m(y)i(v)-5 | |
6911 | b(ariable)34 b(con)m(taining)h(the)h(names)g(of)g(all)e(shell)g | |
6912 | (functions)h(curren)m(tly)f(in)h(the)630 2710 y(execution)g(call)g | |
6913 | (stac)m(k.)57 b(The)34 b(elemen)m(t)i(with)e(index)g(0)i(is)e(the)h | |
6914 | (name)h(of)f(an)m(y)h(curren)m(tly-)630 2819 y(executing)h(shell)e | |
6915 | (function.)57 b(The)37 b(b)s(ottom-most)g(elemen)m(t)g(is)f | |
6916 | Fs(")p Ft(main)p Fs(")p Ft(.)57 b(This)35 b(v)-5 b(ariable)630 | |
6917 | 2929 y(exists)32 b(only)g(when)g(a)h(shell)e(function)g(is)h | |
6918 | (executing.)48 b(Assignmen)m(ts)32 b(to)h Fs(FUNCNAME)e | |
6919 | Ft(ha)m(v)m(e)630 3039 y(no)36 b(e\013ect)h(and)e(return)f(an)i(error)f | |
6920 | (status.)57 b(If)36 b Fs(FUNCNAME)d Ft(is)i(unset,)i(it)e(loses)g(its)g | |
6921 | (sp)s(ecial)630 3148 y(prop)s(erties,)29 b(ev)m(en)i(if)e(it)h(is)g | |
6922 | (subsequen)m(tly)f(reset.)150 3294 y Fs(GLOBIGNORE)630 | |
6923 | 3404 y Ft(A)38 b(colon-separated)h(list)e(of)h(patterns)g(de\014ning)e | |
6924 | (the)i(set)g(of)h(\014lenames)e(to)h(b)s(e)g(ignored)630 | |
6925 | 3513 y(b)m(y)31 b(\014lename)f(expansion.)42 b(If)31 | |
6926 | b(a)h(\014lename)e(matc)m(hed)i(b)m(y)f(a)g(\014lename)g(expansion)f | |
6927 | (pattern)630 3623 y(also)i(matc)m(hes)h(one)f(of)g(the)g(patterns)g(in) | |
6928 | e Fs(GLOBIGNORE)p Ft(,)g(it)h(is)g(remo)m(v)m(ed)i(from)e(the)h(list)f | |
6929 | (of)630 3733 y(matc)m(hes.)150 3879 y Fs(GROUPS)192 b | |
6930 | Ft(An)36 b(arra)m(y)g(v)-5 b(ariable)35 b(con)m(taining)g(the)h(list)f | |
6931 | (of)h(groups)g(of)g(whic)m(h)e(the)j(curren)m(t)e(user)h(is)f(a)630 | |
6932 | 3988 y(mem)m(b)s(er.)47 b(Assignmen)m(ts)32 b(to)h Fs(GROUPS)e | |
6933 | Ft(ha)m(v)m(e)j(no)f(e\013ect)h(and)e(return)g(an)g(error)g(status.)48 | |
6934 | b(If)630 4098 y Fs(GROUPS)29 b Ft(is)g(unset,)h(it)g(loses)g(its)g(sp)s | |
6935 | (ecial)f(prop)s(erties,)g(ev)m(en)i(if)e(it)h(is)g(subsequen)m(tly)f | |
6936 | (reset.)150 4244 y Fs(histchars)630 4354 y Ft(Up)d(to)g(three)g(c)m | |
6937 | (haracters)i(whic)m(h)c(con)m(trol)j(history)d(expansion,)i(quic)m(k)g | |
6938 | (substitution,)f(and)630 4463 y(tok)m(enization)k(\(see)h(Section)e | |
6939 | (9.3)i([History)e(In)m(teraction],)i(page)g(111\).)41 | |
6940 | b(The)29 b(\014rst)e(c)m(harac-)630 4573 y(ter)j(is)e(the)h | |
6941 | Fq(history)f(expansion)g Ft(c)m(haracter,)k(that)e(is,)e(the)i(c)m | |
6942 | (haracter)h(whic)m(h)c(signi\014es)h(the)630 4682 y(start)d(of)f(a)h | |
6943 | (history)e(expansion,)i(normally)d(`)p Fs(!)p Ft('.)39 | |
6944 | b(The)24 b(second)g(c)m(haracter)i(is)d(the)h(c)m(haracter)630 | |
6945 | 4792 y(whic)m(h)35 b(signi\014es)f(`quic)m(k)i(substitution')e(when)h | |
6946 | (seen)h(as)g(the)g(\014rst)f(c)m(haracter)j(on)e(a)g(line,)630 | |
6947 | 4902 y(normally)25 b(`)p Fs(^)p Ft('.)39 b(The)26 b(optional)g(third)e | |
6948 | (c)m(haracter)k(is)d(the)i(c)m(haracter)h(whic)m(h)d(indicates)g(that) | |
6949 | 630 5011 y(the)34 b(remainder)e(of)i(the)g(line)e(is)g(a)i(commen)m(t)h | |
6950 | (when)e(found)f(as)i(the)g(\014rst)f(c)m(haracter)i(of)f(a)630 | |
6951 | 5121 y(w)m(ord,)i(usually)d(`)p Fs(#)p Ft('.)55 b(The)34 | |
6952 | b(history)g(commen)m(t)i(c)m(haracter)h(causes)e(history)f | |
6953 | (substitution)630 5230 y(to)27 b(b)s(e)f(skipp)s(ed)e(for)j(the)f | |
6954 | (remaining)f(w)m(ords)h(on)h(the)f(line.)38 b(It)27 b(do)s(es)f(not)h | |
6955 | (necessarily)e(cause)630 5340 y(the)31 b(shell)d(parser)i(to)h(treat)g | |
6956 | (the)g(rest)g(of)f(the)h(line)d(as)j(a)g(commen)m(t.)p | |
6957 | eop | |
6958 | %%Page: 59 65 | |
6959 | 59 64 bop 150 -116 a Ft(Chapter)30 b(5:)41 b(Shell)28 | |
6960 | b(V)-8 b(ariables)2457 b(59)150 299 y Fs(HISTCMD)144 | |
6961 | b Ft(The)35 b(history)g(n)m(um)m(b)s(er,)h(or)f(index)f(in)h(the)h | |
6962 | (history)e(list,)i(of)g(the)g(curren)m(t)f(command.)56 | |
6963 | b(If)630 408 y Fs(HISTCMD)28 b Ft(is)g(unset,)i(it)f(loses)h(its)f(sp)s | |
6964 | (ecial)f(prop)s(erties,)h(ev)m(en)h(if)f(it)g(is)g(subsequen)m(tly)f | |
6965 | (reset.)150 578 y Fs(HISTCONTROL)630 688 y Ft(A)40 b(colon-separated)h | |
6966 | (list)e(of)h(v)-5 b(alues)39 b(con)m(trolling)g(ho)m(w)h(commands)g | |
6967 | (are)h(sa)m(v)m(ed)g(on)f(the)630 797 y(history)28 b(list.)39 | |
6968 | b(If)28 b(the)h(list)f(of)h(v)-5 b(alues)28 b(includes)e(`)p | |
6969 | Fs(ignorespace)p Ft(',)h(lines)g(whic)m(h)h(b)s(egin)f(with)630 | |
6970 | 907 y(a)39 b(space)g(c)m(haracter)i(are)e(not)g(sa)m(v)m(ed)g(in)f(the) | |
6971 | h(history)e(list.)64 b(A)39 b(v)-5 b(alue)38 b(of)h(`)p | |
6972 | Fs(ignoredups)p Ft(')630 1017 y(causes)34 b(lines)f(whic)m(h)g(matc)m | |
6973 | (h)i(the)f(previous)e(history)h(en)m(try)i(to)g(not)f(b)s(e)f(sa)m(v)m | |
6974 | (ed.)53 b(A)34 b(v)-5 b(alue)630 1126 y(of)32 b(`)p Fs(ignoreboth)p | |
6975 | Ft(')d(is)i(shorthand)f(for)i(`)p Fs(ignorespace)p Ft(')d(and)i(`)p | |
6976 | Fs(ignoredups)p Ft('.)42 b(A)32 b(v)-5 b(alue)31 b(of)630 | |
6977 | 1236 y(`)p Fs(erasedups)p Ft(')g(causes)i(all)f(previous)g(lines)f | |
6978 | (matc)m(hing)i(the)g(curren)m(t)g(line)e(to)j(b)s(e)e(remo)m(v)m(ed)630 | |
6979 | 1345 y(from)42 b(the)h(history)e(list)h(b)s(efore)g(that)h(line)e(is)h | |
6980 | (sa)m(v)m(ed.)78 b(An)m(y)43 b(v)-5 b(alue)42 b(not)h(in)e(the)i(ab)s | |
6981 | (o)m(v)m(e)630 1455 y(list)33 b(is)h(ignored.)52 b(If)34 | |
6982 | b Fs(HISTCONTROL)e Ft(is)h(unset,)j(or)e(do)s(es)h(not)g(include)d(a)j | |
6983 | (v)-5 b(alid)33 b(v)-5 b(alue,)35 b(all)630 1564 y(lines)28 | |
6984 | b(read)i(b)m(y)g(the)g(shell)e(parser)i(are)g(sa)m(v)m(ed)h(on)f(the)g | |
6985 | (history)f(list,)g(sub)5 b(ject)30 b(to)g(the)g(v)-5 | |
6986 | b(alue)630 1674 y(of)42 b Fs(HISTIGNORE)p Ft(.)73 b(The)42 | |
6987 | b(second)g(and)g(subsequen)m(t)f(lines)f(of)j(a)f(m)m(ulti-line)d(comp) | |
6988 | s(ound)630 1784 y(command)33 b(are)h(not)g(tested,)i(and)d(are)h(added) | |
6989 | f(to)h(the)g(history)f(regardless)g(of)h(the)f(v)-5 b(alue)630 | |
6990 | 1893 y(of)31 b Fs(HISTCONTROL)p Ft(.)150 2063 y Fs(HISTFILE)96 | |
6991 | b Ft(The)27 b(name)h(of)g(the)g(\014le)f(to)i(whic)m(h)e(the)h(command) | |
6992 | f(history)g(is)g(sa)m(v)m(ed.)41 b(The)27 b(default)g(v)-5 | |
6993 | b(alue)630 2172 y(is)29 b(`)p Fs(~/.bash_history)p Ft('.)150 | |
6994 | 2342 y Fs(HISTFILESIZE)630 2452 y Ft(The)d(maxim)m(um)e(n)m(um)m(b)s | |
6995 | (er)h(of)h(lines)f(con)m(tained)h(in)f(the)h(history)f(\014le.)38 | |
6996 | b(When)26 b(this)f(v)-5 b(ariable)630 2561 y(is)24 b(assigned)h(a)h(v) | |
6997 | -5 b(alue,)26 b(the)g(history)e(\014le)h(is)f(truncated,)j(if)d | |
6998 | (necessary)-8 b(,)28 b(to)e(con)m(tain)f(no)h(more)630 | |
6999 | 2671 y(than)34 b(that)h(n)m(um)m(b)s(er)d(of)j(lines.)50 | |
7000 | b(The)34 b(history)f(\014le)g(is)g(also)h(truncated)g(to)h(this)e(size) | |
7001 | h(after)630 2781 y(writing)28 b(it)i(when)g(an)g(in)m(teractiv)m(e)h | |
7002 | (shell)e(exits.)40 b(The)30 b(default)g(v)-5 b(alue)30 | |
7003 | b(is)f(500.)150 2950 y Fs(HISTIGNORE)630 3060 y Ft(A)k(colon-separated) | |
7004 | g(list)e(of)i(patterns)f(used)g(to)h(decide)f(whic)m(h)f(command)h | |
7005 | (lines)f(should)630 3169 y(b)s(e)h(sa)m(v)m(ed)h(on)g(the)f(history)g | |
7006 | (list.)45 b(Eac)m(h)33 b(pattern)g(is)e(anc)m(hored)i(at)g(the)f(b)s | |
7007 | (eginning)e(of)j(the)630 3279 y(line)41 b(and)g(m)m(ust)h(matc)m(h)h | |
7008 | (the)g(complete)g(line)d(\(no)j(implicit)c(`)p Fs(*)p | |
7009 | Ft(')j(is)f(app)s(ended\).)75 b(Eac)m(h)630 3389 y(pattern)42 | |
7010 | b(is)f(tested)h(against)g(the)g(line)e(after)i(the)g(c)m(hec)m(ks)h(sp) | |
7011 | s(eci\014ed)d(b)m(y)i Fs(HISTCONTROL)630 3498 y Ft(are)37 | |
7012 | b(applied.)57 b(In)36 b(addition)f(to)i(the)g(normal)f(shell)e(pattern) | |
7013 | j(matc)m(hing)g(c)m(haracters,)j(`)p Fs(&)p Ft(')630 | |
7014 | 3608 y(matc)m(hes)d(the)f(previous)f(history)g(line.)55 | |
7015 | b(`)p Fs(&)p Ft(')36 b(ma)m(y)h(b)s(e)e(escap)s(ed)h(using)f(a)h(bac)m | |
7016 | (kslash;)j(the)630 3717 y(bac)m(kslash)33 b(is)g(remo)m(v)m(ed)i(b)s | |
7017 | (efore)e(attempting)h(a)h(matc)m(h.)51 b(The)34 b(second)f(and)h | |
7018 | (subsequen)m(t)630 3827 y(lines)c(of)j(a)g(m)m(ulti-line)c(comp)s(ound) | |
7019 | i(command)h(are)h(not)f(tested,)i(and)e(are)g(added)g(to)h(the)630 | |
7020 | 3937 y(history)c(regardless)h(of)h(the)f(v)-5 b(alue)30 | |
7021 | b(of)h Fs(HISTIGNORE)p Ft(.)630 4076 y Fs(HISTIGNORE)20 | |
7022 | b Ft(subsumes)g(the)j(function)e(of)i Fs(HISTCONTROL)p | |
7023 | Ft(.)35 b(A)23 b(pattern)f(of)h(`)p Fs(&)p Ft(')g(is)e(iden)m(tical)630 | |
7024 | 4186 y(to)26 b Fs(ignoredups)p Ft(,)e(and)h(a)h(pattern)g(of)f(`)p | |
7025 | Fs([)31 b(]*)p Ft(')25 b(is)g(iden)m(tical)f(to)i Fs(ignorespace)p | |
7026 | Ft(.)36 b(Com)m(bining)630 4295 y(these)30 b(t)m(w)m(o)h(patterns,)f | |
7027 | (separating)f(them)h(with)e(a)i(colon,)g(pro)m(vides)e(the)i | |
7028 | (functionalit)m(y)e(of)630 4405 y Fs(ignoreboth)p Ft(.)150 | |
7029 | 4575 y Fs(HISTSIZE)96 b Ft(The)42 b(maxim)m(um)f(n)m(um)m(b)s(er)g(of)i | |
7030 | (commands)e(to)j(remem)m(b)s(er)d(on)h(the)h(history)e(list.)75 | |
7031 | b(The)630 4684 y(default)30 b(v)-5 b(alue)29 b(is)h(500.)150 | |
7032 | 4854 y Fs(HISTTIMEFORMAT)630 4963 y Ft(If)44 b(this)f(v)-5 | |
7033 | b(ariable)43 b(is)g(set)h(and)g(not)g(n)m(ull,)i(its)e(v)-5 | |
7034 | b(alue)43 b(is)g(used)h(as)g(a)h(format)f(string)f(for)630 | |
7035 | 5073 y Fq(strftime)c Ft(to)c(prin)m(t)e(the)i(time)f(stamp)g(asso)s | |
7036 | (ciated)h(with)f(eac)m(h)h(history)f(en)m(try)g(displa)m(y)m(ed)630 | |
7037 | 5183 y(b)m(y)g(the)f Fs(history)f Ft(builtin.)47 b(If)33 | |
7038 | b(this)g(v)-5 b(ariable)32 b(is)h(set,)i(time)e(stamps)h(are)g(written) | |
7039 | e(to)j(the)630 5292 y(history)29 b(\014le)h(so)g(they)h(ma)m(y)g(b)s(e) | |
7040 | f(preserv)m(ed)g(across)h(shell)d(sessions.)p eop | |
7041 | %%Page: 60 66 | |
7042 | 60 65 bop 150 -116 a Ft(60)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
7043 | 299 y Fs(HOSTFILE)96 b Ft(Con)m(tains)38 b(the)g(name)g(of)h(a)g | |
7044 | (\014le)e(in)g(the)h(same)h(format)g(as)f(`)p Fs(/etc/hosts)p | |
7045 | Ft(')e(that)j(should)630 408 y(b)s(e)i(read)h(when)f(the)i(shell)d | |
7046 | (needs)h(to)i(complete)g(a)f(hostname.)76 b(The)42 b(list)e(of)i(p)s | |
7047 | (ossible)630 518 y(hostname)26 b(completions)e(ma)m(y)j(b)s(e)d(c)m | |
7048 | (hanged)j(while)c(the)j(shell)e(is)g(running;)h(the)h(next)f(time)630 | |
7049 | 628 y(hostname)37 b(completion)g(is)f(attempted)i(after)g(the)f(v)-5 | |
7050 | b(alue)36 b(is)h(c)m(hanged,)i(Bash)e(adds)g(the)630 | |
7051 | 737 y(con)m(ten)m(ts)27 b(of)f(the)g(new)f(\014le)g(to)i(the)f | |
7052 | (existing)e(list.)38 b(If)25 b Fs(HOSTFILE)f Ft(is)h(set,)i(but)e(has)h | |
7053 | (no)f(v)-5 b(alue,)630 847 y(Bash)41 b(attempts)g(to)g(read)f(`)p | |
7054 | Fs(/etc/hosts)p Ft(')f(to)i(obtain)f(the)g(list)f(of)i(p)s(ossible)d | |
7055 | (hostname)630 956 y(completions.)i(When)30 b Fs(HOSTFILE)e | |
7056 | Ft(is)i(unset,)g(the)g(hostname)h(list)e(is)g(cleared.)150 | |
7057 | 1125 y Fs(HOSTNAME)96 b Ft(The)30 b(name)g(of)h(the)f(curren)m(t)h | |
7058 | (host.)150 1294 y Fs(HOSTTYPE)96 b Ft(A)30 b(string)g(describing)e(the) | |
7059 | i(mac)m(hine)g(Bash)h(is)e(running)f(on.)150 1462 y Fs(IGNOREEOF)630 | |
7060 | 1572 y Ft(Con)m(trols)e(the)i(action)f(of)g(the)g(shell)e(on)i(receipt) | |
7061 | g(of)g(an)g Fs(EOF)f Ft(c)m(haracter)i(as)g(the)f(sole)g(input.)630 | |
7062 | 1681 y(If)j(set,)i(the)f(v)-5 b(alue)31 b(denotes)g(the)g(n)m(um)m(b)s | |
7063 | (er)f(of)h(consecutiv)m(e)h Fs(EOF)e Ft(c)m(haracters)i(that)f(can)h(b) | |
7064 | s(e)630 1791 y(read)40 b(as)f(the)h(\014rst)f(c)m(haracter)i(on)f(an)f | |
7065 | (input)f(line)g(b)s(efore)h(the)h(shell)e(will)f(exit.)69 | |
7066 | b(If)39 b(the)630 1901 y(v)-5 b(ariable)36 b(exists)g(but)g(do)s(es)g | |
7067 | (not)h(ha)m(v)m(e)h(a)g(n)m(umeric)d(v)-5 b(alue)36 b(\(or)i(has)e(no)h | |
7068 | (v)-5 b(alue\))36 b(then)h(the)630 2010 y(default)30 | |
7069 | b(is)g(10.)43 b(If)30 b(the)h(v)-5 b(ariable)29 b(do)s(es)i(not)g | |
7070 | (exist,)g(then)f Fs(EOF)g Ft(signi\014es)f(the)i(end)f(of)h(input)630 | |
7071 | 2120 y(to)g(the)g(shell.)39 b(This)28 b(is)i(only)f(in)g(e\013ect)j | |
7072 | (for)e(in)m(teractiv)m(e)h(shells.)150 2288 y Fs(INPUTRC)144 | |
7073 | b Ft(The)68 b(name)h(of)f(the)h(Readline)e(initialization)f(\014le,)77 | |
7074 | b(o)m(v)m(erriding)67 b(the)i(default)f(of)630 2398 y(`)p | |
7075 | Fs(~/.inputrc)p Ft('.)150 2567 y Fs(LANG)288 b Ft(Used)28 | |
7076 | b(to)h(determine)e(the)h(lo)s(cale)f(category)j(for)e(an)m(y)h | |
7077 | (category)h(not)e(sp)s(eci\014cally)d(selected)630 2676 | |
7078 | y(with)k(a)i(v)-5 b(ariable)29 b(starting)h(with)f Fs(LC_)p | |
7079 | Ft(.)150 2845 y Fs(LC_ALL)192 b Ft(This)27 b(v)-5 b(ariable)27 | |
7080 | b(o)m(v)m(errides)i(the)g(v)-5 b(alue)28 b(of)h Fs(LANG)f | |
7081 | Ft(and)g(an)m(y)h(other)g Fs(LC_)f Ft(v)-5 b(ariable)27 | |
7082 | b(sp)s(ecifying)630 2954 y(a)k(lo)s(cale)f(category)-8 | |
7083 | b(.)150 3123 y Fs(LC_COLLATE)630 3232 y Ft(This)36 b(v)-5 | |
7084 | b(ariable)36 b(determines)h(the)h(collation)f(order)g(used)g(when)f | |
7085 | (sorting)h(the)h(results)f(of)630 3342 y(\014lename)e(expansion,)i(and) | |
7086 | f(determines)f(the)i(b)s(eha)m(vior)e(of)h(range)h(expressions,)g | |
7087 | (equiv-)630 3452 y(alence)e(classes,)h(and)f(collating)f(sequences)h | |
7088 | (within)d(\014lename)i(expansion)g(and)g(pattern)630 | |
7089 | 3561 y(matc)m(hing)c(\(see)i(Section)e(3.5.8)i([Filename)e(Expansion],) | |
7090 | f(page)i(22\).)150 3730 y Fs(LC_CTYPE)96 b Ft(This)35 | |
7091 | b(v)-5 b(ariable)35 b(determines)g(the)i(in)m(terpretation)f(of)h(c)m | |
7092 | (haracters)h(and)e(the)g(b)s(eha)m(vior)g(of)630 3839 | |
7093 | y(c)m(haracter)46 b(classes)f(within)d(\014lename)i(expansion)g(and)g | |
7094 | (pattern)h(matc)m(hing)g(\(see)g(Sec-)630 3949 y(tion)30 | |
7095 | b(3.5.8)i([Filename)e(Expansion],)f(page)i(22\).)150 | |
7096 | 4118 y Fs(LC_MESSAGES)630 4227 y Ft(This)24 b(v)-5 b(ariable)25 | |
7097 | b(determines)g(the)h(lo)s(cale)g(used)f(to)i(translate)f(double-quoted) | |
7098 | f(strings)g(pre-)630 4337 y(ceded)31 b(b)m(y)f(a)h(`)p | |
7099 | Fs($)p Ft(')f(\(see)h(Section)g(3.1.2.5)h([Lo)s(cale)f(T)-8 | |
7100 | b(ranslation],)30 b(page)h(7\).)150 4505 y Fs(LC_NUMERIC)630 | |
7101 | 4615 y Ft(This)e(v)-5 b(ariable)29 b(determines)g(the)i(lo)s(cale)f | |
7102 | (category)i(used)e(for)g(n)m(um)m(b)s(er)f(formatting.)150 | |
7103 | 4784 y Fs(LINENO)192 b Ft(The)30 b(line)f(n)m(um)m(b)s(er)g(in)g(the)h | |
7104 | (script)g(or)g(shell)e(function)i(curren)m(tly)f(executing.)150 | |
7105 | 4952 y Fs(LINES)240 b Ft(Used)25 b(b)m(y)g(the)g Fs(select)e | |
7106 | Ft(builtin)f(command)j(to)h(determine)e(the)h(column)f(length)g(for)h | |
7107 | (prin)m(t-)630 5062 y(ing)30 b(selection)g(lists.)39 | |
7108 | b(Automatically)30 b(set)h(up)s(on)e(receipt)h(of)g(a)h | |
7109 | Fs(SIGWINCH)p Ft(.)150 5230 y Fs(MACHTYPE)96 b Ft(A)26 | |
7110 | b(string)f(that)i(fully)d(describ)s(es)g(the)i(system)g(t)m(yp)s(e)h | |
7111 | (on)f(whic)m(h)e(Bash)j(is)e(executing,)i(in)e(the)630 | |
7112 | 5340 y(standard)30 b Fl(gnu)g Fq(cpu-compan)m(y-system)h | |
7113 | Ft(format.)p eop | |
7114 | %%Page: 61 67 | |
7115 | 61 66 bop 150 -116 a Ft(Chapter)30 b(5:)41 b(Shell)28 | |
7116 | b(V)-8 b(ariables)2457 b(61)150 299 y Fs(MAILCHECK)630 | |
7117 | 408 y Ft(Ho)m(w)28 b(often)g(\(in)f(seconds\))h(that)g(the)f(shell)f | |
7118 | (should)g(c)m(hec)m(k)j(for)e(mail)f(in)g(the)i(\014les)f(sp)s | |
7119 | (eci\014ed)630 518 y(in)i(the)i Fs(MAILPATH)e Ft(or)i | |
7120 | Fs(MAIL)e Ft(v)-5 b(ariables.)41 b(The)30 b(default)g(is)f(60)j | |
7121 | (seconds.)42 b(When)30 b(it)g(is)g(time)630 628 y(to)37 | |
7122 | b(c)m(hec)m(k)h(for)e(mail,)h(the)g(shell)d(do)s(es)i(so)h(b)s(efore)f | |
7123 | (displa)m(ying)e(the)i(primary)f(prompt.)57 b(If)630 | |
7124 | 737 y(this)36 b(v)-5 b(ariable)36 b(is)g(unset,)i(or)f(set)h(to)g(a)f | |
7125 | (v)-5 b(alue)37 b(that)g(is)f(not)i(a)f(n)m(um)m(b)s(er)f(greater)i | |
7126 | (than)f(or)630 847 y(equal)30 b(to)h(zero,)g(the)g(shell)e(disables)f | |
7127 | (mail)h(c)m(hec)m(king.)150 1011 y Fs(OLDPWD)192 b Ft(The)30 | |
7128 | b(previous)f(w)m(orking)g(directory)h(as)h(set)g(b)m(y)f(the)h | |
7129 | Fs(cd)e Ft(builtin.)150 1176 y Fs(OPTERR)192 b Ft(If)35 | |
7130 | b(set)i(to)f(the)h(v)-5 b(alue)35 b(1,)j(Bash)e(displa)m(ys)e(error)h | |
7131 | (messages)i(generated)g(b)m(y)f(the)g Fs(getopts)630 | |
7132 | 1285 y Ft(builtin)27 b(command.)150 1450 y Fs(OSTYPE)192 | |
7133 | b Ft(A)30 b(string)g(describing)e(the)i(op)s(erating)g(system)h(Bash)f | |
7134 | (is)g(running)d(on.)150 1614 y Fs(PIPESTATUS)630 1724 | |
7135 | y Ft(An)c(arra)m(y)h(v)-5 b(ariable)22 b(\(see)j(Section)e(6.7)i([Arra) | |
7136 | m(ys],)g(page)f(72\))h(con)m(taining)e(a)h(list)e(of)i(exit)f(sta-)630 | |
7137 | 1833 y(tus)i(v)-5 b(alues)26 b(from)f(the)h(pro)s(cesses)g(in)e(the)i | |
7138 | (most-recen)m(tly-executed)i(foreground)d(pip)s(eline)630 | |
7139 | 1943 y(\(whic)m(h)k(ma)m(y)i(con)m(tain)g(only)f(a)g(single)f | |
7140 | (command\).)150 2107 y Fs(POSIXLY_CORRECT)630 2217 y | |
7141 | Ft(If)j(this)g(v)-5 b(ariable)32 b(is)g(in)f(the)i(en)m(vironmen)m(t)g | |
7142 | (when)e Fs(bash)h Ft(starts,)i(the)f(shell)e(en)m(ters)j | |
7143 | Fl(posix)630 2326 y Ft(mo)s(de)22 b(\(see)h(Section)f(6.11)i([Bash)e | |
7144 | (POSIX)f(Mo)s(de],)k(page)e(76\))g(b)s(efore)f(reading)f(the)h(startup) | |
7145 | 630 2436 y(\014les,)31 b(as)g(if)g(the)g(`)p Fs(--posix)p | |
7146 | Ft(')f(in)m(v)m(o)s(cation)h(option)g(had)g(b)s(een)g(supplied.)40 | |
7147 | b(If)31 b(it)g(is)f(set)i(while)630 2545 y(the)f(shell)d(is)i(running,) | |
7148 | d Fs(bash)j Ft(enables)f Fl(posix)h Ft(mo)s(de,)g(as)h(if)e(the)i | |
7149 | (command)870 2682 y Fs(set)47 b(-o)g(posix)630 2819 y | |
7150 | Ft(had)30 b(b)s(een)f(executed.)150 2984 y Fs(PPID)288 | |
7151 | b Ft(The)30 b(pro)s(cess)g Fl(id)g Ft(of)h(the)f(shell's)f(paren)m(t)i | |
7152 | (pro)s(cess.)40 b(This)29 b(v)-5 b(ariable)29 b(is)g(readonly)-8 | |
7153 | b(.)150 3148 y Fs(PROMPT_COMMAND)630 3258 y Ft(If)32 | |
7154 | b(set,)h(the)f(v)-5 b(alue)32 b(is)f(in)m(terpreted)g(as)h(a)h(command) | |
7155 | f(to)h(execute)g(b)s(efore)f(the)g(prin)m(ting)e(of)630 | |
7156 | 3367 y(eac)m(h)i(primary)c(prompt)h(\()p Fs($PS1)p Ft(\).)150 | |
7157 | 3532 y Fs(PS3)336 b Ft(The)34 b(v)-5 b(alue)34 b(of)g(this)f(v)-5 | |
7158 | b(ariable)33 b(is)h(used)f(as)i(the)f(prompt)g(for)g(the)g | |
7159 | Fs(select)f Ft(command.)52 b(If)630 3641 y(this)29 b(v)-5 | |
7160 | b(ariable)29 b(is)h(not)g(set,)i(the)e Fs(select)f Ft(command)h | |
7161 | (prompts)f(with)g(`)p Fs(#?)h Ft(')150 3806 y Fs(PS4)336 | |
7162 | b Ft(The)33 b(v)-5 b(alue)33 b(is)g(the)h(prompt)f(prin)m(ted)f(b)s | |
7163 | (efore)h(the)h(command)f(line)f(is)h(ec)m(ho)s(ed)h(when)f(the)630 | |
7164 | 3915 y(`)p Fs(-x)p Ft(')23 b(option)g(is)g(set)h(\(see)g(Section)g(4.3) | |
7165 | g([The)f(Set)h(Builtin],)f(page)h(50\).)40 b(The)23 b(\014rst)f(c)m | |
7166 | (haracter)630 4025 y(of)34 b Fs(PS4)g Ft(is)f(replicated)h(m)m(ultiple) | |
7167 | e(times,)j(as)f(necessary)-8 b(,)37 b(to)e(indicate)e(m)m(ultiple)f | |
7168 | (lev)m(els)i(of)630 4134 y(indirection.)k(The)30 b(default)g(is)f(`)p | |
7169 | Fs(+)h Ft('.)150 4299 y Fs(PWD)336 b Ft(The)30 b(curren)m(t)g(w)m | |
7170 | (orking)g(directory)g(as)g(set)h(b)m(y)f(the)h Fs(cd)f | |
7171 | Ft(builtin.)150 4463 y Fs(RANDOM)192 b Ft(Eac)m(h)30 | |
7172 | b(time)f(this)f(parameter)h(is)f(referenced,)i(a)f(random)g(in)m(teger) | |
7173 | g(b)s(et)m(w)m(een)h(0)f(and)g(32767)630 4573 y(is)h(generated.)43 | |
7174 | b(Assigning)29 b(a)i(v)-5 b(alue)30 b(to)h(this)f(v)-5 | |
7175 | b(ariable)29 b(seeds)i(the)g(random)f(n)m(um)m(b)s(er)f(gen-)630 | |
7176 | 4682 y(erator.)150 4847 y Fs(REPLY)240 b Ft(The)30 b(default)f(v)-5 | |
7177 | b(ariable)30 b(for)g(the)g Fs(read)g Ft(builtin.)150 | |
7178 | 5011 y Fs(SECONDS)144 b Ft(This)39 b(v)-5 b(ariable)39 | |
7179 | b(expands)h(to)h(the)g(n)m(um)m(b)s(er)e(of)i(seconds)g(since)f(the)g | |
7180 | (shell)f(w)m(as)i(started.)630 5121 y(Assignmen)m(t)h(to)h(this)f(v)-5 | |
7181 | b(ariable)41 b(resets)i(the)g(coun)m(t)g(to)g(the)g(v)-5 | |
7182 | b(alue)42 b(assigned,)j(and)d(the)630 5230 y(expanded)35 | |
7183 | b(v)-5 b(alue)35 b(b)s(ecomes)i(the)f(v)-5 b(alue)35 | |
7184 | b(assigned)g(plus)f(the)i(n)m(um)m(b)s(er)f(of)h(seconds)g(since)630 | |
7185 | 5340 y(the)31 b(assignmen)m(t.)p eop | |
7186 | %%Page: 62 68 | |
7187 | 62 67 bop 150 -116 a Ft(62)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
7188 | 299 y Fs(SHELLOPTS)630 408 y Ft(A)g(colon-separated)g(list)e(of)i | |
7189 | (enabled)e(shell)g(options.)40 b(Eac)m(h)31 b(w)m(ord)f(in)f(the)i | |
7190 | (list)e(is)h(a)h(v)-5 b(alid)630 518 y(argumen)m(t)29 | |
7191 | b(for)g(the)g(`)p Fs(-o)p Ft(')g(option)f(to)i(the)f | |
7192 | Fs(set)f Ft(builtin)e(command)j(\(see)g(Section)g(4.3)h([The)630 | |
7193 | 628 y(Set)f(Builtin],)e(page)i(50\).)42 b(The)28 b(options)g(app)s | |
7194 | (earing)f(in)g Fs(SHELLOPTS)f Ft(are)j(those)h(rep)s(orted)630 | |
7195 | 737 y(as)g(`)p Fs(on)p Ft(')f(b)m(y)h(`)p Fs(set)g(-o)p | |
7196 | Ft('.)40 b(If)29 b(this)g(v)-5 b(ariable)28 b(is)h(in)f(the)i(en)m | |
7197 | (vironmen)m(t)f(when)g(Bash)h(starts)g(up,)630 847 y(eac)m(h)41 | |
7198 | b(shell)c(option)i(in)f(the)i(list)e(will)e(b)s(e)j(enabled)g(b)s | |
7199 | (efore)g(reading)f(an)m(y)i(startup)f(\014les.)630 956 | |
7200 | y(This)29 b(v)-5 b(ariable)29 b(is)g(readonly)-8 b(.)150 | |
7201 | 1116 y Fs(SHLVL)240 b Ft(Incremen)m(ted)21 b(b)m(y)g(one)g(eac)m(h)h | |
7202 | (time)e(a)i(new)e(instance)g(of)h(Bash)g(is)f(started.)38 | |
7203 | b(This)19 b(is)h(in)m(tended)630 1225 y(to)31 b(b)s(e)f(a)h(coun)m(t)g | |
7204 | (of)f(ho)m(w)h(deeply)e(y)m(our)h(Bash)h(shells)d(are)j(nested.)150 | |
7205 | 1385 y Fs(TIMEFORMAT)630 1494 y Ft(The)f(v)-5 b(alue)31 | |
7206 | b(of)g(this)f(parameter)h(is)f(used)g(as)h(a)g(format)h(string)e(sp)s | |
7207 | (ecifying)e(ho)m(w)j(the)g(tim-)630 1604 y(ing)36 b(information)e(for)j | |
7208 | (pip)s(elines)c(pre\014xed)i(with)g(the)i Fs(time)e Ft(reserv)m(ed)i(w) | |
7209 | m(ord)f(should)f(b)s(e)630 1714 y(displa)m(y)m(ed.)j(The)27 | |
7210 | b(`)p Fs(\045)p Ft(')h(c)m(haracter)h(in)m(tro)s(duces)d(an)i(escap)s | |
7211 | (e)g(sequence)g(that)g(is)e(expanded)h(to)630 1823 y(a)37 | |
7212 | b(time)f(v)-5 b(alue)35 b(or)i(other)f(information.)57 | |
7213 | b(The)36 b(escap)s(e)g(sequences)h(and)e(their)h(meanings)630 | |
7214 | 1933 y(are)31 b(as)f(follo)m(ws;)g(the)h(braces)f(denote)h(optional)f | |
7215 | (p)s(ortions.)630 2092 y Fs(\045\045)384 b Ft(A)30 b(literal)f(`)p | |
7216 | Fs(\045)p Ft('.)630 2252 y Fs(\045[)p Fj(p)11 b Fs(][l]R)85 | |
7217 | b Ft(The)30 b(elapsed)g(time)g(in)f(seconds.)630 2411 | |
7218 | y Fs(\045[)p Fj(p)11 b Fs(][l]U)85 b Ft(The)30 b(n)m(um)m(b)s(er)f(of)h | |
7219 | (CPU)g(seconds)h(sp)s(en)m(t)f(in)f(user)g(mo)s(de.)630 | |
7220 | 2570 y Fs(\045[)p Fj(p)11 b Fs(][l]S)85 b Ft(The)30 b(n)m(um)m(b)s(er)f | |
7221 | (of)h(CPU)g(seconds)h(sp)s(en)m(t)f(in)f(system)h(mo)s(de.)630 | |
7222 | 2730 y Fs(\045P)384 b Ft(The)30 b(CPU)g(p)s(ercen)m(tage,)i(computed)e | |
7223 | (as)h(\(\045U)f Fs(+)g Ft(\045S\))g(/)h(\045R.)630 2889 | |
7224 | y(The)23 b(optional)h Fq(p)i Ft(is)d(a)h(digit)f(sp)s(ecifying)e(the)j | |
7225 | (precision,)g(the)g(n)m(um)m(b)s(er)f(of)h(fractional)f(digits)630 | |
7226 | 2999 y(after)36 b(a)f(decimal)g(p)s(oin)m(t.)54 b(A)35 | |
7227 | b(v)-5 b(alue)35 b(of)g(0)h(causes)g(no)f(decimal)f(p)s(oin)m(t)g(or)i | |
7228 | (fraction)f(to)h(b)s(e)630 3108 y(output.)48 b(A)m(t)34 | |
7229 | b(most)f(three)g(places)g(after)g(the)g(decimal)f(p)s(oin)m(t)g(ma)m(y) | |
7230 | i(b)s(e)e(sp)s(eci\014ed;)h(v)-5 b(alues)630 3218 y(of)31 | |
7231 | b Fq(p)h Ft(greater)g(than)e(3)h(are)f(c)m(hanged)h(to)g(3.)42 | |
7232 | b(If)29 b Fq(p)k Ft(is)c(not)i(sp)s(eci\014ed,)e(the)i(v)-5 | |
7233 | b(alue)29 b(3)i(is)f(used.)630 3352 y(The)54 b(optional)f | |
7234 | Fs(l)h Ft(sp)s(eci\014es)f(a)i(longer)e(format,)61 b(including)51 | |
7235 | b(min)m(utes,)60 b(of)54 b(the)g(form)630 3462 y Fq(MM)10 | |
7236 | b Ft(m)p Fq(SS)p Ft(.)p Fq(FF)d Ft(s.)103 b(The)50 b(v)-5 | |
7237 | b(alue)51 b(of)g Fq(p)j Ft(determines)c(whether)g(or)h(not)h(the)f | |
7238 | (fraction)g(is)630 3572 y(included.)630 3706 y(If)30 | |
7239 | b(this)f(v)-5 b(ariable)29 b(is)h(not)g(set,)i(Bash)e(acts)h(as)g(if)e | |
7240 | (it)h(had)g(the)h(v)-5 b(alue)870 3841 y Fs | |
7241 | ($'\\nreal\\t\0453lR\\nuser\\t\0453)o(lU\\n)o(sys\\)o(t\0453)o(lS')630 | |
7242 | 3975 y Ft(If)37 b(the)g(v)-5 b(alue)37 b(is)f(n)m(ull,)h(no)h(timing)d | |
7243 | (information)h(is)g(displa)m(y)m(ed.)60 b(A)37 b(trailing)f(newline)f | |
7244 | (is)630 4085 y(added)30 b(when)f(the)i(format)f(string)g(is)f(displa)m | |
7245 | (y)m(ed.)150 4244 y Fs(TMOUT)240 b Ft(If)22 b(set)h(to)g(a)g(v)-5 | |
7246 | b(alue)22 b(greater)i(than)e(zero,)j Fs(TMOUT)d Ft(is)f(treated)j(as)e | |
7247 | (the)h(default)f(timeout)g(for)h(the)630 4354 y Fs(read)31 | |
7248 | b Ft(builtin)e(\(see)k(Section)e(4.2)j([Bash)e(Builtins],)e(page)j | |
7249 | (39\).)47 b(The)32 b Fs(select)e Ft(command)630 4463 | |
7250 | y(\(see)f(Section)g(3.2.4.2)h([Conditional)d(Constructs],)h(page)i | |
7251 | (10\))f(terminates)f(if)g(input)e(do)s(es)630 4573 y(not)31 | |
7252 | b(arriv)m(e)f(after)h Fs(TMOUT)e Ft(seconds)h(when)f(input)g(is)g | |
7253 | (coming)h(from)g(a)h(terminal.)630 4707 y(In)d(an)h(in)m(terativ)m(e)g | |
7254 | (shell,)e(the)i(v)-5 b(alue)29 b(is)e(in)m(terpreted)h(as)h(the)g(n)m | |
7255 | (um)m(b)s(er)f(of)h(seconds)f(to)i(w)m(ait)630 4817 y(for)i(input)e | |
7256 | (after)j(issuing)d(the)i(primary)f(prompt)g(when)g(the)i(shell)d(is)i | |
7257 | (in)m(teractiv)m(e.)47 b(Bash)630 4927 y(terminates)30 | |
7258 | b(after)h(that)g(n)m(um)m(b)s(er)e(of)i(seconds)f(if)f(input)g(do)s(es) | |
7259 | h(not)g(arriv)m(e.)150 5086 y Fs(UID)336 b Ft(The)30 | |
7260 | b(n)m(umeric)f(real)h(user)g(id)f(of)h(the)h(curren)m(t)f(user.)40 | |
7261 | b(This)29 b(v)-5 b(ariable)29 b(is)g(readonly)-8 b(.)p | |
7262 | eop | |
7263 | %%Page: 63 69 | |
7264 | 63 68 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
7265 | b(F)-8 b(eatures)2484 b(63)150 299 y Fo(6)80 b(Bash)54 | |
7266 | b(F)-13 b(eatures)275 537 y Ft(This)28 b(section)j(describ)s(es)d | |
7267 | (features)j(unique)d(to)k(Bash.)150 798 y Fr(6.1)68 b(In)l(v)l(oking)46 | |
7268 | b(Bash)390 1017 y Fs(bash)h([long-opt])e([-ir])h | |
7269 | ([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)11 b Fs(])45 | |
7270 | b([-O)i Fj(shopt_option)11 b Fs(])44 b([)p Fj(ar-)390 | |
7271 | 1127 y(gument)57 b Fs(...)o(])390 1236 y(bash)47 b([long-opt])e | |
7272 | ([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)11 b Fs(])46 | |
7273 | b([-O)g Fj(shopt_option)11 b Fs(])44 b(-c)j Fj(string)57 | |
7274 | b Fs([)p Fj(ar-)390 1346 y(gument)g Fs(...)o(])390 1455 | |
7275 | y(bash)47 b([long-opt])e(-s)i([-abefhkmnptuvxdBCDHP])42 | |
7276 | b([-o)k Fj(option)11 b Fs(])46 b([-O)h Fj(shopt_option)11 | |
7277 | b Fs(])43 b([)p Fj(ar-)390 1565 y(gument)57 b Fs(...)o(])275 | |
7278 | 1701 y Ft(In)28 b(addition)g(to)i(the)f(single-c)m(haracter)h(shell)e | |
7279 | (command-line)g(options)h(\(see)h(Section)f(4.3)i([The)e(Set)150 | |
7280 | 1810 y(Builtin],)24 b(page)h(50\),)i(there)e(are)g(sev)m(eral)g(m)m | |
7281 | (ulti-c)m(haracter)g(options)f(that)h(y)m(ou)g(can)g(use.)38 | |
7282 | b(These)25 b(options)150 1920 y(m)m(ust)30 b(app)s(ear)g(on)g(the)h | |
7283 | (command)f(line)f(b)s(efore)h(the)g(single-c)m(haracter)h(options)f(to) | |
7284 | h(b)s(e)f(recognized.)150 2081 y Fs(--debugger)630 2191 | |
7285 | y Ft(Arrange)j(for)g(the)g(debugger)g(pro\014le)f(to)i(b)s(e)e | |
7286 | (executed)i(b)s(efore)f(the)g(shell)e(starts.)49 b(T)-8 | |
7287 | b(urns)630 2301 y(on)40 b(extended)g(debugging)f(mo)s(de)h(\(see)h | |
7288 | (Section)e(4.2)i([Bash)g(Builtins],)f(page)h(39)g(for)f(a)630 | |
7289 | 2410 y(description)g(of)i(the)f Fs(extdebug)f Ft(option)h(to)h(the)g | |
7290 | Fs(shopt)f Ft(builtin\))d(and)j(shell)f(function)630 | |
7291 | 2520 y(tracing)35 b(\(see)h(Section)f(4.3)i([The)e(Set)g(Builtin],)g | |
7292 | (page)h(50)g(for)f(a)g(description)f(of)h(the)h Fs(-o)630 | |
7293 | 2629 y(functrace)28 b Ft(option\).)150 2790 y Fs(--dump-po-strings)630 | |
7294 | 2900 y Ft(A)37 b(list)e(of)h(all)g(double-quoted)f(strings)g(preceded)h | |
7295 | (b)m(y)h(`)p Fs($)p Ft(')f(is)g(prin)m(ted)f(on)h(the)h(standard)630 | |
7296 | 3009 y(ouput)27 b(in)g(the)h Fl(gnu)g Fs(gettext)d Ft(PO)j(\(p)s | |
7297 | (ortable)f(ob)5 b(ject\))29 b(\014le)e(format.)41 b(Equiv)-5 | |
7298 | b(alen)m(t)26 b(to)j(`)p Fs(-D)p Ft(')630 3119 y(except)i(for)f(the)h | |
7299 | (output)f(format.)150 3280 y Fs(--dump-strings)630 3389 | |
7300 | y Ft(Equiv)-5 b(alen)m(t)29 b(to)i(`)p Fs(-D)p Ft('.)150 | |
7301 | 3550 y Fs(--help)192 b Ft(Displa)m(y)30 b(a)g(usage)h(message)h(on)e | |
7302 | (standard)g(output)g(and)f(exit)i(sucessfully)-8 b(.)150 | |
7303 | 3711 y Fs(--init-file)27 b Fj(filename)150 3820 y Fs(--rcfile)h | |
7304 | Fj(filename)630 3930 y Ft(Execute)42 b(commands)f(from)f | |
7305 | Fq(\014lename)46 b Ft(\(instead)41 b(of)g(`)p Fs(~/.bashrc)p | |
7306 | Ft('\))e(in)h(an)h(in)m(teractiv)m(e)630 4039 y(shell.)150 | |
7307 | 4200 y Fs(--login)144 b Ft(Equiv)-5 b(alen)m(t)29 b(to)i(`)p | |
7308 | Fs(-l)p Ft('.)150 4361 y Fs(--noediting)630 4471 y Ft(Do)h(not)e(use)h | |
7309 | (the)g Fl(gnu)f Ft(Readline)g(library)e(\(see)j(Chapter)g(8)g([Command) | |
7310 | f(Line)f(Editing],)630 4580 y(page)i(83\))h(to)f(read)f(command)g | |
7311 | (lines)f(when)g(the)i(shell)d(is)i(in)m(teractiv)m(e.)150 | |
7312 | 4741 y Fs(--noprofile)630 4850 y Ft(Don't)i(load)e(the)h(system-wide)f | |
7313 | (startup)g(\014le)f(`)p Fs(/etc/profile)p Ft(')f(or)j(an)m(y)g(of)g | |
7314 | (the)f(p)s(ersonal)630 4960 y(initialization)24 b(\014les)i(`)p | |
7315 | Fs(~/.bash_profile)p Ft(',)f(`)p Fs(~/.bash_login)p Ft(',)g(or)i(`)p | |
7316 | Fs(~/.profile)p Ft(')e(when)630 5070 y(Bash)31 b(is)e(in)m(v)m(ok)m(ed) | |
7317 | i(as)f(a)h(login)e(shell.)150 5230 y Fs(--norc)192 b | |
7318 | Ft(Don't)31 b(read)g(the)f(`)p Fs(~/.bashrc)p Ft(')f(initialization)e | |
7319 | (\014le)i(in)g(an)i(in)m(teractiv)m(e)g(shell.)39 b(This)29 | |
7320 | b(is)g(on)630 5340 y(b)m(y)h(default)g(if)f(the)i(shell)d(is)i(in)m(v)m | |
7321 | (ok)m(ed)h(as)f Fs(sh)p Ft(.)p eop | |
7322 | %%Page: 64 70 | |
7323 | 64 69 bop 150 -116 a Ft(64)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
7324 | 299 y Fs(--posix)144 b Ft(Change)24 b(the)h(b)s(eha)m(vior)e(of)h(Bash) | |
7325 | h(where)e(the)i(default)e(op)s(eration)h(di\013ers)f(from)g(the)i | |
7326 | Fl(posix)630 408 y Ft(1003.2)31 b(standard)d(to)i(matc)m(h)f(the)g | |
7327 | (standard.)40 b(This)27 b(is)g(in)m(tended)h(to)i(mak)m(e)f(Bash)g(b)s | |
7328 | (eha)m(v)m(e)630 518 y(as)39 b(a)f(strict)g(sup)s(erset)g(of)g(that)h | |
7329 | (standard.)64 b(See)38 b(Section)g(6.11)i([Bash)f(POSIX)e(Mo)s(de],)630 | |
7330 | 628 y(page)31 b(76,)h(for)e(a)g(description)f(of)h(the)h(Bash)g | |
7331 | Fl(posix)e Ft(mo)s(de.)150 787 y Fs(--restricted)630 | |
7332 | 897 y Ft(Mak)m(e)54 b(the)e(shell)e(a)j(restricted)f(shell)e(\(see)j | |
7333 | (Section)f(6.10)i([The)d(Restricted)i(Shell],)630 1006 | |
7334 | y(page)31 b(76\).)150 1166 y Fs(--verbose)630 1275 y | |
7335 | Ft(Equiv)-5 b(alen)m(t)29 b(to)i(`)p Fs(-v)p Ft('.)41 | |
7336 | b(Prin)m(t)29 b(shell)g(input)f(lines)h(as)i(they're)f(read.)150 | |
7337 | 1435 y Fs(--version)630 1544 y Ft(Sho)m(w)e(v)m(ersion)f(information)f | |
7338 | (for)i(this)f(instance)h(of)g(Bash)g(on)g(the)g(standard)f(output)h | |
7339 | (and)630 1654 y(exit)i(successfully)-8 b(.)275 1813 y(There)28 | |
7340 | b(are)i(sev)m(eral)f(single-c)m(haracter)h(options)e(that)i(ma)m(y)g(b) | |
7341 | s(e)e(supplied)e(at)k(in)m(v)m(o)s(cation)f(whic)m(h)f(are)150 | |
7342 | 1923 y(not)j(a)m(v)-5 b(ailable)29 b(with)g(the)i Fs(set)e | |
7343 | Ft(builtin.)150 2082 y Fs(-c)h Fj(string)630 2192 y Ft(Read)23 | |
7344 | b(and)f(execute)i(commands)f(from)f Fq(string)30 b Ft(after)23 | |
7345 | b(pro)s(cessing)e(the)i(options,)h(then)f(exit.)630 2301 | |
7346 | y(An)m(y)37 b(remaining)d(argumen)m(ts)j(are)g(assigned)f(to)h(the)g(p) | |
7347 | s(ositional)d(parameters,)39 b(starting)630 2411 y(with)29 | |
7348 | b Fs($0)p Ft(.)150 2570 y Fs(-i)384 b Ft(F)-8 b(orce)22 | |
7349 | b(the)g(shell)d(to)i(run)f(in)m(teractiv)m(ely)-8 b(.)38 | |
7350 | b(In)m(teractiv)m(e)22 b(shells)d(are)j(describ)s(ed)c(in)i(Section)h | |
7351 | (6.3)630 2680 y([In)m(teractiv)m(e)32 b(Shells],)d(page)i(67.)150 | |
7352 | 2839 y Fs(-l)384 b Ft(Mak)m(e)33 b(this)d(shell)g(act)i(as)g(if)e(it)h | |
7353 | (had)g(b)s(een)f(directly)g(in)m(v)m(ok)m(ed)i(b)m(y)g(login.)42 | |
7354 | b(When)31 b(the)h(shell)630 2949 y(is)k(in)m(teractiv)m(e,)41 | |
7355 | b(this)36 b(is)g(equiv)-5 b(alen)m(t)37 b(to)h(starting)g(a)f(login)g | |
7356 | (shell)e(with)h(`)p Fs(exec)30 b(-l)g(bash)p Ft('.)630 | |
7357 | 3059 y(When)h(the)g(shell)f(is)g(not)h(in)m(teractiv)m(e,)i(the)e | |
7358 | (login)f(shell)g(startup)h(\014les)f(will)e(b)s(e)j(executed.)630 | |
7359 | 3168 y(`)p Fs(exec)e(bash)h(-l)p Ft(')43 b(or)h(`)p Fs(exec)29 | |
7360 | b(bash)g(--login)p Ft(')42 b(will)f(replace)j(the)g(curren)m(t)f(shell) | |
7361 | f(with)h(a)630 3278 y(Bash)26 b(login)e(shell.)37 b(See)26 | |
7362 | b(Section)f(6.2)i([Bash)e(Startup)g(Files],)h(page)g(65,)i(for)d(a)h | |
7363 | (description)630 3387 y(of)31 b(the)f(sp)s(ecial)f(b)s(eha)m(vior)h(of) | |
7364 | g(a)h(login)e(shell.)150 3547 y Fs(-r)384 b Ft(Mak)m(e)54 | |
7365 | b(the)e(shell)e(a)j(restricted)f(shell)e(\(see)j(Section)f(6.10)i([The) | |
7366 | d(Restricted)i(Shell],)630 3656 y(page)31 b(76\).)150 | |
7367 | 3816 y Fs(-s)384 b Ft(If)24 b(this)g(option)h(is)f(presen)m(t,)i(or)f | |
7368 | (if)f(no)g(argumen)m(ts)i(remain)d(after)j(option)e(pro)s(cessing,)h | |
7369 | (then)630 3925 y(commands)j(are)h(read)g(from)f(the)h(standard)f | |
7370 | (input.)38 b(This)27 b(option)h(allo)m(ws)g(the)h(p)s(ositional)630 | |
7371 | 4035 y(parameters)i(to)g(b)s(e)f(set)g(when)g(in)m(v)m(oking)f(an)i(in) | |
7372 | m(teractiv)m(e)g(shell.)150 4194 y Fs(-D)384 b Ft(A)37 | |
7373 | b(list)e(of)h(all)g(double-quoted)f(strings)g(preceded)h(b)m(y)h(`)p | |
7374 | Fs($)p Ft(')f(is)g(prin)m(ted)f(on)h(the)h(standard)630 | |
7375 | 4304 y(ouput.)71 b(These)40 b(are)h(the)g(strings)f(that)h(are)g(sub)5 | |
7376 | b(ject)41 b(to)g(language)g(translation)f(when)630 4413 | |
7377 | y(the)d(curren)m(t)g(lo)s(cale)f(is)g(not)h Fs(C)g Ft(or)f | |
7378 | Fs(POSIX)g Ft(\(see)h(Section)g(3.1.2.5)i([Lo)s(cale)f(T)-8 | |
7379 | b(ranslation],)630 4523 y(page)31 b(7\).)42 b(This)28 | |
7380 | b(implies)g(the)i(`)p Fs(-n)p Ft(')h(option;)f(no)g(commands)g(will)e | |
7381 | (b)s(e)h(executed.)150 4682 y Fs([-+]O)g([)p Fj(shopt_option)11 | |
7382 | b Fs(])630 4792 y Fq(shopt)p 854 4792 28 4 v 40 w(option)43 | |
7383 | b Ft(is)g(one)i(of)f(the)g(shell)f(options)g(accepted)i(b)m(y)f(the)h | |
7384 | Fs(shopt)d Ft(builtin)f(\(see)630 4902 y(Chapter)29 b(4)i([Shell)d | |
7385 | (Builtin)f(Commands],)j(page)g(33\).)42 b(If)30 b Fq(shopt)p | |
7386 | 2856 4902 V 39 w(option)g Ft(is)f(presen)m(t,)h(`)p Fs(-O)p | |
7387 | Ft(')630 5011 y(sets)39 b(the)f(v)-5 b(alue)38 b(of)g(that)h(option;)j | |
7388 | (`)p Fs(+O)p Ft(')c(unsets)g(it.)64 b(If)38 b Fq(shopt)p | |
7389 | 2803 5011 V 39 w(option)g Ft(is)f(not)i(supplied,)630 | |
7390 | 5121 y(the)28 b(names)f(and)h(v)-5 b(alues)27 b(of)g(the)h(shell)e | |
7391 | (options)h(accepted)i(b)m(y)f Fs(shopt)e Ft(are)i(prin)m(ted)e(on)i | |
7392 | (the)630 5230 y(standard)33 b(output.)50 b(If)33 b(the)h(in)m(v)m(o)s | |
7393 | (cation)g(option)f(is)g(`)p Fs(+O)p Ft(',)h(the)g(output)f(is)g(displa) | |
7394 | m(y)m(ed)f(in)h(a)630 5340 y(format)e(that)g(ma)m(y)g(b)s(e)e(reused)h | |
7395 | (as)h(input.)p eop | |
7396 | %%Page: 65 71 | |
7397 | 65 70 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
7398 | b(F)-8 b(eatures)2484 b(65)150 299 y Fs(--)384 b Ft(A)38 | |
7399 | b Fs(--)g Ft(signals)e(the)j(end)e(of)i(options)e(and)h(disables)e | |
7400 | (further)h(option)g(pro)s(cessing.)63 b(An)m(y)630 408 | |
7401 | y(argumen)m(ts)31 b(after)g(the)f Fs(--)g Ft(are)h(treated)g(as)g | |
7402 | (\014lenames)e(and)h(argumen)m(ts.)275 575 y(A)d Fm(lo)-5 | |
7403 | b(gin)35 b Ft(shell)25 b(is)h(one)i(whose)f(\014rst)f(c)m(haracter)j | |
7404 | (of)e(argumen)m(t)h(zero)f(is)g(`)p Fs(-)p Ft(',)h(or)f(one)g(in)m(v)m | |
7405 | (ok)m(ed)h(with)e(the)150 685 y(`)p Fs(--login)p Ft(')j(option.)275 | |
7406 | 825 y(An)24 b Fm(inter)-5 b(active)33 b Ft(shell)23 b(is)h(one)h | |
7407 | (started)g(without)f(non-option)h(argumen)m(ts,)h(unless)e(`)p | |
7408 | Fs(-s)p Ft(')g(is)g(sp)s(eci\014ed,)150 934 y(without)42 | |
7409 | b(sp)s(ecifying)e(the)k(`)p Fs(-c)p Ft(')e(option,)k(and)c(whose)h | |
7410 | (input)e(and)h(output)g(are)h(b)s(oth)g(connected)g(to)150 | |
7411 | 1044 y(terminals)20 b(\(as)j(determined)e(b)m(y)h Fs(isatty\(3\))p | |
7412 | Ft(\),)f(or)i(one)f(started)g(with)f(the)h(`)p Fs(-i)p | |
7413 | Ft(')g(option.)38 b(See)22 b(Section)g(6.3)150 1153 y([In)m(teractiv)m | |
7414 | (e)32 b(Shells],)d(page)i(67,)g(for)f(more)h(information.)275 | |
7415 | 1293 y(If)38 b(argumen)m(ts)h(remain)f(after)h(option)g(pro)s(cessing,) | |
7416 | h(and)e(neither)g(the)h(`)p Fs(-c)p Ft(')f(nor)h(the)g(`)p | |
7417 | Fs(-s)p Ft(')f(option)150 1403 y(has)33 b(b)s(een)g(supplied,)f(the)i | |
7418 | (\014rst)e(argumen)m(t)j(is)d(assumed)h(to)h(b)s(e)f(the)h(name)g(of)g | |
7419 | (a)g(\014le)f(con)m(taining)g(shell)150 1512 y(commands)d(\(see)g | |
7420 | (Section)g(3.8)h([Shell)d(Scripts],)h(page)i(31\).)41 | |
7421 | b(When)30 b(Bash)g(is)f(in)m(v)m(ok)m(ed)i(in)d(this)h(fashion,)150 | |
7422 | 1622 y Fs($0)37 b Ft(is)f(set)i(to)h(the)e(name)h(of)f(the)h(\014le,)h | |
7423 | (and)d(the)i(p)s(ositional)d(parameters)j(are)g(set)g(to)g(the)g | |
7424 | (remaining)150 1731 y(argumen)m(ts.)h(Bash)26 b(reads)f(and)g(executes) | |
7425 | h(commands)f(from)g(this)f(\014le,)i(then)f(exits.)39 | |
7426 | b(Bash's)25 b(exit)h(status)150 1841 y(is)f(the)i(exit)g(status)f(of)h | |
7427 | (the)g(last)f(command)g(executed)h(in)f(the)g(script.)39 | |
7428 | b(If)26 b(no)g(commands)g(are)h(executed,)150 1951 y(the)k(exit)f | |
7429 | (status)h(is)e(0.)150 2221 y Fr(6.2)68 b(Bash)45 b(Startup)g(Files)275 | |
7430 | 2470 y Ft(This)35 b(section)j(describs)e(ho)m(w)h(Bash)h(executes)h | |
7431 | (its)e(startup)g(\014les.)61 b(If)37 b(an)m(y)h(of)g(the)g(\014les)e | |
7432 | (exist)i(but)150 2579 y(cannot)26 b(b)s(e)e(read,)i(Bash)f(rep)s(orts)g | |
7433 | (an)g(error.)38 b(Tildes)23 b(are)j(expanded)e(in)f(\014le)i(names)g | |
7434 | (as)g(describ)s(ed)e(ab)s(o)m(v)m(e)150 2689 y(under)29 | |
7435 | b(Tilde)f(Expansion)h(\(see)i(Section)f(3.5.2)j([Tilde)28 | |
7436 | b(Expansion],)h(page)j(18\).)275 2828 y(In)m(teractiv)m(e)f(shells)e | |
7437 | (are)i(describ)s(ed)d(in)h(Section)h(6.3)i([In)m(teractiv)m(e)g | |
7438 | (Shells],)c(page)j(67.)150 3063 y Fk(In)m(v)m(ok)m(ed)40 | |
7439 | b(as)h(an)f(in)m(teractiv)m(e)f(login)j(shell,)g(or)g(with)e(`)p | |
7440 | Fi(--login)p Fk(')275 3312 y Ft(When)e(Bash)g(is)g(in)m(v)m(ok)m(ed)h | |
7441 | (as)f(an)g(in)m(teractiv)m(e)i(login)d(shell,)i(or)f(as)h(a)g(non-in)m | |
7442 | (teractiv)m(e)g(shell)d(with)150 3422 y(the)f(`)p Fs(--login)p | |
7443 | Ft(')d(option,)k(it)d(\014rst)h(reads)g(and)g(executes)i(commands)e | |
7444 | (from)f(the)i(\014le)f(`)p Fs(/etc/profile)p Ft(',)150 | |
7445 | 3531 y(if)27 b(that)i(\014le)e(exists.)40 b(After)28 | |
7446 | b(reading)g(that)g(\014le,)g(it)g(lo)s(oks)g(for)g(`)p | |
7447 | Fs(~/.bash_profile)p Ft(',)d(`)p Fs(~/.bash_login)p Ft(',)150 | |
7448 | 3641 y(and)j(`)p Fs(~/.profile)p Ft(',)f(in)h(that)h(order,)g(and)f | |
7449 | (reads)g(and)h(executes)h(commands)e(from)g(the)h(\014rst)f(one)h(that) | |
7450 | 150 3750 y(exists)h(and)f(is)g(readable.)40 b(The)30 | |
7451 | b(`)p Fs(--noprofile)p Ft(')d(option)j(ma)m(y)g(b)s(e)g(used)f(when)g | |
7452 | (the)h(shell)f(is)g(started)h(to)150 3860 y(inhibit)d(this)i(b)s(eha)m | |
7453 | (vior.)275 3999 y(When)72 b(a)i(login)e(shell)f(exits,)84 | |
7454 | b(Bash)73 b(reads)g(and)g(executes)h(commands)f(from)g(the)g(\014le)150 | |
7455 | 4109 y(`)p Fs(~/.bash_logout)p Ft(',)27 b(if)j(it)f(exists.)150 | |
7456 | 4343 y Fk(In)m(v)m(ok)m(ed)40 b(as)h(an)f(in)m(teractiv)m(e)f | |
7457 | (non-login)k(shell)275 4592 y Ft(When)35 b(an)g(in)m(teractiv)m(e)h | |
7458 | (shell)e(that)h(is)g(not)g(a)h(login)e(shell)g(is)g(started,)j(Bash)f | |
7459 | (reads)f(and)g(executes)150 4702 y(commands)24 b(from)f(`)p | |
7460 | Fs(~/.bashrc)p Ft(',)h(if)f(that)h(\014le)f(exists.)39 | |
7461 | b(This)22 b(ma)m(y)j(b)s(e)e(inhibited)d(b)m(y)k(using)f(the)h(`)p | |
7462 | Fs(--norc)p Ft(')150 4812 y(option.)51 b(The)33 b(`)p | |
7463 | Fs(--rcfile)28 b Fj(file)11 b Ft(')33 b(option)g(will)e(force)k(Bash)f | |
7464 | (to)h(read)e(and)h(execute)h(commands)e(from)150 4921 | |
7465 | y Fq(\014le)i Ft(instead)29 b(of)i(`)p Fs(~/.bashrc)p | |
7466 | Ft('.)275 5061 y(So,)f(t)m(ypically)-8 b(,)30 b(y)m(our)g(`)p | |
7467 | Fs(~/.bash_profile)p Ft(')d(con)m(tains)k(the)f(line)390 | |
7468 | 5200 y Fs(if)47 b([)h(-f)f(~/.bashrc)e(];)i(then)g(.)g(~/.bashrc;)e(fi) | |
7469 | 150 5340 y Ft(after)31 b(\(or)g(b)s(efore\))f(an)m(y)h(login-sp)s | |
7470 | (eci\014c)d(initializations.)p eop | |
7471 | %%Page: 66 72 | |
7472 | 66 71 bop 150 -116 a Ft(66)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
7473 | 299 y Fk(In)m(v)m(ok)m(ed)40 b(non-in)m(teractiv)m(ely)275 | |
7474 | 571 y Ft(When)24 b(Bash)h(is)f(started)h(non-in)m(teractiv)m(ely)-8 | |
7475 | b(,)26 b(to)g(run)d(a)i(shell)e(script,)i(for)g(example,)h(it)e(lo)s | |
7476 | (oks)g(for)h(the)150 680 y(v)-5 b(ariable)33 b Fs(BASH_ENV)f | |
7477 | Ft(in)h(the)i(en)m(vironmen)m(t,)g(expands)f(its)f(v)-5 | |
7478 | b(alue)34 b(if)g(it)g(app)s(ears)f(there,)j(and)e(uses)g(the)150 | |
7479 | 790 y(expanded)c(v)-5 b(alue)29 b(as)i(the)g(name)f(of)h(a)f(\014le)g | |
7480 | (to)h(read)f(and)g(execute.)42 b(Bash)31 b(b)s(eha)m(v)m(es)g(as)g(if)e | |
7481 | (the)h(follo)m(wing)150 900 y(command)g(w)m(ere)h(executed:)390 | |
7482 | 1062 y Fs(if)47 b([)h(-n)f("$BASH_ENV")e(];)i(then)f(.)i("$BASH_ENV";)c | |
7483 | (fi)150 1224 y Ft(but)30 b(the)g(v)-5 b(alue)30 b(of)h(the)f | |
7484 | Fs(PATH)f Ft(v)-5 b(ariable)30 b(is)f(not)i(used)e(to)i(searc)m(h)g | |
7485 | (for)f(the)h(\014le)e(name.)275 1387 y(As)38 b(noted)h(ab)s(o)m(v)m(e,) | |
7486 | j(if)37 b(a)i(non-in)m(teractiv)m(e)g(shell)e(is)h(in)m(v)m(ok)m(ed)h | |
7487 | (with)e(the)h(`)p Fs(--login)p Ft(')g(option,)i(Bash)150 | |
7488 | 1496 y(attempts)31 b(to)g(read)g(and)e(execute)j(commands)e(from)g(the) | |
7489 | h(login)e(shell)g(startup)g(\014les.)150 1776 y Fk(In)m(v)m(ok)m(ed)40 | |
7490 | b(with)g(name)g Fi(sh)275 2048 y Ft(If)29 b(Bash)g(is)g(in)m(v)m(ok)m | |
7491 | (ed)h(with)e(the)i(name)f Fs(sh)p Ft(,)g(it)h(tries)e(to)j(mimic)d(the) | |
7492 | h(startup)g(b)s(eha)m(vior)g(of)h(historical)150 2158 | |
7493 | y(v)m(ersions)g(of)g Fs(sh)g Ft(as)h(closely)f(as)g(p)s(ossible,)e | |
7494 | (while)h(conforming)g(to)i(the)g Fl(posix)e Ft(standard)h(as)h(w)m | |
7495 | (ell.)275 2320 y(When)50 b(in)m(v)m(ok)m(ed)i(as)g(an)f(in)m(teractiv)m | |
7496 | (e)h(login)e(shell,)55 b(or)c(as)g(a)h(non-in)m(teractiv)m(e)f(shell)f | |
7497 | (with)g(the)150 2430 y(`)p Fs(--login)p Ft(')39 b(option,)j(it)e | |
7498 | (\014rst)f(attempts)i(to)g(read)f(and)g(execute)h(commands)f(from)g(`)p | |
7499 | Fs(/etc/profile)p Ft(')150 2539 y(and)d(`)p Fs(~/.profile)p | |
7500 | Ft(',)g(in)f(that)i(order.)62 b(The)37 b(`)p Fs(--noprofile)p | |
7501 | Ft(')e(option)i(ma)m(y)h(b)s(e)f(used)g(to)h(inhibit)c(this)150 | |
7502 | 2649 y(b)s(eha)m(vior.)81 b(When)44 b(in)m(v)m(ok)m(ed)g(as)h(an)f(in)m | |
7503 | (teractiv)m(e)h(shell)d(with)h(the)h(name)g Fs(sh)p Ft(,)j(Bash)d(lo)s | |
7504 | (oks)g(for)g(the)150 2759 y(v)-5 b(ariable)35 b Fs(ENV)p | |
7505 | Ft(,)i(expands)e(its)h(v)-5 b(alue)35 b(if)g(it)h(is)f(de\014ned,)i | |
7506 | (and)e(uses)h(the)g(expanded)g(v)-5 b(alue)35 b(as)i(the)f(name)150 | |
7507 | 2868 y(of)i(a)h(\014le)f(to)h(read)f(and)g(execute.)66 | |
7508 | b(Since)37 b(a)i(shell)d(in)m(v)m(ok)m(ed)j(as)g Fs(sh)e | |
7509 | Ft(do)s(es)h(not)h(attempt)g(to)g(read)g(and)150 2978 | |
7510 | y(execute)i(commands)e(from)g(an)m(y)h(other)g(startup)f(\014les,)i | |
7511 | (the)f(`)p Fs(--rcfile)p Ft(')d(option)i(has)h(no)f(e\013ect.)70 | |
7512 | b(A)150 3087 y(non-in)m(teractiv)m(e)30 b(shell)d(in)m(v)m(ok)m(ed)i | |
7513 | (with)f(the)h(name)g Fs(sh)f Ft(do)s(es)g(not)i(attempt)g(to)f(read)g | |
7514 | (an)m(y)g(other)g(startup)150 3197 y(\014les.)275 3359 | |
7515 | y(When)h(in)m(v)m(ok)m(ed)g(as)h Fs(sh)p Ft(,)f(Bash)h(en)m(ters)g | |
7516 | Fl(posix)e Ft(mo)s(de)h(after)h(the)g(startup)f(\014les)f(are)i(read.) | |
7517 | 150 3639 y Fk(In)m(v)m(ok)m(ed)40 b(in)h Fh(posix)f Fk(mo)s(de)275 | |
7518 | 3911 y Ft(When)d(Bash)g(is)f(started)i(in)e Fl(posix)g | |
7519 | Ft(mo)s(de,)j(as)e(with)f(the)i(`)p Fs(--posix)p Ft(')d(command)i(line) | |
7520 | f(option,)i(it)150 4021 y(follo)m(ws)26 b(the)i Fl(posix)e | |
7521 | Ft(standard)h(for)g(startup)g(\014les.)38 b(In)27 b(this)f(mo)s(de,)h | |
7522 | (in)m(teractiv)m(e)i(shells)c(expand)h(the)i Fs(ENV)150 | |
7523 | 4131 y Ft(v)-5 b(ariable)34 b(and)h(commands)g(are)h(read)g(and)f | |
7524 | (executed)h(from)f(the)h(\014le)f(whose)g(name)g(is)g(the)h(expanded) | |
7525 | 150 4240 y(v)-5 b(alue.)40 b(No)31 b(other)g(startup)f(\014les)f(are)i | |
7526 | (read.)150 4520 y Fk(In)m(v)m(ok)m(ed)40 b(b)m(y)g(remote)g(shell)i | |
7527 | (daemon)275 4792 y Ft(Bash)34 b(attempts)i(to)f(determine)f(when)f(it)h | |
7528 | (is)g(b)s(eing)f(run)g(b)m(y)h(the)h(remote)h(shell)c(daemon,)k | |
7529 | (usually)150 4902 y Fs(rshd)p Ft(.)60 b(If)36 b(Bash)h(determines)f(it) | |
7530 | h(is)f(b)s(eing)g(run)f(b)m(y)i(rshd,)h(it)e(reads)h(and)f(executes)j | |
7531 | (commands)d(from)150 5011 y(`)p Fs(~/.bashrc)p Ft(',)h(if)f(that)h | |
7532 | (\014le)f(exists)h(and)f(is)g(readable.)61 b(It)37 b(will)d(not)j(do)g | |
7533 | (this)f(if)g(in)m(v)m(ok)m(ed)h(as)h Fs(sh)p Ft(.)59 | |
7534 | b(The)150 5121 y(`)p Fs(--norc)p Ft(')34 b(option)h(ma)m(y)i(b)s(e)e | |
7535 | (used)f(to)j(inhibit)32 b(this)i(b)s(eha)m(vior,)j(and)e(the)g(`)p | |
7536 | Fs(--rcfile)p Ft(')f(option)h(ma)m(y)i(b)s(e)150 5230 | |
7537 | y(used)25 b(to)h(force)g(another)g(\014le)e(to)j(b)s(e)e(read,)h(but)f | |
7538 | Fs(rshd)g Ft(do)s(es)g(not)g(generally)g(in)m(v)m(ok)m(e)i(the)e(shell) | |
7539 | f(with)g(those)150 5340 y(options)30 b(or)g(allo)m(w)g(them)g(to)h(b)s | |
7540 | (e)f(sp)s(eci\014ed.)p eop | |
7541 | %%Page: 67 73 | |
7542 | 67 72 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
7543 | b(F)-8 b(eatures)2484 b(67)150 299 y Fk(In)m(v)m(ok)m(ed)40 | |
7544 | b(with)g(unequal)h(e\013ectiv)m(e)e(and)i(real)g Fh(uid/gid)p | |
7545 | Fk(s)275 538 y Ft(If)26 b(Bash)i(is)e(started)i(with)e(the)h | |
7546 | (e\013ectiv)m(e)i(user)e(\(group\))g(id)f(not)i(equal)f(to)h(the)f | |
7547 | (real)g(user)g(\(group\))g(id,)150 648 y(and)f(the)i | |
7548 | Fs(-p)e Ft(option)g(is)g(not)i(supplied,)c(no)j(startup)g(\014les)f | |
7549 | (are)h(read,)h(shell)d(functions)h(are)h(not)g(inherited)150 | |
7550 | 757 y(from)g(the)h(en)m(vironmen)m(t,)g(the)g Fs(SHELLOPTS)d | |
7551 | Ft(v)-5 b(ariable,)27 b(if)g(it)g(app)s(ears)g(in)f(the)i(en)m | |
7552 | (vironmen)m(t,)g(is)f(ignored,)150 867 y(and)g(the)h(e\013ectiv)m(e)i | |
7553 | (user)d(id)f(is)h(set)h(to)h(the)f(real)f(user)g(id.)39 | |
7554 | b(If)27 b(the)h Fs(-p)g Ft(option)f(is)g(supplied)d(at)29 | |
7555 | b(in)m(v)m(o)s(cation,)150 977 y(the)i(startup)f(b)s(eha)m(vior)f(is)g | |
7556 | (the)i(same,)g(but)f(the)g(e\013ectiv)m(e)i(user)e(id)f(is)g(not)i | |
7557 | (reset.)150 1220 y Fr(6.3)68 b(In)l(teractiv)l(e)47 b(Shells)150 | |
7558 | 1540 y Fk(6.3.1)63 b(What)40 b(is)h(an)g(In)m(teractiv)m(e)e(Shell?)275 | |
7559 | 1779 y Ft(An)25 b(in)m(teractiv)m(e)h(shell)d(is)i(one)g(started)h | |
7560 | (without)f(non-option)f(argumen)m(ts,)j(unless)d(`)p | |
7561 | Fs(-s)p Ft(')h(is)f(sp)s(eci\014ed,)150 1889 y(without)40 | |
7562 | b(sp)s(eci\014ying)f(the)i(`)p Fs(-c)p Ft(')g(option,)j(and)c(whose)h | |
7563 | (input)e(and)i(output)f(are)i(b)s(oth)e(connected)i(to)150 | |
7564 | 1998 y(terminals)29 b(\(as)i(determined)e(b)m(y)h Fs(isatty\(3\))p | |
7565 | Ft(\),)e(or)j(one)f(started)h(with)e(the)i(`)p Fs(-i)p | |
7566 | Ft(')f(option.)275 2128 y(An)g(in)m(teractiv)m(e)h(shell)d(generally)i | |
7567 | (reads)g(from)g(and)g(writes)f(to)i(a)g(user's)f(terminal.)275 | |
7568 | 2258 y(The)e(`)p Fs(-s)p Ft(')i(in)m(v)m(o)s(cation)f(option)g(ma)m(y)h | |
7569 | (b)s(e)f(used)f(to)i(set)g(the)g(p)s(ositional)d(parameters)i(when)g | |
7570 | (an)g(in)m(ter-)150 2367 y(activ)m(e)j(shell)c(is)i(started.)150 | |
7571 | 2577 y Fk(6.3.2)63 b(Is)41 b(this)g(Shell)g(In)m(teractiv)m(e?)275 | |
7572 | 2817 y Ft(T)-8 b(o)32 b(determine)f(within)f(a)i(startup)g(script)f | |
7573 | (whether)h(or)g(not)g(Bash)g(is)f(running)f(in)m(teractiv)m(ely)-8 | |
7574 | b(,)33 b(test)150 2926 y(the)42 b(v)-5 b(alue)41 b(of)g(the)h(`)p | |
7575 | Fs(-)p Ft(')g(sp)s(ecial)e(parameter.)75 b(It)41 b(con)m(tains)h | |
7576 | Fs(i)f Ft(when)g(the)h(shell)d(is)i(in)m(teractiv)m(e.)75 | |
7577 | b(F)-8 b(or)150 3036 y(example:)390 3166 y Fs(case)47 | |
7578 | b("$-")f(in)390 3275 y(*i*\))h(echo)f(This)h(shell)f(is)h(interactive)e | |
7579 | (;;)390 3385 y(*\))i(echo)g(This)f(shell)h(is)g(not)g(interactive)e(;;) | |
7580 | 390 3495 y(esac)275 3624 y Ft(Alternativ)m(ely)-8 b(,)25 | |
7581 | b(startup)e(scripts)g(ma)m(y)h(examine)f(the)h(v)-5 b(ariable)23 | |
7582 | b Fs(PS1)p Ft(;)i(it)f(is)e(unset)i(in)e(non-in)m(teractiv)m(e)150 | |
7583 | 3734 y(shells,)29 b(and)g(set)i(in)e(in)m(teractiv)m(e)j(shells.)38 | |
7584 | b(Th)m(us:)390 3864 y Fs(if)47 b([)h(-z)f("$PS1")f(];)h(then)772 | |
7585 | 3973 y(echo)f(This)h(shell)f(is)i(not)f(interactive)390 | |
7586 | 4083 y(else)772 4193 y(echo)f(This)h(shell)f(is)i(interactive)390 | |
7587 | 4302 y(fi)150 4512 y Fk(6.3.3)63 b(In)m(teractiv)m(e)38 | |
7588 | b(Shell)k(Beha)m(vior)275 4752 y Ft(When)30 b(the)g(shell)f(is)g | |
7589 | (running)f(in)m(teractiv)m(ely)-8 b(,)31 b(it)f(c)m(hanges)h(its)f(b)s | |
7590 | (eha)m(vior)g(in)f(sev)m(eral)h(w)m(a)m(ys.)199 4881 | |
7591 | y(1.)61 b(Startup)37 b(\014les)f(are)i(read)f(and)g(executed)h(as)f | |
7592 | (describ)s(ed)f(in)g(Section)h(6.2)h([Bash)g(Startup)e(Files],)330 | |
7593 | 4991 y(page)31 b(65.)199 5121 y(2.)61 b(Job)35 b(Con)m(trol)f(\(see)i | |
7594 | (Chapter)f(7)g([Job)g(Con)m(trol],)h(page)g(79\))g(is)e(enabled)g(b)m | |
7595 | (y)h(default.)54 b(When)34 b(job)330 5230 y(con)m(trol)g(is)f(in)f | |
7596 | (e\013ect,)37 b(Bash)d(ignores)f(the)h(k)m(eyb)s(oard-generated)h(job)e | |
7597 | (con)m(trol)h(signals)f Fs(SIGTTIN)p Ft(,)330 5340 y | |
7598 | Fs(SIGTTOU)p Ft(,)c(and)g Fs(SIGTSTP)p Ft(.)p eop | |
7599 | %%Page: 68 74 | |
7600 | 68 73 bop 150 -116 a Ft(68)2572 b(Bash)31 b(Reference)g(Man)m(ual)199 | |
7601 | 299 y(3.)61 b(Bash)39 b(expands)f(and)g(displa)m(ys)f | |
7602 | Fs(PS1)h Ft(b)s(efore)h(reading)f(the)h(\014rst)f(line)f(of)i(a)g | |
7603 | (command,)i(and)d(ex-)330 408 y(pands)30 b(and)g(displa)m(ys)f | |
7604 | Fs(PS2)g Ft(b)s(efore)i(reading)f(the)h(second)f(and)h(subsequen)m(t)f | |
7605 | (lines)f(of)i(a)g(m)m(ulti-line)330 518 y(command.)199 | |
7606 | 669 y(4.)61 b(Bash)26 b(executes)i(the)e(v)-5 b(alue)26 | |
7607 | b(of)g(the)h Fs(PROMPT_COMMAND)22 b Ft(v)-5 b(ariable)25 | |
7608 | b(as)i(a)f(command)g(b)s(efore)g(prin)m(ting)330 779 | |
7609 | y(the)31 b(primary)d(prompt,)i Fs($PS1)f Ft(\(see)i(Section)f(5.2)i | |
7610 | ([Bash)f(V)-8 b(ariables],)30 b(page)h(55\).)199 930 | |
7611 | y(5.)61 b(Readline)28 b(\(see)j(Chapter)e(8)h([Command)e(Line)h | |
7612 | (Editing],)f(page)i(83\))h(is)e(used)g(to)h(read)f(commands)330 | |
7613 | 1039 y(from)h(the)g(user's)g(terminal.)199 1190 y(6.)61 | |
7614 | b(Bash)36 b(insp)s(ects)f(the)i(v)-5 b(alue)36 b(of)g(the)g | |
7615 | Fs(ignoreeof)e Ft(option)i(to)h Fs(set)29 b(-o)36 b Ft(instead)g(of)g | |
7616 | (exiting)g(imme-)330 1300 y(diately)f(when)g(it)h(receiv)m(es)h(an)f | |
7617 | Fs(EOF)f Ft(on)h(its)f(standard)g(input)f(when)i(reading)f(a)h(command) | |
7618 | g(\(see)330 1409 y(Section)30 b(4.3)i([The)e(Set)g(Builtin],)f(page)i | |
7619 | (50\).)199 1560 y(7.)61 b(Command)43 b(history)g(\(see)i(Section)f(9.1) | |
7620 | h([Bash)f(History)g(F)-8 b(acilities],)47 b(page)e(109\))h(and)d | |
7621 | (history)330 1670 y(expansion)22 b(\(see)j(Section)e(9.3)i([History)e | |
7622 | (In)m(teraction],)j(page)e(111\))h(are)f(enabled)f(b)m(y)g(default.)38 | |
7623 | b(Bash)330 1779 y(will)20 b(sa)m(v)m(e)25 b(the)e(command)f(history)g | |
7624 | (to)i(the)f(\014le)f(named)g(b)m(y)h Fs($HISTFILE)d Ft(when)i(an)h(in)m | |
7625 | (teractiv)m(e)h(shell)330 1889 y(exits.)199 2040 y(8.)61 | |
7626 | b(Alias)29 b(expansion)h(\(see)h(Section)f(6.6)h([Aliases],)g(page)g | |
7627 | (71\))h(is)d(p)s(erformed)g(b)m(y)h(default.)199 2191 | |
7628 | y(9.)61 b(In)24 b(the)g(absence)h(of)f(an)m(y)h(traps,)g(Bash)g | |
7629 | (ignores)e Fs(SIGTERM)g Ft(\(see)i(Section)f(3.7.6)i([Signals],)e(page) | |
7630 | h(31\).)154 2342 y(10.)61 b(In)26 b(the)h(absence)h(of)f(an)m(y)g | |
7631 | (traps,)g Fs(SIGINT)e Ft(is)h(caugh)m(t)i(and)f(handled)d(\(\(see)29 | |
7632 | b(Section)d(3.7.6)j([Signals],)330 2451 y(page)i(31\).)42 | |
7633 | b Fs(SIGINT)29 b Ft(will)e(in)m(terrupt)i(some)i(shell)e(builtins.)154 | |
7634 | 2602 y(11.)61 b(An)40 b(in)m(teractiv)m(e)h(login)e(shell)g(sends)g(a)i | |
7635 | Fs(SIGHUP)d Ft(to)j(all)e(jobs)h(on)g(exit)g(if)g(the)g | |
7636 | Fs(hupoxexit)e Ft(shell)330 2712 y(option)30 b(has)g(b)s(een)g(enabled) | |
7637 | f(\(see)i(Section)f(3.7.6)j([Signals],)c(page)i(31\).)154 | |
7638 | 2863 y(12.)61 b(The)31 b(`)p Fs(-n)p Ft(')g(in)m(v)m(o)s(cation)g | |
7639 | (option)f(is)h(ignored,)f(and)h(`)p Fs(set)f(-n)p Ft(')g(has)h(no)g | |
7640 | (e\013ect)i(\(see)f(Section)f(4.3)h([The)330 2972 y(Set)f(Builtin],)d | |
7641 | (page)j(50\).)154 3123 y(13.)61 b(Bash)32 b(will)d(c)m(hec)m(k)34 | |
7642 | b(for)e(mail)e(p)s(erio)s(dically)-8 b(,)30 b(dep)s(ending)f(on)j(the)g | |
7643 | (v)-5 b(alues)31 b(of)h(the)h Fs(MAIL)p Ft(,)e Fs(MAILPATH)p | |
7644 | Ft(,)330 3233 y(and)f Fs(MAILCHECK)e Ft(shell)g(v)-5 | |
7645 | b(ariables)29 b(\(see)j(Section)e(5.2)h([Bash)g(V)-8 | |
7646 | b(ariables],)30 b(page)h(55\).)154 3384 y(14.)61 b(Expansion)31 | |
7647 | b(errors)i(due)f(to)i(references)f(to)h(un)m(b)s(ound)c(shell)h(v)-5 | |
7648 | b(ariables)32 b(after)i(`)p Fs(set)29 b(-u)p Ft(')k(has)g(b)s(een)330 | |
7649 | 3494 y(enabled)c(will)f(not)j(cause)g(the)f(shell)f(to)i(exit)f(\(see)h | |
7650 | (Section)g(4.3)g([The)f(Set)h(Builtin],)d(page)j(50\).)154 | |
7651 | 3644 y(15.)61 b(The)48 b(shell)f(will)e(not)k(exit)f(on)h(expansion)e | |
7652 | (errors)h(caused)g(b)m(y)h Fq(v)-5 b(ar)54 b Ft(b)s(eing)47 | |
7653 | b(unset)h(or)h(n)m(ull)d(in)330 3754 y Fs(${)p Fj(var)11 | |
7654 | b Fs(:?)p Fj(word)g Fs(})26 b Ft(expansions)j(\(see)i(Section)g(3.5.3)h | |
7655 | ([Shell)c(P)m(arameter)k(Expansion],)d(page)i(18\).)154 | |
7656 | 3905 y(16.)61 b(Redirection)29 b(errors)h(encoun)m(tered)h(b)m(y)f | |
7657 | (shell)f(builtins)e(will)g(not)k(cause)g(the)f(shell)f(to)i(exit.)154 | |
7658 | 4056 y(17.)61 b(When)26 b(running)e(in)i Fl(posix)f Ft(mo)s(de,)j(a)f | |
7659 | (sp)s(ecial)e(builtin)e(returning)i(an)h(error)h(status)g(will)d(not)i | |
7660 | (cause)330 4166 y(the)31 b(shell)d(to)j(exit)g(\(see)g(Section)f(6.11)i | |
7661 | ([Bash)f(POSIX)e(Mo)s(de],)i(page)g(76\).)154 4316 y(18.)61 | |
7662 | b(A)34 b(failed)e Fs(exec)h Ft(will)e(not)j(cause)g(the)g(shell)e(to)i | |
7663 | (exit)g(\(see)g(Section)g(4.1)h([Bourne)f(Shell)d(Builtins],)330 | |
7664 | 4426 y(page)g(33\).)154 4577 y(19.)61 b(P)m(arser)31 | |
7665 | b(syn)m(tax)f(errors)g(will)e(not)j(cause)g(the)f(shell)f(to)i(exit.) | |
7666 | 154 4728 y(20.)61 b(Simple)19 b(sp)s(elling)g(correction)i(for)h | |
7667 | (directory)f(argumen)m(ts)g(to)i(the)e Fs(cd)g Ft(builtin)d(is)j | |
7668 | (enabled)f(b)m(y)i(default)330 4838 y(\(see)38 b(the)e(description)f | |
7669 | (of)i(the)f Fs(cdspell)f Ft(option)h(to)h(the)g Fs(shopt)e | |
7670 | Ft(builtin)e(in)j(Section)g(4.2)i([Bash)330 4947 y(Builtins],)28 | |
7671 | b(page)j(39\).)154 5098 y(21.)61 b(The)42 b(shell)f(will)f(c)m(hec)m(k) | |
7672 | k(the)f(v)-5 b(alue)42 b(of)g(the)h Fs(TMOUT)e Ft(v)-5 | |
7673 | b(ariable)42 b(and)g(exit)g(if)g(a)h(command)f(is)g(not)330 | |
7674 | 5208 y(read)30 b(within)e(the)i(sp)s(eci\014ed)e(n)m(um)m(b)s(er)h(of)i | |
7675 | (seconds)f(after)g(prin)m(ting)e Fs($PS1)h Ft(\(see)i(Section)f(5.2)i | |
7676 | ([Bash)330 5317 y(V)-8 b(ariables],)30 b(page)h(55\).)p | |
7677 | eop | |
7678 | %%Page: 69 75 | |
7679 | 69 74 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
7680 | b(F)-8 b(eatures)2484 b(69)150 299 y Fr(6.4)68 b(Bash)45 | |
7681 | b(Conditional)h(Expressions)275 548 y Ft(Conditional)35 | |
7682 | b(expressions)i(are)i(used)f(b)m(y)g(the)g Fs([[)g Ft(comp)s(ound)f | |
7683 | (command)h(and)g(the)g Fs(test)g Ft(and)f Fs([)150 657 | |
7684 | y Ft(builtin)27 b(commands.)275 796 y(Expressions)k(ma)m(y)i(b)s(e)g | |
7685 | (unary)f(or)h(binary)-8 b(.)47 b(Unary)33 b(expressions)e(are)j(often)f | |
7686 | (used)f(to)i(examine)f(the)150 906 y(status)26 b(of)g(a)h(\014le.)38 | |
7687 | b(There)26 b(are)g(string)f(op)s(erators)h(and)g(n)m(umeric)e | |
7688 | (comparison)i(op)s(erators)g(as)g(w)m(ell.)38 b(If)26 | |
7689 | b(the)150 1016 y Fq(\014le)37 b Ft(argumen)m(t)d(to)f(one)h(of)f(the)g | |
7690 | (primaries)e(is)h(of)h(the)g(form)g(`)p Fs(/dev/fd/)p | |
7691 | Fj(N)11 b Ft(',)31 b(then)i(\014le)f(descriptor)g Fq(N)43 | |
7692 | b Ft(is)150 1125 y(c)m(hec)m(k)m(ed.)e(If)26 b(the)g | |
7693 | Fq(\014le)k Ft(argumen)m(t)c(to)h(one)f(of)g(the)h(primaries)c(is)i | |
7694 | (one)h(of)g(`)p Fs(/dev/stdin)p Ft(',)f(`)p Fs(/dev/stdout)p | |
7695 | Ft(',)150 1235 y(or)30 b(`)p Fs(/dev/stderr)p Ft(',)e(\014le)i | |
7696 | (descriptor)f(0,)i(1,)g(or)g(2,)g(resp)s(ectiv)m(ely)-8 | |
7697 | b(,)30 b(is)f(c)m(hec)m(k)m(ed.)150 1401 y Fs(-a)h Fj(file)162 | |
7698 | b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b Ft(exists.)150 | |
7699 | 1565 y Fs(-b)30 b Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f | |
7700 | Fq(\014le)35 b Ft(exists)30 b(and)g(is)f(a)i(blo)s(c)m(k)f(sp)s(ecial)f | |
7701 | (\014le.)150 1729 y Fs(-c)h Fj(file)162 b Ft(T)-8 b(rue)30 | |
7702 | b(if)f Fq(\014le)35 b Ft(exists)30 b(and)g(is)f(a)i(c)m(haracter)h(sp)s | |
7703 | (ecial)d(\014le.)150 1893 y Fs(-d)h Fj(file)162 b Ft(T)-8 | |
