]>
Commit | Line | Data |
---|---|---|
5e13499c | 1 | %!PS-Adobe-2.0 |
e59452c7 | 2 | %%Creator: dvips(k) 2021.1 Copyright 2021 Radical Eye Software |
5e13499c | 3 | %%Title: bashref.dvi |
3011048a | 4 | %%CreationDate: Tue Jan 18 15:57:35 2022 |
5e6f45d9 | 5 | %%Pages: 195 |
5e13499c CR |
6 | %%PageOrder: Ascend |
7 | %%BoundingBox: 0 0 612 792 | |
c302751c | 8 | %%DocumentFonts: CMBX12 CMR10 CMTT10 CMSL10 CMSY10 CMMI12 CMMI10 CMCSC10 |
50fc6e33 | 9 | %%+ CMTI10 CMSLTT10 SFRM1095 CMTT12 CMTT9 CMMI9 CMR9 SFRM1440 |
d3ad40de | 10 | %%DocumentPaperSizes: Letter |
5e13499c CR |
11 | %%EndComments |
12 | %DVIPSWebPage: (www.radicaleye.com) | |
13 | %DVIPSCommandLine: dvips -D 600 -t letter -o bashref.ps bashref.dvi | |
d3ad40de | 14 | %DVIPSParameters: dpi=600 |
3011048a | 15 | %DVIPSSource: TeX output 2022.01.18:1057 |
d3ad40de | 16 | %%BeginProcSet: tex.pro 0 0 |
5e13499c CR |
17 | %! |
18 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
19 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
20 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
21 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
22 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
23 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
24 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
25 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
26 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
27 | N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin | |
28 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array | |
29 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 | |
30 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N | |
31 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
32 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
33 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
34 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
d3ad40de CR |
35 | 1 add N}if}B/CharBuilder{save 3 1 roll S A/base get 2 index get S |
36 | /BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy | |
37 | setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]{Ci}imagemask | |
38 | restore}B/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
5e13499c CR |
39 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put |
40 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
41 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
42 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
43 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
44 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
45 | 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 | |
46 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N | |
45c0f7f8 CR |
47 | /dir 0 def/dyy{/dir 0 def}B/dyt{/dir 1 def}B/dty{/dir 2 def}B/dtt{/dir 3 |
48 | def}B/p{dir 2 eq{-90 rotate show 90 rotate}{dir 3 eq{-90 rotate show 90 | |
49 | rotate}{show}ifelse}ifelse}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 | |
50 | N/Ry 0 N/V{}B/RV/v{/Ry X/Rx X V}B statusdict begin/product where{pop | |
51 | false[(Display)(NeXT)(LaserWriter 16/600)]{A length product length le{A | |
52 | length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse} | |
53 | forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{ | |
54 | BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat | |
55 | {BDot}imagemask grestore}}ifelse B/QV{gsave newpath transform round exch | |
56 | round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 | |
57 | rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B | |
58 | /M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M} | |
59 | B/g{0 M}B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p | |
60 | -3 w}B/n{p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{ | |
61 | 0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
5e13499c | 62 | |
50fc6e33 CR |
63 | %%EndProcSet |
64 | %%BeginProcSet: cm-super-t1.enc 0 0 | |
65 | % This file is generated from `T1uni.map' and `glyphlist.txt', `gl-other.txt' | |
66 | % | |
67 | % LIGKERN hyphen hyphen =: endash ; endash hyphen =: emdash ; | |
68 | % LIGKERN quoteleft quoteleft =: quotedblleft ; | |
69 | % LIGKERN quoteright quoteright =: quotedblright ; | |
70 | % LIGKERN comma comma =: quotedblbase ; less less =: guillemotleft ; | |
71 | % LIGKERN greater greater =: guillemotright ; | |
72 | % LIGKERN f f =: ff ; f i =: fi ; f l =: fl ; ff i =: ffi ; ff l =: ffl ; | |
73 | % | |
74 | % LIGKERN space {} * ; * {} space ; zero {} * ; * {} zero ; | |
75 | % LIGKERN one {} * ; * {} one ; two {} * ; * {} two ; | |
76 | % LIGKERN three {} * ; * {} three ; four {} * ; * {} four ; | |
77 | % LIGKERN five {} * ; * {} five ; six {} * ; * {} six ; | |
78 | % LIGKERN seven {} * ; * {} seven ; eight {} * ; * {} eight ; | |
79 | % LIGKERN nine {} * ; * {} nine ; | |
80 | % | |
81 | /T1Encoding [ | |
82 | % 0x00 | |
83 | /grave | |
84 | /acute | |
85 | /circumflex | |
86 | /tilde | |
87 | /dieresis | |
88 | /hungarumlaut | |
89 | /ring | |
90 | /caron | |
91 | /breve | |
92 | /macron | |
93 | /dotaccent | |
94 | /cedilla | |
95 | /ogonek | |
96 | /quotesinglbase | |
97 | /guilsinglleft | |
98 | /guilsinglright | |
99 | % 0x10 | |
100 | /quotedblleft | |
101 | /quotedblright | |
102 | /quotedblbase | |
103 | /guillemotleft | |
104 | /guillemotright | |
105 | /endash | |
106 | /emdash | |
107 | /afii61664 | |
108 | /perthousandzero % PERTHOUSAND ZERO | |
109 | /dotlessi | |
110 | /dotlessj | |
111 | /ff | |
112 | /fi | |
113 | /fl | |
114 | /ffi | |
115 | /ffl | |
116 | % 0x20 | |
117 | /uni2423 | |
118 | /exclam | |
119 | /quotedbl | |
120 | /numbersign | |
121 | /dollar | |
122 | /percent | |
123 | /ampersand | |
124 | /quoteright | |
125 | /parenleft | |
126 | /parenright | |
127 | /asterisk | |
128 | /plus | |
129 | /comma | |
130 | /hyphen | |
131 | /period | |
132 | /slash | |
133 | % 0x30 | |
134 | /zero | |
135 | /one | |
136 | /two | |
137 | /three | |
138 | /four | |
139 | /five | |
140 | /six | |
141 | /seven | |
142 | /eight | |
143 | /nine | |
144 | /colon | |
145 | /semicolon | |
146 | /less | |
147 | /equal | |
148 | /greater | |
149 | /question | |
150 | % 0x40 | |
151 | /at | |
152 | /A | |
153 | /B | |
154 | /C | |
155 | /D | |
156 | /E | |
157 | /F | |
158 | /G | |
159 | /H | |
160 | /I | |
161 | /J | |
162 | /K | |
163 | /L | |
164 | /M | |
165 | /N | |
166 | /O | |
167 | % 0x50 | |
168 | /P | |
169 | /Q | |
170 | /R | |
171 | /S | |
172 | /T | |
173 | /U | |
174 | /V | |
175 | /W | |
176 | /X | |
177 | /Y | |
178 | /Z | |
179 | /bracketleft | |
180 | /backslash | |
181 | /bracketright | |
182 | /asciicircum | |
183 | /underscore | |
184 | % 0x60 | |
185 | /quoteleft | |
186 | /a | |
187 | /b | |
188 | /c | |
189 | /d | |
190 | /e | |
191 | /f | |
192 | /g | |
193 | /h | |
194 | /i | |
195 | /j | |
196 | /k | |
197 | /l | |
198 | /m | |
199 | /n | |
200 | /o | |
201 | % 0x70 | |
202 | /p | |
203 | /q | |
204 | /r | |
205 | /s | |
206 | /t | |
207 | /u | |
208 | /v | |
209 | /w | |
210 | /x | |
211 | /y | |
212 | /z | |
213 | /braceleft | |
214 | /bar | |
215 | /braceright | |
216 | /asciitilde | |
217 | /hyphen.alt % HANGING HYPHEN | |
218 | % 0x80 | |
219 | /Abreve | |
220 | /Aogonek | |
221 | /Cacute | |
222 | /Ccaron | |
223 | /Dcaron | |
224 | /Ecaron | |
225 | /Eogonek | |
226 | /Gbreve | |
227 | /Lacute | |
228 | /Lcaron | |
229 | /Lslash | |
230 | /Nacute | |
231 | /Ncaron | |
232 | /Eng | |
233 | /Ohungarumlaut | |
234 | /Racute | |
235 | % 0x90 | |
236 | /Rcaron | |
237 | /Sacute | |
238 | /Scaron | |
239 | /Scedilla | |
240 | /Tcaron | |
241 | /Tcommaaccent | |
242 | /Uhungarumlaut | |
243 | /Uring | |
244 | /Ydieresis | |
245 | /Zacute | |
246 | /Zcaron | |
247 | /Zdotaccent | |
248 | /IJ | |
249 | /Idotaccent | |
250 | /dcroat | |
251 | /section | |
252 | % 0xA0 | |
253 | /abreve | |
254 | /aogonek | |
255 | /cacute | |
256 | /ccaron | |
257 | /dcaron | |
258 | /ecaron | |
259 | /eogonek | |
260 | /gbreve | |
261 | /lacute | |
262 | /lcaron | |
263 | /lslash | |
264 | /nacute | |
265 | /ncaron | |
266 | /eng | |
267 | /ohungarumlaut | |
268 | /racute | |
269 | % 0xB0 | |
270 | /rcaron | |
271 | /sacute | |
272 | /scaron | |
273 | /scedilla | |
274 | /tcaron | |
275 | /tcommaaccent | |
276 | /uhungarumlaut | |
277 | /uring | |
278 | /ydieresis | |
279 | /zacute | |
280 | /zcaron | |
281 | /zdotaccent | |
282 | /ij | |
283 | /exclamdown | |
284 | /questiondown | |
285 | /sterling | |
286 | % 0xC0 | |
287 | /Agrave | |
288 | /Aacute | |
289 | /Acircumflex | |
290 | /Atilde | |
291 | /Adieresis | |
292 | /Aring | |
293 | /AE | |
294 | /Ccedilla | |
295 | /Egrave | |
296 | /Eacute | |
297 | /Ecircumflex | |
298 | /Edieresis | |
299 | /Igrave | |
300 | /Iacute | |
301 | /Icircumflex | |
302 | /Idieresis | |
303 | % 0xD0 | |
304 | /Eth | |
305 | /Ntilde | |
306 | /Ograve | |
307 | /Oacute | |
308 | /Ocircumflex | |
309 | /Otilde | |
310 | /Odieresis | |
311 | /OE | |
312 | /Oslash | |
313 | /Ugrave | |
314 | /Uacute | |
315 | /Ucircumflex | |
316 | /Udieresis | |
317 | /Yacute | |
318 | /Thorn | |
319 | /SS % Germandbls | |
320 | % 0xE0 | |
321 | /agrave | |
322 | /aacute | |
323 | /acircumflex | |
324 | /atilde | |
325 | /adieresis | |
326 | /aring | |
327 | /ae | |
328 | /ccedilla | |
329 | /egrave | |
330 | /eacute | |
331 | /ecircumflex | |
332 | /edieresis | |
333 | /igrave | |
334 | /iacute | |
335 | /icircumflex | |
336 | /idieresis | |
337 | % 0xF0 | |
338 | /eth | |
339 | /ntilde | |
340 | /ograve | |
341 | /oacute | |
342 | /ocircumflex | |
343 | /otilde | |
344 | /odieresis | |
345 | /oe | |
346 | /oslash | |
347 | /ugrave | |
348 | /uacute | |
349 | /ucircumflex | |
350 | /udieresis | |
351 | /yacute | |
352 | /thorn | |
353 | /germandbls % or /germandbls.alt | |
354 | ] def | |
355 | ||
5e13499c | 356 | %%EndProcSet |
d3ad40de | 357 | %%BeginProcSet: texps.pro 0 0 |
37c41ab1 CR |
358 | %! |
359 | TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 | |
360 | index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll | |
361 | exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]FontType 0 | |
362 | ne{/Metrics exch def dict begin Encoding{exch dup type/integertype ne{ | |
363 | pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get | |
364 | div def}ifelse}forall Metrics/Metrics currentdict end def}{{1 index type | |
365 | /nametype eq{exit}if exch pop}loop}ifelse[2 index currentdict end | |
366 | definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{dup | |
367 | sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll | |
368 | mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[ | |
369 | exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}if} | |
370 | forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}def | |
8a9c66f6 | 371 | end |
37c41ab1 CR |
372 | |
373 | %%EndProcSet | |
50fc6e33 CR |
374 | %%BeginFont: SFRM1440 |
375 | %!FontType1-1.0: SFRM1440 0.3 | |
376 | %%CreationDate: Wed Sep 12 2001 | |
377 | % Copyright (c) 2001 Vladimir Volovich <vvv@vsu.ru>. | |
378 | % See the file COPYING (GNU General Public License) for license conditions. | |
379 | % Converted from METAFONT EC/TC and LH fonts: | |
380 | % ecrm1440, tcrm1440, larm1440, lbrm1440, lcrm1440, rxrm1440. | |
381 | 11 dict begin | |
382 | /FontInfo 6 dict dup begin | |
383 | /version (0.3) def | |
384 | /FullName (Computer Modern Roman) def | |
385 | /FamilyName (Computer Modern) def | |
386 | /ItalicAngle 0 def | |
387 | /isFixedPitch false def | |
388 | /Weight (Medium) def | |
389 | end readonly def | |
390 | /FontName /SFRM1440 def | |
391 | /Encoding StandardEncoding def | |
392 | /PaintType 0 def | |
393 | /FontType 1 def | |
394 | /FontMatrix [0.001 0 0 0.001 0 0] def | |
395 | /FontBBox{-178 -319 1370 944}readonly def | |
396 | currentdict end | |
397 | currentfile eexec | |
398 | D9D66F633B846A97B686A97E45A3D0AA052BD0CE60552BD63101D7CDBEEF5B11 | |
399 | 69C468645FE4ED1AF2541AA0770C1DCF81623DE0ECDF49F2B522618F650CE6CB | |
400 | CC8C21885DD61AF8A523AA677EAEDDFA51A1F9B1885EEE0456196D634E04EF89 | |
401 | F17499DAD982502ACC349B9EEAAE4A71A73D1147318C60A8BAC10510DE90D8D3 | |
402 | F46E47295D27129A5AFE0C65E22BAD10D06885A2EE623FF8E1D90287A083E00C | |
403 | EF25195F68A2A98170E4875AA6B96583CD5632BAD9EB3D511DF934CD36447A31 | |
404 | D420FA313B5721C37085F478B27E13191957AD30B8B082BCE733AF8402AA3B7D | |
405 | EC69807BBAA8142AF1CE151D99F5A59AD18798F94781EFAD48BEC8C62C05C56A | |
406 | 336D71AB584F6DF014C56523108606FADE931125496247870E980A65AB33C0C6 | |
407 | D5B074864D0F58CBE333EFA1201AF335FBDBFB1CC8B1294856C250F222BFB8BE | |
408 | 5DE74F808904F7678552F213C674497F829E96812D340939F73737731D289801 | |
409 | 54E5A8F7F5067ACD9D768F4649B51E54513F2F7878141FC719627C23FC5FBBB6 | |
410 | 3F663343D902E95C56C559B588088227B22378FAAB29392FA62933283D2FB2EA | |
411 | FDAEC6C1A94ABA0B5BEFA1E728A2052434BFBF6D9759D02A2C6092D4EF794241 | |
412 | CC28BC939A424AFA193F96530985EE89E2731F6A99BC84C6551A3FEA1342509D | |
413 | D389F786C8EAF972B8C98B79003B6C71E6696518BE4CAD2A317C5D29621031B4 | |
414 | 00A035445D8CFB67D6C136B3F6D82396E11A3679BC82498519C27601236F1FCA | |
415 | 073DA7817B529424CAF49A0AEE8FF7520C0F204A3B1725F46C2C6953C20E93B6 | |
416 | 2F3EED0EEDF87A350CB841516107D9571503A3D62A2F81840070D43392160783 | |
417 | D111F3463760EBE634515DA1A1B6C3A5D14FC475F277BAC792FB69B4219E9BF5 | |
418 | E6F8520584096A7B7BFE439A1604C2BBBB9140A4F4728B4B553A27E1AF52181D | |
419 | 701E90C4FBB16EA8DB39B562E5A2932D45893081D52E020A1FCBC44DC204F4A5 | |
420 | BEE47F9D25876644CC856B1FC225B61124B89B896C39CDAB0ACCA8277F827382 | |
421 | 6F58A0C8456DC41217219D894B42968FB2EC75D5518B6C4413BAC889532F0B0B | |
422 | A8D728949CEA00D4A1FD757B3A2336D472842ACF8EB9869044947C67D9AC7BBF | |
423 | 7386DDE209A8DC9F18085952818F67FDC6088D9C8BC51BA6DC0FA37A0F81EDB8 | |
424 | 6F259FA8C0FA3D55BC44529889E72E407C89ACF658631A0508FD7991088644B4 | |
425 | C958031B52421F9CE73A0479A3175231EFD9E0F7A7B08380E9BAF015730B175B | |
426 | 93C380D1D0F3EB929B7182691BE7E2116CE295CA4331ABD7ECAD7D2DD46FE3E0 | |
427 | 5D3893ED100135901FD42B4E11BEB2689A13E86F1E68635DD81E5A720082E802 | |
428 | 89B440A111B2CDC6BFE79E5B2EB0C528FA0E958F0E981EC29C3B02A9186D7907 | |
429 | A0CC29251E567958BA95DE609A421581433DD50AF96A82A5ADEFD1C9540D87A8 | |
430 | D74A7709AF84AD36753784ED8267D3C2521A32C7A9D5BE01E0AF3B349200639C | |
431 | 90C8BF2E26920AC410A9C5D1EB85C0ADD16BAA83B6C0BFE82483D3B719DC19AC | |
432 | 89155140691E3E37F861C53A6F39441B5F229828B198DF5BF6286060DCB64433 | |
433 | F43499E4AB973F84655311A644ED0921B41B9AE7A8060CB1F45E824FB3497C63 | |
434 | 0A13CB5902294E66186E4496A825447734DF4AB581803488B912E7DCD6007527 | |
435 | B4CFDC5AD5D1DB430007AE929F969EE332CCF235DAF977D387E47BE0EE337118 | |
436 | 8CFAAC0907E16B0BEAECC3B39221867AE6464BE9AB4CE591B2E24B45AD2C70E2 | |
437 | A183065810D6AC3DE8EA9F66615113F1E683A4475CE5817491ECBDD4A4818AED | |
438 | EAFEAB8B93FBDB335D02FAF9276958EFAEE1057C45D313419D195068076D77B2 | |
439 | C0FF6EA8D6F3F0A899D17E04B8B2141EE335 | |
440 | 0000000000000000000000000000000000000000000000000000000000000000 | |
441 | 0000000000000000000000000000000000000000000000000000000000000000 | |
442 | 0000000000000000000000000000000000000000000000000000000000000000 | |
443 | 0000000000000000000000000000000000000000000000000000000000000000 | |
444 | 0000000000000000000000000000000000000000000000000000000000000000 | |
445 | 0000000000000000000000000000000000000000000000000000000000000000 | |
446 | 0000000000000000000000000000000000000000000000000000000000000000 | |
447 | 0000000000000000000000000000000000000000000000000000000000000000 | |
448 | cleartomark | |
449 | %%EndFont | |
37c41ab1 | 450 | %%BeginFont: CMR9 |
45c0f7f8 CR |
451 | %!PS-AdobeFont-1.0: CMR9 003.002 |
452 | %%Title: CMR9 | |
453 | %Version: 003.002 | |
454 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
455 | %%Creator: David M. Jones | |
456 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
457 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMR9. | |
458 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
459 | % This license is in the accompanying file OFL.txt, and is also | |
460 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
461 | %%EndComments | |
462 | FontDirectory/CMR9 known{/CMR9 findfont dup/UniqueID known{dup | |
463 | /UniqueID get 5000792 eq exch/FontType get 1 eq and}{pop false}ifelse | |
464 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 465 | 11 dict begin |
45c0f7f8 CR |
466 | /FontType 1 def |
467 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
468 | /FontName /CMR9 def | |
469 | /FontBBox {-39 -250 1036 750 }readonly def | |
45c0f7f8 CR |
470 | /PaintType 0 def |
471 | /FontInfo 9 dict dup begin | |
472 | /version (003.002) readonly def | |
473 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMR9.) readonly def | |
37c41ab1 CR |
474 | /FullName (CMR9) readonly def |
475 | /FamilyName (Computer Modern) readonly def | |
476 | /Weight (Medium) readonly def | |
477 | /ItalicAngle 0 def | |
478 | /isFixedPitch false def | |
45c0f7f8 CR |
479 | /UnderlinePosition -100 def |
480 | /UnderlineThickness 50 def | |
37c41ab1 | 481 | end readonly def |
37c41ab1 CR |
482 | /Encoding 256 array |
483 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
484 | dup 12 /fi put |
485 | dup 44 /comma put | |
486 | dup 48 /zero put | |
487 | dup 49 /one put | |
488 | dup 50 /two put | |
489 | dup 51 /three put | |
490 | dup 52 /four put | |
491 | dup 53 /five put | |
492 | dup 54 /six put | |
493 | dup 55 /seven put | |
494 | dup 56 /eight put | |
495 | dup 57 /nine put | |
496 | dup 65 /A put | |
497 | dup 66 /B put | |
d37a4722 | 498 | dup 67 /C put |
d3ad40de | 499 | dup 68 /D put |
d3ad40de CR |
500 | dup 72 /H put |
501 | dup 73 /I put | |
d37a4722 | 502 | dup 76 /L put |
d3ad40de CR |
503 | dup 77 /M put |
504 | dup 78 /N put | |
505 | dup 79 /O put | |
506 | dup 80 /P put | |
507 | dup 82 /R put | |
508 | dup 83 /S put | |
d3ad40de CR |
509 | dup 88 /X put |
510 | dup 97 /a put | |
511 | dup 98 /b put | |
512 | dup 99 /c put | |
513 | dup 100 /d put | |
514 | dup 101 /e put | |
515 | dup 102 /f put | |
516 | dup 103 /g put | |
517 | dup 104 /h put | |
518 | dup 105 /i put | |
519 | dup 106 /j put | |
520 | dup 107 /k put | |
521 | dup 108 /l put | |
522 | dup 109 /m put | |
523 | dup 110 /n put | |
524 | dup 111 /o put | |
525 | dup 112 /p put | |
526 | dup 113 /q put | |
527 | dup 114 /r put | |
528 | dup 115 /s put | |
529 | dup 116 /t put | |
530 | dup 117 /u put | |
531 | dup 118 /v put | |
532 | dup 119 /w put | |
533 | dup 120 /x put | |
534 | dup 121 /y put | |
535 | dup 122 /z put | |
37c41ab1 | 536 | readonly def |
37c41ab1 CR |
537 | currentdict end |
538 | currentfile eexec | |
45c0f7f8 CR |
539 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
540 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
541 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
542 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
543 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
544 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
545 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2DB9AF72336CC4AD340 | |
546 | 15A449513D5F74BFB9A68ABC471020464E3E6E33008238B123DEDE18557D712E | |
547 | ED5223722892A4DAC477120B8C9F3FE3FD334EACD3E8AABDC3C967C61FF003B4 | |
548 | B10C56D6A490CE9594D57A2D431B9E5E10FE3D8832E227A7087611431ABCD029 | |
549 | 85F4865E17E17F8CFBD2CADC97E0A8820E3ACEC873F31464466A9545E967E53C | |
550 | DBDDB8478E69063FBB891566BAF88B7660A4405B16834761F041CCF7650AF955 | |
551 | F9E853AA9F5F4382E1FE7D0C5BB4023818A2383F91249D48CE021250EC9EEB1D | |
552 | 2835E18FB73026250B32A8849067D5E2258797C917F998F2D4121D96560C5FB5 | |
553 | B5D3471216639A8671B6DFAC5E3554EC36D9A72518525A795590C74DD70DA3A7 | |
554 | 78BFC43E51D6F2BA52F17D4DD00D389D3983EC54912AFF73684A8A7E345537B7 | |
555 | E62361C04A47859DA084BC72EA53512DC54132EB2EE671793603015652EAFDE3 | |
556 | 41C4B6B679BD60AEC5153EA0D2200CB1D097DAD770F5F31E6FC475A225995277 | |
557 | B867B731D5401E2D02B85BA85158C80FF7E2BBCC42B98AC867E67D25DB656072 | |
558 | 55A0D32AB7AA483A5A9686CEA4E2B3031D90D84DB3E2DEE7706C91BA81CB8DAA | |
559 | 700E5F61E07D6998C9552C81B66FD10A10033D49EF3BCB0FF22ED0A3737523C9 | |
560 | 8F851C61C4BF8A213BF6EC70C956AE48B5BD276CC0437C72BF6515B10739919A | |
561 | F00F6ADD2798CB211668842349171A5AEB0664D2C44397E55A4A9EBDF54A3EF4 | |
562 | FBBCDAD9DAEF4B0CAEF7112FA828F2F8D9F633D37E5516AB5ECEA87342EF8DC4 | |
563 | 3A50548490F5BC9A8A1F98AC7AEAD9D913BFA10CA86D73AEB5BACC1FEEFDCC15 | |
564 | B3655522CCA2C772E902FAB2A6FC153597D52763EB44AB7489FF061F7F58E8F2 | |
565 | AEAAF4D17F36CBFC00D3C653F335D14240C87DB4339DA9D30A5BD1F502BC9013 | |
566 | 461B9DB2FBEEC01BB18990439A0E9CA6576BC9CF6B1A3DB9386C4A5D4AA6A5DC | |
567 | CFA45FB75F22E10ECB72565DB441A194902C91427B4F676E531C661F7A2C3C85 | |
568 | CD534D1C89B6779B2EDC8E44667B992C20C70B663BFBF680A6CF4383EB7CA26C | |
569 | 4D1F06B5EF4025BBE65795F1EDB5CCB97050872D6C07BC2974F905ACDB7A765F | |
570 | 291365D6C8152153E7F017A25FB4476C60FD9EAF9A121633DBEAC32F62850223 | |
571 | D6418566AB350F90F4B35F19598478F76B63E347D4C61E203D4DB8ECB9889181 | |
572 | C387F4B663A502C638761D2782BB96EAC81A0108D7BD6938F67FEBB69218D115 | |
573 | D8E89CFABCE15C6ACC7FEB983332A51A6A73CF4E341574F366713D7FB29956D9 | |
574 | 9BF238A87483D37E526A2EA2F101EDD34E34CB92730DCA7235AA0027189BE405 | |
575 | 2DAB4AA021A30C28B26C50808E1E965C02F6212EC7C72F5683339425A7739380 | |
576 | A422E6191ED8453AF0CAAA424AE44DFA7CC5C2F6EAA8D73A5101D8E9517DBCFB | |
577 | 2858D0E8ECB7DC430EF23A9E4428CB7DED8D035D6050251AC101A2D0E884721E | |
578 | 2F21E573F948048BB8FF888911C508CC198BD750083B339500C426AFCD5634A6 | |
579 | AAAC1C7E91249667B231BBFC64B4317192FE07FE9DA0DDB5E517D097AAE46577 | |
580 | 9555F29D45C67CDE9812CAD03F220B20519F2FF32DCA56A554D4296FE2D1F3FB | |
581 | B209B5270E0E695EA5A0EF1144957CE045881AEB8D05D72CE57F4D34617AED67 | |
582 | 0D3AF0472CD8D60933651626550366E300E72A9C89ACD475C2E2ED9BD44B472D | |
583 | 9DAFE943F8E02A6DC38E447EED964624C37C3130E48211CA279BB6A0BD59466B | |
584 | 42F3D89B5746F29E084E22CF58395AF0F29E55113F3A3F2F52CB3A6DF3D026D0 | |
585 | C81754B8E2E4A15F6943BE9D0087D5166060734FD07C4C57D7C7D90E8C9C1F35 | |
586 | 623CEEE3ABAE75E1A18A1E3B50B7266BD2D8E812CFEB4A46B856885B185640D6 | |
587 | B9C22179551002B94282F57FB433B7FF157D2F0D240836B72AF4A331668AE5D4 | |
588 | E6B85415F4E8B9D2F9AF90FAFAA0A3866DF417CA5A31348CF9B41B8F5F4D2F97 | |
589 | CCF7ADE851B5E2E2F6E319AAF5792EBB9DA2C6AA8B73D889F3CDAA42932CDA7D | |
590 | 07A7E59183CD89520DDFC36E5D513BFD8AD0886046585F29B4D7F42CC0C27AA7 | |
591 | 53915AB1167D292FE91957E94A57FEE2D49C20C9070ECD736BDEE0F046E60350 | |
592 | EA539DC298156A4E0D019E7D481FDDA6861E20678516AB80ABEC1F09B126BCB9 | |
593 | 52E8272A06BB6DD87ACFC423B4A4FC9A3DC8DCAEBB807C5F748F1FF8B17B8B88 | |
594 | F426206BF1B7B7D239D26BC3CF0776C467A98CFBBCA5FB6145D5900137ED19DC | |
595 | D002F10704AA680EC753C22E29AAB15712EF22AF73D80820A1EEE953463D4EA3 | |
596 | 81FAF99518D4FD0F862A324FC44C4B9542A92C5B60CC983CC8F647CE5BDB4D6D | |
597 | B92B380E0E5F7208A9CD91FA9A469548162C761C1BA05AC9D60B766764D821B6 | |
598 | B4E17F56CE455F06EA1EE2D38FE47581746C4C5FBA63AEE2B58E877D1A8FA83A | |
599 | 31C972D53B64E92EEEA147426A92CFBF76FC614119C6E9C6476FD6A069C803BF | |
600 | E949FBE50B5AB1F1463F9747E8D353F7BBD991C4F90F920BC9407D8E24720293 | |
601 | 846D052214E60390C3CB926D38C83AF697425D80C2B4FC4706615B905516B733 | |
602 | 46ACA325CEA68FB21B2D17CF0B68BA4DF249368625CF83441EDBF2B86C957C1E | |
603 | 44CD722BD2537CE84FBA07EC7AE15C840041B9F7F3040072E6084CD55B301C08 | |
604 | A64A53BD4D3DC30DCAC6C152F316ABC59B8EE978793EBD568849DCC2A75A495A | |
605 | BC83470D503F8E389F54B4A4A31624E83C601B43AC1E52CB811FAA7CA6B644A5 | |
606 | 1AE0BFD4FC774C9C9DFC2769ABFA9C83F900BE2DD4010416053A1D4874E6ECF4 | |
607 | D86E44B4CAB15D53E5630C144B0C15B58DAAD785BA298B1893D1B09BA5D40344 | |
608 | 6678FD2D17FF6674433C976D6DAC659175CED26139967C9B2B9CFFD78FC2570A | |
609 | E5142141C2888DBF2DC8503F9137CE7CB21A1EBC2D65BF33FCEFBC85C9CB736E | |
610 | 24E8595CE934AB032CC70BD6A3B0F3BDBFBBE185512FDB7BE3D4A6620478453E | |
611 | 75D044BF770B44C9741E31985E6DAF5A318D7BED12B02A4BCFE60D25EF12843D | |
612 | EFC9BAE2A3F2EFAD66D7858E83EB46BB09D2FF8AE9C43844A7001C86ED97AF51 | |
613 | C511E3A89A1BE349FF5215D1A57843EF51456B9838133846F19BE79AAA5C1AB0 | |
614 | 5F400E5E8E7B0BF96EFCA3B8F0894BE589F2C9FB6C97BD16D38F0A237CD4F034 | |
615 | 099C41F85C7E2C7BEC8E02C4F327306A53B4B48B26A8926670CEEF96F6DF2281 | |
616 | 7C2DAD99EF8B81BBB777227C2475AE7400DC393D9C0445E925DB1E955950F7AE | |
617 | 53E9AC4306794239346A419F7B5DF4168382EF5956B81F83BD4BB7635B3BCC84 | |
618 | 7D84D05AEDC02D14675D777CD19B08124001A4F4EA96990D96000C082A12F00F | |
619 | 7FEF793A7FA69D56D3A38D012168C5458B667190AFE80E02C816CAFF0A71953C | |
620 | D80B085CD286027E2FDBB05452AA762FD7C813B2E19A79C74190E04E746C4933 | |
621 | CE1E300CAF5DD53B08110509BDA404EF07FA1BC5224BF1205DE8E0C3276A13DD | |
622 | 866675103B960C5F36644F96B4FAC16F5D6E91F74629B318FCCC8E8CB13EB76B | |
623 | B0B7B90718D913A52A04732EA3667674994A325A7973C601A7DDD50F658E0826 | |
624 | ACB8E53D4914B0274AED98D7BC3B2B7F9D48A7ECC2F8ABEE05CF2C4F2B90360B | |
625 | B7DF779EAF3E103D1D83EDBE32DDA873768D8C37DC10A5354A94B4153049AD64 | |
626 | FF3E0BB51AB91D7C0B4134D8731CD0270DAAF19BED9EAD800A14B65B68EEE89B | |
627 | 40DD624111670DDC7C030DEFE0D1B96420E249332445C155BA96231C88E70643 | |
628 | D526BDF3CA1E05FEE72CE2B881CFC01ED780C10E89F0828AD55FE29043BC56E8 | |
629 | 2750A6DD15AADD54492F6092618F4CC6A31766B17FC60766D18C307EFC9BB787 | |
630 | 39047DAD6B38419EFBA46B4E2C932F97451FE78AD75FA90DE409FC6DD46585D2 | |
631 | 1941F5ED47A8FBAEF5A917A240959E8D9F9917DEA3247D9CAE6BF7A88DB4C4A4 | |
632 | F9F5A6DCE542420A032FF3392FE0F3357B51F884D6181583A554F75B1DF192E9 | |
633 | 253CC828FF06B0D992D5316435980B044BB191508C7C45CD90F797F88856424B | |
634 | 14A5707459C50EDCF3E3D8D1667AAA83015405354CE744C66D9A5728F29E0085 | |
635 | 6DBF740717FA0799E3BCC4ED7841588B496A5E549B953A7FD288B4A045DB611E | |
636 | E3B2F35963FF18ACCB1C968BEEA2CBF52B3999AAF89A05320BB2E97F52CFE06B | |
637 | 9F10E3A79865A3059A957F97972D80ADF678A36E2B586C101FC6AFA4D137C13E | |
638 | EE7102C9B8EF78CB057F8B7476F146E8FF5C897FD5503DD198128CFF7B5FB339 | |
639 | FAD0AF0EA967F77B07B367A4AC9F668F8BED99B98E87FAC750EE045602D76C3F | |
640 | 289FC9D97694C96AAC0AD1BD3FA94DF2CBCEA24B40F47B9B59E54EECEE7AC4C3 | |
641 | A3F5D19160E4C1EA830D57FBE10D8D46AC5CA0260F22FAA45236F0F542BEA9C5 | |
642 | 5A88F878F68B36114E0573900C65E305462B22A3429A17C7A567694414DDDA46 | |
643 | 5F30542B8FD4F00F6C295B2E8D3A986B953D96822DB2ECD48E8BB1763434E652 | |
644 | 152EF3717F5E7FA10FF0B01D9F64E22C5DBD7254629658887BACEC0ABDE972EE | |
645 | 67299FB84A05B3EFE22B6976DB4CCA384232DDAE38C31623A4E39EA2E82C1EA3 | |
646 | BBB68F1A7DBF405DEC37CB7203A895C36A44BD2D63F45B3888AF91D37B510A59 | |
647 | 3C921BB44DA620892AD87B665F69F6FA510B071ECC403CB2BE2F54B3969C9E88 | |
648 | 713244BC97C1466DA8216DA7600C221E7E7EF5C789D2E12B36422023A03E11BF | |
649 | 2790FD6062FE6BF62F5010A92F0A104B76E255A0975E04F6F20F760881BDA7F5 | |
650 | D834D1D328B6EC19AA7D5E5678A84C74C82553DBE8BB5765E84F5A8789032143 | |
651 | 6020940B4B8D45FC3433D356E28C25F42D0C19F911213D85951B2B00D01B77BB | |
652 | A4C72E964F9D95422BEDE582A05CD52E03D28A996E6CC8FCD910CBAB728073F9 | |
653 | F9FAEED5470FFA55930447C5BA816F826F983D53EC9941EC8364B3060FD74C95 | |
654 | 26D4F5CA753B574FD2FA4D1D333785241D8741B79E628BC852FDC35478C5ED9A | |
655 | C1BE88C5EE7302816E65C12B58EA16FEDD4672EB3E24B6EDAD5DCE263BA8A970 | |
656 | 350B651E5A9F3C281D85BC3F44EADD0D93402E36489BA5185E7D388974B0B700 | |
657 | 70575188BB610CCA20F081E2CBDA13DCC6F72567962ADB342E02C1E763B673C5 | |
658 | F7384E24C6E1730A3A790D690A2103AEF88E0C1D4480DC9B25E5C8C9E1919C95 | |
659 | F83320179B4C7C4A26D559BFB24D7D596FB73758C9990C451E77FCDDD17763B8 | |
660 | 9C30A9534E3CB6680D3D419D4B70B0B0A0D160FCCDE169714E373F65B7144CC2 | |
661 | DB9A44E041211E1517D3148E65A2486CBE5E74E625261CCF65392FB4F3091473 | |
662 | F9E8DF327D59A58558E5C9F7190DB577D5DC658F5E36258291C708B3D224653D | |
663 | 064BB6079F91293FC733710893AD1C96169B30CBFE4E9D52E7EFAE4AFEE68FEF | |
664 | 1AFD5E7E9DFCE8DE332B0FDC0514F9B3090AC85BBFB527FD8034DD33E9576325 | |
665 | A8769AE09AF1BA792447DDD932B98FC9486B39E0B04DDB3EFB7A30DA0940B33E | |
666 | E27490E0E841E87B1C90E5248A91742ABEDC10F43A8AF0F9C5B4A4930B1AADAF | |
667 | 01874B9AC3B8D0DBECCDA6CD7E96471FAA15CB7F8A599C5746327CE392224C3C | |
668 | 40BD60AF97BCA6FF6FCAB2FEA114D7300B89E91C3BC92D5B3E2C83BB37992D8C | |
669 | 72F661EFD0AA034C738C019DFB79BF40651A1A34BC1EB9F5AAF58F8B3DA32645 | |
670 | 24AFF8636486F08BC21533B5FF7391B0679A78DFDCB03DAF6BB7475A1D51DAC1 | |
671 | EE4BE9B986655D1FDB6936445EF99B58B303FE79F11275EEA96A9F6808EA8775 | |
672 | D873D1052FAC93769789C700F20EB2ED6D15676F6E563A769CA9298E463FC311 | |
673 | 83281483B1C953370D196727A6A0E66D32D9480AB1B6DCA77868C1A2D5DB6483 | |
674 | 5F31EB6B18EEFEF1CDC31533E69B0AFC6B30FC9912DC89BAAEEADC30BE14F448 | |
675 | 1A6B70D36A5D9B01799BEEA686066114910842D022EB464A9A1E8F0A5628BA69 | |
676 | AA9A1925CCADD44703BC67A89F3B48E4680726DC4360274185CF3C8AB747A8FC | |
677 | 4B928AD62B092EFE48B01E33ED756DB696171FDB775396BBA138E056F71EDAE3 | |
678 | 7A1E4CC272B8418114B0E81DE0BC43DB3C133167344488820A92DF10FFA26FB9 | |
679 | 65FCA2C87D302E956DE6B4FE145145440C83DB43A68F8B29A592B127BDF49063 | |
680 | B7F11E155CD4CAE305525BEA56B7C412A6260426407BD892A3F2B444AC3421E6 | |
681 | FB6E6425EB5C3053C5644666B80405530FA0012B54557327C98E0F4F064099A6 | |
682 | 4ACAAFC1870359C1B6FBE7606BB8A26026AE20C212210449905E628AF1B20490 | |
683 | 8CE908B7EF3E3DB551C85AEB0F7FEB6A8D215B97998E5DD9C7CCFB2A9402B8B6 | |
684 | 1770D4023777D4B45A73F471355353412C51D4CE71FAD1E0AFBD87B5F86307F3 | |
685 | 10D0B94F1194EFFB64AD5DA54A4200490F609CA8B912E149F8217ABB1E9EBB3B | |
686 | C4470E7365CF5E1E761AA1945044B225BD53D142F6588C50E0644740F7DD55E4 | |
687 | 8F73201E5354A8BC78339211AFC4935F44701FBA043AAC4BA4698E9D7700029A | |
688 | C79F992F62627C91EB855F64C4B251718FDA71EDAF082A0C7B00550949D617A0 | |
689 | 7071FB14F05620CCF2180941341D8E60FC88823438FD728A4042AFA8B853107F | |
690 | 852F631518B61B234565291B5D5B89DA818DEE3AE3B68A2869DFA63255CC882C | |
691 | 3B16BBA08FCE3632E57FF7A07F857A1F0FDCADAB39D77960BD827CCC8661A997 | |
692 | 648BF5BEBC0FD2286C2A112A8DEB9CCB6330A049170D5D68EEEEA011D3EF3EBD | |
693 | 855236B9380087CBBB6BE24191F728B7EAC5B50F7A547AA0989B7C7D3437DBCE | |
694 | 1669341264E290646F2C8C5A3ACAAC7CB63DC692FAAE13E9B40E8BD39FE16A0C | |
695 | 1660CE66872D061056C04DDDC265C024BEF8B7E3C3AEE76FE5C9702002C28BE0 | |
696 | B180295EE00E567FA2E5CD1638226D24A7C732E1BD8103B476EF5702768689C7 | |
697 | D4FCD47F2AB94A2B1FBAE6ABF87B09E7713C773FB65CA83F7318035B332B9F99 | |
698 | 24A2C8897527021321D003AAD7C273E4BFA2710B9BB26C2CFD3D9A5D7ED1096C | |
699 | 552D50028AE2476FCD6D12A5D0A897521313ED1A3A8456A70C16EAA50A3E6733 | |
700 | 6DC89FEC56AB54A579EF264377A103939D5EE00A90B4F2206D0023AF9491FBE0 | |
701 | 800C6540FC945199E20E945F46CEEA2E885F6800B9DF042BCEF4291A4B1A62C8 | |
702 | 6A7ACFF872B25FA3AE69E0093F3D0FF13A3313430C06F1AF94D500431566F659 | |
703 | E8C859A5F80F5BD2E85C8E32603D3745628E8FE6FBC50FA68F9C3811A2BEFEA4 | |
704 | 5852CAE2AE5AAD3230ED050593BAD0A9581EB7B327C6916B8FC348F4C23E6FA2 | |
705 | 00FA28AAACCB3091C1D83F7BB88672A53A2EA3B8C7C24374E400C57F0F01019F | |
706 | E52D5C47F389D4C9AF126F4080F9AB8D1C8F470932BBECCEC72A9796F6E965A4 | |
707 | 82057DDB43D68298A00880D4C2E2496F26F015FD83C5549215753459310339B7 | |
708 | 6B2961EEEE74DA31FEC8E2BDDA42D4080A32372AC372524BDDA580EF6634ACE3 | |
709 | 128C69D04D890DCA337212B109585C665AA83EFE47D5BABC2627A86EAD11BF7D | |
710 | 744176652C7F9497785A7A06A994ED8414BBE8B26E74D48CB83FA24AAFBDD507 | |
711 | 84A90195EA3D77BCE8C2BEDDD1DC52E8164DF15D65B916EBDF3A8A76849653DF | |
712 | AE3CAF9561AF3B705F75B9E5DFD6758DB65A2FD54683759912E0D0035CFBCD86 | |
713 | 5C7018E5F1DFB86B739C4749DDCFB2F40529E1F15174DF4AE9833958B66ED869 | |
714 | 920CFB9524F05AB2FA84A4AC41A02490699F277A3B4ECC3C31ACF79E884B979C | |
715 | AEFF660A8EEF118C79F8DA266F89F32078B1C333DFA5264D6B64371276ED4DBD | |
716 | 5A2DF213D85A56B1CA85DEA53ED0299C1FA48D463B11FC9A0751C986CAABB184 | |
717 | 829B1133CA8422DC11C6CEAAD463FEB468FC7AA2DDBE2E708D27D89164B12BD8 | |
718 | B9A71A1D06D2FA9ED0B02168B32F6CC0FE765F2AF8A19C7196EE55648E642184 | |
719 | BDF993C99EF7C10AD2A7962DB9B7851E6EE24A0C53475186BB44083AE18254B9 | |
720 | F1CEA0B66A6581C81DE19DA8EEC9330A030F3384C1DF8216E5A25FB38C1B94F3 | |
721 | 403C3541593A016CB5FD306F41F40E82D4561EBCBF76153BDFCF338284348755 | |
722 | 0208360C5842FCD6B2D614387575B6E49F4B5A4DA281A352ABE8B76CFCD94A00 | |
723 | 1C586D19B68D965BD8D7EF0DC87271478CB4D0D1633676A2FC51B36876002A9B | |
724 | F5D632ED778BA9EA1C3741FFCC15AEEC11C8E1544DA7358473325812E50C2135 | |
725 | 84ECE7DCE281956681179C09C0E8DBAC5E4424AAD00FDA269BCD6412F1D6DCE0 | |
726 | 2BC7CABF85AE803D620F5140C63DAC4B0E5F7896343973FBB99486B93B6DB58F | |
727 | 38ACBE8868CC58B3918C1AB4406FBCC7BE8496C78C9D628716BF1E306AA802D4 | |
728 | 5FAC522B1EE90448387DB8E85235FFAAF3754E2317B693D567A488753993B8C5 | |
729 | DA3C8FA50A35202958FD0BF2900A6CE175920C2EC7CD449D4DB189A50958BF17 | |
730 | 644345CC38250088A694CF0F482ECC55ADCD02E17B3CCE66213A6163B8B44C9A | |
731 | 89068E3B5301D2364F85BF9DF7C77342796363A7B6B294CE26DBB9179DC15756 | |
732 | E1B32CE919AF44BC79A3AA8FDF6118345B2AE03F3B11D57D9AF50EBCF7152E37 | |
733 | 15510FBF60F16756FC674E2BF58E88CAB2CA2E8B47F50096C51179684331FD61 | |
734 | 8B34520C9C7D01E1511C924FA76B3CAF79501E0AA2C6E1EC6F00CB6CE24B4123 | |
735 | F493B149B5A5147EF6BF1EF3CD21A76945B95082E1FB3C5A150D8AF793348E8C | |
736 | A988354FA46E3775486A6999E022EBE293E8396C8F9416929607730606CFA772 | |
737 | BC8388BA5D64B79E52DD2048ABF21661121A001E6A75731B5DC43CE040396BD7 | |
738 | B85603C8A0F37E522FD0CBA63C454B12960451CE65A69F98FB2FDBAE725C0999 | |
739 | 05FB68B4C1D320F5F3D61FA8446BE6F8BC46AD9CFA5674A3EC73B8F3419AF9EF | |
740 | 7A1A3C9EDE3BD6359902D4B5F3AB4E3FF9CB2E1937937AFA182C651985703F20 | |
741 | FB70E37AADED6345EF4E83CB140FF92310BACFBDA11F2CD5AD93AA7563D7426B | |
742 | 0D4B6CF9B669F9A702956CA845E3814E4B5491E58F8C89714229942165A6E8E6 | |
743 | 58982D89C4FA7BC557214BF9ACE2C63AD88F2D1B18A04F510211687C35AA1F7F | |
744 | D2003D4E60400B95E70422024A7111D926F1B5A77074910710594B95680CFC4D | |
745 | 911FC16B928D9644340A9D2382767FE6AD453E8E4CBF19F77D3DA2934B11FC95 | |
746 | A6900C3CA3F2B6AE4290A005F908305CB37700680D76C4999AFE509B18305D28 | |
747 | 88C36292D6DA208A8D42F8B81FDEA7E93EE59D6AF3F1A3522EE91BE71BC655B9 | |
748 | 79C49B033A036E1FCD94FC581AE732A224F055503CFC69FBCDEA39CB00DC8A0B | |
749 | 4BEFED99CFC4E44ED51DEDF9EA825FF6BB97D316726531CB4BA083B033C0B69B | |
750 | 8068D5D3E3E31DED5F6267439F149549A6E12B00BA85818AEB491978364D9F7D | |
751 | 7375CBD6C5511CC846D0058BD2CE5467EBCEACE5CBEB2D33AC8E12A84CA620EA | |
752 | 99A0ED916B7770A056F6A9C361CD5118B5DDB10A5A4E643FFB8FC5DCBACDCB28 | |
753 | 696E26D030C5918548AD8B87E21E1B4BAA91AF23663CDE350A21C2CEEFD28947 | |
754 | BC07BB49404FA39F251E36B95B7338EF03F2E63FBE0E023452097F21931A2599 | |
755 | 4EBA7BFA669EBEDC0F5B33375DFE6DB1638D19D4B5112B5338B14C93F707D340 | |
756 | 056B2B75AFE418EAF9CD57ED842F7B5FFF037B3A4B369C63E4DF9F0BDB4E39C6 | |
757 | C5BE8EDA628F1C6FEEBC9D9886DBE502CCAA86092646094118069757DAC25C38 | |
758 | 2CA53CBA27577BAF2C57196489CBA54B96C650A1C130184A4444CDE2D0CB1A49 | |
759 | FADCAF1FE3A66334F85FAFB00F142F28AF2D8FEFC29FE8E0FDA448F181040BF1 | |
760 | 62EA7AE75100BA46B49EF30F596CD9091164AF70666E254938BF6A44F01BBD2C | |
761 | 4160164FD89FCD358E48908BEFBAAC4411B52390CEED6B46D729698CCA8E164C | |
762 | F77CEBB50C5254F81570E414B1E9E79269D3B2575E161620CC732C0405A29ED7 | |
763 | 1E5A6597D35B11EE08DC09FC9C27F0126C22C73A0EED657D7F91790777E7D8B1 | |
764 | EBAFB0EC9ADAEFEF7F6A91A1028E46D76289EB1BC15D3597CFCD78D88B633759 | |
765 | 93CB4477596E28A1E413BE25D513BA611757C994AE812C5A6D9AD3F770499252 | |
d37a4722 CR |
766 | C7F53E585E03B2FF056EECFB7ABAC474A981D757AB3B6F2815E7AA8AF8BBA42D |
767 | 4D83EF8A0FE21CA5EBC295042AE5D74E6D05BECCEFDC74ACDD0A59AFDAD3E94F | |
768 | 141E4BFA04ABEF7E6C43418A5EC54C6E8CCEA1C34DDFAC9CC87DD5E9D4BEE705 | |
769 | F11B003956DB37B145DDEF022C645C19329E6C04E1EDCDB5F6A33AF1EDB9A17F | |
770 | 79066B1C3579E70B2D43DD89D1F5FD2B2015FA5009D612781CF4916DD8C7B1B5 | |
771 | 21FF0CFAFCE882A106D356D8851F73635A4E7C81FE0BF6378DC2219BC883E3A8 | |
772 | 23290969A2ACC06A77866A8AB83B39289EB14B4F67511FC97F3BE410B4DE91C3 | |
773 | 54876DEB96AB3C60D1FB17D29172F96E98D3FA77B772C69D17A757B6CE32D2C1 | |
774 | 67182DC41B5E19F31F669A886DD4D08092AFAE132C0E0FF810FCBF937EB3AF0F | |
775 | 5AF1416C11508EBDE0C0EC1C618CB6F66658D9CA3793D523D224F8C9A8ADF6B8 | |
776 | 16CE7D210FD4771ADCFEF08809C0E9A37170F0C02A9C9907FE38DF8795C6093E | |
777 | 0DD464FC59313CA7EEF4658A498CFDA9458AA1A86B2A0933182954BFEC58E9AB | |
778 | 3BF65DEF9BE5289826A7AE0AB0E93D83178049CCF8BADDAA7BCBCCA47F983E22 | |
779 | 3CCBB9D2D522DA2A5EDF409A862A52297FAC35CE11176A8B89671BE758CEA324 | |
780 | 5BD245937C46D52F15241E22F803F77E7B5ED83B6395F5387EA7CA46E1DB1F8D | |
781 | 239374BE3F4640A6FE06CE65A07123B722523AB913DA6EA385F524940432DC0D | |
782 | CE2A2A50539C42DC0942ACC30D372BACF8192645F9943391A602A019EDD69241 | |
783 | BB0EF67C1C367344D82F5669A75D5234A3FE9312EB4C6BE310722AF8065835F7 | |
784 | E55443034F04E4B41F321B7CF95EF163231979A8D7D2E7B982D6DE774E8F4CCD | |
785 | D846A38D9029028C50A99ECE834C67F7CA30F39F4D1803B3CDF4D19FBC3D1FED | |
786 | EA3F72427D13D6C51FB97E417D38E4AD86E93498AC245EA17317EEE503D11C60 | |
787 | E6981F07798D11364ACCAA0F06E6D748584EEC92720F50B71157AB2887406B13 | |
788 | 491C79A0054F145417D7E4902CBB38AF4DFAB4F84E25985A6FBF308D974457D0 | |
789 | 8FACC57B056749382FD35F7D9CFC58B2616D205CA0328294C7F47AB9EB50E1D3 | |
790 | 56B4AA213B1605985939AA68DEBCA1F50407136AE16196EA910089D913A4DDA8 | |
791 | 079F046AAD1DFBBD36DF39C43CF356E40972D8AE3F044F31320A3567520331CD | |
792 | 67227812DF611C31DF6C7B420A170B43A478D0678F615AE88B94646F0F1A400D | |
793 | 3E6FE22E584B1197B373FF2A0CA5C90CCF064A5C8A08170269E967DA2833840B | |
794 | BE87A26B8A5C80F8460100D97C17B62BB62F5F4DDF270DCE6C4F08A733EE750F | |
795 | 6FA75D57A96F5EA3D089D5634FE7C29D6A3DD8206FFAC31EFD273484042313DC | |
796 | 406A646C898E7FCAB097C6E362CE13741CC04549691C6BC246D9FA598AD671DE | |
797 | 81A05E8D011A838E3B9F984676E03BB77EAA1B1256C04028801748155A2B5082 | |
798 | 57E9BFA74C3C18BBBDB7458B5AA3D484CA516A265A9132CA6A16A1C6A1E8F600 | |
799 | 9F9368F4E22AC348EBB52736035A4A4524BCD4B2EF54314007FC9AF134754FD2 | |
800 | C20294DA556EF82639E26A3014F597955B8766C1E317D21E978A2ACEBAAFD25B | |
801 | 6D27E861E254230360B34431BB58A0037C3372CFDF13DD806DC6ED6B0CA4C96F | |
802 | B7018FE26AA64C1D23879F117F9969FCBD649805FE66D5B439F6531E5D841B0F | |
803 | 43D110BFE886A11CE54869E036D6480F6C6E0DDE33B40D605671D99A6D297C82 | |
804 | 65B1F442602A026AB0B73BCBCE1B098C423CC623D40D679E45052492E5129675 | |
805 | F1CA105AE94D7BBF162E8B3CFECC63429E866ED4CBB69F25687DB74A330C7F5F | |
806 | 9727BD3DCF5890FA9BEE5A7BD997433CDD1315850B490DD4EF503BC1A4F30F93 | |
807 | F032E761C9B4A099ECB96F1DDCE4262FBD75620EDD89659CBC70EE3FEF7C50AE | |
808 | CB47D9BD8BDDFB7D5ADFCE11EF6871AB41369A582211BB5680DEE2BC141259C3 | |
809 | 08B73E26815015B99AC3683EDD9EBC880A5A64EA728DE0AD8B038D666955E6C4 | |
810 | 0CB961183309835A70BE28AC86A0C90EBCDE36B2C2F9DCF6E61B27845C048932 | |
811 | 1D9CD3F5E7EE7157A478A9B624C46E044AA050942FF1E15C8553321D36EA7586 | |
812 | 3D4A7CB9D971063AF089F6B2A288A83513B4EE3A0F3CF537633604E31FD22B04 | |
813 | A7A63C54535D31129C4713E5561100F41F596A2771E3399A84C7798C187AC61D | |
814 | 359E2181B61DEC7EBB1E38A5B188A85B9E0A4CC22E0AE4FDFCFE8DD776C703DF | |
815 | D581E9F3F68DC63B91B7CC430EAE05D7451345EE9928B18947D1EF0907138FE8 | |
816 | EC9F98CEECEABDB91CE0DC993391632A2993E0F23EDB138C388ED74AA061F4AB | |
817 | A9879A48EF233D72C2CC6A976212801677FF31818CAA227205687600362634E6 | |
818 | 380A6FE49F7A3E111B50DC40B97D58A7138BEF9BF2D58633643715D96F09568F | |
819 | D192E619E4DF5BAD6E934C3AA1E29579E85127024193F3866F235C58A9A097F1 | |
820 | 56158AEDDC8A1B66777C28E798DFFD2404507A1E793E990ABEA01D772343B3C8 | |
821 | 0258461306AB5112B36455E39B024D544BC723C61AE4756B78B97566546201F4 | |
822 | 77EF79F142297609B74AAF54FBB44473197E0B5A706FF921C1D7B80CBFF03524 | |
823 | C6C9B37BF5FF366B0D60026FBE01D9A213905B384449F62FFC7F872114C64F01 | |
824 | 1BD76FF84899641A793D10A504F0B56A7500354C748A68EA4396296F0EE9448C | |
825 | 1997C351D262E9055D2265E4C467FBA11F97E80B6A862D398D341E46212B0389 | |
826 | 08BFCB93BB7ED61C0E4D3BAB05C9A620E78E19342F02A9433B97CF7ACB027528 | |
827 | E70EA97389D55DDA0FE4BAF2BA8205D3ECD294BC8EC81293C9A11F79C87EEFC6 | |
828 | C18A8AEEA8F0987BC183C9EED25A91F77408952DDBA65BA715018CDF4145B64A | |
829 | 393ABA54A176F8DCF83A5238D538B3E7B569229F5C4CFAC3CC9827661AF20F1B | |
830 | 44A7930D1DA6688FC1B11BAF855E3E994751E9FE7BF4D588816618A022E25673 | |
831 | F9C2D9D9AD9C6A16CCC923BD9E94E9A916C6561E692724C499F0A49E13762197 | |
832 | DE52122CCBF93E3505209FF7F66A36780C7492650F4534E5984642BC7844C69C | |
833 | 0DC60DD6145A5B1662884BB82E4A97EFF6541D10D8799707CA86591BD8CD4CB8 | |
834 | 59BFD8D36AF4D1DCCA1433F20CDD724F3550D88875CDF3FFD49C6F1EA956576B | |
835 | A1C64746D10C0EE07644371CD7FA3388C308B0E20918061607730E92A11057C2 | |
836 | 27303C387E163212DA3C5EE8952BD9F7F328E35D7AD3CC0FB84943ADB0BAD7E9 | |
837 | 6B4426FA53EEA4F2155359CD3F8E8DD5F0A1FB0B6C8F6A83F5B8BB179FB57256 | |
838 | 57A3DB758AE0F7B0D3A636F09AD0A86BE31303A6F48F2B925B6EF764DE59C3E7 | |
839 | C995C5422BB61BDD691A5980CCC3639234A7A48A351E67E7ED9F0314B2074210 | |
840 | 36725D5306BBA32DB24BCDBE3F989EC1BB9CFFFDC156280BE9A7F7253F7F4516 | |
841 | 0F368A18CA6B1DCAA5C99693B6B0F593400D09AB18EC8F741091A32E5B5F9BE6 | |
842 | B628F840E28643A9BF7E24D37E9C39A05BB70479AE6C9905E9B763F23E546A54 | |
843 | 8231D1A6009C658AEA37CA6FD5D2A36604370262583DE5CE3568999E594E5A3F | |
844 | 4D665BBE80C7109A6FF96A856B511F4251555B7FCFA55FB1F739922F7E62F396 | |
845 | 482ED48EFC10B10E6D68148DE88308307BB7643999890BBBAAF2D11484425A43 | |
846 | B41A4F2F076CA8D187074F3621C0E4326F7B48D5F582A91763A02CAA769947C6 | |
847 | A424FA57F87E92EB9B199A540A05D4C65D121321BDD09F99EFFD4D43536EC180 | |
848 | 2A2DA1672CA05956D8737D514B088DCAB5D09C633A75BFD6CD35105A9DE88968 | |
849 | F46E049EB38822AABEFC6EFC14A693555A7D35BD96764D7B915E6A1153A9F5B3 | |
850 | 84A79D547CA8DFFCC4D1F1C168EB6EF6450DC470DBE0A72D1264EDD2375C69AE | |
851 | 554AB2DCC7F966F013F0A76F0FBEA1CAACBCE1B372F098EB069DC35688E6A4AD | |
852 | 6F29454E371DA51CEA13A8E8ACFE916389DBCB162CC81964B4ABE791BB71A27C | |
853 | 51E24E7571CD8FD16BB862199B562E1B9965AD602A77A644E687129A6980F2F0 | |
854 | F6C1CB584BB8FD1D1A1F8BAA3812CE8D051D23014622A8A508E4296541EE9846 | |
855 | 4A2551A843B6977091E90E9006ED40E62D487ABF2B48633F09080C6C06B390BA | |
856 | CEF77C69E858E23547FBF6F22BC51C1C5ECF5430588F006EF7B3DC6DC0B0356E | |
857 | CC8F8099721A5E3475857C1F906A11BDADD1FB27B3A8683FBE50BAF54CD4F4F9 | |
858 | 9EB56147DDDE5B5D861CC8B89DFF9502E088AF20947AE7F72BD6F427F617A7C4 | |
859 | 6A3062AF9029071BE53A25E8C329CD0EE5FD191FA2CC3DFD4D623217C5F6C82D | |
860 | 5FC9661900C111EAD81C6A88FDD47AF5D4B72B0FF9C658139FA478A05EE75DEB | |
861 | 83AD2C79BF78D9CA975BE573AFAAB5E5F0F01E0DD9ED868BEFFACB15DEF79237 | |
862 | 6E685CEEC76F5884B37F94D8FF36D3FE25A771CE4523D4F4D7D53904683BBF91 | |
863 | 18996F3FA2090CDDAFF660AD63D9B5CABFEBD576C0F8ADA93B13EEB8147C1976 | |
864 | C0172D637ED71C995EDA78AB85C3654D1441DCB41083C4EF1A123980F96FDD80 | |
865 | 6D4190183B4153BC8BE62232A0D6493D7A17C1644057A21E1AFE7322406F27C3 | |
866 | 94E714925202996554228981A8C39EF9AFB30F5EBCEDDF39DEEE3824D78C6437 | |
867 | FA7FEE75F3B2280DAC4D76339F99F5848B0BB425B127DCC6EB20C1CA50A5233C | |
868 | 793276BFA23F8B2CC4E061BD5797563ABCD7DDF79BF0957436A26D32723EE772 | |
869 | AA63FC5F282FB238676439B1868946D59ABA007C5C5A2100A0878AE07DEA3CBB | |
870 | B14FF6E4F69F2A443D7551A6BEBA2C1654E3A8F3058DA2DC0A26CA05C8724013 | |
871 | 39D3B730E70893F0AB453F43DD2E802A46CF66A3E67CAAAB0C4357F167FFC174 | |
872 | A9BF4E1BEBCF56DFAE9C5A76577FE0AEB09A738E6BED9E62BDF7BCF5B624312F | |
873 | E48B9DE428BAF38EF9AF8F450CF90E8BCF452D1888C42CEF8BBF2A75953E1F64 | |
874 | AE35EE604F03199852323AFCCC72CCB2C20C489F2514BF347BBB5930BD425888 | |
875 | 6FF69321A007E21D77F57367F9D41E5D0E01171E96EECA01175F3F85A946C621 | |
876 | 9531EE5570189773AEC2E9D9F2AE5E4CEF742E80FBF22B0A3D4C56D825689D81 | |
877 | 6F6186E00B39E9054559F4C05D35EEA024C8B2AD71F0573BCD1B781F31BB44E6 | |
878 | FDCE0787C66554093121FB5DCFBF83F06092DFF4E1FD10E6195ED375F9B4AF57 | |
879 | 0186238CFBC277EADC64675C7A9F2F2E17BB2652024C2E9AFBB0D9852D6D4B15 | |
880 | 2ED2EE3374436C58A78EAA552617F8694F123FDA2ED16E7E2D4C45593E0EB4B6 | |
881 | 3257A22F303D0D0AFF77A320967E5FBCCE40BA0FEBB14DCD0649B63A68C6F78E | |
882 | 53DB018C87D8FF4FD1DD789159E76F50CAE880AAB7850FFD309B0B929A641DE0 | |
883 | FBA51339C4ED5D050398A37EEAAF4D84EB7223D3557E846123462EB60CB8C35F | |
884 | 8B5A628A16692B1EDDEF9ADA7C53FC1BFC1159A2290682ABA5888506482FC7C5 | |
885 | 26A27CDAE23C5D7079FCFE42CB1BCAF8358886B08585872528C6699442358D53 | |
886 | FDA54CBF9A6D5AFA19450A5D394D209570C970679BB11806423E7A451D7811AD | |
887 | 6284843A4CBB0B7591646B650BDB39E17C6344F846A2F3318CABA7BE6BEE67D4 | |
888 | 712AABD80A4623DB2D797B9D109B7403C46659EA299C8274CB49E9D31A0A9889 | |
889 | 5747621182A9986751141890719C900A785C4DD03C8476C2A3DDF1FC85441D6D | |
890 | 089C7C126A72D8950A453C8C40CF92FBF4107DCC4653E836264BD29F584E1B73 | |
891 | 47B9234FDAEBF0768968BB1F75871DBC0C39CED01611F823B6A17742FF4C407F | |
892 | 6E514DA20DAB72B53D3752B3F2CB8AA720A3F1A4E71938DEE47821E16E97E0F5 | |
893 | 32C9F57335B12B0CEF6B20917C1CC06F035E23F93B6376BE83467C23F0B3A687 | |
894 | 57D9616B932D6BBBF181B6DF116B3D88E5B6B4327F84A16DBABC9ECF4562A96E | |
895 | D89A445409AB5599175743E559E9C642361DA758611C0D56ADBEE0B686AF487A | |
896 | EF7EC4FA9CD87239886968B7FC3144313F5F9B90D1A76E45718DB65D2F44D123 | |
897 | 81189F26088D950335E085EB3BB1BDAC3AEE5F5A1AD7C44BD119D04693454422 | |
898 | CFC2855C6667E64CD8FCC76088F3DB888DA386CB77A060B52930576B80E6CCE1 | |
899 | D393E689AD64D9A3A3BB37C0EC3CF9286488CFAB18D656E1A0F1B078BC8F5D63 | |
900 | 4B56A82578844BE89201880C0863BBF7F35F1983FBC70C5D6372E298B877E6D9 | |
901 | 89B3A60FFCD876C5372605CF2B5C6E3EB4642D14C75DE75DB264111AD783D49E | |
902 | F63C3CA3B6D27A2BDA9C9593E6AA5C0A851CA1B8420249B8A3294664BB8025E1 | |
903 | EF9246BA8D12186C6EBFF3EAE52B4169832CD1E95EFC52F70F0AC1C4AD47E661 | |
904 | 80997CAE243FD5F4B924C597F32E0FE4E32BE29C6063F4813DDCBB96F25955AE | |
905 | 2E691AE1A7268B0592C934FF2AC5B6F7F54C8858406D1204EF17B09C3CFA171C | |
906 | 5FD08034D00EF30FE2276F9E1C0788FF3CFA161EA1B9F233991B949E21942DA0 | |
907 | B1026B5EF71B85BF1393E114FEDFD47189BA3DD480D3633A8A208DCA897150A3 | |
908 | C47EAA87B8789E7D57543973497D119AD04F4E3FBFC5DC7741FD7645CEA76742 | |
909 | 8F2F551AD179A45C361D5B314692CE4C4E5A571583804F35D3A45A941C46E168 | |
910 | 68844DD4CD99284F2580E45DA23300B47C10B666E1F7B5C25B8BC054ACD1DC44 | |
911 | 12668056ED2E045E777D11836A5BFBF6B1C79AF48659C57910472C8232C37447 | |
912 | 328185C6FFF6CE1E24EB9D29D0B21E6F40BFA843E2FC6DB59A3A576EA7C26F0D | |
913 | 9275663D03ED3AF206727909CF6E82B1916FED911C5390D4089E33E01D3A3580 | |
914 | EE8A6D35421297812C7250FAFA6B333655B2A249BA8489146EF66CD31BB734F8 | |
915 | EC289D5B6541A15D423BA486E7D173676282FA6A12DFAB03FB706DBF0A2C0332 | |
916 | DAE3E859146D2ADCC1EEDF29AB5E98A4B4085F8F312CE94E5448F93653A44AEB | |
917 | 1DB10210A1EA1597064BF3BDC2BF8BE227B8E0321884DC1B2C1F426370929D30 | |
918 | 22D72F8329C8DEF5D80E6DECD597158968F60F4B5F910537749E1963C161DBD8 | |
919 | 83D94CC3C7A334722545D617B9A8586489D5B866429D9130E785AFF3DB7F5AA6 | |
920 | 571A01DEF40E75570CC9F48C4BDD044C5D9412683C282406BF2C5DA0B0661528 | |
921 | 7834CECCAF019ACA31D27C4865A11BB664EA1BE6377A972E76A05F12E697569E | |
922 | 2C400B018F1EB7BB747BD91DE1557E8B85F890A983D5459EEC773DC0CE99B403 | |
923 | B15CBA9EED2EA4887C7961E8B62C566CAEE124F329F21BAD56E8CA6ECE16A249 | |
924 | 6256504DDF5C84F5D1222076B4DFA6FB430D2142ECD3765B65DF8A6C87278435 | |
925 | 45E4C826C1922E357DF688EB6F4A6AFB6438D94F7E3C444C0372B7C7CD26AAF5 | |
926 | 6C7B8A44EBE6DD58CE6F878747F7E59FFE8F680661EFDD36DFC4771EECE0403C | |
927 | F83B20412E006F32870ECF167167974906F99BA655BB23E5E26288535A4AE670 | |
928 | D3D087F96E076E060AE6A3544570264FC780DA250805993A69D237712BFFE3AD | |
929 | E587B70D2970692918D3F80E38A769697E98EF5D034C9CFF6D8387D95E16AF89 | |
930 | 4B558561839DD96439349C745BA98D28DE129BA9334EF36994171DB9F358A41E | |
931 | C1E7CEE3DB6B8CA16E93ED1DABD8C89AB3BA454C20F201D24895D2F2186B9079 | |
932 | B15430E6742BCD6DBF54A4915CA100B043B341B489F9AB72F5AAB8546E1B2704 | |
933 | E4E8D752DC3E90B1B153A78CD30E00B87B9E812693BB5F8A72BE121FE861DEC2 | |
934 | EFBC76D20201C0357C93662F6243AB7C003D51B1B3E4C94830361C81B606C747 | |
935 | 6FE16472E5FF087A25540E66BDB10A7B23641E893396A1BE38C102EB4C391648 | |
936 | DD50D074BC2B3A10AE6E3A2732C5A94DE40547D21B7F9DC11635B8D6D6AC72AB | |
937 | 4048758EA9F043295973B44B0917B14A8FDDB152D47E92731762B5FBE7E2D424 | |
938 | A9BCEF2D296B3D8F41E724B6FA037540C465A087037AC77F1AA11A8AFA6B6E1C | |
939 | 8960CDB46F764CED85F36A34D12AAB1B6722910A9233134C1544DFFB42B98D2F | |
940 | 83A97B3898EC57DC07EC4BD53D01E467AAFE50DCFF7135DE13ABF0B826558D66 | |
941 | 5B4FC5862C48A5ED474B3F7BE7EFAB84D141BC92EA5AC299AAA26A6AB4C1DE9A | |
942 | AF8EF838CBB14C4959BEE5928DC77A84786A0DE55B91B86290651481CB528085 | |
943 | AECE1722541CC470971F6A2DE7F4B116667189630CA8CBB78541807DBECDE55A | |
944 | D5CACBC8BF7AE4100130E499ADA3521C7D59FFF2ADC8826FB85A4B8A7F6A7B5B | |
945 | ED19E9C421D8873270FF623B39A4DB33ED21A32A6A282597595C1FF9E849CC85 | |
946 | F7AEE01F8CBB21F75660B5520501226CD6B872E116BBB746FB9DDD3B3C545175 | |
947 | 0F4661041FA2A8F5EC7601C145AFE3DF783F676291A3BFE672C743CE2254677A | |
948 | 646CCF082F592F8A2B074ED57BDD4AF9A5DD8D11C86694CFF16A0C67D1FA1C92 | |
949 | 6653A957054357BB9EAEA4C8988599D7B0EB635C03ACD63463EB8F449FDDEC80 | |
950 | EA43FDD1B6CAB14E3D9B0C2AD3E118E0A0BEBACE1F893939E2DFABE6BD99BAC7 | |
951 | 96083DFF40B552F469AF20D34A434E48EA180BFC8E900F20992601761DA723C6 | |
952 | 1C37176DE8455D0D9D563CD165FF48348F3B5401A5F192F9FED4321E5E765DDD | |
953 | 824ED3671F21A449D9A623264174B5D64904CC1B10C10AA482E25100F764D76E | |
954 | E73A630AC8A559DE6C260965DC16BA31B46517ABC20C5C3D89FC6FC187D0303A | |
955 | 516C7A2C1C5462E313DAC0C11EAD5D7E771B42B468AB101F284BB94A82432278 | |
956 | D77E799D2E8F968EA055EB2512EBB67607569173BD75F5154BD3E8BC74B1991E | |
957 | 5224C3930CBE1E222A4568A043C508FDA7B3A9FC07C994D90DA667C78D28EDF5 | |
958 | 2CD2CE44DDBD236316CB70DFD53D179A78A01F3A0243A88B94B69CE85588A85C | |
959 | FFD9A23A0156293DF9A3F5FD01DB8E1674D691E7ECE78E5767271185C231EBC4 | |
960 | 5D91DE1ADFA89EC1A8FE743062D934120AEDB02006FE70DE82F5EE24B36E829B | |
961 | 0BF2BB312BE578CC81F4F4DA811E6F25DA2D82173620AC20966C9AAEA2819AF9 | |
962 | 0EDE7FD2EA43F7C02A52DBC4E3E91F287D115B835646E53627A041F700D5B631 | |
963 | 1C9236501F2717B2BADA21C20CD9BA48F7BAC488913DF34E5B8679CC4BA71F87 | |
964 | 0FA9968E9D00C5D0CF8AA0FEE7DFF80131C8F5736361C016BDFCD85E28DF8239 | |
965 | 8DE792BC87B0886EFF1D313EFA13D6486478E6A52F5B6383CE563FF948DF4B8C | |
966 | 33F95133650F966B3D38E9AC0C61C47527193CCFA54EC6368542691480DEF9EF | |
967 | 0B74E4382CD2D7EAC72D0DDCF86F9FADED7F2E11C10F992BFD6C74A1AA8A1013 | |
968 | D317438AFC7F22DD3C7EB64AEB8C8F267FA73F398BAA4434254B993FB12E1922 | |
969 | EEF8515BE3CDF0BD57C1F0433F9ED466963E0136644C0A4280902C1BE9A86656 | |
970 | 729343D578E0E335407B7D73B9E6657E28675941D76836073E1BDF1768E657E8 | |
971 | 9A06266FED44EB127C0A20650528E3FB33D5771EE49F579C7A70E8231E093A59 | |
972 | 4B8390600524F0198C313F2E6AD936B382098C1BC7FB228F5A647E7EFC382F93 | |
973 | AF398A0640C5999880057A5619AEAD4CD6BC34F70E7F8B9D5EA6BFCF432C6BBA | |
974 | 8A23510A0C306C5EA0BB33407C56ADC76892EB7407110CD7D2B2B063F870AFE8 | |
975 | B1ED86BF1593426FF9CFAB3082CB3ECE1BC3F103E0006B2BA846DEB0A0ADC549 | |
976 | 1AA0D92AA01094F8F5CEFA6C86FD432B40D010C148EFADCB035BEC296A4D6F38 | |
977 | 12406270DE9046C76E80FF56FEE665465BE12AC6FA74C2F4C648D29164248CE5 | |
978 | 8831C4BE49DABD324754CF75DCD125F59948B2B1D1F0E116DF84BD02A99E5803 | |
979 | 1D3309C72875BEF544DC1BD37F4AF566745A2BE93CAD7E55EEF5DB17BA290B5E | |
980 | DA86BFE145591C2034BF045006BB8D59AC0B1C585959AAD12B0B50C2A6175093 | |
981 | 3CB5F54B957712912FC0B2BEB6033012D928859F510312EEB5374ED10CFD5C19 | |
982 | 8749731A97AB9DA6A2A63C44A399A1FD09FF17AF1DFE301232A8383A6AC2F797 | |
983 | 40A188F69CD72FFC973B0BA64F7BA901DAFD00F28F986582D9AFE5DA387714E3 | |
984 | 41B60BF69D803539F0A1B0D3D42896D449DF4411348A00C05C38ED31265DD53B | |
985 | 967427E22F0089F357B5A39B81C1281248214FDD1148F92E75761D4D7D5E8982 | |
986 | 95CDBFE275FE44399FF05DC34245C4BDC38C4F7D265A4F3C1E11717A6F3FCE2E | |
987 | 720FC5142AF5CEAA75CC1868D172425A72253EE3EF7CB99A09D1E46609E3A935 | |
988 | 0F39505442E1A756FB0AAE7D30BA8D3DDD938D0AB9D746E65349D5705B36F60B | |
989 | 335DBD91662CD5A12983EE0161F8C4338336575EF6C9C6842E0611331EBB34B4 | |
990 | DC778CA9FE0CAB8839FD80D19AB95CF070A73CFB99467256F91D37BB669A470F | |
991 | C5E25FE5342423A2969CEAB12CCBA86DB276A8ABF9BCDBF377C187CA63BA2087 | |
992 | FF862833B9F03FFF0132E790064B08913C625E7CEE675C1D4226AD06B75C49CD | |
993 | DB8CB63A2D32C57031959F177AC8720313569A540BFD5B31E92EB12A923B7329 | |
994 | A128E58C06A6A0A056FF16F02B37270C9BC345B8459A7A66E1BBDBAAE72547A1 | |
995 | D4D7571BD1D23FBA973C096C0ECB08E93EF56EAB20D009C7A1A9F396151964FA | |
996 | 57DD810E1784731BDCFAC8868F84C666009FEBE9452934099E7DC25EBEDCA33E | |
997 | A81D7D49A1FFC7839AEC3A6F621C7170C6BB0F13A2FECBE5A1590A6EA8934E1F | |
998 | 7396AB950A313852EE08A87B98F103C9E67AB7FBD9641DC4D63B0708B2401D9A | |
999 | D2A864D1DB420628B35A9908E9AD019245C30312E8E64819C1D221B964CEA54B | |
1000 | A195B12E517CF48AE685D2B50D34CB38B685370E762E95455ED521B4D2D9D441 | |
1001 | AD04B19E87CEE1E101E0F6258B66E470A0068EA4ED6AC706D7BB0A4B7A9F56D7 | |
1002 | E166CEB698465FFA3FDD7F63CB9C2F07AA7221BAF32E8066E1608D5CBBC0F1AC | |
1003 | D7A8460668E59A7C8DF2AD01851199D997CD10496D687413D05E934BBD028721 | |
1004 | EDB1CBB81993265D6547FA78E7BD9D01FF60FA333F90AEAC3B6944D629F5E9FB | |
1005 | 5F8FD93E49E4DE564F9441B83BD8D93D6121C76F8AB0DFE84E62F21C34585514 | |
1006 | CE0C80F8BBCA8E5472404DE3D990015828187F7BDA1D66C324F9217A3AE1C9D8 | |
1007 | 6F5AAAA20A7F6AB652BA36971B40C4F0A90D762864F8E2AB4F5327CAB2CD70C6 | |
1008 | F5020B01155F908799EE5B906487A3BAF15579C814D94BA8A38EC38515582A40 | |
1009 | 439F347A516379BB54F9770E1449D08F89717E1EC32C305C2D6CDDC35D0D5F8A | |
1010 | 8189D3378D09D6B333C6D5B83CA36C7029FA7795C9DF09EA6DE61362AF79A5FD | |
1011 | 38EA53024DD44FB8E53BDB29EB2BB60A7A284EA01B429DFC9BBD5421C8DF7EA1 | |
1012 | 93665459A202289AB7217576CB845E2A1D83EC6693FD3CDE809A0AAB042E3778 | |
1013 | F9506DBA544E1032F690F0C783CD4E7CAA58228247DB04F1FD4B90F3305B0B21 | |
1014 | 002737BF3F1DC28217AB98D7632B6F966D9CFDAEF72C2973FF3EFF17E02AD8B2 | |
1015 | 1084C5E4DFBCC76B3E1EB7762B965D2D8844A771F08434253A0364120634AE38 | |
1016 | 54CE24483F46388CD94601F361FF3FE78A304C549B82F178D204C5E4BE9B2485 | |
1017 | 8A39D1D0CE1AF954AEC6B2982EEBDF8A0FADECC33733CBC144576FCA8F58D0EC | |
1018 | 77431B64BE9C9D3744E26BE5FEBF912DA0B16AF22EFDFD92526E9A65431D70DB | |
1019 | 547D241269D266DE9EAF67A24B1EC9E329310DFC31E23EBCBE7FE8DBC78AB553 | |
1020 | 6A257514969808E1E79E5AE3C6C24FA363E4F616F52B4724291996DEB52D8E74 | |
1021 | 391357477DFD2A594A0B1F10B2831579F4C526B234BEB990A4223F0E5AE15A59 | |
1022 | ADD7112BDE6E257EA454C9E0D439D24E6412520CA5CDD3D5B85EB35934EE5E92 | |
1023 | 404C808346B7C97C61CB21908AC35347545F7F426B363175D50AEC231460BD2C | |
1024 | 035BD4A94C40B213D13654E2C778277EE429444F098B2C81D37DF81EF898C799 | |
1025 | E645375E86DE4F00D18B26F303C3102B4E8EFBA1DD6B64E49EA81FB5FF52E94A | |
1026 | 281C8AD2733339FD58E207D80F6E225D53ED62F1BB2FFFE2764F35B80CDFF711 | |
1027 | A3B84DBF388EADE65A4F7E38D6AFAE2DD00E3A161F85F68B79DE87CE4CD5D77A | |
1028 | 73641E1B8E6B355A84740D5CA4E74EB3B245C261F6F769E789C855BC6985090F | |
1029 | 564FAECE25C11FC509D63C661A8E6A8FF1FBE8AAEEB3759CD25FAC35BBEF23BA | |
1030 | 745FE0A1ABA7A477C8FB63968B8AD3F7DA8E248CDA0AD67445B9D6F6FC034B99 | |
1031 | 792BE166BBB0781BB3B5BE5B9EF6B3EBD02C01A4BB1AB7FC048A71F0C429B78A | |
1032 | 182BF84D462645F2A11A2A41CB1C94CFEBF17ADBBB9063B4F5D0FA9CDEAEFD14 | |
1033 | FB9E03BD6D5A7737FA1CBF6A7387F84178453B2419CCE7018184E0EAD5F40981 | |
1034 | 55A1D215AEB571A861A1F12DFF84A17B142925582709DC5BFB6237C7D37D5ADB | |
1035 | 706179768BB1EAA959137401AB9DF46CD54314F93E31A4CBEC0E1C589134F6D1 | |
1036 | C3D3B273E947D09DEB0704A928571D1468C3CB347EB545040E07D3A670816D72 | |
1037 | 764998EC7988C5A25E6D2403382866FE5408037BEAEE7EA98BD8EE300B957965 | |
1038 | 5B79E8F4BC6F84E4CB037270D4D9FCBC0008408485D855E67D3CB8ADCF7380A9 | |
1039 | 09350593ED80A9BE9CF77DE6D1D4A170DAFE7583CF6851970B14219A3A2B4684 | |
1040 | A8010B4F7B422DD699C167BEE110E3890699D710148550482CBF2BD5CEFBA8A5 | |
1041 | C1B45320C9D0C8838546474830316E1E238CE2704C12D43211639333E9AEB018 | |
1042 | 68C7068212A440912FB4E58124325DCC233A8BAE6D634C9E47DBDF449974F42D | |
1043 | 1D346C206E452F1C1AAF76852A3FD5F156AE0FE1DC777E460DFF136FB94A6879 | |
1044 | 54F0E6D4825AC0C6F72A71DBCEBBE355BCF1D0A336043325BE80D780DD21992B | |
1045 | 5240312D13CD85C2C2C9F236CCED4F364ACEB22B8712BC0598B75E565BD05A9E | |
1046 | B579CD12D262FF8114D93BFE09D1EBE2B38C6856938C0224D6D900EA9E3C033E | |
1047 | 18F7C4E9D4954BBF699B4F7BF5424EFBC36C9DAD6A54C1304A425DA7BF3CC236 | |
1048 | CC82139A00874BA953C4581ABC1B6B06567CDCDF78247C090644C8101E0454F7 | |
1049 | 37B42EEAA2743D855C90D03A0DCE75EC28AE7765A5AC7888B477AEE2922C1121 | |
1050 | FBAD4188E125B110C216A7AAF048F41AA81E7F32ABBF1A3F597069561BB6470C | |
1051 | 1FA96B179FED4D6781C6F70A343A9CA3D757AD37E73D062970AFC4DD6B54304E | |
1052 | A9D7F87154801D7DFD1C45E0717387EA331B8A5DB13DA5AFE56B341FE296A775 | |
1053 | EACD862B7D6987BAF4B73B04455341B07BB91830868639DA3FD78C0E570E8CF0 | |
1054 | 4E85BA82CADB689E7E5DE5777D0200DBF1691AF7A44D0E3ACB9700B1829AE038 | |
1055 | 50566EDDE5A9FDA33AAABD737E5F73FD76FB021805406F8E525EEF4FE985B6ED | |
1056 | 178570FA9B4453535E38C6D3472BD475A07DB82B0EAE3950D569F7D0C16C17B8 | |
1057 | 3737B780DA66F50B7F678B8020527277E243001434176C6E8B9B9DAC87139FBC | |
1058 | 30F676E3621F59D2F8F0476FF8C528302C7748CBAEB2997645DC7724FA8588FF | |
1059 | C2969DD8921AFE6E1773AD1135775DEFA1EFD197C113AD53A656D4B7BC1613F3 | |
1060 | 8C56B27578F856FDDA30652F7D6DB38B819D1E536B2745421DAB8F5E21932B7E | |
1061 | 20412937F8668163EA41BF6D7855B884943179FFE4F2C0C3340C86ECFF4B6DBB | |
1062 | F41CBF9DED39E7BFDABE6AD603FD6202A47536E5102E7181FD60166EB10D51EA | |
1063 | 5729F7FBDBCA979A65A8FE0A387F78A99CC7E41D87E0D791EEC0136BE1A077C0 | |
1064 | 19FC4B16C601DED739DF6FE9CEFA9E48997624B7C768FD5259D0766A9C94B0BA | |
1065 | 9FC8336C05005DFEC39BF559A36962F16F21F208F2691705BB19FE25AA2FB0D1 | |
1066 | DB727839FA045A900A0BCC2717A35A2FF401D10B7E504FCE43C58769563D8289 | |
1067 | 03EB34FF2A2C34107C0D2F8984ED | |
37c41ab1 CR |
1068 | 0000000000000000000000000000000000000000000000000000000000000000 |
1069 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1070 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1071 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1072 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1073 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1074 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1075 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1076 | cleartomark | |
45c0f7f8 | 1077 | {restore}if |
37c41ab1 | 1078 | %%EndFont |
c302751c | 1079 | %%BeginFont: CMMI9 |
45c0f7f8 CR |
1080 | %!PS-AdobeFont-1.0: CMMI9 003.002 |
1081 | %%Title: CMMI9 | |
1082 | %Version: 003.002 | |
1083 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1084 | %%Creator: David M. Jones | |
1085 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1086 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI9. | |
1087 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1088 | % This license is in the accompanying file OFL.txt, and is also | |
1089 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1090 | %%EndComments | |
1091 | FontDirectory/CMMI9 known{/CMMI9 findfont dup/UniqueID known{dup | |
1092 | /UniqueID get 5087384 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1093 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1094 | 11 dict begin |
45c0f7f8 CR |
1095 | /FontType 1 def |
1096 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1097 | /FontName /CMMI9 def | |
1098 | /FontBBox {-29 -250 1075 750 }readonly def | |
45c0f7f8 CR |
1099 | /PaintType 0 def |
1100 | /FontInfo 10 dict dup begin | |
1101 | /version (003.002) readonly def | |
1102 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI9.) readonly def | |
c302751c | 1103 | /FullName (CMMI9) readonly def |
37c41ab1 CR |
1104 | /FamilyName (Computer Modern) readonly def |
1105 | /Weight (Medium) readonly def | |
1106 | /ItalicAngle -14.04 def | |
1107 | /isFixedPitch false def | |
45c0f7f8 CR |
1108 | /UnderlinePosition -100 def |
1109 | /UnderlineThickness 50 def | |
1110 | /ascent 750 def | |
37c41ab1 | 1111 | end readonly def |
37c41ab1 CR |
1112 | /Encoding 256 array |
1113 | 0 1 255 {1 index exch /.notdef put} for | |
c302751c | 1114 | dup 58 /period put |
37c41ab1 | 1115 | readonly def |
37c41ab1 CR |
1116 | currentdict end |
1117 | currentfile eexec | |
45c0f7f8 CR |
1118 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
1119 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
1120 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
1121 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
1122 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
1123 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
1124 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBD07FC5A8862A8DB | |
1125 | 7E2B90C16137614CDAFB584A32E50C0935109679E31306B8BDD29F1756946A67 | |
1126 | 7A7C2D9BA6FAB9B20A424AA0E6F4BA64C2801C2FB5A1156CBEED0ACB95F697B8 | |
1127 | BC2A6E6AA7EB1F9FD8E3C9B1A16697EE1F0E7400421A7765AB218FC837A49365 | |
1128 | 82DC6B2C877A7DA84A81E6126EE96DB25C17A207D3020A045DCDAA064360DFFC | |
1129 | E3CD50E21ED239D2A6450D04F879A26443ADEB6A20ACC504989876476C7D1A74 | |
1130 | 91564FEA1F4CC2C8C8FDF666DB537F315AE1886C73CB5B00E67E7B398A6C018E | |
1131 | 540EAEE98BB8136C4F044EDD63C33431D2CF9740F051DF365A4045D9D8782112 | |
1132 | 7BB5D494D9235BA98CF2F30CB119F5A904C32AD04C960C43FC1F5FD8DA7D90D8 | |
1133 | 93AFB59F3FF4F796481AE2A7548F948FECFC6C127C4D3F159B08F206AE8C296D | |
1134 | EE470DB2F879EA79475E029D22D7A8535C09A18689DB0609CC233E5199C02756 | |
1135 | 972CC9C94D9FCE264DEE5D75C8D651E4E2D1189AD9588CB815722BB5EE3C379A | |
1136 | 6F31C2E6AE1AE4CCEB29766190AFA20EA937114978752189F1A9F42B39483149 | |
1137 | 796FCFA123BA9CCD1D9BE28289660BCAE16C40B5B504058D55CFCBFB4F4E3D94 | |
1138 | DDBF39F157E63946534DA81C018B1C01B9F10DDB55E0A5C2B3985ED1977C039B | |
1139 | D6755EA42CD09E27751E159C30B93F376DBE61CD3AED34BA36A768F232EB3B80 | |
1140 | E3E6B77C4A48D408217818E398B83D995AB6BC871F20991DF57313D6EB0C793D | |
1141 | 0F28088EBDB7F38DAF7E01AAB3476EC24D7BB38A9889A7D3038D930FF4289B83 | |
1142 | F54A7BE1E2D98A3822098D2E4D067A0D400C20C0B2B4BBD74C13ED1B827490F9 | |
1143 | ECF48F8C3994C1C5AAC9CF783BFA4F307528F51EAB55F961808A42ED53F00C97 | |
1144 | 72A432EAEDCFCFB622389BDA707B6ACC9433B065CF29EBFE93AD14B8ECD5F47F | |
1145 | F073F11822C49B8BE924CDFA6348C3A75E9BB9BF3F31C41716B34794B28CDAC9 | |
1146 | 4DB8B087E180A9B3B17680F73D9C12C8D86A922C948093629F5D7F542ED882A1 | |
1147 | 692F4F6696865E53E3E2DD43B2D5E8C989CFAA5CA5C4C5999045E170BDE9921C | |
1148 | BACD6F2863F5553EAB2BA2D4A9034729EC0C4201DE90DA89B0A27C5A5C974109 | |
1149 | 4E37BFB3F46B3A506169FB0C68E1CAFC844419A8D261A1FD86A3BB78E33D5FB1 | |
1150 | CFC687A5975987CE45155E5FDFAF0CC5FD5568CB1C26212F92E88255F0549F59 | |
1151 | 41B33125946DE43436BEC00804063FBF03EC796E3361B1C852EC3038D107F80A | |
1152 | 9198968265D5488B26D7670B22C2D75EDFFD1B7B4AAFA36DFD94640C9D0E2D20 | |
1153 | 5BCA18683EFB91834A3939AB8EB60E2F09655BE003582634C52770DA9668C292 | |
1154 | 2E02929D812EE2B0CC65F020064AD5BDAC5F5693B30508F40ED8E20E87149BD5 | |
1155 | 8DD41AFF83FD1944804017DC5A04512E593549FFFAE501131CE2FDB65EFD0B8B | |
1156 | 33809CBAEE411B3941C241550B9C30DD28088708F1C0CC3125CBEDCD985EAD28 | |
1157 | 03313741F67DB5744A87B381147D5BA70AE1145C27F794854628D87D6C1ECCA1 | |
1158 | 749E3465B950175D3C3F40E344297BD92D3190041A4392033A79BEAEAABB8DBE | |
1159 | CC14E39612F43721CFAE6F79074429221CA588AA2501DE520A464DE157A03AFE | |
1160 | 3C082FAE7628FC0C57FFC61D0330AE6332D20FDBB09BF36848FE05E782D6379F | |
1161 | 64F9C82C45402481B0A35989027F9756BF5A79DA2D96E10F39167ADB4305578F | |
1162 | 90B509B6891338FA1D67DCFD61804AA6621526B2EE4769589A2646581712AC05 | |
1163 | DA6E98D16494F07D612743058F54FEE516BD89A8EC3E03F9D7F905175D3412C8 | |
1164 | F7329077FD6EB25213F3CAC94BA0C3363B759401B6EF7548C7D709F3241D030D | |
1165 | 4EB46A1AE81863C412BDDAEA6084C37143A4C5E41BC646315B1CD09F934186CF | |
1166 | 49D1D8239E363A435307030BD79536B50B723A39DD763DB539F24A10DDA12BD4 | |
1167 | E467339D2D6DB177D6FC539FA77D2DE4118EBAC161E928749F7C753ADEF86117 | |
1168 | 58619F1155C563DF2E11ACA8347908B98113AED58FCD0394150EEC94B7F986EE | |
1169 | 88BF7171D208D8F1774B1DD478F0C2958AE372D257E7EDF0F6B5D6059CC4D5D3 | |
1170 | B00FCBD2E9CBE79235B9A5A3E943CC27AABB58728C95C7DBD4F4A1F8A4DA99AE | |
1171 | 7377B0CC0BFBD454794398AE0D5F7281771FFE87B25A819F36E692286A42D776 | |
1172 | 01794A43CA9BB30FB8FFDAAF014F909A369E34C2F6C75B7D4EB9DB0580E33F46 | |
1173 | 19654443AFF8384B95600B86FF8E41FEFD032355626D60C7507C058EF832DF41 | |
1174 | 194B48A36F11082D1DCF4723E21401E0C7447AABFAB4639B26E3D2730E348F55 | |
1175 | 53EBFF39CDD03E06E2FA5FB379603C879EDB7E1A10F89695C9C47DEEE52BE0A3 | |
1176 | F446F187AB9D7E93E6F9387F21129034F36DF40605D28FD526AF82CA9D232BE4 | |
1177 | 412567F06B38ECCD496EF40A7B243E46C9FEBA4F1BF4B1ECA029C5EC239353D6 | |
1178 | C0B100BF7E7DB33BD1277DE104F15AA19F37340A777741AD1AD693BC76DA48CC | |
1179 | C6F83CD84591ECFEE375979972B0FAC4C10B625E4BFB261B9FFFA83C31DA0108 | |
1180 | 4FFB6377466E9739E0EB64424BD9FC7239C7DD834EC6788A0F97FE714AF92831 | |
1181 | E1BA36A8A9E24739F1DC82DC26CC3CE28C210AA7C569B19E1784D663A0CA4E81 | |
1182 | AFF43E86D6F5F63778847700072CEB77A4EB946DC1F23DBC00BCE773203F76DF | |
1183 | 00F0B085F31420672974DDC642D885E95BA6BBE43E1CA8ABF464D9881CDECC7A | |
1184 | E98E31B9754C9B72A8BD5CF6D4D214DBC3BA7A0CDF6635953F5AC1E7639C4A91 | |
1185 | C7AECE4C75CA3389C348F656FC2CC96C84C85A926237B6504DB51937C9CFCDAC | |
1186 | B75C31ED570D180757884E27757783DB2D5F35ECC48C496CDA342D49AA947BF8 | |
1187 | 2FDAD2F19DFE8CD1C76A8FA08F33681F3E12E229D7DAB45BE3A3F258B5ED4980 | |
1188 | F15340CF20D965252843E026803E8AEE736EC41CCA82167401977AB719AA2F50 | |
1189 | 0B791EEAA82027B3C712D2EB9D14BF8F94FBDE2227609BCAC41EC08DE2BAC023 | |
1190 | 28352F913F7DF08D4E1C66E83F764578B22B4EB7191E852B91ADCCB1BCFDB1F4 | |
1191 | E63DFD152E86FA9DE9BC8908130EFDE29CC4401339C05B5B9764CF8EFF14951A | |
1192 | C6C13AF979546996BF22F2B96D3D585B90CD27DADEC78914DA48432C6ACBDD42 | |
1193 | 20EF583FD41F2F6D6D10C3DF7DD077304B5940BB0462656E306CBD91EB9B756B | |
1194 | 7014B1884A36201EC582FC9345C386043DD2818FC301EF78791C1D7854F8FACE | |
1195 | 5DE9801DE9F59D5B4271E003AB897B2EF49501589D681D59CFFD9B03F722EEF4 | |
1196 | 74ABD29997515DA3591496B62666744EA76DCA45504F8075C0652D6779DBEAE4 | |
1197 | 90430C2945FBD60AD53B51DDBEFC7ED703C418B4B244C8FFA5A3C1B7600C5A55 | |
1198 | 3EBDB93C16AC191C3A28EB2279BD3F0D67C826BC6A73D3C0AD02262368AB4621 | |
1199 | 98A1605F2887BC5880E1AF2780330E0FD01D7CAACBB0F008A42C427F38236066 | |
1200 | 54799594E515B289044BAC4DADF8B3686B4372C5110201221FDA923F131E07E7 | |
1201 | 93C44BAD406838BA4D1C277EF74098B8C0EDC41EEDD58C195D7DFF5FEDBF96FC | |
1202 | 19CEBC6C3006DD2CBF76916B4298BB915663C2F61AFD7747E03A03BD7280197A | |
1203 | 9DA590E3D081C6F53DBF94E8D6FDDDD910A70AB18A0F6D48A590FFAB314D6CFD | |
1204 | E3FB20C1F3C91063F00726A2C13A3D48323F9854839405E5A29D66A43E6E2B84 | |
1205 | A8B3765F1D817071D4D6FF42BC785C2D11AB2B9452F141696CE19C6AFB9777DB | |
1206 | 107D6E22D8CC6C26440BC48248AD8805C4329D46BF433741CB519B21663392DA | |
1207 | 5DC7FC9BF37E5BC396BFADD7263D09F6B4D69594AB386B7BDFCF3BACB97A0E08 | |
1208 | 22013E716E642592A20136CF9CFD61D4E515D80E06A4CB4FC9D9B916C93CEA95 | |
1209 | B83B98C48CF36C1D02291D4F5C0419338D64E33C90C90EDD2BA3B96D70FAFE0D | |
1210 | 403A060CFF448D3E28A9B1E3916018465E86095BAAB4706CF7ED350D7C554789 | |
1211 | D7F4FE5F180767DE8739259E68CF142040BE1E2E8C6152DE3417C1FAEA7584B6 | |
1212 | 20781DC4A9796431EE713DAC4E713C839D7A4FDC8AB6BFEFFE767AFD8B67FDA6 | |
1213 | 943AD387E5D3BCB09039ADB64ECC2BE2620C6EC269E708DD06C311F450099E33 | |
1214 | AF46AEC644222E7DC4DBB9371EE12CFBC4F9B27AB46AD1DA96CE006E1DF8291F | |
1215 | A550A93026CBFFC1087B134EC6EA76F5E109CDA58FF47338A0039A786A575F70 | |
1216 | B8A03A4F9C8D07A4C856C77D9BCC8E3EAA740172D0C2D0A15BA35C9E5717D7FA | |
1217 | 2691774DDE730BB9D7C70D7AE103DB8D35F3728470C76EBA0E670634E1A0BA84 | |
1218 | 2FA102BAD7271DF2680D86A4CA6FC353869987700E5E3FD778165456033D624F | |
1219 | E9B3E80EBF431ACC934AA0357E824B8AD73E222B510DE8445C55C07C8E5DE46D | |
1220 | E478F832BDDECAF2EBB11941DCF84CCD887043FAED9AA90D12BC8CA9A0C8D94F | |
1221 | 8D3BF1F80B14B6CAE6BB1C6AA405AA64BB94D5A82CFEA548BA070796A02F9642 | |
1222 | 87326D066101435AB9EB40BA9EA9E61B363F5F5E3B924369796E8B78DE3414A4 | |
1223 | 2B79C6A13ECB2F34E6299658D07D2B3DEF3D4383CE009A927F0EF5C196652842 | |
1224 | D96B857AB5E905201E7E8BA21A5EBED1FC6863BA9A1A6E5390407F75055E2EEC | |
1225 | 512FBDB3E82CEA13663F1A1944DA072C765D8CED06AB461470C5723BDC1271D4 | |
1226 | 4D1D049D3EB131743F1EC9A6ADDAA038ACA2C41D139DC6A84EC3C61AC7F1E559 | |
1227 | 6155CC2F49171F6E07CF56D721D9728E87FC7DCBCAC46455A3694C765FE807E9 | |
1228 | 9CBC2D304AF37E0F28CCB22F239541B53A4D24D09C662559267467EA487BD33A | |
1229 | 0BEFD4899B581D20582930703A868655C31BE935364CA6A95FBCB22CB714C040 | |
1230 | 9718824DFE97929D0482430726CCB5A5307957DD2432A9B6271E849148DEB76B | |
1231 | FAA290FF6D0B18DC5B76407852E81C105EC6CFAB0F620C6DC9DA555A33C167B1 | |
1232 | 430A8BC338BFC7D75B7099CC906AD923FA107C74D3FBB719D77A4E5A685FF9D8 | |
1233 | 56424EE4AA074434B809D894ED50F6A60A035C5223EA25DD8983B9B34210DABE | |
1234 | 718D7B2BEB293FF1B63CFB1CBDAFC69552963D90F5E3FF533A3FDBB626E9FAA3 | |
1235 | F3C119E5E01C7BFF832A033C3515BF049E29558B1DAD652F2888E339E67D15AE | |
1236 | 95F9BD14E3253DFE9072B24C0E7E85025B71096AF51C86AECB2921126A43156B | |
1237 | EC812B32B1164BD9B2B947D503C015616DBF2024F5C8CB3236C1DCA653D661FE | |
1238 | 6B1C19A22D272A176B7F1B7F9E67AF40DB0EFD4940E58B2A050249CA4E55CAF7 | |
1239 | 6ACFD84FB46FEF952D18552B3972D79D808B4C263B8C7E1BB647A2D03E102867 | |
1240 | 630D5C3F2C917F765A4F6FB8106BA6A9D0093E27A4CB6049C2371287D94B5111 | |
1241 | 6E7020776EBD744C6C920464BBBC0AC206033E8240017F8CCB112596ECD7CAFA | |
1242 | 89950CF43FD87ACA750C03A778A37FBCE9C82C2F5ABB135BB02DA8E8C0D24475 | |
1243 | 3BEA9D79372D0022FF1ABD378C151417DBC69FE5C9CA38D23A3900E34BF924A2 | |
1244 | 90777ACDC37930B67DD44A2E76DDBD9B89598D5F626BFD325A978D277265DA47 | |
1245 | 38CFAF16E7FF1946E15F41CA73F7B4B02E5AE8FC4C37B115BC567E4EEEFEFC34 | |
1246 | EC8974B1465AE57759EDDA28DD38A9210871D35D331AE1BE6097C3EC21C770C9 | |
1247 | B25D040B2ECCC3AEB1EA1BF99E0C2C0F192C13BB9152CFCF75332E03F9CEC376 | |
1248 | 9B8C285A35F53655BE38713E09AE34BA2DA9C06FA42A6FD2D00CBF2AFD2BADB9 | |
1249 | 1571629C65DA38A431710CF5B01FCA68E8B8569922FBC3F9B64A5509B6F677AF | |
1250 | 1B97E91FFFEB6308AB68AC58F9BA43DB5E764021E75B56170EB44C2C0A7DB86C | |
1251 | 62B8982256D3621EBE3DB3994DBF5C5A14CF34B4AF3BD5697F8E3203085DE9D5 | |
1252 | 84B0598169760B925463E93DC87CE70AF4C2DF0F4287D2F2069847BCCF7A37A2 | |
1253 | AD451D5ACE4DBCCB2E14D5DF38B226952E7446BF87BEC736EF3D5AE793304618 | |
1254 | D66D3299AB9F9CA1D13F134FAEDF36750046E27706C7CBD8E0877BB6276E5196 | |
1255 | BC2A355D109C0253644918E1CC11B717DE6FBDA201E769812752888CD66268F6 | |
1256 | 4ACF4A9449378F9F9923D584BA1B51F33663BE7A306887BC14A37E3C5A4654E6 | |
1257 | 531D6EB63DE3946BD8BA95CFB037991174F36D61D842071E6625605CAA350A24 | |
1258 | FE551025D10871FE0E2599A63900C8520EF4911C53A03897C8BEE152451708E2 | |
1259 | 43FCF4E700C583A5E8DBCC03BF9CAB864DBD19E1760945DEA0EC0BA38BEA8256 | |
1260 | D3A8D4F70F6685A99C6BD2BA8B412A26C002D76138CFCC7DF6802931E5D97BA6 | |
1261 | 0151F6A4C572235B4196B22B7B2D14B32886DF0D2CA8A277ABAAC53B63F64CE4 | |
1262 | E4C088192AAB674497E8AF81961359C389B51F4A257373D907C615030BFBEF53 | |
1263 | DBD99058FD06E352450B658478C10454AC8FC0232B70D5CB916981978053E358 | |
1264 | 99D322A07294748BA427FFD1E45C909171017B52B7C742FD77A8560852D819DD | |
1265 | 8DD53211A14D7B2FD11E42941722FD3985D627FDAF87EB57326A0D290B5077D1 | |
1266 | 8A4230BEB40523A8565F95E0D44F036A571DB698EDD9D94FEC9512369E5E5E73 | |
1267 | A3CA5C142617944F4F99C0697ED088ACAC007FCE06E5A6EDE7D0E03A3399DCE5 | |
1268 | 362271BC31533866BA79FD1FB3F608B22CCD4111FFB1BA35D920A23AD157C6B3 | |
1269 | C3DAE11069D5E46DEDA7158C6478D8B8C0D9DC237CDF0CC6633911673C43FB79 | |
1270 | E4F9B7F27495201E5ADE66255BC2CBE9D9F237DECB62A19D62CB41A1C92432D2 | |
1271 | 07F0629E913A71B3F1AAF8B8C5AC66D3C8605A48F8913E39C859E163DB1DBC8F | |
1272 | 0ACFEE80A40B6172032E95A76B752B873FB4DF23CF3A655AF1A1B88C8DC156C6 | |
1273 | 190DE72973950565454C0A188A33395FD3D529A88F2B578356DE8EBBC12F04C4 | |
1274 | 5B899F667D9E6F3A4EC6DD8DE71FD4C2E2B6D56823EE4E0526679D71FF1B868D | |
1275 | F261489F06F97B010CCBE640E2F57BA3DC3332B329F7958394BA9777D833AB50 | |
1276 | 005E8E9232547104065ACE33396772B0E0BD66D2C6CC54DEDD071E444D8C95F8 | |
1277 | 6F88B31E20FDB80F77C83151B7E25BD3736B4F9BDC52EE78C41E9475E5A6D94C | |
1278 | D348AB42F5E36B4F167D29EBDFBD43B03F77EB296B06A36880FF17D412E77EA9 | |
1279 | F2E7C25FD05E16BEC6732681EA21AC3FF6893B93FC09316A370CDDB86D9E6087 | |
1280 | F6042C3F9ECD742778389170F5F041329782FB9F9702F7533E51F355F71825AE | |
1281 | 2BF4F8FE50D413AC9A20C41B42537FDBE8DDC5A5C793D3760C1EE13716068752 | |
1282 | F0AF10812250BEDFB4D7133FD58F4587BACD572505C84A7D3802D27443175FE0 | |
1283 | 0D89C3398B55176D8642AFBAB5CBCDFD6220C8488564B4306D74A58CD2921AAD | |
1284 | 73CF803C754DAC2F30A5324886E273064FA51781D5BC596BFEDDCE3982EA1AA2 | |
1285 | 62CA7BAA1B16C6EBB99B2AAC4E6C9CEFB3D10F19987045C4918DB239E6E63D79 | |
1286 | 5F44B9D097118D081153AFF96E5EB39CBFBB99A3BE30909F614869031358EB98 | |
1287 | F07A97EA78AE50375941B2474DB46AF3305F2B208D45921F93743A6CB8AC584F | |
1288 | 6BEBE25ECAADD5A789EF60C9F54446687E7B030DA3E5243189F02BA46BFD28B7 | |
1289 | DC14822E136AC7E40CE20458DDBF356488045C95907363864CD6943643BF0109 | |
1290 | EE027A3091C11EA392EA91320EBFEA3B857370AD8EB86D73F035A476F7058222 | |
1291 | E8CDE78CA1AA9EA69A8AA6EBFF3E67324C567B914134DE042D6F8F18A9373107 | |
1292 | 536E8D90189917D343F5299024239E2EC1D2D177D82DC8E344A7CF2AC71AEC18 | |
1293 | 36F139E7A4EB59A67192BCA9ED0EB25DE13032F6FEAFC3B1F4FC81BB0EDC41DF | |
1294 | B9EB92618667C59EA499B788CD26C2137D70F1B0AF793AF5AD0D0941F2E746E3 | |
1295 | F5A7F0288BC1EE11E982EAAE763CA422D72FBBC0D754AD58FBF92629DC8866A0 | |
1296 | 431213513744DB48E52EFC89C83FEB082588E4F30D7DA77BB598E51CAE7E4900 | |
1297 | 5CD570C914EFBA426BAFF7A56FC775ECF5BE13F2C42E51EF96784E5201C0B64C | |
1298 | 074AC229FF0BFDF71E6D5E08D8755D2C12B770B6466A9C9C61C15582DCD2FF78 | |
1299 | E9E74DC2B1CAA344EC0339EBFF92CD2CC1D62E2FA8FF15E7459A83C6CFA58A77 | |
1300 | 2F1A40BD276E76B675FD6834052B33BF9190F04DF6AA5FA3BB7D77A88DD5B600 | |
1301 | 324C5E28216F47682EC29EABF35BA842BA2294A3D72B126EBB852AB741186C9F | |
1302 | FC84B12DC4A6CEC08F2D03EE61B65C845841EE17F1B765649A | |
37c41ab1 CR |
1303 | 0000000000000000000000000000000000000000000000000000000000000000 |
1304 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1305 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1306 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1307 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1308 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1309 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1310 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1311 | cleartomark | |
45c0f7f8 | 1312 | {restore}if |
37c41ab1 CR |
1313 | %%EndFont |
1314 | %%BeginFont: CMSLTT10 | |
45c0f7f8 CR |
1315 | %!PS-AdobeFont-1.0: CMSLTT10 003.002 |
1316 | %%Title: CMSLTT10 | |
1317 | %Version: 003.002 | |
1318 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1319 | %%Creator: David M. Jones | |
1320 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1321 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSLTT10. | |
1322 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1323 | % This license is in the accompanying file OFL.txt, and is also | |
1324 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1325 | %%EndComments | |
1326 | FontDirectory/CMSLTT10 known{/CMSLTT10 findfont dup/UniqueID known{dup | |
1327 | /UniqueID get 5000800 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1328 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1329 | 11 dict begin |
45c0f7f8 CR |
1330 | /FontType 1 def |
1331 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1332 | /FontName /CMSLTT10 def | |
1333 | /FontBBox {-20 -233 617 696 }readonly def | |
45c0f7f8 CR |
1334 | /PaintType 0 def |
1335 | /FontInfo 9 dict dup begin | |
1336 | /version (003.002) readonly def | |
1337 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSLTT10.) readonly def | |
37c41ab1 CR |
1338 | /FullName (CMSLTT10) readonly def |
1339 | /FamilyName (Computer Modern) readonly def | |
1340 | /Weight (Medium) readonly def | |
1341 | /ItalicAngle -9.46 def | |
1342 | /isFixedPitch true def | |
45c0f7f8 CR |
1343 | /UnderlinePosition -100 def |
1344 | /UnderlineThickness 50 def | |
37c41ab1 | 1345 | end readonly def |
37c41ab1 CR |
1346 | /Encoding 256 array |
1347 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de | 1348 | dup 39 /quoteright put |
d3ad40de CR |
1349 | dup 45 /hyphen put |
1350 | dup 48 /zero put | |
1351 | dup 49 /one put | |
1352 | dup 50 /two put | |
1353 | dup 51 /three put | |
1354 | dup 58 /colon put | |
1355 | dup 65 /A put | |
1356 | dup 67 /C put | |
1357 | dup 68 /D put | |
1358 | dup 69 /E put | |
1359 | dup 70 /F put | |
1360 | dup 72 /H put | |
1361 | dup 73 /I put | |
1362 | dup 74 /J put | |
1363 | dup 76 /L put | |
1364 | dup 77 /M put | |
1365 | dup 78 /N put | |
1366 | dup 80 /P put | |
1367 | dup 82 /R put | |
1368 | dup 84 /T put | |
1369 | dup 88 /X put | |
1370 | dup 92 /backslash put | |
1371 | dup 95 /underscore put | |
1372 | dup 97 /a put | |
1373 | dup 98 /b put | |
1374 | dup 99 /c put | |
1375 | dup 100 /d put | |
1376 | dup 101 /e put | |
1377 | dup 102 /f put | |
1378 | dup 103 /g put | |
1379 | dup 104 /h put | |
1380 | dup 105 /i put | |
1381 | dup 106 /j put | |
1382 | dup 107 /k put | |
1383 | dup 108 /l put | |
1384 | dup 109 /m put | |
1385 | dup 110 /n put | |
1386 | dup 111 /o put | |
1387 | dup 112 /p put | |
1388 | dup 113 /q put | |
1389 | dup 114 /r put | |
1390 | dup 115 /s put | |
1391 | dup 116 /t put | |
1392 | dup 117 /u put | |
1393 | dup 118 /v put | |
1394 | dup 119 /w put | |
1395 | dup 120 /x put | |
1396 | dup 121 /y put | |
37c41ab1 | 1397 | readonly def |
37c41ab1 CR |
1398 | currentdict end |
1399 | currentfile eexec | |
45c0f7f8 CR |
1400 | D9D66F633B846AB284BCF8B0411B772DE5CE33C33655F6FF751F340A8D6C01E3 |
1401 | 2E02C24E186BA91B34A1F538959D4450CB683EAE5B034D030186901B458D3777 | |
1402 | 6B3942BD2E07121385120248891AEC2EB33C4E3A0CF00828D0F130C31A918C18 | |
1403 | 979FE94379C648EF21ABF659253E43CD1253866F157F1DF85AE7E8714F061B1E | |
1404 | ABA3AD094FE8D6293916FA82EE4F486C7E513A06D4C9BE44306A8287970B4ABF | |
1405 | B6D1F9274A5A0BB6ECF713ADBD1260D5D6C4420D357FD486470A74B2F0621B59 | |
1406 | A9373ABECDBF32FA68AABB66FAB0C970A3354A335FEDDA1C288245E6C890B8DA | |
1407 | 3D0EB953283ABFE372221EEB1586B0167F634E3F29CADCAB484B81A243CE1E3F | |
1408 | D5106AD6BDB1AEC91123377F816711CB9D5140120FEA84B8205B79D1569509FC | |
1409 | 6B671211985CEF51691C45A168740BD826464B2CB0ABC575E7D453161328F80F | |
1410 | 3AF1C99EC219010EC6C95E0A8D1909719CF18BE424967E90DF67537220E60C3C | |
1411 | 4345B154D08F9EA684710E659DFFB0BA1B7FDDCD519305900A5E1CDA219A6C90 | |
1412 | DF8BD712A3686DAB90344E8784C7A9AF3318550285039B701B9FA1D3A3C3B6C2 | |
1413 | 753F1E794A3463A173C99A9EC0E2AB5737134CEC2C97CD6A37E38692ADB4B131 | |
1414 | 54697B7BBBB23680C72CE96066D8007B90AF0FC5958232AB4F21826691E9874D | |
1415 | 107F47DAC1026298D787989BD77CB43A09FC95F6997DB00D8483AE9C2716CBD3 | |
1416 | 7CDF02DA34FDA2F0754ED0968270E118DDD8BAAAA65C41D699E2BCC2556AA231 | |
1417 | 328187D2F50FD518CF458B0BA1F7DBAF4B231CFD61D5DC56335B53C3013BCCC9 | |
1418 | 85690E19E992ACE55EEF2BA7A75DEE6DC33933C226FC1494269B7CA4CBAE987C | |
1419 | 2C787386400172AE3F44AE47115F4117EED866713BDDCA4A7AF658C49F913CB7 | |
1420 | 308635000043F63BA210410A66E192289592882C477B2EEA0B2A339F0E7CF450 | |
1421 | CA0EF79D3A6C28598825CA03FD688DA60C95EF707C6E67CB7E57DE7A80545195 | |
1422 | 739ACBDF27069F34C9E0216C3D17CFE7A652B910FCC9B9AECC2E646809C22D93 | |
1423 | FAFAD465DE794755AFF5BEC17160C9563B5C51D07022E2D3A256FB5CACE131D6 | |
1424 | F4B30F591A0419D957D8F0DCAA0A8D65A8D83422AD7C2613FF13A302E152B312 | |
1425 | 3F1ABB45E42084EAC894FE335C07324849C9736D00C872C4551997DB889AF17A | |
1426 | A52C5AA77DEB548B0103B77F65717F70B90C1BBAEA7BCB4959F32851A9882A3F | |
1427 | 55673F24103D6BF7FB3AD3EC3CC50FD8FBB4A6B13C3D278174320713A7B327CC | |
1428 | A71F01E50840B33D0FC3F5F6A6F2B0F2D0E38494B1C73096A430510F927235FB | |
1429 | 69E931DA8CE5415EE88D0248565E3347353621A48F7948AC9EAB5F5057541B50 | |
1430 | 82BA955D90BBC82E582FD71904445A59186022FB928015235B60830DA59813D0 | |
1431 | 8DA3FC306C43FF8BB2CB6772B1F7BA3C1AA4B2343E7DA7E065EA53A4E5E28DC8 | |
1432 | 0790F2D5CFB203CB135A08DCC9702B59A63290444F202756E55B9FB053F773D6 | |
1433 | 0F69C63E74DE593E49186FF4304E8FA76C3E3006358DE549E946DB69431981E8 | |
1434 | 1261C9C9A884E4EC708F69E6AF5D22C5BAC49F2AE85903E3D48D03B7B97054F1 | |
1435 | D2937A0C685D912D6D20A75A77712164DCBF8FE4D5460DACE139C5A934EEA09F | |
1436 | B94DBF168A4BC03A9D689936D833018FF43837DF9519AD10F357F00BC068E737 | |
1437 | 170FC9FC6715165F733A0B6FADB9ABB48B845167DBE6D771C916577FC2132863 | |
1438 | 767DC6E3D460E779254194AA690983184D934F5E858C1176B3862B69B42EBE7D | |
1439 | EC9AC4E020085D474093F7694C8A8C2025D4B0163E29320C384D62A9F3FBCB1F | |
1440 | AB5A374EF3DBA48AC2147A207AEFE8B78BECEBC55C97B538F3A0FF4589D171E3 | |
1441 | 826342C8A5186224FEE54E4C6AD5EB02BCB4088B132FA1A48362824BEF161235 | |
1442 | 8E661DCFDFD8429C65CCEF63902D0E07C2FEC1DC2756D942F13FECCB7E8A8048 | |
1443 | 345338F24B7808E46A04A915C111F939E2669A12FAC0BA4F74B832EAC83EABEE | |
1444 | 67E2817C058E69C2010F2572FDD15194CD8DF0FE9F827D349C0444A18D1A86FD | |
1445 | 802BC120A5114FA3523C221242C7E767B0AAF6AD15DA1561CE8EB18A2401D71E | |
1446 | 20481FA5F1E247CB5288F47795A6A3A3BB186E89EAAC4A54AC91405427136127 | |
1447 | 5B151203426830F7CADABDB3FF63B40CA29CF8E667E71615869978E99E6F3F07 | |
1448 | 0170EACDE3DC62DC05681D7680E2E96C30002AE34A4E5EAEDF88577601A82C36 | |
1449 | 22D625A03B0451D7BBAAAE0C396711500E94A482EA787495073F16A76D1657DC | |
1450 | 4EA7C7B83BC30CE7F145B65B6E2ADC207D192CE3B5FEF7031F4BD64F57E1BEFF | |
1451 | CCFFE06F1E4ECA48B442DF413766A70DA626359183A9B24C70419487423C816B | |
1452 | 4BCB067E661E47E172563090D6328BD738D2B0FE41A0C1D7A47576A79BAFC880 | |
1453 | 0473229D134F998909898301CEF50A82B627A9A06DF59D0B9C530EC5D877F1E5 | |
1454 | 220D3A1ABD2ACBFDF1933F92B3137B22B9F95A961D93B729307749A50D8A6403 | |
1455 | 7AD0F9C40743E39B8D198CFCF7C033D99440D46D821D97545B930EF92E7AE005 | |
1456 | 27F2FC766FDD4790FD1913C7A13328E73E587618ABD9008022C5C6C23935CEFE | |
1457 | B5ECA2CEBA1D25DD846B48423F7186E03B1F61C8F1D5AC95CE03C83B2F221300 | |
1458 | 7A761D6CB5F7F9251D3F9A7F4B25B99EE7A1347ED3059A811A82A35A033E9B07 | |
1459 | A4FB2A95009576F48665605C478E5F6C1B135016FEB4AE6A6BE4B4359836E04D | |
1460 | 45AA11366992162973FB6266547C2E570B8F56F6D992D2C0F63950A16839FE10 | |
1461 | F56E59D93A37573E3268C5892C9F3358753D1FAD6379E82BE740FA17236E96F7 | |
1462 | C53A2FF785FAB86AD17EB1DE8A6AA9C69B91C9D9B43B5188E51F6939FEC21B65 | |
1463 | AF17DCE95DD3BA4F1DD51F0BD5E5869A1ECA7398B6E664EB0D189181E9C23012 | |
1464 | DC1E54C146842A90909DBEC03B79B58909205F2CB2A7F83C66B437D7F7DB9781 | |
1465 | FF0C67F004E979C95B706D8D85255CCD827CF6196D847DB380B56980109E96CA | |
1466 | 997157BE78A4F758CE59D78158A854EF2C20099438F74777D3B0298D45BA86D4 | |
1467 | 3C0AC30C984718FD62ABA0567AF0A70C1DD41953E3E7212D5C562085177E650A | |
1468 | 2ACD49940551E3F7619B4CC31DBF67AC15D938619B95DBF66E6D1300B1BB8605 | |
1469 | 31C4011379FB5388CA49E4A9BD6C921560CB8D513F8716A0733D2A7D77E62D22 | |
1470 | A69B54E9048CA168D210816E613CF6357706EF6B118A1263B858B7E19AA98891 | |
1471 | 43BD675B06C893579957BAB97199ACB82C080593ECB8B66A7334779CC16E4D0D | |
1472 | 4AF365CA6AF9727AE29417B61A5FD52452873B1D666044F8E7C1F6C6AA3397B5 | |
1473 | 94A5780F4005FB5E41698FADD1594B505A58253D68D2AE3320E22165D198050E | |
1474 | 425820CC0A43FF1D61F168D87CDD30C14D387610B6CDB63BAA39B3EC9B3CA616 | |
1475 | FF1CC679227749DED3DDEA26B4D97C633090DCB8D8A6E5E07E3579E4A99BF1D5 | |
1476 | 51E43D1D7F139C9CB1D76D8F693A3F23A74EFBE79F01E0B850BC6B6C7F62C2E9 | |
1477 | 859469A144853434895D73DA6BD2B348A48BA80E79327ABD96539F2EA2209852 | |
1478 | E1BF6B0B819D7C68A9A1D0F6F39416E3EC4AC21DCD3C51D3B5B8D417EFAE165F | |
1479 | 2A7E0B76E558AC9F685A76FEC7E3C73CD607D9025DE6113BE5D0401887A53910 | |
1480 | 82A813B026A502B51D484797D9D7E79A25B6624940AEDB4A15F2C73CA1AF60FA | |
1481 | 22D15BFBF268EB044FAE17822511AC6580D1D74DBA3C3335217780B29FEE792D | |
1482 | 200B00B8CD888A8BFF15D938FC758BB5CD9B3E08E1AC6CD1669E663BE86711A5 | |
1483 | 892684DFCAF70C11E803164994BDAD89128AAD6461D4558AC2ECA3E05EB56D32 | |
1484 | 0290AB16A6DF7133DDCBDEAE89C6CD83552792E23CBF567D57E46548EEB0A140 | |
1485 | 437492B53C14419B6FE7E64AC23923A9E85F56A9DF209DC4E6BCAF1E045F9CA3 | |
1486 | BB904BFA150F4083C18B0CB5580450CDB657EA768E71222C71DA911A722AB9D9 | |
1487 | E18B6847F417125C40EA8A0CA1F551A4548712D098209C78DF9C3F78605E5402 | |
1488 | DA2DBE2218E49B819296D5AC88D17DDBA982E171733D1E9E295B3157C9B90BF1 | |
1489 | CE68CB185947D1E3D7544155B741296D14B064BEFD3E6AF25C74006CF6800551 | |
1490 | 80FCAAEE6FC9105E1674EDFE68C45617D8D3E2264CD395EE94EDD017EB85884F | |
1491 | FDF530EDF4F3F14750CA066F149E688FAF8EF4B5FE6AB515CD298E8D170346CA | |
1492 | 9B32BAD1D86DC147BD12EBEDF6CE1E749C5B48314F512470A568C172C35CFA41 | |
1493 | 031E34586A89404CB5372D7B2C7A6D96F420D4D7C2D4C08184F4AF86B4536A90 | |
1494 | 9367598424112A7B05D7107B23695CBCD569002290599E0FF4EC5C852C31F5F3 | |
1495 | 9BD56BB840DC17DEEA579E7A7A9F764788D4E3774BD523D21267869224D68891 | |
1496 | 4523070E80A123B58F7B579866332FC38A41A5915EC06F2D14FBE4A6CAF59AEB | |
1497 | 57E98D661637EBB885AA5D74AD429CCFF64E5149815E7350118E6385F4C74E0B | |
1498 | 2EB474A6DED021D429F01C9B0634A09250C40E22B3BFE1B7246D18116D585F39 | |
1499 | 0E06E9B5F27A6CB77C8E9462189CB900CFEF08F798CAE15FBD94587F33816EE9 | |
1500 | 03FB2DA6826EB69D8C284AB9F7B00630D0420EB6E35E0E288BA25F5C2345C067 | |
1501 | 22412633898AF99C2FB232D1469025BF262B567F29A05F4816FE8EEF5F02BD79 | |
1502 | 06202F6A1E3E5D4B3C91BA8D5FF53D5136BF70E5FAEF441A7310CA83721711FC | |
1503 | 39EE48BFB2FF287234B1A6102AF146B10A632A53AF97E11FFAC3A2A86BBAE3BD | |
1504 | E0459ECF0305366078066F2CC628A3918E775E4236651B3D817AF1684B07A163 | |
1505 | A0142D16F55D2FB5F2255A8813B8E54EF3E801E95A4A226AB8C0476AC5EDCAD6 | |
1506 | 9258ACB6F7C0CBDD298A0B816560622A1871FBE2FAEBFE697A8216A0D8FE30C6 | |
1507 | B1BA6C3E975F78182743842E7F851064037394142AC91B2530FB1D511EB20F3F | |
1508 | 79EDD8B7E1579D35F6E7B2883C47A46B6C1A458BECD6BE58AAFD834A7D82A553 | |
1509 | 2FE4E66878E4699856DEDE964F454638F768AEDB595A883E380408F558015FB5 | |
1510 | 8720954ECE2704AFAD4D62E8BB2657C4FA920D72248B3F762B2F12D125B796AA | |
1511 | 1C4BD6B42D766EC1C9B2C7AA4B6A3474BF753742DE8AB76D0AB0DD9A20EE2DCA | |
1512 | 0F34CB25995ED3183759CA83ABC32B8BDF0B06EF169252587971F7D37463BFA2 | |
1513 | BE36B2E45559DD73DE7CBE29DE92B9BE6B9F8093F934BA311D81E18A8DA92FC3 | |
1514 | 312E3FAB43C53E803975981F0076EBB8F257C123908450661B6FA79E7ECE98F3 | |
1515 | B0A94E0DE3A4DCC8E0FEC106CDEDAA297A75BF1E40F3C2419BF72A644F452E2F | |
1516 | 9A8793810319885EB3AB23B1E80E8B62A889311355C73722C18E62711A7E6A16 | |
1517 | A5B923408444B13F6522FECA9A60B067EE332B83E1A69CD835C9D69B5D8859D6 | |
1518 | 91F9276863D2E2E8193641E4239F4ED15E2C482C735BF5434BAA454EC2830C1F | |
1519 | 7CF766DAC9E924F17F03093132627673BA3D99DC2DBFC89E5BA032C16D3C1C8D | |
1520 | 78B3C464081044DB53C7A29E925F4157EEEE928C8E28EDA5F0A4BB6E0042D8AC | |
1521 | 7595C350645118172D04FBF06B2C9A9F3603A54B57999E2960C993724CCD6A09 | |
1522 | 766BDF73F66E07FCA9BD09079CE8010E6CFECBE2E5DE1EA4E280AB78D5184C11 | |
1523 | 016385007CB5AC0BC95955A1E88EA1A1D8EFEA886007708BA063F556D9284D4D | |
1524 | C764E75CECA51BEE3D35DFCEBF6175953D30FDAC00F23B1721A1DD577945B5E3 | |
1525 | 8176A21A649D907B5F63C71718ECF32ECCF1B26BF15AF694F1045CF98FC75278 | |
1526 | E9782ACD3D83CBDBEE690D29B3176E745AAE436382D258CB22F3DEDD02E441FC | |
1527 | 6A9931AC2F61156DE258DAAD5EDAD41E6C0DFC902173168BB4F51DFA7EA615C8 | |
1528 | B0F92FDB118378CBAC3D56B6B9BB0883C0C14EAA67396AAA7987222A132B7959 | |
1529 | 44FC1E9D6DB6D549DFBEF8D2DD8C53DD3B66935FC239E74E2C440CCA13C068EB | |
1530 | C4A3B69F499F573D076E2C92E24F2C69B806591B0807CD903E078683854963EE | |
1531 | 5125C3640860CEF37BE186DB781475554BFE6C528A9633AD5772BD53244E24AB | |
1532 | 42CA2D1123AF45FA257940CE611D83014DF04E60220E9AF27CB2A2247BBB004A | |
1533 | F5722A5EF058FDC7DC2B6ED1406649DBAA58DF2ED3A91483D60F11C4A39BAF57 | |
1534 | CB1E320A987B790672CDD3E3BEF4A67032244DED2FF4588B2072CDABFEB36009 | |
1535 | 9F4BCBEE16F811A44CEC77F8AE873C90C0F4C975E51014ECBD45A56A63F034C2 | |
1536 | 82212977023A132E5C88AAA826D841FDE9CBCE7A01E4B6F0EBDDB9A69EFEBD72 | |
1537 | 0B41EDA807CEDB791084047624BC11CE10B7A0A311272EFC9E013FA374D97EA5 | |
1538 | F7998FD908748CA72D8CABFD0F01220C2114D3B462B22FB71A23B284B1CBC7D9 | |
1539 | EA20BE71F8ACCED21F096009A14A7C7B51450BA51514707EB46B9FAAB31CFBEA | |
1540 | E1DDA6F5D9AF0B6E7D05A1EEEEECD606427B0F2363D1B882B50140466B9D3CBD | |
1541 | D00DB06DDD1BD4681E367DAA4B7C405C6281B67FFF794041738FC6A01D261CDD | |
1542 | F6E0A330985F2CA782CBCC02B6F4EE5993434F656B91A51CC03B1D73FFA6629F | |
1543 | 14F6075EBFD83B702D8844A96CFB5C14051595BC7DB2218156A6DEDA5C98CAD8 | |
1544 | BEB5284D9D9F86406A8C1AE85857185991C360E5F44DEF352A1F301207BE94C2 | |
1545 | 9A3A11BA468FACB3FA2D683419C44EFDD7C8F1079659F3ABD89D7F168B1591E5 | |
1546 | 6105F9B3FA481BA953CD34CCFE73E427D3AFC46E5C58C2981198BA284DB8B37A | |
1547 | 6647BEAA561799877DD6858FCA71CA6003F2961FAA529906673EA94D82D78116 | |
1548 | 4DAC81011FD175DA707C1E15D4B6FF19F8720A4E05E6E103E2DE880FA9C192BE | |
1549 | C5ABE7C311C2ECCBCE8F9713DBA74AEC37A61C8F21F271B35F0F7C88B182525B | |
1550 | A4183377597ACDA9A6E2F181725D427795B975BC4168A408D292CAA484BD1B8C | |
1551 | 9DC62E737ABC805C8FCB7E96454DA032B601345570EAE0379BDA84BB6D15D780 | |
1552 | 42FA1E068A7D62F152B43B788513E13724666FAB4E2B4F04B0448194E46582CE | |
1553 | 7389BAF0D1DD4435BAA6B82AC305C04686B89FD51197C721D941BD2893596024 | |
1554 | 1598E6C2BD84527EDA6FAB782033E4BB4F964FBACD96CAEC3F3CF89CBABF6B4D | |
1555 | 4D3AD14A03D4BE931632BB03BC2B92842FAD51A19A756892D5B978DB695D0540 | |
1556 | CC9D030C612E2B201D60D09F56332DD0BA1351EE62816C21A35C33DC11B37BE4 | |
1557 | D2F164ACD836A5CA1553CBC733E3B159860454B17064B4E22D3764FF6293BC81 | |
1558 | CFA3B2325C8E072857F6FF4ADAA8818247D431A28D3C5FDFBFB24A6CAA327AC1 | |
1559 | 0B3630C84ED9F0D33B8255A3CAA9C5A0C79F7BF6BA3B9801C3BD0B30AEF7CCA9 | |
1560 | 92F25E332EA97A7CC653C93D1497992D6B76363885B92ADE34C2A33E30A3B1A0 | |
1561 | 57E9C16D8CEC189565808D3FAC92973C71CDE74DE9D8781CCAF88747758014C4 | |
1562 | 5B62667D4D2CC5EBEBE77C5AD00C6A69D1819F5A786964501E077EB3BBEA52A4 | |
1563 | 57729AEDF35253F7E1D31F2DD1587BC15CCFC1B0CA930DA83E2031B099A38158 | |
1564 | 8D1849E7145AC74777A3C7136DEABB0C787E5A218309A65EC7D128147EDE3AE0 | |
1565 | C0AC039B56F767A22555CFCC12DCBC7F5A5A3B4E86EF5A69EEA93DF0BAF2A3F3 | |
1566 | 7504F5C6A7A67388D2F9045BD755BEB7DFBC2EED679497EBEC808BE20FDCB5C7 | |
1567 | B586463BBB898DECCCF7249E9047DA943FAF0718A2050FCFDF8A4C2029FBA674 | |
1568 | EA64003AC03A847185936FC375CC67B3006EA681F61F640C3640A78D0C7FF521 | |
1569 | D477981E23E5956BAF42252463FDBEC49BB560A9428D248B0C5250CFA2A49CD9 | |
1570 | DBCEF73123C13BA382D3CF6A7B8A8CA3191D379A659F0E2C6E9CAFE9DA2AC074 | |
1571 | F622E397A2F7C73347364AE249B11AE2C34AA7F0D27B5F35D548D5AD1228597D | |
1572 | D16A478C901D3A34D870BA39F770885B7DE62298F0114752435050E99EA4E5E0 | |
1573 | 56B965EA185E8DF96B9FE97EE23DD45AADBFE02B427222B9FC99DA94FB2648B8 | |
1574 | 46BD30F881BAD3820DCA4D8093BA0FE70E03482CC063B751439125623FA7AE40 | |
1575 | 52DB2A380D89D5E37BF264CC73DA9A1540031587F481A0F146C6ED6F3F2957FA | |
1576 | 19477F075ACF64D424279612DA5AE02B2A140048386D01B1F30EADF2050B71A7 | |
1577 | 993773D5B68C6FE65EAC53411AC6E7E26E49BE5FE1079A8BC565D2CEB7E3B896 | |
1578 | 593D720DBF66CDB26DA5D8E533A346845E31374A7C85FB6B06C3D54FE3408013 | |
1579 | 864CB0954A2FFC00ED17CC167AF714716376B789A71059DF2032E0E907761E81 | |
1580 | F0C887810337F52662AF43FA1A7528923B0A30A217FA184ACB73207EB3018D5C | |
1581 | 09EA88CA0873AE690E94D43B360D9C1070D7CBAE9BBA72E82EF9914D3AED6D1A | |
1582 | 5539585EA969F0A1407C8FEDAB69BA3EEE3097D5B123C5770D5ACBCB0882F35A | |
1583 | E8A3E3B1FE3903A941EA2090266B60D218407AB99EEF38F18C9FA307D73E2F5C | |
1584 | 42F8C37E2F668BA6B0779791D8404E2B2CA52E28F0B34C85250B0D6AAF9D2DCA | |
1585 | A12133B5B601D971345EB6D892B85FB971DB8C4A4188ADA6575DC6DC42D2F0C8 | |
1586 | 4EB946AB47F487B6B4C4C59B2FCEB1291C386805C5B62B61FD7310A13B4620BA | |
1587 | 650DDF28FC1AF21FA124C16EE8ABB98904F03E7F49E54348B1AF2211A1768768 | |
1588 | D62E35EA2EF7F2756B58168F9FFB5785DAEAB324C90FDF6207E670DF277D6AB5 | |
1589 | F0924B26BCF52CDA2980680320314F41244B73DA6367C434B5DCDB96B6F0F454 | |
9f178efb CR |
1590 | 89BE7553B58CB230BE71B2C7A7F1D63C3B1E80C159DD941027EA44D54767355C |
1591 | 6EB30D38D407FA1189474C2F9D3FD92F5CC6CECC63CF6CA6B33D77F08D274A1B | |
1592 | 0AD7C2DCEE55F1B425BCB98F24D0BD431A5BAF6F42BF897BDE9198E6BB331C81 | |
1593 | 6B5B63F3604235FB733A882BA5464A3E5415341C8E9A2E79A5896C8C334CCBB8 | |
1594 | A2047CB4E6BB167BD586FFC4A1409B4C13DA0B84608126D10754D562A9812A79 | |
1595 | F2B3078B7CD1D0A37A192E1D58623331B582E62291B6EF6FE3C92E8EC9A40C37 | |
1596 | B251270944393FCF133426FBCE86A318E16141654DD7BB12AD46B60A05E86D3F | |
1597 | 14BDDE12FE3B17F9E2443E057FD0A25677D1F17C2BD87F84BA7D6AE3E7EF3EF9 | |
1598 | 3DEB268B580A7823253430FF8D80FEFA0F9E4F66D0733E251E7F680B8B23B7B5 | |
1599 | A614F4FAEFAB880843451E4D9840AF7B8BBB6333E010A169528748AFBAE9A6D9 | |
1600 | 499E221149C0AA19D536F3F121DF1AE056D3D0FF5C6D837BD8061153501F0209 | |
1601 | 79076B4E0C63738C54BB31156F2273A327D3B6D0DDB5039D27D1C4020E90C94E | |
1602 | 4A4B156B32F28DD132D2AB4D9CFE18B7851A65BA965382B23CCC0915EB6847A0 | |
1603 | B14492B0405395BDDAB36C2205F229891D989196608455629CB3CD67E07DEDB6 | |
1604 | A09E68BE431182D6CE52CE41B8531FF111ECECA60A68E7E7BDB6B91C7B694688 | |
1605 | 47786E04588AE7D21DC6F2309D492FC9795DD054C150ED94110A7F89CF3E92F7 | |
1606 | 4649D3F4C778FBF02ADA9E577C5EBA24A1F0278E9D9DC5556A60EADEC068AC57 | |
1607 | 5359E9FD0D2E3E7B0006127F95F333D2BE77C70EBB163EA9679207C76C999903 | |
1608 | 50D76BDAB2DF0D6A506EEA9C952A3D28D419FB78CC64078CD91C39A5D4FCD9B9 | |
1609 | D135A4E24E373E24047EF1180D3BF51DE4167F3945825B7124198FCDF7432E20 | |
1610 | C35BE9B0C7C0CC194867C4CE9BCD27860826C14749B811E8FEE29015CD65E7F5 | |
1611 | 307300B316054B7914CB7464E6AA37DFF4BD0AFC04C0E8BFD1269E2D4CB5A201 | |
1612 | 785C32B6B5656A7F6CA6AD8F7C77DF8F70B8F99C88BD8D548E78986096C917F1 | |
1613 | C0C195F4CE7972F1354B95D1BD84934D80CFD09FA14F3DF37300B5E8C208C66B | |
1614 | C544BFBF9B18AA7E27AC4E8567CB7188C20B1807BE56BB2B348C551767F40A07 | |
1615 | 022EBCBE0749DE0D8FF1E2792A0BF2B84C940A127203E2216EA4F8689C84C739 | |
1616 | 58D5693082E057B67C9BD80FBCA6463D9EFBA2B9F4D3C8F239C1A70D8A4A824C | |
1617 | B045489E1C6BCD28DA4F1BEA2BD80D424722479D0E8A1A99A8B2FE26822D3198 | |
1618 | 722E2D276A123A95128EB6C5C6AF9AAD213D088EE92917E0870179888296F4D1 | |
1619 | 0FFB87A340D7F052B07C6274027559A8B3843F2422C3640848CD8BF664645EA7 | |
1620 | 20EBCB14E9B15F552E9E793B2F5D7BFE849817CCDD9BAF7DBA26BEED536DF80B | |
1621 | E250F831A12EC703AEE5ED6F5C688849B00C85AF124451A29CB67398FD3D4015 | |
1622 | C5D8824B7EC81F85CE9170560BEACD43ABF5EB5329A4E38431F243099B8F88F6 | |
1623 | 58E8F6A7DF8AED9153CA90F9C941320750E5C26262BD14CE3CDBA9AED2270546 | |
1624 | 24917E378761B5A96F0689511C12A0E598E7BD54A6ABD40AA4FE651AAB9DE733 | |
1625 | 88677F863423C714476E797F4A22B94AF646819D91F9612E6E5CCFD9F7D11AB2 | |
1626 | DBDD3C8ED9D257E5A8BE4B7DF9997EB2ED23EBF4BFCBA1993796E34AD93C8CAD | |
1627 | DDEE75EC199BF642C34BA24E323A7099C4B7D232328ED3C7A3BD476FC0B3D921 | |
1628 | 8E773970ED221BFD47FC656BD14FEE47F06834C55C0EF960DF0265E847EA4421 | |
1629 | CF81FDFB40A4C997B1EDA3556FCD8BB4EB141EAF4DF853FD353120BBD37D4B44 | |
1630 | 2CA1C1D5D8A5626870AAFD925B461A65FA0E2924A197F27B224E53A7140A83C3 | |
1631 | 10A7F3868E4801C216EBFC5F8391A1576C69537686DB1CF7F2AE299FB03CF222 | |
1632 | 6A38A57466A9C0DC13E9A8200649DA837A6C40E002C25114F0CFB3D2C0A9AF20 | |
1633 | C7B387856AEEE008AD60FA1B26179D95B3486DD3E5BBD096D4B105117418F60B | |
1634 | 26AEFDF53A815F712956AFAE0585B243D5A2B4AF5B517023867F57ECE2D538D3 | |
1635 | 89804EFA77C0D9CE905A3303F19A9AB3B228A03B88CB26631814A36C27D09E56 | |
1636 | E965514293048ACF6BBAC80329F0422591F06637A274F2582A6BC59ECE5DBB7B | |
1637 | 7CB5056822A2426E4359DE632F89734AEB6F783952B007EA1D2EBB7CFB1C1D78 | |
1638 | 7EADDF28CA76CE34F78E568B11AA69FAB64D8B0FC933FAD372B9EF19D5F31A25 | |
1639 | 35BAF075193980F69141538B7E7586E8DB534762CBD9E95442AD17C8C2F438D4 | |
1640 | DAC23C5F5D772D1809ECEB13809662C6C8B97DCFA5AFD46C6CF3FC6F07BDD604 | |
1641 | 5A4C473C7FF3ED34462A79487EB47D5BD4580E98BD44CFF016DCC942E831F7BC | |
1642 | 759A345622F5C65C067C83F7474EBEEF62E63F5B49519E0E1A7BA279784977DB | |
1643 | C646DFE8D0AC7D78CD27B8F9D8E18A3A1C1AD427A85401543B0CE4F4469FE14F | |
1644 | BFD02FEBB2050BD06558FEBA3F61D35AE7A0E49639DF68910174F41A20F5C839 | |
1645 | 79545CB64FA870FA9AAB20B80CE7D85DB8A0F64915E1742E5835B5152BCD4B89 | |
1646 | 4E7BC34E8D8CC93F5DE675090B7BDAD2728022F29D6A7D0F5508A189B8E0CCBB | |
1647 | 87AB29B9680978381252A9A37AD5CEBA8E4F8CA2C06D7A2133FF94B3AF05EA7B | |
1648 | 0C1497955A4E04183092871E66A7386E063B58764B62C33B6997F2E0D7F4AB76 | |
1649 | 6093F606DF3C4E5F8A06E9D602E36F2DF4CA2E8C59EA6F8537A8269EEE427271 | |
1650 | E1FFFFEC053811328AB1FC60821F4C13D277EC66F56F27E0208726C915CBF178 | |
1651 | D2DFBEB767FE08AF1DEF4219F6C97BA5505DA3CF06BCE02E8E5013872DDB0E9B | |
1652 | 01103E8F7213F1A00C473349820BA7F202C9F8632B9D7AC4FCC98287175CB2EC | |
1653 | 7800B05D4A7617335D1CCC2094F70BA6556A99F2B9365409971DA4BA1913B7E8 | |
1654 | D6D84BBF1CB40FFCBC9B1C6306E9A148F39874A1E2A8FC677EB621FB46304D59 | |
1655 | B982A381886E99BE387640FAEFCE8182A2CC9AC76C1078D9E03CEAFA0747AACE | |
1656 | 16F9A95F5A97265A208ABD10C3BF49C1856461B710A29887CB6D57B61D24DDC1 | |
1657 | 5DBBFEE1DD43EA93F9B0B70276253A89546A4E3918B5C93A991AD372606F091F | |
1658 | EC35362E95CAAC00280DB8BA15DFA28F9AF7A6F9EC51FB2ADE3D15599AF01627 | |
1659 | B4D96F3D35FC4995EB18DA916FB6D24B56D60084E0CD8A32AB934845FF24B689 | |
1660 | 67883D3EAB40BAB8FEBC3C17F6145CE0B96BA50A9ABEC6F1FF955C9FF80DF500 | |
1661 | BEEC7AEEA8C2FAA50968A57FFA5E9AFBAFF08451A63625918621B8FE9A46255C | |
1662 | 86B9E145C2526E4D27F974D74221FC90BC691454D7CC6413AEE3321D64E57F58 | |
1663 | 81DF5C5954C794492D4135F130855678C8BB7C4A3E3551D2E89F3DF6B049D857 | |
1664 | 9115B3697E07024C34985FDAF5EF24210B2864F9471879835FBFED10D7535002 | |
1665 | E806CE05BEC90ACF31E49AA6C62D9E169196A7C358E1AA5C886C1E1544568C2B | |
1666 | 500F208319AFCB37CBE4A568136B1791844DB5B627F66C75DBB7FCAAC4EA4620 | |
1667 | 323DD1FC501727D74CEEA2C3D1B4D63779120AE0B0843FC978E1EAA6FE4FC337 | |
1668 | 46F12F90D6168313CA077B85990EF9C6EB27F71D3B8C262FDBB297B1B88625E4 | |
1669 | 62143BD515F6FEFEBAAF35ADF8B57486A14DC57614488C332E2B81B946397168 | |
1670 | 1069CE21C21E8F44B2DB9EFC2F4160F17ADC55DA7218DBE64FBD5BABCA4C5718 | |
1671 | 9748B61B8F7F9573847E7BB62DCA710100AD39FA555C2C3B3800BCE7C78BA404 | |
1672 | 3DBEE48BA6328F47B1E72A507432BE4A7EA3F0AF034B2E29A4CFFAE8B30AF806 | |
1673 | F71936B5FE86F73F9C4B81123E1AE017B60EB2EB108EAC9579F3EF142CEEC861 | |
1674 | EAECCABA38C637306D8379C02548B4B33FB5D8A6169B3899A2D0499899946371 | |
1675 | BCD7D8D37924B66E4DFDF25ECD17408AA78A9A1D1C8A3615E428EDAE3E56017A | |
1676 | 0C2CD79A0D92E6DDC54746E5095B4659D73A251F3B7FD7625CE7EAC3EFB61409 | |
1677 | C1463D4015619BA3746F278188E2F30F997D477491D39625C2B829845D4EA97E | |
1678 | 56D7F3883CDD5938BF1BDCA2DF5BBD0E3D495554A01840E7E7A081A736DF6D7E | |
1679 | 6BDD580F717261F6A3953157DA05AA3B57FBB1E977C6A43555F7BDFCB35C8B8E | |
1680 | B6356A4F1B01317B029918AB1C0400CD32A41515CA55E59CDC9C4641A570DA65 | |
1681 | 96FA304094735B8B070FCDBA01DABC55C493A390F3A0B60D31C6EE3176BD5257 | |
1682 | F6CFCD17682833155B9DE734CE94A232BF9FD8AA45C35DCC0B16FEE6EC241BC1 | |
1683 | E944B183ACFFCBA57219D6BD9132E9610780D4AB07FB2F77428114E800CB5855 | |
1684 | 0C26502E4B09AD0EC8A4B342DA732E24CBCBC7BEB15322BC3A4B004CB9652D27 | |
1685 | B85525C0E59DF15D972EE00D5D6DCDDE1A141DEDF0BF9309463C7D5D0D95077C | |
1686 | F41EACAFA40CBA65004AC680983DB2CC892C1089A58514051E2C0FC16D74056B | |
1687 | 34151DCA72FADD08765BF73139A2A15A46067064490DAC5AB5039C545DE452F7 | |
1688 | 35416482DD79C77BD0256D6BE9005C80902D9BE36F06FA4431F1DFBA7C982C66 | |
1689 | E141DA88A07902D83D1A83C0538DF2F8F8719409259196EC46B9D7815E17F836 | |
1690 | 4F06E024C1A05A594BCC8C7489B3DE9E9C3B9D2D15B8149F6D09A35A8444CE1C | |
1691 | 704E2B8F273FAD8128A6033E871F1A36B95969EF3EA5EE8DE9B2720FED92D43A | |
1692 | B894DFB54E6F3E4D92E18AFD7B4D72FD675AB7447729F4F618FAC4938ABBE9BF | |
1693 | 29045FD578CFEDE3BAFA55419C564CE39F324592304FF7B339DC2D889C157BE3 | |
1694 | A182E42DBCB6BEA7773CE2A058EE2076C77CC98F0C37CE8128E1671D8BD8AEB3 | |
1695 | 1E724BE5297AEF6F8F90719D75E2218470034C970C7C3BC4CE46234CF25F3092 | |
1696 | 526AD39838F4DD2399A4DE9BE341EA932FC616B02FBFE7EC68AD6E98F5AB3040 | |
1697 | C00C615ED7C7D427387D5AA99594EAFD54D3CE88DEEAB0A408C14B48217D73B7 | |
1698 | AAFF60D219FC71262E05BF9D15DA7739FAB52683D27A3E094B40D84E3C272D26 | |
1699 | F9CC125000AADA491137363EEBDE57EF302943F26E7DE08EC71707B62E717F92 | |
1700 | BE14CB7F5D4FF8A802030B10FA8AB4D93286AC064E0547032E2AAFA3E353F4A2 | |
1701 | 4B3EA80EF4221C81BA5698D58A460C0412B1C1BF143E547DCA6CCA584011B55F | |
1702 | 526742925DBE8300564D621015796CD280DE573A0A733C5F6B2D4AD811EE4778 | |
1703 | FE60F46ACF6B6943B07B0EB0E4636823430A301B06BE688CC24785A8896BCD42 | |
1704 | 39B97D9963BB74BD8BF05217B615983E27994FBEDB0577010E46BCAA04DB1A72 | |
1705 | 77F4ED8257D145EC44B2B65B408BC71239F1C2E8434C1C2FEE4642BEA1C60C7A | |
1706 | F02BF44140D0DA3E94D7658312A212FABFC0AA74F3512D513E82248BACD86A15 | |
1707 | B5A2C71F3692C8D702FA11B262ECE33B382C681D54BC275FBAB326D928A6A327 | |
1708 | AB2ABFF6C4A65339D945A671AD839DEACA7412ACA3253B399BA17E363B213FCC | |
1709 | 962725E0BD8CCE55985438700204353C507E4DB96C1B57DD7A071124476A5095 | |
1710 | BDA4C678F514AA63CADCF7003C73F0C505590526C0D1BCD7DAC0236243AEE48A | |
1711 | 5F351E12194DE6754336416227A63FE6C37D472EA1688AFD88FC94922094E799 | |
1712 | 930F9952B2B1B86D1436C843A90AA230139B82449E16EA8B29108AA624933D1F | |
1713 | 5BB7E1EC1E7F570BD1DC0D2A9C338F4590D590AFE417D289B103E11156D66DEF | |
1714 | F9E1F1F3A68DF07D69FB9CF4D09F2E2D47C2168E0BCECB8BA1CF856826B51D23 | |
1715 | D440D7EE177DC922BA367BC69871D037A508B80E75F43C331F7BB5FC96493932 | |
1716 | 0B3CA39DB05BB29C08348C3F0FAC71ADA5C07BCFD160FE677A8A030BDE2C4A6C | |
1717 | A866D89CAFBFE647B36F7931664F82997CBFDECB6F88C795609D1C94DC80F09A | |
1718 | 87221FDA3A699D0748F97E682B5B8C7B1EBA75BD44070DDBECB03824F9EA4E1B | |
1719 | BC66A08A1A0F8AA3DC482D408C83B469315A2ABA685726CEA99BC3D15799D28D | |
1720 | F81E0BB958E34A1670C23FCEE68A0DADD2BE3CFCC1914A9FA1B1A661693ADFC6 | |
1721 | 378969C2E400E5D4AB0CB7DC0FA364893D2484DA98264CB50205B7B9A2532492 | |
1722 | 81A2697B7FA4FC77E71D3117608ED7C474AA2FFEE8B3F1DD942CB16A1FF06C6F | |
1723 | 3741AF6972D09A5EDA91B4EDE291A7B3E3D481005BB578DC5AF13C88EEE51380 | |
1724 | 78E57D8E073FA46B89A1DD73D51AB11B44048CE2F031031018697B2DA15BB05E | |
1725 | B69E9E54F85E09EE3EBCFF390A9CF28B6F0932A46C9306911F2F36B8CA3ABC14 | |
1726 | 022697A6BC560C0A688BD1E49AA9F9CF4917130ECF08F8C500E0096A8BE65E01 | |
1727 | EE5A2618E3C9DDD1D227EB584EB0763C6294B91DADC65AA8F1DB42BA25E77B9B | |
1728 | AAAABEC083135CC61C18987128961505D602E409C3DB90F301CE2C792AB7ABD8 | |
1729 | 1B7442AB1C8D5B1FB5AB30444752254A530B227A1E7CBC615B045031FB07468D | |
1730 | DADBE63C9D1AC6F9742738FCF2896ECE73C131063E6FB3B954A77D1CD1F5764E | |
1731 | 3D65A43B627E8E7E10C5966C93E9794A3211D8B349D7F82427A65DA39B4AD1AE | |
1732 | A98733594453F400B9841AD3207DF9A908372B8B7F8EAC363D0DDFB90411A468 | |
1733 | 1F3F0E7A8DE83F3CEC745BF43D341A20F53BD0667B70613FDB9B1379FA61BC9E | |
1734 | 516118F7B1DC7A7B049E116A7A254F0A363694920EA156DF045038B14C229E6D | |
1735 | 19417309B6DFF125580B5279D6CAE9AACA31A1D21AAEA8DE32180F3456AF61E8 | |
1736 | AE8011BFA62D7B5A8123A02131D2F622211D74F104CD729CBE44EBC70672C064 | |
1737 | 6D8CE2956C78B8CAF172B77E78F715DDA875A492CDD8357CB3AA3ED817043631 | |
1738 | 0D278C6AB079AEC3C765D5E0267BD01C1D3F7AAACD0CF34EF8DD2FC5FF8FE85D | |
1739 | E410CBDCE53C792C0ED5092162DB85E6465C058D95816008077E22EB8A98B8D2 | |
1740 | 5A4069933FD3F3DE33926152C7DC712807784C17863EC78F9FD11A335BF8C700 | |
1741 | F4963F7C1A72505DB453012507A3EE51F7F2E814CB77769356C7654B9569B68D | |
1742 | 36C1EBCFACDF5C8D91D664820758BA73A83EA9660E33D4589C6950CC5C612710 | |
1743 | E9E97BEB5CB43F4109FC0F9E5EA126C1A9F2C4617CA146013F01E810EED40041 | |
1744 | 5D09159A5B53FAF73B151499CF4BA3B79A19034CE461298D1B805E161CE837C1 | |
1745 | AE9A7298DB9DD9E54C347E64772AF100A5C736173D5D9EF4C45B8FF6B0ECA17D | |
1746 | C1ED7FA96FAC530778D72CAB4D9920BC6C137EB3187B1DEE669419753B6472C4 | |
1747 | D29CF8ECD1D43AC03DB1413FE6D4A883857E2574C68AEC9AC7F7D3173E9EA7AD | |
1748 | 1A8762EB2841D29BA98B8C59BF52ADB41A1C06A50FA66C169605BF950AFFFED3 | |
1749 | 6CF7FEE0126C0AF7DD7A85796BE7D93A124581EF530AA62DF4CB06A15A17D5E3 | |
1750 | F6B6B72CD7481D238B2EF97123EE55872A43599ADCD48443DD9DFBFD469C71D2 | |
1751 | 624FE39A15FB5CC331E29B20DD1994FDBADF7E2843ADFEFFB38AF6E727638848 | |
1752 | 4BB02352C312A363C3920604853550205484499FE4B1D8A29A4913F440E37CBA | |
1753 | 9CFE762651749B33BA532DDFEBA257869BE4585699ED7E918FF72D25F3EC0C71 | |
1754 | FC49EF6C38DD1105AE50D5DC13F6F1AE2FC3264C549FB4D8D1A959F25DFE913C | |
1755 | 1ABC41ECBB5B538BA1C4870E73599BA518FF41B6445D40C9B9BDAC2D552E4533 | |
1756 | 670DE0C40C155E46AEDF4B74BD44A521815B69981F4F33EBB774391320D8B6DB | |
1757 | AD9C9545557E21A90EA55CFA69B967F3E136CCA7A1E4C9D312D9D08940DECDC9 | |
1758 | 1CF646FB7704DFDF783BBB1739DA1D2EF502B7B3A1FBEAD958DC99F086E6B623 | |
1759 | F33ADC3A758138E47EA3DE1FEC42EBC6D675C658B9AAA4C4054B1F81CCC4D216 | |
1760 | 9559BDFD542140F2A101095F2B3FFEA124F407A8B650032265A48F065C3C5BD9 | |
1761 | 66D843E3A2BA4CD7BF56A6A10D90345B51969A03DF45C91EBC2F3023A3E71B4A | |
1762 | B6A7DADD9E3EC5C70207F743157A9A0ECE23A7A95798C2174281A7900919878D | |
1763 | 955EBCA90D02F07876BC3F5EB1252A82D891FB3E0FB9FC032080E6F700981030 | |
1764 | 0E81FC3E75AC8623405CCAFA66161D5D471EA952F0FD4021754CB61A7B1445AC | |
1765 | 0547EBD4D78F141651A5DEA6262F0A05559DEFD434C5485FFBEEE7DA647AFECD | |
1766 | 6468D4D3905576FC4F670BA39F9956149CC371A31ACA929CAF0668B667DC2CF1 | |
1767 | 8810C6CF9EA23CD5576C110183155DBF15F24CF0973532800274127C6C5C9C79 | |
1768 | EB121C5F0B74D824DDFA3EC4BD7BBB8799875B8A4776B60F840AE96A8F65724F | |
1769 | AAC3BB862EA6F8697D935C60C2DF962F042521BB1D3EB9C064F2CBFD84208D94 | |
1770 | 0E9DD9242157F4D3DB05194E82FAD5EF8C09092055463620D1B4ACE3BF9CFDC4 | |
1771 | 989840A2CE7BF62D69BBC387D0184EBD87755E4DCEB8296D1005E79779A19B14 | |
1772 | 354345A8A0324F1E61D88A22BC423D3DB4686ACB6CCA3CC515B6A5CCA6C888FD | |
1773 | EC2CCB767778AE3FFD7ECBD8BF1828E5BDDF119247F11B299D5272C475C67113 | |
1774 | 8F124D25A87AD26E8B7713A5189FDD920EAFC2D9069664744B6E7DE1AB20E798 | |
1775 | 8BF9B8885BED5CBAB904032F6245AC752F392524C2FE09F636B59B17ACCE1E56 | |
1776 | ECDE4533FEE75C6ACA81D3FD7F6032B865D8B6F34DF1A99E01FB6534659921FB | |
1777 | 81631346B4530CC2E6B15389D7D494A4851C5F7CB502B394E840ECB67D359B77 | |
1778 | E940F25E96B3AA4DBFB0689C0C8D41EBFB5A9ABF7B817AC487093BA1013E345F | |
1779 | B42647E031C22B77A319062324A7BBFDC9DAB8D5B1E0FA4FBF8036AD46E554F9 | |
1780 | 6B925144323B7A79B103E808A43954DB3A03120EE5BF48438C0ED2807DE82FF1 | |
1781 | 6800AA8EEEA5C70DE747B76246A437B09F402C8E1B545636E0860F670D10E42D | |
1782 | 9A579DEFDAFC447917E0AE0AD49F49EFEEAD72A83149A22A82F909670FDF4A9A | |
1783 | B106147A6CD6D9CA4FD64191B7883E89C30FFC30D3262B9B09CD7D2440D85F28 | |
1784 | 983B191CEDBCDBC06375195625EB247DAF10FC3F01259E59184F462B79592181 | |
1785 | DF37D70E698785E55E0810FC9A5094CA115B2067FBEE8ECB004856C68A18AE7C | |
1786 | 9BB1186342D173068A4BD0020FC703BC1AE0D6C8EF419288D7D0F09042C5CAC3 | |
1787 | 6DDFFAF9A79B811C55F41AC87F93DF99604165A6D6E5938016C155EC65393512 | |
1788 | EF633ED422AD5BF8C66AD82B3B2B0FC59F40ACA8B62B2195D84478F920C39EFC | |
1789 | 328C9EEAB999D28CB365ABA1A99475D57D5BE151E107BCA6C65D535D8E83EF91 | |
1790 | 35EC4BBDC0C5A124CE24ED6438F2103FA03BC103F899CC0E12428A807763DDC6 | |
1791 | CD11E4E11749145810B387906A7B3065BCF1E29A1815ED266DB7A429C3FB2860 | |
1792 | AF3305E4FE74E02626385FAB8833954B803CFF6231810CA8CE55EDB2DC2B1548 | |
1793 | 82CFD8F105CC916B0A55E3955BEF60680B544501937E9A6FBDFF46E12B114967 | |
1794 | 2066512D019B1D727D3759A708E5D8D8FCD99AEB82B3F660602F8BAF091A7AE9 | |
1795 | ECBF15E7720F671E85C5FE0F2871CE1EC0A7B8E923EDD845F6C8F8CEACC70DDD | |
1796 | B2F87D25890FF1DB39BFF89A3A35B8B14742B4571F412CDF868177E406C9D07D | |
1797 | B759D6D32A7CE22D9E9FD13802A170F20E9FD757B9DA76B12712FF6DD0E8F4E7 | |
1798 | 4A296ED2795FFA5A0C3CE468C7A9CCA440C599C207BB084B1DEE83817A7F23EA | |
1799 | 1A4ECF72B3786D72D12FE3123D33559793046B7773C9E93AC1172026014A1917 | |
1800 | 4B66A90C5AF50072C231F0B633F00EFED86156FF0FBD451C161DD06EDF438A38 | |
1801 | 91FA7FFBA022A4468296A7132A3D88AC243B69C70F21B7AEB32BB5AA21800620 | |
1802 | BE6C8116466BB843FEBE361D1DE93F7C38033C95EBFA922FCC45E812B48B1A23 | |
1803 | C33DE814EE885A2354B37C05E405D27A0D3870E19CC718284FDD45F7926758DC | |
1804 | 62D79AC3C0EAF56B6812049148970442ABD34E0C0F49A6711A134C5568004C24 | |
1805 | F92B455E8085D77F48ECE5FE9F27FA91379C939919E78B60A54E235B0936B3F0 | |
1806 | E1300BB4CBFD05A18DBBBD76524B4084D54D990F5EA51E5670906E358B4977C1 | |
1807 | 83A7124F6BC09AEC282DB90C2FCCD9D909B57959E6E68D2E50344100EB1B6BD0 | |
1808 | 1A1FF2C2F0B250AC9B1FFB4A4EF3F28C022F7F873C7B3AF76E1830C9B039154F | |
1809 | B3C3BD97DB32958B718D53B552A7A0B033E84EE515B42184A22A10D77FFE32EC | |
1810 | 0E1CD1708021D7931DC73448FB098A61C93B7D03F98465BA42D4B927AB115C49 | |
1811 | C0CB10C0BD55B16E6BA017306506D3D610ABECFA480D8840DAAF23CA03AFD9CF | |
1812 | 1075C8E9B821499DE23D4882C081D51649E5C9BBFF1431057D95D61351287B03 | |
1813 | 0C9A6BD89F33C02555E1D3DA7F03CC395C1E3633FC902F060DF903FC96C19719 | |
1814 | A5B6A39E | |
37c41ab1 CR |
1815 | 0000000000000000000000000000000000000000000000000000000000000000 |
1816 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1817 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1818 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1819 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1820 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1821 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1822 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1823 | cleartomark | |
45c0f7f8 | 1824 | {restore}if |
37c41ab1 CR |
1825 | %%EndFont |
1826 | %%BeginFont: CMTT9 | |
45c0f7f8 CR |
1827 | %!PS-AdobeFont-1.0: CMTT9 003.002 |
1828 | %%Title: CMTT9 | |
1829 | %Version: 003.002 | |
1830 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
1831 | %%Creator: David M. Jones | |
1832 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
1833 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT9. | |
1834 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
1835 | % This license is in the accompanying file OFL.txt, and is also | |
1836 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
1837 | %%EndComments | |
1838 | FontDirectory/CMTT9 known{/CMTT9 findfont dup/UniqueID known{dup | |
1839 | /UniqueID get 5000831 eq exch/FontType get 1 eq and}{pop false}ifelse | |
1840 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 1841 | 11 dict begin |
45c0f7f8 CR |
1842 | /FontType 1 def |
1843 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
1844 | /FontName /CMTT9 def | |
1845 | /FontBBox {-6 -233 542 698 }readonly def | |
45c0f7f8 CR |
1846 | /PaintType 0 def |
1847 | /FontInfo 9 dict dup begin | |
1848 | /version (003.002) readonly def | |
1849 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT9.) readonly def | |
37c41ab1 CR |
1850 | /FullName (CMTT9) readonly def |
1851 | /FamilyName (Computer Modern) readonly def | |
1852 | /Weight (Medium) readonly def | |
1853 | /ItalicAngle 0 def | |
1854 | /isFixedPitch true def | |
45c0f7f8 CR |
1855 | /UnderlinePosition -100 def |
1856 | /UnderlineThickness 50 def | |
37c41ab1 | 1857 | end readonly def |
37c41ab1 CR |
1858 | /Encoding 256 array |
1859 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
1860 | dup 33 /exclam put |
1861 | dup 35 /numbersign put | |
1862 | dup 36 /dollar put | |
1863 | dup 38 /ampersand put | |
1864 | dup 39 /quoteright put | |
1865 | dup 40 /parenleft put | |
1866 | dup 41 /parenright put | |
1867 | dup 42 /asterisk put | |
1868 | dup 44 /comma put | |
1869 | dup 45 /hyphen put | |
1870 | dup 46 /period put | |
1871 | dup 47 /slash put | |
1872 | dup 48 /zero put | |
1873 | dup 49 /one put | |
1874 | dup 50 /two put | |
1875 | dup 51 /three put | |
1876 | dup 52 /four put | |
1877 | dup 58 /colon put | |
1878 | dup 59 /semicolon put | |
1879 | dup 60 /less put | |
1880 | dup 62 /greater put | |
1881 | dup 63 /question put | |
1882 | dup 64 /at put | |
1883 | dup 65 /A put | |
1884 | dup 66 /B put | |
1885 | dup 67 /C put | |
1886 | dup 68 /D put | |
1887 | dup 69 /E put | |
1888 | dup 70 /F put | |
1889 | dup 71 /G put | |
1890 | dup 72 /H put | |
1891 | dup 73 /I put | |
1892 | dup 75 /K put | |
1893 | dup 76 /L put | |
1894 | dup 77 /M put | |
1895 | dup 78 /N put | |
1896 | dup 79 /O put | |
1897 | dup 80 /P put | |
1898 | dup 82 /R put | |
1899 | dup 83 /S put | |
1900 | dup 84 /T put | |
1901 | dup 85 /U put | |
1902 | dup 86 /V put | |
1903 | dup 87 /W put | |
1904 | dup 88 /X put | |
1905 | dup 89 /Y put | |
1906 | dup 90 /Z put | |
1907 | dup 91 /bracketleft put | |
1908 | dup 93 /bracketright put | |
1909 | dup 94 /asciicircum put | |
1910 | dup 95 /underscore put | |
1911 | dup 96 /quoteleft put | |
1912 | dup 97 /a put | |
1913 | dup 98 /b put | |
1914 | dup 99 /c put | |
1915 | dup 100 /d put | |
1916 | dup 101 /e put | |
1917 | dup 102 /f put | |
1918 | dup 103 /g put | |
1919 | dup 104 /h put | |
1920 | dup 105 /i put | |
1921 | dup 106 /j put | |
1922 | dup 107 /k put | |
1923 | dup 108 /l put | |
1924 | dup 109 /m put | |
1925 | dup 110 /n put | |
1926 | dup 111 /o put | |
1927 | dup 112 /p put | |
1928 | dup 113 /q put | |
1929 | dup 114 /r put | |
1930 | dup 115 /s put | |
1931 | dup 116 /t put | |
1932 | dup 117 /u put | |
1933 | dup 118 /v put | |
1934 | dup 119 /w put | |
1935 | dup 120 /x put | |
1936 | dup 121 /y put | |
1937 | dup 122 /z put | |
1938 | dup 123 /braceleft put | |
1939 | dup 125 /braceright put | |
1940 | dup 126 /asciitilde put | |
37c41ab1 | 1941 | readonly def |
37c41ab1 CR |
1942 | currentdict end |
1943 | currentfile eexec | |
45c0f7f8 CR |
1944 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
1945 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
1946 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
1947 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
1948 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
1949 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
1950 | C01924195A181D03F5054A93B71E5065F8D92FE23794DDF2E6BABDA4215500A0 | |
1951 | 42D1A3D0D02C0C98BB1D6ED0B7791274C38B038FC7921FF1FB8FAE7258C09259 | |
1952 | 4B8E1BD9EDCEDE9ADAD9BD9598EEA9691589649A9A21539161E374075BEE3457 | |
1953 | 689F308A4A7AC9F2FE4B301A6C36B0442FB92E3B002623493DC087800B5A0521 | |
1954 | 0DB96A23175AC584DE166F59142779F26FEE9783E28DE49FC3A8D6583EE63FBA | |
1955 | 610DA773CA18ACE6F64A4867A1A7817120ABF9DE4D17782866E6CB6B65A9F6D8 | |
1956 | 3667C8D3E61E5356E35343FDD4C6436DF73934470916CB5F0ECEA6BFF092E735 | |
1957 | C7C355B56189D1DD5715EC97E50145FFC17BB1497315A9585D713A7A6DFC7933 | |
1958 | 995468EFD0F59E3C15865B87925A3F2930E20D5A35970E2C44F1629FA16E00EE | |
1959 | EE21EFC50D49F5BC02300D0A7BB85E649CB4E2E828C8B1C5469463013E71D723 | |
1960 | 2CB11BCBAC191AC751A2AF7FC228395CE9472DC1809052012AEC2CD66695DAF0 | |
1961 | 4CA04234F0187F4116C93F59A7F1F8123DE87F111853B785A20CA8B49B3B0CEC | |
1962 | B11AD345E1A11578D2EFEB0536D125237086CC8CD9F34A5137AC5DDFD8746014 | |
1963 | D74AAE8239B81ACF65F379CF2153B06A238A2D767F294CAE0D79228F0B7D45CE | |
1964 | 510AC9657A1776202FEF42F96D476E7DF407786AEA12DEA0013D3B4C5D0640F5 | |
1965 | BC5BB72C34066270399CE595827175B23B25072723BD24E07F6BCD9EF0175DEF | |
1966 | 93714BAA53960F81103CFB731CED4A267B53727BCA3C97B0BA5004055D4EF0EC | |
1967 | F725658E53AC86E4061B489AD4154915C3981B3B703E1E2A8D390CCECCA99385 | |
1968 | 45EBE35441B062D7D12DAB2B31569387187D74A4043FD71F1C6D352EAE0F6757 | |
1969 | 4345FBFB6DB15CAE47CAC4BAE47AECAE5FF5EC19057DCEFA1B23F47364ABDF47 | |
1970 | 088A7C6A2AE26B10459B6D41CB69182FD1472F326CE3A15B59255D1DE3B616D8 | |
1971 | 9D1F12561038839781E657C896B8C58A32DF5AEA23732A0966D96C68C988ED7A | |
1972 | 09B7E2C8F9F3D0D56879764781566299A4EDD3588BDF70E3D924D25074F30988 | |
1973 | E35BDD827AE4D0B4A06F55A9976BF0DB3C0B1D09CD08E8CB168B50617691638C | |
1974 | 0EC1A791C228177D4FFB021EC3DF5082CA3487AD2EFC8DE9466A690ADDB4C52A | |
1975 | FE2A6DB4CC275CD33D9136E735279FBB2008D59E667905EBB04326EC33C98B2C | |
1976 | 94744B7F540D86E90DED64572ECF1EAD3A58EC101642B245A9C7232DC8FB8741 | |
1977 | 03F97883BB32FB955C22F878FA0FD114451A3B3859B0B5537AFAB73AEC7DB2BF | |
1978 | 409E1FB41D473714F6BEA73CB085139879FA31710E01915C2938C37BAD6D7D71 | |
1979 | 45B897E00857D3931A489EAC7B42BCE4E65F73F67FE027CE482DC47598ABCB95 | |
1980 | 39E98DA8ECA3E23F0799D5963ABA6E2984DEACBE7B46B40ADC6213E0F4D08971 | |
1981 | 58F68C946C748E4B4217CBA2391BE2086C9758F4E32C9B6413E48D84D33A6E85 | |
1982 | 84747029C0A9C9B92841D217A902BA8EB333999D62FDA9F82BFC8ED11F67988A | |
1983 | 0CAE42182E414A9766AFFF4B046A09D476F8E3F15A8C7829BEE982D8350BDF5F | |
1984 | F215F2BBBF68D4B567BAB798B9604C79306C475926E9FEC0F07A99F43473C6FD | |
1985 | B15AC29C3D07FEBAD1BAFF75AAF2FBE94F104F1DBF838044FAD94B661B06AECD | |
1986 | D9AEBD02B60CA4546DD6B5B5C1A3833ED07845671CEFCA8955CE0DE5DB8FC93B | |
1987 | 3306683CBFB8E5B79A863DE78D455DE9D592043C2686F88A43140F8B9F3B553B | |
1988 | 7047420E93E753829F8D47AC7621CFE3626F271E31F0019CC02D0B57F67BB47D | |
1989 | 8CFB63E902EA3231C00EC66EEC0D30FE8394558BD3535C888C4CEFC6EB72E737 | |
1990 | 712ADC6300162D5D79BEE0CA1F6E4127A0BC90656C01692F6D82C85550AFC97E | |
1991 | C2693E379160FDB9636FA41AE9C75B7F6643B05971C6D67CE30971D590FC07B3 | |
1992 | E0B36B4D1C7F25110B5DA2130D574FA292B47322975A2BADBDB39AAE69BDDBDA | |
1993 | A880F9AAB580117708C79204DFFDC08BF4A48919B5C22228845CE8C3109E93AC | |
1994 | 2479E523B8A1C12A6E541118F121DC6B4EAED83491A03192D5C3A2A45D1A2467 | |
1995 | 757E7B377C635CF5CAE11A7CB49D49F3A1BB2286090B5F0E4F89869D1771D50C | |
1996 | 54B5C5E091E3048A2C194F0ED00DD64FB95BAC6FA9D61ECD093ED416DA3A4981 | |
1997 | DB07CFF17C4F55C62DF628EBFF06FAC3F3D3F91C30EBB34052BE1A08F5EDA4B9 | |
1998 | 08977197950A282B84E21D43C64BE3AE4BCE22C70E7D392DE09D89B7F23351AD | |
1999 | 6AD37225C12BA79EC9951F5DA1E505DB26200190ADE0E549305B7530CB86EFD2 | |
2000 | A896F13A97E51754F70B609CB4511CEFC38BA579C071E9510A49982389980DC5 | |
2001 | 336D6C4A2DB100DFEC4055C7AA9C55880F94FBEA9EB280BEF66CB8E1E38A359D | |
2002 | E5AFB12B540CD599085ADDA7FC2C72E7C873015773FFEECA2C596B75BC39A3EB | |
2003 | 3C43FA2E53C0D7993042F3D652BCC483E48B7F6C94C3FF6D38E276086A6AE67A | |
2004 | E5A571B9C72E0D7824E0BC2ADF51A393B9E334649F786EC1923C854382B89627 | |
2005 | 1B9E701AE5A6C42E672B2C6A33C8BBCA8F69B9061E787D6B92183F20CF4C3903 | |
2006 | FF5417427B84798C82BE28D2C81624E3920CA61EC9EADB364B5A6E50E49A1A72 | |
2007 | A9A090A1FCD84814B8B2708AD787D2B5015DA1305874F58C5EB62F843685FCB6 | |
2008 | 465FCA80176CAB2B2FE65E0A270BCE1E3DB97564BEDFAE5CA44395A8DF4505C0 | |
2009 | 3E103CC3B914359B2870DA6CD30382EAE8949131CFE31E9E75C3E47A3834BB32 | |
2010 | CF183D4A8B9001710D0A11390C9DAD116196568591D38C2AF4ADD852F31494EF | |
2011 | 573462759A35415900360882739789D6B89ACEFA251C5ED90ED704DD7C3C80CA | |
2012 | 9F6CDED69537D201D520C99E69EEAD5D3C0EB84C166660B3C190166D93EDFE6D | |
2013 | 15BCB6DC5CDCA825E48D33845CC2FB15291AAB823F25CF8BB0A1EAED8BEC524D | |
2014 | D9CA016027141FAC9D35B64FB9C224552F29EF6B32497254E319090E698FD8A5 | |
2015 | 15491CDFE1B988C79A0E3B9D01E12FF084E9FA86CCAE02A3EE6F2917B61A2CC1 | |
2016 | 64B8CAF309D1AB48A34227A7729DFF99CB6EC282E3FAEDD2673779AA7E4C1789 | |
2017 | D93FDC37FE95F087C5F88F53D30A2DA9C913BF205FC6BDD060A40184F4AAEB3C | |
2018 | D080D63B89CA3DEFF310D09EF0A83F3914BD5B7932980ECE139EF0313C20B4C8 | |
2019 | 576EE0FE3F28FAF4D3CE7CD0890BC824A85B8EF4636BDF1EF1BB519F93D36540 | |
2020 | ED09FAF93FD71992CA2CE2E83F5355162ECEB32AD218092F45D5A61A44E67135 | |
2021 | EF0453589CECDC6962D0E8DA7E7567603BAF50B2C8F1CA65EA5320984E7D69AC | |
2022 | 9A7D3D7F92565D79E8C9DD2D92CCA7DE9CD058545E9F98AA47904D70E1897099 | |
2023 | 3C4C852B3BA131DDD348433C336BDF5FBDFB62120DDEAEB3255E3207B0C84A0A | |
2024 | 1ECF9EC869DB9BFA3693B03FCB27C5A5D3CDD62630DEDE91B4DD5B9784BF0BDD | |
2025 | FC6EEC3FA7ACA9E15FAE47CDD9B7FCD2BF0EFA10716F08C0AF25FF67CB6F9598 | |
2026 | C607D2FCA452417D2C69DC808A9441A66492394C3450BD30632AE739EAD654BA | |
2027 | 4343459CA36B6D5B2C12C39495952F2EF93D82C73E33236785A79609E260C4E0 | |
2028 | CF3A3C950DE71DDC3939D42DB1CB1CA917CEAD56979A70F8F3B207C805319FA7 | |
2029 | 3C000AE2B21D711A6D78C7BFB901334DC06F59EAB6D94B507734C27971F8458D | |
2030 | D00193645AB92FB8FE163D5C51AE4F40BDB4F2C51691E76EE0636F071F37AAA9 | |
2031 | BA78BD12459CA499210EB0CE2F8BD317387797C33F5933AE7A6264DA06B4A6A6 | |
2032 | 1188326147A16B205D1F965872DED7D8EDB3294FAD2FCDF0D423329E9CCF879D | |
2033 | 4E0B966D509F45527F7609DD09694D286F6FF7535EF8971B7DFBAF608A19D442 | |
2034 | C133207EB1152ABBD11C455D0977F66A9B73E51381D1CA4B66E87C0C7175A63D | |
2035 | 80C699A052F00C41DAEF42E7A40E07B1B14107AB0787E24E17C1462960E3C54C | |
2036 | AE73BE4924464FB177EC62F116B2822842541543EFF7ABDDEE197D6BD8F8D4E6 | |
2037 | 59175D8C5957550B70BE775AD52FFF6E7C00DA7CDC16E1DF7446BB5D8FD82647 | |
2038 | 3E9F87D5EA365C82A2D991321ECB14A9E3AEADC5A56665DF7072D6DAE402BCB6 | |
2039 | 14D92B17F9E063E4E9D8D239C91F5C7C0BCD2FBD936C9D4A0B57659420343B59 | |
2040 | B395BBD1AB5B6003F653699D57E7581F9813CC98D4F072FB78899D6DECC42D34 | |
2041 | F2787EDEA64058B46C4BFAA2BB96E9BE5CACE8D91E4C080ADFC0FA0D4A29C6B8 | |
2042 | 54FEA9E11DBCF53D9CA40A21AE5076451EDAB3593E56B6D453DC8EAB8C78B588 | |
2043 | 34D4C4F36861B5649BC1E9F3091E704BDA7613ED45C911DFECA74EEA05165191 | |
2044 | 825F95A947CAF382FBAF01F3B8B041ACCDF39718D7DC5BA6CA12BB20EEE96439 | |
2045 | BF2E2628AA3BD2C91998E6247A690FCB0CC95F286F427345CC4F1115BA3A6E54 | |
2046 | 4743355F2CC991CBDFF5725902C1F5A6DEFDC8638A26EA456C33C27773D6214F | |
2047 | 66536CD2E44FD253531732D5A8C44B336B1BB47B0477350EB8CF74889B93402E | |
2048 | 2356A9CAAFCA562315D8E0B3F42F08932CB87BA2499A875AFA08D11DA73B38AF | |
2049 | F46D03B7F639A8D7BF88CF07FFF4E91716DCCE6E2CCAB60A64D5E40EFD8B336A | |
2050 | 1BFCC4CB04F49DE1FBDE7AA5B2092A6EDBD913D161A3271AB6411622D0E14416 | |
2051 | 37F81E0102F5B0F2F9A2B27819E4BACD7C50E29D6291AE5B0973C657761545A6 | |
2052 | 741729620EF2BF1046B3913399C10982EE5F4142CF461EA31042E432CC79A1A1 | |
2053 | 39C607D22E45A6DEC008CB4BF6007CDE9DD5802B49A62C8E02A6D448B64177CC | |
2054 | 887AD71D171B99E7ABE2085B37D90B3BD8513995D9A57F53184DA474F6DB5E49 | |
2055 | B73E04CC214EA5398DF7D7541F94E623E8687B511640457A48A68E9D9D6584CD | |
2056 | 15B57CC044D8091C771D175F2EEDD411099BC8F7B4317DC503BB5E405AEEB526 | |
2057 | 5E6E1B1F2705275D274E012A98F66075CEB90AFC648B964DDC0E9C4AE7B24CE1 | |
2058 | 80B051022E5781A533A21DCFB97893847D685137EAD85BA708A7E118C72FA839 | |
2059 | A9E460B5D17365A0AF1F53A98319FB64A5819B087F554BC056C4BE44113A5404 | |
2060 | BEF759F890C1CA5E7AE156F4F8106FDB4F8DFCCC640976983EADB30976344048 | |
2061 | 2A86D7B2AF4A01CA736B98D52ACE392AD4BECE7E61C710B08B66F01857CA460B | |
2062 | B8376E257113E10F6DEDF14CE2A4E6A99ECBCD302C36CADB713D849EAE9EB598 | |
2063 | F29DC98531D793B79F83091F9B136809E006F34E423D528CC4309AFFB3EEB47B | |
2064 | 9A9DE4D5B25CE953345C326BCBE2B4912641780637783084D3D12693F8135483 | |
2065 | CBB0AC4EE0B5610D7CEB7DF205830BDB9BB404DC1B28FB0824CC187B26C19A91 | |
2066 | DA0025EC739BF3993700101D042DED86D67F5FB87912CFC51AA7DF53F2162D62 | |
2067 | 6314A2CE13810D0B8D81F45771391A236422CFA0F35F7A0CDF14ACB2724AA57B | |
2068 | 7C2C28D53029B1146558610E0CFBBF72A85AB9BA308F846228F299F13F68E8F7 | |
2069 | D963B2EE9EF7D4C21690632B640BDDAD0556EFA4EFBF035F13377ABB5CBC280B | |
2070 | 9E0C12AACB153C93351E5BA95A7D149010E204950A59C7FC6581D9703468C1E9 | |
2071 | EFAE37E7E6ACB892B3F8D1248D9A4A72F642FECC5E0B25C15EEB921EDDE84D12 | |
2072 | 0E524FE6133C4921FF4921242392C12FBE69744D53739F7E849C1B96C4020AB2 | |
2073 | 1FF10DEA608F111749E2FBD8DBCB17F353DCB3075B4F4B8186963EFE95A76A10 | |
2074 | 85AA5BB6DB4095291974221829A8E436680F4860E01C3843BE5BB3101D0869C0 | |
2075 | EFCE08D187BC04F58C7A450A59093680A0F09E8E3F12DF5223E7EAFEFA01978F | |
2076 | D8354753A68022CC92C71F2CA732DADAA8A466D4AAE5999B0DC077715671F518 | |
2077 | E6277741F44AE798EE50DF44CCF71FCF8BC71F76374005FEBC4883C6EDA854B0 | |
2078 | 88C0C2B476709AA809ECE41AE786DB1A32B3FBBCC14921673578D3514C8CA842 | |
2079 | E1FF90BE33F7B93ADF6BFB8B1AFBBD080783BEF056A6BFAEF676F7BF9F2DFCC8 | |
2080 | 01D255A9F0391951210D60D4D4DCA93AA858B38C0D7B8FD740D5FC6F277C2A68 | |
2081 | 54CC2DE1F40B6347201FCA2A0A91822708D820CE645C3E4E5A09FE25721AB33A | |
2082 | 97871ED448F38FC5A349D81F402B34461D840D5768BFC6849439AB6115104F78 | |
2083 | B87115B1DAE12542EA898F86ACE247709817850B067F537E6137196101D46DD2 | |
2084 | D842EA03EF4501E34074E8458E638ACC4EB349A7430AB035BEF2DD4CE00554F9 | |
2085 | 18F9FE32A55AC1E7E50D64AAFDA278D77A7149C59DC5B1E3064A4B281A54C9CE | |
2086 | A5EA94ABEAE4C6D5674C208ABC72563976487136AF2E21F835BEFD232D7F0D13 | |
2087 | 1D19932367F51D5379934DA7F1635AC51EE5CEBFA63D4D32F018DEF13624EE62 | |
2088 | 31DAE68A08DBE3B4FDAAFC75291C8C6CC7A657E3C7453C7D1461A36E88E633D5 | |
2089 | 408253B673AD87A9FB2D0F56DF1305916D14D5DD62051E27BCE09CEE9A1F14AF | |
2090 | 1D7164BA5FB6E6EC8D38750F7E28BE330909F303ECDEE692E347DE13C8C2F82E | |
2091 | 29C8BE6EFD76546F362A12A1C2DC12389EA95ACB4DCBE95620F0C193EAD91B33 | |
2092 | BAAC5801AE827B9AB3FCE5D11D1D7854F8FA8A31670119CC0CA98628F801838B | |
2093 | AAC7EF90AC5466BE69CE3E3CD9951A5EB9AC08014285422F6DA6F6E221BB30F8 | |
2094 | 0042A11F2E4B765BB0D142AD52F4D85785EA71B2E1CE20728B9E9306CE93268D | |
2095 | 99B822A5AB5232EC7E26EE1160850AD3905864A01357F22722B6A54D4EBE58CE | |
2096 | 480EAD9FBF068EE965AC4B5FD2FA8CCB91ECFC6E90B9C49268CA0B0FDAD23ADC | |
2097 | D5A74B41149BB08454054C451AD0DA4CCF8B60F2EBD061AA03A011D548B6B481 | |
2098 | FAB00AF9225BB5463F27FD67333FB51F8664536267E95CFAA0BE3BC1B8F889CB | |
2099 | 587A3A4FA2B45864F07E11372C9507A625C0030EF7030A0B4D931BCC48F6DD51 | |
2100 | A4D1F63FDC4B59C1CB18E6242E9F4B4B8AD9755B870FE60D640181FB7EB8120C | |
2101 | C56F51DC8C47FCC6318C2145EDCBEFA7BC4253315BA67FD2B3D4AF6A9F3F229C | |
2102 | AB75B592EADE15B1FB5FDBA1C0F786BD21A51506B7A2E42C2D086BA6F84D1B3D | |
2103 | AC7531545F0B01346831FF36A52CAC1E390F99AEDC265B44B0FC9C581BBA6BE4 | |
2104 | 48B723811EBCAEA5FEFAEA7E5B987F2C7B3E9A65D2D14A7B74F099401C57E367 | |
2105 | 385352D0776D2A908F7A5A2E4D4160946C5591397877025C8C387CA413EFED56 | |
2106 | 8B142E8341E349DB4DBA422A4FEE56A573972A0C66590175158E48850A9F7F38 | |
2107 | 4B95726787B8F969FDBC97491CC81CABC976CD00A27D1DFCA7CF467A956C1C6C | |
2108 | 839817AEF8794B6151FAE9261119DD5DB787DC9D3B420FD325ED6599FACADE0C | |
2109 | 320D54C2E0D296537E22C1783670A9D9BECAEC63853EC2F05A990260DC189D63 | |
2110 | 7CCC0BDDF2CF7585071ABAC14630666737041194D0777EA4292AE60BD7F7100E | |
2111 | DB568C90F0D899EA006CA423CFFD6EC70A5D3D8AC43C747DBAD3B02219E47D8D | |
2112 | DE030631F4678C357A58ECC52782B31B50CFD44EC33F41585E51B27E3997D33F | |
2113 | 461BEF897220AEC80007F13C5A1EE3A0430CA899047DF944831F8B010A7DE74A | |
2114 | BFD26001472DC00CDC9F17CC435F61ADAD4E9AE062ED477FC621FDDF9242C449 | |
2115 | 1BB3F77FDD1519A251B663A693D84B42BF0962F537757F38CE5C5D56B98AB10A | |
2116 | 3B70C8AE8D52DCAFCEC22E7B09D3C4EFDA1841C74CA975E4F8294F7BDC796500 | |
2117 | 0ABE197ED3737A65F7BAE601C91DB3983EAE11DA3EA18ABBBA3650DC361C2E77 | |
2118 | EF9F97618B0C337A906FF39926D2B0B7883ABBA650816C4C6B34EEA836994EEA | |
2119 | AFEDDE56E0099D0E09EB88EB093544B9BF4871200746A0409C475FC4232A38D8 | |
2120 | F3105B0FF44E4F132378DD12D9E796412FD0F9478322215E9F59E69396C35AC4 | |
2121 | 097C4995B2C3BAB2DD04B1A7097DE16DFDD76465E79ADEEBA90489ADD0914EBA | |
2122 | 53E11A43ECB11D072C68D2131BE1C7C43CB9DD5FBA0A67BA43D6851AD4CD3BC7 | |
2123 | 39AE2E22CCC183A56CEB71D4F9F578518E376426E42B6390426A8434B5A83E78 | |
2124 | 77A5B9963BAECD5FA5521C2A29418764E4EC1A72462B04957F823E2817A7F8D0 | |
2125 | 1512919889500024B1C42EC107E8B8533C0B314EE4E23313A4C1BDB009A2073F | |
2126 | 9BAB479A3F9DA76CCD65629CCEF78015ADBC2D0D124B3BB2D322FC4D209E417D | |
2127 | 84BC3C758B6AB64A01E25C9C7B71D741AF90A19A339F99A0BE9FC39622F04C6F | |
2128 | 737474CFEC19C890A657BCE192B9DCD8F273CDC5294875DD4507DC5723EBB357 | |
2129 | 73DB0933927DC21081E67E5DCF4E41FAA6E00E8DF04128F86348FB0718068FA9 | |
2130 | 918319C4EE9D090CDF348153B6CC48648C55E889B4FFD3D75466F1B50C437546 | |
2131 | 7DD9CF20980B148F60BB146402DC0732A27F255DCB859CFB6F9D329C12FB14A6 | |
2132 | 7824D6DE27B03FF85BC59703A5D6C5B7D1CEBCF3C3FCD71D6D6F0311E41BF8BF | |
2133 | 0609D23C84720FA9EAC961C9D49C2E962D9618C32BAFBAA8CAB0B2F616E57DA6 | |
2134 | 8CB44C5595A22377B28599F7D34A3BEA4173E1D31A2A6C5670D1F026EE2092A1 | |
2135 | DD0D2BBACAB46E5B0A7113B1BC379709C5870981E482E01EE3D16AF9ACF1A5D8 | |
2136 | 7ABDB4BA5C3B13AF047826F360C8892642B482C3C61FAC97F332888AE156B35C | |
2137 | 5C8415A75B4F0F25F8E95BC4102FEB4A8287C544C99778EB0C163C22481F615B | |
2138 | 0004F764FB7CCB01AE01A614AFC9650D3934F748E8785416BBC89F66C696AF5B | |
2139 | B5F6F125F115241728D85E7159FCDBB10B64598249BB0E6FF1AF845B0A2370AE | |
2140 | E6A973023FCAC4BB6158D48B0C928ABC4E29A0DD611D0F5266AAC8239064C266 | |
2141 | 82D4D33B032418967406BC98156CFCE1F091F733D8BAB9523690B4D6765DBADC | |
2142 | 210E814DB8715A269474EC0501CF66FA0D8FD224EDDE93AF243032E73714F730 | |
2143 | FB382372C0F9B9372450FA6F13689C9429EDE1A105F234B216263A7D0A917A15 | |
2144 | D1FC128580A16B5572436E398C353A0EC62539CAA188901FC30DF7511C1BF6E3 | |
2145 | B462203AE937653C4562FFFF03078EE7A184F554E6F01932AFD07722A00E50BB | |
2146 | 2D2BB785961F76273A16CEEB0EE833DFE14BBA539CC7E48F67A9D20C94283137 | |
2147 | BE84025E86C714DC9C6FD7CE4D1D0C50B6EDC79E066521FDFAB6285C83A68B4E | |
2148 | B1A119875B4E45BF5403950A25286214CB4183C345173F72E6ACFEA5C13B4D2D | |
2149 | FD12BD235193EE6BB66519B553CD963EDD68E7EF9439DF0411C8193ACB183C09 | |
2150 | 4143657304B1BE2AB8D2D0203E677FA1DD01152D2ECF9D987B16C3FE0B3F5F12 | |
2151 | 5C920243E1CB5FDCBE97DF55102EDED12811F3F7165F4FE1F6FD5A6BA809824C | |
2152 | 041FF9441529509EF4442EA873E8E7FF507607D526DD27315859B31D0AC11475 | |
2153 | 53C573EBF9DC37A4667133E99D8AA608ACB729F90B736395211043CCA3272AD1 | |
2154 | 470F1EB485629AA8B9DCB56479F734703D859F1E4EE8789FD6F739D0122348F5 | |
2155 | 1D487FAF1F24EF7A14CF69ADE7A87550F55F394506BC7627A5E319B30F362528 | |
2156 | 8AB497EC03B69B58736A5EE0AD63743E7F22125536104674EA63F9AC5286A746 | |
2157 | 47C73EE8E0320E7DC098CF43F23EDEF32D213523125110140F46202435EA8E79 | |
2158 | E285C7F3AA0C5877F75FE0F16BDF478A00A6F380C7B677BE479FE900ED3C4A0C | |
2159 | 832966F634C63211B58E9AAC3A3346ACACBD040164B491287B45E0131479046F | |
2160 | B430EDCF59B0DB6B0594775AA57CE029EE8DC445463169EA976945A5765AC390 | |
2161 | CA615933FD05173C47D30DD5CCBD56D89B4557C7192C31D7B500B779D7DD3707 | |
2162 | BD4B64980767B6C9A1BC9A948DFB8518AEF581A1D888C6F767F3315EE99F57E8 | |
2163 | 4EAA54D04A3A9E34B100024AA7C49DFE273231E3DF17073CCAF5B0EF20566755 | |
2164 | 6831F85C57454D1B0A5A8438EFC7F4E396F09CC200643564BADECD2208915FEC | |
2165 | 78E94025CEC8ED965EEE5F6B8BA081478231547355F93491915CFC4DBD619862 | |
2166 | 0F99133CE7F44756C593C8DF1874E973237ACB17F9614B79D45672CF62AFE009 | |
2167 | EC61B395BD96B0081DE750421A41E9D474F0E030C6B8591D364F29A6D7246EF1 | |
2168 | 6B4CF9B931A9A474011C62D504F408651692921AE83116CA0E4E6F41AF877FC3 | |
2169 | CE77764197719291E68B01570AB7038D91B8B81EA501DCB5ECB6083B6764BE3D | |
2170 | DF21B4B3A1E1A5C917F324A1CE5AF92BE3B2F8634A140637425F9BDFBD21FF33 | |
2171 | CBA42069981B230D211602FEF410EFDC199B6DF283343FA5E6B4FF2804DE56A1 | |
2172 | 61DDC684579F82C65DAC3A4F92B34FFB6273EF4F4591317B8D2250850BBA236B | |
2173 | C1E36185BC3C8C7A7654B24D7A10A489BDF675F6EFE7B4253F14CB3B5ECD1756 | |
2174 | 1882F3D139EB5EC7860D70A176D1536F5119A6C23EE9AE9AB21B586DA19B483C | |
2175 | 6BEBA87C457B9DE3D7C71DD7F97E352B642D84455E44EFC54417ADBE7E190F7B | |
2176 | 7ABF6FA0EA84A394C8316BF420D6E2DE5B867E6D602365925C3ACFC69ED653A1 | |
2177 | DA30FF3B49D407237196B9401B1EDB7EF2260E582D02B18EDD38AC0016F28896 | |
2178 | 0A61CA720216012D0FE2B58D5D675D25A679B1D70FAC10A4EB38060C0BB1AD1D | |
2179 | D1C59BD5F44FDD8768EFBE75B6795543533C02198E21A4B8A5430C2C432E45AA | |
2180 | 0C0937D6CED532EE6714C58ADFE2B15B117E9AEDFFC1E172716C756260BA9931 | |
2181 | 23AB837CCC7C36BD6B86B628BAA7D6002720AF00411E9D039E435EE479D5015E | |
2182 | 23DC9F3993546E50A442CD9D0429F7AF22D9F14064CADF2A3062F218582CA520 | |
2183 | 3FD8E0F30B224408594EC426C8DEA57ED60FAB24461611E86302C421BA600CDF | |
2184 | D4EDBF4044F0E2893143D4BABF0A6AA09F28FB4190B779B82A61C65264A199D7 | |
2185 | C2F50BD82837F08970F630E1CC74B4EF421B1032967FEF552DF3C1C83ED995BC | |
2186 | CB9192ED8AAA906CD9708A4882150B27B1E75FFC0D1383C50BB3E6C36F5CBF28 | |
2187 | C0572BD2F01AFFEE5927EBE3B6CB8FE778ED2B524E252F59AF00A3F8F880116B | |
2188 | 8EA655D9C6A68CAA28DB7A75003D0C3B653C7587BD1A7D93BE73CA6219024EA1 | |
2189 | 07C31E7F7BC9B874183C9337538C925226CDC48FA25D51A6A0677A2BFF699AE1 | |
2190 | E28D9E58369BD6AD73ABA706531DE565E1984A9C89D0C1EC6FC030A93D3D863F | |
2191 | C45EA66F195CFEFF9A03A1673BC544FB4F491AE5E50ECFF7F34B095DA96288F4 | |
2192 | 31C02347DCB6792ABE9DE684A1A92318A2BDA38C2D8DDEF29B8FED450DCDCC7A | |
2193 | 5C5D124FF0DA047D37E8874370D5537AEE869E771835EA607E1634BC0707C0FF | |
2194 | 75D5764B867BEDD8FA075F0CBBA7191B3CBAFC9EF8DFE79E9D7FD5A58916101A | |
2195 | A920F37BC5EC845621EFE3A953C19853C2989FD31952FC4876A8F7C58C4F21C1 | |
2196 | 31E6ECE0389BFDC8D6E391B04D443EDEFAEB77985808C398583BC4D8C9979A38 | |
2197 | 9842C4FCB7A4E84BD67BE72551A43B2B330293D8655A3D6655A2358E014F5686 | |
2198 | 613D19B474AE0A92A80E6E701F4B63EDAF59C3E12DD961A5B413FD1CB5400743 | |
2199 | 91F673B3502C6FD90A1349D649EBA4F5D8A6E5AA41F1A4DE1C387E22C9CC2733 | |
2200 | D542291D5B2E5CCD0E1FC1835BD6A74F5DB97FC174730AF33CFE5E68349BEFB6 | |
2201 | F2C76171C578412F075F9730567BE7A2644B17012DDA04D681018CBE09BDFCA6 | |
2202 | 1BB460699CBD6006C031A02634BE0B16375FDB9C582EBE6683B60768BC3901E7 | |
2203 | 4388A7E058B61713E3046F28F5ABF58417DA878E1870787C472FA08C2FAC7517 | |
2204 | 4CE71727BB69D19BB40AEB50F1BD66704EA37D2A0B82F60D72E15440BD27064C | |
2205 | E67CA41D97349309151DA28E1A7850587569A794E9FE46848A4611066291973C | |
2206 | A6CD19857B92F0E36B271F24D54ED663A7C64DE3534B0989D41E21E01469AD69 | |
2207 | 916AE35C5177C6BA8CEDA45C92694077DF3EBB0377269619F9925876919A472D | |
2208 | 14751E6515118EF9B84A5DD8C92695818BA4C959485EE1EDB6C6D3553B6FBD27 | |
2209 | A0FC42DDF20BB335F7D46F0951C51E9BB69FA6E7C76A8C960FB6A4305FDD2A30 | |
2210 | 234A5EFA64C34948422255C14C2A0D8A57174AFB7DF3DB2F520EBB401CA2DD79 | |
2211 | FDF6C624654DFFCEA8FCF5B34C34CAA7C6EAEBA6DC98E8557042126E49E51C3E | |
2212 | BB7C91497A44A69E4EBCBDC0656AA5A7F419D0443576F530C8136AE8612589CE | |
2213 | 781205654730006F3A39B4F3E5301784F164A2C87C2F86C894EAFB5E79D7231B | |
2214 | E410219BED0210BADEFCF27EEF683A01FE01DAB70AC8DC4E82ACCF6B5BFB4DAC | |
2215 | A42AEF344755A06DE8A6BF6F2786435E2EB1D103C8FA4306573BE699571880DA | |
2216 | 53548A1FC1F24E50B3C2BACE9261C0245F671694A0FBFB4ADAD535AB9949C020 | |
2217 | DEFE36F7EA12B3F8D80E3E3D7B3CBBD8B6EB0AD2573DD5DD0B4FABBC790C9F28 | |
2218 | 428B33CA533D5A6348D1A64D868863F4385A3F19D9F4766B6B81CF634981090D | |
2219 | AF0D763F09A2919A9DABC0DC4602D72F8747176F947A92077956FF59FD0D88CF | |
2220 | FE224B9B16C5DD710E6DE3B94D47DED695BCE5414A3794E4CEB7845915272ECF | |
2221 | E4A657C7B53DE7DE96A8C901DA24D54A467EE083181CEE606E5917FED2C97728 | |
2222 | 57887C7D19EEA950AADF6E8A99798789757BA126D925E330BB7D931FDF4EE14A | |
2223 | 04F58858CE09DCB1F57B8F780DABEDD1C26D72C9A5287C9DD30365693C5DD06D | |
2224 | 7365B309AF1C97BD3443B393309929F6D1AE27A1CB55C2F5085EE81928E138F4 | |
2225 | 4FA21E90C89F0397C9CDB4D707780F2418B38D8A8D76793C868D4BBF10AFBCD2 | |
2226 | 9BBB8202DCC02C37BE63D3CD22208A23743025921A54307A72037E6356EF807F | |
2227 | B2E7DF2B94C51F19895C3C059DB4C42C2DBF4E08E27E31A294B580E2367D2F63 | |
2228 | 0C074F03DB73EEC7293AB98DEF387B3C18761C716EE02C95315A36D42BC5334D | |
2229 | 984E6E35587BC0711D1B7F8EA8656C8059683C49CA41B0520D6FE1952A1991DC | |
2230 | 659D83269307EAAF5A9CA8000FA086B55587FCD0C798FD93905B1CD88A9AA33E | |
2231 | 9DBC2FE2A89CC800565567422052BCF5BAA443EB441E3B7B6AF0322014458764 | |
2232 | 7AAEF162D0E03F28F1D0A0EEED8714442E9DC41FD4B90436DB8A7E3A9431E726 | |
2233 | FAC0CB7151B6236B2438DCE9EE814A358DC10699244FAFB932C928E0E878D91E | |
2234 | 36E840135A9F372A0DC2EECA730E8490F4D42DE218150497C5EE87A5FF5C2282 | |
2235 | 3AA9D4B71996F86F8BDA700EBC01E3054459AA3F87CAB9C3A230551D4534C3AD | |
2236 | 18F6C76C41E10DB9DD67D19614A516BDD39C432005676C78B36C53BDB3646934 | |
2237 | 3AE6BC84D339851BD4D07CEC26129467C7181760DE58D0A288FF1F0DEE52D68A | |
2238 | 8423FEA92D3D9331F75E3B062BDB37BEE45D5C338BFC462612D1CA5CFF432D7D | |
2239 | 89D34ABEB9F42CB40A63BBECECACC033538136B3F9B81F1230453A52549B648F | |
2240 | E8AA9EE2B0AE82A1904FB78A6237247DD96B906B82945AAA772DA058B85494B5 | |
2241 | DBF53ADE76C1013C1DCC7A19AA3ADD198E3EEDE3269C4F3A6DFE54CBD17C7608 | |
2242 | 3BF7513E37D9C8D688087E2A09B863882D46454A5B99CBFF538C008FA9BADC2C | |
2243 | 004ED4ECE65C4301862323B134BA11C6D4E691AA899C0E83CEA6A625AED13F65 | |
2244 | 78D330A389A6D6EC23CD82D70D53D4F571C9D872E1A09679444FE686A12647B1 | |
2245 | 6BB67C8AA4D500F6DACCB2E0C682C835D24C646A51259A72ED3E281C93743832 | |
2246 | A51B3B89D38E575B8521A39D87F8105F892AE9BE53FD758B8DBE2021716ACFB7 | |
2247 | 350D5408C621CDEDC04E63DC4468C301435C2C2D61F3B2C24117F9ACBCD9E3A6 | |
2248 | BEA36A9A4227287DCACA0EBB1C6267F23BC0C3E0F28A89184FACFB919D49843B | |
2249 | AEA30EDC40944FFE38FFBD7B33B6B05F5AE1D0E168E924AC698B7200D2E86C14 | |
2250 | E79E6768E27E848768A75DD694B48FE4839058824A9F5C472081962020B96FE8 | |
2251 | 45DBD7153E2086C2DECB97B99850286211660573EB090E315BD727C989B8FE41 | |
2252 | D25635F195218A2F15FE8A5C5FAD2857F75969D1257158EE5C52055C1E11D18A | |
2253 | 8770E2DE895D7118B3886FD549441424F56DCB3820D5709B9D838435AAE4D64B | |
2254 | 6F49CB37B640BD905D6C3FC1E53C8304B0EB694269D6C48D81300DD537373040 | |
2255 | 65B95EF64F81AEE581FFAFFF8B32DBFC16B4F1F7FF9DDCE9CF5D6A8A6D79E4C4 | |
2256 | 209E47E16C32343B7D8B65D863F33717FC01CEF14A0F012805FAA46552535809 | |
2257 | 14126B88CCC2F0E276F5EB42E0C7628CB2397645DD951E31566B9D80F4379A57 | |
2258 | 8D10288DD980E93AD47F7F5EB41C4E0DE8AFC5118CFE87A804F309C6A9D1E126 | |
2259 | C0912E55D9B1FA95611FE7FD22C722610746316AA8703953AEE8D52F4B67F0E8 | |
2260 | 1C12A3A1A38B3AFC87E78B29AB79174E1CB09880DED63F5EE28AE6916E9BDF2D | |
2261 | 3DBBF6F8A09A229BCFE45B37D0E28A3A519DD20CD8B7AFAABCF0EEE058EC5BEC | |
2262 | 98CA3FF46CDB8324A5CFD9985AFD545B1425BA1B1F8A3209D159925194C2C7B4 | |
2263 | F353F587F1CEC839996FB9761DA1343F24A17BBE4206324041E9DB6DC5CFB21E | |
2264 | 789DCC82093269E3D2894773C8BCD25DB0D6B3DBF7A799276936132C262C2F0C | |
2265 | 980D6689EBC8459C62E19C91EF5169439185F8DB0946D7156108A689F9B0A52D | |
2266 | 10E02422207CDF2CEF1C2B5D3D50E4D458B4A6C936CE9E6A6C4975AFD8790E5D | |
2267 | 057FACE7B96263BAE67A549B42F8CA016C5EF42B55C2FDF20D3A25A68B13FA44 | |
2268 | 99D57478B9FFB6BACF69CABEA3C64B559A0D0897176CE2BE218396DD2CB25D70 | |
2269 | 59BB599060F97D2CA6422F46D28D3FED8AA36FE161A91DADE4B621EC24BEB0DB | |
2270 | 31FAB9F4B67209C5DA12F4AC49B8BADD510C8226962D4657A80DD7DD49104E88 | |
2271 | A0287F75C8784516C98BD7BD15D91F4513384B46BB097291EF6D6229A529BF62 | |
2272 | 0A5F4AF3C21150A058B08D0B47DAF540DB98EAAFC88E117BC9DBA9AC19DDD756 | |
2273 | 9A90C45BA3E8C37368C7E44BD6BDFD96619ED819CB067ECBC13BE325409987C6 | |
2274 | CB804C705C040AE82EEA129A1A7AD4B7B362E799F2CE5C0390722A16FC60B1E8 | |
2275 | 44B0B85D097AE0D5E08DEC18C3E576E22268D7F0CDA46D9469019C20EAE9BA74 | |
2276 | 7B49EA6166F5AC94672063D25C4C0E8FCE359712939ACEDFFF9AB5E7442A2A00 | |
2277 | A7E7A05E9E10A209672155C03EB12CD5E80155A5DEE3D503BA08D71E423C472B | |
2278 | A74CD26E15A200FBAB8E94086928E73860E50BB7389B3A8E0E833ABAC5FF8C62 | |
2279 | B894E007E5C220FAE6D53ADE85C747BD84D88BD0F40132A0D1FE51ECDCE1BE9B | |
2280 | BD89734A56C3577515520025A7743F45B01D74588DAED6FCC209CC819CE0DC65 | |
2281 | B590337F93D92D71615422728C6A8AA4D357A4E350BF6CE2480D4E1A818EFD9C | |
2282 | E6243B96F72EF5C5E88645A73189D9772E97911A0713A03201A69D78A98F743C | |
2283 | C0C8562CD876F8DE0A488CCAA3EC11142190BC32B2D8FFBEE6E155EFD20BB003 | |
2284 | 055C74D843F2AB34D9552E5620FACE9E40C04DD84E29A602151B7C3352798963 | |
2285 | 94674A8246B77CECFCC9A896B64F296EBD891E669A538343C0394E6634D9BDB7 | |
2286 | AB6D9C584DC7DEDF6AEB695FF83953653CED9E2B7F6E5D2A965B60F1FD3DC752 | |
2287 | 3FE4EBD010AD47E0A9FD989B15559783B429F50B3A70A1D8CFCBC150A492A8C6 | |
2288 | 4F570111E78A66DB463BB2EA226890FC25BD5CCFAEDAB7DEB2D081480821426B | |
2289 | 45EDFD5C048A41F295415C43E86930C53961D954B54F6886044A1C5F6D2526EF | |
2290 | F6521BFA9BCEA510AB3E1731719DA2E83729BD08AA2814663532756B1AC5E199 | |
2291 | 329025C143B47106919977514AC51B681FBBF5B115AB82A15E24C7315091DFD4 | |
2292 | CD11E813DCFB89355F4CFAFBBD54822018E7EA7ACB3A06DE7B571267E0C66BD5 | |
2293 | 6DEFA8A8AED615B9A7F40B138841D094D5BEB32197BF5213BA572AED3C87AC6F | |
2294 | 6ED6356BA2A2B9A3E26E43B3E6780BB66CC93A1A2CE94C90D48ADCA2BE608B64 | |
2295 | 7C0C0410A9134B81EF24CCDC7426E5096CAE44EE96D666A4F3F72774105AB03E | |
2296 | 320FC752F294CA8A537BE8EB6FA85F069E6809553D3A9CB3384E132275D2028A | |
2297 | DC6CE52E75DE9142E8D19C656F7A74D985BEC5367F151A151E5D41346AF70ED3 | |
2298 | 14D68F0C83E4EC225E6F60A48200AAA0FAC3725551B8859AF513FFBE2AB3C205 | |
2299 | DCD56B1177021C5D819DC38BA8A042DB92A0A34224E37250AA0F65707C2786C6 | |
2300 | 189F518C2E635D327D999949C4358402F4EFB6237C8A0A8BBC01E9B01F58A83E | |
2301 | 3BF161E39EF504F2E31BB62F27B4830EAE9B05977DA47EF338817109E0BA1059 | |
2302 | 6DFFC6426DBBCE33297E6D36D3492B098C1691DEA31FDF967BE80808199760C8 | |
2303 | 46E9D075B01F433DD5A43A2AD872061B3852B74BB421B3564E57C44ED0DE500B | |
2304 | D976E02B51C656974673846B1B5E31F7F9EB5FAB81F92F62ED34EA0715950780 | |
2305 | 6F5674E2D6120A4B9B89F749120921EE65043A66F0272B75C05BDDD09217A10F | |
2306 | E9E93E647617CA513F52252556D23F34248D0EBDB3FFCA6BD7C31E3369CB1F0C | |
2307 | 20BF53BDF7C4F7A1C37BAD112254C227FACDFD40CA33EDF4688600E16586A5B1 | |
2308 | D53C2AFEEAA2416B29948B4FA677FC1EAC94B4A7A2AA4EFFA901F90B56BC2F04 | |
2309 | 921AAC33FA46982497BD267EC185F64A2C6F51C48691908568A4F9814175AC6B | |
2310 | E1B34565EF12D99AD27B74481FCBA29E4C58C8D031DAC1E58E24AE5E432C74E4 | |
2311 | CFDA7278C66FE60C11D9501EE25CFB8F816F06D1427D8A8A119F7E9A66471847 | |
2312 | 90BEA16129627D6E12463C9DB6E4CBF9AC20F51EEFC808ED48D41F334115616C | |
2313 | FC0F037AAEAB996F754FA6A8653B8912BA0A9BD0D0EA381B3A54A86155156D1E | |
2314 | BF1BFF694F9EEA20EBE388D4F01CE5117C0EA6E061B807AD4B53270006E6CC45 | |
2315 | 5016272BB7FE8540070D51A260A018E09D9A1C7CB3E3C6409BC1993E59667A42 | |
2316 | 049F2393C872D0E8EC41FBC2671D0F5E4B99BDC5AD13F7B0930B881CC049FC39 | |
2317 | 938DD4D270BA8FD68DFF2ADCC21C7C24ABD1391C947142F1C7CC6E7EE5D31252 | |
2318 | F84B92C304757C0B8394E9E2C2D4DCEBD7709FA645B883D8A5F9657FE6116F2C | |
2319 | 891F3DB3BD7DEA5922EE488678297C5A043720DDD777451AB916FA664519A6A8 | |
2320 | 9BE9214DC67D68FAF516E19E1F65F162C246B6C010911220978C2FAEEA7023CD | |
2321 | E2C2A175D2C79817AD4E4364090B9C6B95CE86840857599448EA77982CDEE30D | |
2322 | F4E739DE78F7C1831B2FAD322EB48FCA0ED8FE56A0BE9E26E6921171C31F8E79 | |
2323 | D5A59BC6225A0AA217FEB684D1CCF1B12E21DBEF1F1315C920EB46163B5C2F46 | |
2324 | 80669943D09CD519256D5A4DE9144FD5103B52774A530D2A4318E9ABFFEF15A0 | |
2325 | 24F0590F23BA7612351FC0BD9E5F9A5A8D6ECB677978C4E2AFC4560986B7A8DD | |
2326 | 0CC30A82C2CBD2707A18D988C164F2B8CED74B1C12991E705F005E3A8D10BB25 | |
2327 | F5A45974096ED5C5F8A09ADA293175C763CDF9C3484C4B9ABA9839BB9028425F | |
2328 | DD34E700820CA4B2BAF969C1DEEE659A6FF568EDE7B58400C07BDA06310B92EE | |
2329 | 17FEF247A7FAFBB56044FAD23EB2933D8F313A161767FE211FC103F392A9A1E8 | |
2330 | B633A259920A15D19A4F5780C09071ED04C83FBAB9ABF344A1B0F1FBD2A96A87 | |
2331 | E03F2785DD00CFD5B3B95736CFE6315E86E8A5E838F4C02B36859AB4CA203FED | |
2332 | 4AB0D43E2964FEF26993ACA619F1CF12D3DCFBD8E50AD02A72A6593EB876E244 | |
2333 | D5CDFEE1128408A5C10B5E70D680299E8A33489E1179FA0F753B7FABBB826BD1 | |
2334 | 39D7F7A8E7C15C359E24B6569640123700FF628B2D76E2B7B2DE7C2F098A7A46 | |
2335 | 8309CCDEA49CD277E96366EF221C4DBCCF17882C4565340EA41EBE83998AC89F | |
2336 | D66825F75F751395FACA772DFCEDA5E3368094CF378C31DF2B405D92690F2546 | |
2337 | AA982FE7F32660E0FB33BF253F632FE978DDAFEECCF840997558C607ECF0CD57 | |
2338 | 5CDB3EE71642ADAC37D462F7A23541F850382BC1140C8437FC62C34CD9BE7002 | |
2339 | 0C136657F2ED4AF914AD3AEC860B2E873A77C818E491440EEE98075FBD7EE393 | |
2340 | B68FAB94C574EC914FAE259B065C8666CBB2D3604F9FFAA52DEB5F157079D53D | |
2341 | 3FBBCC93C598FD83769A8C039EFA0C7BDC027A34721E437E548F120137EC099B | |
2342 | 15D65CF68B5F2E5ACBD11A46A6E2168F6E38DACB52D0AF949B8BFC8AA92A6C1B | |
2343 | E5A362B1B05A46F3E58921F6A1CD4C97730B14D31F0C1E2C132D25B2A63D631D | |
2344 | C65813C00332FB695789D21D9903B3CD1425CC36C25C18C7D49014F85BB771C8 | |
2345 | D0D18204492ECCBF69D97B2342457C95A7CBD46C489690CE6B4A4363653B9D46 | |
2346 | A5A03BB8BC675B56A1CDFC8E0C3BC7DD7E4804E61DD27EB6D25119887EEF49DE | |
2347 | 905543AEA98A60471A3D512D63CFA12F8768CBDCF8F9EDD9AF084027DBF313DD | |
2348 | 059EC75136FC08C22D280B76F1A4AE628CF21DB9A6E567085DCEF55E68812A8D | |
2349 | F72DFBF59786430216884E02416419FEC67428E36B62093250EE61EDA4E9FDC9 | |
2350 | 08F01063F9841E1A5FC54F34A65F738A9E330E8074930BD9E85F05AB0E9DDCF1 | |
2351 | 2CCC343C8BA7619FA512292B53F37BC95635A3EE07C3E4E91B123E2CC34EA9F9 | |
2352 | 123C38F41B1DF9C2A7034BD05D83CFC2B86D69639B8C34940F53F44D5F549305 | |
2353 | F196464989975EF35F33B2B4B52CA9EDC6B32033B63BB03462CC58BBED662365 | |
2354 | 2F36F7A46A371A60B245D53F9A7DAA64428EECD40A8F4C93D460490B092558CB | |
2355 | 647E53E34771DC04DEEB2C285965F4DCF2CCB8669ADB238CC12897F7DF46E6DB | |
2356 | FD9D5BFBEA1DD262C4CC1B24E681643FAB80B34D057BC920ABAED5B39D2ACFE7 | |
2357 | 4CA3A1999ACF8C9AD0F99B12922D37C03D06B77985EF38B3FBCBD6AFD21572BF | |
2358 | 84A7BB8C4ED5C3BE657673F8E9F3A1655C0179A4CA565D3B6F0949B2CBBEC189 | |
2359 | B0B46D5727EA5EDB274B66C9FD872C00969B9C6B7CDC3A8CEC053A443CB847F2 | |
2360 | 540FAE81CBE3F6B306D1B8B913919D1B9FC029CD5D414DB2E16C7EC97F0BC73C | |
2361 | 1BDCD5F3FB0695EB84873FA73629005D7CE48A9A1374CD2A0DAC7F507D3F04EA | |
2362 | A8F71F37B65C4D5F5928C7A59BDB73E1702D4E9508519508DF62DD29AE1209FA | |
2363 | 8766D6311A78B12C830AC0D870CB02DAC0D6434801CB48972C196E0CC92BDDEA | |
2364 | 398622BAA5B384FB8A0396777CF517A08F646774EFD5C6CAB81C37ED7AF68276 | |
2365 | C86AD81C3C41476A6398A6A22D65421526EEC405F6CC9F2520FAD97FFDDBA3EF | |
2366 | 9E8DD5295CE2390650C5B19930B45A410083442196A24413ED58BC3994D003EE | |
2367 | F13DA0A43E7D99C70365FE768AADD61628BDF66FFC0D4195AE0CB7FF33EE475E | |
2368 | 2B0EB97F66B2FE63D3436568729519B2639BF5AD17F7061BF9F8A2EADDC7F806 | |
2369 | 50C1EBC0AF0BAB233868B10EC7711A0C2FFAACDCE3C49D3A0301C49B82A2DD78 | |
2370 | 92BD6740EC601CBD20D460B90EED562B2AE48E55A7C28C8643B4DACAE95AD33F | |
2371 | 27F2CB34AC65A0E62BE71CDC3D05361D1F07584945E4E89514C40D8A3132C707 | |
2372 | A4D56B054572CAF5F12E40406C26E5077C9E255516000F1733B136CA5C58961D | |
2373 | A9B22F6FEE7B57DA278A3F8F2B8A2B52B5E2E1FED54F14AFC9F13B18734E42C5 | |
2374 | C04846F7CEE4700920DAC45D381100CF7D5DF4E601D3B933998D86D5FDFDF666 | |
2375 | CC4ECF675477D74327EAB256DC1727A44C3F7A6A970D9598EB46A5C38E81F3C5 | |
2376 | 10D8307C19D849BBEB0C962BFBB37409195756E505278D619A73140B2C661235 | |
2377 | 2091B4C6A3C81A3F532B8168E69EB1DA998C84834C2C87A910A2A65B264A20AD | |
2378 | 50F7B5B8DDA82DC3F45F394BAAE1BAAF5FE217BB95A30E2164C3193083013EDB | |
2379 | 950B9F2F8559B483BD35507E77A8C59CE5E6571EF07AA5ADFC51C4E54346AE1E | |
2380 | 6E22EE5A58C7B31687B936299B29547E214971677A0D5FDC566E61EA08E86BC6 | |
2381 | 976077F73FBC8EA0CFCA796D37DDF0977130FF25C4791DC6CD5B7450A594BD1B | |
2382 | 291A8650DFFFAB3154F4129AEBE08C3A0F76A61F23A6662795F20B096772DA49 | |
2383 | FDC818E8F431C8D7488139A55443B81474F5D80D63E1CC6B1AA2241C0AEE0169 | |
2384 | 9077ED92D2CB61C71F765AEB0A26665F2677D214B6C5EF0111171B165531D3E4 | |
2385 | 7E9E43F1659A4F3E96BFE53F74D902BCCB2557013D900D19B86DBEE27F12CE31 | |
2386 | A94697D4DA12D98DF2F197BF7B7F6380E1CD7D1F9E13B65D5841A990642DE6F8 | |
2387 | 0F86E9C087D82FD2A903B7C5191D7D87CB2797C3B24432F7D29BB50DE05D37A5 | |
2388 | B9090F2D26B1AF1EF3DF11645E317BBAD8136611F64885A3D635C3C1F1F42995 | |
2389 | 83BB3D6719766FE2D016B42753A30887C1D57DF9CB860FAC2F95BF993EB7DC4B | |
2390 | F61EA29CCCA247F2728D4504648A8EE0B7FA0A766282E63511F89CAD7B612348 | |
2391 | 7E83A9D8F233757716321B251D122D9793FCC20090AB7BE19B1575A3AD6CB93B | |
2392 | 9FED5A9A6CDD855A1F09FCBE5C9DD97F93C49FAD92D3DAB4B32DFAE82E36165D | |
2393 | 5A6BFCE2AEA0F568A481C480D75C1F32ABA8FB904CCBF3FA6AAF58C02B501A62 | |
2394 | 4D6C1F8F690BB4B7325A31B13A712549AFA18174BDFDA6010BBFECCCDFDB06B9 | |
2395 | 406732F56AA41EFBC80266EBF0B9852EE08E76EEB14A276935114FAD24214CB5 | |
2396 | D177262C90AB93798A00D55A152D635C96846D70395C7EAC49F7A750027F9024 | |
2397 | 3781BEE23D56131397B4B241BC6976A4F2B04C8C64EFD55E801D833664019765 | |
2398 | 7A22B810889C096B55AD2B4D8963CE240D5DF0FDAB71E9091A167A80F5A3418F | |
2399 | DF87AA78FFB1EFEBD8A2C97E8E7667B289BC23CFC16F0B138CE179402015CC4D | |
2400 | F36912CAE318490F6A050B56B778DCEDA7AD335FBB6F3F05C526C8B5EF0B7BD2 | |
2401 | DFBCF5FD5C40F39B6A3455B86B34E89060AB0E6AB96C3914019CEE49EED033F2 | |
2402 | EE547725E1EDD60358DDF57F9EC734134515949C482D52079316D9A2481A1547 | |
2403 | 94B4CA6724EFABBE3DE13F07951329A119D84A07CA8CDB199704694F4B3AF26B | |
2404 | 95DABE0B18F99025A88898EDE46BB3C314FDDA77018279B5DC8C854096F3C7F5 | |
2405 | 4DE88F3BE84881A03C5E19A77B769EC57B4F6E5BB885485CF242A23C6E5FC322 | |
2406 | 04511A00F27AB274232A97A2E5C45188538013667C552E804283C579F1700DD8 | |
2407 | B3C70F6D22FE133C15FA6D5095582333F9B4495282BAD0537B90BC6548427F7E | |
2408 | 12C9D744869A3F5F133CB2CA078C83B80F95AAEE5D64203110CA1AF12E5E0273 | |
2409 | 298B2EB72DBB5FBC3F6A6D7004FAA17AEFB086870C83E8D742EE560DEAA5F727 | |
2410 | CD7BA16A4D6FAB7ED191AB92BA39300BFB73EE31B7820D85DAE74DE35B2E3FF5 | |
2411 | 8879D9D02B251D7903CA30DA07E2B5694F23631CFB5EB08656AECE21A93DA6B9 | |
2412 | EB6CE1A290631B795A55CA75A5EFBC99BD1E21C40D7374181C96B43B696F9079 | |
2413 | E7BC8BCC96044E09E48EAA625B9D5C53CAF79C84E8032A0F976EC2FEEA9583AC | |
2414 | 25DCC02DEC8D4798E0C145CC523E5EEE82A1A73AE0EFBB08876278A7983FFF86 | |
2415 | 527052AC0100CB273390888702DA5C62889808C3DC427BCC5B0A8D787102E641 | |
2416 | 2ABFCA74C325F26A74AE2CC7637C9996547B34F33CE355165910F2C0E6445E7E | |
2417 | 70DE25D7D187EF97902D4D535956A4ADA1F1FA0CE9881399477A0B72CFB5F841 | |
2418 | 1893157F662F071419B5AAB14EE66E1D478AA9DDA4E4DCDAFB7060EC629ADFAF | |
2419 | 5C779DE9AB8A65A65722109954599B931C42DE431F5A988459BE94F48F7D2539 | |
2420 | 1A8D09133020EA37FA9C7CF8A32C9C1BAE51E112CFCF59CD7FA6E9676BAFD4D8 | |
2421 | 093CBF4FCC3BB2E468ED55E28D75DF47CCF621662632E2087A8227945723823C | |
2422 | 02629CCDF94D5168A3810B815522588487CD8AD69EDE6D7FA593E638F603D808 | |
2423 | 0E2DC9278B63534E63D22876BDEE3A7CAB88C637DC55C9D1C4F3309C01DF68F0 | |
2424 | 3919523B2CE7CA52961AA3C2E618EFE1BBCD2C8DC65EC648CD380E3421F287C7 | |
2425 | 6F7308C13F6D857C74522BE6A0B09E15420CFAAE8DE28CFE6350217DA9DB5083 | |
2426 | D15B0CA455D343119E3C1D25F1CA143D5568D63CE32856F21328D5AAD69236BD | |
2427 | 208BEC83099D6652E91253440A613155EBE7F2D902CAC765F5049FB5433AD361 | |
2428 | 7C7EF2BF062877DB1981B9481F961A097D0402CD89E0BFA180027E29B990C2EF | |
2429 | 138AACF0D146CE117990CB9561FA6C0A8D1929D5B8BA4C4D9168D6A744ED4B4F | |
2430 | 457EFD4B36189371E60DCE4D2D97EDE139145241DFB26394A142D4457AFC0E04 | |
2431 | 990DBBF7E40FF9CC5B0624E9B898CEED3A63865690D1CA256330F472EFA9059E | |
2432 | 81920A9D365AD4CF9618E64AF8FE19DEFEFAAABF8B878C42C07490AA600C0E56 | |
2433 | 76E6C97F5B0038169395855E4338C84108D1ACB59E5482AF5FA034769A116EF2 | |
2434 | F408FDFAF2205DAD5AE5324EE9F1AC7192E070EA40EF350817F8A69D680DCEE2 | |
2435 | 1B30277FDCE432D5541D27536E9086C2C74B2B0D5AB976C3E188EBED10777172 | |
2436 | 76F7D7F73E38D15D03809B350C2F55E80AB7EB7D4C4C9B7DD97179F36DB5E4F0 | |
2437 | 1140662023CA3C389A8B168A68303117179A4AF84A64B2C2A56ACCBECD6A98AA | |
2438 | 14CD43B8CD3FB79202D957E0D5BFFB49967E5421426205FE24C9608E5F591854 | |
2439 | DF895083505CD0A4F53DA06D931AFE3BB68F3FC3DCEC7059D3FF5218BF5F1082 | |
2440 | CDEA29587E7E9E357EC1329411FCCA0C3078E9787A12EA78D59B2E8CF2AF09C8 | |
2441 | DA12B2B0EA4A43283C8FC9AC945EB0E63CCFE272BE758B0F8B2C9BAC46F3BA97 | |
2442 | D05C0E720C584E805589D2804EFEFEDA9962B4CD5B145FF7305FA959B660FC9B | |
2443 | 37C79503EBC2D1639D2593B0A9F24EE3CC07352614C0B6C531585F27CFB6EFCF | |
2444 | 044F2F2A261B0C2D79FF78899DB6B1F2FB06BFAFEB488504D2FD579F55980DFE | |
2445 | 9D15DBCCC176E41EA7AD6364D40D931CE561E0AB57F5FEA21549290E539A3C7F | |
2446 | DCE12F4ED93538385B2D30DFA578BAC6DC92A144A72D1C2CEA334ACA6F6C2133 | |
2447 | D1996B97AE8B102EC56426ED5D59DBBA11BA7D6FD39A8692F0931B64538975F5 | |
2448 | 61B79F8640773407E873FB4714516037A5C6FFA8C796A9B01898CDFDC2A3F2A1 | |
2449 | 5D3BD4C09165F6AFA9EEA3E0C84DB1D058A4C54EC0673860170038CC318DCCF7 | |
2450 | 1F3960F12AA2C9447090D91B0EF8A320E933FC8E89FDA5D5897266A4D156BDB4 | |
2451 | 077745CC076FB9A12F9D3BE989E2F8ABF44F4BF842DF548111DE129B36B535ED | |
2452 | E5ECF8AB96D94EDB9E0484E00BF942491ED250EA8E062FC59F223A85F26649CC | |
2453 | AB1AF18824045625756CE044529471B253B1F3B5FA2BBC3DCEDC457C0A42E29D | |
2454 | 7A152AE14C8D60122C5AEAF5D4360E51BE81A84F3A6CB164181DD1B62AB204E2 | |
2455 | 3F078794D9FE570D6115B1C9DEA193996CEBDC5A32D8EF3EA3C309B9F87C726C | |
2456 | 5F2957494663A92639A418C450D42D027053DE7342921EEFD3CCF162DBD32E16 | |
2457 | 9C8FF39084FE1117958230EF168E6FA9B48590EDC108D7FDCEBD76BAAAFFBD0A | |
2458 | 4EBBA485DEA8C89778456A1A36F420FE78B0A8F854CFDE7E26E76CDC2270C983 | |
2459 | 1D5D914F3EEEC7E4105228ADD1646013CAE11C03108C6971EAD9C13524537A4C | |
2460 | 2CC3D193CE5CF0FED9939AF23E241FF6C82FCBE73CACA6B4B6F88C17A18CE4D3 | |
2461 | 4F49BEFCF830777A1B26CF228DA61EA5177A826645B18F21C10E06C748E113C9 | |
2462 | 03402DFE318270EAA54F518FF635C340FF581055C1529CD6976951F6819D5A45 | |
2463 | A4DD081C55E7597D257DB9E2E3DBD46B0878895155DB0C4D859B1E61291EAFFA | |
2464 | 7F2816E365A5D6AF6EACFD49362833DE3ECA447871D071BEACE9EB8591F31EC7 | |
2465 | CBCE3C2EA428301FCEB42ED2E082F89476F39F7EB993044B8DC23832B25DD3AB | |
2466 | FD6E0A199A3CF03A79F323FF826682C8FEC47BB2B74C22A92D01F0E0CD8CEBB5 | |
2467 | C59ECEE83A7B02E949225EDEE26D5D11521DB381A26E30CEAC4D8E2FFB87E0F1 | |
2468 | 44ED94C0E3C022D4B2DC2922321EEF1BB71DE6C221535B0EB6A9837C8A775440 | |
2469 | BDC58FAA05C859F05A654242BBB4620D92E5E8B3C5A937B98064BF97549E68B8 | |
2470 | 8FD29B4E57EE27055217C910A199900E2A465051AE0573E3D46E5CD541BBBA59 | |
2471 | 5062CF9444E95536CAB30FDCD35A56AF4F5038E65690633DA9890CE8229F6EB9 | |
2472 | E5BAA68E54F9AF6590B4FDAD42B7BC0A6708A1C2E809B743A5767ED46FCB9847 | |
2473 | 8274E288E9B2A49803D238ED5FAEFBDE3863B29D55118E3ADC937E4B02287439 | |
2474 | B452DD41CE8298B10AE99AE275D45C5E0EB5680DDDE9F449855FF97B28AD1A9B | |
2475 | BE728BC56C8B4632938A4337D794EFDB56050F5459C031DCCBB1CFAEBBA79348 | |
2476 | F5514685F1F16FADF390B55DB5B671D0E020C03C8D301683FDA4BE8CDB3C7948 | |
2477 | 2F5648A2E049A495608CE414857236A70AAEF5EBAABAF1A0950A2B0B814AFD0D | |
2478 | 443CD6D2E0365332CEBFD557DD16FE1E3342A85057C5C8337ECEE5466406A324 | |
2479 | B7A5F881BBB2E442C9775A1C33B5321887E3A8E8001ABAA65B1B2BD1191D6659 | |
2480 | 3BBD32F2B01A37BBFE2A3964BF37646262E4D667BEBCAF970226BE5AFFB86A1A | |
2481 | 21CC0D74E7376B9634EC8BCC46D551FAA67603D4B707DCBF6C65D932FC76C2B4 | |
2482 | 8B2D03F5E29C4E2327F5791CCE1E42395319739422607AFC0B6962680A04A5CE | |
2483 | B9FCA10C3EA7F9B1CFEA675F44029F68E3C9C0B90CD7751040239137508E1E3F | |
2484 | 1FFCA19DA7B0933ACEB8239703097AFA4DBEC0FD8F94AA7854F83DF191A44326 | |
2485 | EA23CB5F18E342A9110D30A1D9427492564E7CA82FA80CDE8B7ADD8787B3FCDF | |
2486 | A5D52B14B6147262461F3563101CD20A457672F78F9BCB7F996D7699975C018C | |
2487 | 07ABAE4E0987AEB32A45577BA6157B51E9BBC37839FCBB886B8987389D8C82C2 | |
2488 | 0281A89F98874003140328866916A547FF0B47F24982E346FEC11458EF35C95B | |
2489 | 033F35334E2956A631F7192A | |
37c41ab1 CR |
2490 | 0000000000000000000000000000000000000000000000000000000000000000 |
2491 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2492 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2493 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2494 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2495 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2496 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2497 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2498 | cleartomark | |
45c0f7f8 | 2499 | {restore}if |
37c41ab1 | 2500 | %%EndFont |
c302751c | 2501 | %%BeginFont: CMR10 |
45c0f7f8 CR |
2502 | %!PS-AdobeFont-1.0: CMR10 003.002 |
2503 | %%Title: CMR10 | |
2504 | %Version: 003.002 | |
2505 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
2506 | %%Creator: David M. Jones | |
2507 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
2508 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMR10. | |
2509 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
2510 | % This license is in the accompanying file OFL.txt, and is also | |
2511 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
2512 | %%EndComments | |
2513 | FontDirectory/CMR10 known{/CMR10 findfont dup/UniqueID known{dup | |
2514 | /UniqueID get 5000793 eq exch/FontType get 1 eq and}{pop false}ifelse | |
2515 | {save true}{false}ifelse}{false}ifelse | |
37c41ab1 | 2516 | 11 dict begin |
45c0f7f8 CR |
2517 | /FontType 1 def |
2518 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
2519 | /FontName /CMR10 def | |
2520 | /FontBBox {-40 -250 1009 750 }readonly def | |
45c0f7f8 CR |
2521 | /PaintType 0 def |
2522 | /FontInfo 9 dict dup begin | |
2523 | /version (003.002) readonly def | |
2524 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMR10.) readonly def | |
c302751c | 2525 | /FullName (CMR10) readonly def |
37c41ab1 CR |
2526 | /FamilyName (Computer Modern) readonly def |
2527 | /Weight (Medium) readonly def | |
2528 | /ItalicAngle 0 def | |
2529 | /isFixedPitch false def | |
45c0f7f8 CR |
2530 | /UnderlinePosition -100 def |
2531 | /UnderlineThickness 50 def | |
37c41ab1 | 2532 | end readonly def |
37c41ab1 CR |
2533 | /Encoding 256 array |
2534 | 0 1 255 {1 index exch /.notdef put} for | |
d3ad40de CR |
2535 | dup 11 /ff put |
2536 | dup 12 /fi put | |
c302751c CR |
2537 | dup 13 /fl put |
2538 | dup 14 /ffi put | |
d3ad40de | 2539 | dup 33 /exclam put |
c302751c | 2540 | dup 34 /quotedblright put |
6e51e0d0 | 2541 | dup 35 /numbersign put |
d3ad40de | 2542 | dup 36 /dollar put |
c302751c | 2543 | dup 37 /percent put |
a8fd3f3e | 2544 | dup 38 /ampersand put |
d3ad40de | 2545 | dup 39 /quoteright put |
c302751c CR |
2546 | dup 40 /parenleft put |
2547 | dup 41 /parenright put | |
9f178efb | 2548 | dup 42 /asterisk put |
d3ad40de CR |
2549 | dup 44 /comma put |
2550 | dup 45 /hyphen put | |
2551 | dup 46 /period put | |
c302751c | 2552 | dup 47 /slash put |
d3ad40de CR |
2553 | dup 48 /zero put |
2554 | dup 49 /one put | |
2555 | dup 50 /two put | |
2556 | dup 51 /three put | |
2557 | dup 52 /four put | |
2558 | dup 53 /five put | |
2559 | dup 54 /six put | |
2560 | dup 55 /seven put | |
2561 | dup 56 /eight put | |
2562 | dup 57 /nine put | |
2563 | dup 58 /colon put | |
c302751c CR |
2564 | dup 59 /semicolon put |
2565 | dup 61 /equal put | |
d3ad40de | 2566 | dup 63 /question put |
6e51e0d0 | 2567 | dup 64 /at put |
d3ad40de CR |
2568 | dup 65 /A put |
2569 | dup 66 /B put | |
2570 | dup 67 /C put | |
2571 | dup 68 /D put | |
2572 | dup 69 /E put | |
2573 | dup 70 /F put | |
2574 | dup 71 /G put | |
2575 | dup 72 /H put | |
2576 | dup 73 /I put | |
2577 | dup 74 /J put | |
2578 | dup 75 /K put | |
2579 | dup 76 /L put | |
2580 | dup 77 /M put | |
2581 | dup 78 /N put | |
2582 | dup 79 /O put | |
2583 | dup 80 /P put | |
2584 | dup 81 /Q put | |
2585 | dup 82 /R put | |
2586 | dup 83 /S put | |
2587 | dup 84 /T put | |
2588 | dup 85 /U put | |
2589 | dup 86 /V put | |
2590 | dup 87 /W put | |
2591 | dup 88 /X put | |
2592 | dup 89 /Y put | |
c302751c | 2593 | dup 90 /Z put |
d3ad40de | 2594 | dup 91 /bracketleft put |
c302751c | 2595 | dup 92 /quotedblleft put |
d3ad40de CR |
2596 | dup 93 /bracketright put |
2597 | dup 96 /quoteleft put | |
2598 | dup 97 /a put | |
2599 | dup 98 /b put | |
2600 | dup 99 /c put | |
2601 | dup 100 /d put | |
2602 | dup 101 /e put | |
2603 | dup 102 /f put | |
2604 | dup 103 /g put | |
2605 | dup 104 /h put | |
2606 | dup 105 /i put | |
2607 | dup 106 /j put | |
2608 | dup 107 /k put | |
2609 | dup 108 /l put | |
2610 | dup 109 /m put | |
2611 | dup 110 /n put | |
2612 | dup 111 /o put | |
2613 | dup 112 /p put | |
2614 | dup 113 /q put | |
2615 | dup 114 /r put | |
2616 | dup 115 /s put | |
2617 | dup 116 /t put | |
2618 | dup 117 /u put | |
2619 | dup 118 /v put | |
2620 | dup 119 /w put | |
2621 | dup 120 /x put | |
2622 | dup 121 /y put | |
c302751c CR |
2623 | dup 122 /z put |
2624 | dup 123 /endash put | |
2625 | dup 124 /emdash put | |
37c41ab1 | 2626 | readonly def |
37c41ab1 CR |
2627 | currentdict end |
2628 | currentfile eexec | |
45c0f7f8 CR |
2629 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
2630 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
2631 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
2632 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
2633 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
2634 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
2635 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2DB9B8591E5F01442D8 | |
2636 | 569672CF86B91C3F79C5DDC97C190EE0082814A5B5A2A5E77C790F087E729079 | |
2637 | 24A5AC880DDED58334DD5E8DC6A0B2BD4F04B17334A74BF8FF5D88B7B678A04A | |
2638 | 2255C050CB39A389106B0C672A1912AFA86A49EFD02E61E6509E50EE35E67944 | |
2639 | 8FC63D91C3D2794B49A0C2993832BC4CDC8F7BD7575AD61BCDF42E2E421AA93E | |
2640 | 3FF9E4FAD980256D8B377043A07FC75D6169338028692CCA8CD1FE92FD60AD26 | |
2641 | D57B7519B80A8F8DCE9CEE5CDF720AF268D3C14099498A843D76E3B6C0328F24 | |
2642 | D36EFE7F5C4E5B5C612786200C8DE3A41EE5F1FFAF4097653CFCDC8F4FD32E0B | |
2643 | 03EDB3E413283B9EFB0AC33B055617005BC9B0057FD68C52D1B0E67F0C571685 | |
2644 | 767F2AA85ADE4E0104A1C777733D5E318A22A9944336E5B98D965E50D31F357A | |
2645 | 8B6EA5A0EA98E1B027CE68C2EDB149EDDD04ED74A1B3D206D471A0C11C11449B | |
2646 | DE190BBFEBC08C9E1B7513B43DA3134D6B11A2516E6E86B67F68C970A320D05E | |
2647 | 94FEC57FB347606DF89989C33482BD09D011C55AA920319E7B26A205D3D0F004 | |
2648 | 22466F09C0482A164CFB27EF6ED2B040ECCC3DCAF345B5A73676F193D43123B7 | |
2649 | 72FD6CFC5E37930E61EBD5A6307E4DE70194E6384EC0D79DB6AD86D3B319A31C | |
2650 | 8B0589D0FE28241D8ACE280D0530EE99C80723E560BB72AE9D53F4713181F491 | |
2651 | 344B06D3027BA4E9E94D4305BE1D817197C54C8FF56CD6964165F6448ECC8A8A | |
2652 | 64B48B4F0FD69299A137589E2491A283509B21A3A5772F75B7602A9F60AE559B | |
2653 | 07A58436D04222C73EAEA72DE9A5A441F88D27C11F4F91255EFE280E91A4ACAC | |
2654 | 1E98A4E5E6C57B9AE86FD218C3CD8F24A4104156A80F13821384E529783C52C8 | |
2655 | 78B94AB3A0096090867ED32E8A30980E737922037F75F062BD83BF4F5929BC51 | |
2656 | CC22AEE2DBBAAA001CFFBFF41D258424FAD888FFF1BEAB796A44E3126159E120 | |
2657 | 7E4025C676CF94888A1971AEF8B6764B3AF4A92D36FAF6FC56FD049710EE3782 | |
2658 | BC2CD84FE2473F133BE03C1346B875463F126DCAB15C7A9BCC9A727D23611462 | |
2659 | 4E8D2BFD2466600285D79518712B8681ABCD69608E6AA9578F7BD771EC36E01A | |
2660 | 5A17BC17E375020ECA59B43790ABEB9DF5F4FBBEF807E5699EFEAC563E1ACC5D | |
2661 | EFA336E75DE6D8248E9381BB110884FDC89C2F9A41EBBC9A8A1F98E6A41F68BE | |
2662 | EE30E25CA148C1EFF42DFF8C214A6537AB11F260B8C329A4947B5FC8DC9C5622 | |
2663 | 4DF7BF4FBFB00380D47BABB03BC30627AA74103E553F55278F538EDD8C1E64CE | |
2664 | 0F1398CA0AB5A86630139B4A7E8FC02804CAFF3830114640AE50D2FDA3B561B5 | |
2665 | C63AD7EE3347804CBB40FB1E77A6C89735DD870351C3A1811591AB493251B904 | |
2666 | 314F65791963C0412377C1D02362C5E9655F1C3D4803CD379A8EF24C48218C2E | |
2667 | DF1165840462BF37DDE1B8D5FF09FA2C3B261E2F1A65ECFBE5D4EAD43B52C029 | |
2668 | EEB3948CB8A252CBAF545C8FA1C31E920E23A12DD7222CEF2D2A513BD758EA13 | |
2669 | DA33BF5FBF1D734653EB83DA2D374A5B9A0CE316F24EE375D6DF6BDA49954C2E | |
2670 | DB25A88821193636119D469BA66E5DAA9C92520FD4F84426A4E54273FA469084 | |
2671 | 7517817A6EE3E21176D333825E88046F50B3CF6938AF9BA79A2F51398239EB91 | |
2672 | 1A2D07F7FCD948427FF62F40FF95E39FE1A1AA8451411563FD5388472251C155 | |
2673 | 69BDE9283B41900B21EB1190D06E6B13B7794FED020D2C1BDD205AE77B084BCE | |
2674 | EF628249398B496DE85B406FC2E1939EF00DFC84C07E26CF72EC401BAAE756E5 | |
2675 | 7F6673216E7560D1C2A723CB405EE5CA474A07F61B81F8836482F73DC9516D67 | |
2676 | CE0CB770EAD755B6B356198B4B97EBB29C63456953270CCC8D5650C1D006E69D | |
2677 | 38DE2DFEAB27DAD50A817F0D645D30AF5B75A7B53CBD3D2B8D87BD0A7E525AF3 | |
2678 | 22F7ADDFCE31716914C2318260C2E2B4664893921B68C5A93334A361D94A759C | |
2679 | 0D7B146D6FD94F0442D672BDA0F6432E18F3C5DFA37ADA378D95B75F413C9ED1 | |
2680 | BB5C606A3EC7DFB3F796F59B0478C13FD1900381EFE0BB5242D5B5D34D03AF1D | |
2681 | 4BDC93EAF8020E26CA23C8B0E7DDEBBC6762A557067A4CE05A524188A8F02E2F | |
2682 | 3625DA38DFCF381727887F5646A3995A8A38A5FB1E5D5EBB395FDD0B7C8E71AD | |
2683 | B48EEDB62AB2CE99D121435EFBBFCEEA69AE9ED8238B60CC7288DE33C766CDFE | |
2684 | 15B767B4AE2E6CE0965E77272AC9F86023DA620548CFAC85BC751C44218A29C9 | |
2685 | 849F1C2DCBDFAD895B54E51A569952ED50F82DC8A19F367E7E44643854EFD6B3 | |
2686 | FCAEB04E55E4661C82D31E2932611748480EF61FB2FBFB0CFB940BEA81AFCD84 | |
2687 | 4C6A6332D7A600170E38A8EAFCD4F93DC153C43175434C86BC747348FAC61B76 | |
2688 | 1FEC9027C1A193E55C80F1F20B5317AA0A05AAA36AE235F6E49F06E570FEE798 | |
2689 | 84857D7552EA92EF3EFAD52DE39C2F8F43C59E3A957B7B926FC95FC4B60186DF | |
2690 | 7F3523EE2AB74E294C8C4BCD8B4975E84849E0FBDA6C0B0F24A636DFA578B122 | |
2691 | CF97BC5089E21E9F5298D1C9F30CB8BAFF6A3A11BB4D9A0A5CF2B18D055C44CA | |
2692 | 4FD4D8FE1AF3630907DE7E585AA811F9CD11FB2C8FC791851D651009FA5DF20B | |
2693 | 3C33FD2FF848A9E3F5652BD294965A332DD3F246C91B0ADA34017FF2451D1394 | |
2694 | F9C3C95AAC6EC8062BE98E8914D51DA6A164AD13938693D446044859D03A949D | |
2695 | F9AC5DF4A000CDA98BB516D762CB9F6D44B5268FD0C26E88BC4A760C0F75A140 | |
2696 | DEBDECA4F511128B7D2805872160C55236F0A0FA7637FF0D4E94AC079CD3C8A7 | |
2697 | D03A5A56F26B0438B577C46011A10532FEBCAD14FBD6032E224F45691A726886 | |
2698 | 56F305231EB2FCDF59C8BBFCB5DBD2D093A0E84D62AC93A2312CA69295E937C4 | |
2699 | 8DBA1802B85F54B5E7E6D6216A918F911FF705D3B5CF055F1D873B96283A0B53 | |
2700 | 59344D910CD396D883F6F7836BA65FAB4393A773A8F6BC298069E5BA38210EED | |
2701 | 49C9D920F718E3FCE692527DC7CCE6963BF744F2C91BC5952564196D60574E86 | |
2702 | 87A0FAB21F2DB2BD5A51D7FBD8FC19946D24E5A228462C4772F978E650ADCE3B | |
2703 | 8D66B9C21279C531CA1C3A8ECE3420BB65837287A7222CC3673A2A5F8BBFDB60 | |
2704 | C719CD073EF9A23675198462C7C87B24CC92D6AEE5C25AC63855CC3281494342 | |
2705 | D28F3D2FDE0C183486769A4FD5B0143193D31FCB2C2A14E487BBD96D0BADBB64 | |
2706 | D1B56021C363A795BF10E2DB448261C363A54A4AC1182B470C457AA82DF3F5D1 | |
2707 | F4B329806141EBD53CAE309319B94133D7EBDC2D0453A905ADD207364371E178 | |
2708 | 0A95C2686E3B34C4A978BFC0EE968C39ABA00889BC5149162C2B54483D44FD3B | |
2709 | 5CFF41F611C7E03B94945F414560E874D7CF27FFD0630890D7D7EA66CBD15448 | |
2710 | 229059E1C436BB33D69552B5367AB5D53591C4678D0C704DD3EA23F5D9E8A7AC | |
2711 | 17D003C19E333E726FFFA2961F33C70F429085F7BFE3E2510F59B78F58B19CB4 | |
2712 | 01B48E184BAD9020FECCE3AF52048A056981DAEA02AE78197E65855DDB170616 | |
2713 | F54278395D9EA50DC83761AE759F9CDEF9E1948E7002414FC05286ED793E6662 | |
2714 | 3347F2A9AF8917493D7305B92CF93E8E9185F70015F5594084298A6C2F9FD3C0 | |
2715 | 689F262AC9FEDC9B89577ECDE92F08D3142209FBCE7B5C0A840CC767BCA56C20 | |
2716 | 4E4E545E2BE4D21C53855CEE4CD0AB35D1A604C0FFFF77DBAE4289752276559F | |
2717 | A05FEE65F45ECAF44E95E23FAB6052195C7948AF0B1126482D4E02D72BF8AB03 | |
2718 | DE0F1A632F7672AD9DDE70EDC82AA993678A82BEAD0BC2649C4707FD8509810D | |
2719 | 364B5C6FE0E10772E95288C622C2F06C634F4DF8C7FD1432BC9310D5F24FEE3F | |
2720 | 7AB324863D6DABAA1576E70643CA79EF4D7DF4105093D66CEE0F3B87D2164A7F | |
2721 | 26EA05F5C4645B22D3E1BFD2219657712C168FD90DE801FB0F32759E80DEC1E1 | |
2722 | 43CEEB19FED12D757205043FC98FEC62D6A8D8B97BC083B4A0E985AF7850D6FD | |
2723 | 8716B9957C1C35A0675BC53DF672C425C79F43FDABAEE7D63F092CF271C9A9D7 | |
2724 | C41F40C4189510987887942E60A412B3EEC84C9A6E1AC7D54D528F5604B72C08 | |
2725 | 94B7882621A5BF1F325B92FF96B80878CC550D1AE4D8196E41CB1251856609A5 | |
2726 | C4D3BD05A922D0D45E039D9450DEF8490A3E924E41434194910BF60BA1B08BE1 | |
2727 | B41824345627745541A4F1703E956328F6227D11C74946B38CFB096139979E56 | |
2728 | 4E723B889B44C6D78673868C89912F8B4F0B4B485F1587A637B630F92E6072D5 | |
2729 | 7F3B44EA6FD96BBD4FC28A6C1D90805E3BE3E42A7BC9C880762966C55BC04E01 | |
2730 | 204D083AE976FAE6F37C94F27E68F8C0F28D52B17F6C0FD7C9150701FD78F8CE | |
2731 | B8E8DC9260E3974005EB5CA728171F482D765016C94D4ADFE4A42EF42212BC56 | |
2732 | 7E4EEEE8B0D2A7856CD4E44F55C0BAB762F92CB8D64C17022D4BF3A47C12F5E6 | |
2733 | 279FC23101FEE93753653CE8CEDC3B75C9CCB29BF1D4554C6120DE8EE750FCBB | |
2734 | E38B5D915206974962E320362E59B3F21B3AB1875703191043D03284D4467346 | |
2735 | CFF2F98CEB4845B73ED8E003E0DC94251B73E13A9B51A3F1430BCF6A21EB9B7A | |
2736 | 65E17FA411F53BE6432F1506232B8159E008FA257F884A4A01AC53BE91754D78 | |
2737 | BF14A5B0FBFB9C31BF4908355F8A762052968DF526D118708CCB0B7CB5BEE285 | |
2738 | 6DAB6CD2E3934178E60BECB11AAB5478623CF6C50C92F8BB5D1A583609028FA7 | |
2739 | B8A53B791BDC9EF76A124F3F7641857E4BEA0837CB36176EC9A522EA7F41B8D3 | |
2740 | 63C37D1145367BD300F17B54522A834BBB74DE12BF9EB26ACE6F24A046D58F89 | |
2741 | 4D4B7DF74875F1A0C1C9D97BE0849593D7B398EB4B00BEBC8C8D1497B6EF831A | |
2742 | A35380FFB7F1AFA4D888AA52C9482E8B1755CC209905F98F40D95B44D4DCBCB6 | |
2743 | 67423D1BC2F3560FF0A8B4F0CAC352A4EE2C1D946E45AAEC8A6AD40303F3382C | |
2744 | DF0756BFA3B1ED64C169E56ED1C760F2FF0E24DC5C9F41306EF8D2628153D30A | |
2745 | 5DCB0791126BEFD4947D7EF08301FE015F2B0008DFFCBF9F2D4D859FD43EC7D9 | |
2746 | C5BE237E9BF6665B7B1BEBB362F0C0C3A8D86010B9C97FA741C97C2E0513386C | |
2747 | 9C26C235B14DD2A58BFDAC7B5F63DB4DA6D5D37D0098175A9071590E1DF66A3D | |
2748 | B8173A047C29D7D35557F06132CC920B5460B8AFC11D23D09A4E45D089F5EB51 | |
2749 | 963FA1A6256E359D485107FD143B2BF21FDE9DA5744BC2615E86C31C89470CF0 | |
2750 | D06C6397D9FCCB316EA9989430240759D2C4945D941F159FC02327F34B042BAB | |
2751 | B5C3A47C78E8C1A6FBCD396B1A51CC4B020B8AD401841EDABACECDB482D6EC5B | |
2752 | 72D2BFEB4556720FADD49D07307C8B22ACB7E310CA4151A85C71EEF70E8D15DE | |
2753 | B3B00F26E0E166C14647A65ADA228A3D1C89025BE059306565DB1B1EFC37D358 | |
2754 | 8C1EB024254AFD049BA977BD4C2C605050E17940A89D0D4C5D963E792320F5DB | |
2755 | 3706682E03D25D9E02487247819551465092CC22B6B56E93F3AB528038FEC3F0 | |
2756 | 668F866707A19B0463BE706EC729D2EE1653AAC7E29BD25BFB3241D4792F5152 | |
2757 | ED415B4E7FA92C2EE5A22E27E8B75542C492E56D811C192E95542A6FE0BFE5A5 | |
2758 | 69273C2ABED4300D491B92D2AECDD278404CB84B1BB1BD7AFEC858215837D118 | |
2759 | C0E928BE7E07CFEEB51A6D21375B772B8248C994564014015232A0DA4BEA1754 | |
2760 | 3274F407FED0837A236371F1A32056240F2015B1E7F4B2CA72C6B58610A66F13 | |
2761 | 407CFFBA5E0A2893C1F572D50F51286E9133B5A84239C9493B0574E77D281D01 | |
2762 | 11D00683354A000C9700EAFBC1FD104EA19DFCB87470190E7E2CE26E3A6FD0FF | |
2763 | 2620B87B82AC8686B6206B530F17E9348BC7D04B948348802CE53A312443DB87 | |
2764 | 4DBBA5313A6A2A8DAB8A1CC9A594FF8C299281C0A261C8CB2226B732FBEEDE40 | |
2765 | 2C6ACC74A1A61379E2E1CD5548CD908268A32FA83D8504C442EA0E183ADBF7FF | |
2766 | 9FD09C037AB03516ECCA93FF048235BD11A25DB07F164512A079C5392AC7F889 | |
2767 | CE96AE5C8D9580BCAFCC087C35E76EED1A671E87C12E3045E15A687134736DF8 | |
2768 | DA984772AFD189D68571A2ED7256F1E204230E41D3D9DD876F938951714A3973 | |
2769 | 0CA9310489F8E807C1C7A4E51AEA5BC030610A5D7263FF7E0F9FDE3E5E37A362 | |
2770 | 5B919000BD94D978583B942EB79CF2BEAC33FEBC9A67272EB10865BA8FB75FD7 | |
2771 | 9D280AB59F91B96C16C982DE848D76D8FA8620DFD7C80B7DEAE7264350D6FB3A | |
2772 | EF04794DA3305844A7CF718F6D1A4A3AFF6826173A076A1372ABFC54ED3AC6C2 | |
2773 | 09C9287FC830556CA694E21CA5342ECA7B10C90AFC4783D841D7B1E34FA3DB7A | |
2774 | 2B706F3E21B0FBAB23E7257962FC3BC309CEA2C7239A9D6B44CC96825115ABD2 | |
2775 | AF9A2566D2F3382C01569FBDB94C8D664A5DA0F7DC3DD140CA77C743D7BC1420 | |
2776 | 324ECF9E4780280EB119885E96A6C619CE3C0C8E1E264E2DEB137E5DC8149786 | |
2777 | 486D65667ECF47B1A1E20E9E6E4FC8323E0BC8E61BDD3BCDFC6575C69C03E31A | |
2778 | EFFC290472CBBD049DE3F840AEE37A2486034240F80E75D8A79E0762377DF660 | |
2779 | 52B12EAA16D678990B11A9BFBC03C1D4FCDA9FD4FFBB3E88352438102F10B7C5 | |
2780 | 9F04C013B6575B5E948FAB58EA691984A0E54E6B9F3F505FFFEF74D06FA1CDF3 | |
2781 | 4B8A95904C8A2763AA8AF5B71D00F5DE09DC1CDF87A08B6D181453063E14C12D | |
2782 | B7BB3775A6E2A901636273D9EEB833EA8CF20FD83AE899E28DADE10EEEC20BD7 | |
2783 | BD93085A4B1AC80AC1AE8280C14767F1A487BD066007A0D050317BD081131A14 | |
2784 | 6EA0898ED59E46DA7B6254BDCCBC660686E2EDA0E77A705A653733BB5C5497D0 | |
2785 | B130359F866CF293FB6EF0C2AC5BAA2DB0DED045E2DED3A2612D078333260359 | |
2786 | 16CF0CCB272D34767EA069E0F0B0D42327A18529D72E890EDA6195C2688438ED | |
2787 | E9ACDBEED41E81CA8EB5E43C2B09CE266EFCA03F2D7FF57F12B06F9E54FCC6A6 | |
2788 | 546676F6FFC5B8B7D3F0982B6FF0D21D949309F0C0B175CC1D0976F8C55C6AED | |
2789 | 6E821C39041E22D91AB30922F2B2EC2746BC7DAB484991542FBC82D87B487507 | |
2790 | 559AB466F73EE23C2D3194DC5CE4C9AE66D3164613AC5CBB3DB501B64DA7C91B | |
2791 | C7ED2EE9027FC0906820B35D4F2CF66C4F9CE4A884B7C07155BCA884ECA5EB3A | |
2792 | ABB83F84DB1F5639599DC7D3F51241AB5D95C3BCB7AB1EC90B4BC989F74FB354 | |
2793 | 04B2D7366A34D335A47B8C00C05CB423482BF6C7970A95545424A08AFF9A035B | |
2794 | 7F83F52B65A9799CE76E303B85664B624C65E9CA58184C7BE2BB9D9C86A4DE5A | |
2795 | 8165EE3DA2E652B5022EE7893896BABD88931DE1D538F615787645DF5ACBBA0B | |
2796 | A8E5B899A37321AA7D4B283AC9234978C2DD81813A1EE5DB6EC170DAC1B6EF02 | |
2797 | 94892635B498765C07A38D2E9DB0B7581B11056C28278F89B0E60998379C07EB | |
2798 | C0EAEDC32AA69B8B836F92A61AFD35688315B2C3F860632FC13E4BDFB63214BC | |
2799 | 41CC6859EAB3AC3034449213CAB99FA1D216563419CD6D6CE4E1B56F33E6C654 | |
2800 | 7AA9DCB5B05FC068DF02AC32408C8010AD004F6CCA9887830927F8CBCD49CDB5 | |
2801 | 18CAC1EAFF815FF2F6F527F936948201565003022C6C7390B4E3C2B219FB4F76 | |
2802 | 9F12BD25CA7B3B61D1A2F8DFEE795D04D5428B42FB66E0C254AF7B7A10CEF7FD | |
2803 | E5ADA5E217BE24851180E9A1700FBA66C7D2B0D7BFDE4F4EED1D24B821A40947 | |
2804 | 5620363657F6D048E651A689822CF815E72FC8AE9D835BE31D1DD8B54C9A717F | |
2805 | 4DC319B4B59AE073936EA40B070524C7E71D5A7B64436DA107749746B516E29F | |
2806 | E3BBCB8F8C473E706670E11E5B221716F315FF097CD1841D0069FA69EA1898FF | |
2807 | 9F9EC2518C77806A19730C97F54BEAD604548D553D4A6EDB247853225E24E7E9 | |
2808 | 89D71F6BC94DB986467E755CCC99069B313F5745B02B4BB608A39F0A0A732B87 | |
2809 | 7EA2DED68219754BF1FBCA350327572D769C962EF9242132D93A5C8E9725D8D3 | |
2810 | AAAEC15ED0F362471AA58488620156F3474FA59CA080EA96FE995D2B3DEEADF3 | |
2811 | 3141D157481C66507725ACA5953CBBE1ACEE7E3F02C72C6552D15EB3D612730E | |
2812 | 61A06A43575568DC3CF3844BABF04CA767E2995196097015E0C4F622C4356B6B | |
2813 | F41DBAFD797A4B9D7AC22332C552043EF98913D0D9B50CA6B7CDAF903BC5C04F | |
2814 | D20A952BA5CC35B646ACD0A287C956B98C450051AF6AAF79DF37F8954473F8F6 | |
2815 | 652BF03AE2AE82B99D820CF93F5FC0BA17EBD7AF90313E70594EB5C354023BFA | |
2816 | 07912408F1757319C7288E99872B907D5AB583B082EEED8AB079C63E38B07D11 | |
2817 | 6744856E689A479CB3A8BC081F33CB06755926204981DC0A45B3ACC18F6865BB | |
2818 | EE2C50DB43B62E3630FC1D9B1FFB3BFFAA6D0A20C0381ADF48E4D916BEE85BA2 | |
2819 | BB40F538F55C11D50F882B73913840B45161262BC8B0012694C3EF26452F9B77 | |
2820 | 2CD7C7AD6BFEEAFE31C8A721C2D46AA00C10681BA9970D09F1E10DDC250E2AC3 | |
2821 | 9A160EC8C9654FCEB36AC2B586E978D54744FC8A0E963D8EF6E228ADD22D093B | |
2822 | B889C940206F504F14DD921D909BE06EC9BACBC23EB9E9D137FBC983570FFD2E | |
2823 | CC5D2EB5D2A4A8604A4AD418B800EDC6B89809E0009760E9470F037FDD15E649 | |
2824 | 93E9C8FCD9436AF02447C7F5AC380FBE69D1405189E8DBFDACF0E7DAECFA095F | |
2825 | E6AE1A2E9ACFC032BA9A5DEDE9DDEE22A88D9A1F1E0FD9BAE2D88FA168386D43 | |
2826 | 4B93EFF3AD84A9C05A80462BB3A940B2F7311CF7054F501BDD4F1347213C9327 | |
2827 | 5653B73E9D78866901235C66B0C49CBDE3A1BA3A11991E6B8443117745D96020 | |
9f178efb CR |
2828 | 38F4A74D9676E4E99291D4420C57ADE4A8D5214D07B14916D83DF15114393048 |
2829 | FBE0DB83223F609ABE120AB877FEF549B6E2389487BB7ECF1979BCB0785DAD1A | |
2830 | 2916961A1DA60AB491FC90BCD6578571226B4DFD204E75FF18FB5E72DFE8A028 | |
2831 | C66F8576254930567A877DBD22F8372E7BA4F23F9497ED653906F5F67A66A1B2 | |
2832 | 51957AEB8D443550161075E5523F3D2AFF386E2640B276C3EC5EDAB74AC0DC94 | |
2833 | 7D975D7F5781A652BD13AA7F97ADDBE68847167997ACDD038E74E930D8248F0C | |
2834 | 2CCBC094031C7147BD8D4DD664184695CF8C474845692540FE2B8A72CDF9DB62 | |
2835 | BE05E15A05F59D56E5EDBE7C371BE5CB3B276FC7A03B5942057EC3136591A1B9 | |
2836 | 15E504DC497B663A9DD1729EFD1478C233B9317351D000DC0982F061BFF25A3A | |
2837 | 8983E560AE31E321DFB137C77C0AEC704F8DA99024232F26AA6920D58CB17DE3 | |
2838 | C1BC8E20988FBC4705E594569BEFC3F6666785B2FFA49367E3CC695F2A1EB846 | |
2839 | DEB37E120B0F4C0783C0D54655C143C4F74DA0690C6D08D07ED225F361BC0F86 | |
2840 | 572D79540730791DCAC15823991FD5DF1AB8F25F84EF40C085B17C9070C59EE6 | |
2841 | 31DCE45AFA78440BDE4C69A4D954C2006070A2C310179851F2D39B1B5D3EDBAA | |
2842 | 289570BE80F25D75116BBDA61F002B832F9EF2C32B53258B15A1174225168B28 | |
2843 | EC3324C6EC61E5711811E658A1BA65C8D2D47CEC6071CD88DBCDE9CFD2BC34DF | |
2844 | 1ECD2226AD588B50AF2399D171E99D8086DDE33E24640A767F249797B1B742CC | |
2845 | F4E95A64E1AF8D88FB128194673CDEFD6A1672DD1D03B6749E729587C0CB7C6D | |
2846 | 13BFC785759F35578D611E924CD89FF87DFBC5C93FA7BE150624825F7D137CBB | |
2847 | FBFB1238C1A397826B8D1DF0A39EBDABA5F10B37FE8C27568E1C088F279A0E28 | |
2848 | 020DFD377694024FA154AB5C06EDC3CAAC3CB5A69297E1079F5C2F351D81614C | |
2849 | D73ED708907A96F6F8FB0994D3247045E8D41028432E91C7ADB2F22066D6F8D2 | |
2850 | 701298CC9FDA7928F99CA135B69808AF6FA1E0A3CCE1BFDE234E9218A565FE28 | |
2851 | 96541CB9381E887182873FD7866F5F8415EBE92E51E7FF064D6CEB7BDBEE4DF9 | |
2852 | 97633E53488AB11EE93137AA185AA7E4AA043BC73DF1739C92B4D3A8C46BA689 | |
2853 | B9F8FA73BE010D7C4F9007937AD0EE3EE4E3041C72A2C4DB92C6C5433DF33A10 | |
2854 | 700F9E891885DAFDA44A00781BD019A9FFFDB6FDF9361520D50AA5037E654C8A | |
2855 | ACD179511AF61BA10DB29A0535972DDE8B838091B5EC3F6C3408E02B8CBB3FD1 | |
2856 | E213E2C53DB7AB14D465CB0E4FE2A2CAFA20E74BF4601CC23687FA7921CB1B86 | |
2857 | 6DB57E04C99BF7F56FED75A052362016840676DE91888490B4A1DFE0C079C88D | |
2858 | C8C3BD3527F7C006E1403DABB47C3F9174208A379C221931724F06270985BDE6 | |
2859 | A53263227EDB00124C5677613BEA94BA029F9D6F8BD1F7B87C4426210AE554C0 | |
2860 | 7BC707199BF6DB673E40D55741CE1F0853504A414099BA8E0BC7F5EBA5392684 | |
2861 | 79552A5D4F7C0CD3A6D80B18014008AB011C8C66C74D32AAD748EF30C1AD484D | |
2862 | B56BFB090C5BB937E81189912665F332911E11E83CCE75A79DEC2838E811D5B7 | |
2863 | DA85AD6ACB7D8A98D15DEC66504CF2131FF06AC9A8A4FBC4CF34EFB8455C231D | |
2864 | 0F73A50052AC8FCFB2B2ACB95033AF04078E9CB99551FBB1C46EE6C413D86C90 | |
2865 | AE8BD7FBDB7BA6E9087658C79C4758E242256C0546DB76A3857BC89F26A4DD9A | |
2866 | F4A848104BF1ADB2DCDA25C79BBBDB66CE1C1A45C7427FE7CE5BDDA7CB599B4D | |
2867 | B5D346B15414DC9688A9D00F0372DB98FD33E6164E5D78D6CCEEF0FEA60A7F5A | |
2868 | 9873AA7E2A7F98893AC5A9598B71BD06D13D2766489248190A262E5EAA459888 | |
2869 | 6D0A38261697EBFA55180F3D416C2190B36C309202D1619A405764612BAA3506 | |
2870 | 7D157F49FA1E0A7F252FCB0B8459A30975E02748AE1A891FD6BB288E0D7C144A | |
2871 | 1D348F1DDD145912678DAE1906796591E35012373AE01E18515F5CC3BB29A629 | |
2872 | F8B28B54376A9E10D0CFB29B81981E66F27B6AF44DDE0A3621B9ADADA9588201 | |
2873 | 11A0362FEF840B200C84480177C9E3F0777350BE92707BA916A90AA81160D498 | |
2874 | 6417DB6C7E15766EC5C9058CD51879041BDF2D2514B0D6B968CA0A300EE2E30B | |
2875 | 6AE41238D76DF324B0502BF79D58C2DA1FF7E384891182AA59918DC8EDF92299 | |
2876 | BA162134FC3DADB6FA5CEABB94D1CA9BE1635F769EAA88377AD96510A4DA8F8C | |
2877 | 5319E0C06CDBDA1BA9845302F716DECFF7B965BE413A7BCFF3C4EADC91626070 | |
2878 | 9A5776EC64C67DDBDBBC66F16962306631D70E62616DE4997ECFE39DC6BC9A75 | |
2879 | D2297C2159066195F43B7002138456AE7EF69220925877C87405D06144D250E3 | |
2880 | 55EEF1575DE8564BF98E2ED403591F2EA4F6AD71A126A9B1F5D350819058FE4A | |
2881 | 949B8C3A7907A725B463B752EB3B44B090C731EBB86FAFE24340D1A89D3FC0A6 | |
2882 | B89E64C3FA480C91DFCCE4922C000B0533A052FB9305EA3B58A38A3AC2688715 | |
2883 | A7C7418637C393439725F0509B3B08E07DE5E0350A005E4C5DB815CD317EDACF | |
2884 | 6460DADCF9281BC6523DC8FFFFE18CFFB2EC61884E7B324806851A91F7E0336C | |
2885 | F86AF2C88F1EA1EAF0F87013AFC7DAB6F6BE426D92A406437E38C75614AAC461 | |
2886 | 4EDBD8F129D985A1385B0F9F1A4E6D9936FEC600F4E431C653DFD1D56F694471 | |
2887 | FABDCEC7BAAA0C266D35D7380AEE587F61DA5CD1229D99F82BFA7B1A45A165FB | |
2888 | 658A4E7A741E11931D6E5C1358CF76056CC0DCF4B623C2A8CCED91694E46661F | |
2889 | BCBA0225541BA9A58EA1F2E2B2402299EF2B691C39A87AB3D5C722DB2738EDC6 | |
2890 | 8ADEB09750D714286EB392D198A55784AD908470517724B92849D539ACAE89E7 | |
2891 | A8E37CF20CA87635FF92F1140DDBAA76CD52BFC0B40FBFCA768F837D0AFBC7E9 | |
2892 | BBC89422CBD6429B284F67AD2DF917AF69346A5BFE8DA3DA8F9597C2265F3BC5 | |
2893 | A90CCE79572DB45176AED6E1A5FBADC98816F0E29BF58DBCEF62EF76A8D8C845 | |
2894 | 4C7E9AB94A0EA43D2FA271BEA800890613D8247171938596CE4948BCBC7960AD | |
2895 | 5B2BA3E0A4384749A7D88F3DD515CC1DA7292EE9775B67F621E156020419D0D2 | |
2896 | 1A6AF5B51E64D3EA7D182AA65AD1F663FB28739B86F9EE5880A5A96C3AE1C563 | |
2897 | 7A002FD0ECE3AEE80AF18A0FBCA3EDD496C18C8974E856BA39226C382CF8541F | |
2898 | F7E2C35B3CEB1DEE3BA8F346199944BE2F350E4C3DC89D789250C3C5192236AC | |
2899 | 513D1A3058230470BBA11E0B39141F48065B808B6FC459A897C304B749B5A656 | |
2900 | 38B55950D6F379A535CE2816498DE36D03747FD07514C2DA1764217BF2DE17BF | |
2901 | C8FB2F06382136D301953DC42EA0B429489275571F6B86AAF496E6A2EB196547 | |
2902 | B76BD6DFF6054DAFC9CDC11FBC541426DF0351ED027FE76128411F6F62DAD159 | |
2903 | C116B43AC59C885B3308B158EB74405541F2BD247BEED5D3B35554EABCC133F1 | |
2904 | B71EA3C7C7876661EEDC141818A3E8A9C519E7054E26DC023320A0166FED1C19 | |
2905 | DB1C3044D23E5BA7F039D86ACFBCB5F881A6FF9135E1F5DCF910A873E6F7DF8F | |
2906 | 11372C039D09A875DDACA3FFADB73504C1749932C3792CA80D78979CE0269AD7 | |
2907 | 47CBE7CA39E26FCE1E71DB711D176644423FB964CF8CCDF16FBB686877B1B99B | |
2908 | FC570BBEE55DC7F2AED8E81FF38DFD61322F1FB69E5CD6EEB8135128A35FC23A | |
2909 | 5ADD95D4F873B2EFD14A1FF76CD20454BD3BD2752C9A5F0C21F1E5F39C5865C6 | |
2910 | D4874580E6224B22FAB9240E0346C843AF0C495E7FD5B3310D90A6308D47E882 | |
2911 | EAF80772C87D3F7FB9DDA52F253FE4E3D1E56EBFCBDB9BB9A977DC7E9772428C | |
2912 | 47EDCE4D4F793F4DB9C66E65827109E83723E50424A87B36D6E74DD05B327128 | |
2913 | E407252F937ABE315B18312C8BE965E84ED9C895D275A331EBA6E872DBCEE1BB | |
2914 | C6254960940B95F46CAB4F8469E7412F546E62683AA356366F454308367A789E | |
2915 | B1E6F3A07B87829111DD17856727E948E0FAECA4EB00192F125C2331011AABA8 | |
2916 | F4067FD01D56853FA445ADEAE5901242DF460ED8AEF939332F87D81DBE9A30A4 | |
2917 | 18884AFF8A7F00530BC7DDD3A1E6C40549BE3E567B225E7C8844F0AF3E19A4A7 | |
2918 | E61F818A5F1BC836012FBB9AC4A5AE737FFA908EBFC88B2EAA62877B05B1B1BB | |
2919 | 65062420B89BC4C3C4B7CFAD1148C6A373F26ABA9A8DDC74DBFE47937035DB49 | |
2920 | 20F0B8E788C0AD02381732BEB2B9587D6B50E6F7B4E9DAD171B8C64B60A04776 | |
2921 | F70BDD9C6C8831AE39561701FB54D68810E4C3249C32E4D39BB40C500C8A735D | |
2922 | F316A68985E3A0338D8CF730881326E2B76D75BD2566D7387C0DD8C5724592D5 | |
2923 | 1FEE9798B269DE09387D3A1EDAB20063BA852726BC7EF07CED98E2DD1957F94F | |
2924 | 7E336F6047A935E128444DA8F525FF1E458ADBCB1B6D910B68955DCC59512591 | |
2925 | 2F1228007F9524A0AA6113FC6805AC4ED806D5CE6E03AC9EB6830EA9A7AE975D | |
2926 | 99A4FDA50B92FB6977BCE8BCBE2D8EA44BCE9B39718584A452205C4349561CBC | |
2927 | 7B1E281C058D0BE636CDDE883E1C1AE3802A35C5426443AEB6FF705EC26AF94A | |
2928 | 2A7BC536F373C0EBAB41C780E56F5BD1CA645DCED5090CF32D4F0E5A780651A0 | |
2929 | 477CB27558B2D0E2AE3D0A02565EE38D5F437D01308A6BEF55E80422F5B5B56F | |
2930 | 6DD11ED717B034083F9BB1536D76E321255A137E618B398875B5BB8F5AF02B6E | |
6e51e0d0 CR |
2931 | B4DFFB173C424B24BCAF3C9271A54166A65927519C9770B0DC44CE276ED0C20C |
2932 | 8EF41AC3AEBEB0996DEE664E8F872023710D0BA81DD3A3EBF79BC24717BA1280 | |
2933 | 9E9CEE362F5BBADAF6D8200835311B1063FAE4D6EC8325A694EC516AFD24FF99 | |
2934 | EEE758AC14E76FA1573462BCAA75D246AC363C412185D20CDF1539011C35D1C9 | |
2935 | B3B3717F6A37DE522943CF9B3D8CF284B4C0068A1ABD9B58FDFC20CFDC45BCA3 | |
2936 | DD054AF00C18CD7EAF8DFFD45C28A82C7B417AB7188BDB49A5871320B2EFE0B0 | |
2937 | 25CE25F3BEFB53856689A44D365C55218190B407B7BF9855ADCBEC5C0094CA63 | |
2938 | 11E014EAFA0D1BB324D3B1D94DA4A7AAE9D29C71E2D5F122F1C79726731FD066 | |
2939 | 6545816A5E05DE1F8DEF865DDAE0D80E9AD0120A0C81384AFA5BCAED3F8FF80B | |
2940 | B9F8C8A7517A3863034C312BE64AEABAD77A5269253883D460DCB2F0A3B28700 | |
2941 | 255BB96397D1D613A14C3368C9F27F3E42B887108793F4B12E2233E5A3620BC4 | |
2942 | F886F124503FE64421C1A40C37B25127094476713D39EB73004CB56E877935BF | |
2943 | BA0C7B095414A1FD59CA11573B86EA32E297BA38B907938B3A25992F0563022D | |
2944 | CF54FD863B8792EFB58A27DC2CA6C4DF48B9388F5676CD462C1AC745488F6BA4 | |
2945 | 2B923427A7D29935417E010099FEB69B16BE5A2AF7B4883BBA80815A09693AD3 | |
2946 | 2B78D3A939FF18798043F7C88A76BDD527B554BEBAEF922FDC9B381D72C7CD3C | |
2947 | 49698A1444FC33E276D3B9263CAFA375F1E64C8B39C89D4A65FC42A7183E41F4 | |
2948 | 1C3F0CF7EBBE5260F862EBBA059765497817B8597DECFCDDDA5C1D15AFD3C3D1 | |
2949 | 6F1A8E43709540948B1E3B41E32AC13B469222867483B0E765FB427300AE9BB5 | |
2950 | 4CED17DE5C45EC8391687036EF43D57835CFE689B99FA0B860E3FAA6471417AB | |
2951 | BD505F23013DBD726BB5645F3006BDAFFD5ED0CAA7428EAFB448E0A30F8B7858 | |
2952 | 311E3FC16FAF9FAC5E86998E4954AC4C9E32FBE6E9DF280B457BE80DDA2959A4 | |
2953 | 0A874282A7F9AE5236843298C26D5D4160A4554ADBD3EF0254C4F2D108D49DAD | |
2954 | E1D1B996D5147560D574FC238DD005D18CB32A6CD73C265F05E0AEA17C73E3F7 | |
2955 | 2FAA00290D1A6361CF67EEAA68800D9212BB5B8F0259FC8D133A21E6BD375FF0 | |
2956 | 4BB0FB1E78F065E51298E97164C1FF241336428932D1AB97E1D0ADEE93BA8903 | |
2957 | A8124A3169AE0B905465D7E8DF132D903C9B4C64074147F2BDB1F722BC261E10 | |
2958 | D366C246E8D664CB57A92883CD7174218655BA68D9919D0C8678DC4E7A7E66B5 | |
2959 | DD7DA4E011769991DA9D93311A06A623B680DDCA32B287104A1D7BBD05AA061E | |
2960 | 019BE06684F9BF987FA635B9764DCEC3A3286340A7D50355663D5556103267CF | |
2961 | 8CD9DDB4DAF109C47176A1E9443F3E2703788B85B6FDC8951783D08F02DF72AB | |
2962 | DB5F8739B2B9B38CC813796F48FCC21B0CFEBC8F074E464989AE5EDDEE5CC3EA | |
2963 | 69C281CC4CC295360FC11F67AF3746CE3598A215FA109709A4B193BFEA270261 | |
2964 | 8ACB9B7081A9D60CC49AB3F25B0B6F922672E58708BD707AF7DF35E32E7CB939 | |
2965 | CC25BE8392B3DF687FB67F25342671FA831264230CA39D189AB6267095B7CBE5 | |
2966 | 09DDBFD5512A8831DFDCF53CDA45E3F0C097C0C4DA1F12589F7AB3D83178E9FB | |
2967 | 2E9B5236ABD35A872EB9A37ED9545C6ADAF8FF2000E67AA8C8A8E61C9829F29C | |
2968 | 5555FA19BF6949AE81487EBA68E8ACB6244ED2EE8CD537155B68BD1305FCE20D | |
2969 | 710147B9AB3CCF6BBC0F2C3D8D77D783ADFA68B208829F05522211E28432729E | |
2970 | AE8A8C09C04174BAEF8D560D62733BBAF506D2EBA030AA77F18A38EA8E98B38B | |
2971 | C03B5A3C33A7B36EBFD1D55D503FC06F19056EEF9D1D01CE279D2BF23B04E880 | |
2972 | D6873E16AAA583ABBEF1EA8E5D6C3D038738573081E264C01DFBEEEF02B8844B | |
2973 | 19BB8D27BAD7354AD310ED720DE2D4240F3106275AEF6F7ED61735D799306DB6 | |
2974 | 4A3BECE20525769A0D99EB90D957297D5913CC48A98EEE84FEE5D02B30651CA3 | |
2975 | B7573DE50F1B9D8D50E5746394DA8C5BA5D71CF1647F80BC9337F00EC31476E3 | |
2976 | 1019B41BD01DE7FD55886402565F688D1E09810DD8AF982032B048548D87AEBF | |
2977 | B20C6B938C6D8F96C2D7B42A1E69DBFE6AC28D166804E03AC698B180A48503D0 | |
2978 | 0549D2DD2EBA5C601841A711DBE9D7019E5DE56CF78457F412E42CEEC248DC5A | |
2979 | C0F349903F745E40897D0331124749D0F9F9C71B704E4CB0898AC7120A880215 | |
2980 | 236800020AC60B1E5682656534F3332C2DB06A7510AEA061D9206B4C033A80F8 | |
2981 | 77DC8EAF7D32A7B791FA3930647CB1A29228DE62A9733C6AE072144BEFF15651 | |
2982 | 791C8F99508DA1E3F8B451985DC68251044FEF9F91C7578A2F3956D97D544D3D | |
2983 | 0E6A3F7719F9561B47D76612D833BDB64780728A6456E8CF273BB708FFFEF743 | |
2984 | CF069E55B1A871718E02778CA80A5D21597D597246C260AD390E5F4A285A5CCD | |
2985 | E55AE1C37589EE307C6D2E1DEFC605C9BC33511968CC8AA7E61F5390951087AC | |
2986 | F4376C5BC48DCB22D8F0CA6CABF25383616DADD012FAD655FF4198245209E305 | |
2987 | 274D18A98D760203C8AB09F7204A967D07B75E7650BE0A0595742F821F74193D | |
2988 | CA0AF1A4875F50D1F3F2786C5532EA3913B3589215386E78157D6F38C4860698 | |
2989 | 7DC51E51908A7AA304DF1233ABAE2B3C9B03F2496B320DCA5B7DE98FFBFD6FF6 | |
2990 | EFD2FFECDCEA32D0A7F799382366C6325B89C94B37CED9A1A1BC88602AC5D9BD | |
2991 | 1BEDB8D5CD2D38FD1FA33703C41F979BC24F1609B3B35295CF756551F9F2D770 | |
2992 | ADC3D23C5B7C6A777CB33A06791EE8481BF577A94016A061D8AF8882466F7499 | |
2993 | E66E7E93F104E599C79CB6F76D42608B9BC1171A9AFAAD93E846008330DC3C0B | |
2994 | 6E8BC7623E8693C1E7E8B5B8BC426B1EF8EE705D2E806486775BAC15660BDB75 | |
2995 | 66BD708939D23762BFB8628A863C4F9978F83733049F63709066CD4203476CF4 | |
2996 | 575DB5CA5B5F01D8E4DF345D78C2A938B5EEEE618507B2AC9EB9C4BC9B64CFBD | |
2997 | AECF052FA5D93B306C075AA8A645E5B93D1005C252F0DAB540243C7E3C3EE52C | |
2998 | 0886A5D89A30DAAB4ED8F38ECE11217F0198347E62BDA7A1BEB6D46482BE3726 | |
2999 | 33CFBB23A78756BA63741693D764467273078167DA48362985CCEA2889133C7F | |
3000 | A5B0BA827E92333BB02221F6757E4ACB8C2198BD7A976A29387CFB9B7F51C65C | |
3001 | 2E151D1D1F73470B14587A6F11AAD77465975961CB77306E7793EDAC65EA7AD5 | |
3002 | E562F2673FBE78794C9D38659647EF5189F6ADD9B4250085A59F84C0448EE47A | |
3003 | A073B712B6B1CE984DDE3125960C16AC77098424004666BA6116A042551B48E7 | |
3004 | 507FA464B21209D31C506D1DAFB628FC2AB30279E6148F3A2DFDD183FD770551 | |
3005 | 0CD3FE854FD619E7D2B62A8888C300838E41744BA759EA4E4F19AD5CD249E8DF | |
3006 | 74E81BFBFBEE42B2F67370B748B1B3FD5C6201866D8CFFF8D9ED127F43F4009A | |
3007 | CB5D9651587B54ACB8C6D410128362A74EB358437D0CEBB9E0FEA7FFC27A5509 | |
3008 | E799762B27F30B5FAA4ED3B492752B04702E48B1D0C55155157FD7B4E578A560 | |
3009 | 5C0343A472546826E9B9B80E91867D2D4C3EEC02133BC338954AC6B58499AA9D | |
3010 | 24CC3CBD2023E962D147618C08BBDDCDF36E91EC2D51D6DEB97A1477D8156707 | |
3011 | 9C1B858385FBA45CF0FE74563A5D5A51ACCC3EFE991429A8CE57131AD56F352C | |
3012 | E95401BEE11B310C96E9C3CFACACA00114625BA7B4400FFBC5947574317E8699 | |
3013 | 90BD8678107AAFFE1516A59027E9907359B61C6B8A97B4F99A338BEFDA2C25DC | |
3014 | D6413A0CAC46051E76BF732CFFCCD0FF1408DD26C76DFFB54F7745C79F3A7ED3 | |
3015 | 1D9F8BED7C6977067E6C8E46EFEC63AE0D3953175A6E51DA38EFA2DEF475DD93 | |
3016 | 1C34376F5C6C6218DF78EB84773361B9339FA58A88E96C646F291CEEF398D281 | |
3017 | E0DEB2EE21C3EDE0996427EDA0CA0A44247B1A0E03BD9366E75F763C9B1D2BD8 | |
3018 | 00D2066BEF933DC6AB3586EEBD04E6D750A22978ABE902200200B468135B690F | |
3019 | B840BEAD5EF80E068F6F87442D93848684A127EA79F4A8A24DE737A373ECCA3B | |
3020 | B405847430C138E51DC18C367702E868CBAAEF6890FEE68A75C5781F32B96D86 | |
3021 | BF5A0C99F04DF2B7FE968B6566BD816C96D7EE35A863C0D4635047FF09F68302 | |
3022 | EF62B9293BBB8BADCFA64C6CD9024C4F739C8C730BD62F2B613C6E1923F04BD5 | |
3023 | 62C556E3927411C2655045B9744C9DCB7F1DA9C1B5C70A145E9A35DACF1B68A8 | |
3024 | B5DAE1C62DF9220483F1DC721D559B87D7CD802AB539AF1BF3E434EBCB796A8E | |
3025 | 378B1139CB3DD3134DE8F40C716BA87185D3E406E3C941D336A1436D891803E3 | |
3026 | D2C8E627204A343811FA82FD1A232FFD6915501C1B158E890C534CB94FCD9ABA | |
3027 | F64EAF649056C1198F0F58F56D3E1C91C167D4D9B4481D48A12CE297D5DCD0BB | |
3028 | 8BE16BF18DE1D58F7D2587B70FF5734EF8391DC5F709BC39E729713CDCFC2EC4 | |
3029 | 5E7AA863CBEE1CE8185E657E7FA6565EBD6868F478554E96FA808A708B48E463 | |
3030 | AACC817DF43EB9A5233606A402F3A83FCE99F73B8DD819A4D014FB435BA7F23D | |
3031 | F2AC40C473A34FEAF0A5DE457AB5A18A6CEEE95A55FF604AB5225C5C1DB6C6C7 | |
3032 | 0C7647F075E5FD3CBA9F3B316887B4A01F1C2FE09719B4BD09A84C5A3DCB82BF | |
3033 | F5EE9FD0133F987FCF77098E0CB919CA7FB8468059FD35088B97705F180D5A19 | |
3034 | CDEFA29A02C5D3EC4893985A2478B0BE83B18FABD32654040A2F2A9BF7BB4F7B | |
3035 | 5781D2A6B5E416BA14BDBB481B3D619B0C885CB392111E32B2AD6C8BA13E9F93 | |
3036 | 49CC4B5A35B1F93B68A5ACCA4823DE44BA8979181E50A3804E43D6245488A15A | |
3037 | BD51999A729A20B9DE927F728E59312ABCF89176C35BDED4BEBEC14636B19989 | |
3038 | CB8BF2927C1BDF5460BBB09BA81FB83020BE4D4B69179C8E3B838D6763946166 | |
3039 | B328ED82B448CAB5EC2331CE7601EE8B39B334BCE11038B0EBD8437E5463C640 | |
3040 | 73C5FACEA06A219AE83515674CEF03AA2F5FEACF656ADBAB944CBB237813CDC5 | |
3041 | 06C303EA518CC59486410D65F5E5395DE84D0EBF8EA37633BECF5A08851B4758 | |
3042 | 1BAE6460B2B67D29A8F88FBE52A26DE7A6E6D859CA00BF437837DC123C459B9E | |
3043 | 43FB6DA6B79DC16C60F9035EE3B10E2CCEA9F7ED4FE29667E0559A3A34F6B550 | |
3044 | E4184ED8E953247B104DE7D912C5BF66F3259214FF091096DAD710C9F4EF531B | |
3045 | B4C6B3BFBB4715F3654587A5EAC63C917E100F37862B03EC240E762F2DF72CCC | |
3046 | 9CBF233ED204EB966F6A34519C0A169EA6130D18CB8E53EE96B7A63C828CFB28 | |
3047 | 45CDBBF7FD775137119B7C7BB2A665074691199B387ECF452A3DC5F859D4248F | |
3048 | 3A02D4D65167A9E6C92E0A16D293ACE234C049D98E961D14D070DF2A7F55C232 | |
3049 | B2CBF0378ED83686DF80E05DD417153A3FB34A7B2F0DEFA69A34E19CBFF56D1F | |
3050 | 14EB4CEFE99DE9CABC5F0FDDEDED79A50F29151294E2576CE97CA00F734702C7 | |
3051 | B94243299D8080957B7102AB370D5448226870CBB5DEA5A295D3D5C8F7D1B5C9 | |
3052 | 44E6F16F703E4CD3F74B37AD19BB53635CC4801A317C953F2A131F82DBF39694 | |
3053 | FE552FC18B94EEFC490A579F263DCF470D2AF1336C166F0FC69D84800CB1765D | |
3054 | 85937598431461E7B5DB95839BFA81D51ADE49E4242E2DEA4560DF41D27C7733 | |
3055 | 2D1F036614FA1AB505537197F419E6722D4EBAF5DB087FCFF838E782D239BE68 | |
3056 | 43AB130B26003747C36CFFE7A96CF8522F3F369E1E6443C923C4EF6616241DC2 | |
3057 | 5366259FA9FB2559B5B797ECFA474D491E96F2CF07DFCB0765A1A7B0FA8EB181 | |
3058 | 0A82708A93C8C8C2EC711CEB46D4A4D51ED42E6D023932F6C29F7E4D9735A5D5 | |
3059 | 269481F9A92673E88970CD15DD2F532A2D96C48150C10854F3A98B200612EED5 | |
3060 | C2074848780E53C5E086AB78EBD0444A064C5377945680900997D1739E93EABB | |
3061 | 520519269E2516C7757FFACF312E6725805BB2261552C760CB68A7BCDDA0438E | |
3062 | 0BD4E6DD87C204039396684FDFC4398421E1D94B110F2831AC0DA589822357AD | |
3063 | A78CEF72FAB2EFCC848DE7C5486AC56D56DBD0BCB39D608F40E0981572B9FB0E | |
3064 | 51F11778CDE7A9DCE029ACD63D61C22135CA5AC9DA490C29FF12165AE20F3127 | |
3065 | 9D57AF7441F31659BDA2872A720100F3F63D9CBEB596FCC23FE1BDC7DAB26FD8 | |
3066 | 00182A4EB8C9ED92B3BB9971AD01063CA67ABE06F51F66232545EA42AC145113 | |
3067 | 1BB165ED65DCC3A1C0E288FED14706BD7FA08D3D4F143B8B3BA68BEABE09225D | |
3068 | 2D0524B51E2D7ECDFAC0F8D66C7D96D885D0D87B7657F6134B3E7D0493E4BA5A | |
3069 | 6DD7591027A957EF7E04AD08B10D93205A5F268E65B30242AD7D07C2EF59238F | |
3070 | F5B6FB46BAFB04D0E354072DD934FC5C63A4FD47541A4BA4B68E531E4614BEF5 | |
3071 | 15AC43BEB87A1204B9BC873E9E79BAE958F4622077B7F7C2EBC0FFB7F7B6EA39 | |
3072 | C9D47152C26BC4A41188B367569A22762B8800E715416B7B396BB3B5ABC11A19 | |
3073 | C427DA9CC6EFAB2450C54030DC95A775422AF14156388FC0DB8901D3D13CB248 | |
3074 | B774DC8E8E36C7FEB216ECD93288F0520FDA6FCAC443C62347D680CFE38039F4 | |
3075 | 1D15F56B06632BB1E91AA8E098EF73D8A054AF1A8E327BC6E7D37EF19166633D | |
3076 | 1714371B2E916869E420A69BFC9AF4CCD3F1DA4569D3542AA43722748E5079E6 | |
3077 | EBDAD7306314586BB17C9C7FF0825D865AF14F0FB03EA08F5E2D22A97B9702A4 | |
3078 | 8A169602A94B3F08ED7A0CF6B9288E35FD989F2D0020411EE777702C408920E2 | |
3079 | 7A7F37E36734BA4937FEC3B14FB1FCC92BE0944C9D893929A63DEA8030DFD9BF | |
3080 | 86C40A4E5421C663BEE7F2C29248B4839E441AD9D04F051AA0991A6D6EC47280 | |
3081 | 10CEF96A41D329CB263A566A2D0C993FB918C6356C1249BC14BBE3B39596F7FE | |
3082 | DF719A7A9175B271E37F0C3B46B6F1A53ED40E6C3EA4313A7C90B65997EBD308 | |
3083 | E2F08EA3B7038E0694294BE05E9583BC74306255DE19846A692C0D0D64506C30 | |
3084 | F1E7B83EE2090F0B0C9A1DE01474DF9DC7D618193149E95DB2F6BD8C0DDE48C9 | |
3085 | 625313BC0C265A6A4BF5FC9598EF8E16477DD19068CD1AB4C52777E9CBD2EF5F | |
3086 | 99E28F5A2CE31E2924C196492A8E3319B1024C84CBD4FC175BE286F1F0829E3C | |
3087 | 7628AA9FFFB1810C93336E3749A818E46206A3E415139064C9C7D004D0CEC1F1 | |
3088 | FAB611B672C0EB951AB9CEFE67BEB2817BE9248F887836DB614BD26A59CCA79F | |
3089 | 04CA82700DDD8D792E89EA14D0B90FB3F8D6648090A39C99894C8CB638EADAEB | |
3090 | D9BC62555D36EBED36A39AD7601BCE938D26C84EB1A6302CA1111B0C362C7718 | |
3091 | 3791067E2B506460D1BE71A13D02451036C4FAD7B917CC9CB347E8FC30EDE59E | |
3092 | 8BF9874561A4B0E4235BBA799471EFBAAA64DC644958D1695526A86D56DAA3B6 | |
3093 | 8AFA3A1AA7B66C840DDA7860072BF4C937B37FDA41922388FF8B4E3C305335BB | |
3094 | ED114714115CFE1385261C6EF0EC27CE200A0B2434BE519CF064FD5860CB7395 | |
3095 | C934A9D7B06DAA01F039DCF3318F393E22AA8CCEA80F58094F5129B06A5856C6 | |
3096 | 9DB2EEB9B377135ACDD04876012CFCE0CAEFA831CDDE6B3ABF574573EB6D72D6 | |
3097 | F03D294CE59A42D5348781C90D1F0D8BDCF770E6989A939E3FD42A68D34E6B0E | |
3098 | A0AE88E2B52577B1BAA36EEA23071FCFB8FC4C41A8FCB9F8871F265D78B274B2 | |
3099 | D0D8F92D55011A124E037B5254162E7956465E96DC76D0CD96643AF172BD33A9 | |
3100 | DD48C30161EF717BA3AE6C7231F05DC4E330964C01F6BE6EE652AEE0AA41086A | |
3101 | B2FB3DEE6697965BF24EFDEB87D49BB4D617A10480CC29C978C953A0B826E470 | |
3102 | BC73AB39F4A8A94306CAC840DE844C60F650537E695C6323991AB9038DB838DC | |
3103 | 0264EDB30E27E3F38B9073C8F7FAEEEF4B8285FDFEFF1C7CB16E43C712D78345 | |
3104 | 813848FC335ACBA0768BCA0A9D57E99026CF04808F002FD842AF9DDD4E72BC61 | |
3105 | 4997B2B39E28E971F60F8D96B66D8EB5911B8856287E3CC2D24D662312C238F3 | |
3106 | 777745B73A30CF91BCAF4C6205808A2286285462580052DE31EC1EDB0BBDE46E | |
3107 | 5DBA461A815EEDCA60F8D64F7A2A84613DEB4C4745EBD6C04DAE969BF4681B5A | |
3108 | F95ABFAFD2E9FB49A8504348551E67EB6EED4F87362FF9A5CC9BF06478E815E9 | |
3109 | EB946FBAC21430CF51569E331E0060BABFC7B21535D987B480FE1264A3738EB9 | |
3110 | F67197E54D9C2B032A06AAACD80FEEE298763DF5CFD00E2814F58A69A8643AB3 | |
3111 | 3902057079A36C46D8ABE38C48ECCC6F7491D4D4A581A452C48CFC961DD8E85A | |
3112 | 5929131DD9543262E81C96631C7FD7B94C724102DE9C365AD97D6ABAF44AEFEC | |
3113 | BFFCB5DB96D395117A665FD30A70E8090C3883FCF7ABE76954BFC07E4467E5D6 | |
3114 | 262D9C949ADA532E94F9676D15DE90911D34BA384081A789D304584C688025BA | |
3115 | 4F6EABB4ABBD427CD00FF823773B11F283241BAA9B9719808D7FC5E77FCFFFA4 | |
3116 | F95DAA339D4843AD99133A1DE37103F386B4092343814923FCC22A87D8A91F98 | |
3117 | 3E72139EA419D61789C36D99A207600C188477278887467F15D6A6635BC18D38 | |
3118 | 53FC280A6AF75015E003E2C80F312FC1D967203234583FF829FF13890D62FDAD | |
3119 | 69DBF4D1AA69AB22A11A64662AFA11952042294C55F890EC1805936402B7C229 | |
3120 | F0A33C29453754544D92CB1E338AB7F3337BAFDC535CC93DCA0A049368B91FB7 | |
3121 | 07670DEC8F84592CA1B4B8CF94E0D6A64A0DF9C0C239382D283AB166206B1893 | |
3122 | 510E6320866A16450FBC2B0F82A38E460689EB07AD663A0785971D53E42EDD4A | |
3123 | 4BA81BAECF10B93B346B20FBAA70E4D15AFEFBE7CCA040D982A92E7853D055E2 | |
3124 | 065A09DEBCFA1B2ECAE26C38F8DBD378E976FF597397C27828EE0E6791B8641A | |
3125 | 95CEAAEE1849027B06DA878994B70F94C835444F6B69A2DFBD6E4FECA5160C53 | |
3126 | 7F12F395CBB410A6C92DFF74F8CDDAF64EFCF4F8ED9B832AD75E48B3F01DBFA8 | |
3127 | 86D7ABCC22CA3C13603580C64B639948E2B74654FC8AF03B4F56BC8302645BB3 | |
3128 | B682950933DF6086F8641FEA62CC01F451312D22F4CC5804EDCDF981F6DEE997 | |
3129 | BB777110A8E8ACADFAF6428096108F535472D856AF4165C255A1B43342202F3B | |
3130 | A72C931CD8A966D1898B78B12B14DBC0D3663983A9E2153CBC23184A4FDA6A0F | |
3131 | 779AF83DB6FA36FF6258473B17FB452EA4AB02F0D34C0B8C8E1FBBB35B680D94 | |
3132 | 0201AB0D0F0637DDE7031FDD239BCD083FF5A28AC9AAB7271D9179A8AE589B26 | |
3133 | A897659AA8E9CA50ADCECF5D5F4D21C7142D4A85678466CBF033D883ADF819FD | |
3134 | CD27E3A6046F3EAEF987DD9171440DE702ECFD3AA51C12AEAB971FB8E3128291 | |
3135 | 592A3619A00A4DDE933F960CF460C31AB712D12AE4A37357E42CAA235672926B | |
3136 | 00FF510B7686F013ED7841FD01805D2496293CC262F80E730D2FB94EF320314B | |
3137 | 2E9BFC65A17A0BCC2233F53ACCC3ADFFAE00F19277AFABBBE4D2E377BE54EC2D | |
3138 | 82038A9D3A35D7B13744E468A1AB3D0231D394EBEFF06BC1D52F18430F7F77E8 | |
3139 | DB47FE2A958D86452CB7FB6FAB65198AC7507BAC92FF4F46B97A265BB80E99EE | |
3140 | B2211B9989BBF73B1753B4BD6730271DB7679FAF4D3B223839094C1C980C15D3 | |
3141 | 2C9E74DC9DCE7CE0D48B1E2A8E2E3DEBE2DCF6FF7B8407FA88F59A8D572E818F | |
3142 | 0C6AEF5B4A99F83398F97B162429D82A62E2377361853F630E7D0A7D728DFEC6 | |
3143 | EE39A9DAD89967BF1579C57AB99CD78DE820C407CAE52C2D7E65C97A594FCE3D | |
3144 | 378AC8FF6F8867E8953FBE91D2D8131AF97821F28D6EAA5A9F025DF790FA0967 | |
3145 | 2C0A1339E953EEE5FC75F76FEEEE780F332A1C0C08DD80EEF52F1CB7E02DFE52 | |
3146 | 86F148A998753B27CB823FA9B4907B37007A5FDB8395AB3FEE7CCD947D1F6CFE | |
3147 | E81CD88BC9690E2F89F7CB130C9A2834F938B3D562A42CEFDC45A38E6BF62ADA | |
3148 | 1517974E61F6D35267795C7A9E945856824329B14E70EB350C997756A8FC0A8F | |
3149 | 7CBABC48C4AAF0A5D6A8F58AC190AC3F980C00D93FEFF1539D417AF2DFBE1021 | |
3150 | 2882782C625D2BD323B9E0D53F1494F8CEF84ABEE30CA90C251887075A697386 | |
3151 | 89F38001C3B2FDA9991D9A5EDA186C37DFBD0A77D47E24204981DC0A45B3AC66 | |
3152 | DD14D43A8A9826A0BBD96FE2279638F5AF12F010474075C381BE0243E3217199 | |
3153 | ABF00214D7D13F66411A6AB4FDBFDDF295163DEF72E788302F63FA8225F08ECE | |
3154 | 1F32D71BDBCC1ECBBC067187C9713C686E3EDF304BD3C58981C76B6943E66F34 | |
3155 | 2BE57CB3145FE9A286F570074DC259CDAB2A415DCFDCAF46FA3E195FD43C38F5 | |
3156 | A612D653E3F178E16D9FCCB637CAC9AFEA648AF52B945B9BFE37F241DF9DDD61 | |
3157 | 5425B37F903B079F337E8E15B70CCDB8920F15AF89538608A573E7C9008BE814 | |
3158 | FFAD305F0B94C7AE5F3DB35D34C04C1A250E89C252759581AD933896B468547F | |
3159 | BF0AFC136FEC40C7436120A944979C9DB4D492A52B0FD658E8083E0EACBC60DE | |
3160 | 67DCC01E3F87F04754223A34732D211B43248A5A5BDB19992CAF481A564DC9DE | |
3161 | B16CABD3BBF40BB4F84D67015773F7261FB175806DBA97597A0A8AF8920596A1 | |
3162 | 3C77C728F23CDA310161CC8573ADE490419AE08CEB622DB6883CF0B75D43F0B8 | |
3163 | B37715EB9AFD9CBA33DEC10BD2D78E541499738D77A6450B93B795EBAD5F44C7 | |
3164 | 311134D264B1881069ED3422281C15D1822DE565FF7768B80B58096D5B03D168 | |
3165 | 0158B52A52B7B5B94609793DB02F8EA785A2E0A039FE4F8CBA3CD0C2A934F2D0 | |
3166 | A2F862F75093FFB2743748EAE9947B5D9F56CA0D67ABCC01E4432BE67E22DE05 | |
3167 | 39664D8D7E9D732A897F03DF889A0D3C09E60C4F3A3996AED7293B8743353739 | |
3168 | DE1D41C5FEDC2BBF6662BFC35660CF8EA4F2C0DA06AE90AE91A9E0A8BC94D43A | |
3169 | B79F3778BB68BB937032EE09062E1C4611EF8E86CB7007F2AA7DD3E46A31AC00 | |
3170 | 8CC36771023DE9E9BB5483C051FFEF412A14A65F30DF95C91990408BBB8A1E6E | |
3171 | FE801BA15666D3C270F045A8178BE9E424998653471706D0D86D49967771961C | |
3172 | 3F62F1B6F36652DE97526AD89E748221893C9B6E5915C1504FF46B6CD09D85F5 | |
3173 | 57F881284D70C35BEA64731C99C0D865E2E9C9FFBD50806164157CE198DF009F | |
3174 | B560FA76FD75CF742308B01F8ABF13E7F9DF82298FE454C1F709387B6F23C306 | |
3175 | 61FD8651CA2F51C5F28786D6766B4339928115601BB265F6895712C39D4EB75E | |
3176 | 1E1EBE9BD2E808299CAD5092397B7AFC8B386E992AF8A47FB618101925514570 | |
3177 | 2CF7F3D9418ECDF120DE0D9B14BA35A19312BB4C87C9A1862E7AC946AAF7E0DB | |
3178 | 9126282D6813095178325D6F7510550788D387CC3F7936E5BDFC55543FC2AD73 | |
3179 | 0A47BF75CB6B625FE8F087C3E53330DA3EDA69BEB3601FE3223BF111C6235FC6 | |
3180 | 8ACA71E69693779A68F93DB849000C3915225B007E9F1A64211A66634F67247D | |
3181 | CB39A389107705AD40B0EE4D1E1AFB6B6F6E7F1D59D12847F748BAA026367172 | |
3182 | 61FB9E0FF8EAD4609047340623E92C4954683F777B761B09A1B6E06E13977B66 | |
3183 | B7D5B557C9E0682A0E4EB4B04EC5191E68ED14DB179A9E167389023CEBD2F046 | |
3184 | 05B7B10F352B91FBC1D499BC63A8B63A782692732DD2C49C0532E0D98BF9B5B9 | |
3185 | F1EDF5A5E00EA42DF50F9FF5700FA06DE26B5EFDBD15375BFB87068ABFD6101E | |
3186 | 4DCFB11A4F6CE0A126B1AF08A0DD21B487FCE447DB919FB215BF614D5027E67C | |
3187 | CBDD8B631B0755EF9B2F6E261D4EE7D892285D1579F3027F9B04BCB1DB28A8E3 | |
3188 | BB0E83592AB3BF25CB92A3BA038A91C5854402DD5C47E1F535750D1090DEE1BB | |
3189 | A5AB0785C67806FE7A4D1C7DA3A8D40E5F8EECD2DB7F5221ECC3AAE50BC607A5 | |
3190 | 6B91C718E2092102B2958EEE11B3FAA96868D425513142D1C374886E63A705EE | |
3191 | 6D996AE31AC5F89456AD296DD490CA6E63BA98B78E4E9FC2AB540F27D47BAA6D | |
3192 | C8BA9D2F10FB380F3C37575FDCAFC69F42E83301FCFA1DC31DEE29087614B306 | |
3193 | F158970D92374D7435EF08EFB3B32BECBC3C6C9FBD42951801B86C715A7FB306 | |
3194 | 65B90CFF9FDE5AA20F20BC8DA696E5FE7214E98F39D2EE60185F926027A6CD5B | |
3195 | 960579744D143C1A7BC8BDF10C70003858B2A6EE72F854CD35ECCEC8E92BD664 | |
3196 | F9734FEBD981C41DAA2A42AE83697E3B030C9E2C6C3969293D324A7D68274044 | |
3197 | 487004C3F6FAC5B64BA149DF711EDF2F17881864AEDE3E1E4C3147BB3DDB4ED0 | |
3198 | 2F79305B402E76F974CD56CB04A4B562DFF36B40DBED2F35D38DBCA5CE8DDD12 | |
3199 | 70C28A19C891D126927DAAECF16B2DF41802882956716BDBB442E9F062DAF65F | |
3200 | 6E3808CF58F9A4912209644195F04B4A5B209314017E96A700903AF6F4A8E8EA | |
3201 | 6CE36F67EA9139F816CC75A806C3585BBFD882F14028770670FEA22F34358E0D | |
3202 | CD9626705BEDEB3A0965697647220C1962FCE67D0D3E2B9FC5DA3C3861F84209 | |
3203 | C56B90CC792B95076CD73D35974433DF6567FCE72A24162B434208A79117055E | |
3204 | 53BE3CDCA527E33638F940BED805EE57A3526186F80ADC5B6ACAEE25E2081A63 | |
3205 | 3E6D985A8A6256F923B971E34BDA04D21EA99D34095AB201BF44B62258B19ECC | |
3206 | 45149754F896F64FBBBA939E41A11082C307165C5EA32F7C8CDEB80851B5219B | |
3207 | 7A680F7A8D02C9BAB72FE3B941E324F554E34F5DD5E4936250A82DB846F5966B | |
3208 | 779F29A9A4E53BCEA49CB4C6CC7D0034515E9F7B357B6AFC0FCC6FCDA1A34B5B | |
3209 | 103062647367EB77762F6B47773264536E40536C5DB2985C3048969F9D6C698A | |
3210 | EEB959112EC964BDB8DC3C6F307477C2615BB536C03E9C9B346A7916D1C69C0E | |
3211 | 116DD955FEE0B8F6A0B476DDF245B7C901473A96C2C53DFB5BF4833F984F4D42 | |
3212 | C06B6751BFA6D96E9493139AEE7BE7839B8CB2290735C80542C40D266283CF68 | |
3213 | 4DE60FABB54F29A930357CD2AAA60F5E85D1E674610F2E7C280401061AD47B55 | |
3214 | 5A1EA0B0196423DD4DC994CD41094818332B99FC9218B2D628E86983DBC5B842 | |
3215 | AEDB7362D479C940452A947973C8BCCD46588808F0F9FFC55EF2D75C1C075BF7 | |
3216 | FE6C21DF51E5F6B00D807B033ACD1C7C6A8B3CCB7332E5ADC93433422095C0C3 | |
3217 | 8CBDC619DC8EAC0382428C88443B16ED0DF49CD042D38082CDA4DFB035CE50C3 | |
3218 | 9271344F46D3765ACA3E1B2942215F559EF1E308DBC2AF0659DC980F5DCEC6DA | |
3219 | B33D596CB3F26EDD5A11D6647DB7AC5AC4FD41B62BC353356CD12DA5FC6EC2ED | |
3220 | 86DB312ED5C8323E1C766A0108ECE43C11D2BA0A63F1BE2B0A9D40EB995647C1 | |
3221 | 82D5C9FC55169F50121ECA94D1953CFBF9F38B1FE0C7DD8B786902A841F24A23 | |
3222 | B8762B929FB5AF021414A5321C7288BCA19A240EE15D106043DA19354C4EE1B2 | |
3223 | 434A967968C29B9125BE84A907D22B0BC2A2CD09AED00F3CC3C5C7C9AE7C906A | |
3224 | 7050756D4E67E11F2F2C14DE59A92C013849CAD0A1B6CD32C0CEAD2A4B20AD3E | |
3225 | ACF8CE2AA125F1EE154B79690659E1B90563E3884B47699AE1F7A71579C3C4CD | |
3226 | B66E6FA9BF98769452C5A2BD8B54112351F05BB77D3D3E3EE9250953BBA94EC9 | |
3227 | C0DAF20B0606C3CFCE4815A876F9CAB8A9A2E5662F7764050A0F5A7852B9AE4B | |
3228 | 5799C95B8718D481452AB4262A843E01CCE943DBB8377B7052FB397600962A01 | |
3229 | 25E5FA112149DF197FD9C8F16BE5819096B87CB3555969026B8A5F4FCDBF3171 | |
3230 | BB1D5F36E7CF89D94457F4CFFFECFD8BB3E009655D799C4F262FBEF937E5107A | |
3231 | 511677585FE4D4560C34F03183E6293EC2BDECF5DB400CD1A29BA1678083CBDF | |
3232 | EAFE8D078B72B42BC1CEF9FB5FAB5B2EAA044F5E98D99D9B907A3FE4E1BD4E0A | |
3233 | 2B845C58D7D0119C323AAC85463968D97A651A087DF3B6866EE0D09BA5583D8A | |
3234 | 8DB9837B487DF5FA27624BE3C7F17E6C734D294A1D200D971EAECF983A0A2378 | |
3235 | BC2FF6B206A5121EC01229C14E0C22CFE7371AE1007ED8F556B54347ED545D05 | |
3236 | EB488D7DBD5F668F45986703122FFF97A19523731B7D3CDFF8FE45ECCF2B91A2 | |
3237 | 0907AB03E8698E0E3F6D846A4417B9F66703DEC16AB8DE158431D3424BF6462A | |
3238 | 70085CD88F8BD3DF2023F0738FA6E3F36E752DBE7590F6BBFE1BA8092CB69B54 | |
3239 | BA30D871F6200BB9CEAAD3D6A5AD721FD4A48D002BDFD8E339483D6E32ABE379 | |
3240 | 914BE6B673F6FF3CC20BB2A971184433A714E802CBAFE2C85DD5F0E29B5F9459 | |
3241 | 16AFA7D594B373139006786FB5B8594D50C91217D49ECE8E684C292946D79658 | |
3242 | A9BC010ACED5F757796BB9C32F98409ECA6511351E340C2C9E3CE2AC1007A52E | |
3243 | 95E6DA9F56E11D4B0586F88A149FA8A2BE78DD25F89BF504A99140A7453E4C3B | |
3244 | EC9F94B300E4F6AB24C4528E029DBC0C61E116BDA8F0AE3108E3269A76927509 | |
3245 | 95B41AAF17DB3759D04E9F0E7CA4863A9A771A49293B1EE6CB38E33A125342D0 | |
3246 | 6C63AB27F308D08F60F4DEB8C0A335B115D25683F8AFF549598A3B1E88BBCBFB | |
3247 | 7C418723054B346E748DB987ADF0EB40FD0B8FAAFE5871EDDF9D68821C8C9643 | |
3248 | 7A3EF4FD3BDE591022C83EECE829BE8189C6D819708103BB96A29CD107F416FE | |
3249 | 3230C3E7E358722AFD9469FFF2C7FD9DEC35BE527B99BAFF00C799B99080BE0E | |
3250 | C88272197BFDEE472E29D1A197083F1BF10324E834C9D76190223E095487AB37 | |
3251 | 50BB4FC92179754DD1138F9A55269137543FDE3173BB57BF3E5A2C42F5C58536 | |
3252 | BF4FE748D9033B0E319E3061A7044883A795BFF107E9C12F2449197FD29A2BD4 | |
3253 | C5B7DBC42C28596D43CA57E4184250213D3EE5D447A0D8023E2BDCA6B095DAB2 | |
3254 | 3094B07797FA4AD49A4BC874F462D46F9DB4A21773BA0181B3482CF9235D9C78 | |
3255 | B967B280FF82EF3938F51211D5822F527127A5B4D7D643A443581EC8599C62A9 | |
3256 | A91D57B358D8787A39DFC4AD363869F6002E1EE878EC3573521ABBA11B6FAA80 | |
3257 | 2F73E889DE675B42463A8488C72AF383482D6509F49786ADA521F76D93C4A91B | |
3258 | 7A5B23417305F5F89FB34261C2FF16B3BF983B19DBAB9BB6B1A2EBA3C2AF80C7 | |
3259 | 450248EFADA22E1F8D18CBEE599C8D210498432C47CA067449143710A73DA7C1 | |
3260 | 38C859665D0D88FF0E4ACB573E954655B5DD4B8C7DBE9B8A3B2C4526872CEB80 | |
3261 | 45CB40C3D53F89ACEF33BF54BA05439AB4137D9F6A5F7CC983CC0344216AEE0E | |
3262 | 2BCED1790BF4506A8908E1D7AC441366E9938551A962C6AF4BF5E2E6B706CB0D | |
3263 | 8572EC4AC8CA0714A5EF6D4861932F42509F217477AC1547A3F96CCD15787A6B | |
3264 | B7DFFA17B0F44E83A08486E779A1E36B7748B17F2D09FE6D7717E1CD3E306004 | |
3265 | F69F2EE47DD0A9FEDA1D43558C8217FC810C109B8E55446B6F151D44C08FC996 | |
3266 | 63530C24C7F0B8A59AE9FB7ECD212902BD8E4115A6F6411266A57CA3F7532E2F | |
3267 | C631F18FAAEE1F1B7224B598AC585A4279155501B1BE29E06893A8C56DE80D66 | |
3268 | 4D5586C74C54B88D1B61602D44CAC618E21F447A3A17123F9032AE7B7854C08E | |
3269 | E63B5335540A7F4B36DCD11A47FC8E672E8EDBD9BE813702927FA8B0E0715943 | |
3270 | E1AD81AFDA2350A8D9C05295A208EAB36592672ED05E16C4D9392B3CDC1EAC2C | |
3271 | 526F600BACC7C2F6E0AD1283259B1388E83880DF85DC9790DCED3EE2CB06245C | |
3272 | 3FA795567CF8F6E63059D974D5E2DA8B5262CBEAE15984ED2D6FBE0C5580CD20 | |
3273 | 05640AC7C4D28C5692D3F814A1A90A7BA2633A68A7A9752AE74761AD428B19DB | |
3274 | 79133438C8E0CACA1624A5780A14DF07A74003E6EF75F75662EF6E817223BACB | |
3275 | 0B0B47C05B22016F6EC2E518EA8AF4DA0BDC4B02EBBA5D746CCD8F698E5F25CC | |
3276 | 47184CA13E1670BC214C44C27A70CE6DFBFA31B6C82B015C1A4F64F2C767960D | |
3277 | E2E40BC61F84B19C6F874381488053602966F43AE5058C0FAD7FCD563D01DC11 | |
3278 | 09C7252BD1FC94D7975F72047395F685A7FABA083130F64B8DEA9029F14C6AC6 | |
3279 | 874B97B05248E3D6A435711263526F395BA49D30A21D4AE548141E399FBAB5B1 | |
3280 | 6EE081015FE3C5663CCC484B8B4183EFB92E69EFFDD7F01F518569E03A72C4FB | |
3281 | 6772A0644FA922FC56B0B99B1F35832A11D929CAEC8280793D062109E3BC57B9 | |
3282 | 43E01331FCA8548A573FEB914F916BE1D06D2561296972C28F6AB92BD7C739FB | |
3283 | B1D5251FC46E2ACA742585DA6C13ABF373F66B51B45B44DB1471220A3C5AC33D | |
3284 | B1CBEA5B541B8C1AAEE38ED30735CB1C12D02DF0F6770979AE08BA566887CFF7 | |
3285 | 54C4AF9ACC382793D4BF251D09A088691EDF51E72BD9BF9F2455A8380D40723B | |
3286 | 1D90B78C210ED9972BA6BEAD25A7B240219C012E3757353802DA6183C365F51D | |
3287 | D94C2C57373A44EC5C422D3959C140BD87F1271405B33BB9747A78E5460A96DE | |
3288 | 2C1E98D4B4FD3A15E10989FAFBBA5C57644D6206CDB81493667B3E4FD684F3F5 | |
3289 | 8FAEC6F36B47625DAC46AF37D9A04536EB5D64B84D17FA194BA862BADF76E107 | |
3290 | 548B078BD5DEAFEC764E789E6CC8E78039801CC4716FFF5E7857B0FA3BC31CA7 | |
3291 | E1AB37C519A9EFC58DD1D3926226A3AB147EEDF10D63CBCDAF2DE66E4356711D | |
3292 | EFB9601764562A81D21D943A01AAA3D814DA167531C164BDE763F6E3D619FE40 | |
3293 | 4705A2A03672929945500B4D11F01ECB2B09CED1927029D49A9ABC19B23463EB | |
3294 | 0FAB85297CE11F97C1D560C5CFD27691E39FAAA95B468A502988BA484664EF88 | |
3295 | 2630187E829EAFC67146942DAFE5DD566A72FD6BF32B33F27B383ABF99F9E438 | |
3296 | C30F7CF8513F209A6B4E76F16BEA603005E8F71C817BA98D25B415B930988A1D | |
