From: Chet Ramey Date: Wed, 23 Nov 2011 23:39:33 +0000 (-0500) Subject: Readline-2.0 import: initial import X-Git-Tag: readline-6.3~27 X-Git-Url: http://git.ipfire.org/?a=commitdiff_plain;h=06cd36cdc90634c88636a6d09230c573078ead0e;p=thirdparty%2Freadline.git Readline-2.0 import: initial import --- 06cd36cdc90634c88636a6d09230c573078ead0e diff --git a/COPYING b/COPYING new file mode 100644 index 0000000..1bb82d1 --- /dev/null +++ b/COPYING @@ -0,0 +1,257 @@ + + GNU GENERAL PUBLIC LICENSE + Version 1, February 1989 + + Copyright (C) 1989 Free Software Foundation, Inc. + 675 Mass Ave, Cambridge, MA 02139, USA + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + +The Free Software Foundation has exempted Bash from the requirement of +Paragraph 2c of the General Public License. This is to say, there is +no requirement for Bash to print a notice when it is started +interactively in the usual way. We made this exception because users +and standards expect shells not to print such messages. This +exception applies to any program that serves as a shell and that is +based primarily on Bash as opposed to other GNU software. + + Preamble + + The license agreements of most software companies try to keep users +at the mercy of those companies. By contrast, our General Public +License is intended to guarantee your freedom to share and change free +software--to make sure the software is free for all its users. The +General Public License applies to the Free Software Foundation's +software and to any other program whose authors commit to using it. +You can use it for your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Specifically, the General Public License is designed to make +sure that you have the freedom to give away or sell copies of free +software, that you receive source code or can get it if you want it, +that you can change the software or use pieces of it in new free +programs; and that you know you can do these things. + + To protect your rights, we need to make restrictions that forbid +anyone to deny you these rights or to ask you to surrender the rights. +These restrictions translate to certain responsibilities for you if you +distribute copies of the software, or if you modify it. + + For example, if you distribute copies of a such a program, whether +gratis or for a fee, you must give the recipients all the rights that +you have. You must make sure that they, too, receive or can get the +source code. And you must tell them their rights. + + We protect your rights with two steps: (1) copyright the software, and +(2) offer you this license which gives you legal permission to copy, +distribute and/or modify the software. + + Also, for each author's protection and ours, we want to make certain +that everyone understands that there is no warranty for this free +software. If the software is modified by someone else and passed on, we +want its recipients to know that what they have is not the original, so +that any problems introduced by others will not reflect on the original +authors' reputations. + + The precise terms and conditions for copying, distribution and +modification follow. + + GNU GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License Agreement applies to any program or other work which +contains a notice placed by the copyright holder saying it may be +distributed under the terms of this General Public License. The +"Program", below, refers to any such program or work, and a "work based +on the Program" means either the Program or any work containing the +Program or a portion of it, either verbatim or with modifications. Each +licensee is addressed as "you". + + 1. You may copy and distribute verbatim copies of the Program's source +code as you receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice and +disclaimer of warranty; keep intact all the notices that refer to this +General Public License and to the absence of any warranty; and give any +other recipients of the Program a copy of this General Public License +along with the Program. You may charge a fee for the physical act of +transferring a copy. + + 2. You may modify your copy or copies of the Program or any portion of +it, and copy and distribute such modifications under the terms of Paragraph +1 above, provided that you also do the following: + + a) cause the modified files to carry prominent notices stating that + you changed the files and the date of any change; and + + b) cause the whole of any work that you distribute or publish, that + in whole or in part contains the Program or any part thereof, either + with or without modifications, to be licensed at no charge to all + third parties under the terms