7704 | b(rue)30 b(if)f Fq(\014le)35 b Ft(exists)30 b(and)g(is)f(a)i(directory) | |
7705 | -8 b(.)150 2058 y Fs(-e)30 b Fj(file)162 b Ft(T)-8 b(rue)30 | |
7706 | b(if)f Fq(\014le)35 b Ft(exists.)150 2222 y Fs(-f)30 | |
7707 | b Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 | |
7708 | b Ft(exists)30 b(and)g(is)f(a)i(regular)e(\014le.)150 | |
7709 | 2386 y Fs(-g)h Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f | |
7710 | Fq(\014le)35 b Ft(exists)30 b(and)g(its)f(set-group-id)h(bit)g(is)f | |
7711 | (set.)150 2550 y Fs(-h)h Fj(file)162 b Ft(T)-8 b(rue)30 | |
7712 | b(if)f Fq(\014le)35 b Ft(exists)30 b(and)g(is)f(a)i(sym)m(b)s(olic)e | |
7713 | (link.)150 2714 y Fs(-k)h Fj(file)162 b Ft(T)-8 b(rue)30 | |
7714 | b(if)f Fq(\014le)35 b Ft(exists)30 b(and)g(its)f Fs(")p | |
7715 | Ft(stic)m(ky)p Fs(")h Ft(bit)g(is)f(set.)150 2878 y Fs(-p)h | |
7716 | Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b | |
7717 | Ft(exists)30 b(and)g(is)f(a)i(named)f(pip)s(e)e(\(FIF)m(O\).)150 | |
7718 | 3042 y Fs(-r)i Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f | |
7719 | Fq(\014le)35 b Ft(exists)30 b(and)g(is)f(readable.)150 | |
7720 | 3206 y Fs(-s)h Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f | |
7721 | Fq(\014le)35 b Ft(exists)30 b(and)g(has)g(a)g(size)h(greater)g(than)f | |
7722 | (zero.)150 3370 y Fs(-t)g Fj(fd)258 b Ft(T)-8 b(rue)30 | |
7723 | b(if)f(\014le)h(descriptor)f Fq(fd)k Ft(is)d(op)s(en)f(and)h(refers)g | |
7724 | (to)h(a)g(terminal.)150 3534 y Fs(-u)f Fj(file)162 b | |
7725 | Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b Ft(exists)30 b(and)g(its)f | |
7726 | (set-user-id)h(bit)f(is)h(set.)150 3698 y Fs(-w)g Fj(file)162 | |
7727 | b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b Ft(exists)30 | |
7728 | b(and)g(is)f(writable.)150 3863 y Fs(-x)h Fj(file)162 | |
7729 | b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b Ft(exists)30 | |
7730 | b(and)g(is)f(executable.)150 4027 y Fs(-O)h Fj(file)162 | |
7731 | b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b Ft(exists)30 | |
7732 | b(and)g(is)f(o)m(wned)h(b)m(y)h(the)f(e\013ectiv)m(e)i(user)e(id.)150 | |
7733 | 4191 y Fs(-G)g Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f | |
7734 | Fq(\014le)35 b Ft(exists)30 b(and)g(is)f(o)m(wned)h(b)m(y)h(the)f | |
7735 | (e\013ectiv)m(e)i(group)e(id.)150 4355 y Fs(-L)g Fj(file)162 | |
7736 | b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b Ft(exists)30 | |
7737 | b(and)g(is)f(a)i(sym)m(b)s(olic)e(link.)150 4519 y Fs(-S)h | |
7738 | Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 b | |
7739 | Ft(exists)30 b(and)g(is)f(a)i(so)s(c)m(k)m(et.)150 4683 | |
7740 | y Fs(-N)f Fj(file)162 b Ft(T)-8 b(rue)30 b(if)f Fq(\014le)35 | |
7741 | b Ft(exists)30 b(and)g(has)g(b)s(een)f(mo)s(di\014ed)g(since)g(it)h(w)m | |
7742 | (as)h(last)f(read.)150 4847 y Fj(file1)39 b Fs(-nt)30 | |
7743 | b Fj(file2)630 4957 y Ft(T)-8 b(rue)23 b(if)g Fq(\014le1)31 | |
7744 | b Ft(is)23 b(new)m(er)h(\(according)g(to)h(mo)s(di\014cation)d(date\))j | |
7745 | (than)f Fq(\014le2)p Ft(,)h(or)f(if)f Fq(\014le1)30 b | |
7746 | Ft(exists)630 5066 y(and)g Fq(\014le2)37 b Ft(do)s(es)30 | |
7747 | b(not.)150 5230 y Fj(file1)39 b Fs(-ot)30 b Fj(file2)630 | |
7748 | 5340 y Ft(T)-8 b(rue)30 b(if)f Fq(\014le1)37 b Ft(is)30 | |
7749 | b(older)f(than)h Fq(\014le2)p Ft(,)h(or)f(if)f Fq(\014le2)37 | |
7750 | b Ft(exists)30 b(and)g Fq(\014le1)37 b Ft(do)s(es)30 | |
7751 | b(not.)p eop | |
7752 | %%Page: 70 76 | |
7753 | 70 75 bop 150 -116 a Ft(70)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
7754 | 299 y Fj(file1)39 b Fs(-ef)30 b Fj(file2)630 408 y Ft(T)-8 | |
7755 | b(rue)30 b(if)f Fq(\014le1)37 b Ft(and)30 b Fq(\014le2)37 | |
7756 | b Ft(refer)30 b(to)i(the)e(same)h(device)f(and)g(ino)s(de)f(n)m(um)m(b) | |
7757 | s(ers.)150 570 y Fs(-o)h Fj(optname)630 679 y Ft(T)-8 | |
7758 | b(rue)41 b(if)f(shell)f(option)i Fq(optname)47 b Ft(is)40 | |
7759 | b(enabled.)72 b(The)41 b(list)f(of)h(options)f(app)s(ears)h(in)f(the) | |
7760 | 630 789 y(description)18 b(of)j(the)f(`)p Fs(-o)p Ft(')g(option)g(to)h | |
7761 | (the)g Fs(set)e Ft(builtin)e(\(see)k(Section)f(4.3)h([The)g(Set)f | |
7762 | (Builtin],)630 898 y(page)31 b(50\).)150 1060 y Fs(-z)f | |
7763 | Fj(string)630 1169 y Ft(T)-8 b(rue)30 b(if)f(the)i(length)f(of)g | |
7764 | Fq(string)37 b Ft(is)30 b(zero.)150 1330 y Fs(-n)g Fj(string)150 | |
7765 | 1440 y(string)192 b Ft(T)-8 b(rue)30 b(if)f(the)i(length)f(of)g | |
7766 | Fq(string)37 b Ft(is)30 b(non-zero.)150 1601 y Fj(string1)39 | |
7767 | b Fs(==)30 b Fj(string2)630 1711 y Ft(T)-8 b(rue)33 b(if)g(the)h | |
7768 | (strings)e(are)i(equal.)50 b(`)p Fs(=)p Ft(')34 b(ma)m(y)g(b)s(e)f | |
7769 | (used)g(in)f(place)i(of)f(`)p Fs(==)p Ft(')h(for)f(strict)h | |
7770 | Fl(posix)630 1820 y Ft(compliance.)150 1981 y Fj(string1)39 | |
7771 | b Fs(!=)30 b Fj(string2)630 2091 y Ft(T)-8 b(rue)30 b(if)f(the)i | |
7772 | (strings)e(are)i(not)f(equal.)150 2252 y Fj(string1)39 | |
7773 | b Fs(<)30 b Fj(string2)630 2362 y Ft(T)-8 b(rue)30 b(if)f | |
7774 | Fq(string1)37 b Ft(sorts)31 b(b)s(efore)f Fq(string2)37 | |
7775 | b Ft(lexicographically)28 b(in)h(the)i(curren)m(t)f(lo)s(cale.)150 | |
7776 | 2523 y Fj(string1)39 b Fs(>)30 b Fj(string2)630 2632 | |
7777 | y Ft(T)-8 b(rue)30 b(if)f Fq(string1)37 b Ft(sorts)31 | |
7778 | b(after)g Fq(string2)37 b Ft(lexicographically)28 b(in)h(the)h(curren)m | |
7779 | (t)h(lo)s(cale.)150 2794 y Fj(arg1)40 b Fs(OP)29 b Fj(arg2)630 | |
7780 | 2903 y Fs(OP)k Ft(is)g(one)h(of)h(`)p Fs(-eq)p Ft(',)f(`)p | |
7781 | Fs(-ne)p Ft(',)h(`)p Fs(-lt)p Ft(',)g(`)p Fs(-le)p Ft(',)f(`)p | |
7782 | Fs(-gt)p Ft(',)h(or)f(`)p Fs(-ge)p Ft('.)51 b(These)34 | |
7783 | b(arithmetic)f(binary)630 3013 y(op)s(erators)j(return)e(true)i(if)e | |
7784 | Fq(arg1)44 b Ft(is)35 b(equal)g(to,)j(not)e(equal)f(to,)j(less)d(than,) | |
7785 | i(less)e(than)g(or)630 3122 y(equal)28 b(to,)h(greater)h(than,)e(or)g | |
7786 | (greater)i(than)d(or)i(equal)e(to)i Fq(arg2)p Ft(,)h(resp)s(ectiv)m | |
7787 | (ely)-8 b(.)40 b Fq(Arg1)c Ft(and)630 3232 y Fq(arg2)j | |
7788 | Ft(ma)m(y)30 b(b)s(e)g(p)s(ositiv)m(e)g(or)g(negativ)m(e)i(in)m | |
7789 | (tegers.)150 3494 y Fr(6.5)68 b(Shell)45 b(Arithmetic)275 | |
7790 | 3740 y Ft(The)34 b(shell)e(allo)m(ws)i(arithmetic)g(expressions)g(to)h | |
7791 | (b)s(e)f(ev)-5 b(aluated,)36 b(as)f(one)g(of)g(the)f(shell)f | |
7792 | (expansions)150 3849 y(or)d(b)m(y)h(the)f Fs(let)g Ft(and)f(the)i(`)p | |
7793 | Fs(-i)p Ft(')f(option)g(to)h(the)g Fs(declare)d Ft(builtins.)275 | |
7794 | 3985 y(Ev)-5 b(aluation)25 b(is)h(done)g(in)f(\014xed-width)g(in)m | |
7795 | (tegers)i(with)e(no)i(c)m(hec)m(k)h(for)e(o)m(v)m(er\015o)m(w,)j | |
7796 | (though)d(division)e(b)m(y)150 4095 y(0)j(is)f(trapp)s(ed)g(and)h | |
7797 | (\015agged)g(as)h(an)f(error.)39 b(The)26 b(op)s(erators)h(and)g(their) | |
7798 | f(precedence,)i(asso)s(ciativit)m(y)-8 b(,)29 b(and)150 | |
7799 | 4205 y(v)-5 b(alues)34 b(are)i(the)f(same)g(as)h(in)d(the)i(C)g | |
7800 | (language.)55 b(The)35 b(follo)m(wing)e(list)h(of)h(op)s(erators)g(is)f | |
7801 | (group)s(ed)g(in)m(to)150 4314 y(lev)m(els)25 b(of)h(equal-precedence)h | |
7802 | (op)s(erators.)39 b(The)25 b(lev)m(els)h(are)g(listed)f(in)f(order)i | |
7803 | (of)g(decreasing)f(precedence.)150 4476 y Fj(id)11 b | |
7804 | Fs(++)29 b Fj(id)p Fs(--)630 4586 y Ft(v)-5 b(ariable)29 | |
7805 | b(p)s(ost-incremen)m(t)h(and)g(p)s(ost-decremen)m(t)150 | |
7806 | 4747 y Fs(++)p Fj(id)40 b Fs(--)p Fj(id)630 4857 y Ft(v)-5 | |
7807 | b(ariable)29 b(pre-incremen)m(t)h(and)g(pre-decremen)m(t)150 | |
7808 | 5018 y Fs(-)g(+)354 b Ft(unary)29 b(min)m(us)g(and)h(plus)150 | |
7809 | 5179 y Fs(!)g(~)354 b Ft(logical)30 b(and)g(bit)m(wise)f(negation)150 | |
7810 | 5340 y Fs(**)384 b Ft(exp)s(onen)m(tiation)p eop | |
7811 | %%Page: 71 77 | |
7812 | 71 76 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
7813 | b(F)-8 b(eatures)2484 b(71)150 299 y Fs(*)30 b(/)g(\045)276 | |
7814 | b Ft(m)m(ultiplication,)28 b(division,)f(remainder)150 | |
7815 | 464 y Fs(+)j(-)354 b Ft(addition,)29 b(subtraction)150 | |
7816 | 630 y Fs(<<)h(>>)258 b Ft(left)30 b(and)g(righ)m(t)g(bit)m(wise)f | |
7817 | (shifts)150 795 y Fs(<=)h(>=)g(<)g(>)102 b Ft(comparison)150 | |
7818 | 961 y Fs(==)30 b(!=)258 b Ft(equalit)m(y)30 b(and)g(inequalit)m(y)150 | |
7819 | 1126 y Fs(&)432 b Ft(bit)m(wise)29 b(AND)150 1292 y Fs(^)432 | |
7820 | b Ft(bit)m(wise)29 b(exclusiv)m(e)h(OR)150 1458 y Fs(|)432 | |
7821 | b Ft(bit)m(wise)29 b(OR)150 1623 y Fs(&&)384 b Ft(logical)30 | |
7822 | b(AND)150 1789 y Fs(||)384 b Ft(logical)30 b(OR)150 1954 | |
7823 | y Fs(expr)f(?)h(expr)f(:)h(expr)630 2064 y Ft(conditional)f(op)s | |
7824 | (erator)150 2229 y Fs(=)h(*=)g(/=)g(\045=)f(+=)h(-=)g(<<=)f(>>=)h(&=)g | |
7825 | (^=)f(|=)630 2339 y Ft(assignmen)m(t)150 2504 y Fs(expr1)g(,)h(expr2) | |
7826 | 630 2614 y Ft(comma)275 2782 y(Shell)36 b(v)-5 b(ariables)37 | |
7827 | b(are)i(allo)m(w)m(ed)g(as)g(op)s(erands;)i(parameter)e(expansion)f(is) | |
7828 | f(p)s(erformed)h(b)s(efore)g(the)150 2892 y(expression)f(is)g(ev)-5 | |
7829 | b(aluated.)65 b(Within)36 b(an)j(expression,)g(shell)d(v)-5 | |
7830 | b(ariables)37 b(ma)m(y)i(also)f(b)s(e)g(referenced)g(b)m(y)150 | |
7831 | 3002 y(name)31 b(without)e(using)g(the)i(parameter)g(expansion)e(syn)m | |
7832 | (tax.)42 b(A)31 b(shell)d(v)-5 b(ariable)30 b(that)h(is)e(n)m(ull)g(or) | |
7833 | h(unset)150 3111 y(ev)-5 b(aluates)40 b(to)g(0)g(when)e(referenced)h(b) | |
7834 | m(y)g(name)h(without)e(using)g(the)h(parameter)h(expansion)e(syn)m | |
7835 | (tax.)150 3221 y(The)d(v)-5 b(alue)36 b(of)g(a)h(v)-5 | |
7836 | b(ariable)34 b(is)h(ev)-5 b(aluated)37 b(as)f(an)g(arithmetic)f | |
7837 | (expression)g(when)g(it)g(is)g(referenced,)j(or)150 3330 | |
7838 | y(when)31 b(a)i(v)-5 b(ariable)31 b(whic)m(h)g(has)h(b)s(een)f(giv)m | |
7839 | (en)i(the)f Fq(in)m(teger)39 b Ft(attribute)32 b(using)f(`)p | |
7840 | Fs(declare)e(-i)p Ft(')i(is)h(assigned)150 3440 y(a)37 | |
7841 | b(v)-5 b(alue.)57 b(A)36 b(n)m(ull)e(v)-5 b(alue)36 b(ev)-5 | |
7842 | b(aluates)37 b(to)g(0.)58 b(A)36 b(shell)f(v)-5 b(ariable)34 | |
7843 | b(need)i(not)h(ha)m(v)m(e)g(its)f(in)m(teger)g(attribute)150 | |
7844 | 3550 y(turned)29 b(on)h(to)i(b)s(e)d(used)h(in)f(an)h(expression.)275 | |
7845 | 3690 y(Constan)m(ts)41 b(with)f(a)i(leading)d(0)j(are)g(in)m(terpreted) | |
7846 | e(as)h(o)s(ctal)h(n)m(um)m(b)s(ers.)72 b(A)41 b(leading)f(`)p | |
7847 | Fs(0x)p Ft(')h(or)g(`)p Fs(0X)p Ft(')150 3800 y(denotes)31 | |
7848 | b(hexadecimal.)41 b(Otherwise,)30 b(n)m(um)m(b)s(ers)f(tak)m(e)k(the)e | |
7849 | (form)f([)p Fq(base)5 b Fs(#)p Ft(])p Fq(n)p Ft(,)31 | |
7850 | b(where)f Fq(base)36 b Ft(is)30 b(a)h(decimal)150 3909 | |
7851 | y(n)m(um)m(b)s(er)26 b(b)s(et)m(w)m(een)i(2)f(and)g(64)h(represen)m | |
7852 | (ting)f(the)g(arithmetic)f(base,)j(and)d Fq(n)h Ft(is)f(a)i(n)m(um)m(b) | |
7853 | s(er)e(in)g(that)i(base.)150 4019 y(If)39 b Fq(base)5 | |
7854 | b Fs(#)40 b Ft(is)f(omitted,)j(then)e(base)g(10)g(is)f(used.)68 | |
7855 | b(The)39 b(digits)g(greater)i(than)e(9)h(are)g(represen)m(ted)g(b)m(y) | |
7856 | 150 4129 y(the)34 b(lo)m(w)m(ercase)g(letters,)h(the)e(upp)s(ercase)g | |
7857 | (letters,)h(`)p Fs(@)p Ft(',)h(and)e(`)p Fs(_)p Ft(',)h(in)e(that)i | |
7858 | (order.)50 b(If)32 b Fq(base)39 b Ft(is)33 b(less)f(than)150 | |
7859 | 4238 y(or)38 b(equal)f(to)i(36,)h(lo)m(w)m(ercase)g(and)d(upp)s(ercase) | |
7860 | g(letters)h(ma)m(y)g(b)s(e)f(used)g(in)m(terc)m(hangably)g(to)i | |
7861 | (represen)m(t)150 4348 y(n)m(um)m(b)s(ers)29 b(b)s(et)m(w)m(een)i(10)g | |
7862 | (and)f(35.)275 4488 y(Op)s(erators)44 b(are)h(ev)-5 b(aluated)45 | |
7863 | b(in)f(order)g(of)h(precedence.)85 b(Sub-expressions)43 | |
7864 | b(in)g(paren)m(theses)j(are)150 4598 y(ev)-5 b(aluated)31 | |
7865 | b(\014rst)e(and)h(ma)m(y)h(o)m(v)m(erride)f(the)h(precedence)g(rules)e | |
7866 | (ab)s(o)m(v)m(e.)150 4871 y Fr(6.6)68 b(Aliases)275 5121 | |
7867 | y Fq(Aliases)32 b Ft(allo)m(w)d(a)i(string)d(to)j(b)s(e)e(substituted)f | |
7868 | (for)i(a)g(w)m(ord)f(when)g(it)g(is)g(used)g(as)h(the)g(\014rst)f(w)m | |
7869 | (ord)h(of)g(a)150 5230 y(simple)g(command.)45 b(The)31 | |
7870 | b(shell)g(main)m(tains)f(a)j(list)d(of)i(aliases)g(that)g(ma)m(y)h(b)s | |
7871 | (e)e(set)h(and)g(unset)f(with)g(the)150 5340 y Fs(alias)e | |
7872 | Ft(and)h Fs(unalias)e Ft(builtin)f(commands.)p eop | |
7873 | %%Page: 72 78 | |
7874 | 72 77 bop 150 -116 a Ft(72)2572 b(Bash)31 b(Reference)g(Man)m(ual)275 | |
7875 | 299 y(The)e(\014rst)f(w)m(ord)i(of)f(eac)m(h)i(simple)d(command,)i(if)e | |
7876 | (unquoted,)h(is)g(c)m(hec)m(k)m(ed)i(to)g(see)f(if)f(it)g(has)g(an)g | |
7877 | (alias.)150 408 y(If)34 b(so,)i(that)f(w)m(ord)f(is)f(replaced)h(b)m(y) | |
7878 | g(the)h(text)g(of)g(the)f(alias.)52 b(The)34 b(alias)g(name)g(and)g | |
7879 | (the)g(replacemen)m(t)150 518 y(text)g(ma)m(y)f(con)m(tain)g(an)m(y)g | |
7880 | (v)-5 b(alid)31 b(shell)g(input,)h(including)d(shell)i(metac)m | |
7881 | (haracters,)36 b(with)c(the)h(exception)150 628 y(that)i(the)f(alias)f | |
7882 | (name)h(ma)m(y)h(not)g(con)m(tain)f(`)p Fs(=)p Ft('.)52 | |
7883 | b(The)34 b(\014rst)f(w)m(ord)h(of)g(the)g(replacemen)m(t)h(text)g(is)e | |
7884 | (tested)150 737 y(for)26 b(aliases,)h(but)f(a)h(w)m(ord)f(that)h(is)f | |
7885 | (iden)m(tical)f(to)i(an)g(alias)e(b)s(eing)g(expanded)h(is)g(not)g | |
7886 | (expanded)g(a)h(second)150 847 y(time.)40 b(This)27 b(means)i(that)g | |
7887 | (one)g(ma)m(y)h(alias)e Fs(ls)g Ft(to)i Fs("ls)f(-F")p | |
7888 | Ft(,)g(for)f(instance,)i(and)e(Bash)h(do)s(es)f(not)h(try)g(to)150 | |
7889 | 956 y(recursiv)m(ely)j(expand)g(the)h(replacemen)m(t)g(text.)50 | |
7890 | b(If)32 b(the)h(last)g(c)m(haracter)h(of)g(the)f(alias)f(v)-5 | |
7891 | b(alue)32 b(is)g(a)h(space)150 1066 y(or)f(tab)g(c)m(haracter,)j(then)d | |
7892 | (the)g(next)g(command)g(w)m(ord)g(follo)m(wing)e(the)i(alias)g(is)f | |
7893 | (also)h(c)m(hec)m(k)m(ed)i(for)e(alias)150 1176 y(expansion.)275 | |
7894 | 1325 y(Aliases)27 b(are)h(created)i(and)d(listed)g(with)g(the)h | |
7895 | Fs(alias)f Ft(command,)h(and)g(remo)m(v)m(ed)h(with)e(the)h | |
7896 | Fs(unalias)150 1434 y Ft(command.)275 1583 y(There)44 | |
7897 | b(is)g(no)h(mec)m(hanism)f(for)g(using)g(argumen)m(ts)h(in)e(the)i | |
7898 | (replacemen)m(t)h(text,)j(as)d(in)d Fs(csh)p Ft(.)83 | |
7899 | b(If)150 1693 y(argumen)m(ts)37 b(are)h(needed,)g(a)g(shell)d(function) | |
7900 | g(should)g(b)s(e)i(used)f(\(see)i(Section)f(3.3)h([Shell)d(F)-8 | |
7901 | b(unctions],)150 1802 y(page)31 b(13\).)275 1951 y(Aliases)g(are)j(not) | |
7902 | e(expanded)g(when)g(the)h(shell)e(is)h(not)h(in)m(teractiv)m(e,)h | |
7903 | (unless)d(the)i Fs(expand_aliases)150 2061 y Ft(shell)c(option)g(is)h | |
7904 | (set)h(using)e Fs(shopt)g Ft(\(see)i(Section)f(4.2)i([Bash)e | |
7905 | (Builtins],)e(page)k(39\).)275 2210 y(The)38 b(rules)g(concerning)h | |
7906 | (the)g(de\014nition)e(and)i(use)g(of)g(aliases)g(are)g(somewhat)h | |
7907 | (confusing.)66 b(Bash)150 2320 y(alw)m(a)m(ys)41 b(reads)g(at)h(least)f | |
7908 | (one)g(complete)h(line)d(of)i(input)e(b)s(efore)i(executing)g(an)m(y)g | |
7909 | (of)g(the)g(commands)150 2429 y(on)h(that)h(line.)75 | |
7910 | b(Aliases)42 b(are)g(expanded)g(when)f(a)i(command)f(is)f(read,)46 | |
7911 | b(not)c(when)g(it)f(is)h(executed.)150 2539 y(Therefore,)g(an)e(alias)f | |
7912 | (de\014nition)e(app)s(earing)i(on)g(the)h(same)h(line)d(as)i(another)g | |
7913 | (command)f(do)s(es)h(not)150 2648 y(tak)m(e)31 b(e\013ect)f(un)m(til)e | |
7914 | (the)h(next)g(line)f(of)h(input)e(is)h(read.)41 b(The)28 | |
7915 | b(commands)h(follo)m(wing)f(the)h(alias)f(de\014nition)150 | |
7916 | 2758 y(on)f(that)h(line)d(are)j(not)f(a\013ected)i(b)m(y)e(the)g(new)g | |
7917 | (alias.)39 b(This)25 b(b)s(eha)m(vior)h(is)g(also)h(an)g(issue)f(when)g | |
7918 | (functions)150 2868 y(are)d(executed.)39 b(Aliases)22 | |
7919 | b(are)h(expanded)f(when)f(a)i(function)f(de\014nition)e(is)i(read,)i | |
7920 | (not)f(when)e(the)i(function)150 2977 y(is)h(executed,)k(b)s(ecause)d | |
7921 | (a)h(function)e(de\014nition)e(is)j(itself)f(a)h(comp)s(ound)f | |
7922 | (command.)39 b(As)25 b(a)h(consequence,)150 3087 y(aliases)34 | |
7923 | b(de\014ned)f(in)g(a)h(function)f(are)i(not)f(a)m(v)-5 | |
7924 | b(ailable)34 b(un)m(til)e(after)j(that)g(function)e(is)g(executed.)53 | |
7925 | b(T)-8 b(o)35 b(b)s(e)150 3196 y(safe,)41 b(alw)m(a)m(ys)e(put)e(alias) | |
7926 | h(de\014nitions)e(on)i(a)h(separate)g(line,)g(and)f(do)g(not)g(use)g | |
7927 | Fs(alias)f Ft(in)g(comp)s(ound)150 3306 y(commands.)275 | |
7928 | 3455 y(F)-8 b(or)31 b(almost)f(ev)m(ery)h(purp)s(ose,)e(shell)g | |
7929 | (functions)g(are)h(preferred)g(o)m(v)m(er)h(aliases.)150 | |
7930 | 3749 y Fr(6.7)68 b(Arra)l(ys)275 4007 y Ft(Bash)33 b(pro)m(vides)f | |
7931 | (one-dimensional)f(arra)m(y)i(v)-5 b(ariables.)48 b(An)m(y)33 | |
7932 | b(v)-5 b(ariable)32 b(ma)m(y)h(b)s(e)g(used)f(as)h(an)g(arra)m(y;)150 | |
7933 | 4117 y(the)c Fs(declare)d Ft(builtin)f(will)h(explicitly)g(declare)j | |
7934 | (an)f(arra)m(y)-8 b(.)41 b(There)28 b(is)g(no)g(maxim)m(um)g(limit)e | |
7935 | (on)i(the)h(size)150 4227 y(of)d(an)g(arra)m(y)-8 b(,)27 | |
7936 | b(nor)f(an)m(y)g(requiremen)m(t)f(that)h(mem)m(b)s(ers)f(b)s(e)g | |
7937 | (indexed)f(or)i(assigned)f(con)m(tiguously)-8 b(.)39 | |
7938 | b(Arra)m(ys)150 4336 y(are)31 b(zero-based.)275 4485 | |
7939 | y(An)f(arra)m(y)g(is)g(created)h(automatically)f(if)g(an)m(y)h(v)-5 | |
7940 | b(ariable)29 b(is)g(assigned)h(to)h(using)e(the)h(syn)m(tax)390 | |
7941 | 4634 y Fs(name[)p Fj(subscript)11 b Fs(]=)p Fj(value)150 | |
7942 | 4783 y Ft(The)25 b Fq(subscript)f Ft(is)h(treated)h(as)f(an)g | |
7943 | (arithmetic)f(expression)g(that)i(m)m(ust)f(ev)-5 b(aluate)26 | |
7944 | b(to)f(a)h(n)m(um)m(b)s(er)e(greater)150 4893 y(than)30 | |
7945 | b(or)g(equal)g(to)h(zero.)42 b(T)-8 b(o)31 b(explicitly)d(declare)i(an) | |
7946 | g(arra)m(y)-8 b(,)32 b(use)390 5042 y Fs(declare)46 b(-a)h | |
7947 | Fj(name)150 5191 y Ft(The)30 b(syn)m(tax)390 5340 y Fs(declare)46 | |
7948 | b(-a)h Fj(name)11 b Fs([)p Fj(subscript)g Fs(])p eop | |
7949 | %%Page: 73 79 | |
7950 | 73 78 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
7951 | b(F)-8 b(eatures)2484 b(73)150 299 y(is)28 b(also)i(accepted;)h(the)f | |
7952 | Fq(subscript)f Ft(is)f(ignored.)40 b(A)m(ttributes)29 | |
7953 | b(ma)m(y)h(b)s(e)e(sp)s(eci\014ed)g(for)h(an)g(arra)m(y)h(v)-5 | |
7954 | b(ariable)150 408 y(using)39 b(the)i Fs(declare)d Ft(and)i | |
7955 | Fs(readonly)f Ft(builtins.)67 b(Eac)m(h)42 b(attribute)e(applies)f(to)i | |
7956 | (all)f(mem)m(b)s(ers)f(of)i(an)150 518 y(arra)m(y)-8 | |
7957 | b(.)275 663 y(Arra)m(ys)30 b(are)h(assigned)e(to)i(using)e(comp)s(ound) | |
7958 | g(assignmen)m(ts)h(of)h(the)f(form)390 809 y Fs(name=\(value)p | |
7959 | Fj(1)55 b Fs(...)47 b(value)p Fj(n)11 b Fs(\))150 954 | |
7960 | y Ft(where)37 b(eac)m(h)h Fq(v)-5 b(alue)42 b Ft(is)37 | |
7961 | b(of)g(the)h(form)e Fs([[)p Fj(subscript)11 b Fs(]=])p | |
7962 | Fq(string)p Ft(.)57 b(If)36 b(the)i(optional)e(subscript)f(is)i(sup-) | |
7963 | 150 1064 y(plied,)42 b(that)g(index)e(is)g(assigned)h(to;)47 | |
7964 | b(otherwise)41 b(the)g(index)f(of)i(the)f(elemen)m(t)h(assigned)e(is)h | |
7965 | (the)g(last)150 1173 y(index)33 b(assigned)h(to)h(b)m(y)f(the)h | |
7966 | (statemen)m(t)h(plus)c(one.)54 b(Indexing)32 b(starts)j(at)g(zero.)54 | |
7967 | b(This)33 b(syn)m(tax)i(is)e(also)150 1283 y(accepted)i(b)m(y)f(the)g | |
7968 | Fs(declare)e Ft(builtin.)47 b(Individual)30 b(arra)m(y)k(elemen)m(ts)g | |
7969 | (ma)m(y)h(b)s(e)e(assigned)g(to)h(using)f(the)150 1392 | |
7970 | y Fs(name[)p Fq(subscript)r Fs(]=)p Fq(v)-5 b(alue)31 | |
7971 | b Ft(syn)m(tax)g(in)m(tro)s(duced)e(ab)s(o)m(v)m(e.)275 | |
7972 | 1538 y(An)m(y)k(elemen)m(t)h(of)g(an)f(arra)m(y)h(ma)m(y)g(b)s(e)f | |
7973 | (referenced)g(using)f Fs(${name[)p Fq(subscript)r Fs(]})p | |
7974 | Ft(.)45 b(The)33 b(braces)h(are)150 1647 y(required)27 | |
7975 | b(to)k(a)m(v)m(oid)e(con\015icts)g(with)f(the)i(shell's)d(\014lename)i | |
7976 | (expansion)f(op)s(erators.)41 b(If)28 b(the)i Fq(subscript)f | |
7977 | Ft(is)150 1757 y(`)p Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)f(the)h(w)m | |
7978 | (ord)f(expands)f(to)i(all)e(mem)m(b)s(ers)g(of)i(the)f(arra)m(y)h | |
7979 | Fq(name)p Ft(.)40 b(These)29 b(subscripts)e(di\013er)h(only)150 | |
7980 | 1866 y(when)36 b(the)g(w)m(ord)g(app)s(ears)g(within)e(double)h | |
7981 | (quotes.)60 b(If)36 b(the)h(w)m(ord)f(is)f(double-quoted,)j | |
7982 | Fs(${name[*]})150 1976 y Ft(expands)20 b(to)h(a)g(single)e(w)m(ord)h | |
7983 | (with)g(the)h(v)-5 b(alue)20 b(of)g(eac)m(h)i(arra)m(y)f(mem)m(b)s(er)f | |
7984 | (separated)h(b)m(y)g(the)f(\014rst)g(c)m(haracter)150 | |
7985 | 2086 y(of)38 b(the)g Fs(IFS)f Ft(v)-5 b(ariable,)39 b(and)e | |
7986 | Fs(${name[@]})e Ft(expands)i(eac)m(h)i(elemen)m(t)f(of)g | |
7987 | Fq(name)43 b Ft(to)c(a)f(separate)h(w)m(ord.)150 2195 | |
7988 | y(When)33 b(there)g(are)g(no)g(arra)m(y)g(mem)m(b)s(ers,)g | |
7989 | Fs(${name[@]})d Ft(expands)i(to)i(nothing.)47 b(This)31 | |
7990 | b(is)h(analogous)h(to)150 2305 y(the)i(expansion)f(of)i(the)f(sp)s | |
7991 | (ecial)f(parameters)h(`)p Fs(@)p Ft(')h(and)e(`)p Fs(*)p | |
7992 | Ft('.)55 b Fs(${#name[)p Fq(subscript)r Fs(]})31 b Ft(expands)j(to)i | |
7993 | (the)150 2414 y(length)k(of)g Fs(${name[)p Fq(subscript)r | |
7994 | Fs(]})p Ft(.)66 b(If)40 b Fq(subscript)g Ft(is)g(`)p | |
7995 | Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)i(the)e(expansion)e(is)g(the)i(n)m | |
7996 | (um)m(b)s(er)e(of)150 2524 y(elemen)m(ts)e(in)e(the)i(arra)m(y)-8 | |
7997 | b(.)60 b(Referencing)36 b(an)g(arra)m(y)i(v)-5 b(ariable)35 | |
7998 | b(without)g(a)i(subscript)e(is)g(equiv)-5 b(alen)m(t)36 | |
7999 | b(to)150 2634 y(referencing)30 b(elemen)m(t)g(zero.)275 | |
8000 | 2779 y(The)i Fs(unset)g Ft(builtin)e(is)i(used)h(to)h(destro)m(y)g | |
8001 | (arra)m(ys.)50 b Fs(unset)31 b Fq(name)5 b Ft([)p Fq(subscript)r | |
8002 | Ft(])32 b(destro)m(ys)i(the)f(arra)m(y)150 2888 y(elemen)m(t)c(at)h | |
8003 | (index)d Fq(subscript)p Ft(.)38 b Fs(unset)27 b Fq(name)p | |
8004 | Ft(,)j(where)e Fq(name)34 b Ft(is)27 b(an)i(arra)m(y)-8 | |
8005 | b(,)30 b(remo)m(v)m(es)g(the)f(en)m(tire)g(arra)m(y)-8 | |
8006 | b(.)150 2998 y(A)30 b(subscript)f(of)h(`)p Fs(*)p Ft(')h(or)f(`)p | |
8007 | Fs(@)p Ft(')h(also)f(remo)m(v)m(es)i(the)e(en)m(tire)h(arra)m(y)-8 | |
8008 | b(.)275 3143 y(The)22 b Fs(declare)p Ft(,)h Fs(local)p | |
8009 | Ft(,)g(and)g Fs(readonly)e Ft(builtins)e(eac)m(h)25 b(accept)f(a)g(`)p | |
8010 | Fs(-a)p Ft(')f(option)f(to)i(sp)s(ecify)e(an)h(arra)m(y)-8 | |
8011 | b(.)150 3253 y(The)24 b Fs(read)g Ft(builtin)e(accepts)k(a)f(`)p | |
8012 | Fs(-a)p Ft(')g(option)g(to)g(assign)g(a)g(list)f(of)h(w)m(ords)f(read)h | |
8013 | (from)g(the)g(standard)f(input)150 3363 y(to)37 b(an)f(arra)m(y)-8 | |
8014 | b(,)39 b(and)c(can)h(read)g(v)-5 b(alues)36 b(from)f(the)i(standard)e | |
8015 | (input)f(in)m(to)i(individual)c(arra)m(y)k(elemen)m(ts.)150 | |
8016 | 3472 y(The)30 b Fs(set)f Ft(and)h Fs(declare)e Ft(builtins)f(displa)m | |
8017 | (y)h(arra)m(y)j(v)-5 b(alues)30 b(in)f(a)h(w)m(a)m(y)h(that)g(allo)m | |
8018 | (ws)f(them)g(to)h(b)s(e)f(reused)150 3582 y(as)h(input.)150 | |
8019 | 3866 y Fr(6.8)68 b(The)45 b(Directory)g(Stac)l(k)275 | |
8020 | 4121 y Ft(The)26 b(directory)f(stac)m(k)j(is)e(a)h(list)e(of)i(recen)m | |
8021 | (tly-visited)e(directories.)39 b(The)26 b Fs(pushd)f | |
8022 | Ft(builtin)e(adds)j(direc-)150 4231 y(tories)e(to)g(the)h(stac)m(k)g | |
8023 | (as)f(it)g(c)m(hanges)g(the)h(curren)m(t)e(directory)-8 | |
8024 | b(,)26 b(and)d(the)h Fs(popd)f Ft(builtin)d(remo)m(v)m(es)26 | |
8025 | b(sp)s(eci\014ed)150 4340 y(directories)h(from)h(the)h(stac)m(k)h(and)d | |
8026 | (c)m(hanges)j(the)e(curren)m(t)g(directory)g(to)h(the)g(directory)e | |
8027 | (remo)m(v)m(ed.)41 b(The)150 4450 y Fs(dirs)29 b Ft(builtin)e(displa)m | |
8028 | (ys)i(the)h(con)m(ten)m(ts)i(of)f(the)f(directory)g(stac)m(k.)275 | |
8029 | 4595 y(The)35 b(con)m(ten)m(ts)i(of)f(the)h(directory)e(stac)m(k)i(are) | |
8030 | f(also)g(visible)e(as)i(the)g(v)-5 b(alue)35 b(of)h(the)g | |
8031 | Fs(DIRSTACK)e Ft(shell)150 4705 y(v)-5 b(ariable.)150 | |
8032 | 4951 y Fk(6.8.1)63 b(Directory)40 b(Stac)m(k)g(Builtins)150 | |
8033 | 5200 y Fs(dirs)870 5340 y(dirs)47 b([+)p Fj(N)57 b Fs(|)48 | |
8034 | b(-)p Fj(N)11 b Fs(])46 b([-clpv])p eop | |
8035 | %%Page: 74 80 | |
8036 | 74 79 bop 150 -116 a Ft(74)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
8037 | 299 y(Displa)m(y)i(the)h(list)e(of)i(curren)m(tly)f(remem)m(b)s(ered)g | |
8038 | (directories.)49 b(Directories)34 b(are)g(added)f(to)630 | |
8039 | 408 y(the)28 b(list)f(with)g(the)h Fs(pushd)f Ft(command;)i(the)f | |
8040 | Fs(popd)f Ft(command)h(remo)m(v)m(es)h(directories)e(from)630 | |
8041 | 518 y(the)k(list.)630 670 y Fs(+)p Fj(N)384 b Ft(Displa)m(ys)21 | |
8042 | b(the)h Fq(N)10 b Ft(th)21 b(directory)g(\(coun)m(ting)h(from)f(the)h | |
8043 | (left)f(of)h(the)g(list)e(prin)m(ted)1110 780 y(b)m(y)30 | |
8044 | b Fs(dirs)f Ft(when)h(in)m(v)m(ok)m(ed)h(without)e(options\),)h | |
8045 | (starting)g(with)g(zero.)630 932 y Fs(-)p Fj(N)384 b | |
8046 | Ft(Displa)m(ys)45 b(the)i Fq(N)10 b Ft(th)46 b(directory)g(\(coun)m | |
8047 | (ting)g(from)g(the)g(righ)m(t)g(of)h(the)f(list)1110 | |
8048 | 1042 y(prin)m(ted)24 b(b)m(y)h Fs(dirs)g Ft(when)f(in)m(v)m(ok)m(ed)i | |
8049 | (without)f(options\),)h(starting)g(with)e(zero.)630 1194 | |
8050 | y Fs(-c)384 b Ft(Clears)30 b(the)g(directory)g(stac)m(k)i(b)m(y)e | |
8051 | (deleting)f(all)h(of)g(the)h(elemen)m(ts.)630 1347 y | |
8052 | Fs(-l)384 b Ft(Pro)s(duces)30 b(a)i(longer)f(listing;)f(the)i(default)e | |
8053 | (listing)g(format)h(uses)g(a)h(tilde)e(to)1110 1456 y(denote)h(the)f | |
8054 | (home)h(directory)-8 b(.)630 1609 y Fs(-p)384 b Ft(Causes)30 | |
8055 | b Fs(dirs)f Ft(to)i(prin)m(t)e(the)i(directory)f(stac)m(k)i(with)d(one) | |
8056 | h(en)m(try)h(p)s(er)e(line.)630 1761 y Fs(-v)384 b Ft(Causes)36 | |
8057 | b Fs(dirs)f Ft(to)i(prin)m(t)e(the)h(directory)g(stac)m(k)i(with)d(one) | |
8058 | i(en)m(try)f(p)s(er)f(line,)1110 1871 y(pre\014xing)29 | |
8059 | b(eac)m(h)i(en)m(try)g(with)e(its)h(index)e(in)i(the)g(stac)m(k.)150 | |
8060 | 2023 y Fs(popd)870 2154 y(popd)47 b([+)p Fj(N)57 b Fs(|)48 | |
8061 | b(-)p Fj(N)11 b Fs(])46 b([-n])630 2285 y Ft(Remo)m(v)m(e)26 | |
8062 | b(the)e(top)g(en)m(try)h(from)e(the)h(directory)g(stac)m(k,)j(and)c | |
8063 | Fs(cd)h Ft(to)h(the)f(new)f(top)i(directory)-8 b(.)630 | |
8064 | 2395 y(When)32 b(no)g(argumen)m(ts)h(are)g(giv)m(en,)g | |
8065 | Fs(popd)e Ft(remo)m(v)m(es)j(the)f(top)f(directory)g(from)g(the)g(stac) | |
8066 | m(k)630 2504 y(and)f(p)s(erforms)e(a)j Fs(cd)f Ft(to)h(the)f(new)g(top) | |
8067 | h(directory)-8 b(.)43 b(The)31 b(elemen)m(ts)h(are)f(n)m(um)m(b)s(ered) | |
8068 | f(from)630 2614 y(0)d(starting)f(at)h(the)g(\014rst)f(directory)g | |
8069 | (listed)f(with)g Fs(dirs)p Ft(;)i(i.e.,)h Fs(popd)d Ft(is)h(equiv)-5 | |
8070 | b(alen)m(t)26 b(to)h Fs(popd)630 2724 y(+0)p Ft(.)630 | |
8071 | 2876 y Fs(+)p Fj(N)384 b Ft(Remo)m(v)m(es)22 b(the)f | |
8072 | Fq(N)10 b Ft(th)20 b(directory)f(\(coun)m(ting)i(from)f(the)g(left)g | |
8073 | (of)h(the)f(list)f(prin)m(ted)1110 2986 y(b)m(y)30 b | |
8074 | Fs(dirs)p Ft(\),)g(starting)g(with)f(zero.)630 3138 y | |
8075 | Fs(-)p Fj(N)384 b Ft(Remo)m(v)m(es)46 b(the)g Fq(N)10 | |
8076 | b Ft(th)44 b(directory)g(\(coun)m(ting)h(from)g(the)g(righ)m(t)f(of)h | |
8077 | (the)g(list)1110 3248 y(prin)m(ted)29 b(b)m(y)h Fs(dirs)p | |
8078 | Ft(\),)g(starting)g(with)f(zero.)630 3400 y Fs(-n)384 | |
8079 | b Ft(Suppresses)27 b(the)j(normal)f(c)m(hange)h(of)g(directory)f(when)f | |
8080 | (remo)m(ving)i(directo-)1110 3510 y(ries)f(from)h(the)h(stac)m(k,)h(so) | |
8081 | f(that)g(only)e(the)i(stac)m(k)g(is)f(manipulated.)150 | |
8082 | 3684 y Fs(pushd)870 3815 y(pushd)46 b([)p Fj(dir)58 b | |
8083 | Fs(|)47 b(+)p Fj(N)58 b Fs(|)47 b Fj(-N)11 b Fs(])47 | |
8084 | b([-n])630 3946 y Ft(Sa)m(v)m(e)30 b(the)e(curren)m(t)g(directory)g(on) | |
8085 | g(the)h(top)f(of)h(the)f(directory)g(stac)m(k)i(and)e(then)g | |
8086 | Fs(cd)f Ft(to)i Fq(dir)p Ft(.)630 4055 y(With)h(no)g(argumen)m(ts,)h | |
8087 | Fs(pushd)e Ft(exc)m(hanges)j(the)e(top)h(t)m(w)m(o)h(directories.)630 | |
8088 | 4208 y Fs(+)p Fj(N)384 b Ft(Brings)28 b(the)g Fq(N)10 | |
8089 | b Ft(th)29 b(directory)f(\(coun)m(ting)h(from)f(the)g(left)h(of)f(the)h | |
8090 | (list)e(prin)m(ted)1110 4317 y(b)m(y)34 b Fs(dirs)p Ft(,)g(starting)g | |
8091 | (with)f(zero\))j(to)f(the)f(top)g(of)h(the)f(list)f(b)m(y)h(rotating)h | |
8092 | (the)1110 4427 y(stac)m(k.)630 4579 y Fs(-)p Fj(N)384 | |
8093 | b Ft(Brings)22 b(the)h Fq(N)10 b Ft(th)23 b(directory)g(\(coun)m(ting)g | |
8094 | (from)f(the)i(righ)m(t)e(of)h(the)h(list)d(prin)m(ted)1110 | |
8095 | 4689 y(b)m(y)34 b Fs(dirs)p Ft(,)g(starting)g(with)f(zero\))j(to)f(the) | |
8096 | f(top)g(of)h(the)f(list)f(b)m(y)h(rotating)h(the)1110 | |
8097 | 4798 y(stac)m(k.)630 4951 y Fs(-n)384 b Ft(Suppresses)26 | |
8098 | b(the)i(normal)g(c)m(hange)h(of)f(directory)g(when)f(adding)g | |
8099 | (directories)1110 5060 y(to)k(the)g(stac)m(k,)h(so)e(that)h(only)f(the) | |
8100 | g(stac)m(k)i(is)e(manipulated.)630 5213 y Fj(dir)336 | |
8101 | b Ft(Mak)m(es)36 b(the)f(curren)m(t)g(w)m(orking)f(directory)g(b)s(e)g | |
8102 | (the)h(top)g(of)g(the)g(stac)m(k,)j(and)1110 5322 y(then)30 | |
8103 | b(executes)i(the)e(equiv)-5 b(alen)m(t)30 b(of)h(`)p | |
8104 | Fs(cd)f Fq(dir)7 b Ft('.)38 b Fs(cd)p Ft(s)30 b(to)h | |
8105 | Fq(dir)p Ft(.)p eop | |
8106 | %%Page: 75 81 | |
8107 | 75 80 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
8108 | b(F)-8 b(eatures)2484 b(75)150 299 y Fr(6.9)68 b(Con)l(trolling)47 | |
8109 | b(the)e(Prompt)275 544 y Ft(The)c(v)-5 b(alue)42 b(of)g(the)h(v)-5 | |
8110 | b(ariable)41 b Fs(PROMPT_COMMAND)d Ft(is)j(examined)g(just)h(b)s(efore) | |
8111 | g(Bash)g(prin)m(ts)f(eac)m(h)150 653 y(primary)f(prompt.)73 | |
8112 | b(If)41 b Fs(PROMPT_COMMAND)d Ft(is)i(set)i(and)f(has)h(a)g(non-n)m | |
8113 | (ull)d(v)-5 b(alue,)44 b(then)d(the)h(v)-5 b(alue)41 | |
8114 | b(is)150 763 y(executed)31 b(just)f(as)h(if)e(it)h(had)g(b)s(een)f(t)m | |
8115 | (yp)s(ed)h(on)h(the)f(command)g(line.)275 898 y(In)d(addition,)h(the)h | |
8116 | (follo)m(wing)e(table)h(describ)s(es)f(the)i(sp)s(ecial)e(c)m | |
8117 | (haracters)j(whic)m(h)e(can)g(app)s(ear)g(in)g(the)150 | |
8118 | 1008 y(prompt)h(v)-5 b(ariables:)150 1168 y Fs(\\a)384 | |
8119 | b Ft(A)30 b(b)s(ell)f(c)m(haracter.)150 1328 y Fs(\\d)384 | |
8120 | b Ft(The)30 b(date,)h(in)e Fs(")p Ft(W)-8 b(eekda)m(y)32 | |
8121 | b(Mon)m(th)f(Date)p Fs(")h Ft(format)f(\(e.g.,)h Fs(")p | |
8122 | Ft(T)-8 b(ue)30 b(Ma)m(y)h(26)p Fs(")p Ft(\).)150 1488 | |
8123 | y Fs(\\D{)p Fj(format)11 b Fs(})630 1598 y Ft(The)27 | |
8124 | b Fq(format)i Ft(is)e(passed)f(to)i Fs(strftime)p Ft(\(3\))f(and)f(the) | |
8125 | i(result)e(is)g(inserted)g(in)m(to)h(the)h(prompt)630 | |
8126 | 1708 y(string;)41 b(an)e(empt)m(y)f Fq(format)j Ft(results)c(in)g(a)i | |
8127 | (lo)s(cale-sp)s(eci\014c)e(time)h(represen)m(tation.)64 | |
8128 | b(The)630 1817 y(braces)31 b(are)f(required.)150 1977 | |
8129 | y Fs(\\e)384 b Ft(An)30 b(escap)s(e)h(c)m(haracter.)150 | |
8130 | 2137 y Fs(\\h)384 b Ft(The)30 b(hostname,)h(up)e(to)i(the)g(\014rst)e | |
8131 | (`.'.)150 2298 y Fs(\\H)384 b Ft(The)30 b(hostname.)150 | |
8132 | 2458 y Fs(\\j)384 b Ft(The)30 b(n)m(um)m(b)s(er)f(of)h(jobs)g(curren)m | |
8133 | (tly)g(managed)h(b)m(y)f(the)g(shell.)150 2618 y Fs(\\l)384 | |
8134 | b Ft(The)30 b(basename)h(of)f(the)h(shell's)d(terminal)h(device)h | |
8135 | (name.)150 2778 y Fs(\\n)384 b Ft(A)30 b(newline.)150 | |
8136 | 2938 y Fs(\\r)384 b Ft(A)30 b(carriage)h(return.)150 | |
8137 | 3098 y Fs(\\s)384 b Ft(The)22 b(name)g(of)h(the)f(shell,)g(the)h | |
8138 | (basename)f(of)h Fs($0)f Ft(\(the)g(p)s(ortion)f(follo)m(wing)g(the)i | |
8139 | (\014nal)d(slash\).)150 3258 y Fs(\\t)384 b Ft(The)30 | |
8140 | b(time,)g(in)f(24-hour)i(HH:MM:SS)g(format.)150 3418 | |
8141 | y Fs(\\T)384 b Ft(The)30 b(time,)g(in)f(12-hour)i(HH:MM:SS)g(format.) | |
8142 | 150 3579 y Fs(\\@)384 b Ft(The)30 b(time,)g(in)f(12-hour)i(am/pm)f | |
8143 | (format.)150 3739 y Fs(\\A)384 b Ft(The)30 b(time,)g(in)f(24-hour)i | |
8144 | (HH:MM)g(format.)150 3899 y Fs(\\u)384 b Ft(The)30 b(username)g(of)g | |
8145 | (the)h(curren)m(t)f(user.)150 4059 y Fs(\\v)384 b Ft(The)30 | |
8146 | b(v)m(ersion)g(of)g(Bash)h(\(e.g.,)h(2.00\))150 4219 | |
8147 | y Fs(\\V)384 b Ft(The)30 b(release)h(of)f(Bash,)h(v)m(ersion)f | |
8148 | Fs(+)g Ft(patc)m(hlev)m(el)g(\(e.g.,)j(2.00.0\))150 4379 | |
8149 | y Fs(\\w)384 b Ft(The)30 b(curren)m(t)g(w)m(orking)g(directory)-8 | |
8150 | b(.)150 4539 y Fs(\\W)384 b Ft(The)30 b(basename)h(of)f | |
8151 | Fs($PWD)p Ft(.)150 4699 y Fs(\\!)384 b Ft(The)30 b(history)f(n)m(um)m | |
8152 | (b)s(er)g(of)i(this)e(command.)150 4860 y Fs(\\#)384 | |
8153 | b Ft(The)30 b(command)g(n)m(um)m(b)s(er)f(of)i(this)e(command.)150 | |
8154 | 5020 y Fs(\\$)384 b Ft(If)30 b(the)g(e\013ectiv)m(e)i(uid)d(is)g(0,)i | |
8155 | Fs(#)p Ft(,)g(otherwise)f Fs($)p Ft(.)150 5180 y Fs(\\)p | |
8156 | Fj(nnn)288 b Ft(The)30 b(c)m(haracter)i(whose)e(ASCI)s(I)f(co)s(de)h | |
8157 | (is)g(the)g(o)s(ctal)h(v)-5 b(alue)30 b Fq(nnn)p Ft(.)150 | |
8158 | 5340 y Fs(\\\\)384 b Ft(A)30 b(bac)m(kslash.)p eop | |
8159 | %%Page: 76 82 | |
8160 | 76 81 bop 150 -116 a Ft(76)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
8161 | 299 y Fs(\\[)384 b Ft(Begin)37 b(a)g(sequence)g(of)g(non-prin)m(ting)e | |
8162 | (c)m(haracters.)61 b(This)35 b(could)h(b)s(e)h(used)f(to)h(em)m(b)s(ed) | |
8163 | g(a)630 408 y(terminal)29 b(con)m(trol)i(sequence)f(in)m(to)h(the)f | |
8164 | (prompt.)150 568 y Fs(\\])384 b Ft(End)29 b(a)i(sequence)g(of)f | |
8165 | (non-prin)m(ting)e(c)m(haracters.)275 728 y(The)d(command)h(n)m(um)m(b) | |
8166 | s(er)f(and)h(the)g(history)f(n)m(um)m(b)s(er)g(are)i(usually)d | |
8167 | (di\013eren)m(t:)38 b(the)26 b(history)f(n)m(um)m(b)s(er)150 | |
8168 | 838 y(of)i(a)f(command)h(is)e(its)h(p)s(osition)e(in)h(the)i(history)e | |
8169 | (list,)h(whic)m(h)g(ma)m(y)h(include)d(commands)i(restored)g(from)150 | |
8170 | 947 y(the)39 b(history)g(\014le)f(\(see)i(Section)f(9.1)i([Bash)e | |
8171 | (History)g(F)-8 b(acilities],)41 b(page)f(109\),)j(while)38 | |
8172 | b(the)h(command)150 1057 y(n)m(um)m(b)s(er)j(is)g(the)i(p)s(osition)d | |
8173 | (in)h(the)h(sequence)h(of)f(commands)g(executed)h(during)d(the)j | |
8174 | (curren)m(t)f(shell)150 1167 y(session.)275 1302 y(After)35 | |
8175 | b(the)g(string)f(is)g(deco)s(ded,)i(it)e(is)g(expanded)g(via)h | |
8176 | (parameter)g(expansion,)h(command)e(substi-)150 1411 | |
8177 | y(tution,)j(arithmetic)e(expansion,)h(and)f(quote)h(remo)m(v)-5 | |
8178 | b(al,)38 b(sub)5 b(ject)35 b(to)i(the)f(v)-5 b(alue)35 | |
8179 | b(of)h(the)g Fs(promptvars)150 1521 y Ft(shell)29 b(option)g(\(see)j | |
8180 | (Section)e(4.2)h([Bash)g(Builtins],)d(page)j(39\).)150 | |
8181 | 1779 y Fr(6.10)68 b(The)45 b(Restricted)h(Shell)275 2024 | |
8182 | y Ft(If)26 b(Bash)h(is)e(started)i(with)f(the)h(name)f | |
8183 | Fs(rbash)p Ft(,)h(or)f(the)h(`)p Fs(--restricted)p Ft(')d(or)j(`)p | |
8184 | Fs(-r)p Ft(')f(option)g(is)g(supplied)150 2133 y(at)32 | |
8185 | b(in)m(v)m(o)s(cation,)g(the)f(shell)e(b)s(ecomes)j(restricted.)43 | |
8186 | b(A)31 b(restricted)g(shell)e(is)h(used)h(to)h(set)f(up)f(an)i(en)m | |
8187 | (viron-)150 2243 y(men)m(t)26 b(more)f(con)m(trolled)g(than)g(the)h | |
8188 | (standard)e(shell.)38 b(A)25 b(restricted)g(shell)f(b)s(eha)m(v)m(es)i | |
8189 | (iden)m(tically)d(to)j Fs(bash)150 2352 y Ft(with)j(the)i(exception)f | |
8190 | (that)h(the)g(follo)m(wing)e(are)h(disallo)m(w)m(ed)f(or)i(not)f(p)s | |
8191 | (erformed:)225 2487 y Fp(\017)60 b Ft(Changing)29 b(directories)g(with) | |
8192 | h(the)g Fs(cd)g Ft(builtin.)225 2622 y Fp(\017)60 b Ft(Setting)30 | |
8193 | b(or)g(unsetting)g(the)h(v)-5 b(alues)29 b(of)i(the)f | |
8194 | Fs(SHELL)p Ft(,)g Fs(PATH)p Ft(,)f Fs(ENV)p Ft(,)h(or)g | |
8195 | Fs(BASH_ENV)e Ft(v)-5 b(ariables.)225 2757 y Fp(\017)60 | |
8196 | b Ft(Sp)s(ecifying)28 b(command)i(names)g(con)m(taining)g(slashes.)225 | |
8197 | 2891 y Fp(\017)60 b Ft(Sp)s(ecifying)28 b(a)j(\014lename)e(con)m | |
8198 | (taining)h(a)h(slash)e(as)i(an)f(argumen)m(t)h(to)g(the)f | |
8199 | Fs(.)h Ft(builtin)26 b(command.)225 3026 y Fp(\017)60 | |
8200 | b Ft(Sp)s(ecifying)26 b(a)k(\014lename)e(con)m(taining)g(a)i(slash)d | |
8201 | (as)i(an)g(argumen)m(t)h(to)f(the)g(`)p Fs(-p)p Ft(')g(option)f(to)i | |
8202 | (the)f Fs(hash)330 3136 y Ft(builtin)e(command.)225 3270 | |
8203 | y Fp(\017)60 b Ft(Imp)s(orting)29 b(function)g(de\014nitions)f(from)h | |
8204 | (the)i(shell)e(en)m(vironmen)m(t)h(at)h(startup.)225 | |
8205 | 3405 y Fp(\017)60 b Ft(P)m(arsing)30 b(the)g(v)-5 b(alue)30 | |
8206 | b(of)h Fs(SHELLOPTS)d Ft(from)h(the)i(shell)e(en)m(vironmen)m(t)h(at)h | |
8207 | (startup.)225 3540 y Fp(\017)60 b Ft(Redirecting)29 b(output)h(using)f | |
8208 | (the)i(`)p Fs(>)p Ft(',)g(`)p Fs(>|)p Ft(',)f(`)p Fs(<>)p | |
8209 | Ft(',)h(`)p Fs(>&)p Ft(',)f(`)p Fs(&>)p Ft(',)h(and)e(`)p | |
8210 | Fs(>>)p Ft(')i(redirection)e(op)s(erators.)225 3675 y | |
8211 | Fp(\017)60 b Ft(Using)30 b(the)g Fs(exec)f Ft(builtin)e(to)k(replace)g | |
8212 | (the)f(shell)f(with)g(another)i(command.)225 3809 y Fp(\017)60 | |
8213 | b Ft(Adding)39 b(or)i(deleting)f(builtin)d(commands)k(with)e(the)i(`)p | |
8214 | Fs(-f)p Ft(')g(and)f(`)p Fs(-d)p Ft(')h(options)f(to)i(the)f | |
8215 | Fs(enable)330 3919 y Ft(builtin.)225 4054 y Fp(\017)60 | |
8216 | b Ft(Using)30 b(the)g Fs(enable)f Ft(builtin)e(command)j(to)h(enable)f | |
8217 | (disabled)e(shell)g(builtins.)225 4188 y Fp(\017)60 b | |
8218 | Ft(Sp)s(ecifying)28 b(the)i(`)p Fs(-p)p Ft(')h(option)f(to)h(the)f | |
8219 | Fs(command)f Ft(builtin.)225 4323 y Fp(\017)60 b Ft(T)-8 | |
8220 | b(urning)28 b(o\013)j(restricted)f(mo)s(de)g(with)f(`)p | |
8221 | Fs(set)h(+r)p Ft(')g(or)g(`)p Fs(set)g(+o)g(restricted)p | |
8222 | Ft('.)275 4483 y(These)g(restrictions)f(are)i(enforced)f(after)h(an)m | |
8223 | (y)g(startup)f(\014les)f(are)i(read.)275 4618 y(When)j(a)i(command)e | |
8224 | (that)i(is)e(found)g(to)h(b)s(e)g(a)g(shell)e(script)h(is)g(executed)i | |
8225 | (\(see)g(Section)f(3.8)h([Shell)150 4727 y(Scripts],)24 | |
8226 | b(page)f(31\),)j Fs(rbash)c Ft(turns)g(o\013)i(an)m(y)f(restrictions)f | |
8227 | (in)g(the)h(shell)f(spa)m(wned)g(to)i(execute)g(the)g(script.)150 | |
8228 | 4986 y Fr(6.11)68 b(Bash)45 b(POSIX)f(Mo)t(de)275 5230 | |
8229 | y Ft(Starting)20 b(Bash)h(with)e(the)i(`)p Fs(--posix)p | |
8230 | Ft(')e(command-line)h(option)g(or)h(executing)g(`)p Fs(set)30 | |
8231 | b(-o)f(posix)p Ft(')20 b(while)150 5340 y(Bash)33 b(is)e(running)f | |
8232 | (will)g(cause)j(Bash)f(to)i(conform)e(more)h(closely)f(to)h(the)g | |
8233 | Fl(posix)e Ft(1003.2)k(standard)d(b)m(y)p eop | |
8234 | %%Page: 77 83 | |
8235 | 77 82 bop 150 -116 a Ft(Chapter)30 b(6:)41 b(Bash)30 | |
8236 | b(F)-8 b(eatures)2484 b(77)150 299 y(c)m(hanging)37 b(the)g(b)s(eha)m | |
8237 | (vior)f(to)h(matc)m(h)h(that)f(sp)s(eci\014ed)f(b)m(y)g | |
8238 | Fl(posix)g Ft(in)g(areas)h(where)g(the)g(Bash)g(default)150 | |
8239 | 408 y(di\013ers.)275 554 y(When)30 b(in)m(v)m(ok)m(ed)g(as)h | |
8240 | Fs(sh)p Ft(,)f(Bash)h(en)m(ters)g Fl(posix)e Ft(mo)s(de)h(after)h | |
8241 | (reading)f(the)g(startup)g(\014les.)275 700 y(The)f(follo)m(wing)g | |
8242 | (list)g(is)h(what's)g(c)m(hanged)h(when)e(`)p Fl(posix)h | |
8243 | Ft(mo)s(de')h(is)e(in)g(e\013ect:)199 846 y(1.)61 b(When)28 | |
8244 | b(a)i(command)e(in)f(the)i(hash)f(table)h(no)f(longer)g(exists,)h(Bash) | |
8245 | g(will)d(re-searc)m(h)k Fs($PATH)d Ft(to)i(\014nd)330 | |
8246 | 955 y(the)i(new)e(lo)s(cation.)41 b(This)28 b(is)i(also)g(a)m(v)-5 | |
8247 | b(ailable)30 b(with)f(`)p Fs(shopt)g(-s)h(checkhash)p | |
8248 | Ft('.)199 1095 y(2.)61 b(The)42 b(message)h(prin)m(ted)d(b)m(y)i(the)g | |
8249 | (job)g(con)m(trol)h(co)s(de)f(and)f(builtins)e(when)i(a)h(job)g(exits)g | |
8250 | (with)f(a)330 1205 y(non-zero)31 b(status)g(is)e(`Done\(status\)'.)199 | |
8251 | 1345 y(3.)61 b(The)40 b(message)h(prin)m(ted)e(b)m(y)h(the)h(job)f(con) | |
8252 | m(trol)g(co)s(de)h(and)f(builtins)c(when)k(a)g(job)g(is)g(stopp)s(ed)f | |
8253 | (is)330 1455 y(`Stopp)s(ed\()p Fq(signame)5 b Ft(\)',)30 | |
8254 | b(where)g Fq(signame)35 b Ft(is,)30 b(for)g(example,)g | |
8255 | Fs(SIGTSTP)p Ft(.)199 1595 y(4.)61 b(Reserv)m(ed)31 b(w)m(ords)f(ma)m | |
8256 | (y)h(not)f(b)s(e)g(aliased.)199 1735 y(5.)61 b(The)39 | |
8257 | b Fl(posix)f Ft(1003.2)k Fs(PS1)d Ft(and)f Fs(PS2)h Ft(expansions)f(of) | |
8258 | h(`)p Fs(!)p Ft(')h(to)g(the)f(history)f(n)m(um)m(b)s(er)g(and)h(`)p | |
8259 | Fs(!!)p Ft(')g(to)330 1844 y(`)p Fs(!)p Ft(')c(are)h(enabled,)g(and)f | |
8260 | (parameter)g(expansion)g(is)f(p)s(erformed)g(on)h(the)h(v)-5 | |
8261 | b(alues)34 b(of)i Fs(PS1)e Ft(and)h Fs(PS2)330 1954 y | |
8262 | Ft(regardless)30 b(of)g(the)h(setting)f(of)h(the)f Fs(promptvars)e | |
8263 | Ft(option.)199 2094 y(6.)61 b(The)30 b Fl(posix)g Ft(1003.2)i(startup)e | |
8264 | (\014les)g(are)g(executed)i(\()p Fs($ENV)p Ft(\))e(rather)g(than)g(the) | |
8265 | g(normal)g(Bash)g(\014les.)199 2234 y(7.)61 b(Tilde)28 | |
8266 | b(expansion)h(is)f(only)h(p)s(erformed)g(on)h(assignmen)m(ts)f | |
8267 | (preceding)g(a)h(command)g(name,)g(rather)330 2344 y(than)g(on)g(all)g | |
8268 | (assignmen)m(t)g(statemen)m(ts)i(on)e(the)h(line.)199 | |
8269 | 2484 y(8.)61 b(The)30 b(default)f(history)h(\014le)f(is)h(`)p | |
8270 | Fs(~/.sh_history)p Ft(')d(\(this)j(is)f(the)h(default)g(v)-5 | |
8271 | b(alue)30 b(of)g Fs($HISTFILE)p Ft(\).)199 2624 y(9.)61 | |
8272 | b(The)23 b(output)f(of)i(`)p Fs(kill)29 b(-l)p Ft(')23 | |
8273 | b(prin)m(ts)e(all)h(the)i(signal)d(names)i(on)g(a)h(single)e(line,)h | |
8274 | (separated)g(b)m(y)g(spaces,)330 2733 y(without)29 b(the)i(`)p | |
8275 | Fs(SIG)p Ft(')f(pre\014x.)154 2874 y(10.)61 b(The)30 | |
8276 | b Fs(kill)f Ft(builtin)e(do)s(es)j(not)h(accept)h(signal)d(names)h | |
8277 | (with)f(a)i(`)p Fs(SIG)p Ft(')f(pre\014x.)154 3014 y(11.)61 | |
8278 | b(Non-in)m(teractiv)m(e)32 b(shells)c(exit)i(if)g Fq(\014lename)k | |
8279 | Ft(in)29 b Fs(.)h Fq(\014lename)35 b Ft(is)30 b(not)g(found.)154 | |
8280 | 3154 y(12.)61 b(Non-in)m(teractiv)m(e)39 b(shells)d(exit)i(if)f(a)h | |
8281 | (syn)m(tax)g(error)g(in)e(an)i(arithmetic)f(expansion)g(results)f(in)h | |
8282 | (an)330 3263 y(in)m(v)-5 b(alid)28 b(expression.)154 | |
8283 | 3403 y(13.)61 b(Redirection)23 b(op)s(erators)h(do)g(not)g(p)s(erform)f | |
8284 | (\014lename)g(expansion)g(on)h(the)g(w)m(ord)f(in)g(the)h(redirection) | |
8285 | 330 3513 y(unless)29 b(the)h(shell)f(is)g(in)m(teractiv)m(e.)154 | |
8286 | 3653 y(14.)61 b(Redirection)29 b(op)s(erators)i(do)f(not)h(p)s(erform)e | |
8287 | (w)m(ord)h(splitting)e(on)i(the)h(w)m(ord)f(in)f(the)h(redirection.)154 | |
8288 | 3793 y(15.)61 b(F)-8 b(unction)34 b(names)h(m)m(ust)f(b)s(e)g(v)-5 | |
8289 | b(alid)33 b(shell)f Fs(name)p Ft(s.)52 b(That)34 b(is,)h(they)g(ma)m(y) | |
8290 | g(not)g(con)m(tain)f(c)m(haracters)330 3903 y(other)f(than)g(letters,)g | |
8291 | (digits,)g(and)f(underscores,)h(and)f(ma)m(y)h(not)g(start)h(with)d(a)i | |
8292 | (digit.)47 b(Declaring)330 4012 y(a)31 b(function)e(with)g(an)h(in)m(v) | |
8293 | -5 b(alid)28 b(name)j(causes)f(a)h(fatal)g(syn)m(tax)g(error)f(in)f | |
8294 | (non-in)m(teractiv)m(e)i(shells.)154 4153 y(16.)61 b | |
8295 | Fl(posix)23 b Ft(1003.2)j(`sp)s(ecial')c(builtins)e(are)k(found)e(b)s | |
8296 | (efore)h(shell)f(functions)g(during)f(command)i(lo)s(okup.)154 | |
8297 | 4293 y(17.)61 b(If)33 b(a)h Fl(posix)f Ft(1003.2)j(sp)s(ecial)c | |
8298 | (builtin)f(returns)h(an)i(error)f(status,)i(a)f(non-in)m(teractiv)m(e)g | |
8299 | (shell)e(exits.)330 4402 y(The)43 b(fatal)i(errors)e(are)h(those)h | |
8300 | (listed)d(in)h(the)h(POSIX.2)g(standard,)j(and)c(include)f(things)h | |
8301 | (lik)m(e)330 4512 y(passing)24 b(incorrect)i(options,)g(redirection)e | |
8302 | (errors,)i(v)-5 b(ariable)24 b(assignmen)m(t)h(errors)g(for)g | |
8303 | (assignmen)m(ts)330 4621 y(preceding)k(the)i(command)f(name,)h(and)e | |
8304 | (so)i(on.)154 4762 y(18.)61 b(If)33 b(the)h Fs(cd)f Ft(builtin)e | |
8305 | (\014nds)h(a)i(directory)f(to)i(c)m(hange)g(to)f(using)f | |
8306 | Fs($CDPATH)p Ft(,)g(the)h(v)-5 b(alue)33 b(it)g(assigns)g(to)330 | |
8307 | 4871 y(the)e Fs(PWD)e Ft(v)-5 b(ariable)29 b(do)s(es)h(not)h(con)m | |
8308 | (tain)g(an)m(y)f(sym)m(b)s(olic)f(links,)f(as)j(if)e(`)p | |
8309 | Fs(cd)h(-P)p Ft(')g(had)g(b)s(een)g(executed.)154 5011 | |
8310 | y(19.)61 b(If)34 b Fs(CDPATH)f Ft(is)g(set,)j(the)f Fs(cd)f | |
8311 | Ft(builtin)d(will)g(not)k(implicitly)c(app)s(end)h(the)j(curren)m(t)f | |
8312 | (directory)g(to)h(it.)330 5121 y(This)28 b(means)h(that)h | |
8313 | Fs(cd)f Ft(will)e(fail)h(if)h(no)g(v)-5 b(alid)28 b(directory)h(name)g | |
8314 | (can)h(b)s(e)f(constructed)h(from)f(an)m(y)h(of)330 5230 | |
8315 | y(the)i(en)m(tries)f(in)f Fs($CDPATH)p Ft(,)f(ev)m(en)j(if)f(the)g(a)h | |
8316 | (directory)f(with)f(the)h(same)h(name)f(as)h(the)g(name)f(giv)m(en)330 | |
8317 | 5340 y(as)g(an)f(argumen)m(t)h(to)g Fs(cd)f Ft(exists)g(in)f(the)h | |
8318 | (curren)m(t)g(directory)-8 b(.)p eop | |
8319 | %%Page: 78 84 | |
8320 | 78 83 bop 150 -116 a Ft(78)2572 b(Bash)31 b(Reference)g(Man)m(ual)154 | |
8321 | 299 y(20.)61 b(A)31 b(non-in)m(teractiv)m(e)h(shell)d(exits)i(with)e | |
8322 | (an)i(error)g(status)g(if)f(a)h(v)-5 b(ariable)30 b(assignmen)m(t)h | |
8323 | (error)f(o)s(ccurs)330 408 y(when)38 b(no)h(command)g(name)g(follo)m | |
8324 | (ws)g(the)g(assignmen)m(t)g(statemen)m(ts.)69 b(A)39 | |
8325 | b(v)-5 b(ariable)38 b(assignmen)m(t)330 518 y(error)30 | |
8326 | b(o)s(ccurs,)g(for)g(example,)h(when)e(trying)h(to)h(assign)e(a)i(v)-5 | |
8327 | b(alue)30 b(to)h(a)g(readonly)e(v)-5 b(ariable.)154 653 | |
8328 | y(21.)61 b(A)43 b(non-in)m(teractiv)m(e)g(shell)e(exits)i(with)f(an)g | |
8329 | (error)h(status)g(if)f(the)h(iteration)f(v)-5 b(ariable)42 | |
8330 | b(in)g(a)h Fs(for)330 762 y Ft(statemen)m(t)32 b(or)f(the)f(selection)g | |
8331 | (v)-5 b(ariable)30 b(in)f(a)h Fs(select)f Ft(statemen)m(t)j(is)e(a)g | |
8332 | (readonly)g(v)-5 b(ariable.)154 897 y(22.)61 b(Pro)s(cess)30 | |
8333 | b(substitution)e(is)i(not)g(a)m(v)-5 b(ailable.)154 1031 | |
8334 | y(23.)61 b(Assignmen)m(t)31 b(statemen)m(ts)h(preceding)e | |
8335 | Fl(posix)h Ft(1003.2)i(sp)s(ecial)d(builtins)d(p)s(ersist)j(in)f(the)j | |
8336 | (shell)d(en-)330 1141 y(vironmen)m(t)h(after)g(the)h(builtin)c | |
8337 | (completes.)154 1275 y(24.)61 b(Assignmen)m(t)34 b(statemen)m(ts)i | |
8338 | (preceding)e(shell)e(function)h(calls)h(p)s(ersist)f(in)g(the)i(shell)d | |
8339 | (en)m(vironmen)m(t)330 1385 y(after)f(the)f(function)g(returns,)f(as)i | |
8340 | (if)e(a)i Fl(posix)e Ft(sp)s(ecial)g(builtin)e(command)j(had)g(b)s(een) | |
8341 | g(executed.)154 1519 y(25.)61 b(The)38 b Fs(export)f | |
8342 | Ft(and)g Fs(readonly)f Ft(builtin)f(commands)j(displa)m(y)f(their)g | |
8343 | (output)h(in)f(the)i(format)g(re-)330 1629 y(quired)29 | |
8344 | b(b)m(y)h Fl(posix)f Ft(1003.2.)154 1763 y(26.)61 b(The)30 | |
8345 | b Fs(trap)f Ft(builtin)e(displa)m(ys)h(signal)i(names)g(without)f(the)i | |
8346 | (leading)e Fs(SIG)p Ft(.)154 1898 y(27.)61 b(The)24 b | |
8347 | Fs(trap)g Ft(builtin)d(do)s(esn't)k(c)m(hec)m(k)h(the)f(\014rst)f | |
8348 | (argumen)m(t)h(for)g(a)g(p)s(ossible)d(signal)i(sp)s(eci\014cation)g | |
8349 | (and)330 2007 y(rev)m(ert)32 b(the)f(signal)f(handling)f(to)j(the)g | |
8350 | (original)d(disp)s(osition)f(if)i(it)h(is.)43 b(If)30 | |
8351 | b(users)h(w)m(an)m(t)h(to)g(reset)g(the)330 2117 y(handler)j(for)h(a)i | |
8352 | (giv)m(en)e(signal)g(to)h(the)g(original)e(disp)s(osition,)h(they)h | |
8353 | (should)d(use)j(`)p Fs(-)p Ft(')g(as)g(the)g(\014rst)330 | |
8354 | 2227 y(argumen)m(t.)154 2361 y(28.)61 b(The)21 b Fs(.)h | |
8355 | Ft(and)f Fs(source)f Ft(builtins)e(do)j(not)h(searc)m(h)h(the)f(curren) | |
8356 | m(t)f(directory)g(for)h(the)g(\014lename)e(argumen)m(t)330 | |
8357 | 2471 y(if)29 b(it)h(is)g(not)g(found)f(b)m(y)i(searc)m(hing)f | |
8358 | Fs(PATH)p Ft(.)154 2605 y(29.)61 b(Subshells)18 b(spa)m(wned)j(to)h | |
8359 | (execute)g(command)g(substitutions)d(inherit)g(the)i(v)-5 | |
8360 | b(alue)21 b(of)h(the)f(`)p Fs(-e)p Ft(')g(option)330 | |
8361 | 2715 y(from)34 b(the)h(paren)m(t)g(shell.)53 b(When)34 | |
8362 | b(not)i(in)d Fl(posix)h Ft(mo)s(de,)i(Bash)f(clears)g(the)g(`)p | |
8363 | Fs(-e)p Ft(')f(option)h(in)e(suc)m(h)330 2824 y(subshells.)154 | |
8364 | 2959 y(30.)61 b(Alias)29 b(expansion)h(is)f(alw)m(a)m(ys)i(enabled,)e | |
8365 | (ev)m(en)j(in)d(non-in)m(teractiv)m(e)i(shells.)154 3093 | |
8366 | y(31.)61 b(When)43 b(the)g Fs(alias)f Ft(builtin)d(displa)m(ys)j(alias) | |
8367 | g(de\014nitions,)i(it)e(do)s(es)h(not)g(displa)m(y)f(them)h(with)f(a) | |
8368 | 330 3203 y(leading)29 b(`)p Fs(alias)g Ft(')i(unless)e(the)h(`)p | |
8369 | Fs(-p)p Ft(')g(option)g(is)g(supplied.)154 3337 y(32.)61 | |
8370 | b(When)40 b(the)g Fs(set)f Ft(builtin)e(is)i(in)m(v)m(ok)m(ed)h | |
8371 | (without)f(options,)j(it)e(do)s(es)g(not)g(displa)m(y)e(shell)g | |
8372 | (function)330 3447 y(names)30 b(and)g(de\014nitions.)154 | |
8373 | 3582 y(33.)61 b(When)36 b(the)g Fs(set)g Ft(builtin)d(is)i(in)m(v)m(ok) | |
8374 | m(ed)i(without)e(options,)i(it)f(displa)m(ys)e(v)-5 b(ariable)35 | |
8375 | b(v)-5 b(alues)36 b(without)330 3691 y(quotes,)26 b(unless)c(they)j | |
8376 | (con)m(tain)f(shell)e(metac)m(haracters,)28 b(ev)m(en)d(if)e(the)h | |
8377 | (result)f(con)m(tains)i(nonprin)m(ting)330 3801 y(c)m(haracters.)154 | |
8378 | 3935 y(34.)61 b(When)35 b(the)g Fs(cd)f Ft(builtin)e(is)i(in)m(v)m(ok)m | |
8379 | (ed)i(in)d Fq(logical)38 b Ft(mo)s(de,)e(and)f(the)g(pathname)g | |
8380 | (constructed)g(from)330 4045 y Fs($PWD)i Ft(and)h(the)h(directory)e | |
8381 | (name)i(supplied)c(as)k(an)f(argumen)m(t)h(do)s(es)f(not)g(refer)h(to)g | |
8382 | (an)f(existing)330 4154 y(directory)-8 b(,)31 b Fs(cd)e | |
8383 | Ft(will)f(fail)h(instead)h(of)g(falling)e(bac)m(k)k(to)f | |
8384 | Fq(ph)m(ysical)h Ft(mo)s(de.)275 4314 y(There)d(is)h(other)g | |
8385 | Fl(posix)g Ft(1003.2)j(b)s(eha)m(vior)c(that)i(Bash)g(do)s(es)f(not)h | |
8386 | (implemen)m(t.)39 b(Sp)s(eci\014cally:)199 4448 y(1.)61 | |
8387 | b(Assignmen)m(t)25 b(statemen)m(ts)j(a\013ect)f(the)f(execution)f(en)m | |
8388 | (vironmen)m(t)h(of)g(all)e(builtins,)f(not)j(just)f(sp)s(ecial)330 | |
8389 | 4558 y(ones.)199 4692 y(2.)61 b(When)20 b(a)h(subshell)d(is)i(created)h | |
8390 | (to)h(execute)g(a)f(shell)d(script)i(with)f(execute)j(p)s(ermission,)e | |
8391 | (but)g(without)330 4802 y(a)35 b(leading)f(`)p Fs(#!)p | |
8392 | Ft(',)i(Bash)g(sets)f Fs($0)f Ft(to)i(the)f(full)e(pathname)i(of)g(the) | |
8393 | g(script)f(as)h(found)f(b)m(y)h(searc)m(hing)330 4912 | |
8394 | y Fs($PATH)p Ft(,)29 b(rather)h(than)h(the)f(command)g(as)h(t)m(yp)s | |
8395 | (ed)f(b)m(y)g(the)h(user.)199 5046 y(3.)61 b(When)28 | |
8396 | b(using)e(`)p Fs(.)p Ft(')i(to)g(source)g(a)h(shell)d(script)g(found)h | |
8397 | (in)f Fs($PATH)p Ft(,)i(bash)f(c)m(hec)m(ks)i(execute)g(p)s(ermission) | |
8398 | 330 5156 y(bits)g(rather)i(than)f(read)g(p)s(ermission)d(bits,)j(just)g | |
8399 | (as)g(if)f(it)h(w)m(ere)h(searc)m(hing)f(for)h(a)f(command.)p | |
8400 | eop | |
8401 | %%Page: 79 85 | |
8402 | 79 84 bop 150 -116 a Ft(Chapter)30 b(7:)41 b(Job)30 b(Con)m(trol)2570 | |
8403 | b(79)150 299 y Fo(7)80 b(Job)54 b(Con)l(trol)275 544 | |
8404 | y Ft(This)33 b(c)m(hapter)j(discusses)e(what)h(job)g(con)m(trol)h(is,)g | |
8405 | (ho)m(w)f(it)g(w)m(orks,)i(and)e(ho)m(w)g(Bash)h(allo)m(ws)e(y)m(ou)i | |
8406 | (to)150 653 y(access)c(its)d(facilities.)150 919 y Fr(7.1)68 | |
8407 | b(Job)45 b(Con)l(trol)h(Basics)275 1167 y Ft(Job)30 b(con)m(trol)i | |
8408 | (refers)f(to)h(the)g(abilit)m(y)d(to)j(selectiv)m(ely)g(stop)f(\(susp)s | |
8409 | (end\))f(the)h(execution)h(of)f(pro)s(cesses)150 1277 | |
8410 | y(and)24 b(con)m(tin)m(ue)h(\(resume\))g(their)f(execution)h(at)g(a)h | |
8411 | (later)e(p)s(oin)m(t.)38 b(A)25 b(user)f(t)m(ypically)g(emplo)m(ys)g | |
8412 | (this)g(facilit)m(y)150 1386 y(via)30 b(an)g(in)m(teractiv)m(e)h(in)m | |
8413 | (terface)g(supplied)d(join)m(tly)h(b)m(y)h(the)h(system's)f(terminal)f | |
8414 | (driv)m(er)g(and)h(Bash.)275 1524 y(The)23 b(shell)g(asso)s(ciates)i(a) | |
8415 | g Fq(job)h Ft(with)d(eac)m(h)j(pip)s(eline.)35 b(It)25 | |
8416 | b(k)m(eeps)f(a)h(table)g(of)f(curren)m(tly)g(executing)g(jobs,)150 | |
8417 | 1634 y(whic)m(h)32 b(ma)m(y)j(b)s(e)e(listed)f(with)g(the)i | |
8418 | Fs(jobs)f Ft(command.)50 b(When)33 b(Bash)h(starts)g(a)g(job)g(async)m | |
8419 | (hronously)-8 b(,)33 b(it)150 1744 y(prin)m(ts)c(a)i(line)d(that)j(lo)s | |
8420 | (oks)f(lik)m(e:)390 1882 y Fs([1])47 b(25647)150 2020 | |
8421 | y Ft(indicating)31 b(that)j(this)e(job)h(is)f(job)h(n)m(um)m(b)s(er)f | |
8422 | (1)i(and)f(that)g(the)h(pro)s(cess)f Fl(id)g Ft(of)g(the)h(last)f(pro)s | |
8423 | (cess)g(in)f(the)150 2129 y(pip)s(eline)39 b(asso)s(ciated)k(with)e | |
8424 | (this)g(job)h(is)g(25647.)78 b(All)41 b(of)i(the)g(pro)s(cesses)f(in)f | |
8425 | (a)i(single)e(pip)s(eline)e(are)150 2239 y(mem)m(b)s(ers)30 | |
8426 | b(of)g(the)h(same)f(job.)41 b(Bash)30 b(uses)g(the)h | |
8427 | Fq(job)h Ft(abstraction)e(as)h(the)g(basis)e(for)h(job)g(con)m(trol.) | |
8428 | 275 2377 y(T)-8 b(o)23 b(facilitate)g(the)g(implemen)m(tation)f(of)i | |
8429 | (the)f(user)f(in)m(terface)i(to)g(job)f(con)m(trol,)i(the)e(op)s | |
8430 | (erating)g(system)150 2486 y(main)m(tains)i(the)h(notion)g(of)g(a)g | |
8431 | (curren)m(t)g(terminal)e(pro)s(cess)i(group)g Fl(id)p | |
8432 | Ft(.)39 b(Mem)m(b)s(ers)26 b(of)g(this)f(pro)s(cess)g(group)150 | |
8433 | 2596 y(\(pro)s(cesses)h(whose)g(pro)s(cess)g(group)g | |
8434 | Fl(id)g Ft(is)g(equal)g(to)h(the)f(curren)m(t)g(terminal)f(pro)s(cess)h | |
8435 | (group)f Fl(id)p Ft(\))i(receiv)m(e)150 2706 y(k)m(eyb)s | |
8436 | (oard-generated)22 b(signals)e(suc)m(h)g(as)h Fs(SIGINT)p | |
8437 | Ft(.)36 b(These)21 b(pro)s(cesses)g(are)g(said)f(to)h(b)s(e)g(in)e(the) | |
8438 | i(foreground.)150 2815 y(Bac)m(kground)38 b(pro)s(cesses)f(are)h(those) | |
8439 | g(whose)f(pro)s(cess)g(group)g Fl(id)h Ft(di\013ers)e(from)h(the)g | |
8440 | (terminal's;)j(suc)m(h)150 2925 y(pro)s(cesses)24 b(are)g(imm)m(une)f | |
8441 | (to)h(k)m(eyb)s(oard-generated)h(signals.)38 b(Only)22 | |
8442 | b(foreground)h(pro)s(cesses)h(are)g(allo)m(w)m(ed)150 | |
8443 | 3034 y(to)35 b(read)f(from)f(or)h(write)f(to)i(the)f(terminal.)50 | |
8444 | b(Bac)m(kground)34 b(pro)s(cesses)g(whic)m(h)f(attempt)i(to)g(read)e | |
8445 | (from)150 3144 y(\(write)d(to\))h(the)g(terminal)e(are)i(sen)m(t)g(a)f | |
8446 | Fs(SIGTTIN)f Ft(\()p Fs(SIGTTOU)p Ft(\))g(signal)g(b)m(y)h(the)h | |
8447 | (terminal)e(driv)m(er,)g(whic)m(h,)150 3254 y(unless)g(caugh)m(t,)i | |
8448 | (susp)s(ends)d(the)j(pro)s(cess.)275 3392 y(If)j(the)i(op)s(erating)f | |
8449 | (system)g(on)h(whic)m(h)e(Bash)h(is)g(running)d(supp)s(orts)i(job)h | |
8450 | (con)m(trol,)i(Bash)f(con)m(tains)150 3501 y(facilities)26 | |
8451 | b(to)j(use)f(it.)39 b(T)m(yping)27 b(the)h Fq(susp)s(end)h | |
8452 | Ft(c)m(haracter)h(\(t)m(ypically)d(`)p Fs(^Z)p Ft(',)i(Con)m(trol-Z\))f | |
8453 | (while)e(a)i(pro)s(cess)150 3611 y(is)41 b(running)f(causes)j(that)g | |
8454 | (pro)s(cess)f(to)h(b)s(e)f(stopp)s(ed)f(and)h(returns)f(con)m(trol)i | |
8455 | (to)g(Bash.)77 b(T)m(yping)41 b(the)150 3720 y Fq(dela)m(y)m(ed)k(susp) | |
8456 | s(end)g Ft(c)m(haracter)h(\(t)m(ypically)d(`)p Fs(^Y)p | |
8457 | Ft(',)48 b(Con)m(trol-Y\))d(causes)f(the)h(pro)s(cess)e(to)i(b)s(e)f | |
8458 | (stopp)s(ed)150 3830 y(when)26 b(it)h(attempts)i(to)f(read)f(input)f | |
8459 | (from)g(the)i(terminal,)f(and)g(con)m(trol)g(to)h(b)s(e)f(returned)f | |
8460 | (to)j(Bash.)39 b(The)150 3940 y(user)e(then)g(manipulates)f(the)i | |
8461 | (state)h(of)f(this)e(job,)k(using)c(the)i Fs(bg)f Ft(command)g(to)h | |
8462 | (con)m(tin)m(ue)g(it)f(in)g(the)150 4049 y(bac)m(kground,)h(the)f | |
8463 | Fs(fg)g Ft(command)f(to)i(con)m(tin)m(ue)f(it)f(in)f(the)i(foreground,) | |
8464 | h(or)f(the)g Fs(kill)f Ft(command)g(to)150 4159 y(kill)24 | |
8465 | b(it.)39 b(A)27 b(`)p Fs(^Z)p Ft(')g(tak)m(es)h(e\013ect)g(immediately) | |
8466 | -8 b(,)26 b(and)g(has)h(the)f(additional)f(side)g(e\013ect)k(of)d | |
8467 | (causing)g(p)s(ending)150 4268 y(output)k(and)g(t)m(yp)s(eahead)h(to)g | |
8468 | (b)s(e)e(discarded.)275 4406 y(There)j(are)g(a)h(n)m(um)m(b)s(er)e(of)i | |
8469 | (w)m(a)m(ys)g(to)h(refer)e(to)h(a)g(job)f(in)f(the)i(shell.)45 | |
8470 | b(The)32 b(c)m(haracter)i(`)p Fs(\045)p Ft(')f(in)m(tro)s(duces)150 | |
8471 | 4516 y(a)e(job)f(name.)275 4654 y(Job)h(n)m(um)m(b)s(er)f | |
8472 | Fs(n)h Ft(ma)m(y)h(b)s(e)f(referred)g(to)h(as)g(`)p Fs(\045n)p | |
8473 | Ft('.)44 b(The)31 b(sym)m(b)s(ols)f(`)p Fs(\045\045)p | |
8474 | Ft(')i(and)f(`)p Fs(\045+)p Ft(')g(refer)h(to)g(the)g(shell's)150 | |
8475 | 4764 y(notion)42 b(of)g(the)h(curren)m(t)f(job,)j(whic)m(h)c(is)g(the)h | |
8476 | (last)h(job)e(stopp)s(ed)h(while)e(it)i(w)m(as)g(in)f(the)i(foreground) | |
8477 | 150 4873 y(or)36 b(started)h(in)e(the)h(bac)m(kground.)58 | |
8478 | b(The)36 b(previous)f(job)g(ma)m(y)i(b)s(e)f(referenced)g(using)f(`)p | |
8479 | Fs(\045-)p Ft('.)58 b(In)35 b(output)150 4983 y(p)s(ertaining)24 | |
8480 | b(to)j(jobs)e(\(e.g.,)k(the)d(output)g(of)g(the)g Fs(jobs)f | |
8481 | Ft(command\),)j(the)e(curren)m(t)g(job)g(is)f(alw)m(a)m(ys)h(\015agged) | |
8482 | 150 5092 y(with)j(a)i(`)p Fs(+)p Ft(',)g(and)e(the)i(previous)e(job)h | |
8483 | (with)f(a)i(`)p Fs(-)p Ft('.)275 5230 y(A)38 b(job)g(ma)m(y)h(also)f(b) | |
8484 | s(e)g(referred)f(to)j(using)c(a)j(pre\014x)e(of)i(the)f(name)h(used)e | |
8485 | (to)i(start)g(it,)h(or)f(using)e(a)150 5340 y(substring)28 | |
8486 | b(that)j(app)s(ears)f(in)f(its)h(command)g(line.)39 b(F)-8 | |
8487 | b(or)31 b(example,)f(`)p Fs(\045ce)p Ft(')g(refers)g(to)h(a)g(stopp)s | |
8488 | (ed)e Fs(ce)h Ft(job.)p eop | |
8489 | %%Page: 80 86 | |
8490 | 80 85 bop 150 -116 a Ft(80)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
8491 | 299 y(Using)26 b(`)p Fs(\045?ce)p Ft(',)h(on)f(the)h(other)g(hand,)g | |
8492 | (refers)f(to)h(an)m(y)g(job)g(con)m(taining)f(the)h(string)e(`)p | |
8493 | Fs(ce)p Ft(')i(in)e(its)h(command)150 408 y(line.)39 | |
8494 | b(If)30 b(the)h(pre\014x)e(or)h(substring)e(matc)m(hes)k(more)e(than)h | |
8495 | (one)f(job,)h(Bash)f(rep)s(orts)g(an)g(error.)275 544 | |
8496 | y(Simply)e(naming)i(a)h(job)g(can)g(b)s(e)f(used)h(to)g(bring)e(it)i | |
8497 | (in)m(to)g(the)g(foreground:)41 b(`)p Fs(\0451)p Ft(')31 | |
8498 | b(is)f(a)i(synon)m(ym)e(for)150 654 y(`)p Fs(fg)g(\0451)p | |
8499 | Ft(',)i(bringing)d(job)i(1)g(from)g(the)h(bac)m(kground)f(in)m(to)h | |