3297 | 4EFC4CC7BA7801869D53863261CCAF234BBC398FFC8D7F736F231E77DC9C0EA3 | |
3298 | 1AA359D0A1962649825F59DBBA3B5975D70B2D6FBEE024FEBB2908E47858568D | |
3299 | 4BF000D59D21F549FBC46726878B0123BC5F2450F60B092AB46065DDC9BB7D41 | |
3300 | 8E3CDB9982369E2CED9B88B58D47A94A108324E6BC009395CB656230FD9C5EC3 | |
3301 | 8631D1F70F5B29CBABA91706687A4EC238AADFD7BC3B43166134AC044E72007B | |
3302 | 8BB28A578560F256B2C9F818D948CD3CB57E351BA8F34834C164F3AF6F544B64 | |
3303 | 0DA5FF8D23E70669BE37DDD66EDD81132EE4AC92607D6309C5CDFC6D800FA012 | |
3304 | BEDEF9E53F5F3DE3B0955FF6D7F6AFAF7C5026F2B989F8103E4FD2E39176E5C7 | |
3305 | A50333B89EC266B1C39E2534EA4AB75B62B90962065D26D8958DE43A879FB0A6 | |
3306 | 316D86559080C6048BF798AAB878E578673FF67A92741F60CADD40265C658184 | |
3307 | A42E9B85997CC8BB4696F50CB08AA5F0F1A658041F6C32A0859B99E9B41A0141 | |
3308 | E9EC90FDA5A358995A7FE0F8E7D5B74F1CEE7C6EE8272B35BD242B5219AC103B | |
3309 | CDD20FB4F83F7BC30E2D0DC150B036CEB93C92908D53C6FD6D2D5BE1A1EB1596 | |
3310 | CD9374A4F388507EB1624048C79366F13C1319E410B9EEF4F33C5BC5BA7392CE | |
3311 | 852B8F2F649AF0781AD969BA91CE623BAAE3A45626D4A6D98F210C30C60DFB30 | |
3312 | 72C19559C54ECD9FBE406551B0B3C8B1833A8834E1BFECD87A20D90B25F4859A | |
3313 | 3A7A21054BD82BD20A3E2112F447ADAD7BDE83EE87ED04683DAB283627AEC13E | |
3314 | 450DA15C25855BC4ADA345C1D92CB5880AD4466DDA84568FF703A824A8EE8E29 | |
3315 | F0E221661D6BCF20BF046F80C044A860A2925E96063CCE02D044DAA35923E5FF | |
3316 | 6DAEFA7845ECDA7EB4D3145F0436EB4850AB3A65120C32BD2AFAFF65518A7529 | |
3317 | AF8B2E8F5DB78B7F789ED6144D3EE5588A64DC1709E64C69B3907A8B4872AAC2 | |
3318 | 896172C0119889060CFC265751C8A781208282157BA8F925BFDFE72E4AE0BB4C | |
3319 | D472F838F9FD40E229A3B36F18D96C99FE8D88CA44BD2702C5723D7BD75CA5E7 | |
3320 | E606909DC6EF9550DC7866C54E6F08F6993E6AC0E78CA0FDB60DB16AFE9149D9 | |
3321 | CE9E29E6461C1FDCAC59B0CA7814F7CB663BD335998F2B946407D92791AB32CA | |
3322 | BC3FAF02A19178205981B654FBC761D3316337936BB9C02F4435E9FF33A93228 | |
3323 | CDCB3DBD347E15779CEB58473E78A5AF2F234F2FF350FF5F2589FD2A3F38EA2A | |
3324 | 0411507AE1ED51B550AD45D561344D3A6470C9449E25522F261E9F861A87F272 | |
3325 | 250144D4A7FF42EFE2F53F262B4D50A9296958A5FCCAB2A72192C87AA4D7163E | |
3326 | F5C23005FB2BFDDBB7696A39A987822C4D71A1BCFFF58FCE32435CE6580DC9FF | |
3327 | F02B40A04772837D1C090B31D98E73E79D6E63D973AF32C762643D50575E99B2 | |
3328 | D2944583F89A5C23DB7BC78F34E2A23079DFE9CE9E9AD70C5EA9AC910B721861 | |
3329 | 9CD2CF56C2E9F92311D2F4319C4E55411BCE3D593188E4324A653B730C2435DA | |
3330 | 3D2839B68C3919AF4DFE343C1F1BE951985F50F264253552CC514B6962EA363D | |
3331 | CA92F7AFF2A2F64B14194F69137D3EE3E4854B0BE9E9D9400EF10A9F1B40A01F | |
3332 | 0AB88A7542A3F40A29B012ACD52C644EBE181CD24FBAA9A2687A182BDC142695 | |
3333 | 6013E51C2A8E561A067760B4696EC55E2DF1D6A04CEE65E74A11F712BCB2F8A6 | |
3334 | 9994358EC86660EC04F7DA6C7A133CAB415B034B567F36DC71EDD3DEF8F0802D | |
3335 | 437DC1488532EDEC290E147FC9279F4821F0EA2F5BA6E2A43B64CAF0B1942F33 | |
3336 | 215C18ED620C928F1EA7D0452613927FE3A78377C01542FBA8A397D0C6D6D26B | |
3337 | AEE8F0A3C15AE5CC927CA38E4C0CD2AB9C71B6780E5EE878523177130C291C70 | |
3338 | 75D865FD73B3A875F450331C332ED0205F74355A07C528AA047568789CE16005 | |
3339 | A3CDB32578707DFABCA888B476BDB2FBC69425F9157AE29C0E807B4D996DA7E0 | |
3340 | 75C8F714F2EF2803C456E2EE318F6111C286CC7305D2C1E270643BAD7587DC7D | |
3341 | 4030E32069D4CB84C8F07D0DF1E492E4F4C9AC6C71ADC174925CECA25FE6878C | |
3342 | 4C2BD2D4E3A3CFF16E0FCD8C308B759C2A4FEEDF484BEB0F5BB9B7895DC641D2 | |
3343 | 922631FD2E23257128523B31B369AEC4D3A63E3AB3DBE2F649BA1C2E4BB4F8FA | |
3344 | 7CC579D3C6FBF2B045EAEC3E5522802DF1E107179B98CDB9F0A9D400CC5DC89C | |
3345 | 561A93455644ECF841E34C28FD690062504AEF2D5E09E9E84230E93B56B741D1 | |
3346 | 1AC88BDB4E77B90D49DAFF1333758F9E72CC153F4F1823407E9EA929067E180B | |
3347 | 989D5B459D867D3B242CECABDA3439BA08BE3F96155B62E3323FFD874DB7897B | |
3348 | CC139739546D83739C5C1665F6CCD89F74CB7C07138891E23DACABD4B67AD04A | |
3349 | 1DA2D547378B8E77D1D6CF3A89295BC499F383FEE55EA8359544EF60ACF1F750 | |
3350 | 1C607FFAA1AA10A361DDDE23B2858E77C71F0FD2D47ECDE5E77CEE1DA878A8B1 | |
3351 | 40211679D7691011B81246ACFF2B487F106FEFF52E79B7B7B05442D846FA7381 | |
3352 | 98E1EE04940FD3446A516B47C815943870C9CA9C1B1BDA2894AD89DEA6E1B96E | |
3353 | 60C94BE49C89A0FC4B009AEAA8B9E658798B79AB404EB06515D23D0C83465473 | |
3354 | 4833AFB6B56761858EDBC5E125891D58DE477CD512943AEFCFCCA741D39CFA02 | |
3355 | E0CBD9045ED5FAF2580C39A1102196A85E1CBC67A1C56A7CDFA12BE2AD351D9F | |
3356 | 37D4783CD6A8B0EA717B5FE28D7B39000712E37E622A821D040AC927726402E3 | |
3357 | 63345131FE928E3147B83D619DA8F212E144B19EDA829C7F6CBDE636F76ABEB7 | |
3358 | 82658AE7276C2F8BEFD02188598DC592E05666984DA2BC8C9F3549E96DF45D44 | |
3359 | 9FC713AF972127020E99F95AF3904EAA898F4B67D19BA296AA36FBC14C4DC5AB | |
3360 | C88DCCE567002214C7518098D015FA37AF02BEA5D9F5845FE3FF9037C15EBC79 | |
3361 | 4CDCB7D79129ACBFD2573A884EDEAF3939E2D3D6967F1A0117A0DC6C8597FD47 | |
3362 | 01813A0B01D60D7709BC55D5DDFCB08F53B441D7EEC6544FF96638CF1ED431EC | |
3363 | 794A0E716F63233C0D80E8B4123F30E632AD427857EF57A6CF6A106F5382EF74 | |
3364 | F9088615AF05E3362609E86DC9CB58CD2F709F8196FB61FB4F82F9B1F0792B09 | |
3365 | D6AD2F194A9353F60EDE331B84B7704F0C797415FAC6F5DBD56D39B44A45D1DE | |
3366 | B6A2319784AF1B2A9573DB75B573926AFC074627FAA9E8B4BF773A802896CC96 | |
3367 | 65B535DDA172851A2F052934E7D7D593D3E2644444F7C635179D00536099420E | |
3368 | CC56526A9FBCA1B2DDFC48D479DD9A928197AE138735926D72737FE8EF7D1B21 | |
3369 | 6425B94AF20B5EE8BC00FD87705DB8DF11ADF16715177FE917C2AAE6DC1CE5EC | |
3370 | EBFA2BBC044398B8F85DF05D50BA8A53E97F44D6CCE9690F901A50B844416408 | |
3371 | 91F0DA30C55BC25008122D9A08EE92A8C84F6CEACF40591E4320A114E2B62F15 | |
3372 | 92971E5DD0613D6D323245F1DE0C5397802E88C79D9C8C7719F4A13902828BDB | |
3373 | 34D6E8D8B68BEEF5A4AB6A4DFCD93AF6ACE8C60A16A593474CB17982F611D6B1 | |
3374 | 3294A28699B8E8E73C27C68910AB90B2CC147944323A5F339A5844B674AD75EE | |
3375 | 7BA8094D3BFA4FBE6D1EFBBF7603607E38B920BF9CE43E418452E4D61A6D28C1 | |
3376 | F91CC04699210332A1555931106ECB43AC1FE2D08882F0E9180E5924C0335693 | |
3377 | AA13697E9F7F1091D71360D373661CBAA631992B3B2627DA5340DC655F712572 | |
3378 | FD675340127A1CBEFE3656AB4009BCD1BAE64048275146C32E79F031EEC428A2 | |
3379 | 0B786601B1B44D5BF9E464CAF224E5636B0D2D83EF07E81A545EE9A5F9A531D2 | |
3380 | 064EC94A90714E13760440450A6ACF3DD244C32A9ED0A65C546BA46C27FD7801 | |
3381 | C94F5C0735A1E9E6934D30AD680799FB3A761896C9E1F1BC0422CEEDDE021770 | |
3382 | 1837B9A79B0F8775340CE0C2A18E260F6C471E98A3C6E4AC73A148CAB6EFAB3C | |
3383 | E50F14240785645FEE335349C9B8D59B99FD884EA4A1C878A5AB6934511DA544 | |
3384 | 7D009675FD5B62F999ED528C3B70D337A7D93D4D14522D1270B5C345B5ADE5ED | |
3385 | 518AB80590221630B0E66A85B1DC67A6CDC6B3694F8EE53BF90223FD68ACF7D9 | |
3386 | A4106D543E16EA756EC3CF9C96FAD7E45A8966B8BBBD5B1E5E9509F2DDA57EC1 | |
3387 | AB2B457D495F9C8452376C11C649FE4015844D876967666AF9824AE5E3ED033C | |
3388 | D3DE8808897B223FB36CC42BF7867775B8B97610CAD61760B48C7F3F2DE23908 | |
3389 | 035EA9A89551B4AC734DEFF55D121AA9D365BFE4C621AC78344A11360E042213 | |
3390 | EE8F7EB0EEC8BEC6C9294D22467B5D6DB1A0B0E03F371E1AE162C5DD46DD127F | |
3391 | F8F75142EA07F5F5E3B4848E9F4B884F0257D4FCBA87797839A716CAAF03EE52 | |
3392 | FF4479EB9FA912146C609AD0784C7EBC41CD480FB7B3CBA7D5BB91BEBA43B5BC | |
3393 | AA5E4A9CEDB68B34B4EF7A15AE58EEBD677D7D2ACB6570A569F79AA9F8C08334 | |
3394 | 2575F0AD37AD980DECA14BD61D6D0F38DA4C8F5E4350778BE866AB63AA8260F0 | |
3395 | 3D9105FD3738B1C5417EBC9BE27027718016DAB611E3D06529A5F9C2C0A05371 | |
3396 | 3A7B87144805AE4E317F26B518FAC096F5A9BAA8EA45D77BE19CDD1E352FC955 | |
3397 | 1ADDD93B080C6E95DE94CE3CC6AE60E797B09EB9FF1EA0B5C60822953F8612A5 | |
3398 | 93923E7D7FA07A86AD52B23D3D0B88630B88D6E8C62D009DEF41CC7D95EAC8EB | |
3399 | B26AC8E3DCF0929016378EC4841E1C4F951059105BB7F4D9D827ABA155102A09 | |
3400 | 0242EDC57D050CBB9A0B6C5302B1534EC041093CF0C05C0E30F0B3513F3F5356 | |
3401 | 75E913640AE066B795197E009D880CF19ED6C92FBE4D9CD3C96C88A59F2097E3 | |
3402 | D9F0F923CF7537FC69D5C714DA5E53CBEF307D8BA7FEB8CAF2DC63B9B07D4556 | |
3403 | CF751C7AA7CB1268BEE3591838C5DA625BDD22B4748A2118B7073C7AC7A885A1 | |
3404 | 4996A7900CE4F42B19383E12F0BFBF0862E3A539F952038E1149B57D3B92DD18 | |
3405 | FC33B2AEFF202D53D5212300869B57A104AD5640DDE1A5E3F1240482EA9CC7DD | |
3406 | A63BE8B6DB82A2FBB5DFD31E72A6CED413ABA65C6DD3674A76E547A4CC9C1C5A | |
3407 | 504992A649C7F2AC469A9BCA5E9C84333AA74C686A863A05FB73110E466A34C1 | |
3408 | 3E3AE5E21B912282BEDAE14864E420B05F9E2EE8B1C523B362A4237929BF2D06 | |
3409 | A0D398D91ADCFD021113D4489736B4D8E703D77F2BB92973874EE461E76ECFE3 | |
3410 | D114EEB3F611531FF20CE6310C338C6C426F2CDE535C69E3F14CBFE16F48C7E7 | |
3411 | 7420777D9A175710174DD5E23B2BA6FFEC521907939AD66488857BE8021B385B | |
3412 | D6E1162BFD8BB36174E0D5C238BFD778BA5817BF31B2624429080A5B93AC98E3 | |
3413 | B6C5E9C792F9B1CBA7BBDF63277A28B6891DDCD36D0CF656C4F510C77AA08991 | |
3414 | 0545717C76D2289D77C79DB34F2FF22E29AFB3F5E9B6313A2F582E4DDD2373CE | |
3415 | 6064843D24FBC35B1A08AAD4A9B408541301166DBE585317FF2A8E15C25DA94F | |
3416 | 5A5B9D11F5F0B1A658648C529717151A96623F590FD41908A5CA20CDC0D75D84 | |
3417 | 6DBFD25E5D4739177AF9 | |
37c41ab1 CR |
3418 | 0000000000000000000000000000000000000000000000000000000000000000 |
3419 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3420 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3421 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3422 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3423 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3424 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3425 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3426 | cleartomark | |
45c0f7f8 | 3427 | {restore}if |
37c41ab1 | 3428 | %%EndFont |
c302751c | 3429 | %%BeginFont: CMCSC10 |
45c0f7f8 CR |
3430 | %!PS-AdobeFont-1.0: CMCSC10 003.002 |
3431 | %%Title: CMCSC10 | |
3432 | %Version: 003.002 | |
3433 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
3434 | %%Creator: David M. Jones | |
3435 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
3436 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMCSC10. | |
3437 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
3438 | % This license is in the accompanying file OFL.txt, and is also | |
3439 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
3440 | %%EndComments | |
3441 | FontDirectory/CMCSC10 known{/CMCSC10 findfont dup/UniqueID known{dup | |
3442 | /UniqueID get 5087402 eq exch/FontType get 1 eq and}{pop false}ifelse | |
3443 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 3444 | 11 dict begin |
45c0f7f8 CR |
3445 | /FontType 1 def |
3446 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
3447 | /FontName /CMCSC10 def | |
3448 | /FontBBox {14 -250 1077 750 }readonly def | |
45c0f7f8 CR |
3449 | /PaintType 0 def |
3450 | /FontInfo 10 dict dup begin | |
3451 | /version (003.002) readonly def | |
3452 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMCSC10.) readonly def | |
c302751c CR |
3453 | /FullName (CMCSC10) readonly def |
3454 | /FamilyName (Computer Modern) readonly def | |
3455 | /Weight (Medium) readonly def | |
3456 | /ItalicAngle 0 def | |
3457 | /isFixedPitch false def | |
45c0f7f8 CR |
3458 | /UnderlinePosition -100 def |
3459 | /UnderlineThickness 50 def | |
3460 | /ascent 750 def | |
c302751c | 3461 | end readonly def |
c302751c CR |
3462 | /Encoding 256 array |
3463 | 0 1 255 {1 index exch /.notdef put} for | |
3464 | dup 45 /hyphen put | |
3465 | dup 47 /slash put | |
3466 | dup 50 /two put | |
3467 | dup 97 /a put | |
3468 | dup 98 /b put | |
3469 | dup 99 /c put | |
3470 | dup 100 /d put | |
3471 | dup 101 /e put | |
3472 | dup 102 /f put | |
3473 | dup 103 /g put | |
3474 | dup 105 /i put | |
3475 | dup 108 /l put | |
3476 | dup 109 /m put | |
3477 | dup 110 /n put | |
3478 | dup 111 /o put | |
3479 | dup 112 /p put | |
3480 | dup 114 /r put | |
3481 | dup 115 /s put | |
3482 | dup 117 /u put | |
3483 | dup 120 /x put | |
3484 | readonly def | |
c302751c CR |
3485 | currentdict end |
3486 | currentfile eexec | |
45c0f7f8 CR |
3487 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
3488 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
3489 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
3490 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
3491 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
3492 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
3493 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BB89566A9BDEC70EB4F2 | |
3494 | 048A6EB631F05C014D372103E37FC3FA317EBC9973565A638403DA02E48B7D31 | |
3495 | CFF6C241DC5CDB470561002FF46437C06EF93BC99352DF04393C661FFFBF4BA2 | |
3496 | 0723ABD9B3E9CA9E63BA57EFDBAE684655CBBDBA15ADAE43E1A2C98A3CF060A3 | |
3497 | D16AF8FE3A49B50A24C20EEED716E49AF6013D4D38CD9CC41A91C17E4D04D79D | |
3498 | 567E1EF49110AA9C34464E95D81A730ECEB2C9AF38FBA6B45E253288438B4CB3 | |
3499 | DC75B3A906D4357293BA41E59C35223A6C9CBD6FF5FC90C2D07CBB376C7320FF | |
3500 | 435A6251822BFCBB612CE630EDF826C37E95F541C21B93FCE127591D5E38165E | |
3501 | 2B58A34AAE37712BC58B63FFD70AB80F4F24612CFD2F1466BAAF3CA2BCB45148 | |
3502 | D0DEA0E9B8FBA4C4FF5B8B3CB02E461355051842BD1C94F41066B9B909DB83B1 | |
3503 | DCDCBEF7CD00A43E4C0B8191A29600CA197F0BA227FB8309BB539D2A620BAC70 | |
3504 | 8A1AB2DFA51ADC9873B8E5582DCD3ED154E5D727D1665F99BD89883D69E6CC2F | |
3505 | DB3A57AEB612171A88E22F038461DE03FC357F771675E34E90D4D19B4B36891C | |
3506 | 9D2333960400E97494F4FC4DBCE6A73C34A0409E433BBDC0AAAEBA7D3555066E | |
3507 | 1CFBB4515C8B573C9B9DD12ED5B6ECEBE35AD0DDEA9DB004FC6CB540B5117B49 | |
3508 | 59CABE5FD74C6F5B6482B42C20B5FF0467D1DBD7CED2CC651CA57852B6FBB402 | |
3509 | A6764DB342889132C911CAA713A7F2FDD8A5E849345D6C81025E02F5B8B682BA | |
3510 | 90CC9B467FBC37362436EA6BF8EB62D784B01D5430147945BC09D1F49EE89F2E | |
3511 | 3E2B8E6D439248A56F82F2E03EA5C7A922F2813BE6538A3A423BEBC55B345AFB | |
3512 | 3B3C125306749E137C647D78028AE1FBF3E1A82C260132832A9668F454D39C41 | |
3513 | 736717DED0A99F6B11F005F0E1D07FE84713AAB4C042FDC166AA146D7B5E9198 | |
3514 | E4F485BE5B135EA281FF1C1E616B5AAF02771F58C5840CB5A427FF9794F93E94 | |
3515 | 17FD799C78AED1DC4810BCEF4C6C51D3C1504EA2C6F2B29805B7ECF97B5F637D | |
3516 | FE92E168CB9029E90404CB54FB312FC7AA8A9F2F524C03E61F03B1E31D4F061E | |
3517 | 1677B39D5D30C9FD4673E1723F4AE3CCF38593AD6D7F61E9DF3C010E51F25085 | |
3518 | 35D51105E1464BA146A78D7297D4D310AD91342A0BB942034A3EC0696B467367 | |
3519 | 3E39D202D637E6B14D0EBCA6AD3CF22B07D4CA69C0FCBB6C93782B2F0DFC5AC1 | |
3520 | 5D8A16CB5EDB671A0C1BA9D10F63CEAFCD0E06E42C730C8EF769CCFD57937245 | |
3521 | 658F486036D37E8BDDE5670A212FB488A8753322A5B170C9662750AA958C0BBD | |
3522 | 8E97D8239D2A08B30416504DEEC4E506013E037C91785C674F8A6A44E23FEE6F | |
3523 | CCC00CC5E4D355B0871FDB8ECD64F70EE32449BB5D6F84F8C8AA2D5B1A489BA9 | |
3524 | D7FF2DBAA8D0B84054E93D64D3E77850A3724824914A0F821EEC3D605DD851A7 | |
3525 | 606936B8B9E24D6E932E16C448140FE94DD96C75AECB73850035ED9C04A1D93C | |
3526 | 64B21E7D4657E030483EC5C3554AEF8BE4D0FE5B9743B875340B09E01273DAE8 | |
3527 | F256C50A1A8F2E0417440A8BB0173F59E11523E1CEF2593A4AC5AF2167627B00 | |
3528 | C5EA97D125EB8A4BD4C372877ABF10F5B7B149D73787E0834BFB3084E9508DF7 | |
3529 | 072DD71637019599252059738D4D6BC57A9358E4B14F6AF9C4B31DB8E25C29B3 | |
3530 | 7A15F9953BD73ACDE5F0445A5DC406BB4635FAE51C1D8202AE31730E6F355317 | |
3531 | 1DC197DB0B6177307C60E5D38F4487363EE051B2E609A52BC4D45B14B6558B6B | |
3532 | 5E1618748794B8340752CDBE7756C068975B559615D4CD5A97CE30BAA7B2B1A3 | |
3533 | 2FEF2E055232B24FD8A21BECDE1B6A479A28EC80AE2CD16DB50B30B4A6CFCF06 | |
3534 | 491C7CD5AC29FB964D4846415233947522676DEABDA0D9535F8507D33693930C | |
3535 | B4E4240A02B0CE7EA288516B8A6EF908D7F8BAF9012D052C6AC96D9F8F6ADB07 | |
3536 | 8984F3559C5E7E3022A957982155FC9CD599C74E18328D3AB46F9DD15D1C4C3F | |
3537 | 9B93ADB4489BA02CFCF57DE6270F3AD2F8597BE71786510EF08142F430EE5568 | |
3538 | 4F9DDB792B7C46B6135E341DBBF062FBC50FABA80CD4A384157BAE57CBEA9781 | |
3539 | AA4416323265168AC097DE7E30A0D4750143A4FCE70A863A31876A8FA5327C3E | |
3540 | 36E89589E363AA2B1A6E8B09F5AEB8FFFD0396067173465B6503383DE517A6EA | |
3541 | 88C0FC08578398C2A721E5AEB29F4AC9BC990A50CD87BD35A11F9E81F68E7B85 | |
3542 | 5E5B95A4F9A5D30379EF90D78E1E466DEF867BAEFC4F5ED2C762BFF099C1C2B3 | |
3543 | 5E0DA1C2FB33BE1379413CDDB1EE6BB3A495331F72F2FAEB8152E8AD5FD334A8 | |
3544 | AAB0082A71D5574B618EA8D487B8FAF1B445F3395B1E21224F5492A0E06F5152 | |
3545 | 7726835C900E2E52BE3B7B654183AEDEC68053DD0AF19EF6DBC10B6FC08EC7D0 | |
3546 | CC0E2C8FAF8C9A4C21FB7C34E074BBA4EE64226BEC8C928A784C1BEE35B72EC8 | |
3547 | E9295240B29DDC2539CD118BAC38DB3917D14CD33AB45FE47E827F2A2B193AFF | |
3548 | 53C5396C52CEA4F43F06AC2D08C74CC85D608CBA267175EC31311EE25AB48DD9 | |
3549 | FE811B411AE426C9FC0B6044D1EBF130231623F1566CEA4D1C06D8032FD9808A | |
3550 | 94479C842BC41B675CF6B90113BD681F8D43F51D5016D80EDC11D7640FB950D4 | |
3551 | E709A46184406ED90D0892A4CD9062938A8205697A200DBE1F38EB166EFEA0EC | |
3552 | 4FCB45CDAF82EA103DD6FDD03D146F3E42EDA6496064DB3F4FC1C5280C9E604B | |
3553 | D5EBCA08BF2AAC90156C11EF68137DC76502EBF216F3AF3EE30DD2676D218428 | |
3554 | F41C655093F8B530FCA378B5769F262A6FDB4B66B83F18F050E77227E28D71F4 | |
3555 | 5F4425CB8D51B3DAE872CD86D7804F870BC564A6DA1CA13EDB00D131CE4F6460 | |
3556 | 7021661B99612629DCC20C85CF155EDC5111E015A77B0B82A8FC1EBB374B7EF2 | |
3557 | 361419BA93B857D5C9944BB5B4AEDD86ABCC261542077FE09701C96370168579 | |
3558 | 5F89D5AAA08D700E2643E88C2FB8D1D56D37AAA9744872E7C050B4CE046B47A7 | |
3559 | 83F224FA9FD311C955EFBF173042C8FC66524135F579B1397828870D5C9DC71F | |
3560 | 8615FADE2A1CFAEA90F732B6C266E2F3048FC43EDA7A6B6D98E9DB793CF457B3 | |
3561 | F5877E7A055C92B0246FEA8C72B3B3456F93BF36E2651D32CD614C3AECC0B4BC | |
3562 | F824C8363E593A6458D37408FC5B09883B280005DD24123E2D4B1B85F4113327 | |
3563 | EEDD9186A4AF2CD6439B46C5C168C125CA80F9EE9E68906620EE126CFBF26E15 | |
3564 | B269838A54224EDCFE2A373EB750D4829BFA410DE5F1541E428BB1E024AF496D | |
3565 | F5F1C151F5A645C8622F2EF9088D57A2811868A8A8BFCDBFCE3ACB8463AC35B4 | |
3566 | 8B6F44E1C1232805842F56FA468F81FF37D5D55B81CA56058558544C142EB3BE | |
3567 | 07CFB1F75DECB1E48C14D6AFDD455989AA6FFE8B8DC54F462B3C20E31D270BCE | |
3568 | 8E68E2B43A6625AC7E9792704FAAD6CE8BBE0B341DA7189EBB3E9D5375B27FD4 | |
3569 | 12506D5BCA50AEDC6955E6C3C7BAA84BACAF7ABDF3A270C7734EC3C6EC22793B | |
3570 | E67B0E288F99699D38DA8B79F2D21DD97945FBDDD132A8F0BF947950D3C0B4AA | |
3571 | EB7B2C435AFE54489E1930610311D718AC610C21A644F34CB2D1959B3066F39B | |
3572 | EADEAB5CFC6AF4D191D86B02402B00D1C5262707861C5308730579795EB53207 | |
3573 | A291A27A8B5C4DAE0A87A0C6A260026CA3CB620E1002E066A515D7990F3DEA29 | |
3574 | 0FAC962E0B82B7A6C86B1EDC54007822BAECED673FAAEF88C8109777EB79A53F | |
3575 | AF3C58546974F2F56E70E9B5CB59ACB5C27CB01895557B2D82134D7F02029B24 | |
3576 | 3331621F38E68717F5CB68A8892D0B9C0A8ED4F8BB56E80505170D44C6856128 | |
3577 | 2DED0254ADA4875CF56B4D97372AAE730D4C77A2940DC8C178274DF88A9EE037 | |
3578 | 215C6FE7B9D481EE4DE809B124C0270782411ACCCF89906A8B143D0BA8B2CEDE | |
3579 | E9B90465C3E57A4FD9AD2702323450256ABD09A1F8C26F08480317C08B75B720 | |
3580 | 70A161C99715A35A94DD5C9647ED0F8A5337B774C8E54F9653AC859485A1FED5 | |
3581 | 37B725A7E4BA58711CBCDA6054E34CBD8E9F9460179DA7DBD243D81A1531FDDE | |
3582 | BF2BD425BD9DBE75EAA333B1F5793669A215549A774597E6ADA16D323FE5601A | |
3583 | EDA41092730009A99BF5B5AAE281844A6BF3292D4D4EDE36B4FD8BCAEB6EB72F | |
3584 | AC5D3CD53D0D621CA9EA8D254FDCB2B5161EE9E80B266563F669805A3A15271A | |
3585 | 0753983004A1ECC7FBADF62AFEA4DAB49A178C231759857DB910668BDB07CB3F | |
3586 | 7E8EC24901863088B3231EE3FA563924032C91CA9D68DB398F9BD9AC0C651EC8 | |
3587 | 9051C9F709CD784F3FF5951DECD7E869ACC34B83AECDB011E6594347855EE7F5 | |
3588 | 28811F744A4BD70D4E9077EA7EC19FFCF612689F12B34332857AE41F13E6D16A | |
3589 | 962DB9B6AAAC167B9FBDF0068EA13412F318384134B29F3F0C399F1973A3564E | |
3590 | F9C3C39B5BDD4C98D81A6CB476E565860B50704BD65ABD630A5F1372F2D826F3 | |
3591 | 3AD47C08B8AD3176A170C369EF3CEEB190134006D6135C5B8CCDBE1C11FFF1EC | |
3592 | 3F6D8C46E15C4F5EB9ED9F31A129594D542D40DC3815CD075A0DBB648D868AF5 | |
3593 | 15A05C4BDB28BF23653A3AD96CF6AFC065DCCCB23D5D9A945F8CBB539DD3BFA8 | |
3594 | DB8F1FBF9B6F25B41EB4309995CA3D5D6ABD70CBB4A2F0C6364E5439AD1045FF | |
3595 | 72F6B45A30BD3A548CFAADDCC6C15D46F6D783D3E520215751DC98335A4ED512 | |
3596 | D7D19235CDF911CC69F3CF4365B678EBF3E87C456A4E77339C74930083445588 | |
3597 | 462529C22A96A28C5CE87AFA0C981F26CAED5A1C8DBCDDA612624DBE0373F026 | |
3598 | 465185A4D8C73CCD8D71EE97116F8F7D341B87FD78F9CCB9FBDA2A7799711607 | |
3599 | 6BBA855AE9D5C505870DC85FDFAAA130A351D56AADBFBD6A7D52055E3200F8B7 | |
3600 | 8AE9A00092B55DEA8BDE224B4BA7FD4A191CB1FFC4CB995FEE1AC2883AB69E1A | |
3601 | AFFC09AB5B9AE311A030A5BA05E2213F9BBF016C8FA80689C069314D91274B20 | |
3602 | 53FCC65C7D7B3A7504887525BFFA060304931672A078BCD7F269595686310E34 | |
3603 | E1ECA868899BC402D17EC36CE40D5041D7CEDA77F7764C9D98793F5334F574DF | |
3604 | E93CB10A5E8ADAE95CE63D2339557091B4B4911A4987CF21B7F1DBADBC2DD605 | |
3605 | 8EB72473C1F2EABCC44E0D0339EECB55DA74085606C3F89D57ACFBF5755A5395 | |
3606 | CA8D4BD47E4EE8D8B882D3AB31A1F0C62E74654C7E041E4FF2693A38A9796064 | |
3607 | 46526B0A37E6B5BF8E48E80EDEF81E34DA8F6CC9025936A4D0E6D709D61B7B5C | |
3608 | AB550397117F3F9D2F5A542A64DEA8E1178F7337124D6B56BA92F659AAD694D7 | |
3609 | 391028731E01284BFEA635314A8DA8DF7A34EA3B6B2F8803BE6DCB423A9E8015 | |
3610 | 55EBD90EBAE8A00298B3B6B1C02BA516AF528122C1F2B07EF69F5466C2C36643 | |
3611 | 0D665D6561705509B7582D8301AF3C32E2F3B9433E3E04D62117C7E8A368BDE1 | |
3612 | 0D4DAA1C415B2A6573116D2A169AFEF700A83F55D88813585E89C94C07802BA8 | |
3613 | 3AE8F9BC3CDBFD9C2E35D062B1FD6E79E1EF104FC70B0AB09D12CA027F33F85A | |
3614 | 22F0ECBB4AD55FE8C616B82C46CE69A600E4F767BD7A9C5F9B37A3196B038384 | |
3615 | 5DEF76A8884425FE598A63AEB19FA698C2AF7CAA4983CEC789268E22BA051EE0 | |
3616 | 20A40633D22D8F707626ED30E8273EAAD1C065F0B2E1718B5AC853ABE09330C3 | |
3617 | B0082A71D557169BC1559B6D285A3499D41C4CCF1F74884EC3917EB9C574371E | |
3618 | AFE8578DDCA459B8D22C0188A8D150437B05FB92022C95EB6FBCC954216B5FED | |
3619 | CBC7C90B9A1F061376A9840FB64390A6BA99CFC8279A86A730C6DBFD14C53C4B | |
3620 | 7277D676BD42203677E9ABEEC8C97E13DAA626474513B06F8734DD784F2FBBB9 | |
3621 | B3B448B8E8221E380AB4A86D3A683B86A54129519D50DD4FE63B30954D805CED | |
3622 | A9A5D9A39C58B65B08E1C19555E927C6DBF7FD07252B2B57F62B905D6B488201 | |
3623 | 213D106A41033B26FFBAC2E616DA6ADA6D560BADF10E68872806CFD6F6E19D7B | |
3624 | 57CF1F7A030A7BAD374F16A977E0ECB8742D034ADAF9C247DA19C8AEA74EF6CE | |
3625 | DAFD6B1DC562FD3B77E4D008BDE4D8C7FCA9895DA1AC9EAA01C32A0DA712B082 | |
3626 | 9438E77230D38FC4153E1711417B918BA6CC03203A5FF082AF880F48518D8271 | |
3627 | C1121E4F1386B30A7F1BC6F10EA98443F8A65C867A109336B808BC9A8E2A75AC | |
3628 | F950835AA84B56F59DA4C8A18859C3B68F6B6DE09A6675F639EA9107BDB67B0F | |
3629 | 54EBC564BC2D781B61C14363A54956BA78A2BB89C9F966C94EEFC29EE9F4E23E | |
3630 | C0BF750144DC289F0DEE1F8A25BB52E54F656FAFEE4BD2DA57E1306BBE648051 | |
3631 | 1D0CFD6A23A3DF082E3CF13197BF1B7FB22B2CD427BB78F455C9634DF989DC90 | |
3632 | 7BB2AE247B1C99AB2062855B2948341B0F857ACD750B59E370A6698C6A1F5287 | |
3633 | 72A4A9628A592E313956C242DF8277EDD2F1FDFB07CDC104275FFBF796D7518A | |
3634 | DF49FF3CDEC3BDFF1D290C382F244DF18005ECDABF0C5C2C64EEC4383E2E07DC | |
3635 | 5C82587C071E59B46B7BEF31D268F39D9B12D534344FBA515E9DE8F166FAD1E2 | |
3636 | 7D1558967AAAD3829D3F7EC6938D20E5379F414532976ABA844D97A5E9078901 | |
3637 | EAE4D0ED1F4C7EE7A2D80D891A5013D6409A38ACFA497F5A169EB7F9F4890DC4 | |
3638 | 62FA6A89EA48267331F086992B9CA9305E16611E6AEE67DCDD588A25D37F45B1 | |
3639 | 0DE75C802EE021E574B64B3969DE2E5061ED9364B646C38D4BBA86802CA6338A | |
3640 | 94E135D2256920EBFB1AA22D9E90C7D16853F0DF9F2D942748EE540E4FCE63C6 | |
3641 | 5380D7AB4ADD6CB00FE8F7867E4862D8DB432F28331428CC350CDF7F447A65ED | |
3642 | D7683ECA35A22ADD06E9FE6BAF060913AEEE7B2B8EE4798E437698CC9EB2428E | |
3643 | 74CE73F84D0D2292DE709D71FFF8901C3505370E6F1D4E28E6B7372492C65A88 | |
3644 | 159371B1D60D77CEC93B272B6C5394EE1D2EF9969DB2838B8E128553879A1BA5 | |
3645 | 2884B0A596E8FC3D1E648B7E26A4AC57DF09B9CE09B2F91D8CA618CA52AB3DBD | |
3646 | D005A56A420366069B73146A6F58E88BA49671A1AB7C2070C3D42AA770285143 | |
3647 | 40AE7D7868C0E1993506B07C086AD7D4F28CE2D15853FC5FBCBF9425D8012B9E | |
3648 | DB6E1E5002517659C8DA69DCEACA94F368537668843D281FC11782F1C5F71977 | |
3649 | CA215349EE6F20565DE3D8D8212A40E1227A4B22965FA64A0B02C62BFDE97E6F | |
3650 | C3C54FED4057EF9D258C42D7440C78C5E0CC58A40DD74ECED4152F70A93CE71A | |
3651 | 1B3A57C46F74A6D27BF98C97CCD31A8EA487260F224A3E40F52C65490AB4098A | |
3652 | 7B9EEB54A5A415C8C88568F7D9EFE74BBB785FA18AA27D9201F28BBC477A20A5 | |
3653 | D1307AA78EB8C7CAD409AB64B29E4115E45F5FADDCC80CA74B296C4265A40614 | |
3654 | 37F2ACD8386AC0202D6FDB6711E8CB06442F209D781E940ADDD6D881D4F8E874 | |
3655 | 357C533115923B90138FFE31D3577C6AAE60D768970FAAB682CD0DCA3E9A9A68 | |
3656 | 6393E4B772691C1013ADFFC90C508D51B02D2518ADCC7E79F7DE5DF9D18B8435 | |
3657 | 6129064DD1A3995E5A6F45D78287CC10A0EAFBF47223494C5EA934B1BC2F7C53 | |
3658 | 686C5880303F9E3ADC8B100D441D944686E1FD811C646C6DD0224F6CF55FA87F | |
3659 | D132EF50450879A25242A18683BD6D0266F8F333F3768D1952B0F32AA75106D8 | |
3660 | EC0AB703F287E847CB91FFB88CD9DA174B49171822BDE34621CF41EA772230A6 | |
3661 | 3088F8D19CF2364A329162D39E166AC728B15800222E54C40FDA8B73C48CE82B | |
3662 | B2B3E7EF15157FB4510BCDD7EEBBE3FDDF708EA08540D94827AF3EA1B210446C | |
3663 | DEA9EE0EE9B4758863AA33FC296740F0DD9B42A45861516AAE6208F189D8CB8E | |
3664 | BBBDDBCC34B65A7D17B8BE932148C39084A9C71516582BCE25EBF7C1E0D84314 | |
3665 | 45B273AF903055D53313DBD159BB698038A397AEF418B4446739318E8D273642 | |
3666 | 095B1E04CC60718A2DC2BCD99B34202878786A58AE7C2F43D985874AB8A3F204 | |
3667 | 4DBD4B9240EE96F0487CB687830972BF302F262C6381B2C79773EEB152B712E9 | |
3668 | 34E8229E0B59788EB9B9FC1AC1E123751D1FF032610410F0847E6B9B9A575306 | |
d37a4722 CR |
3669 | 53FC00ED82D0BDA8EB008F2380FDBA06D2F8C0210A261508BA95DD600436E0BF |
3670 | 5E8A00CE3C92859961557763D413E79CDD37FDB07131FDC420EF525CC0B5377F | |
3671 | 9772D3876DBFDB57FE6275D187832F2B7A635967B201E70B532E85838ED3874B | |
3672 | 82B36AB9EAB7DD4D2B5C4140419CA04E87316E802CC93DE6336C22FEBE80C3A5 | |
3673 | D43A0F808E5E6A17F7BCF812FF5EE5AC1959E07F36B24C9192E375FCA3C0A84C | |
3674 | 1D1DD2093D4F151B9FEFBA90DB4E94A1D68E49DF5A715A5BE04E7B7D8C384D61 | |
3675 | 5DDD71F057FEF51DE7D002AB3BFE0096C47EB3AAC7B89EEEB9E2F9CFC6BCDFD9 | |
3676 | A438C1097D5253E49DC0DE5B6E8F976AE8894914BF8CAB5236C8A3BB2A437CE6 | |
3677 | 374D96AFC592F1238357817E1F2836EA763A3C0DEA2DD3F7D758BA61307C21F4 | |
3678 | 796A18638504797DD9A5131EC48DB0D23FC9A3E069B2FECA5B36A2260C6FED2E | |
3679 | 6EBDE3AED119EDFA96B837C56202ADF7F7747291A43CDDED6EB7DB5B9373CB78 | |
3680 | F6FA0B92BB2C17AD8DA549E878D8DEA681028539E5E2A223E2F9BA4CA09A6FF4 | |
3681 | EA195F1EAE62CC33F2282888962B9032D1C83EC4EDD832866A472426EBA6080A | |
3682 | 75E02F39CE0421C5C06B9D593022C23D675D7BE879FCE0B20A9CBB394F9D3815 | |
3683 | 9C847518BB8DDBF3A89D699C1FA84E704B02BC85D61ADA5E548CD8DBE269A3E7 | |
3684 | 03626A0FEE75E116F95B5D31C73BC852C5FDCF524542BFD9D05D8EB4B2A114E0 | |
3685 | C2FFCE282CBD87D82C1D4E64772B0492068B139B1795E287899CED7791EF5C8F | |
3686 | E77391C51552FF08DAA85BC8B9896CB5C792C3E1C4D44E3CAC1EAEC02E4B986F | |
3687 | E5059463613DD3643F8DCE2264FA66D712A0DACCF86DDAB315393219F5EBD18E | |
3688 | E220AD61CE3C67664615A5F9734421152382E8EA9CBED8269ACFFC37873BA329 | |
3689 | 20649A6F684D31BF37194952496E8B962B75B83CEDE72F0DAAB761120B710677 | |
3690 | F3AECF2A67F512F7C423B1DA012D0D0D44F009346C4953447950F514731830D1 | |
3691 | 59D01BFF4511CD0257D5ECC2CC4A859E0ED92627F659547C8F137DC0F49F06D6 | |
3692 | 02F624EEBDBC779FBECB1816A88F02B3565A9C3D42E919F755F3D80F6FAB681B | |
3693 | 585B5A49F62581EDE1D1DF1906007A8926932FE74FA2A94B92026DE9D678EA3B | |
3694 | ABC3C2EE5A3757317AD5F5CD361A511F4019CAF77C46C8FFE4615CD6CFDF7F8C | |
3695 | 8CD06F1A2DDBD3BBA03FBBF8DCC898EE71E7D19CDE66971150359310D0BB68B8 | |
3696 | 65F3E41D34C8D063A71C27B6C0F27753A9E35D291477858E5B734D72C40C4573 | |
3697 | 203C5529340CB56BC00EA0E02B3DB54173E6480D29D957E6735146163980F0A8 | |
3698 | CA4086192E6095F411939DD3FF19854F8F58B39A23D3ABA22BEAE05C4B6B6845 | |
3699 | 98968C08559A037DE955F77359FC39249C1149BC4634D10DAABB086A23D9A37A | |
3700 | 73A61EAB63BE3B1A8D8E76ED94E731169E892B469056757EC885D8AC4FF50E5C | |
3701 | 1D80EFE20E40E26006953C53D765B3BCB4C5396646DB3AEF01F939BD163ADD87 | |
3702 | FEB1E55A73722A0866DEC922EFF8B06AFDF2FC742EB1CA422822BB378310A994 | |
3703 | 794062BE62D5BC4D44C25655C902F4FB4FA63CE21E095E4DF3723CFE7D2D961F | |
3704 | 10A715B194ED855942588BDA460A28F1B5D849A34D85756CC8CE874E2384AD9F | |
3705 | 3A1C348996EA94927BCE9715A8B229C0D7FCC2C07592052796D7BAE23DF895DA | |
3706 | 1CF991E912EAC97601FD79F35616A1F23D82647BCB49C360740CF010CA4E8ADF | |
3707 | 97A9CAC032D12919CC167CA4C2E6C60EBB4AB87C8F2BDF71E28E91A9BC96056F | |
3708 | 5D905902AE964E5336CFDACC8C5CFC5607D75CA5F364AB8E9A65FD372BF15FA9 | |
3709 | 0CE1519CD7DBF31F92D2A078754E4BF90F3121F6F698DEC238404EDDD4EEA153 | |
3710 | 0335941E4EB8F08DE0104FD8633BE277E9ED26FC65D28FC1D604D8504B2F788A | |
3711 | 11E2206ACE8AB33D14CE9D4CFC917008D44AFA2B1877C3D42455593889867784 | |
3712 | 7CE696EABDEF95872F065DAFEFAC253F367D47127CE76FCB85BBF0684DD1663C | |
3713 | 876E68EC35B21593A10EA5553311880B8EF744014CD1ACFC067FDFD46978BA23 | |
3714 | C86FBA05CEB66E67621680BEE0ABF82364D4E3235A20033437C6B84A71FB34E6 | |
3715 | F8A160AC477A1302B4F98D00FDDB2A35ED9B315700669D9D8A3D254F786316AF | |
3716 | 882CAC6555A766281A0836CD45D8CD8245CA69729260D54C11DB43032A0FAC0B | |
3717 | 05869ED0A432CEF854FE665BACB0F780C9123B4DA1E1895F8717DDE4A58BD3FD | |
3718 | D214195066D4587463E839EDF667E475BC04EEDAEC41422AC9BC27C238E88318 | |
3719 | 7DFFED5D04AAFB1F63AC651B1A4113B7CE9838ABAF75632EDA8B5EE0C8474678 | |
3720 | 58898AD595ACD99029DC34EB4BADE834C04444941C3D8280B93951A9E8554EF9 | |
3721 | 5F0FAA218DD8224B94807CE2D8DF7E4A5E2B28C44A551DB0708B5D6D5F000B96 | |
3722 | 0422A8E953233296B6E5EA698921F1EEEBDF0C5CC72263663895940B4C1EA28E | |
3723 | E0E3AF21698D5430D6495E32E0D5F5E538EF835FBCF4A96DAD8F011B145584EF | |
3724 | 1C33809372DF602D1FB3D80A4EAB65897F672642E4317926DF178BAB6F9851C7 | |
3725 | 63613B3DB11FF07F9C7582592B620C7767D005D7B0C28AF2D309E6CAC222055F | |
3726 | 2C20A58AC1B407641B483D571B9E959A3AE0DEF316EFF7A4514D5313C47AAFBE | |
3727 | 82CC583BEB32F20E4C3A5650B58812EF357B68F26882D30A6BBEBDE64E2FD910 | |
3728 | AB8D974CE5C968C7D34390529F4714A9F1D2373DB1D912D418225932541FB250 | |
3729 | 9C74346749DE9C5662B1C40437E783A78A283AD6EF43B2C111DEFBEECEB17ED7 | |
3730 | 3630AE404B310F1148C82F4969A794D945CA5E1C18F39BB6F9C46EDC8BC3C88B | |
3731 | FAC2116B2338E1AF9C975ECC8474BCA351E3FDF89ED4352FF6A3D6C7EF7A7BDC | |
3732 | DD4B2DA9E7C77F8A6623B670963D2B9B9A80F8445E17B85194AD45E02FF10484 | |
3733 | 85E0A700BDE9F574487F9494B424646D48999EA67D469A22B9CB72123F31EA5E | |
3734 | 51C07370BFB1C5EDB4ADE75E7111A0116C212920F1362353BF58F33D7E8EE680 | |
3735 | DBF8085B46AFC40ED9FFD7AE756CB267D0F321FDB71F2DD35FBD3003E91E2758 | |
3736 | 3DED65748BE5CD0D2D244E8FA187749FED44ED0C71056AD954FCF656DE28E70B | |
3737 | 93A79EB4D7BD59E92911EC64EA794732A79B9908B7C6DD42C99BDF07AAA06E07 | |
3738 | 5CD6497C489BC56B09E44D22D0FE69521A9BA20ACBFDAB8EE718625711BF479E | |
3739 | 512FEC4A8F9EC7CF66D4CC44E2D0EA1235BF17C3D0AD6859385CECA3D4A640B0 | |
3740 | 762D325D3A449BF7115CE8469A493C494721D6636BCB9C55ACF1D0F3489E5534 | |
3741 | 4A76A8F3E3AD6252D8CBD3EDFDAC890A7B497286241AFE35B2261B66018A1523 | |
3742 | 4B9FD31AE07A6CCA6B91A176BC38BC03F97D71F80270E14B83B012FA5270B7B4 | |
3743 | 73F889DED2D4BFB24536E495F96BDF408E3840AF1567E9960A4F22F0B749749B | |
3744 | C156336BD7F349F2F82CE54B459462CB7C9846CC090E752DCDC871FF0873076E | |
3745 | 8885B0AEF490DB0C9FA98A8FDF84EDFD52AB0F992EEB236A79FB8FB52718EBA6 | |
3746 | E0D586512F81079D468A75336540163B966670B437304F3272CF6E49252662C6 | |
3747 | 419E8B2B14D240A1DB0CF6EF14E024F9D8C6882F865D7E007B46DB65E2E6AB1A | |
3748 | 22C5F096B255E91CABA7C441A3149FFB4E19BA97E5D43779C2A80208E279A91E | |
3749 | 8B8A281C079B819BBB6A5B1A62F34D59B7223D9FBB5F5E96F0D9AFEBD3CE3D57 | |
3750 | A4C4D2345776FCA140EA95242C8AF1EE7B93D2676209B750ABFCFC8CAF50F578 | |
3751 | 4C364CF8BC46839A4379624D56B7B917743E9D6A284E7B315D461ED66B262413 | |
3752 | A9AE1741C633A92061DF92AAF78A18586CDCA41248C586F7D272378F9CA76980 | |
3753 | 202A391CC9FD46794140F06CC75AF2F4986D690939E083CDF9B96D066B1EC8F3 | |
3754 | DE3B68AC8FAB84970B1A199B3F3AA5BE27ED8119F306CC5F26230C16E9D9FB31 | |
3755 | 1EE9D3F5175E4D4D7A8A2945000C37BC73816AEDE6F2AC0F09B788C9988BA69B | |
3756 | 82CF336482F490F05725696EB080E460FC03B3E28C1B3613C8E5FE3DEA048D97 | |
3757 | 4AC72C9955FDE282FA8C8385B30E3A7EFE247B48B370DCB439FA721BED19AF4C | |
3758 | FDC3D3543A25A4E0273419B6CDD7209FB336C1542BA56257E5D31B70529C12D7 | |
3759 | 524617868F4F3B49799322EDF504750D1BAAE307ABC4843704B64ED8AD4996B7 | |
3760 | 5193CEA660390527734BF1448AC09998E70FF15BD70F8B6388B0A987CBC783FC | |
3761 | 990F7A5EA016EBC024F12BC9812C7C4DD6E991DB89415A49D0B265E453732F4D | |
3762 | 2B6BB50E995E719B00DEBE74E7D1E291A739C4EAB39B5A61763DDB65BDA6E1C9 | |
3763 | 17C49BF1A76546BE0EDAAA17310AB2D01BDF059B066263C8FFBDA53281C882DA | |
3764 | E2DA35ECE5B4454C8031DBECD8675B60E54261A7D1F70560C6D8CBAB436EF058 | |
3765 | 5A0189426AF00AD7EB43FBD13976D8D769ED2639ACBF613A308C941CDB5A632F | |
3766 | F76E14224909A8E7E45B9B5A47BDC9B7B3E3616AEC4DEEAF2899A59B6E144802 | |
3767 | 534109EB0E3ECD270E417B2E9CD8D27DE637AC798ED5CCF791061297A0B218A6 | |
3768 | 1188C03BAC8DD8DD783BBBF8C4C9AE98E8F1EFC4684CA4BEE6D533458BB229ED | |
3769 | 4E31392DC4591DF2D2D07632EBEC0A5FA2C4508C1FD48D56EE871EAF4A84AC07 | |
3770 | A1E34CA2CD81ED369043998A23DD01301D41C582963F07EC3417F09ABF45844E | |
3771 | A74F386BA813F0AC462FE268407B9D2A8813FFCA604C342CE82493DAF631B2B3 | |
3772 | B6D3E9F3398761C4B958569F0D833D27973B07F9DA9D84AC512C284844C04866 | |
3773 | 74A325E4ED894F640B8F802097B7C6C4F04BBBC8A7BC6EAECC60EBBF4E676A30 | |
3774 | 4A5D0DE4AB45D0C913CCEEB8032D1946A35928BFB0FD76AE324E7E3CEB5B99C9 | |
3775 | 0A0A6EBAA6F6D8E4292F9C5408D3859CFDEBFC9413032FA1A6E194C5F616A3D6 | |
3776 | FB0FEB8966534CCC9E6D67DFCA105E8994810D8EE414DAFC80B8A95CAFA254CA | |
3777 | CCAA72B84130B5E485529013A35040074072A8A63B2F4384D976BBFA0A743C5A | |
3778 | 0A079A2CD15E598801AD121303CC37A2FD3942776FD1AA0805BED2B646D4D1CD | |
3779 | 9DE65CB859735EDC177C5A4D1A54C3E8BE7A91BCA91AB93A9DACAC90204CC207 | |
3780 | 8432E95B2C47654DA02EC1664566E2137860F16F798E0A1EFFC819F4304B0FE2 | |
3781 | AA54AFE0AF6CC26D417B0CC9E3F5F6B9BD6DDDE6A2D7FC4C840E4AEF73452D16 | |
3782 | 241FF01413DF2125BA3563B3A49EECC8EC4D0BF06283B3C8242F362A546E71B6 | |
3783 | 21F3C6DA63882992A14E295926387D66EA6D9F296455276D4FEF0CDC706FBC25 | |
3784 | 57169AAF546A1BC72114A3A6DC3A1A76CE001962D771C267864A987188BF6087 | |
3785 | 183573E3E9DED10D7023965D29F19C8950B6B9B83E680010995360E54911AAAB | |
3786 | 44D07524518EE59F58E49485E885F56FF2CF8D30FC5779770685C305AEC4262C | |
3787 | B8C0C194C26F5E122DF5E4153316C971460C3B3B336C1B72 | |
c302751c CR |
3788 | 0000000000000000000000000000000000000000000000000000000000000000 |
3789 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3790 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3791 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3792 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3793 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3794 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3795 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3796 | cleartomark | |
45c0f7f8 | 3797 | {restore}if |
c302751c | 3798 | %%EndFont |
037a8b7f CR |
3799 | %%BeginFont: CMTT12 |
3800 | %!PS-AdobeFont-1.0: CMTT12 003.002 | |
3801 | %%Title: CMTT12 | |
3802 | %Version: 003.002 | |
3803 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
3804 | %%Creator: David M. Jones | |
3805 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
3806 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT12. | |
3807 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
3808 | % This license is in the accompanying file OFL.txt, and is also | |
3809 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
3810 | %%EndComments | |
3811 | FontDirectory/CMTT12 known{/CMTT12 findfont dup/UniqueID known{dup | |
3812 | /UniqueID get 5000833 eq exch/FontType get 1 eq and}{pop false}ifelse | |
3813 | {save true}{false}ifelse}{false}ifelse | |
3814 | 11 dict begin | |
3815 | /FontType 1 def | |
3816 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
3817 | /FontName /CMTT12 def | |
3818 | /FontBBox {-1 -234 524 695 }readonly def | |
3819 | /PaintType 0 def | |
3820 | /FontInfo 9 dict dup begin | |
3821 | /version (003.002) readonly def | |
3822 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT12.) readonly def | |
3823 | /FullName (CMTT12) readonly def | |
3824 | /FamilyName (Computer Modern) readonly def | |
3825 | /Weight (Medium) readonly def | |
3826 | /ItalicAngle 0 def | |
3827 | /isFixedPitch true def | |
3828 | /UnderlinePosition -100 def | |
3829 | /UnderlineThickness 50 def | |
3830 | end readonly def | |
3831 | /Encoding 256 array | |
3832 | 0 1 255 {1 index exch /.notdef put} for | |
3833 | dup 45 /hyphen put | |
3834 | dup 103 /g put | |
3835 | dup 104 /h put | |
3836 | dup 105 /i put | |
3837 | dup 108 /l put | |
3838 | dup 110 /n put | |
3839 | dup 111 /o put | |
3840 | dup 115 /s put | |
3841 | readonly def | |
3842 | currentdict end | |
3843 | currentfile eexec | |
3844 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 | |
3845 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
3846 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
3847 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
3848 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
3849 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
3850 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1B57D05DA0555DF933BB0 | |
3851 | 7B42D264831116C06C79335D519461E7B0E870A6715E3D74A08D1BCF86E3BCC3 | |
3852 | A43FC6BAD1C68BD9D4AFCC06D845FD1F1E70D7A47F0BBCAECE8396E04591E5E3 | |
3853 | 4797F646AFEEB7DB548183F0B74C9BB6BA2AA04E7F5950EC8AE97C741D4B2C5C | |
3854 | A8E7A8DF5A36A30B5A7592D95E1DBC63EF33C92FE459792CED29E2B8B6919251 | |
3855 | 75EF62089BD7D44A6E1F9B62EC802FBE62B821DA1C3B2DDED45D27964AD29ED0 | |
3856 | 9FB7868F3A8FEADA87A8E42D52C1EB7229D7C79B60BDA263F2BDB025AE14A507 | |
3857 | 098FA274206BACFB4A0A7257D5998EE8F0FDCA79CB61DD1FC59DADD11E16BF02 | |
3858 | ECDFD706CDA1E72054D4EB55AF7BA9F19955886BC0BD6E0E3FE3769C94AF3581 | |
3859 | DFB2BCD67FE2892AF07E858A01280194D8DD7332B3D0A585C87FAB056C2EAA9B | |
3860 | 5AD48D1C9F00CEF8EF0D1408DBE1C03D04B231D7B8D5D998FE0CD7EE19828EF2 | |
3861 | F988EBF6DDBFEE00F04A4A1F4E1A55DED7EF3AACEAB5005F1962C724A017C914 | |
3862 | 2936E2E0DF26A55ACD7DD836C6035CBF07981C1BCE3615064F0540A1034C69B4 | |
3863 | E3908E76EF8925D486DF0B4A8E1F02D8AA99585A7C31847AB9382F83880C1C21 | |
3864 | C496AB2DF8E7BD4643B28B704B5F6B53429D3EE940A79135F5BF0396E5B46F23 | |
3865 | 42AF406C26D12BEA7A41F332AEB75DF43C15334CF4651A99F602036946B1B91D | |
3866 | 4BB0D2E51C20216D892C8173241AC8FD15A37C3CDD8AB4FB67D8565AFA61C068 | |
3867 | 95E3D6E46D7C09BBD09428207D506AD43C693F3C3D787F6A5C39084AE45E81C9 | |
3868 | 830900DB50DAD10A17E118FB5E9680B5194716A788FF7514A1167DD1A305FBE5 | |
3869 | 5925388A2E95AE46E8806E0F7B954D1A9F70EE29B069A9FEB0349298CE5311BB | |
3870 | CAB039C21AEB714781BBCDBF2FFCBE7C4750D7693ED142ED0475EE9DB5D5F94F | |
3871 | 4D4613E2C379E494464447C4167C625D70B9DBE4756DEF299974B704A3C238DC | |
3872 | FCD3AD96645559ACA5056F7FD695D2AA709960E30F055ADBDCC7FDF641920A9F | |
3873 | A279AAB98424E76D01937F9CFE3CF4E3779650D7C2DC38AB27FB81EB16C19B13 | |
3874 | D47E0AC60C83641CCC1A00136625FE274C6AC706B516CBF14C54000BC2B7BD20 | |
3875 | A28D40FCD6D9B321855BDA608E23BD365208DAB23983C0D8A7C9DDC28ED62216 | |
3876 | 12A20A3068D843B5FA016B8C6B9BBD36356BF85A128F96F0CE861FB9C998BB21 | |
3877 | E8624E3DE453C686D41DA7B72ABD919C5BE2F24440D11962C77742A8C0115A72 | |
3878 | 9E974E71247FCD58318A4347813D4D5A73CF882A7513E2EFE05CE8C7195BDDC7 | |
3879 | DF250B59AD14D02D2991E2D0CF2D0022EF52D78F043D6D7FEEC3E77B6982B1C0 | |
3880 | 8CE51E4D3C8342C08ABD84EFCC8239883D8E66CB0FB0BFE8699155B179CCD63E | |
3881 | 884C502F7F0496A01360C67D7A9BFC8533346485646AF058A743472B3276FB96 | |
3882 | EC4C82188A4A67763ABCE6AF7898C3B924A01118DCE34C77F22E62BB4C4CB561 | |
3883 | 75C93226142D43D5ECB9F43C3A275A52F9E5AE4C9BB9E614082AAEAC5E7453DE | |
3884 | B3F71F9FB747033E227E84E853E75E79771B71495CACE8F911329274CE752AFC | |
3885 | 46C993132BA8CF6B9DA2CFC11A0BD57C9A4BC11B7A6D68A4C346D9768E6A6204 | |
3886 | 4227F51932162DA350878EF80D0F4084C82CC61F3223010D771EBE7DEC1B80CF | |
3887 | 327393AAD4C689BF6A791CA2925878C51069C4F06ABFA42B66860082301FCA71 | |
3888 | EA52BED540116A9B12D9741A4C078F207F92B78923C7965A47A3130CCAEF480F | |
3889 | 6B4AD58077FBECC4F99F53BC1F4F24CF3777182A7ADC32FE3260C774E5244912 | |
3890 | 470697609A0726EECB72390E6C5C5A1204521D45316989E3C0B4D398958D4363 | |
3891 | 3C7A4524B500241161C55C4D8C4CB06034BD825AA2CF2A6895BB9A30BFF00422 | |
3892 | 553E4346A53B271C70DE5D0A5AEB92F81CAC1A0E75E47229AA80C8DB09EE3B19 | |
3893 | 6E9D3EC0E7ECAB7B879C652282A376C52E5BBF5D4BAF051A0A995460B7F427E9 | |
3894 | 521743E74783312E8D7100DE1F31C1C7C85DA33D8D0A626E6E6184DDD538EA7F | |
3895 | 46D50247225E036DB3E6072395C88026D429659DFCFC6416D22A9BE285EEA910 | |
3896 | F7B1B74275B8B043721A829F2D4FE6140E5AFB78F0CFCC27FF27ACE773131462 | |
3897 | 48B271781695D31C909FED024B2F3220C206B63601A1B02DBBE2C5D94D027982 | |
3898 | F9E7EA6D4B0A812D28855CF62D372A040F138069F7C28BE3344262EA72795CAC | |
3899 | 2CC8E21D1A666ABFED384875FD2D098066FF0CD902AD6725AECFE61B2CD83860 | |
3900 | 82E587B8893F5E09B155EBD813030499E534C050D6902E5F8BA296030512ACCE | |
3901 | BF19933ECDDA6DAAA1848686DAC81EC429CA7AB1A73B7DFEC0750B404F601F1E | |
3902 | 6755F07C0784A56E403C5962905E9147E44E8042C3858E4A91F7B8A71143263C | |
3903 | 21DC47E481DF1A38EC4A9F682FE059FE80F257576FEF3A3300A36BC27273152A | |
3904 | 78019783D0BC34AB29353EDAEDF48FF6C5DC27C1633CE1CE2C03509992549B87 | |
3905 | 75AE1100939A6A2F5AA2BC7C534357687DA72129B9C9F2E511BD95452F10DF8C | |
3906 | A698CEE0BCAF726111B63C4838F05AC5B2EB43D04115145CDBF2EDCC1EFAB612 | |
3907 | 5E35EF5CCC5F4296536DC96F1326B86C65DE657BA06E5B97BB7C4F8ED11DF9CD | |
3908 | 969FA4302F06A5D43B48D40D3DE360F6A7B8F329022CF5B13A33980E8BE54325 | |
3909 | 17FE37C9D78E73A74B5734231ADF0594A2E5F2DAD9BCB682A0F5C59507032DE3 | |
3910 | AD0C62E50C258F1F820ADF788D6611CBE6D1988D09D07F8813D6A3EDEBE034C8 | |
3911 | 05F7EDC5DD2E4C15B60FE9284E267C8F7DF53F3CC13C131201DE819049324E53 | |
3912 | 499FE93874A92EF07AD0121B8FDA88F7D60DE52E2B20AF958A77421F221F8B29 | |
3913 | B2188307F484E1832988059E5A68C52AA7E840D805E646F17DFFDCE1A2A8C0B5 | |
3914 | 2CF6F218A06EE1E2543461030E9697624B086FC6619205C04230CC8DADA60721 | |
3915 | F5C4622673ACA45BEABBE3941E7F40080D652567DED98AA3404A4384DA3006A4 | |
3916 | E8A9298AC3FEF04C92A273 | |
3917 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3918 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3919 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3920 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3921 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3922 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3923 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3924 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3925 | cleartomark | |
3926 | {restore}if | |
3927 | %%EndFont | |
50fc6e33 CR |
3928 | %%BeginFont: SFRM1095 |
3929 | %!FontType1-1.0: SFRM1095 0.3 | |
3930 | %%CreationDate: Wed Sep 12 2001 | |
3931 | % Copyright (c) 2001 Vladimir Volovich <vvv@vsu.ru>. | |
3932 | % See the file COPYING (GNU General Public License) for license conditions. | |
3933 | % Converted from METAFONT EC/TC and LH fonts: | |
3934 | % ecrm1095, tcrm1095, larm1095, lbrm1095, lcrm1095, rxrm1095. | |
3935 | 11 dict begin | |
3936 | /FontInfo 6 dict dup begin | |
3937 | /version (0.3) def | |
3938 | /FullName (Computer Modern Roman) def | |
3939 | /FamilyName (Computer Modern) def | |
3940 | /ItalicAngle 0 def | |
3941 | /isFixedPitch false def | |
3942 | /Weight (Medium) def | |
3943 | end readonly def | |
3944 | /FontName /SFRM1095 def | |
3945 | /Encoding StandardEncoding def | |
3946 | /PaintType 0 def | |
3947 | /FontType 1 def | |
3948 | /FontMatrix [0.001 0 0 0.001 0 0] def | |
3949 | /FontBBox{-188 -320 1445 942}readonly def | |
3950 | currentdict end | |
3951 | currentfile eexec | |
3952 | D9D66F633B846A97B686A97E45A3D0AA052BD0CE60552BD63101D7CDBEEF5B11 | |
3953 | 69C468645FE4ED1AF2541AA0770C1DCF81623DE0ECDF49F2B522618F650CE6CB | |
3954 | CC8C21885DD61AF8A523AA677EAEDDFA51A1F9B1885EEE0456196D634E04EF89 | |
3955 | F17499DAD982502ACC349B9EEAAE4A71A73D1147318C60A8BAC10510DE90D8D3 | |
3956 | F46E47295D27129A5AFE0C65E22BAD10D06885A2EE623FF8E1D90287A083E00C | |
3957 | EF25195F68A2A98170E48759F33528B839DFD4B92DF0482493852D12053A7904 | |
3958 | BF6E144B9488970F220C299E80886366662C1276120E72472BF84082B9EEC729 | |
3959 | F7007ECDC5A850C88810EA679DABE81714004E65D938DA9ABDF29C949A52EF02 | |
3960 | EDA8451563235D51286E9133FFC7A27067DF0332ED614AC2D4FAB88EC84E6CB9 | |
3961 | FAB41C933E84B88097BA8742BC30A81416D1CAA3545F08E2554B28362B99B79E | |
3962 | FC42281922B94604AABAF5F7A9B8E2D9A4358F38F2382EF9544B859D098DF243 | |
3963 | 034CC475CEDEBF0EDD0A60C907127BB32F7D85A62A44E90B4056D9B4B2FF3A49 | |
3964 | 786032C6B25794E2C0003C7852C6B0688351FBFC43300FB0B72880BB7B58BB61 | |
3965 | 3D1064E7D4DDB128A9B38EF7510B7E5F82BDE39489E2D1DF08816781B13836E4 | |
3966 | 89390F84577F31776FE43A5F94F817A4AA4A698AA4AE84B178FCB65F1B5A5CE1 | |
3967 | 334417595F6E40849041565BAA497F6E4B8F4305D849128C9A26A98B909EABE9 | |
3968 | 8F2659189ED27C588ADC7C744712B4D9AD0C5DD25D1233E979DE7F53C5F1C47C | |
3969 | E9DF254086E5EC70EBC6B7E080060BA72F15E6BB75C75011B15B7ABB6BF761DD | |
3970 | 428FF1BD688938C75BEABA7DEE2AF49364D2E198FDC7F8FA2313BBE598ED3703 | |
3971 | 7ECAAA4670BE3A85C693ACA829A5936778BCDCDB38A5981D4CAC8994E2B2F086 | |
3972 | 26D8793AC1393D49A8F2FE391F0EF8899F63CFA5A77BC739C867C6CFB9A226B4 | |
3973 | 620AED34573F068052604331B7E8E1F0C3BC0BD7DF733F056DB8C3F57E3035BB | |
3974 | EC82DF5B511453A952D429AC721A4F94D5C9BA5B83545948643D0596F4C6C9C5 | |
3975 | 796BEC7B26EB9D729F337E0FDFA91E5955585C330D0C4F193FAC870A28CE054C | |
3976 | 8942BDA170717B7AE9927C936DF0076507F55CA2979BADD3EFACC0A599933EB6 | |
3977 | F148BB7C3D61066CCC93A5856D253D759F30E37534743210743F0D53F58D0B45 | |
3978 | 463F053E19A16E5A1B111915D1E664802F8C6C3ACA0F1BFCF3E209D1FD6C79D1 | |
3979 | 5D867E142AD6E69933768274F4E2AB57CC518AD5A1C120887EEDDDF18C291BE7 | |
3980 | B3DB17E8FDB124B11B6142DC60F560DDD668D700614732F3FBAC4637B9F41361 | |
3981 | 54CD2D8757A9D9BEDD1EC72FDAAED3CE4A1144F1E919FDB952BA7CA1E3D31C3E | |
3982 | 9E434E2E44E7A83AE3480EBE89E0881584045E4AA5814897382EEE5FB5C9410C | |
3983 | 2DC7A2136551DE2AA713487A77B911A7E7AEE41F0BEA1FDAC1950473B1394479 | |
3984 | 513741DE60091BFB9751C780D99F2DADD5AD8283DC9CD1C81B902C9F3C9C3EB9 | |
3985 | 55608E09D6DD423540BCF72394A24F81135C9D9063C0F4441BFE0120E03558D3 | |
3986 | 4A16744457EC281AB2A60432C97DEDD16B2F1FF4C1A90D72D46C9F9BE984C6E3 | |
3987 | E239F98B59A938C2A6490889B437CFC21D923572530E41B7567A9C7E2464DB2B | |
3988 | 18FAF3EB7CBFE7BED6E77219C0366A7D54D469CE3FF62E75FCA2ED6A46F3E5C4 | |
3989 | 489992EE1A42C19DA52F0CB2B1A6956BB3F1767B97FDF225685FF7C9E9243497 | |
3990 | 144D31ECF634CABABB79E323CFD483BD7A7B0C2679A9C3DFF0D44F09F084CF3E | |
3991 | 886CBC91C5386A266730CE2AF3863534E2450583F6ABB520C27C4EFEA01EBC8A | |
3992 | F019D25B7BDB40CD6712D7DF2DEBF0BC70A92D3B64D1FDF723DBF3D4AE939E96 | |
3993 | D93646BAAE0BC57BB244AAF47ADE59A5228F057192D917E2BBBF588335E09095 | |
3994 | 1CD4AA406C1D10C8EE6812DA676A8FD166461064BE4150CB95C41FC055FF8FA1 | |
3995 | 89A4BAACB0B978A58EDDDB0CBEBF6566D47CC0AFC93110751B59EA33AB5D6EAB | |
3996 | 0DB9A65CB16A053495F06B0D49A70BA8A7826EB571B8428AFE5EBB99AB9B56C6 | |
3997 | F69DCC77C25BBBB53FF25C5DB5CB8E742E3C0BFC25098B4CAEF12D299C886881 | |
3998 | 0D4EB71D637BC0CD4D63BD6B4F5FEF9B083D95C34FB9E7BC9FCCAC0B9C7D8AB1 | |
3999 | 1816B17AFBFE1DA146662723887E435E17AD2E2315AD800EBEE700B3C12B50EF | |
4000 | 4A48C2839AB4BB367E908F59BB5AB88635C3E1B89948BE9F32EFEDC2E439CC79 | |
4001 | BD9754280477F7C982850438092D309C213D70F8D476728119E8FA03762C22B8 | |
4002 | 89AC2A2A7C0BEBB0C91CAA95BCCDF91AA918766C82A978B7313870327F89107E | |
4003 | 11A44FF02F597C8D4B085F6D7A098233ADADA521CDF34A78081F8965DCA615FB | |
4004 | 55DB12C1E3459E49C273ABD2663B13447365C9C1C52E192282E96049FD58506F | |
4005 | FBC9507DDD77014C29275D1352CD5FC765853E858A5781F2DA41360D32FB5A54 | |
4006 | D04E088FD99F8C01DF740E587AACB0E431E03E170CBDA9FF1FCDE8D9FF5E43A5 | |
4007 | 73166AF5990B238122AB322F709FEF2F0E2FA7C04FBB62C5383997BC9CFAC8EE | |
4008 | 3FAD26E788DB37ECB388CD80A7D861AA9E9199E7BD065BD7A4D21A0D56DA9323 | |
4009 | 2AFAE158CBB662283EA7310D32FB5A54D04E088FD99F8C01DF7535A5156B8344 | |
4010 | F1CCDE84A46AB2CC7F0CFD113074A1C4D90758EE58F61589051A0150121A7BAB | |
4011 | A636171E6814A1398DCB9F13FE9B11ED5A5F2EEAC14E0C831B2540D10BC0EDAE | |
4012 | 833A83965A33180B0AEA361848DF8FE8E50DF6856F1D10C8EE6BB5198CFB7607 | |
4013 | B6B044160CBE8D4CFF067DF3579918B19B9128C2A83512FC0567CF47B38961BD | |
4014 | CC60FB8C6330A30AFEA9B276DA89313D6A83343298F34461B13C382575BE392E | |
4015 | F94E3EA3004D6D37C025DA3F1846E41606DD510D2C7D0BE9DD194E46BE7CAAF7 | |
4016 | A60D496CE85D2393457C50B2D586E010C7C4C7272F496F0CED0084EA956455F6 | |
4017 | 2EE57D13B6485B968190360A3E30210D2664BF91C73AD1A811651CAC09A9DC0E | |
4018 | 3A328E1DCA16082699B41A3D533703E58E366E871C982F262478E41DA3483028 | |
4019 | 6BDBF03E444C6F0F4DA2CE9AB049F324F887732D21C4BF9C5365C603C9971CFA | |
4020 | 7E45249203329FB9B4054B163C166E1322DED12CAAE39E289C126301D25076D0 | |
4021 | 2FD409FABA5247D7A25945AD5881E18C2DAEC09606228CF925557DDFA155400F | |
4022 | 8D446CFB8AD19704B6C544CFCE47ACCB854A74DEB5C646318679DD738987F800 | |
4023 | 96844722729076811B5054DA998F9AEBE37DE5068418F41A007E645599C0BC21 | |
4024 | 8363573C695B3F68111CE4A6199C8BD40D61E46A153C3C25D0C7DC125415D125 | |
4025 | D0C6130BB6B603ED78153E0CFE7384F7481FD4EDA141C27898B3636398EFBBC1 | |
4026 | 9E81060816655B2F7052016A4C72A6A1CDB83BCCB2EB475A9BE17EB08A5ADA04 | |
4027 | CA8AACF6FE68BBDE580243B111BE76EC06E70CB7751A8B206143D0134BF52670 | |
4028 | BB3F44DD8AA7D26283A483CB46286EE0A9BB4FDB0337342BBF362C236C30A120 | |
4029 | D85812760265E3B283F48C05E78F47CF5C678F54658A30EBD7AAD5840F3C7B9E | |
4030 | 21D8CA390CFD164792FF2040E07FA087FDA110A93430C7FAD65C951AEEF79D91 | |
4031 | FC25EC950E250511BB22156C2886A249CD442575934D385554B2B4534AC28C31 | |
4032 | 43A657DC937CFAF3F6C87EF4F2826BB02C41DB634D91B70BCCC4F83F4C32796F | |
4033 | C5664490597DA5F2CAC7C0013B18373EF51520DFE081F95E0C1693D02E39AA2B | |
4034 | E356FD312C233285B2A8C8C337504C1EA7E9E1F6BD250B5874842F68C92DA11D | |
4035 | F74E6068495709EDCC6E4BB3A96AA3A4C89411FF06B66DA03FCBB052CF5DE837 | |
4036 | 4834FDB84E2248DBC10CD7454636E97E399A7AC5A16A2191D763AFC09588F5EE | |
4037 | 57E80130CBDAF18FE2F530BDBD2CFC21D684AF84A8CA37BF2258C80CA61485BB | |
4038 | 27EFEBB52E5FDDA77E57AC8EEB3811BE2BC948A926FBBBAE974D9CE89333C945 | |
4039 | A9DFE37E5F34BA68EE97019BDBDAC7482826B8F71EC51A777B64C52B1C37326D | |
4040 | 1172F83F6E4DF93B37E66CDD6344810758B10B2EA8C68918DBDBC72F8821F1E1 | |
4041 | 96AB78288A2E00C2E03FA05640009DD0EB0D0D318C6A726DE5D8F2B1B035C658 | |
4042 | D09053A4B27B18F18BE4396C900A730908D832F3E8A21C36E32F2D603D0263C0 | |
4043 | 8EADB43290CC59C43AD57D357057B13C9ABE55F11DAAA8D78574C430939CEF9E | |
4044 | FB36B462DA71CFB6E86C72ACAA04D5FE4732AC386F52D4AC92C47F9B11FC32E5 | |
4045 | B188AF2890EE3786AE2772D2FBC5D75A7FC59B0519F32D930B71AAEC8B88F1F5 | |
4046 | DCBACC2CBB9951DCC8F21A26F197A309C26ABBC4C25E3FF22B2A511A96F0BFF1 | |
4047 | 2BD9AA37DA5DDDF261EAB0E48C62DE0885B8D074A7642D59C8E216B5F0A8B327 | |
4048 | 1794E0BA5B672E41832562DE119AC5DA1AFB74AA66885ADB605AF60B44C1D904 | |
4049 | EF85F00E1F143A19DAC00F751E77EE62D394ACD26B463F7C7EBE4EFD40DD93F8 | |
4050 | 81C2956C4250F5F28207671D7AFB3AC09FDD0126533384CF1B2004F31E053135 | |
4051 | 44EDCAD0114140E52B7E153C354CF3F2BF37A15E2D19A2ED688710B6F9F83C5B | |
4052 | BA14795934112F7963FFD217F016DE82353B915549CECBDF7BDFC6FA4F7B74BE | |
4053 | E202170C9F25C7448970684BC555C8390E34A5098F55E0B003B841CAE775D48C | |
4054 | 1603730AF8C091C0622640AC5A0B46757165B44F0AE1EC1072DA26A8EE0DA335 | |
4055 | A6BC8AF994F5508921F3D9E4E09B375A58ACBB9E6B0448903E19A5CF2A51F619 | |
4056 | 81D2A539A4556B9C25722D4DFAAB480586C90874DCDFC2D70716B18572557BE9 | |
4057 | E9CAB7F5A3959D5419DD9FEC22D015EBB5D4BB5CABE110D76E8A76D6EF3513DB | |
4058 | 5C23D3AE05BEFA77BF6B4ED5C413E8DB87B5ABD1B2FA9B3BF37A81C784ABC42B | |
4059 | 1FEFDE6DF012974241B33B67AA67FA38798336F7354F0984D612DBB455D0662B | |
4060 | C8F15F12DA07E391480C1A150213ABBBB0F2927D223D5752B69C930053655C34 | |
4061 | FC487DD271A8AF594F457F6A083C4150686FBCBD60832E4E7D0D4987CAE5484B | |
4062 | CA81A230A21F9C49DFBEB24C94C93ADC954B9B3B3EC484C502BD0DFD605F6D5E | |
4063 | 13158237535FA2EADA044ADCC1E1AD42918C8C67320F6621369C250D5335FC05 | |
4064 | AFEA1B294EA5D2A6F335FADB80CB26FCE9EBC0A4EBF72DD47806EBA23C3BCD77 | |
4065 | 7F175E2041EA03E2F0B2BD2B81E9A6DD43BA3486375883C30B8606D917C678B6 | |
4066 | 6E567A92A0E0DE89BEE5E5AC45C9202D46EED5E045302B71EABAC5FD997A9A7D | |
4067 | 8F522B2CA316B7FDF16CE4981DBC25E4E2FCE3981324B16A18236476FE242584 | |
4068 | AE70C683199B7647325D295528EB7CB15A7E3940FE2D248945015E9DEEB9EB26 | |
4069 | 7012041740F5A2A6C7DB7B2358EBC0358E9385E734D208957ADFC7DEF83F5E5F | |
4070 | 4EDE55E2F078E994312214EEAF63F8D0B481C3D523E712901AD838AF2D840055 | |
4071 | E57D34F8FDD4C842D64D3D94B1CA46CEADF497A2FC75A45AC59F8696DE49672E | |
4072 | E33773AEB31A204F01793262E820E813949115DB90A7C798BDDEA0D5D1E699ED | |
4073 | 753593F2B6373BD24D4647CF35A448037ED5E72DF3175DD6744ABAA0E2E0864A | |
4074 | 2F4EFF3B07B035520A598CDF1AA97D7DC3057414513DDDDE40C2A9DEFB23631C | |
4075 | B2291ECEEF4D18652CEA451BB1559C0743FE3205BFB6711F1026A613D244BB07 | |
4076 | DB3830F07F32EA637775BCC1B2CEF0C6B0D119AF6CCA17DB1B03AB1E9281C568 | |
4077 | 33502239B067013D261BBF33358AAB8803C451B2F570EC34BBA052170AB42F95 | |
4078 | F9386DA11A2C7BB9C05E8C9FDC96111549EAC90DFD8DC906C03F0281C40EC1BF | |
4079 | EB6B15455CF32FCE5C7DF6F55C91132223FD13FBD62A787EB15CF3E4E6E59AB7 | |
4080 | A529DA186B178CC6E8A4D876794527F3AD72FA86B7C2BAE14D3E5A41D8F90754 | |
4081 | AA28185D92C9ECBBDE4EE53E2BBDF05AB4C9700C1367B3D81FFC1AA34A79CEC1 | |
4082 | 1CA7D422CB58C8E21870F680E48EB1B2D5A30D974A7E9B24DE13958976C76225 | |
4083 | 45415635E32FF316DC4A69B3CD5EFC6EF5F845C8E24C92166C9076691817FA6E | |
4084 | AA5D1F1CE12235DEA3902F3C355CBDA5CC344376A5394AAA7C2CB50BCF32DB50 | |
4085 | 4B6D9BED63F0A8928C0C06829558B714FD54F355501EEBE29882185A6CA1703F | |
4086 | 6AE65F03CB07406324CCDF00093EBC76627A11A84B5EDB688D20DF49616D8D3F | |
4087 | 7491719761E7627CF8FDCFC0DD2265160BEB33ADBE3AD01E7464370E3E0F9D45 | |
4088 | 51FC9A87C678EAE5B16A564333DB11687FCB4D1D82C75A2F551FB4F940E0C71D | |
4089 | 74CFDDA0974D787BE959B2B87FE13DC290C53819DBDC2081CCD16F34F0A61AF4 | |
4090 | 3CF53914B713820BF8F2243C0679345EFD56307165AEDF16E3BC771EFBFF595E | |
4091 | C6B1DB8B028342D5DA1E8CF3FF4269126B48BDDE9BEEF7896CBA70EC77063CFB | |
4092 | 0EB3C6FF697509736BCACAA7F03C4C326875396F0499B198DAF7842384C36C2F | |
4093 | 36B17A65A1D9FB77649DD78499592C817679F344E0B88D80B8D78EEF9EC6A9FF | |
4094 | 41F4D635520B2269035CEDDCB3B5518D63DEBAD4F365A70533AE119F11323AB2 | |
4095 | EF07047536DA6370C07B2215C3A82BFDB44DA593C6B3A33BACC38A105BEA2109 | |
4096 | 06DC63737E3EB362A122FE90CE8EF37B9C73FA6933BF27C39EBDE137F15AC495 | |
4097 | 7F58F6549759FFD86C2BD3A09490AB47B60E204B16910AFB0C18E4F2361AA033 | |
4098 | 9BE5EF972F4B52F18548E3CB947F083768C7254FC019CBD8C4DE7E01DFA456A1 | |
4099 | 065EF834C7B146FD395ADBB9FB72B8EABF58EE9E2B2276C87FB83CEAD49BBA55 | |
4100 | 7DA56ECA50BE1AE4819EA3C72DBE30F363D43C75287945B0DE47D1FF0283C494 | |
4101 | EA65527E8708279B3B2437BF1CA2456E260020E4FC0A85BA18562CDB8261FDBE | |
4102 | 0B928EF40F0DD40E215B8BBD40BB5B5DCF2FD9AB4D5AF64F82EC77BFF8C37BE3 | |
4103 | 74BB9B2E44C819E84CE2C634D55A9EEB4F6DA28025C3831B601AD254108178F3 | |
4104 | 3EC068E78ED8C72AFC5C3BE0BFE17F31A23B55E7158FFC40381F36DFEB6612EF | |
4105 | 33A54D2004D92F0A44B3468DBAC0ED5E34F70561F5E77DA369754685B7F6B04F | |
4106 | 233454A59AFDF45F28383B05B6120717744B58D2A96BA706CC9317B5E7FD0848 | |
4107 | 56665EB38E31C7F8C87B0C65041A5D2E349CB4264523AABF9C10CA95CDD3BE1D | |
4108 | 9923C1A11D046FFC2E82A09E36ED0146978DC383AC6D70EABB20327360CF7EE1 | |
4109 | DC4DE736760F5CF3B47F7BA082DCBF881ED8DEBC1A4580C287418295CFEBFB01 | |
4110 | 51B09DFC98C8A8C9C5F9AAA6971CA95D96A23166E5931F7E464B288F4E357112 | |
4111 | 4111BB33FB7F0E042448478D3ED7AAEA57D1B0B4E237F919152F8D9E86229BFC | |
4112 | B8D59BF9FB9E0062A3ED67A367669D0F2F8EFEB2219E5FFE7400A9DC725ADA62 | |
4113 | 706D4D1860BC04D4432F49D7F4271376678D381B148D72DAD9012173FF3779A1 | |
4114 | 7C4D92B28D3117888C864440902499FF0F9BEAB0C83FBD788E26B0BA47484188 | |
4115 | FC01B0349E045421E7D912E1BD329A536F61169344F16D65F6B90DB87E22F72D | |
4116 | 8E6F486F8D21E6DAE282C35A2723464F560CAD8B31A931CCA7A2FDB9530769FC | |
4117 | BE0A5F66F1D4DBC0EAF834D078CFAFA415F43DC87AC62A1D8913334016B3FF37 | |
4118 | 20902A7E5644848A57346228A13D7B1C757DFA9B5FC4E9E1DCB2C2AA2FD37386 | |
4119 | 87E6B350662256D158D8C7DCD2F7AB1E02D6C5C8E3ECB1C6055A6C0B807B8FF7 | |
4120 | 997E562EDBEDF7646B64165A55DED91178BF13FD30ADC1A6B6D621B1A7AEE1F4 | |
4121 | 2E30D49CF3BD0656F584CECE76A17151913D7ADB223727B47EB3D7F491385112 | |
4122 | D36848973526DDAD7C1C1C0FB672EC627172D10DD33ADF2445483470F28AF65F | |
4123 | 29CB086189B3FFA31E0CDA710B6DE2B0EE515A46A3FCFC354AF01AF5C5D0B301 | |
4124 | C8FDEADC6DB9D492554777965E2751A715F8FFB6E0248AC51928DD65CA4F6574 | |
4125 | BB1E01B3ED95D736691EBEA8ADFCD8265F128A67C372720840A206056F66A7A4 | |
4126 | 10E1722E4C1BDEA8C980250F9E034C29FE0F7D2F5DAACAE3173C865CA9C4C240 | |
4127 | 49B6D4D0CD90B75D3BC68B8C84605923075A9A2D5D6F7008365E52796975CCA5 | |
4128 | 02770D168EAF28C337D45762A08817666907C68142CFAB9D75C4F6D6A73FB4C0 | |
4129 | 748F038F140CB009A24A80270037C9B5E514E04AEAD7CA8468C4D22E1059F2D2 | |
4130 | EA0E7CA2979C7066F1629B49FDB893DBECF6620FF9C48132297E81F717820A90 | |
4131 | BDB45E16CA1D0D9C152B12D50AF4E1B2519FBB2B779218C5E42E31FDF82448E3 | |
4132 | 5AFC5F90AA018902EFFC4D5A14D4326911F7055F9B7AC5B592E2E2D3A198E2C7 | |
4133 | F476CB49DBA0FFB2CAAF494DAD087639203084CEA25DED422E0F8A30634FF1DF | |
4134 | EE5C61FEEC33D547A17961534B3535AA673AE15F560DDFF08EA7AC126882B57F | |
4135 | A1AE8A5313E6D21F67FB6D16AD32690FCE021616D0DB89C51001090A4A7FB515 | |
4136 | 139B751F6137DFEA833004F4689474DE3A8FF64D98EF09D25802C3B35DD2DED9 | |
4137 | FB5300E4F50E5CC70FAD3A21917D15D5DAAFE30DC1CCF79A359B81AA3F21359D | |
4138 | 297B9795636C03E483A80D47A4826930854329FAC093193AEE3A19BA91063421 | |
4139 | 988EA0ACD987862A716C42F071140254B72AC91B91911CD6A9D275FD7F6636B7 | |
4140 | 4B1B0A47FD39120411E1D5442E711A6C1EB0741C67B0A44C1A2F98C9FF245A9D | |
4141 | 5AE4A04B529CC5FDBABB1C6E8C1590B3CE658EB77B58F4D04803DC351C5645D0 | |
4142 | 4DB49D76906E068C3FB553AE91FDFF5F22F734DC4BF8E9D019B06D3A1BB7CDCE | |
4143 | 9101E9D2276CCACFB36B9EC74AD213BCE896FAC45D08EBE43E676816DDA135EA | |
4144 | 8B78003042DA8581975D4C14CBDECE0B027AE87DF28611F387E64B951812C848 | |
4145 | B661FCC0DF91B39DEF14976D7D00609DE2DB8195C186E376F4029CBACE3AF24D | |
4146 | AABB788FB1AC87D58BF341F95EC2DBD14BFF27D3DAD9A06569FD4EEE40C516AC | |
4147 | D809E761BFCA049DCD6F8E43E60A0BFE64BCB922D1989CC14EAC1987147A5559 | |
4148 | 4F1CA14635DF029AC387BE36036BAEA8AE7DD09D090EBE271FE59FD806894A72 | |
4149 | 61C714D6D08322726CAAF168C08CE31F26CDF6613C06CC50DBD59B70DA211B44 | |
4150 | 1BFA22AD62D56AD098FFB998E25FABBD89A2C17EB7A3AE81F79C05AA4677D744 | |
4151 | 7F412484C16CFB322FABEACF98AF9F152E3217D0F2593D6863E7872C5B6F82BB | |
4152 | FDFD09B13FA639680E972DC7B086D7DAAB076CF346814556119BDFBDC3A16374 | |
4153 | E7B92CE50B3BEE8B7C26856BDD3C2ED98337C2B877ED5EE4878C50F06A64F750 | |
4154 | E9C8CA83B7FE6C91E10FA717CCEC0D2F8E21CB5A2367B5C90A81897B6973FAD7 | |
4155 | D4D95F6BEDE4E1EBE6D852A937D5D814AA6BA62324C08AC12FC09C5037588F7B | |
4156 | 1B043BC503D725EC657F47DE02CBA939ECD8418F4B7C705EDA3E9AF1E623A989 | |
4157 | 074165DB0DDD59B7ECF513C714B7D0A1013E4E3F2B071F6A6DB89B7BBC2774B8 | |
4158 | 87ADA7C572B0AA702156B715159829BA38A9EC28E1CF3494B0CEC876A97B4617 | |
4159 | 2CC9162F204C36850CA9188B0B97300CDB1AB4F57B55D39BC539BFA5047B032F | |
4160 | 02A88CDF11D098FD30F6A6B82B98AB9D288570FE18E4E6A707179D96287D438F | |
4161 | 2D5D3C2305C5FAF075E0979EAB1DB645AD9DC87A621219C260FF67C2DB8D541F | |
4162 | 8BE9E20ACDCF64C4C721AEF5B2B65761D0310CEF36B1A3E57092DEFB978A43F8 | |
4163 | B553169F523517518CA0618E31F9A5940EDA42D8B9D851AD1E77BC1C0C8EED23 | |
4164 | F469B0568B5A556A5FD5A20F5F4E00FA6F030ECC5E711865F1549E409792F7DA | |
4165 | D1FFD1BE1E6DD22619163B98EB0425319E738254ADA0AE57FE29E121B0D8F172 | |
4166 | DD717E0B59842BE9F6B37FEC3F1BBECE15664851EDA3DA3A1848191C38F2CF60 | |
4167 | 7A262D4440322C26150C605AADAD4EC3EF0CA22D6A2F63BE63C9C08EA643B68B | |
4168 | 9C88ED95D2F2F0868CC40278DC2752A1E61C793FB87EE69A6D348F98A0174B09 | |
4169 | 5AE09E214EDA066174A6823347B831ADF2619281E43A71D549FE194D5AD4ED5B | |
4170 | 1DE112CA90BB9D92C57FC3D89F1A57F7CEF2ACE8E944B8B725557F567D9DFC72 | |
4171 | 3D28B0E11DA3F81633C042B5FD05513542A2B431B3744E2E9581ED828F5F8A8A | |
4172 | C600F526EA874274FEB94E64F0AD787F47C98899DAA4552E447D4B97B3774334 | |
4173 | 8DF26A38D7CD36EA79B64CB31DB0302BFD0DD2280E10FFDEF59E2D1F6452FB09 | |
4174 | E2A7015523BC1A46AC2F816135FD4EC198D30E95203ECD2623E83FFC1436FF74 | |
4175 | 068CFF87C1ABDE2D31AD1FEEE6031D889A25B9F2C05036F16BBDC143705545D8 | |
4176 | 4D14A2467639644AFF1D239BB08AA769BB5476DD4FE9974DC01E85C02F82958C | |
4177 | 12C3AAE071BF1E57C358F72290F15A2655C1C79DB5E5264133AD0139F9F9B540 | |
4178 | 972A3FD82BF0377FDB8711A746B9F4C6016172C30CB33CEC0B327DA0DE2668BB | |
4179 | CD41 | |
4180 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4181 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4182 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4183 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4184 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4185 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4186 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4187 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4188 | cleartomark | |
4189 | %%EndFont | |
c302751c | 4190 | %%BeginFont: CMBX12 |
45c0f7f8 CR |
4191 | %!PS-AdobeFont-1.0: CMBX12 003.002 |
4192 | %%Title: CMBX12 | |
4193 | %Version: 003.002 | |
4194 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
4195 | %%Creator: David M. Jones | |
4196 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
4197 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMBX12. | |
4198 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
4199 | % This license is in the accompanying file OFL.txt, and is also | |
4200 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
4201 | %%EndComments | |
4202 | FontDirectory/CMBX12 known{/CMBX12 findfont dup/UniqueID known{dup | |
4203 | /UniqueID get 5000769 eq exch/FontType get 1 eq and}{pop false}ifelse | |
4204 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 4205 | 11 dict begin |
45c0f7f8 CR |
4206 | /FontType 1 def |
4207 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
4208 | /FontName /CMBX12 def | |
4209 | /FontBBox {-53 -251 1139 750 }readonly def | |
45c0f7f8 CR |
4210 | /PaintType 0 def |
4211 | /FontInfo 9 dict dup begin | |
4212 | /version (003.002) readonly def | |
4213 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMBX12.) readonly def | |
c302751c CR |
4214 | /FullName (CMBX12) readonly def |
4215 | /FamilyName (Computer Modern) readonly def | |
4216 | /Weight (Bold) readonly def | |
4217 | /ItalicAngle 0 def | |
4218 | /isFixedPitch false def | |
45c0f7f8 CR |
4219 | /UnderlinePosition -100 def |
4220 | /UnderlineThickness 50 def | |
c302751c | 4221 | end readonly def |
c302751c CR |
4222 | /Encoding 256 array |
4223 | 0 1 255 {1 index exch /.notdef put} for | |
4224 | dup 11 /ff put | |
4225 | dup 12 /fi put | |
4226 | dup 33 /exclam put | |
4227 | dup 35 /numbersign put | |
4228 | dup 36 /dollar put | |
c302751c CR |
4229 | dup 42 /asterisk put |
4230 | dup 44 /comma put | |
4231 | dup 45 /hyphen put | |
4232 | dup 46 /period put | |
4233 | dup 48 /zero put | |
4234 | dup 49 /one put | |
4235 | dup 50 /two put | |
4236 | dup 51 /three put | |
4237 | dup 52 /four put | |
4238 | dup 53 /five put | |
4239 | dup 54 /six put | |
4240 | dup 55 /seven put | |
4241 | dup 56 /eight put | |
4242 | dup 57 /nine put | |
4243 | dup 58 /colon put | |
4244 | dup 63 /question put | |
4245 | dup 64 /at put | |
4246 | dup 65 /A put | |
4247 | dup 66 /B put | |
4248 | dup 67 /C put | |
4249 | dup 68 /D put | |
4250 | dup 69 /E put | |
4251 | dup 70 /F put | |
4252 | dup 71 /G put | |
4253 | dup 72 /H put | |
4254 | dup 73 /I put | |
4255 | dup 74 /J put | |
4256 | dup 75 /K put | |
4257 | dup 76 /L put | |
4258 | dup 77 /M put | |
4259 | dup 78 /N put | |
4260 | dup 79 /O put | |
4261 | dup 80 /P put | |
4262 | dup 81 /Q put | |
4263 | dup 82 /R put | |
4264 | dup 83 /S put | |
4265 | dup 84 /T put | |
4266 | dup 85 /U put | |
4267 | dup 86 /V put | |
4268 | dup 87 /W put | |
4269 | dup 88 /X put | |
4270 | dup 89 /Y put | |
4271 | dup 91 /bracketleft put | |
4272 | dup 93 /bracketright put | |
c302751c CR |
4273 | dup 97 /a put |
4274 | dup 98 /b put | |
4275 | dup 99 /c put | |
4276 | dup 100 /d put | |
4277 | dup 101 /e put | |
4278 | dup 102 /f put | |
4279 | dup 103 /g put | |
4280 | dup 104 /h put | |
4281 | dup 105 /i put | |
4282 | dup 106 /j put | |
4283 | dup 107 /k put | |
4284 | dup 108 /l put | |
4285 | dup 109 /m put | |
4286 | dup 110 /n put | |
4287 | dup 111 /o put | |
4288 | dup 112 /p put | |
4289 | dup 113 /q put | |
4290 | dup 114 /r put | |
4291 | dup 115 /s put | |
4292 | dup 116 /t put | |
4293 | dup 117 /u put | |
4294 | dup 118 /v put | |
4295 | dup 119 /w put | |
4296 | dup 120 /x put | |
4297 | dup 121 /y put | |
037a8b7f | 4298 | dup 123 /endash put |
c302751c | 4299 | readonly def |
c302751c CR |
4300 | currentdict end |
4301 | currentfile eexec | |
45c0f7f8 CR |
4302 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
4303 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
4304 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
4305 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
4306 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
4307 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
4308 | C01924195A181D03F5054A93B71E5065F8D92FE23794D2D43A151FEE81296FBE | |
4309 | 0CF37DF6A338C826464BA5198991445EC4BE80971DB687336AE8F74B516E333D | |
4310 | 2D8AB74D362C559AAE6ACFAE49AEEF4F52E28C869222C1301D041E7A0BC1B608 | |
4311 | 1BF728EF9E98F3A12EB2714E7F16B14E055FE1FA0EEFB058860ACADEDA9D0E4C | |
4312 | 42E3C6F1E4869471BFAA3760175F3FBD842755A9D7847EBF605F18293B42F557 | |
4313 | FBE2715002669091BB033E1AAD657532F34F7C66E4F04D63ABB07E6CB9D9AEAE | |
4314 | 78EDE8B79DD9BC87A1FF445EAA05B5572BB880E69F4DE1F82D7F0E9980AB0C18 | |
4315 | 22C448B0B1722D3CC33C56FF287CECB80658B3AF5E7675BE82CEFF3DAD5942EE | |
4316 | A03C955FF979E41E54BCFB5316A9AB8945C403A73180D0961416EC9C92F49811 | |
4317 | 4B91BC4C788392994587517718521E416D469F69952149FF7F9224377EBA1065 | |
4318 | 4A727BF806A112A7B45B0A1BA1D5A23683960575368D9EAC8C04753BF7465AF7 | |
4319 | 95F25C258C63E4FDFFD0B412FD381946AA38C0B961652BCEC30322C47BF4755D | |
4320 | 9F91880688AF066E32FFB22E1A52DE741307AD3ED830D6BAA1D1F562919666DC | |
4321 | 5E8FD9862AC8600B0AE0BC7FC779252AAC57248744ACC8A8AAFA836BCF09B0DF | |
4322 | 9253DFBB1CB77EA8A59D42D1B18FF25E9AED72FA62FEC3F126F030F5D7DED9C3 | |
4323 | CF60FE890BA4A48E39E687BFFAEAB96AE542A6387F6624486037C8924002A511 | |
4324 | BEE5FBFD780AC1D4BEC3FBC47A930BAD0280D444259528B6C565DE11DE36BB65 | |
4325 | 9BADC55C1EDA1A80458E98896D782DFB5C137897419602809F9BF8CA39F00C68 | |
4326 | EFB9E076FB324C2963F23CBFED28B9EF70EAA4E4B903225D1F199A7162AB239A | |
4327 | D92D71C18B1B682D04C6A48926275BCB16D413B2A0E953E1257E0B12D8B717CE | |
4328 | 2EC84CFBC046A4338A69F454A469B12118E562B4F56C5FFB3CA5D357513E6FFE | |
4329 | 947A564B229C7FD873057D5C7CDF03E958294A1003B37D8DF565A70A00A3734B | |
4330 | 0138AE5277D383D10C2BD853EF806D3CCDC47739F0E374A3DF3B63638B949ED6 | |
4331 | 4EC25869DC1C0B1F4DBDFFCC97382841D8F10F3635C792139A1EC462FDBA379C | |
4332 | BE0990CA2E70FE73137AFBBF30CA54954D7E7377CC50BDD780DDD4C7FDC77AD2 | |
4333 | F3EB1169F14A0041F18160F43C24FAF556DB5D621709FBC544CE55424F7446D4 | |
4334 | 6AC07A51C8CD5161AB0AD5084A96FB35D77F1CA155147DEF8D7A590EA6939514 | |
4335 | D4A226588295CE0007BA8A550895511C8D80BBE5CDFB8A50D249C3BDCA974415 | |
4336 | F5557914A9B805782F399E4078DDB6264F1A49A9A5BA45E284A5196E9828EBA8 | |
4337 | 481D357B8D9E6ECA631A6204439FDFACE7D7E6A2392726107CB7D2517CD19A24 | |
4338 | FBE592C119626DB221BBB635B6EB84845C16A9585282E34958B961F4A543AF9D | |
4339 | 419B6A9105BF185FC767712D923437BE08A9C0EB92AB6792DBDC671029B6FCA6 | |
4340 | 7F717FCE379C0F3B51C6CF042A762ED04898FBB4B0105C3C4ADDDC18C51BAA3B | |
4341 | 70A93666669547081D9246732CFF74C83EE90DA17F5B4F8BAF47FE4D81590988 | |
4342 | 2858C9B96071341FA0A0D23BDD4947FC9BC2297913CFBD4FD6CA4303AB3179AE | |
4343 | 0203F1BD502065F90CE9BEA3B52DAFE4A29446082EA0E6B1D7AF1F31D0AD02CC | |
4344 | 9A7FACE2CA86E5FE0F6A425B28A5940ECA306891CECDB3CFC7A5BBC76B5D9E8A | |
4345 | C754379ADE80B4D72CE493010317BF21A0CF4A0A55C1246218839DCA3F4D626D | |
4346 | 1F4161D38F54AD5142C1CEE95C61D8BB10FAD4B772F4955777AFDE8AE5A837C2 | |
4347 | A2BBB11D0BF5DA2E63D0B75ED421DBA9C789B281B01846B65DC572BA69591969 | |
4348 | 21265DB722AE86BD8CAA3D887C975A617ACEDDFB7AAB341F47532AC0F354A530 | |
4349 | 7662C089DA3939588774FFA16FC4A52555DED6D6F51DE718BF5F345C23C90198 | |
4350 | 17B77CB8B5D53A5CE7A79F3E286B6A59F3F6178AC8BF15C0A15C1A8A95D03B60 | |
4351 | 30EBE53DE328CE085CD9A1D49C69AA299C5B58B24334A546F6E274C1B534DC8F | |
4352 | 3289553F560C2F81E413ADB92FA0E7DD1C2F39D5FD268EBA97AB7335ECF28257 | |
4353 | 96B4EADB7D0778706CB41C7E9C882760E7670936774A1088FFB2011115FDADB3 | |
4354 | B69EBD5108760762521C25C968C3E282DC3400001AC8FB1EA27FF643E3025950 | |
4355 | 1D617BB8BB321281708E496277E11DD3AE0023DA9F25AD06B39C7CF527FED27B | |
4356 | 57397E88D3DF70EE4FCCEFC8A0927D6B05517E571B3E70ECC99F3CBA32CCD4DE | |
4357 | B8BF22626B6C94FE65598A88AB90D238461EBD9A098DADEA4091AF1CDD7560EC | |
4358 | 8E1B9BC2321686E1759E6B8A270C8CB4A254F7368039602EAEAB86ED21CDED91 | |
4359 | 8F2DB9889F46981C494C7EAF5E819B91C129F0740B8002B510014985E5791F59 | |
4360 | B16879CC6521D8E9F1C4C1890AC85A78022BE614BEFF318AB2616F0C3F02405E | |
4361 | BB425D1555472A2642BA7686E431DC3FB8A1688B76660D9957C3FDE8D58109AC | |
4362 | 21B1234C9DDF3F0FAF93BCF7B2F88A001F23162E1A13E5E9118D51B485B70A91 | |
4363 | D0CBC39CF44413FD8686D9030782DAB58064F5B987E0402AF5B264B17BD31BD4 | |
4364 | FDF63951BECD73ACA6138854EF35B062D01F33073850D9C09A818828C581241F | |
4365 | A625AB3638081DD0F00F946BE5450D38489CECEA4E66B4D85CC8AE0157E2AEE4 | |
4366 | A22A9313829F24D573101D84CC1784D1CED7DFAD5DD966601370C6CCBB723082 | |
4367 | A86BBAF0A5D867D0D2E3CA16E14E5109A29EF02649C47E12E88B3B397D65CACA | |
4368 | DEB9940B92100744D686066F8250FF30E5F13D81428EE238A2E4E07ACE0F5C38 | |
4369 | 7D79D4A336D0D26AF9C2B84088ED8ECDF94A1E3FADB45AFDAB46CAD6FF950B0F | |
4370 | 07AA2CDF82374DA76C56D29C80138841EB13F0D02ADD32F88B23E282ECC845F9 | |
4371 | BB9AAECE9CDC644AC2D49577A92307A83A99434F6493156DF25DBF0FCF2EC21E | |
4372 | 8C50A312C3D19E0609C0038554CF4FEF3ACEB7A833FD54B06EF0D617C2971C89 | |
4373 | E4C06075B09B84A4F78A82152B9A9C540B1D881313C2C74F20ED064A9606EC2C | |
4374 | B56D7BB4797F1EEF4A9B13579CCF311FA4A4DFA62D80FDB7F535CC6526D1AAE5 | |
4375 | 45C008EAF024B48C377522F74D939A475970533E645B1BFA81997549AFF26F67 | |
4376 | 2AAE6C2EFA357DB3B525276EF330905688777057F4E4CBF584520A534A8587E5 | |
4377 | 5A8360891E75A15205E8ADAC4A4E5A6E27D0C4A7D492216E4BC023AB027F37AF | |
4378 | A8DC7579BA50204D5F45A51460C5BD8A5A7F87668CA6451137F2F59E117BBE28 | |
4379 | 5C40820882A5546FA76F0CF49F8A6EC445F0647CC3227C400F56E7E9B84A6975 | |
4380 | E85E243CC1666DBAFF4E07EEAF3AF71BDACB30DAEA792F2B8504CAB071544F01 | |
4381 | 5D66243D529C479D276FE22F7E275D9E7FA9C6EECA18716B2F213916E32C1D94 | |
4382 | 6E32397B41AC6779543218E506569E3544803BBF9B404A983EBA62A494187B30 | |
4383 | 8D3DFA4E1237A2E5E08224A60492C09ADAD8775B7CDB830520829BA164209ACB | |
4384 | BCDEB2D574CEBFB7AE4BE72DF4EB1945FEF2458761AD8DCC0D378AEB7DA002C6 | |
4385 | 9C14A665DAAA532B0ABA98D7BFB5A6151FF6703385AF7AE8FD315A492FCCDBCB | |
4386 | B825707F9566B3B4943A3C61C3DEFDC31A843A2D67AB06891F3E110DD8C73D3B | |
4387 | B5E4151B51D9F13905D7D94DB9ABBFCAF35F43B6EEE256B1A80ED6D1739D8D5E | |
4388 | 8C767F6F0E8704C5345D028A2A6DAFD9BB7AA048B8B895FE9423A7ACE858BADD | |
4389 | 595CB074A128DAFE08FDFFD6BDAC0114159A702FDCBF8013804B0CAEAD7AF38E | |
4390 | FAF086A3248AD4FCA1401A85AE2F72E3E6956DC0996FE8ADB18F89B14A208A15 | |
4391 | 13F81AF73D0DB72F78C4DA634ADE3C73756CAE6AF2E149C26316DFD93370BE1A | |
4392 | FB4A79F77A67C07CB0A53C78367F21661D4AFE9E27328E077B522B50FD9AE2E3 | |
4393 | DA087BE481515B5DD7BF894A96A84A6C78874100505B7DDE1D22EFCE8D58B3AB | |
4394 | 313AB5495F72E2CA4E6AE22C0CB854302B9990372F1661D9F0A517F90686F248 | |
4395 | C5643008B3D29F7296E5C8FD4049886662EFDD4106E17C879F5D41CE84F87E89 | |
4396 | F6A3117C968B95A35940CC29C43E1E0DEF51C1E46B676301F40D59615C3F73DD | |
4397 | DE37B72FF7105DB84227DA5241583272AB1C3CD97AE11C1EE98FFDB5E5F44844 | |
4398 | 8FC41BEA5C54B26341AFF6830D9D0A5A2901B0653D8BD0746838194D240FF753 | |
4399 | E99750D3383373F453723D86BE97B571B8B84D8696089B5CFDD53E6C562A2197 | |
4400 | A8C4FB0CC690C27761A816B441029D3D306245052E0C41B53025D8CB7267CFE3 | |
4401 | C17FDFE348E765326F91AEB700CC49162DF748171214252CBC821493DD01AA20 | |
4402 | 417D66DF47EBEFFF3E9BB2B0A2BE7D9B8C68BD570FC2EB0FA54CECC318F04C43 | |
4403 | 19598BDE93F2F13DC7847354C99059AB20593EE51E94F9D4E9241869D605AAF4 | |
4404 | 9D9B5FD88C3798A039A67993C5EC68B6326B132E647F67EACCA7F7AE7F718D85 | |
4405 | 12666E90D7C73EF210E344964A38228B236679A2B18F5E081234CAA2458F8D83 | |
4406 | 3F0CA308D19663CB12EB904076EF88E556407C33C9380A6A3D68A9EFE65387C1 | |
4407 | A1BCD2D26DFD2AC0881EC30E81C0A4E76C244A2BD822EE88C4A60B480D107E68 | |
4408 | 90E419A1F512E865BA922A7830909BC2611A80931CB2E9344529586726614D94 | |
4409 | 3AC5200FB9FF68AD9686506C5EFA8788C0AD0251AFE7F95E84683380CDB421C5 | |
4410 | B1A783B6D5F3A6BD1BC1C14B363DB01C87C0796DCDD5BECF41A1A9F43183CF6B | |
4411 | 82C2AE49F0BFDC5DEF7729F2E638EE6EA9E4D059EB9BB1B992AD8C82D501A550 | |
4412 | 1BF73CBBFE740179B54E193E84A55DCD61B343C1852780FFB44248FC9426AC94 | |
4413 | AA2B3FE20FBA30F6C4D1E0FF3EDCDD8C0F57CCB50CDB0EFE2E04A8927E239C1D | |
4414 | 9B026C7929BB48461D4D695FFC766C8A0E545B1BCC2AA068D1865333108E7985 | |
4415 | 2D93F9B00EA0A90939D0D3840D59B6CC0CE2C147B2E1A9A4F14270FE3ACF51D5 | |
4416 | 99F7349106165AD627CBBB0ABA01ECC6D3A14C1DC1ED23A9DB9865BB4396C51A | |
4417 | 31ECD001EAC94B33C34E29C5611148EF3E55DD61813470B8F3CE32564C749414 | |
4418 | 3C93C77EA5A3538A0B5AE3FC4DA32813B06772E0E48E25BB39F3F6FDCC077E86 | |
4419 | F86FA50E18FD19EB2F37311CE87F18F3BC85CE7FD71CA92D5C3264E34E04A2E5 | |
4420 | 70C79D99F54D6C6D9D527AE45EBB48411221134587D2253E7C8ED7658EDCA34E | |
4421 | 5E768DD14E0200470F73C44D006CE8CB35DE1CA3EC10ADC668B0662A7774C891 | |
4422 | 84EC95A31DD872F0728D9F65CA80940080E04630BE4DEC77A2C49E3913C39978 | |
4423 | BF145F8832AF2C4385EBCDB15F9D32C22CBA0CF950877717D6F1591D7C0B8047 | |
4424 | 8C9BFCB16AF7124ED83137695F3D69228DB633053208C29E0ABA1B06A7FB3EE7 | |
4425 | 5625CB44927E2DA6E038A6E62DEBDA2D96A03177982D8FA33BAAF4426E05F4B7 | |
4426 | 9C1748B3FF7691F9888E7FF864A10B9DF761A41E6B5CFAD2BDD7E1C4924AC97B | |
4427 | F4B352705316DD1A58637CC12D71C18A5CA691AB2AA8F171590EC24582B1123E | |
4428 | 94D4DC587D8F99E18A711776BF4013C96446BFECFEE4C809EA94B169088024DE | |
4429 | 0CBD20199A915AA406F0BD5F3D63D1467C49B4691AEBBB35ED6624F2D7BB74BC | |
4430 | E80FD92B9FD04DD9C2BE9B6FD29EC7EC07FAB447511C61DD299C783BC09AE2A4 | |
4431 | 7B3CBCA6A20C6631D06D0B2E2482A50612BB7C29B7E7D0A205EB0E8436702581 | |
4432 | 596BC996ABD58CD8D5BAAE4B1478195CAFF98FE0141287296C4EFB8D2E7A8442 | |
4433 | F0A3AA9F9264329982532295A176BA1867EF732BBAC49AF485D9D0F7130F617E | |
4434 | 7F7DEEF935874D55A22240F8EDE4F247D5F73481373A392D40A8076BD91079E1 | |
4435 | 1CE5998BA13D48D56B49A92B4A18430E316405D2E2E391B496A1934671FF1785 | |
4436 | AF42BA3B2D14B8E04014437FD194455C50289DFBA61B5C377BCBDADA48E82DEE | |
4437 | 4E70EF5E9DC03064907BCB8BE4D59DE069FB0C0CB140DA54708E630767313F9F | |
4438 | 744594AD8A499CFEF733E640A11FD74E46A749F9C7D18D49251BF85C6EB4668D | |
4439 | 67598C31A8F90922FEAEAD4B83B6E7184567DC798E4BA1C4C9B3461A478D63CA | |
4440 | 054F13B502DACB674EB49D6BB935E5EC82BF99FDA7D47C581AD7F940DF4FC6FA | |
4441 | 6C6D25D647033AC69505F0CAC58DE99087F365531A6283CB89CB644688963C3B | |
4442 | 8B2203A94294E58739EF23C7803630A1F9121D62BE1977DE2F41687C8CAF87FE | |
4443 | CBD7AD3B98E0D95C8C6E1A7CCB0E09465AA874DC90A0F5DB2C5E7C130297FD39 | |
4444 | EFE63B0350B5139D09E6864D22C3F1150B29196E40EEF9723E71158B7ECFB8E4 | |
4445 | C426FEDCD439420B7F1C251FADA347C9A2C49738B5A17922E1EA93CA7B125B76 | |
4446 | 57449EAA9C1D591CAD327D0E98EF2D44D614EE9ED49DD31ACAC0B956620B6BA5 | |
4447 | 5BF6D08CA7541059D5ED2EF00AE2EE95488F5645BF6837D9241C0D3959B7580F | |
4448 | C9ECB2BCF3E65C07D52EC9CFB21C11CD4C883E44C173214C900C44D2E1E43DD1 | |
4449 | CE8DFE3DA93C38B548BC4EC46FF91F30CFB97525E1FD4E77686433B20BABF8D2 | |
4450 | 848C1CDF1BCF185CFD7A81D2D4BB826E837E2AF35CFC4F419F698DB0C43E9F9C | |
4451 | B0FB628AC9A3CBE9B1FF4A067016E70333E78B32AB2D89C483834B31F5808FDB | |
4452 | 77492E099F1504DABCA5722C7860CDCEDB2DDEB512FFCC7D287F4945FD711F28 | |
4453 | 87BC3D36173566B81FC2C1290C717A09697DAC6072408E20926D39270121CE58 | |
4454 | 3EF97CE12EDD7F87F2C8CFE36C3C0400869C0D813B71C425343EE0CDF717BDD8 | |
4455 | 409D5297D0F8F7FDEB0257C0A391F5635E0DB1116058942FF3E7C94D5F2873A7 | |
4456 | A3B0ADAFC3835AF2BE474E6741319BC6695FB37F59AEE388F81F6E66F910000B | |
4457 | 72E6BA7531B4378CEFEEDC79CCF4947BA1703823B5AB4F4AD73D9615C66C489D | |
4458 | 99D68E49C9BF765B7FC547BAB9640D51D5A7A2396507AB5A4DFF3D14F52422CD | |
4459 | 8FCFEAA06A56C6C7FFCD29C9A7A59DDD2A909A9363FE5F1E9629616D25ED38CB | |
4460 | E754C059E4379318CC491C3B1A90128693AC53F80F8210FAEA7EE638902A7D3C | |
4461 | 82B95B3F5AE340EC1B648DBB9FB679D6E80B7F426D8671FE7136D97F51E2D2F3 | |
4462 | C9CE9183E4061CA40091A2A70DBB9ECBB19CE3F65ADD0FB346B54BAB182E2CD0 | |
4463 | EAF4C0F402C25573FB344EA771B297BEB615FCD0595172E84ED2A62FF8962634 | |
4464 | 23C19076C2A9ECEED5135994EB397303A9619C76DC55E032DA83FBA441BD484A | |
4465 | 59F70A5110A8927F6239A14D4E223E189A5462E4A92EAEFFA4B961A2A32B320F | |
4466 | C2B4E8C1821FA67A655B5042C15E4DE1FB3652B55078DB123573C4E986B19DB0 | |
4467 | 1C5131F3DFAB271C30A5476B4A19D8FC922E31879C34BAED94C07A4841B8209C | |
4468 | 403369FB8E842610D1EB4662B6171A4465FD0E819964F62EC5B0ADC92F08CF90 | |
4469 | 1DE0B410FFBAD16F6D355E8AD72CCF67961EDB6CDA82398021007C2D0462E893 | |
4470 | 75EB0710AE4A6CDD15077C9DEFC5774EF4A657734D703CE42174259B58E5277E | |
4471 | 0DF26BF59AF8D1A3E7DC12E3C12AA4B67CF35B19962F6950C2020B698D971B35 | |
4472 | 82FF84E72F72FBB0C54A112BADBAE6C4CAA358BDE6A705AB59332C3850CA3D25 | |
4473 | C7564499BC1319121CE0D93218210C68080AFF33420E3CB3A48BF9EB66BC07C8 | |
4474 | A79D8CD8E78C200FF7CFA3DAED0B9E87E6141C88B436D8FCBA50AC195FCBB9BC | |
4475 | 9512B95FE3A37FFAAB39850FCEBD4D50A243EA416E73F53B4B00F3B6EAE0CA06 | |
6e51e0d0 CR |
4476 | 0693AFFEF215D00BFCAD02E45496D7C8F5E99EB9096FC4300D038C1AFD31EC4C |
4477 | 5ACA6B72C1BE7204E37A4CBBCB1EC26AB87F2FF82DE20601025169A5FBD2D060 | |
4478 | 62B5B2DBC288C79C33B596832AA18D730AD572C6EDFABCBD36DEA87C0F323C3D | |
4479 | 6E537AD3B43C6F3A905597570A8C6B0B4A5E08C08EAFF9731E745F2BA8ED0C0E | |
4480 | 1ADF7821CFCD4E38F3F4C243CAD31D9F8FC68B9043740852B4CCBDD37BF728E5 | |
4481 | 648215961FA82A0C847ADCC5187331D0863A4573BE520C02CAE14AED4F06B3F1 | |
4482 | FB4A318AB54CD86DEC824707B29F858FD726A167F2333855C0575EAF4EBEA0B6 | |
4483 | 754B1775F967140641FC06F82B191244186FF347A351FBD8FA62E8C978B21F6A | |
4484 | E124929876488AFA97FAD262BE3D172E2F03F564F1325C9F1E050C83C12E0CE3 | |
4485 | C7F58270B5C40B46B3F592FB41FFB7F59EBD69B2F489441E398FEF7F84C85055 | |
4486 | 531D95FD21629B0E509C2FCEE995D025BAD5D3F28CDBA5CD414405ACBD936C3F | |
4487 | AA4CB2620D7426002161F983AE95E542EB8553AFF7E57B82E05FDD5FC433E1DB | |
4488 | BBCFFB1ED92299DB0291CAB10A84529B7FE279C62628A24A2FC36B01976E13A9 | |
4489 | C528A198B8EC8654AD69CCB5C209964A2B25D6DA9BA0FFB366D19D8C69701D7E | |
4490 | 8ECBEA88569601C80ACCC2D5487DDBDC27DC463A53A8E59F9EC17D0ECB7D2188 | |
4491 | B6CEC6BBCEE631DBB9959A9855B997481B5D88B8BA29995053CF42C5518A3E8C | |
4492 | AD21553A0F6BC3483624B013D3537F7C85D7C558A9C772554CFC1C3FE7A70633 | |
037a8b7f CR |
4493 | 318A99508F5D2FB656B5A91E94F80F74C7472F507428AADC375AB9F18CCED8EE |
4494 | 9DD57456CA8DB8D3B133596CFF2D510746BFA00B23F4001A3D0E8A24476C497F | |
4495 | A14422160995F3378EC9A74A5D72D776BF8BF91146E73518E61C94AC5C7ACEE7 | |
4496 | 783E29B29962E638F75366A0C0235475327F024CC6C824A52A6C25E669546A39 | |
4497 | C3459E06945AF250269C9F7B541B1EDA04DF9B9C7B442CC7484595E7B1A860C2 | |
4498 | EE36E1F845BC6E79C445E11925A881A0D3A9849030954BC5FBFED8D254AB3307 | |
4499 | A399E20BC127C05EC76D54C928A3CE1F99F672A8F47C8520C5D444D1EACEE114 | |
4500 | A71EBF58CA1088DEF117A723C391F62C0AF3985BCFD5526503360C33B1DB957C | |
4501 | 039360854589686E27DCA9375B709FF2F8F5EAED9564F979A245AE2498556344 | |
4502 | 69E2A27804B51D5C52844E3582CFA648E82492354EE0A312AFCC4E90866F63CD | |
4503 | 173E4CC6A74D82568D0CD88E078BEB0A5232202C7F74C3A8C80DA4CA4BE6C421 | |
4504 | 15B80B4A2A50F91F7841F60C5EBB4DC67ABB15A3A285214E20B5090E25EC9C7A | |
4505 | 2A8F1C9F2FD755368F61370634A37A2EBDC4B8728D2439D55B73596A2D5B28BB | |
4506 | A83A38BFCE4B84AA3D8D373C53DCF5DBB5A327D9364288907C0ABC0D5E6B1D1F | |
4507 | 7E57E3E21ECD67DD9E3F0E86E00BAE52ABF645D6FE70EEBAD9C853FE34801A46 | |
4508 | 8F6BAB6A2C22BAE5DED459A3F06096ECBA2D20C707A5F47FA067FCEC8C8D6466 | |
4509 | 9E478B07712A577400F5FFC65EC107578C4E6F28961509BB7C41E49F5E45FC1F | |
4510 | ED4AF951E8BF1B261E06E4D8AC3B4CD60AA0FC495E73E6203605E5473047818A | |
4511 | 46C98482D55F198EFECEA05092BF11A982798FACA6AC540293AA90208B56E2B4 | |
4512 | 05A05AA45B2F8A67CA109A6987A670340523EAABC230E0034454E773C31543EB | |
4513 | C1C2A99CBD1DC7532E2D2169C3C25B5853E2F0148E4AB501112B8BF210A5B39C | |
4514 | 1C4E8991DD2DDCC634D3D63415B5C7DFC564102751C1BCA38AEAA8F4E69D603C | |
4515 | 13A5B5A81BAACDBF724AAF76189BF3DB6239A7E19A1B2D6DB4943910A0FEC76B | |
4516 | 233994CDB5A903872A55E51561F06A6B999E0F91C9FEA20E0176612E869FC157 | |
4517 | CA648E8C2C4859D3C17905352F1E950675D8C56369B50BC8C75413021319BE2D | |
4518 | C982926A6CFC9FDFD4BD728E8FC1B6FA1074FD7271C136B260C013A9A33CDFED | |
4519 | A82DB154C0423B391E7BDD9C5B35D92D3C4F5CA5C773AD3712840EF3BD5F3C0C | |
4520 | 9BF19092B9296CFDA740566999ABF31B92E8AA5A92D29840D33625338A3E7C02 | |
4521 | 5854A6B272591E3B581BFCFC1620C9C0F0B128B0B69CF0FE34E56B191FF65DD0 | |
4522 | 59BB27457FB4CAE161551620278082F048A6BE2B9073ACF7A6BFAC7D1F9F7F0B | |
4523 | 3DBB05CBA5BE5424E1A07BA58458074101EB3731E775802C97133C9FEAE5494F | |
4524 | C0EAA6D6CF2DDBC064CE7696F610A3DD93024161BFF27FA1D8075A295BE3B80F | |
4525 | CC225A257619628F07D9D740349854CBF43BD72E25F63249470C6AD3E171C6AE | |
4526 | 149931C1434F22B467BC377604669C077F5806E9193F9E16A737C19BD3FD5C3B | |
4527 | 7420A718C022EF57CFC7D7BDFE22C3FE896EF34BFDC09A6D5A6E559D6E1F4D31 | |
4528 | 8A6B69C544385C1CB338D352749ED74FD1A051ED6579D5F1673522CB02BC25D4 | |
4529 | 5A9A51D740B3A9B6AA52F2B9532A32F4C22FECE7BE96873ACFA2836063BABD50 | |
4530 | D4D0647FCF2FC9975A2ADAB86FE1AB14A5FB4C3A576387A993E9EAD3D401D3B9 | |
4531 | F231F890215B7192A71327BE72F2405E94E47EB82C9A7479B00C6122A94DFEB3 | |
4532 | 293F1F328765B0AB7A2D4B51C48E5E2B6E7C96C765EFB49FEBCB593DF1A90284 | |
4533 | 4C0723CBD625288D62D821F47FC3C28473B3C5DD3322C8D16C4EBEA14523376A | |
4534 | 844F4E51F255B2C1FEFDE840EF9F3E5812411FDB55185100403155B295C63B3A | |
4535 | DBC92BAC9D6973F0D609CD11CC3C3BE89C92CDB21B6C976164FCE64C78C7DCFC | |
4536 | DC64B362067DB28BA59ECB57C2A5880EDCE8DF84606B2A87979DB086E06ABE21 | |
4537 | 2663D35368F31CE867F91BF71FF831CE0E38084F98D501095CD4706C2B82FD59 | |
4538 | 4E1501EDA7B03CCA974AA84EE5B39FED998FFC3D641B2634D72D92AE5B8BE9BF | |
4539 | 64FBCA1B8A80969285372EBCF24A27AE19B48009B144376992058FC36C23CC5A | |
4540 | 6E4A0CF12337A9EB8AF4EB6694621877CAD1C713A85940DCCE4FA1EFB2CAC5A1 | |
4541 | 5FC3CBB1E61418DE140D044900F52A6BACC68CECF39C9491756BD3153D07768E | |
4542 | 9D271FDF798A9BE772E9D6203CB03206020B45BF76810C0315448861A5A2030F | |
4543 | DA8EC1254C22D7CC89684B5AAA2141B7FE3AA4EA3BF55D907B8AD5FDD7488DF2 | |
4544 | A92B28261638A4862130B2EDC13E78F97B9E61B0E933F0AA0EDF58A66BE288FE | |
4545 | 84C209CC1881C5E57ACB026EE9EEA1CBCD4A4B02E7FDEE62BF76D885E26B2297 | |
4546 | 2C274B7FB21A9B660E934FEA1471473999B90DF953DCFB6D68DF5D2E021349D3 | |
4547 | 14314662237C892EE094D4735D2858FFCD6DD748530645E493C98D80A8285CE5 | |
4548 | 6715A6328533B1397C3705CD56E0C75387838B370112A8B235ADC17A0A56E03C | |
4549 | D175FB1AC49115DF3A8068BFAE58E8CBBCE530216BBBD0F9F3944427571544F2 | |
4550 | 8C62339695952397AB33C31BB14D2B0C9F3ADA35ADFA8E4C4B60412A4ED03363 | |
4551 | 7EB00119980897F8FAD36DD39AAEB4D841CB7FD8A232A277AF527D50DE49C5BD | |
4552 | 936E0784FA8D2E9820110C5BA10584B294B2791FD0E49A687753DEE31EA923DE | |
4553 | BBD92D8C08FBACD88FE0677BCAB4938C5902229AE85756DA918D1EAAC6290FF7 | |
4554 | D9F6060953B2BEF26E8C07CC430D70EB307F1C727A57F3D46BD6267A03FF3437 | |
4555 | E1D2A9716E3C4054FC42D3C0246721BDC61D4A5BDD65016F90D55BE8FB63BFD7 | |
4556 | 06B527A49F84B91FB321607879A9669EDFBA9668D1B4DBD407A7D53F7EF6CC40 | |
4557 | 83B4F1A930BA2432BF2C984C4EA14CBFB7030CD0BC1DE50473BE03E04BE50DD1 | |
4558 | 7FB991971A7410A7EE4118F6FE4198835C448B709D612075D0187F1D064A55D0 | |
4559 | BF3AEBDEAC29A16EB33EB458F44B0664E74A58EA5BDD24B9EE38374F68E2A923 | |
4560 | 8E6EF9E9F26315A22BFE353D875F5ADDF0821009F568476C9642BD3B942090F9 | |
4561 | 39B7902DA57E8C13BDD10ED0E137F3521D1B29F287FD6CDFA7D26E2EAF839C7A | |
4562 | 38F06ACD6D713FCBFF0510C4C35038553E463A0761F0A23DC9030F6CC4FF96BF | |
4563 | 99AF97F7D9267593812BE751607032E736626FAE21BA2912CB67547A5624F9FF | |
4564 | 3253923D889FEADC594F8975A032E566CEB10E876AF5047937881C262732BFB8 | |
4565 | 1F73C6FD56077C00902C6EBB852D1747B8FFFB1468E8204A9400C4AAF7F7504B | |
4566 | 89244B5317C1DB608BAF91FABC56827754D6AB01EB4188C1DD73EB4258F962F6 | |
4567 | D18B5C14089225B509D23D5CD4C1DC4EBDEAD354A1B108466BDC3DD86535C7D5 | |
4568 | 9DC062AC8F099821864264F13C4AB2441E7ACD2C47AF331AAEE509B0BA31A92F | |
4569 | 18CCEE565B5CE02FF94D635AAAFD9497FD00E8CFD213D22F06BE684D43369131 | |
4570 | 24DA92CD0D50373B137892A8B6A9D619094621247B06BE1E433FDB25CBEDDE0C | |
4571 | A7DBFF7A6CCD6DD55186F56A089E3901136B014C0F5AC86C819D5824292E6FBB | |
4572 | 17704445C90AC7BE8252FEB750B78804B33B2CDA000073A5530C7A7F2A4AE279 | |
4573 | 4D627939E1DF094EFFD5FCE391C4CF81949BF45203819647EDEC018D18CC1D5A | |
4574 | C0C1B1FE3D2BCBABEA21861E2F2FE5DA884F134A93F17F001DE4D595014F3E76 | |
4575 | D4ABF5249A652CA8B53ECE9461924FD87EA819F5F68893EED1A7A1FE4F231514 | |
4576 | 3E69D4993A48F014F7E4FAAFF2D8685DF2FF50A41F309F5626E6328EBE3D7793 | |
4577 | 6B8EB46F10997C63901343326BC91D6945666C8B3362A1A94A73AAD158E38E2D | |
4578 | 1436AF6B3AD32B064A6FFFBEAE70AD11ABCE5ACBF810974EED6623FF916F947E | |
4579 | 8897C2171970FE02EF18874092950F75632A916FC6EE77883AF461597245F0AE | |
4580 | 8C9C7005217A59C63F192A57B8CB74D07048E7A25F294418AAAB0ED28B0229D4 | |
4581 | 2571A21B6B46570EC066319191D8B155B903598F4942F692E3547AFE51D76191 | |
4582 | 3A16F163FCB3A73C36471EE438FD549754C91190553CAD1FCC0BA3B1C1921470 | |
4583 | 78784DBF40B54294F9EC7EC7F5A8D574CF9CF9D22B5AFA790BA5659631FA3059 | |
4584 | E2E1953F58FB83780B1C99407D48B75A13999CC536089B8AED30485E52DC4985 | |
4585 | 82D1A5790B451407C982AD06399DABB46A1A4AFAB1FB85F11B558723706CA227 | |
4586 | 37FA6429311FC4A178800ED5DAFFE353929EE385E7AC9E04E4FC63C66296C1E6 | |
4587 | 3C5E2DEDD62975D7743C6D35155A5A8367EF7395E4092F095745C3192A5A66A9 | |
4588 | 7AE6B45029753FB2230B881A5F7B0A393AB2193B15C06535458598458618C70A | |
4589 | CA5EAAA28AAFE895B5D4CF0A6B2E3C2573F790EB4E0B91C69E1E17FA78B77CC1 | |
4590 | 376510918CDF6E955F231BD7DBE1D4B0C1B663DDDBBCD1D95024181273D58215 | |
4591 | A7455285B8DE11E9795DC15B579EA328D21E9E2F8F276D3D7DD7DD69A5BED0A9 | |
4592 | 351216C84EBFDB27DA7A3E151B42BFD9165B491D670014B3FA0274F15863F51C | |
4593 | 54C322A69313804D6960AA6F0CD14A970F28182796656266DF384B25F627CF3B | |
4594 | 5D51F9831719A33AE20EB9CD0511871B416E3DDD76916219B7C93431CF22C76B | |
4595 | DBBF4D6E85432A920C532D8EED18515C4352A52E0B3CECCBADFC1C1133267F2E | |
4596 | D66668799BCCA45FB84FEC96E1BE5F9F62784043B71C05383C353CC53F04162A | |
4597 | 9D8419FF16DF736F4CEDF9EC973C501587145DB5E1F1ED63838CD8312011F19F | |
4598 | 94F8BDA1CF1225204B9510B972ABAA4F6E9A92A86787127AD97A42BD3952C5D5 | |
4599 | 3C588E96FBC8B48C088979F3881BE01C85B53BD456E0EAC91B8A899BFE0E5C1B | |
4600 | D6E38EB78BBA172D26B7F1F6E90F029AFD3CCC6E3B101777F6E045D8892C2005 | |
4601 | 12CEE278F85797C382624E847BDC406BDFC013F099F6236C6B4C21D85F205D3E | |
4602 | 6FFE140165D3176467E7B241E4BCEDCB0850B03E2810045E79E3190BC6D251C9 | |
4603 | 8A2D9CA4314B334868DD0B63DB9D00CCE4D80B4D359E54E9E81F01799905F8A5 | |
4604 | FC2860201F49F53045CAF0D9DDF9EEA4B00221BE2EEEB189D5E1CB6B15DC91E2 | |
4605 | DA3C7A24A571BB9517F8FAC84F7DD0A41F53148D61BC69C6BA042714A69340D2 | |
4606 | 86F5874B6653A43EFFD735CBAF59B539B91C1B05E6699A74B1995D5E6AB5601F | |
4607 | 9A606A94F85F32DE43ACF78E3E2B75411565BCD9A90491E29E22DB3596F92BA6 | |
4608 | F7C2DE622841483492295376FCE5EE8BA0B13D54740109D82F686810A03CED91 | |
4609 | CA7442086B0E3A5DCC22F11FAADA1474AE0B6A893B3CA6065343D21B834F7239 | |
4610 | 48B88675A71B046352293E2FA73932485BFFE08C8CF502F6BE95E999660D8B2A | |
4611 | 0FA634AB11C8C4765CB478F19595D5AC0EEAC22E20BD6F30B1A1E3B10805CE25 | |
4612 | FA694E5DEA8DC007C05D654BA6593C846B1FB7548A7ADB2579811D5785EAD68B | |
4613 | AD679E1B61F5FF45E4F8684C7EB447EBB9C9F19C1D346A1D321F2D49E84FD923 | |
4614 | 5C54CAA7F85B97232B8CEE6BD06F88F71755AFBD86D0CD6FA10ACF67CE92B40C | |
4615 | 605C488E397A2CC9C206C3D96133EF0CCBAEA910F86DD04D645AB8D40F440439 | |
4616 | 3D5F0DE8C89DD451C007793ACB6592E65441A9F49BAADB4C33EEF1BB685A74A1 | |
4617 | 25BFB78143CF48AE6E4220532452C6437E8FA281C961C9D205DB1B9ECE54A7B2 | |
4618 | 02128113842C8454CDD922610DEDEC6AFA3605F800A2C66B1E014EE0520FA2EC | |
4619 | E033F8E7BA6C6A64334D877426070CC64F4A30CF382F2FA2511FCC4E8F32B68B | |
4620 | 10D7EEC8A2D3FEB524B64E1ACC9A5D888916D1C52CB3358E4064926E46A0E80A | |
4621 | D7D379A531BE1B3679CD227B51E6D6C02FF46437C0689E7E5346D47AF8694844 | |
4622 | 8DD0BA48D36677A4E612DF41F5109385E07B96AE023621BEEFA0A691E2AA2B90 | |
4623 | E8CADEA34F5570B8B23BC40420ED1D6B2561C28A147E099EEDA54721E38D48EF | |
4624 | 4C685E67F4228E94F657486A8066269822E58B38B3BC343F9D5F57987579C683 | |
4625 | 1568DB43597420CE2BACAC2BB30614464BA2D6CD239CAA21F4CABD42E0025967 | |
4626 | 017314B488D7E5EE80E110F82477CCEE750ED06A76054A57FEA3E58EDA4E3C3E | |
4627 | E420DAF021E8ED0D4EF74864A7A1E824C4FF703ECE2C7A1E6BBEDCF03E07B370 | |
4628 | 4E1165A4EDD682BE80FFB57B031CF2F1AA3A087FD8F0097423DD6C5CB7534B5D | |
4629 | 657B06513CBA6B7003EEF17DE1694B408603A07E466032CE47A12D891803588E | |
4630 | B1C2A4654A823859C31F6A9C1E43A6CD1BC33ED401C057ACF6226FB683A81D5A | |
4631 | 9275BE95DC05E58600D03387859171860B5CC021542EC0F9A1D09564CD5D1AB9 | |
4632 | AB4D7912746DB575690193F7AF9F1E8796C9D768C36CC1E7881B7DAF0B577A49 | |
4633 | 3120506D2C28E487509CE32C3AF08DDAD24E3661C510A118B1E6532BBF715A0D | |
4634 | 6823411E2F423322A0AE1278664A2A391525C51407FC44082FA112B052D18241 | |
4635 | C4BD149FD298430464B8805A392636365F16B552C3A8C85FB4391779C219E8C8 | |
4636 | 7666533C8173D05FBD8380AF078D402E8ECD110D8211100B61C2B3AD289F2ED8 | |
4637 | 06513E48847DEC3265DDA8589CE2D08462D88BC1DE42C42C7B85C5814FDE1A22 | |
4638 | 185627E533C6D6FEF2F08829E4308401F9A3688E43966F682E008CBCEA1FAA78 | |
4639 | AF167872B047977087BABE9CBD0D32C5BEE00DBA8FB601CA91632BCBCF931FB2 | |
4640 | 6A7545A1B85240B4CC322AB87215F7FD0861E2E15D6610793D37343DDD37CFE2 | |
4641 | DA8FE76F21F89D36681AA6A43DC0A18AEE2B8890A7888DEBDC7706B0950C5941 | |
4642 | 1B4E0DA58D126082D077CDED69545AEC02608232764F1BD76E619096084F6A40 | |
4643 | E2C90B7DCC3EC1B44B0A9D57CF9A26175839B5E794DDF3D971A66BD17066F96B | |
4644 | 8F5BCD802920130F76E434A76F8FAE8CE36A682B88013043CD4FC58F0E43957E | |
4645 | 6BAD3CD19DA0CDDC20A1A59232EBA4B3D7BFBDFB03B340476C88C8D1E2610162 | |
4646 | AFA87AE597856905EA9E3BF9A9F876708E4EE74EA2B873CD6334EF39934E82EF | |
4647 | 57FED286EC865B17F0458D8C80EEA530A48AE583D90327BEF4D5572C2D6302B7 | |
4648 | 2826CDC8273D472681AADF689B1C35468B4BD921176E2E6110B701CEE8849057 | |
4649 | 1308F271EB8865D933305FAC772D81DBB57AB63B9FE4A099FC5C12A3D0C3B53E | |
4650 | 5734D8F9A6363E7A495DA00171614BB09EAC3DBDF70FF4BE66A1B7CBDB0EE947 | |
4651 | A66EFB7FE439A044014FE080B3456E6882885826AB7F7607B83420EB3F1938BC | |
4652 | CD256A898830737E39B674A2AA18FFEF4A5060294EB206535C95C56EBDE03FC6 | |
4653 | 58A99B4F468DFA4BE4F63E1355C57B9365CFC853D4DA74774E8C6EC887F1BA26 | |
4654 | 5D1850271128267EAD0C2B707BC18382C8F1C30F45DE1BA668B694AA78AFBB5D | |
4655 | C8948DA576469BA18204F616F978E606BE2B07BD972F3247351D3F8119EFA501 | |
4656 | 7C471171B70EF45ED3557A26501F599B7606A1F3D3F543C840B38AB2A9AE7D3F | |
4657 | 9AA1633E6DE860AB2378329FB9513F1B479B9C553EE43B4565E49D4FB7E39CD2 | |
4658 | 998D5FC63EEDA03C1CFB5CC07F3203AACA07C853B69DABD3B48FF745B79AE1F4 | |
4659 | E6013DA04F13E069648104D5A38A2678F31BB1DD166D07578DA08A3476E773E0 | |
4660 | 9C23D8E05016ED76A0CCA6BC01BF814996AAF260249389C47CC8CE66B454A5E9 | |
4661 | 2643DC04C42CFB12FBB9ADB0E78C79C982D7F24B2FB4E5D32EE804FFEDC9FDC0 | |
4662 | B9984261D8124B3086B2303636C1DCD552AB7CD18AE2E6BFE248D02882014F5D | |
4663 | 659C48DB8AE75DD1C5589272EC3D33A552089E26F80142AD0CC676F70A94E2A8 | |
4664 | 70BD0F2DE0F1BEAA038C6EE73CF58AA15BE408EFFDE8BC1B2645E1C13272EEB2 | |
4665 | 45E63EC4B4E34DE3F1BF7E8530DDDCAD1DB9477E253BB0CDD7DB76423668F37B | |
4666 | 6D8CF668643783F562D1A88F831885F92165158476A408B5891AE6583B10E0A8 | |
4667 | 2DC1178398D7DDD886B05FEEEF6505C499EAE9A4ED51099D3D424879E7BBD4AA | |
4668 | 61C14D18B0239F63C1E6A3D559D232C4833E09C36B5E7A22ADC68E1963610666 | |
4669 | 1A6BDFB86A6693CC2CB647A4E339C09BF17FDD40BF22CD952491A5F5A66B9732 | |
4670 | 017B68D7961C360A317C013F335CD54FAED7A0F75C75C25C575DE3E65E3F0FDE | |
4671 | C30C7FA545BAA0A3A1A22BB859C16F58E93FB0CA74E98E3899D7923C055AE485 | |
4672 | E75FE2C05DFF8874F452796F95BAB9CBD271423DB40C6087626C5122454C6A9C | |
4673 | BBF205BC00D07D9830F8AD3A76A5A228E9911583358D2122F959B233A8F590FE | |
4674 | BB916539D2AF54A10C52AC6541B1C1CE997480908E02A722256EDB75BEC4E962 | |
4675 | 1CE8BDDABF01A673F31775C408EAA2A5FED6AAC014B05C36F3C54D9AD2DCD025 | |
4676 | BB70733EA2185F9FD618788854DF25427E870D37224C6B6617E3FA0C251C3FB0 | |
4677 | 6B358CA539D752088A0945DF665D6488E37017EBCC6502CABE9CE267BA87A6DA | |
4678 | E48B1F12FAA0BF3C12FA2E860259C6586FA7843F584CDA55404C88D283141685 | |
4679 | 41812C6FEFA7A66AE6C731929D09CE093EC6712749285DC2FD2512F40EC1B114 | |
4680 | 70B7613B43D761CB6A02F570A059331ADFA10921C3A3C4E6BE9637FC8B690F23 | |
4681 | 138A098D8E1EC01EFF56C86D246BE7270FFAA7C512C6FBD96E3C472F939C1893 | |
4682 | C8A3394C34045B700CF10355913744AF99463D6E2573106B2FB9ED07B79ECEDA | |
4683 | F9F6D041B6061CFD8E02887E5C5B0194243F3DCB40909C3C03333A279E0D9A9B | |
4684 | 037B84BD6F7300D0E5EAF980EE53B7FD883886528D521DDE4F74536C7F1C5BA8 | |
4685 | 6CF279C90DDBB82DDD1EED77FDB05E8350DA91080BCEE5E3C84F003325433D10 | |
4686 | D03C08B43EF95318EA3748DB9BF84D57A712C0308E80F5A54A38F0B2F7AA403B | |
4687 | C57BD4BB6243F7A0B09AB0C885735D9861115ACA7567ADEA6FEC6F59973584BD | |
4688 | 43B3AFD18824327CD6C21D4FE1F16F6C67D01B97FBB6F70DB5D7D6E46FDE0D09 | |
4689 | DBC1E45DCF82E9FB3D465175DCBBF254C59447D3C3DF1F66E0EF8CB6653EA52E | |
4690 | 4C1D346D33499D2CF129D9704D74AC399DA2A23092216969B5B8D8B520F05DB0 | |
4691 | 345E1BE31E211BE01A1B1FEDCD9F2699E9533385D29F0C80F990CA5A874EC60D | |
4692 | 8CDBC045FC2E2F6E7A2E426C485DD04C4052A80568951B7C5B7A7FDF8DD163A3 | |
4693 | CA1D6A36A80B7CB4401674E6E1B9E8F2DEF2ACBF87879AF5131DBDF6A0458B01 | |
4694 | 3243CAFB8284DF8C4F946C328B453A363103665491D387CB40A493B9159F46F1 | |
4695 | E95207F8E71D827A15A895EB17899D2C0FD610B9C3D3F8378310602034DA6BB4 | |
4696 | 6131CE208D659FD3AEB590D2CA5918ABD2C10E16DC378CC922D605C66850C6FF | |
4697 | 2CA7BB0A1538BE6DD5CCBE51CA7509A995F2FBA6D2813AFFFB625604D25D5BE3 | |
4698 | 4B677D6CC459FED33F0A58E740A1EF93455D2B7CD3B6D7ABEE83D3BC3823F2AA | |
4699 | FA77DA4784BB1DBDA4083D991F9104BB62EFE168D1BA37A2E3EA54BFE6FC2C94 | |
4700 | 47078B5E340D2237B312258AA715FE854291D40061B6AA9F9907146EB2FA3B1E | |
4701 | A1CCF2C8D2FB8230406FEBA3D184317B4F7F777410261D500F55751A0A445DCF | |
4702 | 8B100FE5B149B2D2880C3390422BBB8E8C6B8A8B773072A0091C1BBF8415B329 | |
4703 | D16FE300AD05CB4B62C90ED22ECCE09B5786547455213BDCA572889B926E3DC2 | |
4704 | 6FCA839E42D5519C1C2CDCF412755B645AF3BC38897CE7750B8E47F6E352702C | |
4705 | 9C554B0E2ADB99F2A0CDF93DCF419AA331BA310ACD315C11912F4F8898EE964D | |
4706 | C1E9B8606981B25AEB7E411114D74B37952C0528E51447675CD888D80A0F15C6 | |
4707 | 21A42FC33BB3346D51B6BA20B726EC79F582A90EC43EE690F0A83B83D2E23F3E | |
4708 | 4F5C12E8BD48F1CFD04A189937925596C040562F4DA681B185BEABB00F7EEF7E | |
4709 | 1E44F8ADFC6792AFC7C3C809338A6B1C046917289139040D382F60652624775E | |
4710 | 6C6214AF5BE1D81A2A23CF2380BF6A13E88E87E2F1095B60798AB4F657A26671 | |
4711 | FE1C598578506C804FD43FFBFB76DF8D4C8E647F9D021C46011E70880A8AEDA8 | |
4712 | CBF3F181533340999B7620066A460E564C3C23FA8B29CC1BC8D337E2B1E49ED6 | |
4713 | 9D10EAD96A52AB4D06982F4C48873C6F4872054695F253B592B83A1BC90A4BA9 | |
4714 | 8371C4D319DD261B9A0AB13F74274E5B376A3288FF60C93421F114B51355E725 | |
4715 | FB265D39C00AABB2DE4300968FBE7F652C4EC71A7EBD58A20F2B4C1E2D1E3646 | |
4716 | 902A0F815E9D67B50861D6CC2AE3AB45BDDF3782D685ED8E41C0D8F1FA37F238 | |
4717 | 00A8A3ACAD22D898CF8E95855558179BC84D199C6C79A3EE2651167A4067A9A3 | |
4718 | 49109AE7F53B59EEB1F57DFD4A00077DFC2BD2CB1E3169F0A348D4DDD2D9BFDB | |
4719 | A31951065B0230504FEC2975FB5015838759745EEA1347DE8591A58783F1EA48 | |
4720 | C7A7456E94BD2ECB916B85160277F98FDEC95DEFA7FC19532AF90C6AB3399C55 | |
4721 | 86BF03B871A4C4386714AC62E44857919EEB2658D1AD72570D70F1F9926D6B3A | |
4722 | D12988299F620196898ADC3125C5A7D11765025B237983BA1DB66418B484B022 | |
4723 | EA1018CB14150269A089EE9CB3EAF08D4F7E15E29048F729B9D39A15C00B8715 | |
4724 | F030F927C8AC027A3B040CCD0CA1FFC5C6BCBD00457BDDB418BA3805C30AC43B | |
4725 | A8DAAE706D404E22DFEB24AF9874D741C9DA45B3163C259E8DBFFB6ECECE2B97 | |
4726 | 6BD4335015222631F5D86490C0F9BD7C22ABD32D6DD412DF772548B38399EC08 | |
4727 | 0E28700A2ADAE8F0D50EFC4CA8642E0E996D72BFCDEE1CFB252A6F4D8E03347E | |
4728 | F6328BF18282ECBC88DE3FF382726F910FAC2DD599E63EF7C3068C1CD785D101 | |
4729 | 16B7671ECE1E0D30CCA1C6F2D3AB5E81E309696DBE4973F71D240C207CF73CAA | |
4730 | D620DBE563AC9B2000A628E8657A45A24030432AC74B5ABDD022CCF6AB855E1A | |
4731 | 61619EB4DBB848A6C2ED5745005938EC8F516979806AF5E714704027A0CECE87 | |
4732 | 4C44DAE80608392EE0EE0E39555ACADF1D3A873D35CA84D87ECC2AC41937CB62 | |
4733 | B250E3C1AB878BA32AE2E161D13FA536A305B352E3E0210636A81C6655CFED25 | |
4734 | A2B75AAA6FB0D2FCF696358223E78DBC2B9BCA15271F7612769ADC00BA66A2FA | |
4735 | 8E38ACEB99E18B7B4A5C2B7977169EC141121F0664EAD87EDDA372BE22988222 | |
4736 | 27D477A6A4715C71091CB2F01C6B3176160BEE79CC8FC854166DBB093A49DCF5 | |
4737 | E45AB3B20EF3223684E83C8FFB2D5DE9CB49754799E038B748E75C99EBA6D69B | |
4738 | 36E162CC3860E33896371D0164C14138181F2E00FFC08E2A3619E1820A560C7F | |
4739 | 63B054216AC8CBA7B034AEEA8E735705AEBB0D78F17856E1A0476DA6E543E985 | |
4740 | 4F7AAD98E3ABB2D7B4B1629FB0E24B9FF10F06192AC8475CF8C35EE3E635BEF6 | |
4741 | ACA79F1847FB84C4B20E6067BC0593C7C39657E08A3CFF64915F887D5B99356D | |
4742 | 91C0722A917B347945E1A867B062C016EBB7D924F11C74873EB4656B61A41CCE | |
4743 | DA1780D204D28B6F0CDCB1E059B3517A5AB44D45B43221DC53FC699BBDC4F2D2 | |
4744 | 865C697EAA3B49D2AF5A4CBB66244196A3D8A09C8815FFDA307DA47760CFAD34 | |
4745 | 434D00946C23BE41A6292220F0CC19CED3277801C9C1C3CBFC755A261B4ADA4A | |
4746 | 0C9C3E7F8ADB77A5C68021775619D9CE770B4FE975CD468BC5CED173CE1356CD | |
4747 | A26E6AE273197511E50A014B19A5B79C7B75A57B08185B20AED966A4C9DB4426 | |
4748 | 1294A5BF040A05A4FE60FB202C7CD2BE018DA7702CDE728193B72F03C3C0F1EE | |
4749 | 58CEF81EF167CE9F8967B4DB7A3A3BC0868B8542DFF05D46DA08CA79F62ABDC4 | |
4750 | 39373C66A08D536491CCB5EE828E410576057488E85A47D5D9F99F748E19AC88 | |
4751 | E207C21EB573B9429A7086A93CA63467B3EDFE08931BF575DB82B76AA9C05E00 | |
4752 | 29C7D4F53CA16E6DD53BF23A0991B1C5B4902E4DDD5178E55C2BAEA308C5877A | |
4753 | 3A21D1184FDAF68ADF993920AAD2EDB045E98C990584EFED9250A332BBC01217 | |
4754 | DD58CCBF7DB9C0E51473CA37655DECE639C28E04EB47E5B52DCA10E92BF83F08 | |
4755 | AF3EC395D0A74BCD4377EB7AFBD1F0B521F6D8F0741A07BE28D6A8C235B90B7E | |
4756 | B448354C9FD450F98270B3083515004B56718E81C4C6654E40B692780D83695C | |
4757 | 3F456A401A6D24740C67A485AA8B616B94B23EB889AE93CE66F5CD6916E32C66 | |
4758 | 809F5D3C4D52195D1335F89D1AEA6C07A1AC8E8F30AC662E11541536C50A6763 | |
4759 | 5D8C71FA8E0EA2BB0141FCADA7AF9CA0A69AC758DF87159707038D81DD706B6D | |
4760 | 123D53212F77FBF6AC06A7771FE86D254F9E6B29045CB60628EF491A26226D02 | |
4761 | D799A4B2E1E4DC25BB157BBDFD0958E1A4617EFF11145D3EB94A389F514D1247 | |
4762 | 4B6A4CDE1DDF18A826C0BA8FBDCA2045C3BD3465C371248428A4CE147069B2DE | |
4763 | 63E85D5F92038E8986DF08510C6FF1DCD615A7164A287A8C8C869C4B1151820C | |
4764 | 8BE898107D19E768E66125C6A6BCA28D1A99BD7E6F58F60DA14E77ABA2001B54 | |
4765 | 899B488C4DE7DA167A762CA3CAB0E8D157F6BED3679F019546F0322A7F6ED7E0 | |
4766 | D6AB34BF0F646E07A4C08EABC1DC40062E17386A406F88FF43C3AD322E8A85B3 | |
4767 | 9EC8C24C751ECCA65BC7A2ABC5BC0E8C883ED0FE37DC111181650CC6DF943495 | |
4768 | 5F0DEE475D1CFED3C23655E6053A884DC41E8A4D194A02051E5F7F38C625FF89 | |
4769 | 5894F611575CF75A533095881952BAB2C81BD8C303C903C81D937E4D72A28261 | |
4770 | 2167382EB3632D975CADB689A7DD5419F12E32DE2345CFAD7A85A9ACE0E63BB5 | |
4771 | 3C49A690274EBCC5CDE015218223D2FAE1A1E7344932BD8CD076FE564F523B92 | |
4772 | 6B50380301C36A67A264AC735C9B038CFD7D897ADAEC00EC65E174F47EF1EF0E | |
4773 | F4A1C83EAEC77CD415ADBFF5E3AF7769661AD8506C356C20595B1BBB7BFF1808 | |
4774 | 92015E73FEBB58376DB5368C54BD47B486330BD22F9E1804A05B350671BA373D | |
4775 | 737BD0BBF7E78ECE5C76FCE2B1DA10BDC7074164DCE3D2940F1CDBD02A996EB9 | |
4776 | 7F4227B2446C7BDC11AA79B727696467941A4C2E3D51E3EAF366EAC7857F8180 | |
4777 | AB05461898B99098E955BFA09A8371FCF1EB671DE86C89776B7C90AFB9A4EE02 | |
4778 | 39B35FFDE25BE1585476BDE88912D1E2D4C1083BA56BA4346B90EE84E6CE5BDD | |
4779 | A7CB599B4D716F7F25668D8C559E2347F20311D49CC7D3D4AA0117D017F065D6 | |
4780 | E43EB82320EEE8B29B7C7B83A6CF79D3A20B16393235FCE7F9D0D5592A80B33C | |
4781 | E664FD2F2B0FFDF29C89F7F5A5B0EA96456CC42DE1C2BC36E791BDEE54293D48 | |
4782 | BAD9DFA71606A78B5C2B8120A45F17A394F417C60CC181EB7ACA7D461A1A8095 | |
4783 | 2372E368C1869D19E4A1A23607B6C2B0FAEF474C703492E7C1D68A3248CB8F77 | |
4784 | FB17BDF28A502BACFB2E4601BE018D24EC2CEAA4537271B2B9BB7807CF447BDF | |
4785 | 5A7DF27A00D96C481ABE0B02EC0B61606505E357FBC1BF8F1A198A184BFC8B88 | |
4786 | 1ECCF1EEAFADC8D299F72370BF10AF53EDCA219DBBE145E0F1FF317515BEC422 | |
4787 | 623045574C79B689412F5E7E5B66FB463E11C507DCFAF31AC1AC380F35CB7DA3 | |
4788 | FF9A0B82402DE0696CA50B4CAF93667A489C1640867AD454CB797645710D9929 | |
4789 | 4857D74A887D7E458109B90202A50ED46F0375F71482C7C6BC14E5CA6B001206 | |
4790 | 62A44754C351B56B41AA8324EECF26A80E7D3FD85086741E70FD33C8BBD546C6 | |
4791 | 3AA832DD5BDB976D17B28481B7DAF12DEF348DDFAAC53E3455F82DEB8056C13E | |
4792 | 931F9159178FF1C744AA7882E7D49D88398EB3D023A272B8A89FB5659AF715D3 | |
4793 | 0809BB26F3EF80A788CF54449988A73B416219862845F904E091951992A279F8 | |
4794 | 33FF4A4CC37F9AFD5521E41F6FF1F12B1D9C7C0482BB38D1BE007DDCCCC37C9E | |
4795 | 1F7F34B5ECEC3E6DDF6F6EDFD95605BF60F55F2B1D345430A89813FE189F391E | |
4796 | 844C44571502F66FC3A56B222DFEF0D676041A660E6D741D8F72967DDE8C0A3E | |
4797 | 96BC0FE3243DC07CBC1F0E99619BEA04EE85039B404122E496AA7BE34A4775AD | |
4798 | E4A310C1C020AFC6E74279DBDD0F6F374691D8E3B6EEC90B11AABD20E59F8595 | |
4799 | 3397C7E9BA2052454250585469A67EF40741A9F09BA2A2A04885CED6AAAC081D | |
4800 | 0475A63CA91BFA5D6A3770C1CF80F9D01521A51D815ABB1F31A89EA13412BA42 | |
4801 | 7F1916165E012C0A94135C485E42A5161C7B94A02724B5E6D196D42BE3F408A1 | |
4802 | C11D207F5EA2CC3F2DEDBACF246719BD222861389AAC1ACFB94496CDFC5F3348 | |
4803 | 4ED4336E52D03342822CC7E267C2C9694D9C07448ED043C56C57123B08124AB6 | |
4804 | 8EC0700E42478E6F0FEFBB0549B2BE787570D2AED16C44AACBD6933A925055A2 | |
4805 | 022517A427181398FF7ADAAF7910954360EB4403E16A92D7203A4587ADB06169 | |
4806 | EADDEBC7EA4AD684C2FCB0C1008CA92508C4B755E93401568145C5555C8B794E | |
4807 | F9FE03CDD2D904FF6B3C4429188DE0ACA011BC44D0ADAC60939EEDBAB25AD69D | |
4808 | 48A5E171F88DC43B1511C6883DA9AEA734590F09FB58793D0BA23CC46DFE5FE8 | |
4809 | A9C82D1411002EC457793FE7DA76D29FB65F026587DB905A1EE651AF6E4F2122 | |
4810 | A8561A524984E0FA2FBDFEB7A8A4935DF29E126C1CF41ED66412FCDA7D07053F | |
4811 | EEDB110E865CED746D2530704C3D906DA828873B6AF2FC2D9E9EFD835D71BEB4 | |
4812 | A0C889B6156AE539B48E0D8026F5A8FD0DEB71FF8EAFC66BEA2130B9005645C7 | |
4813 | 6FCA01DE45783C2D7B75EE9A9A6A8F5BA5F1B13EBDAF2F246D701507DADB5518 | |
4814 | CA8E75918A1975617EDD5F5701AC7FDD1365F9408E3BA2171D4903A78D223BB8 | |
4815 | 0CA0E842DDBBA3C6B41D2339A7C620692F10C4FA9E8C950AAC4E86607955BD81 | |
4816 | A4E3B0131984BEF21770B436B286B93456646004854BA2055C3DE31CDF212205 | |
4817 | 883E2D4DDF58152F192E50B4663F0F9779B455C665ACD6F40E7948351BD9F78F | |
4818 | 24550832F18950ED308B402D5FC6327CFE094F1090871431A59C7238CF1AA562 | |
4819 | 3A976BCD5808405E7BCC3DED691D332C9B279C849936CD65A6FEBCF58CC2311A | |
4820 | 054CBD1D630459B59071379C3865C3C6A14E22B5B0381F44372DF1DBC8727B1C | |
4821 | 59A733C294C4322E243223A986FB8D2BF832755B5CEED304E6B3699998B223E8 | |
4822 | E28EA70BEA1358C2CEB7AB07112D30B83197B263E56937CDD0F074EC29FAE7BC | |
4823 | 8D6A89133CE8F837D64B703BC40EB64F2DCC73C763A0D31F3C058B5E9443EEB7 | |
4824 | 52874573C500ACAE072071AF89FB9C4F4641AECCD14F7315150E5947731C8963 | |
4825 | 55403D9A4A92EFAAAC4F5F6E95B4751351C4177271712F85495397CCFCCEE992 | |
4826 | 98E7DBADAE9D3C1F273AA78F75012CA5AA357DB035655B3D98ACC2988169E894 | |
4827 | C573D80D60010DFE08394A6D05932944E07BAF050AEC00E45E04A424C6C351C1 | |
4828 | 511DB1E856616281570F6DB61D75078B2D1DB18629731358D8663C615782D63D | |
4829 | E6D7D9464CD95D8B446E563D684D16914B0CA2978C473CB514A5A06D25522569 | |
4830 | 9CD74C4E46C95DCA19C8AE79ECF576A677BBEE3510F93C4176A4B5F1A4F24E36 | |
4831 | E0C5CEB30DCED55B7B051C01AB5251CB839AC2E371944C169D9CA4AE4B91450C | |
4832 | 5503BFFCEBFE1AFE8574E2020D3DF2BC16BEDEEEB76C7FBE3FEF7F085BBF4BCF | |
4833 | 2513333E3A01DCA64322049010D1802D1E50B50E39768F960BA243AE4A79C12A | |
4834 | 54D8F7CB63476916E634273F76663E4496466DB6BC16CE9E74727C9EE9FE79FD | |
4835 | B27EF3DF0E46EA9C028AA3FE5470E983BB251AC803FC07164644F385B6BA347F | |
4836 | 3FC80E540BB262BB5E0CA619CBED3C8A4311B9C2B0EB70DAAAB4DBD04CA642A9 | |
4837 | 53FA5B77D48384A8FE1F706DAE7DC478145A2F97FE5075092149C536F32A83C8 | |
4838 | 32DEB9CBF5177AB311222565F16AAC5109F31F7C84321824ED15CF558D65BCA4 | |
4839 | 9A73C570753D325F081EE9A3A78AA2F18258C5DFB32739242C0297C185C22200 | |
4840 | 34C6F979B51240A7B1A3326677929904B567550051B4D548F3AAA253111F7316 | |
4841 | D3C84FC22E64F65882773C7AC585041DFFE3A6A15F365D825FA0C43DE16DB215 | |
4842 | 243E53975DFAB3C1FA30D6CB8B52B9C55FEF96526624D5D8807AA901B16293F3 | |
4843 | AE0C4E03E6E22ABD78342AF9837A380BB99B68ADF493C1FB18CC4B968D707AB7 | |
4844 | B744D296FFEB8F2178B7C47D94DEDEAA916AABF76FA32BC0B86E2526F66ECF17 | |
4845 | 6FE4A289C2571DE0F86B9B44459726C41C6C648838F928A8E6FA682A43DEA7FC | |
4846 | 3C724137DAEBD60591A73E72F2A92373103808D3973501F08647028F83F2A9FF | |
4847 | 400344095BCEC1EDA8A93325FDD58769ECB58511436843AFC403B5ACA14B7F22 | |
4848 | AD9D64C888F1A8F4E2FAD374804A72E16C0DCC0F2F56B91B3908FAF52A2C6DAD | |
4849 | EB9BF87C40FE29015B6E655F40FAC45FEE240C5DE731CF7B54C0F48027697146 | |
4850 | 3A6FF6ADE84F6CC90E3799331799DA11AA92F445929BF4A95E9C5F4BD4D63CA1 | |
4851 | C84FE7BE3CDCA2ADF4DCEA99EBCD25D7724760516259D45DDC9D6CDF7E538128 | |
4852 | F3D92F8676AC2D0CFC3687AFB29E8BAE8671ADE209AECC9CED20037759EAB6AE | |
4853 | 42E1B41111C9BB92D422CD344E7CB85A7403788C7765AAFA62CBA09A5522A6A5 | |
4854 | 0EBE06D0ACD23E77BEF1A15A9E99A4713E67E7C08467C6B2890EEE9AA1F0558F | |
4855 | EC24065FBFB04573E13C52137EACC7A931791A5D5F675AB42E9B716DECB6308D | |
4856 | EF96E59E36E8D40B99A1E6D9F2DA7F32C1E47091733341D89DD109FCA2AFD4B6 | |
4857 | 2D65D6366EAFE4A5BB0891B9344557DB94F065B3CD7D75874AD92F24454C2B21 | |
4858 | C4D2600AAD92684996A07B4DBC73BF4A3A01620373202E31B7495DCA42DA4B50 | |
4859 | 6464003C1431AF808D30E08C4AF67E5CAE26F78188000AA0E8C97151491BF1C4 | |
4860 | 94B1CDD72126412E0673ACD9B9322C3EBAA2AA1D039EFB53BD2C708873BF77A4 | |
4861 | 7C89B9A48EFAB9E55ABE4FBB6FE868A9B2D86F96A5DB527514C6361DEAB44B53 | |
4862 | BC93CE3D3546324D72B13FDCB33F519812C1D9D66ECC126F8C3724F4D194DCD6 | |
4863 | 3FA6E6F06B2509FCEF85C6A80F9C2ADC3D15A9562D2A65C4D1392FF915679CA4 | |
4864 | 36E048D8C93D540DFE0265952094E7E6C8CB33BDCD517247FB81D564670F3964 | |
4865 | E65AD1F253EC49752D8ABF2CE12B2425551E7F03D5AFF08A7AF854E99322B8AD | |
4866 | 4C2A300672CB3A06B668A11B752BBE824C07531EB46698EE6C6B65112CB77F0A | |
4867 | FEFA9A531F51D29EE7F45E8D0C73ADA57B32099FE3F0DD59BB97BCEF2CBA4E84 | |
4868 | D892E8B6880397808D46E78E05F42AACF717A2DDEC317BE5E5FFCAEA963032AE | |
4869 | 515B76D34F880C049F3DF624FB85DAAFE31882A2D7CC9C29E7EF28E2AA4C46A2 | |
4870 | FE2B035FF8303879C436EA4A2BC67DF287FF0C3430E9566857F0CAF38CDFD955 | |
4871 | 559249751A61BB9ABB4946A31881ADED4F938C6468318A97B9F1D60A59C996C9 | |
4872 | C8154F002185DDE6063E67449A6E0A9D9155EF95A7EEC84568EC8DEC4E3E9D6D | |
4873 | 5E3E37F01FA5CD500715E0777C0B8FC6940C4BB4E6BE1CBFF8D7F461CCEF1641 | |
4874 | 9FBBE9EF79801121137F5336350701ECC4A2ED838874BA412944545B2395C1CC | |
4875 | 6873816AFAB5F4B71E978EBA442C309799F81E66312BD6585FDF500075CCD649 | |
4876 | DA023880E008D9E046660FEE0C93B5FF18722BDF423C5D820DCE694C6803B83B | |
4877 | 101E61412650B945C63348D5053C3F97B6D38821A262600A8231E151718268DE | |
4878 | 4DCB22329C49DF12D9135872A03CD900DAF07D8F3A396A39FC9A5FD04C8AD26D | |
4879 | 4A41211D509B31D9032418D372A90CA0AF2E16DB8996E659CF103EC725BC4820 | |
4880 | 9ACFB3C8D5155D87A2AFCE311BA6A18F95E37A9218BB5A45620FA20FD485FBC6 | |
4881 | DFBA5A3FA163833657572CC295C5BE868D584046555006623FAACB6602F612B5 | |
4882 | E6DA8CF67C8C7664992B8062C25E877B578194A33F29039ABD44B3DF14980E77 | |
4883 | 18F51B2AC035CF9CC17F6C6C3D75D2FF145B14CBC4F9A551D5050B7E52C855E7 | |
4884 | B5D02F32D2807518958AF87E7380B6968C51A54C735000F02DD66B2E837EE0FD | |
4885 | BAD9D9603E517B55B8A9765B5C6301040A83E56AE013786CB760C98DB9537966 | |
4886 | 8D9AE205EE938ACEAE707397C3BE2980B090C3B50C814A247F82B3267FD63506 | |
4887 | A21E253CA1FE7DA323C9AEE3F8BFAB2D9DF4A01F18DD530E3C618C889B219610 | |
4888 | E313775F33870ED4791EAFA21B649142534100060E28CA081A2391F1458F3ECD | |
4889 | CAB0BB41419C90D0C9CA95C5A4631A01DF76F52DDE04C6570F22578D556AB841 | |
4890 | A38FFC5A97300AAAB48177442755D76247F84BF57284B05E5D8DE15D0F69D689 | |
4891 | 0264FCC502E5A8D8FC2DE3F7823A0363F1BDEC4B694282D0850CCCBFFD84F4AC | |
4892 | 06CEB968973837652E674C1F953725039933EB7988BA490D4D8567EE3BAE7BD0 | |
4893 | 21CC586C3CDD38F79B0A3A94FB81FACD7D9ED04B4007345A4C7A47860E38F965 | |
4894 | 8CB23565121D1E7A0D0F3F3B7DA86BC3BDF2B4CF412BEBE667E6C427F3F86E63 | |
4895 | DCF7920FECF73F2E421E54F6F0A8E84A8BDE2D0B9C5E441F4C428CE8622360CF | |
4896 | 6D319385106B2590E0D1A8B6C56DFDE8874A3F30D6DC25C1ECB02356D488BAA8 | |
4897 | C2BA0E8CFF8EF6DA75E2EEA6D27E822F511BBA288F7AB46B3C519FA75B676B55 | |
4898 | 72E553764D23EC460CB17BAB327FACE33450E14D8329F2339600F0366869153A | |
4899 | D775A0F12471286F485A65054859B96A00723E1C451C6A8A05C88B32D10AB013 | |
4900 | 94D834F675EE8DE2A26910F924583509BBAB4B1DCC5B1FC8781D80E8CF024EAE | |
4901 | BED6FE0FBBE088F73987477FCE10B4055C28199A91BFDCE080B5F52A1DD5EF9E | |
4902 | 8506B78DE1DAAA88DCDE13C048AAC003735970A5A74E469EA21D2078FF721966 | |
4903 | FEC29EB8D667540184E3CE37797EBA575CFE7F484C71F16D84ACFCC11A769250 | |
4904 | 585B7E825E70BC5AF10B9DA5D4E0D7661B486DE2B1357259D473A57598E257B3 | |
4905 | 993F51D3FC6E6EEB9F4792150179796020914877D26AEB07C527CAA4468AC50B | |
4906 | 56D8BF2F137F59E55AF7E778DB993EA55FF446CEE4E8E5D87852F211CC342557 | |
4907 | D2F3647F6BC423260E2AC6398D | |
c302751c CR |
4908 | 0000000000000000000000000000000000000000000000000000000000000000 |
4909 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4910 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4911 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4912 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4913 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4914 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4915 | 0000000000000000000000000000000000000000000000000000000000000000 | |
4916 | cleartomark | |
45c0f7f8 | 4917 | {restore}if |
c302751c CR |
4918 | %%EndFont |
4919 | %%BeginFont: CMTI10 | |
45c0f7f8 CR |
4920 | %!PS-AdobeFont-1.0: CMTI10 003.002 |
4921 | %%Title: CMTI10 | |
4922 | %Version: 003.002 | |
4923 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
4924 | %%Creator: David M. Jones | |
4925 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
4926 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTI10. | |
4927 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
4928 | % This license is in the accompanying file OFL.txt, and is also | |
4929 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
4930 | %%EndComments | |
4931 | FontDirectory/CMTI10 known{/CMTI10 findfont dup/UniqueID known{dup | |
4932 | /UniqueID get 5000828 eq exch/FontType get 1 eq and}{pop false}ifelse | |
4933 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 4934 | 11 dict begin |
45c0f7f8 CR |
4935 | /FontType 1 def |
4936 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
4937 | /FontName /CMTI10 def | |
4938 | /FontBBox {-35 -250 1124 750 }readonly def | |
45c0f7f8 CR |
4939 | /PaintType 0 def |
4940 | /FontInfo 9 dict dup begin | |
4941 | /version (003.002) readonly def | |
4942 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTI10.) readonly def | |
c302751c CR |
4943 | /FullName (CMTI10) readonly def |
4944 | /FamilyName (Computer Modern) readonly def | |
4945 | /Weight (Medium) readonly def | |
4946 | /ItalicAngle -14.04 def | |
4947 | /isFixedPitch false def | |
45c0f7f8 CR |
4948 | /UnderlinePosition -100 def |
4949 | /UnderlineThickness 50 def | |
c302751c | 4950 | end readonly def |
c302751c CR |
4951 | /Encoding 256 array |
4952 | 0 1 255 {1 index exch /.notdef put} for | |
4953 | dup 12 /fi put | |
4954 | dup 45 /hyphen put | |
4955 | dup 97 /a put | |
4956 | dup 99 /c put | |
4957 | dup 100 /d put | |
4958 | dup 101 /e put | |
4959 | dup 103 /g put | |
4960 | dup 105 /i put | |
e6983002 | 4961 | dup 107 /k put |
c302751c CR |
4962 | dup 108 /l put |
4963 | dup 109 /m put | |
4964 | dup 110 /n put | |
4965 | dup 111 /o put | |
4966 | dup 112 /p put | |
4967 | dup 114 /r put | |
4968 | dup 115 /s put | |
4969 | dup 116 /t put | |
4970 | dup 118 /v put | |
4971 | dup 120 /x put | |
4972 | readonly def | |
c302751c CR |
4973 | currentdict end |
4974 | currentfile eexec | |
45c0f7f8 CR |
4975 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
4976 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
4977 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
4978 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
4979 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
4980 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
4981 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1B57C5FD29DA32D34C95E | |
4982 | 2AB2ADB3F60EEB0600C8ADE15A2380DE10AC5AAD585FBD13097B1A7E8E210D4A | |
4983 | EE96785449E07F0C8EBC2EC5EFBFD0897DFDC15E5BFAC9584D8DE95C5AB288CD | |
4984 | 8AD8B9BEF0B8E5F887B3B0B331542FC8184DCCB753DB6ACEEF98B85756B988DF | |
4985 | CAF1AE0DBE7D37D5F44A2E760AAE3A5197C27B15E32275A64946C3E4D0476FD2 | |
4986 | 7FDE148C788DD2106F7C825E270588AC05B57E625AB17BDD02306F9E5FC851DC | |
4987 | 32A5A6EDC43C770A71419B2C0C8074EF3F222C8A2097CD81A91F333A521B3A09 | |
4988 | 482A4FE1CB231CE344AD126AA284C3280AAC3AD162CF0EE241BFB4C8F20502FF | |
4989 | 118507F5D1B5FD898571015E73E5CF2281085072E00D401F6F59761EEC3E8381 | |
4990 | 1F26F75DB66C504AB6BABA87D121B1E7040A07AA2FE01F80DBC246CC03C4B2DC | |
4991 | C2A715980C52B7F96BC1A78FCC7F4F52EEED5F705E08FC1E5BBFCAD121FA88AA | |
4992 | 8EBE58172C162AF409DBB0728F14923ED02A65EA24E5D52B6AD07777455A70A4 | |
4993 | 61833D3789C719BA92E901232599767E423D5AD9C807670BE0E7B5CFF8256A20 | |
4994 | C7BF7214FFE0342809570F5966A2C43E784F35015D9040BA34FEAB6A6F089504 | |
4995 | 3A40A9E9D711A2721D3F4998371430FB3C94BFC619559B97D49627BB630F4B70 | |
4996 | 9D0A8FE4E916235335C3962F3CFDB04C4A3CF714DB5E260F4E66FFF2F27CEF2A | |
4997 | D4AA26BBCAED23B8BDC98F8F453BA27AD7758537561E766B82DC3032E92A9EB0 | |
4998 | 125D98A22C5466AF069BF72A9BFA052A8628FEC6A6AD0B711DFFEDE3AA2D7CE8 | |
4999 | 34EA487038EF50F953B8B4471CBA6FC3C53877EC1BC94582B1123EDF44B4056A | |
5000 | 30F49394BDE22CDAD7F01951C7013D26979277D18EFA594E8F4F2B5E615187D9 | |
5001 | 39E842EC28461B9ABA52020A127D2CB9002A673A435B13C10602EEFDBBA6BD49 | |
5002 | 9DDEAB9E68D655443A5C2492BA061C1391A51592BA8C353A6F6A0708E8860184 | |
5003 | 2B5D031D2CAB87D618E9F6F7A0BF3F66B3FD5A25BB91F7F1F5F99CFF56EFF4FF | |
5004 | 0A35C55658001ED2E97B26C869292F6274D433A5443179DBB8EE987196306348 | |
5005 | 3F9E87C6422AFFDD30080C9AC4EE7FE5E2DCBFEE4974331F4AAE479FD8806D4D | |
5006 | 9C2B85FC69EB0453AD827A1E767E5C484BDFBF5C8D6E2B3C96298B390F22D757 | |
5007 | 802643A79D5E29CF3AEDF0E12CFBECA4663444FC87F2027571DBA9ECF688BF28 | |
5008 | FF0DDB3AEDBA0FB28447CB4B5D5205F40C1E7A525FD7373392EEFFD910AC82D0 | |
5009 | 98E71660A1B3227C4A2592F3E853CA4CDF64DF19A52582E167234F4036FAAAB9 | |
5010 | 5446BE102DE2BF43E82F0112C2A20F15A3F92C6571AC761665A905362C4F8BDF | |
5011 | AC8705519C99862CD9C0D75113C4AB5FBB83C880E46B82715B5628890D9103AD | |
5012 | A2329638B95D93C4DECDC5E6C588C9D5183EE6FC28FAF9825F02DCA567306D93 | |
5013 | 5440987A81B51EE7291107A08F201C609FEF91A8F0587E8B13D4BAF74A5A6815 | |
5014 | DE9E4441F46AF8E1DDDFA2D611C889614040B144A5EC064DEE4638C04EAB2E37 | |
5015 | 4CA8F50FB8C4D65BB296DCCCD39F1F554CFBED96670A91F515CA10EF896874BC | |
5016 | 8EF48C6447752C70FF5A06F928DB55586354076773BFF7E94C4C3A7A1C1F421B | |
5017 | A9B4E3936EC26E0C19BBBFC90F021E877F54B62108F6DD1C7F6D5B8E64FC9362 | |
5018 | E173F01BF2904B7E5A08B3543611562C2714099DE7D4FA330DB148B560A9601F | |
5019 | 42A84452811CE213DCE782A0D7809CFD954D6BC1EBF2BA4D1B18F50FA8174C96 | |
5020 | 3E0120E266AD5DDB40B3F6798AC28CDC5C3C4BC34583528F5B5DC8A222B80B59 | |
5021 | A3A93DC715D061EC6915E6E6E21A25425C25E8747C60F170D61047108826F96F | |
5022 | 7830E220C108B441B6EA3198E33C49BAD8D43086E49F5A2BC7958A1A8CD011C4 | |
5023 | 49045193394696EC3DDD0BE084E8F2E9F0B9496F035C0DEC1CE11409DF566428 | |
5024 | D50043CFF5CDD1092F6E0807E660B68163BCA738E8D98FC6EE3F713164CD204C | |
5025 | 0BA84FFF4F33F47BC31750B448603D7ADB9AE92FA91AEBBBEC0DCD66980E6955 | |
5026 | CEB425ED07115B24E40F53B29B9D840842EAC691B4F591F866DF27556474B485 | |
5027 | 1C6F53DD72499847109B16C7093984A6B8487D4F3870DD517945CD90E648C1BB | |
5028 | 8A6861E540FCF9D75B984B5009B5CC760CBE297042C240DD624111670B703388 | |
5029 | 6FE6FC0E89C6B4C88F51DFF3913D0CC1FB4770C8CBEADD4B86393605C0B6C468 | |
5030 | 83CA5594754411B6FC331EF56D7CD6D247FAE42E966583C29239A8F862348D29 | |
5031 | 60B177984B6B957E733DB4D275015691D91443BBB13C2DA96097A29733CDB284 | |
5032 | 42F89C85A7A743338C9DD3BBC4EE53F695E5163E6E1ABE5791ABF100B198B9B2 | |
5033 | 1C21E2FA2FB4AFE7F9BB2D381260CDD3A2CC05BF513AA1E80ED69FA27BC5ED5A | |
5034 | 21445BF00BC2F997B356D94AF13736C6D3B0613EB6F4CD96A685FEB672661DCA | |
5035 | 206105EDC3CA07900676EB2FAB37F48D2E8207BDE1463894DA3C5B1488AC1EE9 | |
5036 | D39DAF691648048F5D7A384B8927F8DA2BE3602669F71D80686E427F395134E7 | |
5037 | 7ADCC611BA91AD4B7A0237213C60CF2C905359C90795230344FC3C50A22BD44B | |
5038 | 55B2044792509F50F5C21F53D9F9E9F063ADBED3AB99E2613B23334FE8DF70B4 | |
5039 | 6120F2EDF69F50BE793EE145B9FF9C73179DE640FC2ACEB5C6617F918CEEB762 | |
5040 | 4CD81E665B2E544864D13230B058717B207D3CC5D6647D5343DB4D0356082392 | |
5041 | 871EFFA896631A7E0D6477942B632074A9A4EF7B09D4701B1639BAAB4E03A40E | |
5042 | 9B54A7A4F845CD63F88831EBFA4FB847847CB98F3455CB5957F2E0A0F5623645 | |
5043 | DBB5C5564C7F8B117D6E27E65C0F3EA81AE67B4AE4B201E7C4FB0A8364FE53F5 | |
5044 | 41A7CE8F834C2C4B322809B353A5E63BBA7BF3B7DC1A85EA700BD287C2BD3FC8 | |
5045 | 2832B0BB4695FC937FF5EF06FCD87DCE6DE793C2B1EE10E6450352C17726155F | |
5046 | 220D550B1759E15AB2C1D5968E52C8080CD280E99D3CCC0E80C2EF8BBFD96001 | |
5047 | A226FEED7311EFB4B67F424B557A877379A15BCA54780F0CD2CCA00400B9B39D | |
5048 | 981C6B552AFD2506D1B23618FA9AE6D8143CD7198A8482CB416CCE62B992347F | |
5049 | 337D505A4078713BBD91E5535BD58EF0351EBDCD749CC24D4AD39F8CECD7D6C8 | |
5050 | 139756680A4C03A58B3374CEC658D30160AE4863A3938A891BB59CBE02BB451B | |
5051 | 1BA4B2B6E68AB61DEB85F95E3C909B8B66E220B9F18280161C279F10F7093CDC | |
5052 | 100A53D542F071CC0A5AF834DC1D18738F5DD62A5573E884E1FFD22BD810828A | |
5053 | 1EA47F8218C15A2E97CBC609927DA3CC2B802EA4A0D7EB57627C135E3B065905 | |
5054 | F97597D818A2C5CC6F328AD25AD11FA50F1E4FE637980B7474D6F85A521892FB | |
5055 | 72989AABEBE02A2D0EFE88A6F67AC29F5D8DDFEDAAF465C439983C6B84389FF7 | |
5056 | A6434462BEB7B07DBE4BBA61ACD4A60C55B5C0AAE527DE381DFECA2E6BAFDC8D | |
5057 | 310364ECB42CAFF72BA93C067B2F02D1CA7C34AE7CDC46787A0E234C8BE8A928 | |
5058 | 7A6F3DDE0338FAD532A9886E8E3525B85DD39364AB03EC4C0DD25DC179CC1989 | |
5059 | 1BE232E387E857C78332D834679195E10F1E7B87B7966DA3B2238F53D1E13FE2 | |
5060 | 8F55ED6A92A750C7250C9B91E29796621E7E9520373214D7DA81B2875A986D33 | |
5061 | 80382AFF6DE1F829F048E57664D9C4ACE91E4684A51023943A4964AB5657D610 | |
5062 | 3A5405EFD4CFD1EBA684243E15093C9667797BB47617B66054EE02C41FFEC45C | |
5063 | C1BAE8AD56B00D323FCB1D2744F061FA16E161988741A319B1564E04BA210996 | |
5064 | 4F9F02A3268CABE450D166A763F5284954564A1C86B76544C5F5ACDFE0D758DB | |
5065 | 865A1CFCF9FE8CD5F9C3B2998C56468FD52DF8EE60C6935A3D221EAEC7714E3B | |
5066 | 301371C7DDA0B03A2416238F2B47BAD3A2C5021C886DF51C695AF9C87A864B48 | |
5067 | 3BB3FE0B355EED5454B59B25A0D8A1B8CBD356C24F64D9B55E16C30C011365C9 | |
5068 | 1E0380753BA3EDC0868788D5F50B9353D0227BCEE1BE36998B2622C0759BD66B | |
5069 | E4444250589F9CEDE766D8B940770CB6B89503E925B35C00CBEC2873D2DC4A29 | |
5070 | 0823FB7A3717B69A7DEDBAAECC067949932728E89BEECAA91DE3AF9BF070B9C0 | |
5071 | 30EEFA8C0A55C8388CAA2F0515915C98E67FA095BB98967D14B0DCAFA9622E4E | |
5072 | 2E0EBFC768D80585ACDF28D8A5C2B6EE2FE7AAF62FFB90F569F84A0903996DF0 | |
5073 | C1D5723366C436E4088F3E2BB9B47F9789052A71CF5C49908CDC1DDA194BFB89 | |
5074 | 14D7E3D7D4D72A150FD6FFD8303E9DE5A97A71B808B8BDF2AE466F31BF5D7A4A | |
5075 | 44F81230BBE2B456A221E2F72A8B59F8FEA8D31F8A005A5BD93B9F49CFDC3DCC | |
5076 | CE2B67090460F632271C7157BDC2F05BC2749FD562FC28682A616A52D1B67654 | |
5077 | DF78B7843A9EC26A7DE2EB168F874904C2915B97534B2D4D9F74A9573A771D34 | |
5078 | 9F7BC855E8F794621BF6AD471BCC347E2DF5F620F5C209E33A4CBF1EA85AEA87 | |
5079 | 4492A77342DD33EF615FF34037D660B713C908786D9022051B825226545827A3 | |
5080 | 2AD1B05D654DB6E6D261B4E8AF0933AD1F0FCFC7201E1A7C1B4199F160C38676 | |
5081 | 21ABA2DDF1CEB655B3EC3226E0B122976EEA998F7A5241F062E54AD1DFD6ED26 | |
5082 | 47C99A439E0AE95415059179867CDD3F0FF751F3141309F40E00A6C7C28433E4 | |
5083 | F649BCD5DAA64177580E05C495EE7BCBCC5FBF104DAF360CC2711386655B26F9 | |
5084 | D349D887EEB32ADE595241560FD5924A1745A22E6A01DB9C285EF14596EBFF0F | |
5085 | 03F36EB2E0A7C3864F819EF7B0855121292D49482F046A55CD7271FE03F02EA5 | |
5086 | 886864D9D8EC22A68C23089EAEFFF03DED6484D8C341861EF8B6FD3C5BDF5AC8 | |
5087 | 352DA4E13A1E30D0CB71E090E9CFB9AB2CAFD0CA7C34AE7D8E3B2EB4666834BD | |
5088 | 9CCD1AC2108348AFEF6071796F4BB2FFA4A67ED917E76A109FA2DC2A30D744A0 | |
5089 | 9AE653A748C1D18FB52595D84E87F1C1FB6B2F32667FE203262C66627AEFFED3 | |
5090 | 92B23861E5EB238BB4EDCE09DAE1C65BAFC198CDD1B45D42CDF93E16BB82D35F | |
5091 | 821E9E49067E966AFAB2AB52928F8DD6359984071FC37AA652FB834A09E5BD93 | |
5092 | 3AFAE161140E74C6531E413E8FBBFC42BFE8A464B71EB1D8CAA93B33D7BCC3B0 | |
5093 | 47C7EEFCD3E9FCF26FF9441DD9BDE68D77AD7251C06BBB9A2103049E8827CAF0 | |
5094 | F26BEF33F656A690235DEEC623CC519AFA82DE2AE16FB99F780FD7D8290DA40B | |
5095 | 9B604AEF36B529FD184239E7D50561A07428D28E51B55546590A1AEAD4B7F2B1 | |
5096 | AB8C5B9022C1FA03E33F8F409B24911AB8BFCF6EF4A8E415263C789F89063E71 | |
5097 | C0910DC20347469380B7FC1EEB87D4CED7F4A361E58B61C91AFCABA35C03F978 | |
5098 | B9FB5257C31657EE48504C355CE893FE3C553274C641DBC4004F5D5B879CC5ED | |
5099 | D3F21F867F6DF054127067DE86189F0B59A1B90FDABCDFEE61423609D888EEFD | |
5100 | F4A1367129962110C651D9481CEDDB8C5C2576A59AED64E95F7ED042AEAE2F7E | |
5101 | 81AC0C408E593DC30DCAC334EDE9EE27D932B98F040DDCD195D6155607DD2038 | |
5102 | 970EB78221A94C52BD4F0EAC65F1FC10E5DAA93C17266F351669CAE56F42B68C | |
5103 | 6D01E1EA03AE554D63CE76D800FDD9CFD89F80A241EAEFF7EDFA41794EA25CE7 | |
5104 | 97BD5028464D2CD45B53834B4AEF8BF0B9E7C6ECDEACEC887E8790A47A93F668 | |
5105 | A9095E5FA1116A122C0E5B74E2226C654D3187C6CFD8807917820423DA3EC1DE | |
5106 | AA020EEEF2280C44A15209EE2F3FC1776875308CEAD38571E7BF889F287E4594 | |
5107 | 971A83605E0B4169D4A23EE790515223DF8724054EDAD905F57918FC0BC64F96 | |
5108 | 514B4BF7DC9BA79E763C22C977FB6146B10D26FEA1BAA7BAF21312F78D1625A7 | |
5109 | 8E242D743471DB5821408AB786E4A7EA9D35E30E85533C617689F95758FB2C7C | |
5110 | 392E759C299DCCE36689686DE0C4DCE32649493650BA194A6208C5EAB670B170 | |
5111 | 3F2C70BF0EF0E3BE2FB0A79224FF4ECECD6BB3388C6D06867A0E5E3DB93C1B2F | |
5112 | 464C23E44D3132E7D4086E3B59B1D13F49EB4772DEDF8EDC4F603217233FB7BE | |
5113 | C13C28648E9AA51D53F11FB896839F97AEDD8834BCA53CB0021AE91FD8E95E2E | |
5114 | F8A094093AF556B9639F508A401542B06821FF9DE1A745FE9AC5CACD5E8E1053 | |
5115 | 911442FC15CA5333751ABFE2C617D38FA1DC332BFEF44AE569DC631C93EC54D6 | |
5116 | 261583A695F5A392867A57F59B741EFCD2DCFECBC55D1EA5F2317601C9DFE9ED | |
5117 | D1EA466210FFA905A8F85BD58B98991BEA58DFD1CDED5C9B086D42CCE632DADA | |
5118 | 147941917B879139E016B0DDEB8446BA017FC8EE5A354533D667B0835F5D027D | |
5119 | C2D580C16B80B3D05CC92C0465CAE077729F0A15B2DAFC89DCD349B3F81D0516 | |
5120 | C65526EB5C10E45A8A85D716EE35FB9AB201FD7C89ADE5AD925A174169DA20FB | |
5121 | 61E96C73A143DF964C20589EF24A0FCFE6195317F2FA0D2249C0D8E649C3D9AD | |
5122 | FF13332EA2E4C9CD36D8443EC8F027B61CEF92C6A6B72DD4ACBACC16E429A9A3 | |
5123 | F5F29C1631360E32F8C1C93ACB22F810B86D2969A7480F486F62F8488BEEC74C | |
5124 | 2C1AF13BB92BC578E8CD30BEA6BC8CB68ED730F54CED0167605FA76AD7B7E88C | |
5125 | 7AE7688E598F91C471BD65A542E96D64B1EAF19FB4F1234308C48C2DC86E2193 | |
5126 | 11ABDB4C6189C6F201627C693691A86DD07FF55C30FDB3F72381E09C6080FD7C | |
5127 | 9182762E5001E30F52A216E0B71E4D2D4E2F3B20F95DF3A11FDB2D2B5B5FAA66 | |
5128 | C46226D5E0C77066349770514E5675550FAC9394FB27CD2C2F974F1FD58C04A3 | |
5129 | 1EF53A8AB3B2202CCA1CEFA66228E1480A0709436C44BD3319C40CF888AE4692 | |
5130 | 5DBBB52B15CF3A518F627F672135A24D5DB9B2EBEF04C860AECF231EBB5A3BF5 | |
5131 | 6DCCD5E72FE4B6DD29E896691868A7DE4120AD06AC573F5608B8449B38E71CA0 | |
5132 | EB5CDA3F942482EA7973661170F81DC88D54DD5B92323F46F833DFA757107E9E | |
5133 | F62A47CC50FAA1B68ED535C3E0E1073532A05ED339C8D70B3B9864808ABACD23 | |
5134 | AA95E9FDA43D54C66A675FA074E0A5B8777D3C07850A09087F36852B5351F35D | |
5135 | 8BC4DDFCA35CF29CD5E3DE118A741FAC4DED36847F2E2C6CFE08669301722D94 | |
5136 | 376F540982958074E7F1383C409652F6C99DA39FE90B38221E75BC1ECB93ABF6 | |
5137 | B00F410A0C5651DB418566AB350FDA1789AFD88286AF3BCB42B98386F7BC144B | |
5138 | 02DEB8940D20A6B3062F0C4244EABC50923390064F1D027A8BACC3DE45156E56 | |
5139 | 4A942D1B87F1C4A76B0D4D6801AE792CCAE3009BF25368B31B6AD5476FBD3BFF | |
5140 | 9759EF463EF5E78E10B7BF64005B2ABE0E8813950A08A1808587A98E0021D0DD | |
5141 | 751AD515E8278F1A0759E85D8A084490BBB0F8206484AA36388B1013643D3198 | |
5142 | 3509078847BDAE08E76FA5BF3E3A73C323CE093DCC148E3C02C2DE1E26C94D5A | |
5143 | 40EC8308ECB02FF7DD04EC1005A2A0DC74D4E587F10A3EF349E828F69FD38962 | |
5144 | 2F0C74D5DAB3ED6CC9F97008ACCE74C086A503948DEF1AAF58FC8BEC703CD360 | |
5145 | D32098A56AC776B1BD08442052A2A4EF6C8798F7CDC102AF1A2009657254762A | |
5146 | 0793F79A39DCD6ADBAA5EC84A7ED6018BBE727E5D477893D84F157074B24C13E | |
5147 | 8D4881C7DF8ADC13EBA0D89745EF93B7616EC5355600BB0D2B630AABA3CF2946 | |
5148 | AFFD0B2B724EF0F28393F2034B2E69DA5061426805353EB4D80E20739BC4C510 | |
5149 | 6C45275B8261DCBA10DE1D104B12F46ACD230977EE7D7D1D35D2814139E38C4B | |
5150 | CA6937CCFA653349B1EF64A98457F7B4B5D8F2978F16ECCEF7054905863AA46E | |
5151 | DD524CB33459220C71E9EFA7845A3A760A507B3D3ABC525B35930B613710A13D | |
5152 | 098832C58EBBC8B0CA6AD516E6385792C59220331D0922A1F6F838A8DE13C337 | |
5153 | 900462F952EABBDC2EB1FBF94A66186C177501453CD3FE3582073DD86F04406B | |
5154 | 41B6AEB440DA475E13240445D46726A6D45185D56BAB8807CEC8A8F7CE1AD149 | |
5155 | 7CE2E1BB5DE4E5B9592241DD136479A65905FD0062C91DFF7349874BFEA5D9EA | |
5156 | 2F610ADB9AE7757B2307A1BB9D6797D9F9C4844A59841C7C7682105E23A374BC | |
5157 | A91885E7410F56F60C29AB8B417E2D6092F8BB70A2DD5DEDD4BA1077D7CC62FD | |
5158 | EA43428C6F79C332342E15F75B08A1ED360B3511F823E75AD49BA7AE63B19238 | |
5159 | 2AFE8FAC2715E2FDC895E95036D23127557837506A3B542B0E4651CE2B89C252 | |
5160 | 31EE8ADC26E2C04E8E30A9CA12F066CE01953BE7867171FF6C7E834742C36C3B | |
5161 | 58E74E4B482CB85FD4D24DB03D753F260A585D552CDC9E1941446F2F5B45FF24 | |
5162 | 2DA4932B973139F328E7E92828B900BFD398B6F41DAA0D6861C66AA7F5E3299C | |
5163 | 87A5925CE0E0F9E09AAE0792954A1F2C0AAA8288DEEFFE579E38A3CE8A943EB4 | |
5164 | 55322A87C1634074EBEC25F724DC1BCC1BC10458CA6C4395659B0DB6B612C151 | |
5165 | 557CC669D8DC37769E59A5AC6BF061C79FEE265DBB59520EB8FFEA273601D1E8 | |
5166 | 2984B8AE31AE343F37D03E2BF97DC48AFE50BB6138C7B9F9B5E28672A37BD8F5 | |
5167 | 8F8C98DC43DB22C6537028798198E2D3B0453ED72487267D653DD50F1BBBDA92 | |
5168 | 833A987A95FC1F275B90B581B4BB62B6863A4CFAE37F715EDF3EA5A33679FEB6 | |
5169 | 4847ABB4B3D170C275B9F1AC3156D731198DACE0B051674E85B758500AC9FBEE | |
5170 | ECC75EBBD85F8D62AAA328FB09C6526F853077AEF7EFBFC2B6A29D6D508B1E19 | |
5171 | EAFA4C67EEE44045B9F15B9762B3DDF5CE5C18B23A5C2F73A1F6DF7F8679AB78 | |
5172 | 843AA41FD2A7DC02B45B729EB76C66A89F5F76E5C4A0C0563B1EC5E75D72EE35 | |
5173 | A7F1FC89216B60D82F6F2B8DBE85E4FF4D63712C689E696F60B52AB622C2A4F9 | |
5174 | 37C380775EDB72638D3F81F61D8D74C76D813DDFFF35ABD9A502F2BC7FF65754 | |
5175 | 2A8660A5A53E0CDC2E8A95B6E33CA153EB711DC796D313C8183D707D3F0E3EE8 | |
5176 | BA65E0FCE3F1C07F3D93F77056688B5496AE35A6BA0B59619DE78640A8C3F7D9 | |
5177 | 7DC5E94894E1E63A7D80600B945B1CCA50F1B85F57673C6CE09EFC4E229D4635 | |
5178 | 48AB466118D273BAF7C1B52A067A88C00EBFA7FCB378F1575BC0145F294E6F7F | |
5179 | 8007602C6560476FA20BDB91831B22404DB1C4C167594B1216C25226D262FEC6 | |
5180 | F5D0DBAC4B8D743C669CFF2068CB9BCD2DAE8CD6EE1B33BBF7514C4E5EA79D46 | |
5181 | 11AAEEA72B791C22A1822E686F3858E95A37D9CEF904EDEC7EBFB0E60995CF64 | |
5182 | 57CF0EAAE6D4925126349DE06E101868BED82BB51E911852E6780772912570AF | |
5183 | CD5690C6DA70110DD9903BAA3BAD581D206571D1E57712C75D112254C7A3DC8C | |
5184 | 892B66CA346EE682E7D910343C1CCD07465D9E49489839BEDA6174FB2E0DB935 | |
5185 | 2D2CBA6B67ADDA1BAA6A51690A10C819692C9BD35BDC689F9DEFEA78BFE79C47 | |
5186 | C9CCFB3D04D20F1D3E0B73498FC0BDC50A3BA6DDB3FAB9458803BB26487C1397 | |
5187 | 511717CA3493A7590E27B34C2E2E1BE2ED884CAFD5F7C185CD6EDA68951673D6 | |
5188 | 384E6CD12944F86D178E73C8D78D9048A5B1E2FCB489E723F8178F842B362BC9 | |
5189 | F3E4D511B369670908B2C8087AA29F8B592B8AF7018311C0F12A8D45A3625096 | |
5190 | D4C88B19890571C60821F38310685F8DEE7A7A5D209265986F92AAF11143DC85 | |
5191 | F435BC210621851001B6A402E3A07D0F204A3B0D75DA3CD7FF6637D1F434B962 | |
5192 | F404DB3C6BC318EF517AA0836A975C5196976250B5D6B21DF528FB47181F5279 | |
5193 | E1EEBBA0F344D7EABE71904B5C1DB0FD07694C469085D50DF4990E294334E785 | |
5194 | 5E5BCC4ADCD38685147CE535B23F3027AAC01A0D65AC751D9CA289B4A8906A64 | |
e6983002 CR |
5195 | 165427976FE6FD699442196B0C247C960C9086AB2E440885D11BDD314A3FFD40 |
5196 | 9C5FFF29B40110381ED22F58CA53CB2407E5B993930DE5E32CBC4CDB2FC46604 | |
5197 | AE51C1375F9A41D7B5CB2B2FA52F65CB925BDA5CE18BDCFC46933071789E3F20 | |
5198 | C08FC64F367F409C38279E5F88EDFBEE38105A2469CF009344F9E846419519E5 | |
5199 | 8A5EC45DE2F6837C65A883C524305D18769A563691F5887D920CAA8EF0D9D56F | |
5200 | F208395E7390570C6DBBE5AF515BF64478059F922068F0E473C020E54CEBF22D | |
5201 | 495D5E843839912C58FDE0A61D4E390E4502E9973562BCA49B3A17BCAC0352AE | |
5202 | 5C27DA44578C4FA5821B9A3B03FFAA97E15E83CE09AE155BE919EA42301E6195 | |
5203 | F59C0A9131C4089E97223BF614A37B5C7603190DD465105AD86DFEB74E65479B | |
5204 | BBCEC9EF93508604339454483E244A348A78F29EC4A60554E77136749A4A74BE | |
5205 | F4DE4955FFDB6AEEBE19705EA184605994D2A5284C05A479A33D56FF398DDF3C | |
5206 | 5B474F53743255BD5F42DADADD7F71BAC446A10084DE15876FF74765654405C3 | |
5207 | 470144E2902EF213A594FB721D0B0FD823DAC347777B7AA58688EA834514299F | |
5208 | 75A3C80BCF2FD24D19650B7D2C21ED664D290EFB9122C125F5DE1B2C4A817905 | |
5209 | 06C27E7188C9BF3965A6A25A5A9C0353A53D05BF64FD4C226837AF6D9599BE70 | |
5210 | 04142CC78E03626BF10D68CE17C2D081B3A4248FF392E985A6946D89BE97AF1B | |
5211 | C6BE7E9820405D06F5FFC06D6304028E5697E8AE15225A8FE19CDF3DFA2079A8 | |
5212 | BA537833DDBEB6106BAADD45E9ABD1C7B5157C5CB26F971B0E7EE8069E3C8FD4 | |
5213 | A7A1833B19CB43DE4E7497D505AE0B7BFEBB3E489315842DCB3D6CB7E6E43AEE | |
5214 | E215D011B2854A3CEE5AADB34A9CB5AE595F2F02CC5CAEA9AB28161FD93F3FD5 | |
5215 | 87D17D564939ED05A5055029D1AAAD21726C1AEFA777EFEDF8D687D9F2FCA607 | |
5216 | CE3B585E044A8CFFBD6E93849467378BAE5AB8C02615AA974546C3D7AD70AF26 | |
5217 | 55C62A9C4EFE256B5303BBD0B9E13544F408F8AFD7265425BE1421FE6B1E41E3 | |
5218 | B6D9C509B4EB820507F2B41A92F93A584AF62987450095DCE78F9862284F0C53 | |
5219 | F46B02549CA9EA57C9C4CA8A0BC1EBE947AFE73B8F7958853BEAF81D78E23C25 | |
5220 | 3BEB6EC3823E1DC7524E38CD63577795EC3DDE03027369957906C85A22F9D805 | |
5221 | 2EBD287C2CAEE0D3985264AE614380E421EF23453A68F6E616B3191B506113AD | |
5222 | F6D569E4A20D3B23961DFB3ECE07B382AFD2CCB1F2BC4F3C1974C06C8652682B | |
5223 | EE7ED59D4B2F9EB8492FF978747AB12E123932B34C0F9F3335587C7B8B8E13A4 | |
5224 | 0E1EE5212AB1671DD7A2AB5AF2373B60B3353C22FF8128198A5245F9C701B6E9 | |
5225 | 80E92AB14A77AE7BA217D33ABDED222EEE9B5888AC6653459EA8738703FF7423 | |
5226 | 8391380AF83E56A3BDFD3AD43F2F00E87DB9153D99A3B358A38313A7E6D6B43B | |
5227 | 07804A9929FE01EE112C0B1960B286C97E7F563D552250DEB189F3467ADE8491 | |
5228 | 9C25A473EC8D590BC6EE6E7F340991D4317F1F0E29737ED93D18BA4DEF6A6C0C | |
5229 | F9A71EFDDBE489F1A5E27699F8C120DDBC96C4F3F3F2F90AC5014F78AF6517F3 | |
5230 | 3C8E2B548C7BD7CA91ABC4E71930761D5C609CCB41B7CE490389C7CA6B1A7B34 | |
5231 | 7130074DADA12806475998153EC604A5FD7A04AF35D00DA9564123A384E39126 | |
5232 | B228353532842504229FD646A0FA1C24AC462A75A119743C17071D0F3C370D04 | |
5233 | 2FBBB8155EC868014066C6EFEA257752846195C4158AF9DF215C8B20AE276F50 | |
5234 | 67AB636CF7A49D34B26435233460DFF6F728E91F1FC4224A7AB1C991C94D3224 | |
5235 | E75B5764642BF2972C9F72A347861CA23B78BD37E0902CE7E3776E347AB20388 | |
5236 | 2F97386F31D1D41B43B5A1F52C11C908155E7C3AD9C818BD5F8AB022FE979EFC | |
5237 | 695DB2B79BE6264EF7DEBC936048FF17E81408CC701C0B1C742B11F6D9442E4D | |
5238 | 2BE899B3D354D07CDD71FB19ED3972363ACB918BF229ECDF8C5D6F9ABD5263A1 | |
5239 | 81A0BB786D0A859C53BBEEF61872E24BB550FDEF14A66FB0C09836F4677DD4FF | |
5240 | 26FB82FFD120F2F8947B51B0A38F47E65A8019C88A1C343E144F7CCDD1E9C541 | |
5241 | 640452BFC800ACD27D181077E8F59E12CFFD7C67DF26CD9DE94B87A16BCA14D5 | |
5242 | 9EC57D1963A82E2E1667BA64E7C10015A22C4C6FA06B9D76A9CF591FBD2003C9 | |
5243 | 116043C62347D68F99214E90E01E80D140B1D3E8AF7526C17AC8A2056B63E192 | |
5244 | 031101D44760E5679C4FFA2FF739CBA5A80AE9F95DDD80973F32D0411F9A43A3 | |
5245 | 887CB08E116C823DF5921C157390E1568C76B82DD9A7C69FC76501712D2F24DE | |
5246 | 7478B1FF5F7C648754860E394340F17D90865DF0D75A1A7770C177ED1052E10A | |
5247 | 2A60B370A9DE3A6876B9E102A6706E464A91DFF642F498162C9BDB4F0827AA54 | |
5248 | 0D1F36557B76DC6FAB62E52078C40F608CBE6C447CCD32A29C9751C53ED48951 | |
5249 | 3E2466B2BC8C28CF21A439CF54B50E6DEA50761A23333E8E96233215BE86B870 | |
5250 | 461D46D227790B1E65198B0C32C44F9861B94EDC731836D157B0B3419AB6AA9F | |
5251 | 41BEF201D3637F1F6C3F7DCB71BD670EC111B24C411D0AE3310DFC4C9279BCB8 | |
5252 | F5D936F0211B5FC10B7957259D2C3874724EDF11A646D951E79CD958B60EB6E8 | |
5253 | 071CD06657B15B5D0BF492312911076FA5E74F7DD94729A1A17393FE5891280B | |
5254 | D0BA2F31DFA6B3E01C0C0F662D02EF94590EDA84EDEFE9F28F5E7DE75B79D8F9 | |
5255 | 4178ACBA78D1F147820EF76DB4850910C3249DCE6EA13C1161DA6EC36BC129FF | |
5256 | E9C97EFAF481A1605F788CDD66DAC83A95BF09FA47850FA0D7A844AB7014D9C4 | |
5257 | 95A1C6AF0D3AA8A0DBE08FAF4E4FF7D6039F6115845EF41EEBC31D1D6B2CA95C | |
5258 | FB29A10E77935F79EC66A5D14FA898CF1347CA2502496BFC44DC1057AD6B00D9 | |
5259 | E22C8A982C04B48494C7B1C630FFB2FD1701F65B0558C5A2BE9C5A017B3788A4 | |
5260 | B9A22CA8E87600A54D570A6391D814FB95FCCA3631B123AD03A9EE0ECF9A8B6B | |
5261 | A5C050A34767371D99220A3395B8EEE63067AD64C93F4323A1C33BAAB8ED8B85 | |
5262 | FB1F71CCB36B381463157A5F19F0CD76CA14C77839BE94271264F5B454044D8F | |
5263 | 4458AF7DC8A85ACD3EC014E424D102D2FED460A7AC342E23B960846056031213 | |
5264 | 25CAE1315149CC2069E8963AB540265026F4B11BABD9C4711875217188D5B5DB | |
5265 | 6E9CC8E436A56D53B37809295276DC0A21F0CF2D50CD5FEA1AD417F1098A8999 | |
5266 | F4163AEA50ACBF468E0863C901DC518029692C076C5BBD7954DEE6504EBB39CE | |
5267 | 8F680420CEE573D8338DB67A5BB2B5361734D36D029812BF3AF22AE71CC4BE7C | |
5268 | 8C0E047CA409DA46AA3EF4E6B345A3E1A53A9892A1943BB32ECFD340439C1D52 | |
5269 | 14BC35A77EE696CF792BC25DE49B75F3B04F09704B64C8B1EA9FF39E6E8D9B4C | |
5270 | A39ADDE4B5B49E3FBE3A7F0AC51988057E46379173D5D3AB9E786EDF308B5F0A | |
5271 | 5B2DA6D030F881DFA0D479D8D6D97D66F3D25ED946128B38DECFD701E607221D | |
5272 | EE1069CADB078D3434253AA89970029EADFE217FF24C825718F68575379A653A | |
5273 | 0024F720B6355DB4C7EA81077DC68DD6DC61F85C2AE59E28FE04234E7887A9DA | |
5274 | E4E9E36FB0012C49B48F057C1E98380639744B5EF0B135596964BB2F020ADF92 | |
5275 | 812966653E399B2EF9D5044A6F8E2C788EAEF6108AEB70166157E322EB549002 | |
5276 | 12A5FC7F4DB295C0DC64BE331D154D07E49DB9090DA8194B941117326D763EA0 | |
5277 | 4CCC8B7F97881190EA60F9D0B33BD2DFF04BA5AC81143068D66DBA61A08D3930 | |
5278 | 439A0A87540C2CD06F56A3D732CA041DCA2F74DFB4CD05FBD76455E389095AEB | |
5279 | 4CE5ED7BE40BFE6003C9D6534F19D150FF8AF8DA936D0739EBE9128BCAD016BE | |
5280 | 70EAC25338227E83963F81AD1466C3618B8044AFA276879B9E621F00B96B0B67 | |
5281 | 2E8C2D95E222EA6F4586EC05BE9768957AC121965B9BBF9481EA4C513BC092F9 | |
5282 | A4D44F4F949E5537C1F59F74B48AFAFA371F62823286B5E005EADCC936729DAC | |
5283 | 4817750D66C15D3508DAEF758FDFB5C84245DF6C040EC0A91B207A1377DEEC10 | |
5284 | 5387A82D27199E8826C00B44A5C2A4DC784B1A8288769428FD632D7AF1C3508C | |
5285 | C42FC3ECAE21E060637D961D448568FBF539B8E85B7AD60F1A573995C7857AD9 | |
5286 | 9755535F9D04B4ADD5DF7EAAAA0819A5F21F111D9D9821089D071907307025F9 | |
5287 | B6E4C4DCB3E7F6F06492BA6EEF4F32B38393CB787BA9E00D8F60A8B4CC91B228 | |
5288 | 0FADC305AC966F9C2547DAE80B4F60959658AEFBFF9F63B95F106EA226978D84 | |
5289 | C7863BEA1C71B13A5FDAC35FE9D7037758574081CB58AF6DDE2C80E90ABC48E6 | |
5290 | DC0716B13DD52ECE01079EE01A114E444C1F09AA1788356432E51806D996A99A | |
5291 | BF169DFBE02DF5728D88FEC214B3B272CB1A7C9B9168F302B505C54584A0B428 | |
5292 | 17CBA6046E0319FB5041FB9319E75E7F805232DBE8312E63C639F35CD679638A | |
5293 | 60E1B0BAE1F1F9D359A2786AB8838694270C368D7BC92E9D65D119BF317B8909 | |
5294 | 7BFD7AF55533BCA289460558977CFC99E3E89D0C4A3B50C17DE43E2A7D7210E0 | |
5295 | 96F0B6BA7A4C654A8C59DF2DD5881BE5AFACB64489FEC5B129ABFB10FA17B3A7 | |
5296 | 426E2445778B53336CE63969C5F3567DC66DEF49A7D1A6C19C84EDE1C2FDDA4D | |
5297 | 4FA5854F4F15C7FC1AC8175587087D068E2150D05141970845D173E5312CAC9F | |
5298 | 8B9CAA28EC46FBDDF610B9371BAC2F577ACFF2F7CE3634CB13941BD437390F84 | |
5299 | ED894384E3130E663F5C0EE25C2C8096B7BF90F7783FE1B00F6EB78D92DC41D6 | |
5300 | BADF384149742D6B9CCF1BA890446599FD957258E9E3041201B958C2E5BA6842 | |
5301 | 32176AB1367690BF1AE79B6075315D538C7D6634117A20DD82FD8067F5237B5C | |
5302 | C93F4989D054A45FEA482AA961738EF0B9CA8D6711DA94A512BA132038866CF6 | |
5303 | E59012950C870598644FC143CB205494BB65EB649FDD6157FACC5814014C5B46 | |
5304 | 1153221D8F2D3B3FAFEB01DFF0BEAA0C00353668793379A88FD7C9827277860C | |
5305 | 516724161906BE5B164E | |
c302751c CR |
5306 | 0000000000000000000000000000000000000000000000000000000000000000 |
5307 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5308 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5309 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5310 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5311 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5312 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5313 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5314 | cleartomark | |
45c0f7f8 | 5315 | {restore}if |
c302751c CR |
5316 | %%EndFont |
5317 | %%BeginFont: CMMI10 | |
45c0f7f8 CR |
5318 | %!PS-AdobeFont-1.0: CMMI10 003.002 |
5319 | %%Title: CMMI10 | |
5320 | %Version: 003.002 | |
5321 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5322 | %%Creator: David M. Jones | |
5323 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5324 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI10. | |
5325 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5326 | % This license is in the accompanying file OFL.txt, and is also | |
5327 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5328 | %%EndComments | |
5329 | FontDirectory/CMMI10 known{/CMMI10 findfont dup/UniqueID known{dup | |
5330 | /UniqueID get 5087385 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5331 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5332 | 11 dict begin |
45c0f7f8 CR |
5333 | /FontType 1 def |
5334 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5335 | /FontName /CMMI10 def | |
5336 | /FontBBox {-32 -250 1048 750 }readonly def | |
45c0f7f8 CR |
5337 | /PaintType 0 def |
5338 | /FontInfo 10 dict dup begin | |
5339 | /version (003.002) readonly def | |
5340 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI10.) readonly def | |
c302751c CR |
5341 | /FullName (CMMI10) readonly def |
5342 | /FamilyName (Computer Modern) readonly def | |
5343 | /Weight (Medium) readonly def | |
5344 | /ItalicAngle -14.04 def | |
5345 | /isFixedPitch false def | |
45c0f7f8 CR |
5346 | /UnderlinePosition -100 def |
5347 | /UnderlineThickness 50 def | |
5348 | /ascent 750 def | |
c302751c | 5349 | end readonly def |
c302751c CR |
5350 | /Encoding 256 array |
5351 | 0 1 255 {1 index exch /.notdef put} for | |
5352 | dup 58 /period put | |
5353 | readonly def | |
c302751c CR |
5354 | currentdict end |
5355 | currentfile eexec | |
45c0f7f8 CR |
5356 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
5357 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
5358 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
5359 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
5360 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
5361 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
5362 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBC7878DFBD546AC2 | |
5363 | 1EF6CC527FEEA044B7C8E686367E920F575AD585387358FFF41BCB212922791C | |
5364 | 7B0BD3BED7C6D8F3D9D52D0F181CD4D164E75851D04F64309D810A0DEA1E257B | |
5365 | 0D7633CEFE93FEF9D2FB7901453A46F8ACA007358D904E0189AE7B7221545085 | |
5366 | EDD3D5A3CEACD6023861F13C8A345A68115425E94B8FDCCEC1255454EC3E7A37 | |
5367 | 404F6C00A3BCCF851B929D4FE66B6D8FD1C0C80130541609759F18EF07BCD133 | |
5368 | 78CBC4A0D8A796A2574260C6A952CA73D9EB5C28356F5C90D1A59DC788762BFF | |
5369 | A1B6F0614958D09751C0DB2309406F6B4489125B31C5DD365B2F140CB5E42CEE | |
5370 | 88BE11C7176E6BBC90D24E40956279FBDC9D89A6C4A1F4D27EC57F496602FBC4 | |
5371 | C854143903A53EF1188D117C49F8B6F2498B4698C25F2C5E8D8BD833206F88FC | |
5372 | BD5B495EB993A26B6055BD0BBA2B3DDFD462C39E022D4A1760C845EA448DED88 | |
5373 | 98C44BAAB85CD0423E00154C4741240EB3A2290B67144A4C80C88BE3D59AD760 | |
5374 | E553DAC4E8BA00B06398B1D0DFE96FB89449D4AE18CE8B27AFE75D2B84EFDB44 | |
5375 | 143FD887F8FB364D000651912E40B0BAEDDA5AD57A3BC0E411E1AD908C77DCE3 | |
5376 | 981985F98E258A9BB3A1B845FC4A21BCC54559E51BC0E6C22F0C38540F8C9490 | |
5377 | 88A0E23EA504FA79F8960CC9D58611C519D3ACDC63FB2FBCAE6674357D7F2285 | |
5378 | 4BCC9F54D3DA421D744D3A341DA3B494BB526C0734E1A8FC71501745399F7683 | |
5379 | FD17EC3044419A88C3979FD2ABA5B0130907B145A8462AAF0A9B511D2C8A7C7F | |
5380 | 347FF6AC057E6512902BFD2918E2CD31DE615F5D643764E900B60287670AE18F | |
5381 | FDE15545D8BC69591A8CBBB275AFFC9B14BD68DF0AAB32268FB84844D4DBC7BB | |
5382 | C591C1AC5102C50A9C7BAAA848DA88B0519F0F5F0813BF055CF0E3C86F633A04 | |
5383 | B779D2E8E656DB1E09A66A85FE21CA8BA5523F472A229E83F2C4E91ABA46C733 | |
5384 | F3C7B5775B06C97782BC225C46385BEBDC61572458EFC5CF4190AB7A9C1C92DA | |
5385 | 29F84BAACF552089195966E3AD9E57CC914D20B6962BE80429A16D4DF1ECAA66 | |
5386 | 36C4343FADF0B2B48F12E2EB8443C4AA29D00949255F3968617F98B8ABD4CC12 | |
5387 | 048B838EE243A21AC808BD295195E4AE9027005F52258BFCA915C8D9AED9A2C0 | |
5388 | 80814F79CF943FBE3594C530A22A92E11BE80FCEC1684C4F56712D5846B0749C | |
5389 | 9B54A979B315222F209DEE72583B03093EC38F7C5B9F9BCB21DBE8EDDAE9BE8B | |
5390 | 75ACE6B12A31083AC8348EC84D1D29D2297A266284B7E9734E207DAF59A25F4E | |
5391 | 4AA38509E993C5394FED76E6A2F25462685C4C86C6E8CFC9863338EC1428BDFC | |
5392 | 74616BB1BC8948B0ED4C87C15B4405F3A7796F9DB3798FFFE8BD0A94E834817B | |
5393 | D5E9812E308D0CC920470A6F2CD088FCB80462BF7CB3F039A7DF3DAF5B2B5355 | |
5394 | E083A385CD2EAF0FC181E40E96DD7E9AB9EF5C7E6866A13B8A54718E950FE097 | |
5395 | EF0951A357114F18CE9933D28B3A77AA71E3CE884661F13284BCED5D5FD1A86D | |
5396 | 543E588FF473DC2CF9A4DC312500135F29C2D0174B32018C8DBD40EF9A232883 | |
5397 | 710A1F2AB2CD11312300ACDF789A9B7B93D2035D81D1C84984D92D78A53A00C6 | |
5398 | EDA94B24BBAC1AD17774A4E07E6F74ABD90415965616AD540C8ECD8C3A44EE4F | |
5399 | 7F4F6BB6238C5062D63FA59B7BF08BE93FAEA70A2AB08FBEAAF7DBF56B95FD93 | |
5400 | 03CA406543BA6C9527D0DF01F5108D31A51778A5EB1C93F27B72B46146A353A2 | |
5401 | 01CACBC829603B9989A87CF64528682CCBA0562A8165B185C58A5C6BB72F5E89 | |
5402 | 500ACCAAB8ECEFBB2640E99EAEEC4EA979AA793D013D61D8ACF8784FF8D9398F | |
5403 | F6A252A709324FB39509F0B3A4E725E82F53543383C6765BE556CC897C758208 | |
5404 | AA3AD37B0406E4A79F8F0A6C1983FC73E71CD858C0DB66ED66D5D992978614EE | |
5405 | 1EA91EBE191E082EBA1FC040AF19A2202575C2EBEB8058833E3520FA03D2F915 | |
5406 | 85C1ED337E457B9FEEB0C6EF2735EFDA6E0D05FA641BCF698AC6B97751E8306C | |
5407 | 4DF00A39B8581FF53DB8F8525FDB196D85950906CCB59B8EF171349AA3B567B1 | |
5408 | 6A00819947A995FB383C3C1709C9A2C113B2E40BB832B7D4A0FBA0B16A2C455F | |
5409 | 55809CC425C403E9668DC66BE45B71A81C332FD4DB279D22A2959962304A8F18 | |
5410 | 085893DAC61317D24A8F198FDAB95F3B86F0AFD35047B868A9A17037A2829A02 | |
5411 | BAB042F75F349E197A7EED41984C2859754CAFD0251439921C248B463B516951 | |
5412 | 2E1322C80D73F9CBCAA63A585450275AC2492E4D3FB78E800F788254DB5E610D | |
5413 | CF788DF5C70FF99892BCDF16133E34B24B77C8F097F546B87C603DDB8998B66E | |
5414 | BACB68BA27462AF54AA405682EC96D701F0D474DECD5F95CA2102DF639EB169E | |
5415 | D518162C2BAE45FF698B6DE15FC6E7DE48C336C40A670FD26952A6BAB09115E1 | |
5416 | 991F0073419F2CC2A1C08BE91096936AA0C37E4ED3CCCEE235476074B8FF1125 | |
5417 | 6BDE3701F85532D8BB64CCC927CC335281C95EA689706F0AC717DC2CF680C754 | |
5418 | E5EFD7FA4BB8880B2B727A964C876D4A223069D4E6001771F0E23EAD2A4BBC80 | |
5419 | E76675297B2EF05F52BF4E71B3EE2BE3048CF088C79540113C66AE98B2FD3CB1 | |
5420 | B0741A215FD070882C52765009D7D711DAA2508F19AE7DDA15229A856AC49BC3 | |
5421 | 4DDF40814FF96500E4B9B02D412E94623C5FDCC76C0FB8E42DF56A904FE49D65 | |
5422 | 1DA7C53901B2EA71AB658A464D3ABDE27D9DB8D9E0B48F64E61A2495AD5D8DAB | |
5423 | B5E72424AD017DF37964AF911BD7FA21A5EB4775DC8E95EF0C0EB856B00D89D7 | |
5424 | 8172A1DE8530767D317B8256103E53CFB877E10686A04F5A08F8DC58D843DEBA | |
5425 | FD5F40597588663D103689F6EB3EB14D06E18C8078F2538B43E712DF491FC5C6 | |
5426 | AF639256C8C6134B64D560D8476DEA6329D995E46CC4BC78841C59E73648B47E | |
5427 | BFA7DE0846422F738454AE77E822A083405289247BD7C478BE4974F742CD6051 | |
5428 | E99FBB1D1B3FBABFEE855174734EE45E87D0AADF32B1283B911162A9955847FD | |
5429 | 38944D70584FAA6B1A7191C5C134B73F98EB632B69E2F0C0F94156787C34C8A3 | |
5430 | 7622A029D58F9626B74F8A8A1F3803E0BC20E0EADEB1E99B70F1BD9F980FB751 | |
5431 | 2A842843DE42EB142A84D5D3138629AE9EAF6F3479C423E8829C8816FA6EFA27 | |
5432 | DCE5580E65AA9854B1C64163DC318420CD993C15BFD76A8BA1182860A6B03D6D | |
5433 | 22B8CF43CFE6C8AB27C64842E239CAE707D3086BADDE1D7C94E3BC96319470D6 | |
5434 | 8D26915C575CFDD03271D6BB9DE86A0EB6EEA6E768B224A626C62A9AB48A6EDB | |
5435 | 44F70BB5AF991CDF9736D65933E81CC57A78F623F33EC9AF535F2F25FA4EEC90 | |
5436 | D50DB7E87F31E971A75A33A301CA6013EEC5A4E179D695B33DADF2C98364434A | |
5437 | 42926776000B610E17524162253F6FA638D6581C18F99EA0BD1D2E24D2424ADF | |
5438 | C05010D08192485153DD03930C7BF45237593E484F9851E6D464FA10FECA5D9E | |
5439 | 0C8CCC97DE029030900CDBB491C5CF226DBF903CFE7735D939C3FDF3A20B70CE | |
5440 | 66579B28B99313FEE914E295388C7BC8E055A2E54EA3A8206D3C8F4F7C0BA5E6 | |
5441 | E519419FD8CE215F7B8E9BEC604A9E3FE272A0328A24E31997C8A91E0946BCF1 | |
5442 | 6943A97CBED2AB9FC636B49828BBB8B89E0BBC2653796431224895ABA5DAC41E | |
5443 | 1854BD9764E86147FD7624F736F40DE3B7582EDDFD15C2BDE3F22B5A54D7DF10 | |
5444 | B87A1301CE85CFC061689A890A321412A13314AE96DCD3EDA75035FDD8F4AB9B | |
5445 | 897A2C68263A68457032C469987970648BA2D88B1C5375DFEAA35A917B8A952E | |
5446 | EE670427942AEDB3CB599C5746180E392837D371E15D860620ABDB6AA7772C40 | |
5447 | A5E346661673ACA530BE3D8E3FFB895E5DA3DC23B1B43C080C77F7E47847F0F3 | |
5448 | F3AA5CA9E4BF75FC5EBD18D19F21A7DAA3B11CABC6E4070A15F7DBC8B05EB6AA | |
5449 | A02EF1B078EB66D61D6AFE41DA9B36FE7EC9EF94D1EA26282A9871E2CACB3126 | |
5450 | 2AD49C2D9B50A6E47D8F2CCAD50992D1B430979A45FD9E76182A19964BB2A1F6 | |
5451 | 51779A2B258DC1DF4C2F3074621286831F3848AC152DDD2BA561E6586ADA88D3 | |
5452 | 598A2CE2CD048F027CE0008B828BD915887D7785341E8305DF2346ADB76BE99F | |
5453 | 87B02173BDC334E9221C8DF54114A6B24C1C5340299512FA6C8C51AB4C8778CE | |
5454 | 178CEF531C6D1B5FF0A1BE8EFF767F959BD4C345C52699A29A17B2A230842BF6 | |
5455 | 4B011217D6D24EDAC3F6D53482786F1CA33169B90ECD499407D37CE9B70DDF78 | |
5456 | 7B7547B32952535BA9ACD1E244447AE3FCED3AF28717083CF9590A09780984D6 | |
5457 | AF0743C82AE4FB3E2BB2856A4153A3967A023FFC35382D6C22D84A924900B6A6 | |
5458 | 3DDD400E6D2418DA6C27F2FA34C075C902B89EBAE658B3C9A18EEE449DA5A379 | |
5459 | 337DE95CB7AB3F0970CF1A5D8FAD8090E495570FDFB2FBBA79244780D8035547 | |
5460 | C5A55BB21A2270F724BF5D442CDC5BB9F09BE0CAE59B1C2270F0BDACE698F2C5 | |
5461 | DE8F66BFB9634904B161F5BA2B1950048300D69BABD312D58D89C4ED527AF7BA | |
5462 | 7DA2478EDC2CDEE3473DD8A8ED9D891CD1FC21F23013228BB3281B71FCE959BD | |
5463 | 6F8E9059D682A7FCC5265A0620992D4FA8D78377EB34CE3ECA070EE3707239BC | |
5464 | 98907DB0120CE42ABA32CF97127E28382BDDFD685674279F588D4F951216C355 | |
5465 | 821361790F64C2CC720DE97E8ECB57326C43EE47367628E05769E106868B54F4 | |
5466 | C33C9951908DF6FC4F5ED2C7787BD8FA591BBB3E9C6C1DA94CC5E38D9B20C886 | |
5467 | 7D237572FF46DD896A4D6163408EA6CEFAC398EE041EAE29D577E75326CA17A6 | |
5468 | B072D47A7B13EC441CE6DAA042ECD02134CBFA6809A435050413817193DAEB16 | |
5469 | A5882C8AEA44BCF36E74E9ECCDFE7E19FF5A5DD7A94E5AB4F8702C3DA7F42325 | |
5470 | 23C808670A0490F5B373DADE40814FF9650241D3D69C91FBC5ECE728F827D9BF | |
5471 | C928602E05477903449E079164CA39859C4BCA60C579F490AA455F82B5050BB3 | |
5472 | 969AFB478E0D4A257B3356EA3CD62051FCE6C6B1929CFF85BFDF166BEF658E10 | |
5473 | 3A55E007F38EBBB248B3F0B8ED1925106B499B762E45113AE1AC9DE09644C84B | |
5474 | 9C08034B297314EE69BC32DB6E7D7FB9913CE5AC17E7335979E9DCCE2BAB3725 | |
5475 | 1976155551F9706A576FE0E3ADCCF72C87683291528ECB749CB0ED291966E239 | |
5476 | B5E3630676BD409E08F85BC1AEC9A2D4135376284A96EA24431243BD6FE8B966 | |
5477 | 95F11A4BB53F392E0AEFEA623064FF8A7002367B0A515635CB2D2DDFB9B4A8D7 | |
5478 | FE721754E81BBA548848A235B91AD4E4F7DB19CCE2F61D277FC00AB956EB93BE | |
5479 | 44AB4970CA56BF59506C94ED160FB1E25D3DF2988A532BDB787BFB8539D22986 | |
5480 | FDC378AC31444E63C4727FEE121A43751043849E6DCAC5B59D0FC703AAFBBFD4 | |
5481 | E8B7C268F21615AD02CE9DABEFA27B5FE6A6441B619539CAB1F810F1263447AA | |
5482 | 633F5DAF483752EF1A0421740E3A811D2D2898CBF53E7F686C9223FD7235F02D | |
5483 | 6F90D2D48CC20AB87778DE3C6FB335E0F0EC20B5DC5B65223FE117526DE2C72F | |
5484 | FE839DF93CB2A7D66CD900CB325F891E311BEC932F703FB4FEFA29DB8B9C88DD | |
5485 | 375EC71B3D58C7BC59ADA91971A3BDA1ADEA629CE6CC92BD542CDDFAA7706FB2 | |
5486 | 6CDDE2DF07E56D6741916AE8E8744339816F3E6C38062747AA9FDA2A2678A6B7 | |
5487 | EFEA870AA3A4D71B25EE3013EAB1DBA34401B867C7A41AE51E0421D41D3BB83C | |
5488 | E120C8FEABA6E5DEC53A689C21426D4BBCB68CB37568761C360E6D4E3596FB7D | |
5489 | F4DEC7918E58C0293D12D6DDA7E9DCDAAD7C939F55CD1BC4A228B31E9A904156 | |
5490 | DA6B40B08E6ACE674618B768DD681C772A3E55FE096CF949CF3B0460ABDCD891 | |
5491 | D17B37B355B29AB5137899C036F31DA026244FA25FB798FBE5105BDA29F46538 | |
5492 | D3D3AC1001A7BCECE64DE94FFE6C354166A0F97256137BDFA07F6E22A3D1D2F4 | |
5493 | 9588DBAE95E895BC5E64DDCBBAA8D0A22C229B42CB717FC711E7E9DF793DF80B | |
5494 | 9F14754585A3C7E17F37B32924B9F9870DA8635E3E18BD1DCD81EDF01834D9C6 | |
5495 | B33F23C956C2FCBFA47D84422F583459D827D1E120B97694D12F1F54D02379C0 | |
5496 | D288F7104F3FFCF4F76E3494F4ACBD1BE3A15543CC680924C78A473F8E311ADF | |
5497 | 8FE00A04C6C393DE61AD3EDA5BC031E2353076A2489391B52632387CA28A7B93 | |
5498 | FBB065A6EF3658AE80B1ADA47E9B2539E73A71FA75645F85ED8ECC257FB4CF26 | |
5499 | B6C912DE9D0F9899E70BECCB934AD32CF49A093371A9F73DE6255EBC39DE1E7F | |
5500 | 00D0CBDABD4D0383977E694890E71FBE5C376BE5F3A80C28987417504F515C50 | |
5501 | 909F3D31178BB9B1D085BE514F71B910A9085BD6122DDC72A150BFE266920E49 | |
5502 | 5661BCB4BAB51D6DEFE32B616963DBD989FCDD1637B294CE4E288655FBEFA1BF | |
5503 | 7F25BBF8CF17C2D5FD161A7C2CC9CC7490D9BF15A1D35B3BFA43ADE256E88BDA | |
5504 | BD490D92907C57BAC408A575EC84D6AEE070148C7C9A91C03B09FDBD792E8FF0 | |
5505 | C0B886AAD2EDD86541E5E579359D40E3AC312ACD3D8FD49F71BD533DDF8859B1 | |
5506 | BAF17F1884E331DD07CEEF93B71D492AEBAADF7A263450A7A72210CE630A0D37 | |
5507 | BF024BDC09ACC882816B8C22C62AE38A3A8D0F6EBC2B1B2C0B8161A8B076DD5D | |
5508 | 4B779C0788546BB4CF57332230D237856B00D79C28A7C01D11F44B7304F69075 | |
5509 | 94B97A745DA43D1BE561372CE611C345A843834E46AD9DDB16CABCD3FA33D6F1 | |
5510 | F6B5C0497F5EE5400B305CDC16A7EC286AA4D45D0EEBB9DA06AC9C5294D68EC9 | |
5511 | E4DC3CA2B92CE8FC0526184A86EDC7AB34D67E60AC12D9CA8FD300235EC968BA | |
5512 | 92C6FBDA47572BC5600F25249F60AD287CBDAE980E747FCBE7EE5CD323E733F0 | |
5513 | 63553B494D3DDEB9CC1480B5C3BB79A28E419AA65B18CB297AB383419E890E2A | |
5514 | CE6F98C9900CCB4675280A10CF060B8D220DDA1BE55DFA65715EABCC1AFAA271 | |
5515 | B1F8732341613E17B231231A0D24D4D7FC198AE04D89A99C4536217769C6FBD9 | |
5516 | 5EE24A6302F97438F7C0E311C878F674B4477A5ADA3952CDE4055AC408B8174E | |
5517 | 86F8FB797646DFFFE0ECA25D1BAB9A9F71F3926D3D85AA63E7A8C931D71E79E0 | |
5518 | AF1EAC26FADE468F4FF7F3861D14C10E3BE1F9EAFD6D3A544E8108D5DAB5B180 | |
5519 | 3950C74818BC8AF4758A108F462EF1826647A49667F5E482038C54716856D9BC | |
5520 | 35F29922846D2148F92F943E951D7438C73D6A60459A8003174036C64E1629CD | |
5521 | 155D47FD04B03C023AD67CD5A70C98AB556EEAB8C48169706E5B352F6505D580 | |
5522 | AC945171BFE62E81F8F500438AC3B64D857BA5BC54C2C4BBB237F8FA51296255 | |
5523 | E66A92A61FE13FDE781D393557EB72CEBAD86511035F775FAC39A0479CCD400F | |
5524 | 226709118F887F47CC2ECC8F79816D4A945B2845F50AFD62D8C9A9BBF4739496 | |
5525 | 9E644BC9F7B04803B7EE75A09EAE94365F6F374B4FCEB0B506C76297564B9B6B | |
5526 | 8B812BC3A33929AA94692572B010E6210AEAA312BDFC88BF302244AB9D587A9B | |
5527 | 919823FD01DE12438D960944D1977800FEB49E638C32E5B188B1CA033E0C37EE | |
5528 | A142F746367888AA119535F0CCAF7EAA461B790EB089D2D6962E28A398439BB7 | |
5529 | 9C9943654D7A2D765B46BC0DD1F915327F369162E1BA1BA83110B93F442905E0 | |
5530 | 523BFF5E279508A98568CD5CFD18FABBE9D17265A9081E7BF64155A2CE3C0DF7 | |
5531 | 88D00671AD65654709589BAD7EA65BBA811387ABA5CA0BC3F66D3D48597A0D1D | |
5532 | 2C268375DF47CCF62166262AE4840AB03BF49BE67A05EF66328EC729F03CA5FF | |
5533 | AD3937FC053E223303565DC771ACF32E63DFB96D5030E787961D72D02C195C66 | |
5534 | B48E9AF0309DC169CFE8D16E2818DA94693A18F027DEA0D916672480464F7E22 | |
5535 | CA6E431FE38D3FC019BDD229E064B72C545C61C6EA55984565CCA88ACB01F744 | |
5536 | 3B4593CC8944C70F30925FB48A16342CC26D444F54CA15E5A624C4A2DAA2AEF8 | |
5537 | 404145BBA339F2A2D6FC2F3ECE54387761CA1213C8D56FF96E37C6147CA44B84 | |
5538 | 262EA87E7CC10D931E6B5B80D7F09813498497AA84ACB4AC69BC6C8481ED2953 | |
5539 | 084F560D7B1CF90555E69BD2AF7C5D944E8E3506165014652462BE1BC81CA341 | |
5540 | E1B0725159D36DA0FFF3577D1DEBC5D91AE683FB0384 | |
c302751c CR |
5541 | 0000000000000000000000000000000000000000000000000000000000000000 |
5542 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5543 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5544 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5545 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5546 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5547 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5548 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5549 | cleartomark | |
45c0f7f8 | 5550 | {restore}if |
c302751c CR |
5551 | %%EndFont |
5552 | %%BeginFont: CMMI12 | |
45c0f7f8 CR |
5553 | %!PS-AdobeFont-1.0: CMMI12 003.002 |
5554 | %%Title: CMMI12 | |
5555 | %Version: 003.002 | |
5556 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5557 | %%Creator: David M. Jones | |
5558 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
5559 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMMI12. | |
5560 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
5561 | % This license is in the accompanying file OFL.txt, and is also | |
5562 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5563 | %%EndComments | |
5564 | FontDirectory/CMMI12 known{/CMMI12 findfont dup/UniqueID known{dup | |
5565 | /UniqueID get 5087386 eq exch/FontType get 1 eq and}{pop false}ifelse | |
5566 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 5567 | 11 dict begin |
45c0f7f8 CR |
5568 | /FontType 1 def |
5569 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
5570 | /FontName /CMMI12 def | |
5571 | /FontBBox {-31 -250 1026 750 }readonly def | |
45c0f7f8 CR |
5572 | /PaintType 0 def |
5573 | /FontInfo 10 dict dup begin | |
5574 | /version (003.002) readonly def | |
5575 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMMI12.) readonly def | |
c302751c CR |
5576 | /FullName (CMMI12) readonly def |
5577 | /FamilyName (Computer Modern) readonly def | |
5578 | /Weight (Medium) readonly def | |
5579 | /ItalicAngle -14.04 def | |
5580 | /isFixedPitch false def | |
45c0f7f8 CR |
5581 | /UnderlinePosition -100 def |
5582 | /UnderlineThickness 50 def | |
5583 | /ascent 750 def | |
c302751c | 5584 | end readonly def |
c302751c CR |
5585 | /Encoding 256 array |
5586 | 0 1 255 {1 index exch /.notdef put} for | |
5587 | dup 58 /period put | |
5588 | readonly def | |
c302751c CR |
5589 | currentdict end |
5590 | currentfile eexec | |
45c0f7f8 CR |
5591 | D9D66F633B846AB284BCF8B0411B772DE5CE3C05EF98F858322DCEA45E0874C5 |
5592 | 45D25FE192539D9CDA4BAA46D9C431465E6ABF4E4271F89EDED7F37BE4B31FB4 | |
5593 | 7934F62D1F46E8671F6290D6FFF601D4937BF71C22D60FB800A15796421E3AA7 | |
5594 | 72C500501D8B10C0093F6467C553250F7C27B2C3D893772614A846374A85BC4E | |
5595 | BEC0B0A89C4C161C3956ECE25274B962C854E535F418279FE26D8F83E38C5C89 | |
5596 | 974E9A224B3CBEF90A9277AF10E0C7CAC8DC11C41DC18B814A7682E5F0248674 | |
5597 | 11453BC81C443407AF41AF8A831A85A700CFC65E2181BCBFBFE3573BF464E2BE | |
5598 | 882A715BE109B49A15C32F62CF5C10257E5EA12C24F72137EB63297C28625AC3 | |
5599 | 2274038691582D6D75FE8F895A0813982793297E49CC9B54053BA2ABD429156A | |
5600 | 7FFCD7B19DAA44E2107720921B74185AE507AC33141819511A6AC20BC20FB541 | |
5601 | 0B5AAEC5743673E9E39C1976D5E6EB4E4D8E2B31BEA302E5AF1B2FBCEC6D9E69 | |
5602 | 987970648B9276232093695D55A806D87648B1749CB537E78BB08AA83A5001F7 | |
5603 | 609CD1D17FFA1043EB3807AF0B596AF38C91A9675E2A53196FEF45849C95F7DC | |
5604 | 182A5EC0EC4435A8A4B6E1CDBF9A5AF457564EA72BF85228EB6FD244F2511F5A | |
5605 | CA9B71A65D53CC06EF5F7EC3A85106139A4D312378BC22183C09A229577B793A | |
5606 | 1B7422611C03E84BF809F46C62CE52D3AE29CE01C32B202ACDAA5B72733EB0AE | |
5607 | C31D7EF7BA88D2D14F85313F7A8B9B7A5B124B03AB923744D336C969E5CE304D | |
5608 | 3AD977A46664479EDEFB69F113024E761C05FA48A54072DF9E12C2F352ACB3E6 | |
5609 | D04F6EEFFDE209E7FA3DA22E5B1D1409461F4286B7F4F8251B44E5CB7805762E | |
5610 | E129FF4A06A7458F3191926B1CAF70E32C6571AD2DC07C34FF62840896F4D200 | |
5611 | 761B1A7FA356526D1E3AB4C542AF13623BAEB9F61B1BEEF79A9205B1FEFDAE24 | |
5612 | 8799D516A9ACC30BC0139C63C9A0523E9D5439213B67D490C96F902958779B8F | |
5613 | 68BD8E9FDDCE8A3A2E35877DB6C94B7612382ED8F218EB1157D2ADD090A2448D | |
5614 | 10B99FBC9211C5629ED1C61C74FE93041E5AA03EA4AC3FFDA00C2B6E719CFAA4 | |
5615 | 262FE17F66804A6B54D3669836EE4367D2A2991580C5564463C973CA0DA38AC6 | |
5616 | 922716E13B4A807B50304B8826CEFEAA47C305FC07EB2AF25FA7945797237B16 | |
5617 | 56CDE17AB0834F5C97E0CC5741B061C6FF3A8DD1A79B9A173B66A6A750538E26 | |
5618 | 32FBC92E75BA15CFFE22A7302F47908547007402569158F62C29BA2956534FEA | |
5619 | 7DACF1E507AC309DAE8C325F2A6023D2FBD81EF42146BFCE6A16A6310A650460 | |
5620 | 7B07BB7647C8760FADDF0DBBCD3DA6CC4645D1732DB3A22D8B76E1D2D48E4D4A | |
5621 | 46F4BEB80CE65F3517283A1AE08391FD1C10ED452133706BC6725AABC80107FD | |
5622 | 754A8BA47B0281D479F052CE26A723EFFACB79B213041A536542AB334769A2BF | |
5623 | 88505D82C498ABDD5A73EB539530F47CAC52825D16A969C8BB56D4A7F2830B8F | |
5624 | CB63B92B576E7BD922A4B25E634751F8A3B7C4EBAFCB373EDC8B8281B1D1371A | |
5625 | 7844E9AD990CFF09F0D7ED73A5CF873D2D5C9E8A9923CFA31E1A4B4CCCC40760 | |
5626 | 8B3AC8FC3C88BC08BD7407725281BB879A1A822D94997826418F1B89D303F2C0 | |
5627 | BE7A0102E6F529630CBF1BC5BF3E4578C164A3DDE45E62A957EF3FB7F0FBBA6B | |
5628 | CA1E79A1ED195B6A11CFB345B663C5E72FA55D80476F604F6C4257B51686AE25 | |
5629 | 8F7D159FE605DDA0AC74BAA5034F29FFFD403070013C6E2D8EF6A0990D91173B | |
5630 | D5A3AEB98B64E412991505C3CB7C2CDE13C091FEB3DFBCAF30C4C19511102300 | |
5631 | 135BD5D444BB55692013F52056908DFAB2ABFACE81A58423ACEC59344CEF7D4A | |
5632 | C5A3EFFFFF70759BC3E593D878281225060B97D1BEE6B26EED90571FEAFA1812 | |
5633 | 1115C0EEC892F5DE6FDD68321A0B3F10A2D771B79BD85476AF6018472A499A86 | |
5634 | 07D64CFF4550866AFE590C471C80EB12CB3A989A60BC7BED39097C12D9286E39 | |
5635 | 14C7952C4C64820B4DE44A1827B7B0B535244E93FDB80036D6332F90F95B472D | |
5636 | 7031E7E3819E881BD0313CFA112EB3AAE943C99C47635CCA7E34DC0306C04E5D | |
5637 | 2E9F60FF037EB11602BE74E8E6B711392E866E3E55D988F7C856417A2B9C186D | |
5638 | 639819B4786D039B77F8578EF63C088FF28BD08D8353031445C8498A8F445BC3 | |
5639 | D08923D32AC04BF3CAFEFCCC1E77EA894F4E846F47EF62D6841B8D8576FEAE8F | |
5640 | 90044626869D04D61D64D56E8C51AF8C18D6CC3FEF3B6C4F7D56FE3260354948 | |
5641 | 10104F69B117FB8269292579A7D52FED688C663B643D8D99F13956612271073E | |
5642 | 1A337AED059B7A93819A28CDF01569CBEB51069D22ADAE25C47355560F402B2E | |
5643 | 8C9900DA82B79C64497C8494F42FABE5AC41791C2010D98FB7E593C744F250DC | |
5644 | D837DB0EAA4F75D0016970F3AE8359878A08CF9A697A06C5EA945819151265B9 | |
5645 | 1A12122B98F79185DF852257BB4798E7DC03712EA6ED34F6E6AE1476788DBC33 | |
5646 | 9229FADB8D581BE1A63F596698DBD6DB98A092F67197A4FD4A50B648F2691875 | |
5647 | EE2495D6BB310078F516785A0CEC7EB6E8305FDBAEB1D15690409FE32DD9CFAE | |
5648 | DBD3866FB63EBCAAB73E3E4BE5D7F3AA44793938AAF3F8341683F0790F1D46A3 | |
5649 | 60CE083F9BEDDA22E0639A92393960F86602216FA51E2754BC2F4CD0BDECE3D8 | |
5650 | FFAB7E0E49613DD4956C9A10AEA798BDA1F756C755BEC12147ADECAB0FB73B7D | |
5651 | 203A11D84DD2AB5AA98FD38C1C2573570FD49A4924A94A106D2A7D850E793608 | |
5652 | FB135853E8C4204441CDBE697FD0CB330B1C3596F32D2BCBF263237EAB362D09 | |
5653 | DA6F531B40384DC91F30674760CA7B64BA1968F6A7FC9EBEF431A1AFC5E76D7F | |
5654 | 2D44DCB7F61C7F6B16196B3E8B47343F572DBA8B8B21B43E35BB6B2DD5C7982D | |
5655 | 244FD4304D254D6CCB5E8CF70E77F50812F41A988EEB3B26BF0F6F69BBA18077 | |
5656 | 31134B5A5823D10FEF6201D045AEE7A24E0F25376E9FC66340C56C05F6CD810B | |
5657 | 724D85CC4BB8D789834A447CBBA159565D08BA5793D8599035BB5063271518E8 | |
5658 | F6C50E7DCE71B1D186270DDC860C6DC0CD506010EB5B1FDF6BE47A9A18CC15D7 | |
5659 | D657E58BED9EECAD5CE5D49F63139A39BC52C6584BB2C3264D51BD584B40F8EA | |
5660 | AFCD8B83F548594386EB2B05CE803105E84931DC6E7A1398073D48E130E0D907 | |
5661 | CD0F1ECC3254EDF5D4DDBF44415DC9BA66C673820CDB0FDF033D59BE2B5EFCEF | |
5662 | 01FF9D33EDC88F8D522E07F1689D024DBCD09A16A63519E1764C8630FF36058D | |
5663 | CFC07027E0ECDA01E0E85B166C613B22F587B4D355EB018BA93E92A36007B4DA | |
5664 | 287FF5A91F7D8A0EDF5554ACCF45AC8066E88865C5692E63EB99CAC81367B605 | |
5665 | 8E6C19EB98EBFE0D2D161B447B9A70CDD1122C7B78A413369016E6D8481E2AE9 | |
5666 | 9AA97B5DD0ACC9B0820F7742CEB2F46F89F3E2092621969A88DC0156B4F941A1 | |
5667 | 6BF1546D4B136657C47B082A8A35FE96016BAF3D9679B8C32EDDD6AE6DF3BFB5 | |
5668 | 7854074FA019707FC22BFA82299E72ADF9A980AE29A8E2434277E58B01F6B03C | |
5669 | 192E1E25DADD49F6E3F69799AE62B56E00B60A031BF8721DB8B2CB6D4A4C15CA | |
5670 | AB1FDE010AB7DC0DDED977389B101B8E53A949222FAA126656E02817DD32B0D4 | |
5671 | A49516CEC2B97EA7C78FD66229B044EB92F502384BCC6CCDFFF995EABE3BB7A9 | |
5672 | 50D5D1AED861E7D3BA8D333026C673C5762712E763E59261426044583D789C67 | |
5673 | A606B96F97663F92BF104CE02FBFDFC521EC0D6670B7D4F85A229F51426DE912 | |
5674 | 3B729C4A535FB7C88D0A5E78074751B58885DD6BDD2DD9E9C83F105E8CF63DDF | |
5675 | CA7DB39D0319CA7CC2E73F42747F007574DE25AE1538B4D493D22D0D5F0F80C6 | |
5676 | 5F6FA3937C8391DE2F0116F81DB2DB0EF751EC838A7F85F163A6F48804E84B96 | |
5677 | 8D715EF25B7E2A5CAECC558D80F421052A1D698F3B8452AC27E30A4E6226E3CE | |
5678 | 084C8A83ADA0818A110923CF7AC7AD4CB92AE4ABBE0A9EC1FF935FD02774C1F7 | |
5679 | 92A278E513012AD17722A23C55EF82E18F8847B5CCE47F4FE3EC508BA563F7B2 | |
5680 | AE56C94285A18DED4D432FB0CEFC05A20BC17DDF9FF919C724810A8ED7358A27 | |
5681 | 97EC93C1A13C443A91947FE1F6F528EA7B628917FA7E554A1D7B31ED46C5ABCF | |
5682 | 92BA57961C8876DB4041305EBB029B03D8351D5E2819FF87E97ED214D8F1CEF5 | |
5683 | 7F7668DDE223721C0B810F4A4AC81CA4EAC86EAE546E1B15D91E626FB9A31824 | |
5684 | 5BFF17C4E79FD56ADBF6DBF01BAF6453A81EBDCB38A5FC0FD0FF0646B3B0D199 | |
5685 | 13E2E59A1B5CAB6DE5329BE389BA0E2A2AB55CA40B711ED746C24F1E48892E76 | |
5686 | 6DACF7DA163CDC90CF076763008E7A899870CDED5A80758E6177BE6B93B07EB1 | |
5687 | 5800A3BF7B9AAC3FA825CE594EF5B7546B181375FA8F37608DF17856D2F8EBD5 | |
5688 | 6030A9E6F6BEAF224AD2AEF76D03B023E2FCB922CB8E3C6816AABB61FE6E4F83 | |
5689 | F21B4935102C860ECA03DBEFCA461F0E5B93E5A8D18440BCF7D1D6252A24CB6E | |
5690 | A64FDAC8B67C4888519AA368D9C4A8C08C7155DF5BACD75C5196C571C3C456C4 | |
5691 | 7CE8D90215FA6EE8CDD72C48740F7F5930EC3632DB63A9C8D2DA125088C0F05A | |
5692 | 9FC83D16B7F53163F4EB6FF372C6C3115F1E68EB35967D11126EDEDF0BF80817 | |
5693 | E68A698183B3EB0A207DB43786E1B9D289359D75AD5E465328CAA90E712C2962 | |
5694 | AE2A466173F2FF30EB535A6054BB0B875DC8552C16B49DF17CF84D98D35497BD | |
5695 | F55E273FCBB0C735899529A69990E09149FBD2DDE64B7FA8D50AE83925DF03C8 | |
5696 | 0B63EA158FBABB12A028803DA4B9DD6C48C0FEC469C4E730729F4BB420D5B003 | |
5697 | 1918B4AE9CF35CFD31E8E62A44C0484E3D00143BF1D330235E821E5CFEAB4D31 | |
5698 | 7CB4604DB1F310457FCF9075A3527279644D908DE847CCD00B6F50DBDEF91D3E | |
5699 | 38238CAF550FDCABA2C3A46237218DCC5A09AFAF69997E1EBDA7EFE6FC99ECC8 | |
5700 | 5D4AFD5EE35FE2346BE79B499EC8EC436868154A947D13BC02C780EBA4B9E64F | |
5701 | 3026F1BF5DC1F8D64FEA1281EA40B4BC355638A3A59BD9055BCBB232FA45EA0B | |
5702 | B405131B64F105814019BC55466EE78E9E9ABB62DB30EA452F7EFD7196C76A85 | |
5703 | 15B2CFCD89922CADC0F392B0C54A231F3999AEFB53C24EB0C63B0C8A1A1ABB6B | |
5704 | AAB2F93E5ECC7AB90EADA320E918106BAAFC1F8C425C617639984629018BA674 | |
5705 | 6FF4F338AC43E23BC3740542911C058D43A49A11CB3A0CC8E3088BB5BA6048D6 | |
5706 | CC2AD250DE956BFBE83BB24C945C20D9C22E7105983F284EF478F9B68BFB0322 | |
5707 | EEB7D62802CBAAEFF1C2332159DCC7243EA40CE15C734EA905E04C476B178B82 | |
5708 | A08ABCB0B86A7330C75E62EE7844C9E22DDB013ADDF20AFE08122EE1B930A81D | |
5709 | 806A0F8CC584CB7FF5F56F9B35E5FF78FD93E7E4A40C64537464EAA275FE88F4 | |
5710 | 461FC6A467C8A69B9A9FBC10D44AC1B753D313A8E7D97F5FAEB60F82855658D1 | |
5711 | 4DCEE043C8FCDFD8A29DD091F3BA55874A458B2B8989F35055C72FC411382361 | |
5712 | 9AADC717E602B48D7C9521D3971A6F7EB19D539445DDE9EFBC5B58FA9E5E426C | |
5713 | 172C45CDA24985FC4632287FC3B15849DEB56F5A061993AB10A6BC59868534E6 | |
5714 | 69888175053108B77E4978D971B4EC57224C0F93EEA4C15AE92254140A94704E | |
5715 | ED5666FC06C5341F643F779CC88A9E81891565C63B6F7F6286E664F4E0A48690 | |
5716 | 356DC96F1B98026C563700772485B83BFA06435D4E0793EF822F423C93FBACA0 | |
5717 | E5D889D2B76771C6F0EE997A5DB43C2F6921132890406E3C33F6F159B14C5D78 | |
5718 | 7C151BDFFDD02B697315F191B5490073EB418A4FF2A398C68D44F0CD1B87CF9C | |
5719 | B52F12728B72F94D752D23151196A256908135C87991E508B8906CE2539DCA8A | |
5720 | 31F86809C8C6C18A09F6129BD7CDC6B37E76B648788056851F22BD3E3B5772FF | |
5721 | EC01D822B57FFDB3BAE624F05531292641FD6A7E3666152D18F6C653048DD7D7 | |
5722 | 98A942C840C4A0FA662F260B21C64214152BB86F03662A330109C5AC0A5EBA30 | |
5723 | C6201F558858130703DF76AF4FBBEE069BDE45C0D9467077D85FFED4F9BA9C61 | |
5724 | AED87D67CDCA453A6528AC5BA153E1039D9CCC556CEA5CBB542265FF54A1B208 | |
5725 | E0E13740E7E7C26AA00AEE909F8F3ADC2726081A744D8EF6BB711BF5F611A900 | |
5726 | 76F91C26A338DA13A7160A9F42410CCEB3190000D963D036FDA05A29F598EF40 | |
5727 | 8FAE6F8E7E6F50C99C3304A573501C13A00023085F057DF331E3354CBE65D573 | |
5728 | CAE73BF15B3B96B502E0AAF2B4A86237E98A997AAEFFF4227D5A26E8972C48E7 | |
5729 | 761F430733E6EF8AB2D903C17FAFBFA21C25F8A0AC157D397BF3CC1AE7598F0A | |
5730 | 2BE4FB46B29443CE57F41FD5F91122E9D86F903E94D5B55E2BB95949C156D138 | |
5731 | 89883BEFD634311F9280C7F028DCA6408D3A682DF5B55B9F7ABF08F019190F60 | |
5732 | D39E4F0E80F0594235B09A5320109638B938633A2C196E4ED2B43DCD8643C3CF | |
5733 | C6123B076B7F73352F906D96FDE0FBF50CCCA432712C574D5857838BAC30B485 | |
5734 | D25024EB254A7EFE57D1DF0892C275CDB3DF77602F0FED0FAEBC644BCACA04B8 | |
5735 | B424DB125E487794CAB36E01B5E1A26F5E1E97A739AA36D77A12F5B45338EB39 | |
5736 | AF36CEBDED55DCBFCF497FD475FC6BAB5530AD6153C6BD982564EE8712185F1F | |
5737 | D5EA7ADF4104661168A01994C1FD773A50C8AD6A3E4D332E4D59521BB8BBC6C3 | |
5738 | 866EB4AC3EA4532477E6CBF6BBF0860031C3B916AA25E3492670EA67F55CF4FD | |
5739 | 207C684A0DDB6F4AD21B2909CBA71BCE2E762012B0927BA72367A6AE0AF87F73 | |
5740 | 756C9BC85E4EDE35317E2CCCD138C02C7A8013AFDC1A48C3A4BB8EF257BDEEA7 | |
5741 | 60E012F54D12D31D18DC59D5E526F12567B8688B4B67E16B56713870300016BD | |
5742 | A3B9DA87FDC865246AF8E94316799110D86B1DDADB8A673402D4226C519C058A | |
5743 | 1D1E5A5778584FC28AF12819B1924060BC4F54B1054EA6AB0149E04B8C4302D4 | |
5744 | A56D8A347EB5D3D2A0E12CF7E35059BDB53D9FF6BD25F6D9619BC4669CFC1048 | |
5745 | C6C9978B8751B840F27D82A69075832BE59F55C1737CBB1220FB8FF691FDBDF3 | |
5746 | 03BD7D225A9372AC221C38245E48320E1CCF898D9EEDD678E5B8C65B7F588321 | |
5747 | 1A3953EEB9B39EA9A8CB72DB08C3E9234DFFF5FDF9DF804C021D57E97DA7622B | |
5748 | 97F4CB6E0EB640E0DC9EA15C5193F92A3A7565F4C7A4C9CC327F7CD2C44900AE | |
5749 | D9E76FFE62FC37FA376E77131B566AE67C3E09DA80F198BBB995EE8FA47EEDB8 | |
5750 | 4B467C6C7DB8AEA745CF8C56B8BE56534E9C56FCB2B7006426DFE93D728FA4CF | |
5751 | 94F131C549814E54ECE7C914C5FE8E4961D3437CE7475D03534B62650F551D97 | |
5752 | 201C794AA877445DBEB11C85ADF6119B05360700F8CEDE4766E3A1D7A35CDDC7 | |
5753 | 9ABF7C619E3868A39D1852DBE1EEAF5D7898C78323873AC005542B68C43C5000 | |
5754 | CC58F675EB595F87C879694751494676465891E8A897158B481F11A171CCBBD7 | |
5755 | 29603F00210CFD7FF31FE3D273933ECC34AFBCC4108D9B76D9ECE63EA06CF939 | |
5756 | 4799092A54A749DACB82C1424E9879672C8BC084C360014C9C1B6D5D65C68AED | |
5757 | 66CE329C3AD712C0A36BE7EF03FDF339CAA2E0336D387A693B1DFAB5D5164E31 | |
5758 | 14755A158168962C9B399F8F1DF3FF5060D7464D5071058C30C572A2BC7DEE53 | |
5759 | 84BD7614A4BEC4C84E18CF7EC81C811724463BD46CECA5FB57B0F55EAE20CC74 | |
5760 | 6AD815D1897B037C197D2456797B992C20C70B663BF99FE28C513B4E221C8E12 | |
5761 | 49779F8C0AE8517048ADDF7CDF0D698E3EFE60071C4997B7F5EF12B6CB65390C | |
5762 | 224F13FBB99FFC034C0710F05019899689B6D3350BBA65C7CE7C2AB03D81B9A5 | |
5763 | 5F3D65E4D462DAB189006669F7390A78A1B8908A4C913B15DB8827DFF15BB9A4 | |
5764 | A6037DDB643103B937257A7DAB025F09D53FBBC2BCB6B0BCD8D56B2B2784E498 | |
5765 | 1F6CF8470DCC892AD0CFE11578718948BABF9C1427084643B66BB9181094E29D | |
5766 | 5FBE37708E1D8A6B7518A96876844CB66954227A7A6AF28DD075A462526DD5D6 | |
5767 | 40EECC56FA366106E55C7068997B54B7F0D03AC1AD45D28C67C7ECA99DBEDB1C | |
5768 | E18A79C353113E2E05B837E703278B202112B1C69E42A69D64B62F0E7D8F7E5B | |
5769 | C1F93F0F99EC20EF312046F4B0CD7DAB31E422070B629A7FA96583CF3F1519CD | |
5770 | CF08806F40ACD7BB5C960F21E9DA7FB3C72CBA0801ADE83DF738A4EC94F2977D | |
5771 | 2B95A166BA4AE28CAD1E37FBBF49D342CDB4DF615E2C5F3076313AC517C350DE | |
5772 | 710F5D52DE31DF69864D29DABF14234DF13904BA4333B0D714EEA55CDD79DE45 | |
5773 | FF5D64259C877191547076B1C7684CD252C0337BD9DF66CDC5DBAA4F3102F2E8 | |
5774 | FE48385C55727B80D11F3BE0B7568AA9356FB2B180A6B1392D620DED02F0B736 | |
5775 | 5F4399FB9D32DFBC8ED942AD311C82250DA8BFE98D65 | |
c302751c CR |
5776 | 0000000000000000000000000000000000000000000000000000000000000000 |
5777 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5778 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5779 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5780 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5781 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5782 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5783 | 0000000000000000000000000000000000000000000000000000000000000000 | |
5784 | cleartomark | |
45c0f7f8 | 5785 | {restore}if |
c302751c | 5786 | %%EndFont |
0fcb3344 CR |
5787 | %%BeginFont: CMSY10 |
5788 | %!PS-AdobeFont-1.0: CMSY10 003.002 | |
5789 | %%Title: CMSY10 | |
45c0f7f8 CR |
5790 | %Version: 003.002 |
5791 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
5792 | %%Creator: David M. Jones | |
5793 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
0fcb3344 | 5794 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSY10. |
45c0f7f8 CR |
5795 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. |
5796 | % This license is in the accompanying file OFL.txt, and is also | |
5797 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
5798 | %%EndComments | |
0fcb3344 CR |
5799 | FontDirectory/CMSY10 known{/CMSY10 findfont dup/UniqueID known{dup |
5800 | /UniqueID get 5096651 eq exch/FontType get 1 eq and}{pop false}ifelse | |
45c0f7f8 | 5801 | {save true}{false}ifelse}{false}ifelse |
c302751c | 5802 | 11 dict begin |
45c0f7f8 CR |
5803 | /FontType 1 def |
5804 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
0fcb3344 CR |
5805 | /FontName /CMSY10 def |
5806 | /FontBBox {-29 -960 1116 775 }readonly def | |
5807 | /PaintType 0 def | |
5808 | /FontInfo 9 dict dup begin | |
5809 | /version (003.002) readonly def | |
5810 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSY10.) readonly def | |
5811 | /FullName (CMSY10) readonly def | |
5812 | /FamilyName (Computer Modern) readonly def | |
5813 | /Weight (Medium) readonly def | |
5814 | /ItalicAngle -14.04 def | |
5815 | /isFixedPitch false def | |
5816 | /UnderlinePosition -100 def | |
5817 | /UnderlineThickness 50 def | |
5818 | end readonly def | |
5819 | /Encoding 256 array | |
5820 | 0 1 255 {1 index exch /.notdef put} for | |
5821 | dup 0 /minus put | |
5822 | dup 13 /circlecopyrt put | |
5823 | dup 15 /bullet put | |
5824 | dup 33 /arrowright put | |
5825 | dup 55 /mapsto put | |
5826 | readonly def | |
5827 | currentdict end | |
5828 | currentfile eexec | |
5829 | D9D66F633B846AB284BCF8B0411B772DE5CD06DFE1BE899059C588357426D7A0 | |
5830 | 7B684C079A47D271426064AD18CB9750D8A986D1D67C1B2AEEF8CE785CC19C81 | |
5831 | DE96489F740045C5E342F02DA1C9F9F3C167651E646F1A67CF379789E311EF91 | |
5832 | 511D0F605B045B279357D6FC8537C233E7AEE6A4FDBE73E75A39EB206D20A6F6 | |
5833 | 1021961B748D419EBEEB028B592124E174CA595C108E12725B9875544955CFFD | |
5834 | 028B698EF742BC8C19F979E35B8E99CADDDDC89CC6C59733F2A24BC3AF36AD86 | |
5835 | 1319147A4A219ECB92D0D9F6228B51A97C29547000FCC8A581BE543D73F1FED4 | |
5836 | 3D08C53693138003C01E1D216B185179E1856E2A05AA6C66AABB68B7E4409021 | |
5837 | 91AA9D8E4C5FBBDA55F1BB6BC679EABA06BE9795DB920A6343CE934B04D75DF2 | |
5838 | E0C30B8FD2E475FE0D66D4AA65821864C7DD6AC9939A04094EEA832EAD33DB7A | |
5839 | 11EE8D595FB0E543D0E80D31D584B97879B3C7B4A85CC6358A41342D70AD0B97 | |
5840 | C14123421FE8A7D131FB0D03900B392FDA0ABAFC25E946D2251F150EC595E857 | |
5841 | D17AE424DB76B431366086F377B2A0EEFD3909E3FA35E51886FC318989C1EF20 | |
5842 | B6F5990F1D39C22127F0A47BC8461F3AFDF87D9BDA4B6C1D1CFD7513F1E3C3D3 | |
5843 | 93BEF764AA832316343F9FE869A720E4AA87AE76FA87A833BBC5892DE05B867F | |
5844 | 10FA225E233BCFA9BB51F46A6DF22ADCEACC01C3CD1F54C9AEFA25E92EFAC00D | |
5845 | 7E2BA427C25483BA42A199F4D2E43DFCE79A7156F7417ACF78E41FCA91E6C9EF | |
5846 | B933450D851B73A6AB6AEA7EE4C710CB5C14270D1674FA334686653793FCB31B | |
5847 | 491E870D3C2BC654D2C1DE463EC9BA29D7371AA1078800EF93D3F66263A2EBBB | |
5848 | F5723697BF7448BD0D2E301544BECF497FD475B85DFEF52AF4F8F8BE445CABE6 | |
5849 | 019318806D10C5952157FF8F8286C1EE701545C8F60EFA854EAE66835A2046A6 | |
5850 | 915D395F1E0366EFE0C0391583FE001FF16D82A2E2DA5F57754A2C6F69306E36 | |
5851 | 356ECF8EFC3F1188AD6FCD2427E0580C97A5B69B4E0E09B85EEDE142F5ADD2F0 | |
5852 | 5DE51D6DB72B127412A0D57106C19CA493048A4F815129ABE767D51715B1515D | |
5853 | 9C21067CB5BC88741B7298C83EAE36A866DFA87D8981F179B1C31292F56BBB64 | |
5854 | 3C430779468AAF07C8A8B4934E1E775FE3F35186BD1FA6EE3689C1C750678AF1 | |
5855 | FBF9B23195A124C5C991FE670AC0C86FD39D2B07B9A319E74EFD498B45820252 | |
5856 | 720ECDF7294F7B0B137CEB86D33BFCEB8606985A3260FD669E461C8BE94216C5 | |
5857 | D434FD8854F44EE66E5A289A9F9E32BC36AF645D53F96652602BAED418C8D726 | |
5858 | BD04A1B4617551FE4DEF54083D414F7DCE004E6BB2DC9C2EF7CE232B254BA2C5 | |
5859 | 7DCBD36C2072ED46FF711F121A701E2284BF1B718B3164382B8F453D68FA0377 | |
5860 | DFE106503B8401D4DB87F5402A3AC9A442FA060B0610A9524D530C7157C26B56 | |
5861 | AC970FCC1D5655FFFFA39246E6420CF97D08ADFB7B05822679BD40C638DDF0E7 | |
5862 | A97BFE8918B611A145AC965C203F1428812F9D340AF499B3A915B22BE798594E | |
5863 | 0F520109FC81E452180AE45B170FF999C5FC2761C6CECD8742A5A6FC97F16743 | |
5864 | AD4EFCC6572A6D3F3E4E330C5CB2FF6FEA48A5B64DD3DBE943BD9918D4A18E18 | |
5865 | CBCF598AEFBB6AB3CD2CBC9BFD6099272F6543F3E532E0E21E614BD2880B1023 | |
5866 | 0AC234CB705827BF016DB84E00E8C255FDEFA0101A842929540B7B4AA8A089BD | |
5867 | 5EFF05B72356B6BC3727817823B5CDBB1B963103000D7F2A4E2A1472FC3E614B | |
5868 | 5CBCB6D6D784023173DEFEBFA8F9ED87EC1A0A9EE98CA59CFC964CF943DC683F | |
5869 | E9E00DA718C4425A705A69D99988EC6F152525C790912C2E46A2381A569424AB | |
5870 | 54DF4798BC2D7E7A361E7991641D4B756CE2A7FF4A2848927092C59C2C4B8809 | |
5871 | E13AB84FB6B111E680D7FB9F2FFC2C5C66B0B501E4447C2E46C10E2F6124476F | |
5872 | A140C404CFE2DC9E0199BF61E035CEB481D438139A9630934E541D261FFD2906 | |
5873 | 4CAD99E20655FA746AFB81EDBB5601F5FD6B1D6832A01D585E2C55053F6A7378 | |
5874 | 4DAACCAC7608DBDADAAE732D66B3E7F87E79756337C1A961E53A4651BE7C77F4 | |
5875 | 038B89C87F650C54A2A90EB7F1D525BB353F33318551EE8D84A6A83C718EA5A4 | |
5876 | B2AC0F7306B1E095819B87015A90CA3ED739B09061782C28CDB36BA4BD5E5308 | |
5877 | 5CBB70414E4112193DAC4A1FA30996327230D1E021F3CD8115E12D239D93FFDC | |
5878 | B645910EB29E40D830E7BAF2DB255FD7C4E776557BB38157917D993EAC245837 | |
5879 | A3B515147043574157B8342D829C7228CCEA843ABC89D1785A9672A5923FC4CD | |
5880 | 2F3FF27E6FCACF84E2D3136CA2C0FD3EF1EE7354CD04C38B5FB874553646ED2D | |
5881 | CEDF7E362EADD04B18051F20A8FB0DE18E152385B9D05F98A3A7EF177824E246 | |
5882 | 455ABE69E2F700EB78185CCFC07E3B4C6FA301112528D977367D30D0D5D59EDE | |
5883 | FAEB706DDC970A9E296236C725B2B55B09B9C336B8E23CBA5FB8692D56F33B03 | |
5884 | 16294E5FC7FAA42E96395A57CE51CA8DDD77442F142E2E576B778373FB31C81C | |
5885 | 16840BB422CA827E30A81829648BDF1CA36700EA32AD888D097C1FE0A05B2D9F | |
5886 | 483AEE40269DF09AF0D1AD3DF80C45DDC59C2A03FBB661C79B87853737C6D352 | |
5887 | 67626B657321B16198DBD6DB98A092F17878AE4698121E1006E53D6F9B0A3BE2 | |
5888 | 3FB68828EF854A0CDBAA68B37ABCA6AD4A3D809AAF0BAB1697A81FE59C98C472 | |
5889 | 1E33CD70A75A22C249DD11D76C2575ED3370A25892A16D2FD569CDA70C130770 | |
5890 | 93F493C7D47D6F9A5424A7A542BAD726BFC3AB225DCEBBE6AC4BE006F8C7C0EA | |
5891 | 051424B08305BF2D951AB2986AAFEA04E078CA79B399585BFF0F1ADCED02E15B | |
5892 | 8765EB6BF6A8E4D0901EFF2C3AA104924EAD9637A35D877E0C51A3C37DA78CD4 | |
5893 | 8643C8CE6DCDDE3F116A6C2390F948E5371BEB5AD2E87B41C5F01FB5C196C436 | |
5894 | 6E256A88D082E3F46E4EFFBF605B2EFF1E9D9AD5EE4DDC323A137CD9451EDEE0 | |
5895 | 06F7D82898D71FAF2362C0FCF1F726F97F820305B7CE20728CA08C63575083A7 | |
5896 | 84BA28B7DE2B916432475510E274C12FFD1660A717F51DACFDF0A102D85224E0 | |
5897 | D6DB607BB72569ABB8A7BC6A10354CBBC01732EFE35B72062DF269CB25EA3DE6 | |
5898 | DC603B04C90C5912D2C38D7A5ACDCDD3F6F116D884F0D8C528F69D5D47BA20DB | |
5899 | 0A9E585C7D8CC3C324FE8A1DF150279F7E8FB43BDB720E624E5E9918032C02CD | |
5900 | 8020636AE5C38DA2484B7F4B34163E0D0A561B43B80E97746DC05C871AB620EC | |
5901 | C5D47101ECED4A7E25F291184BEF8B80024AA7BB456C1B83A907652B331DEA34 | |
5902 | 754226C39C6889EBEEFDAD081E01EF8FE47751987667836FDE4C8BB8A3FD4406 | |
5903 | 1E643B4EA37BD370734D1A2DB17C2F4B74B4ED75098B433601F75A88C9A37A05 | |
5904 | CCB157EF6E32023BFA33973F3E655A4D58289136996FCFA61EEABD70791B6523 | |
5905 | 1FF5DE71AB8A17038923118A5EED8D59C4C58D246FFA9BB26472346B40C8741F | |
5906 | 153D19CAFF20DD2A86C6DB89154A630FB1761929FC3F0448EE2F089C1C953E02 | |
5907 | 905BA8DE75D101A982A611056C4B237596C10951DD98BAB838B742D3CF7DE718 | |
5908 | 617DB72E5268583223E37E029D1C8FD3F1D21690151F76B76C52C725CA135CA2 | |
5909 | 8666553E863CE188BFC9B99AF56AC2DB5BFEBEB12FB563D00244EB89E478657A | |
5910 | 98AF2E1223C1ABC25A4500E8119B86EB3C26B8A2F3505A3E5610F89B7C34E278 | |
5911 | 53FA0A54A7F46D84A35EFEC36AE660A9E3C37EE3864106702DE5AF6C45ABF64B | |
5912 | 888A4A51323138CE77DB935576FE6B4824B6942DF80625098CE1B5B32B234F1D | |
5913 | 052A9D6039697118A9D793793775D8729D8574A2E74D7109C7B7E23BC5E2E87A | |
5914 | CA8E019203952A4892544E1AD3D4EDD22971611358AB230E9A2ABDF00A288501 | |
5915 | A01B67C42B33F6B78C39562DB50F4663B922D9BE0D8A150311AE44B83C1F129F | |
5916 | 07337323E9A23211EE58E16043E127C6F9574019179F5635648A011266677B56 | |
5917 | B5D0201A4E1470B952A1579B57AB2329CD4C615395023C653F784D36B5EE3672 | |
5918 | 10D191F29EA508CE84763CA4CE7C2C5229E38E241255A5CABCD6C7CBAED901A2 | |
5919 | CA53B5E24111921CDDF83578D33D463D70EDACA0E470D8F592303FB6BFD68B4D | |
5920 | 3F3BE2D7C5EC8BBF10C90111A33E205F2649B56E8443F6FAA6C721C66575AE12 | |
5921 | D4C40F1F46CF9E9DA675AB5D5840D938780CD9E4AD6736ECBEB6A4397613586F | |
5922 | 849B51048AC5F9405E03E14540A5E5582F61CDCDB57EDDF95A8C6705F433EE16 | |
5923 | 648F098C03DED8A2AD94AE3DE202D629B9422ABB031318D48F2C85F9DBFA17BE | |
5924 | 84708AA3B6C9F81F4508F7A5CB7B6646AB8722ECF817877B77D473F577556DAA | |
5925 | 2BA0ABACFCF5DEA7498C47328E873019A956FBB250FD9D8885D21D368FA70CBD | |
5926 | 2709D2DA44EE7A9869963EAB48789541906DE49FAE785ECE1F18A22C7E7ED204 | |
5927 | 9768896B78E9EB7A2BD6EEC1B26083940656ECD689D92942CC8AF05CBF82AED0 | |
5928 | B45A7DF4DD7AA6526FB597322560B9ED3087A65B5EEF1371C328A021411BFE3B | |
5929 | D9B5088B2F1AAE381FFED52D2D1E02CD0DA78683E3B06171CBE94BE9760005D7 | |
5930 | 135893D7CC2DB097F6AC664D9594CF1C650F84DA80D2EDE04802DBA33CE3DAFE | |
5931 | EB7A37E8AEFA4FDA6252FF21E8673DD98E67124D5DBC7BACF361E57077B71939 | |
5932 | C1D1FB923E4E35C075CD1BCBE0E80DAEA1320D55B43EAB45D9B26C366B278782 | |
5933 | 7519FDC482D98839BF0DF2E7C3A56A1C1A3FC0E57A75CA414F6536C1FE8EB7A0 | |
5934 | 4ADFEE3BEDA0F53BE8CF5F64230784A797133E8CD46BCCB3BF38BCE38A73CCE2 | |
5935 | 9E073ADE792F7128231DDD1F63E6156ADB2609C200837C2E8A2D93D2A7BC9171 | |
5936 | 050C709A71E44E32B1B03C92EB5CF1D3BAB1C38E027DC4ED9AED633D98CD7486 | |
5937 | 3F773ACF8AE332631CF2ABE6D606607593FE862ADE31803964E3F4DC3CE3A271 | |
5938 | C76BDD95C87CDB3B87BC26FC7A16D567EEC62E6FF0D471B4853DB8A94D4CACF8 | |
5939 | 843824F818083F10E88D52FC4253E8203292CB40F1414AE7E51DD7347007C342 | |
5940 | CD70E8E9F2D2A13D71213B841DDEAAB208AD9EA644591C15DEB084165F9DF24B | |
5941 | B91D3BBEEC2E34E38EF16A0C3F00700A7BDCBBFED2EC0D09601AD6538288DB50 | |
5942 | 3478B051B5E16B604A0341FE621A58718D960D699D3FAD284310DCF54EB13175 | |
5943 | 19A75A539EE98E804AEA24689D3540F0F12951A3C01FACCE9A7BAF4D0DAFA946 | |
5944 | FF65A4D2A4C39969607272C6886F44E90ABE27CA3A1F12A29D9B32E60E8E34F0 | |
5945 | 17C5FE43D0E69A99A922D98909B2BBCD145E59A5E7F5426B3988F73B09A525F6 | |
5946 | 8BD4915663C1301323180E760BE81CB874B020FDA3AE63340E4261E4F3E4949B | |
5947 | CC0966BDC4426190BE9F5D77F76A72AD925662E5FE1CEF9CCAB68F0BD33DA003 | |
5948 | F11EB91AC4502FBD6AE48DA0F9D07C35B96B103E379B8A83A05FE728F1716194 | |
5949 | 1F650F75BEBADB2E3810388F3E2DC7B19F1BA9E32925F2FD9F19F4E8701F3E4E | |
5950 | 4069125D7C401144740691E7A460021A47B1E27997FC1DDABEC5BD0EE0B20194 | |
5951 | 2D579C7D6727AA124083242BDA46D8E116E2751C5F298851A62B60AEBE82A929 | |
5952 | 9B9F2492BA35690D1EFD16215B8EF14E7A3803B93C28FA41D971B05B6AF3B593 | |
5953 | E74AD1E68A5FCE12A86E63B78BFEA87D3949FD164F12277A4688BE96356791CB | |
5954 | 8671C49365608F3EDECC109321AF92B4C29CAF073DA3A7D73E913D0D83FAC5EB | |
5955 | BD884D4C686056404DAAAD6F82F94F803FA1FB0DD8908D1DF08FB87A8BB83027 | |
5956 | 04DE0CBB1C6FEB6B517FBD7CF065120079E608CE41893C2BC96A347826CCDFD5 | |
5957 | C69E161217F2127A59F1A6F22037641613F191F22D5B4CDCBCC2EE5615623404 | |
5958 | ABA7BE6C5FE475481615B2AC1A2412E54688DD21E44CC9AF5F16E634AFCA389C | |
5959 | 4D740B7B51BB141BFAD1080E7C726C1606A28ED492E6BDE9F800EFACD1513909 | |
5960 | 84E98CEB6A0B7A2A6F3E1D1DCC3B2552795E0932673E59ECC56DDD37A1D52BA6 | |
5961 | C3F0E905978AB568941A163F4CE3AAB5C5B16F86016EC47BA6F3F7AAAA77C3B6 | |
5962 | 09C8C3ABDB6D514A76ECD37C37AA88B5860630B3406B494F7725975596F84777 | |
5963 | D9CF48686EC9C5DBCC1D78513F591C7C10AB9D153B3D41426B7BF668B0D04503 | |
5964 | 56BCB686258462C1DC61095724B9F3312316262FD7C1AEC6E54DE7E5A7BD8EFF | |
5965 | 035299B8FD8A4A7B0F51404F4A760F4D8B4C0FB7A32FA4B2383AB6E9C78FDEDB | |
5966 | FE6A5788D38A6701B123630C2A6D820A684166FBBC83DB17069494FBD411B333 | |
5967 | CB37E2491C5BD035A33867A6D3A3D420CC31ACF43AA07182CAAE67E40EC63663 | |
5968 | B678F71D4C6E0EC3A0AAF904CD3AA66E0DE5E3CDE049E94249B39A1C06E3CE9A | |
5969 | F974B2484BB2CDA14282B9511E505B3C89F9C802218AE40D1A7541335C5736DD | |
5970 | CD565D4B9F4CC78F3A393737EDB4FBD0DA299E21CCFEBA5478EEF013F0552A8B | |
5971 | 0BB11FF46CCDB784E8BDCF730A16363E66572049E42C695886EAB42A9AD9094C | |
5972 | B635DF4B5B9BD9B9AE8455DFA3EEFC77653190F9A8B1E93B7281C2A21EA7DDA9 | |
5973 | 33484745BDF7E3DD63C7AC66C286C9A5A698A5E4D7A91710B7FF943FB23609B6 | |
5974 | 4B442F83CB795788FAB5E9CF3F75D5487DA26170E4561C7941C910B088C3B86D | |
5975 | F844B0F340CF82786A3FCF347048463EBD2006281A816627065DDA6CD4D3AC5E | |
5976 | 2024BC96C7D896381BBB567951E7A1F29D4E95351298B000D29E5F3D0448CB5A | |
5977 | CFDAE1BADE9403B90371C3A07D208948AFA022A69C519434B6813086ADF518D5 | |
5978 | 88E0B92072A44BA1B3EBB630A13B7AB90992E85B6D67361C8D96F3E0D826FF37 | |
5979 | 17B67E4B1EB7BADFD98D7F4FD17BECE740ADF13C141EBF0A91CB105DABB32FE0 | |
5980 | 55086D56A0D358841D15FD349E6B95512E4EDF4C430216FF85C2ABE995E4B40A | |
5981 | A6044CC8820AD885C07E052B3F91C2E9A1D163BFFD210F7BE95B923E2500DB50 | |
5982 | 2075106DB541C267BD450B25B670CE80BCD068D4DBFF2D82634175B61FBD3BC3 | |
5983 | 406131F44C7D6F18D375D1F2270829DDF29DC14DBB58A30AC193245D18DE91F8 | |
5984 | AB88AB548D8138605BB5A50073295534E314366E26665AE70482B890E4101D6B | |
5985 | 60E4F3B37ABCA1346DAAE8FDB8DD9C832EFF3E73BA470E2BACE7B8515CB43388 | |
5986 | C27AF99FF9322175CF8D4947E6B3846AFF5163E972156847F58A66660EC8A3A6 | |
5987 | 5FB47C9F637B4CBB4C73B6A080B0CF6FD1E9665E92032540570FFCC747C67C50 | |
5988 | 822811AADC404BC7ECD1673E8AA6C3A2F1D82F39430B58C29145E2F1B679C46E | |
5989 | 94EDC711883F1E4EA84117A54757E8895A40401A26E1437B39A2F65CAADD6E02 | |
5990 | D71FA8AF7453668DC613F326A3344F74AD7AC67569AF399385500ABDA5EDD3BA | |
5991 | 343CC5EDD4B558467626850E752B9959FEF1454E53E7A3DCBC2255AD8F6AB4FE | |
5992 | 894455118A61C58840CB68A925ACCAD75CEACE863D806916228F0614191A1CD5 | |
5993 | DC9BAE256018615AA3725834519449B0A88B4F396654E74099C007930ADB1327 | |
5994 | DD119BF799FE3B0B223E1EDA04FE2DA7A1C879143E1C33B6C6344F4BA033AD6F | |
5995 | 8E88C33DEF1977796B454BAB2494C930F492A518E8198C708A75FFEF8C49C324 | |
5996 | A718AB59B889DED521229E741FFE53F98EBE88B0405AD523254FD3FA4BBE96DA | |
5997 | DA1C27C1C979A0DD4E61C3B1F4C4DE01E42F1C4435EECFC02D97994BC8AF5270 | |
5998 | E7CB1458D76ED0229C5FFB4A23B8716018F9050970895D51722CDE8F2EA3D947 | |
5999 | DFF374D84915D5C5D16463A6FFCD079D1ED416C4347BF831FF0C4ADFB61295DC | |
6000 | 4D5785BB0852BF472CFC97EC174491CAF961AB90629F055E75DAA6D9898E8653 | |
6001 | 5BCF379816CAE46FEA62E7BE8E9B953466E51828172C4DBD0E1BBAD1CE28B5B1 | |
6002 | 02B3E36403BE80B49A47446A6677FCED438F01D60EB10F478C89528FA337D0D8 | |
6003 | 88D3FC123C076507ACDAF783A9A6E24ED73BF24B6E0F11C13E532DE5F70B15A0 | |
6004 | 657F5ED27D204449A841ED19E01432CFFE928E921321113780D036D34F2797DE | |
6005 | D4459CFD15BB117B5C9745EF3CD2B296D91FAD48C80B136D94476967E255F808 | |
6006 | AD2B5D522ADEC64176833756510391815A1D4A8DA1D0AEE7CAD36A1D161889F2 | |
6007 | 3347D5B6BC503300FDDD48F594F391D5FB42C42113C538E707C16EE24A3F375E | |
6008 | 7C506E8F49CE50FF9DEF3B4A4C1BEB3848EAA3477349833BA22D2A9012287D8B | |
6009 | A8C4CB4307A1188ACC0E6E9338E1559BE5FAFF381BD82A6C71C267409468B3C0 | |
6010 | 2C1A29F4281D565836EAE57F680490FEA4A952FF64C8CD11C377C294DCD1EC25 | |
6011 | CEFB2B6DCE959D0208F85B6E32E9B44FD455F9B134A5306D95EA29F37BB8B86D | |
6012 | 9E592159338E1293F449380E13C21AE42E6D6952083BFD432F72DFB7B6F9257F | |
6013 | 5784C683A6E9ACD72334E0EA8060A81E14EE32300055040E24B49810DFA1468D | |
6014 | A962DE1D1AEE09B49109257898F155A63A83D514996DCD2F96BC0F52796267DD | |
6015 | DA6229F5E9024F78B02154C27EFDB9B6E09B131C9E9E4DB41A0FAEDD93A05512 | |
6016 | A919AC8869C09FC929682B51174D816B85DADE28C00F6391429BA98327848AA8 | |
6017 | C52FEFEBB2296BB78F06BC1950A8E0405EDBA2D8C51F1F607E73F5A2173E5469 | |
6018 | BEB7918844D450B652DCFBC4C0D0C4AC2AD678B7165AA8F053B717C1D417ECF2 | |
6019 | 3A2909E864E503059135C05EA8F7CF185DA45CE17FA40B4076ABDD8B167B6F02 | |
6020 | 3C8962F09CE07257495ECE5357F755C48E49F4385DB5CE4FBACA3AD4D18E39B8 | |
6021 | F7057F4BF581ED26ADAEE218CE130B0CCCA0C7B273E51D7F314F53EC8EC84100 | |
6022 | 8292750A37A4D4551A5C2A65D2382DB0941409D83FE1005752BAD1980307F153 | |
6023 | BD7C92FC12AEBC7C04839FD7F01BC85F0880DB22FE524204FB924445B6B3DF6E | |
6024 | 1B657353086539BF4E60909524FFC4CCFBC8E0139F65F53ACF3EEC572C673CD0 | |
6025 | 64AB1C29253049B26888A322E0FFCF7DF8871F701CAF5BE7B509E090C43B4755 | |
6026 | B100C929D5A8A4B9646E8EB39F2E705006AD23EEC58E0E1CD0C18A346D8ED66B | |
6027 | D0D2E215F637D25EC4F05C449FF8E25250211635C9D5121EE0D51E712B7A8699 | |
6028 | 19E96ED8451ECBE97A7197337C65CCB44FA2522EF6735BFB60CD053EFAC10381 | |
6029 | C70053C2DB3B6DB8DAD720DA6DA25069131FD9759EC2182D1B649AE67FE4181D | |
6030 | B223BA15F5FEB0BBA498F9993F6A9C8DB9088DFACF064ECCB56FC4951EC8F9 | |
6031 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6032 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6033 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6034 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6035 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6036 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6037 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6038 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6039 | cleartomark | |
6040 | {restore}if | |
6041 | %%EndFont | |
6042 | %%BeginFont: CMSL10 | |
6043 | %!PS-AdobeFont-1.0: CMSL10 003.002 | |
6044 | %%Title: CMSL10 | |
6045 | %Version: 003.002 | |
6046 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
6047 | %%Creator: David M. Jones | |
6048 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
6049 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMSL10. | |
6050 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
6051 | % This license is in the accompanying file OFL.txt, and is also | |
6052 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
6053 | %%EndComments | |
6054 | FontDirectory/CMSL10 known{/CMSL10 findfont dup/UniqueID known{dup | |
6055 | /UniqueID get 5000798 eq exch/FontType get 1 eq and}{pop false}ifelse | |
6056 | {save true}{false}ifelse}{false}ifelse | |
6057 | 11 dict begin | |
6058 | /FontType 1 def | |
6059 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
6060 | /FontName /CMSL10 def | |
6061 | /FontBBox {-62 -250 1123 750 }readonly def | |
45c0f7f8 CR |
6062 | /PaintType 0 def |
6063 | /FontInfo 9 dict dup begin | |
6064 | /version (003.002) readonly def | |
037a8b7f CR |
6065 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMSL10.) readonly def |
6066 | /FullName (CMSL10) readonly def | |
c302751c CR |
6067 | /FamilyName (Computer Modern) readonly def |
6068 | /Weight (Medium) readonly def | |
037a8b7f | 6069 | /ItalicAngle -9.46 def |
c302751c | 6070 | /isFixedPitch false def |
45c0f7f8 CR |
6071 | /UnderlinePosition -100 def |
6072 | /UnderlineThickness 50 def | |
c302751c | 6073 | end readonly def |
c302751c CR |
6074 | /Encoding 256 array |
6075 | 0 1 255 {1 index exch /.notdef put} for | |
037a8b7f CR |
6076 | dup 11 /ff put |
6077 | dup 12 /fi put | |
6078 | dup 14 /ffi put | |
f6029107 | 6079 | dup 33 /exclam put |
037a8b7f CR |
6080 | dup 36 /dollar put |
6081 | dup 45 /hyphen put | |
6082 | dup 49 /one put | |
6083 | dup 50 /two put | |
6084 | dup 51 /three put | |
037a8b7f CR |
6085 | dup 65 /A put |
6086 | dup 66 /B put | |
6087 | dup 67 /C put | |
6088 | dup 68 /D put | |
6089 | dup 69 /E put | |
6090 | dup 70 /F put | |
6091 | dup 71 /G put | |
6092 | dup 72 /H put | |
6093 | dup 73 /I put | |
6094 | dup 75 /K put | |
6095 | dup 76 /L put | |
6096 | dup 77 /M put | |
6097 | dup 78 /N put | |
6098 | dup 79 /O put | |
6099 | dup 80 /P put | |
6100 | dup 82 /R put | |
6101 | dup 83 /S put | |
6102 | dup 84 /T put | |
6103 | dup 85 /U put | |
6104 | dup 87 /W put | |
6105 | dup 88 /X put | |
6106 | dup 89 /Y put | |
6107 | dup 97 /a put | |
6108 | dup 98 /b put | |
6109 | dup 99 /c put | |
6110 | dup 100 /d put | |
6111 | dup 101 /e put | |
6112 | dup 102 /f put | |
6113 | dup 103 /g put | |
6114 | dup 104 /h put | |
6115 | dup 105 /i put | |
6116 | dup 106 /j put | |
6117 | dup 107 /k put | |
6118 | dup 108 /l put | |
6119 | dup 109 /m put | |
6120 | dup 110 /n put | |
6121 | dup 111 /o put | |
6122 | dup 112 /p put | |
6123 | dup 113 /q put | |
6124 | dup 114 /r put | |
6125 | dup 115 /s put | |
6126 | dup 116 /t put | |
6127 | dup 117 /u put | |
6128 | dup 118 /v put | |
6129 | dup 119 /w put | |
6130 | dup 120 /x put | |
6131 | dup 121 /y put | |
b729dac1 | 6132 | dup 122 /z put |
c302751c | 6133 | readonly def |
c302751c CR |
6134 | currentdict end |
6135 | currentfile eexec | |
45c0f7f8 CR |
6136 | D9D66F633B846AB284BCF8B0411B772DE5CE32340DC6F28AF40857E4451976E7 |
6137 | 5182433CF9F333A38BD841C0D4E68BF9E012EB32A8FFB76B5816306B5EDF7C99 | |
6138 | 8B3A16D9B4BC056662E32C7CD0123DFAEB734C7532E64BBFBF5A60336E646716 | |
6139 | EFB852C877F440D329172C71F1E5D59CE9473C26B8AEF7AD68EF0727B6EC2E0C | |
6140 | 02CE8D8B07183838330C0284BD419CBDAE42B141D3D4BE492473F240CEED931D | |
6141 | 46E9F999C5CB3235E2C6DAAA2C0169E1991BEAEA0D704BF49CEA3E98E8C2361A | |
6142 | 4B60D020D325E4C2450F3BCF59223103D20DB6943DE1BA6FC8D4362C3CE32E0D | |
6143 | DCE118A7394CB72B56624142B74A3863C1D054C7CB14F89CBAFF08A4162FC384 | |
6144 | 7FEDA760DD8E09028C461D7C8C765390E13667DD233EA2E20063634941F668C0 | |
6145 | C14657504A30C0C298F341B0EC9D1247E084CC760B7D4F27874744CDC5D76814 | |
6146 | 25E2367955EA15B0B5CD2C4A0B21F3653FCC70D32D6AC6E28FB470EB246D6ED5 | |
6147 | 7872201EF784EE43930DC4801FC99043C93D789F5ED9A09946EC104C430B5581 | |
6148 | 299CB76590919D5538B16837F966CF6B213D6E40238F55B4E0F715DBD2A8B8B8 | |
6149 | 80A4B633D128EB01BB783569E827F83AF61665C0510C7EA8E6FC89A30B0BC0EB | |
6150 | 5A53E5E67EF62D8855F6606E421BD351916549C569C7368AAFB714E22A023584 | |
6151 | 8B1D6B52FC6F635E44058690002C6BA02CEC21C54CC8875B408A8BB84F445894 | |
6152 | 5D6B3E4841CA20AF852A660FE9C832F773691DC6F7197FF3DEAEE97418A5ED2F | |
6153 | F2AE65300416227CD3BB03C29003C770CD7D2A7A2E4C1DCA193651C2CDDBF93B | |
6154 | 966938788694BFB562AB0010268955FC3555E5984CCAB0A9B7590C77C9BC713E | |
6155 | A29E5BD7193A4E971D1752DDD0F0AA4648E7E87BBCE66A1E836C715C408B07A5 | |
6156 | 9EB56BEFD4596706CF839BA4CFA90CAD4038C1E006B51913279A2C31FBEE5BD4 | |
6157 | A7D74F9103CE6124F5B439CB860987DF44FE17EF88EF1BF62C67060D25696BCD | |
6158 | 94ADF08F04E349CEBDF9D3389D870D94CC05E393B3F4362A13A6A672EE5E8F5A | |
6159 | DFE7046AFE3EBAEA58FFEBA4A47BF61F92E2003756DA643CCF2C9DFCCAB62669 | |
6160 | E3C2A18D690B64D907F50BCA155A85E47C3A6954C6FF7ACA36D8DFCE777B7929 | |
6161 | 5F5D5F787B9C247ABF13D6D7B4A8F06BA25CCB342F8A5071325CDA86AD71BA23 | |
6162 | 8A9695C7D1D50D0AAC267AB7CDBA7AAF46A264B7B081B7E79AD937FEE4969FD5 | |
6163 | 155A99E652461EFFB4BD010E5885631E2B2497D6B8C43CE77D7D47FE201DD46E | |
6164 | 4482FFDCE150A1183C22C004A0AF0E1F42AA6804E038E1DFC8B0A3CE26B52038 | |
6165 | 44D2E7F759DA5C252489E5525963D68BC27C82247BEB18818C7D4CF0BC5CC97D | |
6166 | 8C701034B8DF798DD4CE36C3F8B1FD40B2DA14EA75583852875031AF8C909EE0 | |
6167 | 04495FDCD04B05A5EFEBA56A8CAC1F57F1B8AB91FB25C81CD51EE69D6E0F52CC | |
6168 | A0E12CF7E3187D67DF71A599FFD895FAA7BF80E2E6B96592BE77AE96905BAF0F | |
6169 | F547355A36C443797DDA7C414AA606CF9153E03450B77D1BA4088D739DF55F07 | |
6170 | 111B9E11AF37F45B6EDE6D7AC126E05886A57C83886DA87761BE600DEECD1344 | |
6171 | 8A82BD652BE7ABFE6A0F50ED7C6F4EE12CDFD80CA7A5518692F267C51C3FE76C | |
6172 | 567BB8DDBE09A2AF901F79AD02B435287CB8057B3D5EE6655071F67B00438728 | |
6173 | C4C3EBD648BAF650993AFE5E2B29074A99ED0FB725D9B8CE8B0292B08A280214 | |
6174 | C3AF252BEEAD30C88F72E322FAC3E9D78A1038F5DFC41F7BF1AE3744A0677094 | |
6175 | 51B77C2D630B67853FE5E975A395C06A4D4DA744040B272C2B88D8B7ED3A2C01 | |
6176 | 66F503C9DFD3C7DDAC865900D2A4F2CDF517F449851DB1963468D0266D7A3E58 | |
6177 | 9F6B2A1843E6444274F16A9930302DACD8D2BC4588765099A86BCCD8A31DF0E6 | |
6178 | 2853114DFF2D19F812F19AE6C2E419D7AC1BC024D1195074FD0C6717BFB389A4 | |
6179 | 4D5428E7BB2E4F9E9FDEDED7BDCBDD3460805AEA0B5F6460C2FDF19273CE5BA7 | |
6180 | 5D3AAE0DB94C6AFA8339646191C23B0149E7CBF136FC4C844E025A38935DF256 | |
6181 | 0A0A6466A45EE8B9B23B6A055856FB084F87C73BA28F1883E3B184CD813C72F9 | |
6182 | 233B78CA4E125ABD26F29B92CD9DF39D6FDC2A217E2B6B45D9B0A4D536790A5D | |
6183 | BC0903069565A442FA7466414D948AC432C6B75D8D0E1DBB217CA3DC38A52DEF | |
6184 | 62E9D5AE9E753956C13819D93148C7683BE4F71B80BC066D8C19FC807FB1C086 | |
6185 | B49215DCF56A91A42089F0D063B9981925691F7DDE3237403AC714F5CC3ACA88 | |
6186 | DB2F1DD205578C00472FD70C8BA4F752E3923ACF3164D442A6B639902ED060D0 | |
6187 | C5777BC20F9A3BDA60FA3BC986C38136FBD2E8F910E32EF36377C9CC187F4AFA | |
6188 | CCEC423DB925B378522B748BDF12D523804CABA83CB5A7ED69FAB9AAB75EE8FC | |
6189 | 38D9866E3754C4E2F2B9AEFA804044D878DED0E114EA0E9682FCF38F6628E63D | |
6190 | FE1C1B5615E54FAE8684566EDC4B616F76EEFD6207E0386F06D3BFFA26425F24 | |
6191 | 303CC7C8A8D7021E7D09B202616988287838C3DBCE3179B4FB5C726E603A47F2 | |
6192 | 8248CB508F327D1291CF3F08F7C88298DC2D0F778D24304EFCF6E074182BF5B1 | |
6193 | 8E6551811FD6991971692108E289B61053D6DCBA2925B3903E8916EBD09D97A2 | |
6194 | C6D08E89DE4C0CDF7185E1E00DF456B249F0BFC686E04FDAAD2772DC2C39DD53 | |
6195 | 9C23A41471267F53A87E5C2B8CBCDB66CE0B9844BC506428E6150B48D2FA6363 | |
6196 | 4FDB2CEDFBAE0B7DBCE4D83E29B2955F8966272CB865EDB360C8A8C19EC62A29 | |
6197 | 03066483E4083524A1E8D80FE3867BC1AA91753C26ACBE8489AB0E3330206212 | |
6198 | 93E07ED473DBF457EB8489E66FB4B8ED8A9EA8911CF9308CFE3E6D6F36810EE8 | |
6199 | 91CCB11BD548617B2C683C354452B9229E7C9E68828BBEC324420DF7C188CCE0 | |
6200 | FBB514547553A7E9B38AC265783891F42DA472388569C8E7594F7E8810895A27 | |
6201 | 06E456902A8D9F65CA808F1FD475D011C4572F8A654BA01D67942226A663D179 | |
6202 | 95149FFF41A9F55AE84EEB9A6A39C017D7E4FD6EFEEE7FF3CE847CDB064A4954 | |
6203 | 9DCD273B810E0F259501BA4003A3EC1ABA6E13D24C0B57FF82D6DF077833B6A2 | |
6204 | 7EA54801BA81DB961C261689C0887FAD83771E55D3D137AFBB21779397E11972 | |
6205 | 6C6CA922F45AFA5C0526863A5AD8B9C0775CCBA17FFD37A44CED4710884DBC31 | |
6206 | 5C9D3F5441595B86CF7CA2EEE42AE87896E9E60EBF5F35C2B7FDBF9A9CDAE262 | |
6207 | 3F48396F0F741E9DDF1D4FEF75E68AFB020D06CC29B3A7B2ED819D1AABC12B91 | |
6208 | CA2A65F1AFDDA2F3FB322E0268DBBA024663E49EFF076455338FE31A16B04EC1 | |
6209 | 797EAB0B49AFFB906A0690A1E8E2F5314773E1CCFFF43E6FB3875AC907F0C5D0 | |
6210 | DCB9BCC127014D472463560CA0CB1C2CE614D94177C7A52A5B089316689C8112 | |
6211 | CA57E35D716D956DBF9013B1E5B9626456B1433C8C15FA906458F957133B9E19 | |
6212 | 8D46DC3AC015F7602538C2AE3927C6DDBACF38E59220C2F5AF36B68DE9117C51 | |
6213 | 04CF7DF32B1AF55B87D1D8A5F4BCFEC66F63B32B6548DEDA3AAB06C5310E4757 | |
6214 | 78AFF947DA22809B360FE535506A554DDDE5A6F2411246653710ECE5CD3185BE | |
6215 | 730520A766C47E1ED01890059882BE1432586864E1A86A7F586438C8DD35C00F | |
6216 | 021A741ED47E0F16DB6070ED0C50038632CA4AC2975578A8372A080CC0447C79 | |
6217 | CEABDF2BCD5E78564247B0F0025F556DA8FB62125227849EACFB724A4AE3EF57 | |
6218 | 90C07A5B27D2E59425F56BF8AD84C5F5310FEB1BC73D536339FC2E6A5BE2DAFD | |
6219 | 97FC835E0D52F680F80ACA37DB498AACF152B9B44626CD89E3302C3EE1623EE0 | |
6220 | F998FA78305960AAB9F483F731F5F67A8C963C23DB8E48FB804EF8B86FAFE7F9 | |
6221 | 4C09641915FA7E3930AC922682313408BC1607C76751CEEAFD660206A39CF394 | |
6222 | 40ABE2A313AB7D5FD6444E219DC5C26734D322BA268D330AC17959A390D6C8E7 | |
6223 | 3A155095BDD66516DAD5D65519A7FB871ECDA77061EFB21F359158B4470EF79B | |
6224 | 362C35C06B85C9A9505C8361939C6AC013F2CFE8EEF46FD8CB4452AAB3EF1FA7 | |
6225 | DC066557BADC2ADDDF7DDC2A0E1DD4A357E27A2073427EACF9B9035DA5272136 | |
6226 | 7DF37E26D96ED4B2ACD60596E039BCB15E259C72FEB3344E3EEE3D4F17DF4233 | |
6227 | 04C1416BCADE80BD483DD8C9AF979E1C7D50C4CF015870703F88B92C4FE46AB8 | |
6228 | DE6717B55C460C805B391B84333097E116F4A51F631FAFAB34CFC925BEE8B72B | |
6229 | C9FD5F5A79D8F2295FBFAE649DC6AB47794AC7D73431FFE5BE992F2B5AC67049 | |
6230 | B5208251C0E442385A9FACF25E3A98D7F5D4C2A1ABDC600AABE84769CA83350F | |
6231 | 9B87F71CEAD3600E02FF9AC03C1B5C21C84F911511A0CF0111BAC7605EE31229 | |
6232 | 3C526A79D943D92E1CC3C38ABE82D560CFD4172F318030852A5FCC0534B8B3FE | |
6233 | D7365987C8B48A072907B26CDC2108130A33233E8E0BB5FDF14FB55098A10EA2 | |
6234 | B51AD9EFB119F82B08D256D396D3263FBD9DBF172D43A90ACD1A31F3E89E8571 | |
6235 | 74BE98B9560E2CD661A2F93C69FEA3FF26B00772AE2C2C24B98D3D122EA2AA8A | |
6236 | 44652CCDF4EF4F01CA7D62A976E23E8A86291F43BFAF38FD9C325E70F9C36CB5 | |
6237 | A181DAD30156E98339E6A0498D3420B7BB3B4E651A9090D4A17604AE386273A8 | |
6238 | 3D4AE8CC18345E6E19DF06BA848F203F74B161D6A8882991CBA7385F308696A1 | |
6239 | BEEB0130D938A764B98A2001A38489B1334025EA848CA44A116D64926D460D64 | |
6240 | 01159E77EA7ED9ECE7BA77635BE564A4ED89315BDFF54ACE6AA1A26591D13CD4 | |
6241 | 6D6425CA7933769B842192858D10998509396829263290A3A7CFEBBDA3EE6CDD | |
6242 | DF1E492AECDFF7941B53573F01F623CA0A5ECC9D05A3D0954F7AE8CE94AC3B2A | |
6243 | CD4E27519B2E16F033EB732AA024BBAF74626DB55DC74B1FDDB07FAE98B4AC5C | |
6244 | 683CFD8744F361838D343B657EBF52DEEE7AEA7565C5BEEFE455DDDBC4DCCA7D | |
6245 | 87D6D769C5ECCF14118A14A85A86865777C8E28F953160D5E82844AE54D541DF | |
6246 | 550D5F1519E183E0C42BE88F0458CE8087F2CD4B1B49A8E9E3D127C4A4CB74A6 | |
6247 | 2E73BF4CC317781D03FF04BC36AC0E4AF99E2ACAD20F6F8029DE8A035DAB40DB | |
6248 | 17D237850BCDD05931FF4B0FE2D0B79EC5A88FE0236271CCB075BD194AA25AFB | |
6249 | 3FB93A5206F61A14602E4EB6F1C31C654527CE0C02D04314DF9AFD710D0EBB9E | |
6250 | F8721B97F5FB18E27507E1F800B5509A58A1A8296C72B7B73F99B6CFE42E9C2F | |
6251 | B63B3555475E562672645CD374BCDE937A9B05A157FB3E74C8297507253E957B | |
6252 | 1A9DC421946734CEFA3D5EE357DAC7E9DE17A5BDDEF6B2D2A740BC58128FC514 | |
6253 | 61154664412BA1C05209EC992A77B7CA45AB7C0EEBF590A5B5652866008CDEF7 | |
6254 | 124A3003AE6A7CF9DF3C72750CBD281358CD2FF25B162B78CBB971DB3477F8D2 | |
6255 | ECA3EE9CBC90323B2C236E375337EA0848CD7CB5781A2B0A42DE7E4D99DB2746 | |
6256 | 0B26796CEE129D23C76794B7CE21C13C7D4A998B752C8CF43A4821B736EBE246 | |
6257 | D2A2BD7BA3351FBCD1B0A501EC1EAABE60D06DA2FE39BE1F0AD629769FDDC933 | |
6258 | F9D02F9686EC8C2D7455C26AF4DD3F6860B2289E3A30E1C254AD17D731CB73B2 | |
6259 | BF4DFE90CAEECE3ED0CD3FB4C8F4C7BE1C056AB4E9B95781A8968E3CC1010003 | |
6260 | 75DFBC4AB9F6B27C5A9AD88D94441A8ADF09EB275E5F0E5E6F3BFEA0FA8C308A | |
6261 | 8593ABA0645ECA8FDC3F0E264B35D4B0DDB86B93CD8A047FC409E18196B501C3 | |
6262 | B003622999C47BAC04FD1ABD8AD359C977766E9643EF3BD6385306B08EE3E13E | |
6263 | 7DA5A06AE33D17A3D574C6390DB6E9429754B210F0C349C359559C7EAA2350BD | |
6264 | F61D4D8A92B1AF697BC620FA0351E67E0D9F41A95A47EE0BF210C2C48691901F | |
6265 | F905F65693DCB85BE412F097480F6A7266AE0A928729DA0F691CBFFF3B276EA7 | |
6266 | 322BCD2206D96E3DAFDFB992CA8F2955F0E8B882729DFF840569D12E4DA1775E | |
6267 | 523AA734552AAB6F2F16B89B39F1A3FF0E07EA08D13E612F201716C67F327017 | |
6268 | 6C041760DA30374434808273062C1FFA2C47B3FB578807BC26537F542040FF77 | |
6269 | 66C995EF3E8B08B09FCD3EE89C30F157158A739606D2CEAA26694A4F1CEA6633 | |
6270 | B54933141CB85C60AB262E2D4E824A3B85C2BEF810DD774F296AB37D0BAE7182 | |
6271 | 5648CD18556ACB124246A75474B232D712C2358908B5D9A76F82C626BFDE01A1 | |
6272 | 093B8FA6AA0B32F2CDEF737B28BC0448FF816DDB5812131DA0DD5979D77C3838 | |
6273 | B978CC3F6778A4BFCE9A7087EFB19749285AE4C92B99A6649DA349A2E0889D72 | |
6274 | 6D4FC664522F06C8C4D86D30BA43ED4E42211217D01636A4E17E2A132D26F394 | |
6275 | EC34EA12D84594AED9C6CDBBC0908860F39B240FA7D7B3003DB10322498691CF | |
6276 | A294C0FC7ACC0BAD1EED3E9D60AAE3F7429695892D1A21CEBF062C6129B33966 | |
6277 | 8B2EF6E932F9891DE6028B81C5E9B23278D35B7F0D83989BCBA25E20E9D503DE | |
6278 | 144DC485F09A4EFA1268AC5E4B551C5B2F1D51E9B9B9C0FEE585204F869D0BE0 | |
6279 | 7287D7570A12940A47C1F51AC6134F03B415C30E147C49F89228855D093EE55F | |
6280 | 172711F37776E97A99CC4B36E2F10713E36FB279FD3FA5A0EB9F3938F42E2BB9 | |
6281 | 254EB8F0C0F30391735019E02BFDA21D9813C6A22279B898EAF01AA892B14DC6 | |
6282 | 5912B9275167AB46EBC420836CC1A5F38A4EB47C039A7BCA62BC3FCE4199FC71 | |
6283 | 011DD6E5FFA0F3D7F04AC02AF91B9249B9F993AE346572329DA852115BEF8460 | |
6284 | B94690E790003586F473F37EAB5AC2922F5F663EE2C3C0C336A8DB71650631AC | |
6285 | 0A923A389AC911CB215EC2EC7D50CF8AEFD59EBFFA53A9F1FFB7E6215F17093E | |
6286 | 3975F186FE23BB5FA5474C11408FABD223E1E6F62035B5A5C1AEFD8899F00FFB | |
6287 | E729C2D5FD551E80716CEA4E8281660286A802AAE8D5834F37F2EAC46297E57E | |
6288 | 993B09251DD7789D3467417E393B7DEABD06676B96241B0E43ED1A1A9FC3B12E | |
6289 | 0D34B2B0792B79AA648FE9450C3B209FB6D7D91F50C52A5DAB0BC81A8B698BD9 | |
6290 | 18946EFF691912D7348D48FE68CD876FC6F71F81165D0C3272DA1A992308D9E0 | |
6291 | ED6D0A4DAD679AF495F62B78D462B463BD4A40931172290C615B3B3B6B47E45F | |
6292 | CEBB85E0A6AB6832067CA6D403C239530D07F199788AA4DD52553836851C5228 | |
6293 | 1072406F6D7323A334E7A7FCA588897C4FBA6D4F7DEB65525EFB74E539C988C3 | |
6294 | A685A98752F7198E77E456A545F0D23A1BEF81EF58B02D289CF980A3F17BEC8A | |
6295 | 6F83DD90C4A917EB0E5E2B444A608E2E9D2FF80620E16AC1D7775C0A10C1299B | |
6296 | BEE0E1AB24C50647E5CA1DA65CFF3B2C295F0644CA7826E1DC6FADEA93D66A20 | |
6297 | DE852F20AD224D28DB900519EB1569837139C833F24B799F7EBE3FDC14235323 | |
6298 | 1D0BCD4991C861F38DF413A5A5588B73AEC3BBFDB885CE17BB3E97B4E6A79761 | |
6299 | 93EC8418C2BC4725CD61B5E30C07352F647C3FD50083878C13CFAC241DDCB082 | |
6300 | E53703D182068727F9EB6FACEC25F6D901D7309ED7370867E34E267519E22D62 | |
6301 | 4FC7093448BD0D6B1C43D318A3E14C92032325C132AE0FF7ED707E1FA4A955FB | |
6302 | F5224BE0045CB14ECC321D0F333FE24EEFCC504F7C756451D7693C3E6CA87526 | |
6303 | 4912E1B6DB935BDE76FBFAFCA4ED473F1D2618812CFF25A6859C626A216603C1 | |
6304 | 361BE3E071FCFEC2D4BF2FEBDE07DBD56A1BFF8303901168FA06488BA6B76F36 | |
6305 | 95B0A90D7724E9ADB567C2ADC65CF3482CF47FD1D16F70AA19A97D0F9EFC611C | |
6306 | AEA5E1ACCDA7FB2DF05E9480936281484BC329F0B771775E73F7FD72FE3F45F0 | |
6307 | 50ADBD03932B38F37A8F0A66B2F739EA3AC8811C8F514E68C5643E4AFF485C81 | |
6308 | 88475A523D7FCCA5C8809BD49846C77795A38DC6406082000236A4D2628B5932 | |
6309 | AB7916D44EC2210CB941B1455867E510E9D8A0B83CB645BCABDCDBFCD51A4E12 | |
6310 | 60CFFEF0CCA548F654037D01CD631FC4E1F97B4F65DA9AE79D99F13A726E93DC | |
6311 | BBB027B7D175FD17A704C4668F6F8428262959DACA9F8C687C923CFA053804C9 | |
6312 | 9B2005FA7E0F07D81E52A9A37AD5CEBA8EA63929093ED0DAB9F7C99C82A50E6C | |
6313 | 6440387049A0C359218F5268C9A28F581783BB9D29E08772D7252FAFA6739687 | |
6314 | 22570150178893C418531769CB3D96F799BF1C6415820F96B6EFAB5344E82796 | |
6315 | 38A0DF66609F5EA332C1065274EC93027D264B84B52AA8AD82E13E2A41AED340 | |
6316 | B240D1888CB89FBB748FD10B214773D466A44AA2AF44371CA8B9A4450DA76EDC | |
f6029107 CR |
6317 | 0167B4015A270B9983B89EFFA023A3DFFDE181B90C51D70557B08444263B84F8 |
6318 | A2A807C55D74265931B553F6D7F132B110DDDD3361BC9563803C888B89881DD5 | |
6319 | 09E1A623957F074F5B3644BB3F93D7F96770C73499AC0AFC3D7157EA08BF9D15 | |
6320 | DA7739FAB528A8BC30C0EA7899A3193CB9E8EB51EF67DF4F97D36005EC228B30 | |
d37a4722 CR |
6321 | E54D14471A6ADD6DFC0A9E18243743457F55C92DC10202632F8ED3DA25B4EC18 |
6322 | A8602DA1E1AB8DEA6778893BA825CD9DE6E52089AACB336885882690FFE504C6 | |
6323 | 7C0098265EDD8DCF06F07452CC311A8B516C61EBE50214B11B72132EE0033528 | |
6324 | 13181B4280F37E2CDE07919B43D2120C22971BAE4821E799143EE8E2726D21A5 | |
6325 | E8728B8F0768597285E8420B583BF7E84B02BAC1991ABC1A5917039DF9EF3B8C | |
6326 | 86C9A3CB4F1666755BBFC2E5623339D0ADDF433A6845728195D58C7AE4C04487 | |
6327 | F42B90E877B053AE9A6DD19B8910851CDBBB0702EAA0294506CBBC0A9A1049AE | |
6328 | CB08948CBFA5E8F07D51336C68A034893B6D146B0897024D482176B14FC63C97 | |
6329 | 1F08988DDA2846BAA3E4EA0084642063BD71B165479641E15AB05BE6D9598891 | |
6330 | B18215FFF0BF4BF195D34703919C1DFB595F52568E46ECCC2855F69A375C25D5 | |
6331 | 10718CE804ABB8C07763C09D9FF6A363C6210E108AC351864AFB17CB5A4AE336 | |
6332 | B582016781DE6A38EF6BEBA595FF4AE88B8C995D96417152176B66F9180FB6FB | |
6333 | 5F6D7C6CFF01901E954BBA64CDDD83A0ADA2FF7CD6DD1EC365080E5159E51E66 | |
6334 | E2B32369F28D845BE68AAE8C67C30D2CD4E6ACB627A8DC9568CCCD414D85A2FD | |
6335 | CAFE36BD8991420E3672E2812D9ADFB4B7FA0C0E027503B6FDFC245B725D7EC6 | |
6336 | 8AE43F6C8B168111F7E25DEDFD64AAC0BC8776F2D257A3AA8A74FA883092E4A2 | |
6337 | A887EFBD80EE15DF491C5D43D0CFABA834C11583ABC8D549E1DDEDD1A1A3CD5D | |
6338 | 5659FC5808D20FF87DC95BEC80CD71B9E5BE3F304A1A03C2F666597072DE657F | |
6339 | 75A1AB1193B5EADB81D92C4E4E41648666F0AC8AEBCD484D30FBDEBDD87E6BB5 | |
6340 | 06265B9C04BA54625207A13FE4B6F292D27C3014F20FA77588CEC44C3F67DC59 | |
6341 | 7F9A77E3CB226C5CC7167A33C006AF85B806097DA22428AF5F2AC68413EF5F44 | |
6342 | A29A02773A2E0C3116B0A016E5D1F5B212896772ECDA058AAB5FE55C60C89AF1 | |
6343 | 0ADFAC6A1EEBB828671CC95C7604D4CCB1CCD89FC758131645522626D280A8D3 | |
6344 | B40E343B18EB52ABCF3511C9DE75D9D10E91FD5D780D5D36E484206EE99BBBD7 | |
6345 | FA03A5526800EAECA69F8B9B62E25017576CFB81783F420DCAED6C94CE71E8E7 | |
6346 | CD158B8F7DCA917ACDC5CBAECC9E0DDBF21BFB63DE462B810031D61B385EDBA3 | |
6347 | 5FAC4BE68B0442575E0FB9FAB7113797A7EDE04BB699EAE0A23A47009ED0EE95 | |
6348 | 58637EF6A5C077B9A0ABDDC9267290F878E80CF79DC2E65842879F2A7AB9D6E3 | |
6349 | 0E296776CBDE5DEB9EDEF38BD020DFBD31379A6FED182FB3A0DCCB340A70DB0D | |
6350 | 81280D3A0D373A2E672C68D2B2F08AF6061917779FE33419F77A5CA2ECF6E46F | |
6351 | E11D9803E4BAF5A7D0971F6708931CE92B5F83C998FA4716B73AE9A29E6F732D | |
6352 | A89F2A3E686DF93E5DBB6BC6C45C30736081395456D16E25AF42B0F8064DEB21 | |
6353 | 2A9E1E4BC599A18E08955209F5195DAE5217F8189CEC5550C1491EE792B7F6B9 | |
6354 | BA2EF22477B92F0F9F6FE8AB9EAD6D6206377D202660FD7FB4BBB21C9F9E289D | |
6355 | D8F6AABC3862D7CAFE7AE4AA3E02B154749C029337C30E0E6452A8FCCB32B0D3 | |
6356 | E8FB74DC71D0874777F5E78D71E8C3D9FE33939CB3A910651438ABC55BDA1906 | |
6357 | 4432BA1EA0366DB8B07247E4D1E5EEAF6AA804350D319AF66CCCDEB1104541BE | |
6358 | 4C621C23CF07173F423D277173989655AE4EC72786203E00B223F19A4A1FEBBF | |
6359 | 7C48EDEF9252AE6330304B5A92DFD8B3BEEEAC5CA058A9F8562E1D016CFFBC02 | |
6360 | 539B46123685E87FDCEFFEC42D0106DAFFA86835667DAF47212A9B715DA7A446 | |
6361 | FDE048EC64661262495A7A9D01EF11109EDDB180C43EB9DB662963265EBCFAF9 | |
6362 | 5470DD411214CCAEC8AC7F182DF8BD93FE984E1BFA8A1171F4619D213EA9810C | |
6363 | 44C65998F3639A7278966684A56FD3A83060A36416430CB1CAADD42112E4302B | |