of this General Public License (except + that you may choose to grant warranty protection to some or all + third parties, at your option). + + c) If the modified program normally reads commands interactively when + run, you must cause it, when started running for such interactive use + in the simplest and most usual way, to print or display an + announcement including an appropriate copyright notice and a notice + that there is no warranty (or else, saying that you provide a + warranty) and that users may redistribute the program under these + conditions, and telling the user how to view a copy of this General + Public License. + + d) You may charge a fee for the physical act of transferring a + copy, and you may at your option offer warranty protection in + exchange for a fee. + +Mere aggregation of another independent work with the Program (or its +derivative) on a volume of a storage or distribution medium does not bring +the other work under the scope of these terms. + + 3. You may copy and distribute the Program (or a portion or derivative of +it, under Paragraph 2) in object code or executable form under the terms of +Paragraphs 1 and 2 above provided that you also do one of the following: + + a) accompany it with the complete corresponding machine-readable + source code, which must be distributed under the terms of + Paragraphs 1 and 2 above; or, + + b) accompany it with a written offer, valid for at least three + years, to give any third party free (except for a nominal charge + for the cost of distribution) a complete machine-readable copy of the + corresponding source code, to be distributed under the terms of + Paragraphs 1 and 2 above; or, + + c) accompany it with the information you received as to where the + corresponding source code may be obtained. (This alternative is + allowed only for noncommercial distribution and only if you + received the program in object code or executable form alone.) + +Source code for a work means the preferred form of the work for making +modifications to it. For an executable file, complete source code means +all the source code for all modules it contains; but, as a special +exception, it need not include source code for modules which are standard +libraries that accompany the operating system on which the executable +file runs, or for standard header files or definitions files that +accompany that operating system. + + 4. You may not copy, modify, sublicense, distribute or transfer the +Program except as expressly provided under this General Public License. +Any attempt otherwise to copy, modify, sublicense, distribute or transfer +the Program is void, and will automatically terminate your rights to use +the Program under this License. However, parties who have received +copies, or rights to use copies, from you under this General Public +License will not have their licenses terminated so long as such parties +remain in full compliance. + + 5. By copying, distributing or modifying the Program (or any work based +on the Program) you indicate your acceptance of this license to do so, +and all its terms and conditions. + + 6. Each time you redistribute the Program (or any work based on the +Program), the recipient automatically receives a license from the original +licensor to copy, distribute or modify the Program subject to these +terms and conditions. You may not impose any further restrictions on the +recipients' exercise of the rights granted herein. + + 7. The Free Software Foundation may publish revised and/or new versions +of the General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + +Each version is given a distinguishing version number. If the Program +specifies a version number of the license which applies to it and "any +later version", you have the option of following the terms and conditions +either of that version or of any later version published by the Free +Software Foundation. If the Program does not specify a version number of +the license, you may choose any version ever published by the Free Software +Foundation. + + 8. If you wish to incorporate parts of the Program into other free +programs whose distribution conditions are different, write to the author +to ask for permission. For software which is copyrighted by the Free +Software Foundation, write to the Free Software Foundation; we sometimes +make exceptions for this. Our decision will be guided by the two goals +of preserving the free status of all derivatives of our free software and +of promoting the sharing and reuse of software generally. + + NO WARRANTY + + 9. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY +FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN +OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES +PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED +OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS +TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE +PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, +REPAIR OR CORRECTION. + + 10. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR +REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, +INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING +OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED +TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY +YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER +PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE +POSSIBILITY OF SUCH DAMAGES. + + END OF TERMS AND CONDITIONS + + Appendix: How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to humanity, the best way to achieve this is to make it +free software which everyone can redistribute and change under these +terms. + + To do so, attach the following notices to the program. It is safest to +attach them to the start of each source file to most effectively convey +the exclusion of warranty; and each file should have at least the +"copyright" line and a pointer to where the full notice is found. + + + Copyright (C) 19yy + + This program is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program; if not, write to the Free Software + Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. + +Also add information on how to contact you by electronic and paper mail. + +If the program is interactive, make it output a short notice like this +when it starts in an interactive mode: + + Gnomovision version 69, Copyright (C) 19xx name of author + Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the +appropriate parts of the General Public License. Of course, the +commands you use may be called something other than `show w' and `show +c'; they could even be mouse-clicks or menu items--whatever suits your +program. + +You should also get your employer (if you work as a programmer) or your +school, if any, to sign a "copyright disclaimer" for the program, if +necessary. Here a sample; alter the names: + + Yoyodyne, Inc., hereby disclaims all copyright interest in the + program `Gnomovision' (a program to direct compilers to make passes + at assemblers) written by James Hacker. + + , 1 April 1989 + Ty Coon, President of Vice + +That's all there is to it! diff --git a/ChangeLog b/ChangeLog new file mode 100644 index 0000000..1cf0c00 --- /dev/null +++ b/ChangeLog @@ -0,0 +1,403 @@ +Tue Mar 23 14:36:51 1993 Brian Fox (bfox@eos.crseo.ucsb.edu) + + * readline.c (rl_copy): Changed name to rl_copy_text. + +Mon Mar 22 19:16:05 1993 Brian Fox (bfox@eos.crseo.ucsb.edu) + + * dispose_cmd.c, several other files. Declare dispose_xxx () as + "void". + + * builtins/hashcom.h: Make declarations of hashed_filenames be + "extern" to keep the SGI compiler happy. + + * readline.c (rl_initialize_everything): Assign values to + out_stream and in_stream immediately, since + output_character_function () can be called before + readline_internal () is called. + +Tue Dec 8 09:30:56 1992 Brian Fox (bfox@cubit) + + * readline.c (rl_init_terminal) Set PC from BC, not from *buffer. + +Mon Nov 30 09:35:47 1992 Brian Fox (bfox@cubit) + + * readline.c (invoking_keyseqs_in_map, rl_parse_and_bind) Allow + backslash to quote characters, such as backslash, double quote, + and space. Backslash quotes all character indiscriminately. + + * funmap.c (vi_keymap) Fix type in "vi-replace" declaration. + +Fri Nov 20 10:55:05 1992 Brian Fox (bfox@cubit) + + * readline.c (init_terminal_io, rl_prep_terminal): FINALLY! + Declare and use termcap variable `ospeed' when setting up terminal + parameters. + +Thu Oct 8 08:53:07 1992 Brian J. Fox (bfox@helios) + + * Makefile, this directory: Include (as links to the canonical + sources), tilde.c, tilde.h, posixstat.h and xmalloc.c. + +Tue Sep 29 13:07:21 1992 Brian J. Fox (bfox@helios) + + * readline.c (init_terminal_io) Don't set arrow keys if the key + sequences that represent them are already set. + + * readline.c (rl_function_of_keyseq) New function returns the first + function (or macro) found while searching a key sequence. + +Mon Sep 28 00:34:04 1992 Brian J. Fox (bfox@helios) + + * readline.c (LibraryVersion) New static char * contains current + version number. Version is at 2.0. + + * readline.c (rl_complete_internal): Incorporated clean changes + from gilmore (gnu@cygnus.com) to support quoted substrings within + completion functions. + + * readline.c (many locations) Added support for the _GO32_, + whatever that is. Patches supplied by