8500 | (the)f(foreground.)44 b(Similarly)-8 b(,)28 b(`)p Fs(\0451)i(&)p | |
8501 | Ft(')i(resumes)150 763 y(job)e(1)h(in)e(the)h(bac)m(kground,)h(equiv)-5 | |
8502 | b(alen)m(t)30 b(to)h(`)p Fs(bg)f(\0451)p Ft(')275 899 | |
8503 | y(The)g(shell)g(learns)g(immediately)g(whenev)m(er)h(a)h(job)f(c)m | |
8504 | (hanges)h(state.)45 b(Normally)-8 b(,)31 b(Bash)g(w)m(aits)h(un)m(til) | |
8505 | 150 1009 y(it)24 b(is)g(ab)s(out)g(to)i(prin)m(t)d(a)i(prompt)f(b)s | |
8506 | (efore)g(rep)s(orting)g(c)m(hanges)h(in)f(a)h(job's)f(status)h(so)g(as) | |
8507 | g(to)g(not)g(in)m(terrupt)150 1119 y(an)m(y)g(other)g(output.)39 | |
8508 | b(If)24 b(the)i(`)p Fs(-b)p Ft(')e(option)h(to)g(the)g | |
8509 | Fs(set)f Ft(builtin)e(is)i(enabled,)h(Bash)g(rep)s(orts)f(suc)m(h)h(c)m | |
8510 | (hanges)150 1228 y(immediately)j(\(see)i(Section)f(4.3)h([The)f(Set)h | |
8511 | (Builtin],)d(page)j(50\).)42 b(An)m(y)29 b(trap)g(on)g | |
8512 | Fs(SIGCHLD)f Ft(is)g(executed)150 1338 y(for)i(eac)m(h)i(c)m(hild)c | |
8513 | (pro)s(cess)i(that)h(exits.)275 1474 y(If)e(an)g(attempt)i(to)g(exit)e | |
8514 | (Bash)h(is)f(while)f(jobs)h(are)h(stopp)s(ed,)f(the)h(shell)e(prin)m | |
8515 | (ts)g(a)i(message)h(w)m(arning)150 1583 y(that)f(there)g(are)g(stopp)s | |
8516 | (ed)f(jobs.)40 b(The)30 b Fs(jobs)e Ft(command)i(ma)m(y)g(then)f(b)s(e) | |
8517 | h(used)f(to)h(insp)s(ect)f(their)f(status.)150 1693 y(If)i(a)h(second)g | |
8518 | (attempt)g(to)h(exit)e(is)g(made)g(without)g(an)g(in)m(terv)m(ening)g | |
8519 | (command,)h(Bash)f(do)s(es)h(not)f(prin)m(t)150 1802 | |
8520 | y(another)h(w)m(arning,)e(and)h(the)g(stopp)s(ed)g(jobs)g(are)g | |
8521 | (terminated.)150 2063 y Fr(7.2)68 b(Job)45 b(Con)l(trol)h(Builtins)150 | |
8522 | 2308 y Fs(bg)870 2443 y(bg)h([)p Fj(jobspec)11 b Fs(])630 | |
8523 | 2578 y Ft(Resume)28 b(the)g(susp)s(ended)d(job)j Fq(jobsp)s(ec)k | |
8524 | Ft(in)27 b(the)h(bac)m(kground,)h(as)f(if)f(it)g(had)g(b)s(een)g | |
8525 | (started)630 2688 y(with)k(`)p Fs(&)p Ft('.)45 b(If)31 | |
8526 | b Fq(jobsp)s(ec)37 b Ft(is)31 b(not)h(supplied,)d(the)j(curren)m(t)g | |
8527 | (job)f(is)g(used.)45 b(The)31 b(return)g(status)630 2797 | |
8528 | y(is)h(zero)h(unless)e(it)h(is)g(run)f(when)h(job)g(con)m(trol)h(is)f | |
8529 | (not)h(enabled,)g(or,)g(when)f(run)f(with)g(job)630 2907 | |
8530 | y(con)m(trol)37 b(enabled,)h(if)e Fq(jobsp)s(ec)42 b | |
8531 | Ft(w)m(as)37 b(not)h(found)d(or)i Fq(jobsp)s(ec)42 b | |
8532 | Ft(sp)s(eci\014es)36 b(a)h(job)g(that)h(w)m(as)630 3017 | |
8533 | y(started)31 b(without)e(job)h(con)m(trol.)150 3177 y | |
8534 | Fs(fg)870 3312 y(fg)47 b([)p Fj(jobspec)11 b Fs(])630 | |
8535 | 3448 y Ft(Resume)43 b(the)g(job)g Fq(jobsp)s(ec)48 b | |
8536 | Ft(in)42 b(the)h(foreground)g(and)f(mak)m(e)j(it)d(the)i(curren)m(t)f | |
8537 | (job.)78 b(If)630 3557 y Fq(jobsp)s(ec)41 b Ft(is)36 | |
8538 | b(not)g(supplied,)f(the)h(curren)m(t)h(job)f(is)f(used.)58 | |
8539 | b(The)36 b(return)f(status)h(is)g(that)h(of)630 3667 | |
8540 | y(the)d(command)g(placed)g(in)m(to)g(the)g(foreground,)g(or)g(non-zero) | |
8541 | h(if)e(run)g(when)g(job)g(con)m(trol)630 3776 y(is)h(disabled)f(or,)k | |
8542 | (when)d(run)g(with)g(job)h(con)m(trol)g(enabled,)h Fq(jobsp)s(ec)k | |
8543 | Ft(do)s(es)35 b(not)h(sp)s(ecify)e(a)630 3886 y(v)-5 | |
8544 | b(alid)29 b(job)h(or)g Fq(jobsp)s(ec)35 b Ft(sp)s(eci\014es)29 | |
8545 | b(a)i(job)f(that)h(w)m(as)g(started)g(without)e(job)h(con)m(trol.)150 | |
8546 | 4047 y Fs(jobs)870 4182 y(jobs)47 b([-lnprs])e([)p Fj(jobspec)11 | |
8547 | b Fs(])870 4291 y(jobs)47 b(-x)g Fj(command)56 b Fs([)p | |
8548 | Fj(arguments)11 b Fs(])630 4427 y Ft(The)30 b(\014rst)f(form)h(lists)f | |
8549 | (the)i(activ)m(e)g(jobs.)41 b(The)30 b(options)f(ha)m(v)m(e)j(the)e | |
8550 | (follo)m(wing)f(meanings:)630 4587 y Fs(-l)384 b Ft(List)30 | |
8551 | b(pro)s(cess)g Fl(id)p Ft(s)g(in)f(addition)g(to)i(the)f(normal)g | |
8552 | (information.)630 4748 y Fs(-n)384 b Ft(Displa)m(y)24 | |
8553 | b(information)f(only)i(ab)s(out)f(jobs)h(that)g(ha)m(v)m(e)i(c)m | |
8554 | (hanged)e(status)h(since)1110 4858 y(the)31 b(user)e(w)m(as)i(last)f | |
8555 | (noti\014ed)f(of)i(their)e(status.)630 5018 y Fs(-p)384 | |
8556 | b Ft(List)30 b(only)f(the)i(pro)s(cess)f Fl(id)g Ft(of)h(the)f(job's)g | |
8557 | (pro)s(cess)g(group)g(leader.)630 5179 y Fs(-r)384 b | |
8558 | Ft(Restrict)30 b(output)g(to)i(running)27 b(jobs.)630 | |
8559 | 5340 y Fs(-s)384 b Ft(Restrict)30 b(output)g(to)i(stopp)s(ed)d(jobs.)p | |
8560 | eop | |
8561 | %%Page: 81 87 | |
8562 | 81 86 bop 150 -116 a Ft(Chapter)30 b(7:)41 b(Job)30 b(Con)m(trol)2570 | |
8563 | b(81)630 299 y(If)23 b Fq(jobsp)s(ec)28 b Ft(is)23 b(giv)m(en,)i | |
8564 | (output)e(is)g(restricted)g(to)h(information)e(ab)s(out)h(that)h(job.) | |
8565 | 39 b(If)23 b Fq(jobsp)s(ec)630 408 y Ft(is)29 b(not)i(supplied,)c(the)k | |
8566 | (status)g(of)f(all)f(jobs)h(is)g(listed.)630 552 y(If)h(the)g(`)p | |
8567 | Fs(-x)p Ft(')g(option)g(is)f(supplied,)f Fs(jobs)h Ft(replaces)h(an)m | |
8568 | (y)g Fq(jobsp)s(ec)37 b Ft(found)29 b(in)h Fq(command)35 | |
8569 | b Ft(or)630 662 y Fq(argumen)m(ts)41 b Ft(with)36 b(the)i(corresp)s | |
8570 | (onding)d(pro)s(cess)i(group)f Fl(id)p Ft(,)k(and)c(executes)j | |
8571 | Fq(command)p Ft(,)630 771 y(passing)29 b(it)h Fq(argumen)m(t)r | |
8572 | Ft(s,)h(returning)e(its)g(exit)i(status.)150 949 y Fs(kill)870 | |
8573 | 1093 y(kill)47 b([-s)g Fj(sigspec)11 b Fs(])45 b([-n)i | |
8574 | Fj(signum)11 b Fs(])45 b([-)p Fj(sigspec)11 b Fs(])44 | |
8575 | b Fj(jobspec)57 b Fs(or)47 b Fj(pid)870 1202 y Fs(kill)g(-l)g([)p | |
8576 | Fj(exit_status)11 b Fs(])630 1346 y Ft(Send)22 b(a)i(signal)e(sp)s | |
8577 | (eci\014ed)g(b)m(y)h Fq(sigsp)s(ec)28 b Ft(or)c Fq(sign)m(um)e | |
8578 | Ft(to)i(the)g(pro)s(cess)f(named)g(b)m(y)g(job)g(sp)s(eci\014-)630 | |
8579 | 1456 y(cation)j Fq(jobsp)s(ec)31 b Ft(or)26 b(pro)s(cess)g | |
8580 | Fl(id)g Fq(pid)p Ft(.)38 b Fq(sigsp)s(ec)31 b Ft(is)25 | |
8581 | b(either)g(a)i(signal)d(name)j(suc)m(h)e(as)i Fs(SIGINT)630 | |
8582 | 1565 y Ft(\(with)e(or)h(without)g(the)g Fs(SIG)f Ft(pre\014x\))h(or)g | |
8583 | (a)h(signal)e(n)m(um)m(b)s(er;)h Fq(sign)m(um)f Ft(is)g(a)i(signal)e(n) | |
8584 | m(um)m(b)s(er.)630 1675 y(If)35 b Fq(sigsp)s(ec)k Ft(and)c | |
8585 | Fq(sign)m(um)f Ft(are)h(not)h(presen)m(t,)g Fs(SIGTERM)d | |
8586 | Ft(is)h(used.)54 b(The)35 b(`)p Fs(-l)p Ft(')g(option)f(lists)630 | |
8587 | 1785 y(the)d(signal)e(names.)41 b(If)31 b(an)m(y)f(argumen)m(ts)h(are)g | |
8588 | (supplied)d(when)h(`)p Fs(-l)p Ft(')i(is)e(giv)m(en,)i(the)g(names)630 | |
8589 | 1894 y(of)g(the)f(signals)f(corresp)s(onding)g(to)i(the)g(argumen)m(ts) | |
8590 | f(are)h(listed,)f(and)g(the)g(return)g(status)630 2004 | |
8591 | y(is)k(zero.)55 b Fq(exit)p 1122 2004 28 4 v 40 w(status)39 | |
8592 | b Ft(is)34 b(a)i(n)m(um)m(b)s(er)d(sp)s(ecifying)g(a)i(signal)f(n)m(um) | |
8593 | m(b)s(er)g(or)h(the)g(exit)g(status)630 2113 y(of)i(a)f(pro)s(cess)g | |
8594 | (terminated)g(b)m(y)h(a)f(signal.)58 b(The)36 b(return)f(status)i(is)e | |
8595 | (zero)i(if)f(at)h(least)g(one)630 2223 y(signal)30 b(w)m(as)h | |
8596 | (successfully)e(sen)m(t,)j(or)f(non-zero)h(if)e(an)h(error)f(o)s(ccurs) | |
8597 | h(or)g(an)g(in)m(v)-5 b(alid)28 b(option)630 2333 y(is)h(encoun)m | |
8598 | (tered.)150 2510 y Fs(wait)870 2654 y(wait)47 b([)p Fj(jobspec)56 | |
8599 | b Fs(or)47 b Fj(pid)11 b Fs(])630 2798 y Ft(W)-8 b(ait)44 | |
8600 | b(un)m(til)d(the)i(c)m(hild)f(pro)s(cess)g(sp)s(eci\014ed)g(b)m(y)h | |
8601 | (pro)s(cess)f Fl(id)i Fq(pid)g Ft(or)f(job)g(sp)s(eci\014cation)630 | |
8602 | 2907 y Fq(jobsp)s(ec)d Ft(exits)34 b(and)g(return)g(the)g(exit)h | |
8603 | (status)g(of)g(the)g(last)f(command)g(w)m(aited)h(for.)53 | |
8604 | b(If)35 b(a)630 3017 y(job)g(sp)s(ec)f(is)g(giv)m(en,)i(all)e(pro)s | |
8605 | (cesses)h(in)e(the)i(job)g(are)g(w)m(aited)g(for.)54 | |
8606 | b(If)35 b(no)f(argumen)m(ts)i(are)630 3127 y(giv)m(en,)c(all)e(curren)m | |
8607 | (tly)g(activ)m(e)i(c)m(hild)e(pro)s(cesses)h(are)g(w)m(aited)g(for,)h | |
8608 | (and)e(the)i(return)e(status)630 3236 y(is)g(zero.)44 | |
8609 | b(If)30 b(neither)g Fq(jobsp)s(ec)36 b Ft(nor)31 b Fq(pid)h | |
8610 | Ft(sp)s(eci\014es)e(an)h(activ)m(e)h(c)m(hild)e(pro)s(cess)g(of)h(the)g | |
8611 | (shell,)630 3346 y(the)g(return)e(status)i(is)e(127.)150 | |
8612 | 3524 y Fs(disown)870 3667 y(disown)46 b([-ar])g([-h])h([)p | |
8613 | Fj(jobspec)56 b Fs(...)o(])630 3811 y Ft(Without)31 b(options,)g(eac)m | |
8614 | (h)i Fq(jobsp)s(ec)j Ft(is)31 b(remo)m(v)m(ed)h(from)f(the)h(table)f | |
8615 | (of)h(activ)m(e)g(jobs.)44 b(If)31 b(the)630 3921 y(`)p | |
8616 | Fs(-h)p Ft(')36 b(option)g(is)g(giv)m(en,)i(the)f(job)f(is)g(not)g | |
8617 | (remo)m(v)m(ed)i(from)e(the)h(table,)h(but)e(is)f(mark)m(ed)i(so)630 | |
8618 | 4030 y(that)d Fs(SIGHUP)d Ft(is)i(not)g(sen)m(t)h(to)g(the)f(job)g(if)f | |
8619 | (the)i(shell)d(receiv)m(es)j(a)g Fs(SIGHUP)p Ft(.)47 | |
8620 | b(If)33 b Fq(jobsp)s(ec)38 b Ft(is)630 4140 y(not)32 | |
8621 | b(presen)m(t,)f(and)g(neither)g(the)g(`)p Fs(-a)p Ft(')g(nor)g(`)p | |
8622 | Fs(-r)p Ft(')g(option)g(is)g(supplied,)d(the)k(curren)m(t)f(job)g(is) | |
8623 | 630 4249 y(used.)58 b(If)36 b(no)g Fq(jobsp)s(ec)41 b | |
8624 | Ft(is)35 b(supplied,)g(the)i(`)p Fs(-a)p Ft(')f(option)g(means)g(to)h | |
8625 | (remo)m(v)m(e)h(or)e(mark)g(all)630 4359 y(jobs;)28 b(the)f(`)p | |
8626 | Fs(-r)p Ft(')g(option)f(without)g(a)h Fq(jobsp)s(ec)32 | |
8627 | b Ft(argumen)m(t)27 b(restricts)g(op)s(eration)f(to)i(running)630 | |
8628 | 4468 y(jobs.)150 4646 y Fs(suspend)870 4790 y(suspend)46 | |
8629 | b([-f])630 4934 y Ft(Susp)s(end)28 b(the)i(execution)h(of)g(this)e | |
8630 | (shell)f(un)m(til)h(it)h(receiv)m(es)h(a)g Fs(SIGCONT)e | |
8631 | Ft(signal.)39 b(The)30 b(`)p Fs(-f)p Ft(')630 5043 y(option)g(means)g | |
8632 | (to)h(susp)s(end)d(ev)m(en)j(if)f(the)g(shell)f(is)g(a)i(login)e | |
8633 | (shell.)275 5230 y(When)h(job)f(con)m(trol)i(is)e(not)i(activ)m(e,)h | |
8634 | (the)e Fs(kill)f Ft(and)h Fs(wait)f Ft(builtins)d(do)k(not)h(accept)h | |
8635 | Fq(jobsp)s(ec)j Ft(argu-)150 5340 y(men)m(ts.)41 b(They)30 | |
8636 | b(m)m(ust)g(b)s(e)g(supplied)d(pro)s(cess)j Fl(id)p Ft(s.)p | |
8637 | eop | |
8638 | %%Page: 82 88 | |
8639 | 82 87 bop 150 -116 a Ft(82)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
8640 | 299 y Fr(7.3)68 b(Job)45 b(Con)l(trol)h(V)-11 b(ariables)150 | |
8641 | 543 y Fs(auto_resume)630 653 y Ft(This)30 b(v)-5 b(ariable)30 | |
8642 | b(con)m(trols)h(ho)m(w)h(the)f(shell)f(in)m(teracts)i(with)e(the)i | |
8643 | (user)e(and)h(job)g(con)m(trol.)44 b(If)630 762 y(this)27 | |
8644 | b(v)-5 b(ariable)28 b(exists)g(then)g(single)f(w)m(ord)h(simple)f | |
8645 | (commands)h(without)f(redirections)h(are)630 872 y(treated)j(as)g | |
8646 | (candidates)e(for)h(resumption)f(of)h(an)g(existing)f(job.)41 | |
8647 | b(There)29 b(is)g(no)i(am)m(biguit)m(y)630 981 y(allo)m(w)m(ed;)d(if)e | |
8648 | (there)h(is)f(more)h(than)f(one)h(job)g(b)s(eginning)d(with)h(the)i | |
8649 | (string)f(t)m(yp)s(ed,)h(then)g(the)630 1091 y(most)j(recen)m(tly)g | |
8650 | (accessed)g(job)f(will)e(b)s(e)i(selected.)41 b(The)29 | |
8651 | b(name)g(of)h(a)g(stopp)s(ed)e(job,)i(in)e(this)630 1200 | |
8652 | y(con)m(text,)i(is)d(the)h(command)g(line)e(used)h(to)h(start)g(it.)40 | |
8653 | b(If)27 b(this)g(v)-5 b(ariable)26 b(is)h(set)h(to)h(the)e(v)-5 | |
8654 | b(alue)630 1310 y(`)p Fs(exact)p Ft(',)33 b(the)g(string)f(supplied)e | |
8655 | (m)m(ust)j(matc)m(h)g(the)h(name)f(of)g(a)g(stopp)s(ed)f(job)h | |
8656 | (exactly;)i(if)630 1420 y(set)29 b(to)h(`)p Fs(substring)p | |
8657 | Ft(',)d(the)i(string)f(supplied)d(needs)k(to)g(matc)m(h)h(a)f | |
8658 | (substring)e(of)i(the)g(name)630 1529 y(of)38 b(a)f(stopp)s(ed)g(job.) | |
8659 | 62 b(The)37 b(`)p Fs(substring)p Ft(')e(v)-5 b(alue)37 | |
8660 | b(pro)m(vides)f(functionalit)m(y)g(analogous)i(to)630 | |
8661 | 1639 y(the)g(`)p Fs(\045?)p Ft(')f(job)h Fl(id)f Ft(\(see)i(Section)e | |
8662 | (7.1)i([Job)f(Con)m(trol)f(Basics],)j(page)e(79\).)64 | |
8663 | b(If)37 b(set)h(to)h(an)m(y)630 1748 y(other)32 b(v)-5 | |
8664 | b(alue,)31 b(the)h(supplied)c(string)j(m)m(ust)g(b)s(e)g(a)h(pre\014x)f | |
8665 | (of)h(a)g(stopp)s(ed)e(job's)i(name;)g(this)630 1858 | |
8666 | y(pro)m(vides)d(functionalit)m(y)g(analogous)i(to)g(the)g(`)p | |
8667 | Fs(\045)p Ft(')f(job)g Fl(id)p Ft(.)p eop | |
8668 | %%Page: 83 89 | |
8669 | 83 88 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
8670 | b(Line)h(Editing)2105 b(83)150 299 y Fo(8)80 b(Command)52 | |
8671 | b(Line)i(Editing)275 539 y Ft(This)38 b(c)m(hapter)i(describ)s(es)f | |
8672 | (the)h(basic)f(features)h(of)h(the)f Fl(gnu)f Ft(command)h(line)e | |
8673 | (editing)h(in)m(terface.)150 648 y(Command)25 b(line)f(editing)g(is)h | |
8674 | (pro)m(vided)f(b)m(y)i(the)g(Readline)e(library)-8 b(,)25 | |
8675 | b(whic)m(h)g(is)g(used)g(b)m(y)g(sev)m(eral)h(di\013eren)m(t)150 | |
8676 | 758 y(programs,)k(including)d(Bash.)150 1020 y Fr(8.1)68 | |
8677 | b(In)l(tro)t(duction)45 b(to)g(Line)h(Editing)275 1266 | |
8678 | y Ft(The)29 b(follo)m(wing)g(paragraphs)h(describ)s(e)f(the)h(notation) | |
8679 | h(used)e(to)j(represen)m(t)e(k)m(eystrok)m(es.)275 1402 | |
8680 | y(The)i(text)j Fj(C-k)d Ft(is)h(read)g(as)h(`Con)m(trol-K')f(and)g | |
8681 | (describ)s(es)f(the)h(c)m(haracter)i(pro)s(duced)d(when)g(the)3663 | |
8682 | 1399 y Fg(h)p 3687 1346 38 4 v 3687 1402 a Ff(k)p 3687 | |
8683 | 1417 V 3720 1399 a Fg(i)150 1512 y Ft(k)m(ey)f(is)f(pressed)f(while)f | |
8684 | (the)j(Con)m(trol)f(k)m(ey)h(is)f(depressed.)275 1648 | |
8685 | y(The)h(text)i Fj(M-k)e Ft(is)g(read)g(as)i(`Meta-K')g(and)f(describ)s | |
8686 | (es)e(the)i(c)m(haracter)h(pro)s(duced)e(when)f(the)i(Meta)150 | |
8687 | 1757 y(k)m(ey)d(\(if)f(y)m(ou)h(ha)m(v)m(e)g(one\))g(is)f(depressed,)g | |
8688 | (and)f(the)1859 1754 y Fg(h)p 1883 1701 V 1883 1757 a | |
8689 | Ff(k)p 1883 1773 V 1916 1754 a Fg(i)1974 1757 y Ft(k)m(ey)j(is)d | |
8690 | (pressed.)39 b(The)28 b(Meta)i(k)m(ey)f(is)f(lab)s(eled)3558 | |
8691 | 1754 y Fg(h)p 3582 1701 143 4 v 3582 1757 a Ff(AL)-6 | |
8692 | b(T)p 3582 1773 V 3720 1754 a Fg(i)150 1867 y Ft(on)26 | |
8693 | b(man)m(y)g(k)m(eyb)s(oards.)39 b(On)26 b(k)m(eyb)s(oards)g(with)f(t)m | |
8694 | (w)m(o)i(k)m(eys)g(lab)s(eled)2425 1864 y Fg(h)p 2450 | |
8695 | 1811 V 2450 1867 a Ff(AL)-6 b(T)p 2450 1882 V 2587 1864 | |
8696 | a Fg(i)2643 1867 y Ft(\(usually)25 b(to)i(either)e(side)g(of)i(the)150 | |
8697 | 1977 y(space)32 b(bar\),)g(the)775 1974 y Fg(h)p 799 | |
8698 | 1921 V 799 1977 a Ff(AL)-6 b(T)p 799 1992 V 937 1974 | |
8699 | a Fg(i)998 1977 y Ft(on)32 b(the)f(left)g(side)g(is)f(generally)h(set)g | |
8700 | (to)i(w)m(ork)e(as)h(a)f(Meta)i(k)m(ey)-8 b(.)45 b(The)3393 | |
8701 | 1974 y Fg(h)p 3417 1921 V 3417 1977 a Ff(AL)-6 b(T)p | |
8702 | 3417 1992 V 3555 1974 a Fg(i)3616 1977 y Ft(k)m(ey)150 | |
8703 | 2086 y(on)33 b(the)h(righ)m(t)f(ma)m(y)h(also)f(b)s(e)g(con\014gured)f | |
8704 | (to)i(w)m(ork)g(as)g(a)f(Meta)i(k)m(ey)f(or)g(ma)m(y)g(b)s(e)e | |
8705 | (con\014gured)h(as)h(some)150 2196 y(other)d(mo)s(di\014er,)d(suc)m(h)i | |
8706 | (as)h(a)g(Comp)s(ose)f(k)m(ey)h(for)f(t)m(yping)g(accen)m(ted)i(c)m | |
8707 | (haracters.)275 2332 y(If)21 b(y)m(ou)h(do)g(not)g(ha)m(v)m(e)h(a)f | |
8708 | (Meta)h(or)1388 2329 y Fg(h)p 1412 2276 V 1412 2332 a | |
8709 | Ff(AL)-6 b(T)p 1412 2348 V 1550 2329 a Fg(i)1601 2332 | |
8710 | y Ft(k)m(ey)e(,)25 b(or)d(another)g(k)m(ey)h(w)m(orking)e(as)h(a)g | |
8711 | (Meta)h(k)m(ey)-8 b(,)25 b(the)d(iden)m(tical)150 2442 | |
8712 | y(k)m(eystrok)m(e)i(can)f(b)s(e)f(generated)i(b)m(y)e(t)m(yping)1619 | |
8713 | 2439 y Fg(h)p 1643 2386 139 4 v 1643 2442 a Ff(ESC)p | |
8714 | 1643 2457 V 1777 2439 a Fg(i)1829 2442 y Fm(\014rst)p | |
8715 | Ft(,)j(and)d(then)g(t)m(yping)2678 2439 y Fg(h)p 2703 | |
8716 | 2386 38 4 v 2703 2442 a Ff(k)p 2703 2457 V 2736 2439 | |
8717 | a Fg(i)2765 2442 y Ft(.)38 b(Either)22 b(pro)s(cess)g(is)f(kno)m(wn)150 | |
8718 | 2551 y(as)31 b Fq(metafying)38 b Ft(the)850 2548 y Fg(h)p | |
8719 | 874 2495 V 874 2551 a Ff(k)p 874 2567 V 907 2548 a Fg(i)968 | |
8720 | 2551 y Ft(k)m(ey)-8 b(.)275 2688 y(The)39 b(text)j Fj(M-C-k)d | |
8721 | Ft(is)g(read)h(as)h(`Meta-Con)m(trol-k')i(and)c(describ)s(es)g(the)h(c) | |
8722 | m(haracter)i(pro)s(duced)d(b)m(y)150 2797 y Fq(metafying)f | |
8723 | Fj(C-k)p Ft(.)275 2934 y(In)e(addition,)h(sev)m(eral)g(k)m(eys)g(ha)m | |
8724 | (v)m(e)h(their)e(o)m(wn)h(names.)60 b(Sp)s(eci\014cally)-8 | |
8725 | b(,)2768 2931 y Fg(h)p 2792 2878 146 4 v 2792 2934 a | |
8726 | Ff(DEL)p 2792 2949 V 2934 2931 a Fg(i)2964 2934 y Ft(,)3028 | |
8727 | 2931 y Fg(h)p 3052 2878 139 4 v 3052 2934 a Ff(ESC)p | |
8728 | 3052 2949 V 3186 2931 a Fg(i)3216 2934 y Ft(,)3279 2931 | |
8729 | y Fg(h)p 3303 2878 144 4 v 3303 2934 a Ff(LFD)p 3303 | |
8730 | 2949 V 3443 2931 a Fg(i)3473 2934 y Ft(,)3537 2931 y | |
8731 | Fg(h)p 3561 2878 139 4 v 3561 2934 a Ff(SPC)p 3561 2949 | |
8732 | V 3695 2931 a Fg(i)3725 2934 y Ft(,)150 3040 y Fg(h)p | |
8733 | 174 2987 151 4 v 174 3043 a Ff(RET)p 174 3059 V 321 3040 | |
8734 | a Fg(i)351 3043 y Ft(,)47 b(and)612 3040 y Fg(h)p 637 | |
8735 | 2987 148 4 v 637 3043 a Ff(T)-6 b(AB)p 637 3059 V 780 | |
8736 | 3040 a Fg(i)853 3043 y Ft(all)43 b(stand)g(for)g(themselv)m(es)h(when)e | |
8737 | (seen)i(in)e(this)g(text,)48 b(or)43 b(in)f(an)i(init)d(\014le)i(\(see) | |
8738 | 150 3153 y(Section)36 b(8.3)h([Readline)e(Init)g(File],)i(page)g(86\).) | |
8739 | 59 b(If)36 b(y)m(our)g(k)m(eyb)s(oard)g(lac)m(ks)g(a)2897 | |
8740 | 3150 y Fg(h)p 2921 3097 144 4 v 2921 3153 a Ff(LFD)p | |
8741 | 2921 3168 V 3061 3150 a Fg(i)3127 3153 y Ft(k)m(ey)-8 | |
8742 | b(,)39 b(t)m(yping)3604 3150 y Fg(h)p 3628 3097 97 4 | |
8743 | v 3628 3153 a Ff(C-j)p 3628 3168 V 3720 3150 a Fg(i)150 | |
8744 | 3262 y Ft(will)27 b(pro)s(duce)h(the)i(desired)e(c)m(haracter.)42 | |
8745 | b(The)1748 3259 y Fg(h)p 1772 3206 151 4 v 1772 3262 | |
8746 | a Ff(RET)p 1772 3278 V 1919 3259 a Fg(i)1978 3262 y Ft(k)m(ey)30 | |
8747 | b(ma)m(y)g(b)s(e)f(lab)s(eled)2770 3259 y Fg(h)p 2794 | |
8748 | 3206 217 4 v 2794 3262 a Ff(Return)p 2794 3278 V 3007 | |
8749 | 3259 a Fg(i)3066 3262 y Ft(or)3176 3259 y Fg(h)p 3201 | |
8750 | 3206 172 4 v 3201 3262 a Ff(En)n(ter)p 3201 3278 V 3368 | |
8751 | 3259 a Fg(i)3427 3262 y Ft(on)h(some)150 3372 y(k)m(eyb)s(oards.)150 | |
8752 | 3634 y Fr(8.2)68 b(Readline)47 b(In)l(teraction)275 3880 | |
8753 | y Ft(Often)24 b(during)f(an)i(in)m(teractiv)m(e)h(session)f(y)m(ou)g(t) | |
8754 | m(yp)s(e)h(in)e(a)h(long)g(line)e(of)j(text,)h(only)e(to)g(notice)h | |
8755 | (that)g(the)150 3989 y(\014rst)32 b(w)m(ord)g(on)g(the)g(line)f(is)h | |
8756 | (missp)s(elled.)43 b(The)32 b(Readline)f(library)f(giv)m(es)i(y)m(ou)h | |
8757 | (a)g(set)g(of)f(commands)g(for)150 4099 y(manipulating)27 | |
8758 | b(the)j(text)h(as)f(y)m(ou)g(t)m(yp)s(e)g(it)f(in,)g(allo)m(wing)f(y)m | |
8759 | (ou)i(to)h(just)e(\014x)g(y)m(our)h(t)m(yp)s(o,)g(and)g(not)g(forcing) | |
8760 | 150 4209 y(y)m(ou)e(to)h(ret)m(yp)s(e)g(the)f(ma)5 b(jorit)m(y)28 | |
8761 | b(of)g(the)h(line.)38 b(Using)27 b(these)i(editing)e(commands,)h(y)m | |
8762 | (ou)h(mo)m(v)m(e)g(the)g(cursor)150 4318 y(to)35 b(the)f(place)h(that)f | |
8763 | (needs)g(correction,)i(and)e(delete)g(or)g(insert)g(the)g(text)h(of)g | |
8764 | (the)f(corrections.)53 b(Then,)150 4428 y(when)30 b(y)m(ou)i(are)f | |
8765 | (satis\014ed)f(with)g(the)h(line,)f(y)m(ou)i(simply)c(press)2320 | |
8766 | 4425 y Fg(h)p 2344 4372 151 4 v 2344 4428 a Ff(RET)p | |
8767 | 2344 4443 V 2491 4425 a Fg(i)2520 4428 y Ft(.)43 b(Y)-8 | |
8768 | b(ou)32 b(do)f(not)g(ha)m(v)m(e)i(to)e(b)s(e)g(at)h(the)150 | |
8769 | 4537 y(end)j(of)h(the)g(line)e(to)j(press)1126 4534 y | |
8770 | Fg(h)p 1150 4481 V 1150 4537 a Ff(RET)p 1150 4553 V 1297 | |
8771 | 4534 a Fg(i)1327 4537 y Ft(;)h(the)e(en)m(tire)g(line)e(is)h(accepted)i | |
8772 | (regardless)e(of)h(the)g(lo)s(cation)g(of)g(the)150 4647 | |
8773 | y(cursor)30 b(within)e(the)i(line.)150 4875 y Fk(8.2.1)63 | |
8774 | b(Readline)40 b(Bare)h(Essen)m(tials)275 5121 y Ft(In)22 | |
8775 | b(order)g(to)i(en)m(ter)g(c)m(haracters)g(in)m(to)f(the)h(line,)f | |
8776 | (simply)d(t)m(yp)s(e)k(them.)38 b(The)22 b(t)m(yp)s(ed)h(c)m(haracter)i | |
8777 | (app)s(ears)150 5230 y(where)32 b(the)h(cursor)e(w)m(as,)j(and)e(then)g | |
8778 | (the)h(cursor)e(mo)m(v)m(es)j(one)f(space)g(to)g(the)g(righ)m(t.)46 | |
8779 | b(If)32 b(y)m(ou)h(mist)m(yp)s(e)f(a)150 5340 y(c)m(haracter,)g(y)m(ou) | |
8780 | f(can)g(use)f(y)m(our)g(erase)h(c)m(haracter)h(to)f(bac)m(k)g(up)f(and) | |
8781 | f(delete)i(the)g(mist)m(yp)s(ed)d(c)m(haracter.)p eop | |
8782 | %%Page: 84 90 | |
8783 | 84 89 bop 150 -116 a Ft(84)2572 b(Bash)31 b(Reference)g(Man)m(ual)275 | |
8784 | 299 y(Sometimes)f(y)m(ou)h(ma)m(y)h(mist)m(yp)s(e)d(a)j(c)m(haracter,)g | |
8785 | (and)e(not)i(notice)f(the)g(error)f(un)m(til)f(y)m(ou)i(ha)m(v)m(e)h(t) | |
8786 | m(yp)s(ed)150 408 y(sev)m(eral)d(other)g(c)m(haracters.)42 | |
8787 | b(In)28 b(that)i(case,)g(y)m(ou)f(can)g(t)m(yp)s(e)h | |
8788 | Fj(C-b)d Ft(to)j(mo)m(v)m(e)g(the)f(cursor)g(to)g(the)g(left,)h(and)150 | |
8789 | 518 y(then)g(correct)i(y)m(our)e(mistak)m(e.)41 b(Afterw)m(ards,)31 | |
8790 | b(y)m(ou)f(can)h(mo)m(v)m(e)h(the)e(cursor)g(to)h(the)g(righ)m(t)f | |
8791 | (with)f Fj(C-f)p Ft(.)275 679 y(When)j(y)m(ou)h(add)f(text)h(in)e(the)i | |
8792 | (middle)d(of)j(a)g(line,)f(y)m(ou)g(will)e(notice)j(that)g(c)m | |
8793 | (haracters)h(to)g(the)e(righ)m(t)150 789 y(of)d(the)g(cursor)f(are)h | |
8794 | (`pushed)e(o)m(v)m(er')j(to)g(mak)m(e)f(ro)s(om)g(for)f(the)h(text)h | |
8795 | (that)f(y)m(ou)g(ha)m(v)m(e)h(inserted.)39 b(Lik)m(ewise,)150 | |
8796 | 898 y(when)e(y)m(ou)g(delete)h(text)h(b)s(ehind)34 b(the)k(cursor,)h(c) | |
8797 | m(haracters)g(to)f(the)g(righ)m(t)f(of)h(the)g(cursor)e(are)i(`pulled) | |
8798 | 150 1008 y(bac)m(k')24 b(to)f(\014ll)e(in)g(the)i(blank)e(space)j | |
8799 | (created)f(b)m(y)g(the)g(remo)m(v)-5 b(al)23 b(of)g(the)g(text.)39 | |
8800 | b(A)23 b(list)e(of)i(the)g(bare)f(essen)m(tials)150 1117 | |
8801 | y(for)30 b(editing)f(the)i(text)g(of)g(an)f(input)e(line)h(follo)m(ws.) | |
8802 | 150 1317 y Fj(C-b)336 b Ft(Mo)m(v)m(e)32 b(bac)m(k)g(one)e(c)m | |
8803 | (haracter.)150 1502 y Fj(C-f)336 b Ft(Mo)m(v)m(e)32 b(forw)m(ard)e(one) | |
8804 | h(c)m(haracter.)150 1685 y Fg(h)p 174 1632 146 4 v 174 | |
8805 | 1688 a Ff(DEL)p 174 1704 V 316 1685 a Fg(i)376 1688 y | |
8806 | Ft(or)487 1685 y Fg(h)p 512 1632 317 4 v 512 1688 a Ff(Bac)n(kspace)p | |
8807 | 512 1704 V 824 1685 a Fg(i)630 1798 y Ft(Delete)h(the)e(c)m(haracter)i | |
8808 | (to)f(the)g(left)f(of)g(the)h(cursor.)150 1984 y Fj(C-d)336 | |
8809 | b Ft(Delete)32 b(the)e(c)m(haracter)i(underneath)d(the)i(cursor.)150 | |
8810 | 2170 y(Prin)m(ting)e(c)m(haracters)630 2279 y(Insert)h(the)g(c)m | |
8811 | (haracter)i(in)m(to)f(the)f(line)f(at)i(the)g(cursor.)150 | |
8812 | 2465 y Fj(C-_)e Ft(or)i Fj(C-x)e(C-u)630 2575 y Ft(Undo)k(the)h(last)f | |
8813 | (editing)f(command.)50 b(Y)-8 b(ou)34 b(can)f(undo)g(all)f(the)h(w)m(a) | |
8814 | m(y)i(bac)m(k)f(to)g(an)g(empt)m(y)630 2684 y(line.)150 | |
8815 | 2883 y(\(Dep)s(ending)f(on)h(y)m(our)g(con\014guration,)g(the)1726 | |
8816 | 2880 y Fg(h)p 1750 2827 V 1750 2883 a Ff(Bac)n(kspace)p | |
8817 | 1750 2899 V 2063 2880 a Fg(i)2127 2883 y Ft(k)m(ey)h(b)s(e)e(set)h(to)h | |
8818 | (delete)f(the)g(c)m(haracter)i(to)f(the)150 2993 y(left)e(of)g(the)g | |
8819 | (cursor)f(and)h(the)1192 2990 y Fg(h)p 1216 2937 146 | |
8820 | 4 v 1216 2993 a Ff(DEL)p 1216 3008 V 1358 2990 a Fg(i)1421 | |
8821 | 2993 y Ft(k)m(ey)g(set)h(to)g(delete)f(the)g(c)m(haracter)i(underneath) | |
8822 | c(the)i(cursor,)h(lik)m(e)150 3103 y Fj(C-d)p Ft(,)c(rather)g(than)g | |
8823 | (the)h(c)m(haracter)h(to)f(the)f(left)g(of)h(the)f(cursor.\))150 | |
8824 | 3380 y Fk(8.2.2)63 b(Readline)40 b(Mo)m(v)m(emen)m(t)g(Commands)275 | |
8825 | 3650 y Ft(The)25 b(ab)s(o)m(v)m(e)i(table)f(describ)s(es)f(the)h(most)h | |
8826 | (basic)e(k)m(eystrok)m(es)j(that)f(y)m(ou)f(need)g(in)f(order)g(to)i | |
8827 | (do)f(editing)150 3760 y(of)g(the)f(input)f(line.)37 | |
8828 | b(F)-8 b(or)27 b(y)m(our)e(con)m(v)m(enience,)j(man)m(y)d(other)h | |
8829 | (commands)f(ha)m(v)m(e)i(b)s(een)e(added)g(in)f(addition)150 | |
8830 | 3869 y(to)33 b Fj(C-b)p Ft(,)e Fj(C-f)p Ft(,)h Fj(C-d)p | |
8831 | Ft(,)g(and)1043 3866 y Fg(h)p 1067 3813 V 1067 3869 a | |
8832 | Ff(DEL)p 1067 3885 V 1209 3866 a Fg(i)1239 3869 y Ft(.)45 | |
8833 | b(Here)33 b(are)f(some)g(commands)g(for)g(mo)m(ving)g(more)g(rapidly)d | |
8834 | (ab)s(out)j(the)150 3979 y(line.)150 4178 y Fj(C-a)336 | |
8835 | b Ft(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f(line.)150 | |
8836 | 4364 y Fj(C-e)336 b Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h | |
8837 | (line.)150 4550 y Fj(M-f)336 b Ft(Mo)m(v)m(e)32 b(forw)m(ard)e(a)h(w)m | |
8838 | (ord,)f(where)g(a)h(w)m(ord)f(is)f(comp)s(osed)h(of)h(letters)g(and)e | |
8839 | (digits.)150 4736 y Fj(M-b)336 b Ft(Mo)m(v)m(e)32 b(bac)m(kw)m(ard)f(a) | |
8840 | g(w)m(ord.)150 4922 y Fj(C-l)336 b Ft(Clear)30 b(the)g(screen,)h | |
8841 | (reprin)m(ting)d(the)j(curren)m(t)f(line)f(at)i(the)f(top.)275 | |
8842 | 5121 y(Notice)25 b(ho)m(w)g Fj(C-f)e Ft(mo)m(v)m(es)j(forw)m(ard)e(a)h | |
8843 | (c)m(haracter,)j(while)23 b Fj(M-f)g Ft(mo)m(v)m(es)j(forw)m(ard)e(a)h | |
8844 | (w)m(ord.)39 b(It)24 b(is)g(a)h(lo)s(ose)150 5230 y(con)m(v)m(en)m | |
8845 | (tion)31 b(that)g(con)m(trol)f(k)m(eystrok)m(es)i(op)s(erate)e(on)g(c)m | |
8846 | (haracters)h(while)d(meta)j(k)m(eystrok)m(es)h(op)s(erate)e(on)150 | |
8847 | 5340 y(w)m(ords.)p eop | |
8848 | %%Page: 85 91 | |
8849 | 85 90 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
8850 | b(Line)h(Editing)2105 b(85)150 299 y Fk(8.2.3)63 b(Readline)40 | |
8851 | b(Killing)i(Commands)275 566 y Fq(Killing)f Ft(text)e(means)e(to)h | |
8852 | (delete)f(the)h(text)g(from)f(the)g(line,)h(but)f(to)h(sa)m(v)m(e)h(it) | |
8853 | d(a)m(w)m(a)m(y)k(for)d(later)g(use,)150 675 y(usually)32 | |
8854 | b(b)m(y)i Fq(y)m(anking)41 b Ft(\(re-inserting\))33 b(it)h(bac)m(k)h | |
8855 | (in)m(to)f(the)g(line.)50 b(\(`Cut')35 b(and)e(`paste')i(are)g(more)f | |
8856 | (recen)m(t)150 785 y(jargon)d(for)f(`kill')e(and)i(`y)m(ank'.\))275 | |
8857 | 942 y(If)f(the)i(description)d(for)i(a)h(command)f(sa)m(ys)g(that)h(it) | |
8858 | f(`kills')e(text,)k(then)e(y)m(ou)g(can)h(b)s(e)e(sure)h(that)h(y)m(ou) | |
8859 | 150 1052 y(can)g(get)g(the)g(text)g(bac)m(k)g(in)e(a)i(di\013eren)m(t)f | |
8860 | (\(or)h(the)f(same\))h(place)g(later.)275 1209 y(When)23 | |
8861 | b(y)m(ou)g(use)g(a)h(kill)d(command,)j(the)g(text)g(is)e(sa)m(v)m(ed)j | |
8862 | (in)d(a)h Fq(kill-ring)p Ft(.)35 b(An)m(y)24 b(n)m(um)m(b)s(er)e(of)h | |
8863 | (consecutiv)m(e)150 1318 y(kills)28 b(sa)m(v)m(e)33 b(all)d(of)h(the)g | |
8864 | (killed)e(text)j(together,)g(so)g(that)f(when)f(y)m(ou)h(y)m(ank)h(it)e | |
8865 | (bac)m(k,)i(y)m(ou)g(get)g(it)e(all.)41 b(The)150 1428 | |
8866 | y(kill)30 b(ring)h(is)g(not)i(line)e(sp)s(eci\014c;)h(the)h(text)g | |
8867 | (that)g(y)m(ou)g(killed)c(on)k(a)f(previously)e(t)m(yp)s(ed)j(line)d | |
8868 | (is)i(a)m(v)-5 b(ailable)150 1537 y(to)31 b(b)s(e)f(y)m(ank)m(ed)h(bac) | |
8869 | m(k)g(later,)g(when)e(y)m(ou)i(are)g(t)m(yping)e(another)i(line.)275 | |
8870 | 1695 y(Here)f(is)g(the)g(list)f(of)i(commands)f(for)g(killing)d(text.) | |
8871 | 150 1888 y Fj(C-k)336 b Ft(Kill)28 b(the)i(text)i(from)e(the)g(curren)m | |
8872 | (t)g(cursor)g(p)s(osition)f(to)i(the)f(end)g(of)g(the)h(line.)150 | |
8873 | 2070 y Fj(M-d)336 b Ft(Kill)24 b(from)i(the)g(cursor)g(to)h(the)f(end)g | |
8874 | (of)h(the)f(curren)m(t)g(w)m(ord,)h(or,)h(if)d(b)s(et)m(w)m(een)i(w)m | |
8875 | (ords,)g(to)g(the)630 2180 y(end)j(of)g(the)h(next)f(w)m(ord.)41 | |
8876 | b(W)-8 b(ord)30 b(b)s(oundaries)e(are)j(the)g(same)f(as)h(those)g(used) | |
8877 | f(b)m(y)g Fj(M-f)p Ft(.)150 2362 y Fj(M-)246 2359 y Fg(h)p | |
8878 | 270 2306 146 4 v 270 2362 a Ff(DEL)p 270 2377 V 411 2359 | |
8879 | a Fg(i)630 2362 y Ft(Kill)e(from)i(the)h(cursor)f(the)g(start)h(of)g | |
8880 | (the)g(curren)m(t)f(w)m(ord,)h(or,)f(if)g(b)s(et)m(w)m(een)h(w)m(ords,) | |
8881 | f(to)i(the)630 2471 y(start)39 b(of)f(the)h(previous)e(w)m(ord.)64 | |
8882 | b(W)-8 b(ord)39 b(b)s(oundaries)d(are)j(the)f(same)h(as)g(those)f(used) | |
8883 | g(b)m(y)630 2581 y Fj(M-b)p Ft(.)150 2763 y Fj(C-w)336 | |
8884 | b Ft(Kill)29 b(from)h(the)i(cursor)e(to)i(the)g(previous)d(whitespace.) | |
8885 | 43 b(This)30 b(is)g(di\013eren)m(t)h(than)g Fj(M-)3555 | |
8886 | 2760 y Fg(h)p 3578 2707 V 3578 2763 a Ff(DEL)p 3578 2778 | |
8887 | V 3720 2760 a Fg(i)630 2872 y Ft(b)s(ecause)f(the)h(w)m(ord)f(b)s | |
8888 | (oundaries)e(di\013er.)275 3066 y(Here)42 b(is)e(ho)m(w)i(to)g | |
8889 | Fq(y)m(ank)47 b Ft(the)42 b(text)g(bac)m(k)h(in)m(to)e(the)h(line.)72 | |
8890 | b(Y)-8 b(anking)42 b(means)f(to)h(cop)m(y)h(the)e(most-)150 | |
8891 | 3175 y(recen)m(tly-killed)29 b(text)i(from)f(the)g(kill)f(bu\013er.)150 | |
8892 | 3369 y Fj(C-y)336 b Ft(Y)-8 b(ank)31 b(the)f(most)h(recen)m(tly)g | |
8893 | (killed)d(text)j(bac)m(k)g(in)m(to)g(the)f(bu\013er)g(at)h(the)f | |
8894 | (cursor.)150 3551 y Fj(M-y)336 b Ft(Rotate)36 b(the)f(kill-ring,)e(and) | |
8895 | h(y)m(ank)h(the)f(new)g(top.)54 b(Y)-8 b(ou)35 b(can)g(only)e(do)i | |
8896 | (this)e(if)h(the)h(prior)630 3660 y(command)30 b(is)g | |
8897 | Fj(C-y)f Ft(or)h Fj(M-y)p Ft(.)150 3930 y Fk(8.2.4)63 | |
8898 | b(Readline)40 b(Argumen)m(ts)275 4197 y Ft(Y)-8 b(ou)29 | |
8899 | b(can)h(pass)f(n)m(umeric)f(argumen)m(ts)h(to)h(Readline)e(commands.)40 | |
8900 | b(Sometimes)29 b(the)g(argumen)m(t)h(acts)150 4306 y(as)40 | |
8901 | b(a)h(rep)s(eat)f(coun)m(t,)j(other)e(times)e(it)h(is)f(the)h | |
8902 | Fm(sign)47 b Ft(of)41 b(the)f(argumen)m(t)g(that)h(is)e(signi\014can)m | |
8903 | (t.)69 b(If)40 b(y)m(ou)150 4416 y(pass)33 b(a)h(negativ)m(e)h(argumen) | |
8904 | m(t)f(to)g(a)g(command)f(whic)m(h)f(normally)g(acts)i(in)e(a)i(forw)m | |
8905 | (ard)f(direction,)g(that)150 4525 y(command)i(will)e(act)j(in)e(a)i | |
8906 | (bac)m(kw)m(ard)f(direction.)55 b(F)-8 b(or)36 b(example,)g(to)g(kill)d | |
8907 | (text)j(bac)m(k)g(to)g(the)g(start)g(of)150 4635 y(the)31 | |
8908 | b(line,)e(y)m(ou)h(migh)m(t)g(t)m(yp)s(e)h(`)p Fs(M--)f(C-k)p | |
8909 | Ft('.)275 4792 y(The)d(general)h(w)m(a)m(y)i(to)e(pass)g(n)m(umeric)f | |
8910 | (argumen)m(ts)i(to)g(a)f(command)g(is)f(to)i(t)m(yp)s(e)f(meta)i | |
8911 | (digits)c(b)s(efore)150 4902 y(the)31 b(command.)42 b(If)30 | |
8912 | b(the)h(\014rst)f(`digit')g(t)m(yp)s(ed)h(is)f(a)h(min)m(us)e(sign)h | |
8913 | (\(`)p Fs(-)p Ft('\),)i(then)f(the)g(sign)e(of)i(the)g(argumen)m(t)150 | |
8914 | 5011 y(will)36 b(b)s(e)h(negativ)m(e.)65 b(Once)38 b(y)m(ou)h(ha)m(v)m | |
8915 | (e)g(t)m(yp)s(ed)f(one)h(meta)g(digit)e(to)h(get)i(the)e(argumen)m(t)h | |
8916 | (started,)i(y)m(ou)150 5121 y(can)29 b(t)m(yp)s(e)g(the)g(remainder)e | |
8917 | (of)i(the)g(digits,)f(and)h(then)f(the)h(command.)40 | |
8918 | b(F)-8 b(or)30 b(example,)f(to)g(giv)m(e)h(the)f Fj(C-d)150 | |
8919 | 5230 y Ft(command)37 b(an)g(argumen)m(t)h(of)g(10,)i(y)m(ou)e(could)e | |
8920 | (t)m(yp)s(e)i(`)p Fs(M-1)29 b(0)h(C-d)p Ft(',)39 b(whic)m(h)d(will)f | |
8921 | (delete)j(the)f(next)h(ten)150 5340 y(c)m(haracters)32 | |
8922 | b(on)e(the)h(input)d(line.)p eop | |
8923 | %%Page: 86 92 | |
8924 | 86 91 bop 150 -116 a Ft(86)2572 b(Bash)31 b(Reference)g(Man)m(ual)150 | |
8925 | 299 y Fk(8.2.5)63 b(Searc)m(hing)40 b(for)h(Commands)f(in)h(the)g | |
8926 | (History)275 548 y Ft(Readline)21 b(pro)m(vides)h(commands)g(for)h | |
8927 | (searc)m(hing)g(through)f(the)h(command)g(history)e(\(see)j(Section)f | |
8928 | (9.1)150 657 y([Bash)37 b(History)g(F)-8 b(acilities],)38 | |
8929 | b(page)f(109\))i(for)d(lines)f(con)m(taining)i(a)g(sp)s(eci\014ed)e | |
8930 | (string.)59 b(There)36 b(are)i(t)m(w)m(o)150 767 y(searc)m(h)31 | |
8931 | b(mo)s(des:)40 b Fq(incremen)m(tal)33 b Ft(and)d Fq(non-incremen)m(tal) | |
8932 | p Ft(.)275 906 y(Incremen)m(tal)25 b(searc)m(hes)i(b)s(egin)d(b)s | |
8933 | (efore)h(the)h(user)f(has)h(\014nished)d(t)m(yping)i(the)h(searc)m(h)g | |
8934 | (string.)38 b(As)26 b(eac)m(h)150 1015 y(c)m(haracter)37 | |
8935 | b(of)e(the)h(searc)m(h)g(string)e(is)h(t)m(yp)s(ed,)h(Readline)e | |
8936 | (displa)m(ys)g(the)h(next)h(en)m(try)g(from)e(the)i(history)150 | |
8937 | 1125 y(matc)m(hing)24 b(the)g(string)f(t)m(yp)s(ed)h(so)g(far.)39 | |
8938 | b(An)23 b(incremen)m(tal)h(searc)m(h)g(requires)f(only)g(as)h(man)m(y)g | |
8939 | (c)m(haracters)i(as)150 1235 y(needed)i(to)i(\014nd)d(the)i(desired)e | |
8940 | (history)h(en)m(try)-8 b(.)41 b(T)-8 b(o)29 b(searc)m(h)h(bac)m(kw)m | |
8941 | (ard)f(in)e(the)i(history)f(for)g(a)i(particular)150 | |
8942 | 1344 y(string,)f(t)m(yp)s(e)g Fj(C-r)p Ft(.)40 b(T)m(yping)28 | |
8943 | b Fj(C-s)h Ft(searc)m(hes)h(forw)m(ard)f(through)g(the)g(history)-8 | |
8944 | b(.)40 b(The)29 b(c)m(haracters)i(presen)m(t)150 1454 | |
8945 | y(in)37 b(the)h(v)-5 b(alue)37 b(of)h(the)g Fs(isearch-terminators)33 | |
8946 | b Ft(v)-5 b(ariable)37 b(are)h(used)f(to)i(terminate)f(an)g(incremen)m | |
8947 | (tal)150 1563 y(searc)m(h.)63 b(If)38 b(that)g(v)-5 b(ariable)36 | |
8948 | b(has)i(not)g(b)s(een)f(assigned)g(a)h(v)-5 b(alue,)39 | |
8949 | b(the)2578 1560 y Fg(h)p 2602 1507 139 4 v 2602 1563 | |
8950 | a Ff(ESC)p 2602 1579 V 2736 1560 a Fg(i)2804 1563 y Ft(and)e | |
8951 | Fj(C-J)f Ft(c)m(haracters)k(will)150 1673 y(terminate)i(an)h(incremen)m | |
8952 | (tal)e(searc)m(h.)78 b Fj(C-g)41 b Ft(will)f(ab)s(ort)i(an)g(incremen)m | |
8953 | (tal)g(searc)m(h)h(and)f(restore)h(the)150 1782 y(original)27 | |
8954 | b(line.)39 b(When)28 b(the)h(searc)m(h)h(is)e(terminated,)h(the)g | |
8955 | (history)f(en)m(try)h(con)m(taining)f(the)h(searc)m(h)h(string)150 | |
8956 | 1892 y(b)s(ecomes)h(the)f(curren)m(t)g(line.)275 2031 | |
8957 | y(T)-8 b(o)31 b(\014nd)e(other)j(matc)m(hing)f(en)m(tries)g(in)e(the)i | |
8958 | (history)f(list,)g(t)m(yp)s(e)i Fj(C-r)e Ft(or)h Fj(C-s)f | |
8959 | Ft(as)h(appropriate.)42 b(This)150 2141 y(will)23 b(searc)m(h)k(bac)m | |
8960 | (kw)m(ard)g(or)f(forw)m(ard)g(in)e(the)j(history)e(for)h(the)g(next)g | |
8961 | (en)m(try)h(matc)m(hing)f(the)g(searc)m(h)h(string)150 | |
8962 | 2250 y(t)m(yp)s(ed)37 b(so)h(far.)63 b(An)m(y)38 b(other)f(k)m(ey)i | |
8963 | (sequence)f(b)s(ound)e(to)i(a)g(Readline)f(command)g(will)e(terminate)j | |
8964 | (the)150 2360 y(searc)m(h)22 b(and)e(execute)j(that)e(command.)38 | |
8965 | b(F)-8 b(or)22 b(instance,)g(a)2127 2357 y Fg(h)p 2151 | |
8966 | 2304 151 4 v 2151 2360 a Ff(RET)p 2151 2375 V 2298 2357 | |
8967 | a Fg(i)2349 2360 y Ft(will)c(terminate)j(the)g(searc)m(h)h(and)e | |
8968 | (accept)150 2469 y(the)30 b(line,)e(thereb)m(y)h(executing)h(the)f | |
8969 | (command)g(from)g(the)h(history)e(list.)39 b(A)29 b(mo)m(v)m(emen)m(t)j | |
8970 | (command)d(will)150 2579 y(terminate)h(the)h(searc)m(h,)g(mak)m(e)h | |
8971 | (the)e(last)g(line)f(found)g(the)i(curren)m(t)f(line,)f(and)h(b)s(egin) | |
8972 | f(editing.)275 2718 y(Readline)k(remem)m(b)s(ers)h(the)h(last)g | |
8973 | (incremen)m(tal)f(searc)m(h)h(string.)53 b(If)34 b(t)m(w)m(o)j | |
8974 | Fj(C-r)p Ft(s)c(are)i(t)m(yp)s(ed)g(without)150 2828 | |
8975 | y(an)m(y)i(in)m(terv)m(ening)e(c)m(haracters)j(de\014ning)d(a)i(new)f | |
8976 | (searc)m(h)h(string,)g(an)m(y)g(remem)m(b)s(ered)e(searc)m(h)i(string)f | |
8977 | (is)150 2937 y(used.)275 3076 y(Non-incremen)m(tal)46 | |
8978 | b(searc)m(hes)i(read)e(the)h(en)m(tire)g(searc)m(h)g(string)f(b)s | |
8979 | (efore)g(starting)g(to)i(searc)m(h)f(for)150 3186 y(matc)m(hing)c | |
8980 | (history)e(lines.)76 b(The)42 b(searc)m(h)h(string)f(ma)m(y)h(b)s(e)f | |
8981 | (t)m(yp)s(ed)g(b)m(y)g(the)h(user)f(or)h(b)s(e)f(part)g(of)h(the)150 | |
8982 | 3295 y(con)m(ten)m(ts)32 b(of)f(the)f(curren)m(t)g(line.)150 | |
8983 | 3564 y Fr(8.3)68 b(Readline)47 b(Init)e(File)275 3813 | |
8984 | y Ft(Although)f(the)h(Readline)f(library)e(comes)k(with)e(a)i(set)f(of) | |
8985 | g(Emacs-lik)m(e)g(k)m(eybindings)e(installed)150 3922 | |
8986 | y(b)m(y)f(default,)h(it)f(is)e(p)s(ossible)f(to)k(use)e(a)h(di\013eren) | |
8987 | m(t)f(set)h(of)g(k)m(eybindings.)72 b(An)m(y)42 b(user)f(can)h | |
8988 | (customize)150 4032 y(programs)32 b(that)h(use)f(Readline)f(b)m(y)i | |
8989 | (putting)e(commands)h(in)f(an)h Fq(inputrc)k Ft(\014le,)d(con)m(v)m(en) | |
8990 | m(tionally)f(in)f(his)150 4142 y(home)e(directory)-8 | |
8991 | b(.)40 b(The)28 b(name)g(of)h(this)f(\014le)f(is)h(tak)m(en)i(from)e | |
8992 | (the)h(v)-5 b(alue)28 b(of)h(the)f(shell)f(v)-5 b(ariable)28 | |
8993 | b Fs(INPUTRC)p Ft(.)150 4251 y(If)i(that)h(v)-5 b(ariable)29 | |
8994 | b(is)g(unset,)i(the)f(default)g(is)f(`)p Fs(~/.inputrc)p | |
8995 | Ft('.)275 4390 y(When)g(a)h(program)f(whic)m(h)g(uses)g(the)h(Readline) | |
8996 | e(library)f(starts)j(up,)f(the)h(init)e(\014le)g(is)h(read,)h(and)f | |
8997 | (the)150 4500 y(k)m(ey)i(bindings)c(are)k(set.)275 4639 | |
8998 | y(In)26 b(addition,)g(the)h Fs(C-x)i(C-r)d Ft(command)h(re-reads)g | |
8999 | (this)e(init)g(\014le,)i(th)m(us)g(incorp)s(orating)e(an)m(y)i(c)m | |
9000 | (hanges)150 4748 y(that)k(y)m(ou)g(migh)m(t)f(ha)m(v)m(e)h(made)g(to)g | |
9001 | (it.)150 4982 y Fk(8.3.1)63 b(Readline)40 b(Init)h(File)g(Syn)m(tax)275 | |
9002 | 5230 y Ft(There)33 b(are)h(only)f(a)h(few)f(basic)g(constructs)h(allo)m | |
9003 | (w)m(ed)f(in)g(the)h(Readline)e(init)g(\014le.)50 b(Blank)33 | |
9004 | b(lines)f(are)150 5340 y(ignored.)71 b(Lines)40 b(b)s(eginning)e(with)i | |
9005 | (a)h(`)p Fs(#)p Ft(')g(are)h(commen)m(ts.)73 b(Lines)40 | |
9006 | b(b)s(eginning)e(with)h(a)j(`)p Fs($)p Ft(')f(indicate)p | |
9007 | eop | |
9008 | %%Page: 87 93 | |
9009 | 87 92 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9010 | b(Line)h(Editing)2105 b(87)150 299 y(conditional)40 b(constructs)h | |
9011 | (\(see)i(Section)e(8.3.2)i([Conditional)c(Init)h(Constructs],)k(page)f | |
9012 | (91\).)74 b(Other)150 408 y(lines)29 b(denote)i(v)-5 | |
9013 | b(ariable)29 b(settings)h(and)g(k)m(ey)h(bindings.)150 | |
9014 | 562 y(V)-8 b(ariable)30 b(Settings)630 671 y(Y)-8 b(ou)41 | |
9015 | b(can)g(mo)s(dify)d(the)j(run-time)e(b)s(eha)m(vior)g(of)i(Readline)e | |
9016 | (b)m(y)h(altering)f(the)i(v)-5 b(alues)40 b(of)630 781 | |
9017 | y(v)-5 b(ariables)32 b(in)g(Readline)h(using)f(the)h | |
9018 | Fs(set)g Ft(command)g(within)e(the)j(init)e(\014le.)49 | |
9019 | b(The)33 b(syn)m(tax)630 891 y(is)c(simple:)870 1022 | |
9020 | y Fs(set)47 b Fj(variable)56 b(value)630 1154 y Ft(Here,)29 | |
9021 | b(for)e(example,)g(is)g(ho)m(w)g(to)h(c)m(hange)g(from)f(the)g(default) | |
9022 | g(Emacs-lik)m(e)g(k)m(ey)h(binding)c(to)630 1263 y(use)30 | |
9023 | b Fs(vi)g Ft(line)f(editing)g(commands:)870 1395 y Fs(set)47 | |
9024 | b(editing-mode)d(vi)630 1526 y Ft(V)-8 b(ariable)34 b(names)h(and)g(v) | |
9025 | -5 b(alues,)35 b(where)g(appropriate,)g(are)h(recognized)f(without)f | |
9026 | (regard)630 1636 y(to)d(case.)630 1767 y(The)37 b Fs(bind)30 | |
9027 | b(-V)37 b Ft(command)g(lists)g(the)h(curren)m(t)f(Readline)g(v)-5 | |
9028 | b(ariable)36 b(names)i(and)f(v)-5 b(alues.)630 1877 y(See)31 | |
9029 | b(Section)f(4.2)h([Bash)g(Builtins],)d(page)j(39.)630 | |
9030 | 2008 y(A)f(great)i(deal)e(of)h(run-time)e(b)s(eha)m(vior)g(is)g(c)m | |
9031 | (hangeable)j(with)d(the)h(follo)m(wing)f(v)-5 b(ariables.)630 | |
9032 | 2162 y Fs(bell-style)1110 2271 y Ft(Con)m(trols)43 b(what)h(happ)s(ens) | |
9033 | e(when)h(Readline)g(w)m(an)m(ts)h(to)h(ring)d(the)i(termi-)1110 | |
9034 | 2381 y(nal)36 b(b)s(ell.)59 b(If)37 b(set)h(to)g(`)p | |
9035 | Fs(none)p Ft(',)g(Readline)e(nev)m(er)i(rings)d(the)j(b)s(ell.)59 | |
9036 | b(If)36 b(set)i(to)1110 2491 y(`)p Fs(visible)p Ft(',)32 | |
9037 | b(Readline)g(uses)h(a)g(visible)d(b)s(ell)h(if)h(one)h(is)f(a)m(v)-5 | |
9038 | b(ailable.)48 b(If)33 b(set)g(to)1110 2600 y(`)p Fs(audible)p | |
9039 | Ft(')j(\(the)i(default\),)h(Readline)d(attempts)i(to)h(ring)d(the)h | |
9040 | (terminal's)1110 2710 y(b)s(ell.)630 2863 y Fs(comment-begin)1110 | |
9041 | 2973 y Ft(The)29 b(string)f(to)i(insert)e(at)i(the)f(b)s(eginning)e(of) | |
9042 | i(the)h(line)d(when)h(the)i Fs(insert-)1110 3082 y(comment)e | |
9043 | Ft(command)j(is)e(executed.)42 b(The)29 b(default)h(v)-5 | |
9044 | b(alue)30 b(is)f Fs("#")p Ft(.)630 3236 y Fs(completion-ignore-case) | |
9045 | 1110 3345 y Ft(If)e(set)h(to)g(`)p Fs(on)p Ft(',)g(Readline)e(p)s | |
9046 | (erforms)g(\014lename)g(matc)m(hing)i(and)f(completion)1110 | |
9047 | 3455 y(in)i(a)i(case-insensitiv)m(e)f(fashion.)39 b(The)30 | |
9048 | b(default)g(v)-5 b(alue)29 b(is)h(`)p Fs(off)p Ft('.)630 | |
9049 | 3608 y Fs(completion-query-items)1110 3718 y Ft(The)c(n)m(um)m(b)s(er)f | |
9050 | (of)h(p)s(ossible)e(completions)h(that)i(determines)e(when)g(the)i | |
9051 | (user)1110 3828 y(is)h(ask)m(ed)i(whether)f(the)h(list)e(of)h(p)s | |
9052 | (ossibilities)c(should)i(b)s(e)i(displa)m(y)m(ed.)39 | |
9053 | b(If)29 b(the)1110 3937 y(n)m(um)m(b)s(er)d(of)h(p)s(ossible)d | |
9054 | (completions)i(is)g(greater)i(than)e(this)g(v)-5 b(alue,)27 | |
9055 | b(Readline)1110 4047 y(will)d(ask)j(the)f(user)g(whether)g(or)g(not)h | |
9056 | (he)f(wishes)f(to)j(view)d(them;)j(otherwise,)1110 4156 | |
9057 | y(they)d(are)f(simply)e(listed.)38 b(This)22 b(v)-5 b(ariable)23 | |
9058 | b(m)m(ust)i(b)s(e)e(set)i(to)g(an)g(in)m(teger)f(v)-5 | |
9059 | b(alue)1110 4266 y(greater)32 b(than)e(or)g(equal)g(to)h(0.)41 | |
9060 | b(The)30 b(default)g(limit)e(is)h Fs(100)p Ft(.)630 4419 | |
9061 | y Fs(convert-meta)1110 4529 y Ft(If)22 b(set)g(to)h(`)p | |
9062 | Fs(on)p Ft(',)h(Readline)d(will)e(con)m(v)m(ert)24 b(c)m(haracters)f | |
9063 | (with)e(the)h(eigh)m(th)g(bit)f(set)1110 4639 y(to)h(an)f | |
9064 | Fl(asci)r(i)g Ft(k)m(ey)h(sequence)g(b)m(y)f(stripping)d(the)k(eigh)m | |
9065 | (th)f(bit)f(and)h(pre\014xing)e(an)1110 4745 y Fg(h)p | |
9066 | 1134 4692 139 4 v 1134 4748 a Ff(ESC)p 1134 4764 V 1268 | |
9067 | 4745 a Fg(i)1332 4748 y Ft(c)m(haracter,)36 b(con)m(v)m(erting)f(them)f | |
9068 | (to)g(a)h(meta-pre\014xed)f(k)m(ey)g(sequence.)1110 4858 | |
9069 | y(The)c(default)f(v)-5 b(alue)30 b(is)g(`)p Fs(on)p Ft('.)630 | |
9070 | 5011 y Fs(disable-completion)1110 5121 y Ft(If)36 b(set)h(to)h(`)p | |
9071 | Fs(On)p Ft(',)g(Readline)d(will)f(inhibit)f(w)m(ord)k(completion.)58 | |
9072 | b(Completion)1110 5230 y(c)m(haracters)28 b(will)23 b(b)s(e)i(inserted) | |
9073 | g(in)m(to)h(the)h(line)d(as)i(if)f(they)i(had)e(b)s(een)g(mapp)s(ed) | |
9074 | 1110 5340 y(to)31 b Fs(self-insert)p Ft(.)38 b(The)30 | |
9075 | b(default)f(is)h(`)p Fs(off)p Ft('.)p eop | |
9076 | %%Page: 88 94 | |
9077 | 88 93 bop 150 -116 a Ft(88)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
9078 | 299 y Fs(editing-mode)1110 408 y Ft(The)d Fs(editing-mode)e | |
9079 | Ft(v)-5 b(ariable)27 b(con)m(trols)i(whic)m(h)e(default)h(set)i(of)e(k) | |
9080 | m(ey)i(bind-)1110 518 y(ings)24 b(is)g(used.)38 b(By)26 | |
9081 | b(default,)f(Readline)f(starts)h(up)f(in)g(Emacs)h(editing)f(mo)s(de,) | |
9082 | 1110 628 y(where)29 b(the)g(k)m(eystrok)m(es)i(are)e(most)h(similar)c | |
9083 | (to)k(Emacs.)40 b(This)28 b(v)-5 b(ariable)28 b(can)1110 | |
9084 | 737 y(b)s(e)i(set)h(to)g(either)f(`)p Fs(emacs)p Ft(')f(or)h(`)p | |
9085 | Fs(vi)p Ft('.)630 934 y Fs(enable-keypad)1110 1044 y | |
9086 | Ft(When)23 b(set)h(to)g(`)p Fs(on)p Ft(',)h(Readline)d(will)f(try)i(to) | |
9087 | h(enable)f(the)g(application)f(k)m(eypad)1110 1154 y(when)k(it)g(is)f | |
9088 | (called.)39 b(Some)27 b(systems)f(need)h(this)e(to)i(enable)f(the)h | |
9089 | (arro)m(w)g(k)m(eys.)1110 1263 y(The)j(default)f(is)h(`)p | |
9090 | Fs(off)p Ft('.)630 1461 y Fs(expand-tilde)1110 1570 y | |
9091 | Ft(If)d(set)h(to)h(`)p Fs(on)p Ft(',)f(tilde)e(expansion)h(is)f(p)s | |
9092 | (erformed)g(when)h(Readline)f(attempts)1110 1680 y(w)m(ord)k | |
9093 | (completion.)40 b(The)30 b(default)f(is)h(`)p Fs(off)p | |
9094 | Ft('.)1110 1833 y(If)f(set)i(to)f(`)p Fs(on)p Ft(',)g(the)g(history)f | |
9095 | (co)s(de)h(attempts)g(to)h(place)e(p)s(oin)m(t)g(at)i(the)f(same)1110 | |
9096 | 1943 y(lo)s(cation)j(on)g(eac)m(h)i(history)d(line)g(retriev)m(ed)h | |
9097 | (with)f Fs(previous-history)d Ft(or)1110 2052 y Fs(next-history)p | |
9098 | Ft(.)630 2250 y Fs(horizontal-scroll-mode)1110 2359 y | |
9099 | Ft(This)34 b(v)-5 b(ariable)35 b(can)h(b)s(e)f(set)h(to)h(either)e(`)p | |
9100 | Fs(on)p Ft(')h(or)g(`)p Fs(off)p Ft('.)57 b(Setting)35 | |
9101 | b(it)g(to)i(`)p Fs(on)p Ft(')1110 2469 y(means)26 b(that)h(the)f(text)h | |
9102 | (of)g(the)f(lines)e(b)s(eing)h(edited)h(will)d(scroll)i(horizon)m | |
9103 | (tally)1110 2578 y(on)32 b(a)g(single)e(screen)i(line)e(when)g(they)i | |
9104 | (are)g(longer)g(than)f(the)h(width)e(of)i(the)1110 2688 | |
9105 | y(screen,)27 b(instead)f(of)g(wrapping)e(on)m(to)j(a)f(new)g(screen)g | |
9106 | (line.)37 b(By)27 b(default,)f(this)1110 2798 y(v)-5 | |
9107 | b(ariable)29 b(is)h(set)g(to)i(`)p Fs(off)p Ft('.)630 | |
9108 | 2995 y Fs(input-meta)1110 3104 y Ft(If)f(set)g(to)h(`)p | |
9109 | Fs(on)p Ft(',)g(Readline)e(will)e(enable)j(eigh)m(t-bit)g(input)e(\(it) | |
9110 | i(will)d(not)k(clear)1110 3214 y(the)40 b(eigh)m(th)f(bit)g(in)f(the)i | |
9111 | (c)m(haracters)h(it)e(reads\),)k(regardless)38 b(of)i(what)g(the)1110 | |
9112 | 3324 y(terminal)e(claims)h(it)h(can)g(supp)s(ort.)68 | |
9113 | b(The)39 b(default)g(v)-5 b(alue)39 b(is)g(`)p Fs(off)p | |
9114 | Ft('.)69 b(The)1110 3433 y(name)30 b Fs(meta-flag)e Ft(is)i(a)g(synon)m | |
9115 | (ym)g(for)g(this)g(v)-5 b(ariable.)630 3630 y Fs(isearch-terminators) | |
9116 | 1110 3740 y Ft(The)51 b(string)g(of)h(c)m(haracters)h(that)f(should)d | |
9117 | (terminate)j(an)g(incremen)m(tal)1110 3850 y(searc)m(h)25 | |
9118 | b(without)f(subsequen)m(tly)g(executing)h(the)g(c)m(haracter)h(as)f(a)g | |
9119 | (command)1110 3959 y(\(see)42 b(Section)e(8.2.5)j([Searc)m(hing],)h | |
9120 | (page)d(86\).)73 b(If)41 b(this)f(v)-5 b(ariable)39 b(has)i(not)1110 | |
9121 | 4069 y(b)s(een)31 b(giv)m(en)g(a)h(v)-5 b(alue,)31 b(the)h(c)m | |
9122 | (haracters)2494 4066 y Fg(h)p 2518 4013 139 4 v 2518 | |
9123 | 4069 a Ff(ESC)p 2518 4084 V 2652 4066 a Fg(i)2713 4069 | |
9124 | y Ft(and)f Fj(C-J)g Ft(will)e(terminate)i(an)1110 4178 | |
9125 | y(incremen)m(tal)f(searc)m(h.)630 4376 y Fs(keymap)192 | |
9126 | b Ft(Sets)39 b(Readline's)e(idea)i(of)g(the)g(curren)m(t)f(k)m(eymap)h | |
9127 | (for)g(k)m(ey)g(binding)d(com-)1110 4485 y(mands.)81 | |
9128 | b(Acceptable)46 b Fs(keymap)c Ft(names)i(are)h Fs(emacs)p | |
9129 | Ft(,)i Fs(emacs-standard)p Ft(,)1110 4595 y Fs(emacs-meta)p | |
9130 | Ft(,)99 b Fs(emacs-ctlx)p Ft(,)f Fs(vi)p Ft(,)j Fs(vi-move)p | |
9131 | Ft(,)f Fs(vi-command)p Ft(,)f(and)1110 4704 y Fs(vi-insert)p | |
9132 | Ft(.)64 b Fs(vi)38 b Ft(is)g(equiv)-5 b(alen)m(t)39 b(to)g | |
9133 | Fs(vi-command)p Ft(;)i Fs(emacs)c Ft(is)h(equiv)-5 b(alen)m(t)1110 | |
9134 | 4814 y(to)33 b Fs(emacs-standard)p Ft(.)41 b(The)31 b(default)g(v)-5 | |
9135 | b(alue)31 b(is)g Fs(emacs)p Ft(.)44 b(The)31 b(v)-5 b(alue)32 | |
9136 | b(of)g(the)1110 4924 y Fs(editing-mode)27 b Ft(v)-5 b(ariable)29 | |
9137 | b(also)i(a\013ects)g(the)g(default)e(k)m(eymap.)630 5121 | |
9138 | y Fs(mark-directories)1110 5230 y Ft(If)38 b(set)g(to)h(`)p | |
9139 | Fs(on)p Ft(',)i(completed)d(directory)f(names)h(ha)m(v)m(e)i(a)e(slash) | |
9140 | f(app)s(ended.)1110 5340 y(The)30 b(default)f(is)h(`)p | |
9141 | Fs(on)p Ft('.)p eop | |
9142 | %%Page: 89 95 | |
9143 | 89 94 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9144 | b(Line)h(Editing)2105 b(89)630 299 y Fs(mark-modified-lines)1110 | |
9145 | 408 y Ft(This)34 b(v)-5 b(ariable,)36 b(when)f(set)h(to)h(`)p | |
9146 | Fs(on)p Ft(',)g(causes)g(Readline)d(to)j(displa)m(y)d(an)h(as-)1110 | |
9147 | 518 y(terisk)e(\(`)p Fs(*)p Ft('\))i(at)f(the)g(start)g(of)g(history)f | |
9148 | (lines)f(whic)m(h)g(ha)m(v)m(e)j(b)s(een)e(mo)s(di\014ed.)1110 | |
9149 | 628 y(This)c(v)-5 b(ariable)29 b(is)g(`)p Fs(off)p Ft(')h(b)m(y)g | |
9150 | (default.)630 786 y Fs(mark-symlinked-directori)o(es)1110 | |
9151 | 896 y Ft(If)44 b(set)h(to)h(`)p Fs(on)p Ft(',)i(completed)d(names)g | |
9152 | (whic)m(h)e(are)i(sym)m(b)s(olic)e(links)g(to)i(di-)1110 | |
9153 | 1005 y(rectories)i(ha)m(v)m(e)g(a)g(slash)e(app)s(ended)f(\(sub)5 | |
9154 | b(ject)47 b(to)g(the)f(v)-5 b(alue)46 b(of)g Fs(mark-)1110 | |
9155 | 1115 y(directories)p Ft(\).)38 b(The)30 b(default)f(is)h(`)p | |
9156 | Fs(off)p Ft('.)630 1273 y Fs(match-hidden-files)1110 | |
9157 | 1383 y Ft(This)20 b(v)-5 b(ariable,)23 b(when)f(set)g(to)h(`)p | |
9158 | Fs(on)p Ft(',)h(causes)f(Readline)e(to)i(matc)m(h)g(\014les)e(whose) | |
9159 | 1110 1492 y(names)44 b(b)s(egin)f(with)g(a)h(`)p Fs(.)p | |
9160 | Ft(')g(\(hidden)e(\014les\))i(when)f(p)s(erforming)f(\014lename)1110 | |
9161 | 1602 y(completion,)i(unless)c(the)h(leading)f(`)p Fs(.)p | |
9162 | Ft(')i(is)f(supplied)d(b)m(y)j(the)h(user)f(in)f(the)1110 | |
9163 | 1711 y(\014lename)30 b(to)h(b)s(e)e(completed.)41 b(This)29 | |
9164 | b(v)-5 b(ariable)29 b(is)g(`)p Fs(on)p Ft(')i(b)m(y)f(default.)630 | |
9165 | 1870 y Fs(output-meta)1110 1979 y Ft(If)35 b(set)h(to)g(`)p | |
9166 | Fs(on)p Ft(',)h(Readline)d(will)f(displa)m(y)g(c)m(haracters)k(with)d | |
9167 | (the)i(eigh)m(th)f(bit)1110 2089 y(set)i(directly)e(rather)h(than)g(as) | |
9168 | h(a)g(meta-pre\014xed)f(escap)s(e)h(sequence.)59 b(The)1110 | |
9169 | 2198 y(default)30 b(is)f(`)p Fs(off)p Ft('.)630 2357 | |
9170 | y Fs(page-completions)1110 2466 y Ft(If)k(set)i(to)f(`)p | |
9171 | Fs(on)p Ft(',)h(Readline)e(uses)g(an)h(in)m(ternal)f | |
9172 | Fs(more)p Ft(-lik)m(e)f(pager)i(to)h(displa)m(y)1110 | |
9173 | 2576 y(a)e(screenful)e(of)h(p)s(ossible)e(completions)i(at)h(a)g(time.) | |
9174 | 46 b(This)30 b(v)-5 b(ariable)32 b(is)f(`)p Fs(on)p Ft(')1110 | |
9175 | 2685 y(b)m(y)f(default.)630 2844 y Fs(print-completions-horizo)o(ntal)o | |
9176 | (ly)1110 2953 y Ft(If)23 b(set)i(to)g(`)p Fs(on)p Ft(',)g(Readline)e | |
9177 | (will)e(displa)m(y)h(completions)h(with)g(matc)m(hes)i(sorted)1110 | |
9178 | 3063 y(horizon)m(tally)42 b(in)g(alphab)s(etical)g(order,)47 | |
9179 | b(rather)c(than)g(do)m(wn)g(the)h(screen.)1110 3173 y(The)30 | |
9180 | b(default)f(is)h(`)p Fs(off)p Ft('.)630 3331 y Fs | |
9181 | (show-all-if-ambiguous)1110 3440 y Ft(This)e(alters)i(the)g(default)f | |
9182 | (b)s(eha)m(vior)g(of)h(the)h(completion)e(functions.)39 | |
9183 | b(If)29 b(set)1110 3550 y(to)f(`)p Fs(on)p Ft(',)g(w)m(ords)f(whic)m(h) | |
9184 | f(ha)m(v)m(e)j(more)f(than)f(one)h(p)s(ossible)d(completion)h(cause) | |
9185 | 1110 3660 y(the)39 b(matc)m(hes)h(to)g(b)s(e)e(listed)f(immediately)h | |
9186 | (instead)g(of)h(ringing)e(the)i(b)s(ell.)1110 3769 y(The)30 | |
9187 | b(default)f(v)-5 b(alue)30 b(is)g(`)p Fs(off)p Ft('.)630 | |
9188 | 3927 y Fs(show-all-if-unmodified)1110 4037 y Ft(This)37 | |
9189 | b(alters)h(the)h(default)f(b)s(eha)m(vior)g(of)g(the)h(completion)f | |
9190 | (functions)f(in)h(a)1110 4147 y(fashion)24 b(similar)f(to)j | |
9191 | Fq(sho)m(w-all-if-am)m(biguous)p Ft(.)37 b(If)25 b(set)h(to)h(`)p | |
9192 | Fs(on)p Ft(',)f(w)m(ords)f(whic)m(h)1110 4256 y(ha)m(v)m(e)32 | |
9193 | b(more)f(than)f(one)i(p)s(ossible)c(completion)i(without)g(an)m(y)h(p)s | |
9194 | (ossible)d(par-)1110 4366 y(tial)41 b(completion)h(\(the)h(p)s(ossible) | |
9195 | d(completions)h(don't)h(share)g(a)h(common)1110 4475 | |
9196 | y(pre\014x\))30 b(cause)g(the)h(matc)m(hes)g(to)g(b)s(e)f(listed)e | |
9197 | (immediately)h(instead)g(of)i(ring-)1110 4585 y(ing)f(the)g(b)s(ell.)39 | |
9198 | b(The)30 b(default)f(v)-5 b(alue)30 b(is)f(`)p Fs(off)p | |
9199 | Ft('.)630 4743 y Fs(visible-stats)1110 4853 y Ft(If)i(set)i(to)f(`)p | |
9200 | Fs(on)p Ft(',)h(a)f(c)m(haracter)i(denoting)d(a)h(\014le's)f(t)m(yp)s | |
9201 | (e)h(is)f(app)s(ended)f(to)j(the)1110 4963 y(\014lename)d(when)f | |
9202 | (listing)f(p)s(ossible)g(completions.)40 b(The)30 b(default)f(is)h(`)p | |
9203 | Fs(off)p Ft('.)150 5121 y(Key)g(Bindings)630 5230 y(The)41 | |
9204 | b(syn)m(tax)i(for)f(con)m(trolling)e(k)m(ey)j(bindings)c(in)i(the)h | |
9205 | (init)e(\014le)h(is)g(simple.)73 b(First)42 b(y)m(ou)630 | |
9206 | 5340 y(need)27 b(to)i(\014nd)d(the)i(name)f(of)h(the)g(command)f(that)i | |
9207 | (y)m(ou)f(w)m(an)m(t)g(to)g(c)m(hange.)41 b(The)27 b(follo)m(wing)p | |
9208 | eop | |
9209 | %%Page: 90 96 | |
9210 | 90 95 bop 150 -116 a Ft(90)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
9211 | 299 y(sections)36 b(con)m(tain)g(tables)g(of)g(the)g(command)f(name,)j | |
9212 | (the)e(default)f(k)m(eybinding,)g(if)g(an)m(y)-8 b(,)630 | |
9213 | 408 y(and)30 b(a)h(short)f(description)e(of)j(what)f(the)g(command)h | |
9214 | (do)s(es.)630 543 y(Once)36 b(y)m(ou)g(kno)m(w)g(the)g(name)g(of)g(the) | |
9215 | g(command,)h(simply)d(place)i(on)f(a)i(line)d(in)h(the)h(init)630 | |
9216 | 653 y(\014le)d(the)h(name)f(of)h(the)g(k)m(ey)g(y)m(ou)g(wish)e(to)i | |
9217 | (bind)e(the)i(command)f(to,)i(a)f(colon,)h(and)e(then)630 | |
9218 | 762 y(the)f(name)g(of)g(the)g(command.)46 b(The)31 b(name)h(of)g(the)g | |
9219 | (k)m(ey)h(can)f(b)s(e)f(expressed)h(in)e(di\013eren)m(t)630 | |
9220 | 872 y(w)m(a)m(ys,)h(dep)s(ending)d(on)j(what)f(y)m(ou)h(\014nd)d(most)j | |
9221 | (comfortable.)630 1006 y(In)k(addition)f(to)j(command)f(names,)i | |
9222 | (readline)c(allo)m(ws)h(k)m(eys)i(to)g(b)s(e)e(b)s(ound)f(to)j(a)f | |
9223 | (string)630 1116 y(that)31 b(is)e(inserted)h(when)f(the)i(k)m(ey)g(is)e | |
9224 | (pressed)h(\(a)h Fq(macro)5 b Ft(\).)630 1250 y(The)42 | |
9225 | b Fs(bind)30 b(-p)42 b Ft(command)h(displa)m(ys)e(Readline)g(function)h | |
9226 | (names)h(and)f(bindings)e(in)i(a)630 1360 y(format)37 | |
9227 | b(that)h(can)f(put)f(directly)g(in)m(to)h(an)g(initialization)d | |
9228 | (\014le.)59 b(See)38 b(Section)e(4.2)j([Bash)630 1469 | |
9229 | y(Builtins],)28 b(page)j(39.)630 1629 y Fq(k)m(eyname)5 | |
9230 | b Ft(:)42 b Fq(function-name)34 b Ft(or)d Fq(macro)1110 | |
9231 | 1738 y(k)m(eyname)k Ft(is)28 b(the)g(name)h(of)g(a)g(k)m(ey)h(sp)s | |
9232 | (elled)c(out)j(in)f(English.)37 b(F)-8 b(or)30 b(example:)1350 | |
9233 | 1873 y Fs(Control-u:)45 b(universal-argument)1350 1983 | |
9234 | y(Meta-Rubout:)f(backward-kill-word)1350 2092 y(Control-o:)h(">)i | |
9235 | (output")1110 2227 y Ft(In)38 b(the)h(ab)s(o)m(v)m(e)h(example,)g | |
9236 | Fj(C-u)e Ft(is)g(b)s(ound)e(to)k(the)e(function)g Fs(universal-)1110 | |
9237 | 2336 y(argument)p Ft(,)g Fj(M-DEL)e Ft(is)h(b)s(ound)f(to)i(the)g | |
9238 | (function)f Fs(backward-kill-word)p Ft(,)1110 2446 y(and)h | |
9239 | Fj(C-o)g Ft(is)g(b)s(ound)f(to)j(run)d(the)j(macro)f(expressed)g(on)f | |
9240 | (the)i(righ)m(t)e(hand)1110 2555 y(side)29 b(\(that)j(is,)d(to)i | |
9241 | (insert)f(the)g(text)i(`)p Fs(>)e(output)p Ft(')f(in)m(to)h(the)h | |
9242 | (line\).)1110 2690 y(A)37 b(n)m(um)m(b)s(er)f(of)h(sym)m(b)s(olic)e(c)m | |
9243 | (haracter)k(names)e(are)g(recognized)g(while)e(pro-)1110 | |
9244 | 2800 y(cessing)23 b(this)g(k)m(ey)h(binding)d(syn)m(tax:)37 | |
9245 | b Fq(DEL)p Ft(,)24 b Fq(ESC)p Ft(,)f Fq(ESCAPE)p Ft(,)g | |
9246 | Fq(LFD)p Ft(,)h Fq(NEW-)1110 2909 y(LINE)p Ft(,)30 b | |
9247 | Fq(RET)p Ft(,)g Fq(RETURN)p Ft(,)h Fq(R)m(UBOUT)p Ft(,)g | |
9248 | Fq(SP)-8 b(A)m(CE)p Ft(,)30 b Fq(SPC)p Ft(,)g(and)f Fq(T)-8 | |
9249 | b(AB)p Ft(.)630 3068 y Fs(")p Fq(k)m(eyseq)r Fs(")p Ft(:)41 | |
9250 | b Fq(function-name)35 b Ft(or)30 b Fq(macro)1110 3178 | |
9251 | y(k)m(eyseq)k Ft(di\013ers)c(from)g Fq(k)m(eyname)37 | |
9252 | b Ft(ab)s(o)m(v)m(e)32 b(in)e(that)i(strings)e(denoting)g(an)h(en-)1110 | |
9253 | 3288 y(tire)i(k)m(ey)i(sequence)f(can)g(b)s(e)f(sp)s(eci\014ed,)g(b)m | |
9254 | (y)g(placing)g(the)h(k)m(ey)g(sequence)g(in)1110 3397 | |
9255 | y(double)28 b(quotes.)41 b(Some)29 b Fl(gnu)h Ft(Emacs)f(st)m(yle)h(k)m | |
9256 | (ey)g(escap)s(es)g(can)g(b)s(e)f(used,)g(as)1110 3507 | |
9257 | y(in)j(the)i(follo)m(wing)f(example,)h(but)f(the)h(sp)s(ecial)f(c)m | |
9258 | (haracter)i(names)f(are)g(not)1110 3616 y(recognized.)1350 | |
9259 | 3751 y Fs("\\C-u":)46 b(universal-argument)1350 3861 | |
9260 | y("\\C-x\\C-r":)f(re-read-init-file)1350 3970 y("\\e[11~":)g("Function) | |
9261 | h(Key)g(1")1110 4105 y Ft(In)64 b(the)g(ab)s(o)m(v)m(e)i(example,)73 | |
9262 | b Fj(C-u)64 b Ft(is)f(again)i(b)s(ound)d(to)k(the)e(function)1110 | |
9263 | 4214 y Fs(universal-argument)39 b Ft(\(just)k(as)h(it)f(w)m(as)h(in)f | |
9264 | (the)g(\014rst)g(example\),)48 b(`)p Fj(C-x)1110 4324 | |
9265 | y(C-r)p Ft(')41 b(is)f(b)s(ound)f(to)j(the)f(function)f | |
9266 | Fs(re-read-init-file)p Ft(,)f(and)i(`)3462 4321 y Fg(h)p | |
9267 | 3486 4268 139 4 v 3486 4324 a Ff(ESC)p 3486 4339 V 3620 | |
9268 | 4321 a Fg(i)31 b(h)p 3705 4268 20 4 v 3705 4324 a Ff([)p | |
9269 | 3705 4340 V 3720 4321 a Fg(i)1110 4430 y(h)p 1134 4377 | |
9270 | 36 4 v 1134 4433 a Ff(1)p 1134 4449 V 1165 4430 a Fg(i)f(h)p | |
9271 | 1250 4377 V 1250 4433 a Ff(1)p 1250 4449 V 1281 4430 | |
9272 | a Fg(i)g(h)p 1365 4377 48 4 v 1365 4433 a Fs(~)p 1365 | |
9273 | 4449 V 1409 4430 a Fg(i)1438 4433 y Ft(')h(is)e(b)s(ound)g(to)i(insert) | |
9274 | e(the)i(text)g(`)p Fs(Function)d(Key)i(1)p Ft('.)630 | |
9275 | 4593 y(The)f(follo)m(wing)f Fl(gnu)i Ft(Emacs)g(st)m(yle)g(escap)s(e)g | |
9276 | (sequences)g(are)g(a)m(v)-5 b(ailable)29 b(when)g(sp)s(ecifying)630 | |
9277 | 4702 y(k)m(ey)i(sequences:)630 4862 y Fj(\\C-)336 b Ft(con)m(trol)31 | |
9278 | b(pre\014x)630 5021 y Fj(\\M-)336 b Ft(meta)31 b(pre\014x)630 | |
9279 | 5181 y Fj(\\e)384 b Ft(an)30 b(escap)s(e)h(c)m(haracter)630 | |
9280 | 5340 y Fj(\\\\)384 b Ft(bac)m(kslash)p eop | |
9281 | %%Page: 91 97 | |
9282 | 91 96 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9283 | b(Line)h(Editing)2105 b(91)630 299 y Fj(\\)p Fs(")1110 | |
9284 | 296 y Fg(h)p 1134 243 48 4 v 1134 299 a Fs(")p 1134 314 | |
9285 | V 1178 296 a Fg(i)1208 299 y Ft(,)30 b(a)h(double)e(quotation)h(mark) | |
9286 | 630 460 y Fj(\\')1110 457 y Fg(h)p 1134 403 20 4 v 1134 | |
9287 | 460 a Ff(')p 1134 475 V 1150 457 a Fg(i)1179 460 y Ft(,)h(a)g(single)e | |
9288 | (quote)i(or)f(ap)s(ostrophe)630 620 y(In)d(addition)f(to)i(the)g | |
9289 | Fl(gnu)f Ft(Emacs)h(st)m(yle)g(escap)s(e)g(sequences,)h(a)f(second)f | |
9290 | (set)h(of)g(bac)m(kslash)630 730 y(escap)s(es)j(is)e(a)m(v)-5 | |
9291 | b(ailable:)630 890 y Fs(\\a)384 b Ft(alert)30 b(\(b)s(ell\))630 | |
9292 | 1051 y Fs(\\b)384 b Ft(bac)m(kspace)630 1212 y Fs(\\d)g | |
9293 | Ft(delete)630 1372 y Fs(\\f)g Ft(form)30 b(feed)630 1533 | |
9294 | y Fs(\\n)384 b Ft(newline)630 1694 y Fs(\\r)g Ft(carriage)31 | |
9295 | b(return)630 1854 y Fs(\\t)384 b Ft(horizon)m(tal)30 | |
9296 | b(tab)630 2015 y Fs(\\v)384 b Ft(v)m(ertical)30 b(tab)630 | |
9297 | 2176 y Fs(\\)p Fj(nnn)288 b Ft(the)35 b(eigh)m(t-bit)f(c)m(haracter)i | |
9298 | (whose)e(v)-5 b(alue)34 b(is)g(the)g(o)s(ctal)h(v)-5 | |
9299 | b(alue)34 b Fq(nnn)f Ft(\(one)i(to)1110 2285 y(three)c(digits\))630 | |