6364 | E3331562F5CCF6B5B68B60851AF7EC86B534CE1963A2149D9582820E4360870F | |
6365 | 8FB29E163121459FACE85EB665765E6455A2D719C9619D55D60DCA65D46F1EB7 | |
6366 | 3A5FCDE0284F82FAA0A49ED106D226D7C0052F647F0904556C4729D50455DBFE | |
6367 | 7CFD9F8503FF76A117DFDD2B28BD444DD1B0EFDA48D1F6C2B26D805BF4506D7F | |
6368 | 167850D37D16FD07CB5AFCA2C78769292AE449D53AFABBDAB026162AA850F133 | |
6369 | 96D2213EEB37C3CBD535554FA70AA75964F357A5E847E63936740D9AB95B13D2 | |
6370 | 90F334D8FEDA273BA84C7B370FB27D4701598BD6FD563DBD3A5F7B98FA97A9B3 | |
6371 | 3E1F87D9664D7AF53A3B7CBFECE3A57856D03C766F8E1552EB33E441AC3AA6DF | |
6372 | 1DCA2B9B577B646BEF8F0B25C3AA843939CD0AD20E0659885C7F8E488D2E8E4C | |
6373 | 437ED072CCF065697FAEAF59D6D9E83592121D9B40A202003126983D7E169094 | |
6374 | F7FFF67C8F1F0B9F5F48C616BDA5C100804F8B9E6B4824949DC26B4634AA6C21 | |
6375 | E2B1B891A55E5B954D7987B7E6E3CB5E0FC645D7D0B8F7C627F5C642F4DC0453 | |
6376 | 5A8E6494B9F4005D2E5F3432D7418111F730707FA9A0623AE971BAD1AB5FB931 | |
6377 | 5EDDAC1DB70CDC151BF085D241202D7F1692A45BFA18EAEE8E8F79D5828C9592 | |
6378 | 8D945F5177DDF3AF5062AE044BB523CA31378DAC15E19675497988764781797E | |
6379 | 2EF746525D1857B45A0FDA679076ADBB5C4C2644A29225CD1E15744B1635B21A | |
6380 | D64C21EAB13BB8EE8B2759504217D8A06DCB690080DA7CDB2D9BC5BCA23017DF | |
6381 | 3C73811C1840B092E3AFF36E3F322E3FD4B6E8A6CFF25BFC2EFA25940FDD4985 | |
6382 | F3D447E20960EA675B7CDC617974772691DEB833CED5F18D98FAC99B1F00CDB6 | |
6383 | EBD9E77A98413284C98E4CFB3726987F80B8A82DEC86085943750ABAF974BFF4 | |
6384 | 5348BFF04DA5B9DE8238C13D8937427F03C1CDEE994B0C6ECA9D6ABF474DA97D | |
6385 | F34ABCC065173765858424E545421E38E79CE216F4FD5791FB51DB485D1467DB | |
6386 | 0EF3A6DB914F763E3B0FC6BF0AF856A0C2BEC44E875C6D6D5A6AD777DA3B17A9 | |
6387 | 91A9825B4C3C0AF1ED5D5F43036FE58CF48106D42825AF00D193BBF3B8465BED | |
6388 | 00A2267AED6A07EAD4F5747E1EC018D2645FC78EBFE8D5C49FE792F33DFD8CB8 | |
6389 | CEDE83AE62B5A3112C6F5693A6CA7850D01F2F6582B00E7F9F20672C460A3B80 | |
6390 | 09F6C9BBA22780BBA997534DAB7B0FD5DBE4003E3FFE8539900458CB905FB0D1 | |
6391 | 8E76029048C7E070D2C24E8840A3269EB340B2394D37B3628EC608366FB2A695 | |
6392 | 7FDBE02249D82AB905AD105804B6D8E912F2BB7C9625F4B09A7F99325CD7EBA9 | |
6393 | E7083842781FD5746AAF7AEBD6AB5ECCA4D5928B9913D360AEA835FF9379A782 | |
6394 | 7B47DC824CB51E77317540378971D2AACDBBE242BAF561128AF71E639F67ACD0 | |
6395 | B04251C644C9C9B26C6D1AF06AC685B5A0D008EC6FD0105F64976613BFAAD28D | |
6396 | 83AB4F5D1CB5C570AD134575EBB95781C701BF4C9FF8C344251773C12E1C0859 | |
6397 | 119108448094F41E3EA84BA93A582FFBF33CD086F1FB78AC26E44858863AE3F2 | |
6398 | 15DDBE2B9C27D8484C480EC74C1847E4DAF520E507A6B5BDC786145EAD85FACB | |
6399 | 66900381C821444834B653F6D511AF6553FB221112A438BCC8193B330881027A | |
6400 | 908CFAA18E86A2D326326FFC25457C9041BB23701584BAE3FC9185B4B5AB6956 | |
6401 | D8F2BA841F98B0B93F8144B35234067B12FFFDD274DE40183837AAFFEE380CD7 | |
6402 | 28DC181C76DA7A4AF637197F53A931D2666E751A2B899F20FFF9FA312A1A79DF | |
6403 | E04432E4D4591C525B67D008DB6FB611CE089A96D25457291663FA9F264576B0 | |
6404 | 74A5AF80BDEA1D411DC027775EB5F1A1B135B5E5ACFACE7EF66A2EDBE90771D7 | |
6405 | 5D52FD964D4DDE1C419EF7812B15EFBF7481F90F44C276CB3AB69FD5C16EDD5D | |
6406 | 41A3F665C6B86CAA2F7C832AEDE7CE813DE65EB0424D45A721CF7CC7E2E2ACA2 | |
6407 | 2F0FB88F1D61B60F5B7557BB94A88B94CC15BB89B9E67B1C93156586703EA237 | |
6408 | 398EF6F454C70B7F93AD86E1CA3A722BAE4EB6912D19B56DA223484ABFB4C863 | |
6409 | AE40A43BCA384B6FA642B5FDC1877D993BEB7DC9C572B096F15F33A5C95F66EE | |
6410 | 8DD97A03EAA53F319C3BC9D2F12F0AEF079256604C6DF649E264EDE6E30E7828 | |
6411 | 7B74BB86578FB903BA583C955B1A4CAD417073145D7B2405F03AA98F989D1C90 | |
6412 | 8C3F625B28B2B5A8BB5C3E97DF05017B0DF1C7E32F8203556EC952BB2FA045FD | |
6413 | 76A9903FEA605A8F03BC4025B4737BBF8C35DA55D0DC2E2DCFD8B9D6C1310AFD | |
6414 | 481FCB0AE96095FF7E54BE72F713E00C5553B95EB23247C8F17CBCF9D76CD146 | |
6415 | 86543993C53CD843B2284EDF996A0014140A2BC3D6B7CF1883541F932CF17A68 | |
6416 | 09030CB936AE925C6CEDE67B053BDA271A427CAC85EADBEEB559E50FE1983DA5 | |
6417 | 69476CEAE07BEF681CF40593806F3766189536EBDF92AC72270EBAA9DEC38C82 | |
6418 | 8E27F56DC72BB45C38BDEF1E809B69E8C9A787FA37E636C678B7684A74B718B3 | |
6419 | CEF980C3214631C7E89947CC1577259B3E7ED37BCEC9622538B3E21677C48974 | |
6420 | A1F687EB3BB9662F88E6A3D387C9A30C30EB4E206F586B4A90B61729A84A612B | |
6421 | 395975B134FEAE92AA05AF675A9D995F60BFA37FCA4D098F91B9D0854B0D1992 | |
6422 | 8A3DBA87301552C291F404FA4F590243B24E3D4C6F23CD9874D4EBEDCD51C1E2 | |
6423 | BAF3EB9B690ADE288031FD6481D5C40044F71CEC3AE50F6704D9236839EF9B1C | |
6424 | 7FDA3F6E4039FBD2E5B99BB31573BDDA7236FED53D49CF51E3D4B1EECC9F530E | |
6425 | 41E5FD3099C5BBDE367D1ABA42A476DC8C7015E1E028595994748D526E2E1D78 | |
6426 | D8DEE2625BD9EBA9A23BD4FAC1BD00DC3C08B078F96F4252843A566B22718B8D | |
6427 | 0D4A3B7FFF310A76ED12B345A3AEE2F6C8A1AD394665A6F8C9EBD044A4AB0706 | |
6428 | 958E404F955C4E46DF196E1C9BD16E47D60D4EC935864D1A922A5F08DDFCFD34 | |
6429 | 21285BADA201BE83254B4A817F7372B64481B3929F1292E12BC91667763E382D | |
6430 | 66720076AC19BF952A5B6A7A36D50338F256119F85E44093EE26D7EEA0DB0A6A | |
6431 | 2D11DEDFC942EA5E22F4202359C91C65F4B7623EBC539EBA75815866CC964AFA | |
6432 | 6369952AB12AF0F7D0F3BADACE96BCC865B4C246D392F6D118CAD444A97E6F89 | |
6433 | 3100F3D786EE03431E1B3F1F45E2BC45AD0EF659667E757BAB0E7182DE558C8F | |
6434 | 4CF615B2B286B2EDAA9B8A28312DDC1E586CC1225FF6435465A4AF56CCB2694E | |
6435 | B131A72BA2650689E03239761A264AA922FB6544395D991C3DB620F50006C140 | |
6436 | 4258D85225E8013155B4531A6FA2017EA450F77F91AC191C50C1A2FAE77B1B05 | |
6437 | F40339270FF24D91BD842CCADBF9DFEA5AA13CA2C8EA069A242C93A73B9BF6CB | |
6438 | 5C01247F02AE06329464E02C5A3F6835C3B2A1F110E0E72D907C8629DC0219E0 | |
6439 | 4BD43EAD38454B8100021E55FA294C53188B6323F64C0042CC2F9728F776C99F | |
6440 | 66B34990B279FD59B4AE356D1DB317F18DA66AF2E12EB5C9553D58BD075424A3 | |
6441 | 00BFA49F981FBC0733F388710A62EE9216A96A959B700B02FD79E2174093D6EE | |
6442 | 30E5CA22AD61E0563AA18865E47A4DF8FFD40FCAAF36FA72136533B3184BA684 | |
6443 | 87E2C88C4A8F119F1DCC5B7CC8BCA31CD23806E08CB77530038FB09CABC6A035 | |
6444 | E21971E5088665D46747FC3D66B0626295252642C833862FCEF1C749CA6B6199 | |
6445 | 738198327FBCD7DA364D6F0AE000DC56AA44D8A7D3E74BB7A7C91B117203257C | |
6446 | 1ED384C741B14E526571B06E3665865D89A494F32D78674BB62063DF2A48989E | |
6447 | 12293072B16049DBC1AAD7EDEBE0DF69F69FAC857D950BD962E17C8BF097DD63 | |
6448 | DA98E41A07C1C299FF834D41D6B075C8802E1081764B017809361A4C1043D141 | |
6449 | C340AA469642D10EAD0ED5F01314CDC9024EBE21924D5488B9FF775934B1B563 | |
6450 | 591AF1D8973CF814A987637E8C8231653036AC5714B74680F23D2A41770C1E02 | |
6451 | 22659A92D305AFCE2AFC973776939095B142E60375D5CC0AA54CE490BDE293A9 | |
6452 | F19DBD653D7BA4D9C968FDDEBB95A0B6035016FE534D438DD0BF26336F83C555 | |
6453 | 1BF5AD6CA8F02CD063CC67D2929D2B6ABB42DFE5FCEE51D583155BD8FE72AB28 | |
6454 | BD423808157195E0293F75818ED5ECD68294C8B6866948084078D83246E9ED70 | |
6455 | 38667D6B3398710C5ABC172F446AA0C5AF3F4023F08CC22D02E51D804299A12B | |
6456 | 9503C2AA055914AA5DD5481A1B92CF8F70BFED758B447EEB256272CE393FAB8C | |
6457 | 08F090E434EA61838AAA3CF02356D5EA8A8323881E413579C55123F64E817D51 | |
6458 | 7504A8A473E7D6C39662B665556F9C5CF0F3DF9D42C0C03AA3FBD95DEAF4DA64 | |
6459 | B41FF342092A5445E96FCC6CC910DD9EDF8DAABDF255814A0D0D874B03D3687B | |
6460 | 1441639C03FE3176093361CFF731478E609E4A86AF8810832EF983C5EACE4CF1 | |
6461 | AB8419AE0655F8DD18DE8E68F320BC1C1FA89DF622A03866E8AC8EBCBC336E76 | |
6462 | 8AF4E24D9D53E0003E4FEE40D4386BC59E6FE3FB13AB6FB94D28FBBD95576A20 | |
6463 | 8F8ECFC0952959796BE533D4867224DFC44D079FB8166AEF46F118CFC1B114DD | |
6464 | C87AA0156DFA28A10D8599B40588E1F84907CE0300C7A8CF3C6DB63505A79D04 | |
6465 | 1AE29BB896A6B2266FEFB1CA6799CF384B1113F54ECE96FB5C8C90E0B36367AF | |
6466 | 5E580A75E1EA2278CFBD60956D333FA75BCAFBEB7FA767EB960097BD38D4F4F3 | |
6467 | E16F00AB29674C802F1EBE7291B4452664260992AF6F834C1D02273BF1B3EA24 | |
6468 | 5D6CB3D611F1A99F27300035ED706E6C3D18F56C7CFC472134A96690FCF476D0 | |
6469 | 6843014794534851A4CAAA547D5DC4AADC3D94A03BE478FCDCE19CB05BC7CF54 | |
6470 | 8B88D9698141D2309327680139F05275D56D025ECA13A25B3211A0F07AFEFFAF | |
6471 | 2FB4A48CD4CC4915F988A619C6410A2E16B031EC19B7FDB904D149467F1D295D | |
6472 | 6777FDC0712AA90E529D4768339EF966B5907B41CB1258BE514B39C8F853D28A | |
6473 | 8951224C1FD0EA80D19D0BEF548A23E70E9D172A2FC6E6BAE3900D81D4E6C530 | |
6474 | 1317BBAC68FFE952F47EDFDE434966B89B9E6DB348C6D3D8D10EF6254AAD9B9E | |
6475 | 427FCA129A3867C5A0CA1723D4828F8DB1D99774606CC00BEBDB15E02A88F7AA | |
6476 | 2B3F47F420E12A5104A09D6AC903E0C9C715BB99A87DBC453829F2ED8CC6A934 | |
6477 | FE875D5947EB0B7C5FBF193769C209CFB55AB5E331DA007C22517035295F7833 | |
6478 | C5F54040629BFE9CF0FD9FA9FF10A7DA143138CE41689004557E0DA6A51349BB | |
6479 | 9530B852DBB52EC7FAFA39FCF8381CE3419AF0E9E6D69B14E5020C8DECFB66CA | |
6480 | 7071451B87A1FDD2789736E5A3DAB0644CC9727B58529B5A807388CF904C1BEB | |
6481 | 8CD7B322676FF8B7CC6A25F887CBCA97DE6A7CC53DD7142BBBD1FB447634E2A5 | |
6482 | E52158C7CA2951E87722298B50ACCD1A381F3FCEA2B8669026C751898DFBE999 | |
6483 | 49B86879D78B50F5CBB3FFF59FB9CC55D6C0AFD190C521C9D087B8F0C34B11BE | |
6484 | 7F5C705FCED255F6376E3A86A49B49E8059406A6A387FA711478EAC4007E5D80 | |
6485 | C907C72BCB7DF583F76B6685ED9B4262F607D69B23554D1D275A03692D5DFE85 | |
6486 | 5002120CD7786263ACDE7CA7158644D8D8D78A757182C03620DC5112538E66F1 | |
6487 | 61B30CC11B60AAA0B1873A846DB6281D7AE2420A76E6F66FA5D5B288B8888666 | |
6488 | F707AA8F77363AE3C2B0BBF0577D0131F0F7FAB358AB10A0511605B28C5402B5 | |
6489 | C5EA4466ABBAC85601CF8E61101D80F84D7FD7629620B931302E14E7A89B8955 | |
6490 | 41D7A89413A906399D5E375665A4C24DEBA6DFFBC751E23F4D17642D391A4626 | |
6491 | F8397EC5553572023B0F57D5430E35163156F76CFE24442D041B6FA0B44AF48C | |
6492 | 15FE0C8C9CBC300AF3A8BBB79B5BA6D2D1F45A294E201DC327BCFFBB5CBCF384 | |
6493 | CF4FDE8C9B07874E8C954603C4A4F0EE585610B19976F6682B41FE2EB56299BA | |
6494 | 25EFC2604FBD73F7DE1AF858F325DB0D1FD2A3F8965A1DB71CB68C23ECFFE678 | |
6495 | E08C34E52C0E0B4F61B2CBAF3E765ABABDBE364B31C5C7AD94BB7CD5C92AB012 | |
6496 | 43DDCD9A83C43F021176F69945AE6A702FCCACEBF5DBCBA63A92D82453DE824B | |
6497 | B240CFF9B29DF6677D635BCDB3A22DE9F1C0172F32136BC107A1CF2C614897F5 | |
6498 | D6D1C35B2ECDE7E0C8D8BDBF30944D46DEDBCF50E9C45D49A4AECDD5E079BA5E | |
6499 | 4866856A603494B605E4E5BE811E626B6A5F54938324785CF96240C12CF83F2A | |
6500 | 5302D5588F54E27486A9BB00BAA9262145DA0B7A1DA5E514DD6789692290109C | |
6501 | 3F6C8C1C63E49C74BBCDF5FD1D7CC7CBBDEE68BDEED59DAA8BF185044C159365 | |
6502 | 0CE5077F69F99A1368365057527484D54BE5461BE90AD66334149EDB5EE3317A | |
6503 | E9070F453CC27111F223C18081AE540DEB5F17E1978E28FB47C5033AA48E55E1 | |
6504 | AD0574F400E446499C63C0937ECBC03CD00E75355E2C41BCC160FB1D793D0407 | |
6505 | 355BE741FF520F35C41C0EE6F7FE36065F33B4E30C6DCE227B4B514A575D09A0 | |
6506 | 47A0BB2C03240393E73A976A06C6FAF22B9EB30619149F05E9B65F651F8E6199 | |
6507 | 634F9485E2AAB2BDED709E56126111165A08D0171538BA37E325A173E4982BE2 | |
6508 | 55023BBA920F46060883183231565C764196AFB26DEA93056F0FB140630E9725 | |
6509 | 1EE72FB4374FF43A2A8E0807B8F77EB429B7B9D5ABBDC04072836F7EFB4DEE53 | |
6510 | 26C1CEC5F6CF13334B84F47EBD1975A83FAE789C309A9243919104C844B6220C | |
6511 | F0FF4E9C6E693A6E4EB2D260D7DA96FDB956216E30C5EAC29AA568894361FAB2 | |
6512 | F9EEEDBFD197B278BAB7F2AD3DEBF46B0B1EE58F005132844C96171806BCD864 | |
6513 | 2FD40897CC3E719856A9D137B772AFEEDDAB2D2B353C0705EFEDDC42D169818F | |
6514 | A2D0404F7C84DC9F9CB7527A36F7D8555FAC44AF8A91E872985FA0D758D1C898 | |
6515 | 35BE8560D6B584ED66CF9D834C9EA63434575FBB33E54554D9E4B127EC94F55E | |
6516 | 7B761616E717A84216C8BC656F79B0E567553932D9F30D3355A30BCB9DC8BC80 | |
6517 | 1779D6995E35B3D97D019601BFB970E3CBE8483FF168860909534621D8873D37 | |
6518 | 0073F48FEE38F40A8468FC016F7F76E6E1F09D33DD992FEDCFB2ED3860472E84 | |
6519 | 6204643E41699ADF19440FDD4F0DCEEEEF52351B782DD90583361B7B8B5541BB | |
6520 | 61D25A5AF18FA9F70C599F424C8F9DCFB47420CF4104120FC6F9EF03DF7133FB | |
6521 | 27ECF4D848F5E067A27377985CCD10DF85D1E517B813DAD36E8A40664B352FAA | |
6522 | 184A8DA90C0DE095DBEF531A2481BB31996107FC057A9D6263514089FA589C0E | |
6523 | AFD82DD4EFEF08B80F0F5D91B22E47A0474E27A0EE54755D6280AF36D52E0938 | |
6524 | C57614778147BEB2E89B4236B540457C7FF03BDB6C6978BB69584FCB58AE4625 | |
6525 | CE733497EC0DF25BEDB7E116C6C5D3FEEEB88D771D616AF3D050B3FA5568F6BB | |
6526 | 0752DD30E42B427CB6E6065CD968C6257F2B325F94CC09F5729FD6FD3797E1B6 | |
6527 | C403A0F1B8F3784A856226E64EC3FDE9F4837B512BA76F78F781E44888186DC9 | |
6528 | C2CABDCD59EC4145F6A70B539A55941E830E6237C72AA0B9BF6EFBA37C0DA4B1 | |
6529 | CB4A72627A658600CEA384EC9C5B0CCD3C1ED49530A29C6A6091529CD8D6B2B7 | |
6530 | 027E5759C87D353F4090802F13CCB8BBADF1AB157AA24310AA275F0A4FFDA93E | |
6531 | 00E05E4E534735CF2E575DD02FCA3CFA96A9896451E9C0365CFB4952667E2CFD | |
6532 | D46D3ABC40FA8F73EC68072FB5AE920E14B37C19FF936649DF5E8A978E9DC653 | |
6533 | FC7DADD3C2DCB18A1839CDA3653470E56E62230A148304BFD323CB1D39F6B50E | |
6534 | D5444C8608AB03D73183210E6F4AAA2EB97005E0824AA42A2ACA2732A58B1D36 | |
6535 | B1EC88C9C5E2848AADED90D2F1BDA936C84263BE055793C553B986B73FE8A22C | |
6536 | 1AD099E1D845D5AA1106670C003D889E169ED1877DC454B7601112DC539F56A4 | |
6537 | E936C65227E657BE26FEB41C8E950BCF54224805D9FD6D2516C4DEC09FAA3753 | |
6538 | 262B0A82357EBA2978E80C291B267EE5FC19FB8B6BD509DEE723E032FBCAD28A | |
6539 | 658F6516D60AE9498A14E1B0AD1FDDC65025EE114FD73EB506992C1FCA660041 | |
6540 | 98B6C72AB28D643BFFE1160F600543585524AD00C04BA1C54335536D65B7C471 | |
6541 | FC823F7AEF385E4A013C4924750DC2DC8F12388029D0D958368C15B9C19D718A | |
6542 | AC77E9831E75A330583871159AB63A0332984FDF9D0498AFFD678ABA43FB885D | |
6543 | EB0662034DCEB9576F66174254B26CC515DDAF9EDFFADA446BB02E356E2B6499 | |
6544 | C6B7F4BADF5F949F6E50CD85E869646102F2E5222E62405A4798955E7F4D8018 | |
6545 | 050125F9F5F1D8B2AD8F4A6472C2661DF0BBC6B669868C6CB8B52D528F389911 | |
6546 | CD58F5AA9592027BE25DB1946ED1216F2E915B4333AF69C8C0CCAEA467A46376 | |
6547 | D0AC46F291251D3B09883EFCF8EDA7386BBE03A5DA3B5F2FEDE4EC516FDCD92F | |
6548 | 12D72BF6C7E690AE3FFCD13C587D2A48574653F562526B0ADCA0B701BE848951 | |
6549 | 3A281BE4957189FC236B8CD68FD182FDE918E5C7FE2EFE91C4E6573BD9D0F0C6 | |
6550 | 2DDA5F477152DBF21676DEAB763F441C7984F7650920CE6EF3DC77D707F8E03F | |
6551 | 622F8E97AA3E7749D080FF7CC0FD1CC561B84714BB4BEFF4628DDC90711AA7DD | |
6552 | 6EDA62DF8F73B9829904E802D8E0D60AF8F06A0DAB973B4C6A89020D3030B61A | |
6553 | D8C92ED9D14E29AA92C5305FC4687061998CF71056FE50AEA39BB265E6DF72F5 | |
6554 | F6EF4287D4DB779617F1CFFB3AB1E9D9DF73512C86CF2A82354749586EC9F273 | |
6555 | 8CD928A02590A5C51CFB2FBD5F5CF25488800090376519E4A5CF5F0D1FC98BDB | |
6556 | 101ED47F36A3678FBE57A31C09FBDBE605F0E9CBCD3254D415061AB3B9E668C2 | |
6557 | 4CF41E833517AC0A07C3A0AD412E608CB5F0996D27E7341A2C637931B1BFD660 | |
6558 | 1C330898C707F7323B1A47A6E6794AA94EF07C99D9BCD106108EEB903549140F | |
6559 | 31D5E0DE52FA3FCDE78C9DB6F202940E69F86DA4AFFC8974D669A8802E6D5C49 | |
6560 | D60E640E5433F7474BD623580D24432927E6919E575FEC9FD044398D6174DA64 | |
6561 | 7E6B7B042777003E55C4DF4981DC0A45B3AC04B1512380CE39B97544D3420C4C | |
6562 | B926016CDC82F5CD160FE7106DB362DDACEDAECEBD20464513AFA156038414C7 | |
6563 | DAECA2AE5D517DC2BE95B0E4707E0B191B3730EFB539CC0D3B80E1CC7B6ADCC9 | |
6564 | 1F142222BE572124CFAA7246975BD131748A110B0362874FB61D91EA94A4E330 | |
6565 | B88C30A9CC1F7EA5AEAA12018A02EC5681D000A889B19641609A6E712116B7D2 | |
6566 | C7A04AA207CFE9A619290044CC4BDB7979502B5E7182D742DB646A923973EC3D | |
6567 | 04382E589C9FDB590D5B25A1D414060802E1251E1F0DBED3B2674DE3FEB7ED96 | |
6568 | 50AC23B0E3D9E44F2904B064D06A002AB11A44813BBE243F907681F6A5B7E4B4 | |
6569 | 2BBB1D15AA391977FC0D644B9E4EDDEA1F6593F9D6D64F30F1F8DD238E762E53 | |
6570 | CC5B588DA5014CFDF4E281A34CC875656BF31B1ABE80617C269D3C32EDC40CA8 | |
6571 | E354DD255A369C4DF775C35EC9FFA8941D71FA984261AC1BE8C09C5B656658CC | |
6572 | CC2AD41D7CCE283A5530AE8DD2B8D03BCBB3B6B3696FD601C563289526310DBA | |
6573 | FFA90463815A687ECF1D69F69F7B449AEDA02A15E1A9227B0FEBC29F6E16866E | |
6574 | 9E0FF502CB87D973ACC8D1BD08B5B76798CAB1A5D8A17DA7CC244EF085F080AC | |
6575 | 96CB5CF0F0B2DCE2A1DB769A8777C971A7A4550C759071440654E195A7DC4044 | |
6576 | F60BD207C81295CA20A54903E0E2EBA0726C82DE70F2880A52198CFF2AECC6FF | |
6577 | 0DC562A031D56847F6B8E3FEDBEC86862162F3E982169743CBA32DCEF2DFEA24 | |
6578 | D548A862DACE88B14677B0657420CF60E9E186B35AF3863BE4A9E5455BDAE62D | |
6579 | D39E6C7DE4B3E079BEB082842A1486DB5F8E759204926F146037DA7A77CE50B6 | |
6580 | 8C29BC9B5299739FE52778D232B44833033A7DFB300429DD002E14F37EF31D08 | |
6581 | 069B7D94E70BD31F90495D237B4F175540B12675874396FC75F9D005497F0424 | |
6582 | F68BED0F8CE28AFCCCDE87BF0D0F5301DADCF69980812F989CA9A7642FC5D50E | |
6583 | 0632D79277781F3CD9E014E9DA160B2A56CA7EB621EE3D89018774B34E943F8E | |
6584 | EAC217CB05EB834B562B03CCEE6E457C681692C54339506BC7447B943D151012 | |
6585 | 93F026765C80712D5398D3EC320BD4864BBA9C4F7242FD066CEBA54390D119BA | |
6586 | C3A15E45CF70E4999BCD0BA14FBA7C6480DA52D9900CC36DDE18693DD1FDDCC7 | |
6587 | FB5BCB5328E5304C0B3189166A2D7F3F3EFA16A4D8C8EAA30CDA83EC1BA519CD | |
6588 | C6CDF954A680DC9487D5397201A20B1530AC427F0DD32A17B8823428E4D1AD8C | |
6589 | 8C512FF0F9576EBB8639852BF36E043E302D19A3B559F5F43D4077AC0F9CCDC4 | |
6590 | 1A0B6BF5A5F657CB0378772D7476027E060D592492534DA6CFDC84639FDCF136 | |
6591 | 036EAB94BBF6AE2A3302A6640EB48A537B579532A557C69240B5BE6DCB609E65 | |
6592 | B248336A2F7A326E85B9651659AD493245223EA204DC2ABBF33007DFA9307E34 | |
6593 | 90F924B657395F3622C5449CB9965988E90A9B840FBC2F8B74BB2151B50467FB | |
6594 | 0478F1423A776F79DF8AC78E999B1D6081A9B83F714ADABB5C548CD2AF4E9EF5 | |
6595 | A631BD50FC51817AED8EBC6BF7A46767E562BA211561347D89308D28FBC7C04C | |
6596 | 61A1324C22E2352DF95EAABCE7EC3ADF40B863589557962D4330F443D0A14F5C | |
6597 | F3DE678CC2C45E6582F47F4EB36EBB12A73B395149CCDBD9A92E3E7A9EFAC658 | |
6598 | 13AF608A3BF637A36A7318A342FCC9804352E361AF67436E7B4E6361FEB8656E | |
6599 | 6FC5328E38D8C855BB6994E602481654E5372BEBBCBF48C63F6CFACC9F3D4FD3 | |
6600 | 95B963ABCCD595D90C427ABE71671BC690DB170494938B4A9B8C0B329C4B0F65 | |
6601 | 28B3BBB68584C7CEC9975566FFBF29EA166441185340639DD0FB38BA355A969B | |
6602 | 1460753D46ADC2B94315E08A56E5023BA5473DA1933EAF6CF46C1C6413966EB6 | |
6603 | 246A6F259FB72738C4DF24F91061764EDCCB4B1834F6EEB9BD80AB12CCBB6BAE | |
6604 | 3E9715FC068386456612014DC8457AC3EA92D3140C7E9901856FBF9406F5FEEC | |
6605 | C4814CB0CEB13A44908644A5B6D69DDCACE742080D4A41A70D93705433D8B1D7 | |
6606 | 51C782D483FE38BD619D1E0E863BD24AF8D1ED22CCFD1DDC63E481DD1D525BD3 | |
6607 | A69323974D440E4C676A8480ADA8BEDB2F8D7B82DF7E8CF71E9BFB6594A59055 | |
6608 | A50BF0B479C6D1E62E1C25E9BF89C898F815558AA20DB908210E6156A3C0C98C | |
6609 | DB0215DC67BEE211C018E82F504DA56DC959DE82E9467C9889CFC353D379E8D3 | |
6610 | 08B40C015840E9EA9F9B11AEB3B1690F7B51E00181EAFC769C32A0EB57EDB2CB | |
6611 | B8304C16B1E391D9C83496A99F765A2F593AE9E60170F93E68D99414A71B2298 | |
6612 | F869CC5617669A5842F10170D8C73BE732CFCE2A2803B1ED4CC582817356A304 | |
6613 | 2E80D38F53DB04091D403F76E9648FE51BD4CD3728FE0E27C563DDBA778D2B57 | |
6614 | 8B9082ED2A2EA10C0A9EC44DC8695E1B930F408604FC497BB411F34718535925 | |
6615 | A8C763ABD12D21129E018416D6A7F3B85010642706F63E9109CA68AC84FF543F | |
6616 | 5CE4ACEA6680A279A54A7E0A83F28B661684AB955DDFBCF3483D2255986F8CC5 | |
6617 | 2141404DA424CE7C0F45AC2938AD5A9908B18259FD2C7865B242C3A6427DFC53 | |
6618 | B2AB4291DDA1CD7484AADAEEBEAEE1F6D9AFD997644C576E703F9588338E7DC3 | |
6619 | 3E8BF6265048FD288DABEB790875CB83D7102EE1EF1ADEBD252146F5F1C34CA9 | |
6620 | 270577C4D71EE41705F6A2F76A17463C8E553BF1E09C06CE00A600B907F36611 | |
6621 | 464B9D2974D1C9C8BCB589AC5BB056FA8502E4CDB65B7FD34F5FDC2108915465 | |
6622 | E92B246505C67119DFB1E0A251ED432409F6674195B591E704B029E40E2AA827 | |
6623 | 8D8C6A1E2E6E8A0FFEBEFB75896E0943E394F90F03A0DF61ED23E57A24E0C2D2 | |
6624 | 79F9977AAA33E6AA211B48720A1D0AD4789608A29ED895DAA0D4A2428654EFFD | |
6625 | F5EA4087E6F727DE7C5EA25C15FA2A6A967FD0A240E890997D78AF8466EEB7DF | |
6626 | 8D8BE4552E1996C4684BCE3E853E1C541C7D9C2333ED357D179E4E92A44518B1 | |
6627 | 06D92F646AE65F7A27F746EC366EF4921D088CC6CDFD723838AE89648D6B6EAF | |
6628 | 824C08B6AFC9D8439DAA5CCC862FFA61AC4B0EEFB2453C972B1A64FE31C071FA | |
6629 | A2DCF66B9CEED757FE42B9DCAE3302F807F7CB2C779F7441EC5F11C776036719 | |
6630 | 427F1799BEF7CDFAB114B7C30F27C43CE3D71A71C7BA87C4FC34B711FFCCF892 | |
6631 | 23450E5CB964642AE0E4638FF80A913FB7BEDF489DA43E315E8CB8506A4AE884 | |
6632 | BC0832A6B83CB4B390519DA862769AEEF454D3C4CAC6CD3899238A044718FEBB | |
6633 | 59F5D7C79EE547269AAEF1ADB1DB7A97E5A01435D957413FF0FB229527025DFB | |
6634 | E1BC87C4198E5EFCFEFA3ACB877B1370D222C1CC30D0AA411440B6A59D545D53 | |
6635 | 7D72D4D98337E08107FE636E3F25932D57108A8E3BA3F72006744D1B2E33EE8B | |
6636 | CABD44AEEA44A3307ABF8AC6B68F8D83CD6EDA68951673D6984DC6E2FE260C16 | |
6637 | A8673467A85E727DF7D5F2E5909BD2D22D272F87C945B0E93B4EC1A759393A9B | |
6638 | 75F7C462B34542FA02DF5548CAB66E75B88A834354AB7439DDE480C6068A214F | |
6639 | D3748CE5C2B2F1693DE0EA5162771F7FBD17F5A1A7467667CAAAD0610F38CADD | |
6640 | 89102E1351F7B5DB870DD9A3CEA56863C249263A102E649FD16FD827BD60BD19 | |
6641 | E680DAB90D235E5BF75D5315B2BE376EA7C1FC97D709FA12CCD937CDAC17845D | |
6642 | C373FDDBB0533C37169A34CF072F187E5661FE60DB1285920E3AD01EE806C874 | |
6643 | 48BF676D73DCE4A919E3BD19B6A6DF8C4A23BA65A599774CF0E45F2F20410EAD | |
6644 | 5A9E43CE85B335F953A0879CC8327B903C0F24CBDF65AE01836745EC4946749C | |
6645 | DC9810CEC0A4868C3356DE8D6447547785EEBD102E069C2DB83EB107696C8EAA | |
6646 | EB71EDB076E924F27351293F26EEE77DE1ED19EEF02EFF9DC8AD8827BFD0E10F | |
6647 | E3301ED3500E006F4898D0FA373F902A40DEAFD33850059A0EDBCC4FB23B7BFA | |
6648 | 5087714FF84D9D987933D86D6533C0784BC72A32DE5E26A4CAEAC39715A19360 | |
6649 | 79DAAFB08C7097553749CC993001EF6C17100AEDAF505DB97CE45372632F5CEC | |
6650 | A48C77B21F9E50E81EDE28E19D604ED0D7398D9621B7428F729FFA20F9DA8847 | |
6651 | F83FE50721CCF7260F38E1DF313C9D545D237A28C15934B1018C513F0AE93D72 | |
6652 | F0F22E8F2385686BCE5435122C3EB067F4AA14FDCFB812E7DEB5BA9ADECFBC44 | |
6653 | BA562AAF8AAAC463FC0B2E04A4BA98460A16C49B8AF7B9D624012D432E29FE9C | |
6654 | 44836E970CCD5900BA3C2E7A9F4FA98E4AC8DCDD503162CEF4C0CF1598EF607B | |
6655 | E11D60FA839D420207FF3B46E1F432A69C99722BD77535A5A1827C0370BFDB83 | |
6656 | 5EA905F8EBD42B427A38FAA2CF4E819C9FD74BF27F548875248AB6D00D2E29FC | |
6657 | 6060F2F151C48B758F2C85C1EBF5868A18A1B747D324F7DB49855024F213092E | |
6658 | FF0BA46976813383A25196A4BF30EB1D2214362C75603407488823D2869ED813 | |
6659 | 2D84E759F25F9BAB59629C2AB691076AA9BE254A27B49652B05E9AF71865E5E7 | |
6660 | BC324DDD2A1400F4B2888620E60EB08A9EFABB287CA0E52575A364CB0F22380F | |
6661 | E27FC8A0DD537BC0959413A2657AE6FE12936A61EA31ACA64F08523AD9B21514 | |
6662 | 0F352F2EF3DDC159795F83E9E12870C13D1D9B98D3E152CED06D3BBEF27B9531 | |
6663 | 000CE08D0B280C2C37C8D295557F1BA92C8233259A007E1F0FA0D54762E7A6C4 | |
6664 | 28AA751CB4E4D6AB5466D8A04E4AE9F64A3781B730A0BCC6108C9D5198810D35 | |
6665 | CC353F1E76DD3C78D33772F3B3245716DC623F4177418224AC4A5F3E2CA59D03 | |
6666 | 95BD0C240231093AB97FD553194ED4B63856045E23D72F67BB6D6A4D6CBC0FA6 | |
6667 | B62BBDF0AABB66C36DACD73A99801E813C6F3BBEE1AFA053BFC3530F2699D2CD | |
6668 | 31F66636514A088710DD1DB370BEAFC47470A122381AB4F374BBFBD2AB39A953 | |
6669 | DD0FC82DEDEA60A99C9EB07EC0F702547C9ADF01164D5B22D6A41059984F347F | |
6670 | CAFE7146B3626AC97EC8AFB2614D085CD5FEDDA92EC73D7EC86FC0DD5BC9E912 | |
6671 | D68AFBC4DD321E00B6954F14D5CD9D6580C8DDDDB34ECC92B16BE8953B035AEF | |
6672 | 0523D929EF5A086E7064E1117DD2AE2CFC346889116731CF431A2E22C6FE34B7 | |
6673 | 6B7535EBAD4AE760956837944EAAF4F001120CB784D249E6CACCE4E0E0FFD8F0 | |
6674 | 330C57C7A6E27545825F36189476B887BD56A72802D8947A42323C36114FBD24 | |
6675 | B47F11B3B0F7C5498463F54EA557574F1A8EAAD4D47964B9B244D75FEF37327E | |
6676 | 6096D66FCA9E617E441978D58AD792A93E3C37FDB5FDE506AFE0BC0588FDDEA1 | |
6677 | 2E64D54283E22364267A5B499EB52F623FFA9CB11DE74FC33715AF2ACFE57C25 | |
6678 | A621B07E7D39E56F4ED2AC442C1B85B412DFA95C574BBDE5111A09F2F70F46CD | |
6679 | FF84965EE534CC63034A2E579FA7928906DD2E64560CA3405B7B5247ACE33391 | |
6680 | F24669DB56F6BD022BBFA47934547003902ED8344277AE5761DBF7604D69C02A | |
6681 | 33A7F20EE06494669AAE3403BDAB6E4C4373DD56DF66F9700A06FA86B030F3F1 | |
6682 | 3B8210C9948A6EEF8400C952C4A81159316390109680E5C9C22595D8E6FA6717 | |
6683 | B0D6803E850AA03F2E854F0A39F819B64357D53B3FA73AE0981ABFEE4352353B | |
6684 | E5A31D3C3672F07FC2AB8FCA25E5B047F2AEABA8A658ECE9E35579E4214A9834 | |
6685 | C6EEA901E3A72FB1521D22FF6F117C6E80396CF1FAB02A8597F2407BF6CAE3BA | |
6686 | 976537E118C6E84C69C76889DEEAFAD6D658CD83381C8CAF989C52BFC59334DC | |
6687 | 7ED97D2741940291B677BB4AB0F02D45CD63379DA8F02F35658F13AF64F9D6AA | |
6688 | A42A77A6D2A1653BB1A0FBB7A52249D8133440827678AC81A66FC3DAB5A55F25 | |
6689 | B821E7B5153C6FACED54C203E5FA9F6DFDDFAF54C9C870B719EB0EA4C1131C98 | |
6690 | 5DE4047C1862E71FCAD3E4FD982FAC9CC900FC22F6770712FF82BD27683CC442 | |
6691 | 9B684AAB15FB663A04001D434E26690056EC7EE8EF3D3E4AF36DFDACEBF21B2D | |
6692 | 681A134805B6D34D639782170DAFEBF22C888757E4BBAED1F72F2AEA9ED6CFF2 | |
6693 | C477430514D06ACD1E2AB0BF1EB27EA4DEE773DD77D140F02D2F4D5DB55B07D8 | |
6694 | 23AEDB701A2885BD8AC950E8DD285172BBC6CC90A000EE8D5FB6C4D2693C70C3 | |
6695 | B90F94B7F806D4584935D69257CA0CB3F72BCFF88087865C9326F94BD3FAB401 | |
6696 | 6C89D92242195DBE02F2437F6A96170F1D0C28623D6921EC424B6222838D18FA | |
6697 | E07B02189A3A79B317770FF5ABAA3D8EC721A5AF14B5276651930AED5B20CACC | |
6698 | 34128430F8D6AE1BB7A52DCC22A9796792C926528C0DAC4FD652906A43D695B8 | |
6699 | 267B1E89FC1B96628CD003FC2A3E8890E68655532146DC927D36C60E98E956C7 | |
6700 | F86DC4B803247084EF8014C3711867EB692B06F90E1B099501F4CD9AE0EEE694 | |
6701 | 5A2B34E927E5239DEA54A8E9BD542DA437CD7928C67AFB661A72B9A2914416FB | |
6702 | 6441889C6316F0D4045E09419F5D507152644126C4B614013B868D9F7631EB98 | |
6703 | 46A5979176C2E3F9F6463BE83908141553E90F523420FDA7ED53F711C27A4517 | |
6704 | 1052685F33B23C9A3D34288073B7FE4AC7796A0C3D7669531B4A4CD47C8BA1BC | |
6705 | 9179E425B3C5C004A93ADE699B521F798B9AAE48753028A9F95F68ABB41792E8 | |
6706 | D067F9819247E7D81AFA10D72D0A7B3EFB3C202DE67ADEF30EFF42B4FA14DFE8 | |
6707 | 573AFA45CF40E34AEE040ED718C7A37604E898F79184D346AFA0299ACE9BE973 | |
6708 | 90B606F0B88DB4336292577439829D202B8BC881559868C2D32DACB708DC7EEC | |
6709 | 59632D3E618D37B284780AF2666CC81BADB341C10C9745A1437015AA91AF676E | |
6710 | 36741DEA9046B9EE93C70CDE6E5BE30C1574E295A592B03B951137A5443F980D | |
6711 | C36ED9B52125EB8A71078F51FC10BB49CFB048A54824A6911D945641933857D0 | |
6712 | A9DC80654384B562FA3F5AB575ACFFBC53B493A0FB579DC9DE1231A49FDF4375 | |
6713 | 865FAB1BA20E74E4B314211692DD359441E47068397D57E608871CA05FB89BCF | |
6714 | E0D46BB5F84BF354BE90BDDE0ED7C565B84C32CF953F2BE1136D9C651891A894 | |
6715 | FC786EC9FACBB8E3F0ABFFE37463BEB48D313D59BAB7210BA2B6CFAE1B2A8BE1 | |
6716 | ED6B45CC9E251C4E8003E5F562EC048B69CF13A634680A2C67550CC94CEF59A1 | |
6717 | F217EE7665184E18D63DC0C91F5C606AD52F2987D379088B39E217C33CA14538 | |
6718 | DF3FF835551D339BF2B836957217D3ABB4DC57BDCEBBCCE14B70DAB6821FAF0E | |
6719 | FE68781DAB924B6966569A4FE5134ED14A74F72FCCEC988EEC4868DCD443A503 | |
6720 | 0974EAE6F07E8311C1979A3B2B586188EB5BBABE38017D31FE9685EA852AD59D | |
6721 | 8CD75108CDD566599D06B611AEDE7C492B3E82186980527C9281DE79D7449BB9 | |
6722 | 660A8353E924B4DB1B9F6166553F436409A93BD5C603021AC613D5C470EFB743 | |
6723 | A6ABA267B872D32B531399BF9ECB63364379CFC3D1804CA7BFDDC19D8AB9560C | |
6724 | 66B7D20F94E6AB76722D02E681D3E4561DEE24E21977A4C76967FD8D6499B435 | |
6725 | 18BC23E58ABAEB635A8683C4D13551CCFE2B2179661992E3AE95EED9F0470693 | |
6726 | D09152B40DFBBB0298A9429F8B2300676D0353522265ECF91369F3A9888A26 | |
c302751c CR |
6727 | 0000000000000000000000000000000000000000000000000000000000000000 |
6728 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6729 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6730 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6731 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6732 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6733 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6734 | 0000000000000000000000000000000000000000000000000000000000000000 | |
6735 | cleartomark | |
45c0f7f8 | 6736 | {restore}if |
c302751c CR |
6737 | %%EndFont |
6738 | %%BeginFont: CMTT10 | |
45c0f7f8 CR |
6739 | %!PS-AdobeFont-1.0: CMTT10 003.002 |
6740 | %%Title: CMTT10 | |
6741 | %Version: 003.002 | |
6742 | %%CreationDate: Mon Jul 13 16:17:00 2009 | |
6743 | %%Creator: David M. Jones | |
6744 | %Copyright: Copyright (c) 1997, 2009 American Mathematical Society | |
6745 | %Copyright: (<http://www.ams.org>), with Reserved Font Name CMTT10. | |
6746 | % This Font Software is licensed under the SIL Open Font License, Version 1.1. | |
6747 | % This license is in the accompanying file OFL.txt, and is also | |
6748 | % available with a FAQ at: http://scripts.sil.org/OFL. | |
6749 | %%EndComments | |
6750 | FontDirectory/CMTT10 known{/CMTT10 findfont dup/UniqueID known{dup | |
6751 | /UniqueID get 5000832 eq exch/FontType get 1 eq and}{pop false}ifelse | |
6752 | {save true}{false}ifelse}{false}ifelse | |
c302751c | 6753 | 11 dict begin |
45c0f7f8 CR |
6754 | /FontType 1 def |
6755 | /FontMatrix [0.001 0 0 0.001 0 0 ]readonly def | |
6756 | /FontName /CMTT10 def | |
6757 | /FontBBox {-4 -233 537 696 }readonly def | |
45c0f7f8 CR |
6758 | /PaintType 0 def |
6759 | /FontInfo 9 dict dup begin | |
6760 | /version (003.002) readonly def | |
6761 | /Notice (Copyright \050c\051 1997, 2009 American Mathematical Society \050<http://www.ams.org>\051, with Reserved Font Name CMTT10.) readonly def | |
c302751c CR |
6762 | /FullName (CMTT10) readonly def |
6763 | /FamilyName (Computer Modern) readonly def | |
6764 | /Weight (Medium) readonly def | |
6765 | /ItalicAngle 0 def | |
6766 | /isFixedPitch true def | |
45c0f7f8 CR |
6767 | /UnderlinePosition -100 def |
6768 | /UnderlineThickness 50 def | |
c302751c | 6769 | end readonly def |
c302751c CR |
6770 | /Encoding 256 array |
6771 | 0 1 255 {1 index exch /.notdef put} for | |
6772 | dup 33 /exclam put | |
6773 | dup 34 /quotedbl put | |
6774 | dup 35 /numbersign put | |
6775 | dup 36 /dollar put | |
6776 | dup 37 /percent put | |
6777 | dup 38 /ampersand put | |
6778 | dup 39 /quoteright put | |
6779 | dup 40 /parenleft put | |
6780 | dup 41 /parenright put | |
6781 | dup 42 /asterisk put | |
6782 | dup 43 /plus put | |
6783 | dup 44 /comma put | |
6784 | dup 45 /hyphen put | |
6785 | dup 46 /period put | |
6786 | dup 47 /slash put | |
6787 | dup 48 /zero put | |
6788 | dup 49 /one put | |
6789 | dup 50 /two put | |
6790 | dup 51 /three put | |
6791 | dup 52 /four put | |
6792 | dup 53 /five put | |
6793 | dup 54 /six put | |
6794 | dup 55 /seven put | |
6795 | dup 56 /eight put | |
6796 | dup 57 /nine put | |
6797 | dup 58 /colon put | |
6798 | dup 59 /semicolon put | |
6799 | dup 60 /less put | |
6800 | dup 61 /equal put | |
6801 | dup 62 /greater put | |
6802 | dup 63 /question put | |
6803 | dup 64 /at put | |
6804 | dup 65 /A put | |
6805 | dup 66 /B put | |
6806 | dup 67 /C put | |
6807 | dup 68 /D put | |
6808 | dup 69 /E put | |
6809 | dup 70 /F put | |
6810 | dup 71 /G put | |
6811 | dup 72 /H put | |
6812 | dup 73 /I put | |
6813 | dup 75 /K put | |
6814 | dup 76 /L put | |
6815 | dup 77 /M put | |
6816 | dup 78 /N put | |
6817 | dup 79 /O put | |
6818 | dup 80 /P put | |
6819 | dup 81 /Q put | |
6820 | dup 82 /R put | |
6821 | dup 83 /S put | |
6822 | dup 84 /T put | |
6823 | dup 85 /U put | |
6824 | dup 86 /V put | |
6825 | dup 87 /W put | |
6826 | dup 88 /X put | |
6827 | dup 89 /Y put | |
6828 | dup 90 /Z put | |
6829 | dup 91 /bracketleft put | |
6830 | dup 92 /backslash put | |
6831 | dup 93 /bracketright put | |
6832 | dup 94 /asciicircum put | |
6833 | dup 95 /underscore put | |
6834 | dup 96 /quoteleft put | |
6835 | dup 97 /a put | |
6836 | dup 98 /b put | |
6837 | dup 99 /c put | |
6838 | dup 100 /d put | |
6839 | dup 101 /e put | |
6840 | dup 102 /f put | |
6841 | dup 103 /g put | |
6842 | dup 104 /h put | |
6843 | dup 105 /i put | |
6844 | dup 106 /j put | |
6845 | dup 107 /k put | |
6846 | dup 108 /l put | |
6847 | dup 109 /m put | |
6848 | dup 110 /n put | |
6849 | dup 111 /o put | |
6850 | dup 112 /p put | |
6851 | dup 113 /q put | |
6852 | dup 114 /r put | |
6853 | dup 115 /s put | |
6854 | dup 116 /t put | |
6855 | dup 117 /u put | |
6856 | dup 118 /v put | |
6857 | dup 119 /w put | |
6858 | dup 120 /x put | |
6859 | dup 121 /y put | |
6860 | dup 122 /z put | |
6861 | dup 123 /braceleft put | |
6862 | dup 124 /bar put | |
6863 | dup 125 /braceright put | |
6864 | dup 126 /asciitilde put | |
6865 | readonly def | |
c302751c CR |
6866 | currentdict end |
6867 | currentfile eexec | |
45c0f7f8 CR |
6868 | D9D66F633B846AB284BCF8B0411B772DE5CE3DD325E55798292D7BD972BD75FA |
6869 | 0E079529AF9C82DF72F64195C9C210DCE34528F540DA1FFD7BEBB9B40787BA93 | |
6870 | 51BBFB7CFC5F9152D1E5BB0AD8D016C6CFA4EB41B3C51D091C2D5440E67CFD71 | |
6871 | 7C56816B03B901BF4A25A07175380E50A213F877C44778B3C5AADBCC86D6E551 | |
6872 | E6AF364B0BFCAAD22D8D558C5C81A7D425A1629DD5182206742D1D082A12F078 | |
6873 | 0FD4F5F6D3129FCFFF1F4A912B0A7DEC8D33A57B5AE0328EF9D57ADDAC543273 | |
6874 | C01924195A181D03F5054A93B71E5065F8D92FE23794DDF2E5ECEBA191DB82B3 | |
6875 | 7A69521B0C4D40495B5D9CE7A3AF33D17EE69979B82B715BAD8A5904C5DE0260 | |
6876 | 6C15950CCF6E188A0CDF841EB68E5A2F88253E382140F87C87E55C9EA93B8C89 | |
6877 | 14A36CDF630D6BE7CD36DBDCE22B21778E8648B97B7EC6742EB5114BDF0454B0 | |
6878 | 0EA7B1FE236C84C0E5308C871F67B973892890557AA12E00B2C20C71F516C397 | |
6879 | 3F3BBD14A1D0149CA064391056E45E9470FC7F6F556ABC82653B3C8049AB5CF4 | |
6880 | BA83C8F2158C236B2FFD4208846013BAF4165E8BB8D334C8FF2E8D74AF5DAB2F | |
6881 | D44788869B08399421AAA900ECC6A2D594641C121660D4B5F512938994C18DD0 | |
6882 | FCD9B008F68F0351D21ED735B2740CB1E0C1CCD25EB548C35B844601D98828DB | |
6883 | 556F71D07E081A593FF12DAF83676492A0FFE16E95717A07082B43A966C1EE8F | |
6884 | 8A59E1255E1705C43A23CF29A5E4A6547C93F1680A870EE7BAD8CF74D838CD5E | |
6885 | F806911D8FE4262ED8E7F5BC58B92C9C6D74F8AD45FBB021EC7E97393018B9DB | |
6886 | B1B84E7B243ADB05ADD3F1DB3692ADC5D47FEC7DF93080669E63281F1576B673 | |
6887 | 125EDF08016664BE73364F65389F7C3B66623AD1754ECBEF9E5CE6948D933787 | |
6888 | A5674279ACB2EBECD3B4E6361419AB32028A27670C9F3E18B746A10B00AF6D77 | |
6889 | 4EC00E3BE521C02A99AE5BAA98F793EB1228952BE67934B91472E01AF7B816BC | |
6890 | 56D7F19F631A1927846D800C107B1E9CBFF9D2DD513B4A8CE2E0DFD77B1ED178 | |
6891 | E43FA7052765E9FAF89989D490D8FEF6C536EC0D4AE27A74F474B98DA9E6B92F | |
6892 | 15E063DB260571979A5DE2423920CE1F59F56EB11E00E3BB9D466A8263E1E385 | |
6893 | 2014BEFDA8D1EA3EDA04BE32AEE6CD15C5C010A1DF7F705A2C0C18E87C8DCCE9 | |
6894 | 05D9163181CBA56C0FAC8C06A2990554C8E759D076B01BBEADE3B5FB8B551390 | |
6895 | 6C8E4A2A1C6E7D9C708614626F3770C0AB7DD2027469C77975C27576065862AD | |
6896 | 04E5E50CEBE907E3E991FA0C627302C0E207B4D5992BEBAB5853AD1C0D271728 | |
6897 | C76F40A79392ACCA7358F948AC65DC823CFDA59E1FF69CEBB6B7EC3CF21669E4 | |
6898 | 70D999508F9C49E2D9F8818CA53C977D93E15FBBBAF75B1E84F0BA62BCC4BAFA | |
6899 | 4EEC82D804C8A8C0210F3E5E258BB1F6921AF02BA9861BAD5C3D5FC8CEFABA8A | |
6900 | A607E547B802096F7AEB09FBA99C83C9A494B94408DD607CA6561A6E6660C473 | |
6901 | 62CF8D35F31D052F6C6C8138A8E1430CBA7EA6973D6D510C1A06B3FBD79D9364 | |
6902 | 240C1A00272DA44B89A9FE8D5BF36DC1B5EBB4A78ADBE9C5EDB485F093D9517D | |
6903 | 69E1AC9A8E6C9D7C324E3797CFEAD9A18E82E03F69B2CED7D5DDCD1A218BF2E2 | |
6904 | ED2293AE999FE2A4B5213A10083EE0407BCF8007670B8C737EAB30311C868D84 | |
6905 | 121149ACB4A27F3ED6C0C181C98AAAF51B105F264B5672D7F745131ABAB5BEA4 | |
6906 | 0C9B43C0DD9116D6DC61F90BE72018F290D26D5E9D341055CAF09C9F45333CDB | |
6907 | D45B7954271767F638EEC499F7B53C2CC5774EA7A7F024C4CABFB93D9CB1856A | |
6908 | 0C671A4ECA7C62EA5242648A84E7F3AFB9547A0AFC29593CFCE6D8B873A78157 | |
6909 | D337CABD291431C0A2CE1F37E0CD7340567AC206FF98E4B5A6410F70F750451C | |
6910 | 550EFB54AA259A1B236CA9CB730D2CEF125EC65D959441F7CC9768F777B44844 | |
6911 | CC9842A307C72B740680ACBBF6AA35FA7A94825069BF7696ED81A371A9E5475A | |
6912 | 9D997F2DFAD339AADF797F7E03E654234455AC3D17702A420EE0A597BA31BDE4 | |
6913 | FEB8DBA7C61D311CC90441A620164DC22DC2D373973EF84CC553453AB1B3337F | |
6914 | 7B39983B8DFFB3A9425F119B45C1CD37A76F905777B3154CA6200792F1759D06 | |
6915 | E017890F4041A385F2238E3C48B6C8EE6F5258463FDBFF7AC762F6C4363926D6 | |
6916 | 50F004D473B7B7F73CA686B559C2885F1AA761653C727A77D73431E9D110E76A | |
6917 | 2E55C68CD50F43997C9B2FC4710F8C8540909829E215678E63BB8363C4B8AF05 | |
6918 | 9986102BB36580D9CA95CD216B7C321822CB41B2E0422CD077F3B55E0246FDB2 | |
6919 | 44D5976F67296B5B0BE4B06F6E43535C21164E6C5089C3E9BA2D6B30888C57DE | |
6920 | 49DC8D9D46C0D5EDC47ACF2C03B72DE3B69512508539019B759280BABEA12BC9 | |
6921 | 385308A0395C4CD33182A10A5A229743379C2075D82D8BFCE4A66E1AA087A091 | |
6922 | 8F5372684FA5037D1B92D50CD9CB4F50AD4F8EE7D51F1C9E63C721CB5B9BD011 | |
6923 | 6F0A8DD4FDCD2B008F223A1036D90F0F3B252487DE7898F9AFBB3A9D9CD49E0C | |
6924 | EF4ADAD5155A98D2125ED5A3D3907F67301649519419F33CD942E8DDEAC1BDA0 | |
6925 | E90C431B198F646766A8FA9F8D1561B57E126EF604838C0C1966655CF31FB7EB | |
6926 | C8CCC434FC1C96046D38203E1791EC824A3D7AED85C029288D4608CA7668A2BE | |
6927 | 484C99639F121845B22EEFCE0A3B808261921AA042AE19E641769E91277BEC29 | |
6928 | 4594082CCB3058F90FAC4A700A8A827ACA00FCF574ABC8EB7DBCECD97F2B22C0 | |
6929 | 0AA19E8739B81AF8C6F621D69B8E6F29BAE233FBA655A0AF5BDFD7F5C6B9167C | |
6930 | 6BC7AB693D45EF2AD999F5DA3CEFA39BA48A17EE6D9F2C4DAB91AE3F0044DC3F | |
6931 | 5D5506CE4675AA928B0092D6F173644F91295216D8BBB14CDDE0AD524A4D545C | |
6932 | 1B5E284A3BF0396664081CFB4F186A84A0D24D61E82F4767C1E55A0642720CF3 | |
6933 | 909FA1AB8EAB78030B59BEA067DEDBD2F1D0340E790AB2777DB18248521934A8 | |
6934 | BB38A58B7F633DEA4291B0D5D13E9A882C974697CC6D3B49E030C94EA29B5506 | |
6935 | CC29C44D01B4751B453A46A9F6BF3BF135AE87A4CE232AF57B66578310DE41E0 | |
6936 | 2A6AC422117F1963C4D7CC306BD25A6E724E51921779F22F029733122E23E2F0 | |
6937 | CB340008813ABB104380C80A492B3FC6D0BB07CB8D8409E9576891EF6E5C9D08 | |
6938 | EB8320DFA31BAFFBD336D0C2BBC3D3B2D30368B9860768FC080D30569C7F7811 | |
6939 | 0EBEDA2962476113625EEB555490B8CE4C5F99D74ED10F738C61854CFF8B41C6 | |
6940 | 9402E56BE8856144A1A05D0B05F4CB7EF728B2F4F5A439F18C3B68CEFA41E59A | |
6941 | D8308ADC92EC1289DC84CF48D2CDEFF509A145BF945E1E00D552D329EBD2A7C4 | |
6942 | 21D58082CC8FA790E981F4AC8EAB99950678FD3A7DA3DF13778681B208DD71A0 | |
6943 | 7C3CBD0664B37C9EDC6B601D79A2C51FB54DAEE849F93209793849104E722D3F | |
6944 | 52DFAF7047EEEDDFE744787A5801E4AC2C3D58EC5DDC15FCEE03990C53B0C57A | |
6945 | FC54F125A04C8E4A0ADAA725808C587E7DAFB9F784FA2875689979D316DC22BD | |
6946 | AA36B306A1ABCF907B63C6476737B746099973CAEA8C1E2C5C41F27E0F7DE8D7 | |
6947 | F0D942E34E92F43FE902653D4D2EBB6F3B9F7928B1550A82AF234D45D028F429 | |
6948 | 067652BD3D391BF423AE72B9CB1E8D91E898161BE3A7849D456A861A2046711E | |
6949 | E934DC59442AE7D81661CE8EF727D8D7DDC0270E937E40F896AEAE6171661431 | |
6950 | C1025C53172F9D366834BA0054FBFD84503FBAE328B6FDEA180F8EA35B1DA937 | |
6951 | 5CC3B8F00C206908C2FFFFA6A7AC6915D15EA44BDCF29E2BFCFD4A849535F19B | |
6952 | 0D307C696BE8205C7D84B9C77F02EF27D911056EDBB4080E4D3ED72788666CAD | |
6953 | CD91B0ECE27A177DB23320A7FA9C31408B4D02D2A4B1CC6DDE1A6CAC3D8EC1EC | |
6954 | 2226EC98E51046D1EC26FA20EE62D24747D83CF4941DCE5CCEEC0DBE387149CD | |
6955 | E05B19FFCAFC0D117F9A3E60DCD4C815228D98EF95EB559AD0ACC0D50FFDF714 | |
6956 | 56C3C812EA5ADBB013BBD956A7C4CC0ED7D3E25D5C9AF5E626F18297F75D4957 | |
6957 | F5B0B33379114B903FE98BCF35C3FF76FEE1D9AEB711F2962276531F7380EE3F | |
6958 | E368720E0292A170A15C5539B1FC7BB954EE2624B504CB8C805B8D31AC38307F | |
6959 | 0513606F09211AE64DAC447693B2A0AD15E9A64C34F5A911ECD0ABCA90E9791D | |
6960 | 67C6BD202B0858EF96E7722305B8AC02B01AB1706CC6AE875A8DDD15EE349046 | |
6961 | EAA65005E7866B506EDFB7A5A2AFD5C9E9DCC821A79EE9C1EA2C7BBA32A40BC7 | |
6962 | CEC26DB1AC473C8C3960ACEC581B37D6569E8C8C42950BAB7930B65E1570E3F8 | |
6963 | 9A7FA719F1DCFDA45A3BF2AAB32C9A93BA3552608A61C623DE59BCB346E87EF5 | |
6964 | 9CF025A87803161221C5C1C6F6B3403712C76E9D755C7BD68D7F2DC03C14CDF0 | |
6965 | C1BBED1D648B905B4B17037B7263C1EA7A7F06FAAC4E09E08483A8D714C19861 | |
6966 | 327CD9C32DDF850302DD6DDE24912D00C22ECDF3CDFB18FA831A41A7488EC203 | |
6967 | F564CFE30D506F0829A96D35A7E09C3DCD107D589B627A15B55C5D6649126BEC | |
6968 | 60B88C55ECCBB4E680265D9EAB4CE22965D3B1AF759B01ACB0D0E6C92B6B4EFD | |
6969 | A81E6A648708979487FC591CF09631310D46891423F4EC159A73E30D8DD147A4 | |
6970 | B0EACF6D45D18CD16CEB8176F03ABCB41F2234747B9733C8FAF34AE5D43D3BA5 | |
6971 | 0CE0FACFC9B087F84FB6C68678BC6E76022B1526D6E5B3A48EC1A110BD75F45F | |
6972 | 1C4DC6D39F254976453F57DF873B7D635C80C42026DE020E5BAFE0DA0D54D1E1 | |
6973 | DC634D2621BA184347E5252F645A6A1DB7657C48124186F0E4C644077457C24D | |
6974 | 55753C651A9A7B6349867641464B515B821349C795A645420508673B93750D0C | |
6975 | 7A3B33EB1F09782033742AE8F3A23FC02284E6C03818FADD1731361542E3FA3E | |
6976 | 75B8D52B668C3E18A4AE967D0FC3157083D952AFB8144D549E69EAAC51C279C5 | |
6977 | E5D88A0D9D53013DFFB4352A1598FF84DCDE6FA32FC377306B9B92C0F96EE149 | |
6978 | 8CD55E7B2445B86CCA7A547FA732D52D59025129FD8C6333AC0DF4F0CFF6287E | |
6979 | F2036D5DBBB3B91B92F12FEBE0B61A313A4DB5A9CF0BB3DDB781A56FEBFFACCB | |
6980 | 8CB9D1D3DBDBC4CB6AAE6769E470582403CB920630221B68BCB625CD4605FA8F | |
6981 | D3D5B7A1A28D15E44B38E92E906C138E72C15B86F64C38E23BF0440052A8C914 | |
6982 | 54397F49DBED99D0AF7CEA3B0A05FF37C2D7EAE1412567E6776333237C31E3C0 | |
6983 | 49949EC8BFD6E0F6446CE2D4DCD2C1524A288818CC5D159BF8463A847AE4A2B9 | |
6984 | CC8C58F822804B81B13BF4F2DEB6229C4F51F093075581791D02C36A13B855A0 | |
6985 | 34900AA7CD4F1A797652656FE3A8425A38F421C4CC0ACA1CDD44FA6B31219276 | |
6986 | 1CDE1CD63D6A58CE705CB56CCA1260F9B86E989019071563A9B4C274A87558CA | |
6987 | 6EF1660D574EDA276801F0057740E2C3B80D253D697736484D892CE1AB128B8A | |
6988 | DECD69712F5E70E895FBAA927E8194D792A04AB6CE205E04E38A433BBB793FB4 | |
6989 | E8BBC4279D58A223C6673D909D6AFECD246E66A52F4CB35E5931D24C828489BD | |
6990 | 4ECAF621A220D8ECF702BEB01C4FC7510197D3F6D15321EC87175ADBA6434ECD | |
6991 | 2B5A306E91375CAD22CD94301763E4A8B981472890422C5488FCD523C9CB17DC | |
6992 | ED22FBF12D5F7525D0D6BCFE8CE85B0DFB1D6F989C267FFBA0A996D309E4A934 | |
6993 | 3DB54A9D29C88B9D55D7300DA3D46419256C5A07A2A529A8DE8BD1727281F5FE | |
6994 | 97033D861E0531B14E811378EC1AF1CC7EE9BA2B07D935843D3053F673979F8C | |
6995 | FAFD59D555B56CE338F606747238B22BD62C42BB7238FEA335678D474A643570 | |
6996 | A9E7B4970E8C541CE9DBC7BF70ED7BA33639D6744A18379455029E934C95E2EF | |
6997 | 639C4848CE9A0879B51649FAB023A71782444B451F92A34CB8A124270CCF86D4 | |
6998 | D18EEF5C1D2B2A29012613851C49F50702D63BACF95EE2AB4D72B375E0A62615 | |
6999 | E0991E130A67ECBA9E05329B740708F1CB148724C3A6E5E3AEC1F88EBCA398D2 | |
7000 | 1CA8827C977D72734310233176D1AE26C55CF2CEACA62223315C28FCF6305C7E | |
7001 | A22414D4739A059F552F1F9372CCCA5FED4F9AC987942848EB498900269511F3 | |
7002 | F408CBEA0659B954F5F1B18AE4FB270213646F9B28AE4439D2BA2D3E0AAAA780 | |
7003 | 5E530E4EFC8A060EB979E12191044509DA0C14397AFF949E12DC970658D5EAF5 | |
7004 | 4EA963F5BC1407A32F3837CA6A24B7F3D60EB8E6222B702E25ED903F9D21AE50 | |
7005 | 664A095009BDEAF4B78DAF94E5A55D48366CABF07791A1684B2F54EA69070844 | |
7006 | 4F031AF8DF416C2D3679F8BA038B0DC9DD0400CA6B34667BCBBC07E62C1668A8 | |
7007 | 35A8C57C9048A7227E672E89681B54D662079A189A9E96A3CA96D8DD10189B04 | |
7008 | 1DA49BA2729F1CA585B1BD5C467295285D52E47CA904235A1A3E48EFAE9EB6F6 | |
7009 | 01374125CE89D53C276858668CF45D2F092DDCAA52418E0BB94C2B8266B4D88A | |
7010 | 5D911507BB1DDA3D8F6E7C14A91CA11AE799EC42E993098E18CADA70BD2A1D82 | |
7011 | 2C39326C6E3F9E84CD9758B9AE43D79BF99E6A0CD713E95B3D9B7DB90D127DE0 | |
7012 | DAFEBF850CAAACBD860B5DEF2082F1ADA64B44B193C4A1417BE221FDCA36456C | |
7013 | BE5934C8CE3ED55AE3A11697C2D682B7D0F72D48976451D205783BE25DBD2507 | |
7014 | 39C14FFB4BB828DFD187104F38A7F11D5F0698C11E8C1D4F107CACE573FDC4B1 | |
7015 | C56FDAE47024D6FD16A2FEABB434CA320300FC4B6C1B6CA08F76C60B7C08A665 | |
7016 | 99F404DBA8A2A1EB18EF6750E4EC186E31561A3F080BA6562967546715859481 | |
7017 | 7BA782940F5C5D06626D6F6A412CA7C13820EC7C1DF23E15E5829F698CF617BE | |
7018 | D940523E4EE4ADECEC48C24297DBAD528BA1DCE7AC335A1D15D55415B108EFC8 | |
7019 | 6D45030D27B3EA63B2B4CD771DBE66AE0218ABB1153D4B7482289D1313CEF184 | |
7020 | 5C960B1E3C3C953912CC6F4521D1E15636C1545EEE457EFB87B88C9E43CC2F38 | |
7021 | 6BC4BC96969F4FF28ABB06F4454C01CEF1B6DC538F1E832FC1666D977E5A881B | |
7022 | F72F1B4C7DD4BE167A5535F1163A0706F9A0B26400178DF8A128FB5EBE6A7B81 | |
7023 | E478AD183EC06622B591337B9F1872AAEA356F4FC67EE767B34CB5A4D90702D9 | |
7024 | 39FB846947F4096FB3DCF16EC81455164783BA0B5D723060DAFF411B68307E81 | |
7025 | 7BEA1D9A47A5AA3D648E618C83C60F060029E6EC4D46B045FA7415BAB2AD0AA5 | |
7026 | ED9C729C24136F6AF61E6409C0B5CA760B16225641E268A68CFB8260BBEAFC77 | |
7027 | 6626EBD97195E77CAB425CFB0096D805D9EE699E41680D095AE9FA10122A7882 | |
7028 | 2F00F495C9EB2102DF0D3E61833BC0A2E468C5CF7AB430FDB7C0BE3DF2C0D230 | |
7029 | 1580BAA25D65F599378D873165482A1FBB224AEA89C6BCCFBDBA42AE1C5DCF41 | |
7030 | 06969F585CD3B737D1388D6359F5468D88FCD2279BDB270F6A858FB7D2ABDEFE | |
7031 | 5EE8FB79FA437F8F50237B92C307B73B0DCB808D07A9C3255CB9B3B17039CE5A | |
7032 | 288103D05D132863FB522A02CEE3839EF9AF7F07D99732F0B8B384745369FB3E | |
7033 | 7901166478F4A16076A1504C5E98D17408494E270BBF4470ED12B4332422679F | |
7034 | 759F1D93984D7E506D16950DB6C2682FE1379EFFA6F6C95DD71F6E55BE3EF6AF | |
7035 | E0CB25388EEB436E6527806FC75484133F6E561DEB979D5C1FFEFDAF2A6D964E | |
7036 | 03BAE0BD593C2992AD84569C81050F7A793C5263E50C2F50B98C4CC703EAE17A | |
7037 | 6AEDAACE312DAFAF5278D125B6EFC5587484F61DAFF46B87B7C9B1EEDECA4859 | |
7038 | 314A9A9E2248467DE1E54D90DD671660B9040B3E0DD982260822177EFD757266 | |
7039 | 74A16C83A7FB168016A320D3DF3BD7726F1F4EC90EE5DFE810C96B099FD4368D | |
7040 | 906AE4699049EFD37E8EF058D4B97BF71106445AADD4FC6E90615A0066823A36 | |
7041 | 673B8DE32322BBE861AE251226B4385AB28702831270DBD25D666FBB0AD7B96E | |
7042 | A44E891EA1EAF0F87013AFC982E33D67A28E96E0C9CB99B9E4192536830D9901 | |
7043 | 931A8CAFA41289633B20BA3BD7AA3414B6DA8D57CCF2FBE39920CC06361F075B | |
7044 | CC40335DB9A0071CFF77F6B7BB47F3100DBDC9C4A58C2B81EC99E8E966AF3390 | |
7045 | E3FBCC28BA1D79961C8A1584266454DF772FBA99664D74D4A89FC82FFEDFCFE1 | |
7046 | 4C9E4A04291E803D142E37E7ACA66AB279378F2F192FFB2B5BBAD18B95F03136 | |
7047 | 2CB594A3D6D3F8576B90A6C4DAD6D6C8EE07AF682F925F01D0B26CBA347C03BE | |
7048 | F3B0585CF4539FDC66915E22117078CC94D621F31DCB3E021998A5D6EE94CA4B | |
7049 | E214D07517283D56973D8E4367392BF6C1150DEBF459D141AE0941C1C8C5CFBE | |
7050 | E735D796E365A1B0F60BB4CF2801EAFE4889EE5F338D3C4885368281B3C95CCE | |
7051 | 251C28A90D318A8A0384439B38D63B94757252062EA44E88509FDD2E75FAAB71 | |
7052 | 7329622828B2785C1A8B26351BC74237A6BF99216652ACBD4CCF54CFC8AC72A6 | |
7053 | 46342F1E32D4318E7E27C7B2DAC943B3E72C472FC6F1DDA8684AA922516A672C | |
7054 | E969C047E318B5E3B1270C1BEB1C4071A15BC81B29B268C679B41FC5E381BE33 | |
7055 | DD95F0D68118CBB60C521E5CB2BA46A10E50E9238163713290DF6DD8A27D3813 | |
7056 | F871C07E725D4518013D9A84CEC96782541E5580E33C2EBCDB18F08EB4655A46 | |
7057 | 507A8526DB26C854928B81FD502B0CCE4A68943C12078F57C10F4E85FBEE1025 | |
7058 | 46D925B8B3B447D4920410FEEB9844FABE985F9228FDD9F58392F2F3BD650E49 | |
7059 | 2E3AD5A14984874DF4572816931885CE8A448EC95BBF40DDF4F85653AD90A88C | |
7060 | C4A879C0C7596E61997B972E8A55E57B17F802C738E5C7A8FBF6424F8B131B23 | |
7061 | CEE3EA3747DB066246C250EAD335A76FA166ABF75120CECB59076AB31A51F176 | |
7062 | 57176CBE8C802A97B0542A5CFD6D5E6D7EC848B923012E45D9F065BFFA0D03E6 | |
7063 | 788B68BA4DE51DA37994948F859D41C28BA939C3A82BFDB44DA585AE80B8CD7B | |
7064 | A6EEA79B70BFB4864E06F06A9751BD2D2A209D150D7135E0A25D67263EDD2A7C | |
7065 | C63B5B76ADB05D44BD5BC0BB3EBCE2E74E1AE5F7DE07A59D90C932DAA2553505 | |
7066 | 27F2AFC05F7CEB39E1C7E54F69FB0BBB069959F2FBD11709F8E81F6E7CA06DBA | |
7067 | 1CBDD8E7A78487462596DA288B50B295E46F4C3D9BA862688C68859734B232A7 | |
7068 | 4B371D2BD786924F186524765E789EEAA30B20C069322D42C893A30BF1BD2C46 | |
7069 | F8F3732DDFE80B8FC1789239345944D8B457824FD80D11184E73FBA30EB80A9F | |
7070 | 2FD466826D4E666E3A835B98A1D4AE5D17053A6A648E26E77BD08F9A3E02956A | |
7071 | AE82C4929E9666F539079846527D0E326FE7CBBF86E3722BA3E53F8A5121080B | |
7072 | ACF8D3C67A2A1DF624B9DB92105D3C833F5A6ECEC108E026E1D3D968967A1447 | |
7073 | 15CEFDD09123D56606134BC3449404ADAB1330C9238DE48F3CDFBC91EB86D7B3 | |
7074 | 8B85B5BA97376A0673E434DBFF19798EA90BFBD94493E2D21976F8106FC0C276 | |
7075 | C81C9B9F7D4A68120DDA56FC6EC65FFA40DB78A60A05EC270A106DEEBD2CB92B | |
7076 | F0622BD2B1D43771DF39AAD3ECB655F317AB483F7290C148690903AAA636583C | |
7077 | 99DE3DBA99EFE20773D3D8DDD816A28D7BD8881DE570BAF5C7A30679179E1214 | |
7078 | FCFED81605FE56AEA21C1894167F93D648B474352A65C0756F812F97AB435ADD | |
7079 | 22C031A21714A626DE35308AC51CD676DB1748DD2773532294FA77CFB2AAFD32 | |
7080 | A72BB7A045F12B4934A768F89217233DBBD69B900B28492A26713CA5D61A9042 | |
7081 | A982CB071F1F875718FAC168E4E275860DB6369B8114E1BDD4801110B62C3E3E | |
7082 | CF140554C826967A99F4E9726526E87D57BF845CE38E33893E5F9788769B6A4B | |
7083 | A4577C38C8D45AF2EDC9F4FA7DD9979AB8E14FF5D8956233AB4C02982BE8E561 | |
7084 | C63B7BC314793F634DB6F086E1A60D9FC3B69D3A7C20A99FBF3CB028CDBCEB60 | |
7085 | E803C8DC3C5F0CCAC030905E72BBAC052520CB0E40E23B46B2150DE67F61E4B1 | |
7086 | 8C4D55904B7F90DDE4A4A78B11AE1009DE46DA396791B1C0EA63FB6897FDFA0F | |
7087 | 42474042E7E9B06A703A7C6E672AC6705506F3C0B6861BC85CEBB9DC9BCFDE0D | |
7088 | 43F5248CD7CAD4B89835BACABBCE6C791BC35FE7211E775C009844FC75CBF6CA | |
7089 | DA6A6B7B488270BFAFFA3E9950914CB0F88C8AB7CDEFD2FDE11ADA7073037EF3 | |
7090 | 1A5CEEE37090F3A56D06FBC70597907A26498593783878C02722ECFD5D65903C | |
7091 | 7D421CAFA78924DD27756853568535B02533C3393183D6E30DA6ED4BD6582E09 | |
7092 | A5A4B4404EC452E91CB44515AC6124EBADAAE8A98D8A95E7D14DA39951EBC461 | |
7093 | D426490071462F246794023DE1BDC04AB0F1834D50F748C3C60A07E1FB8EF400 | |
7094 | 78DBAB90B59500BD1232A872ED51928329CC8F06E83164FBB2D0B24222223EE5 | |
7095 | 992241E8E00D5DCCD6DB9A8E2325ADBE12FC8512AC127BBEABDA739672C1644B | |
7096 | 554850CD75724E6779A7E76424CAF89E9455860E0AE2679231F4A535C0ED4336 | |
7097 | 313717D6F7A4A4DA833847A1BCFC7BF99234FA645F2B85C9A9AAF7108931E3CB | |
7098 | 077A9C571E57B0D7EFD92B56C3AA4FCEC0BCAA96005E649AE8012366BE6E62CD | |
7099 | 9E742F8F45AE4C96BCD73AD80AFB6F061D629ABEAEC3018CFF45E41F46751953 | |
7100 | 44E490B1355DC49C1E10BF343307263584091D122ABB1E3892E532B6DBAA105F | |
7101 | CD48375C112331EC5DB49E4D4CE2D126C9274B21E678E5E3EAAD4EA0CAAA29A7 | |
7102 | 86FD8819217B195EC6E40AF23ABCD71156656DAD38C931C8730715A2773DC44C | |
7103 | 4DEF14D92C2A054739F27D7EF349A0EB76D952BD9BA169B4F85C09D80984D232 | |
7104 | 2CB4A3812BDE539DC79E2EDC7C221739D16B10246A5F57151C210878556D4176 | |
7105 | 31EFF3AB6C4D78C4F0DF81692B3C9BDE4F85242BF0E84BACBFA39688BB222A81 | |
7106 | E85E9CB332868ED5B64E140C66E242B97A90C13B6DFBC3D285A49BA9D4BA1A47 | |
7107 | 64D83577FFB50BF974D953F42A249ADF9AC228CC4D8E82213FD463BC757AFF26 | |
7108 | DF4D1678FBCD55AFD5FB3014C0380B2F8CA9D6400DF2AA041580A6FA5694ADBA | |
7109 | 674286F00E531693DB28F7C996D5A66F80AAAF53001EDFBC065C72FA5BE3F114 | |
7110 | 1FA3354376AEF7374AE1D0A8E9B06C58FD029922164DC9FA09343FB6652232E2 | |
7111 | 2EE34C662F0092BE479D739ACE775C6F589775DD768B736F7391B9AEBDE7F760 | |
7112 | 727702E145CF749DC457B2E98A36C52416107B1E59084B5F777B61511B8D17AC | |
7113 | 88386A7933CAF852CA23FE179B67DF8DCF15800755605847ECC0FD77873727FC | |
7114 | 1AF2BA8BC75D30E26C40913771E528724FD7C5DE284A8B58AE55A5C48AF26AC8 | |
7115 | 02E155B8FCD6755D8F7F5A6F1AE66E4D24A13567B6463B18E65972BD75ABF732 | |
7116 | FB41F87A62FECE9A50C697BCEA1E3B3DF1E3DC961DCA598220CC746326F85F83 | |
7117 | 72E803A4E69106EC5BCA01139F92171DBF9964BBEC8D3370039623CA1F927CBF | |
7118 | FE7DA71B04B4321EB4D3FCB27F8404994CC7DE5F26AB8FC019A203D6DF2F449D | |
7119 | 85A4F103F7604986A1AC1F7D05D239E728FD6AD1DB5024B0A0542130D2B0E7EA | |
7120 | 4432F910F9FD75568F5732EAC95F7A87CEBC359949C26595741533E952327791 | |
7121 | 87E42DF84E1064E1BDD3F5A6455087B8E9C783AB9ABBCAF032E9FA32C27ED7E6 | |
7122 | CA7E3D1D76CD1905166090BD81A85485B9B4E976DB2E19A8E62EFB795FD6298C | |
7123 | 9ADA57D5BDA2FEBB227F0EFEC59E4B51E06B8358006F9D79C1EFE92510D6046B | |
7124 | 6AFEEDC793137DE622A8B3F5C9E3B21F29A98A589D9CEE75E348FD4D206415CE | |
7125 | 508AB95A7496236AF1F6F5ED6B3ADFBAF1E35B51484F9B1E0C11C5AEAB9336F5 | |
7126 | A8861ACE1EC74C4A145A64E4FC8F6BEB3A16B021AFF4AEDA59B06326A8D7FCB3 | |
7127 | 3B75F9729BFB7EEEDA8A1774728C80AED40BC35D42045E5CEEBBBEFAD2566CB1 | |
7128 | AD69A9A972826DF0F2303BB232367E611C115E8955DC97779B1AF269B84574C0 | |
7129 | 9D816C88BAE3AACA6428CFC648FCF0869AD9236591E3B8FA326BD2EDE7F97286 | |
7130 | 511C75F4EE4F7B4DA33BA2CE7F778D92AE7C1B4844CAB3ED8FCA285454D78469 | |
7131 | 1639D24729E8002E4507A114407DF51543CF7DFFDB7E05ADB2D36E139F2DBACF | |
7132 | D90AF274AFB3E5AB5B38918A28EDFCF6EACA78248BEFDC2FAC0E041AD35B130F | |
7133 | 8A91E20251CE976680FCE3F8B65B33118EF7C138CA1260D3CA855C94FCC02CC2 | |
7134 | B29C94A3FFD38056ACE512DE680DA29D97BCFC35FB2A85057E484FC9F72C9A7D | |
7135 | 08AFAFCA705335C6E9AEDAFA97D884E0E463E79D8AB45DDF86C56EC922283C4B | |
7136 | 777EAABC0D57BEE30D4D47FFA16FEAE2FA972E36516480E1FCAFFA5CE692B7E8 | |
7137 | 8F887C5AE573B96643F10BC62FAFA4BC6CD04F5353C0D40CBCEFBBA4DE7B8960 | |
7138 | 352E7F6497C9C4489779028934084522336B5E5DF6FF84A78158ED5035FFFC9F | |
7139 | F199AFD543D5D81C0155F3EE0E7F6FAF7898F7F26941D417F7AB37703FE67D37 | |
7140 | C263078FDC85C5430CF379E657FF9ADA0C00DBD605386F5494459C63D4AC057B | |
7141 | 2E061B06E17B54AEF38A9EB401FD4C76C6755F2AB651473DA2F19E28C89229E3 | |
7142 | FD385D8559EFFEEE5D0CEF127A8A6CF9017459466E0FAC341DE1994C03A0CA5A | |
7143 | 799CCD03DD2B41A05F7B36493638AAF8D7CD380E03726B0A18B02A46A0BCA027 | |
7144 | 9BF16ED75AE0494C36161ED2C22DD7036FBBA2E319106B9A56FECC732B87E2F2 | |
7145 | 596167125221D42DE9D4435DAD321F878FDA68B9E72DBC2E31178621327BAC50 | |
7146 | 72148C123D4C8568DE822169839906B9F0ACAF3B4DCEB9352C8A9E246A9A5EA7 | |
7147 | 31E04981D0A53F44B6905704CFFB9F0463518C02538DEF2DBDABE936D1213FBB | |
7148 | FCD28F833C5872057CAA92536B8E8EBA129745E2E2B5A9F07086A1212D466785 | |
7149 | EE640432A0E47C91CCFF3FED5669C8ABC2B43551AD04E7A2FEE2F3C16511F7D4 | |
7150 | 048A8207351E83AD32A72360A2DB1AA8F78C5D2630D770F5E13D5C49BE166475 | |
7151 | 79483B2F7FEBC1D73B04E0E5D9B8243DBEF7E5D201D9F644B150A230B5CF9B90 | |
7152 | CA34BB8474BCF408E37757B8CE5B33FE7400A68C70F542C7E2A22B8C0AB1EF9F | |
7153 | 2BBA7A646A4C872C43C0A748F078AA98A13E882085B460050CB3F5B09B62EC01 | |
7154 | AB87AF8DFCA6823ED6CF8426EC115C5E4DA335FE416E1D37311B7FD56793CCA0 | |
7155 | BF90B579B0FD4E4E1D0A26FB0C1D490D99CF4994693630FA343960E15AFFC596 | |
7156 | 49BB7297BFB82FD56BBCB36DC1597F94A157AEDFC53419BA867CC02C26464BC0 | |
7157 | 2875127C688DA6902567716A908153DB4CBF710CDBCE50AB98E0CCF1DF5CC571 | |
7158 | 00027F6582CF6AB4E584436471D3C8DA2D780E5B02A9B1717364899D51EC679D | |
7159 | CF5F4A4981EDC24F710E892772E4F891AD02B7B98A113FB1AD2B5A51046693A4 | |
7160 | 19D03A75A3140C19791C85A0DDD173BB3618E9498CDDC8696CCA6EF81729AD1E | |
7161 | EFE4F3D6242E1766A3079371D1D1833841F46F04F2F8029D8C1943F6986A95E4 | |
7162 | 9E77806F221CECAFB3EAE0F979DADC5D2E4715BFB5C64245CBD2300E59030B99 | |
7163 | 0885F08417E1A0C57C3746230F9EF4E968C0F41F67706BDA2E983012BF317612 | |
7164 | 38E9C0178F027EDA0E679F306AF71F0D8985C712C4B4BBBFC57A86AE052CC2FE | |
7165 | 5C1BDFD948801509ADFD4FF9FA7A25E30D6CCC7C7E418EEAB34C4ECC6AC8FADA | |
7166 | 637B5CC70136EA5A57B727EB11075755A7840215CE2B9939BBB6C3A7E22DE42E | |
7167 | B3725C1AD0BEE0A54C0B57CB93E6A20E319E2FE4515D80D09972E0A742D20DE0 | |
7168 | 55117C1B9F3C181456406FCA70A7E3B757A813F7CF9E3562EB8CAE1CFB65DAA2 | |
7169 | B384C17AE103C20851906846AA4AA5EEE5EE989F292D42B11EB4C4FC057EE4BB | |
7170 | B09A4D81E8AF0CE1C851B2E328E977207A6989F13F7FF039A4E295507CF0A53F | |
7171 | 10A345A516EDB7C5FD5763CC27543452249D229BC22099C6FC1DFCC07A35144C | |
7172 | 6267BE8D5BDCE57F9C7C65F6A64A74DC2207C8601231477DD57BC8259B26C683 | |
7173 | 22FD4DBF0E3BD814E31C9E194CE2EB212268A249216DB084226802B79DC72AAB | |
7174 | FAC4ED3AF6BC51E2D9A1D5A37F5124BEBB1E0B010C34A1B7FBCED45414AD2285 | |
7175 | 43BE684BC7BB56C5036D182AFECC061F749522456B4DCD80E3315F48E7E8AB98 | |
7176 | 40C4FBDE71DA957C8FD860C4AB02C97578BC8299EF448A526CFC585F27EA14E8 | |
7177 | 88F9928CBF87C8E46F69100F0CB43E2720B0BC8DCA50D59FEFBB84383B4036A3 | |
7178 | 0ED89F67B433AB4BF686487194107C63BF989A80D761EF3FB20146A0A496E5E9 | |
7179 | 26375866581146F3537156051C61F82AA5C68B6E8418297DDA7704EA50262775 | |
7180 | B96E1E1D7643370288780188ABCF25B9B23BBE408EC5DE254F51469D5FB06FF6 | |
7181 | 2EA926F94CF1730E014F34822ED267643B773B7CADF967D431B6F3DDC998E56A | |
7182 | 243880E9F772F3BAB3702C19C5DC92ACF864D6A771783E178F4A7BFBAD36008A | |
7183 | F0A61C5B437A69E31235DDA9898B4B081F1176C197C0834CAA25FDC9BEB696AA | |
7184 | 8ABD1FDBE17E30070690EDA533E2EBC19180DCE4CA8146D6657BDDB765DDFB21 | |
7185 | D0CDB86912E49DB109F66DBB9226E297945BCE9073E724EBABB58E42AD94CDA4 | |
7186 | C9DAEC40F79F3A3D36777B18C61DC9D22EC351324FAC3426917C893E36C8D953 | |
7187 | 4ACFACA05F8764BC61A17F6B40D3A97177B97CF88C2B0023ECB3F29F9CB347DC | |
7188 | E686012FB31904DCA042679776108D9D611EEE971D341ABCEACBD0866DA21DCC | |
7189 | 270D3DBBBC9CD438F4F651B58D1405A82960CA991CF690B8B564033154645D8D | |
7190 | ED5E4E059D9DFAF3A5C2BA1C1AFE1B865901C8D117262CAB210A3C7A03443544 | |
7191 | E22EA5577AEF1378A9A4528592F32A8AEBCB1CB6A7E4948FF78C6FD230A5892B | |
7192 | D8953ED89392929FB91C042D31E7E8A4912FC701E722D7FAF0308625B3B748F2 | |
7193 | 26DE427383236E131022A95395C72B3DEBB139C81811582FA4E9C7F970FA605D | |
7194 | C8DBB3ED8B141428ACE6DF426B2567B10C5D68A4060F25D5D64BA262101CF5C3 | |
7195 | 4B7948CDEB6CAC66FFFA0F1795C5F3174F7D319D252DC2D22BD08FAB54CEA742 | |
7196 | 64C0C6B94BDF182DC0942C0C82E82A0B04654A7C2E6BE685EC3DAF1D5FE48790 | |
7197 | DA815DBBD0A176BB4D4424ED7F893B4CED54C2EF94D73CBB154E547CD33D874A | |
7198 | E754A17AD1F10C23BC5FA4E709330A10A73C93B843D8CD8A65D5A4241B35CD19 | |
7199 | 938F2BA2FA95551F0C2FEF1CB8B056D9A9120F7607BD4C497762C577B66B2DF6 | |
7200 | 8F3F661EBD7F3E73E3A0032790ED80F774423A026F8ADE2FA82129E1FF27DB3A | |
7201 | 1B6E603479668FD783735606F7AC6BE9D65C17F7ECCA3B622C13F0FC95F8259D | |
7202 | DA4801A7EE18656AAC3D730CF2E17FCE8657AD6289850DC06E897A759F7B53CA | |
7203 | 502E764B07FDDBE6E99D25ECF1600D6646622334871C57133A8AFD03FBBC2368 | |
7204 | 1BCDABFA9FF4C4A9EF150045F694A3AA487BE461BDD2BF1BBB38BBC365837063 | |
7205 | 70963C7C1E7E4809797F4E497DBF6D5A90A71D6E89BEEDD5D16B31ADCAD67A81 | |
7206 | A9A3085B4CA7BD93E1A9591BD4A7C88FF930EE7A131C5F3338817D88AE31813A | |
7207 | C09D5E7120AFA6565B0A647A40CA94B78F20905B7110FE44A90794F7F0CD63DB | |
7208 | E99675C781255B7BA257CEB14DFDF9C13A02701B0FE41C6A6F50CC62C028A3BA | |
7209 | E9A918549B7F9F206DA0909F2009CC87BBB565F281F24D0ACBCB71F12709DB31 | |
7210 | 5D355415D97F66DB25CAC37E90BEDB51F2FA97E0A61EF85E845F702D0B3AF935 | |
7211 | 14F3EB201323209D76C7C5970AEFCE4225FFB4A1477B177BB52332AA0539291B | |
7212 | 9B8004F23CE4E055F7AB6D6F2A8E74C2994306A407A4FC831D1C887C42FFD0DF | |
7213 | EF07891681C7F4AA914AECC427057A8D73261E25F82DC3EEE7295C0870E91523 | |
7214 | E15187584B32B8F8B0F2E9BF4E67E5A2858F00B0C59DA1B1B59B00374C6C6AD9 | |
7215 | 741E0998EE0DCC6F5ACD1925CC40807D5B66E971CDCFA4651BBF2490FADD15EF | |
7216 | C8A7EA3ECD078D34D875C3EC5EDAB74AC0DCA00F2329184455C24C97EB0AD4C5 | |
7217 | 40B8E4AA2CE6E7816580F9DBCDAE7F01AF0533397CD37C401D4841B60CB976EB | |
7218 | E3093FC863F368C85AECE6E6CF7D9ADABDF628D9806C1269A0EE06FEC90948E5 | |
7219 | CBE40C0A2C72E08D9AD94F07470692D571F595E465CB32BF486AE9C3971B6F7B | |
7220 | FBBDE2699E1FC9DACB156D880DA379262A98C6708A9850FF8EE36C35FF636E46 | |
7221 | D8D00FB3550786C1D73E6B91F9B35D6998F33BC953E0C8AFF996F4C707F8DBAA | |
7222 | AFD76432E45605D5E703C2569856A0BD8C8ACB29BCAC87F1A72F859D20205328 | |
7223 | 6272929343C1CBCB053D7E19AEC4B2EFAA765B2002F43E7F62ED5281C94ABDAE | |
7224 | 750B2C88B3801559FC6DF0D66E55952FD67AD41718D49D35DBF2B7CCBC1E755E | |
7225 | 800ABB45EA4D7547756CE9E6D3AE0B80D8D97D681DFFCF4D5D5330F0FD6AA729 | |
7226 | 5BCB1475F18E9612197D6F5F7C7AE8FB931C242993D385AAE7829391D370819A | |
7227 | 496B9518C6F913E666C27F0896C7684AA1DB1A335C7B50762B4F8445D45C907B | |
7228 | 9E30F7FD84E403DACCB0A8DFF2940312386C315FFA700B0E42242EEE04042E2A | |
7229 | 3F4840E719A42FAC426870CC20DF083537010550A6B43A02A330D92CE15222FB | |
7230 | BE6A9F6EFA44F7987224533983D96BD2E1E536437F89E2E43884AE09FF5C7902 | |
7231 | A284704F78AC067C332EA207F53CAB61ED51EF3FE79A9B7A373C3DF72A4F3A5D | |
7232 | 67B4F60BB470E5D093FD880AD32809160E550CC1EE67E01CFA80318C03E6FDAD | |
7233 | A8E744FEA593E2761C60D2CE83F3F6D3A2B203739C62A69D4E271FA12372C45F | |
7234 | 6C378E4CC21B9B0CBFCF43233562E4BD4D52F7A634D1F0493F8DE445D140EA4A | |
7235 | D3956E9971263B7C3CAEC8AC83E541D58F52E00C1C80EBD9A31F0A9D17FA2D63 | |
7236 | E5E0D22CA28D51E39A055C40AB769EF224AEFE2AF714E322FDCB9770EB00686B | |
7237 | 208AAEE2160D059DEED823FF4F9769359C183A6A6398F9E4ED55397F02C68FB1 | |
7238 | 016CB495A0599DED25BF1006343DF9AB7C3BAEBD1EB2F99F4FCB07E84AD2D959 | |
7239 | D1D573B89C220DAD815D9EBA41CEF4D664630082DB97645AEA6779A8F0D7765E | |
7240 | B76A4B8B429CF95F22474EEF2FF1C792DD525E50E1EE0A1ECD78570970B62293 | |
7241 | 43DBE6E9B97585B754AEFE28E960B5F8B3F549EC7F168FFFC5EBB52C7CDDACCB | |
7242 | DF9E1FD89F2F8CEE44285E79724FDDFED021AAD2025006239EE5CA8543B86200 | |
7243 | C7E8522668B07608615F6F102E295003B1B89264810A2BFC3DAFECFF126B1807 | |
7244 | 2388839274203BEEC2B319C7F263ABBE6B181FECB5FDB9516E8F0456B6A1BEAD | |
7245 | 7F45DB0F95F4943B2ACF52CB30DFDC6EC936A6292DC2AD0BD67164900CECF3DC | |
7246 | 097528073246A88607DDEE1DE4BCFC298892F3B73E897734D7001A466170F60E | |
7247 | 5F2948ED36A6AC13975086A2D68B6CD8B033CD14C1B85EEE4AD3679D74DEB998 | |
7248 | AF62D045BF1102FB3927E5B9078F8AF93A0ADDF1937276C423CD346F30D17D3C | |
7249 | C57CE052053EC21A2991D063B157FD535850DD63E55890427BC2C883785DFBA2 | |
7250 | 436BDED247251001AB1AE56EA19880B88B3F1BFA6C232876E6C002E9EA850700 | |
7251 | 517C80537C27033737A162B10B179624F869FEC056F339D5A292E6E945E7BB31 | |
7252 | A271CA30990B4AA5874CAD851C1154275BBA868EDA5D156F4663E2D436DE6DD2 | |
7253 | 74E6579AB19EC803927046D9130BD9E735D64248A6FA78F1DD6B51DF0B1DD553 | |
7254 | 316D96795355878C426BDA09F052D54880E5F3E5C1F29786DA0A8084D81A5849 | |
7255 | B2A301BFF171446EEB4DAECAF40D8C4F6C489BEA6C592F8257E68C514180756D | |
7256 | A13569A03827561348B73584D69626B3175247018DB9DFAA9E989E55C97F9A32 | |
7257 | B02423EA16FADA78FE1E3C56EF4122C640EB8D77C5E957B5E425A2FBFD173423 | |
7258 | E8AA1758A91E1B5B85D174D7DA1F11B3AA76761346D2464BDBA290435A6DA50C | |
7259 | 1F14E14FE29396C918E3E4C388E93D1C3F7A7161FC61DFA1543D4CA86B6A3A5D | |
7260 | B64FC69BADC3F3E0F7DA2AA5FD6C39700C2CB8A6C823D2620D39FBB0B507003B | |
7261 | 6D28C8D67F57C019DE3D8A4B6BD01CF0B305163BB1229F470AAD7436D13C326C | |
7262 | 5D205B4C818D0F765E2B9FDDE26B033D1060EBEEAD6E5C49EC8C6F395B54C259 | |
7263 | 4E24E89DB787773423E358A1C64C3FDEE4CCBAAC4AC652012A0CD7269A062643 | |
7264 | 0F52A1BD1DEE9401B5835752C48CD0B705476B00458D31E70599761C793987D1 | |
7265 | 1A14288D5EB2C9452C2C4524202A40A8C773AA8A3B9D10ABFF457478532B2C58 | |
7266 | 0DA8776E116853B77D1A8EE320C87B23A693BB5D3E77A9C419772675690DD75C | |
7267 | 7AC5BC3ACF97BB11C70C0261EB5DECD96577D755B03EECBC66B3B8FAFAD87950 | |
7268 | 94AA617A40E4CFE88939F28D0D36C5C6FB5B4F6E4321BDBF12DCD428BDEC76DC | |
7269 | 192AD968A9699084DBFFA3FE06D5F79D336DD6CFCA4C9E1F427A29DB1F4F0492 | |
7270 | A29F5F052310D455E8AE1847083B70EE57C4799FF4B470655D855B8298FD3694 | |
7271 | 66E00CF5D04415601598C0ABD6802FA0DC4C12965546076E46C2DE87467CCC8D | |
7272 | F9ED9FE429CDE1DB2AFE61363327B4D11F46C678B59E74F8F09D8B9C14C48004 | |
7273 | CEC93F33A4A6906CD71B2414C05B3599E4D1FC1EB839D4B5E5968711359D3BB2 | |
7274 | 8E6E262896409C7EE86DF7A8CF1DCA1EDCB2BE723CAAF5B1D7DC94F093864855 | |
7275 | 7FB08EF776FDCF9DD8342ECB7F7B307542880A7C04D3BD09D65BE13F80E36120 | |
7276 | 24BBE4C422F1CC0DC956CE53261B903ABA0E0CF1CB0AA8895C0DA8127DE3DC9D | |
7277 | 4B491926B5408AC8D29D2FE62CC3CEF548C0A57A1DA202EAEA8F4584D8B64E49 | |
7278 | A3D11A48600CC0913B744180AFB6873BE72DCDFF8EA2203E34082E011C87C3F8 | |
7279 | EE91457705ED0BD4E2C193B7E818B50DDDD734F2BA1B876D262C39D94B0FC27F | |
7280 | 0B5A87423EAE91BDAB38BE457EB0309D05FA5E458109305C03295FC39B0D06BD | |
7281 | BFA2B4520DD610E12C3AF842A94296108FB67495B300991C3491F0983B5A0403 | |
7282 | 68A8D19218D9429EE400C3B91DDE2A9F163684D9F28120B584FEC88628EAA60F | |
7283 | 79F5988BE7BE31153A675BC7B344E7F62CE85E8850361D1996D57E71690472BB | |
7284 | 8055755DE965D795E6D2424F7D76AE7F249AEF4BFD75103B2CE4D62FECCD2FAE | |
7285 | 3702A57A3320C54D19D5015ABA5AF39B237C53D38DBD80773C0B9D6406574BFA | |
7286 | 48BA4EE71769AD140E202D24D9F1691BA072E1AF182FD6DC06C2FD25E3437E38 | |
7287 | ED1D0033E77D2B188F3A84EAE17787110EC5462EF5CD0FEBBE5CE39976B5CDA4 | |
7288 | 8206BE5EB8A06C7698C5E6A45EC7F59CAD3D6ED3AC19FABF3D29C9AEBEFDD74A | |
7289 | 6B7261D349FE509BD769D9A24B16C276C917F0CBE8B25FFE19BF8528E1C46D38 | |
7290 | 3738E3CEE8170E3EE323A464A3C8FF30B3DAD0BE87518E008E37F60DB471E3EC | |
7291 | 110E9B8AAA5C875AF759126B39B90A8E7BCB25FA3EFA783AF7B069AED1887A19 | |
7292 | 6A75C799940E5352C34A93F125DE82A7387CFDD7073A28C1026C9E06A1D8163B | |
7293 | E66DC3BAAEBBDF96B7B3143B9414AB45643D022294C2AF8C87EBFF1276EF991B | |
7294 | 7A1C720C1A7CFD392F211A190A530A19012EB117670AFAE4CF700048D901A5BE | |
7295 | 074F9B05AA555FA4ED6D0A92C08E4B795279F9BE48887886B5121DDD857E8A86 | |
7296 | A2885B9A672C72BAB990E0AF6DCCC769A7E18E65A86B3E1482D8297FD98E0510 | |
7297 | 30B27AFCB9B261771A1AFC298F96E272E779A8B6AB6B03410ECE32B7B69369C7 | |
7298 | 5597FDD08BF2E6CA29E093428DBB0BC53C64E5ECBF216111AC90E82822E7604B | |
7299 | A9AF479BE9FD2FB2ED27EBF4027C22357DB27A5A6FBC6B14607DC26F95A81BA5 | |
7300 | 1737D6C406B19857FFF2903F966DCD56BB73B06F5F74C917517DF95D8D5E5108 | |
7301 | 350AB839CBDFD7D1F3C687D0B6B576FFE108AE8708B967C29F9840A0D6784789 | |
7302 | DDD7A0D76E92082162603CC916ADAD75BB205E7C9B7A72D286C5411F3771EB6B | |
7303 | 9F9022BB24AC9EE7700907280F52862F1D542605F3D3AB06679252DB9A8A4E41 | |
7304 | FD9740AE35473A9FD025F364B863DDD063AF91A114EB529A38F28C4B4551E276 | |
7305 | F76C254669B81BD3CA8479F0C7208AFE5A1927F2AB12FBEC47FE0BF9AC3DBF3C | |
7306 | 340DC67125FA0D65B245260B32FB74F90CCA6D327874BDB6C252614C75425F20 | |
7307 | 2AD8C9ADD15733715B9281DB9D73C66B9664491416643C04165C64F5939CA73F | |
7308 | F8D7652592F391E59B82EF0BEDA9DC7F42713005E4AEAA1111EAB4E74BD99119 | |
7309 | D86490DEE3DA6C021B36D7AFDF9EEDBB1E3253176EF0607469E0982034AF57A8 | |
7310 | 83F024DD4B42B99BBA110514E52498F6BE463B3053DF5114F2D6644FA27702D3 | |
7311 | 15DB327F632E3750171BDAD75F0B7D2A84267C712132373A2FE740BB086D53B5 | |
7312 | C3E9A68583159E46FE46ED3B645B0FD505D206E09D438052E27B75EFE7F5D83F | |
7313 | BC153E4BAD47FF241AD46BE13605E1840C5C2CE3492C29EA5FFF5550AA3986E4 | |
7314 | FF28A404908C88269D821EB2FBB193DC311750F6163D75872603A254B949C756 | |
7315 | CB97829F0BE3AD796D52969E483A0A53CA650CFB9AD57E0F4DED89C7746341EB | |
7316 | 3D3333F06556BC61BABC3553C7B0D83DDC5B3BFDC77DBD9B6DE41680DD6439E9 | |
7317 | 4C9FA49DF62830C86E7A4B1CBD37F2794EB6DAFC3F1676697392A6A635E626DD | |
7318 | 3A3BC9E2378C152F9895178C694596191B37BE3DD8C0FF34C82C386289EBD7CC | |
7319 | B63139A3243F193EA10211A8E390B4C4046663CEC373928556F5CC99FE094ED2 | |
7320 | 841DDF013CAA6CA5C48CD9382CB776964B38BC24BB009DF203DB81D4EE3A4463 | |
7321 | C5F2BD876E0C9B9B226FF39C0CE6E67589A38388A02A81D3DEA72CC031BB8B2F | |
7322 | 66C481F00167DC0BEEE6740A78D736F429B44B82A3B01ED2127052646DB442FC | |
7323 | C1EC78B100F11D42512810F26EEABFFDEE3E46DD584FCC2194896F7BB5670634 | |
7324 | 480771223C1E2641A253CE2490AD75591FD94F19B2DBA95F0CD64EE4BA03D3B2 | |
7325 | BB0C7A6437B610004CA4F1B914D9075051F7CBB6CDA305F6337307F317CC05C7 | |
7326 | 8BA5A409ED6D915263680852670F8A474AB0646ACF77FA3AC35332DFE2B00CEA | |
7327 | FA99D25DAC950B173DB84ACD9DD99AB23973390FE32E384C6003FEB9A4D3FB1A | |
7328 | CA17FE87AD558921F203432EC00D0BD9E0294A0364048A9743516F46EAC01B7A | |
7329 | AF23DACE21FC2D26692D8F1A85F1B0AA8156D6360B322724C4804FAE55DFA814 | |
7330 | ACCE2F8508335CD775539E7931007A73DFDEEF7695487B10BB0D95FCA66D0F53 | |
7331 | 6E86DD15234A025709C4F7DD08761711D05655EAD8122D8BA2F7177E820B48C2 | |
7332 | 5EC82CD16644832ADF374ACF193975B4635FB374451D0AED47030807CFDCF240 | |
7333 | 783160D79230AAC1F2E5066F09C327ACE24CA2D712D08749FC63C3D8EDADCE22 | |
7334 | B81A7E03350AE88F30BE8222B6954ED0D2910AECBA460EC21BB032C4D5DC1B12 | |
7335 | 39F1EB91215B384CDE3F1FBDABA298E37D4460D0B07B0493053444AC73654815 | |
7336 | 376ADD2F64BDE78BF59CD75D93A3A3BC730562E9A1F2A730A2F766AA19DE458F | |
7337 | 06DD501B215E0C2070CD64DDE13E99719671FA4809FBCB6623E206253081A50F | |
7338 | 5329F16F1B0F0F69276852A7A0AC023A821B8E7880F9D7AE5DA74D0483AACB4F | |
7339 | FF09D975ABF439500ADEADA4990CA29A50D82C0A7704F11DDE0C9C8E4DA21382 | |
7340 | C4F7289719D9A4A44BF2735CCAA2BCA698A5FAEC9A3BCCDDA1C88CCE18510733 | |
7341 | 5A88B88A193C9DF15ACD00F20A965C11DD8A35CE316EF3E4716AB3FB4EC6288A | |
7342 | 91C0F824FC9933315C9A71CA786C9305A9A30F407777F0AEA7D341D1D9605378 | |
7343 | 72CF445A4A2E3666C0075E2F9AAC3F452811EF7E60E6C04F37F3808FE8BD39F2 | |
7344 | 346F5E25757E3ED2232F1B9B4DADF83DA45F7F302809251973F705CF71E34C18 | |
7345 | 7C452C4B5D29E0CB74CD6EA67637FFF0E9D9B211FF96E04FFFE9A27BE5E13BF6 | |
7346 | B51EF214FF4F0A58C5D5734E6BCB0ECD419AE3CF79AB67D1B3EAE70FC1E83691 | |
7347 | 095D0C370C9CF847C2A914F0B810124D763A972464C5F2C1F69914A8672D46EE | |
7348 | 30F9EFFA7E9628D667E5DB582C123160BF28E77DBBD77598F14A32DD74F67032 | |
7349 | B4A0537D0FF938CC61BB0F9798B600FFB1AD7AE6AEE67E0FC6557FC3FBAA1E4E | |
7350 | C793B0D207EE0395913818CB2446E9B82B880537C1625C70ACBC87F97CEA8C77 | |
7351 | 82E6229E1734F80FBF8477F062F3836FA9DCF83A4BA49703FE3DCB5F2CF6266F | |
7352 | 4480EDFA91B1D98FAB8BE14DA6E84B9D58B46DE5D034734496474241F59317F4 | |
7353 | 4AE4AFFABA7CA3FA149A26CF5050B83BDCB1C56B529900AA20EE6098D135E65E | |
7354 | 61026EF0852D497B3799DA044CB378332924CA360A1C62E24B5A0628813829AF | |
7355 | A1236DD728559DAA01188D6EBBF3CEF983C5201904D03A46B62A41E9C5F494DB | |
7356 | 135F6B62BD5F3745625E96E1B401848BFD935AD1FE128507866FB807693E8376 | |
7357 | 634F1B39763087EE7E454069D5CED93DAE8BE9D1366669A152968E2DF13EFA54 | |
7358 | D1A631CCCA33D914CC1DA8C0DF8ECE2FABD18641FFB43BB5E82DD0A56CC20DCC | |
7359 | 64EC0A7A04709085C80C2A1477CF85A29D0C11F204CEA455072DFBA6F5F5C693 | |
7360 | CB2B56EA189926EB51E92D2B5D89F25AB94E1F7FA208916FFE89601B616B41EB | |
7361 | EFA70F4C8CFC3FAD1D056E4076E8CDC2C3058A2B35B34FA0A29A2ED3746060AD | |
7362 | 1A6B6988B1B0986DE495FDE9A8C45119DA7EC756E1C83C89842C8744AC4B80DC | |
7363 | 264792E2E8D5AE4120BC57C170C742EEB0EAE8C9C4537AE432654DA4DF89FD45 | |
7364 | AE0DBDD92D0DDFA0C90C4FB90FD5A7ABB522A193117153CF578A584447FCD674 | |
7365 | 548ECB9250DA4669DDC8CDBEBBA49999F2519DE29B0CE693DEB2F420D4B0CE02 | |
7366 | D9AA3C2C15A6DC98495E1EA54C7670482E2B1034B91692285AC47EFD6271659E | |
7367 | 400D6D7DC137A904647FD092B1B4D59170F1EED8E29FCD584FEA2C77642AB839 | |
7368 | 0A44403D75504E8DDF1BDBBA6B51B7F9F64B63676B6FBDE514701B9333312126 | |
7369 | 4D8AC19B638254A4BFDEACA80AB2CBC4DD12AB48BC34771E210FB576FA0DE013 | |
7370 | 5C49E765028D57C056BD7C14E6941B0A92A2073CA3CCA67E9A18F18BE4934550 | |
7371 | EFB984B486B9036B8E3221F63D8642E2C71E6547A8E4B25FC3EC3C42D27DFD85 | |
7372 | E85F2D08C69CDCF3174A09E363E92A8B3D75BFD57CA37144D5267BA4D1750988 | |
7373 | 8FA3A9B9100838AA7DFFA97C5E4D2516F5649CA756C97C5A3D500A60D2AC5039 | |
7374 | 812B603639C2E3CE36F26CC0AFCB385A5BBD582E7BD1B5920F67DBAF9ABF9EE5 | |
7375 | FCF66EECB566DD87F0618AB73199C230034DE379CAC1F6BD17526305D6B6ECD5 | |
7376 | 8C5C57FA76FA775B2A25C7F5C83C27A1F4C71DCA93487469004EDFF855A156C0 | |
7377 | 8C8EE1972CEB91B9292F5619118F7DA38B1FCDD069D71D0DAE61BE55AF0E255B | |
7378 | 3B8D2DE974592BCA7D92F0DE92538C74A801CF16A424621627BEE5BEC2CC5E68 | |
7379 | 9B88BE0ADDB7C8125F7C35D74A52779C6D5D87143506EAB799765589617D08F3 | |
7380 | 1305B15752D134A97F7D872CF330F4B3BB62946570C5EA7DB77612DF9B7F91E9 | |
7381 | 22321623627FEC40FA04FDC1AA21DECC7AE531510375D6F68A68C6B8BD649A67 | |
7382 | A3E24B30E04ACC2171A510DCD77F7688E2ABD7D3346BD84E8363BCDB2EABBE0E | |
7383 | 5BC87A595CE80F977190EF06D3D0BE12DA50EA0C33D25617A9DA8940967906B5 | |
7384 | F5317F4CDCE1DCC7ED48B4AC4DA131EBCCD11F7D241551AF8A2A723A5C634EAC | |
7385 | 575113186D3B83F8B6E2E50796481B6CA50D440D5B20C5206A85F539FB7D52B8 | |
7386 | B831EF10B784D195BF7EFF05A9125A3B90CE131D84ADBBE6E47AAC2FBE51DDDF | |
7387 | 1286C0DCCA8343F7803FCB25CD690EF9FB49C1C3B91BB7FCE5D330C781744502 | |
7388 | AE46FEC050B4C695101F3B86ACE09D502572DFF5F8534DBE6DEAE838B4000712 | |
7389 | 4B21697BA3FCDCCB3B858251438F05B3EA1F8CABC08A502C5324D1315214E7DA | |
7390 | 6B62576C10E6EE9A69FDB9D424FE1C7BC32CF37EE9EFC42B9F6726C486762574 | |
7391 | 03913F9B3F5A20B1EFA8D4E072EA2F641D7AF64403C4EC76E3A81185B976499D | |
7392 | C78FAD546598AB094B628942EBA51C11FD572264BFC7B0E97A1715D7443F29EB | |
7393 | 7BB4E6848383836F99850E22316C73B76B0E6848008B832E49B7373A94DADEE4 | |
7394 | E7EB32C428F531FFA2067E3316A47C08068D93E27525A9A2A915CD9F204AB4DE | |
7395 | 01EF65ECE8167C184DFA747930AA322FC136DE0D412E99E6F37ACF87A788141B | |
7396 | 3043A3B0D20DDE8C2137EF0DA77A899A581A51AC4CD5A1031F84BD428D0A17A9 | |
7397 | 989877277917D07CB806DF051C23F1AB0049FBDE843B34CFC9DEC4147D97759E | |
7398 | 983C395F0C9DC2832139DFDE0455002BEBC392E7617156400301F76441347A3E | |
7399 | E94D2FB65A31DA189BCC3CE94AFC1613B546D424A36EB2F83F3444DDAB0F03A0 | |
7400 | F3C270A9B8BC62465F46D83929DB7F0240E52CAC458194BFD50645F825D0C41C | |
7401 | 773B1D6757625906C7643BDCE990E24467C011ACDAF6D4A26A62D71FAF1F475C | |
7402 | F14CA4D545E9E4F80BB01F3AC573D046DA7356FB9884CAE3A29DC357BC8CB255 | |
7403 | E5108AB355F0E087902C9BB458DCE8F341F1AEB79E468EE9A45855FE037780E7 | |
7404 | 9EA9ADC1CFA141A3F976DFEF51A428D237F234BF5C694DAD4CCF2AE84FFAB574 | |
7405 | A25C1FBA2F38110C305D962420A310FE93301B8677478BDBBBDC518B8C94E819 | |
7406 | 26BD2529D0EBF0E770CB3A1E107440D135848D2F90CE8F37693EDAF6071B79F4 | |
7407 | FEA5ABF4D9F2DC67F2468F2BDA3FA968EED4CAF8D7A22CB28AA43804F72F56B9 | |
7408 | 545DBD0E3F27DD5617329305CD8577AF38CD4C472CB181CF3DBEA07CD42C6C1C | |
7409 | 51E819286FFFC75E38F5EFF96C763F51A31A78B0848CF56DE1A2CBE2F39B0C41 | |
7410 | FC7C0D42D48D6C75516316B27F6C34AE6D5F5873233914790ECE044C014E9796 | |
7411 | 20E200F53FC51ABFEC15C1E08D36E9A4DA7E58DAC014E2C0627EE8ACC6AD021A | |
7412 | D2E2C431ACE954602EB99D4584250637F807507A17DA18521B6820E066058B09 | |
7413 | 8C2B4609FDEA9E02007A097F833C7A9854D74B38DC81016759DD8FC6F98071FE | |
7414 | 620AFA1A8DE5AA974C281A1DEC9C8B866E7E350BE5EF3C7C53F82280790CF239 | |
7415 | C847E4C7F74BCEBED8BCC57D4C01BC4394F0E9EC5AD01852B3B06B93A477A1AB | |
7416 | AA97B588415A03C1984B0C9619C899DFD4766A2CE91CD6A65120E07756100696 | |
7417 | 297345CACCE1551A2CB549077A292B73ECD47C3A098049BC49F2125BBF004DAA | |
7418 | 8827C407B06A07E5F39CC17843FE876FB2DC6CA2ADC0A4D8812901FC82913ECF | |
7419 | BD04C66B3647B7A698B4BC6C2F136C04AF4792F10C31231F2A04E4B55538CC17 | |
7420 | AFE4B47BA2F575BB4E7E222E9F6A4F904F11CBBC6DF6C2F3C15DCF268A39D6AB | |
7421 | DEB9D091EFE6ECD5DF61ED23E570D484A6AFD5F8D34B7D484F76F150D3D97EBE | |
7422 | 5E91D7A458FAB380BE167E7F2FAAC82BC2C7F3C14BDFD06D9665F5AB2CE34800 | |
7423 | E779AC43B70E22199D3BC4A2A14EFD5D20AF12D8CC26BCE54762ECCA9D9F5FDE | |
7424 | 84B43104575B2D6533FD3BD245AAAA4B82314EAEC2E6E566EB32AE367D2F2BBE | |
7425 | 8F6DF9D63F56693D701E259ED828A3E27561A5901B87F606AADBEDDD7E846AC1 | |
7426 | F07D1ACCEC90CF6AB18114A140FE4BC918EDC9B06284B40E2C82D4BE3C1EAB92 | |
7427 | E2E2F0DE115737561F7ACA173B81C9AF7EFCD6797BC1AE6366646C8F1ADC38A9 | |
7428 | F1928933BFB6AB474FA81D8C006AA11B76461ED98DB4DCB95D7772E3D15C2A29 | |
7429 | F116DF0437225E8EA1FC5C3997633CD63539069F7788AAB84BC9FA8A1A61316D | |
7430 | 2C0F07D2914A61B0418912B276561540BE5DBC1F7A20241E85ED95BB775E16D4 | |
7431 | 1F22262C8128967F53031EBA86D0A2184DEB01D51D4F7E15BADE50B7DE246C05 | |
7432 | 38B9B49D264A4B29A372FCBF57323308C71A0E14748850B56D51BB932B1DCAA3 | |
7433 | A1469E84536A42B0D8B55A0292C8050D6CD1BFDCC4D287B15082801EA40AB8DE | |
7434 | CD8628D0E1252DBC57333D74841246D7A6392F158EAA9FD5BC6CB2E535DDBEAB | |
7435 | F16FF32617952596187203D41342DF7FC1E0CAEA2EE8F012236DAB0208A626E4 | |
7436 | 5FC5EC819580727F7890BF2B114523A3006CFE3B67F19419A009826C635C4B2C | |
7437 | 10CED88293D753A6FC63C5C17A424E911169E316DAC022EE37A5F93A6D7BB446 | |
7438 | 5402EDB1F758FFCCBE83F7842CF09E84DAC17CC8A5D0521CDBCA8B320D90F24F | |
7439 | 32AA9B86DAFD068FB0D234C94EC0889134DCCF83F8B0C89F67D660EC4D6E2B34 | |
7440 | D4CC5E094049ACFA09767E7C0AFD789767D0660825FC94878BFCA40105597194 | |
7441 | BDF88A8636D180BAFEF635601218B47E1242497D1E90E7A0F1098FE4161E6C7D | |
7442 | D1E920DBECEDE54FD9D8EA40E25881F0E31C3FECCA22ED507DF496122D25AF56 | |
7443 | E6E690952EC746BE46F4D228D54C634B04D036DD33252E5A5B6309E559EB9CF9 | |
7444 | DD17101EF262D5FEBE9C207007A2E7F3BCCCE3243333F0A79C1779E727414D60 | |
7445 | B451BDC14BA3FFCBB9D49641DE51BE92C7D136C2C910559A6EE106DC05CB4890 | |
7446 | 322BC12FD592C4789FD8368DFB7827A67FF8FADE351646D0B4B35F74A924E229 | |
7447 | DDCBE1B5D24D049CBD4424B123B6AAE7F5AF8AEEC7F862431541F6B755A272CE | |
7448 | 177CAB058D297A35041646435664056644B2422B2CB890080C3BEC3C52C6363C | |
7449 | B843F24977C482C7A37CF18DEDE4E8FECB280E86263BBB5BD413A9BE19329817 | |
7450 | EC424B1AEEEF713A52D68143AF0DC2B02F293425F041A616D148ABED9E7FA7A0 | |
7451 | AE99B5762A52E38BE8E7148EF22808632CBDEA8613948D8E3D576580FA3F4B3E | |
7452 | 0B5F9E1B240BC7D0744FB1D121E3231994DEDE24B919A72869C15B839DDD9917 | |
7453 | D3BF2466E673B142E4B527B17893D3405603E1271E2D005A6318DC98CFA3D25C | |
7454 | 3A7B59A16B1D6C5C31F267B964E951DFDB1143F8D9005E378A3D4F5B072911CC | |
7455 | 814C191A806A989BC176544E45BA9A5CB16281394572CC6275A96865BEAB6F9D | |
7456 | 06DD94701FB30DEAC86652473C182379F43877528F28AB0B5FD9669347003055 | |
7457 | 2E6169601690053E00E18BE7FA7143DA61EA74326BE8122E56485E65B0572821 | |
7458 | BBE05576C1D9706EE219A8377338E93DFFFEE5E37E6054412A9B875A092C948C | |
7459 | C4663F161AEBAFBB964859E9056D42B76A806A2B1C435318459E272DD51339B6 | |
7460 | B16BC73787ADF1D7A2CD630CA98F8B6C479693BA427D7096E83AAC35B6D1CCAE | |
7461 | B5879B03B706C6AA3FC1A1D180315A2252DE59C45E9429E107D7A73A645AB182 | |
7462 | 6FCD53B44907874A1B286BC50D9051160CBFB374856E59C961C376C3B553454B | |
7463 | 108BC5FFAC60EB8C7426A70A1FFC2CE80D8989A3EEC43A9AD51771D48884BB32 | |
7464 | 1749E328FDCCD4FDD104E80EB6813FB98D83139791DD2A2C9ED7A70BC458DB09 | |
7465 | 5D73B21DAF0FFC110324B8F2BC145FA61962C5D78B4D6C8D014D6938AF09F36A | |
7466 | 2A3E5634A140A1A525BFCAA00616AA1D8195A8A68E4260B8ADDDF789B131C074 | |
7467 | 01EF325E06AEA94A459CE1F51F312C3C19142528AC941551F324BE2653BBCF38 | |
7468 | 46DDC6BDF7EF77D68C32F4DE7D8604E63A632AB2108086C77B94DC31D926D1E7 | |
7469 | 1D3653D8B35CC5AC431368B7B2D7C3A565FEE9D9B2E366F265A627FE7B4378C4 | |
7470 | 81A0C4DBDDE6F7DD940F08764D307A5B09097320431AA76A41C4ADE92C260588 | |
7471 | 522B197B802DC488FA2169BC2E13AE36A98591E1673C1CAC29B4E0E15D2227E7 | |
7472 | 80928CA4C060FECE89B014C3FB6A42313FC438E448DDD73CB66ADEF1FACF2E2A | |
7473 | 4601F76ECFF658D97BC22C765C0B1B04B03EE08A41E2C778A8E5954CABE7B386 | |
7474 | BFC2DC7C60E720BAB2B1A726D8AF4933355F21731FD7C930F31720C1E16F6C01 | |
7475 | C0C8B6747961B605CDFFB02FD6D6A7758B1097AA1D47C6DA9DBF0F87E55672AD | |
7476 | FE93D17DA6FE7B2E3A5360C5BF0C3F4715165CC6748BC95CFA74D4AD57B481B9 | |
7477 | 3784040A6B1BB028CA9F69B6AE52CFF8FF3FD169FDE1A85B52651D99B4042E72 | |
7478 | D5E952BD9F976EFA21C935F2ECBF5C8D4D8BA0AA97DD1458650F6DB9C80B3B21 | |
7479 | F60761C150944567DE98E9DED3BB831A57DE2A5C8CC4417D0D02BF24EB09C2A7 | |
7480 | B8262EFB223FDEDB45E75E2559190060C676B43721B5894EA52440AAAF72B77D | |
7481 | 42138ABF062B92255DCE006EC18492D4CC0CA6FE753E8851305B967B4B01D481 | |
7482 | 85D8A1B78CAEBEB99ED44E5BD7B0CD242B46F8C3C4B1DCE6B103497A89D0C48A | |
7483 | FCA2DDB3CBEF2CC076673FE28DD397F4975BF03EABF542C8ECAE8311822A6564 | |
7484 | 14C20DE022F9AFBF672B31D124F96E2475073E6B53F8032685A45AC7181B0158 | |
7485 | A6FDBF2DFCC9D842D42E098BC02AEFABA6D571821604BBDC389E80931BC8A767 | |
7486 | A92DC7CE49EDDC3C89521CD3AF5AEFF121EAA27B74A37BF043B1AC045A0D9A38 | |
7487 | 8767D85D15DBF0F5ABC495207AA3AD05BE201642206044F470EFDF4A8D52C050 | |
7488 | D600F04B97ACED3F7FC8A56E7640A6A4AAAE1816F3A77D887A378AA0B130B509 | |
7489 | 72A8ADBD5808E9BBB7F83216D995EC74FD168D5A3D171AB9C52A0E21169172A2 | |
7490 | 9C680D926D2327A314835700D399CE25A8311D22D1127B43CB8A9D900133C4D1 | |
7491 | CA1F71C4331F37DBE7F26650B4D512C5E192635CD8CF4C560AB5BFFE0671424D | |
7492 | 456BA00271A643AA2477DAB650F682D89B932BEBB5A66EBC9072A469EE78E0B3 | |
7493 | 86F58B1BA76F31B978C167A0E5CE18889C4DA968CEF94EFA70060960E1D53535 | |
7494 | 17230FC0C8AA0E878AD3D6E306533800DB46BF785219872DBCAAEC33A236A8AA | |
7495 | E86D9C9316CEE8D75888217824D56420EF7AFE70E18C6AC6E7E71161373D574A | |
7496 | D399548B201868F2D1B2DEC136ECFEFE25C307630331F2F893FE36E0CCC8113F | |
7497 | 9D7A6DE87881BC713E6B438F1E804B2C6F00DAA4FF0A33F2B051EE2655BD8583 | |
7498 | 9AA5BB2F7A4AD400F34963FA1BD28D5AB933EAE84C047D636122BE431DB097BC | |
7499 | 85D7CB6C30B09333A567F7DFC0A0482E4373512294562297BACC2F53E2BF1718 | |
7500 | 4E23AA470CB1879235832D66846522B8EC1536E17172B8DA9DEB14877C9405D4 | |
7501 | 531E548E8ACEBE66D41992C0D0A25CE7FE2641DC2F06A1399C864A7C1155DDD4 | |
7502 | 20A2D292688E6426B147572C2CD3706C96C22C977A4A6C4A30A54C7DDD50DCB9 | |
7503 | 7BBC5C0B744CD85DF88166B916C0F1909A38742C6BCB58045C4223B70F4B3BAD | |
7504 | 74EBBE8395A3F64A14D6838554EB6AB7CE417DD7448EBB4F3EE10B13B454C4EA | |
7505 | 949AF16A87E72ED21159408171A4847199C5E403FADCC67D0FFA5A58452ADC67 | |
7506 | FC3C597826B20BD85A1AC7BFA715531D99DDA5155185E3FBF29DDF559A103F75 | |
7507 | 538AC8CC0B4C4041288E89B387F6ABE04F90E8CEB2099293D1DC4FE00647C80C | |
7508 | 5DBE532282708D050BC6A226F45DBC314D109554BB25CF04770ED4874EED1B1F | |
7509 | E18E006F254BB4297C435B416A9AFC6FC51568D89317BCDD9885E2D1ED15F4F7 | |
7510 | AF253B5FAEE5CC44BF9D860982B7F4706C8B8018E6488E337B773A4A7AAF9998 | |
7511 | 6796B30721736F7AB66CE22EBEF616FE5847929A2E08D64DA7E912F4CA899F73 | |
7512 | 6A0A1F1F2163886A7C5E6999D98AB9708EADE2030050B2D05AEF0AA9447F8698 | |
7513 | 7C191DD81DB9131D0DC19BB7CD0CD9A60AEBBA3FAD203CA51B6FECB75EC91C14 | |
7514 | EE75CBB49420594C7B9A56EDE29343B5D1817AFF27B71F0BF2B8D59D8198C2B7 | |
7515 | A9F4091A085C973412051D6ACCD3F0B37D502D8FE193CD5E42769D1F497847CF | |
7516 | B986233F0DE24FE2F4ED03BFA105DD04182887D3C6CB827A1D5B00170B8DFA5E | |
7517 | EB1BE4FEEACCC82A5BB4BCE2C8320CBCF6EEBFC955025F3980763F51170EA440 | |
7518 | C2144AD36893326E5A3DC214AF59FF505E8168593AB9543FC6690F0D63262FBB | |
7519 | 978B833906430E5D2DC99D729D1CCE7A0A91725537BCF91DFBF8073EEE494A2B | |
7520 | E38F1AA3D81C602D05FAD3CA3A8A5A7E1F0A7F7CA736B561F3C29275E68D01E1 | |
7521 | FA253D089243988C475ABF8077C71DD93F1414E69FAEE565F42C863C61BE554B | |
7522 | 44C92919D78D898E70510D9EA1FCAB702FD53337263606A777A001224390AA6C | |
7523 | D8CA04FE8F34D61F03E083D0A050EA3985ED026479142A7184494C615A7AC675 | |
7524 | 97B6196C56F2034850A77938B7585B18AEEA2D249E41D25302DFF2416FCADC13 | |
7525 | E69030FD907778821C66F93220A31991386640AC2315A5B7DB80B4AE91A6A4D7 | |
7526 | 8BC19E632295CFECA8D65B4045C5A7614852CD48686A27D61F6DC6ED6120D30D | |
7527 | 92C97F4D0B5135823FA4A59DFB7633 | |
c302751c CR |
7528 | 0000000000000000000000000000000000000000000000000000000000000000 |
7529 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7530 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7531 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7532 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7533 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7534 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7535 | 0000000000000000000000000000000000000000000000000000000000000000 | |
7536 | cleartomark | |
45c0f7f8 | 7537 | {restore}if |
c302751c | 7538 | %%EndFont |
37c41ab1 | 7539 | TeXDict begin 40258431 52099146 1000 600 600 (bashref.dvi) |
50fc6e33 CR |
7540 | @start /Fa 130[55 1[55 123[{ T1Encoding ReEncodeFont }2 |
7541 | 116.231 /SFRM1440 rf /Fb 133[34 41 41 55 41 43 30 30 | |
7542 | 30 41 43 38 43 64 21 41 23 21 43 38 23 34 43 34 43 38 | |
7543 | 8[58 4[43 57 1[52 60 58 70 48 2[28 58 3[59 55 54 58 7[38 | |
7544 | 38 38 38 38 38 38 38 38 38 3[21 31[43 12[{}52 74.7198 | |
7545 | /CMR9 rf /Fc 197[21 58[{}1 74.7198 /CMMI9 rf /Fd 134[39 | |
7546 | 39 2[39 39 39 39 2[39 39 39 39 2[39 39 1[39 39 39 2[39 | |
7547 | 19[39 27[39 39 2[39 45[{}20 74.7198 /CMSLTT10 rf /Fe | |
7548 | 129[39 39 1[39 39 39 39 39 39 39 39 39 39 39 39 39 39 | |
7549 | 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 1[39 | |
7550 | 39 39 39 39 39 39 39 39 39 1[39 39 39 39 39 39 1[39 39 | |
7551 | 39 39 39 39 39 39 39 39 39 39 1[39 39 39 5[39 39 39 39 | |
7552 | 39 39 39 39 39 1[39 39 39 39 39 1[39 39 1[39 33[{}81 | |
7553 | 74.7198 /CMTT9 rf /Ff 167[62 3[60 46 2[57 1[62 76 52 | |
7554 | 1[43 1[62 65 54 1[63 60 67[{}13 83.022 /CMR10 rf /Fg | |
7555 | 135[67 2[67 1[50 2[61 69 5[33 1[70 2[68 52[60 47[{}9 | |
7556 | 109.174 /CMCSC10 rf /Fh 140[56 3[56 56 1[56 2[56 56 56 | |
7557 | 57[56 45[{}8 109.091 /CMTT12 rf /Fi 130[45 1[45 123[{ | |
7558 | T1Encoding ReEncodeFont }2 91.3242 /SFRM1095 rf /Fj | |
7559 | 134[48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 | |
7560 | 48 48 48 48 48 48 48 48 1[48 2[48 3[48 3[48 1[48 1[48 | |
7561 | 1[48 48 48 1[48 48 48 1[48 48 48 48 1[48 6[48 6[48 48 | |
7562 | 48 48 2[48 5[48 39[{}49 90.9091 /CMSLTT10 rf /Fk 134[65 | |
0fcb3344 CR |
7563 | 65 89 65 68 48 48 50 65 68 61 68 102 34 65 1[34 68 61 |
7564 | 37 56 68 55 68 60 7[93 1[127 1[94 85 68 92 92 84 92 96 | |
7565 | 116 74 96 1[46 96 96 77 81 94 89 87 93 1[58 5[61 61 61 | |
7566 | 61 61 61 61 61 61 61 1[34 41 34 31[68 72 11[{}62 109.091 | |
7567 | /CMBX12 rf /Fl 135[42 1[42 1[30 37 38 1[46 46 51 74 23 | |
e6983002 | 7568 | 42 1[28 1[42 1[42 46 42 1[46 51[33 32[51 12[{}19 90.9091 |
0fcb3344 | 7569 | /CMTI10 rf /Fm 135[56 2[56 1[42 55 1[51 58 56 68 47 2[27 |
d37a4722 CR |
7570 | 1[58 49 51 57 54 53 56 46[50 2[50 1[34 45[{}20 90.9091 |
7571 | /CMCSC10 rf /Fn 197[25 58[{}1 90.9091 /CMMI10 rf /Fo | |
7572 | 197[33 58[{}1 119.552 /CMMI12 rf /Fp 134[85 85 1[85 90 | |
7573 | 63 64 66 1[90 81 90 134 45 1[49 45 90 81 49 74 90 72 | |
7574 | 90 78 10[122 124 112 90 120 3[126 153 97 1[83 60 126 | |
7575 | 127 101 106 124 117 115 122 7[81 81 81 81 81 81 81 81 | |
7576 | 81 81 35[90 94 11[{}52 143.462 /CMBX12 rf /Fq 200[0 21[91 | |
7577 | 17[45 1[91 12[71{}5 90.9091 /CMSY10 rf /Fr 133[40 48 | |
7578 | 48 66 48 51 35 36 36 48 51 45 51 76 25 48 28 25 51 45 | |
7579 | 28 40 51 40 51 45 7[68 68 93 1[68 66 51 67 1[62 71 68 | |
7580 | 83 57 71 1[33 68 71 59 62 69 66 64 68 13[45 45 45 3[30 | |
7581 | 8[45 2[25 18[76 1[51 53 11[{}57 90.9091 /CMSL10 rf /Fs | |
7582 | 132[67 1[71 71 97 71 75 52 53 55 1[75 67 75 112 37 71 | |
7583 | 41 37 75 67 41 61 75 60 75 65 3[37 1[37 1[102 102 139 | |
7584 | 102 103 94 75 100 101 92 101 105 128 81 105 69 50 105 | |
7585 | 106 85 88 103 97 96 102 105 64 4[37 67 67 67 67 67 67 | |
7586 | 67 67 67 67 1[37 1[37 1[67 5[67 112 1[41 20[75 78 11[{}73 | |
7587 | 119.552 /CMBX12 rf /Ft 129[48 48 48 48 48 48 48 48 48 | |
258e3d46 | 7588 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
37c41ab1 | 7589 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
d37a4722 | 7590 | 48 48 48 48 48 48 48 1[48 48 48 48 48 48 48 48 48 48 |
37c41ab1 | 7591 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
d37a4722 CR |
7592 | 48 48 48 48 48 48 48 48 48 48 48 48 48 33[{}93 90.9091 |
7593 | /CMTT10 rf /Fu 131[91 45 40 48 48 66 48 51 35 36 36 48 | |
7594 | 51 45 51 76 25 48 28 25 51 45 28 40 51 40 51 45 25 2[25 | |
7595 | 45 25 56 68 68 93 68 68 66 51 67 71 62 71 68 83 57 71 | |
7596 | 47 33 68 71 59 62 69 66 64 68 71 43 1[71 1[25 25 45 45 | |
7597 | 45 45 45 45 45 45 45 45 45 25 30 25 1[45 35 35 25 71 | |
7598 | 76 45 76 45 25 18[76 51 51 53 11[{}91 90.9091 /CMR10 | |
7599 | rf /Fv 138[108 1[76 79 3[108 1[54 3[108 1[59 88 1[86 | |
7600 | 1[94 14[144 4[184 10[138 66[{}13 172.154 /CMBX12 rf end | |
5e13499c CR |
7601 | %%EndProlog |
7602 | %%BeginSetup | |
7603 | %%Feature: *Resolution 600dpi | |
7604 | TeXDict begin | |
7605 | %%BeginPaperSize: Letter | |
45c0f7f8 CR |
7606 | /setpagedevice where |
7607 | { pop << /PageSize [612 792] >> setpagedevice } | |
7608 | { /letter where { pop letter } if } | |
7609 | ifelse | |
5e13499c | 7610 | %%EndPaperSize |
37c41ab1 | 7611 | end |
5e13499c CR |
7612 | %%EndSetup |
7613 | %%Page: 1 1 | |
6e51e0d0 CR |
7614 | TeXDict begin 1 0 bop 150 1318 a Fv(Bash)64 b(Reference)j(Man)-5 |
7615 | b(ual)p 150 1385 3600 34 v 2361 1481 a Fu(Reference)31 | |
fffe80d4 | 7616 | b(Do)s(cumen)m(tation)i(for)d(Bash)2428 1589 y(Edition)h(5.2,)g(for)f |
3011048a CR |
7617 | Ft(Bash)g Fu(V)-8 b(ersion)31 b(5.2.)3218 1697 y(Jan)m(uary)f(2022)150 |
7618 | 4927 y Fs(Chet)45 b(Ramey)-11 b(,)46 b(Case)g(W)-11 b(estern)46 | |
7619 | b(Reserv)l(e)g(Univ)l(ersit)l(y)150 5068 y(Brian)f(F)-11 | |
7620 | b(o)l(x,)45 b(F)-11 b(ree)45 b(Soft)l(w)l(are)h(F)-11 | |
9128f932 | 7621 | b(oundation)p 150 5141 3600 17 v eop end |
5e13499c | 7622 | %%Page: 2 2 |
6e51e0d0 | 7623 | TeXDict begin 2 1 bop 150 4279 a Fu(This)35 b(text)h(is)g(a)g(brief)f |
37c41ab1 | 7624 | (description)h(of)f(the)h(features)g(that)g(are)g(presen)m(t)g(in)f |
3011048a CR |
7625 | (the)h(Bash)f(shell)h(\(v)m(ersion)150 4389 y(5.2,)c(17)f(Jan)m(uary)f |
7626 | (2022\).)150 4523 y(This)35 b(is)h(Edition)f(5.2,)k(last)d(up)s(dated)f | |
7627 | (17)h(Jan)m(uary)f(2022,)k(of)d Fr(The)f(GNU)i(Bash)e(Reference)i(Man)m | |
7628 | (ual)p Fu(,)150 4633 y(for)30 b Ft(Bash)p Fu(,)g(V)-8 | |
7629 | b(ersion)31 b(5.2.)150 4767 y(Cop)m(yrigh)m(t)602 4764 | |
7630 | y(c)577 4767 y Fq(\015)f Fu(1988{2021)35 b(F)-8 b(ree)31 | |
7631 | b(Soft)m(w)m(are)h(F)-8 b(oundation,)31 b(Inc.)390 4902 | |
7632 | y(P)m(ermission)21 b(is)f(gran)m(ted)h(to)g(cop)m(y)-8 | |
d514a087 CR |
7633 | b(,)24 b(distribute)c(and/or)h(mo)s(dify)e(this)i(do)s(cumen)m(t)f |
7634 | (under)f(the)390 5011 y(terms)25 b(of)h(the)f(GNU)h(F)-8 | |
aaf6036e | 7635 | b(ree)27 b(Do)s(cumen)m(tation)g(License,)g(V)-8 b(ersion)26 |
ad4aef08 | 7636 | b(1.3)g(or)f(an)m(y)h(later)g(v)m(ersion)390 5121 y(published)43 |
aaf6036e CR |
7637 | b(b)m(y)h(the)h(F)-8 b(ree)46 b(Soft)m(w)m(are)g(F)-8 |
7638 | b(oundation;)53 b(with)44 b(no)g(In)m(v)-5 b(arian)m(t)46 | |
ad4aef08 | 7639 | b(Sections,)j(no)390 5230 y(F)-8 b(ron)m(t-Co)m(v)m(er)31 |
aaf6036e | 7640 | b(T)-8 b(exts,)30 b(and)f(no)f(Bac)m(k-Co)m(v)m(er)k(T)-8 |
9f178efb | 7641 | b(exts.)41 b(A)29 b(cop)m(y)h(of)f(the)g(license)h(is)f(included)390 |
ad4aef08 CR |
7642 | 5340 y(in)h(the)h(section)g(en)m(titled)h(\\GNU)f(F)-8 |
7643 | b(ree)32 b(Do)s(cumen)m(tation)g(License".)p eop end | |
5e13499c | 7644 | %%Page: -1 3 |
6e51e0d0 | 7645 | TeXDict begin -1 2 bop 3725 -116 a Fu(i)150 299 y Fp(T)-13 |
967625cd | 7646 | b(able)53 b(of)h(Con)l(ten)l(ts)150 649 y Fs(1)135 b(In)l(tro)t |
037a8b7f CR |
7647 | (duction)31 b Fo(:)19 b(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7648 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7649 | f(:)h(:)f(:)h(:)f(:)g(:)44 b Fs(1)275 786 y Fu(1.1)92 | |
7650 | b(What)31 b(is)f(Bash?)10 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7651 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7652 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7653 | (:)f(:)h(:)f(:)g(:)h(:)23 b Fu(1)275 896 y(1.2)92 b(What)31 | |
7654 | b(is)f(a)h(shell?)22 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
c302751c | 7655 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
037a8b7f CR |
7656 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7657 | g(:)h(:)35 b Fu(1)150 1147 y Fs(2)135 b(De\014nitions)31 | |
7658 | b Fo(:)20 b(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f | |
7659 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:) | |
7660 | f(:)h(:)f(:)g(:)h(:)43 b Fs(3)150 1425 y(3)135 b(Basic)45 | |
7661 | b(Shell)g(F)-11 b(eatures)19 b Fo(:)h(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
7662 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7663 | h(:)f(:)32 b Fs(5)275 1562 y Fu(3.1)92 b(Shell)30 b(Syn)m(tax)13 | |
7664 | b Fn(:)j(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7665 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
c302751c | 7666 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
037a8b7f CR |
7667 | 27 b Fu(5)399 1671 y(3.1.1)93 b(Shell)30 b(Op)s(eration)14 |
7668 | b Fn(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7669 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h | |
7670 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)28 b Fu(5)399 | |
7671 | 1781 y(3.1.2)93 b(Quoting)23 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7672 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
c302751c | 7673 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
037a8b7f CR |
7674 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)37 b Fu(6)524 1890 y(3.1.2.1)93 |
7675 | b(Escap)s(e)30 b(Character)19 b Fn(:)d(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7676 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7677 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)33 b Fu(6)524 | |
7678 | 2000 y(3.1.2.2)93 b(Single)31 b(Quotes)16 b Fn(:)g(:)f(:)g(:)h(:)f(:)h | |
7679 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7680 | h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)30 | |
7681 | b Fu(6)524 2110 y(3.1.2.3)93 b(Double)31 b(Quotes)14 | |
7682 | b Fn(:)i(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7683 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7684 | (:)h(:)f(:)g(:)h(:)f(:)28 b Fu(6)524 2219 y(3.1.2.4)93 | |
7685 | b(ANSI-C)30 b(Quoting)15 b Fn(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
c302751c | 7686 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) |
037a8b7f CR |
7687 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)29 b Fu(6)524 |
7688 | 2329 y(3.1.2.5)93 b(Lo)s(cale-Sp)s(eci\014c)32 b(T)-8 | |
7689 | b(ranslation)17 b Fn(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7690 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)30 | |
7691 | b Fu(7)399 2438 y(3.1.3)93 b(Commen)m(ts)14 b Fn(:)i(:)f(:)g(:)h(:)f(:) | |
c302751c CR |
7692 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7693 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
e59452c7 | 7694 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)28 b Fu(9)275 2548 y(3.2)92 |
037a8b7f CR |
7695 | b(Shell)30 b(Commands)9 b Fn(:)15 b(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7696 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7697 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
e59452c7 | 7698 | (:)h(:)f(:)23 b Fu(9)399 2658 y(3.2.1)93 b(Reserv)m(ed)31 |
d37a4722 | 7699 | b(W)-8 b(ords)27 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
220537f2 | 7700 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
d37a4722 | 7701 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)40 |
e59452c7 | 7702 | b Fu(9)399 2767 y(3.2.2)93 b(Simple)30 b(Commands)15 |
d37a4722 CR |
7703 | b Fn(:)f(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7704 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
e59452c7 CR |
7705 | (:)f(:)h(:)f(:)g(:)h(:)f(:)29 b Fu(9)399 2877 y(3.2.3)93 |
7706 | b(Pip)s(elines)23 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7707 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7708 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7709 | (:)f(:)h(:)36 b Fu(10)399 2986 y(3.2.4)93 b(Lists)30 | |
7710 | b(of)h(Commands)20 b Fn(:)15 b(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
7711 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7712 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)33 b Fu(10)399 | |
d37a4722 CR |
7713 | 3096 y(3.2.5)93 b(Comp)s(ound)28 b(Commands)9 b Fn(:)14 |
7714 | b(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7715 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
e59452c7 | 7716 | 22 b Fu(11)524 3205 y(3.2.5.1)93 b(Lo)s(oping)30 b(Constructs)16 |
d37a4722 CR |
7717 | b Fn(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7718 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)29 | |
e59452c7 | 7719 | b Fu(11)524 3315 y(3.2.5.2)93 b(Conditional)31 b(Constructs)25 |
d37a4722 CR |
7720 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7721 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)39 | |
e59452c7 | 7722 | b Fu(12)524 3425 y(3.2.5.3)93 b(Grouping)30 b(Commands)22 |
037a8b7f CR |
7723 | b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7724 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)36 | |
e59452c7 | 7725 | b Fu(17)399 3534 y(3.2.6)93 b(Copro)s(cesses)26 b Fn(:)15 |
037a8b7f CR |
7726 | b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7727 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
e59452c7 | 7728 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)39 b Fu(18)399 |
d37a4722 | 7729 | 3644 y(3.2.7)93 b(GNU)31 b(P)m(arallel)13 b Fn(:)k(:)f(:)f(:)h(:)f(:)h |
037a8b7f | 7730 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
c302751c | 7731 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
e59452c7 | 7732 | (:)f(:)g(:)h(:)26 b Fu(19)275 3753 y(3.3)92 b(Shell)30 |
037a8b7f CR |
7733 | b(F)-8 b(unctions)16 b Fn(:)g(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7734 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7735 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
e59452c7 | 7736 | (:)h(:)29 b Fu(19)275 3863 y(3.4)92 b(Shell)30 b(P)m(arameters)c |
037a8b7f | 7737 | Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
c302751c | 7738 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f | 7739 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)38 b |
e59452c7 | 7740 | Fu(21)399 3973 y(3.4.1)93 b(P)m(ositional)32 b(P)m(arameters)8 |
037a8b7f CR |
7741 | b Fn(:)17 b(:)f(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h |
7742 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
e59452c7 | 7743 | h(:)f(:)h(:)21 b Fu(22)399 4082 y(3.4.2)93 b(Sp)s(ecial)30 |
037a8b7f CR |
7744 | b(P)m(arameters)c Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7745 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
e59452c7 | 7746 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)37 b Fu(23)275 4192 |
037a8b7f | 7747 | y(3.5)92 b(Shell)30 b(Expansions)24 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h |
c302751c | 7748 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
037a8b7f | 7749 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
e59452c7 | 7750 | (:)g(:)h(:)f(:)38 b Fu(24)399 4301 y(3.5.1)93 b(Brace)31 |
037a8b7f CR |
7751 | b(Expansion)9 b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7752 | (:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7753 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)22 b | |
e59452c7 | 7754 | Fu(24)399 4411 y(3.5.2)93 b(Tilde)30 b(Expansion)18 b |
037a8b7f CR |
7755 | Fn(:)d(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f |
7756 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
e59452c7 | 7757 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)31 b Fu(25)399 4521 y(3.5.3)93 |
037a8b7f | 7758 | b(Shell)30 b(P)m(arameter)i(Expansion)26 b Fn(:)15 b(:)g(:)h(:)f(:)h(:) |
c302751c | 7759 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
e59452c7 | 7760 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)39 b Fu(26)399 4630 y(3.5.4)93 |
037a8b7f | 7761 | b(Command)29 b(Substitution)20 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
c302751c | 7762 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
3011048a | 7763 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)33 b Fu(34)399 4740 |
037a8b7f CR |
7764 | y(3.5.5)93 b(Arithmetic)31 b(Expansion)c Fn(:)15 b(:)h(:)f(:)g(:)h(:)f |
7765 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7766 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)40 b | |
e59452c7 | 7767 | Fu(34)399 4849 y(3.5.6)93 b(Pro)s(cess)30 b(Substitution)15 |
037a8b7f CR |
7768 | b Fn(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
7769 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
e59452c7 | 7770 | (:)f(:)g(:)h(:)28 b Fu(34)399 4959 y(3.5.7)93 b(W)-8 |
037a8b7f CR |
7771 | b(ord)31 b(Splitting)d Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7772 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7773 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)41 | |
3011048a | 7774 | b Fu(35)399 5068 y(3.5.8)93 b(Filename)32 b(Expansion)22 |
037a8b7f CR |
7775 | b Fn(:)14 b(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7776 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
e59452c7 | 7777 | f(:)h(:)f(:)g(:)35 b Fu(35)524 5178 y(3.5.8.1)93 b(P)m(attern)31 |
037a8b7f | 7778 | b(Matc)m(hing)14 b Fn(:)k(:)d(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
c302751c | 7779 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
e59452c7 | 7780 | h(:)f(:)g(:)h(:)f(:)h(:)27 b Fu(36)399 5288 y(3.5.9)93 |
037a8b7f CR |
7781 | b(Quote)31 b(Remo)m(v)-5 b(al)17 b Fn(:)g(:)e(:)h(:)f(:)h(:)f(:)g(:)h |
7782 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7783 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)30 | |
e59452c7 | 7784 | b Fu(37)p eop end |
5e13499c | 7785 | %%Page: -2 4 |
d37a4722 CR |
7786 | TeXDict begin -2 3 bop 3699 -116 a Fu(ii)275 83 y(3.6)92 |
7787 | b(Redirections)14 b Fn(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7788 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
7789 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
e59452c7 | 7790 | (:)h(:)f(:)g(:)27 b Fu(37)399 193 y(3.6.1)93 b(Redirecting)31 |
d37a4722 CR |
7791 | b(Input)11 b Fn(:)j(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7792 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
e59452c7 | 7793 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)24 b Fu(39)399 302 |
d37a4722 | 7794 | y(3.6.2)93 b(Redirecting)31 b(Output)15 b Fn(:)f(:)i(:)f(:)h(:)f(:)g(:) |
037a8b7f | 7795 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
d37a4722 | 7796 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)28 |
e59452c7 | 7797 | b Fu(39)399 412 y(3.6.3)93 b(App)s(ending)28 b(Redirected)k(Output)20 |
d37a4722 | 7798 | b Fn(:)14 b(:)h(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
e59452c7 | 7799 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)33 b Fu(39)399 |
d37a4722 CR |
7800 | 521 y(3.6.4)93 b(Redirecting)31 b(Standard)e(Output)h(and)f(Standard)h |
7801 | (Error)16 b Fn(:)e(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)29 b | |
e59452c7 | 7802 | Fu(39)399 631 y(3.6.5)93 b(App)s(ending)28 b(Standard)i(Output)f(and)h |
d37a4722 | 7803 | (Standard)f(Error)d Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)40 |
3011048a | 7804 | b Fu(40)399 741 y(3.6.6)93 b(Here)31 b(Do)s(cumen)m(ts)15 |
037a8b7f CR |
7805 | b Fn(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7806 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
e59452c7 | 7807 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)27 b Fu(40)399 850 y(3.6.7)93 |
037a8b7f | 7808 | b(Here)31 b(Strings)16 b Fn(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
c302751c | 7809 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f | 7810 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)29 |
e59452c7 | 7811 | b Fu(40)399 960 y(3.6.8)93 b(Duplicating)32 b(File)f(Descriptors)25 |
037a8b7f CR |
7812 | b Fn(:)15 b(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7813 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)37 | |
e59452c7 | 7814 | b Fu(40)399 1069 y(3.6.9)93 b(Mo)m(ving)32 b(File)f(Descriptors)d |
6e51e0d0 | 7815 | Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
037a8b7f | 7816 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
e59452c7 | 7817 | 40 b Fu(41)399 1179 y(3.6.10)93 b(Op)s(ening)29 b(File)j(Descriptors)f |
037a8b7f | 7818 | (for)f(Reading)h(and)f(W)-8 b(riting)29 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f |
e59452c7 | 7819 | (:)41 b Fu(41)275 1289 y(3.7)92 b(Executing)31 b(Commands)24 |
037a8b7f CR |
7820 | b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7821 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
e59452c7 | 7822 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 b Fu(41)399 1398 y(3.7.1)93 |
037a8b7f CR |
7823 | b(Simple)30 b(Command)f(Expansion)11 b Fn(:)k(:)g(:)h(:)f(:)g(:)h(:)f |
7824 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
e59452c7 | 7825 | h(:)f(:)g(:)h(:)f(:)24 b Fu(41)399 1508 y(3.7.2)93 b(Command)29 |
037a8b7f CR |
7826 | b(Searc)m(h)i(and)f(Execution)15 b Fn(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7827 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
e59452c7 | 7828 | 28 b Fu(42)399 1617 y(3.7.3)93 b(Command)29 b(Execution)i(En)m |
037a8b7f | 7829 | (vironmen)m(t)17 b Fn(:)e(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
e59452c7 | 7830 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)30 b Fu(42)399 |
d37a4722 | 7831 | 1727 y(3.7.4)93 b(En)m(vironmen)m(t)26 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h |
037a8b7f | 7832 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
c302751c | 7833 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
3011048a | 7834 | (:)f(:)g(:)h(:)39 b Fu(44)399 1836 y(3.7.5)93 b(Exit)31 |
037a8b7f | 7835 | b(Status)16 b Fn(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
c302751c | 7836 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
037a8b7f | 7837 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)29 |
e59452c7 | 7838 | b Fu(44)399 1946 y(3.7.6)93 b(Signals)23 b Fn(:)15 b(:)h(:)f(:)h(:)f(:) |
037a8b7f CR |
7839 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7840 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
3011048a | 7841 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)36 b Fu(45)275 |
d37a4722 | 7842 | 2056 y(3.8)92 b(Shell)30 b(Scripts)12 b Fn(:)i(:)i(:)f(:)h(:)f(:)h(:)f |
c302751c CR |
7843 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7844 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
3011048a | 7845 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)25 b Fu(46)150 2306 |
037a8b7f CR |
7846 | y Fs(4)135 b(Shell)45 b(Builtin)g(Commands)14 b Fo(:)20 |
7847 | b(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
e59452c7 | 7848 | (:)h(:)f(:)h(:)f(:)27 b Fs(47)275 2443 y Fu(4.1)92 b(Bourne)30 |
037a8b7f CR |
7849 | b(Shell)g(Builtins)16 b Fn(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7850 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7851 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)29 | |
e59452c7 | 7852 | b Fu(47)275 2553 y(4.2)92 b(Bash)30 b(Builtin)h(Commands)13 |
037a8b7f CR |
7853 | b Fn(:)h(:)i(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
7854 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
e59452c7 | 7855 | (:)f(:)g(:)h(:)f(:)26 b Fu(54)275 2663 y(4.3)92 b(Mo)s(difying)30 |
037a8b7f CR |
7856 | b(Shell)g(Beha)m(vior)18 b Fn(:)f(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7857 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
e59452c7 | 7858 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)31 b Fu(66)399 |
d37a4722 | 7859 | 2772 y(4.3.1)93 b(The)30 b(Set)g(Builtin)14 b Fn(:)i(:)f(:)h(:)f(:)g(:) |
037a8b7f CR |
7860 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7861 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
e59452c7 | 7862 | f(:)g(:)27 b Fu(66)399 2882 y(4.3.2)93 b(The)30 b(Shopt)f(Builtin)21 |
037a8b7f CR |
7863 | b Fn(:)16 b(:)g(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7864 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
e59452c7 | 7865 | h(:)f(:)h(:)f(:)g(:)h(:)34 b Fu(70)275 2991 y(4.4)92 |
037a8b7f CR |
7866 | b(Sp)s(ecial)30 b(Builtins)9 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7867 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
7868 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
e59452c7 | 7869 | f(:)g(:)h(:)f(:)22 b Fu(76)150 3242 y Fs(5)135 b(Shell)45 |
037a8b7f CR |
7870 | b(V)-11 b(ariables)11 b Fo(:)20 b(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f |
7871 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:) | |
e59452c7 | 7872 | f(:)h(:)f(:)g(:)h(:)f(:)24 b Fs(77)275 3379 y Fu(5.1)92 |
037a8b7f CR |
7873 | b(Bourne)30 b(Shell)g(V)-8 b(ariables)10 b Fn(:)17 b(:)e(:)g(:)h(:)f(:) |
7874 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
c302751c | 7875 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
e59452c7 | 7876 | 23 b Fu(77)275 3489 y(5.2)92 b(Bash)30 b(V)-8 b(ariables)26 |
037a8b7f CR |
7877 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7878 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7879 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)38 | |
e59452c7 | 7880 | b Fu(77)150 3739 y Fs(6)135 b(Bash)44 b(F)-11 b(eatures)32 |
037a8b7f CR |
7881 | b Fo(:)19 b(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h |
7882 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
e59452c7 | 7883 | 44 b Fs(90)275 3876 y Fu(6.1)92 b(In)m(v)m(oking)31 b(Bash)16 |
037a8b7f | 7884 | b Fn(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
c302751c | 7885 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
037a8b7f | 7886 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)29 |
e59452c7 | 7887 | b Fu(90)275 3986 y(6.2)92 b(Bash)30 b(Startup)g(Files)f |
037a8b7f CR |
7888 | Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7889 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
e59452c7 | 7890 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)41 b Fu(92)275 |
d37a4722 | 7891 | 4095 y(6.3)92 b(In)m(teractiv)m(e)32 b(Shells)19 b Fn(:)d(:)f(:)h(:)f |
037a8b7f | 7892 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
c302751c | 7893 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
e59452c7 | 7894 | (:)h(:)f(:)g(:)h(:)f(:)h(:)32 b Fu(93)399 4205 y(6.3.1)93 |
037a8b7f CR |
7895 | b(What)31 b(is)f(an)h(In)m(teractiv)m(e)h(Shell?)25 b |
7896 | Fn(:)16 b(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7897 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 | |
e59452c7 | 7898 | b Fu(94)399 4315 y(6.3.2)93 b(Is)30 b(this)g(Shell)g(In)m(teractiv)m |
037a8b7f | 7899 | (e?)22 b Fn(:)d(:)c(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
c302751c | 7900 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
e59452c7 | 7901 | h(:)35 b Fu(94)399 4424 y(6.3.3)93 b(In)m(teractiv)m(e)33 |
037a8b7f CR |
7902 | b(Shell)d(Beha)m(vior)11 b Fn(:)17 b(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7903 | f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
e59452c7 | 7904 | (:)h(:)f(:)g(:)h(:)f(:)24 b Fu(94)275 4534 y(6.4)92 b(Bash)30 |
037a8b7f CR |
7905 | b(Conditional)h(Expressions)10 b Fn(:)k(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7906 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
e59452c7 | 7907 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)23 b Fu(95)275 4643 y(6.5)92 |
037a8b7f | 7908 | b(Shell)30 b(Arithmetic)13 b Fn(:)k(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
c302751c | 7909 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
037a8b7f | 7910 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
e59452c7 | 7911 | (:)h(:)26 b Fu(97)275 4753 y(6.6)92 b(Aliases)20 b Fn(:)d(:)e(:)h(:)f |
037a8b7f CR |
7912 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7913 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7914 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)33 | |
e59452c7 | 7915 | b Fu(99)275 4863 y(6.7)92 b(Arra)m(ys)25 b Fn(:)16 b(:)f(:)h(:)f(:)g(:) |
037a8b7f CR |
7916 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7917 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
7918 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)38 | |
e59452c7 CR |
7919 | b Fu(99)275 4972 y(6.8)92 b(The)29 b(Directory)j(Stac)m(k)14 |
7920 | b Fn(:)j(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
7921 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7922 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)27 b Fu(101)399 5082 y(6.8.1)93 | |
7923 | b(Directory)32 b(Stac)m(k)f(Builtins)20 b Fn(:)c(:)f(:)h(:)f(:)h(:)f(:) | |
7924 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7925 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)33 b Fu(101)275 5191 | |
7926 | y(6.9)92 b(Con)m(trolling)31 b(the)g(Prompt)10 b Fn(:)15 | |
7927 | b(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h | |
037a8b7f | 7928 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
e59452c7 CR |
7929 | h(:)f(:)h(:)23 b Fu(103)275 5301 y(6.10)92 b(The)30 b(Restricted)h |
7930 | (Shell)9 b Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7931 | g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g | |
7932 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)22 b Fu(104)p | |
7933 | eop end | |
8e1a6eaa | 7934 | %%Page: -3 5 |
d37a4722 CR |
7935 | TeXDict begin -3 4 bop 3674 -116 a Fu(iii)275 83 y(6.11)92 |
7936 | b(Bash)31 b(POSIX)e(Mo)s(de)14 b Fn(:)i(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
7937 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
7938 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)28 | |
e59452c7 | 7939 | b Fu(105)275 193 y(6.12)92 b(Shell)30 b(Compatibilit)m(y)i(Mo)s(de)25 |
d37a4722 CR |
7940 | b Fn(:)15 b(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
7941 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
fffe80d4 | 7942 | h(:)38 b Fu(109)150 443 y Fs(7)135 b(Job)45 b(Con)l(trol)35 |
d37a4722 CR |
7943 | b Fo(:)20 b(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h |
7944 | (:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) | |
fffe80d4 | 7945 | g(:)48 b Fs(112)275 580 y Fu(7.1)92 b(Job)30 b(Con)m(trol)h(Basics)23 |
d37a4722 CR |
7946 | b Fn(:)16 b(:)g(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
7947 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) | |
fffe80d4 | 7948 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)36 b Fu(112)275 690 |
d37a4722 CR |
7949 | y(7.2)92 b(Job)30 b(Con)m(trol)h(Builtins)11 b Fn(:)k(:)g(:)h(:)f(:)h |
7950 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
9f178efb | 7951 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
fffe80d4 | 7952 | (:)f(:)24 b Fu(113)275 800 y(7.3)92 b(Job)30 b(Con)m(trol)h(V)-8 |
037a8b7f CR |
7953 | b(ariables)26 b Fn(:)15 b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7954 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
fffe80d4 | 7955 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)38 b Fu(115)150 |
d37a4722 | 7956 | 1050 y Fs(8)135 b(Command)45 b(Line)g(Editing)11 b Fo(:)20 |
037a8b7f | 7957 | b(:)g(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f |
fffe80d4 | 7958 | (:)g(:)h(:)f(:)h(:)k Fs(116)275 1187 y Fu(8.1)92 b(In)m(tro)s(duction) |
d37a4722 CR |
7959 | 30 b(to)h(Line)f(Editing)12 b Fn(:)k(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
7960 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
fffe80d4 | 7961 | (:)h(:)f(:)g(:)h(:)f(:)h(:)25 b Fu(116)275 1297 y(8.2)92 |
037a8b7f CR |
7962 | b(Readline)31 b(In)m(teraction)14 b Fn(:)j(:)e(:)g(:)h(:)f(:)h(:)f(:)g |
7963 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
7964 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)27 | |
fffe80d4 | 7965 | b Fu(116)399 1406 y(8.2.1)93 b(Readline)31 b(Bare)g(Essen)m(tials)13 |
037a8b7f CR |
7966 | b Fn(:)j(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7967 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)26 | |
fffe80d4 | 7968 | b Fu(117)399 1516 y(8.2.2)93 b(Readline)31 b(Mo)m(v)m(emen)m(t)i |
037a8b7f CR |
7969 | (Commands)13 b Fn(:)i(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
7970 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)27 | |
fffe80d4 | 7971 | b Fu(117)399 1626 y(8.2.3)93 b(Readline)31 b(Killing)g(Commands)24 |
037a8b7f CR |
7972 | b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
7973 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 | |
fffe80d4 | 7974 | b Fu(118)399 1735 y(8.2.4)93 b(Readline)31 b(Argumen)m(ts)17 |
037a8b7f CR |
7975 | b Fn(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
7976 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
fffe80d4 | 7977 | (:)f(:)h(:)30 b Fu(118)399 1845 y(8.2.5)93 b(Searc)m(hing)31 |
037a8b7f | 7978 | b(for)f(Commands)f(in)h(the)h(History)15 b Fn(:)g(:)h(:)f(:)h(:)f(:)h |
fffe80d4 | 7979 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)28 b Fu(118)275 |
d37a4722 | 7980 | 1954 y(8.3)92 b(Readline)31 b(Init)f(File)8 b Fn(:)17 |
037a8b7f CR |
7981 | b(:)e(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
7982 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
fffe80d4 | 7983 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)22 b Fu(119)399 2064 |
037a8b7f CR |
7984 | y(8.3.1)93 b(Readline)31 b(Init)f(File)i(Syn)m(tax)21 |
7985 | b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
7986 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)34 | |
fffe80d4 | 7987 | b Fu(119)399 2174 y(8.3.2)93 b(Conditional)31 b(Init)f(Constructs)14 |
037a8b7f CR |
7988 | b Fn(:)h(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
7989 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)27 | |
fffe80d4 | 7990 | b Fu(127)399 2283 y(8.3.3)93 b(Sample)30 b(Init)g(File)20 |
037a8b7f CR |
7991 | b Fn(:)d(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
7992 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
fffe80d4 | 7993 | (:)h(:)f(:)g(:)h(:)f(:)h(:)33 b Fu(129)275 2393 y(8.4)92 |
037a8b7f | 7994 | b(Bindable)30 b(Readline)h(Commands)19 b Fn(:)c(:)g(:)h(:)f(:)h(:)f(:)g |
9f178efb | 7995 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
fffe80d4 | 7996 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)33 b Fu(132)399 2502 y(8.4.1)93 |
037a8b7f CR |
7997 | b(Commands)29 b(F)-8 b(or)31 b(Mo)m(ving)16 b Fn(:)h(:)e(:)h(:)f(:)g(:) |
7998 | h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
fffe80d4 | 7999 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)29 b Fu(132)399 |
d37a4722 | 8000 | 2612 y(8.4.2)93 b(Commands)29 b(F)-8 b(or)31 b(Manipulating)g(The)f |
037a8b7f | 8001 | (History)c Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
fffe80d4 | 8002 | f(:)39 b Fu(133)399 2721 y(8.4.3)93 b(Commands)29 b(F)-8 |
037a8b7f CR |
8003 | b(or)31 b(Changing)f(T)-8 b(ext)9 b Fn(:)17 b(:)e(:)h(:)f(:)h(:)f(:)g |
8004 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:) | |
fffe80d4 | 8005 | h(:)f(:)23 b Fu(135)399 2831 y(8.4.4)93 b(Killing)31 |
037a8b7f | 8006 | b(And)e(Y)-8 b(anking)10 b Fn(:)17 b(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
9f178efb | 8007 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
fffe80d4 | 8008 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)24 b Fu(136)399 |
d37a4722 | 8009 | 2941 y(8.4.5)93 b(Sp)s(ecifying)30 b(Numeric)g(Argumen)m(ts)25 |
037a8b7f | 8010 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
fffe80d4 | 8011 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)39 b Fu(137)399 |
d37a4722 | 8012 | 3050 y(8.4.6)93 b(Letting)31 b(Readline)g(T)m(yp)s(e)f(F)-8 |
037a8b7f CR |
8013 | b(or)31 b(Y)-8 b(ou)20 b Fn(:)c(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
8014 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)33 | |
fffe80d4 | 8015 | b Fu(138)399 3160 y(8.4.7)93 b(Keyb)s(oard)29 b(Macros)9 |
6e51e0d0 | 8016 | b Fn(:)17 b(:)e(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
c302751c | 8017 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
fffe80d4 | 8018 | h(:)f(:)h(:)f(:)g(:)h(:)22 b Fu(139)399 3269 y(8.4.8)93 |
037a8b7f | 8019 | b(Some)30 b(Miscellaneous)j(Commands)14 b Fn(:)f(:)j(:)f(:)h(:)f(:)g(:) |
c302751c | 8020 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
fffe80d4 | 8021 | (:)f(:)27 b Fu(140)275 3379 y(8.5)92 b(Readline)31 b(vi)f(Mo)s(de)e |
037a8b7f | 8022 | Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
c302751c | 8023 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
fffe80d4 | 8024 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)41 b Fu(142)275 |
d37a4722 | 8025 | 3489 y(8.6)92 b(Programmable)30 b(Completion)25 b Fn(:)15 |
037a8b7f CR |
8026 | b(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
8027 | (:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)37 | |
fffe80d4 | 8028 | b Fu(142)275 3598 y(8.7)92 b(Programmable)30 b(Completion)h(Builtins)14 |
037a8b7f | 8029 | b Fn(:)i(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
fffe80d4 | 8030 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)28 b Fu(145)275 |
d37a4722 | 8031 | 3708 y(8.8)92 b(A)30 b(Programmable)h(Completion)g(Example)8 |
037a8b7f | 8032 | b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
fffe80d4 | 8033 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)22 b Fu(149)150 3958 y |
037a8b7f CR |
8034 | Fs(9)135 b(Using)45 b(History)h(In)l(teractiv)l(ely)28 |
8035 | b Fo(:)22 b(:)d(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g | |
fffe80d4 | 8036 | (:)h(:)41 b Fs(151)275 4095 y Fu(9.1)92 b(Bash)30 b(History)h(F)-8 |
037a8b7f | 8037 | b(acilities)9 b Fn(:)19 b(:)c(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
c302751c | 8038 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
fffe80d4 | 8039 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)22 b Fu(151)275 |
d37a4722 | 8040 | 4205 y(9.2)92 b(Bash)30 b(History)h(Builtins)d Fn(:)16 |
037a8b7f CR |
8041 | b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
8042 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
fffe80d4 | 8043 | h(:)f(:)h(:)f(:)41 b Fu(151)275 4315 y(9.3)92 b(History)31 |
037a8b7f CR |
8044 | b(Expansion)10 b Fn(:)k(:)h(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
8045 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
8046 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)23 | |
fffe80d4 | 8047 | b Fu(153)399 4424 y(9.3.1)93 b(Ev)m(en)m(t)31 b(Designators)19 |
037a8b7f CR |
8048 | b Fn(:)e(:)e(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
8049 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f | |
fffe80d4 | 8050 | (:)h(:)f(:)g(:)h(:)32 b Fu(154)399 4534 y(9.3.2)93 b(W)-8 |
037a8b7f CR |
8051 | b(ord)31 b(Designators)c Fn(:)15 b(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
8052 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
fffe80d4 | 8053 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)39 b Fu(155)399 |
d37a4722 | 8054 | 4643 y(9.3.3)93 b(Mo)s(di\014ers)15 b Fn(:)g(:)g(:)h(:)f(:)g(:)h(:)f(:) |
037a8b7f | 8055 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
c302751c | 8056 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
fffe80d4 | 8057 | h(:)f(:)h(:)f(:)g(:)29 b Fu(155)p eop end |
967625cd CR |
8058 | %%Page: -4 6 |
8059 | TeXDict begin -4 5 bop 3677 -116 a Fu(iv)150 83 y Fs(10)135 | |
037a8b7f CR |
8060 | b(Installing)46 b(Bash)16 b Fo(:)j(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
8061 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) | |
fffe80d4 | 8062 | f(:)h(:)f(:)29 b Fs(157)275 220 y Fu(10.1)92 b(Basic)32 |
037a8b7f | 8063 | b(Installation)8 b Fn(:)17 b(:)f(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) |
c302751c | 8064 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
037a8b7f | 8065 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)22 |
fffe80d4 | 8066 | b Fu(157)275 330 y(10.2)92 b(Compilers)30 b(and)g(Options)17 |
037a8b7f CR |
8067 | b Fn(:)d(:)i(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
8068 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
fffe80d4 | 8069 | (:)f(:)h(:)f(:)30 b Fu(158)275 439 y(10.3)92 b(Compiling)30 |
037a8b7f CR |
8070 | b(F)-8 b(or)32 b(Multiple)f(Arc)m(hitectures)10 b Fn(:)16 |
8071 | b(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f | |
fffe80d4 | 8072 | (:)g(:)h(:)f(:)h(:)f(:)23 b Fu(158)275 549 y(10.4)92 |
037a8b7f CR |
8073 | b(Installation)32 b(Names)22 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:) |
8074 | f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
8075 | (:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)35 | |
fffe80d4 | 8076 | b Fu(159)275 658 y(10.5)92 b(Sp)s(ecifying)30 b(the)g(System)h(T)m(yp)s |
037a8b7f | 8077 | (e)21 b Fn(:)14 b(:)i(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
c302751c | 8078 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
fffe80d4 | 8079 | h(:)34 b Fu(159)275 768 y(10.6)92 b(Sharing)30 b(Defaults)24 |
037a8b7f | 8080 | b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f |
c302751c | 8081 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
fffe80d4 | 8082 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)37 b Fu(159)275 |
037a8b7f | 8083 | 878 y(10.7)92 b(Op)s(eration)30 b(Con)m(trols)12 b Fn(:)k(:)f(:)h(:)f |
c302751c | 8084 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) |
037a8b7f | 8085 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f |
fffe80d4 | 8086 | (:)h(:)f(:)25 b Fu(160)275 987 y(10.8)92 b(Optional)31 |
037a8b7f CR |
8087 | b(F)-8 b(eatures)19 b Fn(:)d(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) |
8088 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h | |
8089 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)32 | |
fffe80d4 | 8090 | b Fu(160)150 1238 y Fs(App)t(endix)44 b(A)119 b(Rep)t(orting)46 |
037a8b7f | 8091 | b(Bugs)21 b Fo(:)f(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h |
5e6f45d9 | 8092 | (:)f(:)g(:)h(:)f(:)35 b Fs(166)150 1498 y(App)t(endix)44 |
037a8b7f CR |
8093 | b(B)125 b(Ma)7 b(jor)46 b(Di\013erences)g(F)-11 b(rom)284 |
8094 | 1639 y(The)45 b(Bourne)f(Shell)35 b Fo(:)19 b(:)h(:)f(:)h(:)f(:)h(:)f | |
8095 | (:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)h(:) | |
5e6f45d9 | 8096 | f(:)g(:)h(:)f(:)h(:)47 b Fs(167)275 1776 y Fu(B.1)92 |
037a8b7f CR |
8097 | b(Implemen)m(tation)31 b(Di\013erences)h(F)-8 b(rom)31 |
8098 | b(The)e(SVR4.2)j(Shell)22 b Fn(:)15 b(:)g(:)g(:)h(:)f(:)h(:)f(:)g(:)h | |
5e6f45d9 | 8099 | (:)35 b Fu(171)150 2027 y Fs(App)t(endix)44 b(C)124 b(GNU)36 |
037a8b7f | 8100 | b(F)-11 b(ree)35 b(Do)t(cumen)l(tation)i(License)25 b |
5e6f45d9 | 8101 | Fo(:)20 b(:)29 b Fs(173)150 2305 y(App)t(endix)44 b(D)118 |
037a8b7f CR |
8102 | b(Indexes)27 b Fo(:)20 b(:)g(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:) |
8103 | h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)40 | |
5e6f45d9 | 8104 | b Fs(181)275 2442 y Fu(D.1)92 b(Index)29 b(of)i(Shell)f(Builtin)h |
037a8b7f CR |
8105 | (Commands)23 b Fn(:)16 b(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:) |
8106 | g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)38 | |
5e6f45d9 | 8107 | b Fu(181)275 2552 y(D.2)92 b(Index)29 b(of)i(Shell)f(Reserv)m(ed)h(W)-8 |
037a8b7f CR |
8108 | b(ords)20 b Fn(:)c(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)h(:)f |
8109 | (:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)34 | |
5e6f45d9 | 8110 | b Fu(182)275 2661 y(D.3)92 b(P)m(arameter)31 b(and)f(V)-8 |
037a8b7f CR |
8111 | b(ariable)32 b(Index)27 b Fn(:)16 b(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g |
8112 | (:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:) | |
5e6f45d9 | 8113 | h(:)f(:)g(:)42 b Fu(183)275 2771 y(D.4)92 b(F)-8 b(unction)31 |
037a8b7f CR |
8114 | b(Index)24 b Fn(:)15 b(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h |
8115 | (:)f(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:) | |
8116 | f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)38 | |
5e6f45d9 | 8117 | b Fu(185)275 2880 y(D.5)92 b(Concept)30 b(Index)15 b |
037a8b7f CR |
8118 | Fn(:)g(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h |
8119 | (:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:) | |
8120 | h(:)f(:)h(:)f(:)g(:)h(:)f(:)h(:)f(:)g(:)h(:)f(:)29 b | |
5e6f45d9 | 8121 | Fu(187)p eop end |
5e13499c | 8122 | %%Page: 1 7 |
037a8b7f CR |
8123 | TeXDict begin 1 6 bop 3705 -116 a Fu(1)150 299 y Fp(1)80 |
8124 | b(In)l(tro)t(duction)150 604 y Fs(1.1)68 b(What)45 b(is)g(Bash?)150 | |
8125 | 763 y Fu(Bash)38 b(is)g(the)g(shell,)i(or)d(command)h(language)h(in)m | |
6e51e0d0 | 8126 | (terpreter,)h(for)e(the)g Fm(gnu)f Fu(op)s(erating)h(system.)63 |
967625cd | 8127 | b(The)150 873 y(name)33 b(is)g(an)g(acron)m(ym)g(for)g(the)g(`)p |
6e51e0d0 | 8128 | Ft(Bourne-Again)27 b(SHell)p Fu(',)32 b(a)i(pun)d(on)i(Stephen)f |
967625cd | 8129 | (Bourne,)h(the)g(author)150 983 y(of)f(the)f(direct)h(ancestor)h(of)e |
6e51e0d0 | 8130 | (the)h(curren)m(t)f(Unix)g(shell)h Ft(sh)p Fu(,)f(whic)m(h)g(app)s |
967625cd | 8131 | (eared)g(in)g(the)h(Sev)m(en)m(th)g(Edition)150 1092 |
37c41ab1 | 8132 | y(Bell)g(Labs)e(Researc)m(h)h(v)m(ersion)g(of)f(Unix.)275 |
967625cd | 8133 | 1221 y(Bash)f(is)g(largely)i(compatible)f(with)f Ft(sh)g |
6e51e0d0 CR |
8134 | Fu(and)g(incorp)s(orates)g(useful)g(features)g(from)g(the)g(Korn)g |
8135 | (shell)150 1330 y Ft(ksh)37 b Fu(and)h(the)g(C)g(shell)g | |
8136 | Ft(csh)p Fu(.)64 b(It)38 b(is)g(in)m(tended)g(to)h(b)s(e)f(a)g | |
8137 | (conforman)m(t)h(implemen)m(tation)h(of)e(the)g Fm(ieee)150 | |
967625cd | 8138 | 1440 y(posix)c Fu(Shell)g(and)g(T)-8 b(o)s(ols)35 b(p)s(ortion)f(of)g |
6e51e0d0 | 8139 | (the)h Fm(ieee)f(posix)f Fu(sp)s(eci\014cation)j(\()p |
967625cd | 8140 | Fm(ieee)e Fu(Standard)f(1003.1\).)56 b(It)150 1550 y(o\013ers)31 |
6e51e0d0 CR |
8141 | b(functional)f(impro)m(v)m(emen)m(ts)i(o)m(v)m(er)g Ft(sh)d |
8142 | Fu(for)i(b)s(oth)e(in)m(teractiv)m(e)k(and)d(programming)g(use.)275 | |
967625cd | 8143 | 1678 y(While)h(the)g Fm(gnu)f Fu(op)s(erating)h(system)g(pro)m(vides)f |
37c41ab1 | 8144 | (other)h(shells,)g(including)f(a)h(v)m(ersion)g(of)g |
6e51e0d0 CR |
8145 | Ft(csh)p Fu(,)f(Bash)150 1788 y(is)j(the)h(default)f(shell.)49 |
8146 | b(Lik)m(e)34 b(other)g Fm(gnu)f Fu(soft)m(w)m(are,)i(Bash)f(is)f(quite) | |
37c41ab1 | 8147 | h(p)s(ortable.)49 b(It)33 b(curren)m(tly)g(runs)f(on)150 |
967625cd | 8148 | 1897 y(nearly)c(ev)m(ery)g(v)m(ersion)g(of)f(Unix)h(and)e(a)i(few)f |
6e51e0d0 | 8149 | (other)h(op)s(erating)g(systems)f Fq(\000)g Fu(indep)s(enden)m |
967625cd | 8150 | (tly-supp)s(orted)150 2007 y(p)s(orts)j(exist)h(for)f |
6e51e0d0 | 8151 | Fm(ms-dos)p Fu(,)f Fm(os/2)p Fu(,)i(and)f(Windo)m(ws)g(platforms.)150 |
967625cd | 8152 | 2236 y Fs(1.2)68 b(What)45 b(is)g(a)h(shell?)150 2395 |
6e51e0d0 | 8153 | y Fu(A)m(t)32 b(its)f(base,)h(a)f(shell)g(is)h(simply)e(a)h(macro)h |
c302751c | 8154 | (pro)s(cessor)f(that)g(executes)i(commands.)42 b(The)30 |
967625cd | 8155 | b(term)h(macro)150 2505 y(pro)s(cessor)25 b(means)g(functionalit)m(y)i |
c302751c | 8156 | (where)d(text)j(and)d(sym)m(b)s(ols)h(are)h(expanded)e(to)i(create)h |
967625cd | 8157 | (larger)f(expres-)150 2615 y(sions.)275 2743 y(A)34 b(Unix)h(shell)g |
c302751c | 8158 | (is)f(b)s(oth)g(a)h(command)g(in)m(terpreter)g(and)f(a)h(programming)f |
967625cd | 8159 | (language.)55 b(As)35 b(a)g(com-)150 2853 y(mand)30 b(in)m(terpreter,)i |
37c41ab1 | 8160 | (the)g(shell)f(pro)m(vides)g(the)h(user)e(in)m(terface)j(to)f(the)f |
6e51e0d0 | 8161 | (ric)m(h)h(set)g(of)f Fm(gnu)g Fu(utilities.)44 b(The)150 |
967625cd | 8162 | 2962 y(programming)30 b(language)h(features)f(allo)m(w)h(these)g |
d3ad40de | 8163 | (utilities)g(to)g(b)s(e)e(com)m(bined.)41 b(Files)31 |
967625cd | 8164 | b(con)m(taining)g(com-)150 3072 y(mands)e(can)i(b)s(e)e(created,)j(and) |
37c41ab1 | 8165 | d(b)s(ecome)i(commands)f(themselv)m(es.)42 b(These)30 |
967625cd | 8166 | b(new)f(commands)h(ha)m(v)m(e)i(the)150 3182 y(same)j(status)g(as)g |
6e51e0d0 CR |
8167 | (system)g(commands)f(in)g(directories)i(suc)m(h)e(as)h |
8168 | Ft(/bin)p Fu(,)g(allo)m(wing)h(users)e(or)g(groups)g(to)150 | |
967625cd CR |
8169 | 3291 y(establish)d(custom)f(en)m(vironmen)m(ts)h(to)g(automate)h(their) |
8170 | f(common)f(tasks.)275 3420 y(Shells)j(ma)m(y)h(b)s(e)f(used)g(in)m | |
37c41ab1 CR |
8171 | (teractiv)m(ely)k(or)d(non-in)m(teractiv)m(ely)-8 b(.)54 |
8172 | b(In)33 b(in)m(teractiv)m(e)j(mo)s(de,)f(they)e(accept)150 | |
967625cd | 8173 | 3529 y(input)21 b(t)m(yp)s(ed)h(from)g(the)h(k)m(eyb)s(oard.)37 |
37c41ab1 | 8174 | b(When)22 b(executing)i(non-in)m(teractiv)m(ely)-8 b(,)27 |
967625cd CR |
8175 | b(shells)c(execute)g(commands)150 3639 y(read)30 b(from)g(a)h(\014le.) |
8176 | 275 3768 y(A)41 b(shell)g(allo)m(ws)h(execution)h(of)e | |
6e51e0d0 | 8177 | Fm(gnu)g Fu(commands,)i(b)s(oth)e(sync)m(hronously)f(and)h(async)m |
967625cd | 8178 | (hronously)-8 b(.)150 3877 y(The)29 b(shell)g(w)m(aits)i(for)e(sync)m |
d3ad40de | 8179 | (hronous)f(commands)h(to)h(complete)h(b)s(efore)e(accepting)i(more)e |
967625cd | 8180 | (input;)g(asyn-)150 3987 y(c)m(hronous)22 b(commands)h(con)m(tin)m(ue)h |
37c41ab1 | 8181 | (to)f(execute)h(in)e(parallel)i(with)f(the)f(shell)h(while)g(it)g |
967625cd | 8182 | (reads)g(and)f(executes)150 4096 y(additional)35 b(commands.)50 |
6e51e0d0 | 8183 | b(The)33 b Fr(redirection)h Fu(constructs)g(p)s(ermit)f(\014ne-grained) |
967625cd | 8184 | g(con)m(trol)i(of)f(the)g(input)150 4206 y(and)40 b(output)f(of)i |
37c41ab1 CR |
8185 | (those)f(commands.)70 b(Moreo)m(v)m(er,)45 b(the)c(shell)f(allo)m(ws)h |
8186 | (con)m(trol)h(o)m(v)m(er)g(the)e(con)m(ten)m(ts)i(of)150 | |
967625cd | 8187 | 4316 y(commands')30 b(en)m(vironmen)m(ts.)275 4444 y(Shells)k(also)i |
37c41ab1 | 8188 | (pro)m(vide)g(a)f(small)h(set)f(of)g(built-in)g(commands)g(\()p |
6e51e0d0 | 8189 | Fr(builtins)t Fu(\))g(implemen)m(ting)h(function-)150 |
967625cd | 8190 | 4554 y(alit)m(y)i(imp)s(ossible)e(or)g(incon)m(v)m(enien)m(t)j(to)e |
37c41ab1 | 8191 | (obtain)g(via)g(separate)g(utilities.)61 b(F)-8 b(or)37 |
967625cd | 8192 | b(example,)i Ft(cd)p Fu(,)e Ft(break)p Fu(,)150 4663 |
6e51e0d0 | 8193 | y Ft(continue)p Fu(,)28 b(and)i Ft(exec)f Fu(cannot)i(b)s(e)f(implemen) |
74d0116b | 8194 | m(ted)h(outside)g(of)f(the)h(shell)f(b)s(ecause)h(they)f(directly)h |
967625cd | 8195 | (ma-)150 4773 y(nipulate)d(the)g(shell)g(itself.)41 b(The)27 |
6e51e0d0 | 8196 | b Ft(history)p Fu(,)g Ft(getopts)p Fu(,)f Ft(kill)p Fu(,)i(or)g |
967625cd | 8197 | Ft(pwd)f Fu(builtins,)h(among)g(others,)h(could)150 4883 |
74d0116b CR |
8198 | y(b)s(e)34 b(implemen)m(ted)g(in)g(separate)h(utilities,)i(but)d(they)g |
8199 | (are)g(more)h(con)m(v)m(enien)m(t)h(to)f(use)f(as)g(builtin)g(com-)150 | |
967625cd | 8200 | 4992 y(mands.)40 b(All)31 b(of)f(the)h(shell)f(builtins)g(are)h |
74d0116b CR |
8201 | (describ)s(ed)e(in)h(subsequen)m(t)g(sections.)275 5121 |
8202 | y(While)39 b(executing)h(commands)e(is)g(essen)m(tial,)43 | |
c302751c CR |
8203 | b(most)c(of)g(the)g(p)s(o)m(w)m(er)f(\(and)g(complexit)m(y\))j(of)e |
8204 | (shells)150 5230 y(is)34 b(due)f(to)i(their)f(em)m(b)s(edded)f | |
8205 | (programming)h(languages.)52 b(Lik)m(e)35 b(an)m(y)f(high-lev)m(el)i | |
8206 | (language,)h(the)d(shell)150 5340 y(pro)m(vides)c(v)-5 | |
8207 | b(ariables,)32 b(\015o)m(w)e(con)m(trol)i(constructs,)f(quoting,)g(and) | |
8208 | f(functions.)p eop end | |
5e13499c | 8209 | %%Page: 2 8 |
6e51e0d0 | 8210 | TeXDict begin 2 7 bop 150 -116 a Fu(Chapter)30 b(1:)41 |
ad4aef08 CR |
8211 | b(In)m(tro)s(duction)2592 b(2)275 299 y(Shells)21 b(o\013er)i(features) |
8212 | f(geared)h(sp)s(eci\014cally)g(for)f(in)m(teractiv)m(e)j(use)d(rather)g | |
c302751c CR |
8213 | (than)g(to)h(augmen)m(t)g(the)f(pro-)150 408 y(gramming)32 |
8214 | b(language.)48 b(These)32 b(in)m(teractiv)m(e)j(features)d(include)g | |
8215 | (job)g(con)m(trol,)j(command)c(line)i(editing,)150 518 | |
8216 | y(command)d(history)g(and)g(aliases.)42 b(Eac)m(h)31 | |
37c41ab1 CR |
8217 | b(of)g(these)g(features)f(is)h(describ)s(ed)e(in)h(this)g(man)m(ual.)p |
8218 | eop end | |
5e13499c | 8219 | %%Page: 3 9 |
037a8b7f CR |
8220 | TeXDict begin 3 8 bop 3705 -116 a Fu(3)150 299 y Fp(2)80 |
8221 | b(De\014nitions)150 552 y Fu(These)30 b(de\014nitions)g(are)h(used)e | |
8222 | (throughout)h(the)h(remainder)f(of)g(this)h(man)m(ual.)150 | |
8223 | 720 y Ft(POSIX)240 b Fu(A)27 b(family)g(of)g(op)s(en)f(system)g | |
8224 | (standards)g(based)g(on)h(Unix.)39 b(Bash)27 b(is)g(primarily)f | |
8225 | (concerned)630 830 y(with)k(the)h(Shell)f(and)g(Utilities)i(p)s(ortion) | |
8226 | e(of)h(the)f Fm(posix)g Fu(1003.1)j(standard.)150 995 | |
8227 | y Ft(blank)240 b Fu(A)30 b(space)h(or)g(tab)f(c)m(haracter.)150 | |
8228 | 1161 y Ft(builtin)144 b Fu(A)35 b(command)g(that)g(is)g(implemen)m(ted) | |
8229 | g(in)m(ternally)h(b)m(y)f(the)g(shell)g(itself,)i(rather)d(than)h(b)m | |
8230 | (y)630 1271 y(an)30 b(executable)i(program)e(somewhere)h(in)f(the)g | |
8231 | (\014le)h(system.)150 1436 y Ft(control)d(operator)630 | |
8232 | 1546 y Fu(A)20 b Ft(token)f Fu(that)i(p)s(erforms)e(a)i(con)m(trol)g | |
6e51e0d0 CR |
8233 | (function.)37 b(It)21 b(is)f(a)h Ft(newline)d Fu(or)j(one)f(of)h(the)f |
8234 | (follo)m(wing:)630 1655 y(`)p Ft(||)p Fu(',)31 b(`)p | |
8235 | Ft(&&)p Fu(',)f(`)p Ft(&)p Fu(',)h(`)p Ft(;)p Fu(',)g(`)p | |
71574d7e CR |
8236 | Ft(;;)p Fu(',)f(`)p Ft(;&)p Fu(',)h(`)p Ft(;;&)p Fu(',)f(`)p |
8237 | Ft(|)p Fu(',)h(`)p Ft(|&)p Fu(',)f(`)p Ft(\()p Fu(',)h(or)f(`)p | |
8238 | Ft(\))p Fu('.)150 1821 y Ft(exit)f(status)630 1931 y | |
8239 | Fu(The)f(v)-5 b(alue)29 b(returned)e(b)m(y)h(a)h(command)f(to)h(its)g | |
8240 | (caller.)41 b(The)28 b(v)-5 b(alue)29 b(is)f(restricted)h(to)h(eigh)m | |
8241 | (t)630 2040 y(bits,)h(so)f(the)h(maxim)m(um)f(v)-5 b(alue)31 | |
8242 | b(is)f(255.)150 2206 y Ft(field)240 b Fu(A)27 b(unit)g(of)g(text)h | |
8243 | (that)g(is)f(the)g(result)g(of)g(one)h(of)f(the)g(shell)g(expansions.) | |
8244 | 40 b(After)27 b(expansion,)630 2315 y(when)e(executing)h(a)g(command,)h | |
8245 | (the)f(resulting)f(\014elds)g(are)h(used)f(as)h(the)g(command)f(name) | |
8246 | 630 2425 y(and)30 b(argumen)m(ts.)150 2591 y Ft(filename)96 | |
8247 | b Fu(A)30 b(string)h(of)f(c)m(haracters)i(used)e(to)h(iden)m(tify)g(a)f | |
8248 | (\014le.)150 2756 y Ft(job)336 b Fu(A)31 b(set)h(of)f(pro)s(cesses)g | |
8249 | (comprising)g(a)g(pip)s(eline,)g(and)g(an)m(y)g(pro)s(cesses)g | |
8250 | (descended)g(from)f(it,)630 2866 y(that)h(are)g(all)g(in)f(the)h(same)f | |
8251 | (pro)s(cess)g(group.)150 3031 y Ft(job)f(control)630 | |
8252 | 3141 y Fu(A)22 b(mec)m(hanism)g(b)m(y)f(whic)m(h)h(users)f(can)h | |
8253 | (selectiv)m(ely)i(stop)e(\(susp)s(end\))e(and)h(restart)i(\(resume\)) | |
8254 | 630 3251 y(execution)32 b(of)e(pro)s(cesses.)150 3416 | |
8255 | y Ft(metacharacter)630 3526 y Fu(A)23 b(c)m(haracter)h(that,)h(when)d | |
8256 | (unquoted,)h(separates)h(w)m(ords.)37 b(A)23 b(metac)m(haracter)i(is)e | |
8257 | (a)g Ft(space)p Fu(,)630 3635 y Ft(tab)p Fu(,)29 b Ft(newline)p | |
8258 | Fu(,)e(or)i(one)h(of)f(the)h(follo)m(wing)g(c)m(haracters:)42 | |
8259 | b(`)p Ft(|)p Fu(',)29 b(`)p Ft(&)p Fu(',)h(`)p Ft(;)p | |
8260 | Fu(',)g(`)p Ft(\()p Fu(',)g(`)p Ft(\))p Fu(',)g(`)p Ft(<)p | |
8261 | Fu(',)f(or)h(`)p Ft(>)p Fu('.)150 3801 y Ft(name)288 | |
d7935593 CR |
8262 | b Fu(A)37 b Ft(word)f Fu(consisting)i(solely)h(of)e(letters,)j(n)m(um)m |
8263 | (b)s(ers,)e(and)f(underscores,)h(and)f(b)s(eginning)630 | |
8264 | 3910 y(with)23 b(a)g(letter)h(or)f(underscore.)38 b Ft(Name)p | |
8265 | Fu(s)22 b(are)h(used)f(as)i(shell)f(v)-5 b(ariable)24 | |
8266 | b(and)e(function)h(names.)630 4020 y(Also)31 b(referred)f(to)h(as)f(an) | |
8267 | h Ft(identifier)p Fu(.)150 4186 y Ft(operator)96 b Fu(A)38 | |
8268 | b Ft(control)28 b(operator)36 b Fu(or)h(a)i Ft(redirection)27 | |
8269 | b(operator)p Fu(.)61 b(See)38 b(Section)g(3.6)h([Redirec-)630 | |
e59452c7 | 8270 | 4295 y(tions],)f(page)f(37,)i(for)d(a)g(list)h(of)f(redirection)h(op)s |
d7935593 CR |
8271 | (erators.)58 b(Op)s(erators)35 b(con)m(tain)j(at)f(least)630 |
8272 | 4405 y(one)31 b(unquoted)e Ft(metacharacter)p Fu(.)150 | |
8273 | 4570 y Ft(process)f(group)630 4680 y Fu(A)i(collection)k(of)c(related)h | |
8274 | (pro)s(cesses)g(eac)m(h)g(ha)m(ving)g(the)g(same)f(pro)s(cess)g(group)g | |
6e51e0d0 CR |
8275 | Fm(id)p Fu(.)150 4846 y Ft(process)e(group)h(ID)630 4955 |
8276 | y Fu(A)h(unique)g(iden)m(ti\014er)h(that)f(represen)m(ts)h(a)g | |
8277 | Ft(process)d(group)h Fu(during)g(its)i(lifetime.)150 | |
8278 | 5121 y Ft(reserved)d(word)630 5230 y Fu(A)h Ft(word)e | |
8279 | Fu(that)i(has)f(a)h(sp)s(ecial)g(meaning)f(to)h(the)g(shell.)40 | |
ed35cb4a | 8280 | b(Most)30 b(reserv)m(ed)e(w)m(ords)g(in)m(tro)s(duce)630 |
a9fac3b2 | 8281 | 5340 y(shell)j(\015o)m(w)f(con)m(trol)i(constructs,)f(suc)m(h)f(as)g |
6e51e0d0 | 8282 | Ft(for)g Fu(and)g Ft(while)p Fu(.)p eop end |
5e13499c | 8283 | %%Page: 4 10 |
6e51e0d0 CR |
8284 | TeXDict begin 4 9 bop 150 -116 a Fu(Chapter)30 b(2:)41 |
8285 | b(De\014nitions)2662 b(4)150 299 y Ft(return)29 b(status)630 | |
8286 | 408 y Fu(A)h(synon)m(ym)g(for)g Ft(exit)g(status)p Fu(.)150 | |
8287 | 568 y Ft(signal)192 b Fu(A)40 b(mec)m(hanism)h(b)m(y)e(whic)m(h)h(a)h | |
a9fac3b2 CR |
8288 | (pro)s(cess)e(ma)m(y)i(b)s(e)e(noti\014ed)h(b)m(y)g(the)h(k)m(ernel)f |
8289 | (of)g(an)g(ev)m(en)m(t)630 677 y(o)s(ccurring)30 b(in)g(the)h(system.) | |
6e51e0d0 | 8290 | 150 837 y Ft(special)d(builtin)630 946 y Fu(A)j(shell)f(builtin)g |
a9fac3b2 | 8291 | (command)h(that)g(has)f(b)s(een)g(classi\014ed)h(as)g(sp)s(ecial)g(b)m |
6e51e0d0 CR |
8292 | (y)f(the)h Fm(posix)f Fu(stan-)630 1056 y(dard.)150 1215 |
8293 | y Ft(token)240 b Fu(A)38 b(sequence)h(of)f(c)m(haracters)h(considered)f | |
a9fac3b2 | 8294 | (a)h(single)g(unit)e(b)m(y)h(the)h(shell.)64 b(It)38 |
6e51e0d0 CR |
8295 | b(is)g(either)h(a)630 1325 y Ft(word)29 b Fu(or)i(an)f |
8296 | Ft(operator)p Fu(.)150 1484 y Ft(word)288 b Fu(A)28 b(sequence)g(of)g | |
a9fac3b2 CR |
8297 | (c)m(haracters)h(treated)g(as)f(a)g(unit)f(b)m(y)h(the)g(shell.)40 |
8298 | b(W)-8 b(ords)28 b(ma)m(y)g(not)g(include)630 1594 y(unquoted)i | |
6e51e0d0 | 8299 | Ft(metacharacters)p Fu(.)p eop end |
5e13499c | 8300 | %%Page: 5 11 |
037a8b7f CR |
8301 | TeXDict begin 5 10 bop 3705 -116 a Fu(5)150 299 y Fp(3)80 |
8302 | b(Basic)54 b(Shell)e(F)-13 b(eatures)150 601 y Fu(Bash)21 | |
8303 | b(is)g(an)f(acron)m(ym)i(for)e(`)p Ft(Bourne-Again)27 | |
6e51e0d0 | 8304 | b(SHell)p Fu('.)37 b(The)20 b(Bourne)g(shell)h(is)g(the)g(traditional)h |
967625cd | 8305 | (Unix)f(shell)150 710 y(originally)h(written)f(b)m(y)f(Stephen)g |
c302751c | 8306 | (Bourne.)38 b(All)21 b(of)g(the)g(Bourne)f(shell)h(builtin)f(commands)g |
967625cd | 8307 | (are)i(a)m(v)-5 b(ailable)150 820 y(in)26 b(Bash,)h(The)f(rules)f(for)h |
c302751c | 8308 | (ev)-5 b(aluation)28 b(and)d(quoting)h(are)h(tak)m(en)g(from)f(the)g |
967625cd CR |
8309 | Fm(posix)f Fu(sp)s(eci\014cation)i(for)f(the)150 929 |
8310 | y(`standard')k(Unix)g(shell.)275 1086 y(This)h(c)m(hapter)i(brie\015y)e | |
c302751c | 8311 | (summarizes)h(the)h(shell's)f(`building)g(blo)s(c)m(ks':)45 |
967625cd | 8312 | b(commands,)32 b(con)m(trol)i(struc-)150 1196 y(tures,)k(shell)e |
6e51e0d0 CR |
8313 | (functions,)h(shell)g Fl(p)-5 b(ar)g(ameters)p Fu(,)41 |
8314 | b(shell)36 b(expansions,)i Fl(r)-5 b(e)g(dir)g(e)g(ctions)p | |
967625cd | 8315 | Fu(,)40 b(whic)m(h)c(are)h(a)f(w)m(a)m(y)h(to)150 1306 |
c302751c CR |
8316 | y(direct)31 b(input)e(and)h(output)g(from)g(and)g(to)h(named)f |
8317 | (\014les,)g(and)g(ho)m(w)g(the)h(shell)g(executes)g(commands.)150 | |
967625cd | 8318 | 1580 y Fs(3.1)68 b(Shell)45 b(Syn)l(tax)150 1740 y Fu(When)40 |
c302751c CR |
8319 | b(the)h(shell)g(reads)f(input,)i(it)f(pro)s(ceeds)f(through)g(a)h |
8320 | (sequence)g(of)g(op)s(erations.)71 b(If)40 b(the)h(input)150 | |
967625cd | 8321 | 1849 y(indicates)31 b(the)f(b)s(eginning)f(of)h(a)g(commen)m(t,)h(the)f |
c302751c | 8322 | (shell)g(ignores)g(the)g(commen)m(t)h(sym)m(b)s(ol)f(\(`)p |
967625cd CR |
8323 | Ft(#)p Fu('\),)h(and)e(the)150 1959 y(rest)i(of)f(that)h(line.)275 |
8324 | 2116 y(Otherwise,)h(roughly)f(sp)s(eaking,)i(the)f(shell)g(reads)g(its) | |
c302751c | 8325 | g(input)f(and)h(divides)f(the)i(input)e(in)m(to)h(w)m(ords)150 |
967625cd | 8326 | 2225 y(and)23 b(op)s(erators,)j(emplo)m(ying)e(the)g(quoting)h(rules)e |
37c41ab1 | 8327 | (to)h(select)i(whic)m(h)d(meanings)h(to)h(assign)f(v)-5 |
967625cd CR |
8328 | b(arious)23 b(w)m(ords)150 2335 y(and)30 b(c)m(haracters.)275 |
8329 | 2492 y(The)38 b(shell)h(then)f(parses)g(these)h(tok)m(ens)h(in)m(to)f | |
37c41ab1 | 8330 | (commands)g(and)f(other)h(constructs,)i(remo)m(v)m(es)f(the)150 |
967625cd | 8331 | 2602 y(sp)s(ecial)31 b(meaning)f(of)g(certain)h(w)m(ords)f(or)g(c)m |
37c41ab1 | 8332 | (haracters,)i(expands)d(others,)h(redirects)h(input)e(and)g(output)150 |
967625cd | 8333 | 2711 y(as)d(needed,)g(executes)g(the)g(sp)s(eci\014ed)e(command,)j(w)m |
37c41ab1 | 8334 | (aits)f(for)f(the)g(command's)g(exit)i(status,)f(and)f(mak)m(es)150 |
967625cd | 8335 | 2821 y(that)31 b(exit)g(status)g(a)m(v)-5 b(ailable)33 |
37c41ab1 | 8336 | b(for)d(further)f(insp)s(ection)h(or)h(pro)s(cessing.)150 |
967625cd | 8337 | 3043 y Fk(3.1.1)63 b(Shell)41 b(Op)s(eration)150 3190 |
6e51e0d0 | 8338 | y Fu(The)c(follo)m(wing)h(is)f(a)h(brief)e(description)i(of)f(the)g |
c302751c | 8339 | (shell's)h(op)s(eration)f(when)f(it)i(reads)f(and)f(executes)j(a)150 |
967625cd CR |
8340 | 3299 y(command.)h(Basically)-8 b(,)34 b(the)c(shell)h(do)s(es)f(the)h |
8341 | (follo)m(wing:)199 3456 y(1.)61 b(Reads)42 b(its)h(input)e(from)h(a)g | |
3011048a | 8342 | (\014le)h(\(see)g(Section)g(3.8)g([Shell)f(Scripts],)j(page)e(46\),)k |
967625cd | 8343 | (from)41 b(a)i(string)330 3566 y(supplied)30 b(as)h(an)g(argumen)m(t)h |
6e51e0d0 | 8344 | (to)g(the)f Ft(-c)g Fu(in)m(v)m(o)s(cation)i(option)f(\(see)g(Section)g |
e59452c7 | 8345 | (6.1)g([In)m(v)m(oking)g(Bash],)330 3675 y(page)f(90\),)h(or)e(from)g |
967625cd | 8346 | (the)h(user's)f(terminal.)199 3821 y(2.)61 b(Breaks)43 |
37c41ab1 | 8347 | b(the)g(input)f(in)m(to)h(w)m(ords)f(and)g(op)s(erators,)k(ob)s(eying)d |
967625cd | 8348 | (the)g(quoting)g(rules)f(describ)s(ed)f(in)330 3931 y(Section)27 |
37c41ab1 | 8349 | b(3.1.2)i([Quoting],)f(page)f(6.)40 b(These)26 b(tok)m(ens)i(are)f |
6e51e0d0 | 8350 | (separated)g(b)m(y)f Ft(metacharacters)p Fu(.)36 b(Alias)330 |
967625cd | 8351 | 4040 y(expansion)30 b(is)h(p)s(erformed)d(b)m(y)j(this)f(step)g(\(see)i |
e59452c7 | 8352 | (Section)f(6.6)g([Aliases],)i(page)e(99\).)199 4186 y(3.)61 |
37c41ab1 CR |
8353 | b(P)m(arses)35 b(the)g(tok)m(ens)g(in)m(to)h(simple)e(and)g(comp)s |
8354 | (ound)f(commands)h(\(see)h(Section)h(3.2)f([Shell)g(Com-)330 | |
e59452c7 | 8355 | 4296 y(mands],)30 b(page)h(9\).)199 4442 y(4.)61 b(P)m(erforms)40 |
37c41ab1 | 8356 | b(the)h(v)-5 b(arious)40 b(shell)h(expansions)f(\(see)h(Section)g(3.5)g |
e59452c7 | 8357 | ([Shell)g(Expansions],)h(page)f(24\),)330 4551 y(breaking)35 |
37c41ab1 | 8358 | b(the)g(expanded)g(tok)m(ens)h(in)m(to)g(lists)f(of)g(\014lenames)h |
967625cd | 8359 | (\(see)g(Section)f(3.5.8)i([Filename)g(Ex-)330 4661 y(pansion],)30 |
e59452c7 | 8360 | b(page)h(35\))h(and)e(commands)g(and)g(argumen)m(ts.)199 |
967625cd | 8361 | 4807 y(5.)61 b(P)m(erforms)36 b(an)m(y)i(necessary)f(redirections)g |
e59452c7 | 8362 | (\(see)h(Section)f(3.6)h([Redirections],)i(page)e(37\))g(and)e(re-)330 |
967625cd | 8363 | 4916 y(mo)m(v)m(es)c(the)e(redirection)h(op)s(erators)g(and)f(their)g |
c302751c | 8364 | (op)s(erands)f(from)h(the)h(argumen)m(t)f(list.)199 5062 |
37c41ab1 | 8365 | y(6.)61 b(Executes)31 b(the)g(command)f(\(see)h(Section)g(3.7)h |
e59452c7 | 8366 | ([Executing)f(Commands],)f(page)h(41\).)199 5208 y(7.)61 |
37c41ab1 CR |
8367 | b(Optionally)40 b(w)m(aits)g(for)f(the)g(command)g(to)h(complete)g(and) |
8368 | f(collects)i(its)f(exit)g(status)f(\(see)h(Sec-)330 5317 | |
e59452c7 | 8369 | y(tion)31 b(3.7.5)h([Exit)f(Status],)g(page)g(44\).)p |
37c41ab1 | 8370 | eop end |
5e13499c | 8371 | %%Page: 6 12 |
6e51e0d0 | 8372 | TeXDict begin 6 11 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
ad4aef08 | 8373 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(6)150 299 |
6e51e0d0 | 8374 | y Fk(3.1.2)63 b(Quoting)150 446 y Fu(Quoting)32 b(is)h(used)e(to)i |
ad4aef08 CR |
8375 | (remo)m(v)m(e)h(the)e(sp)s(ecial)h(meaning)f(of)h(certain)g(c)m |
8376 | (haracters)g(or)f(w)m(ords)g(to)h(the)f(shell.)150 555 | |
8377 | y(Quoting)c(can)f(b)s(e)g(used)f(to)j(disable)e(sp)s(ecial)h(treatmen)m | |
8378 | (t)h(for)e(sp)s(ecial)h(c)m(haracters,)i(to)e(prev)m(en)m(t)g(reserv)m | |
8379 | (ed)150 665 y(w)m(ords)i(from)g(b)s(eing)g(recognized)h(as)g(suc)m(h,)f | |
8380 | (and)g(to)h(prev)m(en)m(t)g(parameter)g(expansion.)275 | |
e59452c7 | 8381 | 799 y(Eac)m(h)22 b(of)g(the)g(shell)g(metac)m(haracters)i(\(see)f |
ad4aef08 | 8382 | (Chapter)e(2)i([De\014nitions],)h(page)f(3\))g(has)e(sp)s(ecial)i |
e59452c7 | 8383 | (meaning)150 908 y(to)40 b(the)g(shell)f(and)g(m)m(ust)g(b)s(e)g |
ad4aef08 | 8384 | (quoted)g(if)h(it)g(is)f(to)h(represen)m(t)g(itself.)68 |
e59452c7 | 8385 | b(When)39 b(the)h(command)f(history)150 1018 y(expansion)i(facilities)j |
01ed5ba4 | 8386 | (are)e(b)s(eing)f(used)g(\(see)h(Section)h(9.3)f([History)h(In)m |
fffe80d4 | 8387 | (teraction],)j(page)c(153\),)47 b(the)150 1127 y Fr(history)30 |
6e51e0d0 CR |
8388 | b(expansion)h Fu(c)m(haracter,)h(usually)f(`)p Ft(!)p |
8389 | Fu(',)g(m)m(ust)f(b)s(e)g(quoted)h(to)g(prev)m(en)m(t)g(history)g | |
e59452c7 | 8390 | (expansion.)41 b(See)150 1237 y(Section)22 b(9.1)g([Bash)f(History)h(F) |
fffe80d4 | 8391 | -8 b(acilities],)26 b(page)c(151,)j(for)20 b(more)h(details)h |
e59452c7 | 8392 | (concerning)g(history)f(expansion.)275 1370 y(There)37 |
6e51e0d0 CR |
8393 | b(are)h(three)f(quoting)h(mec)m(hanisms:)56 b(the)38 |
8394 | b Fr(escap)s(e)g(c)m(haracter)p Fu(,)j(single)d(quotes,)i(and)d(double) | |
e59452c7 CR |
8395 | 150 1480 y(quotes.)150 1677 y Fk(3.1.2.1)63 b(Escap)s(e)41 |
8396 | b(Character)150 1824 y Fu(A)36 b(non-quoted)f(bac)m(kslash)h(`)p | |
6e51e0d0 | 8397 | Ft(\\)p Fu(')g(is)f(the)h(Bash)g(escap)s(e)f(c)m(haracter.)58 |
c302751c | 8398 | b(It)36 b(preserv)m(es)f(the)h(literal)h(v)-5 b(alue)36 |
e59452c7 | 8399 | b(of)150 1934 y(the)27 b(next)g(c)m(haracter)h(that)f(follo)m(ws,)i |
6e51e0d0 | 8400 | (with)d(the)h(exception)g(of)g Ft(newline)p Fu(.)38 b(If)26 |
e59452c7 | 8401 | b(a)h Ft(\\newline)d Fu(pair)i(app)s(ears,)150 2043 y(and)k(the)h(bac)m |
6e51e0d0 CR |
8402 | (kslash)g(itself)g(is)g(not)g(quoted,)g(the)f Ft(\\newline)f |
8403 | Fu(is)h(treated)i(as)f(a)g(line)g(con)m(tin)m(uation)h(\(that)150 | |
e59452c7 CR |
8404 | 2153 y(is,)f(it)g(is)f(remo)m(v)m(ed)h(from)f(the)h(input)e(stream)i |
8405 | (and)f(e\013ectiv)m(ely)j(ignored\).)150 2350 y Fk(3.1.2.2)63 | |
8406 | b(Single)42 b(Quotes)150 2497 y Fu(Enclosing)24 b(c)m(haracters)h(in)e | |
6e51e0d0 | 8407 | (single)h(quotes)g(\(`)p Ft(')p Fu('\))g(preserv)m(es)g(the)f(literal)i |
c302751c | 8408 | (v)-5 b(alue)24 b(of)g(eac)m(h)g(c)m(haracter)h(within)150 |
e59452c7 | 8409 | 2607 y(the)31 b(quotes.)42 b(A)31 b(single)h(quote)f(ma)m(y)g(not)g(o)s |
c302751c | 8410 | (ccur)g(b)s(et)m(w)m(een)g(single)h(quotes,)f(ev)m(en)h(when)d |
e59452c7 CR |
8411 | (preceded)i(b)m(y)g(a)150 2717 y(bac)m(kslash.)150 2914 |
8412 | y Fk(3.1.2.3)63 b(Double)42 b(Quotes)150 3061 y Fu(Enclosing)24 | |
6e51e0d0 CR |
8413 | b(c)m(haracters)h(in)f(double)f(quotes)h(\(`)p Ft(")p |
8414 | Fu('\))g(preserv)m(es)g(the)g(literal)h(v)-5 b(alue)24 | |
e59452c7 | 8415 | b(of)g(all)g(c)m(haracters)h(within)150 3170 y(the)34 |
6e51e0d0 CR |
8416 | b(quotes,)h(with)f(the)g(exception)h(of)f(`)p Ft($)p |
8417 | Fu(',)h(`)p Ft(`)p Fu(',)g(`)p Ft(\\)p Fu(',)g(and,)f(when)f(history)g | |
e59452c7 | 8418 | (expansion)h(is)g(enabled,)h(`)p Ft(!)p Fu('.)150 3280 |
602eae4d | 8419 | y(When)c(the)g(shell)g(is)g(in)f Fm(posix)h Fu(mo)s(de)f(\(see)i |
e59452c7 CR |
8420 | (Section)g(6.11)g([Bash)f(POSIX)f(Mo)s(de],)i(page)g(105\),)h(the)e(`)p |
8421 | Ft(!)p Fu(')150 3390 y(has)d(no)g(sp)s(ecial)h(meaning)g(within)f | |
967625cd | 8422 | (double)g(quotes,)h(ev)m(en)g(when)f(history)g(expansion)g(is)g |
e59452c7 | 8423 | (enabled.)40 b(The)150 3499 y(c)m(haracters)h(`)p Ft($)p |
967625cd CR |
8424 | Fu(')e(and)g(`)p Ft(`)p Fu(')g(retain)h(their)f(sp)s(ecial)h(meaning)f |
8425 | (within)g(double)g(quotes)h(\(see)g(Section)g(3.5)150 | |
e59452c7 | 8426 | 3609 y([Shell)29 b(Expansions],)g(page)h(24\).)41 b(The)28 |
967625cd | 8427 | b(bac)m(kslash)i(retains)f(its)h(sp)s(ecial)f(meaning)g(only)g(when)f |
e59452c7 | 8428 | (follo)m(w)m(ed)150 3718 y(b)m(y)41 b(one)f(of)h(the)g(follo)m(wing)h |
967625cd CR |
8429 | (c)m(haracters:)63 b(`)p Ft($)p Fu(',)43 b(`)p Ft(`)p |
8430 | Fu(',)h(`)p Ft(")p Fu(',)g(`)p Ft(\\)p Fu(',)f(or)e Ft(newline)p | |
e59452c7 | 8431 | Fu(.)69 b(Within)41 b(double)f(quotes,)150 3828 y(bac)m(kslashes)25 |
967625cd CR |
8432 | b(that)h(are)f(follo)m(w)m(ed)h(b)m(y)e(one)h(of)g(these)g(c)m |
8433 | (haracters)h(are)f(remo)m(v)m(ed.)40 b(Bac)m(kslashes)26 | |
e59452c7 | 8434 | b(preceding)150 3938 y(c)m(haracters)35 b(without)e(a)h(sp)s(ecial)f |
967625cd | 8435 | (meaning)h(are)f(left)h(unmo)s(di\014ed.)47 b(A)34 b(double)f(quote)g |
e59452c7 | 8436 | (ma)m(y)h(b)s(e)f(quoted)150 4047 y(within)h(double)h(quotes)g(b)m(y)g |
967625cd | 8437 | (preceding)g(it)g(with)g(a)g(bac)m(kslash.)55 b(If)35 |
e59452c7 | 8438 | b(enabled,)h(history)f(expansion)g(will)150 4157 y(b)s(e)f(p)s |
967625cd CR |
8439 | (erformed)g(unless)g(an)h(`)p Ft(!)p Fu(')g(app)s(earing)f(in)h(double) |
8440 | f(quotes)i(is)f(escap)s(ed)g(using)f(a)h(bac)m(kslash.)55 | |
e59452c7 CR |
8441 | b(The)150 4266 y(bac)m(kslash)31 b(preceding)f(the)h(`)p |
8442 | Ft(!)p Fu(')f(is)h(not)g(remo)m(v)m(ed.)275 4400 y(The)41 | |
967625cd CR |
8443 | b(sp)s(ecial)h(parameters)f(`)p Ft(*)p Fu(')h(and)f(`)p |
8444 | Ft(@)p Fu(')h(ha)m(v)m(e)g(sp)s(ecial)g(meaning)g(when)f(in)g(double)g | |
e59452c7 CR |
8445 | (quotes)h(\(see)150 4509 y(Section)31 b(3.5.3)h([Shell)f(P)m(arameter)h |
8446 | (Expansion],)e(page)h(26\).)150 4707 y Fk(3.1.2.4)63 | |
8447 | b(ANSI-C)40 b(Quoting)150 4854 y Fu(Character)g(sequences)h(of)f(the)g | |
8448 | (form)g($')p Fr(string)8 b Fu(')40 b(are)h(treated)g(as)f(a)h(sp)s | |
8449 | (ecial)f(kind)f(of)i(single)f(quotes.)150 4963 y(The)e(sequence)i | |
8450 | (expands)e(to)i Fr(string)p Fu(,)h(with)e(bac)m(kslash-escap)s(ed)h(c)m | |
8451 | (haracters)g(in)f Fr(string)46 b Fu(replaced)40 b(as)150 | |
8452 | 5073 y(sp)s(eci\014ed)32 b(b)m(y)h(the)g(ANSI)f(C)h(standard.)47 | |
8453 | b(Bac)m(kslash)34 b(escap)s(e)g(sequences,)g(if)e(presen)m(t,)i(are)f | |
8454 | (deco)s(ded)g(as)150 5182 y(follo)m(ws:)150 5340 y Ft(\\a)384 | |
8455 | b Fu(alert)31 b(\(b)s(ell\))p eop end | |
5e13499c | 8456 | %%Page: 7 13 |
6e51e0d0 | 8457 | TeXDict begin 7 12 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
37c41ab1 | 8458 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(7)150 299 |
e59452c7 CR |
8459 | y Ft(\\b)384 b Fu(bac)m(kspace)150 466 y Ft(\\e)150 576 |
8460 | y(\\E)g Fu(an)30 b(escap)s(e)h(c)m(haracter)h(\(not)f(ANSI)f(C\))150 | |
8461 | 743 y Ft(\\f)384 b Fu(form)30 b(feed)150 911 y Ft(\\n)384 | |
8462 | b Fu(newline)150 1078 y Ft(\\r)g Fu(carriage)32 b(return)150 | |
8463 | 1245 y Ft(\\t)384 b Fu(horizon)m(tal)32 b(tab)150 1413 | |
8464 | y Ft(\\v)384 b Fu(v)m(ertical)32 b(tab)150 1580 y Ft(\\\\)384 | |
8465 | b Fu(bac)m(kslash)150 1747 y Ft(\\')g Fu(single)31 b(quote)150 | |
8466 | 1915 y Ft(\\")384 b Fu(double)30 b(quote)150 2082 y Ft(\\?)384 | |
8467 | b Fu(question)31 b(mark)150 2249 y Ft(\\)p Fj(nnn)288 | |
8468 | b Fu(the)36 b(eigh)m(t-bit)h(c)m(haracter)g(whose)f(v)-5 | |
8469 | b(alue)36 b(is)f(the)h(o)s(ctal)h(v)-5 b(alue)36 b Fr(nnn)e | |
8470 | Fu(\(one)i(to)h(three)f(o)s(ctal)630 2359 y(digits\))150 | |
8471 | 2526 y Ft(\\x)p Fj(HH)288 b Fu(the)36 b(eigh)m(t-bit)i(c)m(haracter)f | |
8472 | (whose)f(v)-5 b(alue)36 b(is)g(the)g(hexadecimal)h(v)-5 | |
8473 | b(alue)36 b Fr(HH)46 b Fu(\(one)37 b(or)f(t)m(w)m(o)630 | |
8474 | 2636 y(hex)30 b(digits\))150 2803 y Ft(\\u)p Fj(HHHH)192 | |
8475 | b Fu(the)33 b(Unico)s(de)f(\(ISO/IEC)g(10646\))j(c)m(haracter)f(whose)e | |
8476 | (v)-5 b(alue)33 b(is)g(the)g(hexadecimal)g(v)-5 b(alue)630 | |
8477 | 2913 y Fr(HHHH)41 b Fu(\(one)31 b(to)g(four)f(hex)g(digits\))150 | |
8478 | 3080 y Ft(\\U)p Fj(HHHHHHHH)630 3190 y Fu(the)j(Unico)s(de)f(\(ISO/IEC) | |
8479 | g(10646\))j(c)m(haracter)f(whose)e(v)-5 b(alue)33 b(is)g(the)g | |
8480 | (hexadecimal)g(v)-5 b(alue)630 3299 y Fr(HHHHHHHH)42 | |
8481 | b Fu(\(one)31 b(to)g(eigh)m(t)g(hex)g(digits\))150 3467 | |
8482 | y Ft(\\c)p Fj(x)336 b Fu(a)31 b(con)m(trol-)p Fr(x)38 | |
8483 | b Fu(c)m(haracter)150 3638 y(The)30 b(expanded)f(result)i(is)f | |
984a1947 | 8484 | (single-quoted,)i(as)f(if)f(the)g(dollar)h(sign)g(had)e(not)i(b)s(een)f |
e59452c7 CR |
8485 | (presen)m(t.)150 3845 y Fk(3.1.2.5)63 b(Lo)s(cale-Sp)s(eci\014c)41 |
8486 | b(T)-10 b(ranslation)150 3992 y Fu(Pre\014xing)38 b(a)h(double-quoted)g | |
8487 | (string)f(with)g(a)h(dollar)g(sign)g(\(`)p Ft($)p Fu('\),)j(suc)m(h)c | |
8488 | (as)h Ft($"hello,)45 b(world")p Fu(,)40 b(will)150 4102 | |
8489 | y(cause)33 b(the)f(string)h(to)g(b)s(e)f(translated)h(according)g(to)g | |
8490 | (the)g(curren)m(t)f(lo)s(cale.)48 b(The)32 b Ft(gettext)e | |
8491 | Fu(infrastruc-)150 4211 y(ture)41 b(p)s(erforms)e(the)i(lo)s(okup)g | |
8492 | (and)f(translation,)45 b(using)40 b(the)i Ft(LC_MESSAGES)p | |
8493 | Fu(,)e Ft(TEXTDOMAINDIR)p Fu(,)h(and)150 4321 y Ft(TEXTDOMAIN)34 | |
8494 | b Fu(shell)i(v)-5 b(ariables,)39 b(as)e(explained)f(b)s(elo)m(w.)60 | |
8495 | b(See)36 b(the)h(gettext)i(do)s(cumen)m(tation)e(for)f(addi-)150 | |
8496 | 4430 y(tional)24 b(details)g(not)f(co)m(v)m(ered)i(here.)38 | |
8497 | b(If)23 b(the)g(curren)m(t)f(lo)s(cale)j(is)e Ft(C)g | |
8498 | Fu(or)g Ft(POSIX)p Fu(,)g(if)g(there)g(are)g(no)g(translations)150 | |
8499 | 4540 y(a)m(v)-5 b(ailable,)32 b(of)c(if)h(the)f(string)h(is)g(not)f | |
8500 | (translated,)i(the)f(dollar)g(sign)f(is)h(ignored.)40 | |
8501 | b(Since)29 b(this)f(is)h(a)g(form)f(of)150 4650 y(double)d(quoting,)j | |
8502 | (the)e(string)g(remains)f(double-quoted)h(b)m(y)g(default,)h(whether)e | |
8503 | (or)h(not)g(it)g(is)g(translated)150 4759 y(and)i(replaced.)41 | |
8504 | b(If)28 b(the)h Ft(noexpand_translation)23 b Fu(option)29 | |
8505 | b(is)g(enabled)f(using)h(the)f Ft(shopt)g Fu(builtin)g(\(see)150 | |
8506 | 4869 y(Section)33 b(4.3.2)h([The)e(Shopt)f(Builtin],)j(page)f(70\),)h | |
8507 | (translated)f(strings)e(are)i(single-quoted)g(instead)g(of)150 | |
8508 | 4978 y(double-quoted.)275 5121 y(The)39 b(rest)i(of)g(this)f(section)h | |
8509 | (is)g(a)g(brief)f(o)m(v)m(erview)i(of)e(ho)m(w)h(y)m(ou)f(use)g | |
8510 | (gettext)j(to)e(create)h(transla-)150 5230 y(tions)33 | |
8511 | b(for)f(strings)g(in)g(a)h(shell)f(script)h(named)f Fr(scriptname)p | |
8512 | Fu(.)46 b(There)32 b(are)h(more)g(details)g(in)f(the)h(gettext)150 | |
8513 | 5340 y(do)s(cumen)m(tation.)p eop end | |
c302751c | 8514 | %%Page: 8 14 |
6e51e0d0 | 8515 | TeXDict begin 8 13 bop 150 -116 a Fu(Chapter)30 b(3:)41 |
e59452c7 CR |
8516 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(8)275 299 |
8517 | y(Once)34 b(y)m(ou'v)m(e)i(mark)m(ed)f(the)f(strings)h(in)f(y)m(our)g | |
8518 | (script)h(that)g(y)m(ou)g(w)m(an)m(t)g(to)g(translate)h(using)e($)p | |
8519 | Ft(")p Fu(...)p Ft(")p Fu(,)150 408 y(y)m(ou)d(create)h(a)e(gettext)j | |
8520 | Ft(")p Fu(template)p Ft(")e Fu(\014le)g(using)f(the)g(command)390 | |
8521 | 540 y Ft(bash)47 b(--dump-po-strings)c Fj(scriptname)i | |
8522 | Ft(>)i Fj(domain)p Ft(.pot)150 671 y Fu(The)36 b Fr(domain)g | |
8523 | Fu(is)g(y)m(our)h Fr(message)g(domain)p Fu(.)58 b(It's)37 | |
8524 | b(just)e(an)i(arbitrary)f(string)g(that's)h(used)e(to)i(iden)m(tify)150 | |
8525 | 781 y(the)32 b(\014les)g(gettext)i(needs,)f(lik)m(e)g(a)f(pac)m(k)-5 | |
8526 | b(age)35 b(or)d(script)f(name.)46 b(It)32 b(needs)g(to)h(b)s(e)e | |
8527 | (unique)g(among)i(all)g(the)150 891 y(message)41 b(domains)f(on)f | |
8528 | (systems)h(where)g(y)m(ou)g(install)h(the)f(translations,)j(so)d | |
8529 | (gettext)i(kno)m(ws)e(whic)m(h)150 1000 y(translations)27 | |
8530 | b(corresp)s(ond)e(to)i(y)m(our)f(script.)39 b(Y)-8 b(ou'll)28 | |
8531 | b(use)d(the)i(template)g(\014le)g(to)f(create)i(translations)f(for)150 | |
8532 | 1110 y(eac)m(h)32 b(target)f(language.)43 b(The)29 b(template)j(\014le) | |
8533 | f(con)m(v)m(en)m(tionally)i(has)d(the)h(su\016x)e(`)p | |
8534 | Ft(.pot)p Fu('.)275 1241 y(Y)-8 b(ou)23 b(cop)m(y)g(this)g(template)h | |
8535 | (\014le)f(to)h(a)f(separate)h(\014le)f(for)g(eac)m(h)h(target)g | |
8536 | (language)g(y)m(ou)f(w)m(an)m(t)h(to)g(supp)s(ort)150 | |
8537 | 1351 y(\(called)39 b Ft(")p Fu(PO)p Ft(")e Fu(\014les,)i(whic)m(h)f | |
8538 | (use)f(the)h(su\016x)e(`)p Ft(.po)p Fu('\).)63 b(PO)37 | |
8539 | b(\014les)g(use)h(v)-5 b(arious)37 b(naming)h(con)m(v)m(en)m(tions,)150 | |
8540 | 1461 y(but)31 b(when)g(y)m(ou)i(are)f(w)m(orking)g(to)h(translate)g(a)f | |
8541 | (template)i(\014le)e(in)m(to)h(a)f(particular)g(language,)i(y)m(ou)f | |
8542 | (\014rst)150 1570 y(cop)m(y)k(the)g(template)h(\014le)e(to)h(a)g | |
8543 | (\014le)f(whose)h(name)f(is)g(the)h(language)h(y)m(ou)f(w)m(an)m(t)g | |
8544 | (to)g(target,)j(with)c(the)150 1680 y(`)p Ft(.po)p Fu(')29 | |
8545 | b(su\016x.)39 b(F)-8 b(or)30 b(instance,)g(the)f(Spanish)f | |
8546 | (translations)i(of)f(y)m(our)g(strings)g(w)m(ould)g(b)s(e)f(in)h(a)g | |
8547 | (\014le)g(named)150 1789 y(`)p Ft(es.po)p Fu(',)h(and)f(to)j(get)f | |
8548 | (started)g(using)f(a)h(message)g(domain)f(named)g Ft(")p | |
8549 | Fu(example,)p Ft(")h Fu(y)m(ou)g(w)m(ould)f(run)390 1921 | |
8550 | y Ft(cp)47 b(example.pot)e(es.po)150 2052 y Fu(Ultimately)-8 | |
8551 | b(,)42 b(PO)37 b(\014les)g(are)h(often)g(named)f Fr(domain)p | |
8552 | Fu(.p)s(o)g(and)g(installed)h(in)f(directories)i(that)f(con)m(tain)150 | |
8553 | 2162 y(m)m(ultiple)31 b(translation)g(\014les)g(for)f(a)h(particular)f | |
8554 | (language.)275 2293 y(Whic)m(hev)m(er)k(naming)f(con)m(v)m(en)m(tion)i | |
8555 | (y)m(ou)e(c)m(ho)s(ose,)i(y)m(ou)e(will)g(need)g(to)g(translate)h(the)f | |
8556 | (strings)g(in)g(the)150 2403 y(PO)d(\014les)g(in)m(to)i(the)e | |
8557 | (appropriate)h(languages.)42 b(This)29 b(has)h(to)h(b)s(e)f(done)g(man) | |
8558 | m(ually)-8 b(.)275 2534 y(When)35 b(y)m(ou)h(ha)m(v)m(e)g(the)g | |
8559 | (translations)g(and)f(PO)g(\014les)g(complete,)k(y)m(ou'll)d(use)g(the) | |
8560 | f(gettext)j(to)s(ols)e(to)150 2644 y(pro)s(duce)26 b(what)g(are)i | |
8561 | (called)g Ft(")p Fu(MO)p Ft(")e Fu(\014les,)i(whic)m(h)e(are)h | |
8562 | (compiled)h(v)m(ersions)f(of)g(the)g(PO)f(\014les)h(the)g(gettext)150 | |
8563 | 2754 y(to)s(ols)42 b(use)f(to)h(lo)s(ok)g(up)e(translations)j | |
8564 | (e\016cien)m(tly)-8 b(.)75 b(MO)42 b(\014les)f(are)g(also)i(called)f | |
8565 | Ft(")p Fu(message)g(catalog)p Ft(")150 2863 y Fu(\014les.)k(Y)-8 | |
8566 | b(ou)33 b(use)f(the)g Ft(msgfmt)f Fu(program)h(to)h(do)f(this.)46 | |
8567 | b(F)-8 b(or)33 b(instance,)g(if)f(y)m(ou)h(had)f(a)g(\014le)h(with)e | |
8568 | (Spanish)150 2973 y(translations,)g(y)m(ou)g(could)g(run)390 | |
8569 | 3104 y Ft(msgfmt)46 b(-o)h(es.mo)g(es.po)150 3236 y Fu(to)31 | |
8570 | b(pro)s(duce)e(the)i(corresp)s(onding)e(MO)i(\014le.)275 | |
8571 | 3367 y(Once)21 b(y)m(ou)h(ha)m(v)m(e)i(the)e(MO)f(\014les,)j(y)m(ou)e | |
8572 | (decide)g(where)g(to)g(install)h(them)f(and)f(use)h(the)g | |
8573 | Ft(TEXTDOMAINDIR)150 3477 y Fu(shell)32 b(v)-5 b(ariable)33 | |
8574 | b(to)g(tell)h(the)e(gettext)i(to)s(ols)f(where)f(they)g(are.)47 | |
8575 | b(Mak)m(e)34 b(sure)d(to)i(use)f(the)g(same)h(message)150 | |
8576 | 3587 y(domain)d(to)h(name)g(the)f(MO)h(\014les)f(as)h(y)m(ou)f(did)g | |
8577 | (for)g(the)h(PO)e(\014les)i(when)e(y)m(ou)i(install)g(them.)275 | |
8578 | 3718 y(Y)-8 b(our)21 b(users)f(will)h(use)g(the)g Ft(LANG)f | |
8579 | Fu(or)h Ft(LC_MESSAGES)d Fu(shell)j(v)-5 b(ariables)21 | |
8580 | b(to)h(select)h(the)e(desired)f(language.)275 3850 y(Y)-8 | |
8581 | b(ou)29 b(set)g(the)g Ft(TEXTDOMAIN)d Fu(v)-5 b(ariable)30 | |
8582 | b(to)f(the)g(script's)g(message)h(domain.)40 b(As)29 | |
8583 | b(ab)s(o)m(v)m(e,)h(y)m(ou)f(use)g(the)150 3959 y(message)i(domain)g | |
8584 | (to)g(name)f(y)m(our)h(translation)g(\014les.)275 4091 | |
8585 | y(Y)-8 b(ou,)31 b(or)g(p)s(ossibly)f(y)m(our)g(users,)h(set)g(the)g | |
8586 | Ft(TEXTDOMAINDIR)c Fu(v)-5 b(ariable)31 b(to)h(the)f(name)f(of)h(a)g | |
8587 | (directory)150 4200 y(where)d(the)h(message)h(catalog)i(\014les)d(are)g | |
8588 | (stored.)40 b(If)28 b(y)m(ou)i(install)f(the)g(message)h(\014les)f(in)m | |
8589 | (to)h(the)f(system's)150 4310 y(standard)h(message)h(catalog)i | |
8590 | (directory)-8 b(,)32 b(y)m(ou)e(don't)h(need)f(to)h(w)m(orry)f(ab)s | |
8591 | (out)g(this)g(v)-5 b(ariable.)275 4441 y(The)31 b(directory)h(where)g | |
8592 | (the)g(message)h(catalog)h(\014les)e(are)g(stored)g(v)-5 | |
8593 | b(aries)32 b(b)s(et)m(w)m(een)h(systems.)45 b(Some)150 | |
8594 | 4551 y(use)24 b(the)h(message)g(catalog)j(selected)e(b)m(y)e(the)h | |
8595 | Ft(LC_MESSAGES)c Fu(shell)k(v)-5 b(ariable.)39 b(Others)24 | |
8596 | b(create)i(the)f(name)150 4661 y(of)i(the)h(message)g(catalog)i(from)d | |
8597 | (the)g(v)-5 b(alue)27 b(of)h(the)f Ft(TEXTDOMAIN)e Fu(shell)i(v)-5 | |
8598 | b(ariable,)29 b(p)s(ossibly)d(adding)h(the)150 4770 y(`)p | |
8599 | Ft(.mo)p Fu(')32 b(su\016x.)47 b(If)33 b(y)m(ou)g(use)f(the)h | |
8600 | Ft(TEXTDOMAIN)d Fu(v)-5 b(ariable,)35 b(y)m(ou)e(ma)m(y)g(need)g(to)g | |
8601 | (set)h(the)f Ft(TEXTDOMAINDIR)150 4880 y Fu(v)-5 b(ariable)26 | |
8602 | b(to)g(the)g(lo)s(cation)h(of)e(the)h(message)h(catalog)h(\014les,)e | |
8603 | (as)g(ab)s(o)m(v)m(e.)40 b(It's)26 b(common)g(to)g(use)f(b)s(oth)f(v)-5 | |
8604 | b(ari-)150 4989 y(ables)31 b(in)f(this)g(fashion:)41 | |
8605 | b Ft($TEXTDOMAINDIR)p Fu(/)p Ft($LC_MESSAG)o(ES)p Fu(/LC)p | |
8606 | 2474 4989 28 4 v 34 w(MESSA)m(GES/)p Ft($TEXTDOMAIN)p | |
8607 | Fu(.mo.)275 5121 y(If)i(y)m(ou)h(used)f(that)h(last)g(con)m(v)m(en)m | |
8608 | (tion,)50 b(and)43 b(y)m(ou)h(w)m(an)m(ted)g(to)h(store)f(the)g | |
8609 | (message)h(catalog)h(\014les)150 5230 y(with)28 b(Spanish)f(\(es\))i | |
8610 | (and)f(Esp)s(eran)m(to)h(\(eo\))g(translations)h(in)m(to)f(a)g(lo)s | |
8611 | (cal)h(directory)f(y)m(ou)f(use)g(for)h(custom)150 5340 | |
8612 | y(translation)i(\014les,)g(y)m(ou)g(could)f(run)p eop | |
8613 | end | |
8614 | %%Page: 9 15 | |
8615 | TeXDict begin 9 14 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
8616 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(9)390 299 | |
8617 | y Ft(TEXTDOMAIN=example)390 408 y(TEXTDOMAINDIR=/usr/local)o(/sha)o | |
8618 | (re/l)o(oca)o(le)390 628 y(cp)47 b(es.mo)g(${TEXTDOMAINDIR}/es/LC_)o | |
8619 | (MES)o(SAGE)o(S/${)o(TEX)o(TDOM)o(AIN})o(.mo)390 737 | |
8620 | y(cp)g(eo.mo)g(${TEXTDOMAINDIR}/eo/LC_)o(MES)o(SAGE)o(S/${)o(TEX)o | |
8621 | (TDOM)o(AIN})o(.mo)275 868 y Fu(When)30 b(all)i(of)f(this)f(is)h(done,) | |
8622 | g(and)f(the)h(message)h(catalog)h(\014les)e(con)m(taining)h(the)f | |
8623 | (compiled)g(transla-)150 977 y(tions)c(are)g(installed)h(in)e(the)h | |
8624 | (correct)h(lo)s(cation,)h(y)m(our)e(users)f(will)h(b)s(e)f(able)h(to)h | |
8625 | (see)f(translated)h(strings)e(in)150 1087 y(an)m(y)k(of)f(the)h(supp)s | |
8626 | (orted)d(languages)k(b)m(y)e(setting)h(the)g Ft(LANG)e | |
8627 | Fu(or)h Ft(LC_MESSAGES)d Fu(en)m(vironmen)m(t)k(v)-5 | |
8628 | b(ariables)150 1197 y(b)s(efore)30 b(running)f(y)m(our)h(script.)150 | |
8629 | 1388 y Fk(3.1.3)63 b(Commen)m(ts)150 1535 y Fu(In)21 | |
8630 | b(a)i(non-in)m(teractiv)m(e)h(shell,)g(or)e(an)g(in)m(teractiv)m(e)j | |
8631 | (shell)d(in)g(whic)m(h)g(the)g Ft(interactive_comments)16 | |
8632 | b Fu(option)150 1645 y(to)40 b(the)f Ft(shopt)e Fu(builtin)h(is)h | |
8633 | (enabled)g(\(see)h(Section)g(4.3.2)g([The)f(Shopt)f(Builtin],)k(page)e | |
8634 | (70\),)i(a)d(w)m(ord)150 1754 y(b)s(eginning)26 b(with)g(`)p | |
8635 | Ft(#)p Fu(')g(causes)h(that)f(w)m(ord)g(and)g(all)h(remaining)g(c)m | |
8636 | (haracters)g(on)f(that)h(line)g(to)g(b)s(e)f(ignored.)150 | |
8637 | 1864 y(An)43 b(in)m(teractiv)m(e)j(shell)e(without)f(the)g | |
d37a4722 | 8638 | Ft(interactive_comments)38 b Fu(option)44 b(enabled)f(do)s(es)g(not)g |
e59452c7 CR |
8639 | (allo)m(w)150 1973 y(commen)m(ts.)56 b(The)34 b Ft |
8640 | (interactive_comments)c Fu(option)35 b(is)g(on)g(b)m(y)g(default)g(in)g | |
8641 | (in)m(teractiv)m(e)j(shells.)55 b(See)150 2083 y(Section)30 | |
8642 | b(6.3)f([In)m(teractiv)m(e)j(Shells],)d(page)h(93,)g(for)e(a)i | |
8643 | (description)e(of)h(what)g(mak)m(es)h(a)f(shell)g(in)m(teractiv)m(e.) | |
8644 | 150 2316 y Fs(3.2)68 b(Shell)45 b(Commands)150 2476 y | |
8645 | Fu(A)d(simple)g(shell)g(command)f(suc)m(h)h(as)g Ft(echo)29 | |
8646 | b(a)h(b)g(c)41 b Fu(consists)i(of)f(the)f(command)h(itself)h(follo)m(w) | |
8647 | m(ed)g(b)m(y)150 2585 y(argumen)m(ts,)31 b(separated)g(b)m(y)f(spaces.) | |
8648 | 275 2716 y(More)h(complex)h(shell)f(commands)g(are)g(comp)s(osed)g(of)g | |
8649 | (simple)g(commands)g(arranged)g(together)h(in)150 2825 | |
8650 | y(a)f(v)-5 b(ariet)m(y)32 b(of)f(w)m(a)m(ys:)41 b(in)31 | |
8651 | b(a)g(pip)s(eline)f(in)g(whic)m(h)g(the)h(output)f(of)h(one)f(command)h | |
8652 | (b)s(ecomes)f(the)h(input)f(of)150 2935 y(a)h(second,)f(in)h(a)f(lo)s | |
8653 | (op)h(or)f(conditional)i(construct,)f(or)f(in)g(some)h(other)g | |
8654 | (grouping.)150 3126 y Fk(3.2.1)63 b(Reserv)m(ed)40 b(W)-10 | |
8655 | b(ords)150 3273 y Fu(Reserv)m(ed)33 b(w)m(ords)g(are)g(w)m(ords)g(that) | |
d37a4722 | 8656 | g(ha)m(v)m(e)h(sp)s(ecial)g(meaning)f(to)h(the)f(shell.)49 |
e59452c7 CR |
8657 | b(They)32 b(are)h(used)g(to)g(b)s(egin)150 3383 y(and)d(end)f(the)i |
8658 | (shell's)g(comp)s(ound)e(commands.)275 3514 y(The)k(follo)m(wing)i(w)m | |
d37a4722 | 8659 | (ords)e(are)h(recognized)i(as)e(reserv)m(ed)f(when)g(unquoted)g(and)g |
e59452c7 CR |
8660 | (the)h(\014rst)f(w)m(ord)h(of)g(a)150 3623 y(command)c(\(see)h(b)s(elo) |
8661 | m(w)g(for)f(exceptions\):)150 3754 y Ft(if)364 b(then)168 | |
8662 | b(elif)g(else)g(fi)336 b(time)150 3863 y(for)316 b(in)264 | |
8663 | b(until)120 b(while)g(do)336 b(done)150 3973 y(case)268 | |
8664 | b(esac)168 b(coproc)72 b(select)g(function)150 4083 y({)412 | |
8665 | b(})312 b([[)264 b(]])g(!)150 4213 y(in)33 b Fu(is)h(recognized)h(as)f | |
d37a4722 | 8666 | (a)g(reserv)m(ed)f(w)m(ord)h(if)f(it)h(is)g(the)g(third)f(w)m(ord)g(of) |
e59452c7 | 8667 | h(a)g Ft(case)e Fu(or)i Ft(select)e Fu(command.)150 4323 |
d37a4722 CR |
8668 | y Ft(in)e Fu(and)g Ft(do)f Fu(are)i(recognized)h(as)e(reserv)m(ed)h(w)m |
8669 | (ords)f(if)g(they)h(are)f(the)h(third)f(w)m(ord)g(in)g(a)g | |
e59452c7 CR |
8670 | Ft(for)g Fu(command.)150 4514 y Fk(3.2.2)63 b(Simple)41 |
8671 | b(Commands)150 4661 y Fu(A)29 b(simple)f(command)g(is)h(the)g(kind)e | |
d37a4722 | 8672 | (of)i(command)f(encoun)m(tered)h(most)g(often.)40 b(It's)29 |
e59452c7 | 8673 | b(just)f(a)h(sequence)g(of)150 4771 y(w)m(ords)22 b(separated)i(b)m(y)e |
d37a4722 | 8674 | Ft(blank)p Fu(s,)i(terminated)f(b)m(y)g(one)g(of)g(the)g(shell's)g(con) |
e59452c7 | 8675 | m(trol)h(op)s(erators)f(\(see)h(Chapter)f(2)150 4881 |
d37a4722 CR |
8676 | y([De\014nitions],)37 b(page)e(3\).)54 b(The)35 b(\014rst)e(w)m(ord)i |
8677 | (generally)g(sp)s(eci\014es)g(a)g(command)f(to)h(b)s(e)f(executed,)j | |
e59452c7 CR |
8678 | (with)150 4990 y(the)31 b(rest)f(of)h(the)f(w)m(ords)g(b)s(eing)g(that) |
8679 | h(command's)f(argumen)m(ts.)275 5121 y(The)h(return)h(status)g(\(see)i | |
8680 | (Section)f(3.7.5)h([Exit)f(Status],)h(page)f(44\))g(of)g(a)g(simple)f | |
8681 | (command)g(is)h(its)150 5230 y(exit)38 b(status)f(as)g(pro)m(vided)f(b) | |
6e51e0d0 | 8682 | m(y)h(the)g Fm(posix)f Fu(1003.1)j Ft(waitpid)c Fu(function,)j(or)f |
e59452c7 CR |
8683 | (128)p Ft(+)p Fr(n)g Fu(if)g(the)g(command)150 5340 y(w)m(as)31 |
8684 | b(terminated)g(b)m(y)f(signal)h Fr(n)p Fu(.)p eop end | |
8685 | %%Page: 10 16 | |
8686 | TeXDict begin 10 15 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
8687 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(10)150 299 | |
8688 | y Fk(3.2.3)63 b(Pip)s(elines)150 446 y Fu(A)21 b Ft(pipeline)d | |
fc527055 CR |
8689 | Fu(is)j(a)g(sequence)g(of)g(one)g(or)g(more)g(commands)f(separated)h(b) |
8690 | m(y)g(one)g(of)g(the)g(con)m(trol)h(op)s(erators)150 | |
e59452c7 CR |
8691 | 555 y(`)p Ft(|)p Fu(')31 b(or)f(`)p Ft(|&)p Fu('.)275 |
8692 | 683 y(The)f(format)i(for)f(a)h(pip)s(eline)f(is)390 810 | |
8693 | y Ft([time)46 b([-p]])h([!])g Fj(command1)e Ft([)j(|)f(or)g(|&)g | |
8694 | Fj(command2)f Ft(])h(...)150 938 y Fu(The)25 b(output)f(of)i(eac)m(h)g | |
6e51e0d0 | 8695 | (command)f(in)f(the)i(pip)s(eline)e(is)i(connected)g(via)f(a)h(pip)s(e) |
e59452c7 | 8696 | e(to)i(the)f(input)f(of)h(the)h(next)150 1047 y(command.)40 |
6e51e0d0 | 8697 | b(That)29 b(is,)h(eac)m(h)h(command)e(reads)g(the)h(previous)f |
e59452c7 | 8698 | (command's)g(output.)40 b(This)29 b(connection)150 1157 |
6e51e0d0 | 8699 | y(is)h(p)s(erformed)f(b)s(efore)h(an)m(y)h(redirections)g(sp)s |
e59452c7 | 8700 | (eci\014ed)f(b)m(y)g Fr(command1)p Fu(.)275 1284 y(If)k(`)p |
6e51e0d0 CR |
8701 | Ft(|&)p Fu(')h(is)f(used,)i Fr(command1)7 b Fu('s)35 |
8702 | b(standard)f(error,)i(in)e(addition)h(to)h(its)f(standard)f(output,)i | |
e59452c7 | 8703 | (is)e(con-)150 1394 y(nected)h(to)g Fr(command2)7 b Fu('s)35 |
6e51e0d0 | 8704 | b(standard)f(input)f(through)h(the)g(pip)s(e;)i(it)f(is)g(shorthand)e |
e59452c7 | 8705 | (for)h Ft(2>&1)29 b(|)p Fu(.)53 b(This)150 1504 y(implicit)41 |
6e51e0d0 | 8706 | b(redirection)f(of)g(the)g(standard)f(error)g(to)h(the)g(standard)f |
e59452c7 CR |
8707 | (output)g(is)h(p)s(erformed)e(after)j(an)m(y)150 1613 |
8708 | y(redirections)31 b(sp)s(eci\014ed)f(b)m(y)g Fr(command1)p | |
8709 | Fu(.)275 1741 y(The)36 b(reserv)m(ed)g(w)m(ord)g Ft(time)g | |
8710 | Fu(causes)h(timing)g(statistics)h(to)f(b)s(e)f(prin)m(ted)g(for)g(the)h | |
8711 | (pip)s(eline)f(once)h(it)150 1850 y(\014nishes.)51 b(The)34 | |
8712 | b(statistics)i(curren)m(tly)e(consist)h(of)f(elapsed)h(\(w)m(all-clo)s | |
8713 | (c)m(k\))i(time)e(and)f(user)f(and)h(system)150 1960 | |
8714 | y(time)e(consumed)e(b)m(y)h(the)g(command's)g(execution.)44 | |
8715 | b(The)31 b Ft(-p)f Fu(option)i(c)m(hanges)g(the)f(output)g(format)g(to) | |
8716 | 150 2069 y(that)j(sp)s(eci\014ed)e(b)m(y)h Fm(posix)p | |
8717 | Fu(.)49 b(When)33 b(the)g(shell)g(is)h(in)e Fm(posix)h | |
8718 | Fu(mo)s(de)g(\(see)h(Section)g(6.11)g([Bash)g(POSIX)150 | |
8719 | 2179 y(Mo)s(de],)j(page)e(105\),)j(it)e(do)s(es)e(not)i(recognize)g | |
602eae4d | 8720 | Ft(time)e Fu(as)h(a)h(reserv)m(ed)f(w)m(ord)f(if)h(the)g(next)g(tok)m |
e59452c7 | 8721 | (en)h(b)s(egins)150 2289 y(with)d(a)g(`)p Ft(-)p Fu('.)49 |
6e51e0d0 | 8722 | b(The)33 b Ft(TIMEFORMAT)d Fu(v)-5 b(ariable)34 b(ma)m(y)g(b)s(e)f(set) |
9ec5ed66 | 8723 | g(to)h(a)g(format)f(string)g(that)h(sp)s(eci\014es)f(ho)m(w)g(the)150 |
e59452c7 | 8724 | 2398 y(timing)38 b(information)g(should)e(b)s(e)h(displa)m(y)m(ed.)62 |
9ec5ed66 | 8725 | b(See)38 b(Section)g(5.2)g([Bash)g(V)-8 b(ariables],)41 |
e59452c7 | 8726 | b(page)d(77,)i(for)e(a)150 2508 y(description)27 b(of)g(the)h(a)m(v)-5 |
6e51e0d0 CR |
8727 | b(ailable)29 b(formats.)40 b(The)26 b(use)h(of)g Ft(time)f |
8728 | Fu(as)i(a)f(reserv)m(ed)g(w)m(ord)g(p)s(ermits)f(the)h(timing)150 | |
e59452c7 | 8729 | 2617 y(of)38 b(shell)g(builtins,)i(shell)e(functions,)i(and)d(pip)s |
6e51e0d0 | 8730 | (elines.)63 b(An)38 b(external)h Ft(time)e Fu(command)h(cannot)g(time) |
e59452c7 | 8731 | 150 2727 y(these)31 b(easily)-8 b(.)275 2854 y(When)26 |
602eae4d | 8732 | b(the)h(shell)g(is)g(in)g Fm(posix)f Fu(mo)s(de)g(\(see)i(Section)f |
e59452c7 CR |
8733 | (6.11)i([Bash)e(POSIX)f(Mo)s(de],)i(page)g(105\),)h Ft(time)150 |
8734 | 2964 y Fu(ma)m(y)d(b)s(e)f(follo)m(w)m(ed)j(b)m(y)d(a)h(newline.)39 | |
9ec5ed66 | 8735 | b(In)25 b(this)h(case,)i(the)d(shell)h(displa)m(ys)g(the)g(total)h |
e59452c7 | 8736 | (user)e(and)g(system)h(time)150 3073 y(consumed)33 b(b)m(y)h(the)h |
6e51e0d0 CR |
8737 | (shell)f(and)f(its)i(c)m(hildren.)51 b(The)34 b Ft(TIMEFORMAT)d |
8738 | Fu(v)-5 b(ariable)35 b(ma)m(y)g(b)s(e)e(used)g(to)i(sp)s(ecify)150 | |
e59452c7 CR |
8739 | 3183 y(the)c(format)f(of)h(the)f(time)h(information.)275 |
8740 | 3311 y(If)36 b(the)h(pip)s(eline)g(is)g(not)g(executed)h(async)m | |
8741 | (hronously)f(\(see)h(Section)g(3.2.4)g([Lists],)i(page)e(10\),)i(the) | |
8742 | 150 3420 y(shell)31 b(w)m(aits)g(for)f(all)h(commands)f(in)g(the)h(pip) | |
8743 | s(eline)f(to)h(complete.)275 3548 y(Eac)m(h)e(command)g(in)g(a)g(pip)s | |
8744 | (eline)g(is)g(executed)h(in)e(its)i(o)m(wn)f Fr(subshell)p | |
8745 | Fu(,)f(whic)m(h)h(is)g(a)g(separate)h(pro)s(cess)150 | |
8746 | 3657 y(\(see)g(Section)g(3.7.3)h([Command)e(Execution)h(En)m(vironmen)m | |
8747 | (t],)g(page)g(42\).)41 b(If)29 b(the)g Ft(lastpipe)e | |
8748 | Fu(option)j(is)150 3767 y(enabled)35 b(using)g(the)g | |
8749 | Ft(shopt)f Fu(builtin)g(\(see)i(Section)g(4.3.2)h([The)e(Shopt)f | |
8750 | (Builtin],)j(page)f(70\),)i(the)d(last)150 3876 y(elemen)m(t)d(of)e(a)h | |
8751 | (pip)s(eline)f(ma)m(y)h(b)s(e)f(run)f(b)m(y)h(the)h(shell)f(pro)s(cess) | |
8752 | g(when)f(job)h(con)m(trol)i(is)f(not)f(activ)m(e.)275 | |
8753 | 4004 y(The)24 b(exit)i(status)f(of)h(a)f(pip)s(eline)g(is)g(the)g(exit) | |
8754 | h(status)f(of)h(the)f(last)h(command)f(in)f(the)i(pip)s(eline,)g | |
8755 | (unless)150 4113 y(the)31 b Ft(pipefail)d Fu(option)j(is)g(enabled)f | |
8756 | (\(see)i(Section)f(4.3.1)i([The)d(Set)h(Builtin],)g(page)h(66\).)42 | |
8757 | b(If)30 b Ft(pipefail)150 4223 y Fu(is)f(enabled,)g(the)f(pip)s | |
8758 | (eline's)g(return)g(status)h(is)f(the)h(v)-5 b(alue)29 | |
8759 | b(of)f(the)h(last)g(\(righ)m(tmost\))i(command)d(to)h(exit)150 | |
8760 | 4333 y(with)34 b(a)h(non-zero)g(status,)i(or)d(zero)i(if)e(all)i | |
8761 | (commands)e(exit)h(successfully)-8 b(.)54 b(If)34 b(the)h(reserv)m(ed)g | |
8762 | (w)m(ord)f(`)p Ft(!)p Fu(')150 4442 y(precedes)e(the)f(pip)s(eline,)h | |
8763 | (the)f(exit)i(status)f(is)f(the)h(logical)i(negation)f(of)e(the)h(exit) | |
8764 | g(status)g(as)g(describ)s(ed)150 4552 y(ab)s(o)m(v)m(e.)63 | |
8765 | b(The)38 b(shell)f(w)m(aits)i(for)e(all)i(commands)e(in)g(the)h(pip)s | |
8766 | (eline)f(to)h(terminate)h(b)s(efore)e(returning)g(a)150 | |
8767 | 4661 y(v)-5 b(alue.)150 4846 y Fk(3.2.4)63 b(Lists)41 | |
8768 | b(of)h(Commands)150 4993 y Fu(A)37 b Ft(list)e Fu(is)i(a)g(sequence)g | |
8769 | (of)g(one)g(or)f(more)h(pip)s(elines)f(separated)h(b)m(y)g(one)g(of)f | |
8770 | (the)h(op)s(erators)g(`)p Ft(;)p Fu(',)i(`)p Ft(&)p Fu(',)150 | |
8771 | 5103 y(`)p Ft(&&)p Fu(',)31 b(or)f(`)p Ft(||)p Fu(',)g(and)g | |
8772 | (optionally)i(terminated)f(b)m(y)f(one)h(of)f(`)p Ft(;)p | |
8773 | Fu(',)h(`)p Ft(&)p Fu(',)g(or)f(a)h Ft(newline)p Fu(.)275 | |
8774 | 5230 y(Of)23 b(these)h(list)g(op)s(erators,)i(`)p Ft(&&)p | |
8775 | Fu(')d(and)g(`)p Ft(||)p Fu(')h(ha)m(v)m(e)h(equal)f(precedence,)i | |
8776 | (follo)m(w)m(ed)f(b)m(y)f(`)p Ft(;)p Fu(')g(and)f(`)p | |
8777 | Ft(&)p Fu(',)i(whic)m(h)150 5340 y(ha)m(v)m(e)32 b(equal)e(precedence.) | |
8778 | p eop end | |
8779 | %%Page: 11 17 | |
8780 | TeXDict begin 11 16 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
8781 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(11)275 299 | |
8782 | y(A)29 b(sequence)h(of)g(one)g(or)g(more)g(newlines)f(ma)m(y)h(app)s | |
8783 | (ear)f(in)h(a)g Ft(list)e Fu(to)j(delimit)f(commands,)g(equiv-)150 | |
8784 | 408 y(alen)m(t)i(to)f(a)g(semicolon.)275 548 y(If)c(a)h(command)f(is)h | |
8785 | (terminated)g(b)m(y)g(the)g(con)m(trol)h(op)s(erator)f(`)p | |
6e51e0d0 | 8786 | Ft(&)p Fu(',)h(the)e(shell)h(executes)h(the)f(command)150 |
e59452c7 | 8787 | 658 y(async)m(hronously)g(in)h(a)g(subshell.)39 b(This)28 |
6e51e0d0 | 8788 | b(is)h(kno)m(wn)f(as)h(executing)h(the)f(command)g(in)f(the)h |
e59452c7 CR |
8789 | Fr(bac)m(kground)p Fu(,)150 767 y(and)42 b(these)i(are)f(referred)g(to) |
8790 | g(as)h Fr(async)m(hronous)i Fu(commands.)78 b(The)43 | |
8791 | b(shell)g(do)s(es)g(not)g(w)m(ait)h(for)f(the)150 877 | |
68701259 CR |
8792 | y(command)34 b(to)h(\014nish,)f(and)f(the)h(return)f(status)i(is)f(0)g |
8793 | (\(true\).)53 b(When)34 b(job)g(con)m(trol)h(is)f(not)h(activ)m(e)h | |
fffe80d4 | 8794 | (\(see)150 986 y(Chapter)27 b(7)h([Job)f(Con)m(trol],)i(page)g(112\),)h |
e59452c7 CR |
8795 | (the)d(standard)g(input)f(for)i(async)m(hronous)f(commands,)h(in)f(the) |
8796 | 150 1096 y(absence)k(of)f(an)m(y)h(explicit)h(redirections,)f(is)f | |
8797 | (redirected)h(from)f Ft(/dev/null)p Fu(.)275 1236 y(Commands)19 | |
68701259 CR |
8798 | b(separated)j(b)m(y)f(a)g(`)p Ft(;)p Fu(')g(are)h(executed)g(sequen)m |
8799 | (tially;)k(the)21 b(shell)g(w)m(aits)h(for)f(eac)m(h)h(command)150 | |
e59452c7 | 8800 | 1345 y(to)31 b(terminate)h(in)e(turn.)39 b(The)30 b(return)f(status)i |
68701259 | 8801 | (is)f(the)h(exit)g(status)g(of)g(the)f(last)h(command)f(executed.)275 |
e59452c7 | 8802 | 1485 y Fm(and)g Fu(and)h Fm(or)g Fu(lists)h(are)g(sequences)f(of)h(one) |
6a8fd0ed | 8803 | g(or)f(more)h(pip)s(elines)e(separated)i(b)m(y)g(the)f(con)m(trol)i(op) |
e59452c7 | 8804 | s(er-)150 1594 y(ators)e(`)p Ft(&&)p Fu(')f(and)g(`)p |
6e51e0d0 CR |
8805 | Ft(||)p Fu(',)h(resp)s(ectiv)m(ely)-8 b(.)42 b Fm(and)30 |
8806 | b Fu(and)f Fm(or)h Fu(lists)h(are)g(executed)g(with)f(left)h(asso)s | |
e59452c7 CR |
8807 | (ciativit)m(y)-8 b(.)275 1734 y(An)30 b Fm(and)f Fu(list)i(has)f(the)h |
8808 | (form)390 1874 y Fj(command1)46 b Ft(&&)h Fj(command2)150 | |
8809 | 2013 y Fr(command2)38 b Fu(is)30 b(executed)i(if,)e(and)g(only)g(if,)h | |
8810 | Fr(command1)38 b Fu(returns)29 b(an)h(exit)h(status)g(of)g(zero)g | |
8811 | (\(success\).)275 2153 y(An)f Fm(or)f Fu(list)i(has)f(the)h(form)390 | |
8812 | 2293 y Fj(command1)46 b Ft(||)h Fj(command2)150 2432 | |
8813 | y Fr(command2)38 b Fu(is)30 b(executed)i(if,)e(and)g(only)g(if,)h | |
8814 | Fr(command1)38 b Fu(returns)29 b(a)i(non-zero)g(exit)g(status.)275 | |
8815 | 2572 y(The)h(return)g(status)i(of)f Fm(and)f Fu(and)h | |
8816 | Fm(or)f Fu(lists)i(is)f(the)g(exit)h(status)g(of)f(the)g(last)h | |
8817 | (command)f(executed)150 2681 y(in)d(the)h(list.)150 2886 | |
8818 | y Fk(3.2.5)63 b(Comp)s(ound)42 b(Commands)150 3033 y | |
8819 | Fu(Comp)s(ound)29 b(commands)h(are)i(the)f(shell)g(programming)f | |
8820 | (language)j(constructs.)42 b(Eac)m(h)32 b(construct)f(b)s(e-)150 | |
8821 | 3142 y(gins)25 b(with)f(a)i(reserv)m(ed)f(w)m(ord)f(or)h(con)m(trol)h | |
8822 | (op)s(erator)f(and)g(is)g(terminated)g(b)m(y)g(a)g(corresp)s(onding)f | |
8823 | (reserv)m(ed)150 3252 y(w)m(ord)i(or)g(op)s(erator.)40 | |
8824 | b(An)m(y)26 b(redirections)g(\(see)i(Section)f(3.6)g([Redirections],)h | |
8825 | (page)f(37\))h(asso)s(ciated)f(with)150 3361 y(a)k(comp)s(ound)f | |
8826 | (command)h(apply)f(to)i(all)g(commands)f(within)f(that)i(comp)s(ound)d | |
8827 | (command)i(unless)f(ex-)150 3471 y(plicitly)i(o)m(v)m(erridden.)275 | |
8828 | 3611 y(In)20 b(most)h(cases)g(a)g(list)h(of)f(commands)f(in)g(a)h(comp) | |
8829 | s(ound)f(command's)g(description)h(ma)m(y)g(b)s(e)f(separated)150 | |
8830 | 3720 y(from)30 b(the)h(rest)g(of)g(the)g(command)g(b)m(y)f(one)h(or)g | |
1a5fa30b | 8831 | (more)g(newlines,)g(and)f(ma)m(y)i(b)s(e)e(follo)m(w)m(ed)i(b)m(y)f(a)g |
e59452c7 CR |
8832 | (newline)150 3830 y(in)f(place)h(of)g(a)g(semicolon.)275 |
8833 | 3969 y(Bash)45 b(pro)m(vides)h(lo)s(oping)g(constructs,)j(conditional)e | |
ad4aef08 | 8834 | (commands,)j(and)44 b(mec)m(hanisms)i(to)g(group)150 |
e59452c7 CR |
8835 | 4079 y(commands)30 b(and)g(execute)i(them)e(as)g(a)h(unit.)150 |
8836 | 4283 y Fk(3.2.5.1)63 b(Lo)s(oping)43 b(Constructs)150 | |
8837 | 4430 y Fu(Bash)31 b(supp)s(orts)d(the)j(follo)m(wing)g(lo)s(oping)g | |
8838 | (constructs.)275 4570 y(Note)k(that)f(wherev)m(er)g(a)g(`)p | |
6e51e0d0 | 8839 | Ft(;)p Fu(')g(app)s(ears)f(in)h(the)g(description)g(of)g(a)g(command's) |
e59452c7 CR |
8840 | g(syn)m(tax,)i(it)e(ma)m(y)h(b)s(e)150 4680 y(replaced)c(with)f(one)h |
8841 | (or)f(more)g(newlines.)150 4847 y Ft(until)240 b Fu(The)30 | |
6e51e0d0 | 8842 | b(syn)m(tax)h(of)f(the)h Ft(until)e Fu(command)h(is:)870 |
e59452c7 CR |
8843 | 4984 y Ft(until)46 b Fj(test-commands)p Ft(;)e(do)j Fj |
8844 | (consequent-commands)p Ft(;)c(done)630 5121 y Fu(Execute)f | |
6e51e0d0 | 8845 | Fr(consequen)m(t-commands)k Fu(as)41 b(long)h(as)f Fr(test-commands)46 |
e59452c7 | 8846 | b Fu(has)41 b(an)g(exit)h(status)630 5230 y(whic)m(h)c(is)h(not)g |
6e51e0d0 | 8847 | (zero.)67 b(The)38 b(return)g(status)h(is)f(the)h(exit)h(status)f(of)g |
e59452c7 CR |
8848 | (the)g(last)g(command)630 5340 y(executed)31 b(in)f Fr(consequen)m |
8849 | (t-commands)p Fu(,)i(or)e(zero)h(if)g(none)f(w)m(as)h(executed.)p | |
8850 | eop end | |
8851 | %%Page: 12 18 | |
8852 | TeXDict begin 12 17 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
8853 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(12)150 299 | |
8854 | y Ft(while)240 b Fu(The)30 b(syn)m(tax)h(of)f(the)h Ft(while)e | |
8855 | Fu(command)h(is:)870 436 y Ft(while)46 b Fj(test-commands)p | |
8856 | Ft(;)e(do)j Fj(consequent-commands)p Ft(;)c(done)630 | |
8857 | 573 y Fu(Execute)f Fr(consequen)m(t-commands)k Fu(as)41 | |
8858 | b(long)h(as)f Fr(test-commands)46 b Fu(has)41 b(an)g(exit)h(status)630 | |
8859 | 683 y(of)34 b(zero.)53 b(The)34 b(return)f(status)h(is)h(the)f(exit)h | |
8860 | (status)g(of)f(the)g(last)h(command)f(executed)h(in)630 | |
8861 | 792 y Fr(consequen)m(t-commands)p Fu(,)c(or)g(zero)g(if)f(none)g(w)m | |
8862 | (as)h(executed.)150 957 y Ft(for)336 b Fu(The)30 b(syn)m(tax)h(of)f | |
8863 | (the)h Ft(for)e Fu(command)i(is:)870 1094 y Ft(for)47 | |
8864 | b Fj(name)g Ft([)g([in)g([)p Fj(words)f Ft(...)o(])i(])f(;)h(])f(do)g | |
8865 | Fj(commands)p Ft(;)e(done)630 1231 y Fu(Expand)30 b Fr(w)m(ords)k | |
8866 | Fu(\(see)d(Section)h(3.5)g([Shell)f(Expansions],)g(page)g(24\),)i(and)d | |
8867 | (execute)i Fr(com-)630 1341 y(mands)43 b Fu(once)e(for)g(eac)m(h)g(mem) | |
1a5fa30b | 8868 | m(b)s(er)f(in)g(the)h(resultan)m(t)g(list,)j(with)c Fr(name)46 |
e59452c7 | 8869 | b Fu(b)s(ound)39 b(to)i(the)630 1450 y(curren)m(t)34 |
1a5fa30b CR |
8870 | b(mem)m(b)s(er.)53 b(If)35 b(`)p Ft(in)30 b Fj(words)p |
8871 | Fu(')j(is)i(not)g(presen)m(t,)h(the)f Ft(for)e Fu(command)i(executes)h | |
e59452c7 | 8872 | (the)630 1560 y Fr(commands)j Fu(once)e(for)f(eac)m(h)h(p)s(ositional)g |
1a5fa30b | 8873 | (parameter)f(that)h(is)f(set,)i(as)e(if)g(`)p Ft(in)30 |
e59452c7 CR |
8874 | b("$@")p Fu(')36 b(had)630 1670 y(b)s(een)30 b(sp)s(eci\014ed)f(\(see)j |
8875 | (Section)f(3.4.2)h([Sp)s(ecial)f(P)m(arameters],)h(page)f(23\).)630 | |
8876 | 1807 y(The)c(return)f(status)h(is)g(the)h(exit)g(status)f(of)g(the)h | |
1a5fa30b | 8877 | (last)g(command)e(that)i(executes.)41 b(If)27 b(there)630 |
e59452c7 | 8878 | 1916 y(are)38 b(no)f(items)g(in)g(the)h(expansion)f(of)g |
1a5fa30b | 8879 | Fr(w)m(ords)p Fu(,)i(no)e(commands)g(are)g(executed,)j(and)d(the)630 |
e59452c7 CR |
8880 | 2026 y(return)29 b(status)i(is)f(zero.)630 2163 y(An)g(alternate)i |
8881 | (form)e(of)h(the)f Ft(for)g Fu(command)g(is)g(also)h(supp)s(orted:)870 | |
8882 | 2300 y Ft(for)47 b(\(\()g Fj(expr1)f Ft(;)i Fj(expr2)e | |
1a5fa30b | 8883 | Ft(;)i Fj(expr3)e Ft(\)\))h(;)h(do)f Fj(commands)e Ft(;)j(done)630 |
e59452c7 | 8884 | 2437 y Fu(First,)38 b(the)f(arithmetic)h(expression)e |
1a5fa30b | 8885 | Fr(expr1)43 b Fu(is)36 b(ev)-5 b(aluated)38 b(according)f(to)g(the)g |
e59452c7 CR |
8886 | (rules)f(de-)630 2547 y(scrib)s(ed)41 b(b)s(elo)m(w)h(\(see)h(Section)g |
8887 | (6.5)g([Shell)g(Arithmetic],)j(page)d(97\).)77 b(The)42 | |
8888 | b(arithmetic)630 2656 y(expression)33 b Fr(expr2)41 b | |
1a5fa30b | 8889 | Fu(is)34 b(then)f(ev)-5 b(aluated)35 b(rep)s(eatedly)f(un)m(til)g(it)g |
e59452c7 | 8890 | (ev)-5 b(aluates)35 b(to)g(zero.)51 b(Eac)m(h)630 2766 |
1a5fa30b CR |
8891 | y(time)23 b Fr(expr2)30 b Fu(ev)-5 b(aluates)25 b(to)e(a)g(non-zero)h |
8892 | (v)-5 b(alue,)25 b Fr(commands)h Fu(are)d(executed)g(and)g(the)g | |
e59452c7 | 8893 | (arith-)630 2876 y(metic)29 b(expression)f Fr(expr3)36 |
1a5fa30b | 8894 | b Fu(is)28 b(ev)-5 b(aluated.)41 b(If)28 b(an)m(y)h(expression)f(is)g |
e59452c7 | 8895 | (omitted,)i(it)f(b)s(eha)m(v)m(es)g(as)630 2985 y(if)i(it)h(ev)-5 |
37c41ab1 CR |
8896 | b(aluates)32 b(to)g(1.)44 b(The)30 b(return)g(v)-5 b(alue)32 |
8897 | b(is)f(the)g(exit)h(status)g(of)f(the)g(last)h(command)f(in)630 | |
e59452c7 | 8898 | 3095 y Fr(commands)j Fu(that)d(is)f(executed,)i(or)e(false)h(if)f(an)m |
9ec5ed66 | 8899 | (y)h(of)g(the)f(expressions)g(is)h(in)m(v)-5 b(alid.)275 |
e59452c7 CR |
8900 | 3262 y(The)26 b Ft(break)g Fu(and)h Ft(continue)e Fu(builtins)i(\(see)h |
8901 | (Section)h(4.1)f([Bourne)g(Shell)f(Builtins],)i(page)f(47\))g(ma)m(y) | |
8902 | 150 3372 y(b)s(e)i(used)f(to)i(con)m(trol)h(lo)s(op)f(execution.)150 | |
8903 | 3576 y Fk(3.2.5.2)63 b(Conditional)42 b(Constructs)150 | |
8904 | 3751 y Ft(if)384 b Fu(The)30 b(syn)m(tax)h(of)f(the)h | |
8905 | Ft(if)f Fu(command)g(is:)870 3888 y Ft(if)47 b Fj(test-commands)p | |
8906 | Ft(;)d(then)965 3997 y Fj(consequent-commands)p Ft(;)870 | |
8907 | 4107 y([elif)i Fj(more-test-commands)p Ft(;)d(then)965 | |
8908 | 4217 y Fj(more-consequents)p Ft(;])870 4326 y([else)j | |
8909 | Fj(alternate-consequents)p Ft(;])870 4436 y(fi)630 4573 | |
1a5fa30b | 8910 | y Fu(The)53 b Fr(test-commands)58 b Fu(list)c(is)g(executed,)60 |
74d0116b | 8911 | b(and)53 b(if)g(its)h(return)e(status)i(is)f(zero,)61 |
e59452c7 | 8912 | b(the)630 4682 y Fr(consequen)m(t-commands)44 b Fu(list)d(is)f |
6e51e0d0 | 8913 | (executed.)70 b(If)40 b Fr(test-commands)k Fu(returns)39 |
e59452c7 | 8914 | b(a)h(non-zero)630 4792 y(status,)45 b(eac)m(h)e Ft(elif)d |
6e51e0d0 | 8915 | Fu(list)i(is)g(executed)h(in)e(turn,)j(and)d(if)g(its)h(exit)h(status)f |
e59452c7 | 8916 | (is)f(zero,)46 b(the)630 4902 y(corresp)s(onding)37 b |
6e51e0d0 | 8917 | Fr(more-consequen)m(ts)42 b Fu(is)c(executed)g(and)f(the)h(command)g |
e59452c7 | 8918 | (completes.)63 b(If)630 5011 y(`)p Ft(else)29 b Fj |
6e51e0d0 | 8919 | (alternate-consequents)p Fu(')c(is)30 b(presen)m(t,)h(and)f(the)g |
e59452c7 | 8920 | (\014nal)g(command)g(in)g(the)g(\014nal)630 5121 y Ft(if)44 |
6e51e0d0 | 8921 | b Fu(or)g Ft(elif)f Fu(clause)i(has)f(a)h(non-zero)g(exit)g(status,)j |
e59452c7 | 8922 | (then)c Fr(alternate-consequen)m(ts)51 b Fu(is)630 5230 |
ed35cb4a | 8923 | y(executed.)k(The)34 b(return)g(status)h(is)f(the)h(exit)h(status)f(of) |
e59452c7 CR |
8924 | g(the)g(last)g(command)g(executed,)630 5340 y(or)30 b(zero)i(if)e(no)g |
8925 | (condition)h(tested)g(true.)p eop end | |
8926 | %%Page: 13 19 | |
8927 | TeXDict begin 13 18 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
8928 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(13)150 299 | |
8929 | y Ft(case)288 b Fu(The)30 b(syn)m(tax)h(of)f(the)h Ft(case)e | |
8930 | Fu(command)h(is:)870 425 y Ft(case)47 b Fj(word)f Ft(in)1061 | |
8931 | 535 y([)h([\(])g Fj(pattern)f Ft([|)h Fj(pattern)p Ft(]...)m(\))h | |
8932 | Fj(command-list)c Ft(;;]...)870 645 y(esac)630 771 y(case)20 | |
8933 | b Fu(will)i(selectiv)m(ely)j(execute)e(the)e Fr(command-list)k | |
8934 | Fu(corresp)s(onding)20 b(to)i(the)g(\014rst)f Fr(pattern)630 | |
8935 | 881 y Fu(that)h(matc)m(hes)h Fr(w)m(ord)p Fu(.)38 b(The)21 | |
8936 | b(matc)m(h)h(is)g(p)s(erformed)e(according)j(to)f(the)g(rules)g | |
8937 | (describ)s(ed)e(b)s(e-)630 990 y(lo)m(w)25 b(in)e(Section)i(3.5.8.1)h | |
8938 | ([P)m(attern)f(Matc)m(hing],)i(page)e(36.)39 b(If)23 | |
8939 | b(the)h Ft(nocasematch)d Fu(shell)j(op-)630 1100 y(tion)j(\(see)g(the)f | |
8940 | (description)g(of)g Ft(shopt)f Fu(in)g(Section)i(4.3.2)h([The)e(Shopt)f | |
8941 | (Builtin],)j(page)f(70\))630 1209 y(is)40 b(enabled,)i(the)e(matc)m(h)h | |
8942 | (is)e(p)s(erformed)g(without)g(regard)h(to)h(the)f(case)g(of)g(alphab)s | |
8943 | (etic)630 1319 y(c)m(haracters.)48 b(The)32 b(`)p Ft(|)p | |
8944 | Fu(')g(is)h(used)e(to)i(separate)h(m)m(ultiple)f(patterns,)g(and)f(the) | |
8945 | g(`)p Ft(\))p Fu(')h(op)s(erator)630 1428 y(terminates)f(a)f(pattern)g | |
8946 | (list.)43 b(A)31 b(list)g(of)g(patterns)g(and)f(an)h(asso)s(ciated)h | |
8947 | (command-list)g(is)630 1538 y(kno)m(wn)e(as)g(a)h Fr(clause)p | |
8948 | Fu(.)630 1665 y(Eac)m(h)42 b(clause)g(m)m(ust)f(b)s(e)g(terminated)h | |
6e51e0d0 CR |
8949 | (with)e(`)p Ft(;;)p Fu(',)45 b(`)p Ft(;&)p Fu(',)f(or)d(`)p |
8950 | Ft(;;&)p Fu('.)73 b(The)41 b Fr(w)m(ord)j Fu(under-)630 | |
e59452c7 CR |
8951 | 1774 y(go)s(es)35 b(tilde)f(expansion,)h(parameter)g(expansion,)g |
8952 | (command)f(substitution,)h(arithmetic)630 1884 y(expansion,)g(and)f | |
8953 | (quote)g(remo)m(v)-5 b(al)36 b(\(see)f(Section)g(3.5.3)h([Shell)e(P)m | |
8954 | (arameter)h(Expansion],)630 1993 y(page)i(26\))g(b)s(efore)e(matc)m | |
8955 | (hing)i(is)f(attempted.)59 b(Eac)m(h)36 b Fr(pattern)g | |
8956 | Fu(undergo)s(es)f(tilde)i(expan-)630 2103 y(sion,)e(parameter)g | |
8957 | (expansion,)g(command)f(substitution,)h(arithmetic)h(expansion,)f(pro-) | |
8958 | 630 2212 y(cess)c(substitution,)f(and)g(quote)h(remo)m(v)-5 | |
8959 | b(al.)630 2339 y(There)30 b(ma)m(y)g(b)s(e)f(an)h(arbitrary)g(n)m(um)m | |
8960 | (b)s(er)f(of)h Ft(case)f Fu(clauses,)i(eac)m(h)g(terminated)g(b)m(y)e | |
8961 | (a)i(`)p Ft(;;)p Fu(',)630 2449 y(`)p Ft(;&)p Fu(',)c(or)e(`)p | |
8962 | Ft(;;&)p Fu('.)39 b(The)25 b(\014rst)g(pattern)h(that)g(matc)m(hes)h | |
8963 | (determines)e(the)h(command-list)g(that)630 2558 y(is)35 | |
8964 | b(executed.)55 b(It's)35 b(a)g(common)g(idiom)g(to)g(use)g(`)p | |
8965 | Ft(*)p Fu(')g(as)g(the)g(\014nal)f(pattern)h(to)h(de\014ne)e(the)630 | |
8966 | 2668 y(default)d(case,)g(since)g(that)g(pattern)f(will)h(alw)m(a)m(ys)h | |
8967 | (matc)m(h.)630 2794 y(Here)j(is)g(an)g(example)h(using)e | |
d37a4722 | 8968 | Ft(case)g Fu(in)g(a)h(script)g(that)h(could)f(b)s(e)f(used)g(to)h |
e59452c7 CR |
8969 | (describ)s(e)g(one)630 2904 y(in)m(teresting)d(feature)f(of)f(an)g |
8970 | (animal:)870 3030 y Ft(echo)47 b(-n)g("Enter)f(the)h(name)f(of)i(an)f | |
8971 | (animal:)f(")870 3140 y(read)h(ANIMAL)870 3249 y(echo)g(-n)g("The)f | |
8972 | ($ANIMAL)g(has)h(")870 3359 y(case)g($ANIMAL)e(in)965 | |
8973 | 3469 y(horse)i(|)g(dog)g(|)h(cat\))e(echo)h(-n)g("four";;)965 | |
8974 | 3578 y(man)g(|)h(kangaroo)d(\))j(echo)e(-n)i("two";;)965 | |
8975 | 3688 y(*\))g(echo)e(-n)h("an)g(unknown)f(number)g(of";;)870 | |
8976 | 3797 y(esac)870 3907 y(echo)h(")g(legs.")630 4050 y Fu(If)40 | |
e230f997 | 8977 | b(the)i(`)p Ft(;;)p Fu(')e(op)s(erator)i(is)f(used,)i(no)e(subsequen)m |
e59452c7 | 8978 | (t)f(matc)m(hes)i(are)f(attempted)h(after)g(the)630 4160 |
e230f997 CR |
8979 | y(\014rst)c(pattern)h(matc)m(h.)67 b(Using)39 b(`)p Ft(;&)p |
8980 | Fu(')g(in)f(place)i(of)f(`)p Ft(;;)p Fu(')g(causes)g(execution)h(to)g | |
e59452c7 | 8981 | (con)m(tin)m(ue)630 4269 y(with)34 b(the)g Fr(command-list)j |
e230f997 | 8982 | Fu(asso)s(ciated)f(with)e(the)h(next)f(clause,)i(if)f(an)m(y)-8 |
e59452c7 | 8983 | b(.)53 b(Using)34 b(`)p Ft(;;&)p Fu(')g(in)630 4379 y(place)c(of)f(`)p |
e230f997 CR |
8984 | Ft(;;)p Fu(')g(causes)h(the)f(shell)h(to)g(test)g(the)f(patterns)g(in)g |
8985 | (the)g(next)h(clause,)g(if)f(an)m(y)-8 b(,)31 b(and)630 | |
e59452c7 | 8986 | 4489 y(execute)26 b(an)m(y)f(asso)s(ciated)h Fr(command-list)h |
e230f997 | 8987 | Fu(on)e(a)f(successful)h(matc)m(h,)i(con)m(tin)m(uing)e(the)g(case)630 |
e59452c7 CR |
8988 | 4598 y(statemen)m(t)32 b(execution)g(as)e(if)h(the)f(pattern)h(list)g |
8989 | (had)f(not)g(matc)m(hed.)630 4725 y(The)c(return)f(status)h(is)g(zero)h | |
e230f997 | 8990 | (if)f(no)g Fr(pattern)g Fu(is)g(matc)m(hed.)40 b(Otherwise,)27 |
e59452c7 CR |
8991 | b(the)g(return)e(status)630 4834 y(is)30 b(the)h(exit)g(status)g(of)f |
8992 | (the)h Fr(command-list)i Fu(executed.)150 4977 y Ft(select)630 | |
8993 | 5104 y Fu(The)g Ft(select)f Fu(construct)i(allo)m(ws)h(the)f(easy)g | |
1a5fa30b | 8994 | (generation)h(of)e(men)m(us.)50 b(It)34 b(has)f(almost)i(the)630 |
e59452c7 CR |
8995 | 5214 y(same)c(syn)m(tax)g(as)f(the)h Ft(for)e Fu(command:)870 |
8996 | 5340 y Ft(select)46 b Fj(name)h Ft([in)g Fj(words)f Ft(...)o(];)h(do)h | |
8997 | Fj(commands)p Ft(;)d(done)p eop end | |
d37a4722 CR |
8998 | %%Page: 14 20 |
8999 | TeXDict begin 14 19 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9000 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(14)630 299 | |
e59452c7 CR |
9001 | y(The)25 b(list)h(of)f(w)m(ords)g(follo)m(wing)i Ft(in)d |
9002 | Fu(is)h(expanded,)h(generating)h(a)e(list)h(of)g(items.)39 | |
9003 | b(The)25 b(set)h(of)630 408 y(expanded)i(w)m(ords)h(is)g(prin)m(ted)f | |
9004 | (on)h(the)g(standard)f(error)h(output)f(stream,)i(eac)m(h)g(preceded) | |
9005 | 630 518 y(b)m(y)21 b(a)g(n)m(um)m(b)s(er.)37 b(If)20 | |
9006 | b(the)i(`)p Ft(in)30 b Fj(words)p Fu(')20 b(is)h(omitted,)j(the)d(p)s | |
9007 | (ositional)h(parameters)g(are)f(prin)m(ted,)630 628 y(as)28 | |
9008 | b(if)f(`)p Ft(in)j("$@")p Fu(')d(had)f(b)s(een)h(sp)s(eci\014ed.)39 | |
9009 | b(The)27 b Ft(PS3)g Fu(prompt)f(is)i(then)f(displa)m(y)m(ed)h(and)f(a)h | |
9010 | (line)630 737 y(is)h(read)f(from)h(the)f(standard)g(input.)39 | |
9011 | b(If)29 b(the)g(line)g(consists)g(of)g(a)g(n)m(um)m(b)s(er)e(corresp)s | |
9012 | (onding)630 847 y(to)36 b(one)f(of)h(the)f(displa)m(y)m(ed)h(w)m(ords,) | |
9013 | g(then)f(the)g(v)-5 b(alue)36 b(of)f Fr(name)40 b Fu(is)35 | |
9014 | b(set)h(to)g(that)g(w)m(ord.)54 b(If)630 956 y(the)37 | |
9015 | b(line)h(is)f(empt)m(y)-8 b(,)39 b(the)e(w)m(ords)g(and)f(prompt)g(are) | |
9016 | i(displa)m(y)m(ed)f(again.)62 b(If)37 b Ft(EOF)f Fu(is)h(read,)630 | |
9017 | 1066 y(the)c Ft(select)e Fu(command)i(completes.)50 b(An)m(y)33 | |
9018 | b(other)g(v)-5 b(alue)33 b(read)g(causes)g Fr(name)38 | |
9019 | b Fu(to)c(b)s(e)e(set)630 1176 y(to)f(n)m(ull.)41 b(The)30 | |
9020 | b(line)g(read)h(is)f(sa)m(v)m(ed)h(in)g(the)f(v)-5 b(ariable)31 | |
9021 | b Ft(REPLY)p Fu(.)630 1310 y(The)42 b Fr(commands)j Fu(are)d(executed)h | |
9022 | (after)g(eac)m(h)g(selection)h(un)m(til)e(a)h Ft(break)d | |
9023 | Fu(command)i(is)630 1420 y(executed,)32 b(at)f(whic)m(h)f(p)s(oin)m(t)g | |
9024 | (the)h Ft(select)d Fu(command)i(completes.)630 1555 y(Here)39 | |
9025 | b(is)g(an)g(example)h(that)f(allo)m(ws)i(the)e(user)f(to)i(pic)m(k)f(a) | |
9026 | g(\014lename)h(from)e(the)h(curren)m(t)630 1665 y(directory)-8 | |
9027 | b(,)32 b(and)d(displa)m(ys)i(the)f(name)h(and)f(index)f(of)i(the)g | |
9028 | (\014le)f(selected.)870 1799 y Ft(select)46 b(fname)g(in)i(*;)870 | |
9029 | 1909 y(do)870 2019 y(echo)f(you)g(picked)f($fname)g(\\\($REPLY\\\))870 | |
9030 | 2128 y(break;)870 2238 y(done)150 2398 y(\(\(...)o(\)\))870 | |
9031 | 2533 y(\(\()h Fj(expression)e Ft(\)\))630 2668 y Fu(The)33 | |
9032 | b(arithmetic)i Fr(expression)f Fu(is)f(ev)-5 b(aluated)35 | |
9033 | b(according)g(to)f(the)g(rules)f(describ)s(ed)g(b)s(elo)m(w)630 | |
9034 | 2777 y(\(see)22 b(Section)f(6.5)h([Shell)f(Arithmetic],)j(page)d(97\).) | |
9035 | 39 b(The)20 b Fr(expression)h Fu(undergo)s(es)f(the)h(same)630 | |
9036 | 2887 y(expansions)35 b(as)h(if)f(it)h(w)m(ere)g(within)f(double)f | |
9037 | (quotes,)k(but)d(double)f(quote)i(c)m(haracters)h(in)630 | |
9038 | 2996 y Fr(expression)29 b Fu(are)h(not)f(treated)h(sp)s(ecially)g(are)g | |
9039 | (remo)m(v)m(ed.)41 b(If)29 b(the)h(v)-5 b(alue)29 b(of)h(the)f | |
9040 | (expression)630 3106 y(is)h(non-zero,)i(the)e(return)f(status)i(is)g | |
9041 | (0;)g(otherwise)f(the)h(return)e(status)i(is)f(1.)150 | |
9042 | 3266 y Ft([[...)o(]])870 3401 y([[)47 b Fj(expression)e | |
9043 | Ft(]])630 3536 y Fu(Return)25 b(a)h(status)f(of)h(0)g(or)g(1)g(dep)s | |
9044 | (ending)e(on)h(the)h(ev)-5 b(aluation)27 b(of)e(the)h(conditional)h | |
9045 | (expres-)630 3646 y(sion)j Fr(expression)p Fu(.)41 b(Expressions)29 | |
9046 | b(are)i(comp)s(osed)f(of)g(the)h(primaries)f(describ)s(ed)f(b)s(elo)m | |
9047 | (w)h(in)630 3755 y(Section)37 b(6.4)g([Bash)f(Conditional)h | |
9048 | (Expressions],)g(page)g(95.)58 b(The)36 b(w)m(ords)f(b)s(et)m(w)m(een)i | |
9049 | (the)630 3865 y Ft([[)h Fu(and)g Ft(]])g Fu(do)g(not)h(undergo)f(w)m | |
9050 | (ord)g(splitting)h(and)f(\014lename)h(expansion.)65 b(The)38 | |
9051 | b(shell)630 3974 y(p)s(erforms)26 b(tilde)j(expansion,)f(parameter)g | |
9052 | (and)g(v)-5 b(ariable)28 b(expansion,)h(arithmetic)g(expan-)630 | |
9053 | 4084 y(sion,)j(command)g(substitution,)g(pro)s(cess)g(substitution,)g | |
9054 | (and)f(quote)i(remo)m(v)-5 b(al)33 b(on)e(those)630 4194 | |
9055 | y(w)m(ords)k(\(the)h(expansions)g(that)g(w)m(ould)f(o)s(ccur)h(if)g | |
9056 | (the)f(w)m(ords)h(w)m(ere)g(enclosed)g(in)f(double)630 | |
9057 | 4303 y(quotes\).)41 b(Conditional)28 b(op)s(erators)g(suc)m(h)f(as)i(`) | |
9058 | p Ft(-f)p Fu(')e(m)m(ust)h(b)s(e)f(unquoted)g(to)h(b)s(e)g(recognized) | |
9059 | 630 4413 y(as)j(primaries.)630 4548 y(When)k(used)f(with)h | |
9060 | Ft([[)p Fu(,)h(the)f(`)p Ft(<)p Fu(')g(and)g(`)p Ft(>)p | |
9061 | Fu(')g(op)s(erators)g(sort)g(lexicographically)j(using)d(the)630 | |
9062 | 4657 y(curren)m(t)30 b(lo)s(cale.)630 4792 y(When)22 | |
9063 | b(the)h(`)p Ft(==)p Fu(')f(and)g(`)p Ft(!=)p Fu(')g(op)s(erators)h(are) | |
9064 | g(used,)g(the)g(string)f(to)i(the)e(righ)m(t)h(of)g(the)g(op)s(erator) | |
9065 | 630 4902 y(is)31 b(considered)g(a)h(pattern)f(and)g(matc)m(hed)h | |
9066 | (according)g(to)g(the)g(rules)f(describ)s(ed)f(b)s(elo)m(w)h(in)630 | |
9067 | 5011 y(Section)d(3.5.8.1)h([P)m(attern)f(Matc)m(hing],)h(page)f(36,)g | |
9068 | (as)f(if)g(the)g Ft(extglob)d Fu(shell)j(option)g(w)m(ere)630 | |
9069 | 5121 y(enabled.)46 b(The)31 b(`)p Ft(=)p Fu(')h(op)s(erator)h(is)f | |
9070 | (iden)m(tical)h(to)g(`)p Ft(==)p Fu('.)46 b(If)31 b(the)h | |
9071 | Ft(nocasematch)d Fu(shell)j(option)630 5230 y(\(see)42 | |
9072 | b(the)f(description)g(of)h Ft(shopt)d Fu(in)i(Section)h(4.3.2)h([The)e | |
9073 | (Shopt)f(Builtin],)45 b(page)d(70\))630 5340 y(is)e(enabled,)i(the)e | |
9074 | (matc)m(h)h(is)e(p)s(erformed)g(without)g(regard)h(to)h(the)f(case)g | |
9075 | (of)g(alphab)s(etic)p eop end | |
fc35c477 CR |
9076 | %%Page: 15 21 |
9077 | TeXDict begin 15 20 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9078 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(15)630 299 | |
e59452c7 CR |
9079 | y(c)m(haracters.)41 b(The)28 b(return)e(v)-5 b(alue)28 |
9080 | b(is)g(0)g(if)g(the)g(string)g(matc)m(hes)h(\(`)p Ft(==)p | |
9081 | Fu('\))f(or)g(do)s(es)f(not)h(matc)m(h)630 408 y(\(`)p | |
9082 | Ft(!=)p Fu('\))j(the)g(pattern,)f(and)g(1)h(otherwise.)630 | |
9083 | 543 y(If)20 b(y)m(ou)h(quote)g(an)m(y)f(part)h(of)f(the)h(pattern,)h | |
9084 | (using)e(an)m(y)h(of)f(the)h(shell's)g(quoting)g(mec)m(hanisms,)630 | |
9085 | 653 y(the)43 b(quoted)g(p)s(ortion)g(is)g(matc)m(hed)h(literally)-8 | |
9086 | b(.)81 b(This)42 b(means)h(ev)m(ery)h(c)m(haracter)h(in)e(the)630 | |
9087 | 763 y(quoted)34 b(p)s(ortion)f(matc)m(hes)i(itself,)h(instead)e(of)f | |
9088 | (ha)m(ving)i(an)m(y)f(sp)s(ecial)g(pattern)g(matc)m(hing)630 | |
9089 | 872 y(meaning.)630 1007 y(An)f(additional)i(binary)e(op)s(erator,)i(`)p | |
9090 | Ft(=~)p Fu(',)g(is)f(a)m(v)-5 b(ailable,)37 b(with)c(the)h(same)g | |
9091 | (precedence)h(as)630 1117 y(`)p Ft(==)p Fu(')40 b(and)g(`)p | |
9092 | Ft(!=)p Fu('.)70 b(When)40 b(y)m(ou)g(use)g(`)p Ft(=~)p | |
9093 | Fu(',)j(the)d(string)h(to)f(the)h(righ)m(t)g(of)f(the)g(op)s(erator)h | |
9094 | (is)630 1226 y(considered)36 b(a)g Fm(posix)f Fu(extended)g(regular)h | |
9095 | (expression)g(pattern)f(and)g(matc)m(hed)i(accord-)630 | |
9096 | 1336 y(ingly)k(\(using)f(the)h Fm(posix)f Ft(regcomp)f | |
9097 | Fu(and)h Ft(regexec)e Fu(in)m(terfaces)k(usually)f(describ)s(ed)e(in) | |
9098 | 630 1445 y Fl(r)-5 b(e)g(gex)11 b Fu(\(3\)\).)56 b(The)34 | |
9099 | b(return)g(v)-5 b(alue)35 b(is)g(0)g(if)g(the)g(string)g(matc)m(hes)h | |
9100 | (the)f(pattern,)h(and)e(1)i(if)e(it)630 1555 y(do)s(es)39 | |
9101 | b(not.)66 b(If)38 b(the)h(regular)g(expression)g(is)g(syn)m(tactically) | |
9102 | i(incorrect,)i(the)c(conditional)630 1665 y(expression)e(returns)e(2.) | |
9103 | 61 b(If)37 b(the)g Ft(nocasematch)d Fu(shell)j(option)h(\(see)g(the)f | |
9104 | (description)g(of)630 1774 y Ft(shopt)d Fu(in)h(Section)h(4.3.2)h([The) | |
9105 | e(Shopt)f(Builtin],)k(page)e(70\))g(is)g(enabled,)g(the)g(matc)m(h)g | |
9106 | (is)630 1884 y(p)s(erformed)29 b(without)h(regard)h(to)g(the)f(case)i | |
9107 | (of)e(alphab)s(etic)h(c)m(haracters.)630 2019 y(Y)-8 | |
9108 | b(ou)23 b(can)g(quote)g(an)m(y)g(part)g(of)g(the)g(pattern)f(to)i | |
9109 | (force)f(the)g(quoted)g(p)s(ortion)f(to)h(b)s(e)f(matc)m(hed)630 | |
9110 | 2128 y(literally)33 b(instead)f(of)g(as)f(a)h(regular)g(expression)f | |
9111 | (\(see)h(ab)s(o)m(v)m(e\).)46 b(If)31 b(the)h(pattern)f(is)h(stored)630 | |
9112 | 2238 y(in)h(a)i(shell)f(v)-5 b(ariable,)35 b(quoting)f(the)g(v)-5 | |
9113 | b(ariable)35 b(expansion)e(forces)i(the)f(en)m(tire)g(pattern)g(to)630 | |
9114 | 2347 y(b)s(e)c(matc)m(hed)h(literally)-8 b(.)630 2482 | |
9115 | y(The)25 b(pattern)h(will)g(matc)m(h)h(if)e(it)i(matc)m(hes)f(an)m(y)h | |
9116 | (part)e(of)h(the)g(string.)39 b(If)25 b(y)m(ou)h(w)m(an)m(t)h(to)f | |
9117 | (force)630 2592 y(the)j(pattern)h(to)g(matc)m(h)g(the)f(en)m(tire)h | |
9118 | (string,)g(anc)m(hor)g(the)f(pattern)h(using)e(the)i(`)p | |
9119 | Ft(^)p Fu(')f(and)g(`)p Ft($)p Fu(')630 2701 y(regular)i(expression)f | |
9120 | (op)s(erators.)630 2836 y(F)-8 b(or)31 b(example,)g(the)f(follo)m(wing) | |
9121 | h(will)f(matc)m(h)h(a)g(line)f(\(stored)g(in)g(the)g(shell)g(v)-5 | |
9122 | b(ariable)31 b Ft(line)p Fu(\))630 2946 y(if)42 b(there)h(is)g(a)f | |
9123 | (sequence)h(of)g(c)m(haracters)h(an)m(ywhere)e(in)g(the)h(v)-5 | |
9124 | b(alue)43 b(consisting)g(of)g(an)m(y)630 3055 y(n)m(um)m(b)s(er,)26 | |
9125 | b(including)g(zero,)i(of)f(c)m(haracters)g(in)f(the)h | |
9126 | Ft(space)e Fu(c)m(haracter)j(class,)g(immediately)630 | |
9127 | 3165 y(follo)m(w)m(ed)k(b)m(y)e(zero)h(or)g(one)f(instances)h(of)g(`)p | |
9128 | Ft(a)p Fu(',)g(then)f(a)h(`)p Ft(b)p Fu(':)870 3300 y | |
9129 | Ft([[)47 b($line)g(=~)g([[:space:]]*\(a\)?b)c(]])630 | |
9130 | 3435 y Fu(That)f(means)g(v)-5 b(alues)42 b(for)g Ft(line)f | |
9131 | Fu(lik)m(e)i(`)p Ft(aab)p Fu(',)i(`)31 b Ft(aaaaaab)p | |
9132 | Fu(',)43 b(`)p Ft(xaby)p Fu(',)i(and)c(`)31 b Ft(ab)p | |
9133 | Fu(')42 b(will)g(all)630 3544 y(matc)m(h,)32 b(as)e(will)h(a)g(line)f | |
9134 | (con)m(taining)i(a)f(`)p Ft(b)p Fu(')g(an)m(ywhere)f(in)g(its)h(v)-5 | |
9135 | b(alue.)630 3679 y(If)28 b(y)m(ou)h(w)m(an)m(t)g(to)g(matc)m(h)h(a)e(c) | |
9136 | m(haracter)j(that's)e(sp)s(ecial)g(to)g(the)g(regular)f(expression)g | |
9137 | (gram-)630 3789 y(mar)g(\(`)p Ft(^$|[]\(\)\\.*+?)p Fu('\),)e(it)j(has)f | |
9138 | (to)h(b)s(e)e(quoted)h(to)h(remo)m(v)m(e)g(its)g(sp)s(ecial)g(meaning.) | |
9139 | 40 b(This)630 3898 y(means)24 b(that)h(in)f(the)h(pattern)f(`)p | |
9140 | Ft(xxx.txt)p Fu(',)g(the)h(`)p Ft(.)p Fu(')f(matc)m(hes)i(an)m(y)f(c)m | |
9141 | (haracter)g(in)f(the)h(string)630 4008 y(\(its)34 b(usual)f(regular)g | |
9142 | (expression)g(meaning\),)i(but)e(in)g(the)g(pattern)h(`)p | |
9143 | Ft("xxx.txt")p Fu(',)e(it)i(can)630 4118 y(only)c(matc)m(h)i(a)f | |
9144 | (literal)g(`)p Ft(.)p Fu('.)630 4253 y(Lik)m(ewise,)i(if)f(y)m(ou)g(w)m | |
9145 | (an)m(t)g(to)h(include)e(a)h(c)m(haracter)h(in)e(y)m(our)h(pattern)g | |
9146 | (that)g(has)f(a)h(sp)s(ecial)630 4362 y(meaning)21 b(to)h(the)g | |
9147 | (regular)f(expression)g(grammar,)i(y)m(ou)f(m)m(ust)f(mak)m(e)h(sure)e | |
9148 | (it's)i(not)g(quoted.)630 4472 y(If)44 b(y)m(ou)g(w)m(an)m(t)h(to)g | |
9149 | (anc)m(hor)f(a)h(pattern)f(at)h(the)f(b)s(eginning)f(or)h(end)g(of)g | |
9150 | (the)g(string,)k(for)630 4581 y(instance,)e(y)m(ou)d(cannot)g(quote)g | |
9151 | (the)f(`)p Ft(^)p Fu(')h(or)f(`)p Ft($)p Fu(')g(c)m(haracters)i(using)e | |
9152 | (an)m(y)g(form)g(of)h(shell)630 4691 y(quoting.)630 4826 | |
9153 | y(If)28 b(y)m(ou)h(w)m(an)m(t)g(to)g(matc)m(h)h(`)p Ft(initial)e | |
9154 | (string)p Fu(')f(at)i(the)g(start)g(of)g(a)g(line,)g(the)g(follo)m | |
9155 | (wing)h(will)630 4935 y(w)m(ork:)870 5070 y Ft([[)47 | |
9156 | b($line)g(=~)g(^"initial)e(string")h(]])630 5205 y Fu(but)30 | |
9157 | b(this)g(will)h(not:)870 5340 y Ft([[)47 b($line)g(=~)g("^initial)e | |
9158 | (string")h(]])p eop end | |
9159 | %%Page: 16 22 | |
9160 | TeXDict begin 16 21 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9161 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(16)630 299 | |
9162 | y(b)s(ecause)42 b(in)h(the)f(second)h(example)g(the)g(`)p | |
9163 | Ft(^)p Fu(')f(is)h(quoted)g(and)f(do)s(esn't)g(ha)m(v)m(e)i(its)e | |
9164 | (usual)630 408 y(sp)s(ecial)31 b(meaning.)630 540 y(It)h(is)f | |
9165 | (sometimes)h(di\016cult)g(to)g(sp)s(ecify)f(a)h(regular)g(expression)f | |
9166 | (prop)s(erly)f(without)h(using)630 650 y(quotes,)c(or)f(to)g(k)m(eep)h | |
9167 | (trac)m(k)g(of)e(the)h(quoting)g(used)f(b)m(y)h(regular)f(expressions)h | |
9168 | (while)f(pa)m(ying)630 759 y(atten)m(tion)40 b(to)f(shell)f(quoting)h | |
9169 | (and)e(the)h(shell's)h(quote)f(remo)m(v)-5 b(al.)65 b(Storing)38 | |
9170 | b(the)h(regular)630 869 y(expression)45 b(in)g(a)g(shell)h(v)-5 | |
9171 | b(ariable)46 b(is)f(often)g(a)h(useful)e(w)m(a)m(y)i(to)g(a)m(v)m(oid)h | |
9172 | (problems)d(with)630 978 y(quoting)35 b(c)m(haracters)g(that)g(are)g | |
9173 | (sp)s(ecial)g(to)g(the)f(shell.)53 b(F)-8 b(or)35 b(example,)h(the)e | |
9174 | (follo)m(wing)i(is)630 1088 y(equiv)-5 b(alen)m(t)32 | |
9175 | b(to)f(the)f(pattern)h(used)f(ab)s(o)m(v)m(e:)870 1219 | |
9176 | y Ft(pattern='[[:space:]]*\(a\))o(?b')870 1329 y([[)47 | |
9177 | b($line)g(=~)g($pattern)e(]])630 1461 y Fu(Shell)29 b(programmers)f | |
9178 | (should)f(tak)m(e)k(sp)s(ecial)e(care)g(with)g(bac)m(kslashes,)h(since) | |
9179 | f(bac)m(kslashes)630 1570 y(are)22 b(used)f(b)m(y)h(b)s(oth)f(the)h | |
9180 | (shell)g(and)f(regular)h(expressions)f(to)i(remo)m(v)m(e)g(the)f(sp)s | |
9181 | (ecial)h(meaning)630 1680 y(from)j(the)g(follo)m(wing)i(c)m(haracter.) | |
9182 | 41 b(This)25 b(means)h(that)h(after)g(the)f(shell's)g(w)m(ord)g | |
9183 | (expansions)630 1789 y(complete)i(\(see)f(Section)g(3.5)h([Shell)e | |
9184 | (Expansions],)h(page)g(24\),)i(an)m(y)d(bac)m(kslashes)i(remain-)630 | |
9185 | 1899 y(ing)44 b(in)f(parts)g(of)h(the)g(pattern)f(that)h(w)m(ere)g | |
9186 | (originally)h(not)f(quoted)g(can)g(remo)m(v)m(e)h(the)630 | |
9187 | 2008 y(sp)s(ecial)29 b(meaning)g(of)g(pattern)f(c)m(haracters.)42 | |
9188 | b(If)28 b(an)m(y)h(part)g(of)f(the)h(pattern)g(is)f(quoted,)i(the)630 | |
9189 | 2118 y(shell)h(do)s(es)f(its)g(b)s(est)g(to)i(ensure)d(that)i(the)g | |
9190 | (regular)f(expression)h(treats)g(those)g(remaining)630 | |
9191 | 2228 y(bac)m(kslashes)g(as)g(literal,)h(if)e(they)h(app)s(eared)f(in)g | |
9192 | (a)g(quoted)h(p)s(ortion.)630 2359 y(The)f(follo)m(wing)i(t)m(w)m(o)f | |
9193 | (sets)g(of)g(commands)f(are)h Fl(not)39 b Fu(equiv)-5 | |
9194 | b(alen)m(t:)870 2491 y Ft(pattern='\\.')870 2710 y([[)47 | |
9195 | b(.)h(=~)f($pattern)e(]])870 2819 y([[)i(.)h(=~)f(\\.)g(]])870 | |
9196 | 3039 y([[)g(.)h(=~)f("$pattern")e(]])870 3148 y([[)i(.)h(=~)f('\\.')f | |
9197 | (]])630 3280 y Fu(The)28 b(\014rst)h(t)m(w)m(o)h(matc)m(hes)g(will)f | |
9198 | (succeed,)h(but)f(the)g(second)g(t)m(w)m(o)h(will)f(not,)h(b)s(ecause)f | |
9199 | (in)g(the)630 3389 y(second)e(t)m(w)m(o)i(the)e(bac)m(kslash)h(will)f | |
9200 | (b)s(e)g(part)g(of)g(the)g(pattern)g(to)h(b)s(e)f(matc)m(hed.)40 | |
9201 | b(In)26 b(the)i(\014rst)630 3499 y(t)m(w)m(o)33 b(examples,)f(the)g | |
9202 | (pattern)f(passed)g(to)h(the)g(regular)f(expression)h(parser)e(is)i(`)p | |
9203 | Ft(\\.)p Fu('.)43 b(The)630 3608 y(bac)m(kslash)35 b(remo)m(v)m(es)g | |
9204 | (the)g(sp)s(ecial)f(meaning)h(from)e(`)p Ft(.)p Fu(',)j(so)e(the)h | |
9205 | (literal)g(`)p Ft(.)p Fu(')g(matc)m(hes.)53 b(In)630 | |
9206 | 3718 y(the)35 b(second)h(t)m(w)m(o)g(examples,)h(the)f(pattern)f | |
9207 | (passed)g(to)h(the)f(regular)h(expression)f(parser)630 | |
9208 | 3828 y(has)26 b(the)g(bac)m(kslash)g(quoted)g(\(e.g.,)j(`)p | |
9209 | Ft(\\\\\\.)p Fu('\),)e(whic)m(h)e(will)h(not)g(matc)m(h)h(the)f | |
9210 | (string,)h(since)f(it)630 3937 y(do)s(es)31 b(not)g(con)m(tain)h(a)g | |
9211 | (bac)m(kslash.)43 b(If)31 b(the)g(string)g(in)g(the)g(\014rst)f | |
9212 | (examples)i(w)m(ere)g(an)m(ything)630 4047 y(other)f(than)f(`)p | |