Cygnus, typed in by hand, + with cleanups. + +Sun Aug 16 12:46:24 1992 Brian Fox (bfox@cubit) + + * readline.c (init_terminal_io): Find out the values of the keypad + arrows and bind them to appropriate RL functions if present. + +Mon Aug 10 18:13:24 1992 Brian Fox (bfox@cubit) + + * history.c (stifle_history): A negative argument to stifle + becomes zero. + +Tue Jul 28 09:28:41 1992 Brian Fox (bfox@cubit) + + * readline.c (rl_variable_bind): New local structure describes + booleans by name and address; code in rl_variable_bind () looks at + structure to set simple variables. + + * parens.c (rl_insert_close): New variable rl_blink_matching_paren + is non-zero if we want to blink the matching open when a close is + inserted. If FD_SET is defined, rl_blink_matching_paren defaults + to 1, else 0. If FD_SET is not defined, and + rl_blink_matching_paren is non-zero, the close character(s) are/is + simply inserted. + +Wed Jul 22 20:03:59 1992 Brian Fox (bfox@cubit) + + * history.c, readline.c, vi_mode.c: Cause the functions strchr () + and strrchr () to be used instead of index () and rindex () + throughout the source. + +Mon Jul 13 11:34:07 1992 Brian Fox (bfox@cubit) + + * readline.c: (rl_variable_bind) New variable "meta-flag" if "on" + means force the use of the 8th bit as Meta bit. Internal variable + is called meta_flag. + +Thu Jul 9 10:37:56 1992 Brian Fox (bfox@cubit) + + * history.c (get_history_event) Change INDEX to LOCAL_INDEX. If + compiling for the shell, allow shell metacharacters to separate + history tokens as they would for shell tokens. + +Sat Jul 4 19:29:12 1992 Brian Fox (bfox@cubit) + + * vi_keymap.c: According to Posix, TAB self-inserts instead of + doing completion. + + * vi_mode.c: (rl_vi_yank_arg) Enter VI insert mode after yanking + an arg from the previous line. + + * search.c: New file takes over vi style searching and implements + non-incremental searching the history. + + Makefile: Add search.c and search.o. + + funmap.c: Add names for non-incremental-forward-search-history and + non-incremental-reverse-search-history. + + readline.h: Add extern definitions for non-incremental searching. + + vi_mode.c: Remove old search code; add calls to code in search.c. + +Fri Jul 3 10:36:33 1992 Brian Fox (bfox@cubit) + + * readline.c (rl_delete_horizontal_space); New function deletes + all whitespace surrounding point. + + funmap.c: Add "delete-horizontal-space". + emacs_keymap.c: Put rl_delete_horizontal_space () on M-\. + + * readline.c (rl_set_signals, rl_clear_signals); New function + rl_set_sighandler () is either defined in a Posix way (if + HAVE_POSIX_SIGNALS is defined) or in a BSD way. Function is + called from rl_set_signals () and rl_clear_signals (). + +Fri May 8 12:50:15 1992 Brian Fox (bfox@cubit) + + * readline.c: (readline_default_bindings) Do comparisons with + _POSIX_VDISABLE casted to `unsigned char'. Change tty characters + to be unsigned char. + +Thu Apr 30 12:36:35 1992 Brian Fox (bfox@cubit) + + * readline.c: (rl_getc) Handle "read would block" error on + non-blocking IO streams. + + * readline.c: (rl_signal_handler): Unblock only the signal that we + have caught, not all signals. + +Sun Feb 23 03:33:09 1992 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: Many functions. Use only the macros META_CHAR and + UNMETA to deal with meta characters. Prior to this, we used + numeric values and tests. + + * readline.c (rl_complete_internal) Report exactly the number of + possible completions, not the number + 1. + + * vi_mode.c (rl_do_move) Do not change the cursor position when + using `cw' or `cW'. + + * vi_mode.c (rl_vi_complete) Enter insert mode after completing + with `*' or `\'. + +Fri Feb 21 05:58:18 1992 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (rl_dispatch) Increment rl_key_sequence_length for + meta characters that map onto ESC map. + +Mon Feb 10 01:41:35 1992 Brian Fox (bfox at gnuwest.fsf.org) + + * history.c (history_do_write) Build a buffer of all of the lines + to write and write them in one fell swoop (lower overhead than + calling write () for each line). Suggested by Peter Ho. + + * readline.c: Include hbullx20 as well as hpux for determining + USGr3ness. + + * readline.c (rl_unix_word_rubout) As per the "Now REMEMBER" + comment, pass arguments to rl_kill_text () in the correct order to + preserve prepending and appending of killed text. + + * readline.c (rl_search_history) malloc (), realloc (), and free + () SEARCH_STRING so that there are no static limits on searching. + + * vi_mode.c (rl_vi_subst) Don't forget to end the undo group. + +Fri Jan 31 14:51:02 1992 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (rl_signal_handler): Zero