9300 | 2446 y Fs(\\x)p Fj(HH)288 b Ft(the)40 b(eigh)m(t-bit)f(c)m(haracter)i | |
9301 | (whose)e(v)-5 b(alue)38 b(is)h(the)g(hexadecimal)g(v)-5 | |
9302 | b(alue)39 b Fq(HH)1110 2555 y Ft(\(one)31 b(or)f(t)m(w)m(o)i(hex)e | |
9303 | (digits\))630 2716 y(When)37 b(en)m(tering)g(the)h(text)g(of)g(a)g | |
9304 | (macro,)i(single)c(or)h(double)f(quotes)i(m)m(ust)f(b)s(e)g(used)f(to) | |
9305 | 630 2826 y(indicate)21 b(a)g(macro)h(de\014nition.)36 | |
9306 | b(Unquoted)21 b(text)i(is)d(assumed)h(to)h(b)s(e)f(a)h(function)e | |
9307 | (name.)38 b(In)630 2935 y(the)22 b(macro)f(b)s(o)s(dy)-8 | |
9308 | b(,)23 b(the)e(bac)m(kslash)g(escap)s(es)h(describ)s(ed)d(ab)s(o)m(v)m | |
9309 | (e)k(are)e(expanded.)37 b(Bac)m(kslash)630 3045 y(will)g(quote)k(an)m | |
9310 | (y)f(other)g(c)m(haracter)i(in)c(the)j(macro)f(text,)k(including)36 | |
9311 | b(`)p Fs(")p Ft(')k(and)g(`)p Fs(')p Ft('.)69 b(F)-8 | |
9312 | b(or)630 3154 y(example,)27 b(the)f(follo)m(wing)e(binding)e(will)h | |
9313 | (mak)m(e)k(`)p Fj(C-x)j Fs(\\)p Ft(')c(insert)e(a)i(single)f(`)p | |
9314 | Fs(\\)p Ft(')h(in)m(to)f(the)h(line:)870 3290 y Fs("\\C-x\\\\":)45 | |
9315 | b("\\\\")150 3516 y Fk(8.3.2)63 b(Conditional)41 b(Init)g(Constructs) | |
9316 | 275 3762 y Ft(Readline)34 b(implemen)m(ts)f(a)j(facilit)m(y)f(similar)d | |
9317 | (in)i(spirit)f(to)j(the)g(conditional)e(compilation)g(features)150 | |
9318 | 3871 y(of)h(the)f(C)g(prepro)s(cessor)g(whic)m(h)f(allo)m(ws)h(k)m(ey)h | |
9319 | (bindings)c(and)j(v)-5 b(ariable)33 b(settings)i(to)g(b)s(e)f(p)s | |
9320 | (erformed)f(as)150 3981 y(the)e(result)e(of)h(tests.)42 | |
9321 | b(There)30 b(are)h(four)e(parser)h(directiv)m(es)g(used.)150 | |
9322 | 4142 y Fs($if)336 b Ft(The)31 b Fs($if)f Ft(construct)i(allo)m(ws)f | |
9323 | (bindings)d(to)k(b)s(e)e(made)i(based)f(on)g(the)g(editing)f(mo)s(de,)i | |
9324 | (the)630 4252 y(terminal)37 b(b)s(eing)f(used,)k(or)e(the)g | |
9325 | (application)e(using)h(Readline.)62 b(The)38 b(text)h(of)f(the)g(test) | |
9326 | 630 4361 y(extends)30 b(to)h(the)g(end)f(of)g(the)h(line;)e(no)h(c)m | |
9327 | (haracters)i(are)f(required)d(to)j(isolate)g(it.)630 | |
9328 | 4522 y Fs(mode)288 b Ft(The)20 b Fs(mode=)g Ft(form)g(of)h(the)g | |
9329 | Fs($if)f Ft(directiv)m(e)h(is)f(used)g(to)h(test)h(whether)e(Readline) | |
9330 | 1110 4631 y(is)28 b(in)h Fs(emacs)f Ft(or)h Fs(vi)g Ft(mo)s(de.)40 | |
9331 | b(This)28 b(ma)m(y)i(b)s(e)e(used)h(in)f(conjunction)h(with)f(the)1110 | |
9332 | 4741 y(`)p Fs(set)i(keymap)p Ft(')c(command,)i(for)f(instance,)h(to)g | |
9333 | (set)g(bindings)d(in)h(the)i Fs(emacs-)1110 4851 y(standard)23 | |
9334 | b Ft(and)h Fs(emacs-ctlx)f Ft(k)m(eymaps)i(only)f(if)g(Readline)g(is)g | |
9335 | (starting)h(out)1110 4960 y(in)k Fs(emacs)g Ft(mo)s(de.)630 | |
9336 | 5121 y Fs(term)288 b Ft(The)26 b Fs(term=)g Ft(form)g(ma)m(y)i(b)s(e)e | |
9337 | (used)g(to)i(include)d(terminal-sp)s(eci\014c)f(k)m(ey)k(bind-)1110 | |
9338 | 5230 y(ings,)37 b(p)s(erhaps)d(to)j(bind)d(the)i(k)m(ey)h(sequences)f | |
9339 | (output)g(b)m(y)g(the)g(terminal's)1110 5340 y(function)23 | |
9340 | b(k)m(eys.)39 b(The)23 b(w)m(ord)h(on)f(the)i(righ)m(t)e(side)g(of)h | |
9341 | (the)g(`)p Fs(=)p Ft(')g(is)f(tested)i(against)p eop | |
9342 | %%Page: 92 98 | |
9343 | 92 97 bop 150 -116 a Ft(92)2572 b(Bash)31 b(Reference)g(Man)m(ual)1110 | |
9344 | 299 y(b)s(oth)e(the)h(full)e(name)i(of)g(the)g(terminal)f(and)g(the)i | |
9345 | (p)s(ortion)d(of)i(the)g(terminal)1110 408 y(name)k(b)s(efore)f(the)g | |
9346 | (\014rst)g(`)p Fs(-)p Ft('.)50 b(This)32 b(allo)m(ws)h | |
9347 | Fs(sun)g Ft(to)h(matc)m(h)g(b)s(oth)f Fs(sun)g Ft(and)1110 | |
9348 | 518 y Fs(sun-cmd)p Ft(,)c(for)h(instance.)630 677 y Fs(application)1110 | |
9349 | 787 y Ft(The)21 b Fq(application)g Ft(construct)h(is)f(used)g(to)i | |
9350 | (include)d(application-sp)s(eci\014c)f(set-)1110 897 | |
9351 | y(tings.)38 b(Eac)m(h)26 b(program)e(using)f(the)i(Readline)e(library)g | |
9352 | (sets)i(the)g Fq(application)1110 1006 y(name)p Ft(,)g(and)e(y)m(ou)g | |
9353 | (can)h(test)g(for)f(a)g(particular)f(v)-5 b(alue.)38 | |
9354 | b(This)21 b(could)h(b)s(e)h(used)f(to)1110 1116 y(bind)31 | |
9355 | b(k)m(ey)i(sequences)g(to)h(functions)d(useful)g(for)i(a)g(sp)s | |
9356 | (eci\014c)e(program.)48 b(F)-8 b(or)1110 1225 y(instance,)34 | |
9357 | b(the)f(follo)m(wing)e(command)i(adds)f(a)i(k)m(ey)f(sequence)h(that)f | |
9358 | (quotes)1110 1335 y(the)e(curren)m(t)f(or)g(previous)f(w)m(ord)h(in)f | |
9359 | (Bash:)1350 1469 y Fs($if)47 b(Bash)1350 1579 y(#)g(Quote)g(the)g | |
9360 | (current)f(or)h(previous)e(word)1350 1689 y("\\C-xq":)h | |
9361 | ("\\eb\\"\\ef\\"")1350 1798 y($endif)150 1958 y($endif)192 | |
9362 | b Ft(This)28 b(command,)j(as)f(seen)h(in)e(the)h(previous)f(example,)h | |
9363 | (terminates)g(an)h Fs($if)e Ft(command.)150 2117 y Fs($else)240 | |
9364 | b Ft(Commands)29 b(in)g(this)h(branc)m(h)f(of)i(the)f | |
9365 | Fs($if)g Ft(directiv)m(e)g(are)h(executed)g(if)e(the)i(test)g(fails.) | |
9366 | 150 2276 y Fs($include)96 b Ft(This)42 b(directiv)m(e)h(tak)m(es)i(a)e | |
9367 | (single)g(\014lename)f(as)i(an)f(argumen)m(t)h(and)f(reads)g(commands) | |
9368 | 630 2386 y(and)38 b(bindings)d(from)j(that)i(\014le.)64 | |
9369 | b(F)-8 b(or)39 b(example,)i(the)e(follo)m(wing)e(directiv)m(e)h(reads)g | |
9370 | (from)630 2496 y(`)p Fs(/etc/inputrc)p Ft(':)870 2630 | |
9371 | y Fs($include)46 b(/etc/inputrc)150 2854 y Fk(8.3.3)63 | |
9372 | b(Sample)40 b(Init)h(File)275 3098 y Ft(Here)31 b(is)e(an)h(example)h | |
9373 | (of)f(an)g Fq(inputrc)k Ft(\014le.)41 b(This)28 b(illustrates)h(k)m(ey) | |
9374 | i(binding,)d(v)-5 b(ariable)29 b(assignmen)m(t,)150 3208 | |
9375 | y(and)h(conditional)e(syn)m(tax.)p eop | |
9376 | %%Page: 93 99 | |
9377 | 93 98 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9378 | b(Line)h(Editing)2105 b(93)390 408 y Fs(#)47 b(This)g(file)g(controls)e | |
9379 | (the)i(behaviour)e(of)j(line)e(input)h(editing)e(for)390 | |
9380 | 518 y(#)i(programs)f(that)h(use)g(the)f(GNU)h(Readline)f(library.)93 | |
9381 | b(Existing)390 628 y(#)47 b(programs)f(include)g(FTP,)g(Bash,)h(and)g | |
9382 | (GDB.)390 737 y(#)390 847 y(#)g(You)g(can)g(re-read)f(the)h(inputrc)f | |
9383 | (file)g(with)h(C-x)g(C-r.)390 956 y(#)g(Lines)g(beginning)e(with)i('#') | |
9384 | g(are)g(comments.)390 1066 y(#)390 1176 y(#)g(First,)g(include)e(any)i | |
9385 | (systemwide)e(bindings)h(and)h(variable)390 1285 y(#)g(assignments)e | |
9386 | (from)i(/etc/Inputrc)390 1395 y($include)f(/etc/Inputrc)390 | |
9387 | 1614 y(#)390 1724 y(#)h(Set)g(various)f(bindings)g(for)h(emacs)f(mode.) | |
9388 | 390 1943 y(set)h(editing-mode)d(emacs)390 2162 y($if)j(mode=emacs)390 | |
9389 | 2381 y(Meta-Control-h:)91 b(backward-kill-word)43 b(Text)k(after)f(the) | |
9390 | h(function)f(name)g(is)h(ignored)390 2600 y(#)390 2710 | |
9391 | y(#)g(Arrow)g(keys)f(in)i(keypad)e(mode)390 2819 y(#)390 | |
9392 | 2929 y(#"\\M-OD":)379 b(backward-char)390 3039 y(#"\\M-OC":)g | |
9393 | (forward-char)390 3148 y(#"\\M-OA":)g(previous-history)390 | |
9394 | 3258 y(#"\\M-OB":)g(next-history)390 3367 y(#)390 3477 | |
9395 | y(#)47 b(Arrow)g(keys)f(in)i(ANSI)e(mode)390 3587 y(#)390 | |
9396 | 3696 y("\\M-[D":)380 b(backward-char)390 3806 y("\\M-[C":)g | |
9397 | (forward-char)390 3915 y("\\M-[A":)g(previous-history)390 | |
9398 | 4025 y("\\M-[B":)g(next-history)390 4134 y(#)390 4244 | |
9399 | y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(keypad)f(mode)390 | |
9400 | 4354 y(#)390 4463 y(#"\\M-\\C-OD":)331 b(backward-char)390 | |
9401 | 4573 y(#"\\M-\\C-OC":)g(forward-char)390 4682 y(#"\\M-\\C-OA":)g | |
9402 | (previous-history)390 4792 y(#"\\M-\\C-OB":)g(next-history)390 | |
9403 | 4902 y(#)390 5011 y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(ANSI)g(mode) | |
9404 | 390 5121 y(#)390 5230 y(#"\\M-\\C-[D":)331 b(backward-char)390 | |
9405 | 5340 y(#"\\M-\\C-[C":)g(forward-char)p eop | |
9406 | %%Page: 94 100 | |
9407 | 94 99 bop 150 -116 a Ft(94)2572 b(Bash)31 b(Reference)g(Man)m(ual)390 | |
9408 | 299 y Fs(#"\\M-\\C-[A":)331 b(previous-history)390 408 | |
9409 | y(#"\\M-\\C-[B":)g(next-history)390 628 y(C-q:)47 b(quoted-insert)390 | |
9410 | 847 y($endif)390 1066 y(#)g(An)h(old-style)d(binding.)93 | |
9411 | b(This)47 b(happens)f(to)h(be)g(the)g(default.)390 1176 | |
9412 | y(TAB:)g(complete)390 1395 y(#)g(Macros)g(that)f(are)h(convenient)e | |
9413 | (for)i(shell)f(interaction)390 1504 y($if)h(Bash)390 | |
9414 | 1614 y(#)g(edit)g(the)g(path)390 1724 y("\\C-xp":)f | |
9415 | ("PATH=${PATH}\\e\\C-e\\C-a)o(\\ef)o(\\C-f)o(")390 1833 | |
9416 | y(#)h(prepare)f(to)h(type)g(a)h(quoted)e(word)g(--)390 | |
9417 | 1943 y(#)h(insert)g(open)f(and)h(close)f(double)h(quotes)390 | |
9418 | 2052 y(#)g(and)g(move)g(to)g(just)g(after)f(the)h(open)g(quote)390 | |
9419 | 2162 y("\\C-x\\"":)e("\\"\\"\\C-b")390 2271 y(#)i(insert)g(a)g | |
9420 | (backslash)e(\(testing)h(backslash)f(escapes)390 2381 | |
9421 | y(#)i(in)h(sequences)d(and)i(macros\))390 2491 y("\\C-x\\\\":)e("\\\\") | |
9422 | 390 2600 y(#)i(Quote)g(the)g(current)f(or)h(previous)e(word)390 | |
9423 | 2710 y("\\C-xq":)h("\\eb\\"\\ef\\"")390 2819 y(#)h(Add)g(a)h(binding)e | |
9424 | (to)h(refresh)f(the)h(line,)f(which)g(is)h(unbound)390 | |
9425 | 2929 y("\\C-xr":)f(redraw-current-line)390 3039 y(#)h(Edit)g(variable)f | |
9426 | (on)h(current)f(line.)390 3148 y("\\M-\\C-v":)f | |
9427 | ("\\C-a\\C-k$\\C-y\\M-\\C-e\\C-)o(a\\C-)o(y=")390 3258 | |
9428 | y($endif)390 3477 y(#)i(use)g(a)h(visible)e(bell)g(if)h(one)g(is)h | |
9429 | (available)390 3587 y(set)f(bell-style)e(visible)390 | |
9430 | 3806 y(#)i(don't)g(strip)f(characters)f(to)i(7)h(bits)e(when)h(reading) | |
9431 | 390 3915 y(set)g(input-meta)e(on)390 4134 y(#)i(allow)g(iso-latin1)e | |
9432 | (characters)g(to)i(be)g(inserted)f(rather)390 4244 y(#)h(than)g | |
9433 | (converted)e(to)j(prefix-meta)c(sequences)390 4354 y(set)j | |
9434 | (convert-meta)d(off)390 4573 y(#)j(display)f(characters)f(with)i(the)g | |
9435 | (eighth)f(bit)h(set)g(directly)390 4682 y(#)g(rather)g(than)f(as)h | |
9436 | (meta-prefixed)e(characters)390 4792 y(set)i(output-meta)e(on)390 | |
9437 | 5011 y(#)i(if)h(there)e(are)h(more)g(than)f(150)h(possible)f | |
9438 | (completions)e(for)390 5121 y(#)j(a)h(word,)e(ask)h(the)g(user)g(if)g | |
9439 | (he)g(wants)f(to)i(see)f(all)f(of)i(them)390 5230 y(set)f | |
9440 | (completion-query-items)42 b(150)p eop | |
9441 | %%Page: 95 101 | |
9442 | 95 100 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9443 | b(Line)h(Editing)2105 b(95)390 299 y Fs(#)47 b(For)g(FTP)390 | |
9444 | 408 y($if)g(Ftp)390 518 y("\\C-xg":)f("get)g(\\M-?")390 | |
9445 | 628 y("\\C-xt":)g("put)g(\\M-?")390 737 y("\\M-.":)g(yank-last-arg)390 | |
9446 | 847 y($endif)150 1086 y Fr(8.4)68 b(Bindable)45 b(Readline)i(Commands) | |
9447 | 275 1323 y Ft(This)33 b(section)j(describ)s(es)e(Readline)g(commands)i | |
9448 | (that)g(ma)m(y)g(b)s(e)f(b)s(ound)f(to)i(k)m(ey)h(sequences.)56 | |
9449 | b(Y)-8 b(ou)150 1433 y(can)29 b(list)e(y)m(our)i(k)m(ey)g(bindings)d(b) | |
9450 | m(y)j(executing)f Fs(bind)i(-P)e Ft(or,)h(for)g(a)g(more)f(terse)i | |
9451 | (format,)f(suitable)f(for)g(an)150 1543 y Fq(inputrc)33 | |
9452 | b Ft(\014le,)28 b Fs(bind)h(-p)p Ft(.)40 b(\(See)30 b(Section)e(4.2)i | |
9453 | ([Bash)g(Builtins],)d(page)j(39.\))41 b(Command)28 b(names)h(without) | |
9454 | 150 1652 y(an)h(accompan)m(ying)h(k)m(ey)g(sequence)g(are)g(un)m(b)s | |
9455 | (ound)d(b)m(y)i(default.)275 1780 y(In)25 b(the)h(follo)m(wing)f | |
9456 | (descriptions,)g Fq(p)s(oin)m(t)i Ft(refers)f(to)h(the)f(curren)m(t)g | |
9457 | (cursor)g(p)s(osition,)f(and)h Fq(mark)31 b Ft(refers)150 | |
9458 | 1890 y(to)40 b(a)f(cursor)f(p)s(osition)f(sa)m(v)m(ed)j(b)m(y)f(the)g | |
9459 | Fs(set-mark)d Ft(command.)66 b(The)38 b(text)i(b)s(et)m(w)m(een)g(the)f | |
9460 | (p)s(oin)m(t)f(and)150 2000 y(mark)30 b(is)g(referred)f(to)i(as)g(the)f | |
9461 | Fq(region)p Ft(.)150 2205 y Fk(8.4.1)63 b(Commands)40 | |
9462 | b(F)-10 b(or)41 b(Mo)m(ving)150 2443 y Fs(beginning-of-line)26 | |
9463 | b(\(C-a\))630 2553 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f | |
9464 | (curren)m(t)g(line.)150 2700 y Fs(end-of-line)d(\(C-e\))630 | |
9465 | 2809 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
9466 | 2956 y Fs(forward-char)c(\(C-f\))630 3066 y Ft(Mo)m(v)m(e)32 | |
9467 | b(forw)m(ard)e(a)h(c)m(haracter.)150 3213 y Fs(backward-char)c(\(C-b\)) | |
9468 | 630 3322 y Ft(Mo)m(v)m(e)32 b(bac)m(k)g(a)e(c)m(haracter.)150 | |
9469 | 3469 y Fs(forward-word)d(\(M-f\))630 3579 y Ft(Mo)m(v)m(e)32 | |
9470 | b(forw)m(ard)e(to)h(the)f(end)g(of)g(the)h(next)f(w)m(ord.)41 | |
9471 | b(W)-8 b(ords)30 b(are)h(comp)s(osed)f(of)g(letters)h(and)630 | |
9472 | 3689 y(digits.)150 3835 y Fs(backward-word)c(\(M-b\))630 | |
9473 | 3945 y Ft(Mo)m(v)m(e)36 b(bac)m(k)e(to)g(the)g(start)g(of)g(the)g | |
9474 | (curren)m(t)f(or)g(previous)f(w)m(ord.)50 b(W)-8 b(ords)34 | |
9475 | b(are)g(comp)s(osed)630 4055 y(of)d(letters)f(and)g(digits.)150 | |
9476 | 4202 y Fs(clear-screen)d(\(C-l\))630 4311 y Ft(Clear)f(the)h(screen)f | |
9477 | (and)h(redra)m(w)f(the)h(curren)m(t)f(line,)g(lea)m(ving)g(the)h | |
9478 | (curren)m(t)g(line)e(at)i(the)g(top)630 4421 y(of)k(the)f(screen.)150 | |
9479 | 4568 y Fs(redraw-current-line)25 b(\(\))630 4677 y Ft(Refresh)30 | |
9480 | b(the)g(curren)m(t)h(line.)39 b(By)30 b(default,)g(this)f(is)h(un)m(b)s | |
9481 | (ound.)150 4883 y Fk(8.4.2)63 b(Commands)40 b(F)-10 b(or)41 | |
9482 | b(Manipulating)h(The)f(History)150 5121 y Fs(accept-line)27 | |
9483 | b(\(Newline)h(or)i(Return\))630 5230 y Ft(Accept)25 b(the)e(line)f | |
9484 | (regardless)h(of)g(where)g(the)h(cursor)e(is.)38 b(If)23 | |
9485 | b(this)f(line)g(is)g(non-empt)m(y)-8 b(,)26 b(add)c(it)630 | |
9486 | 5340 y(to)27 b(the)f(history)f(list)g(according)h(to)h(the)f(setting)h | |
9487 | (of)f(the)g Fs(HISTCONTROL)d Ft(and)j Fs(HISTIGNORE)p | |
9488 | eop | |
9489 | %%Page: 96 102 | |
9490 | 96 101 bop 150 -116 a Ft(96)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
9491 | 299 y(v)-5 b(ariables.)40 b(If)30 b(this)g(line)f(is)h(a)h(mo)s | |
9492 | (di\014ed)d(history)i(line,)f(then)h(restore)i(the)f(history)e(line)g | |
9493 | (to)630 408 y(its)h(original)e(state.)150 562 y Fs(previous-history)e | |
9494 | (\(C-p\))630 672 y Ft(Mo)m(v)m(e)32 b(`bac)m(k')g(through)e(the)g | |
9495 | (history)g(list,)f(fetc)m(hing)h(the)h(previous)e(command.)150 | |
9496 | 826 y Fs(next-history)e(\(C-n\))630 935 y Ft(Mo)m(v)m(e)32 | |
9497 | b(`forw)m(ard')f(through)e(the)i(history)e(list,)h(fetc)m(hing)g(the)h | |
9498 | (next)f(command.)150 1089 y Fs(beginning-of-history)25 | |
9499 | b(\(M-<\))630 1199 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(\014rst)g(line)e(in) | |
9500 | i(the)g(history)-8 b(.)150 1352 y Fs(end-of-history)26 | |
9501 | b(\(M->\))630 1462 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h | |
9502 | (input)d(history)-8 b(,)30 b(i.e.,)h(the)g(line)d(curren)m(tly)i(b)s | |
9503 | (eing)f(en)m(tered.)150 1616 y Fs(reverse-search-history)24 | |
9504 | b(\(C-r\))630 1725 y Ft(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)f(at)h | |
9505 | (the)f(curren)m(t)g(line)e(and)i(mo)m(ving)g(`up')f(through)h(the)g | |
9506 | (his-)630 1835 y(tory)g(as)f(necessary)-8 b(.)42 b(This)28 | |
9507 | b(is)i(an)g(incremen)m(tal)g(searc)m(h.)150 1989 y Fs | |
9508 | (forward-search-history)24 b(\(C-s\))630 2098 y Ft(Searc)m(h)30 | |
9509 | b(forw)m(ard)f(starting)g(at)h(the)g(curren)m(t)f(line)f(and)h(mo)m | |
9510 | (ving)g(`do)m(wn')g(through)g(the)h(the)630 2208 y(history)f(as)i | |
9511 | (necessary)-8 b(.)41 b(This)29 b(is)g(an)i(incremen)m(tal)e(searc)m(h.) | |
9512 | 150 2362 y Fs(non-incremental-reverse-)o(sear)o(ch-h)o(ist)o(ory)24 | |
9513 | b(\(M-p\))630 2471 y Ft(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)f(at)h | |
9514 | (the)f(curren)m(t)g(line)e(and)i(mo)m(ving)g(`up')f(through)h(the)g | |
9515 | (his-)630 2581 y(tory)36 b(as)g(necessary)h(using)d(a)j(non-incremen)m | |
9516 | (tal)e(searc)m(h)h(for)g(a)g(string)f(supplied)e(b)m(y)j(the)630 | |
9517 | 2690 y(user.)150 2844 y Fs(non-incremental-forward-)o(sear)o(ch-h)o | |
9518 | (ist)o(ory)24 b(\(M-n\))630 2954 y Ft(Searc)m(h)30 b(forw)m(ard)f | |
9519 | (starting)g(at)h(the)g(curren)m(t)f(line)f(and)h(mo)m(ving)g(`do)m(wn') | |
9520 | g(through)g(the)h(the)630 3063 y(history)c(as)g(necessary)i(using)d(a)i | |
9521 | (non-incremen)m(tal)e(searc)m(h)j(for)e(a)h(string)f(supplied)d(b)m(y)k | |
9522 | (the)630 3173 y(user.)150 3327 y Fs(history-search-forward)d(\(\))630 | |
9523 | 3436 y Ft(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i(history)e(for)h | |
9524 | (the)h(string)e(of)i(c)m(haracters)h(b)s(et)m(w)m(een)f(the)630 | |
9525 | 3546 y(start)36 b(of)f(the)g(curren)m(t)g(line)e(and)i(the)g(p)s(oin)m | |
9526 | (t.)54 b(This)33 b(is)i(a)g(non-incremen)m(tal)f(searc)m(h.)56 | |
9527 | b(By)630 3655 y(default,)30 b(this)f(command)h(is)g(un)m(b)s(ound.)150 | |
9528 | 3809 y Fs(history-search-backward)24 b(\(\))630 3919 | |
9529 | y Ft(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f(the)h(history)f(for)h | |
9530 | (the)f(string)g(of)h(c)m(haracters)h(b)s(et)m(w)m(een)g(the)630 | |
9531 | 4028 y(start)g(of)f(the)g(curren)m(t)g(line)e(and)i(the)g(p)s(oin)m(t.) | |
9532 | 54 b(This)33 b(is)i(a)g(non-incremen)m(tal)f(searc)m(h.)56 | |
9533 | b(By)630 4138 y(default,)30 b(this)f(command)h(is)g(un)m(b)s(ound.)150 | |
9534 | 4292 y Fs(yank-nth-arg)d(\(M-C-y\))630 4401 y Ft(Insert)e(the)i | |
9535 | (\014rst)e(argumen)m(t)h(to)h(the)f(previous)f(command)g(\(usually)f | |
9536 | (the)i(second)g(w)m(ord)g(on)630 4511 y(the)k(previous)f(line\))f(at)j | |
9537 | (p)s(oin)m(t.)39 b(With)30 b(an)g(argumen)m(t)g Fq(n)p | |
9538 | Ft(,)g(insert)e(the)j Fq(n)p Ft(th)e(w)m(ord)g(from)h(the)630 | |
9539 | 4621 y(previous)25 b(command)i(\(the)h(w)m(ords)e(in)g(the)h(previous)e | |
9540 | (command)i(b)s(egin)e(with)h(w)m(ord)h(0\).)40 b(A)630 | |
9541 | 4730 y(negativ)m(e)27 b(argumen)m(t)f(inserts)e(the)i | |
9542 | Fq(n)p Ft(th)f(w)m(ord)g(from)g(the)h(end)f(of)h(the)g(previous)e | |
9543 | (command.)150 4884 y Fs(yank-last-arg)j(\(M-.)i(or)h(M-_\))630 | |
9544 | 4994 y Ft(Insert)k(last)h(argumen)m(t)h(to)g(the)f(previous)e(command)i | |
9545 | (\(the)h(last)e(w)m(ord)h(of)g(the)g(previous)630 5103 | |
9546 | y(history)30 b(en)m(try\).)41 b(With)30 b(an)h(argumen)m(t,)g(b)s(eha)m | |
9547 | (v)m(e)g(exactly)h(lik)m(e)e Fs(yank-nth-arg)p Ft(.)38 | |
9548 | b(Succes-)630 5213 y(siv)m(e)c(calls)g(to)h Fs(yank-last-arg)c | |
9549 | Ft(mo)m(v)m(e)36 b(bac)m(k)g(through)d(the)i(history)f(list,)g | |
9550 | (inserting)f(the)630 5322 y(last)d(argumen)m(t)h(of)g(eac)m(h)g(line)e | |
9551 | (in)g(turn.)p eop | |
9552 | %%Page: 97 103 | |
9553 | 97 102 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9554 | b(Line)h(Editing)2105 b(97)150 299 y Fk(8.4.3)63 b(Commands)40 | |
9555 | b(F)-10 b(or)41 b(Changing)g(T)-10 b(ext)150 549 y Fs(delete-char)27 | |
9556 | b(\(C-d\))630 659 y Ft(Delete)40 b(the)f(c)m(haracter)i(at)e(p)s(oin)m | |
9557 | (t.)65 b(If)39 b(p)s(oin)m(t)e(is)h(at)i(the)f(b)s(eginning)d(of)j(the) | |
9558 | g(line,)h(there)630 769 y(are)d(no)g(c)m(haracters)i(in)c(the)j(line,)f | |
9559 | (and)f(the)h(last)g(c)m(haracter)i(t)m(yp)s(ed)e(w)m(as)g(not)g(b)s | |
9560 | (ound)e(to)630 878 y Fs(delete-char)p Ft(,)28 b(then)i(return)f | |
9561 | Fl(eof)p Ft(.)150 1050 y Fs(backward-delete-char)c(\(Rubout\))630 | |
9562 | 1160 y Ft(Delete)31 b(the)g(c)m(haracter)g(b)s(ehind)d(the)i(cursor.)40 | |
9563 | b(A)30 b(n)m(umeric)f(argumen)m(t)i(means)f(to)h(kill)d(the)630 | |
9564 | 1270 y(c)m(haracters)k(instead)d(of)i(deleting)e(them.)150 | |
9565 | 1442 y Fs(forward-backward-delete-)o(char)24 b(\(\))630 | |
9566 | 1551 y Ft(Delete)39 b(the)g(c)m(haracter)h(under)c(the)j(cursor,)h | |
9567 | (unless)c(the)j(cursor)e(is)g(at)i(the)g(end)e(of)i(the)630 | |
9568 | 1661 y(line,)31 b(in)f(whic)m(h)g(case)j(the)f(c)m(haracter)h(b)s | |
9569 | (ehind)c(the)j(cursor)f(is)f(deleted.)45 b(By)32 b(default,)f(this)630 | |
9570 | 1771 y(is)e(not)i(b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 | |
9571 | 1943 y Fs(quoted-insert)27 b(\(C-q)i(or)h(C-v\))630 2052 | |
9572 | y Ft(Add)j(the)i(next)f(c)m(haracter)i(t)m(yp)s(ed)e(to)h(the)f(line)f | |
9573 | (v)m(erbatim.)52 b(This)32 b(is)i(ho)m(w)g(to)h(insert)e(k)m(ey)630 | |
9574 | 2162 y(sequences)e(lik)m(e)e Fj(C-q)p Ft(,)h(for)g(example.)150 | |
9575 | 2334 y Fs(self-insert)d(\(a,)j(b,)g(A,)f(1,)h(!,)g(...)o(\))630 | |
9576 | 2444 y Ft(Insert)g(y)m(ourself.)150 2616 y Fs(transpose-chars)c | |
9577 | (\(C-t\))630 2725 y Ft(Drag)33 b(the)f(c)m(haracter)h(b)s(efore)f(the)g | |
9578 | (cursor)f(forw)m(ard)h(o)m(v)m(er)h(the)f(c)m(haracter)i(at)e(the)g | |
9579 | (cursor,)630 2835 y(mo)m(ving)j(the)h(cursor)f(forw)m(ard)g(as)g(w)m | |
9580 | (ell.)55 b(If)35 b(the)h(insertion)e(p)s(oin)m(t)g(is)g(at)j(the)e(end) | |
9581 | g(of)h(the)630 2945 y(line,)22 b(then)g(this)f(transp)s(oses)g(the)h | |
9582 | (last)g(t)m(w)m(o)h(c)m(haracters)g(of)f(the)h(line.)36 | |
9583 | b(Negativ)m(e)24 b(argumen)m(ts)630 3054 y(ha)m(v)m(e)32 | |
9584 | b(no)e(e\013ect.)150 3226 y Fs(transpose-words)c(\(M-t\))630 | |
9585 | 3336 y Ft(Drag)33 b(the)g(w)m(ord)f(b)s(efore)g(p)s(oin)m(t)f(past)h | |
9586 | (the)h(w)m(ord)f(after)g(p)s(oin)m(t,)h(mo)m(ving)f(p)s(oin)m(t)f(past) | |
9587 | h(that)630 3446 y(w)m(ord)c(as)h(w)m(ell.)39 b(If)27 | |
9588 | b(the)i(insertion)d(p)s(oin)m(t)i(is)f(at)i(the)g(end)e(of)i(the)f | |
9589 | (line,)g(this)f(transp)s(oses)h(the)630 3555 y(last)i(t)m(w)m(o)i(w)m | |
9590 | (ords)e(on)g(the)h(line.)150 3727 y Fs(upcase-word)c(\(M-u\))630 | |
9591 | 3837 y Ft(Upp)s(ercase)32 b(the)g(curren)m(t)g(\(or)g(follo)m(wing\))f | |
9592 | (w)m(ord.)45 b(With)31 b(a)h(negativ)m(e)i(argumen)m(t,)f(upp)s(er-)630 | |
9593 | 3947 y(case)e(the)g(previous)e(w)m(ord,)h(but)g(do)g(not)h(mo)m(v)m(e)h | |
9594 | (the)e(cursor.)150 4119 y Fs(downcase-word)d(\(M-l\))630 | |
9595 | 4228 y Ft(Lo)m(w)m(ercase)c(the)f(curren)m(t)f(\(or)h(follo)m(wing\))f | |
9596 | (w)m(ord.)37 b(With)21 b(a)h(negativ)m(e)h(argumen)m(t,)h(lo)m(w)m | |
9597 | (ercase)630 4338 y(the)31 b(previous)d(w)m(ord,)j(but)e(do)i(not)f(mo)m | |
9598 | (v)m(e)i(the)f(cursor.)150 4510 y Fs(capitalize-word)26 | |
9599 | b(\(M-c\))630 4620 y Ft(Capitalize)20 b(the)i(curren)m(t)f(\(or)g | |
9600 | (follo)m(wing\))f(w)m(ord.)38 b(With)20 b(a)i(negativ)m(e)g(argumen)m | |
9601 | (t,)i(capitalize)630 4729 y(the)31 b(previous)d(w)m(ord,)j(but)e(do)i | |
9602 | (not)f(mo)m(v)m(e)i(the)f(cursor.)150 4902 y Fs(overwrite-mode)26 | |
9603 | b(\(\))630 5011 y Ft(T)-8 b(oggle)34 b(o)m(v)m(erwrite)g(mo)s(de.)48 | |
9604 | b(With)32 b(an)h(explicit)e(p)s(ositiv)m(e)h(n)m(umeric)g(argumen)m(t,) | |
9605 | i(switc)m(hes)630 5121 y(to)22 b(o)m(v)m(erwrite)h(mo)s(de.)37 | |
9606 | b(With)21 b(an)h(explicit)e(non-p)s(ositiv)m(e)g(n)m(umeric)h(argumen)m | |
9607 | (t,)j(switc)m(hes)d(to)630 5230 y(insert)29 b(mo)s(de.)41 | |
9608 | b(This)29 b(command)i(a\013ects)h(only)d Fs(emacs)g Ft(mo)s(de;)i | |
9609 | Fs(vi)f Ft(mo)s(de)g(do)s(es)g(o)m(v)m(erwrite)630 5340 | |
9610 | y(di\013eren)m(tly)-8 b(.)40 b(Eac)m(h)31 b(call)f(to)h | |
9611 | Fs(readline\(\))c Ft(starts)k(in)e(insert)g(mo)s(de.)p | |
9612 | eop | |
9613 | %%Page: 98 104 | |
9614 | 98 103 bop 150 -116 a Ft(98)2572 b(Bash)31 b(Reference)g(Man)m(ual)630 | |
9615 | 299 y(In)d(o)m(v)m(erwrite)i(mo)s(de,)f(c)m(haracters)i(b)s(ound)c(to)j | |
9616 | Fs(self-insert)c Ft(replace)j(the)h(text)g(at)g(p)s(oin)m(t)630 | |
9617 | 408 y(rather)41 b(than)h(pushing)d(the)j(text)g(to)g(the)g(righ)m(t.)74 | |
9618 | b(Characters)42 b(b)s(ound)d(to)j Fs(backward-)630 518 | |
9619 | y(delete-char)27 b Ft(replace)k(the)f(c)m(haracter)i(b)s(efore)e(p)s | |
9620 | (oin)m(t)g(with)f(a)h(space.)630 647 y(By)h(default,)e(this)h(command)g | |
9621 | (is)f(un)m(b)s(ound.)150 854 y Fk(8.4.4)63 b(Killing)42 | |
9622 | b(And)e(Y)-10 b(anking)150 1093 y Fs(kill-line)28 b(\(C-k\))630 | |
9623 | 1202 y Ft(Kill)g(the)i(text)i(from)e(p)s(oin)m(t)f(to)i(the)g(end)e(of) | |
9624 | i(the)f(line.)150 1350 y Fs(backward-kill-line)25 b(\(C-x)30 | |
9625 | b(Rubout\))630 1460 y Ft(Kill)e(bac)m(kw)m(ard)j(to)g(the)f(b)s | |
9626 | (eginning)e(of)i(the)h(line.)150 1608 y Fs(unix-line-discard)26 | |
9627 | b(\(C-u\))630 1718 y Ft(Kill)i(bac)m(kw)m(ard)j(from)e(the)i(cursor)f | |
9628 | (to)h(the)f(b)s(eginning)e(of)j(the)f(curren)m(t)g(line.)150 | |
9629 | 1866 y Fs(kill-whole-line)c(\(\))630 1975 y Ft(Kill)34 | |
9630 | b(all)h(c)m(haracters)j(on)f(the)f(curren)m(t)h(line,)f(no)h(matter)g | |
9631 | (where)f(p)s(oin)m(t)g(is.)58 b(By)36 b(default,)630 | |
9632 | 2085 y(this)29 b(is)h(un)m(b)s(ound.)150 2233 y Fs(kill-word)e(\(M-d\)) | |
9633 | 630 2343 y Ft(Kill)f(from)i(p)s(oin)m(t)f(to)i(the)g(end)e(of)i(the)f | |
9634 | (curren)m(t)h(w)m(ord,)f(or)g(if)g(b)s(et)m(w)m(een)h(w)m(ords,)f(to)h | |
9635 | (the)g(end)630 2452 y(of)h(the)f(next)h(w)m(ord.)40 b(W)-8 | |
9636 | b(ord)31 b(b)s(oundaries)d(are)i(the)h(same)g(as)f Fs(forward-word)p | |
9637 | Ft(.)150 2600 y Fs(backward-kill-word)25 b(\(M-)1183 | |
9638 | 2597 y Fg(h)p 1207 2544 146 4 v 1207 2600 a Ff(DEL)p | |
9639 | 1207 2616 V 1348 2597 a Fg(i)1378 2600 y Fs(\))630 2710 | |
9640 | y Ft(Kill)h(the)j(w)m(ord)g(b)s(ehind)d(p)s(oin)m(t.)39 | |
9641 | b(W)-8 b(ord)29 b(b)s(oundaries)e(are)i(the)g(same)g(as)g | |
9642 | Fs(backward-word)p Ft(.)150 2858 y Fs(unix-word-rubout)d(\(C-w\))630 | |
9643 | 2968 y Ft(Kill)j(the)j(w)m(ord)f(b)s(ehind)e(p)s(oin)m(t,)i(using)f | |
9644 | (white)h(space)h(as)g(a)g(w)m(ord)f(b)s(oundary)-8 b(.)43 | |
9645 | b(The)31 b(killed)630 3077 y(text)g(is)f(sa)m(v)m(ed)h(on)g(the)f | |
9646 | (kill-ring.)150 3225 y Fs(delete-horizontal-space)24 | |
9647 | b(\(\))630 3335 y Ft(Delete)32 b(all)d(spaces)i(and)e(tabs)i(around)e | |
9648 | (p)s(oin)m(t.)40 b(By)31 b(default,)e(this)h(is)f(un)m(b)s(ound.)150 | |
9649 | 3483 y Fs(kill-region)e(\(\))630 3593 y Ft(Kill)h(the)i(text)i(in)d | |
9650 | (the)h(curren)m(t)h(region.)40 b(By)31 b(default,)e(this)h(command)g | |
9651 | (is)f(un)m(b)s(ound.)150 3741 y Fs(copy-region-as-kill)c(\(\))630 | |
9652 | 3851 y Ft(Cop)m(y)34 b(the)g(text)h(in)e(the)h(region)f(to)i(the)f | |
9653 | (kill)e(bu\013er,)i(so)g(it)g(can)g(b)s(e)f(y)m(ank)m(ed)i(righ)m(t)e | |
9654 | (a)m(w)m(a)m(y)-8 b(.)630 3960 y(By)31 b(default,)e(this)h(command)g | |
9655 | (is)f(un)m(b)s(ound.)150 4108 y Fs(copy-backward-word)c(\(\))630 | |
9656 | 4218 y Ft(Cop)m(y)38 b(the)h(w)m(ord)f(b)s(efore)g(p)s(oin)m(t)f(to)j | |
9657 | (the)e(kill)e(bu\013er.)64 b(The)38 b(w)m(ord)g(b)s(oundaries)e(are)j | |
9658 | (the)630 4327 y(same)31 b(as)f Fs(backward-word)p Ft(.)38 | |
9659 | b(By)30 b(default,)g(this)f(command)h(is)g(un)m(b)s(ound.)150 | |
9660 | 4476 y Fs(copy-forward-word)c(\(\))630 4585 y Ft(Cop)m(y)31 | |
9661 | b(the)g(w)m(ord)g(follo)m(wing)e(p)s(oin)m(t)h(to)i(the)f(kill)e | |
9662 | (bu\013er.)42 b(The)30 b(w)m(ord)h(b)s(oundaries)d(are)k(the)630 | |
9663 | 4695 y(same)f(as)f Fs(forward-word)p Ft(.)38 b(By)30 | |
9664 | b(default,)g(this)g(command)g(is)f(un)m(b)s(ound.)150 | |
9665 | 4843 y Fs(yank)g(\(C-y\))630 4952 y Ft(Y)-8 b(ank)31 | |
9666 | b(the)f(top)h(of)g(the)f(kill)e(ring)h(in)m(to)i(the)f(bu\013er)g(at)h | |
9667 | (p)s(oin)m(t.)150 5101 y Fs(yank-pop)d(\(M-y\))630 5210 | |
9668 | y Ft(Rotate)36 b(the)f(kill-ring,)e(and)h(y)m(ank)h(the)f(new)g(top.)54 | |
9669 | b(Y)-8 b(ou)35 b(can)g(only)e(do)i(this)e(if)h(the)h(prior)630 | |
9670 | 5320 y(command)30 b(is)g Fs(yank)f Ft(or)h Fs(yank-pop)p | |
9671 | Ft(.)p eop | |
9672 | %%Page: 99 105 | |
9673 | 99 104 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9674 | b(Line)h(Editing)2105 b(99)150 299 y Fk(8.4.5)63 b(Sp)s(ecifying)41 | |
9675 | b(Numeric)f(Argumen)m(ts)150 548 y Fs(digit-argument)26 | |
9676 | b(\()p Fj(M-0)p Fs(,)j Fj(M-1)p Fs(,)h(...)f Fj(M--)p | |
9677 | Fs(\))630 658 y Ft(Add)d(this)g(digit)f(to)j(the)f(argumen)m(t)g | |
9678 | (already)g(accum)m(ulating,)g(or)g(start)h(a)f(new)f(argumen)m(t.)630 | |
9679 | 767 y Fj(M--)j Ft(starts)i(a)g(negativ)m(e)h(argumen)m(t.)150 | |
9680 | 937 y Fs(universal-argument)25 b(\(\))630 1047 y Ft(This)f(is)g | |
9681 | (another)i(w)m(a)m(y)g(to)h(sp)s(ecify)d(an)h(argumen)m(t.)40 | |
9682 | b(If)25 b(this)f(command)i(is)e(follo)m(w)m(ed)h(b)m(y)h(one)630 | |
9683 | 1156 y(or)k(more)f(digits,)g(optionally)f(with)g(a)i(leading)f(min)m | |
9684 | (us)f(sign,)h(those)h(digits)e(de\014ne)h(the)h(ar-)630 | |
9685 | 1266 y(gumen)m(t.)41 b(If)28 b(the)i(command)f(is)f(follo)m(w)m(ed)g(b) | |
9686 | m(y)h(digits,)g(executing)g Fs(universal-argument)630 | |
9687 | 1376 y Ft(again)j(ends)f(the)h(n)m(umeric)e(argumen)m(t,)j(but)e(is)g | |
9688 | (otherwise)g(ignored.)44 b(As)32 b(a)g(sp)s(ecial)f(case,)630 | |
9689 | 1485 y(if)h(this)g(command)g(is)g(immediately)f(follo)m(w)m(ed)i(b)m(y) | |
9690 | f(a)h(c)m(haracter)i(that)e(is)f(neither)g(a)h(digit)630 | |
9691 | 1595 y(or)28 b(min)m(us)e(sign,)i(the)g(argumen)m(t)g(coun)m(t)h(for)e | |
9692 | (the)i(next)f(command)f(is)g(m)m(ultiplied)e(b)m(y)i(four.)630 | |
9693 | 1704 y(The)37 b(argumen)m(t)h(coun)m(t)f(is)g(initially)d(one,)39 | |
9694 | b(so)f(executing)f(this)f(function)g(the)i(\014rst)e(time)630 | |
9695 | 1814 y(mak)m(es)d(the)e(argumen)m(t)i(coun)m(t)f(four,)f(a)i(second)e | |
9696 | (time)h(mak)m(es)g(the)g(argumen)m(t)g(coun)m(t)h(six-)630 | |
9697 | 1924 y(teen,)e(and)f(so)h(on.)40 b(By)31 b(default,)f(this)f(is)g(not)i | |
9698 | (b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 2169 y Fk(8.4.6)63 | |
9699 | b(Letting)40 b(Readline)h(T)m(yp)s(e)g(F)-10 b(or)42 | |
9700 | b(Y)-10 b(ou)150 2418 y Fs(complete)28 b(\()610 2415 | |
9701 | y Fg(h)p 634 2362 148 4 v 634 2418 a Ff(T)-6 b(AB)p 634 | |
9702 | 2434 V 778 2415 a Fg(i)808 2418 y Fs(\))630 2528 y Ft(A)m(ttempt)24 | |
9703 | b(to)f(p)s(erform)e(completion)h(on)h(the)g(text)g(b)s(efore)f(p)s(oin) | |
9704 | m(t.)38 b(The)22 b(actual)h(completion)630 2637 y(p)s(erformed)33 | |
9705 | b(is)g(application-sp)s(eci\014c.)49 b(Bash)35 b(attempts)g(completion) | |
9706 | e(treating)i(the)f(text)630 2747 y(as)39 b(a)h(v)-5 b(ariable)37 | |
9707 | b(\(if)i(the)g(text)h(b)s(egins)d(with)h(`)p Fs($)p Ft('\),)k(username) | |
9708 | c(\(if)h(the)g(text)h(b)s(egins)d(with)630 2857 y(`)p | |
9709 | Fs(~)p Ft('\),)31 b(hostname)f(\(if)f(the)h(text)h(b)s(egins)d(with)h | |
9710 | (`)p Fs(@)p Ft('\),)i(or)f(command)f(\(including)e(aliases)j(and)630 | |
9711 | 2966 y(functions\))k(in)f(turn.)53 b(If)34 b(none)g(of)h(these)h(pro)s | |
9712 | (duces)d(a)i(matc)m(h,)i(\014lename)d(completion)g(is)630 | |
9713 | 3076 y(attempted.)150 3246 y Fs(possible-completions)25 | |
9714 | b(\(M-?\))630 3355 y Ft(List)30 b(the)g(p)s(ossible)e(completions)i(of) | |
9715 | g(the)h(text)g(b)s(efore)f(p)s(oin)m(t.)150 3525 y Fs | |
9716 | (insert-completions)25 b(\(M-*\))630 3635 y Ft(Insert)30 | |
9717 | b(all)f(completions)h(of)h(the)g(text)g(b)s(efore)f(p)s(oin)m(t)g(that) | |
9718 | h(w)m(ould)e(ha)m(v)m(e)j(b)s(een)e(generated)630 3744 | |
9719 | y(b)m(y)g Fs(possible-completions)p Ft(.)150 3914 y Fs(menu-complete)d | |
9720 | (\(\))630 4024 y Ft(Similar)21 b(to)j Fs(complete)p Ft(,)f(but)h | |
9721 | (replaces)f(the)h(w)m(ord)g(to)g(b)s(e)f(completed)h(with)e(a)j(single) | |
9722 | d(matc)m(h)630 4133 y(from)37 b(the)h(list)f(of)h(p)s(ossible)d | |
9723 | (completions.)62 b(Rep)s(eated)39 b(execution)f(of)g | |
9724 | Fs(menu-complete)630 4243 y Ft(steps)i(through)g(the)g(list)f(of)h(p)s | |
9725 | (ossible)e(completions,)k(inserting)c(eac)m(h)k(matc)m(h)f(in)e(turn.) | |
9726 | 630 4353 y(A)m(t)f(the)f(end)f(of)h(the)g(list)e(of)i(completions,)g | |
9727 | (the)g(b)s(ell)e(is)h(rung)g(\(sub)5 b(ject)36 b(to)i(the)f(setting)630 | |
9728 | 4462 y(of)f Fs(bell-style)p Ft(\))e(and)h(the)h(original)f(text)i(is)e | |
9729 | (restored.)57 b(An)36 b(argumen)m(t)h(of)f Fq(n)f Ft(mo)m(v)m(es)i | |
9730 | Fq(n)630 4572 y Ft(p)s(ositions)c(forw)m(ard)h(in)f(the)i(list)f(of)g | |
9731 | (matc)m(hes;)39 b(a)c(negativ)m(e)h(argumen)m(t)f(ma)m(y)g(b)s(e)f | |
9732 | (used)g(to)630 4681 y(mo)m(v)m(e)40 b(bac)m(kw)m(ard)e(through)g(the)g | |
9733 | (list.)63 b(This)37 b(command)h(is)f(in)m(tended)g(to)i(b)s(e)f(b)s | |
9734 | (ound)e(to)630 4788 y Fg(h)p 654 4735 V 654 4791 a Ff(T)-6 | |
9735 | b(AB)p 654 4806 V 798 4788 a Fg(i)828 4791 y Ft(,)30 | |
9736 | b(but)g(is)f(un)m(b)s(ound)f(b)m(y)i(default.)150 4961 | |
9737 | y Fs(delete-char-or-list)25 b(\(\))630 5070 y Ft(Deletes)j(the)f(c)m | |
9738 | (haracter)h(under)e(the)h(cursor)f(if)g(not)h(at)g(the)g(b)s(eginning)e | |
9739 | (or)h(end)h(of)g(the)g(line)630 5180 y(\(lik)m(e)i Fs(delete-char)p | |
9740 | Ft(\).)37 b(If)29 b(at)h(the)f(end)f(of)i(the)f(line,)f(b)s(eha)m(v)m | |
9741 | (es)i(iden)m(tically)d(to)i Fs(possible-)630 5290 y(completions)p | |
9742 | Ft(.)38 b(This)28 b(command)i(is)g(un)m(b)s(ound)e(b)m(y)i(default.)p | |
9743 | eop | |
9744 | %%Page: 100 106 | |
9745 | 100 105 bop 150 -116 a Ft(100)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
9746 | 150 299 y Fs(complete-filename)26 b(\(M-/\))630 408 y | |
9747 | Ft(A)m(ttempt)32 b(\014lename)d(completion)h(on)g(the)h(text)g(b)s | |
9748 | (efore)f(p)s(oin)m(t.)150 577 y Fs(possible-filename-comple)o(tion)o(s) | |
9749 | 24 b(\(C-x)30 b(/\))630 687 y Ft(List)e(the)h(p)s(ossible)d | |
9750 | (completions)h(of)i(the)g(text)g(b)s(efore)g(p)s(oin)m(t,)f(treating)h | |
9751 | (it)f(as)h(a)f(\014lename.)150 856 y Fs(complete-username)e(\(M-~\))630 | |
9752 | 966 y Ft(A)m(ttempt)32 b(completion)d(on)i(the)f(text)i(b)s(efore)e(p)s | |
9753 | (oin)m(t,)f(treating)i(it)f(as)g(a)h(username.)150 1135 | |
9754 | y Fs(possible-username-comple)o(tion)o(s)24 b(\(C-x)30 | |
9755 | b(~\))630 1244 y Ft(List)24 b(the)h(p)s(ossible)e(completions)h(of)h | |
9756 | (the)g(text)h(b)s(efore)f(p)s(oin)m(t,)g(treating)g(it)g(as)g(a)g | |
9757 | (username.)150 1413 y Fs(complete-variable)h(\(M-$\))630 | |
9758 | 1523 y Ft(A)m(ttempt)32 b(completion)d(on)i(the)f(text)i(b)s(efore)e(p) | |
9759 | s(oin)m(t,)f(treating)i(it)f(as)g(a)h(shell)e(v)-5 b(ariable.)150 | |
9760 | 1692 y Fs(possible-variable-comple)o(tion)o(s)24 b(\(C-x)30 | |
9761 | b($\))630 1802 y Ft(List)41 b(the)h(p)s(ossible)e(completions)h(of)h | |
9762 | (the)g(text)h(b)s(efore)e(p)s(oin)m(t,)k(treating)d(it)f(as)h(a)h | |
9763 | (shell)630 1911 y(v)-5 b(ariable.)150 2080 y Fs(complete-hostname)26 | |
9764 | b(\(M-@\))630 2190 y Ft(A)m(ttempt)32 b(completion)d(on)i(the)f(text)i | |
9765 | (b)s(efore)e(p)s(oin)m(t,)f(treating)i(it)f(as)g(a)h(hostname.)150 | |
9766 | 2359 y Fs(possible-hostname-comple)o(tion)o(s)24 b(\(C-x)30 | |
9767 | b(@\))630 2468 y Ft(List)24 b(the)h(p)s(ossible)d(completions)h(of)i | |
9768 | (the)g(text)g(b)s(efore)g(p)s(oin)m(t,)g(treating)g(it)f(as)g(a)h | |
9769 | (hostname.)150 2637 y Fs(complete-command)h(\(M-!\))630 | |
9770 | 2747 y Ft(A)m(ttempt)32 b(completion)e(on)h(the)g(text)h(b)s(efore)e(p) | |
9771 | s(oin)m(t,)g(treating)h(it)g(as)g(a)g(command)g(name.)630 | |
9772 | 2857 y(Command)46 b(completion)g(attempts)i(to)f(matc)m(h)h(the)f(text) | |
9773 | h(against)f(aliases,)k(reserv)m(ed)630 2966 y(w)m(ords,)36 | |
9774 | b(shell)e(functions,)i(shell)d(builtins,)h(and)h(\014nally)e | |
9775 | (executable)j(\014lenames,)g(in)e(that)630 3076 y(order.)150 | |
9776 | 3245 y Fs(possible-command-complet)o(ions)24 b(\(C-x)29 | |
9777 | b(!\))630 3354 y Ft(List)c(the)i(p)s(ossible)d(completions)h(of)h(the)h | |
9778 | (text)g(b)s(efore)f(p)s(oin)m(t,)g(treating)g(it)g(as)h(a)f(command)630 | |
9779 | 3464 y(name.)150 3633 y Fs(dynamic-complete-history)e(\(M-)1470 | |
9780 | 3630 y Fg(h)p 1493 3577 148 4 v 1493 3633 a Ff(T)-6 b(AB)p | |
9781 | 1493 3648 V 1637 3630 a Fg(i)1667 3633 y Fs(\))630 3743 | |
9782 | y Ft(A)m(ttempt)31 b(completion)f(on)g(the)g(text)h(b)s(efore)f(p)s | |
9783 | (oin)m(t,)f(comparing)h(the)g(text)h(against)g(lines)630 | |
9784 | 3852 y(from)f(the)g(history)g(list)f(for)h(p)s(ossible)e(completion)i | |
9785 | (matc)m(hes.)150 4021 y Fs(complete-into-braces)25 b(\(M-{\))630 | |
9786 | 4131 y Ft(P)m(erform)f(\014lename)e(completion)h(and)h(insert)e(the)i | |
9787 | (list)e(of)i(p)s(ossible)d(completions)i(enclosed)630 | |
9788 | 4240 y(within)32 b(braces)j(so)f(the)h(list)e(is)h(a)m(v)-5 | |
9789 | b(ailable)34 b(to)h(the)g(shell)e(\(see)i(Section)g(3.5.1)h([Brace)g | |
9790 | (Ex-)630 4350 y(pansion],)29 b(page)i(17\).)150 4593 | |
9791 | y Fk(8.4.7)63 b(Keyb)s(oard)41 b(Macros)150 4842 y Fs(start-kbd-macro) | |
9792 | 26 b(\(C-x)j(\(\))630 4952 y Ft(Begin)h(sa)m(ving)h(the)f(c)m | |
9793 | (haracters)i(t)m(yp)s(ed)e(in)m(to)g(the)h(curren)m(t)f(k)m(eyb)s(oard) | |
9794 | g(macro.)150 5121 y Fs(end-kbd-macro)d(\(C-x)i(\)\))630 | |
9795 | 5230 y Ft(Stop)e(sa)m(ving)g(the)h(c)m(haracters)g(t)m(yp)s(ed)f(in)m | |
9796 | (to)h(the)f(curren)m(t)g(k)m(eyb)s(oard)g(macro)h(and)f(sa)m(v)m(e)i | |
9797 | (the)630 5340 y(de\014nition.)p eop | |
9798 | %%Page: 101 107 | |
9799 | 101 106 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9800 | b(Line)h(Editing)2060 b(101)150 299 y Fs(call-last-kbd-macro)25 | |
9801 | b(\(C-x)k(e\))630 408 y Ft(Re-execute)37 b(the)e(last)g(k)m(eyb)s(oard) | |
9802 | g(macro)h(de\014ned,)f(b)m(y)h(making)e(the)h(c)m(haracters)i(in)d(the) | |
9803 | 630 518 y(macro)d(app)s(ear)f(as)g(if)g(t)m(yp)s(ed)g(at)h(the)f(k)m | |
9804 | (eyb)s(oard.)150 739 y Fk(8.4.8)63 b(Some)40 b(Miscellaneous)j | |
9805 | (Commands)150 982 y Fs(re-read-init-file)26 b(\(C-x)j(C-r\))630 | |
9806 | 1091 y Ft(Read)22 b(in)f(the)h(con)m(ten)m(ts)h(of)f(the)g | |
9807 | Fq(inputrc)k Ft(\014le,)d(and)e(incorp)s(orate)g(an)m(y)i(bindings)18 | |
9808 | b(or)k(v)-5 b(ariable)630 1201 y(assignmen)m(ts)30 b(found)f(there.)150 | |
9809 | 1358 y Fs(abort)g(\(C-g\))630 1468 y Ft(Ab)s(ort)d(the)h(curren)m(t)f | |
9810 | (editing)f(command)h(and)g(ring)g(the)g(terminal's)f(b)s(ell)g(\(sub)5 | |
9811 | b(ject)26 b(to)i(the)630 1577 y(setting)i(of)h Fs(bell-style)p | |
9812 | Ft(\).)150 1734 y Fs(do-uppercase-version)25 b(\(M-a,)k(M-b,)g(M-)p | |
9813 | Fj(x)p Fs(,)g(...)o(\))630 1844 y Ft(If)e(the)h(meta\014ed)g(c)m | |
9814 | (haracter)h Fq(x)34 b Ft(is)27 b(lo)m(w)m(ercase,)i(run)e(the)g | |
9815 | (command)h(that)g(is)f(b)s(ound)e(to)k(the)630 1953 y(corresp)s(onding) | |
9816 | f(upp)s(ercase)i(c)m(haracter.)150 2111 y Fs(prefix-meta)d(\()753 | |
9817 | 2108 y Fg(h)p 777 2055 139 4 v 777 2111 a Ff(ESC)p 777 | |
9818 | 2126 V 911 2108 a Fg(i)941 2111 y Fs(\))630 2220 y Ft(Metafy)39 | |
9819 | b(the)e(next)h(c)m(haracter)h(t)m(yp)s(ed.)62 b(This)36 | |
9820 | b(is)g(for)i(k)m(eyb)s(oards)f(without)f(a)i(meta)g(k)m(ey)-8 | |
9821 | b(.)630 2330 y(T)m(yping)29 b(`)968 2327 y Fg(h)p 993 | |
9822 | 2274 V 993 2330 a Ff(ESC)p 993 2345 V 1127 2327 a Fg(i)1187 | |
9823 | 2330 y Fs(f)p Ft(')h(is)f(equiv)-5 b(alen)m(t)30 b(to)h(t)m(yping)f | |
9824 | Fj(M-f)p Ft(.)150 2487 y Fs(undo)f(\(C-_)g(or)h(C-x)g(C-u\))630 | |
9825 | 2596 y Ft(Incremen)m(tal)g(undo,)g(separately)g(remem)m(b)s(ered)g(for) | |
9826 | g(eac)m(h)i(line.)150 2754 y Fs(revert-line)27 b(\(M-r\))630 | |
9827 | 2863 y Ft(Undo)33 b(all)f(c)m(hanges)i(made)f(to)h(this)e(line.)47 | |
9828 | b(This)31 b(is)h(lik)m(e)h(executing)g(the)g Fs(undo)f | |
9829 | Ft(command)630 2973 y(enough)e(times)g(to)h(get)h(bac)m(k)f(to)g(the)f | |
9830 | (b)s(eginning.)150 3130 y Fs(tilde-expand)d(\(M-&\))630 | |
9831 | 3239 y Ft(P)m(erform)j(tilde)f(expansion)h(on)g(the)g(curren)m(t)h(w)m | |
9832 | (ord.)150 3396 y Fs(set-mark)d(\(C-@\))630 3506 y Ft(Set)33 | |
9833 | b(the)g(mark)f(to)i(the)f(p)s(oin)m(t.)47 b(If)32 b(a)h(n)m(umeric)f | |
9834 | (argumen)m(t)h(is)f(supplied,)e(the)j(mark)g(is)e(set)630 | |
9835 | 3616 y(to)g(that)g(p)s(osition.)150 3773 y Fs(exchange-point-and-mark) | |
9836 | 24 b(\(C-x)29 b(C-x\))630 3882 y Ft(Sw)m(ap)i(the)g(p)s(oin)m(t)f(with) | |
9837 | g(the)h(mark.)43 b(The)31 b(curren)m(t)g(cursor)f(p)s(osition)g(is)g | |
9838 | (set)i(to)f(the)h(sa)m(v)m(ed)630 3992 y(p)s(osition,)d(and)g(the)i | |
9839 | (old)f(cursor)f(p)s(osition)g(is)g(sa)m(v)m(ed)j(as)e(the)h(mark.)150 | |
9840 | 4149 y Fs(character-search)26 b(\(C-]\))630 4259 y Ft(A)f(c)m(haracter) | |
9841 | h(is)e(read)h(and)f(p)s(oin)m(t)g(is)g(mo)m(v)m(ed)i(to)g(the)f(next)g | |
9842 | (o)s(ccurrence)g(of)g(that)g(c)m(haracter.)630 4368 y(A)30 | |
9843 | b(negativ)m(e)i(coun)m(t)f(searc)m(hes)g(for)f(previous)f(o)s | |
9844 | (ccurrences.)150 4525 y Fs(character-search-backwar)o(d)24 | |
9845 | b(\(M-C-]\))630 4635 y Ft(A)45 b(c)m(haracter)h(is)e(read)h(and)f(p)s | |
9846 | (oin)m(t)g(is)g(mo)m(v)m(ed)i(to)f(the)g(previous)e(o)s(ccurrence)i(of) | |
9847 | g(that)630 4745 y(c)m(haracter.)d(A)31 b(negativ)m(e)g(coun)m(t)g | |
9848 | (searc)m(hes)h(for)e(subsequen)m(t)f(o)s(ccurrences.)150 | |
9849 | 4902 y Fs(insert-comment)d(\(M-#\))630 5011 y Ft(Without)35 | |
9850 | b(a)h(n)m(umeric)f(argumen)m(t,)i(the)f(v)-5 b(alue)35 | |
9851 | b(of)h(the)g Fs(comment-begin)c Ft(v)-5 b(ariable)34 | |
9852 | b(is)h(in-)630 5121 y(serted)d(at)g(the)g(b)s(eginning)d(of)j(the)f | |
9853 | (curren)m(t)h(line.)43 b(If)31 b(a)h(n)m(umeric)e(argumen)m(t)i(is)f | |
9854 | (supplied,)630 5230 y(this)k(command)i(acts)g(as)g(a)g(toggle:)54 | |
9855 | b(if)36 b(the)g(c)m(haracters)i(at)g(the)e(b)s(eginning)e(of)j(the)g | |
9856 | (line)630 5340 y(do)30 b(not)h(matc)m(h)h(the)f(v)-5 | |
9857 | b(alue)30 b(of)g Fs(comment-begin)p Ft(,)e(the)i(v)-5 | |
9858 | b(alue)30 b(is)g(inserted,)g(otherwise)g(the)p eop | |
9859 | %%Page: 102 108 | |
9860 | 102 107 bop 150 -116 a Ft(102)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
9861 | 630 299 y(c)m(haracters)42 b(in)c Fs(comment-begin)f | |
9862 | Ft(are)j(deleted)g(from)g(the)g(b)s(eginning)e(of)i(the)g(line.)69 | |
9863 | b(In)630 408 y(either)36 b(case,)k(the)e(line)d(is)h(accepted)j(as)e | |
9864 | (if)f(a)h(newline)e(had)i(b)s(een)f(t)m(yp)s(ed.)60 b(The)37 | |
9865 | b(default)630 518 y(v)-5 b(alue)31 b(of)h Fs(comment-begin)c | |
9866 | Ft(causes)k(this)e(command)i(to)g(mak)m(e)h(the)e(curren)m(t)h(line)e | |
9867 | (a)i(shell)630 628 y(commen)m(t.)40 b(If)26 b(a)h(n)m(umeric)e(argumen) | |
9868 | m(t)i(causes)g(the)f(commen)m(t)i(c)m(haracter)g(to)f(b)s(e)f(remo)m(v) | |
9869 | m(ed,)630 737 y(the)31 b(line)d(will)g(b)s(e)i(executed)h(b)m(y)f(the)h | |
9870 | (shell.)150 887 y Fs(dump-functions)26 b(\(\))630 996 | |
9871 | y Ft(Prin)m(t)f(all)h(of)g(the)h(functions)e(and)h(their)f(k)m(ey)i | |
9872 | (bindings)c(to)28 b(the)e(Readline)f(output)h(stream.)630 | |
9873 | 1106 y(If)31 b(a)h(n)m(umeric)f(argumen)m(t)h(is)f(supplied,)e(the)j | |
9874 | (output)f(is)g(formatted)h(in)e(suc)m(h)i(a)g(w)m(a)m(y)g(that)630 | |
9875 | 1215 y(it)e(can)h(b)s(e)e(made)i(part)f(of)g(an)h Fq(inputrc)j | |
9876 | Ft(\014le.)40 b(This)28 b(command)i(is)g(un)m(b)s(ound)d(b)m(y)k | |
9877 | (default.)150 1365 y Fs(dump-variables)26 b(\(\))630 | |
9878 | 1474 y Ft(Prin)m(t)20 b(all)g(of)i(the)f(settable)h(v)-5 | |
9879 | b(ariables)20 b(and)h(their)f(v)-5 b(alues)21 b(to)h(the)f(Readline)f | |
9880 | (output)h(stream.)630 1584 y(If)31 b(a)h(n)m(umeric)f(argumen)m(t)h(is) | |
9881 | f(supplied,)e(the)j(output)f(is)g(formatted)h(in)e(suc)m(h)i(a)g(w)m(a) | |
9882 | m(y)g(that)630 1694 y(it)e(can)h(b)s(e)e(made)i(part)f(of)g(an)h | |
9883 | Fq(inputrc)j Ft(\014le.)40 b(This)28 b(command)i(is)g(un)m(b)s(ound)d | |
9884 | (b)m(y)k(default.)150 1843 y Fs(dump-macros)c(\(\))630 | |
9885 | 1953 y Ft(Prin)m(t)33 b(all)f(of)i(the)g(Readline)e(k)m(ey)j(sequences) | |
9886 | f(b)s(ound)e(to)i(macros)g(and)f(the)h(strings)f(they)630 | |
9887 | 2062 y(output.)53 b(If)35 b(a)g(n)m(umeric)e(argumen)m(t)j(is)d | |
9888 | (supplied,)g(the)i(output)g(is)e(formatted)j(in)d(suc)m(h)i(a)630 | |
9889 | 2172 y(w)m(a)m(y)c(that)g(it)e(can)h(b)s(e)g(made)g(part)f(of)i(an)e | |
9890 | Fq(inputrc)34 b Ft(\014le.)40 b(This)28 b(command)i(is)f(un)m(b)s(ound) | |
9891 | e(b)m(y)630 2281 y(default.)150 2431 y Fs(glob-complete-word)e(\(M-g\)) | |
9892 | 630 2540 y Ft(The)i(w)m(ord)h(b)s(efore)f(p)s(oin)m(t)g(is)g(treated)i | |
9893 | (as)f(a)h(pattern)f(for)f(pathname)h(expansion,)f(with)g(an)630 | |
9894 | 2650 y(asterisk)d(implicitly)d(app)s(ended.)37 b(This)22 | |
9895 | b(pattern)j(is)e(used)h(to)h(generate)h(a)e(list)f(of)i(matc)m(hing)630 | |
9896 | 2760 y(\014le)k(names)i(for)f(p)s(ossible)e(completions.)150 | |
9897 | 2909 y Fs(glob-expand-word)e(\(C-x)j(*\))630 3019 y Ft(The)40 | |
9898 | b(w)m(ord)g(b)s(efore)g(p)s(oin)m(t)g(is)g(treated)h(as)g(a)g(pattern)g | |
9899 | (for)f(pathname)g(expansion,)j(and)630 3128 y(the)d(list)e(of)h(matc)m | |
9900 | (hing)h(\014le)e(names)h(is)g(inserted,)h(replacing)f(the)g(w)m(ord.)67 | |
9901 | b(If)39 b(a)h(n)m(umeric)630 3238 y(argumen)m(t)31 b(is)e(supplied,)f | |
9902 | (a)i(`)p Fs(*)p Ft(')h(is)e(app)s(ended)g(b)s(efore)h(pathname)g | |
9903 | (expansion.)150 3387 y Fs(glob-list-expansions)25 b(\(C-x)k(g\))630 | |
9904 | 3497 y Ft(The)k(list)f(of)h(expansions)f(that)i(w)m(ould)e(ha)m(v)m(e)i | |
9905 | (b)s(een)f(generated)h(b)m(y)f Fs(glob-expand-word)630 | |
9906 | 3606 y Ft(is)g(displa)m(y)m(ed,)g(and)g(the)h(line)e(is)g(redra)m(wn.) | |
9907 | 50 b(If)33 b(a)h(n)m(umeric)f(argumen)m(t)h(is)e(supplied,)g(a)i(`)p | |
9908 | Fs(*)p Ft(')630 3716 y(is)29 b(app)s(ended)g(b)s(efore)h(pathname)g | |
9909 | (expansion.)150 3866 y Fs(display-shell-version)25 b(\(C-x)k(C-v\))630 | |
9910 | 3975 y Ft(Displa)m(y)h(v)m(ersion)f(information)g(ab)s(out)h(the)h | |
9911 | (curren)m(t)f(instance)g(of)g(Bash.)150 4125 y Fs(shell-expand-line)c | |
9912 | (\(M-C-e\))630 4234 y Ft(Expand)34 b(the)h(line)f(as)i(the)f(shell)f | |
9913 | (do)s(es.)55 b(This)33 b(p)s(erforms)h(alias)g(and)h(history)f | |
9914 | (expansion)630 4344 y(as)g(w)m(ell)e(as)i(all)f(of)g(the)h(shell)e(w)m | |
9915 | (ord)h(expansions)f(\(see)j(Section)e(3.5)i([Shell)c(Expansions],)630 | |
9916 | 4453 y(page)g(16\).)150 4603 y Fs(history-expand-line)25 | |
9917 | b(\(M-^\))630 4712 y Ft(P)m(erform)30 b(history)g(expansion)f(on)h(the) | |
9918 | h(curren)m(t)f(line.)150 4862 y Fs(magic-space)d(\(\))630 | |
9919 | 4971 y Ft(P)m(erform)c(history)f(expansion)g(on)h(the)g(curren)m(t)g | |
9920 | (line)e(and)i(insert)f(a)h(space)h(\(see)g(Section)f(9.3)630 | |
9921 | 5081 y([History)30 b(In)m(teraction],)i(page)f(111\).)150 | |
9922 | 5230 y Fs(alias-expand-line)26 b(\(\))630 5340 y Ft(P)m(erform)i(alias) | |
9923 | g(expansion)f(on)h(the)h(curren)m(t)f(line)f(\(see)i(Section)f(6.6)i | |
9924 | ([Aliases],)e(page)h(71\).)p eop | |
9925 | %%Page: 103 109 | |
9926 | 103 108 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
9927 | b(Line)h(Editing)2060 b(103)150 299 y Fs(history-and-alias-expand)o | |
9928 | (-lin)o(e)24 b(\(\))630 408 y Ft(P)m(erform)30 b(history)g(and)f(alias) | |
9929 | h(expansion)f(on)h(the)h(curren)m(t)f(line.)150 570 y | |
9930 | Fs(insert-last-argument)25 b(\(M-.)k(or)h(M-_\))630 680 | |
9931 | y Ft(A)g(synon)m(ym)g(for)g Fs(yank-last-arg)p Ft(.)150 | |
9932 | 842 y Fs(operate-and-get-next)25 b(\(C-o\))630 952 y | |
9933 | Ft(Accept)42 b(the)e(curren)m(t)h(line)d(for)j(execution)f(and)g(fetc)m | |
9934 | (h)i(the)e(next)h(line)e(relativ)m(e)i(to)g(the)630 1061 | |
9935 | y(curren)m(t)30 b(line)f(from)h(the)g(history)g(for)g(editing.)39 | |
9936 | b(An)m(y)31 b(argumen)m(t)f(is)g(ignored.)150 1223 y | |
9937 | Fs(edit-and-execute-command)24 b(\(C-xC-e\))630 1333 | |
9938 | y Ft(In)m(v)m(ok)m(e)34 b(an)f(editor)f(on)h(the)g(curren)m(t)f | |
9939 | (command)h(line,)f(and)g(execute)i(the)f(result)f(as)h(shell)630 | |
9940 | 1442 y(commands.)81 b(Bash)44 b(attempts)h(to)g(in)m(v)m(ok)m(e)g | |
9941 | Fs($FCEDIT)p Ft(,)g Fs($EDITOR)p Ft(,)h(and)d Fs(emacs)g | |
9942 | Ft(as)h(the)630 1552 y(editor,)30 b(in)f(that)i(order.)150 | |
9943 | 1816 y Fr(8.5)68 b(Readline)47 b(vi)e(Mo)t(de)275 2062 | |
9944 | y Ft(While)22 b(the)i(Readline)e(library)f(do)s(es)j(not)g(ha)m(v)m(e)g | |
9945 | (a)h(full)c(set)j(of)g Fs(vi)f Ft(editing)f(functions,)i(it)f(do)s(es)h | |
9946 | (con)m(tain)150 2172 y(enough)34 b(to)h(allo)m(w)e(simple)f(editing)h | |
9947 | (of)h(the)g(line.)50 b(The)34 b(Readline)e Fs(vi)i Ft(mo)s(de)f(b)s | |
9948 | (eha)m(v)m(es)i(as)f(sp)s(eci\014ed)e(in)150 2281 y(the)f | |
9949 | Fl(posix)e Ft(1003.2)k(standard.)275 2418 y(In)i(order)g(to)i(switc)m | |
9950 | (h)e(in)m(teractiv)m(ely)h(b)s(et)m(w)m(een)g Fs(emacs)f | |
9951 | Ft(and)g Fs(vi)g Ft(editing)f(mo)s(des,)j(use)f(the)g(`)p | |
9952 | Fs(set)30 b(-o)150 2528 y(emacs)p Ft(')21 b(and)g(`)p | |
9953 | Fs(set)29 b(-o)h(vi)p Ft(')21 b(commands)h(\(see)g(Section)g(4.3)h | |
9954 | ([The)e(Set)h(Builtin],)g(page)g(50\).)39 b(The)21 b(Readline)150 | |
9955 | 2638 y(default)30 b(is)f Fs(emacs)g Ft(mo)s(de.)275 2775 | |
9956 | y(When)g(y)m(ou)i(en)m(ter)f(a)h(line)d(in)h Fs(vi)g | |
9957 | Ft(mo)s(de,)h(y)m(ou)h(are)f(already)g(placed)f(in)g(`insertion')f(mo)s | |
9958 | (de,)i(as)h(if)e(y)m(ou)150 2884 y(had)d(t)m(yp)s(ed)g(an)g(`)p | |
9959 | Fs(i)p Ft('.)39 b(Pressing)1215 2881 y Fg(h)p 1239 2828 | |
9960 | 139 4 v 1239 2884 a Ff(ESC)p 1239 2900 V 1373 2881 a | |
9961 | Fg(i)1429 2884 y Ft(switc)m(hes)26 b(y)m(ou)h(in)m(to)f(`command')g(mo) | |
9962 | s(de,)h(where)f(y)m(ou)h(can)f(edit)g(the)150 2994 y(text)35 | |
9963 | b(of)f(the)g(line)e(with)g(the)i(standard)f Fs(vi)g Ft(mo)m(v)m(emen)m | |
9964 | (t)j(k)m(eys,)g(mo)m(v)m(e)f(to)f(previous)f(history)f(lines)g(with)150 | |
9965 | 3103 y(`)p Fs(k)p Ft(')f(and)e(subsequen)m(t)h(lines)f(with)g(`)p | |
9966 | Fs(j)p Ft(',)h(and)g(so)h(forth.)150 3367 y Fr(8.6)68 | |
9967 | b(Programmable)47 b(Completion)275 3614 y Ft(When)25 | |
9968 | b(w)m(ord)g(completion)g(is)g(attempted)h(for)g(an)f(argumen)m(t)h(to)h | |
9969 | (a)f(command)f(for)h(whic)m(h)e(a)i(comple-)150 3723 | |
9970 | y(tion)e(sp)s(eci\014cation)f(\(a)j Fq(compsp)s(ec)6 | |
9971 | b Ft(\))24 b(has)g(b)s(een)g(de\014ned)g(using)f(the)h | |
9972 | Fs(complete)f Ft(builtin)e(\(see)k(Section)g(8.7)150 | |
9973 | 3833 y([Programmable)e(Completion)f(Builtins],)g(page)i(105\),)j(the)c | |
9974 | (programmable)g(completion)f(facilities)g(are)150 3943 | |
9975 | y(in)m(v)m(ok)m(ed.)275 4080 y(First,)g(the)f(command)g(name)g(is)g | |
9976 | (iden)m(ti\014ed.)35 b(If)21 b(a)g(compsp)s(ec)g(has)g(b)s(een)f | |
9977 | (de\014ned)g(for)h(that)h(command,)150 4189 y(the)44 | |
9978 | b(compsp)s(ec)g(is)f(used)g(to)h(generate)i(the)e(list)e(of)i(p)s | |
9979 | (ossible)e(completions)h(for)g(the)h(w)m(ord.)81 b(If)44 | |
9980 | b(the)150 4299 y(command)33 b(w)m(ord)f(is)g(a)h(full)e(pathname,)j(a)f | |
9981 | (compsp)s(ec)f(for)h(the)g(full)e(pathname)h(is)g(searc)m(hed)i(for)e | |
9982 | (\014rst.)150 4408 y(If)f(no)h(compsp)s(ec)f(is)g(found)f(for)h(the)h | |
9983 | (full)e(pathname,)i(an)f(attempt)i(is)e(made)g(to)i(\014nd)d(a)i | |
9984 | (compsp)s(ec)f(for)150 4518 y(the)g(p)s(ortion)e(follo)m(wing)f(the)j | |
9985 | (\014nal)e(slash.)275 4655 y(Once)34 b(a)g(compsp)s(ec)g(has)g(b)s(een) | |
9986 | f(found,)h(it)g(is)f(used)g(to)i(generate)h(the)e(list)f(of)h(matc)m | |
9987 | (hing)g(w)m(ords.)51 b(If)150 4765 y(a)37 b(compsp)s(ec)f(is)f(not)i | |
9988 | (found,)f(the)h(default)e(Bash)i(completion)e(describ)s(ed)f(ab)s(o)m | |
9989 | (v)m(e)k(\(see)f(Section)f(8.4.6)150 4874 y([Commands)30 | |
9990 | b(F)-8 b(or)31 b(Completion],)e(page)i(99\))h(is)d(p)s(erformed.)275 | |
9991 | 5011 y(First,)h(the)h(actions)f(sp)s(eci\014ed)f(b)m(y)i(the)f(compsp)s | |
9992 | (ec)h(are)g(used.)40 b(Only)29 b(matc)m(hes)j(whic)m(h)d(are)i | |
9993 | (pre\014xed)150 5121 y(b)m(y)25 b(the)h(w)m(ord)f(b)s(eing)e(completed) | |
9994 | j(are)f(returned.)38 b(When)25 b(the)h(`)p Fs(-f)p Ft(')f(or)g(`)p | |
9995 | Fs(-d)p Ft(')g(option)g(is)f(used)h(for)g(\014lename)150 | |
9996 | 5230 y(or)30 b(directory)g(name)g(completion,)g(the)g(shell)f(v)-5 | |
9997 | b(ariable)29 b Fs(FIGNORE)f Ft(is)h(used)g(to)i(\014lter)f(the)g(matc)m | |
9998 | (hes.)42 b(See)150 5340 y(Section)30 b(5.2)i([Bash)e(V)-8 | |
9999 | b(ariables],)31 b(page)g(55,)g(for)f(a)h(description)e(of)h | |
10000 | Fs(FIGNORE)p Ft(.)p eop | |
10001 | %%Page: 104 110 | |
10002 | 104 109 bop 150 -116 a Ft(104)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10003 | 275 299 y(An)m(y)e(completions)f(sp)s(eci\014ed)g(b)m(y)h(a)h | |
10004 | (\014lename)e(expansion)h(pattern)g(to)h(the)g(`)p Fs(-G)p | |
10005 | Ft(')f(option)g(are)g(gener-)150 408 y(ated)h(next.)40 | |
10006 | b(The)29 b(w)m(ords)g(generated)h(b)m(y)f(the)h(pattern)f(need)g(not)g | |
10007 | (matc)m(h)i(the)e(w)m(ord)g(b)s(eing)f(completed.)150 | |
10008 | 518 y(The)42 b Fs(GLOBIGNORE)d Ft(shell)i(v)-5 b(ariable)41 | |
10009 | b(is)g(not)i(used)e(to)i(\014lter)e(the)i(matc)m(hes,)j(but)c(the)g | |
10010 | Fs(FIGNORE)f Ft(shell)150 628 y(v)-5 b(ariable)29 b(is)h(used.)275 | |
10011 | 778 y(Next,)35 b(the)g(string)d(sp)s(eci\014ed)h(as)h(the)g(argumen)m | |
10012 | (t)g(to)h(the)f(`)p Fs(-W)p Ft(')g(option)f(is)g(considered.)51 | |
10013 | b(The)33 b(string)150 888 y(is)f(\014rst)f(split)g(using)g(the)i(c)m | |
10014 | (haracters)h(in)d(the)i Fs(IFS)e Ft(sp)s(ecial)h(v)-5 | |
10015 | b(ariable)31 b(as)i(delimiters.)45 b(Shell)30 b(quoting)i(is)150 | |
10016 | 998 y(honored.)37 b(Eac)m(h)21 b(w)m(ord)g(is)f(then)g(expanded)g | |
10017 | (using)g(brace)h(expansion,)h(tilde)d(expansion,)j(parameter)g(and)150 | |
10018 | 1107 y(v)-5 b(ariable)24 b(expansion,)h(command)g(substitution,)f | |
10019 | (arithmetic)g(expansion,)h(and)g(pathname)g(expansion,)150 | |
10020 | 1217 y(as)j(describ)s(ed)d(ab)s(o)m(v)m(e)k(\(see)f(Section)g(3.5)g | |
10021 | ([Shell)e(Expansions],)g(page)j(16\).)41 b(The)27 b(results)f(are)i | |
10022 | (split)d(using)150 1326 y(the)33 b(rules)f(describ)s(ed)e(ab)s(o)m(v)m | |
10023 | (e)k(\(see)g(Section)f(3.5.7)i([W)-8 b(ord)33 b(Splitting],)f(page)h | |
10024 | (22\).)50 b(The)32 b(results)g(of)h(the)150 1436 y(expansion)g(are)i | |
10025 | (pre\014x-matc)m(hed)f(against)h(the)f(w)m(ord)g(b)s(eing)f(completed,) | |
10026 | j(and)e(the)g(matc)m(hing)g(w)m(ords)150 1545 y(b)s(ecome)d(the)f(p)s | |
10027 | (ossible)e(completions.)275 1696 y(After)h(these)g(matc)m(hes)i(ha)m(v) | |
10028 | m(e)f(b)s(een)f(generated,)h(an)m(y)g(shell)d(function)h(or)h(command)g | |
10029 | (sp)s(eci\014ed)e(with)150 1806 y(the)j(`)p Fs(-F)p Ft(')g(and)f(`)p | |
10030 | Fs(-C)p Ft(')h(options)f(is)g(in)m(v)m(ok)m(ed.)40 b(When)30 | |
10031 | b(the)g(command)g(or)f(function)g(is)g(in)m(v)m(ok)m(ed,)h(the)g | |
10032 | Fs(COMP_)150 1915 y(LINE)21 b Ft(and)h Fs(COMP_POINT)d | |
10033 | Ft(v)-5 b(ariables)21 b(are)i(assigned)f(v)-5 b(alues)21 | |
10034 | b(as)i(describ)s(ed)d(ab)s(o)m(v)m(e)k(\(see)f(Section)f(5.2)i([Bash) | |
10035 | 150 2025 y(V)-8 b(ariables],)31 b(page)h(55\).)44 b(If)30 | |
10036 | b(a)i(shell)d(function)g(is)h(b)s(eing)g(in)m(v)m(ok)m(ed,)i(the)f | |
10037 | Fs(COMP_WORDS)d Ft(and)j Fs(COMP_CWORD)150 2134 y Ft(v)-5 | |
10038 | b(ariables)38 b(are)i(also)g(set.)68 b(When)40 b(the)f(function)g(or)g | |
10039 | (command)g(is)g(in)m(v)m(ok)m(ed,)j(the)e(\014rst)f(argumen)m(t)h(is) | |
10040 | 150 2244 y(the)34 b(name)f(of)h(the)g(command)f(whose)g(argumen)m(ts)h | |
10041 | (are)g(b)s(eing)e(completed,)j(the)e(second)h(argumen)m(t)g(is)150 | |
10042 | 2354 y(the)h(w)m(ord)g(b)s(eing)f(completed,)i(and)f(the)g(third)e | |
10043 | (argumen)m(t)j(is)e(the)h(w)m(ord)g(preceding)f(the)i(w)m(ord)e(b)s | |
10044 | (eing)150 2463 y(completed)d(on)f(the)h(curren)m(t)g(command)f(line.)40 | |
10045 | b(No)31 b(\014ltering)e(of)i(the)g(generated)h(completions)e(against) | |
10046 | 150 2573 y(the)f(w)m(ord)g(b)s(eing)e(completed)i(is)f(p)s(erformed;)g | |
10047 | (the)h(function)f(or)h(command)f(has)h(complete)g(freedom)g(in)150 | |
10048 | 2682 y(generating)i(the)f(matc)m(hes.)275 2833 y(An)m(y)h(function)g | |
10049 | (sp)s(eci\014ed)f(with)g(`)p Fs(-F)p Ft(')i(is)f(in)m(v)m(ok)m(ed)h | |
10050 | (\014rst.)44 b(The)31 b(function)g(ma)m(y)h(use)g(an)m(y)g(of)g(the)g | |
10051 | (shell)150 2943 y(facilities,)40 b(including)d(the)j | |
10052 | Fs(compgen)d Ft(builtin)g(describ)s(ed)g(b)s(elo)m(w)i(\(see)i(Section) | |
10053 | e(8.7)i([Programmable)150 3052 y(Completion)26 b(Builtins],)f(page)j | |
10054 | (105\),)i(to)e(generate)h(the)e(matc)m(hes.)41 b(It)27 | |
10055 | b(m)m(ust)g(put)g(the)g(p)s(ossible)e(comple-)150 3162 | |
10056 | y(tions)30 b(in)f(the)h Fs(COMPREPLY)e Ft(arra)m(y)j(v)-5 | |
10057 | b(ariable.)275 3313 y(Next,)23 b(an)m(y)e(command)f(sp)s(eci\014ed)f | |
10058 | (with)g(the)i(`)p Fs(-C)p Ft(')f(option)g(is)g(in)m(v)m(ok)m(ed)h(in)e | |
10059 | (an)h(en)m(vironmen)m(t)g(equiv)-5 b(alen)m(t)150 3422 | |
10060 | y(to)26 b(command)e(substitution.)37 b(It)25 b(should)e(prin)m(t)h(a)h | |
10061 | (list)f(of)h(completions,)g(one)g(p)s(er)f(line,)h(to)h(the)f(standard) | |
10062 | 150 3532 y(output.)40 b(Bac)m(kslash)31 b(ma)m(y)g(b)s(e)f(used)g(to)h | |
10063 | (escap)s(e)g(a)f(newline,)f(if)g(necessary)-8 b(.)275 | |
10064 | 3682 y(After)42 b(all)e(of)i(the)g(p)s(ossible)e(completions)h(are)h | |
10065 | (generated,)k(an)m(y)c(\014lter)f(sp)s(eci\014ed)f(with)h(the)h(`)p | |
10066 | Fs(-X)p Ft(')150 3792 y(option)33 b(is)f(applied)f(to)j(the)f(list.)47 | |
10067 | b(The)33 b(\014lter)f(is)g(a)i(pattern)f(as)g(used)g(for)g(pathname)g | |
10068 | (expansion;)g(a)h(`)p Fs(&)p Ft(')150 3902 y(in)k(the)h(pattern)g(is)f | |
10069 | (replaced)g(with)g(the)h(text)h(of)f(the)g(w)m(ord)g(b)s(eing)e | |
10070 | (completed.)67 b(A)39 b(literal)e(`)p Fs(&)p Ft(')i(ma)m(y)150 | |
10071 | 4011 y(b)s(e)e(escap)s(ed)h(with)f(a)i(bac)m(kslash;)j(the)c(bac)m | |
10072 | (kslash)g(is)f(remo)m(v)m(ed)i(b)s(efore)e(attempting)i(a)f(matc)m(h.) | |
10073 | 65 b(An)m(y)150 4121 y(completion)33 b(that)i(matc)m(hes)g(the)f | |
10074 | (pattern)g(will)d(b)s(e)j(remo)m(v)m(ed)h(from)e(the)h(list.)51 | |
10075 | b(A)34 b(leading)e(`)p Fs(!)p Ft(')j(negates)150 4230 | |
10076 | y(the)c(pattern;)f(in)f(this)h(case)h(an)m(y)g(completion)e(not)i(matc) | |
10077 | m(hing)g(the)f(pattern)h(will)c(b)s(e)j(remo)m(v)m(ed.)275 | |
10078 | 4381 y(Finally)-8 b(,)30 b(an)m(y)i(pre\014x)f(and)g(su\016x)g(sp)s | |
10079 | (eci\014ed)f(with)h(the)h(`)p Fs(-P)p Ft(')f(and)g(`)p | |
10080 | Fs(-S)p Ft(')h(options)f(are)h(added)f(to)i(eac)m(h)150 | |
10081 | 4491 y(mem)m(b)s(er)e(of)g(the)h(completion)f(list,)f(and)h(the)h | |
10082 | (result)e(is)h(returned)f(to)i(the)g(Readline)e(completion)h(co)s(de) | |
10083 | 150 4600 y(as)g(the)f(list)f(of)i(p)s(ossible)d(completions.)275 | |
10084 | 4751 y(If)22 b(the)i(previously-applied)19 b(actions)24 | |
10085 | b(do)f(not)h(generate)h(an)m(y)f(matc)m(hes,)i(and)d(the)g(`)p | |
10086 | Fs(-o)30 b(dirnames)p Ft(')22 b(op-)150 4861 y(tion)28 | |