9213 | Ft(.)p Fu(',)h(sa)m(y)g(`)p Ft(a)p Fu(',)g(the)f(pattern)h(w)m(ould)f | |
9214 | (not)h(matc)m(h,)g(b)s(ecause)g(the)f(quoted)h(`)p Ft(.)p | |
9215 | Fu(')f(in)630 4156 y(the)h(pattern)f(loses)h(its)g(sp)s(ecial)g | |
9216 | (meaning)g(of)f(matc)m(hing)i(an)m(y)e(single)h(c)m(haracter.)630 | |
9217 | 4288 y(Brac)m(k)m(et)d(expressions)d(in)g(regular)h(expressions)f(can)h | |
9218 | (b)s(e)e(sources)i(of)f(errors)g(as)h(w)m(ell,)i(since)630 | |
9219 | 4398 y(c)m(haracters)43 b(that)f(are)g(normally)g(sp)s(ecial)g(in)f | |
9220 | (regular)h(expressions)f(lose)i(their)e(sp)s(ecial)630 | |
9221 | 4507 y(meanings)24 b(b)s(et)m(w)m(een)g(brac)m(k)m(ets.)40 | |
9222 | b(Ho)m(w)m(ev)m(er,)27 b(y)m(ou)e(can)f(use)f(brac)m(k)m(et)i | |
9223 | (expressions)f(to)g(matc)m(h)630 4617 y(sp)s(ecial)31 | |
9224 | b(pattern)g(c)m(haracters)h(without)f(quoting)g(them,)f(so)h(they)g | |
9225 | (are)g(sometimes)h(useful)630 4726 y(for)e(this)g(purp)s(ose.)630 | |
9226 | 4858 y(Though)f(it)i(migh)m(t)g(seem)f(lik)m(e)i(a)e(strange)h(w)m(a)m | |
9227 | (y)g(to)g(write)f(it,)h(the)g(follo)m(wing)g(pattern)g(will)630 | |
9228 | 4967 y(matc)m(h)g(a)g(`)p Ft(.)p Fu(')g(in)f(the)g(string:)870 | |
9229 | 5099 y Ft([[)47 b(.)h(=~)f([.])g(]])630 5230 y Fu(The)30 | |
9230 | b(shell)g(p)s(erforms)f(an)m(y)i(w)m(ord)f(expansions)g(b)s(efore)g | |
9231 | (passing)g(the)g(pattern)h(to)g(the)f(reg-)630 5340 y(ular)44 | |
9232 | b(expression)g(functions,)k(so)d(y)m(ou)f(can)h(assume)f(that)h(the)g | |
9233 | (shell's)g(quoting)f(tak)m(es)p eop end | |
9234 | %%Page: 17 23 | |
9235 | TeXDict begin 17 22 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9236 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(17)630 299 | |
9237 | y(precedence.)63 b(As)37 b(noted)h(ab)s(o)m(v)m(e,)j(the)d(regular)f | |
9238 | (expression)h(parser)f(will)h(in)m(terpret)g(an)m(y)630 | |
9239 | 408 y(unquoted)30 b(bac)m(kslashes)h(remaining)g(in)g(the)g(pattern)f | |
9240 | (after)i(shell)e(expansion)h(according)630 518 y(to)40 | |
9241 | b(its)g(o)m(wn)f(rules.)68 b(The)39 b(in)m(ten)m(tion)i(is)e(to)h(a)m | |
9242 | (v)m(oid)h(making)f(shell)f(programmers)g(quote)630 628 | |
9243 | y(things)31 b(t)m(wice)h(as)f(m)m(uc)m(h)f(as)h(p)s(ossible,)g(so)g | |
9244 | (shell)g(quoting)g(should)f(b)s(e)g(su\016cien)m(t)h(to)g(quote)630 | |
9245 | 737 y(sp)s(ecial)g(pattern)f(c)m(haracters)i(where)e(that's)h | |
9246 | (necessary)-8 b(.)630 878 y(The)39 b(arra)m(y)h(v)-5 | |
9247 | b(ariable)40 b Ft(BASH_REMATCH)c Fu(records)j(whic)m(h)g(parts)g(of)g | |
9248 | (the)h(string)f(matc)m(hed)630 987 y(the)34 b(pattern.)51 | |
9249 | b(The)33 b(elemen)m(t)i(of)f Ft(BASH_REMATCH)d Fu(with)i(index)g(0)h | |
9250 | (con)m(tains)h(the)f(p)s(ortion)630 1097 y(of)39 b(the)g(string)g(matc) | |
9251 | m(hing)h(the)g(en)m(tire)f(regular)h(expression.)66 b(Substrings)37 | |
9252 | b(matc)m(hed)j(b)m(y)630 1207 y(paren)m(thesized)k(sub)s(expressions)e | |
9253 | (within)i(the)g(regular)g(expression)g(are)g(sa)m(v)m(ed)h(in)f(the)630 | |
9254 | 1316 y(remaining)33 b Ft(BASH_REMATCH)c Fu(indices.)49 | |
9255 | b(The)32 b(elemen)m(t)i(of)f Ft(BASH_REMATCH)d Fu(with)i(index)g | |
9256 | Fr(n)630 1426 y Fu(is)e(the)h(p)s(ortion)f(of)g(the)h(string)f(matc)m | |
9257 | (hing)i(the)e Fr(n)p Fu(th)g(paren)m(thesized)h(sub)s(expression.)630 | |
9258 | 1567 y(Expressions)23 b(ma)m(y)h(b)s(e)e(com)m(bined)i(using)f(the)h | |
d37a4722 | 9259 | (follo)m(wing)h(op)s(erators,)g(listed)f(in)f(decreasing)630 |
e59452c7 CR |
9260 | 1676 y(order)30 b(of)g(precedence:)630 1848 y Ft(\()g |
9261 | Fj(expression)e Ft(\))1110 1957 y Fu(Returns)i(the)h(v)-5 | |
9262 | b(alue)31 b(of)g Fr(expression)p Fu(.)42 b(This)30 b(ma)m(y)i(b)s(e)e | |
9263 | (used)g(to)i(o)m(v)m(erride)g(the)1110 2067 y(normal)e(precedence)h(of) | |
9264 | g(op)s(erators.)630 2239 y Ft(!)f Fj(expression)1110 | |
9265 | 2348 y Fu(T)-8 b(rue)30 b(if)g Fr(expression)g Fu(is)h(false.)630 | |
9266 | 2520 y Fj(expression1)c Ft(&&)j Fj(expression2)1110 2630 | |
9267 | y Fu(T)-8 b(rue)30 b(if)g(b)s(oth)g Fr(expression1)38 | |
9268 | b Fu(and)29 b Fr(expression2)38 b Fu(are)31 b(true.)630 | |
9269 | 2801 y Fj(expression1)c Ft(||)j Fj(expression2)1110 2911 | |
9270 | y Fu(T)-8 b(rue)30 b(if)g(either)h Fr(expression1)38 | |
6e51e0d0 | 9271 | b Fu(or)30 b Fr(expression2)38 b Fu(is)30 b(true.)630 |
e59452c7 | 9272 | 3083 y(The)24 b Ft(&&)h Fu(and)f Ft(||)g Fu(op)s(erators)h(do)g(not)g |
6e51e0d0 | 9273 | (ev)-5 b(aluate)27 b Fr(expression2)32 b Fu(if)25 b(the)g(v)-5 |
e59452c7 | 9274 | b(alue)25 b(of)g Fr(expression1)630 3192 y Fu(is)30 b(su\016cien)m(t)h |
6e51e0d0 | 9275 | (to)g(determine)g(the)f(return)g(v)-5 b(alue)31 b(of)f(the)h(en)m(tire) |
e59452c7 CR |
9276 | g(conditional)h(expression.)150 3404 y Fk(3.2.5.3)63 |
9277 | b(Grouping)43 b(Commands)150 3551 y Fu(Bash)30 b(pro)m(vides)g(t)m(w)m | |
d37a4722 | 9278 | (o)h(w)m(a)m(ys)f(to)h(group)e(a)h(list)g(of)g(commands)f(to)i(b)s(e)e |
e59452c7 | 9279 | (executed)h(as)g(a)h(unit.)40 b(When)29 b(com-)150 3661 |
d37a4722 CR |
9280 | y(mands)h(are)i(group)s(ed,)f(redirections)h(ma)m(y)g(b)s(e)e(applied)i |
9281 | (to)g(the)f(en)m(tire)h(command)g(list.)44 b(F)-8 b(or)32 | |
e59452c7 | 9282 | b(example,)150 3770 y(the)f(output)f(of)g(all)h(the)g(commands)f(in)g |
d37a4722 | 9283 | (the)h(list)g(ma)m(y)g(b)s(e)e(redirected)i(to)g(a)g(single)g(stream.) |
e59452c7 CR |
9284 | 150 3948 y Ft(\(\))870 4089 y(\()47 b Fj(list)g Ft(\))630 |
9285 | 4229 y Fu(Placing)42 b(a)g(list)g(of)f(commands)g(b)s(et)m(w)m(een)h | |
9286 | (paren)m(theses)f(forces)h(the)f(shell)h(to)g(create)h(a)630 | |
9287 | 4339 y(subshell)33 b(\(see)h(Section)g(3.7.3)i([Command)c(Execution)j | |
9288 | (En)m(vironmen)m(t],)g(page)f(42\),)i(and)630 4449 y(eac)m(h)g(of)f | |
9289 | (the)h(commands)e(in)h Fr(list)i Fu(is)e(executed)h(in)f(that)h | |
9290 | (subshell)e(en)m(vironmen)m(t.)55 b(Since)630 4558 y(the)33 | |
9291 | b Fr(list)j Fu(is)e(executed)g(in)f(a)g(subshell,)h(v)-5 | |
9292 | b(ariable)34 b(assignmen)m(ts)g(do)f(not)g(remain)g(in)g(e\013ect)630 | |
9293 | 4668 y(after)e(the)f(subshell)g(completes.)150 4839 y | |
9294 | Ft({})870 4980 y({)47 b Fj(list)p Ft(;)g(})630 5121 y | |
9295 | Fu(Placing)30 b(a)g(list)g(of)g(commands)f(b)s(et)m(w)m(een)h(curly)f | |
037a8b7f | 9296 | (braces)g(causes)h(the)f(list)h(to)g(b)s(e)f(executed)630 |
e59452c7 | 9297 | 5230 y(in)d(the)h(curren)m(t)g(shell)f(con)m(text.)42 |
037a8b7f | 9298 | b(No)27 b(subshell)f(is)g(created.)41 b(The)26 b(semicolon)i(\(or)f |
e59452c7 CR |
9299 | (newline\))630 5340 y(follo)m(wing)32 b Fr(list)h Fu(is)d(required.)p |
9300 | eop end | |
9301 | %%Page: 18 24 | |
9302 | TeXDict begin 18 23 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9303 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(18)275 299 | |
9304 | y(In)44 b(addition)h(to)h(the)f(creation)i(of)e(a)g(subshell,)j(there)e | |
9305 | (is)f(a)g(subtle)g(di\013erence)h(b)s(et)m(w)m(een)f(these)150 | |
9306 | 408 y(t)m(w)m(o)f(constructs)f(due)g(to)g(historical)i(reasons.)78 | |
9307 | b(The)42 b(braces)i(are)f(reserv)m(ed)g(w)m(ords,)j(so)d(they)g(m)m | |
9308 | (ust)150 518 y(b)s(e)36 b(separated)h(from)f(the)g Fr(list)j | |
9309 | Fu(b)m(y)e Ft(blank)p Fu(s)e(or)h(other)h(shell)f(metac)m(haracters.)62 | |
9310 | b(The)36 b(paren)m(theses)h(are)150 628 y(op)s(erators,)29 | |
9311 | b(and)e(are)i(recognized)g(as)g(separate)g(tok)m(ens)g(b)m(y)f(the)g | |
9312 | (shell)g(ev)m(en)h(if)f(they)h(are)f(not)g(separated)150 | |
9313 | 737 y(from)i(the)g Fr(list)j Fu(b)m(y)e(whitespace.)275 | |
9314 | 865 y(The)e(exit)j(status)e(of)h(b)s(oth)f(of)g(these)h(constructs)g | |
9315 | (is)f(the)h(exit)g(status)f(of)h Fr(list)p Fu(.)150 1050 | |
9316 | y Fk(3.2.6)63 b(Copro)s(cesses)150 1197 y Fu(A)37 b Ft(coprocess)c | |
9317 | Fu(is)k(a)g(shell)f(command)h(preceded)f(b)m(y)g(the)h | |
9318 | Ft(coproc)d Fu(reserv)m(ed)j(w)m(ord.)59 b(A)36 b(copro)s(cess)h(is)150 | |
9319 | 1307 y(executed)g(async)m(hronously)g(in)f(a)h(subshell,)g(as)g(if)g | |
9320 | (the)f(command)h(had)f(b)s(een)f(terminated)i(with)g(the)150 | |
9321 | 1416 y(`)p Ft(&)p Fu(')d(con)m(trol)h(op)s(erator,)g(with)f(a)g(t)m(w)m | |
d37a4722 | 9322 | (o-w)m(a)m(y)i(pip)s(e)d(established)h(b)s(et)m(w)m(een)h(the)f |
e59452c7 CR |
9323 | (executing)h(shell)f(and)f(the)150 1526 y(copro)s(cess.)275 |
9324 | 1653 y(The)c(syn)m(tax)i(for)f(a)h(copro)s(cess)g(is:)390 | |
9325 | 1781 y Ft(coproc)46 b([)p Fj(NAME)p Ft(])g Fj(command)g | |
9326 | Ft([)p Fj(redirections)p Ft(])150 1909 y Fu(This)33 b(creates)i(a)f | |
9327 | (copro)s(cess)g(named)f Fr(NAME)p Fu(.)51 b Fr(command)37 | |
9328 | b Fu(ma)m(y)d(b)s(e)f(either)h(a)g(simple)g(command)f(\(see)150 | |
9329 | 2018 y(Section)44 b(3.2.2)i([Simple)d(Commands],)k(page)d(9\))g(or)g(a) | |
9330 | g(comp)s(ound)e(command)h(\(see)i(Section)f(3.2.5)150 | |
9331 | 2128 y([Comp)s(ound)e(Commands],)47 b(page)e(11\).)83 | |
9332 | b Fr(NAME)50 b Fu(is)44 b(a)g(shell)g(v)-5 b(ariable)45 | |
9333 | b(name.)82 b(If)44 b Fr(NAME)50 b Fu(is)44 b(not)150 | |
9334 | 2237 y(supplied,)29 b(the)i(default)f(name)h(is)f Ft(COPROC)p | |
9335 | Fu(.)275 2365 y(The)f(recommended)h(form)g(to)h(use)f(for)h(a)f(copro)s | |
9336 | (cess)h(is)390 2492 y Ft(coproc)46 b Fj(NAME)h Ft({)g | |
9337 | Fj(command)p Ft(;)f(})150 2620 y Fu(This)31 b(form)g(is)h(recommended)f | |
9338 | (b)s(ecause)h(simple)g(commands)f(result)h(in)f(the)h(copro)s(cess)g | |
9339 | (alw)m(a)m(ys)h(b)s(eing)150 2730 y(named)45 b Ft(COPROC)p | |
9340 | Fu(,)i(and)e(it)h(is)f(simpler)g(to)h(use)f(and)g(more)g(complete)i | |
9341 | (than)e(the)h(other)f(comp)s(ound)150 2839 y(commands.)275 | |
9342 | 2967 y(There)29 b(are)i(other)g(forms)f(of)g(copro)s(cesses:)390 | |
9343 | 3094 y Ft(coproc)46 b Fj(NAME)h(compound-command)390 | |
9344 | 3204 y Ft(coproc)f Fj(compound-command)390 3313 y Ft(coproc)g | |
9345 | Fj(simple-command)150 3441 y Fu(If)41 b Fr(command)46 | |
9346 | b Fu(is)41 b(a)i(comp)s(ound)d(command,)45 b Fr(NAME)i | |
9347 | Fu(is)42 b(optional.)77 b(The)41 b(w)m(ord)g(follo)m(wing)j | |
9348 | Ft(coproc)150 3551 y Fu(determines)27 b(whether)f(that)i(w)m(ord)f(is)g | |
9349 | (in)m(terpreted)g(as)g(a)h(v)-5 b(ariable)28 b(name:)39 | |
9350 | b(it)27 b(is)g(in)m(terpreted)h(as)f Fr(NAME)150 3660 | |
9351 | y Fu(if)i(it)h(is)g(not)f(a)h(reserv)m(ed)f(w)m(ord)g(that)h(in)m(tro)s | |
9352 | (duces)f(a)h(comp)s(ound)e(command.)40 b(If)29 b Fr(command)k | |
9353 | Fu(is)c(a)h(simple)150 3770 y(command,)36 b Fr(NAME)k | |
9354 | Fu(is)35 b(not)f(allo)m(w)m(ed;)39 b(this)34 b(is)h(to)g(a)m(v)m(oid)h | |
9355 | (confusion)f(b)s(et)m(w)m(een)g Fr(NAME)40 b Fu(and)34 | |
9356 | b(the)h(\014rst)150 3879 y(w)m(ord)30 b(of)h(the)f(simple)g(command.) | |
9357 | 275 4007 y(When)42 b(the)i(copro)s(cess)f(is)g(executed,)48 | |
9358 | b(the)43 b(shell)g(creates)i(an)e(arra)m(y)g(v)-5 b(ariable)44 | |
9359 | b(\(see)g(Section)g(6.7)150 4117 y([Arra)m(ys],)49 b(page)c(99\))h | |
9360 | (named)e Fr(NAME)51 b Fu(in)44 b(the)h(con)m(text)h(of)f(the)g | |
9361 | (executing)h(shell.)84 b(The)44 b(standard)150 4226 y(output)32 | |
9362 | b(of)h Fr(command)i Fu(is)e(connected)g(via)g(a)g(pip)s(e)f(to)h(a)g | |
9363 | (\014le)f(descriptor)h(in)f(the)g(executing)i(shell,)g(and)150 | |
9364 | 4336 y(that)d(\014le)g(descriptor)g(is)g(assigned)f(to)i | |
9365 | Fr(NAME)5 b Fu([0].)43 b(The)31 b(standard)f(input)f(of)i | |
9366 | Fr(command)j Fu(is)d(connected)150 4445 y(via)40 b(a)g(pip)s(e)f(to)h | |
9367 | (a)g(\014le)g(descriptor)f(in)g(the)h(executing)h(shell,)h(and)d(that)h | |
9368 | (\014le)g(descriptor)f(is)h(assigned)150 4555 y(to)f | |
9369 | Fr(NAME)5 b Fu([1].)65 b(This)38 b(pip)s(e)f(is)h(established)g(b)s | |
9370 | (efore)g(an)m(y)g(redirections)h(sp)s(eci\014ed)e(b)m(y)h(the)g | |
9371 | (command)150 4664 y(\(see)33 b(Section)f(3.6)h([Redirections],)g(page)g | |
9372 | (37\).)45 b(The)31 b(\014le)h(descriptors)f(can)h(b)s(e)f(utilized)i | |
9373 | (as)f(argumen)m(ts)150 4774 y(to)42 b(shell)g(commands)f(and)g | |
fc35c477 | 9374 | (redirections)h(using)f(standard)g(w)m(ord)g(expansions.)74 |
e59452c7 | 9375 | b(Other)41 b(than)g(those)150 4884 y(created)27 b(to)g(execute)g |
fc35c477 | 9376 | (command)f(and)f(pro)s(cess)h(substitutions,)h(the)f(\014le)g |
e59452c7 CR |
9377 | (descriptors)g(are)g(not)h(a)m(v)-5 b(ailable)150 4993 |
9378 | y(in)30 b(subshells.)275 5121 y(The)d(pro)s(cess)h(ID)h(of)f(the)h | |
fc35c477 | 9379 | (shell)f(spa)m(wned)g(to)h(execute)h(the)e(copro)s(cess)h(is)f(a)m(v)-5 |
e59452c7 CR |
9380 | b(ailable)31 b(as)d(the)h(v)-5 b(alue)29 b(of)150 5230 |
9381 | y(the)k(v)-5 b(ariable)33 b Fj(NAME)p Ft(_PID)p Fu(.)44 | |
9382 | b(The)32 b Ft(wait)g Fu(builtin)f(command)i(ma)m(y)g(b)s(e)e(used)h(to) | |
9383 | h(w)m(ait)h(for)e(the)h(copro)s(cess)150 5340 y(to)e(terminate.)p | |
9384 | eop end | |
9385 | %%Page: 19 25 | |
9386 | TeXDict begin 19 24 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9387 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(19)275 299 | |
9388 | y(Since)20 b(the)g(copro)s(cess)h(is)g(created)g(as)g(an)f(async)m | |
9389 | (hronous)g(command,)i(the)f Ft(coproc)d Fu(command)i(alw)m(a)m(ys)150 | |
9390 | 408 y(returns)29 b(success.)41 b(The)30 b(return)f(status)i(of)f(a)h | |
9391 | (copro)s(cess)g(is)f(the)h(exit)g(status)g(of)f Fr(command)p | |
9392 | Fu(.)150 609 y Fk(3.2.7)63 b(GNU)41 b(P)m(arallel)150 | |
9393 | 756 y Fu(There)30 b(are)h(w)m(a)m(ys)g(to)g(run)f(commands)g(in)g | |
9394 | (parallel)h(that)h(are)e(not)h(built)g(in)m(to)g(Bash.)41 | |
9395 | b(GNU)31 b(P)m(arallel)i(is)150 866 y(a)e(to)s(ol)g(to)g(do)f(just)g | |
9396 | (that.)275 1001 y(GNU)e(P)m(arallel,)i(as)e(its)g(name)f(suggests,)j | |
9397 | (can)d(b)s(e)g(used)g(to)h(build)f(and)g(run)f(commands)h(in)h | |
9398 | (parallel.)150 1111 y(Y)-8 b(ou)41 b(ma)m(y)g(run)e(the)h(same)h | |
9399 | (command)f(with)g(di\013eren)m(t)h(argumen)m(ts,)j(whether)39 | |
9400 | b(they)i(are)g(\014lenames,)150 1221 y(usernames,)27 | |
9401 | b(hostnames,)h(or)e(lines)h(read)f(from)h(\014les.)39 | |
9402 | b(GNU)27 b(P)m(arallel)i(pro)m(vides)d(shorthand)g(references)150 | |
9403 | 1330 y(to)38 b(man)m(y)g(of)g(the)g(most)g(common)g(op)s(erations)g | |
9404 | (\(input)f(lines,)j(v)-5 b(arious)38 b(p)s(ortions)f(of)h(the)g(input)e | |
9405 | (line,)150 1440 y(di\013eren)m(t)f(w)m(a)m(ys)h(to)f(sp)s(ecify)f(the)h | |
9406 | (input)f(source,)i(and)e(so)h(on\).)54 b(P)m(arallel)36 | |
9407 | b(can)f(replace)h Ft(xargs)d Fu(or)i(feed)150 1549 y(commands)30 | |
9408 | b(from)g(its)h(input)e(sources)h(to)i(sev)m(eral)f(di\013eren)m(t)g | |
9409 | (instances)g(of)g(Bash.)275 1685 y(F)-8 b(or)28 b(a)h(complete)g | |
9410 | (description,)g(refer)f(to)g(the)h(GNU)f(P)m(arallel)i(do)s(cumen)m | |
9411 | (tation,)g(whic)m(h)e(is)g(a)m(v)-5 b(ailable)150 1795 | |
9412 | y(at)31 b Ft(https://www.gnu.org/softw)o(are)o(/par)o(alle)o(l/p)o | |
9413 | (aral)o(lel_)o(tut)o(oria)o(l.ht)o(ml)p Fu(.)150 2038 | |
9414 | y Fs(3.3)68 b(Shell)45 b(F)-11 b(unctions)150 2197 y | |
9415 | Fu(Shell)35 b(functions)h(are)g(a)g(w)m(a)m(y)g(to)h(group)e(commands)g | |
9416 | (for)h(later)g(execution)h(using)e(a)h(single)g(name)g(for)150 | |
9417 | 2307 y(the)f(group.)55 b(They)35 b(are)g(executed)h(just)f(lik)m(e)h(a) | |
9418 | g Ft(")p Fu(regular)p Ft(")f Fu(command.)54 b(When)35 | |
9419 | b(the)h(name)f(of)g(a)h(shell)150 2416 y(function)j(is)g(used)f(as)h(a) | |
9420 | h(simple)f(command)g(name,)i(the)e(list)h(of)f(commands)g(asso)s | |
9421 | (ciated)i(with)d(that)150 2526 y(function)25 b(name)h(is)g(executed.)40 | |
9422 | b(Shell)25 b(functions)g(are)i(executed)f(in)f(the)h(curren)m(t)g | |
9423 | (shell)g(con)m(text;)j(no)c(new)150 2635 y(pro)s(cess)30 | |
9424 | b(is)g(created)i(to)f(in)m(terpret)g(them.)275 2771 y(F)-8 | |
9425 | b(unctions)30 b(are)h(declared)g(using)f(this)g(syn)m(tax:)390 | |
9426 | 2907 y Fj(fname)46 b Ft(\(\))i Fj(compound-command)43 | |
9427 | b Ft([)k Fj(redirections)e Ft(])275 3043 y Fu(or)390 | |
9428 | 3179 y Ft(function)h Fj(fname)g Ft([\(\)])h Fj(compound-command)c | |
9429 | Ft([)k Fj(redirections)e Ft(])275 3315 y Fu(This)37 b(de\014nes)h(a)h | |
9430 | (shell)f(function)g(named)g Fr(fname)p Fu(.)65 b(The)38 | |
9431 | b(reserv)m(ed)h(w)m(ord)f Ft(function)e Fu(is)j(optional.)150 | |
9432 | 3424 y(If)33 b(the)g Ft(function)e Fu(reserv)m(ed)i(w)m(ord)g(is)g | |
9433 | (supplied,)g(the)g(paren)m(theses)h(are)f(optional.)50 | |
9434 | b(The)33 b Fr(b)s(o)s(dy)39 b Fu(of)34 b(the)150 3534 | |
9435 | y(function)41 b(is)h(the)g(comp)s(ound)e(command)h Fr(comp)s | |
9436 | (ound-command)j Fu(\(see)e(Section)h(3.2.5)g([Comp)s(ound)150 | |
9437 | 3644 y(Commands],)30 b(page)h(11\).)42 b(That)30 b(command)g(is)g | |
9438 | (usually)h(a)f Fr(list)j Fu(enclosed)e(b)s(et)m(w)m(een)g | |
9439 | Fi({)g Fu(and)f Fi(})p Fu(,)h(but)e(ma)m(y)150 3753 y(b)s(e)k(an)m(y)h | |
9440 | (comp)s(ound)f(command)g(listed)i(ab)s(o)m(v)m(e.)52 | |
9441 | b(If)33 b(the)i Ft(function)c Fu(reserv)m(ed)j(w)m(ord)g(is)f(used,)i | |
9442 | (but)e(the)150 3863 y(paren)m(theses)22 b(are)g(not)f(supplied,)h(the)g | |
9443 | (braces)g(are)f(recommended.)38 b Fr(comp)s(ound-command)24 | |
9444 | b Fu(is)d(executed)150 3972 y(whenev)m(er)29 b Fr(fname)35 | |
9445 | b Fu(is)29 b(sp)s(eci\014ed)g(as)g(the)h(name)f(of)h(a)f(simple)h | |
9446 | (command.)40 b(When)29 b(the)h(shell)f(is)h(in)f Fm(posix)150 | |
9447 | 4082 y Fu(mo)s(de)i(\(see)h(Section)g(6.11)h([Bash)f(POSIX)e(Mo)s(de],) | |
9448 | i(page)g(105\),)i Fr(fname)i Fu(m)m(ust)31 b(b)s(e)g(a)h(v)-5 | |
9449 | b(alid)31 b(shell)h(name)150 4192 y(and)h(ma)m(y)h(not)f(b)s(e)g(the)h | |
9450 | (same)f(as)h(one)g(of)f(the)h(sp)s(ecial)g(builtins)e(\(see)j(Section)f | |
9451 | (4.4)g([Sp)s(ecial)g(Builtins],)150 4301 y(page)d(76\).)43 | |
9452 | b(In)29 b(default)i(mo)s(de,)g(a)f(function)h(name)f(can)h(b)s(e)f(an)m | |
9453 | (y)h(unquoted)e(shell)i(w)m(ord)f(that)h(do)s(es)g(not)150 | |
9454 | 4411 y(con)m(tain)k(`)p Ft($)p Fu('.)52 b(An)m(y)34 b(redirections)g | |
9455 | (\(see)h(Section)g(3.6)g([Redirections],)h(page)f(37\))g(asso)s(ciated) | |
9456 | g(with)f(the)150 4520 y(shell)g(function)f(are)h(p)s(erformed)e(when)h | |
9457 | (the)g(function)h(is)f(executed.)51 b(A)34 b(function)f(de\014nition)g | |
9458 | (ma)m(y)i(b)s(e)150 4630 y(deleted)i(using)e(the)i Ft(-f)e | |
9459 | Fu(option)i(to)f(the)h Ft(unset)d Fu(builtin)i(\(see)h(Section)g(4.1)g | |
9460 | ([Bourne)f(Shell)g(Builtins],)150 4739 y(page)31 b(47\).)275 | |
9461 | 4875 y(The)26 b(exit)i(status)g(of)f(a)h(function)f(de\014nition)g(is)g | |
9462 | (zero)h(unless)f(a)g(syn)m(tax)h(error)f(o)s(ccurs)g(or)g(a)h(readonly) | |
9463 | 150 4985 y(function)k(with)f(the)i(same)f(name)g(already)h(exists.)46 | |
602eae4d | 9464 | b(When)32 b(executed,)h(the)f(exit)h(status)g(of)f(a)g(function)150 |
e59452c7 CR |
9465 | 5095 y(is)e(the)h(exit)g(status)g(of)f(the)h(last)g(command)f(executed) |
9466 | i(in)e(the)g(b)s(o)s(dy)-8 b(.)275 5230 y(Note)22 b(that)f(for)f | |
602eae4d | 9467 | (historical)i(reasons,)h(in)e(the)g(most)g(common)g(usage)g(the)g |
e59452c7 | 9468 | (curly)f(braces)h(that)g(surround)150 5340 y(the)38 b(b)s(o)s(dy)d(of)j |
602eae4d | 9469 | (the)f(function)g(m)m(ust)g(b)s(e)g(separated)h(from)f(the)g(b)s(o)s |
e59452c7 CR |
9470 | (dy)f(b)m(y)h Ft(blank)p Fu(s)f(or)h(newlines.)62 b(This)p |
9471 | eop end | |
9472 | %%Page: 20 26 | |
9473 | TeXDict begin 20 25 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9474 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(20)150 299 | |
9475 | y(is)38 b(b)s(ecause)g(the)h(braces)f(are)h(reserv)m(ed)f(w)m(ords)g | |
9476 | (and)f(are)i(only)f(recognized)i(as)e(suc)m(h)g(when)f(they)i(are)150 | |
9477 | 408 y(separated)26 b(from)f(the)h(command)f(list)i(b)m(y)e(whitespace)h | |
9478 | (or)g(another)g(shell)g(metac)m(haracter.)41 b(Also,)28 | |
9479 | b(when)150 518 y(using)i(the)g(braces,)h(the)g Fr(list)i | |
9480 | Fu(m)m(ust)d(b)s(e)g(terminated)h(b)m(y)f(a)h(semicolon,)h(a)e(`)p | |
9481 | Ft(&)p Fu(',)h(or)g(a)f(newline.)275 658 y(When)i(a)i(function)f(is)g | |
9482 | (executed,)i(the)e(argumen)m(ts)h(to)g(the)f(function)g(b)s(ecome)g | |
9483 | (the)h(p)s(ositional)g(pa-)150 767 y(rameters)42 b(during)e(its)i | |
ac18b312 | 9484 | (execution)h(\(see)f(Section)g(3.4.1)h([P)m(ositional)h(P)m |
e59452c7 | 9485 | (arameters],)i(page)c(22\).)75 b(The)150 877 y(sp)s(ecial)37 |
037a8b7f | 9486 | b(parameter)f(`)p Ft(#)p Fu(')g(that)h(expands)e(to)i(the)f(n)m(um)m(b) |
e59452c7 CR |
9487 | s(er)f(of)h(p)s(ositional)h(parameters)f(is)g(up)s(dated)f(to)150 |
9488 | 986 y(re\015ect)h(the)f(c)m(hange.)56 b(Sp)s(ecial)35 | |
037a8b7f | 9489 | b(parameter)h Ft(0)f Fu(is)g(unc)m(hanged.)54 b(The)35 |
e59452c7 | 9490 | b(\014rst)f(elemen)m(t)j(of)e(the)g Ft(FUNCNAME)150 1096 |
037a8b7f CR |
9491 | y Fu(v)-5 b(ariable)31 b(is)g(set)f(to)i(the)e(name)h(of)f(the)h |
9492 | (function)f(while)g(the)h(function)f(is)g(executing.)275 | |
e59452c7 CR |
9493 | 1235 y(All)25 b(other)g(asp)s(ects)g(of)g(the)g(shell)g(execution)h(en) |
9494 | m(vironmen)m(t)g(are)f(iden)m(tical)h(b)s(et)m(w)m(een)g(a)f(function)g | |
9495 | (and)150 1345 y(its)35 b(caller)i(with)d(these)i(exceptions:)50 | |
037a8b7f | 9496 | b(the)36 b Ft(DEBUG)d Fu(and)h Ft(RETURN)g Fu(traps)g(are)i(not)f |
e59452c7 CR |
9497 | (inherited)f(unless)h(the)150 1455 y(function)26 b(has)g(b)s(een)f(giv) |
9498 | m(en)i(the)g Ft(trace)d Fu(attribute)j(using)f(the)g | |
9499 | Ft(declare)e Fu(builtin)i(or)g(the)h Ft(-o)i(functrace)150 | |
9500 | 1564 y Fu(option)f(has)e(b)s(een)h(enabled)g(with)g(the)g | |
9501 | Ft(set)f Fu(builtin,)i(\(in)f(whic)m(h)f(case)j(all)f(functions)e | |
9502 | (inherit)h(the)g Ft(DEBUG)150 1674 y Fu(and)33 b Ft(RETURN)f | |
9503 | Fu(traps\),)j(and)e(the)h Ft(ERR)f Fu(trap)h(is)g(not)g(inherited)f | |
9504 | (unless)g(the)h Ft(-o)c(errtrace)h Fu(shell)j(option)150 | |
9505 | 1783 y(has)h(b)s(een)f(enabled.)55 b(See)35 b(Section)h(4.1)g([Bourne)f | |
9506 | (Shell)g(Builtins],)i(page)f(47,)i(for)c(the)i(description)f(of)150 | |
9507 | 1893 y(the)c Ft(trap)e Fu(builtin.)275 2032 y(The)38 | |
9508 | b Ft(FUNCNEST)f Fu(v)-5 b(ariable,)42 b(if)d(set)h(to)g(a)g(n)m(umeric) | |
9509 | f(v)-5 b(alue)39 b(greater)h(than)f(0,)j(de\014nes)d(a)g(maxim)m(um)150 | |
9510 | 2142 y(function)24 b(nesting)h(lev)m(el.)40 b(F)-8 b(unction)25 | |
220537f2 | 9511 | b(in)m(v)m(o)s(cations)i(that)e(exceed)g(the)g(limit)g(cause)g(the)g |
e59452c7 CR |
9512 | (en)m(tire)g(command)150 2252 y(to)31 b(ab)s(ort.)275 |
9513 | 2391 y(If)37 b(the)g(builtin)g(command)h Ft(return)d | |
6e51e0d0 | 9514 | Fu(is)j(executed)g(in)g(a)g(function,)h(the)e(function)h(completes)h |
e59452c7 | 9515 | (and)150 2501 y(execution)25 b(resumes)e(with)h(the)g(next)g(command)f |
220537f2 | 9516 | (after)i(the)f(function)f(call.)40 b(An)m(y)24 b(command)f(asso)s |
e59452c7 | 9517 | (ciated)150 2610 y(with)36 b(the)h Ft(RETURN)d Fu(trap)i(is)h(executed) |
d37a4722 | 9518 | g(b)s(efore)f(execution)i(resumes.)57 b(When)37 b(a)f(function)g |
e59452c7 | 9519 | (completes,)150 2720 y(the)h(v)-5 b(alues)38 b(of)f(the)g(p)s |
d37a4722 | 9520 | (ositional)h(parameters)f(and)g(the)g(sp)s(ecial)h(parameter)f(`)p |
e59452c7 | 9521 | Ft(#)p Fu(')g(are)h(restored)f(to)h(the)150 2829 y(v)-5 |
d37a4722 CR |
9522 | b(alues)26 b(they)f(had)g(prior)f(to)i(the)g(function's)f(execution.)40 |
9523 | b(If)25 b(a)h(n)m(umeric)f(argumen)m(t)h(is)f(giv)m(en)h(to)g | |
e59452c7 | 9524 | Ft(return)p Fu(,)150 2939 y(that)j(is)g(the)f(function's)h(return)e |
d37a4722 | 9525 | (status;)j(otherwise)f(the)f(function's)h(return)e(status)i(is)f(the)h |
e59452c7 CR |
9526 | (exit)h(status)150 3049 y(of)h(the)f(last)h(command)f(executed)i(b)s |
9527 | (efore)e(the)g Ft(return)p Fu(.)275 3188 y(V)-8 b(ariables)31 | |
d37a4722 CR |
9528 | b(lo)s(cal)g(to)f(the)g(function)f(ma)m(y)i(b)s(e)e(declared)h(with)f |
9529 | (the)h Ft(local)f Fu(builtin.)40 b(These)29 b(v)-5 b(ariables)150 | |
e59452c7 | 9530 | 3298 y(are)25 b(visible)h(only)f(to)g(the)g(function)g(and)f(the)i |
d37a4722 | 9531 | (commands)e(it)i(in)m(v)m(ok)m(es.)40 b(This)24 b(is)h(particularly)h |
e59452c7 CR |
9532 | (imp)s(ortan)m(t)150 3407 y(when)j(a)i(shell)g(function)f(calls)h |
9533 | (other)g(functions.)275 3547 y(Lo)s(cal)41 b(v)-5 b(ariables)42 | |
d37a4722 CR |
9534 | b Ft(")p Fu(shado)m(w)p Ft(")e Fu(v)-5 b(ariables)42 |
9535 | b(with)f(the)g(same)g(name)g(declared)h(at)f(previous)g(scop)s(es.)150 | |
e59452c7 | 9536 | 3656 y(F)-8 b(or)41 b(instance,)j(a)d(lo)s(cal)h(v)-5 |
d37a4722 | 9537 | b(ariable)41 b(declared)g(in)f(a)h(function)f(hides)g(a)h(global)h(v)-5 |
e59452c7 | 9538 | b(ariable)41 b(of)g(the)g(same)150 3766 y(name:)59 b(references)40 |
d37a4722 CR |
9539 | b(and)f(assignmen)m(ts)h(refer)f(to)i(the)f(lo)s(cal)g(v)-5 |
9540 | b(ariable,)43 b(lea)m(ving)f(the)d(global)i(v)-5 b(ariable)150 | |
e59452c7 | 9541 | 3875 y(unmo)s(di\014ed.)39 b(When)30 b(the)g(function)g(returns,)g(the) |
d37a4722 | 9542 | g(global)i(v)-5 b(ariable)31 b(is)g(once)g(again)g(visible.)275 |
e59452c7 | 9543 | 4015 y(The)f(shell)h(uses)g Fr(dynamic)g(scoping)39 b |
d37a4722 | 9544 | Fu(to)32 b(con)m(trol)g(a)f(v)-5 b(ariable's)32 b(visibilit)m(y)h |
e59452c7 | 9545 | (within)d(functions.)42 b(With)150 4125 y(dynamic)31 |
fc35c477 CR |
9546 | b(scoping,)i(visible)e(v)-5 b(ariables)32 b(and)f(their)h(v)-5 |
9547 | b(alues)32 b(are)f(a)h(result)g(of)f(the)h(sequence)g(of)f(function)150 | |
e59452c7 | 9548 | 4234 y(calls)37 b(that)g(caused)g(execution)g(to)g(reac)m(h)g(the)g |
e230f997 | 9549 | (curren)m(t)f(function.)58 b(The)36 b(v)-5 b(alue)36 |
e59452c7 | 9550 | b(of)h(a)g(v)-5 b(ariable)37 b(that)g(a)150 4344 y(function)24 |
e230f997 CR |
9551 | b(sees)g(dep)s(ends)f(on)h(its)g(v)-5 b(alue)25 b(within)e(its)i |
9552 | (caller,)i(if)d(an)m(y)-8 b(,)26 b(whether)e(that)g(caller)i(is)e(the)g | |
e59452c7 | 9553 | Ft(")p Fu(global)p Ft(")150 4453 y Fu(scop)s(e)41 b(or)g(another)g |
e230f997 CR |
9554 | (shell)g(function.)73 b(This)40 b(is)h(also)h(the)f(v)-5 |
9555 | b(alue)41 b(that)h(a)f(lo)s(cal)i(v)-5 b(ariable)41 b(declaration)150 | |
e59452c7 | 9556 | 4563 y Ft(")p Fu(shado)m(ws)p Ft(")p Fu(,)30 b(and)g(the)g(v)-5 |
e230f997 | 9557 | b(alue)31 b(that)g(is)f(restored)h(when)e(the)i(function)f(returns.)275 |
e59452c7 CR |
9558 | 4702 y(F)-8 b(or)38 b(example,)h(if)f(a)f(v)-5 b(ariable)38 |
9559 | b Ft(var)f Fu(is)g(declared)h(as)f(lo)s(cal)i(in)e(function)g | |
9560 | Ft(func1)p Fu(,)g(and)g Ft(func1)f Fu(calls)150 4812 | |
9561 | y(another)29 b(function)g Ft(func2)p Fu(,)f(references)i(to)f | |
9562 | Ft(var)g Fu(made)g(from)f(within)h Ft(func2)f Fu(will)h(resolv)m(e)i | |
9563 | (to)e(the)h(lo)s(cal)150 4922 y(v)-5 b(ariable)31 b Ft(var)f | |
9564 | Fu(from)g Ft(func1)p Fu(,)f(shado)m(wing)h(an)m(y)h(global)h(v)-5 | |
9565 | b(ariable)31 b(named)f Ft(var)p Fu(.)275 5061 y(The)f(follo)m(wing)j | |
9566 | (script)f(demonstrates)f(this)h(b)s(eha)m(vior.)40 b(When)31 | |
9567 | b(executed,)g(the)g(script)f(displa)m(ys)390 5200 y Ft(In)47 | |
9568 | b(func2,)f(var)h(=)h(func1)e(local)390 5340 y(func1\(\))p | |
d37a4722 CR |
9569 | eop end |
9570 | %%Page: 21 27 | |
9571 | TeXDict begin 21 26 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
e59452c7 CR |
9572 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(21)390 299 |
9573 | y Ft({)581 408 y(local)46 b(var='func1)f(local')581 518 | |
9574 | y(func2)390 628 y(})390 847 y(func2\(\))390 956 y({)581 | |
9575 | 1066 y(echo)i("In)f(func2,)h(var)f(=)i($var")390 1176 | |
9576 | y(})390 1395 y(var=global)390 1504 y(func1)275 1636 y | |
9577 | Fu(The)32 b Ft(unset)g Fu(builtin)g(also)i(acts)g(using)e(the)i(same)f | |
9578 | (dynamic)g(scop)s(e:)46 b(if)33 b(a)g(v)-5 b(ariable)34 | |
9579 | b(is)f(lo)s(cal)h(to)g(the)150 1745 y(curren)m(t)i(scop)s(e,)h | |
9580 | Ft(unset)e Fu(will)h(unset)g(it;)j(otherwise)e(the)f(unset)f(will)h | |
9581 | (refer)g(to)h(the)f(v)-5 b(ariable)37 b(found)d(in)150 | |
9582 | 1855 y(an)m(y)j(calling)h(scop)s(e)f(as)g(describ)s(ed)f(ab)s(o)m(v)m | |
9583 | (e.)61 b(If)36 b(a)h(v)-5 b(ariable)38 b(at)f(the)g(curren)m(t)g(lo)s | |
9584 | (cal)h(scop)s(e)e(is)h(unset,)h(it)150 1965 y(will)27 | |
9585 | b(remain)h(so)f(un)m(til)g(it)h(is)f(reset)h(in)f(that)g(scop)s(e)h(or) | |
9586 | f(un)m(til)g(the)h(function)e(returns.)39 b(Once)27 b(the)g(function) | |
9587 | 150 2074 y(returns,)34 b(an)m(y)h(instance)g(of)f(the)g(v)-5 | |
9588 | b(ariable)35 b(at)g(a)g(previous)e(scop)s(e)i(will)f(b)s(ecome)h | |
9589 | (visible.)52 b(If)34 b(the)g(unset)150 2184 y(acts)e(on)f(a)h(v)-5 | |
9590 | b(ariable)32 b(at)g(a)f(previous)g(scop)s(e,)h(an)m(y)f(instance)h(of)f | |
9591 | (a)h(v)-5 b(ariable)32 b(with)f(that)h(name)f(that)h(had)150 | |
9592 | 2293 y(b)s(een)e(shado)m(w)m(ed)g(will)h(b)s(ecome)g(visible.)275 | |
9593 | 2425 y(F)-8 b(unction)51 b(names)f(and)g(de\014nitions)g(ma)m(y)i(b)s | |
9594 | (e)e(listed)h(with)f(the)h Ft(-f)f Fu(option)h(to)g(the)g | |
9595 | Ft(declare)150 2535 y Fu(\()p Ft(typeset)p Fu(\))43 b(builtin)h | |
9596 | (command)g(\(see)h(Section)g(4.2)g([Bash)g(Builtins],)j(page)d(54\).)83 | |
9597 | b(The)44 b Ft(-F)f Fu(option)150 2644 y(to)e Ft(declare)e | |
9598 | Fu(or)i Ft(typeset)e Fu(will)i(list)g(the)g(function)f(names)h(only)g | |
9599 | (\(and)f(optionally)i(the)f(source)g(\014le)150 2754 | |
9600 | y(and)g(line)h(n)m(um)m(b)s(er,)h(if)f(the)g Ft(extdebug)d | |
9601 | Fu(shell)j(option)g(is)g(enabled\).)75 b(F)-8 b(unctions)42 | |
9602 | b(ma)m(y)g(b)s(e)f(exp)s(orted)150 2863 y(so)i(that)g(c)m(hild)g(shell) | |
9603 | g(pro)s(cesses)g(\(those)g(created)h(when)e(executing)i(a)f(separate)h | |
9604 | (shell)f(in)m(v)m(o)s(cation\))150 2973 y(automatically)34 | |
9605 | b(ha)m(v)m(e)e(them)e(de\014ned)g(with)g(the)h Ft(-f)f | |
9606 | Fu(option)i(to)f(the)g Ft(export)e Fu(builtin)i(\(see)g(Section)h(4.1) | |
9607 | 150 3083 y([Bourne)e(Shell)h(Builtins],)g(page)g(47\).)275 | |
9608 | 3214 y(F)-8 b(unctions)33 b(ma)m(y)g(b)s(e)g(recursiv)m(e.)48 | |
9609 | b(The)32 b Ft(FUNCNEST)f Fu(v)-5 b(ariable)34 b(ma)m(y)f(b)s(e)f(used)g | |
9610 | (to)i(limit)g(the)f(depth)f(of)150 3324 y(the)27 b(function)f(call)i | |
9611 | (stac)m(k)h(and)d(restrict)h(the)g(n)m(um)m(b)s(er)f(of)h(function)f | |
9612 | (in)m(v)m(o)s(cations.)42 b(By)27 b(default,)g(no)g(limit)150 | |
9613 | 3433 y(is)j(placed)h(on)g(the)f(n)m(um)m(b)s(er)f(of)i(recursiv)m(e)f | |
9614 | (calls.)150 3668 y Fs(3.4)68 b(Shell)45 b(P)l(arameters)150 | |
9615 | 3827 y Fu(A)39 b Fr(parameter)45 b Fu(is)39 b(an)g(en)m(tit)m(y)h(that) | |
9616 | f(stores)g(v)-5 b(alues.)66 b(It)39 b(can)g(b)s(e)f(a)h | |
9617 | Ft(name)p Fu(,)h(a)f(n)m(um)m(b)s(er,)g(or)g(one)g(of)g(the)150 | |
9618 | 3937 y(sp)s(ecial)c(c)m(haracters)h(listed)g(b)s(elo)m(w.)53 | |
9619 | b(A)35 b Fr(v)-5 b(ariable)41 b Fu(is)34 b(a)h(parameter)h(denoted)e(b) | |
9620 | m(y)h(a)g Ft(name)p Fu(.)52 b(A)35 b(v)-5 b(ariable)150 | |
9621 | 4047 y(has)41 b(a)h Ft(value)d Fu(and)i(zero)h(or)f(more)g | |
9622 | Ft(attributes)p Fu(.)71 b(A)m(ttributes)42 b(are)f(assigned)h(using)f | |
9623 | (the)g Ft(declare)150 4156 y Fu(builtin)29 b(command)g(\(see)h(the)g | |
9624 | (description)f(of)g(the)h Ft(declare)d Fu(builtin)i(in)g(Section)h(4.2) | |
9625 | g([Bash)g(Builtins],)150 4266 y(page)h(54\).)275 4397 | |
9626 | y(A)d(parameter)h(is)g(set)g(if)f(it)h(has)f(b)s(een)g(assigned)h(a)g | |
9627 | (v)-5 b(alue.)40 b(The)28 b(n)m(ull)h(string)f(is)h(a)g(v)-5 | |
9628 | b(alid)28 b(v)-5 b(alue.)41 b(Once)150 4507 y(a)31 b(v)-5 | |
9629 | b(ariable)31 b(is)f(set,)i(it)e(ma)m(y)h(b)s(e)f(unset)g(only)h(b)m(y)f | |
9630 | (using)g(the)g Ft(unset)f Fu(builtin)h(command.)275 4639 | |
9631 | y(A)g(v)-5 b(ariable)31 b(ma)m(y)g(b)s(e)f(assigned)g(to)i(b)m(y)e(a)h | |
9632 | (statemen)m(t)h(of)e(the)h(form)390 4770 y Fj(name)p | |
9633 | Ft(=[)p Fj(value)p Ft(])150 4902 y Fu(If)43 b Fr(v)-5 | |
9634 | b(alue)49 b Fu(is)43 b(not)h(giv)m(en,)k(the)c(v)-5 b(ariable)44 | |
9635 | b(is)f(assigned)h(the)f(n)m(ull)h(string.)80 b(All)44 | |
9636 | b Fr(v)-5 b(alue)5 b Fu(s)43 b(undergo)g(tilde)150 5011 | |
9637 | y(expansion,)25 b(parameter)f(and)f(v)-5 b(ariable)25 | |
9638 | b(expansion,)g(command)e(substitution,)i(arithmetic)g(expansion,)150 | |
9639 | 5121 y(and)i(quote)i(remo)m(v)-5 b(al)29 b(\(see)g(Section)f(3.5.3)i | |
9640 | ([Shell)e(P)m(arameter)h(Expansion],)f(page)h(26\).)41 | |
9641 | b(If)27 b(the)h(v)-5 b(ariable)150 5230 y(has)35 b(its)h | |
9642 | Ft(integer)e Fu(attribute)i(set,)i(then)d Fr(v)-5 b(alue)42 | |
9643 | b Fu(is)35 b(ev)-5 b(aluated)37 b(as)f(an)f(arithmetic)i(expression)f | |
9644 | (ev)m(en)g(if)150 5340 y(the)i Ft($\(\(...)n(\)\))f Fu(expansion)g(is)g | |
9645 | (not)h(used)e(\(see)j(Section)f(3.5.5)h([Arithmetic)f(Expansion],)h | |
9646 | (page)f(34\).)p eop end | |
9647 | %%Page: 22 28 | |
9648 | TeXDict begin 22 27 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9649 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(22)150 299 | |
9650 | y(W)-8 b(ord)26 b(splitting)h(and)e(\014lename)h(expansion)g(are)g(not) | |
9651 | h(p)s(erformed.)37 b(Assignmen)m(t)27 b(statemen)m(ts)g(ma)m(y)g(also) | |
9652 | 150 408 y(app)s(ear)22 b(as)h(argumen)m(ts)g(to)h(the)f | |
9653 | Ft(alias)p Fu(,)g Ft(declare)p Fu(,)f Ft(typeset)p Fu(,)h | |
9654 | Ft(export)p Fu(,)g Ft(readonly)p Fu(,)f(and)g Ft(local)f | |
9655 | Fu(builtin)150 518 y(commands)31 b(\()p Fr(declaration)j | |
9656 | Fu(commands\).)44 b(When)32 b(in)f Fm(posix)g Fu(mo)s(de)g(\(see)h | |
9657 | (Section)h(6.11)g([Bash)f(POSIX)150 628 y(Mo)s(de],)h(page)f(105\),)i | |
9658 | (these)e(builtins)f(ma)m(y)h(app)s(ear)f(in)g(a)h(command)f(after)h | |
9659 | (one)g(or)g(more)g(instances)g(of)150 737 y(the)f Ft(command)d | |
9660 | Fu(builtin)i(and)g(retain)h(these)f(assignmen)m(t)i(statemen)m(t)g | |
9661 | (prop)s(erties.)275 867 y(In)d(the)h(con)m(text)i(where)d(an)h | |
9662 | (assignmen)m(t)h(statemen)m(t)h(is)e(assigning)g(a)h(v)-5 | |
9663 | b(alue)30 b(to)h(a)f(shell)g(v)-5 b(ariable)31 b(or)150 | |
9664 | 977 y(arra)m(y)38 b(index)e(\(see)i(Section)g(6.7)h([Arra)m(ys],)g | |
9665 | (page)f(99\),)j(the)c(`)p Ft(+=)p Fu(')g(op)s(erator)g(can)h(b)s(e)e | |
9666 | (used)h(to)h(app)s(end)150 1086 y(to)e(or)g(add)e(to)j(the)e(v)-5 | |
9667 | b(ariable's)36 b(previous)f(v)-5 b(alue.)57 b(This)34 | |
9668 | b(includes)h(argumen)m(ts)h(to)g(builtin)f(commands)150 | |
9669 | 1196 y(suc)m(h)29 b(as)g Ft(declare)e Fu(that)i(accept)h(assignmen)m(t) | |
9670 | g(statemen)m(ts)h(\(declaration)f(commands\).)41 b(When)28 | |
9671 | b(`)p Ft(+=)p Fu(')h(is)150 1305 y(applied)36 b(to)h(a)f(v)-5 | |
9672 | b(ariable)37 b(for)f(whic)m(h)f(the)i Ft(integer)d Fu(attribute)i(has)g | |
9673 | (b)s(een)g(set,)i Fr(v)-5 b(alue)41 b Fu(is)36 b(ev)-5 | |
9674 | b(aluated)38 b(as)150 1415 y(an)28 b(arithmetic)h(expression)f(and)f | |
9675 | (added)h(to)h(the)f(v)-5 b(ariable's)29 b(curren)m(t)e(v)-5 | |
9676 | b(alue,)30 b(whic)m(h)d(is)i(also)f(ev)-5 b(aluated.)150 | |
9677 | 1525 y(When)43 b(`)p Ft(+=)p Fu(')g(is)h(applied)f(to)h(an)f(arra)m(y)h | |
9678 | (v)-5 b(ariable)44 b(using)f(comp)s(ound)e(assignmen)m(t)j(\(see)h | |
9679 | (Section)f(6.7)150 1634 y([Arra)m(ys],)j(page)e(99\),)j(the)43 | |
9680 | b(v)-5 b(ariable's)44 b(v)-5 b(alue)44 b(is)g(not)f(unset)g(\(as)h(it)g | |
9681 | (is)f(when)g(using)f(`)p Ft(=)p Fu('\),)48 b(and)42 b(new)150 | |
9682 | 1744 y(v)-5 b(alues)27 b(are)g(app)s(ended)f(to)h(the)g(arra)m(y)h(b)s | |
9683 | (eginning)e(at)h(one)g(greater)i(than)d(the)h(arra)m(y's)h(maxim)m(um)e | |
9684 | (index)150 1853 y(\(for)32 b(indexed)g(arra)m(ys\),)i(or)e(added)f(as)i | |
9685 | (additional)g(k)m(ey-v)-5 b(alue)34 b(pairs)d(in)h(an)g(asso)s(ciativ)m | |
9686 | (e)j(arra)m(y)-8 b(.)47 b(When)150 1963 y(applied)27 | |
9687 | b(to)h(a)f(string-v)-5 b(alued)28 b(v)-5 b(ariable,)29 | |
9688 | b Fr(v)-5 b(alue)32 b Fu(is)c(expanded)e(and)h(app)s(ended)e(to)j(the)f | |
9689 | (v)-5 b(ariable's)28 b(v)-5 b(alue.)275 2093 y(A)28 b(v)-5 | |
9690 | b(ariable)28 b(can)h(b)s(e)e(assigned)h(the)h Ft(nameref)d | |
9691 | Fu(attribute)i(using)g(the)g Ft(-n)f Fu(option)i(to)g(the)f | |
9692 | Ft(declare)e Fu(or)150 2202 y Ft(local)f Fu(builtin)h(commands)g(\(see) | |
9693 | i(Section)f(4.2)h([Bash)f(Builtins],)h(page)f(54\))h(to)f(create)i(a)e | |
9694 | Fr(nameref)p Fu(,)g(or)g(a)150 2312 y(reference)f(to)g(another)f(v)-5 | |
1a5fa30b CR |
9695 | b(ariable.)40 b(This)24 b(allo)m(ws)j(v)-5 b(ariables)26 |
9696 | b(to)g(b)s(e)e(manipulated)h(indirectly)-8 b(.)40 b(Whenev)m(er)150 | |
e59452c7 | 9697 | 2422 y(the)31 b(nameref)g(v)-5 b(ariable)32 b(is)f(referenced,)g |
1a5fa30b | 9698 | (assigned)h(to,)g(unset,)f(or)g(has)f(its)i(attributes)f(mo)s(di\014ed) |
e59452c7 | 9699 | f(\(other)150 2531 y(than)c(using)g(or)h(c)m(hanging)g(the)g(nameref)f |
1a5fa30b | 9700 | (attribute)i(itself)7 b(\),)29 b(the)d(op)s(eration)h(is)g(actually)h |
e59452c7 | 9701 | (p)s(erformed)d(on)150 2641 y(the)31 b(v)-5 b(ariable)31 |
1a5fa30b | 9702 | b(sp)s(eci\014ed)f(b)m(y)g(the)h(nameref)f(v)-5 b(ariable's)31 |
d37a4722 | 9703 | b(v)-5 b(alue.)42 b(A)30 b(nameref)g(is)h(commonly)g(used)e(within)150 |
e59452c7 | 9704 | 2750 y(shell)h(functions)g(to)h(refer)f(to)h(a)f(v)-5 |
d37a4722 | 9705 | b(ariable)31 b(whose)f(name)h(is)f(passed)g(as)g(an)g(argumen)m(t)h(to) |
e59452c7 | 9706 | g(the)f(function.)150 2860 y(F)-8 b(or)31 b(instance,)g(if)g(a)g(v)-5 |
d85b4caf | 9707 | b(ariable)31 b(name)f(is)h(passed)e(to)j(a)e(shell)h(function)f(as)h |
e59452c7 CR |
9708 | (its)f(\014rst)g(argumen)m(t,)h(running)390 2990 y Ft(declare)46 |
9709 | b(-n)h(ref=$1)150 3120 y Fu(inside)30 b(the)g(function)g(creates)h(a)g | |
9710 | (nameref)f(v)-5 b(ariable)30 b Ft(ref)g Fu(whose)g(v)-5 | |
9711 | b(alue)30 b(is)g(the)g(v)-5 b(ariable)31 b(name)f(passed)150 | |
9712 | 3229 y(as)c(the)h(\014rst)e(argumen)m(t.)40 b(References)26 | |
9713 | b(and)g(assignmen)m(ts)h(to)g Ft(ref)p Fu(,)f(and)f(c)m(hanges)i(to)g | |
9714 | (its)g(attributes,)h(are)150 3339 y(treated)j(as)f(references,)g | |
0fcb3344 | 9715 | (assignmen)m(ts,)h(and)e(attribute)i(mo)s(di\014cations)f(to)h(the)f(v) |
e59452c7 CR |
9716 | -5 b(ariable)30 b(whose)g(name)150 3448 y(w)m(as)h(passed)f(as)g |
9717 | Ft($1)p Fu(.)275 3578 y(If)h(the)g(con)m(trol)i(v)-5 | |
fc35c477 CR |
9718 | b(ariable)32 b(in)g(a)f Ft(for)g Fu(lo)s(op)h(has)f(the)g(nameref)h |
9719 | (attribute,)g(the)g(list)g(of)g(w)m(ords)f(can)h(b)s(e)150 | |
e59452c7 | 9720 | 3688 y(a)h(list)h(of)f(shell)g(v)-5 b(ariables,)34 b(and)e(a)i(name)f |
fc35c477 | 9721 | (reference)g(will)g(b)s(e)f(established)h(for)g(eac)m(h)h(w)m(ord)e(in) |
e59452c7 | 9722 | h(the)g(list,)150 3798 y(in)c(turn,)g(when)g(the)h(lo)s(op)g(is)g |
fc35c477 | 9723 | (executed.)41 b(Arra)m(y)30 b(v)-5 b(ariables)30 b(cannot)h(b)s(e)e |
e59452c7 | 9724 | (giv)m(en)h(the)g(nameref)g(attribute.)150 3907 y(Ho)m(w)m(ev)m(er,)39 |
e230f997 CR |
9725 | b(nameref)d(v)-5 b(ariables)36 b(can)g(reference)g(arra)m(y)g(v)-5 |
9726 | b(ariables)37 b(and)e(subscripted)f(arra)m(y)i(v)-5 b(ariables.)150 | |
e59452c7 | 9727 | 4017 y(Namerefs)36 b(can)f(b)s(e)g(unset)g(using)g(the)h |
e230f997 | 9728 | Ft(-n)e Fu(option)i(to)g(the)g Ft(unset)e Fu(builtin)h(\(see)h(Section) |
e59452c7 | 9729 | g(4.1)h([Bourne)150 4126 y(Shell)43 b(Builtins],)j(page)e(47\).)79 |
fc527055 | 9730 | b(Otherwise,)45 b(if)e Ft(unset)e Fu(is)i(executed)h(with)e(the)h(name) |
e59452c7 | 9731 | g(of)g(a)g(nameref)150 4236 y(v)-5 b(ariable)31 b(as)g(an)f(argumen)m |
fc527055 | 9732 | (t,)h(the)g(v)-5 b(ariable)31 b(referenced)f(b)m(y)g(the)h(nameref)f(v) |
e59452c7 CR |
9733 | -5 b(ariable)31 b(will)g(b)s(e)f(unset.)150 4426 y Fk(3.4.1)63 |
9734 | b(P)m(ositional)41 b(P)m(arameters)150 4573 y Fu(A)28 | |
037a8b7f CR |
9735 | b Fr(p)s(ositional)h(parameter)35 b Fu(is)28 b(a)g(parameter)g(denoted) |
9736 | g(b)m(y)g(one)g(or)g(more)g(digits,)h(other)g(than)e(the)h(single)150 | |
e59452c7 | 9737 | 4682 y(digit)34 b Ft(0)p Fu(.)48 b(P)m(ositional)36 b(parameters)d(are) |
e230f997 | 9738 | g(assigned)h(from)e(the)i(shell's)f(argumen)m(ts)g(when)f(it)i(is)f(in) |
e59452c7 | 9739 | m(v)m(ok)m(ed,)150 4792 y(and)38 b(ma)m(y)i(b)s(e)e(reassigned)i(using) |
e230f997 | 9740 | e(the)h Ft(set)g Fu(builtin)f(command.)67 b(P)m(ositional)41 |
e59452c7 | 9741 | b(parameter)e Ft(N)g Fu(ma)m(y)h(b)s(e)150 4902 y(referenced)34 |
6e51e0d0 CR |
9742 | b(as)h Ft(${N})p Fu(,)g(or)f(as)h Ft($N)e Fu(when)h Ft(N)g |
9743 | Fu(consists)h(of)f(a)h(single)g(digit.)54 b(P)m(ositional)37 | |
e59452c7 | 9744 | b(parameters)d(ma)m(y)150 5011 y(not)j(b)s(e)f(assigned)h(to)g(with)f |
6e51e0d0 CR |
9745 | (assignmen)m(t)i(statemen)m(ts.)61 b(The)36 b Ft(set)g |
9746 | Fu(and)g Ft(shift)f Fu(builtins)h(are)h(used)f(to)150 | |
e59452c7 CR |
9747 | 5121 y(set)k(and)f(unset)f(them)i(\(see)g(Chapter)f(4)g([Shell)h |
9748 | (Builtin)g(Commands],)h(page)f(47\).)68 b(The)39 b(p)s(ositional)150 | |
9749 | 5230 y(parameters)44 b(are)g(temp)s(orarily)g(replaced)h(when)e(a)h | |
124d67cd | 9750 | (shell)g(function)g(is)g(executed)g(\(see)h(Section)g(3.3)150 |
e59452c7 CR |
9751 | 5340 y([Shell)30 b(F)-8 b(unctions],)32 b(page)f(19\).)p |
9752 | eop end | |
9753 | %%Page: 23 29 | |
9754 | TeXDict begin 23 28 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9755 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(23)275 299 | |
9756 | y(When)27 b(a)i(p)s(ositional)g(parameter)g(consisting)f(of)h(more)f | |
879213c6 | 9757 | (than)g(a)g(single)h(digit)g(is)f(expanded,)g(it)h(m)m(ust)150 |
e59452c7 CR |
9758 | 408 y(b)s(e)h(enclosed)h(in)f(braces.)150 596 y Fk(3.4.2)63 |
9759 | b(Sp)s(ecial)41 b(P)m(arameters)150 743 y Fu(The)d(shell)g(treats)h | |
12beeabf CR |
9760 | (sev)m(eral)g(parameters)f(sp)s(ecially)-8 b(.)65 b(These)38 |
9761 | b(parameters)h(ma)m(y)f(only)g(b)s(e)g(referenced;)150 | |
e59452c7 CR |
9762 | 853 y(assignmen)m(t)31 b(to)g(them)g(is)f(not)h(allo)m(w)m(ed.)150 |
9763 | 1000 y Ft(*)432 b Fu(\($*\))38 b(Expands)d(to)i(the)f(p)s(ositional)h | |
6e51e0d0 | 9764 | (parameters,)h(starting)f(from)f(one.)59 b(When)36 b(the)g(ex-)630 |
e59452c7 CR |
9765 | 1110 y(pansion)h(is)h(not)g(within)f(double)g(quotes,)j(eac)m(h)f(p)s |
9766 | (ositional)f(parameter)g(expands)f(to)i(a)630 1220 y(separate)23 | |
fc35c477 CR |
9767 | b(w)m(ord.)38 b(In)21 b(con)m(texts)j(where)e(it)g(is)h(p)s(erformed,)f |
9768 | (those)h(w)m(ords)e(are)i(sub)5 b(ject)22 b(to)h(fur-)630 | |
e59452c7 | 9769 | 1329 y(ther)k(w)m(ord)g(splitting)i(and)e(\014lename)g(expansion.)40 |
fc35c477 | 9770 | b(When)27 b(the)h(expansion)f(o)s(ccurs)g(within)630 |
e59452c7 | 9771 | 1439 y(double)37 b(quotes,)k(it)d(expands)f(to)h(a)g(single)h(w)m(ord)e |
fc35c477 | 9772 | (with)h(the)f(v)-5 b(alue)39 b(of)f(eac)m(h)g(parameter)630 |
e59452c7 | 9773 | 1548 y(separated)g(b)m(y)g(the)f(\014rst)g(c)m(haracter)i(of)f(the)g |
fc35c477 | 9774 | Ft(IFS)f Fu(sp)s(ecial)h(v)-5 b(ariable.)63 b(That)38 |
e59452c7 | 9775 | b(is,)h Ft("$*")e Fu(is)630 1658 y(equiv)-5 b(alen)m(t)39 |
fc35c477 CR |
9776 | b(to)g Ft("$1)p Fj(c)p Ft($2)p Fj(c)p Ft(...)m(")p Fu(,)h(where)d |
9777 | Fr(c)44 b Fu(is)38 b(the)g(\014rst)g(c)m(haracter)h(of)f(the)g(v)-5 | |
e59452c7 | 9778 | b(alue)39 b(of)f(the)630 1767 y Ft(IFS)29 b Fu(v)-5 b(ariable.)41 |
595e3e69 | 9779 | b(If)29 b Ft(IFS)g Fu(is)h(unset,)f(the)h(parameters)g(are)g(separated) |
e59452c7 | 9780 | g(b)m(y)g(spaces.)41 b(If)29 b Ft(IFS)g Fu(is)630 1877 |
595e3e69 | 9781 | y(n)m(ull,)i(the)f(parameters)h(are)g(joined)f(without)g(in)m(terv)m |
e59452c7 | 9782 | (ening)i(separators.)150 2025 y Ft(@)432 b Fu(\($@\))43 |
12beeabf | 9783 | b(Expands)f(to)h(the)g(p)s(ositional)g(parameters,)k(starting)c(from)f |
e59452c7 | 9784 | (one.)78 b(In)42 b(con)m(texts)630 2134 y(where)35 b(w)m(ord)h |
12beeabf | 9785 | (splitting)g(is)g(p)s(erformed,)g(this)g(expands)e(eac)m(h)j(p)s |
e59452c7 | 9786 | (ositional)g(parameter)f(to)630 2244 y(a)d(separate)h(w)m(ord;)g(if)f |
12beeabf | 9787 | (not)g(within)g(double)f(quotes,)j(these)e(w)m(ords)g(are)g(sub)5 |
e59452c7 | 9788 | b(ject)33 b(to)g(w)m(ord)630 2354 y(splitting.)60 b(In)36 |
12beeabf | 9789 | b(con)m(texts)j(where)d(w)m(ord)g(splitting)h(is)g(not)g(p)s(erformed,) |
e59452c7 | 9790 | g(this)f(expands)g(to)630 2463 y(a)c(single)h(w)m(ord)e(with)h(eac)m(h) |
12beeabf | 9791 | h(p)s(ositional)g(parameter)f(separated)g(b)m(y)g(a)g(space.)46 |
e59452c7 | 9792 | b(When)32 b(the)630 2573 y(expansion)i(o)s(ccurs)h(within)e(double)i |
d37a4722 | 9793 | (quotes,)h(and)e(w)m(ord)g(splitting)h(is)g(p)s(erformed,)f(eac)m(h)630 |
e59452c7 | 9794 | 2682 y(parameter)23 b(expands)f(to)i(a)f(separate)h(w)m(ord.)37 |
fc35c477 | 9795 | b(That)23 b(is,)i Ft("$@")c Fu(is)i(equiv)-5 b(alen)m(t)24 |
e59452c7 | 9796 | b(to)g Ft("$1")29 b("$2")630 2792 y(...)o Fu(.)39 b(If)26 |
fc35c477 | 9797 | b(the)g(double-quoted)g(expansion)f(o)s(ccurs)h(within)f(a)h(w)m(ord,)h |
e59452c7 | 9798 | (the)f(expansion)g(of)g(the)630 2902 y(\014rst)31 b(parameter)h(is)g |
fc35c477 | 9799 | (joined)f(with)g(the)h(b)s(eginning)f(part)h(of)f(the)h(original)h(w)m |
e59452c7 | 9800 | (ord,)f(and)f(the)630 3011 y(expansion)25 b(of)g(the)h(last)g |
d37a4722 | 9801 | (parameter)f(is)h(joined)f(with)g(the)g(last)h(part)f(of)g(the)h |
e59452c7 | 9802 | (original)g(w)m(ord.)630 3121 y(When)i(there)g(are)g(no)g(p)s |
d37a4722 | 9803 | (ositional)g(parameters,)h Ft("$@")e Fu(and)g Ft($@)h |
e59452c7 CR |
9804 | Fu(expand)f(to)h(nothing)g(\(i.e.,)630 3230 y(they)j(are)f(remo)m(v)m |
9805 | (ed\).)150 3378 y Ft(#)432 b Fu(\($#\))31 b(Expands)e(to)i(the)g(n)m | |
d37a4722 | 9806 | (um)m(b)s(er)e(of)h(p)s(ositional)i(parameters)e(in)g(decimal.)150 |
e59452c7 | 9807 | 3526 y Ft(?)432 b Fu(\($?\))88 b(Expands)45 b(to)h(the)g(exit)h(status) |
d37a4722 | 9808 | f(of)g(the)g(most)h(recen)m(tly)g(executed)g(foreground)630 |
e59452c7 | 9809 | 3635 y(pip)s(eline.)150 3783 y Ft(-)432 b Fu(\($-,)24 |
d37a4722 CR |
9810 | b(a)e(h)m(yphen.\))37 b(Expands)20 b(to)i(the)f(curren)m(t)h(option)f |
9811 | (\015ags)h(as)f(sp)s(eci\014ed)g(up)s(on)f(in)m(v)m(o)s(cation,)630 | |
e59452c7 | 9812 | 3893 y(b)m(y)38 b(the)h Ft(set)f Fu(builtin)g(command,)j(or)d(those)i |
d37a4722 | 9813 | (set)f(b)m(y)f(the)h(shell)g(itself)g(\(suc)m(h)g(as)g(the)g |
e59452c7 CR |
9814 | Ft(-i)630 4002 y Fu(option\).)150 4150 y Ft($)432 b Fu(\($$\))39 |
9815 | b(Expands)c(to)j(the)f(pro)s(cess)g Fm(id)g Fu(of)g(the)g(shell.)61 | |
9816 | b(In)36 b(a)h(subshell,)h(it)g(expands)e(to)i(the)630 | |
9817 | 4260 y(pro)s(cess)30 b Fm(id)g Fu(of)h(the)g(in)m(v)m(oking)g(shell,)g | |
9818 | (not)g(the)f(subshell.)150 4407 y Ft(!)432 b Fu(\($!\))51 | |
e230f997 CR |
9819 | b(Expands)32 b(to)i(the)g(pro)s(cess)f Fm(id)h Fu(of)f(the)h(job)f |
9820 | (most)h(recen)m(tly)h(placed)f(in)m(to)g(the)g(bac)m(k-)630 | |
e59452c7 | 9821 | 4517 y(ground,)26 b(whether)g(executed)g(as)h(an)f(async)m(hronous)f |
e230f997 | 9822 | (command)h(or)g(using)g(the)g Ft(bg)f Fu(builtin)630 |
e59452c7 | 9823 | 4627 y(\(see)31 b(Section)h(7.2)f([Job)f(Con)m(trol)h(Builtins],)g |
fffe80d4 | 9824 | (page)h(113\).)150 4774 y Ft(0)432 b Fu(\($0\))46 b(Expands)d(to)i(the) |
e230f997 | 9825 | g(name)g(of)f(the)h(shell)g(or)f(shell)h(script.)83 b(This)44 |
e59452c7 | 9826 | b(is)g(set)h(at)h(shell)630 4884 y(initialization.)d(If)27 |
e230f997 | 9827 | b(Bash)h(is)g(in)m(v)m(ok)m(ed)h(with)e(a)i(\014le)e(of)h(commands)g |
3011048a | 9828 | (\(see)g(Section)h(3.8)g([Shell)630 4994 y(Scripts],)g(page)g(46\),)h |
e230f997 | 9829 | Ft($0)e Fu(is)h(set)g(to)g(the)f(name)h(of)f(that)h(\014le.)41 |
e59452c7 | 9830 | b(If)28 b(Bash)g(is)h(started)g(with)f(the)630 5103 y |
e230f997 | 9831 | Ft(-c)i Fu(option)h(\(see)h(Section)g(6.1)f([In)m(v)m(oking)h(Bash],)g |
e59452c7 CR |
9832 | (page)f(90\),)i(then)d Ft($0)g Fu(is)h(set)g(to)h(the)f(\014rst)630 |
9833 | 5213 y(argumen)m(t)g(after)g(the)g(string)g(to)g(b)s(e)f(executed,)i | |
e230f997 | 9834 | (if)f(one)g(is)f(presen)m(t.)42 b(Otherwise,)31 b(it)g(is)f(set)630 |
e59452c7 CR |
9835 | 5322 y(to)h(the)g(\014lename)f(used)g(to)h(in)m(v)m(ok)m(e)h(Bash,)f |
9836 | (as)g(giv)m(en)g(b)m(y)f(argumen)m(t)h(zero.)p eop end | |
9837 | %%Page: 24 30 | |
9838 | TeXDict begin 24 29 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9839 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(24)150 299 | |
9840 | y Fs(3.5)68 b(Shell)45 b(Expansions)150 458 y Fu(Expansion)27 | |
e230f997 CR |
9841 | b(is)i(p)s(erformed)d(on)i(the)g(command)g(line)h(after)f(it)h(has)f(b) |
9842 | s(een)f(split)h(in)m(to)i Ft(token)p Fu(s.)38 b(There)28 | |
e59452c7 CR |
9843 | b(are)150 568 y(sev)m(en)j(kinds)e(of)i(expansion)f(p)s(erformed:)225 |
9844 | 701 y Fq(\017)60 b Fu(brace)31 b(expansion)225 834 y | |
9845 | Fq(\017)60 b Fu(tilde)31 b(expansion)225 967 y Fq(\017)60 | |
e230f997 | 9846 | b Fu(parameter)31 b(and)f(v)-5 b(ariable)31 b(expansion)225 |
e59452c7 CR |
9847 | 1100 y Fq(\017)60 b Fu(command)30 b(substitution)225 |
9848 | 1233 y Fq(\017)60 b Fu(arithmetic)32 b(expansion)225 | |
9849 | 1366 y Fq(\017)60 b Fu(w)m(ord)30 b(splitting)225 1499 | |
9850 | y Fq(\017)60 b Fu(\014lename)31 b(expansion)275 1655 | |
9851 | y(The)24 b(order)h(of)h(expansions)f(is:)39 b(brace)25 | |
9852 | b(expansion;)j(tilde)e(expansion,)g(parameter)g(and)f(v)-5 | |
9853 | b(ariable)26 b(ex-)150 1765 y(pansion,)j(arithmetic)i(expansion,)f(and) | |
9854 | f(command)g(substitution)g(\(done)g(in)h(a)f(left-to-righ)m(t)k | |
9855 | (fashion\);)150 1874 y(w)m(ord)d(splitting;)h(and)f(\014lename)h | |
9856 | (expansion.)275 2007 y(On)c(systems)h(that)h(can)g(supp)s(ort)e(it,)i | |
9857 | (there)g(is)f(an)g(additional)i(expansion)e(a)m(v)-5 | |
9858 | b(ailable:)42 b Fr(pro)s(cess)28 b(sub-)150 2117 y(stitution)p | |
9859 | Fu(.)42 b(This)30 b(is)g(p)s(erformed)f(at)j(the)e(same)h(time)h(as)e | |
9860 | (tilde,)i(parameter,)f(v)-5 b(ariable,)32 b(and)e(arithmetic)150 | |
9861 | 2226 y(expansion)g(and)g(command)g(substitution.)275 | |
9862 | 2359 y(After)g(these)h(expansions)f(are)g(p)s(erformed,)f(quote)i(c)m | |
4d63a619 | 9863 | (haracters)h(presen)m(t)e(in)g(the)g(original)i(w)m(ord)e(are)150 |
e59452c7 | 9864 | 2469 y(remo)m(v)m(ed)h(unless)f(they)h(ha)m(v)m(e)g(b)s(een)f(quoted)g |
d37a4722 | 9865 | (themselv)m(es)i(\()p Fr(quote)f(remo)m(v)-5 b(al)t Fu(\).)275 |
e59452c7 | 9866 | 2602 y(Only)31 b(brace)i(expansion,)h(w)m(ord)e(splitting,)i(and)e |
e230f997 | 9867 | (\014lename)h(expansion)f(can)h(increase)g(the)g(n)m(um)m(b)s(er)150 |
e59452c7 | 9868 | 2711 y(of)24 b(w)m(ords)g(of)g(the)h(expansion;)h(other)e(expansions)g |
e230f997 | 9869 | (expand)g(a)g(single)h(w)m(ord)f(to)h(a)f(single)h(w)m(ord.)38 |
e59452c7 | 9870 | b(The)24 b(only)150 2821 y(exceptions)i(to)f(this)g(are)g(the)g |
e230f997 | 9871 | (expansions)g(of)g Ft("$@")f Fu(and)g Ft($*)g Fu(\(see)i(Section)f |
e59452c7 CR |
9872 | (3.4.2)i([Sp)s(ecial)e(P)m(arameters],)150 2931 y(page)31 |
9873 | b(23\),)h(and)e Ft("${)p Fj(name)p Ft([@]}")d Fu(and)i | |
e230f997 | 9874 | Ft(${)p Fj(name)p Ft([*]})f Fu(\(see)j(Section)h(6.7)f([Arra)m(ys],)g |
e59452c7 | 9875 | (page)g(99\).)275 3064 y(After)41 b(all)i(expansions,)h |
e230f997 | 9876 | Ft(quote)29 b(removal)40 b Fu(\(see)i(Section)h(3.5.9)g([Quote)f(Remo)m |
e59452c7 CR |
9877 | (v)-5 b(al],)47 b(page)42 b(37\))h(is)150 3173 y(p)s(erformed.)150 |
9878 | 3369 y Fk(3.5.1)63 b(Brace)40 b(Expansion)150 3516 y | |
e230f997 CR |
9879 | Fu(Brace)32 b(expansion)f(is)f(a)i(mec)m(hanism)f(b)m(y)f(whic)m(h)h |
9880 | (arbitrary)f(strings)h(ma)m(y)g(b)s(e)f(generated.)43 | |
e59452c7 | 9881 | b(This)30 b(mec)m(h-)150 3626 y(anism)35 b(is)h(similar)f(to)h |
e230f997 | 9882 | Fr(\014lename)g(expansion)f Fu(\(see)i(Section)f(3.5.8)h([Filename)g |
e59452c7 | 9883 | (Expansion],)f(page)g(35\),)150 3736 y(but)26 b(the)h(\014lenames)g |
e230f997 CR |
9884 | (generated)h(need)f(not)g(exist.)40 b(P)m(atterns)28 |
9885 | b(to)f(b)s(e)g(brace)g(expanded)f(tak)m(e)i(the)f(form)g(of)150 | |
e59452c7 | 9886 | 3845 y(an)j(optional)h Fr(pream)m(ble)p Fu(,)g(follo)m(w)m(ed)g(b)m(y)f |
e230f997 | 9887 | (either)g(a)h(series)f(of)g(comma-separated)i(strings)d(or)h(a)h |
e59452c7 | 9888 | (sequence)150 3955 y(expression)36 b(b)s(et)m(w)m(een)g(a)h(pair)e(of)i |
e230f997 | 9889 | (braces,)g(follo)m(w)m(ed)h(b)m(y)e(an)g(optional)h Fr(p)s(ostscript)p |
e59452c7 | 9890 | Fu(.)57 b(The)36 b(pream)m(ble)g(is)150 4064 y(pre\014xed)28 |
037a8b7f CR |
9891 | b(to)h(eac)m(h)h(string)f(con)m(tained)h(within)e(the)h(braces,)g(and)g |
9892 | (the)g(p)s(ostscript)f(is)h(then)f(app)s(ended)f(to)150 | |
e59452c7 CR |
9893 | 4174 y(eac)m(h)32 b(resulting)e(string,)h(expanding)e(left)j(to)f(righ) |
9894 | m(t.)275 4307 y(Brace)37 b(expansions)f(ma)m(y)h(b)s(e)f(nested.)59 | |
37c41ab1 | 9895 | b(The)36 b(results)g(of)h(eac)m(h)g(expanded)f(string)g(are)h(not)g |
e59452c7 CR |
9896 | (sorted;)150 4416 y(left)31 b(to)g(righ)m(t)g(order)f(is)g(preserv)m |
9897 | (ed.)41 b(F)-8 b(or)31 b(example,)390 4549 y Ft(bash$)46 | |
9898 | b(echo)h(a{d,c,b}e)390 4659 y(ade)g(ace)g(abe)275 4792 | |
124d67cd | 9899 | y Fu(A)23 b(sequence)g(expression)g(tak)m(es)i(the)e(form)g |
6e51e0d0 CR |
9900 | Ft({)p Fj(x)p Ft(..)p Fj(y)p Ft([..)p Fj(incr)p Ft(]})p |
9901 | Fu(,)e(where)i Fr(x)29 b Fu(and)23 b Fr(y)30 b Fu(are)24 | |
e59452c7 CR |
9902 | b(either)g(in)m(tegers)150 4902 y(or)34 b(letters,)i(and)d |
9903 | Fr(incr)p Fu(,)h(an)g(optional)g(incremen)m(t,)i(is)d(an)h(in)m(teger.) | |
9904 | 52 b(When)33 b(in)m(tegers)i(are)f(supplied,)g(the)150 | |
9905 | 5011 y(expression)f(expands)f(to)i(eac)m(h)g(n)m(um)m(b)s(er)e(b)s(et)m | |
9906 | (w)m(een)i Fr(x)39 b Fu(and)33 b Fr(y)p Fu(,)h(inclusiv)m(e.)50 | |
9907 | b(Supplied)31 b(in)m(tegers)k(ma)m(y)f(b)s(e)150 5121 | |
9908 | y(pre\014xed)h(with)h(`)p Ft(0)p Fu(')g(to)h(force)g(eac)m(h)h(term)e | |
9909 | (to)h(ha)m(v)m(e)g(the)g(same)g(width.)57 b(When)36 b(either)h | |
9910 | Fr(x)42 b Fu(or)37 b Fr(y)43 b Fu(b)s(egins)150 5230 | |
9911 | y(with)37 b(a)h(zero,)j(the)c(shell)h(attempts)h(to)f(force)g(all)g | |
9912 | (generated)h(terms)e(to)i(con)m(tain)g(the)e(same)h(n)m(um)m(b)s(er)150 | |
9913 | 5340 y(of)30 b(digits,)h(zero-padding)f(where)f(necessary)-8 | |
9914 | b(.)41 b(When)30 b(letters)g(are)h(supplied,)d(the)i(expression)g | |
9915 | (expands)p eop end | |
9916 | %%Page: 25 31 | |
9917 | TeXDict begin 25 30 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
9918 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(25)150 299 | |
9919 | y(to)34 b(eac)m(h)g(c)m(haracter)h(lexicographically)h(b)s(et)m(w)m | |
9920 | (een)e Fr(x)40 b Fu(and)32 b Fr(y)p Fu(,)i(inclusiv)m(e,)i(using)c(the) | |
9921 | i(default)f(C)g(lo)s(cale.)150 408 y(Note)f(that)f(b)s(oth)f | |
9922 | Fr(x)37 b Fu(and)30 b Fr(y)38 b Fu(m)m(ust)31 b(b)s(e)f(of)h(the)g | |
9923 | (same)g(t)m(yp)s(e)g(\(in)m(teger)h(or)f(letter\).)43 | |
9924 | b(When)30 b(the)h(incremen)m(t)150 518 y(is)e(supplied,)g(it)h(is)f | |
9925 | (used)f(as)i(the)f(di\013erence)h(b)s(et)m(w)m(een)g(eac)m(h)g(term.)41 | |
9926 | b(The)29 b(default)g(incremen)m(t)h(is)f(1)h(or)f(-1)150 | |
9927 | 628 y(as)i(appropriate.)275 764 y(Brace)36 b(expansion)g(is)f(p)s | |
9928 | (erformed)f(b)s(efore)h(an)m(y)h(other)g(expansions,)h(and)e(an)m(y)g | |
9929 | (c)m(haracters)i(sp)s(ecial)150 873 y(to)32 b(other)g(expansions)g(are) | |
9930 | g(preserv)m(ed)f(in)h(the)f(result.)45 b(It)32 b(is)g(strictly)g | |
9931 | (textual.)46 b(Bash)32 b(do)s(es)f(not)h(apply)150 983 | |
9932 | y(an)m(y)27 b(syn)m(tactic)i(in)m(terpretation)g(to)f(the)f(con)m(text) | |
9933 | i(of)e(the)g(expansion)g(or)g(the)h(text)g(b)s(et)m(w)m(een)f(the)h | |
9934 | (braces.)275 1119 y(A)h(correctly-formed)i(brace)f(expansion)f(m)m(ust) | |
9935 | h(con)m(tain)h(unquoted)e(op)s(ening)g(and)g(closing)i(braces,)150 | |
9936 | 1228 y(and)h(at)i(least)g(one)f(unquoted)g(comma)g(or)g(a)h(v)-5 | |
4d63a619 | 9937 | b(alid)33 b(sequence)g(expression.)48 b(An)m(y)33 b(incorrectly)h |
e59452c7 CR |
9938 | (formed)150 1338 y(brace)d(expansion)f(is)g(left)h(unc)m(hanged.)275 |
9939 | 1474 y(A)25 b Fi({)h Fu(or)f(`)p Ft(,)p Fu(')g(ma)m(y)h(b)s(e)f(quoted) | |
091c6bc4 | 9940 | h(with)f(a)g(bac)m(kslash)h(to)g(prev)m(en)m(t)g(its)g(b)s(eing)f |
e59452c7 | 9941 | (considered)g(part)g(of)h(a)g(brace)150 1583 y(expression.)51 |
091c6bc4 CR |
9942 | b(T)-8 b(o)34 b(a)m(v)m(oid)i(con\015icts)e(with)g(parameter)g |
9943 | (expansion,)h(the)f(string)g(`)p Ft(${)p Fu(')g(is)g(not)g(considered) | |
e59452c7 | 9944 | 150 1693 y(eligible)e(for)e(brace)h(expansion,)f(and)g(inhibits)g |
091c6bc4 | 9945 | (brace)h(expansion)f(un)m(til)g(the)h(closing)h(`)p Ft(})p |
e59452c7 | 9946 | Fu('.)275 1829 y(This)e(construct)h(is)g(t)m(ypically)i(used)d(as)h |
091c6bc4 | 9947 | (shorthand)f(when)g(the)h(common)g(pre\014x)f(of)h(the)g(strings)g(to) |
e59452c7 CR |
9948 | 150 1939 y(b)s(e)f(generated)h(is)g(longer)g(than)f(in)g(the)g(ab)s(o)m |
9949 | (v)m(e)i(example:)390 2074 y Ft(mkdir)46 b(/usr/local/src/bash/{old,n)o | |
9950 | (ew,)o(dist)o(,bug)o(s})275 2210 y Fu(or)390 2346 y Ft(chown)g(root)h | |
d37a4722 | 9951 | (/usr/{ucb/{ex,edit},lib/)o({ex?)o(.?*,)o(how)o(_ex})o(})150 |
e59452c7 | 9952 | 2547 y Fk(3.5.2)63 b(Tilde)41 b(Expansion)150 2694 y |
d37a4722 | 9953 | Fu(If)29 b(a)h(w)m(ord)g(b)s(egins)f(with)g(an)h(unquoted)f(tilde)h(c)m |
e230f997 | 9954 | (haracter)h(\(`)p Ft(~)p Fu('\),)g(all)g(of)f(the)g(c)m(haracters)h(up) |
e59452c7 | 9955 | d(to)j(the)f(\014rst)150 2804 y(unquoted)24 b(slash)g(\(or)h(all)h(c)m |
e230f997 | 9956 | (haracters,)h(if)e(there)g(is)f(no)h(unquoted)e(slash\))i(are)g |
e59452c7 | 9957 | (considered)g(a)g Fr(tilde-pre\014x)p Fu(.)150 2913 y(If)38 |
e230f997 CR |
9958 | b(none)g(of)g(the)h(c)m(haracters)g(in)f(the)h(tilde-pre\014x)f(are)h |
9959 | (quoted,)h(the)f(c)m(haracters)h(in)d(the)i(tilde-pre\014x)150 | |
e59452c7 | 9960 | 3023 y(follo)m(wing)28 b(the)g(tilde)f(are)h(treated)g(as)f(a)g(p)s |
4d63a619 | 9961 | (ossible)g Fr(login)h(name)p Fu(.)39 b(If)27 b(this)g(login)h(name)f |
e59452c7 | 9962 | (is)g(the)g(n)m(ull)g(string,)150 3132 y(the)35 b(tilde)g(is)g |
d37a4722 CR |
9963 | (replaced)g(with)f(the)h(v)-5 b(alue)35 b(of)g(the)g |
9964 | Ft(HOME)e Fu(shell)i(v)-5 b(ariable.)54 b(If)34 b Ft(HOME)g | |
e59452c7 | 9965 | Fu(is)h(unset,)g(the)g(home)150 3242 y(directory)e(of)g(the)f(user)g |
d37a4722 | 9966 | (executing)i(the)e(shell)h(is)f(substituted)g(instead.)47 |
e59452c7 | 9967 | b(Otherwise,)33 b(the)g(tilde-pre\014x)150 3352 y(is)d(replaced)h(with) |
d37a4722 | 9968 | f(the)h(home)f(directory)h(asso)s(ciated)h(with)e(the)h(sp)s(eci\014ed) |
e59452c7 | 9969 | e(login)j(name.)275 3487 y(If)g(the)h(tilde-pre\014x)f(is)h(`)p |
4d63a619 CR |
9970 | Ft(~+)p Fu(',)g(the)g(v)-5 b(alue)33 b(of)g(the)g(shell)g(v)-5 |
9971 | b(ariable)34 b Ft(PWD)d Fu(replaces)j(the)f(tilde-pre\014x.)47 | |
e59452c7 | 9972 | b(If)150 3597 y(the)31 b(tilde-pre\014x)f(is)g(`)p Ft(~-)p |
4d63a619 CR |
9973 | Fu(',)h(the)f(v)-5 b(alue)31 b(of)g(the)f(shell)h(v)-5 |
9974 | b(ariable)31 b Ft(OLDPWD)p Fu(,)e(if)h(it)h(is)g(set,)g(is)f | |
e59452c7 | 9975 | (substituted.)275 3733 y(If)f(the)h(c)m(haracters)h(follo)m(wing)h(the) |
4d63a619 | 9976 | e(tilde)g(in)g(the)g(tilde-pre\014x)g(consist)g(of)g(a)h(n)m(um)m(b)s |
e59452c7 | 9977 | (er)d Fr(N)p Fu(,)j(optionally)150 3843 y(pre\014xed)22 |
4d63a619 CR |
9978 | b(b)m(y)h(a)h(`)p Ft(+)p Fu(')f(or)h(a)f(`)p Ft(-)p Fu(',)j(the)d |
9979 | (tilde-pre\014x)g(is)h(replaced)f(with)g(the)h(corresp)s(onding)e | |
e59452c7 | 9980 | (elemen)m(t)j(from)e(the)150 3952 y(directory)36 b(stac)m(k,)i(as)e(it) |
4d63a619 CR |
9981 | g(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m(y)g(the)f |
9982 | Ft(dirs)g Fu(builtin)g(in)m(v)m(ok)m(ed)i(with)e(the)g(c)m(haracters) | |
e59452c7 | 9983 | 150 4062 y(follo)m(wing)40 b(tilde)f(in)g(the)f(tilde-pre\014x)h(as)g |
4d63a619 | 9984 | (an)f(argumen)m(t)h(\(see)h(Section)f(6.8)h([The)e(Directory)i(Stac)m |
e59452c7 CR |
9985 | (k],)150 4171 y(page)34 b(101\).)50 b(If)32 b(the)h(tilde-pre\014x,)h |
9986 | (sans)e(the)h(tilde,)i(consists)e(of)g(a)h(n)m(um)m(b)s(er)d(without)i | |
9987 | (a)g(leading)h(`)p Ft(+)p Fu(')f(or)150 4281 y(`)p Ft(-)p | |
9988 | Fu(',)e(`)p Ft(+)p Fu(')f(is)h(assumed.)275 4417 y(If)e(the)i(login)g | |
9989 | (name)g(is)f(in)m(v)-5 b(alid,)31 b(or)g(the)f(tilde)h(expansion)f | |
124d67cd | 9990 | (fails,)i(the)e(w)m(ord)g(is)h(left)g(unc)m(hanged.)275 |
e59452c7 | 9991 | 4553 y(Eac)m(h)38 b(v)-5 b(ariable)38 b(assignmen)m(t)h(is)e(c)m(hec)m |
124d67cd | 9992 | (k)m(ed)j(for)d(unquoted)g(tilde-pre\014xes)h(immediately)g(follo)m |
e59452c7 | 9993 | (wing)150 4662 y(a)d(`)p Ft(:)p Fu(')g(or)g(the)g(\014rst)f(`)p |
4d63a619 CR |
9994 | Ft(=)p Fu('.)54 b(In)34 b(these)h(cases,)i(tilde)e(expansion)g(is)g |
9995 | (also)h(p)s(erformed.)52 b(Consequen)m(tly)-8 b(,)37 | |
e59452c7 | 9996 | b(one)150 4772 y(ma)m(y)29 b(use)e(\014lenames)h(with)g(tildes)g(in)g |
879213c6 CR |
9997 | (assignmen)m(ts)g(to)h Ft(PATH)p Fu(,)f Ft(MAILPATH)p |
9998 | Fu(,)e(and)h Ft(CDPATH)p Fu(,)g(and)h(the)g(shell)150 | |
e59452c7 | 9999 | 4882 y(assigns)j(the)f(expanded)g(v)-5 b(alue.)275 5018 |
879213c6 | 10000 | y(The)29 b(follo)m(wing)j(table)g(sho)m(ws)e(ho)m(w)g(Bash)h(treats)g |
e59452c7 CR |
10001 | (unquoted)e(tilde-pre\014xes:)150 5179 y Ft(~)432 b Fu(The)30 |
10002 | b(v)-5 b(alue)31 b(of)f Ft($HOME)150 5340 y(~/foo)240 | |
10003 | b($HOME/foo)p eop end | |
10004 | %%Page: 26 32 | |
10005 | TeXDict begin 26 31 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10006 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(26)150 299 | |
10007 | y Ft(~fred/foo)630 408 y Fu(The)30 b(sub)s(directory)f | |
10008 | Ft(foo)h Fu(of)g(the)h(home)f(directory)h(of)g(the)f(user)g | |
10009 | Ft(fred)150 576 y(~+/foo)192 b($PWD/foo)150 744 y(~-/foo)g | |
10010 | (${OLDPWD-'~-'}/foo)150 912 y(~)p Fj(N)384 b Fu(The)30 | |
10011 | b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m(y)f(`)p | |
10012 | Ft(dirs)g(+)p Fj(N)p Fu(')150 1080 y Ft(~+)p Fj(N)336 | |
879213c6 | 10013 | b Fu(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m |
e59452c7 | 10014 | (y)f(`)p Ft(dirs)g(+)p Fj(N)p Fu(')150 1248 y Ft(~-)p |
879213c6 | 10015 | Fj(N)336 b Fu(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m |
e59452c7 CR |
10016 | (ed)h(b)m(y)f(`)p Ft(dirs)g(-)p Fj(N)p Fu(')275 1421 |
10017 | y(Bash)40 b(also)h(p)s(erforms)e(tilde)h(expansion)g(on)h(w)m(ords)e | |
10018 | (satisfying)i(the)f(conditions)h(of)f(v)-5 b(ariable)41 | |
10019 | b(as-)150 1530 y(signmen)m(ts)f(\(see)h(Section)g(3.4)g([Shell)f(P)m | |
10020 | (arameters],)k(page)d(21\))g(when)e(they)h(app)s(ear)f(as)i(argumen)m | |
10021 | (ts)150 1640 y(to)c(simple)f(commands.)57 b(Bash)36 b(do)s(es)f(not)h | |
10022 | (do)g(this,)i(except)f(for)e(the)h(declaration)i(commands)d(listed)150 | |
10023 | 1749 y(ab)s(o)m(v)m(e,)d(when)d(in)h Fm(posix)g Fu(mo)s(de.)150 | |
10024 | 1957 y Fk(3.5.3)63 b(Shell)41 b(P)m(arameter)f(Expansion)150 | |
10025 | 2104 y Fu(The)g(`)p Ft($)p Fu(')h(c)m(haracter)i(in)m(tro)s(duces)d | |
10026 | (parameter)h(expansion,)j(command)d(substitution,)i(or)e(arithmetic)150 | |
10027 | 2214 y(expansion.)d(The)22 b(parameter)h(name)f(or)g(sym)m(b)s(ol)h(to) | |
10028 | g(b)s(e)e(expanded)h(ma)m(y)h(b)s(e)f(enclosed)h(in)f(braces,)i(whic)m | |
10029 | (h)150 2323 y(are)31 b(optional)g(but)f(serv)m(e)h(to)h(protect)f(the)g | |
10030 | (v)-5 b(ariable)31 b(to)g(b)s(e)f(expanded)g(from)g(c)m(haracters)i | |
10031 | (immediately)150 2433 y(follo)m(wing)g(it)f(whic)m(h)f(could)g(b)s(e)g | |
10032 | (in)m(terpreted)h(as)f(part)h(of)f(the)h(name.)275 2576 | |
10033 | y(When)44 b(braces)i(are)f(used,)j(the)e(matc)m(hing)g(ending)f(brace)g | |
10034 | (is)g(the)g(\014rst)g(`)p Ft(})p Fu(')g(not)g(escap)s(ed)h(b)m(y)f(a) | |
10035 | 150 2686 y(bac)m(kslash)40 b(or)f(within)g(a)g(quoted)g(string,)j(and)c | |
10036 | (not)i(within)e(an)h(em)m(b)s(edded)f(arithmetic)j(expansion,)150 | |
10037 | 2795 y(command)30 b(substitution,)g(or)h(parameter)g(expansion.)275 | |
10038 | 2938 y(The)40 b(basic)i(form)f(of)g(parameter)h(expansion)f(is)h($)p | |
b52e30b8 | 10039 | Fi({)p Fr(parameter)7 b Fi(})p Fu(.)74 b(The)41 b(v)-5 |
e59452c7 | 10040 | b(alue)42 b(of)g Fr(parameter)48 b Fu(is)150 3048 y(substituted.)43 |
b52e30b8 CR |
10041 | b(The)31 b Fr(parameter)39 b Fu(is)31 b(a)h(shell)f(parameter)h(as)g |
10042 | (describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g(3.4)h([Shell)150 | |
e59452c7 CR |
10043 | 3157 y(P)m(arameters],)e(page)f(21\))h(or)e(an)g(arra)m(y)h(reference)f |
10044 | (\(see)i(Section)f(6.7)g([Arra)m(ys],)g(page)g(99\).)42 | |
10045 | b(The)29 b(braces)150 3267 y(are)j(required)g(when)f | |
d37a4722 | 10046 | Fr(parameter)39 b Fu(is)32 b(a)h(p)s(ositional)f(parameter)h(with)f |
e59452c7 | 10047 | (more)g(than)g(one)g(digit,)i(or)e(when)150 3377 y Fr(parameter)37 |
d37a4722 CR |
10048 | b Fu(is)31 b(follo)m(w)m(ed)h(b)m(y)e(a)h(c)m(haracter)h(that)f(is)f |
10049 | (not)h(to)g(b)s(e)f(in)m(terpreted)g(as)h(part)f(of)h(its)f(name.)275 | |
e59452c7 | 10050 | 3520 y(If)k(the)h(\014rst)f(c)m(haracter)i(of)f Fr(parameter)42 |
8a0829e9 | 10051 | b Fu(is)35 b(an)g(exclamation)i(p)s(oin)m(t)e(\(!\),)i(and)d |
e59452c7 CR |
10052 | Fr(parameter)42 b Fu(is)34 b(not)i(a)150 3629 y(nameref,)c(it)f(in)m |
10053 | (tro)s(duces)h(a)f(lev)m(el)i(of)f(indirection.)44 b(Bash)31 | |
10054 | b(uses)g(the)g(v)-5 b(alue)32 b(formed)f(b)m(y)g(expanding)g(the)150 | |
10055 | 3739 y(rest)c(of)f Fr(parameter)33 b Fu(as)27 b(the)g(new)f | |
10056 | Fr(parameter)7 b Fu(;)28 b(this)e(is)g(then)g(expanded)g(and)g(that)h | |
10057 | (v)-5 b(alue)27 b(is)f(used)g(in)g(the)150 3848 y(rest)33 | |
10058 | b(of)f(the)h(expansion,)g(rather)g(than)f(the)h(expansion)f(of)h(the)g | |
10059 | (original)g Fr(parameter)p Fu(.)48 b(This)32 b(is)g(kno)m(wn)150 | |
10060 | 3958 y(as)42 b Ft(indirect)28 b(expansion)p Fu(.)71 b(The)41 | |
10061 | b(v)-5 b(alue)41 b(is)h(sub)5 b(ject)41 b(to)h(tilde)g(expansion,)i | |
10062 | (parameter)e(expansion,)150 4068 y(command)31 b(substitution,)g(and)g | |
10063 | (arithmetic)h(expansion.)43 b(If)31 b Fr(parameter)38 | |
10064 | b Fu(is)32 b(a)f(nameref,)h(this)f(expands)150 4177 y(to)d(the)g(name)g | |
10065 | (of)f(the)h(v)-5 b(ariable)28 b(referenced)g(b)m(y)f | |
10066 | Fr(parameter)35 b Fu(instead)27 b(of)h(p)s(erforming)e(the)i(complete)h | |
10067 | (in-)150 4287 y(direct)e(expansion.)39 b(The)25 b(exceptions)i(to)g | |
10068 | (this)f(are)h(the)f(expansions)g(of)g($)p Fi({)p Fu(!)p | |
10069 | Fr(pre\014x)6 b Fu(*)p Fi(})28 b Fu(and)d($)p Fi({)p | |
10070 | Fu(!)p Fr(name)5 b Fu([@])p Fi(})150 4396 y Fu(describ)s(ed)28 | |
10071 | b(b)s(elo)m(w.)41 b(The)28 b(exclamation)j(p)s(oin)m(t)f(m)m(ust)f | |
10072 | (immediately)h(follo)m(w)g(the)g(left)f(brace)h(in)f(order)f(to)150 | |
10073 | 4506 y(in)m(tro)s(duce)i(indirection.)275 4649 y(In)39 | |
10074 | b(eac)m(h)i(of)g(the)f(cases)h(b)s(elo)m(w,)i Fr(w)m(ord)h | |
10075 | Fu(is)c(sub)5 b(ject)40 b(to)h(tilde)f(expansion,)j(parameter)e | |
10076 | (expansion,)150 4759 y(command)30 b(substitution,)g(and)g(arithmetic)i | |
10077 | (expansion.)275 4902 y(When)h(not)h(p)s(erforming)e(substring)h | |
10078 | (expansion,)h(using)g(the)f(form)h(describ)s(ed)e(b)s(elo)m(w)i | |
10079 | (\(e.g.,)i(`)p Ft(:-)p Fu('\),)150 5011 y(Bash)d(tests)h(for)e(a)i | |
9f178efb | 10080 | (parameter)f(that)h(is)e(unset)h(or)g(n)m(ull.)48 b(Omitting)33 |
e59452c7 | 10081 | b(the)h(colon)f(results)g(in)g(a)g(test)h(only)150 5121 |
9f178efb CR |
10082 | y(for)c(a)i(parameter)f(that)g(is)g(unset.)41 b(Put)31 |
10083 | b(another)f(w)m(a)m(y)-8 b(,)33 b(if)e(the)f(colon)i(is)f(included,)f | |
e59452c7 | 10084 | (the)h(op)s(erator)g(tests)150 5230 y(for)36 b(b)s(oth)g |
879213c6 CR |
10085 | Fr(parameter)7 b Fu('s)37 b(existence)h(and)e(that)i(its)f(v)-5 |
10086 | b(alue)37 b(is)g(not)f(n)m(ull;)k(if)d(the)g(colon)h(is)e(omitted,)k | |
e59452c7 CR |
10087 | (the)150 5340 y(op)s(erator)31 b(tests)g(only)f(for)g(existence.)p |
10088 | eop end | |
10089 | %%Page: 27 33 | |
10090 | TeXDict begin 27 32 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10091 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(27)150 299 | |
10092 | y Ft(${)p Fj(parameter)p Ft(:)p Fq(\000)p Fj(word)p Ft(})630 | |
10093 | 408 y Fu(If)30 b Fr(parameter)37 b Fu(is)30 b(unset)g(or)h(n)m(ull,)f | |
10094 | (the)h(expansion)f(of)g Fr(w)m(ord)k Fu(is)c(substituted.)40 | |
10095 | b(Otherwise,)630 518 y(the)31 b(v)-5 b(alue)30 b(of)h | |
10096 | Fr(parameter)37 b Fu(is)31 b(substituted.)870 661 y Ft($)47 | |
10097 | b(v=123)870 771 y($)g(echo)g(${v-unset})870 881 y(123)150 | |
10098 | 1058 y(${)p Fj(parameter)p Ft(:=)p Fj(word)p Ft(})630 | |
10099 | 1167 y Fu(If)33 b Fr(parameter)40 b Fu(is)33 b(unset)f(or)h(n)m(ull,)h | |
10100 | (the)f(expansion)g(of)g Fr(w)m(ord)j Fu(is)d(assigned)g(to)h | |
10101 | Fr(parameter)p Fu(.)630 1277 y(The)c(v)-5 b(alue)32 b(of)f | |
595e3e69 | 10102 | Fr(parameter)38 b Fu(is)31 b(then)g(substituted.)42 b(P)m(ositional)33 |
e59452c7 CR |
10103 | b(parameters)e(and)f(sp)s(ecial)630 1386 y(parameters)h(ma)m(y)g(not)f |
10104 | (b)s(e)g(assigned)h(to)g(in)f(this)g(w)m(a)m(y)-8 b(.)870 | |
10105 | 1530 y Ft($)47 b(var=)870 1639 y($)g(:)h(${var:=DEFAULT})870 | |
10106 | 1749 y($)f(echo)g($var)870 1858 y(DEFAULT)150 2035 y(${)p | |
10107 | Fj(parameter)p Ft(:?)p Fj(word)p Ft(})630 2145 y Fu(If)26 | |
10108 | b Fr(parameter)33 b Fu(is)26 b(n)m(ull)g(or)g(unset,)h(the)f(expansion) | |
10109 | g(of)g Fr(w)m(ord)k Fu(\(or)c(a)h(message)g(to)g(that)f(e\013ect)630 | |
10110 | 2255 y(if)i Fr(w)m(ord)j Fu(is)d(not)g(presen)m(t\))h(is)f(written)g | |
10111 | (to)h(the)f(standard)f(error)h(and)f(the)h(shell,)h(if)f(it)h(is)f(not) | |
10112 | 630 2364 y(in)m(teractiv)m(e,)33 b(exits.)42 b(Otherwise,)30 | |
10113 | b(the)h(v)-5 b(alue)31 b(of)f Fr(parameter)38 b Fu(is)30 | |
10114 | b(substituted.)870 2508 y Ft($)47 b(var=)870 2617 y($)g(:)h(${var:?var) | |
10115 | d(is)i(unset)f(or)i(null})870 2727 y(bash:)e(var:)h(var)g(is)g(unset)f | |
10116 | (or)i(null)150 2904 y(${)p Fj(parameter)p Ft(:+)p Fj(word)p | |
10117 | Ft(})630 3013 y Fu(If)35 b Fr(parameter)42 b Fu(is)36 | |
10118 | b(n)m(ull)f(or)h(unset,)g(nothing)g(is)f(substituted,)i(otherwise)e | |
10119 | (the)h(expansion)630 3123 y(of)31 b Fr(w)m(ord)i Fu(is)e(substituted.) | |
10120 | 870 3266 y Ft($)47 b(var=123)870 3376 y($)g(echo)g(${var:+var)e(is)i | |
10121 | (set)g(and)g(not)g(null})870 3485 y(var)g(is)g(set)g(and)g(not)g(null) | |
10122 | 150 3662 y(${)p Fj(parameter)p Ft(:)p Fj(offset)p Ft(})150 | |
10123 | 3772 y(${)p Fj(parameter)p Ft(:)p Fj(offset)p Ft(:)p | |
10124 | Fj(lengt)o(h)p Ft(})630 3882 y Fu(This)30 b(is)h(referred)f(to)h(as)g | |
10125 | (Substring)f(Expansion.)41 b(It)31 b(expands)f(to)h(up)f(to)h | |
10126 | Fr(length)g Fu(c)m(harac-)630 3991 y(ters)k(of)g(the)h(v)-5 | |
10127 | b(alue)35 b(of)g Fr(parameter)42 b Fu(starting)36 b(at)g(the)f(c)m | |
10128 | (haracter)i(sp)s(eci\014ed)d(b)m(y)h Fr(o\013set)p Fu(.)55 | |
10129 | b(If)630 4101 y Fr(parameter)32 b Fu(is)26 b(`)p Ft(@)p | |
10130 | Fu(',)g(an)f(indexed)g(arra)m(y)h(subscripted)e(b)m(y)h(`)p | |
10131 | Ft(@)p Fu(')g(or)h(`)p Ft(*)p Fu(',)g(or)g(an)f(asso)s(ciativ)m(e)j | |
10132 | (ar-)630 4210 y(ra)m(y)g(name,)h(the)f(results)g(di\013er)g(as)g | |
10133 | (describ)s(ed)f(b)s(elo)m(w.)40 b(If)28 b Fr(length)g | |
10134 | Fu(is)g(omitted,)i(it)f(expands)630 4320 y(to)e(the)g(substring)f(of)g | |
d37a4722 CR |
10135 | (the)h(v)-5 b(alue)27 b(of)g Fr(parameter)33 b Fu(starting)28 |
10136 | b(at)f(the)g(c)m(haracter)h(sp)s(eci\014ed)e(b)m(y)630 | |
e59452c7 | 10137 | 4430 y Fr(o\013set)37 b Fu(and)d(extending)g(to)h(the)f(end)g(of)g(the) |
d37a4722 | 10138 | g(v)-5 b(alue.)53 b Fr(length)34 b Fu(and)g Fr(o\013set)j |
e59452c7 CR |
10139 | Fu(are)e(arithmetic)630 4539 y(expressions)30 b(\(see)h(Section)g(6.5)h |
10140 | ([Shell)e(Arithmetic],)i(page)f(97\).)630 4682 y(If)39 | |
d37a4722 CR |
10141 | b Fr(o\013set)k Fu(ev)-5 b(aluates)41 b(to)f(a)g(n)m(um)m(b)s(er)f |
10142 | (less)h(than)f(zero,)k(the)d(v)-5 b(alue)40 b(is)g(used)e(as)i(an)g | |
e59452c7 | 10143 | (o\013set)630 4792 y(in)33 b(c)m(haracters)i(from)f(the)f(end)g(of)h |
d37a4722 | 10144 | (the)g(v)-5 b(alue)34 b(of)g Fr(parameter)p Fu(.)51 b(If)33 |
e59452c7 | 10145 | b Fr(length)h Fu(ev)-5 b(aluates)35 b(to)g(a)630 4902 |
d37a4722 CR |
10146 | y(n)m(um)m(b)s(er)23 b(less)h(than)g(zero,)j(it)d(is)h(in)m(terpreted)f |
10147 | (as)g(an)h(o\013set)g(in)f(c)m(haracters)h(from)f(the)g(end)g(of)630 | |
e59452c7 | 10148 | 5011 y(the)31 b(v)-5 b(alue)31 b(of)g Fr(parameter)38 |
d37a4722 | 10149 | b Fu(rather)30 b(than)h(a)g(n)m(um)m(b)s(er)f(of)g(c)m(haracters,)j |
e59452c7 | 10150 | (and)d(the)h(expansion)630 5121 y(is)39 b(the)g(c)m(haracters)i(b)s(et) |
d37a4722 | 10151 | m(w)m(een)f Fr(o\013set)i Fu(and)c(that)i(result.)67 |
e59452c7 | 10152 | b(Note)40 b(that)g(a)g(negativ)m(e)h(o\013set)630 5230 |
d37a4722 CR |
10153 | y(m)m(ust)27 b(b)s(e)g(separated)g(from)g(the)g(colon)i(b)m(y)e(at)h |
10154 | (least)g(one)f(space)h(to)g(a)m(v)m(oid)h(b)s(eing)e(confused)630 | |
e59452c7 CR |
10155 | 5340 y(with)j(the)h(`)p Ft(:-)p Fu(')f(expansion.)p eop |
10156 | end | |
10157 | %%Page: 28 34 | |
10158 | TeXDict begin 28 33 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10159 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(28)630 299 | |
10160 | y(Here)43 b(are)g(some)f(examples)h(illustrating)g(substring)f | |
10161 | (expansion)g(on)g(parameters)h(and)630 408 y(subscripted)29 | |
10162 | b(arra)m(ys:)630 628 y Ft($)47 b(string=01234567890abcdefgh)630 | |
10163 | 737 y($)g(echo)g(${string:7})630 847 y(7890abcdefgh)630 | |
10164 | 956 y($)g(echo)g(${string:7:0})630 1176 y($)g(echo)g(${string:7:2})630 | |
10165 | 1285 y(78)630 1395 y($)g(echo)g(${string:7:-2})630 1504 | |
10166 | y(7890abcdef)630 1614 y($)g(echo)g(${string:)e(-7})630 | |
10167 | 1724 y(bcdefgh)630 1833 y($)i(echo)g(${string:)e(-7:0})630 | |
10168 | 2052 y($)i(echo)g(${string:)e(-7:2})630 2162 y(bc)630 | |
10169 | 2271 y($)i(echo)g(${string:)e(-7:-2})630 2381 y(bcdef)630 | |
10170 | 2491 y($)i(set)g(--)h(01234567890abcdefgh)630 2600 y($)f(echo)g(${1:7}) | |
10171 | 630 2710 y(7890abcdefgh)630 2819 y($)g(echo)g(${1:7:0})630 | |
10172 | 3039 y($)g(echo)g(${1:7:2})630 3148 y(78)630 3258 y($)g(echo)g | |
10173 | (${1:7:-2})630 3367 y(7890abcdef)630 3477 y($)g(echo)g(${1:)g(-7})630 | |
10174 | 3587 y(bcdefgh)630 3696 y($)g(echo)g(${1:)g(-7:0})630 | |
10175 | 3915 y($)g(echo)g(${1:)g(-7:2})630 4025 y(bc)630 4134 | |
10176 | y($)g(echo)g(${1:)g(-7:-2})630 4244 y(bcdef)630 4354 | |
10177 | y($)g(array[0]=01234567890abcdef)o(gh)630 4463 y($)g(echo)g | |
10178 | (${array[0]:7})630 4573 y(7890abcdefgh)630 4682 y($)g(echo)g | |
10179 | (${array[0]:7:0})630 4902 y($)g(echo)g(${array[0]:7:2})630 | |
10180 | 5011 y(78)630 5121 y($)g(echo)g(${array[0]:7:-2})630 | |
10181 | 5230 y(7890abcdef)630 5340 y($)g(echo)g(${array[0]:)e(-7})p | |
10182 | eop end | |
10183 | %%Page: 29 35 | |
10184 | TeXDict begin 29 34 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10185 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(29)630 299 | |
10186 | y Ft(bcdefgh)630 408 y($)47 b(echo)g(${array[0]:)e(-7:0})630 | |
10187 | 628 y($)i(echo)g(${array[0]:)e(-7:2})630 737 y(bc)630 | |
10188 | 847 y($)i(echo)g(${array[0]:)e(-7:-2})630 956 y(bcdef)630 | |
10189 | 1084 y Fu(If)22 b Fr(parameter)30 b Fu(is)23 b(`)p Ft(@)p | |
b52e30b8 | 10190 | Fu(',)i(the)e(result)g(is)g Fr(length)h Fu(p)s(ositional)f(parameters)h |
e59452c7 | 10191 | (b)s(eginning)e(at)i Fr(o\013set)p Fu(.)630 1194 y(A)36 |
b52e30b8 CR |
10192 | b(negativ)m(e)j Fr(o\013set)g Fu(is)e(tak)m(en)g(relativ)m(e)i(to)e |
10193 | (one)g(greater)g(than)f(the)h(greatest)h(p)s(ositional)630 | |
e59452c7 | 10194 | 1303 y(parameter,)29 b(so)f(an)g(o\013set)h(of)f(-1)g(ev)-5 |
b52e30b8 | 10195 | b(aluates)30 b(to)e(the)g(last)h(p)s(ositional)g(parameter.)40 |
e59452c7 | 10196 | b(It)28 b(is)g(an)630 1413 y(expansion)i(error)g(if)h |
12beeabf | 10197 | Fr(length)f Fu(ev)-5 b(aluates)32 b(to)f(a)g(n)m(um)m(b)s(er)e(less)i |
e59452c7 | 10198 | (than)f(zero.)630 1541 y(The)i(follo)m(wing)i(examples)f(illustrate)h |
12beeabf | 10199 | (substring)d(expansion)i(using)f(p)s(ositional)h(param-)630 |
e59452c7 CR |
10200 | 1650 y(eters:)630 1778 y Ft($)47 b(set)g(--)h(1)f(2)g(3)h(4)f(5)h(6)f |
10201 | (7)h(8)f(9)h(0)f(a)h(b)f(c)g(d)h(e)f(f)h(g)f(h)630 1888 | |
10202 | y($)g(echo)g(${@:7})630 1998 y(7)g(8)h(9)f(0)h(a)f(b)h(c)f(d)h(e)f(f)h | |
10203 | (g)f(h)630 2107 y($)g(echo)g(${@:7:0})630 2326 y($)g(echo)g(${@:7:2}) | |
10204 | 630 2436 y(7)g(8)630 2545 y($)g(echo)g(${@:7:-2})630 | |
10205 | 2655 y(bash:)f(-2:)h(substring)f(expression)f(<)i(0)630 | |
10206 | 2765 y($)g(echo)g(${@:)g(-7:2})630 2874 y(b)g(c)630 2984 | |
10207 | y($)g(echo)g(${@:0})630 3093 y(./bash)f(1)i(2)f(3)g(4)h(5)f(6)h(7)f(8)h | |
10208 | (9)f(0)h(a)f(b)h(c)f(d)g(e)h(f)f(g)h(h)630 3203 y($)f(echo)g(${@:0:2}) | |
10209 | 630 3313 y(./bash)f(1)630 3422 y($)h(echo)g(${@:)g(-7:0})630 | |
10210 | 3660 y Fu(If)36 b Fr(parameter)43 b Fu(is)36 b(an)g(indexed)g(arra)m(y) | |
1a5fa30b | 10211 | g(name)g(subscripted)f(b)m(y)h(`)p Ft(@)p Fu(')g(or)h(`)p |
e59452c7 | 10212 | Ft(*)p Fu(',)h(the)e(result)g(is)630 3769 y(the)j Fr(length)g |
6e51e0d0 CR |
10213 | Fu(mem)m(b)s(ers)f(of)h(the)f(arra)m(y)i(b)s(eginning)d(with)i |
10214 | Ft(${)p Fj(parameter)p Ft([)p Fj(offset)p Ft(]})p Fu(.)60 | |
e59452c7 | 10215 | b(A)630 3879 y(negativ)m(e)33 b Fr(o\013set)g Fu(is)e(tak)m(en)h |
6e51e0d0 | 10216 | (relativ)m(e)g(to)g(one)f(greater)g(than)g(the)f(maxim)m(um)h(index)f |
e59452c7 | 10217 | (of)h(the)630 3988 y(sp)s(eci\014ed)38 b(arra)m(y)-8 |
d37a4722 CR |
10218 | b(.)65 b(It)38 b(is)g(an)h(expansion)f(error)f(if)i Fr(length)f |
10219 | Fu(ev)-5 b(aluates)40 b(to)f(a)g(n)m(um)m(b)s(er)e(less)630 | |
e59452c7 | 10220 | 4098 y(than)30 b(zero.)630 4226 y(These)23 b(examples)i(sho)m(w)e(ho)m |
d37a4722 | 10221 | (w)h(y)m(ou)g(can)g(use)f(substring)f(expansion)i(with)f(indexed)g |
e59452c7 CR |
10222 | (arra)m(ys:)630 4354 y Ft($)47 b(array=\(0)f(1)h(2)h(3)f(4)h(5)f(6)h(7) |
10223 | f(8)h(9)f(0)h(a)f(b)g(c)h(d)f(e)h(f)f(g)h(h\))630 4463 | |
10224 | y($)f(echo)g(${array[@]:7})630 4573 y(7)g(8)h(9)f(0)h(a)f(b)h(c)f(d)h | |
10225 | (e)f(f)h(g)f(h)630 4682 y($)g(echo)g(${array[@]:7:2})630 | |
10226 | 4792 y(7)g(8)630 4902 y($)g(echo)g(${array[@]:)e(-7:2})630 | |
10227 | 5011 y(b)i(c)630 5121 y($)g(echo)g(${array[@]:)e(-7:-2})630 | |
10228 | 5230 y(bash:)h(-2:)h(substring)f(expression)f(<)i(0)630 | |
10229 | 5340 y($)g(echo)g(${array[@]:0})p eop end | |
10230 | %%Page: 30 36 | |
10231 | TeXDict begin 30 35 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10232 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(30)630 299 | |
10233 | y Ft(0)47 b(1)h(2)f(3)h(4)f(5)h(6)f(7)h(8)f(9)h(0)f(a)g(b)h(c)f(d)h(e)f | |
10234 | (f)h(g)f(h)630 408 y($)g(echo)g(${array[@]:0:2})630 518 | |
10235 | y(0)g(1)630 628 y($)g(echo)g(${array[@]:)e(-7:0})630 | |
10236 | 902 y Fu(Substring)25 b(expansion)g(applied)h(to)h(an)f(asso)s(ciativ)m | |
10237 | (e)j(arra)m(y)d(pro)s(duces)f(unde\014ned)f(results.)630 | |
10238 | 1066 y(Substring)32 b(indexing)i(is)f(zero-based)i(unless)e(the)h(p)s | |
10239 | (ositional)g(parameters)g(are)g(used,)g(in)630 1176 y(whic)m(h)29 | |
fc527055 CR |
10240 | b(case)i(the)f(indexing)g(starts)g(at)g(1)g(b)m(y)g(default.)41 |
10241 | b(If)29 b Fr(o\013set)k Fu(is)d(0,)g(and)f(the)h(p)s(ositional)630 | |
e59452c7 CR |
10242 | 1285 y(parameters)h(are)f(used,)g Ft($0)g Fu(is)g(pre\014xed)g(to)h |
10243 | (the)f(list.)150 1504 y Ft(${!)p Fj(prefix)p Ft(*})150 | |
10244 | 1614 y(${!)p Fj(prefix)p Ft(@})630 1724 y Fu(Expands)24 | |
879213c6 CR |
10245 | b(to)h(the)g(names)g(of)g(v)-5 b(ariables)26 b(whose)f(names)f(b)s |
10246 | (egin)h(with)f Fr(pre\014x)p Fu(,)i(separated)f(b)m(y)630 | |
e59452c7 | 10247 | 1833 y(the)k(\014rst)f(c)m(haracter)j(of)e(the)g Ft(IFS)f |
879213c6 | 10248 | Fu(sp)s(ecial)i(v)-5 b(ariable.)41 b(When)29 b(`)p Ft(@)p |
e59452c7 | 10249 | Fu(')g(is)g(used)f(and)h(the)g(expan-)630 1943 y(sion)35 |
879213c6 CR |
10250 | b(app)s(ears)g(within)f(double)h(quotes,)i(eac)m(h)f(v)-5 |
10251 | b(ariable)36 b(name)f(expands)g(to)g(a)h(separate)630 | |
e59452c7 CR |
10252 | 2052 y(w)m(ord.)150 2271 y Ft(${!)p Fj(name)p Ft([@]})150 |
10253 | 2381 y(${!)p Fj(name)p Ft([*]})630 2491 y Fu(If)26 b | |
10254 | Fr(name)32 b Fu(is)27 b(an)f(arra)m(y)h(v)-5 b(ariable,)29 | |
10255 | b(expands)d(to)h(the)g(list)g(of)g(arra)m(y)g(indices)g(\(k)m(eys\))h | |
10256 | (assigned)630 2600 y(in)c Fr(name)p Fu(.)39 b(If)24 b | |
10257 | Fr(name)30 b Fu(is)24 b(not)h(an)f(arra)m(y)-8 b(,)27 | |
10258 | b(expands)c(to)j(0)f(if)f Fr(name)30 b Fu(is)24 b(set)h(and)f(n)m(ull)g | |
10259 | (otherwise.)630 2710 y(When)39 b(`)p Ft(@)p Fu(')h(is)f(used)g(and)f | |
10260 | (the)i(expansion)f(app)s(ears)g(within)f(double)h(quotes,)k(eac)m(h)d | |
10261 | (k)m(ey)630 2819 y(expands)30 b(to)h(a)f(separate)i(w)m(ord.)150 | |
10262 | 3039 y Ft(${#)p Fj(parameter)p Ft(})630 3148 y Fu(The)40 | |
10263 | b(length)g(in)g(c)m(haracters)i(of)e(the)h(expanded)e(v)-5 | |
10264 | b(alue)41 b(of)f Fr(parameter)47 b Fu(is)40 b(substituted.)630 | |
10265 | 3258 y(If)i Fr(parameter)50 b Fu(is)43 b(`)p Ft(*)p Fu(')g(or)g(`)p | |
6e51e0d0 | 10266 | Ft(@)p Fu(',)k(the)c(v)-5 b(alue)43 b(substituted)f(is)h(the)g(n)m(um)m |
e59452c7 | 10267 | (b)s(er)f(of)h(p)s(ositional)630 3367 y(parameters.)i(If)32 |
6e51e0d0 CR |
10268 | b Fr(parameter)38 b Fu(is)32 b(an)g(arra)m(y)g(name)g(subscripted)f(b)m |
10269 | (y)g(`)p Ft(*)p Fu(')h(or)g(`)p Ft(@)p Fu(',)g(the)g(v)-5 | |
e59452c7 | 10270 | b(alue)630 3477 y(substituted)30 b(is)h(the)g(n)m(um)m(b)s(er)e(of)i |
ad4aef08 | 10271 | (elemen)m(ts)i(in)d(the)h(arra)m(y)-8 b(.)43 b(If)30 |
e59452c7 | 10272 | b Fr(parameter)38 b Fu(is)31 b(an)f(indexed)630 3587 |
091c6bc4 CR |
10273 | y(arra)m(y)37 b(name)g(subscripted)f(b)m(y)h(a)g(negativ)m(e)i(n)m(um)m |
10274 | (b)s(er,)f(that)f(n)m(um)m(b)s(er)f(is)g(in)m(terpreted)i(as)630 | |
e59452c7 | 10275 | 3696 y(relativ)m(e)47 b(to)g(one)e(greater)i(than)e(the)h(maxim)m(um)f |
1a5fa30b | 10276 | (index)g(of)g Fr(parameter)p Fu(,)50 b(so)c(negativ)m(e)630 |
e59452c7 | 10277 | 3806 y(indices)30 b(coun)m(t)h(bac)m(k)g(from)f(the)h(end)e(of)i(the)f |
1a5fa30b | 10278 | (arra)m(y)-8 b(,)32 b(and)e(an)g(index)g(of)g(-1)h(references)g(the)630 |
e59452c7 CR |
10279 | 3915 y(last)g(elemen)m(t.)150 4134 y Ft(${)p Fj(parameter)p |
10280 | Ft(#)p Fj(word)p Ft(})150 4244 y(${)p Fj(parameter)p | |
10281 | Ft(##)p Fj(word)p Ft(})630 4354 y Fu(The)43 b Fr(w)m(ord)k | |
d37a4722 | 10282 | Fu(is)d(expanded)f(to)h(pro)s(duce)f(a)h(pattern)g(and)f(matc)m(hed)i |
e59452c7 | 10283 | (according)f(to)h(the)630 4463 y(rules)31 b(describ)s(ed)g(b)s(elo)m(w) |
d37a4722 | 10284 | h(\(see)h(Section)g(3.5.8.1)h([P)m(attern)g(Matc)m(hing],)g(page)f |
e59452c7 | 10285 | (36\).)46 b(If)32 b(the)630 4573 y(pattern)37 b(matc)m(hes)h(the)f(b)s |
d37a4722 | 10286 | (eginning)f(of)h(the)g(expanded)f(v)-5 b(alue)38 b(of)f |
e59452c7 | 10287 | Fr(parameter)p Fu(,)i(then)e(the)630 4682 y(result)f(of)h(the)f |
d37a4722 | 10288 | (expansion)h(is)f(the)h(expanded)e(v)-5 b(alue)37 b(of)g |
e59452c7 | 10289 | Fr(parameter)43 b Fu(with)36 b(the)h(shortest)630 4792 |
d37a4722 CR |
10290 | y(matc)m(hing)31 b(pattern)e(\(the)h(`)p Ft(#)p Fu(')g(case\))h(or)e |
10291 | (the)h(longest)h(matc)m(hing)f(pattern)g(\(the)g(`)p | |
e59452c7 | 10292 | Ft(##)p Fu(')g(case\))630 4902 y(deleted.)49 b(If)32 |
d37a4722 | 10293 | b Fr(parameter)40 b Fu(is)33 b(`)p Ft(@)p Fu(')g(or)g(`)p |
f602026a | 10294 | Ft(*)p Fu(',)h(the)f(pattern)g(remo)m(v)-5 b(al)34 b(op)s(eration)g(is) |
e59452c7 | 10295 | f(applied)f(to)630 5011 y(eac)m(h)38 b(p)s(ositional)g(parameter)g(in)f |
f602026a | 10296 | (turn,)h(and)e(the)h(expansion)g(is)h(the)f(resultan)m(t)h(list.)61 |
e59452c7 | 10297 | b(If)630 5121 y Fr(parameter)38 b Fu(is)32 b(an)f(arra)m(y)h(v)-5 |
f602026a | 10298 | b(ariable)32 b(subscripted)e(with)h(`)p Ft(@)p Fu(')g(or)h(`)p |
e59452c7 | 10299 | Ft(*)p Fu(',)g(the)f(pattern)h(remo)m(v)-5 b(al)630 5230 |
f602026a CR |
10300 | y(op)s(eration)30 b(is)g(applied)f(to)i(eac)m(h)g(mem)m(b)s(er)e(of)h |
10301 | (the)g(arra)m(y)g(in)f(turn,)g(and)g(the)h(expansion)g(is)630 | |
e59452c7 CR |
10302 | 5340 y(the)h(resultan)m(t)g(list.)p eop end |
10303 | %%Page: 31 37 | |
10304 | TeXDict begin 31 36 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10305 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(31)150 299 | |
10306 | y Ft(${)p Fj(parameter)p Ft(\045)p Fj(word)p Ft(})150 | |
10307 | 408 y(${)p Fj(parameter)p Ft(\045\045)p Fj(word)p Ft(})630 | |
10308 | 518 y Fu(The)43 b Fr(w)m(ord)k Fu(is)d(expanded)f(to)h(pro)s(duce)f(a)h | |
e230f997 | 10309 | (pattern)g(and)f(matc)m(hed)i(according)f(to)h(the)630 |
e59452c7 CR |
10310 | 628 y(rules)f(describ)s(ed)g(b)s(elo)m(w)h(\(see)h(Section)g(3.5.8.1)h |
10311 | ([P)m(attern)f(Matc)m(hing],)51 b(page)45 b(36\).)85 | |
10312 | b(If)630 737 y(the)43 b(pattern)g(matc)m(hes)h(a)g(trailing)g(p)s | |
e230f997 | 10313 | (ortion)e(of)h(the)g(expanded)g(v)-5 b(alue)43 b(of)g |
e59452c7 | 10314 | Fr(parameter)p Fu(,)630 847 y(then)c(the)g(result)g(of)h(the)f |
e230f997 | 10315 | (expansion)g(is)h(the)f(v)-5 b(alue)40 b(of)f Fr(parameter)46 |
e59452c7 | 10316 | b Fu(with)39 b(the)h(shortest)630 956 y(matc)m(hing)31 |
e230f997 CR |
10317 | b(pattern)e(\(the)h(`)p Ft(\045)p Fu(')g(case\))h(or)e(the)h(longest)h |
10318 | (matc)m(hing)f(pattern)g(\(the)g(`)p Ft(\045\045)p Fu(')g(case\))630 | |
e59452c7 | 10319 | 1066 y(deleted.)49 b(If)32 b Fr(parameter)40 b Fu(is)33 |
e230f997 | 10320 | b(`)p Ft(@)p Fu(')g(or)g(`)p Ft(*)p Fu(',)h(the)f(pattern)g(remo)m(v)-5 |
e59452c7 | 10321 | b(al)34 b(op)s(eration)g(is)f(applied)f(to)630 1176 y(eac)m(h)38 |
e230f997 | 10322 | b(p)s(ositional)g(parameter)g(in)f(turn,)h(and)e(the)h(expansion)g(is)h |
e59452c7 | 10323 | (the)f(resultan)m(t)h(list.)61 b(If)630 1285 y Fr(parameter)38 |
e230f997 CR |
10324 | b Fu(is)32 b(an)f(arra)m(y)h(v)-5 b(ariable)32 b(subscripted)e(with)h |
10325 | (`)p Ft(@)p Fu(')g(or)h(`)p Ft(*)p Fu(',)g(the)f(pattern)h(remo)m(v)-5 | |
e59452c7 | 10326 | b(al)630 1395 y(op)s(eration)30 b(is)g(applied)f(to)i(eac)m(h)g(mem)m |
e230f997 | 10327 | (b)s(er)e(of)h(the)g(arra)m(y)g(in)f(turn,)g(and)g(the)h(expansion)g |
e59452c7 | 10328 | (is)630 1504 y(the)h(resultan)m(t)g(list.)150 1677 y |
e230f997 | 10329 | Ft(${)p Fj(parameter)p Ft(/)p Fj(pattern)p Ft(/)p Fj(stri)o(ng)p |
e59452c7 CR |
10330 | Ft(})150 1786 y(${)p Fj(parameter)p Ft(//)p Fj(pattern)p |
10331 | Ft(/)p Fj(str)o(ing)p Ft(})150 1896 y(${)p Fj(parameter)p | |
10332 | Ft(/#)p Fj(pattern)p Ft(/)p Fj(str)o(ing)p Ft(})150 2005 | |
10333 | y(${)p Fj(parameter)p Ft(/\045)p Fj(pattern)p Ft(/)p | |
10334 | Fj(str)o(ing)p Ft(})630 2115 y Fu(The)37 b Fr(pattern)g | |
10335 | Fu(is)g(expanded)g(to)h(pro)s(duce)e(a)h(pattern)g(just)g(as)h(in)e | |
10336 | (\014lename)i(expansion.)630 2225 y Fr(P)m(arameter)46 | |
10337 | b Fu(is)38 b(expanded)f(and)g(the)i(longest)g(matc)m(h)g(of)f | |
10338 | Fr(pattern)g Fu(against)h(its)f(v)-5 b(alue)39 b(is)630 | |
10339 | 2334 y(replaced)30 b(with)e Fr(string)p Fu(.)41 b Fr(string)c | |
10340 | Fu(undergo)s(es)28 b(tilde)i(expansion,)f(parameter)h(and)e(v)-5 | |
10341 | b(ariable)630 2444 y(expansion,)25 b(arithmetic)g(expansion,)g(command) | |
10342 | e(and)g(pro)s(cess)g(substitution,)i(and)e(quote)630 | |
10343 | 2553 y(remo)m(v)-5 b(al.)54 b(The)33 b(matc)m(h)j(is)e(p)s(erformed)f | |
10344 | (according)i(to)g(the)f(rules)g(describ)s(ed)f(b)s(elo)m(w)i(\(see)630 | |
10345 | 2663 y(Section)c(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)g(page)f(36\).) | |
10346 | 630 2804 y(In)45 b(the)g(\014rst)g(form)g(ab)s(o)m(v)m(e,)50 | |
10347 | b(only)c(the)f(\014rst)g(matc)m(h)h(is)f(replaced.)86 | |
10348 | b(If)45 b(there)h(are)g(t)m(w)m(o)630 2913 y(slashes)28 | |
10349 | b(separating)g Fr(parameter)35 b Fu(and)27 b Fr(pattern)g | |
10350 | Fu(\(the)i(second)e(form)g(ab)s(o)m(v)m(e\),)j(all)f(matc)m(hes)630 | |
10351 | 3023 y(of)d Fr(pattern)g Fu(are)g(replaced)g(with)f Fr(string)p | |
10352 | Fu(.)40 b(If)25 b Fr(pattern)h Fu(is)f(preceded)h(b)m(y)f(`)p | |
10353 | Ft(#)p Fu(')h(\(the)h(third)d(form)630 3133 y(ab)s(o)m(v)m(e\),)32 | |
10354 | b(it)e(m)m(ust)f(matc)m(h)i(at)f(the)g(b)s(eginning)e(of)i(the)g | |
10355 | (expanded)f(v)-5 b(alue)30 b(of)f Fr(parameter)p Fu(.)41 | |
10356 | b(If)630 3242 y Fr(pattern)28 b Fu(is)g(preceded)g(b)m(y)g(`)p | |
10357 | Ft(\045)p Fu(')g(\(the)h(fourth)e(form)h(ab)s(o)m(v)m(e\),)i(it)f(m)m | |
10358 | (ust)f(matc)m(h)h(at)g(the)f(end)g(of)630 3352 y(the)i(expanded)e(v)-5 | |
10359 | b(alue)30 b(of)g Fr(parameter)p Fu(.)41 b(If)28 b(the)i(expansion)f(of) | |
10360 | h Fr(string)37 b Fu(is)29 b(n)m(ull,)h(matc)m(hes)h(of)630 | |
10361 | 3461 y Fr(pattern)d Fu(are)g(deleted.)41 b(If)28 b Fr(string)35 | |
10362 | b Fu(is)28 b(n)m(ull,)h(matc)m(hes)g(of)f Fr(pattern)g | |
10363 | Fu(are)h(deleted)f(and)g(the)g(`)p Ft(/)p Fu(')630 3571 | |
10364 | y(follo)m(wing)k Fr(pattern)e Fu(ma)m(y)h(b)s(e)f(omitted.)630 | |
10365 | 3712 y(If)f(the)h Ft(patsub_replacement)25 b Fu(shell)30 | |
10366 | b(option)g(is)f(enabled)h(using)f Ft(shopt)p Fu(,)g(an)m(y)h(unquoted) | |
3011048a CR |
10367 | 630 3821 y(instances)40 b(of)g(`)p Ft(&)p Fu(')g(in)f |
10368 | Fr(string)48 b Fu(are)40 b(replaced)g(with)g(the)g(matc)m(hing)g(p)s | |
10369 | (ortion)g(of)g Fr(pattern)p Fu(.)630 3931 y(This)30 b(is)g(in)m(tended) | |
10370 | g(to)h(duplicate)g(a)g(common)g Ft(sed)e Fu(idiom.)630 | |
10371 | 4072 y(Quoting)g(an)m(y)f(part)h(of)f Fr(string)36 b | |
10372 | Fu(inhibits)28 b(replacemen)m(t)i(in)e(the)g(expansion)h(of)f(the)h | |
10373 | (quoted)630 4181 y(p)s(ortion,)j(including)g(replacemen)m(t)h(strings)f | |
10374 | (stored)g(in)g(shell)g(v)-5 b(ariables.)46 b(Bac)m(kslash)34 | |
10375 | b(will)630 4291 y(escap)s(e)k(`)p Ft(&)p Fu(')g(in)f | |
10376 | Fr(string)8 b Fu(;)42 b(the)c(bac)m(kslash)g(is)g(remo)m(v)m(ed)g(in)g | |
10377 | (order)f(to)h(p)s(ermit)f(a)i(literal)g(`)p Ft(&)p Fu(')630 | |
10378 | 4401 y(in)31 b(the)h(replacemen)m(t)h(string.)44 b(Users)32 | |
10379 | b(should)e(tak)m(e)k(care)e(if)g Fr(string)39 b Fu(is)32 | |
10380 | b(double-quoted)f(to)630 4510 y(a)m(v)m(oid)37 b(un)m(w)m(an)m(ted)f | |
10381 | (in)m(teractions)i(b)s(et)m(w)m(een)e(the)g(bac)m(kslash)h(and)e | |
10382 | (double-quoting,)j(since)630 4620 y(bac)m(kslash)31 b(has)f(sp)s(ecial) | |
10383 | h(meaning)f(within)g(double)f(quotes.)42 b(P)m(attern)31 | |
10384 | b(substitution)f(p)s(er-)630 4729 y(forms)e(the)h(c)m(hec)m(k)i(for)d | |
10385 | (unquoted)g(`)p Ft(&)p Fu(')h(after)g(expanding)g Fr(string)p | |
10386 | Fu(,)g(so)g(users)f(should)g(ensure)630 4839 y(to)33 | |
10387 | b(prop)s(erly)e(quote)i(an)m(y)f(o)s(ccurrences)g(of)h(`)p | |
10388 | Ft(&)p Fu(')f(they)g(w)m(an)m(t)h(to)g(b)s(e)f(tak)m(en)h(literally)h | |
10389 | (in)e(the)630 4949 y(replacemen)m(t)k(and)e(ensure)g(an)m(y)h | |
10390 | (instances)g(of)g(`)p Ft(&)p Fu(')f(they)h(w)m(an)m(t)g(to)h(b)s(e)e | |
10391 | (replaced)h(are)g(un-)630 5058 y(quoted.)630 5199 y(F)-8 | |
10392 | b(or)31 b(instance,)870 5340 y Ft(var=abcdef)p eop end | |
e59452c7 CR |
10393 | %%Page: 32 38 |
10394 | TeXDict begin 32 37 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10395 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(32)870 299 | |
3011048a CR |
10396 | y Ft(rep='&)46 b(')870 408 y(echo)h(${var/abc/&)d(})870 |
10397 | 518 y(echo)j("${var/abc/&)d(}")870 628 y(echo)j(${var/abc/$rep})870 | |
10398 | 737 y(echo)g("${var/abc/$rep}")630 867 y Fu(will)31 b(displa)m(y)f | |
10399 | (four)g(lines)h(of)f Ft(")p Fu(ab)s(c)g(def)p Ft(")p | |
10400 | Fu(,)g(while)870 996 y Ft(var=abcdef)870 1106 y(rep='&)46 | |
10401 | b(')870 1215 y(echo)h(${var/abc/\\&)d(})870 1325 y(echo)j | |
10402 | ("${var/abc/\\&)d(}")870 1435 y(echo)j(${var/abc/"&)d("})870 | |
10403 | 1544 y(echo)j(${var/abc/"$rep"})630 1674 y Fu(will)34 | |
10404 | b(displa)m(y)g(four)g(lines)g(of)g Ft(")p Fu(&)f(def)p | |
10405 | Ft(")p Fu(.)51 b(Lik)m(e)35 b(the)f(pattern)g(remo)m(v)-5 | |
10406 | b(al)35 b(op)s(erators,)g(double)630 1783 y(quotes)23 | |
10407 | b(surrounding)c(the)k(replacemen)m(t)g(string)f(quote)h(the)f(expanded) | |
10408 | f(c)m(haracters,)26 b(while)630 1893 y(double)43 b(quotes)i(enclosing)f | |
10409 | (the)g(en)m(tire)h(parameter)f(substitution)f(do)h(not,)k(since)c(the) | |
10410 | 630 2002 y(expansion)e(is)h(p)s(erformed)e(in)h(a)h(con)m(text)h(that)f | |
10411 | (do)s(esn't)f(tak)m(e)i(an)m(y)f(enclosing)g(double)630 | |
10412 | 2112 y(quotes)31 b(in)m(to)g(accoun)m(t.)630 2242 y(Since)24 | |
10413 | b(bac)m(kslash)i(can)e(escap)s(e)h(`)p Ft(&)p Fu(',)h(it)f(can)g(also)h | |
10414 | (escap)s(e)f(a)f(bac)m(kslash)i(in)e(the)g(replacemen)m(t)630 | |
10415 | 2351 y(string.)39 b(This)26 b(means)g(that)h(`)p Ft(\\\\)p | |
10416 | Fu(')g(will)f(insert)h(a)f(literal)i(bac)m(kslash)f(in)m(to)h(the)e | |
10417 | (replacemen)m(t,)630 2461 y(so)31 b(these)f(t)m(w)m(o)i | |
10418 | Ft(echo)d Fu(commands)870 2590 y Ft(var=abcdef)870 2700 | |
10419 | y(rep='\\\\&xyz')870 2809 y(echo)47 b(${var/abc/\\\\&xyz})870 | |
10420 | 2919 y(echo)g(${var/abc/$rep})630 3049 y Fu(will)31 b(b)s(oth)e(output) | |
10421 | h(`)p Ft(\\abcxyzdef)p Fu('.)630 3178 y(It)g(should)g(rarely)g(b)s(e)g | |
10422 | (necessary)h(to)g(enclose)h(only)e Fr(string)38 b Fu(in)30 | |
10423 | b(double)g(quotes.)630 3308 y(If)j(the)h Ft(nocasematch)d | |
10424 | Fu(shell)i(option)h(\(see)h(the)f(description)f(of)h | |
10425 | Ft(shopt)e Fu(in)i(Section)g(4.3.2)630 3417 y([The)23 | |
10426 | b(Shopt)g(Builtin],)j(page)e(70\))h(is)e(enabled,)i(the)f(matc)m(h)g | |
10427 | (is)g(p)s(erformed)e(without)h(regard)630 3527 y(to)31 | |
10428 | b(the)f(case)h(of)g(alphab)s(etic)f(c)m(haracters.)42 | |
e59452c7 | 10429 | b(If)30 b Fr(parameter)37 b Fu(is)30 b(`)p Ft(@)p Fu(')g(or)g(`)p |
3011048a | 10430 | Ft(*)p Fu(',)h(the)f(substitution)630 3636 y(op)s(eration)g(is)f |
e59452c7 | 10431 | (applied)g(to)h(eac)m(h)g(p)s(ositional)g(parameter)g(in)e(turn,)h(and) |
3011048a | 10432 | g(the)g(expansion)g(is)630 3746 y(the)i(resultan)m(t)h(list.)45 |
e59452c7 CR |
10433 | b(If)30 b Fr(parameter)39 b Fu(is)31 b(an)g(arra)m(y)h(v)-5 |
10434 | b(ariable)32 b(subscripted)e(with)h(`)p Ft(@)p Fu(')g(or)h(`)p | |
3011048a | 10435 | Ft(*)p Fu(',)630 3856 y(the)e(substitution)g(op)s(eration)h(is)f |
e59452c7 | 10436 | (applied)g(to)h(eac)m(h)h(mem)m(b)s(er)e(of)g(the)g(arra)m(y)h(in)f |
3011048a CR |
10437 | (turn,)g(and)630 3965 y(the)h(expansion)f(is)g(the)h(resultan)m(t)g |
10438 | (list.)150 4115 y Ft(${)p Fj(parameter)p Ft(^)p Fj(pattern)p | |
10439 | Ft(})150 4224 y(${)p Fj(parameter)p Ft(^^)p Fj(pattern)p | |
10440 | Ft(})150 4334 y(${)p Fj(parameter)p Ft(,)p Fj(pattern)p | |
10441 | Ft(})150 4443 y(${)p Fj(parameter)p Ft(,,)p Fj(pattern)p | |
10442 | Ft(})630 4553 y Fu(This)36 b(expansion)g(mo)s(di\014es)g(the)g(case)i | |
e59452c7 | 10443 | (of)f(alphab)s(etic)g(c)m(haracters)h(in)e Fr(parameter)p |
3011048a | 10444 | Fu(.)59 b(The)630 4663 y Fr(pattern)33 b Fu(is)g(expanded)e(to)j(pro)s |
e59452c7 | 10445 | (duce)d(a)j(pattern)e(just)g(as)h(in)g(\014lename)g(expansion.)47 |
3011048a | 10446 | b(Eac)m(h)630 4772 y(c)m(haracter)32 b(in)e(the)g(expanded)f(v)-5 |
e59452c7 | 10447 | b(alue)31 b(of)f Fr(parameter)37 b Fu(is)30 b(tested)h(against)h |
3011048a | 10448 | Fr(pattern)p Fu(,)e(and,)g(if)630 4882 y(it)j(matc)m(hes)h(the)g |
091c6bc4 | 10449 | (pattern,)f(its)h(case)g(is)f(con)m(v)m(erted.)49 b(The)33 |
3011048a CR |
10450 | b(pattern)g(should)f(not)h(attempt)630 4991 y(to)e(matc)m(h)g(more)g |
10451 | (than)f(one)h(c)m(haracter.)630 5121 y(The)f(`)p Ft(^)p | |
e59452c7 CR |
10452 | Fu(')g(op)s(erator)g(con)m(v)m(erts)i(lo)m(w)m(ercase)g(letters)g(matc) |
10453 | m(hing)f Fr(pattern)f Fu(to)h(upp)s(ercase;)f(the)630 | |
3011048a | 10454 | 5230 y(`)p Ft(,)p Fu(')25 b(op)s(erator)f(con)m(v)m(erts)i(matc)m(hing) |
e59452c7 | 10455 | g(upp)s(ercase)d(letters)j(to)f(lo)m(w)m(ercase.)41 b(The)24 |
3011048a | 10456 | b(`)p Ft(^^)p Fu(')g(and)g(`)p Ft(,,)p Fu(')630 5340 |
e59452c7 CR |
10457 | y(expansions)31 b(con)m(v)m(ert)i(eac)m(h)g(matc)m(hed)f(c)m(haracter)h |
10458 | (in)e(the)h(expanded)f(v)-5 b(alue;)32 b(the)g(`)p Ft(^)p | |
3011048a CR |
10459 | Fu(')g(and)p eop end |
10460 | %%Page: 33 39 | |
10461 | TeXDict begin 33 38 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10462 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(33)630 299 | |
10463 | y(`)p Ft(,)p Fu(')24 b(expansions)f(matc)m(h)i(and)e(con)m(v)m(ert)j | |
10464 | (only)d(the)h(\014rst)f(c)m(haracter)j(in)d(the)h(expanded)f(v)-5 | |
10465 | b(alue.)630 408 y(If)30 b Fr(pattern)g Fu(is)h(omitted,)g(it)g(is)g | |
10466 | (treated)g(lik)m(e)h(a)f(`)p Ft(?)p Fu(',)f(whic)m(h)g(matc)m(hes)i(ev) | |
10467 | m(ery)f(c)m(haracter.)630 539 y(If)23 b Fr(parameter)31 | |
10468 | b Fu(is)24 b(`)p Ft(@)p Fu(')g(or)g(`)p Ft(*)p Fu(',)h(the)f(case)h(mo) | |
10469 | s(di\014cation)f(op)s(eration)g(is)g(applied)g(to)g(eac)m(h)h(p)s(osi-) | |
10470 | 630 649 y(tional)h(parameter)e(in)h(turn,)f(and)g(the)h(expansion)f(is) | |
10471 | g(the)h(resultan)m(t)g(list.)40 b(If)23 b Fr(parameter)32 | |
10472 | b Fu(is)630 758 y(an)e(arra)m(y)g(v)-5 b(ariable)31 b(subscripted)d | |
10473 | (with)i(`)p Ft(@)p Fu(')g(or)f(`)p Ft(*)p Fu(',)i(the)f(case)g(mo)s | |
10474 | (di\014cation)h(op)s(eration)f(is)630 868 y(applied)d(to)g(eac)m(h)h | |
10475 | (mem)m(b)s(er)e(of)h(the)g(arra)m(y)g(in)g(turn,)g(and)f(the)h | |
10476 | (expansion)f(is)h(the)g(resultan)m(t)630 977 y(list.)150 | |
10477 | 1129 y Ft(${)p Fj(parameter)p Ft(@)p Fj(operator)p Ft(})630 | |
10478 | 1239 y Fu(The)h(expansion)h(is)f(either)h(a)g(transformation)g(of)g | |
10479 | (the)g(v)-5 b(alue)29 b(of)g Fr(parameter)35 b Fu(or)29 | |
10480 | b(informa-)630 1348 y(tion)e(ab)s(out)f Fr(parameter)33 | |
e59452c7 CR |
10481 | b Fu(itself,)28 b(dep)s(ending)c(on)i(the)h(v)-5 b(alue)26 |
10482 | b(of)h Fr(op)s(erator)p Fu(.)39 b(Eac)m(h)27 b Fr(op)s(erator)630 | |
3011048a | 10483 | 1458 y Fu(is)j(a)h(single)g(letter:)630 1610 y Ft(U)432 |
e59452c7 CR |
10484 | b Fu(The)31 b(expansion)g(is)g(a)g(string)h(that)f(is)h(the)f(v)-5 |
10485 | b(alue)32 b(of)f Fr(parameter)38 b Fu(with)31 b(lo)m(w-)1110 | |
3011048a CR |
10486 | 1719 y(ercase)g(alphab)s(etic)g(c)m(haracters)h(con)m(v)m(erted)g(to)f |
10487 | (upp)s(ercase.)630 1871 y Ft(u)432 b Fu(The)34 b(expansion)g(is)g(a)h | |
10488 | (string)f(that)h(is)g(the)f(v)-5 b(alue)35 b(of)f Fr(parameter)42 | |
10489 | b Fu(with)34 b(the)1110 1981 y(\014rst)c(c)m(haracter)i(con)m(v)m | |
10490 | (erted)f(to)h(upp)s(ercase,)d(if)i(it)g(is)f(alphab)s(etic.)630 | |
10491 | 2132 y Ft(L)432 b Fu(The)33 b(expansion)h(is)g(a)g(string)g(that)h(is)f | |
10492 | (the)g(v)-5 b(alue)34 b(of)g Fr(parameter)41 b Fu(with)34 | |
10493 | b(up-)1110 2242 y(p)s(ercase)c(alphab)s(etic)h(c)m(haracters)h(con)m(v) | |
10494 | m(erted)g(to)f(lo)m(w)m(ercase.)630 2394 y Ft(Q)432 b | |
10495 | Fu(The)30 b(expansion)h(is)g(a)g(string)f(that)i(is)f(the)g(v)-5 | |
d37a4722 | 10496 | b(alue)31 b(of)g Fr(parameter)37 b Fu(quoted)31 b(in)1110 |
3011048a CR |
10497 | 2503 y(a)g(format)f(that)h(can)g(b)s(e)f(reused)f(as)i(input.)630 |
10498 | 2655 y Ft(E)432 b Fu(The)27 b(expansion)g(is)g(a)g(string)h(that)f(is)h | |
d37a4722 | 10499 | (the)f(v)-5 b(alue)28 b(of)f Fr(parameter)34 b Fu(with)27 |
3011048a | 10500 | b(bac)m(k-)1110 2765 y(slash)e(escap)s(e)h(sequences)f(expanded)g(as)g |
d37a4722 | 10501 | (with)g(the)h Ft($'...)o(')e Fu(quoting)i(mec)m(h-)1110 |
3011048a | 10502 | 2874 y(anism.)630 3026 y Ft(P)432 b Fu(The)22 b(expansion)h(is)g(a)g |
e59452c7 | 10503 | (string)g(that)g(is)g(the)g(result)g(of)g(expanding)f(the)h(v)-5 |
3011048a | 10504 | b(alue)24 b(of)1110 3136 y Fr(parameter)31 b Fu(as)24 |
e59452c7 | 10505 | b(if)f(it)h(w)m(ere)g(a)g(prompt)f(string)h(\(see)g(Section)h(6.9)g |
3011048a CR |
10506 | ([Con)m(trolling)1110 3245 y(the)31 b(Prompt],)f(page)h(103\).)630 |
10507 | 3397 y Ft(A)432 b Fu(The)24 b(expansion)g(is)g(a)h(string)f(in)g(the)g | |
e59452c7 | 10508 | (form)g(of)h(an)f(assignmen)m(t)h(statemen)m(t)h(or)1110 |
3011048a CR |
10509 | 3506 y Ft(declare)h Fu(command)i(that,)h(if)f(ev)-5 b(aluated,)31 |
10510 | b(will)e(recreate)i Fr(parameter)36 b Fu(with)1110 3616 | |
10511 | y(its)31 b(attributes)g(and)e(v)-5 b(alue.)630 3768 y | |
e59452c7 CR |
10512 | Ft(K)432 b Fu(Pro)s(duces)33 b(a)i(p)s(ossibly-quoted)e(v)m(ersion)i |
10513 | (of)f(the)h(v)-5 b(alue)34 b(of)h Fr(parameter)p Fu(,)g(ex-)1110 | |
3011048a | 10514 | 3877 y(cept)46 b(that)h(it)f(prin)m(ts)f(the)h(v)-5 b(alues)47 |
e59452c7 | 10515 | b(of)f(indexed)f(and)g(asso)s(ciativ)m(e)k(arra)m(ys)1110 |
3011048a | 10516 | 3987 y(as)37 b(a)g(sequence)f(of)h(quoted)g(k)m(ey-v)-5 |
e59452c7 | 10517 | b(alue)38 b(pairs)e(\(see)h(Section)h(6.7)f([Arra)m(ys],)1110 |
3011048a | 10518 | 4097 y(page)31 b(99\).)630 4248 y Ft(a)432 b Fu(The)30 |
e59452c7 | 10519 | b(expansion)g(is)g(a)h(string)f(consisting)h(of)g(\015ag)g(v)-5 |
3011048a CR |
10520 | b(alues)30 b(represen)m(ting)h Fr(pa-)1110 4358 y(rameter)7 |
10521 | b Fu('s)31 b(attributes.)630 4510 y Ft(k)432 b Fu(Lik)m(e)29 | |
e59452c7 | 10522 | b(the)g(`)p Ft(K)p Fu(')g(transformation,)g(but)f(expands)g(the)g(k)m |
3011048a | 10523 | (eys)i(and)d(v)-5 b(alues)29 b(of)g(in-)1110 4619 y(dexed)c(and)f(asso) |
e59452c7 | 10524 | s(ciativ)m(e)k(arra)m(ys)d(to)h(separate)f(w)m(ords)g(after)g(w)m(ord)g |
3011048a | 10525 | (splitting.)630 4771 y(If)k Fr(parameter)37 b Fu(is)30 |
e59452c7 CR |
10526 | b(`)p Ft(@)p Fu(')g(or)g(`)p Ft(*)p Fu(',)g(the)g(op)s(eration)g(is)g |
10527 | (applied)f(to)i(eac)m(h)g(p)s(ositional)f(parameter)630 | |
3011048a | 10528 | 4881 y(in)24 b(turn,)g(and)f(the)h(expansion)g(is)g(the)g(resultan)m(t) |
e59452c7 | 10529 | h(list.)39 b(If)23 b Fr(parameter)31 b Fu(is)24 b(an)g(arra)m(y)g(v)-5 |
3011048a | 10530 | b(ariable)630 4990 y(subscripted)24 b(with)h(`)p Ft(@)p |
e59452c7 | 10531 | Fu(')h(or)g(`)p Ft(*)p Fu(',)h(the)e(op)s(eration)h(is)g(applied)f(to)h |
3011048a | 10532 | (eac)m(h)h(mem)m(b)s(er)e(of)h(the)f(arra)m(y)630 5100 |
e59452c7 | 10533 | y(in)30 b(turn,)g(and)f(the)i(expansion)f(is)h(the)f(resultan)m(t)h |
3011048a | 10534 | (list.)630 5230 y(The)c(result)h(of)g(the)f(expansion)h(is)g(sub)5 |
e59452c7 | 10535 | b(ject)27 b(to)h(w)m(ord)g(splitting)g(and)f(\014lename)h(expansion)630 |
3011048a CR |
10536 | 5340 y(as)j(describ)s(ed)e(b)s(elo)m(w.)p eop end |
10537 | %%Page: 34 40 | |
10538 | TeXDict begin 34 39 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10539 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(34)150 299 | |
10540 | y Fk(3.5.4)63 b(Command)41 b(Substitution)150 446 y Fu(Command)f | |
10541 | (substitution)h(allo)m(ws)i(the)e(output)g(of)h(a)f(command)g(to)h | |
10542 | (replace)g(the)g(command)f(itself.)150 555 y(Command)29 | |
10543 | b(substitution)h(o)s(ccurs)h(when)e(a)i(command)f(is)g(enclosed)h(as)g | |
10544 | (follo)m(ws:)390 691 y Ft($\()p Fj(command)p Ft(\))150 | |
10545 | 827 y Fu(or)390 962 y Ft(`)p Fj(command)p Ft(`)150 1098 | |
10546 | y Fu(Bash)20 b(p)s(erforms)f(the)i(expansion)f(b)m(y)g(executing)i | |
091c6bc4 | 10547 | Fr(command)h Fu(in)d(a)h(subshell)e(en)m(vironmen)m(t)i(and)f |
3011048a | 10548 | (replacing)150 1207 y(the)40 b(command)g(substitution)f(with)h(the)g |
091c6bc4 | 10549 | (standard)f(output)g(of)h(the)g(command,)i(with)e(an)m(y)g(trailing)150 |
3011048a | 10550 | 1317 y(newlines)e(deleted.)64 b(Em)m(b)s(edded)37 b(newlines)h(are)g |
091c6bc4 | 10551 | (not)g(deleted,)j(but)d(they)g(ma)m(y)h(b)s(e)e(remo)m(v)m(ed)i(during) |
3011048a | 10552 | 150 1427 y(w)m(ord)30 b(splitting.)42 b(The)30 b(command)g |
091c6bc4 | 10553 | (substitution)h Ft($\(cat)e Fj(file)p Ft(\))g Fu(can)h(b)s(e)g |
3011048a CR |
10554 | (replaced)h(b)m(y)g(the)f(equiv)-5 b(alen)m(t)150 1536 |
10555 | y(but)30 b(faster)g Ft($\(<)g Fj(file)p Ft(\))p Fu(.)275 | |
10556 | 1672 y(When)j(the)i(old-st)m(yle)h(bac)m(kquote)f(form)f(of)g | |
091c6bc4 | 10557 | (substitution)g(is)g(used,)h(bac)m(kslash)f(retains)h(its)f(literal)150 |
3011048a | 10558 | 1781 y(meaning)k(except)h(when)e(follo)m(w)m(ed)j(b)m(y)e(`)p |
091c6bc4 CR |
10559 | Ft($)p Fu(',)j(`)p Ft(`)p Fu(',)f(or)e(`)p Ft(\\)p Fu('.)64 |
10560 | b(The)38 b(\014rst)f(bac)m(kquote)j(not)e(preceded)g(b)m(y)g(a)150 | |
3011048a | 10561 | 1891 y(bac)m(kslash)k(terminates)f(the)h(command)e(substitution.)72 |
091c6bc4 | 10562 | b(When)41 b(using)f(the)i Ft($\()p Fj(command)p Ft(\))c |
3011048a CR |
10563 | Fu(form,)43 b(all)150 2000 y(c)m(haracters)32 b(b)s(et)m(w)m(een)f(the) |
10564 | f(paren)m(theses)h(mak)m(e)g(up)f(the)g(command;)h(none)f(are)h | |
10565 | (treated)g(sp)s(ecially)-8 b(.)275 2136 y(Command)22 | |
10566 | b(substitutions)g(ma)m(y)i(b)s(e)e(nested.)39 b(T)-8 | |
10567 | b(o)23 b(nest)g(when)f(using)h(the)g(bac)m(kquoted)h(form,)g(escap)s(e) | |
10568 | 150 2246 y(the)31 b(inner)e(bac)m(kquotes)j(with)e(bac)m(kslashes.)275 | |
10569 | 2381 y(If)e(the)i(substitution)e(app)s(ears)h(within)g(double)f | |
10570 | (quotes,)i(w)m(ord)f(splitting)h(and)f(\014lename)g(expansion)150 | |
10571 | 2491 y(are)i(not)f(p)s(erformed)f(on)h(the)h(results.)150 | |
10572 | 2691 y Fk(3.5.5)63 b(Arithmetic)40 b(Expansion)150 2838 | |
10573 | y Fu(Arithmetic)25 b(expansion)g(allo)m(ws)g(the)g(ev)-5 | |
fc527055 | 10574 | b(aluation)26 b(of)f(an)f(arithmetic)i(expression)e(and)g(the)g |
3011048a CR |
10575 | (substitution)150 2948 y(of)31 b(the)f(result.)41 b(The)30 |
10576 | b(format)g(for)g(arithmetic)i(expansion)e(is:)390 3083 | |
10577 | y Ft($\(\()47 b Fj(expression)e Ft(\)\))275 3219 y Fu(The)34 | |
e59452c7 | 10578 | b Fr(expression)h Fu(undergo)s(es)f(the)h(same)h(expansions)e(as)i(if)f |
3011048a | 10579 | (it)g(w)m(ere)h(within)e(double)h(quotes,)i(but)150 3328 |
e59452c7 CR |
10580 | y(double)g(quote)g(c)m(haracters)i(in)d Fr(expression)h |
10581 | Fu(are)g(not)g(treated)h(sp)s(ecially)g(and)f(are)g(remo)m(v)m(ed.)61 | |
3011048a | 10582 | b(All)38 b(to-)150 3438 y(k)m(ens)c(in)f(the)h(expression)f(undergo)g |
e59452c7 | 10583 | (parameter)h(and)f(v)-5 b(ariable)34 b(expansion,)h(command)e |
3011048a | 10584 | (substitution,)150 3548 y(and)41 b(quote)i(remo)m(v)-5 |
e59452c7 | 10585 | b(al.)76 b(The)41 b(result)h(is)g(treated)h(as)f(the)g(arithmetic)h |
3011048a | 10586 | (expression)f(to)g(b)s(e)f(ev)-5 b(aluated.)150 3657 |
e59452c7 | 10587 | y(Arithmetic)31 b(expansions)f(ma)m(y)h(b)s(e)f(nested.)275 |
3011048a | 10588 | 3793 y(The)k(ev)-5 b(aluation)37 b(is)f(p)s(erformed)e(according)i(to)g |
e59452c7 | 10589 | (the)g(rules)f(listed)h(b)s(elo)m(w)g(\(see)g(Section)g(6.5)h([Shell) |
3011048a | 10590 | 150 3902 y(Arithmetic],)32 b(page)f(97\).)42 b(If)30 |
e59452c7 | 10591 | b(the)h(expression)f(is)g(in)m(v)-5 b(alid,)32 b(Bash)e(prin)m(ts)g(a)h |
3011048a CR |
10592 | (message)g(indicating)h(failure)150 4012 y(to)f(the)g(standard)e(error) |
10593 | h(and)g(no)g(substitution)g(o)s(ccurs.)150 4212 y Fk(3.5.6)63 | |
10594 | b(Pro)s(cess)42 b(Substitution)150 4359 y Fu(Pro)s(cess)33 | |
e59452c7 CR |
10595 | b(substitution)g(allo)m(ws)i(a)e(pro)s(cess's)g(input)f(or)h(output)g |
10596 | (to)h(b)s(e)f(referred)f(to)i(using)f(a)g(\014lename.)150 | |
3011048a CR |
10597 | 4469 y(It)d(tak)m(es)i(the)f(form)f(of)390 4604 y Ft(<\()p |
10598 | Fj(list)p Ft(\))150 4740 y Fu(or)390 4876 y Ft(>\()p | |
10599 | Fj(list)p Ft(\))150 5011 y Fu(The)e(pro)s(cess)h Fr(list)j | |
e59452c7 CR |
10600 | Fu(is)d(run)e(async)m(hronously)-8 b(,)30 b(and)e(its)i(input)e(or)h |
10601 | (output)f(app)s(ears)h(as)g(a)g(\014lename.)41 b(This)150 | |
3011048a | 10602 | 5121 y(\014lename)25 b(is)g(passed)g(as)g(an)g(argumen)m(t)h(to)g(the)f |
e59452c7 | 10603 | (curren)m(t)g(command)g(as)g(the)g(result)g(of)g(the)h(expansion.)38 |
3011048a | 10604 | b(If)150 5230 y(the)28 b Ft(>\()p Fj(list)p Ft(\))d Fu(form)i(is)g |
e59452c7 CR |
10605 | (used,)h(writing)f(to)h(the)g(\014le)f(will)h(pro)m(vide)g(input)e(for) |
10606 | h Fr(list)p Fu(.)41 b(If)26 b(the)i Ft(<\()p Fj(list)p | |
3011048a | 10607 | Ft(\))d Fu(form)150 5340 y(is)g(used,)g(the)f(\014le)h(passed)f(as)h |
e59452c7 | 10608 | (an)f(argumen)m(t)h(should)e(b)s(e)h(read)h(to)g(obtain)g(the)f(output) |
3011048a CR |
10609 | g(of)h Fr(list)p Fu(.)40 b(Note)25 b(that)p eop end |
10610 | %%Page: 35 41 | |
10611 | TeXDict begin 35 40 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10612 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(35)150 299 | |
10613 | y(no)33 b(space)g(ma)m(y)g(app)s(ear)f(b)s(et)m(w)m(een)i(the)f | |
e59452c7 | 10614 | Ft(<)f Fu(or)h Ft(>)f Fu(and)g(the)h(left)h(paren)m(thesis,)f |
3011048a | 10615 | (otherwise)h(the)f(construct)150 408 y(w)m(ould)j(b)s(e)g(in)m |
e59452c7 | 10616 | (terpreted)g(as)h(a)f(redirection.)59 b(Pro)s(cess)36 |
d37a4722 | 10617 | b(substitution)g(is)h(supp)s(orted)d(on)i(systems)g(that)150 |
3011048a | 10618 | 518 y(supp)s(ort)29 b(named)h(pip)s(es)f(\()p Fm(fif)n(o)p |
d37a4722 | 10619 | Fu(s\))h(or)h(the)f Ft(/dev/fd)f Fu(metho)s(d)h(of)g(naming)g(op)s(en)g |
3011048a | 10620 | (\014les.)275 647 y(When)36 b(a)m(v)-5 b(ailable,)40 |
d37a4722 | 10621 | b(pro)s(cess)c(substitution)h(is)f(p)s(erformed)f(sim)m(ultaneously)i |
3011048a CR |
10622 | (with)g(parameter)g(and)150 757 y(v)-5 b(ariable)31 b(expansion,)g |
10623 | (command)f(substitution,)g(and)g(arithmetic)i(expansion.)150 | |
10624 | 945 y Fk(3.5.7)63 b(W)-10 b(ord)41 b(Splitting)150 1092 | |
10625 | y Fu(The)30 b(shell)h(scans)g(the)g(results)f(of)h(parameter)g | |
f602026a | 10626 | (expansion,)g(command)g(substitution,)g(and)f(arithmetic)150 |
3011048a CR |
10627 | 1201 y(expansion)g(that)h(did)f(not)g(o)s(ccur)h(within)e(double)h |
10628 | (quotes)h(for)f(w)m(ord)g(splitting.)275 1330 y(The)e(shell)g(treats)i | |
6e51e0d0 | 10629 | (eac)m(h)g(c)m(haracter)g(of)f Ft($IFS)e Fu(as)i(a)g(delimiter,)h(and)e |
3011048a | 10630 | (splits)g(the)h(results)f(of)h(the)g(other)150 1440 y(expansions)22 |
1101193a | 10631 | b(in)m(to)i(w)m(ords)e(using)h(these)g(c)m(haracters)h(as)f(\014eld)f |
6e51e0d0 | 10632 | (terminators.)39 b(If)22 b Ft(IFS)g Fu(is)h(unset,)h(or)e(its)h(v)-5 |
3011048a | 10633 | b(alue)150 1549 y(is)36 b(exactly)j Ft(<space><tab><newline>)p |
6e51e0d0 | 10634 | Fu(,)32 b(the)37 b(default,)h(then)e(sequences)h(of)67 |
3011048a | 10635 | b Ft(<space>)p Fu(,)36 b Ft(<tab>)p Fu(,)h(and)150 1659 |
6e51e0d0 | 10636 | y Ft(<newline>)28 b Fu(at)k(the)f(b)s(eginning)f(and)h(end)f(of)h(the)g |
e230f997 | 10637 | (results)g(of)g(the)g(previous)g(expansions)f(are)i(ignored,)150 |
3011048a | 10638 | 1769 y(and)k(an)m(y)h(sequence)h(of)f Ft(IFS)f Fu(c)m(haracters)i(not)f |
1101193a | 10639 | (at)h(the)f(b)s(eginning)f(or)h(end)f(serv)m(es)h(to)h(delimit)f(w)m |
3011048a CR |
10640 | (ords.)150 1878 y(If)43 b Ft(IFS)f Fu(has)h(a)h(v)-5 |
10641 | b(alue)43 b(other)h(than)f(the)g(default,)k(then)c(sequences)h(of)f | |
10642 | (the)h(whitespace)f(c)m(haracters)150 1988 y Ft(space)p | |
10643 | Fu(,)29 b Ft(tab)p Fu(,)h(and)g Ft(newline)e Fu(are)j(ignored)g(at)g | |
10644 | (the)f(b)s(eginning)g(and)g(end)g(of)g(the)h(w)m(ord,)f(as)h(long)g(as) | |
10645 | g(the)150 2097 y(whitespace)c(c)m(haracter)h(is)f(in)f(the)g(v)-5 | |
967625cd | 10646 | b(alue)27 b(of)g Ft(IFS)e Fu(\(an)i Ft(IFS)e Fu(whitespace)i(c)m |
3011048a | 10647 | (haracter\).)42 b(An)m(y)26 b(c)m(haracter)i(in)150 2207 |
967625cd CR |
10648 | y Ft(IFS)c Fu(that)h(is)g(not)f Ft(IFS)g Fu(whitespace,)j(along)f(with) |
10649 | e(an)m(y)h(adjacen)m(t)h Ft(IFS)e Fu(whitespace)h(c)m(haracters,)i | |
3011048a | 10650 | (delimits)150 2317 y(a)k(\014eld.)40 b(A)31 b(sequence)g(of)f |
967625cd | 10651 | Ft(IFS)g Fu(whitespace)h(c)m(haracters)h(is)e(also)h(treated)h(as)f(a)f |
3011048a | 10652 | (delimiter.)42 b(If)30 b(the)g(v)-5 b(alue)150 2426 y(of)31 |
b52e30b8 | 10653 | b Ft(IFS)e Fu(is)h(n)m(ull,)h(no)f(w)m(ord)g(splitting)h(o)s(ccurs.)275 |
3011048a | 10654 | 2555 y(Explicit)21 b(n)m(ull)g(argumen)m(ts)g(\()p Ft("")g |
037a8b7f | 10655 | Fu(or)g Ft('')p Fu(\))f(are)h(retained)h(and)e(passed)g(to)i(commands)e |
3011048a | 10656 | (as)i(empt)m(y)f(strings.)150 2665 y(Unquoted)37 b(implicit)i(n)m(ull)f |
037a8b7f | 10657 | (argumen)m(ts,)i(resulting)d(from)g(the)h(expansion)g(of)g(parameters)f |
3011048a | 10658 | (that)i(ha)m(v)m(e)150 2774 y(no)32 b(v)-5 b(alues,)33 |
037a8b7f CR |
10659 | b(are)f(remo)m(v)m(ed.)47 b(If)32 b(a)g(parameter)h(with)e(no)h(v)-5 |
10660 | b(alue)33 b(is)f(expanded)f(within)h(double)f(quotes,)j(a)150 | |
3011048a | 10661 | 2884 y(n)m(ull)c(argumen)m(t)g(results)g(and)f(is)h(retained)g(and)f |
037a8b7f | 10662 | (passed)g(to)i(a)f(command)g(as)g(an)f(empt)m(y)i(string.)40 |
3011048a | 10663 | b(When)150 2993 y(a)f(quoted)f(n)m(ull)g(argumen)m(t)h(app)s(ears)e(as) |
b52e30b8 | 10664 | i(part)f(of)g(a)g(w)m(ord)g(whose)g(expansion)g(is)h(non-n)m(ull,)h |
3011048a | 10665 | (the)e(n)m(ull)150 3103 y(argumen)m(t)i(is)f(remo)m(v)m(ed.)69 |
d345f817 CR |
10666 | b(That)39 b(is,)j(the)e(w)m(ord)f Ft(-d'')f Fu(b)s(ecomes)i |
10667 | Ft(-d)e Fu(after)i(w)m(ord)f(splitting)h(and)f(n)m(ull)150 | |
3011048a | 10668 | 3213 y(argumen)m(t)31 b(remo)m(v)-5 b(al.)275 3342 y(Note)31 |
e59452c7 | 10669 | b(that)g(if)g(no)f(expansion)g(o)s(ccurs,)g(no)h(splitting)g(is)f(p)s |
3011048a CR |
10670 | (erformed.)150 3530 y Fk(3.5.8)63 b(Filename)41 b(Expansion)150 |
10671 | 3677 y Fu(After)30 b(w)m(ord)f(splitting,)i(unless)d(the)i | |
e59452c7 | 10672 | Ft(-f)f Fu(option)h(has)f(b)s(een)g(set)h(\(see)g(Section)h(4.3.1)g |
3011048a | 10673 | ([The)e(Set)h(Builtin],)150 3786 y(page)d(66\),)i(Bash)d(scans)h(eac)m |
e59452c7 CR |
10674 | (h)h(w)m(ord)e(for)g(the)h(c)m(haracters)g(`)p Ft(*)p |
10675 | Fu(',)h(`)p Ft(?)p Fu(',)g(and)e(`)p Ft([)p Fu('.)39 | |
3011048a | 10676 | b(If)26 b(one)h(of)g(these)f(c)m(haracters)150 3896 y(app)s(ears,)34 |
fc35c477 CR |
10677 | b(and)f(is)g(not)h(quoted,)h(then)e(the)h(w)m(ord)f(is)h(regarded)f(as) |
10678 | h(a)g Fr(pattern)p Fu(,)h(and)e(replaced)h(with)f(an)150 | |
3011048a | 10679 | 4006 y(alphab)s(etically)41 b(sorted)e(list)h(of)g(\014lenames)f(matc)m |
fc35c477 | 10680 | (hing)i(the)e(pattern)g(\(see)i(Section)f(3.5.8.1)i([P)m(attern)150 |
3011048a | 10681 | 4115 y(Matc)m(hing],)e(page)e(36\).)60 b(If)36 b(no)h(matc)m(hing)g |
fc35c477 | 10682 | (\014lenames)g(are)g(found,)g(and)f(the)g(shell)h(option)g |
3011048a | 10683 | Ft(nullglob)150 4225 y Fu(is)k(disabled,)i(the)f(w)m(ord)e(is)h(left)h |
fc35c477 | 10684 | (unc)m(hanged.)72 b(If)40 b(the)h Ft(nullglob)e Fu(option)i(is)g(set,)k |
3011048a | 10685 | (and)40 b(no)h(matc)m(hes)150 4334 y(are)c(found,)g(the)g(w)m(ord)f(is) |
fc35c477 | 10686 | g(remo)m(v)m(ed.)60 b(If)36 b(the)h Ft(failglob)d Fu(shell)j(option)g |
3011048a | 10687 | (is)g(set,)i(and)c(no)i(matc)m(hes)h(are)150 4444 y(found,)e(an)g |
fc35c477 | 10688 | (error)f(message)i(is)f(prin)m(ted)f(and)h(the)g(command)f(is)h(not)g |
3011048a | 10689 | (executed.)58 b(If)35 b(the)h(shell)g(option)150 4553 |
fc35c477 CR |
10690 | y Ft(nocaseglob)e Fu(is)j(enabled,)i(the)e(matc)m(h)h(is)f(p)s |
10691 | (erformed)e(without)i(regard)g(to)h(the)f(case)h(of)f(alphab)s(etic)150 | |
3011048a | 10692 | 4663 y(c)m(haracters.)275 4792 y(When)23 b(a)h(pattern)f(is)h(used)f |
fc35c477 CR |
10693 | (for)g(\014lename)h(expansion,)h(the)e(c)m(haracter)i(`)p |
10694 | Ft(.)p Fu(')f(at)g(the)g(start)g(of)g(a)g(\014lename)150 | |
3011048a | 10695 | 4902 y(or)f(immediately)i(follo)m(wing)g(a)f(slash)f(m)m(ust)h(b)s(e)f |
fc35c477 | 10696 | (matc)m(hed)h(explicitly)-8 b(,)27 b(unless)c(the)g(shell)h(option)g |
3011048a | 10697 | Ft(dotglob)150 5011 y Fu(is)36 b(set.)58 b(In)35 b(order)g(to)i(matc)m |
e59452c7 CR |
10698 | (h)f(the)g(\014lenames)g(`)p Ft(.)p Fu(')g(and)g(`)p |
10699 | Ft(..)p Fu(',)h(the)f(pattern)g(m)m(ust)g(b)s(egin)f(with)h(`)p | |
3011048a | 10700 | Ft(.)p Fu(')g(\(for)150 5121 y(example,)42 b(`)p Ft(.?)p |
5e6f45d9 CR |
10701 | Fu('\),)f(ev)m(en)f(if)f Ft(dotglob)d Fu(is)j(set.)67 |
10702 | b(If)38 b(the)h Ft(globskipdots)d Fu(shell)j(option)g(is)g(enabled,)i | |
3011048a | 10703 | (the)150 5230 y(\014lenames)33 b(`)p Ft(.)p Fu(')g(and)f(`)p |
5e6f45d9 CR |
10704 | Ft(..)p Fu(')h(are)g(nev)m(er)g(matc)m(hed,)h(ev)m(en)g(if)e(the)h |
10705 | (pattern)g(b)s(egins)f(with)h(a)g(`)p Ft(.)p Fu('.)48 | |
3011048a | 10706 | b(When)33 b(not)150 5340 y(matc)m(hing)e(\014lenames,)g(the)g(`)p |
5e6f45d9 | 10707 | Ft(.)p Fu(')f(c)m(haracter)i(is)f(not)f(treated)i(sp)s(ecially)-8 |
3011048a CR |
10708 | b(.)p eop end |
10709 | %%Page: 36 42 | |
10710 | TeXDict begin 36 41 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10711 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(36)275 299 | |
10712 | y(When)30 b(matc)m(hing)i(a)f(\014lename,)h(the)f(slash)f(c)m(haracter) | |
10713 | j(m)m(ust)d(alw)m(a)m(ys)j(b)s(e)d(matc)m(hed)h(explicitly)i(b)m(y)e(a) | |
10714 | 150 408 y(slash)d(in)f(the)h(pattern,)h(but)e(in)h(other)g(matc)m(hing) | |
10715 | h(con)m(texts)h(it)e(can)g(b)s(e)g(matc)m(hed)g(b)m(y)g(a)g(sp)s(ecial) | |
10716 | h(pattern)150 518 y(c)m(haracter)j(as)f(describ)s(ed)e(b)s(elo)m(w)h | |
10717 | (\(see)i(Section)f(3.5.8.1)i([P)m(attern)e(Matc)m(hing],)i(page)e | |
10718 | (36\).)275 647 y(See)d(the)g(description)g(of)g Ft(shopt)e | |
10719 | Fu(in)i(Section)g(4.3.2)i([The)e(Shopt)f(Builtin],)i(page)g(70,)g(for)f | |
10720 | (a)g(descrip-)150 757 y(tion)j(of)f(the)h Ft(nocaseglob)p | |
10721 | Fu(,)d Ft(nullglob)p Fu(,)g Ft(globskipdots)p Fu(,)f | |
10722 | Ft(failglob)p Fu(,)i(and)h Ft(dotglob)e Fu(options.)275 | |
10723 | 886 y(The)36 b Ft(GLOBIGNORE)d Fu(shell)k(v)-5 b(ariable)37 | |
e59452c7 | 10724 | b(ma)m(y)g(b)s(e)f(used)g(to)h(restrict)g(the)g(set)g(of)g(\014le)f |
3011048a | 10725 | (names)h(matc)m(hing)150 995 y(a)42 b(pattern.)74 b(If)41 |
e59452c7 | 10726 | b Ft(GLOBIGNORE)e Fu(is)i(set,)k(eac)m(h)e(matc)m(hing)f(\014le)g(name) |
3011048a | 10727 | f(that)h(also)h(matc)m(hes)f(one)g(of)g(the)150 1105 |
e59452c7 CR |
10728 | y(patterns)34 b(in)g Ft(GLOBIGNORE)d Fu(is)k(remo)m(v)m(ed)g(from)f |
10729 | (the)g(list)h(of)f(matc)m(hes.)54 b(If)33 b(the)i Ft(nocaseglob)c | |
3011048a | 10730 | Fu(option)k(is)150 1214 y(set,)c(the)e(matc)m(hing)i(against)g(the)f |
e59452c7 | 10731 | (patterns)f(in)h Ft(GLOBIGNORE)c Fu(is)k(p)s(erformed)e(without)i |
3011048a | 10732 | (regard)f(to)i(case.)150 1324 y(The)d(\014lenames)h Ft(.)g |
e59452c7 CR |
10733 | Fu(and)f Ft(..)h Fu(are)g(alw)m(a)m(ys)h(ignored)f(when)f |
10734 | Ft(GLOBIGNORE)f Fu(is)i(set)g(and)f(not)h(n)m(ull.)41 | |
3011048a | 10735 | b(Ho)m(w)m(ev)m(er,)150 1433 y(setting)30 b Ft(GLOBIGNORE)d |
e59452c7 | 10736 | Fu(to)j(a)f(non-n)m(ull)g(v)-5 b(alue)30 b(has)f(the)g(e\013ect)i(of)f |
3011048a CR |
10737 | (enabling)f(the)h Ft(dotglob)d Fu(shell)i(option,)150 |
10738 | 1543 y(so)j(all)h(other)f(\014lenames)g(b)s(eginning)f(with)h(a)g(`)p | |
5e6f45d9 | 10739 | Ft(.)p Fu(')g(will)h(matc)m(h.)46 b(T)-8 b(o)32 b(get)h(the)f(old)g(b)s |
3011048a | 10740 | (eha)m(vior)g(of)h(ignoring)150 1653 y(\014lenames)c(b)s(eginning)f |
5e6f45d9 CR |
10741 | (with)h(a)h(`)p Ft(.)p Fu(',)f(mak)m(e)h(`)p Ft(.*)p |
10742 | Fu(')f(one)h(of)f(the)g(patterns)g(in)g Ft(GLOBIGNORE)p | |
3011048a CR |
10743 | Fu(.)37 b(The)29 b Ft(dotglob)150 1762 y Fu(option)i(is)f(disabled)g |
10744 | (when)g Ft(GLOBIGNORE)d Fu(is)k(unset.)150 1950 y Fk(3.5.8.1)63 | |
10745 | b(P)m(attern)40 b(Matc)m(hing)150 2097 y Fu(An)m(y)24 | |
5e6f45d9 CR |
10746 | b(c)m(haracter)h(that)f(app)s(ears)f(in)g(a)h(pattern,)i(other)e(than)f |
10747 | (the)h(sp)s(ecial)g(pattern)g(c)m(haracters)h(describ)s(ed)150 | |
3011048a | 10748 | 2207 y(b)s(elo)m(w,)31 b(matc)m(hes)g(itself.)42 b(The)29 |
5e6f45d9 | 10749 | b Fm(nul)h Fu(c)m(haracter)i(ma)m(y)e(not)h(o)s(ccur)f(in)g(a)h |
3011048a | 10750 | (pattern.)40 b(A)31 b(bac)m(kslash)g(escap)s(es)150 2317 |
5e6f45d9 CR |
10751 | y(the)38 b(follo)m(wing)g(c)m(haracter;)43 b(the)37 b(escaping)i(bac)m |
10752 | (kslash)e(is)h(discarded)f(when)f(matc)m(hing.)63 b(The)36 | |
3011048a | 10753 | b(sp)s(ecial)150 2426 y(pattern)30 b(c)m(haracters)i(m)m(ust)f(b)s(e)e |
5e6f45d9 | 10754 | (quoted)i(if)f(they)h(are)f(to)i(b)s(e)d(matc)m(hed)i(literally)-8 |
3011048a CR |
10755 | b(.)275 2555 y(The)29 b(sp)s(ecial)i(pattern)g(c)m(haracters)h(ha)m(v)m |
10756 | (e)f(the)g(follo)m(wing)h(meanings:)150 2703 y Ft(*)432 | |
5e6f45d9 CR |
10757 | b Fu(Matc)m(hes)31 b(an)m(y)e(string,)h(including)f(the)g(n)m(ull)g |
10758 | (string.)41 b(When)29 b(the)g Ft(globstar)e Fu(shell)i(option)630 | |
3011048a | 10759 | 2813 y(is)37 b(enabled,)h(and)e(`)p Ft(*)p Fu(')h(is)g(used)f(in)g(a)h |
e230f997 | 10760 | (\014lename)g(expansion)g(con)m(text,)j(t)m(w)m(o)e(adjacen)m(t)g(`)p |
3011048a | 10761 | Ft(*)p Fu('s)630 2923 y(used)f(as)g(a)h(single)g(pattern)g(will)f(matc) |
e230f997 | 10762 | m(h)i(all)f(\014les)f(and)g(zero)h(or)g(more)f(directories)i(and)630 |
3011048a | 10763 | 3032 y(sub)s(directories.)g(If)25 b(follo)m(w)m(ed)j(b)m(y)e(a)g(`)p |
6e51e0d0 | 10764 | Ft(/)p Fu(',)h(t)m(w)m(o)g(adjacen)m(t)h(`)p Ft(*)p Fu('s)e(will)g |
3011048a CR |
10765 | (matc)m(h)h(only)f(directories)630 3142 y(and)k(sub)s(directories.)150 |
10766 | 3290 y Ft(?)432 b Fu(Matc)m(hes)32 b(an)m(y)f(single)g(c)m(haracter.) | |
10767 | 150 3438 y Ft([...)o(])241 b Fu(Matc)m(hes)27 b(an)m(y)e(one)g(of)g | |
e59452c7 | 10768 | (the)g(enclosed)g(c)m(haracters.)41 b(A)25 b(pair)f(of)h(c)m(haracters) |
3011048a | 10769 | i(separated)e(b)m(y)g(a)630 3548 y(h)m(yphen)k(denotes)i(a)g |
6e51e0d0 | 10770 | Fr(range)g(expression)p Fu(;)f(an)m(y)h(c)m(haracter)h(that)f(falls)g |
3011048a | 10771 | (b)s(et)m(w)m(een)g(those)g(t)m(w)m(o)630 3657 y(c)m(haracters,)d |
ad4aef08 | 10772 | (inclusiv)m(e,)f(using)d(the)h(curren)m(t)f(lo)s(cale's)j(collating)g |
3011048a | 10773 | (sequence)e(and)f(c)m(haracter)630 3767 y(set,)31 b(is)f(matc)m(hed.)42 |
ad4aef08 | 10774 | b(If)30 b(the)g(\014rst)g(c)m(haracter)i(follo)m(wing)g(the)e(`)p |
6e51e0d0 | 10775 | Ft([)p Fu(')h(is)f(a)h(`)p Ft(!)p Fu(')f(or)g(a)h(`)p |
3011048a | 10776 | Ft(^)p Fu(')g(then)f(an)m(y)630 3877 y(c)m(haracter)c(not)f(enclosed)g |
6e51e0d0 | 10777 | (is)g(matc)m(hed.)40 b(A)25 b(`)p Fq(\000)p Fu(')f(ma)m(y)i(b)s(e)e |
3011048a | 10778 | (matc)m(hed)h(b)m(y)f(including)h(it)g(as)g(the)630 3986 |
ad4aef08 | 10779 | y(\014rst)32 b(or)h(last)h(c)m(haracter)h(in)e(the)g(set.)50 |
6e51e0d0 | 10780 | b(A)33 b(`)p Ft(])p Fu(')g(ma)m(y)h(b)s(e)e(matc)m(hed)i(b)m(y)f |
3011048a | 10781 | (including)g(it)g(as)h(the)630 4096 y(\014rst)25 b(c)m(haracter)i(in)e |
ad4aef08 | 10782 | (the)h(set.)40 b(The)25 b(sorting)h(order)f(of)h(c)m(haracters)h(in)f |
3011048a | 10783 | (range)g(expressions)f(is)630 4205 y(determined)h(b)m(y)h(the)g(curren) |
fc527055 | 10784 | m(t)f(lo)s(cale)j(and)d(the)h(v)-5 b(alues)27 b(of)g(the)g |
3011048a CR |
10785 | Ft(LC_COLLATE)d Fu(and)i Ft(LC_ALL)630 4315 y Fu(shell)31 |
10786 | b(v)-5 b(ariables,)31 b(if)f(set.)630 4444 y(F)-8 b(or)34 | |
74d0116b | 10787 | b(example,)g(in)f(the)g(default)g(C)f(lo)s(cale,)k(`)p |
6e51e0d0 | 10788 | Ft([a-dx-z])p Fu(')31 b(is)i(equiv)-5 b(alen)m(t)34 b(to)g(`)p |
3011048a | 10789 | Ft([abcdxyz])p Fu('.)630 4554 y(Man)m(y)68 b(lo)s(cales)h(sort)f(c)m |
74d0116b | 10790 | (haracters)h(in)e(dictionary)i(order,)76 b(and)67 b(in)g(these)h(lo)s |
3011048a | 10791 | (cales)630 4663 y(`)p Ft([a-dx-z])p Fu(')36 b(is)i(t)m(ypically)i(not)e |
12beeabf | 10792 | (equiv)-5 b(alen)m(t)39 b(to)g(`)p Ft([abcdxyz])p Fu(';)g(it)g(migh)m |
3011048a | 10793 | (t)f(b)s(e)f(equiv)-5 b(alen)m(t)630 4773 y(to)34 b(`)p |
12beeabf CR |
10794 | Ft([aBbCcDdxXyYz])p Fu(',)c(for)j(example.)49 b(T)-8 |
10795 | b(o)33 b(obtain)h(the)f(traditional)h(in)m(terpretation)h(of)630 | |
3011048a | 10796 | 4882 y(ranges)e(in)f(brac)m(k)m(et)i(expressions,)g(y)m(ou)f(can)g |
12beeabf | 10797 | (force)g(the)g(use)f(of)h(the)g(C)f(lo)s(cale)i(b)m(y)f(setting)630 |
3011048a | 10798 | 4992 y(the)c Ft(LC_COLLATE)e Fu(or)i Ft(LC_ALL)f Fu(en)m(vironmen)m(t)i |
12beeabf | 10799 | (v)-5 b(ariable)30 b(to)g(the)f(v)-5 b(alue)30 b(`)p |
3011048a CR |
10800 | Ft(C)p Fu(',)g(or)f(enable)h(the)630 5101 y Ft(globasciiranges)c |
10801 | Fu(shell)31 b(option.)630 5230 y(Within)23 b(`)p Ft([)p | |
12beeabf CR |
10802 | Fu(')h(and)e(`)p Ft(])p Fu(',)j Fr(c)m(haracter)g(classes)j |
10803 | Fu(can)c(b)s(e)e(sp)s(eci\014ed)h(using)f(the)i(syn)m(tax)f | |
3011048a | 10804 | Ft([:)p Fr(class)t Ft(:])p Fu(,)630 5340 y(where)30 b |
12beeabf | 10805 | Fr(class)35 b Fu(is)30 b(one)h(of)f(the)h(follo)m(wing)h(classes)f |
3011048a CR |
10806 | (de\014ned)e(in)h(the)h Fm(posix)f Fu(standard:)p eop |
10807 | end | |
10808 | %%Page: 37 43 | |
10809 | TeXDict begin 37 42 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10810 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(37)870 299 | |
091c6bc4 | 10811 | y Ft(alnum)142 b(alpha)g(ascii)f(blank)h(cntrl)g(digit)g(graph)g(lower) |
3011048a CR |
10812 | 870 408 y(print)g(punct)g(space)f(upper)h(word)190 b(xdigit)630 |
10813 | 543 y Fu(A)42 b(c)m(haracter)h(class)f(matc)m(hes)h(an)m(y)f(c)m | |
d37a4722 | 10814 | (haracter)h(b)s(elonging)f(to)g(that)g(class.)75 b(The)41 |
3011048a CR |
10815 | b Ft(word)630 653 y Fu(c)m(haracter)32 b(class)f(matc)m(hes)h(letters,) |
10816 | f(digits,)h(and)d(the)i(c)m(haracter)h(`)p Ft(_)p Fu('.)630 | |
10817 | 788 y(Within)25 b(`)p Ft([)p Fu(')f(and)g(`)p Ft(])p | |
10818 | Fu(',)i(an)e Fr(equiv)-5 b(alence)26 b(class)j Fu(can)24 | |
10819 | b(b)s(e)g(sp)s(eci\014ed)g(using)g(the)g(syn)m(tax)h | |
10820 | Ft([=)p Fr(c)6 b Ft(=])p Fu(,)630 897 y(whic)m(h)29 b(matc)m(hes)i(all) | |
10821 | f(c)m(haracters)h(with)e(the)h(same)g(collation)h(w)m(eigh)m(t)g(\(as)f | |
10822 | (de\014ned)e(b)m(y)i(the)630 1007 y(curren)m(t)g(lo)s(cale\))j(as)d | |
10823 | (the)h(c)m(haracter)h Fr(c)p Fu(.)630 1142 y(Within)22 | |
10824 | b(`)p Ft([)p Fu(')f(and)g(`)p Ft(])p Fu(',)j(the)d(syn)m(tax)h | |
10825 | Ft([.)p Fr(sym)m(b)s(ol)t Ft(.])e Fu(matc)m(hes)i(the)g(collating)i | |
10826 | (sym)m(b)s(ol)d Fr(sym)m(b)s(ol)p Fu(.)275 1303 y(If)i(the)g | |
10827 | Ft(extglob)f Fu(shell)h(option)h(is)g(enabled)f(using)g(the)h | |
10828 | Ft(shopt)e Fu(builtin,)i(the)g(shell)f(recognizes)j(sev)m(eral)150 | |
10829 | 1412 y(extended)i(pattern)f(matc)m(hing)i(op)s(erators.)40 | |
e59452c7 | 10830 | b(In)26 b(the)i(follo)m(wing)h(description,)g(a)e Fr(pattern-list)k |
3011048a CR |
10831 | Fu(is)d(a)g(list)g(of)150 1522 y(one)23 b(or)f(more)h(patterns)g |
10832 | (separated)g(b)m(y)f(a)h(`)p Ft(|)p Fu('.)38 b(When)22 | |
10833 | b(matc)m(hing)i(\014lenames,)g(the)f Ft(dotglob)e Fu(shell)h(option)150 | |
10834 | 1631 y(determines)h(the)h(set)g(of)g(\014lenames)f(that)h(are)g | |
10835 | (tested,)i(as)d(describ)s(ed)g(ab)s(o)m(v)m(e.)39 b(Comp)s(osite)24 | |
10836 | b(patterns)f(ma)m(y)150 1741 y(b)s(e)30 b(formed)g(using)f(one)i(or)f | |
10837 | (more)h(of)g(the)f(follo)m(wing)i(sub-patterns:)150 1901 | |
10838 | y Ft(?\()p Fj(pattern-list)p Ft(\))630 2011 y Fu(Matc)m(hes)g(zero)f | |
10839 | (or)g(one)f(o)s(ccurrence)h(of)f(the)h(giv)m(en)g(patterns.)150 | |
10840 | 2171 y Ft(*\()p Fj(pattern-list)p Ft(\))630 2281 y Fu(Matc)m(hes)h | |
10841 | (zero)f(or)g(more)f(o)s(ccurrences)h(of)f(the)h(giv)m(en)g(patterns.) | |
10842 | 150 2441 y Ft(+\()p Fj(pattern-list)p Ft(\))630 2551 | |
10843 | y Fu(Matc)m(hes)h(one)f(or)f(more)h(o)s(ccurrences)f(of)h(the)f(giv)m | |
10844 | (en)i(patterns.)150 2711 y Ft(@\()p Fj(pattern-list)p | |
10845 | Ft(\))630 2820 y Fu(Matc)m(hes)g(one)f(of)f(the)h(giv)m(en)g(patterns.) | |
10846 | 150 2981 y Ft(!\()p Fj(pattern-list)p Ft(\))630 3090 | |
10847 | y Fu(Matc)m(hes)h(an)m(ything)f(except)g(one)g(of)f(the)h(giv)m(en)g | |
10848 | (patterns.)275 3251 y(When)26 b(matc)m(hing)i(\014lenames,)g(the)f | |
10849 | Ft(dotglob)e Fu(shell)i(option)h(determines)f(the)g(set)g(of)g | |
10850 | (\014lenames)g(that)150 3360 y(are)34 b(tested:)47 b(when)33 | |
e59452c7 | 10851 | b Ft(dotglob)e Fu(is)i(enabled,)i(the)e(set)h(of)g(\014lenames)f |
3011048a | 10852 | (includes)g(all)h(\014les)g(b)s(eginning)e(with)150 3470 |
e59452c7 CR |
10853 | y(`)p Ft(.)p Fu(',)d(but)e(the)g(\014lenames)h(`)p Ft(.)p |
10854 | Fu(')g(and)f(`)p Ft(..)p Fu(')g(m)m(ust)h(b)s(e)f(matc)m(hed)h(b)m(y)g | |
10855 | (a)g(pattern)g(or)f(sub-pattern)g(that)h(b)s(egins)150 | |
3011048a | 10856 | 3580 y(with)33 b(a)g(dot;)j(when)c(it)h(is)h(disabled,)f(the)h(set)g |
e59452c7 | 10857 | (do)s(es)e(not)i(include)f(an)m(y)g(\014lenames)g(b)s(eginning)g(with)g |
3011048a | 10858 | (\\.")150 3689 y(unless)24 b(the)g(pattern)h(or)f(sub-pattern)g(b)s |
e59452c7 CR |
10859 | (egins)g(with)g(a)g(`)p Ft(.)p Fu('.)39 b(As)25 b(ab)s(o)m(v)m(e,)i(`)p |
10860 | Ft(.)p Fu(')d(only)h(has)f(a)h(sp)s(ecial)g(meaning)150 | |
3011048a | 10861 | 3799 y(when)k(matc)m(hing)j(\014lenames.)275 3934 y(Complicated)41 |
e59452c7 | 10862 | b(extended)f(pattern)g(matc)m(hing)h(against)h(long)f(strings)f(is)g |
3011048a | 10863 | (slo)m(w,)k(esp)s(ecially)d(when)150 4044 y(the)29 b(patterns)g(con)m |
e59452c7 | 10864 | (tain)i(alternations)f(and)f(the)g(strings)g(con)m(tain)h(m)m(ultiple)g |
3011048a | 10865 | (matc)m(hes.)42 b(Using)29 b(separate)150 4153 y(matc)m(hes)38 |
e59452c7 | 10866 | b(against)g(shorter)e(strings,)i(or)f(using)f(arra)m(ys)h(of)g(strings) |
3011048a CR |
10867 | f(instead)h(of)g(a)g(single)g(long)h(string,)150 4263 |
10868 | y(ma)m(y)31 b(b)s(e)f(faster.)150 4463 y Fk(3.5.9)63 | |
10869 | b(Quote)41 b(Remo)m(v)-7 b(al)150 4610 y Fu(After)32 | |
e59452c7 CR |
10870 | b(the)g(preceding)g(expansions,)h(all)f(unquoted)f(o)s(ccurrences)h(of) |
10871 | g(the)h(c)m(haracters)g(`)p Ft(\\)p Fu(',)g(`)p Ft(')p | |
3011048a | 10872 | Fu(',)f(and)g(`)p Ft(")p Fu(')150 4719 y(that)f(did)f(not)g(result)g |
e59452c7 | 10873 | (from)g(one)h(of)g(the)f(ab)s(o)m(v)m(e)i(expansions)e(are)h(remo)m(v)m |
3011048a | 10874 | (ed.)150 4961 y Fs(3.6)68 b(Redirections)150 5121 y Fu(Before)32 |
d37a4722 CR |
10875 | b(a)f(command)f(is)h(executed,)h(its)f(input)e(and)h(output)h(ma)m(y)g |
10876 | (b)s(e)f Fr(redirected)k Fu(using)c(a)i(sp)s(ecial)f(no-)150 | |
3011048a | 10877 | 5230 y(tation)d(in)m(terpreted)f(b)m(y)f(the)h(shell.)40 |
e59452c7 | 10878 | b Fr(Redirection)27 b Fu(allo)m(ws)h(commands')f(\014le)f(handles)g(to) |
3011048a | 10879 | i(b)s(e)e(duplicated,)150 5340 y(op)s(ened,)i(closed,)i(made)e(to)h |
e59452c7 | 10880 | (refer)f(to)h(di\013eren)m(t)f(\014les,)h(and)f(can)g(c)m(hange)h(the)g |
3011048a CR |
10881 | (\014les)f(the)g(command)g(reads)p eop end |
10882 | %%Page: 38 44 | |
10883 | TeXDict begin 38 43 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10884 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(38)150 299 | |
10885 | y(from)39 b(and)g(writes)h(to.)69 b(Redirection)40 b(ma)m(y)g(also)h(b) | |
10886 | s(e)e(used)g(to)h(mo)s(dify)f(\014le)g(handles)g(in)g(the)h(curren)m(t) | |
10887 | 150 408 y(shell)e(execution)h(en)m(vironmen)m(t.)65 b(The)37 | |
d37a4722 | 10888 | b(follo)m(wing)j(redirection)f(op)s(erators)f(ma)m(y)g(precede)h(or)f |
3011048a | 10889 | (app)s(ear)150 518 y(an)m(ywhere)30 b(within)f(a)h(simple)f(command)h |
d37a4722 | 10890 | (or)f(ma)m(y)i(follo)m(w)g(a)f(command.)40 b(Redirections)30 |
3011048a CR |
10891 | b(are)g(pro)s(cessed)150 628 y(in)g(the)h(order)f(they)g(app)s(ear,)g |
10892 | (from)g(left)h(to)g(righ)m(t.)275 767 y(Eac)m(h)45 b(redirection)h | |
d37a4722 | 10893 | (that)f(ma)m(y)h(b)s(e)e(preceded)g(b)m(y)h(a)h(\014le)f(descriptor)f |
3011048a CR |
10894 | (n)m(um)m(b)s(er)g(ma)m(y)h(instead)h(b)s(e)150 877 y(preceded)41 |
10895 | b(b)m(y)g(a)h(w)m(ord)f(of)g(the)h(form)f Fi({)p Fr(v)-5 | |
10896 | b(arname)5 b Fi(})p Fu(.)74 b(In)41 b(this)g(case,)k(for)c(eac)m(h)i | |
10897 | (redirection)f(op)s(erator)150 986 y(except)37 b Ft(>)p | |
10898 | Fu(&-)e(and)g Ft(<)p Fu(&-,)i(the)f(shell)g(will)g(allo)s(cate)j(a)d | |
10899 | (\014le)g(descriptor)f(greater)i(than)f(10)g(and)f(assign)h(it)150 | |
10900 | 1096 y(to)e Fi({)p Fr(v)-5 b(arname)5 b Fi(})p Fu(.)52 | |
10901 | b(If)33 b Ft(>)p Fu(&-)g(or)h Ft(<)p Fu(&-)f(is)g(preceded)h(b)m(y)f | |
10902 | Fi({)p Fr(v)-5 b(arname)5 b Fi(})p Fu(,)36 b(the)e(v)-5 | |
e6983002 | 10903 | b(alue)34 b(of)f Fr(v)-5 b(arname)39 b Fu(de\014nes)33 |
3011048a | 10904 | b(the)150 1206 y(\014le)e(descriptor)g(to)h(close.)43 |
e6983002 CR |
10905 | b(If)31 b Fi({)p Fr(v)-5 b(arname)5 b Fi(})32 b Fu(is)f(supplied,)f |
10906 | (the)h(redirection)g(p)s(ersists)f(b)s(ey)m(ond)h(the)g(scop)s(e)150 | |
3011048a CR |
10907 | 1315 y(of)42 b(the)f(command,)j(allo)m(wing)f(the)f(shell)g(programmer) |
10908 | f(to)h(manage)g(the)g(\014le)f(descriptor's)h(lifetime)150 | |
10909 | 1425 y(man)m(ually)-8 b(.)41 b(The)29 b Ft(varredir_close)c | |
e59452c7 | 10910 | Fu(shell)k(option)g(manages)h(this)f(b)s(eha)m(vior)g(\(see)h(Section)f |
3011048a CR |
10911 | (4.3.2)i([The)150 1534 y(Shopt)f(Builtin],)h(page)g(70\).)275 |
10912 | 1674 y(In)c(the)i(follo)m(wing)h(descriptions,)g(if)e(the)h(\014le)g | |
e59452c7 | 10913 | (descriptor)f(n)m(um)m(b)s(er)g(is)g(omitted,)i(and)f(the)f(\014rst)g |
3011048a | 10914 | (c)m(har-)150 1784 y(acter)42 b(of)f(the)g(redirection)g(op)s(erator)g |
e59452c7 | 10915 | (is)g(`)p Ft(<)p Fu(',)i(the)e(redirection)g(refers)g(to)g(the)g |
3011048a | 10916 | (standard)f(input)f(\(\014le)150 1893 y(descriptor)33 |
e59452c7 CR |
10917 | b(0\).)49 b(If)33 b(the)g(\014rst)f(c)m(haracter)i(of)g(the)f |
10918 | (redirection)g(op)s(erator)h(is)f(`)p Ft(>)p Fu(',)h(the)f(redirection) | |
3011048a CR |
10919 | g(refers)150 2003 y(to)e(the)g(standard)e(output)h(\(\014le)h |
10920 | (descriptor)f(1\).)275 2142 y(The)h(w)m(ord)h(follo)m(wing)i(the)f | |
e59452c7 | 10921 | (redirection)g(op)s(erator)f(in)g(the)h(follo)m(wing)h(descriptions,)f |
3011048a | 10922 | (unless)e(other-)150 2252 y(wise)21 b(noted,)i(is)e(sub)5 |
e59452c7 | 10923 | b(jected)21 b(to)h(brace)f(expansion,)i(tilde)f(expansion,)h(parameter) |
3011048a | 10924 | e(expansion,)i(command)150 2362 y(substitution,)31 b(arithmetic)h |
e59452c7 | 10925 | (expansion,)f(quote)h(remo)m(v)-5 b(al,)33 b(\014lename)e(expansion,)g |
3011048a | 10926 | (and)f(w)m(ord)h(splitting.)150 2471 y(If)f(it)h(expands)e(to)i(more)g |
e59452c7 | 10927 | (than)f(one)h(w)m(ord,)f(Bash)h(rep)s(orts)e(an)h(error.)275 |
3011048a | 10928 | 2611 y(Note)h(that)g(the)g(order)f(of)g(redirections)h(is)g |
e59452c7 | 10929 | (signi\014can)m(t.)41 b(F)-8 b(or)31 b(example,)h(the)e(command)390 |
3011048a | 10930 | 2751 y Ft(ls)47 b(>)h Fj(dirlist)d Ft(2>&1)150 2890 y |
e59452c7 CR |
10931 | Fu(directs)28 b(b)s(oth)f(standard)g(output)g(\(\014le)h(descriptor)f |
10932 | (1\))i(and)e(standard)f(error)i(\(\014le)g(descriptor)f(2\))h(to)h(the) | |
3011048a CR |
10933 | 150 3000 y(\014le)h Fr(dirlist)p Fu(,)h(while)f(the)h(command)390 |
10934 | 3139 y Ft(ls)47 b(2>&1)g(>)g Fj(dirlist)150 3279 y Fu(directs)28 | |
e230f997 CR |
10935 | b(only)f(the)h(standard)e(output)i(to)g(\014le)f Fr(dirlist)p |
10936 | Fu(,)h(b)s(ecause)g(the)f(standard)g(error)g(w)m(as)h(made)f(a)h(cop)m | |
3011048a | 10937 | (y)150 3389 y(of)j(the)f(standard)g(output)g(b)s(efore)g(the)g |
e230f997 | 10938 | (standard)g(output)g(w)m(as)g(redirected)h(to)g Fr(dirlist)p |
3011048a | 10939 | Fu(.)275 3528 y(Bash)26 b(handles)f(sev)m(eral)j(\014lenames)e(sp)s |
e230f997 | 10940 | (ecially)h(when)f(they)g(are)g(used)g(in)g(redirections,)i(as)e |
3011048a | 10941 | (describ)s(ed)150 3638 y(in)38 b(the)h(follo)m(wing)h(table.)66 |
e230f997 | 10942 | b(If)38 b(the)h(op)s(erating)g(system)f(on)h(whic)m(h)f(Bash)h(is)f |
3011048a | 10943 | (running)f(pro)m(vides)h(these)150 3747 y(sp)s(ecial)27 |
e230f997 CR |
10944 | b(\014les,)g(bash)e(will)i(use)f(them;)h(otherwise)g(it)f(will)h(em)m |
10945 | (ulate)h(them)e(in)m(ternally)h(with)f(the)g(b)s(eha)m(vior)150 | |
3011048a CR |
10946 | 3857 y(describ)s(ed)j(b)s(elo)m(w.)150 4024 y Ft(/dev/fd/)p |
10947 | Fj(fd)630 4134 y Fu(If)h Fr(fd)j Fu(is)d(a)h(v)-5 b(alid)31 | |
e59452c7 | 10948 | b(in)m(teger,)h(\014le)e(descriptor)h Fr(fd)i Fu(is)d(duplicated.)150 |
3011048a CR |
10949 | 4298 y Ft(/dev/stdin)630 4408 y Fu(File)i(descriptor)e(0)h(is)f |
10950 | (duplicated.)150 4573 y Ft(/dev/stdout)630 4682 y Fu(File)i(descriptor) | |
10951 | e(1)h(is)f(duplicated.)150 4847 y Ft(/dev/stderr)630 | |
10952 | 4956 y Fu(File)i(descriptor)e(2)h(is)f(duplicated.)150 | |
10953 | 5121 y Ft(/dev/tcp/)p Fj(host)p Ft(/)p Fj(port)630 5230 | |
e59452c7 CR |
10954 | y Fu(If)41 b Fr(host)i Fu(is)f(a)g(v)-5 b(alid)41 b(hostname)h(or)f(In) |
10955 | m(ternet)h(address,)i(and)c Fr(p)s(ort)j Fu(is)f(an)f(in)m(teger)i(p)s | |
3011048a | 10956 | (ort)630 5340 y(n)m(um)m(b)s(er)23 b(or)i(service)h(name,)g(Bash)f |
e6983002 | 10957 | (attempts)h(to)f(op)s(en)f(the)h(corresp)s(onding)f(TCP)g(so)s(c)m(k)m |
3011048a | 10958 | (et.)p eop end |
e59452c7 CR |
10959 | %%Page: 39 45 |
10960 | TeXDict begin 39 44 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
10961 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(39)150 299 | |
3011048a CR |
10962 | y Ft(/dev/udp/)p Fj(host)p Ft(/)p Fj(port)630 408 y Fu(If)41 |
10963 | b Fr(host)i Fu(is)f(a)g(v)-5 b(alid)41 b(hostname)h(or)f(In)m(ternet)h | |
10964 | (address,)i(and)c Fr(p)s(ort)j Fu(is)f(an)f(in)m(teger)i(p)s(ort)630 | |
10965 | 518 y(n)m(um)m(b)s(er)23 b(or)h(service)h(name,)h(Bash)e(attempts)h(to) | |
10966 | g(op)s(en)f(the)g(corresp)s(onding)f(UDP)i(so)s(c)m(k)m(et.)275 | |
10967 | 684 y(A)30 b(failure)h(to)g(op)s(en)e(or)i(create)h(a)e(\014le)h | |
10968 | (causes)g(the)f(redirection)h(to)g(fail.)275 822 y(Redirections)f | |
10969 | (using)e(\014le)i(descriptors)f(greater)h(than)f(9)h(should)e(b)s(e)h | |
10970 | (used)f(with)h(care,)h(as)g(they)f(ma)m(y)150 932 y(con\015ict)i(with)f | |
10971 | (\014le)h(descriptors)f(the)g(shell)h(uses)f(in)m(ternally)-8 | |
10972 | b(.)150 1135 y Fk(3.6.1)63 b(Redirecting)40 b(Input)150 | |
10973 | 1282 y Fu(Redirection)35 b(of)f(input)f(causes)i(the)f(\014le)g(whose)g | |
10974 | (name)g(results)g(from)g(the)g(expansion)g(of)g Fr(w)m(ord)k | |
10975 | Fu(to)d(b)s(e)150 1392 y(op)s(ened)d(for)g(reading)g(on)g(\014le)h | |
10976 | (descriptor)f Ft(n)p Fu(,)h(or)f(the)g(standard)g(input)f(\(\014le)i | |
10977 | (descriptor)f(0\))h(if)f Ft(n)g Fu(is)h(not)150 1501 | |
10978 | y(sp)s(eci\014ed.)275 1640 y(The)c(general)j(format)e(for)h | |
10979 | (redirecting)g(input)e(is:)390 1778 y Ft([)p Fj(n)p Ft(]<)p | |
10980 | Fj(word)150 1982 y Fk(3.6.2)63 b(Redirecting)40 b(Output)150 | |
10981 | 2129 y Fu(Redirection)31 b(of)g(output)f(causes)h(the)f(\014le)h(whose) | |
10982 | f(name)g(results)h(from)e(the)i(expansion)f(of)h Fr(w)m(ord)i | |
10983 | Fu(to)f(b)s(e)150 2238 y(op)s(ened)d(for)g(writing)g(on)g(\014le)h | |
10984 | (descriptor)f Fr(n)p Fu(,)g(or)g(the)h(standard)e(output)h(\(\014le)h | |
10985 | (descriptor)f(1\))h(if)g Fr(n)e Fu(is)i(not)150 2348 | |
10986 | y(sp)s(eci\014ed.)40 b(If)30 b(the)g(\014le)h(do)s(es)f(not)h(exist)g | |
10987 | (it)g(is)f(created;)i(if)e(it)h(do)s(es)f(exist)h(it)g(is)g(truncated)f | |
10988 | (to)h(zero)g(size.)275 2486 y(The)e(general)j(format)e(for)h | |
10989 | (redirecting)g(output)f(is:)390 2625 y Ft([)p Fj(n)p | |
10990 | Ft(]>[|])p Fj(word)275 2764 y Fu(If)g(the)h(redirection)g(op)s(erator)g | |
10991 | (is)g(`)p Ft(>)p Fu(',)g(and)f(the)h Ft(noclobber)d Fu(option)j(to)g | |
10992 | (the)g Ft(set)f Fu(builtin)g(has)h(b)s(een)150 2873 y(enabled,)h(the)g | |
d37a4722 CR |
10993 | (redirection)h(will)f(fail)h(if)e(the)i(\014le)e(whose)h(name)g |
10994 | (results)g(from)f(the)h(expansion)g(of)g Fr(w)m(ord)150 | |
3011048a | 10995 | 2983 y Fu(exists)f(and)f(is)g(a)h(regular)g(\014le.)41 |
e230f997 CR |
10996 | b(If)30 b(the)h(redirection)g(op)s(erator)g(is)f(`)p |
10997 | Ft(>|)p Fu(',)h(or)f(the)h(redirection)g(op)s(erator)g(is)150 | |
3011048a | 10998 | 3092 y(`)p Ft(>)p Fu(')36 b(and)f(the)g Ft(noclobber)e |
e230f997 | 10999 | Fu(option)j(is)g(not)g(enabled,)h(the)e(redirection)h(is)g(attempted)g |
3011048a CR |
11000 | (ev)m(en)h(if)e(the)h(\014le)150 3202 y(named)30 b(b)m(y)g |
11001 | Fr(w)m(ord)k Fu(exists.)150 3405 y Fk(3.6.3)63 b(App)s(ending)42 | |
11002 | b(Redirected)e(Output)150 3552 y Fu(Redirection)23 b(of)e(output)h(in)f | |
e230f997 | 11003 | (this)h(fashion)f(causes)h(the)g(\014le)g(whose)f(name)h(results)f |
3011048a | 11004 | (from)g(the)h(expansion)g(of)150 3662 y Fr(w)m(ord)28 |
e230f997 CR |
11005 | b Fu(to)e(b)s(e)e(op)s(ened)g(for)h(app)s(ending)e(on)i(\014le)g |
11006 | (descriptor)g Fr(n)p Fu(,)g(or)g(the)g(standard)f(output)h(\(\014le)g | |
3011048a | 11007 | (descriptor)150 3771 y(1\))31 b(if)f Fr(n)g Fu(is)h(not)f(sp)s |
e230f997 | 11008 | (eci\014ed.)40 b(If)30 b(the)h(\014le)f(do)s(es)g(not)h(exist)g(it)g |
3011048a CR |
11009 | (is)f(created.)275 3910 y(The)f(general)j(format)e(for)h(app)s(ending)e |
11010 | (output)h(is:)390 4049 y Ft([)p Fj(n)p Ft(]>>)p Fj(word)150 | |
11011 | 4252 y Fk(3.6.4)63 b(Redirecting)40 b(Standard)h(Output)g(and)g | |
11012 | (Standard)g(Error)150 4399 y Fu(This)33 b(construct)i(allo)m(ws)g(b)s | |
e59452c7 | 11013 | (oth)f(the)g(standard)g(output)f(\(\014le)i(descriptor)f(1\))h(and)f |
3011048a | 11014 | (the)g(standard)f(error)150 4508 y(output)d(\(\014le)h(descriptor)f |
e59452c7 | 11015 | (2\))h(to)g(b)s(e)f(redirected)h(to)g(the)f(\014le)h(whose)f(name)h(is) |
3011048a | 11016 | f(the)g(expansion)h(of)f Fr(w)m(ord)p Fu(.)275 4647 y(There)f(are)i(t)m |
e59452c7 | 11017 | (w)m(o)h(formats)e(for)h(redirecting)g(standard)e(output)h(and)g |
3011048a CR |
11018 | (standard)f(error:)390 4786 y Ft(&>)p Fj(word)150 4924 |
11019 | y Fu(and)390 5063 y Ft(>&)p Fj(word)150 5201 y Fu(Of)h(the)g(t)m(w)m(o) | |
e59452c7 CR |
11020 | i(forms,)e(the)h(\014rst)e(is)i(preferred.)39 b(This)30 |
11021 | b(is)g(seman)m(tically)j(equiv)-5 b(alen)m(t)32 b(to)390 | |
3011048a | 11022 | 5340 y Ft(>)p Fj(word)46 b Ft(2>&1)p eop end |
e59452c7 CR |
11023 | %%Page: 40 46 |
11024 | TeXDict begin 40 45 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11025 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(40)275 299 | |
3011048a CR |
11026 | y(When)41 b(using)g(the)h(second)f(form,)k Fr(w)m(ord)f |
11027 | Fu(ma)m(y)e(not)g(expand)f(to)h(a)g(n)m(um)m(b)s(er)f(or)g(`)p | |
11028 | Ft(-)p Fu('.)75 b(If)41 b(it)h(do)s(es,)150 408 y(other)27 | |
11029 | b(redirection)g(op)s(erators)f(apply)h(\(see)g(Duplicating)h(File)f | |
11030 | (Descriptors)h(b)s(elo)m(w\))f(for)f(compatibilit)m(y)150 | |
11031 | 518 y(reasons.)150 711 y Fk(3.6.5)63 b(App)s(ending)42 | |
11032 | b(Standard)f(Output)g(and)g(Standard)g(Error)150 858 | |
11033 | y Fu(This)33 b(construct)i(allo)m(ws)g(b)s(oth)f(the)g(standard)g | |
11034 | (output)f(\(\014le)i(descriptor)f(1\))h(and)f(the)g(standard)f(error) | |
11035 | 150 968 y(output)d(\(\014le)h(descriptor)f(2\))h(to)g(b)s(e)f(app)s | |
11036 | (ended)f(to)i(the)f(\014le)h(whose)f(name)g(is)h(the)f(expansion)h(of)f | |
11037 | Fr(w)m(ord)p Fu(.)275 1099 y(The)f(format)i(for)f(app)s(ending)f | |
11038 | (standard)h(output)g(and)f(standard)h(error)g(is:)390 | |
11039 | 1231 y Ft(&>>)p Fj(word)150 1362 y Fu(This)g(is)g(seman)m(tically)j | |
11040 | (equiv)-5 b(alen)m(t)32 b(to)390 1493 y Ft(>>)p Fj(word)46 | |
11041 | b Ft(2>&1)275 1625 y Fu(\(see)31 b(Duplicating)h(File)f(Descriptors)g | |
11042 | (b)s(elo)m(w\).)150 1818 y Fk(3.6.6)63 b(Here)41 b(Do)s(cumen)m(ts)150 | |
11043 | 1965 y Fu(This)26 b(t)m(yp)s(e)g(of)h(redirection)g(instructs)f(the)g | |
11044 | (shell)h(to)g(read)f(input)g(from)g(the)g(curren)m(t)h(source)f(un)m | |
11045 | (til)h(a)g(line)150 2074 y(con)m(taining)h(only)e Fr(w)m(ord)k | |
d37a4722 CR |
11046 | Fu(\(with)c(no)g(trailing)h(blanks\))f(is)g(seen.)40 |
11047 | b(All)27 b(of)f(the)g(lines)h(read)f(up)f(to)i(that)g(p)s(oin)m(t)150 | |
3011048a | 11048 | 2184 y(are)k(then)f(used)f(as)i(the)g(standard)e(input)h(\(or)g(\014le) |
d37a4722 | 11049 | h(descriptor)f Fr(n)g Fu(if)g Fr(n)g Fu(is)g(sp)s(eci\014ed\))g(for)h |
3011048a CR |
11050 | (a)f(command.)275 2315 y(The)f(format)i(of)g(here-do)s(cumen)m(ts)f |
11051 | (is:)390 2447 y Ft([)p Fj(n)p Ft(]<<[)p Fq(\000)p Ft(])p | |
11052 | Fj(word)772 2556 y(here-document)390 2666 y(delimiter)275 | |
11053 | 2797 y Fu(No)i(parameter)h(and)f(v)-5 b(ariable)32 b(expansion,)h | |
d37a4722 | 11054 | (command)f(substitution,)h(arithmetic)g(expansion,)g(or)150 |
3011048a | 11055 | 2907 y(\014lename)26 b(expansion)g(is)g(p)s(erformed)e(on)i |
b729dac1 CR |
11056 | Fr(w)m(ord)p Fu(.)39 b(If)25 b(an)m(y)i(part)e(of)h Fr(w)m(ord)j |
11057 | Fu(is)d(quoted,)i(the)e Fr(delimiter)33 b Fu(is)26 b(the)150 | |
3011048a | 11058 | 3017 y(result)33 b(of)g(quote)g(remo)m(v)-5 b(al)34 b(on)f |
b729dac1 | 11059 | Fr(w)m(ord)p Fu(,)g(and)f(the)h(lines)g(in)g(the)g(here-do)s(cumen)m(t) |
3011048a | 11060 | g(are)g(not)g(expanded.)47 b(If)150 3126 y Fr(w)m(ord)26 |
b729dac1 CR |
11061 | b Fu(is)c(unquoted,)h(all)g(lines)g(of)g(the)f(here-do)s(cumen)m(t)g |
11062 | (are)h(sub)5 b(jected)22 b(to)h(parameter)g(expansion,)h(com-)150 | |
3011048a | 11063 | 3236 y(mand)30 b(substitution,)g(and)g(arithmetic)h(expansion,)g(the)f |
b729dac1 | 11064 | (c)m(haracter)i(sequence)f Ft(\\newline)d Fu(is)j(ignored,)150 |
3011048a | 11065 | 3345 y(and)f(`)p Ft(\\)p Fu(')g(m)m(ust)h(b)s(e)e(used)h(to)h(quote)g |
b729dac1 | 11066 | (the)g(c)m(haracters)g(`)p Ft(\\)p Fu(',)g(`)p Ft($)p |
3011048a | 11067 | Fu(',)g(and)f(`)p Ft(`)p Fu('.)275 3477 y(If)21 b(the)i(redirection)g |
e230f997 CR |
11068 | (op)s(erator)g(is)f(`)p Ft(<<-)p Fu(',)i(then)e(all)h(leading)g(tab)g |
11069 | (c)m(haracters)h(are)e(stripp)s(ed)f(from)h(input)150 | |
3011048a | 11070 | 3586 y(lines)33 b(and)f(the)h(line)h(con)m(taining)g |
e230f997 | 11071 | Fr(delimiter)p Fu(.)49 b(This)32 b(allo)m(ws)i(here-do)s(cumen)m(ts)f |
3011048a CR |
11072 | (within)f(shell)i(scripts)e(to)150 3696 y(b)s(e)e(inden)m(ted)g(in)g(a) |
11073 | h(natural)f(fashion.)150 3889 y Fk(3.6.7)63 b(Here)41 | |
11074 | b(Strings)150 4036 y Fu(A)30 b(v)-5 b(arian)m(t)32 b(of)e(here)h(do)s | |
11075 | (cumen)m(ts,)f(the)g(format)h(is:)390 4167 y Ft([)p Fj(n)p | |
11076 | Ft(]<<<)46 b Fj(word)275 4299 y Fu(The)29 b Fr(w)m(ord)k | |
e59452c7 | 11077 | Fu(undergo)s(es)c(tilde)i(expansion,)f(parameter)h(and)e(v)-5 |
3011048a | 11078 | b(ariable)31 b(expansion,)f(command)g(sub-)150 4408 y(stitution,)f |
e59452c7 | 11079 | (arithmetic)f(expansion,)g(and)f(quote)h(remo)m(v)-5 |
fc35c477 | 11080 | b(al.)41 b(Filename)29 b(expansion)e(and)f(w)m(ord)h(splitting)150 |
3011048a | 11081 | 4518 y(are)35 b(not)g(p)s(erformed.)51 b(The)34 b(result)h(is)g |
e230f997 | 11082 | (supplied)e(as)i(a)f(single)i(string,)f(with)g(a)g(newline)f(app)s |
3011048a | 11083 | (ended,)g(to)150 4628 y(the)d(command)f(on)g(its)h(standard)e(input)h |
e230f997 | 11084 | (\(or)g(\014le)h(descriptor)f Fr(n)g Fu(if)g Fr(n)g Fu(is)h(sp)s |
3011048a CR |
11085 | (eci\014ed\).)150 4821 y Fk(3.6.8)63 b(Duplicating)41 |
11086 | b(File)g(Descriptors)150 4968 y Fu(The)30 b(redirection)h(op)s(erator) | |
11087 | 390 5099 y Ft([)p Fj(n)p Ft(]<&)p Fj(word)150 5230 y | |
e230f997 CR |
11088 | Fu(is)k(used)e(to)j(duplicate)f(input)f(\014le)g(descriptors.)53 |
11089 | b(If)34 b Fr(w)m(ord)k Fu(expands)c(to)h(one)g(or)g(more)g(digits,)h | |
3011048a | 11090 | (the)f(\014le)150 5340 y(descriptor)e(denoted)h(b)m(y)f |
e230f997 | 11091 | Fr(n)g Fu(is)g(made)h(to)g(b)s(e)f(a)g(cop)m(y)h(of)g(that)g(\014le)f |
3011048a CR |
11092 | (descriptor.)50 b(If)33 b(the)h(digits)g(in)f Fr(w)m(ord)p |
11093 | eop end | |
e59452c7 CR |
11094 | %%Page: 41 47 |
11095 | TeXDict begin 41 46 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11096 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(41)150 299 | |
3011048a CR |
11097 | y(do)29 b(not)h(sp)s(ecify)f(a)h(\014le)f(descriptor)g(op)s(en)g(for)g |
11098 | (input,)g(a)h(redirection)g(error)f(o)s(ccurs.)40 b(If)29 | |
11099 | b Fr(w)m(ord)j Fu(ev)-5 b(aluates)150 408 y(to)31 b(`)p | |
11100 | Ft(-)p Fu(',)g(\014le)g(descriptor)g Fr(n)f Fu(is)g(closed.)43 | |
11101 | b(If)30 b Fr(n)g Fu(is)g(not)h(sp)s(eci\014ed,)f(the)h(standard)f | |
11102 | (input)g(\(\014le)h(descriptor)f(0\))150 518 y(is)g(used.)275 | |
11103 | 652 y(The)f(op)s(erator)390 786 y Ft([)p Fj(n)p Ft(]>&)p | |
11104 | Fj(word)150 920 y Fu(is)40 b(used)g(similarly)h(to)g(duplicate)f | |
11105 | (output)g(\014le)h(descriptors.)70 b(If)40 b Fr(n)f Fu(is)i(not)f(sp)s | |
11106 | (eci\014ed,)i(the)f(standard)150 1030 y(output)30 b(\(\014le)g | |
11107 | (descriptor)g(1\))h(is)f(used.)39 b(If)30 b(the)g(digits)h(in)e | |
11108 | Fr(w)m(ord)34 b Fu(do)29 b(not)i(sp)s(ecify)e(a)i(\014le)f(descriptor)g | |
11109 | (op)s(en)150 1139 y(for)35 b(output,)h(a)g(redirection)g(error)e(o)s | |
11110 | (ccurs.)55 b(If)35 b Fr(w)m(ord)j Fu(ev)-5 b(aluates)37 | |
11111 | b(to)f(`)p Ft(-)p Fu(',)h(\014le)e(descriptor)g Fr(n)g | |
11112 | Fu(is)g(closed.)150 1249 y(As)f(a)g(sp)s(ecial)h(case,)h(if)e | |
11113 | Fr(n)f Fu(is)h(omitted,)i(and)e Fr(w)m(ord)j Fu(do)s(es)d(not)g(expand) | |
11114 | f(to)i(one)f(or)g(more)g(digits)h(or)f(`)p Ft(-)p Fu(',)150 | |
11115 | 1359 y(the)d(standard)e(output)h(and)g(standard)f(error)h(are)h | |
11116 | (redirected)g(as)g(describ)s(ed)e(previously)-8 b(.)150 | |
11117 | 1557 y Fk(3.6.9)63 b(Mo)m(ving)41 b(File)h(Descriptors)150 | |
11118 | 1704 y Fu(The)30 b(redirection)h(op)s(erator)390 1838 | |
11119 | y Ft([)p Fj(n)p Ft(]<&)p Fj(digit)p Ft(-)150 1972 y Fu(mo)m(v)m(es)i | |
11120 | (the)f(\014le)g(descriptor)f Fr(digit)k Fu(to)d(\014le)g(descriptor)g | |
11121 | Fr(n)p Fu(,)f(or)h(the)g(standard)f(input)f(\(\014le)j(descriptor)e | |
11122 | (0\))150 2082 y(if)f Fr(n)g Fu(is)h(not)f(sp)s(eci\014ed.)40 | |
11123 | b Fr(digit)33 b Fu(is)e(closed)g(after)g(b)s(eing)f(duplicated)g(to)h | |
11124 | Fr(n)p Fu(.)275 2216 y(Similarly)-8 b(,)31 b(the)f(redirection)h(op)s | |
11125 | (erator)390 2350 y Ft([)p Fj(n)p Ft(]>&)p Fj(digit)p | |
11126 | Ft(-)150 2484 y Fu(mo)m(v)m(es)e(the)g(\014le)f(descriptor)f | |
6e51e0d0 | 11127 | Fr(digit)k Fu(to)e(\014le)f(descriptor)g Fr(n)p Fu(,)g(or)g(the)g |
abe2eb5b | 11128 | (standard)f(output)h(\(\014le)g(descriptor)g(1\))150 |
3011048a CR |
11129 | 2593 y(if)i Fr(n)g Fu(is)h(not)f(sp)s(eci\014ed.)150 |
11130 | 2792 y Fk(3.6.10)63 b(Op)s(ening)42 b(File)g(Descriptors)g(for)g | |
11131 | (Reading)e(and)h(W)-10 b(riting)150 2939 y Fu(The)30 | |
11132 | b(redirection)h(op)s(erator)390 3073 y Ft([)p Fj(n)p | |
11133 | Ft(]<>)p Fj(word)150 3207 y Fu(causes)39 b(the)g(\014le)g(whose)g(name) | |
6e51e0d0 | 11134 | g(is)g(the)g(expansion)g(of)g Fr(w)m(ord)j Fu(to)d(b)s(e)g(op)s(ened)f |
3011048a | 11135 | (for)g(b)s(oth)h(reading)g(and)150 3316 y(writing)33 |
6e51e0d0 CR |
11136 | b(on)f(\014le)h(descriptor)f Fr(n)p Fu(,)h(or)g(on)f(\014le)h |
11137 | (descriptor)g(0)g(if)f Fr(n)g Fu(is)h(not)g(sp)s(eci\014ed.)47 | |
3011048a CR |
11138 | b(If)32 b(the)h(\014le)f(do)s(es)h(not)150 3426 y(exist,)e(it)g(is)g |
11139 | (created.)150 3666 y Fs(3.7)68 b(Executing)46 b(Commands)150 | |
11140 | 3890 y Fk(3.7.1)63 b(Simple)41 b(Command)h(Expansion)150 | |
11141 | 4037 y Fu(When)33 b(a)g(simple)g(command)g(is)g(executed,)h(the)g | |
e59452c7 | 11142 | (shell)f(p)s(erforms)e(the)i(follo)m(wing)i(expansions,)e(assign-)150 |
3011048a CR |
11143 | 4146 y(men)m(ts,)e(and)f(redirections,)h(from)f(left)h(to)g(righ)m(t,)g |
11144 | (in)f(the)h(follo)m(wing)h(order.)199 4280 y(1.)61 b(The)38 | |
e59452c7 CR |
11145 | b(w)m(ords)f(that)i(the)g(parser)e(has)h(mark)m(ed)g(as)h(v)-5 |
11146 | b(ariable)39 b(assignmen)m(ts)g(\(those)g(preceding)f(the)330 | |
3011048a CR |
11147 | 4390 y(command)30 b(name\))h(and)f(redirections)h(are)f(sa)m(v)m(ed)i |
11148 | (for)e(later)h(pro)s(cessing.)199 4524 y(2.)61 b(The)39 | |
e59452c7 CR |
11149 | b(w)m(ords)g(that)i(are)f(not)g(v)-5 b(ariable)40 b(assignmen)m(ts)h |
11150 | (or)e(redirections)i(are)f(expanded)f(\(see)h(Sec-)330 | |
3011048a | 11151 | 4633 y(tion)d(3.5)i([Shell)e(Expansions],)h(page)g(24\).)61 |
e59452c7 | 11152 | b(If)37 b(an)m(y)g(w)m(ords)f(remain)h(after)h(expansion,)h(the)e |
3011048a | 11153 | (\014rst)330 4743 y(w)m(ord)31 b(is)g(tak)m(en)h(to)g(b)s(e)f(the)g |
e59452c7 | 11154 | (name)h(of)f(the)h(command)f(and)f(the)i(remaining)f(w)m(ords)g(are)g |
3011048a | 11155 | (the)h(argu-)330 4853 y(men)m(ts.)199 4987 y(3.)61 b(Redirections)25 |
e59452c7 | 11156 | b(are)f(p)s(erformed)f(as)h(describ)s(ed)f(ab)s(o)m(v)m(e)i(\(see)g |
3011048a | 11157 | (Section)g(3.6)g([Redirections],)i(page)d(37\).)199 5121 |
e59452c7 CR |
11158 | y(4.)61 b(The)25 b(text)h(after)f(the)g(`)p Ft(=)p Fu(')h(in)e(eac)m(h) |
11159 | j(v)-5 b(ariable)25 b(assignmen)m(t)h(undergo)s(es)e(tilde)i | |
3011048a | 11160 | (expansion,)g(parameter)330 5230 y(expansion,)49 b(command)d |
e59452c7 | 11161 | (substitution,)j(arithmetic)d(expansion,)k(and)45 b(quote)h(remo)m(v)-5 |
3011048a CR |
11162 | b(al)46 b(b)s(efore)330 5340 y(b)s(eing)30 b(assigned)h(to)g(the)f(v)-5 |
11163 | b(ariable.)p eop end | |
e59452c7 CR |
11164 | %%Page: 42 48 |
11165 | TeXDict begin 42 47 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11166 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(42)275 299 | |
3011048a CR |
11167 | y(If)32 b(no)i(command)f(name)g(results,)h(the)g(v)-5 |
11168 | b(ariable)34 b(assignmen)m(ts)g(a\013ect)h(the)f(curren)m(t)f(shell)h | |
11169 | (en)m(viron-)150 408 y(men)m(t.)68 b(In)38 b(the)h(case)i(of)e(suc)m(h) | |
11170 | g(a)g(command)g(\(one)h(that)g(consists)g(only)f(of)g(assignmen)m(t)h | |
11171 | (statemen)m(ts)150 518 y(and)27 b(redirections\),)i(assignmen)m(t)g | |
11172 | (statemen)m(ts)g(are)f(p)s(erformed)e(b)s(efore)h(redirections.)41 | |
11173 | b(Otherwise,)28 b(the)150 628 y(v)-5 b(ariables)27 b(are)g(added)e(to)i | |
11174 | (the)g(en)m(vironmen)m(t)g(of)f(the)h(executed)g(command)f(and)g(do)g | |
11175 | (not)h(a\013ect)h(the)e(cur-)150 737 y(ren)m(t)32 b(shell)f(en)m | |
11176 | (vironmen)m(t.)44 b(If)31 b(an)m(y)g(of)h(the)f(assignmen)m(ts)h | |
11177 | (attempts)g(to)g(assign)g(a)f(v)-5 b(alue)32 b(to)g(a)g(readonly)150 | |
11178 | 847 y(v)-5 b(ariable,)31 b(an)g(error)f(o)s(ccurs,)g(and)g(the)g | |
11179 | (command)g(exits)i(with)e(a)g(non-zero)h(status.)275 | |
11180 | 980 y(If)i(no)g(command)g(name)h(results,)g(redirections)g(are)g(p)s | |
e59452c7 | 11181 | (erformed,)f(but)g(do)h(not)f(a\013ect)i(the)f(curren)m(t)150 |
3011048a | 11182 | 1090 y(shell)d(en)m(vironmen)m(t.)41 b(A)30 b(redirection)h(error)f |
e59452c7 | 11183 | (causes)h(the)g(command)f(to)h(exit)g(with)f(a)h(non-zero)g(status.)275 |
3011048a | 11184 | 1223 y(If)26 b(there)i(is)f(a)h(command)f(name)h(left)g(after)g |
e59452c7 | 11185 | (expansion,)g(execution)h(pro)s(ceeds)e(as)g(describ)s(ed)f(b)s(elo)m |
3011048a | 11186 | (w.)150 1333 y(Otherwise,)39 b(the)e(command)g(exits.)62 |
e59452c7 | 11187 | b(If)37 b(one)g(of)g(the)h(expansions)f(con)m(tained)h(a)g(command)f |
3011048a CR |
11188 | (substitu-)150 1442 y(tion,)i(the)d(exit)h(status)g(of)f(the)h(command) |
11189 | f(is)h(the)f(exit)h(status)g(of)f(the)h(last)g(command)f(substitution) | |
11190 | 150 1552 y(p)s(erformed.)55 b(If)35 b(there)g(w)m(ere)h(no)g(command)f | |
e59452c7 | 11191 | (substitutions,)i(the)e(command)h(exits)g(with)f(a)h(status)g(of)150 |
3011048a CR |
11192 | 1661 y(zero.)150 1858 y Fk(3.7.2)63 b(Command)41 b(Searc)m(h)f(and)h |
11193 | (Execution)150 2005 y Fu(After)i(a)h(command)f(has)g(b)s(een)f(split)h | |
e59452c7 | 11194 | (in)m(to)h(w)m(ords,)j(if)c(it)g(results)g(in)g(a)h(simple)f(command)g |
3011048a CR |
11195 | (and)f(an)150 2115 y(optional)32 b(list)f(of)f(argumen)m(ts,)h(the)g |
11196 | (follo)m(wing)g(actions)h(are)f(tak)m(en.)199 2248 y(1.)61 | |
e59452c7 CR |
11197 | b(If)24 b(the)g(command)g(name)g(con)m(tains)i(no)e(slashes,)i(the)e |
11198 | (shell)h(attempts)g(to)g(lo)s(cate)h(it.)39 b(If)24 b(there)g(exists) | |
3011048a | 11199 | 330 2357 y(a)h(shell)g(function)f(b)m(y)g(that)h(name,)h(that)f |
e59452c7 | 11200 | (function)f(is)h(in)m(v)m(ok)m(ed)h(as)e(describ)s(ed)g(in)g(Section)h |
3011048a CR |
11201 | (3.3)h([Shell)330 2467 y(F)-8 b(unctions],)31 b(page)h(19.)199 |
11202 | 2600 y(2.)61 b(If)41 b(the)g(name)h(do)s(es)f(not)g(matc)m(h)i(a)e | |
e59452c7 | 11203 | (function,)j(the)e(shell)f(searc)m(hes)i(for)e(it)h(in)f(the)g(list)h |
3011048a CR |
11204 | (of)g(shell)330 2710 y(builtins.)e(If)30 b(a)h(matc)m(h)g(is)f(found,)g |
11205 | (that)h(builtin)f(is)g(in)m(v)m(ok)m(ed.)199 2843 y(3.)61 | |
e59452c7 CR |
11206 | b(If)40 b(the)g(name)h(is)f(neither)h(a)f(shell)h(function)f(nor)g(a)g |
11207 | (builtin,)j(and)d(con)m(tains)h(no)g(slashes,)i(Bash)330 | |
3011048a | 11208 | 2953 y(searc)m(hes)c(eac)m(h)g(elemen)m(t)g(of)g Ft($PATH)d |
e59452c7 | 11209 | Fu(for)i(a)g(directory)h(con)m(taining)g(an)f(executable)h(\014le)f(b)m |
3011048a | 11210 | (y)g(that)330 3062 y(name.)56 b(Bash)36 b(uses)f(a)h(hash)e(table)j(to) |
e59452c7 | 11211 | f(remem)m(b)s(er)f(the)h(full)f(pathnames)g(of)h(executable)h(\014les)e |
3011048a | 11212 | (to)330 3172 y(a)m(v)m(oid)e(m)m(ultiple)f Ft(PATH)f |
e59452c7 | 11213 | Fu(searc)m(hes)i(\(see)f(the)g(description)g(of)f Ft(hash)g |
3011048a | 11214 | Fu(in)g(Section)i(4.1)f([Bourne)g(Shell)330 3281 y(Builtins],)37 |
e59452c7 CR |
11215 | b(page)f(47\).)55 b(A)35 b(full)g(searc)m(h)g(of)g(the)g(directories)h |
11216 | (in)f Ft($PATH)e Fu(is)i(p)s(erformed)f(only)h(if)g(the)330 | |
3011048a | 11217 | 3391 y(command)24 b(is)h(not)g(found)e(in)i(the)g(hash)f(table.)39 |
e59452c7 | 11218 | b(If)25 b(the)f(searc)m(h)i(is)e(unsuccessful,)h(the)g(shell)g(searc)m |
3011048a | 11219 | (hes)330 3501 y(for)e(a)h(de\014ned)e(shell)h(function)h(named)e |
e59452c7 | 11220 | Ft(command_not_found_handle)p Fu(.)32 b(If)23 b(that)h(function)f |
3011048a | 11221 | (exists,)330 3610 y(it)33 b(is)f(in)m(v)m(ok)m(ed)i(in)e(a)h(separate)h |
e59452c7 | 11222 | (execution)f(en)m(vironmen)m(t)g(with)f(the)h(original)h(command)e(and) |
3011048a | 11223 | g(the)330 3720 y(original)26 b(command's)e(argumen)m(ts)h(as)g(its)g |
e59452c7 | 11224 | (argumen)m(ts,)h(and)e(the)h(function's)f(exit)i(status)f(b)s(ecomes) |
3011048a | 11225 | 330 3829 y(the)j(exit)g(status)g(of)f(that)h(subshell.)39 |
d37a4722 | 11226 | b(If)27 b(that)h(function)f(is)h(not)g(de\014ned,)f(the)g(shell)h(prin) |
3011048a CR |
11227 | m(ts)f(an)g(error)330 3939 y(message)k(and)f(returns)f(an)i(exit)g |
11228 | (status)g(of)f(127.)199 4072 y(4.)61 b(If)33 b(the)g(searc)m(h)h(is)g | |
d37a4722 | 11229 | (successful,)g(or)f(if)g(the)h(command)f(name)g(con)m(tains)i(one)f(or) |
3011048a | 11230 | f(more)g(slashes,)i(the)330 4182 y(shell)g(executes)h(the)f(named)f |
d37a4722 | 11231 | (program)g(in)h(a)g(separate)h(execution)f(en)m(vironmen)m(t.)55 |
3011048a | 11232 | b(Argumen)m(t)35 b(0)330 4291 y(is)30 b(set)h(to)h(the)e(name)h(giv)m |
d37a4722 | 11233 | (en,)g(and)f(the)h(remaining)f(argumen)m(ts)h(to)g(the)g(command)f(are) |
3011048a CR |
11234 | h(set)g(to)g(the)330 4401 y(argumen)m(ts)g(supplied,)e(if)h(an)m(y)-8 |
11235 | b(.)199 4534 y(5.)61 b(If)35 b(this)h(execution)h(fails)f(b)s(ecause)g | |
74d0116b | 11236 | (the)f(\014le)h(is)g(not)g(in)f(executable)j(format,)f(and)e(the)h |
3011048a | 11237 | (\014le)g(is)g(not)330 4644 y(a)d(directory)-8 b(,)34 |
6e51e0d0 CR |
11238 | b(it)f(is)g(assumed)e(to)j(b)s(e)d(a)i Fr(shell)g(script)h |
11239 | Fu(and)e(the)h(shell)f(executes)i(it)f(as)g(describ)s(ed)e(in)330 | |
3011048a CR |
11240 | 4753 y(Section)g(3.8)h([Shell)e(Scripts],)g(page)i(46.)199 |
11241 | 4887 y(6.)61 b(If)38 b(the)h(command)f(w)m(as)h(not)g(b)s(egun)e(async) | |
8a0829e9 | 11242 | m(hronously)-8 b(,)42 b(the)c(shell)h(w)m(aits)h(for)e(the)h(command)f |
3011048a CR |
11243 | (to)330 4996 y(complete)32 b(and)e(collects)i(its)f(exit)g(status.)150 |
11244 | 5193 y Fk(3.7.3)63 b(Command)41 b(Execution)f(En)m(vironmen)m(t)150 | |
11245 | 5340 y Fu(The)30 b(shell)g(has)h(an)f Fr(execution)h(en)m(vironmen)m(t) | |
11246 | p Fu(,)h(whic)m(h)e(consists)h(of)f(the)h(follo)m(wing:)p | |
e59452c7 CR |
11247 | eop end |
11248 | %%Page: 43 49 | |
11249 | TeXDict begin 43 48 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11250 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(43)225 299 | |
3011048a CR |
11251 | y Fq(\017)60 b Fu(op)s(en)32 b(\014les)g(inherited)g(b)m(y)h(the)f |
11252 | (shell)h(at)g(in)m(v)m(o)s(cation,)j(as)c(mo)s(di\014ed)g(b)m(y)g | |
11253 | (redirections)h(supplied)e(to)330 408 y(the)g Ft(exec)e | |
11254 | Fu(builtin)225 547 y Fq(\017)60 b Fu(the)28 b(curren)m(t)g(w)m(orking)h | |
11255 | (directory)g(as)f(set)h(b)m(y)f Ft(cd)p Fu(,)g Ft(pushd)p | |
11256 | Fu(,)g(or)g Ft(popd)p Fu(,)g(or)g(inherited)g(b)m(y)g(the)h(shell)f(at) | |
11257 | 330 656 y(in)m(v)m(o)s(cation)225 795 y Fq(\017)60 b | |
11258 | Fu(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)g(as)h(set)g(b)m(y)f | |
11259 | Ft(umask)f Fu(or)h(inherited)g(from)g(the)h(shell's)f(paren)m(t)225 | |
11260 | 933 y Fq(\017)60 b Fu(curren)m(t)30 b(traps)g(set)h(b)m(y)f | |
11261 | Ft(trap)225 1071 y Fq(\017)60 b Fu(shell)30 b(parameters)f(that)h(are)g | |
602eae4d | 11262 | (set)g(b)m(y)g(v)-5 b(ariable)30 b(assignmen)m(t)g(or)g(with)f |
3011048a CR |
11263 | Ft(set)f Fu(or)i(inherited)f(from)g(the)330 1181 y(shell's)i(paren)m(t) |
11264 | f(in)g(the)h(en)m(vironmen)m(t)225 1319 y Fq(\017)60 | |
11265 | b Fu(shell)44 b(functions)f(de\014ned)f(during)h(execution)i(or)e | |
602eae4d | 11266 | (inherited)h(from)f(the)h(shell's)g(paren)m(t)f(in)h(the)330 |
3011048a | 11267 | 1429 y(en)m(vironmen)m(t)225 1567 y Fq(\017)60 b Fu(options)33 |
602eae4d | 11268 | b(enabled)g(at)h(in)m(v)m(o)s(cation)h(\(either)f(b)m(y)f(default)g(or) |
3011048a CR |
11269 | g(with)g(command-line)g(argumen)m(ts\))h(or)330 1676 |
11270 | y(b)m(y)c Ft(set)225 1815 y Fq(\017)60 b Fu(options)31 | |
d37a4722 | 11271 | b(enabled)f(b)m(y)g Ft(shopt)f Fu(\(see)j(Section)f(4.3.2)h([The)e |
3011048a | 11272 | (Shopt)g(Builtin],)h(page)g(70\))225 1953 y Fq(\017)60 |
d37a4722 | 11273 | b Fu(shell)31 b(aliases)g(de\014ned)f(with)g Ft(alias)f |
e59452c7 | 11274 | Fu(\(see)i(Section)g(6.6)h([Aliases],)g(page)f(99\))225 |
3011048a | 11275 | 2091 y Fq(\017)60 b Fu(v)-5 b(arious)50 b(pro)s(cess)f |
6e51e0d0 | 11276 | Fm(id)p Fu(s,)55 b(including)49 b(those)i(of)e(bac)m(kground)h(jobs)f |
3011048a | 11277 | (\(see)i(Section)g(3.2.4)g([Lists],)330 2201 y(page)31 |
e59452c7 | 11278 | b(10\),)h(the)f(v)-5 b(alue)30 b(of)h Ft($$)p Fu(,)f(and)g(the)g(v)-5 |
3011048a | 11279 | b(alue)31 b(of)g Ft($PPID)275 2372 y Fu(When)j(a)g(simple)h(command)f |
abe2eb5b | 11280 | (other)g(than)g(a)h(builtin)f(or)g(shell)h(function)f(is)g(to)h(b)s(e)f |
3011048a | 11281 | (executed,)i(it)f(is)150 2481 y(in)m(v)m(ok)m(ed)25 b(in)f(a)g |
d37a4722 | 11282 | (separate)h(execution)g(en)m(vironmen)m(t)g(that)f(consists)g(of)h(the) |
3011048a | 11283 | f(follo)m(wing.)40 b(Unless)24 b(otherwise)150 2591 y(noted,)31 |
a8fd3f3e | 11284 | b(the)f(v)-5 b(alues)31 b(are)g(inherited)f(from)g(the)g(shell.)225 |
3011048a | 11285 | 2733 y Fq(\017)60 b Fu(the)31 b(shell's)h(op)s(en)e(\014les,)i(plus)e |
4a8bb13f | 11286 | (an)m(y)h(mo)s(di\014cations)h(and)e(additions)h(sp)s(eci\014ed)g(b)m |
3011048a | 11287 | (y)g(redirections)g(to)330 2842 y(the)g(command)225 2981 |
6e51e0d0 | 11288 | y Fq(\017)60 b Fu(the)31 b(curren)m(t)f(w)m(orking)g(directory)225 |
3011048a CR |
11289 | 3119 y Fq(\017)60 b Fu(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)225 |
11290 | 3257 y Fq(\017)60 b Fu(shell)32 b(v)-5 b(ariables)33 | |
122f603c | 11291 | b(and)e(functions)h(mark)m(ed)g(for)g(exp)s(ort,)g(along)h(with)f(v)-5 |
3011048a | 11292 | b(ariables)32 b(exp)s(orted)g(for)g(the)330 3367 y(command,)e(passed)g |
122f603c | 11293 | (in)g(the)h(en)m(vironmen)m(t)g(\(see)g(Section)g(3.7.4)i([En)m |
3011048a | 11294 | (vironmen)m(t],)e(page)g(44\))225 3505 y Fq(\017)60 b |
6e51e0d0 | 11295 | Fu(traps)31 b(caugh)m(t)h(b)m(y)f(the)g(shell)h(are)f(reset)h(to)g(the) |
122f603c | 11296 | f(v)-5 b(alues)32 b(inherited)e(from)h(the)g(shell's)h(paren)m(t,)g |
3011048a CR |
11297 | (and)330 3615 y(traps)e(ignored)h(b)m(y)f(the)g(shell)h(are)g(ignored) |
11298 | 275 3785 y(A)41 b(command)g(in)m(v)m(ok)m(ed)i(in)e(this)h(separate)g | |
e59452c7 | 11299 | (en)m(vironmen)m(t)g(cannot)g(a\013ect)h(the)f(shell's)g(execution)150 |
3011048a | 11300 | 3895 y(en)m(vironmen)m(t.)275 4037 y(A)30 b Fr(subshell)j |
e59452c7 | 11301 | Fu(is)d(a)h(cop)m(y)g(of)g(the)f(shell)h(pro)s(cess.)275 |
3011048a CR |
11302 | 4179 y(Command)k(substitution,)j(commands)e(group)s(ed)f(with)i(paren)m |
11303 | (theses,)h(and)e(async)m(hronous)g(com-)150 4289 y(mands)c(are)h(in)m | |
e59452c7 CR |
11304 | (v)m(ok)m(ed)i(in)d(a)i(subshell)e(en)m(vironmen)m(t)h(that)h(is)f(a)g |
11305 | (duplicate)h(of)f(the)g(shell)g(en)m(vironmen)m(t,)150 | |
3011048a | 11306 | 4398 y(except)i(that)g(traps)f(caugh)m(t)h(b)m(y)f(the)h(shell)f(are)g |
e59452c7 | 11307 | (reset)h(to)g(the)f(v)-5 b(alues)35 b(that)g(the)f(shell)h(inherited)e |
3011048a | 11308 | (from)150 4508 y(its)g(paren)m(t)f(at)h(in)m(v)m(o)s(cation.)49 |
122f603c | 11309 | b(Builtin)32 b(commands)g(that)h(are)g(in)m(v)m(ok)m(ed)h(as)e(part)g |
3011048a | 11310 | (of)h(a)f(pip)s(eline)g(are)h(also)150 4618 y(executed)41 |
122f603c CR |
11311 | b(in)f(a)h(subshell)e(en)m(vironmen)m(t.)72 b(Changes)40 |
11312 | b(made)g(to)h(the)g(subshell)e(en)m(vironmen)m(t)i(cannot)150 | |
3011048a CR |
11313 | 4727 y(a\013ect)32 b(the)f(shell's)f(execution)i(en)m(vironmen)m(t.)275 |
11314 | 4869 y(Subshells)c(spa)m(wned)i(to)h(execute)g(command)f(substitutions) | |
6e51e0d0 | 11315 | g(inherit)g(the)g(v)-5 b(alue)31 b(of)f(the)h Ft(-e)e |
3011048a | 11316 | Fu(option)150 4979 y(from)23 b(the)i(paren)m(t)f(shell.)38 |
6e51e0d0 | 11317 | b(When)24 b(not)g(in)g Fm(posix)f Fu(mo)s(de,)i(Bash)f(clears)h(the)f |
3011048a | 11318 | Ft(-e)f Fu(option)i(in)e(suc)m(h)h(subshells.)275 5121 |
8a0829e9 | 11319 | y(If)f(a)h(command)g(is)g(follo)m(w)m(ed)h(b)m(y)f(a)g(`)p |
6e51e0d0 | 11320 | Ft(&)p Fu(')g(and)f(job)h(con)m(trol)h(is)f(not)g(activ)m(e,)k(the)c |
3011048a | 11321 | (default)g(standard)f(input)150 5230 y(for)35 b(the)g(command)g(is)g |
6e51e0d0 | 11322 | (the)g(empt)m(y)h(\014le)f Ft(/dev/null)p Fu(.)52 b(Otherwise,)37 |
3011048a | 11323 | b(the)e(in)m(v)m(ok)m(ed)h(command)f(inherits)150 5340 |
6e51e0d0 | 11324 | y(the)c(\014le)f(descriptors)g(of)h(the)f(calling)i(shell)f(as)f(mo)s |
3011048a | 11325 | (di\014ed)g(b)m(y)g(redirections.)p eop end |
e59452c7 CR |
11326 | %%Page: 44 50 |
11327 | TeXDict begin 44 49 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11328 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(44)150 299 | |
3011048a CR |
11329 | y Fk(3.7.4)63 b(En)m(vironmen)m(t)150 446 y Fu(When)29 |
11330 | b(a)g(program)f(is)h(in)m(v)m(ok)m(ed)h(it)g(is)f(giv)m(en)g(an)g(arra) | |
11331 | m(y)g(of)g(strings)g(called)h(the)f Fr(en)m(vironmen)m(t)p | |
11332 | Fu(.)41 b(This)28 b(is)h(a)150 555 y(list)i(of)g(name-v)-5 | |
11333 | b(alue)31 b(pairs,)f(of)h(the)f(form)g Ft(name=value)p | |
11334 | Fu(.)275 683 y(Bash)39 b(pro)m(vides)g(sev)m(eral)i(w)m(a)m(ys)g(to)f | |
11335 | (manipulate)f(the)h(en)m(vironmen)m(t.)69 b(On)38 b(in)m(v)m(o)s | |
11336 | (cation,)44 b(the)c(shell)150 792 y(scans)g(its)h(o)m(wn)f(en)m | |
11337 | (vironmen)m(t)h(and)f(creates)i(a)f(parameter)f(for)g(eac)m(h)i(name)e | |
11338 | (found,)i(automatically)150 902 y(marking)23 b(it)h(for)f | |
11339 | Ft(export)f Fu(to)i(c)m(hild)g(pro)s(cesses.)38 b(Executed)24 | |
11340 | b(commands)f(inherit)g(the)g(en)m(vironmen)m(t.)39 b(The)150 | |
11341 | 1012 y Ft(export)c Fu(and)i(`)p Ft(declare)29 b(-x)p | |
11342 | Fu(')36 b(commands)h(allo)m(w)i(parameters)e(and)g(functions)g(to)h(b)s | |
11343 | (e)e(added)h(to)h(and)150 1121 y(deleted)21 b(from)f(the)h(en)m | |
e59452c7 CR |
11344 | (vironmen)m(t.)38 b(If)20 b(the)h(v)-5 b(alue)21 b(of)g(a)g(parameter)g |
11345 | (in)f(the)g(en)m(vironmen)m(t)i(is)e(mo)s(di\014ed,)i(the)150 | |
3011048a | 11346 | 1231 y(new)31 b(v)-5 b(alue)32 b(b)s(ecomes)f(part)h(of)f(the)h(en)m |
e59452c7 | 11347 | (vironmen)m(t,)g(replacing)h(the)e(old.)44 b(The)31 b(en)m(vironmen)m |
3011048a | 11348 | (t)h(inherited)150 1340 y(b)m(y)f(an)m(y)g(executed)h(command)f |
e59452c7 | 11349 | (consists)g(of)g(the)g(shell's)h(initial)g(en)m(vironmen)m(t,)g(whose)f |
3011048a | 11350 | (v)-5 b(alues)31 b(ma)m(y)h(b)s(e)150 1450 y(mo)s(di\014ed)26 |
595e3e69 CR |
11351 | b(in)g(the)h(shell,)h(less)f(an)m(y)g(pairs)f(remo)m(v)m(ed)i(b)m(y)f |
11352 | (the)g Ft(unset)e Fu(and)h(`)p Ft(export)j(-n)p Fu(')e(commands,)g | |
3011048a CR |
11353 | (plus)150 1560 y(an)m(y)k(additions)f(via)h(the)g Ft(export)d |
11354 | Fu(and)i(`)p Ft(declare)f(-x)p Fu(')h(commands.)275 1687 | |
595e3e69 | 11355 | y(The)j(en)m(vironmen)m(t)i(for)f(an)m(y)g(simple)h(command)f(or)g |
220537f2 | 11356 | (function)g(ma)m(y)g(b)s(e)g(augmen)m(ted)h(temp)s(orarily)150 |
3011048a | 11357 | 1797 y(b)m(y)c(pre\014xing)e(it)i(with)g(parameter)g(assignmen)m(ts,)h |
220537f2 | 11358 | (as)e(describ)s(ed)g(in)g(Section)i(3.4)g([Shell)e(P)m(arameters],)150 |
3011048a | 11359 | 1906 y(page)g(21.)41 b(These)29 b(assignmen)m(t)i(statemen)m(ts)g |
220537f2 | 11360 | (a\013ect)f(only)g(the)f(en)m(vironmen)m(t)h(seen)g(b)m(y)f(that)h |
3011048a | 11361 | (command.)275 2034 y(If)g(the)h Ft(-k)g Fu(option)g(is)g(set)h(\(see)g |
e59452c7 | 11362 | (Section)g(4.3.1)g([The)f(Set)g(Builtin],)h(page)g(66\),)h(then)e(all)g |
3011048a | 11363 | (parameter)150 2143 y(assignmen)m(ts)f(are)g(placed)h(in)e(the)h(en)m |
d37a4722 | 11364 | (vironmen)m(t)g(for)g(a)g(command,)f(not)h(just)f(those)i(that)f |
3011048a | 11365 | (precede)g(the)150 2253 y(command)g(name.)275 2380 y(When)h(Bash)h(in)m |
d37a4722 CR |
11366 | (v)m(ok)m(es)i(an)e(external)h(command,)f(the)g(v)-5 |
11367 | b(ariable)33 b(`)p Ft($_)p Fu(')f(is)g(set)h(to)f(the)g(full)g | |
3011048a CR |
11368 | (pathname)150 2490 y(of)f(the)f(command)g(and)g(passed)g(to)h(that)g |
11369 | (command)f(in)g(its)h(en)m(vironmen)m(t.)150 2675 y Fk(3.7.5)63 | |
11370 | b(Exit)40 b(Status)150 2822 y Fu(The)23 b(exit)i(status)f(of)h(an)e | |
e59452c7 | 11371 | (executed)i(command)f(is)g(the)g(v)-5 b(alue)24 b(returned)f(b)m(y)h |
3011048a | 11372 | (the)g Ft(waitpid)e Fu(system)i(call)h(or)150 2932 y(equiv)-5 |
e59452c7 CR |
11373 | b(alen)m(t)33 b(function.)45 b(Exit)32 b(statuses)g(fall)g(b)s(et)m(w)m |
11374 | (een)h(0)f(and)f(255,)i(though,)f(as)g(explained)g(b)s(elo)m(w,)h(the) | |
3011048a | 11375 | 150 3041 y(shell)i(ma)m(y)g(use)f(v)-5 b(alues)35 b(ab)s(o)m(v)m(e)g |
e59452c7 | 11376 | (125)h(sp)s(ecially)-8 b(.)54 b(Exit)35 b(statuses)g(from)f(shell)h |
3011048a | 11377 | (builtins)f(and)f(comp)s(ound)150 3151 y(commands)j(are)g(also)h |
e59452c7 | 11378 | (limited)g(to)g(this)f(range.)58 b(Under)36 b(certain)h(circumstances,) |
3011048a | 11379 | h(the)e(shell)h(will)f(use)150 3260 y(sp)s(ecial)31 b(v)-5 |
e59452c7 | 11380 | b(alues)31 b(to)g(indicate)g(sp)s(eci\014c)f(failure)h(mo)s(des.)275 |
3011048a | 11381 | 3388 y(F)-8 b(or)32 b(the)g(shell's)g(purp)s(oses,)e(a)j(command)e |
e59452c7 | 11382 | (whic)m(h)h(exits)g(with)g(a)g(zero)g(exit)h(status)f(has)f(succeeded.) |
3011048a | 11383 | 150 3497 y(A)e(non-zero)h(exit)g(status)g(indicates)g(failure.)40 |
e59452c7 | 11384 | b(This)28 b(seemingly)i(coun)m(ter-in)m(tuitiv)m(e)i(sc)m(heme)e(is)f |
3011048a | 11385 | (used)g(so)150 3607 y(there)34 b(is)g(one)g(w)m(ell-de\014ned)g(w)m(a)m |
e59452c7 CR |
11386 | (y)g(to)h(indicate)g(success)f(and)f(a)h(v)-5 b(ariet)m(y)35 |
11387 | b(of)f(w)m(a)m(ys)h(to)f(indicate)h(v)-5 b(arious)150 | |
3011048a | 11388 | 3716 y(failure)38 b(mo)s(des.)62 b(When)37 b(a)h(command)f(terminates)i |
e59452c7 | 11389 | (on)e(a)h(fatal)h(signal)g(whose)e(n)m(um)m(b)s(er)f(is)i |
3011048a | 11390 | Fr(N)p Fu(,)i(Bash)150 3826 y(uses)30 b(the)g(v)-5 b(alue)31 |
091c6bc4 | 11391 | b(128)p Ft(+)p Fr(N)42 b Fu(as)30 b(the)h(exit)g(status.)275 |
3011048a | 11392 | 3954 y(If)k(a)h(command)g(is)g(not)g(found,)g(the)g(c)m(hild)h(pro)s |
091c6bc4 | 11393 | (cess)e(created)i(to)g(execute)g(it)g(returns)d(a)j(status)f(of)150 |
3011048a | 11394 | 4063 y(127.)42 b(If)30 b(a)h(command)f(is)g(found)f(but)h(is)g(not)h |
091c6bc4 | 11395 | (executable,)h(the)f(return)e(status)i(is)f(126.)275 |
3011048a | 11396 | 4191 y(If)i(a)i(command)f(fails)g(b)s(ecause)g(of)h(an)f(error)f |
e59452c7 | 11397 | (during)g(expansion)h(or)g(redirection,)i(the)f(exit)g(status)150 |
3011048a | 11398 | 4300 y(is)c(greater)i(than)e(zero.)275 4428 y(The)38 |
e59452c7 | 11399 | b(exit)h(status)g(is)g(used)f(b)m(y)g(the)h(Bash)g(conditional)h |
3011048a | 11400 | (commands)e(\(see)h(Section)h(3.2.5.2)h([Con-)150 4537 |
e59452c7 CR |
11401 | y(ditional)i(Constructs],)h(page)f(12\))g(and)e(some)i(of)f(the)g(list) |
11402 | g(constructs)g(\(see)h(Section)f(3.2.4)i([Lists],)150 | |
3011048a | 11403 | 4647 y(page)31 b(10\).)275 4774 y(All)40 b(of)g(the)h(Bash)f(builtins)f |
e59452c7 | 11404 | (return)g(an)h(exit)h(status)g(of)f(zero)h(if)f(they)g(succeed)g(and)g |
3011048a | 11405 | (a)g(non-zero)150 4884 y(status)34 b(on)f(failure,)i(so)f(they)g(ma)m |
e59452c7 | 11406 | (y)g(b)s(e)f(used)g(b)m(y)g(the)h(conditional)h(and)e(list)h |
3011048a | 11407 | (constructs.)50 b(All)35 b(builtins)150 4993 y(return)e(an)i(exit)g |
e59452c7 | 11408 | (status)g(of)f(2)h(to)g(indicate)h(incorrect)f(usage,)h(generally)g(in) |
3011048a CR |
11409 | m(v)-5 b(alid)35 b(options)g(or)f(missing)150 5103 y(argumen)m(ts.)275 |
11410 | 5230 y(The)f(exit)i(status)f(of)h(the)f(last)h(command)f(is)g(a)m(v)-5 | |
e59452c7 | 11411 | b(ailable)36 b(in)e(the)g(sp)s(ecial)h(parameter)f($?)52 |
3011048a CR |
11412 | b(\(see)35 b(Sec-)150 5340 y(tion)c(3.4.2)h([Sp)s(ecial)f(P)m |
11413 | (arameters],)h(page)f(23\).)p eop end | |
e59452c7 CR |
11414 | %%Page: 45 51 |
11415 | TeXDict begin 45 50 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11416 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(45)150 299 | |
3011048a CR |
11417 | y Fk(3.7.6)63 b(Signals)150 446 y Fu(When)36 b(Bash)g(is)h(in)m |
11418 | (teractiv)m(e,)j(in)c(the)h(absence)f(of)h(an)m(y)f(traps,)i(it)e | |
11419 | (ignores)h Ft(SIGTERM)d Fu(\(so)j(that)g(`)p Ft(kill)150 | |
11420 | 555 y(0)p Fu(')c(do)s(es)g(not)g(kill)g(an)g(in)m(teractiv)m(e)j | |
11421 | (shell\),)f(and)d Ft(SIGINT)f Fu(is)i(caugh)m(t)h(and)f(handled)f(\(so) | |
11422 | h(that)h(the)f Ft(wait)150 665 y Fu(builtin)24 b(is)h(in)m | |
11423 | (terruptible\).)39 b(When)24 b(Bash)g(receiv)m(es)j(a)d | |
11424 | Ft(SIGINT)p Fu(,)h(it)g(breaks)f(out)h(of)f(an)m(y)h(executing)h(lo)s | |
11425 | (ops.)150 775 y(In)31 b(all)h(cases,)h(Bash)f(ignores)g | |
11426 | Ft(SIGQUIT)p Fu(.)42 b(If)32 b(job)f(con)m(trol)i(is)e(in)h(e\013ect)h | |
11427 | (\(see)f(Chapter)f(7)h([Job)g(Con)m(trol],)150 884 y(page)f(112\),)h | |
11428 | (Bash)f(ignores)g Ft(SIGTTIN)p Fu(,)d Ft(SIGTTOU)p Fu(,)h(and)h | |
11429 | Ft(SIGTSTP)p Fu(.)275 1043 y(Non-builtin)h(commands)g(started)g(b)m(y)g | |
091c6bc4 | 11430 | (Bash)h(ha)m(v)m(e)g(signal)g(handlers)e(set)i(to)g(the)g(v)-5 |
3011048a | 11431 | b(alues)31 b(inherited)150 1153 y(b)m(y)37 b(the)h(shell)g(from)f(its)h |
091c6bc4 | 11432 | (paren)m(t.)62 b(When)38 b(job)f(con)m(trol)i(is)e(not)h(in)f |
3011048a | 11433 | (e\013ect,)k(async)m(hronous)c(commands)150 1262 y(ignore)f |
091c6bc4 CR |
11434 | Ft(SIGINT)e Fu(and)h Ft(SIGQUIT)e Fu(in)j(addition)f(to)i(these)f |
11435 | (inherited)f(handlers.)55 b(Commands)35 b(run)f(as)i(a)150 | |
3011048a CR |
11436 | 1372 y(result)27 b(of)h(command)f(substitution)h(ignore)g(the)g(k)m |
11437 | (eyb)s(oard-generated)g(job)g(con)m(trol)h(signals)f | |
11438 | Ft(SIGTTIN)p Fu(,)150 1482 y Ft(SIGTTOU)p Fu(,)h(and)g | |
11439 | Ft(SIGTSTP)p Fu(.)275 1641 y(The)h(shell)i(exits)g(b)m(y)f(default)g | |
11440 | (up)s(on)f(receipt)i(of)f(a)h Ft(SIGHUP)p Fu(.)42 b(Before)32 | |
11441 | b(exiting,)h(an)e(in)m(teractiv)m(e)j(shell)150 1750 | |
11442 | y(resends)41 b(the)i Ft(SIGHUP)e Fu(to)i(all)g(jobs,)i(running)c(or)h | |
11443 | (stopp)s(ed.)76 b(Stopp)s(ed)41 b(jobs)h(are)h(sen)m(t)g | |
11444 | Ft(SIGCONT)d Fu(to)150 1860 y(ensure)32 b(that)h(they)g(receiv)m(e)i | |
11445 | (the)e Ft(SIGHUP)p Fu(.)47 b(T)-8 b(o)33 b(prev)m(en)m(t)g(the)g(shell) | |
11446 | g(from)g(sending)f(the)h Ft(SIGHUP)e Fu(signal)150 1969 | |
11447 | y(to)i(a)g(particular)g(job,)g(it)g(should)f(b)s(e)g(remo)m(v)m(ed)h | |
11448 | (from)g(the)f(jobs)g(table)i(with)e(the)h Ft(disown)e | |
11449 | Fu(builtin)h(\(see)150 2079 y(Section)c(7.2)g([Job)e(Con)m(trol)i | |
11450 | (Builtins],)g(page)g(113\))h(or)e(mark)m(ed)g(to)g(not)g(receiv)m(e)i | |
11451 | Ft(SIGHUP)c Fu(using)i Ft(disown)150 2189 y(-h)p Fu(.)275 | |
11452 | 2348 y(If)38 b(the)h Ft(huponexit)e Fu(shell)i(option)g(has)g(b)s(een)f | |
11453 | (set)i(with)f Ft(shopt)e Fu(\(see)j(Section)g(4.3.2)h([The)e(Shopt)150 | |
11454 | 2457 y(Builtin],)31 b(page)g(70\),)h(Bash)f(sends)e(a)i | |
595e3e69 | 11455 | Ft(SIGHUP)e Fu(to)i(all)g(jobs)f(when)f(an)i(in)m(teractiv)m(e)i(login) |
3011048a | 11456 | e(shell)g(exits.)275 2616 y(If)38 b(Bash)h(is)g(w)m(aiting)h(for)f(a)g |
595e3e69 | 11457 | (command)f(to)i(complete)g(and)e(receiv)m(es)j(a)e(signal)h(for)e(whic) |
3011048a | 11458 | m(h)h(a)g(trap)150 2726 y(has)c(b)s(een)f(set,)i(the)f(trap)g(will)g |
595e3e69 | 11459 | (not)g(b)s(e)f(executed)i(un)m(til)f(the)g(command)f(completes.)55 |
3011048a | 11460 | b(When)35 b(Bash)g(is)150 2835 y(w)m(aiting)j(for)f(an)g(async)m |
595e3e69 | 11461 | (hronous)g(command)g(via)h(the)f Ft(wait)f Fu(builtin,)i(the)g |
3011048a | 11462 | (reception)g(of)f(a)g(signal)h(for)150 2945 y(whic)m(h)d(a)g(trap)g |
6e51e0d0 CR |
11463 | (has)g(b)s(een)f(set)h(will)h(cause)f(the)g Ft(wait)f |
11464 | Fu(builtin)h(to)g(return)f(immediately)i(with)f(an)g(exit)150 | |
3011048a CR |
11465 | 3055 y(status)c(greater)g(than)f(128,)i(immediately)g(after)f(whic)m(h) |
11466 | f(the)h(trap)f(is)g(executed.)275 3214 y(When)41 b(job)g(con)m(trol)h | |
e59452c7 | 11467 | (is)g(not)f(enabled,)k(and)40 b(Bash)i(is)f(w)m(aiting)i(for)e(a)h |
3011048a | 11468 | (foreground)e(command)h(to)150 3323 y(complete,)35 b(the)e(shell)h |
e59452c7 | 11469 | (receiv)m(es)g(k)m(eyb)s(oard-generated)g(signals)g(suc)m(h)e(as)i |
3011048a | 11470 | Ft(SIGINT)d Fu(\(usually)i(generated)150 3433 y(b)m(y)e(`)p |
e59452c7 CR |
11471 | Ft(^C)p Fu('\))h(that)g(users)e(commonly)i(in)m(tend)g(to)g(send)e(to)j |
11472 | (that)f(command.)43 b(This)31 b(happ)s(ens)e(b)s(ecause)j(the)150 | |
3011048a | 11473 | 3542 y(shell)23 b(and)g(the)h(command)f(are)g(in)g(the)h(same)f(pro)s |
e59452c7 | 11474 | (cess)g(group)g(as)h(the)f(terminal,)i(and)e(`)p Ft(^C)p |
3011048a | 11475 | Fu(')g(sends)g Ft(SIGINT)150 3652 y Fu(to)35 b(all)g(pro)s(cesses)f(in) |
e59452c7 | 11476 | g(that)g(pro)s(cess)g(group.)51 b(See)35 b(Chapter)e(7)i([Job)f(Con)m |
3011048a CR |
11477 | (trol],)i(page)f(112,)h(for)e(a)h(more)150 3762 y(in-depth)30 |
11478 | b(discussion)f(of)i(pro)s(cess)f(groups.)275 3921 y(When)35 | |
e59452c7 CR |
11479 | b(Bash)h(is)g(running)f(without)h(job)f(con)m(trol)i(enabled)f(and)g |
11480 | (receiv)m(es)h Ft(SIGINT)e Fu(while)h(w)m(aiting)150 | |
3011048a | 11481 | 4030 y(for)g(a)h(foreground)f(command,)i(it)f(w)m(aits)g(un)m(til)g |
e59452c7 | 11482 | (that)g(foreground)f(command)g(terminates)h(and)f(then)150 |
3011048a CR |
11483 | 4140 y(decides)31 b(what)f(to)h(do)f(ab)s(out)g(the)h |
11484 | Ft(SIGINT)p Fu(:)199 4299 y(1.)61 b(If)29 b(the)h(command)f(terminates) | |
e59452c7 | 11485 | i(due)d(to)j(the)e Ft(SIGINT)p Fu(,)g(Bash)g(concludes)h(that)g(the)g |
3011048a | 11486 | (user)f(mean)m(t)h(to)330 4408 y(end)25 b(the)h(en)m(tire)h(script,)g |
e59452c7 | 11487 | (and)f(acts)h(on)e(the)i Ft(SIGINT)d Fu(\(e.g.,)k(b)m(y)e(running)f(a)h |
3011048a CR |
11488 | Ft(SIGINT)e Fu(trap)i(or)g(exiting)330 4518 y(itself)7 |
11489 | b(\);)199 4665 y(2.)61 b(If)39 b(the)g(pip)s(eline)g(do)s(es)g(not)h | |
e59452c7 | 11490 | (terminate)g(due)f(to)h Ft(SIGINT)p Fu(,)g(the)g(program)f(handled)f |
3011048a | 11491 | (the)i Ft(SIGINT)330 4774 y Fu(itself)35 b(and)e(did)h(not)g(treat)h |
e59452c7 | 11492 | (it)g(as)f(a)g(fatal)i(signal.)52 b(In)33 b(that)i(case,)h(Bash)e(do)s |
3011048a | 11493 | (es)g(not)g(treat)i Ft(SIGINT)330 4884 y Fu(as)41 b(a)g(fatal)g |
e59452c7 CR |
11494 | (signal,)j(either,)g(instead)d(assuming)f(that)h(the)g |
11495 | Ft(SIGINT)d Fu(w)m(as)j(used)f(as)h(part)f(of)h(the)330 | |
3011048a | 11496 | 4994 y(program's)32 b(normal)g(op)s(eration)h(\(e.g.,)h |
e59452c7 | 11497 | Ft(emacs)d Fu(uses)g(it)i(to)g(ab)s(ort)f(editing)h(commands\))f(or)g |
3011048a | 11498 | (delib-)330 5103 y(erately)41 b(discarded.)69 b(Ho)m(w)m(ev)m(er,)45 |
e59452c7 | 11499 | b(Bash)40 b(will)h(run)d(an)m(y)j(trap)e(set)i(on)f Ft(SIGINT)p |
3011048a | 11500 | Fu(,)h(as)f(it)h(do)s(es)e(with)330 5213 y(an)m(y)31 |
e59452c7 CR |
11501 | b(other)f(trapp)s(ed)f(signal)i(it)g(receiv)m(es)h(while)e(it)h(is)f(w) |
11502 | m(aiting)h(for)f(the)h(foreground)e(command)h(to)330 | |
3011048a CR |
11503 | 5322 y(complete,)i(for)e(compatibilit)m(y)-8 b(.)p eop |
11504 | end | |
e59452c7 CR |
11505 | %%Page: 46 52 |
11506 | TeXDict begin 46 51 bop 150 -116 a Fu(Chapter)30 b(3:)41 | |
11507 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(46)150 299 | |
3011048a CR |
11508 | y Fs(3.8)68 b(Shell)45 b(Scripts)150 458 y Fu(A)30 b(shell)f(script)h |
11509 | (is)f(a)h(text)h(\014le)f(con)m(taining)h(shell)f(commands.)40 | |
11510 | b(When)29 b(suc)m(h)g(a)h(\014le)g(is)f(used)g(as)h(the)g(\014rst)150 | |
11511 | 568 y(non-option)c(argumen)m(t)h(when)e(in)m(v)m(oking)i(Bash,)g(and)f | |
11512 | (neither)g(the)g Ft(-c)g Fu(nor)f Ft(-s)h Fu(option)g(is)g(supplied)f | |
11513 | (\(see)150 677 y(Section)39 b(6.1)g([In)m(v)m(oking)g(Bash],)h(page)f | |
11514 | (90\),)i(Bash)d(reads)g(and)f(executes)i(commands)f(from)f(the)i | |
11515 | (\014le,)150 787 y(then)32 b(exits.)46 b(This)32 b(mo)s(de)f(of)i(op)s | |
11516 | (eration)f(creates)i(a)e(non-in)m(teractiv)m(e)j(shell.)46 | |
11517 | b(The)31 b(shell)i(\014rst)e(searc)m(hes)150 897 y(for)d(the)g(\014le)g | |
11518 | (in)g(the)g(curren)m(t)f(directory)-8 b(,)30 b(and)d(lo)s(oks)i(in)e | |
11519 | (the)i(directories)g(in)e Ft($PATH)g Fu(if)h(not)g(found)e(there.)275 | |
11520 | 1031 y(When)34 b(Bash)h(runs)e(a)i(shell)g(script,)g(it)h(sets)f(the)f | |
e59452c7 | 11521 | (sp)s(ecial)i(parameter)f Ft(0)f Fu(to)h(the)g(name)g(of)g(the)g |
3011048a | 11522 | (\014le,)150 1141 y(rather)k(than)g(the)h(name)f(of)h(the)f(shell,)j |
e59452c7 | 11523 | (and)d(the)h(p)s(ositional)g(parameters)f(are)h(set)g(to)g(the)g |
3011048a CR |
11524 | (remain-)150 1250 y(ing)f(argumen)m(ts,)j(if)d(an)m(y)g(are)g(giv)m |
11525 | (en.)67 b(If)39 b(no)g(additional)g(argumen)m(ts)h(are)f(supplied,)h | |
11526 | (the)f(p)s(ositional)150 1360 y(parameters)31 b(are)f(unset.)275 | |
11527 | 1494 y(A)39 b(shell)h(script)f(ma)m(y)h(b)s(e)f(made)h(executable)h(b)m | |
6e51e0d0 | 11528 | (y)e(using)g(the)h Ft(chmod)e Fu(command)h(to)h(turn)e(on)i(the)150 |
3011048a | 11529 | 1604 y(execute)j(bit.)73 b(When)41 b(Bash)g(\014nds)e(suc)m(h)i(a)h |
6e51e0d0 | 11530 | (\014le)f(while)g(searc)m(hing)h(the)f Ft($PATH)f Fu(for)h(a)h |
3011048a | 11531 | (command,)h(it)150 1714 y(creates)32 b(a)f(new)e(instance)i(of)g |
e59452c7 | 11532 | (itself)g(to)g(execute)h(it.)41 b(In)30 b(other)h(w)m(ords,)f |
3011048a CR |
11533 | (executing)390 1848 y Ft(filename)46 b Fj(arguments)150 |
11534 | 1983 y Fu(is)30 b(equiv)-5 b(alen)m(t)32 b(to)f(executing)390 | |
11535 | 2117 y Ft(bash)47 b(filename)e Fj(arguments)150 2252 | |
e59452c7 CR |
11536 | y Fu(if)30 b Ft(filename)d Fu(is)j(an)f(executable)j(shell)e(script.)40 |
11537 | b(This)29 b(subshell)g(reinitializes)i(itself,)g(so)f(that)h(the)e | |
3011048a | 11538 | (e\013ect)150 2361 y(is)36 b(as)h(if)g(a)f(new)g(shell)h(had)f(b)s(een) |
e59452c7 | 11539 | g(in)m(v)m(ok)m(ed)h(to)h(in)m(terpret)e(the)h(script,)h(with)e(the)h |
3011048a | 11540 | (exception)h(that)f(the)150 2471 y(lo)s(cations)25 b(of)g(commands)e |
e59452c7 CR |
11541 | (remem)m(b)s(ered)h(b)m(y)g(the)g(paren)m(t)g(\(see)h(the)f |
11542 | (description)g(of)g Ft(hash)f Fu(in)h(Section)h(4.1)150 | |
3011048a CR |
11543 | 2580 y([Bourne)30 b(Shell)h(Builtins],)g(page)g(47\))h(are)e(retained)h |
11544 | (b)m(y)f(the)h(c)m(hild.)275 2715 y(Most)36 b(v)m(ersions)g(of)g(Unix)f | |
e59452c7 | 11545 | (mak)m(e)h(this)g(a)g(part)f(of)h(the)g(op)s(erating)g(system's)f |
3011048a | 11546 | (command)h(execution)150 2824 y(mec)m(hanism.)50 b(If)33 |
e59452c7 CR |
11547 | b(the)g(\014rst)g(line)h(of)f(a)h(script)f(b)s(egins)g(with)g(the)g(t)m |
11548 | (w)m(o)i(c)m(haracters)g(`)p Ft(#!)p Fu(',)f(the)g(remainder)150 | |
3011048a | 11549 | 2934 y(of)27 b(the)g(line)g(sp)s(eci\014es)g(an)g(in)m(terpreter)g(for) |
e59452c7 | 11550 | g(the)g(program)g(and,)g(dep)s(ending)e(on)i(the)g(op)s(erating)h |
3011048a | 11551 | (system,)150 3044 y(one)e(or)g(more)g(optional)h(argumen)m(ts)f(for)g |
e59452c7 | 11552 | (that)g(in)m(terpreter.)40 b(Th)m(us,)26 b(y)m(ou)g(can)g(sp)s(ecify)g |
3011048a | 11553 | (Bash,)h Ft(awk)p Fu(,)f(P)m(erl,)150 3153 y(or)k(some)h(other)g(in)m |
e59452c7 | 11554 | (terpreter)g(and)e(write)i(the)f(rest)h(of)g(the)f(script)g(\014le)h |
3011048a | 11555 | (in)f(that)h(language.)275 3288 y(The)k(argumen)m(ts)h(to)h(the)f(in)m |
e59452c7 | 11556 | (terpreter)h(consist)f(of)h(one)f(or)g(more)g(optional)h(argumen)m(ts)f |
3011048a | 11557 | (follo)m(wing)150 3397 y(the)e(in)m(terpreter)g(name)g(on)g(the)g |
e59452c7 | 11558 | (\014rst)g(line)g(of)g(the)g(script)g(\014le,)h(follo)m(w)m(ed)h(b)m(y) |
3011048a | 11559 | e(the)g(name)g(of)g(the)g(script)150 3507 y(\014le,)k(follo)m(w)m(ed)g |
e59452c7 CR |
11560 | (b)m(y)e(the)g(rest)g(of)g(the)h(argumen)m(ts)f(supplied)f(to)i(the)f |
11561 | (script.)58 b(The)35 b(details)i(of)g(ho)m(w)f(the)150 | |
3011048a | 11562 | 3616 y(in)m(terpreter)26 b(line)g(is)g(split)g(in)m(to)h(an)f(in)m |
e59452c7 | 11563 | (terpreter)g(name)g(and)f(a)h(set)h(of)e(argumen)m(ts)i(v)-5 |
3011048a | 11564 | b(ary)25 b(across)i(systems.)150 3726 y(Bash)j(will)f(p)s(erform)g |
e59452c7 | 11565 | (this)g(action)i(on)e(op)s(erating)h(systems)g(that)g(do)f(not)h |
3011048a | 11566 | (handle)f(it)h(themselv)m(es.)42 b(Note)150 3836 y(that)e(some)g(older) |
e59452c7 | 11567 | g(v)m(ersions)g(of)g(Unix)f(limit)i(the)f(in)m(terpreter)g(name)g(and)f |
3011048a | 11568 | (a)h(single)g(argumen)m(t)g(to)h(a)150 3945 y(maxim)m(um)21 |
e59452c7 CR |
11569 | b(of)g(32)h(c)m(haracters,)j(so)c(it's)h(not)g(p)s(ortable)f(to)h |
11570 | (assume)e(that)i(using)f(more)g(than)g(one)g(argumen)m(t)150 | |
3011048a | 11571 | 4055 y(will)31 b(w)m(ork.)275 4189 y(Bash)h(scripts)g(often)g(b)s(egin) |
e59452c7 | 11572 | g(with)g Ft(#!)e(/bin/bash)g Fu(\(assuming)i(that)h(Bash)f(has)g(b)s |
3011048a | 11573 | (een)f(installed)i(in)150 4299 y Ft(/bin)p Fu(\),)26 |
e59452c7 CR |
11574 | b(since)h(this)f(ensures)f(that)i(Bash)f(will)h(b)s(e)f(used)f(to)i(in) |
11575 | m(terpret)f(the)h(script,)g(ev)m(en)g(if)f(it)h(is)f(executed)150 | |
3011048a | 11576 | 4408 y(under)h(another)h(shell.)41 b(It's)28 b(a)h(common)g(idiom)f(to) |
e59452c7 | 11577 | h(use)f Ft(env)g Fu(to)h(\014nd)e Ft(bash)g Fu(ev)m(en)i(if)f(it's)i(b) |
3011048a | 11578 | s(een)d(installed)150 4518 y(in)h(another)g(directory:)40 |
e59452c7 | 11579 | b Ft(#!/usr/bin/env)27 b(bash)f Fu(will)j(\014nd)d(the)j(\014rst)e(o)s |
d37a4722 CR |
11580 | (ccurrence)h(of)g Ft(bash)f Fu(in)h Ft($PATH)p Fu(.)p |
11581 | eop end | |
e59452c7 CR |
11582 | %%Page: 47 53 |
11583 | TeXDict begin 47 52 bop 3659 -116 a Fu(47)150 299 y Fp(4)80 | |
967625cd | 11584 | b(Shell)53 b(Builtin)f(Commands)150 499 y Fu(Builtin)34 |
c302751c CR |
11585 | b(commands)f(are)h(con)m(tained)g(within)f(the)h(shell)g(itself.)50 |
11586 | b(When)34 b(the)f(name)h(of)f(a)h(builtin)f(com-)150 | |
967625cd | 11587 | 608 y(mand)26 b(is)i(used)e(as)i(the)g(\014rst)e(w)m(ord)h(of)h(a)f |
d37a4722 | 11588 | (simple)h(command)f(\(see)h(Section)g(3.2.2)h([Simple)f(Commands],)150 |
e59452c7 | 11589 | 718 y(page)21 b(9\),)j(the)d(shell)g(executes)h(the)f(command)f |
37c41ab1 | 11590 | (directly)-8 b(,)24 b(without)d(in)m(v)m(oking)h(another)f(program.)37 |
967625cd | 11591 | b(Builtin)150 828 y(commands)f(are)h(necessary)g(to)g(implemen)m(t)g |
37c41ab1 | 11592 | (functionalit)m(y)h(imp)s(ossible)e(or)h(incon)m(v)m(enien)m(t)h(to)f |
967625cd CR |
11593 | (obtain)150 937 y(with)30 b(separate)h(utilities.)275 |
11594 | 1065 y(This)c(section)j(brie\015y)e(describ)s(es)g(the)h(builtins)f | |
ac18b312 | 11595 | (whic)m(h)g(Bash)h(inherits)f(from)g(the)h(Bourne)g(Shell,)g(as)150 |
967625cd | 11596 | 1174 y(w)m(ell)i(as)g(the)g(builtin)e(commands)h(whic)m(h)h(are)f |
ac18b312 | 11597 | (unique)g(to)h(or)f(ha)m(v)m(e)i(b)s(een)d(extended)i(in)f(Bash.)275 |
967625cd | 11598 | 1302 y(Sev)m(eral)45 b(builtin)e(commands)h(are)h(describ)s(ed)e(in)h |
ac18b312 | 11599 | (other)g(c)m(hapters:)69 b(builtin)43 b(commands)h(whic)m(h)150 |
967625cd | 11600 | 1412 y(pro)m(vide)23 b(the)h(Bash)f(in)m(terface)i(to)f(the)g(job)f |
37c41ab1 | 11601 | (con)m(trol)i(facilities)g(\(see)f(Section)h(7.2)f([Job)f(Con)m(trol)h |
fffe80d4 | 11602 | (Builtins],)150 1521 y(page)33 b(113\),)i(the)e(directory)g(stac)m(k)h |
e59452c7 CR |
11603 | (\(see)f(Section)h(6.8.1)g([Directory)g(Stac)m(k)g(Builtins],)g(page)f |
11604 | (101\),)i(the)150 1631 y(command)23 b(history)h(\(see)g(Section)g(9.2)h | |
fffe80d4 | 11605 | ([Bash)f(History)g(Builtins],)h(page)g(151\),)h(and)d(the)h |
967625cd | 11606 | (programmable)150 1740 y(completion)32 b(facilities)g(\(see)g(Section)f |
fffe80d4 | 11607 | (8.7)g([Programmable)g(Completion)g(Builtins],)g(page)h(145\).)275 |
967625cd CR |
11608 | 1868 y(Man)m(y)f(of)f(the)h(builtins)e(ha)m(v)m(e)j(b)s(een)e(extended) |
11609 | g(b)m(y)g Fm(posix)g Fu(or)g(Bash.)275 1996 y(Unless)20 | |
d7935593 | 11610 | b(otherwise)h(noted,)h(eac)m(h)g(builtin)e(command)g(do)s(cumen)m(ted)g |
560db36b CR |
11611 | (as)h(accepting)h(options)e(preceded)150 2105 y(b)m(y)42 |
11612 | b(`)p Ft(-)p Fu(')g(accepts)h(`)p Ft(--)p Fu(')f(to)h(signify)f(the)g | |
11613 | (end)f(of)h(the)g(options.)76 b(The)41 b Ft(:)p Fu(,)k | |
11614 | Ft(true)p Fu(,)f Ft(false)p Fu(,)g(and)d Ft(test)p Fu(/)p | |
11615 | Ft([)150 2215 y Fu(builtins)32 b(do)g(not)h(accept)h(options)f(and)f | |
11616 | (do)g(not)h(treat)g(`)p Ft(--)p Fu(')g(sp)s(ecially)-8 | |
11617 | b(.)48 b(The)32 b Ft(exit)p Fu(,)g Ft(logout)p Fu(,)f | |
11618 | Ft(return)p Fu(,)150 2325 y Ft(break)p Fu(,)38 b Ft(continue)p | |
11619 | Fu(,)f Ft(let)p Fu(,)i(and)d Ft(shift)g Fu(builtins)h(accept)i(and)e | |
11620 | (pro)s(cess)g(argumen)m(ts)h(b)s(eginning)e(with)150 | |
11621 | 2434 y(`)p Ft(-)p Fu(')h(without)f(requiring)g(`)p Ft(--)p | |
11622 | Fu('.)59 b(Other)36 b(builtins)g(that)h(accept)h(argumen)m(ts)f(but)f | |
11623 | (are)h(not)g(sp)s(eci\014ed)f(as)150 2544 y(accepting)28 | |
11624 | b(options)f(in)m(terpret)g(argumen)m(ts)g(b)s(eginning)e(with)i(`)p | |
11625 | Ft(-)p Fu(')f(as)h(in)m(v)-5 b(alid)27 b(options)g(and)f(require)g(`)p | |
11626 | Ft(--)p Fu(')150 2653 y(to)31 b(prev)m(en)m(t)g(this)f(in)m | |
11627 | (terpretation.)150 2880 y Fs(4.1)68 b(Bourne)45 b(Shell)g(Builtins)150 | |
11628 | 3040 y Fu(The)22 b(follo)m(wing)j(shell)d(builtin)h(commands)f(are)h | |
11629 | (inherited)g(from)f(the)h(Bourne)g(Shell.)38 b(These)22 | |
11630 | b(commands)150 3149 y(are)31 b(implemen)m(ted)g(as)f(sp)s(eci\014ed)g | |
11631 | (b)m(y)g(the)h Fm(posix)e Fu(standard.)150 3295 y Ft(:)h | |
11632 | Fu(\(a)h(colon\))870 3405 y Ft(:)47 b([)p Fj(arguments)p | |
11633 | Ft(])630 3532 y Fu(Do)c(nothing)f(b)s(ey)m(ond)g(expanding)f | |
11634 | Fr(argumen)m(ts)46 b Fu(and)c(p)s(erforming)f(redirections.)76 | |
11635 | b(The)630 3642 y(return)29 b(status)i(is)f(zero.)150 | |
967625cd | 11636 | 3788 y Ft(.)g Fu(\(a)h(p)s(erio)s(d\))870 3897 y Ft(.)47 |
bce12dd7 | 11637 | b Fj(filename)f Ft([)p Fj(arguments)p Ft(])630 4025 y |
6e51e0d0 CR |
11638 | Fu(Read)34 b(and)f(execute)i(commands)e(from)g(the)h |
11639 | Fr(\014lename)39 b Fu(argumen)m(t)34 b(in)f(the)h(curren)m(t)g(shell) | |
bce12dd7 | 11640 | 630 4134 y(con)m(text.)45 b(If)31 b Fr(\014lename)37 |
6e51e0d0 CR |
11641 | b Fu(do)s(es)31 b(not)g(con)m(tain)i(a)e(slash,)h(the)g |
11642 | Ft(PATH)e Fu(v)-5 b(ariable)32 b(is)f(used)f(to)i(\014nd)630 | |
e59452c7 CR |
11643 | 4244 y Fr(\014lename)p Fu(,)38 b(but)e Fr(\014lename)41 |
11644 | b Fu(do)s(es)36 b(not)h(need)f(to)h(b)s(e)e(executable.)60 | |
11645 | b(When)36 b(Bash)g(is)h(not)f(in)630 4354 y Fm(posix)25 | |
11646 | b Fu(mo)s(de,)i(the)f(curren)m(t)g(directory)g(is)g(searc)m(hed)h(if)e | |
11647 | Fr(\014lename)32 b Fu(is)26 b(not)g(found)e(in)i Ft($PATH)p | |
11648 | Fu(.)630 4463 y(If)39 b(an)m(y)h Fr(argumen)m(ts)j Fu(are)d(supplied,)h | |
11649 | (they)e(b)s(ecome)h(the)g(p)s(ositional)g(parameters)g(when)630 | |
11650 | 4573 y Fr(\014lename)i Fu(is)36 b(executed.)60 b(Otherwise)36 | |
11651 | b(the)h(p)s(ositional)g(parameters)g(are)g(unc)m(hanged.)58 | |
11652 | b(If)630 4682 y(the)33 b Ft(-T)g Fu(option)g(is)g(enabled,)h | |
11653 | Ft(.)f Fu(inherits)g(an)m(y)g(trap)g(on)g Ft(DEBUG)p | |
11654 | Fu(;)g(if)g(it)h(is)f(not,)h(an)m(y)f Ft(DEBUG)630 4792 | |
11655 | y Fu(trap)f(string)g(is)g(sa)m(v)m(ed)h(and)f(restored)g(around)f(the)i | |
11656 | (call)g(to)g Ft(.)p Fu(,)f(and)g Ft(.)g Fu(unsets)f(the)h | |
11657 | Ft(DEBUG)630 4902 y Fu(trap)f(while)h(it)g(executes.)46 | |
11658 | b(If)31 b Ft(-T)g Fu(is)g(not)h(set,)h(and)d(the)i(sourced)f(\014le)h | |
11659 | (c)m(hanges)h(the)e Ft(DEBUG)630 5011 y Fu(trap,)e(the)f(new)g(v)-5 | |
11660 | b(alue)29 b(is)f(retained)h(when)e Ft(.)h Fu(completes.)42 | |
11661 | b(The)27 b(return)h(status)g(is)h(the)f(exit)630 5121 | |
11662 | y(status)k(of)f(the)h(last)g(command)f(executed,)i(or)f(zero)g(if)f(no) | |
11663 | h(commands)f(are)h(executed.)44 b(If)630 5230 y Fr(\014lename)d | |
11664 | Fu(is)36 b(not)g(found,)h(or)e(cannot)i(b)s(e)e(read,)j(the)e(return)f | |
11665 | (status)h(is)g(non-zero.)58 b(This)630 5340 y(builtin)30 | |
11666 | b(is)g(equiv)-5 b(alen)m(t)32 b(to)f Ft(source)p Fu(.)p | |
11667 | eop end | |
11668 | %%Page: 48 54 | |
11669 | TeXDict begin 48 53 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
11670 | b(Shell)30 b(Builtin)h(Commands)2069 b(48)150 299 y Ft(break)870 | |
11671 | 433 y(break)46 b([)p Fj(n)p Ft(])630 568 y Fu(Exit)f(from)f(a)g | |
bce12dd7 CR |
11672 | Ft(for)p Fu(,)k Ft(while)p Fu(,)e Ft(until)p Fu(,)h(or)d |
11673 | Ft(select)f Fu(lo)s(op.)83 b(If)44 b Fr(n)g Fu(is)g(supplied,)j(the)e | |
e59452c7 | 11674 | Fr(n)p Fu(th)630 677 y(enclosing)c(lo)s(op)f(is)h(exited.)70 |
bce12dd7 | 11675 | b Fr(n)40 b Fu(m)m(ust)g(b)s(e)f(greater)j(than)d(or)i(equal)f(to)h(1.) |
e59452c7 | 11676 | 70 b(The)40 b(return)630 787 y(status)31 b(is)f(zero)h(unless)f |
bce12dd7 | 11677 | Fr(n)g Fu(is)g(not)h(greater)g(than)g(or)f(equal)h(to)g(1.)150 |
e59452c7 CR |
11678 | 946 y Ft(cd)870 1081 y(cd)47 b([-L|[-P)f([-e]])g([-@])h([)p |
11679 | Fj(directory)p Ft(])630 1215 y Fu(Change)27 b(the)g(curren)m(t)f(w)m | |
bce12dd7 | 11680 | (orking)h(directory)g(to)h Fr(directory)p Fu(.)40 b(If)26 |
e59452c7 CR |
11681 | b Fr(directory)35 b Fu(is)27 b(not)g(supplied,)630 1325 |
11682 | y(the)k(v)-5 b(alue)31 b(of)g(the)g Ft(HOME)e Fu(shell)i(v)-5 | |
11683 | b(ariable)32 b(is)f(used.)40 b(If)31 b(the)g(shell)g(v)-5 | |
11684 | b(ariable)31 b Ft(CDPATH)e Fu(exists,)630 1435 y(it)44 | |
11685 | b(is)f(used)g(as)h(a)f(searc)m(h)h(path:)67 b(eac)m(h)45 | |
11686 | b(directory)f(name)f(in)g Ft(CDPATH)f Fu(is)h(searc)m(hed)h(for)630 | |
11687 | 1544 y Fr(directory)p Fu(,)k(with)c(alternativ)m(e)i(directory)f(names) | |
11688 | e(in)h Ft(CDPATH)e Fu(separated)j(b)m(y)f(a)g(colon)630 | |
11689 | 1654 y(\(`)p Ft(:)p Fu('\).)e(If)30 b Fr(directory)38 | |
11690 | b Fu(b)s(egins)30 b(with)g(a)h(slash,)f Ft(CDPATH)f Fu(is)h(not)h | |
11691 | (used.)630 1788 y(The)g Ft(-P)h Fu(option)g(means)g(to)h(not)f(follo)m | |
11692 | (w)h(sym)m(b)s(olic)g(links:)44 b(sym)m(b)s(olic)32 b(links)g(are)g | |
11693 | (resolv)m(ed)630 1898 y(while)41 b Ft(cd)f Fu(is)h(tra)m(v)m(ersing)h | |
6e51e0d0 | 11694 | Fr(directory)49 b Fu(and)40 b(b)s(efore)g(pro)s(cessing)h(an)f |
e59452c7 CR |
11695 | (instance)i(of)f(`)p Ft(..)p Fu(')f(in)630 2007 y Fr(directory)p |
11696 | Fu(.)630 2142 y(By)34 b(default,)h(or)e(when)g(the)g | |
6e51e0d0 | 11697 | Ft(-L)g Fu(option)h(is)g(supplied,)f(sym)m(b)s(olic)h(links)f(in)h |
e59452c7 | 11698 | Fr(directory)42 b Fu(are)630 2252 y(resolv)m(ed)31 b(after)g |
6e51e0d0 | 11699 | Ft(cd)f Fu(pro)s(cesses)g(an)g(instance)h(of)g(`)p Ft(..)p |
e59452c7 | 11700 | Fu(')f(in)g Fr(directory)p Fu(.)630 2386 y(If)35 b(`)p |
6e51e0d0 CR |
11701 | Ft(..)p Fu(')f(app)s(ears)h(in)f Fr(directory)p Fu(,)j(it)f(is)f(pro)s |
11702 | (cessed)f(b)m(y)h(remo)m(ving)h(the)f(immediately)h(pre-)630 | |
e59452c7 | 11703 | 2496 y(ceding)31 b(pathname)f(comp)s(onen)m(t,)h(bac)m(k)g(to)g(a)g |
6e51e0d0 | 11704 | (slash)f(or)h(the)f(b)s(eginning)g(of)g Fr(directory)p |
e59452c7 | 11705 | Fu(.)630 2630 y(If)i(the)i Ft(-e)e Fu(option)h(is)g(supplied)f(with)g |
6e51e0d0 | 11706 | Ft(-P)h Fu(and)f(the)h(curren)m(t)g(w)m(orking)g(directory)g(cannot)630 |
e59452c7 | 11707 | 2740 y(b)s(e)k(successfully)g(determined)g(after)i(a)e(successful)h |
6e51e0d0 | 11708 | (directory)g(c)m(hange,)i Ft(cd)d Fu(will)h(return)630 |
e59452c7 | 11709 | 2849 y(an)30 b(unsuccessful)f(status.)630 2984 y(On)41 |
6e51e0d0 CR |
11710 | b(systems)h(that)h(supp)s(ort)d(it,)46 b(the)c Ft(-@)g |
11711 | Fu(option)g(presen)m(ts)g(the)g(extended)g(attributes)630 | |
e59452c7 CR |
11712 | 3093 y(asso)s(ciated)32 b(with)e(a)h(\014le)f(as)h(a)f(directory)-8 |
11713 | b(.)630 3228 y(If)41 b Fr(directory)49 b Fu(is)41 b(`)p | |
6e51e0d0 | 11714 | Ft(-)p Fu(',)j(it)e(is)f(con)m(v)m(erted)h(to)g Ft($OLDPWD)d |
e59452c7 CR |
11715 | Fu(b)s(efore)i(the)g(directory)h(c)m(hange)g(is)630 3337 |
11716 | y(attempted.)630 3472 y(If)33 b(a)h(non-empt)m(y)g(directory)g(name)f | |
6e51e0d0 | 11717 | (from)g Ft(CDPATH)f Fu(is)h(used,)h(or)g(if)f(`)p Ft(-)p |
e59452c7 | 11718 | Fu(')h(is)f(the)h(\014rst)f(argu-)630 3582 y(men)m(t,)28 |
d76edd30 | 11719 | b(and)e(the)h(directory)g(c)m(hange)h(is)f(successful,)h(the)f |
e59452c7 | 11720 | (absolute)g(pathname)g(of)f(the)h(new)630 3691 y(w)m(orking)k |
d76edd30 | 11721 | (directory)g(is)f(written)g(to)i(the)e(standard)g(output.)630 |
e59452c7 CR |
11722 | 3826 y(If)i(the)i(directory)f(c)m(hange)h(is)f(successful,)h |
11723 | Ft(cd)e Fu(sets)h(the)h(v)-5 b(alue)33 b(of)g(the)g Ft(PWD)f | |
11724 | Fu(en)m(vironmen)m(t)630 3935 y(v)-5 b(ariable)32 b(to)g(the)f(new)g | |
11725 | (directory)g(name,)h(and)e(sets)i(the)f Ft(OLDPWD)e Fu(en)m(vironmen)m | |
11726 | (t)j(v)-5 b(ariable)630 4045 y(to)31 b(the)g(v)-5 b(alue)31 | |
11727 | b(of)f(the)h(curren)m(t)f(w)m(orking)g(directory)h(b)s(efore)f(the)h(c) | |
11728 | m(hange.)630 4179 y(The)e(return)g(status)h(is)f(zero)i(if)e(the)h | |
11729 | (directory)g(is)g(successfully)g(c)m(hanged,)g(non-zero)g(oth-)630 | |
11730 | 4289 y(erwise.)150 4448 y Ft(continue)870 4583 y(continue)46 | |
11731 | b([)p Fj(n)p Ft(])630 4717 y Fu(Resume)32 b(the)g(next)g(iteration)i | |
6e51e0d0 | 11732 | (of)e(an)g(enclosing)h Ft(for)p Fu(,)f Ft(while)p Fu(,)f |
e59452c7 | 11733 | Ft(until)p Fu(,)g(or)h Ft(select)f Fu(lo)s(op.)630 4827 |
6e51e0d0 CR |
11734 | y(If)f Fr(n)h Fu(is)g(supplied,)e(the)j(execution)g(of)f(the)g |
11735 | Fr(n)p Fu(th)f(enclosing)i(lo)s(op)f(is)f(resumed.)42 | |
e59452c7 | 11736 | b Fr(n)30 b Fu(m)m(ust)h(b)s(e)630 4936 y(greater)39 |
37c41ab1 | 11737 | b(than)f(or)g(equal)g(to)h(1.)63 b(The)38 b(return)e(status)j(is)e |
e59452c7 CR |
11738 | (zero)i(unless)e Fr(n)h Fu(is)g(not)g(greater)630 5046 |
11739 | y(than)30 b(or)g(equal)h(to)g(1.)150 5205 y Ft(eval)870 | |
11740 | 5340 y(eval)47 b([)p Fj(arguments)p Ft(])p eop end | |
11741 | %%Page: 49 55 | |
11742 | TeXDict begin 49 54 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
11743 | b(Shell)30 b(Builtin)h(Commands)2069 b(49)630 299 y(The)25 | |
6e51e0d0 | 11744 | b(argumen)m(ts)h(are)g(concatenated)i(together)f(in)m(to)f(a)g(single)h |
e59452c7 | 11745 | (command,)f(whic)m(h)g(is)f(then)630 408 y(read)35 b(and)g(executed,)j |
6e51e0d0 | 11746 | (and)d(its)h(exit)g(status)g(returned)e(as)h(the)h(exit)g(status)g(of)g |
e59452c7 | 11747 | Ft(eval)p Fu(.)54 b(If)630 518 y(there)31 b(are)f(no)h(argumen)m(ts)f |
6e51e0d0 | 11748 | (or)h(only)f(empt)m(y)h(argumen)m(ts,)g(the)f(return)g(status)g(is)h |
e59452c7 CR |
11749 | (zero.)150 679 y Ft(exec)870 815 y(exec)47 b([-cl])f([-a)h |
11750 | Fj(name)p Ft(])f([)p Fj(command)g Ft([)p Fj(arguments)p | |
11751 | Ft(]])630 950 y Fu(If)36 b Fr(command)k Fu(is)c(supplied,)h(it)g | |
11752 | (replaces)h(the)e(shell)h(without)f(creating)i(a)f(new)f(pro)s(cess.) | |
11753 | 630 1060 y(If)k(the)h Ft(-l)e Fu(option)i(is)g(supplied,)h(the)e(shell) | |
11754 | h(places)g(a)g(dash)f(at)h(the)f(b)s(eginning)g(of)h(the)630 | |
11755 | 1169 y(zeroth)36 b(argumen)m(t)h(passed)e(to)h Fr(command)p | |
11756 | Fu(.)57 b(This)35 b(is)h(what)f(the)h Ft(login)e Fu(program)i(do)s(es.) | |
11757 | 630 1279 y(The)i Ft(-c)g Fu(option)g(causes)h Fr(command)j | |
11758 | Fu(to)d(b)s(e)f(executed)h(with)f(an)g(empt)m(y)h(en)m(vironmen)m(t.) | |
11759 | 630 1388 y(If)c Ft(-a)g Fu(is)h(supplied,)f(the)h(shell)g(passes)f | |
11760 | Fr(name)41 b Fu(as)36 b(the)f(zeroth)i(argumen)m(t)f(to)g | |
11761 | Fr(command)p Fu(.)630 1498 y(If)c Fr(command)j Fu(cannot)e(b)s(e)f | |
45c0f7f8 | 11762 | (executed)h(for)f(some)g(reason,)h(a)g(non-in)m(teractiv)m(e)i(shell)d |
e59452c7 | 11763 | (exits,)630 1608 y(unless)27 b(the)g Ft(execfail)e Fu(shell)i(option)h |
45c0f7f8 | 11764 | (is)f(enabled.)40 b(In)27 b(that)g(case,)j(it)d(returns)f(failure.)40 |
e59452c7 | 11765 | b(An)630 1717 y(in)m(teractiv)m(e)35 b(shell)d(returns)f(failure)h(if)g |
560db36b | 11766 | (the)g(\014le)g(cannot)h(b)s(e)e(executed.)47 b(A)32 |
e59452c7 | 11767 | b(subshell)f(exits)630 1827 y(unconditionally)j(if)g |
560db36b | 11768 | Ft(exec)f Fu(fails.)52 b(If)33 b(no)h Fr(command)j Fu(is)d(sp)s |
e59452c7 | 11769 | (eci\014ed,)h(redirections)f(ma)m(y)h(b)s(e)630 1936 |
560db36b CR |
11770 | y(used)30 b(to)i(a\013ect)g(the)f(curren)m(t)g(shell)g(en)m(vironmen)m |
11771 | (t.)43 b(If)30 b(there)i(are)f(no)g(redirection)g(errors,)630 | |
e59452c7 CR |
11772 | 2046 y(the)g(return)e(status)i(is)f(zero;)h(otherwise)g(the)g(return)e |
11773 | (status)i(is)f(non-zero.)150 2207 y Ft(exit)870 2342 | |
11774 | y(exit)47 b([)p Fj(n)p Ft(])630 2478 y Fu(Exit)30 b(the)g(shell,)h | |
560db36b | 11775 | (returning)d(a)j(status)f(of)g Fr(n)f Fu(to)h(the)g(shell's)g(paren)m |
e59452c7 | 11776 | (t.)41 b(If)30 b Fr(n)f Fu(is)h(omitted,)h(the)630 2587 |
560db36b CR |
11777 | y(exit)c(status)g(is)g(that)g(of)g(the)g(last)g(command)f(executed.)41 |
11778 | b(An)m(y)26 b(trap)h(on)f Ft(EXIT)f Fu(is)i(executed)630 | |
e59452c7 CR |
11779 | 2697 y(b)s(efore)j(the)h(shell)f(terminates.)150 2858 |
11780 | y Ft(export)870 2993 y(export)46 b([-fn])g([-p])h([)p | |
11781 | Fj(name)p Ft([=)p Fj(value)p Ft(]])630 3129 y Fu(Mark)40 | |
560db36b CR |
11782 | b(eac)m(h)h Fr(name)k Fu(to)40 b(b)s(e)f(passed)g(to)i(c)m(hild)f(pro)s |
11783 | (cesses)f(in)g(the)h(en)m(vironmen)m(t.)70 b(If)39 b(the)630 | |
e59452c7 | 11784 | 3238 y Ft(-f)33 b Fu(option)h(is)g(supplied,)f(the)h |
6e51e0d0 | 11785 | Fr(name)5 b Fu(s)33 b(refer)g(to)i(shell)e(functions;)i(otherwise)f |
e59452c7 | 11786 | (the)g(names)630 3348 y(refer)c(to)h(shell)g(v)-5 b(ariables.)41 |
6e51e0d0 | 11787 | b(The)30 b Ft(-n)f Fu(option)i(means)f(to)h(no)f(longer)h(mark)f(eac)m |
e59452c7 CR |
11788 | (h)i Fr(name)j Fu(for)630 3458 y(exp)s(ort.)51 b(If)34 |
11789 | b(no)g Fr(name)5 b Fu(s)34 b(are)g(supplied,)g(or)g(if)g(the)g | |
11790 | Ft(-p)f Fu(option)i(is)f(giv)m(en,)i(a)e(list)h(of)f(names)630 | |
11791 | 3567 y(of)d(all)h(exp)s(orted)e(v)-5 b(ariables)31 b(is)g(displa)m(y)m | |
6e51e0d0 | 11792 | (ed.)43 b(The)30 b Ft(-p)g Fu(option)i(displa)m(ys)e(output)h(in)f(a)h |
e59452c7 | 11793 | (form)630 3677 y(that)25 b(ma)m(y)g(b)s(e)f(reused)g(as)h(input.)38 |
6e51e0d0 CR |
11794 | b(If)24 b(a)h(v)-5 b(ariable)25 b(name)g(is)g(follo)m(w)m(ed)h(b)m(y)e |
11795 | (=)p Fr(v)-5 b(alue)p Fu(,)27 b(the)d(v)-5 b(alue)630 | |
e59452c7 CR |
11796 | 3786 y(of)31 b(the)f(v)-5 b(ariable)31 b(is)g(set)g(to)g |
11797 | Fr(v)-5 b(alue)p Fu(.)630 3922 y(The)29 b(return)e(status)j(is)f(zero)h | |
6e51e0d0 | 11798 | (unless)e(an)h(in)m(v)-5 b(alid)29 b(option)h(is)f(supplied,)f(one)i |
e59452c7 | 11799 | (of)f(the)g(names)630 4031 y(is)k(not)g(a)h(v)-5 b(alid)33 |
6e51e0d0 | 11800 | b(shell)h(v)-5 b(ariable)33 b(name,)i(or)e Ft(-f)f Fu(is)h(supplied)f |
e59452c7 CR |
11801 | (with)h(a)g(name)g(that)h(is)f(not)h(a)630 4141 y(shell)d(function.)150 |
11802 | 4302 y Ft(getopts)870 4437 y(getopts)46 b Fj(optstring)f(name)i | |
11803 | Ft([)p Fj(arg)f Ft(...])630 4573 y(getopts)28 b Fu(is)i(used)g(b)m(y)g | |
6e51e0d0 | 11804 | (shell)g(scripts)g(to)g(parse)g(p)s(ositional)h(parameters.)41 |
e59452c7 | 11805 | b Fr(optstring)d Fu(con-)630 4682 y(tains)k(the)g(option)f(c)m |
6e51e0d0 | 11806 | (haracters)i(to)g(b)s(e)d(recognized;)49 b(if)42 b(a)f(c)m(haracter)j |
e59452c7 | 11807 | (is)d(follo)m(w)m(ed)i(b)m(y)f(a)630 4792 y(colon,)33 |
6e51e0d0 | 11808 | b(the)f(option)g(is)g(exp)s(ected)g(to)h(ha)m(v)m(e)g(an)e(argumen)m |
e59452c7 | 11809 | (t,)i(whic)m(h)f(should)e(b)s(e)h(separated)630 4902 |
6e51e0d0 CR |
11810 | y(from)40 b(it)g(b)m(y)g(whitespace.)70 b(The)40 b(colon)h(\(`)p |
11811 | Ft(:)p Fu('\))g(and)e(question)h(mark)g(\(`)p Ft(?)p | |
e59452c7 | 11812 | Fu('\))h(ma)m(y)f(not)h(b)s(e)630 5011 y(used)d(as)g(option)h(c)m |
6e51e0d0 | 11813 | (haracters.)67 b(Eac)m(h)39 b(time)g(it)g(is)f(in)m(v)m(ok)m(ed,)k |
e59452c7 | 11814 | Ft(getopts)37 b Fu(places)i(the)g(next)630 5121 y(option)29 |
6e51e0d0 CR |
11815 | b(in)f(the)h(shell)g(v)-5 b(ariable)30 b Fr(name)p Fu(,)f(initializing) |
11816 | i Fr(name)j Fu(if)28 b(it)h(do)s(es)g(not)g(exist,)h(and)e(the)630 | |
e59452c7 | 11817 | 5230 y(index)33 b(of)g(the)h(next)f(argumen)m(t)h(to)g(b)s(e)e(pro)s |
6e51e0d0 | 11818 | (cessed)h(in)m(to)h(the)g(v)-5 b(ariable)34 b Ft(OPTIND)p |
e59452c7 | 11819 | Fu(.)48 b Ft(OPTIND)630 5340 y Fu(is)41 b(initialized)i(to)f(1)f(eac)m |
6e51e0d0 | 11820 | (h)h(time)g(the)f(shell)g(or)g(a)g(shell)g(script)g(is)g(in)m(v)m(ok)m |
e59452c7 CR |
11821 | (ed.)74 b(When)41 b(an)p eop end |
11822 | %%Page: 50 56 | |
11823 | TeXDict begin 50 55 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
11824 | b(Shell)30 b(Builtin)h(Commands)2069 b(50)630 299 y(option)36 | |
11825 | b(requires)e(an)h(argumen)m(t,)i Ft(getopts)c Fu(places)j(that)g | |
11826 | (argumen)m(t)g(in)m(to)g(the)f(v)-5 b(ariable)630 408 | |
11827 | y Ft(OPTARG)p Fu(.)55 b(The)35 b(shell)g(do)s(es)h(not)g(reset)g | |
11828 | Ft(OPTIND)e Fu(automatically;)41 b(it)36 b(m)m(ust)f(b)s(e)g(man)m | |
11829 | (ually)630 518 y(reset)i(b)s(et)m(w)m(een)g(m)m(ultiple)h(calls)f(to)g | |
11830 | Ft(getopts)e Fu(within)h(the)h(same)g(shell)f(in)m(v)m(o)s(cation)j(if) | |
11831 | e(a)630 628 y(new)30 b(set)h(of)f(parameters)h(is)f(to)i(b)s(e)d(used.) | |
11832 | 630 771 y(When)41 b(the)h(end)e(of)i(options)g(is)f(encoun)m(tered,)k | |
11833 | Ft(getopts)39 b Fu(exits)j(with)f(a)h(return)e(v)-5 b(alue)630 | |
11834 | 881 y(greater)32 b(than)e(zero.)41 b Ft(OPTIND)29 b Fu(is)h(set)h(to)g | |
11835 | (the)g(index)f(of)g(the)h(\014rst)f(non-option)g(argumen)m(t,)630 | |
11836 | 990 y(and)g Fr(name)35 b Fu(is)c(set)g(to)g(`)p Ft(?)p | |
11837 | Fu('.)630 1133 y Ft(getopts)c Fu(normally)j(parses)e(the)i(p)s | |
d76edd30 | 11838 | (ositional)g(parameters,)g(but)e(if)i(more)f(argumen)m(ts)h(are)630 |
e59452c7 CR |
11839 | 1243 y(supplied)f(as)i Fr(arg)38 b Fu(v)-5 b(alues,)31 |
11840 | b Ft(getopts)e Fu(parses)h(those)h(instead.)630 1386 | |
11841 | y Ft(getopts)h Fu(can)h(rep)s(ort)g(errors)g(in)h(t)m(w)m(o)h(w)m(a)m | |
fc35c477 | 11842 | (ys.)51 b(If)33 b(the)h(\014rst)e(c)m(haracter)k(of)d |
e59452c7 | 11843 | Fr(optstring)42 b Fu(is)34 b(a)630 1496 y(colon,)g Fr(silen)m(t)h |
6e51e0d0 | 11844 | Fu(error)d(rep)s(orting)f(is)i(used.)45 b(In)31 b(normal)h(op)s |
e59452c7 | 11845 | (eration,)h(diagnostic)h(messages)630 1606 y(are)c(prin)m(ted)e(when)g |
ad4aef08 | 11846 | (in)m(v)-5 b(alid)30 b(options)g(or)f(missing)g(option)g(argumen)m(ts)h |
e59452c7 | 11847 | (are)f(encoun)m(tered.)630 1715 y(If)34 b(the)g(v)-5 |
6e51e0d0 | 11848 | b(ariable)35 b Ft(OPTERR)d Fu(is)i(set)h(to)f(0,)i(no)e(error)g |
d76edd30 | 11849 | (messages)h(will)f(b)s(e)f(displa)m(y)m(ed,)j(ev)m(en)f(if)630 |
e59452c7 CR |
11850 | 1825 y(the)c(\014rst)e(c)m(haracter)j(of)f Ft(optstring)d |
11851 | Fu(is)i(not)h(a)f(colon.)630 1968 y(If)39 b(an)h(in)m(v)-5 | |
6e51e0d0 CR |
11852 | b(alid)41 b(option)f(is)g(seen,)i Ft(getopts)c Fu(places)j(`)p |
11853 | Ft(?)p Fu(')f(in)m(to)h Fr(name)k Fu(and,)d(if)e(not)g(silen)m(t,)630 | |
e59452c7 | 11854 | 2078 y(prin)m(ts)f(an)h(error)f(message)h(and)f(unsets)g |
6e51e0d0 | 11855 | Ft(OPTARG)p Fu(.)67 b(If)39 b Ft(getopts)f Fu(is)i(silen)m(t,)j(the)c |
e59452c7 | 11856 | (option)630 2187 y(c)m(haracter)32 b(found)d(is)h(placed)h(in)f |
6e51e0d0 | 11857 | Ft(OPTARG)f Fu(and)h(no)g(diagnostic)i(message)f(is)g(prin)m(ted.)630 |
e59452c7 | 11858 | 2330 y(If)c(a)g(required)f(argumen)m(t)i(is)f(not)g(found,)g(and)f |
6e51e0d0 | 11859 | Ft(getopts)f Fu(is)i(not)h(silen)m(t,)h(a)e(question)g(mark)630 |
e59452c7 | 11860 | 2440 y(\(`)p Ft(?)p Fu('\))h(is)g(placed)g(in)f Fr(name)p |
6e51e0d0 | 11861 | Fu(,)h Ft(OPTARG)e Fu(is)h(unset,)h(and)f(a)g(diagnostic)i(message)g |
e59452c7 | 11862 | (is)e(prin)m(ted.)39 b(If)630 2550 y Ft(getopts)28 b |
6e51e0d0 CR |
11863 | Fu(is)h(silen)m(t,)i(then)e(a)h(colon)h(\(`)p Ft(:)p |
11864 | Fu('\))f(is)g(placed)g(in)f Fr(name)35 b Fu(and)29 b | |
e59452c7 CR |
11865 | Ft(OPTARG)f Fu(is)h(set)h(to)h(the)630 2659 y(option)g(c)m(haracter)h |
11866 | (found.)150 2836 y Ft(hash)870 2980 y(hash)47 b([-r])f([-p)h | |
11867 | Fj(filename)p Ft(])e([-dt])i([)p Fj(name)p Ft(])630 3123 | |
6e51e0d0 | 11868 | y Fu(Eac)m(h)32 b(time)g Ft(hash)e Fu(is)h(in)m(v)m(ok)m(ed,)j(it)d |
45c0f7f8 | 11869 | (remem)m(b)s(ers)g(the)g(full)g(pathnames)g(of)h(the)f(commands)630 |
e59452c7 | 11870 | 3232 y(sp)s(eci\014ed)i(as)i Fr(name)k Fu(argumen)m(ts,)c(so)g(they)f |
122f603c | 11871 | (need)g(not)g(b)s(e)f(searc)m(hed)i(for)f(on)g(subsequen)m(t)630 |
e59452c7 CR |
11872 | 3342 y(in)m(v)m(o)s(cations.)79 b(The)41 b(commands)h(are)h(found)e(b)m |
11873 | (y)h(searc)m(hing)i(through)d(the)i(directories)630 3452 | |
6e51e0d0 CR |
11874 | y(listed)37 b(in)g Ft($PATH)p Fu(.)58 b(An)m(y)37 b(previously-remem)m |
11875 | (b)s(ered)f(pathname)h(is)g(discarded.)59 b(The)37 b | |
e59452c7 | 11876 | Ft(-p)630 3561 y Fu(option)d(inhibits)f(the)h(path)g(searc)m(h,)h(and)e |
6e51e0d0 | 11877 | Fr(\014lename)39 b Fu(is)34 b(used)f(as)h(the)f(lo)s(cation)j(of)e |
e59452c7 | 11878 | Fr(name)p Fu(.)630 3671 y(The)42 b Ft(-r)g Fu(option)h(causes)f(the)h |
6e51e0d0 | 11879 | (shell)g(to)g(forget)g(all)h(remem)m(b)s(ered)d(lo)s(cations.)79 |
e59452c7 | 11880 | b(The)42 b Ft(-d)630 3780 y Fu(option)31 b(causes)g(the)f(shell)h(to)g |
6e51e0d0 | 11881 | (forget)h(the)f(remem)m(b)s(ered)e(lo)s(cation)j(of)f(eac)m(h)h |
e59452c7 | 11882 | Fr(name)p Fu(.)41 b(If)30 b(the)630 3890 y Ft(-t)39 b |
6e51e0d0 | 11883 | Fu(option)h(is)g(supplied,)g(the)g(full)f(pathname)h(to)g(whic)m(h)f |
e59452c7 | 11884 | (eac)m(h)i Fr(name)k Fu(corresp)s(onds)38 b(is)630 4000 |
a2851804 CR |
11885 | y(prin)m(ted.)i(If)28 b(m)m(ultiple)h Fr(name)34 b Fu(argumen)m(ts)29 |
11886 | b(are)g(supplied)f(with)g Ft(-t)p Fu(,)h(the)g Fr(name)34 | |
e59452c7 | 11887 | b Fu(is)28 b(prin)m(ted)630 4109 y(b)s(efore)h(the)i(hashed)e(full)g |
6e51e0d0 | 11888 | (pathname.)41 b(The)29 b Ft(-l)g Fu(option)i(causes)f(output)f(to)i(b)s |
e59452c7 | 11889 | (e)e(displa)m(y)m(ed)630 4219 y(in)23 b(a)h(format)g(that)g(ma)m(y)g(b) |
6e51e0d0 | 11890 | s(e)f(reused)f(as)i(input.)37 b(If)23 b(no)h(argumen)m(ts)f(are)h(giv)m |
e59452c7 | 11891 | (en,)i(or)e(if)f(only)h Ft(-l)630 4328 y Fu(is)35 b(supplied,)f |
6e51e0d0 | 11892 | (information)h(ab)s(out)g(remem)m(b)s(ered)f(commands)g(is)h(prin)m |
e59452c7 | 11893 | (ted.)53 b(The)34 b(return)630 4438 y(status)d(is)f(zero)h(unless)f(a)h |
6e51e0d0 | 11894 | Fr(name)k Fu(is)c(not)f(found)f(or)i(an)f(in)m(v)-5 b(alid)31 |
e59452c7 CR |
11895 | b(option)g(is)f(supplied.)150 4615 y Ft(pwd)870 4758 |
11896 | y(pwd)47 b([-LP])630 4902 y Fu(Prin)m(t)29 b(the)g(absolute)h(pathname) | |
6e51e0d0 | 11897 | e(of)h(the)h(curren)m(t)e(w)m(orking)h(directory)-8 b(.)42 |
e59452c7 | 11898 | b(If)28 b(the)h Ft(-P)f Fu(option)630 5011 y(is)39 b(supplied,)h(the)f |
6e51e0d0 | 11899 | (pathname)g(prin)m(ted)g(will)g(not)h(con)m(tain)g(sym)m(b)s(olic)f |
e59452c7 | 11900 | (links.)67 b(If)38 b(the)i Ft(-L)630 5121 y Fu(option)k(is)g(supplied,) |
6e51e0d0 | 11901 | i(the)e(pathname)f(prin)m(ted)h(ma)m(y)g(con)m(tain)h(sym)m(b)s(olic)f |
e59452c7 | 11902 | (links.)80 b(The)630 5230 y(return)26 b(status)h(is)h(zero)g(unless)e |
6e51e0d0 | 11903 | (an)h(error)g(is)g(encoun)m(tered)g(while)h(determining)f(the)g(name) |
e59452c7 CR |
11904 | 630 5340 y(of)k(the)f(curren)m(t)g(directory)h(or)f(an)h(in)m(v)-5 |
11905 | b(alid)31 b(option)g(is)f(supplied.)p eop end | |
11906 | %%Page: 51 57 | |
11907 | TeXDict begin 51 56 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
11908 | b(Shell)30 b(Builtin)h(Commands)2069 b(51)150 299 y Ft(readonly)870 | |
11909 | 432 y(readonly)46 b([-aAf])g([-p])g([)p Fj(name)p Ft([=)p | |
11910 | Fj(value)p Ft(]])e(...)630 565 y Fu(Mark)33 b(eac)m(h)h | |
6e51e0d0 CR |
11911 | Fr(name)39 b Fu(as)33 b(readonly)-8 b(.)49 b(The)32 b(v)-5 |
11912 | b(alues)34 b(of)f(these)g(names)g(ma)m(y)h(not)f(b)s(e)f(c)m(hanged)630 | |
e59452c7 | 11913 | 675 y(b)m(y)38 b(subsequen)m(t)g(assignmen)m(t.)65 b(If)38 |
6e51e0d0 | 11914 | b(the)h Ft(-f)f Fu(option)g(is)h(supplied,)g(eac)m(h)h |
e59452c7 CR |
11915 | Fr(name)j Fu(refers)38 b(to)630 784 y(a)f(shell)g(function.)59 |
11916 | b(The)36 b Ft(-a)g Fu(option)h(means)f(eac)m(h)i Fr(name)k | |
11917 | Fu(refers)36 b(to)h(an)f(indexed)g(arra)m(y)630 894 y(v)-5 | |
11918 | b(ariable;)28 b(the)f Ft(-A)e Fu(option)h(means)g(eac)m(h)h | |
6e51e0d0 | 11919 | Fr(name)k Fu(refers)26 b(to)g(an)g(asso)s(ciativ)m(e)i(arra)m(y)f(v)-5 |
e59452c7 | 11920 | b(ariable.)630 1003 y(If)35 b(b)s(oth)g(options)h(are)h(supplied,)f |
6e51e0d0 | 11921 | Ft(-A)f Fu(tak)m(es)i(precedence.)58 b(If)35 b(no)h Fr(name)k |
e59452c7 | 11922 | Fu(argumen)m(ts)d(are)630 1113 y(giv)m(en,)k(or)c(if)h(the)g |
6e51e0d0 | 11923 | Ft(-p)f Fu(option)h(is)f(supplied,)i(a)f(list)g(of)g(all)g(readonly)g |
e59452c7 CR |
11924 | (names)f(is)h(prin)m(ted.)630 1223 y(The)32 b(other)g(options)g(ma)m(y) |
11925 | h(b)s(e)f(used)f(to)i(restrict)g(the)f(output)g(to)h(a)f(subset)g(of)g | |
11926 | (the)g(set)h(of)630 1332 y(readonly)c(names.)41 b(The)28 | |
6e51e0d0 | 11927 | b Ft(-p)h Fu(option)h(causes)g(output)e(to)j(b)s(e)d(displa)m(y)m(ed)i |
e59452c7 | 11928 | (in)f(a)h(format)f(that)630 1442 y(ma)m(y)j(b)s(e)e(reused)g(as)i |
6e51e0d0 CR |
11929 | (input.)42 b(If)30 b(a)i(v)-5 b(ariable)31 b(name)h(is)f(follo)m(w)m |
11930 | (ed)h(b)m(y)f(=)p Fr(v)-5 b(alue)p Fu(,)32 b(the)f(v)-5 | |
e59452c7 | 11931 | b(alue)32 b(of)630 1551 y(the)i(v)-5 b(ariable)34 b(is)f(set)i(to)f |
6e51e0d0 | 11932 | Fr(v)-5 b(alue)p Fu(.)50 b(The)33 b(return)g(status)g(is)h(zero)g |
e59452c7 | 11933 | (unless)f(an)g(in)m(v)-5 b(alid)34 b(option)630 1661 |
6e51e0d0 CR |
11934 | y(is)c(supplied,)f(one)h(of)g(the)g Fr(name)35 b Fu(argumen)m(ts)30 |
11935 | b(is)g(not)g(a)g(v)-5 b(alid)31 b(shell)f(v)-5 b(ariable)30 | |
e59452c7 | 11936 | b(or)g(function)630 1771 y(name,)h(or)f(the)h Ft(-f)e |
6e51e0d0 | 11937 | Fu(option)i(is)g(supplied)e(with)h(a)h(name)f(that)h(is)f(not)h(a)g |
e59452c7 CR |
11938 | (shell)f(function.)150 1927 y Ft(return)870 2060 y(return)46 |
11939 | b([)p Fj(n)p Ft(])630 2193 y Fu(Cause)37 b(a)g(shell)h(function)f(to)g | |
6e51e0d0 | 11940 | (stop)h(executing)g(and)e(return)h(the)g(v)-5 b(alue)37 |
e59452c7 | 11941 | b Fr(n)g Fu(to)h(its)f(caller.)630 2303 y(If)h Fr(n)h |
6e51e0d0 CR |
11942 | Fu(is)g(not)g(supplied,)h(the)f(return)e(v)-5 b(alue)40 |
11943 | b(is)f(the)g(exit)g(status)g(of)g(the)g(last)h(command)630 | |
e59452c7 | 11944 | 2412 y(executed)i(in)f(the)g(function.)72 b(If)41 b Ft(return)e |
fc527055 | 11945 | Fu(is)i(executed)h(b)m(y)f(a)h(trap)f(handler,)i(the)e(last)630 |
e59452c7 CR |
11946 | 2522 y(command)d(used)f(to)i(determine)f(the)g(status)g(is)h(the)f |
11947 | (last)h(command)e(executed)i(b)s(efore)630 2632 y(the)27 | |
879213c6 | 11948 | b(trap)g(handler.)39 b(If)26 b Ft(return)g Fu(is)h(executed)h(during)d |
e59452c7 | 11949 | (a)j Ft(DEBUG)d Fu(trap,)j(the)f(last)h(command)630 2741 |
fc527055 | 11950 | y(used)f(to)h(determine)g(the)f(status)h(is)g(the)f(last)i(command)e |
e59452c7 | 11951 | (executed)h(b)m(y)g(the)f(trap)h(handler)630 2851 y(b)s(efore)e |
fc527055 CR |
11952 | Ft(return)f Fu(w)m(as)i(in)m(v)m(ok)m(ed.)41 b Ft(return)25 |
11953 | b Fu(ma)m(y)i(also)g(b)s(e)f(used)g(to)h(terminate)h(execution)g(of)630 | |
e59452c7 | 11954 | 2960 y(a)34 b(script)g(b)s(eing)g(executed)g(with)g(the)g |
6e51e0d0 | 11955 | Ft(.)g Fu(\()p Ft(source)p Fu(\))f(builtin,)h(returning)f(either)i |
e59452c7 | 11956 | Fr(n)e Fu(or)h(the)630 3070 y(exit)j(status)f(of)g(the)g(last)h |
d76edd30 | 11957 | (command)e(executed)i(within)e(the)h(script)g(as)g(the)g(exit)h(status) |
e59452c7 | 11958 | 630 3180 y(of)i(the)g(script.)65 b(If)38 b Fr(n)g Fu(is)h(supplied,)h |
d76edd30 | 11959 | (the)f(return)e(v)-5 b(alue)39 b(is)g(its)g(least)h(signi\014can)m(t)g |
e59452c7 | 11960 | (8)f(bits.)630 3289 y(An)m(y)g(command)f(asso)s(ciated)j(with)d(the)h |
6e51e0d0 | 11961 | Ft(RETURN)e Fu(trap)i(is)g(executed)g(b)s(efore)g(execution)630 |
e59452c7 | 11962 | 3399 y(resumes)29 b(after)h(the)g(function)g(or)g(script.)40 |
6e51e0d0 | 11963 | b(The)29 b(return)g(status)h(is)g(non-zero)g(if)g Ft(return)e |
e59452c7 | 11964 | Fu(is)630 3508 y(supplied)h(a)i(non-n)m(umeric)g(argumen)m(t)g(or)f(is) |
d76edd30 | 11965 | h(used)f(outside)h(a)g(function)f(and)g(not)h(during)630 |
e59452c7 CR |
11966 | 3618 y(the)g(execution)g(of)g(a)f(script)h(b)m(y)f Ft(.)g |
11967 | Fu(or)g Ft(source)p Fu(.)150 3774 y Ft(shift)870 3907 | |
11968 | y(shift)46 b([)p Fj(n)p Ft(])630 4041 y Fu(Shift)41 b(the)g(p)s | |
6e51e0d0 | 11969 | (ositional)h(parameters)g(to)g(the)f(left)h(b)m(y)g Fr(n)p |
e59452c7 | 11970 | Fu(.)73 b(The)40 b(p)s(ositional)j(parameters)630 4150 |
6e51e0d0 CR |
11971 | y(from)34 b Fr(n)p Ft(+)p Fu(1)39 b(.)22 b(.)h(.)45 b |
11972 | Ft($#)34 b Fu(are)g(renamed)g(to)h Ft($1)k Fu(.)22 b(.)g(.)46 | |
11973 | b Ft($#)p Fu(-)p Fr(n)p Fu(.)51 b(P)m(arameters)36 b(represen)m(ted)e | |
e59452c7 | 11974 | (b)m(y)g(the)630 4260 y(n)m(um)m(b)s(ers)d Ft($#)i Fu(do)m(wn)f(to)i |
e6983002 CR |
11975 | Ft($#)p Fu(-)p Fr(n)p Ft(+)p Fu(1)e(are)h(unset.)48 b |
11976 | Fr(n)32 b Fu(m)m(ust)h(b)s(e)f(a)h(non-negativ)m(e)i(n)m(um)m(b)s(er)d | |
e59452c7 | 11977 | (less)630 4369 y(than)g(or)g(equal)h(to)g Ft($#)p Fu(.)46 |
e6983002 | 11978 | b(If)31 b Fr(n)h Fu(is)g(zero)h(or)f(greater)i(than)e |
e59452c7 | 11979 | Ft($#)p Fu(,)g(the)h(p)s(ositional)g(parameters)630 4479 |
e6983002 CR |
11980 | y(are)e(not)h(c)m(hanged.)43 b(If)31 b Fr(n)g Fu(is)g(not)g(supplied,)f |
11981 | (it)i(is)f(assumed)f(to)i(b)s(e)f(1.)43 b(The)31 b(return)f(status)630 | |
e59452c7 | 11982 | 4589 y(is)g(zero)i(unless)d Fr(n)h Fu(is)g(greater)i(than)e |
e6983002 | 11983 | Ft($#)g Fu(or)g(less)h(than)f(zero,)i(non-zero)e(otherwise.)150 |
e59452c7 CR |
11984 | 4745 y Ft(test)150 4855 y([)870 4988 y(test)47 b Fj(expr)630 |
11985 | 5121 y Fu(Ev)-5 b(aluate)43 b(a)f(conditional)h(expression)f | |
b729dac1 | 11986 | Fr(expr)48 b Fu(and)41 b(return)g(a)h(status)g(of)g(0)g(\(true\))h(or)f |
e59452c7 | 11987 | (1)630 5230 y(\(false\).)g(Eac)m(h)31 b(op)s(erator)f(and)f(op)s(erand) |
122f603c | 11988 | g(m)m(ust)h(b)s(e)f(a)i(separate)g(argumen)m(t.)41 b(Expressions)630 |
e59452c7 CR |
11989 | 5340 y(are)26 b(comp)s(osed)f(of)g(the)h(primaries)f(describ)s(ed)f(b)s |
11990 | (elo)m(w)h(in)g(Section)h(6.4)h([Bash)e(Conditional)p | |
11991 | eop end | |
11992 | %%Page: 52 58 | |
11993 | TeXDict begin 52 57 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
11994 | b(Shell)30 b(Builtin)h(Commands)2069 b(52)630 299 y(Expressions],)39 | |
11995 | b(page)g(95.)64 b Ft(test)37 b Fu(do)s(es)g(not)h(accept)i(an)m(y)e | |
11996 | (options,)i(nor)e(do)s(es)f(it)h(accept)630 408 y(and)30 | |
11997 | b(ignore)h(an)f(argumen)m(t)h(of)f Ft(--)g Fu(as)h(signifying)f(the)h | |
11998 | (end)f(of)g(options.)630 550 y(When)g(the)h Ft([)f Fu(form)g(is)g | |
11999 | (used,)g(the)g(last)i(argumen)m(t)e(to)i(the)e(command)g(m)m(ust)h(b)s | |
12000 | (e)e(a)i Ft(])p Fu(.)630 692 y(Expressions)23 b(ma)m(y)h(b)s(e)e(com)m | |
12001 | (bined)i(using)f(the)h(follo)m(wing)h(op)s(erators,)g(listed)f(in)f | |
12002 | (decreasing)630 801 y(order)30 b(of)h(precedence.)43 | |
12003 | b(The)30 b(ev)-5 b(aluation)33 b(dep)s(ends)28 b(on)j(the)g(n)m(um)m(b) | |
12004 | s(er)f(of)h(argumen)m(ts;)g(see)630 911 y(b)s(elo)m(w.)41 | |
12005 | b(Op)s(erator)30 b(precedence)h(is)f(used)g(when)f(there)i(are)f(\014v) | |
12006 | m(e)h(or)f(more)h(argumen)m(ts.)630 1084 y Ft(!)f Fj(expr)210 | |
12007 | b Fu(T)-8 b(rue)30 b(if)g Fr(expr)37 b Fu(is)30 b(false.)630 | |
12008 | 1258 y Ft(\()g Fj(expr)f Ft(\))133 b Fu(Returns)23 b(the)i(v)-5 | |
12009 | b(alue)25 b(of)f Fr(expr)p Fu(.)38 b(This)24 b(ma)m(y)h(b)s(e)e(used)h | |
12010 | (to)h(o)m(v)m(erride)g(the)g(normal)1110 1367 y(precedence)31 | |
12011 | b(of)f(op)s(erators.)630 1541 y Fj(expr1)f Ft(-a)h Fj(expr2)1110 | |
12012 | 1650 y Fu(T)-8 b(rue)30 b(if)g(b)s(oth)g Fr(expr1)37 | |
12013 | b Fu(and)30 b Fr(expr2)38 b Fu(are)30 b(true.)630 1824 | |
12014 | y Fj(expr1)f Ft(-o)h Fj(expr2)1110 1934 y Fu(T)-8 b(rue)30 | |
12015 | b(if)g(either)h Fr(expr1)38 b Fu(or)30 b Fr(expr2)37 | |
12016 | b Fu(is)31 b(true.)630 2107 y(The)37 b Ft(test)f Fu(and)g | |
12017 | Ft([)h Fu(builtins)g(ev)-5 b(aluate)39 b(conditional)f(expressions)f | |
12018 | (using)g(a)g(set)h(of)f(rules)630 2217 y(based)30 b(on)g(the)h(n)m(um)m | |
12019 | (b)s(er)e(of)h(argumen)m(ts.)630 2390 y(0)h(argumen)m(ts)1110 | |
12020 | 2500 y(The)f(expression)g(is)g(false.)630 2673 y(1)h(argumen)m(t)1110 | |
12021 | 2783 y(The)f(expression)g(is)g(true)h(if,)f(and)g(only)g(if,)h(the)g | |
12022 | (argumen)m(t)f(is)h(not)f(n)m(ull.)630 2956 y(2)h(argumen)m(ts)1110 | |
12023 | 3066 y(If)f(the)h(\014rst)f(argumen)m(t)h(is)g(`)p Ft(!)p | |
12024 | Fu(',)g(the)g(expression)g(is)g(true)f(if)h(and)f(only)h(if)g(the)1110 | |
12025 | 3176 y(second)j(argumen)m(t)f(is)h(n)m(ull.)50 b(If)33 | |
12026 | b(the)h(\014rst)e(argumen)m(t)i(is)g(one)g(of)f(the)h(unary)1110 | |
12027 | 3285 y(conditional)42 b(op)s(erators)f(\(see)g(Section)h(6.4)f([Bash)g | |
12028 | (Conditional)g(Expres-)1110 3395 y(sions],)34 b(page)f(95\),)i(the)e | |
12029 | (expression)f(is)h(true)g(if)g(the)g(unary)e(test)j(is)f(true.)47 | |
12030 | b(If)1110 3504 y(the)33 b(\014rst)g(argumen)m(t)h(is)f(not)g(a)h(v)-5 | |
12031 | b(alid)34 b(unary)e(op)s(erator,)i(the)g(expression)f(is)1110 | |
12032 | 3614 y(false.)630 3787 y(3)e(argumen)m(ts)1110 3897 y(The)f(follo)m | |
12033 | (wing)i(conditions)f(are)f(applied)h(in)f(the)g(order)g(listed.)1159 | |
12034 | 4039 y(1.)61 b(If)29 b(the)g(second)g(argumen)m(t)h(is)f(one)h(of)f | |
12035 | (the)h(binary)e(conditional)j(op)s(era-)1290 4148 y(tors)c(\(see)h | |
12036 | (Section)g(6.4)g([Bash)g(Conditional)f(Expressions],)h(page)f(95\),) | |
12037 | 1290 4258 y(the)d(result)g(of)f(the)h(expression)g(is)g(the)f(result)h | |
12038 | (of)g(the)g(binary)f(test)h(using)1290 4367 y(the)35 | |
12039 | b(\014rst)e(and)h(third)g(argumen)m(ts)h(as)f(op)s(erands.)52 | |
12040 | b(The)34 b(`)p Ft(-a)p Fu(')g(and)g(`)p Ft(-o)p Fu(')1290 | |
12041 | 4477 y(op)s(erators)24 b(are)g(considered)g(binary)f(op)s(erators)h | |
12042 | (when)f(there)h(are)h(three)1290 4587 y(argumen)m(ts.)1159 | |
12043 | 4728 y(2.)61 b(If)41 b(the)h(\014rst)e(argumen)m(t)i(is)f(`)p | |
a6ae8f35 | 12044 | Ft(!)p Fu(',)k(the)d(v)-5 b(alue)41 b(is)h(the)f(negation)i(of)f(the) |
e59452c7 CR |
12045 | 1290 4838 y(t)m(w)m(o-argumen)m(t)33 b(test)e(using)f(the)g(second)h |
12046 | (and)e(third)h(argumen)m(ts.)1159 4979 y(3.)61 b(If)35 | |
a6ae8f35 | 12047 | b(the)h(\014rst)e(argumen)m(t)i(is)g(exactly)h(`)p Ft(\()p |
e59452c7 | 12048 | Fu(')f(and)f(the)g(third)g(argumen)m(t)h(is)1290 5089 |
a6ae8f35 | 12049 | y(exactly)i(`)p Ft(\))p Fu(',)g(the)f(result)f(is)h(the)f(one-argumen)m |
e59452c7 CR |
12050 | (t)i(test)f(of)f(the)h(second)1290 5198 y(argumen)m(t.)1159 |
12051 | 5340 y(4.)61 b(Otherwise,)30 b(the)h(expression)f(is)g(false.)p | |
12052 | eop end | |
12053 | %%Page: 53 59 | |
12054 | TeXDict begin 53 58 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12055 | b(Shell)30 b(Builtin)h(Commands)2069 b(53)630 299 y(4)31 | |
12056 | b(argumen)m(ts)1110 408 y(The)f(follo)m(wing)i(conditions)f(are)f | |
12057 | (applied)h(in)f(the)g(order)g(listed.)1159 544 y(1.)61 | |
12058 | b(If)39 b(the)i(\014rst)e(argumen)m(t)h(is)g(`)p Ft(!)p | |
12059 | Fu(',)j(the)d(result)f(is)h(the)g(negation)i(of)e(the)1290 | |
12060 | 653 y(three-argumen)m(t)k(expression)e(comp)s(osed)g(of)h(the)g | |
12061 | (remaining)g(argu-)1290 763 y(men)m(ts.)1159 898 y(2.)61 | |
12062 | b(If)31 b(the)g(\014rst)f(argumen)m(t)i(is)f(exactly)i(`)p | |
12063 | Ft(\()p Fu(')e(and)g(the)g(fourth)f(argumen)m(t)i(is)1290 | |
12064 | 1008 y(exactly)38 b(`)p Ft(\))p Fu(',)f(the)f(result)g(is)g(the)g(t)m | |
12065 | (w)m(o-argumen)m(t)i(test)f(of)f(the)g(second)1290 1118 | |
12066 | y(and)30 b(third)f(argumen)m(ts.)1159 1253 y(3.)61 b(Otherwise,)26 | |
12067 | b(the)f(expression)f(is)h(parsed)f(and)g(ev)-5 b(aluated)26 | |
12068 | b(according)g(to)1290 1363 y(precedence)31 b(using)f(the)g(rules)g | |
12069 | (listed)h(ab)s(o)m(v)m(e.)630 1524 y(5)g(or)f(more)h(argumen)m(ts)1110 | |
12070 | 1633 y(The)43 b(expression)f(is)i(parsed)e(and)g(ev)-5 | |
12071 | b(aluated)45 b(according)f(to)f(precedence)1110 1743 | |
12072 | y(using)30 b(the)g(rules)g(listed)h(ab)s(o)m(v)m(e.)630 | |
12073 | 1904 y(When)40 b(used)f(with)g Ft(test)g Fu(or)h(`)p | |
12074 | Ft([)p Fu(',)j(the)d(`)p Ft(<)p Fu(')g(and)f(`)p Ft(>)p | |
12075 | Fu(')h(op)s(erators)g(sort)g(lexicographically)630 2014 | |
12076 | y(using)30 b(ASCI)s(I)f(ordering.)150 2175 y Ft(times)870 | |
12077 | 2310 y(times)630 2446 y Fu(Prin)m(t)37 b(out)h(the)g(user)e(and)h | |
12078 | (system)g(times)h(used)f(b)m(y)g(the)h(shell)f(and)g(its)h(c)m | |
12079 | (hildren.)61 b(The)630 2555 y(return)29 b(status)i(is)f(zero.)150 | |
12080 | 2716 y Ft(trap)870 2852 y(trap)47 b([-lp])f([)p Fj(arg)p | |
12081 | Ft(])g([)p Fj(sigspec)g Ft(...)o(])630 2987 y Fu(The)d(commands)f(in)h | |
12082 | Fr(arg)51 b Fu(are)44 b(to)g(b)s(e)e(read)h(and)g(executed)h(when)e | |
12083 | (the)h(shell)g(receiv)m(es)630 3097 y(signal)36 b Fr(sigsp)s(ec)p | |
12084 | Fu(.)57 b(If)35 b Fr(arg)44 b Fu(is)36 b(absen)m(t)g(\(and)f(there)h | |
12085 | (is)g(a)f(single)i Fr(sigsp)s(ec)6 b Fu(\))35 b(or)h(equal)g(to)h(`)p | |
12086 | Ft(-)p Fu(',)630 3206 y(eac)m(h)k(sp)s(eci\014ed)e(signal's)h(disp)s | |
12087 | (osition)g(is)f(reset)i(to)f(the)g(v)-5 b(alue)40 b(it)g(had)f(when)g | |
12088 | (the)h(shell)630 3316 y(w)m(as)33 b(started.)47 b(If)32 | |
12089 | b Fr(arg)41 b Fu(is)32 b(the)h(n)m(ull)f(string,)i(then)e(the)g(signal) | |
12090 | i(sp)s(eci\014ed)d(b)m(y)i(eac)m(h)g Fr(sigsp)s(ec)630 | |
12091 | 3425 y Fu(is)g(ignored)h(b)m(y)f(the)g(shell)h(and)e(commands)h(it)h | |
12092 | (in)m(v)m(ok)m(es.)51 b(If)33 b Fr(arg)41 b Fu(is)33 | |
12093 | b(not)h(presen)m(t)f(and)g Ft(-p)630 3535 y Fu(has)g(b)s(een)g | |
12094 | (supplied,)f(the)i(shell)f(displa)m(ys)h(the)f(trap)g(commands)g(asso)s | |
12095 | (ciated)i(with)e(eac)m(h)630 3645 y Fr(sigsp)s(ec)p Fu(.)47 | |
12096 | b(If)31 b(no)i(argumen)m(ts)f(are)h(supplied,)e(or)i(only)f | |
12097 | Ft(-p)g Fu(is)g(giv)m(en,)i Ft(trap)d Fu(prin)m(ts)h(the)g(list)630 | |
12098 | 3754 y(of)c(commands)f(asso)s(ciated)i(with)f(eac)m(h)h(signal)f(n)m | |
12099 | (um)m(b)s(er)e(in)i(a)g(form)f(that)h(ma)m(y)h(b)s(e)e(reused)630 | |
12100 | 3864 y(as)f(shell)h(input.)38 b(The)26 b Ft(-l)f Fu(option)i(causes)f | |
12101 | (the)g(shell)h(to)g(prin)m(t)e(a)i(list)f(of)h(signal)g(names)f(and)630 | |
12102 | 3973 y(their)33 b(corresp)s(onding)f(n)m(um)m(b)s(ers.)47 | |
12103 | b(Eac)m(h)34 b Fr(sigsp)s(ec)39 b Fu(is)33 b(either)g(a)h(signal)g | |
12104 | (name)f(or)g(a)g(signal)630 4083 y(n)m(um)m(b)s(er.)39 | |
12105 | b(Signal)31 b(names)f(are)h(case)h(insensitiv)m(e)f(and)f(the)g | |
12106 | Ft(SIG)g Fu(pre\014x)f(is)i(optional.)630 4218 y(If)k(a)g | |
12107 | Fr(sigsp)s(ec)41 b Fu(is)35 b Ft(0)g Fu(or)g Ft(EXIT)p | |
12108 | Fu(,)g Fr(arg)43 b Fu(is)35 b(executed)h(when)e(the)h(shell)h(exits.)55 | |
12109 | b(If)35 b(a)g Fr(sigsp)s(ec)41 b Fu(is)630 4328 y Ft(DEBUG)p | |
12110 | Fu(,)32 b(the)g(command)g Fr(arg)40 b Fu(is)33 b(executed)g(b)s(efore)f | |
12111 | (ev)m(ery)h(simple)f(command,)h Ft(for)e Fu(com-)630 | |
12112 | 4437 y(mand,)d Ft(case)g Fu(command,)h Ft(select)e Fu(command,)i(ev)m | |
12113 | (ery)h(arithmetic)g Ft(for)d Fu(command,)j(and)630 4547 | |
12114 | y(b)s(efore)22 b(the)g(\014rst)f(command)h(executes)i(in)e(a)g(shell)h | |
12115 | (function.)37 b(Refer)22 b(to)h(the)g(description)f(of)630 | |
12116 | 4657 y(the)i Ft(extdebug)d Fu(option)j(to)h(the)f Ft(shopt)e | |
12117 | Fu(builtin)h(\(see)i(Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)630 | |
12118 | 4766 y(page)33 b(70\))g(for)f(details)h(of)f(its)h(e\013ect)g(on)f(the) | |
12119 | g Ft(DEBUG)f Fu(trap.)46 b(If)31 b(a)i Fr(sigsp)s(ec)38 | |
12120 | b Fu(is)32 b Ft(RETURN)p Fu(,)f(the)630 4876 y(command)h | |
6e51e0d0 | 12121 | Fr(arg)41 b Fu(is)33 b(executed)g(eac)m(h)h(time)f(a)g(shell)g |
e59452c7 | 12122 | (function)g(or)f(a)h(script)g(executed)g(with)630 4985 |
6e51e0d0 | 12123 | y(the)e Ft(.)f Fu(or)g Ft(source)f Fu(builtins)g(\014nishes)h |
e59452c7 | 12124 | (executing.)630 5121 y(If)20 b(a)i Fr(sigsp)s(ec)27 b |
6e51e0d0 CR |
12125 | Fu(is)21 b Ft(ERR)p Fu(,)h(the)f(command)g Fr(arg)29 |
12126 | b Fu(is)21 b(executed)h(whenev)m(er)e(a)i(pip)s(eline)e(\(whic)m(h)h | |
e59452c7 | 12127 | (ma)m(y)630 5230 y(consist)35 b(of)g(a)f(single)h(simple)g(command\),)h |
ad4aef08 | 12128 | (a)e(list,)j(or)d(a)h(comp)s(ound)e(command)h(returns)630 |
e59452c7 | 12129 | 5340 y(a)41 b(non-zero)g(exit)h(status,)h(sub)5 b(ject)41 |
ad4aef08 | 12130 | b(to)g(the)g(follo)m(wing)h(conditions.)72 b(The)40 b |
e59452c7 CR |
12131 | Ft(ERR)f Fu(trap)i(is)p eop end |
12132 | %%Page: 54 60 | |
12133 | TeXDict begin 54 59 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12134 | b(Shell)30 b(Builtin)h(Commands)2069 b(54)630 299 y(not)37 | |
12135 | b(executed)h(if)f(the)h(failed)f(command)g(is)g(part)g(of)h(the)f | |
12136 | (command)g(list)h(immediately)630 408 y(follo)m(wing)30 | |
12137 | b(an)e Ft(until)f Fu(or)i Ft(while)e Fu(k)m(eyw)m(ord,)i(part)g(of)f | |
12138 | (the)h(test)g(follo)m(wing)h(the)f Ft(if)f Fu(or)g Ft(elif)630 | |
12139 | 518 y Fu(reserv)m(ed)45 b(w)m(ords,)j(part)c(of)h(a)g(command)g | |
12140 | (executed)g(in)g(a)g Ft(&&)f Fu(or)h Ft(||)f Fu(list)h(except)h(the)630 | |
12141 | 628 y(command)28 b(follo)m(wing)j(the)d(\014nal)h Ft(&&)f | |
6e51e0d0 | 12142 | Fu(or)g Ft(||)p Fu(,)h(an)m(y)g(command)f(in)h(a)g(pip)s(eline)f(but)g |
e59452c7 | 12143 | (the)h(last,)630 737 y(or)d(if)g(the)f(command's)h(return)f(status)h |
6e51e0d0 | 12144 | (is)g(b)s(eing)f(in)m(v)m(erted)i(using)e Ft(!)p Fu(.)39 |
e59452c7 | 12145 | b(These)25 b(are)i(the)f(same)630 847 y(conditions)31 |
6e51e0d0 | 12146 | b(ob)s(ey)m(ed)f(b)m(y)h(the)f Ft(errexit)f Fu(\()p Ft(-e)p |
e59452c7 | 12147 | Fu(\))h(option.)630 974 y(Signals)37 b(ignored)f(up)s(on)f(en)m(try)i |
6e51e0d0 | 12148 | (to)g(the)f(shell)h(cannot)g(b)s(e)f(trapp)s(ed)f(or)h(reset.)59 |
e59452c7 | 12149 | b(T)-8 b(rapp)s(ed)630 1084 y(signals)28 b(that)f(are)h(not)f(b)s(eing) |
6e51e0d0 | 12150 | g(ignored)g(are)g(reset)h(to)g(their)f(original)h(v)-5 |
e59452c7 CR |
12151 | b(alues)28 b(in)e(a)i(subshell)630 1194 y(or)i(subshell)g(en)m |
12152 | (vironmen)m(t)h(when)e(one)i(is)f(created.)630 1321 y(The)g(return)f | |
6e51e0d0 CR |
12153 | (status)i(is)f(zero)h(unless)f(a)h Fr(sigsp)s(ec)36 b |
12154 | Fu(do)s(es)30 b(not)h(sp)s(ecify)f(a)g(v)-5 b(alid)31 | |
e59452c7 CR |
12155 | b(signal.)150 1467 y Ft(umask)870 1595 y(umask)46 b([-p])h([-S])g([)p |
12156 | Fj(mode)p Ft(])630 1722 y Fu(Set)30 b(the)f(shell)h(pro)s(cess's)f | |
12157 | (\014le)h(creation)g(mask)g(to)g Fr(mo)s(de)p Fu(.)40 | |
12158 | b(If)29 b Fr(mo)s(de)34 b Fu(b)s(egins)29 b(with)g(a)h(digit,)630 | |
12159 | 1832 y(it)e(is)f(in)m(terpreted)g(as)g(an)g(o)s(ctal)i(n)m(um)m(b)s | |
12160 | (er;)e(if)g(not,)h(it)g(is)f(in)m(terpreted)g(as)g(a)h(sym)m(b)s(olic)f | |
12161 | (mo)s(de)630 1942 y(mask)i(similar)g(to)g(that)h(accepted)g(b)m(y)f | |
12162 | (the)g Ft(chmod)e Fu(command.)40 b(If)28 b Fr(mo)s(de)34 | |
12163 | b Fu(is)28 b(omitted,)j(the)630 2051 y(curren)m(t)39 | |
12164 | b(v)-5 b(alue)40 b(of)f(the)g(mask)g(is)h(prin)m(ted.)66 | |
12165 | b(If)39 b(the)g Ft(-S)g Fu(option)g(is)h(supplied)d(without)j(a)630 | |
12166 | 2161 y Fr(mo)s(de)d Fu(argumen)m(t,)d(the)e(mask)g(is)h(prin)m(ted)f | |
12167 | (in)g(a)g(sym)m(b)s(olic)h(format.)47 b(If)32 b(the)g | |
12168 | Ft(-p)g Fu(option)h(is)630 2270 y(supplied,)f(and)f Fr(mo)s(de)37 | |
fc527055 | 12169 | b Fu(is)32 b(omitted,)i(the)f(output)f(is)g(in)g(a)g(form)g(that)h(ma)m |
e59452c7 | 12170 | (y)g(b)s(e)e(reused)h(as)630 2380 y(input.)62 b(The)38 |
fc527055 | 12171 | b(return)f(status)h(is)g(zero)g(if)g(the)g(mo)s(de)g(is)g(successfully) |
e59452c7 CR |
12172 | g(c)m(hanged)g(or)g(if)g(no)630 2489 y Fr(mo)s(de)d Fu(argumen)m(t)c |
12173 | (is)f(supplied,)g(and)f(non-zero)i(otherwise.)630 2617 | |
a6ae8f35 CR |
12174 | y(Note)38 b(that)e(when)g(the)g(mo)s(de)g(is)g(in)m(terpreted)h(as)f |
12175 | (an)g(o)s(ctal)i(n)m(um)m(b)s(er,)e(eac)m(h)i(n)m(um)m(b)s(er)d(of)630 | |
e59452c7 | 12176 | 2727 y(the)f(umask)g(is)h(subtracted)f(from)f Ft(7)p |
fc527055 | 12177 | Fu(.)53 b(Th)m(us,)34 b(a)h(umask)e(of)i Ft(022)e Fu(results)h(in)g(p)s |
e59452c7 CR |
12178 | (ermissions)630 2836 y(of)d Ft(755)p Fu(.)150 2982 y |
12179 | Ft(unset)870 3110 y(unset)46 b([-fnv])g([)p Fj(name)p | |
12180 | Ft(])630 3237 y Fu(Remo)m(v)m(e)36 b(eac)m(h)f(v)-5 b(ariable)35 | |
fc527055 | 12181 | b(or)f(function)f Fr(name)p Fu(.)52 b(If)33 b(the)i Ft(-v)e |
e59452c7 | 12182 | Fu(option)h(is)g(giv)m(en,)j(eac)m(h)e Fr(name)630 3347 |
b729dac1 CR |
12183 | y Fu(refers)27 b(to)h(a)g(shell)f(v)-5 b(ariable)28 b(and)f(that)h(v)-5 |
12184 | b(ariable)28 b(is)f(remo)m(v)m(ed.)41 b(If)27 b(the)g | |
e59452c7 | 12185 | Ft(-f)g Fu(option)g(is)h(giv)m(en,)630 3457 y(the)37 |
abfcfa4e CR |
12186 | b Fr(name)5 b Fu(s)37 b(refer)f(to)i(shell)f(functions,)h(and)e(the)h |
12187 | (function)g(de\014nition)f(is)h(remo)m(v)m(ed.)61 b(If)630 | |
e59452c7 CR |
12188 | 3566 y(the)34 b Ft(-n)e Fu(option)i(is)f(supplied,)h(and)e |
12189 | Fr(name)39 b Fu(is)33 b(a)h(v)-5 b(ariable)34 b(with)f(the)h | |
12190 | Ft(nameref)d Fu(attribute,)630 3676 y Fr(name)42 b Fu(will)37 | |
12191 | b(b)s(e)f(unset)g(rather)g(than)h(the)g(v)-5 b(ariable)37 | |
12192 | b(it)g(references.)60 b Ft(-n)36 b Fu(has)g(no)h(e\013ect)h(if)630 | |
12193 | 3785 y(the)h Ft(-f)g Fu(option)g(is)h(supplied.)65 b(If)39 | |
12194 | b(no)g(options)h(are)f(supplied,)h(eac)m(h)h Fr(name)j | |
12195 | Fu(refers)39 b(to)h(a)630 3895 y(v)-5 b(ariable;)45 b(if)39 | |
12196 | b(there)g(is)g(no)g(v)-5 b(ariable)40 b(b)m(y)f(that)h(name,)h(a)f | |
12197 | (function)f(with)g(that)g(name,)j(if)630 4004 y(an)m(y)-8 | |
abfcfa4e CR |
12198 | b(,)34 b(is)e(unset.)46 b(Readonly)33 b(v)-5 b(ariables)33 |
12199 | b(and)f(functions)g(ma)m(y)h(not)f(b)s(e)g(unset.)46 | |
e59452c7 | 12200 | b(Some)33 b(shell)630 4114 y(v)-5 b(ariables)29 b(lose)h(their)e(sp)s |
abfcfa4e | 12201 | (ecial)h(b)s(eha)m(vior)g(if)f(they)h(are)g(unset;)g(suc)m(h)f(b)s(eha) |
e59452c7 | 12202 | m(vior)h(is)g(noted)f(in)630 4224 y(the)35 b(description)h(of)f(the)g |
abfcfa4e | 12203 | (individual)g(v)-5 b(ariables.)56 b(The)34 b(return)g(status)i(is)f |
e59452c7 CR |
12204 | (zero)h(unless)f(a)630 4333 y Fr(name)h Fu(is)30 b(readonly)g(or)h(ma)m |
12205 | (y)g(not)f(b)s(e)g(unset.)150 4560 y Fs(4.2)68 b(Bash)45 | |
12206 | b(Builtin)g(Commands)150 4720 y Fu(This)c(section)h(describ)s(es)f | |
12207 | (builtin)f(commands)h(whic)m(h)g(are)h(unique)e(to)j(or)e(ha)m(v)m(e)h | |
12208 | (b)s(een)f(extended)g(in)150 4829 y(Bash.)g(Some)30 b(of)h(these)g | |
12209 | (commands)f(are)g(sp)s(eci\014ed)g(in)g(the)h Fm(posix)e | |
12210 | Fu(standard.)150 4975 y Ft(alias)870 5103 y(alias)46 | |
12211 | b([-p])h([)p Fj(name)p Ft([=)p Fj(value)p Ft(])d(...)o(])630 | |
12212 | 5230 y Fu(Without)26 b(argumen)m(ts)f(or)g(with)f(the)h | |
12213 | Ft(-p)g Fu(option,)h Ft(alias)e Fu(prin)m(ts)g(the)h(list)h(of)f | |
12214 | (aliases)h(on)f(the)630 5340 y(standard)g(output)g(in)g(a)h(form)f | |
6e51e0d0 | 12215 | (that)h(allo)m(ws)h(them)e(to)h(b)s(e)f(reused)g(as)g(input.)39 |
e59452c7 CR |
12216 | b(If)25 b(argumen)m(ts)p eop end |
12217 | %%Page: 55 61 | |
12218 | TeXDict begin 55 60 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12219 | b(Shell)30 b(Builtin)h(Commands)2069 b(55)630 299 y(are)28 | |
12220 | b(supplied,)e(an)i(alias)g(is)f(de\014ned)f(for)h(eac)m(h)h | |
12221 | Fr(name)33 b Fu(whose)27 b Fr(v)-5 b(alue)33 b Fu(is)27 | |
12222 | b(giv)m(en.)41 b(If)26 b(no)h Fr(v)-5 b(alue)630 408 | |
12223 | y Fu(is)37 b(giv)m(en,)j(the)d(name)g(and)g(v)-5 b(alue)37 | |
12224 | b(of)h(the)f(alias)h(is)f(prin)m(ted.)61 b(Aliases)38 | |
12225 | b(are)f(describ)s(ed)f(in)630 518 y(Section)31 b(6.6)h([Aliases],)g | |
12226 | (page)f(99.)150 676 y Ft(bind)870 810 y(bind)47 b([-m)g | |
12227 | Fj(keymap)p Ft(])e([-lpsvPSVX])870 920 y(bind)i([-m)g | |
12228 | Fj(keymap)p Ft(])e([-q)i Fj(function)p Ft(])f([-u)g Fj(function)p | |
12229 | Ft(])g([-r)h Fj(keyseq)p Ft(])870 1029 y(bind)g([-m)g | |
12230 | Fj(keymap)p Ft(])e(-f)j Fj(filename)870 1139 y Ft(bind)f([-m)g | |
12231 | Fj(keymap)p Ft(])e(-x)j Fj(keyseq:shell-command)870 1249 | |
12232 | y Ft(bind)f([-m)g Fj(keymap)p Ft(])e Fj(keyseq:function-name)870 | |
12233 | 1358 y Ft(bind)i([-m)g Fj(keymap)p Ft(])e Fj(keyseq:readline-command) | |
12234 | 870 1468 y Ft(bind)i Fj(readline-command-line)630 1602 | |
12235 | y Fu(Displa)m(y)22 b(curren)m(t)f(Readline)h(\(see)f(Chapter)g(8)g | |
fffe80d4 | 12236 | ([Command)f(Line)h(Editing],)j(page)e(116\))g(k)m(ey)630 |
e59452c7 CR |
12237 | 1711 y(and)36 b(function)g(bindings,)i(bind)d(a)i(k)m(ey)g(sequence)g |
12238 | (to)h(a)f(Readline)g(function)f(or)h(macro,)630 1821 | |
12239 | y(or)44 b(set)h(a)g(Readline)f(v)-5 b(ariable.)83 b(Eac)m(h)45 | |
abfcfa4e | 12240 | b(non-option)g(argumen)m(t)f(is)g(a)h(command)f(as)g(it)630 |
e59452c7 | 12241 | 1931 y(w)m(ould)e(app)s(ear)f(in)h(a)h(Readline)g(initialization)i |
abfcfa4e | 12242 | (\014le)d(\(see)h(Section)g(8.3)g([Readline)g(Init)630 |
fffe80d4 | 12243 | 2040 y(File],)c(page)d(119\),)j(but)c(eac)m(h)h(binding)f(or)g(command) |
e59452c7 | 12244 | h(m)m(ust)f(b)s(e)g(passed)g(as)h(a)g(separate)630 2150 |
a6ae8f35 | 12245 | y(argumen)m(t;)31 b(e.g.,)h(`)p Ft("\\C-x\\C-r":re-read-init-f)o(ile)p |
e59452c7 CR |
12246 | Fu('.)630 2284 y(Options,)e(if)h(supplied,)e(ha)m(v)m(e)i(the)g(follo)m |
12247 | (wing)h(meanings:)630 2442 y Ft(-m)e Fj(keymap)66 b Fu(Use)54 | |
a6ae8f35 | 12248 | b Fr(k)m(eymap)j Fu(as)d(the)g(k)m(eymap)g(to)h(b)s(e)e(a\013ected)i(b) |
e59452c7 | 12249 | m(y)f(the)g(subsequen)m(t)1110 2552 y(bindings.)46 b(Acceptable)34 |
fc527055 | 12250 | b Fr(k)m(eymap)i Fu(names)c(are)h Ft(emacs)p Fu(,)f Ft(emacs-standard)p |
e59452c7 | 12251 | Fu(,)1110 2661 y Ft(emacs-meta)p Fu(,)99 b Ft(emacs-ctlx)p |
fc527055 | 12252 | Fu(,)f Ft(vi)p Fu(,)j Ft(vi-move)p Fu(,)f Ft(vi-command)p |
e59452c7 | 12253 | Fu(,)f(and)1110 2771 y Ft(vi-insert)p Fu(.)81 b Ft(vi)44 |
037a8b7f | 12254 | b Fu(is)h(equiv)-5 b(alen)m(t)46 b(to)g Ft(vi-command)c |
e59452c7 | 12255 | Fu(\()p Ft(vi-move)h Fu(is)i(also)h(a)1110 2880 y(synon)m(ym\);)30 |
037a8b7f | 12256 | b Ft(emacs)f Fu(is)i(equiv)-5 b(alen)m(t)32 b(to)f Ft(emacs-standard)p |
e59452c7 CR |
12257 | Fu(.)630 3039 y Ft(-l)384 b Fu(List)31 b(the)f(names)g(of)h(all)g |
12258 | (Readline)g(functions.)630 3197 y Ft(-p)384 b Fu(Displa)m(y)34 | |
037a8b7f | 12259 | b(Readline)f(function)g(names)g(and)f(bindings)f(in)i(suc)m(h)f(a)i(w)m |
e59452c7 CR |
12260 | (a)m(y)f(that)1110 3306 y(they)e(can)f(b)s(e)g(used)g(as)g(input)g(or)g |
12261 | (in)g(a)h(Readline)g(initialization)i(\014le.)630 3465 | |
037a8b7f | 12262 | y Ft(-P)384 b Fu(List)31 b(curren)m(t)f(Readline)h(function)f(names)g |
e59452c7 | 12263 | (and)g(bindings.)630 3623 y Ft(-v)384 b Fu(Displa)m(y)25 |
037a8b7f | 12264 | b(Readline)f(v)-5 b(ariable)25 b(names)f(and)f(v)-5 b(alues)24 |
e59452c7 | 12265 | b(in)g(suc)m(h)f(a)i(w)m(a)m(y)f(that)h(they)1110 3733 |
037a8b7f | 12266 | y(can)31 b(b)s(e)e(used)h(as)h(input)e(or)h(in)g(a)h(Readline)g |
e59452c7 | 12267 | (initialization)j(\014le.)630 3891 y Ft(-V)384 b Fu(List)31 |
037a8b7f | 12268 | b(curren)m(t)f(Readline)h(v)-5 b(ariable)31 b(names)f(and)g(v)-5 |
e59452c7 | 12269 | b(alues.)630 4049 y Ft(-s)384 b Fu(Displa)m(y)39 b(Readline)f(k)m(ey)g |
ad4aef08 | 12270 | (sequences)f(b)s(ound)f(to)i(macros)g(and)f(the)g(strings)1110 |
e59452c7 CR |
12271 | 4159 y(they)d(output)f(in)h(suc)m(h)f(a)h(w)m(a)m(y)h(that)f(they)g |
12272 | (can)g(b)s(e)f(used)g(as)h(input)e(or)i(in)g(a)1110 4268 | |
12273 | y(Readline)d(initialization)i(\014le.)630 4427 y Ft(-S)384 | |
037a8b7f | 12274 | b Fu(Displa)m(y)39 b(Readline)f(k)m(ey)g(sequences)f(b)s(ound)f(to)i |
e59452c7 CR |
12275 | (macros)g(and)f(the)g(strings)1110 4536 y(they)31 b(output.)630 |
12276 | 4695 y Ft(-f)f Fj(filename)1110 4804 y Fu(Read)h(k)m(ey)g(bindings)e | |
12277 | (from)h Fr(\014lename)p Fu(.)630 4963 y Ft(-q)g Fj(function)1110 | |
12278 | 5072 y Fu(Query)g(ab)s(out)g(whic)m(h)g(k)m(eys)h(in)m(v)m(ok)m(e)h | |
12279 | (the)f(named)f Fr(function)p Fu(.)630 5230 y Ft(-u)g | |
12280 | Fj(function)1110 5340 y Fu(Un)m(bind)f(all)i(k)m(eys)g(b)s(ound)e(to)i | |
12281 | (the)f(named)g Fr(function)p Fu(.)p eop end | |
12282 | %%Page: 56 62 | |
12283 | TeXDict begin 56 61 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12284 | b(Shell)30 b(Builtin)h(Commands)2069 b(56)630 299 y Ft(-r)30 | |
12285 | b Fj(keyseq)66 b Fu(Remo)m(v)m(e)32 b(an)m(y)f(curren)m(t)f(binding)f | |
12286 | (for)h Fr(k)m(eyseq)p Fu(.)630 452 y Ft(-x)g Fj(keyseq:shell-command) | |
12287 | 1110 562 y Fu(Cause)35 b Fr(shell-command)k Fu(to)d(b)s(e)f(executed)h | |
6e51e0d0 | 12288 | (whenev)m(er)f Fr(k)m(eyseq)j Fu(is)d(en)m(tered.)1110 |
e59452c7 CR |
12289 | 671 y(When)46 b Fr(shell-command)k Fu(is)c(executed,)51 |
12290 | b(the)46 b(shell)g(sets)g(the)g Ft(READLINE_)1110 781 | |
6e51e0d0 | 12291 | y(LINE)37 b Fu(v)-5 b(ariable)38 b(to)g(the)g(con)m(ten)m(ts)i(of)e |
e59452c7 CR |
12292 | (the)g(Readline)g(line)g(bu\013er)f(and)g(the)1110 891 |
12293 | y Ft(READLINE_POINT)d Fu(and)j Ft(READLINE_MARK)d Fu(v)-5 | |
12294 | b(ariables)39 b(to)f(the)g(curren)m(t)g(lo-)1110 1000 | |
12295 | y(cation)46 b(of)f(the)g(insertion)g(p)s(oin)m(t)f(and)g(the)h(sa)m(v)m | |
12296 | (ed)h(insertion)f(p)s(oin)m(t)f(\(the)1110 1110 y Fr(mark)6 | |
12297 | b Fu(\),)38 b(resp)s(ectiv)m(ely)-8 b(.)62 b(The)36 b(shell)h(assigns)g | |
12298 | (an)m(y)g(n)m(umeric)g(argumen)m(t)g(the)1110 1219 y(user)43 | |
12299 | b(supplied)g(to)h(the)g Ft(READLINE_ARGUMENT)39 b Fu(v)-5 | |
12300 | b(ariable.)82 b(If)44 b(there)g(w)m(as)1110 1329 y(no)39 | |
12301 | b(argumen)m(t,)j(that)d(v)-5 b(ariable)40 b(is)f(not)g(set.)68 | |
12302 | b(If)38 b(the)h(executed)h(command)1110 1439 y(c)m(hanges)e(the)e(v)-5 | |
12303 | b(alue)37 b(of)g(an)m(y)g(of)g Ft(READLINE_LINE)p Fu(,)d | |
12304 | Ft(READLINE_POINT)p Fu(,)h(or)1110 1548 y Ft(READLINE_MARK)p | |
12305 | Fu(,)i(those)i(new)f(v)-5 b(alues)38 b(will)h(b)s(e)f(re\015ected)h(in) | |
12306 | f(the)g(editing)1110 1658 y(state.)630 1811 y Ft(-X)384 | |
abfcfa4e | 12307 | b Fu(List)27 b(all)i(k)m(ey)f(sequences)f(b)s(ound)e(to)j(shell)g |
e59452c7 | 12308 | (commands)e(and)h(the)g(asso)s(ciated)1110 1921 y(commands)j(in)g(a)h |
abfcfa4e | 12309 | (format)g(that)f(can)h(b)s(e)f(reused)f(as)i(input.)630 |
e59452c7 | 12310 | 2074 y(The)26 b(return)f(status)i(is)f(zero)i(unless)d(an)i(in)m(v)-5 |
e2169ae9 | 12311 | b(alid)27 b(option)g(is)f(supplied)f(or)i(an)f(error)g(o)s(ccurs.)150 |
e59452c7 CR |
12312 | 2228 y Ft(builtin)870 2359 y(builtin)46 b([)p Fj(shell-builtin)e |
12313 | Ft([)p Fj(args)p Ft(]])630 2491 y Fu(Run)35 b(a)i(shell)f(builtin,)i | |
e2169ae9 | 12314 | (passing)e(it)h Fr(args)p Fu(,)h(and)e(return)f(its)i(exit)g(status.)59 |
e59452c7 | 12315 | b(This)35 b(is)i(useful)630 2600 y(when)29 b(de\014ning)h(a)g(shell)h |
a6ae8f35 | 12316 | (function)f(with)g(the)g(same)h(name)f(as)h(a)g(shell)f(builtin,)g |
e59452c7 | 12317 | (retaining)630 2710 y(the)k(functionalit)m(y)h(of)f(the)f(builtin)g |
a6ae8f35 | 12318 | (within)g(the)h(function.)50 b(The)33 b(return)g(status)h(is)f(non-)630 |
e59452c7 CR |
12319 | 2819 y(zero)e(if)g Fr(shell-builtin)f Fu(is)g(not)h(a)g(shell)f |
12320 | (builtin)g(command.)150 2973 y Ft(caller)870 3104 y(caller)46 | |
12321 | b([)p Fj(expr)p Ft(])630 3236 y Fu(Returns)34 b(the)g(con)m(text)j(of)e | |
a6ae8f35 | 12322 | (an)m(y)g(activ)m(e)i(subroutine)c(call)j(\(a)f(shell)g(function)f(or)h |
e59452c7 CR |
12323 | (a)g(script)630 3345 y(executed)c(with)f(the)h Ft(.)f |
12324 | Fu(or)g Ft(source)f Fu(builtins\).)630 3477 y(Without)45 | |
a6ae8f35 | 12325 | b Fr(expr)p Fu(,)j Ft(caller)43 b Fu(displa)m(ys)i(the)f(line)h(n)m(um) |
e59452c7 | 12326 | m(b)s(er)f(and)g(source)g(\014lename)h(of)g(the)630 3587 |
a6ae8f35 CR |
12327 | y(curren)m(t)35 b(subroutine)g(call.)58 b(If)35 b(a)h(non-negativ)m(e)i |
12328 | (in)m(teger)f(is)f(supplied)e(as)i Fr(expr)p Fu(,)h Ft(caller)630 | |
e59452c7 | 12329 | 3696 y Fu(displa)m(ys)k(the)f(line)h(n)m(um)m(b)s(er,)h(subroutine)d |
6e51e0d0 | 12330 | (name,)44 b(and)c(source)g(\014le)h(corresp)s(onding)e(to)630 |
e59452c7 | 12331 | 3806 y(that)c(p)s(osition)g(in)f(the)h(curren)m(t)f(execution)i(call)g |
6e51e0d0 | 12332 | (stac)m(k.)54 b(This)34 b(extra)h(information)g(ma)m(y)630 |
e59452c7 | 12333 | 3915 y(b)s(e)30 b(used,)g(for)g(example,)h(to)g(prin)m(t)f(a)h(stac)m |
d76edd30 | 12334 | (k)h(trace.)42 b(The)29 b(curren)m(t)i(frame)f(is)g(frame)h(0.)630 |
e59452c7 | 12335 | 4047 y(The)d(return)g(v)-5 b(alue)29 b(is)g(0)g(unless)f(the)h(shell)g |
6e51e0d0 | 12336 | (is)g(not)g(executing)h(a)f(subroutine)e(call)j(or)f |
e59452c7 | 12337 | Fr(expr)630 4156 y Fu(do)s(es)h(not)h(corresp)s(ond)e(to)i(a)g(v)-5 |
37c41ab1 | 12338 | b(alid)30 b(p)s(osition)h(in)f(the)g(call)i(stac)m(k.)150 |
e59452c7 CR |
12339 | 4310 y Ft(command)870 4441 y(command)46 b([-pVv])g Fj(command)g |
12340 | Ft([)p Fj(arguments)f Ft(...)o(])630 4573 y Fu(Runs)32 | |
6e51e0d0 | 12341 | b Fr(command)k Fu(with)d Fr(argumen)m(ts)k Fu(ignoring)c(an)m(y)g |
e59452c7 | 12342 | (shell)h(function)e(named)h Fr(command)p Fu(.)630 4682 |
37c41ab1 | 12343 | y(Only)39 b(shell)i(builtin)e(commands)h(or)g(commands)f(found)g(b)m(y) |
e59452c7 | 12344 | h(searc)m(hing)h(the)f Ft(PATH)f Fu(are)630 4792 y(executed.)59 |
6e51e0d0 CR |
12345 | b(If)36 b(there)h(is)f(a)h(shell)f(function)g(named)g |
12346 | Ft(ls)p Fu(,)h(running)e(`)p Ft(command)29 b(ls)p Fu(')35 | |
e59452c7 | 12347 | b(within)630 4902 y(the)c(function)f(will)h(execute)g(the)g(external)g |
6e51e0d0 | 12348 | (command)g Ft(ls)f Fu(instead)g(of)h(calling)h(the)f(func-)630 |
e59452c7 | 12349 | 5011 y(tion)36 b(recursiv)m(ely)-8 b(.)56 b(The)34 b |
6e51e0d0 | 12350 | Ft(-p)h Fu(option)g(means)g(to)h(use)f(a)g(default)h(v)-5 |
e59452c7 | 12351 | b(alue)35 b(for)g Ft(PATH)f Fu(that)i(is)630 5121 y(guaran)m(teed)f(to) |
6e51e0d0 | 12352 | f(\014nd)e(all)j(of)f(the)g(standard)f(utilities.)52 |
e59452c7 | 12353 | b(The)33 b(return)g(status)h(in)f(this)h(case)630 5230 |
6e51e0d0 | 12354 | y(is)29 b(127)g(if)g Fr(command)j Fu(cannot)d(b)s(e)e(found)h(or)g(an)g |
45c0f7f8 | 12355 | (error)h(o)s(ccurred,)f(and)g(the)h(exit)g(status)g(of)630 |
e59452c7 CR |
12356 | 5340 y Fr(command)34 b Fu(otherwise.)p eop end |
12357 | %%Page: 57 63 | |
12358 | TeXDict begin 57 62 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12359 | b(Shell)30 b(Builtin)h(Commands)2069 b(57)630 299 y(If)32 | |
12360 | b(either)h(the)f Ft(-V)g Fu(or)g Ft(-v)g Fu(option)h(is)f(supplied,)g | |
12361 | (a)h(description)f(of)h Fr(command)j Fu(is)c(prin)m(ted.)630 | |
12362 | 408 y(The)f Ft(-v)h Fu(option)g(causes)g(a)g(single)h(w)m(ord)f | |
12363 | (indicating)g(the)g(command)g(or)g(\014le)g(name)g(used)630 | |
12364 | 518 y(to)40 b(in)m(v)m(ok)m(e)h Fr(command)h Fu(to)e(b)s(e)e(displa)m | |
12365 | (y)m(ed;)44 b(the)39 b Ft(-V)f Fu(option)i(pro)s(duces)d(a)j(more)f(v)m | |
12366 | (erb)s(ose)630 628 y(description.)61 b(In)36 b(this)h(case,)j(the)e | |
12367 | (return)e(status)h(is)g(zero)h(if)f Fr(command)k Fu(is)c(found,)h(and) | |
12368 | 630 737 y(non-zero)31 b(if)f(not.)150 897 y Ft(declare)870 | |
12369 | 1031 y(declare)46 b([-aAfFgiIlnrtux])d([-p])k([)p Fj(name)p | |
12370 | Ft([=)p Fj(value)p Ft(])d(...)o(])630 1166 y Fu(Declare)29 | |
54a1fa7c | 12371 | b(v)-5 b(ariables)28 b(and)e(giv)m(e)j(them)e(attributes.)40 |
6e51e0d0 | 12372 | b(If)27 b(no)g Fr(name)5 b Fu(s)27 b(are)h(giv)m(en,)h(then)e(displa)m |
e59452c7 CR |
12373 | (y)630 1275 y(the)k(v)-5 b(alues)30 b(of)h(v)-5 b(ariables)31 |
12374 | b(instead.)630 1410 y(The)k Ft(-p)f Fu(option)i(will)g(displa)m(y)f | |
6e51e0d0 | 12375 | (the)h(attributes)g(and)e(v)-5 b(alues)36 b(of)f(eac)m(h)i |
e59452c7 | 12376 | Fr(name)p Fu(.)55 b(When)36 b Ft(-p)630 1519 y Fu(is)i(used)g(with)g |
6e51e0d0 | 12377 | Fr(name)43 b Fu(argumen)m(ts,)e(additional)e(options,)i(other)d(than)g |
e59452c7 CR |
12378 | Ft(-f)g Fu(and)g Ft(-F)p Fu(,)i(are)630 1629 y(ignored.)630 |
12379 | 1763 y(When)g Ft(-p)g Fu(is)g(supplied)f(without)i Fr(name)k | |
12380 | Fu(argumen)m(ts,)f Ft(declare)38 b Fu(will)j(displa)m(y)f(the)h(at-)630 | |
12381 | 1873 y(tributes)31 b(and)f(v)-5 b(alues)31 b(of)g(all)h(v)-5 | |
abfcfa4e | 12382 | b(ariables)31 b(ha)m(ving)h(the)f(attributes)g(sp)s(eci\014ed)f(b)m(y)h |
e59452c7 CR |
12383 | (the)g(addi-)630 1983 y(tional)k(options.)52 b(If)34 |
12384 | b(no)g(other)g(options)g(are)g(supplied)f(with)h Ft(-p)p | |
12385 | Fu(,)g Ft(declare)e Fu(will)j(displa)m(y)630 2092 y(the)e(attributes)h | |
12386 | (and)e(v)-5 b(alues)33 b(of)g(all)h(shell)f(v)-5 b(ariables.)50 | |
12387 | b(The)32 b Ft(-f)g Fu(option)i(will)f(restrict)h(the)630 | |
12388 | 2202 y(displa)m(y)d(to)g(shell)f(functions.)630 2336 | |
12389 | y(The)41 b Ft(-F)f Fu(option)i(inhibits)e(the)i(displa)m(y)f(of)g | |
12390 | (function)g(de\014nitions;)47 b(only)41 b(the)g(function)630 | |
12391 | 2446 y(name)30 b(and)f(attributes)i(are)f(prin)m(ted.)40 | |
12392 | b(If)30 b(the)g Ft(extdebug)e Fu(shell)i(option)g(is)g(enabled)g(using) | |
12393 | 630 2555 y Ft(shopt)24 b Fu(\(see)i(Section)g(4.3.2)i([The)d(Shopt)f | |
12394 | (Builtin],)k(page)e(70\),)i(the)d(source)h(\014le)f(name)h(and)630 | |
12395 | 2665 y(line)31 b(n)m(um)m(b)s(er)e(where)h(eac)m(h)h | |
abfcfa4e | 12396 | Fr(name)36 b Fu(is)30 b(de\014ned)f(are)i(displa)m(y)m(ed)g(as)g(w)m |
e59452c7 | 12397 | (ell.)41 b Ft(-F)30 b Fu(implies)h Ft(-f)p Fu(.)630 2800 |
abfcfa4e CR |
12398 | y(The)36 b Ft(-g)g Fu(option)h(forces)g(v)-5 b(ariables)37 |
12399 | b(to)g(b)s(e)f(created)i(or)e(mo)s(di\014ed)g(at)h(the)g(global)h(scop) | |
e59452c7 | 12400 | s(e,)630 2909 y(ev)m(en)g(when)e Ft(declare)f Fu(is)j(executed)g(in)f |
abfcfa4e | 12401 | (a)g(shell)h(function.)61 b(It)37 b(is)g(ignored)h(in)f(all)h(other)630 |
e59452c7 | 12402 | 3019 y(cases.)630 3153 y(The)50 b Ft(-I)h Fu(option)g(causes)h(lo)s |
d37a4722 | 12403 | (cal)g(v)-5 b(ariables)51 b(to)h(inherit)f(the)g(attributes)g(\(except) |
e59452c7 CR |
12404 | i(the)630 3263 y Ft(nameref)43 b Fu(attribute\))j(and)f(v)-5 |
12405 | b(alue)46 b(of)f(an)m(y)h(existing)g(v)-5 b(ariable)46 | |
12406 | b(with)f(the)g(same)h Fr(name)630 3372 y Fu(at)40 b(a)f(surrounding)d | |
d37a4722 CR |
12407 | (scop)s(e.)66 b(If)39 b(there)g(is)g(no)f(existing)i(v)-5 |
12408 | b(ariable,)42 b(the)d(lo)s(cal)h(v)-5 b(ariable)40 b(is)630 | |
e59452c7 | 12409 | 3482 y(initially)32 b(unset.)630 3616 y(The)27 b(follo)m(wing)h |
d37a4722 | 12410 | (options)g(can)f(b)s(e)g(used)f(to)i(restrict)g(output)e(to)i(v)-5 |
e59452c7 | 12411 | b(ariables)28 b(with)f(the)g(sp)s(ec-)630 3726 y(i\014ed)j(attributes)h |
d37a4722 | 12412 | (or)f(to)h(giv)m(e)h(v)-5 b(ariables)31 b(attributes:)630 |
e59452c7 | 12413 | 3885 y Ft(-a)384 b Fu(Eac)m(h)36 b Fr(name)k Fu(is)34 |
d37a4722 | 12414 | b(an)h(indexed)g(arra)m(y)g(v)-5 b(ariable)36 b(\(see)f(Section)h(6.7)g |
e59452c7 | 12415 | ([Arra)m(ys],)1110 3995 y(page)31 b(99\).)630 4154 y |
d37a4722 CR |
12416 | Ft(-A)384 b Fu(Eac)m(h)24 b Fr(name)k Fu(is)23 b(an)g(asso)s(ciativ)m |
12417 | (e)j(arra)m(y)e(v)-5 b(ariable)24 b(\(see)g(Section)g(6.7)g([Arra)m | |
e59452c7 CR |
12418 | (ys],)1110 4264 y(page)31 b(99\).)630 4423 y Ft(-f)384 |
12419 | b Fu(Use)31 b(function)f(names)g(only)-8 b(.)630 4583 | |
d37a4722 CR |
12420 | y Ft(-i)384 b Fu(The)36 b(v)-5 b(ariable)37 b(is)f(to)h(b)s(e)f |
12421 | (treated)h(as)g(an)f(in)m(teger;)41 b(arithmetic)c(ev)-5 | |
e59452c7 CR |
12422 | b(aluation)1110 4692 y(\(see)29 b(Section)f(6.5)h([Shell)f |
12423 | (Arithmetic],)i(page)e(97\))h(is)f(p)s(erformed)e(when)h(the)1110 | |
12424 | 4802 y(v)-5 b(ariable)31 b(is)g(assigned)f(a)h(v)-5 b(alue.)630 | |
12425 | 4961 y Ft(-l)384 b Fu(When)26 b(the)g(v)-5 b(ariable)27 | |
d37a4722 | 12426 | b(is)f(assigned)g(a)g(v)-5 b(alue,)28 b(all)f(upp)s(er-case)e(c)m |
e59452c7 | 12427 | (haracters)j(are)1110 5071 y(con)m(v)m(erted)k(to)f(lo)m(w)m(er-case.) |
d37a4722 | 12428 | 43 b(The)30 b(upp)s(er-case)g(attribute)h(is)g(disabled.)630 |
e59452c7 CR |
12429 | 5230 y Ft(-n)384 b Fu(Giv)m(e)28 b(eac)m(h)g Fr(name)k |
12430 | Fu(the)27 b Ft(nameref)d Fu(attribute,)29 b(making)e(it)g(a)g(name)f | |
12431 | (reference)1110 5340 y(to)32 b(another)g(v)-5 b(ariable.)46 | |
d85b4caf | 12432 | b(That)31 b(other)h(v)-5 b(ariable)33 b(is)f(de\014ned)e(b)m(y)i(the)g |
e59452c7 CR |
12433 | (v)-5 b(alue)32 b(of)p eop end |
12434 | %%Page: 58 64 | |
12435 | TeXDict begin 58 63 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12436 | b(Shell)30 b(Builtin)h(Commands)2069 b(58)1110 299 y | |
12437 | Fr(name)p Fu(.)54 b(All)35 b(references,)h(assignmen)m(ts,)h(and)d | |
12438 | (attribute)h(mo)s(di\014cations)g(to)1110 408 y Fr(name)p | |
12439 | Fu(,)27 b(except)f(for)f(those)h(using)f(or)g(c)m(hanging)h(the)f | |
12440 | Ft(-n)g Fu(attribute)h(itself,)i(are)1110 518 y(p)s(erformed)22 | |
12441 | b(on)h(the)g(v)-5 b(ariable)25 b(referenced)e(b)m(y)g | |
12442 | Fr(name)5 b Fu('s)23 b(v)-5 b(alue.)39 b(The)23 b(nameref)1110 | |
12443 | 628 y(attribute)31 b(cannot)g(b)s(e)f(applied)g(to)h(arra)m(y)g(v)-5 | |
12444 | b(ariables.)630 785 y Ft(-r)384 b Fu(Mak)m(e)25 b Fr(name)5 | |
12445 | b Fu(s)23 b(readonly)-8 b(.)39 b(These)24 b(names)f(cannot)h(then)f(b)s | |
12446 | (e)g(assigned)h(v)-5 b(alues)1110 894 y(b)m(y)30 b(subsequen)m(t)g | |
12447 | (assignmen)m(t)h(statemen)m(ts)h(or)f(unset.)630 1052 | |
12448 | y Ft(-t)384 b Fu(Giv)m(e)33 b(eac)m(h)h Fr(name)j Fu(the)32 | |
12449 | b Ft(trace)f Fu(attribute.)46 b(T)-8 b(raced)32 b(functions)g(inherit)g | |
12450 | (the)1110 1161 y Ft(DEBUG)26 b Fu(and)h Ft(RETURN)f Fu(traps)h(from)g | |
12451 | (the)h(calling)h(shell.)40 b(The)27 b(trace)i(attribute)1110 | |
12452 | 1271 y(has)h(no)g(sp)s(ecial)h(meaning)g(for)f(v)-5 b(ariables.)630 | |
12453 | 1428 y Ft(-u)384 b Fu(When)28 b(the)h(v)-5 b(ariable)29 | |
12454 | b(is)f(assigned)h(a)f(v)-5 b(alue,)30 b(all)f(lo)m(w)m(er-case)i(c)m | |
12455 | (haracters)f(are)1110 1538 y(con)m(v)m(erted)i(to)f(upp)s(er-case.)40 | |
12456 | b(The)30 b(lo)m(w)m(er-case)j(attribute)e(is)g(disabled.)630 | |
12457 | 1695 y Ft(-x)384 b Fu(Mark)30 b(eac)m(h)h Fr(name)k Fu(for)29 | |
12458 | b(exp)s(ort)h(to)g(subsequen)m(t)f(commands)h(via)g(the)g(en)m(vi-)1110 | |
12459 | 1805 y(ronmen)m(t.)630 1962 y(Using)e(`)p Ft(+)p Fu(')h(instead)f(of)g | |
12460 | (`)p Ft(-)p Fu(')g(turns)f(o\013)i(the)f(attribute)h(instead,)g(with)f | |
12461 | (the)g(exceptions)h(that)630 2071 y(`)p Ft(+a)p Fu(')23 | |
d37a4722 CR |
12462 | b(and)f(`)p Ft(+A)p Fu(')h(ma)m(y)h(not)f(b)s(e)f(used)g(to)i(destro)m |
12463 | (y)g(arra)m(y)f(v)-5 b(ariables)24 b(and)e(`)p Ft(+r)p | |
e59452c7 | 12464 | Fu(')h(will)g(not)g(remo)m(v)m(e)630 2181 y(the)36 b(readonly)h |
d37a4722 | 12465 | (attribute.)59 b(When)36 b(used)f(in)h(a)h(function,)g |
e59452c7 | 12466 | Ft(declare)d Fu(mak)m(es)j(eac)m(h)h Fr(name)630 2291 |
68701259 CR |
12467 | y Fu(lo)s(cal,)e(as)d(with)h(the)f Ft(local)f Fu(command,)j(unless)d |
12468 | (the)i Ft(-g)f Fu(option)h(is)f(used.)49 b(If)33 b(a)h(v)-5 | |
e59452c7 | 12469 | b(ariable)630 2400 y(name)30 b(is)h(follo)m(w)m(ed)h(b)m(y)e(=)p |
68701259 | 12470 | Fr(v)-5 b(alue)p Fu(,)31 b(the)f(v)-5 b(alue)31 b(of)g(the)f(v)-5 |
abfcfa4e | 12471 | b(ariable)32 b(is)e(set)h(to)g Fr(v)-5 b(alue)p Fu(.)630 |
e59452c7 | 12472 | 2534 y(When)41 b(using)g Ft(-a)g Fu(or)h Ft(-A)e Fu(and)h(the)h(comp)s |
abfcfa4e | 12473 | (ound)e(assignmen)m(t)i(syn)m(tax)g(to)g(create)h(arra)m(y)630 |
e59452c7 | 12474 | 2643 y(v)-5 b(ariables,)28 b(additional)f(attributes)g(do)f(not)h(tak)m |
a6ae8f35 | 12475 | (e)h(e\013ect)g(un)m(til)e(subsequen)m(t)g(assignmen)m(ts.)630 |
e59452c7 | 12476 | 2777 y(The)35 b(return)f(status)i(is)g(zero)g(unless)f(an)g(in)m(v)-5 |
a6ae8f35 | 12477 | b(alid)36 b(option)g(is)g(encoun)m(tered,)h(an)f(attempt)630 |
e59452c7 | 12478 | 2886 y(is)c(made)g(to)g(de\014ne)f(a)h(function)g(using)f(`)p |
a6ae8f35 | 12479 | Ft(-f)f(foo=bar)p Fu(',)h(an)h(attempt)g(is)g(made)g(to)h(assign)630 |
e59452c7 | 12480 | 2996 y(a)42 b(v)-5 b(alue)43 b(to)g(a)f(readonly)g(v)-5 |
a6ae8f35 | 12481 | b(ariable,)47 b(an)42 b(attempt)h(is)f(made)g(to)h(assign)f(a)h(v)-5 |
e59452c7 | 12482 | b(alue)42 b(to)h(an)630 3105 y(arra)m(y)30 b(v)-5 b(ariable)30 |
fc527055 | 12483 | b(without)g(using)e(the)i(comp)s(ound)e(assignmen)m(t)i(syn)m(tax)g |
e59452c7 CR |
12484 | (\(see)h(Section)f(6.7)630 3215 y([Arra)m(ys],)47 b(page)c(99\),)48 |
12485 | b(one)43 b(of)g(the)g Fr(name)5 b Fu(s)42 b(is)h(not)g(a)g(v)-5 | |
fc527055 | 12486 | b(alid)43 b(shell)g(v)-5 b(ariable)44 b(name,)i(an)630 |
e59452c7 | 12487 | 3324 y(attempt)28 b(is)f(made)h(to)f(turn)f(o\013)i(readonly)f(status)g |
15baad62 | 12488 | (for)g(a)h(readonly)f(v)-5 b(ariable,)29 b(an)e(attempt)630 |
e59452c7 | 12489 | 3434 y(is)h(made)h(to)g(turn)e(o\013)i(arra)m(y)f(status)h(for)f(an)g |
15baad62 | 12490 | (arra)m(y)h(v)-5 b(ariable,)30 b(or)e(an)g(attempt)i(is)e(made)g(to)630 |
e59452c7 CR |
12491 | 3544 y(displa)m(y)j(a)f(non-existen)m(t)i(function)e(with)g |
12492 | Ft(-f)p Fu(.)150 3701 y Ft(echo)870 3834 y(echo)47 b([-neE])f([)p | |
12493 | Fj(arg)g Ft(...])630 3968 y Fu(Output)31 b(the)i Fr(arg)8 | |
15baad62 | 12494 | b Fu(s,)33 b(separated)g(b)m(y)g(spaces,)g(terminated)g(with)f(a)h |
e59452c7 | 12495 | (newline.)47 b(The)32 b(return)630 4077 y(status)f(is)f(0)h(unless)f(a) |
15baad62 | 12496 | h(write)g(error)f(o)s(ccurs.)41 b(If)30 b Ft(-n)g Fu(is)h(sp)s |
e59452c7 | 12497 | (eci\014ed,)f(the)h(trailing)g(newline)g(is)630 4187 |
15baad62 CR |
12498 | y(suppressed.)38 b(If)29 b(the)h Ft(-e)f Fu(option)h(is)f(giv)m(en,)i |
12499 | (in)m(terpretation)g(of)e(the)h(follo)m(wing)h(bac)m(kslash-)630 | |
e59452c7 | 12500 | 4296 y(escap)s(ed)43 b(c)m(haracters)h(is)e(enabled.)78 |
15baad62 | 12501 | b(The)42 b Ft(-E)g Fu(option)h(disables)g(the)g(in)m(terpretation)h(of) |
e59452c7 | 12502 | 630 4406 y(these)27 b(escap)s(e)g(c)m(haracters,)i(ev)m(en)e(on)g |
15baad62 | 12503 | (systems)f(where)g(they)h(are)g(in)m(terpreted)g(b)m(y)f(default.)630 |
e59452c7 | 12504 | 4516 y(The)32 b Ft(xpg_echo)f Fu(shell)i(option)g(ma)m(y)h(b)s(e)e |
1101193a | 12505 | (used)g(to)h(dynamically)h(determine)f(whether)f(or)630 |
e59452c7 | 12506 | 4625 y(not)h Ft(echo)f Fu(expands)g(these)h(escap)s(e)h(c)m(haracters)g |
6e51e0d0 | 12507 | (b)m(y)f(default.)48 b Ft(echo)32 b Fu(do)s(es)g(not)i(in)m(terpret)630 |
e59452c7 CR |
12508 | 4735 y Ft(--)c Fu(to)h(mean)f(the)h(end)f(of)g(options.)630 |
12509 | 4868 y Ft(echo)f Fu(in)m(terprets)i(the)f(follo)m(wing)i(escap)s(e)f | |
12510 | (sequences:)630 5026 y Ft(\\a)384 b Fu(alert)31 b(\(b)s(ell\))630 | |
12511 | 5183 y Ft(\\b)384 b Fu(bac)m(kspace)630 5340 y Ft(\\c)g | |
12512 | Fu(suppress)28 b(further)h(output)p eop end | |
12513 | %%Page: 59 65 | |
12514 | TeXDict begin 59 64 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12515 | b(Shell)30 b(Builtin)h(Commands)2069 b(59)630 299 y Ft(\\e)630 | |
12516 | 408 y(\\E)384 b Fu(escap)s(e)630 556 y Ft(\\f)g Fu(form)30 | |
12517 | b(feed)630 703 y Ft(\\n)384 b Fu(new)30 b(line)630 851 | |
12518 | y Ft(\\r)384 b Fu(carriage)32 b(return)630 998 y Ft(\\t)384 | |
12519 | b Fu(horizon)m(tal)32 b(tab)630 1145 y Ft(\\v)384 b Fu(v)m(ertical)32 | |
12520 | b(tab)630 1293 y Ft(\\\\)384 b Fu(bac)m(kslash)630 1440 | |
6e51e0d0 | 12521 | y Ft(\\0)p Fj(nnn)240 b Fu(the)32 b(eigh)m(t-bit)i(c)m(haracter)g |
9f178efb | 12522 | (whose)e(v)-5 b(alue)33 b(is)f(the)g(o)s(ctal)i(v)-5 |
e59452c7 CR |
12523 | b(alue)32 b Fr(nnn)f Fu(\(zero)i(to)1110 1550 y(three)e(o)s(ctal)g |
12524 | (digits\))630 1697 y Ft(\\x)p Fj(HH)288 b Fu(the)38 b(eigh)m(t-bit)i(c) | |
12525 | m(haracter)g(whose)e(v)-5 b(alue)39 b(is)f(the)h(hexadecimal)g(v)-5 | |
12526 | b(alue)39 b Fr(HH)1110 1807 y Fu(\(one)31 b(or)f(t)m(w)m(o)i(hex)e | |
12527 | (digits\))630 1954 y Ft(\\u)p Fj(HHHH)192 b Fu(the)41 | |
12528 | b(Unico)s(de)g(\(ISO/IEC)f(10646\))j(c)m(haracter)g(whose)e(v)-5 | |
12529 | b(alue)41 b(is)g(the)g(hex-)1110 2064 y(adecimal)32 b(v)-5 | |
12530 | b(alue)31 b Fr(HHHH)41 b Fu(\(one)31 b(to)g(four)e(hex)h(digits\))630 | |
12531 | 2211 y Ft(\\U)p Fj(HHHHHHHH)1110 2321 y Fu(the)41 b(Unico)s(de)g | |
12532 | (\(ISO/IEC)f(10646\))j(c)m(haracter)g(whose)e(v)-5 b(alue)41 | |
12533 | b(is)g(the)g(hex-)1110 2430 y(adecimal)32 b(v)-5 b(alue)31 | |
12534 | b Fr(HHHHHHHH)41 b Fu(\(one)31 b(to)g(eigh)m(t)h(hex)e(digits\))150 | |
12535 | 2578 y Ft(enable)870 2706 y(enable)46 b([-a])h([-dnps])f([-f)g | |
12536 | Fj(filename)p Ft(])g([)p Fj(name)g Ft(...)o(])630 2835 | |
12537 | y Fu(Enable)36 b(and)f(disable)h(builtin)g(shell)g(commands.)56 | |
abfcfa4e | 12538 | b(Disabling)37 b(a)g(builtin)e(allo)m(ws)i(a)f(disk)630 |
e59452c7 CR |
12539 | 2944 y(command)e(whic)m(h)g(has)g(the)g(same)h(name)f(as)h(a)f(shell)h |
12540 | (builtin)e(to)i(b)s(e)f(executed)h(without)630 3054 y(sp)s(ecifying)27 | |
abfcfa4e | 12541 | b(a)g(full)g(pathname,)g(ev)m(en)h(though)f(the)g(shell)g(normally)g |
e59452c7 | 12542 | (searc)m(hes)h(for)f(builtins)630 3163 y(b)s(efore)35 |
abfcfa4e CR |
12543 | b(disk)g(commands.)55 b(If)35 b Ft(-n)g Fu(is)g(used,)h(the)g |
12544 | Fr(name)5 b Fu(s)35 b(b)s(ecome)h(disabled.)55 b(Otherwise)630 | |
e59452c7 | 12545 | 3273 y Fr(name)5 b Fu(s)44 b(are)h(enabled.)82 b(F)-8 |
abfcfa4e | 12546 | b(or)45 b(example,)k(to)c(use)f(the)g Ft(test)f Fu(binary)h(found)f |
e59452c7 | 12547 | (via)h Ft($PATH)630 3382 y Fu(instead)31 b(of)f(the)h(shell)f(builtin)g |
abfcfa4e | 12548 | (v)m(ersion,)h(t)m(yp)s(e)g(`)p Ft(enable)e(-n)h(test)p |
e59452c7 | 12549 | Fu('.)630 3511 y(If)45 b(the)i Ft(-p)e Fu(option)h(is)g(supplied,)j(or) |
abfcfa4e | 12550 | d(no)g Fr(name)51 b Fu(argumen)m(ts)46 b(app)s(ear,)k(a)c(list)h(of)f |
e59452c7 | 12551 | (shell)630 3621 y(builtins)37 b(is)h(prin)m(ted.)63 b(With)38 |
6e51e0d0 | 12552 | b(no)f(other)h(argumen)m(ts,)j(the)d(list)g(consists)g(of)g(all)h |
e59452c7 | 12553 | (enabled)630 3730 y(shell)d(builtins.)57 b(The)35 b Ft(-a)h |
6e51e0d0 | 12554 | Fu(option)g(means)g(to)g(list)h(eac)m(h)g(builtin)f(with)f(an)h |
e59452c7 CR |
12555 | (indication)h(of)630 3840 y(whether)30 b(or)g(not)h(it)g(is)f(enabled.) |
12556 | 630 3968 y(The)22 b Ft(-f)f Fu(option)h(means)g(to)h(load)g(the)f(new)g | |
6e51e0d0 | 12557 | (builtin)f(command)h Fr(name)27 b Fu(from)22 b(shared)f(ob)5 |
e59452c7 CR |
12558 | b(ject)630 4078 y Fr(\014lename)p Fu(,)31 b(on)f(systems)g(that)h(supp) |
12559 | s(ort)e(dynamic)h(loading.)41 b(Bash)31 b(will)f(use)g(the)h(v)-5 | |
12560 | b(alue)31 b(of)630 4187 y(the)39 b Ft(BASH_LOADABLES_PATH)34 | |
12561 | b Fu(v)-5 b(ariable)40 b(as)f(a)h(colon-separated)h(list)f(of)f | |
12562 | (directories)h(in)630 4297 y(whic)m(h)31 b(to)h(searc)m(h)g(for)f | |
12563 | Fr(\014lename)p Fu(.)44 b(The)31 b(default)g(is)h(system-dep)s(enden)m | |
12564 | (t.)43 b(The)31 b Ft(-d)f Fu(option)630 4407 y(will)h(delete)g(a)g | |
12565 | (builtin)f(loaded)h(with)f Ft(-f)p Fu(.)630 4535 y(If)j(there)i(are)f | |
12566 | (no)g(options,)h(a)f(list)h(of)f(the)g(shell)g(builtins)g(is)g(displa)m | |
12567 | (y)m(ed.)52 b(The)33 b Ft(-s)g Fu(option)630 4645 y(restricts)j | |
12568 | Ft(enable)d Fu(to)j(the)f Fm(posix)f Fu(sp)s(ecial)i(builtins.)54 | |
6e51e0d0 | 12569 | b(If)34 b Ft(-s)h Fu(is)g(used)f(with)g Ft(-f)p Fu(,)i(the)f(new)630 |
e59452c7 CR |
12570 | 4754 y(builtin)30 b(b)s(ecomes)h(a)f(sp)s(ecial)h(builtin)f(\(see)i |
12571 | (Section)f(4.4)g([Sp)s(ecial)g(Builtins],)g(page)g(76\).)630 | |
12572 | 4883 y(If)24 b(no)g(options)h(are)g(supplied)e(and)h(a)h | |
12573 | Fr(name)k Fu(is)c(not)f(a)h(shell)g(builtin,)g Ft(enable)e | |
12574 | Fu(will)i(attempt)630 4992 y(to)c(load)g Fr(name)26 b | |
12575 | Fu(from)20 b(a)g(shared)g(ob)5 b(ject)21 b(named)f Fr(name)p | |
12576 | Fu(,)j(as)d(if)h(the)f(command)h(w)m(ere)f(`)p Ft(enable)630 | |
12577 | 5102 y(-f)30 b Fj(name)f(name)p Fu('.)630 5230 y(The)d(return)f(status) | |
12578 | h(is)g(zero)h(unless)e(a)i Fr(name)k Fu(is)26 b(not)g(a)h(shell)f | |
12579 | (builtin)g(or)g(there)g(is)g(an)g(error)630 5340 y(loading)31 | |
12580 | b(a)g(new)f(builtin)g(from)g(a)g(shared)g(ob)5 b(ject.)p | |
12581 | eop end | |
12582 | %%Page: 60 66 | |
12583 | TeXDict begin 60 65 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12584 | b(Shell)30 b(Builtin)h(Commands)2069 b(60)150 299 y Ft(help)870 | |
12585 | 435 y(help)47 b([-dms])f([)p Fj(pattern)p Ft(])630 571 | |
12586 | y Fu(Displa)m(y)40 b(helpful)e(information)h(ab)s(out)g(builtin)f | |
12587 | (commands.)66 b(If)38 b Fr(pattern)h Fu(is)g(sp)s(eci\014ed,)630 | |
12588 | 681 y Ft(help)28 b Fu(giv)m(es)i(detailed)g(help)e(on)h(all)h(commands) | |
12589 | e(matc)m(hing)i Fr(pattern)p Fu(,)g(otherwise)f(a)g(list)h(of)630 | |
12590 | 790 y(the)h(builtins)e(is)i(prin)m(ted.)630 926 y(Options,)f(if)h | |
12591 | (supplied,)e(ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 | |
12592 | 1089 y Ft(-d)384 b Fu(Displa)m(y)32 b(a)e(short)g(description)h(of)f | |
12593 | (eac)m(h)i Fr(pattern)630 1251 y Ft(-m)384 b Fu(Displa)m(y)32 | |
12594 | b(the)e(description)g(of)h(eac)m(h)h Fr(pattern)e Fu(in)g(a)h | |
12595 | (manpage-lik)m(e)h(format)630 1414 y Ft(-s)384 b Fu(Displa)m(y)32 | |
12596 | b(only)e(a)h(short)f(usage)h(synopsis)e(for)i(eac)m(h)g | |
12597 | Fr(pattern)630 1576 y Fu(The)f(return)f(status)i(is)f(zero)h(unless)f | |
12598 | (no)g(command)h(matc)m(hes)g Fr(pattern)p Fu(.)150 1739 | |
12599 | y Ft(let)870 1875 y(let)47 b Fj(expression)e Ft([)p Fj(expression)g | |
12600 | Ft(...)o(])630 2011 y Fu(The)c Ft(let)g Fu(builtin)g(allo)m(ws)i | |
12601 | (arithmetic)f(to)h(b)s(e)d(p)s(erformed)g(on)i(shell)g(v)-5 | |
12602 | b(ariables.)74 b(Eac)m(h)630 2120 y Fr(expression)31 | |
12603 | b Fu(is)g(ev)-5 b(aluated)32 b(according)f(to)h(the)f(rules)g(giv)m(en) | |
12604 | h(b)s(elo)m(w)f(in)f(Section)i(6.5)g([Shell)630 2230 | |
12605 | y(Arithmetic],)51 b(page)46 b(97.)87 b(If)45 b(the)g(last)h | |
12606 | Fr(expression)g Fu(ev)-5 b(aluates)47 b(to)f(0,)k Ft(let)44 | |
12607 | b Fu(returns)g(1;)630 2340 y(otherwise)31 b(0)g(is)f(returned.)150 | |
12608 | 2502 y Ft(local)870 2638 y(local)46 b([)p Fj(option)p | |
12609 | Ft(])g Fj(name)p Ft([=)p Fj(value)p Ft(])e(...)630 2774 | |
12610 | y Fu(F)-8 b(or)27 b(eac)m(h)g(argumen)m(t,)g(a)f(lo)s(cal)h(v)-5 | |
12611 | b(ariable)27 b(named)e Fr(name)31 b Fu(is)26 b(created,)i(and)d | |
12612 | (assigned)h Fr(v)-5 b(alue)p Fu(.)630 2884 y(The)37 b | |
12613 | Fr(option)h Fu(can)f(b)s(e)g(an)m(y)h(of)f(the)h(options)g(accepted)g | |
12614 | (b)m(y)g Ft(declare)p Fu(.)59 b Ft(local)36 b Fu(can)i(only)630 | |
12615 | 2993 y(b)s(e)j(used)h(within)f(a)i(function;)48 b(it)42 | |
12616 | b(mak)m(es)h(the)f(v)-5 b(ariable)43 b Fr(name)48 b Fu(ha)m(v)m(e)43 | |
12617 | b(a)f(visible)h(scop)s(e)630 3103 y(restricted)h(to)f(that)h(function)e | |
12618 | (and)g(its)i(c)m(hildren.)78 b(If)42 b Fr(name)48 b Fu(is)43 | |
12619 | b(`)p Ft(-)p Fu(',)j(the)d(set)h(of)f(shell)630 3212 | |
12620 | y(options)34 b(is)f(made)g(lo)s(cal)i(to)f(the)f(function)g(in)g(whic)m | |
12621 | (h)g Ft(local)f Fu(is)h(in)m(v)m(ok)m(ed:)48 b(shell)34 | |
12622 | b(options)630 3322 y(c)m(hanged)e(using)e(the)i Ft(set)e | |
12623 | Fu(builtin)h(inside)g(the)g(function)g(are)g(restored)h(to)g(their)f | |
12624 | (original)630 3432 y(v)-5 b(alues)36 b(when)e(the)i(function)f | |
7a257517 | 12625 | (returns.)54 b(The)35 b(restore)h(is)g(e\013ected)h(as)e(if)h(a)g |
e59452c7 | 12626 | (series)f(of)h Ft(set)630 3541 y Fu(commands)j(w)m(ere)g(executed)h(to) |
7a257517 | 12627 | f(restore)h(the)f(v)-5 b(alues)39 b(that)h(w)m(ere)f(in)f(place)i(b)s |
e59452c7 | 12628 | (efore)f(the)630 3651 y(function.)j(The)30 b(return)g(status)h(is)g |
7a257517 | 12629 | (zero)h(unless)e Ft(local)g Fu(is)h(used)f(outside)h(a)g(function,)g |
e59452c7 | 12630 | (an)630 3760 y(in)m(v)-5 b(alid)31 b Fr(name)k Fu(is)c(supplied,)e(or)i |
7a257517 | 12631 | Fr(name)k Fu(is)c(a)f(readonly)h(v)-5 b(ariable.)150 |
e59452c7 CR |
12632 | 3923 y Ft(logout)870 4059 y(logout)46 b([)p Fj(n)p Ft(])630 |
12633 | 4195 y Fu(Exit)31 b(a)g(login)g(shell,)g(returning)e(a)i(status)g(of)f | |
12634 | Fr(n)g Fu(to)h(the)g(shell's)f(paren)m(t.)150 4357 y | |
12635 | Ft(mapfile)870 4493 y(mapfile)46 b([-d)h Fj(delim)p Ft(])f([-n)h | |
a6ae8f35 | 12636 | Fj(count)p Ft(])f([-O)h Fj(origin)p Ft(])f([-s)g Fj(count)p |
e59452c7 | 12637 | Ft(])1061 4603 y([-t])h([-u)f Fj(fd)p Ft(])h([-C)g Fj(callback)p |
a6ae8f35 | 12638 | Ft(])f([-c)g Fj(quantum)p Ft(])g([)p Fj(array)p Ft(])630 |
e59452c7 | 12639 | 4739 y Fu(Read)38 b(lines)f(from)g(the)h(standard)e(input)g(in)m(to)j |
a6ae8f35 | 12640 | (the)e(indexed)g(arra)m(y)h(v)-5 b(ariable)38 b Fr(arra)m(y)p |
e59452c7 | 12641 | Fu(,)i(or)630 4849 y(from)28 b(\014le)h(descriptor)f |
8a0829e9 CR |
12642 | Fr(fd)k Fu(if)c(the)h Ft(-u)f Fu(option)h(is)g(supplied.)39 |
12643 | b(The)28 b(v)-5 b(ariable)29 b Ft(MAPFILE)e Fu(is)i(the)630 | |
e59452c7 | 12644 | 4958 y(default)i Fr(arra)m(y)p Fu(.)41 b(Options,)30 |
8a0829e9 | 12645 | b(if)g(supplied,)g(ha)m(v)m(e)h(the)g(follo)m(wing)h(meanings:)630 |
e59452c7 | 12646 | 5121 y Ft(-d)384 b Fu(The)37 b(\014rst)g(c)m(haracter)i(of)f |
8a0829e9 | 12647 | Fr(delim)g Fu(is)f(used)g(to)h(terminate)h(eac)m(h)g(input)d(line,)1110 |
e59452c7 | 12648 | 5230 y(rather)41 b(than)h(newline.)74 b(If)41 b Fr(delim)h |
68d220cb | 12649 | Fu(is)g(the)f(empt)m(y)h(string,)j Ft(mapfile)40 b Fu(will)1110 |
e59452c7 CR |
12650 | 5340 y(terminate)31 b(a)g(line)g(when)e(it)i(reads)f(a)h(NUL)g(c)m |
12651 | (haracter.)p eop end | |
12652 | %%Page: 61 67 | |
12653 | TeXDict begin 61 66 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12654 | b(Shell)30 b(Builtin)h(Commands)2069 b(61)630 299 y Ft(-n)384 | |
12655 | b Fu(Cop)m(y)30 b(at)h(most)g Fr(coun)m(t)i Fu(lines.)41 | |
12656 | b(If)30 b Fr(coun)m(t)j Fu(is)d(0,)h(all)h(lines)e(are)h(copied.)630 | |
12657 | 446 y Ft(-O)384 b Fu(Begin)31 b(assigning)g(to)g Fr(arra)m(y)39 | |
12658 | b Fu(at)31 b(index)f Fr(origin)p Fu(.)41 b(The)30 b(default)h(index)f | |
12659 | (is)g(0.)630 594 y Ft(-s)384 b Fu(Discard)31 b(the)f(\014rst)g | |
12660 | Fr(coun)m(t)j Fu(lines)e(read.)630 741 y Ft(-t)384 b | |
12661 | Fu(Remo)m(v)m(e)32 b(a)f(trailing)g Fr(delim)g Fu(\(default)g | |
12662 | (newline\))f(from)g(eac)m(h)i(line)f(read.)630 888 y | |
12663 | Ft(-u)384 b Fu(Read)31 b(lines)f(from)g(\014le)h(descriptor)f | |
12664 | Fr(fd)j Fu(instead)e(of)f(the)h(standard)e(input.)630 | |
12665 | 1036 y Ft(-C)384 b Fu(Ev)-5 b(aluate)26 b Fr(callbac)m(k)33 | |
12666 | b Fu(eac)m(h)26 b(time)g Fr(quan)m(tum)f Fu(lines)g(are)g(read.)39 | |
12667 | b(The)25 b Ft(-c)f Fu(option)1110 1145 y(sp)s(eci\014es)30 | |
12668 | b Fr(quan)m(tum)p Fu(.)630 1293 y Ft(-c)384 b Fu(Sp)s(ecify)30 | |
12669 | b(the)g(n)m(um)m(b)s(er)f(of)i(lines)f(read)h(b)s(et)m(w)m(een)g(eac)m | |
12670 | (h)g(call)h(to)f Fr(callbac)m(k)p Fu(.)630 1440 y(If)36 | |
12671 | b Ft(-C)g Fu(is)g(sp)s(eci\014ed)g(without)g Ft(-c)p | |
12672 | Fu(,)h(the)g(default)f(quan)m(tum)g(is)h(5000.)60 b(When)36 | |
12673 | b Fr(callbac)m(k)44 b Fu(is)630 1550 y(ev)-5 b(aluated,)30 | |
12674 | b(it)e(is)g(supplied)f(the)h(index)f(of)i(the)f(next)g(arra)m(y)g | |
12675 | (elemen)m(t)h(to)g(b)s(e)e(assigned)i(and)630 1659 y(the)39 | |
12676 | b(line)g(to)h(b)s(e)e(assigned)h(to)h(that)f(elemen)m(t)i(as)e | |
12677 | (additional)h(argumen)m(ts.)66 b Fr(callbac)m(k)47 b | |
12678 | Fu(is)630 1769 y(ev)-5 b(aluated)32 b(after)e(the)h(line)g(is)f(read)g | |
12679 | (but)g(b)s(efore)g(the)h(arra)m(y)g(elemen)m(t)g(is)g(assigned.)630 | |
12680 | 1897 y(If)25 b(not)g(supplied)f(with)h(an)g(explicit)i(origin,)g | |
6e51e0d0 | 12681 | Ft(mapfile)c Fu(will)j(clear)g Fr(arra)m(y)34 b Fu(b)s(efore)24 |
e59452c7 | 12682 | b(assigning)630 2007 y(to)31 b(it.)630 2135 y Ft(mapfile)41 |
6e51e0d0 | 12683 | b Fu(returns)g(successfully)i(unless)e(an)i(in)m(v)-5 |
1101193a | 12684 | b(alid)43 b(option)g(or)g(option)g(argumen)m(t)g(is)630 |
e59452c7 | 12685 | 2245 y(supplied,)29 b Fr(arra)m(y)39 b Fu(is)30 b(in)m(v)-5 |
6e51e0d0 | 12686 | b(alid)31 b(or)g(unassignable,)f(or)h Fr(arra)m(y)38 |
7a257517 | 12687 | b Fu(is)31 b(not)f(an)h(indexed)e(arra)m(y)-8 b(.)150 |
e59452c7 CR |
12688 | 2392 y Ft(printf)870 2521 y(printf)46 b([-v)h Fj(var)p |
12689 | Ft(])g Fj(format)f Ft([)p Fj(arguments)p Ft(])630 2649 | |
7a257517 CR |
12690 | y Fu(W)-8 b(rite)27 b(the)g(formatted)f Fr(argumen)m(ts)k |
12691 | Fu(to)d(the)f(standard)f(output)h(under)e(the)i(con)m(trol)i(of)e(the) | |
e59452c7 | 12692 | 630 2759 y Fr(format)p Fu(.)66 b(The)39 b Ft(-v)f Fu(option)h(causes)g |
7a257517 | 12693 | (the)g(output)g(to)g(b)s(e)f(assigned)h(to)h(the)f(v)-5 |
e59452c7 CR |
12694 | b(ariable)39 b Fr(v)-5 b(ar)630 2869 y Fu(rather)30 b(than)g(b)s(eing)g |
12695 | (prin)m(ted)g(to)h(the)g(standard)e(output.)630 2997 | |
7a257517 CR |
12696 | y(The)36 b Fr(format)i Fu(is)f(a)f(c)m(haracter)i(string)e(whic)m(h)g |
12697 | (con)m(tains)i(three)e(t)m(yp)s(es)g(of)h(ob)5 b(jects:)53 | |
e59452c7 | 12698 | b(plain)630 3107 y(c)m(haracters,)41 b(whic)m(h)c(are)h(simply)e |
7a257517 | 12699 | (copied)i(to)g(standard)f(output,)i(c)m(haracter)g(escap)s(e)e(se-)630 |
e59452c7 CR |
12700 | 3216 y(quences,)g(whic)m(h)f(are)g(con)m(v)m(erted)h(and)f(copied)g(to) |
12701 | g(the)g(standard)f(output,)i(and)f(format)630 3326 y(sp)s | |
7a257517 CR |
12702 | (eci\014cations,)j(eac)m(h)e(of)g(whic)m(h)f(causes)g(prin)m(ting)g(of) |
12703 | h(the)f(next)h(successiv)m(e)g Fr(argumen)m(t)p Fu(.)630 | |
e59452c7 | 12704 | 3435 y(In)24 b(addition)h(to)g(the)g(standard)f Ft(printf\(1\))e |
7a257517 | 12705 | Fu(formats,)27 b Ft(printf)c Fu(in)m(terprets)i(the)f(follo)m(wing)630 |
e59452c7 | 12706 | 3545 y(extensions:)630 3692 y Ft(\045b)384 b Fu(Causes)38 |
7a257517 | 12707 | b Ft(printf)f Fu(to)j(expand)e(bac)m(kslash)h(escap)s(e)g(sequences)g |
e59452c7 | 12708 | (in)f(the)h(cor-)1110 3802 y(resp)s(onding)31 b Fr(argumen)m(t)j |
7a257517 | 12709 | Fu(in)e(the)h(same)f(w)m(a)m(y)h(as)g Ft(echo)c(-e)j |
e59452c7 CR |
12710 | Fu(\(see)h(Section)g(4.2)1110 3912 y([Bash)e(Builtins],)g(page)g(54\).) |
12711 | 630 4059 y Ft(\045q)384 b Fu(Causes)32 b Ft(printf)e | |
7a257517 | 12712 | Fu(to)i(output)g(the)g(corresp)s(onding)f Fr(argumen)m(t)j |
e59452c7 CR |
12713 | Fu(in)d(a)i(format)1110 4169 y(that)e(can)g(b)s(e)e(reused)h(as)h |
12714 | (shell)f(input.)630 4316 y Ft(\045Q)384 b Fu(lik)m(e)34 | |
12715 | b Ft(\045q)p Fu(,)f(but)f(applies)g(an)m(y)h(supplied)e(precision)i(to) | |
12716 | h(the)e Fr(argumen)m(t)j Fu(b)s(efore)1110 4425 y(quoting)c(it.)630 | |
12717 | 4573 y Ft(\045\()p Fj(datefmt)p Ft(\)T)1110 4682 y Fu(Causes)e | |
12718 | Ft(printf)e Fu(to)j(output)f(the)g(date-time)i(string)e(resulting)h | |
12719 | (from)e(using)1110 4792 y Fr(datefm)m(t)45 b Fu(as)d(a)g(format)g | |
12720 | (string)g(for)g Ft(strftime)p Fu(\(3\).)74 b(The)41 b(corresp)s(onding) | |
12721 | 1110 4902 y Fr(argumen)m(t)h Fu(is)e(an)g(in)m(teger)i(represen)m(ting) | |
12722 | e(the)g(n)m(um)m(b)s(er)f(of)h(seconds)g(since)1110 5011 | |
12723 | y(the)24 b(ep)s(o)s(c)m(h.)38 b(Tw)m(o)24 b(sp)s(ecial)h(argumen)m(t)f | |
12724 | (v)-5 b(alues)24 b(ma)m(y)h(b)s(e)e(used:)36 b(-1)25 | |
12725 | b(represen)m(ts)1110 5121 y(the)30 b(curren)m(t)g(time,)h(and)e(-2)i | |
12726 | (represen)m(ts)f(the)g(time)h(the)f(shell)g(w)m(as)g(in)m(v)m(ok)m(ed.) | |
12727 | 1110 5230 y(If)38 b(no)g(argumen)m(t)h(is)f(sp)s(eci\014ed,)i(con)m(v)m | |
ad4aef08 | 12728 | (ersion)f(b)s(eha)m(v)m(es)g(as)g(if)f(-1)h(had)f(b)s(een)1110 |
e59452c7 CR |
12729 | 5340 y(giv)m(en.)k(This)29 b(is)i(an)f(exception)i(to)f(the)f(usual)g |
12730 | Ft(printf)f Fu(b)s(eha)m(vior.)p eop end | |
12731 | %%Page: 62 68 | |
12732 | TeXDict begin 62 67 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12733 | b(Shell)30 b(Builtin)h(Commands)2069 b(62)630 299 y(The)26 | |
12734 | b(\045b,)h(\045q,)h(and)e(\045T)g(directiv)m(es)j(all)e(use)g(the)g | |
12735 | (\014eld)f(width)g(and)h(precision)g(argumen)m(ts)630 | |
12736 | 408 y(from)f(the)g(format)h(sp)s(eci\014cation)g(and)e(write)i(that)f | |
12737 | (man)m(y)h(b)m(ytes)f(from)g(\(or)h(use)e(that)i(wide)630 | |
12738 | 518 y(a)42 b(\014eld)g(for\))g(the)h(expanded)e(argumen)m(t,)k(whic)m | |
12739 | (h)d(usually)g(con)m(tains)h(more)f(c)m(haracters)630 | |
12740 | 628 y(than)30 b(the)h(original.)630 760 y(Argumen)m(ts)d(to)h | |
12741 | (non-string)e(format)i(sp)s(eci\014ers)e(are)h(treated)h(as)g(C)e | |
12742 | (language)j(constan)m(ts,)630 870 y(except)22 b(that)g(a)g(leading)g | |
12743 | (plus)e(or)h(min)m(us)f(sign)i(is)f(allo)m(w)m(ed,)k(and)c(if)g(the)g | |
12744 | (leading)h(c)m(haracter)h(is)630 979 y(a)i(single)g(or)f(double)h | |
12745 | (quote,)h(the)f(v)-5 b(alue)25 b(is)f(the)h(ASCI)s(I)e(v)-5 | |
12746 | b(alue)25 b(of)f(the)h(follo)m(wing)h(c)m(haracter.)630 | |
12747 | 1112 y(The)31 b Fr(format)i Fu(is)f(reused)e(as)i(necessary)f(to)i | |
12748 | (consume)e(all)h(of)f(the)h Fr(argumen)m(ts)p Fu(.)44 | |
12749 | b(If)30 b(the)i Fr(for-)630 1222 y(mat)c Fu(requires)e(more)g | |
12750 | Fr(argumen)m(ts)k Fu(than)25 b(are)i(supplied,)e(the)h(extra)h(format)f | |
12751 | (sp)s(eci\014cations)630 1331 y(b)s(eha)m(v)m(e)j(as)g(if)f(a)h(zero)g | |
12752 | (v)-5 b(alue)29 b(or)g(n)m(ull)f(string,)h(as)g(appropriate,)g(had)f(b) | |
12753 | s(een)g(supplied.)38 b(The)630 1441 y(return)29 b(v)-5 | |
12754 | b(alue)31 b(is)g(zero)g(on)f(success,)h(non-zero)g(on)f(failure.)150 | |
12755 | 1597 y Ft(read)870 1729 y(read)47 b([-ers])f([-a)h Fj(aname)p | |
6e51e0d0 | 12756 | Ft(])f([-d)h Fj(delim)p Ft(])f([-i)h Fj(text)p Ft(])f([-n)h |
e59452c7 | 12757 | Fj(nchars)p Ft(])1061 1839 y([-N)g Fj(nchars)p Ft(])f([-p)h |
6e51e0d0 | 12758 | Fj(prompt)p Ft(])e([-t)i Fj(timeout)p Ft(])f([-u)h Fj(fd)p |
e59452c7 | 12759 | Ft(])g([)p Fj(name)f Ft(...)o(])630 1972 y Fu(One)38 |
71574d7e | 12760 | b(line)g(is)g(read)g(from)g(the)g(standard)f(input,)j(or)e(from)f(the)i |
e59452c7 | 12761 | (\014le)f(descriptor)g Fr(fd)j Fu(sup-)630 2081 y(plied)34 |
71574d7e CR |
12762 | b(as)h(an)f(argumen)m(t)h(to)g(the)f Ft(-u)g Fu(option,)i(split)f(in)m |
12763 | (to)g(w)m(ords)f(as)g(describ)s(ed)g(ab)s(o)m(v)m(e)h(in)630 | |
3011048a | 12764 | 2191 y(Section)j(3.5.7)h([W)-8 b(ord)38 b(Splitting],)i(page)e(35,)j |
e59452c7 CR |
12765 | (and)36 b(the)i(\014rst)f(w)m(ord)g(is)g(assigned)h(to)g(the)630 |
12766 | 2300 y(\014rst)32 b Fr(name)p Fu(,)h(the)g(second)g(w)m(ord)f(to)h(the) | |
12767 | g(second)g Fr(name)p Fu(,)g(and)f(so)h(on.)47 b(If)32 | |
12768 | b(there)h(are)g(more)630 2410 y(w)m(ords)39 b(than)g(names,)j(the)e | |
12769 | (remaining)f(w)m(ords)g(and)g(their)h(in)m(terv)m(ening)g(delimiters)h | |
12770 | (are)630 2519 y(assigned)29 b(to)h(the)g(last)g Fr(name)p | |
12771 | Fu(.)40 b(If)29 b(there)g(are)h(few)m(er)f(w)m(ords)g(read)g(from)g | |
12772 | (the)g(input)g(stream)630 2629 y(than)35 b(names,)i(the)e(remaining)h | |
12773 | (names)f(are)h(assigned)f(empt)m(y)h(v)-5 b(alues.)56 | |
12774 | b(The)34 b(c)m(haracters)630 2739 y(in)e(the)h(v)-5 b(alue)33 | |
12775 | b(of)g(the)g Ft(IFS)f Fu(v)-5 b(ariable)33 b(are)h(used)d(to)j(split)f | |
12776 | (the)g(line)g(in)m(to)g(w)m(ords)g(using)f(the)630 2848 | |
12777 | y(same)d(rules)f(the)g(shell)h(uses)f(for)g(expansion)g(\(describ)s(ed) | |
12778 | g(ab)s(o)m(v)m(e)i(in)e(Section)h(3.5.7)h([W)-8 b(ord)630 | |
3011048a | 12779 | 2958 y(Splitting],)38 b(page)f(35\).)60 b(The)35 b(bac)m(kslash)i(c)m |
e59452c7 CR |
12780 | (haracter)h(`)p Ft(\\)p Fu(')e(ma)m(y)h(b)s(e)f(used)f(to)i(remo)m(v)m |
12781 | (e)h(an)m(y)630 3067 y(sp)s(ecial)31 b(meaning)g(for)f(the)g(next)h(c)m | |
12782 | (haracter)h(read)e(and)g(for)g(line)h(con)m(tin)m(uation.)630 | |
12783 | 3200 y(Options,)f(if)h(supplied,)e(ha)m(v)m(e)i(the)g(follo)m(wing)h | |
12784 | (meanings:)630 3356 y Ft(-a)e Fj(aname)114 b Fu(The)34 | |
7a257517 | 12785 | b(w)m(ords)f(are)i(assigned)f(to)h(sequen)m(tial)h(indices)e(of)g(the)g |
e59452c7 | 12786 | (arra)m(y)h(v)-5 b(ariable)1110 3465 y Fr(aname)p Fu(,)29 |
7a257517 | 12787 | b(starting)h(at)f(0.)40 b(All)29 b(elemen)m(ts)h(are)e(remo)m(v)m(ed)i |
e59452c7 | 12788 | (from)d Fr(aname)34 b Fu(b)s(efore)1110 3575 y(the)d(assignmen)m(t.)41 |
abfcfa4e | 12789 | b(Other)30 b Fr(name)36 b Fu(argumen)m(ts)30 b(are)h(ignored.)630 |
e59452c7 | 12790 | 3731 y Ft(-d)f Fj(delim)114 b Fu(The)41 b(\014rst)h(c)m(haracter)h(of)f |
8a0829e9 | 12791 | Fr(delim)g Fu(is)g(used)g(to)g(terminate)h(the)f(input)f(line,)1110 |
e59452c7 | 12792 | 3840 y(rather)31 b(than)g(newline.)42 b(If)30 b Fr(delim)h |
68d220cb | 12793 | Fu(is)g(the)h(empt)m(y)f(string,)g Ft(read)f Fu(will)h(termi-)1110 |
e59452c7 CR |
12794 | 3950 y(nate)g(a)g(line)f(when)g(it)h(reads)f(a)h(NUL)f(c)m(haracter.) |
12795 | 630 4106 y Ft(-e)384 b Fu(Readline)46 b(\(see)g(Chapter)e(8)h([Command) | |
fffe80d4 | 12796 | f(Line)h(Editing],)50 b(page)45 b(116\))i(is)1110 4215 |
68d220cb CR |
12797 | y(used)37 b(to)i(obtain)g(the)f(line.)65 b(Readline)39 |
12798 | b(uses)e(the)i(curren)m(t)f(\(or)g(default,)j(if)1110 | |
e59452c7 CR |
12799 | 4325 y(line)h(editing)g(w)m(as)g(not)g(previously)f(activ)m(e\))k |
12800 | (editing)d(settings,)j(but)c(uses)1110 4434 y(Readline's)31 | |
12801 | b(default)g(\014lename)f(completion.)630 4590 y Ft(-i)g | |
68d220cb CR |
12802 | Fj(text)162 b Fu(If)36 b(Readline)i(is)f(b)s(eing)g(used)f(to)h(read)g |
12803 | (the)g(line,)j Fr(text)f Fu(is)e(placed)h(in)m(to)g(the)1110 | |
e59452c7 CR |
12804 | 4700 y(editing)31 b(bu\013er)e(b)s(efore)h(editing)h(b)s(egins.)630 |
12805 | 4855 y Ft(-n)f Fj(nchars)66 b Ft(read)38 b Fu(returns)f(after)j | |
68d220cb | 12806 | (reading)f Fr(nc)m(hars)j Fu(c)m(haracters)e(rather)f(than)g(w)m |
e59452c7 CR |
12807 | (aiting)1110 4965 y(for)d(a)h(complete)h(line)f(of)g(input,)g(but)f |
12808 | (honors)g(a)h(delimiter)g(if)f(few)m(er)h(than)1110 5075 | |
68d220cb | 12809 | y Fr(nc)m(hars)d Fu(c)m(haracters)e(are)e(read)h(b)s(efore)f(the)g |
e59452c7 | 12810 | (delimiter.)630 5230 y Ft(-N)g Fj(nchars)66 b Ft(read)39 |
68d220cb | 12811 | b Fu(returns)f(after)j(reading)e(exactly)j Fr(nc)m(hars)h |
e59452c7 | 12812 | Fu(c)m(haracters)f(rather)d(than)1110 5340 y(w)m(aiting)32 |
68d220cb | 12813 | b(for)f(a)g(complete)i(line)e(of)g(input,)g(unless)f(EOF)h(is)g(encoun) |
e59452c7 CR |
12814 | m(tered)g(or)p eop end |
12815 | %%Page: 63 69 | |
12816 | TeXDict begin 63 68 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12817 | b(Shell)30 b(Builtin)h(Commands)2069 b(63)1110 299 y | |
12818 | Ft(read)30 b Fu(times)i(out.)43 b(Delimiter)33 b(c)m(haracters)f | |
12819 | (encoun)m(tered)g(in)f(the)g(input)g(are)1110 408 y(not)g(treated)h(sp) | |
12820 | s(ecially)f(and)f(do)h(not)g(cause)g Ft(read)e Fu(to)j(return)d(un)m | |
12821 | (til)i Fr(nc)m(hars)1110 518 y Fu(c)m(haracters)26 b(are)f(read.)38 | |
12822 | b(The)24 b(result)g(is)h(not)f(split)h(on)f(the)h(c)m(haracters)h(in)e | |
12823 | Ft(IFS)p Fu(;)1110 628 y(the)e(in)m(ten)m(t)i(is)e(that)h(the)f(v)-5 | |
0385211b | 12824 | b(ariable)23 b(is)f(assigned)g(exactly)i(the)e(c)m(haracters)i(read) |
e59452c7 CR |
12825 | 1110 737 y(\(with)30 b(the)h(exception)h(of)e(bac)m(kslash;)h(see)g |
12826 | (the)g Ft(-r)f Fu(option)h(b)s(elo)m(w\).)630 894 y Ft(-p)f | |
12827 | Fj(prompt)66 b Fu(Displa)m(y)38 b Fr(prompt)p Fu(,)g(without)e(a)h | |
12828 | (trailing)h(newline,)h(b)s(efore)d(attempting)i(to)1110 | |
12829 | 1004 y(read)f(an)m(y)h(input.)60 b(The)37 b(prompt)g(is)g(displa)m(y)m | |
12830 | (ed)h(only)f(if)g(input)g(is)g(coming)1110 1114 y(from)30 | |
12831 | b(a)h(terminal.)630 1271 y Ft(-r)384 b Fu(If)21 b(this)h(option)g(is)f | |
6e51e0d0 | 12832 | (giv)m(en,)k(bac)m(kslash)d(do)s(es)f(not)h(act)h(as)f(an)f(escap)s(e)h |
e59452c7 | 12833 | (c)m(haracter.)1110 1380 y(The)30 b(bac)m(kslash)i(is)f(considered)g |
6e51e0d0 | 12834 | (to)h(b)s(e)e(part)h(of)g(the)g(line.)43 b(In)30 b(particular,)i(a)1110 |
e59452c7 CR |
12835 | 1490 y(bac)m(kslash-newline)26 b(pair)e(ma)m(y)h(not)g(then)g(b)s(e)f |
12836 | (used)g(as)h(a)g(line)g(con)m(tin)m(uation.)630 1647 | |
0712a90c CR |
12837 | y Ft(-s)384 b Fu(Silen)m(t)28 b(mo)s(de.)40 b(If)27 b(input)f(is)i |
12838 | (coming)g(from)f(a)h(terminal,)h(c)m(haracters)g(are)f(not)1110 | |
e59452c7 | 12839 | 1757 y(ec)m(ho)s(ed.)630 1914 y Ft(-t)i Fj(timeout)1110 |
fffe80d4 CR |
12840 | 2024 y Fu(Cause)23 b Ft(read)f Fu(to)i(time)f(out)h(and)e(return)g |
12841 | (failure)h(if)g(a)h(complete)g(line)g(of)f(input)1110 | |
12842 | 2133 y(\(or)h(a)f(sp)s(eci\014ed)g(n)m(um)m(b)s(er)f(of)i(c)m | |
12843 | (haracters\))h(is)e(not)h(read)f(within)g Fr(timeout)j | |
12844 | Fu(sec-)1110 2243 y(onds.)43 b Fr(timeout)34 b Fu(ma)m(y)e(b)s(e)e(a)i | |
12845 | (decimal)g(n)m(um)m(b)s(er)e(with)h(a)h(fractional)g(p)s(ortion)1110 | |
12846 | 2352 y(follo)m(wing)39 b(the)f(decimal)g(p)s(oin)m(t.)63 | |
12847 | b(This)37 b(option)h(is)g(only)f(e\013ectiv)m(e)k(if)c | |
12848 | Ft(read)1110 2462 y Fu(is)c(reading)h(input)e(from)h(a)h(terminal,)h | |
12849 | (pip)s(e,)e(or)h(other)f(sp)s(ecial)h(\014le;)h(it)f(has)1110 | |
12850 | 2572 y(no)f(e\013ect)i(when)d(reading)i(from)f(regular)g(\014les.)50 | |
12851 | b(If)33 b Ft(read)f Fu(times)i(out,)g Ft(read)1110 2681 | |
12852 | y Fu(sa)m(v)m(es)41 b(an)m(y)f(partial)h(input)e(read)g(in)m(to)i(the)f | |
12853 | (sp)s(eci\014ed)f(v)-5 b(ariable)40 b Fr(name)p Fu(.)69 | |
12854 | b(If)1110 2791 y Fr(timeout)31 b Fu(is)c(0,)i Ft(read)d | |
12855 | Fu(returns)h(immediately)-8 b(,)30 b(without)d(trying)h(to)g(read)g(an) | |
12856 | m(y)1110 2900 y(data.)49 b(The)33 b(exit)h(status)f(is)g(0)g(if)g | |
12857 | (input)f(is)h(a)m(v)-5 b(ailable)36 b(on)c(the)i(sp)s(eci\014ed)e | |
12858 | (\014le)1110 3010 y(descriptor,)37 b(or)e(the)h(read)f(will)h(return)e | |
12859 | (EOF,)h(non-zero)h(otherwise.)56 b(The)1110 3120 y(exit)31 | |
12860 | b(status)g(is)f(greater)i(than)e(128)i(if)e(the)h(timeout)g(is)f | |
12861 | (exceeded.)630 3277 y Ft(-u)g Fj(fd)258 b Fu(Read)31 | |
12862 | b(input)e(from)h(\014le)g(descriptor)h Fr(fd)p Fu(.)630 | |
12863 | 3434 y(If)h(no)g Fr(name)5 b Fu(s)33 b(are)f(supplied,)g(the)h(line)g | |
12864 | (read,)g(without)f(the)h(ending)f(delimiter)h(but)e(oth-)630 | |
12865 | 3544 y(erwise)36 b(unmo)s(di\014ed,)e(is)i(assigned)f(to)h(the)g(v)-5 | |
12866 | b(ariable)36 b Ft(REPLY)p Fu(.)55 b(The)34 b(exit)j(status)e(is)h | |
12867 | (zero,)630 3653 y(unless)i(end-of-\014le)h(is)f(encoun)m(tered,)j | |
12868 | Ft(read)d Fu(times)h(out)f(\(in)h(whic)m(h)f(case)h(the)g(status)g(is) | |
12869 | 630 3763 y(greater)31 b(than)f(128\),)i(a)e(v)-5 b(ariable)30 | |
e6983002 | 12870 | b(assignmen)m(t)h(error)f(\(suc)m(h)f(as)i(assigning)f(to)h(a)f |
e59452c7 | 12871 | (readonly)630 3872 y(v)-5 b(ariable\))30 b(o)s(ccurs,)f(or)f(an)h(in)m |
e6983002 | 12872 | (v)-5 b(alid)29 b(\014le)g(descriptor)f(is)h(supplied)e(as)i(the)g |
e59452c7 CR |
12873 | (argumen)m(t)g(to)g Ft(-u)p Fu(.)150 4030 y Ft(readarray)870 |
12874 | 4139 y(readarray)45 b([-d)i Fj(delim)p Ft(])f([-n)h Fj(count)p | |
e6983002 | 12875 | Ft(])f([-O)h Fj(origin)p Ft(])f([-s)h Fj(count)p Ft(])1061 |
e59452c7 | 12876 | 4249 y([-t])g([-u)f Fj(fd)p Ft(])h([-C)g Fj(callback)p |
e6983002 | 12877 | Ft(])f([-c)g Fj(quantum)p Ft(])g([)p Fj(array)p Ft(])630 |
e59452c7 | 12878 | 4382 y Fu(Read)38 b(lines)f(from)g(the)h(standard)e(input)g(in)m(to)j |
e6983002 | 12879 | (the)e(indexed)g(arra)m(y)h(v)-5 b(ariable)38 b Fr(arra)m(y)p |
e59452c7 | 12880 | Fu(,)i(or)630 4492 y(from)30 b(\014le)g(descriptor)h |
e6983002 | 12881 | Fr(fd)i Fu(if)d(the)h Ft(-u)e Fu(option)i(is)g(supplied.)630 |
e59452c7 CR |
12882 | 4625 y(A)f(synon)m(ym)g(for)g Ft(mapfile)p Fu(.)150 4783 |
12883 | y Ft(source)870 4916 y(source)46 b Fj(filename)630 5049 | |
e6983002 | 12884 | y Fu(A)30 b(synon)m(ym)g(for)g Ft(.)g Fu(\(see)i(Section)f(4.1)g |
e59452c7 CR |
12885 | ([Bourne)g(Shell)f(Builtins],)h(page)g(47\).)150 5207 |
12886 | y Ft(type)870 5340 y(type)47 b([-afptP])e([)p Fj(name)i | |
12887 | Ft(...)o(])p eop end | |
12888 | %%Page: 64 70 | |
12889 | TeXDict begin 64 69 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12890 | b(Shell)30 b(Builtin)h(Commands)2069 b(64)630 299 y(F)-8 | |
12891 | b(or)42 b(eac)m(h)g Fr(name)p Fu(,)i(indicate)e(ho)m(w)g(it)f(w)m(ould) | |
12892 | g(b)s(e)g(in)m(terpreted)g(if)g(used)f(as)i(a)f(command)630 | |
12893 | 408 y(name.)630 543 y(If)g(the)g Ft(-t)g Fu(option)h(is)f(used,)j | |
12894 | Ft(type)c Fu(prin)m(ts)h(a)h(single)g(w)m(ord)f(whic)m(h)g(is)g(one)h | |
12895 | (of)g(`)p Ft(alias)p Fu(',)630 653 y(`)p Ft(function)p | |
12896 | Fu(',)32 b(`)p Ft(builtin)p Fu(',)g(`)p Ft(file)p Fu(')g(or)h(`)p | |
12897 | Ft(keyword)p Fu(',)f(if)h Fr(name)38 b Fu(is)33 b(an)f(alias,)j(shell)e | |
12898 | (function,)630 762 y(shell)i(builtin,)g(disk)g(\014le,)h(or)e(shell)h | |
12899 | (reserv)m(ed)g(w)m(ord,)h(resp)s(ectiv)m(ely)-8 b(.)55 | |
12900 | b(If)34 b(the)h Fr(name)40 b Fu(is)35 b(not)630 872 y(found,)29 | |
12901 | b(then)h(nothing)h(is)f(prin)m(ted,)g(and)g Ft(type)f | |
12902 | Fu(returns)g(a)i(failure)g(status.)630 1007 y(If)25 b(the)g | |
12903 | Ft(-p)g Fu(option)h(is)f(used,)h Ft(type)e Fu(either)h(returns)g(the)g | |
12904 | (name)g(of)h(the)f(disk)g(\014le)g(that)h(w)m(ould)630 | |
12905 | 1116 y(b)s(e)k(executed,)h(or)g(nothing)f(if)g Ft(-t)g | |
12906 | Fu(w)m(ould)g(not)h(return)e(`)p Ft(file)p Fu('.)630 | |
12907 | 1251 y(The)h Ft(-P)g Fu(option)h(forces)g(a)g(path)f(searc)m(h)h(for)g | |
6e51e0d0 | 12908 | (eac)m(h)g Fr(name)p Fu(,)g(ev)m(en)g(if)g Ft(-t)f Fu(w)m(ould)g(not)h |
e59452c7 | 12909 | (return)630 1360 y(`)p Ft(file)p Fu('.)630 1495 y(If)f(a)g(command)g |
15baad62 | 12910 | (is)g(hashed,)f Ft(-p)h Fu(and)f Ft(-P)g Fu(prin)m(t)h(the)g(hashed)f |
e59452c7 | 12911 | (v)-5 b(alue,)31 b(whic)m(h)f(is)g(not)g(neces-)630 1605 |
15baad62 | 12912 | y(sarily)h(the)f(\014le)h(that)g(app)s(ears)e(\014rst)h(in)g |
e59452c7 | 12913 | Ft($PATH)p Fu(.)630 1739 y(If)22 b(the)i Ft(-a)e Fu(option)h(is)g |
15baad62 | 12914 | (used,)h Ft(type)e Fu(returns)f(all)j(of)f(the)g(places)h(that)f(con)m |
e59452c7 | 12915 | (tain)i(an)d(executable)630 1849 y(named)32 b Fr(\014le)p |
15baad62 | 12916 | Fu(.)49 b(This)32 b(includes)h(aliases)h(and)e(functions,)i(if)f(and)f |
e59452c7 CR |
12917 | (only)h(if)g(the)g Ft(-p)f Fu(option)i(is)630 1958 y(not)d(also)g |
12918 | (used.)630 2093 y(If)f(the)g Ft(-f)g Fu(option)g(is)h(used,)e | |
15baad62 | 12919 | Ft(type)g Fu(do)s(es)h(not)h(attempt)g(to)g(\014nd)d(shell)j |
e59452c7 CR |
12920 | (functions,)f(as)g(with)630 2203 y(the)h Ft(command)d |
12921 | Fu(builtin.)630 2337 y(The)j(return)e(status)j(is)f(zero)h(if)f(all)g | |
12922 | (of)h(the)f Fr(name)5 b Fu(s)31 b(are)g(found,)f(non-zero)i(if)f(an)m | |
12923 | (y)g(are)h(not)630 2447 y(found.)150 2607 y Ft(typeset)870 | |
12924 | 2741 y(typeset)46 b([-afFgrxilnrtux])d([-p])k([)p Fj(name)p | |
12925 | Ft([=)p Fj(value)p Ft(])d(...)o(])630 2876 y Fu(The)31 | |
12926 | b Ft(typeset)e Fu(command)i(is)g(supplied)f(for)h(compatibilit)m(y)i | |
12927 | (with)e(the)g(Korn)f(shell.)44 b(It)31 b(is)630 2985 | |
12928 | y(a)g(synon)m(ym)f(for)g(the)g Ft(declare)f Fu(builtin)h(command.)150 | |
12929 | 3145 y Ft(ulimit)870 3280 y(ulimit)46 b([-HS])g(-a)870 | |
12930 | 3389 y(ulimit)g([-HS])g([-bcdefiklmnpqrstuvxPRT])c([)p | |
12931 | Fj(limit)p Ft(])630 3524 y(ulimit)25 b Fu(pro)m(vides)h(con)m(trol)i(o) | |
50fc6e33 | 12932 | m(v)m(er)g(the)f(resources)f(a)m(v)-5 b(ailable)29 b(to)e(pro)s(cesses) |
e59452c7 | 12933 | f(started)h(b)m(y)g(the)630 3634 y(shell,)i(on)f(systems)g(that)h(allo) |
50fc6e33 | 12934 | m(w)h(suc)m(h)e(con)m(trol.)41 b(If)28 b(an)g(option)h(is)f(giv)m(en,)i |
e59452c7 CR |
12935 | (it)e(is)h(in)m(terpreted)630 3743 y(as)i(follo)m(ws:)630 |
12936 | 3903 y Ft(-S)384 b Fu(Change)30 b(and)g(rep)s(ort)g(the)g(soft)h(limit) | |
12937 | g(asso)s(ciated)h(with)e(a)h(resource.)630 4062 y Ft(-H)384 | |
50fc6e33 | 12938 | b Fu(Change)30 b(and)g(rep)s(ort)g(the)g(hard)g(limit)h(asso)s(ciated)h |
e59452c7 | 12939 | (with)e(a)h(resource.)630 4222 y Ft(-a)384 b Fu(All)31 |
50fc6e33 | 12940 | b(curren)m(t)f(limits)h(are)g(rep)s(orted;)f(no)g(limits)h(are)g(set.) |
e59452c7 CR |
12941 | 630 4382 y Ft(-b)384 b Fu(The)30 b(maxim)m(um)g(so)s(c)m(k)m(et)i |
12942 | (bu\013er)e(size.)630 4542 y Ft(-c)384 b Fu(The)30 b(maxim)m(um)g(size) | |
12943 | h(of)g(core)g(\014les)f(created.)630 4701 y Ft(-d)384 | |
50fc6e33 | 12944 | b Fu(The)30 b(maxim)m(um)g(size)h(of)g(a)g(pro)s(cess's)f(data)h |
e59452c7 | 12945 | (segmen)m(t.)630 4861 y Ft(-e)384 b Fu(The)30 b(maxim)m(um)g(sc)m |
50fc6e33 | 12946 | (heduling)h(priorit)m(y)f(\()p Ft(")p Fu(nice)p Ft(")p |
e59452c7 | 12947 | Fu(\).)630 5021 y Ft(-f)384 b Fu(The)30 b(maxim)m(um)g(size)h(of)g |
50fc6e33 | 12948 | (\014les)f(written)h(b)m(y)f(the)g(shell)h(and)f(its)h(c)m(hildren.)630 |
e59452c7 CR |
12949 | 5180 y Ft(-i)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(p)s |
12950 | (ending)e(signals.)630 5340 y Ft(-k)384 b Fu(The)30 b(maxim)m(um)g(n)m | |
12951 | (um)m(b)s(er)f(of)i(kqueues)f(that)h(ma)m(y)g(b)s(e)e(allo)s(cated.)p | |
12952 | eop end | |
12953 | %%Page: 65 71 | |
12954 | TeXDict begin 65 70 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
12955 | b(Shell)30 b(Builtin)h(Commands)2069 b(65)630 299 y Ft(-l)384 | |
12956 | b Fu(The)30 b(maxim)m(um)g(size)h(that)g(ma)m(y)g(b)s(e)f(lo)s(c)m(k)m | |
12957 | (ed)i(in)m(to)f(memory)-8 b(.)630 467 y Ft(-m)384 b Fu(The)36 | |
12958 | b(maxim)m(um)g(residen)m(t)h(set)g(size)g(\(man)m(y)g(systems)f(do)h | |
12959 | (not)f(honor)g(this)1110 576 y(limit\).)630 744 y Ft(-n)384 | |
12960 | b Fu(The)38 b(maxim)m(um)h(n)m(um)m(b)s(er)e(of)i(op)s(en)f(\014le)h | |
12961 | (descriptors)g(\(most)g(systems)g(do)1110 854 y(not)31 | |
12962 | b(allo)m(w)g(this)g(v)-5 b(alue)31 b(to)g(b)s(e)e(set\).)630 | |
12963 | 1022 y Ft(-p)384 b Fu(The)30 b(pip)s(e)f(bu\013er)h(size.)630 | |
12964 | 1190 y Ft(-q)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(b)m | |
12965 | (ytes)g(in)f Fm(posix)f Fu(message)j(queues.)630 1358 | |
d37a4722 | 12966 | y Ft(-r)384 b Fu(The)30 b(maxim)m(um)g(real-time)i(sc)m(heduling)f |
e59452c7 CR |
12967 | (priorit)m(y)-8 b(.)630 1526 y Ft(-s)384 b Fu(The)30 |
12968 | b(maxim)m(um)g(stac)m(k)i(size.)630 1694 y Ft(-t)384 | |
d37a4722 | 12969 | b Fu(The)30 b(maxim)m(um)g(amoun)m(t)h(of)f(cpu)g(time)h(in)f(seconds.) |
e59452c7 | 12970 | 630 1862 y Ft(-u)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i |
d37a4722 | 12971 | (pro)s(cesses)f(a)m(v)-5 b(ailable)33 b(to)e(a)f(single)i(user.)630 |
e59452c7 | 12972 | 2030 y Ft(-v)384 b Fu(The)41 b(maxim)m(um)h(amoun)m(t)g(of)h(virtual)f |
d37a4722 | 12973 | (memory)g(a)m(v)-5 b(ailable)44 b(to)e(the)g(shell,)1110 |
e59452c7 CR |
12974 | 2140 y(and,)30 b(on)g(some)h(systems,)g(to)g(its)g(c)m(hildren.)630 |
12975 | 2308 y Ft(-x)384 b Fu(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i | |
12976 | (\014le)f(lo)s(c)m(ks.)630 2476 y Ft(-P)384 b Fu(The)30 | |
12977 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(pseudoterminals.)630 | |
12978 | 2643 y Ft(-R)384 b Fu(The)27 b(maxim)m(um)h(time)h(a)f(real-time)i(pro) | |
12979 | s(cess)d(can)i(run)d(b)s(efore)i(blo)s(c)m(king,)h(in)1110 | |
12980 | 2753 y(microseconds.)630 2921 y Ft(-T)384 b Fu(The)30 | |
12981 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(threads.)630 3089 | |
12982 | y(If)36 b Fr(limit)k Fu(is)c(giv)m(en,)k(and)c(the)h | |
12983 | Ft(-a)f Fu(option)h(is)f(not)h(used,)h Fr(limit)h Fu(is)e(the)g(new)f | |
12984 | (v)-5 b(alue)37 b(of)g(the)630 3199 y(sp)s(eci\014ed)c(resource.)51 | |
12985 | b(The)34 b(sp)s(ecial)g Fr(limit)j Fu(v)-5 b(alues)34 | |
12986 | b Ft(hard)p Fu(,)g Ft(soft)p Fu(,)g(and)f Ft(unlimited)e | |
12987 | Fu(stand)630 3308 y(for)h(the)g(curren)m(t)g(hard)f(limit,)i(the)g | |
12988 | (curren)m(t)f(soft)g(limit,)h(and)f(no)g(limit,)h(resp)s(ectiv)m(ely)-8 | |
12989 | b(.)48 b(A)630 3418 y(hard)24 b(limit)i(cannot)g(b)s(e)e(increased)h(b) | |
12990 | m(y)g(a)h(non-ro)s(ot)f(user)f(once)i(it)g(is)f(set;)j(a)d(soft)g | |
12991 | (limit)h(ma)m(y)630 3527 y(b)s(e)37 b(increased)h(up)e(to)j(the)f(v)-5 | |
12992 | b(alue)38 b(of)f(the)h(hard)f(limit.)63 b(Otherwise,)39 | |
12993 | b(the)f(curren)m(t)f(v)-5 b(alue)630 3637 y(of)39 b(the)g(soft)h(limit) | |
12994 | g(for)f(the)g(sp)s(eci\014ed)f(resource)h(is)g(prin)m(ted,)i(unless)e | |
12995 | (the)g Ft(-H)f Fu(option)i(is)630 3747 y(supplied.)47 | |
12996 | b(When)33 b(more)g(than)g(one)g(resource)g(is)g(sp)s(eci\014ed,)g(the)g | |
12997 | (limit)h(name)f(and)f(unit,)630 3856 y(if)27 b(appropriate,)h(are)f | |
12998 | (prin)m(ted)g(b)s(efore)g(the)g(v)-5 b(alue.)40 b(When)27 | |
12999 | b(setting)h(new)e(limits,)j(if)e(neither)630 3966 y Ft(-H)38 | |
13000 | b Fu(nor)g Ft(-S)g Fu(is)h(supplied,)h(b)s(oth)e(the)h(hard)f(and)g | |
13001 | (soft)h(limits)g(are)g(set.)67 b(If)38 b(no)h(option)g(is)630 | |
13002 | 4075 y(giv)m(en,)c(then)f Ft(-f)e Fu(is)i(assumed.)49 | |
13003 | b(V)-8 b(alues)35 b(are)e(in)h(1024-b)m(yte)i(incremen)m(ts,)f(except)f | |
13004 | (for)f Ft(-t)p Fu(,)630 4185 y(whic)m(h)e(is)g(in)g(seconds;)h | |
13005 | Ft(-R)p Fu(,)g(whic)m(h)f(is)g(in)g(microseconds;)h Ft(-p)p | |
13006 | Fu(,)g(whic)m(h)f(is)g(in)g(units)g(of)g(512-)630 4295 | |
13007 | y(b)m(yte)k(blo)s(c)m(ks;)j Ft(-P)p Fu(,)e Ft(-T)p Fu(,)f | |
13008 | Ft(-b)p Fu(,)h Ft(-k)p Fu(,)f Ft(-n)g Fu(and)f Ft(-u)p | |
13009 | Fu(,)h(whic)m(h)g(are)g(unscaled)g(v)-5 b(alues;)37 b(and,)f(when)630 | |
13010 | 4404 y(in)g Fm(posix)f Fu(Mo)s(de)h(\(see)g(Section)h(6.11)g([Bash)g | |
13011 | (POSIX)d(Mo)s(de],)k(page)f(105\),)i Ft(-c)c Fu(and)g | |
13012 | Ft(-f)p Fu(,)630 4514 y(whic)m(h)30 b(are)h(in)f(512-b)m(yte)j | |
13013 | (incremen)m(ts.)630 4653 y(The)h(return)g(status)h(is)f(zero)i(unless)e | |
13014 | (an)g(in)m(v)-5 b(alid)36 b(option)f(or)f(argumen)m(t)i(is)e(supplied,) | |
13015 | h(or)630 4762 y(an)30 b(error)g(o)s(ccurs)g(while)h(setting)g(a)g(new)f | |
13016 | (limit.)150 4930 y Ft(unalias)870 5069 y(unalias)46 b([-a])g([)p | |
13017 | Fj(name)h Ft(...)g(])630 5208 y Fu(Remo)m(v)m(e)42 b(eac)m(h)f | |
d37a4722 | 13018 | Fr(name)k Fu(from)39 b(the)i(list)f(of)g(aliases.)71 |
abfcfa4e | 13019 | b(If)40 b Ft(-a)f Fu(is)h(supplied,)h(all)g(aliases)h(are)630 |
e59452c7 CR |
13020 | 5317 y(remo)m(v)m(ed.)g(Aliases)31 b(are)g(describ)s(ed)e(in)h(Section) |
13021 | i(6.6)f([Aliases],)h(page)f(99.)p eop end | |
13022 | %%Page: 66 72 | |
13023 | TeXDict begin 66 71 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
13024 | b(Shell)30 b(Builtin)h(Commands)2069 b(66)150 299 y Fs(4.3)68 | |
13025 | b(Mo)t(difying)45 b(Shell)g(Beha)l(vior)150 520 y Fk(4.3.1)63 | |
13026 | b(The)41 b(Set)g(Builtin)150 667 y Fu(This)35 b(builtin)h(is)g(so)g | |
abfcfa4e CR |
13027 | (complicated)i(that)f(it)f(deserv)m(es)h(its)f(o)m(wn)g(section.)59 |
13028 | b Ft(set)35 b Fu(allo)m(ws)j(y)m(ou)e(to)h(c)m(hange)150 | |
e59452c7 | 13029 | 777 y(the)c(v)-5 b(alues)34 b(of)f(shell)g(options)h(and)e(set)i(the)f |
abfcfa4e | 13030 | (p)s(ositional)h(parameters,)h(or)e(to)h(displa)m(y)f(the)g(names)h |
e59452c7 | 13031 | (and)150 886 y(v)-5 b(alues)31 b(of)f(shell)h(v)-5 b(ariables.)150 |
25e43d2c CR |
13032 | 1041 y Ft(set)870 1172 y(set)47 b([-abefhkmnptuvxBCEHPT])42 |
13033 | b([-o)47 b Fj(option-name)p Ft(])d([--])j([-])g([)p Fj(argument)e | |
e59452c7 | 13034 | Ft(...)o(])870 1282 y(set)i([+abefhkmnptuvxBCEHPT])42 |
25e43d2c | 13035 | b([+o)47 b Fj(option-name)p Ft(])d([--])j([-])g([)p Fj(argument)e |
e59452c7 | 13036 | Ft(...)o(])630 1414 y Fu(If)22 b(no)h(options)g(or)g(argumen)m(ts)g |
abfcfa4e | 13037 | (are)g(supplied,)g Ft(set)f Fu(displa)m(ys)g(the)h(names)g(and)f(v)-5 |
e59452c7 | 13038 | b(alues)23 b(of)g(all)630 1523 y(shell)j(v)-5 b(ariables)27 |
abfcfa4e | 13039 | b(and)e(functions,)h(sorted)g(according)h(to)g(the)f(curren)m(t)f(lo)s |
e59452c7 | 13040 | (cale,)k(in)c(a)i(format)630 1633 y(that)i(ma)m(y)h(b)s(e)e(reused)g |
abfcfa4e | 13041 | (as)h(input)f(for)h(setting)h(or)e(resetting)i(the)f(curren)m(tly-set)h |
e59452c7 | 13042 | (v)-5 b(ariables.)630 1743 y(Read-only)37 b(v)-5 b(ariables)37 |
fc527055 | 13043 | b(cannot)h(b)s(e)e(reset.)59 b(In)36 b Fm(posix)g Fu(mo)s(de,)i(only)f |
e59452c7 CR |
13044 | (shell)f(v)-5 b(ariables)38 b(are)630 1852 y(listed.)630 |
13045 | 1984 y(When)29 b(options)g(are)g(supplied,)f(they)h(set)h(or)f(unset)f | |
fc527055 | 13046 | (shell)h(attributes.)41 b(Options,)29 b(if)g(sp)s(ec-)630 |
e59452c7 CR |
13047 | 2094 y(i\014ed,)h(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
13048 | 2248 y Ft(-a)384 b Fu(Eac)m(h)37 b(v)-5 b(ariable)36 | |
13049 | b(or)g(function)g(that)g(is)g(created)h(or)f(mo)s(di\014ed)f(is)h(giv)m | |
13050 | (en)h(the)1110 2357 y(exp)s(ort)28 b(attribute)h(and)f(mark)m(ed)g(for) | |
13051 | g(exp)s(ort)g(to)h(the)g(en)m(vironmen)m(t)f(of)h(sub-)1110 | |
13052 | 2467 y(sequen)m(t)i(commands.)630 2621 y Ft(-b)384 b | |
13053 | Fu(Cause)44 b(the)h(status)g(of)f(terminated)h(bac)m(kground)g(jobs)f | |
13054 | (to)h(b)s(e)f(rep)s(orted)1110 2730 y(immediately)-8 | |
13055 | b(,)30 b(rather)d(than)f(b)s(efore)h(prin)m(ting)g(the)g(next)g | |
13056 | (primary)g(prompt.)630 2885 y Ft(-e)384 b Fu(Exit)65 | |
13057 | b(immediately)g(if)f(a)h(pip)s(eline)e(\(see)i(Section)g(3.2.3)h([Pip)s | |
13058 | (elines],)1110 2994 y(page)51 b(10\),)58 b(whic)m(h)50 | |
13059 | b(ma)m(y)h(consist)h(of)e(a)i(single)f(simple)g(command)f(\(see)1110 | |
13060 | 3104 y(Section)30 b(3.2.2)i([Simple)d(Commands],)g(page)h(9\),)h(a)f | |
13061 | (list)g(\(see)h(Section)f(3.2.4)1110 3213 y([Lists],)60 | |
13062 | b(page)55 b(10\),)60 b(or)54 b(a)g(comp)s(ound)e(command)h(\(see)i | |
13063 | (Section)f(3.2.5)1110 3323 y([Comp)s(ound)60 b(Commands],)70 | |
13064 | b(page)63 b(11\))g(returns)e(a)i(non-zero)f(status.)1110 | |
13065 | 3432 y(The)41 b(shell)g(do)s(es)g(not)g(exit)h(if)f(the)h(command)f | |
13066 | (that)h(fails)f(is)g(part)g(of)h(the)1110 3542 y(command)g(list)h | |
50fc6e33 | 13067 | (immediately)g(follo)m(wing)g(a)g Ft(while)e Fu(or)h |
e59452c7 | 13068 | Ft(until)e Fu(k)m(eyw)m(ord,)1110 3652 y(part)61 b(of)g(the)g(test)h |
50fc6e33 | 13069 | (in)e(an)h Ft(if)f Fu(statemen)m(t,)71 b(part)61 b(of)g(an)m(y)g |
e59452c7 | 13070 | (command)1110 3761 y(executed)50 b(in)e(a)h Ft(&&)f Fu(or)h |
50fc6e33 | 13071 | Ft(||)f Fu(list)h(except)g(the)g(command)g(follo)m(wing)h(the)1110 |
e59452c7 | 13072 | 3871 y(\014nal)37 b Ft(&&)g Fu(or)g Ft(||)p Fu(,)h(an)m(y)g(command)f |
7a257517 | 13073 | (in)g(a)g(pip)s(eline)g(but)g(the)g(last,)j(or)e(if)f(the)1110 |
e59452c7 | 13074 | 3980 y(command's)c(return)f(status)h(is)g(b)s(eing)g(in)m(v)m(erted)h |
7a257517 | 13075 | (with)e Ft(!)p Fu(.)48 b(If)33 b(a)g(comp)s(ound)1110 |
e59452c7 CR |
13076 | 4090 y(command)g(other)g(than)f(a)i(subshell)d(returns)h(a)h(non-zero)h |
13077 | (status)f(b)s(ecause)1110 4200 y(a)k(command)g(failed)g(while)g | |
7a257517 | 13078 | Ft(-e)f Fu(w)m(as)i(b)s(eing)e(ignored,)j(the)e(shell)g(do)s(es)g(not) |
e59452c7 | 13079 | 1110 4309 y(exit.)42 b(A)30 b(trap)g(on)h Ft(ERR)p Fu(,)e(if)i(set,)g |
7a257517 | 13080 | (is)f(executed)i(b)s(efore)e(the)g(shell)h(exits.)1110 |
e59452c7 CR |
13081 | 4441 y(This)f(option)h(applies)f(to)h(the)g(shell)g(en)m(vironmen)m(t)g |
13082 | (and)f(eac)m(h)h(subshell)f(en-)1110 4551 y(vironmen)m(t)j(separately)i | |
7a257517 | 13083 | (\(see)f(Section)g(3.7.3)h([Command)d(Execution)i(En-)1110 |
e59452c7 CR |
13084 | 4660 y(vironmen)m(t],)i(page)f(42\),)i(and)d(ma)m(y)h(cause)f |
13085 | (subshells)g(to)h(exit)g(b)s(efore)f(exe-)1110 4770 y(cuting)d(all)g | |
13086 | (the)g(commands)f(in)g(the)g(subshell.)1110 4902 y(If)41 | |
7a257517 | 13087 | b(a)g(comp)s(ound)e(command)i(or)g(shell)g(function)g(executes)h(in)f |
e59452c7 | 13088 | (a)g(con)m(text)1110 5011 y(where)31 b Ft(-e)g Fu(is)g(b)s(eing)g |
7a257517 | 13089 | (ignored,)h(none)f(of)h(the)f(commands)g(executed)h(within)1110 |
e59452c7 CR |
13090 | 5121 y(the)j(comp)s(ound)f(command)h(or)g(function)f(b)s(o)s(dy)g(will) |
13091 | h(b)s(e)f(a\013ected)j(b)m(y)e(the)1110 5230 y Ft(-e)25 | |
7a257517 | 13092 | b Fu(setting,)j(ev)m(en)e(if)g Ft(-e)f Fu(is)h(set)g(and)f(a)h(command) |
e59452c7 | 13093 | g(returns)e(a)i(failure)g(status.)1110 5340 y(If)32 b(a)i(comp)s(ound)d |
7a257517 | 13094 | (command)i(or)g(shell)g(function)f(sets)i Ft(-e)e Fu(while)h(executing) |
e59452c7 CR |
13095 | p eop end |
13096 | %%Page: 67 73 | |
13097 | TeXDict begin 67 72 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
13098 | b(Shell)30 b(Builtin)h(Commands)2069 b(67)1110 299 y(in)40 | |
13099 | b(a)h(con)m(text)i(where)d Ft(-e)g Fu(is)h(ignored,)j(that)d(setting)h | |
13100 | (will)f(not)g(ha)m(v)m(e)h(an)m(y)1110 408 y(e\013ect)g(un)m(til)e(the) | |
13101 | h(comp)s(ound)e(command)h(or)g(the)g(command)g(con)m(taining)1110 | |
13102 | 518 y(the)31 b(function)f(call)h(completes.)630 682 y | |
13103 | Ft(-f)384 b Fu(Disable)31 b(\014lename)g(expansion)f(\(globbing\).)630 | |
13104 | 847 y Ft(-h)384 b Fu(Lo)s(cate)33 b(and)e(remem)m(b)s(er)h(\(hash\))g | |
13105 | (commands)f(as)h(they)g(are)g(lo)s(ok)m(ed)h(up)e(for)1110 | |
13106 | 956 y(execution.)42 b(This)29 b(option)i(is)g(enabled)f(b)m(y)g | |
13107 | (default.)630 1121 y Ft(-k)384 b Fu(All)34 b(argumen)m(ts)g(in)f(the)h | |
13108 | (form)f(of)g(assignmen)m(t)h(statemen)m(ts)i(are)d(placed)h(in)1110 | |
13109 | 1230 y(the)k(en)m(vironmen)m(t)g(for)g(a)g(command,)h(not)f(just)f | |
13110 | (those)i(that)f(precede)g(the)1110 1340 y(command)30 | |
13111 | b(name.)630 1504 y Ft(-m)384 b Fu(Job)28 b(con)m(trol)h(is)f(enabled)g | |
fffe80d4 | 13112 | (\(see)h(Chapter)f(7)g([Job)g(Con)m(trol],)i(page)f(112\).)41 |
e59452c7 | 13113 | b(All)1110 1614 y(pro)s(cesses)27 b(run)f(in)i(a)g(separate)g(pro)s |
fc527055 | 13114 | (cess)f(group.)40 b(When)27 b(a)h(bac)m(kground)f(job)1110 |
e59452c7 CR |
13115 | 1724 y(completes,)32 b(the)f(shell)f(prin)m(ts)g(a)h(line)f(con)m |
13116 | (taining)i(its)f(exit)g(status.)630 1888 y Ft(-n)384 | |
fc527055 | 13117 | b Fu(Read)38 b(commands)f(but)f(do)i(not)f(execute)i(them.)62 |
e59452c7 | 13118 | b(This)37 b(ma)m(y)h(b)s(e)f(used)f(to)1110 1998 y(c)m(hec)m(k)d(a)e |
fc527055 | 13119 | (script)g(for)g(syn)m(tax)h(errors.)42 b(This)30 b(option)i(is)f |
e59452c7 CR |
13120 | (ignored)g(b)m(y)g(in)m(terac-)1110 2107 y(tiv)m(e)h(shells.)630 |
13121 | 2271 y Ft(-o)e Fj(option-name)1110 2381 y Fu(Set)h(the)f(option)h | |
13122 | (corresp)s(onding)e(to)i Fr(option-name)5 b Fu(:)1110 | |
13123 | 2545 y Ft(allexport)1590 2655 y Fu(Same)30 b(as)h Ft(-a)p | |
13124 | Fu(.)1110 2819 y Ft(braceexpand)1590 2929 y Fu(Same)f(as)h | |
13125 | Ft(-B)p Fu(.)1110 3093 y Ft(emacs)240 b Fu(Use)25 b(an)f | |
13126 | Ft(emacs)p Fu(-st)m(yle)h(line)f(editing)h(in)m(terface)h(\(see)g | |
13127 | (Chapter)e(8)1590 3203 y([Command)33 b(Line)g(Editing],)h(page)h | |
fffe80d4 | 13128 | (116\).)51 b(This)32 b(also)i(a\013ects)1590 3313 y(the)d(editing)g(in) |
e59452c7 CR |
13129 | m(terface)h(used)d(for)h Ft(read)f(-e)p Fu(.)1110 3477 |
13130 | y Ft(errexit)144 b Fu(Same)30 b(as)h Ft(-e)p Fu(.)1110 | |
13131 | 3641 y Ft(errtrace)96 b Fu(Same)30 b(as)h Ft(-E)p Fu(.)1110 | |
13132 | 3806 y Ft(functrace)1590 3915 y Fu(Same)f(as)h Ft(-T)p | |
13133 | Fu(.)1110 4080 y Ft(hashall)144 b Fu(Same)30 b(as)h Ft(-h)p | |
13134 | Fu(.)1110 4244 y Ft(histexpand)1590 4354 y Fu(Same)f(as)h | |
13135 | Ft(-H)p Fu(.)1110 4518 y Ft(history)144 b Fu(Enable)39 | |
13136 | b(command)g(history)-8 b(,)42 b(as)d(describ)s(ed)f(in)h(Section)h(9.1) | |
fffe80d4 | 13137 | 1590 4628 y([Bash)d(History)g(F)-8 b(acilities],)41 b(page)c(151.)60 |
e59452c7 CR |
13138 | b(This)36 b(option)h(is)f(on)1590 4737 y(b)m(y)30 b(default)h(in)f(in)m |
13139 | (teractiv)m(e)j(shells.)1110 4902 y Ft(ignoreeof)1590 | |
13140 | 5011 y Fu(An)d(in)m(teractiv)m(e)j(shell)e(will)g(not)f(exit)h(up)s(on) | |
13141 | e(reading)i(EOF.)1110 5176 y Ft(keyword)144 b Fu(Same)30 | |
13142 | b(as)h Ft(-k)p Fu(.)1110 5340 y Ft(monitor)144 b Fu(Same)30 | |
13143 | b(as)h Ft(-m)p Fu(.)p eop end | |
13144 | %%Page: 68 74 | |
13145 | TeXDict begin 68 73 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
13146 | b(Shell)30 b(Builtin)h(Commands)2069 b(68)1110 299 y | |
13147 | Ft(noclobber)1590 408 y Fu(Same)30 b(as)h Ft(-C)p Fu(.)1110 | |
5e6f45d9 CR |
13148 | 570 y Ft(noexec)192 b Fu(Same)30 b(as)h Ft(-n)p Fu(.)1110 |
13149 | 731 y Ft(noglob)192 b Fu(Same)30 b(as)h Ft(-f)p Fu(.)1110 | |
13150 | 892 y Ft(nolog)240 b Fu(Curren)m(tly)30 b(ignored.)1110 | |
13151 | 1053 y Ft(notify)192 b Fu(Same)30 b(as)h Ft(-b)p Fu(.)1110 | |
13152 | 1214 y Ft(nounset)144 b Fu(Same)30 b(as)h Ft(-u)p Fu(.)1110 | |
13153 | 1375 y Ft(onecmd)192 b Fu(Same)30 b(as)h Ft(-t)p Fu(.)1110 | |
13154 | 1537 y Ft(physical)96 b Fu(Same)30 b(as)h Ft(-P)p Fu(.)1110 | |
13155 | 1698 y Ft(pipefail)96 b Fu(If)44 b(set,)k(the)d(return)e(v)-5 | |
d37a4722 | 13156 | b(alue)45 b(of)f(a)h(pip)s(eline)e(is)i(the)f(v)-5 b(alue)45 |
5e6f45d9 CR |
13157 | b(of)1590 1807 y(the)33 b(last)h(\(righ)m(tmost\))h(command)e(to)h |
13158 | (exit)g(with)f(a)g(non-zero)1590 1917 y(status,)28 b(or)f(zero)g(if)f | |
d37a4722 | 13159 | (all)i(commands)e(in)g(the)h(pip)s(eline)f(exit)i(suc-)1590 |
5e6f45d9 CR |
13160 | 2027 y(cessfully)-8 b(.)41 b(This)30 b(option)h(is)f(disabled)g(b)m(y)h |
13161 | (default.)1110 2188 y Ft(posix)240 b Fu(Change)30 b(the)g(b)s(eha)m | |
e59452c7 | 13162 | (vior)h(of)f(Bash)g(where)g(the)g(default)h(op)s(era-)1590 |
5e6f45d9 CR |
13163 | 2297 y(tion)25 b(di\013ers)f(from)g(the)h Fm(posix)f |
13164 | Fu(standard)f(to)i(matc)m(h)h(the)f(stan-)1590 2407 y(dard)h(\(see)j | |
e59452c7 | 13165 | (Section)f(6.11)h([Bash)f(POSIX)e(Mo)s(de],)j(page)f(105\).)1590 |
5e6f45d9 CR |
13166 | 2516 y(This)37 b(is)g(in)m(tended)g(to)h(mak)m(e)g(Bash)g(b)s(eha)m(v)m |
13167 | (e)g(as)g(a)f(strict)h(su-)1590 2626 y(p)s(erset)30 b(of)h(that)f | |
13168 | (standard.)1110 2787 y Ft(privileged)1590 2897 y Fu(Same)g(as)h | |
13169 | Ft(-p)p Fu(.)1110 3058 y Ft(verbose)144 b Fu(Same)30 | |
13170 | b(as)h Ft(-v)p Fu(.)1110 3219 y Ft(vi)384 b Fu(Use)36 | |
e59452c7 | 13171 | b(a)g Ft(vi)p Fu(-st)m(yle)g(line)g(editing)g(in)m(terface.)58 |
5e6f45d9 CR |
13172 | b(This)35 b(also)h(a\013ects)1590 3329 y(the)31 b(editing)g(in)m |
13173 | (terface)h(used)d(for)h Ft(read)f(-e)p Fu(.)1110 3490 | |
e59452c7 | 13174 | y Ft(xtrace)192 b Fu(Same)30 b(as)h Ft(-x)p Fu(.)630 |
5e6f45d9 | 13175 | 3651 y Ft(-p)384 b Fu(T)-8 b(urn)33 b(on)h(privileged)h(mo)s(de.)51 |
e59452c7 | 13176 | b(In)34 b(this)g(mo)s(de,)h(the)f Ft($BASH_ENV)e Fu(and)h |
5e6f45d9 | 13177 | Ft($ENV)1110 3761 y Fu(\014les)23 b(are)h(not)f(pro)s(cessed,)h(shell)g |
e59452c7 | 13178 | (functions)e(are)i(not)f(inherited)g(from)f(the)i(en-)1110 |
5e6f45d9 | 13179 | 3870 y(vironmen)m(t,)h(and)e(the)g Ft(SHELLOPTS)p Fu(,)f |
50fc6e33 | 13180 | Ft(BASHOPTS)p Fu(,)h Ft(CDPATH)e Fu(and)i Ft(GLOBIGNORE)1110 |
5e6f45d9 | 13181 | 3980 y Fu(v)-5 b(ariables,)23 b(if)e(they)g(app)s(ear)f(in)g(the)h(en)m |
50fc6e33 | 13182 | (vironmen)m(t,)i(are)e(ignored.)38 b(If)20 b(the)h(shell)1110 |
5e6f45d9 | 13183 | 4089 y(is)37 b(started)h(with)f(the)g(e\013ectiv)m(e)j(user)d |
50fc6e33 | 13184 | (\(group\))g(id)g(not)g(equal)h(to)g(the)f(real)1110 |
5e6f45d9 CR |
13185 | 4199 y(user)h(\(group\))h(id,)i(and)d(the)h Ft(-p)f Fu(option)i(is)e |
13186 | (not)i(supplied,)f(these)h(actions)1110 4309 y(are)32 | |
50fc6e33 | 13187 | b(tak)m(en)i(and)d(the)h(e\013ectiv)m(e)j(user)c(id)h(is)g(set)h(to)f |
5e6f45d9 | 13188 | (the)h(real)f(user)g(id.)45 b(If)32 b(the)1110 4418 y |
50fc6e33 | 13189 | Ft(-p)i Fu(option)h(is)g(supplied)f(at)h(startup,)h(the)f(e\013ectiv)m |
5e6f45d9 | 13190 | (e)i(user)d(id)g(is)h(not)g(reset.)1110 4528 y(T)-8 b(urning)35 |
50fc6e33 | 13191 | b(this)i(option)g(o\013)g(causes)g(the)g(e\013ectiv)m(e)i(user)d(and)g |
5e6f45d9 CR |
13192 | (group)g(ids)g(to)1110 4637 y(b)s(e)30 b(set)h(to)g(the)f(real)h(user)f |
13193 | (and)g(group)g(ids.)630 4798 y Ft(-r)384 b Fu(Enable)32 | |
fffe80d4 | 13194 | b(restricted)h(shell)f(mo)s(de.)45 b(This)31 b(option)i(cannot)g(b)s(e) |
5e6f45d9 CR |
13195 | e(unset)h(once)g(it)1110 4908 y(has)e(b)s(een)g(set.)630 |
13196 | 5069 y Ft(-t)384 b Fu(Exit)31 b(after)g(reading)f(and)g(executing)h | |
13197 | (one)g(command.)630 5230 y Ft(-u)384 b Fu(T)-8 b(reat)25 | |
fffe80d4 | 13198 | b(unset)e(v)-5 b(ariables)25 b(and)e(parameters)h(other)h(than)e(the)h |
5e6f45d9 CR |
13199 | (sp)s(ecial)h(param-)1110 5340 y(eters)32 b(`)p Ft(@)p |
13200 | Fu(')f(or)h(`)p Ft(*)p Fu(',)g(or)f(arra)m(y)h(v)-5 b(ariables)32 | |
13201 | b(subscripted)e(with)h(`)p Ft(@)p Fu(')g(or)h(`)p Ft(*)p | |
13202 | Fu(',)f(as)h(an)p eop end | |
e59452c7 CR |
13203 | %%Page: 69 75 |
13204 | TeXDict begin 69 74 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
5e6f45d9 CR |
13205 | b(Shell)30 b(Builtin)h(Commands)2069 b(69)1110 299 y(error)24 |
13206 | b(when)g(p)s(erforming)g(parameter)h(expansion.)39 b(An)24 | |
13207 | b(error)h(message)h(will)1110 408 y(b)s(e)37 b(written)h(to)h(the)f | |
13208 | (standard)f(error,)i(and)f(a)g(non-in)m(teractiv)m(e)j(shell)d(will) | |
13209 | 1110 518 y(exit.)630 667 y Ft(-v)384 b Fu(Prin)m(t)30 | |
13210 | b(shell)h(input)e(lines)i(as)g(they)f(are)h(read.)630 | |
13211 | 817 y Ft(-x)384 b Fu(Prin)m(t)21 b(a)h(trace)h(of)f(simple)f(commands,) | |
fffe80d4 | 13212 | i Ft(for)e Fu(commands,)i Ft(case)d Fu(commands,)1110 |
5e6f45d9 CR |
13213 | 927 y Ft(select)29 b Fu(commands,)j(and)e(arithmetic)j |
13214 | Ft(for)d Fu(commands)h(and)f(their)i(argu-)1110 1036 | |
13215 | y(men)m(ts)h(or)f(asso)s(ciated)i(w)m(ord)e(lists)h(after)g(they)f(are) | |
13216 | h(expanded)f(and)f(b)s(efore)1110 1146 y(they)i(are)g(executed.)49 | |
13217 | b(The)32 b(v)-5 b(alue)33 b(of)g(the)g Ft(PS4)f Fu(v)-5 | |
13218 | b(ariable)34 b(is)f(expanded)f(and)1110 1255 y(the)24 | |
13219 | b(resultan)m(t)h(v)-5 b(alue)24 b(is)g(prin)m(ted)g(b)s(efore)f(the)h | |
13220 | (command)g(and)f(its)i(expanded)1110 1365 y(argumen)m(ts.)630 | |
13221 | 1514 y Ft(-B)384 b Fu(The)41 b(shell)g(will)g(p)s(erform)f(brace)h | |
13222 | (expansion)g(\(see)h(Section)g(3.5.1)g([Brace)1110 1624 | |
13223 | y(Expansion],)30 b(page)h(24\).)42 b(This)30 b(option)h(is)f(on)g(b)m | |
13224 | (y)h(default.)630 1773 y Ft(-C)384 b Fu(Prev)m(en)m(t)25 | |
13225 | b(output)e(redirection)h(using)f(`)p Ft(>)p Fu(',)i(`)p | |
13226 | Ft(>&)p Fu(',)g(and)e(`)p Ft(<>)p Fu(')g(from)h(o)m(v)m(erwriting)1110 | |
13227 | 1883 y(existing)31 b(\014les.)630 2032 y Ft(-E)384 b | |
13228 | Fu(If)39 b(set,)j(an)m(y)e(trap)f(on)g Ft(ERR)g Fu(is)g(inherited)g(b)m | |
13229 | (y)g(shell)h(functions,)h(command)1110 2142 y(substitutions,)35 | |
13230 | b(and)e(commands)g(executed)i(in)f(a)g(subshell)f(en)m(vironmen)m(t.) | |
13231 | 1110 2252 y(The)d Ft(ERR)f Fu(trap)i(is)f(normally)h(not)f(inherited)g | |
13232 | (in)g(suc)m(h)g(cases.)630 2401 y Ft(-H)384 b Fu(Enable)38 | |
13233 | b(`)p Ft(!)p Fu(')h(st)m(yle)h(history)e(substitution)g(\(see)h | |
13234 | (Section)h(9.3)f([History)g(In-)1110 2511 y(teraction],)g(page)d | |
13235 | (153\).)57 b(This)34 b(option)i(is)f(on)g(b)m(y)h(default)f(for)g(in)m | |
13236 | (teractiv)m(e)1110 2620 y(shells.)630 2770 y Ft(-P)384 | |
13237 | b Fu(If)39 b(set,)j(do)d(not)g(resolv)m(e)i(sym)m(b)s(olic)e(links)g | |
13238 | (when)f(p)s(erforming)g(commands)1110 2879 y(suc)m(h)29 | |
13239 | b(as)h Ft(cd)f Fu(whic)m(h)g(c)m(hange)h(the)g(curren)m(t)f(directory) | |
13240 | -8 b(.)42 b(The)28 b(ph)m(ysical)j(direc-)1110 2989 y(tory)j(is)g(used) | |
13241 | f(instead.)52 b(By)34 b(default,)h(Bash)f(follo)m(ws)h(the)f(logical)i | |
13242 | (c)m(hain)f(of)1110 3098 y(directories)j(when)d(p)s(erforming)h | |
13243 | (commands)g(whic)m(h)g(c)m(hange)i(the)f(curren)m(t)1110 | |
13244 | 3208 y(directory)-8 b(.)1110 3337 y(F)g(or)42 b(example,)i(if)d | |
13245 | Ft(/usr/sys)e Fu(is)i(a)g(sym)m(b)s(olic)g(link)g(to)h | |
13246 | Ft(/usr/local/sys)1110 3447 y Fu(then:)1350 3577 y Ft($)47 | |
13247 | b(cd)h(/usr/sys;)d(echo)i($PWD)1350 3686 y(/usr/sys)1350 | |
13248 | 3796 y($)g(cd)h(..;)f(pwd)1350 3905 y(/usr)1110 4035 | |
13249 | y Fu(If)30 b Ft(set)f(-P)h Fu(is)h(on,)f(then:)1350 4164 | |
13250 | y Ft($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 4274 y(/usr/local/sys) | |
13251 | 1350 4384 y($)g(cd)h(..;)f(pwd)1350 4493 y(/usr/local)630 | |
13252 | 4643 y(-T)384 b Fu(If)34 b(set,)j(an)m(y)e(trap)g(on)g | |
13253 | Ft(DEBUG)e Fu(and)i Ft(RETURN)e Fu(are)i(inherited)g(b)m(y)f(shell)i | |
13254 | (func-)1110 4752 y(tions,)k(command)d(substitutions,)h(and)f(commands)g | |
13255 | (executed)h(in)f(a)h(sub-)1110 4862 y(shell)33 b(en)m(vironmen)m(t.)49 | |
13256 | b(The)32 b Ft(DEBUG)g Fu(and)g Ft(RETURN)f Fu(traps)h(are)i(normally)f | |
13257 | (not)1110 4971 y(inherited)d(in)g(suc)m(h)g(cases.)630 | |
13258 | 5121 y Ft(--)384 b Fu(If)44 b(no)g(argumen)m(ts)g(follo)m(w)i(this)e | |
13259 | (option,)k(then)c(the)h(p)s(ositional)g(parame-)1110 | |
13260 | 5230 y(ters)31 b(are)g(unset.)40 b(Otherwise,)31 b(the)f(p)s(ositional) | |
13261 | i(parameters)f(are)f(set)h(to)h(the)1110 5340 y Fr(argumen)m(ts)p | |
13262 | Fu(,)f(ev)m(en)g(if)f(some)h(of)g(them)f(b)s(egin)g(with)g(a)h(`)p | |
13263 | Ft(-)p Fu('.)p eop end | |
e59452c7 CR |
13264 | %%Page: 70 76 |
13265 | TeXDict begin 70 75 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
5e6f45d9 CR |
13266 | b(Shell)30 b(Builtin)h(Commands)2069 b(70)630 299 y Ft(-)432 |
13267 | b Fu(Signal)45 b(the)g(end)f(of)h(options,)k(cause)c(all)h(remaining)e | |
13268 | Fr(argumen)m(ts)49 b Fu(to)d(b)s(e)1110 408 y(assigned)33 | |
13269 | b(to)h(the)g(p)s(ositional)g(parameters.)49 b(The)33 | |
13270 | b Ft(-x)g Fu(and)f Ft(-v)h Fu(options)h(are)1110 518 | |
13271 | y(turned)k(o\013.)68 b(If)38 b(there)i(are)f(no)g(argumen)m(ts,)j(the)e | |
13272 | (p)s(ositional)g(parameters)1110 628 y(remain)30 b(unc)m(hanged.)630 | |
13273 | 775 y(Using)d(`)p Ft(+)p Fu(')h(rather)f(than)g(`)p Ft(-)p | |
fffe80d4 | 13274 | Fu(')g(causes)h(these)f(options)h(to)g(b)s(e)e(turned)g(o\013.)40 |
5e6f45d9 | 13275 | b(The)27 b(options)h(can)630 884 y(also)36 b(b)s(e)f(used)f(up)s(on)g |
fffe80d4 CR |
13276 | (in)m(v)m(o)s(cation)j(of)e(the)g(shell.)56 b(The)34 |
13277 | b(curren)m(t)h(set)h(of)f(options)h(ma)m(y)g(b)s(e)630 | |
5e6f45d9 CR |
13278 | 994 y(found)29 b(in)h Ft($-)p Fu(.)630 1122 y(The)43 |
13279 | b(remaining)h(N)f Fr(argumen)m(ts)48 b Fu(are)c(p)s(ositional)g | |
13280 | (parameters)g(and)f(are)h(assigned,)j(in)630 1232 y(order,)30 | |
13281 | b(to)h Ft($1)p Fu(,)f Ft($2)p Fu(,)36 b(.)22 b(.)g(.)42 | |
13282 | b Ft($N)p Fu(.)e(The)30 b(sp)s(ecial)h(parameter)g Ft(#)f | |
13283 | Fu(is)g(set)h(to)g(N.)630 1360 y(The)f(return)f(status)i(is)f(alw)m(a)m | |
13284 | (ys)i(zero)f(unless)f(an)g(in)m(v)-5 b(alid)31 b(option)g(is)f | |
13285 | (supplied.)150 1548 y Fk(4.3.2)63 b(The)41 b(Shopt)h(Builtin)150 | |
13286 | 1695 y Fu(This)30 b(builtin)g(allo)m(ws)h(y)m(ou)g(to)g(c)m(hange)h | |
13287 | (additional)f(shell)f(optional)i(b)s(eha)m(vior.)150 | |
13288 | 1842 y Ft(shopt)870 1970 y(shopt)46 b([-pqsu])g([-o])h([)p | |
13289 | Fj(optname)e Ft(...])630 2099 y Fu(T)-8 b(oggle)37 b(the)e(v)-5 | |
13290 | b(alues)35 b(of)g(settings)h(con)m(trolling)g(optional)g(shell)f(b)s | |
13291 | (eha)m(vior.)55 b(The)34 b(settings)630 2208 y(can)24 | |
13292 | b(b)s(e)g(either)h(those)f(listed)h(b)s(elo)m(w,)h(or,)f(if)g(the)f | |
13293 | Ft(-o)f Fu(option)i(is)f(used,)h(those)g(a)m(v)-5 b(ailable)26 | |
13294 | b(with)630 2318 y(the)k Ft(-o)f Fu(option)i(to)f(the)g | |
13295 | Ft(set)f Fu(builtin)h(command)f(\(see)i(Section)g(4.3.1)g([The)f(Set)g | |
13296 | (Builtin],)630 2427 y(page)i(66\).)45 b(With)32 b(no)f(options,)h(or)g | |
13297 | (with)f(the)g Ft(-p)g Fu(option,)h(a)g(list)g(of)f(all)i(settable)g | |
13298 | (options)630 2537 y(is)g(displa)m(y)m(ed,)i(with)e(an)g(indication)h | |
13299 | (of)f(whether)g(or)g(not)g(eac)m(h)h(is)g(set;)h(if)e | |
13300 | Fr(optname)5 b Fu(s)34 b(are)630 2647 y(supplied,)25 | |
13301 | b(the)g(output)g(is)g(restricted)g(to)h(those)g(options.)39 | |
13302 | b(The)24 b Ft(-p)h Fu(option)g(causes)g(output)630 2756 | |
13303 | y(to)30 b(b)s(e)f(displa)m(y)m(ed)g(in)g(a)h(form)f(that)g(ma)m(y)h(b)s | |
13304 | (e)f(reused)f(as)i(input.)39 b(Other)29 b(options)g(ha)m(v)m(e)i(the) | |
13305 | 630 2866 y(follo)m(wing)h(meanings:)630 3013 y Ft(-s)384 | |
13306 | b Fu(Enable)30 b(\(set\))i(eac)m(h)f Fr(optname)p Fu(.)630 | |
13307 | 3160 y Ft(-u)384 b Fu(Disable)31 b(\(unset\))g(eac)m(h)h | |
13308 | Fr(optname)p Fu(.)630 3307 y Ft(-q)384 b Fu(Suppresses)28 | |
13309 | b(normal)h(output;)h(the)g(return)e(status)i(indicates)h(whether)e(the) | |
13310 | 1110 3417 y Fr(optname)37 b Fu(is)31 b(set)h(or)f(unset.)43 | |
13311 | b(If)31 b(m)m(ultiple)h Fr(optname)37 b Fu(argumen)m(ts)31 | |
13312 | b(are)h(giv)m(en)1110 3527 y(with)d Ft(-q)p Fu(,)f(the)i(return)d | |
13313 | (status)j(is)f(zero)g(if)g(all)h Fr(optname)5 b Fu(s)29 | |
13314 | b(are)h(enabled;)f(non-)1110 3636 y(zero)i(otherwise.)630 | |
13315 | 3784 y Ft(-o)384 b Fu(Restricts)22 b(the)f(v)-5 b(alues)22 | |
13316 | b(of)f Fr(optname)27 b Fu(to)22 b(b)s(e)e(those)i(de\014ned)e(for)h | |
13317 | (the)g Ft(-o)f Fu(option)1110 3893 y(to)31 b(the)g Ft(set)e | |
13318 | Fu(builtin)h(\(see)h(Section)h(4.3.1)g([The)e(Set)g(Builtin],)i(page)f | |
13319 | (66\).)630 4040 y(If)e(either)i Ft(-s)e Fu(or)h Ft(-u)f | |
13320 | Fu(is)h(used)f(with)g(no)h Fr(optname)35 b Fu(argumen)m(ts,)c | |
13321 | Ft(shopt)d Fu(sho)m(ws)h(only)h(those)630 4150 y(options)h(whic)m(h)f | |
13322 | (are)h(set)f(or)h(unset,)f(resp)s(ectiv)m(ely)-8 b(.)630 | |
13323 | 4278 y(Unless)30 b(otherwise)h(noted,)g(the)g Ft(shopt)d | |
13324 | Fu(options)j(are)g(disabled)f(\(o\013)7 b(\))32 b(b)m(y)e(default.)630 | |
13325 | 4407 y(The)d(return)f(status)i(when)e(listing)j(options)e(is)h(zero)g | |
13326 | (if)f(all)i Fr(optname)5 b Fu(s)27 b(are)h(enabled,)g(non-)630 | |
13327 | 4516 y(zero)40 b(otherwise.)66 b(When)39 b(setting)h(or)f(unsetting)g | |
13328 | (options,)i(the)e(return)f(status)h(is)g(zero)630 4626 | |
13329 | y(unless)30 b(an)g Fr(optname)36 b Fu(is)30 b(not)h(a)g(v)-5 | |
13330 | b(alid)30 b(shell)h(option.)630 4754 y(The)f(list)h(of)f | |
13331 | Ft(shopt)f Fu(options)i(is:)630 4902 y Ft(assoc_expand_once)1110 | |
13332 | 5011 y Fu(If)h(set,)i(the)e(shell)h(suppresses)e(m)m(ultiple)i(ev)-5 | |
13333 | b(aluation)34 b(of)e(asso)s(ciativ)m(e)j(arra)m(y)1110 | |
13334 | 5121 y(subscripts)24 b(during)h(arithmetic)h(expression)g(ev)-5 | |
13335 | b(aluation,)28 b(while)e(executing)1110 5230 y(builtins)c(that)i(can)f | |
13336 | (p)s(erform)f(v)-5 b(ariable)24 b(assignmen)m(ts,)h(and)e(while)g | |
13337 | (executing)1110 5340 y(builtins)30 b(that)h(p)s(erform)e(arra)m(y)i | |
13338 | (dereferencing.)p eop end | |
e59452c7 CR |
13339 | %%Page: 71 77 |
13340 | TeXDict begin 71 76 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
fffe80d4 CR |
13341 | b(Shell)30 b(Builtin)h(Commands)2069 b(71)630 299 y Ft(autocd)192 |
13342 | b Fu(If)27 b(set,)h(a)g(command)f(name)g(that)h(is)f(the)g(name)g(of)h | |
13343 | (a)f(directory)h(is)f(executed)1110 408 y(as)j(if)f(it)h(w)m(ere)f(the) | |
13344 | h(argumen)m(t)g(to)g(the)f Ft(cd)g Fu(command.)40 b(This)29 | |
13345 | b(option)g(is)h(only)1110 518 y(used)g(b)m(y)g(in)m(teractiv)m(e)j | |
13346 | (shells.)630 682 y Ft(cdable_vars)1110 792 y Fu(If)h(this)h(is)g(set,)i | |
13347 | (an)e(argumen)m(t)g(to)h(the)f Ft(cd)f Fu(builtin)h(command)f(that)i | |
13348 | (is)f(not)1110 902 y(a)c(directory)g(is)g(assumed)f(to)h(b)s(e)f(the)h | |
13349 | (name)f(of)h(a)g(v)-5 b(ariable)31 b(whose)g(v)-5 b(alue)31 | |
13350 | b(is)1110 1011 y(the)g(directory)f(to)i(c)m(hange)f(to.)630 | |
13351 | 1176 y Ft(cdspell)144 b Fu(If)27 b(set,)h(minor)f(errors)f(in)h(the)g | |
13352 | (sp)s(elling)h(of)f(a)g(directory)h(comp)s(onen)m(t)f(in)g(a)h | |
13353 | Ft(cd)1110 1285 y Fu(command)i(will)h(b)s(e)f(corrected.)43 | |
13354 | b(The)30 b(errors)g(c)m(hec)m(k)m(ed)j(for)d(are)h(transp)s(osed)1110 | |
13355 | 1395 y(c)m(haracters,)46 b(a)c(missing)f(c)m(haracter,)47 | |
8e1a6eaa | 13356 | b(and)40 b(a)i(c)m(haracter)h(to)s(o)g(man)m(y)-8 b(.)74 |
fffe80d4 CR |
13357 | b(If)42 b(a)1110 1504 y(correction)25 b(is)e(found,)g(the)h(corrected)g |
13358 | (path)f(is)g(prin)m(ted,)h(and)f(the)g(command)1110 1614 | |
220537f2 | 13359 | y(pro)s(ceeds.)40 b(This)30 b(option)h(is)f(only)h(used)e(b)m(y)h(in)m |
fffe80d4 CR |
13360 | (teractiv)m(e)k(shells.)630 1778 y Ft(checkhash)1110 |
13361 | 1888 y Fu(If)29 b(this)h(is)g(set,)g(Bash)g(c)m(hec)m(ks)h(that)g(a)f | |
13362 | (command)f(found)g(in)g(the)h(hash)f(table)1110 1998 | |
8a0829e9 | 13363 | y(exists)k(b)s(efore)f(trying)h(to)h(execute)g(it.)48 |
fffe80d4 | 13364 | b(If)32 b(a)h(hashed)e(command)i(no)f(longer)1110 2107 |
e59452c7 | 13365 | y(exists,)f(a)g(normal)f(path)g(searc)m(h)h(is)g(p)s(erformed.)630 |
fffe80d4 | 13366 | 2271 y Ft(checkjobs)1110 2381 y Fu(If)d(set,)i(Bash)e(lists)h(the)g |
e59452c7 | 13367 | (status)g(of)f(an)m(y)h(stopp)s(ed)f(and)g(running)e(jobs)i(b)s(efore) |
fffe80d4 | 13368 | 1110 2491 y(exiting)42 b(an)f(in)m(teractiv)m(e)j(shell.)72 |
e59452c7 | 13369 | b(If)41 b(an)m(y)g(jobs)f(are)i(running,)g(this)f(causes)1110 |
fffe80d4 CR |
13370 | 2600 y(the)30 b(exit)g(to)g(b)s(e)f(deferred)g(un)m(til)h(a)f(second)h |
13371 | (exit)g(is)g(attempted)h(without)e(an)1110 2710 y(in)m(terv)m(ening)d | |
13372 | (command)f(\(see)h(Chapter)e(7)h([Job)g(Con)m(trol],)i(page)f(112\).)40 | |
13373 | b(The)1110 2819 y(shell)31 b(alw)m(a)m(ys)g(p)s(ostp)s(ones)f(exiting)h | |
13374 | (if)g(an)m(y)f(jobs)g(are)h(stopp)s(ed.)630 2984 y Ft(checkwinsize)1110 | |
13375 | 3093 y Fu(If)23 b(set,)j(Bash)e(c)m(hec)m(ks)h(the)f(windo)m(w)f(size)h | |
13376 | (after)h(eac)m(h)f(external)h(\(non-builtin\))1110 3203 | |
50fc6e33 | 13377 | y(command)55 b(and,)60 b(if)55 b(necessary)-8 b(,)62 |
7a257517 | 13378 | b(up)s(dates)54 b(the)h(v)-5 b(alues)55 b(of)g Ft(LINES)f |
fffe80d4 CR |
13379 | Fu(and)1110 3313 y Ft(COLUMNS)p Fu(.)39 b(This)29 b(option)i(is)g |
13380 | (enabled)f(b)m(y)g(default.)630 3477 y Ft(cmdhist)144 | |
d37a4722 | 13381 | b Fu(If)33 b(set,)j(Bash)e(attempts)h(to)g(sa)m(v)m(e)g(all)g(lines)f |
fffe80d4 | 13382 | (of)g(a)h(m)m(ultiple-line)g(command)1110 3587 y(in)c(the)g(same)g |
d37a4722 | 13383 | (history)g(en)m(try)-8 b(.)42 b(This)30 b(allo)m(ws)i(easy)g |
fffe80d4 | 13384 | (re-editing)g(of)f(m)m(ulti-line)1110 3696 y(commands.)79 |
68d220cb | 13385 | b(This)43 b(option)g(is)h(enabled)f(b)m(y)g(default,)k(but)c(only)g |
fffe80d4 | 13386 | (has)g(an)1110 3806 y(e\013ect)30 b(if)e(command)g(history)g(is)h |
68d220cb | 13387 | (enabled)f(\(see)h(Section)g(9.1)h([Bash)e(History)1110 |
fffe80d4 CR |
13388 | 3915 y(F)-8 b(acilities],)34 b(page)d(151\).)630 4080 |
13389 | y Ft(compat31)630 4189 y(compat32)630 4299 y(compat40)630 | |
13390 | 4408 y(compat41)630 4518 y(compat42)630 4628 y(compat43)630 | |
13391 | 4737 y(compat44)96 b Fu(These)39 b(con)m(trol)i(asp)s(ects)f(of)f(the)h | |
d37a4722 | 13392 | (shell's)g(compatibilit)m(y)h(mo)s(de)e(\(see)h(Sec-)1110 |
fffe80d4 CR |
13393 | 4847 y(tion)31 b(6.12)h([Shell)e(Compatibilit)m(y)i(Mo)s(de],)f(page)g |
13394 | (109\).)630 5011 y Ft(complete_fullquote)1110 5121 y | |
d37a4722 | 13395 | Fu(If)g(set,)g(Bash)h(quotes)f(all)h(shell)f(metac)m(haracters)i(in)e |
fffe80d4 | 13396 | (\014lenames)g(and)g(direc-)1110 5230 y(tory)g(names)f(when)g(p)s |
a2851804 | 13397 | (erforming)f(completion.)43 b(If)30 b(not)h(set,)g(Bash)g(remo)m(v)m |
fffe80d4 CR |
13398 | (es)1110 5340 y(metac)m(haracters)40 b(suc)m(h)d(as)h(the)g(dollar)g |
13399 | (sign)g(from)f(the)h(set)g(of)f(c)m(haracters)p eop end | |
e59452c7 CR |
13400 | %%Page: 72 78 |
13401 | TeXDict begin 72 77 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
fffe80d4 CR |
13402 | b(Shell)30 b(Builtin)h(Commands)2069 b(72)1110 299 y(that)36 |
13403 | b(will)g(b)s(e)f(quoted)g(in)g(completed)i(\014lenames)e(when)f(these)i | |
13404 | (metac)m(har-)1110 408 y(acters)29 b(app)s(ear)e(in)g(shell)h(v)-5 | |
13405 | b(ariable)28 b(references)g(in)f(w)m(ords)g(to)i(b)s(e)e(completed.) | |
13406 | 1110 518 y(This)k(means)i(that)g(dollar)f(signs)g(in)g(v)-5 | |
13407 | b(ariable)33 b(names)g(that)f(expand)g(to)h(di-)1110 | |
13408 | 628 y(rectories)28 b(will)g(not)f(b)s(e)f(quoted;)j(ho)m(w)m(ev)m(er,)g | |
13409 | (an)m(y)e(dollar)h(signs)f(app)s(earing)f(in)1110 737 | |
13410 | y(\014lenames)j(will)h(not)f(b)s(e)g(quoted,)h(either.)41 | |
13411 | b(This)28 b(is)i(activ)m(e)h(only)e(when)g(bash)1110 | |
13412 | 847 y(is)39 b(using)f(bac)m(kslashes)i(to)g(quote)g(completed)f | |
13413 | (\014lenames.)67 b(This)38 b(v)-5 b(ariable)1110 956 | |
13414 | y(is)41 b(set)g(b)m(y)g(default,)j(whic)m(h)c(is)h(the)g(default)g | |
13415 | (Bash)g(b)s(eha)m(vior)g(in)g(v)m(ersions)1110 1066 y(through)30 | |
13416 | b(4.2.)630 1244 y Ft(direxpand)1110 1354 y Fu(If)k(set,)i(Bash)f | |
13417 | (replaces)g(directory)g(names)g(with)f(the)g(results)h(of)f(w)m(ord)g | |
13418 | (ex-)1110 1463 y(pansion)k(when)g(p)s(erforming)f(\014lename)i | |
13419 | (completion.)67 b(This)38 b(c)m(hanges)i(the)1110 1573 | |
13420 | y(con)m(ten)m(ts)29 b(of)e(the)g(readline)h(editing)g(bu\013er.)38 | |
13421 | b(If)27 b(not)g(set,)i(Bash)e(attempts)h(to)1110 1682 | |
13422 | y(preserv)m(e)j(what)f(the)g(user)g(t)m(yp)s(ed.)630 | |
13423 | 1861 y Ft(dirspell)96 b Fu(If)26 b(set,)i(Bash)f(attempts)g(sp)s | |
fc527055 | 13424 | (elling)g(correction)g(on)g(directory)g(names)f(during)1110 |
fffe80d4 CR |
13425 | 1970 y(w)m(ord)36 b(completion)h(if)f(the)g(directory)g(name)g |
13426 | (initially)h(supplied)e(do)s(es)h(not)1110 2080 y(exist.)630 | |
13427 | 2258 y Ft(dotglob)144 b Fu(If)36 b(set,)i(Bash)e(includes)g | |
e59452c7 | 13428 | (\014lenames)g(b)s(eginning)f(with)h(a)g(`.')58 b(in)36 |
fffe80d4 | 13429 | b(the)g(results)1110 2367 y(of)f(\014lename)f(expansion.)53 |
e59452c7 | 13430 | b(The)33 b(\014lenames)i(`)p Ft(.)p Fu(')f(and)g(`)p |
fffe80d4 | 13431 | Ft(..)p Fu(')g(m)m(ust)h(alw)m(a)m(ys)h(b)s(e)1110 2477 |
50fc6e33 | 13432 | y(matc)m(hed)31 b(explicitly)-8 b(,)33 b(ev)m(en)e(if)f |
fffe80d4 | 13433 | Ft(dotglob)f Fu(is)h(set.)630 2655 y Ft(execfail)96 b |
50fc6e33 | 13434 | Fu(If)24 b(this)h(is)f(set,)j(a)e(non-in)m(teractiv)m(e)i(shell)e(will) |
fffe80d4 | 13435 | f(not)h(exit)h(if)e(it)h(cannot)h(execute)1110 2765 y(the)i(\014le)g |
e59452c7 | 13436 | (sp)s(eci\014ed)g(as)g(an)g(argumen)m(t)g(to)h(the)f |
fffe80d4 | 13437 | Ft(exec)f Fu(builtin)h(command.)39 b(An)1110 2874 y(in)m(teractiv)m(e) |
e59452c7 | 13438 | 33 b(shell)e(do)s(es)f(not)g(exit)i(if)e Ft(exec)f Fu(fails.)630 |
fffe80d4 | 13439 | 3052 y Ft(expand_aliases)1110 3162 y Fu(If)j(set,)h(aliases)g(are)g |
50fc6e33 | 13440 | (expanded)e(as)h(describ)s(ed)f(b)s(elo)m(w)h(under)f(Aliases,)i(Sec-) |
fffe80d4 | 13441 | 1110 3271 y(tion)38 b(6.6)h([Aliases],)j(page)d(99.)64 |
50fc6e33 | 13442 | b(This)37 b(option)h(is)g(enabled)g(b)m(y)g(default)g(for)1110 |
fffe80d4 | 13443 | 3381 y(in)m(teractiv)m(e)33 b(shells.)630 3559 y Ft(extdebug)96 |
e230f997 CR |
13444 | b Fu(If)35 b(set)i(at)f(shell)g(in)m(v)m(o)s(cation,)k(or)c(in)f(a)h |
13445 | (shell)h(startup)e(\014le,)i(arrange)g(to)f(ex-)1110 | |
fffe80d4 CR |
13446 | 3669 y(ecute)h(the)f(debugger)g(pro\014le)g(b)s(efore)g(the)g(shell)h |
13447 | (starts,)h(iden)m(tical)g(to)f(the)1110 3778 y Ft(--debugger)32 | |
e230f997 | 13448 | b Fu(option.)56 b(If)35 b(set)h(after)g(in)m(v)m(o)s(cation,)j(b)s(eha) |
fffe80d4 CR |
13449 | m(vior)c(in)m(tended)g(for)1110 3888 y(use)30 b(b)m(y)g(debuggers)g(is) |
13450 | h(enabled:)1159 4032 y(1.)61 b(The)37 b Ft(-F)g Fu(option)h(to)g(the)g | |
e230f997 | 13451 | Ft(declare)d Fu(builtin)i(\(see)i(Section)f(4.2)h([Bash)1290 |
fffe80d4 CR |
13452 | 4141 y(Builtins],)29 b(page)g(54\))g(displa)m(ys)f(the)g(source)h |
13453 | (\014le)f(name)g(and)f(line)h(n)m(um-)1290 4251 y(b)s(er)h(corresp)s | |
e230f997 | 13454 | (onding)g(to)i(eac)m(h)g(function)f(name)g(supplied)f(as)i(an)f(argu-) |
fffe80d4 | 13455 | 1290 4361 y(men)m(t.)1159 4504 y(2.)61 b(If)20 b(the)h(command)g(run)e |
e230f997 | 13456 | (b)m(y)i(the)f Ft(DEBUG)g Fu(trap)g(returns)g(a)h(non-zero)g(v)-5 |
fffe80d4 CR |
13457 | b(alue,)1290 4614 y(the)31 b(next)f(command)g(is)h(skipp)s(ed)e(and)g |
13458 | (not)i(executed.)1159 4758 y(3.)61 b(If)37 b(the)g(command)g(run)f(b)m | |
e230f997 | 13459 | (y)i(the)f Ft(DEBUG)f Fu(trap)h(returns)f(a)i(v)-5 b(alue)38 |
fffe80d4 CR |
13460 | b(of)f(2,)1290 4867 y(and)c(the)g(shell)h(is)f(executing)i(in)e(a)h |
13461 | (subroutine)e(\(a)i(shell)g(function)f(or)1290 4977 y(a)h(shell)g | |
71574d7e | 13462 | (script)f(executed)h(b)m(y)g(the)f Ft(.)h Fu(or)f Ft(source)f |
fffe80d4 CR |
13463 | Fu(builtins\),)i(the)g(shell)1290 5087 y(sim)m(ulates)d(a)g(call)h(to)f |
13464 | Ft(return)p Fu(.)1159 5230 y(4.)61 b Ft(BASH_ARGC)34 | |
71574d7e | 13465 | b Fu(and)i Ft(BASH_ARGV)e Fu(are)j(up)s(dated)e(as)h(describ)s(ed)g(in) |
fffe80d4 CR |
13466 | g(their)1290 5340 y(descriptions)30 b(\(see)i(Section)f(5.2)g([Bash)g |
13467 | (V)-8 b(ariables],)32 b(page)f(77\).)p eop end | |
e59452c7 CR |
13468 | %%Page: 73 79 |
13469 | TeXDict begin 73 78 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
fffe80d4 CR |
13470 | b(Shell)30 b(Builtin)h(Commands)2069 b(73)1159 299 y(5.)61 |
13471 | b(F)-8 b(unction)57 b(tracing)g(is)g(enabled:)93 b(command)56 | |
13472 | b(substitution,)63 b(shell)1290 408 y(functions,)32 b(and)e(subshells)h | |
13473 | (in)m(v)m(ok)m(ed)i(with)e Ft(\()f Fj(command)e Ft(\))j | |
13474 | Fu(inherit)h(the)1290 518 y Ft(DEBUG)d Fu(and)h Ft(RETURN)e | |
5e6f45d9 CR |
13475 | Fu(traps.)1159 662 y(6.)61 b(Error)41 b(tracing)i(is)f(enabled:)63 |
13476 | b(command)42 b(substitution,)i(shell)f(func-)1290 772 | |
fffe80d4 CR |
13477 | y(tions,)32 b(and)e(subshells)g(in)m(v)m(ok)m(ed)i(with)e |
13478 | Ft(\()g Fj(command)f Ft(\))h Fu(inherit)h(the)g Ft(ERR)1290 | |
5e6f45d9 | 13479 | 881 y Fu(trap.)630 1060 y Ft(extglob)144 b Fu(If)26 b(set,)i(the)f |
fffe80d4 | 13480 | (extended)f(pattern)h(matc)m(hing)g(features)g(describ)s(ed)e(ab)s(o)m |
5e6f45d9 CR |
13481 | (v)m(e)j(\(see)1110 1170 y(Section)j(3.5.8.1)i([P)m(attern)f(Matc)m |
13482 | (hing],)g(page)f(36\))h(are)f(enabled.)630 1349 y Ft(extquote)96 | |
fffe80d4 CR |
13483 | b Fu(If)51 b(set,)58 b Ft($')p Fj(string)p Ft(')49 b |
13484 | Fu(and)i Ft($")p Fj(string)p Ft(")e Fu(quoting)k(is)e(p)s(erformed)f | |
5e6f45d9 | 13485 | (within)1110 1458 y Ft(${)p Fj(parameter)p Ft(})31 b |
fffe80d4 | 13486 | Fu(expansions)k(enclosed)g(in)g(double)f(quotes.)55 b(This)33 |
5e6f45d9 CR |
13487 | b(option)1110 1568 y(is)d(enabled)h(b)m(y)f(default.)630 |
13488 | 1747 y Ft(failglob)96 b Fu(If)36 b(set,)j(patterns)d(whic)m(h)g(fail)h | |
e59452c7 | 13489 | (to)h(matc)m(h)f(\014lenames)f(during)g(\014lename)g(ex-)1110 |
5e6f45d9 CR |
13490 | 1856 y(pansion)30 b(result)g(in)g(an)g(expansion)h(error.)630 |
13491 | 2035 y Ft(force_fignore)1110 2145 y Fu(If)43 b(set,)k(the)d(su\016xes)f | |
abfcfa4e | 13492 | (sp)s(eci\014ed)f(b)m(y)i(the)f Ft(FIGNORE)f Fu(shell)h(v)-5 |
5e6f45d9 | 13493 | b(ariable)44 b(cause)1110 2254 y(w)m(ords)31 b(to)h(b)s(e)f(ignored)h |
e59452c7 | 13494 | (when)f(p)s(erforming)f(w)m(ord)h(completion)i(ev)m(en)f(if)g(the)1110 |
5e6f45d9 CR |
13495 | 2364 y(ignored)37 b(w)m(ords)g(are)g(the)h(only)f(p)s(ossible)g |
13496 | (completions.)62 b(See)37 b(Section)h(5.2)1110 2473 y([Bash)24 | |
e59452c7 | 13497 | b(V)-8 b(ariables],)27 b(page)e(77,)h(for)d(a)h(description)g(of)g |
5e6f45d9 CR |
13498 | Ft(FIGNORE)p Fu(.)37 b(This)22 b(option)1110 2583 y(is)30 |
13499 | b(enabled)h(b)m(y)f(default.)630 2762 y Ft(globasciiranges)1110 | |
13500 | 2871 y Fu(If)j(set,)h(range)f(expressions)g(used)f(in)h(pattern)g(matc) | |
13501 | m(hing)h(brac)m(k)m(et)h(expres-)1110 2981 y(sions)28 | |
e59452c7 | 13502 | b(\(see)h(Section)h(3.5.8.1)g([P)m(attern)g(Matc)m(hing],)h(page)e |
5e6f45d9 | 13503 | (36\))g(b)s(eha)m(v)m(e)g(as)g(if)1110 3091 y(in)i(the)g(traditional)i |
e59452c7 | 13504 | (C)d(lo)s(cale)j(when)d(p)s(erforming)g(comparisons.)44 |
5e6f45d9 | 13505 | b(That)31 b(is,)1110 3200 y(the)d(curren)m(t)g(lo)s(cale's)i(collating) |
e59452c7 | 13506 | h(sequence)d(is)h(not)f(tak)m(en)h(in)m(to)g(accoun)m(t,)i(so)1110 |
5e6f45d9 | 13507 | 3310 y(`)p Ft(b)p Fu(')j(will)g(not)g(collate)i(b)s(et)m(w)m(een)e(`)p |
e59452c7 | 13508 | Ft(A)p Fu(')g(and)f(`)p Ft(B)p Fu(',)h(and)f(upp)s(er-case)g(and)g(lo)m |
5e6f45d9 CR |
13509 | (w)m(er-)1110 3419 y(case)e(ASCI)s(I)e(c)m(haracters)j(will)f(collate)i |
13510 | (together.)630 3598 y Ft(globskipdots)1110 3708 y Fu(If)38 | |
13511 | b(set,)k(\014lename)d(expansion)f(will)h(nev)m(er)g(matc)m(h)h(the)f | |
13512 | (\014lenames)g(`)p Ft(.)p Fu(')g(and)1110 3817 y(`)p | |
13513 | Ft(..)p Fu(',)c(ev)m(en)g(if)g(the)f(pattern)g(b)s(egins)g(with)g(a)h | |
13514 | (`)p Ft(.)p Fu('.)52 b(This)34 b(option)h(is)f(enabled)1110 | |
13515 | 3927 y(b)m(y)c(default.)630 4106 y Ft(globstar)96 b Fu(If)38 | |
13516 | b(set,)j(the)e(pattern)f(`)p Ft(**)p Fu(')h(used)e(in)i(a)f(\014lename) | |
13517 | h(expansion)f(con)m(text)j(will)1110 4215 y(matc)m(h)36 | |
13518 | b(all)g(\014les)f(and)f(zero)i(or)f(more)g(directories)h(and)e(sub)s | |
13519 | (directories.)54 b(If)1110 4325 y(the)30 b(pattern)g(is)g(follo)m(w)m | |
13520 | (ed)i(b)m(y)d(a)i(`)p Ft(/)p Fu(',)f(only)g(directories)h(and)f(sub)s | |
13521 | (directories)1110 4434 y(matc)m(h.)630 4613 y Ft(gnu_errfmt)1110 | |
13522 | 4723 y Fu(If)35 b(set,)j(shell)e(error)g(messages)g(are)h(written)e(in) | |
13523 | h(the)g(standard)f Fm(gnu)g Fu(error)1110 4832 y(message)c(format.)630 | |
13524 | 5011 y Ft(histappend)1110 5121 y Fu(If)c(set,)j(the)e(history)g(list)g | |
71574d7e | 13525 | (is)g(app)s(ended)e(to)j(the)f(\014le)g(named)f(b)m(y)h(the)g(v)-5 |
5e6f45d9 | 13526 | b(alue)29 b(of)1110 5230 y(the)d Ft(HISTFILE)d Fu(v)-5 |
71574d7e | 13527 | b(ariable)26 b(when)e(the)h(shell)h(exits,)h(rather)e(than)h(o)m(v)m |
5e6f45d9 | 13528 | (erwriting)1110 5340 y(the)31 b(\014le.)p eop end |
e59452c7 CR |
13529 | %%Page: 74 80 |
13530 | TeXDict begin 74 79 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
5e6f45d9 CR |
13531 | b(Shell)30 b(Builtin)h(Commands)2069 b(74)630 299 y Ft(histreedit)1110 |
13532 | 408 y Fu(If)33 b(set,)h(and)f(Readline)h(is)f(b)s(eing)g(used,)g(a)g | |
13533 | (user)g(is)g(giv)m(en)h(the)g(opp)s(ortunit)m(y)1110 | |
13534 | 518 y(to)d(re-edit)g(a)g(failed)g(history)f(substitution.)630 | |
13535 | 682 y Ft(histverify)1110 792 y Fu(If)35 b(set,)i(and)e(Readline)h(is)f | |
13536 | (b)s(eing)g(used,)h(the)f(results)g(of)g(history)h(substitu-)1110 | |
13537 | 902 y(tion)h(are)g(not)g(immediately)h(passed)e(to)h(the)g(shell)g | |
13538 | (parser.)59 b(Instead,)38 b(the)1110 1011 y(resulting)i(line)f(is)h | |
13539 | (loaded)g(in)m(to)g(the)g(Readline)g(editing)g(bu\013er,)h(allo)m(wing) | |
13540 | 1110 1121 y(further)29 b(mo)s(di\014cation.)630 1285 | |
13541 | y Ft(hostcomplete)1110 1395 y Fu(If)38 b(set,)j(and)c(Readline)i(is)f | |
13542 | (b)s(eing)g(used,)h(Bash)g(will)f(attempt)h(to)g(p)s(erform)1110 | |
13543 | 1504 y(hostname)d(completion)h(when)e(a)h(w)m(ord)f(con)m(taining)i(a)f | |
13544 | (`)p Ft(@)p Fu(')g(is)g(b)s(eing)f(com-)1110 1614 y(pleted)g(\(see)h | |
fffe80d4 | 13545 | (Section)f(8.4.6)i([Commands)d(F)-8 b(or)36 b(Completion],)g(page)g |
5e6f45d9 CR |
13546 | (138\).)1110 1724 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.) |
13547 | 630 1888 y Ft(huponexit)1110 1998 y Fu(If)i(set,)i(Bash)f(will)h(send)d | |
fffe80d4 | 13548 | Ft(SIGHUP)h Fu(to)h(all)h(jobs)e(when)g(an)g(in)m(teractiv)m(e)k(login) |
5e6f45d9 | 13549 | 1110 2107 y(shell)31 b(exits)g(\(see)g(Section)g(3.7.6)h([Signals],)g |
3011048a | 13550 | (page)f(45\).)630 2271 y Ft(inherit_errexit)1110 2381 |
fffe80d4 | 13551 | y Fu(If)e(set,)h(command)g(substitution)f(inherits)g(the)g(v)-5 |
5e6f45d9 | 13552 | b(alue)30 b(of)g(the)f Ft(errexit)f Fu(op-)1110 2491 |
fffe80d4 | 13553 | y(tion,)33 b(instead)g(of)f(unsetting)g(it)h(in)f(the)g(subshell)f(en)m |
5e6f45d9 CR |
13554 | (vironmen)m(t.)46 b(This)32 b(op-)1110 2600 y(tion)f(is)f(enabled)h |
13555 | (when)e Fm(posix)h Fu(mo)s(de)g(is)g(enabled.)630 2765 | |
13556 | y Ft(interactive_comments)1110 2874 y Fu(Allo)m(w)d(a)g(w)m(ord)e(b)s | |
fffe80d4 | 13557 | (eginning)g(with)h(`)p Ft(#)p Fu(')g(to)h(cause)f(that)h(w)m(ord)f(and) |
5e6f45d9 | 13558 | f(all)i(remain-)1110 2984 y(ing)41 b(c)m(haracters)i(on)e(that)h(line)g |
fffe80d4 | 13559 | (to)g(b)s(e)f(ignored)g(in)g(an)g(in)m(teractiv)m(e)j(shell.)1110 |
5e6f45d9 CR |
13560 | 3093 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.)630 |
13561 | 3258 y Ft(lastpipe)96 b Fu(If)24 b(set,)i(and)e(job)g(con)m(trol)i(is)f | |
fc527055 | 13562 | (not)f(activ)m(e,)k(the)d(shell)f(runs)f(the)i(last)g(command)1110 |
5e6f45d9 CR |
13563 | 3367 y(of)37 b(a)h(pip)s(eline)e(not)h(executed)h(in)f(the)g(bac)m |
13564 | (kground)g(in)g(the)g(curren)m(t)g(shell)1110 3477 y(en)m(vironmen)m | |
13565 | (t.)630 3641 y Ft(lithist)144 b Fu(If)22 b(enabled,)i(and)d(the)h | |
50fc6e33 | 13566 | Ft(cmdhist)e Fu(option)j(is)f(enabled,)i(m)m(ulti-line)f(commands)1110 |
5e6f45d9 CR |
13567 | 3751 y(are)28 b(sa)m(v)m(ed)h(to)g(the)f(history)g(with)f(em)m(b)s |
13568 | (edded)g(newlines)h(rather)g(than)f(using)1110 3861 y(semicolon)32 | |
13569 | b(separators)f(where)e(p)s(ossible.)630 4025 y Ft(localvar_inherit)1110 | |
13570 | 4134 y Fu(If)j(set,)h(lo)s(cal)g(v)-5 b(ariables)33 b(inherit)f(the)g | |
50fc6e33 | 13571 | (v)-5 b(alue)32 b(and)g(attributes)h(of)f(a)g(v)-5 b(ariable)1110 |
5e6f45d9 CR |
13572 | 4244 y(of)36 b(the)g(same)g(name)g(that)h(exists)f(at)h(a)f(previous)g |
13573 | (scop)s(e)g(b)s(efore)f(an)m(y)h(new)1110 4354 y(v)-5 | |
e59452c7 | 13574 | b(alue)31 b(is)f(assigned.)41 b(The)30 b Ft(nameref)e |
5e6f45d9 CR |
13575 | Fu(attribute)k(is)e(not)h(inherited.)630 4518 y Ft(localvar_unset)1110 |
13576 | 4628 y Fu(If)i(set,)i(calling)g Ft(unset)d Fu(on)i(lo)s(cal)g(v)-5 | |
e59452c7 | 13577 | b(ariables)35 b(in)e(previous)g(function)g(scop)s(es)1110 |
5e6f45d9 CR |
13578 | 4737 y(marks)26 b(them)g(so)g(subsequen)m(t)g(lo)s(okups)f(\014nd)g |
13579 | (them)h(unset)f(un)m(til)i(that)g(func-)1110 4847 y(tion)40 | |
e59452c7 | 13580 | b(returns.)68 b(This)39 b(is)g(iden)m(tical)j(to)e(the)g(b)s(eha)m |
5e6f45d9 CR |
13581 | (vior)g(of)g(unsetting)g(lo)s(cal)1110 4956 y(v)-5 b(ariables)31 |
13582 | b(at)g(the)g(curren)m(t)f(function)g(scop)s(e.)630 5121 | |
13583 | y Ft(login_shell)1110 5230 y Fu(The)35 b(shell)h(sets)g(this)f(option)h | |
e59452c7 | 13584 | (if)g(it)g(is)f(started)h(as)g(a)g(login)g(shell)g(\(see)g(Sec-)1110 |
5e6f45d9 CR |
13585 | 5340 y(tion)29 b(6.1)g([In)m(v)m(oking)h(Bash],)f(page)g(90\).)41 |
13586 | b(The)28 b(v)-5 b(alue)29 b(ma)m(y)g(not)f(b)s(e)g(c)m(hanged.)p | |
13587 | eop end | |
e59452c7 CR |
13588 | %%Page: 75 81 |
13589 | TeXDict begin 75 80 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
5e6f45d9 CR |
13590 | b(Shell)30 b(Builtin)h(Commands)2069 b(75)630 299 y Ft(mailwarn)96 |
13591 | b Fu(If)34 b(set,)i(and)e(a)h(\014le)g(that)g(Bash)f(is)h(c)m(hec)m | |
13592 | (king)h(for)f(mail)g(has)f(b)s(een)g(accessed)1110 408 | |
13593 | y(since)24 b(the)h(last)g(time)f(it)h(w)m(as)f(c)m(hec)m(k)m(ed,)k(the) | |
13594 | c(message)h Ft("The)k(mail)h(in)f Fj(mail-)1110 518 y(file)g | |
13595 | Ft(has)h(been)f(read")g Fu(is)h(displa)m(y)m(ed.)630 | |
13596 | 701 y Ft(no_empty_cmd_completion)1110 810 y Fu(If)g(set,)g(and)g | |
13597 | (Readline)g(is)h(b)s(eing)e(used,)h(Bash)g(will)g(not)g(attempt)i(to)e | |
13598 | (searc)m(h)1110 920 y(the)25 b Ft(PATH)f Fu(for)h(p)s(ossible)f | |
13599 | (completions)j(when)d(completion)i(is)f(attempted)h(on)1110 | |
13600 | 1029 y(an)k(empt)m(y)h(line.)630 1212 y Ft(nocaseglob)1110 | |
13601 | 1322 y Fu(If)38 b(set,)k(Bash)d(matc)m(hes)g(\014lenames)g(in)f(a)h | |
13602 | (case-insensitiv)m(e)j(fashion)c(when)1110 1431 y(p)s(erforming)29 | |
13603 | b(\014lename)i(expansion.)630 1614 y Ft(nocasematch)1110 | |
13604 | 1724 y Fu(If)42 b(set,)k(Bash)d(matc)m(hes)g(patterns)g(in)f(a)h | |
13605 | (case-insensitiv)m(e)i(fashion)d(when)1110 1833 y(p)s(erforming)31 | |
e59452c7 | 13606 | b(matc)m(hing)i(while)f(executing)i Ft(case)d Fu(or)h |
5e6f45d9 | 13607 | Ft([[)g Fu(conditional)h(com-)1110 1943 y(mands)25 b(\(see)i(Section)f |
e59452c7 | 13608 | (3.2.5.2)j([Conditional)e(Constructs],)f(page)h(12,)h(when)1110 |
5e6f45d9 CR |
13609 | 2052 y(p)s(erforming)e(pattern)i(substitution)f(w)m(ord)g(expansions,)h |
13610 | (or)f(when)g(\014ltering)1110 2162 y(p)s(ossible)j(completions)h(as)g | |
13611 | (part)f(of)h(programmable)f(completion.)630 2345 y Ft | |
13612 | (noexpand_translation)1110 2454 y Fu(If)23 b(set,)j(Bash)d(encloses)i | |
e59452c7 | 13613 | (the)e(translated)h(results)g(of)f($)p Ft(")p Fu(...)p |
5e6f45d9 | 13614 | Ft(")h Fu(quoting)g(in)f(single)1110 2564 y(quotes)k(instead)g(of)g |
e59452c7 | 13615 | (double)f(quotes.)40 b(If)26 b(the)h(string)f(is)h(not)g(translated,)h |
5e6f45d9 | 13616 | (this)1110 2673 y(has)i(no)g(e\013ect.)630 2856 y Ft(nullglob)96 |
e59452c7 | 13617 | b Fu(If)23 b(set,)j(Bash)e(allo)m(ws)g(\014lename)g(patterns)g(whic)m |
5e6f45d9 | 13618 | (h)f(matc)m(h)h(no)g(\014les)f(to)i(expand)1110 2966 |
e59452c7 | 13619 | y(to)31 b(a)g(n)m(ull)f(string,)h(rather)f(than)g(themselv)m(es.)630 |
5e6f45d9 | 13620 | 3148 y Ft(patsub_replacement)1110 3258 y Fu(If)38 b(set,)k(Bash)d |
e59452c7 | 13621 | (expands)e(o)s(ccurrences)i(of)g(`)p Ft(&)p Fu(')g(in)f(the)h |
5e6f45d9 | 13622 | (replacemen)m(t)h(string)1110 3367 y(of)47 b(pattern)g(substitution)g |
e59452c7 | 13623 | (to)h(the)f(text)h(matc)m(hed)g(b)m(y)f(the)g(pattern,)52 |
5e6f45d9 CR |
13624 | b(as)1110 3477 y(describ)s(ed)45 b(ab)s(o)m(v)m(e)i(\(see)f(Section)h |
13625 | (3.5.3)g([Shell)f(P)m(arameter)h(Expansion],)1110 3587 | |
e59452c7 | 13626 | y(page)31 b(26\).)42 b(This)30 b(option)g(is)h(enabled)f(b)m(y)g |
5e6f45d9 | 13627 | (default.)630 3769 y Ft(progcomp)96 b Fu(If)25 b(set,)i(the)f |
e59452c7 | 13628 | (programmable)g(completion)g(facilities)i(\(see)f(Section)f(8.6)h |
5e6f45d9 CR |
13629 | ([Pro-)1110 3879 y(grammable)45 b(Completion],)k(page)c(142\))h(are)f |
13630 | (enabled.)82 b(This)44 b(option)h(is)1110 3988 y(enabled)30 | |
13631 | b(b)m(y)h(default.)630 4171 y Ft(progcomp_alias)1110 | |
13632 | 4281 y Fu(If)23 b(set,)j(and)d(programmable)h(completion)h(is)f | |
13633 | (enabled,)h(Bash)f(treats)h(a)f(com-)1110 4390 y(mand)34 | |
50fc6e33 | 13634 | b(name)h(that)g(do)s(esn't)f(ha)m(v)m(e)i(an)m(y)g(completions)f(as)g |
5e6f45d9 | 13635 | (a)g(p)s(ossible)g(alias)1110 4500 y(and)40 b(attempts)i(alias)h |
50fc6e33 | 13636 | (expansion.)72 b(If)41 b(it)g(has)g(an)g(alias,)k(Bash)c(attempts)1110 |
5e6f45d9 CR |
13637 | 4609 y(programmable)28 b(completion)h(using)e(the)h(command)f(w)m(ord)h |
13638 | (resulting)f(from)1110 4719 y(the)k(expanded)e(alias.)630 | |
13639 | 4902 y Ft(promptvars)1110 5011 y Fu(If)50 b(set,)56 b(prompt)49 | |
50fc6e33 | 13640 | b(strings)h(undergo)g(parameter)h(expansion,)k(command)1110 |
5e6f45d9 CR |
13641 | 5121 y(substitution,)35 b(arithmetic)g(expansion,)g(and)e(quote)i(remo) |
13642 | m(v)-5 b(al)35 b(after)f(b)s(eing)1110 5230 y(expanded)53 | |
50fc6e33 | 13643 | b(as)h(describ)s(ed)e(b)s(elo)m(w)i(\(see)h(Section)f(6.9)h([Con)m |
5e6f45d9 CR |
13644 | (trolling)g(the)1110 5340 y(Prompt],)30 b(page)h(103\).)43 |
13645 | b(This)29 b(option)i(is)g(enabled)f(b)m(y)g(default.)p | |
13646 | eop end | |
e59452c7 CR |
13647 | %%Page: 76 82 |
13648 | TeXDict begin 76 81 bop 150 -116 a Fu(Chapter)30 b(4:)41 | |
5e6f45d9 CR |
13649 | b(Shell)30 b(Builtin)h(Commands)2069 b(76)630 299 y Ft |
13650 | (restricted_shell)1110 408 y Fu(The)40 b(shell)h(sets)g(this)g(option)g | |
13651 | (if)g(it)h(is)e(started)i(in)e(restricted)i(mo)s(de)e(\(see)1110 | |
13652 | 518 y(Section)32 b(6.10)h([The)d(Restricted)j(Shell],)e(page)h(104\).) | |
13653 | 45 b(The)30 b(v)-5 b(alue)32 b(ma)m(y)g(not)1110 628 | |
13654 | y(b)s(e)g(c)m(hanged.)49 b(This)32 b(is)h(not)h(reset)f(when)f(the)h | |
13655 | (startup)g(\014les)f(are)i(executed,)1110 737 y(allo)m(wing)k(the)e | |
13656 | (startup)f(\014les)h(to)g(disco)m(v)m(er)h(whether)f(or)f(not)i(a)f | |
13657 | (shell)g(is)g(re-)1110 847 y(stricted.)630 1006 y Ft(shift_verbose)1110 | |
13658 | 1116 y Fu(If)g(this)g(is)g(set,)j(the)d Ft(shift)f Fu(builtin)h(prin)m | |
13659 | (ts)f(an)h(error)g(message)i(when)d(the)1110 1225 y(shift)30 | |
13660 | b(coun)m(t)h(exceeds)g(the)g(n)m(um)m(b)s(er)e(of)h(p)s(ositional)i | |
13661 | (parameters.)630 1385 y Ft(sourcepath)1110 1494 y Fu(If)40 | |
13662 | b(set,)45 b(the)c Ft(.)f Fu(\()p Ft(source)p Fu(\))g(builtin)g(uses)h | |
13663 | (the)g(v)-5 b(alue)41 b(of)g Ft(PATH)f Fu(to)h(\014nd)f(the)1110 | |
13664 | 1604 y(directory)32 b(con)m(taining)g(the)g(\014le)f(supplied)f(as)h | |
13665 | (an)g(argumen)m(t.)44 b(This)30 b(option)1110 1714 y(is)g(enabled)h(b)m | |
13666 | (y)f(default.)630 1873 y Ft(varredir_close)1110 1983 | |
13667 | y Fu(If)i(set,)h(the)f(shell)h(automatically)i(closes)e(\014le)f | |
13668 | (descriptors)g(assigned)g(using)1110 2092 y(the)40 b | |
13669 | Ft({varname})c Fu(redirection)k(syn)m(tax)g(\(see)h(Section)f(3.6)g | |
13670 | ([Redirections],)1110 2202 y(page)h(37\))f(instead)h(of)e(lea)m(ving)j | |
13671 | (them)e(op)s(en)f(when)g(the)h(command)f(com-)1110 2311 | |
13672 | y(pletes.)630 2471 y Ft(xpg_echo)96 b Fu(If)31 b(set,)h(the)g | |
e59452c7 | 13673 | Ft(echo)e Fu(builtin)h(expands)f(bac)m(kslash-escap)s(e)j(sequences)f |
5e6f45d9 CR |
13674 | (b)m(y)f(de-)1110 2580 y(fault.)150 2821 y Fs(4.4)68 |
13675 | b(Sp)t(ecial)45 b(Builtins)150 2980 y Fu(F)-8 b(or)35 | |
e59452c7 CR |
13676 | b(historical)h(reasons,)g(the)e Fm(posix)g Fu(standard)f(has)i |
13677 | (classi\014ed)f(sev)m(eral)i(builtin)e(commands)g(as)h | |
5e6f45d9 | 13678 | Fl(sp)-5 b(e-)150 3090 y(cial)p Fu(.)47 b(When)33 b(Bash)f(is)h |
e59452c7 | 13679 | (executing)g(in)f Fm(posix)g Fu(mo)s(de,)h(the)g(sp)s(ecial)g(builtins) |
5e6f45d9 CR |
13680 | e(di\013er)i(from)f(other)g(builtin)150 3200 y(commands)e(in)g(three)h |
13681 | (resp)s(ects:)199 3334 y(1.)61 b(Sp)s(ecial)31 b(builtins)e(are)i | |
e59452c7 | 13682 | (found)e(b)s(efore)h(shell)h(functions)f(during)f(command)h(lo)s(okup.) |
5e6f45d9 | 13683 | 199 3469 y(2.)61 b(If)30 b(a)h(sp)s(ecial)g(builtin)f(returns)f(an)h |
e59452c7 | 13684 | (error)g(status,)h(a)g(non-in)m(teractiv)m(e)i(shell)d(exits.)199 |
5e6f45d9 | 13685 | 3603 y(3.)61 b(Assignmen)m(t)30 b(statemen)m(ts)h(preceding)f(the)f |
e59452c7 | 13686 | (command)g(sta)m(y)i(in)e(e\013ect)i(in)e(the)h(shell)f(en)m(vironmen)m |
5e6f45d9 CR |
13687 | (t)330 3713 y(after)i(the)f(command)h(completes.)275 |
13688 | 3872 y(When)36 b(Bash)g(is)h(not)f(executing)i(in)e Fm(posix)f | |
e59452c7 | 13689 | Fu(mo)s(de,)j(these)f(builtins)f(b)s(eha)m(v)m(e)h(no)f(di\013eren)m |
5e6f45d9 | 13690 | (tly)h(than)150 3982 y(the)31 b(rest)f(of)h(the)f(Bash)h(builtin)e |
e59452c7 | 13691 | (commands.)41 b(The)30 b(Bash)g Fm(posix)g Fu(mo)s(de)g(is)g(describ)s |
5e6f45d9 CR |
13692 | (ed)f(in)h(Section)h(6.11)150 4091 y([Bash)g(POSIX)e(Mo)s(de],)i(page)g |
13693 | (105.)275 4226 y(These)f(are)g(the)h Fm(posix)f Fu(sp)s(ecial)h | |
13694 | (builtins:)390 4360 y Ft(break)46 b(:)i(.)f(continue)f(eval)g(exec)h | |
13695 | (exit)g(export)f(readonly)f(return)h(set)390 4470 y(shift)g(trap)h | |
e59452c7 CR |
13696 | (unset)p eop end |
13697 | %%Page: 77 83 | |
13698 | TeXDict begin 77 82 bop 3659 -116 a Fu(77)150 299 y Fp(5)80 | |
091c6bc4 | 13699 | b(Shell)53 b(V)-13 b(ariables)150 504 y Fu(This)21 b(c)m(hapter)i |
c302751c CR |
13700 | (describ)s(es)e(the)i(shell)f(v)-5 b(ariables)23 b(that)f(Bash)h(uses.) |
13701 | 37 b(Bash)23 b(automatically)h(assigns)f(default)150 | |
091c6bc4 CR |
13702 | 614 y(v)-5 b(alues)31 b(to)g(a)g(n)m(um)m(b)s(er)e(of)h(v)-5 |
13703 | b(ariables.)150 843 y Fs(5.1)68 b(Bourne)45 b(Shell)g(V)-11 | |
13704 | b(ariables)150 1003 y Fu(Bash)30 b(uses)g(certain)h(shell)g(v)-5 | |
c302751c | 13705 | b(ariables)31 b(in)f(the)g(same)h(w)m(a)m(y)g(as)g(the)f(Bourne)g |
091c6bc4 | 13706 | (shell.)41 b(In)30 b(some)g(cases,)i(Bash)150 1112 y(assigns)f(a)f |
c302751c | 13707 | (default)h(v)-5 b(alue)31 b(to)g(the)f(v)-5 b(ariable.)150 |
091c6bc4 | 13708 | 1260 y Ft(CDPATH)192 b Fu(A)39 b(colon-separated)i(list)e(of)g |
c302751c | 13709 | (directories)h(used)f(as)g(a)g(searc)m(h)h(path)e(for)h(the)g |
091c6bc4 | 13710 | Ft(cd)f Fu(builtin)630 1370 y(command.)150 1518 y Ft(HOME)288 |
6e51e0d0 CR |
13711 | b Fu(The)23 b(curren)m(t)h(user's)f(home)g(directory;)k(the)d(default)g |
13712 | (for)f(the)h Ft(cd)f Fu(builtin)g(command.)38 b(The)630 | |
091c6bc4 | 13713 | 1628 y(v)-5 b(alue)37 b(of)f(this)g(v)-5 b(ariable)37 |
37c41ab1 | 13714 | b(is)g(also)g(used)e(b)m(y)h(tilde)h(expansion)f(\(see)i(Section)f |
e59452c7 | 13715 | (3.5.2)h([Tilde)630 1737 y(Expansion],)30 b(page)h(25\).)150 |
091c6bc4 | 13716 | 1885 y Ft(IFS)336 b Fu(A)25 b(list)i(of)e(c)m(haracters)i(that)f |
37c41ab1 | 13717 | (separate)g(\014elds;)h(used)e(when)f(the)i(shell)f(splits)h(w)m(ords)e |
091c6bc4 | 13718 | (as)i(part)630 1995 y(of)31 b(expansion.)150 2143 y Ft(MAIL)288 |
6e51e0d0 | 13719 | b Fu(If)44 b(this)g(parameter)h(is)g(set)g(to)g(a)f(\014lename)h(or)f |
091c6bc4 | 13720 | (directory)h(name)g(and)f(the)g Ft(MAILPATH)630 2252 |
6e51e0d0 | 13721 | y Fu(v)-5 b(ariable)32 b(is)e(not)h(set,)h(Bash)f(informs)f(the)h(user) |
e05be32d | 13722 | f(of)h(the)g(arriv)-5 b(al)31 b(of)g(mail)g(in)g(the)g(sp)s(eci\014ed) |
091c6bc4 CR |
13723 | 630 2362 y(\014le)f(or)h(Maildir-format)g(directory)-8 |
13724 | b(.)150 2510 y Ft(MAILPATH)96 b Fu(A)33 b(colon-separated)i(list)f(of)f | |
37c41ab1 | 13725 | (\014lenames)h(whic)m(h)f(the)g(shell)g(p)s(erio)s(dically)h(c)m(hec)m |
091c6bc4 | 13726 | (ks)g(for)f(new)630 2619 y(mail.)60 b(Eac)m(h)37 b(list)g(en)m(try)g |
37c41ab1 | 13727 | (can)g(sp)s(ecify)f(the)h(message)h(that)f(is)g(prin)m(ted)f(when)f |
091c6bc4 | 13728 | (new)h(mail)630 2729 y(arriv)m(es)31 b(in)g(the)g(mail)g(\014le)g(b)m |
122f603c | 13729 | (y)g(separating)h(the)f(\014lename)g(from)f(the)h(message)h(with)e(a)i |
091c6bc4 | 13730 | (`)p Ft(?)p Fu('.)630 2839 y(When)g(used)f(in)h(the)g(text)i(of)e(the)g |
6e51e0d0 | 13731 | (message,)i Ft($_)e Fu(expands)f(to)i(the)f(name)g(of)h(the)f(curren)m |
091c6bc4 | 13732 | (t)630 2948 y(mail)f(\014le.)150 3096 y Ft(OPTARG)192 |
6e51e0d0 CR |
13733 | b Fu(The)30 b(v)-5 b(alue)31 b(of)f(the)h(last)g(option)g(argumen)m(t)g |
13734 | (pro)s(cessed)f(b)m(y)g(the)g Ft(getopts)f Fu(builtin.)150 | |
091c6bc4 | 13735 | 3244 y Ft(OPTIND)192 b Fu(The)30 b(index)g(of)g(the)h(last)g(option)g |
6e51e0d0 | 13736 | (argumen)m(t)g(pro)s(cessed)f(b)m(y)g(the)g Ft(getopts)f |
091c6bc4 | 13737 | Fu(builtin.)150 3392 y Ft(PATH)288 b Fu(A)32 b(colon-separated)i(list)f |
37c41ab1 | 13738 | (of)f(directories)h(in)e(whic)m(h)h(the)g(shell)g(lo)s(oks)h(for)f |
091c6bc4 | 13739 | (commands.)45 b(A)630 3502 y(zero-length)e(\(n)m(ull\))g(directory)f |
6e51e0d0 | 13740 | (name)g(in)g(the)g(v)-5 b(alue)42 b(of)g Ft(PATH)f Fu(indicates)i(the)f |
091c6bc4 | 13741 | (curren)m(t)630 3611 y(directory)-8 b(.)49 b(A)33 b(n)m(ull)f |
37c41ab1 | 13742 | (directory)i(name)e(ma)m(y)i(app)s(ear)e(as)h(t)m(w)m(o)h(adjacen)m(t)g |
091c6bc4 CR |
13743 | (colons,)g(or)f(as)g(an)630 3721 y(initial)f(or)e(trailing)h(colon.)150 |
13744 | 3869 y Ft(PS1)336 b Fu(The)35 b(primary)f(prompt)h(string.)55 | |
6e51e0d0 | 13745 | b(The)35 b(default)h(v)-5 b(alue)35 b(is)h(`)p Ft(\\s-\\v\\$)28 |
e59452c7 CR |
13746 | b Fu('.)56 b(See)36 b(Section)g(6.9)630 3979 y([Con)m(trolling)i(the)e |
13747 | (Prompt],)i(page)f(103,)i(for)d(the)h(complete)h(list)e(of)h(escap)s(e) | |
13748 | g(sequences)630 4088 y(that)31 b(are)g(expanded)e(b)s(efore)h | |
13749 | Ft(PS1)g Fu(is)g(displa)m(y)m(ed.)150 4236 y Ft(PS2)336 | |
124d67cd CR |
13750 | b Fu(The)28 b(secondary)g(prompt)g(string.)40 b(The)28 |
13751 | b(default)g(v)-5 b(alue)29 b(is)g(`)p Ft(>)h Fu('.)40 | |
091c6bc4 | 13752 | b Ft(PS2)28 b Fu(is)g(expanded)g(in)g(the)630 4346 y(same)j(w)m(a)m(y)g |
124d67cd | 13753 | (as)g Ft(PS1)e Fu(b)s(efore)h(b)s(eing)g(displa)m(y)m(ed.)150 |
091c6bc4 | 13754 | 4575 y Fs(5.2)68 b(Bash)45 b(V)-11 b(ariables)150 4734 |
6e51e0d0 | 13755 | y Fu(These)45 b(v)-5 b(ariables)46 b(are)g(set)g(or)f(used)f(b)m(y)h |
c302751c | 13756 | (Bash,)50 b(but)44 b(other)i(shells)f(do)h(not)f(normally)h(treat)g |
091c6bc4 | 13757 | (them)150 4844 y(sp)s(ecially)-8 b(.)275 4973 y(A)24 |
c302751c CR |
13758 | b(few)g(v)-5 b(ariables)24 b(used)g(b)m(y)f(Bash)i(are)f(describ)s(ed)f |
13759 | (in)h(di\013eren)m(t)g(c)m(hapters:)38 b(v)-5 b(ariables)25 | |
091c6bc4 | 13760 | b(for)f(con)m(trolling)150 5082 y(the)31 b(job)f(con)m(trol)h |
37c41ab1 | 13761 | (facilities)i(\(see)e(Section)g(7.3)h([Job)e(Con)m(trol)h(V)-8 |
fffe80d4 | 13762 | b(ariables],)32 b(page)g(115\).)150 5230 y Ft(_)432 b |
d37a4722 CR |
13763 | Fu(\($)p 716 5230 28 4 v 41 w(,)34 b(an)g(underscore.\))49 |
13764 | b(A)m(t)35 b(shell)f(startup,)g(set)g(to)g(the)g(pathname)f(used)g(to)h | |
13765 | (in)m(v)m(ok)m(e)i(the)630 5340 y(shell)e(or)g(shell)h(script)f(b)s | |
13766 | (eing)f(executed)j(as)e(passed)g(in)f(the)i(en)m(vironmen)m(t)f(or)g | |
13767 | (argumen)m(t)p eop end | |
e59452c7 CR |
13768 | %%Page: 78 84 |
13769 | TeXDict begin 78 83 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13770 | b(Shell)30 b(V)-8 b(ariables)2459 b(78)630 299 y(list.)55 | |
d37a4722 CR |
13771 | b(Subsequen)m(tly)-8 b(,)35 b(expands)f(to)i(the)f(last)g(argumen)m(t)h |
13772 | (to)f(the)g(previous)f(simple)h(com-)630 408 y(mand)21 | |
13773 | b(executed)i(in)e(the)i(foreground,)g(after)f(expansion.)38 | |
13774 | b(Also)22 b(set)h(to)f(the)g(full)g(pathname)630 518 | |
13775 | y(used)h(to)i(in)m(v)m(ok)m(e)h(eac)m(h)g(command)e(executed)h(and)f | |
13776 | (placed)g(in)g(the)g(en)m(vironmen)m(t)h(exp)s(orted)630 | |
13777 | 628 y(to)33 b(that)g(command.)45 b(When)32 b(c)m(hec)m(king)i(mail,)g | |
13778 | (this)e(parameter)g(holds)g(the)g(name)g(of)h(the)630 | |
13779 | 737 y(mail)e(\014le.)150 920 y Ft(BASH)288 b Fu(The)30 | |
13780 | b(full)g(pathname)g(used)g(to)h(execute)h(the)e(curren)m(t)g(instance)h | |
13781 | (of)g(Bash.)150 1103 y Ft(BASHOPTS)96 b Fu(A)31 b(colon-separated)h | |
13782 | (list)f(of)g(enabled)f(shell)h(options.)41 b(Eac)m(h)31 | |
13783 | b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 b(alid)630 | |
13784 | 1212 y(argumen)m(t)37 b(for)g(the)g Ft(-s)f Fu(option)i(to)f(the)g | |
13785 | Ft(shopt)f Fu(builtin)g(command)h(\(see)g(Section)h(4.3.2)630 | |
e59452c7 | 13786 | 1322 y([The)e(Shopt)g(Builtin],)i(page)f(70\).)60 b(The)36 |
091c6bc4 CR |
13787 | b(options)h(app)s(earing)f(in)g Ft(BASHOPTS)e Fu(are)i(those)630 |
13788 | 1431 y(rep)s(orted)e(as)h(`)p Ft(on)p Fu(')f(b)m(y)h(`)p | |
13789 | Ft(shopt)p Fu('.)53 b(If)34 b(this)g(v)-5 b(ariable)36 | |
13790 | b(is)f(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)630 | |
13791 | 1541 y(starts)25 b(up,)f(eac)m(h)i(shell)e(option)h(in)e(the)i(list)g | |
8f714a7c | 13792 | (will)f(b)s(e)g(enabled)g(b)s(efore)g(reading)g(an)m(y)g(startup)630 |
091c6bc4 CR |
13793 | 1650 y(\014les.)41 b(This)29 b(v)-5 b(ariable)31 b(is)g(readonly)-8 |
13794 | b(.)150 1833 y Ft(BASHPID)144 b Fu(Expands)35 b(to)i(the)f(pro)s(cess)f | |
e05be32d | 13795 | (ID)i(of)f(the)g(curren)m(t)g(Bash)g(pro)s(cess.)58 b(This)35 |
091c6bc4 | 13796 | b(di\013ers)h(from)g Ft($$)630 1943 y Fu(under)31 b(certain)j |
8f714a7c | 13797 | (circumstances,)h(suc)m(h)e(as)g(subshells)f(that)i(do)f(not)g(require) |
091c6bc4 | 13798 | g(Bash)g(to)h(b)s(e)630 2052 y(re-initialized.)57 b(Assignmen)m(ts)35 |
7e92fb35 | 13799 | b(to)h Ft(BASHPID)d Fu(ha)m(v)m(e)j(no)f(e\013ect.)56 |
091c6bc4 | 13800 | b(If)34 b Ft(BASHPID)f Fu(is)i(unset,)h(it)630 2162 y(loses)31 |
7e92fb35 | 13801 | b(its)g(sp)s(ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)g |
091c6bc4 CR |
13802 | (subsequen)m(tly)f(reset.)150 2345 y Ft(BASH_ALIASES)630 |
13803 | 2454 y Fu(An)40 b(asso)s(ciativ)m(e)j(arra)m(y)d(v)-5 | |
7e92fb35 | 13804 | b(ariable)41 b(whose)f(mem)m(b)s(ers)f(corresp)s(ond)g(to)i(the)f(in)m |
091c6bc4 | 13805 | (ternal)h(list)630 2564 y(of)c(aliases)h(as)f(main)m(tained)g(b)m(y)g |
7e92fb35 | 13806 | (the)g Ft(alias)e Fu(builtin.)59 b(\(see)37 b(Section)h(4.1)f([Bourne)g |
e59452c7 | 13807 | (Shell)630 2673 y(Builtins],)31 b(page)g(47\).)42 b(Elemen)m(ts)31 |
7e92fb35 | 13808 | b(added)e(to)i(this)f(arra)m(y)h(app)s(ear)f(in)g(the)g(alias)h(list;)h |
091c6bc4 | 13809 | (ho)m(w-)630 2783 y(ev)m(er,)k(unsetting)f(arra)m(y)g(elemen)m(ts)g |
7e92fb35 | 13810 | (curren)m(tly)g(do)s(es)f(not)g(cause)h(aliases)h(to)f(b)s(e)f(remo)m |
091c6bc4 | 13811 | (v)m(ed)630 2892 y(from)25 b(the)h(alias)h(list.)40 b(If)25 |
7e92fb35 | 13812 | b Ft(BASH_ALIASES)d Fu(is)k(unset,)g(it)g(loses)h(its)f(sp)s(ecial)g |
091c6bc4 CR |
13813 | (prop)s(erties,)g(ev)m(en)630 3002 y(if)k(it)h(is)g(subsequen)m(tly)f |
13814 | (reset.)150 3185 y Ft(BASH_ARGC)630 3294 y Fu(An)39 b(arra)m(y)g(v)-5 | |
7e92fb35 | 13815 | b(ariable)40 b(whose)f(v)-5 b(alues)39 b(are)h(the)f(n)m(um)m(b)s(er)f |
091c6bc4 | 13816 | (of)h(parameters)g(in)g(eac)m(h)h(frame)630 3404 y(of)i(the)g(curren)m |
7e92fb35 | 13817 | (t)g(bash)f(execution)i(call)g(stac)m(k.)76 b(The)42 |
091c6bc4 | 13818 | b(n)m(um)m(b)s(er)e(of)i(parameters)g(to)h(the)630 3513 |
7e92fb35 | 13819 | y(curren)m(t)38 b(subroutine)f(\(shell)i(function)e(or)i(script)f |
037a8b7f | 13820 | (executed)h(with)e Ft(.)h Fu(or)g Ft(source)p Fu(\))f(is)h(at)630 |
091c6bc4 | 13821 | 3623 y(the)27 b(top)g(of)g(the)g(stac)m(k.)41 b(When)27 |
037a8b7f | 13822 | b(a)g(subroutine)f(is)h(executed,)i(the)e(n)m(um)m(b)s(er)f(of)h |
091c6bc4 | 13823 | (parameters)630 3733 y(passed)44 b(is)h(pushed)e(on)m(to)j |
037a8b7f | 13824 | Ft(BASH_ARGC)p Fu(.)81 b(The)44 b(shell)h(sets)g Ft(BASH_ARGC)e |
091c6bc4 | 13825 | Fu(only)i(when)e(in)630 3842 y(extended)34 b(debugging)f(mo)s(de)g |
e59452c7 | 13826 | (\(see)i(Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)i(page)g(70,)g(for) |
091c6bc4 | 13827 | 630 3952 y(a)e(description)g(of)f(the)h Ft(extdebug)d |
a2851804 | 13828 | Fu(option)j(to)h(the)e Ft(shopt)g Fu(builtin\).)47 b(Setting)33 |
091c6bc4 | 13829 | b Ft(extdebug)630 4061 y Fu(after)c(the)g(shell)g(has)g(started)g(to)g |
8d125d8b | 13830 | (execute)i(a)e(script,)g(or)g(referencing)g(this)f(v)-5 |
091c6bc4 | 13831 | b(ariable)30 b(when)630 4171 y Ft(extdebug)e Fu(is)j(not)f(set,)h(ma)m |
8d125d8b | 13832 | (y)g(result)g(in)f(inconsisten)m(t)h(v)-5 b(alues.)150 |
091c6bc4 | 13833 | 4354 y Ft(BASH_ARGV)630 4463 y Fu(An)24 b(arra)m(y)g(v)-5 |
8d125d8b | 13834 | b(ariable)25 b(con)m(taining)h(all)f(of)f(the)h(parameters)f(in)g(the)g |
091c6bc4 | 13835 | (curren)m(t)g(bash)g(execution)630 4573 y(call)35 b(stac)m(k.)53 |
8d125d8b | 13836 | b(The)34 b(\014nal)g(parameter)g(of)g(the)g(last)h(subroutine)e(call)i |
091c6bc4 | 13837 | (is)f(at)h(the)f(top)h(of)f(the)630 4682 y(stac)m(k;)28 |
8d125d8b | 13838 | b(the)c(\014rst)f(parameter)i(of)f(the)g(initial)i(call)f(is)f(at)h |
091c6bc4 | 13839 | (the)f(b)s(ottom.)39 b(When)24 b(a)g(subroutine)630 4792 |
8d125d8b | 13840 | y(is)40 b(executed,)j(the)d(parameters)h(supplied)d(are)i(pushed)f(on)m |
091c6bc4 | 13841 | (to)i Ft(BASH_ARGV)p Fu(.)66 b(The)40 b(shell)630 4902 |
8d125d8b | 13842 | y(sets)28 b Ft(BASH_ARGV)e Fu(only)i(when)f(in)h(extended)g(debugging)g |
091c6bc4 | 13843 | (mo)s(de)g(\(see)h(Section)f(4.3.2)i([The)630 5011 y(Shopt)g(Builtin],) |
e59452c7 | 13844 | h(page)g(70,)g(for)g(a)f(description)h(of)f(the)h Ft(extdebug)d |
091c6bc4 | 13845 | Fu(option)j(to)g(the)f Ft(shopt)630 5121 y Fu(builtin\).)64 |
8d125d8b | 13846 | b(Setting)38 b Ft(extdebug)e Fu(after)j(the)f(shell)g(has)g(started)g |
091c6bc4 | 13847 | (to)h(execute)g(a)g(script,)h(or)630 5230 y(referencing)35 |
8d125d8b | 13848 | b(this)f(v)-5 b(ariable)35 b(when)e Ft(extdebug)f Fu(is)j(not)f(set,)j |
091c6bc4 CR |
13849 | (ma)m(y)e(result)f(in)g(inconsisten)m(t)630 5340 y(v)-5 |
13850 | b(alues.)p eop end | |
e59452c7 CR |
13851 | %%Page: 79 85 |
13852 | TeXDict begin 79 84 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13853 | b(Shell)30 b(V)-8 b(ariables)2459 b(79)150 299 y Ft(BASH_ARGV0)630 | |
091c6bc4 CR |
13854 | 408 y Fu(When)31 b(referenced,)g(this)g(v)-5 b(ariable)32 |
13855 | b(expands)e(to)h(the)h(name)f(of)g(the)g(shell)g(or)g(shell)g(script) | |
13856 | 630 518 y(\(iden)m(tical)42 b(to)e Ft($0)p Fu(;)j(See)d(Section)g | |
e59452c7 | 13857 | (3.4.2)i([Sp)s(ecial)e(P)m(arameters],)j(page)d(23,)j(for)c(the)h(de-) |
091c6bc4 CR |
13858 | 630 628 y(scription)32 b(of)g(sp)s(ecial)g(parameter)g(0\).)45 |
13859 | b(Assignmen)m(t)32 b(to)h Ft(BASH_ARGV0)c Fu(causes)j(the)f(v)-5 | |
13860 | b(alue)630 737 y(assigned)34 b(to)h(also)g(b)s(e)e(assigned)h(to)g | |
13861 | Ft($0)p Fu(.)51 b(If)33 b Ft(BASH_ARGV0)f Fu(is)h(unset,)i(it)f(loses)h | |
13862 | (its)f(sp)s(ecial)630 847 y(prop)s(erties,)c(ev)m(en)h(if)f(it)h(is)g | |
d37a4722 CR |
13863 | (subsequen)m(tly)f(reset.)150 1048 y Ft(BASH_CMDS)630 |
13864 | 1157 y Fu(An)k(asso)s(ciativ)m(e)i(arra)m(y)f(v)-5 b(ariable)35 | |
091c6bc4 | 13865 | b(whose)f(mem)m(b)s(ers)f(corresp)s(ond)g(to)i(the)f(in)m(ternal)h |
d37a4722 | 13866 | (hash)630 1267 y(table)c(of)g(commands)f(as)g(main)m(tained)h(b)m(y)g |
091c6bc4 | 13867 | (the)f Ft(hash)f Fu(builtin)h(\(see)h(Section)g(4.1)h([Bourne)630 |
e59452c7 | 13868 | 1377 y(Shell)42 b(Builtins],)k(page)d(47\).)77 b(Elemen)m(ts)43 |
8d125d8b | 13869 | b(added)e(to)i(this)f(arra)m(y)h(app)s(ear)f(in)f(the)i(hash)630 |
d37a4722 | 13870 | 1486 y(table;)k(ho)m(w)m(ev)m(er,)e(unsetting)c(arra)m(y)g(elemen)m(ts) |
091c6bc4 | 13871 | i(curren)m(tly)d(do)s(es)h(not)g(cause)g(command)630 |
d37a4722 | 13872 | 1596 y(names)36 b(to)g(b)s(e)f(remo)m(v)m(ed)i(from)e(the)h(hash)f |
091c6bc4 | 13873 | (table.)58 b(If)36 b Ft(BASH_CMDS)d Fu(is)j(unset,)h(it)f(loses)h(its) |
d37a4722 CR |
13874 | 630 1705 y(sp)s(ecial)31 b(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)g |
13875 | (subsequen)m(tly)f(reset.)150 1906 y Ft(BASH_COMMAND)630 | |
13876 | 2016 y Fu(The)39 b(command)h(curren)m(tly)g(b)s(eing)f(executed)i(or)e | |
8d125d8b | 13877 | (ab)s(out)h(to)g(b)s(e)f(executed,)44 b(unless)39 b(the)630 |
d37a4722 | 13878 | 2125 y(shell)g(is)g(executing)g(a)g(command)g(as)g(the)f(result)h(of)g |
8d125d8b | 13879 | (a)g(trap,)i(in)d(whic)m(h)g(case)i(it)f(is)g(the)630 |
d37a4722 | 13880 | 2235 y(command)30 b(executing)i(at)g(the)f(time)g(of)g(the)g(trap.)41 |
e2169ae9 | 13881 | b(If)30 b Ft(BASH_COMMAND)e Fu(is)i(unset,)h(it)g(loses)630 |
d37a4722 CR |
13882 | 2345 y(its)g(sp)s(ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)f |
13883 | (subsequen)m(tly)g(reset.)150 2545 y Ft(BASH_COMPAT)630 | |
13884 | 2655 y Fu(The)i(v)-5 b(alue)33 b(is)g(used)f(to)h(set)g(the)g(shell's)g | |
13885 | (compatibilit)m(y)i(lev)m(el.)49 b(See)33 b(Section)h(6.12)g([Shell)630 | |
fffe80d4 | 13886 | 2765 y(Compatibilit)m(y)j(Mo)s(de],)h(page)e(109,)i(for)e(a)g |
d37a4722 CR |
13887 | (description)g(of)f(the)h(v)-5 b(arious)36 b(compatibilit)m(y)630 |
13888 | 2874 y(lev)m(els)g(and)f(their)g(e\013ects.)55 b(The)34 | |
13889 | b(v)-5 b(alue)36 b(ma)m(y)f(b)s(e)f(a)i(decimal)f(n)m(um)m(b)s(er)f | |
13890 | (\(e.g.,)k(4.2\))e(or)f(an)630 2984 y(in)m(teger)44 b(\(e.g.,)j(42\))d | |
13891 | (corresp)s(onding)d(to)i(the)g(desired)e(compatibilit)m(y)k(lev)m(el.) | |
13892 | 78 b(If)42 b Ft(BASH_)630 3093 y(COMPAT)28 b Fu(is)j(unset)e(or)h(set)h | |
13893 | (to)g(the)f(empt)m(y)h(string,)f(the)h(compatibilit)m(y)h(lev)m(el)g | |
13894 | (is)e(set)h(to)g(the)630 3203 y(default)39 b(for)g(the)g(curren)m(t)g | |
13895 | (v)m(ersion.)67 b(If)38 b Ft(BASH_COMPAT)e Fu(is)j(set)h(to)f(a)h(v)-5 | |
13896 | b(alue)39 b(that)h(is)f(not)630 3313 y(one)31 b(of)f(the)h(v)-5 | |
13897 | b(alid)31 b(compatibilit)m(y)i(lev)m(els,)f(the)f(shell)f(prin)m(ts)g | |
13898 | (an)h(error)f(message)i(and)e(sets)630 3422 y(the)i(compatibilit)m(y)j | |
13899 | (lev)m(el)e(to)g(the)g(default)f(for)g(the)g(curren)m(t)g(v)m(ersion.) | |
13900 | 47 b(The)31 b(v)-5 b(alid)33 b(v)-5 b(alues)630 3532 | |
13901 | y(corresp)s(ond)31 b(to)i(the)g(compatibilit)m(y)i(lev)m(els)f(describ) | |
13902 | s(ed)d(b)s(elo)m(w)i(\(see)g(Section)h(6.12)g([Shell)630 | |
fffe80d4 | 13903 | 3641 y(Compatibilit)m(y)d(Mo)s(de],)f(page)g(109\).)42 |
d37a4722 CR |
13904 | b(F)-8 b(or)30 b(example,)h(4.2)f(and)f(42)h(are)g(v)-5 |
13905 | b(alid)30 b(v)-5 b(alues)29 b(that)630 3751 y(corresp)s(ond)d(to)i(the) | |
13906 | f Ft(compat42)e(shopt)g Fu(option)j(and)e(set)i(the)f(compatibilit)m(y) | |
13907 | i(lev)m(el)g(to)f(42.)630 3861 y(The)i(curren)m(t)g(v)m(ersion)h(is)f | |
13908 | (also)i(a)e(v)-5 b(alid)31 b(v)-5 b(alue.)150 4061 y | |
13909 | Ft(BASH_ENV)96 b Fu(If)28 b(this)g(v)-5 b(ariable)30 | |
967625cd | 13910 | b(is)e(set)h(when)f(Bash)g(is)h(in)m(v)m(ok)m(ed)h(to)f(execute)h(a)e |
d37a4722 | 13911 | (shell)h(script,)g(its)g(v)-5 b(alue)29 b(is)630 4171 |
967625cd | 13912 | y(expanded)k(and)h(used)g(as)g(the)h(name)f(of)g(a)h(startup)f(\014le)g |
d37a4722 | 13913 | (to)h(read)f(b)s(efore)g(executing)i(the)630 4281 y(script.)41 |
e59452c7 | 13914 | b(See)30 b(Section)h(6.2)h([Bash)f(Startup)e(Files],)j(page)f(92.)150 |
d37a4722 | 13915 | 4482 y Ft(BASH_EXECUTION_STRING)630 4591 y Fu(The)f(command)g(argumen)m |
967625cd | 13916 | (t)h(to)g(the)g Ft(-c)e Fu(in)m(v)m(o)s(cation)k(option.)150 |
e59452c7 CR |
13917 | 4792 y Ft(BASH_LINENO)630 4902 y Fu(An)38 b(arra)m(y)g(v)-5 |
13918 | b(ariable)39 b(whose)f(mem)m(b)s(ers)f(are)i(the)f(line)h(n)m(um)m(b)s | |
13919 | (ers)d(in)i(source)g(\014les)g(where)630 5011 y(eac)m(h)h(corresp)s | |
13920 | (onding)e(mem)m(b)s(er)g(of)h Ft(FUNCNAME)d Fu(w)m(as)k(in)m(v)m(ok)m | |
13921 | (ed.)64 b Ft(${BASH_LINENO[$i]})630 5121 y Fu(is)74 b(the)g(line)h(n)m | |
13922 | (um)m(b)s(er)e(in)g(the)i(source)f(\014le)g(\()p Ft | |
13923 | (${BASH_SOURCE[$i+1]})p Fu(\))69 b(where)630 5230 y Ft(${FUNCNAME[$i]}) | |
13924 | 32 b Fu(w)m(as)37 b(called)g(\(or)g Ft(${BASH_LINENO[$i-1]})31 | |
13925 | b Fu(if)36 b(referenced)g(within)630 5340 y(another)31 | |
13926 | b(shell)f(function\).)41 b(Use)31 b Ft(LINENO)d Fu(to)j(obtain)g(the)g | |
13927 | (curren)m(t)f(line)h(n)m(um)m(b)s(er.)p eop end | |
13928 | %%Page: 80 86 | |
13929 | TeXDict begin 80 85 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13930 | b(Shell)30 b(V)-8 b(ariables)2459 b(80)150 299 y Ft | |
d37a4722 CR |
13931 | (BASH_LOADABLES_PATH)630 408 y Fu(A)39 b(colon-separated)i(list)f(of)f |
13932 | (directories)h(in)f(whic)m(h)g(the)g(shell)h(lo)s(oks)f(for)g | |
13933 | (dynamically)630 518 y(loadable)32 b(builtins)d(sp)s(eci\014ed)h(b)m(y) | |
13934 | g(the)h Ft(enable)e Fu(command.)150 673 y Ft(BASH_REMATCH)630 | |
13935 | 783 y Fu(An)43 b(arra)m(y)i(v)-5 b(ariable)44 b(whose)g(mem)m(b)s(ers)f | |
091c6bc4 | 13936 | (are)h(assigned)g(b)m(y)f(the)h(`)p Ft(=~)p Fu(')g(binary)f(op)s |
d37a4722 CR |
13937 | (erator)630 892 y(to)37 b(the)f Ft([[)g Fu(conditional)i(command)e |
13938 | (\(see)h(Section)g(3.2.5.2)i([Conditional)e(Constructs],)630 | |
e59452c7 | 13939 | 1002 y(page)e(12\).)52 b(The)33 b(elemen)m(t)j(with)d(index)g(0)i(is)f |
091c6bc4 | 13940 | (the)g(p)s(ortion)f(of)h(the)g(string)g(matc)m(hing)h(the)630 |
d37a4722 | 13941 | 1112 y(en)m(tire)29 b(regular)f(expression.)40 b(The)27 |
091c6bc4 | 13942 | b(elemen)m(t)j(with)d(index)h Fr(n)f Fu(is)h(the)g(p)s(ortion)g(of)g |
d37a4722 CR |
13943 | (the)g(string)630 1221 y(matc)m(hing)j(the)g Fr(n)p Fu(th)f(paren)m |
13944 | (thesized)h(sub)s(expression.)150 1377 y Ft(BASH_SOURCE)630 | |
13945 | 1486 y Fu(An)40 b(arra)m(y)h(v)-5 b(ariable)41 b(whose)f(mem)m(b)s(ers) | |
091c6bc4 | 13946 | g(are)h(the)g(source)f(\014lenames)h(where)f(the)g(corre-)630 |
d37a4722 | 13947 | 1596 y(sp)s(onding)27 b(shell)i(function)f(names)g(in)g(the)h |
8d125d8b | 13948 | Ft(FUNCNAME)d Fu(arra)m(y)j(v)-5 b(ariable)30 b(are)f(de\014ned.)38 |
d37a4722 | 13949 | b(The)630 1705 y(shell)26 b(function)g Ft(${FUNCNAME[$i]})c |
8d125d8b | 13950 | Fu(is)k(de\014ned)f(in)g(the)h(\014le)h Ft(${BASH_SOURCE[$i]})21 |
d37a4722 CR |
13951 | b Fu(and)630 1815 y(called)32 b(from)d Ft(${BASH_SOURCE[$i+1]})150 |
13952 | 1970 y(BASH_SUBSHELL)630 2080 y Fu(Incremen)m(ted)24 | |
091c6bc4 | 13953 | b(b)m(y)f(one)h(within)f(eac)m(h)i(subshell)d(or)i(subshell)e(en)m |
d37a4722 | 13954 | (vironmen)m(t)i(when)f(the)h(shell)630 2189 y(b)s(egins)j(executing)i |
091c6bc4 CR |
13955 | (in)e(that)h(en)m(vironmen)m(t.)41 b(The)27 b(initial)i(v)-5 |
13956 | b(alue)28 b(is)f(0.)40 b(If)28 b Ft(BASH_SUBSHELL)630 | |
d37a4722 | 13957 | 2299 y Fu(is)i(unset,)h(it)g(loses)g(its)f(sp)s(ecial)h(prop)s(erties,) |
091c6bc4 | 13958 | f(ev)m(en)h(if)g(it)g(is)f(subsequen)m(tly)g(reset.)150 |
d37a4722 | 13959 | 2454 y Ft(BASH_VERSINFO)630 2564 y Fu(A)36 b(readonly)g(arra)m(y)g(v)-5 |
e59452c7 | 13960 | b(ariable)37 b(\(see)f(Section)h(6.7)g([Arra)m(ys],)h(page)e(99\))h |
d37a4722 | 13961 | (whose)f(mem)m(b)s(ers)630 2673 y(hold)c(v)m(ersion)h(information)f |
091c6bc4 | 13962 | (for)g(this)g(instance)h(of)g(Bash.)46 b(The)32 b(v)-5 |
d37a4722 CR |
13963 | b(alues)32 b(assigned)h(to)g(the)630 2783 y(arra)m(y)e(mem)m(b)s(ers)e |
13964 | (are)i(as)g(follo)m(ws:)630 2938 y Ft(BASH_VERSINFO[0])1110 | |
13965 | 3048 y Fu(The)f(ma)5 b(jor)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
13966 | Fr(release)5 b Fu(\).)630 3203 y Ft(BASH_VERSINFO[1])1110 | |
13967 | 3313 y Fu(The)30 b(minor)g(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
13968 | Fr(v)m(ersion)p Fu(\).)630 3468 y Ft(BASH_VERSINFO[2])1110 | |
13969 | 3577 y Fu(The)f(patc)m(h)h(lev)m(el.)630 3733 y Ft(BASH_VERSINFO[3]) | |
13970 | 1110 3842 y Fu(The)f(build)f(v)m(ersion.)630 3998 y Ft | |
13971 | (BASH_VERSINFO[4])1110 4107 y Fu(The)h(release)i(status)e(\(e.g.,)j | |
e59452c7 CR |
13972 | Ft(beta1)p Fu(\).)630 4262 y Ft(BASH_VERSINFO[5])1110 |
13973 | 4372 y Fu(The)d(v)-5 b(alue)31 b(of)f Ft(MACHTYPE)p Fu(.)150 | |
13974 | 4527 y Ft(BASH_VERSION)630 4637 y Fu(The)g(v)m(ersion)h(n)m(um)m(b)s | |
13975 | (er)e(of)h(the)h(curren)m(t)f(instance)h(of)g(Bash.)150 | |
d37a4722 | 13976 | 4792 y Ft(BASH_XTRACEFD)630 4902 y Fu(If)f(set)h(to)h(an)e(in)m(teger)i |
8f714a7c | 13977 | (corresp)s(onding)e(to)h(a)g(v)-5 b(alid)31 b(\014le)g(descriptor,)g |
d37a4722 | 13978 | (Bash)g(will)g(write)g(the)630 5011 y(trace)37 b(output)f(generated)h |
6e51e0d0 | 13979 | (when)f(`)p Ft(set)29 b(-x)p Fu(')36 b(is)g(enabled)h(to)g(that)f |
d37a4722 | 13980 | (\014le)h(descriptor.)58 b(This)630 5121 y(allo)m(ws)29 |
8f714a7c | 13981 | b(tracing)h(output)d(to)i(b)s(e)f(separated)g(from)g(diagnostic)h(and)f |
d37a4722 | 13982 | (error)f(messages.)41 b(The)630 5230 y(\014le)31 b(descriptor)f(is)h |
6e51e0d0 | 13983 | (closed)g(when)f Ft(BASH_XTRACEFD)d Fu(is)k(unset)f(or)g(assigned)h(a)g |
d37a4722 | 13984 | (new)f(v)-5 b(alue.)630 5340 y(Unsetting)45 b Ft(BASH_XTRACEFD)40 |
6e51e0d0 | 13985 | b Fu(or)k(assigning)g(it)g(the)g(empt)m(y)h(string)e(causes)i(the)f |
d37a4722 | 13986 | (trace)p eop end |
e59452c7 CR |
13987 | %%Page: 81 87 |
13988 | TeXDict begin 81 86 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
13989 | b(Shell)30 b(V)-8 b(ariables)2459 b(81)630 299 y(output)33 | |
d37a4722 CR |
13990 | b(to)i(b)s(e)d(sen)m(t)j(to)f(the)g(standard)e(error.)50 |
13991 | b(Note)35 b(that)g(setting)f Ft(BASH_XTRACEFD)c Fu(to)630 | |
13992 | 408 y(2)39 b(\(the)h(standard)e(error)g(\014le)h(descriptor\))h(and)e | |
13993 | (then)h(unsetting)g(it)g(will)g(result)g(in)g(the)630 | |
13994 | 518 y(standard)30 b(error)g(b)s(eing)f(closed.)150 664 | |
13995 | y Ft(CHILD_MAX)630 774 y Fu(Set)35 b(the)h(n)m(um)m(b)s(er)e(of)h | |
13996 | (exited)h(c)m(hild)g(status)f(v)-5 b(alues)36 b(for)f(the)g(shell)g(to) | |
13997 | h(remem)m(b)s(er.)55 b(Bash)630 883 y(will)37 b(not)g(allo)m(w)i(this)e | |
13998 | (v)-5 b(alue)37 b(to)h(b)s(e)e(decreased)i(b)s(elo)m(w)f(a)g | |
13999 | Fm(posix)p Fu(-mandated)f(minim)m(um,)630 993 y(and)30 | |
091c6bc4 CR |
14000 | b(there)g(is)g(a)h(maxim)m(um)f(v)-5 b(alue)30 b(\(curren)m(tly)h |
14001 | (8192\))h(that)f(this)f(ma)m(y)g(not)h(exceed.)41 b(The)630 | |
d37a4722 CR |
14002 | 1103 y(minim)m(um)30 b(v)-5 b(alue)30 b(is)h(system-dep)s(enden)m(t.) |
14003 | 150 1249 y Ft(COLUMNS)144 b Fu(Used)32 b(b)m(y)f(the)h | |
14004 | Ft(select)e Fu(command)h(to)i(determine)f(the)f(terminal)i(width)d | |
14005 | (when)h(prin)m(ting)630 1358 y(selection)39 b(lists.)63 | |
14006 | b(Automatically)41 b(set)d(if)f(the)h Ft(checkwinsize)d | |
14007 | Fu(option)j(is)f(enabled)h(\(see)630 1468 y(Section)44 | |
e59452c7 | 14008 | b(4.3.2)h([The)e(Shopt)g(Builtin],)k(page)d(70\),)k(or)43 |
d37a4722 CR |
14009 | b(in)g(an)g(in)m(teractiv)m(e)j(shell)e(up)s(on)630 1577 |
14010 | y(receipt)31 b(of)g(a)g Ft(SIGWINCH)p Fu(.)150 1724 y | |
14011 | Ft(COMP_CWORD)630 1833 y Fu(An)38 b(index)g(in)m(to)h | |
8d125d8b | 14012 | Ft(${COMP_WORDS})c Fu(of)k(the)g(w)m(ord)f(con)m(taining)i(the)e |
d37a4722 | 14013 | (curren)m(t)g(cursor)g(p)s(o-)630 1943 y(sition.)72 b(This)40 |
8d125d8b CR |
14014 | b(v)-5 b(ariable)41 b(is)f(a)m(v)-5 b(ailable)43 b(only)e(in)f(shell)h |
14015 | (functions)f(in)m(v)m(ok)m(ed)i(b)m(y)e(the)h(pro-)630 | |
d37a4722 | 14016 | 2052 y(grammable)36 b(completion)g(facilities)i(\(see)e(Section)g(8.6)g |
fffe80d4 | 14017 | ([Programmable)g(Completion],)630 2162 y(page)31 b(142\).)150 |
d37a4722 | 14018 | 2308 y Ft(COMP_LINE)630 2418 y Fu(The)38 b(curren)m(t)h(command)f |
8d125d8b | 14019 | (line.)66 b(This)37 b(v)-5 b(ariable)40 b(is)f(a)m(v)-5 |
d37a4722 | 14020 | b(ailable)41 b(only)d(in)h(shell)f(functions)630 2527 |
8d125d8b | 14021 | y(and)25 b(external)h(commands)f(in)m(v)m(ok)m(ed)h(b)m(y)f(the)h |
d37a4722 | 14022 | (programmable)f(completion)i(facilities)g(\(see)630 2637 |
fffe80d4 | 14023 | y(Section)k(8.6)h([Programmable)f(Completion],)g(page)g(142\).)150 |
d37a4722 | 14024 | 2783 y Ft(COMP_POINT)630 2892 y Fu(The)25 b(index)g(of)h(the)g(curren)m |
7e92fb35 | 14025 | (t)f(cursor)g(p)s(osition)h(relativ)m(e)i(to)e(the)g(b)s(eginning)f(of) |
d37a4722 | 14026 | g(the)h(curren)m(t)630 3002 y(command.)40 b(If)27 b(the)h(curren)m(t)g |
7e92fb35 | 14027 | (cursor)g(p)s(osition)g(is)g(at)g(the)g(end)g(of)g(the)g(curren)m(t)g |
d37a4722 | 14028 | (command,)630 3112 y(the)i(v)-5 b(alue)30 b(of)g(this)g(v)-5 |
7e92fb35 CR |
14029 | b(ariable)31 b(is)f(equal)g(to)h Ft(${#COMP_LINE})p Fu(.)37 |
14030 | b(This)29 b(v)-5 b(ariable)31 b(is)f(a)m(v)-5 b(ailable)630 | |
d37a4722 CR |
14031 | 3221 y(only)36 b(in)f(shell)h(functions)f(and)g(external)h(commands)g |
14032 | (in)m(v)m(ok)m(ed)h(b)m(y)e(the)h(programmable)630 3331 | |
7e92fb35 | 14033 | y(completion)c(facilities)g(\(see)g(Section)f(8.6)g([Programmable)g |
fffe80d4 | 14034 | (Completion],)h(page)f(142\).)150 3477 y Ft(COMP_TYPE)630 |
d37a4722 | 14035 | 3587 y Fu(Set)c(to)h(an)f(in)m(teger)h(v)-5 b(alue)28 |
7e92fb35 | 14036 | b(corresp)s(onding)e(to)h(the)h(t)m(yp)s(e)f(of)g(completion)h |
e59452c7 CR |
14037 | (attempted)g(that)630 3696 y(caused)j(a)g(completion)h(function)e(to)h |
14038 | (b)s(e)f(called:)43 b Ft(TAB)p Fu(,)30 b(for)g(normal)h(completion,)h | |
14039 | (`)p Ft(?)p Fu(',)f(for)630 3806 y(listing)k(completions)h(after)f | |
14040 | (successiv)m(e)g(tabs,)h(`)p Ft(!)p Fu(',)g(for)e(listing)h(alternativ) | |
14041 | m(es)i(on)d(partial)630 3915 y(w)m(ord)22 b(completion,)k(`)p | |
14042 | Ft(@)p Fu(',)f(to)e(list)g(completions)h(if)f(the)g(w)m(ord)f(is)h(not) | |
14043 | g(unmo)s(di\014ed,)f(or)h(`)p Ft(\045)p Fu(',)h(for)630 | |
14044 | 4025 y(men)m(u)i(completion.)41 b(This)25 b(v)-5 b(ariable)27 | |
14045 | b(is)g(a)m(v)-5 b(ailable)28 b(only)f(in)f(shell)g(functions)g(and)g | |
14046 | (external)630 4134 y(commands)32 b(in)m(v)m(ok)m(ed)i(b)m(y)e(the)g | |
14047 | (programmable)h(completion)g(facilities)i(\(see)e(Section)g(8.6)630 | |
fffe80d4 | 14048 | 4244 y([Programmable)e(Completion],)h(page)f(142\).)150 |
d37a4722 | 14049 | 4390 y Ft(COMP_KEY)96 b Fu(The)29 b(k)m(ey)i(\(or)g(\014nal)e(k)m(ey)i |
d3ad40de | 14050 | (of)f(a)g(k)m(ey)h(sequence\))g(used)e(to)i(in)m(v)m(ok)m(e)h(the)e |
d37a4722 CR |
14051 | (curren)m(t)g(completion)630 4500 y(function.)150 4646 |
14052 | y Ft(COMP_WORDBREAKS)630 4756 y Fu(The)f(set)i(of)e(c)m(haracters)j | |
d3ad40de | 14053 | (that)e(the)g(Readline)g(library)g(treats)g(as)g(w)m(ord)g(separators)g |
d37a4722 | 14054 | (when)630 4865 y(p)s(erforming)i(w)m(ord)h(completion.)51 |
6e51e0d0 | 14055 | b(If)33 b Ft(COMP_WORDBREAKS)c Fu(is)34 b(unset,)g(it)f(loses)i(its)e |
d37a4722 CR |
14056 | (sp)s(ecial)630 4975 y(prop)s(erties,)d(ev)m(en)h(if)f(it)h(is)g |
14057 | (subsequen)m(tly)f(reset.)150 5121 y Ft(COMP_WORDS)630 | |
14058 | 5230 y Fu(An)36 b(arra)m(y)g(v)-5 b(ariable)37 b(consisting)g(of)f(the) | |
d3ad40de | 14059 | g(individual)f(w)m(ords)h(in)f(the)h(curren)m(t)g(command)630 |
d37a4722 CR |
14060 | 5340 y(line.)94 b(The)47 b(line)i(is)f(split)g(in)m(to)h(w)m(ords)e(as) |
14061 | h(Readline)h(w)m(ould)f(split)g(it,)53 b(using)47 b Ft(COMP_)p | |
091c6bc4 | 14062 | eop end |
e59452c7 CR |
14063 | %%Page: 82 88 |
14064 | TeXDict begin 82 87 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14065 | b(Shell)30 b(V)-8 b(ariables)2459 b(82)630 299 y Ft(WORDBREAKS)34 | |
d37a4722 CR |
14066 | b Fu(as)i(describ)s(ed)g(ab)s(o)m(v)m(e.)60 b(This)36 |
14067 | b(v)-5 b(ariable)37 b(is)f(a)m(v)-5 b(ailable)39 b(only)e(in)f(shell)h | |
14068 | (func-)630 408 y(tions)32 b(in)m(v)m(ok)m(ed)i(b)m(y)d(the)i | |
14069 | (programmable)f(completion)h(facilities)h(\(see)f(Section)g(8.6)g | |
fffe80d4 | 14070 | ([Pro-)630 518 y(grammable)e(Completion],)g(page)g(142\).)150 |
d37a4722 CR |
14071 | 676 y Ft(COMPREPLY)630 786 y Fu(An)37 b(arra)m(y)h(v)-5 |
14072 | b(ariable)38 b(from)f(whic)m(h)g(Bash)g(reads)g(the)h(p)s(ossible)e | |
14073 | (completions)j(generated)630 896 y(b)m(y)33 b(a)g(shell)h(function)f | |
14074 | (in)m(v)m(ok)m(ed)h(b)m(y)f(the)g(programmable)h(completion)g(facilit)m | |
14075 | (y)h(\(see)f(Sec-)630 1005 y(tion)g(8.6)g([Programmable)g(Completion],) | |
fffe80d4 | 14076 | h(page)f(142\).)51 b(Eac)m(h)34 b(arra)m(y)g(elemen)m(t)h(con)m(tains) |
d37a4722 CR |
14077 | 630 1115 y(one)c(p)s(ossible)f(completion.)150 1273 y |
14078 | Ft(COPROC)192 b Fu(An)27 b(arra)m(y)g(v)-5 b(ariable)28 | |
14079 | b(created)g(to)f(hold)g(the)g(\014le)g(descriptors)g(for)g(output)f | |
14080 | (from)h(and)f(input)630 1383 y(to)31 b(an)f(unnamed)f(copro)s(cess)i | |
e59452c7 | 14081 | (\(see)g(Section)h(3.2.6)g([Copro)s(cesses],)f(page)g(18\).)150 |
d37a4722 CR |
14082 | 1541 y Ft(DIRSTACK)96 b Fu(An)26 b(arra)m(y)h(v)-5 b(ariable)28 |
14083 | b(con)m(taining)g(the)f(curren)m(t)f(con)m(ten)m(ts)j(of)e(the)f | |
14084 | (directory)i(stac)m(k.)41 b(Direc-)630 1650 y(tories)33 | |
14085 | b(app)s(ear)f(in)g(the)h(stac)m(k)h(in)e(the)h(order)f(they)h(are)g | |
14086 | (displa)m(y)m(ed)g(b)m(y)f(the)h Ft(dirs)e Fu(builtin.)630 | |
14087 | 1760 y(Assigning)f(to)h(mem)m(b)s(ers)f(of)g(this)g(arra)m(y)g(v)-5 | |
14088 | b(ariable)31 b(ma)m(y)g(b)s(e)e(used)h(to)h(mo)s(dify)e(directories)630 | |
14089 | 1870 y(already)41 b(in)f(the)h(stac)m(k,)k(but)40 b(the)h | |
14090 | Ft(pushd)e Fu(and)h Ft(popd)f Fu(builtins)h(m)m(ust)h(b)s(e)e(used)h | |
14091 | (to)i(add)630 1979 y(and)37 b(remo)m(v)m(e)h(directories.)63 | |
14092 | b(Assignmen)m(t)37 b(to)h(this)f(v)-5 b(ariable)38 b(will)g(not)f(c)m | |
14093 | (hange)i(the)e(cur-)630 2089 y(ren)m(t)c(directory)-8 | |
14094 | b(.)47 b(If)32 b Ft(DIRSTACK)e Fu(is)i(unset,)g(it)h(loses)g(its)g(sp)s | |
14095 | (ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)630 | |
14096 | 2198 y(subsequen)m(tly)d(reset.)150 2357 y Ft(EMACS)240 | |
14097 | b Fu(If)31 b(Bash)h(\014nds)d(this)j(v)-5 b(ariable)32 | |
14098 | b(in)f(the)h(en)m(vironmen)m(t)g(when)e(the)i(shell)f(starts)h(with)f | |
14099 | (v)-5 b(alue)630 2466 y(`)p Ft(t)p Fu(',)36 b(it)f(assumes)f(that)h | |
14100 | (the)g(shell)f(is)h(running)e(in)h(an)g(Emacs)h(shell)g(bu\013er)e(and) | |
14101 | h(disables)630 2576 y(line)d(editing.)150 2734 y Ft(ENV)336 | |
d514a087 CR |
14102 | b Fu(Expanded)30 b(and)h(executed)h(similarlt)m(y)g(to)g |
14103 | Ft(BASH_ENV)d Fu(\(see)k(Section)f(6.2)g([Bash)g(Startup)630 | |
e59452c7 | 14104 | 2844 y(Files],)39 b(page)e(92\))h(when)d(an)h(in)m(teractiv)m(e)j |
d514a087 CR |
14105 | (shell)d(is)h(in)m(v)m(ok)m(ed)g(in)f Fm(posix)g Fu(Mo)s(de)g(\(see)h |
14106 | (Sec-)630 2953 y(tion)31 b(6.11)h([Bash)f(POSIX)e(Mo)s(de],)i(page)g | |
e59452c7 | 14107 | (105\).)150 3112 y Ft(EPOCHREALTIME)630 3221 y Fu(Eac)m(h)38 |
d514a087 CR |
14108 | b(time)f(this)g(parameter)h(is)f(referenced,)i(it)f(expands)e(to)i(the) |
14109 | f(n)m(um)m(b)s(er)f(of)h(seconds)630 3331 y(since)f(the)g(Unix)f(Ep)s | |
14110 | (o)s(c)m(h)g(as)h(a)g(\015oating)h(p)s(oin)m(t)f(v)-5 | |
14111 | b(alue)36 b(with)f(micro-second)i(gran)m(ularit)m(y)630 | |
e59452c7 CR |
14112 | 3440 y(\(see)k(the)g(do)s(cumen)m(tation)h(for)e(the)h(C)f(library)g |
14113 | (function)g Ft(time)g Fu(for)g(the)h(de\014nition)f(of)630 | |
d514a087 CR |
14114 | 3550 y(Ep)s(o)s(c)m(h\).)82 b(Assignmen)m(ts)44 b(to)h |
14115 | Ft(EPOCHREALTIME)c Fu(are)j(ignored.)83 b(If)43 b Ft(EPOCHREALTIME)e | |
14116 | Fu(is)630 3660 y(unset,)30 b(it)h(loses)g(its)g(sp)s(ecial)g(prop)s | |
14117 | (erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f(reset.)150 | |
14118 | 3818 y Ft(EPOCHSECONDS)630 3927 y Fu(Eac)m(h)38 b(time)f(this)g | |
d37a4722 | 14119 | (parameter)h(is)f(referenced,)i(it)f(expands)e(to)i(the)f(n)m(um)m(b)s |
e59452c7 CR |
14120 | (er)f(of)h(seconds)630 4037 y(since)d(the)g(Unix)g(Ep)s(o)s(c)m(h)f |
14121 | (\(see)i(the)f(do)s(cumen)m(tation)h(for)e(the)i(C)e(library)h | |
14122 | (function)f Ft(time)630 4147 y Fu(for)41 b(the)g(de\014nition)g(of)h | |
d514a087 CR |
14123 | (Ep)s(o)s(c)m(h\).)73 b(Assignmen)m(ts)41 b(to)h Ft(EPOCHSECONDS)c |
14124 | Fu(are)k(ignored.)73 b(If)630 4256 y Ft(EPOCHSECONDS)27 | |
14125 | b Fu(is)j(unset,)g(it)g(loses)h(its)g(sp)s(ecial)f(prop)s(erties,)g(ev) | |
14126 | m(en)h(if)f(it)g(is)g(subsequen)m(tly)630 4366 y(reset.)150 | |
14127 | 4524 y Ft(EUID)288 b Fu(The)30 b(n)m(umeric)g(e\013ectiv)m(e)j(user)d | |
14128 | (id)g(of)g(the)h(curren)m(t)f(user.)40 b(This)30 b(v)-5 | |
14129 | b(ariable)31 b(is)f(readonly)-8 b(.)150 4682 y Ft(EXECIGNORE)630 | |
14130 | 4792 y Fu(A)29 b(colon-separated)h(list)f(of)g(shell)g(patterns)f | |
14131 | (\(see)i(Section)f(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)630 | |
e59452c7 | 14132 | 4902 y(page)j(36\))g(de\014ning)e(the)h(list)g(of)g(\014lenames)g(to)g |
d514a087 CR |
14133 | (b)s(e)g(ignored)g(b)m(y)f(command)h(searc)m(h)g(using)630 |
14134 | 5011 y Ft(PATH)p Fu(.)k(Files)22 b(whose)f(full)g(pathnames)g(matc)m(h) | |
14135 | h(one)f(of)g(these)h(patterns)e(are)i(not)f(considered)630 | |
14136 | 5121 y(executable)j(\014les)e(for)g(the)h(purp)s(oses)d(of)j | |
14137 | (completion)h(and)d(command)i(execution)g(via)g Ft(PATH)630 | |
14138 | 5230 y Fu(lo)s(okup.)56 b(This)35 b(do)s(es)g(not)h(a\013ect)i(the)d(b) | |
14139 | s(eha)m(vior)h(of)g(the)g Ft([)p Fu(,)h Ft(test)p Fu(,)f(and)f | |
14140 | Ft([[)g Fu(commands.)630 5340 y(F)-8 b(ull)42 b(pathnames)e(in)h(the)g | |
14141 | (command)g(hash)f(table)i(are)g(not)f(sub)5 b(ject)41 | |
14142 | b(to)g Ft(EXECIGNORE)p Fu(.)p eop end | |
e59452c7 CR |
14143 | %%Page: 83 89 |
14144 | TeXDict begin 83 88 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14145 | b(Shell)30 b(V)-8 b(ariables)2459 b(83)630 299 y(Use)30 | |
d514a087 CR |
14146 | b(this)f(v)-5 b(ariable)30 b(to)g(ignore)g(shared)f(library)g(\014les)g |
14147 | (that)h(ha)m(v)m(e)h(the)f(executable)h(bit)e(set,)630 | |
14148 | 408 y(but)36 b(are)h(not)g(executable)i(\014les.)60 b(The)36 | |
14149 | b(pattern)h(matc)m(hing)h(honors)e(the)h(setting)h(of)f(the)630 | |
14150 | 518 y Ft(extglob)28 b Fu(shell)j(option.)150 679 y Ft(FCEDIT)192 | |
14151 | b Fu(The)30 b(editor)h(used)e(as)i(a)g(default)f(b)m(y)h(the)f | |
14152 | Ft(-e)g Fu(option)h(to)g(the)f Ft(fc)g Fu(builtin)g(command.)150 | |
14153 | 840 y Ft(FIGNORE)144 b Fu(A)35 b(colon-separated)i(list)f(of)g | |
d37a4722 | 14154 | (su\016xes)e(to)i(ignore)g(when)e(p)s(erforming)g(\014lename)i(comple-) |
d514a087 | 14155 | 630 950 y(tion.)k(A)27 b(\014lename)g(whose)f(su\016x)g(matc)m(hes)i |
d37a4722 | 14156 | (one)f(of)g(the)g(en)m(tries)g(in)g Ft(FIGNORE)d Fu(is)j(excluded)630 |
d514a087 | 14157 | 1060 y(from)j(the)g(list)h(of)g(matc)m(hed)g(\014lenames.)41 |
091c6bc4 | 14158 | b(A)30 b(sample)h(v)-5 b(alue)31 b(is)f(`)p Ft(.o:~)p |
d514a087 | 14159 | Fu(')150 1221 y Ft(FUNCNAME)96 b Fu(An)35 b(arra)m(y)i(v)-5 |
091c6bc4 | 14160 | b(ariable)36 b(con)m(taining)h(the)f(names)g(of)g(all)g(shell)g |
d514a087 | 14161 | (functions)g(curren)m(tly)f(in)h(the)630 1330 y(execution)g(call)h |
d37a4722 | 14162 | (stac)m(k.)57 b(The)34 b(elemen)m(t)j(with)e(index)g(0)h(is)f(the)g |
d514a087 | 14163 | (name)h(of)f(an)m(y)h(curren)m(tly-)630 1440 y(executing)f(shell)f |
d37a4722 | 14164 | (function.)51 b(The)34 b(b)s(ottom-most)h(elemen)m(t)g(\(the)g(one)f |
d514a087 | 14165 | (with)g(the)g(highest)630 1549 y(index\))e(is)h Ft("main")p |
d37a4722 | 14166 | Fu(.)44 b(This)32 b(v)-5 b(ariable)33 b(exists)g(only)g(when)e(a)i |
d514a087 | 14167 | (shell)f(function)g(is)g(executing.)630 1659 y(Assignmen)m(ts)23 |
091c6bc4 CR |
14168 | b(to)f Ft(FUNCNAME)e Fu(ha)m(v)m(e)k(no)e(e\013ect.)39 |
14169 | b(If)22 b Ft(FUNCNAME)e Fu(is)i(unset,)h(it)g(loses)g(its)f(sp)s(ecial) | |
d514a087 CR |
14170 | 630 1769 y(prop)s(erties,)30 b(ev)m(en)h(if)f(it)h(is)g(subsequen)m |
14171 | (tly)f(reset.)630 1904 y(This)h(v)-5 b(ariable)32 b(can)f(b)s(e)g(used) | |
091c6bc4 | 14172 | g(with)g Ft(BASH_LINENO)d Fu(and)j Ft(BASH_SOURCE)p Fu(.)40 |
d514a087 | 14173 | b(Eac)m(h)32 b(elemen)m(t)630 2014 y(of)g Ft(FUNCNAME)d |
091c6bc4 | 14174 | Fu(has)j(corresp)s(onding)e(elemen)m(ts)j(in)f Ft(BASH_LINENO)c |
d514a087 | 14175 | Fu(and)k Ft(BASH_SOURCE)c Fu(to)630 2123 y(describ)s(e)39 |
091c6bc4 CR |
14176 | b(the)h(call)h(stac)m(k.)70 b(F)-8 b(or)41 b(instance,)i |
14177 | Ft(${FUNCNAME[$i]})35 b Fu(w)m(as)41 b(called)f(from)g(the)630 | |
d514a087 | 14178 | 2233 y(\014le)27 b Ft(${BASH_SOURCE[$i+1]})21 b Fu(at)27 |
091c6bc4 | 14179 | b(line)h(n)m(um)m(b)s(er)d Ft(${BASH_LINENO[$i]})p Fu(.)34 |
d514a087 | 14180 | b(The)27 b Ft(caller)630 2342 y Fu(builtin)j(displa)m(ys)g(the)h |
091c6bc4 | 14181 | (curren)m(t)f(call)i(stac)m(k)g(using)d(this)i(information.)150 |
d514a087 | 14182 | 2504 y Ft(FUNCNEST)96 b Fu(If)34 b(set)i(to)f(a)h(n)m(umeric)e(v)-5 |
d7935593 | 14183 | b(alue)36 b(greater)g(than)e(0,)j(de\014nes)d(a)h(maxim)m(um)g |
d514a087 | 14184 | (function)g(nesting)630 2613 y(lev)m(el.)42 b(F)-8 b(unction)29 |
9ec5ed66 | 14185 | b(in)m(v)m(o)s(cations)h(that)f(exceed)h(this)e(nesting)h(lev)m(el)h |
d514a087 CR |
14186 | (will)f(cause)g(the)f(curren)m(t)630 2723 y(command)i(to)h(ab)s(ort.) |
14187 | 150 2884 y Ft(GLOBIGNORE)630 2993 y Fu(A)k(colon-separated)i(list)f(of) | |
a2851804 | 14188 | f(patterns)g(de\014ning)f(the)i(set)f(of)g(\014le)h(names)f(to)g(b)s(e) |
d514a087 | 14189 | g(ignored)630 3103 y(b)m(y)28 b(\014lename)h(expansion.)40 |
7e92fb35 | 14190 | b(If)28 b(a)h(\014le)g(name)g(matc)m(hed)g(b)m(y)g(a)g(\014lename)f |
d514a087 | 14191 | (expansion)h(pattern)630 3213 y(also)k(matc)m(hes)g(one)f(of)g(the)g |
6e51e0d0 | 14192 | (patterns)g(in)f Ft(GLOBIGNORE)p Fu(,)f(it)i(is)g(remo)m(v)m(ed)h(from) |
d514a087 | 14193 | e(the)h(list)h(of)630 3322 y(matc)m(hes.)41 b(The)27 |
967625cd | 14194 | b(pattern)g(matc)m(hing)h(honors)f(the)g(setting)i(of)e(the)h |
d514a087 | 14195 | Ft(extglob)d Fu(shell)i(option.)150 3483 y Ft(GROUPS)192 |
6e51e0d0 | 14196 | b Fu(An)36 b(arra)m(y)g(v)-5 b(ariable)37 b(con)m(taining)g(the)f(list) |
ad4aef08 | 14197 | h(of)f(groups)g(of)g(whic)m(h)f(the)i(curren)m(t)e(user)h(is)g(a)630 |
d514a087 | 14198 | 3593 y(mem)m(b)s(er.)41 b(Assignmen)m(ts)30 b(to)i Ft(GROUPS)d |
d7935593 | 14199 | Fu(ha)m(v)m(e)i(no)g(e\013ect.)42 b(If)30 b Ft(GROUPS)f |
d514a087 | 14200 | Fu(is)i(unset,)f(it)h(loses)h(its)630 3703 y(sp)s(ecial)f(prop)s |
d7935593 | 14201 | (erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f(reset.)150 |
d514a087 | 14202 | 3864 y Ft(histchars)630 3973 y Fu(Up)c(to)g(three)g(c)m(haracters)i |
d7935593 | 14203 | (whic)m(h)d(con)m(trol)j(history)d(expansion,)i(quic)m(k)g |
d514a087 | 14204 | (substitution,)g(and)630 4083 y(tok)m(enization)k(\(see)f(Section)f |
fffe80d4 | 14205 | (9.3)h([History)f(In)m(teraction],)i(page)f(153\).)41 |
d514a087 | 14206 | b(The)29 b(\014rst)e(c)m(harac-)630 4193 y(ter)j(is)f(the)g |
6e51e0d0 | 14207 | Fr(history)g(expansion)g Fu(c)m(haracter,)j(that)e(is,)f(the)h(c)m |
d514a087 | 14208 | (haracter)h(whic)m(h)d(signi\014es)i(the)630 4302 y(start)25 |
b729dac1 CR |
14209 | b(of)f(a)h(history)f(expansion,)i(normally)e(`)p Ft(!)p |
14210 | Fu('.)39 b(The)24 b(second)g(c)m(haracter)i(is)e(the)g(c)m(haracter)630 | |
d514a087 | 14211 | 4412 y(whic)m(h)36 b(signi\014es)g(`quic)m(k)h(substitution')f(when)f |
b729dac1 | 14212 | (seen)h(as)g(the)g(\014rst)f(c)m(haracter)j(on)e(a)g(line,)630 |
d514a087 | 14213 | 4521 y(normally)27 b(`)p Ft(^)p Fu('.)39 b(The)26 b(optional)i(third)d |
b729dac1 | 14214 | (c)m(haracter)j(is)e(the)h(c)m(haracter)h(whic)m(h)e(indicates)h(that) |
d514a087 | 14215 | 630 4631 y(the)34 b(remainder)f(of)h(the)g(line)g(is)f(a)h(commen)m(t)h |
9ec5ed66 | 14216 | (when)e(found)f(as)i(the)g(\014rst)f(c)m(haracter)i(of)f(a)630 |
d514a087 | 14217 | 4740 y(w)m(ord,)i(usually)f(`)p Ft(#)p Fu('.)55 b(The)34 |
9ec5ed66 | 14218 | b(history)h(commen)m(t)h(c)m(haracter)h(causes)e(history)g |
d514a087 | 14219 | (substitution)630 4850 y(to)27 b(b)s(e)f(skipp)s(ed)f(for)i(the)f |
9ec5ed66 | 14220 | (remaining)h(w)m(ords)f(on)h(the)f(line.)40 b(It)27 b(do)s(es)f(not)h |
d514a087 | 14221 | (necessarily)g(cause)630 4960 y(the)k(shell)f(parser)g(to)h(treat)g |
7e92fb35 | 14222 | (the)g(rest)g(of)f(the)h(line)f(as)h(a)g(commen)m(t.)150 |
d37a4722 CR |
14223 | 5121 y Ft(HISTCMD)144 b Fu(The)44 b(history)h(n)m(um)m(b)s(er,)j(or)d |
14224 | (index)g(in)f(the)h(history)g(list,)50 b(of)45 b(the)g(curren)m(t)g | |
14225 | (command.)630 5230 y(Assignmen)m(ts)37 b(to)h Ft(HISTCMD)d | |
14226 | Fu(are)j(ignored.)61 b(If)37 b Ft(HISTCMD)e Fu(is)i(unset,)h(it)g | |
14227 | (loses)g(its)f(sp)s(ecial)630 5340 y(prop)s(erties,)30 | |
14228 | b(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f(reset.)p | |
14229 | eop end | |
e59452c7 CR |
14230 | %%Page: 84 90 |
14231 | TeXDict begin 84 89 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14232 | b(Shell)30 b(V)-8 b(ariables)2459 b(84)150 299 y Ft(HISTCONTROL)630 | |
d37a4722 CR |
14233 | 408 y Fu(A)40 b(colon-separated)i(list)f(of)f(v)-5 b(alues)40 |
14234 | b(con)m(trolling)i(ho)m(w)e(commands)g(are)h(sa)m(v)m(ed)g(on)f(the)630 | |
14235 | 518 y(history)29 b(list.)41 b(If)28 b(the)h(list)h(of)f(v)-5 | |
6e51e0d0 | 14236 | b(alues)29 b(includes)f(`)p Ft(ignorespace)p Fu(',)f(lines)i(whic)m(h)g |
d37a4722 | 14237 | (b)s(egin)f(with)630 628 y(a)39 b(space)g(c)m(haracter)i(are)e(not)g |
9ec5ed66 | 14238 | (sa)m(v)m(ed)g(in)g(the)g(history)f(list.)66 b(A)39 b(v)-5 |
d37a4722 | 14239 | b(alue)39 b(of)g(`)p Ft(ignoredups)p Fu(')630 737 y(causes)34 |
9ec5ed66 CR |
14240 | b(lines)h(whic)m(h)f(matc)m(h)h(the)f(previous)f(history)h(en)m(try)h |
14241 | (to)g(not)f(b)s(e)f(sa)m(v)m(ed.)53 b(A)34 b(v)-5 b(alue)630 | |
d37a4722 | 14242 | 847 y(of)32 b(`)p Ft(ignoreboth)p Fu(')d(is)j(shorthand)e(for)i(`)p |
6e51e0d0 | 14243 | Ft(ignorespace)p Fu(')d(and)i(`)p Ft(ignoredups)p Fu('.)42 |
d37a4722 CR |
14244 | b(A)32 b(v)-5 b(alue)32 b(of)630 956 y(`)p Ft(erasedups)p |
14245 | Fu(')f(causes)i(all)h(previous)f(lines)g(matc)m(hing)h(the)f(curren)m | |
14246 | (t)g(line)g(to)h(b)s(e)e(remo)m(v)m(ed)630 1066 y(from)42 | |
14247 | b(the)h(history)f(list)i(b)s(efore)e(that)h(line)g(is)g(sa)m(v)m(ed.)78 | |
14248 | b(An)m(y)43 b(v)-5 b(alue)43 b(not)g(in)f(the)h(ab)s(o)m(v)m(e)630 | |
14249 | 1176 y(list)35 b(is)g(ignored.)53 b(If)34 b Ft(HISTCONTROL)e | |
14250 | Fu(is)i(unset,)i(or)e(do)s(es)h(not)g(include)f(a)h(v)-5 | |
14251 | b(alid)35 b(v)-5 b(alue,)36 b(all)630 1285 y(lines)30 | |
37c41ab1 CR |
14252 | b(read)g(b)m(y)g(the)g(shell)g(parser)g(are)g(sa)m(v)m(ed)h(on)f(the)g |
14253 | (history)g(list,)h(sub)5 b(ject)30 b(to)g(the)g(v)-5 | |
d37a4722 | 14254 | b(alue)630 1395 y(of)42 b Ft(HISTIGNORE)p Fu(.)73 b(The)42 |
37c41ab1 | 14255 | b(second)g(and)g(subsequen)m(t)f(lines)h(of)h(a)f(m)m(ulti-line)h(comp) |
d37a4722 CR |
14256 | s(ound)630 1504 y(command)33 b(are)h(not)g(tested,)i(and)d(are)h(added) |
14257 | f(to)h(the)g(history)g(regardless)g(of)g(the)f(v)-5 b(alue)630 | |
14258 | 1614 y(of)31 b Ft(HISTCONTROL)p Fu(.)150 1763 y Ft(HISTFILE)96 | |
091c6bc4 CR |
14259 | b Fu(The)27 b(name)h(of)g(the)g(\014le)g(to)h(whic)m(h)f(the)g(command) |
14260 | f(history)h(is)g(sa)m(v)m(ed.)41 b(The)27 b(default)h(v)-5 | |
d37a4722 CR |
14261 | b(alue)630 1873 y(is)30 b Ft(~/.bash_history)p Fu(.)150 |
14262 | 2022 y Ft(HISTFILESIZE)630 2132 y Fu(The)c(maxim)m(um)f(n)m(um)m(b)s | |
091c6bc4 | 14263 | (er)g(of)h(lines)h(con)m(tained)g(in)f(the)g(history)g(\014le.)39 |
d37a4722 | 14264 | b(When)26 b(this)g(v)-5 b(ariable)630 2242 y(is)25 b(assigned)h(a)g(v) |
091c6bc4 CR |
14265 | -5 b(alue,)27 b(the)f(history)f(\014le)h(is)f(truncated,)i(if)e |
14266 | (necessary)-8 b(,)28 b(to)e(con)m(tain)g(no)g(more)630 | |
d37a4722 | 14267 | 2351 y(than)37 b(that)h(n)m(um)m(b)s(er)d(of)j(lines)f(b)m(y)g(remo)m |
091c6bc4 | 14268 | (ving)h(the)f(oldest)h(en)m(tries.)62 b(The)37 b(history)g(\014le)g(is) |
d37a4722 | 14269 | 630 2461 y(also)i(truncated)f(to)h(this)e(size)i(after)g(writing)f(it)g |
9f178efb | 14270 | (when)f(a)h(shell)h(exits.)64 b(If)37 b(the)h(v)-5 b(alue)39 |
d37a4722 | 14271 | b(is)630 2570 y(0,)g(the)e(history)f(\014le)h(is)g(truncated)f(to)i |
9f178efb | 14272 | (zero)f(size.)60 b(Non-n)m(umeric)37 b(v)-5 b(alues)37 |
d37a4722 | 14273 | b(and)f(n)m(umeric)630 2680 y(v)-5 b(alues)31 b(less)f(than)g(zero)h |
9f178efb | 14274 | (inhibit)f(truncation.)41 b(The)29 b(shell)i(sets)f(the)h(default)f(v) |
d37a4722 | 14275 | -5 b(alue)31 b(to)g(the)630 2790 y(v)-5 b(alue)31 b(of)f |
6e51e0d0 | 14276 | Ft(HISTSIZE)f Fu(after)h(reading)h(an)m(y)g(startup)f(\014les.)150 |
d37a4722 | 14277 | 2939 y Ft(HISTIGNORE)630 3049 y Fu(A)j(colon-separated)h(list)f(of)g |
09767ff0 | 14278 | (patterns)f(used)g(to)h(decide)g(whic)m(h)f(command)g(lines)h(should) |
d37a4722 | 14279 | 630 3158 y(b)s(e)f(sa)m(v)m(ed)h(on)g(the)f(history)h(list.)47 |
09767ff0 | 14280 | b(Eac)m(h)33 b(pattern)g(is)f(anc)m(hored)h(at)g(the)f(b)s(eginning)g |
d37a4722 | 14281 | (of)h(the)630 3268 y(line)43 b(and)e(m)m(ust)h(matc)m(h)h(the)g |
6e51e0d0 | 14282 | (complete)h(line)e(\(no)h(implicit)g(`)p Ft(*)p Fu(')f(is)g(app)s |
d37a4722 | 14283 | (ended\).)75 b(Eac)m(h)630 3377 y(pattern)42 b(is)g(tested)g(against)h |
09767ff0 | 14284 | (the)f(line)g(after)g(the)g(c)m(hec)m(ks)h(sp)s(eci\014ed)e(b)m(y)h |
d37a4722 | 14285 | Ft(HISTCONTROL)630 3487 y Fu(are)37 b(applied.)59 b(In)36 |
ad4aef08 | 14286 | b(addition)h(to)g(the)g(normal)g(shell)f(pattern)h(matc)m(hing)h(c)m |
d37a4722 | 14287 | (haracters,)i(`)p Ft(&)p Fu(')630 3597 y(matc)m(hes)d(the)f(previous)g |
6e51e0d0 | 14288 | (history)g(line.)57 b(`)p Ft(&)p Fu(')36 b(ma)m(y)h(b)s(e)e(escap)s(ed) |
d37a4722 | 14289 | h(using)g(a)g(bac)m(kslash;)k(the)630 3706 y(bac)m(kslash)34 |
ad4aef08 | 14290 | b(is)g(remo)m(v)m(ed)h(b)s(efore)e(attempting)i(a)g(matc)m(h.)51 |
d37a4722 | 14291 | b(The)34 b(second)f(and)h(subsequen)m(t)630 3816 y(lines)e(of)h(a)g(m)m |
ad4aef08 | 14292 | (ulti-line)g(comp)s(ound)e(command)h(are)h(not)f(tested,)i(and)e(are)g |
d37a4722 | 14293 | (added)g(to)h(the)630 3925 y(history)k(regardless)h(of)f(the)g(v)-5 |
967625cd | 14294 | b(alue)38 b(of)f Ft(HISTIGNORE)p Fu(.)58 b(The)37 b(pattern)g(matc)m |
d37a4722 CR |
14295 | (hing)i(honors)630 4035 y(the)31 b(setting)g(of)g(the)f |
14296 | Ft(extglob)f Fu(shell)h(option.)630 4164 y Ft(HISTIGNORE)20 | |
6e51e0d0 CR |
14297 | b Fu(subsumes)g(the)j(function)f(of)h Ft(HISTCONTROL)p |
14298 | Fu(.)35 b(A)23 b(pattern)f(of)h(`)p Ft(&)p Fu(')g(is)f(iden)m(tical)630 | |
d37a4722 | 14299 | 4274 y(to)k Ft(ignoredups)p Fu(,)e(and)h(a)h(pattern)g(of)f(`)p |
6e51e0d0 | 14300 | Ft([)31 b(]*)p Fu(')25 b(is)h(iden)m(tical)h(to)f Ft(ignorespace)p |
d37a4722 | 14301 | Fu(.)36 b(Com)m(bining)630 4384 y(these)30 b(t)m(w)m(o)h(patterns,)f |
7e92fb35 | 14302 | (separating)g(them)g(with)f(a)h(colon,)h(pro)m(vides)e(the)h |
d37a4722 CR |
14303 | (functionalit)m(y)h(of)630 4493 y Ft(ignoreboth)p Fu(.)150 |
14304 | 4643 y Ft(HISTSIZE)96 b Fu(The)37 b(maxim)m(um)g(n)m(um)m(b)s(er)e(of)j | |
7e92fb35 | 14305 | (commands)f(to)g(remem)m(b)s(er)g(on)g(the)g(history)g(list.)62 |
d37a4722 | 14306 | b(If)37 b(the)630 4752 y(v)-5 b(alue)26 b(is)g(0,)i(commands)d(are)h |
b729dac1 | 14307 | (not)h(sa)m(v)m(ed)g(in)e(the)h(history)g(list.)40 b(Numeric)26 |
d37a4722 | 14308 | b(v)-5 b(alues)26 b(less)g(than)630 4862 y(zero)i(result)e(in)h(ev)m |
45c0f7f8 | 14309 | (ery)g(command)g(b)s(eing)f(sa)m(v)m(ed)i(on)f(the)g(history)f(list)i |
d37a4722 | 14310 | (\(there)f(is)g(no)g(limit\).)630 4971 y(The)j(shell)g(sets)h(the)g |
45c0f7f8 | 14311 | (default)f(v)-5 b(alue)31 b(to)g(500)h(after)f(reading)f(an)m(y)h |
d37a4722 CR |
14312 | (startup)f(\014les.)150 5121 y Ft(HISTTIMEFORMAT)630 |
14313 | 5230 y Fu(If)44 b(this)g(v)-5 b(ariable)45 b(is)f(set)g(and)g(not)g(n)m | |
45c0f7f8 | 14314 | (ull,)k(its)d(v)-5 b(alue)44 b(is)g(used)g(as)g(a)h(format)f(string)g |
e59452c7 CR |
14315 | (for)630 5340 y Ft(strftime)26 b Fu(to)k(prin)m(t)e(the)g(time)i(stamp) |
14316 | e(asso)s(ciated)i(with)e(eac)m(h)i(history)f(en)m(try)f(displa)m(y)m | |
d37a4722 | 14317 | (ed)p eop end |
e59452c7 CR |
14318 | %%Page: 85 91 |
14319 | TeXDict begin 85 90 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14320 | b(Shell)30 b(V)-8 b(ariables)2459 b(85)630 299 y(b)m(y)34 | |
d37a4722 CR |
14321 | b(the)f Ft(history)f Fu(builtin.)50 b(If)33 b(this)h(v)-5 |
14322 | b(ariable)34 b(is)g(set,)h(time)f(stamps)g(are)g(written)f(to)i(the)630 | |
14323 | 408 y(history)26 b(\014le)g(so)g(they)g(ma)m(y)h(b)s(e)e(preserv)m(ed)g | |
14324 | (across)i(shell)f(sessions.)39 b(This)25 b(uses)h(the)g(history)630 | |
14325 | 518 y(commen)m(t)31 b(c)m(haracter)h(to)f(distinguish)f(timestamps)h | |
14326 | (from)f(other)g(history)h(lines.)150 687 y Ft(HOSTFILE)96 | |
14327 | b Fu(Con)m(tains)33 b(the)g(name)f(of)h(a)g(\014le)f(in)g(the)h(same)g | |
14328 | (format)g(as)f Ft(/etc/hosts)e Fu(that)j(should)f(b)s(e)630 | |
14329 | 797 y(read)21 b(when)g(the)g(shell)h(needs)f(to)h(complete)h(a)e | |
14330 | (hostname.)38 b(The)21 b(list)h(of)g(p)s(ossible)f(hostname)630 | |
14331 | 907 y(completions)27 b(ma)m(y)f(b)s(e)f(c)m(hanged)h(while)f(the)h | |
14332 | (shell)g(is)f(running;)h(the)g(next)f(time)i(hostname)630 | |
14333 | 1016 y(completion)33 b(is)g(attempted)g(after)g(the)f(v)-5 | |
14334 | b(alue)33 b(is)f(c)m(hanged,)i(Bash)e(adds)f(the)i(con)m(ten)m(ts)h(of) | |
14335 | 630 1126 y(the)h(new)f(\014le)g(to)h(the)g(existing)h(list.)53 | |
14336 | b(If)34 b Ft(HOSTFILE)e Fu(is)j(set,)h(but)e(has)g(no)h(v)-5 | |
14337 | b(alue,)36 b(or)e(do)s(es)630 1235 y(not)d(name)f(a)h(readable)g | |
14338 | (\014le,)g(Bash)f(attempts)i(to)f(read)f Ft(/etc/hosts)e | |
14339 | Fu(to)j(obtain)g(the)f(list)630 1345 y(of)h(p)s(ossible)f(hostname)h | |
14340 | (completions.)43 b(When)31 b Ft(HOSTFILE)d Fu(is)j(unset,)f(the)h | |
14341 | (hostname)g(list)630 1455 y(is)f(cleared.)150 1624 y | |
14342 | Ft(HOSTNAME)96 b Fu(The)30 b(name)g(of)h(the)f(curren)m(t)h(host.)150 | |
14343 | 1793 y Ft(HOSTTYPE)96 b Fu(A)30 b(string)h(describing)f(the)g(mac)m | |
14344 | (hine)h(Bash)g(is)f(running)f(on.)150 1963 y Ft(IGNOREEOF)630 | |
14345 | 2072 y Fu(Con)m(trols)e(the)h(action)g(of)f(the)g(shell)g(on)g(receipt) | |
14346 | h(of)f(an)g Ft(EOF)f Fu(c)m(haracter)i(as)g(the)f(sole)h(input.)630 | |
14347 | 2182 y(If)i(set,)i(the)f(v)-5 b(alue)32 b(denotes)f(the)g(n)m(um)m(b)s | |
8d125d8b | 14348 | (er)f(of)h(consecutiv)m(e)i Ft(EOF)d Fu(c)m(haracters)i(that)f(can)h(b) |
d37a4722 | 14349 | s(e)630 2291 y(read)40 b(as)f(the)h(\014rst)f(c)m(haracter)i(on)f(an)f |
8d125d8b | 14350 | (input)g(line)h(b)s(efore)f(the)h(shell)g(will)g(exit.)70 |
d37a4722 | 14351 | b(If)39 b(the)630 2401 y(v)-5 b(ariable)39 b(exists)f(but)g(do)s(es)f |
12beeabf | 14352 | (not)h(ha)m(v)m(e)h(a)g(n)m(umeric)f(v)-5 b(alue,)40 |
d37a4722 | 14353 | b(or)e(has)g(no)g(v)-5 b(alue,)40 b(then)e(the)630 2511 |
12beeabf CR |
14354 | y(default)31 b(is)g(10.)43 b(If)30 b(the)h(v)-5 b(ariable)31 |
14355 | b(do)s(es)g(not)g(exist,)h(then)e Ft(EOF)g Fu(signi\014es)h(the)g(end)f | |
d37a4722 | 14356 | (of)h(input)630 2620 y(to)g(the)g(shell.)41 b(This)29 |
12beeabf | 14357 | b(is)i(only)f(in)g(e\013ect)i(for)e(in)m(teractiv)m(e)j(shells.)150 |
d37a4722 | 14358 | 2790 y Ft(INPUTRC)144 b Fu(The)68 b(name)h(of)f(the)h(Readline)g |
12beeabf | 14359 | (initialization)j(\014le,)78 b(o)m(v)m(erriding)69 b(the)g(default)g |
d37a4722 CR |
14360 | (of)630 2899 y Ft(~/.inputrc)p Fu(.)150 3068 y Ft(INSIDE_EMACS)630 |
14361 | 3178 y Fu(If)29 b(Bash)h(\014nds)e(this)h(v)-5 b(ariable)31 | |
b52e30b8 | 14362 | b(in)e(the)h(en)m(vironmen)m(t)g(when)e(the)i(shell)g(starts,)g(it)g |
d37a4722 | 14363 | (assumes)630 3288 y(that)i(the)g(shell)g(is)f(running)f(in)i(an)f |
b52e30b8 | 14364 | (Emacs)h(shell)g(bu\013er)e(and)h(ma)m(y)i(disable)e(line)h(editing)630 |
d37a4722 CR |
14365 | 3397 y(dep)s(ending)d(on)h(the)h(v)-5 b(alue)31 b(of)f |
14366 | Ft(TERM)p Fu(.)150 3567 y Ft(LANG)288 b Fu(Used)28 b(to)h(determine)f | |
b52e30b8 | 14367 | (the)g(lo)s(cale)h(category)h(for)e(an)m(y)h(category)h(not)e(sp)s |
d37a4722 CR |
14368 | (eci\014cally)g(selected)630 3676 y(with)i(a)h(v)-5 b(ariable)31 |
14369 | b(starting)g(with)f Ft(LC_)p Fu(.)150 3846 y Ft(LC_ALL)192 | |
b52e30b8 CR |
14370 | b Fu(This)28 b(v)-5 b(ariable)29 b(o)m(v)m(errides)h(the)f(v)-5 |
14371 | b(alue)29 b(of)g Ft(LANG)f Fu(and)g(an)m(y)h(other)g | |
d37a4722 CR |
14372 | Ft(LC_)f Fu(v)-5 b(ariable)29 b(sp)s(ecifying)630 3955 |
14373 | y(a)i(lo)s(cale)h(category)-8 b(.)150 4125 y Ft(LC_COLLATE)630 | |
14374 | 4234 y Fu(This)37 b(v)-5 b(ariable)38 b(determines)g(the)g(collation)i | |
b52e30b8 | 14375 | (order)d(used)g(when)f(sorting)i(the)g(results)g(of)630 |
d37a4722 CR |
14376 | 4344 y(\014lename)e(expansion,)i(and)e(determines)g(the)h(b)s(eha)m |
14377 | (vior)f(of)g(range)h(expressions,)h(equiv-)630 4453 y(alence)e | |
b52e30b8 | 14378 | (classes,)h(and)e(collating)i(sequences)e(within)f(\014lename)h |
d37a4722 | 14379 | (expansion)g(and)f(pattern)630 4563 y(matc)m(hing)d(\(see)h(Section)f |
e59452c7 | 14380 | (3.5.8)h([Filename)g(Expansion],)e(page)h(35\).)150 4732 |
b52e30b8 CR |
14381 | y Ft(LC_CTYPE)96 b Fu(This)36 b(v)-5 b(ariable)37 b(determines)f(the)h |
14382 | (in)m(terpretation)h(of)f(c)m(haracters)h(and)e(the)g(b)s(eha)m(vior)h | |
d37a4722 | 14383 | (of)630 4842 y(c)m(haracter)46 b(classes)g(within)e(\014lename)h |
b52e30b8 | 14384 | (expansion)g(and)f(pattern)h(matc)m(hing)h(\(see)f(Sec-)630 |
e59452c7 | 14385 | 4951 y(tion)31 b(3.5.8)h([Filename)g(Expansion],)e(page)h(35\).)150 |
d37a4722 | 14386 | 5121 y Ft(LC_MESSAGES)630 5230 y Fu(This)25 b(v)-5 b(ariable)27 |
7e92fb35 | 14387 | b(determines)f(the)g(lo)s(cale)i(used)d(to)i(translate)g(double-quoted) |
d37a4722 | 14388 | f(strings)g(pre-)630 5340 y(ceded)31 b(b)m(y)f(a)h(`)p |
7e92fb35 | 14389 | Ft($)p Fu(')f(\(see)h(Section)h(3.1.2.5)g([Lo)s(cale)g(T)-8 |
d37a4722 | 14390 | b(ranslation],)32 b(page)f(7\).)p eop end |
e59452c7 CR |
14391 | %%Page: 86 92 |
14392 | TeXDict begin 86 91 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14393 | b(Shell)30 b(V)-8 b(ariables)2459 b(86)150 299 y Ft(LC_NUMERIC)630 | |
d37a4722 | 14394 | 408 y Fu(This)30 b(v)-5 b(ariable)31 b(determines)f(the)h(lo)s(cale)h |
7e92fb35 | 14395 | (category)g(used)e(for)g(n)m(um)m(b)s(er)f(formatting.)150 |
9c10def1 | 14396 | 573 y Ft(LC_TIME)144 b Fu(This)25 b(v)-5 b(ariable)26 |
7e92fb35 | 14397 | b(determines)g(the)g(lo)s(cale)h(category)h(used)d(for)g(data)h(and)f |
9c10def1 | 14398 | (time)i(formatting.)150 737 y Ft(LINENO)192 b Fu(The)32 |
e2169ae9 CR |
14399 | b(line)h(n)m(um)m(b)s(er)e(in)i(the)f(script)h(or)f(shell)h(function)f |
14400 | (curren)m(tly)h(executing.)49 b(If)32 b Ft(LINENO)630 | |
9c10def1 | 14401 | 847 y Fu(is)e(unset,)h(it)g(loses)g(its)f(sp)s(ecial)h(prop)s(erties,)f |
d37a4722 | 14402 | (ev)m(en)h(if)g(it)g(is)f(subsequen)m(tly)g(reset.)150 |
9c10def1 | 14403 | 1011 y Ft(LINES)240 b Fu(Used)43 b(b)m(y)g(the)g Ft(select)e |
d37a4722 | 14404 | Fu(command)i(to)g(determine)g(the)g(column)g(length)g(for)g(prin)m |
9c10def1 | 14405 | (ting)630 1121 y(selection)c(lists.)63 b(Automatically)41 |
d37a4722 | 14406 | b(set)d(if)f(the)h Ft(checkwinsize)d Fu(option)j(is)f(enabled)h(\(see) |
9c10def1 | 14407 | 630 1230 y(Section)44 b(4.3.2)h([The)e(Shopt)g(Builtin],)k(page)d |
e59452c7 | 14408 | (70\),)k(or)43 b(in)g(an)g(in)m(teractiv)m(e)j(shell)e(up)s(on)630 |
9c10def1 | 14409 | 1340 y(receipt)31 b(of)g(a)g Ft(SIGWINCH)p Fu(.)150 1504 |
d37a4722 CR |
14410 | y Ft(MACHTYPE)96 b Fu(A)26 b(string)g(that)h(fully)f(describ)s(es)f |
14411 | (the)h(system)g(t)m(yp)s(e)h(on)f(whic)m(h)f(Bash)i(is)f(executing,)i | |
9c10def1 CR |
14412 | (in)e(the)630 1614 y(standard)k Fm(gnu)g Fr(cpu-compan)m(y-system)h |
14413 | Fu(format.)150 1778 y Ft(MAILCHECK)630 1888 y Fu(Ho)m(w)d(often)g(\(in) | |
091c6bc4 | 14414 | g(seconds\))g(that)g(the)f(shell)h(should)f(c)m(hec)m(k)i(for)e(mail)h |
9c10def1 | 14415 | (in)f(the)h(\014les)g(sp)s(eci\014ed)630 1998 y(in)i(the)h |
091c6bc4 CR |
14416 | Ft(MAILPATH)e Fu(or)i Ft(MAIL)e Fu(v)-5 b(ariables.)43 |
14417 | b(The)30 b(default)h(is)f(60)i(seconds.)42 b(When)30 | |
9c10def1 | 14418 | b(it)h(is)g(time)630 2107 y(to)37 b(c)m(hec)m(k)h(for)e(mail,)j(the)e |
091c6bc4 | 14419 | (shell)f(do)s(es)g(so)h(b)s(efore)f(displa)m(ying)h(the)f(primary)g |
9c10def1 | 14420 | (prompt.)57 b(If)630 2217 y(this)37 b(v)-5 b(ariable)38 |
091c6bc4 | 14421 | b(is)f(unset,)h(or)f(set)h(to)g(a)f(v)-5 b(alue)38 b(that)f(is)g(not)h |
9c10def1 | 14422 | (a)f(n)m(um)m(b)s(er)f(greater)i(than)f(or)630 2326 y(equal)31 |
091c6bc4 | 14423 | b(to)g(zero,)g(the)g(shell)g(disables)f(mail)h(c)m(hec)m(king.)150 |
9c10def1 | 14424 | 2491 y Ft(MAPFILE)144 b Fu(An)35 b(arra)m(y)h(v)-5 b(ariable)36 |
091c6bc4 | 14425 | b(created)g(to)h(hold)e(the)g(text)i(read)e(b)m(y)g(the)h |
9c10def1 CR |
14426 | Ft(mapfile)d Fu(builtin)i(when)630 2600 y(no)30 b(v)-5 |
14427 | b(ariable)31 b(name)g(is)f(supplied.)150 2765 y Ft(OLDPWD)192 | |
091c6bc4 | 14428 | b Fu(The)30 b(previous)g(w)m(orking)g(directory)h(as)g(set)g(b)m(y)f |
9c10def1 | 14429 | (the)h Ft(cd)e Fu(builtin.)150 2929 y Ft(OPTERR)192 b |
091c6bc4 CR |
14430 | Fu(If)35 b(set)i(to)f(the)h(v)-5 b(alue)36 b(1,)i(Bash)e(displa)m(ys)g |
14431 | (error)f(messages)i(generated)g(b)m(y)f(the)g Ft(getopts)630 | |
9c10def1 | 14432 | 3039 y Fu(builtin)30 b(command.)150 3203 y Ft(OSTYPE)192 |
091c6bc4 | 14433 | b Fu(A)30 b(string)h(describing)f(the)g(op)s(erating)h(system)g(Bash)f |
9c10def1 | 14434 | (is)h(running)d(on.)150 3367 y Ft(PIPESTATUS)630 3477 |
091c6bc4 | 14435 | y Fu(An)23 b(arra)m(y)h(v)-5 b(ariable)24 b(\(see)h(Section)f(6.7)h |
e59452c7 | 14436 | ([Arra)m(ys],)g(page)f(99\))h(con)m(taining)g(a)f(list)g(of)g(exit)g |
9c10def1 | 14437 | (sta-)630 3587 y(tus)h(v)-5 b(alues)27 b(from)e(the)h(pro)s(cesses)g |
091c6bc4 | 14438 | (in)f(the)h(most-recen)m(tly-executed)j(foreground)c(pip)s(eline)630 |
9c10def1 CR |
14439 | 3696 y(\(whic)m(h)30 b(ma)m(y)h(con)m(tain)h(only)f(a)f(single)h |
14440 | (command\).)150 3861 y Ft(POSIXLY_CORRECT)630 3970 y | |
6e51e0d0 CR |
14441 | Fu(If)h(this)g(v)-5 b(ariable)34 b(is)e(in)g(the)h(en)m(vironmen)m(t)g |
14442 | (when)e(Bash)i(starts,)g(the)g(shell)g(en)m(ters)g Fm(posix)630 | |
9c10def1 | 14443 | 4080 y Fu(mo)s(de)46 b(\(see)h(Section)g(6.11)g([Bash)g(POSIX)e(Mo)s |
e59452c7 | 14444 | (de],)50 b(page)d(105\))h(b)s(efore)e(reading)g(the)630 |
9c10def1 | 14445 | 4189 y(startup)38 b(\014les,)j(as)e(if)g(the)g Ft(--posix)d |
602eae4d | 14446 | Fu(in)m(v)m(o)s(cation)41 b(option)e(had)f(b)s(een)g(supplied.)64 |
9c10def1 | 14447 | b(If)39 b(it)g(is)630 4299 y(set)31 b(while)f(the)h(shell)f(is)h |
602eae4d | 14448 | (running,)e(Bash)h(enables)h Fm(posix)f Fu(mo)s(de,)g(as)g(if)h(the)f |
9c10def1 | 14449 | (command)870 4436 y Ft(set)47 b(-o)g(posix)630 4573 y |
602eae4d CR |
14450 | Fu(had)33 b(b)s(een)g(executed.)51 b(When)33 b(the)h(shell)f(en)m(ters) |
14451 | h Fm(posix)f Fu(mo)s(de,)h(it)g(sets)g(this)g(v)-5 b(ariable)34 | |
9c10def1 CR |
14452 | b(if)630 4682 y(it)d(w)m(as)g(not)f(already)h(set.)150 |
14453 | 4847 y Ft(PPID)288 b Fu(The)30 b(pro)s(cess)g Fm(id)g | |
602eae4d | 14454 | Fu(of)h(the)f(shell's)h(paren)m(t)g(pro)s(cess.)40 b(This)30 |
9c10def1 CR |
14455 | b(v)-5 b(ariable)31 b(is)f(readonly)-8 b(.)150 5011 y |
14456 | Ft(PROMPT_COMMAND)630 5121 y Fu(If)23 b(this)h(v)-5 b(ariable)24 | |
14457 | b(is)g(set,)i(and)d(is)h(an)f(arra)m(y)-8 b(,)27 b(the)d(v)-5 | |
14458 | b(alue)24 b(of)g(eac)m(h)g(set)h(elemen)m(t)g(is)f(in)m(terpreted)630 | |
14459 | 5230 y(as)29 b(a)g(command)f(to)i(execute)g(b)s(efore)e(prin)m(ting)h | |
14460 | (the)g(primary)f(prompt)f(\()p Ft($PS1)p Fu(\).)40 b(If)28 | |
14461 | b(this)h(is)630 5340 y(set)c(but)f(not)g(an)h(arra)m(y)g(v)-5 | |
14462 | b(ariable,)26 b(its)f(v)-5 b(alue)25 b(is)f(used)g(as)h(a)f(command)g | |
14463 | (to)i(execute)f(instead.)p eop end | |
e59452c7 CR |
14464 | %%Page: 87 93 |
14465 | TeXDict begin 87 92 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14466 | b(Shell)30 b(V)-8 b(ariables)2459 b(87)150 299 y Ft(PROMPT_DIRTRIM)630 | |
d37a4722 CR |
14467 | 408 y Fu(If)27 b(set)g(to)h(a)g(n)m(um)m(b)s(er)e(greater)i(than)f |
14468 | (zero,)i(the)e(v)-5 b(alue)28 b(is)f(used)g(as)g(the)h(n)m(um)m(b)s(er) | |
e59452c7 CR |
14469 | e(of)h(trailing)630 518 y(directory)c(comp)s(onen)m(ts)h(to)f(retain)h |
14470 | (when)e(expanding)g(the)h Ft(\\w)g Fu(and)f Ft(\\W)g | |
14471 | Fu(prompt)h(string)f(es-)630 628 y(cap)s(es)i(\(see)h(Section)g(6.9)g | |
14472 | ([Con)m(trolling)g(the)f(Prompt],)i(page)e(103\).)41 | |
14473 | b(Characters)24 b(remo)m(v)m(ed)630 737 y(are)31 b(replaced)g(with)f | |
d37a4722 CR |
14474 | (an)g(ellipsis.)150 892 y Ft(PS0)336 b Fu(The)32 b(v)-5 |
14475 | b(alue)33 b(of)g(this)g(parameter)g(is)g(expanded)e(lik)m(e)j | |
14476 | Ft(PS1)e Fu(and)g(displa)m(y)m(ed)i(b)m(y)e(in)m(teractiv)m(e)630 | |
14477 | 1002 y(shells)e(after)h(reading)g(a)g(command)f(and)f(b)s(efore)h(the)h | |
14478 | (command)f(is)h(executed.)150 1157 y Ft(PS3)336 b Fu(The)34 | |
14479 | b(v)-5 b(alue)35 b(of)f(this)g(v)-5 b(ariable)35 b(is)g(used)e(as)i | |
14480 | (the)f(prompt)g(for)g(the)g Ft(select)f Fu(command.)52 | |
14481 | b(If)630 1267 y(this)30 b(v)-5 b(ariable)31 b(is)g(not)f(set,)i(the)e | |
14482 | Ft(select)f Fu(command)h(prompts)f(with)h(`)p Ft(#?)g | |
e59452c7 CR |
14483 | Fu(')150 1422 y Ft(PS4)336 b Fu(The)38 b(v)-5 b(alue)39 |
14484 | b(of)g(this)g(parameter)g(is)g(expanded)f(lik)m(e)i Ft(PS1)e | |
14485 | Fu(and)g(the)h(expanded)f(v)-5 b(alue)39 b(is)630 1532 | |
14486 | y(the)c(prompt)f(prin)m(ted)g(b)s(efore)g(the)h(command)f(line)h(is)g | |
14487 | (ec)m(ho)s(ed)g(when)f(the)h Ft(-x)f Fu(option)h(is)630 | |
d37a4722 | 14488 | 1641 y(set)k(\(see)h(Section)g(4.3.1)g([The)f(Set)g(Builtin],)j(page)e |
e59452c7 | 14489 | (66\).)67 b(The)38 b(\014rst)g(c)m(haracter)j(of)e(the)630 |
d37a4722 | 14490 | 1751 y(expanded)33 b(v)-5 b(alue)33 b(is)h(replicated)g(m)m(ultiple)g |
091c6bc4 | 14491 | (times,)h(as)f(necessary)-8 b(,)35 b(to)f(indicate)g(m)m(ultiple)630 |
d37a4722 CR |
14492 | 1861 y(lev)m(els)e(of)e(indirection.)42 b(The)29 b(default)i(is)f(`)p |
14493 | Ft(+)h Fu('.)150 2016 y Ft(PWD)336 b Fu(The)30 b(curren)m(t)g(w)m | |
091c6bc4 | 14494 | (orking)h(directory)g(as)f(set)h(b)m(y)f(the)h Ft(cd)f |
d37a4722 | 14495 | Fu(builtin.)150 2171 y Ft(RANDOM)192 b Fu(Eac)m(h)26 |
091c6bc4 | 14496 | b(time)g(this)f(parameter)h(is)g(referenced,)g(it)g(expands)f(to)h(a)g |
d37a4722 | 14497 | (random)e(in)m(teger)j(b)s(et)m(w)m(een)630 2281 y(0)e(and)e(32767.)41 |
091c6bc4 CR |
14498 | b(Assigning)25 b(a)f(v)-5 b(alue)25 b(to)g(this)f(v)-5 |
14499 | b(ariable)25 b(seeds)f(the)h(random)e(n)m(um)m(b)s(er)g(gener-)630 | |
d37a4722 | 14500 | 2390 y(ator.)41 b(If)27 b Ft(RANDOM)f Fu(is)h(unset,)h(it)g(loses)h |
091c6bc4 | 14501 | (its)f(sp)s(ecial)g(prop)s(erties,)g(ev)m(en)g(if)g(it)g(is)f |
e59452c7 CR |
14502 | (subsequen)m(tly)630 2500 y(reset.)150 2655 y Ft(READLINE_ARGUMENT)630 |
14503 | 2765 y Fu(An)m(y)37 b(n)m(umeric)f(argumen)m(t)h(giv)m(en)g(to)g(a)g | |
14504 | (Readline)g(command)f(that)h(w)m(as)g(de\014ned)e(using)630 | |
14505 | 2874 y(`)p Ft(bind)29 b(-x)p Fu(')h(\(see)i(Section)f(4.2)g([Bash)g | |
14506 | (Builtins],)g(page)h(54,)f(when)e(it)i(w)m(as)g(in)m(v)m(ok)m(ed.)150 | |
14507 | 3029 y Ft(READLINE_LINE)630 3139 y Fu(The)c(con)m(ten)m(ts)i(of)f(the)g | |
14508 | (Readline)g(line)g(bu\013er,)f(for)h(use)f(with)g(`)p | |
14509 | Ft(bind)j(-x)p Fu(')d(\(see)h(Section)h(4.2)630 3249 | |
14510 | y([Bash)i(Builtins],)g(page)g(54\).)150 3404 y Ft(READLINE_MARK)630 | |
14511 | 3513 y Fu(The)26 b(p)s(osition)h(of)g(the)g Fr(mark)32 | |
14512 | b Fu(\(sa)m(v)m(ed)c(insertion)f(p)s(oin)m(t\))g(in)g(the)g(Readline)g | |
14513 | (line)g(bu\013er,)g(for)630 3623 y(use)36 b(with)f(`)p | |
14514 | Ft(bind)30 b(-x)p Fu(')35 b(\(see)i(Section)g(4.2)g([Bash)f(Builtins],) | |
14515 | i(page)f(54\).)58 b(The)35 b(c)m(haracters)630 3733 y(b)s(et)m(w)m(een) | |
14516 | c(the)g(insertion)f(p)s(oin)m(t)g(and)g(the)h(mark)f(are)h(often)f | |
14517 | (called)i(the)f Fr(region)p Fu(.)150 3888 y Ft(READLINE_POINT)630 | |
14518 | 3998 y Fu(The)23 b(p)s(osition)g(of)g(the)h(insertion)f(p)s(oin)m(t)g | |
14519 | (in)g(the)g(Readline)h(line)f(bu\013er,)h(for)f(use)g(with)g(`)p | |
14520 | Ft(bind)630 4107 y(-x)p Fu(')30 b(\(see)h(Section)h(4.2)f([Bash)g | |
14521 | (Builtins],)g(page)g(54\).)150 4262 y Ft(REPLY)240 b | |
14522 | Fu(The)30 b(default)g(v)-5 b(ariable)32 b(for)e(the)g | |
14523 | Ft(read)g Fu(builtin.)150 4418 y Ft(SECONDS)144 b Fu(This)40 | |
14524 | b(v)-5 b(ariable)41 b(expands)f(to)h(the)g(n)m(um)m(b)s(er)e(of)i | |
14525 | (seconds)g(since)g(the)f(shell)h(w)m(as)g(started.)630 | |
14526 | 4527 y(Assignmen)m(t)i(to)g(this)g(v)-5 b(ariable)43 | |
8d125d8b | 14527 | b(resets)g(the)g(coun)m(t)g(to)g(the)g(v)-5 b(alue)43 |
e59452c7 | 14528 | b(assigned,)j(and)c(the)630 4637 y(expanded)35 b(v)-5 |
8d125d8b | 14529 | b(alue)36 b(b)s(ecomes)h(the)f(v)-5 b(alue)36 b(assigned)g(plus)f(the)h |
5e6f45d9 CR |
14530 | (n)m(um)m(b)s(er)f(of)h(seconds)g(since)630 4746 y(the)41 |
14531 | b(assignmen)m(t.)72 b(The)40 b(n)m(um)m(b)s(er)f(of)i(seconds)f(at)h | |
14532 | (shell)g(in)m(v)m(o)s(cation)i(and)c(the)i(curren)m(t)630 | |
14533 | 4856 y(time)30 b(are)g(alw)m(a)m(ys)g(determined)f(b)m(y)g(querying)g | |
14534 | (the)h(system)f(clo)s(c)m(k.)42 b(If)29 b Ft(SECONDS)e | |
14535 | Fu(is)i(unset,)630 4966 y(it)i(loses)g(its)g(sp)s(ecial)g(prop)s | |
14536 | (erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)e(reset.)150 | |
14537 | 5121 y Ft(SHELL)240 b Fu(This)24 b(en)m(vironmen)m(t)i(v)-5 | |
14538 | b(ariable)26 b(expands)e(to)i(the)g(full)f(pathname)g(to)h(the)f | |
14539 | (shell.)39 b(If)25 b(it)g(is)h(not)630 5230 y(set)36 | |
14540 | b(when)f(the)h(shell)g(starts,)i(Bash)e(assigns)h(to)f(it)h(the)f(full) | |
14541 | f(pathname)h(of)g(the)g(curren)m(t)630 5340 y(user's)30 | |
14542 | b(login)h(shell.)p eop end | |
e59452c7 CR |
14543 | %%Page: 88 94 |
14544 | TeXDict begin 88 93 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14545 | b(Shell)30 b(V)-8 b(ariables)2459 b(88)150 299 y Ft(SHELLOPTS)630 | |
14546 | 408 y Fu(A)31 b(colon-separated)h(list)f(of)g(enabled)f(shell)h | |
14547 | (options.)41 b(Eac)m(h)31 b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 | |
14548 | b(alid)630 518 y(argumen)m(t)28 b(for)f(the)h Ft(-o)e | |
14549 | Fu(option)i(to)g(the)g Ft(set)e Fu(builtin)h(command)g(\(see)i(Section) | |
14550 | f(4.3.1)h([The)630 628 y(Set)g(Builtin],)h(page)f(66\).)42 | |
14551 | b(The)28 b(options)h(app)s(earing)f(in)g Ft(SHELLOPTS)e | |
14552 | Fu(are)j(those)h(rep)s(orted)630 737 y(as)g(`)p Ft(on)p | |
14553 | Fu(')f(b)m(y)h(`)p Ft(set)g(-o)p Fu('.)40 b(If)29 b(this)h(v)-5 | |
14554 | b(ariable)30 b(is)g(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)h | |