10087 | b(w)m(as)g(supplied)d(to)k Fs(complete)d Ft(when)h(the)h(compsp)s(ec)g | |
10088 | (w)m(as)g(de\014ned,)g(directory)f(name)i(completion)150 | |
10089 | 4970 y(is)g(attempted.)275 5121 y(If)h(the)i(`)p Fs(-o)e(plusdirs)p | |
10090 | Ft(')f(option)i(w)m(as)g(supplied)d(to)k Fs(complete)e | |
10091 | Ft(when)g(the)h(compsp)s(ec)g(w)m(as)h(de\014ned,)150 | |
10092 | 5230 y(directory)j(name)g(completion)g(is)f(attempted)i(and)f(an)m(y)h | |
10093 | (matc)m(hes)g(are)g(added)f(to)h(the)f(results)f(of)i(the)150 | |
10094 | 5340 y(other)31 b(actions.)p eop | |
10095 | %%Page: 105 111 | |
10096 | 105 110 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
10097 | b(Line)h(Editing)2060 b(105)275 299 y(By)31 b(default,)h(if)e(a)i | |
10098 | (compsp)s(ec)f(is)g(found,)g(whatev)m(er)h(it)f(generates)i(is)d | |
10099 | (returned)h(to)h(the)g(completion)150 408 y(co)s(de)21 | |
10100 | b(as)g(the)g(full)e(set)i(of)g(p)s(ossible)d(completions.)37 | |
10101 | b(The)20 b(default)g(Bash)h(completions)f(are)i(not)f(attempted,)150 | |
10102 | 518 y(and)k(the)h(Readline)e(default)h(of)h(\014lename)f(completion)g | |
10103 | (is)g(disabled.)36 b(If)26 b(the)g(`)p Fs(-o)k(bashdefault)p | |
10104 | Ft(')22 b(option)150 628 y(w)m(as)i(supplied)c(to)25 | |
10105 | b Fs(complete)c Ft(when)i(the)g(compsp)s(ec)h(w)m(as)g(de\014ned,)g | |
10106 | (the)f(default)g(Bash)h(completions)f(are)150 737 y(attempted)h(if)e | |
10107 | (the)h(compsp)s(ec)g(generates)i(no)e(matc)m(hes.)39 | |
10108 | b(If)23 b(the)g(`)p Fs(-o)30 b(default)p Ft(')21 b(option)i(w)m(as)g | |
10109 | (supplied)d(to)150 847 y Fs(complete)25 b Ft(when)h(the)h(compsp)s(ec)f | |
10110 | (w)m(as)i(de\014ned,)e(Readline's)g(default)g(completion)g(will)e(b)s | |
10111 | (e)i(p)s(erformed)150 956 y(if)j(the)i(compsp)s(ec)f(\(and,)g(if)g | |
10112 | (attempted,)h(the)g(default)e(Bash)i(completions\))f(generate)i(no)e | |
10113 | (matc)m(hes.)275 1098 y(When)20 b(a)i(compsp)s(ec)e(indicates)g(that)i | |
10114 | (directory)f(name)g(completion)f(is)g(desired,)i(the)f(programmable)150 | |
10115 | 1208 y(completion)29 b(functions)f(force)j(Readline)d(to)j(app)s(end)d | |
10116 | (a)i(slash)f(to)h(completed)g(names)f(whic)m(h)g(are)h(sym-)150 | |
10117 | 1317 y(b)s(olic)38 b(links)g(to)j(directories,)h(sub)5 | |
10118 | b(ject)40 b(to)h(the)f(v)-5 b(alue)40 b(of)g(the)g Fq(mark-directories) | |
10119 | j Ft(Readline)c(v)-5 b(ariable,)150 1427 y(regardless)30 | |
10120 | b(of)g(the)h(setting)f(of)h(the)f Fq(mark-symlink)m(ed-directories)i | |
10121 | Ft(Readline)d(v)-5 b(ariable.)150 1703 y Fr(8.7)68 b(Programmable)47 | |
10122 | b(Completion)f(Builtins)275 1954 y Ft(Tw)m(o)30 b(builtin)d(commands)j | |
10123 | (are)h(a)m(v)-5 b(ailable)29 b(to)i(manipulate)e(the)i(programmable)e | |
10124 | (completion)h(facil-)150 2063 y(ities.)150 2234 y Fs(compgen)870 | |
10125 | 2372 y(compgen)46 b([)p Fj(option)11 b Fs(])45 b([)p | |
10126 | Fj(word)11 b Fs(])630 2510 y Ft(Generate)27 b(p)s(ossible)c(completion) | |
10127 | i(matc)m(hes)i(for)e Fq(w)m(ord)k Ft(according)d(to)g(the)g | |
10128 | Fq(option)p Ft(s,)g(whic)m(h)630 2620 y(ma)m(y)i(b)s(e)f(an)m(y)h | |
10129 | (option)f(accepted)i(b)m(y)e(the)h Fs(complete)d Ft(builtin)g(with)h | |
10130 | (the)i(exception)f(of)h(`)p Fs(-p)p Ft(')630 2729 y(and)k(`)p | |
10131 | Fs(-r)p Ft(',)i(and)e(write)g(the)h(matc)m(hes)h(to)g(the)f(standard)f | |
10132 | (output.)48 b(When)33 b(using)e(the)i(`)p Fs(-F)p Ft(')630 | |
10133 | 2839 y(or)28 b(`)p Fs(-C)p Ft(')g(options,)g(the)g(v)-5 | |
10134 | b(arious)28 b(shell)e(v)-5 b(ariables)27 b(set)h(b)m(y)g(the)g | |
10135 | (programmable)g(completion)630 2948 y(facilities,)h(while)f(a)m(v)-5 | |
10136 | b(ailable,)30 b(will)e(not)j(ha)m(v)m(e)g(useful)e(v)-5 | |
10137 | b(alues.)630 3087 y(The)34 b(matc)m(hes)h(will)d(b)s(e)i(generated)h | |
10138 | (in)e(the)i(same)g(w)m(a)m(y)g(as)g(if)e(the)i(programmable)e(com-)630 | |
10139 | 3196 y(pletion)c(co)s(de)i(had)f(generated)i(them)e(directly)g(from)g | |
10140 | (a)h(completion)f(sp)s(eci\014cation)f(with)630 3306 | |
10141 | y(the)g(same)h(\015ags.)40 b(If)29 b Fq(w)m(ord)j Ft(is)c(sp)s | |
10142 | (eci\014ed,)g(only)g(those)i(completions)e(matc)m(hing)h | |
10143 | Fq(w)m(ord)k Ft(will)630 3415 y(b)s(e)d(displa)m(y)m(ed.)630 | |
10144 | 3553 y(The)24 b(return)g(v)-5 b(alue)24 b(is)g(true)g(unless)f(an)i(in) | |
10145 | m(v)-5 b(alid)22 b(option)i(is)g(supplied,)e(or)j(no)g(matc)m(hes)g(w)m | |
10146 | (ere)630 3663 y(generated.)150 3830 y Fs(complete)870 | |
10147 | 3968 y(complete)46 b([-abcdefgjksuv])d([-o)k Fj(comp-option)11 | |
10148 | b Fs(])44 b([-A)j Fj(action)11 b Fs(])45 b([-G)i Fj(glob-)870 | |
10149 | 4077 y(pat)11 b Fs(])46 b([-W)h Fj(wordlist)11 b Fs(])870 | |
10150 | 4187 y([-P)47 b Fj(prefix)11 b Fs(])45 b([-S)i Fj(suffix)11 | |
10151 | b Fs(])45 b([-X)i Fj(filterpat)11 b Fs(])45 b([-F)i Fj(function)11 | |
10152 | b Fs(])870 4297 y([-C)47 b Fj(command)11 b Fs(])45 b | |
10153 | Fj(name)57 b Fs([)p Fj(name)g Fs(...)o(])870 4406 y(complete)46 | |
10154 | b(-pr)g([)p Fj(name)57 b Fs(...])630 4544 y Ft(Sp)s(ecify)32 | |
10155 | b(ho)m(w)i(argumen)m(ts)h(to)f(eac)m(h)i Fq(name)j Ft(should)32 | |
10156 | b(b)s(e)h(completed.)52 b(If)33 b(the)i(`)p Fs(-p)p Ft(')e(option)630 | |
10157 | 4654 y(is)c(supplied,)d(or)k(if)f(no)g(options)g(are)h(supplied,)d | |
10158 | (existing)h(completion)h(sp)s(eci\014cations)g(are)630 | |
10159 | 4763 y(prin)m(ted)42 b(in)h(a)h(w)m(a)m(y)h(that)f(allo)m(ws)f(them)h | |
10160 | (to)g(b)s(e)g(reused)f(as)h(input.)79 b(The)43 b(`)p | |
10161 | Fs(-r)p Ft(')g(option)630 4873 y(remo)m(v)m(es)29 b(a)f(completion)f | |
10162 | (sp)s(eci\014cation)f(for)i(eac)m(h)g Fq(name)p Ft(,)h(or,)f(if)f(no)g | |
10163 | Fq(name)5 b Ft(s)28 b(are)g(supplied,)630 4983 y(all)h(completion)h(sp) | |
10164 | s(eci\014cations.)630 5121 y(The)f(pro)s(cess)g(of)h(applying)e(these)i | |
10165 | (completion)e(sp)s(eci\014cations)h(when)f(w)m(ord)i(completion)630 | |
10166 | 5230 y(is)k(attempted)i(is)e(describ)s(ed)f(ab)s(o)m(v)m(e)k(\(see)f | |
10167 | (Section)f(8.6)h([Programmable)f(Completion],)630 5340 | |
10168 | y(page)c(103\).)p eop | |
10169 | %%Page: 106 112 | |
10170 | 106 111 bop 150 -116 a Ft(106)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10171 | 630 299 y(Other)41 b(options,)k(if)40 b(sp)s(eci\014ed,)j(ha)m(v)m(e)g | |
10172 | (the)f(follo)m(wing)f(meanings.)74 b(The)41 b(argumen)m(ts)h(to)630 | |
10173 | 408 y(the)e(`)p Fs(-G)p Ft(',)j(`)p Fs(-W)p Ft(',)g(and)d(`)p | |
10174 | Fs(-X)p Ft(')g(options)f(\(and,)k(if)c(necessary)-8 b(,)44 | |
10175 | b(the)c(`)p Fs(-P)p Ft(')h(and)e(`)p Fs(-S)p Ft(')h(options\))630 | |
10176 | 518 y(should)29 b(b)s(e)i(quoted)g(to)h(protect)g(them)f(from)g | |
10177 | (expansion)f(b)s(efore)h(the)g Fs(complete)e Ft(builtin)630 | |
10178 | 628 y(is)g(in)m(v)m(ok)m(ed.)630 782 y Fs(-o)h Fj(comp-option)1110 | |
10179 | 892 y Ft(The)c Fq(comp-option)h Ft(con)m(trols)g(sev)m(eral)h(asp)s | |
10180 | (ects)f(of)g(the)g(compsp)s(ec's)g(b)s(eha)m(v-)1110 | |
10181 | 1002 y(ior)f(b)s(ey)m(ond)g(the)g(simple)f(generation)i(of)f | |
10182 | (completions.)39 b Fq(comp-option)26 b Ft(ma)m(y)1110 | |
10183 | 1111 y(b)s(e)k(one)g(of:)1110 1266 y Fs(bashdefault)1590 | |
10184 | 1375 y Ft(P)m(erform)d(the)h(rest)f(of)h(the)g(default)e(Bash)i | |
10185 | (completions)e(if)h(the)1590 1485 y(compsp)s(ec)j(generates)i(no)e | |
10186 | (matc)m(hes.)1110 1640 y Fs(default)144 b Ft(Use)22 b(Readline's)e | |
10187 | (default)h(\014lename)g(completion)f(if)h(the)h(comp-)1590 | |
10188 | 1749 y(sp)s(ec)30 b(generates)i(no)e(matc)m(hes.)1110 | |
10189 | 1904 y Fs(dirnames)96 b Ft(P)m(erform)46 b(directory)f(name)i | |
10190 | (completion)e(if)g(the)h(compsp)s(ec)1590 2014 y(generates)32 | |
10191 | b(no)e(matc)m(hes.)1110 2168 y Fs(filenames)1590 2278 | |
10192 | y Ft(T)-8 b(ell)38 b(Readline)f(that)j(the)f(compsp)s(ec)f(generates)j | |
10193 | (\014lenames,)1590 2388 y(so)29 b(it)g(can)g(p)s(erform)f(an)m(y)h | |
10194 | (\014lename-sp)s(eci\014c)f(pro)s(cessing)f(\(lik)m(e)1590 | |
10195 | 2497 y(adding)h(a)i(slash)e(to)i(directory)f(names)g(or)g(suppressing)e | |
10196 | (trail-)1590 2607 y(ing)37 b(spaces\).)66 b(This)36 b(option)i(is)f(in) | |
10197 | m(tended)g(to)i(b)s(e)f(used)f(with)1590 2716 y(shell)29 | |
10198 | b(functions)g(sp)s(eci\014ed)f(with)h(`)p Fs(-F)p Ft('.)1110 | |
10199 | 2871 y Fs(nospace)144 b Ft(T)-8 b(ell)38 b(Readline)g(not)i(to)g(app)s | |
10200 | (end)d(a)j(space)g(\(the)f(default\))g(to)1590 2981 y(w)m(ords)30 | |
10201 | b(completed)g(at)h(the)g(end)f(of)g(the)h(line.)630 3135 | |
10202 | y Fs(-A)f Fj(action)1110 3245 y Ft(The)25 b Fq(action)g | |
10203 | Ft(ma)m(y)h(b)s(e)e(one)h(of)h(the)f(follo)m(wing)f(to)h(generate)i(a)e | |
10204 | (list)f(of)h(p)s(ossible)1110 3354 y(completions:)1110 | |
10205 | 3509 y Fs(alias)240 b Ft(Alias)29 b(names.)41 b(Ma)m(y)31 | |
10206 | b(also)g(b)s(e)f(sp)s(eci\014ed)e(as)j(`)p Fs(-a)p Ft('.)1110 | |
10207 | 3664 y Fs(arrayvar)96 b Ft(Arra)m(y)31 b(v)-5 b(ariable)29 | |
10208 | b(names.)1110 3819 y Fs(binding)144 b Ft(Readline)28 | |
10209 | b(k)m(ey)h(binding)d(names)j(\(see)h(Section)e(8.4)i([Bindable)1590 | |
10210 | 3928 y(Readline)f(Commands],)h(page)h(95\).)1110 4083 | |
10211 | y Fs(builtin)144 b Ft(Names)21 b(of)g(shell)d(builtin)g(commands.)37 | |
10212 | b(Ma)m(y)21 b(also)g(b)s(e)f(sp)s(eci\014ed)1590 4193 | |
10213 | y(as)31 b(`)p Fs(-b)p Ft('.)1110 4347 y Fs(command)144 | |
10214 | b Ft(Command)29 b(names.)41 b(Ma)m(y)32 b(also)e(b)s(e)g(sp)s | |
10215 | (eci\014ed)e(as)j(`)p Fs(-c)p Ft('.)1110 4502 y Fs(directory)1590 | |
10216 | 4612 y Ft(Directory)g(names.)40 b(Ma)m(y)32 b(also)e(b)s(e)g(sp)s | |
10217 | (eci\014ed)f(as)h(`)p Fs(-d)p Ft('.)1110 4766 y Fs(disabled)96 | |
10218 | b Ft(Names)31 b(of)g(disabled)d(shell)g(builtins.)1110 | |
10219 | 4921 y Fs(enabled)144 b Ft(Names)31 b(of)g(enabled)e(shell)f(builtins.) | |
10220 | 1110 5076 y Fs(export)192 b Ft(Names)34 b(of)f(exp)s(orted)f(shell)f(v) | |
10221 | -5 b(ariables.)47 b(Ma)m(y)35 b(also)d(b)s(e)h(sp)s(eci-)1590 | |
10222 | 5185 y(\014ed)d(as)g(`)p Fs(-e)p Ft('.)1110 5340 y Fs(file)288 | |
10223 | b Ft(File)30 b(names.)40 b(Ma)m(y)32 b(also)e(b)s(e)g(sp)s(eci\014ed)e | |
10224 | (as)j(`)p Fs(-f)p Ft('.)p eop | |
10225 | %%Page: 107 113 | |
10226 | 107 112 bop 150 -116 a Ft(Chapter)30 b(8:)41 b(Command)29 | |
10227 | b(Line)h(Editing)2060 b(107)1110 299 y Fs(function)96 | |
10228 | b Ft(Names)31 b(of)g(shell)d(functions.)1110 451 y Fs(group)240 | |
10229 | b Ft(Group)30 b(names.)40 b(Ma)m(y)32 b(also)e(b)s(e)g(sp)s(eci\014ed)f | |
10230 | (as)h(`)p Fs(-g)p Ft('.)1110 603 y Fs(helptopic)1590 | |
10231 | 713 y Ft(Help)36 b(topics)g(as)h(accepted)h(b)m(y)e(the)h | |
10232 | Fs(help)f Ft(builtin)d(\(see)k(Sec-)1590 822 y(tion)30 | |
10233 | b(4.2)h([Bash)g(Builtins],)d(page)j(39\).)1110 975 y | |
10234 | Fs(hostname)96 b Ft(Hostnames,)89 b(as)76 b(tak)m(en)h(from)f(the)g | |
10235 | (\014le)g(sp)s(eci\014ed)e(b)m(y)1590 1084 y(the)55 b | |
10236 | Fs(HOSTFILE)e Ft(shell)h(v)-5 b(ariable)54 b(\(see)i(Section)f(5.2)i | |
10237 | ([Bash)1590 1194 y(V)-8 b(ariables],)30 b(page)h(55\).)1110 | |
10238 | 1346 y Fs(job)336 b Ft(Job)31 b(names,)h(if)f(job)g(con)m(trol)h(is)f | |
10239 | (activ)m(e.)45 b(Ma)m(y)33 b(also)f(b)s(e)f(sp)s(eci-)1590 | |
10240 | 1456 y(\014ed)f(as)g(`)p Fs(-j)p Ft('.)1110 1608 y Fs(keyword)144 | |
10241 | b Ft(Shell)28 b(reserv)m(ed)j(w)m(ords.)40 b(Ma)m(y)32 | |
10242 | b(also)e(b)s(e)g(sp)s(eci\014ed)e(as)j(`)p Fs(-k)p Ft('.)1110 | |
10243 | 1760 y Fs(running)144 b Ft(Names)31 b(of)g(running)c(jobs,)j(if)g(job)g | |
10244 | (con)m(trol)g(is)g(activ)m(e.)1110 1912 y Fs(service)144 | |
10245 | b Ft(Service)30 b(names.)41 b(Ma)m(y)31 b(also)f(b)s(e)g(sp)s | |
10246 | (eci\014ed)f(as)h(`)p Fs(-s)p Ft('.)1110 2064 y Fs(setopt)192 | |
10247 | b Ft(V)-8 b(alid)32 b(argumen)m(ts)h(for)f(the)h(`)p | |
10248 | Fs(-o)p Ft(')g(option)f(to)i(the)f Fs(set)e Ft(builtin)1590 | |
10249 | 2174 y(\(see)g(Section)g(4.3)g([The)f(Set)h(Builtin],)d(page)j(50\).) | |
10250 | 1110 2326 y Fs(shopt)240 b Ft(Shell)38 b(option)h(names)h(as)g | |
10251 | (accepted)i(b)m(y)e(the)g Fs(shopt)e Ft(builtin)1590 | |
10252 | 2436 y(\(see)31 b(Section)g(4.2)g([Bash)g(Builtins],)d(page)j(39\).) | |
10253 | 1110 2588 y Fs(signal)192 b Ft(Signal)29 b(names.)1110 | |
10254 | 2740 y Fs(stopped)144 b Ft(Names)31 b(of)g(stopp)s(ed)e(jobs,)h(if)f | |
10255 | (job)h(con)m(trol)h(is)f(activ)m(e.)1110 2892 y Fs(user)288 | |
10256 | b Ft(User)30 b(names.)41 b(Ma)m(y)32 b(also)e(b)s(e)g(sp)s(eci\014ed)e | |
10257 | (as)j(`)p Fs(-u)p Ft('.)1110 3045 y Fs(variable)96 b | |
10258 | Ft(Names)36 b(of)g(all)e(shell)g(v)-5 b(ariables.)54 | |
10259 | b(Ma)m(y)37 b(also)e(b)s(e)g(sp)s(eci\014ed)f(as)1590 | |
10260 | 3154 y(`)p Fs(-v)p Ft('.)630 3306 y Fs(-G)c Fj(globpat)1110 | |
10261 | 3416 y Ft(The)39 b(\014lename)g(expansion)g(pattern)h | |
10262 | Fq(globpat)i Ft(is)d(expanded)g(to)h(generate)1110 3526 | |
10263 | y(the)31 b(p)s(ossible)c(completions.)630 3678 y Fs(-W)j | |
10264 | Fj(wordlist)1110 3787 y Ft(The)24 b Fq(w)m(ordlist)i | |
10265 | Ft(is)e(split)f(using)g(the)i(c)m(haracters)i(in)c(the)j | |
10266 | Fs(IFS)e Ft(sp)s(ecial)f(v)-5 b(ariable)1110 3897 y(as)36 | |
10267 | b(delimiters,)f(and)h(eac)m(h)h(resultan)m(t)f(w)m(ord)f(is)g | |
10268 | (expanded.)57 b(The)35 b(p)s(ossible)1110 4007 y(completions)29 | |
10269 | b(are)g(the)h(mem)m(b)s(ers)f(of)g(the)h(resultan)m(t)f(list)f(whic)m | |
10270 | (h)g(matc)m(h)j(the)1110 4116 y(w)m(ord)f(b)s(eing)f(completed.)630 | |
10271 | 4268 y Fs(-C)h Fj(command)1110 4378 y Fq(command)35 b | |
10272 | Ft(is)d(executed)h(in)d(a)j(subshell)c(en)m(vironmen)m(t,)j(and)g(its)f | |
10273 | (output)h(is)1110 4488 y(used)e(as)g(the)h(p)s(ossible)d(completions.) | |
10274 | 630 4640 y Fs(-F)i Fj(function)1110 4749 y Ft(The)25 | |
10275 | b(shell)g(function)f Fq(function)h Ft(is)g(executed)i(in)d(the)j | |
10276 | (curren)m(t)e(shell)g(en)m(viron-)1110 4859 y(men)m(t.)40 | |
10277 | b(When)25 b(it)g(\014nishes,)f(the)i(p)s(ossible)d(completions)h(are)i | |
10278 | (retriev)m(ed)f(from)1110 4969 y(the)31 b(v)-5 b(alue)29 | |
10279 | b(of)i(the)g Fs(COMPREPLY)c Ft(arra)m(y)k(v)-5 b(ariable.)630 | |
10280 | 5121 y Fs(-X)30 b Fj(filterpat)1110 5230 y Fq(\014lterpat)c | |
10281 | Ft(is)e(a)h(pattern)g(as)f(used)g(for)h(\014lename)f(expansion.)37 | |
10282 | b(It)25 b(is)f(applied)e(to)1110 5340 y(the)30 b(list)d(of)j(p)s | |
10283 | (ossible)d(completions)h(generated)j(b)m(y)e(the)g(preceding)g(options) | |
10284 | p eop | |
10285 | %%Page: 108 114 | |
10286 | 108 113 bop 150 -116 a Ft(108)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10287 | 1110 299 y(and)c(argumen)m(ts,)i(and)e(eac)m(h)i(completion)e(matc)m | |
10288 | (hing)h Fq(\014lterpat)h Ft(is)e(remo)m(v)m(ed)1110 408 | |
10289 | y(from)j(the)h(list.)40 b(A)30 b(leading)g(`)p Fs(!)p | |
10290 | Ft(')g(in)f Fq(\014lterpat)j Ft(negates)g(the)f(pattern;)g(in)e(this) | |
10291 | 1110 518 y(case,)j(an)m(y)e(completion)g(not)h(matc)m(hing)f | |
10292 | Fq(\014lterpat)i Ft(is)d(remo)m(v)m(ed.)630 677 y Fs(-P)h | |
10293 | Fj(prefix)1110 787 y Fq(pre\014x)39 b Ft(is)33 b(added)g(at)i(the)f(b)s | |
10294 | (eginning)d(of)k(eac)m(h)g(p)s(ossible)c(completion)i(after)1110 | |
10295 | 897 y(all)c(other)i(options)f(ha)m(v)m(e)h(b)s(een)f(applied.)630 | |
10296 | 1056 y Fs(-S)g Fj(suffix)1110 1166 y Fq(su\016x)c Ft(is)19 | |
10297 | b(app)s(ended)g(to)i(eac)m(h)h(p)s(ossible)c(completion)i(after)h(all)e | |
10298 | (other)i(options)1110 1275 y(ha)m(v)m(e)32 b(b)s(een)d(applied.)630 | |
10299 | 1435 y(The)35 b(return)g(v)-5 b(alue)36 b(is)f(true)g(unless)g(an)g(in) | |
10300 | m(v)-5 b(alid)34 b(option)h(is)g(supplied,)f(an)i(option)g(other)630 | |
10301 | 1544 y(than)31 b(`)p Fs(-p)p Ft(')g(or)g(`)p Fs(-r)p | |
10302 | Ft(')g(is)f(supplied)e(without)i(a)h Fq(name)37 b Ft(argumen)m(t,)32 | |
10303 | b(an)f(attempt)h(is)e(made)h(to)630 1654 y(remo)m(v)m(e)h(a)e | |
10304 | (completion)g(sp)s(eci\014cation)f(for)h(a)h Fq(name)k | |
10305 | Ft(for)30 b(whic)m(h)f(no)h(sp)s(eci\014cation)f(exists,)630 | |
10306 | 1763 y(or)h(an)h(error)f(o)s(ccurs)g(adding)f(a)h(completion)g(sp)s | |
10307 | (eci\014cation.)p eop | |
10308 | %%Page: 109 115 | |
10309 | 109 114 bop 150 -116 a Ft(Chapter)30 b(9:)41 b(Using)29 | |
10310 | b(History)h(In)m(teractiv)m(ely)1923 b(109)150 299 y | |
10311 | Fo(9)80 b(Using)54 b(History)g(In)l(teractiv)l(ely)275 | |
10312 | 562 y Ft(This)31 b(c)m(hapter)j(describ)s(es)d(ho)m(w)i(to)h(use)f(the) | |
10313 | g Fl(gnu)g Ft(History)g(Library)e(in)m(teractiv)m(ely)-8 | |
10314 | b(,)34 b(from)f(a)h(user's)150 671 y(standp)s(oin)m(t.)75 | |
10315 | b(It)42 b(should)e(b)s(e)i(considered)f(a)h(user's)g(guide.)75 | |
10316 | b(F)-8 b(or)43 b(information)d(on)i(using)f(the)h Fl(gnu)150 | |
10317 | 781 y Ft(History)30 b(Library)f(in)g(other)h(programs,)g(see)h(the)g | |
10318 | Fl(gnu)f Ft(Readline)f(Library)g(Man)m(ual.)150 1062 | |
10319 | y Fr(9.1)68 b(Bash)45 b(History)h(F)-11 b(acilities)275 | |
10320 | 1316 y Ft(When)36 b(the)h(`)p Fs(-o)30 b(history)p Ft(')k(option)i(to)i | |
10321 | (the)e Fs(set)g Ft(builtin)d(is)j(enabled)f(\(see)j(Section)e(4.3)h | |
10322 | ([The)g(Set)150 1425 y(Builtin],)29 b(page)j(50\),)h(the)e(shell)f(pro) | |
10323 | m(vides)g(access)i(to)g(the)f Fq(command)g(history)p | |
10324 | Ft(,)g(the)g(list)f(of)h(commands)150 1535 y(previously)f(t)m(yp)s(ed.) | |
10325 | 47 b(The)33 b(v)-5 b(alue)32 b(of)g(the)h Fs(HISTSIZE)e | |
10326 | Ft(shell)f(v)-5 b(ariable)32 b(is)g(used)f(as)i(the)g(n)m(um)m(b)s(er)e | |
10327 | (of)i(com-)150 1644 y(mands)i(to)i(sa)m(v)m(e)h(in)d(a)h(history)g | |
10328 | (list.)56 b(The)36 b(text)h(of)g(the)f(last)g Fs($HISTSIZE)e | |
10329 | Ft(commands)i(\(default)f(500\))150 1754 y(is)h(sa)m(v)m(ed.)61 | |
10330 | b(The)36 b(shell)f(stores)j(eac)m(h)g(command)e(in)g(the)h(history)f | |
10331 | (list)f(prior)g(to)j(parameter)f(and)f(v)-5 b(ari-)150 | |
10332 | 1864 y(able)32 b(expansion)g(but)g(after)h(history)e(expansion)h(is)g | |
10333 | (p)s(erformed,)f(sub)5 b(ject)33 b(to)g(the)g(v)-5 b(alues)32 | |
10334 | b(of)h(the)g(shell)150 1973 y(v)-5 b(ariables)29 b Fs(HISTIGNORE)f | |
10335 | Ft(and)h Fs(HISTCONTROL)p Ft(.)275 2117 y(When)g(the)g(shell)f(starts)i | |
10336 | (up,)f(the)h(history)e(is)h(initialized)d(from)j(the)h(\014le)e(named)h | |
10337 | (b)m(y)h(the)f Fs(HISTFILE)150 2227 y Ft(v)-5 b(ariable)19 | |
10338 | b(\(default)i(`)p Fs(~/.bash_history)p Ft('\).)34 b(The)20 | |
10339 | b(\014le)g(named)g(b)m(y)h(the)g(v)-5 b(alue)20 b(of)h | |
10340 | Fs(HISTFILE)d Ft(is)i(truncated,)150 2336 y(if)41 b(necessary)-8 | |
10341 | b(,)45 b(to)e(con)m(tain)f(no)g(more)g(than)f(the)h(n)m(um)m(b)s(er)f | |
10342 | (of)h(lines)e(sp)s(eci\014ed)g(b)m(y)i(the)g(v)-5 b(alue)41 | |
10343 | b(of)h(the)150 2446 y Fs(HISTFILESIZE)21 b Ft(v)-5 b(ariable.)38 | |
10344 | b(When)24 b(an)g(in)m(teractiv)m(e)h(shell)e(exits,)i(the)g(last)f | |
10345 | Fs($HISTSIZE)e Ft(lines)h(are)h(copied)150 2556 y(from)29 | |
10346 | b(the)i(history)d(list)h(to)i(the)f(\014le)f(named)g(b)m(y)h | |
10347 | Fs($HISTFILE)p Ft(.)38 b(If)30 b(the)g Fs(histappend)d | |
10348 | Ft(shell)h(option)h(is)g(set)150 2665 y(\(see)22 b(Section)f(4.2)h | |
10349 | ([Bash)g(Builtins],)e(page)i(39\),)j(the)c(lines)e(are)j(app)s(ended)d | |
10350 | (to)j(the)f(history)f(\014le,)j(otherwise)150 2775 y(the)32 | |
10351 | b(history)e(\014le)g(is)h(o)m(v)m(erwritten.)44 b(If)31 | |
10352 | b Fs(HISTFILE)e Ft(is)i(unset,)g(or)h(if)e(the)i(history)e(\014le)g(is) | |
10353 | h(un)m(writable,)f(the)150 2884 y(history)36 b(is)h(not)g(sa)m(v)m(ed.) | |
10354 | 63 b(After)38 b(sa)m(ving)f(the)g(history)-8 b(,)39 b(the)f(history)e | |
10355 | (\014le)g(is)h(truncated)g(to)h(con)m(tain)g(no)150 2994 | |
10356 | y(more)31 b(than)f Fs($HISTFILESIZE)c Ft(lines.)39 b(If)30 | |
10357 | b Fs(HISTFILESIZE)d Ft(is)j(not)g(set,)h(no)g(truncation)e(is)h(p)s | |
10358 | (erformed.)275 3138 y(If)h(the)h Fs(HISTTIMEFORMAT)d | |
10359 | Ft(is)i(set,)i(the)f(time)g(stamp)g(information)e(asso)s(ciated)j(with) | |
10360 | e(eac)m(h)i(history)150 3247 y(en)m(try)e(is)e(written)g(to)j(the)e | |
10361 | (history)f(\014le.)275 3392 y(The)19 b(builtin)e(command)j | |
10362 | Fs(fc)g Ft(ma)m(y)h(b)s(e)f(used)f(to)i(list)e(or)i(edit)f(and)f | |
10363 | (re-execute)j(a)f(p)s(ortion)e(of)h(the)h(history)150 | |
10364 | 3501 y(list.)39 b(The)27 b Fs(history)f Ft(builtin)f(ma)m(y)k(b)s(e)e | |
10365 | (used)g(to)i(displa)m(y)e(or)h(mo)s(dify)e(the)i(history)f(list)g(and)h | |
10366 | (manipulate)150 3611 y(the)j(history)f(\014le.)41 b(When)31 | |
10367 | b(using)e(command-line)g(editing,)h(searc)m(h)h(commands)g(are)g(a)m(v) | |
10368 | -5 b(ailable)30 b(in)g(eac)m(h)150 3720 y(editing)43 | |
10369 | b(mo)s(de)i(that)g(pro)m(vide)f(access)i(to)f(the)g(history)e(list)h | |
10370 | (\(see)h(Section)g(8.4.2)h([Commands)e(F)-8 b(or)150 | |
10371 | 3830 y(History],)30 b(page)i(95\).)275 3974 y(The)47 | |
10372 | b(shell)g(allo)m(ws)h(con)m(trol)g(o)m(v)m(er)i(whic)m(h)d(commands)h | |
10373 | (are)h(sa)m(v)m(ed)g(on)f(the)h(history)e(list.)93 b(The)150 | |
10374 | 4084 y Fs(HISTCONTROL)25 b Ft(and)j Fs(HISTIGNORE)e Ft(v)-5 | |
10375 | b(ariables)27 b(ma)m(y)j(b)s(e)d(set)j(to)f(cause)g(the)g(shell)d(to)k | |
10376 | (sa)m(v)m(e)g(only)e(a)h(subset)150 4193 y(of)e(the)g(commands)f(en)m | |
10377 | (tered.)40 b(The)26 b Fs(cmdhist)f Ft(shell)g(option,)i(if)f(enabled,)g | |
10378 | (causes)i(the)e(shell)f(to)j(attempt)150 4303 y(to)23 | |
10379 | b(sa)m(v)m(e)h(eac)m(h)f(line)e(of)h(a)h(m)m(ulti-line)c(command)j(in)f | |
10380 | (the)i(same)f(history)f(en)m(try)-8 b(,)25 b(adding)c(semicolons)g | |
10381 | (where)150 4412 y(necessary)37 b(to)f(preserv)m(e)h(syn)m(tactic)g | |
10382 | (correctness.)58 b(The)36 b Fs(lithist)e Ft(shell)g(option)i(causes)h | |
10383 | (the)f(shell)e(to)150 4522 y(sa)m(v)m(e)25 b(the)e(command)h(with)e(em) | |
10384 | m(b)s(edded)g(newlines)f(instead)i(of)g(semicolons.)38 | |
10385 | b(The)23 b Fs(shopt)e Ft(builtin)f(is)j(used)150 4631 | |
10386 | y(to)31 b(set)g(these)g(options.)40 b(See)31 b(Section)f(4.2)h([Bash)g | |
10387 | (Builtins],)d(page)j(39,)h(for)e(a)h(description)d(of)j | |
10388 | Fs(shopt)p Ft(.)150 4913 y Fr(9.2)68 b(Bash)45 b(History)h(Builtins)275 | |
10389 | 5166 y Ft(Bash)30 b(pro)m(vides)f(t)m(w)m(o)j(builtin)27 | |
10390 | b(commands)j(whic)m(h)f(manipulate)g(the)h(history)g(list)f(and)h | |
10391 | (history)f(\014le.)150 5340 y Fs(fc)p eop | |
10392 | %%Page: 110 116 | |
10393 | 110 115 bop 150 -116 a Ft(110)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10394 | 870 299 y Fs(fc)47 b([-e)g Fj(ename)11 b Fs(])46 b([-nlr])g([)p | |
10395 | Fj(first)11 b Fs(])45 b([)p Fj(last)11 b Fs(])870 408 | |
10396 | y(fc)47 b(-s)g([)p Fj(pat)11 b Fs(=)p Fj(rep)g Fs(])45 | |
10397 | b([)p Fj(command)11 b Fs(])630 539 y Ft(Fix)40 b(Command.)68 | |
10398 | b(In)39 b(the)i(\014rst)e(form,)j(a)e(range)h(of)f(commands)g(from)f | |
10399 | Fq(\014rst)i Ft(to)g Fq(last)h Ft(is)630 648 y(selected)34 | |
10400 | b(from)f(the)g(history)f(list.)48 b(Both)34 b Fq(\014rst)h | |
10401 | Ft(and)e Fq(last)i Ft(ma)m(y)f(b)s(e)e(sp)s(eci\014ed)g(as)h(a)h | |
10402 | (string)630 758 y(\(to)26 b(lo)s(cate)g(the)f(most)h(recen)m(t)g | |
10403 | (command)e(b)s(eginning)f(with)h(that)h(string\))g(or)g(as)g(a)g(n)m | |
10404 | (um)m(b)s(er)630 867 y(\(an)f(index)e(in)m(to)h(the)h(history)f(list,)g | |
10405 | (where)g(a)h(negativ)m(e)h(n)m(um)m(b)s(er)d(is)h(used)g(as)g(an)h | |
10406 | (o\013set)g(from)630 977 y(the)j(curren)m(t)f(command)h(n)m(um)m(b)s | |
10407 | (er\).)39 b(If)26 b Fq(last)i Ft(is)e(not)h(sp)s(eci\014ed)e(it)h(is)g | |
10408 | (set)h(to)h Fq(\014rst)p Ft(.)39 b(If)26 b Fq(\014rst)i | |
10409 | Ft(is)630 1087 y(not)j(sp)s(eci\014ed)e(it)h(is)g(set)i(to)f(the)g | |
10410 | (previous)e(command)i(for)f(editing)g(and)g Fp(\000)p | |
10411 | Ft(16)h(for)g(listing.)630 1196 y(If)f(the)g(`)p Fs(-l)p | |
10412 | Ft(')g(\015ag)h(is)e(giv)m(en,)h(the)h(commands)e(are)i(listed)e(on)h | |
10413 | (standard)f(output.)40 b(The)30 b(`)p Fs(-n)p Ft(')630 | |
10414 | 1306 y(\015ag)i(suppresses)f(the)h(command)g(n)m(um)m(b)s(ers)e(when)i | |
10415 | (listing.)43 b(The)32 b(`)p Fs(-r)p Ft(')g(\015ag)g(rev)m(erses)h(the) | |
10416 | 630 1415 y(order)g(of)g(the)h(listing.)47 b(Otherwise,)33 | |
10417 | b(the)g(editor)g(giv)m(en)g(b)m(y)g Fq(ename)39 b Ft(is)32 | |
10418 | b(in)m(v)m(ok)m(ed)i(on)f(a)h(\014le)630 1525 y(con)m(taining)g(those)h | |
10419 | (commands.)52 b(If)33 b Fq(ename)40 b Ft(is)33 b(not)i(giv)m(en,)g(the) | |
10420 | g(v)-5 b(alue)34 b(of)g(the)g(follo)m(wing)630 1634 y(v)-5 | |
10421 | b(ariable)31 b(expansion)f(is)h(used:)42 b Fs(${FCEDIT:-${EDITOR:-vi}}) | |
10422 | p Ft(.)d(This)30 b(sa)m(ys)i(to)g(use)g(the)630 1744 | |
10423 | y(v)-5 b(alue)33 b(of)g(the)h Fs(FCEDIT)e Ft(v)-5 b(ariable)32 | |
10424 | b(if)g(set,)j(or)f(the)f(v)-5 b(alue)33 b(of)h(the)f | |
10425 | Fs(EDITOR)f Ft(v)-5 b(ariable)32 b(if)g(that)630 1854 | |
10426 | y(is)g(set,)j(or)e Fs(vi)g Ft(if)f(neither)g(is)g(set.)50 | |
10427 | b(When)33 b(editing)f(is)g(complete,)i(the)g(edited)e(commands)630 | |
10428 | 1963 y(are)f(ec)m(ho)s(ed)g(and)f(executed.)630 2093 | |
10429 | y(In)k(the)g(second)g(form,)h Fq(command)j Ft(is)33 b(re-executed)j | |
10430 | (after)f(eac)m(h)g(instance)f(of)g Fq(pat)j Ft(in)c(the)630 | |
10431 | 2203 y(selected)e(command)f(is)f(replaced)h(b)m(y)h Fq(rep)p | |
10432 | Ft(.)630 2333 y(A)g(useful)e(alias)h(to)i(use)e(with)g(the)h | |
10433 | Fs(fc)f Ft(command)h(is)f Fs(r='fc)f(-s')p Ft(,)h(so)h(that)h(t)m | |
10434 | (yping)e(`)p Fs(r)g(cc)p Ft(')630 2443 y(runs)35 b(the)h(last)g | |
10435 | (command)g(b)s(eginning)e(with)h Fs(cc)g Ft(and)h(t)m(yping)f(`)p | |
10436 | Fs(r)p Ft(')i(re-executes)h(the)e(last)630 2552 y(command)30 | |
10437 | b(\(see)h(Section)g(6.6)g([Aliases],)f(page)i(71\).)150 | |
10438 | 2703 y Fs(history)870 2833 y(history)46 b([)p Fj(n)11 | |
10439 | b Fs(])870 2943 y(history)46 b(-c)870 3052 y(history)g(-d)h | |
10440 | Fj(offset)870 3162 y Fs(history)f([-anrw])g([)p Fj(filename)11 | |
10441 | b Fs(])870 3271 y(history)46 b(-ps)h Fj(arg)630 3402 | |
10442 | y Ft(With)25 b(no)h(options,)g(displa)m(y)e(the)i(history)f(list)f | |
10443 | (with)g(line)g(n)m(um)m(b)s(ers.)38 b(Lines)25 b(pre\014xed)f(with)630 | |
10444 | 3511 y(a)35 b(`)p Fs(*)p Ft(')g(ha)m(v)m(e)h(b)s(een)e(mo)s(di\014ed.) | |
10445 | 52 b(An)34 b(argumen)m(t)h(of)g Fq(n)f Ft(lists)g(only)g(the)h(last)f | |
10446 | Fq(n)g Ft(lines.)52 b(If)35 b(the)630 3621 y(shell)28 | |
10447 | b(v)-5 b(ariable)29 b Fs(HISTTIMEFORMAT)d Ft(is)j(set)i(and)e(not)i(n)m | |
10448 | (ull,)d(it)i(is)f(used)g(as)h(a)h(format)f(string)630 | |
10449 | 3730 y(for)36 b Fq(strftime)k Ft(to)c(displa)m(y)e(the)i(time)g(stamp)g | |
10450 | (asso)s(ciated)g(with)f(eac)m(h)i(displa)m(y)m(ed)d(history)630 | |
10451 | 3840 y(en)m(try)-8 b(.)47 b(No)33 b(in)m(terv)m(ening)e(blank)g(is)g | |
10452 | (prin)m(ted)g(b)s(et)m(w)m(een)i(the)g(formatted)f(time)g(stamp)h(and) | |
10453 | 630 3950 y(the)e(history)e(line.)630 4080 y(Options,)g(if)h(supplied,)d | |
10454 | (ha)m(v)m(e)k(the)g(follo)m(wing)e(meanings:)630 4230 | |
10455 | y Fs(-c)384 b Ft(Clear)22 b(the)h(history)f(list.)37 | |
10456 | b(This)21 b(ma)m(y)j(b)s(e)e(com)m(bined)g(with)f(the)i(other)h | |
10457 | (options)1110 4340 y(to)31 b(replace)f(the)h(history)e(list)g | |
10458 | (completely)-8 b(.)630 4491 y Fs(-d)30 b Fj(offset)1110 | |
10459 | 4600 y Ft(Delete)24 b(the)g(history)e(en)m(try)i(at)g(p)s(osition)d | |
10460 | Fq(o\013set)p Ft(.)39 b Fq(o\013set)27 b Ft(should)21 | |
10461 | b(b)s(e)i(sp)s(eci\014ed)1110 4710 y(as)31 b(it)f(app)s(ears)f(when)h | |
10462 | (the)g(history)f(is)h(displa)m(y)m(ed.)630 4861 y Fs(-a)384 | |
10463 | b Ft(App)s(end)35 b(the)i(new)g(history)f(lines)f(\(history)h(lines)f | |
10464 | (en)m(tered)j(since)e(the)h(b)s(e-)1110 4970 y(ginning)28 | |
10465 | b(of)j(the)f(curren)m(t)g(Bash)h(session\))f(to)h(the)g(history)e | |
10466 | (\014le.)630 5121 y Fs(-n)384 b Ft(App)s(end)32 b(the)i(history)e | |
10467 | (lines)g(not)i(already)f(read)h(from)f(the)h(history)e(\014le)h(to)1110 | |
10468 | 5230 y(the)26 b(curren)m(t)f(history)f(list.)38 b(These)25 | |
10469 | b(are)h(lines)e(app)s(ended)g(to)i(the)f(history)g(\014le)1110 | |
10470 | 5340 y(since)30 b(the)g(b)s(eginning)e(of)i(the)h(curren)m(t)f(Bash)h | |
10471 | (session.)p eop | |
10472 | %%Page: 111 117 | |
10473 | 111 116 bop 150 -116 a Ft(Chapter)30 b(9:)41 b(Using)29 | |
10474 | b(History)h(In)m(teractiv)m(ely)1923 b(111)630 299 y | |
10475 | Fs(-r)384 b Ft(Read)26 b(the)h(curren)m(t)f(history)f(\014le)g(and)h | |
10476 | (app)s(end)e(its)i(con)m(ten)m(ts)i(to)f(the)f(history)1110 | |
10477 | 408 y(list.)630 571 y Fs(-w)384 b Ft(W)-8 b(rite)31 b(out)f(the)h | |
10478 | (curren)m(t)f(history)f(to)j(the)e(history)f(\014le.)630 | |
10479 | 734 y Fs(-p)384 b Ft(P)m(erform)31 b(history)e(substitution)g(on)h(the) | |
10480 | h Fq(arg)8 b Ft(s)31 b(and)f(displa)m(y)f(the)h(result)g(on)1110 | |
10481 | 843 y(the)e(standard)f(output,)i(without)e(storing)g(the)h(results)f | |
10482 | (in)g(the)h(history)f(list.)630 1006 y Fs(-s)384 b Ft(The)30 | |
10483 | b Fq(arg)8 b Ft(s)30 b(are)h(added)f(to)h(the)f(end)g(of)h(the)f | |
10484 | (history)g(list)f(as)h(a)h(single)e(en)m(try)-8 b(.)630 | |
10485 | 1168 y(When)24 b(an)m(y)h(of)f(the)h(`)p Fs(-w)p Ft(',)h(`)p | |
10486 | Fs(-r)p Ft(',)f(`)p Fs(-a)p Ft(',)h(or)f(`)p Fs(-n)p | |
10487 | Ft(')f(options)f(is)h(used,)h(if)e Fq(\014lename)29 b | |
10488 | Ft(is)23 b(giv)m(en,)j(then)630 1278 y(it)31 b(is)g(used)g(as)h(the)f | |
10489 | (history)g(\014le.)44 b(If)31 b(not,)h(then)g(the)f(v)-5 | |
10490 | b(alue)31 b(of)h(the)g Fs(HISTFILE)d Ft(v)-5 b(ariable)31 | |
10491 | b(is)630 1388 y(used.)150 1653 y Fr(9.3)68 b(History)46 | |
10492 | b(Expansion)275 1900 y Ft(The)35 b(History)g(library)e(pro)m(vides)i(a) | |
10493 | h(history)e(expansion)h(feature)h(that)g(is)f(similar)e(to)j(the)g | |
10494 | (history)150 2010 y(expansion)21 b(pro)m(vided)f(b)m(y)i | |
10495 | Fs(csh)p Ft(.)37 b(This)21 b(section)h(describ)s(es)e(the)i(syn)m(tax)h | |
10496 | (used)e(to)h(manipulate)f(the)h(history)150 2120 y(information.)275 | |
10497 | 2257 y(History)30 b(expansions)f(in)m(tro)s(duce)g(w)m(ords)h(from)g | |
10498 | (the)h(history)e(list)g(in)m(to)h(the)h(input)e(stream,)i(making)150 | |
10499 | 2367 y(it)f(easy)h(to)g(rep)s(eat)g(commands,)f(insert)f(the)i(argumen) | |
10500 | m(ts)f(to)h(a)g(previous)e(command)h(in)m(to)h(the)f(curren)m(t)150 | |
10501 | 2476 y(input)e(line,)h(or)i(\014x)f(errors)f(in)g(previous)g(commands)h | |
10502 | (quic)m(kly)-8 b(.)275 2614 y(History)26 b(expansion)f(tak)m(es)j | |
10503 | (place)e(in)f(t)m(w)m(o)j(parts.)39 b(The)26 b(\014rst)g(is)f(to)i | |
10504 | (determine)f(whic)m(h)f(line)g(from)h(the)150 2724 y(history)h(list)f | |
10505 | (should)g(b)s(e)h(used)g(during)f(substitution.)37 b(The)27 | |
10506 | b(second)h(is)f(to)i(select)f(p)s(ortions)e(of)i(that)h(line)150 | |
10507 | 2833 y(for)d(inclusion)c(in)m(to)k(the)g(curren)m(t)f(one.)40 | |
10508 | b(The)25 b(line)f(selected)i(from)g(the)g(history)e(is)h(called)g(the)h | |
10509 | Fq(ev)m(en)m(t)p Ft(,)j(and)150 2943 y(the)21 b(p)s(ortions)f(of)h | |
10510 | (that)h(line)d(that)j(are)g(acted)g(up)s(on)e(are)h(called)f | |
10511 | Fq(w)m(ords)p Ft(.)38 b(V)-8 b(arious)20 b Fq(mo)s(di\014ers)j | |
10512 | Ft(are)f(a)m(v)-5 b(ailable)150 3052 y(to)35 b(manipulate)d(the)i | |
10513 | (selected)h(w)m(ords.)51 b(The)33 b(line)f(is)h(brok)m(en)h(in)m(to)g | |
10514 | (w)m(ords)f(in)g(the)h(same)h(fashion)d(that)150 3162 | |
10515 | y(Bash)j(do)s(es,)h(so)f(that)h(sev)m(eral)f(w)m(ords)f(surrounded)f(b) | |
10516 | m(y)i(quotes)g(are)g(considered)f(one)h(w)m(ord.)54 b(History)150 | |
10517 | 3272 y(expansions)33 b(are)h(in)m(tro)s(duced)e(b)m(y)i(the)g(app)s | |
10518 | (earance)g(of)g(the)g(history)f(expansion)g(c)m(haracter,)j(whic)m(h)d | |
10519 | (is)150 3381 y(`)p Fs(!)p Ft(')e(b)m(y)f(default.)40 | |
10520 | b(Only)28 b(`)p Fs(\\)p Ft(')j(and)f(`)p Fs(')p Ft(')g(ma)m(y)h(b)s(e)f | |
10521 | (used)g(to)h(escap)s(e)g(the)f(history)f(expansion)h(c)m(haracter.)275 | |
10522 | 3519 y(Sev)m(eral)39 b(shell)f(options)h(settable)h(with)e(the)i | |
10523 | Fs(shopt)e Ft(builtin)e(\(see)k(Section)g(4.2)g([Bash)g(Builtins],)150 | |
10524 | 3629 y(page)32 b(39\))h(ma)m(y)f(b)s(e)f(used)g(to)i(tailor)e(the)g(b)s | |
10525 | (eha)m(vior)g(of)h(history)f(expansion.)43 b(If)31 b(the)h | |
10526 | Fs(histverify)d Ft(shell)150 3738 y(option)38 b(is)f(enabled,)i(and)f | |
10527 | (Readline)e(is)i(b)s(eing)e(used,)k(history)d(substitutions)f(are)i | |
10528 | (not)h(immediately)150 3848 y(passed)30 b(to)h(the)g(shell)e(parser.)40 | |
10529 | b(Instead,)30 b(the)h(expanded)f(line)f(is)g(reloaded)h(in)m(to)h(the)f | |
10530 | (Readline)f(editing)150 3957 y(bu\013er)g(for)i(further)e(mo)s | |
10531 | (di\014cation.)39 b(If)30 b(Readline)f(is)g(b)s(eing)g(used,)h(and)g | |
10532 | (the)g Fs(histreedit)e Ft(shell)g(option)150 4067 y(is)33 | |
10533 | b(enabled,)h(a)h(failed)e(history)g(expansion)g(will)e(b)s(e)j | |
10534 | (reloaded)f(in)m(to)h(the)h(Readline)d(editing)h(bu\013er)g(for)150 | |
10535 | 4176 y(correction.)73 b(The)41 b(`)p Fs(-p)p Ft(')g(option)f(to)i(the)f | |
10536 | Fs(history)f Ft(builtin)d(command)k(ma)m(y)h(b)s(e)e(used)h(to)g(see)h | |
10537 | (what)150 4286 y(a)c(history)f(expansion)f(will)f(do)i(b)s(efore)h | |
10538 | (using)e(it.)62 b(The)37 b(`)p Fs(-s)p Ft(')g(option)g(to)i(the)f | |
10539 | Fs(history)d Ft(builtin)f(ma)m(y)150 4396 y(b)s(e)f(used)h(to)g(add)g | |
10540 | (commands)f(to)i(the)f(end)g(of)g(the)g(history)f(list)g(without)g | |
10541 | (actually)h(executing)g(them,)150 4505 y(so)k(that)h(they)f(are)g(a)m | |
10542 | (v)-5 b(ailable)37 b(for)h(subsequen)m(t)f(recall.)63 | |
10543 | b(This)36 b(is)h(most)h(useful)f(in)f(conjunction)h(with)150 | |
10544 | 4615 y(Readline.)275 4753 y(The)29 b(shell)g(allo)m(ws)h(con)m(trol)h | |
10545 | (of)f(the)h(v)-5 b(arious)29 b(c)m(haracters)j(used)e(b)m(y)g(the)h | |
10546 | (history)e(expansion)h(mec)m(ha-)150 4862 y(nism)f(with)g(the)h | |
10547 | Fs(histchars)e Ft(v)-5 b(ariable.)150 5093 y Fk(9.3.1)63 | |
10548 | b(Ev)m(en)m(t)39 b(Designators)275 5340 y Ft(An)30 b(ev)m(en)m(t)h | |
10549 | (designator)g(is)e(a)i(reference)g(to)g(a)f(command)h(line)d(en)m(try)j | |
10550 | (in)e(the)i(history)e(list.)p eop | |
10551 | %%Page: 112 118 | |
10552 | 112 117 bop 150 -116 a Ft(112)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10553 | 150 299 y Fs(!)432 b Ft(Start)34 b(a)f(history)g(substitution,)f | |
10554 | (except)i(when)f(follo)m(w)m(ed)g(b)m(y)g(a)h(space,)h(tab,)f(the)g | |
10555 | (end)f(of)630 408 y(the)i(line,)e(`)p Fs(=)p Ft(')i(or)f(`)p | |
10556 | Fs(\()p Ft(')h(\(when)e(the)i Fs(extglob)d Ft(shell)h(option)g(is)h | |
10557 | (enabled)f(using)g(the)h Fs(shopt)630 518 y Ft(builtin\).)150 | |
10558 | 674 y Fs(!)p Fj(n)384 b Ft(Refer)30 b(to)i(command)e(line)e | |
10559 | Fq(n)p Ft(.)150 830 y Fs(!-)p Fj(n)336 b Ft(Refer)30 | |
10560 | b(to)i(the)e(command)g Fq(n)g Ft(lines)f(bac)m(k.)150 | |
10561 | 985 y Fs(!!)384 b Ft(Refer)30 b(to)i(the)e(previous)f(command.)40 | |
10562 | b(This)29 b(is)g(a)i(synon)m(ym)f(for)g(`)p Fs(!-1)p | |
10563 | Ft('.)150 1141 y Fs(!)p Fj(string)144 b Ft(Refer)30 b(to)i(the)e(most)h | |
10564 | (recen)m(t)g(command)f(starting)h(with)e Fq(string)p | |
10565 | Ft(.)150 1297 y Fs(!?)p Fj(string)11 b Fs([?])630 1406 | |
10566 | y Ft(Refer)34 b(to)g(the)f(most)h(recen)m(t)h(command)e(con)m(taining)g | |
10567 | Fq(string)p Ft(.)49 b(The)33 b(trailing)f(`)p Fs(?)p | |
10568 | Ft(')h(ma)m(y)i(b)s(e)630 1516 y(omitted)30 b(if)g(the)g | |
10569 | Fq(string)37 b Ft(is)30 b(follo)m(w)m(ed)g(immediately)f(b)m(y)h(a)h | |
10570 | (newline.)150 1672 y Fs(^)p Fj(string1)11 b Fs(^)p Fj(string2)g | |
10571 | Fs(^)630 1781 y Ft(Quic)m(k)31 b(Substitution.)42 b(Rep)s(eat)32 | |
10572 | b(the)g(last)g(command,)g(replacing)e Fq(string1)39 b | |
10573 | Ft(with)30 b Fq(string2)p Ft(.)630 1891 y(Equiv)-5 b(alen)m(t)29 | |
10574 | b(to)i Fs(!!:s/)p Fj(string1)11 b Fs(/)p Fj(string2)g | |
10575 | Fs(/)p Ft(.)150 2047 y Fs(!#)384 b Ft(The)30 b(en)m(tire)g(command)g | |
10576 | (line)f(t)m(yp)s(ed)h(so)h(far.)150 2265 y Fk(9.3.2)63 | |
10577 | b(W)-10 b(ord)41 b(Designators)275 2508 y Ft(W)-8 b(ord)35 | |
10578 | b(designators)f(are)h(used)f(to)h(select)g(desired)e(w)m(ords)i(from)f | |
10579 | (the)h(ev)m(en)m(t.)55 b(A)34 b(`)p Fs(:)p Ft(')h(separates)h(the)150 | |
10580 | 2617 y(ev)m(en)m(t)41 b(sp)s(eci\014cation)d(from)i(the)f(w)m(ord)g | |
10581 | (designator.)68 b(It)40 b(ma)m(y)g(b)s(e)f(omitted)h(if)e(the)i(w)m | |
10582 | (ord)f(designator)150 2727 y(b)s(egins)32 b(with)h(a)i(`)p | |
10583 | Fs(^)p Ft(',)g(`)p Fs($)p Ft(',)g(`)p Fs(*)p Ft(',)h(`)p | |
10584 | Fs(-)p Ft(',)f(or)f(`)p Fs(\045)p Ft('.)52 b(W)-8 b(ords)35 | |
10585 | b(are)f(n)m(um)m(b)s(ered)f(from)g(the)i(b)s(eginning)c(of)j(the)g | |
10586 | (line,)150 2836 y(with)k(the)i(\014rst)f(w)m(ord)g(b)s(eing)f(denoted)i | |
10587 | (b)m(y)g(0)g(\(zero\).)70 b(W)-8 b(ords)39 b(are)h(inserted)f(in)m(to)g | |
10588 | (the)h(curren)m(t)g(line)150 2946 y(separated)31 b(b)m(y)f(single)f | |
10589 | (spaces.)275 3079 y(F)-8 b(or)31 b(example,)150 3234 | |
10590 | y Fs(!!)384 b Ft(designates)36 b(the)g(preceding)f(command.)57 | |
10591 | b(When)35 b(y)m(ou)i(t)m(yp)s(e)f(this,)g(the)g(preceding)f(com-)630 | |
10592 | 3344 y(mand)30 b(is)f(rep)s(eated)h(in)f(toto.)150 3500 | |
10593 | y Fs(!!:$)288 b Ft(designates)22 b(the)h(last)f(argumen)m(t)h(of)f(the) | |
10594 | h(preceding)e(command.)38 b(This)21 b(ma)m(y)i(b)s(e)e(shortened)630 | |
10595 | 3609 y(to)31 b Fs(!$)p Ft(.)150 3765 y Fs(!fi:2)240 b | |
10596 | Ft(designates)29 b(the)h(second)f(argumen)m(t)h(of)f(the)h(most)f | |
10597 | (recen)m(t)i(command)e(starting)g(with)f(the)630 3875 | |
10598 | y(letters)j Fs(fi)p Ft(.)275 4030 y(Here)f(are)h(the)g(w)m(ord)f | |
10599 | (designators:)150 4186 y Fs(0)g(\(zero\))114 b Ft(The)30 | |
10600 | b Fs(0)p Ft(th)g(w)m(ord.)40 b(F)-8 b(or)31 b(man)m(y)g(applications,)e | |
10601 | (this)g(is)g(the)i(command)f(w)m(ord.)150 4342 y Fj(n)432 | |
10602 | b Ft(The)30 b Fq(n)p Ft(th)g(w)m(ord.)150 4498 y Fs(^)432 | |
10603 | b Ft(The)30 b(\014rst)f(argumen)m(t;)j(that)f(is,)e(w)m(ord)h(1.)150 | |
10604 | 4654 y Fs($)432 b Ft(The)30 b(last)g(argumen)m(t.)150 | |
10605 | 4809 y Fs(\045)432 b Ft(The)30 b(w)m(ord)g(matc)m(hed)h(b)m(y)f(the)h | |
10606 | (most)g(recen)m(t)g(`)p Fs(?)p Fj(string)11 b Fs(?)p | |
10607 | Ft(')28 b(searc)m(h.)150 4965 y Fj(x)p Fs(-)p Fj(y)336 | |
10608 | b Ft(A)30 b(range)h(of)g(w)m(ords;)f(`)p Fs(-)p Fj(y)11 | |
10609 | b Ft(')30 b(abbreviates)g(`)p Fs(0-)p Fj(y)11 b Ft('.)150 | |
10610 | 5121 y Fs(*)432 b Ft(All)26 b(of)i(the)g(w)m(ords,)g(except)h(the)e | |
10611 | Fs(0)p Ft(th.)40 b(This)26 b(is)g(a)i(synon)m(ym)f(for)h(`)p | |
10612 | Fs(1-$)p Ft('.)39 b(It)28 b(is)f(not)h(an)f(error)630 | |
10613 | 5230 y(to)j(use)g(`)p Fs(*)p Ft(')f(if)g(there)h(is)f(just)g(one)h(w)m | |
10614 | (ord)f(in)f(the)i(ev)m(en)m(t;)i(the)d(empt)m(y)i(string)d(is)h | |
10615 | (returned)f(in)630 5340 y(that)j(case.)p eop | |
10616 | %%Page: 113 119 | |
10617 | 113 118 bop 150 -116 a Ft(Chapter)30 b(9:)41 b(Using)29 | |
10618 | b(History)h(In)m(teractiv)m(ely)1923 b(113)150 299 y | |
10619 | Fj(x)11 b Fs(*)373 b Ft(Abbreviates)30 b(`)p Fj(x)p Fs(-$)p | |
10620 | Ft(')150 458 y Fj(x)p Fs(-)384 b Ft(Abbreviates)30 b(`)p | |
10621 | Fj(x)p Fs(-$)p Ft(')g(lik)m(e)f(`)p Fj(x)11 b Fs(*)p | |
10622 | Ft(',)31 b(but)e(omits)h(the)h(last)f(w)m(ord.)275 618 | |
10623 | y(If)j(a)h(w)m(ord)g(designator)f(is)g(supplied)e(without)i(an)h(ev)m | |
10624 | (en)m(t)h(sp)s(eci\014cation,)f(the)g(previous)e(command)150 | |
10625 | 727 y(is)d(used)h(as)h(the)f(ev)m(en)m(t.)150 951 y Fk(9.3.3)63 | |
10626 | b(Mo)s(di\014ers)275 1196 y Ft(After)20 b(the)h(optional)f(w)m(ord)h | |
10627 | (designator,)h(y)m(ou)f(can)g(add)f(a)h(sequence)g(of)g(one)g(or)g | |
10628 | (more)g(of)g(the)f(follo)m(wing)150 1305 y(mo)s(di\014ers,)28 | |
10629 | b(eac)m(h)k(preceded)e(b)m(y)g(a)h(`)p Fs(:)p Ft('.)150 | |
10630 | 1465 y Fs(h)432 b Ft(Remo)m(v)m(e)32 b(a)f(trailing)d(pathname)j(comp)s | |
10631 | (onen)m(t,)g(lea)m(ving)f(only)f(the)i(head.)150 1624 | |
10632 | y Fs(t)432 b Ft(Remo)m(v)m(e)32 b(all)d(leading)h(pathname)g(comp)s | |
10633 | (onen)m(ts,)h(lea)m(ving)f(the)g(tail.)150 1783 y Fs(r)432 | |
10634 | b Ft(Remo)m(v)m(e)32 b(a)f(trailing)d(su\016x)i(of)g(the)h(form)f(`)p | |
10635 | Fs(.)p Fj(suffix)11 b Ft(',)28 b(lea)m(ving)j(the)f(basename.)150 | |
10636 | 1943 y Fs(e)432 b Ft(Remo)m(v)m(e)32 b(all)d(but)h(the)h(trailing)d | |
10637 | (su\016x.)150 2102 y Fs(p)432 b Ft(Prin)m(t)29 b(the)i(new)f(command)g | |
10638 | (but)g(do)g(not)g(execute)i(it.)150 2262 y Fs(q)432 b | |
10639 | Ft(Quote)31 b(the)f(substituted)f(w)m(ords,)h(escaping)g(further)f | |
10640 | (substitutions.)150 2421 y Fs(x)432 b Ft(Quote)32 b(the)f(substituted)f | |
10641 | (w)m(ords)g(as)i(with)e(`)p Fs(q)p Ft(',)i(but)e(break)h(in)m(to)h(w)m | |
10642 | (ords)e(at)i(spaces,)h(tabs,)630 2531 y(and)d(newlines.)150 | |
10643 | 2690 y Fs(s/)p Fj(old)11 b Fs(/)p Fj(new)g Fs(/)630 2800 | |
10644 | y Ft(Substitute)31 b Fq(new)40 b Ft(for)32 b(the)h(\014rst)f(o)s | |
10645 | (ccurrence)h(of)f Fq(old)k Ft(in)31 b(the)i(ev)m(en)m(t)h(line.)46 | |
10646 | b(An)m(y)32 b(delimiter)630 2909 y(ma)m(y)25 b(b)s(e)g(used)f(in)f | |
10647 | (place)i(of)g(`)p Fs(/)p Ft('.)39 b(The)24 b(delimiter)e(ma)m(y)k(b)s | |
10648 | (e)e(quoted)h(in)e Fq(old)28 b Ft(and)c Fq(new)32 b Ft(with)24 | |
10649 | b(a)630 3019 y(single)j(bac)m(kslash.)39 b(If)28 b(`)p | |
10650 | Fs(&)p Ft(')g(app)s(ears)g(in)e Fq(new)p Ft(,)j(it)e(is)h(replaced)f(b) | |
10651 | m(y)h Fq(old)p Ft(.)39 b(A)28 b(single)f(bac)m(kslash)630 | |
10652 | 3128 y(will)32 b(quote)j(the)g(`)p Fs(&)p Ft('.)54 b(The)34 | |
10653 | b(\014nal)f(delimiter)g(is)g(optional)h(if)g(it)g(is)f(the)i(last)g(c)m | |
10654 | (haracter)h(on)630 3238 y(the)31 b(input)d(line.)150 | |
10655 | 3397 y Fs(&)432 b Ft(Rep)s(eat)31 b(the)f(previous)f(substitution.)150 | |
10656 | 3557 y Fs(g)150 3666 y(a)432 b Ft(Cause)38 b(c)m(hanges)i(to)f(b)s(e)f | |
10657 | (applied)f(o)m(v)m(er)j(the)f(en)m(tire)f(ev)m(en)m(t)i(line.)64 | |
10658 | b(Used)39 b(in)e(conjunction)630 3776 y(with)29 b(`)p | |
10659 | Fs(s)p Ft(',)i(as)f(in)g Fs(gs/)p Fj(old)11 b Fs(/)p | |
10660 | Fj(new)g Fs(/)p Ft(,)26 b(or)k(with)g(`)p Fs(&)p Ft('.)150 | |
10661 | 3935 y Fs(G)432 b Ft(Apply)29 b(the)h(follo)m(wing)f(`)p | |
10662 | Fs(s)p Ft(')i(mo)s(di\014er)d(once)j(to)g(eac)m(h)h(w)m(ord)e(in)f(the) | |
10663 | h(ev)m(en)m(t.)p eop | |
10664 | %%Page: 114 120 | |
10665 | 114 119 bop 150 -116 a Ft(114)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
10666 | eop | |
10667 | %%Page: 115 121 | |
10668 | 115 120 bop 150 -116 a Ft(Chapter)30 b(10:)41 b(Installing)28 | |
10669 | b(Bash)2356 b(115)150 299 y Fo(10)80 b(Installing)55 | |
10670 | b(Bash)275 535 y Ft(This)38 b(c)m(hapter)j(pro)m(vides)e(basic)g | |
10671 | (instructions)f(for)i(installing)d(Bash)j(on)g(the)h(v)-5 | |
10672 | b(arious)39 b(supp)s(orted)150 645 y(platforms.)57 b(The)36 | |
10673 | b(distribution)d(supp)s(orts)h(the)j Fl(gnu)f Ft(op)s(erating)f | |
10674 | (systems,)k(nearly)c(ev)m(ery)i(v)m(ersion)f(of)150 754 | |
10675 | y(Unix,)g(and)f(sev)m(eral)h(non-Unix)f(systems)h(suc)m(h)f(as)h(BeOS)g | |
10676 | (and)f(In)m(terix.)56 b(Other)35 b(indep)s(enden)m(t)f(p)s(orts)150 | |
10677 | 864 y(exist)c(for)g Fl(ms-dos)p Ft(,)g Fl(os/2)p Ft(,)g(and)g(Windo)m | |
10678 | (ws)g(platforms.)150 1123 y Fr(10.1)68 b(Basic)45 b(Installation)275 | |
10679 | 1367 y Ft(These)30 b(are)g(installation)f(instructions)f(for)i(Bash.) | |
10680 | 275 1503 y(The)f(simplest)g(w)m(a)m(y)i(to)g(compile)f(Bash)g(is:)199 | |
10681 | 1638 y(1.)61 b Fs(cd)38 b Ft(to)h(the)f(directory)g(con)m(taining)g | |
10682 | (the)h(source)f(co)s(de)h(and)f(t)m(yp)s(e)g(`)p Fs(./configure)p | |
10683 | Ft(')e(to)j(con\014gure)330 1747 y(Bash)c(for)f(y)m(our)h(system.)54 | |
10684 | b(If)34 b(y)m(ou're)h(using)e Fs(csh)h Ft(on)g(an)h(old)f(v)m(ersion)g | |
10685 | (of)h(System)f(V,)h(y)m(ou)g(migh)m(t)330 1857 y(need)21 | |
10686 | b(to)g(t)m(yp)s(e)g(`)p Fs(sh)30 b(./configure)p Ft(')18 | |
10687 | b(instead)i(to)h(prev)m(en)m(t)h Fs(csh)e Ft(from)g(trying)g(to)h | |
10688 | (execute)h Fs(configure)330 1966 y Ft(itself.)330 2101 | |
10689 | y(Running)29 b Fs(configure)g Ft(tak)m(es)k(some)e(time.)44 | |
10690 | b(While)30 b(running,)f(it)i(prin)m(ts)f(messages)i(telling)e(whic)m(h) | |
10691 | 330 2211 y(features)h(it)f(is)f(c)m(hec)m(king)i(for.)199 | |
10692 | 2346 y(2.)61 b(T)m(yp)s(e)30 b(`)p Fs(make)p Ft(')g(to)h(compile)e | |
10693 | (Bash)i(and)e(build)f(the)i Fs(bashbug)f Ft(bug)g(rep)s(orting)g | |
10694 | (script.)199 2481 y(3.)61 b(Optionally)-8 b(,)29 b(t)m(yp)s(e)h(`)p | |
10695 | Fs(make)g(tests)p Ft(')f(to)i(run)e(the)h(Bash)h(test)g(suite.)199 | |
10696 | 2615 y(4.)61 b(T)m(yp)s(e)36 b(`)p Fs(make)29 b(install)p | |
10697 | Ft(')35 b(to)i(install)e Fs(bash)g Ft(and)h Fs(bashbug)p | |
10698 | Ft(.)57 b(This)34 b(will)g(also)j(install)d(the)j(man)m(ual)330 | |
10699 | 2725 y(pages)31 b(and)f(Info)g(\014le.)275 2885 y(The)20 | |
10700 | b Fs(configure)f Ft(shell)g(script)h(attempts)i(to)g(guess)f(correct)i | |
10701 | (v)-5 b(alues)20 b(for)h(v)-5 b(arious)20 b(system-dep)s(enden)m(t)150 | |
10702 | 2995 y(v)-5 b(ariables)42 b(used)h(during)f(compilation.)79 | |
10703 | b(It)43 b(uses)h(those)g(v)-5 b(alues)43 b(to)h(create)h(a)g(`)p | |
10704 | Fs(Makefile)p Ft(')c(in)i(eac)m(h)150 3104 y(directory)24 | |
10705 | b(of)h(the)g(pac)m(k)-5 b(age)27 b(\(the)e(top)g(directory)-8 | |
10706 | b(,)26 b(the)f(`)p Fs(builtins)p Ft(',)f(`)p Fs(doc)p | |
10707 | Ft(',)i(and)e(`)p Fs(support)p Ft(')g(directories,)150 | |
10708 | 3214 y(eac)m(h)32 b(directory)e(under)e(`)p Fs(lib)p | |
10709 | Ft(',)j(and)f(sev)m(eral)g(others\).)42 b(It)30 b(also)h(creates)g(a)g | |
10710 | (`)p Fs(config.h)p Ft(')e(\014le)g(con)m(taining)150 | |
10711 | 3324 y(system-dep)s(enden)m(t)i(de\014nitions.)42 b(Finally)-8 | |
10712 | b(,)31 b(it)g(creates)i(a)f(shell)e(script)g(named)h | |
10713 | Fs(config.status)d Ft(that)150 3433 y(y)m(ou)k(can)g(run)e(in)g(the)h | |
10714 | (future)g(to)h(recreate)h(the)f(curren)m(t)f(con\014guration,)g(a)h | |
10715 | (\014le)f(`)p Fs(config.cache)p Ft(')d(that)150 3543 | |
10716 | y(sa)m(v)m(es)35 b(the)f(results)e(of)i(its)f(tests)i(to)f(sp)s(eed)f | |
10717 | (up)g(recon\014guring,)g(and)g(a)h(\014le)f(`)p Fs(config.log)p | |
10718 | Ft(')e(con)m(taining)150 3652 y(compiler)23 b(output)i(\(useful)e | |
10719 | (mainly)g(for)i(debugging)e Fs(configure)p Ft(\).)37 | |
10720 | b(If)24 b(at)i(some)f(p)s(oin)m(t)f(`)p Fs(config.cache)p | |
10721 | Ft(')150 3762 y(con)m(tains)31 b(results)e(y)m(ou)h(don't)h(w)m(an)m(t) | |
10722 | g(to)g(k)m(eep,)g(y)m(ou)g(ma)m(y)g(remo)m(v)m(e)h(or)e(edit)g(it.)275 | |
10723 | 3897 y(T)-8 b(o)37 b(\014nd)f(out)i(more)f(ab)s(out)h(the)f(options)g | |
10724 | (and)g(argumen)m(ts)g(that)h(the)g Fs(configure)d Ft(script)h(under-) | |
10725 | 150 4007 y(stands,)30 b(t)m(yp)s(e)390 4142 y Fs(bash-2.04$)45 | |
10726 | b(./configure)g(--help)150 4277 y Ft(at)31 b(the)g(Bash)f(prompt)g(in)f | |
10727 | (y)m(our)h(Bash)h(source)f(directory)-8 b(.)275 4412 | |
10728 | y(If)53 b(y)m(ou)h(need)f(to)i(do)e(un)m(usual)f(things)g(to)j(compile) | |
10729 | e(Bash,)59 b(please)54 b(try)f(to)i(\014gure)e(out)h(ho)m(w)150 | |
10730 | 4522 y Fs(configure)47 b Ft(could)i(c)m(hec)m(k)i(whether)e(or)g(not)h | |
10731 | (to)h(do)e(them,)55 b(and)49 b(mail)f(di\013s)g(or)i(instructions)d(to) | |
10732 | 150 4631 y Fs(bash-maintainers@gnu.org)24 b Ft(so)30 | |
10733 | b(they)h(can)g(b)s(e)e(considered)h(for)g(the)g(next)h(release.)275 | |
10734 | 4766 y(The)24 b(\014le)h(`)p Fs(configure.in)p Ft(')d(is)j(used)f(to)j | |
10735 | (create)g Fs(configure)22 b Ft(b)m(y)k(a)g(program)f(called)f(Auto)s | |
10736 | (conf.)39 b(Y)-8 b(ou)150 4876 y(only)30 b(need)g(`)p | |
10737 | Fs(configure.in)p Ft(')d(if)j(y)m(ou)g(w)m(an)m(t)i(to)f(c)m(hange)g | |
10738 | (it)f(or)g(regenerate)i Fs(configure)c Ft(using)h(a)i(new)m(er)150 | |
10739 | 4986 y(v)m(ersion)24 b(of)g(Auto)s(conf.)39 b(If)24 b(y)m(ou)h(do)f | |
10740 | (this,)h(mak)m(e)g(sure)f(y)m(ou)h(are)f(using)f(Auto)s(conf)i(v)m | |
10741 | (ersion)e(2.50)j(or)f(new)m(er.)275 5121 y(Y)-8 b(ou)29 | |
10742 | b(can)f(remo)m(v)m(e)i(the)f(program)g(binaries)d(and)i(ob)5 | |
10743 | b(ject)29 b(\014les)f(from)g(the)h(source)f(co)s(de)h(directory)f(b)m | |
10744 | (y)150 5230 y(t)m(yping)j(`)p Fs(make)e(clean)p Ft('.)42 | |
10745 | b(T)-8 b(o)32 b(also)f(remo)m(v)m(e)h(the)g(\014les)e(that)h | |
10746 | Fs(configure)e Ft(created)j(\(so)g(y)m(ou)g(can)f(compile)150 | |
10747 | 5340 y(Bash)g(for)f(a)g(di\013eren)m(t)g(kind)f(of)h(computer\),)h(t)m | |
10748 | (yp)s(e)g(`)p Fs(make)e(distclean)p Ft('.)p eop | |
10749 | %%Page: 116 122 | |
10750 | 116 121 bop 150 -116 a Ft(116)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10751 | 150 299 y Fr(10.2)68 b(Compilers)46 b(and)f(Options)275 | |
10752 | 560 y Ft(Some)40 b(systems)g(require)e(un)m(usual)g(options)h(for)h | |
10753 | (compilation)f(or)h(linking)d(that)j(the)g Fs(configure)150 | |
10754 | 669 y Ft(script)29 b(do)s(es)i(not)g(kno)m(w)f(ab)s(out.)41 | |
10755 | b(Y)-8 b(ou)31 b(can)g(giv)m(e)g Fs(configure)d Ft(initial)g(v)-5 | |
10756 | b(alues)30 b(for)g(v)-5 b(ariables)29 b(b)m(y)i(setting)150 | |
10757 | 779 y(them)21 b(in)e(the)i(en)m(vironmen)m(t.)37 b(Using)20 | |
10758 | b(a)h(Bourne-compatible)f(shell,)h(y)m(ou)g(can)g(do)f(that)i(on)e(the) | |
10759 | h(command)150 888 y(line)29 b(lik)m(e)g(this:)390 1039 | |
10760 | y Fs(CC=c89)46 b(CFLAGS=-O2)f(LIBS=-lposix)g(./configure)275 | |
10761 | 1191 y Ft(On)29 b(systems)h(that)h(ha)m(v)m(e)h(the)f | |
10762 | Fs(env)e Ft(program,)h(y)m(ou)h(can)g(do)f(it)g(lik)m(e)g(this:)390 | |
10763 | 1342 y Fs(env)47 b(CPPFLAGS=-I/usr/local/in)o(clud)o(e)42 | |
10764 | b(LDFLAGS=-s)j(./configure)275 1493 y Ft(The)29 b(con\014guration)h | |
10765 | (pro)s(cess)g(uses)g(GCC)g(to)h(build)c(Bash)k(if)e(it)h(is)g(a)m(v)-5 | |
10766 | b(ailable.)150 1792 y Fr(10.3)68 b(Compiling)46 b(F)-11 | |
10767 | b(or)45 b(Multiple)g(Arc)l(hitectures)275 2052 y Ft(Y)-8 | |
10768 | b(ou)28 b(can)h(compile)e(Bash)i(for)f(more)g(than)g(one)h(kind)d(of)j | |
10769 | (computer)f(at)h(the)g(same)f(time,)h(b)m(y)f(placing)150 | |
10770 | 2162 y(the)39 b(ob)5 b(ject)39 b(\014les)f(for)g(eac)m(h)i(arc)m | |
10771 | (hitecture)f(in)e(their)h(o)m(wn)g(directory)-8 b(.)66 | |
10772 | b(T)-8 b(o)39 b(do)f(this,)i(y)m(ou)f(m)m(ust)f(use)h(a)150 | |
10773 | 2271 y(v)m(ersion)32 b(of)h Fs(make)f Ft(that)i(supp)s(orts)d(the)i | |
10774 | Fs(VPATH)e Ft(v)-5 b(ariable,)33 b(suc)m(h)f(as)i(GNU)f | |
10775 | Fs(make)p Ft(.)47 b Fs(cd)33 b Ft(to)g(the)g(directory)150 | |
10776 | 2381 y(where)23 b(y)m(ou)g(w)m(an)m(t)h(the)f(ob)5 b(ject)24 | |
10777 | b(\014les)e(and)g(executables)i(to)g(go)f(and)g(run)f(the)h | |
10778 | Fs(configure)d Ft(script)i(from)h(the)150 2491 y(source)j(directory)-8 | |
10779 | b(.)39 b(Y)-8 b(ou)26 b(ma)m(y)g(need)g(to)g(supply)e(the)h(`)p | |
10780 | Fs(--srcdir=PATH)p Ft(')e(argumen)m(t)j(to)h(tell)d Fs(configure)150 | |
10781 | 2600 y Ft(where)43 b(the)h(source)g(\014les)f(are.)82 | |
10782 | b Fs(configure)41 b Ft(automatically)j(c)m(hec)m(ks)h(for)f(the)g | |
10783 | (source)g(co)s(de)g(in)f(the)150 2710 y(directory)30 | |
10784 | b(that)h Fs(configure)d Ft(is)h(in)g(and)h(in)f(`..'.)275 | |
10785 | 2861 y(If)20 b(y)m(ou)h(ha)m(v)m(e)i(to)e(use)g(a)g Fs(make)f | |
10786 | Ft(that)i(do)s(es)e(not)i(supp)s(orts)d(the)i Fs(VPATH)e | |
10787 | Ft(v)-5 b(ariable,)22 b(y)m(ou)g(can)f(compile)f(Bash)150 | |
10788 | 2971 y(for)33 b(one)h(arc)m(hitecture)g(at)g(a)g(time)f(in)f(the)i | |
10789 | (source)g(co)s(de)f(directory)-8 b(.)50 b(After)34 b(y)m(ou)g(ha)m(v)m | |
10790 | (e)h(installed)c(Bash)150 3080 y(for)f(one)h(arc)m(hitecture,)g(use)f | |
10791 | (`)p Fs(make)g(distclean)p Ft(')e(b)s(efore)i(recon\014guring)f(for)h | |
10792 | (another)g(arc)m(hitecture.)275 3231 y(Alternativ)m(ely)-8 | |
10793 | b(,)23 b(if)d(y)m(our)i(system)g(supp)s(orts)d(sym)m(b)s(olic)h(links,) | |
10794 | i(y)m(ou)g(can)g(use)f(the)h(`)p Fs(support/mkclone)p | |
10795 | Ft(')150 3341 y(script)g(to)i(create)g(a)f(build)d(tree)k(whic)m(h)e | |
10796 | (has)g(sym)m(b)s(olic)g(links)e(bac)m(k)k(to)g(eac)m(h)g(\014le)e(in)g | |
10797 | (the)h(source)g(directory)-8 b(.)150 3450 y(Here's)41 | |
10798 | b(an)f(example)h(that)g(creates)h(a)e(build)e(directory)i(in)f(the)i | |
10799 | (curren)m(t)f(directory)g(from)g(a)h(source)150 3560 | |
10800 | y(directory)30 b(`)p Fs(/usr/gnu/src/bash-2.0)p Ft(':)390 | |
10801 | 3711 y Fs(bash)47 b(/usr/gnu/src/bash-2.0/s)o(uppo)o(rt/)o(mkcl)o(one) | |
10802 | 41 b(-s)47 b(/usr/gnu/src/bash-2.0)42 b(.)150 3862 y | |
10803 | Ft(The)c Fs(mkclone)e Ft(script)h(requires)g(Bash,)j(so)f(y)m(ou)f(m)m | |
10804 | (ust)h(ha)m(v)m(e)g(already)f(built)e(Bash)i(for)g(at)h(least)g(one)150 | |
10805 | 3972 y(arc)m(hitecture)31 b(b)s(efore)f(y)m(ou)h(can)f(create)i(build)c | |
10806 | (directories)h(for)h(other)h(arc)m(hitectures.)150 4271 | |
10807 | y Fr(10.4)68 b(Installation)47 b(Names)275 4531 y Ft(By)36 | |
10808 | b(default,)g(`)p Fs(make)29 b(install)p Ft(')34 b(will)g(install)f(in)m | |
10809 | (to)j(`)p Fs(/usr/local/bin)p Ft(',)e(`)p Fs(/usr/local/man)p | |
10810 | Ft(',)g(etc.)150 4641 y(Y)-8 b(ou)39 b(can)g(sp)s(ecify)e(an)i | |
10811 | (installation)d(pre\014x)h(other)i(than)g(`)p Fs(/usr/local)p | |
10812 | Ft(')d(b)m(y)i(giving)g Fs(configure)e Ft(the)150 4751 | |
10813 | y(option)k(`)p Fs(--prefix=)p Fj(PATH)11 b Ft(',)41 b(or)g(b)m(y)f(sp)s | |
10814 | (ecifying)f(a)j(v)-5 b(alue)40 b(for)h(the)g Fs(DESTDIR)e | |
10815 | Ft(`)p Fs(make)p Ft(')h(v)-5 b(ariable)40 b(when)150 | |
10816 | 4860 y(running)28 b(`)p Fs(make)h(install)p Ft('.)275 | |
10817 | 5011 y(Y)-8 b(ou)71 b(can)h(sp)s(ecify)e(separate)i(installation)d | |
10818 | (pre\014xes)h(for)h(arc)m(hitecture-sp)s(eci\014c)g(\014les)g(and)150 | |
10819 | 5121 y(arc)m(hitecture-indep)s(enden)m(t)36 b(\014les.)61 | |
10820 | b(If)37 b(y)m(ou)h(giv)m(e)f Fs(configure)e Ft(the)j(option)f(`)p | |
10821 | Fs(--exec-prefix=)p Fj(PATH)11 b Ft(',)150 5230 y(`)p | |
10822 | Fs(make)29 b(install)p Ft(')63 b(will)e(use)i Fq(P)-8 | |
10823 | b(A)g(TH)75 b Ft(as)64 b(the)g(pre\014x)e(for)i(installing)d(programs)i | |
10824 | (and)h(libraries.)150 5340 y(Do)s(cumen)m(tation)31 b(and)f(other)h | |
10825 | (data)g(\014les)e(will)f(still)g(use)i(the)h(regular)e(pre\014x.)p | |
10826 | eop | |
10827 | %%Page: 117 123 | |
10828 | 117 122 bop 150 -116 a Ft(Chapter)30 b(10:)41 b(Installing)28 | |
10829 | b(Bash)2356 b(117)150 299 y Fr(10.5)68 b(Sp)t(ecifying)45 | |
10830 | b(the)g(System)h(T)l(yp)t(e)275 539 y Ft(There)35 b(ma)m(y)h(b)s(e)f | |
10831 | (some)h(features)g Fs(configure)d Ft(can)j(not)g(\014gure)f(out)g | |
10832 | (automatically)-8 b(,)38 b(but)d(need)g(to)150 649 y(determine)g(b)m(y) | |
10833 | h(the)h(t)m(yp)s(e)f(of)g(host)h(Bash)f(will)e(run)g(on.)58 | |
10834 | b(Usually)35 b Fs(configure)f Ft(can)i(\014gure)g(that)g(out,)150 | |
10835 | 758 y(but)c(if)g(it)g(prin)m(ts)g(a)h(message)h(sa)m(ying)f(it)f(can)i | |
10836 | (not)f(guess)g(the)g(host)g(t)m(yp)s(e,)h(giv)m(e)f(it)f(the)h(`)p | |
10837 | Fs(--host=TYPE)p Ft(')150 868 y(option.)38 b(`)p Fs(TYPE)p | |
10838 | Ft(')25 b(can)g(either)f(b)s(e)h(a)g(short)g(name)g(for)g(the)g(system) | |
10839 | g(t)m(yp)s(e,)h(suc)m(h)f(as)g(`)p Fs(sun4)p Ft(',)h(or)f(a)g | |
10840 | (canonical)150 977 y(name)30 b(with)f(three)i(\014elds:)39 | |
10841 | b(`)p Fs(CPU-COMPANY-SYSTEM)p Ft(')26 b(\(e.g.,)32 b(`)p | |
10842 | Fs(i386-unknown-freebsd4.2)p Ft('\).)275 1108 y(See)e(the)h(\014le)e(`) | |
10843 | p Fs(support/config.sub)p Ft(')d(for)k(the)h(p)s(ossible)d(v)-5 | |
10844 | b(alues)29 b(of)i(eac)m(h)g(\014eld.)150 1354 y Fr(10.6)68 | |
10845 | b(Sharing)45 b(Defaults)275 1594 y Ft(If)34 b(y)m(ou)i(w)m(an)m(t)g(to) | |
10846 | g(set)g(default)e(v)-5 b(alues)35 b(for)g Fs(configure)e | |
10847 | Ft(scripts)h(to)i(share,)g(y)m(ou)g(can)g(create)g(a)g(site)150 | |
10848 | 1704 y(shell)46 b(script)g(called)h Fs(config.site)d | |
10849 | Ft(that)k(giv)m(es)g(default)f(v)-5 b(alues)47 b(for)g(v)-5 | |
10850 | b(ariables)46 b(lik)m(e)h Fs(CC)p Ft(,)52 b Fs(cache_)150 | |
10851 | 1813 y(file)p Ft(,)43 b(and)e Fs(prefix)p Ft(.)73 b Fs(configure)39 | |
10852 | b Ft(lo)s(oks)i(for)g(`)p Fs(PREFIX/share/config.site)p | |
10853 | Ft(')35 b(if)41 b(it)g(exists,)j(then)150 1923 y(`)p | |
10854 | Fs(PREFIX/etc/config.site)p Ft(')20 b(if)25 b(it)g(exists.)39 | |
10855 | b(Or,)26 b(y)m(ou)g(can)g(set)g(the)g Fs(CONFIG_SITE)c | |
10856 | Ft(en)m(vironmen)m(t)j(v)-5 b(ari-)150 2033 y(able)39 | |
10857 | b(to)h(the)g(lo)s(cation)f(of)g(the)h(site)f(script.)66 | |
10858 | b(A)40 b(w)m(arning:)57 b(the)40 b(Bash)g Fs(configure)c | |
10859 | Ft(lo)s(oks)j(for)g(a)h(site)150 2142 y(script,)30 b(but)f(not)i(all)e | |
10860 | Fs(configure)f Ft(scripts)h(do.)150 2388 y Fr(10.7)68 | |
10861 | b(Op)t(eration)46 b(Con)l(trols)275 2628 y Fs(configure)27 | |
10862 | b Ft(recognizes)k(the)g(follo)m(wing)e(options)h(to)h(con)m(trol)f(ho)m | |
10863 | (w)h(it)f(op)s(erates.)150 2780 y Fs(--cache-file=)p | |
10864 | Fj(file)630 2890 y Ft(Use)35 b(and)g(sa)m(v)m(e)h(the)f(results)f(of)h | |
10865 | (the)h(tests)f(in)f Fq(\014le)39 b Ft(instead)34 b(of)i(`)p | |
10866 | Fs(./config.cache)p Ft('.)51 b(Set)630 2999 y Fq(\014le)35 | |
10867 | b Ft(to)c(`)p Fs(/dev/null)p Ft(')d(to)j(disable)e(cac)m(hing,)i(for)f | |
10868 | (debugging)f Fs(configure)p Ft(.)150 3151 y Fs(--help)192 | |
10869 | b Ft(Prin)m(t)29 b(a)i(summary)e(of)i(the)f(options)g(to)h | |
10870 | Fs(configure)p Ft(,)d(and)i(exit.)150 3303 y Fs(--quiet)150 | |
10871 | 3412 y(--silent)150 3522 y(-q)384 b Ft(Do)31 b(not)g(prin)m(t)e | |
10872 | (messages)i(sa)m(ying)f(whic)m(h)g(c)m(hec)m(ks)h(are)g(b)s(eing)e | |
10873 | (made.)150 3674 y Fs(--srcdir=)p Fj(dir)630 3783 y Ft(Lo)s(ok)j(for)g | |
10874 | (the)g(Bash)g(source)h(co)s(de)f(in)f(directory)g Fq(dir)p | |
10875 | Ft(.)44 b(Usually)31 b Fs(configure)e Ft(can)j(deter-)630 | |
10876 | 3893 y(mine)d(that)i(directory)f(automatically)-8 b(.)150 | |
10877 | 4045 y Fs(--version)630 4154 y Ft(Prin)m(t)28 b(the)i(v)m(ersion)f(of)h | |
10878 | (Auto)s(conf)f(used)g(to)h(generate)h(the)f Fs(configure)d | |
10879 | Ft(script,)i(and)g(exit.)275 4306 y Fs(configure)34 b | |
10880 | Ft(also)j(accepts)h(some)g(other,)h(not)e(widely)e(used,)j(b)s | |