14555 | (starts)g(up,)630 847 y(eac)m(h)41 b(shell)e(option)h(in)f(the)h(list)g | |
14556 | (will)f(b)s(e)g(enabled)h(b)s(efore)f(reading)g(an)m(y)h(startup)f | |
14557 | (\014les.)630 956 y(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 | |
14558 | b(.)150 1121 y Ft(SHLVL)240 b Fu(Incremen)m(ted)21 b(b)m(y)g(one)g(eac) | |
14559 | m(h)h(time)f(a)h(new)e(instance)h(of)g(Bash)g(is)g(started.)38 | |
14560 | b(This)20 b(is)h(in)m(tended)630 1230 y(to)31 b(b)s(e)f(a)h(coun)m(t)g | |
14561 | (of)f(ho)m(w)h(deeply)f(y)m(our)g(Bash)h(shells)f(are)h(nested.)150 | |
14562 | 1395 y Ft(SRANDOM)144 b Fu(This)36 b(v)-5 b(ariable)37 | |
14563 | b(expands)f(to)h(a)g(32-bit)h(pseudo-random)d(n)m(um)m(b)s(er)g(eac)m | |
14564 | (h)j(time)f(it)g(is)g(ref-)630 1504 y(erenced.)47 b(The)32 | |
14565 | b(random)g(n)m(um)m(b)s(er)f(generator)j(is)e(not)h(linear)g(on)f | |
14566 | (systems)h(that)g(supp)s(ort)630 1614 y Ft(/dev/urandom)26 | |
14567 | b Fu(or)k Ft(arc4random)p Fu(,)d(so)j(eac)m(h)g(returned)f(n)m(um)m(b)s | |
14568 | (er)f(has)h(no)g(relationship)h(to)630 1724 y(the)39 | |
14569 | b(n)m(um)m(b)s(ers)e(preceding)i(it.)66 b(The)38 b(random)g(n)m(um)m(b) | |
14570 | s(er)f(generator)j(cannot)g(b)s(e)e(seeded,)630 1833 | |
14571 | y(so)c(assignmen)m(ts)g(to)g(this)f(v)-5 b(ariable)34 | |
14572 | b(ha)m(v)m(e)h(no)e(e\013ect.)51 b(If)33 b Ft(SRANDOM)e | |
14573 | Fu(is)j(unset,)g(it)f(loses)i(its)630 1943 y(sp)s(ecial)c(prop)s | |
14574 | (erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f(reset.)150 | |
14575 | 2107 y Ft(TIMEFORMAT)630 2217 y Fu(The)g(v)-5 b(alue)32 | |
14576 | b(of)f(this)g(parameter)g(is)g(used)f(as)h(a)g(format)h(string)f(sp)s | |
14577 | (ecifying)f(ho)m(w)h(the)g(tim-)630 2326 y(ing)37 b(information)f(for)h | |
14578 | (pip)s(elines)f(pre\014xed)f(with)h(the)h Ft(time)e Fu(reserv)m(ed)i(w) | |
14579 | m(ord)f(should)g(b)s(e)630 2436 y(displa)m(y)m(ed.)k(The)27 | |
14580 | b(`)p Ft(\045)p Fu(')h(c)m(haracter)h(in)m(tro)s(duces)e(an)h(escap)s | |
14581 | (e)g(sequence)g(that)g(is)f(expanded)g(to)630 2545 y(a)37 | |
14582 | b(time)g(v)-5 b(alue)36 b(or)h(other)f(information.)59 | |
14583 | b(The)36 b(escap)s(e)g(sequences)h(and)e(their)i(meanings)630 | |
14584 | 2655 y(are)31 b(as)f(follo)m(ws;)i(the)f(braces)f(denote)h(optional)h | |
14585 | (p)s(ortions.)630 2819 y Ft(\045\045)384 b Fu(A)30 b(literal)i(`)p | |
14586 | Ft(\045)p Fu('.)630 2984 y Ft(\045[)p Fj(p)p Ft(][l]R)96 | |
14587 | b Fu(The)30 b(elapsed)h(time)g(in)f(seconds.)630 3148 | |
14588 | y Ft(\045[)p Fj(p)p Ft(][l]U)96 b Fu(The)30 b(n)m(um)m(b)s(er)f(of)h | |
14589 | (CPU)g(seconds)h(sp)s(en)m(t)f(in)g(user)f(mo)s(de.)630 | |
14590 | 3313 y Ft(\045[)p Fj(p)p Ft(][l]S)96 b Fu(The)30 b(n)m(um)m(b)s(er)f | |
14591 | (of)h(CPU)g(seconds)h(sp)s(en)m(t)f(in)g(system)g(mo)s(de.)630 | |
14592 | 3477 y Ft(\045P)384 b Fu(The)30 b(CPU)g(p)s(ercen)m(tage,)i(computed)e | |
14593 | (as)h(\(\045U)f Ft(+)g Fu(\045S\))g(/)h(\045R.)630 3641 | |
14594 | y(The)23 b(optional)j Fr(p)g Fu(is)e(a)g(digit)h(sp)s(ecifying)e(the)h | |
14595 | (precision,)i(the)e(n)m(um)m(b)s(er)f(of)h(fractional)h(digits)630 | |
14596 | 3751 y(after)36 b(a)f(decimal)i(p)s(oin)m(t.)55 b(A)35 | |
14597 | b(v)-5 b(alue)36 b(of)f(0)h(causes)g(no)f(decimal)h(p)s(oin)m(t)f(or)h | |
14598 | (fraction)g(to)g(b)s(e)630 3861 y(output.)48 b(A)m(t)34 | |
14599 | b(most)f(three)g(places)h(after)f(the)g(decimal)h(p)s(oin)m(t)f(ma)m(y) | |
14600 | h(b)s(e)e(sp)s(eci\014ed;)i(v)-5 b(alues)630 3970 y(of)31 | |
14601 | b Fr(p)h Fu(greater)g(than)e(3)h(are)f(c)m(hanged)h(to)g(3.)42 | |
e2169ae9 | 14602 | b(If)29 b Fr(p)k Fu(is)d(not)h(sp)s(eci\014ed,)f(the)h(v)-5 |
e59452c7 | 14603 | b(alue)30 b(3)h(is)g(used.)630 4107 y(The)54 b(optional)h |
e2169ae9 | 14604 | Ft(l)f Fu(sp)s(eci\014es)g(a)h(longer)f(format,)61 b(including)54 |
e59452c7 | 14605 | b(min)m(utes,)61 b(of)54 b(the)g(form)630 4217 y Fr(MM)10 |
e2169ae9 CR |
14606 | b Fu(m)p Fr(SS)p Fu(.)p Fr(FF)d Fu(s.)103 b(The)50 b(v)-5 |
14607 | b(alue)52 b(of)f Fr(p)j Fu(determines)d(whether)f(or)h(not)h(the)f | |
e59452c7 | 14608 | (fraction)h(is)630 4326 y(included.)630 4463 y(If)30 |
e2169ae9 | 14609 | b(this)g(v)-5 b(ariable)31 b(is)g(not)f(set,)i(Bash)e(acts)h(as)g(if)f |
e59452c7 | 14610 | (it)h(had)f(the)h(v)-5 b(alue)870 4600 y Ft |
33723c84 | 14611 | ($'\\nreal\\t\0453lR\\nuser\\t\0453)o(lU\\n)o(sys\\)o(t\0453)o(lS')630 |
e59452c7 | 14612 | 4737 y Fu(If)37 b(the)g(v)-5 b(alue)38 b(is)f(n)m(ull,)i(no)f(timing)f |
33723c84 | 14613 | (information)h(is)f(displa)m(y)m(ed.)62 b(A)37 b(trailing)i(newline)e |
e59452c7 CR |
14614 | (is)630 4847 y(added)30 b(when)f(the)i(format)f(string)h(is)f(displa)m |
14615 | (y)m(ed.)150 5011 y Ft(TMOUT)240 b Fu(If)22 b(set)h(to)g(a)g(v)-5 | |
8d125d8b | 14616 | b(alue)23 b(greater)h(than)e(zero,)j Ft(TMOUT)d Fu(is)g(treated)i(as)e |
e59452c7 | 14617 | (the)h(default)g(timeout)g(for)g(the)630 5121 y Ft(read)31 |
8d125d8b | 14618 | b Fu(builtin)h(\(see)h(Section)f(4.2)i([Bash)e(Builtins],)h(page)g |
e59452c7 | 14619 | (54\).)47 b(The)32 b Ft(select)e Fu(command)630 5230 |
d37a4722 | 14620 | y(\(see)f(Section)h(3.2.5.2)g([Conditional)g(Constructs],)e(page)i |
e59452c7 | 14621 | (12\))f(terminates)g(if)g(input)e(do)s(es)630 5340 y(not)k(arriv)m(e)g |
8d125d8b | 14622 | (after)g Ft(TMOUT)e Fu(seconds)h(when)f(input)h(is)g(coming)h(from)f(a) |
e59452c7 CR |
14623 | h(terminal.)p eop end |
14624 | %%Page: 89 95 | |
14625 | TeXDict begin 89 94 bop 150 -116 a Fu(Chapter)30 b(5:)41 | |
14626 | b(Shell)30 b(V)-8 b(ariables)2459 b(89)630 299 y(In)40 | |
14627 | b(an)h(in)m(teractiv)m(e)i(shell,)h(the)d(v)-5 b(alue)41 | |
14628 | b(is)g(in)m(terpreted)g(as)f(the)h(n)m(um)m(b)s(er)f(of)h(seconds)f(to) | |
14629 | 630 408 y(w)m(ait)28 b(for)e(a)g(line)h(of)g(input)e(after)i(issuing)f | |
14630 | (the)h(primary)e(prompt.)39 b(Bash)26 b(terminates)h(after)630 | |
14631 | 518 y(w)m(aiting)32 b(for)e(that)h(n)m(um)m(b)s(er)e(of)h(seconds)h(if) | |
14632 | f(a)h(complete)h(line)e(of)h(input)e(do)s(es)h(not)h(arriv)m(e.)150 | |
14633 | 677 y Ft(TMPDIR)192 b Fu(If)39 b(set,)j(Bash)e(uses)f(its)h(v)-5 | |
14634 | b(alue)40 b(as)f(the)h(name)f(of)h(a)g(directory)g(in)f(whic)m(h)g | |
14635 | (Bash)h(creates)630 787 y(temp)s(orary)30 b(\014les)g(for)g(the)h | |
14636 | (shell's)g(use.)150 946 y Ft(UID)336 b Fu(The)30 b(n)m(umeric)g(real)h | |
14637 | (user)f(id)g(of)g(the)h(curren)m(t)f(user.)40 b(This)30 | |
14638 | b(v)-5 b(ariable)31 b(is)f(readonly)-8 b(.)p eop end | |
14639 | %%Page: 90 96 | |
14640 | TeXDict begin 90 95 bop 3659 -116 a Fu(90)150 299 y Fp(6)80 | |
967625cd CR |
14641 | b(Bash)54 b(F)-13 b(eatures)150 502 y Fu(This)30 b(c)m(hapter)h |
14642 | (describ)s(es)e(features)i(unique)e(to)i(Bash.)150 731 | |
14643 | y Fs(6.1)68 b(In)l(v)l(oking)46 b(Bash)390 890 y Ft(bash)h([long-opt])e | |
6e51e0d0 | 14644 | ([-ir])h([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)p |
12beeabf CR |
14645 | Ft(])581 1000 y([-O)g Fj(shopt_option)p Ft(])d([)p Fj(argument)h |
14646 | Ft(...)o(])390 1110 y(bash)i([long-opt])e([-abefhkmnptuvxdBCDHP])c([-o) | |
14647 | 47 b Fj(option)p Ft(])581 1219 y([-O)g Fj(shopt_option)p | |
14648 | Ft(])d(-c)j Fj(string)f Ft([)p Fj(argument)g Ft(...)o(])390 | |
14649 | 1329 y(bash)h([long-opt])e(-s)i([-abefhkmnptuvxdBCDHP])42 | |
14650 | b([-o)k Fj(option)p Ft(])581 1438 y([-O)h Fj(shopt_option)p | |
14651 | Ft(])d([)p Fj(argument)h Ft(...)o(])275 1567 y Fu(All)31 | |
14652 | b(of)g(the)f(single-c)m(haracter)k(options)d(used)f(with)g(the)h | |
14653 | Ft(set)f Fu(builtin)g(\(see)h(Section)h(4.3.1)g([The)f(Set)150 | |
e59452c7 | 14654 | 1676 y(Builtin],)45 b(page)c(66\))i(can)e(b)s(e)f(used)h(as)g(options)g |
12beeabf CR |
14655 | (when)f(the)i(shell)f(is)g(in)m(v)m(ok)m(ed.)74 b(In)41 |
14656 | b(addition,)j(there)150 1786 y(are)38 b(sev)m(eral)h(m)m(ulti-c)m | |
14657 | (haracter)h(options)d(that)h(y)m(ou)g(can)g(use.)61 b(These)38 | |
14658 | b(options)f(m)m(ust)h(app)s(ear)e(on)i(the)150 1896 y(command)30 | |
14659 | b(line)h(b)s(efore)f(the)g(single-c)m(haracter)j(options)e(to)g(b)s(e)f | |
14660 | (recognized.)150 2043 y Ft(--debugger)630 2152 y Fu(Arrange)j(for)g | |
14661 | (the)g(debugger)g(pro\014le)g(to)h(b)s(e)e(executed)i(b)s(efore)f(the)g | |
14662 | (shell)g(starts.)49 b(T)-8 b(urns)630 2262 y(on)35 b(extended)g | |
14663 | (debugging)f(mo)s(de)h(\(see)g(Section)h(4.3.2)h([The)d(Shopt)g | |
e59452c7 | 14664 | (Builtin],)j(page)f(70,)630 2371 y(for)30 b(a)h(description)f(of)h(the) |
12beeabf CR |
14665 | f Ft(extdebug)f Fu(option)h(to)h(the)g Ft(shopt)e Fu(builtin\).)150 |
14666 | 2519 y Ft(--dump-po-strings)630 2628 y Fu(A)37 b(list)g(of)f(all)i | |
6e51e0d0 | 14667 | (double-quoted)e(strings)g(preceded)g(b)m(y)h(`)p Ft($)p |
967625cd | 14668 | Fu(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 2738 |
6e51e0d0 CR |
14669 | y(output)29 b(in)g(the)g Fm(gnu)g Ft(gettext)f Fu(PO)g(\(p)s(ortable)i |
14670 | (ob)5 b(ject\))30 b(\014le)g(format.)40 b(Equiv)-5 b(alen)m(t)31 | |
967625cd CR |
14671 | b(to)f Ft(-D)630 2847 y Fu(except)h(for)f(the)h(output)f(format.)150 |
14672 | 2995 y Ft(--dump-strings)630 3104 y Fu(Equiv)-5 b(alen)m(t)31 | |
14673 | b(to)g Ft(-D)p Fu(.)150 3251 y Ft(--help)192 b Fu(Displa)m(y)32 | |
6e51e0d0 | 14674 | b(a)e(usage)h(message)h(on)e(standard)g(output)g(and)f(exit)j |
967625cd CR |
14675 | (successfully)-8 b(.)150 3399 y Ft(--init-file)27 b Fj(filename)150 |
14676 | 3508 y Ft(--rcfile)h Fj(filename)630 3618 y Fu(Execute)23 | |
6e51e0d0 CR |
14677 | b(commands)e(from)g Fr(\014lename)28 b Fu(\(instead)22 |
14678 | b(of)g Ft(~/.bashrc)p Fu(\))e(in)h(an)h(in)m(teractiv)m(e)i(shell.)150 | |
967625cd CR |
14679 | 3765 y Ft(--login)144 b Fu(Equiv)-5 b(alen)m(t)31 b(to)g |
14680 | Ft(-l)p Fu(.)150 3912 y Ft(--noediting)630 4022 y Fu(Do)h(not)e(use)h | |
6e51e0d0 | 14681 | (the)g Fm(gnu)f Fu(Readline)i(library)e(\(see)h(Chapter)g(8)g([Command) |
fffe80d4 | 14682 | f(Line)g(Editing],)630 4131 y(page)h(116\))h(to)f(read)g(command)f |
6e51e0d0 | 14683 | (lines)g(when)g(the)g(shell)h(is)f(in)m(teractiv)m(e.)150 |
967625cd | 14684 | 4278 y Ft(--noprofile)630 4388 y Fu(Don't)22 b(load)g(the)g |
6e51e0d0 | 14685 | (system-wide)f(startup)g(\014le)h Ft(/etc/profile)c Fu(or)j(an)m(y)h |
967625cd | 14686 | (of)f(the)h(p)s(ersonal)f(ini-)630 4498 y(tialization)34 |
6e51e0d0 | 14687 | b(\014les)e Ft(~/.bash_profile)p Fu(,)c Ft(~/.bash_login)p |
967625cd | 14688 | Fu(,)g(or)k Ft(~/.profile)c Fu(when)j(Bash)630 4607 y(is)f(in)m(v)m(ok) |
6e51e0d0 CR |
14689 | m(ed)i(as)f(a)g(login)g(shell.)150 4754 y Ft(--norc)192 |
14690 | b Fu(Don't)35 b(read)f(the)g Ft(~/.bashrc)e Fu(initialization)k(\014le) | |
14691 | f(in)e(an)h(in)m(teractiv)m(e)j(shell.)52 b(This)33 b(is)h(on)630 | |
967625cd | 14692 | 4864 y(b)m(y)c(default)h(if)f(the)h(shell)f(is)h(in)m(v)m(ok)m(ed)h(as) |
6e51e0d0 CR |
14693 | e Ft(sh)p Fu(.)150 5011 y Ft(--posix)144 b Fu(Change)24 |
14694 | b(the)h(b)s(eha)m(vior)f(of)g(Bash)h(where)e(the)i(default)f(op)s | |
14695 | (eration)h(di\013ers)f(from)f(the)i Fm(posix)630 5121 | |
14696 | y Fu(standard)35 b(to)h(matc)m(h)g(the)g(standard.)55 | |
eb0b2ad8 | 14697 | b(This)35 b(is)h(in)m(tended)f(to)h(mak)m(e)h(Bash)f(b)s(eha)m(v)m(e)g |
602eae4d | 14698 | (as)g(a)630 5230 y(strict)22 b(sup)s(erset)e(of)h(that)g(standard.)37 |
e59452c7 | 14699 | b(See)21 b(Section)h(6.11)g([Bash)f(POSIX)f(Mo)s(de],)k(page)d(105,)630 |
602eae4d | 14700 | 5340 y(for)30 b(a)h(description)f(of)h(the)f(Bash)h Fm(posix)f |
6e51e0d0 | 14701 | Fu(mo)s(de.)p eop end |
e59452c7 CR |
14702 | %%Page: 91 97 |
14703 | TeXDict begin 91 96 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14704 | b(Bash)30 b(F)-8 b(eatures)2484 b(91)150 299 y Ft(--restricted)630 | |
6e51e0d0 CR |
14705 | 408 y Fu(Mak)m(e)54 b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h |
14706 | (Section)g(6.10)h([The)d(Restricted)j(Shell],)630 518 | |
e59452c7 | 14707 | y(page)31 b(104\).)150 677 y Ft(--verbose)630 787 y Fu(Equiv)-5 |
6e51e0d0 | 14708 | b(alen)m(t)31 b(to)g Ft(-v)p Fu(.)41 b(Prin)m(t)30 b(shell)g(input)g |
560db36b CR |
14709 | (lines)g(as)h(they're)g(read.)150 946 y Ft(--version)630 |
14710 | 1056 y Fu(Sho)m(w)d(v)m(ersion)g(information)g(for)g(this)g(instance)h | |
14711 | (of)f(Bash)g(on)g(the)g(standard)f(output)h(and)630 1166 | |
14712 | y(exit)j(successfully)-8 b(.)275 1325 y(There)28 b(are)i(sev)m(eral)g | |
6e51e0d0 | 14713 | (single-c)m(haracter)i(options)d(that)h(ma)m(y)g(b)s(e)e(supplied)g(at) |
560db36b | 14714 | i(in)m(v)m(o)s(cation)h(whic)m(h)e(are)150 1435 y(not)i(a)m(v)-5 |
6e51e0d0 | 14715 | b(ailable)32 b(with)e(the)h Ft(set)e Fu(builtin.)150 |
560db36b CR |
14716 | 1594 y Ft(-c)384 b Fu(Read)66 b(and)f(execute)i(commands)e(from)g(the)h |
14717 | (\014rst)e(non-option)i(argumen)m(t)g Fr(com-)630 1704 | |
14718 | y(mand)p 859 1704 28 4 v 39 w(string)p Fu(,)34 b(then)e(exit.)49 | |
fc527055 | 14719 | b(If)32 b(there)h(are)g(argumen)m(ts)g(after)g(the)g |
560db36b CR |
14720 | Fr(command)p 3303 1704 V 40 w(string)p Fu(,)h(the)630 |
14721 | 1813 y(\014rst)e(argumen)m(t)h(is)g(assigned)g(to)h Ft($0)e | |
fc527055 | 14722 | Fu(and)h(an)m(y)g(remaining)g(argumen)m(ts)g(are)g(assigned)g(to)630 |
560db36b | 14723 | 1923 y(the)38 b(p)s(ositional)h(parameters.)65 b(The)37 |
fc527055 | 14724 | b(assignmen)m(t)i(to)g Ft($0)f Fu(sets)g(the)h(name)f(of)g(the)g |
560db36b CR |
14725 | (shell,)630 2032 y(whic)m(h)30 b(is)h(used)e(in)h(w)m(arning)g(and)g |
14726 | (error)g(messages.)150 2192 y Ft(-i)384 b Fu(F)-8 b(orce)22 | |
eb0b2ad8 CR |
14727 | b(the)g(shell)f(to)g(run)f(in)m(teractiv)m(ely)-8 b(.)41 |
14728 | b(In)m(teractiv)m(e)23 b(shells)e(are)h(describ)s(ed)d(in)i(Section)h | |
e59452c7 | 14729 | (6.3)630 2301 y([In)m(teractiv)m(e)33 b(Shells],)e(page)g(93.)150 |
560db36b | 14730 | 2461 y Ft(-l)384 b Fu(Mak)m(e)33 b(this)e(shell)h(act)g(as)g(if)f(it)h |
eb0b2ad8 | 14731 | (had)f(b)s(een)f(directly)i(in)m(v)m(ok)m(ed)h(b)m(y)f(login.)44 |
560db36b | 14732 | b(When)31 b(the)h(shell)630 2570 y(is)37 b(in)m(teractiv)m(e,)43 |
eb0b2ad8 | 14733 | b(this)37 b(is)g(equiv)-5 b(alen)m(t)39 b(to)f(starting)h(a)e(login)i |
6e51e0d0 | 14734 | (shell)e(with)g(`)p Ft(exec)30 b(-l)g(bash)p Fu('.)630 |
560db36b | 14735 | 2680 y(When)h(the)g(shell)h(is)f(not)g(in)m(teractiv)m(e,)k(the)c |
eb0b2ad8 | 14736 | (login)h(shell)g(startup)f(\014les)g(will)g(b)s(e)g(executed.)630 |
560db36b | 14737 | 2790 y(`)p Ft(exec)e(bash)h(-l)p Fu(')43 b(or)h(`)p Ft(exec)29 |
6e51e0d0 | 14738 | b(bash)g(--login)p Fu(')42 b(will)i(replace)h(the)f(curren)m(t)f(shell) |
560db36b | 14739 | h(with)g(a)630 2899 y(Bash)26 b(login)g(shell.)39 b(See)26 |
e59452c7 | 14740 | b(Section)g(6.2)h([Bash)e(Startup)g(Files],)j(page)e(92,)i(for)d(a)h |
560db36b CR |
14741 | (description)630 3009 y(of)31 b(the)f(sp)s(ecial)h(b)s(eha)m(vior)g(of) |
14742 | f(a)h(login)g(shell.)150 3168 y Ft(-r)384 b Fu(Mak)m(e)54 | |
37c41ab1 | 14743 | b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h(Section)g(6.10)h([The) |
e59452c7 | 14744 | d(Restricted)j(Shell],)630 3278 y(page)31 b(104\).)150 |
560db36b | 14745 | 3437 y Ft(-s)384 b Fu(If)24 b(this)h(option)h(is)f(presen)m(t,)h(or)f |
eb0b2ad8 | 14746 | (if)g(no)f(argumen)m(ts)i(remain)e(after)i(option)f(pro)s(cessing,)h |
560db36b | 14747 | (then)630 3547 y(commands)i(are)h(read)g(from)f(the)h(standard)f |
eb0b2ad8 | 14748 | (input.)39 b(This)28 b(option)h(allo)m(ws)h(the)f(p)s(ositional)630 |
560db36b CR |
14749 | 3656 y(parameters)i(to)h(b)s(e)e(set)i(when)d(in)m(v)m(oking)k(an)d(in) |
14750 | m(teractiv)m(e)k(shell)d(or)g(when)f(reading)h(input)630 | |
14751 | 3766 y(through)f(a)g(pip)s(e.)150 3925 y Ft(-D)384 b | |
14752 | Fu(A)37 b(list)g(of)f(all)i(double-quoted)e(strings)g(preceded)g(b)m(y) | |
14753 | h(`)p Ft($)p Fu(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 | |
14754 | 4035 y(output.)63 b(These)38 b(are)g(the)g(strings)g(that)h(are)f(sub)5 | |
14755 | b(ject)38 b(to)h(language)g(translation)g(when)630 4144 | |
6e51e0d0 CR |
14756 | y(the)e(curren)m(t)g(lo)s(cale)h(is)f(not)g Ft(C)g Fu(or)f |
14757 | Ft(POSIX)g Fu(\(see)h(Section)h(3.1.2.5)h([Lo)s(cale)g(T)-8 | |
560db36b | 14758 | b(ranslation],)630 4254 y(page)31 b(7\).)42 b(This)29 |
6e51e0d0 | 14759 | b(implies)i(the)f Ft(-n)g Fu(option;)h(no)f(commands)g(will)h(b)s(e)f |
560db36b CR |
14760 | (executed.)150 4413 y Ft([-+]O)f([)p Fj(shopt_option)p |
14761 | Ft(])630 4523 y Fr(shopt)p 854 4523 V 40 w(option)44 | |
6e51e0d0 | 14762 | b Fu(is)g(one)h(of)f(the)g(shell)h(options)f(accepted)h(b)m(y)f(the)h |
560db36b | 14763 | Ft(shopt)d Fu(builtin)i(\(see)630 4633 y(Section)32 b(4.3.2)h([The)e |
e59452c7 | 14764 | (Shopt)f(Builtin],)i(page)g(70\).)44 b(If)31 b Fr(shopt)p |
560db36b CR |
14765 | 2724 4633 V 40 w(option)g Fu(is)g(presen)m(t,)h Ft(-O)f |
14766 | Fu(sets)630 4742 y(the)24 b(v)-5 b(alue)24 b(of)g(that)h(option;)h | |
6e51e0d0 | 14767 | Ft(+O)e Fu(unsets)f(it.)39 b(If)23 b Fr(shopt)p 2423 |
560db36b CR |
14768 | 4742 V 40 w(option)h Fu(is)g(not)g(supplied,)g(the)g(names)630 |
14769 | 4852 y(and)31 b(v)-5 b(alues)32 b(of)g(the)g(shell)g(options)g | |
6e51e0d0 | 14770 | (accepted)h(b)m(y)f Ft(shopt)e Fu(are)i(prin)m(ted)f(on)h(the)g |
560db36b | 14771 | (standard)630 4961 y(output.)40 b(If)29 b(the)h(in)m(v)m(o)s(cation)h |
6e51e0d0 | 14772 | (option)f(is)f Ft(+O)p Fu(,)h(the)f(output)g(is)h(displa)m(y)m(ed)g(in) |
560db36b | 14773 | f(a)h(format)f(that)630 5071 y(ma)m(y)i(b)s(e)f(reused)f(as)i(input.) |
fc527055 | 14774 | 150 5230 y Ft(--)384 b Fu(A)38 b Ft(--)g Fu(signals)g(the)h(end)e(of)i |
6e51e0d0 | 14775 | (options)f(and)g(disables)g(further)f(option)h(pro)s(cessing.)64 |
fc527055 CR |
14776 | b(An)m(y)630 5340 y(argumen)m(ts)31 b(after)g(the)f Ft(--)g |
14777 | Fu(are)h(treated)g(as)g(\014lenames)f(and)g(argumen)m(ts.)p | |
14778 | eop end | |
e59452c7 CR |
14779 | %%Page: 92 98 |
14780 | TeXDict begin 92 97 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14781 | b(Bash)30 b(F)-8 b(eatures)2484 b(92)275 299 y(A)27 b | |
fc527055 CR |
14782 | Fl(lo)-5 b(gin)35 b Fu(shell)27 b(is)g(one)h(whose)f(\014rst)f(c)m |
14783 | (haracter)j(of)e(argumen)m(t)h(zero)f(is)h(`)p Ft(-)p | |
14784 | Fu(',)g(or)f(one)g(in)m(v)m(ok)m(ed)i(with)e(the)150 | |
037a8b7f | 14785 | 408 y Ft(--login)h Fu(option.)275 555 y(An)g Fl(inter)-5 |
fc527055 CR |
14786 | b(active)37 b Fu(shell)30 b(is)f(one)g(started)h(without)f(non-option)h |
14787 | (argumen)m(ts,)g(unless)e Ft(-s)h Fu(is)g(sp)s(eci\014ed,)150 | |
037a8b7f | 14788 | 665 y(without)k(sp)s(ecifying)h(the)f Ft(-c)g Fu(option,)i(and)e(whose) |
fc527055 | 14789 | g(input)g(and)f(output)h(are)h(b)s(oth)f(connected)h(to)g(ter-)150 |
037a8b7f | 14790 | 774 y(minals)g(\(as)g(determined)f(b)m(y)h Ft(isatty\(3\))p |
fc527055 | 14791 | Fu(\),)e(or)i(one)g(started)g(with)f(the)h Ft(-i)f Fu(option.)51 |
037a8b7f | 14792 | b(See)33 b(Section)i(6.3)150 884 y([In)m(teractiv)m(e)e(Shells],)e |
e59452c7 | 14793 | (page)g(93,)g(for)f(more)h(information.)275 1031 y(If)i(argumen)m(ts)h |
fc527055 | 14794 | (remain)g(after)h(option)f(pro)s(cessing,)h(and)e(neither)h(the)g |
037a8b7f | 14795 | Ft(-c)g Fu(nor)f(the)h Ft(-s)g Fu(option)g(has)150 1140 |
fc527055 CR |
14796 | y(b)s(een)44 b(supplied,)j(the)d(\014rst)g(argumen)m(t)h(is)g(assumed)e |
14797 | (to)j(b)s(e)d(the)i(name)g(of)f(a)h(\014le)g(con)m(taining)h(shell)150 | |
037a8b7f | 14798 | 1250 y(commands)30 b(\(see)g(Section)h(3.8)g([Shell)f(Scripts],)g(page) |
3011048a | 14799 | h(46\).)41 b(When)30 b(Bash)g(is)g(in)m(v)m(ok)m(ed)i(in)d(this)h |
037a8b7f | 14800 | (fashion,)150 1359 y Ft($0)37 b Fu(is)g(set)h(to)h(the)e(name)h(of)f |
fc527055 | 14801 | (the)h(\014le,)i(and)c(the)i(p)s(ositional)g(parameters)g(are)g(set)g |
037a8b7f | 14802 | (to)g(the)g(remaining)150 1469 y(argumen)m(ts.)h(Bash)26 |
fc527055 | 14803 | b(reads)f(and)g(executes)h(commands)f(from)g(this)g(\014le,)i(then)e |
037a8b7f | 14804 | (exits.)40 b(Bash's)25 b(exit)i(status)150 1579 y(is)f(the)h(exit)h |
fc527055 | 14805 | (status)e(of)h(the)g(last)g(command)f(executed)h(in)g(the)f(script.)40 |
037a8b7f CR |
14806 | b(If)26 b(no)g(commands)g(are)h(executed,)150 1688 y(the)k(exit)g |
14807 | (status)g(is)f(0.)150 1947 y Fs(6.2)68 b(Bash)45 b(Startup)g(Files)150 | |
14808 | 2107 y Fu(This)23 b(section)j(describ)s(es)d(ho)m(w)i(Bash)f(executes)h | |
c302751c | 14809 | (its)g(startup)f(\014les.)38 b(If)24 b(an)m(y)h(of)f(the)h(\014les)f |
037a8b7f | 14810 | (exist)h(but)e(cannot)150 2216 y(b)s(e)29 b(read,)i(Bash)f(rep)s(orts)f |
122f603c | 14811 | (an)h(error.)40 b(Tildes)30 b(are)g(expanded)f(in)h(\014lenames)g(as)g |
037a8b7f | 14812 | (describ)s(ed)f(ab)s(o)m(v)m(e)i(under)150 2326 y(Tilde)f(Expansion)g |
e59452c7 | 14813 | (\(see)h(Section)h(3.5.2)g([Tilde)e(Expansion],)h(page)g(25\).)275 |
037a8b7f | 14814 | 2473 y(In)m(teractiv)m(e)h(shells)f(are)g(describ)s(ed)e(in)h(Section)h |
e59452c7 | 14815 | (6.3)h([In)m(teractiv)m(e)h(Shells],)d(page)h(93.)150 |
037a8b7f CR |
14816 | 2684 y Fk(In)m(v)m(ok)m(ed)40 b(as)h(an)f(in)m(teractiv)m(e)f(login)j |
14817 | (shell,)g(or)g(with)e Fh(--login)150 2831 y Fu(When)c(Bash)f(is)h(in)m | |
6e51e0d0 | 14818 | (v)m(ok)m(ed)h(as)f(an)g(in)m(teractiv)m(e)j(login)d(shell,)i(or)e(as)g |
037a8b7f | 14819 | (a)g(non-in)m(teractiv)m(e)i(shell)e(with)g(the)150 2940 |
6e51e0d0 CR |
14820 | y Ft(--login)30 b Fu(option,)k(it)f(\014rst)e(reads)h(and)g(executes)i |
14821 | (commands)e(from)f(the)i(\014le)f Ft(/etc/profile)p Fu(,)e(if)i(that) | |
037a8b7f | 14822 | 150 3050 y(\014le)44 b(exists.)80 b(After)44 b(reading)g(that)g |
6e51e0d0 | 14823 | (\014le,)j(it)d(lo)s(oks)g(for)f Ft(~/.bash_profile)p |
037a8b7f | 14824 | Fu(,)g Ft(~/.bash_login)p Fu(,)h(and)150 3160 y Ft(~/.profile)p |
6e51e0d0 | 14825 | Fu(,)25 b(in)i(that)g(order,)h(and)e(reads)h(and)f(executes)j(commands) |
037a8b7f | 14826 | d(from)h(the)g(\014rst)f(one)i(that)f(exists)150 3269 |
6e51e0d0 CR |
14827 | y(and)j(is)h(readable.)42 b(The)30 b Ft(--noprofile)d |
14828 | Fu(option)k(ma)m(y)g(b)s(e)f(used)g(when)g(the)h(shell)f(is)h(started)g | |
037a8b7f | 14829 | (to)g(inhibit)150 3379 y(this)f(b)s(eha)m(vior.)275 3526 |
0385211b CR |
14830 | y(When)h(an)g(in)m(teractiv)m(e)k(login)d(shell)g(exits,)h(or)f(a)g |
14831 | (non-in)m(teractiv)m(e)i(login)f(shell)e(executes)i(the)f | |
037a8b7f | 14832 | Ft(exit)150 3635 y Fu(builtin)g(command,)i(Bash)e(reads)h(and)f |
0385211b | 14833 | (executes)i(commands)e(from)g(the)h(\014le)g Ft(~/.bash_logout)p |
037a8b7f | 14834 | Fu(,)d(if)i(it)150 3745 y(exists.)150 3956 y Fk(In)m(v)m(ok)m(ed)40 |
0385211b | 14835 | b(as)h(an)f(in)m(teractiv)m(e)f(non-login)k(shell)150 |
037a8b7f | 14836 | 4103 y Fu(When)g(an)h(in)m(teractiv)m(e)i(shell)e(that)g(is)f(not)h(a)g |
6e51e0d0 | 14837 | (login)g(shell)g(is)f(started,)48 b(Bash)c(reads)f(and)g(executes)150 |
037a8b7f | 14838 | 4213 y(commands)31 b(from)g Ft(~/.bashrc)p Fu(,)f(if)h(that)h(\014le)g |
6e51e0d0 | 14839 | (exists.)44 b(This)31 b(ma)m(y)h(b)s(e)f(inhibited)g(b)m(y)g(using)g |
037a8b7f | 14840 | (the)h Ft(--norc)150 4322 y Fu(option.)40 b(The)27 b |
6e51e0d0 | 14841 | Ft(--rcfile)h Fj(file)e Fu(option)h(will)g(force)h(Bash)f(to)h(read)f |
037a8b7f CR |
14842 | (and)f(execute)j(commands)d(from)h Fr(\014le)150 4432 |
14843 | y Fu(instead)k(of)f Ft(~/.bashrc)p Fu(.)275 4579 y(So,)g(t)m(ypically) | |
6e51e0d0 | 14844 | -8 b(,)33 b(y)m(our)d Ft(~/.bash_profile)c Fu(con)m(tains)32 |
037a8b7f CR |
14845 | b(the)f(line)390 4725 y Ft(if)47 b([)h(-f)f(~/.bashrc)e(];)i(then)g(.)g |
14846 | (~/.bashrc;)e(fi)150 4872 y Fu(after)31 b(\(or)g(b)s(efore\))f(an)m(y)h | |
14847 | (login-sp)s(eci\014c)g(initializations.)150 5083 y Fk(In)m(v)m(ok)m(ed) | |
14848 | 40 b(non-in)m(teractiv)m(ely)150 5230 y Fu(When)33 b(Bash)g(is)g | |
6e51e0d0 CR |
14849 | (started)h(non-in)m(teractiv)m(ely)-8 b(,)37 b(to)d(run)e(a)h(shell)h |
14850 | (script,)g(for)f(example,)i(it)e(lo)s(oks)h(for)f(the)150 | |
037a8b7f | 14851 | 5340 y(v)-5 b(ariable)35 b Ft(BASH_ENV)d Fu(in)i(the)h(en)m(vironmen)m |
6e51e0d0 | 14852 | (t,)h(expands)e(its)g(v)-5 b(alue)35 b(if)g(it)g(app)s(ears)e(there,)j |
037a8b7f | 14853 | (and)e(uses)g(the)p eop end |
e59452c7 CR |
14854 | %%Page: 93 99 |
14855 | TeXDict begin 93 98 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14856 | b(Bash)30 b(F)-8 b(eatures)2484 b(93)150 299 y(expanded)30 | |
037a8b7f CR |
14857 | b(v)-5 b(alue)30 b(as)h(the)g(name)f(of)h(a)f(\014le)h(to)g(read)f(and) |
14858 | g(execute.)42 b(Bash)31 b(b)s(eha)m(v)m(es)g(as)g(if)f(the)g(follo)m | |
14859 | (wing)150 408 y(command)g(w)m(ere)h(executed:)390 552 | |
14860 | y Ft(if)47 b([)h(-n)f("$BASH_ENV")e(];)i(then)f(.)i("$BASH_ENV";)c(fi) | |
14861 | 150 696 y Fu(but)30 b(the)g(v)-5 b(alue)31 b(of)g(the)f | |
14862 | Ft(PATH)f Fu(v)-5 b(ariable)32 b(is)e(not)h(used)e(to)i(searc)m(h)g | |
14863 | (for)f(the)h(\014lename.)275 840 y(As)42 b(noted)g(ab)s(o)m(v)m(e,)47 | |
fc527055 | 14864 | b(if)42 b(a)h(non-in)m(teractiv)m(e)i(shell)d(is)g(in)m(v)m(ok)m(ed)i |
037a8b7f | 14865 | (with)e(the)h Ft(--login)d Fu(option,)46 b(Bash)150 949 |
fc527055 | 14866 | y(attempts)31 b(to)g(read)g(and)e(execute)j(commands)e(from)g(the)h |
037a8b7f CR |
14867 | (login)g(shell)g(startup)e(\014les.)150 1158 y Fk(In)m(v)m(ok)m(ed)40 |
14868 | b(with)g(name)h Fh(sh)150 1305 y Fu(If)c(Bash)g(is)g(in)m(v)m(ok)m(ed)i | |
fc527055 | 14869 | (with)e(the)g(name)g Ft(sh)p Fu(,)i(it)f(tries)f(to)h(mimic)g(the)f |
037a8b7f | 14870 | (startup)g(b)s(eha)m(vior)g(of)h(historical)150 1414 |
fc527055 CR |
14871 | y(v)m(ersions)31 b(of)f Ft(sh)g Fu(as)h(closely)h(as)e(p)s(ossible,)g |
14872 | (while)h(conforming)f(to)h(the)g Fm(posix)e Fu(standard)h(as)h(w)m | |
037a8b7f | 14873 | (ell.)275 1558 y(When)50 b(in)m(v)m(ok)m(ed)j(as)f(an)f(in)m(teractiv)m |
fc527055 | 14874 | (e)j(login)e(shell,)57 b(or)51 b(as)g(a)h(non-in)m(teractiv)m(e)h |
037a8b7f | 14875 | (shell)f(with)f(the)150 1668 y Ft(--login)31 b Fu(option,)k(it)e |
fc527055 | 14876 | (\014rst)g(attempts)h(to)g(read)f(and)g(execute)h(commands)f(from)g |
037a8b7f | 14877 | Ft(/etc/profile)d Fu(and)150 1777 y Ft(~/.profile)p Fu(,)d(in)i(that)i |
fc527055 | 14878 | (order.)39 b(The)30 b Ft(--noprofile)c Fu(option)k(ma)m(y)g(b)s(e)f |
037a8b7f | 14879 | (used)g(to)h(inhibit)f(this)h(b)s(eha)m(vior.)150 1887 |
fc527055 CR |
14880 | y(When)36 b(in)m(v)m(ok)m(ed)i(as)e(an)g(in)m(teractiv)m(e)j(shell)e |
14881 | (with)f(the)g(name)h Ft(sh)p Fu(,)g(Bash)f(lo)s(oks)h(for)f(the)h(v)-5 | |
037a8b7f | 14882 | b(ariable)37 b Ft(ENV)p Fu(,)150 1997 y(expands)29 b(its)i(v)-5 |
6e51e0d0 CR |
14883 | b(alue)30 b(if)h(it)f(is)g(de\014ned,)g(and)f(uses)h(the)g(expanded)g |
14884 | (v)-5 b(alue)30 b(as)h(the)f(name)g(of)g(a)h(\014le)f(to)h(read)150 | |
037a8b7f | 14885 | 2106 y(and)g(execute.)46 b(Since)32 b(a)g(shell)g(in)m(v)m(ok)m(ed)h |
6e51e0d0 | 14886 | (as)f Ft(sh)f Fu(do)s(es)g(not)h(attempt)h(to)g(read)e(and)g(execute)i |
037a8b7f | 14887 | (commands)150 2216 y(from)39 b(an)m(y)g(other)h(startup)e(\014les,)k |
6e51e0d0 | 14888 | (the)d Ft(--rcfile)e Fu(option)j(has)f(no)g(e\013ect.)69 |
037a8b7f | 14889 | b(A)39 b(non-in)m(teractiv)m(e)j(shell)150 2325 y(in)m(v)m(ok)m(ed)32 |
6e51e0d0 | 14890 | b(with)e(the)g(name)h Ft(sh)f Fu(do)s(es)g(not)g(attempt)i(to)f(read)f |
037a8b7f | 14891 | (an)m(y)h(other)g(startup)e(\014les.)275 2469 y(When)h(in)m(v)m(ok)m |
6e51e0d0 CR |
14892 | (ed)h(as)g Ft(sh)p Fu(,)f(Bash)h(en)m(ters)g Fm(posix)e |
14893 | Fu(mo)s(de)h(after)h(the)g(startup)f(\014les)g(are)h(read.)150 | |
037a8b7f CR |
14894 | 2678 y Fk(In)m(v)m(ok)m(ed)40 b(in)h Fg(posix)g Fk(mo)s(de)150 |
14895 | 2824 y Fu(When)28 b(Bash)h(is)g(started)g(in)g Fm(posix)f | |
6e51e0d0 | 14896 | Fu(mo)s(de,)g(as)h(with)g(the)g Ft(--posix)d Fu(command)j(line)g |
037a8b7f | 14897 | (option,)h(it)f(follo)m(ws)150 2934 y(the)24 b Fm(posix)f |
6e51e0d0 CR |
14898 | Fu(standard)h(for)f(startup)h(\014les.)38 b(In)24 b(this)g(mo)s(de,)h |
14899 | (in)m(teractiv)m(e)i(shells)d(expand)f(the)h Ft(ENV)f | |
037a8b7f | 14900 | Fu(v)-5 b(ariable)150 3044 y(and)30 b(commands)g(are)g(read)h(and)e |
c302751c | 14901 | (executed)j(from)d(the)i(\014le)f(whose)g(name)h(is)f(the)h(expanded)e |
037a8b7f CR |
14902 | (v)-5 b(alue.)41 b(No)150 3153 y(other)31 b(startup)f(\014les)g(are)h |
14903 | (read.)150 3362 y Fk(In)m(v)m(ok)m(ed)40 b(b)m(y)g(remote)h(shell)h | |
14904 | (daemon)150 3509 y Fu(Bash)36 b(attempts)h(to)g(determine)f(when)f(it)i | |
c302751c | 14905 | (is)f(b)s(eing)g(run)e(with)i(its)g(standard)g(input)f(connected)i(to)g |
037a8b7f | 14906 | (a)150 3618 y(net)m(w)m(ork)h(connection,)j(as)c(when)g(executed)h(b)m |
6e51e0d0 | 14907 | (y)f(the)h(remote)g(shell)g(daemon,)h(usually)e Ft(rshd)p |
037a8b7f | 14908 | Fu(,)h(or)g(the)150 3728 y(secure)c(shell)f(daemon)h |
6e51e0d0 | 14909 | Ft(sshd)p Fu(.)49 b(If)33 b(Bash)g(determines)h(it)g(is)f(b)s(eing)g |
037a8b7f | 14910 | (run)f(in)i(this)f(fashion,)h(it)g(reads)g(and)150 3837 |
6e51e0d0 CR |
14911 | y(executes)29 b(commands)e(from)g Ft(~/.bashrc)p Fu(,)e(if)j(that)g |
14912 | (\014le)f(exists)h(and)f(is)g(readable.)41 b(It)27 b(will)h(not)f(do)h | |
037a8b7f | 14913 | (this)f(if)150 3947 y(in)m(v)m(ok)m(ed)k(as)f Ft(sh)p |
6e51e0d0 CR |
14914 | Fu(.)40 b(The)29 b Ft(--norc)f Fu(option)i(ma)m(y)g(b)s(e)f(used)f(to)j |
14915 | (inhibit)e(this)g(b)s(eha)m(vior,)h(and)f(the)h Ft(--rcfile)150 | |
037a8b7f | 14916 | 4057 y Fu(option)36 b(ma)m(y)g(b)s(e)e(used)h(to)h(force)g(another)f |
6e51e0d0 | 14917 | (\014le)h(to)g(b)s(e)e(read,)j(but)d(neither)i Ft(rshd)e |
037a8b7f | 14918 | Fu(nor)h Ft(sshd)f Fu(generally)150 4166 y(in)m(v)m(ok)m(e)e(the)f |
6e51e0d0 | 14919 | (shell)f(with)h(those)f(options)h(or)f(allo)m(w)i(them)f(to)g(b)s(e)e |
037a8b7f | 14920 | (sp)s(eci\014ed.)150 4375 y Fk(In)m(v)m(ok)m(ed)40 b(with)g(unequal)h |
6e51e0d0 | 14921 | (e\013ectiv)m(e)e(and)i(real)g Fg(uid/gid)p Fk(s)150 |
037a8b7f | 14922 | 4522 y Fu(If)34 b(Bash)h(is)g(started)g(with)f(the)h(e\013ectiv)m(e)i |
6e51e0d0 | 14923 | (user)d(\(group\))h(id)f(not)h(equal)g(to)g(the)g(real)g(user)f |
037a8b7f | 14924 | (\(group\))h(id,)150 4631 y(and)26 b(the)i Ft(-p)e Fu(option)h(is)g |
6e51e0d0 | 14925 | (not)h(supplied,)e(no)h(startup)g(\014les)g(are)g(read,)h(shell)f |
037a8b7f | 14926 | (functions)g(are)g(not)g(inherited)150 4741 y(from)41 |
6e51e0d0 CR |
14927 | b(the)g(en)m(vironmen)m(t,)j(the)d Ft(SHELLOPTS)p Fu(,)h |
14928 | Ft(BASHOPTS)p Fu(,)g Ft(CDPATH)p Fu(,)g(and)e Ft(GLOBIGNORE)e | |
037a8b7f | 14929 | Fu(v)-5 b(ariables,)45 b(if)150 4850 y(they)28 b(app)s(ear)f(in)h(the)g |
6e51e0d0 | 14930 | (en)m(vironmen)m(t,)i(are)e(ignored,)h(and)e(the)h(e\013ectiv)m(e)j |
037a8b7f | 14931 | (user)c(id)h(is)g(set)g(to)h(the)f(real)h(user)150 4960 |
6e51e0d0 CR |
14932 | y(id.)62 b(If)38 b(the)f Ft(-p)h Fu(option)g(is)f(supplied)g(at)h(in)m |
14933 | (v)m(o)s(cation,)k(the)c(startup)f(b)s(eha)m(vior)h(is)g(the)g(same,)i | |
037a8b7f CR |
14934 | (but)d(the)150 5070 y(e\013ectiv)m(e)c(user)d(id)g(is)g(not)h(reset.) |
14935 | 150 5324 y Fs(6.3)68 b(In)l(teractiv)l(e)47 b(Shells)p | |
fc527055 | 14936 | eop end |
e59452c7 CR |
14937 | %%Page: 94 100 |
14938 | TeXDict begin 94 99 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
14939 | b(Bash)30 b(F)-8 b(eatures)2484 b(94)150 299 y Fk(6.3.1)63 | |
fc527055 | 14940 | b(What)40 b(is)h(an)g(In)m(teractiv)m(e)e(Shell?)150 |
5e6f45d9 CR |
14941 | 446 y Fu(An)f(in)m(teractiv)m(e)j(shell)e(is)f(one)h(started)g(without) |
14942 | f(non-option)g(argumen)m(ts)h(\(unless)f Ft(-s)g Fu(is)g(sp)s | |
14943 | (eci\014ed\))150 555 y(and)29 b(without)h(sp)s(ecifying)g(the)g | |
14944 | Ft(-c)f Fu(option,)i(whose)e(input)g(and)g(error)h(output)f(are)h(b)s | |
14945 | (oth)f(connected)i(to)150 665 y(terminals)g(\(as)g(determined)f(b)m(y)g | |
14946 | Ft(isatty\(3\))p Fu(\),)e(or)j(one)f(started)h(with)f(the)h | |
d37a4722 | 14947 | Ft(-i)f Fu(option.)275 808 y(An)g(in)m(teractiv)m(e)j(shell)d |
fc527055 | 14948 | (generally)i(reads)e(from)g(and)g(writes)g(to)h(a)g(user's)f(terminal.) |
d37a4722 | 14949 | 275 952 y(The)i Ft(-s)g Fu(in)m(v)m(o)s(cation)j(option)f(ma)m(y)f(b)s |
fc527055 | 14950 | (e)g(used)f(to)i(set)f(the)g(p)s(ositional)h(parameters)f(when)f(an)h |
d37a4722 CR |
14951 | (in)m(ter-)150 1061 y(activ)m(e)g(shell)d(is)h(started.)150 |
14952 | 1269 y Fk(6.3.2)63 b(Is)41 b(this)g(Shell)g(In)m(teractiv)m(e?)150 | |
14953 | 1416 y Fu(T)-8 b(o)30 b(determine)g(within)f(a)h(startup)g(script)f | |
fc527055 | 14954 | (whether)g(or)h(not)g(Bash)g(is)g(running)e(in)m(teractiv)m(ely)-8 |
d37a4722 | 14955 | b(,)33 b(test)e(the)150 1526 y(v)-5 b(alue)30 b(of)g(the)f(`)p |
6e51e0d0 CR |
14956 | Ft(-)p Fu(')h(sp)s(ecial)g(parameter.)41 b(It)29 b(con)m(tains)i |
14957 | Ft(i)e Fu(when)g(the)g(shell)h(is)f(in)m(teractiv)m(e.)44 | |
d37a4722 CR |
14958 | b(F)-8 b(or)30 b(example:)390 1669 y Ft(case)47 b("$-")f(in)390 |
14959 | 1779 y(*i*\))h(echo)f(This)h(shell)f(is)h(interactive)e(;;)390 | |
14960 | 1888 y(*\))i(echo)g(This)f(shell)h(is)g(not)g(interactive)e(;;)390 | |
14961 | 1998 y(esac)275 2141 y Fu(Alternativ)m(ely)-8 b(,)28 | |
6e51e0d0 CR |
14962 | b(startup)23 b(scripts)h(ma)m(y)g(examine)g(the)g(v)-5 |
14963 | b(ariable)25 b Ft(PS1)p Fu(;)g(it)g(is)e(unset)h(in)f(non-in)m | |
d37a4722 CR |
14964 | (teractiv)m(e)150 2251 y(shells,)31 b(and)e(set)i(in)f(in)m(teractiv)m |
14965 | (e)k(shells.)40 b(Th)m(us:)390 2394 y Ft(if)47 b([)h(-z)f("$PS1")f(];)h | |
14966 | (then)772 2503 y(echo)f(This)h(shell)f(is)i(not)f(interactive)390 | |
14967 | 2613 y(else)772 2723 y(echo)f(This)h(shell)f(is)i(interactive)390 | |
14968 | 2832 y(fi)150 3040 y Fk(6.3.3)63 b(In)m(teractiv)m(e)38 | |
14969 | b(Shell)k(Beha)m(vior)150 3187 y Fu(When)30 b(the)h(shell)f(is)h | |
c302751c | 14970 | (running)d(in)m(teractiv)m(ely)-8 b(,)34 b(it)d(c)m(hanges)h(its)f(b)s |
d37a4722 | 14971 | (eha)m(vior)f(in)g(sev)m(eral)i(w)m(a)m(ys.)199 3330 |
37c41ab1 CR |
14972 | y(1.)61 b(Startup)37 b(\014les)g(are)h(read)f(and)g(executed)h(as)f |
14973 | (describ)s(ed)g(in)g(Section)h(6.2)g([Bash)g(Startup)e(Files],)330 | |
e59452c7 | 14974 | 3440 y(page)31 b(92.)199 3579 y(2.)61 b(Job)32 b(Con)m(trol)h(\(see)g |
fffe80d4 | 14975 | (Chapter)e(7)i([Job)f(Con)m(trol],)i(page)f(112\))h(is)e(enabled)g(b)m |
d37a4722 | 14976 | (y)g(default.)46 b(When)32 b(job)330 3689 y(con)m(trol)j(is)f(in)f |
37c41ab1 | 14977 | (e\013ect,)k(Bash)d(ignores)g(the)g(k)m(eyb)s(oard-generated)h(job)e |
d37a4722 CR |
14978 | (con)m(trol)i(signals)g Ft(SIGTTIN)p Fu(,)330 3798 y |
14979 | Ft(SIGTTOU)p Fu(,)29 b(and)g Ft(SIGTSTP)p Fu(.)199 3937 | |
124d67cd CR |
14980 | y(3.)61 b(Bash)25 b(expands)e(and)h(displa)m(ys)h Ft(PS1)e |
14981 | Fu(b)s(efore)h(reading)h(the)f(\014rst)g(line)h(of)f(a)h(command,)h | |
d37a4722 | 14982 | (and)e(expands)330 4047 y(and)33 b(displa)m(ys)h Ft(PS2)f |
124d67cd | 14983 | Fu(b)s(efore)h(reading)g(the)g(second)g(and)f(subsequen)m(t)g(lines)i |
d37a4722 | 14984 | (of)f(a)g(m)m(ulti-line)h(com-)330 4156 y(mand.)42 b(Bash)31 |
124d67cd | 14985 | b(expands)f(and)h(displa)m(ys)g Ft(PS0)f Fu(after)h(it)h(reads)f(a)g |
e59452c7 CR |
14986 | (command)g(but)f(b)s(efore)h(executing)330 4266 y(it.)54 |
14987 | b(See)35 b(Section)h(6.9)f([Con)m(trolling)i(the)d(Prompt],)i(page)g | |
14988 | (103,)h(for)d(a)h(complete)i(list)e(of)g(prompt)330 4375 | |
d37a4722 | 14989 | y(string)30 b(escap)s(e)h(sequences.)199 4514 y(4.)61 |
3c5683a4 CR |
14990 | b(Bash)31 b(executes)i(the)e(v)-5 b(alues)32 b(of)g(the)f(set)h(elemen) |
14991 | m(ts)g(of)g(the)f Ft(PROMPT_COMMAND)d Fu(arra)m(y)k(v)-5 | |
14992 | b(ariable)32 b(as)330 4624 y(commands)27 b(b)s(efore)f(prin)m(ting)h | |
14993 | (the)g(primary)g(prompt,)g Ft($PS1)f Fu(\(see)i(Section)f(5.2)i([Bash)e | |
e59452c7 | 14994 | (V)-8 b(ariables],)330 4733 y(page)31 b(77\).)199 4872 |
d37a4722 | 14995 | y(5.)61 b(Readline)27 b(\(see)g(Chapter)e(8)h([Command)g(Line)g |
fffe80d4 | 14996 | (Editing],)h(page)g(116\))g(is)f(used)g(to)g(read)g(commands)330 |
d37a4722 CR |
14997 | 4982 y(from)k(the)g(user's)g(terminal.)199 5121 y(6.)61 |
14998 | b(Bash)36 b(insp)s(ects)g(the)h(v)-5 b(alue)37 b(of)f(the)g | |
14999 | Ft(ignoreeof)e Fu(option)j(to)g Ft(set)29 b(-o)36 b Fu(instead)h(of)f | |
15000 | (exiting)i(imme-)330 5230 y(diately)f(when)e(it)i(receiv)m(es)h(an)e | |
15001 | Ft(EOF)f Fu(on)h(its)g(standard)f(input)g(when)h(reading)g(a)g(command) | |
15002 | g(\(see)330 5340 y(Section)31 b(4.3.1)h([The)e(Set)h(Builtin],)g(page)g | |
e59452c7 CR |
15003 | (66\).)p eop end |
15004 | %%Page: 95 101 | |
15005 | TeXDict begin 95 100 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15006 | b(Bash)30 b(F)-8 b(eatures)2484 b(95)199 299 y(7.)61 | |
d37a4722 | 15007 | b(Command)43 b(history)h(\(see)h(Section)g(9.1)g([Bash)f(History)h(F)-8 |
fffe80d4 | 15008 | b(acilities],)51 b(page)45 b(151\))h(and)d(history)330 |
d37a4722 | 15009 | 408 y(expansion)h(\(see)i(Section)f(9.3)h([History)g(In)m(teraction],)k |
fffe80d4 | 15010 | (page)45 b(153\))h(are)f(enabled)g(b)m(y)f(default.)330 |
d37a4722 CR |
15011 | 518 y(Bash)28 b(will)g(sa)m(v)m(e)h(the)f(command)f(history)h(to)g(the) |
15012 | g(\014le)g(named)f(b)m(y)h Ft($HISTFILE)d Fu(when)h(a)i(shell)g(with) | |
15013 | 330 628 y(history)i(enabled)h(exits.)199 762 y(8.)61 | |
15014 | b(Alias)31 b(expansion)g(\(see)g(Section)g(6.6)g([Aliases],)i(page)e | |
e59452c7 | 15015 | (99\))h(is)e(p)s(erformed)f(b)m(y)h(default.)199 896 |
d37a4722 CR |
15016 | y(9.)61 b(In)24 b(the)g(absence)h(of)f(an)m(y)h(traps,)g(Bash)g |
15017 | (ignores)f Ft(SIGTERM)f Fu(\(see)i(Section)g(3.7.6)h([Signals],)g(page) | |
3011048a | 15018 | f(45\).)154 1030 y(10.)61 b(In)29 b(the)g(absence)h(of)g(an)m(y)g |
d37a4722 | 15019 | (traps,)f Ft(SIGINT)f Fu(is)h(caugh)m(t)i(and)e(handled)f(\(see)j |
3011048a | 15020 | (Section)f(3.7.6)h([Signals],)330 1140 y(page)g(45\).)42 |
d37a4722 CR |
15021 | b Ft(SIGINT)29 b Fu(will)h(in)m(terrupt)g(some)h(shell)g(builtins.)154 |
15022 | 1274 y(11.)61 b(An)40 b(in)m(teractiv)m(e)j(login)e(shell)g(sends)e(a)i | |
6e51e0d0 | 15023 | Ft(SIGHUP)d Fu(to)j(all)g(jobs)f(on)g(exit)h(if)g(the)f |
d37a4722 | 15024 | Ft(huponexit)e Fu(shell)330 1383 y(option)31 b(has)f(b)s(een)g(enabled) |
3011048a | 15025 | g(\(see)h(Section)g(3.7.6)i([Signals],)e(page)g(45\).)154 |
d37a4722 | 15026 | 1517 y(12.)61 b(The)29 b Ft(-n)g Fu(in)m(v)m(o)s(cation)j(option)e(is)g |
6e51e0d0 | 15027 | (ignored,)g(and)f(`)p Ft(set)h(-n)p Fu(')f(has)h(no)f(e\013ect)j(\(see) |
e59452c7 | 15028 | e(Section)h(4.3.1)g([The)330 1627 y(Set)g(Builtin],)g(page)g(66\).)154 |
d37a4722 | 15029 | 1761 y(13.)61 b(Bash)32 b(will)g(c)m(hec)m(k)i(for)e(mail)g(p)s(erio)s |
6e51e0d0 CR |
15030 | (dically)-8 b(,)34 b(dep)s(ending)c(on)i(the)g(v)-5 b(alues)32 |
15031 | b(of)g(the)h Ft(MAIL)p Fu(,)e Ft(MAILPATH)p Fu(,)330 | |
d37a4722 | 15032 | 1871 y(and)f Ft(MAILCHECK)e Fu(shell)i(v)-5 b(ariables)31 |
6e51e0d0 | 15033 | b(\(see)h(Section)f(5.2)g([Bash)g(V)-8 b(ariables],)32 |
e59452c7 | 15034 | b(page)f(77\).)154 2005 y(14.)61 b(Expansion)32 b(errors)h(due)f(to)i |
6e51e0d0 CR |
15035 | (references)f(to)h(un)m(b)s(ound)c(shell)j(v)-5 b(ariables)34 |
15036 | b(after)g(`)p Ft(set)29 b(-u)p Fu(')k(has)g(b)s(een)330 | |
d37a4722 | 15037 | 2114 y(enabled)d(will)h(not)g(cause)g(the)f(shell)h(to)g(exit)g(\(see)g |
e59452c7 | 15038 | (Section)h(4.3.1)g([The)e(Set)h(Builtin],)g(page)g(66\).)154 |
d37a4722 | 15039 | 2248 y(15.)61 b(The)48 b(shell)h(will)f(not)h(exit)g(on)g(expansion)f |
6e51e0d0 | 15040 | (errors)g(caused)g(b)m(y)h Fr(v)-5 b(ar)54 b Fu(b)s(eing)48 |
d37a4722 | 15041 | b(unset)g(or)h(n)m(ull)f(in)330 2358 y Ft(${)p Fj(var)p |
6e51e0d0 | 15042 | Ft(:?)p Fj(word)p Ft(})27 b Fu(expansions)j(\(see)h(Section)h(3.5.3)g |
e59452c7 | 15043 | ([Shell)e(P)m(arameter)i(Expansion],)e(page)h(26\).)154 |
d37a4722 | 15044 | 2492 y(16.)61 b(Redirection)31 b(errors)f(encoun)m(tered)h(b)m(y)f |
6e51e0d0 | 15045 | (shell)h(builtins)f(will)g(not)h(cause)g(the)f(shell)h(to)g(exit.)154 |
d37a4722 | 15046 | 2626 y(17.)61 b(When)26 b(running)f(in)i Fm(posix)e Fu(mo)s(de,)j(a)f |
6e51e0d0 | 15047 | (sp)s(ecial)g(builtin)f(returning)g(an)g(error)h(status)g(will)g(not)f |
d37a4722 | 15048 | (cause)330 2736 y(the)31 b(shell)f(to)h(exit)h(\(see)f(Section)g(6.11)h |
e59452c7 | 15049 | ([Bash)f(POSIX)e(Mo)s(de],)i(page)g(105\).)154 2870 y(18.)61 |
6e51e0d0 CR |
15050 | b(A)34 b(failed)g Ft(exec)f Fu(will)h(not)g(cause)g(the)g(shell)g(to)g |
15051 | (exit)h(\(see)f(Section)h(4.1)g([Bourne)f(Shell)f(Builtins],)330 | |
e59452c7 | 15052 | 2980 y(page)e(47\).)154 3114 y(19.)61 b(P)m(arser)31 |
37c41ab1 | 15053 | b(syn)m(tax)f(errors)g(will)h(not)g(cause)g(the)f(shell)h(to)g(exit.) |
fffe80d4 CR |
15054 | 154 3248 y(20.)61 b(If)28 b(the)g Ft(cdspell)f Fu(shell)h(option)h(is)g |
15055 | (enabled,)g(the)f(shell)h(will)f(attempt)i(simple)e(sp)s(elling)h | |
15056 | (correction)330 3357 y(for)f(directory)h(argumen)m(ts)g(to)g(the)g | |
15057 | Ft(cd)e Fu(builtin)h(\(see)i(the)e(description)h(of)f(the)h | |
15058 | Ft(cdspell)d Fu(option)j(to)330 3467 y(the)j Ft(shopt)e | |
15059 | Fu(builtin)h(in)h(Section)g(4.3.2)i([The)d(Shopt)g(Builtin],)i(page)g | |
15060 | (70\).)46 b(The)31 b Ft(cdspell)e Fu(option)330 3576 | |
15061 | y(is)h(only)h(e\013ectiv)m(e)i(in)d(in)m(teractiv)m(e)j(shells.)154 | |
15062 | 3711 y(21.)61 b(The)42 b(shell)h(will)g(c)m(hec)m(k)h(the)f(v)-5 | |
15063 | b(alue)43 b(of)f(the)h Ft(TMOUT)e Fu(v)-5 b(ariable)44 | |
15064 | b(and)e(exit)h(if)g(a)g(command)f(is)h(not)330 3820 y(read)30 | |
15065 | b(within)g(the)g(sp)s(eci\014ed)f(n)m(um)m(b)s(er)g(of)i(seconds)f | |
15066 | (after)g(prin)m(ting)g Ft($PS1)f Fu(\(see)i(Section)g(5.2)h([Bash)330 | |
15067 | 3930 y(V)-8 b(ariables],)32 b(page)f(77\).)150 4170 y | |
15068 | Fs(6.4)68 b(Bash)45 b(Conditional)h(Expressions)150 4329 | |
15069 | y Fu(Conditional)25 b(expressions)f(are)g(used)g(b)m(y)g(the)g | |
15070 | Ft([[)g Fu(comp)s(ound)e(command)i(\(see)h(Section)g(3.2.5.2)i([Condi-) | |
15071 | 150 4439 y(tional)h(Constructs],)g(page)f(12\))h(and)e(the)h | |
15072 | Ft(test)f Fu(and)g Ft([)h Fu(builtin)f(commands)h(\(see)g(Section)h | |
15073 | (4.1)g([Bourne)150 4548 y(Shell)37 b(Builtins],)j(page)e(47\).)63 | |
15074 | b(The)36 b Ft(test)g Fu(and)h Ft([)g Fu(commands)g(determine)g(their)h | |
15075 | (b)s(eha)m(vior)f(based)g(on)150 4658 y(the)29 b(n)m(um)m(b)s(er)f(of)h | |
15076 | (argumen)m(ts;)h(see)f(the)h(descriptions)e(of)i(those)f(commands)g | |
15077 | (for)f(an)m(y)i(other)f(command-)150 4768 y(sp)s(eci\014c)h(actions.) | |
15078 | 275 4902 y(Expressions)22 b(ma)m(y)h(b)s(e)g(unary)f(or)h(binary)-8 | |
15079 | b(,)24 b(and)f(are)g(formed)g(from)g(the)g(follo)m(wing)h(primaries.)38 | |
15080 | b(Unary)150 5011 y(expressions)c(are)g(often)g(used)g(to)g(examine)h | |
15081 | (the)f(status)g(of)h(a)f(\014le.)52 b(There)33 b(are)h(string)g(op)s | |
15082 | (erators)h(and)150 5121 y(n)m(umeric)c(comparison)g(op)s(erators)h(as)f | |
15083 | (w)m(ell.)44 b(Bash)31 b(handles)g(sev)m(eral)h(\014lenames)g(sp)s | |
15084 | (ecially)g(when)e(they)150 5230 y(are)35 b(used)e(in)i(expressions.)52 | |
a6ae8f35 | 15085 | b(If)34 b(the)h(op)s(erating)f(system)h(on)f(whic)m(h)g(Bash)h(is)f |
fffe80d4 | 15086 | (running)f(pro)m(vides)h(these)150 5340 y(sp)s(ecial)22 |
a6ae8f35 | 15087 | b(\014les,)i(Bash)e(will)g(use)f(them;)k(otherwise)d(it)g(will)g(em)m |
fffe80d4 CR |
15088 | (ulate)h(them)f(in)m(ternally)h(with)e(this)h(b)s(eha)m(vior:)p |
15089 | eop end | |
e59452c7 CR |
15090 | %%Page: 96 102 |
15091 | TeXDict begin 96 101 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
15092 | b(Bash)30 b(F)-8 b(eatures)2484 b(96)150 299 y(If)27 |
15093 | b(the)g Fr(\014le)33 b Fu(argumen)m(t)27 b(to)h(one)g(of)f(the)h | |
15094 | (primaries)f(is)g(of)h(the)f(form)g Ft(/dev/fd/)p Fj(N)p | |
15095 | Fu(,)e(then)i(\014le)h(descriptor)f Fr(N)150 408 y Fu(is)g(c)m(hec)m(k) | |
15096 | m(ed.)42 b(If)26 b(the)h Fr(\014le)32 b Fu(argumen)m(t)c(to)f(one)h(of) | |
15097 | f(the)g(primaries)f(is)h(one)h(of)f Ft(/dev/stdin)p Fu(,)e | |
15098 | Ft(/dev/stdout)p Fu(,)150 518 y(or)30 b Ft(/dev/stderr)p | |
15099 | Fu(,)e(\014le)i(descriptor)h(0,)g(1,)g(or)f(2,)h(resp)s(ectiv)m(ely)-8 | |
15100 | b(,)32 b(is)f(c)m(hec)m(k)m(ed.)275 655 y(When)37 b(used)g(with)g | |
15101 | Ft([[)p Fu(,)i(the)f(`)p Ft(<)p Fu(')g(and)f(`)p Ft(>)p | |
15102 | Fu(')h(op)s(erators)g(sort)g(lexicographically)i(using)d(the)h(curren)m | |
15103 | (t)150 765 y(lo)s(cale.)k(The)30 b Ft(test)f Fu(command)i(uses)f(ASCI)s | |
15104 | (I)e(ordering.)275 902 y(Unless)44 b(otherwise)h(sp)s(eci\014ed,)j | |
e59452c7 | 15105 | (primaries)c(that)h(op)s(erate)g(on)g(\014les)f(follo)m(w)i(sym)m(b)s |
fffe80d4 | 15106 | (olic)f(links)g(and)150 1011 y(op)s(erate)31 b(on)f(the)h(target)h(of)e |
e59452c7 | 15107 | (the)h(link,)f(rather)h(than)f(the)g(link)h(itself.)150 |
fffe80d4 CR |
15108 | 1175 y Ft(-a)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
15109 | Fr(\014le)36 b Fu(exists.)150 1337 y Ft(-b)30 b Fj(file)162 | |
e59452c7 CR |
15110 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
15111 | b(and)f(is)g(a)h(blo)s(c)m(k)g(sp)s(ecial)g(\014le.)150 | |
fffe80d4 | 15112 | 1499 y Ft(-c)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
e59452c7 | 15113 | Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(a)h(c)m(haracter)h(sp)s(ecial) |
fffe80d4 | 15114 | f(\014le.)150 1661 y Ft(-d)f Fj(file)162 b Fu(T)-8 b(rue)30 |
e59452c7 | 15115 | b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(a)h(directory)-8 |
fffe80d4 CR |
15116 | b(.)150 1823 y Ft(-e)30 b Fj(file)162 b Fu(T)-8 b(rue)30 |
15117 | b(if)g Fr(\014le)36 b Fu(exists.)150 1985 y Ft(-f)30 | |
6e51e0d0 | 15118 | b Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 |
124d67cd | 15119 | b Fu(exists)31 b(and)f(is)g(a)h(regular)f(\014le.)150 |
fffe80d4 | 15120 | 2147 y Ft(-g)g Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
124d67cd | 15121 | Fr(\014le)36 b Fu(exists)31 b(and)f(its)g(set-group-id)h(bit)g(is)f |
fffe80d4 | 15122 | (set.)150 2309 y Ft(-h)g Fj(file)162 b Fu(T)-8 b(rue)30 |
124d67cd | 15123 | b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(a)h(sym)m(b)s(olic)g |
fffe80d4 | 15124 | (link.)150 2471 y Ft(-k)f Fj(file)162 b Fu(T)-8 b(rue)30 |
124d67cd | 15125 | b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(its)g Ft(")p |
fffe80d4 | 15126 | Fu(stic)m(ky)p Ft(")h Fu(bit)g(is)f(set.)150 2633 y Ft(-p)g |
fc527055 | 15127 | Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b |
124d67cd | 15128 | Fu(exists)31 b(and)f(is)g(a)h(named)f(pip)s(e)f(\(FIF)m(O\).)150 |
fffe80d4 | 15129 | 2795 y Ft(-r)h Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
124d67cd | 15130 | Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(readable.)150 |
fffe80d4 | 15131 | 2957 y Ft(-s)g Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
124d67cd | 15132 | Fr(\014le)36 b Fu(exists)31 b(and)f(has)g(a)g(size)i(greater)f(than)f |
fffe80d4 | 15133 | (zero.)150 3119 y Ft(-t)g Fj(fd)258 b Fu(T)-8 b(rue)30 |
124d67cd | 15134 | b(if)g(\014le)h(descriptor)f Fr(fd)j Fu(is)e(op)s(en)e(and)h(refers)g |
fffe80d4 | 15135 | (to)h(a)g(terminal.)150 3281 y Ft(-u)f Fj(file)162 b |
124d67cd | 15136 | Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(its)g |
fffe80d4 | 15137 | (set-user-id)h(bit)f(is)h(set.)150 3443 y Ft(-w)f Fj(file)162 |
6e51e0d0 | 15138 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
fffe80d4 | 15139 | b(and)f(is)g(writable.)150 3605 y Ft(-x)g Fj(file)162 |
6e51e0d0 | 15140 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
fffe80d4 | 15141 | b(and)f(is)g(executable.)150 3767 y Ft(-G)g Fj(file)162 |
124d67cd CR |
15142 | b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 |
15143 | b(and)f(is)g(o)m(wned)g(b)m(y)h(the)f(e\013ectiv)m(e)j(group)d(id.)150 | |
fffe80d4 | 15144 | 3929 y Ft(-L)g Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
124d67cd | 15145 | Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(a)h(sym)m(b)s(olic)g(link.)150 |
fffe80d4 | 15146 | 4091 y Ft(-N)f Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g |
124d67cd | 15147 | Fr(\014le)36 b Fu(exists)31 b(and)f(has)g(b)s(een)f(mo)s(di\014ed)h |
fffe80d4 | 15148 | (since)g(it)h(w)m(as)g(last)g(read.)150 4253 y Ft(-O)f |
6e51e0d0 | 15149 | Fj(file)162 b Fu(T)-8 b(rue)30 b(if)g Fr(\014le)36 b |
124d67cd | 15150 | Fu(exists)31 b(and)f(is)g(o)m(wned)g(b)m(y)h(the)f(e\013ectiv)m(e)j |
fffe80d4 | 15151 | (user)d(id.)150 4416 y Ft(-S)g Fj(file)162 b Fu(T)-8 |
124d67cd | 15152 | b(rue)30 b(if)g Fr(\014le)36 b Fu(exists)31 b(and)f(is)g(a)h(so)s(c)m |
fffe80d4 CR |
15153 | (k)m(et.)150 4578 y Fj(file1)e Ft(-ef)g Fj(file2)630 |
15154 | 4687 y Fu(T)-8 b(rue)30 b(if)g Fr(\014le1)38 b Fu(and)30 | |
124d67cd | 15155 | b Fr(\014le2)38 b Fu(refer)30 b(to)i(the)e(same)h(device)g(and)f(ino)s |
fffe80d4 CR |
15156 | (de)g(n)m(um)m(b)s(ers.)150 4849 y Fj(file1)f Ft(-nt)g |
15157 | Fj(file2)630 4959 y Fu(T)-8 b(rue)23 b(if)h Fr(\014le1)32 | |
124d67cd CR |
15158 | b Fu(is)24 b(new)m(er)g(\(according)h(to)g(mo)s(di\014cation)f(date\))h |
15159 | (than)f Fr(\014le2)p Fu(,)i(or)e(if)g Fr(\014le1)31 b | |
fffe80d4 | 15160 | Fu(exists)630 5068 y(and)f Fr(\014le2)38 b Fu(do)s(es)30 |
e59452c7 | 15161 | b(not.)150 5230 y Fj(file1)f Ft(-ot)g Fj(file2)630 5340 |
124d67cd CR |
15162 | y Fu(T)-8 b(rue)30 b(if)g Fr(\014le1)38 b Fu(is)31 b(older)f(than)g |
15163 | Fr(\014le2)p Fu(,)i(or)e(if)g Fr(\014le2)38 b Fu(exists)31 | |
e59452c7 CR |
15164 | b(and)f Fr(\014le1)38 b Fu(do)s(es)30 b(not.)p eop end |
15165 | %%Page: 97 103 | |
15166 | TeXDict begin 97 102 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15167 | b(Bash)30 b(F)-8 b(eatures)2484 b(97)150 299 y Ft(-o)30 | |
15168 | b Fj(optname)630 408 y Fu(T)-8 b(rue)41 b(if)g(the)g(shell)h(option)f | |
15169 | Fr(optname)47 b Fu(is)41 b(enabled.)73 b(The)41 b(list)h(of)f(options)h | |
15170 | (app)s(ears)e(in)630 518 y(the)33 b(description)h(of)f(the)g | |
15171 | Ft(-o)g Fu(option)g(to)h(the)g Ft(set)e Fu(builtin)h(\(see)h(Section)g | |
15172 | (4.3.1)h([The)e(Set)630 628 y(Builtin],)e(page)g(66\).)150 | |
15173 | 783 y Ft(-v)f Fj(varname)630 892 y Fu(T)-8 b(rue)30 b(if)g(the)h(shell) | |
15174 | f(v)-5 b(ariable)32 b Fr(v)-5 b(arname)35 b Fu(is)30 | |
15175 | b(set)h(\(has)g(b)s(een)e(assigned)i(a)g(v)-5 b(alue\).)150 | |
15176 | 1047 y Ft(-R)30 b Fj(varname)630 1157 y Fu(T)-8 b(rue)30 | |
15177 | b(if)g(the)h(shell)f(v)-5 b(ariable)32 b Fr(v)-5 b(arname)35 | |
15178 | b Fu(is)30 b(set)h(and)f(is)h(a)f(name)h(reference.)150 | |
15179 | 1312 y Ft(-z)f Fj(string)66 b Fu(T)-8 b(rue)30 b(if)g(the)h(length)g | |
15180 | (of)f Fr(string)38 b Fu(is)31 b(zero.)150 1467 y Ft(-n)f | |
15181 | Fj(string)150 1576 y(string)192 b Fu(T)-8 b(rue)30 b(if)g(the)h(length) | |
15182 | g(of)f Fr(string)38 b Fu(is)31 b(non-zero.)150 1731 y | |
15183 | Fj(string1)d Ft(==)i Fj(string2)150 1841 y(string1)e | |
15184 | Ft(=)i Fj(string2)630 1951 y Fu(T)-8 b(rue)43 b(if)h(the)g(strings)g | |
15185 | (are)g(equal.)82 b(When)44 b(used)f(with)g(the)h Ft([[)g | |
15186 | Fu(command,)j(this)d(p)s(er-)630 2060 y(forms)d(pattern)g(matc)m(hing)i | |
15187 | (as)f(describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g(3.2.5.2)i | |
15188 | ([Conditional)630 2170 y(Constructs],)30 b(page)h(12\).)630 | |
15189 | 2302 y(`)p Ft(=)p Fu(')g(should)e(b)s(e)h(used)f(with)h(the)h | |
15190 | Ft(test)e Fu(command)h(for)g Fm(posix)g Fu(conformance.)150 | |
15191 | 2457 y Fj(string1)e Ft(!=)i Fj(string2)630 2567 y Fu(T)-8 | |
fc527055 | 15192 | b(rue)30 b(if)g(the)h(strings)f(are)h(not)f(equal.)150 |
e59452c7 | 15193 | 2722 y Fj(string1)e Ft(<)i Fj(string2)630 2831 y Fu(T)-8 |
fc527055 | 15194 | b(rue)30 b(if)g Fr(string1)38 b Fu(sorts)31 b(b)s(efore)f |
e59452c7 CR |
15195 | Fr(string2)38 b Fu(lexicographically)-8 b(.)150 2986 |
15196 | y Fj(string1)28 b Ft(>)i Fj(string2)630 3096 y Fu(T)-8 | |
fc527055 | 15197 | b(rue)30 b(if)g Fr(string1)38 b Fu(sorts)31 b(after)g |
e59452c7 CR |
15198 | Fr(string2)38 b Fu(lexicographically)-8 b(.)150 3251 |
15199 | y Fj(arg1)29 b Ft(OP)h Fj(arg2)630 3361 y Ft(OP)j Fu(is)h(one)g(of)h(`) | |
fc527055 CR |
15200 | p Ft(-eq)p Fu(',)f(`)p Ft(-ne)p Fu(',)h(`)p Ft(-lt)p |
15201 | Fu(',)g(`)p Ft(-le)p Fu(',)f(`)p Ft(-gt)p Fu(',)h(or)f(`)p | |
15202 | Ft(-ge)p Fu('.)51 b(These)34 b(arithmetic)h(binary)630 | |
e59452c7 | 15203 | 3470 y(op)s(erators)h(return)e(true)i(if)f Fr(arg1)44 |
fc527055 | 15204 | b Fu(is)36 b(equal)g(to,)i(not)e(equal)g(to,)i(less)e(than,)h(less)f |
e59452c7 | 15205 | (than)f(or)630 3580 y(equal)29 b(to,)g(greater)h(than,)e(or)g(greater)i |
fc527055 | 15206 | (than)d(or)i(equal)f(to)h Fr(arg2)p Fu(,)h(resp)s(ectiv)m(ely)-8 |
e59452c7 | 15207 | b(.)42 b Fr(Arg1)36 b Fu(and)630 3689 y Fr(arg2)41 b |
124d67cd CR |
15208 | Fu(ma)m(y)34 b(b)s(e)f(p)s(ositiv)m(e)h(or)f(negativ)m(e)j(in)m |
15209 | (tegers.)50 b(When)33 b(used)g(with)g(the)g Ft([[)g Fu(command,)630 | |
e59452c7 | 15210 | 3799 y Fr(Arg1)41 b Fu(and)33 b Fr(Arg2)41 b Fu(are)33 |
124d67cd | 15211 | b(ev)-5 b(aluated)35 b(as)e(arithmetic)i(expressions)d(\(see)j(Section) |
e59452c7 CR |
15212 | f(6.5)g([Shell)630 3908 y(Arithmetic],)e(page)f(97\).)150 |
15213 | 4145 y Fs(6.5)68 b(Shell)45 b(Arithmetic)150 4304 y Fu(The)26 | |
b729dac1 CR |
15214 | b(shell)h(allo)m(ws)h(arithmetic)f(expressions)g(to)g(b)s(e)f(ev)-5 |
15215 | b(aluated,)29 b(as)d(one)h(of)g(the)g(shell)f(expansions)h(or)f(b)m(y) | |
e59452c7 | 15216 | 150 4414 y(using)h(the)g Ft(\(\()g Fu(comp)s(ound)e(command,)j(the)g |
b729dac1 | 15217 | Ft(let)e Fu(builtin,)i(or)f(the)g Ft(-i)g Fu(option)h(to)f(the)h |
e59452c7 | 15218 | Ft(declare)d Fu(builtin.)275 4546 y(Ev)-5 b(aluation)27 |
b729dac1 CR |
15219 | b(is)g(done)f(in)g(\014xed-width)g(in)m(tegers)i(with)e(no)h(c)m(hec)m |
15220 | (k)h(for)e(o)m(v)m(er\015o)m(w,)j(though)d(division)h(b)m(y)150 | |
e59452c7 | 15221 | 4656 y(0)g(is)g(trapp)s(ed)f(and)h(\015agged)g(as)h(an)f(error.)39 |
b729dac1 | 15222 | b(The)26 b(op)s(erators)h(and)g(their)g(precedence,)h(asso)s(ciativit)m |
e59452c7 | 15223 | (y)-8 b(,)32 b(and)150 4765 y(v)-5 b(alues)35 b(are)h(the)f(same)g(as)h |
b729dac1 | 15224 | (in)e(the)h(C)g(language.)56 b(The)35 b(follo)m(wing)h(list)g(of)f(op)s |
e59452c7 | 15225 | (erators)g(is)g(group)s(ed)f(in)m(to)150 4875 y(lev)m(els)27 |
b729dac1 CR |
15226 | b(of)f(equal-precedence)i(op)s(erators.)39 b(The)25 b(lev)m(els)j(are)e |
15227 | (listed)h(in)e(order)h(of)g(decreasing)g(precedence.)150 | |
e59452c7 | 15228 | 5030 y Fj(id)p Ft(++)j Fj(id)p Ft(--)67 b Fu(v)-5 b(ariable)31 |
b729dac1 | 15229 | b(p)s(ost-incremen)m(t)g(and)f(p)s(ost-decremen)m(t)150 |
e59452c7 CR |
15230 | 5185 y Ft(++)p Fj(id)f Ft(--)p Fj(id)67 b Fu(v)-5 b(ariable)31 |
15231 | b(pre-incremen)m(t)g(and)f(pre-decremen)m(t)150 5340 | |
15232 | y Ft(-)g(+)354 b Fu(unary)29 b(min)m(us)h(and)g(plus)p | |
15233 | eop end | |
15234 | %%Page: 98 104 | |
15235 | TeXDict begin 98 103 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15236 | b(Bash)30 b(F)-8 b(eatures)2484 b(98)150 299 y Ft(!)30 | |
15237 | b(~)354 b Fu(logical)33 b(and)d(bit)m(wise)h(negation)150 | |
15238 | 482 y Ft(**)384 b Fu(exp)s(onen)m(tiation)150 664 y Ft(*)30 | |
15239 | b(/)g(\045)276 b Fu(m)m(ultiplication,)33 b(division,)d(remainder)150 | |
15240 | 847 y Ft(+)g(-)354 b Fu(addition,)31 b(subtraction)150 | |
15241 | 1030 y Ft(<<)f(>>)258 b Fu(left)31 b(and)f(righ)m(t)h(bit)m(wise)g | |
15242 | (shifts)150 1213 y Ft(<=)f(>=)g(<)g(>)102 b Fu(comparison)150 | |
15243 | 1395 y Ft(==)30 b(!=)258 b Fu(equalit)m(y)32 b(and)e(inequalit)m(y)150 | |
15244 | 1578 y Ft(&)432 b Fu(bit)m(wise)31 b(AND)150 1761 y Ft(^)432 | |
15245 | b Fu(bit)m(wise)31 b(exclusiv)m(e)h(OR)150 1944 y Ft(|)432 | |
15246 | b Fu(bit)m(wise)31 b(OR)150 2126 y Ft(&&)384 b Fu(logical)33 | |
15247 | b(AND)150 2309 y Ft(||)384 b Fu(logical)33 b(OR)150 2492 | |
15248 | y Ft(expr)c(?)h(expr)f(:)h(expr)630 2601 y Fu(conditional)i(op)s | |
15249 | (erator)150 2784 y Ft(=)e(*=)g(/=)g(\045=)f(+=)h(-=)g(<<=)f(>>=)h(&=)g | |
15250 | (^=)f(|=)630 2894 y Fu(assignmen)m(t)150 3076 y Ft(expr1)g(,)h(expr2) | |
15251 | 630 3186 y Fu(comma)275 3380 y(Shell)38 b(v)-5 b(ariables)39 | |
79eedac4 | 15252 | b(are)g(allo)m(w)m(ed)i(as)e(op)s(erands;)i(parameter)e(expansion)g(is) |
e59452c7 | 15253 | f(p)s(erformed)g(b)s(efore)g(the)150 3490 y(expression)g(is)g(ev)-5 |
79eedac4 CR |
15254 | b(aluated.)66 b(Within)38 b(an)h(expression,)h(shell)e(v)-5 |
15255 | b(ariables)39 b(ma)m(y)g(also)g(b)s(e)f(referenced)g(b)m(y)150 | |
e59452c7 | 15256 | 3600 y(name)31 b(without)f(using)g(the)h(parameter)g(expansion)f(syn)m |
79eedac4 | 15257 | (tax.)42 b(A)31 b(shell)f(v)-5 b(ariable)32 b(that)f(is)f(n)m(ull)h(or) |
e59452c7 | 15258 | f(unset)150 3709 y(ev)-5 b(aluates)41 b(to)f(0)g(when)e(referenced)h(b) |
79eedac4 | 15259 | m(y)g(name)h(without)f(using)g(the)g(parameter)h(expansion)f(syn)m |
e59452c7 | 15260 | (tax.)150 3819 y(The)c(v)-5 b(alue)37 b(of)f(a)h(v)-5 |
79eedac4 | 15261 | b(ariable)36 b(is)g(ev)-5 b(aluated)38 b(as)e(an)g(arithmetic)h |
e59452c7 CR |
15262 | (expression)f(when)f(it)h(is)g(referenced,)i(or)150 3928 |
15263 | y(when)27 b(a)h(v)-5 b(ariable)29 b(whic)m(h)e(has)h(b)s(een)f(giv)m | |
15264 | (en)i(the)f Ft(integer)e Fu(attribute)i(using)g(`)p Ft(declare)g(-i)p | |
15265 | Fu(')g(is)g(assigned)150 4038 y(a)33 b(v)-5 b(alue.)49 | |
15266 | b(A)33 b(n)m(ull)g(v)-5 b(alue)34 b(ev)-5 b(aluates)34 | |
15267 | b(to)g(0.)49 b(A)33 b(shell)g(v)-5 b(ariable)34 b(need)e(not)i(ha)m(v)m | |
15268 | (e)g(its)f Ft(integer)e Fu(attribute)150 4148 y(turned)e(on)h(to)i(b)s | |
15269 | (e)d(used)h(in)g(an)g(expression.)275 4305 y(In)m(teger)41 | |
15270 | b(constan)m(ts)g(follo)m(w)h(the)e(C)g(language)i(de\014nition,)g | |
15271 | (without)f(su\016xes)e(or)h(c)m(haracter)i(con-)150 4415 | |
15272 | y(stan)m(ts.)f(Constan)m(ts)31 b(with)f(a)g(leading)h(0)f(are)h(in)m | |
15273 | (terpreted)f(as)g(o)s(ctal)i(n)m(um)m(b)s(ers.)39 b(A)30 | |
15274 | b(leading)h(`)p Ft(0x)p Fu(')f(or)g(`)p Ft(0X)p Fu(')150 | |
15275 | 4525 y(denotes)g(hexadecimal.)42 b(Otherwise,)30 b(n)m(um)m(b)s(ers)f | |
15276 | (tak)m(e)i(the)f(form)g([)p Fr(base)5 b Ft(#)p Fu(])p | |
15277 | Fr(n)p Fu(,)30 b(where)f(the)i(optional)g Fr(base)150 | |
15278 | 4634 y Fu(is)e(a)h(decimal)g(n)m(um)m(b)s(er)e(b)s(et)m(w)m(een)h(2)h | |
15279 | (and)e(64)i(represen)m(ting)g(the)f(arithmetic)i(base,)e(and)g | |
15280 | Fr(n)g Fu(is)g(a)g(n)m(um)m(b)s(er)150 4744 y(in)g(that)i(base.)40 | |
602eae4d CR |
15281 | b(If)30 b Fr(base)5 b Ft(#)30 b Fu(is)f(omitted,)i(then)f(base)g(10)g |
15282 | (is)g(used.)40 b(When)30 b(sp)s(ecifying)f Fr(n)p Fu(,)h(if)f(a)i | |
e59452c7 | 15283 | (non-digit)f(is)150 4853 y(required,)k(the)g(digits)h(greater)g(than)e |
602eae4d | 15284 | (9)i(are)f(represen)m(ted)g(b)m(y)f(the)h(lo)m(w)m(ercase)j(letters,)f |
e59452c7 | 15285 | (the)e(upp)s(ercase)150 4963 y(letters,)26 b(`)p Ft(@)p |
602eae4d CR |
15286 | Fu(',)g(and)d(`)p Ft(_)p Fu(',)i(in)e(that)i(order.)38 |
15287 | b(If)23 b Fr(base)29 b Fu(is)23 b(less)h(than)g(or)f(equal)h(to)h(36,)h | |
e59452c7 | 15288 | (lo)m(w)m(ercase)g(and)d(upp)s(ercase)150 5073 y(letters)32 |
602eae4d CR |
15289 | b(ma)m(y)f(b)s(e)e(used)h(in)m(terc)m(hangeably)i(to)f(represen)m(t)g |
15290 | (n)m(um)m(b)s(ers)e(b)s(et)m(w)m(een)i(10)g(and)f(35.)275 | |
e59452c7 | 15291 | 5230 y(Op)s(erators)44 b(are)h(ev)-5 b(aluated)46 b(in)f(order)f(of)h |
602eae4d | 15292 | (precedence.)85 b(Sub-expressions)44 b(in)g(paren)m(theses)i(are)150 |
e59452c7 CR |
15293 | 5340 y(ev)-5 b(aluated)32 b(\014rst)d(and)h(ma)m(y)h(o)m(v)m(erride)g |
15294 | (the)g(precedence)g(rules)f(ab)s(o)m(v)m(e.)p eop end | |
15295 | %%Page: 99 105 | |
15296 | TeXDict begin 99 104 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15297 | b(Bash)30 b(F)-8 b(eatures)2484 b(99)150 299 y Fs(6.6)68 | |
15298 | b(Aliases)150 458 y Fr(Aliases)41 b Fu(allo)m(w)d(a)f(string)f(to)h(b)s | |
15299 | (e)f(substituted)g(for)g(a)g(w)m(ord)g(when)g(it)h(is)f(used)f(as)i | |
15300 | (the)g(\014rst)e(w)m(ord)h(of)h(a)150 568 y(simple)32 | |
15301 | b(command.)45 b(The)31 b(shell)i(main)m(tains)f(a)h(list)f(of)g | |
15302 | (aliases)i(that)e(ma)m(y)h(b)s(e)e(set)h(and)g(unset)f(with)h(the)150 | |
15303 | 677 y Ft(alias)d Fu(and)h Ft(unalias)e Fu(builtin)i(commands.)275 | |
15304 | 810 y(The)f(\014rst)f(w)m(ord)i(of)f(eac)m(h)i(simple)f(command,)g(if)f | |
15305 | (unquoted,)g(is)h(c)m(hec)m(k)m(ed)h(to)g(see)f(if)g(it)g(has)f(an)g | |
15306 | (alias.)150 920 y(If)24 b(so,)i(that)g(w)m(ord)e(is)h(replaced)g(b)m(y) | |
15307 | f(the)h(text)h(of)e(the)h(alias.)40 b(The)24 b(c)m(haracters)i(`)p | |
15308 | Ft(/)p Fu(',)h(`)p Ft($)p Fu(',)f(`)p Ft(`)p Fu(',)g(`)p | |
15309 | Ft(=)p Fu(')f(and)f(an)m(y)h(of)150 1030 y(the)e(shell)g(metac)m | |
15310 | (haracters)i(or)e(quoting)g(c)m(haracters)h(listed)g(ab)s(o)m(v)m(e)g | |
15311 | (ma)m(y)f(not)g(app)s(ear)f(in)h(an)g(alias)h(name.)150 | |
15312 | 1139 y(The)e(replacemen)m(t)h(text)g(ma)m(y)g(con)m(tain)h(an)m(y)e(v) | |
15313 | -5 b(alid)23 b(shell)f(input,)h(including)f(shell)g(metac)m(haracters.) | |
15314 | 40 b(The)150 1249 y(\014rst)35 b(w)m(ord)g(of)h(the)g(replacemen)m(t)i | |
15315 | (text)e(is)g(tested)h(for)e(aliases,)k(but)c(a)h(w)m(ord)g(that)g(is)g | |
15316 | (iden)m(tical)i(to)e(an)150 1358 y(alias)c(b)s(eing)f(expanded)f(is)h | |
15317 | (not)g(expanded)f(a)h(second)g(time.)43 b(This)30 b(means)h(that)g(one) | |
15318 | g(ma)m(y)h(alias)g Ft(ls)e Fu(to)150 1468 y Ft("ls)f(-F")p | |
15319 | Fu(,)f(for)f(instance,)i(and)d(Bash)i(do)s(es)f(not)h(try)f(to)h | |
15320 | (recursiv)m(ely)g(expand)e(the)i(replacemen)m(t)h(text.)40 | |
15321 | b(If)150 1578 y(the)30 b(last)h(c)m(haracter)g(of)g(the)f(alias)h(v)-5 | |
15322 | b(alue)30 b(is)g(a)g Ft(blank)p Fu(,)f(then)h(the)g(next)g(command)g(w) | |
15323 | m(ord)f(follo)m(wing)j(the)150 1687 y(alias)g(is)e(also)h(c)m(hec)m(k)m | |
15324 | (ed)i(for)d(alias)h(expansion.)275 1820 y(Aliases)e(are)f(created)i | |
15325 | (and)d(listed)i(with)f(the)g Ft(alias)f Fu(command,)h(and)g(remo)m(v)m | |
15326 | (ed)h(with)f(the)g Ft(unalias)150 1930 y Fu(command.)275 | |
15327 | 2063 y(There)44 b(is)h(no)g(mec)m(hanism)g(for)f(using)h(argumen)m(ts)g | |
15328 | (in)f(the)h(replacemen)m(t)i(text,)i(as)d(in)e Ft(csh)p | |
15329 | Fu(.)83 b(If)150 2172 y(argumen)m(ts)31 b(are)f(needed,)h(use)f(a)h | |
15330 | (shell)f(function)g(\(see)i(Section)f(3.3)g([Shell)g(F)-8 | |
15331 | b(unctions],)31 b(page)g(19\).)275 2305 y(Aliases)i(are)h(not)e | |
15332 | (expanded)g(when)g(the)h(shell)g(is)g(not)g(in)m(teractiv)m(e,)j | |
15333 | (unless)c(the)h Ft(expand_aliases)150 2415 y Fu(shell)e(option)f(is)h | |
124d67cd | 15334 | (set)g(using)f Ft(shopt)f Fu(\(see)i(Section)g(4.3.2)h([The)e(Shopt)g |
e59452c7 | 15335 | (Builtin],)h(page)g(70\).)275 2548 y(The)38 b(rules)h(concerning)h(the) |
124d67cd | 15336 | f(de\014nition)g(and)g(use)g(of)g(aliases)i(are)e(somewhat)h |
e59452c7 | 15337 | (confusing.)67 b(Bash)150 2657 y(alw)m(a)m(ys)37 b(reads)f(at)h(least)g |
d61300ec | 15338 | (one)f(complete)i(line)e(of)g(input,)h(and)e(all)i(lines)f(that)g(mak)m |
e59452c7 | 15339 | (e)h(up)e(a)h(comp)s(ound)150 2767 y(command,)29 b(b)s(efore)g |
d61300ec | 15340 | (executing)i(an)m(y)e(of)h(the)f(commands)g(on)g(that)h(line)f(or)h |
e59452c7 | 15341 | (the)f(comp)s(ound)f(command.)150 2877 y(Aliases)g(are)g(expanded)e |
d61300ec | 15342 | (when)g(a)i(command)f(is)g(read,)h(not)f(when)f(it)i(is)f(executed.)41 |
e59452c7 | 15343 | b(Therefore,)28 b(an)f(alias)150 2986 y(de\014nition)36 |
d61300ec | 15344 | b(app)s(earing)h(on)f(the)h(same)g(line)g(as)g(another)g(command)f(do)s |
e59452c7 | 15345 | (es)g(not)h(tak)m(e)i(e\013ect)f(un)m(til)f(the)150 3096 |
d61300ec CR |
15346 | y(next)i(line)g(of)g(input)f(is)h(read.)66 b(The)38 b(commands)h(follo) |
15347 | m(wing)h(the)f(alias)h(de\014nition)e(on)h(that)g(line)h(are)150 | |
e59452c7 | 15348 | 3205 y(not)33 b(a\013ected)h(b)m(y)f(the)g(new)f(alias.)49 |
d61300ec | 15349 | b(This)32 b(b)s(eha)m(vior)h(is)g(also)g(an)g(issue)g(when)e(functions) |
e59452c7 | 15350 | i(are)g(executed.)150 3315 y(Aliases)c(are)g(expanded)e(when)g(a)i |
d61300ec | 15351 | (function)e(de\014nition)h(is)g(read,)h(not)f(when)g(the)g(function)g |
e59452c7 | 15352 | (is)g(executed,)150 3425 y(b)s(ecause)36 b(a)h(function)f(de\014nition) |
d61300ec | 15353 | f(is)i(itself)g(a)f(command.)58 b(As)36 b(a)h(consequence,)h(aliases)g |
e59452c7 | 15354 | (de\014ned)d(in)h(a)150 3534 y(function)28 b(are)h(not)g(a)m(v)-5 |
d61300ec | 15355 | b(ailable)31 b(un)m(til)e(after)g(that)g(function)f(is)g(executed.)41 |
fc527055 | 15356 | b(T)-8 b(o)29 b(b)s(e)f(safe,)i(alw)m(a)m(ys)g(put)e(alias)150 |
e59452c7 | 15357 | 3644 y(de\014nitions)i(on)g(a)h(separate)g(line,)g(and)f(do)g(not)h |
fc527055 | 15358 | (use)f Ft(alias)f Fu(in)h(comp)s(ound)f(commands.)275 |
e59452c7 | 15359 | 3777 y(F)-8 b(or)31 b(almost)g(ev)m(ery)g(purp)s(ose,)e(shell)i |
fc527055 | 15360 | (functions)f(are)g(preferred)g(o)m(v)m(er)h(aliases.)150 |
e59452c7 | 15361 | 4014 y Fs(6.7)68 b(Arra)l(ys)150 4174 y Fu(Bash)33 b(pro)m(vides)g |
fc527055 | 15362 | (one-dimensional)g(indexed)f(and)h(asso)s(ciativ)m(e)i(arra)m(y)e(v)-5 |
c302751c | 15363 | b(ariables.)49 b(An)m(y)33 b(v)-5 b(ariable)33 b(ma)m(y)150 |
e59452c7 | 15364 | 4283 y(b)s(e)e(used)h(as)g(an)g(indexed)f(arra)m(y;)j(the)e |
6e51e0d0 | 15365 | Ft(declare)e Fu(builtin)h(will)i(explicitly)g(declare)g(an)f(arra)m(y) |
e59452c7 | 15366 | -8 b(.)46 b(There)32 b(is)150 4393 y(no)h(maxim)m(um)g(limit)h(on)f |
c302751c | 15367 | (the)g(size)h(of)g(an)f(arra)m(y)-8 b(,)35 b(nor)d(an)m(y)i(requiremen) |
e59452c7 | 15368 | m(t)f(that)h(mem)m(b)s(ers)e(b)s(e)g(indexed)150 4503 |
c302751c CR |
15369 | y(or)26 b(assigned)h(con)m(tiguously)-8 b(.)41 b(Indexed)25 |
15370 | b(arra)m(ys)i(are)f(referenced)g(using)g(in)m(tegers)i(\(including)e | |
e59452c7 CR |
15371 | (arithmetic)150 4612 y(expressions)38 b(\(see)h(Section)g(6.5)h([Shell) |
15372 | e(Arithmetic],)k(page)d(97\)\))h(and)d(are)i(zero-based;)k(asso)s | |
15373 | (ciativ)m(e)150 4722 y(arra)m(ys)37 b(use)f(arbitrary)g(strings.)59 | |
9f178efb | 15374 | b(Unless)36 b(otherwise)h(noted,)h(indexed)e(arra)m(y)h(indices)f(m)m |
e59452c7 CR |
15375 | (ust)g(b)s(e)g(non-)150 4831 y(negativ)m(e)d(in)m(tegers.)275 |
15376 | 4964 y(An)26 b(indexed)h(arra)m(y)h(is)f(created)h(automatically)j(if)c | |
d9e1f41e | 15377 | (an)m(y)g(v)-5 b(ariable)28 b(is)g(assigned)f(to)h(using)f(the)g(syn)m |
e59452c7 CR |
15378 | (tax)390 5097 y Fj(name)p Ft([)p Fj(subscript)p Ft(]=)p |
15379 | Fj(value)150 5230 y Fu(The)34 b Fr(subscript)h Fu(is)g(treated)g(as)g | |
f6da9f85 CR |
15380 | (an)f(arithmetic)i(expression)e(that)h(m)m(ust)g(ev)-5 |
15381 | b(aluate)36 b(to)f(a)g(n)m(um)m(b)s(er.)51 b(T)-8 b(o)150 | |
e59452c7 CR |
15382 | 5340 y(explicitly)32 b(declare)f(an)g(arra)m(y)-8 b(,)31 |
15383 | b(use)p eop end | |
15384 | %%Page: 100 106 | |
15385 | TeXDict begin 100 105 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15386 | b(Bash)30 b(F)-8 b(eatures)2439 b(100)390 299 y Ft(declare)46 | |
15387 | b(-a)h Fj(name)150 432 y Fu(The)30 b(syn)m(tax)390 565 | |
15388 | y Ft(declare)46 b(-a)h Fj(name)p Ft([)p Fj(subscript)p | |
15389 | Ft(])150 698 y Fu(is)30 b(also)i(accepted;)g(the)e Fr(subscript)h | |
15390 | Fu(is)g(ignored.)150 831 y(Asso)s(ciativ)m(e)i(arra)m(ys)d(are)h | |
15391 | (created)h(using)390 964 y Ft(declare)46 b(-A)h Fj(name)275 | |
15392 | 1097 y Fu(A)m(ttributes)f(ma)m(y)h(b)s(e)e(sp)s(eci\014ed)g(for)h(an)g | |
15393 | (arra)m(y)g(v)-5 b(ariable)47 b(using)e(the)h Ft(declare)e | |
15394 | Fu(and)h Ft(readonly)150 1207 y Fu(builtins.)40 b(Eac)m(h)31 | |
15395 | b(attribute)g(applies)g(to)g(all)g(mem)m(b)s(ers)f(of)g(an)h(arra)m(y) | |
15396 | -8 b(.)275 1340 y(Arra)m(ys)30 b(are)h(assigned)f(to)h(using)f(comp)s | |
15397 | (ound)f(assignmen)m(ts)i(of)g(the)f(form)390 1473 y Fj(name)p | |
15398 | Ft(=\()p Fj(value1)44 b(value2)j Ft(...)f(\))150 1606 | |
15399 | y Fu(where)33 b(eac)m(h)i Fr(v)-5 b(alue)40 b Fu(ma)m(y)34 | |
15400 | b(b)s(e)g(of)g(the)g(form)f Ft([)p Fj(subscript)p Ft(]=)p | |
15401 | Fr(string)p Fu(.)48 b(Indexed)33 b(arra)m(y)h(assignmen)m(ts)h(do)150 | |
15402 | 1716 y(not)26 b(require)f(an)m(ything)g(but)g Fr(string)p | |
15403 | Fu(.)39 b(When)25 b(assigning)h(to)g(indexed)f(arra)m(ys,)i(if)e(the)h | |
15404 | (optional)g(subscript)150 1825 y(is)h(supplied,)f(that)h(index)g(is)f | |
15405 | (assigned)h(to;)i(otherwise)e(the)g(index)g(of)f(the)h(elemen)m(t)i | |
15406 | (assigned)d(is)h(the)g(last)150 1935 y(index)j(assigned)h(to)g(b)m(y)f | |
15407 | (the)g(statemen)m(t)j(plus)c(one.)41 b(Indexing)30 b(starts)h(at)g | |
15408 | (zero.)275 2068 y(Eac)m(h)26 b Fr(v)-5 b(alue)32 b Fu(in)26 | |
15409 | b(the)h(list)g(undergo)s(es)e(all)i(the)g(shell)f(expansions)g(describ) | |
15410 | s(ed)f(ab)s(o)m(v)m(e)j(\(see)f(Section)g(3.5)150 2178 | |
15411 | y([Shell)j(Expansions],)h(page)g(24\).)275 2311 y(When)k(assigning)i | |
15412 | (to)g(an)f(asso)s(ciativ)m(e)i(arra)m(y)-8 b(,)39 b(the)d(w)m(ords)f | |
15413 | (in)h(a)h(comp)s(ound)d(assignmen)m(t)j(ma)m(y)g(b)s(e)150 | |
15414 | 2420 y(either)31 b(assignmen)m(t)h(statemen)m(ts,)h(for)e(whic)m(h)g | |
15415 | (the)g(subscript)f(is)h(required,)g(or)g(a)g(list)h(of)f(w)m(ords)f | |
15416 | (that)i(is)150 2530 y(in)m(terpreted)g(as)g(a)g(sequence)f(of)h | |
d37a4722 CR |
15417 | (alternating)h(k)m(eys)f(and)f(v)-5 b(alues:)44 b Fr(name)5 |
15418 | b Fu(=\()p Fr(k)m(ey1)40 b(v)-5 b(alue1)40 b(k)m(ey2)g(v)-5 | |
e59452c7 | 15419 | b(alue2)156 2639 y Fu(.)22 b(.)g(.)47 b(\).)57 b(These)35 |
d37a4722 CR |
15420 | b(are)i(treated)f(iden)m(tically)i(to)e Fr(name)5 b Fu(=\()36 |
15421 | b([)p Fr(k)m(ey1)7 b Fu(]=)p Fr(v)-5 b(alue1)46 b Fu([)p | |
15422 | Fr(k)m(ey2)7 b Fu(]=)p Fr(v)-5 b(alue2)51 b Fu(.)22 b(.)h(.)46 | |
e59452c7 | 15423 | b(\).)57 b(The)150 2749 y(\014rst)25 b(w)m(ord)f(in)h(the)h(list)g |
d37a4722 | 15424 | (determines)f(ho)m(w)g(the)h(remaining)f(w)m(ords)g(are)h(in)m |
e59452c7 | 15425 | (terpreted;)h(all)f(assignmen)m(ts)g(in)150 2859 y(a)31 |
d37a4722 CR |
15426 | b(list)f(m)m(ust)h(b)s(e)e(of)h(the)h(same)f(t)m(yp)s(e.)41 |
15427 | b(When)30 b(using)g(k)m(ey/v)-5 b(alue)32 b(pairs,)e(the)g(k)m(eys)h | |
e59452c7 | 15428 | (ma)m(y)g(not)f(b)s(e)g(missing)150 2968 y(or)g(empt)m(y;)h(a)g |
d37a4722 | 15429 | (\014nal)f(missing)g(v)-5 b(alue)31 b(is)g(treated)g(lik)m(e)h(the)e |
e59452c7 | 15430 | (empt)m(y)h(string.)275 3101 y(This)f(syn)m(tax)j(is)e(also)i(accepted) |
d37a4722 | 15431 | g(b)m(y)f(the)f Ft(declare)f Fu(builtin.)44 b(Individual)31 |
e59452c7 | 15432 | b(arra)m(y)h(elemen)m(ts)h(ma)m(y)g(b)s(e)150 3211 y(assigned)e(to)g |
d37a4722 CR |
15433 | (using)f(the)g Fj(name)p Ft([)p Fj(subscript)p Ft(]=)p |
15434 | Fj(value)25 b Fu(syn)m(tax)31 b(in)m(tro)s(duced)e(ab)s(o)m(v)m(e.)275 | |
e59452c7 | 15435 | 3344 y(When)h(assigning)h(to)h(an)e(indexed)g(arra)m(y)-8 |
d37a4722 | 15436 | b(,)32 b(if)f Fr(name)36 b Fu(is)31 b(subscripted)e(b)m(y)i(a)g |
e59452c7 | 15437 | (negativ)m(e)i(n)m(um)m(b)s(er,)c(that)150 3453 y(n)m(um)m(b)s(er)43 |
d37a4722 CR |
15438 | b(is)h(in)m(terpreted)h(as)f(relativ)m(e)j(to)e(one)f(greater)i(than)e |
15439 | (the)g(maxim)m(um)g(index)g(of)h Fr(name)p Fu(,)j(so)150 | |
e59452c7 | 15440 | 3563 y(negativ)m(e)30 b(indices)d(coun)m(t)h(bac)m(k)g(from)f(the)g |
d37a4722 | 15441 | (end)g(of)g(the)h(arra)m(y)-8 b(,)29 b(and)e(an)g(index)g(of)g(-1)h |
e59452c7 | 15442 | (references)g(the)f(last)150 3673 y(elemen)m(t.)275 3806 |
d37a4722 CR |
15443 | y(An)m(y)h(elemen)m(t)h(of)g(an)f(arra)m(y)g(ma)m(y)h(b)s(e)f |
15444 | (referenced)g(using)g Ft(${)p Fj(name)p Ft([)p Fj(subscript)p | |
e59452c7 | 15445 | Ft(]})p Fu(.)35 b(The)27 b(braces)i(are)150 3915 y(required)f(to)j(a)m |
d37a4722 CR |
15446 | (v)m(oid)f(con\015icts)g(with)f(the)h(shell's)f(\014lename)h(expansion) |
15447 | f(op)s(erators.)41 b(If)28 b(the)i Fr(subscript)g Fu(is)150 | |
e59452c7 | 15448 | 4025 y(`)p Ft(@)p Fu(')f(or)h(`)p Ft(*)p Fu(',)f(the)h(w)m(ord)f |
d37a4722 CR |
15449 | (expands)f(to)i(all)g(mem)m(b)s(ers)e(of)i(the)f(arra)m(y)h |
15450 | Fr(name)p Fu(.)40 b(These)29 b(subscripts)f(di\013er)h(only)150 | |
e59452c7 | 15451 | 4134 y(when)36 b(the)g(w)m(ord)g(app)s(ears)g(within)g(double)g |
d37a4722 | 15452 | (quotes.)60 b(If)36 b(the)h(w)m(ord)f(is)g(double-quoted,)j |
e59452c7 | 15453 | Ft(${)p Fj(name)p Ft([*]})150 4244 y Fu(expands)25 b(to)h(a)g(single)h |
d37a4722 CR |
15454 | (w)m(ord)e(with)g(the)h(v)-5 b(alue)26 b(of)g(eac)m(h)h(arra)m(y)f(mem) |
15455 | m(b)s(er)f(separated)h(b)m(y)g(the)f(\014rst)g(c)m(harac-)150 | |
e59452c7 | 15456 | 4354 y(ter)j(of)g(the)h Ft(IFS)e Fu(v)-5 b(ariable,)29 |
fc527055 CR |
15457 | b(and)f Ft(${)p Fj(name)p Ft([@]})d Fu(expands)i(eac)m(h)i(elemen)m(t)h |
15458 | (of)e Fr(name)33 b Fu(to)c(a)f(separate)h(w)m(ord.)150 | |
e59452c7 | 15459 | 4463 y(When)j(there)h(are)f(no)g(arra)m(y)h(mem)m(b)s(ers,)f |
6e51e0d0 | 15460 | Ft(${)p Fj(name)p Ft([@]})e Fu(expands)h(to)i(nothing.)47 |
e59452c7 | 15461 | b(If)31 b(the)i(double-quoted)150 4573 y(expansion)39 |
6e51e0d0 | 15462 | b(o)s(ccurs)h(within)f(a)h(w)m(ord,)i(the)d(expansion)h(of)g(the)f |
e59452c7 | 15463 | (\014rst)g(parameter)h(is)g(joined)f(with)h(the)150 4682 |
6e51e0d0 CR |
15464 | y(b)s(eginning)29 b(part)g(of)h(the)f(original)i(w)m(ord,)e(and)g(the)h |
15465 | (expansion)f(of)h(the)f(last)i(parameter)e(is)h(joined)f(with)150 | |
e59452c7 | 15466 | 4792 y(the)g(last)h(part)f(of)g(the)g(original)h(w)m(ord.)40 |
122f603c | 15467 | b(This)28 b(is)h(analogous)h(to)f(the)h(expansion)e(of)h(the)g(sp)s |
e59452c7 | 15468 | (ecial)h(param-)150 4902 y(eters)g(`)p Ft(@)p Fu(')f(and)g(`)p |
6e51e0d0 CR |
15469 | Ft(*)p Fu('.)41 b Ft(${#)p Fj(name)p Ft([)p Fj(subscript)p |
15470 | Ft(]})24 b Fu(expands)k(to)i(the)g(length)g(of)f Ft(${)p | |
15471 | Fj(name)p Ft([)p Fj(subscript)p Ft(]})p Fu(.)35 b(If)150 | |
e59452c7 | 15472 | 5011 y Fr(subscript)28 b Fu(is)g(`)p Ft(@)p Fu(')f(or)h(`)p |
8a0829e9 CR |
15473 | Ft(*)p Fu(',)g(the)g(expansion)f(is)g(the)h(n)m(um)m(b)s(er)e(of)i |
15474 | (elemen)m(ts)g(in)f(the)h(arra)m(y)-8 b(.)41 b(If)27 | |
e59452c7 | 15475 | b(the)g Fr(subscript)150 5121 y Fu(used)34 b(to)h(reference)g(an)f |
8a0829e9 CR |
15476 | (elemen)m(t)i(of)f(an)f(indexed)g(arra)m(y)h(ev)-5 b(aluates)36 |
15477 | b(to)f(a)g(n)m(um)m(b)s(er)e(less)i(than)f(zero,)i(it)150 | |
e59452c7 | 15478 | 5230 y(is)c(in)m(terpreted)h(as)f(relativ)m(e)i(to)f(one)f(greater)h |
8a0829e9 | 15479 | (than)f(the)h(maxim)m(um)f(index)f(of)h(the)h(arra)m(y)-8 |
e59452c7 | 15480 | b(,)33 b(so)g(negativ)m(e)150 5340 y(indices)d(coun)m(t)h(bac)m(k)h |
8a0829e9 | 15481 | (from)e(the)g(end)g(of)g(the)h(arra)m(y)-8 b(,)31 b(and)f(an)g(index)g |
e59452c7 CR |
15482 | (of)h(-1)g(refers)f(to)h(the)g(last)g(elemen)m(t.)p eop |
15483 | end | |
15484 | %%Page: 101 107 | |
15485 | TeXDict begin 101 106 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15486 | b(Bash)30 b(F)-8 b(eatures)2439 b(101)275 299 y(Referencing)41 | |
15487 | b(an)f(arra)m(y)h(v)-5 b(ariable)42 b(without)e(a)h(subscript)e(is)i | |
15488 | (equiv)-5 b(alen)m(t)42 b(to)f(referencing)g(with)g(a)150 | |
15489 | 408 y(subscript)35 b(of)h(0.)57 b(An)m(y)36 b(reference)g(to)h(a)f(v)-5 | |
8a0829e9 | 15490 | b(ariable)36 b(using)g(a)g(v)-5 b(alid)36 b(subscript)f(is)h(legal,)j |
e59452c7 | 15491 | (and)c Ft(bash)g Fu(will)150 518 y(create)d(an)e(arra)m(y)h(if)f |
fffe80d4 | 15492 | (necessary)-8 b(.)275 659 y(An)35 b(arra)m(y)i(v)-5 b(ariable)37 |
e59452c7 CR |
15493 | b(is)g(considered)f(set)h(if)f(a)h(subscript)e(has)h(b)s(een)g |
15494 | (assigned)g(a)h(v)-5 b(alue.)59 b(The)36 b(n)m(ull)150 | |
fffe80d4 CR |
15495 | 769 y(string)30 b(is)h(a)g(v)-5 b(alid)30 b(v)-5 b(alue.)275 |
15496 | 910 y(It)29 b(is)h(p)s(ossible)f(to)h(obtain)g(the)f(k)m(eys)i | |
e59452c7 CR |
15497 | (\(indices\))f(of)f(an)h(arra)m(y)g(as)f(w)m(ell)i(as)f(the)f(v)-5 |
15498 | b(alues.)41 b($)p Fi({)p Fu(!)p Fr(name)5 b Fu([@])p | |
fffe80d4 | 15499 | Fi(})150 1020 y Fu(and)39 b($)p Fi({)p Fu(!)p Fr(name)5 |
e59452c7 CR |
15500 | b Fu([*])p Fi(})43 b Fu(expand)c(to)i(the)f(indices)h(assigned)f(in)g |
15501 | (arra)m(y)g(v)-5 b(ariable)41 b Fr(name)p Fu(.)70 b(The)39 | |
fffe80d4 | 15502 | b(treatmen)m(t)150 1130 y(when)i(in)g(double)g(quotes)h(is)f(similar)h |
e59452c7 | 15503 | (to)h(the)e(expansion)h(of)f(the)h(sp)s(ecial)g(parameters)g(`)p |
fffe80d4 CR |
15504 | Ft(@)p Fu(')g(and)f(`)p Ft(*)p Fu(')150 1239 y(within)30 |
15505 | b(double)g(quotes.)275 1381 y(The)25 b Ft(unset)g Fu(builtin)g(is)h | |
879213c6 CR |
15506 | (used)f(to)i(destro)m(y)f(arra)m(ys.)40 b Ft(unset)29 |
15507 | b Fj(name)p Ft([)p Fj(subscript)p Ft(])22 b Fu(destro)m(ys)k(the)g | |
fffe80d4 | 15508 | (arra)m(y)150 1490 y(elemen)m(t)40 b(at)e(index)g Fr(subscript)p |
879213c6 | 15509 | Fu(.)62 b(Negativ)m(e)41 b(subscripts)c(to)i(indexed)e(arra)m(ys)i(are) |
fffe80d4 | 15510 | f(in)m(terpreted)h(as)f(de-)150 1600 y(scrib)s(ed)30 |
e59452c7 CR |
15511 | b(ab)s(o)m(v)m(e.)42 b(Unsetting)31 b(the)g(last)g(elemen)m(t)h(of)f |
15512 | (an)g(arra)m(y)g(v)-5 b(ariable)31 b(do)s(es)f(not)h(unset)f(the)h(v)-5 | |
fffe80d4 CR |
15513 | b(ariable.)150 1709 y Ft(unset)29 b Fj(name)p Fu(,)39 |
15514 | b(where)e Fr(name)43 b Fu(is)37 b(an)h(arra)m(y)-8 b(,)41 | |
15515 | b(remo)m(v)m(es)e(the)f(en)m(tire)g(arra)m(y)-8 b(.)64 | |
15516 | b Ft(unset)29 b Fj(name)p Ft([)p Fj(subscript)p Ft(])150 | |
15517 | 1819 y Fu(b)s(eha)m(v)m(es)h(di\013eren)m(tly)g(dep)s(ending)d(on)j | |
15518 | (the)f(arra)m(y)h(t)m(yp)s(e)f(when)g(giv)m(en)h(a)f(subscript)g(of)g | |
15519 | (`)p Ft(*)p Fu(')g(or)h(`)p Ft(@)p Fu('.)40 b(When)150 | |
15520 | 1928 y Fr(name)46 b Fu(is)40 b(an)h(asso)s(ciativ)m(e)i(arra)m(y)-8 | |
15521 | b(,)44 b(it)d(remo)m(v)m(es)h(the)f(elemen)m(t)h(with)e(k)m(ey)h(`)p | |
15522 | Ft(*)p Fu(')g(or)f(`)p Ft(@)p Fu('.)72 b(If)40 b Fr(name)45 | |
15523 | b Fu(is)c(an)150 2038 y(indexed)30 b(arra)m(y)-8 b(,)31 | |
15524 | b Ft(unset)e Fu(remo)m(v)m(es)j(all)f(of)g(the)f(elemen)m(ts,)i(but)e | |
15525 | (do)s(es)g(not)h(remo)m(v)m(e)h(the)e(arra)m(y)h(itself.)275 | |
15526 | 2179 y(When)k(using)g(a)i(v)-5 b(ariable)36 b(name)g(with)g(a)g | |
15527 | (subscript)e(as)i(an)g(argumen)m(t)g(to)h(a)f(command,)h(suc)m(h)f(as) | |
15528 | 150 2289 y(with)k Ft(unset)p Fu(,)h(without)e(using)h(the)g(w)m(ord)f | |
e59452c7 | 15529 | (expansion)h(syn)m(tax)g(describ)s(ed)f(ab)s(o)m(v)m(e,)44 |
fffe80d4 | 15530 | b(the)c(argumen)m(t)g(is)150 2399 y(sub)5 b(ject)25 b(to)h(the)g |
e59452c7 | 15531 | (shell's)g(\014lename)f(expansion.)39 b(If)25 b(\014lename)h(expansion) |
fffe80d4 CR |
15532 | f(is)g(not)h(desired,)g(the)f(argumen)m(t)150 2508 y(should)k(b)s(e)h |
15533 | (quoted.)275 2650 y(The)20 b Ft(declare)p Fu(,)h Ft(local)p | |
e59452c7 CR |
15534 | Fu(,)h(and)e Ft(readonly)f Fu(builtins)h(eac)m(h)i(accept)g(a)g |
15535 | Ft(-a)e Fu(option)h(to)h(sp)s(ecify)f(an)f(indexed)150 | |
fffe80d4 | 15536 | 2759 y(arra)m(y)28 b(and)f(a)h Ft(-A)e Fu(option)i(to)g(sp)s(ecify)f |
e59452c7 CR |
15537 | (an)h(asso)s(ciativ)m(e)i(arra)m(y)-8 b(.)40 b(If)27 |
15538 | b(b)s(oth)g(options)h(are)g(supplied,)f Ft(-A)f Fu(tak)m(es)150 | |
fffe80d4 | 15539 | 2869 y(precedence.)55 b(The)35 b Ft(read)f Fu(builtin)h(accepts)h(a)g |
e59452c7 | 15540 | Ft(-a)e Fu(option)i(to)g(assign)f(a)g(list)h(of)f(w)m(ords)g(read)g |
fffe80d4 | 15541 | (from)g(the)150 2978 y(standard)h(input)g(to)i(an)f(arra)m(y)-8 |
e59452c7 | 15542 | b(,)40 b(and)c(can)h(read)g(v)-5 b(alues)38 b(from)e(the)h(standard)g |
fffe80d4 | 15543 | (input)f(in)m(to)i(individual)150 3088 y(arra)m(y)f(elemen)m(ts.)62 |
e59452c7 CR |
15544 | b(The)36 b Ft(set)g Fu(and)h Ft(declare)d Fu(builtins)j(displa)m(y)g |
15545 | (arra)m(y)g(v)-5 b(alues)37 b(in)g(a)g(w)m(a)m(y)h(that)g(allo)m(ws)150 | |
fffe80d4 CR |
15546 | 3197 y(them)30 b(to)h(b)s(e)f(reused)g(as)g(input.)150 |
15547 | 3449 y Fs(6.8)68 b(The)45 b(Directory)g(Stac)l(k)150 | |
15548 | 3608 y Fu(The)21 b(directory)h(stac)m(k)h(is)e(a)h(list)g(of)f(recen)m | |
124d67cd | 15549 | (tly-visited)j(directories.)39 b(The)20 b Ft(pushd)g |
fffe80d4 | 15550 | Fu(builtin)h(adds)g(directories)150 3718 y(to)42 b(the)f(stac)m(k)i(as) |
124d67cd CR |
15551 | e(it)h(c)m(hanges)g(the)f(curren)m(t)g(directory)-8 b(,)45 |
15552 | b(and)40 b(the)i Ft(popd)e Fu(builtin)g(remo)m(v)m(es)j(sp)s(eci\014ed) | |
fffe80d4 | 15553 | 150 3827 y(directories)29 b(from)f(the)h(stac)m(k)h(and)d(c)m(hanges)j |
124d67cd | 15554 | (the)e(curren)m(t)g(directory)h(to)g(the)g(directory)f(remo)m(v)m(ed.) |
fffe80d4 | 15555 | 41 b(The)150 3937 y Ft(dirs)34 b Fu(builtin)g(displa)m(ys)h(the)g(con)m |
124d67cd | 15556 | (ten)m(ts)i(of)e(the)g(directory)h(stac)m(k.)56 b(The)34 |
fffe80d4 | 15557 | b(curren)m(t)h(directory)g(is)g(alw)m(a)m(ys)150 4046 |
124d67cd | 15558 | y(the)c Ft(")p Fu(top)p Ft(")f Fu(of)g(the)h(directory)g(stac)m(k.)275 |
fffe80d4 | 15559 | 4188 y(The)k(con)m(ten)m(ts)i(of)f(the)h(directory)f(stac)m(k)h(are)f |
124d67cd | 15560 | (also)h(visible)g(as)f(the)g(v)-5 b(alue)36 b(of)g(the)g |
fffe80d4 CR |
15561 | Ft(DIRSTACK)e Fu(shell)150 4297 y(v)-5 b(ariable.)150 |
15562 | 4503 y Fk(6.8.1)63 b(Directory)40 b(Stac)m(k)g(Builtins)150 | |
15563 | 4679 y Ft(dirs)870 4817 y(dirs)47 b([-clpv])e([+)p Fj(N)i | |
15564 | Ft(|)h(-)p Fj(N)p Ft(])630 4955 y Fu(Displa)m(y)35 b(the)f(list)g(of)g | |
124d67cd | 15565 | (curren)m(tly)g(remem)m(b)s(ered)f(directories.)51 b(Directories)36 |
fffe80d4 | 15566 | b(are)e(added)f(to)630 5064 y(the)28 b(list)h(with)f(the)g |
124d67cd | 15567 | Ft(pushd)f Fu(command;)i(the)f Ft(popd)f Fu(command)h(remo)m(v)m(es)h |
fffe80d4 | 15568 | (directories)g(from)630 5174 y(the)i(list.)41 b(The)30 |
124d67cd | 15569 | b(curren)m(t)g(directory)h(is)f(alw)m(a)m(ys)i(the)f(\014rst)e |
fffe80d4 | 15570 | (directory)i(in)f(the)h(stac)m(k.)630 5340 y Ft(-c)384 |
124d67cd | 15571 | b Fu(Clears)31 b(the)f(directory)h(stac)m(k)h(b)m(y)e(deleting)h(all)h |
fffe80d4 | 15572 | (of)e(the)h(elemen)m(ts.)p eop end |
e59452c7 CR |
15573 | %%Page: 102 108 |
15574 | TeXDict begin 102 107 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
15575 | b(Bash)30 b(F)-8 b(eatures)2439 b(102)630 299 y Ft(-l)384 |
15576 | b Fu(Pro)s(duces)31 b(a)h(listing)h(using)e(full)h(pathnames;)h(the)f | |
15577 | (default)g(listing)h(format)1110 408 y(uses)d(a)h(tilde)g(to)g(denote)g | |
15578 | (the)f(home)h(directory)-8 b(.)630 575 y Ft(-p)384 b | |
15579 | Fu(Causes)30 b Ft(dirs)f Fu(to)i(prin)m(t)f(the)h(directory)g(stac)m(k) | |
15580 | h(with)e(one)g(en)m(try)h(p)s(er)e(line.)630 741 y Ft(-v)384 | |
15581 | b Fu(Causes)36 b Ft(dirs)f Fu(to)i(prin)m(t)f(the)g(directory)h(stac)m | |
15582 | (k)h(with)e(one)h(en)m(try)f(p)s(er)f(line,)1110 850 | |
15583 | y(pre\014xing)30 b(eac)m(h)h(en)m(try)g(with)f(its)h(index)e(in)i(the)f | |
15584 | (stac)m(k.)630 1017 y Ft(+)p Fj(N)384 b Fu(Displa)m(ys)23 | |
e59452c7 | 15585 | b(the)f Fr(N)10 b Fu(th)21 b(directory)h(\(coun)m(ting)h(from)e(the)h |
fffe80d4 | 15586 | (left)g(of)g(the)g(list)g(prin)m(ted)1110 1126 y(b)m(y)30 |
e59452c7 | 15587 | b Ft(dirs)f Fu(when)h(in)m(v)m(ok)m(ed)i(without)e(options\),)h |
fffe80d4 | 15588 | (starting)g(with)g(zero.)630 1292 y Ft(-)p Fj(N)384 b |
e59452c7 CR |
15589 | Fu(Displa)m(ys)47 b(the)g Fr(N)10 b Fu(th)46 b(directory)h(\(coun)m |
15590 | (ting)g(from)f(the)g(righ)m(t)h(of)g(the)f(list)1110 | |
fffe80d4 CR |
15591 | 1402 y(prin)m(ted)25 b(b)m(y)g Ft(dirs)g Fu(when)f(in)m(v)m(ok)m(ed)j |
15592 | (without)f(options\),)h(starting)g(with)e(zero.)150 1568 | |
15593 | y Ft(popd)870 1706 y(popd)47 b([-n])f([+)p Fj(N)h Ft(|)h(-)p | |
15594 | Fj(N)p Ft(])630 1844 y Fu(Remo)m(v)m(es)34 b(elemen)m(ts)g(from)e(the)h | |
e59452c7 | 15595 | (directory)g(stac)m(k.)49 b(The)32 b(elemen)m(ts)i(are)f(n)m(um)m(b)s |
fffe80d4 | 15596 | (ered)e(from)630 1953 y(0)38 b(starting)h(at)f(the)g(\014rst)f |
e59452c7 | 15597 | (directory)h(listed)g(b)m(y)g Ft(dirs)p Fu(;)j(that)d(is,)i |
fffe80d4 CR |
15598 | Ft(popd)c Fu(is)i(equiv)-5 b(alen)m(t)39 b(to)630 2063 |
15599 | y Ft(popd)29 b(+0)p Fu(.)630 2201 y(When)j(no)g(argumen)m(ts)h(are)g | |
d37a4722 | 15600 | (giv)m(en,)h Ft(popd)d Fu(remo)m(v)m(es)j(the)f(top)f(directory)h(from) |
fffe80d4 CR |
15601 | f(the)g(stac)m(k)630 2310 y(and)e(c)m(hanges)h(to)g(the)g(new)f(top)g |
15602 | (directory)-8 b(.)630 2448 y(Argumen)m(ts,)31 b(if)f(supplied,)f(ha)m | |
15603 | (v)m(e)j(the)e(follo)m(wing)i(meanings:)630 2614 y Ft(-n)384 | |
e59452c7 | 15604 | b Fu(Suppresses)27 b(the)j(normal)g(c)m(hange)g(of)g(directory)g(when)e |
fffe80d4 | 15605 | (remo)m(ving)j(directo-)1110 2724 y(ries)f(from)g(the)h(stac)m(k,)h(so) |
e59452c7 | 15606 | f(that)g(only)f(the)h(stac)m(k)g(is)g(manipulated.)630 |
fffe80d4 | 15607 | 2890 y Ft(+)p Fj(N)384 b Fu(Remo)m(v)m(es)22 b(the)f |
e59452c7 | 15608 | Fr(N)10 b Fu(th)20 b(directory)g(\(coun)m(ting)i(from)e(the)g(left)h |
fffe80d4 | 15609 | (of)g(the)f(list)h(prin)m(ted)1110 3000 y(b)m(y)30 b |
e59452c7 | 15610 | Ft(dirs)p Fu(\),)g(starting)h(with)f(zero,)i(from)e(the)g(stac)m(k.)630 |
fffe80d4 | 15611 | 3166 y Ft(-)p Fj(N)384 b Fu(Remo)m(v)m(es)46 b(the)g |
e59452c7 | 15612 | Fr(N)10 b Fu(th)44 b(directory)h(\(coun)m(ting)h(from)f(the)g(righ)m(t) |
fffe80d4 | 15613 | g(of)g(the)g(list)1110 3275 y(prin)m(ted)30 b(b)m(y)g |
e59452c7 | 15614 | Ft(dirs)p Fu(\),)g(starting)h(with)f(zero,)i(from)e(the)g(stac)m(k.)630 |
fffe80d4 | 15615 | 3442 y(If)d(the)h(top)g(elemen)m(t)h(of)f(the)g(directory)g(stac)m(k)h |
e59452c7 | 15616 | (is)e(mo)s(di\014ed,)h(and)f(the)h Ft(-n)f Fu(option)h(w)m(as)g(not)630 |
fffe80d4 | 15617 | 3551 y(supplied,)j Ft(popd)g Fu(uses)g(the)h Ft(cd)f |
e59452c7 | 15618 | Fu(builtin)g(to)i(c)m(hange)g(to)f(the)g(directory)g(at)h(the)f(top)g |
fffe80d4 | 15619 | (of)g(the)630 3661 y(stac)m(k.)42 b(If)30 b(the)h Ft(cd)e |
e59452c7 | 15620 | Fu(fails,)j Ft(popd)d Fu(returns)g(a)i(non-zero)g(v)-5 |
fffe80d4 | 15621 | b(alue.)630 3799 y(Otherwise,)34 b Ft(popd)f Fu(returns)f(an)h |
e59452c7 | 15622 | (unsuccessful)g(status)g(if)h(an)f(in)m(v)-5 b(alid)34 |
fffe80d4 | 15623 | b(option)g(is)g(encoun-)630 3908 y(tered,)39 b(the)d(directory)h(stac)m |
e59452c7 | 15624 | (k)i(is)d(empt)m(y)-8 b(,)39 b(or)e(a)g(non-existen)m(t)h(directory)f |
fffe80d4 CR |
15625 | (stac)m(k)h(en)m(try)f(is)630 4018 y(sp)s(eci\014ed.)630 |
15626 | 4156 y(If)32 b(the)h Ft(popd)f Fu(command)h(is)g(successful,)g(Bash)g | |
e59452c7 | 15627 | (runs)f Ft(dirs)f Fu(to)j(sho)m(w)f(the)g(\014nal)f(con)m(ten)m(ts)630 |
fffe80d4 CR |
15628 | 4265 y(of)f(the)f(directory)h(stac)m(k,)h(and)e(the)g(return)g(status)g |
15629 | (is)h(0.)150 4431 y Ft(pushd)870 4569 y(pushd)46 b([-n])h([+)p | |
15630 | Fj(N)g Ft(|)g Fj(-N)h Ft(|)f Fj(dir)p Ft(])630 4707 y | |
e59452c7 CR |
15631 | Fu(Adds)27 b(a)h(directory)h(to)g(the)f(top)g(of)g(the)g(directory)h |
15632 | (stac)m(k,)h(or)e(rotates)h(the)f(stac)m(k,)j(making)630 | |
fffe80d4 | 15633 | 4817 y(the)37 b(new)g(top)g(of)g(the)g(stac)m(k)i(the)e(curren)m(t)f(w) |
e59452c7 | 15634 | m(orking)i(directory)-8 b(.)61 b(With)38 b(no)e(argumen)m(ts,)630 |
fffe80d4 CR |
15635 | 4926 y Ft(pushd)29 b Fu(exc)m(hanges)j(the)e(top)h(t)m(w)m(o)h(elemen)m |
15636 | (ts)f(of)g(the)f(directory)h(stac)m(k.)630 5064 y(Argumen)m(ts,)g(if)f | |
e59452c7 | 15637 | (supplied,)f(ha)m(v)m(e)j(the)e(follo)m(wing)i(meanings:)630 |
fffe80d4 CR |
15638 | 5230 y Ft(-n)384 b Fu(Suppresses)24 b(the)j(normal)f(c)m(hange)h(of)g |
15639 | (directory)f(when)g(rotating)h(or)f(adding)1110 5340 | |
d37a4722 | 15640 | y(directories)31 b(to)h(the)e(stac)m(k,)i(so)f(that)g(only)f(the)h |
fffe80d4 | 15641 | (stac)m(k)h(is)e(manipulated.)p eop end |
e59452c7 CR |
15642 | %%Page: 103 109 |
15643 | TeXDict begin 103 108 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
15644 | b(Bash)30 b(F)-8 b(eatures)2439 b(103)630 299 y Ft(+)p |
15645 | Fj(N)384 b Fu(Brings)29 b(the)f Fr(N)10 b Fu(th)29 b(directory)g | |
15646 | (\(coun)m(ting)h(from)e(the)g(left)i(of)e(the)h(list)g(prin)m(ted)1110 | |
15647 | 408 y(b)m(y)34 b Ft(dirs)p Fu(,)g(starting)h(with)f(zero\))i(to)f(the)f | |
15648 | (top)g(of)h(the)f(list)h(b)m(y)f(rotating)i(the)1110 | |
15649 | 518 y(stac)m(k.)630 680 y Ft(-)p Fj(N)384 b Fu(Brings)23 | |
15650 | b(the)g Fr(N)10 b Fu(th)23 b(directory)h(\(coun)m(ting)g(from)e(the)i | |
15651 | (righ)m(t)f(of)g(the)h(list)f(prin)m(ted)1110 789 y(b)m(y)34 | |
15652 | b Ft(dirs)p Fu(,)g(starting)h(with)f(zero\))i(to)f(the)f(top)g(of)h | |
15653 | (the)f(list)h(b)m(y)f(rotating)i(the)1110 899 y(stac)m(k.)630 | |
15654 | 1060 y Fj(dir)336 b Fu(Mak)m(es)32 b Fr(dir)k Fu(b)s(e)30 | |
15655 | b(the)g(top)h(of)f(the)h(stac)m(k.)630 1222 y(After)39 | |
15656 | b(the)g(stac)m(k)h(has)e(b)s(een)g(mo)s(di\014ed,)i(if)f(the)g | |
15657 | Ft(-n)f Fu(option)h(w)m(as)g(not)g(supplied,)g Ft(pushd)630 | |
15658 | 1332 y Fu(uses)29 b(the)h Ft(cd)f Fu(builtin)g(to)h(c)m(hange)g(to)h | |
15659 | (the)e(directory)h(at)g(the)g(top)g(of)f(the)h(stac)m(k.)42 | |
15660 | b(If)29 b(the)h Ft(cd)630 1441 y Fu(fails,)h Ft(pushd)e | |
15661 | Fu(returns)g(a)i(non-zero)g(v)-5 b(alue.)630 1577 y(Otherwise,)34 | |
e59452c7 | 15662 | b(if)g(no)f(argumen)m(ts)h(are)g(supplied,)f Ft(pushd)f |
fffe80d4 | 15663 | Fu(returns)g(0)i(unless)f(the)g(directory)630 1686 y(stac)m(k)g(is)f |
e59452c7 | 15664 | (empt)m(y)-8 b(.)46 b(When)32 b(rotating)h(the)f(directory)g(stac)m(k,) |
fffe80d4 | 15665 | i Ft(pushd)d Fu(returns)f(0)j(unless)e(the)630 1796 y(directory)g(stac) |
e59452c7 | 15666 | m(k)h(is)e(empt)m(y)h(or)f(a)h(non-existen)m(t)h(directory)f(stac)m(k)g |
fffe80d4 | 15667 | (elemen)m(t)h(is)f(sp)s(eci\014ed.)630 1931 y(If)e(the)g |
e59452c7 CR |
15668 | Ft(pushd)f Fu(command)h(is)g(successful,)h(Bash)f(runs)f |
15669 | Ft(dirs)g Fu(to)i(sho)m(w)f(the)g(\014nal)g(con)m(ten)m(ts)630 | |
fffe80d4 CR |
15670 | 2041 y(of)i(the)f(directory)h(stac)m(k.)150 2285 y Fs(6.9)68 |
15671 | b(Con)l(trolling)47 b(the)e(Prompt)150 2444 y Fu(Bash)37 | |
e59452c7 CR |
15672 | b(examines)h(the)f(v)-5 b(alue)37 b(of)g(the)h(arra)m(y)f(v)-5 |
15673 | b(ariable)38 b Ft(PROMPT_COMMAND)33 b Fu(just)j(b)s(efore)h(prin)m | |
fffe80d4 | 15674 | (ting)g(eac)m(h)150 2554 y(primary)c(prompt.)49 b(If)33 |
e59452c7 CR |
15675 | b(an)m(y)h(elemen)m(ts)h(in)f Ft(PROMPT_COMMAND)29 b |
15676 | Fu(are)34 b(set)h(and)e(non-n)m(ull,)h(Bash)g(executes)150 | |
fffe80d4 | 15677 | 2664 y(eac)m(h)e(v)-5 b(alue,)31 b(in)f(n)m(umeric)g(order,)g(just)g |
d37a4722 | 15678 | (as)g(if)h(it)g(had)e(b)s(een)h(t)m(yp)s(ed)g(on)g(the)h(command)f |
fffe80d4 | 15679 | (line.)275 2800 y(In)d(addition,)j(the)f(follo)m(wing)h(table)f |
d37a4722 | 15680 | (describ)s(es)f(the)h(sp)s(ecial)g(c)m(haracters)h(whic)m(h)f(can)f |
fffe80d4 | 15681 | (app)s(ear)g(in)h(the)150 2910 y(prompt)g(v)-5 b(ariables)32 |
d37a4722 | 15682 | b Ft(PS0)p Fu(,)d Ft(PS1)p Fu(,)h Ft(PS2)p Fu(,)g(and)f |
fffe80d4 CR |
15683 | Ft(PS4)p Fu(:)150 3072 y Ft(\\a)384 b Fu(A)30 b(b)s(ell)h(c)m |
15684 | (haracter.)150 3234 y Ft(\\d)384 b Fu(The)30 b(date,)h(in)f | |
d37a4722 CR |
15685 | Ft(")p Fu(W)-8 b(eekda)m(y)32 b(Mon)m(th)f(Date)p Ft(")h |
15686 | Fu(format)f(\(e.g.,)h Ft(")p Fu(T)-8 b(ue)30 b(Ma)m(y)h(26)p | |
fffe80d4 CR |
15687 | Ft(")p Fu(\).)150 3396 y Ft(\\D{)p Fj(format)p Ft(})630 |
15688 | 3505 y Fu(The)c Fr(format)i Fu(is)f(passed)e(to)i Ft(strftime)p | |
e59452c7 | 15689 | Fu(\(3\))f(and)f(the)i(result)f(is)g(inserted)g(in)m(to)h(the)g(prompt) |
fffe80d4 | 15690 | 630 3615 y(string;)42 b(an)d(empt)m(y)f Fr(format)j Fu(results)d(in)g |
e59452c7 | 15691 | (a)h(lo)s(cale-sp)s(eci\014c)h(time)f(represen)m(tation.)65 |
fffe80d4 | 15692 | b(The)630 3724 y(braces)31 b(are)f(required.)150 3886 |
e59452c7 | 15693 | y Ft(\\e)384 b Fu(An)30 b(escap)s(e)h(c)m(haracter.)150 |
fffe80d4 CR |
15694 | 4047 y Ft(\\h)384 b Fu(The)30 b(hostname,)h(up)e(to)i(the)g(\014rst)e |
15695 | (`.'.)150 4209 y Ft(\\H)384 b Fu(The)30 b(hostname.)150 | |
15696 | 4371 y Ft(\\j)384 b Fu(The)30 b(n)m(um)m(b)s(er)f(of)h(jobs)g(curren)m | |
15697 | (tly)h(managed)g(b)m(y)f(the)g(shell.)150 4532 y Ft(\\l)384 | |
d37a4722 | 15698 | b Fu(The)30 b(basename)h(of)f(the)h(shell's)f(terminal)h(device)g |
fffe80d4 CR |
15699 | (name.)150 4694 y Ft(\\n)384 b Fu(A)30 b(newline.)150 |
15700 | 4855 y Ft(\\r)384 b Fu(A)30 b(carriage)i(return.)150 | |
15701 | 5017 y Ft(\\s)384 b Fu(The)22 b(name)g(of)h(the)f(shell,)i(the)f | |
d37a4722 | 15702 | (basename)f(of)h Ft($0)f Fu(\(the)g(p)s(ortion)g(follo)m(wing)i(the)f |
fffe80d4 CR |
15703 | (\014nal)e(slash\).)150 5178 y Ft(\\t)384 b Fu(The)30 |
15704 | b(time,)h(in)f(24-hour)h(HH:MM:SS)g(format.)150 5340 | |
15705 | y Ft(\\T)384 b Fu(The)30 b(time,)h(in)f(12-hour)h(HH:MM:SS)g(format.)p | |
15706 | eop end | |
e59452c7 CR |
15707 | %%Page: 104 110 |
15708 | TeXDict begin 104 109 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
15709 | b(Bash)30 b(F)-8 b(eatures)2439 b(104)150 299 y Ft(\\@)384 |
15710 | b Fu(The)30 b(time,)h(in)f(12-hour)h(am/pm)f(format.)150 | |
15711 | 456 y Ft(\\A)384 b Fu(The)30 b(time,)h(in)f(24-hour)h(HH:MM)g(format.) | |
15712 | 150 613 y Ft(\\u)384 b Fu(The)30 b(username)g(of)g(the)h(curren)m(t)f | |
15713 | (user.)150 770 y Ft(\\v)384 b Fu(The)30 b(v)m(ersion)h(of)f(Bash)h | |
15714 | (\(e.g.,)h(2.00\))150 927 y Ft(\\V)384 b Fu(The)30 b(release)i(of)e | |
15715 | (Bash,)h(v)m(ersion)g Ft(+)f Fu(patc)m(hlev)m(el)i(\(e.g.,)h(2.00.0\)) | |
15716 | 150 1084 y Ft(\\w)384 b Fu(The)27 b(v)-5 b(alue)28 b(of)g(the)g | |
e59452c7 CR |
15717 | Ft(PWD)f Fu(shell)h(v)-5 b(ariable)28 b(\()p Ft($PWD)p |
15718 | Fu(\),)g(with)g Ft($HOME)e Fu(abbreviated)i(with)f(a)h(tilde)630 | |
fffe80d4 CR |
15719 | 1194 y(\(uses)i(the)h Ft($PROMPT_DIRTRIM)26 b Fu(v)-5 |
15720 | b(ariable\).)150 1351 y Ft(\\W)384 b Fu(The)30 b(basename)h(of)f | |
e59452c7 | 15721 | Ft($PWD)p Fu(,)g(with)g Ft($HOME)f Fu(abbreviated)h(with)g(a)h(tilde.) |
fffe80d4 CR |
15722 | 150 1508 y Ft(\\!)384 b Fu(The)30 b(history)g(n)m(um)m(b)s(er)f(of)i |
15723 | (this)f(command.)150 1665 y Ft(\\#)384 b Fu(The)30 b(command)g(n)m(um)m | |
15724 | (b)s(er)f(of)i(this)f(command.)150 1822 y Ft(\\$)384 | |
e59452c7 | 15725 | b Fu(If)30 b(the)g(e\013ectiv)m(e)j(uid)d(is)g(0,)h Ft(#)p |
fffe80d4 | 15726 | Fu(,)g(otherwise)g Ft($)p Fu(.)150 1979 y Ft(\\)p Fj(nnn)288 |
e59452c7 | 15727 | b Fu(The)30 b(c)m(haracter)i(whose)e(ASCI)s(I)f(co)s(de)h(is)h(the)f(o) |
fffe80d4 CR |
15728 | s(ctal)i(v)-5 b(alue)31 b Fr(nnn)p Fu(.)150 2137 y Ft(\\\\)384 |
15729 | b Fu(A)30 b(bac)m(kslash.)150 2294 y Ft(\\[)384 b Fu(Begin)38 | |
d37a4722 CR |
15730 | b(a)f(sequence)g(of)g(non-prin)m(ting)g(c)m(haracters.)61 |
15731 | b(This)36 b(could)h(b)s(e)g(used)f(to)h(em)m(b)s(ed)g(a)630 | |
fffe80d4 CR |
15732 | 2403 y(terminal)31 b(con)m(trol)h(sequence)e(in)m(to)i(the)e(prompt.) |
15733 | 150 2560 y Ft(\\])384 b Fu(End)29 b(a)i(sequence)g(of)f(non-prin)m | |
15734 | (ting)g(c)m(haracters.)275 2717 y(The)25 b(command)h(n)m(um)m(b)s(er)f | |
d37a4722 | 15735 | (and)h(the)g(history)g(n)m(um)m(b)s(er)f(are)i(usually)f(di\013eren)m |
fffe80d4 | 15736 | (t:)39 b(the)26 b(history)g(n)m(um)m(b)s(er)150 2827 |
d37a4722 | 15737 | y(of)h(a)f(command)h(is)f(its)h(p)s(osition)f(in)g(the)h(history)f |
fc527055 | 15738 | (list,)i(whic)m(h)f(ma)m(y)g(include)f(commands)g(restored)g(from)150 |
fffe80d4 CR |
15739 | 2937 y(the)39 b(history)h(\014le)f(\(see)h(Section)g(9.1)h([Bash)e |
15740 | (History)h(F)-8 b(acilities],)45 b(page)40 b(151\),)j(while)d(the)f | |
15741 | (command)150 3046 y(n)m(um)m(b)s(er)j(is)h(the)h(p)s(osition)f(in)g | |
fc527055 | 15742 | (the)g(sequence)h(of)f(commands)g(executed)h(during)e(the)i(curren)m(t) |
fffe80d4 | 15743 | f(shell)150 3156 y(session.)275 3289 y(After)28 b(the)g(string)g(is)g |
e59452c7 | 15744 | (deco)s(ded,)g(it)g(is)g(expanded)f(via)i(parameter)f(expansion,)h |
fffe80d4 | 15745 | (command)f(substitu-)150 3399 y(tion,)g(arithmetic)f(expansion,)g(and)e |
e59452c7 | 15746 | (quote)i(remo)m(v)-5 b(al,)29 b(sub)5 b(ject)25 b(to)i(the)f(v)-5 |
fffe80d4 | 15747 | b(alue)27 b(of)f(the)g Ft(promptvars)e Fu(shell)150 3508 |
e59452c7 CR |
15748 | y(option)i(\(see)h(Section)g(4.3.2)g([The)f(Shopt)f(Builtin],)j(page)e |
15749 | (70\).)41 b(This)25 b(can)h(ha)m(v)m(e)h(un)m(w)m(an)m(ted)f(side)g | |
fffe80d4 | 15750 | (e\013ects)150 3618 y(if)i(escap)s(ed)f(p)s(ortions)g(of)h(the)g |
e59452c7 | 15751 | (string)f(app)s(ear)g(within)g(command)h(substitution)f(or)h(con)m |
fffe80d4 CR |
15752 | (tain)g(c)m(haracters)150 3727 y(sp)s(ecial)j(to)g(w)m(ord)f |
15753 | (expansion.)150 3966 y Fs(6.10)68 b(The)45 b(Restricted)h(Shell)150 | |
15754 | 4125 y Fu(If)34 b(Bash)g(is)g(started)g(with)g(the)g(name)h | |
d37a4722 | 15755 | Ft(rbash)p Fu(,)e(or)h(the)h Ft(--restricted)30 b Fu(or)k |
fffe80d4 | 15756 | Ft(-r)g Fu(option)g(is)g(supplied)f(at)150 4235 y(in)m(v)m(o)s(cation,) |
d37a4722 CR |
15757 | d(the)d(shell)g(b)s(ecomes)h(restricted.)40 b(A)27 b(restricted)h |
15758 | (shell)f(is)g(used)f(to)i(set)f(up)f(an)h(en)m(vironmen)m(t)150 | |
fffe80d4 | 15759 | 4344 y(more)g(con)m(trolled)i(than)e(the)g(standard)g(shell.)40 |
d37a4722 | 15760 | b(A)27 b(restricted)h(shell)f(b)s(eha)m(v)m(es)h(iden)m(tically)h(to)f |
fffe80d4 | 15761 | Ft(bash)e Fu(with)150 4454 y(the)31 b(exception)g(that)g(the)g(follo)m |
d37a4722 | 15762 | (wing)h(are)e(disallo)m(w)m(ed)i(or)e(not)h(p)s(erformed:)225 |
fffe80d4 CR |
15763 | 4587 y Fq(\017)60 b Fu(Changing)30 b(directories)h(with)g(the)f |
15764 | Ft(cd)g Fu(builtin.)225 4721 y Fq(\017)60 b Fu(Setting)33 | |
d37a4722 CR |
15765 | b(or)g(unsetting)f(the)h(v)-5 b(alues)33 b(of)f(the)h |
15766 | Ft(SHELL)p Fu(,)f Ft(PATH)p Fu(,)g Ft(HISTFILE)p Fu(,)f | |
15767 | Ft(ENV)p Fu(,)h(or)g Ft(BASH_ENV)e Fu(v)-5 b(ari-)330 | |
fffe80d4 CR |
15768 | 4830 y(ables.)225 4964 y Fq(\017)60 b Fu(Sp)s(ecifying)30 |
15769 | b(command)g(names)g(con)m(taining)i(slashes.)225 5097 | |
d37a4722 CR |
15770 | y Fq(\017)60 b Fu(Sp)s(ecifying)30 b(a)h(\014lename)f(con)m(taining)i |
15771 | (a)f(slash)f(as)h(an)f(argumen)m(t)h(to)g(the)f Ft(.)h | |
fffe80d4 | 15772 | Fu(builtin)e(command.)225 5230 y Fq(\017)60 b Fu(Sp)s(ecifying)33 |
d37a4722 | 15773 | b(a)i(\014lename)f(con)m(taining)h(a)g(slash)e(as)i(an)e(argumen)m(t)i |
fffe80d4 CR |
15774 | (to)g(the)f Ft(history)e Fu(builtin)h(com-)330 5340 y(mand.)p |
15775 | eop end | |
e59452c7 CR |
15776 | %%Page: 105 111 |
15777 | TeXDict begin 105 110 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15778 | b(Bash)30 b(F)-8 b(eatures)2439 b(105)225 299 y Fq(\017)60 | |
fffe80d4 CR |
15779 | b Fu(Sp)s(ecifying)32 b(a)g(\014lename)h(con)m(taining)h(a)e(slash)g |
15780 | (as)h(an)f(argumen)m(t)h(to)g(the)f Ft(-p)g Fu(option)h(to)g(the)f | |
15781 | Ft(hash)330 408 y Fu(builtin)e(command.)225 548 y Fq(\017)60 | |
15782 | b Fu(Imp)s(orting)30 b(function)g(de\014nitions)g(from)f(the)i(shell)g | |
15783 | (en)m(vironmen)m(t)g(at)g(startup.)225 687 y Fq(\017)60 | |
e59452c7 CR |
15784 | b Fu(P)m(arsing)31 b(the)f(v)-5 b(alue)31 b(of)g Ft(SHELLOPTS)d |
15785 | Fu(from)h(the)i(shell)g(en)m(vironmen)m(t)g(at)g(startup.)225 | |
fffe80d4 | 15786 | 826 y Fq(\017)60 b Fu(Redirecting)31 b(output)f(using)g(the)h(`)p |
e59452c7 CR |
15787 | Ft(>)p Fu(',)g(`)p Ft(>|)p Fu(',)f(`)p Ft(<>)p Fu(',)h(`)p |
15788 | Ft(>&)p Fu(',)f(`)p Ft(&>)p Fu(',)h(and)e(`)p Ft(>>)p | |
fffe80d4 | 15789 | Fu(')i(redirection)g(op)s(erators.)225 965 y Fq(\017)60 |
e59452c7 | 15790 | b Fu(Using)31 b(the)f Ft(exec)f Fu(builtin)h(to)h(replace)h(the)e |
fffe80d4 | 15791 | (shell)h(with)f(another)h(command.)225 1104 y Fq(\017)60 |
e59452c7 CR |
15792 | b Fu(Adding)24 b(or)g(deleting)i(builtin)e(commands)g(with)h(the)f |
15793 | Ft(-f)g Fu(and)g Ft(-d)g Fu(options)h(to)h(the)e Ft(enable)f | |
fffe80d4 | 15794 | Fu(builtin.)225 1243 y Fq(\017)60 b Fu(Using)31 b(the)f |
e59452c7 | 15795 | Ft(enable)f Fu(builtin)h(command)g(to)h(enable)g(disabled)f(shell)g |
fffe80d4 | 15796 | (builtins.)225 1382 y Fq(\017)60 b Fu(Sp)s(ecifying)30 |
e59452c7 | 15797 | b(the)g Ft(-p)g Fu(option)h(to)g(the)g Ft(command)d Fu(builtin.)225 |
fffe80d4 CR |
15798 | 1521 y Fq(\017)60 b Fu(T)-8 b(urning)29 b(o\013)i(restricted)g(mo)s(de) |
15799 | f(with)g(`)p Ft(set)g(+r)p Fu(')g(or)g(`)p Ft(shopt)f(-u)h | |
15800 | (restricted_shell)p Fu('.)275 1695 y(These)g(restrictions)h(are)g | |
15801 | (enforced)f(after)h(an)m(y)g(startup)f(\014les)g(are)h(read.)275 | |
15802 | 1838 y(When)j(a)i(command)e(that)i(is)f(found)f(to)h(b)s(e)g(a)g(shell) | |
15803 | g(script)g(is)g(executed)h(\(see)g(Section)g(3.8)g([Shell)150 | |
3011048a | 15804 | 1948 y(Scripts],)25 b(page)e(46\),)j Ft(rbash)c Fu(turns)g(o\013)i(an)m |
fffe80d4 CR |
15805 | (y)f(restrictions)h(in)f(the)g(shell)h(spa)m(wned)e(to)i(execute)g(the) |
15806 | g(script.)275 2092 y(The)32 b(restricted)h(shell)g(mo)s(de)g(is)g(only) | |
15807 | g(one)g(comp)s(onen)m(t)g(of)g(a)g(useful)f(restricted)i(en)m(vironmen) | |
15808 | m(t.)49 b(It)150 2201 y(should)22 b(b)s(e)f(accompanied)j(b)m(y)e | |
15809 | (setting)i Ft(PATH)d Fu(to)j(a)f(v)-5 b(alue)23 b(that)g(allo)m(ws)h | |
15810 | (execution)f(of)g(only)g(a)g(few)f(v)m(eri\014ed)150 | |
15811 | 2311 y(commands)35 b(\(commands)g(that)h(allo)m(w)g(shell)f(escap)s(es) | |
15812 | h(are)f(particularly)h(vulnerable\),)h(c)m(hanging)f(the)150 | |
15813 | 2420 y(curren)m(t)28 b(directory)g(to)h(a)f(non-writable)g(directory)g | |
e59452c7 | 15814 | (other)g(than)g Ft($HOME)e Fu(after)j(login,)g(not)f(allo)m(wing)i(the) |
fffe80d4 | 15815 | 150 2530 y(restricted)25 b(shell)g(to)h(execute)g(shell)f(scripts,)h |
e59452c7 | 15816 | (and)e(cleaning)i(the)f(en)m(vironmen)m(t)h(of)f(v)-5 |
fffe80d4 | 15817 | b(ariables)25 b(that)g(cause)150 2640 y(some)31 b(commands)f(to)h(mo)s |
e59452c7 | 15818 | (dify)e(their)i(b)s(eha)m(vior)f(\(e.g.,)j Ft(VISUAL)28 |
fffe80d4 | 15819 | b Fu(or)j Ft(PAGER)p Fu(\).)275 2783 y(Mo)s(dern)e(systems)g(pro)m |
e59452c7 | 15820 | (vide)h(more)g(secure)g(w)m(a)m(ys)g(to)h(implemen)m(t)f(a)g |
fffe80d4 | 15821 | (restricted)h(en)m(vironmen)m(t,)f(suc)m(h)150 2893 y(as)h |
e59452c7 | 15822 | Ft(jails)p Fu(,)e Ft(zones)p Fu(,)g(or)h Ft(containers)p |
fffe80d4 CR |
15823 | Fu(.)150 3148 y Fs(6.11)68 b(Bash)45 b(POSIX)f(Mo)t(de)150 |
15824 | 3307 y Fu(Starting)39 b(Bash)f(with)g(the)h Ft(--posix)d | |
e59452c7 | 15825 | Fu(command-line)j(option)g(or)f(executing)h(`)p Ft(set)30 |
fffe80d4 | 15826 | b(-o)g(posix)p Fu(')37 b(while)150 3417 y(Bash)26 b(is)g(running)e |
e59452c7 | 15827 | (will)j(cause)f(Bash)g(to)h(conform)f(more)g(closely)h(to)g(the)f |
fffe80d4 | 15828 | Fm(posix)f Fu(standard)g(b)m(y)h(c)m(hanging)150 3526 |
e59452c7 CR |
15829 | y(the)31 b(b)s(eha)m(vior)f(to)h(matc)m(h)g(that)g(sp)s(eci\014ed)f(b)m |
15830 | (y)g Fm(posix)g Fu(in)g(areas)h(where)f(the)h(Bash)f(default)h | |
fffe80d4 | 15831 | (di\013ers.)275 3670 y(When)f(in)m(v)m(ok)m(ed)h(as)g |
52e46969 | 15832 | Ft(sh)p Fu(,)f(Bash)h(en)m(ters)g Fm(posix)e Fu(mo)s(de)h(after)h |
fffe80d4 | 15833 | (reading)g(the)f(startup)g(\014les.)275 3814 y(The)f(follo)m(wing)j |
52e46969 | 15834 | (list)f(is)g(what's)f(c)m(hanged)h(when)e(`)p Fm(posix)h |
fffe80d4 | 15835 | Fu(mo)s(de')h(is)f(in)g(e\013ect:)199 3957 y(1.)61 b(Bash)31 |
52e46969 | 15836 | b(ensures)e(that)i(the)f Ft(POSIXLY_CORRECT)d Fu(v)-5 |
fffe80d4 | 15837 | b(ariable)31 b(is)f(set.)199 4096 y(2.)61 b(When)28 b(a)i(command)e(in) |
52e46969 | 15838 | g(the)h(hash)f(table)i(no)e(longer)h(exists,)h(Bash)f(will)g(re-searc)m |
fffe80d4 | 15839 | (h)h Ft($PATH)d Fu(to)i(\014nd)330 4206 y(the)i(new)e(lo)s(cation.)43 |
52e46969 | 15840 | b(This)29 b(is)i(also)g(a)m(v)-5 b(ailable)33 b(with)d(`)p |
fffe80d4 | 15841 | Ft(shopt)f(-s)h(checkhash)p Fu('.)199 4345 y(3.)61 b(Bash)36 |
d37a4722 | 15842 | b(will)g(not)g(insert)g(a)g(command)f(without)h(the)g(execute)h(bit)f |
fffe80d4 | 15843 | (set)g(in)m(to)h(the)f(command)g(hash)330 4455 y(table,)c(ev)m(en)f(if) |
d37a4722 | 15844 | f(it)h(returns)e(it)i(as)g(a)f(\(last-ditc)m(h\))j(result)d(from)g(a)h |
fffe80d4 | 15845 | Ft($PATH)e Fu(searc)m(h.)199 4594 y(4.)61 b(The)42 b(message)h(prin)m |
d37a4722 | 15846 | (ted)e(b)m(y)h(the)g(job)g(con)m(trol)i(co)s(de)e(and)f(builtins)h |
fffe80d4 CR |
15847 | (when)f(a)h(job)g(exits)h(with)f(a)330 4703 y(non-zero)31 |
15848 | b(status)g(is)f(`Done\(status\)'.)199 4843 y(5.)61 b(The)40 | |
d37a4722 CR |
15849 | b(message)h(prin)m(ted)f(b)m(y)g(the)h(job)f(con)m(trol)h(co)s(de)g |
15850 | (and)f(builtins)f(when)h(a)g(job)g(is)h(stopp)s(ed)e(is)330 | |
fffe80d4 | 15851 | 4952 y(`Stopp)s(ed\()p Fr(signame)5 b Fu(\)',)31 b(where)f |
d37a4722 | 15852 | Fr(signame)36 b Fu(is,)31 b(for)f(example,)h Ft(SIGTSTP)p |
fffe80d4 | 15853 | Fu(.)199 5091 y(6.)61 b(Alias)31 b(expansion)g(is)f(alw)m(a)m(ys)i |
d37a4722 | 15854 | (enabled,)e(ev)m(en)i(in)e(non-in)m(teractiv)m(e)j(shells.)199 |
fffe80d4 | 15855 | 5230 y(7.)61 b(Reserv)m(ed)40 b(w)m(ords)g(app)s(earing)f(in)h(a)g(con) |
9e6c30de | 15856 | m(text)i(where)d(reserv)m(ed)h(w)m(ords)f(are)i(recognized)g(do)f(not) |
fffe80d4 CR |
15857 | 330 5340 y(undergo)30 b(alias)h(expansion.)p eop end |
15858 | %%Page: 106 112 | |
15859 | TeXDict begin 106 111 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
15860 | b(Bash)30 b(F)-8 b(eatures)2439 b(106)199 299 y(8.)61 | |
6e51e0d0 CR |
15861 | b(The)38 b Fm(posix)h Ft(PS1)f Fu(and)g Ft(PS2)g Fu(expansions)g(of)i |
15862 | (`)p Ft(!)p Fu(')f(to)g(the)g(history)g(n)m(um)m(b)s(er)f(and)g(`)p | |
fffe80d4 | 15863 | Ft(!!)p Fu(')h(to)g(`)p Ft(!)p Fu(')h(are)330 408 y(enabled,)26 |
ac18b312 | 15864 | b(and)f(parameter)g(expansion)g(is)g(p)s(erformed)e(on)i(the)g(v)-5 |
6e51e0d0 | 15865 | b(alues)25 b(of)g Ft(PS1)f Fu(and)h Ft(PS2)f Fu(regardless)330 |
fffe80d4 CR |
15866 | 518 y(of)31 b(the)f(setting)i(of)e(the)h Ft(promptvars)c |
15867 | Fu(option.)199 646 y(9.)61 b(The)30 b Fm(posix)g Fu(startup)f(\014les)i | |
15868 | (are)g(executed)g(\()p Ft($ENV)p Fu(\))f(rather)g(than)g(the)h(normal)f | |
15869 | (Bash)g(\014les.)154 774 y(10.)61 b(Tilde)30 b(expansion)g(is)f(only)h | |
15870 | (p)s(erformed)f(on)h(assignmen)m(ts)g(preceding)g(a)g(command)g(name,)g | |
15871 | (rather)330 883 y(than)g(on)g(all)i(assignmen)m(t)f(statemen)m(ts)h(on) | |
15872 | e(the)h(line.)154 1011 y(11.)61 b(The)30 b(default)g(history)h(\014le)f | |
15873 | (is)h Ft(~/.sh_history)26 b Fu(\(this)31 b(is)f(the)h(default)g(v)-5 | |
15874 | b(alue)30 b(of)h Ft($HISTFILE)p Fu(\).)154 1139 y(12.)61 | |
e59452c7 CR |
15875 | b(Redirection)25 b(op)s(erators)f(do)g(not)g(p)s(erform)f(\014lename)h |
15876 | (expansion)g(on)g(the)g(w)m(ord)f(in)h(the)g(redirection)330 | |
fffe80d4 CR |
15877 | 1249 y(unless)30 b(the)g(shell)h(is)f(in)m(teractiv)m(e.)154 |
15878 | 1377 y(13.)61 b(Redirection)31 b(op)s(erators)g(do)f(not)h(p)s(erform)e | |
d61300ec | 15879 | (w)m(ord)h(splitting)h(on)f(the)h(w)m(ord)f(in)g(the)g(redirection.)154 |
fffe80d4 | 15880 | 1504 y(14.)61 b(F)-8 b(unction)35 b(names)g(m)m(ust)f(b)s(e)g(v)-5 |
b52e30b8 | 15881 | b(alid)35 b(shell)f Ft(name)p Fu(s.)52 b(That)34 b(is,)i(they)f(ma)m(y) |
fffe80d4 | 15882 | g(not)g(con)m(tain)g(c)m(haracters)330 1614 y(other)e(than)g(letters,)h |
b52e30b8 | 15883 | (digits,)h(and)d(underscores,)h(and)f(ma)m(y)h(not)g(start)h(with)e(a)h |
fffe80d4 | 15884 | (digit.)49 b(Declaring)330 1724 y(a)31 b(function)f(with)g(an)g(in)m(v) |
b52e30b8 | 15885 | -5 b(alid)31 b(name)g(causes)f(a)h(fatal)h(syn)m(tax)f(error)f(in)g |
fffe80d4 | 15886 | (non-in)m(teractiv)m(e)j(shells.)154 1851 y(15.)61 b(F)-8 |
b52e30b8 CR |
15887 | b(unction)31 b(names)f(ma)m(y)h(not)g(b)s(e)f(the)g(same)h(as)g(one)f |
15888 | (of)h(the)f Fm(posix)g Fu(sp)s(ecial)h(builtins.)154 | |
fffe80d4 | 15889 | 1979 y(16.)61 b Fm(posix)30 b Fu(sp)s(ecial)h(builtins)e(are)i(found)e |
879213c6 | 15890 | (b)s(efore)h(shell)h(functions)f(during)f(command)h(lo)s(okup.)154 |
fffe80d4 | 15891 | 2107 y(17.)61 b(When)48 b(prin)m(ting)g(shell)h(function)f |
124d67cd | 15892 | (de\014nitions)g(\(e.g.,)55 b(b)m(y)48 b Ft(type)p Fu(\),)k(Bash)d(do)s |
fffe80d4 CR |
15893 | (es)f(not)h(prin)m(t)f(the)330 2217 y Ft(function)28 |
15894 | b Fu(k)m(eyw)m(ord.)154 2345 y(18.)61 b(Literal)28 b(tildes)g(that)f | |
b52e30b8 CR |
15895 | (app)s(ear)f(as)i(the)f(\014rst)f(c)m(haracter)j(in)d(elemen)m(ts)j(of) |
15896 | e(the)g Ft(PATH)f Fu(v)-5 b(ariable)27 b(are)h(not)330 | |
fffe80d4 CR |
15897 | 2454 y(expanded)i(as)g(describ)s(ed)f(ab)s(o)m(v)m(e)j(under)d(Section) |
15898 | i(3.5.2)h([Tilde)f(Expansion],)f(page)h(25.)154 2582 | |
9e6c30de | 15899 | y(19.)61 b(The)29 b Ft(time)g Fu(reserv)m(ed)h(w)m(ord)g(ma)m(y)g(b)s |
b52e30b8 | 15900 | (e)g(used)f(b)m(y)h(itself)g(as)g(a)h(command.)40 b(When)30 |
fffe80d4 | 15901 | b(used)f(in)g(this)h(w)m(a)m(y)-8 b(,)330 2692 y(it)33 |
b52e30b8 CR |
15902 | b(displa)m(ys)g(timing)g(statistics)h(for)e(the)h(shell)g(and)f(its)g |
15903 | (completed)i(c)m(hildren.)47 b(The)32 b Ft(TIMEFORMAT)330 | |
fffe80d4 CR |
15904 | 2801 y Fu(v)-5 b(ariable)31 b(con)m(trols)h(the)e(format)h(of)g(the)f |
15905 | (timing)h(information.)154 2929 y(20.)61 b(When)33 b(parsing)g(and)f | |
b52e30b8 CR |
15906 | (expanding)h(a)h($)p Fi({)6 b Fu(.)22 b(.)h(.)11 b Fi(})33 |
15907 | b Fu(expansion)g(that)h(app)s(ears)f(within)f(double)h(quotes,)330 | |
fffe80d4 | 15908 | 3039 y(single)42 b(quotes)g(are)g(no)g(longer)g(sp)s(ecial)g(and)f |
e59452c7 | 15909 | (cannot)i(b)s(e)e(used)g(to)h(quote)g(a)g(closing)h(brace)f(or)330 |
fffe80d4 | 15910 | 3148 y(other)31 b(sp)s(ecial)h(c)m(haracter,)i(unless)c(the)i(op)s |
e59452c7 | 15911 | (erator)f(is)g(one)h(of)f(those)h(de\014ned)e(to)i(p)s(erform)e |
fffe80d4 | 15912 | (pattern)330 3258 y(remo)m(v)-5 b(al.)42 b(In)30 b(this)g(case,)i(they) |
e59452c7 | 15913 | e(do)g(not)h(ha)m(v)m(e)h(to)f(app)s(ear)e(as)i(matc)m(hed)g(pairs.)154 |
fffe80d4 | 15914 | 3386 y(21.)61 b(The)29 b(parser)g(do)s(es)g(not)h(recognize)h |
d37a4722 | 15915 | Ft(time)d Fu(as)i(a)g(reserv)m(ed)f(w)m(ord)g(if)h(the)f(next)h(tok)m |
fffe80d4 CR |
15916 | (en)h(b)s(egins)d(with)i(a)330 3495 y(`)p Ft(-)p Fu('.)154 |
15917 | 3623 y(22.)61 b(The)30 b(`)p Ft(!)p Fu(')h(c)m(haracter)h(do)s(es)e | |
e59452c7 | 15918 | (not)h(in)m(tro)s(duce)g(history)f(expansion)h(within)f(a)h |
fffe80d4 CR |
15919 | (double-quoted)g(string,)330 3733 y(ev)m(en)g(if)f(the)h |
15920 | Ft(histexpand)d Fu(option)i(is)h(enabled.)154 3861 y(23.)61 | |
e59452c7 CR |
15921 | b(If)24 b(a)g Fm(posix)g Fu(sp)s(ecial)h(builtin)f(returns)f(an)h |
15922 | (error)g(status,)i(a)e(non-in)m(teractiv)m(e)j(shell)e(exits.)39 | |
fffe80d4 | 15923 | b(The)24 b(fatal)330 3970 y(errors)30 b(are)h(those)f(listed)h(in)f |
e59452c7 | 15924 | (the)h Fm(posix)e Fu(standard,)h(and)g(include)g(things)g(lik)m(e)i |
fffe80d4 | 15925 | (passing)e(incorrect)330 4080 y(options,)43 b(redirection)d(errors,)i |
e59452c7 | 15926 | (v)-5 b(ariable)41 b(assignmen)m(t)g(errors)e(for)g(assignmen)m(ts)i |
fffe80d4 CR |
15927 | (preceding)f(the)330 4189 y(command)30 b(name,)h(and)f(so)g(on.)154 |
15928 | 4317 y(24.)61 b(A)31 b(non-in)m(teractiv)m(e)j(shell)d(exits)h(with)e | |
d37a4722 | 15929 | (an)h(error)g(status)g(if)g(a)g(v)-5 b(ariable)32 b(assignmen)m(t)g |
fffe80d4 | 15930 | (error)e(o)s(ccurs)330 4427 y(when)38 b(no)h(command)g(name)g(follo)m |
d37a4722 | 15931 | (ws)i(the)e(assignmen)m(t)h(statemen)m(ts.)69 b(A)39 |
fffe80d4 | 15932 | b(v)-5 b(ariable)40 b(assignmen)m(t)330 4536 y(error)30 |
d37a4722 | 15933 | b(o)s(ccurs,)g(for)g(example,)i(when)d(trying)i(to)g(assign)f(a)h(v)-5 |
fffe80d4 | 15934 | b(alue)31 b(to)g(a)g(readonly)f(v)-5 b(ariable.)154 4664 |
d37a4722 CR |
15935 | y(25.)61 b(A)31 b(non-in)m(teractiv)m(e)j(shell)d(exits)h(with)e(an)h |
15936 | (error)g(status)g(if)g(a)g(v)-5 b(ariable)32 b(assignmen)m(t)g(error)e | |
fffe80d4 | 15937 | (o)s(ccurs)330 4774 y(in)g(an)g(assignmen)m(t)i(statemen)m(t)g |
d37a4722 | 15938 | (preceding)e(a)h(sp)s(ecial)g(builtin,)f(but)g(not)g(with)h(an)m(y)f |
fffe80d4 | 15939 | (other)h(simple)330 4883 y(command.)38 b(F)-8 b(or)23 |
e59452c7 | 15940 | b(an)m(y)g(other)g(simple)g(command,)h(the)f(shell)g(ab)s(orts)f |
fffe80d4 | 15941 | (execution)i(of)f(that)g(command,)330 4993 y(and)44 b(execution)i(con)m |
e59452c7 CR |
15942 | (tin)m(ues)g(at)g(the)f(top)g(lev)m(el)h(\()p Ft(")p |
15943 | Fu(the)f(shell)h(shall)f(not)g(p)s(erform)e(an)m(y)i(further)330 | |
fffe80d4 CR |
15944 | 5103 y(pro)s(cessing)30 b(of)h(the)f(command)g(in)g(whic)m(h)h(the)f |
15945 | (error)g(o)s(ccurred)p Ft(")p Fu(\).)154 5230 y(26.)61 | |
d37a4722 CR |
15946 | b(A)43 b(non-in)m(teractiv)m(e)i(shell)e(exits)h(with)f(an)f(error)h |
15947 | (status)g(if)g(the)g(iteration)h(v)-5 b(ariable)44 b(in)f(a)g | |
fffe80d4 | 15948 | Ft(for)330 5340 y Fu(statemen)m(t)32 b(or)f(the)f(selection)i(v)-5 |
d37a4722 | 15949 | b(ariable)32 b(in)e(a)g Ft(select)f Fu(statemen)m(t)j(is)f(a)f |
fffe80d4 | 15950 | (readonly)h(v)-5 b(ariable.)p eop end |
e59452c7 CR |
15951 | %%Page: 107 113 |
15952 | TeXDict begin 107 112 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
15953 | b(Bash)30 b(F)-8 b(eatures)2439 b(107)154 299 y(27.)61 |
15954 | b(Non-in)m(teractiv)m(e)34 b(shells)c(exit)h(if)g Fr(\014lename)k | |
15955 | Fu(in)30 b Ft(.)g Fr(\014lename)36 b Fu(is)31 b(not)f(found.)154 | |
15956 | 432 y(28.)61 b(Non-in)m(teractiv)m(e)41 b(shells)d(exit)h(if)f(a)g(syn) | |
15957 | m(tax)g(error)g(in)f(an)h(arithmetic)h(expansion)f(results)f(in)h(an) | |
15958 | 330 541 y(in)m(v)-5 b(alid)31 b(expression.)154 674 y(29.)61 | |
e59452c7 | 15959 | b(Non-in)m(teractiv)m(e)34 b(shells)c(exit)h(if)g(a)f(parameter)h |
fffe80d4 | 15960 | (expansion)g(error)f(o)s(ccurs.)154 806 y(30.)61 b(Non-in)m(teractiv)m |
e59452c7 CR |
15961 | (e)27 b(shells)c(exit)i(if)e(there)h(is)f(a)h(syn)m(tax)g(error)f(in)g |
15962 | (a)h(script)f(read)g(with)h(the)f Ft(.)g Fu(or)h Ft(source)330 | |
fffe80d4 CR |
15963 | 916 y Fu(builtins,)30 b(or)g(in)g(a)h(string)g(pro)s(cessed)e(b)m(y)i |
15964 | (the)f Ft(eval)f Fu(builtin.)154 1049 y(31.)61 b(While)32 | |
e59452c7 CR |
15965 | b(v)-5 b(ariable)32 b(indirection)f(is)g(a)m(v)-5 b(ailable,)34 |
15966 | b(it)d(ma)m(y)h(not)f(b)s(e)g(applied)g(to)g(the)h(`)p | |
15967 | Ft(#)p Fu(')f(and)f(`)p Ft(?)p Fu(')h(sp)s(ecial)330 | |
fffe80d4 | 15968 | 1158 y(parameters.)154 1291 y(32.)61 b(When)28 b(expanding)g(the)g(`)p |
d61300ec | 15969 | Ft(*)p Fu(')g(sp)s(ecial)h(parameter)f(in)g(a)h(pattern)f(con)m(text)i |
fffe80d4 | 15970 | (where)e(the)g(expansion)g(is)330 1401 y(double-quoted)i(do)s(es)g(not) |
d61300ec | 15971 | h(treat)h(the)e Ft($*)g Fu(as)h(if)f(it)h(w)m(ere)g(double-quoted.)154 |
fffe80d4 | 15972 | 1533 y(33.)61 b(Assignmen)m(t)23 b(statemen)m(ts)h(preceding)e |
d61300ec | 15973 | Fm(posix)f Fu(sp)s(ecial)i(builtins)f(p)s(ersist)g(in)f(the)i(shell)f |
fffe80d4 CR |
15974 | (en)m(vironmen)m(t)330 1643 y(after)31 b(the)f(builtin)g(completes.)154 |
15975 | 1775 y(34.)61 b(The)31 b Ft(command)e Fu(builtin)i(do)s(es)g(not)h | |
d37a4722 | 15976 | (prev)m(en)m(t)f(builtins)g(that)h(tak)m(e)h(assignmen)m(t)f(statemen)m |
fffe80d4 | 15977 | (ts)h(as)f(ar-)330 1885 y(gumen)m(ts)40 b(from)e(expanding)h(them)g(as) |
d37a4722 | 15978 | h(assignmen)m(t)g(statemen)m(ts;)46 b(when)38 b(not)i(in)f |
fffe80d4 | 15979 | Fm(posix)f Fu(mo)s(de,)330 1995 y(assignmen)m(t)k(builtins)e(lose)h |
d37a4722 | 15980 | (their)g(assignmen)m(t)h(statemen)m(t)h(expansion)d(prop)s(erties)g |
fffe80d4 CR |
15981 | (when)g(pre-)330 2104 y(ceded)31 b(b)m(y)f Ft(command)p |
15982 | Fu(.)154 2237 y(35.)61 b(The)27 b Ft(bg)g Fu(builtin)g(uses)g(the)h | |
d37a4722 | 15983 | (required)f(format)h(to)g(describ)s(e)f(eac)m(h)i(job)e(placed)h(in)f |
fffe80d4 | 15984 | (the)h(bac)m(kground,)330 2346 y(whic)m(h)h(do)s(es)g(not)g(include)g |
d37a4722 | 15985 | (an)g(indication)h(of)f(whether)f(the)h(job)g(is)g(the)h(curren)m(t)e |
fffe80d4 | 15986 | (or)h(previous)g(job.)154 2479 y(36.)61 b(The)23 b(output)f(of)i(`)p |
d37a4722 CR |
15987 | Ft(kill)29 b(-l)p Fu(')23 b(prin)m(ts)f(all)i(the)g(signal)f(names)g |
15988 | (on)g(a)h(single)g(line,)h(separated)e(b)m(y)g(spaces,)330 | |
fffe80d4 CR |
15989 | 2589 y(without)30 b(the)h(`)p Ft(SIG)p Fu(')f(pre\014x.)154 |
15990 | 2721 y(37.)61 b(The)30 b Ft(kill)f Fu(builtin)h(do)s(es)g(not)h(accept) | |
124d67cd | 15991 | h(signal)f(names)f(with)g(a)h(`)p Ft(SIG)p Fu(')f(pre\014x.)154 |
fffe80d4 | 15992 | 2854 y(38.)61 b(The)38 b Ft(export)f Fu(and)g Ft(readonly)f |
124d67cd | 15993 | Fu(builtin)i(commands)g(displa)m(y)h(their)f(output)g(in)g(the)h |
fffe80d4 CR |
15994 | (format)g(re-)330 2964 y(quired)30 b(b)m(y)g Fm(posix)p |
15995 | Fu(.)154 3096 y(39.)61 b(The)30 b Ft(trap)f Fu(builtin)h(displa)m(ys)g | |
124d67cd | 15996 | (signal)i(names)e(without)g(the)h(leading)g Ft(SIG)p |
fffe80d4 | 15997 | Fu(.)154 3229 y(40.)61 b(The)39 b Ft(trap)e Fu(builtin)i(do)s(esn't)g |
e59452c7 | 15998 | (c)m(hec)m(k)h(the)g(\014rst)e(argumen)m(t)i(for)e(a)i(p)s(ossible)e |
fffe80d4 | 15999 | (signal)i(sp)s(eci\014cation)330 3339 y(and)30 b(rev)m(ert)i(the)e |
e59452c7 | 16000 | (signal)i(handling)e(to)h(the)g(original)h(disp)s(osition)e(if)h(it)g |
fffe80d4 | 16001 | (is,)g(unless)f(that)h(argumen)m(t)330 3448 y(consists)e(solely)g(of)g |
e59452c7 CR |
16002 | (digits)g(and)f(is)g(a)h(v)-5 b(alid)29 b(signal)g(n)m(um)m(b)s(er.)38 |
16003 | b(If)28 b(users)g(w)m(an)m(t)h(to)g(reset)g(the)g(handler)330 | |
fffe80d4 | 16004 | 3558 y(for)h(a)g(giv)m(en)h(signal)g(to)f(the)h(original)g(disp)s |
d37a4722 | 16005 | (osition,)f(they)g(should)f(use)h(`)p Ft(-)p Fu(')g(as)g(the)g(\014rst) |
fffe80d4 | 16006 | f(argumen)m(t.)154 3690 y(41.)61 b Ft(trap)29 b(-p)35 |
d37a4722 | 16007 | b Fu(displa)m(ys)h(signals)h(whose)f(disp)s(ositions)f(are)h(set)h(to)f |
fffe80d4 CR |
16008 | (SIG)p 2687 3690 28 4 v 40 w(DFL)g(and)g(those)g(that)g(w)m(ere)330 |
16009 | 3800 y(ignored)30 b(when)g(the)g(shell)h(started.)154 | |
16010 | 3933 y(42.)61 b(The)21 b Ft(.)h Fu(and)f Ft(source)f | |
d37a4722 | 16011 | Fu(builtins)h(do)g(not)h(searc)m(h)h(the)f(curren)m(t)f(directory)h |
fffe80d4 | 16012 | (for)g(the)g(\014lename)f(argumen)m(t)330 4042 y(if)30 |
d37a4722 | 16013 | b(it)h(is)g(not)f(found)f(b)m(y)i(searc)m(hing)g Ft(PATH)p |
fffe80d4 | 16014 | Fu(.)154 4175 y(43.)61 b(Enabling)21 b Fm(posix)g Fu(mo)s(de)g(has)g |
d37a4722 | 16015 | (the)g(e\013ect)i(of)e(setting)i(the)e Ft(inherit_errexit)d |
fffe80d4 | 16016 | Fu(option,)23 b(so)f(subshells)330 4284 y(spa)m(wned)27 |
d37a4722 CR |
16017 | b(to)i(execute)g(command)e(substitutions)h(inherit)f(the)h(v)-5 |
16018 | b(alue)28 b(of)g(the)g Ft(-e)f Fu(option)h(from)g(the)330 | |
fffe80d4 | 16019 | 4394 y(paren)m(t)37 b(shell.)62 b(When)37 b(the)g Ft(inherit_errexit)c |
d37a4722 | 16020 | Fu(option)38 b(is)f(not)h(enabled,)h(Bash)e(clears)h(the)g |
fffe80d4 CR |
16021 | Ft(-e)330 4504 y Fu(option)31 b(in)f(suc)m(h)g(subshells.)154 |
16022 | 4636 y(44.)61 b(Enabling)32 b Fm(posix)f Fu(mo)s(de)h(has)g(the)h | |
d37a4722 | 16023 | (e\013ect)g(of)g(setting)g(the)g Ft(shift_verbose)28 |
fffe80d4 | 16024 | b Fu(option,)34 b(so)e(n)m(umeric)330 4746 y(argumen)m(ts)f(to)g |
d37a4722 CR |
16025 | Ft(shift)f Fu(that)h(exceed)h(the)e(n)m(um)m(b)s(er)g(of)h(p)s |
16026 | (ositional)g(parameters)g(will)g(result)g(in)f(an)330 | |
fffe80d4 | 16027 | 4855 y(error)g(message.)154 4988 y(45.)61 b(When)43 b(the)g |
d37a4722 | 16028 | Ft(alias)f Fu(builtin)g(displa)m(ys)i(alias)g(de\014nitions,)i(it)d(do) |
fffe80d4 | 16029 | s(es)g(not)g(displa)m(y)h(them)f(with)g(a)330 5098 y(leading)31 |
d37a4722 | 16030 | b(`)p Ft(alias)e Fu(')i(unless)f(the)g Ft(-p)g Fu(option)h(is)f |
fffe80d4 | 16031 | (supplied.)154 5230 y(46.)61 b(When)40 b(the)g Ft(set)f |
d37a4722 | 16032 | Fu(builtin)h(is)g(in)m(v)m(ok)m(ed)h(without)f(options,)j(it)e(do)s(es) |
fffe80d4 CR |
16033 | f(not)g(displa)m(y)g(shell)g(function)330 5340 y(names)30 |
16034 | b(and)g(de\014nitions.)p eop end | |
e59452c7 CR |
16035 | %%Page: 108 114 |
16036 | TeXDict begin 108 113 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
16037 | b(Bash)30 b(F)-8 b(eatures)2439 b(108)154 299 y(47.)61 |
16038 | b(When)36 b(the)g Ft(set)g Fu(builtin)g(is)g(in)m(v)m(ok)m(ed)i | |
16039 | (without)e(options,)i(it)f(displa)m(ys)f(v)-5 b(ariable)37 | |
16040 | b(v)-5 b(alues)37 b(without)330 408 y(quotes,)26 b(unless)d(they)i(con) | |
16041 | m(tain)g(shell)f(metac)m(haracters,)k(ev)m(en)d(if)f(the)g(result)g | |
16042 | (con)m(tains)i(nonprin)m(ting)330 518 y(c)m(haracters.)154 | |
16043 | 663 y(48.)61 b(When)35 b(the)h Ft(cd)e Fu(builtin)h(is)h(in)m(v)m(ok)m | |
16044 | (ed)g(in)f(logical)j(mo)s(de,)e(and)f(the)h(pathname)f(constructed)g | |
16045 | (from)330 772 y Ft($PWD)i Fu(and)h(the)h(directory)f(name)h(supplied)e | |
16046 | (as)i(an)f(argumen)m(t)h(do)s(es)f(not)g(refer)h(to)g(an)f(existing)330 | |
16047 | 882 y(directory)-8 b(,)32 b Ft(cd)d Fu(will)i(fail)g(instead)g(of)f | |
e59452c7 | 16048 | (falling)h(bac)m(k)h(to)f(ph)m(ysical)g(mo)s(de.)154 |
fffe80d4 CR |
16049 | 1026 y(49.)61 b(When)37 b(the)h Ft(cd)f Fu(builtin)g(cannot)h(c)m |
16050 | (hange)h(a)f(directory)g(b)s(ecause)g(the)g(length)g(of)f(the)h | |
16051 | (pathname)330 1136 y(constructed)27 b(from)g Ft($PWD)f | |
16052 | Fu(and)h(the)g(directory)h(name)f(supplied)f(as)i(an)f(argumen)m(t)g | |
16053 | (exceeds)h Ft(PATH_)330 1245 y(MAX)d Fu(when)g(all)h(sym)m(b)s(olic)g | |
16054 | (links)g(are)g(expanded,)g Ft(cd)f Fu(will)h(fail)h(instead)f(of)g | |
16055 | (attempting)h(to)f(use)g(only)330 1355 y(the)31 b(supplied)e(directory) | |
16056 | i(name.)154 1499 y(50.)61 b(The)36 b Ft(pwd)f Fu(builtin)h(v)m | |
16057 | (eri\014es)h(that)g(the)f(v)-5 b(alue)37 b(it)g(prin)m(ts)e(is)i(the)f | |
16058 | (same)h(as)f(the)h(curren)m(t)f(directory)-8 b(,)330 | |
16059 | 1609 y(ev)m(en)31 b(if)f(it)h(is)g(not)f(ask)m(ed)h(to)g(c)m(hec)m(k)h | |
16060 | (the)f(\014le)f(system)h(with)f(the)h Ft(-P)e Fu(option.)154 | |
16061 | 1753 y(51.)61 b(When)35 b(listing)g(the)g(history)-8 | |
16062 | b(,)36 b(the)f Ft(fc)g Fu(builtin)f(do)s(es)g(not)h(include)g(an)f | |
16063 | (indication)i(of)f(whether)f(or)330 1863 y(not)d(a)f(history)h(en)m | |
16064 | (try)f(has)g(b)s(een)g(mo)s(di\014ed.)154 2007 y(52.)61 | |
16065 | b(The)30 b(default)g(editor)h(used)f(b)m(y)g Ft(fc)g | |
16066 | Fu(is)g Ft(ed)p Fu(.)154 2152 y(53.)61 b(The)37 b Ft(type)g | |
16067 | Fu(and)g Ft(command)f Fu(builtins)i(will)g(not)g(rep)s(ort)f(a)i | |
16068 | (non-executable)g(\014le)f(as)g(ha)m(ving)h(b)s(een)330 | |
16069 | 2262 y(found,)26 b(though)h(the)g(shell)g(will)g(attempt)h(to)g | |
122f603c | 16070 | (execute)g(suc)m(h)f(a)g(\014le)g(if)g(it)g(is)g(the)g(only)g(so-named) |
fffe80d4 CR |
16071 | g(\014le)330 2371 y(found)i(in)h Ft($PATH)p Fu(.)154 |
16072 | 2516 y(54.)61 b(The)33 b Ft(vi)f Fu(editing)i(mo)s(de)f(will)g(in)m(v)m | |
a6ae8f35 | 16073 | (ok)m(e)i(the)e Ft(vi)g Fu(editor)h(directly)f(when)f(the)i(`)p |
fffe80d4 CR |
16074 | Ft(v)p Fu(')f(command)g(is)g(run,)330 2625 y(instead)e(of)f(c)m(hec)m |
16075 | (king)i Ft($VISUAL)d Fu(and)g Ft($EDITOR)p Fu(.)154 2770 | |
9e6c30de | 16076 | y(55.)61 b(When)41 b(the)g Ft(xpg_echo)e Fu(option)i(is)g(enabled,)j |
a6ae8f35 | 16077 | (Bash)d(do)s(es)g(not)g(attempt)h(to)g(in)m(terpret)f(an)m(y)h(ar-)330 |
fffe80d4 | 16078 | 2879 y(gumen)m(ts)35 b(to)g Ft(echo)e Fu(as)i(options.)54 |
1c72c0cd | 16079 | b(Eac)m(h)35 b(argumen)m(t)g(is)f(displa)m(y)m(ed,)j(after)e(escap)s(e) |
fffe80d4 CR |
16080 | g(c)m(haracters)h(are)330 2989 y(con)m(v)m(erted.)154 |
16081 | 3133 y(56.)61 b(The)30 b Ft(ulimit)f Fu(builtin)g(uses)h(a)h(blo)s(c)m | |
6e51e0d0 | 16082 | (k)g(size)g(of)g(512)g(b)m(ytes)g(for)f(the)h Ft(-c)f |
fffe80d4 | 16083 | Fu(and)g Ft(-f)f Fu(options.)154 3278 y(57.)61 b(The)39 |
e59452c7 CR |
16084 | b(arriv)-5 b(al)41 b(of)f Ft(SIGCHLD)e Fu(when)h(a)h(trap)g(is)g(set)h |
16085 | (on)f Ft(SIGCHLD)e Fu(do)s(es)h(not)h(in)m(terrupt)g(the)g | |
fffe80d4 | 16086 | Ft(wait)330 3387 y Fu(builtin)c(and)h(cause)g(it)h(to)f(return)f |
e1e48bba | 16087 | (immediately)-8 b(.)62 b(The)37 b(trap)f(command)h(is)g(run)e(once)j |
fffe80d4 CR |
16088 | (for)f(eac)m(h)330 3497 y(c)m(hild)31 b(that)g(exits.)154 |
16089 | 3641 y(58.)61 b(The)27 b Ft(read)f Fu(builtin)g(ma)m(y)i(b)s(e)e(in)m | |
124d67cd | 16090 | (terrupted)h(b)m(y)g(a)h(signal)f(for)g(whic)m(h)g(a)h(trap)f(has)g(b)s |
fffe80d4 | 16091 | (een)f(set.)40 b(If)27 b(Bash)330 3751 y(receiv)m(es)41 |
124d67cd CR |
16092 | b(a)f(trapp)s(ed)e(signal)i(while)f(executing)h Ft(read)p |
16093 | Fu(,)h(the)e(trap)h(handler)e(executes)i(and)f Ft(read)330 | |
fffe80d4 CR |
16094 | 3861 y Fu(returns)29 b(an)h(exit)i(status)e(greater)i(than)e(128.)154 |
16095 | 4005 y(59.)61 b(Bash)27 b(remo)m(v)m(es)h(an)e(exited)i(bac)m(kground)e | |
124d67cd | 16096 | (pro)s(cess's)h(status)g(from)f(the)h(list)g(of)g(suc)m(h)f(statuses)h |
fffe80d4 CR |
16097 | (after)330 4115 y(the)k Ft(wait)e Fu(builtin)h(is)g(used)g(to)h(obtain) |
16098 | g(it.)275 4304 y(There)j(is)g(other)h Fm(posix)f Fu(b)s(eha)m(vior)h | |
fc35c477 | 16099 | (that)g(Bash)g(do)s(es)f(not)h(implemen)m(t)g(b)m(y)g(default)f(ev)m |
fffe80d4 CR |
16100 | (en)i(when)d(in)150 4413 y Fm(posix)d Fu(mo)s(de.)40 |
16101 | b(Sp)s(eci\014cally:)199 4568 y(1.)61 b(The)30 b Ft(fc)f | |
d37a4722 CR |
16102 | Fu(builtin)h(c)m(hec)m(ks)i Ft($EDITOR)c Fu(as)j(a)f(program)g(to)h |
16103 | (edit)g(history)f(en)m(tries)h(if)f Ft(FCEDIT)f Fu(is)h(unset,)330 | |
fffe80d4 | 16104 | 4677 y(rather)g(than)g(defaulting)h(directly)g(to)g Ft(ed)p |
d37a4722 | 16105 | Fu(.)40 b Ft(fc)30 b Fu(uses)g Ft(ed)g Fu(if)g Ft(EDITOR)f |
fffe80d4 | 16106 | Fu(is)h(unset.)199 4822 y(2.)61 b(As)29 b(noted)g(ab)s(o)m(v)m(e,)i |
d37a4722 | 16107 | (Bash)e(requires)g(the)g Ft(xpg_echo)e Fu(option)j(to)g(b)s(e)e |
fffe80d4 CR |
16108 | (enabled)h(for)g(the)g Ft(echo)f Fu(builtin)330 4932 |
16109 | y(to)j(b)s(e)f(fully)g(conforman)m(t.)275 5121 y(Bash)c(can)g(b)s(e)f | |
d37a4722 CR |
16110 | (con\014gured)h(to)g(b)s(e)g Fm(posix)p Fu(-conforman)m(t)g(b)m(y)g |
16111 | (default,)h(b)m(y)f(sp)s(ecifying)g(the)g Ft(--enable-)150 | |
fffe80d4 | 16112 | 5230 y(strict-posix-default)c Fu(to)27 b Ft(configure)e |
d37a4722 | 16113 | Fu(when)h(building)h(\(see)h(Section)g(10.8)g([Optional)g(F)-8 |
fffe80d4 CR |
16114 | b(eatures],)150 5340 y(page)31 b(160\).)p eop end |
16115 | %%Page: 109 115 | |
16116 | TeXDict begin 109 114 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
16117 | b(Bash)30 b(F)-8 b(eatures)2439 b(109)150 299 y Fs(6.12)68 | |
16118 | b(Shell)46 b(Compatibilit)l(y)h(Mo)t(de)150 458 y Fu(Bash-4.0)30 | |
d37a4722 CR |
16119 | b(in)m(tro)s(duced)d(the)i(concept)g(of)f(a)h(`shell)f(compatibilit)m |
16120 | (y)i(lev)m(el',)h(sp)s(eci\014ed)d(as)g(a)h(set)f(of)h(options)150 | |
fffe80d4 | 16121 | 568 y(to)i(the)f(shopt)g(builtin)g(\()p Ft(compat31)p |
d37a4722 | 16122 | Fu(,)e Ft(compat32)p Fu(,)h Ft(compat40)p Fu(,)f Ft(compat41)p |
fffe80d4 CR |
16123 | Fu(,)g(and)i(so)g(on\).)41 b(There)30 b(is)g(only)150 |
16124 | 677 y(one)f(curren)m(t)f(compatibilit)m(y)j(lev)m(el)f({)f(eac)m(h)h | |
16125 | (option)f(is)g(m)m(utually)g(exclusiv)m(e.)41 b(The)28 | |
16126 | b(compatibilit)m(y)j(lev)m(el)150 787 y(is)39 b(in)m(tended)g(to)h | |
16127 | (allo)m(w)g(users)e(to)i(select)h(b)s(eha)m(vior)e(from)f(previous)h(v) | |
16128 | m(ersions)g(that)h(is)f(incompatible)150 897 y(with)d(new)m(er)g(v)m | |
16129 | (ersions)g(while)g(they)g(migrate)h(scripts)f(to)h(use)f(curren)m(t)f | |
16130 | (features)i(and)e(b)s(eha)m(vior.)58 b(It's)150 1006 | |
16131 | y(in)m(tended)30 b(to)h(b)s(e)f(a)h(temp)s(orary)f(solution.)275 | |
16132 | 1134 y(This)k(section)j(do)s(es)e(not)h(men)m(tion)g(b)s(eha)m(vior)g | |
16133 | (that)g(is)f(standard)g(for)g(a)h(particular)g(v)m(ersion)g(\(e.g.,)150 | |
16134 | 1244 y(setting)24 b Ft(compat32)e Fu(means)h(that)h(quoting)g(the)f | |
16135 | (rhs)g(of)g(the)h(regexp)f(matc)m(hing)i(op)s(erator)e(quotes)h(sp)s | |
16136 | (ecial)150 1354 y(regexp)31 b(c)m(haracters)g(in)g(the)f(w)m(ord,)g | |
16137 | (whic)m(h)g(is)h(default)f(b)s(eha)m(vior)h(in)f(bash-3.2)h(and)f(ab)s | |
16138 | (o)m(v)m(e\).)275 1482 y(If)f(a)h(user)f(enables,)h(sa)m(y)-8 | |
16139 | b(,)31 b Ft(compat32)p Fu(,)d(it)i(ma)m(y)g(a\013ect)h(the)f(b)s(eha)m | |
16140 | (vior)g(of)g(other)g(compatibilit)m(y)h(lev)m(els)150 | |
16141 | 1591 y(up)23 b(to)h(and)f(including)h(the)g(curren)m(t)f(compatibilit)m | |
16142 | (y)j(lev)m(el.)41 b(The)23 b(idea)h(is)g(that)g(eac)m(h)h(compatibilit) | |
16143 | m(y)h(lev)m(el)150 1701 y(con)m(trols)35 b(b)s(eha)m(vior)f(that)g(c)m | |
16144 | (hanged)g(in)f(that)h(v)m(ersion)g(of)g(Bash,)h(but)e(that)h(b)s(eha)m | |
16145 | (vior)g(ma)m(y)g(ha)m(v)m(e)h(b)s(een)150 1811 y(presen)m(t)f(in)g | |
16146 | (earlier)g(v)m(ersions.)52 b(F)-8 b(or)35 b(instance,)g(the)f(c)m | |
16147 | (hange)h(to)g(use)f(lo)s(cale-based)h(comparisons)f(with)150 | |
16148 | 1920 y(the)e Ft([[)f Fu(command)g(came)h(in)g(bash-4.1,)h(and)d | |
16149 | (earlier)j(v)m(ersions)f(used)f(ASCI)s(I-based)f(comparisons,)i(so)150 | |
16150 | 2030 y(enabling)27 b Ft(compat32)e Fu(will)i(enable)g(ASCI)s(I-based)e | |
d37a4722 | 16151 | (comparisons)i(as)g(w)m(ell.)41 b(That)26 b(gran)m(ularit)m(y)i(ma)m(y) |
fffe80d4 | 16152 | g(not)150 2139 y(b)s(e)i(su\016cien)m(t)i(for)f(all)g(uses,)g(and)g(as) |
d37a4722 | 16153 | g(a)g(result)g(users)f(should)g(emplo)m(y)i(compatibilit)m(y)h(lev)m |
fffe80d4 | 16154 | (els)g(carefully)-8 b(.)150 2249 y(Read)31 b(the)f(do)s(cumen)m(tation) |
d37a4722 | 16155 | h(for)g(a)f(particular)h(feature)g(to)g(\014nd)e(out)h(the)h(curren)m |
fffe80d4 | 16156 | (t)f(b)s(eha)m(vior.)275 2377 y(Bash-4.3)44 b(in)m(tro)s(duced)e(a)h |
d37a4722 CR |
16157 | (new)f(shell)h(v)-5 b(ariable:)65 b Ft(BASH_COMPAT)p |
16158 | Fu(.)75 b(The)42 b(v)-5 b(alue)43 b(assigned)g(to)g(this)150 | |
fffe80d4 | 16159 | 2487 y(v)-5 b(ariable)32 b(\(a)g(decimal)h(v)m(ersion)e(n)m(um)m(b)s |
d37a4722 | 16160 | (er)f(lik)m(e)j(4.2,)g(or)e(an)h(in)m(teger)g(corresp)s(onding)f(to)h |
fffe80d4 | 16161 | (the)f Ft(compat)p Fr(NN)150 2596 y Fu(option,)g(lik)m(e)h(42\))f |
d37a4722 | 16162 | (determines)g(the)f(compatibilit)m(y)j(lev)m(el.)275 |
fffe80d4 | 16163 | 2724 y(Starting)e(with)g(bash-4.4,)h(Bash)f(has)g(b)s(egun)f |
d37a4722 | 16164 | (deprecating)h(older)h(compatibilit)m(y)h(lev)m(els.)44 |
fffe80d4 | 16165 | b(Ev)m(en)m(tu-)150 2834 y(ally)-8 b(,)32 b(the)e(options)h(will)g(b)s |
d37a4722 | 16166 | (e)f(remo)m(v)m(ed)h(in)f(fa)m(v)m(or)i(of)e Ft(BASH_COMPAT)p |
fffe80d4 | 16167 | Fu(.)275 2962 y(Bash-5.0)36 b(is)f(the)g(\014nal)f(v)m(ersion)i(for)e |
d37a4722 | 16168 | (whic)m(h)h(there)g(will)g(b)s(e)f(an)h(individual)f(shopt)h(option)g |
fffe80d4 | 16169 | (for)g(the)150 3072 y(previous)30 b(v)m(ersion.)41 b(Users)30 |
d37a4722 | 16170 | b(should)g(use)g Ft(BASH_COMPAT)d Fu(on)j(bash-5.0)h(and)f(later)i(v)m |
fffe80d4 | 16171 | (ersions.)275 3200 y(The)24 b(follo)m(wing)i(table)g(describ)s(es)e |
e59452c7 | 16172 | (the)i(b)s(eha)m(vior)f(c)m(hanges)h(con)m(trolled)g(b)m(y)f(eac)m(h)h |
fffe80d4 | 16173 | (compatibilit)m(y)h(lev)m(el)150 3310 y(setting.)43 b(The)30 |
e59452c7 CR |
16174 | b Ft(compat)p Fr(NN)39 b Fu(tag)32 b(is)f(used)f(as)h(shorthand)e(for)h |
16175 | (setting)i(the)f(compatibilit)m(y)i(lev)m(el)f(to)g Fr(NN)150 | |
fffe80d4 | 16176 | 3419 y Fu(using)37 b(one)h(of)g(the)g(follo)m(wing)h(mec)m(hanisms.)63 |
e59452c7 | 16177 | b(F)-8 b(or)39 b(v)m(ersions)f(prior)f(to)h(bash-5.0,)j(the)d |
fffe80d4 | 16178 | (compatibilit)m(y)150 3529 y(lev)m(el)d(ma)m(y)f(b)s(e)e(set)i(using)e |
e59452c7 CR |
16179 | (the)i(corresp)s(onding)e Ft(compat)p Fr(NN)41 b Fu(shopt)33 |
16180 | b(option.)50 b(F)-8 b(or)34 b(bash-4.3)f(and)g(later)150 | |
fffe80d4 | 16181 | 3638 y(v)m(ersions,)40 b(the)e Ft(BASH_COMPAT)d Fu(v)-5 |
e59452c7 | 16182 | b(ariable)39 b(is)e(preferred,)i(and)e(it)i(is)f(required)f(for)g |
fffe80d4 CR |
16183 | (bash-5.1)i(and)e(later)150 3748 y(v)m(ersions.)150 3895 |
16184 | y Ft(compat31)705 4023 y Fq(\017)60 b Fu(quoting)34 b(the)g(rhs)e(of)i | |
e59452c7 | 16185 | (the)f Ft([[)g Fu(command's)h(regexp)f(matc)m(hing)i(op)s(erator)f(\(=) |
fffe80d4 CR |
16186 | p Ft(~)p Fu(\))f(has)810 4133 y(no)d(sp)s(ecial)h(e\013ect)150 |
16187 | 4279 y Ft(compat32)705 4407 y Fq(\017)60 b Fu(in)m(terrupting)28 | |
d37a4722 | 16188 | b(a)g(command)g(list)h(suc)m(h)f(as)g Ft(")p Fu(a)g(;)h(b)f(;)h(c)p |
fffe80d4 | 16189 | Ft(")f Fu(causes)h(the)f(execution)h(of)g(the)810 4517 |
d37a4722 | 16190 | y(next)j(command)f(in)g(the)h(list)g(\(in)f(bash-4.0)h(and)f(later)i(v) |
fffe80d4 | 16191 | m(ersions,)f(the)g(shell)f(acts)i(as)810 4627 y(if)i(it)i(receiv)m(ed)f |
d37a4722 | 16192 | (the)g(in)m(terrupt,)h(so)f(in)m(terrupting)f(one)h(command)f(in)g(a)h |
fffe80d4 CR |
16193 | (list)g(ab)s(orts)810 4736 y(the)31 b(execution)g(of)g(the)f(en)m(tire) |
16194 | i(list\))150 4883 y Ft(compat40)705 5011 y Fq(\017)60 | |
d37a4722 CR |
16195 | b Fu(the)35 b(`)p Ft(<)p Fu(')g(and)f(`)p Ft(>)p Fu(')g(op)s(erators)h |
16196 | (to)g(the)g Ft([[)f Fu(command)h(do)f(not)h(consider)f(the)h(curren)m | |
fffe80d4 | 16197 | (t)810 5121 y(lo)s(cale)41 b(when)d(comparing)i(strings;)k(they)c(use)f |
d37a4722 | 16198 | (ASCI)s(I)f(ordering.)67 b(Bash)40 b(v)m(ersions)810 |
fffe80d4 CR |
16199 | 5230 y(prior)f(to)i(bash-4.1)f(use)g(ASCI)s(I)e(collation)k(and)d |
16200 | (strcmp\(3\);)45 b(bash-4.1)c(and)e(later)810 5340 y(use)30 | |
d37a4722 | 16201 | b(the)h(curren)m(t)f(lo)s(cale's)i(collation)h(sequence)d(and)g |
fffe80d4 | 16202 | (strcoll\(3\).)p eop end |
e59452c7 CR |
16203 | %%Page: 110 116 |
16204 | TeXDict begin 110 115 bop 150 -116 a Fu(Chapter)30 b(6:)41 | |
fffe80d4 CR |
16205 | b(Bash)30 b(F)-8 b(eatures)2439 b(110)150 299 y Ft(compat41)705 |
16206 | 439 y Fq(\017)60 b Fu(in)29 b(p)s(osix)f(mo)s(de,)i Ft(time)e | |
16207 | Fu(ma)m(y)h(b)s(e)g(follo)m(w)m(ed)i(b)m(y)e(options)g(and)g(still)h(b) | |
16208 | s(e)e(recognized)j(as)810 548 y(a)g(reserv)m(ed)f(w)m(ord)g(\(this)h | |
16209 | (is)f Fm(posix)g Fu(in)m(terpretation)i(267\))705 689 | |
16210 | y Fq(\017)60 b Fu(in)37 b(p)s(osix)f(mo)s(de,)i(the)g(parser)e | |
16211 | (requires)g(that)i(an)f(ev)m(en)g(n)m(um)m(b)s(er)f(of)h(single)g | |
16212 | (quotes)810 798 y(o)s(ccur)28 b(in)g(the)h Fr(w)m(ord)i | |
16213 | Fu(p)s(ortion)d(of)h(a)g(double-quoted)f($)p Fi({)6 b | |
16214 | Fu(.)23 b(.)f(.)11 b Fi(})29 b Fu(parameter)g(expansion)810 | |
16215 | 908 y(and)34 b(treats)h(them)f(sp)s(ecially)-8 b(,)37 | |
16216 | b(so)e(that)g(c)m(haracters)g(within)f(the)h(single)g(quotes)g(are)810 | |
16217 | 1017 y(considered)30 b(quoted)h(\(this)f(is)h Fm(posix)e | |
16218 | Fu(in)m(terpretation)j(221\))150 1188 y Ft(compat42)705 | |
16219 | 1328 y Fq(\017)60 b Fu(the)29 b(replacemen)m(t)i(string)e(in)g | |
d37a4722 | 16220 | (double-quoted)h(pattern)f(substitution)g(do)s(es)g(not)h(un-)810 |
fffe80d4 CR |
16221 | 1437 y(dergo)h(quote)g(remo)m(v)-5 b(al,)32 b(as)e(it)h(do)s(es)f(in)g |
16222 | (v)m(ersions)h(after)g(bash-4.2)705 1577 y Fq(\017)60 | |
d37a4722 | 16223 | b Fu(in)39 b(p)s(osix)g(mo)s(de,)j(single)e(quotes)g(are)g(considered)f |
fffe80d4 | 16224 | (sp)s(ecial)h(when)f(expanding)g(the)810 1687 y Fr(w)m(ord)d |
d37a4722 CR |
16225 | Fu(p)s(ortion)c(of)g(a)h(double-quoted)g($)p Fi({)6 b |
16226 | Fu(.)22 b(.)h(.)11 b Fi(})33 b Fu(parameter)g(expansion)f(and)g(can)h | |
fffe80d4 | 16227 | (b)s(e)810 1797 y(used)40 b(to)i(quote)g(a)f(closing)h(brace)f(or)g |
d37a4722 | 16228 | (other)h(sp)s(ecial)f(c)m(haracter)i(\(this)e(is)g(part)g(of)810 |
fffe80d4 | 16229 | 1906 y Fm(posix)36 b Fu(in)m(terpretation)h(221\);)42 |
d37a4722 | 16230 | b(in)36 b(later)h(v)m(ersions,)h(single)f(quotes)g(are)g(not)f(sp)s |
fffe80d4 CR |
16231 | (ecial)810 2016 y(within)30 b(double-quoted)g(w)m(ord)g(expansions)150 |
16232 | 2186 y Ft(compat43)705 2326 y Fq(\017)60 b Fu(the)31 | |
d37a4722 | 16233 | b(shell)g(do)s(es)g(not)g(prin)m(t)f(a)h(w)m(arning)g(message)h(if)f |
fffe80d4 | 16234 | (an)g(attempt)h(is)f(made)f(to)i(use)f(a)810 2436 y(quoted)22 |
d37a4722 | 16235 | b(comp)s(ound)f(assignmen)m(t)i(as)f(an)g(argumen)m(t)h(to)g(declare)g |
fffe80d4 | 16236 | (\(declare)g(-a)g(fo)s(o='\(1)810 2545 y(2\)'\).)42 b(Later)31 |
d37a4722 | 16237 | b(v)m(ersions)g(w)m(arn)f(that)h(this)f(usage)h(is)f(deprecated)705 |
fffe80d4 | 16238 | 2685 y Fq(\017)60 b Fu(w)m(ord)21 b(expansion)g(errors)g(are)h |
d37a4722 | 16239 | (considered)f(non-fatal)h(errors)f(that)h(cause)g(the)f(curren)m(t)810 |
fffe80d4 | 16240 | 2795 y(command)k(to)g(fail,)i(ev)m(en)e(in)g(p)s(osix)f(mo)s(de)h |
d37a4722 | 16241 | (\(the)g(default)g(b)s(eha)m(vior)g(is)g(to)g(mak)m(e)h(them)810 |
fffe80d4 CR |
16242 | 2905 y(fatal)32 b(errors)d(that)i(cause)g(the)g(shell)f(to)i(exit\))705 |
16243 | 3045 y Fq(\017)60 b Fu(when)37 b(executing)i(a)g(shell)f(function,)i | |
e59452c7 | 16244 | (the)f(lo)s(op)f(state)h(\(while/un)m(til/etc.\))68 b(is)38 |
fffe80d4 | 16245 | b(not)810 3154 y(reset,)c(so)g Ft(break)d Fu(or)i Ft(continue)e |
d37a4722 | 16246 | Fu(in)h(that)i(function)f(will)g(break)g(or)g(con)m(tin)m(ue)h(lo)s |
fffe80d4 | 16247 | (ops)810 3264 y(in)h(the)g(calling)h(con)m(text.)57 b(Bash-4.4)37 |
d37a4722 | 16248 | b(and)d(later)i(reset)g(the)f(lo)s(op)g(state)i(to)e(prev)m(en)m(t)810 |
fffe80d4 | 16249 | 3373 y(this)150 3544 y Ft(compat44)705 3684 y Fq(\017)60 |
d37a4722 CR |
16250 | b Fu(the)41 b(shell)g(sets)g(up)e(the)i(v)-5 b(alues)41 |
16251 | b(used)f(b)m(y)h Ft(BASH_ARGV)d Fu(and)i Ft(BASH_ARGC)e | |
fffe80d4 | 16252 | Fu(so)j(they)810 3794 y(can)26 b(expand)f(to)h(the)g(shell's)g(p)s |
d37a4722 | 16253 | (ositional)g(parameters)g(ev)m(en)h(if)e(extended)h(debugging)810 |
fffe80d4 | 16254 | 3903 y(mo)s(de)k(is)g(not)h(enabled)705 4043 y Fq(\017)60 |
d37a4722 CR |
16255 | b Fu(a)40 b(subshell)f(inherits)g(lo)s(ops)h(from)g(its)g(paren)m(t)g |
16256 | (con)m(text,)k(so)c Ft(break)e Fu(or)i Ft(continue)810 | |
fffe80d4 | 16257 | 4153 y Fu(will)35 b(cause)g(the)f(subshell)f(to)i(exit.)54 |
d37a4722 | 16258 | b(Bash-5.0)36 b(and)d(later)j(reset)f(the)f(lo)s(op)h(state)g(to)810 |
fffe80d4 | 16259 | 4262 y(prev)m(en)m(t)c(the)g(exit)705 4402 y Fq(\017)60 |
d37a4722 CR |
16260 | b Fu(v)-5 b(ariable)28 b(assignmen)m(ts)h(preceding)f(builtins)f(lik)m |
16261 | (e)i Ft(export)d Fu(and)h Ft(readonly)e Fu(that)j(set)810 | |
fffe80d4 | 16262 | 4512 y(attributes)37 b(con)m(tin)m(ue)h(to)g(a\013ect)g(v)-5 |
d37a4722 | 16263 | b(ariables)37 b(with)g(the)f(same)h(name)g(in)g(the)f(calling)810 |
fffe80d4 CR |
16264 | 4622 y(en)m(vironmen)m(t)31 b(ev)m(en)g(if)f(the)h(shell)g(is)f(not)h |
16265 | (in)f(p)s(osix)f(mo)s(de)150 4792 y Ft(compat50)f(\(set)h(using)g | |
16266 | (BASH_COMPAT\))705 4902 y Fq(\017)60 b Fu(Bash-5.1)29 | |
d37a4722 | 16267 | b(c)m(hanged)g(the)f(w)m(a)m(y)g Ft($RANDOM)e Fu(is)i(generated)h(to)f |
fffe80d4 | 16268 | (in)m(tro)s(duce)g(sligh)m(tly)h(more)810 5011 y(randomness.)39 |
d37a4722 | 16269 | b(If)30 b(the)f(shell)h(compatibilit)m(y)i(lev)m(el)f(is)f(set)g(to)h |
fffe80d4 | 16270 | (50)f(or)g(lo)m(w)m(er,)h(it)f(rev)m(erts)810 5121 y(to)e(the)g(metho)s |
d37a4722 | 16271 | (d)f(from)g(bash-5.0)h(and)f(previous)g(v)m(ersions,)i(so)e(seeding)h |
fffe80d4 | 16272 | (the)g(random)810 5230 y(n)m(um)m(b)s(er)36 b(generator)j(b)m(y)e |
d37a4722 | 16273 | (assigning)h(a)g(v)-5 b(alue)38 b(to)g Ft(RANDOM)e Fu(will)i(pro)s |
fffe80d4 CR |
16274 | (duce)e(the)i(same)810 5340 y(sequence)31 b(as)f(in)g(bash-5.0)p |
16275 | eop end | |
e59452c7 | 16276 | %%Page: 111 117 |
fffe80d4 CR |
16277 | TeXDict begin 111 116 bop 150 -116 a Fu(Chapter)30 b(6:)41 |
16278 | b(Bash)30 b(F)-8 b(eatures)2439 b(111)705 299 y Fq(\017)60 | |
16279 | b Fu(If)22 b(the)g(command)g(hash)f(table)i(is)f(empt)m(y)-8 | |
16280 | b(,)25 b(Bash)d(v)m(ersions)g(prior)g(to)h(bash-5.1)f(prin)m(ted)810 | |
16281 | 408 y(an)29 b(informational)i(message)g(to)f(that)g(e\013ect,)h(ev)m | |
16282 | (en)g(when)d(pro)s(ducing)g(output)h(that)810 518 y(can)40 | |
16283 | b(b)s(e)g(reused)f(as)h(input.)69 b(Bash-5.1)42 b(suppresses)c(that)j | |
16284 | (message)g(when)e(the)i Ft(-l)810 628 y Fu(option)31 | |
16285 | b(is)f(supplied.)150 787 y Ft(compat51)e(\(set)h(using)g(BASH_COMPAT\)) | |
5e6f45d9 CR |
16286 | 705 897 y Fq(\017)60 b Fu(The)38 b Ft(unset)g Fu(builtin)g(will)h |
16287 | (unset)f(the)h(arra)m(y)g Ft(a)g Fu(giv)m(en)g(an)g(argumen)m(t)g(lik)m | |
16288 | (e)h(`)p Ft(a[@])p Fu('.)810 1006 y(Bash-5.2)32 b(will)f(unset)f(an)g | |
16289 | (elemen)m(t)i(with)e(k)m(ey)i(`)p Ft(@)p Fu(')e(\(asso)s(ciativ)m(e)k | |
16290 | (arra)m(ys\))d(or)f(remo)m(v)m(e)810 1116 y(all)h(the)g(elemen)m(ts)h | |
16291 | (without)e(unsetting)g(the)h(arra)m(y)g(\(indexed)f(arra)m(ys\))705 | |
16292 | 1250 y Fq(\017)60 b Fu(arithmetic)36 b(commands)e(\()h(\(\(...\)\))55 | |
16293 | b(\))f(and)34 b(the)g(expressions)h(in)f(an)g(arithmetic)i(for)810 | |
16294 | 1360 y(statemen)m(t)c(can)f(b)s(e)f(expanded)f(more)i(than)f(once)705 | |
16295 | 1494 y Fq(\017)60 b Fu(expressions)22 b(used)g(as)h(argumen)m(ts)g(to)h | |
16296 | (arithmetic)f(op)s(erators)g(in)g(the)g Ft([[)f Fu(conditional)810 | |
16297 | 1604 y(command)30 b(can)h(b)s(e)f(expanded)f(more)i(than)f(once)705 | |
16298 | 1738 y Fq(\017)60 b Fu(the)35 b(expressions)g(in)g(substring)e | |
16299 | (parameter)j(brace)f(expansion)g(can)g(b)s(e)g(expanded)810 | |
16300 | 1848 y(more)c(than)f(once)705 1983 y Fq(\017)60 b Fu(the)39 | |
16301 | b(expressions)f(in)g(the)h($\(\()h(...)66 b(\)\))f(w)m(ord)39 | |
16302 | b(expansion)f(can)h(b)s(e)f(expanded)g(more)810 2092 | |
16303 | y(than)30 b(once)705 2227 y Fq(\017)60 b Fu(arithmetic)36 | |
16304 | b(expressions)f(used)f(as)h(indexed)f(arra)m(y)i(subscripts)d(can)i(b)s | |
16305 | (e)g(expanded)810 2336 y(more)c(than)f(once)705 2471 | |
16306 | y Fq(\017)60 b Ft(test)29 b(-v)p Fu(,)35 b(when)f(giv)m(en)h(an)g | |
16307 | (argumen)m(t)g(of)f(`)p Ft(A[@])p Fu(',)h(where)f Fr(A)h | |
16308 | Fu(is)f(an)h(existing)g(asso-)810 2580 y(ciativ)m(e)h(arra)m(y)-8 | |
16309 | b(,)37 b(will)d(return)f(true)g(if)h(the)h(arra)m(y)f(has)g(an)m(y)g | |
16310 | (set)g(elemen)m(ts.)53 b(Bash-5.2)810 2690 y(will)31 | |
16311 | b(lo)s(ok)g(for)f(and)g(rep)s(ort)f(on)i(a)f(k)m(ey)i(named)d(`)p | |
16312 | Ft(@)p Fu(')705 2824 y Fq(\017)60 b Fu(the)40 b($)p Fi({)p | |
16313 | Fr(parameter)7 b Fu([:]=)p Fr(v)-5 b(alue)5 b Fi(})42 | |
16314 | b Fu(w)m(ord)e(expansion)f(will)i(return)d Fr(v)-5 b(alue)p | |
16315 | Fu(,)43 b(b)s(efore)d(an)m(y)810 2934 y(v)-5 b(ariable-sp)s(eci\014c)34 | |
16316 | b(transformations)f(ha)m(v)m(e)h(b)s(een)e(p)s(erformed)f(\(e.g.,)36 | |
16317 | b(con)m(v)m(erting)e(to)810 3044 y(lo)m(w)m(ercase\).)43 | |
16318 | b(Bash-5.2)32 b(will)f(return)e(the)i(\014nal)f(v)-5 | |
16319 | b(alue)31 b(assigned)f(to)i(the)e(v)-5 b(ariable.)p eop | |
16320 | end | |
fffe80d4 CR |
16321 | %%Page: 112 118 |
16322 | TeXDict begin 112 117 bop 3614 -116 a Fu(112)150 299 | |
4d63a619 CR |
16323 | y Fp(7)80 b(Job)54 b(Con)l(trol)150 518 y Fu(This)25 |
16324 | b(c)m(hapter)i(discusses)f(what)g(job)f(con)m(trol)j(is,)f(ho)m(w)f(it) | |
16325 | h(w)m(orks,)g(and)f(ho)m(w)g(Bash)g(allo)m(ws)h(y)m(ou)g(to)g(access) | |
16326 | 150 628 y(its)k(facilities.)150 863 y Fs(7.1)68 b(Job)45 | |
037a8b7f CR |
16327 | b(Con)l(trol)h(Basics)150 1022 y Fu(Job)27 b(con)m(trol)i(refers)e(to)h |
16328 | (the)g(abilit)m(y)h(to)f(selectiv)m(ely)j(stop)c(\(susp)s(end\))f(the)i | |
16329 | (execution)h(of)e(pro)s(cesses)h(and)150 1132 y(con)m(tin)m(ue)38 | |
16330 | b(\(resume\))g(their)f(execution)h(at)g(a)g(later)g(p)s(oin)m(t.)61 | |
16331 | b(A)37 b(user)g(t)m(ypically)i(emplo)m(ys)f(this)f(facilit)m(y)150 | |
967625cd | 16332 | 1241 y(via)27 b(an)e(in)m(teractiv)m(e)k(in)m(terface)f(supplied)d |
c302751c | 16333 | (join)m(tly)h(b)m(y)g(the)h(op)s(erating)f(system)g(k)m(ernel's)h |
967625cd | 16334 | (terminal)f(driv)m(er)150 1351 y(and)k(Bash.)275 1482 |
6e51e0d0 | 16335 | y(The)23 b(shell)i(asso)s(ciates)h(a)f Fr(job)h Fu(with)e(eac)m(h)i |
c302751c | 16336 | (pip)s(eline.)38 b(It)25 b(k)m(eeps)f(a)h(table)h(of)e(curren)m(tly)h |
967625cd | 16337 | (executing)g(jobs,)150 1592 y(whic)m(h)33 b(ma)m(y)i(b)s(e)e(listed)h |
6e51e0d0 | 16338 | (with)f(the)h Ft(jobs)f Fu(command.)50 b(When)33 b(Bash)h(starts)g(a)g |
967625cd CR |
16339 | (job)g(async)m(hronously)-8 b(,)34 b(it)150 1701 y(prin)m(ts)c(a)h |
16340 | (line)f(that)h(lo)s(oks)g(lik)m(e:)390 1833 y Ft([1])47 | |
16341 | b(25647)150 1965 y Fu(indicating)34 b(that)g(this)f(job)g(is)g(job)g(n) | |
6e51e0d0 | 16342 | m(um)m(b)s(er)f(1)i(and)f(that)g(the)h(pro)s(cess)f Fm(id)g |
967625cd | 16343 | Fu(of)g(the)h(last)g(pro)s(cess)f(in)g(the)150 2074 y(pip)s(eline)42 |
c302751c CR |
16344 | b(asso)s(ciated)i(with)e(this)g(job)g(is)h(25647.)78 |
16345 | b(All)43 b(of)g(the)g(pro)s(cesses)f(in)g(a)h(single)g(pip)s(eline)f | |
967625cd | 16346 | (are)150 2184 y(mem)m(b)s(ers)30 b(of)g(the)h(same)f(job.)41 |
6e51e0d0 | 16347 | b(Bash)30 b(uses)g(the)h Fr(job)h Fu(abstraction)f(as)g(the)g(basis)f |
967625cd | 16348 | (for)g(job)g(con)m(trol.)275 2315 y(T)-8 b(o)23 b(facilitate)j(the)d |
c302751c | 16349 | (implemen)m(tation)i(of)f(the)f(user)f(in)m(terface)j(to)f(job)f(con)m |
967625cd | 16350 | (trol,)j(the)d(op)s(erating)h(system)150 2425 y(main)m(tains)j(the)f |
c302751c | 16351 | (notion)h(of)f(a)g(curren)m(t)g(terminal)g(pro)s(cess)g(group)g |
6e51e0d0 | 16352 | Fm(id)p Fu(.)39 b(Mem)m(b)s(ers)26 b(of)g(this)g(pro)s(cess)f(group)150 |
967625cd | 16353 | 2534 y(\(pro)s(cesses)h(whose)g(pro)s(cess)g(group)g |
6e51e0d0 | 16354 | Fm(id)g Fu(is)h(equal)g(to)g(the)f(curren)m(t)g(terminal)h(pro)s(cess)f |
967625cd | 16355 | (group)f Fm(id)p Fu(\))i(receiv)m(e)150 2644 y(k)m(eyb)s |
6e51e0d0 CR |
16356 | (oard-generated)22 b(signals)g(suc)m(h)e(as)h Ft(SIGINT)p |
16357 | Fu(.)36 b(These)21 b(pro)s(cesses)g(are)g(said)g(to)g(b)s(e)g(in)f(the) | |
967625cd | 16358 | h(foreground.)150 2754 y(Bac)m(kground)38 b(pro)s(cesses)f(are)h(those) |
6e51e0d0 | 16359 | g(whose)f(pro)s(cess)g(group)g Fm(id)h Fu(di\013ers)f(from)g(the)g |
967625cd | 16360 | (terminal's;)42 b(suc)m(h)150 2863 y(pro)s(cesses)24 |
37c41ab1 CR |
16361 | b(are)g(imm)m(une)g(to)g(k)m(eyb)s(oard-generated)h(signals.)40 |
16362 | b(Only)23 b(foreground)g(pro)s(cesses)h(are)g(allo)m(w)m(ed)150 | |
967625cd | 16363 | 2973 y(to)g(read)e(from)h(or,)h(if)f(the)g(user)f(so)i(sp)s(eci\014es)e |
6e51e0d0 | 16364 | (with)h Ft(stty)29 b(tostop)p Fu(,)23 b(write)g(to)g(the)h(terminal.)38 |
967625cd | 16365 | b(Bac)m(kground)150 3082 y(pro)s(cesses)27 b(whic)m(h)g(attempt)h(to)f |
6e51e0d0 | 16366 | (read)g(from)g(\(write)g(to)h(when)e Ft(stty)j(tostop)d |
967625cd | 16367 | Fu(is)h(in)f(e\013ect\))j(the)e(terminal)150 3192 y(are)32 |
6e51e0d0 | 16368 | b(sen)m(t)g(a)g Ft(SIGTTIN)e Fu(\()p Ft(SIGTTOU)p Fu(\))g(signal)i(b)m |
602bb739 | 16369 | (y)g(the)g(k)m(ernel's)g(terminal)g(driv)m(er,)g(whic)m(h,)g(unless)f |
967625cd CR |
16370 | (caugh)m(t,)150 3302 y(susp)s(ends)d(the)i(pro)s(cess.)275 |
16371 | 3433 y(If)k(the)i(op)s(erating)g(system)f(on)h(whic)m(h)f(Bash)g(is)h | |
602bb739 | 16372 | (running)d(supp)s(orts)h(job)h(con)m(trol,)j(Bash)e(con)m(tains)150 |
967625cd | 16373 | 3543 y(facilities)30 b(to)f(use)f(it.)40 b(T)m(yping)28 |
6e51e0d0 CR |
16374 | b(the)g Fr(susp)s(end)h Fu(c)m(haracter)h(\(t)m(ypically)g(`)p |
16375 | Ft(^Z)p Fu(',)f(Con)m(trol-Z\))g(while)f(a)g(pro)s(cess)150 | |
967625cd | 16376 | 3652 y(is)42 b(running)f(causes)i(that)g(pro)s(cess)f(to)h(b)s(e)f |
602bb739 | 16377 | (stopp)s(ed)f(and)h(returns)f(con)m(trol)j(to)f(Bash.)77 |
967625cd | 16378 | b(T)m(yping)42 b(the)150 3762 y Fr(dela)m(y)m(ed)k(susp)s(end)f |
6e51e0d0 | 16379 | Fu(c)m(haracter)h(\(t)m(ypically)g(`)p Ft(^Y)p Fu(',)i(Con)m(trol-Y\))e |
602bb739 | 16380 | (causes)e(the)h(pro)s(cess)e(to)i(b)s(e)f(stopp)s(ed)150 |
967625cd | 16381 | 3871 y(when)26 b(it)i(attempts)h(to)f(read)f(input)g(from)f(the)i |
602bb739 | 16382 | (terminal,)h(and)e(con)m(trol)h(to)g(b)s(e)f(returned)f(to)j(Bash.)39 |
967625cd | 16383 | b(The)150 3981 y(user)e(then)g(manipulates)h(the)g(state)h(of)f(this)f |
6e51e0d0 | 16384 | (job,)j(using)d(the)h Ft(bg)f Fu(command)g(to)h(con)m(tin)m(ue)h(it)f |
967625cd | 16385 | (in)g(the)150 4091 y(bac)m(kground,)g(the)f Ft(fg)g Fu(command)f(to)i |
602bb739 | 16386 | (con)m(tin)m(ue)g(it)f(in)f(the)h(foreground,)h(or)f(the)g |
967625cd | 16387 | Ft(kill)f Fu(command)g(to)150 4200 y(kill)27 b(it.)40 |
6e51e0d0 | 16388 | b(A)27 b(`)p Ft(^Z)p Fu(')g(tak)m(es)h(e\013ect)g(immediately)-8 |
602bb739 | 16389 | b(,)29 b(and)d(has)h(the)f(additional)i(side)e(e\013ect)j(of)d(causing) |
967625cd | 16390 | h(p)s(ending)150 4310 y(output)j(and)g(t)m(yp)s(eahead)h(to)g(b)s(e)e |
c302751c | 16391 | (discarded.)275 4441 y(There)j(are)g(a)h(n)m(um)m(b)s(er)e(of)i(w)m(a)m |
602bb739 | 16392 | (ys)g(to)h(refer)e(to)h(a)g(job)f(in)g(the)h(shell.)47 |
6e51e0d0 | 16393 | b(The)32 b(c)m(haracter)i(`)p Ft(\045)p Fu(')f(in)m(tro)s(duces)150 |
967625cd | 16394 | 4551 y(a)e(job)f(sp)s(eci\014cation)h(\()p Fr(jobsp)s(ec)6 |
6e51e0d0 CR |
16395 | b Fu(\).)275 4682 y(Job)31 b(n)m(um)m(b)s(er)f Ft(n)h |
16396 | Fu(ma)m(y)h(b)s(e)f(referred)g(to)h(as)g(`)p Ft(\045n)p | |
16397 | Fu('.)44 b(The)31 b(sym)m(b)s(ols)g(`)p Ft(\045\045)p | |
16398 | Fu(')h(and)f(`)p Ft(\045+)p Fu(')g(refer)h(to)g(the)g(shell's)150 | |
c302751c | 16399 | 4792 y(notion)k(of)f(the)g(curren)m(t)g(job,)h(whic)m(h)f(is)g(the)g |
eb2bb562 | 16400 | (last)h(job)f(stopp)s(ed)f(while)h(it)h(w)m(as)g(in)e(the)i(foreground) |
c302751c | 16401 | e(or)150 4902 y(started)27 b(in)g(the)g(bac)m(kground.)40 |
6e51e0d0 | 16402 | b(A)27 b(single)g(`)p Ft(\045)p Fu(')g(\(with)g(no)g(accompan)m(ying)i |
c302751c | 16403 | (job)d(sp)s(eci\014cation\))i(also)g(refers)150 5011 |
09767ff0 | 16404 | y(to)k(the)e(curren)m(t)h(job.)42 b(The)30 b(previous)g(job)h(ma)m(y)g |
6e51e0d0 | 16405 | (b)s(e)f(referenced)h(using)f(`)p Ft(\045-)p Fu('.)42 |
c302751c | 16406 | b(If)30 b(there)h(is)g(only)g(a)g(single)150 5121 y(job,)g(`)p |
6e51e0d0 | 16407 | Ft(\045+)p Fu(')g(and)f(`)p Ft(\045-)p Fu(')h(can)h(b)s(oth)e(b)s(e)g |
09767ff0 | 16408 | (used)h(to)g(refer)g(to)h(that)g(job.)42 b(In)30 b(output)h(p)s |
c302751c | 16409 | (ertaining)g(to)g(jobs)g(\(e.g.,)150 5230 y(the)39 b(output)f(of)g(the) |
6e51e0d0 CR |
16410 | h Ft(jobs)e Fu(command\),)k(the)d(curren)m(t)h(job)f(is)g(alw)m(a)m(ys) |
16411 | i(\015agged)f(with)f(a)h(`)p Ft(+)p Fu(',)i(and)d(the)150 | |
16412 | 5340 y(previous)30 b(job)g(with)g(a)h(`)p Ft(-)p Fu('.)p | |
c302751c | 16413 | eop end |
fffe80d4 CR |
16414 | %%Page: 113 119 |
16415 | TeXDict begin 113 118 bop 150 -116 a Fu(Chapter)30 b(7:)41 | |
16416 | b(Job)30 b(Con)m(trol)2526 b(113)275 299 y(A)38 b(job)g(ma)m(y)h(also)g | |
ad4aef08 | 16417 | (b)s(e)f(referred)f(to)j(using)d(a)i(pre\014x)e(of)i(the)f(name)h(used) |
d37a4722 CR |
16418 | e(to)i(start)g(it,)i(or)e(using)f(a)150 408 y(substring)g(that)j(app)s |
16419 | (ears)e(in)g(its)h(command)f(line.)69 b(F)-8 b(or)41 | |
16420 | b(example,)i(`)p Ft(\045ce)p Fu(')c(refers)g(to)i(a)f(stopp)s(ed)e(job) | |
16421 | 150 518 y(whose)30 b(command)g(name)g(b)s(egins)g(with)g(`)p | |
16422 | Ft(ce)p Fu('.)40 b(Using)31 b(`)p Ft(\045?ce)p Fu(',)f(on)g(the)g | |
16423 | (other)h(hand,)e(refers)h(to)h(an)m(y)f(job)150 628 y(con)m(taining)e | |
16424 | (the)e(string)h(`)p Ft(ce)p Fu(')f(in)g(its)h(command)f(line.)40 | |
16425 | b(If)26 b(the)g(pre\014x)g(or)g(substring)f(matc)m(hes)j(more)e(than) | |
16426 | 150 737 y(one)31 b(job,)f(Bash)g(rep)s(orts)g(an)g(error.)275 | |
16427 | 869 y(Simply)g(naming)h(a)g(job)g(can)g(b)s(e)f(used)h(to)g(bring)f(it) | |
6e51e0d0 | 16428 | i(in)m(to)g(the)f(foreground:)41 b(`)p Ft(\0451)p Fu(')31 |
d37a4722 | 16429 | b(is)g(a)h(synon)m(ym)e(for)150 978 y(`)p Ft(fg)g(\0451)p |
6e51e0d0 CR |
16430 | Fu(',)i(bringing)f(job)g(1)g(from)g(the)h(bac)m(kground)f(in)m(to)i |
16431 | (the)e(foreground.)44 b(Similarly)-8 b(,)32 b(`)p Ft(\0451)e(&)p | |
d37a4722 CR |
16432 | Fu(')i(resumes)150 1088 y(job)e(1)h(in)f(the)g(bac)m(kground,)h(equiv) |
16433 | -5 b(alen)m(t)32 b(to)f(`)p Ft(bg)f(\0451)p Fu(')275 | |
16434 | 1219 y(The)g(shell)i(learns)f(immediately)i(whenev)m(er)e(a)h(job)f(c)m | |
37c41ab1 | 16435 | (hanges)h(state.)45 b(Normally)-8 b(,)33 b(Bash)e(w)m(aits)i(un)m(til) |
d37a4722 | 16436 | 150 1329 y(it)25 b(is)g(ab)s(out)f(to)i(prin)m(t)e(a)h(prompt)f(b)s |
37c41ab1 | 16437 | (efore)g(rep)s(orting)h(c)m(hanges)g(in)g(a)g(job's)f(status)h(so)g(as) |
d37a4722 | 16438 | g(to)g(not)g(in)m(terrupt)150 1439 y(an)m(y)k(other)f(output.)40 |
6e51e0d0 CR |
16439 | b(If)28 b(the)g Ft(-b)g Fu(option)g(to)h(the)g Ft(set)e |
16440 | Fu(builtin)h(is)g(enabled,)h(Bash)g(rep)s(orts)e(suc)m(h)h(c)m(hanges) | |
d37a4722 | 16441 | 150 1548 y(immediately)d(\(see)g(Section)g(4.3.1)g([The)f(Set)g |
e59452c7 | 16442 | (Builtin],)i(page)f(66\).)40 b(An)m(y)24 b(trap)f(on)h |
d37a4722 CR |
16443 | Ft(SIGCHLD)e Fu(is)i(executed)150 1658 y(for)30 b(eac)m(h)i(c)m(hild)e |
16444 | (pro)s(cess)g(that)h(exits.)275 1789 y(If)25 b(an)h(attempt)h(to)g | |
d3ad40de | 16445 | (exit)g(Bash)f(is)h(made)f(while)g(jobs)f(are)i(stopp)s(ed,)f(\(or)h |
d37a4722 | 16446 | (running,)e(if)h(the)g Ft(checkjobs)150 1899 y Fu(option)e(is)f |
d3ad40de | 16447 | (enabled)h({)g(see)g(Section)g(4.3.2)h([The)e(Shopt)g(Builtin],)j(page) |
e59452c7 | 16448 | e(70\),)i(the)e(shell)f(prin)m(ts)g(a)h(w)m(arning)150 |
d37a4722 | 16449 | 2009 y(message,)k(and)c(if)i(the)f Ft(checkjobs)e Fu(option)j(is)f |
d3ad40de | 16450 | (enabled,)i(lists)e(the)h(jobs)f(and)f(their)i(statuses.)39 |
d37a4722 | 16451 | b(The)25 b Ft(jobs)150 2118 y Fu(command)36 b(ma)m(y)h(then)f(b)s(e)f |
d3ad40de | 16452 | (used)g(to)i(insp)s(ect)f(their)g(status.)59 b(If)36 |
d37a4722 | 16453 | b(a)g(second)g(attempt)i(to)f(exit)g(is)f(made)150 2228 |
d3ad40de CR |
16454 | y(without)e(an)f(in)m(terv)m(ening)i(command,)f(Bash)g(do)s(es)f(not)h |
16455 | (prin)m(t)g(another)f(w)m(arning,)i(and)e(an)m(y)h(stopp)s(ed)150 | |
d37a4722 | 16456 | 2337 y(jobs)c(are)h(terminated.)275 2469 y(When)f(the)h(shell)g(is)f(w) |
7e92fb35 CR |
16457 | m(aiting)i(for)f(a)g(job)f(or)h(pro)s(cess)f(using)g(the)h |
16458 | Ft(wait)f Fu(builtin,)g(and)g(job)h(con)m(trol)h(is)150 | |
d37a4722 | 16459 | 2578 y(enabled,)i Ft(wait)f Fu(will)g(return)g(when)f(the)i(job)f(c)m |
9128f932 | 16460 | (hanges)h(state.)51 b(The)33 b Ft(-f)g Fu(option)h(causes)f |
d37a4722 CR |
16461 | Ft(wait)g Fu(to)h(w)m(ait)150 2688 y(un)m(til)d(the)f(job)g(or)h(pro)s |
16462 | (cess)f(terminates)h(b)s(efore)f(returning.)150 2923 | |
16463 | y Fs(7.2)68 b(Job)45 b(Con)l(trol)h(Builtins)150 3104 | |
16464 | y Ft(bg)870 3236 y(bg)h([)p Fj(jobspec)f Ft(...)o(])630 | |
16465 | 3367 y Fu(Resume)24 b(eac)m(h)h(susp)s(ended)d(job)i | |
7e92fb35 | 16466 | Fr(jobsp)s(ec)29 b Fu(in)24 b(the)g(bac)m(kground,)h(as)g(if)f(it)h |
d37a4722 | 16467 | (had)e(b)s(een)g(started)630 3477 y(with)32 b(`)p Ft(&)p |
7e92fb35 CR |
16468 | Fu('.)45 b(If)31 b Fr(jobsp)s(ec)37 b Fu(is)32 b(not)g(supplied,)f(the) |
16469 | h(curren)m(t)g(job)f(is)h(used.)45 b(The)31 b(return)g(status)630 | |
d37a4722 | 16470 | 3586 y(is)i(zero)g(unless)f(it)h(is)g(run)e(when)h(job)g(con)m(trol)i |
7e92fb35 | 16471 | (is)f(not)g(enabled,)h(or,)f(when)f(run)f(with)h(job)630 |
d37a4722 | 16472 | 3696 y(con)m(trol)h(enabled,)g(an)m(y)f Fr(jobsp)s(ec)37 |
7e92fb35 | 16473 | b Fu(w)m(as)32 b(not)g(found)f(or)g(sp)s(eci\014es)h(a)g(job)g(that)g |
d37a4722 CR |
16474 | (w)m(as)g(started)630 3806 y(without)e(job)g(con)m(trol.)150 |
16475 | 3959 y Ft(fg)870 4091 y(fg)47 b([)p Fj(jobspec)p Ft(])630 | |
16476 | 4222 y Fu(Resume)c(the)g(job)g Fr(jobsp)s(ec)48 b Fu(in)43 | |
7e92fb35 | 16477 | b(the)g(foreground)g(and)f(mak)m(e)j(it)e(the)h(curren)m(t)f(job.)78 |
d37a4722 | 16478 | b(If)630 4332 y Fr(jobsp)s(ec)41 b Fu(is)c(not)f(supplied,)h(the)f |
7e92fb35 | 16479 | (curren)m(t)h(job)f(is)g(used.)58 b(The)36 b(return)f(status)h(is)h |
d37a4722 | 16480 | (that)g(of)630 4441 y(the)d(command)g(placed)h(in)m(to)g(the)f |
37c41ab1 | 16481 | (foreground,)g(or)g(non-zero)h(if)f(run)f(when)g(job)g(con)m(trol)630 |
d37a4722 | 16482 | 4551 y(is)i(disabled)g(or,)i(when)d(run)g(with)h(job)g(con)m(trol)h |
6e51e0d0 | 16483 | (enabled,)h Fr(jobsp)s(ec)j Fu(do)s(es)35 b(not)h(sp)s(ecify)f(a)630 |
d37a4722 | 16484 | 4660 y(v)-5 b(alid)31 b(job)f(or)g Fr(jobsp)s(ec)35 b |
6e51e0d0 | 16485 | Fu(sp)s(eci\014es)30 b(a)h(job)f(that)h(w)m(as)g(started)g(without)f |
d37a4722 CR |
16486 | (job)g(con)m(trol.)150 4814 y Ft(jobs)870 4945 y(jobs)47 |
16487 | b([-lnprs])e([)p Fj(jobspec)p Ft(])870 5055 y(jobs)i(-x)g | |
16488 | Fj(command)f Ft([)p Fj(arguments)p Ft(])630 5187 y Fu(The)30 | |
6e51e0d0 | 16489 | b(\014rst)f(form)h(lists)h(the)g(activ)m(e)h(jobs.)41 |
37c41ab1 | 16490 | b(The)30 b(options)g(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
7e92fb35 CR |
16491 | 5340 y Ft(-l)384 b Fu(List)31 b(pro)s(cess)f Fm(id)p |
16492 | Fu(s)g(in)g(addition)h(to)g(the)f(normal)h(information.)p | |
602bb739 | 16493 | eop end |
fffe80d4 CR |
16494 | %%Page: 114 120 |
16495 | TeXDict begin 114 119 bop 150 -116 a Fu(Chapter)30 b(7:)41 | |
16496 | b(Job)30 b(Con)m(trol)2526 b(114)630 299 y Ft(-n)384 | |
7e92fb35 CR |
16497 | b Fu(Displa)m(y)26 b(information)f(only)h(ab)s(out)e(jobs)h(that)g(ha)m |
16498 | (v)m(e)i(c)m(hanged)e(status)h(since)1110 408 y(the)31 | |
16499 | b(user)e(w)m(as)i(last)g(noti\014ed)f(of)h(their)f(status.)630 | |
d37a4722 | 16500 | 583 y Ft(-p)384 b Fu(List)31 b(only)f(the)h(pro)s(cess)f |
7e92fb35 | 16501 | Fm(id)g Fu(of)h(the)f(job's)g(pro)s(cess)g(group)g(leader.)630 |
d37a4722 CR |
16502 | 757 y Ft(-r)384 b Fu(Displa)m(y)32 b(only)e(running)f(jobs.)630 |
16503 | 931 y Ft(-s)384 b Fu(Displa)m(y)32 b(only)e(stopp)s(ed)f(jobs.)630 | |
16504 | 1105 y(If)23 b Fr(jobsp)s(ec)28 b Fu(is)23 b(giv)m(en,)i(output)e(is)g | |
6e51e0d0 | 16505 | (restricted)h(to)g(information)f(ab)s(out)g(that)h(job.)37 |
d37a4722 CR |
16506 | b(If)23 b Fr(jobsp)s(ec)630 1214 y Fu(is)30 b(not)h(supplied,)e(the)i |
16507 | (status)g(of)f(all)h(jobs)f(is)h(listed.)630 1356 y(If)k(the)g | |
6e51e0d0 CR |
16508 | Ft(-x)f Fu(option)i(is)f(supplied,)g Ft(jobs)f Fu(replaces)i(an)m(y)f |
16509 | Fr(jobsp)s(ec)40 b Fu(found)34 b(in)h Fr(command)j Fu(or)630 | |
d37a4722 | 16510 | 1466 y Fr(argumen)m(ts)j Fu(with)c(the)h(corresp)s(onding)e(pro)s(cess) |
7e92fb35 | 16511 | h(group)f Fm(id)p Fu(,)k(and)c(executes)j Fr(command)p |
d37a4722 CR |
16512 | Fu(,)630 1575 y(passing)30 b(it)h Fr(argumen)m(t)r Fu(s,)g(returning)f |
16513 | (its)g(exit)i(status.)150 1749 y Ft(kill)870 1891 y(kill)47 | |
6e51e0d0 | 16514 | b([-s)g Fj(sigspec)p Ft(])e([-n)i Fj(signum)p Ft(])f([-)p |
d37a4722 CR |
16515 | Fj(sigspec)p Ft(])f Fj(jobspec)h Ft(or)h Fj(pid)870 2001 |
16516 | y Ft(kill)g(-l|-L)f([)p Fj(exit_status)p Ft(])630 2143 | |
900a813b CR |
16517 | y Fu(Send)22 b(a)i(signal)g(sp)s(eci\014ed)f(b)m(y)g |
16518 | Fr(sigsp)s(ec)29 b Fu(or)24 b Fr(sign)m(um)f Fu(to)h(the)g(pro)s(cess)f | |
d37a4722 | 16519 | (named)g(b)m(y)g(job)g(sp)s(eci\014-)630 2252 y(cation)k |
900a813b CR |
16520 | Fr(jobsp)s(ec)j Fu(or)25 b(pro)s(cess)g Fm(id)h Fr(pid)p |
16521 | Fu(.)38 b Fr(sigsp)s(ec)31 b Fu(is)25 b(either)h(a)g(case-insensitiv)m | |
d37a4722 | 16522 | (e)i(signal)e(name)630 2362 y(suc)m(h)37 b(as)g Ft(SIGINT)f |
900a813b | 16523 | Fu(\(with)h(or)g(without)g(the)g Ft(SIG)g Fu(pre\014x\))f(or)h(a)h |
d37a4722 | 16524 | (signal)g(n)m(um)m(b)s(er;)h Fr(sign)m(um)630 2471 y |
900a813b CR |
16525 | Fu(is)g(a)f(signal)i(n)m(um)m(b)s(er.)63 b(If)39 b Fr(sigsp)s(ec)44 |
16526 | b Fu(and)38 b Fr(sign)m(um)g Fu(are)h(not)g(presen)m(t,)h | |
d37a4722 | 16527 | Ft(SIGTERM)d Fu(is)h(used.)630 2581 y(The)27 b Ft(-l)h |
900a813b CR |
16528 | Fu(option)g(lists)h(the)f(signal)h(names.)39 b(If)28 |
16529 | b(an)m(y)g(argumen)m(ts)h(are)f(supplied)f(when)g Ft(-l)g | |
d37a4722 | 16530 | Fu(is)630 2690 y(giv)m(en,)32 b(the)g(names)e(of)i(the)f(signals)g |
900a813b | 16531 | (corresp)s(onding)f(to)i(the)f(argumen)m(ts)g(are)h(listed,)g(and)630 |
d37a4722 CR |
16532 | 2800 y(the)c(return)f(status)h(is)g(zero.)41 b Fr(exit)p |
16533 | 1796 2800 28 4 v 41 w(status)32 b Fu(is)c(a)g(n)m(um)m(b)s(er)f(sp)s | |
16534 | (ecifying)g(a)i(signal)f(n)m(um)m(b)s(er)f(or)630 2910 | |
900a813b CR |
16535 | y(the)h(exit)h(status)g(of)f(a)h(pro)s(cess)e(terminated)i(b)m(y)f(a)h |
16536 | (signal.)40 b(The)28 b Ft(-L)g Fu(option)g(is)g(equiv)-5 | |
d37a4722 | 16537 | b(alen)m(t)630 3019 y(to)34 b Ft(-l)p Fu(.)47 b(The)32 |
900a813b | 16538 | b(return)g(status)h(is)g(zero)g(if)g(at)g(least)h(one)f(signal)h(w)m |
d37a4722 | 16539 | (as)f(successfully)g(sen)m(t,)h(or)630 3129 y(non-zero)d(if)f(an)h |
900a813b | 16540 | (error)f(o)s(ccurs)g(or)g(an)g(in)m(v)-5 b(alid)31 b(option)g(is)f |
d37a4722 | 16541 | (encoun)m(tered.)150 3303 y Ft(wait)870 3445 y(wait)47 |
fc35c477 | 16542 | b([-fn])f([-p)h Fj(varname)p Ft(])e([)p Fj(jobspec)h |
d37a4722 | 16543 | Ft(or)h Fj(pid)g Ft(...)o(])630 3587 y Fu(W)-8 b(ait)28 |
fc35c477 CR |
16544 | b(un)m(til)f(the)f(c)m(hild)h(pro)s(cess)f(sp)s(eci\014ed)g(b)m(y)g |
16545 | (eac)m(h)h(pro)s(cess)f Fm(id)h Fr(pid)i Fu(or)d(job)g(sp)s | |
d37a4722 | 16546 | (eci\014cation)630 3696 y Fr(jobsp)s(ec)40 b Fu(exits)35 |
fc35c477 | 16547 | b(and)f(return)g(the)g(exit)i(status)f(of)g(the)g(last)g(command)f(w)m |
d37a4722 | 16548 | (aited)i(for.)53 b(If)35 b(a)630 3806 y(job)g(sp)s(ec)f(is)h(giv)m(en,) |
fc35c477 | 16549 | i(all)f(pro)s(cesses)f(in)f(the)h(job)g(are)g(w)m(aited)h(for.)54 |
d37a4722 | 16550 | b(If)35 b(no)f(argumen)m(ts)i(are)630 3915 y(giv)m(en,)28 |
fc35c477 | 16551 | b Ft(wait)c Fu(w)m(aits)j(for)e(all)i(running)c(bac)m(kground)j(jobs)f |
d37a4722 CR |
16552 | (and)g(the)h(last-executed)h(pro)s(cess)630 4025 y(substitution,)37 |
16553 | b(if)f(its)g(pro)s(cess)f(id)h(is)f(the)h(same)g(as)g | |
16554 | Fr($!)p Fu(,)i(and)d(the)h(return)f(status)h(is)g(zero.)630 | |
16555 | 4134 y(If)h(the)h Ft(-n)f Fu(option)h(is)f(supplied,)i | |
e59452c7 CR |
16556 | Ft(wait)d Fu(w)m(aits)j(for)e(a)h(single)g(job)f(from)h(the)f(list)i |
16557 | (of)e Fr(pid)t Fu(s)630 4244 y(or)31 b Fr(jobsp)s(ec)6 | |
16558 | b Fu(s)30 b(or,)i(if)f(no)g(argumen)m(ts)h(are)f(supplied,)g(an)m(y)g | |
16559 | (job,)h(to)g(complete)h(and)d(returns)630 4354 y(its)36 | |
16560 | b(exit)h(status.)56 b(If)35 b(none)h(of)g(the)g(supplied)e(argumen)m | |
16561 | (ts)i(is)f(a)h(c)m(hild)g(of)g(the)g(shell,)h(or)f(if)630 | |
16562 | 4463 y(no)31 b(argumen)m(ts)g(are)g(supplied)f(and)g(the)h(shell)g(has) | |
16563 | g(no)f(un)m(w)m(aited-for)i(c)m(hildren,)f(the)g(exit)630 | |
16564 | 4573 y(status)k(is)g(127.)55 b(If)34 b(the)h Ft(-p)g | |
16565 | Fu(option)g(is)g(supplied,)f(the)h(pro)s(cess)g(or)f(job)h(iden)m | |
16566 | (ti\014er)g(of)g(the)630 4682 y(job)j(for)g(whic)m(h)f(the)i(exit)g | |
16567 | (status)f(is)g(returned)f(is)h(assigned)h(to)g(the)f(v)-5 | |
16568 | b(ariable)39 b Fr(v)-5 b(arname)630 4792 y Fu(named)29 | |
16569 | b(b)m(y)f(the)i(option)f(argumen)m(t.)41 b(The)28 b(v)-5 | |
16570 | b(ariable)30 b(will)g(b)s(e)e(unset)h(initially)-8 b(,)31 | |
16571 | b(b)s(efore)e(an)m(y)630 4902 y(assignmen)m(t.)76 b(This)41 | |
16572 | b(is)h(useful)f(only)h(when)f(the)h Ft(-n)f Fu(option)i(is)f(supplied.) | |
16573 | 74 b(Supplying)630 5011 y(the)39 b Ft(-f)f Fu(option,)k(when)37 | |
16574 | b(job)i(con)m(trol)h(is)f(enabled,)i(forces)e Ft(wait)e | |
16575 | Fu(to)j(w)m(ait)g(for)e(eac)m(h)i Fr(pid)630 5121 y Fu(or)29 | |
16576 | b Fr(jobsp)s(ec)34 b Fu(to)c(terminate)g(b)s(efore)f(returning)f(its)h | |
16577 | (status,)h(in)m(tead)g(of)f(returning)f(when)g(it)630 | |
16578 | 5230 y(c)m(hanges)37 b(status.)58 b(If)35 b(neither)h | |
fc35c477 | 16579 | Fr(jobsp)s(ec)41 b Fu(nor)36 b Fr(pid)i Fu(sp)s(eci\014es)e(an)g(activ) |
d37a4722 CR |
16580 | m(e)i(c)m(hild)e(pro)s(cess)g(of)630 5340 y(the)31 b(shell,)f(the)h |
16581 | (return)e(status)i(is)f(127.)p eop end | |
fffe80d4 CR |
16582 | %%Page: 115 121 |
16583 | TeXDict begin 115 120 bop 150 -116 a Fu(Chapter)30 b(7:)41 | |
16584 | b(Job)30 b(Con)m(trol)2526 b(115)150 299 y Ft(disown)870 | |
d37a4722 CR |
16585 | 433 y(disown)46 b([-ar])g([-h])h([)p Fj(jobspec)f Ft(...)h(|)g |
16586 | Fj(pid)g Ft(...)g(])630 568 y Fu(Without)33 b(options,)h(remo)m(v)m(e)g | |
16587 | (eac)m(h)f Fr(jobsp)s(ec)38 b Fu(from)32 b(the)h(table)g(of)g(activ)m | |
16588 | (e)h(jobs.)47 b(If)32 b(the)h Ft(-h)630 677 y Fu(option)j(is)f(giv)m | |
f6029107 | 16589 | (en,)i(the)f(job)f(is)g(not)g(remo)m(v)m(ed)h(from)f(the)g(table,)j |
d37a4722 CR |
16590 | (but)c(is)i(mark)m(ed)f(so)g(that)630 787 y Ft(SIGHUP)e |
16591 | Fu(is)j(not)f(sen)m(t)h(to)g(the)f(job)g(if)g(the)g(shell)h(receiv)m | |
f6029107 | 16592 | (es)h(a)e Ft(SIGHUP)p Fu(.)54 b(If)34 b Fr(jobsp)s(ec)40 |
d37a4722 | 16593 | b Fu(is)c(not)630 897 y(presen)m(t,)41 b(and)d(neither)h(the)g |
f6029107 | 16594 | Ft(-a)f Fu(nor)g(the)h Ft(-r)f Fu(option)h(is)g(supplied,)g(the)g |
d37a4722 | 16595 | (curren)m(t)g(job)f(is)630 1006 y(used.)g(If)25 b(no)h |
f6029107 | 16596 | Fr(jobsp)s(ec)k Fu(is)c(supplied,)f(the)h Ft(-a)f Fu(option)h(means)g |
d37a4722 | 16597 | (to)g(remo)m(v)m(e)h(or)e(mark)h(all)g(jobs;)630 1116 |
f6029107 | 16598 | y(the)31 b Ft(-r)e Fu(option)i(without)g(a)f Fr(jobsp)s(ec)36 |
fc35c477 | 16599 | b Fu(argumen)m(t)30 b(restricts)h(op)s(eration)g(to)g(running)e(jobs.) |
d37a4722 CR |
16600 | 150 1275 y Ft(suspend)870 1410 y(suspend)46 b([-f])630 |
16601 | 1544 y Fu(Susp)s(end)31 b(the)i(execution)h(of)g(this)f(shell)g(un)m | |
fc35c477 | 16602 | (til)h(it)g(receiv)m(es)h(a)e Ft(SIGCONT)f Fu(signal.)50 |
d37a4722 | 16603 | b(A)33 b(login)630 1654 y(shell)28 b(cannot)g(b)s(e)f(susp)s(ended;)g |
fc35c477 | 16604 | (the)g Ft(-f)g Fu(option)i(can)f(b)s(e)f(used)g(to)h(o)m(v)m(erride)h |
d37a4722 CR |
16605 | (this)e(and)g(force)630 1763 y(the)k(susp)s(ension.)275 |
16606 | 1923 y(When)f(job)f(con)m(trol)j(is)e(not)h(activ)m(e,)i(the)d | |
fc35c477 | 16607 | Ft(kill)f Fu(and)h Ft(wait)f Fu(builtins)g(do)h(not)h(accept)h |
d37a4722 | 16608 | Fr(jobsp)s(ec)j Fu(argu-)150 2032 y(men)m(ts.)41 b(They)30 |
fc35c477 | 16609 | b(m)m(ust)g(b)s(e)g(supplied)f(pro)s(cess)h Fm(id)p Fu(s.)150 |
d37a4722 CR |
16610 | 2273 y Fs(7.3)68 b(Job)45 b(Con)l(trol)h(V)-11 b(ariables)150 |
16611 | 2457 y Ft(auto_resume)630 2567 y Fu(This)31 b(v)-5 b(ariable)32 | |
fc35c477 | 16612 | b(con)m(trols)g(ho)m(w)g(the)f(shell)h(in)m(teracts)h(with)e(the)h |
d37a4722 | 16613 | (user)e(and)h(job)g(con)m(trol.)45 b(If)630 2677 y(this)28 |
fc35c477 | 16614 | b(v)-5 b(ariable)30 b(exists)f(then)f(single)h(w)m(ord)f(simple)h |
d37a4722 | 16615 | (commands)f(without)g(redirections)i(are)630 2786 y(treated)h(as)g |
fc35c477 | 16616 | (candidates)f(for)g(resumption)g(of)g(an)g(existing)h(job.)41 |
d37a4722 | 16617 | b(There)29 b(is)h(no)h(am)m(biguit)m(y)630 2896 y(allo)m(w)m(ed;)f(if)d |
fc35c477 | 16618 | (there)g(is)g(more)g(than)f(one)h(job)g(b)s(eginning)f(with)g(the)h |
d37a4722 | 16619 | (string)g(t)m(yp)s(ed,)g(then)g(the)630 3005 y(most)j(recen)m(tly)h |
fc35c477 | 16620 | (accessed)f(job)f(will)h(b)s(e)f(selected.)42 b(The)29 |
d37a4722 | 16621 | b(name)g(of)h(a)g(stopp)s(ed)e(job,)i(in)f(this)630 3115 |
fc35c477 CR |
16622 | y(con)m(text,)h(is)e(the)g(command)g(line)g(used)f(to)h(start)g(it.)41 |
16623 | b(If)27 b(this)h(v)-5 b(ariable)28 b(is)g(set)g(to)h(the)e(v)-5 | |
d37a4722 | 16624 | b(alue)630 3225 y(`)p Ft(exact)p Fu(',)33 b(the)g(string)g(supplied)f |
37c41ab1 | 16625 | (m)m(ust)h(matc)m(h)g(the)h(name)f(of)g(a)g(stopp)s(ed)f(job)h |
d37a4722 | 16626 | (exactly;)j(if)630 3334 y(set)29 b(to)h(`)p Ft(substring)p |
6e51e0d0 | 16627 | Fu(',)d(the)i(string)g(supplied)e(needs)i(to)g(matc)m(h)h(a)f |
d37a4722 | 16628 | (substring)f(of)h(the)g(name)630 3444 y(of)38 b(a)f(stopp)s(ed)g(job.) |
6e51e0d0 | 16629 | 62 b(The)37 b(`)p Ft(substring)p Fu(')e(v)-5 b(alue)38 |
37c41ab1 | 16630 | b(pro)m(vides)f(functionalit)m(y)i(analogous)g(to)630 |
d37a4722 | 16631 | 3553 y(the)c(`)p Ft(\045?)p Fu(')g(job)g Fm(id)g Fu(\(see)h(Section)g |
fffe80d4 | 16632 | (7.1)g([Job)e(Con)m(trol)i(Basics],)i(page)e(112\).)56 |
d37a4722 | 16633 | b(If)34 b(set)i(to)g(an)m(y)630 3663 y(other)c(v)-5 b(alue,)32 |
4d63a619 | 16634 | b(the)g(supplied)e(string)i(m)m(ust)f(b)s(e)g(a)h(pre\014x)f(of)h(a)g |
d37a4722 | 16635 | (stopp)s(ed)e(job's)i(name;)g(this)630 3773 y(pro)m(vides)e |
4d63a619 CR |
16636 | (functionalit)m(y)i(analogous)g(to)f(the)g(`)p Ft(\045)p |
16637 | Fu(')f(job)g Fm(id)p Fu(.)p eop end | |
fffe80d4 CR |
16638 | %%Page: 116 122 |
16639 | TeXDict begin 116 121 bop 3614 -116 a Fu(116)150 299 | |
037a8b7f CR |
16640 | y Fp(8)80 b(Command)54 b(Line)f(Editing)150 635 y Fu(This)28 |
16641 | b(c)m(hapter)i(describ)s(es)e(the)h(basic)g(features)h(of)f(the)g | |
16642 | Fm(gnu)f Fu(command)h(line)g(editing)h(in)m(terface.)42 | |
16643 | b(Com-)150 745 y(mand)c(line)i(editing)f(is)g(pro)m(vided)g(b)m(y)g | |
16644 | (the)g(Readline)h(library)-8 b(,)41 b(whic)m(h)e(is)g(used)f(b)m(y)h | |
16645 | (sev)m(eral)h(di\013eren)m(t)150 855 y(programs,)34 b(including)e | |
16646 | (Bash.)49 b(Command)32 b(line)i(editing)f(is)g(enabled)g(b)m(y)g | |
16647 | (default)g(when)f(using)h(an)g(in-)150 964 y(teractiv)m(e)h(shell,)d | |
16648 | (unless)g(the)g Ft(--noediting)d Fu(option)k(is)f(supplied)e(at)j | |
16649 | (shell)f(in)m(v)m(o)s(cation.)45 b(Line)31 b(editing)150 | |
16650 | 1074 y(is)g(also)h(used)f(when)f(using)h(the)g Ft(-e)g | |
16651 | Fu(option)h(to)g(the)f Ft(read)f Fu(builtin)h(command)g(\(see)h | |
e59452c7 | 16652 | (Section)g(4.2)h([Bash)150 1183 y(Builtins],)j(page)f(54\).)52 |
037a8b7f CR |
16653 | b(By)35 b(default,)g(the)f(line)h(editing)f(commands)g(are)h(similar)f |
16654 | (to)h(those)f(of)g(Emacs.)150 1293 y(A)h(vi-st)m(yle)h(line)f(editing)g | |
16655 | (in)m(terface)h(is)e(also)i(a)m(v)-5 b(ailable.)55 b(Line)34 | |
16656 | b(editing)h(can)g(b)s(e)f(enabled)g(at)h(an)m(y)g(time)150 | |
16657 | 1402 y(using)h(the)g Ft(-o)30 b(emacs)35 b Fu(or)h Ft(-o)30 | |
16658 | b(vi)35 b Fu(options)i(to)g(the)f Ft(set)f Fu(builtin)h(command)g | |
16659 | (\(see)h(Section)g(4.3.1)h([The)150 1512 y(Set)31 b(Builtin],)g(page)g | |
e59452c7 | 16660 | (66\),)h(or)e(disabled)g(using)g(the)h Ft(+o)e(emacs)g |
037a8b7f CR |
16661 | Fu(or)i Ft(+o)e(vi)h Fu(options)h(to)g Ft(set)p Fu(.)150 |
16662 | 1804 y Fs(8.1)68 b(In)l(tro)t(duction)45 b(to)g(Line)h(Editing)150 | |
16663 | 1963 y Fu(The)30 b(follo)m(wing)i(paragraphs)d(describ)s(e)h(the)h | |
16664 | (notation)g(used)f(to)h(represen)m(t)f(k)m(eystrok)m(es.)275 | |
16665 | 2132 y(The)35 b(text)i Fj(C-k)f Fu(is)g(read)g(as)h(`Con)m(trol-K')g | |
16666 | (and)f(describ)s(es)f(the)h(c)m(haracter)i(pro)s(duced)d(when)g(the)h | |
16667 | Ft(k)150 2242 y Fu(k)m(ey)31 b(is)g(pressed)e(while)h(the)h(Con)m(trol) | |
16668 | g(k)m(ey)g(is)g(depressed.)275 2410 y(The)g(text)i Fj(M-k)e | |
16669 | Fu(is)h(read)f(as)i(`Meta-K')g(and)f(describ)s(es)f(the)h(c)m(haracter) | |
16670 | h(pro)s(duced)e(when)f(the)i(Meta)150 2520 y(k)m(ey)i(\(if)f(y)m(ou)h | |
16671 | (ha)m(v)m(e)g(one\))g(is)f(depressed,)g(and)f(the)h Ft(k)g | |
16672 | Fu(k)m(ey)h(is)f(pressed.)48 b(The)32 b(Meta)j(k)m(ey)e(is)h(lab)s | |
16673 | (eled)f Ft(ALT)150 2629 y Fu(on)c(man)m(y)h(k)m(eyb)s(oards.)40 | |
16674 | b(On)29 b(k)m(eyb)s(oards)g(with)h(t)m(w)m(o)h(k)m(eys)f(lab)s(eled)g | |
6e51e0d0 | 16675 | Ft(ALT)e Fu(\(usually)i(to)g(either)g(side)g(of)g(the)150 |
967625cd | 16676 | 2739 y(space)h(bar\),)f(the)g Ft(ALT)f Fu(on)h(the)g(left)h(side)f(is)g |
c302751c | 16677 | (generally)h(set)f(to)h(w)m(ork)f(as)g(a)h(Meta)g(k)m(ey)-8 |
967625cd | 16678 | b(.)42 b(The)29 b Ft(ALT)g Fu(k)m(ey)i(on)150 2849 y(the)c(righ)m(t)h |
c302751c CR |
16679 | (ma)m(y)g(also)g(b)s(e)f(con\014gured)f(to)i(w)m(ork)f(as)h(a)f(Meta)i |
16680 | (k)m(ey)f(or)f(ma)m(y)h(b)s(e)e(con\014gured)h(as)g(some)h(other)150 | |
967625cd CR |
16681 | 2958 y(mo)s(di\014er,)i(suc)m(h)g(as)g(a)h(Comp)s(ose)f(k)m(ey)h(for)f |
16682 | (t)m(yping)h(accen)m(ted)h(c)m(haracters.)275 3127 y(If)23 | |
6e51e0d0 CR |
16683 | b(y)m(ou)i(do)f(not)h(ha)m(v)m(e)h(a)f(Meta)g(or)g Ft(ALT)e |
16684 | Fu(k)m(ey)-8 b(,)27 b(or)e(another)f(k)m(ey)i(w)m(orking)e(as)h(a)g | |
967625cd | 16685 | (Meta)h(k)m(ey)-8 b(,)27 b(the)d(iden)m(tical)150 3236 |
c302751c | 16686 | y(k)m(eystrok)m(e)30 b(can)f(b)s(e)f(generated)h(b)m(y)g(t)m(yping)g |
6e51e0d0 CR |
16687 | Ft(ESC)e Fl(\014rst)p Fu(,)j(and)e(then)g(t)m(yping)h |
16688 | Ft(k)p Fu(.)40 b(Either)28 b(pro)s(cess)g(is)g(kno)m(wn)150 | |
967625cd CR |
16689 | 3346 y(as)j Fr(metafying)39 b Fu(the)30 b Ft(k)g Fu(k)m(ey)-8 |
16690 | b(.)275 3515 y(The)39 b(text)j Fj(M-C-k)d Fu(is)h(read)g(as)h | |
c302751c | 16691 | (`Meta-Con)m(trol-k')j(and)39 b(describ)s(es)h(the)g(c)m(haracter)i |
967625cd CR |
16692 | (pro)s(duced)d(b)m(y)150 3624 y Fr(metafying)g Fj(C-k)p |
16693 | Fu(.)275 3793 y(In)c(addition,)j(sev)m(eral)f(k)m(eys)g(ha)m(v)m(e)g | |
c302751c | 16694 | (their)f(o)m(wn)g(names.)58 b(Sp)s(eci\014cally)-8 b(,)38 |
6e51e0d0 | 16695 | b Ft(DEL)p Fu(,)f Ft(ESC)p Fu(,)g Ft(LFD)p Fu(,)g Ft(SPC)p |
967625cd | 16696 | Fu(,)g Ft(RET)p Fu(,)150 3902 y(and)d Ft(TAB)f Fu(all)j(stand)e(for)g |
c302751c | 16697 | (themselv)m(es)i(when)d(seen)i(in)f(this)g(text,)j(or)d(in)h(an)f(init) |
967625cd | 16698 | h(\014le)f(\(see)i(Section)f(8.3)150 4012 y([Readline)f(Init)g(File],)i |
fffe80d4 | 16699 | (page)e(119\).)52 b(If)33 b(y)m(our)g(k)m(eyb)s(oard)h(lac)m(ks)g(a)g |
6e51e0d0 | 16700 | Ft(LFD)f Fu(k)m(ey)-8 b(,)36 b(t)m(yping)e Ft(C-j)e Fu(will)i(pro)s |
967625cd | 16701 | (duce)150 4122 y(the)d(desired)e(c)m(haracter.)43 b(The)30 |
6e51e0d0 CR |
16702 | b Ft(RET)f Fu(k)m(ey)i(ma)m(y)g(b)s(e)f(lab)s(eled)h |
16703 | Ft(Return)d Fu(or)j Ft(Enter)d Fu(on)j(some)g(k)m(eyb)s(oards.)150 | |
16704 | 4413 y Fs(8.2)68 b(Readline)47 b(In)l(teraction)150 4573 | |
16705 | y Fu(Often)32 b(during)g(an)g(in)m(teractiv)m(e)j(session)e(y)m(ou)g(t) | |
c302751c CR |
16706 | m(yp)s(e)g(in)f(a)h(long)g(line)g(of)f(text,)j(only)d(to)i(notice)g |
16707 | (that)f(the)150 4682 y(\014rst)f(w)m(ord)g(on)g(the)g(line)h(is)g | |
37c41ab1 | 16708 | (missp)s(elled.)46 b(The)32 b(Readline)h(library)f(giv)m(es)h(y)m(ou)g |
a9fac3b2 | 16709 | (a)g(set)g(of)f(commands)g(for)150 4792 y(manipulating)e(the)g(text)h |
37c41ab1 CR |
16710 | (as)f(y)m(ou)g(t)m(yp)s(e)g(it)g(in,)g(allo)m(wing)h(y)m(ou)f(to)h |
16711 | (just)e(\014x)g(y)m(our)h(t)m(yp)s(o,)g(and)g(not)g(forcing)150 | |
a9fac3b2 | 16712 | 4902 y(y)m(ou)e(to)h(ret)m(yp)s(e)g(the)f(ma)5 b(jorit)m(y)29 |
37c41ab1 | 16713 | b(of)f(the)h(line.)40 b(Using)28 b(these)h(editing)g(commands,)f(y)m |
a9fac3b2 | 16714 | (ou)h(mo)m(v)m(e)g(the)g(cursor)150 5011 y(to)35 b(the)f(place)i(that)e |
37c41ab1 | 16715 | (needs)g(correction,)j(and)d(delete)h(or)f(insert)h(the)f(text)h(of)g |
c302751c CR |
16716 | (the)f(corrections.)54 b(Then,)150 5121 y(when)24 b(y)m(ou)h(are)g |
16717 | (satis\014ed)g(with)g(the)g(line,)i(y)m(ou)e(simply)f(press)g | |
6e51e0d0 | 16718 | Ft(RET)p Fu(.)39 b(Y)-8 b(ou)25 b(do)g(not)g(ha)m(v)m(e)h(to)g(b)s(e)e |
c302751c | 16719 | (at)h(the)h(end)150 5230 y(of)33 b(the)h(line)g(to)g(press)e |
6e51e0d0 | 16720 | Ft(RET)p Fu(;)i(the)g(en)m(tire)g(line)f(is)h(accepted)g(regardless)g |
c302751c CR |
16721 | (of)f(the)h(lo)s(cation)h(of)e(the)h(cursor)150 5340 |
16722 | y(within)c(the)g(line.)p eop end | |
fffe80d4 CR |
16723 | %%Page: 117 123 |
16724 | TeXDict begin 117 122 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16725 | b(Command)29 b(Line)i(Editing)2062 b(117)150 299 y Fk(8.2.1)63 | |
6e51e0d0 | 16726 | b(Readline)40 b(Bare)h(Essen)m(tials)150 446 y Fu(In)31 |
ad4aef08 CR |
16727 | b(order)h(to)h(en)m(ter)g(c)m(haracters)g(in)m(to)g(the)g(line,)g |
16728 | (simply)e(t)m(yp)s(e)i(them.)46 b(The)31 b(t)m(yp)s(ed)h(c)m(haracter)i | |
16729 | (app)s(ears)150 555 y(where)e(the)h(cursor)e(w)m(as,)j(and)e(then)g | |
16730 | (the)h(cursor)e(mo)m(v)m(es)j(one)f(space)g(to)g(the)g(righ)m(t.)47 | |
16731 | b(If)32 b(y)m(ou)h(mist)m(yp)s(e)g(a)150 665 y(c)m(haracter,)f(y)m(ou)f | |
16732 | (can)g(use)f(y)m(our)g(erase)h(c)m(haracter)h(to)f(bac)m(k)g(up)f(and)f | |
c302751c | 16733 | (delete)j(the)f(mist)m(yp)s(ed)e(c)m(haracter.)275 806 |
a9fac3b2 CR |
16734 | y(Sometimes)i(y)m(ou)g(ma)m(y)h(mist)m(yp)s(e)e(a)i(c)m(haracter,)g |
16735 | (and)e(not)i(notice)g(the)f(error)f(un)m(til)h(y)m(ou)g(ha)m(v)m(e)h(t) | |
c302751c | 16736 | m(yp)s(ed)150 916 y(sev)m(eral)e(other)f(c)m(haracters.)42 |
a9fac3b2 | 16737 | b(In)28 b(that)i(case,)g(y)m(ou)f(can)g(t)m(yp)s(e)h |
6e51e0d0 | 16738 | Fj(C-b)d Fu(to)j(mo)m(v)m(e)g(the)f(cursor)g(to)g(the)g(left,)i(and)150 |
c302751c | 16739 | 1026 y(then)f(correct)i(y)m(our)e(mistak)m(e.)42 b(Afterw)m(ards,)31 |
37c41ab1 | 16740 | b(y)m(ou)f(can)h(mo)m(v)m(e)h(the)e(cursor)g(to)h(the)g(righ)m(t)g |
6e51e0d0 | 16741 | (with)f Fj(C-f)p Fu(.)275 1167 y(When)i(y)m(ou)h(add)f(text)h(in)f(the) |
a9fac3b2 | 16742 | h(middle)f(of)h(a)g(line,)h(y)m(ou)e(will)h(notice)h(that)f(c)m |
c302751c | 16743 | (haracters)h(to)g(the)e(righ)m(t)150 1277 y(of)d(the)g(cursor)f(are)h |
5e13499c | 16744 | (`pushed)e(o)m(v)m(er')j(to)g(mak)m(e)f(ro)s(om)g(for)f(the)h(text)h |
37c41ab1 | 16745 | (that)f(y)m(ou)g(ha)m(v)m(e)h(inserted.)40 b(Lik)m(ewise,)150 |
c302751c | 16746 | 1386 y(when)d(y)m(ou)g(delete)i(text)g(b)s(ehind)c(the)j(cursor,)h(c)m |
37c41ab1 | 16747 | (haracters)g(to)f(the)g(righ)m(t)g(of)g(the)g(cursor)e(are)i(`pulled) |
c302751c | 16748 | 150 1496 y(bac)m(k')24 b(to)f(\014ll)g(in)f(the)h(blank)f(space)i |
37c41ab1 | 16749 | (created)f(b)m(y)g(the)g(remo)m(v)-5 b(al)24 b(of)f(the)g(text.)39 |
c302751c | 16750 | b(A)23 b(list)g(of)g(the)g(bare)f(essen)m(tials)150 1605 |
37c41ab1 | 16751 | y(for)30 b(editing)h(the)g(text)g(of)g(an)f(input)f(line)i(follo)m(ws.) |
6e51e0d0 CR |
16752 | 150 1775 y Fj(C-b)336 b Fu(Mo)m(v)m(e)32 b(bac)m(k)g(one)e(c)m |
16753 | (haracter.)150 1941 y Fj(C-f)336 b Fu(Mo)m(v)m(e)32 b(forw)m(ard)e(one) | |
16754 | h(c)m(haracter.)150 2108 y Ft(DEL)e Fu(or)i Ft(Backspace)630 | |
16755 | 2217 y Fu(Delete)i(the)d(c)m(haracter)i(to)f(the)g(left)g(of)f(the)h | |
16756 | (cursor.)150 2384 y Fj(C-d)336 b Fu(Delete)33 b(the)d(c)m(haracter)i | |
c302751c CR |
16757 | (underneath)d(the)i(cursor.)150 2550 y(Prin)m(ting)g(c)m(haracters)630 |
16758 | 2660 y(Insert)f(the)g(c)m(haracter)i(in)m(to)g(the)e(line)h(at)g(the)g | |
6e51e0d0 CR |
16759 | (cursor.)150 2826 y Fj(C-_)e Fu(or)i Fj(C-x)e(C-u)630 |
16760 | 2936 y Fu(Undo)k(the)h(last)g(editing)g(command.)50 b(Y)-8 | |
c302751c CR |
16761 | b(ou)34 b(can)f(undo)g(all)h(the)f(w)m(a)m(y)i(bac)m(k)f(to)g(an)g |
16762 | (empt)m(y)630 3045 y(line.)150 3215 y(\(Dep)s(ending)29 | |
6e51e0d0 CR |
16763 | b(on)h(y)m(our)f(con\014guration,)i(the)e Ft(Backspace)e |
16764 | Fu(k)m(ey)k(b)s(e)d(set)j(to)f(delete)h(the)e(c)m(haracter)i(to)g(the) | |
c302751c | 16765 | 150 3324 y(left)37 b(of)f(the)h(cursor)e(and)h(the)g |
6e51e0d0 CR |
16766 | Ft(DEL)g Fu(k)m(ey)h(set)f(to)h(delete)h(the)e(c)m(haracter)i |
16767 | (underneath)d(the)h(cursor,)i(lik)m(e)150 3434 y Fj(C-d)p | |
16768 | Fu(,)30 b(rather)g(than)g(the)h(c)m(haracter)h(to)f(the)f(left)h(of)g | |
16769 | (the)f(cursor.\))150 3640 y Fk(8.2.2)63 b(Readline)40 | |
16770 | b(Mo)m(v)m(emen)m(t)h(Commands)150 3787 y Fu(The)27 b(ab)s(o)m(v)m(e)i | |
c302751c CR |
16771 | (table)g(describ)s(es)e(the)g(most)i(basic)f(k)m(eystrok)m(es)h(that)f |
16772 | (y)m(ou)g(need)g(in)f(order)g(to)i(do)e(editing)i(of)150 | |
16773 | 3897 y(the)k(input)f(line.)49 b(F)-8 b(or)34 b(y)m(our)f(con)m(v)m | |
16774 | (enience,)j(man)m(y)d(other)g(commands)f(ha)m(v)m(e)j(b)s(een)d(added)g | |
6e51e0d0 CR |
16775 | (in)h(addition)150 4006 y(to)j Fj(C-b)p Fu(,)f Fj(C-f)p |
16776 | Fu(,)g Fj(C-d)p Fu(,)h(and)e Ft(DEL)p Fu(.)54 b(Here)35 | |
c302751c | 16777 | b(are)g(some)h(commands)e(for)h(mo)m(ving)h(more)f(rapidly)f(ab)s(out)h |
6e51e0d0 CR |
16778 | (the)150 4116 y(line.)150 4286 y Fj(C-a)336 b Fu(Mo)m(v)m(e)32 |
16779 | b(to)g(the)e(start)h(of)g(the)f(line.)150 4452 y Fj(C-e)336 | |
16780 | b Fu(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
16781 | 4618 y Fj(M-f)336 b Fu(Mo)m(v)m(e)32 b(forw)m(ard)e(a)h(w)m(ord,)f | |
c302751c | 16782 | (where)g(a)h(w)m(ord)f(is)g(comp)s(osed)g(of)h(letters)h(and)d(digits.) |
6e51e0d0 CR |
16783 | 150 4785 y Fj(M-b)336 b Fu(Mo)m(v)m(e)32 b(bac)m(kw)m(ard)f(a)g(w)m |
16784 | (ord.)150 4951 y Fj(C-l)336 b Fu(Clear)31 b(the)f(screen,)h(reprin)m | |
c302751c | 16785 | (ting)f(the)h(curren)m(t)f(line)h(at)g(the)f(top.)275 |
6e51e0d0 CR |
16786 | 5121 y(Notice)c(ho)m(w)f Fj(C-f)e Fu(mo)m(v)m(es)j(forw)m(ard)e(a)h(c)m |
16787 | (haracter,)j(while)d Fj(M-f)e Fu(mo)m(v)m(es)j(forw)m(ard)e(a)h(w)m | |
37c41ab1 CR |
16788 | (ord.)39 b(It)24 b(is)h(a)g(lo)s(ose)150 5230 y(con)m(v)m(en)m(tion)32 |
16789 | b(that)f(con)m(trol)g(k)m(eystrok)m(es)h(op)s(erate)e(on)g(c)m | |
16790 | (haracters)h(while)f(meta)h(k)m(eystrok)m(es)h(op)s(erate)e(on)150 | |
16791 | 5340 y(w)m(ords.)p eop end | |
fffe80d4 CR |
16792 | %%Page: 118 124 |
16793 | TeXDict begin 118 123 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16794 | b(Command)29 b(Line)i(Editing)2062 b(118)150 299 y Fk(8.2.3)63 | |
6e51e0d0 CR |
16795 | b(Readline)40 b(Killing)i(Commands)150 446 y Fr(Killing)35 |
16796 | b Fu(text)28 b(means)e(to)h(delete)h(the)f(text)g(from)g(the)f(line,)i | |
c302751c | 16797 | (but)e(to)h(sa)m(v)m(e)h(it)g(a)m(w)m(a)m(y)g(for)e(later)i(use,)f |
6e51e0d0 | 16798 | (usually)150 555 y(b)m(y)g Fr(y)m(anking)35 b Fu(\(re-inserting\))28 |
c302751c CR |
16799 | b(it)g(bac)m(k)f(in)m(to)h(the)f(line.)40 b(\(`Cut')27 |
16800 | b(and)g(`paste')h(are)f(more)g(recen)m(t)h(jargon)f(for)150 | |
16801 | 665 y(`kill')32 b(and)d(`y)m(ank'.\))275 801 y(If)g(the)i(description)f | |
16802 | (for)g(a)h(command)f(sa)m(ys)g(that)h(it)g(`kills')g(text,)h(then)e(y)m | |
16803 | (ou)g(can)h(b)s(e)e(sure)h(that)h(y)m(ou)150 911 y(can)g(get)g(the)g | |
16804 | (text)g(bac)m(k)g(in)f(a)h(di\013eren)m(t)g(\(or)g(the)f(same\))h | |
16805 | (place)h(later.)275 1047 y(When)23 b(y)m(ou)g(use)g(a)h(kill)g | |
16806 | (command,)g(the)g(text)g(is)f(sa)m(v)m(ed)i(in)e(a)g | |
6e51e0d0 | 16807 | Fr(kill-ring)p Fu(.)39 b(An)m(y)24 b(n)m(um)m(b)s(er)e(of)h(consecutiv) |
c302751c | 16808 | m(e)150 1157 y(kills)31 b(sa)m(v)m(e)i(all)f(of)f(the)g(killed)h(text)g |
37c41ab1 | 16809 | (together,)g(so)g(that)f(when)f(y)m(ou)h(y)m(ank)h(it)f(bac)m(k,)h(y)m |
c302751c | 16810 | (ou)g(get)g(it)f(all.)43 b(The)150 1267 y(kill)33 b(ring)f(is)g(not)h |
37c41ab1 CR |
16811 | (line)g(sp)s(eci\014c;)g(the)g(text)g(that)g(y)m(ou)g(killed)f(on)h(a)f |
16812 | (previously)g(t)m(yp)s(ed)h(line)f(is)h(a)m(v)-5 b(ailable)150 | |
c302751c CR |
16813 | 1376 y(to)31 b(b)s(e)f(y)m(ank)m(ed)h(bac)m(k)g(later,)h(when)d(y)m(ou) |
16814 | i(are)g(t)m(yping)f(another)h(line.)275 1513 y(Here)f(is)h(the)f(list)h | |
6e51e0d0 CR |
16815 | (of)g(commands)f(for)g(killing)h(text.)150 1675 y Fj(C-k)336 |
16816 | b Fu(Kill)31 b(the)f(text)i(from)e(the)g(curren)m(t)g(cursor)g(p)s | |
c302751c | 16817 | (osition)h(to)g(the)f(end)g(of)g(the)h(line.)150 1836 |
6e51e0d0 | 16818 | y Fj(M-d)336 b Fu(Kill)27 b(from)f(the)g(cursor)g(to)h(the)f(end)g(of)h |
37c41ab1 | 16819 | (the)f(curren)m(t)g(w)m(ord,)h(or,)h(if)e(b)s(et)m(w)m(een)h(w)m(ords,) |
c302751c | 16820 | g(to)g(the)630 1946 y(end)j(of)g(the)h(next)f(w)m(ord.)41 |
37c41ab1 | 16821 | b(W)-8 b(ord)30 b(b)s(oundaries)f(are)i(the)g(same)f(as)h(those)g(used) |
6e51e0d0 | 16822 | f(b)m(y)g Fj(M-f)p Fu(.)150 2107 y Fj(M-DEL)240 b Fu(Kill)31 |
c302751c CR |
16823 | b(from)f(the)h(cursor)f(the)g(start)h(of)g(the)g(curren)m(t)f(w)m(ord,) |
16824 | h(or,)f(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)i(the)630 | |
16825 | 2217 y(start)39 b(of)f(the)h(previous)f(w)m(ord.)64 b(W)-8 | |
16826 | b(ord)39 b(b)s(oundaries)e(are)i(the)f(same)h(as)g(those)f(used)g(b)m | |
6e51e0d0 | 16827 | (y)630 2326 y Fj(M-b)p Fu(.)150 2487 y Fj(C-w)336 b Fu(Kill)35 |
c302751c | 16828 | b(from)g(the)g(cursor)f(to)i(the)f(previous)g(whitespace.)55 |
6e51e0d0 CR |
16829 | b(This)34 b(is)h(di\013eren)m(t)h(than)e Fj(M-DEL)630 |
16830 | 2597 y Fu(b)s(ecause)c(the)h(w)m(ord)f(b)s(oundaries)f(di\013er.)275 | |
16831 | 2759 y(Here)42 b(is)f(ho)m(w)h(to)g Fr(y)m(ank)47 b Fu(the)42 | |
c302751c CR |
16832 | b(text)g(bac)m(k)h(in)m(to)f(the)g(line.)74 b(Y)-8 b(anking)43 |
16833 | b(means)e(to)h(cop)m(y)h(the)e(most-)150 2869 y(recen)m(tly-killed)33 | |
6e51e0d0 CR |
16834 | b(text)e(from)f(the)g(kill)i(bu\013er.)150 3031 y Fj(C-y)336 |
16835 | b Fu(Y)-8 b(ank)31 b(the)f(most)h(recen)m(tly)h(killed)f(text)g(bac)m | |
c302751c | 16836 | (k)g(in)m(to)h(the)e(bu\013er)g(at)h(the)f(cursor.)150 |
6e51e0d0 | 16837 | 3192 y Fj(M-y)336 b Fu(Rotate)36 b(the)f(kill-ring,)i(and)d(y)m(ank)h |
c302751c | 16838 | (the)f(new)g(top.)54 b(Y)-8 b(ou)35 b(can)g(only)f(do)h(this)f(if)h |
6e51e0d0 CR |
16839 | (the)g(prior)630 3302 y(command)30 b(is)h Fj(C-y)e Fu(or)h |
16840 | Fj(M-y)p Fu(.)150 3503 y Fk(8.2.4)63 b(Readline)40 b(Argumen)m(ts)150 | |
16841 | 3650 y Fu(Y)-8 b(ou)40 b(can)f(pass)g(n)m(umeric)f(argumen)m(ts)i(to)f | |
c302751c CR |
16842 | (Readline)h(commands.)67 b(Sometimes)39 b(the)g(argumen)m(t)h(acts)150 |
16843 | 3760 y(as)g(a)h(rep)s(eat)f(coun)m(t,)j(other)e(times)f(it)h(is)f(the)g | |
6e51e0d0 | 16844 | Fl(sign)47 b Fu(of)41 b(the)f(argumen)m(t)g(that)h(is)f(signi\014can)m |
c302751c | 16845 | (t.)71 b(If)40 b(y)m(ou)150 3869 y(pass)33 b(a)h(negativ)m(e)i(argumen) |
37c41ab1 | 16846 | m(t)e(to)g(a)g(command)f(whic)m(h)g(normally)h(acts)g(in)f(a)h(forw)m |
c302751c | 16847 | (ard)f(direction,)i(that)150 3979 y(command)g(will)h(act)g(in)f(a)h |
37c41ab1 | 16848 | (bac)m(kw)m(ard)f(direction.)57 b(F)-8 b(or)36 b(example,)h(to)f(kill)g |
c302751c | 16849 | (text)g(bac)m(k)g(to)g(the)g(start)g(of)150 4088 y(the)31 |
6e51e0d0 CR |
16850 | b(line,)g(y)m(ou)f(migh)m(t)h(t)m(yp)s(e)g(`)p Ft(M--)f(C-k)p |
16851 | Fu('.)275 4225 y(The)d(general)i(w)m(a)m(y)h(to)e(pass)g(n)m(umeric)g | |
37c41ab1 | 16852 | (argumen)m(ts)h(to)g(a)f(command)g(is)g(to)h(t)m(yp)s(e)f(meta)i |
c302751c | 16853 | (digits)e(b)s(efore)150 4334 y(the)j(command.)42 b(If)30 |
37c41ab1 | 16854 | b(the)h(\014rst)f(`digit')i(t)m(yp)s(ed)f(is)g(a)g(min)m(us)f(sign)h |
6e51e0d0 | 16855 | (\(`)p Ft(-)p Fu('\),)h(then)f(the)g(sign)f(of)h(the)g(argumen)m(t)150 |
c302751c | 16856 | 4444 y(will)39 b(b)s(e)e(negativ)m(e.)66 b(Once)38 b(y)m(ou)h(ha)m(v)m |
37c41ab1 | 16857 | (e)g(t)m(yp)s(ed)f(one)h(meta)g(digit)g(to)f(get)i(the)e(argumen)m(t)h |
c302751c | 16858 | (started,)i(y)m(ou)150 4554 y(can)29 b(t)m(yp)s(e)g(the)g(remainder)f |
37c41ab1 | 16859 | (of)h(the)g(digits,)h(and)f(then)f(the)h(command.)40 |
6e51e0d0 CR |
16860 | b(F)-8 b(or)30 b(example,)g(to)f(giv)m(e)i(the)e Fj(C-d)150 |
16861 | 4663 y Fu(command)37 b(an)g(argumen)m(t)h(of)g(10,)i(y)m(ou)e(could)f | |
16862 | (t)m(yp)s(e)h(`)p Ft(M-1)29 b(0)h(C-d)p Fu(',)39 b(whic)m(h)e(will)h | |
c302751c | 16863 | (delete)h(the)e(next)h(ten)150 4773 y(c)m(haracters)32 |
6e51e0d0 CR |
16864 | b(on)e(the)h(input)e(line.)150 4974 y Fk(8.2.5)63 b(Searc)m(hing)40 |
16865 | b(for)i(Commands)g(in)f(the)g(History)150 5121 y Fu(Readline)35 | |
c302751c CR |
16866 | b(pro)m(vides)f(commands)g(for)g(searc)m(hing)h(through)e(the)i |
16867 | (command)f(history)g(\(see)h(Section)g(9.1)150 5230 y([Bash)i(History)h | |
fffe80d4 | 16868 | (F)-8 b(acilities],)42 b(page)37 b(151\))i(for)d(lines)h(con)m(taining) |
c302751c | 16869 | i(a)e(sp)s(eci\014ed)f(string.)60 b(There)36 b(are)i(t)m(w)m(o)150 |
6e51e0d0 CR |
16870 | 5340 y(searc)m(h)31 b(mo)s(des:)40 b Fr(incremen)m(tal)35 |
16871 | b Fu(and)30 b Fr(non-incremen)m(tal)p Fu(.)p eop end | |
fffe80d4 CR |
16872 | %%Page: 119 125 |
16873 | TeXDict begin 119 124 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16874 | b(Command)29 b(Line)i(Editing)2062 b(119)275 299 y(Incremen)m(tal)26 | |
ad4aef08 CR |
16875 | b(searc)m(hes)h(b)s(egin)e(b)s(efore)g(the)h(user)f(has)h(\014nished)e |
16876 | (t)m(yping)i(the)g(searc)m(h)g(string.)39 b(As)26 b(eac)m(h)150 | |
16877 | 408 y(c)m(haracter)37 b(of)e(the)h(searc)m(h)g(string)f(is)h(t)m(yp)s | |
16878 | (ed,)g(Readline)g(displa)m(ys)g(the)f(next)h(en)m(try)g(from)e(the)i | |
16879 | (history)150 518 y(matc)m(hing)25 b(the)f(string)g(t)m(yp)s(ed)g(so)g | |
16880 | (far.)39 b(An)23 b(incremen)m(tal)j(searc)m(h)e(requires)g(only)g(as)g | |
16881 | (man)m(y)g(c)m(haracters)i(as)150 628 y(needed)i(to)i(\014nd)d(the)i | |
16882 | (desired)f(history)h(en)m(try)-8 b(.)41 b(T)-8 b(o)29 | |
16883 | b(searc)m(h)h(bac)m(kw)m(ard)f(in)f(the)h(history)g(for)f(a)i | |
6e51e0d0 CR |
16884 | (particular)150 737 y(string,)g(t)m(yp)s(e)f Fj(C-r)p |
16885 | Fu(.)40 b(T)m(yping)29 b Fj(C-s)g Fu(searc)m(hes)h(forw)m(ard)f | |
ad4aef08 CR |
16886 | (through)g(the)g(history)-8 b(.)41 b(The)29 b(c)m(haracters)i(presen)m |
16887 | (t)150 847 y(in)38 b(the)g(v)-5 b(alue)38 b(of)g(the)g | |
6e51e0d0 | 16888 | Ft(isearch-terminators)33 b Fu(v)-5 b(ariable)39 b(are)f(used)f(to)i |
ad4aef08 CR |
16889 | (terminate)g(an)f(incremen)m(tal)150 956 y(searc)m(h.)71 |
16890 | b(If)40 b(that)h(v)-5 b(ariable)41 b(has)f(not)h(b)s(een)e(assigned)i | |
6e51e0d0 CR |
16891 | (a)f(v)-5 b(alue,)44 b(the)c Ft(ESC)g Fu(and)f Fj(C-J)h |
16892 | Fu(c)m(haracters)i(will)150 1066 y(terminate)h(an)g(incremen)m(tal)g | |
16893 | (searc)m(h.)78 b Fj(C-g)41 b Fu(will)i(ab)s(ort)f(an)g(incremen)m(tal)i | |
ad4aef08 CR |
16894 | (searc)m(h)f(and)f(restore)h(the)150 1176 y(original)30 |
16895 | b(line.)41 b(When)28 b(the)h(searc)m(h)h(is)f(terminated,)h(the)f | |
16896 | (history)g(en)m(try)g(con)m(taining)h(the)f(searc)m(h)h(string)150 | |
9128f932 | 16897 | 1285 y(b)s(ecomes)h(the)f(curren)m(t)g(line.)275 1416 |
ad4aef08 | 16898 | y(T)-8 b(o)31 b(\014nd)e(other)j(matc)m(hing)g(en)m(tries)g(in)e(the)h |
6e51e0d0 | 16899 | (history)g(list,)h(t)m(yp)s(e)g Fj(C-r)e Fu(or)h Fj(C-s)f |
9128f932 | 16900 | Fu(as)h(appropriate.)43 b(This)150 1525 y(will)26 b(searc)m(h)h(bac)m |
37c41ab1 CR |
16901 | (kw)m(ard)g(or)f(forw)m(ard)g(in)f(the)i(history)f(for)g(the)g(next)g |
16902 | (en)m(try)h(matc)m(hing)g(the)f(searc)m(h)h(string)150 | |
9128f932 | 16903 | 1635 y(t)m(yp)s(ed)37 b(so)h(far.)63 b(An)m(y)38 b(other)f(k)m(ey)i |
37c41ab1 | 16904 | (sequence)f(b)s(ound)e(to)i(a)g(Readline)h(command)e(will)h(terminate)h |
9128f932 | 16905 | (the)150 1744 y(searc)m(h)26 b(and)f(execute)i(that)f(command.)39 |
6e51e0d0 | 16906 | b(F)-8 b(or)26 b(instance,)h(a)f Ft(RET)f Fu(will)g(terminate)i(the)f |
9128f932 | 16907 | (searc)m(h)g(and)e(accept)150 1854 y(the)30 b(line,)g(thereb)m(y)f |
c302751c | 16908 | (executing)i(the)e(command)g(from)g(the)h(history)f(list.)41 |
9128f932 | 16909 | b(A)29 b(mo)m(v)m(emen)m(t)j(command)d(will)150 1964 |
c302751c CR |
16910 | y(terminate)i(the)g(searc)m(h,)g(mak)m(e)h(the)e(last)h(line)g(found)e |
16911 | (the)i(curren)m(t)f(line,)h(and)f(b)s(egin)g(editing.)275 | |
9128f932 | 16912 | 2094 y(Readline)35 b(remem)m(b)s(ers)f(the)h(last)h(incremen)m(tal)g |
6e51e0d0 | 16913 | (searc)m(h)f(string.)54 b(If)34 b(t)m(w)m(o)j Fj(C-r)p |
9128f932 | 16914 | Fu(s)c(are)i(t)m(yp)s(ed)g(without)150 2204 y(an)m(y)i(in)m(terv)m |
c302751c CR |
16915 | (ening)g(c)m(haracters)h(de\014ning)e(a)h(new)f(searc)m(h)h(string,)h |
16916 | (an)m(y)f(remem)m(b)s(ered)e(searc)m(h)i(string)g(is)150 | |
9128f932 | 16917 | 2313 y(used.)275 2444 y(Non-incremen)m(tal)48 b(searc)m(hes)g(read)e |
c302751c | 16918 | (the)h(en)m(tire)h(searc)m(h)f(string)g(b)s(efore)f(starting)h(to)h |
9128f932 | 16919 | (searc)m(h)f(for)150 2553 y(matc)m(hing)d(history)e(lines.)78 |
c302751c | 16920 | b(The)42 b(searc)m(h)h(string)g(ma)m(y)g(b)s(e)f(t)m(yp)s(ed)g(b)m(y)g |
9128f932 CR |
16921 | (the)h(user)f(or)h(b)s(e)f(part)g(of)h(the)150 2663 y(con)m(ten)m(ts)32 |
16922 | b(of)f(the)f(curren)m(t)g(line.)150 2896 y Fs(8.3)68 | |
16923 | b(Readline)47 b(Init)e(File)150 3055 y Fu(Although)f(the)g(Readline)g | |
c302751c | 16924 | (library)f(comes)i(with)e(a)h(set)h(of)f(Emacs-lik)m(e)h(k)m |
9128f932 | 16925 | (eybindings)f(installed)g(b)m(y)150 3165 y(default,)26 |
c302751c CR |
16926 | b(it)g(is)e(p)s(ossible)h(to)g(use)f(a)i(di\013eren)m(t)f(set)g(of)g(k) |
16927 | m(eybindings.)38 b(An)m(y)25 b(user)f(can)h(customize)h(programs)150 | |
e59452c7 CR |
16928 | 3274 y(that)39 b(use)g(Readline)g(b)m(y)f(putting)h(commands)f(in)g(an) |
16929 | h Fr(inputrc)k Fu(\014le,)e(con)m(v)m(en)m(tionally)h(in)c(their)h | |
9128f932 | 16930 | (home)150 3384 y(directory)-8 b(.)59 b(The)35 b(name)i(of)f(this)g |
c302751c | 16931 | (\014le)g(is)g(tak)m(en)h(from)f(the)g(v)-5 b(alue)37 |
6e51e0d0 | 16932 | b(of)f(the)g(shell)h(v)-5 b(ariable)36 b Ft(INPUTRC)p |
9128f932 | 16933 | Fu(.)56 b(If)150 3493 y(that)36 b(v)-5 b(ariable)36 b(is)f(unset,)h |
6e51e0d0 CR |
16934 | (the)f(default)h(is)f Ft(~/.inputrc)p Fu(.)52 b(If)35 |
16935 | b(that)g(\014le)h(do)s(es)e(not)i(exist)g(or)f(cannot)h(b)s(e)150 | |
9128f932 CR |
16936 | 3603 y(read,)f(the)f(ultimate)h(default)f(is)g Ft(/etc/inputrc)p |
16937 | Fu(.)47 b(The)33 b Ft(bind)g Fu(builtin)g(command)h(can)g(also)h(b)s(e) | |
16938 | e(used)150 3713 y(to)e(set)g(Readline)g(k)m(eybindings)f(and)g(v)-5 | |
16939 | b(ariables.)41 b(See)31 b(Section)g(4.2)g([Bash)g(Builtins],)g(page)g | |
e59452c7 | 16940 | (54.)275 3843 y(When)e(a)h(program)f(whic)m(h)h(uses)f(the)h(Readline)g |
6e51e0d0 | 16941 | (library)f(starts)h(up,)f(the)h(init)g(\014le)f(is)h(read,)g(and)f(the) |
9128f932 | 16942 | 150 3953 y(k)m(ey)i(bindings)e(are)i(set.)275 4083 y(In)26 |
6e51e0d0 CR |
16943 | b(addition,)i(the)f Ft(C-x)i(C-r)d Fu(command)h(re-reads)g(this)f(init) |
16944 | h(\014le,)h(th)m(us)f(incorp)s(orating)g(an)m(y)g(c)m(hanges)150 | |
9128f932 CR |
16945 | 4193 y(that)k(y)m(ou)g(migh)m(t)g(ha)m(v)m(e)g(made)g(to)g(it.)150 |
16946 | 4384 y Fk(8.3.1)63 b(Readline)40 b(Init)h(File)g(Syn)m(tax)150 | |
16947 | 4531 y Fu(There)f(are)i(only)f(a)g(few)g(basic)g(constructs)h(allo)m(w) | |
c302751c | 16948 | m(ed)h(in)d(the)h(Readline)h(init)f(\014le.)73 b(Blank)41 |
9128f932 | 16949 | b(lines)h(are)150 4641 y(ignored.)72 b(Lines)41 b(b)s(eginning)f(with)h |
6e51e0d0 CR |
16950 | (a)g(`)p Ft(#)p Fu(')g(are)h(commen)m(ts.)73 b(Lines)41 |
16951 | b(b)s(eginning)f(with)g(a)i(`)p Ft($)p Fu(')f(indicate)150 | |
9128f932 | 16952 | 4750 y(conditional)e(constructs)f(\(see)g(Section)h(8.3.2)g |
fffe80d4 | 16953 | ([Conditional)g(Init)e(Constructs],)j(page)e(127\).)64 |
9128f932 CR |
16954 | b(Other)150 4860 y(lines)31 b(denote)g(v)-5 b(ariable)31 |
16955 | b(settings)g(and)f(k)m(ey)h(bindings.)150 5011 y(V)-8 | |
16956 | b(ariable)32 b(Settings)630 5121 y(Y)-8 b(ou)41 b(can)g(mo)s(dify)e | |
c302751c | 16957 | (the)i(run-time)f(b)s(eha)m(vior)g(of)h(Readline)g(b)m(y)f(altering)h |
9128f932 | 16958 | (the)g(v)-5 b(alues)41 b(of)630 5230 y(v)-5 b(ariables)34 |
6e51e0d0 | 16959 | b(in)f(Readline)i(using)e(the)g Ft(set)g Fu(command)g(within)g(the)h |
9128f932 CR |
16960 | (init)g(\014le.)50 b(The)33 b(syn)m(tax)630 5340 y(is)d(simple:)p |
16961 | eop end | |
fffe80d4 CR |
16962 | %%Page: 120 126 |
16963 | TeXDict begin 120 125 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
16964 | b(Command)29 b(Line)i(Editing)2062 b(120)870 299 y Ft(set)47 | |
25e43d2c | 16965 | b Fj(variable)e(value)630 439 y Fu(Here,)29 b(for)e(example,)h(is)g(ho) |
9128f932 | 16966 | m(w)f(to)h(c)m(hange)g(from)f(the)g(default)h(Emacs-lik)m(e)h(k)m(ey)f |
25e43d2c CR |
16967 | (binding)e(to)630 548 y(use)k Ft(vi)g Fu(line)h(editing)g(commands:)870 |
16968 | 689 y Ft(set)47 b(editing-mode)d(vi)630 829 y Fu(V)-8 | |
9128f932 | 16969 | b(ariable)36 b(names)f(and)g(v)-5 b(alues,)36 b(where)f(appropriate,)h |
25e43d2c | 16970 | (are)g(recognized)g(without)f(regard)630 938 y(to)c(case.)42 |
9128f932 | 16971 | b(Unrecognized)31 b(v)-5 b(ariable)31 b(names)g(are)f(ignored.)630 |
25e43d2c | 16972 | 1078 y(Bo)s(olean)c(v)-5 b(ariables)26 b(\(those)g(that)g(can)f(b)s(e)f |
9128f932 | 16973 | (set)i(to)g(on)f(or)g(o\013)7 b(\))25 b(are)h(set)f(to)h(on)f(if)g(the) |
25e43d2c | 16974 | g(v)-5 b(alue)26 b(is)630 1188 y(n)m(ull)e(or)g(empt)m(y)-8 |
6e51e0d0 | 16975 | b(,)27 b Fr(on)d Fu(\(case-insensitiv)m(e\),)29 b(or)24 |
1c72c0cd | 16976 | b(1.)39 b(An)m(y)25 b(other)f(v)-5 b(alue)25 b(results)f(in)g(the)g(v) |
25e43d2c CR |
16977 | -5 b(ariable)630 1297 y(b)s(eing)30 b(set)h(to)g(o\013.)630 |
16978 | 1437 y(The)37 b Ft(bind)30 b(-V)37 b Fu(command)g(lists)i(the)f(curren) | |
1c72c0cd | 16979 | m(t)f(Readline)i(v)-5 b(ariable)38 b(names)g(and)f(v)-5 |
25e43d2c CR |
16980 | b(alues.)630 1547 y(See)31 b(Section)g(4.2)g([Bash)g(Builtins],)g(page) |
16981 | g(54.)630 1687 y(A)f(great)i(deal)f(of)g(run-time)f(b)s(eha)m(vior)g | |
1c72c0cd | 16982 | (is)g(c)m(hangeable)j(with)d(the)g(follo)m(wing)i(v)-5 |
25e43d2c | 16983 | b(ariables.)630 1857 y Ft(bell-style)1110 1967 y Fu(Con)m(trols)44 |
1c72c0cd | 16984 | b(what)g(happ)s(ens)e(when)h(Readline)i(w)m(an)m(ts)f(to)h(ring)e(the)h |
25e43d2c | 16985 | (termi-)1110 2077 y(nal)37 b(b)s(ell.)61 b(If)37 b(set)h(to)g(`)p |
6e51e0d0 | 16986 | Ft(none)p Fu(',)g(Readline)g(nev)m(er)g(rings)e(the)i(b)s(ell.)61 |
25e43d2c | 16987 | b(If)36 b(set)i(to)1110 2186 y(`)p Ft(visible)p Fu(',)32 |
37c41ab1 | 16988 | b(Readline)i(uses)f(a)g(visible)g(b)s(ell)g(if)g(one)g(is)g(a)m(v)-5 |
25e43d2c | 16989 | b(ailable.)51 b(If)33 b(set)g(to)1110 2296 y(`)p Ft(audible)p |
6e51e0d0 | 16990 | Fu(')j(\(the)i(default\),)i(Readline)e(attempts)g(to)h(ring)e(the)g |
25e43d2c CR |
16991 | (terminal's)1110 2405 y(b)s(ell.)630 2576 y Ft(bind-tty-special-chars) |
16992 | 1110 2685 y Fu(If)e(set)g(to)h(`)p Ft(on)p Fu(')f(\(the)g(default\),)i | |
fc527055 | 16993 | (Readline)f(attempts)g(to)g(bind)d(the)i(con)m(trol)1110 |
25e43d2c CR |
16994 | 2795 y(c)m(haracters)30 b(treated)g(sp)s(ecially)g(b)m(y)f(the)g(k)m |
16995 | (ernel's)h(terminal)f(driv)m(er)g(to)h(their)1110 2905 | |
16996 | y(Readline)h(equiv)-5 b(alen)m(ts.)630 3075 y Ft(blink-matching-paren) | |
16997 | 1110 3185 y Fu(If)36 b(set)g(to)h(`)p Ft(on)p Fu(',)h(Readline)f | |
fc527055 | 16998 | (attempts)g(to)g(brie\015y)e(mo)m(v)m(e)j(the)f(cursor)e(to)i(an)1110 |
25e43d2c CR |
16999 | 3294 y(op)s(ening)k(paren)m(thesis)h(when)f(a)h(closing)h(paren)m |
17000 | (thesis)e(is)h(inserted.)74 b(The)1110 3404 y(default)31 | |
17001 | b(is)f(`)p Ft(off)p Fu('.)630 3574 y Ft(colored-completion-prefi)o(x) | |
17002 | 1110 3684 y Fu(If)f(set)h(to)g(`)p Ft(on)p Fu(',)g(when)e(listing)i | |
8a0829e9 | 17003 | (completions,)h(Readline)f(displa)m(ys)g(the)f(com-)1110 |
25e43d2c | 17004 | 3794 y(mon)c(pre\014x)f(of)i(the)f(set)h(of)g(p)s(ossible)f |
8a0829e9 | 17005 | (completions)h(using)f(a)h(di\013eren)m(t)g(color.)1110 |
25e43d2c CR |
17006 | 3903 y(The)f(color)h(de\014nitions)f(are)h(tak)m(en)g(from)f(the)g(v)-5 |
17007 | b(alue)26 b(of)g(the)f Ft(LS_COLORS)e Fu(en-)1110 4013 | |
17008 | y(vironmen)m(t)34 b(v)-5 b(ariable.)50 b(If)33 b(there)h(is)g(a)f | |
17009 | (color)i(de\014nition)e(in)g Ft(LS_COLORS)e Fu(for)1110 | |
17010 | 4122 y(the)22 b(custom)g(su\016x)f(`)p Ft(readline-colored-complet)o | |
17011 | (ion)o(-pre)o(fix)p Fu(',)c(Read-)1110 4232 y(line)24 | |
17012 | b(uses)e(this)i(color)g(for)f(the)h(common)f(pre\014x)f(instead)i(of)f | |
17013 | (its)h(default.)38 b(The)1110 4341 y(default)31 b(is)f(`)p | |
17014 | Ft(off)p Fu('.)630 4512 y Ft(colored-stats)1110 4622 | |
17015 | y Fu(If)c(set)h(to)g(`)p Ft(on)p Fu(',)h(Readline)f(displa)m(ys)g(p)s | |
17016 | (ossible)f(completions)h(using)f(di\013eren)m(t)1110 | |
17017 | 4731 y(colors)40 b(to)g(indicate)g(their)f(\014le)h(t)m(yp)s(e.)67 | |
abe2eb5b | 17018 | b(The)38 b(color)j(de\014nitions)d(are)i(tak)m(en)1110 |
25e43d2c | 17019 | 4841 y(from)24 b(the)h(v)-5 b(alue)25 b(of)g(the)g Ft(LS_COLORS)d |
6e51e0d0 | 17020 | Fu(en)m(vironmen)m(t)j(v)-5 b(ariable.)40 b(The)24 b(default)1110 |
25e43d2c CR |
17021 | 4950 y(is)30 b(`)p Ft(off)p Fu('.)630 5121 y Ft(comment-begin)1110 |
17022 | 5230 y Fu(The)62 b(string)g(to)h(insert)f(at)h(the)g(b)s(eginning)e(of) | |
17023 | h(the)h(line)f(when)g(the)1110 5340 y Ft(insert-comment)26 | |
6e51e0d0 | 17024 | b Fu(command)31 b(is)f(executed.)42 b(The)30 b(default)g(v)-5 |
25e43d2c | 17025 | b(alue)31 b(is)f Ft("#")p Fu(.)p eop end |
fffe80d4 CR |
17026 | %%Page: 121 127 |
17027 | TeXDict begin 121 126 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17028 | b(Command)29 b(Line)i(Editing)2062 b(121)630 299 y Ft | |
25e43d2c CR |
17029 | (completion-display-width)1110 408 y Fu(The)41 b(n)m(um)m(b)s(er)f(of)i |
17030 | (screen)g(columns)f(used)g(to)h(displa)m(y)g(p)s(ossible)f(matc)m(hes) | |
17031 | 1110 518 y(when)28 b(p)s(erforming)g(completion.)41 b(The)29 | |
17032 | b(v)-5 b(alue)29 b(is)g(ignored)g(if)g(it)h(is)f(less)g(than)1110 | |
17033 | 628 y(0)e(or)f(greater)h(than)f(the)g(terminal)h(screen)f(width.)39 | |
9128f932 | 17034 | b(A)26 b(v)-5 b(alue)27 b(of)f(0)h(will)f(cause)1110 |
25e43d2c | 17035 | 737 y(matc)m(hes)32 b(to)f(b)s(e)e(displa)m(y)m(ed)i(one)g(p)s(er)e |
9128f932 | 17036 | (line.)41 b(The)30 b(default)h(v)-5 b(alue)31 b(is)f(-1.)630 |
25e43d2c | 17037 | 888 y Ft(completion-ignore-case)1110 998 y Fu(If)d(set)h(to)g(`)p |
6e51e0d0 | 17038 | Ft(on)p Fu(',)g(Readline)g(p)s(erforms)e(\014lename)h(matc)m(hing)i |
25e43d2c CR |
17039 | (and)e(completion)1110 1107 y(in)j(a)h(case-insensitiv)m(e)i(fashion.) |
17040 | 40 b(The)30 b(default)h(v)-5 b(alue)30 b(is)h(`)p Ft(off)p | |
17041 | Fu('.)630 1258 y Ft(completion-map-case)1110 1367 y Fu(If)22 | |
8a0829e9 | 17042 | b(set)g(to)h(`)p Ft(on)p Fu(',)h(and)e Fr(completion-ignore-case)31 |
25e43d2c | 17043 | b Fu(is)22 b(enabled,)i(Readline)f(treats)1110 1477 y(h)m(yphens)29 |
fc527055 CR |
17044 | b(\(`)p Ft(-)p Fu('\))j(and)e(underscores)g(\(`)p Ft(_)p |
17045 | Fu('\))i(as)f(equiv)-5 b(alen)m(t)32 b(when)e(p)s(erforming)1110 | |
25e43d2c CR |
17046 | 1587 y(case-insensitiv)m(e)47 b(\014lename)e(matc)m(hing)g(and)f |
17047 | (completion.)85 b(The)44 b(default)1110 1696 y(v)-5 b(alue)31 | |
17048 | b(is)f(`)p Ft(off)p Fu('.)630 1847 y Ft(completion-prefix-displa)o | |
17049 | (y-le)o(ngth)1110 1956 y Fu(The)h(length)g(in)g(c)m(haracters)i(of)f | |
12beeabf | 17050 | (the)f(common)h(pre\014x)e(of)h(a)h(list)g(of)f(p)s(ossible)1110 |
25e43d2c CR |
17051 | 2066 y(completions)g(that)f(is)g(displa)m(y)m(ed)g(without)g(mo)s |
17052 | (di\014cation.)41 b(When)29 b(set)h(to)h(a)1110 2176 | |
fc527055 | 17053 | y(v)-5 b(alue)26 b(greater)h(than)e(zero,)j(common)e(pre\014xes)e |
25e43d2c | 17054 | (longer)j(than)e(this)g(v)-5 b(alue)27 b(are)1110 2285 |
ad4aef08 | 17055 | y(replaced)k(with)f(an)g(ellipsis)h(when)e(displa)m(ying)i(p)s(ossible) |
25e43d2c CR |
17056 | f(completions.)630 2436 y Ft(completion-query-items)1110 |
17057 | 2545 y Fu(The)c(n)m(um)m(b)s(er)f(of)h(p)s(ossible)g(completions)h | |
17058 | (that)g(determines)f(when)f(the)i(user)1110 2655 y(is)43 | |
e6983002 | 17059 | b(ask)m(ed)g(whether)f(the)g(list)h(of)g(p)s(ossibilities)g(should)f(b) |
25e43d2c | 17060 | s(e)g(displa)m(y)m(ed.)77 b(If)1110 2765 y(the)29 b(n)m(um)m(b)s(er)f |
e6983002 | 17061 | (of)h(p)s(ossible)g(completions)h(is)f(greater)h(than)f(or)g(equal)g |
25e43d2c | 17062 | (to)h(this)1110 2874 y(v)-5 b(alue,)45 b(Readline)e(will)f(ask)g |
e6983002 | 17063 | (whether)f(or)h(not)g(the)g(user)f(wishes)g(to)i(view)1110 |
25e43d2c | 17064 | 2984 y(them;)33 b(otherwise,)f(they)g(are)g(simply)g(listed.)45 |
e6983002 | 17065 | b(This)31 b(v)-5 b(ariable)33 b(m)m(ust)e(b)s(e)g(set)1110 |
25e43d2c | 17066 | 3093 y(to)43 b(an)e(in)m(teger)j(v)-5 b(alue)42 b(greater)h(than)f(or)g |
e59452c7 | 17067 | (equal)g(to)h(zero.)76 b(A)42 b(zero)g(v)-5 b(alue)1110 |
25e43d2c | 17068 | 3203 y(means)40 b(Readline)h(should)f(nev)m(er)g(ask;)46 |
e59452c7 | 17069 | b(negativ)m(e)d(v)-5 b(alues)41 b(are)f(treated)i(as)1110 |
25e43d2c CR |
17070 | 3313 y(zero.)g(The)29 b(default)i(limit)g(is)g Ft(100)p |
17071 | Fu(.)630 3463 y Ft(convert-meta)1110 3573 y Fu(If)22 | |
e59452c7 CR |
17072 | b(set)g(to)h(`)p Ft(on)p Fu(',)h(Readline)f(will)f(con)m(v)m(ert)i(c)m |
17073 | (haracters)f(with)f(the)g(eigh)m(th)h(bit)f(set)1110 | |
25e43d2c | 17074 | 3682 y(to)33 b(an)e Fm(asci)r(i)h Fu(k)m(ey)h(sequence)f(b)m(y)g |
e59452c7 | 17075 | (stripping)f(the)h(eigh)m(th)h(bit)f(and)f(pre\014xing)1110 |
25e43d2c CR |
17076 | 3792 y(an)24 b Ft(ESC)g Fu(c)m(haracter,)j(con)m(v)m(erting)f(them)f |
17077 | (to)g(a)g(meta-pre\014xed)f(k)m(ey)h(sequence.)1110 3902 | |
e59452c7 CR |
17078 | y(The)i(default)h(v)-5 b(alue)28 b(is)f(`)p Ft(on)p Fu(',)i(but)d(will) |
17079 | i(b)s(e)f(set)h(to)g(`)p Ft(off)p Fu(')g(if)f(the)h(lo)s(cale)h(is)f | |
25e43d2c CR |
17080 | (one)1110 4011 y(that)j(con)m(tains)h(eigh)m(t-bit)g(c)m(haracters.)630 |
17081 | 4162 y Ft(disable-completion)1110 4271 y Fu(If)k(set)h(to)h(`)p | |
b729dac1 | 17082 | Ft(On)p Fu(',)g(Readline)f(will)g(inhibit)f(w)m(ord)h(completion.)60 |
25e43d2c | 17083 | b(Completion)1110 4381 y(c)m(haracters)28 b(will)e(b)s(e)f(inserted)h |
b729dac1 | 17084 | (in)m(to)h(the)g(line)f(as)g(if)g(they)h(had)e(b)s(een)g(mapp)s(ed)1110 |
25e43d2c CR |
17085 | 4491 y(to)31 b Ft(self-insert)p Fu(.)38 b(The)30 b(default)g(is)h(`)p |
17086 | Ft(off)p Fu('.)630 4641 y Ft(echo-control-characters)1110 | |
17087 | 4751 y Fu(When)f(set)h(to)g(`)p Ft(on)p Fu(',)f(on)g(op)s(erating)h | |
17088 | (systems)f(that)h(indicate)g(they)g(supp)s(ort)1110 4861 | |
b729dac1 | 17089 | y(it,)i(readline)e(ec)m(ho)s(es)i(a)f(c)m(haracter)h(corresp)s(onding)d |
25e43d2c CR |
17090 | (to)j(a)f(signal)g(generated)1110 4970 y(from)e(the)g(k)m(eyb)s(oard.) |
17091 | 41 b(The)30 b(default)g(is)h(`)p Ft(on)p Fu('.)630 5121 | |
17092 | y Ft(editing-mode)1110 5230 y Fu(The)d Ft(editing-mode)e | |
6e51e0d0 | 17093 | Fu(v)-5 b(ariable)29 b(con)m(trols)h(whic)m(h)e(default)h(set)h(of)e(k) |
25e43d2c CR |
17094 | m(ey)i(bind-)1110 5340 y(ings)25 b(is)g(used.)38 b(By)26 |
17095 | b(default,)g(Readline)g(starts)f(up)f(in)h(Emacs)g(editing)h(mo)s(de,)p | |
17096 | eop end | |
fffe80d4 CR |
17097 | %%Page: 122 128 |
17098 | TeXDict begin 122 127 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17099 | b(Command)29 b(Line)i(Editing)2062 b(122)1110 299 y(where)29 | |
25e43d2c CR |
17100 | b(the)g(k)m(eystrok)m(es)i(are)e(most)h(similar)f(to)h(Emacs.)40 |
17101 | b(This)29 b(v)-5 b(ariable)30 b(can)1110 408 y(b)s(e)g(set)h(to)g | |
17102 | (either)g(`)p Ft(emacs)p Fu(')e(or)h(`)p Ft(vi)p Fu('.)630 | |
17103 | 565 y Ft(emacs-mode-string)1110 675 y Fu(If)j(the)h Fr(sho)m(w-mo)s | |
9128f932 | 17104 | (de-in-prompt)h Fu(v)-5 b(ariable)35 b(is)e(enabled,)i(this)f(string)f |
25e43d2c | 17105 | (is)h(dis-)1110 784 y(pla)m(y)m(ed)24 b(immediately)g(b)s(efore)f(the)g |
9128f932 | 17106 | (last)h(line)f(of)h(the)f(primary)f(prompt)g(when)1110 |
25e43d2c | 17107 | 894 y(emacs)g(editing)h(mo)s(de)e(is)h(activ)m(e.)40 |
9128f932 | 17108 | b(The)21 b(v)-5 b(alue)22 b(is)g(expanded)f(lik)m(e)h(a)h(k)m(ey)f |
25e43d2c | 17109 | (bind-)1110 1003 y(ing,)27 b(so)f(the)f(standard)g(set)h(of)f(meta-)i |
9128f932 | 17110 | (and)e(con)m(trol)i(pre\014xes)d(and)h(bac)m(kslash)1110 |
25e43d2c | 17111 | 1113 y(escap)s(e)f(sequences)h(is)e(a)m(v)-5 b(ailable.)41 |
9128f932 | 17112 | b(Use)25 b(the)f(`)p Ft(\\1)p Fu(')f(and)h(`)p Ft(\\2)p |
25e43d2c CR |
17113 | Fu(')g(escap)s(es)g(to)g(b)s(egin)1110 1223 y(and)37 |
17114 | b(end)g(sequences)h(of)f(non-prin)m(ting)h(c)m(haracters,)j(whic)m(h)c | |
17115 | (can)h(b)s(e)f(used)1110 1332 y(to)h(em)m(b)s(ed)f(a)g(terminal)h(con)m | |
17116 | (trol)h(sequence)f(in)m(to)g(the)f(mo)s(de)g(string.)61 | |
17117 | b(The)1110 1442 y(default)31 b(is)f(`)p Ft(@)p Fu('.)630 | |
17118 | 1598 y Ft(enable-active-region)1110 1708 y Fu(The)46 | |
17119 | b Fr(p)s(oin)m(t)j Fu(is)e(the)g(curren)m(t)f(cursor)g(p)s(osition,)52 | |
17120 | b(and)46 b Fr(mark)52 b Fu(refers)46 b(to)i(a)1110 1817 | |
17121 | y(sa)m(v)m(ed)37 b(cursor)f(p)s(osition)g(\(see)i(Section)f(8.4.1)h | |
fffe80d4 | 17122 | ([Commands)d(F)-8 b(or)37 b(Mo)m(ving],)1110 1927 y(page)d(132\).)50 |
25e43d2c CR |
17123 | b(The)33 b(text)h(b)s(et)m(w)m(een)f(the)g(p)s(oin)m(t)g(and)g(mark)g |
17124 | (is)g(referred)f(to)i(as)1110 2037 y(the)23 b Fr(region)p | |
e59452c7 | 17125 | Fu(.)39 b(When)23 b(this)g(v)-5 b(ariable)24 b(is)f(set)h(to)g(`)p |
25e43d2c | 17126 | Ft(On)p Fu(',)h(Readline)f(allo)m(ws)g(certain)1110 2146 |
e59452c7 CR |
17127 | y(commands)37 b(to)h(designate)h(the)e(region)h(as)g |
17128 | Fr(activ)m(e)p Fu(.)64 b(When)37 b(the)h(region)g(is)1110 | |
25e43d2c CR |
17129 | 2256 y(activ)m(e,)g(Readline)d(highligh)m(ts)g(the)g(text)g(in)f(the)h |
17130 | (region)g(using)f(the)g(termi-)1110 2365 y(nal's)c(standout)h(mo)s(de.) | |
e59452c7 | 17131 | 40 b(The)29 b(activ)m(e)k(region)e(sho)m(ws)f(the)g(text)h(inserted)f |
25e43d2c | 17132 | (b)m(y)1110 2475 y(brac)m(k)m(eted-paste)37 b(and)d(an)m(y)i(matc)m |
e59452c7 | 17133 | (hing)f(text)h(found)e(b)m(y)g(incremen)m(tal)j(and)1110 |
25e43d2c CR |
17134 | 2585 y(non-incremen)m(tal)31 b(history)g(searc)m(hes.)41 |
17135 | b(The)30 b(default)h(is)f(`)p Ft(On)p Fu('.)630 2741 | |
17136 | y Ft(enable-bracketed-paste)1110 2851 y Fu(When)24 b(set)h(to)h(`)p | |
9128f932 | 17137 | Ft(On)p Fu(',)g(Readline)f(will)g(con\014gure)f(the)h(terminal)g(in)f |
25e43d2c | 17138 | (a)h(w)m(a)m(y)g(that)1110 2960 y(will)k(enable)f(it)h(to)g(insert)g |
9128f932 | 17139 | (eac)m(h)g(paste)g(in)m(to)g(the)g(editing)g(bu\013er)e(as)i(a)f |
25e43d2c | 17140 | (single)1110 3070 y(string)33 b(of)f(c)m(haracters,)j(instead)e(of)g |
9128f932 | 17141 | (treating)h(eac)m(h)g(c)m(haracter)g(as)f(if)f(it)i(had)1110 |
25e43d2c | 17142 | 3180 y(b)s(een)e(read)i(from)e(the)i(k)m(eyb)s(oard.)49 |
9128f932 | 17143 | b(This)32 b(can)h(prev)m(en)m(t)h(pasted)f(c)m(haracters)1110 |
25e43d2c CR |
17144 | 3289 y(from)d(b)s(eing)g(in)m(terpreted)h(as)f(editing)h(commands.)41 |
17145 | b(The)29 b(default)i(is)f(`)p Ft(On)p Fu('.)630 3446 | |
17146 | y Ft(enable-keypad)1110 3555 y Fu(When)23 b(set)h(to)g(`)p | |
9128f932 | 17147 | Ft(on)p Fu(',)h(Readline)f(will)g(try)f(to)h(enable)g(the)f |
25e43d2c | 17148 | (application)i(k)m(eypad)1110 3665 y(when)h(it)h(is)f(called.)41 |
9128f932 | 17149 | b(Some)27 b(systems)f(need)h(this)f(to)h(enable)g(the)g(arro)m(w)g(k)m |
25e43d2c CR |
17150 | (eys.)1110 3774 y(The)j(default)g(is)h(`)p Ft(off)p Fu('.)630 |
17151 | 3931 y Ft(enable-meta-key)1110 4041 y Fu(When)40 b(set)g(to)g(`)p | |
9128f932 | 17152 | Ft(on)p Fu(',)j(Readline)d(will)g(try)g(to)g(enable)g(an)m(y)g(meta)h |
25e43d2c | 17153 | (mo)s(di\014er)1110 4150 y(k)m(ey)i(the)e(terminal)i(claims)f(to)h |
9128f932 | 17154 | (supp)s(ort)d(when)h(it)h(is)g(called.)76 b(On)41 b(man)m(y)1110 |
25e43d2c CR |
17155 | 4260 y(terminals,)c(the)e(meta)h(k)m(ey)g(is)f(used)g(to)h(send)e(eigh) |
17156 | m(t-bit)j(c)m(haracters.)56 b(The)1110 4369 y(default)31 | |
17157 | b(is)f(`)p Ft(on)p Fu('.)630 4526 y Ft(expand-tilde)1110 | |
17158 | 4635 y Fu(If)d(set)h(to)h(`)p Ft(on)p Fu(',)f(tilde)g(expansion)g(is)f | |
17159 | (p)s(erformed)f(when)h(Readline)h(attempts)1110 4745 | |
9128f932 | 17160 | y(w)m(ord)i(completion.)42 b(The)30 b(default)g(is)h(`)p |
e59452c7 CR |
17161 | Ft(off)p Fu('.)630 4902 y Ft(history-preserve-point)1110 |
17162 | 5011 y Fu(If)41 b(set)h(to)h(`)p Ft(on)p Fu(',)i(the)c(history)h(co)s | |
9128f932 | 17163 | (de)g(attempts)h(to)f(place)h(the)f(p)s(oin)m(t)f(\(the)1110 |
e59452c7 CR |
17164 | 5121 y(curren)m(t)35 b(cursor)g(p)s(osition\))g(at)h(the)g(same)f(lo)s |
17165 | (cation)i(on)e(eac)m(h)h(history)g(line)1110 5230 y(retriev)m(ed)h | |
9128f932 | 17166 | (with)f Ft(previous-history)c Fu(or)37 b Ft(next-history)p |
e59452c7 CR |
17167 | Fu(.)55 b(The)36 b(default)1110 5340 y(is)30 b(`)p Ft(off)p |
17168 | Fu('.)p eop end | |
fffe80d4 CR |
17169 | %%Page: 123 129 |
17170 | TeXDict begin 123 128 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17171 | b(Command)29 b(Line)i(Editing)2062 b(123)630 299 y Ft(history-size)1110 | |
e59452c7 CR |
17172 | 408 y Fu(Set)39 b(the)g(maxim)m(um)g(n)m(um)m(b)s(er)f(of)h(history)g |
17173 | (en)m(tries)h(sa)m(v)m(ed)g(in)f(the)g(history)1110 518 | |
17174 | y(list.)51 b(If)34 b(set)g(to)h(zero,)g(an)m(y)f(existing)h(history)f | |
17175 | (en)m(tries)g(are)g(deleted)h(and)e(no)1110 628 y(new)e(en)m(tries)i | |
17176 | (are)f(sa)m(v)m(ed.)46 b(If)31 b(set)h(to)h(a)f(v)-5 | |
17177 | b(alue)32 b(less)g(than)f(zero,)i(the)f(n)m(um)m(b)s(er)1110 | |
17178 | 737 y(of)f(history)f(en)m(tries)h(is)g(not)g(limited.)42 | |
17179 | b(By)30 b(default,)h(the)g(n)m(um)m(b)s(er)e(of)i(history)1110 | |
17180 | 847 y(en)m(tries)j(is)f(not)g(limited.)49 b(If)32 b(an)h(attempt)h(is)f | |
17181 | (made)g(to)h(set)f Fr(history-size)39 b Fu(to)1110 956 | |
17182 | y(a)34 b(non-n)m(umeric)f(v)-5 b(alue,)34 b(the)g(maxim)m(um)f(n)m(um)m | |
17183 | (b)s(er)f(of)h(history)h(en)m(tries)g(will)1110 1066 | |
17184 | y(b)s(e)c(set)h(to)g(500.)630 1219 y Ft(horizontal-scroll-mode)1110 | |
17185 | 1329 y Fu(This)k(v)-5 b(ariable)37 b(can)f(b)s(e)f(set)h(to)h(either)f | |
17186 | (`)p Ft(on)p Fu(')g(or)g(`)p Ft(off)p Fu('.)57 b(Setting)36 | |
17187 | b(it)g(to)h(`)p Ft(on)p Fu(')1110 1439 y(means)26 b(that)h(the)f(text)h | |
eb0b2ad8 | 17188 | (of)g(the)f(lines)g(b)s(eing)g(edited)h(will)f(scroll)h(horizon)m |
e59452c7 CR |
17189 | (tally)1110 1548 y(on)32 b(a)g(single)g(screen)g(line)g(when)e(they)i |
17190 | (are)g(longer)h(than)e(the)h(width)f(of)h(the)1110 1658 | |
17191 | y(screen,)c(instead)g(of)f(wrapping)f(on)m(to)i(a)g(new)e(screen)i | |
17192 | (line.)40 b(This)26 b(v)-5 b(ariable)28 b(is)1110 1767 | |
17193 | y(automatically)k(set)e(to)g(`)p Ft(on)p Fu(')f(for)g(terminals)g(of)h | |
17194 | (heigh)m(t)g(1.)41 b(By)29 b(default,)h(this)1110 1877 | |
17195 | y(v)-5 b(ariable)31 b(is)g(set)f(to)i(`)p Ft(off)p Fu('.)630 | |
17196 | 2030 y Ft(input-meta)1110 2140 y Fu(If)f(set)g(to)h(`)p | |
17197 | Ft(on)p Fu(',)g(Readline)g(will)f(enable)h(eigh)m(t-bit)h(input)d(\(it) | |
17198 | i(will)f(not)h(clear)1110 2250 y(the)40 b(eigh)m(th)g(bit)g(in)f(the)h | |
17199 | (c)m(haracters)h(it)f(reads\),)j(regardless)c(of)h(what)g(the)1110 | |
17200 | 2359 y(terminal)k(claims)h(it)f(can)g(supp)s(ort.)79 | |
17201 | b(The)44 b(default)g(v)-5 b(alue)44 b(is)g(`)p Ft(off)p | |
17202 | Fu(',)j(but)1110 2469 y(Readline)24 b(will)h(set)f(it)g(to)h(`)p | |
17203 | Ft(on)p Fu(')e(if)h(the)g(lo)s(cale)i(con)m(tains)f(eigh)m(t-bit)g(c)m | |
17204 | (haracters.)1110 2578 y(The)30 b(name)g Ft(meta-flag)e | |
17205 | Fu(is)j(a)f(synon)m(ym)g(for)g(this)h(v)-5 b(ariable.)630 | |
17206 | 2732 y Ft(isearch-terminators)1110 2841 y Fu(The)51 b(string)h(of)g(c)m | |
17207 | (haracters)h(that)f(should)e(terminate)j(an)f(incremen)m(tal)1110 | |
17208 | 2951 y(searc)m(h)25 b(without)g(subsequen)m(tly)g(executing)h(the)f(c)m | |
17209 | (haracter)h(as)f(a)g(command)1110 3061 y(\(see)38 b(Section)g(8.2.5)h | |
fffe80d4 | 17210 | ([Searc)m(hing],)h(page)e(118\).)62 b(If)37 b(this)g(v)-5 |
e59452c7 CR |
17211 | b(ariable)38 b(has)f(not)1110 3170 y(b)s(een)e(giv)m(en)h(a)g(v)-5 |
17212 | b(alue,)37 b(the)f(c)m(haracters)h Ft(ESC)d Fu(and)h | |
17213 | Fj(C-J)g Fu(will)h(terminate)g(an)1110 3280 y(incremen)m(tal)c(searc)m | |
17214 | (h.)630 3433 y Ft(keymap)192 b Fu(Sets)64 b(Readline's)i(idea)f(of)f | |
17215 | (the)h(curren)m(t)f(k)m(eymap)h(for)f(k)m(ey)h(binding)1110 | |
17216 | 3543 y(commands.)71 b(Built-in)41 b Ft(keymap)e Fu(names)h(are)h | |
17217 | Ft(emacs)p Fu(,)h Ft(emacs-standard)p Fu(,)1110 3652 | |
17218 | y Ft(emacs-meta)p Fu(,)99 b Ft(emacs-ctlx)p Fu(,)f Ft(vi)p | |
17219 | Fu(,)j Ft(vi-move)p Fu(,)f Ft(vi-command)p Fu(,)f(and)1110 | |
17220 | 3762 y Ft(vi-insert)p Fu(.)81 b Ft(vi)44 b Fu(is)h(equiv)-5 | |
17221 | b(alen)m(t)46 b(to)g Ft(vi-command)c Fu(\()p Ft(vi-move)h | |
17222 | Fu(is)i(also)h(a)1110 3871 y(synon)m(ym\);)41 b Ft(emacs)c | |
17223 | Fu(is)h(equiv)-5 b(alen)m(t)39 b(to)f Ft(emacs-standard)p | |
17224 | Fu(.)59 b(Applications)1110 3981 y(ma)m(y)32 b(add)e(additional)i | |
a6ae8f35 | 17225 | (names.)43 b(The)30 b(default)h(v)-5 b(alue)32 b(is)f |
e59452c7 | 17226 | Ft(emacs)p Fu(.)41 b(The)30 b(v)-5 b(alue)1110 4091 y(of)31 |
a6ae8f35 | 17227 | b(the)f Ft(editing-mode)d Fu(v)-5 b(ariable)31 b(also)h(a\013ects)f |
e59452c7 CR |
17228 | (the)g(default)g(k)m(eymap.)630 4244 y Ft(keyseq-timeout)1110 |
17229 | 4354 y Fu(Sp)s(eci\014es)25 b(the)g(duration)g(Readline)h(will)g(w)m | |
17230 | (ait)g(for)g(a)f(c)m(haracter)i(when)e(read-)1110 4463 | |
b729dac1 | 17231 | y(ing)30 b(an)g(am)m(biguous)g(k)m(ey)h(sequence)f(\(one)g(that)h(can)f |
e59452c7 | 17232 | (form)g(a)g(complete)h(k)m(ey)1110 4573 y(sequence)j(using)e(the)i |
b729dac1 | 17233 | (input)e(read)h(so)g(far,)h(or)g(can)f(tak)m(e)i(additional)f(input) |
e59452c7 | 17234 | 1110 4682 y(to)g(complete)g(a)f(longer)h(k)m(ey)f(sequence\).)49 |
b729dac1 | 17235 | b(If)33 b(no)f(input)g(is)h(receiv)m(ed)h(within)1110 |
e59452c7 CR |
17236 | 4792 y(the)43 b(timeout,)48 b(Readline)43 b(will)g(use)g(the)g(shorter) |
17237 | g(but)f(complete)j(k)m(ey)e(se-)1110 4902 y(quence.)c(Readline)26 | |
b729dac1 | 17238 | b(uses)f(this)h(v)-5 b(alue)26 b(to)g(determine)g(whether)f(or)g(not)h |
e59452c7 | 17239 | (input)1110 5011 y(is)31 b(a)m(v)-5 b(ailable)33 b(on)d(the)h(curren)m |
b729dac1 | 17240 | (t)f(input)g(source)h(\()p Ft(rl_instream)d Fu(b)m(y)i(default\).)1110 |
e59452c7 | 17241 | 5121 y(The)25 b(v)-5 b(alue)26 b(is)f(sp)s(eci\014ed)f(in)h |
8a0829e9 | 17242 | (milliseconds,)j(so)d(a)h(v)-5 b(alue)26 b(of)f(1000)i(means)e(that) |
e59452c7 | 17243 | 1110 5230 y(Readline)e(will)g(w)m(ait)g(one)g(second)f(for)g |
8a0829e9 | 17244 | (additional)i(input.)37 b(If)22 b(this)g(v)-5 b(ariable)23 |
e59452c7 | 17245 | b(is)1110 5340 y(set)28 b(to)h(a)f(v)-5 b(alue)29 b(less)f(than)g(or)f |
8a0829e9 | 17246 | (equal)i(to)f(zero,)i(or)e(to)g(a)h(non-n)m(umeric)e(v)-5 |
e59452c7 | 17247 | b(alue,)p eop end |
fffe80d4 CR |
17248 | %%Page: 124 130 |
17249 | TeXDict begin 124 129 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17250 | b(Command)29 b(Line)i(Editing)2062 b(124)1110 299 y(Readline)30 | |
e59452c7 CR |
17251 | b(will)f(w)m(ait)i(un)m(til)e(another)h(k)m(ey)g(is)f(pressed)g(to)h |
17252 | (decide)f(whic)m(h)g(k)m(ey)1110 408 y(sequence)i(to)g(complete.)42 | |
17253 | b(The)30 b(default)g(v)-5 b(alue)31 b(is)g Ft(500)p Fu(.)630 | |
17254 | 591 y Ft(mark-directories)1110 701 y Fu(If)38 b(set)g(to)h(`)p | |
17255 | Ft(on)p Fu(',)i(completed)e(directory)f(names)g(ha)m(v)m(e)i(a)e(slash) | |
17256 | g(app)s(ended.)1110 810 y(The)30 b(default)g(is)h(`)p | |
17257 | Ft(on)p Fu('.)630 993 y Ft(mark-modified-lines)1110 1103 | |
17258 | y Fu(This)k(v)-5 b(ariable,)38 b(when)d(set)h(to)h(`)p | |
17259 | Ft(on)p Fu(',)g(causes)g(Readline)f(to)h(displa)m(y)f(an)f(as-)1110 | |
17260 | 1212 y(terisk)f(\(`)p Ft(*)p Fu('\))h(at)f(the)g(start)g(of)g(history)g | |
17261 | (lines)g(whic)m(h)f(ha)m(v)m(e)i(b)s(een)e(mo)s(di\014ed.)1110 | |
17262 | 1322 y(This)d(v)-5 b(ariable)31 b(is)f(`)p Ft(off)p Fu(')g(b)m(y)g | |
17263 | (default.)630 1504 y Ft(mark-symlinked-directori)o(es)1110 | |
17264 | 1614 y Fu(If)59 b(set)h(to)g(`)p Ft(on)p Fu(',)67 b(completed)60 | |
17265 | b(names)f(whic)m(h)g(are)h(sym)m(b)s(olic)g(links)f(to)1110 | |
17266 | 1724 y(directories)71 b(ha)m(v)m(e)f(a)g(slash)f(app)s(ended)f(\(sub)5 | |
17267 | b(ject)70 b(to)g(the)g(v)-5 b(alue)70 b(of)1110 1833 | |
17268 | y Ft(mark-directories)p Fu(\).)37 b(The)30 b(default)g(is)g(`)p | |
17269 | Ft(off)p Fu('.)630 2016 y Ft(match-hidden-files)1110 | |
17270 | 2125 y Fu(This)21 b(v)-5 b(ariable,)25 b(when)d(set)g(to)h(`)p | |
9128f932 | 17271 | Ft(on)p Fu(',)h(causes)f(Readline)g(to)g(matc)m(h)g(\014les)f(whose) |
e59452c7 | 17272 | 1110 2235 y(names)44 b(b)s(egin)g(with)g(a)g(`)p Ft(.)p |
9128f932 | 17273 | Fu(')g(\(hidden)f(\014les\))i(when)e(p)s(erforming)g(\014lename)1110 |
e59452c7 | 17274 | 2345 y(completion.)75 b(If)41 b(set)g(to)h(`)p Ft(off)p |
12beeabf | 17275 | Fu(',)i(the)e(leading)g(`)p Ft(.)p Fu(')f(m)m(ust)g(b)s(e)g(supplied)f |
e59452c7 | 17276 | (b)m(y)1110 2454 y(the)34 b(user)g(in)g(the)g(\014lename)g(to)h(b)s(e)f |
12beeabf | 17277 | (completed.)53 b(This)33 b(v)-5 b(ariable)35 b(is)f(`)p |
e59452c7 CR |
17278 | Ft(on)p Fu(')g(b)m(y)1110 2564 y(default.)630 2746 y |
17279 | Ft(menu-complete-display-pr)o(efix)1110 2856 y Fu(If)f(set)h(to)g(`)p | |
12beeabf | 17280 | Ft(on)p Fu(',)h(men)m(u)e(completion)i(displa)m(ys)e(the)h(common)g |
e59452c7 | 17281 | (pre\014x)e(of)i(the)1110 2966 y(list)k(of)g(p)s(ossible)f(completions) |
12beeabf | 17282 | i(\(whic)m(h)e(ma)m(y)h(b)s(e)f(empt)m(y\))i(b)s(efore)e(cycling)1110 |
e59452c7 CR |
17283 | 3075 y(through)30 b(the)g(list.)42 b(The)29 b(default)i(is)f(`)p |
17284 | Ft(off)p Fu('.)630 3258 y Ft(output-meta)1110 3367 y | |
12beeabf | 17285 | Fu(If)35 b(set)h(to)g(`)p Ft(on)p Fu(',)h(Readline)f(will)g(displa)m(y) |
e59452c7 | 17286 | f(c)m(haracters)i(with)e(the)h(eigh)m(th)g(bit)1110 3477 |
12beeabf | 17287 | y(set)h(directly)g(rather)f(than)g(as)h(a)g(meta-pre\014xed)f(escap)s |
e59452c7 | 17288 | (e)h(sequence.)59 b(The)1110 3587 y(default)26 b(is)f(`)p |
12beeabf CR |
17289 | Ft(off)p Fu(',)i(but)e(Readline)h(will)g(set)g(it)g(to)h(`)p |
17290 | Ft(on)p Fu(')e(if)h(the)f(lo)s(cale)j(con)m(tains)1110 | |
e59452c7 CR |
17291 | 3696 y(eigh)m(t-bit)k(c)m(haracters.)630 3879 y Ft(page-completions) |
17292 | 1110 3988 y Fu(If)h(set)i(to)f(`)p Ft(on)p Fu(',)h(Readline)g(uses)e | |
12beeabf | 17293 | (an)h(in)m(ternal)h Ft(more)p Fu(-lik)m(e)f(pager)g(to)h(displa)m(y) |
e59452c7 | 17294 | 1110 4098 y(a)e(screenful)f(of)g(p)s(ossible)g(completions)i(at)f(a)g |
12beeabf | 17295 | (time.)47 b(This)31 b(v)-5 b(ariable)34 b(is)e(`)p Ft(on)p |
e59452c7 CR |
17296 | Fu(')1110 4208 y(b)m(y)e(default.)630 4390 y Ft |
17297 | (print-completions-horizo)o(ntal)o(ly)1110 4500 y Fu(If)23 | |
12beeabf | 17298 | b(set)i(to)g(`)p Ft(on)p Fu(',)g(Readline)g(will)f(displa)m(y)g |
e59452c7 | 17299 | (completions)h(with)f(matc)m(hes)h(sorted)1110 4609 y(horizon)m(tally) |
12beeabf | 17300 | 45 b(in)e(alphab)s(etical)i(order,)i(rather)c(than)g(do)m(wn)g(the)h |
e59452c7 CR |
17301 | (screen.)1110 4719 y(The)30 b(default)g(is)h(`)p Ft(off)p |
17302 | Fu('.)630 4902 y Ft(revert-all-at-newline)1110 5011 y | |
12beeabf | 17303 | Fu(If)e(set)h(to)g(`)p Ft(on)p Fu(',)g(Readline)g(will)g(undo)f(all)h |
e59452c7 | 17304 | (c)m(hanges)h(to)f(history)g(lines)f(b)s(efore)1110 5121 |
12beeabf | 17305 | y(returning)f(when)f Ft(accept-line)f Fu(is)j(executed.)41 |
e59452c7 | 17306 | b(By)29 b(default,)g(history)g(lines)1110 5230 y(ma)m(y)42 |
a8fd3f3e | 17307 | b(b)s(e)g(mo)s(di\014ed)e(and)h(retain)i(individual)e(undo)g(lists)h |
e59452c7 CR |
17308 | (across)g(calls)h(to)1110 5340 y Ft(readline)p Fu(.)38 |
17309 | b(The)30 b(default)h(is)f(`)p Ft(off)p Fu('.)p eop end | |
fffe80d4 CR |
17310 | %%Page: 125 131 |
17311 | TeXDict begin 125 130 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17312 | b(Command)29 b(Line)i(Editing)2062 b(125)630 299 y Ft | |
e59452c7 CR |
17313 | (show-all-if-ambiguous)1110 408 y Fu(This)29 b(alters)i(the)f(default)g |
17314 | (b)s(eha)m(vior)g(of)g(the)h(completion)g(functions.)40 | |
17315 | b(If)29 b(set)1110 518 y(to)f(`)p Ft(on)p Fu(',)g(w)m(ords)f(whic)m(h)g | |
17316 | (ha)m(v)m(e)i(more)f(than)f(one)h(p)s(ossible)f(completion)h(cause)1110 | |
17317 | 628 y(the)39 b(matc)m(hes)h(to)g(b)s(e)e(listed)h(immediately)i | |
17318 | (instead)e(of)g(ringing)g(the)g(b)s(ell.)1110 737 y(The)30 | |
15baad62 | 17319 | b(default)g(v)-5 b(alue)31 b(is)g(`)p Ft(off)p Fu('.)630 |
e59452c7 | 17320 | 913 y Ft(show-all-if-unmodified)1110 1022 y Fu(This)38 |
15baad62 | 17321 | b(alters)h(the)g(default)g(b)s(eha)m(vior)g(of)f(the)h(completion)h |
e59452c7 | 17322 | (functions)e(in)h(a)1110 1132 y(fashion)25 b(similar)h(to)g |
15baad62 | 17323 | Fr(sho)m(w-all-if-am)m(biguous)p Fu(.)41 b(If)25 b(set)h(to)h(`)p |
e59452c7 | 17324 | Ft(on)p Fu(',)f(w)m(ords)f(whic)m(h)1110 1241 y(ha)m(v)m(e)32 |
15baad62 | 17325 | b(more)f(than)f(one)i(p)s(ossible)e(completion)i(without)f(an)m(y)g(p)s |
e59452c7 CR |
17326 | (ossible)f(par-)1110 1351 y(tial)43 b(completion)h(\(the)f(p)s(ossible) |
17327 | f(completions)h(don't)f(share)g(a)h(common)1110 1461 | |
15baad62 | 17328 | y(pre\014x\))30 b(cause)g(the)h(matc)m(hes)g(to)g(b)s(e)f(listed)g |
e59452c7 | 17329 | (immediately)i(instead)e(of)h(ring-)1110 1570 y(ing)g(the)f(b)s(ell.)41 |
15baad62 | 17330 | b(The)30 b(default)g(v)-5 b(alue)31 b(is)f(`)p Ft(off)p |
e59452c7 CR |
17331 | Fu('.)630 1745 y Ft(show-mode-in-prompt)1110 1855 y Fu(If)24 |
17332 | b(set)h(to)g(`)p Ft(on)p Fu(',)g(add)f(a)h(string)f(to)h(the)f(b)s | |
17333 | (eginning)g(of)g(the)h(prompt)e(indicating)1110 1965 | |
17334 | y(the)33 b(editing)h(mo)s(de:)46 b(emacs,)35 b(vi)e(command,)h(or)f(vi) | |
17335 | h(insertion.)49 b(The)32 b(mo)s(de)1110 2074 y(strings)45 | |
17336 | b(are)h(user-settable)g(\(e.g.,)51 b Fr(emacs-mo)s(de-string)8 | |
17337 | b Fu(\).)87 b(The)45 b(default)1110 2184 y(v)-5 b(alue)31 | |
17338 | b(is)f(`)p Ft(off)p Fu('.)630 2359 y Ft(skip-completed-text)1110 | |
17339 | 2469 y Fu(If)i(set)i(to)f(`)p Ft(on)p Fu(',)h(this)f(alters)g(the)g | |
17340 | (default)g(completion)h(b)s(eha)m(vior)f(when)f(in-)1110 | |
17341 | 2578 y(serting)d(a)h(single)g(matc)m(h)f(in)m(to)h(the)g(line.)40 | |
17342 | b(It's)30 b(only)f(activ)m(e)i(when)d(p)s(erform-)1110 | |
17343 | 2688 y(ing)35 b(completion)h(in)e(the)h(middle)f(of)h(a)f(w)m(ord.)53 | |
17344 | b(If)35 b(enabled,)g(readline)g(do)s(es)1110 2798 y(not)41 | |
17345 | b(insert)f(c)m(haracters)i(from)e(the)h(completion)h(that)f(matc)m(h)g | |
17346 | (c)m(haracters)1110 2907 y(after)c(p)s(oin)m(t)g(in)g(the)g(w)m(ord)f | |
17347 | (b)s(eing)g(completed,)k(so)d(p)s(ortions)f(of)h(the)g(w)m(ord)1110 | |
17348 | 3017 y(follo)m(wing)c(the)f(cursor)f(are)h(not)g(duplicated.)45 | |
17349 | b(F)-8 b(or)32 b(instance,)h(if)f(this)f(is)h(en-)1110 | |
17350 | 3126 y(abled,)43 b(attempting)f(completion)g(when)d(the)i(cursor)f(is)g | |
17351 | (after)h(the)g(`)p Ft(e)p Fu(')f(in)1110 3236 y(`)p Ft(Makefile)p | |
b729dac1 | 17352 | Fu(')c(will)i(result)f(in)g(`)p Ft(Makefile)p Fu(')f(rather)h(than)h(`) |
e59452c7 | 17353 | p Ft(Makefilefile)p Fu(',)1110 3345 y(assuming)d(there)g(is)h(a)f |
b729dac1 | 17354 | (single)h(p)s(ossible)f(completion.)56 b(The)35 b(default)g(v)-5 |
e59452c7 CR |
17355 | b(alue)1110 3455 y(is)30 b(`)p Ft(off)p Fu('.)630 3630 |
17356 | y Ft(vi-cmd-mode-string)1110 3740 y Fu(If)j(the)h Fr(sho)m(w-mo)s | |
879213c6 | 17357 | (de-in-prompt)h Fu(v)-5 b(ariable)35 b(is)e(enabled,)i(this)f(string)f |
e59452c7 | 17358 | (is)h(dis-)1110 3850 y(pla)m(y)m(ed)24 b(immediately)g(b)s(efore)f(the) |
879213c6 | 17359 | g(last)h(line)f(of)h(the)f(primary)f(prompt)g(when)1110 |
e59452c7 | 17360 | 3959 y(vi)32 b(editing)h(mo)s(de)f(is)g(activ)m(e)j(and)c(in)h(command) |
879213c6 | 17361 | g(mo)s(de.)46 b(The)31 b(v)-5 b(alue)33 b(is)f(ex-)1110 |
e59452c7 | 17362 | 4069 y(panded)26 b(lik)m(e)i(a)f(k)m(ey)h(binding,)e(so)i(the)f |
879213c6 | 17363 | (standard)f(set)h(of)g(meta-)h(and)e(con)m(trol)1110 |
e59452c7 | 17364 | 4178 y(pre\014xes)34 b(and)g(bac)m(kslash)i(escap)s(e)g(sequences)f(is) |
879213c6 | 17365 | g(a)m(v)-5 b(ailable.)57 b(Use)35 b(the)g(`)p Ft(\\1)p |
e59452c7 | 17366 | Fu(')1110 4288 y(and)23 b(`)p Ft(\\2)p Fu(')h(escap)s(es)h(to)f(b)s |
879213c6 | 17367 | (egin)g(and)f(end)g(sequences)i(of)f(non-prin)m(ting)f(c)m(harac-)1110 |
e59452c7 CR |
17368 | 4398 y(ters,)31 b(whic)m(h)g(can)g(b)s(e)f(used)g(to)h(em)m(b)s(ed)f(a) |
17369 | h(terminal)h(con)m(trol)g(sequence)f(in)m(to)1110 4507 | |
879213c6 | 17370 | y(the)g(mo)s(de)f(string.)40 b(The)30 b(default)h(is)f(`)p |
e59452c7 CR |
17371 | Ft(\(cmd\))p Fu('.)630 4682 y Ft(vi-ins-mode-string)1110 |
17372 | 4792 y Fu(If)j(the)h Fr(sho)m(w-mo)s(de-in-prompt)h Fu(v)-5 | |
879213c6 | 17373 | b(ariable)35 b(is)e(enabled,)i(this)f(string)f(is)h(dis-)1110 |
e59452c7 CR |
17374 | 4902 y(pla)m(y)m(ed)24 b(immediately)g(b)s(efore)f(the)g(last)h(line)f |
17375 | (of)h(the)f(primary)f(prompt)g(when)1110 5011 y(vi)35 | |
879213c6 | 17376 | b(editing)h(mo)s(de)e(is)i(activ)m(e)h(and)d(in)h(insertion)g(mo)s(de.) |
e59452c7 | 17377 | 54 b(The)35 b(v)-5 b(alue)35 b(is)g(ex-)1110 5121 y(panded)26 |
879213c6 | 17378 | b(lik)m(e)i(a)f(k)m(ey)h(binding,)e(so)i(the)f(standard)f(set)h(of)g |
e59452c7 | 17379 | (meta-)h(and)e(con)m(trol)1110 5230 y(pre\014xes)34 b(and)g(bac)m |
879213c6 | 17380 | (kslash)i(escap)s(e)g(sequences)f(is)g(a)m(v)-5 b(ailable.)57 |
e59452c7 | 17381 | b(Use)35 b(the)g(`)p Ft(\\1)p Fu(')1110 5340 y(and)23 |
879213c6 | 17382 | b(`)p Ft(\\2)p Fu(')h(escap)s(es)h(to)f(b)s(egin)g(and)f(end)g |
e59452c7 CR |
17383 | (sequences)i(of)f(non-prin)m(ting)f(c)m(harac-)p eop |
17384 | end | |
fffe80d4 CR |
17385 | %%Page: 126 132 |
17386 | TeXDict begin 126 131 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17387 | b(Command)29 b(Line)i(Editing)2062 b(126)1110 299 y(ters,)31 | |
e59452c7 CR |
17388 | b(whic)m(h)g(can)g(b)s(e)f(used)g(to)h(em)m(b)s(ed)f(a)h(terminal)h |
17389 | (con)m(trol)g(sequence)f(in)m(to)1110 408 y(the)g(mo)s(de)f(string.)40 | |
17390 | b(The)30 b(default)h(is)f(`)p Ft(\(ins\))p Fu('.)630 | |
17391 | 577 y Ft(visible-stats)1110 686 y Fu(If)h(set)i(to)f(`)p | |
17392 | Ft(on)p Fu(',)h(a)f(c)m(haracter)i(denoting)e(a)g(\014le's)g(t)m(yp)s | |
17393 | (e)g(is)g(app)s(ended)e(to)j(the)1110 796 y(\014lename)e(when)e | |
17394 | (listing)i(p)s(ossible)f(completions.)42 b(The)30 b(default)g(is)h(`)p | |
17395 | Ft(off)p Fu('.)150 964 y(Key)f(Bindings)630 1073 y(The)41 | |
17396 | b(syn)m(tax)i(for)f(con)m(trolling)h(k)m(ey)g(bindings)e(in)h(the)g | |
17397 | (init)g(\014le)g(is)g(simple.)75 b(First)43 b(y)m(ou)630 | |
17398 | 1183 y(need)27 b(to)i(\014nd)d(the)i(name)f(of)h(the)g(command)f(that)i | |
17399 | (y)m(ou)f(w)m(an)m(t)g(to)g(c)m(hange.)41 b(The)27 b(follo)m(wing)630 | |
17400 | 1292 y(sections)37 b(con)m(tain)g(tables)g(of)f(the)g(command)f(name,)j | |
17401 | (the)e(default)g(k)m(eybinding,)h(if)f(an)m(y)-8 b(,)630 | |
17402 | 1402 y(and)30 b(a)h(short)f(description)g(of)h(what)f(the)g(command)h | |
17403 | (do)s(es.)630 1541 y(Once)36 b(y)m(ou)g(kno)m(w)g(the)g(name)g(of)g | |
17404 | (the)g(command,)h(simply)f(place)h(on)e(a)i(line)f(in)g(the)g(init)630 | |
17405 | 1650 y(\014le)e(the)g(name)f(of)h(the)g(k)m(ey)g(y)m(ou)g(wish)f(to)h | |
17406 | (bind)f(the)h(command)f(to,)i(a)f(colon,)i(and)d(then)630 | |
17407 | 1760 y(the)f(name)h(of)f(the)g(command.)46 b(There)32 | |
220537f2 | 17408 | b(can)g(b)s(e)g(no)g(space)g(b)s(et)m(w)m(een)h(the)f(k)m(ey)h(name)g |
e59452c7 CR |
17409 | (and)630 1870 y(the)41 b(colon)h({)f(that)g(will)g(b)s(e)g(in)m |
17410 | (terpreted)g(as)g(part)f(of)h(the)g(k)m(ey)h(name.)72 | |
17411 | b(The)40 b(name)h(of)630 1979 y(the)35 b(k)m(ey)g(can)g(b)s(e)f | |
17412 | (expressed)f(in)i(di\013eren)m(t)g(w)m(a)m(ys,)h(dep)s(ending)d(on)h | |
17413 | (what)h(y)m(ou)g(\014nd)e(most)630 2089 y(comfortable.)630 | |
17414 | 2228 y(In)i(addition)h(to)h(command)f(names,)i(readline)e(allo)m(ws)h | |
17415 | (k)m(eys)g(to)g(b)s(e)e(b)s(ound)f(to)j(a)f(string)630 | |
17416 | 2337 y(that)31 b(is)f(inserted)h(when)e(the)i(k)m(ey)g(is)f(pressed)g | |
17417 | (\(a)h Fr(macro)5 b Fu(\).)630 2476 y(The)42 b Ft(bind)30 | |
17418 | b(-p)42 b Fu(command)h(displa)m(ys)g(Readline)g(function)g(names)g(and) | |
17419 | f(bindings)g(in)h(a)630 2586 y(format)37 b(that)h(can)f(put)f(directly) | |
17420 | i(in)m(to)g(an)f(initialization)j(\014le.)60 b(See)38 | |
17421 | b(Section)f(4.2)i([Bash)630 2695 y(Builtins],)31 b(page)g(54.)630 | |
17422 | 2863 y Fr(k)m(eyname)5 b Fu(:)42 b Fr(function-name)35 | |
17423 | b Fu(or)c Fr(macro)1110 2973 y(k)m(eyname)k Fu(is)29 | |
17424 | b(the)f(name)h(of)g(a)g(k)m(ey)h(sp)s(elled)e(out)h(in)g(English.)39 | |
17425 | b(F)-8 b(or)30 b(example:)1350 3112 y Ft(Control-u:)45 | |
17426 | b(universal-argument)1350 3221 y(Meta-Rubout:)f(backward-kill-word)1350 | |
17427 | 3331 y(Control-o:)h(">)i(output")1110 3470 y Fu(In)94 | |
17428 | b(the)g(example)h(ab)s(o)m(v)m(e,)112 b Fj(C-u)94 b Fu(is)g(b)s(ound)f | |
17429 | (to)i(the)f(function)1110 3579 y Ft(universal-argument)p | |
17430 | Fu(,)124 b Fj(M-DEL)107 b Fu(is)i(b)s(ound)e(to)j(the)f(function)1110 | |
17431 | 3689 y Ft(backward-kill-word)p Fu(,)75 b(and)69 b Fj(C-o)g | |
17432 | Fu(is)h(b)s(ound)e(to)j(run)d(the)i(macro)1110 3798 y(expressed)45 | |
17433 | b(on)h(the)g(righ)m(t)g(hand)e(side)i(\(that)h(is,)i(to)e(insert)e(the) | |
17434 | h(text)h(`)p Ft(>)1110 3908 y(output)p Fu(')29 b(in)m(to)i(the)g | |
17435 | (line\).)1110 4047 y(A)62 b(n)m(um)m(b)s(er)e(of)i(sym)m(b)s(olic)h(c)m | |
17436 | (haracter)g(names)f(are)g(recognized)h(while)1110 4156 | |
17437 | y(pro)s(cessing)40 b(this)f(k)m(ey)i(binding)e(syn)m(tax:)60 | |
17438 | b Fr(DEL)p Fu(,)42 b Fr(ESC)p Fu(,)g Fr(ESCAPE)p Fu(,)f | |
17439 | Fr(LFD)p Fu(,)1110 4266 y Fr(NEWLINE)p Fu(,)31 b Fr(RET)p | |
17440 | Fu(,)f Fr(RETURN)p Fu(,)g Fr(R)m(UBOUT)p Fu(,)h Fr(SP)-8 | |
17441 | b(A)m(CE)p Fu(,)31 b Fr(SPC)p Fu(,)e(and)h Fr(T)-8 b(AB)p | |
17442 | Fu(.)630 4434 y Ft(")p Fr(k)m(eyseq)r Ft(")p Fu(:)41 | |
17443 | b Fr(function-name)36 b Fu(or)30 b Fr(macro)1110 4544 | |
17444 | y(k)m(eyseq)k Fu(di\013ers)d(from)f Fr(k)m(eyname)37 | |
17445 | b Fu(ab)s(o)m(v)m(e)32 b(in)f(that)h(strings)f(denoting)g(an)g(en-)1110 | |
17446 | 4653 y(tire)j(k)m(ey)h(sequence)f(can)g(b)s(e)f(sp)s(eci\014ed,)h(b)m | |
17447 | (y)f(placing)i(the)f(k)m(ey)g(sequence)g(in)1110 4763 | |
17448 | y(double)29 b(quotes.)41 b(Some)29 b Fm(gnu)h Fu(Emacs)f(st)m(yle)i(k)m | |
17449 | (ey)f(escap)s(es)g(can)g(b)s(e)f(used,)g(as)1110 4872 | |
17450 | y(in)k(the)h(follo)m(wing)i(example,)f(but)e(the)h(sp)s(ecial)h(c)m | |
17451 | (haracter)g(names)f(are)g(not)1110 4982 y(recognized.)1350 | |
17452 | 5121 y Ft("\\C-u":)46 b(universal-argument)1350 5230 | |
17453 | y("\\C-x\\C-r":)f(re-read-init-file)1350 5340 y("\\e[11~":)g("Function) | |
17454 | h(Key)g(1")p eop end | |
fffe80d4 CR |
17455 | %%Page: 127 133 |
17456 | TeXDict begin 127 132 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17457 | b(Command)29 b(Line)i(Editing)2062 b(127)1110 299 y(In)64 | |
e59452c7 CR |
17458 | b(the)g(ab)s(o)m(v)m(e)i(example,)74 b Fj(C-u)64 b Fu(is)g(again)i(b)s |
17459 | (ound)c(to)k(the)e(function)1110 408 y Ft(universal-argument)39 | |
17460 | b Fu(\(just)k(as)h(it)g(w)m(as)g(in)g(the)f(\014rst)g(example\),)49 | |
17461 | b(`)p Fj(C-x)1110 518 y(C-r)p Fu(')30 b(is)g(b)s(ound)e(to)j(the)g | |
17462 | (function)f Ft(re-read-init-file)p Fu(,)c(and)j(`)p Ft(ESC)h([)g(1)g(1) | |
17463 | 1110 628 y(~)p Fu(')g(is)h(b)s(ound)d(to)j(insert)f(the)h(text)g(`)p | |
17464 | Ft(Function)e(Key)g(1)p Fu('.)630 780 y(The)g(follo)m(wing)i | |
6e51e0d0 | 17465 | Fm(gnu)f Fu(Emacs)g(st)m(yle)h(escap)s(e)f(sequences)g(are)g(a)m(v)-5 |
e59452c7 CR |
17466 | b(ailable)32 b(when)d(sp)s(ecifying)630 889 y(k)m(ey)i(sequences:)630 |
17467 | 1041 y Fj(\\C-)336 b Fu(con)m(trol)32 b(pre\014x)630 | |
17468 | 1193 y Fj(\\M-)336 b Fu(meta)31 b(pre\014x)630 1345 y | |
6e51e0d0 | 17469 | Fj(\\e)384 b Fu(an)30 b(escap)s(e)h(c)m(haracter)630 |
e59452c7 | 17470 | 1497 y Fj(\\\\)384 b Fu(bac)m(kslash)630 1648 y Fj(\\)p |
6e51e0d0 | 17471 | Ft(")g(")p Fu(,)30 b(a)h(double)f(quotation)i(mark)630 |
e59452c7 CR |
17472 | 1800 y Fj(\\')384 b Ft(')p Fu(,)30 b(a)h(single)g(quote)g(or)f(ap)s |
17473 | (ostrophe)630 1952 y(In)d(addition)h(to)g(the)g Fm(gnu)f | |
17474 | Fu(Emacs)h(st)m(yle)h(escap)s(e)f(sequences,)h(a)f(second)f(set)h(of)g | |
17475 | (bac)m(kslash)630 2062 y(escap)s(es)j(is)f(a)m(v)-5 b(ailable:)630 | |
17476 | 2214 y Ft(\\a)384 b Fu(alert)31 b(\(b)s(ell\))630 2366 | |
17477 | y Ft(\\b)384 b Fu(bac)m(kspace)630 2517 y Ft(\\d)g Fu(delete)630 | |
17478 | 2669 y Ft(\\f)g Fu(form)30 b(feed)630 2821 y Ft(\\n)384 | |
17479 | b Fu(newline)630 2973 y Ft(\\r)g Fu(carriage)32 b(return)630 | |
17480 | 3125 y Ft(\\t)384 b Fu(horizon)m(tal)32 b(tab)630 3277 | |
17481 | y Ft(\\v)384 b Fu(v)m(ertical)32 b(tab)630 3429 y Ft(\\)p | |
9128f932 CR |
17482 | Fj(nnn)288 b Fu(the)35 b(eigh)m(t-bit)h(c)m(haracter)g(whose)e(v)-5 |
17483 | b(alue)35 b(is)g(the)f(o)s(ctal)i(v)-5 b(alue)35 b Fr(nnn)e | |
e59452c7 | 17484 | Fu(\(one)i(to)1110 3538 y(three)c(digits\))630 3690 y |
9128f932 CR |
17485 | Ft(\\x)p Fj(HH)288 b Fu(the)38 b(eigh)m(t-bit)i(c)m(haracter)g(whose)e |
17486 | (v)-5 b(alue)39 b(is)f(the)h(hexadecimal)g(v)-5 b(alue)39 | |
e59452c7 CR |
17487 | b Fr(HH)1110 3800 y Fu(\(one)31 b(or)f(t)m(w)m(o)i(hex)e(digits\))630 |
17488 | 3952 y(When)37 b(en)m(tering)h(the)g(text)g(of)g(a)g(macro,)i(single)e | |
9128f932 | 17489 | (or)f(double)g(quotes)h(m)m(ust)f(b)s(e)g(used)f(to)630 |
e59452c7 | 17490 | 4061 y(indicate)23 b(a)e(macro)h(de\014nition.)38 b(Unquoted)21 |
9128f932 | 17491 | b(text)i(is)e(assumed)g(to)h(b)s(e)f(a)h(function)f(name.)38 |
e59452c7 | 17492 | b(In)630 4171 y(the)22 b(macro)f(b)s(o)s(dy)-8 b(,)23 |
9128f932 | 17493 | b(the)e(bac)m(kslash)h(escap)s(es)g(describ)s(ed)e(ab)s(o)m(v)m(e)j |
e59452c7 | 17494 | (are)e(expanded.)37 b(Bac)m(kslash)630 4280 y(will)j(quote)h(an)m(y)f |
9128f932 | 17495 | (other)g(c)m(haracter)i(in)d(the)i(macro)f(text,)k(including)39 |
6e51e0d0 | 17496 | b(`)p Ft(")p Fu(')h(and)g(`)p Ft(')p Fu('.)69 b(F)-8 |
e59452c7 | 17497 | b(or)630 4390 y(example,)28 b(the)e(follo)m(wing)h(binding)d(will)i |
6e51e0d0 | 17498 | (mak)m(e)h(`)p Fj(C-x)j Ft(\\)p Fu(')c(insert)f(a)h(single)h(`)p |
e59452c7 CR |
17499 | Ft(\\)p Fu(')f(in)m(to)g(the)g(line:)870 4521 y Ft("\\C-x\\\\":)45 |
17500 | b("\\\\")150 4712 y Fk(8.3.2)63 b(Conditional)41 b(Init)g(Constructs) | |
17501 | 150 4859 y Fu(Readline)c(implemen)m(ts)g(a)h(facilit)m(y)g(similar)f | |
278286c9 | 17502 | (in)g(spirit)f(to)i(the)f(conditional)h(compilation)g(features)f(of)150 |
e59452c7 | 17503 | 4969 y(the)31 b(C)f(prepro)s(cessor)g(whic)m(h)g(allo)m(ws)i(k)m(ey)g |
278286c9 | 17504 | (bindings)d(and)h(v)-5 b(ariable)32 b(settings)f(to)h(b)s(e)e(p)s |
e59452c7 | 17505 | (erformed)f(as)i(the)150 5079 y(result)f(of)h(tests.)41 |
278286c9 | 17506 | b(There)30 b(are)h(four)f(parser)f(directiv)m(es)j(used.)150 |
e59452c7 | 17507 | 5230 y Ft($if)336 b Fu(The)31 b Ft($if)f Fu(construct)i(allo)m(ws)h |
278286c9 | 17508 | (bindings)d(to)i(b)s(e)e(made)i(based)f(on)g(the)g(editing)h(mo)s(de,)g |
e59452c7 | 17509 | (the)630 5340 y(terminal)37 b(b)s(eing)f(used,)h(or)f(the)h |
879213c6 | 17510 | (application)g(using)f(Readline.)59 b(The)36 b(text)h(of)f(the)h(test,) |
e59452c7 | 17511 | p eop end |
fffe80d4 CR |
17512 | %%Page: 128 134 |
17513 | TeXDict begin 128 133 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17514 | b(Command)29 b(Line)i(Editing)2062 b(128)630 299 y(after)30 | |
e59452c7 CR |
17515 | b(an)m(y)g(comparison)g(op)s(erator,)g(extends)f(to)h(the)g(end)f(of)h |
17516 | (the)f(line;)i(unless)e(otherwise)630 408 y(noted,)i(no)f(c)m | |
17517 | (haracters)i(are)f(required)e(to)i(isolate)i(it.)630 | |
17518 | 555 y Ft(mode)288 b Fu(The)30 b Ft(mode=)e Fu(form)i(of)g(the)h | |
17519 | Ft($if)e Fu(directiv)m(e)j(is)e(used)f(to)i(test)g(whether)e(Read-)1110 | |
17520 | 664 y(line)44 b(is)f(in)g Ft(emacs)f Fu(or)h Ft(vi)g | |
17521 | Fu(mo)s(de.)79 b(This)42 b(ma)m(y)i(b)s(e)e(used)h(in)g(conjunction) | |
17522 | 1110 774 y(with)c(the)h(`)p Ft(set)29 b(keymap)p Fu(')38 | |
17523 | b(command,)k(for)d(instance,)j(to)e(set)g(bindings)e(in)1110 | |
17524 | 883 y(the)32 b Ft(emacs-standard)c Fu(and)j Ft(emacs-ctlx)d | |
17525 | Fu(k)m(eymaps)k(only)g(if)g(Readline)g(is)1110 993 y(starting)f(out)g | |
17526 | (in)f Ft(emacs)f Fu(mo)s(de.)630 1139 y Ft(term)288 b | |
6e51e0d0 | 17527 | Fu(The)26 b Ft(term=)g Fu(form)g(ma)m(y)i(b)s(e)e(used)g(to)i(include)f |
e59452c7 | 17528 | (terminal-sp)s(eci\014c)g(k)m(ey)h(bind-)1110 1249 y(ings,)38 |
6e51e0d0 | 17529 | b(p)s(erhaps)c(to)j(bind)e(the)h(k)m(ey)h(sequences)f(output)g(b)m(y)g |
e59452c7 | 17530 | (the)g(terminal's)1110 1358 y(function)24 b(k)m(eys.)39 |
6e51e0d0 | 17531 | b(The)23 b(w)m(ord)h(on)f(the)i(righ)m(t)f(side)g(of)g(the)g(`)p |
e59452c7 | 17532 | Ft(=)p Fu(')g(is)g(tested)h(against)1110 1468 y(b)s(oth)k(the)h(full)g |
6e51e0d0 | 17533 | (name)g(of)g(the)g(terminal)h(and)e(the)i(p)s(ortion)e(of)h(the)g |
e59452c7 | 17534 | (terminal)1110 1577 y(name)k(b)s(efore)f(the)g(\014rst)g(`)p |
6e51e0d0 | 17535 | Ft(-)p Fu('.)50 b(This)33 b(allo)m(ws)i Ft(sun)e Fu(to)h(matc)m(h)g(b)s |
e59452c7 CR |
17536 | (oth)f Ft(sun)g Fu(and)1110 1687 y Ft(sun-cmd)p Fu(,)c(for)h(instance.) |
17537 | 630 1833 y Ft(version)144 b Fu(The)44 b Ft(version)f | |
17538 | Fu(test)i(ma)m(y)h(b)s(e)e(used)f(to)j(p)s(erform)d(comparisons)i | |
17539 | (against)1110 1943 y(sp)s(eci\014c)c(Readline)i(v)m(ersions.)74 | |
17540 | b(The)42 b Ft(version)d Fu(expands)i(to)h(the)g(curren)m(t)1110 | |
17541 | 2052 y(Readline)25 b(v)m(ersion.)39 b(The)23 b(set)h(of)g(comparison)h | |
17542 | (op)s(erators)f(includes)f(`)p Ft(=)p Fu(')h(\(and)1110 | |
17543 | 2162 y(`)p Ft(==)p Fu('\),)33 b(`)p Ft(!=)p Fu(',)f(`)p | |
17544 | Ft(<=)p Fu(',)h(`)p Ft(>=)p Fu(',)f(`)p Ft(<)p Fu(',)h(and)e(`)p | |
17545 | Ft(>)p Fu('.)46 b(The)31 b(v)m(ersion)i(n)m(um)m(b)s(er)d(supplied)h | |
17546 | (on)1110 2271 y(the)j(righ)m(t)h(side)f(of)g(the)g(op)s(erator)g | |
17547 | (consists)h(of)f(a)g(ma)5 b(jor)35 b(v)m(ersion)f(n)m(um)m(b)s(er,)1110 | |
17548 | 2381 y(an)45 b(optional)i(decimal)f(p)s(oin)m(t,)k(and)44 | |
17549 | b(an)i(optional)g(minor)f(v)m(ersion)h(\(e.g.,)1110 2491 | |
9128f932 CR |
17550 | y(`)p Ft(7.1)p Fu('\).)40 b(If)27 b(the)h(minor)f(v)m(ersion)h(is)g |
17551 | (omitted,)h(it)f(is)g(assumed)f(to)h(b)s(e)f(`)p Ft(0)p | |
e59452c7 | 17552 | Fu('.)40 b(The)1110 2600 y(op)s(erator)34 b(ma)m(y)g(b)s(e)f(separated) |
9128f932 | 17553 | g(from)g(the)h(string)f Ft(version)f Fu(and)h(from)g(the)1110 |
e59452c7 | 17554 | 2710 y(v)m(ersion)39 b(n)m(um)m(b)s(er)f(argumen)m(t)h(b)m(y)f |
9128f932 | 17555 | (whitespace.)67 b(The)38 b(follo)m(wing)i(example)1110 |
e59452c7 | 17556 | 2819 y(sets)31 b(a)g(v)-5 b(ariable)31 b(if)f(the)h(Readline)g(v)m |
9128f932 | 17557 | (ersion)f(b)s(eing)g(used)g(is)g(7.0)i(or)e(new)m(er:)1350 |
e59452c7 CR |
17558 | 2947 y Ft($if)47 b(version)f(>=)h(7.0)1350 3057 y(set)g |
17559 | (show-mode-in-prompt)42 b(on)1350 3166 y($endif)630 3313 | |
17560 | y(application)1110 3422 y Fu(The)21 b Fr(application)j | |
9128f932 | 17561 | Fu(construct)e(is)g(used)f(to)i(include)f(application-sp)s(eci\014c)h |
e59452c7 | 17562 | (set-)1110 3532 y(tings.)39 b(Eac)m(h)26 b(program)e(using)g(the)h |
9128f932 | 17563 | (Readline)g(library)g(sets)g(the)g Fr(application)1110 |
e59452c7 | 17564 | 3641 y(name)p Fu(,)g(and)e(y)m(ou)g(can)h(test)g(for)f(a)g(particular)h |
9128f932 | 17565 | (v)-5 b(alue.)39 b(This)22 b(could)h(b)s(e)g(used)f(to)1110 |
e59452c7 CR |
17566 | 3751 y(bind)32 b(k)m(ey)h(sequences)g(to)h(functions)e(useful)g(for)h |
17567 | (a)g(sp)s(eci\014c)f(program.)48 b(F)-8 b(or)1110 3861 | |
9128f932 | 17568 | y(instance,)35 b(the)e(follo)m(wing)h(command)f(adds)f(a)i(k)m(ey)f |
e59452c7 CR |
17569 | (sequence)h(that)f(quotes)1110 3970 y(the)e(curren)m(t)f(or)g(previous) |
17570 | g(w)m(ord)g(in)g(Bash:)1350 4098 y Ft($if)47 b(Bash)1350 | |
17571 | 4208 y(#)g(Quote)g(the)g(current)f(or)h(previous)e(word)1350 | |
17572 | 4317 y("\\C-xq":)h("\\eb\\"\\ef\\"")1350 4427 y($endif)630 | |
17573 | 4573 y(variable)96 b Fu(The)33 b Fr(v)-5 b(ariable)39 | |
879213c6 | 17574 | b Fu(construct)33 b(pro)m(vides)g(simple)g(equalit)m(y)i(tests)e(for)g |
e59452c7 | 17575 | (Readline)1110 4682 y(v)-5 b(ariables)32 b(and)f(v)-5 |
879213c6 | 17576 | b(alues.)45 b(The)32 b(p)s(ermitted)f(comparison)h(op)s(erators)f(are)i |
e59452c7 | 17577 | (`)p Ft(=)p Fu(',)1110 4792 y(`)p Ft(==)p Fu(',)49 b(and)44 |
879213c6 | 17578 | b(`)p Ft(!=)p Fu('.)85 b(The)44 b(v)-5 b(ariable)46 b(name)f(m)m(ust)g |
e59452c7 | 17579 | (b)s(e)g(separated)g(from)g(the)1110 4902 y(comparison)25 |
879213c6 | 17580 | b(op)s(erator)g(b)m(y)g(whitespace;)j(the)d(op)s(erator)g(ma)m(y)g(b)s |
e59452c7 | 17581 | (e)f(separated)1110 5011 y(from)33 b(the)h(v)-5 b(alue)35 |
879213c6 | 17582 | b(on)f(the)g(righ)m(t)g(hand)f(side)h(b)m(y)f(whitespace.)52 |
e59452c7 | 17583 | b(Both)35 b(string)1110 5121 y(and)i(b)s(o)s(olean)g(v)-5 |
879213c6 | 17584 | b(ariables)38 b(ma)m(y)h(b)s(e)d(tested.)63 b(Bo)s(olean)39 |
e59452c7 | 17585 | b(v)-5 b(ariables)38 b(m)m(ust)g(b)s(e)1110 5230 y(tested)46 |
879213c6 CR |
17586 | b(against)g(the)f(v)-5 b(alues)46 b Fr(on)f Fu(and)f |
17587 | Fr(o\013)p Fu(.)85 b(The)45 b(follo)m(wing)h(example)g(is)1110 | |
e59452c7 CR |
17588 | 5340 y(equiv)-5 b(alen)m(t)32 b(to)f(the)f Ft(mode=emacs)e |
17589 | Fu(test)j(describ)s(ed)f(ab)s(o)m(v)m(e:)p eop end | |
fffe80d4 CR |
17590 | %%Page: 129 135 |
17591 | TeXDict begin 129 134 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17592 | b(Command)29 b(Line)i(Editing)2062 b(129)1350 299 y Ft($if)47 | |
e59452c7 CR |
17593 | b(editing-mode)d(==)k(emacs)1350 408 y(set)f(show-mode-in-prompt)42 |
17594 | b(on)1350 518 y($endif)150 677 y($endif)192 b Fu(This)29 | |
17595 | b(command,)i(as)f(seen)h(in)f(the)g(previous)g(example,)h(terminates)g | |
17596 | (an)g Ft($if)e Fu(command.)150 837 y Ft($else)240 b Fu(Commands)29 | |
17597 | b(in)h(this)h(branc)m(h)e(of)i(the)f Ft($if)g Fu(directiv)m(e)i(are)f | |
17598 | (executed)g(if)f(the)h(test)g(fails.)150 996 y Ft($include)96 | |
17599 | b Fu(This)43 b(directiv)m(e)i(tak)m(es)g(a)e(single)i(\014lename)e(as)h | |
17600 | (an)f(argumen)m(t)h(and)f(reads)g(commands)630 1106 y(and)38 | |
17601 | b(bindings)f(from)h(that)i(\014le.)65 b(F)-8 b(or)39 | |
17602 | b(example,)j(the)d(follo)m(wing)h(directiv)m(e)g(reads)e(from)630 | |
17603 | 1215 y Ft(/etc/inputrc)p Fu(:)870 1350 y Ft($include)46 | |
17604 | b(/etc/inputrc)150 1549 y Fk(8.3.3)63 b(Sample)41 b(Init)g(File)150 | |
17605 | 1696 y Fu(Here)27 b(is)f(an)h(example)g(of)f(an)h Fr(inputrc)k | |
17606 | Fu(\014le.)39 b(This)26 b(illustrates)h(k)m(ey)h(binding,)e(v)-5 | |
17607 | b(ariable)27 b(assignmen)m(t,)i(and)150 1806 y(conditional)j(syn)m | |
17608 | (tax.)p eop end | |
fffe80d4 CR |
17609 | %%Page: 130 136 |
17610 | TeXDict begin 130 135 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17611 | b(Command)29 b(Line)i(Editing)2062 b(130)390 408 y Ft(#)47 | |
278286c9 CR |
17612 | b(This)g(file)g(controls)e(the)i(behaviour)e(of)j(line)e(input)h |
17613 | (editing)e(for)390 518 y(#)i(programs)f(that)h(use)g(the)f(GNU)h | |
17614 | (Readline)f(library.)93 b(Existing)390 628 y(#)47 b(programs)f(include) | |
17615 | g(FTP,)g(Bash,)h(and)g(GDB.)390 737 y(#)390 847 y(#)g(You)g(can)g | |
17616 | (re-read)f(the)h(inputrc)f(file)g(with)h(C-x)g(C-r.)390 | |
17617 | 956 y(#)g(Lines)g(beginning)e(with)i('#')g(are)g(comments.)390 | |
d76edd30 CR |
17618 | 1066 y(#)390 1176 y(#)g(First,)g(include)e(any)i(system-wide)e |
17619 | (bindings)h(and)g(variable)390 1285 y(#)h(assignments)e(from)i | |
17620 | (/etc/Inputrc)390 1395 y($include)f(/etc/Inputrc)390 | |
17621 | 1614 y(#)390 1724 y(#)h(Set)g(various)f(bindings)g(for)h(emacs)f(mode.) | |
17622 | 390 1943 y(set)h(editing-mode)d(emacs)390 2162 y($if)j(mode=emacs)390 | |
5e13499c CR |
17623 | 2381 y(Meta-Control-h:)91 b(backward-kill-word)43 b(Text)k(after)f(the) |
17624 | h(function)f(name)g(is)h(ignored)390 2600 y(#)390 2710 | |
17625 | y(#)g(Arrow)g(keys)f(in)i(keypad)e(mode)390 2819 y(#)390 | |
17626 | 2929 y(#"\\M-OD":)379 b(backward-char)390 3039 y(#"\\M-OC":)g | |
17627 | (forward-char)390 3148 y(#"\\M-OA":)g(previous-history)390 | |
17628 | 3258 y(#"\\M-OB":)g(next-history)390 3367 y(#)390 3477 | |
17629 | y(#)47 b(Arrow)g(keys)f(in)i(ANSI)e(mode)390 3587 y(#)390 | |
17630 | 3696 y("\\M-[D":)380 b(backward-char)390 3806 y("\\M-[C":)g | |
17631 | (forward-char)390 3915 y("\\M-[A":)g(previous-history)390 | |
17632 | 4025 y("\\M-[B":)g(next-history)390 4134 y(#)390 4244 | |
17633 | y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(keypad)f(mode)390 | |
17634 | 4354 y(#)390 4463 y(#"\\M-\\C-OD":)331 b(backward-char)390 | |
17635 | 4573 y(#"\\M-\\C-OC":)g(forward-char)390 4682 y(#"\\M-\\C-OA":)g | |
17636 | (previous-history)390 4792 y(#"\\M-\\C-OB":)g(next-history)390 | |
17637 | 4902 y(#)390 5011 y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(ANSI)g(mode) | |
17638 | 390 5121 y(#)390 5230 y(#"\\M-\\C-[D":)331 b(backward-char)390 | |
37c41ab1 | 17639 | 5340 y(#"\\M-\\C-[C":)g(forward-char)p eop end |
fffe80d4 CR |
17640 | %%Page: 131 137 |
17641 | TeXDict begin 131 136 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17642 | b(Command)29 b(Line)i(Editing)2062 b(131)390 299 y Ft(#"\\M-\\C-[A":) | |
ad4aef08 | 17643 | 331 b(previous-history)390 408 y(#"\\M-\\C-[B":)g(next-history)390 |
37c41ab1 CR |
17644 | 628 y(C-q:)47 b(quoted-insert)390 847 y($endif)390 1066 |
17645 | y(#)g(An)h(old-style)d(binding.)93 b(This)47 b(happens)f(to)h(be)g(the) | |
17646 | g(default.)390 1176 y(TAB:)g(complete)390 1395 y(#)g(Macros)g(that)f | |
17647 | (are)h(convenient)e(for)i(shell)f(interaction)390 1504 | |
17648 | y($if)h(Bash)390 1614 y(#)g(edit)g(the)g(path)390 1724 | |
17649 | y("\\C-xp":)f("PATH=${PATH}\\e\\C-e\\C-a)o(\\ef)o(\\C-f)o(")390 | |
17650 | 1833 y(#)h(prepare)f(to)h(type)g(a)h(quoted)e(word)g(--)390 | |
5e13499c CR |
17651 | 1943 y(#)h(insert)g(open)f(and)h(close)f(double)h(quotes)390 |
17652 | 2052 y(#)g(and)g(move)g(to)g(just)g(after)f(the)h(open)g(quote)390 | |
17653 | 2162 y("\\C-x\\"":)e("\\"\\"\\C-b")390 2271 y(#)i(insert)g(a)g | |
17654 | (backslash)e(\(testing)h(backslash)f(escapes)390 2381 | |
17655 | y(#)i(in)h(sequences)d(and)i(macros\))390 2491 y("\\C-x\\\\":)e("\\\\") | |
17656 | 390 2600 y(#)i(Quote)g(the)g(current)f(or)h(previous)e(word)390 | |
17657 | 2710 y("\\C-xq":)h("\\eb\\"\\ef\\"")390 2819 y(#)h(Add)g(a)h(binding)e | |
17658 | (to)h(refresh)f(the)h(line,)f(which)g(is)h(unbound)390 | |
17659 | 2929 y("\\C-xr":)f(redraw-current-line)390 3039 y(#)h(Edit)g(variable)f | |
17660 | (on)h(current)f(line.)390 3148 y("\\M-\\C-v":)f | |
17661 | ("\\C-a\\C-k$\\C-y\\M-\\C-e\\C-)o(a\\C-)o(y=")390 3258 | |
17662 | y($endif)390 3477 y(#)i(use)g(a)h(visible)e(bell)g(if)h(one)g(is)h | |
17663 | (available)390 3587 y(set)f(bell-style)e(visible)390 | |
17664 | 3806 y(#)i(don't)g(strip)f(characters)f(to)i(7)h(bits)e(when)h(reading) | |
17665 | 390 3915 y(set)g(input-meta)e(on)390 4134 y(#)i(allow)g(iso-latin1)e | |
17666 | (characters)g(to)i(be)g(inserted)f(rather)390 4244 y(#)h(than)g | |
17667 | (converted)e(to)j(prefix-meta)c(sequences)390 4354 y(set)j | |
17668 | (convert-meta)d(off)390 4573 y(#)j(display)f(characters)f(with)i(the)g | |
17669 | (eighth)f(bit)h(set)g(directly)390 4682 y(#)g(rather)g(than)f(as)h | |
17670 | (meta-prefixed)e(characters)390 4792 y(set)i(output-meta)e(on)390 | |
e6983002 CR |
17671 | 5011 y(#)i(if)h(there)e(are)h(150)g(or)g(more)g(possible)e(completions) |
17672 | g(for)i(a)g(word,)390 5121 y(#)g(ask)g(whether)f(or)h(not)g(the)g(user) | |
17673 | g(wants)f(to)h(see)g(all)g(of)g(them)390 5230 y(set)g | |
37c41ab1 | 17674 | (completion-query-items)42 b(150)p eop end |
fffe80d4 CR |
17675 | %%Page: 132 138 |
17676 | TeXDict begin 132 137 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17677 | b(Command)29 b(Line)i(Editing)2062 b(132)390 299 y Ft(#)47 | |
278286c9 | 17678 | b(For)g(FTP)390 408 y($if)g(Ftp)390 518 y("\\C-xg":)f("get)g(\\M-?")390 |
5e13499c | 17679 | 628 y("\\C-xt":)g("put)g(\\M-?")390 737 y("\\M-.":)g(yank-last-arg)390 |
124d67cd CR |
17680 | 847 y($endif)150 1089 y Fs(8.4)68 b(Bindable)45 b(Readline)i(Commands) |
17681 | 150 1248 y Fu(This)32 b(section)h(describ)s(es)f(Readline)h(commands)f | |
c302751c | 17682 | (that)h(ma)m(y)h(b)s(e)d(b)s(ound)g(to)i(k)m(ey)g(sequences.)48 |
124d67cd | 17683 | b(Y)-8 b(ou)33 b(can)150 1358 y(list)40 b(y)m(our)f(k)m(ey)i(bindings)d |
6e51e0d0 | 17684 | (b)m(y)h(executing)i Ft(bind)29 b(-P)39 b Fu(or,)j(for)d(a)h(more)g |
124d67cd | 17685 | (terse)g(format,)i(suitable)e(for)f(an)150 1468 y Fr(inputrc)34 |
6e51e0d0 | 17686 | b Fu(\014le,)29 b Ft(bind)g(-p)p Fu(.)40 b(\(See)30 b(Section)f(4.2)h |
e59452c7 | 17687 | ([Bash)g(Builtins],)g(page)g(54.\))41 b(Command)28 b(names)h(without) |
124d67cd CR |
17688 | 150 1577 y(an)h(accompan)m(ying)i(k)m(ey)f(sequence)g(are)g(un)m(b)s |
17689 | (ound)d(b)m(y)i(default.)275 1713 y(In)25 b(the)h(follo)m(wing)i | |
6e51e0d0 CR |
17690 | (descriptions,)f Fr(p)s(oin)m(t)h Fu(refers)e(to)h(the)f(curren)m(t)g |
17691 | (cursor)g(p)s(osition,)h(and)f Fr(mark)31 b Fu(refers)150 | |
124d67cd | 17692 | 1822 y(to)40 b(a)f(cursor)f(p)s(osition)h(sa)m(v)m(ed)h(b)m(y)f(the)g |
6e51e0d0 | 17693 | Ft(set-mark)d Fu(command.)66 b(The)38 b(text)i(b)s(et)m(w)m(een)g(the)f |
124d67cd CR |
17694 | (p)s(oin)m(t)g(and)150 1932 y(mark)30 b(is)h(referred)e(to)i(as)g(the)f |
17695 | Fr(region)p Fu(.)150 2132 y Fk(8.4.1)63 b(Commands)42 | |
17696 | b(F)-10 b(or)41 b(Mo)m(ving)150 2304 y Ft(beginning-of-line)26 | |
17697 | b(\(C-a\))630 2414 y Fu(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f | |
17698 | (curren)m(t)g(line.)150 2574 y Ft(end-of-line)d(\(C-e\))630 | |
17699 | 2684 y Fu(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
17700 | 2844 y Ft(forward-char)c(\(C-f\))630 2954 y Fu(Mo)m(v)m(e)32 | |
17701 | b(forw)m(ard)e(a)h(c)m(haracter.)150 3114 y Ft(backward-char)c(\(C-b\)) | |
17702 | 630 3223 y Fu(Mo)m(v)m(e)32 b(bac)m(k)g(a)e(c)m(haracter.)150 | |
17703 | 3384 y Ft(forward-word)d(\(M-f\))630 3493 y Fu(Mo)m(v)m(e)32 | |
5e13499c | 17704 | b(forw)m(ard)e(to)h(the)f(end)g(of)g(the)h(next)f(w)m(ord.)41 |
37c41ab1 | 17705 | b(W)-8 b(ords)30 b(are)h(comp)s(osed)f(of)g(letters)i(and)630 |
124d67cd CR |
17706 | 3603 y(digits.)150 3763 y Ft(backward-word)27 b(\(M-b\))630 |
17707 | 3873 y Fu(Mo)m(v)m(e)36 b(bac)m(k)e(to)g(the)g(start)g(of)g(the)g | |
37c41ab1 | 17708 | (curren)m(t)f(or)g(previous)g(w)m(ord.)50 b(W)-8 b(ords)34 |
124d67cd | 17709 | b(are)g(comp)s(osed)630 3982 y(of)d(letters)g(and)f(digits.)150 |
602eae4d CR |
17710 | 4143 y Ft(shell-forward-word)25 b(\(M-C-f\))630 4252 |
17711 | y Fu(Mo)m(v)m(e)30 b(forw)m(ard)e(to)h(the)f(end)f(of)h(the)h(next)f(w) | |
17712 | m(ord.)40 b(W)-8 b(ords)28 b(are)g(delimited)h(b)m(y)f(non-quoted)630 | |
124d67cd | 17713 | 4362 y(shell)j(metac)m(haracters.)150 4522 y Ft(shell-backward-word)25 |
602eae4d CR |
17714 | b(\(M-C-b\))630 4632 y Fu(Mo)m(v)m(e)37 b(bac)m(k)e(to)h(the)f(start)g |
17715 | (of)g(the)g(curren)m(t)g(or)f(previous)h(w)m(ord.)53 | |
17716 | b(W)-8 b(ords)35 b(are)g(delimited)630 4741 y(b)m(y)30 | |
17717 | b(non-quoted)h(shell)f(metac)m(haracters.)150 4902 y | |
17718 | Ft(previous-screen-line)25 b(\(\))630 5011 y Fu(A)m(ttempt)41 | |
17719 | b(to)g(mo)m(v)m(e)h(p)s(oin)m(t)e(to)h(the)f(same)h(ph)m(ysical)g | |
17720 | (screen)f(column)g(on)g(the)g(previous)630 5121 y(ph)m(ysical)26 | |
17721 | b(screen)f(line.)39 b(This)24 b(will)i(not)f(ha)m(v)m(e)h(the)f | |
17722 | (desired)g(e\013ect)h(if)f(the)h(curren)m(t)e(Readline)630 | |
17723 | 5230 y(line)k(do)s(es)f(not)g(tak)m(e)i(up)d(more)i(than)f(one)g(ph)m | |
17724 | (ysical)h(line)g(or)f(if)g(p)s(oin)m(t)h(is)f(not)h(greater)g(than)630 | |
17725 | 5340 y(the)j(length)f(of)h(the)f(prompt)g(plus)f(the)i(screen)f(width.) | |
17726 | p eop end | |
fffe80d4 CR |
17727 | %%Page: 133 139 |
17728 | TeXDict begin 133 138 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17729 | b(Command)29 b(Line)i(Editing)2062 b(133)150 299 y Ft(next-screen-line) | |
124d67cd CR |
17730 | 26 b(\(\))630 408 y Fu(A)m(ttempt)g(to)f(mo)m(v)m(e)i(p)s(oin)m(t)d(to) |
17731 | i(the)e(same)i(ph)m(ysical)f(screen)g(column)f(on)h(the)f(next)h(ph)m | |
17732 | (ysical)630 518 y(screen)e(line.)39 b(This)23 b(will)g(not)h(ha)m(v)m | |
17733 | (e)h(the)e(desired)g(e\013ect)i(if)e(the)g(curren)m(t)h(Readline)g | |
17734 | (line)f(do)s(es)630 628 y(not)k(tak)m(e)i(up)e(more)g(than)g(one)g(ph)m | |
17735 | (ysical)h(line)g(or)f(if)g(the)h(length)f(of)h(the)f(curren)m(t)g | |
17736 | (Readline)630 737 y(line)k(is)f(not)h(greater)g(than)f(the)h(length)g | |
17737 | (of)f(the)h(prompt)e(plus)h(the)g(screen)h(width.)150 | |
e6983002 | 17738 | 916 y Ft(clear-display)c(\(M-C-l\))630 1026 y Fu(Clear)33 |
d37a4722 | 17739 | b(the)g(screen)g(and,)h(if)e(p)s(ossible,)i(the)f(terminal's)g |
e6983002 | 17740 | (scrollbac)m(k)i(bu\013er,)e(then)f(redra)m(w)630 1136 |
d37a4722 | 17741 | y(the)f(curren)m(t)f(line,)h(lea)m(ving)h(the)e(curren)m(t)h(line)f(at) |
e6983002 CR |
17742 | h(the)g(top)g(of)f(the)h(screen.)150 1315 y Ft(clear-screen)c(\(C-l\)) |
17743 | 630 1424 y Fu(Clear)35 b(the)f(screen,)i(then)e(redra)m(w)g(the)h | |
d37a4722 | 17744 | (curren)m(t)f(line,)i(lea)m(ving)g(the)f(curren)m(t)f(line)h(at)g(the) |
e6983002 CR |
17745 | 630 1534 y(top)c(of)f(the)h(screen.)150 1713 y Ft(redraw-current-line) |
17746 | 25 b(\(\))630 1823 y Fu(Refresh)30 b(the)g(curren)m(t)h(line.)41 | |
17747 | b(By)30 b(default,)h(this)f(is)h(un)m(b)s(ound.)150 2041 | |
d37a4722 | 17748 | y Fk(8.4.2)63 b(Commands)42 b(F)-10 b(or)41 b(Manipulating)h(The)f |
e6983002 CR |
17749 | (History)150 2223 y Ft(accept-line)27 b(\(Newline)h(or)i(Return\))630 |
17750 | 2333 y Fu(Accept)25 b(the)e(line)h(regardless)g(of)f(where)g(the)h | |
d37a4722 | 17751 | (cursor)e(is.)39 b(If)23 b(this)g(line)h(is)f(non-empt)m(y)-8 |
e6983002 | 17752 | b(,)26 b(add)c(it)630 2442 y(to)27 b(the)f(history)g(list)h(according)g |
d37a4722 | 17753 | (to)g(the)f(setting)i(of)e(the)g Ft(HISTCONTROL)d Fu(and)j |
e6983002 | 17754 | Ft(HISTIGNORE)630 2552 y Fu(v)-5 b(ariables.)42 b(If)30 |
d37a4722 | 17755 | b(this)h(line)g(is)g(a)g(mo)s(di\014ed)e(history)i(line,)g(then)f |
e6983002 CR |
17756 | (restore)i(the)f(history)f(line)h(to)630 2662 y(its)g(original)g |
17757 | (state.)150 2841 y Ft(previous-history)26 b(\(C-p\))630 | |
17758 | 2950 y Fu(Mo)m(v)m(e)32 b(`bac)m(k')g(through)e(the)g(history)h(list,)g | |
17759 | (fetc)m(hing)g(the)g(previous)f(command.)150 3129 y Ft(next-history)d | |
17760 | (\(C-n\))630 3239 y Fu(Mo)m(v)m(e)32 b(`forw)m(ard')f(through)e(the)i | |
d37a4722 | 17761 | (history)f(list,)i(fetc)m(hing)f(the)g(next)f(command.)150 |
e6983002 | 17762 | 3418 y Ft(beginning-of-history)25 b(\(M-<\))630 3528 |
d37a4722 | 17763 | y Fu(Mo)m(v)m(e)32 b(to)g(the)e(\014rst)g(line)g(in)h(the)f(history)-8 |
e6983002 | 17764 | b(.)150 3707 y Ft(end-of-history)26 b(\(M->\))630 3816 |
d37a4722 CR |
17765 | y Fu(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(input)e(history)-8 |
17766 | b(,)31 b(i.e.,)h(the)f(line)f(curren)m(tly)h(b)s(eing)f(en)m(tered.)150 | |
e6983002 | 17767 | 3995 y Ft(reverse-search-history)24 b(\(C-r\))630 4105 |
d37a4722 CR |
17768 | y Fu(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g(the)f(curren)m(t)g |
17769 | (line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g(his-)630 | |
e6983002 CR |
17770 | 4215 y(tory)26 b(as)h(necessary)-8 b(.)40 b(This)25 b(is)i(an)f |
17771 | (incremen)m(tal)h(searc)m(h.)40 b(This)25 b(command)h(sets)h(the)f | |
17772 | (region)630 4324 y(to)31 b(the)g(matc)m(hed)g(text)g(and)f(activ)-5 | |
17773 | b(ates)33 b(the)d(mark.)150 4503 y Ft(forward-search-history)24 | |
17774 | b(\(C-s\))630 4613 y Fu(Searc)m(h)44 b(forw)m(ard)f(starting)h(at)h | |
d37a4722 | 17775 | (the)e(curren)m(t)h(line)g(and)f(mo)m(ving)h(`do)m(wn')g(through)f(the) |
e6983002 CR |
17776 | 630 4723 y(history)38 b(as)g(necessary)-8 b(.)65 b(This)38 |
17777 | b(is)g(an)g(incremen)m(tal)h(searc)m(h.)65 b(This)37 | |
17778 | b(command)h(sets)h(the)630 4832 y(region)31 b(to)g(the)g(matc)m(hed)g | |
17779 | (text)g(and)f(activ)-5 b(ates)33 b(the)d(mark.)150 5011 | |
17780 | y Ft(non-incremental-reverse-)o(sear)o(ch-h)o(ist)o(ory)24 | |
17781 | b(\(M-p\))630 5121 y Fu(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g | |
37c41ab1 | 17782 | (the)f(curren)m(t)g(line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g |
e6983002 | 17783 | (his-)630 5230 y(tory)36 b(as)g(necessary)h(using)e(a)i(non-incremen)m |
d37a4722 | 17784 | (tal)g(searc)m(h)f(for)g(a)g(string)g(supplied)f(b)m(y)h(the)630 |
e6983002 CR |
17785 | 5340 y(user.)k(The)30 b(searc)m(h)h(string)f(ma)m(y)h(matc)m(h)g(an)m |
17786 | (ywhere)g(in)f(a)h(history)f(line.)p eop end | |
fffe80d4 CR |
17787 | %%Page: 134 140 |
17788 | TeXDict begin 134 139 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17789 | b(Command)29 b(Line)i(Editing)2062 b(134)150 299 y Ft | |
e6983002 CR |
17790 | (non-incremental-forward-)o(sear)o(ch-h)o(ist)o(ory)24 |
17791 | b(\(M-n\))630 408 y Fu(Searc)m(h)44 b(forw)m(ard)f(starting)h(at)h(the) | |
17792 | e(curren)m(t)h(line)g(and)f(mo)m(ving)h(`do)m(wn')g(through)f(the)630 | |
17793 | 518 y(history)27 b(as)f(necessary)i(using)e(a)h(non-incremen)m(tal)g | |
17794 | (searc)m(h)h(for)e(a)h(string)g(supplied)e(b)m(y)i(the)630 | |
17795 | 628 y(user.)40 b(The)30 b(searc)m(h)h(string)f(ma)m(y)h(matc)m(h)g(an)m | |
17796 | (ywhere)g(in)f(a)h(history)f(line.)150 784 y Ft(history-search-forward) | |
17797 | 24 b(\(\))630 894 y Fu(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i | |
17798 | (history)f(for)g(the)h(string)f(of)h(c)m(haracters)h(b)s(et)m(w)m(een)f | |
17799 | (the)630 1003 y(start)36 b(of)h(the)f(curren)m(t)f(line)i(and)e(the)h | |
17800 | (p)s(oin)m(t.)58 b(The)35 b(searc)m(h)i(string)e(m)m(ust)h(matc)m(h)h | |
17801 | (at)g(the)630 1113 y(b)s(eginning)32 b(of)g(a)h(history)g(line.)47 | |
17802 | b(This)32 b(is)h(a)f(non-incremen)m(tal)i(searc)m(h.)48 | |
17803 | b(By)33 b(default,)g(this)630 1223 y(command)d(is)h(un)m(b)s(ound.)150 | |
17804 | 1379 y Ft(history-search-backward)24 b(\(\))630 1489 | |
17805 | y Fu(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f(the)h(history)g(for)g | |
17806 | (the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m(een)g(the)630 | |
17807 | 1598 y(start)g(of)h(the)f(curren)m(t)f(line)i(and)e(the)h(p)s(oin)m(t.) | |
d37a4722 | 17808 | 58 b(The)35 b(searc)m(h)i(string)e(m)m(ust)h(matc)m(h)h(at)g(the)630 |
e6983002 | 17809 | 1708 y(b)s(eginning)32 b(of)g(a)h(history)g(line.)47 |
d37a4722 | 17810 | b(This)32 b(is)h(a)f(non-incremen)m(tal)i(searc)m(h.)48 |
e6983002 CR |
17811 | b(By)33 b(default,)g(this)630 1817 y(command)d(is)h(un)m(b)s(ound.)150 |
17812 | 1974 y Ft(history-substring-search)o(-for)o(ward)24 b(\(\))630 | |
17813 | 2084 y Fu(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i(history)f(for)g | |
74d0116b | 17814 | (the)h(string)f(of)h(c)m(haracters)h(b)s(et)m(w)m(een)f(the)630 |
e6983002 | 17815 | 2193 y(start)29 b(of)g(the)g(curren)m(t)g(line)g(and)f(the)h(p)s(oin)m |
74d0116b | 17816 | (t.)40 b(The)29 b(searc)m(h)g(string)g(ma)m(y)g(matc)m(h)h(an)m(ywhere) |
e6983002 | 17817 | 630 2303 y(in)i(a)h(history)g(line.)47 b(This)32 b(is)g(a)h |
124d67cd | 17818 | (non-incremen)m(tal)h(searc)m(h.)47 b(By)33 b(default,)h(this)e |
e6983002 | 17819 | (command)630 2412 y(is)e(un)m(b)s(ound.)150 2569 y Ft |
124d67cd | 17820 | (history-substring-search)o(-bac)o(kwar)o(d)24 b(\(\))630 |
e6983002 | 17821 | 2679 y Fu(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f(the)h(history)g |
124d67cd | 17822 | (for)g(the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m(een)g(the)630 |
e6983002 | 17823 | 2788 y(start)29 b(of)g(the)g(curren)m(t)g(line)g(and)f(the)h(p)s(oin)m |
124d67cd | 17824 | (t.)40 b(The)29 b(searc)m(h)g(string)g(ma)m(y)g(matc)m(h)h(an)m(ywhere) |
e6983002 | 17825 | 630 2898 y(in)i(a)h(history)g(line.)47 b(This)32 b(is)g(a)h |
124d67cd | 17826 | (non-incremen)m(tal)h(searc)m(h.)47 b(By)33 b(default,)h(this)e |
e6983002 CR |
17827 | (command)630 3007 y(is)e(un)m(b)s(ound.)150 3164 y Ft(yank-nth-arg)d |
17828 | (\(M-C-y\))630 3273 y Fu(Insert)37 b(the)g(\014rst)f(argumen)m(t)i(to)f | |
124d67cd | 17829 | (the)h(previous)e(command)h(\(usually)g(the)g(second)g(w)m(ord)630 |
e6983002 | 17830 | 3383 y(on)32 b(the)g(previous)f(line\))i(at)f(p)s(oin)m(t.)46 |
124d67cd | 17831 | b(With)32 b(an)g(argumen)m(t)g Fr(n)p Fu(,)g(insert)g(the)g |
e6983002 | 17832 | Fr(n)p Fu(th)f(w)m(ord)g(from)630 3493 y(the)k(previous)f(command)h |
124d67cd | 17833 | (\(the)g(w)m(ords)g(in)f(the)h(previous)g(command)f(b)s(egin)h(with)f |
e6983002 | 17834 | (w)m(ord)630 3602 y(0\).)69 b(A)40 b(negativ)m(e)h(argumen)m(t)f |
124d67cd | 17835 | (inserts)g(the)f Fr(n)p Fu(th)g(w)m(ord)g(from)g(the)h(end)f(of)h(the)f |
e6983002 | 17836 | (previous)630 3712 y(command.)48 b(Once)33 b(the)g(argumen)m(t)h |
124d67cd | 17837 | Fr(n)e Fu(is)h(computed,)h(the)f(argumen)m(t)g(is)g(extracted)i(as)e |
e6983002 CR |
17838 | (if)630 3821 y(the)e(`)p Ft(!)p Fj(n)p Fu(')f(history)g(expansion)g |
17839 | (had)g(b)s(een)g(sp)s(eci\014ed.)150 3978 y Ft(yank-last-arg)d(\(M-.)i | |
17840 | (or)h(M-_\))630 4088 y Fu(Insert)k(last)i(argumen)m(t)g(to)g(the)f | |
124d67cd | 17841 | (previous)f(command)h(\(the)h(last)f(w)m(ord)g(of)g(the)g(previous)630 |
e6983002 | 17842 | 4197 y(history)e(en)m(try\).)51 b(With)34 b(a)g(n)m(umeric)g(argumen)m |
6e51e0d0 | 17843 | (t,)h(b)s(eha)m(v)m(e)f(exactly)h(lik)m(e)g Ft(yank-nth-arg)p |
e6983002 | 17844 | Fu(.)630 4307 y(Successiv)m(e)26 b(calls)g(to)f Ft(yank-last-arg)c |
6e51e0d0 | 17845 | Fu(mo)m(v)m(e)27 b(bac)m(k)e(through)f(the)h(history)g(list,)i |
e6983002 | 17846 | (inserting)630 4416 y(the)c(last)g(w)m(ord)f(\(or)h(the)g(w)m(ord)f(sp) |
278286c9 | 17847 | s(eci\014ed)g(b)m(y)g(the)h(argumen)m(t)g(to)g(the)g(\014rst)f(call\))i |
e6983002 | 17848 | (of)f(eac)m(h)h(line)630 4526 y(in)36 b(turn.)58 b(An)m(y)36 |
278286c9 | 17849 | b(n)m(umeric)h(argumen)m(t)f(supplied)g(to)h(these)g(successiv)m(e)g |
e6983002 | 17850 | (calls)h(determines)630 4635 y(the)d(direction)g(to)h(mo)m(v)m(e)g |
278286c9 | 17851 | (through)e(the)h(history)-8 b(.)54 b(A)35 b(negativ)m(e)i(argumen)m(t)e |
e6983002 | 17852 | (switc)m(hes)h(the)630 4745 y(direction)23 b(through)g(the)g(history)f |
278286c9 | 17853 | (\(bac)m(k)i(or)f(forw)m(ard\).)38 b(The)22 b(history)h(expansion)g |
e6983002 | 17854 | (facilities)630 4855 y(are)28 b(used)f(to)h(extract)h(the)f(last)g |
6e51e0d0 | 17855 | (argumen)m(t,)h(as)e(if)h(the)g(`)p Ft(!$)p Fu(')f(history)g(expansion) |
e6983002 CR |
17856 | h(had)f(b)s(een)630 4964 y(sp)s(eci\014ed.)150 5121 y |
17857 | Ft(operate-and-get-next)e(\(C-o\))630 5230 y Fu(Accept)30 | |
d37a4722 | 17858 | b(the)g(curren)m(t)e(line)i(for)f(return)f(to)h(the)h(calling)g |
e6983002 | 17859 | (application)h(as)e(if)g(a)h(newline)f(had)630 5340 y(b)s(een)22 |
d37a4722 | 17860 | b(en)m(tered,)k(and)d(fetc)m(h)h(the)f(next)g(line)h(relativ)m(e)h(to)f |
e6983002 | 17861 | (the)f(curren)m(t)g(line)h(from)f(the)g(history)p eop |
d37a4722 | 17862 | end |
fffe80d4 CR |
17863 | %%Page: 135 141 |
17864 | TeXDict begin 135 140 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17865 | b(Command)29 b(Line)i(Editing)2062 b(135)630 299 y(for)31 | |
e6983002 CR |
17866 | b(editing.)43 b(A)31 b(n)m(umeric)f(argumen)m(t,)i(if)f(supplied,)f(sp) |
17867 | s(eci\014es)h(the)g(history)f(en)m(try)i(to)f(use)630 | |
e59452c7 CR |
17868 | 408 y(instead)g(of)f(the)h(curren)m(t)f(line.)150 565 |
17869 | y Ft(fetch-history)d(\(\))630 675 y Fu(With)e(a)f(n)m(umeric)g(argumen) | |
17870 | m(t,)i(fetc)m(h)f(that)g(en)m(try)f(from)g(the)g(history)g(list)h(and)e | |
17871 | (mak)m(e)i(it)g(the)630 784 y(curren)m(t)30 b(line.)41 | |
17872 | b(Without)30 b(an)g(argumen)m(t,)h(mo)m(v)m(e)g(bac)m(k)g(to)f(the)g | |
17873 | (\014rst)f(en)m(try)h(in)g(the)g(history)630 894 y(list.)150 | |
17874 | 1090 y Fk(8.4.3)63 b(Commands)42 b(F)-10 b(or)41 b(Changing)g(T)-10 | |
17875 | b(ext)150 1261 y Fj(end-of-file)27 b Ft(\(usually)h(C-d\))630 | |
17876 | 1370 y Fu(The)e(c)m(haracter)h(indicating)h(end-of-\014le)e(as)h(set,)g | |
e6983002 | 17877 | (for)f(example,)i(b)m(y)e Ft(stty)p Fu(.)39 b(If)25 b(this)h(c)m |
e59452c7 | 17878 | (harac-)630 1480 y(ter)c(is)g(read)g(when)e(there)i(are)h(no)e(c)m |
e6983002 | 17879 | (haracters)j(on)d(the)h(line,)i(and)d(p)s(oin)m(t)h(is)g(at)h(the)f(b)s |
e59452c7 | 17880 | (eginning)630 1590 y(of)31 b(the)f(line,)h(Readline)g(in)m(terprets)g |
e6983002 | 17881 | (it)g(as)f(the)h(end)f(of)g(input)f(and)h(returns)f Fm(eof)p |
e59452c7 | 17882 | Fu(.)150 1746 y Ft(delete-char)e(\(C-d\))630 1856 y Fu(Delete)35 |
c61bfbfd | 17883 | b(the)f(c)m(haracter)h(at)f(p)s(oin)m(t.)49 b(If)33 b(this)g(function)g |
e59452c7 | 17884 | (is)g(b)s(ound)e(to)j(the)g(same)f(c)m(haracter)630 1966 |
c61bfbfd CR |
17885 | y(as)e(the)f(tt)m(y)i Fm(eof)d Fu(c)m(haracter,)j(as)f |
17886 | Fj(C-d)e Fu(commonly)i(is,)g(see)g(ab)s(o)m(v)m(e)h(for)e(the)g | |
e59452c7 CR |
17887 | (e\013ects.)150 2122 y Ft(backward-delete-char)25 b(\(Rubout\))630 |
17888 | 2232 y Fu(Delete)32 b(the)f(c)m(haracter)g(b)s(ehind)e(the)h(cursor.)40 | |
d37a4722 | 17889 | b(A)30 b(n)m(umeric)g(argumen)m(t)h(means)f(to)h(kill)g(the)630 |
e59452c7 CR |
17890 | 2341 y(c)m(haracters)h(instead)e(of)h(deleting)g(them.)150 |
17891 | 2498 y Ft(forward-backward-delete-)o(char)24 b(\(\))630 | |
17892 | 2608 y Fu(Delete)40 b(the)f(c)m(haracter)h(under)c(the)j(cursor,)h | |
37c41ab1 | 17893 | (unless)d(the)i(cursor)e(is)h(at)h(the)g(end)e(of)i(the)630 |
e59452c7 | 17894 | 2717 y(line,)33 b(in)e(whic)m(h)g(case)i(the)f(c)m(haracter)h(b)s |
d37a4722 | 17895 | (ehind)d(the)i(cursor)f(is)g(deleted.)46 b(By)32 b(default,)g(this)630 |
e59452c7 CR |
17896 | 2827 y(is)e(not)h(b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 |
17897 | 2983 y Ft(quoted-insert)27 b(\(C-q)i(or)h(C-v\))630 3093 | |
6e51e0d0 | 17898 | y Fu(Add)j(the)i(next)f(c)m(haracter)i(t)m(yp)s(ed)e(to)h(the)f(line)h |
37c41ab1 | 17899 | (v)m(erbatim.)53 b(This)33 b(is)i(ho)m(w)f(to)h(insert)f(k)m(ey)630 |
e59452c7 CR |
17900 | 3203 y(sequences)d(lik)m(e)g Fj(C-q)p Fu(,)f(for)g(example.)150 |
17901 | 3359 y Ft(self-insert)d(\(a,)j(b,)g(A,)f(1,)h(!,)g(...)o(\))630 | |
17902 | 3469 y Fu(Insert)g(y)m(ourself.)150 3626 y Ft(bracketed-paste-begin)25 | |
17903 | b(\(\))630 3735 y Fu(This)f(function)h(is)f(in)m(tended)h(to)h(b)s(e)e | |
124d67cd | 17904 | (b)s(ound)f(to)i(the)g Ft(")p Fu(brac)m(k)m(eted)h(paste)p |
e59452c7 | 17905 | Ft(")f Fu(escap)s(e)h(sequence)630 3845 y(sen)m(t)38 |
124d67cd CR |
17906 | b(b)m(y)f(some)h(terminals,)i(and)d(suc)m(h)g(a)h(binding)e(is)i |
17907 | (assigned)f(b)m(y)h(default.)62 b(It)38 b(allo)m(ws)630 | |
e59452c7 | 17908 | 3954 y(Readline)33 b(to)g(insert)g(the)f(pasted)h(text)g(as)g(a)g |
124d67cd | 17909 | (single)g(unit)f(without)h(treating)h(eac)m(h)f(c)m(har-)630 |
e59452c7 | 17910 | 4064 y(acter)40 b(as)f(if)g(it)g(had)f(b)s(een)g(read)h(from)f(the)h(k) |
124d67cd | 17911 | m(eyb)s(oard.)66 b(The)39 b(c)m(haracters)h(are)f(inserted)630 |
e59452c7 | 17912 | 4173 y(as)44 b(if)g(eac)m(h)i(one)e(w)m(as)g(b)s(ound)e(to)j |
12beeabf | 17913 | Ft(self-insert)c Fu(instead)j(of)h(executing)g(an)m(y)f(editing)630 |
e59452c7 | 17914 | 4283 y(commands.)630 4416 y(Brac)m(k)m(eted)38 b(paste)f(sets)f(the)h |
e6983002 | 17915 | (region)f(\(the)h(c)m(haracters)g(b)s(et)m(w)m(een)g(p)s(oin)m(t)f(and) |
e59452c7 | 17916 | g(the)g(mark\))630 4526 y(to)j(the)g(inserted)f(text.)65 |
e6983002 | 17917 | b(It)39 b(uses)f(the)g(concept)h(of)g(an)f Fl(active)i(mark)10 |
e59452c7 | 17918 | b Fu(:)57 b(when)38 b(the)g(mark)630 4635 y(is)d(activ)m(e,)k(Readline) |
e6983002 | 17919 | c(redispla)m(y)h(uses)e(the)h(terminal's)h(standout)f(mo)s(de)f(to)i |
e59452c7 CR |
17920 | (denote)g(the)630 4745 y(region.)150 4902 y Ft(transpose-chars)26 |
17921 | b(\(C-t\))630 5011 y Fu(Drag)33 b(the)f(c)m(haracter)h(b)s(efore)f(the) | |
e6983002 | 17922 | g(cursor)f(forw)m(ard)h(o)m(v)m(er)h(the)f(c)m(haracter)i(at)e(the)g |
e59452c7 | 17923 | (cursor,)630 5121 y(mo)m(ving)k(the)g(cursor)f(forw)m(ard)g(as)g(w)m |
e6983002 | 17924 | (ell.)57 b(If)35 b(the)h(insertion)g(p)s(oin)m(t)f(is)g(at)i(the)e(end) |
e59452c7 | 17925 | g(of)h(the)630 5230 y(line,)24 b(then)e(this)g(transp)s(oses)f(the)h |
e6983002 | 17926 | (last)h(t)m(w)m(o)g(c)m(haracters)g(of)f(the)h(line.)38 |
e59452c7 CR |
17927 | b(Negativ)m(e)25 b(argumen)m(ts)630 5340 y(ha)m(v)m(e)32 |
17928 | b(no)e(e\013ect.)p eop end | |
fffe80d4 CR |
17929 | %%Page: 136 142 |
17930 | TeXDict begin 136 141 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17931 | b(Command)29 b(Line)i(Editing)2062 b(136)150 299 y Ft(transpose-words) | |
e59452c7 CR |
17932 | 26 b(\(M-t\))630 408 y Fu(Drag)33 b(the)g(w)m(ord)f(b)s(efore)g(p)s |
17933 | (oin)m(t)g(past)g(the)h(w)m(ord)f(after)g(p)s(oin)m(t,)i(mo)m(ving)f(p) | |
17934 | s(oin)m(t)f(past)g(that)630 518 y(w)m(ord)c(as)h(w)m(ell.)41 | |
17935 | b(If)27 b(the)i(insertion)f(p)s(oin)m(t)h(is)f(at)h(the)g(end)e(of)i | |
17936 | (the)f(line,)i(this)e(transp)s(oses)g(the)630 628 y(last)j(t)m(w)m(o)h | |
17937 | (w)m(ords)e(on)g(the)h(line.)150 797 y Ft(upcase-word)c(\(M-u\))630 | |
17938 | 907 y Fu(Upp)s(ercase)32 b(the)g(curren)m(t)g(\(or)g(follo)m(wing\))i | |
17939 | (w)m(ord.)45 b(With)32 b(a)g(negativ)m(e)j(argumen)m(t,)e(upp)s(er-)630 | |
17940 | 1016 y(case)e(the)g(previous)f(w)m(ord,)g(but)g(do)g(not)h(mo)m(v)m(e)h | |
17941 | (the)e(cursor.)150 1186 y Ft(downcase-word)d(\(M-l\))630 | |
17942 | 1296 y Fu(Lo)m(w)m(ercase)c(the)f(curren)m(t)f(\(or)h(follo)m(wing\))i | |
17943 | (w)m(ord.)37 b(With)22 b(a)g(negativ)m(e)i(argumen)m(t,)g(lo)m(w)m | |
17944 | (ercase)630 1405 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f(mo)m | |
17945 | (v)m(e)i(the)f(cursor.)150 1575 y Ft(capitalize-word)26 | |
17946 | b(\(M-c\))630 1684 y Fu(Capitalize)d(the)f(curren)m(t)f(\(or)g(follo)m | |
e6983002 | 17947 | (wing\))i(w)m(ord.)38 b(With)21 b(a)h(negativ)m(e)h(argumen)m(t,)h |
e59452c7 CR |
17948 | (capitalize)630 1794 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f |
17949 | (mo)m(v)m(e)i(the)f(cursor.)150 1964 y Ft(overwrite-mode)26 | |
17950 | b(\(\))630 2073 y Fu(T)-8 b(oggle)35 b(o)m(v)m(erwrite)g(mo)s(de.)48 | |
a9fac3b2 | 17951 | b(With)33 b(an)g(explicit)h(p)s(ositiv)m(e)g(n)m(umeric)f(argumen)m(t,) |
e59452c7 | 17952 | h(switc)m(hes)630 2183 y(to)22 b(o)m(v)m(erwrite)i(mo)s(de.)37 |
a9fac3b2 | 17953 | b(With)22 b(an)g(explicit)h(non-p)s(ositiv)m(e)f(n)m(umeric)g(argumen)m |
e59452c7 | 17954 | (t,)i(switc)m(hes)e(to)630 2292 y(insert)30 b(mo)s(de.)41 |
6e51e0d0 | 17955 | b(This)30 b(command)h(a\013ects)h(only)e Ft(emacs)f Fu(mo)s(de;)i |
e59452c7 | 17956 | Ft(vi)f Fu(mo)s(de)g(do)s(es)g(o)m(v)m(erwrite)630 2402 |
a9fac3b2 | 17957 | y(di\013eren)m(tly)-8 b(.)42 b(Eac)m(h)31 b(call)h(to)f |
d37a4722 | 17958 | Ft(readline\(\))c Fu(starts)k(in)f(insert)g(mo)s(de.)630 |
e59452c7 | 17959 | 2541 y(In)52 b(o)m(v)m(erwrite)h(mo)s(de,)58 b(c)m(haracters)c(b)s |
d37a4722 | 17960 | (ound)c(to)j Ft(self-insert)c Fu(replace)k(the)g(text)g(at)630 |
e59452c7 | 17961 | 2651 y(p)s(oin)m(t)59 b(rather)f(than)h(pushing)e(the)i(text)g(to)h |
d37a4722 | 17962 | (the)f(righ)m(t.)126 b(Characters)59 b(b)s(ound)d(to)630 |
e59452c7 CR |
17963 | 2761 y Ft(backward-delete-char)25 b Fu(replace)31 b(the)g(c)m(haracter) |
17964 | h(b)s(efore)e(p)s(oin)m(t)g(with)g(a)h(space.)630 2900 | |
d37a4722 | 17965 | y(By)g(default,)f(this)h(command)f(is)g(un)m(b)s(ound.)150 |
e59452c7 CR |
17966 | 3110 y Fk(8.4.4)63 b(Killing)42 b(And)e(Y)-10 b(anking)150 |
17967 | 3287 y Ft(kill-line)28 b(\(C-k\))630 3396 y Fu(Kill)k(the)f(text)i | |
7a257517 CR |
17968 | (from)d(p)s(oin)m(t)i(to)g(the)f(end)g(of)g(the)h(line.)44 |
17969 | b(With)31 b(a)h(negativ)m(e)i(n)m(umeric)d(argu-)630 | |
e59452c7 | 17970 | 3506 y(men)m(t,)g(kill)g(bac)m(kw)m(ard)g(from)f(the)g(cursor)g(to)h |
7a257517 | 17971 | (the)g(b)s(eginning)e(of)i(the)g(curren)m(t)f(line.)150 |
e59452c7 CR |
17972 | 3675 y Ft(backward-kill-line)25 b(\(C-x)30 b(Rubout\))630 |
17973 | 3785 y Fu(Kill)40 b(bac)m(kw)m(ard)h(from)e(the)h(cursor)g(to)g(the)g | |
7a257517 | 17974 | (b)s(eginning)g(of)g(the)g(curren)m(t)f(line.)70 b(With)41 |
e59452c7 | 17975 | b(a)630 3895 y(negativ)m(e)47 b(n)m(umeric)e(argumen)m(t,)50 |
7a257517 | 17976 | b(kill)c(forw)m(ard)e(from)h(the)g(cursor)g(to)h(the)f(end)f(of)i(the) |
e59452c7 CR |
17977 | 630 4004 y(curren)m(t)30 b(line.)150 4174 y Ft(unix-line-discard)c |
17978 | (\(C-u\))630 4283 y Fu(Kill)31 b(bac)m(kw)m(ard)g(from)e(the)i(cursor)f | |
7a257517 | 17979 | (to)h(the)f(b)s(eginning)g(of)h(the)f(curren)m(t)g(line.)150 |
e59452c7 | 17980 | 4453 y Ft(kill-whole-line)c(\(\))630 4562 y Fu(Kill)37 |
7a257517 CR |
17981 | b(all)g(c)m(haracters)h(on)f(the)f(curren)m(t)h(line,)h(no)f(matter)g |
17982 | (where)f(p)s(oin)m(t)h(is.)59 b(By)36 b(default,)630 | |
e59452c7 CR |
17983 | 4672 y(this)30 b(is)h(un)m(b)s(ound.)150 4842 y Ft(kill-word)d(\(M-d\)) |
17984 | 630 4951 y Fu(Kill)i(from)f(p)s(oin)m(t)g(to)h(the)g(end)e(of)i(the)f | |
7a257517 | 17985 | (curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)h |
e59452c7 | 17986 | (the)g(end)630 5061 y(of)h(the)f(next)h(w)m(ord.)40 b(W)-8 |
7a257517 | 17987 | b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f Ft(forward-word)p |
e59452c7 CR |
17988 | Fu(.)150 5230 y Ft(backward-kill-word)25 b(\(M-DEL\))630 |
17989 | 5340 y Fu(Kill)k(the)g(w)m(ord)g(b)s(ehind)e(p)s(oin)m(t.)40 | |
7a257517 | 17990 | b(W)-8 b(ord)29 b(b)s(oundaries)f(are)h(the)g(same)g(as)g |
e59452c7 | 17991 | Ft(backward-word)p Fu(.)p eop end |
fffe80d4 CR |
17992 | %%Page: 137 143 |
17993 | TeXDict begin 137 142 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
17994 | b(Command)29 b(Line)i(Editing)2062 b(137)150 299 y Ft(shell-kill-word) | |
e59452c7 CR |
17995 | 26 b(\(M-C-d\))630 408 y Fu(Kill)k(from)f(p)s(oin)m(t)g(to)h(the)g(end) |
17996 | e(of)i(the)f(curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m(w)m(een)g(w)m | |
17997 | (ords,)f(to)h(the)g(end)630 518 y(of)h(the)f(next)h(w)m(ord.)40 | |
17998 | b(W)-8 b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f | |
17999 | Ft(shell-forward-word)p Fu(.)150 692 y Ft(shell-backward-kill-word)24 | |
18000 | b(\(\))630 801 y Fu(Kill)e(the)h(w)m(ord)e(b)s(ehind)g(p)s(oin)m(t.)38 | |
a9fac3b2 | 18001 | b(W)-8 b(ord)22 b(b)s(oundaries)f(are)h(the)g(same)h(as)f |
e59452c7 CR |
18002 | Ft(shell-backward-)630 911 y(word)p Fu(.)150 1084 y Ft |
18003 | (shell-transpose-words)j(\(M-C-t\))630 1194 y Fu(Drag)33 | |
602eae4d CR |
18004 | b(the)g(w)m(ord)f(b)s(efore)g(p)s(oin)m(t)g(past)g(the)h(w)m(ord)f |
18005 | (after)g(p)s(oin)m(t,)i(mo)m(ving)f(p)s(oin)m(t)f(past)g(that)630 | |
e59452c7 | 18006 | 1304 y(w)m(ord)c(as)h(w)m(ell.)41 b(If)27 b(the)i(insertion)f(p)s(oin)m |
602eae4d | 18007 | (t)h(is)f(at)h(the)g(end)e(of)i(the)f(line,)i(this)e(transp)s(oses)g |
e59452c7 | 18008 | (the)630 1413 y(last)j(t)m(w)m(o)h(w)m(ords)d(on)i(the)f(line.)41 |
602eae4d | 18009 | b(W)-8 b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)f(as)h |
e59452c7 CR |
18010 | Ft(shell-forward-)630 1523 y(word)e Fu(and)h Ft(shell-backward-word)p |
18011 | Fu(.)150 1696 y Ft(unix-word-rubout)c(\(C-w\))630 1806 | |
602eae4d CR |
18012 | y Fu(Kill)32 b(the)g(w)m(ord)f(b)s(ehind)f(p)s(oin)m(t,)i(using)f |
18013 | (white)h(space)g(as)g(a)g(w)m(ord)f(b)s(oundary)-8 b(.)43 | |
e59452c7 CR |
18014 | b(The)31 b(killed)630 1915 y(text)g(is)g(sa)m(v)m(ed)g(on)g(the)f |
18015 | (kill-ring.)150 2089 y Ft(unix-filename-rubout)25 b(\(\))630 | |
18016 | 2199 y Fu(Kill)37 b(the)f(w)m(ord)g(b)s(ehind)f(p)s(oin)m(t,)j(using)e | |
e6983002 | 18017 | (white)g(space)h(and)f(the)g(slash)g(c)m(haracter)i(as)f(the)630 |
e59452c7 CR |
18018 | 2308 y(w)m(ord)30 b(b)s(oundaries.)39 b(The)30 b(killed)h(text)g(is)g |
18019 | (sa)m(v)m(ed)g(on)g(the)f(kill-ring.)150 2482 y Ft | |
18020 | (delete-horizontal-space)24 b(\(\))630 2591 y Fu(Delete)33 | |
e6983002 | 18021 | b(all)e(spaces)g(and)e(tabs)i(around)e(p)s(oin)m(t.)41 |
e59452c7 CR |
18022 | b(By)31 b(default,)f(this)h(is)f(un)m(b)s(ound.)150 2765 |
18023 | y Ft(kill-region)d(\(\))630 2874 y Fu(Kill)k(the)f(text)i(in)e(the)g | |
e6983002 | 18024 | (curren)m(t)h(region.)41 b(By)31 b(default,)f(this)h(command)f(is)g(un) |
e59452c7 CR |
18025 | m(b)s(ound.)150 3048 y Ft(copy-region-as-kill)25 b(\(\))630 |
18026 | 3158 y Fu(Cop)m(y)34 b(the)g(text)h(in)f(the)g(region)g(to)h(the)f | |
e6983002 | 18027 | (kill)h(bu\013er,)f(so)g(it)h(can)f(b)s(e)f(y)m(ank)m(ed)i(righ)m(t)f |
e59452c7 CR |
18028 | (a)m(w)m(a)m(y)-8 b(.)630 3267 y(By)31 b(default,)f(this)h(command)f |
18029 | (is)g(un)m(b)s(ound.)150 3441 y Ft(copy-backward-word)25 | |
18030 | b(\(\))630 3550 y Fu(Cop)m(y)38 b(the)h(w)m(ord)f(b)s(efore)g(p)s(oin)m | |
d37a4722 | 18031 | (t)g(to)i(the)e(kill)h(bu\013er.)64 b(The)38 b(w)m(ord)g(b)s(oundaries) |
e59452c7 | 18032 | f(are)i(the)630 3660 y(same)31 b(as)f Ft(backward-word)p |
d37a4722 | 18033 | Fu(.)38 b(By)30 b(default,)h(this)f(command)g(is)h(un)m(b)s(ound.)150 |
e59452c7 | 18034 | 3833 y Ft(copy-forward-word)26 b(\(\))630 3943 y Fu(Cop)m(y)31 |
124d67cd CR |
18035 | b(the)g(w)m(ord)g(follo)m(wing)h(p)s(oin)m(t)f(to)h(the)f(kill)h |
18036 | (bu\013er.)42 b(The)30 b(w)m(ord)h(b)s(oundaries)e(are)j(the)630 | |
e59452c7 | 18037 | 4053 y(same)f(as)f Ft(forward-word)p Fu(.)38 b(By)30 |
602eae4d | 18038 | b(default,)h(this)g(command)f(is)g(un)m(b)s(ound.)150 |
e59452c7 | 18039 | 4226 y Ft(yank)f(\(C-y\))630 4336 y Fu(Y)-8 b(ank)31 |
602eae4d | 18040 | b(the)f(top)h(of)g(the)f(kill)h(ring)f(in)m(to)i(the)e(bu\013er)g(at)h |
e59452c7 | 18041 | (p)s(oin)m(t.)150 4509 y Ft(yank-pop)d(\(M-y\))630 4619 |
602eae4d CR |
18042 | y Fu(Rotate)36 b(the)f(kill-ring,)i(and)d(y)m(ank)h(the)f(new)g(top.)54 |
18043 | b(Y)-8 b(ou)35 b(can)g(only)f(do)h(this)f(if)h(the)g(prior)630 | |
e59452c7 CR |
18044 | 4728 y(command)30 b(is)h Ft(yank)e Fu(or)h Ft(yank-pop)p |
18045 | Fu(.)150 4942 y Fk(8.4.5)63 b(Sp)s(ecifying)42 b(Numeric)f(Argumen)m | |
18046 | (ts)150 5121 y Ft(digit-argument)26 b(\()p Fj(M-0)p Ft(,)j | |
18047 | Fj(M-1)p Ft(,)h(...)f Fj(M--)p Ft(\))630 5230 y Fu(Add)d(this)h(digit)g | |
124d67cd | 18048 | (to)h(the)f(argumen)m(t)g(already)h(accum)m(ulating,)h(or)e(start)h(a)f |
e59452c7 CR |
18049 | (new)f(argumen)m(t.)630 5340 y Fj(M--)j Fu(starts)i(a)g(negativ)m(e)i |
18050 | (argumen)m(t.)p eop end | |
fffe80d4 CR |
18051 | %%Page: 138 144 |
18052 | TeXDict begin 138 143 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18053 | b(Command)29 b(Line)i(Editing)2062 b(138)150 299 y Ft | |
e59452c7 CR |
18054 | (universal-argument)25 b(\(\))630 408 y Fu(This)g(is)g(another)h(w)m(a) |
18055 | m(y)g(to)h(sp)s(ecify)e(an)g(argumen)m(t.)40 b(If)25 | |
18056 | b(this)g(command)h(is)f(follo)m(w)m(ed)i(b)m(y)f(one)630 | |
18057 | 518 y(or)k(more)f(digits,)i(optionally)g(with)e(a)h(leading)h(min)m(us) | |
18058 | e(sign,)h(those)g(digits)g(de\014ne)f(the)h(ar-)630 628 | |
18059 | y(gumen)m(t.)41 b(If)28 b(the)i(command)f(is)g(follo)m(w)m(ed)h(b)m(y)f | |
18060 | (digits,)i(executing)f Ft(universal-argument)630 737 | |
18061 | y Fu(again)j(ends)e(the)h(n)m(umeric)f(argumen)m(t,)i(but)e(is)h | |
8a0829e9 | 18062 | (otherwise)g(ignored.)45 b(As)32 b(a)g(sp)s(ecial)h(case,)630 |
e59452c7 CR |
18063 | 847 y(if)g(this)g(command)f(is)h(immediately)h(follo)m(w)m(ed)h(b)m(y)d |
18064 | (a)h(c)m(haracter)i(that)e(is)g(neither)g(a)g(digit)630 | |
18065 | 956 y(nor)41 b(min)m(us)f(sign,)k(the)e(argumen)m(t)f(coun)m(t)h(for)f | |
8a0829e9 | 18066 | (the)h(next)f(command)g(is)g(m)m(ultiplied)h(b)m(y)630 |
e59452c7 CR |
18067 | 1066 y(four.)54 b(The)35 b(argumen)m(t)g(coun)m(t)h(is)f(initially)h |
18068 | (one,)h(so)e(executing)i(this)e(function)f(the)i(\014rst)630 | |
18069 | 1176 y(time)29 b(mak)m(es)h(the)e(argumen)m(t)i(coun)m(t)f(four,)f(a)h | |
18070 | (second)g(time)g(mak)m(es)h(the)e(argumen)m(t)h(coun)m(t)630 | |
18071 | 1285 y(sixteen,)i(and)f(so)h(on.)40 b(By)31 b(default,)g(this)f(is)g | |
18072 | (not)h(b)s(ound)d(to)k(a)e(k)m(ey)-8 b(.)150 1468 y Fk(8.4.6)63 | |
18073 | b(Letting)40 b(Readline)h(T)m(yp)s(e)g(F)-10 b(or)42 | |
18074 | b(Y)-10 b(ou)150 1632 y Ft(complete)28 b(\(TAB\))630 | |
18075 | 1741 y Fu(A)m(ttempt)c(to)f(p)s(erform)e(completion)j(on)f(the)g(text)g | |
18076 | (b)s(efore)f(p)s(oin)m(t.)39 b(The)22 b(actual)i(completion)630 | |
18077 | 1851 y(p)s(erformed)33 b(is)h(application-sp)s(eci\014c.)53 | |
18078 | b(Bash)35 b(attempts)g(completion)g(treating)h(the)e(text)630 | |
18079 | 1961 y(as)39 b(a)h(v)-5 b(ariable)39 b(\(if)h(the)f(text)h(b)s(egins)e | |
18080 | (with)h(`)p Ft($)p Fu('\),)j(username)c(\(if)i(the)f(text)h(b)s(egins)e | |
18081 | (with)630 2070 y(`)p Ft(~)p Fu('\),)31 b(hostname)f(\(if)g(the)g(text)h | |
18082 | (b)s(egins)e(with)h(`)p Ft(@)p Fu('\),)h(or)f(command)f(\(including)h | |
18083 | (aliases)i(and)630 2180 y(functions\))j(in)f(turn.)53 | |
e6983002 | 18084 | b(If)34 b(none)g(of)h(these)h(pro)s(duces)d(a)i(matc)m(h,)i(\014lename) |
e59452c7 CR |
18085 | e(completion)h(is)630 2289 y(attempted.)150 2433 y Ft |
18086 | (possible-completions)25 b(\(M-?\))630 2542 y Fu(List)35 | |
e6983002 | 18087 | b(the)g(p)s(ossible)f(completions)i(of)e(the)h(text)h(b)s(efore)e(p)s |
e59452c7 | 18088 | (oin)m(t.)54 b(When)34 b(displa)m(ying)h(com-)630 2652 |
e6983002 CR |
18089 | y(pletions,)f(Readline)f(sets)f(the)h(n)m(um)m(b)s(er)e(of)i(columns)f |
18090 | (used)f(for)i(displa)m(y)f(to)h(the)g(v)-5 b(alue)33 | |
e59452c7 | 18091 | b(of)630 2761 y Ft(completion-display-width)o Fu(,)g(the)j(v)-5 |
e6983002 | 18092 | b(alue)37 b(of)g(the)f(en)m(vironmen)m(t)h(v)-5 b(ariable)38 |
e59452c7 CR |
18093 | b Ft(COLUMNS)p Fu(,)630 2871 y(or)30 b(the)h(screen)f(width,)g(in)g |
18094 | (that)h(order.)150 3014 y Ft(insert-completions)25 b(\(M-*\))630 | |
18095 | 3124 y Fu(Insert)30 b(all)h(completions)h(of)f(the)g(text)g(b)s(efore)f | |
e6983002 | 18096 | (p)s(oin)m(t)h(that)g(w)m(ould)f(ha)m(v)m(e)i(b)s(een)e(generated)630 |
e59452c7 CR |
18097 | 3233 y(b)m(y)g Ft(possible-completions)p Fu(.)150 3376 |
18098 | y Ft(menu-complete)d(\(\))630 3486 y Fu(Similar)d(to)g | |
d37a4722 | 18099 | Ft(complete)p Fu(,)f(but)h(replaces)g(the)g(w)m(ord)g(to)g(b)s(e)f |
e59452c7 | 18100 | (completed)i(with)e(a)i(single)f(matc)m(h)630 3596 y(from)37 |
d37a4722 | 18101 | b(the)h(list)h(of)f(p)s(ossible)f(completions.)64 b(Rep)s(eated)39 |
e59452c7 | 18102 | b(execution)g(of)f Ft(menu-complete)630 3705 y Fu(steps)i(through)g |
d37a4722 | 18103 | (the)g(list)h(of)f(p)s(ossible)g(completions,)k(inserting)c(eac)m(h)i |
e59452c7 | 18104 | (matc)m(h)f(in)f(turn.)630 3815 y(A)m(t)e(the)f(end)f(of)h(the)g(list)g |
d37a4722 | 18105 | (of)g(completions,)i(the)e(b)s(ell)g(is)g(rung)f(\(sub)5 |
e59452c7 | 18106 | b(ject)36 b(to)i(the)f(setting)630 3924 y(of)f Ft(bell-style)p |
d37a4722 CR |
18107 | Fu(\))e(and)h(the)h(original)i(text)f(is)f(restored.)57 |
18108 | b(An)36 b(argumen)m(t)h(of)f Fr(n)f Fu(mo)m(v)m(es)i | |
e59452c7 | 18109 | Fr(n)630 4034 y Fu(p)s(ositions)e(forw)m(ard)f(in)g(the)h(list)h(of)e |
a9fac3b2 | 18110 | (matc)m(hes;)39 b(a)c(negativ)m(e)i(argumen)m(t)e(ma)m(y)g(b)s(e)f |
e59452c7 | 18111 | (used)g(to)630 4143 y(mo)m(v)m(e)40 b(bac)m(kw)m(ard)e(through)g(the)g |
a9fac3b2 | 18112 | (list.)65 b(This)38 b(command)g(is)g(in)m(tended)g(to)h(b)s(e)f(b)s |
e59452c7 CR |
18113 | (ound)e(to)630 4253 y Ft(TAB)p Fu(,)30 b(but)f(is)i(un)m(b)s(ound)d(b)m |
18114 | (y)i(default.)150 4396 y Ft(menu-complete-backward)24 | |
18115 | b(\(\))630 4506 y Fu(Iden)m(tical)36 b(to)g Ft(menu-complete)p | |
6e51e0d0 | 18116 | Fu(,)d(but)h(mo)m(v)m(es)j(bac)m(kw)m(ard)e(through)f(the)i(list)f(of)g |
e59452c7 | 18117 | (p)s(ossible)630 4615 y(completions,)d(as)e(if)h Ft(menu-complete)26 |
124d67cd | 18118 | b Fu(had)k(b)s(een)g(giv)m(en)h(a)g(negativ)m(e)i(argumen)m(t.)150 |
e59452c7 | 18119 | 4758 y Ft(delete-char-or-list)25 b(\(\))630 4868 y Fu(Deletes)41 |
6e51e0d0 | 18120 | b(the)e(c)m(haracter)h(under)e(the)h(cursor)f(if)h(not)g(at)g(the)h(b)s |
e59452c7 | 18121 | (eginning)e(or)h(end)f(of)h(the)630 4978 y(line)50 b(\(lik)m(e)h |
6e51e0d0 | 18122 | Ft(delete-char)p Fu(\).)96 b(If)49 b(at)h(the)g(end)f(of)h(the)f(line,) |
e59452c7 | 18123 | 55 b(b)s(eha)m(v)m(es)c(iden)m(tically)g(to)630 5087 |
124d67cd | 18124 | y Ft(possible-completions)p Fu(.)35 b(This)30 b(command)g(is)g(un)m(b)s |
e59452c7 CR |
18125 | (ound)e(b)m(y)i(default.)150 5230 y Ft(complete-filename)c(\(M-/\))630 |
18126 | 5340 y Fu(A)m(ttempt)32 b(\014lename)e(completion)i(on)e(the)h(text)g | |
18127 | (b)s(efore)f(p)s(oin)m(t.)p eop end | |
fffe80d4 CR |
18128 | %%Page: 139 145 |
18129 | TeXDict begin 139 144 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18130 | b(Command)29 b(Line)i(Editing)2062 b(139)150 299 y Ft | |
e59452c7 CR |
18131 | (possible-filename-comple)o(tion)o(s)24 b(\(C-x)30 b(/\))630 |
18132 | 408 y Fu(List)f(the)g(p)s(ossible)f(completions)h(of)g(the)g(text)g(b)s | |
18133 | (efore)g(p)s(oin)m(t,)g(treating)h(it)f(as)g(a)f(\014lename.)150 | |
18134 | 577 y Ft(complete-username)e(\(M-~\))630 687 y Fu(A)m(ttempt)32 | |
e6983002 | 18135 | b(completion)f(on)g(the)f(text)i(b)s(efore)e(p)s(oin)m(t,)g(treating)i |
e59452c7 CR |
18136 | (it)f(as)f(a)h(username.)150 856 y Ft(possible-username-comple)o(tion)o |
18137 | (s)24 b(\(C-x)30 b(~\))630 965 y Fu(List)25 b(the)g(p)s(ossible)g | |
18138 | (completions)h(of)f(the)g(text)h(b)s(efore)f(p)s(oin)m(t,)h(treating)g | |
18139 | (it)g(as)f(a)g(username.)150 1134 y Ft(complete-variable)h(\(M-$\))630 | |
18140 | 1244 y Fu(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i(b)s(efore)e(p) | |
18141 | s(oin)m(t,)g(treating)i(it)f(as)f(a)h(shell)g(v)-5 b(ariable.)150 | |
18142 | 1412 y Ft(possible-variable-comple)o(tion)o(s)24 b(\(C-x)30 | |
18143 | b($\))630 1522 y Fu(List)42 b(the)g(p)s(ossible)g(completions)h(of)f | |
18144 | (the)g(text)h(b)s(efore)e(p)s(oin)m(t,)46 b(treating)d(it)f(as)g(a)h | |
18145 | (shell)630 1632 y(v)-5 b(ariable.)150 1800 y Ft(complete-hostname)26 | |
18146 | b(\(M-@\))630 1910 y Fu(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i | |
e6983002 | 18147 | (b)s(efore)e(p)s(oin)m(t,)g(treating)i(it)f(as)f(a)h(hostname.)150 |
e59452c7 CR |
18148 | 2079 y Ft(possible-hostname-comple)o(tion)o(s)24 b(\(C-x)30 |
18149 | b(@\))630 2188 y Fu(List)25 b(the)g(p)s(ossible)f(completions)h(of)g | |
e6983002 | 18150 | (the)g(text)g(b)s(efore)g(p)s(oin)m(t,)h(treating)g(it)f(as)f(a)h |
e59452c7 CR |
18151 | (hostname.)150 2357 y Ft(complete-command)h(\(M-!\))630 |
18152 | 2467 y Fu(A)m(ttempt)32 b(completion)g(on)f(the)g(text)h(b)s(efore)e(p) | |
e6983002 | 18153 | s(oin)m(t,)h(treating)h(it)g(as)f(a)g(command)g(name.)630 |
e59452c7 CR |
18154 | 2576 y(Command)46 b(completion)i(attempts)g(to)f(matc)m(h)h(the)f(text) |
18155 | h(against)g(aliases,)53 b(reserv)m(ed)630 2686 y(w)m(ords,)36 | |
e6983002 | 18156 | b(shell)g(functions,)h(shell)e(builtins,)i(and)e(\014nally)g |
e59452c7 CR |
18157 | (executable)i(\014lenames,)g(in)e(that)630 2796 y(order.)150 |
18158 | 2964 y Ft(possible-command-complet)o(ions)24 b(\(C-x)29 | |
18159 | b(!\))630 3074 y Fu(List)d(the)h(p)s(ossible)f(completions)h(of)f(the)h | |
e6983002 | 18160 | (text)g(b)s(efore)f(p)s(oin)m(t,)h(treating)g(it)g(as)g(a)f(command)630 |
e59452c7 CR |
18161 | 3184 y(name.)150 3352 y Ft(dynamic-complete-history)e(\(M-TAB\))630 |
18162 | 3462 y Fu(A)m(ttempt)31 b(completion)h(on)e(the)g(text)h(b)s(efore)f(p) | |
e6983002 | 18163 | s(oin)m(t,)g(comparing)h(the)f(text)h(against)h(lines)630 |
e59452c7 CR |
18164 | 3572 y(from)e(the)g(history)h(list)g(for)f(p)s(ossible)g(completion)i |
18165 | (matc)m(hes.)150 3740 y Ft(dabbrev-expand)26 b(\(\))630 | |
18166 | 3850 y Fu(A)m(ttempt)i(men)m(u)e(completion)i(on)f(the)g(text)g(b)s | |
e6983002 | 18167 | (efore)f(p)s(oin)m(t,)i(comparing)f(the)g(text)h(against)630 |
e59452c7 CR |
18168 | 3960 y(lines)j(from)e(the)i(history)f(list)h(for)g(p)s(ossible)e |
18169 | (completion)j(matc)m(hes.)150 4128 y Ft(complete-into-braces)25 | |
18170 | b(\(M-{\))630 4238 y Fu(P)m(erform)f(\014lename)f(completion)i(and)f | |
124d67cd | 18171 | (insert)f(the)h(list)g(of)g(p)s(ossible)f(completions)i(enclosed)630 |
e59452c7 | 18172 | 4348 y(within)34 b(braces)h(so)f(the)h(list)g(is)g(a)m(v)-5 |
124d67cd | 18173 | b(ailable)37 b(to)e(the)g(shell)g(\(see)g(Section)h(3.5.1)g([Brace)g |
e59452c7 CR |
18174 | (Ex-)630 4457 y(pansion],)30 b(page)h(24\).)150 4666 |
18175 | y Fk(8.4.7)63 b(Keyb)s(oard)41 b(Macros)150 4842 y Ft(start-kbd-macro) | |
18176 | 26 b(\(C-x)j(\(\))630 4952 y Fu(Begin)i(sa)m(ving)h(the)e(c)m | |
124d67cd | 18177 | (haracters)i(t)m(yp)s(ed)e(in)m(to)h(the)g(curren)m(t)f(k)m(eyb)s(oard) |
e59452c7 CR |
18178 | g(macro.)150 5121 y Ft(end-kbd-macro)d(\(C-x)i(\)\))630 |
18179 | 5230 y Fu(Stop)e(sa)m(ving)h(the)g(c)m(haracters)g(t)m(yp)s(ed)f(in)m | |
124d67cd | 18180 | (to)i(the)e(curren)m(t)g(k)m(eyb)s(oard)g(macro)h(and)f(sa)m(v)m(e)i |
e59452c7 | 18181 | (the)630 5340 y(de\014nition.)p eop end |
fffe80d4 CR |
18182 | %%Page: 140 146 |
18183 | TeXDict begin 140 145 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18184 | b(Command)29 b(Line)i(Editing)2062 b(140)150 299 y Ft | |
e59452c7 CR |
18185 | (call-last-kbd-macro)25 b(\(C-x)k(e\))630 408 y Fu(Re-execute)37 |
18186 | b(the)e(last)h(k)m(eyb)s(oard)f(macro)h(de\014ned,)f(b)m(y)h(making)f | |
18187 | (the)g(c)m(haracters)i(in)e(the)630 518 y(macro)c(app)s(ear)f(as)g(if)h | |
18188 | (t)m(yp)s(ed)f(at)h(the)f(k)m(eyb)s(oard.)150 671 y Ft | |
18189 | (print-last-kbd-macro)25 b(\(\))630 780 y Fu(Prin)m(t)30 | |
18190 | b(the)h(last)g(k)m(eb)s(oard)f(macro)h(de\014ned)e(in)i(a)f(format)h | |
18191 | (suitable)g(for)f(the)h Fr(inputrc)k Fu(\014le.)150 973 | |
18192 | y Fk(8.4.8)63 b(Some)41 b(Miscellaneous)i(Commands)150 | |
18193 | 1141 y Ft(re-read-init-file)26 b(\(C-x)j(C-r\))630 1251 | |
18194 | y Fu(Read)22 b(in)g(the)g(con)m(ten)m(ts)h(of)f(the)g | |
18195 | Fr(inputrc)27 b Fu(\014le,)d(and)d(incorp)s(orate)h(an)m(y)h(bindings)d | |
18196 | (or)i(v)-5 b(ariable)630 1360 y(assignmen)m(ts)31 b(found)e(there.)150 | |
18197 | 1513 y Ft(abort)g(\(C-g\))630 1622 y Fu(Ab)s(ort)d(the)h(curren)m(t)f | |
18198 | (editing)h(command)f(and)g(ring)h(the)f(terminal's)h(b)s(ell)g(\(sub)5 | |
18199 | b(ject)26 b(to)i(the)630 1732 y(setting)j(of)g Ft(bell-style)p | |
18200 | Fu(\).)150 1885 y Ft(do-lowercase-version)25 b(\(M-A,)k(M-B,)g(M-)p | |
18201 | Fj(x)p Ft(,)g(...)o(\))630 1994 y Fu(If)35 b(the)g(meta\014ed)g(c)m | |
18202 | (haracter)i Fr(x)k Fu(is)35 b(upp)s(er)e(case,)k(run)d(the)h(command)g | |
18203 | (that)g(is)g(b)s(ound)e(to)630 2104 y(the)g(corresp)s(onding)f | |
18204 | (meta\014ed)h(lo)m(w)m(er)i(case)f(c)m(haracter.)50 b(The)32 | |
18205 | b(b)s(eha)m(vior)h(is)g(unde\014ned)e(if)630 2213 y Fr(x)37 | |
18206 | b Fu(is)30 b(already)h(lo)m(w)m(er)h(case.)150 2366 y | |
18207 | Ft(prefix-meta)27 b(\(ESC\))630 2476 y Fu(Metafy)39 b(the)e(next)h(c)m | |
18208 | (haracter)h(t)m(yp)s(ed.)62 b(This)37 b(is)g(for)h(k)m(eyb)s(oards)f | |
18209 | (without)g(a)h(meta)g(k)m(ey)-8 b(.)630 2585 y(T)m(yping)30 | |
18210 | b(`)p Ft(ESC)g(f)p Fu(')g(is)h(equiv)-5 b(alen)m(t)31 | |
18211 | b(to)g(t)m(yping)g Fj(M-f)p Fu(.)150 2738 y Ft(undo)e(\(C-_)g(or)h(C-x) | |
18212 | g(C-u\))630 2847 y Fu(Incremen)m(tal)h(undo,)f(separately)h(remem)m(b)s | |
18213 | (ered)f(for)g(eac)m(h)i(line.)150 3000 y Ft(revert-line)27 | |
18214 | b(\(M-r\))630 3109 y Fu(Undo)33 b(all)h(c)m(hanges)g(made)f(to)h(this)f | |
18215 | (line.)49 b(This)32 b(is)h(lik)m(e)i(executing)f(the)f | |
18216 | Ft(undo)f Fu(command)630 3219 y(enough)e(times)h(to)g(get)h(bac)m(k)f | |
18217 | (to)g(the)f(b)s(eginning.)150 3372 y Ft(tilde-expand)d(\(M-&\))630 | |
18218 | 3481 y Fu(P)m(erform)j(tilde)h(expansion)g(on)f(the)g(curren)m(t)h(w)m | |
18219 | (ord.)150 3634 y Ft(set-mark)d(\(C-@\))630 3743 y Fu(Set)33 | |
18220 | b(the)g(mark)f(to)i(the)f(p)s(oin)m(t.)48 b(If)32 b(a)h(n)m(umeric)g | |
18221 | (argumen)m(t)g(is)g(supplied,)f(the)h(mark)g(is)f(set)630 | |
18222 | 3853 y(to)f(that)g(p)s(osition.)150 4006 y Ft(exchange-point-and-mark) | |
18223 | 24 b(\(C-x)29 b(C-x\))630 4115 y Fu(Sw)m(ap)i(the)g(p)s(oin)m(t)g(with) | |
18224 | g(the)g(mark.)43 b(The)31 b(curren)m(t)g(cursor)f(p)s(osition)i(is)f | |
18225 | (set)h(to)f(the)h(sa)m(v)m(ed)630 4225 y(p)s(osition,)f(and)e(the)i | |
18226 | (old)g(cursor)e(p)s(osition)i(is)f(sa)m(v)m(ed)i(as)e(the)h(mark.)150 | |
18227 | 4377 y Ft(character-search)26 b(\(C-]\))630 4487 y Fu(A)f(c)m(haracter) | |
18228 | h(is)f(read)g(and)f(p)s(oin)m(t)h(is)g(mo)m(v)m(ed)h(to)g(the)f(next)g | |
18229 | (o)s(ccurrence)g(of)g(that)g(c)m(haracter.)630 4596 y(A)30 | |
124d67cd | 18230 | b(negativ)m(e)j(coun)m(t)e(searc)m(hes)g(for)f(previous)g(o)s |
e59452c7 CR |
18231 | (ccurrences.)150 4749 y Ft(character-search-backwar)o(d)24 |
18232 | b(\(M-C-]\))630 4859 y Fu(A)45 b(c)m(haracter)h(is)f(read)g(and)f(p)s | |
124d67cd | 18233 | (oin)m(t)h(is)g(mo)m(v)m(ed)h(to)f(the)g(previous)f(o)s(ccurrence)h(of) |
e59452c7 | 18234 | g(that)630 4968 y(c)m(haracter.)d(A)31 b(negativ)m(e)h(coun)m(t)f |
124d67cd | 18235 | (searc)m(hes)h(for)e(subsequen)m(t)f(o)s(ccurrences.)150 |
e59452c7 | 18236 | 5121 y Ft(skip-csi-sequence)d(\(\))630 5230 y Fu(Read)i(enough)f(c)m |
124d67cd | 18237 | (haracters)h(to)g(consume)f(a)h(m)m(ulti-k)m(ey)h(sequence)f(suc)m(h)f |
e59452c7 | 18238 | (as)g(those)h(de\014ned)630 5340 y(for)37 b(k)m(eys)h(lik)m(e)g(Home)g |
124d67cd | 18239 | (and)f(End.)60 b(Suc)m(h)37 b(sequences)g(b)s(egin)g(with)g(a)h(Con)m |
e59452c7 | 18240 | (trol)g(Sequence)p eop end |
fffe80d4 CR |
18241 | %%Page: 141 147 |
18242 | TeXDict begin 141 146 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18243 | b(Command)29 b(Line)i(Editing)2062 b(141)630 299 y(Indicator)37 | |
e59452c7 CR |
18244 | b(\(CSI\),)f(usually)h(ESC-[.)59 b(If)36 b(this)g(sequence)h(is)g(b)s |
18245 | (ound)d(to)k Ft("\\)p Fu(e[)p Ft(")p Fu(,)g(k)m(eys)f(pro-)630 | |
18246 | 408 y(ducing)31 b(suc)m(h)h(sequences)g(will)h(ha)m(v)m(e)g(no)f | |
18247 | (e\013ect)h(unless)e(explicitly)j(b)s(ound)c(to)i(a)h(readline)630 | |
18248 | 518 y(command,)f(instead)g(of)g(inserting)g(stra)m(y)h(c)m(haracters)g | |
18249 | (in)m(to)g(the)f(editing)h(bu\013er.)44 b(This)31 b(is)630 | |
18250 | 628 y(un)m(b)s(ound)d(b)m(y)i(default,)h(but)f(usually)g(b)s(ound)e(to) | |
18251 | j(ESC-[.)150 792 y Ft(insert-comment)26 b(\(M-#\))630 | |
18252 | 902 y Fu(Without)36 b(a)g(n)m(umeric)g(argumen)m(t,)h(the)f(v)-5 | |
18253 | b(alue)36 b(of)g(the)g Ft(comment-begin)c Fu(v)-5 b(ariable)36 | |
18254 | b(is)g(in-)630 1011 y(serted)c(at)g(the)g(b)s(eginning)f(of)h(the)f | |
18255 | (curren)m(t)h(line.)45 b(If)31 b(a)h(n)m(umeric)f(argumen)m(t)h(is)g | |
18256 | (supplied,)630 1121 y(this)k(command)h(acts)g(as)g(a)g(toggle:)55 | |
18257 | b(if)37 b(the)f(c)m(haracters)i(at)g(the)e(b)s(eginning)g(of)h(the)g | |
18258 | (line)630 1230 y(do)30 b(not)h(matc)m(h)h(the)f(v)-5 | |
18259 | b(alue)31 b(of)f Ft(comment-begin)p Fu(,)e(the)i(v)-5 | |
18260 | b(alue)31 b(is)g(inserted,)g(otherwise)g(the)630 1340 | |
18261 | y(c)m(haracters)42 b(in)d Ft(comment-begin)e Fu(are)j(deleted)h(from)f | |
18262 | (the)g(b)s(eginning)g(of)g(the)g(line.)71 b(In)630 1450 | |
18263 | y(either)37 b(case,)j(the)e(line)f(is)g(accepted)i(as)e(if)g(a)g | |
18264 | (newline)g(had)g(b)s(een)f(t)m(yp)s(ed.)60 b(The)37 b(default)630 | |
18265 | 1559 y(v)-5 b(alue)32 b(of)g Ft(comment-begin)c Fu(causes)k(this)f | |
18266 | (command)h(to)g(mak)m(e)h(the)e(curren)m(t)h(line)g(a)g(shell)630 | |
18267 | 1669 y(commen)m(t.)40 b(If)26 b(a)h(n)m(umeric)f(argumen)m(t)h(causes)g | |
18268 | (the)f(commen)m(t)i(c)m(haracter)g(to)f(b)s(e)f(remo)m(v)m(ed,)630 | |
18269 | 1778 y(the)31 b(line)f(will)h(b)s(e)f(executed)h(b)m(y)f(the)h(shell.) | |
18270 | 150 1943 y Ft(dump-functions)26 b(\(\))630 2052 y Fu(Prin)m(t)g(all)i | |
18271 | (of)e(the)h(functions)f(and)g(their)g(k)m(ey)h(bindings)e(to)j(the)e | |
18272 | (Readline)h(output)f(stream.)630 2162 y(If)31 b(a)h(n)m(umeric)g | |
18273 | (argumen)m(t)g(is)g(supplied,)f(the)h(output)f(is)h(formatted)g(in)f | |
18274 | (suc)m(h)h(a)g(w)m(a)m(y)g(that)630 2271 y(it)f(can)g(b)s(e)e(made)i | |
18275 | (part)f(of)g(an)h Fr(inputrc)k Fu(\014le.)41 b(This)29 | |
18276 | b(command)h(is)h(un)m(b)s(ound)c(b)m(y)k(default.)150 | |
18277 | 2436 y Ft(dump-variables)26 b(\(\))630 2545 y Fu(Prin)m(t)21 | |
18278 | b(all)h(of)g(the)f(settable)i(v)-5 b(ariables)22 b(and)f(their)g(v)-5 | |
18279 | b(alues)22 b(to)g(the)f(Readline)h(output)f(stream.)630 | |
18280 | 2655 y(If)31 b(a)h(n)m(umeric)g(argumen)m(t)g(is)g(supplied,)f(the)h | |
74d0116b | 18281 | (output)f(is)h(formatted)g(in)f(suc)m(h)h(a)g(w)m(a)m(y)g(that)630 |
e59452c7 | 18282 | 2765 y(it)f(can)g(b)s(e)e(made)i(part)f(of)g(an)h Fr(inputrc)k |
6e51e0d0 | 18283 | Fu(\014le.)41 b(This)29 b(command)h(is)h(un)m(b)s(ound)c(b)m(y)k |
e59452c7 CR |
18284 | (default.)150 2929 y Ft(dump-macros)c(\(\))630 3039 y |
18285 | Fu(Prin)m(t)34 b(all)g(of)g(the)g(Readline)g(k)m(ey)h(sequences)f(b)s | |
18286 | (ound)e(to)i(macros)g(and)f(the)h(strings)g(they)630 | |
18287 | 3148 y(output.)53 b(If)35 b(a)g(n)m(umeric)f(argumen)m(t)i(is)e | |
eb0b2ad8 | 18288 | (supplied,)h(the)g(output)g(is)f(formatted)i(in)e(suc)m(h)h(a)630 |
e59452c7 | 18289 | 3258 y(w)m(a)m(y)c(that)g(it)f(can)g(b)s(e)g(made)g(part)f(of)i(an)e |
6e51e0d0 | 18290 | Fr(inputrc)35 b Fu(\014le.)41 b(This)29 b(command)h(is)g(un)m(b)s(ound) |
e59452c7 CR |
18291 | d(b)m(y)630 3367 y(default.)150 3532 y Ft(spell-correct-word)e(\(C-x)30 |
18292 | b(s\))630 3641 y Fu(P)m(erform)36 b(sp)s(elling)h(correction)h(on)e | |
18293 | (the)h(curren)m(t)f(w)m(ord,)i(treating)f(it)g(as)g(a)g(directory)g(or) | |
18294 | 630 3751 y(\014lename,)g(in)e(the)h(same)f(w)m(a)m(y)i(as)e(the)h | |
18295 | Ft(cdspell)d Fu(shell)j(option.)56 b(W)-8 b(ord)36 b(b)s(oundaries)e | |
18296 | (are)630 3861 y(the)d(same)f(as)h(those)g(used)e(b)m(y)i | |
18297 | Ft(shell-forward-word)p Fu(.)150 4025 y Ft(glob-complete-word)25 | |
18298 | b(\(M-g\))630 4134 y Fu(The)i(w)m(ord)h(b)s(efore)f(p)s(oin)m(t)h(is)g | |
18299 | (treated)h(as)f(a)h(pattern)f(for)f(pathname)h(expansion,)g(with)g(an) | |
18300 | 630 4244 y(asterisk)d(implicitly)h(app)s(ended.)37 b(This)23 | |
602eae4d | 18301 | b(pattern)i(is)f(used)g(to)h(generate)h(a)e(list)h(of)g(matc)m(hing)630 |
e59452c7 CR |
18302 | 4354 y(\014le)30 b(names)h(for)f(p)s(ossible)g(completions.)150 |
18303 | 4518 y Ft(glob-expand-word)c(\(C-x)j(*\))630 4628 y Fu(The)40 | |
602eae4d | 18304 | b(w)m(ord)g(b)s(efore)g(p)s(oin)m(t)h(is)g(treated)g(as)g(a)g(pattern)g |
e59452c7 | 18305 | (for)f(pathname)g(expansion,)k(and)630 4737 y(the)c(list)g(of)f(matc)m |
602eae4d | 18306 | (hing)i(\014le)e(names)g(is)h(inserted,)h(replacing)g(the)e(w)m(ord.)67 |
e59452c7 | 18307 | b(If)39 b(a)h(n)m(umeric)630 4847 y(argumen)m(t)31 b(is)f(supplied,)g |
602eae4d | 18308 | (a)g(`)p Ft(*)p Fu(')h(is)f(app)s(ended)f(b)s(efore)h(pathname)g |
e59452c7 CR |
18309 | (expansion.)150 5011 y Ft(glob-list-expansions)25 b(\(C-x)k(g\))630 |
18310 | 5121 y Fu(The)k(list)h(of)f(expansions)g(that)h(w)m(ould)f(ha)m(v)m(e)h | |
602eae4d | 18311 | (b)s(een)f(generated)h(b)m(y)f Ft(glob-expand-word)630 |
e59452c7 | 18312 | 5230 y Fu(is)h(displa)m(y)m(ed,)h(and)e(the)h(line)g(is)f(redra)m(wn.) |
602eae4d | 18313 | 50 b(If)33 b(a)h(n)m(umeric)g(argumen)m(t)g(is)f(supplied,)h(a)g(`)p |
e59452c7 CR |
18314 | Ft(*)p Fu(')630 5340 y(is)c(app)s(ended)f(b)s(efore)h(pathname)g |
18315 | (expansion.)p eop end | |
fffe80d4 CR |
18316 | %%Page: 142 148 |
18317 | TeXDict begin 142 147 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18318 | b(Command)29 b(Line)i(Editing)2062 b(142)150 299 y Ft | |
e59452c7 CR |
18319 | (display-shell-version)25 b(\(C-x)k(C-v\))630 408 y Fu(Displa)m(y)j(v)m |
18320 | (ersion)e(information)h(ab)s(out)f(the)h(curren)m(t)f(instance)h(of)f | |
18321 | (Bash.)150 566 y Ft(shell-expand-line)c(\(M-C-e\))630 | |
18322 | 676 y Fu(Expand)34 b(the)h(line)h(as)g(the)f(shell)h(do)s(es.)55 | |
18323 | b(This)34 b(p)s(erforms)g(alias)i(and)f(history)g(expansion)630 | |
18324 | 785 y(as)f(w)m(ell)g(as)g(all)h(of)e(the)h(shell)g(w)m(ord)f | |
18325 | (expansions)g(\(see)i(Section)f(3.5)h([Shell)e(Expansions],)630 | |
18326 | 895 y(page)e(24\).)150 1053 y Ft(history-expand-line)25 | |
18327 | b(\(M-^\))630 1162 y Fu(P)m(erform)30 b(history)h(expansion)f(on)g(the) | |
18328 | h(curren)m(t)f(line.)150 1320 y Ft(magic-space)d(\(\))630 | |
18329 | 1429 y Fu(P)m(erform)c(history)g(expansion)g(on)g(the)g(curren)m(t)g | |
18330 | (line)g(and)g(insert)g(a)g(space)h(\(see)g(Section)g(9.3)630 | |
fffe80d4 | 18331 | 1539 y([History)31 b(In)m(teraction],)i(page)e(153\).)150 |
e59452c7 CR |
18332 | 1697 y Ft(alias-expand-line)26 b(\(\))630 1806 y Fu(P)m(erform)i(alias) |
18333 | i(expansion)e(on)g(the)h(curren)m(t)f(line)h(\(see)g(Section)g(6.6)h | |
18334 | ([Aliases],)g(page)f(99\).)150 1964 y Ft(history-and-alias-expand)o | |
18335 | (-lin)o(e)24 b(\(\))630 2073 y Fu(P)m(erform)30 b(history)h(and)e | |
e6983002 | 18336 | (alias)j(expansion)e(on)g(the)h(curren)m(t)f(line.)150 |
e59452c7 CR |
18337 | 2231 y Ft(insert-last-argument)25 b(\(M-.)k(or)h(M-_\))630 |
18338 | 2341 y Fu(A)g(synon)m(ym)g(for)g Ft(yank-last-arg)p Fu(.)150 | |
18339 | 2498 y Ft(edit-and-execute-command)24 b(\(C-x)29 b(C-e\))630 | |
18340 | 2608 y Fu(In)m(v)m(ok)m(e)34 b(an)f(editor)g(on)g(the)g(curren)m(t)f | |
74d0116b | 18341 | (command)h(line,)h(and)e(execute)i(the)f(result)g(as)g(shell)630 |
e59452c7 | 18342 | 2718 y(commands.)81 b(Bash)44 b(attempts)h(to)g(in)m(v)m(ok)m(e)h |
6e51e0d0 | 18343 | Ft($VISUAL)p Fu(,)f Ft($EDITOR)p Fu(,)h(and)d Ft(emacs)g |
e59452c7 CR |
18344 | Fu(as)h(the)630 2827 y(editor,)31 b(in)f(that)h(order.)150 |
18345 | 3066 y Fs(8.5)68 b(Readline)47 b(vi)e(Mo)t(de)150 3226 | |
d37a4722 CR |
18346 | y Fu(While)32 b(the)g(Readline)g(library)f(do)s(es)g(not)h(ha)m(v)m(e)h |
18347 | (a)f(full)f(set)h(of)g Ft(vi)f Fu(editing)h(functions,)f(it)h(do)s(es)g | |
e59452c7 | 18348 | (con)m(tain)150 3335 y(enough)i(to)h(allo)m(w)g(simple)f(editing)h(of)f |
d37a4722 | 18349 | (the)g(line.)52 b(The)34 b(Readline)g Ft(vi)g Fu(mo)s(de)f(b)s(eha)m(v) |
e59452c7 CR |
18350 | m(es)i(as)f(sp)s(eci\014ed)f(in)150 3445 y(the)e Fm(posix)e |
18351 | Fu(standard.)275 3578 y(In)35 b(order)g(to)i(switc)m(h)f(in)m(teractiv) | |
d37a4722 CR |
18352 | m(ely)j(b)s(et)m(w)m(een)d Ft(emacs)f Fu(and)g Ft(vi)g |
18353 | Fu(editing)h(mo)s(des,)h(use)f(the)g(`)p Ft(set)30 b(-o)150 | |
e59452c7 | 18354 | 3688 y(emacs)p Fu(')43 b(and)h(`)p Ft(set)30 b(-o)f(vi)p |
d37a4722 | 18355 | Fu(')44 b(commands)g(\(see)i(Section)f(4.3.1)h([The)e(Set)h(Builtin],)j |
e59452c7 CR |
18356 | (page)e(66\).)83 b(The)150 3798 y(Readline)31 b(default)g(is)f |
18357 | Ft(emacs)f Fu(mo)s(de.)275 3931 y(When)g(y)m(ou)i(en)m(ter)f(a)h(line)f | |
d37a4722 | 18358 | (in)g Ft(vi)f Fu(mo)s(de,)h(y)m(ou)h(are)f(already)h(placed)f(in)g |
e59452c7 | 18359 | (`insertion')g(mo)s(de,)g(as)h(if)f(y)m(ou)150 4041 y(had)f(t)m(yp)s |
d37a4722 CR |
18360 | (ed)g(an)g(`)p Ft(i)p Fu('.)41 b(Pressing)29 b Ft(ESC)f |
18361 | Fu(switc)m(hes)i(y)m(ou)g(in)m(to)h(`command')e(mo)s(de,)h(where)e(y)m | |
e59452c7 | 18362 | (ou)i(can)g(edit)g(the)150 4150 y(text)35 b(of)f(the)g(line)g(with)f |
d37a4722 | 18363 | (the)h(standard)f Ft(vi)g Fu(mo)m(v)m(emen)m(t)j(k)m(eys,)g(mo)m(v)m(e) |
e59452c7 | 18364 | f(to)f(previous)g(history)f(lines)h(with)150 4260 y(`)p |
d37a4722 | 18365 | Ft(k)p Fu(')d(and)e(subsequen)m(t)h(lines)h(with)f(`)p |
e59452c7 CR |
18366 | Ft(j)p Fu(',)g(and)g(so)h(forth.)150 4499 y Fs(8.6)68 |
18367 | b(Programmable)47 b(Completion)150 4658 y Fu(When)25 | |
d37a4722 | 18368 | b(w)m(ord)g(completion)i(is)f(attempted)g(for)g(an)f(argumen)m(t)h(to)g |
e59452c7 | 18369 | (a)g(command)f(for)h(whic)m(h)f(a)h(completion)150 4768 |
d37a4722 CR |
18370 | y(sp)s(eci\014cation)40 b(\(a)h Fr(compsp)s(ec)6 b Fu(\))39 |
18371 | b(has)h(b)s(een)f(de\014ned)f(using)h(the)h Ft(complete)d | |
e59452c7 | 18372 | Fu(builtin)j(\(see)g(Section)h(8.7)150 4878 y([Programmable)h |
fffe80d4 | 18373 | (Completion)f(Builtins],)k(page)d(145\),)j(the)c(programmable)g |
e59452c7 CR |
18374 | (completion)i(facilities)150 4987 y(are)31 b(in)m(v)m(ok)m(ed.)275 |
18375 | 5121 y(First,)23 b(the)e(command)g(name)g(is)h(iden)m(ti\014ed.)37 | |
d37a4722 | 18376 | b(If)21 b(a)g(compsp)s(ec)g(has)g(b)s(een)f(de\014ned)g(for)h(that)h |
e59452c7 | 18377 | (command,)150 5230 y(the)44 b(compsp)s(ec)g(is)g(used)f(to)h(generate)i |
d37a4722 | 18378 | (the)e(list)g(of)g(p)s(ossible)g(completions)h(for)e(the)h(w)m(ord.)81 |
e59452c7 | 18379 | b(If)44 b(the)150 5340 y(command)36 b(w)m(ord)g(is)g(the)g(empt)m(y)h |
d37a4722 | 18380 | (string)f(\(completion)i(attempted)f(at)g(the)g(b)s(eginning)e(of)h(an) |
e59452c7 | 18381 | h(empt)m(y)p eop end |
fffe80d4 CR |
18382 | %%Page: 143 149 |
18383 | TeXDict begin 143 148 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18384 | b(Command)29 b(Line)i(Editing)2062 b(143)150 299 y(line\),)30 | |
e59452c7 CR |
18385 | b(an)m(y)g(compsp)s(ec)f(de\014ned)f(with)h(the)h Ft(-E)e |
18386 | Fu(option)i(to)g Ft(complete)d Fu(is)i(used.)40 b(If)29 | |
18387 | b(the)g(command)g(w)m(ord)150 408 y(is)e(a)h(full)e(pathname,)i(a)g | |
18388 | (compsp)s(ec)e(for)h(the)g(full)g(pathname)g(is)g(searc)m(hed)h(for)f | |
18389 | (\014rst.)39 b(If)26 b(no)h(compsp)s(ec)g(is)150 518 | |
18390 | y(found)22 b(for)g(the)h(full)g(pathname,)h(an)f(attempt)h(is)f(made)g | |
18391 | (to)g(\014nd)f(a)h(compsp)s(ec)f(for)h(the)g(p)s(ortion)f(follo)m(wing) | |
18392 | 150 628 y(the)34 b(\014nal)g(slash.)53 b(If)34 b(those)g(searc)m(hes)i | |
18393 | (do)e(not)g(result)h(in)f(a)g(compsp)s(ec,)h(an)m(y)g(compsp)s(ec)f | |
18394 | (de\014ned)f(with)150 737 y(the)k Ft(-D)g Fu(option)g(to)h | |
18395 | Ft(complete)d Fu(is)i(used)g(as)g(the)g(default.)61 b(If)37 | |
18396 | b(there)g(is)h(no)f(default)g(compsp)s(ec,)i(Bash)150 | |
18397 | 847 y(attempts)e(alias)h(expansion)e(on)g(the)h(command)f(w)m(ord)g(as) | |
18398 | h(a)f(\014nal)g(resort,)j(and)c(attempts)j(to)f(\014nd)e(a)150 | |
18399 | 956 y(compsp)s(ec)30 b(for)g(the)h(command)f(w)m(ord)g(from)g(an)m(y)h | |
18400 | (successful)f(expansion)275 1113 y(Once)k(a)g(compsp)s(ec)g(has)g(b)s | |
18401 | (een)f(found,)h(it)h(is)f(used)f(to)i(generate)h(the)e(list)h(of)f | |
18402 | (matc)m(hing)h(w)m(ords.)51 b(If)150 1223 y(a)37 b(compsp)s(ec)f(is)g | |
18403 | (not)h(found,)f(the)h(default)f(Bash)h(completion)g(describ)s(ed)e(ab)s | |
18404 | (o)m(v)m(e)j(\(see)f(Section)g(8.4.6)150 1332 y([Commands)30 | |
fffe80d4 | 18405 | b(F)-8 b(or)31 b(Completion],)g(page)g(138\))h(is)f(p)s(erformed.)275 |
e59452c7 CR |
18406 | 1489 y(First,)g(the)g(actions)g(sp)s(eci\014ed)f(b)m(y)h(the)f(compsp)s |
18407 | (ec)h(are)g(used.)40 b(Only)30 b(matc)m(hes)i(whic)m(h)e(are)h | |
18408 | (pre\014xed)150 1598 y(b)m(y)h(the)f(w)m(ord)h(b)s(eing)f(completed)h | |
18409 | (are)g(returned.)44 b(When)31 b(the)h Ft(-f)f Fu(or)h | |
18410 | Ft(-d)f Fu(option)h(is)f(used)g(for)h(\014lename)150 | |
18411 | 1708 y(or)e(directory)h(name)f(completion,)i(the)e(shell)h(v)-5 | |
18412 | b(ariable)31 b Ft(FIGNORE)d Fu(is)i(used)f(to)i(\014lter)g(the)f(matc)m | |
18413 | (hes.)42 b(See)150 1817 y(Section)31 b(5.2)h([Bash)e(V)-8 | |
18414 | b(ariables],)33 b(page)e(77,)g(for)f(a)h(description)g(of)f | |
18415 | Ft(FIGNORE)p Fu(.)275 1974 y(An)m(y)22 b(completions)h(sp)s(eci\014ed)f | |
6e51e0d0 | 18416 | (b)m(y)g(a)h(\014lename)f(expansion)h(pattern)f(to)h(the)g |
e59452c7 | 18417 | Ft(-G)e Fu(option)i(are)g(generated)150 2084 y(next.)41 |
6e51e0d0 CR |
18418 | b(The)29 b(w)m(ords)g(generated)h(b)m(y)g(the)g(pattern)f(need)h(not)f |
18419 | (matc)m(h)i(the)f(w)m(ord)f(b)s(eing)g(completed.)41 | |
e59452c7 | 18420 | b(The)150 2193 y Ft(GLOBIGNORE)29 b Fu(shell)i(v)-5 b(ariable)32 |
6e51e0d0 | 18421 | b(is)g(not)g(used)e(to)i(\014lter)g(the)g(matc)m(hes,)h(but)d(the)i |
e59452c7 CR |
18422 | Ft(FIGNORE)e Fu(shell)h(v)-5 b(ariable)150 2303 y(is)30 |
18423 | b(used.)275 2459 y(Next,)39 b(the)f(string)f(sp)s(eci\014ed)f(as)h(the) | |
e6983002 | 18424 | g(argumen)m(t)h(to)g(the)f Ft(-W)f Fu(option)i(is)f(considered.)60 |
e59452c7 | 18425 | b(The)37 b(string)150 2569 y(is)c(\014rst)e(split)i(using)f(the)h(c)m |
e6983002 CR |
18426 | (haracters)h(in)e(the)h Ft(IFS)e Fu(sp)s(ecial)j(v)-5 |
18427 | b(ariable)33 b(as)g(delimiters.)48 b(Shell)32 b(quoting)h(is)150 | |
e59452c7 | 18428 | 2679 y(honored)f(within)h(the)g(string,)h(in)f(order)f(to)i(pro)m(vide) |
e6983002 | 18429 | f(a)h(mec)m(hanism)f(for)g(the)g(w)m(ords)g(to)g(con)m(tain)i(shell)150 |
e59452c7 | 18430 | 2788 y(metac)m(haracters)e(or)e(c)m(haracters)i(in)e(the)g(v)-5 |
e6983002 | 18431 | b(alue)31 b(of)g Ft(IFS)p Fu(.)42 b(Eac)m(h)32 b(w)m(ord)e(is)h(then)g |
e59452c7 | 18432 | (expanded)f(using)h(brace)150 2898 y(expansion,)g(tilde)h(expansion,)f |
e6983002 | 18433 | (parameter)g(and)g(v)-5 b(ariable)32 b(expansion,)f(command)f |
e59452c7 | 18434 | (substitution,)i(and)150 3007 y(arithmetic)c(expansion,)f(as)g(describ) |
e6983002 | 18435 | s(ed)e(ab)s(o)m(v)m(e)i(\(see)h(Section)f(3.5)g([Shell)g(Expansions],)g |
e59452c7 | 18436 | (page)g(24\).)40 b(The)150 3117 y(results)23 b(are)h(split)g(using)f |
e6983002 | 18437 | (the)h(rules)f(describ)s(ed)f(ab)s(o)m(v)m(e)j(\(see)g(Section)f(3.5.7) |
3011048a | 18438 | h([W)-8 b(ord)24 b(Splitting],)i(page)e(35\).)150 3226 |
e6983002 CR |
18439 | y(The)j(results)h(of)f(the)h(expansion)g(are)g(pre\014x-matc)m(hed)g |
18440 | (against)h(the)f(w)m(ord)f(b)s(eing)g(completed,)j(and)d(the)150 | |
e59452c7 CR |
18441 | 3336 y(matc)m(hing)k(w)m(ords)f(b)s(ecome)h(the)g(p)s(ossible)f |
18442 | (completions.)275 3493 y(After)f(these)g(matc)m(hes)i(ha)m(v)m(e)f(b)s | |
e6983002 | 18443 | (een)f(generated,)h(an)m(y)g(shell)f(function)g(or)g(command)g(sp)s |
e59452c7 | 18444 | (eci\014ed)f(with)150 3602 y(the)36 b Ft(-F)f Fu(and)g |
e6983002 CR |
18445 | Ft(-C)g Fu(options)h(is)g(in)m(v)m(ok)m(ed.)59 b(When)35 |
18446 | b(the)h(command)g(or)f(function)h(is)g(in)m(v)m(ok)m(ed,)i(the)e | |
e59452c7 | 18447 | Ft(COMP_)150 3712 y(LINE)p Fu(,)42 b Ft(COMP_POINT)p |
d37a4722 CR |
18448 | Fu(,)d Ft(COMP_KEY)p Fu(,)i(and)e Ft(COMP_TYPE)f Fu(v)-5 |
18449 | b(ariables)41 b(are)f(assigned)g(v)-5 b(alues)41 b(as)f(describ)s(ed) | |
e59452c7 CR |
18450 | 150 3821 y(ab)s(o)m(v)m(e)34 b(\(see)g(Section)g(5.2)g([Bash)f(V)-8 |
18451 | b(ariables],)36 b(page)d(77\).)50 b(If)33 b(a)g(shell)g(function)g(is)g | |
18452 | (b)s(eing)f(in)m(v)m(ok)m(ed,)k(the)150 3931 y Ft(COMP_WORDS)j | |
602eae4d | 18453 | Fu(and)i Ft(COMP_CWORD)d Fu(v)-5 b(ariables)42 b(are)g(also)h(set.)74 |
e59452c7 | 18454 | b(When)41 b(the)h(function)f(or)h(command)f(is)150 4041 |
12933b5b CR |
18455 | y(in)m(v)m(ok)m(ed,)c(the)e(\014rst)f(argumen)m(t)h(\($1\))h(is)e(the)h |
18456 | (name)g(of)f(the)h(command)f(whose)h(argumen)m(ts)f(are)h(b)s(eing)150 | |
e59452c7 | 18457 | 4150 y(completed,)30 b(the)f(second)f(argumen)m(t)h(\($2\))h(is)f(the)g |
45c0f7f8 | 18458 | (w)m(ord)f(b)s(eing)g(completed,)i(and)e(the)h(third)e(argumen)m(t)150 |
e59452c7 | 18459 | 4260 y(\($3\))40 b(is)f(the)f(w)m(ord)h(preceding)f(the)h(w)m(ord)f(b)s |
45c0f7f8 | 18460 | (eing)g(completed)i(on)e(the)h(curren)m(t)f(command)h(line.)65 |
e59452c7 | 18461 | b(No)150 4369 y(\014ltering)33 b(of)h(the)f(generated)h(completions)g |
45c0f7f8 | 18462 | (against)h(the)e(w)m(ord)g(b)s(eing)f(completed)i(is)g(p)s(erformed;)f |
e59452c7 CR |
18463 | (the)150 4479 y(function)d(or)g(command)h(has)f(complete)i(freedom)e |
18464 | (in)g(generating)h(the)g(matc)m(hes.)275 4635 y(An)m(y)j(function)h(sp) | |
a6ae8f35 | 18465 | s(eci\014ed)f(with)g Ft(-F)g Fu(is)h(in)m(v)m(ok)m(ed)h(\014rst.)53 |
6e51e0d0 | 18466 | b(The)35 b(function)f(ma)m(y)h(use)g(an)m(y)g(of)g(the)g(shell)150 |
e59452c7 | 18467 | 4745 y(facilities,)50 b(including)44 b(the)h Ft(compgen)d |
6e51e0d0 | 18468 | Fu(and)i Ft(compopt)e Fu(builtins)i(describ)s(ed)f(b)s(elo)m(w)h(\(see) |
e59452c7 | 18469 | i(Section)f(8.7)150 4855 y([Programmable)31 b(Completion)h(Builtins],)f |
fffe80d4 | 18470 | (page)h(145\),)g(to)g(generate)g(the)f(matc)m(hes.)42 |
e59452c7 | 18471 | b(It)31 b(m)m(ust)g(put)f(the)150 4964 y(p)s(ossible)g(completions)h |
124d67cd | 18472 | (in)f(the)h Ft(COMPREPLY)d Fu(arra)m(y)j(v)-5 b(ariable,)31 |
e59452c7 | 18473 | b(one)g(p)s(er)e(arra)m(y)i(elemen)m(t.)275 5121 y(Next,)26 |
124d67cd CR |
18474 | b(an)m(y)f(command)f(sp)s(eci\014ed)g(with)g(the)h Ft(-C)f |
18475 | Fu(option)h(is)f(in)m(v)m(ok)m(ed)i(in)e(an)g(en)m(vironmen)m(t)h | |
e59452c7 | 18476 | (equiv)-5 b(alen)m(t)150 5230 y(to)26 b(command)e(substitution.)39 |
6e51e0d0 | 18477 | b(It)25 b(should)f(prin)m(t)h(a)g(list)h(of)f(completions,)i(one)e(p)s |
e59452c7 | 18478 | (er)f(line,)j(to)f(the)f(standard)150 5340 y(output.)40 |
6e51e0d0 | 18479 | b(Bac)m(kslash)32 b(ma)m(y)f(b)s(e)f(used)g(to)h(escap)s(e)g(a)f |
e59452c7 | 18480 | (newline,)h(if)f(necessary)-8 b(.)p eop end |
fffe80d4 CR |
18481 | %%Page: 144 150 |
18482 | TeXDict begin 144 149 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18483 | b(Command)29 b(Line)i(Editing)2062 b(144)275 299 y(After)24 | |
6e51e0d0 CR |
18484 | b(all)i(of)f(the)f(p)s(ossible)g(completions)i(are)f(generated,)i(an)m |
18485 | (y)e(\014lter)g(sp)s(eci\014ed)e(with)i(the)g Ft(-X)e | |
e59452c7 | 18486 | Fu(option)150 408 y(is)34 b(applied)g(to)g(the)h(list.)52 |
6e51e0d0 | 18487 | b(The)33 b(\014lter)h(is)g(a)h(pattern)f(as)g(used)f(for)h(pathname)g |
e59452c7 | 18488 | (expansion;)i(a)e(`)p Ft(&)p Fu(')g(in)g(the)150 518 |
6e51e0d0 CR |
18489 | y(pattern)28 b(is)f(replaced)h(with)g(the)f(text)i(of)f(the)f(w)m(ord)h |
18490 | (b)s(eing)f(completed.)40 b(A)28 b(literal)h(`)p Ft(&)p | |
e59452c7 | 18491 | Fu(')f(ma)m(y)g(b)s(e)f(escap)s(ed)150 628 y(with)38 |
6e51e0d0 CR |
18492 | b(a)h(bac)m(kslash;)k(the)38 b(bac)m(kslash)h(is)g(remo)m(v)m(ed)g(b)s |
18493 | (efore)f(attempting)h(a)g(matc)m(h.)65 b(An)m(y)39 b(completion)150 | |
e59452c7 | 18494 | 737 y(that)32 b(matc)m(hes)g(the)g(pattern)g(will)f(b)s(e)g(remo)m(v)m |
6e51e0d0 | 18495 | (ed)h(from)f(the)h(list.)44 b(A)32 b(leading)g(`)p Ft(!)p |
e59452c7 | 18496 | Fu(')f(negates)i(the)f(pattern;)150 847 y(in)d(this)g(case)h(an)m(y)g |
8a0829e9 | 18497 | (completion)h(not)e(matc)m(hing)h(the)g(pattern)f(will)h(b)s(e)e(remo)m |
e59452c7 | 18498 | (v)m(ed.)42 b(If)29 b(the)g Ft(nocasematch)150 956 y |
8a0829e9 CR |
18499 | Fu(shell)k(option)f(\(see)i(the)e(description)g(of)h |
18500 | Ft(shopt)e Fu(in)h(Section)h(4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g | |
e59452c7 | 18501 | (70\))h(is)150 1066 y(enabled,)d(the)f(matc)m(h)h(is)g(p)s(erformed)e |
8a0829e9 | 18502 | (without)h(regard)g(to)h(the)g(case)g(of)g(alphab)s(etic)g(c)m |
e59452c7 | 18503 | (haracters.)275 1203 y(Finally)-8 b(,)42 b(an)m(y)c(pre\014x)g(and)f |
6e51e0d0 | 18504 | (su\016x)h(sp)s(eci\014ed)f(with)i(the)f Ft(-P)g Fu(and)g |
e59452c7 | 18505 | Ft(-S)f Fu(options)i(are)g(added)f(to)h(eac)m(h)150 1313 |
6e51e0d0 | 18506 | y(mem)m(b)s(er)31 b(of)g(the)h(completion)h(list,)f(and)f(the)h(result) |
e59452c7 CR |
18507 | f(is)h(returned)e(to)i(the)g(Readline)g(completion)h(co)s(de)150 |
18508 | 1422 y(as)e(the)f(list)h(of)g(p)s(ossible)f(completions.)275 | |
18509 | 1559 y(If)d(the)h(previously-applied)f(actions)i(do)f(not)g(generate)h | |
18510 | (an)m(y)f(matc)m(hes,)i(and)d(the)h Ft(-o)h(dirnames)d | |
18511 | Fu(op-)150 1669 y(tion)j(w)m(as)f(supplied)f(to)i Ft(complete)d | |
18512 | Fu(when)h(the)h(compsp)s(ec)g(w)m(as)g(de\014ned,)g(directory)g(name)h | |
18513 | (completion)150 1778 y(is)h(attempted.)275 1915 y(If)35 | |
18514 | b(the)g Ft(-o)30 b(plusdirs)j Fu(option)j(w)m(as)g(supplied)e(to)i | |
18515 | Ft(complete)e Fu(when)g(the)i(compsp)s(ec)f(w)m(as)h(de\014ned,)150 | |
18516 | 2025 y(directory)g(name)f(completion)i(is)e(attempted)h(and)f(an)m(y)h | |
6e51e0d0 | 18517 | (matc)m(hes)g(are)g(added)f(to)h(the)f(results)g(of)h(the)150 |
e59452c7 | 18518 | 2134 y(other)31 b(actions.)275 2271 y(By)g(default,)i(if)e(a)h(compsp)s |
6e51e0d0 | 18519 | (ec)f(is)h(found,)f(whatev)m(er)h(it)g(generates)h(is)e(returned)g(to)h |
e59452c7 | 18520 | (the)g(completion)150 2381 y(co)s(de)21 b(as)g(the)g(full)g(set)g(of)g |
6e51e0d0 | 18521 | (p)s(ossible)f(completions.)39 b(The)20 b(default)h(Bash)g(completions) |
e59452c7 | 18522 | h(are)g(not)f(attempted,)150 2491 y(and)30 b(the)g(Readline)h(default)f |
e6983002 | 18523 | (of)g(\014lename)h(completion)g(is)f(disabled.)41 b(If)29 |
e59452c7 | 18524 | b(the)i Ft(-o)e(bashdefault)e Fu(option)150 2600 y(w)m(as)d(supplied)e |
e6983002 | 18525 | (to)j Ft(complete)c Fu(when)i(the)g(compsp)s(ec)h(w)m(as)g(de\014ned,)g |
e59452c7 | 18526 | (the)f(default)h(Bash)g(completions)h(are)150 2710 y(attempted)j(if)f |
e6983002 CR |
18527 | (the)h(compsp)s(ec)f(generates)h(no)f(matc)m(hes.)41 |
18528 | b(If)27 b(the)g Ft(-o)j(default)25 b Fu(option)j(w)m(as)f(supplied)f | |
e59452c7 | 18529 | (to)150 2819 y Ft(complete)f Fu(when)h(the)h(compsp)s(ec)f(w)m(as)i |
e6983002 | 18530 | (de\014ned,)e(Readline's)i(default)f(completion)h(will)f(b)s(e)f(p)s |
e59452c7 | 18531 | (erformed)150 2929 y(if)k(the)h(compsp)s(ec)f(\(and,)g(if)h(attempted,) |
e6983002 | 18532 | g(the)g(default)f(Bash)h(completions\))h(generate)g(no)e(matc)m(hes.) |
e59452c7 | 18533 | 275 3066 y(When)20 b(a)i(compsp)s(ec)e(indicates)i(that)g(directory)g |
e6983002 | 18534 | (name)f(completion)h(is)f(desired,)i(the)e(programmable)150 |
e59452c7 | 18535 | 3176 y(completion)31 b(functions)e(force)i(Readline)f(to)h(app)s(end)d |
d37a4722 | 18536 | (a)i(slash)g(to)g(completed)h(names)e(whic)m(h)h(are)g(sym-)150 |
e59452c7 | 18537 | 3285 y(b)s(olic)40 b(links)g(to)h(directories,)j(sub)5 |
d37a4722 | 18538 | b(ject)40 b(to)h(the)f(v)-5 b(alue)41 b(of)f(the)g Fr(mark-directories) |
e59452c7 | 18539 | 45 b Fu(Readline)c(v)-5 b(ariable,)150 3395 y(regardless)31 |
d37a4722 | 18540 | b(of)f(the)h(setting)g(of)g(the)f Fr(mark-symlink)m(ed-directories)36 |
e59452c7 | 18541 | b Fu(Readline)31 b(v)-5 b(ariable.)275 3532 y(There)25 |
d37a4722 CR |
18542 | b(is)i(some)g(supp)s(ort)e(for)h(dynamically)h(mo)s(difying)f |
18543 | (completions.)40 b(This)26 b(is)g(most)h(useful)f(when)150 | |
e59452c7 | 18544 | 3641 y(used)40 b(in)h(com)m(bination)i(with)e(a)g(default)h(completion) |
d37a4722 | 18545 | g(sp)s(eci\014ed)f(with)g Ft(-D)p Fu(.)72 b(It's)42 b(p)s(ossible)f |
e59452c7 | 18546 | (for)g(shell)150 3751 y(functions)28 b(executed)h(as)f(completion)i |
d37a4722 | 18547 | (handlers)d(to)i(indicate)g(that)g(completion)g(should)e(b)s(e)h |
e59452c7 | 18548 | (retried)g(b)m(y)150 3861 y(returning)j(an)i(exit)g(status)f(of)h(124.) |
d37a4722 | 18549 | 48 b(If)31 b(a)i(shell)f(function)g(returns)f(124,)k(and)c(c)m(hanges)j |
e59452c7 | 18550 | (the)e(compsp)s(ec)150 3970 y(asso)s(ciated)43 b(with)e(the)g(command)g |
602eae4d | 18551 | (on)g(whic)m(h)g(completion)i(is)e(b)s(eing)g(attempted)h(\(supplied)e |
e59452c7 | 18552 | (as)i(the)150 4080 y(\014rst)29 b(argumen)m(t)h(when)e(the)i(function)f |
602eae4d | 18553 | (is)g(executed\),)j(programmable)d(completion)i(restarts)f(from)f(the) |
e59452c7 | 18554 | 150 4189 y(b)s(eginning,)e(with)g(an)h(attempt)g(to)g(\014nd)e(a)i(new) |
602eae4d | 18555 | e(compsp)s(ec)i(for)f(that)h(command.)39 b(This)27 b(allo)m(ws)h(a)g |
e59452c7 | 18556 | (set)g(of)150 4299 y(completions)33 b(to)f(b)s(e)g(built)f(dynamically) |
602eae4d | 18557 | i(as)f(completion)h(is)f(attempted,)h(rather)f(than)f(b)s(eing)g |
e59452c7 | 18558 | (loaded)150 4408 y(all)g(at)g(once.)275 4545 y(F)-8 b(or)38 |
602eae4d CR |
18559 | b(instance,)h(assuming)e(that)h(there)f(is)h(a)f(library)g(of)g(compsp) |
18560 | s(ecs,)i(eac)m(h)g(k)m(ept)e(in)g(a)h(\014le)f(corre-)150 | |
e59452c7 | 18561 | 4655 y(sp)s(onding)g(to)j(the)f(name)f(of)h(the)g(command,)i(the)e |
602eae4d | 18562 | (follo)m(wing)h(default)f(completion)h(function)e(w)m(ould)150 |
e59452c7 CR |
18563 | 4765 y(load)31 b(completions)g(dynamically:)390 4902 |
18564 | y Ft(_completion_loader\(\))390 5011 y({)581 5121 y(.)47 | |
602eae4d | 18565 | b("/etc/bash_completion.d/$1)o(.sh)o(")42 b(>/dev/null)j(2>&1)i(&&)g |
e59452c7 CR |
18566 | (return)f(124)390 5230 y(})390 5340 y(complete)g(-D)h(-F)g |
18567 | (_completion_loader)c(-o)k(bashdefault)e(-o)i(default)p | |
18568 | eop end | |
fffe80d4 CR |
18569 | %%Page: 145 151 |
18570 | TeXDict begin 145 150 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18571 | b(Command)29 b(Line)i(Editing)2062 b(145)150 299 y Fs(8.7)68 | |
e59452c7 CR |
18572 | b(Programmable)47 b(Completion)f(Builtins)150 458 y Fu(Three)21 |
18573 | b(builtin)g(commands)f(are)i(a)m(v)-5 b(ailable)24 b(to)e(manipulate)f | |
18574 | (the)h(programmable)f(completion)h(facilities:)150 568 | |
18575 | y(one)34 b(to)g(sp)s(ecify)f(ho)m(w)h(the)f(argumen)m(ts)h(to)g(a)g | |
18576 | (particular)g(command)f(are)h(to)g(b)s(e)f(completed,)j(and)d(t)m(w)m | |
18577 | (o)150 677 y(to)e(mo)s(dify)f(the)g(completion)i(as)e(it)h(is)g(happ)s | |
18578 | (ening.)150 893 y Ft(compgen)870 1046 y(compgen)46 b([)p | |
18579 | Fj(option)p Ft(])f([)p Fj(word)p Ft(])630 1199 y Fu(Generate)27 | |
18580 | b(p)s(ossible)e(completion)i(matc)m(hes)g(for)e Fr(w)m(ord)k | |
18581 | Fu(according)e(to)f(the)g Fr(option)p Fu(s,)h(whic)m(h)630 | |
18582 | 1309 y(ma)m(y)32 b(b)s(e)f(an)m(y)h(option)g(accepted)g(b)m(y)g(the)f | |
18583 | Ft(complete)f Fu(builtin)h(with)g(the)g(exception)i(of)f | |
18584 | Ft(-p)630 1418 y Fu(and)39 b Ft(-r)p Fu(,)i(and)e(write)h(the)g(matc)m | |
18585 | (hes)g(to)g(the)g(standard)f(output.)68 b(When)39 b(using)g(the)h | |
18586 | Ft(-F)630 1528 y Fu(or)33 b Ft(-C)f Fu(options,)i(the)e(v)-5 | |
18587 | b(arious)33 b(shell)g(v)-5 b(ariables)33 b(set)g(b)m(y)g(the)g | |
18588 | (programmable)g(completion)630 1638 y(facilities,)g(while)d(a)m(v)-5 | |
18589 | b(ailable,)33 b(will)e(not)g(ha)m(v)m(e)g(useful)f(v)-5 | |
18590 | b(alues.)630 1791 y(The)34 b(matc)m(hes)h(will)g(b)s(e)f(generated)h | |
18591 | (in)f(the)h(same)g(w)m(a)m(y)g(as)g(if)f(the)h(programmable)f(com-)630 | |
18592 | 1900 y(pletion)d(co)s(de)g(had)f(generated)i(them)e(directly)i(from)e | |
18593 | (a)h(completion)h(sp)s(eci\014cation)f(with)630 2010 | |
18594 | y(the)e(same)h(\015ags.)40 b(If)29 b Fr(w)m(ord)j Fu(is)d(sp)s | |
18595 | (eci\014ed,)g(only)g(those)h(completions)g(matc)m(hing)g | |
18596 | Fr(w)m(ord)j Fu(will)630 2120 y(b)s(e)d(displa)m(y)m(ed.)630 | |
18597 | 2273 y(The)24 b(return)g(v)-5 b(alue)25 b(is)g(true)f(unless)g(an)h(in) | |
e6983002 | 18598 | m(v)-5 b(alid)25 b(option)g(is)g(supplied,)f(or)h(no)g(matc)m(hes)g(w)m |
e59452c7 CR |
18599 | (ere)630 2382 y(generated.)150 2579 y Ft(complete)870 |
18600 | 2732 y(complete)46 b([-abcdefgjksuv])d([-o)k Fj(comp-option)p | |
18601 | Ft(])e([-DEI])h([-A)h Fj(action)p Ft(])e([-)870 2842 | |
18602 | y(G)i Fj(globpat)p Ft(])870 2951 y([-W)g Fj(wordlist)p | |
e6983002 | 18603 | Ft(])e([-F)i Fj(function)p Ft(])e([-C)i Fj(command)p |
e59452c7 | 18604 | Ft(])f([-X)h Fj(filterpat)p Ft(])870 3061 y([-P)g Fj(prefix)p |
e6983002 | 18605 | Ft(])f([-S)h Fj(suffix)p Ft(])e Fj(name)i Ft([)p Fj(name)f |
e59452c7 CR |
18606 | Ft(...])870 3171 y(complete)g(-pr)g([-DEI])h([)p Fj(name)f |
18607 | Ft(...)o(])630 3324 y Fu(Sp)s(ecify)37 b(ho)m(w)h(argumen)m(ts)f(to)i | |
e6983002 | 18608 | (eac)m(h)g Fr(name)j Fu(should)37 b(b)s(e)g(completed.)63 |
e59452c7 | 18609 | b(If)38 b(the)f Ft(-p)g Fu(option)630 3433 y(is)30 b(supplied,)e(or)i |
e6983002 | 18610 | (if)g(no)f(options)h(are)g(supplied,)f(existing)h(completion)h(sp)s |
e59452c7 | 18611 | (eci\014cations)g(are)630 3543 y(prin)m(ted)24 b(in)h(a)g(w)m(a)m(y)g |
d37a4722 | 18612 | (that)h(allo)m(ws)g(them)e(to)i(b)s(e)e(reused)f(as)i(input.)38 |
e59452c7 | 18613 | b(The)24 b Ft(-r)g Fu(option)i(remo)m(v)m(es)630 3653 |
d37a4722 CR |
18614 | y(a)i(completion)h(sp)s(eci\014cation)f(for)g(eac)m(h)h |
18615 | Fr(name)p Fu(,)f(or,)h(if)e(no)h Fr(name)5 b Fu(s)27 | |
e59452c7 | 18616 | b(are)h(supplied,)g(all)g(com-)630 3762 y(pletion)i(sp)s |
d37a4722 | 18617 | (eci\014cations.)42 b(The)29 b Ft(-D)g Fu(option)h(indicates)h(that)f |
e59452c7 | 18618 | (other)g(supplied)e(options)j(and)630 3872 y(actions)c(should)e(apply)g |
d37a4722 | 18619 | (to)i(the)f(\\default")h(command)e(completion;)k(that)e(is,)g |
e59452c7 | 18620 | (completion)630 3981 y(attempted)g(on)f(a)h(command)f(for)g(whic)m(h)g |
d37a4722 | 18621 | (no)g(completion)i(has)d(previously)h(b)s(een)g(de\014ned.)630 |
e59452c7 CR |
18622 | 4091 y(The)e Ft(-E)g Fu(option)h(indicates)g(that)g(other)g(supplied)e |
18623 | (options)h(and)g(actions)i(should)d(apply)h(to)630 4200 | |
d37a4722 | 18624 | y(\\empt)m(y")33 b(command)e(completion;)i(that)f(is,)g(completion)h |
e59452c7 | 18625 | (attempted)f(on)g(a)f(blank)g(line.)630 4310 y(The)24 |
d37a4722 | 18626 | b Ft(-I)g Fu(option)h(indicates)g(that)g(other)g(supplied)e(options)h |
e59452c7 | 18627 | (and)g(actions)i(should)d(apply)h(to)630 4420 y(completion)29 |
d37a4722 | 18628 | b(on)g(the)f(initial)h(non-assignmen)m(t)g(w)m(ord)f(on)g(the)g(line,)i |
e59452c7 | 18629 | (or)e(after)h(a)f(command)630 4529 y(delimiter)41 b(suc)m(h)g(as)f(`)p |
d37a4722 | 18630 | Ft(;)p Fu(')h(or)g(`)p Ft(|)p Fu(',)i(whic)m(h)e(is)f(usually)h |
e59452c7 | 18631 | (command)f(name)h(completion.)72 b(If)630 4639 y(m)m(ultiple)26 |
d37a4722 CR |
18632 | b(options)g(are)g(supplied,)g(the)f Ft(-D)g Fu(option)h(tak)m(es)i |
18633 | (precedence)e(o)m(v)m(er)g Ft(-E)p Fu(,)h(and)e(b)s(oth)630 | |
e59452c7 | 18634 | 4748 y(tak)m(e)34 b(precedence)f(o)m(v)m(er)h Ft(-I)p |
d37a4722 CR |
18635 | Fu(.)47 b(If)32 b(an)m(y)h(of)g Ft(-D)p Fu(,)g Ft(-E)p |
18636 | Fu(,)f(or)h Ft(-I)f Fu(are)h(supplied,)f(an)m(y)h(other)g | |
e59452c7 | 18637 | Fr(name)630 4858 y Fu(argumen)m(ts)k(are)g(ignored;)j(these)d |
b52e30b8 | 18638 | (completions)h(only)e(apply)g(to)i(the)f(case)g(sp)s(eci\014ed)f(b)m(y) |
e59452c7 | 18639 | 630 4968 y(the)31 b(option.)630 5121 y(The)e(pro)s(cess)g(of)h |
b52e30b8 | 18640 | (applying)g(these)g(completion)g(sp)s(eci\014cations)h(when)d(w)m(ord)i |
e59452c7 | 18641 | (completion)630 5230 y(is)35 b(attempted)h(is)f(describ)s(ed)f(ab)s(o)m |
12beeabf | 18642 | (v)m(e)j(\(see)f(Section)g(8.6)g([Programmable)g(Completion],)630 |
fffe80d4 CR |
18643 | 5340 y(page)31 b(142\).)p eop end |
18644 | %%Page: 146 152 | |
18645 | TeXDict begin 146 151 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18646 | b(Command)29 b(Line)i(Editing)2062 b(146)630 299 y(Other)28 | |
e59452c7 CR |
18647 | b(options,)i(if)f(sp)s(eci\014ed,)g(ha)m(v)m(e)h(the)f(follo)m(wing)i |
18648 | (meanings.)40 b(The)29 b(argumen)m(ts)g(to)h(the)630 | |
18649 | 408 y Ft(-G)p Fu(,)41 b Ft(-W)p Fu(,)h(and)c Ft(-X)h | |
18650 | Fu(options)h(\(and,)h(if)f(necessary)-8 b(,)42 b(the)e | |
18651 | Ft(-P)f Fu(and)f Ft(-S)h Fu(options\))h(should)f(b)s(e)630 | |
18652 | 518 y(quoted)28 b(to)h(protect)g(them)f(from)f(expansion)h(b)s(efore)g | |
18653 | (the)g Ft(complete)e Fu(builtin)h(is)h(in)m(v)m(ok)m(ed.)630 | |
18654 | 669 y Ft(-o)i Fj(comp-option)1110 778 y Fu(The)c Fr(comp-option)i | |
6e51e0d0 | 18655 | Fu(con)m(trols)g(sev)m(eral)h(asp)s(ects)e(of)g(the)g(compsp)s(ec's)g |
e59452c7 | 18656 | (b)s(eha)m(v-)1110 888 y(ior)g(b)s(ey)m(ond)f(the)g(simple)h |
6e51e0d0 | 18657 | (generation)h(of)e(completions.)41 b Fr(comp-option)27 |
e59452c7 CR |
18658 | b Fu(ma)m(y)1110 998 y(b)s(e)j(one)g(of:)1110 1148 y |
18659 | Ft(bashdefault)1590 1258 y Fu(P)m(erform)d(the)h(rest)f(of)h(the)g | |
18660 | (default)f(Bash)h(completions)g(if)g(the)1590 1367 y(compsp)s(ec)i | |
18661 | (generates)i(no)e(matc)m(hes.)1110 1518 y Ft(default)144 | |
e6983002 | 18662 | b Fu(Use)22 b(Readline's)g(default)g(\014lename)g(completion)g(if)g |
e59452c7 CR |
18663 | (the)g(comp-)1590 1628 y(sp)s(ec)30 b(generates)i(no)e(matc)m(hes.)1110 |
18664 | 1778 y Ft(dirnames)96 b Fu(P)m(erform)46 b(directory)g(name)h | |
18665 | (completion)g(if)f(the)g(compsp)s(ec)1590 1888 y(generates)32 | |
18666 | b(no)e(matc)m(hes.)1110 2039 y Ft(filenames)1590 2148 | |
18667 | y Fu(T)-8 b(ell)40 b(Readline)f(that)h(the)f(compsp)s(ec)f(generates)j | |
18668 | (\014lenames,)1590 2258 y(so)29 b(it)h(can)f(p)s(erform)f(an)m(y)h | |
e6983002 | 18669 | (\014lename-sp)s(eci\014c)h(pro)s(cessing)e(\(lik)m(e)1590 |
e59452c7 CR |
18670 | 2367 y(adding)22 b(a)g(slash)g(to)h(directory)f(names,)i(quoting)f(sp)s |
18671 | (ecial)f(c)m(har-)1590 2477 y(acters,)39 b(or)d(suppressing)f(trailing) | |
18672 | i(spaces\).)59 b(This)35 b(option)i(is)1590 2587 y(in)m(tended)30 | |
8a0829e9 | 18673 | b(to)g(b)s(e)g(used)f(with)g(shell)i(functions)e(sp)s(eci\014ed)g(with) |
e59452c7 | 18674 | 1590 2696 y Ft(-F)p Fu(.)1110 2847 y Ft(noquote)144 b |
e6983002 | 18675 | Fu(T)-8 b(ell)28 b(Readline)g(not)g(to)g(quote)g(the)g(completed)g(w)m |
e59452c7 CR |
18676 | (ords)f(if)h(they)1590 2956 y(are)j(\014lenames)f(\(quoting)h |
18677 | (\014lenames)g(is)f(the)h(default\).)1110 3107 y Ft(nosort)192 | |
e6983002 | 18678 | b Fu(T)-8 b(ell)23 b(Readline)g(not)f(to)h(sort)g(the)f(list)h(of)f(p)s |
e59452c7 CR |
18679 | (ossible)g(completions)1590 3217 y(alphab)s(etically)-8 |
18680 | b(.)1110 3367 y Ft(nospace)144 b Fu(T)-8 b(ell)40 b(Readline)g(not)g | |
e6983002 | 18681 | (to)g(app)s(end)d(a)j(space)g(\(the)f(default\))h(to)1590 |
e59452c7 CR |
18682 | 3477 y(w)m(ords)30 b(completed)h(at)g(the)g(end)f(of)g(the)h(line.)1110 |
18683 | 3628 y Ft(plusdirs)96 b Fu(After)30 b(an)m(y)h(matc)m(hes)g(de\014ned)d | |
18684 | (b)m(y)i(the)g(compsp)s(ec)g(are)g(gener-)1590 3737 y(ated,)g | |
d37a4722 | 18685 | (directory)f(name)g(completion)i(is)d(attempted)i(and)f(an)m(y)1590 |
e59452c7 CR |
18686 | 3847 y(matc)m(hes)j(are)e(added)g(to)h(the)g(results)f(of)g(the)h |
18687 | (other)g(actions.)630 3998 y Ft(-A)f Fj(action)66 b Fu(The)25 | |
602eae4d | 18688 | b Fr(action)h Fu(ma)m(y)g(b)s(e)e(one)h(of)h(the)f(follo)m(wing)i(to)e |
e59452c7 CR |
18689 | (generate)i(a)e(list)h(of)f(p)s(ossible)1110 4107 y(completions:)1110 |
18690 | 4258 y Ft(alias)240 b Fu(Alias)31 b(names.)41 b(Ma)m(y)31 | |
a6ae8f35 | 18691 | b(also)h(b)s(e)e(sp)s(eci\014ed)f(as)i Ft(-a)p Fu(.)1110 |
e59452c7 CR |
18692 | 4408 y Ft(arrayvar)96 b Fu(Arra)m(y)31 b(v)-5 b(ariable)31 |
18693 | b(names.)1110 4559 y Ft(binding)144 b Fu(Readline)30 | |
a6ae8f35 | 18694 | b(k)m(ey)f(binding)f(names)h(\(see)h(Section)f(8.4)h([Bindable)1590 |
fffe80d4 | 18695 | 4669 y(Readline)h(Commands],)f(page)h(132\).)1110 4819 |
a6ae8f35 | 18696 | y Ft(builtin)144 b Fu(Names)21 b(of)g(shell)f(builtin)h(commands.)37 |
e59452c7 CR |
18697 | b(Ma)m(y)21 b(also)h(b)s(e)e(sp)s(eci\014ed)1590 4929 |
18698 | y(as)31 b Ft(-b)p Fu(.)1110 5080 y Ft(command)144 b Fu(Command)29 | |
b52e30b8 | 18699 | b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i |
e59452c7 | 18700 | Ft(-c)p Fu(.)1110 5230 y Ft(directory)1590 5340 y Fu(Directory)h |
b52e30b8 | 18701 | (names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)g |
e59452c7 | 18702 | Ft(-d)p Fu(.)p eop end |
fffe80d4 CR |
18703 | %%Page: 147 153 |
18704 | TeXDict begin 147 152 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18705 | b(Command)29 b(Line)i(Editing)2062 b(147)1110 299 y Ft(disabled)96 | |
e59452c7 CR |
18706 | b Fu(Names)31 b(of)g(disabled)f(shell)g(builtins.)1110 |
18707 | 460 y Ft(enabled)144 b Fu(Names)31 b(of)g(enabled)f(shell)g(builtins.) | |
18708 | 1110 622 y Ft(export)192 b Fu(Names)34 b(of)f(exp)s(orted)f(shell)h(v) | |
18709 | -5 b(ariables.)49 b(Ma)m(y)35 b(also)e(b)s(e)g(sp)s(eci-)1590 | |
18710 | 731 y(\014ed)d(as)g Ft(-e)p Fu(.)1110 893 y Ft(file)288 | |
12beeabf | 18711 | b Fu(File)32 b(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f |
e59452c7 CR |
18712 | (as)i Ft(-f)p Fu(.)1110 1054 y Ft(function)96 b Fu(Names)31 |
18713 | b(of)g(shell)f(functions.)1110 1216 y Ft(group)240 b | |
12beeabf | 18714 | Fu(Group)30 b(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)g |
e59452c7 CR |
18715 | (as)g Ft(-g)p Fu(.)1110 1377 y Ft(helptopic)1590 1487 |
18716 | y Fu(Help)37 b(topics)g(as)g(accepted)h(b)m(y)e(the)h | |
18717 | Ft(help)f Fu(builtin)g(\(see)h(Sec-)1590 1597 y(tion)31 | |
18718 | b(4.2)g([Bash)g(Builtins],)g(page)g(54\).)1110 1758 y | |
12beeabf | 18719 | Ft(hostname)96 b Fu(Hostnames,)89 b(as)76 b(tak)m(en)h(from)f(the)g |
e59452c7 | 18720 | (\014le)h(sp)s(eci\014ed)e(b)m(y)1590 1868 y(the)55 b |
12beeabf | 18721 | Ft(HOSTFILE)e Fu(shell)j(v)-5 b(ariable)56 b(\(see)g(Section)g(5.2)h |
e59452c7 CR |
18722 | ([Bash)1590 1977 y(V)-8 b(ariables],)32 b(page)f(77\).)1110 |
18723 | 2139 y Ft(job)336 b Fu(Job)31 b(names,)h(if)g(job)f(con)m(trol)i(is)f | |
12beeabf | 18724 | (activ)m(e.)46 b(Ma)m(y)33 b(also)g(b)s(e)e(sp)s(eci-)1590 |
e59452c7 | 18725 | 2248 y(\014ed)f(as)g Ft(-j)p Fu(.)1110 2410 y Ft(keyword)144 |
12beeabf | 18726 | b Fu(Shell)30 b(reserv)m(ed)h(w)m(ords.)40 b(Ma)m(y)32 |
e6983002 | 18727 | b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i Ft(-k)p Fu(.)1110 |
e59452c7 CR |
18728 | 2571 y Ft(running)144 b Fu(Names)31 b(of)g(running)d(jobs,)i(if)h(job)f |
18729 | (con)m(trol)h(is)g(activ)m(e.)1110 2733 y Ft(service)144 | |
e6983002 | 18730 | b Fu(Service)31 b(names.)41 b(Ma)m(y)31 b(also)g(b)s(e)f(sp)s |
e59452c7 | 18731 | (eci\014ed)g(as)g Ft(-s)p Fu(.)1110 2894 y Ft(setopt)192 |
e6983002 | 18732 | b Fu(V)-8 b(alid)39 b(argumen)m(ts)g(for)f(the)h Ft(-o)e |
e59452c7 CR |
18733 | Fu(option)i(to)g(the)g Ft(set)e Fu(builtin)1590 3004 |
18734 | y(\(see)31 b(Section)h(4.3.1)g([The)e(Set)g(Builtin],)i(page)f(66\).) | |
18735 | 1110 3165 y Ft(shopt)240 b Fu(Shell)40 b(option)g(names)g(as)g | |
e6983002 | 18736 | (accepted)i(b)m(y)e(the)g Ft(shopt)e Fu(builtin)1590 |
e59452c7 CR |
18737 | 3275 y(\(see)31 b(Section)h(4.2)f([Bash)g(Builtins],)g(page)g(54\).) |
18738 | 1110 3437 y Ft(signal)192 b Fu(Signal)31 b(names.)1110 | |
18739 | 3598 y Ft(stopped)144 b Fu(Names)31 b(of)g(stopp)s(ed)e(jobs,)h(if)g | |
18740 | (job)g(con)m(trol)i(is)f(activ)m(e.)1110 3760 y Ft(user)288 | |
e6983002 | 18741 | b Fu(User)30 b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f |
e59452c7 | 18742 | (as)i Ft(-u)p Fu(.)1110 3921 y Ft(variable)96 b Fu(Names)36 |
e6983002 | 18743 | b(of)g(all)g(shell)g(v)-5 b(ariables.)56 b(Ma)m(y)37 |
e59452c7 CR |
18744 | b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)1590 4031 y Ft(-v)p |
18745 | Fu(.)630 4192 y Ft(-C)30 b Fj(command)1110 4302 y Fr(command)35 | |
e6983002 | 18746 | b Fu(is)e(executed)g(in)e(a)i(subshell)e(en)m(vironmen)m(t,)i(and)f |
e59452c7 CR |
18747 | (its)g(output)g(is)1110 4411 y(used)e(as)g(the)h(p)s(ossible)f |
18748 | (completions.)630 4573 y Ft(-F)g Fj(function)1110 4682 | |
e6983002 | 18749 | y Fu(The)39 b(shell)g(function)g Fr(function)g Fu(is)g(executed)h(in)f |
e59452c7 | 18750 | (the)g(curren)m(t)g(shell)g(en)m(vi-)1110 4792 y(ronmen)m(t.)72 |
b52e30b8 | 18751 | b(When)41 b(it)g(is)g(executed,)k($1)c(is)g(the)g(name)g(of)g(the)g |
e59452c7 | 18752 | (command)1110 4902 y(whose)34 b(argumen)m(ts)h(are)g(b)s(eing)f |
b52e30b8 | 18753 | (completed,)j($2)e(is)f(the)h(w)m(ord)f(b)s(eing)g(com-)1110 |
e59452c7 CR |
18754 | 5011 y(pleted,)44 b(and)c($3)i(is)e(the)h(w)m(ord)g(preceding)f(the)h |
18755 | (w)m(ord)f(b)s(eing)h(completed,)1110 5121 y(as)g(describ)s(ed)f(ab)s | |
b52e30b8 | 18756 | (o)m(v)m(e)i(\(see)g(Section)f(8.6)h([Programmable)g(Completion],)1110 |
fffe80d4 | 18757 | 5230 y(page)30 b(142\).)42 b(When)29 b(it)h(\014nishes,)e(the)h(p)s |
e59452c7 | 18758 | (ossible)g(completions)h(are)g(retriev)m(ed)1110 5340 |
b52e30b8 | 18759 | y(from)g(the)g(v)-5 b(alue)31 b(of)g(the)f Ft(COMPREPLY)e |
e59452c7 | 18760 | Fu(arra)m(y)j(v)-5 b(ariable.)p eop end |
fffe80d4 CR |
18761 | %%Page: 148 154 |
18762 | TeXDict begin 148 153 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18763 | b(Command)29 b(Line)i(Editing)2062 b(148)630 299 y Ft(-G)30 | |
e59452c7 CR |
18764 | b Fj(globpat)1110 408 y Fu(The)39 b(\014lename)h(expansion)g(pattern)g |
18765 | Fr(globpat)j Fu(is)d(expanded)f(to)h(generate)1110 518 | |
18766 | y(the)31 b(p)s(ossible)e(completions.)630 708 y Ft(-P)h | |
b52e30b8 CR |
18767 | Fj(prefix)66 b Fr(pre\014x)39 b Fu(is)34 b(added)f(at)i(the)f(b)s |
18768 | (eginning)f(of)i(eac)m(h)g(p)s(ossible)e(completion)i(after)1110 | |
e59452c7 CR |
18769 | 817 y(all)c(other)g(options)g(ha)m(v)m(e)g(b)s(een)f(applied.)630 |
18770 | 1007 y Ft(-S)g Fj(suffix)66 b Fr(su\016x)26 b Fu(is)20 | |
a8fd3f3e | 18771 | b(app)s(ended)f(to)i(eac)m(h)h(p)s(ossible)e(completion)i(after)f(all)g |
e59452c7 CR |
18772 | (other)g(options)1110 1116 y(ha)m(v)m(e)32 b(b)s(een)d(applied.)630 |
18773 | 1306 y Ft(-W)h Fj(wordlist)1110 1416 y Fu(The)24 b Fr(w)m(ordlist)k | |
6e51e0d0 | 18774 | Fu(is)d(split)g(using)f(the)h(c)m(haracters)i(in)d(the)i |
e59452c7 | 18775 | Ft(IFS)e Fu(sp)s(ecial)h(v)-5 b(ariable)1110 1525 y(as)36 |
5cdaaf76 | 18776 | b(delimiters,)i(and)e(eac)m(h)h(resultan)m(t)g(w)m(ord)e(is)h |
e59452c7 | 18777 | (expanded.)57 b(The)35 b(p)s(ossible)1110 1635 y(completions)c(are)e |
5cdaaf76 | 18778 | (the)h(mem)m(b)s(ers)f(of)g(the)h(resultan)m(t)g(list)g(whic)m(h)f |
e59452c7 CR |
18779 | (matc)m(h)i(the)1110 1744 y(w)m(ord)f(b)s(eing)g(completed.)630 |
18780 | 1934 y Ft(-X)g Fj(filterpat)1110 2043 y Fr(\014lterpat)d | |
6e51e0d0 | 18781 | Fu(is)e(a)g(pattern)g(as)f(used)g(for)h(\014lename)g(expansion.)38 |
e59452c7 | 18782 | b(It)25 b(is)g(applied)f(to)1110 2153 y(the)30 b(list)f(of)h(p)s |
6e51e0d0 | 18783 | (ossible)f(completions)h(generated)h(b)m(y)e(the)g(preceding)h(options) |
e59452c7 CR |
18784 | 1110 2263 y(and)d(argumen)m(ts,)i(and)e(eac)m(h)i(completion)g(matc)m |
18785 | (hing)g Fr(\014lterpat)h Fu(is)e(remo)m(v)m(ed)1110 2372 | |
6e51e0d0 CR |
18786 | y(from)i(the)h(list.)42 b(A)30 b(leading)i(`)p Ft(!)p |
18787 | Fu(')e(in)g Fr(\014lterpat)j Fu(negates)f(the)f(pattern;)g(in)f(this) | |
e59452c7 CR |
18788 | 1110 2482 y(case,)i(an)m(y)e(completion)i(not)f(matc)m(hing)g |
18789 | Fr(\014lterpat)i Fu(is)d(remo)m(v)m(ed.)630 2671 y(The)35 | |
6e51e0d0 CR |
18790 | b(return)g(v)-5 b(alue)37 b(is)f(true)f(unless)h(an)f(in)m(v)-5 |
18791 | b(alid)37 b(option)f(is)g(supplied,)g(an)g(option)h(other)630 | |
e59452c7 | 18792 | 2781 y(than)h Ft(-p)g Fu(or)g Ft(-r)f Fu(is)h(supplied)f(without)i(a)f |
6e51e0d0 | 18793 | Fr(name)44 b Fu(argumen)m(t,)c(an)e(attempt)i(is)e(made)g(to)630 |
e59452c7 | 18794 | 2891 y(remo)m(v)m(e)32 b(a)e(completion)i(sp)s(eci\014cation)f(for)f(a) |
e6983002 | 18795 | h Fr(name)k Fu(for)30 b(whic)m(h)g(no)g(sp)s(eci\014cation)h(exists,) |
e59452c7 CR |
18796 | 630 3000 y(or)f(an)h(error)f(o)s(ccurs)g(adding)g(a)g(completion)i(sp)s |
18797 | (eci\014cation.)150 3190 y Ft(compopt)870 3339 y(compopt)46 | |
d37a4722 | 18798 | b([-o)h Fj(option)p Ft(])f([-DEI])g([+o)h Fj(option)p |
e59452c7 | 18799 | Ft(])e([)p Fj(name)p Ft(])630 3489 y Fu(Mo)s(dify)33 |
6e51e0d0 CR |
18800 | b(completion)h(options)g(for)f(eac)m(h)h Fr(name)39 b |
18801 | Fu(according)34 b(to)g(the)f Fr(option)p Fu(s,)i(or)e(for)g(the)630 | |
e59452c7 | 18802 | 3598 y(curren)m(tly-executing)46 b(completion)f(if)f(no)f |
6e51e0d0 | 18803 | Fr(name)5 b Fu(s)44 b(are)h(supplied.)80 b(If)43 b(no)h |
e59452c7 | 18804 | Fr(option)p Fu(s)h(are)630 3708 y(giv)m(en,)30 b(displa)m(y)e(the)g |
6e51e0d0 | 18805 | (completion)h(options)g(for)e(eac)m(h)i Fr(name)34 b |
e59452c7 | 18806 | Fu(or)27 b(the)i(curren)m(t)e(completion.)630 3818 y(The)f(p)s(ossible) |
d37a4722 | 18807 | g(v)-5 b(alues)27 b(of)f Fr(option)h Fu(are)g(those)g(v)-5 |
602eae4d | 18808 | b(alid)26 b(for)g(the)h Ft(complete)d Fu(builtin)i(describ)s(ed)630 |
e59452c7 | 18809 | 3927 y(ab)s(o)m(v)m(e.)41 b(The)27 b Ft(-D)f Fu(option)i(indicates)g |
a6ae8f35 | 18810 | (that)g(other)f(supplied)f(options)i(should)e(apply)h(to)h(the)630 |
e59452c7 CR |
18811 | 4037 y(\\default")33 b(command)f(completion;)i(that)f(is,)g(completion) |
18812 | g(attempted)g(on)f(a)g(command)630 4146 y(for)g(whic)m(h)g(no)g | |
a6ae8f35 | 18813 | (completion)i(has)e(previously)g(b)s(een)g(de\014ned.)45 |
e59452c7 | 18814 | b(The)32 b Ft(-E)f Fu(option)i(indicates)630 4256 y(that)23 |
a6ae8f35 | 18815 | b(other)f(supplied)e(options)j(should)e(apply)g(to)i(\\empt)m(y")g |
e59452c7 | 18816 | (command)f(completion;)k(that)630 4366 y(is,)36 b(completion)g |
a6ae8f35 | 18817 | (attempted)g(on)e(a)h(blank)g(line.)54 b(The)34 b Ft(-I)g |
e59452c7 | 18818 | Fu(option)h(indicates)g(that)h(other)630 4475 y(supplied)23 |
e230f997 | 18819 | b(options)i(should)f(apply)g(to)i(completion)g(on)e(the)h(initial)h |
e59452c7 | 18820 | (non-assignmen)m(t)f(w)m(ord)630 4585 y(on)37 b(the)f(line,)j(or)e |
a6ae8f35 CR |
18821 | (after)g(a)g(command)f(delimiter)i(suc)m(h)e(as)h(`)p |
18822 | Ft(;)p Fu(')g(or)f(`)p Ft(|)p Fu(',)j(whic)m(h)e(is)f(usually)630 | |
e59452c7 | 18823 | 4694 y(command)30 b(name)h(completion.)630 4844 y(If)k(m)m(ultiple)i |
b52e30b8 | 18824 | (options)f(are)g(supplied,)g(the)g Ft(-D)g Fu(option)g(tak)m(es)h |
e59452c7 | 18825 | (precedence)g(o)m(v)m(er)g Ft(-E)p Fu(,)g(and)630 4954 |
b52e30b8 | 18826 | y(b)s(oth)30 b(tak)m(e)i(precedence)e(o)m(v)m(er)i Ft(-I)630 |
e59452c7 | 18827 | 5103 y Fu(The)23 b(return)g(v)-5 b(alue)25 b(is)f(true)g(unless)f(an)h |
b52e30b8 | 18828 | (in)m(v)-5 b(alid)24 b(option)h(is)f(supplied,)g(an)g(attempt)h(is)f |
e59452c7 | 18829 | (made)630 5213 y(to)32 b(mo)s(dify)f(the)g(options)h(for)f(a)h |
b52e30b8 | 18830 | Fr(name)k Fu(for)31 b(whic)m(h)g(no)g(completion)i(sp)s(eci\014cation)f |
e59452c7 CR |
18831 | (exists,)630 5322 y(or)e(an)h(output)f(error)g(o)s(ccurs.)p |
18832 | eop end | |
fffe80d4 CR |
18833 | %%Page: 149 155 |
18834 | TeXDict begin 149 154 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18835 | b(Command)29 b(Line)i(Editing)2062 b(149)150 299 y Fs(8.8)68 | |
e59452c7 CR |
18836 | b(A)44 b(Programmable)j(Completion)f(Example)150 458 |
18837 | y Fu(The)37 b(most)g(common)g(w)m(a)m(y)i(to)e(obtain)h(additional)g | |
18838 | (completion)g(functionalit)m(y)h(b)s(ey)m(ond)d(the)i(default)150 | |
18839 | 568 y(actions)29 b Ft(complete)d Fu(and)i Ft(compgen)e | |
18840 | Fu(pro)m(vide)i(is)h(to)f(use)g(a)h(shell)f(function)g(and)g(bind)e(it) | |
18841 | j(to)g(a)g(particular)150 677 y(command)h(using)g Ft(complete)e(-F)p | |
18842 | Fu(.)275 829 y(The)j(follo)m(wing)j(function)e(pro)m(vides)g | |
18843 | (completions)i(for)e(the)g Ft(cd)g Fu(builtin.)46 b(It)32 | |
18844 | b(is)h(a)f(reasonably)h(go)s(o)s(d)150 939 y(example)41 | |
b52e30b8 | 18845 | b(of)g(what)f(shell)h(functions)f(m)m(ust)g(do)h(when)e(used)h(for)g |
e59452c7 | 18846 | (completion.)73 b(This)39 b(function)h(uses)150 1049 |
b52e30b8 CR |
18847 | y(the)32 b(w)m(ord)f(passed)g(as)h Ft($2)f Fu(to)h(determine)g(the)f |
18848 | (directory)h(name)g(to)g(complete.)46 b(Y)-8 b(ou)32 | |
e59452c7 | 18849 | b(can)g(also)g(use)g(the)150 1158 y Ft(COMP_WORDS)c Fu(arra)m(y)i(v)-5 |
68d220cb | 18850 | b(ariable;)32 b(the)e(curren)m(t)h(w)m(ord)f(is)g(indexed)g(b)m(y)g |
e59452c7 | 18851 | (the)h Ft(COMP_CWORD)c Fu(v)-5 b(ariable.)275 1310 y(The)42 |
8a0829e9 CR |
18852 | b(function)h(relies)h(on)e(the)i Ft(complete)c Fu(and)j |
18853 | Ft(compgen)e Fu(builtins)h(to)i(do)f(m)m(uc)m(h)g(of)g(the)h(w)m(ork,) | |
e59452c7 | 18854 | 150 1420 y(adding)25 b(only)h(the)g(things)g(that)g(the)g(Bash)g |
8a0829e9 | 18855 | Ft(cd)f Fu(do)s(es)g(b)s(ey)m(ond)g(accepting)j(basic)e(directory)g |
e59452c7 CR |
18856 | (names:)38 b(tilde)150 1529 y(expansion)22 b(\(see)h(Section)g(3.5.2)g |
18857 | ([Tilde)g(Expansion],)g(page)g(25\),)i(searc)m(hing)e(directories)g(in) | |
18858 | e Fr($CDP)-8 b(A)g(TH)p Fu(,)150 1639 y(whic)m(h)21 b(is)h(describ)s | |
18859 | (ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)h(4.1)f([Bourne)g(Shell)f | |
18860 | (Builtins],)j(page)e(47\),)j(and)c(basic)h(supp)s(ort)150 | |
18861 | 1748 y(for)31 b(the)h Ft(cdable_vars)d Fu(shell)i(option)h(\(see)h | |
18862 | (Section)f(4.3.2)i([The)d(Shopt)g(Builtin],)i(page)f(70\).)46 | |
18863 | b Ft(_comp_)150 1858 y(cd)30 b Fu(mo)s(di\014es)g(the)h(v)-5 | |
8a0829e9 CR |
18864 | b(alue)31 b(of)g Fr(IFS)36 b Fu(so)31 b(that)g(it)g(con)m(tains)h(only) |
18865 | f(a)g(newline)g(to)h(accommo)s(date)g(\014le)f(names)150 | |
e59452c7 | 18866 | 1968 y(con)m(taining)i(spaces)g(and)e(tabs)h({)g Ft(compgen)e |
6e51e0d0 | 18867 | Fu(prin)m(ts)h(the)h(p)s(ossible)f(completions)i(it)g(generates)g(one)f |
e59452c7 | 18868 | (p)s(er)150 2077 y(line.)275 2229 y(P)m(ossible)24 b(completions)h(go)g |
6e51e0d0 CR |
18869 | (in)m(to)g(the)f Fr(COMPREPL)-8 b(Y)36 b Fu(arra)m(y)24 |
18870 | b(v)-5 b(ariable,)26 b(one)e(completion)i(p)s(er)c(arra)m(y)150 | |
e59452c7 | 18871 | 2339 y(elemen)m(t.)42 b(The)30 b(programmable)g(completion)i(system)e |
6e51e0d0 | 18872 | (retriev)m(es)h(the)g(completions)g(from)f(there)g(when)150 |
e59452c7 CR |
18873 | 2448 y(the)h(function)f(returns.)390 2600 y Ft(#)47 b(A)h(completion)d |
18874 | (function)g(for)i(the)g(cd)g(builtin)390 2710 y(#)g(based)g(on)g(the)g | |
e6983002 | 18875 | (cd)g(completion)e(function)h(from)g(the)h(bash_completion)d(package) |
e59452c7 CR |
18876 | 390 2819 y(_comp_cd\(\))390 2929 y({)581 3039 y(local)i(IFS=$')g |
18877 | (\\t\\n')190 b(#)47 b(normalize)f(IFS)581 3148 y(local)g(cur)h | |
18878 | (_skipdot)f(_cdpath)581 3258 y(local)g(i)i(j)f(k)581 | |
18879 | 3477 y(#)g(Tilde)g(expansion,)e(which)h(also)h(expands)f(tilde)g(to)h | |
18880 | (full)g(pathname)581 3587 y(case)g("$2")f(in)581 3696 | |
18881 | y(\\~*\))190 b(eval)46 b(cur="$2")g(;;)581 3806 y(*\))286 | |
18882 | b(cur=$2)46 b(;;)581 3915 y(esac)581 4134 y(#)h(no)h(cdpath)e(or)h | |
e6983002 | 18883 | (absolute)e(pathname)h(--)h(straight)f(directory)f(completion)581 |
e59452c7 CR |
18884 | 4244 y(if)i([[)g(-z)g("${CDPATH:-}")e(]])i(||)g([[)g("$cur")f(==)h |
18885 | (@\(./*|../*|/*\))d(]];)j(then)772 4354 y(#)g(compgen)f(prints)g(paths) | |
e6983002 | 18886 | h(one)f(per)h(line;)g(could)f(also)h(use)g(while)f(loop)772 |
e59452c7 CR |
18887 | 4463 y(IFS=$'\\n')772 4573 y(COMPREPLY=\()f($\(compgen)g(-d)i(--)g |
18888 | ("$cur"\))f(\))772 4682 y(IFS=$')g(\\t\\n')581 4792 y(#)h | |
e6983002 | 18889 | (CDPATH+directories)c(in)k(the)g(current)f(directory)f(if)j(not)e(in)i |
e59452c7 CR |
18890 | (CDPATH)581 4902 y(else)772 5011 y(IFS=$'\\n')772 5121 |
18891 | y(_skipdot=false)772 5230 y(#)f(preprocess)e(CDPATH)h(to)i(convert)d | |
18892 | (null)i(directory)e(names)i(to)g(.)772 5340 y(_cdpath=${CDPATH/#:/.:})p | |
18893 | eop end | |
fffe80d4 CR |
18894 | %%Page: 150 156 |
18895 | TeXDict begin 150 155 bop 150 -116 a Fu(Chapter)30 b(8:)41 | |
18896 | b(Command)29 b(Line)i(Editing)2062 b(150)772 299 y Ft | |
e59452c7 CR |
18897 | (_cdpath=${_cdpath//::/:.)o(:})772 408 y(_cdpath=${_cdpath/\045:/:.}) |
18898 | 772 518 y(for)47 b(i)g(in)g(${_cdpath//:/$'\\n'};)c(do)963 | |
18899 | 628 y(if)k([[)g($i)g(-ef)g(.)h(]];)f(then)f(_skipdot=true;)e(fi)963 | |
18900 | 737 y(k="${#COMPREPLY[@]}")963 847 y(for)j(j)g(in)g($\()g(compgen)f(-d) | |
18901 | h(--)h("$i/$cur")d(\);)i(do)1154 956 y(COMPREPLY[k++]=${j#$i/})375 | |
18902 | b(#)48 b(cut)f(off)f(directory)963 1066 y(done)772 1176 | |
18903 | y(done)772 1285 y($_skipdot)f(||)i(COMPREPLY+=\()e($\(compgen)g(-d)i | |
18904 | (--)g("$cur"\))f(\))772 1395 y(IFS=$')g(\\t\\n')581 1504 | |
18905 | y(fi)581 1724 y(#)h(variable)f(names)g(if)h(appropriate)e(shell)i | |
18906 | (option)f(set)h(and)f(no)i(completions)581 1833 y(if)f(shopt)f(-q)i | |
18907 | (cdable_vars)c(&&)k([[)f(${#COMPREPLY[@]})c(-eq)k(0)g(]];)g(then)772 | |
18908 | 1943 y(COMPREPLY=\()e($\(compgen)g(-v)i(--)g("$cur"\))f(\))581 | |
18909 | 2052 y(fi)581 2271 y(return)g(0)390 2381 y(})275 2516 | |
18910 | y Fu(W)-8 b(e)31 b(install)g(the)g(completion)h(function)e(using)f(the) | |
18911 | i Ft(-F)f Fu(option)h(to)g Ft(complete)p Fu(:)390 2650 | |
18912 | y Ft(#)47 b(Tell)g(readline)f(to)h(quote)f(appropriate)f(and)i(append)f | |
18913 | (slashes)g(to)h(directories;)390 2760 y(#)g(use)g(the)g(bash)g(default) | |
18914 | f(completion)f(for)i(other)f(arguments)390 2869 y(complete)g(-o)h | |
18915 | (filenames)e(-o)i(nospace)f(-o)h(bashdefault)e(-F)i(_comp_cd)f(cd)150 | |
18916 | 3004 y Fu(Since)33 b(w)m(e'd)g(lik)m(e)i(Bash)e(and)f(Readline)i(to)g | |
18917 | (tak)m(e)g(care)g(of)f(some)h(of)f(the)g(other)h(details)g(for)e(us,)i | |
18918 | (w)m(e)f(use)150 3113 y(sev)m(eral)43 b(other)g(options)f(to)h(tell)g | |
18919 | (Bash)f(and)f(Readline)i(what)f(to)g(do.)76 b(The)41 | |
18920 | b Ft(-o)30 b(filenames)39 b Fu(option)150 3223 y(tells)j(Readline)g | |
18921 | (that)g(the)f(p)s(ossible)g(completions)h(should)f(b)s(e)f(treated)i | |
18922 | (as)g(\014lenames,)i(and)d(quoted)150 3333 y(appropriately)-8 | |
18923 | b(.)53 b(That)34 b(option)h(will)g(also)g(cause)g(Readline)g(to)g(app)s | |
18924 | (end)e(a)h(slash)g(to)h(\014lenames)g(it)g(can)150 3442 | |
18925 | y(determine)i(are)g(directories)h(\(whic)m(h)g(is)f(wh)m(y)f(w)m(e)i | |
18926 | (migh)m(t)f(w)m(an)m(t)h(to)g(extend)f Ft(_comp_cd)e | |
18927 | Fu(to)i(app)s(end)f(a)150 3552 y(slash)22 b(if)g(w)m(e're)h(using)f | |
18928 | (directories)h(found)e(via)i Fr(CDP)-8 b(A)g(TH)10 b | |
18929 | Fu(:)37 b(Readline)23 b(can't)g(tell)g(those)g(completions)h(are)150 | |
18930 | 3661 y(directories\).)45 b(The)31 b Ft(-o)f(nospace)f | |
18931 | Fu(option)j(tells)g(Readline)g(to)h(not)e(app)s(end)f(a)i(space)g(c)m | |
18932 | (haracter)h(to)f(the)150 3771 y(directory)c(name,)h(in)f(case)h(w)m(e)f | |
18933 | (w)m(an)m(t)h(to)f(app)s(end)f(to)h(it.)41 b(The)27 b | |
18934 | Ft(-o)j(bashdefault)25 b Fu(option)j(brings)f(in)h(the)150 | |
18935 | 3880 y(rest)h(of)f(the)h Ft(")p Fu(Bash)f(default)p Ft(")h | |
6e51e0d0 | 18936 | Fu(completions)g({)g(p)s(ossible)f(completion)i(that)f(Bash)f(adds)g |
e59452c7 | 18937 | (to)h(the)g(default)150 3990 y(Readline)f(set.)40 b(These)28 |
9128f932 | 18938 | b(include)f(things)g(lik)m(e)i(command)e(name)h(completion,)h(v)-5 |
e59452c7 | 18939 | b(ariable)28 b(completion)h(for)150 4100 y(w)m(ords)e(b)s(eginning)h |
9128f932 CR |
18940 | (with)f(`)p Ft($)p Fu(')h(or)g(`)p Ft(${)p Fu(',)h(completions)g(con)m |
18941 | (taining)g(pathname)f(expansion)g(patterns)g(\(see)150 | |
e59452c7 CR |
18942 | 4209 y(Section)j(3.5.8)h([Filename)g(Expansion],)e(page)i(35\),)f(and)f |
18943 | (so)h(on.)275 4344 y(Once)39 b(installed)i(using)e Ft(complete)p | |
9128f932 | 18944 | Fu(,)h Ft(_comp_cd)d Fu(will)j(b)s(e)g(called)g(ev)m(ery)h(time)f(w)m |
e59452c7 CR |
18945 | (e)g(attempt)h(w)m(ord)150 4453 y(completion)32 b(for)e(a)h |
18946 | Ft(cd)e Fu(command.)275 4588 y(Man)m(y)34 b(more)g(examples)g({)g(an)g | |
a6ae8f35 | 18947 | (extensiv)m(e)h(collection)i(of)c(completions)i(for)f(most)g(of)g(the)g |
e59452c7 | 18948 | (common)150 4697 y(GNU,)g(Unix,)h(and)d(Lin)m(ux)h(commands)g({)h(are)g |
a6ae8f35 | 18949 | (a)m(v)-5 b(ailable)36 b(as)e(part)f(of)h(the)f(bash)p |
e59452c7 CR |
18950 | 2943 4697 28 4 v 39 w(completion)i(pro)5 b(ject.)150 |
18951 | 4807 y(This)33 b(is)h(installed)h(b)m(y)f(default)g(on)g(man)m(y)h | |
a6ae8f35 | 18952 | (GNU/Lin)m(ux)f(distributions.)51 b(Originally)35 b(written)f(b)m(y)g |
e59452c7 | 18953 | (Ian)150 4917 y(Macdonald,)48 b(the)c(pro)5 b(ject)44 |
9128f932 CR |
18954 | b(no)m(w)g(liv)m(es)h(at)f Ft(https:)11 b(/)g(/)g(github)g(.)g(com)g(/) |
18955 | g(sc)o(op)g(/)f(bash)o(-co)o(mple)o(tion)g(/)h Fu(.)150 | |
e59452c7 CR |
18956 | 5026 y(There)30 b(are)h(p)s(orts)e(for)h(other)h(systems)f(suc)m(h)g |
18957 | (as)h(Solaris)g(and)f(Mac)h(OS)f(X.)275 5161 y(An)54 | |
18958 | b(older)h(v)m(ersion)h(of)f(the)g(bash)p 1532 5161 V | |
9128f932 | 18959 | 40 w(completion)h(pac)m(k)-5 b(age)57 b(is)e(distributed)f(with)h(bash) |
e59452c7 | 18960 | f(in)h(the)150 5270 y Ft(examples/complete)26 b Fu(sub)s(directory)-8 |
a6ae8f35 | 18961 | b(.)p eop end |
fffe80d4 CR |
18962 | %%Page: 151 157 |
18963 | TeXDict begin 151 156 bop 3614 -116 a Fu(151)150 299 | |
037a8b7f | 18964 | y Fp(9)80 b(Using)53 b(History)g(In)l(teractiv)l(ely)150 |
a2851804 | 18965 | 554 y Fu(This)42 b(c)m(hapter)h(describ)s(es)f(ho)m(w)g(to)h(use)g(the) |
6e51e0d0 | 18966 | f Fm(gnu)h Fu(History)g(Library)e(in)m(teractiv)m(ely)-8 |
a2851804 | 18967 | b(,)50 b(from)42 b(a)h(user's)150 664 y(standp)s(oin)m(t.)76 |
37c41ab1 | 18968 | b(It)42 b(should)f(b)s(e)h(considered)g(a)g(user's)g(guide.)76 |
6e51e0d0 | 18969 | b(F)-8 b(or)43 b(information)f(on)g(using)g(the)g Fm(gnu)150 |
a2851804 CR |
18970 | 774 y Fu(History)31 b(Library)f(in)g(other)g(programs,)g(see)h(the)g |
18971 | Fm(gnu)f Fu(Readline)h(Library)f(Man)m(ual.)150 1025 | |
18972 | y Fs(9.1)68 b(Bash)45 b(History)h(F)-11 b(acilities)150 | |
18973 | 1184 y Fu(When)44 b(the)g Ft(-o)30 b(history)42 b Fu(option)i(to)h(the) | |
6e51e0d0 | 18974 | f Ft(set)f Fu(builtin)h(is)g(enabled)g(\(see)g(Section)h(4.3.1)h([The)e |
e59452c7 | 18975 | (Set)150 1294 y(Builtin],)32 b(page)g(66\),)h(the)e(shell)h(pro)m |
6e51e0d0 | 18976 | (vides)f(access)h(to)g(the)f Fr(command)g(history)p Fu(,)h(the)f(list)h |
a2851804 | 18977 | (of)f(commands)150 1404 y(previously)h(t)m(yp)s(ed.)47 |
6e51e0d0 CR |
18978 | b(The)33 b(v)-5 b(alue)33 b(of)f(the)h Ft(HISTSIZE)e |
18979 | Fu(shell)h(v)-5 b(ariable)34 b(is)f(used)e(as)i(the)g(n)m(um)m(b)s(er)e | |
a2851804 | 18980 | (of)i(com-)150 1513 y(mands)i(to)i(sa)m(v)m(e)h(in)e(a)g(history)h |
6e51e0d0 | 18981 | (list.)58 b(The)36 b(text)h(of)g(the)f(last)h Ft($HISTSIZE)d |
a2851804 | 18982 | Fu(commands)i(\(default)g(500\))150 1623 y(is)h(sa)m(v)m(ed.)61 |
6e51e0d0 CR |
18983 | b(The)36 b(shell)h(stores)h(eac)m(h)g(command)e(in)h(the)g(history)g |
18984 | (list)g(prior)f(to)i(parameter)f(and)f(v)-5 b(ari-)150 | |
a2851804 | 18985 | 1732 y(able)33 b(expansion)g(but)f(after)h(history)f(expansion)h(is)g |
6e51e0d0 | 18986 | (p)s(erformed,)e(sub)5 b(ject)33 b(to)g(the)g(v)-5 b(alues)33 |
a2851804 CR |
18987 | b(of)g(the)g(shell)150 1842 y(v)-5 b(ariables)31 b Ft(HISTIGNORE)d |
18988 | Fu(and)h Ft(HISTCONTROL)p Fu(.)275 1984 y(When)g(the)g(shell)h(starts)g | |
37c41ab1 | 18989 | (up,)f(the)h(history)f(is)h(initialized)h(from)e(the)h(\014le)f(named)g |
a2851804 | 18990 | (b)m(y)h(the)f Ft(HISTFILE)150 2093 y Fu(v)-5 b(ariable)26 |
6e51e0d0 CR |
18991 | b(\(default)g Ft(~/.bash_history)p Fu(\).)35 b(The)24 |
18992 | b(\014le)i(named)e(b)m(y)h(the)h(v)-5 b(alue)25 b(of)h | |
a2851804 | 18993 | Ft(HISTFILE)c Fu(is)k(truncated,)150 2203 y(if)42 b(necessary)-8 |
37c41ab1 CR |
18994 | b(,)45 b(to)e(con)m(tain)g(no)f(more)g(than)f(the)h(n)m(um)m(b)s(er)f |
18995 | (of)h(lines)g(sp)s(eci\014ed)f(b)m(y)h(the)g(v)-5 b(alue)42 | |
a2851804 | 18996 | b(of)g(the)150 2312 y Ft(HISTFILESIZE)28 b Fu(v)-5 b(ariable.)46 |
9f178efb | 18997 | b(When)31 b(a)h(shell)g(with)g(history)f(enabled)h(exits,)h(the)f(last) |
a2851804 | 18998 | h Ft($HISTSIZE)c Fu(lines)150 2422 y(are)35 b(copied)g(from)g(the)g |
9f178efb | 18999 | (history)f(list)i(to)f(the)g(\014le)g(named)f(b)m(y)h |
6e51e0d0 | 19000 | Ft($HISTFILE)p Fu(.)51 b(If)35 b(the)g Ft(histappend)d |
a2851804 | 19001 | Fu(shell)150 2532 y(option)26 b(is)g(set)g(\(see)h(Section)f(4.2)h |
e59452c7 | 19002 | ([Bash)f(Builtins],)h(page)g(54\),)h(the)e(lines)g(are)g(app)s(ended)e |
a2851804 | 19003 | (to)i(the)g(history)150 2641 y(\014le,)36 b(otherwise)f(the)g(history)f |
6e51e0d0 CR |
19004 | (\014le)h(is)f(o)m(v)m(erwritten.)55 b(If)34 b Ft(HISTFILE)e |
19005 | Fu(is)j(unset,)g(or)g(if)f(the)h(history)f(\014le)h(is)150 | |
a2851804 | 19006 | 2751 y(un)m(writable,)f(the)f(history)g(is)g(not)h(sa)m(v)m(ed.)49 |
9f178efb | 19007 | b(After)34 b(sa)m(ving)g(the)f(history)-8 b(,)34 b(the)g(history)f |
a2851804 | 19008 | (\014le)g(is)g(truncated)150 2860 y(to)g(con)m(tain)h(no)f(more)g(than) |
6e51e0d0 | 19009 | f Ft($HISTFILESIZE)d Fu(lines.)48 b(If)33 b Ft(HISTFILESIZE)c |
a2851804 | 19010 | Fu(is)k(unset,)g(or)f(set)i(to)f(n)m(ull,)h(a)150 2970 |
9f178efb CR |
19011 | y(non-n)m(umeric)c(v)-5 b(alue,)31 b(or)f(a)h(n)m(umeric)f(v)-5 |
19012 | b(alue)31 b(less)g(than)f(zero,)h(the)g(history)f(\014le)h(is)f(not)h | |
a2851804 | 19013 | (truncated.)275 3112 y(If)g(the)h Ft(HISTTIMEFORMAT)d |
6e51e0d0 | 19014 | Fu(is)j(set,)h(the)f(time)h(stamp)f(information)g(asso)s(ciated)i(with) |
a2851804 | 19015 | e(eac)m(h)h(history)150 3221 y(en)m(try)d(is)h(written)f(to)h(the)f |
d3ad40de | 19016 | (history)h(\014le,)f(mark)m(ed)h(with)f(the)g(history)g(commen)m(t)h(c) |
a2851804 | 19017 | m(haracter.)43 b(When)30 b(the)150 3331 y(history)22 |
d3ad40de CR |
19018 | b(\014le)h(is)g(read,)h(lines)f(b)s(eginning)e(with)i(the)f(history)h |
19019 | (commen)m(t)g(c)m(haracter)h(follo)m(w)m(ed)h(immediately)150 | |
a2851804 | 19020 | 3440 y(b)m(y)30 b(a)h(digit)g(are)g(in)m(terpreted)g(as)f(timestamps)h |
037a8b7f | 19021 | (for)f(the)h(follo)m(wing)h(history)e(en)m(try)-8 b(.)275 |
a2851804 | 19022 | 3582 y(The)19 b(builtin)h(command)g Ft(fc)g Fu(ma)m(y)h(b)s(e)f(used)f |
037a8b7f | 19023 | (to)i(list)g(or)g(edit)g(and)e(re-execute)j(a)f(p)s(ortion)f(of)g(the)h |
a2851804 | 19024 | (history)150 3692 y(list.)41 b(The)27 b Ft(history)f |
037a8b7f | 19025 | Fu(builtin)i(ma)m(y)h(b)s(e)e(used)g(to)i(displa)m(y)g(or)f(mo)s(dify)f |
a2851804 | 19026 | (the)h(history)g(list)h(and)f(manipulate)150 3801 y(the)j(history)g |
037a8b7f CR |
19027 | (\014le.)42 b(When)31 b(using)f(command-line)h(editing,)h(searc)m(h)f |
19028 | (commands)g(are)g(a)m(v)-5 b(ailable)33 b(in)e(eac)m(h)150 | |
a2851804 | 19029 | 3911 y(editing)45 b(mo)s(de)g(that)g(pro)m(vide)g(access)h(to)f(the)g |
037a8b7f | 19030 | (history)f(list)i(\(see)f(Section)h(8.4.2)g([Commands)e(F)-8 |
fffe80d4 | 19031 | b(or)150 4020 y(History],)31 b(page)h(133\).)275 4162 |
037a8b7f CR |
19032 | y(The)47 b(shell)i(allo)m(ws)h(con)m(trol)f(o)m(v)m(er)h(whic)m(h)e |
19033 | (commands)g(are)h(sa)m(v)m(ed)g(on)f(the)h(history)f(list.)95 | |
a2851804 | 19034 | b(The)150 4272 y Ft(HISTCONTROL)25 b Fu(and)j Ft(HISTIGNORE)e |
037a8b7f | 19035 | Fu(v)-5 b(ariables)29 b(ma)m(y)h(b)s(e)d(set)j(to)f(cause)g(the)g |
a2851804 | 19036 | (shell)f(to)i(sa)m(v)m(e)g(only)f(a)g(subset)150 4381 |
037a8b7f CR |
19037 | y(of)e(the)g(commands)f(en)m(tered.)40 b(The)26 b Ft(cmdhist)f |
19038 | Fu(shell)i(option,)h(if)f(enabled,)g(causes)h(the)e(shell)h(to)h | |
a2851804 | 19039 | (attempt)150 4491 y(to)23 b(sa)m(v)m(e)h(eac)m(h)f(line)g(of)f(a)h(m)m |
037a8b7f | 19040 | (ulti-line)g(command)f(in)g(the)h(same)f(history)g(en)m(try)-8 |
a2851804 | 19041 | b(,)25 b(adding)d(semicolons)h(where)150 4600 y(necessary)37 |
037a8b7f CR |
19042 | b(to)f(preserv)m(e)h(syn)m(tactic)h(correctness.)58 b(The)36 |
19043 | b Ft(lithist)e Fu(shell)i(option)h(causes)g(the)f(shell)g(to)150 | |
a2851804 CR |
19044 | 4710 y(sa)m(v)m(e)41 b(the)e(command)g(with)f(em)m(b)s(edded)g |
19045 | (newlines)h(instead)g(of)g(semicolons.)68 b(The)39 b | |
19046 | Ft(shopt)e Fu(builtin)i(is)150 4820 y(used)30 b(to)i(set)g(these)g | |
19047 | (options.)43 b(See)32 b(Section)g(4.3.2)h([The)e(Shopt)f(Builtin],)j | |
e59452c7 | 19048 | (page)f(70,)g(for)f(a)h(description)150 4929 y(of)f Ft(shopt)p |
a2851804 CR |
19049 | Fu(.)150 5181 y Fs(9.2)68 b(Bash)45 b(History)h(Builtins)150 |
19050 | 5340 y Fu(Bash)31 b(pro)m(vides)f(t)m(w)m(o)i(builtin)e(commands)g | |
19051 | (whic)m(h)g(manipulate)g(the)h(history)f(list)h(and)f(history)g | |
19052 | (\014le.)p eop end | |
fffe80d4 CR |
19053 | %%Page: 152 158 |
19054 | TeXDict begin 152 157 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
19055 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(152)150 | |
d37a4722 CR |
19056 | 299 y Ft(fc)870 430 y(fc)47 b([-e)g Fj(ename)p Ft(])f([-lnr])g([)p |
19057 | Fj(first)p Ft(])g([)p Fj(last)p Ft(])870 540 y(fc)h(-s)g([)p | |
a2851804 | 19058 | Fj(pat)p Ft(=)p Fj(rep)p Ft(])f([)p Fj(command)p Ft(])630 |
d37a4722 CR |
19059 | 671 y Fu(The)32 b(\014rst)g(form)g(selects)j(a)e(range)g(of)f(commands) |
19060 | h(from)f Fr(\014rst)i Fu(to)f Fr(last)j Fu(from)c(the)h(history)630 | |
19061 | 781 y(list)41 b(and)f(displa)m(ys)g(or)g(edits)h(and)e(re-executes)j | |
19062 | (them.)71 b(Both)40 b Fr(\014rst)i Fu(and)e Fr(last)j | |
19063 | Fu(ma)m(y)e(b)s(e)630 891 y(sp)s(eci\014ed)33 b(as)h(a)g(string)g(\(to) | |
19064 | h(lo)s(cate)h(the)e(most)g(recen)m(t)h(command)f(b)s(eginning)f(with)g | |
19065 | (that)630 1000 y(string\))28 b(or)g(as)h(a)f(n)m(um)m(b)s(er)f(\(an)h | |
19066 | (index)g(in)m(to)h(the)f(history)g(list,)h(where)f(a)g(negativ)m(e)i(n) | |
19067 | m(um)m(b)s(er)630 1110 y(is)g(used)g(as)h(an)f(o\013set)h(from)f(the)h | |
19068 | (curren)m(t)f(command)g(n)m(um)m(b)s(er\).)630 1241 y(When)j(listing,)h | |
19069 | (a)f Fr(\014rst)h Fu(or)f Fr(last)j Fu(of)d(0)g(is)g(equiv)-5 | |
19070 | b(alen)m(t)34 b(to)g(-1)f(and)g(-0)g(is)g(equiv)-5 b(alen)m(t)34 | |
19071 | b(to)g(the)630 1351 y(curren)m(t)k(command)h(\(usually)g(the)g | |
19072 | Ft(fc)f Fu(command\);)43 b(otherwise)c(0)g(is)g(equiv)-5 | |
19073 | b(alen)m(t)40 b(to)f(-1)630 1461 y(and)30 b(-0)h(is)f(in)m(v)-5 | |
19074 | b(alid.)630 1592 y(If)33 b Fr(last)j Fu(is)e(not)f(sp)s(eci\014ed,)h | |
19075 | (it)g(is)f(set)h(to)g Fr(\014rst)p Fu(.)49 b(If)33 b | |
19076 | Fr(\014rst)i Fu(is)e(not)h(sp)s(eci\014ed,)f(it)h(is)g(set)g(to)g(the) | |
19077 | 630 1702 y(previous)g(command)f(for)h(editing)h(and)e | |
19078 | Fq(\000)p Fu(16)i(for)f(listing.)53 b(If)33 b(the)h Ft(-l)g | |
19079 | Fu(\015ag)g(is)g(giv)m(en,)j(the)630 1811 y(commands)27 | |
19080 | b(are)h(listed)g(on)f(standard)g(output.)39 b(The)27 | |
19081 | b Ft(-n)g Fu(\015ag)h(suppresses)e(the)h(command)630 | |
19082 | 1921 y(n)m(um)m(b)s(ers)h(when)h(listing.)42 b(The)29 | |
19083 | b Ft(-r)g Fu(\015ag)i(rev)m(erses)f(the)g(order)f(of)i(the)f(listing.) | |
19084 | 41 b(Otherwise,)630 2030 y(the)i(editor)h(giv)m(en)g(b)m(y)f | |
19085 | Fr(ename)49 b Fu(is)43 b(in)m(v)m(ok)m(ed)i(on)e(a)g(\014le)h(con)m | |
19086 | (taining)g(those)g(commands.)630 2140 y(If)c Fr(ename)46 | |
19087 | b Fu(is)40 b(not)h(giv)m(en,)j(the)d(v)-5 b(alue)41 b(of)f(the)h(follo) | |
19088 | m(wing)h(v)-5 b(ariable)41 b(expansion)f(is)g(used:)630 | |
19089 | 2250 y Ft(${FCEDIT:-${EDITOR:-vi}})o Fu(.)34 b(This)25 | |
19090 | b(sa)m(ys)i(to)g(use)f(the)g(v)-5 b(alue)27 b(of)f(the)h | |
19091 | Ft(FCEDIT)d Fu(v)-5 b(ariable)630 2359 y(if)33 b(set,)i(or)e(the)h(v)-5 | |
19092 | b(alue)33 b(of)h(the)f Ft(EDITOR)f Fu(v)-5 b(ariable)34 | |
19093 | b(if)f(that)h(is)f(set,)i(or)e Ft(vi)f Fu(if)i(neither)f(is)g(set.)630 | |
19094 | 2469 y(When)d(editing)h(is)g(complete,)h(the)e(edited)h(commands)f(are) | |
19095 | h(ec)m(ho)s(ed)g(and)e(executed.)630 2600 y(In)34 b(the)g(second)g | |
19096 | (form,)h Fr(command)j Fu(is)c(re-executed)i(after)f(eac)m(h)g(instance) | |
19097 | g(of)f Fr(pat)j Fu(in)d(the)630 2710 y(selected)29 b(command)e(is)h | |
19098 | (replaced)f(b)m(y)h Fr(rep)p Fu(.)39 b Fr(command)31 | |
19099 | b Fu(is)c(in)m(terpreted)h(the)f(same)h(as)g Fr(\014rst)630 | |
19100 | 2819 y Fu(ab)s(o)m(v)m(e.)630 2951 y(A)j(useful)f(alias)i(to)g(use)e | |
19101 | (with)h(the)g Ft(fc)f Fu(command)h(is)g Ft(r='fc)e(-s')p | |
19102 | Fu(,)h(so)h(that)h(t)m(yping)f(`)p Ft(r)f(cc)p Fu(')630 | |
19103 | 3061 y(runs)35 b(the)h(last)h(command)f(b)s(eginning)g(with)g | |
19104 | Ft(cc)f Fu(and)h(t)m(yping)g(`)p Ft(r)p Fu(')h(re-executes)h(the)e | |
19105 | (last)630 3170 y(command)30 b(\(see)h(Section)h(6.6)f([Aliases],)h | |
e59452c7 | 19106 | (page)g(99\).)150 3324 y Ft(history)870 3455 y(history)46 |
d37a4722 CR |
19107 | b([)p Fj(n)p Ft(])870 3565 y(history)g(-c)870 3674 y(history)g(-d)h |
19108 | Fj(offset)870 3784 y Ft(history)f(-d)h Fj(start)p Ft(-)p | |
19109 | Fj(end)870 3893 y Ft(history)f([-anrw])g([)p Fj(filename)p | |
19110 | Ft(])870 4003 y(history)g(-ps)h Fj(arg)630 4134 y Fu(With)26 | |
6e51e0d0 CR |
19111 | b(no)g(options,)h(displa)m(y)f(the)g(history)g(list)g(with)f(line)h(n)m |
19112 | (um)m(b)s(ers.)38 b(Lines)26 b(pre\014xed)e(with)630 | |
d37a4722 | 19113 | 4244 y(a)35 b(`)p Ft(*)p Fu(')g(ha)m(v)m(e)h(b)s(een)e(mo)s(di\014ed.) |
6e51e0d0 | 19114 | 53 b(An)34 b(argumen)m(t)h(of)g Fr(n)f Fu(lists)i(only)f(the)g(last)g |
d37a4722 | 19115 | Fr(n)f Fu(lines.)54 b(If)35 b(the)630 4354 y(shell)30 |
6e51e0d0 | 19116 | b(v)-5 b(ariable)31 b Ft(HISTTIMEFORMAT)26 b Fu(is)k(set)h(and)e(not)i |
37c41ab1 | 19117 | (n)m(ull,)f(it)h(is)f(used)f(as)h(a)h(format)f(string)630 |
d37a4722 | 19118 | 4463 y(for)36 b Fr(strftime)41 b Fu(to)36 b(displa)m(y)g(the)g(time)h |
37c41ab1 | 19119 | (stamp)f(asso)s(ciated)h(with)f(eac)m(h)h(displa)m(y)m(ed)f(history)630 |
d37a4722 | 19120 | 4573 y(en)m(try)-8 b(.)47 b(No)33 b(in)m(terv)m(ening)g(blank)f(is)g |
37c41ab1 | 19121 | (prin)m(ted)g(b)s(et)m(w)m(een)h(the)g(formatted)f(time)h(stamp)g(and) |
d37a4722 CR |
19122 | 630 4682 y(the)e(history)f(line.)630 4814 y(Options,)g(if)h(supplied,)e |
19123 | (ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 4967 | |
6e51e0d0 | 19124 | y Ft(-c)384 b Fu(Clear)23 b(the)g(history)g(list.)39 |
37c41ab1 | 19125 | b(This)22 b(ma)m(y)i(b)s(e)e(com)m(bined)h(with)f(the)h(other)h |
d37a4722 CR |
19126 | (options)1110 5077 y(to)31 b(replace)g(the)g(history)f(list)h |
19127 | (completely)-8 b(.)630 5230 y Ft(-d)30 b Fj(offset)66 | |
7e92fb35 CR |
19128 | b Fu(Delete)38 b(the)f(history)f(en)m(try)h(at)f(p)s(osition)h |
19129 | Fr(o\013set)p Fu(.)59 b(If)36 b Fr(o\013set)j Fu(is)d(p)s(ositiv)m(e,)j | |
d37a4722 | 19130 | (it)1110 5340 y(should)32 b(b)s(e)h(sp)s(eci\014ed)f(as)i(it)g(app)s |
7e92fb35 | 19131 | (ears)e(when)g(the)i(history)f(is)g(displa)m(y)m(ed.)50 |
d37a4722 | 19132 | b(If)p eop end |
fffe80d4 CR |
19133 | %%Page: 153 159 |
19134 | TeXDict begin 153 158 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
19135 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(153)1110 | |
d37a4722 CR |
19136 | 299 y Fr(o\013set)26 b Fu(is)d(negativ)m(e,)k(it)c(is)g(in)m(terpreted) |
19137 | h(as)f(relativ)m(e)i(to)f(one)f(greater)h(than)f(the)1110 | |
19138 | 408 y(last)36 b(history)f(p)s(osition,)h(so)f(negativ)m(e)i(indices)e | |
19139 | (coun)m(t)h(bac)m(k)f(from)g(the)g(end)1110 518 y(of)h(the)g(history)-8 | |
19140 | b(,)37 b(and)e(an)h(index)f(of)h(`)p Ft(-1)p Fu(')f(refers)g(to)i(the)f | |
19141 | (curren)m(t)f Ft(history)1110 628 y(-d)30 b Fu(command.)630 | |
e59452c7 CR |
19142 | 785 y Ft(-d)g Fj(start)p Ft(-)p Fj(end)1110 895 y Fu(Delete)e(the)e |
19143 | (range)h(of)f(history)g(en)m(tries)h(b)s(et)m(w)m(een)f(p)s(ositions)g | |
19144 | Fr(start)j Fu(and)c Fr(end)p Fu(,)1110 1004 y(inclusiv)m(e.)44 | |
19145 | b(P)m(ositiv)m(e)33 b(and)e(negativ)m(e)i(v)-5 b(alues)31 | |
19146 | b(for)g Fr(start)j Fu(and)d Fr(end)j Fu(are)d(in)m(ter-)1110 | |
19147 | 1114 y(preted)f(as)h(describ)s(ed)e(ab)s(o)m(v)m(e.)630 | |
19148 | 1271 y Ft(-a)384 b Fu(App)s(end)28 b(the)i(new)f(history)g(lines)h(to)h | |
19149 | (the)e(history)h(\014le.)41 b(These)29 b(are)h(history)1110 | |
19150 | 1381 y(lines)36 b(en)m(tered)g(since)f(the)h(b)s(eginning)f(of)g(the)h | |
19151 | (curren)m(t)f(Bash)h(session,)h(but)1110 1490 y(not)31 | |
19152 | b(already)g(app)s(ended)d(to)j(the)g(history)f(\014le.)630 | |
19153 | 1648 y Ft(-n)384 b Fu(App)s(end)32 b(the)i(history)f(lines)h(not)g | |
19154 | (already)g(read)g(from)f(the)h(history)f(\014le)h(to)1110 | |
19155 | 1758 y(the)26 b(curren)m(t)f(history)g(list.)40 b(These)25 | |
19156 | b(are)h(lines)g(app)s(ended)e(to)i(the)f(history)h(\014le)1110 | |
19157 | 1867 y(since)31 b(the)f(b)s(eginning)g(of)g(the)h(curren)m(t)f(Bash)h | |
19158 | (session.)630 2025 y Ft(-r)384 b Fu(Read)31 b(the)f(history)g(\014le)h | |
19159 | (and)f(app)s(end)e(its)j(con)m(ten)m(ts)h(to)f(the)g(history)f(list.) | |
19160 | 630 2182 y Ft(-w)384 b Fu(W)-8 b(rite)32 b(out)e(the)h(curren)m(t)f | |
19161 | (history)g(list)h(to)h(the)e(history)g(\014le.)630 2339 | |
19162 | y Ft(-p)384 b Fu(P)m(erform)31 b(history)f(substitution)h(on)f(the)h | |
19163 | Fr(arg)8 b Fu(s)31 b(and)f(displa)m(y)h(the)f(result)h(on)1110 | |
d37a4722 CR |
19164 | 2449 y(the)d(standard)f(output,)i(without)f(storing)g(the)g(results)g |
19165 | (in)g(the)g(history)g(list.)630 2606 y Ft(-s)384 b Fu(The)30 | |
6e51e0d0 | 19166 | b Fr(arg)8 b Fu(s)30 b(are)h(added)f(to)h(the)f(end)g(of)h(the)f |
c302751c | 19167 | (history)h(list)g(as)f(a)h(single)g(en)m(try)-8 b(.)630 |
d37a4722 | 19168 | 2764 y(When)26 b(an)m(y)h(of)f(the)g Ft(-w)p Fu(,)h Ft(-r)p |
6e51e0d0 CR |
19169 | Fu(,)g Ft(-a)p Fu(,)g(or)f Ft(-n)f Fu(options)i(is)f(used,)h(if)f |
19170 | Fr(\014lename)32 b Fu(is)26 b(giv)m(en,)i(then)e(it)h(is)630 | |
d37a4722 | 19171 | 2873 y(used)h(as)g(the)h(history)f(\014le.)40 b(If)28 |
6e51e0d0 | 19172 | b(not,)i(then)e(the)g(v)-5 b(alue)29 b(of)g(the)g Ft(HISTFILE)d |
e59452c7 CR |
19173 | Fu(v)-5 b(ariable)29 b(is)f(used.)630 3007 y(The)34 b(return)g(v)-5 |
19174 | b(alue)35 b(is)g(0)g(unless)f(an)h(in)m(v)-5 b(alid)35 | |
19175 | b(option)g(is)g(encoun)m(tered,)h(an)f(error)f(o)s(ccurs)630 | |
19176 | 3117 y(while)h(reading)g(or)g(writing)f(the)h(history)g(\014le,)h(an)f | |
19177 | (in)m(v)-5 b(alid)36 b Fr(o\013set)h Fu(or)e(range)g(is)g(supplied)630 | |
19178 | 3226 y(as)c(an)g(argumen)m(t)g(to)h Ft(-d)p Fu(,)e(or)h(the)g(history)g | |
19179 | (expansion)f(supplied)g(as)h(an)g(argumen)m(t)g(to)h | |
19180 | Ft(-p)630 3336 y Fu(fails.)150 3575 y Fs(9.3)68 b(History)46 | |
19181 | b(Expansion)150 3734 y Fu(The)f(History)h(library)e(pro)m(vides)i(a)f | |
19182 | (history)g(expansion)g(feature)h(that)g(is)f(similar)h(to)g(the)f | |
19183 | (history)150 3844 y(expansion)g(pro)m(vided)f(b)m(y)h | |
6e51e0d0 | 19184 | Ft(csh)p Fu(.)83 b(This)44 b(section)i(describ)s(es)e(the)h(syn)m(tax)h |
e59452c7 CR |
19185 | (used)e(to)i(manipulate)f(the)150 3953 y(history)30 b(information.)275 |
19186 | 4087 y(History)h(expansions)f(in)m(tro)s(duce)g(w)m(ords)g(from)g(the)h | |
c302751c | 19187 | (history)f(list)h(in)m(to)g(the)g(input)f(stream,)h(making)150 |
e59452c7 | 19188 | 4196 y(it)g(easy)g(to)g(rep)s(eat)g(commands,)f(insert)g(the)h(argumen) |
37c41ab1 | 19189 | m(ts)f(to)h(a)g(previous)f(command)g(in)m(to)i(the)e(curren)m(t)150 |
e59452c7 CR |
19190 | 4306 y(input)f(line,)i(or)g(\014x)f(errors)f(in)h(previous)g(commands)g |
19191 | (quic)m(kly)-8 b(.)275 4439 y(History)24 b(expansion)f(is)h(p)s | |
c8cd6da3 | 19192 | (erformed)e(immediately)j(after)f(a)g(complete)h(line)f(is)g(read,)h(b) |
e59452c7 | 19193 | s(efore)e(the)h(shell)150 4549 y(breaks)32 b(it)i(in)m(to)f(w)m(ords,)g |
8d125d8b | 19194 | (and)f(is)h(p)s(erformed)e(on)h(eac)m(h)i(line)f(individually)-8 |
e59452c7 | 19195 | b(.)48 b(Bash)33 b(attempts)g(to)h(inform)150 4659 y(the)d(history)f |
8d125d8b | 19196 | (expansion)g(functions)g(ab)s(out)g(quoting)h(still)g(in)f(e\013ect)i |
e59452c7 | 19197 | (from)e(previous)g(lines.)275 4792 y(History)37 b(expansion)f(tak)m(es) |
8d125d8b | 19198 | i(place)g(in)e(t)m(w)m(o)i(parts.)59 b(The)36 b(\014rst)g(is)h(to)g |
e59452c7 | 19199 | (determine)g(whic)m(h)f(line)h(from)150 4902 y(the)42 |
8d125d8b CR |
19200 | b(history)f(list)h(should)e(b)s(e)h(used)f(during)g(substitution.)74 |
19201 | b(The)40 b(second)i(is)f(to)h(select)h(p)s(ortions)e(of)150 | |
e59452c7 | 19202 | 5011 y(that)31 b(line)g(for)f(inclusion)h(in)m(to)g(the)g(curren)m(t)f |
8d125d8b | 19203 | (one.)42 b(The)30 b(line)h(selected)h(from)e(the)h(history)f(is)h |
e59452c7 | 19204 | (called)h(the)150 5121 y Fr(ev)m(en)m(t)p Fu(,)e(and)c(the)i(p)s |
8d125d8b CR |
19205 | (ortions)e(of)i(that)f(line)h(that)g(are)f(acted)i(up)s(on)c(are)j |
19206 | (called)g Fr(w)m(ords)p Fu(.)39 b(V)-8 b(arious)28 b | |
e59452c7 | 19207 | Fr(mo)s(di\014ers)150 5230 y Fu(are)33 b(a)m(v)-5 b(ailable)36 |
8d125d8b CR |
19208 | b(to)d(manipulate)h(the)f(selected)h(w)m(ords.)48 b(The)32 |
19209 | b(line)i(is)f(brok)m(en)f(in)m(to)i(w)m(ords)f(in)f(the)i(same)150 | |
e59452c7 | 19210 | 5340 y(fashion)23 b(that)g(Bash)g(do)s(es,)h(so)f(that)h(sev)m(eral)g |
8d125d8b | 19211 | (w)m(ords)e(surrounded)e(b)m(y)j(quotes)g(are)g(considered)g(one)g(w)m |
e59452c7 | 19212 | (ord.)p eop end |
fffe80d4 CR |
19213 | %%Page: 154 160 |
19214 | TeXDict begin 154 159 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
19215 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(154)150 | |
e59452c7 CR |
19216 | 299 y(History)37 b(expansions)g(are)g(in)m(tro)s(duced)f(b)m(y)h(the)g |
19217 | (app)s(earance)g(of)g(the)g(history)f(expansion)h(c)m(haracter,)150 | |
19218 | 408 y(whic)m(h)30 b(is)h(`)p Ft(!)p Fu(')f(b)m(y)g(default.)275 | |
19219 | 554 y(History)c(expansion)g(implemen)m(ts)h(shell-lik)m(e)h(quoting)f | |
19220 | (con)m(v)m(en)m(tions:)40 b(a)27 b(bac)m(kslash)g(can)f(b)s(e)g(used)f | |
19221 | (to)150 664 y(remo)m(v)m(e)h(the)e(sp)s(ecial)g(handling)g(for)g(the)g | |
19222 | (next)g(c)m(haracter;)k(single)d(quotes)g(enclose)g(v)m(erbatim)g | |
19223 | (sequences)150 774 y(of)k(c)m(haracters,)i(and)e(can)g(b)s(e)g(used)f | |
19224 | (to)i(inhibit)f(history)g(expansion;)g(and)g(c)m(haracters)i(enclosed)e | |
19225 | (within)150 883 y(double)h(quotes)i(ma)m(y)f(b)s(e)f(sub)5 | |
19226 | b(ject)31 b(to)h(history)f(expansion,)g(since)g(bac)m(kslash)g(can)h | |
19227 | (escap)s(e)f(the)g(history)150 993 y(expansion)e(c)m(haracter,)j(but)d | |
19228 | (single)h(quotes)g(ma)m(y)h(not,)f(since)g(they)g(are)g(not)f(treated)i | |
19229 | (sp)s(ecially)f(within)150 1102 y(double)g(quotes.)275 | |
19230 | 1248 y(When)41 b(using)g(the)h(shell,)i(only)e(`)p Ft(\\)p | |
8d125d8b | 19231 | Fu(')g(and)e(`)p Ft(')p Fu(')i(ma)m(y)g(b)s(e)f(used)g(to)h(escap)s(e)g |
e59452c7 | 19232 | (the)g(history)f(expansion)150 1358 y(c)m(haracter,)e(but)34 |
8d125d8b | 19233 | b(the)i(history)g(expansion)f(c)m(haracter)i(is)f(also)g(treated)h(as)e |
e59452c7 | 19234 | (quoted)h(if)g(it)g(immediately)150 1468 y(precedes)30 |
8d125d8b | 19235 | b(the)h(closing)g(double)f(quote)h(in)f(a)h(double-quoted)g(string.)275 |
e59452c7 | 19236 | 1614 y(Sev)m(eral)48 b(shell)g(options)h(settable)g(with)e(the)h |
8d125d8b | 19237 | Ft(shopt)f Fu(builtin)g(\(see)i(Section)f(4.3.2)i([The)e(Shopt)150 |
e59452c7 | 19238 | 1723 y(Builtin],)24 b(page)e(70\))h(ma)m(y)e(b)s(e)g(used)g(to)h |
d37a4722 | 19239 | (tailor)g(the)g(b)s(eha)m(vior)f(of)h(history)f(expansion.)37 |
e59452c7 | 19240 | b(If)21 b(the)h Ft(histverify)150 1833 y Fu(shell)35 |
d37a4722 | 19241 | b(option)f(is)h(enabled,)g(and)f(Readline)h(is)f(b)s(eing)g(used,)h |
e59452c7 | 19242 | (history)g(substitutions)e(are)i(not)g(immedi-)150 1942 |
d37a4722 CR |
19243 | y(ately)i(passed)d(to)i(the)g(shell)f(parser.)55 b(Instead,)37 |
19244 | b(the)e(expanded)g(line)g(is)h(reloaded)g(in)m(to)g(the)f(Readline)150 | |
e59452c7 | 19245 | 2052 y(editing)29 b(bu\013er)f(for)h(further)e(mo)s(di\014cation.)41 |
d37a4722 | 19246 | b(If)28 b(Readline)h(is)g(b)s(eing)f(used,)h(and)f(the)h |
e59452c7 | 19247 | Ft(histreedit)d Fu(shell)150 2161 y(option)e(is)g(enabled,)h(a)g |
d37a4722 | 19248 | (failed)f(history)g(expansion)g(will)g(b)s(e)f(reloaded)h(in)m(to)h |
e59452c7 | 19249 | (the)f(Readline)g(editing)h(bu\013er)150 2271 y(for)31 |
d37a4722 CR |
19250 | b(correction.)43 b(The)30 b Ft(-p)g Fu(option)h(to)h(the)f |
19251 | Ft(history)e Fu(builtin)h(command)h(ma)m(y)g(b)s(e)f(used)g(to)i(see)f | |
e59452c7 | 19252 | (what)g(a)150 2381 y(history)25 b(expansion)g(will)g(do)g(b)s(efore)g |
d37a4722 | 19253 | (using)f(it.)40 b(The)24 b Ft(-s)h Fu(option)g(to)h(the)f |
e59452c7 | 19254 | Ft(history)e Fu(builtin)i(ma)m(y)g(b)s(e)g(used)150 2490 |
d37a4722 CR |
19255 | y(to)36 b(add)f(commands)g(to)h(the)g(end)f(of)g(the)h(history)f(list)i |
19256 | (without)e(actually)i(executing)g(them,)g(so)e(that)150 | |
e59452c7 | 19257 | 2600 y(they)c(are)f(a)m(v)-5 b(ailable)33 b(for)d(subsequen)m(t)g |
d37a4722 | 19258 | (recall.)42 b(This)29 b(is)i(most)g(useful)e(in)h(conjunction)h(with)f |
e59452c7 | 19259 | (Readline.)275 2746 y(The)j(shell)h(allo)m(ws)h(con)m(trol)h(of)e(the)g |
d37a4722 | 19260 | (v)-5 b(arious)34 b(c)m(haracters)h(used)f(b)m(y)f(the)h(history)g |
e59452c7 | 19261 | (expansion)g(mec)m(h-)150 2855 y(anism)h(with)g(the)g |
d37a4722 CR |
19262 | Ft(histchars)d Fu(v)-5 b(ariable,)38 b(as)d(explained)g(ab)s(o)m(v)m(e) |
19263 | i(\(see)f(Section)f(5.2)i([Bash)e(V)-8 b(ariables],)150 | |
e59452c7 | 19264 | 2965 y(page)32 b(77\).)44 b(The)31 b(shell)g(uses)g(the)g(history)g |
d37a4722 | 19265 | (commen)m(t)i(c)m(haracter)f(to)g(mark)f(history)g(timestamps)h(when) |
e59452c7 CR |
19266 | 150 3075 y(writing)e(the)h(history)f(\014le.)150 3285 |
19267 | y Fk(9.3.1)63 b(Ev)m(en)m(t)39 b(Designators)150 3432 | |
d37a4722 CR |
19268 | y Fu(An)32 b(ev)m(en)m(t)j(designator)e(is)g(a)g(reference)g(to)h(a)f |
19269 | (command)f(line)h(en)m(try)g(in)g(the)g(history)g(list.)48 | |
e59452c7 | 19270 | b(Unless)33 b(the)150 3542 y(reference)e(is)f(absolute,)i(ev)m(en)m(ts) |
d37a4722 | 19271 | f(are)g(relativ)m(e)i(to)e(the)f(curren)m(t)g(p)s(osition)h(in)f(the)h |
e59452c7 | 19272 | (history)f(list.)150 3718 y Ft(!)432 b Fu(Start)34 b(a)f(history)h |
d37a4722 | 19273 | (substitution,)g(except)g(when)f(follo)m(w)m(ed)i(b)m(y)e(a)h(space,)h |
e59452c7 | 19274 | (tab,)f(the)g(end)f(of)630 3828 y(the)i(line,)g(`)p Ft(=)p |
d37a4722 CR |
19275 | Fu(')g(or)f(`)p Ft(\()p Fu(')h(\(when)e(the)i Ft(extglob)d |
19276 | Fu(shell)j(option)f(is)h(enabled)f(using)g(the)g Ft(shopt)630 | |
e59452c7 CR |
19277 | 3938 y Fu(builtin\).)150 4109 y Ft(!)p Fj(n)384 b Fu(Refer)30 |
19278 | b(to)i(command)e(line)g Fr(n)p Fu(.)150 4279 y Ft(!-)p | |
d37a4722 | 19279 | Fj(n)336 b Fu(Refer)30 b(to)i(the)e(command)g Fr(n)g |
e59452c7 | 19280 | Fu(lines)h(bac)m(k.)150 4450 y Ft(!!)384 b Fu(Refer)30 |
d37a4722 | 19281 | b(to)i(the)e(previous)g(command.)40 b(This)30 b(is)g(a)h(synon)m(ym)f |
e59452c7 | 19282 | (for)g(`)p Ft(!-1)p Fu('.)150 4621 y Ft(!)p Fj(string)144 |
d37a4722 CR |
19283 | b Fu(Refer)25 b(to)h(the)f(most)h(recen)m(t)g(command)f(preceding)g |
19284 | (the)g(curren)m(t)g(p)s(osition)g(in)g(the)g(history)630 | |
e59452c7 CR |
19285 | 4731 y(list)31 b(starting)g(with)f Fr(string)p Fu(.)150 |
19286 | 4902 y Ft(!?)p Fj(string)p Ft([?])630 5011 y Fu(Refer)25 | |
d37a4722 | 19287 | b(to)h(the)f(most)h(recen)m(t)g(command)f(preceding)g(the)g(curren)m(t) |
e59452c7 | 19288 | g(p)s(osition)g(in)g(the)g(history)630 5121 y(list)32 |
d37a4722 CR |
19289 | b(con)m(taining)i Fr(string)p Fu(.)45 b(The)31 b(trailing)i(`)p |
19290 | Ft(?)p Fu(')f(ma)m(y)g(b)s(e)f(omitted)i(if)f(the)g Fr(string)39 | |
e59452c7 | 19291 | b Fu(is)32 b(follo)m(w)m(ed)630 5230 y(immediately)f(b)m(y)e(a)h |
d37a4722 | 19292 | (newline.)40 b(If)29 b Fr(string)38 b Fu(is)29 b(missing,)h(the)g |
e59452c7 | 19293 | (string)f(from)g(the)h(most)g(recen)m(t)630 5340 y(searc)m(h)h(is)f |
d37a4722 | 19294 | (used;)g(it)h(is)g(an)f(error)g(if)g(there)h(is)f(no)g(previous)g |
e59452c7 | 19295 | (searc)m(h)h(string.)p eop end |
fffe80d4 CR |
19296 | %%Page: 155 161 |
19297 | TeXDict begin 155 160 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
19298 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(155)150 | |
e59452c7 CR |
19299 | 299 y Ft(^)p Fj(string1)p Ft(^)p Fj(string2)p Ft(^)630 |
19300 | 408 y Fu(Quic)m(k)32 b(Substitution.)44 b(Rep)s(eat)32 | |
19301 | b(the)g(last)h(command,)f(replacing)g Fr(string1)40 b | |
19302 | Fu(with)31 b Fr(string2)p Fu(.)630 518 y(Equiv)-5 b(alen)m(t)31 | |
19303 | b(to)g Ft(!!:s^)p Fj(string1)p Ft(^)p Fj(string2)p Ft(^)p | |
19304 | Fu(.)150 673 y Ft(!#)384 b Fu(The)30 b(en)m(tire)h(command)f(line)h(t)m | |
19305 | (yp)s(ed)f(so)h(far.)150 867 y Fk(9.3.2)63 b(W)-10 b(ord)41 | |
19306 | b(Designators)150 1014 y Fu(W)-8 b(ord)27 b(designators)h(are)g(used)e | |
19307 | (to)i(select)h(desired)d(w)m(ords)h(from)f(the)i(ev)m(en)m(t.)41 | |
19308 | b(A)27 b(`)p Ft(:)p Fu(')g(separates)h(the)f(ev)m(en)m(t)150 | |
19309 | 1124 y(sp)s(eci\014cation)38 b(from)e(the)h(w)m(ord)f(designator.)61 | |
c302751c | 19310 | b(It)37 b(ma)m(y)h(b)s(e)e(omitted)i(if)e(the)h(w)m(ord)g(designator)g |
e59452c7 | 19311 | (b)s(egins)150 1233 y(with)30 b(a)g(`)p Ft(^)p Fu(',)g(`)p |
6e51e0d0 CR |
19312 | Ft($)p Fu(',)g(`)p Ft(*)p Fu(',)h(`)p Ft(-)p Fu(',)f(or)g(`)p |
19313 | Ft(\045)p Fu('.)41 b(W)-8 b(ords)30 b(are)g(n)m(um)m(b)s(ered)e(from)i | |
d37a4722 | 19314 | (the)g(b)s(eginning)f(of)h(the)g(line,)g(with)g(the)150 |
e59452c7 CR |
19315 | 1343 y(\014rst)f(w)m(ord)f(b)s(eing)h(denoted)h(b)m(y)f(0)h(\(zero\).) |
19316 | 41 b(W)-8 b(ords)30 b(are)g(inserted)f(in)m(to)h(the)g(curren)m(t)f | |
19317 | (line)g(separated)h(b)m(y)150 1452 y(single)h(spaces.)275 | |
19318 | 1584 y(F)-8 b(or)31 b(example,)150 1739 y Ft(!!)384 b | |
19319 | Fu(designates)37 b(the)f(preceding)g(command.)57 b(When)35 | |
19320 | b(y)m(ou)i(t)m(yp)s(e)f(this,)h(the)f(preceding)g(com-)630 | |
19321 | 1849 y(mand)30 b(is)g(rep)s(eated)g(in)g(toto.)150 2003 | |
19322 | y Ft(!!:$)288 b Fu(designates)23 b(the)g(last)g(argumen)m(t)g(of)f(the) | |
19323 | h(preceding)f(command.)38 b(This)22 b(ma)m(y)h(b)s(e)e(shortened)630 | |
19324 | 2113 y(to)31 b Ft(!$)p Fu(.)150 2267 y Ft(!fi:2)240 b | |
19325 | Fu(designates)30 b(the)g(second)f(argumen)m(t)h(of)f(the)h(most)f | |
19326 | (recen)m(t)i(command)e(starting)h(with)f(the)630 2377 | |
19327 | y(letters)j Ft(fi)p Fu(.)275 2531 y(Here)e(are)h(the)g(w)m(ord)f | |
19328 | (designators:)150 2686 y Ft(0)g(\(zero\))114 b Fu(The)30 | |
19329 | b Ft(0)p Fu(th)g(w)m(ord.)40 b(F)-8 b(or)31 b(man)m(y)g(applications,)h | |
19330 | (this)e(is)g(the)h(command)f(w)m(ord.)150 2840 y Fj(n)432 | |
19331 | b Fu(The)30 b Fr(n)p Fu(th)g(w)m(ord.)150 2995 y Ft(^)432 | |
19332 | b Fu(The)30 b(\014rst)f(argumen)m(t;)j(that)f(is,)f(w)m(ord)g(1.)150 | |
19333 | 3150 y Ft($)432 b Fu(The)30 b(last)h(argumen)m(t.)150 | |
19334 | 3304 y Ft(\045)432 b Fu(The)40 b(\014rst)h(w)m(ord)f(matc)m(hed)i(b)m | |
fc35c477 CR |
19335 | (y)f(the)g(most)g(recen)m(t)h(`)p Ft(?)p Fj(string)p |
19336 | Ft(?)p Fu(')d(searc)m(h,)44 b(if)d(the)g(searc)m(h)630 | |
e59452c7 CR |
19337 | 3414 y(string)30 b(b)s(egins)g(with)g(a)h(c)m(haracter)h(that)f(is)f |
19338 | (part)h(of)f(a)h(w)m(ord.)150 3568 y Fj(x)p Ft(-)p Fj(y)336 | |
fc35c477 | 19339 | b Fu(A)30 b(range)h(of)g(w)m(ords;)f(`)p Ft(-)p Fj(y)p |
e59452c7 | 19340 | Fu(')g(abbreviates)h(`)p Ft(0-)p Fj(y)p Fu('.)150 3723 |
fc35c477 CR |
19341 | y Ft(*)432 b Fu(All)28 b(of)g(the)g(w)m(ords,)g(except)h(the)e |
19342 | Ft(0)p Fu(th.)40 b(This)27 b(is)g(a)h(synon)m(ym)f(for)h(`)p | |
6e51e0d0 | 19343 | Ft(1-$)p Fu('.)39 b(It)28 b(is)g(not)g(an)f(error)630 |
e59452c7 | 19344 | 3832 y(to)j(use)g(`)p Ft(*)p Fu(')f(if)h(there)g(is)g(just)f(one)h(w)m |
122f603c | 19345 | (ord)f(in)g(the)h(ev)m(en)m(t;)i(the)d(empt)m(y)i(string)e(is)h |
e59452c7 | 19346 | (returned)e(in)630 3942 y(that)j(case.)150 4097 y Fj(x)p |
900a813b | 19347 | Ft(*)384 b Fu(Abbreviates)31 b(`)p Fj(x)p Ft(-$)p Fu(')150 |
e59452c7 | 19348 | 4251 y Fj(x)p Ft(-)384 b Fu(Abbreviates)27 b(`)p Fj(x)p |
fc35c477 CR |
19349 | Ft(-$)p Fu(')g(lik)m(e)h(`)p Fj(x)p Ft(*)p Fu(',)g(but)e(omits)i(the)f |
19350 | (last)h(w)m(ord.)39 b(If)27 b(`)p Ft(x)p Fu(')g(is)g(missing,)g(it)h | |
e59452c7 | 19351 | (defaults)630 4361 y(to)j(0.)275 4515 y(If)i(a)h(w)m(ord)g(designator)g |
fc35c477 | 19352 | (is)g(supplied)f(without)h(an)g(ev)m(en)m(t)h(sp)s(eci\014cation,)h |
e59452c7 CR |
19353 | (the)e(previous)f(command)150 4625 y(is)d(used)g(as)h(the)f(ev)m(en)m |
19354 | (t.)150 4819 y Fk(9.3.3)63 b(Mo)s(di\014ers)150 4966 | |
fc35c477 CR |
19355 | y Fu(After)29 b(the)g(optional)g(w)m(ord)g(designator,)g(y)m(ou)g(can)g |
19356 | (add)f(a)h(sequence)g(of)g(one)g(or)f(more)h(of)g(the)f(follo)m(wing) | |
e59452c7 | 19357 | 150 5076 y(mo)s(di\014ers,)33 b(eac)m(h)h(preceded)f(b)m(y)g(a)h(`)p |
fc35c477 | 19358 | Ft(:)p Fu('.)50 b(These)33 b(mo)s(dify)-8 b(,)33 b(or)h(edit,)g(the)g |
e59452c7 CR |
19359 | (w)m(ord)f(or)g(w)m(ords)g(selected)h(from)150 5185 y(the)d(history)f |
19360 | (ev)m(en)m(t.)150 5340 y Ft(h)432 b Fu(Remo)m(v)m(e)32 | |
6e51e0d0 | 19361 | b(a)f(trailing)g(pathname)g(comp)s(onen)m(t,)g(lea)m(ving)h(only)e(the) |
e59452c7 | 19362 | h(head.)p eop end |
fffe80d4 CR |
19363 | %%Page: 156 162 |
19364 | TeXDict begin 156 161 bop 150 -116 a Fu(Chapter)30 b(9:)41 | |
19365 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(156)150 | |
e59452c7 CR |
19366 | 299 y Ft(t)432 b Fu(Remo)m(v)m(e)32 b(all)f(leading)h(pathname)e(comp)s |
19367 | (onen)m(ts,)h(lea)m(ving)h(the)e(tail.)150 458 y Ft(r)432 | |
19368 | b Fu(Remo)m(v)m(e)32 b(a)f(trailing)g(su\016x)f(of)g(the)h(form)f(`)p | |
19369 | Ft(.)p Fj(suffix)p Fu(',)f(lea)m(ving)j(the)f(basename.)150 | |
19370 | 618 y Ft(e)432 b Fu(Remo)m(v)m(e)32 b(all)f(but)f(the)h(trailing)g | |
19371 | (su\016x.)150 777 y Ft(p)432 b Fu(Prin)m(t)30 b(the)h(new)f(command)g | |
19372 | (but)g(do)g(not)g(execute)i(it.)150 936 y Ft(q)432 b | |
19373 | Fu(Quote)31 b(the)f(substituted)g(w)m(ords,)g(escaping)h(further)e | |
19374 | (substitutions.)150 1096 y Ft(x)432 b Fu(Quote)32 b(the)f(substituted)g | |
19375 | (w)m(ords)f(as)i(with)f(`)p Ft(q)p Fu(',)h(but)e(break)h(in)m(to)i(w)m | |
19376 | (ords)d(at)i(spaces,)h(tabs,)630 1205 y(and)38 b(newlines.)66 | |
19377 | b(The)39 b(`)p Ft(q)p Fu(')g(and)f(`)p Ft(x)p Fu(')h(mo)s(di\014ers)f | |
19378 | (are)h(m)m(utually)g(exclusiv)m(e;)45 b(the)39 b(last)h(one)630 | |
19379 | 1315 y(supplied)29 b(is)i(used.)150 1474 y Ft(s/)p Fj(old)p | |
19380 | Ft(/)p Fj(new)p Ft(/)630 1584 y Fu(Substitute)g Fr(new)39 | |
fc35c477 CR |
19381 | b Fu(for)32 b(the)g(\014rst)f(o)s(ccurrence)h(of)f Fr(old)36 |
19382 | b Fu(in)31 b(the)h(ev)m(en)m(t)h(line.)46 b(An)m(y)31 | |
e59452c7 | 19383 | b(c)m(haracter)630 1694 y(ma)m(y)k(b)s(e)e(used)h(as)g(the)h(delimiter) |
d37a4722 | 19384 | g(in)f(place)h(of)f(`)p Ft(/)p Fu('.)53 b(The)33 b(delimiter)i(ma)m(y)g |
e59452c7 | 19385 | (b)s(e)f(quoted)g(in)630 1803 y Fr(old)40 b Fu(and)c |
fc35c477 CR |
19386 | Fr(new)44 b Fu(with)36 b(a)h(single)g(bac)m(kslash.)60 |
19387 | b(If)36 b(`)p Ft(&)p Fu(')h(app)s(ears)e(in)i Fr(new)p | |
e59452c7 | 19388 | Fu(,)g(it)h(is)e(replaced)h(b)m(y)630 1913 y Fr(old)p |
fc35c477 CR |
19389 | Fu(.)k(A)31 b(single)g(bac)m(kslash)g(will)g(quote)g(the)g(`)p |
19390 | Ft(&)p Fu('.)41 b(If)31 b Fr(old)j Fu(is)c(n)m(ull,)h(it)g(is)g(set)g | |
e59452c7 | 19391 | (to)g(the)g(last)g Fr(old)630 2022 y Fu(substituted,)j(or,)g(if)f(no)g |
fc35c477 | 19392 | (previous)g(history)g(substitutions)g(to)s(ok)h(place,)h(the)e(last)h |
e59452c7 | 19393 | Fr(string)630 2132 y Fu(in)j(a)g(!?)p Fr(string)8 b Ft([?])37 |
fc35c477 CR |
19394 | b Fu(searc)m(h.)61 b(If)37 b Fr(new)45 b Fu(is)37 b(is)g(n)m(ull,)i |
19395 | (eac)m(h)f(matc)m(hing)h Fr(old)h Fu(is)e(deleted.)61 | |
e59452c7 | 19396 | b(The)630 2242 y(\014nal)30 b(delimiter)h(is)g(optional)g(if)f(it)h(is) |
fc35c477 | 19397 | g(the)f(last)i(c)m(haracter)f(on)g(the)f(input)g(line.)150 |
e59452c7 CR |
19398 | 2401 y Ft(&)432 b Fu(Rep)s(eat)31 b(the)f(previous)g(substitution.)150 |
19399 | 2560 y Ft(g)150 2670 y(a)432 b Fu(Cause)38 b(c)m(hanges)i(to)f(b)s(e)f | |
fc35c477 | 19400 | (applied)h(o)m(v)m(er)h(the)f(en)m(tire)g(ev)m(en)m(t)h(line.)66 |
e59452c7 | 19401 | b(Used)39 b(in)f(conjunction)630 2780 y(with)30 b(`)p |
fc35c477 | 19402 | Ft(s)p Fu(',)h(as)f(in)h Ft(gs/)p Fj(old)p Ft(/)p Fj(new)p |
e59452c7 | 19403 | Ft(/)p Fu(,)c(or)j(with)h(`)p Ft(&)p Fu('.)150 2939 y |
fc35c477 CR |
19404 | Ft(G)432 b Fu(Apply)30 b(the)g(follo)m(wing)i(`)p Ft(s)p |
19405 | Fu(')f(or)f(`)p Ft(&)p Fu(')h(mo)s(di\014er)e(once)i(to)g(eac)m(h)h(w)m | |
19406 | (ord)e(in)g(the)g(ev)m(en)m(t.)p eop end | |
fffe80d4 CR |
19407 | %%Page: 157 163 |
19408 | TeXDict begin 157 162 bop 3614 -116 a Fu(157)150 299 | |
e59452c7 | 19409 | y Fp(10)80 b(Installing)52 b(Bash)150 539 y Fu(This)31 |
037a8b7f CR |
19410 | b(c)m(hapter)h(pro)m(vides)g(basic)g(instructions)f(for)g(installing)i |
19411 | (Bash)f(on)f(the)h(v)-5 b(arious)31 b(supp)s(orted)f(plat-)150 | |
e59452c7 | 19412 | 648 y(forms.)40 b(The)28 b(distribution)h(supp)s(orts)e(the)j |
037a8b7f | 19413 | Fm(gnu)f Fu(op)s(erating)h(systems,)f(nearly)h(ev)m(ery)g(v)m(ersion)f |
e59452c7 | 19414 | (of)h(Unix,)150 758 y(and)d(sev)m(eral)j(non-Unix)d(systems)h(suc)m(h)g |
037a8b7f | 19415 | (as)g(BeOS)g(and)f(In)m(terix.)40 b(Other)28 b(indep)s(enden)m(t)e(p)s |
e59452c7 CR |
19416 | (orts)h(exist)i(for)150 867 y Fm(ms-dos)p Fu(,)h Fm(os/2)p |
19417 | Fu(,)g(and)g(Windo)m(ws)g(platforms.)150 1111 y Fs(10.1)68 | |
19418 | b(Basic)45 b(Installation)150 1270 y Fu(These)30 b(are)h(installation)h | |
19419 | (instructions)e(for)h(Bash.)275 1407 y(The)e(simplest)i(w)m(a)m(y)g(to) | |
19420 | g(compile)h(Bash)e(is:)199 1543 y(1.)61 b Ft(cd)38 b | |
6e51e0d0 CR |
19421 | Fu(to)h(the)f(directory)h(con)m(taining)h(the)f(source)f(co)s(de)h(and) |
19422 | f(t)m(yp)s(e)g(`)p Ft(./configure)p Fu(')e(to)j(con\014gure)330 | |
e59452c7 | 19423 | 1653 y(Bash)c(for)f(y)m(our)h(system.)54 b(If)34 b(y)m(ou're)h(using)f |
6e51e0d0 | 19424 | Ft(csh)g Fu(on)g(an)h(old)g(v)m(ersion)g(of)g(System)f(V,)h(y)m(ou)g |
e59452c7 | 19425 | (migh)m(t)330 1762 y(need)21 b(to)g(t)m(yp)s(e)g(`)p |
6e51e0d0 CR |
19426 | Ft(sh)30 b(./configure)p Fu(')18 b(instead)j(to)g(prev)m(en)m(t)h |
19427 | Ft(csh)e Fu(from)g(trying)h(to)g(execute)h Ft(configure)330 | |
e59452c7 | 19428 | 1872 y Fu(itself.)330 2007 y(Running)30 b Ft(configure)f |
6e51e0d0 | 19429 | Fu(tak)m(es)k(some)e(time.)45 b(While)32 b(running,)e(it)i(prin)m(ts)f |
e59452c7 CR |
19430 | (messages)h(telling)h(whic)m(h)330 2117 y(features)e(it)g(is)f(c)m(hec) |
19431 | m(king)i(for.)199 2252 y(2.)61 b(T)m(yp)s(e)30 b(`)p | |
6e51e0d0 | 19432 | Ft(make)p Fu(')g(to)h(compile)g(Bash)g(and)e(build)h(the)g |
e59452c7 | 19433 | Ft(bashbug)f Fu(bug)g(rep)s(orting)h(script.)199 2388 |
6e51e0d0 | 19434 | y(3.)61 b(Optionally)-8 b(,)32 b(t)m(yp)s(e)e(`)p Ft(make)g(tests)p |
e59452c7 CR |
19435 | Fu(')f(to)i(run)e(the)h(Bash)h(test)g(suite.)199 2523 |
19436 | y(4.)61 b(T)m(yp)s(e)42 b(`)p Ft(make)30 b(install)p | |
19437 | Fu(')41 b(to)i(install)h Ft(bash)d Fu(and)i Ft(bashbug)p | |
19438 | Fu(.)76 b(This)42 b(will)h(also)g(install)h(the)f(man-)330 | |
19439 | 2633 y(ual)30 b(pages)g(and)g(Info)f(\014le,)h(message)h(translation)g | |
19440 | (\014les,)f(some)g(supplemen)m(tal)h(do)s(cumen)m(tation,)g(a)330 | |
19441 | 2742 y(n)m(um)m(b)s(er)c(of)h(example)h(loadable)g(builtin)f(commands,) | |
19442 | g(and)g(a)g(set)h(of)f(header)g(\014les)g(for)g(dev)m(eloping)330 | |
19443 | 2852 y(loadable)36 b(builtins.)55 b(Y)-8 b(ou)36 b(ma)m(y)f(need)g | |
19444 | (additional)h(privileges)g(to)g(install)g Ft(bash)e Fu(to)i(y)m(our)f | |
19445 | (desired)330 2962 y(destination,)f(so)f(`)p Ft(sudo)d(make)f(install)p | |
19446 | Fu(')i(migh)m(t)i(b)s(e)f(required.)47 b(More)33 b(information)g(ab)s | |
19447 | (out)f(con-)330 3071 y(trolling)c(the)g(lo)s(cations)g(where)f | |
19448 | Ft(bash)f Fu(and)h(other)g(\014les)g(are)h(installed)g(is)f(b)s(elo)m | |
19449 | (w)g(\(see)h(Section)g(10.4)330 3181 y([Installation)k(Names],)g(page)f | |
fffe80d4 | 19450 | (159\).)275 3343 y(The)20 b Ft(configure)f Fu(shell)i(script)g |
e59452c7 CR |
19451 | (attempts)h(to)g(guess)f(correct)i(v)-5 b(alues)21 b(for)g(v)-5 |
19452 | b(arious)21 b(system-dep)s(enden)m(t)150 3453 y(v)-5 | |
19453 | b(ariables)38 b(used)f(during)f(compilation.)64 b(It)37 | |
19454 | b(uses)g(those)h(v)-5 b(alues)38 b(to)g(create)h(a)f | |
19455 | Ft(Makefile)d Fu(in)i(eac)m(h)i(di-)150 3562 y(rectory)32 | |
19456 | b(of)f(the)h(pac)m(k)-5 b(age)33 b(\(the)f(top)f(directory)-8 | |
19457 | b(,)33 b(the)e Ft(builtins)p Fu(,)f Ft(doc)p Fu(,)h Ft(po)p | |
19458 | Fu(,)g(and)f Ft(support)g Fu(directories,)150 3672 y(eac)m(h)38 | |
19459 | b(directory)g(under)d Ft(lib)p Fu(,)j(and)f(sev)m(eral)h(others\).)61 | |
19460 | b(It)38 b(also)g(creates)g(a)f Ft(config.h)e Fu(\014le)i(con)m(taining) | |
19461 | 150 3781 y(system-dep)s(enden)m(t)31 b(de\014nitions.)44 | |
19462 | b(Finally)-8 b(,)34 b(it)e(creates)h(a)f(shell)g(script)f(named)g | |
19463 | Ft(config.status)d Fu(that)150 3891 y(y)m(ou)35 b(can)h(run)d(in)i(the) | |
19464 | g(future)f(to)i(recreate)g(the)g(curren)m(t)e(con\014guration,)j(a)f | |
19465 | (\014le)f Ft(config.cache)c Fu(that)150 4001 y(sa)m(v)m(es)39 | |
19466 | b(the)e(results)g(of)g(its)h(tests)g(to)g(sp)s(eed)e(up)h | |
19467 | (recon\014guring,)h(and)f(a)h(\014le)f Ft(config.log)d | |
19468 | Fu(con)m(taining)150 4110 y(compiler)c(output)g(\(useful)f(mainly)h | |
19469 | (for)f(debugging)h Ft(configure)p Fu(\).)38 b(If)29 b(at)i(some)f(p)s | |
19470 | (oin)m(t)f Ft(config.cache)150 4220 y Fu(con)m(tains)j(results)e(y)m | |
19471 | (ou)g(don't)h(w)m(an)m(t)g(to)g(k)m(eep,)g(y)m(ou)g(ma)m(y)g(remo)m(v)m | |
19472 | (e)h(or)e(edit)h(it.)275 4356 y(T)-8 b(o)37 b(\014nd)f(out)i(more)f(ab) | |
19473 | s(out)h(the)f(options)h(and)f(argumen)m(ts)g(that)h(the)g | |
19474 | Ft(configure)d Fu(script)i(under-)150 4466 y(stands,)30 | |
19475 | b(t)m(yp)s(e)390 4602 y Ft(bash-4.2$)45 b(./configure)g(--help)150 | |
19476 | 4738 y Fu(at)31 b(the)g(Bash)f(prompt)g(in)g(y)m(our)g(Bash)h(source)f | |
19477 | (directory)-8 b(.)275 4875 y(If)34 b(y)m(ou)h(w)m(an)m(t)g(to)g(build)f | |
19478 | (Bash)g(in)h(a)g(directory)g(separate)g(from)f(the)h(source)g | |
19479 | (directory)g({)g(to)g(build)150 4984 y(for)30 b(m)m(ultiple)i(arc)m | |
19480 | (hitectures,)g(for)e(example)h({)g(just)f(use)h(the)f(full)h(path)f(to) | |
19481 | h(the)g(con\014gure)f(script.)41 b(The)150 5094 y(follo)m(wing)24 | |
19482 | b(commands)f(will)g(build)f(bash)g(in)g(a)h(directory)h(under)d | |
19483 | Ft(/usr/local/build)d Fu(from)23 b(the)g(source)150 5204 | |
19484 | y(co)s(de)31 b(in)f Ft(/usr/local/src/bash-4.4)o Fu(:)390 | |
19485 | 5340 y Ft(mkdir)46 b(/usr/local/build/bash-4.4)p eop | |
19486 | end | |
fffe80d4 CR |
19487 | %%Page: 158 164 |
19488 | TeXDict begin 158 163 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19489 | b(Installing)31 b(Bash)2356 b(158)390 299 y Ft(cd)47 | |
e59452c7 CR |
19490 | b(/usr/local/build/bash-4.4)390 408 y(bash)g(/usr/local/src/bash-4.4)o |
19491 | (/con)o(fig)o(ure)390 518 y(make)275 652 y Fu(See)27 | |
19492 | b(Section)h(10.3)g([Compiling)g(F)-8 b(or)27 b(Multiple)h(Arc)m | |
fffe80d4 | 19493 | (hitectures],)i(page)d(158,)j(for)c(more)i(information)150 |
e59452c7 CR |
19494 | 762 y(ab)s(out)i(building)g(in)g(a)g(directory)h(separate)h(from)e(the) |
19495 | g(source.)275 896 y(If)53 b(y)m(ou)h(need)f(to)i(do)e(un)m(usual)g | |
19496 | (things)g(to)i(compile)g(Bash,)k(please)c(try)e(to)i(\014gure)e(out)h | |
19497 | (ho)m(w)150 1006 y Ft(configure)47 b Fu(could)j(c)m(hec)m(k)h(whether)e | |
19498 | (or)g(not)h(to)h(do)e(them,)55 b(and)49 b(mail)h(di\013s)f(or)h | |
19499 | (instructions)f(to)150 1115 y Ft(bash-maintainers@gnu.org)24 | |
19500 | b Fu(so)30 b(they)h(can)g(b)s(e)e(considered)i(for)f(the)g(next)h | |
19501 | (release.)275 1250 y(The)e(\014le)g Ft(configure.ac)d | |
19502 | Fu(is)k(used)e(to)j(create)g Ft(configure)c Fu(b)m(y)i(a)h(program)f | |
19503 | (called)i(Auto)s(conf.)40 b(Y)-8 b(ou)150 1359 y(only)34 | |
19504 | b(need)g Ft(configure.ac)d Fu(if)i(y)m(ou)i(w)m(an)m(t)g(to)f(c)m | |
19505 | (hange)i(it)e(or)g(regenerate)i Ft(configure)31 b Fu(using)j(a)g(new)m | |
19506 | (er)150 1469 y(v)m(ersion)25 b(of)f(Auto)s(conf.)39 b(If)24 | |
19507 | b(y)m(ou)h(do)f(this,)i(mak)m(e)f(sure)f(y)m(ou)h(are)f(using)g(Auto)s | |
19508 | (conf)h(v)m(ersion)f(2.69)i(or)f(new)m(er.)275 1603 y(Y)-8 | |
19509 | b(ou)29 b(can)f(remo)m(v)m(e)i(the)f(program)g(binaries)f(and)g(ob)5 | |
19510 | b(ject)29 b(\014les)g(from)f(the)h(source)f(co)s(de)h(directory)g(b)m | |
19511 | (y)150 1713 y(t)m(yping)j(`)p Ft(make)d(clean)p Fu('.)42 | |
19512 | b(T)-8 b(o)32 b(also)g(remo)m(v)m(e)g(the)g(\014les)f(that)g | |
a2851804 | 19513 | Ft(configure)e Fu(created)j(\(so)g(y)m(ou)g(can)f(compile)150 |
e59452c7 CR |
19514 | 1822 y(Bash)g(for)f(a)g(di\013eren)m(t)h(kind)f(of)g(computer\),)h(t)m |
19515 | (yp)s(e)g(`)p Ft(make)e(distclean)p Fu('.)150 2063 y | |
19516 | Fs(10.2)68 b(Compilers)46 b(and)f(Options)150 2222 y | |
a2851804 CR |
19517 | Fu(Some)28 b(systems)h(require)f(un)m(usual)f(options)i(for)f |
19518 | (compilation)i(or)f(linking)f(that)h(the)g Ft(configure)d | |
e59452c7 | 19519 | Fu(script)150 2332 y(do)s(es)32 b(not)g(kno)m(w)g(ab)s(out.)44 |
a2851804 CR |
19520 | b(Y)-8 b(ou)33 b(can)f(giv)m(e)h Ft(configure)d Fu(initial)j(v)-5 |
19521 | b(alues)32 b(for)g(v)-5 b(ariables)32 b(b)m(y)g(setting)h(them)150 | |
e59452c7 | 19522 | 2441 y(in)k(the)g(en)m(vironmen)m(t.)62 b(Using)38 b(a)f |
a2851804 | 19523 | (Bourne-compatible)i(shell,)g(y)m(ou)f(can)g(do)f(that)h(on)f(the)g |
e59452c7 | 19524 | (command)150 2551 y(line)31 b(lik)m(e)g(this:)390 2685 |
a2851804 | 19525 | y Ft(CC=c89)46 b(CFLAGS=-O2)f(LIBS=-lposix)g(./configure)275 |
e59452c7 | 19526 | 2819 y Fu(On)29 b(systems)h(that)h(ha)m(v)m(e)h(the)f |
6e51e0d0 | 19527 | Ft(env)e Fu(program,)h(y)m(ou)h(can)g(do)f(it)h(lik)m(e)h(this:)390 |
e59452c7 CR |
19528 | 2954 y Ft(env)47 b(CPPFLAGS=-I/usr/local/in)o(clud)o(e)42 |
19529 | b(LDFLAGS=-s)j(./configure)275 3088 y Fu(The)29 b(con\014guration)i | |
37c41ab1 | 19530 | (pro)s(cess)f(uses)g(GCC)g(to)h(build)e(Bash)i(if)f(it)h(is)g(a)m(v)-5 |
e59452c7 CR |
19531 | b(ailable.)150 3328 y Fs(10.3)68 b(Compiling)46 b(F)-11 |
19532 | b(or)45 b(Multiple)g(Arc)l(hitectures)150 3488 y Fu(Y)-8 | |
c302751c CR |
19533 | b(ou)27 b(can)g(compile)g(Bash)g(for)f(more)h(than)f(one)h(kind)f(of)g |
19534 | (computer)h(at)g(the)g(same)g(time,)h(b)m(y)e(placing)i(the)150 | |
e59452c7 | 19535 | 3597 y(ob)5 b(ject)31 b(\014les)f(for)g(eac)m(h)i(arc)m(hitecture)f(in) |
c302751c CR |
19536 | f(their)g(o)m(wn)h(directory)-8 b(.)41 b(T)-8 b(o)31 |
19537 | b(do)f(this,)g(y)m(ou)h(m)m(ust)f(use)g(a)g(v)m(ersion)150 | |
e59452c7 | 19538 | 3707 y(of)36 b Ft(make)e Fu(that)i(supp)s(orts)e(the)i |
a2851804 CR |
19539 | Ft(VPATH)e Fu(v)-5 b(ariable,)38 b(suc)m(h)d(as)h(GNU)g |
19540 | Ft(make)p Fu(.)55 b Ft(cd)35 b Fu(to)i(the)e(directory)h(where)150 | |
e59452c7 | 19541 | 3817 y(y)m(ou)k(w)m(an)m(t)h(the)g(ob)5 b(ject)41 b(\014les)f(and)f |
a2851804 | 19542 | (executables)j(to)e(go)h(and)f(run)e(the)j Ft(configure)c |
e59452c7 | 19543 | Fu(script)j(from)g(the)150 3926 y(source)32 b(directory)h(\(see)g |
fffe80d4 | 19544 | (Section)f(10.1)i([Basic)f(Installation],)i(page)e(157\).)47 |
e59452c7 | 19545 | b(Y)-8 b(ou)32 b(ma)m(y)h(need)f(to)g(supply)150 4036 |
a2851804 CR |
19546 | y(the)43 b Ft(--srcdir=PATH)c Fu(argumen)m(t)k(to)h(tell)g |
19547 | Ft(configure)c Fu(where)i(the)h(source)g(\014les)g(are.)78 | |
e59452c7 | 19548 | b Ft(configure)150 4145 y Fu(automatically)33 b(c)m(hec)m(ks)f(for)e |
a2851804 | 19549 | (the)h(source)f(co)s(de)h(in)f(the)h(directory)f(that)h |
e59452c7 | 19550 | Ft(configure)d Fu(is)j(in)f(and)f(in)h(`..'.)275 4280 |
6e51e0d0 CR |
19551 | y(If)20 b(y)m(ou)h(ha)m(v)m(e)i(to)e(use)g(a)g Ft(make)f |
19552 | Fu(that)i(do)s(es)e(not)i(supp)s(orts)d(the)i Ft(VPATH)e | |
19553 | Fu(v)-5 b(ariable,)24 b(y)m(ou)e(can)f(compile)h(Bash)150 | |
e59452c7 | 19554 | 4389 y(for)33 b(one)h(arc)m(hitecture)h(at)f(a)g(time)g(in)f(the)h |
37c41ab1 | 19555 | (source)g(co)s(de)f(directory)-8 b(.)51 b(After)34 b(y)m(ou)g(ha)m(v)m |
e59452c7 | 19556 | (e)h(installed)f(Bash)150 4499 y(for)c(one)h(arc)m(hitecture,)h(use)e |
6e51e0d0 | 19557 | (`)p Ft(make)g(distclean)p Fu(')e(b)s(efore)i(recon\014guring)g(for)g |
e59452c7 | 19558 | (another)g(arc)m(hitecture.)275 4633 y(Alternativ)m(ely)-8 |
6e51e0d0 | 19559 | b(,)30 b(if)c(y)m(our)g(system)h(supp)s(orts)d(sym)m(b)s(olic)j(links,) |
e59452c7 | 19560 | g(y)m(ou)g(can)g(use)f(the)g Ft(support/mkclone)150 4743 |
6e51e0d0 CR |
19561 | y Fu(script)d(to)h(create)g(a)f(build)f(tree)i(whic)m(h)f(has)f(sym)m |
19562 | (b)s(olic)i(links)e(bac)m(k)i(to)g(eac)m(h)g(\014le)f(in)g(the)g | |
e59452c7 | 19563 | (source)g(directory)-8 b(.)150 4852 y(Here's)41 b(an)f(example)i(that)f |
6e51e0d0 | 19564 | (creates)h(a)e(build)g(directory)h(in)f(the)h(curren)m(t)f(directory)h |
e59452c7 CR |
19565 | (from)f(a)h(source)150 4962 y(directory)31 b Ft(/usr/gnu/src/bash-2.0)p |
19566 | Fu(:)390 5096 y Ft(bash)47 b(/usr/gnu/src/bash-2.0/s)o(uppo)o(rt/)o | |
6e51e0d0 | 19567 | (mkcl)o(one)41 b(-s)47 b(/usr/gnu/src/bash-2.0)42 b(.)150 |
e59452c7 | 19568 | 5230 y Fu(The)c Ft(mkclone)e Fu(script)i(requires)g(Bash,)i(so)f(y)m |
6e51e0d0 | 19569 | (ou)f(m)m(ust)h(ha)m(v)m(e)g(already)g(built)f(Bash)g(for)g(at)h(least) |
e59452c7 CR |
19570 | h(one)150 5340 y(arc)m(hitecture)32 b(b)s(efore)e(y)m(ou)h(can)f |
19571 | (create)i(build)e(directories)h(for)f(other)h(arc)m(hitectures.)p | |
967625cd | 19572 | eop end |
fffe80d4 CR |
19573 | %%Page: 159 165 |
19574 | TeXDict begin 159 164 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19575 | b(Installing)31 b(Bash)2356 b(159)150 299 y Fs(10.4)68 | |
e59452c7 CR |
19576 | b(Installation)47 b(Names)150 458 y Fu(By)36 b(default,)g(`)p |
19577 | Ft(make)30 b(install)p Fu(')j(will)j(install)g(in)m(to)g | |
19578 | Ft(/usr/local/bin)p Fu(,)d Ft(/usr/local/man)p Fu(,)g(etc.;)39 | |
19579 | b(that)150 568 y(is,)i(the)d Fr(installation)i(pre\014x)k | |
19580 | Fu(defaults)38 b(to)h Ft(/usr/local)p Fu(.)62 b(Y)-8 | |
19581 | b(ou)39 b(can)g(sp)s(ecify)f(an)g(installation)i(pre\014x)150 | |
19582 | 677 y(other)34 b(than)g Ft(/usr/local)d Fu(b)m(y)j(giving)h | |
19583 | Ft(configure)d Fu(the)i(option)g Ft(--prefix=)p Fj(PATH)p | |
19584 | Fu(,)e(or)i(b)m(y)g(sp)s(ecifying)150 787 y(a)h(v)-5 | |
19585 | b(alue)34 b(for)h(the)f Ft(prefix)f Fu(`)p Ft(make)p | |
19586 | Fu(')g(v)-5 b(ariable)35 b(when)f(running)e(`)p Ft(make)e(install)p | |
19587 | Fu(')i(\(e.g.,)37 b(`)p Ft(make)30 b(install)150 897 | |
19588 | y(prefix=)p Fj(PATH)p Fu('\).)35 b(The)21 b Ft(prefix)f | |
19589 | Fu(v)-5 b(ariable)22 b(pro)m(vides)g(a)f(default)h(for)f | |
19590 | Ft(exec_prefix)e Fu(and)i(other)g(v)-5 b(ariables)150 | |
19591 | 1006 y(used)30 b(when)f(installing)i(bash.)275 1159 y(Y)-8 | |
19592 | b(ou)71 b(can)h(sp)s(ecify)f(separate)h(installation)h(pre\014xes)d | |
19593 | (for)h(arc)m(hitecture-sp)s(eci\014c)i(\014les)f(and)150 | |
19594 | 1268 y(arc)m(hitecture-indep)s(enden)m(t)44 b(\014les.)80 | |
19595 | b(If)43 b(y)m(ou)h(giv)m(e)h Ft(configure)c Fu(the)j(option)g | |
19596 | Ft(--exec-prefix=)p Fj(PATH)p Fu(,)150 1378 y(`)p Ft(make)29 | |
19597 | b(install)p Fu(')63 b(will)h(use)f Fr(P)-8 b(A)g(TH)75 | |
19598 | b Fu(as)64 b(the)g(pre\014x)e(for)i(installing)h(programs)e(and)h | |
19599 | (libraries.)150 1488 y(Do)s(cumen)m(tation)32 b(and)e(other)h(data)g | |
19600 | (\014les)f(will)h(still)g(use)f(the)h(regular)f(pre\014x.)275 | |
19601 | 1640 y(If)35 b(y)m(ou)i(w)m(ould)e(lik)m(e)j(to)e(c)m(hange)i(the)e | |
19602 | (installation)i(lo)s(cations)f(for)f(a)h(single)f(run,)h(y)m(ou)f(can)g | |
19603 | (sp)s(ecify)150 1750 y(these)28 b(v)-5 b(ariables)27 | |
19604 | b(as)h(argumen)m(ts)f(to)h Ft(make)p Fu(:)38 b(`)p Ft(make)29 | |
19605 | b(install)g(exec_prefix=/)p Fu(')23 b(will)28 b(install)g | |
19606 | Ft(bash)e Fu(and)150 1859 y Ft(bashbug)i Fu(in)m(to)k | |
19607 | Ft(/bin)d Fu(instead)i(of)f(the)h(default)f Ft(/usr/local/bin)p | |
19608 | Fu(.)275 2012 y(If)43 b(y)m(ou)i(w)m(an)m(t)g(to)g(see)f(the)h(\014les) | |
19609 | f(bash)f(will)i(install)g(and)e(where)h(it)g(will)h(install)g(them)f | |
19610 | (without)150 2122 y(c)m(hanging)35 b(an)m(ything)f(on)f(y)m(our)h | |
19611 | (system,)h(sp)s(ecify)e(the)h(v)-5 b(ariable)35 b Ft(DESTDIR)d | |
19612 | Fu(as)i(an)f(argumen)m(t)h(to)h Ft(make)p Fu(.)150 2231 | |
19613 | y(Its)29 b(v)-5 b(alue)29 b(should)f(b)s(e)g(the)h(absolute)h | |
19614 | (directory)f(path)g(y)m(ou'd)g(lik)m(e)h(to)g(use)e(as)i(the)f(ro)s(ot) | |
19615 | g(of)g(y)m(our)g(sample)150 2341 y(installation)j(tree.)42 | |
19616 | b(F)-8 b(or)31 b(example,)390 2493 y Ft(mkdir)46 b(/fs1/bash-install) | |
19617 | 390 2603 y(make)h(install)e(DESTDIR=/fs1/bash-install)150 | |
19618 | 2756 y Fu(will)37 b(install)g Ft(bash)e Fu(in)m(to)j | |
19619 | Ft(/fs1/bash-install/usr/l)o(ocal)o(/bin)o(/ba)o(sh)p | |
19620 | Fu(,)32 b(the)37 b(do)s(cumen)m(tation)g(in)m(to)150 | |
19621 | 2865 y(directories)44 b(within)e Ft(/fs1/bash-install/usr/l)o(ocal)o | |
19622 | (/sha)o(re)p Fu(,)e(the)i(example)i(loadable)g(builtins)150 | |
19623 | 2975 y(in)m(to)35 b Ft(/fs1/bash-install/usr/loc)o(al/l)o(ib/b)o(ash)o | |
19624 | Fu(,)30 b(and)k(so)g(on.)53 b(Y)-8 b(ou)34 b(can)h(use)f(the)h(usual)e | |
19625 | Ft(exec_)150 3084 y(prefix)c Fu(and)g Ft(prefix)g Fu(v)-5 | |
19626 | b(ariables)31 b(to)g(alter)h(the)e(directory)h(paths)f(b)s(eneath)g | |
19627 | (the)h(v)-5 b(alue)30 b(of)h Ft(DESTDIR)p Fu(.)275 3237 | |
19628 | y(The)24 b(GNU)i(Mak)m(e\014le)h(standards)d(pro)m(vide)i(a)f(more)h | |
19629 | (complete)g(description)g(of)f(these)h(v)-5 b(ariables)26 | |
19630 | b(and)150 3346 y(their)k(e\013ects.)150 3614 y Fs(10.5)68 | |
19631 | b(Sp)t(ecifying)45 b(the)g(System)h(T)l(yp)t(e)150 3774 | |
19632 | y Fu(There)f(ma)m(y)g(b)s(e)f(some)i(features)f Ft(configure)e | |
19633 | Fu(can)i(not)g(\014gure)g(out)g(automatically)-8 b(,)52 | |
19634 | b(but)44 b(need)h(to)150 3883 y(determine)26 b(b)m(y)g(the)g(t)m(yp)s | |
19635 | (e)g(of)g(host)g(Bash)g(will)g(run)f(on.)39 b(Usually)26 | |
a2851804 | 19636 | b Ft(configure)d Fu(can)k(\014gure)e(that)h(out,)i(but)150 |
e59452c7 | 19637 | 3993 y(if)g(it)g(prin)m(ts)f(a)h(message)g(sa)m(ying)h(it)f(can)g(not)f |
a2851804 | 19638 | (guess)h(the)g(host)f(t)m(yp)s(e,)i(giv)m(e)g(it)f(the)g |
e59452c7 | 19639 | Ft(--host=TYPE)c Fu(option.)150 4103 y(`)p Ft(TYPE)p |
a2851804 CR |
19640 | Fu(')29 b(can)h(either)g(b)s(e)g(a)g(short)f(name)h(for)f(the)h(system) |
19641 | g(t)m(yp)s(e,)h(suc)m(h)e(as)h(`)p Ft(sun4)p Fu(',)g(or)f(a)h | |
e59452c7 | 19642 | (canonical)i(name)150 4212 y(with)e(three)h(\014elds:)40 |
a2851804 | 19643 | b(`)p Ft(CPU-COMPANY-SYSTEM)p Fu(')26 b(\(e.g.,)32 b(`)p |
e59452c7 | 19644 | Ft(i386-unknown-freebsd4.2)p Fu('\).)275 4365 y(See)e(the)h(\014le)f |
a2851804 | 19645 | Ft(support/config.sub)c Fu(for)k(the)g(p)s(ossible)g(v)-5 |
e59452c7 CR |
19646 | b(alues)31 b(of)f(eac)m(h)i(\014eld.)150 4633 y Fs(10.6)68 |
19647 | b(Sharing)45 b(Defaults)150 4792 y Fu(If)d(y)m(ou)i(w)m(an)m(t)g(to)f | |
6e51e0d0 CR |
19648 | (set)h(default)f(v)-5 b(alues)43 b(for)g Ft(configure)d |
19649 | Fu(scripts)j(to)h(share,)i(y)m(ou)d(can)g(create)i(a)e(site)150 | |
e59452c7 | 19650 | 4902 y(shell)48 b(script)f(called)i Ft(config.site)44 |
6e51e0d0 CR |
19651 | b Fu(that)k(giv)m(es)h(default)f(v)-5 b(alues)48 b(for)f(v)-5 |
19652 | b(ariables)48 b(lik)m(e)h Ft(CC)p Fu(,)j Ft(cache_)150 | |
e59452c7 | 19653 | 5011 y(file)p Fu(,)c(and)d Ft(prefix)p Fu(.)85 b Ft(configure)43 |
6e51e0d0 | 19654 | b Fu(lo)s(oks)j(for)f Ft(PREFIX/share/config.site)39 |
e59452c7 | 19655 | b Fu(if)46 b(it)g(exists,)k(then)150 5121 y Ft(PREFIX/etc/config.site) |
6e51e0d0 CR |
19656 | 24 b Fu(if)31 b(it)g(exists.)42 b(Or,)30 b(y)m(ou)h(can)g(set)g(the)g |
19657 | Ft(CONFIG_SITE)c Fu(en)m(vironmen)m(t)k(v)-5 b(ari-)150 | |
e59452c7 | 19658 | 5230 y(able)40 b(to)g(the)g(lo)s(cation)h(of)e(the)h(site)g(script.)67 |
6e51e0d0 | 19659 | b(A)40 b(w)m(arning:)58 b(the)40 b(Bash)g Ft(configure)c |
e59452c7 CR |
19660 | Fu(lo)s(oks)k(for)f(a)h(site)150 5340 y(script,)31 b(but)e(not)i(all)g |
19661 | Ft(configure)d Fu(scripts)i(do.)p eop end | |
fffe80d4 CR |
19662 | %%Page: 160 166 |
19663 | TeXDict begin 160 165 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19664 | b(Installing)31 b(Bash)2356 b(160)150 299 y Fs(10.7)68 | |
e59452c7 | 19665 | b(Op)t(eration)46 b(Con)l(trols)150 458 y Ft(configure)28 |
6e51e0d0 | 19666 | b Fu(recognizes)k(the)e(follo)m(wing)i(options)f(to)g(con)m(trol)h(ho)m |
e59452c7 CR |
19667 | (w)e(it)h(op)s(erates.)150 606 y Ft(--cache-file=)p Fj(file)630 |
19668 | 716 y Fu(Use)d(and)g(sa)m(v)m(e)h(the)f(results)g(of)g(the)h(tests)f | |
19669 | (in)g Fr(\014le)33 b Fu(instead)28 b(of)h Ft(./config.cache)p | |
19670 | Fu(.)36 b(Set)28 b Fr(\014le)630 825 y Fu(to)j Ft(/dev/null)d | |
19671 | Fu(to)j(disable)g(cac)m(hing,)h(for)e(debugging)g Ft(configure)p | |
19672 | Fu(.)150 973 y Ft(--help)192 b Fu(Prin)m(t)30 b(a)h(summary)e(of)i(the) | |
19673 | f(options)h(to)g Ft(configure)p Fu(,)d(and)i(exit.)150 | |
19674 | 1121 y Ft(--quiet)150 1230 y(--silent)150 1340 y(-q)384 | |
19675 | b Fu(Do)31 b(not)g(prin)m(t)f(messages)h(sa)m(ying)g(whic)m(h)g(c)m | |
19676 | (hec)m(ks)g(are)g(b)s(eing)f(made.)150 1487 y Ft(--srcdir=)p | |
19677 | Fj(dir)630 1597 y Fu(Lo)s(ok)i(for)g(the)g(Bash)g(source)h(co)s(de)f | |
19678 | (in)g(directory)g Fr(dir)p Fu(.)45 b(Usually)33 b Ft(configure)c | |
19679 | Fu(can)j(deter-)630 1707 y(mine)e(that)h(directory)g(automatically)-8 | |
19680 | b(.)150 1854 y Ft(--version)630 1964 y Fu(Prin)m(t)29 | |
19681 | b(the)h(v)m(ersion)g(of)g(Auto)s(conf)f(used)g(to)h(generate)h(the)f | |
19682 | Ft(configure)d Fu(script,)j(and)f(exit.)275 2112 y Ft(configure)34 | |
19683 | b Fu(also)k(accepts)g(some)g(other,)h(not)e(widely)g(used,)h(b)s | |
19684 | (oilerplate)g(options.)61 b(`)p Ft(configure)150 2221 | |
19685 | y(--help)p Fu(')29 b(prin)m(ts)h(the)g(complete)i(list.)150 | |
19686 | 2450 y Fs(10.8)68 b(Optional)46 b(F)-11 b(eatures)150 | |
19687 | 2610 y Fu(The)29 b(Bash)h Ft(configure)d Fu(has)j(a)g(n)m(um)m(b)s(er)f | |
19688 | (of)h Ft(--enable-)p Fj(feature)25 b Fu(options,)30 b(where)g | |
19689 | Fr(feature)35 b Fu(indicates)150 2719 y(an)e(optional)i(part)e(of)h | |
19690 | (Bash.)50 b(There)33 b(are)g(also)i(sev)m(eral)g Ft(--with-)p | |
19691 | Fj(package)29 b Fu(options,)35 b(where)e Fr(pac)m(k)-5 | |
19692 | b(age)150 2829 y Fu(is)32 b(something)h(lik)m(e)h(`)p | |
19693 | Ft(bash-malloc)p Fu(')c(or)i(`)p Ft(purify)p Fu('.)45 | |
19694 | b(T)-8 b(o)33 b(turn)e(o\013)i(the)f(default)h(use)f(of)g(a)h(pac)m(k) | |
19695 | -5 b(age,)35 b(use)150 2939 y Ft(--without-)p Fj(package)p | |
19696 | Fu(.)46 b(T)-8 b(o)34 b(con\014gure)g(Bash)g(without)f(a)i(feature)f | |
19697 | (that)g(is)g(enabled)g(b)m(y)f(default,)i(use)150 3048 | |
19698 | y Ft(--disable-)p Fj(feature)p Fu(.)275 3177 y(Here)28 | |
19699 | b(is)g(a)h(complete)g(list)g(of)f(the)h Ft(--enable-)c | |
19700 | Fu(and)j Ft(--with-)e Fu(options)i(that)h(the)f(Bash)g | |
19701 | Ft(configure)150 3286 y Fu(recognizes.)150 3434 y Ft(--with-afs)630 | |
19702 | 3544 y Fu(De\014ne)j(if)f(y)m(ou)h(are)f(using)g(the)h(Andrew)e(File)j | |
19703 | (System)e(from)g(T)-8 b(ransarc.)150 3691 y Ft(--with-bash-malloc)630 | |
19704 | 3801 y Fu(Use)34 b(the)g(Bash)h(v)m(ersion)f(of)g Ft(malloc)e | |
19705 | Fu(in)i(the)g(directory)h Ft(lib/malloc)p Fu(.)48 b(This)34 | |
19706 | b(is)g(not)g(the)630 3911 y(same)e Ft(malloc)e Fu(that)j(app)s(ears)e | |
19707 | (in)g Fm(gnu)h Fu(lib)s(c,)g(but)f(an)h(older)f(v)m(ersion)i | |
19708 | (originally)g(deriv)m(ed)630 4020 y(from)f(the)h(4.2)g | |
19709 | Fm(bsd)f Ft(malloc)p Fu(.)45 b(This)31 b Ft(malloc)g | |
19710 | Fu(is)i(v)m(ery)f(fast,)i(but)e(w)m(astes)h(some)g(space)g(on)630 | |
19711 | 4130 y(eac)m(h)j(allo)s(cation.)58 b(This)34 b(option)i(is)f(enabled)g | |
19712 | (b)m(y)g(default.)56 b(The)34 b Ft(NOTES)g Fu(\014le)h(con)m(tains)i(a) | |
19713 | 630 4239 y(list)29 b(of)f(systems)f(for)h(whic)m(h)g(this)g(should)e(b) | |
19714 | s(e)i(turned)e(o\013,)j(and)f Ft(configure)d Fu(disables)j(this)630 | |
19715 | 4349 y(option)j(automatically)i(for)d(a)h(n)m(um)m(b)s(er)e(of)i | |
19716 | (systems.)150 4497 y Ft(--with-curses)630 4606 y Fu(Use)h(the)h(curses) | |
967625cd | 19717 | e(library)h(instead)g(of)h(the)f(termcap)g(library)-8 |
e59452c7 | 19718 | b(.)46 b(This)32 b(should)f(b)s(e)g(supplied)630 4716 |
6e51e0d0 | 19719 | y(if)f(y)m(our)h(system)f(has)g(an)h(inadequate)g(or)f(incomplete)i |
e59452c7 CR |
19720 | (termcap)e(database.)150 4863 y Ft(--with-gnu-malloc)630 |
19721 | 4973 y Fu(A)g(synon)m(ym)g(for)g Ft(--with-bash-malloc)p | |
19722 | Fu(.)150 5121 y Ft(--with-installed-readlin)o(e[=)p Fj(P)o(REFI)o(X)p | |
19723 | Ft(])630 5230 y Fu(De\014ne)c(this)f(to)h(mak)m(e)h(Bash)f(link)f(with) | |
6e51e0d0 | 19724 | g(a)h(lo)s(cally-installed)i(v)m(ersion)e(of)g(Readline)g(rather)630 |
e59452c7 | 19725 | 5340 y(than)f(the)h(v)m(ersion)g(in)f Ft(lib/readline)p |
6e51e0d0 | 19726 | Fu(.)36 b(This)25 b(w)m(orks)g(only)h(with)f(Readline)h(5.0)h(and)e |
e59452c7 | 19727 | (later)p eop end |
fffe80d4 CR |
19728 | %%Page: 161 167 |
19729 | TeXDict begin 161 166 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19730 | b(Installing)31 b(Bash)2356 b(161)630 299 y(v)m(ersions.)46 | |
e59452c7 CR |
19731 | b(If)32 b Fr(PREFIX)41 b Fu(is)32 b Ft(yes)f Fu(or)i(not)f(supplied,)f |
19732 | Ft(configure)f Fu(uses)i(the)g(v)-5 b(alues)32 b(of)h(the)630 | |
19733 | 408 y(mak)m(e)28 b(v)-5 b(ariables)29 b Ft(includedir)24 | |
19734 | b Fu(and)j Ft(libdir)p Fu(,)g(whic)m(h)g(are)h(sub)s(directories)f(of)g | |
19735 | Ft(prefix)f Fu(b)m(y)630 518 y(default,)44 b(to)d(\014nd)f(the)h | |
19736 | (installed)g(v)m(ersion)h(of)f(Readline)g(if)g(it)g(is)g(not)g(in)g | |
19737 | (the)g(standard)630 628 y(system)35 b(include)f(and)g(library)g | |
19738 | (directories.)54 b(If)34 b Fr(PREFIX)43 b Fu(is)35 b | |
19739 | Ft(no)p Fu(,)g(Bash)f(links)h(with)f(the)630 737 y(v)m(ersion)42 | |
19740 | b(in)e Ft(lib/readline)p Fu(.)70 b(If)40 b Fr(PREFIX)51 | |
19741 | b Fu(is)41 b(set)g(to)h(an)m(y)g(other)f(v)-5 b(alue,)44 | |
19742 | b Ft(configure)630 847 y Fu(treats)27 b(it)g(as)f(a)h(directory)g | |
19743 | (pathname)f(and)f(lo)s(oks)i(for)f(the)g(installed)h(v)m(ersion)g(of)f | |
19744 | (Readline)630 956 y(in)34 b(sub)s(directories)f(of)h(that)h(directory)g | |
19745 | (\(include)f(\014les)g(in)g Fr(PREFIX)9 b Fu(/)p Ft(include)32 | |
19746 | b Fu(and)i(the)630 1066 y(library)c(in)g Fr(PREFIX)9 | |
19747 | b Fu(/)p Ft(lib)p Fu(\).)150 1236 y Ft(--with-libintl-prefix[=)p | |
19748 | Fj(P)o(REFI)o(X)p Ft(])630 1345 y Fu(De\014ne)45 b(this)f(to)h(mak)m(e) | |
19749 | g(Bash)g(link)f(with)g(a)h(lo)s(cally-installed)i(v)m(ersion)e(of)g | |
19750 | (the)f(libin)m(tl)630 1455 y(library)30 b(instead)h(ofthe)f(v)m(ersion) | |
19751 | h(in)f Ft(lib/intl)p Fu(.)150 1625 y Ft(--with-libiconv-prefix[=)o | |
19752 | Fj(PREF)o(IX)p Ft(])630 1734 y Fu(De\014ne)g(this)g(to)g(mak)m(e)h | |
3c5683a4 | 19753 | (Bash)f(lo)s(ok)g(for)g(libicon)m(v)h(in)e Fr(PREFIX)39 |
e59452c7 | 19754 | b Fu(instead)30 b(of)g(the)g(standard)630 1844 y(system)h(lo)s |
3c5683a4 | 19755 | (cations.)42 b(There)30 b(is)g(no)g(v)m(ersion)h(included)f(with)g |
e59452c7 | 19756 | (Bash.)150 2014 y Ft(--enable-minimal-config)630 2123 |
3c5683a4 | 19757 | y Fu(This)23 b(pro)s(duces)f(a)i(shell)g(with)f(minimal)h(features,)h |
e59452c7 CR |
19758 | (close)g(to)f(the)g(historical)h(Bourne)e(shell.)275 |
19759 | 2298 y(There)35 b(are)i(sev)m(eral)h Ft(--enable-)c Fu(options)j(that)g | |
19760 | (alter)g(ho)m(w)g(Bash)f(is)h(compiled,)i(link)m(ed,)f(and)e(in-)150 | |
19761 | 2408 y(stalled,)c(rather)e(than)g(c)m(hanging)h(run-time)f(features.) | |
19762 | 150 2583 y Ft(--enable-largefile)630 2692 y Fu(Enable)36 | |
19763 | b(supp)s(ort)f(for)g(large)j(\014les)e(\()p Ft(http:)5 | |
19764 | b(/)g(/)g(www)g(.)g(unix)g(.)g(org)t(/)g(v)o(ersi)o(on2)t(/)g(w)o(hats) | |
19765 | o(new)t(/)630 2802 y(lfs20mar)h(.)g(html)p Fu(\))35 b(if)j(the)g(op)s | |
19766 | (erating)g(system)g(requires)f(sp)s(ecial)i(compiler)f(options)g(to)630 | |
19767 | 2911 y(build)33 b(programs)g(whic)m(h)h(can)g(access)h(large)g | |
19768 | (\014les.)51 b(This)33 b(is)h(enabled)g(b)m(y)g(default,)h(if)f(the)630 | |
19769 | 3021 y(op)s(erating)d(system)f(pro)m(vides)h(large)g(\014le)g(supp)s | |
19770 | (ort.)150 3191 y Ft(--enable-profiling)630 3300 y Fu(This)g(builds)f(a) | |
3c5683a4 | 19771 | i(Bash)g(binary)f(that)h(pro)s(duces)e(pro\014ling)h(information)h(to)h |
e59452c7 CR |
19772 | (b)s(e)d(pro)s(cessed)630 3410 y(b)m(y)g Ft(gprof)f Fu(eac)m(h)j(time)f |
19773 | (it)g(is)f(executed.)150 3580 y Ft(--enable-separate-helpfi)o(les)630 | |
19774 | 3689 y Fu(Use)i(external)h(\014les)f(for)g(the)g(do)s(cumen)m(tation)h | |
3c5683a4 | 19775 | (displa)m(y)m(ed)f(b)m(y)g(the)g Ft(help)f Fu(builtin)h(instead)630 |
e59452c7 CR |
19776 | 3799 y(of)f(storing)f(the)h(text)g(in)m(ternally)-8 b(.)150 |
19777 | 3969 y Ft(--enable-static-link)630 4078 y Fu(This)37 | |
3c5683a4 CR |
19778 | b(causes)h(Bash)f(to)h(b)s(e)f(link)m(ed)h(statically)-8 |
19779 | b(,)43 b(if)37 b Ft(gcc)g Fu(is)g(b)s(eing)g(used.)61 | |
e59452c7 CR |
19780 | b(This)37 b(could)h(b)s(e)630 4188 y(used)30 b(to)h(build)e(a)i(v)m |
19781 | (ersion)g(to)g(use)f(as)g(ro)s(ot's)h(shell.)275 4363 | |
6e51e0d0 | 19782 | y(The)f(`)p Ft(minimal-config)p Fu(')d(option)k(can)g(b)s(e)f(used)f |
37c41ab1 | 19783 | (to)j(disable)e(all)i(of)f(the)f(follo)m(wing)i(options,)g(but)d(it)150 |
e59452c7 | 19784 | 4472 y(is)h(pro)s(cessed)g(\014rst,)g(so)h(individual)f(options)g(ma)m |
6e51e0d0 | 19785 | (y)h(b)s(e)f(enabled)g(using)g(`)p Ft(enable-)p Fj(feature)p |
e59452c7 CR |
19786 | Fu('.)275 4617 y(All)133 b(of)g(the)g(follo)m(wing)i(options)e(except)h |
19787 | (for)f(`)p Ft(alt-array-implementation)o Fu(',)150 4727 | |
19788 | y(`)p Ft(disabled-builtins)p Fu(',)212 b(`)p Ft(direxpand-default)p | |
19789 | Fu(',)h(`)p Ft(strict-posix-default)p Fu(',)f(and)150 | |
19790 | 4836 y(`)p Ft(xpg-echo-default)p Fu(')28 b(are)33 b(enabled)f(b)m(y)g | |
19791 | (default,)h(unless)e(the)i(op)s(erating)f(system)h(do)s(es)e(not)i(pro) | |
19792 | m(vide)150 4946 y(the)e(necessary)f(supp)s(ort.)150 5121 | |
19793 | y Ft(--enable-alias)630 5230 y Fu(Allo)m(w)41 b(alias)g(expansion)f | |
19794 | (and)f(include)g(the)h Ft(alias)f Fu(and)g Ft(unalias)e | |
19795 | Fu(builtins)j(\(see)g(Sec-)630 5340 y(tion)31 b(6.6)g([Aliases],)i | |
19796 | (page)e(99\).)p eop end | |
fffe80d4 CR |
19797 | %%Page: 162 168 |
19798 | TeXDict begin 162 167 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19799 | b(Installing)31 b(Bash)2356 b(162)150 299 y Ft | |
e59452c7 CR |
19800 | (--enable-alt-array-imple)o(ment)o(atio)o(n)630 408 y |
19801 | Fu(This)33 b(builds)g(bash)g(using)h(an)g(alternate)i(implemen)m | |
19802 | (tation)f(of)g(arra)m(ys)f(\(see)h(Section)g(6.7)630 | |
19803 | 518 y([Arra)m(ys],)47 b(page)d(99\))h(that)f(pro)m(vides)f(faster)h | |
19804 | (access)g(at)g(the)g(exp)s(ense)f(of)g(using)g(more)630 | |
19805 | 628 y(memory)30 b(\(sometimes)i(man)m(y)e(times)h(more,)g(dep)s(ending) | |
19806 | e(on)h(ho)m(w)h(sparse)f(an)g(arra)m(y)h(is\).)150 774 | |
19807 | y Ft(--enable-arith-for-comma)o(nd)630 883 y Fu(Include)21 | |
19808 | b(supp)s(ort)g(for)g(the)i(alternate)g(form)f(of)g(the)g | |
19809 | Ft(for)f Fu(command)h(that)h(b)s(eha)m(v)m(es)f(lik)m(e)i(the)630 | |
19810 | 993 y(C)30 b(language)i Ft(for)d Fu(statemen)m(t)j(\(see)g(Section)f | |
19811 | (3.2.5.1)i([Lo)s(oping)d(Constructs],)h(page)g(11\).)150 | |
19812 | 1139 y Ft(--enable-array-variables)630 1249 y Fu(Include)h(supp)s(ort)g | |
37c41ab1 | 19813 | (for)h(one-dimensional)h(arra)m(y)f(shell)h(v)-5 b(ariables)33 |
e59452c7 CR |
19814 | b(\(see)h(Section)g(6.7)h([Ar-)630 1358 y(ra)m(ys],)c(page)g(99\).)150 |
19815 | 1504 y Ft(--enable-bang-history)630 1614 y Fu(Include)36 | |
6e51e0d0 | 19816 | b(supp)s(ort)f(for)h Ft(csh)p Fu(-lik)m(e)h(history)g(substitution)f |
e59452c7 | 19817 | (\(see)h(Section)g(9.3)h([History)f(In-)630 1724 y(teraction],)c(page)e |
fffe80d4 | 19818 | (153\).)150 1870 y Ft(--enable-brace-expansion)630 1979 |
6e51e0d0 CR |
19819 | y Fu(Include)40 b Ft(csh)p Fu(-lik)m(e)h(brace)f(expansion)g(\()h |
19820 | Ft(b{a,b}c)d Fq(7!)i Ft(bac)30 b(bbc)39 b Fu(\).)71 b(See)40 | |
e59452c7 CR |
19821 | b(Section)h(3.5.1)630 2089 y([Brace)32 b(Expansion],)e(page)h(24,)h |
19822 | (for)e(a)g(complete)i(description.)150 2235 y Ft | |
19823 | (--enable-casemod-attribu)o(tes)630 2345 y Fu(Include)37 | |
09767ff0 | 19824 | b(supp)s(ort)g(for)g(case-mo)s(difying)i(attributes)g(in)e(the)h |
e59452c7 CR |
19825 | Ft(declare)e Fu(builtin)i(and)f(as-)630 2454 y(signmen)m(t)43 |
19826 | b(statemen)m(ts.)78 b(V)-8 b(ariables)44 b(with)e(the)g | |
19827 | Ft(uppercase)e Fu(attribute,)46 b(for)c(example,)630 | |
19828 | 2564 y(will)31 b(ha)m(v)m(e)g(their)g(v)-5 b(alues)30 | |
19829 | b(con)m(v)m(erted)i(to)f(upp)s(ercase)f(up)s(on)f(assignmen)m(t.)150 | |