10881 | (oilerplate)d(options.)60 b(`)p Fs(configure)150 4415 | |
10882 | y(--help)p Ft(')29 b(prin)m(ts)g(the)h(complete)h(list.)150 | |
10883 | 4661 y Fr(10.8)68 b(Optional)46 b(F)-11 b(eatures)275 | |
10884 | 4902 y Ft(The)34 b(Bash)h Fs(configure)d Ft(has)j(a)g(n)m(um)m(b)s(er)f | |
10885 | (of)h(`)p Fs(--enable-)p Fj(feature)11 b Ft(')30 b(options,)36 | |
10886 | b(where)f Fq(feature)40 b Ft(in-)150 5011 y(dicates)32 | |
10887 | b(an)g(optional)f(part)h(of)g(Bash.)45 b(There)32 b(are)g(also)g(sev)m | |
10888 | (eral)g(`)p Fs(--with-)p Fj(package)11 b Ft(')29 b(options,)i(where)150 | |
10889 | 5121 y Fq(pac)m(k)-5 b(age)35 b Ft(is)27 b(something)h(lik)m(e)g(`)p | |
10890 | Fs(bash-malloc)p Ft(')d(or)j(`)p Fs(purify)p Ft('.)39 | |
10891 | b(T)-8 b(o)29 b(turn)e(o\013)h(the)h(default)e(use)h(of)g(a)h(pac)m(k-) | |
10892 | 150 5230 y(age,)43 b(use)d(`)p Fs(--without-)p Fj(package)11 | |
10893 | b Ft('.)63 b(T)-8 b(o)40 b(con\014gure)g(Bash)f(without)g(a)h(feature)g | |
10894 | (that)g(is)f(enabled)f(b)m(y)150 5340 y(default,)30 b(use)g(`)p | |
10895 | Fs(--disable-)p Fj(feature)11 b Ft('.)p eop | |
10896 | %%Page: 118 124 | |
10897 | 118 123 bop 150 -116 a Ft(118)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
10898 | 275 299 y(Here)21 b(is)f(a)h(complete)g(list)f(of)h(the)g(`)p | |
10899 | Fs(--enable-)p Ft(')e(and)h(`)p Fs(--with-)p Ft(')g(options)g(that)h | |
10900 | (the)g(Bash)g Fs(configure)150 408 y Ft(recognizes.)150 | |
10901 | 589 y Fs(--with-afs)630 698 y Ft(De\014ne)31 b(if)e(y)m(ou)i(are)f | |
10902 | (using)f(the)i(Andrew)e(File)h(System)g(from)g(T)-8 b(ransarc.)150 | |
10903 | 872 y Fs(--with-bash-malloc)630 981 y Ft(Use)40 b(the)f(Bash)h(v)m | |
10904 | (ersion)f(of)g Fs(malloc)f Ft(in)g(`)p Fs(lib/malloc/malloc.c)p | |
10905 | Ft('.)63 b(This)38 b(is)g(not)i(the)630 1091 y(same)34 | |
10906 | b Fs(malloc)f Ft(that)h(app)s(ears)f(in)g Fl(gnu)h Ft(lib)s(c,)f(but)g | |
10907 | (an)h(older)f(v)m(ersion)g(deriv)m(ed)g(from)h(the)630 | |
10908 | 1200 y(4.2)45 b Fl(bsd)d Fs(malloc)p Ft(.)79 b(This)41 | |
10909 | b Fs(malloc)h Ft(is)h(v)m(ery)h(fast,)j(but)c(w)m(astes)h(some)g(space) | |
10910 | g(on)g(eac)m(h)630 1310 y(allo)s(cation.)39 b(This)27 | |
10911 | b(option)g(is)h(enabled)f(b)m(y)h(default.)39 b(The)28 | |
10912 | b(`)p Fs(NOTES)p Ft(')f(\014le)h(con)m(tains)g(a)h(list)e(of)630 | |
10913 | 1419 y(systems)e(for)h(whic)m(h)e(this)g(should)f(b)s(e)i(turned)f | |
10914 | (o\013,)j(and)e Fs(configure)e Ft(disables)g(this)h(option)630 | |
10915 | 1529 y(automatically)30 b(for)g(a)h(n)m(um)m(b)s(er)e(of)i(systems.)150 | |
10916 | 1702 y Fs(--with-curses)630 1812 y Ft(Use)h(the)h(curses)e(library)f | |
10917 | (instead)h(of)i(the)f(termcap)g(library)-8 b(.)44 b(This)31 | |
10918 | b(should)f(b)s(e)h(supplied)630 1921 y(if)e(y)m(our)i(system)f(has)g | |
10919 | (an)h(inadequate)f(or)g(incomplete)g(termcap)g(database.)150 | |
10920 | 2095 y Fs(--with-gnu-malloc)630 2204 y Ft(A)g(synon)m(ym)g(for)g | |
10921 | Fs(--with-bash-malloc)p Ft(.)150 2378 y Fs(--with-installed-readlin)o | |
10922 | (e[=)p Fj(P)o(REFI)o(X)11 b Fs(])630 2487 y Ft(De\014ne)26 | |
10923 | b(this)e(to)i(mak)m(e)h(Bash)f(link)d(with)h(a)i(lo)s(cally-installed)c | |
10924 | (v)m(ersion)j(of)h(Readline)e(rather)630 2597 y(than)38 | |
10925 | b(the)h(v)m(ersion)f(in)g(`)p Fs(lib/readline)p Ft('.)62 | |
10926 | b(This)37 b(w)m(orks)i(only)e(with)h(Readline)f(4.3)j(and)630 | |
10927 | 2706 y(later)28 b(v)m(ersions.)39 b(If)28 b Fq(PREFIX)37 | |
10928 | b Ft(is)27 b Fs(yes)g Ft(or)h(not)g(supplied,)d Fs(configure)h | |
10929 | Ft(uses)h(the)h(v)-5 b(alues)28 b(of)630 2816 y(the)d(mak)m(e)g(v)-5 | |
10930 | b(ariables)23 b Fs(includedir)f Ft(and)h Fs(libdir)p | |
10931 | Ft(,)h(whic)m(h)g(are)g(sub)s(directories)e(of)j Fs(prefix)630 | |
10932 | 2926 y Ft(b)m(y)32 b(default,)f(to)i(\014nd)d(the)i(installed)e(v)m | |
10933 | (ersion)h(of)h(Readline)f(if)g(it)g(is)g(not)h(in)f(the)h(standard)630 | |
10934 | 3035 y(system)j(include)d(and)i(library)e(directories.)52 | |
10935 | b(If)34 b Fq(PREFIX)43 b Ft(is)34 b Fs(no)p Ft(,)h(Bash)f(links)f(with) | |
10936 | g(the)630 3145 y(v)m(ersion)k(in)f(`)p Fs(lib/readline)p | |
10937 | Ft('.)58 b(If)37 b Fq(PREFIX)46 b Ft(is)37 b(set)h(to)g(an)m(y)f(other) | |
10938 | h(v)-5 b(alue,)38 b Fs(configure)630 3254 y Ft(treats)27 | |
10939 | b(it)f(as)g(a)h(directory)f(pathname)g(and)f(lo)s(oks)h(for)g(the)g | |
10940 | (installed)e(v)m(ersion)i(of)g(Readline)630 3364 y(in)33 | |
10941 | b(sub)s(directories)e(of)j(that)h(directory)f(\(include)e(\014les)h(in) | |
10942 | g Fq(PREFIX)9 b Ft(/)p Fs(include)32 b Ft(and)i(the)630 | |
10943 | 3473 y(library)28 b(in)h Fq(PREFIX)9 b Ft(/)p Fs(lib)p | |
10944 | Ft(\).)150 3647 y Fs(--with-purify)630 3756 y Ft(De\014ne)23 | |
10945 | b(this)f(to)i(use)f(the)g(Purify)e(memory)i(allo)s(cation)f(c)m(hec)m | |
10946 | (k)m(er)j(from)e(Rational)g(Soft)m(w)m(are.)150 3930 | |
10947 | y Fs(--enable-minimal-config)630 4039 y Ft(This)f(pro)s(duces)g(a)i | |
10948 | (shell)e(with)g(minimal)f(features,)k(close)f(to)g(the)g(historical)e | |
10949 | (Bourne)h(shell.)275 4219 y(There)g(are)i(sev)m(eral)f(`)p | |
10950 | Fs(--enable-)p Ft(')e(options)i(that)g(alter)g(ho)m(w)h(Bash)f(is)f | |
10951 | (compiled)g(and)g(link)m(ed,)h(rather)150 4329 y(than)30 | |
10952 | b(c)m(hanging)g(run-time)f(features.)150 4509 y Fs(--enable-largefile) | |
10953 | 630 4619 y Ft(Enable)75 b(supp)s(ort)g(for)h(large)g(\014les)f(\()p | |
10954 | Fs(http://www.sas.com/standar)o(ds/l)o(arge)o(_)630 4728 | |
10955 | y(file/x_open.20Mar96.html)o Ft(\))23 b(if)k(the)h(op)s(erating)g | |
10956 | (system)g(requires)f(sp)s(ecial)f(compiler)630 4838 y(options)44 | |
10957 | b(to)h(build)c(programs)j(whic)m(h)f(can)h(access)i(large)e(\014les.)81 | |
10958 | b(This)43 b(is)g(enabled)g(b)m(y)630 4948 y(default,)30 | |
10959 | b(if)f(the)i(op)s(erating)f(system)g(pro)m(vides)f(large)i(\014le)e | |
10960 | (supp)s(ort.)150 5121 y Fs(--enable-profiling)630 5230 | |
10961 | y Ft(This)h(builds)e(a)k(Bash)g(binary)e(that)i(pro)s(duces)e | |
10962 | (pro\014ling)f(information)h(to)j(b)s(e)d(pro)s(cessed)630 | |
10963 | 5340 y(b)m(y)g Fs(gprof)f Ft(eac)m(h)j(time)e(it)g(is)f(executed.)p | |
10964 | eop | |
10965 | %%Page: 119 125 | |
10966 | 119 124 bop 150 -116 a Ft(Chapter)30 b(10:)41 b(Installing)28 | |
10967 | b(Bash)2356 b(119)150 299 y Fs(--enable-static-link)630 | |
10968 | 408 y Ft(This)36 b(causes)i(Bash)f(to)h(b)s(e)f(link)m(ed)f(statically) | |
10969 | -8 b(,)40 b(if)c Fs(gcc)h Ft(is)f(b)s(eing)g(used.)61 | |
10970 | b(This)36 b(could)h(b)s(e)630 518 y(used)30 b(to)h(build)c(a)k(v)m | |
10971 | (ersion)f(to)h(use)f(as)g(ro)s(ot's)h(shell.)275 663 | |
10972 | y(The)f(`)p Fs(minimal-config)p Ft(')d(option)j(can)h(b)s(e)f(used)f | |
10973 | (to)j(disable)c(all)i(of)h(the)f(follo)m(wing)f(options,)i(but)e(it)150 | |
10974 | 772 y(is)g(pro)s(cessed)h(\014rst,)g(so)h(individual)26 | |
10975 | b(options)j(ma)m(y)i(b)s(e)f(enabled)f(using)g(`)p Fs(enable-)p | |
10976 | Fj(feature)11 b Ft('.)275 899 y(All)35 b(of)i(the)f(follo)m(wing)f | |
10977 | (options)h(except)i(for)e(`)p Fs(disabled-builtins)p | |
10978 | Ft(')d(and)j(`)p Fs(xpg-echo-default)p Ft(')150 1009 | |
10979 | y(are)26 b(enabled)f(b)m(y)h(default,)g(unless)f(the)h(op)s(erating)f | |
10980 | (system)h(do)s(es)g(not)g(pro)m(vide)f(the)h(necessary)g(supp)s(ort.) | |
10981 | 150 1154 y Fs(--enable-alias)630 1263 y Ft(Allo)m(w)39 | |
10982 | b(alias)g(expansion)g(and)g(include)e(the)j Fs(alias)f | |
10983 | Ft(and)g Fs(unalias)e Ft(builtins)g(\(see)j(Sec-)630 | |
10984 | 1373 y(tion)30 b(6.6)h([Aliases],)g(page)g(71\).)150 | |
10985 | 1518 y Fs(--enable-arith-for-comma)o(nd)630 1627 y Ft(Include)20 | |
10986 | b(supp)s(ort)h(for)g(the)i(alternate)f(form)g(of)g(the)g | |
10987 | Fs(for)f Ft(command)h(that)h(b)s(eha)m(v)m(es)f(lik)m(e)g(the)630 | |
10988 | 1737 y(C)30 b(language)h Fs(for)e Ft(statemen)m(t)j(\(see)g(Section)e | |
10989 | (3.2.4.1)j([Lo)s(oping)c(Constructs],)i(page)g(9\).)150 | |
10990 | 1881 y Fs(--enable-array-variables)630 1991 y Ft(Include)g(supp)s(ort)h | |
10991 | (for)h(one-dimensional)e(arra)m(y)i(shell)f(v)-5 b(ariables)31 | |
10992 | b(\(see)j(Section)f(6.7)i([Ar-)630 2101 y(ra)m(ys],)c(page)g(72\).)150 | |
10993 | 2245 y Fs(--enable-bang-history)630 2355 y Ft(Include)k(supp)s(ort)g | |
10994 | (for)h Fs(csh)p Ft(-lik)m(e)f(history)h(substitution)e(\(see)j(Section) | |
10995 | f(9.3)i([History)e(In-)630 2464 y(teraction],)c(page)f(111\).)150 | |
10996 | 2609 y Fs(--enable-brace-expansion)630 2719 y Ft(Include)39 | |
10997 | b Fs(csh)p Ft(-lik)m(e)g(brace)h(expansion)f(\()i Fs(b{a,b}c)2445 | |
10998 | 2715 y Fp(7!)2576 2719 y Fs(bac)30 b(bbc)39 b Ft(\).)71 | |
10999 | b(See)40 b(Section)g(3.5.1)630 2828 y([Brace)32 b(Expansion],)d(page)i | |
11000 | (17,)h(for)e(a)g(complete)h(description.)150 2973 y Fs | |
11001 | (--enable-command-timing)630 3082 y Ft(Include)42 b(supp)s(ort)g(for)h | |
11002 | (recognizing)g Fs(time)g Ft(as)g(a)h(reserv)m(ed)g(w)m(ord)f(and)g(for) | |
11003 | h(displa)m(ying)630 3192 y(timing)35 b(statistics)h(for)g(the)g(pip)s | |
11004 | (eline)d(follo)m(wing)i Fs(time)g Ft(\(see)i(Section)f(3.2.2)i([Pip)s | |
11005 | (elines],)630 3302 y(page)24 b(8\).)39 b(This)22 b(allo)m(ws)g(pip)s | |
11006 | (elines)e(as)k(w)m(ell)e(as)i(shell)d(builtins)f(and)j(functions)f(to)i | |
11007 | (b)s(e)e(timed.)150 3446 y Fs(--enable-cond-command)630 | |
11008 | 3556 y Ft(Include)32 b(supp)s(ort)g(for)i(the)g Fs([[)f | |
11009 | Ft(conditional)f(command.)51 b(\(see)34 b(Section)g(3.2.4.2)i([Condi-) | |
11010 | 630 3665 y(tional)30 b(Constructs],)g(page)h(10\).)150 | |
11011 | 3810 y Fs(--enable-cond-regexp)630 3920 y Ft(Include)e(supp)s(ort)g | |
11012 | (for)i(matc)m(hing)g(POSIX)e(regular)h(expressions)g(using)f(the)i(`)p | |
11013 | Fs(=~)p Ft(')g(binary)630 4029 y(op)s(erator)25 b(in)e(the)i | |
11014 | Fs([[)f Ft(conditional)e(command.)39 b(\(see)25 b(Section)g(3.2.4.2)i | |
11015 | ([Conditional)22 b(Con-)630 4139 y(structs],)31 b(page)g(10\).)150 | |
11016 | 4284 y Fs(--enable-directory-stack)630 4393 y Ft(Include)h(supp)s(ort)h | |
11017 | (for)h(a)g Fs(csh)p Ft(-lik)m(e)f(directory)g(stac)m(k)j(and)d(the)i | |
11018 | Fs(pushd)p Ft(,)f Fs(popd)p Ft(,)g(and)f Fs(dirs)630 | |
11019 | 4503 y Ft(builtins)27 b(\(see)k(Section)f(6.8)i([The)e(Directory)h | |
11020 | (Stac)m(k],)h(page)f(73\).)150 4647 y Fs(--enable-disabled-builti)o(ns) | |
11021 | 630 4757 y Ft(Allo)m(w)38 b(builtin)d(commands)j(to)h(b)s(e)f(in)m(v)m | |
11022 | (ok)m(ed)h(via)f(`)p Fs(builtin)29 b(xxx)p Ft(')37 b(ev)m(en)j(after)f | |
11023 | Fs(xxx)e Ft(has)630 4867 y(b)s(een)31 b(disabled)e(using)h(`)p | |
11024 | Fs(enable)e(-n)i(xxx)p Ft('.)43 b(See)32 b(Section)f(4.2)i([Bash)e | |
11025 | (Builtins],)f(page)i(39,)630 4976 y(for)e(details)g(of)g(the)h | |
11026 | Fs(builtin)d Ft(and)i Fs(enable)e Ft(builtin)f(commands.)150 | |
11027 | 5121 y Fs(--enable-dparen-arithmet)o(ic)630 5230 y Ft(Include)41 | |
11028 | b(supp)s(ort)g(for)h(the)h Fs(\(\(...)o(\)\))f Ft(command)g(\(see)i | |
11029 | (Section)e(3.2.4.2)j([Conditional)630 5340 y(Constructs],)30 | |
11030 | b(page)h(10\).)p eop | |
11031 | %%Page: 120 126 | |
11032 | 120 125 bop 150 -116 a Ft(120)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
11033 | 150 299 y Fs(--enable-extended-glob)630 408 y Ft(Include)39 | |
11034 | b(supp)s(ort)f(for)i(the)h(extended)f(pattern)h(matc)m(hing)f(features) | |
11035 | h(describ)s(ed)d(ab)s(o)m(v)m(e)630 518 y(under)29 b(Section)h(3.5.8.1) | |
11036 | j([P)m(attern)e(Matc)m(hing],)h(page)f(23.)150 682 y | |
11037 | Fs(--enable-help-builtin)630 792 y Ft(Include)23 b(the)i | |
11038 | Fs(help)f Ft(builtin,)e(whic)m(h)i(displa)m(ys)e(help)i(on)g(shell)f | |
11039 | (builtins)e(and)k(v)-5 b(ariables)23 b(\(see)630 902 | |
11040 | y(Section)30 b(4.2)i([Bash)e(Builtins],)f(page)i(39\).)150 | |
11041 | 1066 y Fs(--enable-history)630 1176 y Ft(Include)d(command)h(history)g | |
11042 | (and)g(the)h Fs(fc)f Ft(and)g Fs(history)e Ft(builtin)g(commands)i | |
11043 | (\(see)h(Sec-)630 1285 y(tion)g(9.1)h([Bash)g(History)f(F)-8 | |
11044 | b(acilities],)30 b(page)h(109\).)150 1450 y Fs(--enable-job-control)630 | |
11045 | 1559 y Ft(This)d(enables)i(the)g(job)g(con)m(trol)g(features)h(\(see)g | |
11046 | (Chapter)f(7)g([Job)g(Con)m(trol],)g(page)h(79\),)h(if)630 | |
11047 | 1669 y(the)f(op)s(erating)e(system)i(supp)s(orts)d(them.)150 | |
11048 | 1833 y Fs(--enable-multibyte)630 1943 y Ft(This)g(enables)i(supp)s(ort) | |
11049 | e(for)i(m)m(ultib)m(yte)f(c)m(haracters)i(if)e(the)h(op)s(erating)g | |
11050 | (system)g(pro)m(vides)630 2052 y(the)h(necessary)f(supp)s(ort.)150 | |
11051 | 2217 y Fs(--enable-net-redirection)o(s)630 2326 y Ft(This)20 | |
11052 | b(enables)h(the)h(sp)s(ecial)f(handling)e(of)j(\014lenames)f(of)h(the)g | |
11053 | (form)f Fs(/dev/tcp/)p Fj(host)11 b Fs(/)p Fj(port)630 | |
11054 | 2436 y Ft(and)29 b Fs(/dev/udp/)p Fj(host)11 b Fs(/)p | |
11055 | Fj(port)34 b Ft(when)28 b(used)g(in)g(redirections)g(\(see)i(Section)f | |
11056 | (3.6)h([Redirec-)630 2545 y(tions],)g(page)h(24\).)150 | |
11057 | 2710 y Fs(--enable-process-substit)o(utio)o(n)630 2819 | |
11058 | y Ft(This)48 b(enables)i(pro)s(cess)g(substitution)e(\(see)j(Section)f | |
11059 | (3.5.6)i([Pro)s(cess)e(Substitution],)630 2929 y(page)31 | |
11060 | b(22\))h(if)d(the)i(op)s(erating)e(system)i(pro)m(vides)e(the)i | |
11061 | (necessary)g(supp)s(ort.)150 3093 y Fs(--enable-prompt-string-d)o(ecod) | |
11062 | o(ing)630 3203 y Ft(T)-8 b(urn)46 b(on)h(the)h(in)m(terpretation)e(of)i | |
11063 | (a)g(n)m(um)m(b)s(er)e(of)h(bac)m(kslash-escap)s(ed)g(c)m(haracters)i | |
11064 | (in)630 3313 y(the)39 b Fs($PS1)p Ft(,)g Fs($PS2)p Ft(,)h | |
11065 | Fs($PS3)p Ft(,)f(and)f Fs($PS4)f Ft(prompt)h(strings.)63 | |
11066 | b(See)39 b(Section)f(6.9)i([Prin)m(ting)d(a)630 3422 | |
11067 | y(Prompt],)30 b(page)h(75,)h(for)e(a)h(complete)g(list)e(of)h(prompt)g | |
11068 | (string)f(escap)s(e)i(sequences.)150 3587 y Fs(--enable-progcomp)630 | |
11069 | 3696 y Ft(Enable)c(the)h(programmable)f(completion)h(facilities)e | |
11070 | (\(see)j(Section)f(8.6)h([Programmable)630 3806 y(Completion],)g(page)j | |
11071 | (103\).)42 b(If)30 b(Readline)f(is)g(not)i(enabled,)e(this)h(option)g | |
11072 | (has)g(no)g(e\013ect.)150 3970 y Fs(--enable-readline)630 | |
11073 | 4080 y Ft(Include)d(supp)s(ort)g(for)h(command-line)f(editing)g(and)h | |
11074 | (history)f(with)g(the)i(Bash)g(v)m(ersion)f(of)630 4189 | |
11075 | y(the)j(Readline)e(library)f(\(see)j(Chapter)f(8)g([Command)g(Line)f | |
11076 | (Editing],)g(page)i(83\).)150 4354 y Fs(--enable-restricted)630 | |
11077 | 4463 y Ft(Include)40 b(supp)s(ort)g(for)i(a)g Fq(restricted)f(shell)p | |
11078 | Ft(.)73 b(If)42 b(this)e(is)h(enabled,)j(Bash,)h(when)c(called)630 | |
11079 | 4573 y(as)f Fs(rbash)p Ft(,)h(en)m(ters)f(a)g(restricted)g(mo)s(de.)68 | |
11080 | b(See)40 b(Section)g(6.10)h([The)f(Restricted)g(Shell],)630 | |
11081 | 4682 y(page)31 b(76,)h(for)e(a)g(description)f(of)h(restricted)g(mo)s | |
11082 | (de.)150 4847 y Fs(--enable-select)630 4956 y Ft(Include)k(the)h | |
11083 | Fs(select)f Ft(builtin,)f(whic)m(h)h(allo)m(ws)h(the)h(generation)f(of) | |
11084 | h(simple)d(men)m(us)i(\(see)630 5066 y(Section)30 b(3.2.4.2)j | |
11085 | ([Conditional)28 b(Constructs],)j(page)g(10\).)150 5230 | |
11086 | y Fs(--enable-usg-echo-defaul)o(t)630 5340 y Ft(A)f(synon)m(ym)g(for)g | |
11087 | Fs(--enable-xpg-echo-default)p Ft(.)p eop | |
11088 | %%Page: 121 127 | |
11089 | 121 126 bop 150 -116 a Ft(Chapter)30 b(10:)41 b(Installing)28 | |
11090 | b(Bash)2356 b(121)150 299 y Fs(--enable-xpg-echo-defaul)o(t)630 | |
11091 | 408 y Ft(Mak)m(e)26 b(the)f Fs(echo)e Ft(builtin)f(expand)i(bac)m | |
11092 | (kslash-escap)s(ed)g(c)m(haracters)i(b)m(y)f(default,)g(without)630 | |
11093 | 518 y(requiring)39 b(the)i(`)p Fs(-e)p Ft(')g(option.)72 | |
11094 | b(This)40 b(sets)h(the)g(default)g(v)-5 b(alue)40 b(of)i(the)f | |
11095 | Fs(xpg_echo)e Ft(shell)630 628 y(option)25 b(to)h Fs(on)p | |
11096 | Ft(,)g(whic)m(h)f(mak)m(es)h(the)g(Bash)g Fs(echo)e Ft(b)s(eha)m(v)m(e) | |
11097 | i(more)g(lik)m(e)f(the)h(v)m(ersion)f(sp)s(eci\014ed)630 | |
11098 | 737 y(in)40 b(the)i(Single)e(Unix)g(Sp)s(eci\014cation,)j(v)m(ersion)f | |
11099 | (2.)74 b(See)42 b(Section)f(4.2)i([Bash)f(Builtins],)630 | |
11100 | 847 y(page)31 b(39,)h(for)e(a)g(description)f(of)h(the)h(escap)s(e)g | |
11101 | (sequences)f(that)h Fs(echo)f Ft(recognizes.)275 1006 | |
11102 | y(The)23 b(\014le)h(`)p Fs(config-top.h)p Ft(')d(con)m(tains)k(C)f | |
11103 | (Prepro)s(cessor)g(`)p Fs(#define)p Ft(')e(statemen)m(ts)k(for)f | |
11104 | (options)e(whic)m(h)150 1116 y(are)35 b(not)g(settable)h(from)e | |
11105 | Fs(configure)p Ft(.)51 b(Some)35 b(of)g(these)g(are)h(not)f(mean)m(t)g | |
11106 | (to)h(b)s(e)e(c)m(hanged;)k(b)s(ew)m(are)d(of)150 1225 | |
11107 | y(the)h(consequences)g(if)e(y)m(ou)i(do.)55 b(Read)36 | |
11108 | b(the)g(commen)m(ts)g(asso)s(ciated)g(with)e(eac)m(h)j(de\014nition)c | |
11109 | (for)i(more)150 1335 y(information)29 b(ab)s(out)h(its)g(e\013ect.)p | |
11110 | eop | |
11111 | %%Page: 122 128 | |
11112 | 122 127 bop 150 -116 a Ft(122)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
11113 | eop | |
11114 | %%Page: 123 129 | |
11115 | 123 128 bop 150 -116 a Ft(App)s(endix)28 b(A:)i(Rep)s(orting)g(Bugs) | |
11116 | 2299 b(123)150 299 y Fo(App)t(endix)53 b(A)121 b(Rep)t(orting)53 | |
11117 | b(Bugs)275 533 y Ft(Please)34 b(rep)s(ort)f(all)g(bugs)h(y)m(ou)g | |
11118 | (\014nd)f(in)g(Bash.)52 b(But)34 b(\014rst,)h(y)m(ou)f(should)e(mak)m | |
11119 | (e)j(sure)f(that)g(it)g(really)150 643 y(is)h(a)h(bug,)h(and)e(that)h | |
11120 | (it)g(app)s(ears)f(in)f(the)i(latest)h(v)m(ersion)e(of)h(Bash.)57 | |
11121 | b(The)35 b(latest)i(v)m(ersion)e(of)h(Bash)g(is)150 752 | |
11122 | y(alw)m(a)m(ys)31 b(a)m(v)-5 b(ailable)30 b(for)g(FTP)g(from)g | |
11123 | Fs(ftp://ftp.gnu.org/pub/ba)o(sh/)o Ft(.)275 887 y(Once)41 | |
11124 | b(y)m(ou)g(ha)m(v)m(e)h(determined)e(that)i(a)f(bug)g(actually)f | |
11125 | (exists,)k(use)d(the)g Fs(bashbug)e Ft(command)i(to)150 | |
11126 | 996 y(submit)24 b(a)i(bug)g(rep)s(ort.)38 b(If)26 b(y)m(ou)g(ha)m(v)m | |
11127 | (e)h(a)f(\014x,)h(y)m(ou)f(are)g(encouraged)h(to)f(mail)f(that)h(as)g | |
11128 | (w)m(ell!)38 b(Suggestions)150 1106 y(and)20 b(`philosophical')f(bug)h | |
11129 | (rep)s(orts)g(ma)m(y)i(b)s(e)f(mailed)e(to)j Fs(bug-bash@gnu.org)17 | |
11130 | b Ft(or)k(p)s(osted)f(to)i(the)f(Usenet)150 1215 y(newsgroup)29 | |
11131 | b Fs(gnu.bash.bug)p Ft(.)275 1350 y(All)g(bug)g(rep)s(orts)h(should)e | |
11132 | (include:)225 1484 y Fp(\017)60 b Ft(The)30 b(v)m(ersion)g(n)m(um)m(b)s | |
11133 | (er)f(of)h(Bash.)225 1619 y Fp(\017)60 b Ft(The)30 b(hardw)m(are)g(and) | |
11134 | g(op)s(erating)f(system.)225 1753 y Fp(\017)60 b Ft(The)30 | |
11135 | b(compiler)f(used)g(to)i(compile)f(Bash.)225 1888 y Fp(\017)60 | |
11136 | b Ft(A)30 b(description)f(of)h(the)h(bug)f(b)s(eha)m(viour.)225 | |
11137 | 2022 y Fp(\017)60 b Ft(A)30 b(short)h(script)e(or)h(`recip)s(e')g(whic) | |
11138 | m(h)f(exercises)i(the)f(bug)g(and)g(ma)m(y)h(b)s(e)f(used)f(to)i(repro) | |
11139 | s(duce)e(it.)150 2182 y Fs(bashbug)d Ft(inserts)h(the)i(\014rst)f | |
11140 | (three)g(items)g(automatically)g(in)m(to)h(the)f(template)h(it)f(pro)m | |
11141 | (vides)f(for)h(\014ling)f(a)150 2291 y(bug)j(rep)s(ort.)275 | |
11142 | 2426 y(Please)g(send)g(all)f(rep)s(orts)h(concerning)f(this)h(man)m | |
11143 | (ual)f(to)i Fs(chet@po.CWRU.Edu)p Ft(.)p eop | |
11144 | %%Page: 124 130 | |
11145 | 124 129 bop 150 -116 a Ft(124)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
11146 | eop | |
11147 | %%Page: 125 131 | |
11148 | 125 130 bop 150 -116 a Ft(App)s(endix)28 b(B:)j(Ma)5 | |
11149 | b(jor)31 b(Di\013erences)f(F)-8 b(rom)31 b(The)f(Bourne)g(Shell)1256 | |
11150 | b(125)150 141 y Fo(App)t(endix)53 b(B)128 b(Ma)9 b(jor)54 | |
11151 | b(Di\013erences)e(F)-13 b(rom)53 b(The)g(Bourne)1135 | |
11152 | 299 y(Shell)275 524 y Ft(Bash)25 b(implemen)m(ts)e(essen)m(tially)h | |
11153 | (the)i(same)f(grammar,)i(parameter)e(and)g(v)-5 b(ariable)24 | |
11154 | b(expansion,)h(redi-)150 633 y(rection,)j(and)e(quoting)g(as)h(the)h | |
11155 | (Bourne)e(Shell.)38 b(Bash)27 b(uses)f(the)h Fl(posix)f | |
11156 | Ft(1003.2)k(standard)c(as)h(the)g(sp)s(ec-)150 743 y(i\014cation)k(of)g | |
11157 | (ho)m(w)h(these)g(features)g(are)g(to)g(b)s(e)f(implemen)m(ted.)43 | |
11158 | b(There)31 b(are)h(some)g(di\013erences)f(b)s(et)m(w)m(een)150 | |
11159 | 853 y(the)h(traditional)e(Bourne)h(shell)e(and)i(Bash;)i(this)d | |
11160 | (section)i(quic)m(kly)e(details)h(the)g(di\013erences)g(of)h(signif-) | |
11161 | 150 962 y(icance.)51 b(A)34 b(n)m(um)m(b)s(er)e(of)i(these)h | |
11162 | (di\013erences)e(are)h(explained)e(in)g(greater)j(depth)e(in)f | |
11163 | (previous)h(sections.)150 1072 y(This)c(section)h(uses)g(the)h(v)m | |
11164 | (ersion)e(of)i Fs(sh)f Ft(included)d(in)i(SVR4.2)j(as)e(the)h(baseline) | |
11165 | e(reference.)225 1204 y Fp(\017)60 b Ft(Bash)32 b(is)g | |
11166 | Fl(posix)p Ft(-conforman)m(t,)h(ev)m(en)g(where)f(the)g | |
11167 | Fl(posix)g Ft(sp)s(eci\014cation)f(di\013ers)g(from)h(traditional)330 | |
11168 | 1314 y Fs(sh)e Ft(b)s(eha)m(vior)f(\(see)j(Section)e(6.11)i([Bash)e | |
11169 | (POSIX)g(Mo)s(de],)h(page)g(76\).)225 1447 y Fp(\017)60 | |
11170 | b Ft(Bash)26 b(has)g(m)m(ulti-c)m(haracter)g(in)m(v)m(o)s(cation)g | |
11171 | (options)g(\(see)g(Section)g(6.1)h([In)m(v)m(oking)f(Bash],)i(page)e | |
11172 | (63\).)225 1579 y Fp(\017)60 b Ft(Bash)28 b(has)g(command-line)f | |
11173 | (editing)f(\(see)j(Chapter)f(8)g([Command)f(Line)g(Editing],)h(page)g | |
11174 | (83\))i(and)330 1689 y(the)h Fs(bind)e Ft(builtin.)225 | |
11175 | 1822 y Fp(\017)60 b Ft(Bash)46 b(pro)m(vides)f(a)h(programmable)f(w)m | |
11176 | (ord)g(completion)g(mec)m(hanism)g(\(see)i(Section)f(8.6)h([Pro-)330 | |
11177 | 1931 y(grammable)20 b(Completion],)h(page)g(103\),)k(and)19 | |
11178 | b(t)m(w)m(o)j(builtin)17 b(commands,)22 b Fs(complete)c | |
11179 | Ft(and)i Fs(compgen)p Ft(,)330 2041 y(to)31 b(manipulate)e(it.)225 | |
11180 | 2173 y Fp(\017)60 b Ft(Bash)26 b(has)f(command)h(history)e(\(see)j | |
11181 | (Section)e(9.1)i([Bash)f(History)g(F)-8 b(acilities],)26 | |
11182 | b(page)g(109\))i(and)d(the)330 2283 y Fs(history)k Ft(and)h | |
11183 | Fs(fc)g Ft(builtins)d(to)k(manipulate)e(it.)41 b(The)30 | |
11184 | b(Bash)h(history)f(list)f(main)m(tains)g(timestamp)330 | |
11185 | 2393 y(information)g(and)g(uses)h(the)h(v)-5 b(alue)30 | |
11186 | b(of)g(the)h Fs(HISTTIMEFORMAT)26 b Ft(v)-5 b(ariable)30 | |
11187 | b(to)h(displa)m(y)d(it.)225 2525 y Fp(\017)60 b Ft(Bash)48 | |
11188 | b(implemen)m(ts)f Fs(csh)p Ft(-lik)m(e)g(history)g(expansion)g(\(see)i | |
11189 | (Section)f(9.3)i([History)e(In)m(teraction],)330 2635 | |
11190 | y(page)31 b(111\).)225 2768 y Fp(\017)60 b Ft(Bash)33 | |
11191 | b(has)g(one-dimensional)e(arra)m(y)i(v)-5 b(ariables)32 | |
11192 | b(\(see)i(Section)f(6.7)h([Arra)m(ys],)g(page)g(72\),)h(and)e(the)330 | |
11193 | 2877 y(appropriate)38 b(v)-5 b(ariable)38 b(expansions)g(and)h | |
11194 | (assignmen)m(t)g(syn)m(tax)h(to)g(use)f(them.)67 b(Sev)m(eral)39 | |
11195 | b(of)h(the)330 2987 y(Bash)32 b(builtins)c(tak)m(e)34 | |
11196 | b(options)d(to)i(act)g(on)e(arra)m(ys.)46 b(Bash)32 b(pro)m(vides)f(a)h | |
11197 | (n)m(um)m(b)s(er)f(of)h(built-in)c(arra)m(y)330 3096 | |
11198 | y(v)-5 b(ariables.)225 3229 y Fp(\017)60 b Ft(The)37 | |
11199 | b Fs($'...)n(')g Ft(quoting)f(syn)m(tax,)k(whic)m(h)c(expands)g(ANSI-C) | |
11200 | h(bac)m(kslash-escap)s(ed)g(c)m(haracters)h(in)330 3339 | |
11201 | y(the)26 b(text)h(b)s(et)m(w)m(een)g(the)g(single)d(quotes,)k(is)d | |
11202 | (supp)s(orted)g(\(see)i(Section)f(3.1.2.4)i([ANSI-C)e(Quoting],)330 | |
11203 | 3448 y(page)31 b(6\).)225 3581 y Fp(\017)60 b Ft(Bash)69 | |
11204 | b(supp)s(orts)e(the)i Fs($"...)n(")g Ft(quoting)f(syn)m(tax)h(to)h(do)e | |
11205 | (lo)s(cale-sp)s(eci\014c)g(translation)g(of)330 3690 | |
11206 | y(the)d(c)m(haracters)i(b)s(et)m(w)m(een)f(the)f(double)f(quotes.)145 | |
11207 | b(The)65 b(`)p Fs(-D)p Ft(',)74 b(`)p Fs(--dump-strings)p | |
11208 | Ft(',)d(and)330 3800 y(`)p Fs(--dump-po-strings)p Ft(')27 | |
11209 | b(in)m(v)m(o)s(cation)k(options)f(list)g(the)h(translatable)f(strings)g | |
11210 | (found)g(in)g(a)h(script)330 3910 y(\(see)g(Section)g(3.1.2.5)h([Lo)s | |
11211 | (cale)f(T)-8 b(ranslation],)30 b(page)h(7\).)225 4042 | |
11212 | y Fp(\017)60 b Ft(Bash)44 b(implemen)m(ts)e(the)h Fs(!)h | |
11213 | Ft(k)m(eyw)m(ord)g(to)g(negate)h(the)f(return)e(v)-5 | |
11214 | b(alue)43 b(of)h(a)g(pip)s(eline)c(\(see)k(Sec-)330 4152 | |
11215 | y(tion)32 b(3.2.2)j([Pip)s(elines],)c(page)j(8\).)49 | |
11216 | b(V)-8 b(ery)33 b(useful)e(when)h(an)h Fs(if)f Ft(statemen)m(t)j(needs) | |
11217 | d(to)i(act)g(only)e(if)330 4261 y(a)f(test)g(fails.)225 | |
11218 | 4394 y Fp(\017)60 b Ft(Bash)34 b(has)g(the)g Fs(time)f | |
11219 | Ft(reserv)m(ed)h(w)m(ord)g(and)f(command)h(timing)f(\(see)i(Section)f | |
11220 | (3.2.2)h([Pip)s(elines],)330 4504 y(page)g(8\).)52 b(The)33 | |
11221 | b(displa)m(y)g(of)h(the)g(timing)e(statistics)i(ma)m(y)h(b)s(e)e(con)m | |
11222 | (trolled)h(with)f(the)h Fs(TIMEFORMAT)330 4613 y Ft(v)-5 | |
11223 | b(ariable.)225 4746 y Fp(\017)60 b Ft(Bash)23 b(implemen)m(ts)e(the)j | |
11224 | Fs(for)29 b(\(\()h Fj(expr1)39 b Fs(;)30 b Fj(expr2)40 | |
11225 | b Fs(;)30 b Fj(expr3)39 b Fs(\)\))23 b Ft(arithmetic)f(for)g(command,)j | |
11226 | (sim-)330 4855 y(ilar)k(to)i(the)g(C)f(language)g(\(see)i(Section)e | |
11227 | (3.2.4.1)j([Lo)s(oping)c(Constructs],)i(page)g(9\).)225 | |
11228 | 4988 y Fp(\017)60 b Ft(Bash)31 b(includes)d(the)i Fs(select)f | |
11229 | Ft(comp)s(ound)g(command,)i(whic)m(h)e(allo)m(ws)h(the)h(generation)f | |
11230 | (of)h(simple)330 5098 y(men)m(us)f(\(see)h(Section)f(3.2.4.2)j | |
11231 | ([Conditional)28 b(Constructs],)j(page)g(10\).)225 5230 | |
11232 | y Fp(\017)60 b Ft(Bash)26 b(includes)e(the)j Fs([[)f | |
11233 | Ft(comp)s(ound)f(command,)i(whic)m(h)e(mak)m(es)i(conditional)e | |
11234 | (testing)h(part)g(of)h(the)330 5340 y(shell)i(grammar)h(\(see)h | |
11235 | (Section)f(3.2.4.2)j([Conditional)c(Constructs],)h(page)h(10\).)p | |
11236 | eop | |
11237 | %%Page: 126 132 | |
11238 | 126 131 bop 150 -116 a Ft(126)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
11239 | 225 299 y Fp(\017)60 b Ft(Bash)27 b(includes)e(brace)j(expansion)e | |
11240 | (\(see)i(Section)f(3.5.1)j([Brace)e(Expansion],)f(page)h(17\))h(and)d | |
11241 | (tilde)330 408 y(expansion)j(\(see)j(Section)e(3.5.2)i([Tilde)d | |
11242 | (Expansion],)g(page)i(18\).)225 537 y Fp(\017)60 b Ft(Bash)24 | |
11243 | b(implemen)m(ts)f(command)g(aliases)h(and)f(the)i Fs(alias)d | |
11244 | Ft(and)i Fs(unalias)e Ft(builtins)e(\(see)25 b(Section)f(6.6)330 | |
11245 | 647 y([Aliases],)30 b(page)h(71\).)225 776 y Fp(\017)60 | |
11246 | b Ft(Bash)32 b(pro)m(vides)f(shell)f(arithmetic,)i(the)g | |
11247 | Fs(\(\()g Ft(comp)s(ound)e(command)i(\(see)h(Section)e(3.2.4.2)k([Con-) | |
11248 | 330 886 y(ditional)29 b(Constructs],)h(page)i(10\),)g(and)e(arithmetic) | |
11249 | g(expansion)f(\(see)j(Section)e(6.5)i([Shell)d(Arith-)330 | |
11250 | 995 y(metic],)i(page)g(70\).)225 1124 y Fp(\017)60 b | |
11251 | Ft(V)-8 b(ariables)29 b(presen)m(t)g(in)f(the)h(shell's)f(initial)e(en) | |
11252 | m(vironmen)m(t)j(are)h(automatically)f(exp)s(orted)g(to)h(c)m(hild)330 | |
11253 | 1234 y(pro)s(cesses.)38 b(The)23 b(Bourne)g(shell)e(do)s(es)i(not)g | |
11254 | (normally)e(do)i(this)f(unless)g(the)h(v)-5 b(ariables)22 | |
11255 | b(are)h(explicitly)330 1343 y(mark)m(ed)30 b(using)f(the)i | |
11256 | Fs(export)e Ft(command.)225 1472 y Fp(\017)60 b Ft(Bash)36 | |
11257 | b(includes)e(the)i Fl(posix)f Ft(pattern)h(remo)m(v)-5 | |
11258 | b(al)36 b(`)p Fs(\045)p Ft(',)i(`)p Fs(#)p Ft(',)g(`)p | |
11259 | Fs(\045\045)p Ft(')e(and)f(`)p Fs(##)p Ft(')h(expansions)f(to)h(remo)m | |
11260 | (v)m(e)330 1582 y(leading)d(or)h(trailing)e(substrings)g(from)h(v)-5 | |
11261 | b(ariable)33 b(v)-5 b(alues)34 b(\(see)h(Section)f(3.5.3)h([Shell)e(P)m | |
11262 | (arameter)330 1691 y(Expansion],)c(page)i(18\).)225 1820 | |
11263 | y Fp(\017)60 b Ft(The)46 b(expansion)f Fs(${#xx})p Ft(,)k(whic)m(h)c | |
11264 | (returns)g(the)i(length)e(of)i Fs(${xx})p Ft(,)i(is)d(supp)s(orted)e | |
11265 | (\(see)j(Sec-)330 1930 y(tion)30 b(3.5.3)i([Shell)d(P)m(arameter)i | |
11266 | (Expansion],)e(page)j(18\).)225 2059 y Fp(\017)60 b Ft(The)30 | |
11267 | b(expansion)f Fs(${var:)p Fq(o\013set)r Fs([:)p Fq(length)p | |
11268 | Fs(]})p Ft(,)g(whic)m(h)g(expands)h(to)h(the)g(substring)d(of)j | |
11269 | Fs(var)p Ft('s)e(v)-5 b(alue)330 2168 y(of)43 b(length)f | |
11270 | Fq(length)p Ft(,)k(b)s(eginning)40 b(at)k Fq(o\013set)p | |
11271 | Ft(,)j(is)42 b(presen)m(t)h(\(see)g(Section)g(3.5.3)i([Shell)c(P)m | |
11272 | (arameter)330 2278 y(Expansion],)29 b(page)i(18\).)225 | |
11273 | 2407 y Fp(\017)60 b Ft(The)21 b(expansion)e Fs(${var/[/])p | |
11274 | Fq(pattern)p Fs([/)p Fq(replacemen)m(t)r Fs(]})p Ft(,)i(whic)m(h)e | |
11275 | (matc)m(hes)k Fq(pattern)e Ft(and)f(replaces)330 2516 | |
11276 | y(it)28 b(with)e Fq(replacemen)m(t)31 b Ft(in)c(the)h(v)-5 | |
11277 | b(alue)28 b(of)g Fs(var)p Ft(,)g(is)f(a)m(v)-5 b(ailable)28 | |
11278 | b(\(see)h(Section)e(3.5.3)j([Shell)d(P)m(arameter)330 | |
11279 | 2626 y(Expansion],)i(page)i(18\).)225 2755 y Fp(\017)60 | |
11280 | b Ft(The)32 b(expansion)f Fs(${!)p Fj(prefix)p Fs(})p | |
11281 | Fj(*)40 b Ft(expansion,)31 b(whic)m(h)g(expands)h(to)h(the)f(names)g | |
11282 | (of)h(all)e(shell)f(v)-5 b(ari-)330 2865 y(ables)35 b(whose)h(names)g | |
11283 | (b)s(egin)f(with)g Fq(pre\014x)p Ft(,)h(is)f(a)m(v)-5 | |
11284 | b(ailable)36 b(\(see)h(Section)f(3.5.3)h([Shell)e(P)m(arameter)330 | |
11285 | 2974 y(Expansion],)29 b(page)i(18\).)225 3103 y Fp(\017)60 | |
11286 | b Ft(Bash)22 b(has)f Fq(indirect)h Ft(v)-5 b(ariable)20 | |
11287 | b(expansion)h(using)f Fs(${!word})f Ft(\(see)k(Section)e(3.5.3)j | |
11288 | ([Shell)c(P)m(arameter)330 3213 y(Expansion],)29 b(page)i(18\).)225 | |
11289 | 3342 y Fp(\017)60 b Ft(Bash)31 b(can)f(expand)g(p)s(ositional)e | |
11290 | (parameters)j(b)s(ey)m(ond)e Fs($9)h Ft(using)f Fs(${)p | |
11291 | Fj(num)11 b Fs(})p Ft(.)225 3471 y Fp(\017)60 b Ft(The)27 | |
11292 | b Fl(posix)g Fs($\(\))g Ft(form)g(of)h(command)g(substitution)d(is)i | |
11293 | (implemen)m(ted)f(\(see)j(Section)e(3.5.4)j([Com-)330 | |
11294 | 3580 y(mand)38 b(Substitution],)i(page)g(21\),)j(and)38 | |
11295 | b(preferred)g(to)i(the)g(Bourne)f(shell's)f Fs(``)g Ft(\(whic)m(h)h(is) | |
11296 | f(also)330 3690 y(implemen)m(ted)29 b(for)h(bac)m(kw)m(ards)h | |
11297 | (compatibilit)m(y\).)225 3819 y Fp(\017)60 b Ft(Bash)31 | |
11298 | b(has)f(pro)s(cess)g(substitution)e(\(see)j(Section)f(3.5.6)i([Pro)s | |
11299 | (cess)f(Substitution],)d(page)j(22\).)225 3948 y Fp(\017)60 | |
11300 | b Ft(Bash)55 b(automatically)g(assigns)g(v)-5 b(ariables)53 | |
11301 | b(that)j(pro)m(vide)e(information)g(ab)s(out)h(the)g(curren)m(t)330 | |
11302 | 4057 y(user)40 b(\()p Fs(UID)p Ft(,)i Fs(EUID)p Ft(,)g(and)e | |
11303 | Fs(GROUPS)p Ft(\),)h(the)g(curren)m(t)f(host)g(\()p Fs(HOSTTYPE)p | |
11304 | Ft(,)h Fs(OSTYPE)p Ft(,)h Fs(MACHTYPE)p Ft(,)f(and)330 | |
11305 | 4167 y Fs(HOSTNAME)p Ft(\),)55 b(and)c(the)g(instance)g(of)h(Bash)f | |
11306 | (that)h(is)e(running)f(\()p Fs(BASH)p Ft(,)56 b Fs(BASH_VERSION)p | |
11307 | Ft(,)e(and)330 4276 y Fs(BASH_VERSINFO)p Ft(\).)37 b(See)31 | |
11308 | b(Section)f(5.2)i([Bash)e(V)-8 b(ariables],)31 b(page)g(55,)g(for)f | |
11309 | (details.)225 4405 y Fp(\017)60 b Ft(The)44 b Fs(IFS)f | |
11310 | Ft(v)-5 b(ariable)43 b(is)g(used)g(to)i(split)d(only)h(the)h(results)f | |
11311 | (of)i(expansion,)h(not)e(all)f(w)m(ords)h(\(see)330 4515 | |
11312 | y(Section)28 b(3.5.7)i([W)-8 b(ord)29 b(Splitting],)e(page)i(22\).)41 | |
11313 | b(This)27 b(closes)h(a)h(longstanding)e(shell)f(securit)m(y)i(hole.)225 | |
11314 | 4644 y Fp(\017)60 b Ft(Bash)33 b(implemen)m(ts)f(the)h(full)e(set)j(of) | |
11315 | f Fl(posix)f Ft(1003.2)k(\014lename)c(expansion)g(op)s(erators,)i | |
11316 | (including)330 4753 y Fq(c)m(haracter)23 b(classes)p | |
11317 | Ft(,)g Fq(equiv)-5 b(alence)21 b(classes)p Ft(,)i(and)e | |
11318 | Fq(collating)f(sym)m(b)s(ols)k Ft(\(see)e(Section)f(3.5.8)i([Filename) | |
11319 | 330 4863 y(Expansion],)29 b(page)i(22\).)225 4992 y Fp(\017)60 | |
11320 | b Ft(Bash)35 b(implemen)m(ts)e(extended)i(pattern)g(matc)m(hing)g | |
11321 | (features)g(when)f(the)h Fs(extglob)d Ft(shell)h(option)330 | |
11322 | 5101 y(is)c(enabled)h(\(see)h(Section)f(3.5.8.1)j([P)m(attern)f(Matc)m | |
11323 | (hing],)f(page)g(23\).)225 5230 y Fp(\017)60 b Ft(It)22 | |
11324 | b(is)f(p)s(ossible)f(to)j(ha)m(v)m(e)g(a)f(v)-5 b(ariable)21 | |
11325 | b(and)h(a)g(function)f(with)g(the)h(same)g(name;)j Fs(sh)d | |
11326 | Ft(do)s(es)g(not)g(separate)330 5340 y(the)31 b(t)m(w)m(o)g(name)g | |
11327 | (spaces.)p eop | |
11328 | %%Page: 127 133 | |
11329 | 127 132 bop 150 -116 a Ft(App)s(endix)28 b(B:)j(Ma)5 | |
11330 | b(jor)31 b(Di\013erences)f(F)-8 b(rom)31 b(The)f(Bourne)g(Shell)1256 | |
11331 | b(127)225 299 y Fp(\017)60 b Ft(Bash)30 b(functions)d(are)j(p)s | |
11332 | (ermitted)e(to)i(ha)m(v)m(e)h(lo)s(cal)e(v)-5 b(ariables)28 | |
11333 | b(using)g(the)h Fs(local)f Ft(builtin,)f(and)h(th)m(us)330 | |
11334 | 408 y(useful)h(recursiv)m(e)g(functions)g(ma)m(y)i(b)s(e)f(written)f | |
11335 | (\(see)j(Section)e(4.2)h([Bash)g(Builtins],)d(page)k(39\).)225 | |
11336 | 537 y Fp(\017)60 b Ft(V)-8 b(ariable)23 b(assignmen)m(ts)h(preceding)e | |
11337 | (commands)i(a\013ect)h(only)e(that)h(command,)h(ev)m(en)f(builtins)d | |
11338 | (and)330 647 y(functions)35 b(\(see)i(Section)f(3.7.4)i([En)m(vironmen) | |
11339 | m(t],)g(page)f(30\).)60 b(In)35 b Fs(sh)p Ft(,)j(all)d(v)-5 | |
11340 | b(ariable)35 b(assignmen)m(ts)330 757 y(preceding)29 | |
11341 | b(commands)h(are)h(global)f(unless)e(the)j(command)f(is)g(executed)h | |
11342 | (from)f(the)g(\014le)g(system.)225 886 y Fp(\017)60 b | |
11343 | Ft(Bash)44 b(p)s(erforms)e(\014lename)h(expansion)f(on)i(\014lenames)f | |
11344 | (sp)s(eci\014ed)f(as)i(op)s(erands)e(to)j(input)d(and)330 | |
11345 | 995 y(output)30 b(redirection)f(op)s(erators)i(\(see)g(Section)f(3.6)i | |
11346 | ([Redirections],)e(page)h(24\).)225 1124 y Fp(\017)60 | |
11347 | b Ft(Bash)29 b(con)m(tains)g(the)g(`)p Fs(<>)p Ft(')f(redirection)g(op) | |
11348 | s(erator,)h(allo)m(wing)f(a)h(\014le)f(to)h(b)s(e)f(op)s(ened)g(for)h | |
11349 | (b)s(oth)f(read-)330 1234 y(ing)34 b(and)g(writing,)g(and)g(the)h(`)p | |
11350 | Fs(&>)p Ft(')g(redirection)e(op)s(erator,)j(for)f(directing)e(standard) | |
11351 | h(output)h(and)330 1343 y(standard)30 b(error)g(to)h(the)f(same)h | |
11352 | (\014le)e(\(see)j(Section)e(3.6)h([Redirections],)f(page)i(24\).)225 | |
11353 | 1472 y Fp(\017)60 b Ft(Bash)25 b(treats)h(a)f(n)m(um)m(b)s(er)e(of)i | |
11354 | (\014lenames)f(sp)s(ecially)e(when)i(they)h(are)g(used)f(in)f | |
11355 | (redirection)h(op)s(erators)330 1582 y(\(see)31 b(Section)g(3.6)g | |
11356 | ([Redirections],)f(page)h(24\).)225 1711 y Fp(\017)60 | |
11357 | b Ft(Bash)33 b(can)f(op)s(en)g(net)m(w)m(ork)i(connections)e(to)i | |
11358 | (arbitrary)d(mac)m(hines)h(and)g(services)g(with)f(the)i(redi-)330 | |
11359 | 1820 y(rection)d(op)s(erators)h(\(see)g(Section)f(3.6)i | |
11360 | ([Redirections],)e(page)h(24\).)225 1949 y Fp(\017)60 | |
11361 | b Ft(The)29 b Fs(noclobber)e Ft(option)i(is)g(a)m(v)-5 | |
11362 | b(ailable)29 b(to)h(a)m(v)m(oid)g(o)m(v)m(erwriting)f(existing)g | |
11363 | (\014les)f(with)h(output)g(redi-)330 2059 y(rection)g(\(see)i(Section)e | |
11364 | (4.3)h([The)g(Set)f(Builtin],)f(page)i(50\).)41 b(The)29 | |
11365 | b(`)p Fs(>|)p Ft(')h(redirection)e(op)s(erator)h(ma)m(y)330 | |
11366 | 2168 y(b)s(e)h(used)f(to)i(o)m(v)m(erride)g Fs(noclobber)p | |
11367 | Ft(.)225 2297 y Fp(\017)60 b Ft(The)34 b(Bash)g Fs(cd)g | |
11368 | Ft(and)f Fs(pwd)g Ft(builtins)e(\(see)k(Section)f(4.1)h([Bourne)g | |
11369 | (Shell)d(Builtins],)g(page)j(33\))h(eac)m(h)330 2407 | |
11370 | y(tak)m(e)c(`)p Fs(-L)p Ft(')e(and)g(`)p Fs(-P)p Ft(')g(options)g(to)h | |
11371 | (switc)m(h)f(b)s(et)m(w)m(een)h(logical)f(and)f(ph)m(ysical)g(mo)s | |
11372 | (des.)225 2536 y Fp(\017)60 b Ft(Bash)25 b(allo)m(ws)f(a)i(function)d | |
11373 | (to)j(o)m(v)m(erride)f(a)h(builtin)21 b(with)j(the)h(same)g(name,)i | |
11374 | (and)d(pro)m(vides)g(access)i(to)330 2645 y(that)34 b(builtin's)c | |
11375 | (functionalit)m(y)h(within)g(the)i(function)f(via)h(the)g | |
11376 | Fs(builtin)f Ft(and)g Fs(command)g Ft(builtins)330 2755 | |
11377 | y(\(see)f(Section)g(4.2)g([Bash)g(Builtins],)d(page)j(39\).)225 | |
11378 | 2884 y Fp(\017)60 b Ft(The)35 b Fs(command)e Ft(builtin)f(allo)m(ws)j | |
11379 | (selectiv)m(e)h(disabling)d(of)i(functions)f(when)h(command)g(lo)s | |
11380 | (okup)f(is)330 2993 y(p)s(erformed)29 b(\(see)i(Section)f(4.2)i([Bash)f | |
11381 | (Builtins],)d(page)j(39\).)225 3122 y Fp(\017)60 b Ft(Individual)20 | |
11382 | b(builtins)g(ma)m(y)25 b(b)s(e)e(enabled)g(or)h(disabled)e(using)g(the) | |
11383 | i Fs(enable)f Ft(builtin)d(\(see)25 b(Section)f(4.2)330 | |
11384 | 3232 y([Bash)31 b(Builtins],)d(page)j(39\).)225 3361 | |
11385 | y Fp(\017)60 b Ft(The)26 b(Bash)h Fs(exec)e Ft(builtin)e(tak)m(es)28 | |
11386 | b(additional)c(options)i(that)h(allo)m(w)f(users)f(to)j(con)m(trol)f | |
11387 | (the)f(con)m(ten)m(ts)330 3471 y(of)35 b(the)f(en)m(vironmen)m(t)g | |
11388 | (passed)g(to)h(the)g(executed)g(command,)h(and)d(what)i(the)f(zeroth)h | |
11389 | (argumen)m(t)330 3580 y(to)c(the)g(command)f(is)f(to)i(b)s(e)f(\(see)h | |
11390 | (Section)g(4.1)g([Bourne)f(Shell)f(Builtins],)f(page)j(33\).)225 | |
11391 | 3709 y Fp(\017)60 b Ft(Shell)27 b(functions)h(ma)m(y)i(b)s(e)f(exp)s | |
11392 | (orted)g(to)h(c)m(hildren)d(via)i(the)h(en)m(vironmen)m(t)f(using)f | |
11393 | Fs(export)g(-f)h Ft(\(see)330 3819 y(Section)h(3.3)i([Shell)c(F)-8 | |
11394 | b(unctions],)31 b(page)g(13\).)225 3948 y Fp(\017)60 | |
11395 | b Ft(The)37 b(Bash)g Fs(export)p Ft(,)h Fs(readonly)p | |
11396 | Ft(,)f(and)f Fs(declare)g Ft(builtins)e(can)j(tak)m(e)i(a)f(`)p | |
11397 | Fs(-f)p Ft(')f(option)g(to)h(act)g(on)330 4057 y(shell)24 | |
11398 | b(functions,)h(a)i(`)p Fs(-p)p Ft(')e(option)g(to)i(displa)m(y)d(v)-5 | |
11399 | b(ariables)24 b(with)h(v)-5 b(arious)24 b(attributes)i(set)g(in)e(a)j | |
11400 | (format)330 4167 y(that)g(can)f(b)s(e)f(used)h(as)g(shell)e(input,)i(a) | |
11401 | g(`)p Fs(-n)p Ft(')g(option)f(to)i(remo)m(v)m(e)h(v)-5 | |
11402 | b(arious)25 b(v)-5 b(ariable)25 b(attributes,)i(and)330 | |
11403 | 4276 y(`)p Fs(name=value)p Ft(')h(argumen)m(ts)j(to)g(set)g(v)-5 | |
11404 | b(ariable)29 b(attributes)h(and)g(v)-5 b(alues)29 b(sim)m(ultaneously) | |
11405 | -8 b(.)225 4405 y Fp(\017)60 b Ft(The)42 b(Bash)h Fs(hash)f | |
11406 | Ft(builtin)d(allo)m(ws)k(a)g(name)g(to)g(b)s(e)f(asso)s(ciated)i(with)d | |
11407 | (an)i(arbitrary)e(\014lename,)330 4515 y(ev)m(en)30 b(when)e(that)h | |
11408 | (\014lename)f(cannot)i(b)s(e)e(found)g(b)m(y)h(searc)m(hing)f(the)h | |
11409 | Fs($PATH)p Ft(,)g(using)e(`)p Fs(hash)i(-p)p Ft(')g(\(see)330 | |
11410 | 4624 y(Section)h(4.1)i([Bourne)e(Shell)e(Builtins],)g(page)k(33\).)225 | |
11411 | 4753 y Fp(\017)60 b Ft(Bash)27 b(includes)d(a)k Fs(help)d | |
11412 | Ft(builtin)f(for)i(quic)m(k)g(reference)i(to)f(shell)e(facilities)g | |
11413 | (\(see)j(Section)f(4.2)h([Bash)330 4863 y(Builtins],)g(page)j(39\).)225 | |
11414 | 4992 y Fp(\017)60 b Ft(The)42 b Fs(printf)g Ft(builtin)d(is)j(a)m(v)-5 | |
11415 | b(ailable)42 b(to)i(displa)m(y)d(formatted)i(output)g(\(see)h(Section)f | |
11416 | (4.2)h([Bash)330 5101 y(Builtins],)28 b(page)j(39\).)225 | |
11417 | 5230 y Fp(\017)60 b Ft(The)26 b(Bash)h Fs(read)f Ft(builtin)d(\(see)28 | |
11418 | b(Section)f(4.2)h([Bash)f(Builtins],)e(page)j(39\))g(will)c(read)j(a)g | |
11419 | (line)e(ending)330 5340 y(in)g(`)p Fs(\\)p Ft(')i(with)e(the)h(`)p | |
11420 | Fs(-r)p Ft(')h(option,)g(and)e(will)f(use)i(the)h Fs(REPLY)e | |
11421 | Ft(v)-5 b(ariable)25 b(as)i(a)f(default)g(if)f(no)i(non-option)p | |
11422 | eop | |
11423 | %%Page: 128 134 | |
11424 | 128 133 bop 150 -116 a Ft(128)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
11425 | 330 299 y(argumen)m(ts)g(are)h(supplied.)40 b(The)30 | |
11426 | b(Bash)i Fs(read)e Ft(builtin)d(also)32 b(accepts)g(a)g(prompt)e | |
11427 | (string)g(with)g(the)330 408 y(`)p Fs(-p)p Ft(')35 b(option)f(and)g | |
11428 | (will)e(use)j(Readline)e(to)j(obtain)e(the)h(line)e(when)h(giv)m(en)h | |
11429 | (the)g(`)p Fs(-e)p Ft(')g(option.)53 b(The)330 518 y | |
11430 | Fs(read)31 b Ft(builtin)e(also)k(has)f(additional)e(options)i(to)h(con) | |
11431 | m(trol)g(input:)43 b(the)32 b(`)p Fs(-s)p Ft(')h(option)e(will)f(turn)i | |
11432 | (o\013)330 628 y(ec)m(hoing)37 b(of)f(input)e(c)m(haracters)k(as)e | |
11433 | (they)h(are)f(read,)i(the)e(`)p Fs(-t)p Ft(')g(option)g(will)e(allo)m | |
11434 | (w)h Fs(read)g Ft(to)i(time)330 737 y(out)c(if)f(input)f(do)s(es)h(not) | |
11435 | h(arriv)m(e)f(within)f(a)i(sp)s(eci\014ed)e(n)m(um)m(b)s(er)g(of)i | |
11436 | (seconds,)h(the)f(`)p Fs(-n)p Ft(')f(option)h(will)330 | |
11437 | 847 y(allo)m(w)27 b(reading)f(only)h(a)h(sp)s(eci\014ed)d(n)m(um)m(b)s | |
11438 | (er)h(of)i(c)m(haracters)h(rather)e(than)g(a)h(full)d(line,)i(and)f | |
11439 | (the)i(`)p Fs(-d)p Ft(')330 956 y(option)i(will)e(read)i(un)m(til)e(a)j | |
11440 | (particular)e(c)m(haracter)j(rather)e(than)g(newline.)225 | |
11441 | 1096 y Fp(\017)60 b Ft(The)33 b Fs(return)e Ft(builtin)f(ma)m(y)j(b)s | |
11442 | (e)g(used)f(to)i(ab)s(ort)f(execution)g(of)g(scripts)f(executed)i(with) | |
11443 | e(the)h Fs(.)g Ft(or)330 1205 y Fs(source)c Ft(builtins)d(\(see)32 | |
11444 | b(Section)e(4.1)h([Bourne)g(Shell)d(Builtins],)g(page)j(33\).)225 | |
11445 | 1345 y Fp(\017)60 b Ft(Bash)43 b(includes)e(the)i Fs(shopt)f | |
11446 | Ft(builtin,)h(for)g(\014ner)f(con)m(trol)i(of)f(shell)f(optional)g | |
11447 | (capabilities)f(\(see)330 1455 y(Section)33 b(4.2)h([Bash)f(Builtins],) | |
11448 | f(page)h(39\),)i(and)e(allo)m(ws)f(these)h(options)g(to)g(b)s(e)g(set)g | |
11449 | (and)g(unset)f(at)330 1564 y(shell)d(in)m(v)m(o)s(cation)h(\(see)h | |
11450 | (Section)f(6.1)i([In)m(v)m(oking)e(Bash],)h(page)h(63\).)225 | |
11451 | 1704 y Fp(\017)60 b Ft(Bash)23 b(has)f(m)m(uc)m(h)g(more)h(optional)f | |
11452 | (b)s(eha)m(vior)f(con)m(trollable)h(with)f(the)i Fs(set)e | |
11453 | Ft(builtin)e(\(see)24 b(Section)e(4.3)330 1813 y([The)30 | |
11454 | b(Set)h(Builtin],)d(page)j(50\).)225 1953 y Fp(\017)60 | |
11455 | b Ft(The)31 b(`)p Fs(-x)p Ft(')g(\()p Fs(xtrace)p Ft(\))g(option)g | |
11456 | (displa)m(ys)e(commands)j(other)f(than)h(simple)d(commands)i(when)g(p)s | |
11457 | (er-)330 2062 y(forming)e(an)h(execution)h(trace)g(\(see)h(Section)e | |
11458 | (4.3)h([The)g(Set)f(Builtin],)e(page)k(50\).)225 2202 | |
11459 | y Fp(\017)60 b Ft(The)28 b Fs(test)g Ft(builtin)e(\(see)k(Section)e | |
11460 | (4.1)i([Bourne)f(Shell)e(Builtins],)g(page)j(33\))g(is)e(sligh)m(tly)f | |
11461 | (di\013eren)m(t,)330 2311 y(as)c(it)f(implemen)m(ts)e(the)j | |
11462 | Fl(posix)f Ft(algorithm,)h(whic)m(h)e(sp)s(eci\014es)g(the)i(b)s(eha)m | |
11463 | (vior)e(based)h(on)h(the)f(n)m(um)m(b)s(er)330 2421 y(of)31 | |
11464 | b(argumen)m(ts.)225 2560 y Fp(\017)60 b Ft(Bash)31 b(includes)e(the)j | |
11465 | Fs(caller)d Ft(builtin,)g(whic)m(h)h(displa)m(ys)f(the)i(con)m(text)i | |
11466 | (of)f(an)m(y)g(activ)m(e)g(subroutine)330 2670 y(call)26 | |
11467 | b(\(a)h(shell)d(function)i(or)g(a)h(script)e(executed)i(with)e(the)i | |
11468 | Fs(.)f Ft(or)g Fs(source)f Ft(builtins\).)36 b(This)25 | |
11469 | b(supp)s(orts)330 2780 y(the)31 b(bash)e(debugger.)225 | |
11470 | 2919 y Fp(\017)60 b Ft(The)42 b Fs(trap)f Ft(builtin)e(\(see)44 | |
11471 | b(Section)e(4.1)i([Bourne)e(Shell)e(Builtins],)k(page)f(33\))h(allo)m | |
11472 | (ws)e(a)g Fs(DEBUG)330 3029 y Ft(pseudo-signal)36 b(sp)s | |
11473 | (eci\014cation,)i(similar)d(to)j Fs(EXIT)p Ft(.)62 b(Commands)36 | |
11474 | b(sp)s(eci\014ed)g(with)g(a)i Fs(DEBUG)e Ft(trap)330 | |
11475 | 3138 y(are)k(executed)g(b)s(efore)f(ev)m(ery)h(simple)d(command,)42 | |
11476 | b Fs(for)c Ft(command,)k Fs(case)c Ft(command,)k Fs(select)330 | |
11477 | 3248 y Ft(command,)35 b(ev)m(ery)g(arithmetic)e Fs(for)g | |
11478 | Ft(command,)i(and)f(b)s(efore)g(the)g(\014rst)f(command)h(executes)h | |
11479 | (in)330 3357 y(a)29 b(shell)e(function.)39 b(The)28 b | |
11480 | Fs(DEBUG)g Ft(trap)g(is)g(not)h(inherited)d(b)m(y)j(shell)e(functions)g | |
11481 | (unless)g(the)i(function)330 3467 y(has)35 b(b)s(een)g(giv)m(en)h(the)g | |
11482 | Fs(trace)e Ft(attribute)h(or)h(the)g Fs(functrace)d Ft(option)i(has)g | |
11483 | (b)s(een)g(enabled)f(using)330 3577 y(the)28 b Fs(shopt)e | |
11484 | Ft(builtin.)36 b(The)27 b Fs(extdebug)f Ft(shell)g(option)h(has)g | |
11485 | (additional)e(e\013ects)k(on)f(the)g Fs(DEBUG)e Ft(trap.)330 | |
11486 | 3716 y(The)21 b Fs(trap)e Ft(builtin)f(\(see)k(Section)f(4.1)h([Bourne) | |
11487 | f(Shell)e(Builtins],)i(page)h(33\))g(allo)m(ws)e(an)h | |
11488 | Fs(ERR)f Ft(pseudo-)330 3826 y(signal)28 b(sp)s(eci\014cation,)h | |
11489 | (similar)e(to)j Fs(EXIT)f Ft(and)g Fs(DEBUG)p Ft(.)39 | |
11490 | b(Commands)28 b(sp)s(eci\014ed)g(with)g(an)h Fs(ERR)g | |
11491 | Ft(trap)330 3935 y(are)40 b(executed)g(after)g(a)f(simple)f(command)h | |
11492 | (fails,)h(with)e(a)i(few)f(exceptions.)67 b(The)39 b | |
11493 | Fs(ERR)g Ft(trap)g(is)330 4045 y(not)g(inherited)d(b)m(y)j(shell)e | |
11494 | (functions)g(unless)g(the)i Fs(-o)29 b(errtrace)37 b | |
11495 | Ft(option)h(to)h(the)g Fs(set)f Ft(builtin)d(is)330 4154 | |
11496 | y(enabled.)330 4294 y(The)j Fs(trap)g Ft(builtin)e(\(see)j(Section)g | |
11497 | (4.1)h([Bourne)f(Shell)e(Builtins],)h(page)i(33\))g(allo)m(ws)e(a)i | |
11498 | Fs(RETURN)330 4403 y Ft(pseudo-signal)33 b(sp)s(eci\014cation,)j | |
11499 | (similar)c(to)k Fs(EXIT)e Ft(and)g Fs(DEBUG)p Ft(.)54 | |
11500 | b(Commands)34 b(sp)s(eci\014ed)f(with)h(an)330 4513 y | |
11501 | Fs(RETURN)39 b Ft(trap)i(are)g(executed)h(b)s(efore)e(execution)h | |
11502 | (resumes)f(after)h(a)g(shell)e(function)h(or)h(a)g(shell)330 | |
11503 | 4623 y(script)35 b(executed)h(with)f Fs(.)g Ft(or)h Fs(source)e | |
11504 | Ft(returns.)56 b(The)35 b Fs(RETURN)f Ft(trap)i(is)f(not)h(inherited)d | |
11505 | (b)m(y)j(shell)330 4732 y(functions.)225 4872 y Fp(\017)60 | |
11506 | b Ft(The)30 b(Bash)g Fs(type)f Ft(builtin)e(is)i(more)h(extensiv)m(e)h | |
11507 | (and)e(giv)m(es)i(more)f(information)f(ab)s(out)h(the)g(names)330 | |
11508 | 4981 y(it)g(\014nds)f(\(see)i(Section)f(4.2)i([Bash)e(Builtins],)f | |
11509 | (page)i(39\).)225 5121 y Fp(\017)60 b Ft(The)34 b(Bash)h | |
11510 | Fs(umask)e Ft(builtin)e(p)s(ermits)i(a)h(`)p Fs(-p)p | |
11511 | Ft(')h(option)f(to)h(cause)g(the)g(output)f(to)h(b)s(e)f(displa)m(y)m | |
11512 | (ed)f(in)330 5230 y(the)i(form)g(of)g(a)h Fs(umask)e | |
11513 | Ft(command)h(that)g(ma)m(y)h(b)s(e)f(reused)f(as)h(input)f(\(see)i | |
11514 | (Section)f(4.1)h([Bourne)330 5340 y(Shell)28 b(Builtins],)g(page)k | |
11515 | (33\).)p eop | |
11516 | %%Page: 129 135 | |
11517 | 129 134 bop 150 -116 a Ft(App)s(endix)28 b(B:)j(Ma)5 | |
11518 | b(jor)31 b(Di\013erences)f(F)-8 b(rom)31 b(The)f(Bourne)g(Shell)1256 | |
11519 | b(129)225 299 y Fp(\017)60 b Ft(Bash)34 b(implemen)m(ts)f(a)i | |
11520 | Fs(csh)p Ft(-lik)m(e)e(directory)g(stac)m(k,)k(and)d(pro)m(vides)f(the) | |
11521 | h Fs(pushd)p Ft(,)g Fs(popd)p Ft(,)g(and)g Fs(dirs)330 | |
11522 | 408 y Ft(builtins)d(to)36 b(manipulate)d(it)i(\(see)g(Section)g(6.8)h | |
11523 | ([The)f(Directory)g(Stac)m(k],)j(page)d(73\).)56 b(Bash)35 | |
11524 | b(also)330 518 y(mak)m(es)c(the)g(directory)f(stac)m(k)h(visible)d(as)j | |
11525 | (the)f(v)-5 b(alue)30 b(of)h(the)f Fs(DIRSTACK)f Ft(shell)f(v)-5 | |
11526 | b(ariable.)225 646 y Fp(\017)60 b Ft(Bash)28 b(in)m(terprets)g(sp)s | |
11527 | (ecial)f(bac)m(kslash-escap)s(ed)h(c)m(haracters)h(in)e(the)i(prompt)e | |
11528 | (strings)g(when)g(in)m(ter-)330 756 y(activ)m(e)32 b(\(see)f(Section)f | |
11529 | (6.9)i([Prin)m(ting)c(a)j(Prompt],)g(page)g(75\).)225 | |
11530 | 885 y Fp(\017)60 b Ft(The)46 b(Bash)h(restricted)f(mo)s(de)g(is)g(more) | |
11531 | g(useful)f(\(see)i(Section)g(6.10)h([The)e(Restricted)h(Shell],)330 | |
11532 | 994 y(page)31 b(76\);)h(the)f(SVR4.2)g(shell)d(restricted)i(mo)s(de)g | |
11533 | (is)g(to)s(o)h(limited.)225 1123 y Fp(\017)60 b Ft(The)30 | |
11534 | b Fs(disown)f Ft(builtin)e(can)k(remo)m(v)m(e)h(a)f(job)f(from)g(the)h | |
11535 | (in)m(ternal)e(shell)g(job)h(table)h(\(see)g(Section)g(7.2)330 | |
11536 | 1232 y([Job)i(Con)m(trol)g(Builtins],)e(page)j(80\))h(or)e(suppress)e | |
11537 | (the)i(sending)f(of)h Fs(SIGHUP)e Ft(to)j(a)g(job)f(when)f(the)330 | |
11538 | 1342 y(shell)d(exits)h(as)g(the)h(result)e(of)i(a)f Fs(SIGHUP)p | |
11539 | Ft(.)225 1470 y Fp(\017)60 b Ft(The)28 b(SVR4.2)h(shell)d(has)i(t)m(w)m | |
11540 | (o)i(privilege-related)c(builtins)f(\()p Fs(mldmode)h | |
11541 | Ft(and)i Fs(priv)p Ft(\))f(not)i(presen)m(t)f(in)330 | |
11542 | 1580 y(Bash.)225 1708 y Fp(\017)60 b Ft(Bash)31 b(do)s(es)f(not)g(ha)m | |
11543 | (v)m(e)i(the)e Fs(stop)g Ft(or)g Fs(newgrp)f Ft(builtins.)225 | |
11544 | 1837 y Fp(\017)60 b Ft(Bash)31 b(do)s(es)f(not)g(use)g(the)h | |
11545 | Fs(SHACCT)d Ft(v)-5 b(ariable)30 b(or)g(p)s(erform)f(shell)g(accoun)m | |
11546 | (ting.)225 1965 y Fp(\017)60 b Ft(The)30 b(SVR4.2)h Fs(sh)f | |
11547 | Ft(uses)g(a)g Fs(TIMEOUT)f Ft(v)-5 b(ariable)29 b(lik)m(e)h(Bash)g | |
11548 | (uses)g Fs(TMOUT)p Ft(.)150 2112 y(More)h(features)g(unique)d(to)j | |
11549 | (Bash)g(ma)m(y)g(b)s(e)f(found)f(in)g(Chapter)g(6)i([Bash)g(F)-8 | |
11550 | b(eatures],)32 b(page)f(63.)150 2351 y Fr(B.1)67 b(Implemen)l(tation)48 | |
11551 | b(Di\013erences)e(F)-11 b(rom)44 b(The)h(SVR4.2)g(Shell)275 | |
11552 | 2589 y Ft(Since)38 b(Bash)i(is)e(a)i(completely)g(new)f(implemen)m | |
11553 | (tation,)h(it)f(do)s(es)h(not)f(su\013er)g(from)g(man)m(y)h(of)g(the) | |
11554 | 150 2699 y(limitations)28 b(of)j(the)f(SVR4.2)h(shell.)39 | |
11555 | b(F)-8 b(or)31 b(instance:)225 2827 y Fp(\017)60 b Ft(Bash)32 | |
11556 | b(do)s(es)f(not)h(fork)f(a)h(subshell)c(when)j(redirecting)f(in)m(to)i | |
11557 | (or)f(out)h(of)g(a)g(shell)d(con)m(trol)j(structure)330 | |
11558 | 2937 y(suc)m(h)e(as)h(an)f Fs(if)g Ft(or)g Fs(while)f | |
11559 | Ft(statemen)m(t.)225 3065 y Fp(\017)60 b Ft(Bash)29 b(do)s(es)f(not)h | |
11560 | (allo)m(w)f(un)m(balanced)g(quotes.)41 b(The)28 b(SVR4.2)h(shell)e | |
11561 | (will)f(silen)m(tly)h(insert)h(a)h(needed)330 3175 y(closing)e(quote)i | |
11562 | (at)f Fs(EOF)f Ft(under)g(certain)g(circumstances.)40 | |
11563 | b(This)26 b(can)i(b)s(e)g(the)g(cause)g(of)g(some)h(hard-)330 | |
11564 | 3285 y(to-\014nd)h(errors.)225 3413 y Fp(\017)60 b Ft(The)45 | |
11565 | b(SVR4.2)h(shell)d(uses)i(a)g(baro)s(que)g(memory)g(managemen)m(t)i(sc) | |
11566 | m(heme)e(based)g(on)g(trapping)330 3523 y Fs(SIGSEGV)p | |
11567 | Ft(.)57 b(If)35 b(the)i(shell)d(is)i(started)h(from)e(a)i(pro)s(cess)f | |
11568 | (with)f Fs(SIGSEGV)f Ft(blo)s(c)m(k)m(ed)j(\(e.g.,)i(b)m(y)d(using)330 | |
11569 | 3632 y(the)31 b Fs(system\(\))d Ft(C)i(library)e(function)h(call\),)h | |
11570 | (it)g(misb)s(eha)m(v)m(es)g(badly)-8 b(.)225 3761 y Fp(\017)60 | |
11571 | b Ft(In)26 b(a)i(questionable)e(attempt)j(at)f(securit)m(y)-8 | |
11572 | b(,)28 b(the)f(SVR4.2)h(shell,)e(when)h(in)m(v)m(ok)m(ed)g(without)g | |
11573 | (the)g(`)p Fs(-p)p Ft(')330 3870 y(option,)38 b(will)33 | |
11574 | b(alter)k(its)e(real)h(and)g(e\013ectiv)m(e)i Fl(uid)e | |
11575 | Ft(and)g Fl(gid)h Ft(if)e(they)i(are)f(less)g(than)g(some)h(magic)330 | |
11576 | 3980 y(threshold)29 b(v)-5 b(alue,)30 b(commonly)g(100.)42 | |
11577 | b(This)28 b(can)j(lead)f(to)h(unexp)s(ected)f(results.)225 | |
11578 | 4108 y Fp(\017)60 b Ft(The)30 b(SVR4.2)h(shell)e(do)s(es)h(not)g(allo)m | |
11579 | (w)g(users)g(to)h(trap)f Fs(SIGSEGV)p Ft(,)f Fs(SIGALRM)p | |
11580 | Ft(,)f(or)j Fs(SIGCHLD)p Ft(.)225 4237 y Fp(\017)60 b | |
11581 | Ft(The)34 b(SVR4.2)h(shell)e(do)s(es)i(not)f(allo)m(w)h(the)f | |
11582 | Fs(IFS)p Ft(,)h Fs(MAILCHECK)p Ft(,)f Fs(PATH)p Ft(,)h | |
11583 | Fs(PS1)p Ft(,)g(or)f Fs(PS2)g Ft(v)-5 b(ariables)33 b(to)330 | |
11584 | 4346 y(b)s(e)d(unset.)225 4475 y Fp(\017)60 b Ft(The)30 | |
11585 | b(SVR4.2)h(shell)e(treats)i(`)p Fs(^)p Ft(')f(as)h(the)g(undo)s(cumen)m | |
11586 | (ted)e(equiv)-5 b(alen)m(t)29 b(of)i(`)p Fs(|)p Ft('.)225 | |
11587 | 4603 y Fp(\017)60 b Ft(Bash)37 b(allo)m(ws)f(m)m(ultiple)e(option)i | |
11588 | (argumen)m(ts)h(when)e(it)h(is)g(in)m(v)m(ok)m(ed)h(\()p | |
11589 | Fs(-x)30 b(-v)p Ft(\);)40 b(the)c(SVR4.2)i(shell)330 | |
11590 | 4713 y(allo)m(ws)32 b(only)g(one)h(option)f(argumen)m(t)h(\()p | |
11591 | Fs(-xv)p Ft(\).)47 b(In)32 b(fact,)i(some)f(v)m(ersions)f(of)h(the)g | |
11592 | (shell)d(dump)h(core)330 4822 y(if)e(the)i(second)f(argumen)m(t)h(b)s | |
11593 | (egins)e(with)g(a)i(`)p Fs(-)p Ft('.)225 4951 y Fp(\017)60 | |
11594 | b Ft(The)35 b(SVR4.2)i(shell)c(exits)j(a)g(script)f(if)f(an)m(y)i | |
11595 | (builtin)c(fails;)37 b(Bash)f(exits)g(a)g(script)e(only)h(if)g(one)h | |
11596 | (of)330 5060 y(the)d Fl(posix)g Ft(1003.2)i(sp)s(ecial)d(builtins)d | |
11597 | (fails,)k(and)f(only)h(for)f(certain)h(failures,)g(as)g(en)m(umerated)g | |
11598 | (in)330 5170 y(the)e Fl(posix)e Ft(1003.2)k(standard.)225 | |
11599 | 5298 y Fp(\017)60 b Ft(The)30 b(SVR4.2)h(shell)e(b)s(eha)m(v)m(es)h | |
11600 | (di\013eren)m(tly)f(when)h(in)m(v)m(ok)m(ed)h(as)f Fs(jsh)g | |
11601 | Ft(\(it)g(turns)f(on)h(job)g(con)m(trol\).)p eop | |
11602 | %%Page: 130 136 | |
11603 | 130 135 bop 150 -116 a Ft(130)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
11604 | eop | |
11605 | %%Page: 131 137 | |
11606 | 131 136 bop 150 -116 a Ft(App)s(endix)28 b(C:)i(Cop)m(ying)f(This)g | |
11607 | (Man)m(ual)2062 b(131)150 299 y Fo(App)t(endix)53 b(C)126 | |
11608 | b(Cop)l(ying)52 b(This)i(Man)l(ual)150 690 y Fr(C.1)68 | |
11609 | b(GNU)45 b(F)-11 b(ree)45 b(Do)t(cumen)l(tation)h(License)1396 | |
11610 | 909 y Ft(V)-8 b(ersion)30 b(1.2,)i(No)m(v)m(em)m(b)s(er)g(2002)390 | |
11611 | 1052 y(Cop)m(yrigh)m(t)842 1049 y(c)817 1052 y Fp(\015)e | |
11612 | Ft(2000,2001,2002)36 b(F)-8 b(ree)32 b(Soft)m(w)m(are)f(F)-8 | |
11613 | b(oundation,)31 b(Inc.)390 1161 y(59)g(T)-8 b(emple)30 | |
11614 | b(Place,)h(Suite)e(330,)j(Boston,)g(MA)61 b(02111-1307,)35 | |
11615 | b(USA)390 1380 y(Ev)m(ery)m(one)c(is)f(p)s(ermitted)f(to)i(cop)m(y)g | |
11616 | (and)f(distribute)e(v)m(erbatim)i(copies)390 1490 y(of)h(this)e | |
11617 | (license)g(do)s(cumen)m(t,)i(but)e(c)m(hanging)i(it)f(is)f(not)i(allo)m | |
11618 | (w)m(ed.)199 1632 y(0.)61 b(PREAMBLE)330 1770 y(The)37 | |
11619 | b(purp)s(ose)e(of)i(this)f(License)h(is)f(to)i(mak)m(e)g(a)g(man)m | |
11620 | (ual,)g(textb)s(o)s(ok,)i(or)d(other)g(functional)f(and)330 | |
11621 | 1880 y(useful)28 b(do)s(cumen)m(t)i Fq(free)36 b Ft(in)28 | |
11622 | b(the)j(sense)f(of)g(freedom:)41 b(to)31 b(assure)e(ev)m(ery)m(one)j | |
11623 | (the)e(e\013ectiv)m(e)i(freedom)330 1990 y(to)g(cop)m(y)g(and)f | |
11624 | (redistribute)e(it,)i(with)g(or)g(without)f(mo)s(difying)f(it,)j | |
11625 | (either)f(commercially)f(or)h(non-)330 2099 y(commercially)-8 | |
11626 | b(.)53 b(Secondarily)-8 b(,)34 b(this)g(License)g(preserv)m(es)h(for)f | |
11627 | (the)h(author)f(and)g(publisher)d(a)k(w)m(a)m(y)330 2209 | |
11628 | y(to)i(get)g(credit)f(for)g(their)f(w)m(ork,)j(while)c(not)i(b)s(eing)f | |
11629 | (considered)g(resp)s(onsible)e(for)j(mo)s(di\014cations)330 | |
11630 | 2318 y(made)30 b(b)m(y)h(others.)330 2457 y(This)21 b(License)i(is)f(a) | |
11631 | i(kind)d(of)j(\\cop)m(yleft",)i(whic)m(h)c(means)h(that)h(deriv)-5 | |
11632 | b(ativ)m(e)22 b(w)m(orks)h(of)h(the)f(do)s(cumen)m(t)330 | |
11633 | 2566 y(m)m(ust)34 b(themselv)m(es)g(b)s(e)f(free)h(in)f(the)h(same)g | |
11634 | (sense.)51 b(It)34 b(complemen)m(ts)g(the)g(GNU)g(General)g(Public)330 | |
11635 | 2676 y(License,)c(whic)m(h)f(is)h(a)g(cop)m(yleft)h(license)f(designed) | |
11636 | f(for)h(free)h(soft)m(w)m(are.)330 2814 y(W)-8 b(e)31 | |
11637 | b(ha)m(v)m(e)f(designed)f(this)f(License)h(in)f(order)h(to)i(use)e(it)g | |
11638 | (for)g(man)m(uals)g(for)g(free)h(soft)m(w)m(are,)h(b)s(ecause)330 | |
11639 | 2924 y(free)42 b(soft)m(w)m(are)i(needs)e(free)g(do)s(cumen)m(tation:) | |
11640 | 64 b(a)42 b(free)h(program)f(should)e(come)j(with)e(man)m(uals)330 | |
11641 | 3033 y(pro)m(viding)27 b(the)i(same)g(freedoms)f(that)i(the)f(soft)m(w) | |
11642 | m(are)h(do)s(es.)40 b(But)29 b(this)e(License)i(is)f(not)h(limited)d | |
11643 | (to)330 3143 y(soft)m(w)m(are)32 b(man)m(uals;)e(it)g(can)h(b)s(e)f | |
11644 | (used)g(for)g(an)m(y)h(textual)g(w)m(ork,)g(regardless)f(of)h(sub)5 | |
11645 | b(ject)30 b(matter)i(or)330 3252 y(whether)f(it)g(is)f(published)e(as)k | |
11646 | (a)f(prin)m(ted)f(b)s(o)s(ok.)44 b(W)-8 b(e)32 b(recommend)f(this)g | |
11647 | (License)g(principally)c(for)330 3362 y(w)m(orks)j(whose)h(purp)s(ose)d | |
11648 | (is)i(instruction)e(or)i(reference.)199 3500 y(1.)61 | |
11649 | b(APPLICABILITY)29 b(AND)j(DEFINITIONS)330 3639 y(This)38 | |
11650 | b(License)i(applies)e(to)i(an)m(y)h(man)m(ual)e(or)h(other)g(w)m(ork,)i | |
11651 | (in)d(an)m(y)h(medium,)h(that)f(con)m(tains)h(a)330 3748 | |
11652 | y(notice)h(placed)f(b)m(y)g(the)h(cop)m(yrigh)m(t)g(holder)e(sa)m(ying) | |
11653 | h(it)g(can)h(b)s(e)f(distributed)d(under)i(the)i(terms)330 | |
11654 | 3858 y(of)c(this)e(License.)61 b(Suc)m(h)37 b(a)h(notice)g(gran)m(ts)g | |
11655 | (a)g(w)m(orld-wide,)f(ro)m(y)m(alt)m(y-free)j(license,)e(unlimited)c | |
11656 | (in)330 3967 y(duration,)48 b(to)e(use)f(that)g(w)m(ork)h(under)d(the)j | |
11657 | (conditions)d(stated)j(herein.)84 b(The)45 b(\\Do)s(cumen)m(t",)330 | |
11658 | 4077 y(b)s(elo)m(w,)28 b(refers)g(to)h(an)m(y)g(suc)m(h)f(man)m(ual)g | |
11659 | (or)g(w)m(ork.)40 b(An)m(y)29 b(mem)m(b)s(er)e(of)i(the)f(public)e(is)h | |
11660 | (a)i(licensee,)g(and)330 4187 y(is)24 b(addressed)g(as)h(\\y)m(ou".)40 | |
11661 | b(Y)-8 b(ou)26 b(accept)g(the)f(license)f(if)g(y)m(ou)i(cop)m(y)-8 | |
11662 | b(,)27 b(mo)s(dify)c(or)i(distribute)e(the)i(w)m(ork)330 | |
11663 | 4296 y(in)k(a)i(w)m(a)m(y)g(requiring)d(p)s(ermission)f(under)i(cop)m | |
11664 | (yrigh)m(t)i(la)m(w.)330 4435 y(A)j(\\Mo)s(di\014ed)e(V)-8 | |
11665 | b(ersion")34 b(of)g(the)g(Do)s(cumen)m(t)g(means)g(an)m(y)g(w)m(ork)f | |
11666 | (con)m(taining)h(the)g(Do)s(cumen)m(t)g(or)330 4544 y(a)k(p)s(ortion)e | |
11667 | (of)i(it,)h(either)e(copied)g(v)m(erbatim,)i(or)e(with)g(mo)s | |
11668 | (di\014cations)e(and/or)j(translated)f(in)m(to)330 4654 | |
11669 | y(another)31 b(language.)330 4792 y(A)26 b(\\Secondary)g(Section")g(is) | |
11670 | f(a)i(named)e(app)s(endix)e(or)j(a)h(fron)m(t-matter)g(section)f(of)g | |
11671 | (the)g(Do)s(cumen)m(t)330 4902 y(that)c(deals)f(exclusiv)m(ely)f(with)g | |
11672 | (the)h(relationship)e(of)i(the)h(publishers)17 b(or)k(authors)g(of)h | |
11673 | (the)f(Do)s(cumen)m(t)330 5011 y(to)38 b(the)f(Do)s(cumen)m(t's)i(o)m | |
11674 | (v)m(erall)e(sub)5 b(ject)37 b(\(or)h(to)g(related)f(matters\))h(and)f | |
11675 | (con)m(tains)g(nothing)f(that)330 5121 y(could)j(fall)g(directly)g | |
11676 | (within)f(that)j(o)m(v)m(erall)g(sub)5 b(ject.)70 b(\(Th)m(us,)42 | |
11677 | b(if)d(the)i(Do)s(cumen)m(t)g(is)e(in)g(part)i(a)330 | |
11678 | 5230 y(textb)s(o)s(ok)24 b(of)g(mathematics,)i(a)e(Secondary)f(Section) | |
11679 | g(ma)m(y)h(not)g(explain)e(an)m(y)i(mathematics.\))39 | |
11680 | b(The)330 5340 y(relationship)25 b(could)h(b)s(e)h(a)g(matter)i(of)e | |
11681 | (historical)f(connection)h(with)f(the)i(sub)5 b(ject)27 | |
11682 | b(or)g(with)f(related)p eop | |
11683 | %%Page: 132 138 | |
11684 | 132 137 bop 150 -116 a Ft(132)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
11685 | 330 299 y(matters,)38 b(or)d(of)h(legal,)g(commercial,)h | |
11686 | (philosophical,)d(ethical)h(or)g(p)s(olitical)e(p)s(osition)h | |
11687 | (regarding)330 408 y(them.)330 549 y(The)25 b(\\In)m(v)-5 | |
11688 | b(arian)m(t)26 b(Sections")g(are)g(certain)f(Secondary)h(Sections)f | |
11689 | (whose)g(titles)g(are)h(designated,)h(as)330 659 y(b)s(eing)e(those)i | |
11690 | (of)g(In)m(v)-5 b(arian)m(t)26 b(Sections,)i(in)d(the)i(notice)g(that)g | |
11691 | (sa)m(ys)g(that)g(the)g(Do)s(cumen)m(t)g(is)f(released)330 | |
11692 | 769 y(under)g(this)h(License.)39 b(If)27 b(a)h(section)g(do)s(es)g(not) | |
11693 | f(\014t)h(the)g(ab)s(o)m(v)m(e)h(de\014nition)c(of)j(Secondary)f(then)h | |
11694 | (it)f(is)330 878 y(not)32 b(allo)m(w)m(ed)g(to)g(b)s(e)g(designated)f | |
11695 | (as)h(In)m(v)-5 b(arian)m(t.)45 b(The)31 b(Do)s(cumen)m(t)i(ma)m(y)f | |
11696 | (con)m(tain)h(zero)f(In)m(v)-5 b(arian)m(t)330 988 y(Sections.)38 | |
11697 | b(If)25 b(the)f(Do)s(cumen)m(t)i(do)s(es)e(not)h(iden)m(tify)e(an)m(y)i | |
11698 | (In)m(v)-5 b(arian)m(t)24 b(Sections)h(then)f(there)h(are)g(none.)330 | |
11699 | 1129 y(The)36 b(\\Co)m(v)m(er)i(T)-8 b(exts")38 b(are)f(certain)f | |
11700 | (short)h(passages)g(of)g(text)g(that)h(are)f(listed,)g(as)f(F)-8 | |
11701 | b(ron)m(t-Co)m(v)m(er)330 1238 y(T)g(exts)26 b(or)f(Bac)m(k-Co)m(v)m | |
11702 | (er)j(T)-8 b(exts,)27 b(in)c(the)i(notice)h(that)f(sa)m(ys)h(that)g | |
11703 | (the)f(Do)s(cumen)m(t)h(is)e(released)g(under)330 1348 | |
11704 | y(this)h(License.)39 b(A)25 b(F)-8 b(ron)m(t-Co)m(v)m(er)29 | |
11705 | b(T)-8 b(ext)26 b(ma)m(y)h(b)s(e)e(at)i(most)f(5)g(w)m(ords,)g(and)g(a) | |
11706 | g(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext)26 b(ma)m(y)330 1457 | |
11707 | y(b)s(e)k(at)h(most)g(25)g(w)m(ords.)330 1598 y(A)36 | |
11708 | b(\\T)-8 b(ransparen)m(t")36 b(cop)m(y)g(of)g(the)f(Do)s(cumen)m(t)h | |
11709 | (means)g(a)g(mac)m(hine-readable)f(cop)m(y)-8 b(,)38 | |
11710 | b(represen)m(ted)330 1708 y(in)c(a)i(format)g(whose)g(sp)s | |
11711 | (eci\014cation)e(is)h(a)m(v)-5 b(ailable)35 b(to)i(the)f(general)f | |
11712 | (public,)g(that)h(is)f(suitable)f(for)330 1817 y(revising)c(the)i(do)s | |
11713 | (cumen)m(t)f(straigh)m(tforw)m(ardly)g(with)f(generic)i(text)h(editors) | |
11714 | e(or)g(\(for)h(images)g(com-)330 1927 y(p)s(osed)23 b(of)h(pixels\))e | |
11715 | (generic)i(pain)m(t)f(programs)h(or)f(\(for)h(dra)m(wings\))f(some)h | |
11716 | (widely)e(a)m(v)-5 b(ailable)23 b(dra)m(wing)330 2037 | |
11717 | y(editor,)29 b(and)g(that)g(is)f(suitable)g(for)h(input)e(to)j(text)g | |
11718 | (formatters)f(or)g(for)g(automatic)h(translation)e(to)330 | |
11719 | 2146 y(a)f(v)-5 b(ariet)m(y)27 b(of)g(formats)g(suitable)f(for)g(input) | |
11720 | f(to)j(text)g(formatters.)40 b(A)27 b(cop)m(y)g(made)g(in)f(an)h | |
11721 | (otherwise)330 2256 y(T)-8 b(ransparen)m(t)37 b(\014le)g(format)h | |
11722 | (whose)f(markup,)i(or)e(absence)h(of)g(markup,)g(has)g(b)s(een)f | |
11723 | (arranged)g(to)330 2365 y(th)m(w)m(art)27 b(or)g(discourage)f | |
11724 | (subsequen)m(t)g(mo)s(di\014cation)f(b)m(y)i(readers)f(is)f(not)i(T)-8 | |
11725 | b(ransparen)m(t.)39 b(An)27 b(image)330 2475 y(format)35 | |
11726 | b(is)e(not)i(T)-8 b(ransparen)m(t)34 b(if)f(used)h(for)g(an)m(y)g | |
11727 | (substan)m(tial)f(amoun)m(t)i(of)g(text.)53 b(A)35 b(cop)m(y)g(that)g | |
11728 | (is)330 2585 y(not)c(\\T)-8 b(ransparen)m(t")31 b(is)e(called)h | |
11729 | (\\Opaque".)330 2725 y(Examples)52 b(of)h(suitable)f(formats)h(for)g(T) | |
11730 | -8 b(ransparen)m(t)53 b(copies)g(include)e(plain)g Fl(asci)r(i)i | |
11731 | Ft(without)330 2835 y(markup,)41 b(T)-8 b(exinfo)39 b(input)f(format,)k | |
11732 | (LaT)1775 2855 y(E)1826 2835 y(X)d(input)f(format,)43 | |
11733 | b Fl(sgml)c Ft(or)g Fl(xml)g Ft(using)f(a)i(publicly)330 | |
11734 | 2945 y(a)m(v)-5 b(ailable)31 b Fl(dtd)p Ft(,)g(and)g | |
11735 | (standard-conforming)f(simple)g Fl(html)p Ft(,)h(P)m(ostScript)g(or)g | |
11736 | Fl(pdf)g Ft(designed)f(for)330 3054 y(h)m(uman)37 b(mo)s(di\014cation.) | |
11737 | 63 b(Examples)37 b(of)h(transparen)m(t)g(image)h(formats)f(include)e | |
11738 | Fl(png)p Ft(,)k Fl(x)n(cf)e Ft(and)330 3164 y Fl(jpg)p | |
11739 | Ft(.)63 b(Opaque)38 b(formats)g(include)e(proprietary)h(formats)h(that) | |
11740 | h(can)f(b)s(e)g(read)g(and)f(edited)h(only)330 3273 y(b)m(y)h | |
11741 | (proprietary)f(w)m(ord)h(pro)s(cessors,)j Fl(sgml)c Ft(or)i | |
11742 | Fl(xml)e Ft(for)i(whic)m(h)e(the)h Fl(dtd)g Ft(and/or)g(pro)s(cessing) | |
11743 | 330 3383 y(to)s(ols)31 b(are)g(not)g(generally)f(a)m(v)-5 | |
11744 | b(ailable,)31 b(and)f(the)h(mac)m(hine-generated)h Fl(html)p | |
11745 | Ft(,)e(P)m(ostScript)h(or)g Fl(pdf)330 3493 y Ft(pro)s(duced)e(b)m(y)h | |
11746 | (some)h(w)m(ord)f(pro)s(cessors)g(for)g(output)g(purp)s(oses)e(only)-8 | |
11747 | b(.)330 3634 y(The)34 b(\\Title)f(P)m(age")k(means,)e(for)f(a)h(prin)m | |
11748 | (ted)e(b)s(o)s(ok,)i(the)f(title)g(page)h(itself,)f(plus)f(suc)m(h)g | |
11749 | (follo)m(wing)330 3743 y(pages)28 b(as)g(are)g(needed)g(to)g(hold,)f | |
11750 | (legibly)-8 b(,)27 b(the)h(material)f(this)g(License)g(requires)f(to)i | |
11751 | (app)s(ear)f(in)g(the)330 3853 y(title)f(page.)40 b(F)-8 | |
11752 | b(or)28 b(w)m(orks)e(in)f(formats)i(whic)m(h)f(do)g(not)h(ha)m(v)m(e)h | |
11753 | (an)m(y)e(title)h(page)g(as)g(suc)m(h,)g(\\Title)f(P)m(age")330 | |
11754 | 3962 y(means)31 b(the)f(text)i(near)e(the)h(most)g(prominen)m(t)f(app)s | |
11755 | (earance)g(of)h(the)g(w)m(ork's)g(title,)f(preceding)g(the)330 | |
11756 | 4072 y(b)s(eginning)e(of)i(the)h(b)s(o)s(dy)e(of)h(the)h(text.)330 | |
11757 | 4213 y(A)f(section)g(\\En)m(titled)f(XYZ")h(means)f(a)h(named)g | |
11758 | (subunit)d(of)i(the)h(Do)s(cumen)m(t)h(whose)e(title)g(either)330 | |
11759 | 4322 y(is)e(precisely)f(XYZ)i(or)f(con)m(tains)h(XYZ)g(in)e(paren)m | |
11760 | (theses)j(follo)m(wing)d(text)j(that)f(translates)g(XYZ)f(in)330 | |
11761 | 4432 y(another)e(language.)39 b(\(Here)26 b(XYZ)f(stands)f(for)h(a)g | |
11762 | (sp)s(eci\014c)f(section)h(name)g(men)m(tioned)g(b)s(elo)m(w,)g(suc)m | |
11763 | (h)330 4542 y(as)j(\\Ac)m(kno)m(wledgemen)m(ts",)k(\\Dedications",)d | |
11764 | (\\Endorsemen)m(ts",)g(or)f(\\History".\))41 b(T)-8 b(o)29 | |
11765 | b(\\Preserv)m(e)330 4651 y(the)34 b(Title")f(of)g(suc)m(h)h(a)g | |
11766 | (section)f(when)g(y)m(ou)h(mo)s(dify)d(the)j(Do)s(cumen)m(t)h(means)e | |
11767 | (that)h(it)f(remains)g(a)330 4761 y(section)e(\\En)m(titled)e(XYZ")i | |
11768 | (according)f(to)h(this)f(de\014nition.)330 4902 y(The)d(Do)s(cumen)m(t) | |
11769 | i(ma)m(y)f(include)d(W)-8 b(arran)m(t)m(y)30 b(Disclaimers)c(next)i(to) | |
11770 | g(the)g(notice)g(whic)m(h)e(states)j(that)330 5011 y(this)k(License)g | |
11771 | (applies)f(to)j(the)f(Do)s(cumen)m(t.)52 b(These)33 b(W)-8 | |
11772 | b(arran)m(t)m(y)36 b(Disclaimers)c(are)j(considered)d(to)330 | |
11773 | 5121 y(b)s(e)37 b(included)e(b)m(y)i(reference)h(in)f(this)f(License,)j | |
11774 | (but)e(only)g(as)h(regards)f(disclaiming)e(w)m(arran)m(ties:)330 | |
11775 | 5230 y(an)m(y)i(other)g(implication)e(that)i(these)g(W)-8 | |
11776 | b(arran)m(t)m(y)39 b(Disclaimers)c(ma)m(y)j(ha)m(v)m(e)g(is)e(v)m(oid)g | |
11777 | (and)g(has)h(no)330 5340 y(e\013ect)32 b(on)e(the)h(meaning)e(of)i | |
11778 | (this)e(License.)p eop | |
11779 | %%Page: 133 139 | |
11780 | 133 138 bop 150 -116 a Ft(App)s(endix)28 b(C:)i(Cop)m(ying)f(This)g | |
11781 | (Man)m(ual)2062 b(133)199 299 y(2.)61 b(VERBA)-8 b(TIM)31 | |
11782 | b(COPYING)330 445 y(Y)-8 b(ou)39 b(ma)m(y)f(cop)m(y)h(and)e(distribute) | |
11783 | f(the)i(Do)s(cumen)m(t)h(in)e(an)m(y)h(medium,)g(either)g(commercially) | |
11784 | f(or)330 555 y(noncommercially)-8 b(,)45 b(pro)m(vided)c(that)i(this)e | |
11785 | (License,)46 b(the)c(cop)m(yrigh)m(t)h(notices,)j(and)c(the)h(license) | |
11786 | 330 664 y(notice)36 b(sa)m(ying)g(this)e(License)i(applies)d(to)k(the)f | |
11787 | (Do)s(cumen)m(t)g(are)g(repro)s(duced)e(in)h(all)f(copies,)k(and)330 | |
11788 | 774 y(that)27 b(y)m(ou)g(add)f(no)h(other)f(conditions)f(whatso)s(ev)m | |
11789 | (er)j(to)f(those)g(of)g(this)e(License.)39 b(Y)-8 b(ou)27 | |
11790 | b(ma)m(y)g(not)g(use)330 883 y(tec)m(hnical)33 b(measures)f(to)i | |
11791 | (obstruct)f(or)g(con)m(trol)g(the)g(reading)f(or)h(further)e(cop)m | |
11792 | (ying)i(of)g(the)g(copies)330 993 y(y)m(ou)25 b(mak)m(e)g(or)g | |
11793 | (distribute.)36 b(Ho)m(w)m(ev)m(er,)28 b(y)m(ou)d(ma)m(y)g(accept)h | |
11794 | (comp)s(ensation)e(in)f(exc)m(hange)k(for)d(copies.)330 | |
11795 | 1103 y(If)32 b(y)m(ou)g(distribute)e(a)j(large)f(enough)g(n)m(um)m(b)s | |
11796 | (er)f(of)h(copies)g(y)m(ou)g(m)m(ust)h(also)f(follo)m(w)f(the)h | |
11797 | (conditions)330 1212 y(in)d(section)i(3.)330 1358 y(Y)-8 | |
11798 | b(ou)21 b(ma)m(y)h(also)e(lend)g(copies,)i(under)e(the)h(same)g | |
11799 | (conditions)e(stated)j(ab)s(o)m(v)m(e,)i(and)c(y)m(ou)h(ma)m(y)g | |
11800 | (publicly)330 1468 y(displa)m(y)29 b(copies.)199 1614 | |
11801 | y(3.)61 b(COPYING)30 b(IN)g(QUANTITY)330 1760 y(If)25 | |
11802 | b(y)m(ou)g(publish)d(prin)m(ted)h(copies)i(\(or)h(copies)f(in)f(media)g | |
11803 | (that)i(commonly)f(ha)m(v)m(e)h(prin)m(ted)e(co)m(v)m(ers\))j(of)330 | |
11804 | 1870 y(the)32 b(Do)s(cumen)m(t,)h(n)m(um)m(b)s(ering)d(more)i(than)f | |
11805 | (100,)j(and)d(the)h(Do)s(cumen)m(t's)h(license)d(notice)i(requires)330 | |
11806 | 1979 y(Co)m(v)m(er)j(T)-8 b(exts,)36 b(y)m(ou)f(m)m(ust)f(enclose)h | |
11807 | (the)f(copies)g(in)f(co)m(v)m(ers)j(that)f(carry)-8 b(,)36 | |
11808 | b(clearly)d(and)h(legibly)-8 b(,)34 b(all)330 2089 y(these)40 | |
11809 | b(Co)m(v)m(er)g(T)-8 b(exts:)59 b(F)-8 b(ron)m(t-Co)m(v)m(er)41 | |
11810 | b(T)-8 b(exts)40 b(on)f(the)g(fron)m(t)g(co)m(v)m(er,)44 | |
11811 | b(and)38 b(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts)40 b(on)330 | |
11812 | 2198 y(the)29 b(bac)m(k)h(co)m(v)m(er.)42 b(Both)30 b(co)m(v)m(ers)h(m) | |
11813 | m(ust)e(also)g(clearly)f(and)h(legibly)e(iden)m(tify)g(y)m(ou)j(as)f | |
11814 | (the)h(publisher)330 2308 y(of)k(these)h(copies.)52 b(The)34 | |
11815 | b(fron)m(t)h(co)m(v)m(er)h(m)m(ust)e(presen)m(t)g(the)h(full)d(title)i | |
11816 | (with)e(all)i(w)m(ords)f(of)i(the)f(title)330 2418 y(equally)c | |
11817 | (prominen)m(t)f(and)h(visible.)40 b(Y)-8 b(ou)31 b(ma)m(y)g(add)g | |
11818 | (other)g(material)f(on)h(the)g(co)m(v)m(ers)h(in)d(addition.)330 | |
11819 | 2527 y(Cop)m(ying)35 b(with)g(c)m(hanges)i(limited)d(to)j(the)g(co)m(v) | |
11820 | m(ers,)i(as)d(long)g(as)h(they)f(preserv)m(e)g(the)h(title)e(of)i(the) | |
11821 | 330 2637 y(Do)s(cumen)m(t)h(and)e(satisfy)h(these)g(conditions,)h(can)f | |
11822 | (b)s(e)g(treated)h(as)f(v)m(erbatim)g(cop)m(ying)g(in)f(other)330 | |
11823 | 2746 y(resp)s(ects.)330 2892 y(If)c(the)h(required)e(texts)j(for)e | |
11824 | (either)g(co)m(v)m(er)j(are)e(to)s(o)g(v)m(oluminous)e(to)i(\014t)g | |
11825 | (legibly)-8 b(,)32 b(y)m(ou)h(should)e(put)330 3002 y(the)i(\014rst)f | |
11826 | (ones)h(listed)e(\(as)j(man)m(y)f(as)g(\014t)g(reasonably\))f(on)h(the) | |
11827 | g(actual)g(co)m(v)m(er,)i(and)e(con)m(tin)m(ue)g(the)330 | |
11828 | 3112 y(rest)e(on)m(to)g(adjacen)m(t)h(pages.)330 3258 | |
11829 | y(If)27 b(y)m(ou)g(publish)c(or)k(distribute)e(Opaque)h(copies)h(of)g | |
11830 | (the)h(Do)s(cumen)m(t)f(n)m(um)m(b)s(ering)e(more)j(than)e(100,)330 | |
11831 | 3367 y(y)m(ou)i(m)m(ust)g(either)g(include)d(a)k(mac)m(hine-readable)e | |
11832 | (T)-8 b(ransparen)m(t)28 b(cop)m(y)h(along)f(with)e(eac)m(h)j(Opaque) | |
11833 | 330 3477 y(cop)m(y)-8 b(,)38 b(or)d(state)h(in)e(or)h(with)f(eac)m(h)i | |
11834 | (Opaque)e(cop)m(y)i(a)g(computer-net)m(w)m(ork)g(lo)s(cation)f(from)f | |
11835 | (whic)m(h)330 3587 y(the)24 b(general)h(net)m(w)m(ork-using)f(public)d | |
11836 | (has)j(access)i(to)f(do)m(wnload)e(using)g(public-standard)e(net)m(w)m | |
11837 | (ork)330 3696 y(proto)s(cols)39 b(a)g(complete)g(T)-8 | |
11838 | b(ransparen)m(t)39 b(cop)m(y)g(of)g(the)h(Do)s(cumen)m(t,)i(free)d(of)g | |
11839 | (added)f(material.)65 b(If)330 3806 y(y)m(ou)39 b(use)g(the)g(latter)g | |
11840 | (option,)h(y)m(ou)g(m)m(ust)e(tak)m(e)j(reasonably)d(pruden)m(t)f | |
11841 | (steps,)k(when)d(y)m(ou)h(b)s(egin)330 3915 y(distribution)c(of)j | |
11842 | (Opaque)g(copies)g(in)e(quan)m(tit)m(y)-8 b(,)42 b(to)c(ensure)g(that)h | |
11843 | (this)e(T)-8 b(ransparen)m(t)38 b(cop)m(y)h(will)330 | |
11844 | 4025 y(remain)29 b(th)m(us)h(accessible)g(at)h(the)f(stated)h(lo)s | |
11845 | (cation)f(un)m(til)e(at)j(least)g(one)f(y)m(ear)h(after)g(the)f(last)g | |
11846 | (time)330 4134 y(y)m(ou)37 b(distribute)d(an)j(Opaque)f(cop)m(y)i | |
11847 | (\(directly)e(or)g(through)g(y)m(our)h(agen)m(ts)h(or)f(retailers\))f | |
11848 | (of)h(that)330 4244 y(edition)29 b(to)i(the)g(public.)330 | |
11849 | 4390 y(It)k(is)e(requested,)j(but)e(not)h(required,)f(that)h(y)m(ou)g | |
11850 | (con)m(tact)h(the)f(authors)f(of)h(the)g(Do)s(cumen)m(t)g(w)m(ell)330 | |
11851 | 4500 y(b)s(efore)28 b(redistributing)d(an)m(y)k(large)g(n)m(um)m(b)s | |
11852 | (er)e(of)i(copies,)g(to)g(giv)m(e)g(them)g(a)g(c)m(hance)h(to)f(pro)m | |
11853 | (vide)f(y)m(ou)330 4609 y(with)h(an)h(up)s(dated)f(v)m(ersion)h(of)h | |
11854 | (the)f(Do)s(cumen)m(t.)199 4755 y(4.)61 b(MODIFICA)-8 | |
11855 | b(TIONS)330 4902 y(Y)g(ou)26 b(ma)m(y)g(cop)m(y)g(and)f(distribute)e(a) | |
11856 | j(Mo)s(di\014ed)e(V)-8 b(ersion)25 b(of)h(the)g(Do)s(cumen)m(t)g(under) | |
11857 | e(the)h(conditions)330 5011 y(of)c(sections)g(2)h(and)e(3)h(ab)s(o)m(v) | |
11858 | m(e,)k(pro)m(vided)19 b(that)j(y)m(ou)f(release)h(the)f(Mo)s(di\014ed)e | |
11859 | (V)-8 b(ersion)21 b(under)e(precisely)330 5121 y(this)28 | |
11860 | b(License,)h(with)f(the)h(Mo)s(di\014ed)e(V)-8 b(ersion)29 | |
11861 | b(\014lling)d(the)j(role)g(of)g(the)g(Do)s(cumen)m(t,)h(th)m(us)f | |
11862 | (licensing)330 5230 y(distribution)h(and)k(mo)s(di\014cation)e(of)j | |
11863 | (the)f(Mo)s(di\014ed)e(V)-8 b(ersion)34 b(to)h(who)s(ev)m(er)f(p)s | |
11864 | (ossesses)f(a)i(cop)m(y)g(of)330 5340 y(it.)40 b(In)30 | |
11865 | b(addition,)f(y)m(ou)h(m)m(ust)h(do)f(these)h(things)e(in)g(the)i(Mo)s | |
11866 | (di\014ed)d(V)-8 b(ersion:)p eop | |
11867 | %%Page: 134 140 | |
11868 | 134 139 bop 150 -116 a Ft(134)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
11869 | 357 299 y(A.)60 b(Use)33 b(in)e(the)i(Title)f(P)m(age)i(\(and)f(on)f | |
11870 | (the)h(co)m(v)m(ers,)i(if)d(an)m(y\))h(a)g(title)f(distinct)f(from)i | |
11871 | (that)g(of)g(the)510 408 y(Do)s(cumen)m(t,)j(and)d(from)g(those)i(of)f | |
11872 | (previous)e(v)m(ersions)h(\(whic)m(h)g(should,)g(if)g(there)h(w)m(ere)g | |
11873 | (an)m(y)-8 b(,)510 518 y(b)s(e)31 b(listed)f(in)g(the)h(History)g | |
11874 | (section)g(of)h(the)f(Do)s(cumen)m(t\).)45 b(Y)-8 b(ou)32 | |
11875 | b(ma)m(y)g(use)f(the)g(same)h(title)f(as)510 628 y(a)g(previous)e(v)m | |
11876 | (ersion)g(if)h(the)g(original)f(publisher)e(of)j(that)h(v)m(ersion)f | |
11877 | (giv)m(es)h(p)s(ermission.)360 758 y(B.)61 b(List)30 | |
11878 | b(on)g(the)h(Title)e(P)m(age,)k(as)d(authors,)h(one)g(or)f(more)h(p)s | |
11879 | (ersons)e(or)h(en)m(tities)h(resp)s(onsible)c(for)510 | |
11880 | 867 y(authorship)d(of)i(the)h(mo)s(di\014cations)d(in)h(the)h(Mo)s | |
11881 | (di\014ed)e(V)-8 b(ersion,)27 b(together)h(with)c(at)j(least)g(\014v)m | |
11882 | (e)510 977 y(of)d(the)g(principal)d(authors)i(of)i(the)f(Do)s(cumen)m | |
11883 | (t)g(\(all)f(of)i(its)e(principal)e(authors,)k(if)e(it)g(has)h(few)m | |
11884 | (er)510 1087 y(than)30 b(\014v)m(e\),)h(unless)e(they)i(release)f(y)m | |
11885 | (ou)h(from)f(this)f(requiremen)m(t.)359 1217 y(C.)60 | |
11886 | b(State)32 b(on)e(the)h(Title)f(page)h(the)g(name)g(of)g(the)g | |
11887 | (publisher)c(of)k(the)g(Mo)s(di\014ed)e(V)-8 b(ersion,)31 | |
11888 | b(as)g(the)510 1326 y(publisher.)355 1456 y(D.)61 b(Preserv)m(e)31 | |
11889 | b(all)e(the)i(cop)m(yrigh)m(t)g(notices)f(of)h(the)f(Do)s(cumen)m(t.) | |
11890 | 363 1587 y(E.)60 b(Add)30 b(an)i(appropriate)e(cop)m(yrigh)m(t)i | |
11891 | (notice)f(for)h(y)m(our)f(mo)s(di\014cations)e(adjacen)m(t)k(to)f(the)g | |
11892 | (other)510 1696 y(cop)m(yrigh)m(t)f(notices.)365 1826 | |
11893 | y(F.)61 b(Include,)27 b(immediately)f(after)i(the)h(cop)m(yrigh)m(t)f | |
11894 | (notices,)h(a)f(license)f(notice)h(giving)f(the)h(public)510 | |
11895 | 1936 y(p)s(ermission)21 b(to)26 b(use)e(the)g(Mo)s(di\014ed)f(V)-8 | |
11896 | b(ersion)24 b(under)f(the)i(terms)f(of)h(this)e(License,)j(in)d(the)h | |
11897 | (form)510 2045 y(sho)m(wn)30 b(in)f(the)h(Addendum)f(b)s(elo)m(w.)353 | |
11898 | 2176 y(G.)61 b(Preserv)m(e)23 b(in)f(that)h(license)f(notice)h(the)g | |
11899 | (full)e(lists)g(of)i(In)m(v)-5 b(arian)m(t)22 b(Sections)h(and)f | |
11900 | (required)f(Co)m(v)m(er)510 2285 y(T)-8 b(exts)31 b(giv)m(en)f(in)f | |
11901 | (the)i(Do)s(cumen)m(t's)g(license)f(notice.)357 2415 | |
11902 | y(H.)60 b(Include)29 b(an)h(unaltered)f(cop)m(y)i(of)g(this)e(License.) | |
11903 | 392 2545 y(I.)60 b(Preserv)m(e)33 b(the)f(section)g(En)m(titled)f | |
11904 | (\\History",)i(Preserv)m(e)g(its)e(Title,)h(and)f(add)h(to)h(it)e(an)h | |
11905 | (item)510 2655 y(stating)c(at)h(least)f(the)h(title,)f(y)m(ear,)i(new)d | |
11906 | (authors,)i(and)e(publisher)d(of)29 b(the)f(Mo)s(di\014ed)e(V)-8 | |
11907 | b(ersion)510 2765 y(as)32 b(giv)m(en)f(on)g(the)h(Title)e(P)m(age.)45 | |
11908 | b(If)31 b(there)h(is)e(no)h(section)h(En)m(titled)e(\\History")i(in)e | |
11909 | (the)h(Do)s(cu-)510 2874 y(men)m(t,)37 b(create)f(one)f(stating)g(the)g | |
11910 | (title,)g(y)m(ear,)i(authors,)f(and)e(publisher)d(of)k(the)g(Do)s | |
11911 | (cumen)m(t)510 2984 y(as)h(giv)m(en)g(on)g(its)g(Title)f(P)m(age,)k | |
11912 | (then)d(add)g(an)g(item)f(describing)f(the)i(Mo)s(di\014ed)f(V)-8 | |
11913 | b(ersion)36 b(as)510 3093 y(stated)31 b(in)e(the)i(previous)e(sen)m | |
11914 | (tence.)378 3224 y(J.)60 b(Preserv)m(e)33 b(the)g(net)m(w)m(ork)g(lo)s | |
11915 | (cation,)g(if)e(an)m(y)-8 b(,)34 b(giv)m(en)e(in)g(the)g(Do)s(cumen)m | |
11916 | (t)h(for)g(public)c(access)34 b(to)510 3333 y(a)e(T)-8 | |
11917 | b(ransparen)m(t)30 b(cop)m(y)i(of)g(the)f(Do)s(cumen)m(t,)h(and)f(lik)m | |
11918 | (ewise)e(the)j(net)m(w)m(ork)g(lo)s(cations)e(giv)m(en)h(in)510 | |
11919 | 3443 y(the)h(Do)s(cumen)m(t)g(for)g(previous)e(v)m(ersions)h(it)g(w)m | |
11920 | (as)h(based)f(on.)45 b(These)31 b(ma)m(y)h(b)s(e)f(placed)g(in)g(the) | |
11921 | 510 3552 y(\\History")26 b(section.)39 b(Y)-8 b(ou)25 | |
11922 | b(ma)m(y)h(omit)f(a)g(net)m(w)m(ork)h(lo)s(cation)e(for)h(a)h(w)m(ork)f | |
11923 | (that)g(w)m(as)h(published)510 3662 y(at)36 b(least)g(four)f(y)m(ears)i | |
11924 | (b)s(efore)e(the)h(Do)s(cumen)m(t)h(itself,)f(or)f(if)g(the)h(original) | |
11925 | e(publisher)e(of)k(the)510 3771 y(v)m(ersion)30 b(it)g(refers)g(to)h | |
11926 | (giv)m(es)g(p)s(ermission.)354 3902 y(K.)60 b(F)-8 b(or)24 | |
11927 | b(an)m(y)h(section)e(En)m(titled)g(\\Ac)m(kno)m(wledgemen)m(ts")j(or)e | |
11928 | (\\Dedications",)i(Preserv)m(e)e(the)g(Title)510 4011 | |
11929 | y(of)j(the)f(section,)i(and)e(preserv)m(e)h(in)e(the)i(section)f(all)g | |
11930 | (the)g(substance)h(and)f(tone)h(of)f(eac)m(h)i(of)f(the)510 | |
11931 | 4121 y(con)m(tributor)j(ac)m(kno)m(wledgemen)m(ts)i(and/or)e | |
11932 | (dedications)f(giv)m(en)i(therein.)368 4251 y(L.)60 b(Preserv)m(e)36 | |
11933 | b(all)e(the)i(In)m(v)-5 b(arian)m(t)35 b(Sections)g(of)g(the)h(Do)s | |
11934 | (cumen)m(t,)h(unaltered)e(in)f(their)g(text)j(and)510 | |
11935 | 4361 y(in)e(their)g(titles.)56 b(Section)36 b(n)m(um)m(b)s(ers)e(or)i | |
11936 | (the)g(equiv)-5 b(alen)m(t)36 b(are)g(not)g(considered)f(part)h(of)g | |
11937 | (the)510 4470 y(section)31 b(titles.)341 4600 y(M.)61 | |
11938 | b(Delete)32 b(an)m(y)f(section)g(En)m(titled)e(\\Endorsemen)m(ts".)42 | |
11939 | b(Suc)m(h)30 b(a)i(section)e(ma)m(y)i(not)f(b)s(e)f(included)510 | |
11940 | 4710 y(in)f(the)i(Mo)s(di\014ed)d(V)-8 b(ersion.)357 | |
11941 | 4840 y(N.)60 b(Do)29 b(not)g(retitle)f(an)m(y)g(existing)g(section)g | |
11942 | (to)h(b)s(e)f(En)m(titled)f(\\Endorsemen)m(ts")i(or)f(to)h(con\015ict)f | |
11943 | (in)510 4950 y(title)i(with)f(an)m(y)i(In)m(v)-5 b(arian)m(t)30 | |
11944 | b(Section.)354 5080 y(O.)60 b(Preserv)m(e)31 b(an)m(y)g(W)-8 | |
11945 | b(arran)m(t)m(y)32 b(Disclaimers.)330 5230 y(If)h(the)g(Mo)s(di\014ed)f | |
11946 | (V)-8 b(ersion)33 b(includes)e(new)i(fron)m(t-matter)i(sections)e(or)g | |
11947 | (app)s(endices)f(that)i(qualify)330 5340 y(as)28 b(Secondary)g | |
11948 | (Sections)f(and)g(con)m(tain)i(no)e(material)h(copied)f(from)g(the)h | |
11949 | (Do)s(cumen)m(t,)i(y)m(ou)e(ma)m(y)g(at)p eop | |
11950 | %%Page: 135 141 | |
11951 | 135 140 bop 150 -116 a Ft(App)s(endix)28 b(C:)i(Cop)m(ying)f(This)g | |
11952 | (Man)m(ual)2062 b(135)330 299 y(y)m(our)32 b(option)g(designate)h(some) | |
11953 | f(or)h(all)e(of)h(these)h(sections)g(as)f(in)m(v)-5 b(arian)m(t.)46 | |
11954 | b(T)-8 b(o)33 b(do)f(this,)g(add)g(their)330 408 y(titles)j(to)h(the)f | |
11955 | (list)f(of)i(In)m(v)-5 b(arian)m(t)35 b(Sections)g(in)f(the)i(Mo)s | |
11956 | (di\014ed)e(V)-8 b(ersion's)35 b(license)f(notice.)56 | |
11957 | b(These)330 518 y(titles)30 b(m)m(ust)g(b)s(e)g(distinct)f(from)g(an)m | |
11958 | (y)i(other)g(section)f(titles.)330 650 y(Y)-8 b(ou)43 | |
11959 | b(ma)m(y)g(add)f(a)g(section)h(En)m(titled)e(\\Endorsemen)m(ts",)46 | |
11960 | b(pro)m(vided)41 b(it)h(con)m(tains)g(nothing)g(but)330 | |
11961 | 759 y(endorsemen)m(ts)30 b(of)g(y)m(our)f(Mo)s(di\014ed)f(V)-8 | |
11962 | b(ersion)30 b(b)m(y)f(v)-5 b(arious)29 b(parties|for)g(example,)g | |
11963 | (statemen)m(ts)j(of)330 869 y(p)s(eer)27 b(review)f(or)h(that)h(the)f | |
11964 | (text)i(has)d(b)s(een)h(appro)m(v)m(ed)g(b)m(y)g(an)h(organization)f | |
11965 | (as)g(the)h(authoritativ)m(e)330 978 y(de\014nition)g(of)j(a)f | |
11966 | (standard.)330 1110 y(Y)-8 b(ou)29 b(ma)m(y)g(add)e(a)i(passage)g(of)g | |
11967 | (up)e(to)i(\014v)m(e)g(w)m(ords)e(as)i(a)g(F)-8 b(ron)m(t-Co)m(v)m(er) | |
11968 | 30 b(T)-8 b(ext,)30 b(and)e(a)g(passage)i(of)e(up)330 | |
11969 | 1219 y(to)g(25)g(w)m(ords)e(as)i(a)f(Bac)m(k-Co)m(v)m(er)j(T)-8 | |
11970 | b(ext,)29 b(to)f(the)f(end)f(of)i(the)f(list)f(of)h(Co)m(v)m(er)h(T)-8 | |
11971 | b(exts)27 b(in)f(the)i(Mo)s(di\014ed)330 1329 y(V)-8 | |
11972 | b(ersion.)57 b(Only)34 b(one)i(passage)h(of)f(F)-8 b(ron)m(t-Co)m(v)m | |
11973 | (er)38 b(T)-8 b(ext)36 b(and)g(one)g(of)g(Bac)m(k-Co)m(v)m(er)j(T)-8 | |
11974 | b(ext)36 b(ma)m(y)h(b)s(e)330 1439 y(added)27 b(b)m(y)g(\(or)h(through) | |
11975 | f(arrangemen)m(ts)h(made)g(b)m(y\))g(an)m(y)g(one)f(en)m(tit)m(y)-8 | |
11976 | b(.)41 b(If)27 b(the)h(Do)s(cumen)m(t)g(already)330 1548 | |
11977 | y(includes)k(a)i(co)m(v)m(er)h(text)g(for)f(the)g(same)h(co)m(v)m(er,)h | |
11978 | (previously)c(added)h(b)m(y)h(y)m(ou)g(or)g(b)m(y)g(arrangemen)m(t)330 | |
11979 | 1658 y(made)h(b)m(y)g(the)h(same)f(en)m(tit)m(y)h(y)m(ou)g(are)f | |
11980 | (acting)h(on)f(b)s(ehalf)e(of,)k(y)m(ou)f(ma)m(y)g(not)f(add)g | |
11981 | (another;)j(but)330 1767 y(y)m(ou)c(ma)m(y)h(replace)f(the)g(old)f | |
11982 | (one,)j(on)e(explicit)e(p)s(ermission)f(from)i(the)i(previous)d | |
11983 | (publisher)e(that)330 1877 y(added)g(the)g(old)g(one.)330 | |
11984 | 2008 y(The)25 b(author\(s\))h(and)f(publisher\(s\))d(of)k(the)f(Do)s | |
11985 | (cumen)m(t)h(do)g(not)f(b)m(y)h(this)e(License)h(giv)m(e)h(p)s | |
11986 | (ermission)330 2118 y(to)31 b(use)f(their)f(names)i(for)f(publicit)m(y) | |
11987 | d(for)k(or)f(to)h(assert)g(or)f(imply)e(endorsemen)m(t)i(of)h(an)m(y)g | |
11988 | (Mo)s(di\014ed)330 2228 y(V)-8 b(ersion.)199 2359 y(5.)61 | |
11989 | b(COMBINING)31 b(DOCUMENTS)330 2491 y(Y)-8 b(ou)39 b(ma)m(y)g(com)m | |
11990 | (bine)g(the)g(Do)s(cumen)m(t)g(with)f(other)g(do)s(cumen)m(ts)h | |
11991 | (released)f(under)g(this)f(License,)330 2600 y(under)g(the)h(terms)g | |
11992 | (de\014ned)f(in)g(section)h(4)h(ab)s(o)m(v)m(e)g(for)f(mo)s(di\014ed)e | |
11993 | (v)m(ersions,)k(pro)m(vided)d(that)i(y)m(ou)330 2710 | |
11994 | y(include)23 b(in)h(the)h(com)m(bination)g(all)f(of)i(the)f(In)m(v)-5 | |
11995 | b(arian)m(t)25 b(Sections)g(of)h(all)e(of)h(the)h(original)d(do)s | |
11996 | (cumen)m(ts,)330 2819 y(unmo)s(di\014ed,)i(and)h(list)f(them)i(all)e | |
11997 | (as)i(In)m(v)-5 b(arian)m(t)27 b(Sections)f(of)h(y)m(our)g(com)m(bined) | |
11998 | f(w)m(ork)g(in)g(its)g(license)330 2929 y(notice,)31 | |
11999 | b(and)f(that)h(y)m(ou)f(preserv)m(e)h(all)e(their)h(W)-8 | |
12000 | b(arran)m(t)m(y)32 b(Disclaimers.)330 3061 y(The)e(com)m(bined)f(w)m | |
12001 | (ork)i(need)e(only)h(con)m(tain)g(one)h(cop)m(y)g(of)f(this)f(License,) | |
12002 | i(and)e(m)m(ultiple)f(iden)m(tical)330 3170 y(In)m(v)-5 | |
12003 | b(arian)m(t)32 b(Sections)g(ma)m(y)h(b)s(e)f(replaced)g(with)f(a)i | |
12004 | (single)e(cop)m(y)-8 b(.)48 b(If)32 b(there)h(are)g(m)m(ultiple)d(In)m | |
12005 | (v)-5 b(arian)m(t)330 3280 y(Sections)26 b(with)g(the)h(same)g(name)g | |
12006 | (but)f(di\013eren)m(t)g(con)m(ten)m(ts,)j(mak)m(e)f(the)f(title)f(of)h | |
12007 | (eac)m(h)h(suc)m(h)f(section)330 3389 y(unique)32 b(b)m(y)i(adding)e | |
12008 | (at)j(the)f(end)g(of)g(it,)g(in)f(paren)m(theses,)j(the)e(name)g(of)g | |
12009 | (the)g(original)e(author)i(or)330 3499 y(publisher)21 | |
12010 | b(of)k(that)h(section)f(if)f(kno)m(wn,)i(or)f(else)g(a)g(unique)e(n)m | |
12011 | (um)m(b)s(er.)38 b(Mak)m(e)26 b(the)g(same)f(adjustmen)m(t)330 | |
12012 | 3608 y(to)g(the)g(section)f(titles)g(in)f(the)i(list)e(of)h(In)m(v)-5 | |
12013 | b(arian)m(t)25 b(Sections)f(in)f(the)h(license)g(notice)h(of)f(the)h | |
12014 | (com)m(bined)330 3718 y(w)m(ork.)330 3850 y(In)41 b(the)g(com)m | |
12015 | (bination,)j(y)m(ou)d(m)m(ust)g(com)m(bine)g(an)m(y)h(sections)f(En)m | |
12016 | (titled)f(\\History")i(in)e(the)h(v)-5 b(ari-)330 3959 | |
12017 | y(ous)32 b(original)e(do)s(cumen)m(ts,)j(forming)e(one)h(section)g(En)m | |
12018 | (titled)f(\\History";)j(lik)m(ewise)d(com)m(bine)h(an)m(y)330 | |
12019 | 4069 y(sections)g(En)m(titled)e(\\Ac)m(kno)m(wledgemen)m(ts",)35 | |
12020 | b(and)c(an)m(y)h(sections)g(En)m(titled)f(\\Dedications".)45 | |
12021 | b(Y)-8 b(ou)330 4178 y(m)m(ust)30 b(delete)h(all)e(sections)i(En)m | |
12022 | (titled)e(\\Endorsemen)m(ts.")199 4310 y(6.)61 b(COLLECTIONS)28 | |
12023 | b(OF)i(DOCUMENTS)330 4441 y(Y)-8 b(ou)32 b(ma)m(y)h(mak)m(e)g(a)f | |
12024 | (collection)f(consisting)g(of)h(the)g(Do)s(cumen)m(t)g(and)g(other)g | |
12025 | (do)s(cumen)m(ts)f(released)330 4551 y(under)41 b(this)g(License,)k | |
12026 | (and)d(replace)g(the)h(individual)38 b(copies)k(of)g(this)f(License)h | |
12027 | (in)f(the)i(v)-5 b(arious)330 4661 y(do)s(cumen)m(ts)42 | |
12028 | b(with)f(a)i(single)e(cop)m(y)j(that)f(is)e(included)f(in)h(the)i | |
12029 | (collection,)i(pro)m(vided)c(that)j(y)m(ou)330 4770 y(follo)m(w)36 | |
12030 | b(the)i(rules)d(of)i(this)f(License)h(for)g(v)m(erbatim)g(cop)m(ying)g | |
12031 | (of)g(eac)m(h)h(of)f(the)h(do)s(cumen)m(ts)e(in)g(all)330 | |
12032 | 4880 y(other)31 b(resp)s(ects.)330 5011 y(Y)-8 b(ou)32 | |
12033 | b(ma)m(y)g(extract)h(a)f(single)e(do)s(cumen)m(t)h(from)g(suc)m(h)g(a)h | |
12034 | (collection,)f(and)g(distribute)e(it)i(individu-)330 | |
12035 | 5121 y(ally)j(under)f(this)h(License,)i(pro)m(vided)e(y)m(ou)h(insert)f | |
12036 | (a)h(cop)m(y)h(of)f(this)f(License)g(in)m(to)h(the)h(extracted)330 | |
12037 | 5230 y(do)s(cumen)m(t,)d(and)f(follo)m(w)g(this)f(License)h(in)g(all)f | |
12038 | (other)i(resp)s(ects)f(regarding)g(v)m(erbatim)g(cop)m(ying)h(of)330 | |
12039 | 5340 y(that)e(do)s(cumen)m(t.)p eop | |
12040 | %%Page: 136 142 | |
12041 | 136 141 bop 150 -116 a Ft(136)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
12042 | 199 299 y(7.)61 b(A)m(GGREGA)-8 b(TION)32 b(WITH)e(INDEPENDENT)h(W)m | |
12043 | (ORKS)330 428 y(A)d(compilation)f(of)h(the)g(Do)s(cumen)m(t)h(or)f(its) | |
12044 | f(deriv)-5 b(ativ)m(es)28 b(with)e(other)j(separate)g(and)e(indep)s | |
12045 | (enden)m(t)330 538 y(do)s(cumen)m(ts)33 b(or)g(w)m(orks,)h(in)e(or)i | |
12046 | (on)f(a)g(v)m(olume)g(of)h(a)f(storage)i(or)e(distribution)d(medium,)i | |
12047 | (is)h(called)330 648 y(an)d(\\aggregate")k(if)29 b(the)h(cop)m(yrigh)m | |
12048 | (t)h(resulting)d(from)h(the)i(compilation)d(is)h(not)i(used)e(to)i | |
12049 | (limit)d(the)330 757 y(legal)e(righ)m(ts)g(of)h(the)g(compilation's)e | |
12050 | (users)h(b)s(ey)m(ond)g(what)g(the)h(individual)22 b(w)m(orks)k(p)s | |
12051 | (ermit.)38 b(When)330 867 y(the)28 b(Do)s(cumen)m(t)g(is)f(included)e | |
12052 | (an)i(aggregate,)32 b(this)26 b(License)h(do)s(es)h(not)g(apply)e(to)i | |
12053 | (the)g(other)g(w)m(orks)330 976 y(in)h(the)i(aggregate)i(whic)m(h)c | |
12054 | (are)i(not)f(themselv)m(es)h(deriv)-5 b(ativ)m(e)30 b(w)m(orks)g(of)h | |
12055 | (the)f(Do)s(cumen)m(t.)330 1106 y(If)22 b(the)h(Co)m(v)m(er)h(T)-8 | |
12056 | b(ext)23 b(requiremen)m(t)f(of)h(section)g(3)g(is)f(applicable)f(to)i | |
12057 | (these)h(copies)e(of)h(the)g(Do)s(cumen)m(t,)330 1215 | |
12058 | y(then)f(if)f(the)i(Do)s(cumen)m(t)g(is)f(less)f(than)h(one)h(half)e | |
12059 | (of)i(the)g(en)m(tire)f(aggregate,)27 b(the)c(Do)s(cumen)m(t's)g(Co)m | |
12060 | (v)m(er)330 1325 y(T)-8 b(exts)27 b(ma)m(y)g(b)s(e)f(placed)g(on)h(co)m | |
12061 | (v)m(ers)h(that)f(brac)m(k)m(et)h(the)f(Do)s(cumen)m(t)g(within)d(the)j | |
12062 | (aggregate,)j(or)d(the)330 1435 y(electronic)35 b(equiv)-5 | |
12063 | b(alen)m(t)34 b(of)i(co)m(v)m(ers)g(if)e(the)h(Do)s(cumen)m(t)h(is)e | |
12064 | (in)g(electronic)h(form.)54 b(Otherwise)34 b(they)330 | |
12065 | 1544 y(m)m(ust)c(app)s(ear)g(on)g(prin)m(ted)f(co)m(v)m(ers)j(that)f | |
12066 | (brac)m(k)m(et)h(the)f(whole)e(aggregate.)199 1674 y(8.)61 | |
12067 | b(TRANSLA)-8 b(TION)330 1803 y(T)g(ranslation)39 b(is)g(considered)f(a) | |
12068 | j(kind)d(of)i(mo)s(di\014cation,)h(so)f(y)m(ou)g(ma)m(y)h(distribute)c | |
12069 | (translations)330 1913 y(of)45 b(the)f(Do)s(cumen)m(t)h(under)e(the)h | |
12070 | (terms)h(of)f(section)h(4.)83 b(Replacing)43 b(In)m(v)-5 | |
12071 | b(arian)m(t)44 b(Sections)g(with)330 2022 y(translations)g(requires)g | |
12072 | (sp)s(ecial)g(p)s(ermission)f(from)i(their)f(cop)m(yrigh)m(t)i | |
12073 | (holders,)i(but)d(y)m(ou)g(ma)m(y)330 2132 y(include)22 | |
12074 | b(translations)i(of)g(some)h(or)g(all)e(In)m(v)-5 b(arian)m(t)24 | |
12075 | b(Sections)g(in)f(addition)g(to)i(the)g(original)e(v)m(ersions)330 | |
12076 | 2242 y(of)32 b(these)f(In)m(v)-5 b(arian)m(t)32 b(Sections.)43 | |
12077 | b(Y)-8 b(ou)32 b(ma)m(y)g(include)d(a)j(translation)e(of)i(this)e | |
12078 | (License,)i(and)e(all)h(the)330 2351 y(license)40 b(notices)h(in)f(the) | |
12079 | i(Do)s(cumen)m(t,)j(and)40 b(an)m(y)i(W)-8 b(arran)m(t)m(y)42 | |
12080 | b(Disclaimers,)h(pro)m(vided)d(that)i(y)m(ou)330 2461 | |
12081 | y(also)e(include)e(the)i(original)e(English)g(v)m(ersion)h(of)h(this)f | |
12082 | (License)h(and)f(the)h(original)e(v)m(ersions)i(of)330 | |
12083 | 2570 y(those)35 b(notices)f(and)f(disclaimers.)50 b(In)33 | |
12084 | b(case)i(of)g(a)f(disagreemen)m(t)g(b)s(et)m(w)m(een)h(the)f | |
12085 | (translation)g(and)330 2680 y(the)h(original)f(v)m(ersion)g(of)i(this)e | |
12086 | (License)h(or)g(a)g(notice)h(or)f(disclaimer,)f(the)i(original)d(v)m | |
12087 | (ersion)i(will)330 2790 y(prev)-5 b(ail.)330 2919 y(If)28 | |
12088 | b(a)h(section)g(in)e(the)i(Do)s(cumen)m(t)h(is)d(En)m(titled)h(\\Ac)m | |
12089 | (kno)m(wledgemen)m(ts",)j(\\Dedications",)f(or)f(\\His-)330 | |
12090 | 3029 y(tory",)f(the)f(requiremen)m(t)e(\(section)i(4\))g(to)g(Preserv)m | |
12091 | (e)g(its)e(Title)h(\(section)g(1\))h(will)d(t)m(ypically)h(require)330 | |
12092 | 3138 y(c)m(hanging)30 b(the)h(actual)g(title.)199 3268 | |
12093 | y(9.)61 b(TERMINA)-8 b(TION)330 3397 y(Y)g(ou)30 b(ma)m(y)h(not)f(cop)m | |
12094 | (y)-8 b(,)31 b(mo)s(dify)-8 b(,)29 b(sublicense,)f(or)i(distribute)d | |
12095 | (the)j(Do)s(cumen)m(t)g(except)h(as)f(expressly)330 3507 | |
12096 | y(pro)m(vided)40 b(for)i(under)e(this)h(License.)74 b(An)m(y)42 | |
12097 | b(other)g(attempt)h(to)g(cop)m(y)-8 b(,)46 b(mo)s(dify)-8 | |
12098 | b(,)43 b(sublicense)d(or)330 3616 y(distribute)34 b(the)j(Do)s(cumen)m | |
12099 | (t)g(is)f(v)m(oid,)i(and)e(will)e(automatically)i(terminate)h(y)m(our)f | |
12100 | (righ)m(ts)g(under)330 3726 y(this)27 b(License.)39 b(Ho)m(w)m(ev)m | |
12101 | (er,)31 b(parties)c(who)g(ha)m(v)m(e)i(receiv)m(ed)f(copies,)h(or)e | |
12102 | (righ)m(ts,)h(from)g(y)m(ou)g(under)e(this)330 3836 y(License)36 | |
12103 | b(will)e(not)j(ha)m(v)m(e)h(their)e(licenses)f(terminated)i(so)g(long)f | |
12104 | (as)h(suc)m(h)f(parties)g(remain)g(in)f(full)330 3945 | |
12105 | y(compliance.)154 4075 y(10.)61 b(FUTURE)30 b(REVISIONS)f(OF)i(THIS)e | |
12106 | (LICENSE)330 4204 y(The)41 b(F)-8 b(ree)43 b(Soft)m(w)m(are)f(F)-8 | |
12107 | b(oundation)42 b(ma)m(y)g(publish)c(new,)44 b(revised)c(v)m(ersions)h | |
12108 | (of)h(the)g(GNU)g(F)-8 b(ree)330 4314 y(Do)s(cumen)m(tation)33 | |
12109 | b(License)e(from)h(time)g(to)h(time.)45 b(Suc)m(h)31 | |
12110 | b(new)h(v)m(ersions)f(will)f(b)s(e)h(similar)e(in)i(spirit)330 | |
12111 | 4423 y(to)k(the)g(presen)m(t)f(v)m(ersion,)h(but)f(ma)m(y)h(di\013er)e | |
12112 | (in)g(detail)g(to)i(address)f(new)g(problems)e(or)j(concerns.)330 | |
12113 | 4533 y(See)c Fs(http://www.gnu.org/copy)o(left)o(/)p | |
12114 | Ft(.)330 4663 y(Eac)m(h)f(v)m(ersion)f(of)h(the)f(License)g(is)g(giv)m | |
12115 | (en)g(a)h(distinguishing)25 b(v)m(ersion)k(n)m(um)m(b)s(er.)39 | |
12116 | b(If)29 b(the)g(Do)s(cumen)m(t)330 4772 y(sp)s(eci\014es)44 | |
12117 | b(that)i(a)g(particular)d(n)m(um)m(b)s(ered)h(v)m(ersion)h(of)g(this)f | |
12118 | (License)h(\\or)h(an)m(y)g(later)f(v)m(ersion")330 4882 | |
12119 | y(applies)31 b(to)i(it,)g(y)m(ou)f(ha)m(v)m(e)i(the)f(option)f(of)g | |
12120 | (follo)m(wing)f(the)i(terms)f(and)g(conditions)f(either)h(of)g(that)330 | |
12121 | 4991 y(sp)s(eci\014ed)k(v)m(ersion)i(or)f(of)h(an)m(y)h(later)f(v)m | |
12122 | (ersion)f(that)h(has)g(b)s(een)f(published)d(\(not)39 | |
12123 | b(as)f(a)g(draft\))g(b)m(y)330 5101 y(the)33 b(F)-8 b(ree)34 | |
12124 | b(Soft)m(w)m(are)f(F)-8 b(oundation.)48 b(If)32 b(the)h(Do)s(cumen)m(t) | |
12125 | g(do)s(es)g(not)g(sp)s(ecify)e(a)i(v)m(ersion)f(n)m(um)m(b)s(er)g(of) | |
12126 | 330 5210 y(this)h(License,)j(y)m(ou)e(ma)m(y)i(c)m(ho)s(ose)f(an)m(y)g | |
12127 | (v)m(ersion)f(ev)m(er)h(published)c(\(not)k(as)g(a)f(draft\))h(b)m(y)f | |
12128 | (the)h(F)-8 b(ree)330 5320 y(Soft)m(w)m(are)31 b(F)-8 | |
12129 | b(oundation.)p eop | |
12130 | %%Page: 137 143 | |
12131 | 137 142 bop 150 -116 a Ft(App)s(endix)28 b(C:)i(Cop)m(ying)f(This)g | |
12132 | (Man)m(ual)2062 b(137)150 299 y Fk(C.1.1)62 b(ADDENDUM:)41 | |
12133 | b(Ho)m(w)f(to)h(use)h(this)f(License)g(for)g(y)m(our)g(do)s(cumen)m(ts) | |
12134 | 275 543 y Ft(T)-8 b(o)27 b(use)g(this)f(License)h(in)f(a)i(do)s(cumen)m | |
12135 | (t)f(y)m(ou)h(ha)m(v)m(e)g(written,)f(include)e(a)j(cop)m(y)g(of)f(the) | |
12136 | h(License)f(in)f(the)150 653 y(do)s(cumen)m(t)k(and)g(put)g(the)g | |
12137 | (follo)m(wing)f(cop)m(yrigh)m(t)i(and)f(license)f(notices)h(just)g | |
12138 | (after)h(the)g(title)f(page:)468 765 y Fe(Copyright)42 | |
12139 | b(\(C\))79 b Fd(year)88 b(your)40 b(name)p Fe(.)468 852 | |
12140 | y(Permission)i(is)e(granted)g(to)g(copy,)h(distribute)g(and/or)g | |
12141 | (modify)f(this)g(document)468 939 y(under)h(the)f(terms)g(of)g(the)g | |
12142 | (GNU)g(Free)g(Documentation)i(License,)f(Version)g(1.2)468 | |
12143 | 1026 y(or)f(any)g(later)g(version)h(published)h(by)d(the)h(Free)g | |
12144 | (Software)h(Foundation;)468 1113 y(with)g(no)e(Invariant)j(Sections,)f | |
12145 | (no)f(Front-Cover)h(Texts,)g(and)f(no)f(Back-Cover)j(Texts.)468 | |
12146 | 1200 y(A)e(copy)g(of)g(the)g(license)g(is)g(included)h(in)f(the)g | |
12147 | (section)h(entitled)g(``GNU)468 1288 y(Free)g(Documentation)h | |
12148 | (License''.)275 1410 y Ft(If)d(y)m(ou)h(ha)m(v)m(e)h(In)m(v)-5 | |
12149 | b(arian)m(t)40 b(Sections,)i(F)-8 b(ron)m(t-Co)m(v)m(er)42 | |
12150 | b(T)-8 b(exts)41 b(and)e(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts,)43 | |
12151 | b(replace)d(the)150 1520 y(\\with...T)-8 b(exts.")42 | |
12152 | b(line)28 b(with)i(this:)547 1632 y Fe(with)40 b(the)g(Invariant)h | |
12153 | (Sections)g(being)g Fd(list)f(their)g(titles)p Fe(,)h(with)547 | |
12154 | 1719 y(the)f(Front-Cover)i(Texts)e(being)g Fd(list)p | |
12155 | Fe(,)h(and)f(with)g(the)g(Back-Cover)h(Texts)547 1806 | |
12156 | y(being)f Fd(list)p Fe(.)275 1929 y Ft(If)34 b(y)m(ou)i(ha)m(v)m(e)g | |
12157 | (In)m(v)-5 b(arian)m(t)35 b(Sections)g(without)f(Co)m(v)m(er)i(T)-8 | |
12158 | b(exts,)38 b(or)d(some)g(other)h(com)m(bination)e(of)i(the)150 | |
12159 | 2038 y(three,)31 b(merge)g(those)g(t)m(w)m(o)g(alternativ)m(es)g(to)g | |
12160 | (suit)e(the)i(situation.)275 2173 y(If)23 b(y)m(our)h(do)s(cumen)m(t)f | |
12161 | (con)m(tains)h(non)m(trivial)e(examples)i(of)g(program)f(co)s(de,)j(w)m | |
12162 | (e)e(recommend)g(releasing)150 2283 y(these)44 b(examples)e(in)g | |
12163 | (parallel)f(under)h(y)m(our)h(c)m(hoice)h(of)f(free)g(soft)m(w)m(are)h | |
12164 | (license,)i(suc)m(h)d(as)g(the)g(GNU)150 2392 y(General)30 | |
12165 | b(Public)e(License,)j(to)g(p)s(ermit)d(their)i(use)g(in)f(free)h(soft)m | |
12166 | (w)m(are.)p eop | |
12167 | %%Page: 138 144 | |
12168 | 138 143 bop 150 -116 a Ft(138)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
12169 | eop | |
12170 | %%Page: 139 145 | |
12171 | 139 144 bop 150 -116 a Ft(Index)30 b(of)g(Shell)e(Builtin)g(Commands) | |
12172 | 2133 b(139)150 299 y Fo(Index)53 b(of)h(Shell)g(Builtin)h(Commands)150 | |
12173 | 560 y Fr(.)150 686 y Fe(.)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12174 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g | |
12175 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
12176 | b Fb(33)150 945 y Fr(:)150 1071 y Fe(:)17 b Fc(.)12 b(.)h(.)f(.)g(.)h | |
12177 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12178 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12179 | (.)g(.)h(.)42 b Fb(33)150 1339 y Fr([)150 1465 y Fe([)17 | |
12180 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12181 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12182 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(37)150 1732 | |
12183 | y Fr(A)150 1858 y Fe(alias)11 b Fc(.)j(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12184 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12185 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 b | |
12186 | Fb(39)150 2116 y Fr(B)150 2242 y Fe(bg)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h | |
12187 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12188 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12189 | (.)41 b Fb(80)150 2334 y Fe(bind)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12190 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g | |
12191 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
12192 | b Fb(39)150 2426 y Fe(break)11 b Fc(.)j(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12193 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12194 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 b | |
12195 | Fb(33)150 2518 y Fe(builtin)8 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g | |
12196 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12197 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fb(40)150 | |
12198 | 2777 y Fr(C)150 2903 y Fe(caller)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.) | |
12199 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12200 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 | |
12201 | b Fb(40)150 2995 y Fe(cd)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12202 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12203 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
12204 | b Fb(33)150 3087 y Fe(command)8 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g | |
12205 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12206 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fb(41)150 | |
12207 | 3179 y Fe(compgen)7 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12208 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12209 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)33 b Fb(105)150 3271 y Fe(complete)26 | |
12210 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
12211 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12212 | 50 b Fb(105)150 3363 y Fe(continue)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.) | |
12213 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12214 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(34)150 | |
12215 | 3621 y Fr(D)150 3747 y Fe(declare)8 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f | |
12216 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12217 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b | |
12218 | Fb(41)150 3839 y Fe(dirs)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12219 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
12220 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
12221 | b Fb(73)150 3931 y Fe(disown)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12222 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12223 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(81)150 | |
12224 | 4190 y Fr(E)150 4316 y Fe(echo)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12225 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12226 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
12227 | b Fb(42)150 4408 y Fe(enable)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12228 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12229 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(42)150 | |
12230 | 4500 y Fe(eval)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12231 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12232 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(34)150 | |
12233 | 4592 y Fe(exec)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12234 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12235 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(34)150 | |
12236 | 4684 y Fe(exit)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12237 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12238 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(34)150 | |
12239 | 4776 y Fe(export)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12240 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12241 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(34)150 5053 | |
12242 | y Fr(F)150 5179 y Fe(fc)14 b Fc(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12243 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12244 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
12245 | b Fb(109)150 5271 y Fe(fg)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
12246 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12247 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
12248 | b Fb(80)150 5548 y Fr(G)150 5674 y Fe(getopts)8 b Fc(.)14 | |
12249 | b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12250 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12251 | g(.)34 b Fb(35)2025 560 y Fr(H)2025 676 y Fe(hash)13 | |
12252 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12253 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12254 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(35)2025 764 y Fe(help)13 | |
12255 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12256 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12257 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(43)2025 851 y Fe(history)7 | |
12258 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12259 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
12260 | g(.)h(.)33 b Fb(110)2025 1103 y Fr(J)2025 1219 y Fe(jobs)13 | |
12261 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12262 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12263 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(80)2025 1470 y Fr(K)2025 | |
12264 | 1586 y Fe(kill)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12265 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12266 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(81)2025 | |
12267 | 1819 y Fr(L)2025 1935 y Fe(let)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12268 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12269 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12270 | b Fb(43)2025 2023 y Fe(local)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12271 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12272 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
12273 | b Fb(43)2025 2110 y Fe(logout)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
12274 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12275 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b | |
12276 | Fb(43)2025 2362 y Fr(P)2025 2478 y Fe(popd)13 b Fc(.)g(.)f(.)g(.)g(.)h | |
12277 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12278 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12279 | b Fb(74)2025 2565 y Fe(printf)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
12280 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12281 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b | |
12282 | Fb(43)2025 2652 y Fe(pushd)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12283 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12284 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b | |
12285 | Fb(74)2025 2739 y Fe(pwd)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12286 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
12287 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12288 | b Fb(36)2025 2991 y Fr(R)2025 3107 y Fe(read)13 b Fc(.)g(.)f(.)g(.)g(.) | |
12289 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12290 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12291 | 38 b Fb(44)2025 3194 y Fe(readonly)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.) | |
12292 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12293 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(36)2025 | |
12294 | 3281 y Fe(return)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12295 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12296 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(36)2025 3514 | |
12297 | y Fr(S)2025 3630 y Fe(set)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12298 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12299 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12300 | b Fb(50)2025 3718 y Fe(shift)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12301 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12302 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
12303 | b Fb(36)2025 3805 y Fe(shopt)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12304 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12305 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
12306 | b Fb(45)2025 3892 y Fe(source)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
12307 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12308 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b | |
12309 | Fb(48)2025 3979 y Fe(suspend)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f | |
12310 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12311 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(81)2025 | |
12312 | 4231 y Fr(T)2025 4347 y Fe(test)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
12313 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12314 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12315 | b Fb(37)2025 4434 y Fe(times)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12316 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12317 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
12318 | b Fb(38)2025 4521 y Fe(trap)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12319 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12320 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12321 | b Fb(38)2025 4609 y Fe(type)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12322 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12323 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12324 | b Fb(48)2025 4696 y Fe(typeset)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) | |
12325 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12326 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(49)2025 | |
12327 | 4948 y Fr(U)2025 5064 y Fe(ulimit)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f | |
12328 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12329 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
12330 | b Fb(49)2025 5151 y Fe(umask)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12331 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12332 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
12333 | b Fb(38)2025 5238 y Fe(unalias)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) | |
12334 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12335 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(50)2025 | |
12336 | 5325 y Fe(unset)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12337 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12338 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(39)2025 5558 | |
12339 | y Fr(W)2025 5674 y Fe(wait)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12340 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12341 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12342 | b Fb(81)p eop | |
12343 | %%Page: 140 146 | |
12344 | 140 145 bop 150 -116 a Ft(140)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
12345 | eop | |
12346 | %%Page: 141 147 | |
12347 | 141 146 bop 150 -116 a Ft(Index)30 b(of)g(Shell)e(Reserv)m(ed)j(W)-8 | |
12348 | b(ords)2247 b(141)150 299 y Fo(Index)53 b(of)h(Shell)g(Reserv)l(ed)e(W) | |
12349 | -13 b(ords)150 610 y Fr(!)150 743 y Fe(!)18 b Fc(.)12 | |
12350 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12351 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12352 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 b Fb(8)150 1029 y | |
12353 | Fr([)150 1162 y Fe([[)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12354 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12355 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
12356 | b Fb(12)150 1455 y Fr(])150 1587 y Fe(]])15 b Fc(.)e(.)g(.)f(.)g(.)g(.) | |
12357 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12358 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12359 | f(.)41 b Fb(12)150 1873 y Fa({)150 2006 y Fe({)17 b Fc(.)12 | |
12360 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12361 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12362 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(13)150 2292 y Fa(})150 | |
12363 | 2425 y Fe(})17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12364 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
12365 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
12366 | b Fb(13)150 2709 y Fr(C)150 2842 y Fe(case)13 b Fc(.)g(.)f(.)g(.)h(.)f | |
12367 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12368 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
12369 | b Fb(11)150 3119 y Fr(D)150 3252 y Fe(do)16 b Fc(.)d(.)g(.)f(.)g(.)h(.) | |
12370 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12371 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12372 | f(.)g(.)43 b Fb(9)150 3347 y Fe(done)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.) | |
12373 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12374 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12375 | b Fb(9)2025 610 y Fr(E)2025 726 y Fe(elif)13 b Fc(.)g(.)f(.)g(.)g(.)h | |
12376 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12377 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12378 | b Fb(10)2025 814 y Fe(else)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12379 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12380 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12381 | b Fb(10)2025 901 y Fe(esac)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12382 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12383 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12384 | b Fb(11)2025 1134 y Fr(F)2025 1250 y Fe(fi)15 b Fc(.)e(.)f(.)h(.)f(.)g | |
12385 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12386 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12387 | (.)f(.)41 b Fb(10)2025 1338 y Fe(for)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.) | |
12388 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12389 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12390 | b Fb(10)2025 1425 y Fe(function)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h | |
12391 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12392 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(13)2025 | |
12393 | 1658 y Fr(I)2025 1775 y Fe(if)15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
12394 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12395 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
12396 | b Fb(10)2025 1862 y Fe(in)15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12397 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12398 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
12399 | b Fb(11)2025 2095 y Fr(S)2025 2211 y Fe(select)10 b Fc(.)j(.)f(.)h(.)f | |
12400 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12401 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
12402 | b Fb(11)2025 2445 y Fr(T)2025 2561 y Fe(then)13 b Fc(.)g(.)f(.)g(.)g(.) | |
12403 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12404 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
12405 | 38 b Fb(10)2025 2648 y Fe(time)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
12406 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12407 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)40 | |
12408 | b Fb(8)2025 2881 y Fr(U)2025 2998 y Fe(until)12 b Fc(.)h(.)g(.)f(.)g(.) | |
12409 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12410 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12411 | 38 b Fb(9)2025 3231 y Fr(W)2025 3347 y Fe(while)11 b | |
12412 | Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12413 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12414 | g(.)h(.)f(.)g(.)37 b Fb(10)p eop | |
12415 | %%Page: 142 148 | |
12416 | 142 147 bop 150 -116 a Ft(142)2527 b(Bash)31 b(Reference)g(Man)m(ual)p | |
12417 | eop | |
12418 | %%Page: 143 149 | |
12419 | 143 148 bop 150 -116 a Ft(P)m(arameter)32 b(and)d(V)-8 | |
12420 | b(ariable)30 b(Index)2262 b(143)150 299 y Fo(P)l(arameter)53 | |
12421 | b(and)g(V)-13 b(ariable)55 b(Index)150 610 y Fr(!)150 | |
12422 | 727 y Fe(!)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12423 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
12424 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
12425 | b Fb(16)150 963 y Fr(#)150 1080 y Fe(#)17 b Fc(.)12 b(.)h(.)f(.)g(.)h | |
12426 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12427 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12428 | (.)g(.)h(.)42 b Fb(16)150 1325 y Fr($)150 1442 y Fe($)17 | |
12429 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12430 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12431 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)150 1694 | |
12432 | y Fr(*)150 1811 y Fe(*)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12433 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12434 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
12435 | b Fb(15)150 2046 y Fr(-)150 2163 y Fe(-)17 b Fc(.)12 | |
12436 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12437 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12438 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)150 2399 y Fr(?)150 | |
12439 | 2516 y Fe(?)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12440 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
12441 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
12442 | b Fb(16)150 2751 y Fr(@)150 2868 y Fe(@)17 b Fc(.)12 | |
12443 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12444 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12445 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(15)p 159 3104 41 | |
12446 | 6 v 150 3221 a Fe(_)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12447 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12448 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
12449 | b Fb(16)150 3456 y Fr(0)150 3573 y Fe(0)17 b Fc(.)12 | |
12450 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12451 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12452 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)150 3809 y Fr(A)150 | |
12453 | 3926 y Fe(auto_resume)23 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12454 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12455 | (.)f(.)g(.)h(.)f(.)46 b Fb(82)150 4171 y Fr(B)150 4288 | |
12456 | y Fe(BASH)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12457 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12458 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(55)150 4375 | |
12459 | y Fe(BASH_ARGC)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12460 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12461 | h(.)f(.)g(.)h(.)f(.)49 b Fb(56)150 4463 y Fe(BASH_ARGV)25 | |
12462 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12463 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12464 | 49 b Fb(56)150 4551 y Fe(BASH_COMMAND)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.) | |