19830 | 2710 y Ft(--enable-casemod-expansi)o(on)630 2819 y Fu(Include)h(supp)s | |
19831 | (ort)e(for)i(case-mo)s(difying)i(w)m(ord)e(expansions.)150 | |
19832 | 2966 y Ft(--enable-command-timing)630 3075 y Fu(Include)43 | |
19833 | b(supp)s(ort)f(for)h(recognizing)i Ft(time)e Fu(as)g(a)h(reserv)m(ed)g | |
19834 | (w)m(ord)f(and)g(for)h(displa)m(ying)630 3185 y(timing)37 | |
19835 | b(statistics)h(for)e(the)g(pip)s(eline)g(follo)m(wing)i | |
19836 | Ft(time)d Fu(\(see)i(Section)g(3.2.3)h([Pip)s(elines],)630 | |
19837 | 3294 y(page)j(10\).)70 b(This)40 b(allo)m(ws)h(pip)s(elines)e(as)h(w)m | |
19838 | (ell)h(as)f(shell)h(builtins)e(and)g(functions)h(to)h(b)s(e)630 | |
19839 | 3404 y(timed.)150 3550 y Ft(--enable-cond-command)630 | |
19840 | 3660 y Fu(Include)33 b(supp)s(ort)f(for)i(the)g Ft([[)f | |
19841 | Fu(conditional)i(command.)51 b(\(see)34 b(Section)h(3.2.5.2)h([Condi-) | |
19842 | 630 3769 y(tional)c(Constructs],)e(page)h(12\).)150 3915 | |
19843 | y Ft(--enable-cond-regexp)630 4025 y Fu(Include)k(supp)s(ort)f(for)i | |
3c5683a4 | 19844 | (matc)m(hing)h Fm(posix)e Fu(regular)h(expressions)g(using)f(the)h(`)p |
e59452c7 | 19845 | Ft(=~)p Fu(')g(binary)630 4134 y(op)s(erator)25 b(in)f(the)h |
d37a4722 | 19846 | Ft([[)f Fu(conditional)h(command.)39 b(\(see)25 b(Section)h(3.2.5.2)h |
e59452c7 CR |
19847 | ([Conditional)e(Con-)630 4244 y(structs],)31 b(page)g(12\).)150 |
19848 | 4390 y Ft(--enable-coprocesses)630 4500 y Fu(Include)23 | |
6e51e0d0 | 19849 | b(supp)s(ort)f(for)i(copro)s(cesses)g(and)f(the)h Ft(coproc)e |
d37a4722 | 19850 | Fu(reserv)m(ed)i(w)m(ord)g(\(see)h(Section)f(3.2.3)630 |
e59452c7 CR |
19851 | 4609 y([Pip)s(elines],)31 b(page)g(10\).)150 4756 y Ft |
19852 | (--enable-debugger)630 4865 y Fu(Include)f(supp)s(ort)e(for)i(the)h | |
3c5683a4 | 19853 | (bash)f(debugger)g(\(distributed)g(separately\).)150 |
e59452c7 | 19854 | 5011 y Ft(--enable-dev-fd-stat-bro)o(ken)630 5121 y Fu(If)c(calling)j |
3c5683a4 CR |
19855 | Ft(stat)d Fu(on)g(/dev/fd/)p Fr(N)38 b Fu(returns)25 |
19856 | b(di\013eren)m(t)j(results)f(than)f(calling)j Ft(fstat)c | |
e59452c7 | 19857 | Fu(on)i(\014le)630 5230 y(descriptor)g Fr(N)p Fu(,)i(supply)c(this)j |
3c5683a4 | 19858 | (option)g(to)g(enable)f(a)h(w)m(ork)-5 b(around.)39 b(This)27 |
e59452c7 CR |
19859 | b(has)g(implications)630 5340 y(for)j(conditional)i(commands)e(that)h |
19860 | (test)g(\014le)g(attributes.)p eop end | |
fffe80d4 CR |
19861 | %%Page: 163 169 |
19862 | TeXDict begin 163 168 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19863 | b(Installing)31 b(Bash)2356 b(163)150 299 y Ft | |
e59452c7 CR |
19864 | (--enable-direxpand-defau)o(lt)630 408 y Fu(Cause)53 |
19865 | b(the)g Ft(direxpand)d Fu(shell)j(option)h(\(see)g(Section)f(4.3.2)i | |
19866 | ([The)e(Shopt)f(Builtin],)630 518 y(page)29 b(70\))g(to)f(b)s(e)f | |
19867 | (enabled)h(b)m(y)g(default)g(when)e(the)i(shell)g(starts.)41 | |
19868 | b(It)27 b(is)h(normally)g(disabled)630 628 y(b)m(y)i(default.)150 | |
19869 | 807 y Ft(--enable-directory-stack)630 917 y Fu(Include)j(supp)s(ort)g | |
19870 | (for)h(a)g Ft(csh)p Fu(-lik)m(e)h(directory)f(stac)m(k)i(and)d(the)i | |
19871 | Ft(pushd)p Fu(,)f Ft(popd)p Fu(,)g(and)f Ft(dirs)630 | |
19872 | 1026 y Fu(builtins)d(\(see)h(Section)g(6.8)h([The)e(Directory)i(Stac)m | |
19873 | (k],)g(page)f(101\).)150 1205 y Ft(--enable-disabled-builti)o(ns)630 | |
19874 | 1315 y Fu(Allo)m(w)40 b(builtin)e(commands)g(to)h(b)s(e)f(in)m(v)m(ok)m | |
19875 | (ed)i(via)f(`)p Ft(builtin)29 b(xxx)p Fu(')37 b(ev)m(en)j(after)f | |
19876 | Ft(xxx)e Fu(has)630 1425 y(b)s(een)31 b(disabled)g(using)g(`)p | |
6e51e0d0 | 19877 | Ft(enable)d(-n)i(xxx)p Fu('.)43 b(See)32 b(Section)g(4.2)h([Bash)e |
e59452c7 | 19878 | (Builtins],)i(page)f(54,)630 1534 y(for)e(details)i(of)e(the)h |
6e51e0d0 | 19879 | Ft(builtin)d Fu(and)i Ft(enable)e Fu(builtin)i(commands.)150 |
e59452c7 | 19880 | 1714 y Ft(--enable-dparen-arithmet)o(ic)630 1823 y Fu(Include)42 |
6e51e0d0 | 19881 | b(supp)s(ort)f(for)h(the)h Ft(\(\(...)o(\)\))f Fu(command)g(\(see)i |
e59452c7 CR |
19882 | (Section)f(3.2.5.2)i([Conditional)630 1933 y(Constructs],)30 |
19883 | b(page)h(12\).)150 2112 y Ft(--enable-extended-glob)630 | |
19884 | 2222 y Fu(Include)40 b(supp)s(ort)e(for)i(the)h(extended)f(pattern)h | |
09767ff0 | 19885 | (matc)m(hing)g(features)g(describ)s(ed)e(ab)s(o)m(v)m(e)630 |
e59452c7 CR |
19886 | 2331 y(under)29 b(Section)i(3.5.8.1)i([P)m(attern)e(Matc)m(hing],)i |
19887 | (page)e(36.)150 2511 y Ft(--enable-extended-glob-d)o(efau)o(lt)630 | |
19888 | 2620 y Fu(Set)37 b(the)f(default)h(v)-5 b(alue)37 b(of)f(the)h | |
19889 | Ft(extglob)d Fu(shell)j(option)g(describ)s(ed)e(ab)s(o)m(v)m(e)j(under) | |
19890 | c(Sec-)630 2730 y(tion)d(4.3.2)h([The)e(Shopt)g(Builtin],)h(page)g(70,) | |
19891 | h(to)f(b)s(e)f(enabled.)150 2909 y Ft(--enable-function-import)630 | |
19892 | 3019 y Fu(Include)23 b(supp)s(ort)g(for)g(imp)s(orting)h(function)g | |
8a0829e9 | 19893 | (de\014nitions)f(exp)s(orted)h(b)m(y)g(another)g(instance)630 |
e59452c7 CR |
19894 | 3128 y(of)31 b(the)f(shell)h(from)f(the)g(en)m(vironmen)m(t.)41 |
19895 | b(This)30 b(option)h(is)f(enabled)h(b)m(y)f(default.)150 | |
19896 | 3308 y Ft(--enable-glob-asciirange)o(-def)o(ault)630 | |
19897 | 3417 y Fu(Set)f(the)f(default)h(v)-5 b(alue)29 b(of)f(the)h | |
19898 | Ft(globasciiranges)24 b Fu(shell)29 b(option)g(describ)s(ed)e(ab)s(o)m | |
19899 | (v)m(e)j(un-)630 3527 y(der)c(Section)i(4.3.2)h([The)d(Shopt)g | |
19900 | (Builtin],)j(page)f(70,)g(to)g(b)s(e)e(enabled.)40 b(This)26 | |
19901 | b(con)m(trols)i(the)630 3636 y(b)s(eha)m(vior)40 b(of)f(c)m(haracter)i | |
19902 | (ranges)f(when)f(used)f(in)i(pattern)f(matc)m(hing)i(brac)m(k)m(et)g | |
19903 | (expres-)630 3746 y(sions.)150 3925 y Ft(--enable-help-builtin)630 | |
19904 | 4035 y Fu(Include)24 b(the)h Ft(help)f Fu(builtin,)h(whic)m(h)g(displa) | |
19905 | m(ys)f(help)h(on)f(shell)h(builtins)f(and)h(v)-5 b(ariables)25 | |
19906 | b(\(see)630 4144 y(Section)31 b(4.2)h([Bash)e(Builtins],)i(page)f | |
19907 | (54\).)150 4324 y Ft(--enable-history)630 4433 y Fu(Include)e(command)g | |
19908 | (history)h(and)f(the)h Ft(fc)f Fu(and)g Ft(history)e | |
19909 | Fu(builtin)j(commands)f(\(see)h(Sec-)630 4543 y(tion)h(9.1)g([Bash)g | |
fffe80d4 | 19910 | (History)g(F)-8 b(acilities],)34 b(page)d(151\).)150 |
e59452c7 CR |
19911 | 4722 y Ft(--enable-job-control)630 4832 y Fu(This)h(enables)i(the)f |
19912 | (job)g(con)m(trol)i(features)e(\(see)i(Chapter)d(7)i([Job)f(Con)m | |
fffe80d4 | 19913 | (trol],)i(page)f(112\),)630 4941 y(if)c(the)h(op)s(erating)g(system)f |
e59452c7 CR |
19914 | (supp)s(orts)f(them.)150 5121 y Ft(--enable-multibyte)630 |
19915 | 5230 y Fu(This)g(enables)i(supp)s(ort)d(for)i(m)m(ultib)m(yte)h(c)m | |
19916 | (haracters)g(if)f(the)g(op)s(erating)h(system)f(pro)m(vides)630 | |
19917 | 5340 y(the)h(necessary)f(supp)s(ort.)p eop end | |
fffe80d4 CR |
19918 | %%Page: 164 170 |
19919 | TeXDict begin 164 169 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19920 | b(Installing)31 b(Bash)2356 b(164)150 299 y Ft | |
e59452c7 CR |
19921 | (--enable-net-redirection)o(s)630 408 y Fu(This)23 b(enables)h(the)g |
19922 | (sp)s(ecial)h(handling)e(of)h(\014lenames)g(of)g(the)g(form)g | |
19923 | Ft(/dev/tcp/)p Fj(host)p Ft(/)p Fj(port)630 518 y Fu(and)31 | |
19924 | b Ft(/dev/udp/)p Fj(host)p Ft(/)p Fj(port)26 b Fu(when)31 | |
19925 | b(used)g(in)g(redirections)h(\(see)g(Section)g(3.6)h([Redirec-)630 | |
5e6f45d9 CR |
19926 | 628 y(tions],)e(page)g(37\).)150 787 y Ft(--enable-process-substit)o |
19927 | (utio)o(n)630 897 y Fu(This)49 b(enables)i(pro)s(cess)f(substitution)g | |
e59452c7 | 19928 | (\(see)h(Section)g(3.5.6)h([Pro)s(cess)e(Substitution],)630 |
5e6f45d9 CR |
19929 | 1006 y(page)31 b(34\))h(if)e(the)h(op)s(erating)f(system)h(pro)m(vides) |
19930 | f(the)h(necessary)g(supp)s(ort.)150 1166 y Ft(--enable-progcomp)630 | |
19931 | 1275 y Fu(Enable)d(the)g(programmable)g(completion)i(facilities)g | |
19932 | (\(see)f(Section)g(8.6)g([Programmable)630 1385 y(Completion],)i(page)h | |
fffe80d4 | 19933 | (142\).)42 b(If)30 b(Readline)h(is)f(not)h(enabled,)f(this)h(option)g |
5e6f45d9 CR |
19934 | (has)f(no)g(e\013ect.)150 1544 y Ft(--enable-prompt-string-d)o(ecod)o |
19935 | (ing)630 1654 y Fu(T)-8 b(urn)30 b(on)i(the)f(in)m(terpretation)i(of)f | |
e59452c7 | 19936 | (a)g(n)m(um)m(b)s(er)e(of)i(bac)m(kslash-escap)s(ed)g(c)m(haracters)i |
5e6f45d9 | 19937 | (in)d(the)630 1763 y Ft($PS0)p Fu(,)36 b Ft($PS1)p Fu(,)g |
e59452c7 CR |
19938 | Ft($PS2)p Fu(,)h(and)e Ft($PS4)f Fu(prompt)h(strings.)57 |
19939 | b(See)36 b(Section)h(6.9)g([Con)m(trolling)g(the)630 | |
5e6f45d9 CR |
19940 | 1873 y(Prompt],)30 b(page)h(103,)h(for)f(a)f(complete)i(list)f(of)g |
19941 | (prompt)e(string)i(escap)s(e)f(sequences.)150 2032 y | |
19942 | Ft(--enable-readline)630 2142 y Fu(Include)e(supp)s(ort)f(for)h | |
e59452c7 | 19943 | (command-line)h(editing)g(and)f(history)g(with)g(the)h(Bash)g(v)m |
5e6f45d9 CR |
19944 | (ersion)g(of)630 2252 y(the)i(Readline)g(library)f(\(see)h(Chapter)f(8) |
19945 | g([Command)g(Line)g(Editing],)h(page)g(116\).)150 2411 | |
19946 | y Ft(--enable-restricted)630 2521 y Fu(Include)41 b(supp)s(ort)f(for)i | |
e59452c7 | 19947 | (a)g Fr(restricted)g(shell)p Fu(.)75 b(If)42 b(this)f(is)h(enabled,)j |
5e6f45d9 | 19948 | (Bash,)g(when)c(called)630 2630 y(as)f Ft(rbash)p Fu(,)h(en)m(ters)f(a) |
e59452c7 | 19949 | g(restricted)h(mo)s(de.)68 b(See)40 b(Section)h(6.10)g([The)f |
5e6f45d9 CR |
19950 | (Restricted)h(Shell],)630 2740 y(page)31 b(104,)h(for)e(a)h |
19951 | (description)f(of)h(restricted)g(mo)s(de.)150 2899 y | |
19952 | Ft(--enable-select)630 3009 y Fu(Include)25 b(the)h Ft(select)f | |
e59452c7 | 19953 | Fu(comp)s(ound)f(command,)j(whic)m(h)e(allo)m(ws)j(the)e(generation)h |
5e6f45d9 CR |
19954 | (of)f(simple)630 3118 y(men)m(us)k(\(see)h(Section)g(3.2.5.2)i |
19955 | ([Conditional)e(Constructs],)g(page)g(12\).)150 3278 | |
19956 | y Ft(--enable-single-help-str)o(ings)630 3387 y Fu(Store)40 | |
3c5683a4 CR |
19957 | b(the)g(text)h(displa)m(y)m(ed)g(b)m(y)e(the)i Ft(help)d |
19958 | Fu(builtin)i(as)g(a)g(single)h(string)f(for)f(eac)m(h)i(help)630 | |
5e6f45d9 | 19959 | 3497 y(topic.)54 b(This)33 b(aids)i(in)f(translating)h(the)g(text)g(to) |
e59452c7 | 19960 | g(di\013eren)m(t)g(languages.)54 b(Y)-8 b(ou)35 b(ma)m(y)g(need)630 |
5e6f45d9 CR |
19961 | 3606 y(to)c(disable)g(this)f(if)g(y)m(our)h(compiler)g(cannot)f(handle) |
19962 | g(v)m(ery)h(long)g(string)f(literals.)150 3766 y Ft | |
19963 | (--enable-strict-posix-de)o(faul)o(t)630 3875 y Fu(Mak)m(e)c(Bash)f | |
3c5683a4 | 19964 | Fm(posix)p Fu(-conforman)m(t)g(b)m(y)f(default)h(\(see)g(Section)h |
5e6f45d9 CR |
19965 | (6.11)g([Bash)f(POSIX)e(Mo)s(de],)630 3985 y(page)31 |
19966 | b(105\).)150 4144 y Ft(--enable-translatable-st)o(ring)o(s)630 | |
19967 | 4254 y Fu(Enable)h(supp)s(ort)e(for)i Ft($")p Fj(string)p | |
19968 | Ft(")e Fu(translatable)j(strings)f(\(see)h(Section)g(3.1.2.5)h([Lo)s | |
19969 | (cale)630 4364 y(T)-8 b(ranslation],)32 b(page)f(7\).)150 | |
19970 | 4523 y Ft(--enable-usg-echo-defaul)o(t)630 4633 y Fu(A)f(synon)m(ym)g | |
19971 | (for)g Ft(--enable-xpg-echo-default)p Fu(.)150 4792 y | |
19972 | Ft(--enable-xpg-echo-defaul)o(t)630 4902 y Fu(Mak)m(e)c(the)f | |
19973 | Ft(echo)e Fu(builtin)i(expand)f(bac)m(kslash-escap)s(ed)h(c)m | |
19974 | (haracters)h(b)m(y)f(default,)h(without)630 5011 y(requiring)d(the)h | |
19975 | Ft(-e)f Fu(option.)39 b(This)23 b(sets)h(the)g(default)g(v)-5 | |
19976 | b(alue)24 b(of)g(the)g Ft(xpg_echo)e Fu(shell)h(option)630 | |
19977 | 5121 y(to)28 b Ft(on)p Fu(,)g(whic)m(h)f(mak)m(es)h(the)g(Bash)f | |
19978 | Ft(echo)f Fu(b)s(eha)m(v)m(e)i(more)g(lik)m(e)h(the)e(v)m(ersion)h(sp)s | |
19979 | (eci\014ed)f(in)g(the)630 5230 y(Single)35 b(Unix)f(Sp)s | |
19980 | (eci\014cation,)i(v)m(ersion)e(3.)53 b(See)35 b(Section)g(4.2)g([Bash)g | |
19981 | (Builtins],)h(page)f(54,)630 5340 y(for)30 b(a)h(description)f(of)h | |
19982 | (the)f(escap)s(e)h(sequences)g(that)g Ft(echo)e Fu(recognizes.)p | |
19983 | eop end | |
19984 | %%Page: 165 171 | |
19985 | TeXDict begin 165 170 bop 150 -116 a Fu(Chapter)30 b(10:)41 | |
19986 | b(Installing)31 b(Bash)2356 b(165)275 299 y(The)28 b(\014le)i | |
3c5683a4 CR |
19987 | Ft(config-top.h)c Fu(con)m(tains)31 b(C)d(Prepro)s(cessor)h(`)p |
19988 | Ft(#define)p Fu(')f(statemen)m(ts)j(for)f(options)f(whic)m(h)150 | |
5e6f45d9 | 19989 | 408 y(are)35 b(not)g(settable)i(from)d Ft(configure)p |
3c5683a4 | 19990 | Fu(.)51 b(Some)35 b(of)g(these)g(are)h(not)f(mean)m(t)g(to)h(b)s(e)e(c) |
5e6f45d9 | 19991 | m(hanged;)k(b)s(ew)m(are)d(of)150 518 y(the)h(consequences)g(if)f(y)m |
3c5683a4 | 19992 | (ou)h(do.)55 b(Read)36 b(the)g(commen)m(ts)g(asso)s(ciated)h(with)e |
5e6f45d9 CR |
19993 | (eac)m(h)i(de\014nition)e(for)g(more)150 628 y(information)c(ab)s(out)f |
19994 | (its)h(e\013ect.)p eop end | |
19995 | %%Page: 166 172 | |
19996 | TeXDict begin 166 171 bop 3614 -116 a Fu(166)150 299 | |
037a8b7f CR |
19997 | y Fp(App)t(endix)52 b(A)81 b(Rep)t(orting)53 b(Bugs)150 |
19998 | 533 y Fu(Please)33 b(rep)s(ort)e(all)h(bugs)f(y)m(ou)h(\014nd)e(in)i | |
19999 | (Bash.)44 b(But)32 b(\014rst,)g(y)m(ou)g(should)e(mak)m(e)j(sure)e | |
20000 | (that)h(it)g(really)h(is)f(a)150 643 y(bug,)d(and)g(that)h(it)g(app)s | |
20001 | (ears)f(in)g(the)h(latest)h(v)m(ersion)f(of)g(Bash.)40 | |
20002 | b(The)29 b(latest)j(v)m(ersion)e(of)f(Bash)h(is)f(alw)m(a)m(ys)150 | |
e59452c7 CR |
20003 | 752 y(a)m(v)-5 b(ailable)43 b(for)d(FTP)g(from)g Ft(ftp:)8 |
20004 | b(/)g(/)g(ftp)g(.)g(gnu)g(.)g(org)g(/)g(pub)g(/)g(gnu)g(/)g(bash)g(/)45 | |
20005 | b Fu(and)40 b(from)g Ft(http:)8 b(/)g(/)g(git)g(.)150 | |
20006 | 862 y(savannah.gnu.org/cgit/ba)o(sh.g)o(it/s)o(nap)o(shot)o(/bas)o(h-m) | |
20007 | o(aste)o(r.ta)o(r.g)o(z)p Fu(.)275 996 y(Once)41 b(y)m(ou)g(ha)m(v)m(e) | |
20008 | h(determined)f(that)h(a)f(bug)g(actually)h(exists,)j(use)c(the)g | |
20009 | Ft(bashbug)e Fu(command)i(to)150 1106 y(submit)25 b(a)h(bug)g(rep)s | |
20010 | (ort.)38 b(If)26 b(y)m(ou)g(ha)m(v)m(e)h(a)f(\014x,)h(y)m(ou)f(are)g | |
20011 | (encouraged)h(to)f(mail)h(that)f(as)g(w)m(ell!)40 b(Suggestions)150 | |
20012 | 1215 y(and)j(`philosophical')i(bug)e(rep)s(orts)f(ma)m(y)j(b)s(e)e | |
20013 | (mailed)h(to)g Ft(bug-bash@gnu)11 b(.)g(org)39 b Fu(or)k(p)s(osted)g | |
20014 | (to)i(the)150 1325 y(Usenet)31 b(newsgroup)e Ft(gnu.bash.bug)p | |
20015 | Fu(.)275 1460 y(All)i(bug)e(rep)s(orts)h(should)f(include:)225 | |
20016 | 1594 y Fq(\017)60 b Fu(The)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(of)h | |
20017 | (Bash.)225 1729 y Fq(\017)60 b Fu(The)30 b(hardw)m(are)g(and)g(op)s | |
20018 | (erating)g(system.)225 1863 y Fq(\017)60 b Fu(The)30 | |
20019 | b(compiler)h(used)e(to)i(compile)h(Bash.)225 1998 y Fq(\017)60 | |
6e51e0d0 | 20020 | b Fu(A)30 b(description)h(of)f(the)h(bug)f(b)s(eha)m(viour.)225 |
e59452c7 | 20021 | 2132 y Fq(\017)60 b Fu(A)30 b(short)h(script)f(or)g(`recip)s(e')h(whic) |
37c41ab1 | 20022 | m(h)f(exercises)i(the)e(bug)g(and)g(ma)m(y)h(b)s(e)f(used)f(to)i(repro) |
e59452c7 | 20023 | s(duce)e(it.)150 2291 y Ft(bashbug)d Fu(inserts)i(the)h(\014rst)f |
37c41ab1 | 20024 | (three)g(items)h(automatically)i(in)m(to)f(the)e(template)i(it)f(pro)m |
e59452c7 CR |
20025 | (vides)f(for)g(\014ling)h(a)150 2401 y(bug)h(rep)s(ort.)275 |
20026 | 2535 y(Please)h(send)f(all)h(rep)s(orts)f(concerning)g(this)h(man)m | |
6e51e0d0 | 20027 | (ual)f(to)h Ft(bug-bash@gnu.org)p Fu(.)p eop end |
5e6f45d9 CR |
20028 | %%Page: 167 173 |
20029 | TeXDict begin 167 172 bop 3614 -116 a Fu(167)150 141 | |
037a8b7f CR |
20030 | y Fp(App)t(endix)58 b(B)81 b(Ma)9 b(jor)54 b(Di\013erences)d(F)-13 |
20031 | b(rom)54 b(The)g(Bourne)1088 299 y(Shell)150 530 y Fu(Bash)26 | |
c302751c CR |
20032 | b(implemen)m(ts)h(essen)m(tially)g(the)g(same)f(grammar,)h(parameter)f |
20033 | (and)g(v)-5 b(ariable)27 b(expansion,)g(redirec-)150 | |
20034 | 640 y(tion,)i(and)e(quoting)g(as)h(the)g(Bourne)f(Shell.)40 | |
6e51e0d0 | 20035 | b(Bash)27 b(uses)g(the)h Fm(posix)f Fu(standard)f(as)i(the)g(sp)s |
c302751c CR |
20036 | (eci\014cation)g(of)150 749 y(ho)m(w)34 b(these)h(features)g(are)g(to)g |
20037 | (b)s(e)f(implemen)m(ted.)53 b(There)34 b(are)h(some)g(di\013erences)g | |
20038 | (b)s(et)m(w)m(een)g(the)g(tradi-)150 859 y(tional)e(Bourne)e(shell)h | |
ac18b312 CR |
20039 | (and)f(Bash;)i(this)f(section)g(quic)m(kly)h(details)g(the)e |
20040 | (di\013erences)h(of)g(signi\014cance.)46 b(A)150 969 | |
20041 | y(n)m(um)m(b)s(er)24 b(of)h(these)h(di\013erences)f(are)h(explained)f | |
20042 | (in)g(greater)h(depth)f(in)g(previous)f(sections.)40 | |
20043 | b(This)25 b(section)150 1078 y(uses)33 b(the)i(v)m(ersion)f(of)g | |
6e51e0d0 | 20044 | Ft(sh)f Fu(included)g(in)h(SVR4.2)h(\(the)f(last)h(v)m(ersion)f(of)g |
ac18b312 | 20045 | (the)g(historical)i(Bourne)d(shell\))150 1188 y(as)e(the)f(baseline)h |
6e51e0d0 CR |
20046 | (reference.)225 1322 y Fq(\017)60 b Fu(Bash)32 b(is)h |
20047 | Fm(posix)p Fu(-conforman)m(t,)g(ev)m(en)g(where)f(the)g | |
20048 | Fm(posix)g Fu(sp)s(eci\014cation)h(di\013ers)f(from)g(traditional)330 | |
20049 | 1431 y Ft(sh)e Fu(b)s(eha)m(vior)g(\(see)i(Section)f(6.11)h([Bash)e | |
e59452c7 | 20050 | (POSIX)g(Mo)s(de],)h(page)g(105\).)225 1565 y Fq(\017)60 |
6e51e0d0 | 20051 | b Fu(Bash)26 b(has)g(m)m(ulti-c)m(haracter)i(in)m(v)m(o)s(cation)g |
1c72c0cd | 20052 | (options)f(\(see)f(Section)h(6.1)g([In)m(v)m(oking)g(Bash],)h(page)e |
e59452c7 | 20053 | (90\).)225 1699 y Fq(\017)60 b Fu(Bash)40 b(has)f(command-line)h |
9f178efb | 20054 | (editing)g(\(see)h(Chapter)e(8)h([Command)f(Line)g(Editing],)k(page)d |
fffe80d4 | 20055 | (116\))330 1809 y(and)30 b(the)g Ft(bind)g Fu(builtin.)225 |
6e51e0d0 | 20056 | 1943 y Fq(\017)60 b Fu(Bash)46 b(pro)m(vides)g(a)g(programmable)g(w)m |
1c72c0cd | 20057 | (ord)f(completion)i(mec)m(hanism)f(\(see)h(Section)g(8.6)g([Pro-)330 |
fffe80d4 | 20058 | 2052 y(grammable)39 b(Completion],)i(page)e(142\),)i(and)d(builtin)g |
6e51e0d0 CR |
20059 | (commands)f Ft(complete)p Fu(,)h Ft(compgen)p Fu(,)h(and)330 |
20060 | 2162 y Ft(compopt)p Fu(,)29 b(to)i(manipulate)g(it.)225 | |
20061 | 2296 y Fq(\017)60 b Fu(Bash)26 b(has)f(command)h(history)f(\(see)i | |
37c41ab1 | 20062 | (Section)f(9.1)h([Bash)f(History)h(F)-8 b(acilities],)30 |
fffe80d4 | 20063 | b(page)c(151\))i(and)d(the)330 2405 y Ft(history)k Fu(and)h |
6e51e0d0 | 20064 | Ft(fc)g Fu(builtins)g(to)h(manipulate)g(it.)42 b(The)30 |
37c41ab1 | 20065 | b(Bash)h(history)g(list)g(main)m(tains)g(timestamp)330 |
1c72c0cd | 20066 | 2515 y(information)g(and)e(uses)h(the)h(v)-5 b(alue)31 |
6e51e0d0 CR |
20067 | b(of)f(the)h Ft(HISTTIMEFORMAT)26 b Fu(v)-5 b(ariable)32 |
20068 | b(to)f(displa)m(y)f(it.)225 2649 y Fq(\017)60 b Fu(Bash)48 | |
20069 | b(implemen)m(ts)h Ft(csh)p Fu(-lik)m(e)g(history)f(expansion)g(\(see)h | |
1c72c0cd | 20070 | (Section)g(9.3)h([History)f(In)m(teraction],)330 2759 |
fffe80d4 | 20071 | y(page)31 b(153\).)225 2892 y Fq(\017)60 b Fu(Bash)33 |
37c41ab1 | 20072 | b(has)g(one-dimensional)h(arra)m(y)f(v)-5 b(ariables)34 |
e59452c7 | 20073 | b(\(see)g(Section)g(6.7)g([Arra)m(ys],)g(page)g(99\),)h(and)e(the)330 |
1c72c0cd | 20074 | 3002 y(appropriate)39 b(v)-5 b(ariable)40 b(expansions)f(and)g |
37c41ab1 | 20075 | (assignmen)m(t)h(syn)m(tax)g(to)g(use)f(them.)67 b(Sev)m(eral)40 |
1c72c0cd | 20076 | b(of)g(the)330 3112 y(Bash)32 b(builtins)f(tak)m(e)j(options)e(to)h |
37c41ab1 | 20077 | (act)g(on)e(arra)m(ys.)46 b(Bash)32 b(pro)m(vides)g(a)g(n)m(um)m(b)s |
1c72c0cd | 20078 | (er)f(of)h(built-in)f(arra)m(y)330 3221 y(v)-5 b(ariables.)225 |
6e51e0d0 | 20079 | 3355 y Fq(\017)60 b Fu(The)37 b Ft($'...)n(')g Fu(quoting)g(syn)m(tax,) |
37c41ab1 | 20080 | j(whic)m(h)d(expands)f(ANSI-C)h(bac)m(kslash-escap)s(ed)h(c)m |
1c72c0cd | 20081 | (haracters)g(in)330 3465 y(the)26 b(text)h(b)s(et)m(w)m(een)g(the)g |
37c41ab1 | 20082 | (single)f(quotes,)i(is)e(supp)s(orted)f(\(see)i(Section)g(3.1.2.4)h |
1c72c0cd | 20083 | ([ANSI-C)e(Quoting],)330 3574 y(page)31 b(6\).)225 3708 |
6e51e0d0 CR |
20084 | y Fq(\017)60 b Fu(Bash)30 b(supp)s(orts)f(the)h Ft($"...)o(")f |
20085 | Fu(quoting)i(syn)m(tax)g(to)f(do)g(lo)s(cale-sp)s(eci\014c)i | |
20086 | (translation)g(of)e(the)g(c)m(har-)330 3818 y(acters)g(b)s(et)m(w)m | |
20087 | (een)f(the)f(double)g(quotes.)41 b(The)28 b Ft(-D)p Fu(,)h | |
20088 | Ft(--dump-strings)p Fu(,)c(and)j Ft(--dump-po-strings)330 | |
20089 | 3927 y Fu(in)m(v)m(o)s(cation)42 b(options)d(list)i(the)e(translatable) | |
20090 | i(strings)f(found)e(in)h(a)h(script)g(\(see)g(Section)g(3.1.2.5)330 | |
20091 | 4037 y([Lo)s(cale)32 b(T)-8 b(ranslation],)31 b(page)h(7\).)225 | |
20092 | 4171 y Fq(\017)60 b Fu(Bash)44 b(implemen)m(ts)g(the)f | |
20093 | Ft(!)h Fu(k)m(eyw)m(ord)g(to)g(negate)h(the)f(return)e(v)-5 | |
20094 | b(alue)44 b(of)g(a)g(pip)s(eline)f(\(see)h(Sec-)330 4281 | |
e59452c7 CR |
20095 | y(tion)36 b(3.2.3)h([Pip)s(elines],)g(page)f(10\).)57 |
20096 | b(V)-8 b(ery)36 b(useful)f(when)f(an)h Ft(if)g Fu(statemen)m(t)i(needs) | |
20097 | e(to)h(act)h(only)330 4390 y(if)32 b(a)g(test)g(fails.)45 | |
20098 | b(The)31 b(Bash)h(`)p Ft(-o)e(pipefail)p Fu(')g(option)i(to)g | |
20099 | Ft(set)f Fu(will)h(cause)g(a)g(pip)s(eline)g(to)g(return)f(a)330 | |
20100 | 4500 y(failure)g(status)f(if)h(an)m(y)f(command)g(fails.)225 | |
6e51e0d0 CR |
20101 | 4634 y Fq(\017)60 b Fu(Bash)34 b(has)g(the)g Ft(time)f |
20102 | Fu(reserv)m(ed)h(w)m(ord)g(and)f(command)h(timing)h(\(see)g(Section)g | |
e59452c7 CR |
20103 | (3.2.3)g([Pip)s(elines],)330 4743 y(page)d(10\).)43 b(The)31 |
20104 | b(displa)m(y)g(of)g(the)g(timing)h(statistics)h(ma)m(y)e(b)s(e)f(con)m | |
6e51e0d0 CR |
20105 | (trolled)j(with)e(the)g Ft(TIMEFORMAT)330 4853 y Fu(v)-5 |
20106 | b(ariable.)225 4987 y Fq(\017)60 b Fu(Bash)28 b(implemen)m(ts)g(the)f | |
20107 | Ft(for)j(\(\()g Fj(expr1)f Ft(;)h Fj(expr2)f Ft(;)h Fj(expr3)f | |
20108 | Ft(\)\))e Fu(arithmetic)h(for)g(command,)g(sim-)330 5096 | |
d37a4722 | 20109 | y(ilar)j(to)g(the)g(C)f(language)h(\(see)h(Section)f(3.2.5.1)i([Lo)s |
e59452c7 | 20110 | (oping)d(Constructs],)h(page)g(11\).)225 5230 y Fq(\017)60 |
6e51e0d0 CR |
20111 | b Fu(Bash)31 b(includes)f(the)g Ft(select)f Fu(comp)s(ound)g(command,)i |
20112 | (whic)m(h)f(allo)m(ws)i(the)f(generation)g(of)g(simple)330 | |
d37a4722 | 20113 | 5340 y(men)m(us)f(\(see)h(Section)g(3.2.5.2)i([Conditional)e |
e59452c7 | 20114 | (Constructs],)g(page)g(12\).)p eop end |
5e6f45d9 CR |
20115 | %%Page: 168 174 |
20116 | TeXDict begin 168 173 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 20117 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
5e6f45d9 | 20118 | b(The)f(Bourne)g(Shell)1258 b(168)225 299 y Fq(\017)60 |
6e51e0d0 | 20119 | b Fu(Bash)40 b(includes)g(the)g Ft([[)g Fu(comp)s(ound)e(command,)43 |
1c72c0cd | 20120 | b(whic)m(h)c(mak)m(es)i(conditional)h(testing)f(part)f(of)330 |
d37a4722 | 20121 | 408 y(the)f(shell)g(grammar)g(\(see)h(Section)f(3.2.5.2)j([Conditional) |
e59452c7 | 20122 | d(Constructs],)i(page)f(12\),)i(including)330 518 y(optional)32 |
6e51e0d0 CR |
20123 | b(regular)e(expression)g(matc)m(hing.)225 653 y Fq(\017)60 |
20124 | b Fu(Bash)31 b(pro)m(vides)f(optional)h(case-insensitiv)m(e)i(matc)m | |
20125 | (hing)f(for)e(the)g Ft(case)g Fu(and)f Ft([[)h Fu(constructs.)225 | |
20126 | 789 y Fq(\017)60 b Fu(Bash)27 b(includes)g(brace)h(expansion)f(\(see)h | |
e59452c7 | 20127 | (Section)g(3.5.1)i([Brace)e(Expansion],)g(page)g(24\))h(and)d(tilde)330 |
1c72c0cd | 20128 | 898 y(expansion)k(\(see)i(Section)f(3.5.2)h([Tilde)f(Expansion],)f |
e59452c7 | 20129 | (page)h(25\).)225 1034 y Fq(\017)60 b Fu(Bash)24 b(implemen)m(ts)h |
6e51e0d0 CR |
20130 | (command)e(aliases)j(and)d(the)i Ft(alias)d Fu(and)i |
20131 | Ft(unalias)e Fu(builtins)h(\(see)i(Section)g(6.6)330 | |
e59452c7 | 20132 | 1143 y([Aliases],)32 b(page)f(99\).)225 1279 y Fq(\017)60 |
6e51e0d0 | 20133 | b Fu(Bash)32 b(pro)m(vides)g(shell)g(arithmetic,)i(the)e |
d37a4722 | 20134 | Ft(\(\()g Fu(comp)s(ound)e(command)i(\(see)h(Section)f(3.2.5.2)j([Con-) |
e59452c7 | 20135 | 330 1388 y(ditional)d(Constructs],)e(page)i(12\),)g(and)e(arithmetic)i |
1c72c0cd | 20136 | (expansion)e(\(see)i(Section)f(6.5)h([Shell)f(Arith-)330 |
e59452c7 | 20137 | 1498 y(metic],)h(page)f(97\).)225 1633 y Fq(\017)60 b |
6e51e0d0 | 20138 | Fu(V)-8 b(ariables)31 b(presen)m(t)e(in)g(the)g(shell's)h(initial)g(en) |
37c41ab1 | 20139 | m(vironmen)m(t)g(are)g(automatically)i(exp)s(orted)d(to)h(c)m(hild)330 |
1c72c0cd | 20140 | 1743 y(pro)s(cesses.)38 b(The)23 b(Bourne)g(shell)g(do)s(es)g(not)g |
37c41ab1 | 20141 | (normally)g(do)g(this)g(unless)g(the)g(v)-5 b(ariables)24 |
1c72c0cd | 20142 | b(are)f(explicitly)330 1852 y(mark)m(ed)30 b(using)g(the)h |
6e51e0d0 CR |
20143 | Ft(export)e Fu(command.)225 1988 y Fq(\017)60 b Fu(Bash)26 |
20144 | b(supp)s(orts)d(the)j(`)p Ft(+=)p Fu(')f(assignmen)m(t)i(op)s(erator,)g | |
1c72c0cd CR |
20145 | (whic)m(h)e(app)s(ends)f(to)i(the)g(v)-5 b(alue)26 b(of)f(the)h(v)-5 |
20146 | b(ariable)330 2097 y(named)30 b(on)g(the)h(left)g(hand)e(side.)225 | |
6e51e0d0 CR |
20147 | 2233 y Fq(\017)60 b Fu(Bash)36 b(includes)g(the)g Fm(posix)f |
20148 | Fu(pattern)h(remo)m(v)-5 b(al)37 b(`)p Ft(\045)p Fu(',)h(`)p | |
20149 | Ft(#)p Fu(',)g(`)p Ft(\045\045)p Fu(')e(and)f(`)p Ft(##)p | |
20150 | Fu(')h(expansions)g(to)g(remo)m(v)m(e)330 2342 y(leading)f(or)f | |
1c72c0cd CR |
20151 | (trailing)h(substrings)e(from)g(v)-5 b(ariable)35 b(v)-5 |
20152 | b(alues)35 b(\(see)g(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
e59452c7 | 20153 | 2452 y(Expansion],)30 b(page)h(26\).)225 2587 y Fq(\017)60 |
6e51e0d0 CR |
20154 | b Fu(The)46 b(expansion)g Ft(${#xx})p Fu(,)j(whic)m(h)d(returns)f(the)i |
20155 | (length)f(of)h Ft(${xx})p Fu(,)i(is)e(supp)s(orted)d(\(see)j(Sec-)330 | |
1c72c0cd | 20156 | 2697 y(tion)31 b(3.5.3)h([Shell)f(P)m(arameter)g(Expansion],)f(page)i |
e59452c7 | 20157 | (26\).)225 2832 y Fq(\017)60 b Fu(The)30 b(expansion)g |
6e51e0d0 CR |
20158 | Ft(${var:)p Fr(o\013set)r Ft([:)p Fr(length)p Ft(]})p |
20159 | Fu(,)g(whic)m(h)g(expands)g(to)h(the)g(substring)e(of)i | |
20160 | Ft(var)p Fu('s)e(v)-5 b(alue)330 2942 y(of)43 b(length)g | |
20161 | Fr(length)p Fu(,)k(b)s(eginning)42 b(at)i Fr(o\013set)p | |
20162 | Fu(,)j(is)c(presen)m(t)g(\(see)g(Section)h(3.5.3)h([Shell)e(P)m | |
e59452c7 CR |
20163 | (arameter)330 3051 y(Expansion],)30 b(page)h(26\).)225 |
20164 | 3187 y Fq(\017)60 b Fu(The)21 b(expansion)f Ft(${)p Fj(var)p | |
20165 | Ft(/[/])p Fr(pattern)p Ft([/)p Fr(replacemen)m(t)r Ft(]})p | |
20166 | Fu(,)i(whic)m(h)e(matc)m(hes)j Fr(pattern)e Fu(and)f(replaces)330 | |
20167 | 3296 y(it)30 b(with)f Fr(replacemen)m(t)k Fu(in)c(the)h(v)-5 | |
20168 | b(alue)30 b(of)g Fr(v)-5 b(ar)p Fu(,)30 b(is)f(a)m(v)-5 | |
20169 | b(ailable)32 b(\(see)e(Section)h(3.5.3)g([Shell)f(P)m(arameter)330 | |
20170 | 3406 y(Expansion],)g(page)h(26\).)225 3541 y Fq(\017)60 | |
6e51e0d0 CR |
20171 | b Fu(The)33 b(expansion)g Ft(${!)p Fj(prefix)p Ft(*})d |
20172 | Fu(expansion,)k(whic)m(h)e(expands)h(to)h(the)f(names)g(of)g(all)h | |
20173 | (shell)f(v)-5 b(ari-)330 3651 y(ables)36 b(whose)g(names)g(b)s(egin)g | |
20174 | (with)g Fr(pre\014x)p Fu(,)g(is)g(a)m(v)-5 b(ailable)39 | |
20175 | b(\(see)e(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
e59452c7 CR |
20176 | 3761 y(Expansion],)30 b(page)h(26\).)225 3896 y Fq(\017)60 |
20177 | b Fu(Bash)22 b(has)g(indirect)g(v)-5 b(ariable)22 b(expansion)g(using)f | |
20178 | Ft(${!word})f Fu(\(see)i(Section)h(3.5.3)h([Shell)e(P)m(arameter)330 | |
20179 | 4006 y(Expansion],)30 b(page)h(26\).)225 4141 y Fq(\017)60 | |
20180 | b Fu(Bash)31 b(can)f(expand)g(p)s(ositional)h(parameters)g(b)s(ey)m | |
20181 | (ond)e Ft($9)h Fu(using)g Ft(${)p Fj(num)p Ft(})p Fu(.)225 | |
20182 | 4276 y Fq(\017)60 b Fu(The)27 b Fm(posix)g Ft($\(\))g | |
20183 | Fu(form)g(of)h(command)g(substitution)f(is)h(implemen)m(ted)g(\(see)h | |
20184 | (Section)f(3.5.4)i([Com-)330 4386 y(mand)38 b(Substitution],)k(page)e | |
3011048a | 20185 | (34\),)j(and)38 b(preferred)g(to)i(the)g(Bourne)f(shell's)h |
e59452c7 CR |
20186 | Ft(``)e Fu(\(whic)m(h)i(is)f(also)330 4495 y(implemen)m(ted)31 |
20187 | b(for)f(bac)m(kw)m(ards)h(compatibilit)m(y\).)225 4631 | |
20188 | y Fq(\017)60 b Fu(Bash)31 b(has)f(pro)s(cess)g(substitution)g(\(see)h | |
20189 | (Section)g(3.5.6)h([Pro)s(cess)f(Substitution],)f(page)h(34\).)225 | |
20190 | 4766 y Fq(\017)60 b Fu(Bash)55 b(automatically)j(assigns)e(v)-5 | |
20191 | b(ariables)55 b(that)h(pro)m(vide)f(information)h(ab)s(out)f(the)g | |
20192 | (curren)m(t)330 4876 y(user)40 b(\()p Ft(UID)p Fu(,)i | |
20193 | Ft(EUID)p Fu(,)g(and)e Ft(GROUPS)p Fu(\),)h(the)g(curren)m(t)f(host)g | |
20194 | (\()p Ft(HOSTTYPE)p Fu(,)h Ft(OSTYPE)p Fu(,)h Ft(MACHTYPE)p | |
20195 | Fu(,)f(and)330 4985 y Ft(HOSTNAME)p Fu(\),)55 b(and)c(the)g(instance)h | |
20196 | (of)g(Bash)f(that)h(is)f(running)f(\()p Ft(BASH)p Fu(,)56 | |
20197 | b Ft(BASH_VERSION)p Fu(,)e(and)330 5095 y Ft(BASH_VERSINFO)p | |
20198 | Fu(\).)37 b(See)31 b(Section)g(5.2)h([Bash)e(V)-8 b(ariables],)33 | |
20199 | b(page)e(77,)g(for)f(details.)225 5230 y Fq(\017)60 b | |
20200 | Fu(The)44 b Ft(IFS)f Fu(v)-5 b(ariable)45 b(is)f(used)f(to)i(split)f | |
20201 | (only)g(the)g(results)g(of)h(expansion,)i(not)d(all)h(w)m(ords)f(\(see) | |
20202 | 330 5340 y(Section)29 b(3.5.7)h([W)-8 b(ord)29 b(Splitting],)h(page)f | |
3011048a | 20203 | (35\).)41 b(This)28 b(closes)h(a)g(longstanding)g(shell)f(securit)m(y)h |
e59452c7 | 20204 | (hole.)p eop end |
5e6f45d9 CR |
20205 | %%Page: 169 175 |
20206 | TeXDict begin 169 174 bop 150 -116 a Fu(App)s(endix)29 | |
37c41ab1 | 20207 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
5e6f45d9 | 20208 | b(The)f(Bourne)g(Shell)1258 b(169)225 299 y Fq(\017)60 |
6e51e0d0 CR |
20209 | b Fu(The)36 b(\014lename)h(expansion)f(brac)m(k)m(et)i(expression)f(co) |
20210 | s(de)f(uses)g(`)p Ft(!)p Fu(')h(and)f(`)p Ft(^)p Fu(')h(to)g(negate)h | |
ad4aef08 CR |
20211 | (the)f(set)g(of)330 408 y(c)m(haracters)32 b(b)s(et)m(w)m(een)f(the)f |
20212 | (brac)m(k)m(ets.)43 b(The)29 b(Bourne)i(shell)f(uses)g(only)h(`)p | |
6e51e0d0 CR |
20213 | Ft(!)p Fu('.)225 536 y Fq(\017)60 b Fu(Bash)38 b(implemen)m(ts)g(the)g |
20214 | (full)g(set)g(of)g Fm(posix)f Fu(\014lename)h(expansion)g(op)s | |
e59452c7 CR |
20215 | (erators,)i(including)d(c)m(har-)330 646 y(acter)j(classes,)i(equiv)-5 |
20216 | b(alence)39 b(classes,)j(and)c(collating)j(sym)m(b)s(ols)d(\(see)i | |
20217 | (Section)f(3.5.8)h([Filename)330 756 y(Expansion],)30 | |
20218 | b(page)h(35\).)225 883 y Fq(\017)60 b Fu(Bash)35 b(implemen)m(ts)g | |
20219 | (extended)g(pattern)g(matc)m(hing)h(features)f(when)f(the)h | |
20220 | Ft(extglob)d Fu(shell)j(option)330 993 y(is)30 b(enabled)h(\(see)g | |
20221 | (Section)g(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)g(page)f(36\).)225 | |
20222 | 1121 y Fq(\017)60 b Fu(It)22 b(is)g(p)s(ossible)g(to)h(ha)m(v)m(e)g(a)f | |
20223 | (v)-5 b(ariable)23 b(and)f(a)g(function)g(with)g(the)g(same)g(name;)j | |
6e51e0d0 CR |
20224 | Ft(sh)d Fu(do)s(es)g(not)g(separate)330 1230 y(the)31 |
20225 | b(t)m(w)m(o)g(name)g(spaces.)225 1358 y Fq(\017)60 b | |
20226 | Fu(Bash)30 b(functions)e(are)i(p)s(ermitted)f(to)h(ha)m(v)m(e)h(lo)s | |
20227 | (cal)g(v)-5 b(ariables)30 b(using)f(the)g Ft(local)f | |
20228 | Fu(builtin,)i(and)e(th)m(us)330 1468 y(useful)i(recursiv)m(e)g | |
20229 | (functions)g(ma)m(y)h(b)s(e)f(written)g(\(see)i(Section)f(4.2)g([Bash)g | |
e59452c7 | 20230 | (Builtins],)g(page)h(54\).)225 1596 y Fq(\017)60 b Fu(V)-8 |
6e51e0d0 CR |
20231 | b(ariable)25 b(assignmen)m(ts)g(preceding)e(commands)h(a\013ect)h(only) |
20232 | f(that)g(command,)h(ev)m(en)f(builtins)g(and)330 1705 | |
20233 | y(functions)36 b(\(see)h(Section)g(3.7.4)h([En)m(vironmen)m(t],)h(page) | |
3011048a | 20234 | e(44\).)60 b(In)35 b Ft(sh)p Fu(,)j(all)f(v)-5 b(ariable)37 |
6e51e0d0 CR |
20235 | b(assignmen)m(ts)330 1815 y(preceding)30 b(commands)g(are)h(global)h |
20236 | (unless)d(the)i(command)f(is)h(executed)g(from)f(the)g(\014le)h | |
20237 | (system.)225 1943 y Fq(\017)60 b Fu(Bash)44 b(p)s(erforms)e(\014lename) | |
20238 | i(expansion)f(on)h(\014lenames)g(sp)s(eci\014ed)f(as)h(op)s(erands)e | |
20239 | (to)j(input)e(and)330 2052 y(output)30 b(redirection)h(op)s(erators)g | |
e59452c7 | 20240 | (\(see)g(Section)g(3.6)h([Redirections],)g(page)f(37\).)225 |
6e51e0d0 CR |
20241 | 2180 y Fq(\017)60 b Fu(Bash)29 b(con)m(tains)h(the)f(`)p |
20242 | Ft(<>)p Fu(')f(redirection)i(op)s(erator,)f(allo)m(wing)i(a)e(\014le)g | |
20243 | (to)g(b)s(e)f(op)s(ened)g(for)h(b)s(oth)f(read-)330 2290 | |
20244 | y(ing)35 b(and)f(writing,)i(and)e(the)h(`)p Ft(&>)p Fu(')g(redirection) | |
20245 | g(op)s(erator,)h(for)f(directing)g(standard)f(output)h(and)330 | |
20246 | 2399 y(standard)30 b(error)g(to)h(the)f(same)h(\014le)f(\(see)i | |
e59452c7 | 20247 | (Section)f(3.6)g([Redirections],)h(page)g(37\).)225 2527 |
6e51e0d0 CR |
20248 | y Fq(\017)60 b Fu(Bash)21 b(includes)f(the)h(`)p Ft(<<<)p |
20249 | Fu(')g(redirection)g(op)s(erator,)i(allo)m(wing)g(a)e(string)f(to)i(b)s | |
20250 | (e)e(used)g(as)h(the)g(standard)330 2637 y(input)29 b(to)j(a)e | |
20251 | (command.)225 2765 y Fq(\017)60 b Fu(Bash)32 b(implemen)m(ts)f(the)h(`) | |
20252 | p Ft([n]<&)p Fj(word)p Fu(')d(and)i(`)p Ft([n]>&)p Fj(word)p | |
20253 | Fu(')e(redirection)j(op)s(erators,)g(whic)m(h)f(mo)m(v)m(e)330 | |
20254 | 2874 y(one)g(\014le)f(descriptor)g(to)h(another.)225 | |
20255 | 3002 y Fq(\017)60 b Fu(Bash)25 b(treats)h(a)f(n)m(um)m(b)s(er)e(of)i | |
20256 | (\014lenames)g(sp)s(ecially)g(when)f(they)h(are)g(used)f(in)g | |
20257 | (redirection)i(op)s(erators)330 3112 y(\(see)31 b(Section)h(3.6)f | |
e59452c7 | 20258 | ([Redirections],)h(page)f(37\).)225 3240 y Fq(\017)60 |
6e51e0d0 CR |
20259 | b Fu(Bash)33 b(can)f(op)s(en)g(net)m(w)m(ork)i(connections)f(to)h |
20260 | (arbitrary)e(mac)m(hines)h(and)f(services)h(with)f(the)h(redi-)330 | |
20261 | 3349 y(rection)e(op)s(erators)g(\(see)g(Section)g(3.6)h | |
e59452c7 | 20262 | ([Redirections],)g(page)f(37\).)225 3477 y Fq(\017)60 |
6e51e0d0 | 20263 | b Fu(The)29 b Ft(noclobber)e Fu(option)j(is)g(a)m(v)-5 |
37c41ab1 | 20264 | b(ailable)32 b(to)e(a)m(v)m(oid)h(o)m(v)m(erwriting)g(existing)g |
ad4aef08 | 20265 | (\014les)e(with)h(output)f(redi-)330 3587 y(rection)39 |
e59452c7 | 20266 | b(\(see)h(Section)f(4.3.1)h([The)e(Set)h(Builtin],)i(page)e(66\).)66 |
6e51e0d0 | 20267 | b(The)38 b(`)p Ft(>|)p Fu(')h(redirection)g(op)s(erator)330 |
ad4aef08 | 20268 | 3696 y(ma)m(y)31 b(b)s(e)f(used)f(to)i(o)m(v)m(erride)h |
6e51e0d0 CR |
20269 | Ft(noclobber)p Fu(.)225 3824 y Fq(\017)60 b Fu(The)34 |
20270 | b(Bash)g Ft(cd)g Fu(and)f Ft(pwd)g Fu(builtins)h(\(see)h(Section)g(4.1) | |
e59452c7 | 20271 | g([Bourne)g(Shell)f(Builtins],)h(page)g(47\))h(eac)m(h)330 |
6e51e0d0 CR |
20272 | 3934 y(tak)m(e)c Ft(-L)e Fu(and)f Ft(-P)h Fu(options)h(to)g(switc)m(h)g |
20273 | (b)s(et)m(w)m(een)g(logical)i(and)c(ph)m(ysical)i(mo)s(des.)225 | |
20274 | 4061 y Fq(\017)60 b Fu(Bash)25 b(allo)m(ws)h(a)g(function)e(to)i(o)m(v) | |
20275 | m(erride)g(a)g(builtin)e(with)h(the)g(same)g(name,)i(and)d(pro)m(vides) | |
20276 | h(access)h(to)330 4171 y(that)34 b(builtin's)f(functionalit)m(y)h | |
20277 | (within)f(the)g(function)g(via)h(the)f Ft(builtin)f Fu(and)g | |
20278 | Ft(command)g Fu(builtins)330 4281 y(\(see)f(Section)h(4.2)f([Bash)g | |
e59452c7 | 20279 | (Builtins],)g(page)g(54\).)225 4408 y Fq(\017)60 b Fu(The)35 |
6e51e0d0 CR |
20280 | b Ft(command)e Fu(builtin)i(allo)m(ws)i(selectiv)m(e)h(disabling)e(of)f |
20281 | (functions)g(when)g(command)g(lo)s(okup)g(is)330 4518 | |
20282 | y(p)s(erformed)29 b(\(see)i(Section)g(4.2)h([Bash)f(Builtins],)g(page)g | |
e59452c7 | 20283 | (54\).)225 4646 y Fq(\017)60 b Fu(Individual)23 b(builtins)g(ma)m(y)i |
6e51e0d0 CR |
20284 | (b)s(e)e(enabled)h(or)g(disabled)g(using)f(the)h Ft(enable)f |
20285 | Fu(builtin)g(\(see)i(Section)g(4.2)330 4756 y([Bash)31 | |
e59452c7 | 20286 | b(Builtins],)g(page)g(54\).)225 4883 y Fq(\017)60 b Fu(The)26 |
6e51e0d0 | 20287 | b(Bash)h Ft(exec)e Fu(builtin)h(tak)m(es)i(additional)f(options)g(that) |
d3ad40de | 20288 | g(allo)m(w)h(users)d(to)j(con)m(trol)g(the)e(con)m(ten)m(ts)330 |
ad4aef08 | 20289 | 4993 y(of)35 b(the)f(en)m(vironmen)m(t)h(passed)f(to)h(the)g(executed)g |
d3ad40de | 20290 | (command,)h(and)d(what)i(the)f(zeroth)h(argumen)m(t)330 |
ad4aef08 | 20291 | 5103 y(to)c(the)g(command)f(is)g(to)h(b)s(e)f(\(see)h(Section)h(4.1)f |
e59452c7 | 20292 | ([Bourne)f(Shell)h(Builtins],)g(page)g(47\).)225 5230 |
6e51e0d0 | 20293 | y Fq(\017)60 b Fu(Shell)29 b(functions)g(ma)m(y)h(b)s(e)f(exp)s(orted)g |
37c41ab1 | 20294 | (to)h(c)m(hildren)f(via)h(the)g(en)m(vironmen)m(t)g(using)f |
6e51e0d0 | 20295 | Ft(export)f(-f)h Fu(\(see)330 5340 y(Section)i(3.3)h([Shell)e(F)-8 |
e59452c7 | 20296 | b(unctions],)32 b(page)f(19\).)p eop end |
5e6f45d9 CR |
20297 | %%Page: 170 176 |
20298 | TeXDict begin 170 175 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 20299 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
5e6f45d9 | 20300 | b(The)f(Bourne)g(Shell)1258 b(170)225 299 y Fq(\017)60 |
6e51e0d0 CR |
20301 | b Fu(The)40 b(Bash)h Ft(export)p Fu(,)h Ft(readonly)p |
20302 | Fu(,)f(and)g Ft(declare)d Fu(builtins)j(can)g(tak)m(e)h(a)f | |
20303 | Ft(-f)f Fu(option)i(to)f(act)h(on)330 408 y(shell)30 | |
20304 | b(functions,)f(a)h Ft(-p)f Fu(option)g(to)i(displa)m(y)e(v)-5 | |
20305 | b(ariables)30 b(with)f(v)-5 b(arious)30 b(attributes)g(set)g(in)f(a)h | |
20306 | (format)330 518 y(that)g(can)g(b)s(e)f(used)g(as)g(shell)h(input,)f(a)h | |
20307 | Ft(-n)f Fu(option)h(to)g(remo)m(v)m(e)h(v)-5 b(arious)30 | |
20308 | b(v)-5 b(ariable)30 b(attributes,)h(and)330 628 y(`)p | |
20309 | Ft(name=value)p Fu(')d(argumen)m(ts)j(to)g(set)g(v)-5 | |
37c41ab1 | 20310 | b(ariable)31 b(attributes)g(and)f(v)-5 b(alues)30 b(sim)m(ultaneously) |
6e51e0d0 CR |
20311 | -8 b(.)225 765 y Fq(\017)60 b Fu(The)42 b(Bash)h Ft(hash)f |
20312 | Fu(builtin)g(allo)m(ws)j(a)e(name)g(to)g(b)s(e)f(asso)s(ciated)j(with)d | |
1c72c0cd | 20313 | (an)h(arbitrary)f(\014lename,)330 874 y(ev)m(en)30 b(when)e(that)h |
37c41ab1 | 20314 | (\014lename)g(cannot)h(b)s(e)e(found)g(b)m(y)h(searc)m(hing)g(the)g |
6e51e0d0 | 20315 | Ft($PATH)p Fu(,)g(using)f(`)p Ft(hash)h(-p)p Fu(')g(\(see)330 |
e59452c7 | 20316 | 984 y(Section)i(4.1)h([Bourne)e(Shell)g(Builtins],)h(page)h(47\).)225 |
6e51e0d0 CR |
20317 | 1121 y Fq(\017)60 b Fu(Bash)27 b(includes)f(a)i Ft(help)d |
20318 | Fu(builtin)i(for)f(quic)m(k)h(reference)h(to)f(shell)g(facilities)i | |
e59452c7 | 20319 | (\(see)f(Section)g(4.2)g([Bash)330 1230 y(Builtins],)j(page)g(54\).)225 |
6e51e0d0 | 20320 | 1367 y Fq(\017)60 b Fu(The)42 b Ft(printf)g Fu(builtin)g(is)h(a)m(v)-5 |
37c41ab1 | 20321 | b(ailable)45 b(to)f(displa)m(y)f(formatted)g(output)g(\(see)h(Section)g |
e59452c7 | 20322 | (4.2)g([Bash)330 1477 y(Builtins],)31 b(page)g(54\).)225 |
6e51e0d0 | 20323 | 1614 y Fq(\017)60 b Fu(The)26 b(Bash)h Ft(read)f Fu(builtin)g(\(see)i |
e59452c7 | 20324 | (Section)g(4.2)g([Bash)f(Builtins],)h(page)g(54\))g(will)f(read)g(a)g |
6e51e0d0 CR |
20325 | (line)g(ending)330 1724 y(in)i(`)p Ft(\\)p Fu(')h(with)f(the)g |
20326 | Ft(-r)g Fu(option,)i(and)d(will)i(use)f(the)h Ft(REPLY)e | |
20327 | Fu(v)-5 b(ariable)30 b(as)g(a)f(default)h(if)f(no)h(non-option)330 | |
20328 | 1833 y(argumen)m(ts)h(are)h(supplied.)42 b(The)30 b(Bash)i | |
20329 | Ft(read)e Fu(builtin)g(also)j(accepts)f(a)g(prompt)e(string)h(with)g | |
20330 | (the)330 1943 y Ft(-p)c Fu(option)h(and)f(will)g(use)h(Readline)g(to)g | |
20331 | (obtain)g(the)g(line)f(when)g(giv)m(en)h(the)g Ft(-e)f | |
20332 | Fu(option.)40 b(The)27 b Ft(read)330 2052 y Fu(builtin)h(also)i(has)e | |
20333 | (additional)i(options)f(to)g(con)m(trol)h(input:)39 b(the)29 | |
20334 | b Ft(-s)f Fu(option)h(will)g(turn)e(o\013)j(ec)m(hoing)330 | |
20335 | 2162 y(of)f(input)f(c)m(haracters)j(as)e(they)g(are)h(read,)f(the)g | |
20336 | Ft(-t)g Fu(option)g(will)h(allo)m(w)g Ft(read)e Fu(to)i(time)g(out)f | |
20337 | (if)g(input)330 2271 y(do)s(es)i(not)h(arriv)m(e)g(within)f(a)h(sp)s | |
20338 | (eci\014ed)f(n)m(um)m(b)s(er)f(of)i(seconds,)g(the)f | |
20339 | Ft(-n)g Fu(option)h(will)g(allo)m(w)h(reading)330 2381 | |
20340 | y(only)38 b(a)g(sp)s(eci\014ed)f(n)m(um)m(b)s(er)f(of)i(c)m(haracters)h | |
20341 | (rather)e(than)g(a)h(full)g(line,)i(and)d(the)h Ft(-d)f | |
20342 | Fu(option)h(will)330 2491 y(read)30 b(un)m(til)h(a)g(particular)f(c)m | |
20343 | (haracter)i(rather)f(than)f(newline.)225 2628 y Fq(\017)60 | |
20344 | b Fu(The)33 b Ft(return)e Fu(builtin)i(ma)m(y)g(b)s(e)g(used)f(to)i(ab) | |
20345 | s(ort)f(execution)h(of)f(scripts)g(executed)h(with)f(the)g | |
20346 | Ft(.)g Fu(or)330 2737 y Ft(source)c Fu(builtins)g(\(see)j(Section)f | |
e59452c7 | 20347 | (4.1)g([Bourne)g(Shell)f(Builtins],)h(page)g(47\).)225 |
6e51e0d0 CR |
20348 | 2874 y Fq(\017)60 b Fu(Bash)43 b(includes)g(the)g Ft(shopt)f |
20349 | Fu(builtin,)k(for)d(\014ner)f(con)m(trol)j(of)e(shell)h(optional)g | |
d3ad40de | 20350 | (capabilities)h(\(see)330 2984 y(Section)c(4.3.2)g([The)f(Shopt)f |
e59452c7 | 20351 | (Builtin],)k(page)d(70\),)k(and)39 b(allo)m(ws)i(these)f(options)h(to)f |
d3ad40de CR |
20352 | (b)s(e)f(set)i(and)330 3093 y(unset)30 b(at)h(shell)g(in)m(v)m(o)s |
20353 | (cation)h(\(see)f(Section)h(6.1)f([In)m(v)m(oking)g(Bash],)g(page)h | |
e59452c7 | 20354 | (90\).)225 3230 y Fq(\017)60 b Fu(Bash)45 b(has)f(m)m(uc)m(h)g(more)h |
d3ad40de | 20355 | (optional)h(b)s(eha)m(vior)e(con)m(trollable)j(with)e(the)f |
6e51e0d0 | 20356 | Ft(set)g Fu(builtin)g(\(see)h(Sec-)330 3340 y(tion)31 |
e59452c7 | 20357 | b(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(66\).)225 3477 |
6e51e0d0 CR |
20358 | y Fq(\017)60 b Fu(The)31 b(`)p Ft(-x)p Fu(')g(\()p Ft(xtrace)p |
20359 | Fu(\))g(option)h(displa)m(ys)f(commands)h(other)f(than)h(simple)f | |
20360 | (commands)g(when)g(p)s(er-)330 3587 y(forming)f(an)g(execution)i(trace) | |
e59452c7 | 20361 | f(\(see)h(Section)f(4.3.1)h([The)e(Set)h(Builtin],)g(page)g(66\).)225 |
6e51e0d0 | 20362 | 3724 y Fq(\017)60 b Fu(The)28 b Ft(test)g Fu(builtin)h(\(see)h(Section) |
e59452c7 | 20363 | f(4.1)h([Bourne)f(Shell)g(Builtins],)h(page)g(47\))g(is)f(sligh)m(tly)h |
1c72c0cd | 20364 | (di\013eren)m(t,)330 3833 y(as)23 b(it)g(implemen)m(ts)f(the)h |
6e51e0d0 | 20365 | Fm(posix)f Fu(algorithm,)j(whic)m(h)d(sp)s(eci\014es)g(the)h(b)s(eha)m |
1c72c0cd | 20366 | (vior)f(based)g(on)h(the)f(n)m(um)m(b)s(er)330 3943 y(of)31 |
6e51e0d0 CR |
20367 | b(argumen)m(ts.)225 4080 y Fq(\017)60 b Fu(Bash)31 b(includes)g(the)h |
20368 | Ft(caller)d Fu(builtin,)j(whic)m(h)f(displa)m(ys)g(the)g(con)m(text)i | |
1c72c0cd | 20369 | (of)f(an)m(y)g(activ)m(e)h(subroutine)330 4189 y(call)28 |
37c41ab1 | 20370 | b(\(a)f(shell)f(function)h(or)f(a)h(script)f(executed)h(with)f(the)h |
6e51e0d0 | 20371 | Ft(.)f Fu(or)g Ft(source)f Fu(builtins\).)39 b(This)26 |
e59452c7 | 20372 | b(supp)s(orts)330 4299 y(the)31 b(Bash)f(debugger.)225 |
6e51e0d0 | 20373 | 4436 y Fq(\017)60 b Fu(The)42 b Ft(trap)f Fu(builtin)h(\(see)i(Section) |
e59452c7 | 20374 | f(4.1)h([Bourne)e(Shell)g(Builtins],)47 b(page)c(47\))h(allo)m(ws)g(a)e |
6e51e0d0 CR |
20375 | Ft(DEBUG)330 4545 y Fu(pseudo-signal)c(sp)s(eci\014cation,)i(similar)e |
20376 | (to)g Ft(EXIT)p Fu(.)62 b(Commands)36 b(sp)s(eci\014ed)h(with)g(a)h | |
20377 | Ft(DEBUG)e Fu(trap)330 4655 y(are)k(executed)g(b)s(efore)f(ev)m(ery)h | |
20378 | (simple)f(command,)j Ft(for)c Fu(command,)k Ft(case)c | |
20379 | Fu(command,)k Ft(select)330 4765 y Fu(command,)35 b(ev)m(ery)g | |
20380 | (arithmetic)g Ft(for)e Fu(command,)i(and)f(b)s(efore)g(the)g(\014rst)f | |
1c72c0cd | 20381 | (command)h(executes)h(in)330 4874 y(a)29 b(shell)g(function.)40 |
6e51e0d0 | 20382 | b(The)28 b Ft(DEBUG)g Fu(trap)g(is)h(not)g(inherited)f(b)m(y)h(shell)g |
1c72c0cd | 20383 | (functions)f(unless)g(the)h(function)330 4984 y(has)35 |
6e51e0d0 CR |
20384 | b(b)s(een)g(giv)m(en)i(the)f Ft(trace)e Fu(attribute)i(or)g(the)g |
20385 | Ft(functrace)d Fu(option)j(has)f(b)s(een)g(enabled)g(using)330 | |
20386 | 5093 y(the)28 b Ft(shopt)e Fu(builtin.)39 b(The)27 b | |
20387 | Ft(extdebug)f Fu(shell)i(option)g(has)f(additional)h(e\013ects)h(on)f | |
20388 | (the)g Ft(DEBUG)e Fu(trap.)330 5230 y(The)21 b Ft(trap)e | |
20389 | Fu(builtin)i(\(see)h(Section)g(4.1)g([Bourne)f(Shell)g(Builtins],)j | |
e59452c7 | 20390 | (page)e(47\))g(allo)m(ws)g(an)f Ft(ERR)f Fu(pseudo-)330 |
1c72c0cd | 20391 | 5340 y(signal)30 b(sp)s(eci\014cation,)h(similar)f(to)g |
6e51e0d0 CR |
20392 | Ft(EXIT)f Fu(and)g Ft(DEBUG)p Fu(.)39 b(Commands)28 b(sp)s(eci\014ed)h |
20393 | (with)g(an)g Ft(ERR)g Fu(trap)p eop end | |
5e6f45d9 CR |
20394 | %%Page: 171 177 |
20395 | TeXDict begin 171 176 bop 150 -116 a Fu(App)s(endix)29 | |
1c72c0cd | 20396 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
5e6f45d9 | 20397 | b(The)f(Bourne)g(Shell)1258 b(171)330 299 y(are)40 b(executed)g(after)g |
1c72c0cd | 20398 | (a)f(simple)h(command)f(fails,)j(with)d(a)h(few)f(exceptions.)68 |
6e51e0d0 CR |
20399 | b(The)39 b Ft(ERR)g Fu(trap)g(is)330 408 y(not)g(inherited)f(b)m(y)h |
20400 | (shell)g(functions)f(unless)g(the)h Ft(-o)29 b(errtrace)37 | |
20401 | b Fu(option)i(to)g(the)g Ft(set)f Fu(builtin)g(is)330 | |
20402 | 518 y(enabled.)330 650 y(The)g Ft(trap)g Fu(builtin)h(\(see)g(Section)h | |
e59452c7 | 20403 | (4.1)g([Bourne)f(Shell)g(Builtins],)i(page)f(47\))g(allo)m(ws)g(a)g |
967625cd | 20404 | Ft(RETURN)330 759 y Fu(pseudo-signal)35 b(sp)s(eci\014cation,)j |
6e51e0d0 | 20405 | (similar)d(to)h Ft(EXIT)e Fu(and)g Ft(DEBUG)p Fu(.)54 |
c302751c | 20406 | b(Commands)34 b(sp)s(eci\014ed)g(with)h(an)330 869 y |
6e51e0d0 | 20407 | Ft(RETURN)k Fu(trap)i(are)g(executed)h(b)s(efore)e(execution)i(resumes) |
967625cd | 20408 | e(after)h(a)g(shell)g(function)g(or)g(a)g(shell)330 978 |
6e51e0d0 CR |
20409 | y(script)36 b(executed)g(with)g Ft(.)f Fu(or)h Ft(source)e |
20410 | Fu(returns.)56 b(The)35 b Ft(RETURN)f Fu(trap)i(is)g(not)g(inherited)f | |
c302751c | 20411 | (b)m(y)h(shell)330 1088 y(functions)k(unless)h(the)g(function)f(has)h |
6e51e0d0 CR |
20412 | (b)s(een)f(giv)m(en)i(the)f Ft(trace)e Fu(attribute)j(or)e(the)h |
20413 | Ft(functrace)330 1198 y Fu(option)31 b(has)f(b)s(een)g(enabled)g(using) | |
967625cd | 20414 | g(the)g Ft(shopt)f Fu(builtin.)225 1329 y Fq(\017)60 |
6e51e0d0 | 20415 | b Fu(The)30 b(Bash)g Ft(type)f Fu(builtin)h(is)g(more)g(extensiv)m(e)i |
37c41ab1 | 20416 | (and)d(giv)m(es)j(more)e(information)h(ab)s(out)f(the)g(names)330 |
967625cd | 20417 | 1439 y(it)h(\014nds)e(\(see)i(Section)g(4.2)h([Bash)e(Builtins],)i |
e59452c7 | 20418 | (page)f(54\).)225 1570 y Fq(\017)60 b Fu(The)27 b(Bash)h |
6e51e0d0 CR |
20419 | Ft(umask)e Fu(builtin)h(p)s(ermits)g(a)h Ft(-p)f Fu(option)h(to)h |
20420 | (cause)f(the)g(output)f(to)h(b)s(e)f(displa)m(y)m(ed)h(in)g(the)330 | |
967625cd | 20421 | 1680 y(form)i(of)h(a)g Ft(umask)f Fu(command)g(that)i(ma)m(y)f(b)s(e)f |
6e51e0d0 | 20422 | (reused)g(as)h(input)f(\(see)i(Section)f(4.1)h([Bourne)f(Shell)330 |
e59452c7 | 20423 | 1789 y(Builtins],)g(page)g(47\).)225 1921 y Fq(\017)60 |
6e51e0d0 CR |
20424 | b Fu(Bash)34 b(implemen)m(ts)h(a)g Ft(csh)p Fu(-lik)m(e)g(directory)f |
20425 | (stac)m(k,)j(and)d(pro)m(vides)g(the)g Ft(pushd)p Fu(,)g | |
e59452c7 CR |
20426 | Ft(popd)p Fu(,)g(and)g Ft(dirs)330 2030 y Fu(builtins)d(to)i |
20427 | (manipulate)f(it)h(\(see)g(Section)f(6.8)h([The)f(Directory)h(Stac)m | |
20428 | (k],)h(page)f(101\).)47 b(Bash)32 b(also)330 2140 y(mak)m(es)f(the)g | |
6e51e0d0 CR |
20429 | (directory)g(stac)m(k)g(visible)g(as)g(the)f(v)-5 b(alue)31 |
20430 | b(of)g(the)f Ft(DIRSTACK)f Fu(shell)h(v)-5 b(ariable.)225 | |
967625cd | 20431 | 2272 y Fq(\017)60 b Fu(Bash)28 b(in)m(terprets)h(sp)s(ecial)g(bac)m |
6e51e0d0 | 20432 | (kslash-escap)s(ed)g(c)m(haracters)g(in)f(the)h(prompt)e(strings)h |
967625cd | 20433 | (when)f(in)m(ter-)330 2381 y(activ)m(e)33 b(\(see)e(Section)g(6.9)h |
e59452c7 | 20434 | ([Con)m(trolling)f(the)g(Prompt],)f(page)h(103\).)225 |
967625cd | 20435 | 2513 y Fq(\017)60 b Fu(The)46 b(Bash)h(restricted)g(mo)s(de)f(is)h |
1c72c0cd | 20436 | (more)f(useful)g(\(see)h(Section)h(6.10)g([The)e(Restricted)i(Shell],) |
e59452c7 | 20437 | 330 2622 y(page)31 b(104\);)h(the)f(SVR4.2)g(shell)g(restricted)g(mo)s |
602eae4d | 20438 | (de)f(is)g(to)s(o)h(limited.)225 2754 y Fq(\017)60 b |
6e51e0d0 | 20439 | Fu(The)30 b Ft(disown)f Fu(builtin)h(can)h(remo)m(v)m(e)h(a)f(job)f |
1c72c0cd | 20440 | (from)g(the)h(in)m(ternal)g(shell)g(job)f(table)i(\(see)f(Section)h |
fffe80d4 | 20441 | (7.2)330 2863 y([Job)e(Con)m(trol)h(Builtins],)g(page)g(113\))g(or)g |
900a813b | 20442 | (suppress)d(the)i(sending)g(of)g Ft(SIGHUP)e Fu(to)j(a)g(job)f(when)f |
967625cd CR |
20443 | (the)330 2973 y(shell)i(exits)g(as)f(the)h(result)f(of)h(a)f |
20444 | Ft(SIGHUP)p Fu(.)225 3104 y Fq(\017)60 b Fu(Bash)31 b(includes)f(a)g(n) | |
1c72c0cd | 20445 | m(um)m(b)s(er)f(of)i(features)g(to)g(supp)s(ort)d(a)j(separate)g |
967625cd | 20446 | (debugger)f(for)h(shell)f(scripts.)225 3236 y Fq(\017)60 |
6e51e0d0 CR |
20447 | b Fu(The)28 b(SVR4.2)h(shell)f(has)g(t)m(w)m(o)i(privilege-related)g |
20448 | (builtins)e(\()p Ft(mldmode)e Fu(and)i Ft(priv)p Fu(\))f(not)i(presen)m | |
967625cd | 20449 | (t)f(in)330 3346 y(Bash.)225 3477 y Fq(\017)60 b Fu(Bash)31 |
6e51e0d0 | 20450 | b(do)s(es)f(not)g(ha)m(v)m(e)i(the)e Ft(stop)g Fu(or)g |
967625cd | 20451 | Ft(newgrp)f Fu(builtins.)225 3609 y Fq(\017)60 b Fu(Bash)31 |
6e51e0d0 | 20452 | b(do)s(es)f(not)g(use)g(the)h Ft(SHACCT)d Fu(v)-5 b(ariable)32 |
967625cd | 20453 | b(or)e(p)s(erform)f(shell)i(accoun)m(ting.)225 3740 y |
6e51e0d0 CR |
20454 | Fq(\017)60 b Fu(The)30 b(SVR4.2)h Ft(sh)f Fu(uses)g(a)g |
20455 | Ft(TIMEOUT)f Fu(v)-5 b(ariable)31 b(lik)m(e)h(Bash)e(uses)g | |
967625cd | 20456 | Ft(TMOUT)p Fu(.)150 3894 y(More)h(features)g(unique)e(to)i(Bash)g(ma)m |
1c72c0cd | 20457 | (y)g(b)s(e)f(found)f(in)h(Chapter)f(6)i([Bash)g(F)-8 |
e59452c7 | 20458 | b(eatures],)32 b(page)f(90.)150 4128 y Fs(B.1)67 b(Implemen)l(tation)48 |
c302751c | 20459 | b(Di\013erences)e(F)-11 b(rom)44 b(The)h(SVR4.2)g(Shell)150 |
967625cd | 20460 | 4288 y Fu(Since)33 b(Bash)h(is)f(a)g(completely)i(new)e(implemen)m |
c302751c | 20461 | (tation,)j(it)e(do)s(es)e(not)i(su\013er)e(from)h(man)m(y)g(of)h(the)f |
967625cd CR |
20462 | (limi-)150 4397 y(tations)f(of)e(the)h(SVR4.2)g(shell.)41 |
20463 | b(F)-8 b(or)31 b(instance:)225 4529 y Fq(\017)60 b Fu(Bash)32 | |
37c41ab1 CR |
20464 | b(do)s(es)f(not)h(fork)f(a)h(subshell)e(when)h(redirecting)h(in)m(to)h |
20465 | (or)e(out)h(of)g(a)g(shell)f(con)m(trol)i(structure)330 | |
967625cd | 20466 | 4639 y(suc)m(h)d(as)h(an)f Ft(if)g Fu(or)g Ft(while)f |
6e51e0d0 | 20467 | Fu(statemen)m(t.)225 4770 y Fq(\017)60 b Fu(Bash)29 b(do)s(es)f(not)h |
37c41ab1 | 20468 | (allo)m(w)h(un)m(balanced)f(quotes.)41 b(The)28 b(SVR4.2)h(shell)g |
967625cd | 20469 | (will)g(silen)m(tly)i(insert)d(a)h(needed)330 4880 y(closing)g(quote)g |
6e51e0d0 | 20470 | (at)f Ft(EOF)f Fu(under)g(certain)h(circumstances.)41 |
37c41ab1 | 20471 | b(This)27 b(can)h(b)s(e)g(the)g(cause)g(of)g(some)h(hard-)330 |
6e51e0d0 | 20472 | 4989 y(to-\014nd)h(errors.)225 5121 y Fq(\017)60 b Fu(The)45 |
37c41ab1 | 20473 | b(SVR4.2)h(shell)f(uses)g(a)g(baro)s(que)g(memory)g(managemen)m(t)i(sc) |
6e51e0d0 CR |
20474 | m(heme)e(based)g(on)g(trapping)330 5230 y Ft(SIGSEGV)p |
20475 | Fu(.)57 b(If)35 b(the)i(shell)f(is)h(started)g(from)e(a)i(pro)s(cess)f | |
20476 | (with)g Ft(SIGSEGV)e Fu(blo)s(c)m(k)m(ed)k(\(e.g.,)h(b)m(y)d(using)330 | |
20477 | 5340 y(the)31 b Ft(system\(\))d Fu(C)i(library)g(function)g(call\),)i | |
1c72c0cd | 20478 | (it)f(misb)s(eha)m(v)m(es)g(badly)-8 b(.)p eop end |
5e6f45d9 CR |
20479 | %%Page: 172 178 |
20480 | TeXDict begin 172 177 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 20481 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
5e6f45d9 | 20482 | b(The)f(Bourne)g(Shell)1258 b(172)225 299 y Fq(\017)60 |
6e51e0d0 CR |
20483 | b Fu(In)30 b(a)i(questionable)g(attempt)g(at)g(securit)m(y)-8 |
20484 | b(,)33 b(the)e(SVR4.2)h(shell,)g(when)e(in)m(v)m(ok)m(ed)j(without)e | |
20485 | (the)h Ft(-p)330 408 y Fu(option,)39 b(will)d(alter)i(its)e(real)h(and) | |
20486 | f(e\013ectiv)m(e)j Fm(uid)d Fu(and)g Fm(gid)h Fu(if)f(they)h(are)f | |
20487 | (less)h(than)f(some)h(magic)330 518 y(threshold)30 b(v)-5 | |
20488 | b(alue,)31 b(commonly)g(100.)42 b(This)29 b(can)i(lead)g(to)g(unexp)s | |
20489 | (ected)f(results.)225 653 y Fq(\017)60 b Fu(The)30 b(SVR4.2)h(shell)g | |
20490 | (do)s(es)f(not)g(allo)m(w)i(users)e(to)h(trap)f Ft(SIGSEGV)p | |
20491 | Fu(,)f Ft(SIGALRM)p Fu(,)f(or)j Ft(SIGCHLD)p Fu(.)225 | |
20492 | 787 y Fq(\017)60 b Fu(The)34 b(SVR4.2)h(shell)g(do)s(es)g(not)f(allo)m | |
20493 | (w)j(the)d Ft(IFS)p Fu(,)h Ft(MAILCHECK)p Fu(,)f Ft(PATH)p | |
20494 | Fu(,)h Ft(PS1)p Fu(,)g(or)f Ft(PS2)g Fu(v)-5 b(ariables)35 | |
20495 | b(to)330 897 y(b)s(e)30 b(unset.)225 1031 y Fq(\017)60 | |
20496 | b Fu(The)30 b(SVR4.2)h(shell)g(treats)g(`)p Ft(^)p Fu(')f(as)h(the)g | |
20497 | (undo)s(cumen)m(ted)e(equiv)-5 b(alen)m(t)31 b(of)g(`)p | |
20498 | Ft(|)p Fu('.)225 1166 y Fq(\017)60 b Fu(Bash)37 b(allo)m(ws)h(m)m | |
20499 | (ultiple)f(option)g(argumen)m(ts)g(when)e(it)i(is)g(in)m(v)m(ok)m(ed)h | |
20500 | (\()p Ft(-x)30 b(-v)p Fu(\);)40 b(the)c(SVR4.2)i(shell)330 | |
1c72c0cd | 20501 | 1275 y(allo)m(ws)c(only)f(one)g(option)g(argumen)m(t)g(\()p |
6e51e0d0 | 20502 | Ft(-xv)p Fu(\).)47 b(In)32 b(fact,)i(some)f(v)m(ersions)g(of)g(the)g |
1c72c0cd | 20503 | (shell)f(dump)f(core)330 1385 y(if)f(the)h(second)f(argumen)m(t)h(b)s |
6e51e0d0 CR |
20504 | (egins)f(with)g(a)h(`)p Ft(-)p Fu('.)225 1519 y Fq(\017)60 |
20505 | b Fu(The)26 b(SVR4.2)i(shell)f(exits)g(a)g(script)g(if)g(an)m(y)g | |
ac18b312 | 20506 | (builtin)f(fails;)j(Bash)e(exits)g(a)g(script)g(only)g(if)g(one)g(of)g |
6e51e0d0 | 20507 | (the)330 1629 y Fm(posix)34 b Fu(sp)s(ecial)h(builtins)f(fails,)i(and)e |
ac18b312 | 20508 | (only)h(for)f(certain)h(failures,)h(as)f(en)m(umerated)g(in)f(the)h |
6e51e0d0 CR |
20509 | Fm(posix)330 1738 y Fu(standard.)225 1873 y Fq(\017)60 |
20510 | b Fu(The)30 b(SVR4.2)h(shell)g(b)s(eha)m(v)m(es)f(di\013eren)m(tly)h | |
20511 | (when)f(in)m(v)m(ok)m(ed)i(as)e Ft(jsh)g Fu(\(it)h(turns)e(on)h(job)g | |
ac18b312 | 20512 | (con)m(trol\).)p eop end |
5e6f45d9 CR |
20513 | %%Page: 173 179 |
20514 | TeXDict begin 173 178 bop 3614 -116 a Fu(173)150 299 | |
037a8b7f CR |
20515 | y Fp(App)t(endix)52 b(C)81 b(GNU)54 b(F)-13 b(ree)53 |
20516 | b(Do)t(cumen)l(tation)e(License)1359 502 y Fu(V)-8 b(ersion)31 | |
20517 | b(1.3,)g(3)g(No)m(v)m(em)m(b)s(er)h(2008)390 635 y(Cop)m(yrigh)m(t)842 | |
20518 | 632 y(c)817 635 y Fq(\015)e Fu(2000,)j(2001,)f(2002,)g(2007,)h(2008)f | |
20519 | (F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 b(oundation,)31 | |
20520 | b(Inc.)390 745 y Ft(http://fsf.org/)390 964 y Fu(Ev)m(ery)m(one)g(is)g | |
20521 | (p)s(ermitted)f(to)h(cop)m(y)g(and)f(distribute)g(v)m(erbatim)h(copies) | |
20522 | 390 1074 y(of)g(this)f(license)h(do)s(cumen)m(t,)g(but)e(c)m(hanging)j | |
20523 | (it)f(is)f(not)h(allo)m(w)m(ed.)199 1207 y(0.)61 b(PREAMBLE)330 | |
1231ac47 CR |
20524 | 1340 y(The)37 b(purp)s(ose)e(of)i(this)g(License)h(is)f(to)h(mak)m(e)g |
20525 | (a)g(man)m(ual,)h(textb)s(o)s(ok,)h(or)d(other)g(functional)h(and)330 | |
6e51e0d0 | 20526 | 1450 y(useful)29 b(do)s(cumen)m(t)h Fr(free)36 b Fu(in)29 |
37c41ab1 | 20527 | b(the)i(sense)f(of)g(freedom:)41 b(to)31 b(assure)e(ev)m(ery)m(one)j |
c2a47ea9 | 20528 | (the)e(e\013ectiv)m(e)j(freedom)330 1559 y(to)f(cop)m(y)g(and)f |
37c41ab1 | 20529 | (redistribute)g(it,)h(with)g(or)f(without)g(mo)s(difying)g(it,)i |
c2a47ea9 | 20530 | (either)f(commercially)h(or)e(non-)330 1669 y(commercially)-8 |
37c41ab1 | 20531 | b(.)56 b(Secondarily)-8 b(,)36 b(this)f(License)g(preserv)m(es)g(for)f |
c2a47ea9 | 20532 | (the)h(author)f(and)g(publisher)f(a)i(w)m(a)m(y)330 1778 |
37c41ab1 CR |
20533 | y(to)i(get)g(credit)g(for)f(their)g(w)m(ork,)i(while)e(not)g(b)s(eing)g |
20534 | (considered)g(resp)s(onsible)f(for)h(mo)s(di\014cations)330 | |
c2a47ea9 | 20535 | 1888 y(made)30 b(b)m(y)h(others.)330 2021 y(This)22 b(License)i(is)f(a) |
37c41ab1 CR |
20536 | h(kind)e(of)i(\\cop)m(yleft",)j(whic)m(h)c(means)g(that)h(deriv)-5 |
20537 | b(ativ)m(e)24 b(w)m(orks)f(of)h(the)f(do)s(cumen)m(t)330 | |
c2a47ea9 | 20538 | 2131 y(m)m(ust)34 b(themselv)m(es)h(b)s(e)e(free)h(in)g(the)g(same)g |
37c41ab1 | 20539 | (sense.)51 b(It)34 b(complemen)m(ts)h(the)f(GNU)g(General)h(Public)330 |
c2a47ea9 CR |
20540 | 2240 y(License,)c(whic)m(h)f(is)h(a)f(cop)m(yleft)i(license)g(designed) |
20541 | e(for)g(free)h(soft)m(w)m(are.)330 2373 y(W)-8 b(e)31 | |
37c41ab1 CR |
20542 | b(ha)m(v)m(e)f(designed)g(this)f(License)h(in)f(order)g(to)i(use)e(it)h |
20543 | (for)f(man)m(uals)h(for)f(free)h(soft)m(w)m(are,)h(b)s(ecause)330 | |
c2a47ea9 | 20544 | 2483 y(free)42 b(soft)m(w)m(are)i(needs)e(free)g(do)s(cumen)m(tation:) |
37c41ab1 | 20545 | 65 b(a)42 b(free)h(program)f(should)f(come)i(with)f(man)m(uals)330 |
c2a47ea9 | 20546 | 2592 y(pro)m(viding)29 b(the)g(same)g(freedoms)f(that)i(the)f(soft)m(w) |
37c41ab1 | 20547 | m(are)h(do)s(es.)40 b(But)29 b(this)f(License)i(is)f(not)g(limited)g |
c2a47ea9 | 20548 | (to)330 2702 y(soft)m(w)m(are)j(man)m(uals;)f(it)g(can)g(b)s(e)f(used)g |
37c41ab1 | 20549 | (for)g(an)m(y)h(textual)h(w)m(ork,)f(regardless)g(of)g(sub)5 |
c2a47ea9 | 20550 | b(ject)30 b(matter)i(or)330 2812 y(whether)f(it)h(is)f(published)f(as)i |
37c41ab1 | 20551 | (a)f(prin)m(ted)g(b)s(o)s(ok.)44 b(W)-8 b(e)32 b(recommend)f(this)h |
c2a47ea9 CR |
20552 | (License)g(principally)f(for)330 2921 y(w)m(orks)f(whose)h(purp)s(ose)d |
20553 | (is)j(instruction)f(or)g(reference.)199 3054 y(1.)61 | |
20554 | b(APPLICABILITY)29 b(AND)j(DEFINITIONS)330 3187 y(This)39 | |
37c41ab1 | 20555 | b(License)i(applies)f(to)g(an)m(y)h(man)m(ual)f(or)g(other)g(w)m(ork,)i |
c2a47ea9 | 20556 | (in)e(an)m(y)g(medium,)i(that)e(con)m(tains)i(a)330 3297 |
37c41ab1 CR |
20557 | y(notice)h(placed)f(b)m(y)f(the)h(cop)m(yrigh)m(t)h(holder)e(sa)m(ying) |
20558 | h(it)g(can)g(b)s(e)f(distributed)f(under)g(the)i(terms)330 | |
c2a47ea9 | 20559 | 3407 y(of)c(this)f(License.)62 b(Suc)m(h)37 b(a)h(notice)h(gran)m(ts)f |
37c41ab1 | 20560 | (a)g(w)m(orld-wide,)h(ro)m(y)m(alt)m(y-free)i(license,)f(unlimited)d |
c2a47ea9 | 20561 | (in)330 3516 y(duration,)49 b(to)d(use)f(that)g(w)m(ork)h(under)d(the)j |
37c41ab1 | 20562 | (conditions)f(stated)h(herein.)85 b(The)45 b(\\Do)s(cumen)m(t",)330 |
c2a47ea9 | 20563 | 3626 y(b)s(elo)m(w,)29 b(refers)f(to)h(an)m(y)g(suc)m(h)f(man)m(ual)h |
37c41ab1 | 20564 | (or)f(w)m(ork.)40 b(An)m(y)29 b(mem)m(b)s(er)e(of)i(the)f(public)g(is)g |
c2a47ea9 | 20565 | (a)h(licensee,)i(and)330 3735 y(is)25 b(addressed)f(as)h(\\y)m(ou".)40 |
37c41ab1 CR |
20566 | b(Y)-8 b(ou)26 b(accept)g(the)f(license)h(if)f(y)m(ou)h(cop)m(y)-8 |
20567 | b(,)27 b(mo)s(dify)d(or)h(distribute)g(the)g(w)m(ork)330 | |
c2a47ea9 CR |
20568 | 3845 y(in)30 b(a)h(w)m(a)m(y)g(requiring)f(p)s(ermission)f(under)g(cop) |
20569 | m(yrigh)m(t)j(la)m(w.)330 3978 y(A)i(\\Mo)s(di\014ed)f(V)-8 | |
37c41ab1 | 20570 | b(ersion")35 b(of)f(the)g(Do)s(cumen)m(t)g(means)g(an)m(y)g(w)m(ork)f |
c2a47ea9 | 20571 | (con)m(taining)j(the)e(Do)s(cumen)m(t)g(or)330 4088 y(a)k(p)s(ortion)f |
37c41ab1 | 20572 | (of)h(it,)i(either)e(copied)g(v)m(erbatim,)i(or)d(with)h(mo)s |
c2a47ea9 CR |
20573 | (di\014cations)f(and/or)h(translated)g(in)m(to)330 4197 |
20574 | y(another)31 b(language.)330 4330 y(A)26 b(\\Secondary)g(Section")h(is) | |
37c41ab1 | 20575 | f(a)h(named)e(app)s(endix)f(or)i(a)h(fron)m(t-matter)g(section)g(of)f |
c2a47ea9 | 20576 | (the)g(Do)s(cumen)m(t)330 4440 y(that)c(deals)g(exclusiv)m(ely)h(with)e |
37c41ab1 | 20577 | (the)g(relationship)h(of)f(the)h(publishers)d(or)i(authors)g(of)h(the)f |
c2a47ea9 | 20578 | (Do)s(cumen)m(t)330 4549 y(to)38 b(the)f(Do)s(cumen)m(t's)i(o)m(v)m |
37c41ab1 | 20579 | (erall)g(sub)5 b(ject)37 b(\(or)h(to)g(related)g(matters\))g(and)f(con) |
c2a47ea9 | 20580 | m(tains)h(nothing)f(that)330 4659 y(could)j(fall)h(directly)g(within)f |
37c41ab1 CR |
20581 | (that)h(o)m(v)m(erall)i(sub)5 b(ject.)70 b(\(Th)m(us,)42 |
20582 | b(if)e(the)h(Do)s(cumen)m(t)g(is)f(in)g(part)h(a)330 | |
c2a47ea9 | 20583 | 4769 y(textb)s(o)s(ok)24 b(of)g(mathematics,)j(a)d(Secondary)f(Section) |
37c41ab1 | 20584 | h(ma)m(y)g(not)g(explain)g(an)m(y)g(mathematics.\))40 |
c2a47ea9 | 20585 | b(The)330 4878 y(relationship)28 b(could)f(b)s(e)g(a)g(matter)i(of)e |
37c41ab1 | 20586 | (historical)i(connection)f(with)f(the)h(sub)5 b(ject)27 |
c2a47ea9 | 20587 | b(or)g(with)g(related)330 4988 y(matters,)38 b(or)d(of)h(legal,)i |
37c41ab1 | 20588 | (commercial,)h(philosophical,)f(ethical)f(or)e(p)s(olitical)i(p)s |
c2a47ea9 | 20589 | (osition)f(regarding)330 5097 y(them.)330 5230 y(The)25 |
37c41ab1 CR |
20590 | b(\\In)m(v)-5 b(arian)m(t)27 b(Sections")g(are)f(certain)g(Secondary)g |
20591 | (Sections)g(whose)f(titles)i(are)f(designated,)i(as)330 | |
c2a47ea9 | 20592 | 5340 y(b)s(eing)e(those)h(of)g(In)m(v)-5 b(arian)m(t)27 |
37c41ab1 | 20593 | b(Sections,)i(in)d(the)h(notice)h(that)f(sa)m(ys)g(that)g(the)g(Do)s |
c2a47ea9 | 20594 | (cumen)m(t)g(is)g(released)p eop end |
5e6f45d9 CR |
20595 | %%Page: 174 180 |
20596 | TeXDict begin 174 179 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 20597 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 20598 | b(174)330 299 y(under)26 b(this)i(License.)40 b(If)27 |
ad4aef08 | 20599 | b(a)h(section)h(do)s(es)f(not)f(\014t)h(the)g(ab)s(o)m(v)m(e)h |
c2a47ea9 | 20600 | (de\014nition)e(of)h(Secondary)f(then)h(it)g(is)330 408 |
37c41ab1 CR |
20601 | y(not)k(allo)m(w)m(ed)i(to)e(b)s(e)g(designated)g(as)g(In)m(v)-5 |
20602 | b(arian)m(t.)46 b(The)31 b(Do)s(cumen)m(t)i(ma)m(y)f(con)m(tain)i(zero) | |
c2a47ea9 | 20603 | e(In)m(v)-5 b(arian)m(t)330 518 y(Sections.)39 b(If)25 |
37c41ab1 CR |
20604 | b(the)f(Do)s(cumen)m(t)i(do)s(es)e(not)h(iden)m(tify)g(an)m(y)g(In)m(v) |
20605 | -5 b(arian)m(t)25 b(Sections)h(then)e(there)h(are)g(none.)330 | |
1231ac47 | 20606 | 669 y(The)36 b(\\Co)m(v)m(er)i(T)-8 b(exts")38 b(are)f(certain)g(short) |
c2a47ea9 | 20607 | g(passages)g(of)g(text)g(that)h(are)f(listed,)i(as)d(F)-8 |
1231ac47 | 20608 | b(ron)m(t-Co)m(v)m(er)330 778 y(T)g(exts)26 b(or)f(Bac)m(k-Co)m(v)m(er) |
c2a47ea9 | 20609 | j(T)-8 b(exts,)27 b(in)d(the)h(notice)i(that)e(sa)m(ys)h(that)g(the)f |
1231ac47 | 20610 | (Do)s(cumen)m(t)h(is)f(released)g(under)330 888 y(this)h(License.)40 |
c2a47ea9 CR |
20611 | b(A)25 b(F)-8 b(ron)m(t-Co)m(v)m(er)29 b(T)-8 b(ext)26 |
20612 | b(ma)m(y)h(b)s(e)e(at)i(most)f(5)g(w)m(ords,)g(and)g(a)g(Bac)m(k-Co)m | |
1231ac47 CR |
20613 | (v)m(er)j(T)-8 b(ext)26 b(ma)m(y)330 998 y(b)s(e)k(at)h(most)g(25)g(w)m |
20614 | (ords.)330 1148 y(A)36 b(\\T)-8 b(ransparen)m(t")36 b(cop)m(y)g(of)g | |
c2a47ea9 | 20615 | (the)f(Do)s(cumen)m(t)h(means)g(a)g(mac)m(hine-readable)h(cop)m(y)-8 |
1231ac47 | 20616 | b(,)38 b(represen)m(ted)330 1258 y(in)d(a)h(format)g(whose)g(sp)s |
37c41ab1 | 20617 | (eci\014cation)g(is)g(a)m(v)-5 b(ailable)38 b(to)f(the)f(general)g |
1231ac47 | 20618 | (public,)h(that)f(is)g(suitable)g(for)330 1367 y(revising)c(the)g(do)s |
37c41ab1 | 20619 | (cumen)m(t)f(straigh)m(tforw)m(ardly)i(with)e(generic)i(text)g(editors) |
1231ac47 | 20620 | f(or)f(\(for)h(images)h(com-)330 1477 y(p)s(osed)23 b(of)h(pixels\))g |
37c41ab1 | 20621 | (generic)h(pain)m(t)f(programs)g(or)f(\(for)h(dra)m(wings\))g(some)g |
1231ac47 | 20622 | (widely)g(a)m(v)-5 b(ailable)26 b(dra)m(wing)330 1587 |
37c41ab1 CR |
20623 | y(editor,)k(and)f(that)g(is)g(suitable)h(for)f(input)f(to)i(text)g |
20624 | (formatters)f(or)g(for)g(automatic)i(translation)f(to)330 | |
1231ac47 | 20625 | 1696 y(a)d(v)-5 b(ariet)m(y)28 b(of)f(formats)g(suitable)h(for)e(input) |
37c41ab1 | 20626 | g(to)i(text)g(formatters.)40 b(A)27 b(cop)m(y)g(made)g(in)g(an)g |
1231ac47 | 20627 | (otherwise)330 1806 y(T)-8 b(ransparen)m(t)37 b(\014le)h(format)g |
5e13499c | 20628 | (whose)f(markup,)i(or)e(absence)h(of)g(markup,)g(has)g(b)s(een)f |
1231ac47 | 20629 | (arranged)g(to)330 1915 y(th)m(w)m(art)27 b(or)g(discourage)g |
37c41ab1 | 20630 | (subsequen)m(t)f(mo)s(di\014cation)h(b)m(y)g(readers)f(is)g(not)h(T)-8 |
1231ac47 | 20631 | b(ransparen)m(t.)39 b(An)27 b(image)330 2025 y(format)35 |
37c41ab1 CR |
20632 | b(is)f(not)h(T)-8 b(ransparen)m(t)34 b(if)g(used)g(for)g(an)m(y)g |
20633 | (substan)m(tial)h(amoun)m(t)g(of)g(text.)53 b(A)35 b(cop)m(y)g(that)g | |
1231ac47 CR |
20634 | (is)330 2134 y(not)c(\\T)-8 b(ransparen)m(t")31 b(is)f(called)i |
20635 | (\\Opaque".)330 2285 y(Examples)53 b(of)g(suitable)h(formats)f(for)g(T) | |
6e51e0d0 CR |
20636 | -8 b(ransparen)m(t)53 b(copies)h(include)f(plain)g Fm(asci)r(i)g |
20637 | Fu(without)330 2395 y(markup,)37 b(T)-8 b(exinfo)36 b(input)f(format,)j | |
c302751c | 20638 | (LaT)1759 2414 y(E)1810 2395 y(X)e(input)f(format,)j |
6e51e0d0 CR |
20639 | Ff(SGML)f Fu(or)f Ff(XML)g Fu(using)g(a)g(publicly)330 |
20640 | 2504 y(a)m(v)-5 b(ailable)42 b Ff(DTD)p Fu(,)h(and)c | |
20641 | (standard-conforming)g(simple)h Ff(HTML)p Fu(,)i(P)m(ostScript)e(or)f | |
20642 | Ff(PDF)h Fu(designed)330 2614 y(for)e(h)m(uman)f(mo)s(di\014cation.)65 | |
20643 | b(Examples)38 b(of)h(transparen)m(t)f(image)h(formats)g(include)f | |
20644 | Ff(PNG)p Fu(,)i Ff(X)n(CF)330 2724 y Fu(and)e Ff(JPG)p | |
20645 | Fu(.)64 b(Opaque)38 b(formats)h(include)f(proprietary)h(formats)f(that) | |
20646 | h(can)g(b)s(e)f(read)h(and)f(edited)330 2833 y(only)54 | |
20647 | b(b)m(y)f(proprietary)h(w)m(ord)f(pro)s(cessors,)59 b | |
20648 | Ff(SGML)54 b Fu(or)f Ff(XML)h Fu(for)g(whic)m(h)f(the)h | |
20649 | Ff(DTD)g Fu(and/or)330 2943 y(pro)s(cessing)61 b(to)s(ols)h(are)f(not)g | |
20650 | (generally)i(a)m(v)-5 b(ailable,)71 b(and)60 b(the)h(mac)m | |
20651 | (hine-generated)j Ff(HTML)p Fu(,)330 3052 y(P)m(ostScript)31 | |
20652 | b(or)f Ff(PDF)h Fu(pro)s(duced)d(b)m(y)j(some)f(w)m(ord)g(pro)s | |
20653 | (cessors)g(for)g(output)g(purp)s(oses)f(only)-8 b(.)330 | |
20654 | 3203 y(The)34 b(\\Title)h(P)m(age")i(means,)e(for)f(a)h(prin)m(ted)f(b) | |
20655 | s(o)s(ok,)h(the)f(title)i(page)f(itself,)h(plus)e(suc)m(h)f(follo)m | |
20656 | (wing)330 3313 y(pages)28 b(as)g(are)g(needed)g(to)g(hold,)g(legibly)-8 | |
20657 | b(,)30 b(the)e(material)h(this)e(License)i(requires)e(to)h(app)s(ear)f | |
20658 | (in)h(the)330 3422 y(title)g(page.)40 b(F)-8 b(or)28 | |
20659 | b(w)m(orks)e(in)g(formats)h(whic)m(h)g(do)f(not)h(ha)m(v)m(e)h(an)m(y)e | |
20660 | (title)j(page)e(as)g(suc)m(h,)g(\\Title)h(P)m(age")330 | |
20661 | 3532 y(means)j(the)f(text)i(near)e(the)h(most)g(prominen)m(t)g(app)s | |
20662 | (earance)f(of)h(the)g(w)m(ork's)g(title,)h(preceding)f(the)330 | |
20663 | 3641 y(b)s(eginning)f(of)g(the)h(b)s(o)s(dy)e(of)h(the)h(text.)330 | |
20664 | 3792 y(The)j(\\publisher")g(means)h(an)m(y)f(p)s(erson)g(or)h(en)m(tit) | |
20665 | m(y)h(that)f(distributes)f(copies)i(of)e(the)h(Do)s(cumen)m(t)330 | |
20666 | 3902 y(to)c(the)g(public.)330 4052 y(A)f(section)h(\\En)m(titled)g | |
20667 | (XYZ")f(means)f(a)h(named)g(subunit)e(of)h(the)h(Do)s(cumen)m(t)h | |
20668 | (whose)e(title)i(either)330 4162 y(is)d(precisely)g(XYZ)g(or)f(con)m | |
20669 | (tains)i(XYZ)f(in)f(paren)m(theses)i(follo)m(wing)g(text)g(that)f | |
20670 | (translates)h(XYZ)e(in)330 4271 y(another)e(language.)40 | |
20671 | b(\(Here)26 b(XYZ)f(stands)f(for)h(a)g(sp)s(eci\014c)g(section)h(name)f | |
20672 | (men)m(tioned)h(b)s(elo)m(w,)g(suc)m(h)330 4381 y(as)i(\\Ac)m(kno)m | |
20673 | (wledgemen)m(ts",)33 b(\\Dedications",)e(\\Endorsemen)m(ts",)e(or)f | |
20674 | (\\History".\))42 b(T)-8 b(o)29 b(\\Preserv)m(e)330 4491 | |
20675 | y(the)34 b(Title")h(of)e(suc)m(h)h(a)g(section)g(when)f(y)m(ou)h(mo)s | |
20676 | (dify)e(the)i(Do)s(cumen)m(t)h(means)e(that)h(it)g(remains)g(a)330 | |
20677 | 4600 y(section)e(\\En)m(titled)f(XYZ")g(according)g(to)g(this)g | |
20678 | (de\014nition.)330 4751 y(The)c(Do)s(cumen)m(t)i(ma)m(y)f(include)f(W) | |
20679 | -8 b(arran)m(t)m(y)30 b(Disclaimers)f(next)f(to)g(the)g(notice)h(whic)m | |
20680 | (h)e(states)i(that)330 4861 y(this)34 b(License)g(applies)g(to)h(the)f | |
20681 | (Do)s(cumen)m(t.)52 b(These)33 b(W)-8 b(arran)m(t)m(y)36 | |
20682 | b(Disclaimers)f(are)g(considered)e(to)330 4970 y(b)s(e)k(included)g(b)m | |
20683 | (y)g(reference)h(in)g(this)f(License,)j(but)d(only)h(as)g(regards)f | |
20684 | (disclaiming)i(w)m(arran)m(ties:)330 5080 y(an)m(y)e(other)g | |
20685 | (implication)i(that)e(these)g(W)-8 b(arran)m(t)m(y)39 | |
20686 | b(Disclaimers)f(ma)m(y)g(ha)m(v)m(e)g(is)f(v)m(oid)g(and)f(has)h(no)330 | |
20687 | 5189 y(e\013ect)32 b(on)e(the)h(meaning)f(of)h(this)f(License.)199 | |
20688 | 5340 y(2.)61 b(VERBA)-8 b(TIM)31 b(COPYING)p eop end | |
5e6f45d9 CR |
20689 | %%Page: 175 181 |
20690 | TeXDict begin 175 180 bop 150 -116 a Fu(App)s(endix)29 | |
c2a47ea9 | 20691 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 20692 | b(175)330 299 y(Y)-8 b(ou)39 b(ma)m(y)f(cop)m(y)h(and)e(distribute)h |
1231ac47 CR |
20693 | (the)g(Do)s(cumen)m(t)h(in)f(an)m(y)g(medium,)h(either)g(commercially)h |
20694 | (or)330 408 y(noncommercially)-8 b(,)48 b(pro)m(vided)42 | |
20695 | b(that)h(this)f(License,)47 b(the)42 b(cop)m(yrigh)m(t)i(notices,)j | |
20696 | (and)42 b(the)h(license)330 518 y(notice)37 b(sa)m(ying)g(this)e | |
20697 | (License)i(applies)e(to)i(the)f(Do)s(cumen)m(t)g(are)g(repro)s(duced)e | |
20698 | (in)i(all)g(copies,)j(and)330 628 y(that)27 b(y)m(ou)g(add)f(no)h | |
20699 | (other)f(conditions)h(whatso)s(ev)m(er)h(to)f(those)g(of)g(this)f | |
20700 | (License.)40 b(Y)-8 b(ou)27 b(ma)m(y)g(not)g(use)330 | |
20701 | 737 y(tec)m(hnical)35 b(measures)d(to)i(obstruct)f(or)g(con)m(trol)h | |
20702 | (the)f(reading)g(or)g(further)e(cop)m(ying)j(of)f(the)g(copies)330 | |
20703 | 847 y(y)m(ou)25 b(mak)m(e)g(or)g(distribute.)38 b(Ho)m(w)m(ev)m(er,)28 | |
37c41ab1 | 20704 | b(y)m(ou)d(ma)m(y)g(accept)h(comp)s(ensation)f(in)f(exc)m(hange)j(for)d |
1231ac47 | 20705 | (copies.)330 956 y(If)32 b(y)m(ou)g(distribute)g(a)h(large)g(enough)f |
37c41ab1 | 20706 | (n)m(um)m(b)s(er)f(of)h(copies)h(y)m(ou)f(m)m(ust)h(also)g(follo)m(w)g |
1231ac47 | 20707 | (the)f(conditions)330 1066 y(in)e(section)i(3.)330 1200 |
37c41ab1 CR |
20708 | y(Y)-8 b(ou)21 b(ma)m(y)h(also)f(lend)g(copies,)i(under)d(the)h(same)g |
20709 | (conditions)g(stated)h(ab)s(o)m(v)m(e,)i(and)c(y)m(ou)h(ma)m(y)g | |
1231ac47 CR |
20710 | (publicly)330 1310 y(displa)m(y)31 b(copies.)199 1443 |
20711 | y(3.)61 b(COPYING)30 b(IN)g(QUANTITY)330 1577 y(If)25 | |
37c41ab1 CR |
20712 | b(y)m(ou)g(publish)f(prin)m(ted)g(copies)i(\(or)g(copies)g(in)f(media)g |
20713 | (that)h(commonly)g(ha)m(v)m(e)g(prin)m(ted)f(co)m(v)m(ers\))i(of)330 | |
1231ac47 | 20714 | 1687 y(the)32 b(Do)s(cumen)m(t,)h(n)m(um)m(b)s(ering)e(more)h(than)f |
37c41ab1 | 20715 | (100,)j(and)d(the)h(Do)s(cumen)m(t's)h(license)f(notice)h(requires)330 |
1231ac47 | 20716 | 1797 y(Co)m(v)m(er)i(T)-8 b(exts,)36 b(y)m(ou)f(m)m(ust)f(enclose)i |
37c41ab1 | 20717 | (the)e(copies)h(in)f(co)m(v)m(ers)i(that)f(carry)-8 b(,)36 |
1231ac47 | 20718 | b(clearly)f(and)f(legibly)-8 b(,)37 b(all)330 1906 y(these)j(Co)m(v)m |
37c41ab1 | 20719 | (er)g(T)-8 b(exts:)59 b(F)-8 b(ron)m(t-Co)m(v)m(er)41 |
5e13499c CR |
20720 | b(T)-8 b(exts)40 b(on)f(the)g(fron)m(t)g(co)m(v)m(er,)44 |
20721 | b(and)38 b(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts)40 b(on)330 | |
1231ac47 | 20722 | 2016 y(the)29 b(bac)m(k)h(co)m(v)m(er.)42 b(Both)30 b(co)m(v)m(ers)h(m) |
37c41ab1 | 20723 | m(ust)e(also)h(clearly)g(and)f(legibly)h(iden)m(tify)f(y)m(ou)h(as)f |
1231ac47 | 20724 | (the)h(publisher)330 2125 y(of)k(these)h(copies.)53 b(The)34 |
37c41ab1 | 20725 | b(fron)m(t)h(co)m(v)m(er)h(m)m(ust)e(presen)m(t)g(the)h(full)f(title)i |
1231ac47 | 20726 | (with)d(all)j(w)m(ords)d(of)i(the)f(title)330 2235 y(equally)e |
37c41ab1 CR |
20727 | (prominen)m(t)e(and)g(visible.)43 b(Y)-8 b(ou)31 b(ma)m(y)g(add)g |
20728 | (other)g(material)h(on)f(the)g(co)m(v)m(ers)h(in)e(addition.)330 | |
1231ac47 | 20729 | 2345 y(Cop)m(ying)36 b(with)g(c)m(hanges)h(limited)g(to)g(the)g(co)m(v) |
37c41ab1 | 20730 | m(ers,)i(as)d(long)h(as)g(they)f(preserv)m(e)g(the)h(title)g(of)g(the) |
1231ac47 | 20731 | 330 2454 y(Do)s(cumen)m(t)h(and)e(satisfy)i(these)f(conditions,)j(can)d |
37c41ab1 | 20732 | (b)s(e)g(treated)h(as)f(v)m(erbatim)h(cop)m(ying)g(in)f(other)330 |
1231ac47 | 20733 | 2564 y(resp)s(ects.)330 2698 y(If)32 b(the)h(required)f(texts)i(for)e |
37c41ab1 | 20734 | (either)h(co)m(v)m(er)i(are)e(to)s(o)g(v)m(oluminous)g(to)g(\014t)g |
1231ac47 | 20735 | (legibly)-8 b(,)35 b(y)m(ou)e(should)f(put)330 2807 y(the)h(\014rst)f |
37c41ab1 CR |
20736 | (ones)h(listed)g(\(as)h(man)m(y)f(as)g(\014t)g(reasonably\))g(on)g(the) |
20737 | g(actual)h(co)m(v)m(er,)h(and)e(con)m(tin)m(ue)h(the)330 | |
1231ac47 | 20738 | 2917 y(rest)d(on)m(to)g(adjacen)m(t)h(pages.)330 3051 |
37c41ab1 CR |
20739 | y(If)27 b(y)m(ou)g(publish)e(or)i(distribute)g(Opaque)f(copies)i(of)f |
20740 | (the)h(Do)s(cumen)m(t)f(n)m(um)m(b)s(ering)f(more)i(than)e(100,)330 | |
1231ac47 | 20741 | 3160 y(y)m(ou)i(m)m(ust)g(either)h(include)e(a)i(mac)m(hine-readable)g |
37c41ab1 | 20742 | (T)-8 b(ransparen)m(t)28 b(cop)m(y)h(along)g(with)e(eac)m(h)i(Opaque) |
1231ac47 | 20743 | 330 3270 y(cop)m(y)-8 b(,)38 b(or)d(state)h(in)f(or)g(with)g(eac)m(h)h |
37c41ab1 | 20744 | (Opaque)e(cop)m(y)i(a)g(computer-net)m(w)m(ork)g(lo)s(cation)h(from)d |
1231ac47 | 20745 | (whic)m(h)330 3380 y(the)24 b(general)i(net)m(w)m(ork-using)f(public)e |
37c41ab1 | 20746 | (has)h(access)i(to)f(do)m(wnload)f(using)g(public-standard)f(net)m(w)m |
1231ac47 | 20747 | (ork)330 3489 y(proto)s(cols)40 b(a)f(complete)h(T)-8 |
5e13499c | 20748 | b(ransparen)m(t)39 b(cop)m(y)g(of)g(the)h(Do)s(cumen)m(t,)i(free)d(of)g |
1231ac47 | 20749 | (added)f(material.)67 b(If)330 3599 y(y)m(ou)39 b(use)g(the)g(latter)h |
37c41ab1 | 20750 | (option,)h(y)m(ou)f(m)m(ust)e(tak)m(e)j(reasonably)e(pruden)m(t)e |
1231ac47 | 20751 | (steps,)k(when)d(y)m(ou)h(b)s(egin)330 3708 y(distribution)f(of)g |
37c41ab1 CR |
20752 | (Opaque)g(copies)h(in)e(quan)m(tit)m(y)-8 b(,)43 b(to)38 |
20753 | b(ensure)g(that)h(this)f(T)-8 b(ransparen)m(t)38 b(cop)m(y)h(will)330 | |
1231ac47 | 20754 | 3818 y(remain)30 b(th)m(us)g(accessible)i(at)f(the)f(stated)h(lo)s |
37c41ab1 | 20755 | (cation)h(un)m(til)e(at)h(least)h(one)e(y)m(ear)h(after)g(the)f(last)h |
1231ac47 | 20756 | (time)330 3927 y(y)m(ou)37 b(distribute)f(an)h(Opaque)f(cop)m(y)i |
37c41ab1 | 20757 | (\(directly)g(or)e(through)g(y)m(our)h(agen)m(ts)h(or)f(retailers\))h |
1231ac47 CR |
20758 | (of)f(that)330 4037 y(edition)31 b(to)g(the)g(public.)330 |
20759 | 4171 y(It)k(is)f(requested,)i(but)e(not)h(required,)g(that)g(y)m(ou)g | |
5e13499c | 20760 | (con)m(tact)h(the)f(authors)f(of)h(the)g(Do)s(cumen)m(t)g(w)m(ell)330 |
1231ac47 | 20761 | 4281 y(b)s(efore)28 b(redistributing)g(an)m(y)h(large)h(n)m(um)m(b)s |
37c41ab1 | 20762 | (er)d(of)i(copies,)h(to)f(giv)m(e)h(them)f(a)g(c)m(hance)h(to)f(pro)m |
1231ac47 CR |
20763 | (vide)g(y)m(ou)330 4390 y(with)h(an)g(up)s(dated)f(v)m(ersion)i(of)g |
20764 | (the)f(Do)s(cumen)m(t.)199 4524 y(4.)61 b(MODIFICA)-8 | |
20765 | b(TIONS)330 4658 y(Y)g(ou)26 b(ma)m(y)g(cop)m(y)g(and)f(distribute)g(a) | |
37c41ab1 | 20766 | h(Mo)s(di\014ed)f(V)-8 b(ersion)26 b(of)g(the)g(Do)s(cumen)m(t)g(under) |
1231ac47 | 20767 | e(the)h(conditions)330 4768 y(of)c(sections)h(2)g(and)e(3)h(ab)s(o)m(v) |
37c41ab1 | 20768 | m(e,)k(pro)m(vided)20 b(that)i(y)m(ou)f(release)i(the)e(Mo)s(di\014ed)f |
1231ac47 | 20769 | (V)-8 b(ersion)22 b(under)d(precisely)330 4877 y(this)29 |
37c41ab1 CR |
20770 | b(License,)h(with)f(the)g(Mo)s(di\014ed)f(V)-8 b(ersion)30 |
20771 | b(\014lling)f(the)g(role)h(of)f(the)g(Do)s(cumen)m(t,)h(th)m(us)f | |
1231ac47 | 20772 | (licensing)330 4987 y(distribution)k(and)h(mo)s(di\014cation)g(of)h |
37c41ab1 | 20773 | (the)f(Mo)s(di\014ed)f(V)-8 b(ersion)35 b(to)g(who)s(ev)m(er)f(p)s |
1231ac47 | 20774 | (ossesses)f(a)i(cop)m(y)g(of)330 5096 y(it.)41 b(In)30 |
37c41ab1 | 20775 | b(addition,)h(y)m(ou)f(m)m(ust)h(do)f(these)h(things)f(in)g(the)h(Mo)s |
1231ac47 | 20776 | (di\014ed)e(V)-8 b(ersion:)357 5230 y(A.)60 b(Use)33 |
c2a47ea9 CR |
20777 | b(in)f(the)h(Title)h(P)m(age)g(\(and)f(on)f(the)h(co)m(v)m(ers,)i(if)e |
20778 | (an)m(y\))g(a)g(title)h(distinct)f(from)g(that)g(of)g(the)510 | |
1231ac47 | 20779 | 5340 y(Do)s(cumen)m(t,)j(and)d(from)g(those)i(of)f(previous)f(v)m |
c2a47ea9 | 20780 | (ersions)h(\(whic)m(h)g(should,)g(if)g(there)g(w)m(ere)g(an)m(y)-8 |
1231ac47 | 20781 | b(,)p eop end |
5e6f45d9 CR |
20782 | %%Page: 176 182 |
20783 | TeXDict begin 176 181 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 20784 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 20785 | b(176)510 299 y(b)s(e)31 b(listed)h(in)f(the)g(History)h(section)g(of)g |
ad4aef08 CR |
20786 | (the)f(Do)s(cumen)m(t\).)45 b(Y)-8 b(ou)32 b(ma)m(y)g(use)f(the)g(same) |
20787 | h(title)h(as)510 408 y(a)e(previous)f(v)m(ersion)g(if)h(the)f(original) | |
20788 | i(publisher)d(of)h(that)h(v)m(ersion)g(giv)m(es)h(p)s(ermission.)360 | |
20789 | 545 y(B.)61 b(List)31 b(on)f(the)h(Title)g(P)m(age,)i(as)d(authors,)h | |
20790 | (one)g(or)f(more)h(p)s(ersons)e(or)h(en)m(tities)j(resp)s(onsible)c | |
20791 | (for)510 655 y(authorship)c(of)h(the)h(mo)s(di\014cations)f(in)g(the)g | |
20792 | (Mo)s(di\014ed)f(V)-8 b(ersion,)28 b(together)g(with)d(at)i(least)h | |
20793 | (\014v)m(e)510 765 y(of)c(the)g(principal)g(authors)f(of)i(the)f(Do)s | |
20794 | (cumen)m(t)g(\(all)h(of)g(its)f(principal)g(authors,)h(if)f(it)g(has)g | |
20795 | (few)m(er)510 874 y(than)30 b(\014v)m(e\),)h(unless)f(they)h(release)g | |
20796 | (y)m(ou)g(from)f(this)g(requiremen)m(t.)359 1011 y(C.)60 | |
1231ac47 CR |
20797 | b(State)32 b(on)e(the)h(Title)h(page)f(the)g(name)g(of)g(the)g |
20798 | (publisher)e(of)i(the)g(Mo)s(di\014ed)f(V)-8 b(ersion,)32 | |
20799 | b(as)f(the)510 1121 y(publisher.)355 1258 y(D.)61 b(Preserv)m(e)31 | |
20800 | b(all)g(the)g(cop)m(yrigh)m(t)h(notices)f(of)g(the)f(Do)s(cumen)m(t.) | |
20801 | 363 1395 y(E.)60 b(Add)30 b(an)i(appropriate)f(cop)m(yrigh)m(t)i | |
20802 | (notice)f(for)g(y)m(our)f(mo)s(di\014cations)g(adjacen)m(t)i(to)f(the)g | |
20803 | (other)510 1504 y(cop)m(yrigh)m(t)g(notices.)365 1641 | |
20804 | y(F.)61 b(Include,)28 b(immediately)h(after)f(the)h(cop)m(yrigh)m(t)g | |
20805 | (notices,)h(a)e(license)h(notice)g(giving)g(the)f(public)510 | |
20806 | 1751 y(p)s(ermission)23 b(to)j(use)e(the)g(Mo)s(di\014ed)g(V)-8 | |
20807 | b(ersion)25 b(under)e(the)i(terms)f(of)h(this)f(License,)j(in)d(the)g | |
20808 | (form)510 1861 y(sho)m(wn)30 b(in)g(the)g(Addendum)f(b)s(elo)m(w.)353 | |
20809 | 1998 y(G.)61 b(Preserv)m(e)23 b(in)g(that)g(license)h(notice)g(the)f | |
37c41ab1 | 20810 | (full)g(lists)g(of)g(In)m(v)-5 b(arian)m(t)23 b(Sections)h(and)e |
1231ac47 CR |
20811 | (required)g(Co)m(v)m(er)510 2107 y(T)-8 b(exts)31 b(giv)m(en)g(in)f |
20812 | (the)h(Do)s(cumen)m(t's)g(license)h(notice.)357 2244 | |
37c41ab1 | 20813 | y(H.)60 b(Include)30 b(an)g(unaltered)g(cop)m(y)h(of)g(this)f(License.) |
1231ac47 | 20814 | 392 2381 y(I.)60 b(Preserv)m(e)33 b(the)f(section)h(En)m(titled)g |
37c41ab1 | 20815 | (\\History",)h(Preserv)m(e)f(its)f(Title,)i(and)d(add)h(to)h(it)f(an)g |
1231ac47 | 20816 | (item)510 2491 y(stating)d(at)g(least)g(the)g(title,)h(y)m(ear,)g(new)d |
37c41ab1 | 20817 | (authors,)i(and)e(publisher)f(of)j(the)f(Mo)s(di\014ed)f(V)-8 |
1231ac47 | 20818 | b(ersion)510 2600 y(as)32 b(giv)m(en)g(on)f(the)h(Title)g(P)m(age.)45 |
37c41ab1 | 20819 | b(If)31 b(there)h(is)f(no)g(section)i(En)m(titled)f(\\History")h(in)e |
1231ac47 | 20820 | (the)g(Do)s(cu-)510 2710 y(men)m(t,)37 b(create)f(one)f(stating)h(the)f |
37c41ab1 | 20821 | (title,)i(y)m(ear,)g(authors,)f(and)e(publisher)f(of)i(the)g(Do)s |
1231ac47 | 20822 | (cumen)m(t)510 2819 y(as)h(giv)m(en)h(on)f(its)h(Title)g(P)m(age,)i |
37c41ab1 | 20823 | (then)d(add)g(an)g(item)g(describing)g(the)g(Mo)s(di\014ed)g(V)-8 |
1231ac47 CR |
20824 | b(ersion)37 b(as)510 2929 y(stated)31 b(in)f(the)h(previous)f(sen)m |
20825 | (tence.)378 3066 y(J.)60 b(Preserv)m(e)33 b(the)g(net)m(w)m(ork)g(lo)s | |
37c41ab1 | 20826 | (cation,)i(if)d(an)m(y)-8 b(,)34 b(giv)m(en)f(in)g(the)f(Do)s(cumen)m |
1231ac47 | 20827 | (t)h(for)g(public)e(access)j(to)510 3176 y(a)e(T)-8 b(ransparen)m(t)30 |
37c41ab1 | 20828 | b(cop)m(y)i(of)g(the)f(Do)s(cumen)m(t,)h(and)f(lik)m(ewise)h(the)g(net) |
1231ac47 | 20829 | m(w)m(ork)g(lo)s(cations)g(giv)m(en)g(in)510 3285 y(the)g(Do)s(cumen)m |
37c41ab1 | 20830 | (t)g(for)g(previous)f(v)m(ersions)h(it)g(w)m(as)g(based)f(on.)45 |
1231ac47 | 20831 | b(These)31 b(ma)m(y)h(b)s(e)f(placed)h(in)g(the)510 3395 |
37c41ab1 CR |
20832 | y(\\History")27 b(section.)40 b(Y)-8 b(ou)25 b(ma)m(y)h(omit)g(a)f(net) |
20833 | m(w)m(ork)h(lo)s(cation)g(for)f(a)h(w)m(ork)f(that)g(w)m(as)h | |
1231ac47 | 20834 | (published)510 3504 y(at)36 b(least)h(four)e(y)m(ears)i(b)s(efore)e |
37c41ab1 | 20835 | (the)h(Do)s(cumen)m(t)h(itself,)h(or)d(if)h(the)g(original)h(publisher) |
1231ac47 CR |
20836 | d(of)i(the)510 3614 y(v)m(ersion)31 b(it)g(refers)f(to)h(giv)m(es)h(p)s |
20837 | (ermission.)354 3751 y(K.)60 b(F)-8 b(or)24 b(an)m(y)h(section)f(En)m | |
37c41ab1 | 20838 | (titled)h(\\Ac)m(kno)m(wledgemen)m(ts")i(or)d(\\Dedications",)k |
1231ac47 | 20839 | (Preserv)m(e)c(the)g(Title)510 3861 y(of)j(the)f(section,)j(and)d |
37c41ab1 | 20840 | (preserv)m(e)h(in)f(the)h(section)g(all)h(the)e(substance)h(and)f(tone) |
1231ac47 | 20841 | h(of)f(eac)m(h)i(of)f(the)510 3970 y(con)m(tributor)k(ac)m(kno)m |
37c41ab1 | 20842 | (wledgemen)m(ts)i(and/or)d(dedications)h(giv)m(en)h(therein.)368 |
1231ac47 | 20843 | 4107 y(L.)60 b(Preserv)m(e)36 b(all)g(the)g(In)m(v)-5 |
37c41ab1 | 20844 | b(arian)m(t)36 b(Sections)g(of)f(the)h(Do)s(cumen)m(t,)h(unaltered)f |
1231ac47 | 20845 | (in)f(their)g(text)i(and)510 4217 y(in)f(their)g(titles.)58 |
37c41ab1 CR |
20846 | b(Section)37 b(n)m(um)m(b)s(ers)d(or)i(the)g(equiv)-5 |
20847 | b(alen)m(t)38 b(are)e(not)g(considered)g(part)g(of)g(the)510 | |
1231ac47 | 20848 | 4326 y(section)c(titles.)341 4463 y(M.)61 b(Delete)33 |
37c41ab1 CR |
20849 | b(an)m(y)e(section)h(En)m(titled)f(\\Endorsemen)m(ts".)42 |
20850 | b(Suc)m(h)30 b(a)i(section)f(ma)m(y)h(not)f(b)s(e)f(included)510 | |
1231ac47 CR |
20851 | 4573 y(in)g(the)h(Mo)s(di\014ed)e(V)-8 b(ersion.)357 |
20852 | 4710 y(N.)60 b(Do)29 b(not)g(retitle)h(an)m(y)e(existing)i(section)f | |
37c41ab1 | 20853 | (to)g(b)s(e)f(En)m(titled)h(\\Endorsemen)m(ts")g(or)f(to)h(con\015ict)g |
1231ac47 CR |
20854 | (in)510 4819 y(title)j(with)e(an)m(y)h(In)m(v)-5 b(arian)m(t)31 |
20855 | b(Section.)354 4956 y(O.)60 b(Preserv)m(e)31 b(an)m(y)g(W)-8 | |
20856 | b(arran)m(t)m(y)32 b(Disclaimers.)330 5121 y(If)h(the)g(Mo)s(di\014ed)g | |
37c41ab1 | 20857 | (V)-8 b(ersion)34 b(includes)f(new)g(fron)m(t-matter)i(sections)f(or)f |
1231ac47 | 20858 | (app)s(endices)g(that)h(qualify)330 5230 y(as)28 b(Secondary)g |
37c41ab1 | 20859 | (Sections)g(and)f(con)m(tain)j(no)d(material)j(copied)e(from)f(the)h |
1231ac47 | 20860 | (Do)s(cumen)m(t,)i(y)m(ou)e(ma)m(y)g(at)330 5340 y(y)m(our)k(option)h |
c2a47ea9 | 20861 | (designate)h(some)e(or)h(all)g(of)f(these)h(sections)h(as)e(in)m(v)-5 |
1231ac47 | 20862 | b(arian)m(t.)48 b(T)-8 b(o)33 b(do)f(this,)h(add)f(their)p |
c2a47ea9 | 20863 | eop end |
5e6f45d9 CR |
20864 | %%Page: 177 183 |
20865 | TeXDict begin 177 182 bop 150 -116 a Fu(App)s(endix)29 | |
c2a47ea9 | 20866 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 20867 | b(177)330 299 y(titles)37 b(to)f(the)f(list)h(of)g(In)m(v)-5 |
1231ac47 CR |
20868 | b(arian)m(t)36 b(Sections)g(in)f(the)h(Mo)s(di\014ed)f(V)-8 |
20869 | b(ersion's)36 b(license)g(notice.)57 b(These)330 408 | |
20870 | y(titles)32 b(m)m(ust)e(b)s(e)g(distinct)h(from)e(an)m(y)i(other)g | |
20871 | (section)g(titles.)330 551 y(Y)-8 b(ou)43 b(ma)m(y)g(add)f(a)g(section) | |
20872 | i(En)m(titled)f(\\Endorsemen)m(ts",)j(pro)m(vided)c(it)h(con)m(tains)g | |
20873 | (nothing)g(but)330 661 y(endorsemen)m(ts)30 b(of)g(y)m(our)f(Mo)s | |
37c41ab1 | 20874 | (di\014ed)g(V)-8 b(ersion)31 b(b)m(y)e(v)-5 b(arious)30 |
1231ac47 | 20875 | b(parties|for)g(example,)g(statemen)m(ts)i(of)330 770 |
37c41ab1 CR |
20876 | y(p)s(eer)27 b(review)g(or)g(that)h(the)f(text)i(has)d(b)s(een)h(appro) |
20877 | m(v)m(ed)g(b)m(y)g(an)h(organization)h(as)e(the)h(authoritativ)m(e)330 | |
1231ac47 | 20878 | 880 y(de\014nition)i(of)h(a)f(standard.)330 1022 y(Y)-8 |
37c41ab1 CR |
20879 | b(ou)29 b(ma)m(y)g(add)e(a)i(passage)g(of)g(up)e(to)i(\014v)m(e)g(w)m |
20880 | (ords)e(as)i(a)g(F)-8 b(ron)m(t-Co)m(v)m(er)30 b(T)-8 | |
1231ac47 | 20881 | b(ext,)30 b(and)e(a)g(passage)i(of)e(up)330 1132 y(to)g(25)g(w)m(ords)e |
37c41ab1 CR |
20882 | (as)i(a)f(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext,)29 b(to)f(the)f(end)f(of)i |
20883 | (the)f(list)h(of)f(Co)m(v)m(er)h(T)-8 b(exts)27 b(in)g(the)h(Mo)s | |
1231ac47 | 20884 | (di\014ed)330 1241 y(V)-8 b(ersion.)58 b(Only)35 b(one)h(passage)h(of)f |
37c41ab1 | 20885 | (F)-8 b(ron)m(t-Co)m(v)m(er)38 b(T)-8 b(ext)36 b(and)g(one)g(of)g(Bac)m |
1231ac47 | 20886 | (k-Co)m(v)m(er)j(T)-8 b(ext)36 b(ma)m(y)h(b)s(e)330 1351 |
37c41ab1 CR |
20887 | y(added)27 b(b)m(y)g(\(or)h(through)f(arrangemen)m(ts)h(made)g(b)m(y\)) |
20888 | g(an)m(y)g(one)f(en)m(tit)m(y)-8 b(.)42 b(If)27 b(the)h(Do)s(cumen)m(t) | |
1231ac47 | 20889 | g(already)330 1461 y(includes)34 b(a)g(co)m(v)m(er)h(text)g(for)f(the)g |
37c41ab1 | 20890 | (same)h(co)m(v)m(er,)h(previously)e(added)f(b)m(y)h(y)m(ou)g(or)g(b)m |
1231ac47 | 20891 | (y)g(arrangemen)m(t)330 1570 y(made)h(b)m(y)g(the)h(same)f(en)m(tit)m |
37c41ab1 | 20892 | (y)i(y)m(ou)f(are)f(acting)i(on)e(b)s(ehalf)f(of,)j(y)m(ou)f(ma)m(y)g |
1231ac47 | 20893 | (not)f(add)g(another;)j(but)330 1680 y(y)m(ou)c(ma)m(y)h(replace)g(the) |
37c41ab1 | 20894 | f(old)g(one,)i(on)e(explicit)h(p)s(ermission)e(from)g(the)i(previous)e |
1231ac47 CR |
20895 | (publisher)f(that)330 1789 y(added)e(the)g(old)h(one.)330 |
20896 | 1932 y(The)25 b(author\(s\))h(and)f(publisher\(s\))f(of)i(the)f(Do)s | |
37c41ab1 | 20897 | (cumen)m(t)h(do)g(not)f(b)m(y)h(this)f(License)h(giv)m(e)h(p)s |
1231ac47 | 20898 | (ermission)330 2041 y(to)k(use)f(their)g(names)h(for)f(publicit)m(y)g |
37c41ab1 | 20899 | (for)h(or)f(to)h(assert)g(or)f(imply)g(endorsemen)m(t)g(of)h(an)m(y)g |
1231ac47 CR |
20900 | (Mo)s(di\014ed)330 2151 y(V)-8 b(ersion.)199 2293 y(5.)61 |
20901 | b(COMBINING)31 b(DOCUMENTS)330 2436 y(Y)-8 b(ou)39 b(ma)m(y)g(com)m | |
37c41ab1 | 20902 | (bine)h(the)f(Do)s(cumen)m(t)g(with)g(other)f(do)s(cumen)m(ts)h |
1231ac47 | 20903 | (released)g(under)f(this)g(License,)330 2545 y(under)f(the)h(terms)g |
37c41ab1 | 20904 | (de\014ned)f(in)h(section)h(4)g(ab)s(o)m(v)m(e)g(for)f(mo)s(di\014ed)f |
1231ac47 | 20905 | (v)m(ersions,)k(pro)m(vided)d(that)h(y)m(ou)330 2655 |
37c41ab1 CR |
20906 | y(include)25 b(in)g(the)g(com)m(bination)i(all)f(of)g(the)f(In)m(v)-5 |
20907 | b(arian)m(t)26 b(Sections)g(of)g(all)g(of)f(the)h(original)g(do)s | |
1231ac47 | 20908 | (cumen)m(ts,)330 2765 y(unmo)s(di\014ed,)g(and)g(list)h(them)g(all)g |
37c41ab1 | 20909 | (as)g(In)m(v)-5 b(arian)m(t)28 b(Sections)f(of)g(y)m(our)g(com)m(bined) |
1231ac47 | 20910 | g(w)m(ork)f(in)h(its)g(license)330 2874 y(notice,)32 |
37c41ab1 | 20911 | b(and)e(that)h(y)m(ou)f(preserv)m(e)h(all)g(their)g(W)-8 |
1231ac47 | 20912 | b(arran)m(t)m(y)32 b(Disclaimers.)330 3017 y(The)e(com)m(bined)g(w)m |
37c41ab1 | 20913 | (ork)h(need)e(only)i(con)m(tain)g(one)g(cop)m(y)g(of)f(this)g(License,) |
1231ac47 | 20914 | i(and)d(m)m(ultiple)i(iden)m(tical)330 3126 y(In)m(v)-5 |
37c41ab1 CR |
20915 | b(arian)m(t)33 b(Sections)g(ma)m(y)g(b)s(e)f(replaced)h(with)f(a)h |
20916 | (single)g(cop)m(y)-8 b(.)48 b(If)32 b(there)h(are)g(m)m(ultiple)g(In)m | |
1231ac47 | 20917 | (v)-5 b(arian)m(t)330 3236 y(Sections)27 b(with)g(the)g(same)g(name)g |
37c41ab1 | 20918 | (but)f(di\013eren)m(t)h(con)m(ten)m(ts,)i(mak)m(e)f(the)f(title)h(of)f |
1231ac47 | 20919 | (eac)m(h)h(suc)m(h)f(section)330 3345 y(unique)33 b(b)m(y)h(adding)f |
37c41ab1 | 20920 | (at)i(the)f(end)g(of)g(it,)h(in)f(paren)m(theses,)i(the)e(name)g(of)g |
1231ac47 | 20921 | (the)g(original)h(author)f(or)330 3455 y(publisher)23 |
37c41ab1 | 20922 | b(of)i(that)h(section)g(if)f(kno)m(wn,)h(or)f(else)h(a)f(unique)f(n)m |
5e13499c | 20923 | (um)m(b)s(er.)38 b(Mak)m(e)26 b(the)g(same)f(adjustmen)m(t)330 |
1231ac47 | 20924 | 3565 y(to)g(the)g(section)g(titles)h(in)e(the)h(list)g(of)f(In)m(v)-5 |
37c41ab1 | 20925 | b(arian)m(t)26 b(Sections)f(in)f(the)g(license)i(notice)g(of)e(the)h |
1231ac47 | 20926 | (com)m(bined)330 3674 y(w)m(ork.)330 3817 y(In)41 b(the)g(com)m |
37c41ab1 CR |
20927 | (bination,)46 b(y)m(ou)41 b(m)m(ust)g(com)m(bine)h(an)m(y)g(sections)g |
20928 | (En)m(titled)g(\\History")h(in)e(the)g(v)-5 b(ari-)330 | |
1231ac47 | 20929 | 3926 y(ous)32 b(original)h(do)s(cumen)m(ts,)g(forming)f(one)g(section)h |
37c41ab1 | 20930 | (En)m(titled)g(\\History";)i(lik)m(ewise)f(com)m(bine)f(an)m(y)330 |
1231ac47 | 20931 | 4036 y(sections)g(En)m(titled)f(\\Ac)m(kno)m(wledgemen)m(ts",)k(and)31 |
37c41ab1 | 20932 | b(an)m(y)h(sections)h(En)m(titled)g(\\Dedications".)47 |
1231ac47 CR |
20933 | b(Y)-8 b(ou)330 4145 y(m)m(ust)30 b(delete)i(all)f(sections)h(En)m |
20934 | (titled)f(\\Endorsemen)m(ts.")199 4288 y(6.)61 b(COLLECTIONS)28 | |
20935 | b(OF)i(DOCUMENTS)330 4430 y(Y)-8 b(ou)32 b(ma)m(y)h(mak)m(e)g(a)f | |
37c41ab1 | 20936 | (collection)i(consisting)f(of)f(the)g(Do)s(cumen)m(t)g(and)g(other)g |
1231ac47 | 20937 | (do)s(cumen)m(ts)f(released)330 4540 y(under)41 b(this)h(License,)k |
37c41ab1 | 20938 | (and)c(replace)h(the)g(individual)f(copies)h(of)f(this)g(License)h(in)f |
1231ac47 | 20939 | (the)h(v)-5 b(arious)330 4650 y(do)s(cumen)m(ts)42 b(with)g(a)h(single) |
37c41ab1 | 20940 | g(cop)m(y)h(that)f(is)f(included)g(in)g(the)h(collection,)48 |
1231ac47 | 20941 | b(pro)m(vided)42 b(that)i(y)m(ou)330 4759 y(follo)m(w)38 |
37c41ab1 CR |
20942 | b(the)g(rules)e(of)h(this)g(License)h(for)f(v)m(erbatim)h(cop)m(ying)g |
20943 | (of)f(eac)m(h)h(of)f(the)h(do)s(cumen)m(ts)e(in)h(all)330 | |
1231ac47 | 20944 | 4869 y(other)31 b(resp)s(ects.)330 5011 y(Y)-8 b(ou)32 |
37c41ab1 CR |
20945 | b(ma)m(y)g(extract)h(a)f(single)g(do)s(cumen)m(t)f(from)g(suc)m(h)g(a)h |
20946 | (collection,)i(and)d(distribute)g(it)h(individu-)330 | |
1231ac47 | 20947 | 5121 y(ally)k(under)d(this)i(License,)i(pro)m(vided)e(y)m(ou)g(insert)g |
37c41ab1 | 20948 | (a)g(cop)m(y)h(of)f(this)g(License)g(in)m(to)h(the)g(extracted)330 |
1231ac47 | 20949 | 5230 y(do)s(cumen)m(t,)d(and)f(follo)m(w)i(this)e(License)h(in)g(all)g |
37c41ab1 | 20950 | (other)g(resp)s(ects)f(regarding)h(v)m(erbatim)g(cop)m(ying)h(of)330 |
1231ac47 | 20951 | 5340 y(that)d(do)s(cumen)m(t.)p eop end |
5e6f45d9 CR |
20952 | %%Page: 178 184 |
20953 | TeXDict begin 178 183 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 20954 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 20955 | b(178)199 299 y(7.)61 b(A)m(GGREGA)-8 b(TION)32 b(WITH)e(INDEPENDENT)h |
ad4aef08 CR |
20956 | (W)m(ORKS)330 441 y(A)d(compilation)i(of)e(the)g(Do)s(cumen)m(t)h(or)f |
20957 | (its)g(deriv)-5 b(ativ)m(es)30 b(with)d(other)i(separate)g(and)e(indep) | |
20958 | s(enden)m(t)330 551 y(do)s(cumen)m(ts)33 b(or)g(w)m(orks,)h(in)f(or)h | |
20959 | (on)f(a)g(v)m(olume)h(of)g(a)f(storage)i(or)e(distribution)g(medium,)g | |
20960 | (is)h(called)330 661 y(an)c(\\aggregate")k(if)c(the)g(cop)m(yrigh)m(t)i | |
20961 | (resulting)e(from)f(the)i(compilation)g(is)f(not)h(used)e(to)i(limit)g | |
20962 | (the)330 770 y(legal)d(righ)m(ts)f(of)g(the)g(compilation's)h(users)e | |
20963 | (b)s(ey)m(ond)g(what)g(the)h(individual)f(w)m(orks)g(p)s(ermit.)39 | |
1231ac47 CR |
20964 | b(When)330 880 y(the)g(Do)s(cumen)m(t)g(is)f(included)g(in)g(an)g |
20965 | (aggregate,)44 b(this)38 b(License)h(do)s(es)f(not)h(apply)f(to)h(the)g | |
20966 | (other)330 989 y(w)m(orks)30 b(in)g(the)h(aggregate)i(whic)m(h)d(are)h | |
20967 | (not)g(themselv)m(es)g(deriv)-5 b(ativ)m(e)32 b(w)m(orks)f(of)f(the)h | |
20968 | (Do)s(cumen)m(t.)330 1132 y(If)22 b(the)h(Co)m(v)m(er)h(T)-8 | |
20969 | b(ext)23 b(requiremen)m(t)g(of)g(section)h(3)f(is)g(applicable)h(to)f | |
20970 | (these)h(copies)f(of)g(the)g(Do)s(cumen)m(t,)330 1241 | |
20971 | y(then)f(if)g(the)h(Do)s(cumen)m(t)g(is)g(less)f(than)g(one)h(half)f | |
20972 | (of)h(the)g(en)m(tire)g(aggregate,)k(the)c(Do)s(cumen)m(t's)g(Co)m(v)m | |
20973 | (er)330 1351 y(T)-8 b(exts)27 b(ma)m(y)g(b)s(e)f(placed)h(on)g(co)m(v)m | |
20974 | (ers)h(that)f(brac)m(k)m(et)h(the)f(Do)s(cumen)m(t)g(within)f(the)h | |
20975 | (aggregate,)j(or)d(the)330 1461 y(electronic)37 b(equiv)-5 | |
20976 | b(alen)m(t)36 b(of)g(co)m(v)m(ers)g(if)f(the)g(Do)s(cumen)m(t)h(is)f | |
20977 | (in)g(electronic)i(form.)54 b(Otherwise)35 b(they)330 | |
20978 | 1570 y(m)m(ust)30 b(app)s(ear)g(on)g(prin)m(ted)g(co)m(v)m(ers)i(that)f | |
20979 | (brac)m(k)m(et)h(the)f(whole)f(aggregate.)199 1713 y(8.)61 | |
20980 | b(TRANSLA)-8 b(TION)330 1855 y(T)g(ranslation)41 b(is)f(considered)f(a) | |
37c41ab1 | 20981 | i(kind)e(of)h(mo)s(di\014cation,)j(so)d(y)m(ou)g(ma)m(y)h(distribute)e |
1231ac47 | 20982 | (translations)330 1965 y(of)45 b(the)f(Do)s(cumen)m(t)h(under)e(the)h |
37c41ab1 | 20983 | (terms)h(of)f(section)i(4.)83 b(Replacing)45 b(In)m(v)-5 |
1231ac47 | 20984 | b(arian)m(t)45 b(Sections)g(with)330 2074 y(translations)h(requires)f |
37c41ab1 | 20985 | (sp)s(ecial)h(p)s(ermission)f(from)g(their)g(cop)m(yrigh)m(t)i |
1231ac47 | 20986 | (holders,)i(but)c(y)m(ou)g(ma)m(y)330 2184 y(include)24 |
37c41ab1 CR |
20987 | b(translations)i(of)e(some)h(or)g(all)g(In)m(v)-5 b(arian)m(t)25 |
20988 | b(Sections)g(in)f(addition)h(to)g(the)g(original)h(v)m(ersions)330 | |
1231ac47 | 20989 | 2293 y(of)32 b(these)f(In)m(v)-5 b(arian)m(t)33 b(Sections.)44 |
37c41ab1 | 20990 | b(Y)-8 b(ou)32 b(ma)m(y)g(include)f(a)h(translation)g(of)g(this)f |
1231ac47 | 20991 | (License,)i(and)d(all)j(the)330 2403 y(license)42 b(notices)g(in)f(the) |
37c41ab1 | 20992 | h(Do)s(cumen)m(t,)j(and)40 b(an)m(y)i(W)-8 b(arran)m(t)m(y)42 |
1231ac47 | 20993 | b(Disclaimers,)k(pro)m(vided)41 b(that)h(y)m(ou)330 2513 |
37c41ab1 CR |
20994 | y(also)f(include)f(the)g(original)h(English)f(v)m(ersion)g(of)g(this)g |
20995 | (License)h(and)e(the)h(original)h(v)m(ersions)g(of)330 | |
1231ac47 | 20996 | 2622 y(those)35 b(notices)g(and)e(disclaimers.)53 b(In)33 |
37c41ab1 | 20997 | b(case)i(of)g(a)f(disagreemen)m(t)h(b)s(et)m(w)m(een)g(the)f |
1231ac47 | 20998 | (translation)i(and)330 2732 y(the)f(original)i(v)m(ersion)e(of)h(this)f |
37c41ab1 | 20999 | (License)h(or)f(a)g(notice)i(or)e(disclaimer,)i(the)f(original)g(v)m |
1231ac47 | 21000 | (ersion)g(will)330 2841 y(prev)-5 b(ail.)330 2984 y(If)28 |
37c41ab1 CR |
21001 | b(a)h(section)h(in)e(the)h(Do)s(cumen)m(t)h(is)e(En)m(titled)i(\\Ac)m |
21002 | (kno)m(wledgemen)m(ts",)i(\\Dedications",)g(or)d(\\His-)330 | |
1231ac47 | 21003 | 3093 y(tory",)f(the)f(requiremen)m(t)f(\(section)i(4\))f(to)g(Preserv)m |
37c41ab1 | 21004 | (e)g(its)f(Title)i(\(section)f(1\))g(will)g(t)m(ypically)h(require)330 |
1231ac47 CR |
21005 | 3203 y(c)m(hanging)j(the)g(actual)h(title.)199 3345 y(9.)61 |
21006 | b(TERMINA)-8 b(TION)330 3488 y(Y)g(ou)30 b(ma)m(y)h(not)f(cop)m(y)-8 | |
37c41ab1 | 21007 | b(,)31 b(mo)s(dify)-8 b(,)30 b(sublicense,)g(or)g(distribute)f(the)h |
1231ac47 CR |
21008 | (Do)s(cumen)m(t)g(except)h(as)f(expressly)330 3598 y(pro)m(vided)38 |
21009 | b(under)f(this)i(License.)65 b(An)m(y)39 b(attempt)h(otherwise)f(to)g | |
21010 | (cop)m(y)-8 b(,)42 b(mo)s(dify)-8 b(,)40 b(sublicense,)h(or)330 | |
21011 | 3707 y(distribute)30 b(it)h(is)f(v)m(oid,)h(and)f(will)h(automatically) | |
21012 | i(terminate)f(y)m(our)e(righ)m(ts)h(under)e(this)h(License.)330 | |
21013 | 3850 y(Ho)m(w)m(ev)m(er,)35 b(if)e(y)m(ou)f(cease)i(all)f(violation)i | |
21014 | (of)d(this)g(License,)i(then)e(y)m(our)h(license)g(from)f(a)h | |
21015 | (particular)330 3959 y(cop)m(yrigh)m(t)k(holder)e(is)h(reinstated)h | |
21016 | (\(a\))f(pro)m(visionally)-8 b(,)39 b(unless)c(and)g(un)m(til)h(the)g | |
21017 | (cop)m(yrigh)m(t)h(holder)330 4069 y(explicitly)42 b(and)e(\014nally)h | |
21018 | (terminates)g(y)m(our)g(license,)j(and)c(\(b\))h(p)s(ermanen)m(tly)-8 | |
21019 | b(,)43 b(if)e(the)g(cop)m(yrigh)m(t)330 4178 y(holder)34 | |
21020 | b(fails)h(to)g(notify)g(y)m(ou)g(of)f(the)h(violation)h(b)m(y)e(some)h | |
21021 | (reasonable)g(means)g(prior)e(to)i(60)h(da)m(ys)330 4288 | |
21022 | y(after)31 b(the)f(cessation.)330 4430 y(Moreo)m(v)m(er,)k(y)m(our)d | |
21023 | (license)i(from)e(a)h(particular)f(cop)m(yrigh)m(t)i(holder)e(is)h | |
21024 | (reinstated)g(p)s(ermanen)m(tly)f(if)330 4540 y(the)d(cop)m(yrigh)m(t)h | |
21025 | (holder)f(noti\014es)g(y)m(ou)g(of)g(the)g(violation)h(b)m(y)f(some)g | |
21026 | (reasonable)h(means,)f(this)g(is)g(the)330 4650 y(\014rst)f(time)i(y)m | |
21027 | (ou)f(ha)m(v)m(e)h(receiv)m(ed)g(notice)g(of)f(violation)i(of)e(this)f | |
21028 | (License)i(\(for)f(an)m(y)g(w)m(ork\))g(from)f(that)330 | |
21029 | 4759 y(cop)m(yrigh)m(t)33 b(holder,)g(and)e(y)m(ou)h(cure)g(the)g | |
21030 | (violation)i(prior)d(to)i(30)f(da)m(ys)h(after)f(y)m(our)g(receipt)h | |
21031 | (of)f(the)330 4869 y(notice.)330 5011 y(T)-8 b(ermination)28 | |
21032 | b(of)g(y)m(our)f(righ)m(ts)h(under)e(this)i(section)g(do)s(es)f(not)h | |
21033 | (terminate)h(the)e(licenses)i(of)f(parties)330 5121 y(who)38 | |
21034 | b(ha)m(v)m(e)h(receiv)m(ed)h(copies)e(or)h(righ)m(ts)f(from)g(y)m(ou)g | |
21035 | (under)f(this)h(License.)64 b(If)38 b(y)m(our)g(righ)m(ts)h(ha)m(v)m(e) | |
21036 | 330 5230 y(b)s(een)25 b(terminated)i(and)e(not)h(p)s(ermanen)m(tly)g | |
21037 | (reinstated,)i(receipt)f(of)f(a)g(cop)m(y)h(of)f(some)h(or)f(all)h(of)f | |
21038 | (the)330 5340 y(same)31 b(material)h(do)s(es)e(not)g(giv)m(e)i(y)m(ou)f | |
21039 | (an)m(y)g(righ)m(ts)f(to)i(use)e(it.)p eop end | |
5e6f45d9 CR |
21040 | %%Page: 179 185 |
21041 | TeXDict begin 179 184 bop 150 -116 a Fu(App)s(endix)29 | |
1231ac47 | 21042 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 21043 | b(179)154 299 y(10.)61 b(FUTURE)30 b(REVISIONS)f(OF)i(THIS)e(LICENSE) |
1231ac47 CR |
21044 | 330 433 y(The)41 b(F)-8 b(ree)43 b(Soft)m(w)m(are)f(F)-8 |
21045 | b(oundation)43 b(ma)m(y)f(publish)e(new,)k(revised)d(v)m(ersions)h(of)g | |
21046 | (the)g(GNU)g(F)-8 b(ree)330 543 y(Do)s(cumen)m(tation)34 | |
21047 | b(License)e(from)g(time)h(to)g(time.)46 b(Suc)m(h)31 | |
21048 | b(new)h(v)m(ersions)g(will)h(b)s(e)e(similar)h(in)g(spirit)330 | |
21049 | 653 y(to)j(the)g(presen)m(t)f(v)m(ersion,)i(but)e(ma)m(y)h(di\013er)f | |
21050 | (in)g(detail)h(to)g(address)f(new)g(problems)f(or)i(concerns.)330 | |
6e51e0d0 | 21051 | 762 y(See)c Ft(http://www.gnu.org/copy)o(left)o(/)p Fu(.)330 |
1231ac47 CR |
21052 | 897 y(Eac)m(h)f(v)m(ersion)g(of)g(the)f(License)h(is)g(giv)m(en)g(a)g |
21053 | (distinguishing)f(v)m(ersion)h(n)m(um)m(b)s(er.)39 b(If)29 | |
21054 | b(the)g(Do)s(cumen)m(t)330 1006 y(sp)s(eci\014es)45 b(that)h(a)g | |
21055 | (particular)f(n)m(um)m(b)s(ered)f(v)m(ersion)i(of)f(this)g(License)h | |
21056 | (\\or)g(an)m(y)g(later)g(v)m(ersion")330 1116 y(applies)33 | |
21057 | b(to)g(it,)h(y)m(ou)e(ha)m(v)m(e)i(the)f(option)g(of)f(follo)m(wing)i | |
21058 | (the)f(terms)f(and)g(conditions)h(either)g(of)f(that)330 | |
21059 | 1225 y(sp)s(eci\014ed)37 b(v)m(ersion)i(or)e(of)h(an)m(y)h(later)g(v)m | |
37c41ab1 | 21060 | (ersion)f(that)g(has)g(b)s(een)f(published)f(\(not)j(as)f(a)g(draft\))g |
1231ac47 | 21061 | (b)m(y)330 1335 y(the)33 b(F)-8 b(ree)34 b(Soft)m(w)m(are)f(F)-8 |
37c41ab1 | 21062 | b(oundation.)49 b(If)32 b(the)h(Do)s(cumen)m(t)g(do)s(es)g(not)g(sp)s |
1231ac47 | 21063 | (ecify)f(a)h(v)m(ersion)g(n)m(um)m(b)s(er)f(of)330 1445 |
37c41ab1 CR |
21064 | y(this)i(License,)j(y)m(ou)d(ma)m(y)i(c)m(ho)s(ose)f(an)m(y)g(v)m |
21065 | (ersion)g(ev)m(er)g(published)e(\(not)i(as)g(a)f(draft\))h(b)m(y)f(the) | |
1231ac47 CR |
21066 | h(F)-8 b(ree)330 1554 y(Soft)m(w)m(are)33 b(F)-8 b(oundation.)46 |
21067 | b(If)32 b(the)g(Do)s(cumen)m(t)g(sp)s(eci\014es)g(that)g(a)h(pro)m(xy)f | |
21068 | (can)g(decide)g(whic)m(h)g(future)330 1664 y(v)m(ersions)h(of)g(this)f | |
21069 | (License)h(can)g(b)s(e)f(used,)g(that)i(pro)m(xy's)e(public)g(statemen) | |
21070 | m(t)i(of)f(acceptance)i(of)e(a)330 1773 y(v)m(ersion)e(p)s(ermanen)m | |
21071 | (tly)f(authorizes)h(y)m(ou)g(to)g(c)m(ho)s(ose)g(that)g(v)m(ersion)g | |
21072 | (for)f(the)h(Do)s(cumen)m(t.)154 1908 y(11.)61 b(RELICENSING)330 | |
21073 | 2042 y(\\Massiv)m(e)39 b(Multiauthor)f(Collab)s(oration)g(Site")h(\(or) | |
21074 | e(\\MMC)h(Site"\))h(means)e(an)m(y)h(W)-8 b(orld)37 b(Wide)330 | |
21075 | 2152 y(W)-8 b(eb)36 b(serv)m(er)g(that)h(publishes)d(cop)m(yrigh)m | |
21076 | (table)k(w)m(orks)e(and)f(also)i(pro)m(vides)e(prominen)m(t)h | |
21077 | (facilities)330 2262 y(for)27 b(an)m(yb)s(o)s(dy)g(to)h(edit)g(those)g | |
21078 | (w)m(orks.)39 b(A)28 b(public)f(wiki)h(that)g(an)m(yb)s(o)s(dy)e(can)i | |
21079 | (edit)g(is)f(an)h(example)g(of)330 2371 y(suc)m(h)33 | |
21080 | b(a)h(serv)m(er.)51 b(A)34 b(\\Massiv)m(e)i(Multiauthor)e(Collab)s | |
21081 | (oration")h(\(or)f(\\MMC"\))h(con)m(tained)g(in)f(the)330 | |
21082 | 2481 y(site)d(means)f(an)m(y)h(set)g(of)g(cop)m(yrigh)m(table)h(w)m | |
21083 | (orks)e(th)m(us)g(published)f(on)h(the)h(MMC)f(site.)330 | |
21084 | 2615 y(\\CC-BY-SA")36 b(means)f(the)g(Creativ)m(e)i(Commons)e(A)m | |
21085 | (ttribution-Share)g(Alik)m(e)i(3.0)f(license)g(pub-)330 | |
21086 | 2725 y(lished)27 b(b)m(y)f(Creativ)m(e)j(Commons)d(Corp)s(oration,)h(a) | |
21087 | g(not-for-pro\014t)g(corp)s(oration)h(with)e(a)h(principal)330 | |
21088 | 2834 y(place)g(of)f(business)e(in)i(San)f(F)-8 b(rancisco,)29 | |
21089 | b(California,)f(as)e(w)m(ell)h(as)f(future)f(cop)m(yleft)i(v)m(ersions) | |
21090 | f(of)g(that)330 2944 y(license)31 b(published)e(b)m(y)h(that)h(same)g | |
21091 | (organization.)330 3078 y(\\Incorp)s(orate")h(means)e(to)h(publish)e | |
21092 | (or)i(republish)e(a)i(Do)s(cumen)m(t,)g(in)g(whole)g(or)f(in)g(part,)h | |
21093 | (as)g(part)330 3188 y(of)g(another)f(Do)s(cumen)m(t.)330 | |
21094 | 3323 y(An)c(MMC)g(is)h(\\eligible)h(for)e(relicensing")h(if)g(it)f(is)h | |
21095 | (licensed)f(under)f(this)h(License,)i(and)e(if)g(all)h(w)m(orks)330 | |
21096 | 3432 y(that)43 b(w)m(ere)f(\014rst)f(published)f(under)h(this)h | |
21097 | (License)g(somewhere)g(other)g(than)g(this)g(MMC,)h(and)330 | |
21098 | 3542 y(subsequen)m(tly)34 b(incorp)s(orated)h(in)f(whole)h(or)g(in)f | |
21099 | (part)h(in)m(to)h(the)f(MMC,)g(\(1\))h(had)e(no)h(co)m(v)m(er)h(texts) | |
21100 | 330 3651 y(or)30 b(in)m(v)-5 b(arian)m(t)32 b(sections,)g(and)d(\(2\))j | |
21101 | (w)m(ere)f(th)m(us)f(incorp)s(orated)g(prior)g(to)h(No)m(v)m(em)m(b)s | |
21102 | (er)g(1,)g(2008.)330 3786 y(The)40 b(op)s(erator)h(of)g(an)f(MMC)h | |
21103 | (Site)g(ma)m(y)g(republish)e(an)h(MMC)h(con)m(tained)h(in)e(the)h(site) | |
21104 | g(under)330 3895 y(CC-BY-SA)30 b(on)g(the)h(same)f(site)h(at)g(an)m(y)g | |
21105 | (time)g(b)s(efore)e(August)h(1,)h(2009,)h(pro)m(vided)e(the)g(MMC)h(is) | |
21106 | 330 4005 y(eligible)h(for)e(relicensing.)p eop end | |
5e6f45d9 CR |
21107 | %%Page: 180 186 |
21108 | TeXDict begin 180 185 bop 150 -116 a Fu(App)s(endix)29 | |
ad4aef08 | 21109 | b(C:)h(GNU)h(F)-8 b(ree)31 b(Do)s(cumen)m(tation)i(License)1560 |
5e6f45d9 | 21110 | b(180)150 299 y Fs(ADDENDUM:)45 b(Ho)l(w)h(to)f(use)g(this)h(License)f |
6e51e0d0 | 21111 | (for)g(y)l(our)g(do)t(cumen)l(ts)150 458 y Fu(T)-8 b(o)35 |
ad4aef08 CR |
21112 | b(use)f(this)h(License)g(in)f(a)h(do)s(cumen)m(t)g(y)m(ou)f(ha)m(v)m(e) |
21113 | i(written,)g(include)f(a)f(cop)m(y)i(of)f(the)f(License)h(in)g(the)150 | |
21114 | 568 y(do)s(cumen)m(t)30 b(and)g(put)g(the)g(follo)m(wing)i(cop)m(yrigh) | |
21115 | m(t)g(and)e(license)h(notices)g(just)f(after)h(the)g(title)h(page:)468 | |
6e51e0d0 CR |
21116 | 680 y Fe(Copyright)42 b(\(C\))79 b Fd(year)g(your)40 |
21117 | b(name)p Fe(.)468 767 y(Permission)i(is)e(granted)g(to)g(copy,)h | |
ad4aef08 CR |
21118 | (distribute)g(and/or)g(modify)f(this)g(document)468 854 |
21119 | y(under)h(the)f(terms)g(of)g(the)g(GNU)g(Free)g(Documentation)i | |
21120 | (License,)f(Version)g(1.3)468 941 y(or)f(any)g(later)g(version)h | |
21121 | (published)h(by)d(the)h(Free)g(Software)h(Foundation;)468 | |
21122 | 1029 y(with)g(no)e(Invariant)j(Sections,)f(no)f(Front-Cover)h(Texts,)g | |
21123 | (and)f(no)f(Back-Cover)468 1116 y(Texts.)80 b(A)40 b(copy)g(of)g(the)f | |
21124 | (license)i(is)f(included)h(in)f(the)g(section)g(entitled)h(``GNU)468 | |
6e51e0d0 | 21125 | 1203 y(Free)g(Documentation)h(License''.)275 1337 y Fu(If)d(y)m(ou)h |
ad4aef08 CR |
21126 | (ha)m(v)m(e)h(In)m(v)-5 b(arian)m(t)41 b(Sections,)i(F)-8 |
21127 | b(ron)m(t-Co)m(v)m(er)42 b(T)-8 b(exts)41 b(and)e(Bac)m(k-Co)m(v)m(er)k | |
21128 | (T)-8 b(exts,)43 b(replace)e(the)150 1447 y(\\with)6 | |
21129 | b(.)22 b(.)g(.)12 b(T)-8 b(exts.")41 b(line)31 b(with)f(this:)547 | |
21130 | 1559 y Fe(with)40 b(the)g(Invariant)h(Sections)g(being)g | |
6e51e0d0 CR |
21131 | Fd(list)f(their)g(titles)p Fe(,)h(with)547 1646 y(the)f(Front-Cover)i |
21132 | (Texts)e(being)g Fd(list)p Fe(,)h(and)f(with)g(the)g(Back-Cover)h | |
21133 | (Texts)547 1733 y(being)f Fd(list)p Fe(.)275 1868 y Fu(If)34 | |
21134 | b(y)m(ou)i(ha)m(v)m(e)g(In)m(v)-5 b(arian)m(t)36 b(Sections)g(without)f | |
21135 | (Co)m(v)m(er)h(T)-8 b(exts,)38 b(or)d(some)g(other)h(com)m(bination)g | |
21136 | (of)g(the)150 1978 y(three,)31 b(merge)g(those)g(t)m(w)m(o)g | |
21137 | (alternativ)m(es)i(to)e(suit)f(the)h(situation.)275 2112 | |
21138 | y(If)23 b(y)m(our)h(do)s(cumen)m(t)f(con)m(tains)i(non)m(trivial)g | |
21139 | (examples)g(of)f(program)f(co)s(de,)j(w)m(e)e(recommend)g(releasing)150 | |
21140 | 2222 y(these)44 b(examples)f(in)g(parallel)h(under)e(y)m(our)h(c)m | |
21141 | (hoice)i(of)e(free)g(soft)m(w)m(are)h(license,)k(suc)m(h)43 | |
21142 | b(as)g(the)g(GNU)150 2331 y(General)31 b(Public)f(License,)i(to)f(p)s | |
21143 | (ermit)e(their)i(use)f(in)g(free)g(soft)m(w)m(are.)p | |
21144 | eop end | |
5e6f45d9 CR |
21145 | %%Page: 181 187 |
21146 | TeXDict begin 181 186 bop 3614 -116 a Fu(181)150 299 | |
037a8b7f CR |
21147 | y Fp(App)t(endix)52 b(D)81 b(Indexes)150 639 y Fs(D.1)68 |
21148 | b(Index)45 b(of)g(Shell)g(Builtin)g(Commands)146 806 | |
21149 | y(.)150 923 y Fe(.)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
21150 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
21151 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
e59452c7 | 21152 | (:)33 b Fb(47)146 1163 y Fs(:)150 1280 y Fe(:)19 b Fc(:)13 |
037a8b7f CR |
21153 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21154 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
e59452c7 | 21155 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(47)146 |
037a8b7f CR |
21156 | 1523 y Fs([)150 1640 y Fe([)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21157 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
21158 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
e59452c7 | 21159 | (:)g(:)g(:)33 b Fb(51)146 1881 y Fs(A)150 1998 y Fe(alias)9 |
037a8b7f | 21160 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c | 21161 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 | 21162 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(54)146 2239 y |
037a8b7f | 21163 | Fs(B)150 2356 y Fe(bg)14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c | 21164 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f | 21165 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)29 |
fffe80d4 | 21166 | b Fb(113)150 2443 y Fe(bind)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
21167 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21168 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21169 | b Fb(55)150 2531 y Fe(break)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c | 21170 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f | 21171 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 |
e59452c7 | 21172 | b Fb(48)150 2618 y Fe(builtin)f Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
c302751c | 21173 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21174 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 |
e59452c7 | 21175 | b Fb(56)146 2859 y Fs(C)150 2976 y Fe(caller)6 b Fc(:)15 |
037a8b7f CR |
21176 | b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21177 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21178 | g(:)g(:)g(:)h(:)f(:)20 b Fb(56)150 3063 y Fe(cd)c Fc(:)e(:)f(:)g(:)g(:) |
037a8b7f CR |
21179 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21180 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
e59452c7 | 21181 | g(:)g(:)g(:)g(:)g(:)31 b Fb(48)150 3151 y Fe(command)22 |
037a8b7f CR |
21182 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21183 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21184 | h(:)f(:)g(:)g(:)g(:)35 b Fb(56)150 3238 y Fe(compgen)18 |
037a8b7f | 21185 | b Fc(:)d(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
c302751c | 21186 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21187 | (:)h(:)f(:)g(:)33 b Fb(145)150 3326 y Fe(complete)16 |
037a8b7f CR |
21188 | b Fc(:)f(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21189 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
fffe80d4 | 21190 | (:)g(:)g(:)31 b Fb(145)150 3413 y Fe(compopt)18 b Fc(:)d(:)e(:)g(:)h(:) |
c302751c | 21191 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
037a8b7f | 21192 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)33 |
fffe80d4 | 21193 | b Fb(148)150 3501 y Fe(continue)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g |
c302751c | 21194 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f | 21195 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b |
e59452c7 | 21196 | Fb(48)146 3741 y Fs(D)150 3858 y Fe(declare)22 b Fc(:)13 |
037a8b7f CR |
21197 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
21198 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 CR |
21199 | g(:)g(:)g(:)35 b Fb(57)150 3946 y Fe(dirs)9 b Fc(:)14 |
21200 | b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
21201 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
21202 | h(:)f(:)g(:)g(:)g(:)g(:)24 b Fb(101)150 4033 y Fe(disown)e | |
21203 | Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
21204 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
fffe80d4 | 21205 | g(:)g(:)g(:)g(:)g(:)36 b Fb(115)146 4274 y Fs(E)150 4391 |
e59452c7 CR |
21206 | y Fe(echo)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21207 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
21208 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b | |
21209 | Fb(58)150 4478 y Fe(enable)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
21210 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
21211 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 | |
21212 | b Fb(59)150 4566 y Fe(eval)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
21213 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
21214 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
21215 | b Fb(48)150 4653 y Fe(exec)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
037a8b7f CR |
21216 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21217 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21218 | b Fb(49)150 4741 y Fe(exit)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
21219 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21220 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21221 | b Fb(49)150 4828 y Fe(export)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g |
037a8b7f CR |
21222 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
21223 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 | |
e59452c7 | 21224 | b Fb(49)146 5080 y Fs(F)150 5197 y Fe(fc)14 b Fc(:)g(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
21225 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21226 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
fffe80d4 | 21227 | g(:)g(:)g(:)29 b Fb(152)150 5284 y Fe(fg)14 b Fc(:)g(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
21228 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21229 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
fffe80d4 | 21230 | g(:)g(:)g(:)29 b Fb(113)2021 871 y Fs(G)2025 988 y Fe(getopts)22 |
037a8b7f | 21231 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c | 21232 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21233 | g(:)g(:)h(:)f(:)g(:)35 b Fb(49)2021 1250 y Fs(H)2025 |
037a8b7f | 21234 | 1369 y Fe(hash)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
c302751c | 21235 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f | 21236 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 |
e59452c7 | 21237 | b Fb(50)2025 1457 y Fe(help)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c | 21238 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21239 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 |
e59452c7 | 21240 | b Fb(60)2025 1544 y Fe(history)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g |
d7935593 | 21241 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f | 21242 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b |
fffe80d4 | 21243 | Fb(152)2021 1806 y Fs(J)2025 1924 y Fe(jobs)9 b Fc(:)14 |
037a8b7f CR |
21244 | b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21245 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
fffe80d4 | 21246 | g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(113)2021 2186 y Fs(K)2025 |
037a8b7f CR |
21247 | 2303 y Fe(kill)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21248 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
21249 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 | |
fffe80d4 | 21250 | b Fb(114)2021 2554 y Fs(L)2025 2672 y Fe(let)14 b Fc(:)f(:)g(:)h(:)f(:) |
037a8b7f CR |
21251 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21252 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21253 | g(:)g(:)h(:)f(:)28 b Fb(60)2025 2760 y Fe(local)9 b Fc(:)14 |
037a8b7f CR |
21254 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21255 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 21256 | g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(60)2025 2848 y Fe(logout)6 |
037a8b7f CR |
21257 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21258 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21259 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(60)2021 3110 y Fs(M)2025 |
037a8b7f CR |
21260 | 3227 y Fe(mapfile)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21261 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
e59452c7 CR |
21262 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(60)2021 |
21263 | 3489 y Fs(P)2025 3608 y Fe(popd)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h | |
21264 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21265 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 | |
21266 | b Fb(102)2025 3696 y Fe(printf)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:) | |
21267 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
21268 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 | |
21269 | b Fb(61)2025 3784 y Fe(pushd)6 b Fc(:)14 b(:)g(:)f(:)g(:)g(:)g(:)g(:)g | |
21270 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
21271 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21 | |
21272 | b Fb(102)2025 3871 y Fe(pwd)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
037a8b7f CR |
21273 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
21274 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 | |
e59452c7 | 21275 | b Fb(50)2021 4133 y Fs(R)2025 4251 y Fe(read)11 b Fc(:)j(:)f(:)g(:)g(:) |
c302751c CR |
21276 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21277 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21278 | g(:)g(:)g(:)26 b Fb(62)2025 4339 y Fe(readarray)15 b |
037a8b7f CR |
21279 | Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
21280 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 | 21281 | g(:)g(:)30 b Fb(63)2025 4427 y Fe(readonly)18 b Fc(:)d(:)e(:)g(:)g(:)g |
037a8b7f CR |
21282 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21283 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
e59452c7 | 21284 | b Fb(51)2025 4515 y Fe(return)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
21285 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21286 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 | |
e59452c7 | 21287 | b Fb(51)2021 4765 y Fs(S)2025 4884 y Fe(set)14 b Fc(:)f(:)g(:)h(:)f(:)g |
037a8b7f CR |
21288 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
21289 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21290 | (:)g(:)h(:)f(:)28 b Fb(66)2025 4972 y Fe(shift)9 b Fc(:)14 |
037a8b7f CR |
21291 | b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21292 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 21293 | g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(51)2025 5060 y Fe(shopt)9 |
037a8b7f | 21294 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
c302751c | 21295 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
e59452c7 | 21296 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(70)2025 5148 |
037a8b7f CR |
21297 | y Fe(source)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21298 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21299 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(63)2025 |
037a8b7f CR |
21300 | 5235 y Fe(suspend)d Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21301 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
fffe80d4 | 21302 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)33 b Fb(115)p eop end |
5e6f45d9 CR |
21303 | %%Page: 182 188 |
21304 | TeXDict begin 182 187 bop 150 -116 a Fu(App)s(endix)29 | |
21305 | b(D:)i(Indexes)2623 b(182)146 294 y Fs(T)150 410 y Fe(test)11 | |
037a8b7f | 21306 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
6e51e0d0 | 21307 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
e59452c7 | 21308 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(51)150 497 |
037a8b7f CR |
21309 | y Fe(times)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
21310 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
e59452c7 | 21311 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(53)150 |
037a8b7f CR |
21312 | 584 y Fe(trap)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21313 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21314 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21315 | b Fb(53)150 671 y Fe(type)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
21316 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21317 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21318 | b Fb(63)150 758 y Fe(typeset)d Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f CR |
21319 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21320 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 | |
e59452c7 | 21321 | b Fb(64)146 1003 y Fs(U)150 1119 y Fe(ulimit)6 b Fc(:)15 |
037a8b7f CR |
21322 | b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21323 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21324 | g(:)g(:)g(:)h(:)f(:)20 b Fb(64)150 1206 y Fe(umask)9 |
037a8b7f CR |
21325 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21326 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 21327 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(54)150 1293 y |
037a8b7f CR |
21328 | Fe(unalias)f Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21329 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 21330 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(65)150 1380 y |
037a8b7f CR |
21331 | Fe(unset)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
21332 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 | 21333 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(54)2021 |
037a8b7f | 21334 | 294 y Fs(W)2025 433 y Fe(wait)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)h(:)f |
c302751c | 21335 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f | 21336 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 |
fffe80d4 | 21337 | b Fb(114)150 2133 y Fs(D.2)68 b(Index)45 b(of)g(Shell)g(Reserv)l(ed)h |
e59452c7 CR |
21338 | (W)-11 b(ords)146 2704 y(!)150 2820 y Fe(!)19 b Fc(:)13 |
21339 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
21340 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
21341 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(10)146 | |
0fcb3344 | 21342 | 3056 y Fs([)150 3172 y Fe([[)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:) |
037a8b7f CR |
21343 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21344 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21345 | g(:)31 b Fb(14)146 3414 y Fs(])150 3530 y Fe(]])16 b |
037a8b7f CR |
21346 | Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21347 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 21348 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 b Fb(14)146 |
0fcb3344 | 21349 | 3770 y Fa({)150 3886 y Fe({)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
c302751c | 21350 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21351 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
e59452c7 | 21352 | (:)g(:)g(:)33 b Fb(17)146 4125 y Fa(})150 4241 y Fe(})19 |
0fcb3344 CR |
21353 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21354 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
21355 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b | |
e59452c7 | 21356 | Fb(17)146 4475 y Fs(C)150 4591 y Fe(case)11 b Fc(:)j(:)f(:)g(:)h(:)f(:) |
0fcb3344 | 21357 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
6e51e0d0 | 21358 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21359 | g(:)h(:)25 b Fb(13)146 4825 y Fs(D)150 4941 y Fe(do)16 |
0fcb3344 CR |
21360 | b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21361 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
e59452c7 | 21362 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 b Fb(11)150 |
0fcb3344 CR |
21363 | 5028 y Fe(done)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21364 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21365 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21366 | b Fb(11)146 5261 y Fs(E)150 5377 y Fe(elif)11 b Fc(:)j(:)f(:)g(:)h(:)f |
0fcb3344 CR |
21367 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
21368 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
e59452c7 | 21369 | (:)g(:)h(:)25 b Fb(12)150 5465 y Fe(else)11 b Fc(:)j(:)f(:)g(:)h(:)f(:) |
037a8b7f | 21370 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
0fcb3344 | 21371 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21372 | g(:)h(:)25 b Fb(12)150 5552 y Fe(esac)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g |
0fcb3344 CR |
21373 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21374 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21375 | (:)h(:)25 b Fb(13)2021 2703 y Fs(F)2025 2836 y Fe(fi)16 |
0fcb3344 | 21376 | b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f | 21377 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
e59452c7 | 21378 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)31 b Fb(12)2025 |
0fcb3344 CR |
21379 | 2928 y Fe(for)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21380 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
21381 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 | |
e59452c7 | 21382 | b Fb(12)2025 3015 y Fe(function)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f |
0fcb3344 CR |
21383 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21384 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b | |
e59452c7 | 21385 | Fb(19)2021 3359 y Fs(I)2025 3491 y Fe(if)16 b Fc(:)e(:)f(:)g(:)g(:)g(:) |
0fcb3344 CR |
21386 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
21387 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 | 21388 | g(:)g(:)g(:)g(:)31 b Fb(12)2025 3578 y Fe(in)16 b Fc(:)e(:)f(:)g(:)g(:) |
0fcb3344 | 21389 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
6e51e0d0 | 21390 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 21391 | f(:)g(:)g(:)g(:)g(:)31 b Fb(13)2021 3921 y Fs(S)2025 |
0fcb3344 CR |
21392 | 4048 y Fe(select)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21393 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21394 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b | |
e59452c7 | 21395 | Fb(13)2021 4392 y Fs(T)2025 4524 y Fe(then)11 b Fc(:)j(:)f(:)g(:)g(:)g |
0fcb3344 CR |
21396 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
21397 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
e59452c7 CR |
21398 | (:)g(:)g(:)26 b Fb(12)2025 4611 y Fe(time)11 b Fc(:)j(:)f(:)g(:)g(:)g |
21399 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
21400 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
21401 | (:)g(:)g(:)26 b Fb(10)2021 4954 y Fs(U)2025 5081 y Fe(until)9 | |
21402 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
21403 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21404 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(11)2021 5425 | |
21405 | y Fs(W)2025 5552 y Fe(while)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
21406 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
21407 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 | |
21408 | b Fb(12)p eop end | |
5e6f45d9 CR |
21409 | %%Page: 183 189 |
21410 | TeXDict begin 183 188 bop 150 -116 a Fu(App)s(endix)29 | |
21411 | b(D:)i(Indexes)2623 b(183)150 299 y Fs(D.3)68 b(P)l(arameter)47 | |
0fcb3344 CR |
21412 | b(and)d(V)-11 b(ariable)46 b(Index)146 955 y(!)150 1073 |
21413 | y Fe(!)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
21414 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
21415 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 | |
e59452c7 | 21416 | b Fb(23)146 1327 y Fs(#)150 1445 y Fe(#)19 b Fc(:)13 |
037a8b7f CR |
21417 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21418 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
e59452c7 | 21419 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(23)146 |
0fcb3344 | 21420 | 1701 y Fs($)150 1820 y Fe($)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
c302751c | 21421 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
0fcb3344 | 21422 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
e59452c7 | 21423 | (:)g(:)g(:)33 b Fb(23)150 1909 y Fe($!)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
21424 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
21425 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
e59452c7 | 21426 | (:)g(:)g(:)g(:)31 b Fb(23)150 1997 y Fe($#)16 b Fc(:)e(:)f(:)g(:)g(:)g |
d7935593 | 21427 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
037a8b7f | 21428 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
e59452c7 | 21429 | (:)g(:)g(:)g(:)g(:)31 b Fb(23)150 2085 y Fe($$)16 b Fc(:)e(:)f(:)g(:)g |
d7935593 | 21430 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21431 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
e59452c7 | 21432 | (:)g(:)g(:)g(:)g(:)g(:)31 b Fb(23)150 2173 y Fe($*)16 |
037a8b7f CR |
21433 | b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21434 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
e59452c7 | 21435 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 b Fb(23)150 |
0fcb3344 CR |
21436 | 2261 y Fe($-)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
21437 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
21438 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)31 | |
e59452c7 | 21439 | b Fb(23)150 2350 y Fe($?)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
0fcb3344 CR |
21440 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21441 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21442 | 31 b Fb(23)150 2438 y Fe($@)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
0fcb3344 CR |
21443 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21444 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21445 | (:)31 b Fb(23)150 2526 y Fe($_)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f |
0fcb3344 CR |
21446 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
21447 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21448 | (:)g(:)31 b Fb(77)150 2613 y Fe($0)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h |
0fcb3344 CR |
21449 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21450 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
e59452c7 | 21451 | (:)g(:)g(:)31 b Fb(23)146 2876 y Fs(*)150 2994 y Fe(*)19 |
037a8b7f | 21452 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
d7935593 | 21453 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21454 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b |
e59452c7 | 21455 | Fb(23)146 3248 y Fs({)150 3366 y Fe(-)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:) |
037a8b7f CR |
21456 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21457 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21458 | g(:)h(:)f(:)g(:)g(:)33 b Fb(23)146 3620 y Fs(?)150 3738 |
0fcb3344 | 21459 | y Fe(?)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
037a8b7f CR |
21460 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
21461 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 | |
e59452c7 | 21462 | b Fb(23)146 3992 y Fs(@)150 4110 y Fe(@)19 b Fc(:)13 |
037a8b7f | 21463 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
d7935593 | 21464 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 21465 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 b Fb(23)p |
0fcb3344 CR |
21466 | 156 4364 41 6 v 150 4482 a Fe(_)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g |
21467 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
21468 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
e59452c7 | 21469 | (:)f(:)g(:)g(:)33 b Fb(77)146 4736 y Fs(0)150 4854 y |
0fcb3344 | 21470 | Fe(0)19 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
037a8b7f | 21471 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
0fcb3344 | 21472 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)33 |
e59452c7 | 21473 | b Fb(23)146 5108 y Fs(A)150 5226 y Fe(auto_resume)8 b |
0fcb3344 CR |
21474 | Fc(:)16 b(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21475 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
fffe80d4 | 21476 | 23 b Fb(115)2021 954 y Fs(B)2025 1074 y Fe(BASH)11 b |
0fcb3344 CR |
21477 | Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21478 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21479 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 b Fb(78)2025 1163 |
0fcb3344 CR |
21480 | y Fe(BASH_ALIASES)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21481 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21482 | g(:)g(:)g(:)g(:)h(:)22 b Fb(78)2025 1251 y Fe(BASH_ARGC)15 |
0fcb3344 CR |
21483 | b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
21484 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
e59452c7 | 21485 | (:)g(:)g(:)30 b Fb(78)2025 1340 y Fe(BASH_ARGV)15 b Fc(:)g(:)f(:)f(:)g |
8a0829e9 | 21486 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
0fcb3344 | 21487 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 |
e59452c7 | 21488 | b Fb(78)2025 1429 y Fe(BASH_ARGV0)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g |
7e92fb35 | 21489 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 | 21490 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(79)2025 |
7e92fb35 CR |
21491 | 1517 y Fe(BASH_CMDS)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21492 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21493 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(79)2025 1606 |
7e92fb35 CR |
21494 | y Fe(BASH_COMMAND)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21495 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21496 | g(:)g(:)g(:)g(:)h(:)22 b Fb(79)2025 1695 y Fe(BASH_COMPAT)10 |
037a8b7f CR |
21497 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21498 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21499 | g(:)25 b Fb(79)2025 1783 y Fe(BASH_ENV)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g |
037a8b7f CR |
21500 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
21501 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
e59452c7 | 21502 | b Fb(79)2025 1872 y Fe(BASH_EXECUTION_STRING)24 b Fc(:)13 |
037a8b7f | 21503 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
e59452c7 | 21504 | (:)g(:)g(:)g(:)g(:)34 b Fb(79)2025 1960 y Fe(BASH_LINENO)10 |
037a8b7f CR |
21505 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21506 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21507 | g(:)25 b Fb(79)2025 2049 y Fe(BASH_LOADABLES_PATH)7 b |
037a8b7f | 21508 | Fc(:)17 b(:)c(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
e59452c7 | 21509 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(80)2025 |
7e92fb35 | 21510 | 2138 y Fe(BASH_REMATCH)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
bce12dd7 | 21511 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
e59452c7 | 21512 | (:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(80)2025 2226 y Fe(BASH_SOURCE)10 |
037a8b7f CR |
21513 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21514 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21515 | g(:)25 b Fb(80)2025 2315 y Fe(BASH_SUBSHELL)g Fc(:)13 |
037a8b7f CR |
21516 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21517 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
e59452c7 | 21518 | b Fb(80)2025 2403 y Fe(BASH_VERSINFO)25 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g |
037a8b7f | 21519 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 | 21520 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 b Fb(80)2025 2492 |
037a8b7f CR |
21521 | y Fe(BASH_VERSION)8 b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21522 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21523 | g(:)g(:)g(:)g(:)h(:)22 b Fb(80)2025 2581 y Fe(BASH_XTRACEFD)j |
037a8b7f CR |
21524 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21525 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
e59452c7 | 21526 | b Fb(80)2025 2669 y Fe(BASHOPTS)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f |
037a8b7f CR |
21527 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21528 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b | |
e59452c7 | 21529 | Fb(78)2025 2758 y Fe(BASHPID)22 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c | 21530 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21531 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 |
e59452c7 | 21532 | b Fb(78)2025 2847 y Fe(bell-style)11 b Fc(:)k(:)e(:)g(:)g(:)g(:)h(:)f |
037a8b7f | 21533 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 21534 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)26 b Fb(120)2025 |
7e92fb35 | 21535 | 2935 y Fe(bind-tty-special-chars)14 b Fc(:)k(:)13 b(:)g(:)h(:)f(:)g(:)g |
037a8b7f | 21536 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)29 |
fffe80d4 | 21537 | b Fb(120)2025 3022 y Fe(blink-matching-paren)24 b Fc(:)13 |
037a8b7f | 21538 | b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 21539 | (:)g(:)g(:)g(:)h(:)34 b Fb(120)2021 3297 y Fs(C)2025 |
7e92fb35 | 21540 | 3417 y Fe(CDPATH)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
037a8b7f CR |
21541 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21542 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b | |
e59452c7 | 21543 | Fb(77)2025 3506 y Fe(CHILD_MAX)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g |
037a8b7f | 21544 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 21545 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(81)2025 |
7e92fb35 | 21546 | 3595 y Fe(colored-completion-prefix)7 b Fc(:)18 b(:)13 |
037a8b7f | 21547 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 |
fffe80d4 | 21548 | b Fb(120)2025 3683 y Fe(colored-stats)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f |
037a8b7f | 21549 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 21550 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(120)2025 3772 y Fe(COLUMNS)22 |
037a8b7f | 21551 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
c302751c | 21552 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21553 | g(:)g(:)h(:)f(:)g(:)35 b Fb(81)2025 3860 y Fe(comment-begin)23 |
037a8b7f CR |
21554 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21555 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 | |
fffe80d4 | 21556 | b Fb(120)2025 3949 y Fe(COMP_CWORD)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g |
037a8b7f | 21557 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 | 21558 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(81)2025 |
7e92fb35 | 21559 | 4038 y Fe(COMP_KEY)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
037a8b7f | 21560 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21561 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(81)2025 4126 |
037a8b7f CR |
21562 | y Fe(COMP_LINE)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21563 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 21564 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(81)2025 4215 y Fe(COMP_POINT)13 |
037a8b7f CR |
21565 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21566 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21567 | (:)h(:)27 b Fb(81)2025 4303 y Fe(COMP_TYPE)15 b Fc(:)g(:)f(:)f(:)g(:)g |
037a8b7f CR |
21568 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21569 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 | |
e59452c7 | 21570 | b Fb(81)2025 4392 y Fe(COMP_WORDBREAKS)17 b Fc(:)g(:)c(:)g(:)g(:)g(:)g |
037a8b7f | 21571 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21572 | h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(81)2025 4481 y Fe(COMP_WORDS)13 |
037a8b7f CR |
21573 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21574 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21575 | (:)h(:)27 b Fb(81)2025 4569 y Fe(completion-display-width)9 |
037a8b7f | 21576 | b Fc(:)19 b(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21577 | (:)h(:)f(:)g(:)24 b Fb(121)2025 4658 y Fe(completion-ignore-case)14 |
037a8b7f | 21578 | b Fc(:)k(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 21579 | (:)g(:)g(:)h(:)f(:)29 b Fb(121)2025 4747 y Fe(completion-map-case)d |
037a8b7f | 21580 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 21581 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 b Fb(121)2025 4835 |
037a8b7f | 21582 | y Fe(completion-prefix-display-leng)q(th)29 b Fc(:)13 |
fffe80d4 | 21583 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)38 b Fb(121)2025 4924 |
037a8b7f CR |
21584 | y Fe(completion-query-items)14 b Fc(:)k(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g |
21585 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)29 | |
fffe80d4 | 21586 | b Fb(121)2025 5012 y Fe(COMPREPLY)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g |
037a8b7f CR |
21587 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
21588 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b | |
e59452c7 | 21589 | Fb(82)2025 5101 y Fe(convert-meta)25 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f | 21590 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21591 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)38 b Fb(121)2025 5188 |
037a8b7f CR |
21592 | y Fe(COPROC)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21593 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 | 21594 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(82)p |
0fcb3344 | 21595 | eop end |
5e6f45d9 CR |
21596 | %%Page: 184 190 |
21597 | TeXDict begin 184 189 bop 150 -116 a Fu(App)s(endix)29 | |
21598 | b(D:)i(Indexes)2623 b(184)146 294 y Fs(D)150 415 y Fe(DIRSTACK)18 | |
0fcb3344 CR |
21599 | b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
21600 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
e59452c7 | 21601 | (:)g(:)h(:)f(:)32 b Fb(82)150 502 y Fe(disable-completion)7 |
0fcb3344 | 21602 | b Fc(:)18 b(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 21603 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 b Fb(121)146 |
e59452c7 | 21604 | 782 y Fs(E)150 903 y Fe(echo-control-characters)12 b |
0fcb3344 | 21605 | Fc(:)18 b(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 21606 | g(:)g(:)g(:)h(:)26 b Fb(121)150 991 y Fe(editing-mode)f |
0fcb3344 CR |
21607 | Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21608 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)37 | |
fffe80d4 | 21609 | b Fb(121)150 1080 y Fe(emacs-mode-string)10 b Fc(:)17 |
0fcb3344 | 21610 | b(:)c(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 21611 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)25 b Fb(122)150 1169 |
0fcb3344 CR |
21612 | y Fe(EMACS)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
21613 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
e59452c7 CR |
21614 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(82)150 |
21615 | 1258 y Fe(enable-active-region)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
21616 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)34 | |
fffe80d4 | 21617 | b Fb(122)150 1347 y Fe(enable-bracketed-paste)14 b Fc(:)k(:)c(:)f(:)g |
e59452c7 | 21618 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 |
fffe80d4 | 21619 | b Fb(122)150 1436 y Fe(enable-keypad)23 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g |
037a8b7f | 21620 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 21621 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(122)150 1525 y Fe(ENV)14 |
037a8b7f CR |
21622 | b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21623 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
e59452c7 CR |
21624 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 b Fb(82)150 |
21625 | 1613 y Fe(EPOCHREALTIME)d Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
037a8b7f | 21626 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
e59452c7 | 21627 | g(:)g(:)g(:)g(:)37 b Fb(82)150 1702 y Fe(EPOCHSECONDS)8 |
7e92fb35 CR |
21628 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21629 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
e59452c7 | 21630 | 22 b Fb(82)150 1791 y Fe(EUID)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g |
7e92fb35 CR |
21631 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
21632 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21633 | b Fb(82)150 1880 y Fe(EXECIGNORE)13 b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f | 21634 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
e59452c7 CR |
21635 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fb(82)150 |
21636 | 1967 y Fe(expand-tilde)e Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
037a8b7f | 21637 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 21638 | g(:)g(:)g(:)h(:)37 b Fb(122)146 2247 y Fs(F)150 2368 |
037a8b7f CR |
21639 | y Fe(FCEDIT)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21640 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 CR |
21641 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fb(83)150 |
21642 | 2457 y Fe(FIGNORE)i Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
037a8b7f | 21643 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
e59452c7 CR |
21644 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 b Fb(83)150 |
21645 | 2545 y Fe(FUNCNAME)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
037a8b7f | 21646 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21647 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(83)150 2633 |
037a8b7f CR |
21648 | y Fe(FUNCNEST)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21649 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
e59452c7 CR |
21650 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(83)146 2901 y |
21651 | Fs(G)150 3022 y Fe(GLOBIGNORE)13 b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g | |
037a8b7f | 21652 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 CR |
21653 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fb(83)150 |
21654 | 3109 y Fe(GROUPS)6 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
037a8b7f CR |
21655 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21656 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b | |
e59452c7 | 21657 | Fb(83)146 3377 y Fs(H)150 3498 y Fe(histchars)15 b Fc(:)h(:)d(:)g(:)g |
bce12dd7 | 21658 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21659 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)30 |
e59452c7 | 21660 | b Fb(83)150 3587 y Fe(HISTCMD)22 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f CR |
21661 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
21662 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)35 | |
e59452c7 | 21663 | b Fb(83)150 3676 y Fe(HISTCONTROL)10 b Fc(:)16 b(:)d(:)g(:)g(:)h(:)f(:) |
bce12dd7 | 21664 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
e59452c7 CR |
21665 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)25 b Fb(84)150 |
21666 | 3765 y Fe(HISTFILE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
037a8b7f | 21667 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21668 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(84)150 3854 |
037a8b7f | 21669 | y Fe(HISTFILESIZE)8 b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
bce12dd7 | 21670 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21671 | g(:)g(:)h(:)f(:)g(:)22 b Fb(84)150 3942 y Fe(HISTIGNORE)13 |
037a8b7f CR |
21672 | b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
21673 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
e59452c7 | 21674 | (:)g(:)27 b Fb(84)150 4031 y Fe(history-preserve-point)14 |
037a8b7f | 21675 | b Fc(:)k(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 21676 | h(:)f(:)g(:)g(:)29 b Fb(122)150 4120 y Fe(history-size)c |
037a8b7f CR |
21677 | Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21678 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)37 | |
fffe80d4 | 21679 | b Fb(123)150 4209 y Fe(HISTSIZE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g |
e05be32d | 21680 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
037a8b7f | 21681 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b |
e59452c7 | 21682 | Fb(84)150 4298 y Fe(HISTTIMEFORMAT)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f |
220537f2 | 21683 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
e59452c7 | 21684 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(84)150 4387 y Fe(HOME)11 |
037a8b7f CR |
21685 | b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21686 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21687 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 b Fb(77)150 4475 |
037a8b7f | 21688 | y Fe(horizontal-scroll-mode)14 b Fc(:)k(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 21689 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(123)150 |
e59452c7 | 21690 | 4564 y Fe(HOSTFILE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
037a8b7f | 21691 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21692 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(85)150 4653 |
037a8b7f CR |
21693 | y Fe(HOSTNAME)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21694 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
e59452c7 | 21695 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(85)150 4740 y |
037a8b7f CR |
21696 | Fe(HOSTTYPE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
21697 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 | 21698 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)32 b Fb(85)2021 294 y Fs(I)2025 |
b52e30b8 | 21699 | 420 y Fe(IFS)14 b Fc(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
037a8b7f | 21700 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
0fcb3344 | 21701 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 |
e59452c7 | 21702 | b Fb(77)2025 510 y Fe(IGNOREEOF)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:)g |
0fcb3344 | 21703 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 21704 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(85)2025 |
b52e30b8 | 21705 | 600 y Fe(input-meta)11 b Fc(:)k(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 21706 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 21707 | h(:)f(:)g(:)g(:)g(:)g(:)26 b Fb(123)2025 691 y Fe(INPUTRC)c |
0fcb3344 CR |
21708 | Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21709 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21710 | g(:)g(:)h(:)f(:)g(:)35 b Fb(85)2025 781 y Fe(INSIDE_EMACS)8 |
b52e30b8 CR |
21711 | b Fc(:)15 b(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21712 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
e59452c7 | 21713 | 22 b Fb(85)2025 868 y Fe(isearch-terminators)k Fc(:)13 |
b52e30b8 | 21714 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21715 | (:)h(:)f(:)g(:)g(:)g(:)37 b Fb(123)2021 1167 y Fs(K)2025 |
b52e30b8 CR |
21716 | 1290 y Fe(keymap)22 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
21717 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
fffe80d4 | 21718 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 b Fb(123)2021 |
e59452c7 CR |
21719 | 1601 y Fs(L)2025 1727 y Fe(LANG)20 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g |
21720 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
21721 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)35 | |
21722 | b Fb(8,)26 b(85)2025 1817 y Fe(LC_ALL)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g | |
21723 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
21724 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 | |
21725 | b Fb(85)2025 1907 y Fe(LC_COLLATE)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g | |
b52e30b8 | 21726 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 | 21727 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(85)2025 |
b52e30b8 CR |
21728 | 1998 y Fe(LC_CTYPE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21729 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21730 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(85)2025 2088 |
b52e30b8 CR |
21731 | y Fe(LC_MESSAGES)21 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21732 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
e59452c7 | 21733 | g(:)g(:)g(:)34 b Fb(8,)26 b(85)2025 2178 y Fe(LC_NUMERIC)13 |
037a8b7f CR |
21734 | b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21735 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21736 | (:)h(:)27 b Fb(86)2025 2269 y Fe(LC_TIME)22 b Fc(:)13 |
b52e30b8 | 21737 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
8a0829e9 | 21738 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21739 | h(:)f(:)g(:)35 b Fb(86)2025 2359 y Fe(LINENO)6 b Fc(:)14 |
b52e30b8 CR |
21740 | b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
21741 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 | 21742 | g(:)g(:)g(:)g(:)g(:)21 b Fb(86)2025 2446 y Fe(LINES)9 |
b52e30b8 CR |
21743 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21744 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
e59452c7 | 21745 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fb(86)2021 2746 |
b52e30b8 | 21746 | y Fs(M)2025 2872 y Fe(MACHTYPE)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f |
0fcb3344 CR |
21747 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21748 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b | |
e59452c7 | 21749 | Fb(86)2025 2962 y Fe(MAIL)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
0fcb3344 | 21750 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
b52e30b8 | 21751 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 |
e59452c7 | 21752 | b Fb(77)2025 3052 y Fe(MAILCHECK)15 b Fc(:)g(:)f(:)f(:)g(:)g(:)g(:)g(:) |
b52e30b8 | 21753 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
e59452c7 | 21754 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(86)2025 |
b52e30b8 CR |
21755 | 3143 y Fe(MAILPATH)18 b Fc(:)d(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21756 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21757 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 b Fb(77)2025 3233 |
b52e30b8 CR |
21758 | y Fe(MAPFILE)22 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
21759 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
e59452c7 | 21760 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(86)2025 3323 |
b52e30b8 CR |
21761 | y Fe(mark-modified-lines)26 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21762 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
fffe80d4 | 21763 | b Fb(124)2025 3414 y Fe(mark-symlinked-directories)27 |
b52e30b8 | 21764 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 21765 | 36 b Fb(124)2025 3504 y Fe(match-hidden-files)7 b Fc(:)17 |
b52e30b8 | 21766 | b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
fffe80d4 | 21767 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(124)2025 3594 |
b52e30b8 | 21768 | y Fe(menu-complete-display-prefix)17 b Fc(:)h(:)13 b(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 21769 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)31 b Fb(124)2025 3681 y Fe(meta-flag)13 |
b52e30b8 CR |
21770 | b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
21771 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
fffe80d4 | 21772 | (:)f(:)28 b Fb(123)2021 3992 y Fs(O)2025 4118 y Fe(OLDPWD)6 |
b52e30b8 CR |
21773 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21774 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21775 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(86)2025 4208 y Fe(OPTARG)6 |
b52e30b8 CR |
21776 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21777 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21778 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(77)2025 4299 y Fe(OPTERR)6 |
b52e30b8 CR |
21779 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21780 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21781 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(86)2025 4389 y Fe(OPTIND)6 |
b52e30b8 CR |
21782 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21783 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21784 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(77)2025 4480 y Fe(OSTYPE)6 |
b52e30b8 CR |
21785 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21786 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21787 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fb(86)2025 4567 y Fe(output-meta)8 |
b52e30b8 CR |
21788 | b Fc(:)16 b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21789 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
fffe80d4 | 21790 | 23 b Fb(124)p eop end |
5e6f45d9 CR |
21791 | %%Page: 185 191 |
21792 | TeXDict begin 185 190 bop 150 -116 a Fu(App)s(endix)29 | |
21793 | b(D:)i(Indexes)2623 b(185)146 294 y Fs(P)150 410 y Fe(page-completions) | |
0fcb3344 | 21794 | 13 b Fc(:)j(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21795 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)27 b Fb(124)150 |
0fcb3344 CR |
21796 | 497 y Fe(PATH)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
21797 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21798 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)25 | |
e59452c7 | 21799 | b Fb(77)150 584 y Fe(PIPESTATUS)13 b Fc(:)i(:)e(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 21800 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 21801 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fb(86)150 |
0fcb3344 CR |
21802 | 671 y Fe(POSIXLY_CORRECT)17 b Fc(:)g(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21803 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
e59452c7 | 21804 | (:)g(:)g(:)32 b Fb(86)150 758 y Fe(PPID)11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g |
0fcb3344 CR |
21805 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21806 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 21807 | (:)h(:)25 b Fb(86)150 846 y Fe(PROMPT_COMMAND)e Fc(:)13 |
9c10def1 CR |
21808 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21809 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 | |
e59452c7 | 21810 | b Fb(86)150 933 y Fe(PROMPT_DIRTRIM)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f |
9c10def1 | 21811 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
e59452c7 | 21812 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(87)150 1020 y Fe(PS0)14 |
9c10def1 CR |
21813 | b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21814 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
e59452c7 | 21815 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 b Fb(87)150 |
9c10def1 CR |
21816 | 1107 y Fe(PS1)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
21817 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
21818 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 | |
e59452c7 | 21819 | b Fb(77)150 1194 y Fe(PS2)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
9c10def1 CR |
21820 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21821 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 | |
e59452c7 | 21822 | b Fb(77)150 1281 y Fe(PS3)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
9c10def1 CR |
21823 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21824 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 | |
e59452c7 | 21825 | b Fb(87)150 1369 y Fe(PS4)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
9c10def1 CR |
21826 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21827 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 | |
e59452c7 | 21828 | b Fb(87)150 1456 y Fe(PWD)14 b Fc(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
9c10def1 CR |
21829 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
21830 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 | |
e59452c7 | 21831 | b Fb(87)146 1689 y Fs(R)150 1804 y Fe(RANDOM)6 b Fc(:)15 |
9c10def1 CR |
21832 | b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
21833 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
e59452c7 CR |
21834 | g(:)g(:)g(:)h(:)f(:)20 b Fb(87)150 1892 y Fe(READLINE_ARGUMENT)12 |
21835 | b Fc(:)17 b(:)c(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
21836 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)26 b Fb(87)150 | |
21837 | 1979 y Fe(READLINE_LINE)f Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h | |
21838 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21839 | g(:)g(:)g(:)g(:)37 b Fb(87)150 2066 y Fe(READLINE_MARK)25 | |
037a8b7f CR |
21840 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21841 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 | |
e59452c7 CR |
21842 | b Fb(87)150 2153 y Fe(READLINE_POINT)23 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f |
21843 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
21844 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(87)150 2240 y Fe(REPLY)9 | |
21845 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
21846 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
21847 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(87)150 2327 y | |
21848 | Fe(revert-all-at-newline)17 b Fc(:)h(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
21849 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)32 | |
fffe80d4 | 21850 | b Fb(124)146 2560 y Fs(S)150 2676 y Fe(SECONDS)22 b Fc(:)13 |
e59452c7 CR |
21851 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
21852 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
21853 | g(:)g(:)g(:)35 b Fb(87)150 2763 y Fe(SHELL)9 b Fc(:)14 | |
21854 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
037a8b7f | 21855 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 CR |
21856 | g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(87)150 2851 y Fe(SHELLOPTS)15 |
21857 | b Fc(:)h(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
21858 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
21859 | (:)g(:)g(:)30 b Fb(88)150 2938 y Fe(SHLVL)9 b Fc(:)14 | |
037a8b7f CR |
21860 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21861 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 21862 | g(:)h(:)f(:)g(:)g(:)g(:)23 b Fb(88)150 3025 y Fe(show-all-if-ambiguous) |
037a8b7f | 21863 | 17 b Fc(:)h(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 21864 | (:)f(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(125)150 3112 y Fe |
e59452c7 | 21865 | (show-all-if-unmodified)14 b Fc(:)k(:)c(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
fffe80d4 | 21866 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(125)150 |
e59452c7 CR |
21867 | 3199 y Fe(show-mode-in-prompt)d Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21868 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 | |
fffe80d4 | 21869 | b Fb(125)2025 260 y Fe(skip-completed-text)26 b Fc(:)13 |
e59452c7 | 21870 | b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21871 | (:)h(:)f(:)g(:)g(:)g(:)37 b Fb(125)2025 347 y Fe(SRANDOM)22 |
e59452c7 | 21872 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
52e46969 | 21873 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 CR |
21874 | g(:)g(:)h(:)f(:)g(:)35 b Fb(88)2021 673 y Fs(T)2025 803 |
21875 | y Fe(TEXTDOMAIN)15 b Fc(:)g(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
21876 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
21877 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)30 b Fb(8)2025 895 y Fe(TEXTDOMAINDIR)7 | |
21878 | b Fc(:)16 b(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
21879 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
21880 | 23 b Fb(8)2025 986 y Fe(TIMEFORMAT)13 b Fc(:)i(:)e(:)g(:)g(:)h(:)f(:)g | |
21881 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
21882 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)27 b Fb(88)2025 | |
21883 | 1078 y Fe(TMOUT)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
52e46969 CR |
21884 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
21885 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 | |
e59452c7 | 21886 | b Fb(88)2025 1165 y Fe(TMPDIR)6 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g |
52e46969 CR |
21887 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
21888 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 | |
e59452c7 | 21889 | b Fb(89)2021 1492 y Fs(U)2025 1617 y Fe(UID)14 b Fc(:)f(:)g(:)h(:)f(:)g |
9f178efb | 21890 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
037a8b7f | 21891 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
e59452c7 | 21892 | (:)g(:)h(:)f(:)28 b Fb(89)2021 1943 y Fs(V)2025 2073 |
037a8b7f CR |
21893 | y Fe(vi-cmd-mode-string)7 b Fc(:)17 b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
21894 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 | |
fffe80d4 | 21895 | b Fb(125)2025 2165 y Fe(vi-ins-mode-string)7 b Fc(:)17 |
037a8b7f | 21896 | b(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
fffe80d4 | 21897 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 b Fb(125)2025 2252 |
037a8b7f CR |
21898 | y Fe(visible-stats)h Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21899 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
fffe80d4 | 21900 | f(:)g(:)35 b Fb(126)150 3845 y Fs(D.4)68 b(F)-11 b(unction)44 |
e59452c7 | 21901 | b(Index)146 4330 y(A)150 4447 y Fe(abort)27 b(\(C-g\))15 |
037a8b7f CR |
21902 | b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
21903 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)30 | |
fffe80d4 | 21904 | b Fb(140)150 4535 y Fe(accept-line)e(\(Newline)g(or)e(Return\))12 |
037a8b7f | 21905 | b Fc(:)i(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)27 |
fffe80d4 | 21906 | b Fb(133)150 4622 y Fe(alias-expand-line)i(\(\))9 b Fc(:)14 |
037a8b7f | 21907 | b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21908 | (:)h(:)f(:)g(:)g(:)g(:)24 b Fb(142)146 4873 y Fs(B)150 |
e59452c7 | 21909 | 4990 y Fe(backward-char)29 b(\(C-b\))12 b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:) |
037a8b7f | 21910 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 21911 | (:)26 b Fb(132)150 5077 y Fe(backward-delete-char)k(\(Rubout\))22 |
037a8b7f | 21912 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)35 |
fffe80d4 | 21913 | b Fb(135)150 5165 y Fe(backward-kill-line)30 b(\(C-x)c(Rubout\))e |
037a8b7f | 21914 | Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)37 b |
fffe80d4 | 21915 | Fb(136)150 5252 y Fe(backward-kill-word)30 b(\(M-DEL\))11 |
037a8b7f | 21916 | b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 21917 | 26 b Fb(136)150 5340 y Fe(backward-word)j(\(M-b\))12 |
037a8b7f | 21918 | b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
fffe80d4 | 21919 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)26 b Fb(132)2025 4300 |
e59452c7 | 21920 | y Fe(beginning-of-history)k(\(M-<\))11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 21921 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)26 b Fb(133)2025 |
e59452c7 | 21922 | 4389 y Fe(beginning-of-line)j(\(C-a\))20 b Fc(:)13 b(:)g(:)g(:)g(:)h(:) |
037a8b7f | 21923 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)34 |
fffe80d4 | 21924 | b Fb(132)2025 4477 y Fe(bracketed-paste-begin)c(\(\))16 |
0fcb3344 | 21925 | b Fc(:)e(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
fffe80d4 | 21926 | g(:)g(:)31 b Fb(135)2021 4769 y Fs(C)2025 4893 y Fe |
0fcb3344 | 21927 | (call-last-kbd-macro)f(\(C-x)c(e\))15 b Fc(:)f(:)f(:)g(:)g(:)h(:)f(:)g |
fffe80d4 | 21928 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)30 b Fb(140)2025 4982 |
0fcb3344 CR |
21929 | y Fe(capitalize-word)f(\(M-c\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:) |
21930 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 | |
fffe80d4 | 21931 | b Fb(136)2025 5072 y Fe(character-search)29 b(\(C-]\))22 |
967625cd | 21932 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21933 | (:)h(:)f(:)g(:)g(:)36 b Fb(140)2025 5161 y Fe |
0fcb3344 | 21934 | (character-search-backward)31 b(\(M-C-]\))10 b Fc(:)15 |
fffe80d4 | 21935 | b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)25 b Fb(140)2025 5250 |
d37a4722 CR |
21936 | y Fe(clear-display)j(\(M-C-l\))7 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:) |
21937 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 | |
fffe80d4 | 21938 | b Fb(133)2025 5340 y Fe(clear-screen)28 b(\(C-l\))14 |
d37a4722 | 21939 | b Fc(:)h(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
fffe80d4 | 21940 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 b Fb(133)p eop |
e59452c7 | 21941 | end |
5e6f45d9 CR |
21942 | %%Page: 186 192 |
21943 | TeXDict begin 186 191 bop 150 -116 a Fu(App)s(endix)29 | |
21944 | b(D:)i(Indexes)2623 b(186)150 264 y Fe(complete)27 b(\(TAB\))7 | |
e59452c7 CR |
21945 | b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
21946 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 | |
fffe80d4 | 21947 | b Fb(138)150 352 y Fe(complete-command)29 b(\(M-!\))23 |
e59452c7 | 21948 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 21949 | (:)f(:)g(:)g(:)g(:)36 b Fb(139)150 440 y Fe(complete-filename)29 |
d37a4722 | 21950 | b(\(M-/\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 21951 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(138)150 528 y Fe(complete-hostname) |
d37a4722 | 21952 | c(\(M-@\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 21953 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(139)150 616 y Fe |
10db6565 | 21954 | (complete-into-braces)d(\(M-{\))11 b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 21955 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 b Fb(139)150 704 |
10db6565 CR |
21956 | y Fe(complete-username)j(\(M-~\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g |
21957 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 | |
fffe80d4 | 21958 | b Fb(139)150 792 y Fe(complete-variable)c(\(M-$\))20 |
0fcb3344 | 21959 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 21960 | (:)g(:)h(:)f(:)33 b Fb(139)150 880 y Fe(copy-backward-word)d(\(\))7 |
037a8b7f | 21961 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
fffe80d4 | 21962 | (:)g(:)g(:)g(:)g(:)h(:)f(:)21 b Fb(137)150 968 y Fe(copy-forward-word) |
0fcb3344 | 21963 | 29 b(\(\))9 b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
fffe80d4 | 21964 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(137)150 |
e59452c7 CR |
21965 | 1056 y Fe(copy-region-as-kill)30 b(\(\))22 b Fc(:)13 |
21966 | b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
fffe80d4 | 21967 | (:)g(:)g(:)36 b Fb(137)146 1320 y Fs(D)150 1438 y Fe(dabbrev-expand)29 |
0fcb3344 CR |
21968 | b(\(\))17 b Fc(:)c(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
21969 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 | |
fffe80d4 | 21970 | b Fb(139)150 1527 y Fe(delete-char)c(\(C-d\))17 b Fc(:)d(:)f(:)g(:)h(:) |
0fcb3344 | 21971 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 21972 | (:)g(:)g(:)g(:)g(:)32 b Fb(135)150 1615 y Fe(delete-char-or-list)e |
0fcb3344 | 21973 | (\(\))22 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 21974 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 b Fb(138)150 1703 y Fe |
0fcb3344 | 21975 | (delete-horizontal-space)31 b(\(\))11 b Fc(:)i(:)g(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 21976 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 b Fb(137)150 |
e59452c7 | 21977 | 1791 y Fe(digit-argument)j(\()p Fd(M-0)p Fe(,)e Fd(M-1)p |
0fcb3344 | 21978 | Fe(,)f(...)g Fd(M--)p Fe(\))11 b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 21979 | 26 b Fb(137)150 1879 y Fe(display-shell-version)k(\(C-x)d(C-v\))c |
0fcb3344 | 21980 | Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)37 b |
fffe80d4 | 21981 | Fb(142)150 1958 y Fe(do-lowercase-version)30 b(\(M-A,)227 |
e59452c7 | 21982 | 2046 y(M-B,)c(M-)p Fd(x)p Fe(,)h(...\))10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 21983 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
fffe80d4 | 21984 | g(:)g(:)g(:)g(:)g(:)25 b Fb(140)150 2134 y Fe(downcase-word)k(\(M-l\)) |
0fcb3344 | 21985 | 12 b Fc(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 21986 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)26 b Fb(136)150 2222 |
0fcb3344 CR |
21987 | y Fe(dump-functions)j(\(\))17 b Fc(:)c(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
21988 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
fffe80d4 | 21989 | 32 b Fb(141)150 2310 y Fe(dump-macros)c(\(\))7 b Fc(:)14 |
0fcb3344 CR |
21990 | b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
21991 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 | |
fffe80d4 | 21992 | b Fb(141)150 2398 y Fe(dump-variables)29 b(\(\))17 b |
0fcb3344 | 21993 | Fc(:)c(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 21994 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(141)150 |
e59452c7 | 21995 | 2485 y Fe(dynamic-complete-history)f(\(M-TAB\))13 b Fc(:)i(:)e(:)g(:)g |
fffe80d4 | 21996 | (:)g(:)g(:)g(:)g(:)h(:)27 b Fb(139)146 2749 y Fs(E)150 |
e59452c7 | 21997 | 2868 y Fe(edit-and-execute-command)k(\(C-x)c(C-e\))14 |
fffe80d4 | 21998 | b Fc(:)g(:)f(:)g(:)g(:)h(:)f(:)g(:)29 b Fb(142)150 2956 |
7e92fb35 CR |
21999 | y Fe(end-kbd-macro)g(\(C-x)d(\)\))13 b Fc(:)h(:)f(:)g(:)g(:)h(:)f(:)g |
22000 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)28 | |
fffe80d4 | 22001 | b Fb(139)150 3044 y Fd(end-of-file)g Fe(\(usually)g(C-d\))21 |
0fcb3344 | 22002 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
fffe80d4 | 22003 | (:)g(:)35 b Fb(135)150 3132 y Fe(end-of-history)29 b(\(M->\))9 |
037a8b7f | 22004 | b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 22005 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(133)150 3220 y |
037a8b7f CR |
22006 | Fe(end-of-line)k(\(C-e\))17 b Fc(:)d(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
22007 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 | |
fffe80d4 | 22008 | b Fb(132)150 3308 y Fe(exchange-point-and-mark)f(\(C-x)26 |
037a8b7f | 22009 | b(C-x\))17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)32 |
fffe80d4 | 22010 | b Fb(140)146 3571 y Fs(F)150 3690 y Fe(fetch-history)d(\(\))19 |
e59452c7 | 22011 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 22012 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(135)150 |
e59452c7 | 22013 | 3778 y Fe(forward-backward-delete-char)e(\(\))15 b Fc(:)f(:)f(:)g(:)g |
fffe80d4 | 22014 | (:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(135)150 3867 y Fe(forward-char)e |
e59452c7 CR |
22015 | (\(C-f\))14 b Fc(:)h(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
22016 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b | |
fffe80d4 | 22017 | Fb(132)150 3955 y Fe(forward-search-history)i(\(C-s\))24 |
e59452c7 | 22018 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)38 |
fffe80d4 | 22019 | b Fb(133)150 4042 y Fe(forward-word)28 b(\(M-f\))14 b |
e59452c7 | 22020 | Fc(:)h(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22021 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)29 b Fb(132)146 4295 |
e59452c7 | 22022 | y Fs(G)150 4414 y Fe(glob-complete-word)h(\(M-g\))16 |
037a8b7f | 22023 | b Fc(:)e(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 22024 | g(:)g(:)31 b Fb(141)150 4502 y Fe(glob-expand-word)e(\(C-x)e(*\))c |
037a8b7f | 22025 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 22026 | (:)g(:)g(:)38 b Fb(141)150 4590 y Fe(glob-list-expansions)30 |
037a8b7f | 22027 | b(\(C-x)d(g\))13 b Fc(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 22028 | (:)g(:)h(:)27 b Fb(141)2021 294 y Fs(H)2025 422 y Fe |
0fcb3344 | 22029 | (history-and-alias-expand-line)32 b(\(\))13 b Fc(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 22030 | g(:)g(:)g(:)g(:)28 b Fb(142)2025 513 y Fe(history-expand-line)i |
0fcb3344 | 22031 | (\(M-^\))13 b Fc(:)h(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 22032 | g(:)g(:)g(:)h(:)28 b Fb(142)2025 604 y Fe(history-search-backward)j |
0fcb3344 | 22033 | (\(\))11 b Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
fffe80d4 | 22034 | (:)g(:)g(:)26 b Fb(134)2025 695 y Fe(history-search-forward)k(\(\))13 |
0fcb3344 | 22035 | b Fc(:)h(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 CR |
22036 | h(:)28 b Fb(134)2025 786 y Fe(history-substring-search-backw)q(ard)k |
22037 | (\(\))20 b Fc(:)13 b(:)g(:)g(:)g(:)35 b Fb(134)2025 874 | |
7e92fb35 | 22038 | y Fe(history-substring-search-forwa)q(rd)d(\(\))22 b |
fffe80d4 | 22039 | Fc(:)13 b(:)h(:)f(:)g(:)g(:)37 b Fb(134)2021 1200 y Fs(I)2025 |
124d67cd | 22040 | 1329 y Fe(insert-comment)29 b(\(M-#\))9 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f |
0fcb3344 | 22041 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 22042 | 24 b Fb(141)2025 1420 y Fe(insert-completions)29 b(\(M-*\))16 |
7e92fb35 | 22043 | b Fc(:)f(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
fffe80d4 | 22044 | g(:)g(:)31 b Fb(138)2025 1507 y Fe(insert-last-argument)f(\(M-.)c(or)g |
7e92fb35 | 22045 | (M-_\))7 b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 |
fffe80d4 | 22046 | b Fb(142)2021 1834 y Fs(K)2025 1962 y Fe(kill-line)27 |
7e92fb35 CR |
22047 | b(\(C-k\))c Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
22048 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
fffe80d4 | 22049 | b Fb(136)2025 2053 y Fe(kill-region)28 b(\(\))7 b Fc(:)14 |
7e92fb35 CR |
22050 | b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
22051 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)22 | |
fffe80d4 | 22052 | b Fb(137)2025 2144 y Fe(kill-whole-line)29 b(\(\))14 |
7e92fb35 | 22053 | b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
fffe80d4 | 22054 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 b Fb(136)2025 |
124d67cd | 22055 | 2231 y Fe(kill-word)e(\(M-d\))c Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
0fcb3344 | 22056 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
fffe80d4 | 22057 | g(:)g(:)g(:)37 b Fb(136)2021 2548 y Fs(M)2025 2676 y |
0fcb3344 CR |
22058 | Fe(magic-space)28 b(\(\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
22059 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
fffe80d4 | 22060 | g(:)g(:)h(:)f(:)22 b Fb(142)2025 2767 y Fe(menu-complete)28 |
0fcb3344 CR |
22061 | b(\(\))20 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
22062 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)34 | |
fffe80d4 | 22063 | b Fb(138)2025 2854 y Fe(menu-complete-backward)c(\(\))13 |
0fcb3344 | 22064 | b Fc(:)h(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 22065 | h(:)28 b Fb(138)2021 3181 y Fs(N)2025 3309 y Fe(next-history)g(\(C-n\)) |
0fcb3344 | 22066 | 14 b Fc(:)h(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 22067 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 b Fb(133)2025 |
124d67cd CR |
22068 | 3401 y Fe(next-screen-line)g(\(\))12 b Fc(:)h(:)g(:)h(:)f(:)g(:)g(:)g |
22069 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
fffe80d4 | 22070 | 27 b Fb(133)2025 3472 y Fe(non-incremental-forward-)2102 |
124d67cd CR |
22071 | 3560 y(search-history)h(\(M-n\))23 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g |
22072 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
fffe80d4 | 22073 | b Fb(134)2025 3647 y Fe(non-incremental-reverse-)2102 |
124d67cd CR |
22074 | 3734 y(search-history)28 b(\(M-p\))23 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g |
22075 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)37 | |
fffe80d4 | 22076 | b Fb(133)2021 4070 y Fs(O)2025 4198 y Fe(operate-and-get-next)30 |
124d67cd | 22077 | b(\(C-o\))11 b Fc(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
fffe80d4 | 22078 | (:)g(:)g(:)g(:)26 b Fb(134)2025 4285 y Fe(overwrite-mode)j(\(\))17 |
124d67cd | 22079 | b Fc(:)c(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
fffe80d4 | 22080 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(136)p |
0fcb3344 | 22081 | eop end |
5e6f45d9 CR |
22082 | %%Page: 187 193 |
22083 | TeXDict begin 187 192 bop 150 -116 a Fu(App)s(endix)29 | |
22084 | b(D:)i(Indexes)2623 b(187)146 294 y Fs(P)150 411 y Fe | |
0fcb3344 | 22085 | (possible-command-completions)32 b(\(C-x)26 b(!\))9 b |
fffe80d4 | 22086 | Fc(:)14 b(:)g(:)f(:)g(:)g(:)24 b Fb(139)150 499 y Fe |
0fcb3344 | 22087 | (possible-completions)30 b(\(M-?\))11 b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 22088 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 b Fb(138)150 |
602eae4d | 22089 | 586 y Fe(possible-filename-completions)32 b(\(C-x)27 |
fffe80d4 | 22090 | b(/\))7 b Fc(:)13 b(:)g(:)g(:)g(:)22 b Fb(139)150 674 |
0fcb3344 | 22091 | y Fe(possible-hostname-completions)32 b(\(C-x)27 b(@\))7 |
fffe80d4 | 22092 | b Fc(:)13 b(:)g(:)g(:)g(:)22 b Fb(139)150 762 y Fe |
0fcb3344 | 22093 | (possible-username-completions)32 b(\(C-x)27 b(~\))7 |
fffe80d4 | 22094 | b Fc(:)13 b(:)g(:)g(:)g(:)22 b Fb(139)150 849 y Fe |
0fcb3344 | 22095 | (possible-variable-completions)32 b(\(C-x)27 b($\))7 |
fffe80d4 | 22096 | b Fc(:)13 b(:)g(:)g(:)g(:)22 b Fb(139)150 937 y Fe(prefix-meta)28 |
0fcb3344 CR |
22097 | b(\(ESC\))17 b Fc(:)d(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
22098 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 | |
fffe80d4 | 22099 | b Fb(140)150 1025 y Fe(previous-history)d(\(C-p\))23 |
0fcb3344 | 22100 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 22101 | (:)f(:)g(:)g(:)g(:)36 b Fb(133)150 1112 y Fe(previous-screen-line)30 |
0fcb3344 | 22102 | b(\(\))19 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22103 | (:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(132)150 1200 y Fe |
124d67cd | 22104 | (print-last-kbd-macro)d(\(\))19 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
fffe80d4 | 22105 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)33 b Fb(140)146 |
e59452c7 | 22106 | 1454 y Fs(Q)150 1571 y Fe(quoted-insert)c(\(C-q)d(or)g(C-v\))8 |
124d67cd | 22107 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
fffe80d4 | 22108 | (:)g(:)22 b Fb(135)146 1825 y Fs(R)150 1943 y Fe(re-read-init-file)29 |
0fcb3344 | 22109 | b(\(C-x)e(C-r\))15 b Fc(:)f(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
fffe80d4 | 22110 | (:)g(:)g(:)g(:)30 b Fb(140)150 2030 y Fe(redraw-current-line)g(\(\))22 |
0fcb3344 | 22111 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 22112 | (:)f(:)g(:)g(:)g(:)36 b Fb(133)150 2118 y Fe(reverse-search-history)31 |
0fcb3344 | 22113 | b(\(C-r\))24 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 22114 | g(:)38 b Fb(133)150 2205 y Fe(revert-line)28 b(\(M-r\))17 |
0fcb3344 | 22115 | b Fc(:)d(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
fffe80d4 | 22116 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(140)146 |
e59452c7 | 22117 | 2449 y Fs(S)150 2567 y Fe(self-insert)c(\(a,)e(b,)g(A,)g(1,)h(!,)f |
0fcb3344 | 22118 | (...\))13 b Fc(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)27 |
fffe80d4 | 22119 | b Fb(135)150 2654 y Fe(set-mark)g(\(C-@\))7 b Fc(:)15 |
0fcb3344 | 22120 | b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
037a8b7f | 22121 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 |
fffe80d4 | 22122 | b Fb(140)150 2742 y Fe(shell-backward-kill-word)31 b(\(\))8 |
0fcb3344 | 22123 | b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 22124 | 23 b Fb(137)150 2830 y Fe(shell-backward-word)30 b(\(M-C-b\))8 |
602eae4d | 22125 | b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 22126 | 23 b Fb(132)150 2917 y Fe(shell-expand-line)29 b(\(M-C-e\))13 |
602eae4d | 22127 | b Fc(:)j(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
fffe80d4 | 22128 | g(:)28 b Fb(142)150 3005 y Fe(shell-forward-word)i(\(M-C-f\))11 |
602eae4d | 22129 | b Fc(:)j(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 22130 | 26 b Fb(132)150 3093 y Fe(shell-kill-word)j(\(M-C-d\))20 |
602eae4d | 22131 | b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 22132 | (:)g(:)h(:)f(:)33 b Fb(137)150 3180 y Fe(shell-transpose-words)d |
602eae4d | 22133 | (\(M-C-t\))22 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22134 | (:)35 b Fb(137)2025 264 y Fe(skip-csi-sequence)29 b(\(\))9 |
602eae4d | 22135 | b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22136 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)24 b Fb(140)2025 361 y |
e59452c7 | 22137 | Fe(spell-correct-word)29 b(\(C-x)e(s\))18 b Fc(:)13 b(:)g(:)h(:)f(:)g |
fffe80d4 | 22138 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)33 b Fb(141)2025 |
e59452c7 CR |
22139 | 448 y Fe(start-kbd-macro)c(\(C-x)d(\(\))8 b Fc(:)14 b(:)f(:)g(:)h(:)f |
22140 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)23 | |
fffe80d4 | 22141 | b Fb(139)2021 891 y Fs(T)2025 1038 y Fe(tilde-expand)28 |
602eae4d CR |
22142 | b(\(M-&\))14 b Fc(:)h(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
22143 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 | |
fffe80d4 | 22144 | b Fb(140)2025 1135 y Fe(transpose-chars)g(\(C-t\))7 b |
602eae4d | 22145 | Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
fffe80d4 | 22146 | (:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(135)2025 1222 y Fe(transpose-words) |
602eae4d | 22147 | 29 b(\(M-t\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 22148 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(136)2021 |
e59452c7 | 22149 | 1676 y Fs(U)2025 1823 y Fe(undo)k(\(C-_)h(or)f(C-x)g(C-u\))10 |
602eae4d | 22150 | b Fc(:)k(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
fffe80d4 | 22151 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)25 b Fb(140)2025 1920 y Fe |
602eae4d CR |
22152 | (universal-argument)k(\(\))7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
22153 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)22 | |
fffe80d4 | 22154 | b Fb(138)2025 2017 y Fe(unix-filename-rubout)30 b(\(\))19 |
0fcb3344 | 22155 | b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 22156 | (:)g(:)g(:)g(:)34 b Fb(137)2025 2114 y Fe(unix-line-discard)29 |
602eae4d | 22157 | b(\(C-u\))20 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
fffe80d4 | 22158 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)34 b Fb(136)2025 2211 y Fe |
602eae4d CR |
22159 | (unix-word-rubout)29 b(\(C-w\))22 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g |
22160 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 | |
fffe80d4 | 22161 | b Fb(137)2025 2298 y Fe(upcase-word)28 b(\(M-u\))17 b |
602eae4d | 22162 | Fc(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
fffe80d4 | 22163 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)32 b Fb(136)2021 |
e59452c7 | 22164 | 2752 y Fs(Y)2025 2899 y Fe(yank)26 b(\(C-y\))18 b Fc(:)c(:)f(:)g(:)h(:) |
602eae4d CR |
22165 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
22166 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)33 | |
fffe80d4 | 22167 | b Fb(137)2025 2996 y Fe(yank-last-arg)28 b(\(M-.)f(or)f(M-_\))8 |
602eae4d | 22168 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 22169 | (:)h(:)22 b Fb(134)2025 3093 y Fe(yank-nth-arg)28 b(\(M-C-y\))9 |
602eae4d | 22170 | b Fc(:)15 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22171 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)24 b Fb(134)2025 3180 |
602eae4d | 22172 | y Fe(yank-pop)j(\(M-y\))7 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
037a8b7f | 22173 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
fffe80d4 | 22174 | g(:)g(:)h(:)f(:)22 b Fb(137)150 3929 y Fs(D.5)68 b(Concept)45 |
e59452c7 | 22175 | b(Index)146 4523 y(A)150 4648 y Fb(alias)27 b(expansion)7 |
602eae4d CR |
22176 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
22177 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)21 | |
e59452c7 | 22178 | b Fb(99)150 4738 y(arithmetic)26 b(ev)l(aluation)d Fc(:)13 |
967625cd | 22179 | b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
e59452c7 | 22180 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(97)150 4828 y(arithmetic)26 |
037a8b7f CR |
22181 | b(expansion)11 b Fc(:)j(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
22182 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)26 | |
e59452c7 | 22183 | b Fb(34)150 4919 y(arithmetic,)h(shell)6 b Fc(:)14 b(:)f(:)g(:)g(:)g(:) |
037a8b7f | 22184 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
e59452c7 | 22185 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)20 b Fb(97)150 5006 |
037a8b7f CR |
22186 | y(arra)n(ys)h Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
22187 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 CR |
22188 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)35 b Fb(99)2021 |
22189 | 4523 y Fs(B)2025 4646 y Fb(bac)n(kground)13 b Fc(:)f(:)h(:)g(:)g(:)h(:) | |
4d63a619 | 22190 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22191 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)28 b Fb(112)2025 |
e59452c7 | 22192 | 4735 y(Bash)e(con\014guration)11 b Fc(:)j(:)f(:)g(:)g(:)g(:)g(:)h(:)f |
4d63a619 | 22193 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
fffe80d4 | 22194 | g(:)g(:)26 b Fb(157)2025 4825 y(Bash)g(installation)9 |
0fcb3344 CR |
22195 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
22196 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 | |
fffe80d4 | 22197 | b Fb(157)2025 4914 y(Bourne)i(shell)20 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f |
0fcb3344 CR |
22198 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
22199 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)35 b | |
e59452c7 | 22200 | Fb(5)2025 5004 y(brace)26 b(expansion)9 b Fc(:)k(:)g(:)h(:)f(:)g(:)g(:) |
967625cd | 22201 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
e59452c7 | 22202 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)24 b Fb(24)2025 5091 y(builtin)15 |
0fcb3344 CR |
22203 | b Fc(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
22204 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
22205 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 b Fb(3)p eop end | |
5e6f45d9 CR |
22206 | %%Page: 188 194 |
22207 | TeXDict begin 188 193 bop 150 -116 a Fu(App)s(endix)29 | |
22208 | b(D:)i(Indexes)2623 b(188)146 294 y Fs(C)150 415 y Fb(command)26 | |
0fcb3344 CR |
22209 | b(editing)19 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
22210 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)34 | |
fffe80d4 | 22211 | b Fb(117)150 503 y(command)26 b(execution)12 b Fc(:)h(:)g(:)g(:)g(:)g |
0fcb3344 | 22212 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22213 | g(:)h(:)f(:)g(:)g(:)26 b Fb(42)150 592 y(command)g(expansion)c |
0fcb3344 | 22214 | Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
e59452c7 | 22215 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)36 b Fb(41)150 |
d37a4722 | 22216 | 681 y(command)26 b(history)18 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
0fcb3344 | 22217 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
fffe80d4 | 22218 | g(:)g(:)g(:)33 b Fb(151)150 770 y(command)26 b(searc)n(h)16 |
0fcb3344 CR |
22219 | b Fc(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
22220 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)30 | |
e59452c7 | 22221 | b Fb(42)150 859 y(command)c(substitution)21 b Fc(:)13 |
0fcb3344 | 22222 | b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
3011048a | 22223 | (:)g(:)g(:)g(:)h(:)f(:)g(:)35 b Fb(34)150 947 y(command)26 |
e59452c7 CR |
22224 | b(timing)11 b Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
22225 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)25 | |
22226 | b Fb(10)150 1036 y(commands,)h(comp)r(ound)c Fc(:)13 | |
d37a4722 | 22227 | b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
e59452c7 | 22228 | (:)g(:)g(:)g(:)g(:)g(:)g(:)37 b Fb(11)150 1125 y(commands,)26 |
d37a4722 CR |
22229 | b(conditional)10 b Fc(:)15 b(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
22230 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)25 | |
e59452c7 | 22231 | b Fb(12)150 1214 y(commands,)h(grouping)15 b Fc(:)f(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 22232 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
e59452c7 CR |
22233 | g(:)g(:)g(:)29 b Fb(17)150 1302 y(commands,)d(lists)10 |
22234 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
22235 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)24 | |
22236 | b Fb(10)150 1391 y(commands,)i(lo)r(oping)e Fc(:)13 b(:)g(:)g(:)g(:)h | |
22237 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
22238 | g(:)g(:)g(:)g(:)g(:)37 b Fb(11)150 1480 y(commands,)26 | |
22239 | b(pip)r(elines)16 b Fc(:)e(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
22240 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)30 | |
22241 | b Fb(10)150 1569 y(commands,)c(shell)c Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:) | |
22242 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
22243 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)36 b Fb(9)150 1657 y(commands,)26 | |
0fcb3344 CR |
22244 | b(simple)e Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
22245 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)38 | |
e59452c7 | 22246 | b Fb(9)150 1746 y(commen)n(ts,)26 b(shell)13 b Fc(:)i(:)e(:)g(:)g(:)g |
037a8b7f | 22247 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22248 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 b Fb(9)150 |
d37a4722 CR |
22249 | 1835 y(Compatibilit)n(y)f(Lev)n(el)10 b Fc(:)j(:)g(:)g(:)g(:)g(:)h(:)f |
22250 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
fffe80d4 | 22251 | g(:)g(:)25 b Fb(109)150 1924 y(Compatibilit)n(y)i(Mo)r(de)22 |
d37a4722 | 22252 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
fffe80d4 | 22253 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)36 b Fb(109)150 |
d37a4722 CR |
22254 | 2013 y(completion)27 b(builtins)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f |
22255 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
fffe80d4 | 22256 | g(:)g(:)36 b Fb(145)150 2101 y(con\014guration)22 b Fc(:)13 |
0fcb3344 CR |
22257 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
22258 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 | |
fffe80d4 | 22259 | b Fb(157)150 2190 y(con)n(trol)26 b(op)r(erator)8 b Fc(:)15 |
0fcb3344 CR |
22260 | b(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
22261 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 | |
d37a4722 | 22262 | b Fb(3)150 2277 y(copro)r(cess)18 b Fc(:)c(:)f(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 CR |
22263 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
22264 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)32 b | |
e59452c7 CR |
22265 | Fb(18)146 2553 y Fs(D)150 2672 y Fb(directory)26 b(stac)n(k)9 |
22266 | b Fc(:)k(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
22267 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 | |
22268 | b Fb(101)146 2948 y Fs(E)150 3069 y Fb(editing)i(command)g(lines)17 | |
0fcb3344 | 22269 | b Fc(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
fffe80d4 | 22270 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(117)150 3158 y(en)n(vironmen)n(t)18 |
0fcb3344 CR |
22271 | b Fc(:)12 b(:)h(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
22272 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
3011048a | 22273 | f(:)32 b Fb(44)150 3247 y(ev)l(aluation,)26 b(arithmetic)12 |
0fcb3344 | 22274 | b Fc(:)i(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
e59452c7 | 22275 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)26 b Fb(97)150 3335 |
0fcb3344 | 22276 | y(ev)n(en)n(t)f(designators)c Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
037a8b7f | 22277 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 22278 | g(:)h(:)34 b Fb(154)150 3424 y(execution)26 b(en)n(vironmen)n(t)17 |
0fcb3344 | 22279 | b Fc(:)12 b(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
e59452c7 | 22280 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)31 b Fb(42)150 3513 |
0fcb3344 CR |
22281 | y(exit)25 b(status)7 b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
22282 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
e59452c7 | 22283 | (:)f(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(3,)k(44)150 3602 y(expansion)9 |
0fcb3344 CR |
22284 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
22285 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
e59452c7 | 22286 | g(:)g(:)g(:)g(:)24 b Fb(24)150 3691 y(expansion,)i(arithmetic)18 |
0fcb3344 | 22287 | b Fc(:)c(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
e59452c7 | 22288 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)32 b Fb(34)150 3779 |
0fcb3344 | 22289 | y(expansion,)26 b(brace)16 b Fc(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
8a0829e9 | 22290 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 22291 | f(:)g(:)g(:)30 b Fb(24)150 3868 y(expansion,)c(\014lename)18 |
0fcb3344 | 22292 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
e59452c7 | 22293 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)32 b Fb(35)150 |
d37a4722 | 22294 | 3957 y(expansion,)26 b(parameter)21 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g |
0fcb3344 | 22295 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
e59452c7 | 22296 | g(:)34 b Fb(26)150 4046 y(expansion,)26 b(pathname)7 |
0fcb3344 | 22297 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
e59452c7 | 22298 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fb(35)150 |
d37a4722 | 22299 | 4134 y(expansion,)k(tilde)14 b Fc(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 22300 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22301 | h(:)f(:)g(:)g(:)g(:)28 b Fb(25)150 4223 y(expressions,)f(arithmetic)13 |
0fcb3344 | 22302 | b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 22303 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)27 b Fb(97)150 4310 y(expressions,)g |
0fcb3344 | 22304 | (conditional)17 b Fc(:)d(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
e59452c7 CR |
22305 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)32 b Fb(95)2021 |
22306 | 294 y Fs(F)2025 414 y Fb(\014eld)21 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g | |
0fcb3344 CR |
22307 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
22308 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 22309 | (:)h(:)36 b Fb(3)2025 503 y(\014lename)21 b Fc(:)14 b(:)f(:)g(:)g(:)g |
0fcb3344 CR |
22310 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
22311 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)36 | |
e59452c7 | 22312 | b Fb(3)2025 591 y(\014lename)26 b(expansion)11 b Fc(:)i(:)h(:)f(:)g(:)g |
037a8b7f | 22313 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22314 | g(:)g(:)h(:)f(:)g(:)g(:)26 b Fb(35)2025 680 y(foreground)9 |
4d63a619 CR |
22315 | b Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
22316 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
fffe80d4 | 22317 | h(:)f(:)24 b Fb(112)2025 767 y(functions,)i(shell)9 b |
4d63a619 | 22318 | Fc(:)14 b(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 22319 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 |
e59452c7 | 22320 | b Fb(19)2021 1038 y Fs(H)2025 1158 y Fb(history)h(builtins)20 |
0fcb3344 CR |
22321 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
22322 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)35 | |
fffe80d4 | 22323 | b Fb(151)2025 1247 y(history)25 b(ev)n(en)n(ts)8 b Fc(:)13 |
037a8b7f | 22324 | b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 22325 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 |
fffe80d4 | 22326 | b Fb(154)2025 1335 y(history)i(expansion)14 b Fc(:)g(:)f(:)g(:)g(:)h(:) |
0fcb3344 | 22327 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22328 | (:)g(:)g(:)g(:)h(:)f(:)29 b Fb(153)2025 1424 y(history)c(list)9 |
0fcb3344 CR |
22329 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
22330 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
fffe80d4 | 22331 | g(:)g(:)24 b Fb(151)2025 1511 y(History)-6 b(,)25 b(ho)n(w)h(to)g(use) |
0fcb3344 | 22332 | 19 b Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
fffe80d4 | 22333 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)34 b Fb(150)2021 |
e59452c7 | 22334 | 1782 y Fs(I)2025 1903 y Fb(iden)n(ti\014er)12 b Fc(:)g(:)h(:)h(:)f(:)g |
0fcb3344 CR |
22335 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
22336 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)27 | |
e59452c7 | 22337 | b Fb(3)2025 1991 y(initialization)h(\014le,)e(readline)17 |
0fcb3344 | 22338 | b Fc(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
fffe80d4 | 22339 | f(:)g(:)g(:)g(:)32 b Fb(119)2025 2080 y(installation)21 |
0fcb3344 CR |
22340 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
22341 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) | |
fffe80d4 | 22342 | g(:)34 b Fb(157)2025 2168 y(in)n(teraction,)26 b(readline)7 |
0fcb3344 | 22343 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 22344 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)22 b Fb(116)2025 |
e59452c7 | 22345 | 2257 y(in)n(teractiv)n(e)k(shell)20 b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g |
0fcb3344 | 22346 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22347 | h(:)f(:)g(:)34 b Fb(92,)27 b(93)2025 2346 y(in)n(ternationalization)22 |
0fcb3344 CR |
22348 | b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
22349 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)35 | |
e59452c7 CR |
22350 | b Fb(7)2025 2433 y(in)n(ternationalized)27 b(scripts)13 |
22351 | b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
22352 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)28 b Fb(7)2021 2704 y | |
22353 | Fs(J)2025 2824 y Fb(job)23 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g | |
8a0829e9 | 22354 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 CR |
22355 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
22356 | (:)38 b Fb(3)2025 2911 y(job)26 b(con)n(trol)17 b Fc(:)d(:)f(:)g(:)g(:) | |
22357 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
fffe80d4 | 22358 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)31 b Fb(3,)c(112)2021 |
e59452c7 CR |
22359 | 3183 y Fs(K)2025 3303 y Fb(kill)f(ring)7 b Fc(:)14 b(:)f(:)g(:)g(:)g(:) |
22360 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
22361 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)22 | |
fffe80d4 | 22362 | b Fb(118)2025 3390 y(killing)k(text)6 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g |
4d63a619 | 22363 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
e59452c7 | 22364 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)21 b |
fffe80d4 | 22365 | Fb(118)2021 3661 y Fs(L)2025 3782 y Fb(lo)r(calization)i |
e59452c7 CR |
22366 | Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
22367 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
22368 | g(:)g(:)h(:)35 b Fb(7)2025 3869 y(login)26 b(shell)6 | |
22369 | b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h | |
22370 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
22371 | g(:)g(:)g(:)g(:)21 b Fb(92)2021 4140 y Fs(M)2025 4260 | |
22372 | y Fb(matc)n(hing,)26 b(pattern)9 b Fc(:)k(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
22373 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
22374 | h(:)f(:)g(:)g(:)24 b Fb(36)2025 4347 y(metac)n(haracter)7 | |
22375 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
22376 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
22377 | h(:)22 b Fb(3)p eop end | |
5e6f45d9 CR |
22378 | %%Page: 189 195 |
22379 | TeXDict begin 189 194 bop 150 -116 a Fu(App)s(endix)29 | |
22380 | b(D:)i(Indexes)2623 b(189)146 294 y Fs(N)150 410 y Fb(name)19 | |
0fcb3344 | 22381 | b Fc(:)14 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
037a8b7f | 22382 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
0fcb3344 CR |
22383 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)34 b Fb(3)150 497 |
22384 | y(nativ)n(e)25 b(languages)c Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
037a8b7f | 22385 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) |
0fcb3344 CR |
22386 | h(:)f(:)g(:)g(:)g(:)34 b Fb(7)150 584 y(notation,)27 |
22387 | b(readline)13 b Fc(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
22388 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)27 | |
fffe80d4 | 22389 | b Fb(117)146 826 y Fs(O)150 942 y Fb(op)r(erator,)g(shell)c |
0fcb3344 CR |
22390 | Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
22391 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 22392 | 37 b Fb(3)146 1184 y Fs(P)150 1300 y Fb(parameter)26 |
0fcb3344 CR |
22393 | b(expansion)13 b Fc(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
22394 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)28 | |
e59452c7 | 22395 | b Fb(26)150 1388 y(parameters)c Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
74d0116b | 22396 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 CR |
22397 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)37 b Fb(21)150 |
22398 | 1475 y(parameters,)27 b(p)r(ositional)7 b Fc(:)15 b(:)e(:)g(:)g(:)g(:)g | |
037a8b7f | 22399 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 22400 | f(:)g(:)21 b Fb(22)150 1562 y(parameters,)27 b(sp)r(ecial)7 |
0fcb3344 CR |
22401 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
22402 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)21 | |
e59452c7 | 22403 | b Fb(23)150 1649 y(pathname)k(expansion)18 b Fc(:)c(:)f(:)g(:)g(:)g(:)g |
037a8b7f | 22404 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22405 | h(:)f(:)g(:)32 b Fb(35)150 1736 y(pattern)25 b(matc)n(hing)c |
0fcb3344 CR |
22406 | Fc(:)13 b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
22407 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)34 | |
e59452c7 CR |
22408 | b Fb(36)150 1824 y(pip)r(eline)10 b Fc(:)j(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
22409 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
22410 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 | |
22411 | b Fb(10)150 1911 y(POSIX)e Fc(:)13 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
22412 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
22413 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)38 | |
22414 | b Fb(3)150 1998 y(POSIX)25 b(Mo)r(de)14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:) | |
602eae4d | 22415 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g |
e59452c7 | 22416 | (:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)29 b Fb(105)150 2085 |
602eae4d CR |
22417 | y(pro)r(cess)e(group)15 b Fc(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
22418 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g | |
e59452c7 | 22419 | (:)g(:)g(:)g(:)g(:)h(:)f(:)30 b Fb(3)150 2172 y(pro)r(cess)d(group)e |
602eae4d CR |
22420 | (ID)11 b Fc(:)i(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g |
22421 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)26 | |
e59452c7 | 22422 | b Fb(3)150 2259 y(pro)r(cess)h(substitution)11 b Fc(:)h(:)i(:)f(:)g(:)g |
0fcb3344 | 22423 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
e59452c7 | 22424 | g(:)h(:)f(:)g(:)g(:)25 b Fb(34)150 2347 y(programmable)i(completion)8 |
602eae4d | 22425 | b Fc(:)14 b(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
fffe80d4 | 22426 | (:)h(:)f(:)g(:)g(:)23 b Fb(142)150 2434 y(prompting)15 |
e59452c7 CR |
22427 | b Fc(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
22428 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
22429 | (:)g(:)30 b Fb(103)146 2676 y Fs(Q)150 2792 y Fb(quoting)16 | |
602eae4d CR |
22430 | b Fc(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) |
22431 | g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
e59452c7 | 22432 | (:)g(:)h(:)f(:)g(:)g(:)g(:)31 b Fb(6)150 2879 y(quoting,)26 |
602eae4d CR |
22433 | b(ANSI)18 b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g |
22434 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 22435 | h(:)f(:)g(:)34 b Fb(6)146 3121 y Fs(R)150 3237 y Fb(Readline,)26 |
602eae4d CR |
22436 | b(ho)n(w)g(to)g(use)11 b Fc(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h |
22437 | (:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)26 | |
fffe80d4 | 22438 | b Fb(115)150 3325 y(redirection)13 b Fc(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g |
602eae4d | 22439 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
e59452c7 CR |
22440 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)27 b Fb(37)150 |
22441 | 3412 y(reserv)n(ed)f(w)n(ord)13 b Fc(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
602eae4d | 22442 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
e59452c7 | 22443 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)28 b Fb(3)150 3499 |
d37a4722 CR |
22444 | y(reserv)n(ed)e(w)n(ords)15 b Fc(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) |
22445 | g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g | |
e59452c7 | 22446 | (:)g(:)g(:)g(:)h(:)f(:)g(:)30 b Fb(9)150 3586 y(restricted)c(shell)12 |
d37a4722 CR |
22447 | b Fc(:)i(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
22448 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)27 | |
e59452c7 | 22449 | b Fb(104)150 3673 y(return)e(status)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)g |
d37a4722 CR |
22450 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) |
22451 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)25 b Fb(4)2021 | |
e59452c7 | 22452 | 294 y Fs(S)2025 427 y Fb(shell)h(arithmetic)17 b Fc(:)d(:)f(:)g(:)g(:)g |
d37a4722 | 22453 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:) |
e59452c7 | 22454 | f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)31 b Fb(97)2025 520 |
d37a4722 | 22455 | y(shell)26 b(function)18 b Fc(:)13 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
0fcb3344 | 22456 | h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
e59452c7 | 22457 | (:)g(:)g(:)g(:)g(:)g(:)h(:)32 b Fb(19)2025 613 y(shell)26 |
d37a4722 CR |
22458 | b(script)10 b Fc(:)k(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
22459 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f | |
3011048a | 22460 | (:)g(:)g(:)g(:)g(:)g(:)25 b Fb(46)2025 706 y(shell)h(v)l(ariable)7 |
d37a4722 CR |
22461 | b Fc(:)14 b(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
22462 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) | |
e59452c7 | 22463 | g(:)22 b Fb(21)2025 798 y(shell,)k(in)n(teractiv)n(e)21 |
d37a4722 CR |
22464 | b Fc(:)13 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f |
22465 | (:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)34 | |
e59452c7 | 22466 | b Fb(93)2025 891 y(signal)13 b Fc(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
d37a4722 CR |
22467 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) |
22468 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)28 | |
e59452c7 | 22469 | b Fb(4)2025 984 y(signal)f(handling)6 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g |
602eae4d | 22470 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) |
3011048a | 22471 | g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21 b Fb(45)2025 1077 |
d37a4722 CR |
22472 | y(sp)r(ecial)27 b(builtin)16 b Fc(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h |
22473 | (:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) | |
e59452c7 | 22474 | g(:)g(:)g(:)g(:)31 b Fb(4,)26 b(76)2025 1170 y(startup)f(\014les)10 |
d37a4722 CR |
22475 | b Fc(:)k(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) |
22476 | g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g | |
e59452c7 CR |
22477 | (:)g(:)25 b Fb(92)2025 1262 y(string)h(translations)8 |
22478 | b Fc(:)14 b(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
22479 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 | |
22480 | b Fb(7)2025 1350 y(susp)r(ending)i(jobs)10 b Fc(:)k(:)f(:)g(:)h(:)f(:)g | |
22481 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
fffe80d4 | 22482 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)25 b Fb(112)2021 1710 y Fs(T)2025 |
e59452c7 CR |
22483 | 1843 y Fb(tilde)h(expansion)7 b Fc(:)13 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
22484 | (:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
22485 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)22 b Fb(25)2025 1936 y(tok)n(en)17 | |
22486 | b Fc(:)12 b(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g | |
22487 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) | |
22488 | f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)32 b Fb(4)2025 2023 | |
22489 | y(translation,)27 b(nativ)n(e)e(languages)c Fc(:)13 b(:)g(:)g(:)g(:)g | |
22490 | (:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)34 | |
22491 | b Fb(7)2021 2384 y Fs(V)2025 2517 y Fb(v)l(ariable,)26 | |
22492 | b(shell)14 b Fc(:)g(:)f(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
22493 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) | |
22494 | g(:)g(:)28 b Fb(21)2025 2604 y(v)l(ariables,)f(readline)7 | |
22495 | b Fc(:)13 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g | |
22496 | (:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 | |
fffe80d4 | 22497 | b Fb(120)2021 2965 y Fs(W)2025 3098 y Fb(w)n(ord)10 b |
037a8b7f CR |
22498 | Fc(:)j(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g |
22499 | (:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) | |
e59452c7 | 22500 | g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)25 b Fb(4)2025 3185 |
037a8b7f CR |
22501 | y(w)n(ord)h(splitting)9 b Fc(:)14 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
22502 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) | |
3011048a | 22503 | g(:)h(:)f(:)g(:)g(:)g(:)24 b Fb(35)2021 3545 y Fs(Y)2025 |
e59452c7 | 22504 | 3673 y Fb(y)n(anking)h(text)13 b Fc(:)f(:)h(:)g(:)g(:)h(:)f(:)g(:)g(:)g |
037a8b7f | 22505 | (:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) |
fffe80d4 | 22506 | g(:)h(:)f(:)g(:)g(:)g(:)g(:)28 b Fb(118)p eop end |
5e13499c | 22507 | %%Trailer |
37c41ab1 | 22508 | |
5e13499c CR |
22509 | userdict /end-hook known{end-hook}if |
22510 | %%EOF |