12465 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12466 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 b Fb(56)150 4638 y | |
12467 | Fe(BASH_ENV)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12468 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12469 | g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(56)150 4726 y Fe(BASH_EXECUTION_STRING) | |
12470 | d Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12471 | (.)g(.)h(.)f(.)g(.)50 b Fb(56)150 4814 y Fe(BASH_LINENO)23 | |
12472 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12473 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 | |
12474 | b Fb(56)150 4901 y Fe(BASH_REMATCH)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h | |
12475 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12476 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 b Fb(56)150 4989 y Fe(BASH_SOURCE)23 | |
12477 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12478 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 | |
12479 | b Fb(56)150 5077 y Fe(BASH_SUBSHELL)18 b Fc(.)d(.)d(.)h(.)f(.)g(.)g(.)h | |
12480 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12481 | h(.)f(.)g(.)h(.)f(.)43 b Fb(56)150 5165 y Fe(BASH_VERSINFO)18 | |
12482 | b Fc(.)d(.)d(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12483 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 | |
12484 | b Fb(56)150 5252 y Fe(BASH_VERSION)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h | |
12485 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12486 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 b Fb(57)150 5340 y Fe(bell-style)24 | |
12487 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12488 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 | |
12489 | b Fb(87)2025 610 y Fr(C)2025 730 y Fe(CDPATH)10 b Fc(.)j(.)f(.)h(.)f(.) | |
12490 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12491 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
12492 | b Fb(55)2025 819 y Fe(COLUMNS)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f | |
12493 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12494 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(57)2025 | |
12495 | 908 y Fe(comment-begin)18 b Fc(.)d(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12496 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12497 | g(.)h(.)43 b Fb(87)2025 997 y Fe(COMP_CWORD)24 b Fc(.)12 | |
12498 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
12499 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 | |
12500 | b Fb(57)2025 1086 y Fe(COMP_LINE)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g | |
12501 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12502 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(57)2025 1175 | |
12503 | y Fe(COMP_POINT)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12504 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12505 | g(.)h(.)f(.)g(.)48 b Fb(57)2025 1264 y Fe(COMP_WORDBREAKS)15 | |
12506 | b Fc(.)g(.)e(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12507 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 b Fb(57)2025 | |
12508 | 1353 y Fe(COMP_WORDS)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12509 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12510 | f(.)g(.)h(.)f(.)g(.)48 b Fb(57)2025 1442 y Fe(completion-query-items)27 | |
12511 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12512 | (.)f(.)g(.)h(.)48 b Fb(87)2025 1531 y Fe(COMPREPLY)25 | |
12513 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12514 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12515 | 49 b Fb(58)2025 1621 y Fe(convert-meta)22 b Fc(.)12 b(.)g(.)h(.)f(.)g | |
12516 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12517 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 b Fb(87)2025 1863 | |
12518 | y Fr(D)2025 1983 y Fe(DIRSTACK)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) | |
12519 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12520 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(58)2025 | |
12521 | 2072 y Fe(disable-completion)10 b Fc(.)17 b(.)12 b(.)g(.)g(.)h(.)f(.)g | |
12522 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12523 | 36 b Fb(87)2025 2333 y Fr(E)2025 2453 y Fe(editing-mode)22 | |
12524 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12525 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
12526 | b Fb(88)2025 2542 y Fe(EMACS)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12527 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12528 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
12529 | b Fb(58)2025 2631 y Fe(enable-keypad)18 b Fc(.)d(.)d(.)g(.)h(.)f(.)g(.) | |
12530 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12531 | (.)g(.)h(.)f(.)g(.)h(.)43 b Fb(88)2025 2720 y Fe(EUID)13 | |
12532 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12533 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12534 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(58)2025 2809 y Fe(expand-tilde)22 | |
12535 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12536 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
12537 | b Fb(88)2025 3071 y Fr(F)2025 3190 y Fe(FCEDIT)10 b Fc(.)j(.)f(.)h(.)f | |
12538 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12539 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
12540 | b Fb(58)2025 3279 y Fe(FIGNORE)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) | |
12541 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12542 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(58)2025 | |
12543 | 3368 y Fe(FUNCNAME)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12544 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12545 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(58)2025 3611 y | |
12546 | Fr(G)2025 3731 y Fe(GLOBIGNORE)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
12547 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12548 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(58)2025 3820 | |
12549 | y Fe(GROUPS)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12550 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12551 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(58)2025 4063 y Fr(H)2025 | |
12552 | 4182 y Fe(histchars)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12553 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12554 | g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(58)2025 4271 y Fe(HISTCMD)8 | |
12555 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12556 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12557 | g(.)h(.)f(.)34 b Fb(59)2025 4360 y Fe(HISTCONTROL)23 | |
12558 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12559 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)46 | |
12560 | b Fb(59)2025 4449 y Fe(HISTFILE)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h | |
12561 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12562 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(59)2025 | |
12563 | 4539 y Fe(HISTFILESIZE)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12564 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12565 | g(.)h(.)f(.)g(.)45 b Fb(59)2025 4628 y Fe(HISTIGNORE)24 | |
12566 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12567 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 | |
12568 | b Fb(59)2025 4717 y Fe(history-preserve-point)27 b Fc(.)13 | |
12569 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12570 | (.)h(.)48 b Fb(88)2025 4806 y Fe(HISTSIZE)7 b Fc(.)14 | |
12571 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12572 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12573 | 32 b Fb(59)2025 4895 y Fe(HISTTIMEFORMAT)16 b Fc(.)f(.)e(.)f(.)g(.)h(.) | |
12574 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12575 | (.)f(.)g(.)g(.)h(.)f(.)42 b Fb(59)2025 4984 y Fe(HOME)13 | |
12576 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12577 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12578 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(55)2025 5073 y Fe | |
12579 | (horizontal-scroll-mode)27 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12580 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fb(88)2025 | |
12581 | 5162 y Fe(HOSTFILE)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12582 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12583 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(59)2025 5251 y | |
12584 | Fe(HOSTNAME)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12585 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12586 | f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(60)2025 5340 y Fe(HOSTTYPE)7 | |
12587 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12588 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12589 | g(.)h(.)32 b Fb(60)p eop | |
12590 | %%Page: 144 150 | |
12591 | 144 149 bop 150 -116 a Ft(144)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
12592 | 150 299 y Fr(I)150 416 y Fe(IFS)14 b Fc(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
12593 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12594 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 | |
12595 | b Fb(55)150 503 y Fe(IGNOREEOF)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
12596 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12597 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(60)150 591 | |
12598 | y Fe(input-meta)24 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
12599 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12600 | h(.)f(.)g(.)h(.)47 b Fb(88)150 678 y Fe(INPUTRC)8 b Fc(.)14 | |
12601 | b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12602 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12603 | g(.)34 b Fb(60)150 766 y Fe(isearch-terminators)9 b Fc(.)17 | |
12604 | b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12605 | f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(88)150 1000 y Fr(K)150 | |
12606 | 1117 y Fe(keymap)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12607 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12608 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(88)150 1370 | |
12609 | y Fr(L)150 1487 y Fe(LANG)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12610 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12611 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
12612 | b Fb(60)150 1575 y Fe(LC_ALL)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12613 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12614 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(60)150 | |
12615 | 1662 y Fe(LC_COLLATE)24 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12616 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12617 | g(.)h(.)f(.)g(.)h(.)47 b Fb(60)150 1750 y Fe(LC_CTYPE)7 | |
12618 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12619 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12620 | g(.)h(.)32 b Fb(60)150 1837 y Fe(LC_MESSAGES)14 b Fc(.)h(.)d(.)h(.)f(.) | |
12621 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
12622 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fb(7,)26 b(60)150 | |
12623 | 1925 y Fe(LC_NUMERIC)e Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
12624 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12625 | (.)h(.)f(.)g(.)h(.)47 b Fb(60)150 2012 y Fe(LINENO)10 | |
12626 | b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
12627 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12628 | (.)g(.)h(.)f(.)35 b Fb(60)150 2100 y Fe(LINES)11 b Fc(.)j(.)e(.)g(.)g | |
12629 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12630 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 | |
12631 | b Fb(60)150 2335 y Fr(M)150 2451 y Fe(MACHTYPE)7 b Fc(.)14 | |
12632 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12633 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12634 | 32 b Fb(60)150 2539 y Fe(MAIL)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12635 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12636 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
12637 | b Fb(55)150 2626 y Fe(MAILCHECK)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
12638 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12639 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(61)150 2714 | |
12640 | y Fe(MAILPATH)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12641 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12642 | g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(55)150 2801 y Fe(mark-modified-lines)9 | |
12643 | b Fc(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12644 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(89)150 2889 | |
12645 | y Fe(mark-symlinked-directories)17 b Fc(.)h(.)12 b(.)h(.)f(.)g(.)h(.)f | |
12646 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(89)150 2977 | |
12647 | y Fe(match-hidden-files)10 b Fc(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f | |
12648 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36 | |
12649 | b Fb(89)150 3064 y Fe(meta-flag)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
12650 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12651 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(88)150 3317 | |
12652 | y Fr(O)150 3434 y Fe(OLDPWD)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12653 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12654 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(61)150 | |
12655 | 3522 y Fe(OPTARG)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12656 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12657 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(55)150 3609 | |
12658 | y Fe(OPTERR)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12659 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12660 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(61)150 3697 y Fe(OPTIND)10 | |
12661 | b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
12662 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12663 | (.)g(.)h(.)f(.)35 b Fb(55)150 3784 y Fe(OSTYPE)10 b Fc(.)j(.)g(.)f(.)g | |
12664 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12665 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 | |
12666 | b Fb(61)150 3872 y Fe(output-meta)23 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.) | |
12667 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12668 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 b Fb(89)2025 299 y | |
12669 | Fr(P)2025 420 y Fe(page-completions)13 b Fc(.)j(.)c(.)h(.)f(.)g(.)h(.)f | |
12670 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12671 | h(.)f(.)39 b Fb(89)2025 510 y Fe(PATH)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f | |
12672 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12673 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12674 | b Fb(55)2025 600 y Fe(PIPESTATUS)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
12675 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12676 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(61)2025 689 y | |
12677 | Fe(POSIXLY_CORRECT)15 b Fc(.)g(.)e(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12678 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
12679 | b Fb(61)2025 779 y Fe(PPID)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12680 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12681 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
12682 | b Fb(61)2025 869 y Fe(PROMPT_COMMAND)16 b Fc(.)f(.)e(.)f(.)g(.)h(.)f(.) | |
12683 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12684 | (.)g(.)g(.)h(.)f(.)42 b Fb(61)2025 958 y Fe(PS1)14 b | |
12685 | Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12686 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12687 | h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(55)2025 1048 y Fe(PS2)14 | |
12688 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12689 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12690 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(55)2025 1138 y Fe(PS3)14 | |
12691 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12692 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12693 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(61)2025 1228 y Fe(PS4)14 | |
12694 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12695 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12696 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(61)2025 1317 y Fe(PWD)14 | |
12697 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12698 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12699 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(61)2025 1563 y Fr(R)2025 | |
12700 | 1685 y Fe(RANDOM)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12701 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12702 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(61)2025 1774 | |
12703 | y Fe(REPLY)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12704 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12705 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(61)2025 2021 | |
12706 | y Fr(S)2025 2142 y Fe(SECONDS)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f | |
12707 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12708 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(61)2025 | |
12709 | 2231 y Fe(SHELLOPTS)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12710 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12711 | g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(62)2025 2321 y Fe(SHLVL)11 | |
12712 | b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
12713 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12714 | (.)g(.)h(.)f(.)g(.)37 b Fb(62)2025 2411 y Fe(show-all-if-ambiguous)29 | |
12715 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12716 | (.)g(.)g(.)h(.)f(.)50 b Fb(89)2025 2501 y Fe(show-all-if-unmodified)27 | |
12717 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12718 | (.)f(.)g(.)h(.)48 b Fb(89)2025 2747 y Fr(T)2025 2868 | |
12719 | y Fe(TEXTDOMAIN)25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12720 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12721 | g(.)h(.)f(.)g(.)h(.)49 b Fb(7)2025 2958 y Fe(TEXTDOMAINDIR)21 | |
12722 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12723 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 | |
12724 | b Fb(7)2025 3047 y Fe(TIMEFORMAT)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
12725 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12726 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(62)2025 3137 | |
12727 | y Fe(TMOUT)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12728 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12729 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(62)2025 3383 | |
12730 | y Fr(U)2025 3505 y Fe(UID)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12731 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12732 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12733 | b Fb(62)2025 3751 y Fr(V)2025 3872 y Fe(visible-stats)18 | |
12734 | b Fc(.)d(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
12735 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 | |
12736 | b Fb(89)p eop | |
12737 | %%Page: 145 151 | |
12738 | 145 150 bop 150 -116 a Ft(F)-8 b(unction)30 b(Index)2861 | |
12739 | b(145)150 299 y Fo(F)-13 b(unction)53 b(Index)150 610 | |
12740 | y Fr(A)150 749 y Fe(abort)27 b(\(C-g\))8 b Fc(.)13 b(.)g(.)f(.)g(.)h(.) | |
12741 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12742 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(101)150 848 | |
12743 | y Fe(accept-line)28 b(\(Newline)g(or)e(Return\))12 b | |
12744 | Fc(.)h(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)37 b | |
12745 | Fb(95)150 946 y Fe(alias-expand-line)29 b(\(\))13 b Fc(.)g(.)g(.)f(.)g | |
12746 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12747 | 39 b Fb(102)150 1257 y Fr(B)150 1397 y Fe(backward-char)29 | |
12748 | b(\(C-b\))16 b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12749 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)41 b Fb(95)150 | |
12750 | 1495 y Fe(backward-delete-char)30 b(\(Rubout\))21 b Fc(.)13 | |
12751 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 b | |
12752 | Fb(97)150 1594 y Fe(backward-kill-line)30 b(\(C-x)c(Rubout\))f | |
12753 | Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)49 b | |
12754 | Fb(98)150 1692 y Fe(backward-kill-word)30 b(\(M-)999 | |
12755 | 1689 y Fg(h)p 1024 1636 146 4 v 1024 1692 a Ff(DEL)p | |
12756 | 1024 1708 V 1165 1689 a Fg(i)1195 1692 y Fe(\))21 b Fc(.)13 | |
12757 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
12758 | b Fb(98)150 1791 y Fe(backward-word)29 b(\(M-b\))16 b | |
12759 | Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12760 | (.)g(.)h(.)f(.)g(.)g(.)h(.)41 b Fb(95)150 1889 y Fe | |
12761 | (beginning-of-history)30 b(\(M-<\))25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f | |
12762 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)49 b Fb(96)150 | |
12763 | 1988 y Fe(beginning-of-line)29 b(\(C-a\))10 b Fc(.)k(.)e(.)g(.)h(.)f(.) | |
12764 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
12765 | b Fb(95)150 2299 y Fr(C)150 2438 y Fe(call-last-kbd-macro)30 | |
12766 | b(\(C-x)c(e\))10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12767 | (.)f(.)g(.)36 b Fb(101)150 2537 y Fe(capitalize-word)29 | |
12768 | b(\(M-c\))13 b Fc(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
12769 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(97)150 2635 | |
12770 | y Fe(character-search)29 b(\(C-]\))10 b Fc(.)k(.)e(.)h(.)f(.)g(.)h(.)f | |
12771 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)36 | |
12772 | b Fb(101)150 2734 y Fe(character-search-backward)31 b(\(M-C-]\))12 | |
12773 | b Fc(.)j(.)d(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(101)150 2832 | |
12774 | y Fe(clear-screen)28 b(\(C-l\))17 b Fc(.)d(.)e(.)h(.)f(.)g(.)h(.)f(.)g | |
12775 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)43 | |
12776 | b Fb(95)150 2931 y Fe(complete)27 b(\()528 2928 y Fg(h)p | |
12777 | 553 2875 148 4 v 553 2931 a Ff(T)-6 b(AB)p 553 2946 V | |
12778 | 697 2928 a Fg(i)726 2931 y Fe(\))20 b Fc(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f | |
12779 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12780 | f(.)g(.)45 b Fb(99)150 3029 y Fe(complete-command)29 | |
12781 | b(\(M-!\))10 b Fc(.)k(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12782 | (.)g(.)h(.)f(.)g(.)g(.)h(.)36 b Fb(100)150 3128 y Fe(complete-filename) | |
12783 | 29 b(\(M-/\))10 b Fc(.)k(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12784 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(99)150 3226 y Fe(complete-hostname) | |
12785 | 29 b(\(M-@\))9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12786 | (.)h(.)f(.)g(.)h(.)f(.)g(.)35 b Fb(100)150 3325 y Fe | |
12787 | (complete-into-braces)30 b(\(M-{\))24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f | |
12788 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)49 b Fb(100)150 3423 | |
12789 | y Fe(complete-username)29 b(\(M-~\))9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g | |
12790 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)35 | |
12791 | b Fb(100)150 3522 y Fe(complete-variable)29 b(\(M-$\))9 | |
12792 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12793 | (.)f(.)g(.)35 b Fb(100)150 3620 y Fe(copy-backward-word)30 | |
12794 | b(\(\))13 b Fc(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12795 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(98)150 3719 y | |
12796 | Fe(copy-forward-word)29 b(\(\))14 b Fc(.)f(.)g(.)f(.)g(.)h(.)f(.)g(.)h | |
12797 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
12798 | b Fb(98)150 3817 y Fe(copy-region-as-kill)30 b(\(\))11 | |
12799 | b Fc(.)i(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12800 | g(.)h(.)f(.)g(.)37 b Fb(98)150 4128 y Fr(D)150 4268 y | |
12801 | Fe(delete-char)28 b(\(C-d\))20 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12802 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12803 | 44 b Fb(97)150 4366 y Fe(delete-char-or-list)30 b(\(\))11 | |
12804 | b Fc(.)i(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12805 | g(.)h(.)f(.)g(.)37 b Fb(99)150 4465 y Fe(delete-horizontal-space)31 | |
12806 | b(\(\))24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12807 | (.)g(.)h(.)49 b Fb(98)150 4563 y Fe(digit-argument)29 | |
12808 | b(\()p Fd(M-0)p Fe(,)e Fd(M-1)p Fe(,)f(...)g Fd(M--)p | |
12809 | Fe(\))14 b Fc(.)g(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)40 b | |
12810 | Fb(99)150 4662 y Fe(display-shell-version)30 b(\(C-x)d(C-v\))c | |
12811 | Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 b Fb(102)150 | |
12812 | 4760 y Fe(do-uppercase-version)30 b(\(M-a,)d(M-b,)f(M-)p | |
12813 | Fd(x)p Fe(,)h(...)q(\))317 4847 y Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12814 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12815 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 | |
12816 | b Fb(101)150 4946 y Fe(downcase-word)29 b(\(M-l\))16 | |
12817 | b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12818 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)41 b Fb(97)150 5044 y Fe(dump-functions)29 | |
12819 | b(\(\))18 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12820 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b Fb(102)150 | |
12821 | 5143 y Fe(dump-macros)28 b(\(\))22 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
12822 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12823 | h(.)f(.)g(.)48 b Fb(102)150 5241 y Fe(dump-variables)29 | |
12824 | b(\(\))18 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12825 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b Fb(102)150 | |
12826 | 5340 y Fe(dynamic-complete-history)31 b(\(M-)1234 5337 | |
12827 | y Fg(h)p 1259 5284 V 1259 5340 a Ff(T)-6 b(AB)p 1259 | |
12828 | 5355 V 1403 5337 a Fg(i)1432 5340 y Fe(\))10 b Fc(.)j(.)g(.)f(.)g(.)h | |
12829 | (.)f(.)36 b Fb(100)2025 610 y Fr(E)2025 730 y Fe | |
12830 | (edit-and-execute-command)31 b(\(C-xC-e\))12 b Fc(.)i(.)f(.)f(.)g(.)h | |
12831 | (.)f(.)g(.)39 b Fb(103)2025 819 y Fe(end-kbd-macro)28 | |
12832 | b(\(C-x)f(\)\))19 b Fc(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12833 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 b Fb(100)2025 | |
12834 | 909 y Fe(end-of-history)29 b(\(M->\))14 b Fc(.)f(.)g(.)f(.)g(.)h(.)f(.) | |
12835 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 | |
12836 | b Fb(96)2025 998 y Fe(end-of-line)28 b(\(C-e\))20 b Fc(.)12 | |
12837 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12838 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fb(95)2025 1087 y | |
12839 | Fe(exchange-point-and-mark)31 b(\(C-x)26 b(C-x\))20 b | |
12840 | Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fb(101)2025 | |
12841 | 1349 y Fr(F)2025 1469 y Fe(forward-backward-delete-char)32 | |
12842 | b(\(\))16 b Fc(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)42 | |
12843 | b Fb(97)2025 1558 y Fe(forward-char)28 b(\(C-f\))17 b | |
12844 | Fc(.)d(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12845 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)43 b Fb(95)2025 1647 y | |
12846 | Fe(forward-search-history)30 b(\(C-s\))22 b Fc(.)13 b(.)f(.)g(.)h(.)f | |
12847 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)47 b Fb(96)2025 1736 | |
12848 | y Fe(forward-word)28 b(\(M-f\))17 b Fc(.)d(.)e(.)g(.)h(.)f(.)g(.)h(.)f | |
12849 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)43 | |
12850 | b Fb(95)2025 1988 y Fr(G)2025 2108 y Fe(glob-complete-word)29 | |
12851 | b(\(M-g\))7 b Fc(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12852 | (.)h(.)f(.)g(.)g(.)34 b Fb(102)2025 2197 y Fe(glob-expand-word)29 | |
12853 | b(\(C-x)e(*\))14 b Fc(.)f(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12854 | (.)g(.)h(.)f(.)g(.)h(.)40 b Fb(102)2025 2286 y Fe(glob-list-expansions) | |
12855 | 30 b(\(C-x)c(g\))8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12856 | (.)g(.)g(.)35 b Fb(102)2025 2548 y Fr(H)2025 2668 y Fe | |
12857 | (history-and-alias-expand-line)d(\(\))14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g | |
12858 | (.)h(.)f(.)40 b Fb(103)2025 2757 y Fe(history-expand-line)30 | |
12859 | b(\(M-^\))25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
12860 | f(.)g(.)h(.)50 b Fb(102)2025 2846 y Fe(history-search-backward)31 | |
12861 | b(\(\))24 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12862 | (.)g(.)h(.)49 b Fb(96)2025 2935 y Fe(history-search-forward)30 | |
12863 | b(\(\))7 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12864 | g(.)h(.)f(.)g(.)33 b Fb(96)2025 3197 y Fr(I)2025 3317 | |
12865 | y Fe(insert-comment)c(\(M-#\))13 b Fc(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)g | |
12866 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 | |
12867 | b Fb(101)2025 3406 y Fe(insert-completions)29 b(\(M-*\))8 | |
12868 | b Fc(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12869 | (.)h(.)f(.)34 b Fb(99)2025 3495 y Fe(insert-last-argument)c(\(M-.)c(or) | |
12870 | g(M-_\))8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)34 | |
12871 | b Fb(103)2025 3757 y Fr(K)2025 3877 y Fe(kill-line)27 | |
12872 | b(\(C-k\))c Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12873 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)47 | |
12874 | b Fb(98)2025 3966 y Fe(kill-region)28 b(\(\))23 b Fc(.)13 | |
12875 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12876 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)49 b Fb(98)2025 | |
12877 | 4056 y Fe(kill-whole-line)29 b(\(\))17 b Fc(.)c(.)f(.)g(.)h(.)f(.)g(.)h | |
12878 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
12879 | 43 b Fb(98)2025 4145 y Fe(kill-word)27 b(\(M-d\))c Fc(.)12 | |
12880 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12881 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(98)2025 | |
12882 | 4396 y Fr(M)2025 4516 y Fe(magic-space)28 b(\(\))22 b | |
12883 | Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12884 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 b Fb(102)2025 | |
12885 | 4605 y Fe(menu-complete)28 b(\(\))21 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.) | |
12886 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12887 | (.)f(.)g(.)46 b Fb(99)2025 4867 y Fr(N)2025 4987 y Fe(next-history)28 | |
12888 | b(\(C-n\))17 b Fc(.)d(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12889 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)43 b Fb(96)2025 | |
12890 | 5076 y Fe(non-incremental-forward-search)q(-hist)q(ory)32 | |
12891 | b(\(M-n\))2193 5164 y Fc(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12892 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12893 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fb(96)2025 | |
12894 | 5253 y Fe(non-incremental-reverse-search)q(-hist)q(ory)32 | |
12895 | b(\(M-p\))2193 5340 y Fc(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12896 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12897 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fb(96)p | |
12898 | eop | |
12899 | %%Page: 146 152 | |
12900 | 146 151 bop 150 -116 a Ft(146)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
12901 | 150 299 y Fr(O)150 422 y Fe(operate-and-get-next)f(\(C-o\))24 | |
12902 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)49 | |
12903 | b Fb(103)150 513 y Fe(overwrite-mode)29 b(\(\))19 b Fc(.)12 | |
12904 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12905 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 b Fb(97)150 772 y Fr(P)150 | |
12906 | 895 y Fe(possible-command-completions)32 b(\(C-x)26 b(!\))15 | |
12907 | b Fc(.)e(.)g(.)f(.)g(.)41 b Fb(100)150 985 y Fe(possible-completions)30 | |
12908 | b(\(M-?\))25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12909 | g(.)g(.)h(.)49 b Fb(99)150 1076 y Fe(possible-filename-completions)32 | |
12910 | b(\(C-x)27 b(/\))14 b Fc(.)e(.)g(.)h(.)39 b Fb(100)150 | |
12911 | 1167 y Fe(possible-hostname-completions)32 b(\(C-x)27 | |
12912 | b(@\))14 b Fc(.)e(.)g(.)h(.)39 b Fb(100)150 1257 y Fe | |
12913 | (possible-username-completions)32 b(\(C-x)27 b(~\))14 | |
12914 | b Fc(.)e(.)g(.)h(.)39 b Fb(100)150 1348 y Fe | |
12915 | (possible-variable-completions)32 b(\(C-x)27 b($\))14 | |
12916 | b Fc(.)e(.)g(.)h(.)39 b Fb(100)150 1438 y Fe(prefix-meta)28 | |
12917 | b(\()646 1435 y Fg(h)p 671 1382 139 4 v 671 1438 a Ff(ESC)p | |
12918 | 671 1454 V 804 1435 a Fg(i)834 1438 y Fe(\))19 b Fc(.)13 | |
12919 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
12920 | (.)g(.)h(.)f(.)g(.)45 b Fb(101)150 1529 y Fe(previous-history)29 | |
12921 | b(\(C-p\))11 b Fc(.)j(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12922 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(96)150 1799 y | |
12923 | Fr(Q)150 1922 y Fe(quoted-insert)29 b(\(C-q)d(or)g(C-v\))20 | |
12924 | b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12925 | (.)45 b Fb(97)150 2191 y Fr(R)150 2314 y Fe(re-read-init-file)29 | |
12926 | b(\(C-x)e(C-r\))10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12927 | (.)f(.)g(.)36 b Fb(101)150 2405 y Fe(redraw-current-line)30 | |
12928 | b(\(\))11 b Fc(.)i(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12929 | (.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(95)150 2496 y Fe | |
12930 | (reverse-search-history)31 b(\(C-r\))22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g | |
12931 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 b Fb(96)150 2586 y | |
12932 | Fe(revert-line)28 b(\(M-r\))18 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
12933 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 | |
12934 | b Fb(101)2025 299 y Fr(S)2025 417 y Fe(self-insert)28 | |
12935 | b(\(a,)e(b,)g(A,)g(1,)g(!,)g(...)q(\))13 b Fc(.)f(.)h(.)f(.)g(.)h(.)f | |
12936 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(97)2025 505 y Fe(set-mark)27 | |
12937 | b(\(C-@\))c Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12938 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 | |
12939 | b Fb(101)2025 593 y Fe(shell-expand-line)29 b(\(M-C-e\))d | |
12940 | Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)50 | |
12941 | b Fb(102)2025 681 y Fe(start-kbd-macro)29 b(\(C-x)d(\(\))16 | |
12942 | b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12943 | f(.)g(.)42 b Fb(100)2025 927 y Fr(T)2025 1045 y Fe(tilde-expand)28 | |
12944 | b(\(M-&\))16 b Fc(.)e(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12945 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(101)2025 | |
12946 | 1133 y Fe(transpose-chars)29 b(\(C-t\))13 b Fc(.)g(.)f(.)h(.)f(.)g(.)h | |
12947 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)39 | |
12948 | b Fb(97)2025 1221 y Fe(transpose-words)29 b(\(M-t\))13 | |
12949 | b Fc(.)g(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12950 | g(.)h(.)f(.)g(.)g(.)39 b Fb(97)2025 1477 y Fr(U)2025 | |
12951 | 1595 y Fe(undo)26 b(\(C-_)h(or)f(C-x)g(C-u\))14 b Fc(.)f(.)g(.)f(.)g(.) | |
12952 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 | |
12953 | b Fb(101)2025 1683 y Fe(universal-argument)29 b(\(\))13 | |
12954 | b Fc(.)g(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12955 | g(.)h(.)f(.)g(.)g(.)39 b Fb(99)2025 1771 y Fe(unix-line-discard)29 | |
12956 | b(\(C-u\))10 b Fc(.)k(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
12957 | (.)h(.)f(.)g(.)h(.)f(.)g(.)36 b Fb(98)2025 1860 y Fe(unix-word-rubout) | |
12958 | 29 b(\(C-w\))11 b Fc(.)j(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12959 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)37 b Fb(98)2025 1948 | |
12960 | y Fe(upcase-word)28 b(\(M-u\))20 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12961 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12962 | (.)44 b Fb(97)2025 2204 y Fr(Y)2025 2322 y Fe(yank)26 | |
12963 | b(\(C-y\))11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12964 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
12965 | f(.)g(.)h(.)36 b Fb(98)2025 2410 y Fe(yank-last-arg)28 | |
12966 | b(\(M-.)f(or)f(M-_\))20 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
12967 | (.)h(.)f(.)g(.)g(.)h(.)f(.)45 b Fb(96)2025 2498 y Fe(yank-nth-arg)28 | |
12968 | b(\(M-C-y\))14 b Fc(.)g(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
12969 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fb(96)2025 | |
12970 | 2586 y Fe(yank-pop)27 b(\(M-y\))d Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12971 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12972 | h(.)f(.)g(.)49 b Fb(98)p eop | |
12973 | %%Page: 147 153 | |
12974 | 147 152 bop 150 -116 a Ft(Concept)31 b(Index)2882 b(147)150 | |
12975 | 299 y Fo(Concept)52 b(Index)150 638 y Fr(A)150 754 y | |
12976 | Fb(alias)27 b(expansion)20 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12977 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12978 | h(.)f(.)g(.)45 b Fb(71)150 841 y(arithmetic)25 b(ev)l(aluation)g | |
12979 | Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
12980 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fb(70)150 929 y(arithmetic)25 | |
12981 | b(expansion)12 b Fc(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12982 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 b Fb(21)150 | |
12983 | 1016 y(arithmetic,)26 b(shell)20 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12984 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
12985 | (.)g(.)h(.)f(.)45 b Fb(70)150 1103 y(arra)n(ys)6 b Fc(.)13 | |
12986 | b(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12987 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
12988 | h(.)f(.)g(.)32 b Fb(72)150 1353 y Fr(B)150 1469 y Fb(bac)n(kground)23 | |
12989 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g | |
12990 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49 | |
12991 | b Fb(79)150 1556 y(Bash)26 b(con\014guration)11 b Fc(.)i(.)f(.)g(.)h(.) | |
12992 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12993 | (.)f(.)g(.)h(.)36 b Fb(115)150 1643 y(Bash)26 b(installation)6 | |
12994 | b Fc(.)15 b(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g | |
12995 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32 b Fb(115)150 | |
12996 | 1730 y(Bourne)26 b(shell)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
12997 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
12998 | (.)f(.)g(.)h(.)f(.)g(.)h(.)36 b Fb(5)150 1818 y(brace)26 | |
12999 | b(expansion)d Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13000 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)48 | |
13001 | b Fb(17)150 1905 y(builtin)17 b Fc(.)c(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13002 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13003 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b | |
13004 | Fb(3)150 2138 y Fr(C)150 2254 y Fb(command)24 b(editing)19 | |
13005 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13006 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fb(83)150 | |
13007 | 2341 y(command)24 b(execution)11 b Fc(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13008 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13009 | 37 b Fb(28)150 2428 y(command)24 b(expansion)f Fc(.)12 | |
13010 | b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13011 | (.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fb(28)150 2515 y(command)24 | |
13012 | b(history)16 b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13013 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
13014 | b Fb(109)150 2603 y(command)24 b(searc)n(h)12 b Fc(.)h(.)f(.)g(.)h(.)f | |
13015 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13016 | f(.)g(.)h(.)f(.)g(.)g(.)38 b Fb(28)150 2690 y(command)24 | |
13017 | b(substitution)g Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
13018 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49 b Fb(21)150 | |
13019 | 2777 y(command)24 b(timing)8 b Fc(.)k(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13020 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13021 | g(.)h(.)f(.)34 b Fb(8)150 2864 y(commands,)24 b(comp)r(ound)8 | |
13022 | b Fc(.)k(.)g(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13023 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(9)150 2952 y(commands,)24 | |
13024 | b(conditional)13 b Fc(.)h(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13025 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)39 b Fb(10)150 | |
13026 | 3039 y(commands,)24 b(grouping)15 b Fc(.)f(.)e(.)g(.)h(.)f(.)g(.)h(.)f | |
13027 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)41 | |
13028 | b Fb(13)150 3126 y(commands,)24 b(lists)6 b Fc(.)14 b(.)f(.)f(.)g(.)h | |
13029 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13030 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(9)150 3213 y(commands,)24 | |
13031 | b(lo)r(oping)h Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13032 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 | |
13033 | b Fb(9)150 3300 y(commands,)24 b(pip)r(elines)17 b Fc(.)d(.)e(.)g(.)h | |
13034 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13035 | h(.)f(.)g(.)h(.)43 b Fb(8)150 3388 y(commands,)24 b(shell)16 | |
13036 | b Fc(.)e(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13037 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 | |
13038 | b Fb(8)150 3475 y(commands,)24 b(simple)d Fc(.)12 b(.)g(.)h(.)f(.)g(.)h | |
13039 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
13040 | g(.)h(.)f(.)g(.)47 b Fb(8)150 3562 y(commen)n(ts,)24 | |
13041 | b(shell)8 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13042 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13043 | 34 b Fb(7)150 3649 y(completion)26 b(builtins)c Fc(.)12 | |
13044 | b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13045 | (.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(105)150 3736 y(con\014guration)15 | |
13046 | b Fc(.)e(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13047 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 | |
13048 | b Fb(115)150 3824 y(con)n(trol)26 b(op)r(erator)c Fc(.)12 | |
13049 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
13050 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)47 b Fb(3)150 | |
13051 | 4073 y Fr(D)150 4189 y Fb(directory)26 b(stac)n(k)e Fc(.)12 | |
13052 | b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13053 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(73)150 | |
13054 | 4439 y Fr(E)150 4555 y Fb(editing)26 b(command)e(lines)f | |
13055 | Fc(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13056 | (.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(83)150 4642 y(en)n(vironmen)n(t)10 | |
13057 | b Fc(.)h(.)h(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13058 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
13059 | b Fb(30)150 4729 y(ev)l(aluation,)26 b(arithmetic)13 | |
13060 | b Fc(.)g(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
13061 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 b Fb(70)150 4817 y(ev)n(en)n(t)25 | |
13062 | b(designators)18 b Fc(.)c(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13063 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 | |
13064 | b Fb(111)150 4904 y(execution)26 b(en)n(vironmen)n(t)18 | |
13065 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13066 | (.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fb(29)150 4991 y(exit)25 | |
13067 | b(status)17 b Fc(.)c(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13068 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13069 | (.)43 b Fb(3,)26 b(30)150 5078 y(expansion)16 b Fc(.)d(.)f(.)g(.)h(.)f | |
13070 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13071 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 b | |
13072 | Fb(16)150 5166 y(expansion,)26 b(arithmetic)19 b Fc(.)13 | |
13073 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13074 | (.)h(.)f(.)g(.)h(.)f(.)45 b Fb(21)150 5253 y(expansion,)26 | |
13075 | b(brace)12 b Fc(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13076 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)38 | |
13077 | b Fb(17)150 5340 y(expansion,)26 b(\014lename)18 b Fc(.)11 | |
13078 | b(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13079 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fb(22)2025 638 y(expansion,)26 | |
13080 | b(parameter)21 b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13081 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(18)2025 | |
13082 | 729 y(expansion,)26 b(pathname)8 b Fc(.)j(.)h(.)h(.)f(.)g(.)h(.)f(.)g | |
13083 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 | |
13084 | b Fb(22)2025 819 y(expansion,)26 b(tilde)9 b Fc(.)j(.)h(.)f(.)g(.)h(.)f | |
13085 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
13086 | h(.)f(.)g(.)h(.)f(.)g(.)35 b Fb(18)2025 910 y(expressions,)27 | |
13087 | b(arithmetic)16 b Fc(.)c(.)g(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13088 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 b Fb(70)2025 | |
13089 | 1000 y(expressions,)27 b(conditional)22 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f | |
13090 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)47 | |
13091 | b Fb(69)2025 1267 y Fr(F)2025 1390 y Fb(FDL,)25 b(GNU)g(F)-6 | |
13092 | b(ree)26 b(Do)r(cumen)n(tation)f(License)10 b Fc(.)j(.)g(.)f(.)g(.)h(.) | |
13093 | 36 b Fb(131)2025 1480 y(\014eld)21 b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g | |
13094 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13095 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)48 | |
13096 | b Fb(3)2025 1571 y(\014lename)8 b Fc(.)j(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13097 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13098 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(3)2025 | |
13099 | 1661 y(\014lename)25 b(expansion)10 b Fc(.)i(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
13100 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13101 | (.)g(.)36 b Fb(22)2025 1752 y(foreground)20 b Fc(.)12 | |
13102 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13103 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)45 | |
13104 | b Fb(79)2025 1842 y(functions,)26 b(shell)c Fc(.)13 b(.)f(.)g(.)h(.)f | |
13105 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13106 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(13)2025 2109 y Fr(H)2025 | |
13107 | 2232 y Fb(history)25 b(builtins)16 b Fc(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
13108 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
13109 | f(.)g(.)h(.)42 b Fb(109)2025 2322 y(history)25 b(ev)n(en)n(ts)20 | |
13110 | b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13111 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
13112 | b Fb(111)2025 2413 y(history)25 b(expansion)13 b Fc(.)g(.)f(.)h(.)f(.)g | |
13113 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13114 | f(.)g(.)h(.)f(.)39 b Fb(111)2025 2503 y(history)25 b(list)18 | |
13115 | b Fc(.)c(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13116 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 | |
13117 | b Fb(109)2025 2594 y(History)-6 b(,)25 b(ho)n(w)h(to)g(use)20 | |
13118 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13119 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)46 b Fb(108)2025 2861 | |
13120 | y Fr(I)2025 2984 y Fb(iden)n(ti\014er)16 b Fc(.)c(.)g(.)h(.)f(.)g(.)h | |
13121 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13122 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)43 | |
13123 | b Fb(3)2025 3074 y(initialization)28 b(\014le,)e(readline)7 | |
13124 | b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13125 | (.)g(.)h(.)f(.)g(.)33 b Fb(86)2025 3165 y(installation)11 | |
13126 | b Fc(.)j(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
13127 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)37 | |
13128 | b Fb(115)2025 3255 y(in)n(teraction,)26 b(readline)9 | |
13129 | b Fc(.)14 b(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13130 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)35 b Fb(83)2025 | |
13131 | 3346 y(in)n(teractiv)n(e)26 b(shell)20 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f | |
13132 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13133 | h(.)f(.)45 b Fb(65,)27 b(67)2025 3436 y(in)n(ternationalization)21 | |
13134 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13135 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fb(7)2025 | |
13136 | 3686 y Fr(J)2025 3809 y Fb(job)22 b Fc(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f | |
13137 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13138 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)48 | |
13139 | b Fb(3)2025 3900 y(job)26 b(con)n(trol)12 b Fc(.)h(.)f(.)h(.)f(.)g(.)h | |
13140 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13141 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(3,)26 b(79)2025 | |
13142 | 4166 y Fr(K)2025 4289 y Fb(kill)g(ring)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g | |
13143 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13144 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)40 | |
13145 | b Fb(85)2025 4380 y(killing)26 b(text)16 b Fc(.)c(.)h(.)f(.)g(.)h(.)f | |
13146 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13147 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)42 b Fb(85)2025 | |
13148 | 4647 y Fr(L)2025 4769 y Fb(lo)r(calization)10 b Fc(.)15 | |
13149 | b(.)d(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
13150 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)36 | |
13151 | b Fb(7)2025 4860 y(login)26 b(shell)13 b Fc(.)h(.)e(.)g(.)h(.)f(.)g(.)h | |
13152 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13153 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)39 b Fb(65)2025 | |
13154 | 5127 y Fr(M)2025 5249 y Fb(matc)n(hing,)25 b(pattern)7 | |
13155 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
13156 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33 b Fb(23)2025 | |
13157 | 5340 y(metac)n(haracter)17 b Fc(.)c(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13158 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13159 | g(.)h(.)f(.)g(.)44 b Fb(3)p eop | |
13160 | %%Page: 148 154 | |
13161 | 148 153 bop 150 -116 a Ft(148)2527 b(Bash)31 b(Reference)g(Man)m(ual) | |
13162 | 150 299 y Fr(N)150 417 y Fb(name)20 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f | |
13163 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13164 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)47 | |
13165 | b Fb(3)150 506 y(nativ)n(e)25 b(languages)14 b Fc(.)h(.)d(.)g(.)h(.)f | |
13166 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
13167 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 b Fb(7)150 594 y(notation,)27 | |
13168 | b(readline)12 b Fc(.)h(.)f(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13169 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 | |
13170 | b Fb(83)150 851 y Fr(O)150 969 y Fb(op)r(erator,)27 b(shell)15 | |
13171 | b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13172 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
13173 | b Fb(3)150 1225 y Fr(P)150 1344 y Fb(parameter)25 b(expansion)14 | |
13174 | b Fc(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
13175 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(18)150 1432 y(parameters)14 | |
13176 | b Fc(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13177 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 | |
13178 | b Fb(15)150 1521 y(parameters,)26 b(p)r(ositional)9 b | |
13179 | Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13180 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(15)150 1609 y(parameters,)26 | |
13181 | b(sp)r(ecial)f Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
13182 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 | |
13183 | b Fb(15)150 1698 y(pathname)24 b(expansion)19 b Fc(.)12 | |
13184 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13185 | (.)g(.)h(.)f(.)g(.)h(.)f(.)44 b Fb(22)150 1786 y(pattern)25 | |
13186 | b(matc)n(hing)18 b Fc(.)12 b(.)g(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13187 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 | |
13188 | b Fb(23)150 1875 y(pip)r(eline)15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
13189 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
13190 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 b | |
13191 | Fb(8)150 1963 y(POSIX)8 b Fc(.)k(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13192 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13193 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(3)150 | |
13194 | 2052 y(POSIX)25 b(Mo)r(de)10 b Fc(.)i(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
13195 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13196 | h(.)f(.)g(.)h(.)f(.)35 b Fb(76)150 2140 y(pro)r(cess)27 | |
13197 | b(group)7 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13198 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13199 | g(.)h(.)33 b Fb(3)150 2229 y(pro)r(cess)27 b(group)e(ID)f | |
13200 | Fc(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13201 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)50 | |
13202 | b Fb(3)150 2317 y(pro)r(cess)27 b(substitution)10 b Fc(.)i(.)h(.)f(.)g | |
13203 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
13204 | f(.)g(.)h(.)f(.)36 b Fb(22)150 2406 y(programmable)25 | |
13205 | b(completion)16 b Fc(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13206 | f(.)g(.)h(.)f(.)g(.)g(.)42 b Fb(103)150 2494 y(prompting)7 | |
13207 | b Fc(.)k(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13208 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13209 | (.)32 b Fb(75)150 2750 y Fr(Q)150 2869 y Fb(quoting)19 | |
13210 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13211 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13212 | g(.)h(.)f(.)g(.)46 b Fb(6)150 2957 y(quoting,)26 b(ANSI)12 | |
13213 | b Fc(.)f(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
13214 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)38 | |
13215 | b Fb(6)150 3213 y Fr(R)150 3332 y Fb(Readline,)26 b(ho)n(w)g(to)g(use) | |
13216 | 14 b Fc(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
13217 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(82)150 3421 | |
13218 | y(redirection)21 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13219 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13220 | (.)f(.)g(.)h(.)f(.)46 b Fb(24)2025 299 y(reserv)n(ed)25 | |
13221 | b(w)n(ord)f Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13222 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13223 | g(.)50 b Fb(3)2025 386 y(restricted)26 b(shell)8 b Fc(.)13 | |
13224 | b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13225 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)34 | |
13226 | b Fb(76)2025 473 y(return)25 b(status)19 b Fc(.)13 b(.)f(.)g(.)h(.)f(.) | |
13227 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13228 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fb(3)2025 | |
13229 | 707 y Fr(S)2025 823 y Fb(shell)26 b(arithmetic)12 b Fc(.)g(.)h(.)f(.)g | |
13230 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13231 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 b Fb(70)2025 910 y(shell)26 | |
13232 | b(function)11 b Fc(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g | |
13233 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13234 | g(.)37 b Fb(13)2025 997 y(shell)26 b(script)18 b Fc(.)13 | |
13235 | b(.)f(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13236 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 | |
13237 | b Fb(31)2025 1084 y(shell)26 b(v)l(ariable)17 b Fc(.)c(.)g(.)f(.)g(.)h | |
13238 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13239 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fb(15)2025 1172 | |
13240 | y(shell,)26 b(in)n(teractiv)n(e)16 b Fc(.)d(.)g(.)f(.)g(.)h(.)f(.)g(.)h | |
13241 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13242 | g(.)h(.)f(.)42 b Fb(67)2025 1259 y(signal)14 b Fc(.)f(.)g(.)f(.)g(.)h | |
13243 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13244 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
13245 | b Fb(4)2025 1346 y(signal)27 b(handling)18 b Fc(.)13 | |
13246 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13247 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)44 b Fb(31)2025 | |
13248 | 1433 y(sp)r(ecial)27 b(builtin)12 b Fc(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13249 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13250 | g(.)g(.)h(.)38 b Fb(4,)26 b(53)2025 1521 y(startup)f(\014les)20 | |
13251 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13252 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)45 | |
13253 | b Fb(65)2025 1608 y(susp)r(ending)25 b(jobs)7 b Fc(.)14 | |
13254 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13255 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)33 b Fb(79)2025 | |
13256 | 1858 y Fr(T)2025 1974 y Fb(tilde)26 b(expansion)19 b | |
13257 | Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13258 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 | |
13259 | b Fb(18)2025 2061 y(tok)n(en)18 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
13260 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13261 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
13262 | b Fb(4)2025 2148 y(translation,)27 b(nativ)n(e)e(languages)9 | |
13263 | b Fc(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
13264 | (.)g(.)h(.)35 b Fb(7)2025 2398 y Fr(V)2025 2514 y Fb(v)l(ariable,)26 | |
13265 | b(shell)7 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13266 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
13267 | h(.)32 b Fb(15)2025 2601 y(v)l(ariables,)27 b(readline)7 | |
13268 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
13269 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(87)2025 | |
13270 | 2851 y Fr(W)2025 2967 y Fb(w)n(ord)10 b Fc(.)i(.)h(.)f(.)g(.)h(.)f(.)g | |
13271 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
13272 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)36 | |
13273 | b Fb(4)2025 3055 y(w)n(ord)26 b(splitting)21 b Fc(.)12 | |
13274 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
13275 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
13276 | b Fb(22)2025 3304 y Fr(Y)2025 3421 y Fb(y)n(anking)25 | |
13277 | b(text)7 b Fc(.)k(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
13278 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
13279 | g(.)33 b Fb(85)p eop | |
13280 | %%Trailer | |
13281 | end | |
13282 | userdict /end-hook known{end-hook}if | |
13283 | %%EOF |