the current history entry's + pointer after freeing the undo_list when SIGINT received. + Reformat a couple of functions. + +Sat Jan 25 13:47:35 1992 Brian Fox (bfox at bears) + + * readline.c (parser_if): free () TNAME after use. + +Tue Jan 21 01:01:35 1992 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (rl_redisplay) and (rl_character_len): Display + Control characters as "^c" and Meta characters as "\234", instead + of "C-C" and "M-C". + +Sun Dec 29 10:59:00 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (init_terminal_io) Default to environment variables + LINES and COLUMNS before termcap entry values. If all else fails, + then assume 80x24 terminal. + +Sat Dec 28 16:33:11 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: If this machine is USG and it is hpux, then define + USGr3. + + * history.c: Cosmetic fixes. + +Thu Nov 21 00:10:12 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * vi_mode.c: (rl_do_move) Place cursor at end of line, never at + next to last character. + +Thu Nov 14 05:08:01 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * history.c (get_history_event) Non-anchored searches can have a + return index of greater than zero from get_history_event (). + +Fri Nov 1 07:02:13 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (rl_translate_keyseq) Make C-? translate to RUBOUT + unconditionally. + +Mon Oct 28 11:34:52 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c; Use Posix directory routines and macros. + + * funmap.c; Add entry for call-last-kbd-macro. + + * readline.c (rl_prep_term); Use system EOF character on POSIX + systems also. + +Thu Oct 3 16:19:53 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c; Make a distinction between having a TERMIOS tty + driver, and having POSIX signal handling. You might one without + the other. New defines used HAVE_POSIX_SIGNALS, and + TERMIOS_TTY_DRIVER. + +Tue Jul 30 22:37:26 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: rl_getc () If a call to read () returns without an + error, but with zero characters, the file is empty, so return EOF. + +Thu Jul 11 20:58:38 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: (rl_get_next_history, rl_get_previous_history) + Reallocate the buffer space if the line being moved to is longer + the the current space allocated. Amazing that no one has found + this bug until now. + +Sun Jul 7 02:37:05 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c:(rl_parse_and_bind) Allow leading whitespace. + Make sure TERMIO and TERMIOS systems treat CR and NL + disctinctly. + +Tue Jun 25 04:09:27 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: Rework parsing conditionals to pay attention to the + prior states of the conditional stack. This makes $if statements + work correctly. + +Mon Jun 24 20:45:59 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: support for displaying key binding information + includes the functions rl_list_funmap_names (), + invoking_keyseqs_in_map (), rl_invoking_keyseqs (), + rl_dump_functions (), and rl_function_dumper (). + + funmap.c: support for same includes rl_funmap_names (). + + readline.c, funmap.c: no longer define STATIC_MALLOC. However, + update both version of xrealloc () to handle a null pointer. + +Thu Apr 25 12:03:49 1991 Brian Fox (bfox at gnuwest.fsf.org) + + * vi_mode.c (rl_vi_fword, fWord, etc. All functions use + the macro `isident()'. Fixed movement bug which prevents + continious movement through the text. + +Fri Jul 27 16:47:01 1990 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (parser_if) Allow "$if term=foo" construct. + +Wed May 23 16:10:33 1990 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c (rl_dispatch) Correctly remember the last command + executed. Fixed typo in username_completion_function (). + +Mon Apr 9 19:55:48 1990 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: username_completion_function (); For text passed in + with a leading `~', remember that this could be a filename (after + it is completed). + +Thu Apr 5 13:44:24 1990 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: rl_search_history (): Correctly handle case of an + unfound search string, but a graceful exit (as with ESC). + + * readline.c: rl_restart_output (); The Apollo passes the address + of the file descriptor to TIOCSTART, not the descriptor itself. + +Tue Mar 20 05:38:55 1990 Brian Fox (bfox at gnuwest.fsf.org) + + * readline.c: rl_complete (); second call in a row causes possible + completions to be listed. + + * readline.c: rl_redisplay (), added prompt_this_line variable + which is the first character character following \n in prompt. + +Sun Mar 11 04:32:03 1990 Brian Fox (bfox at gnuwest.fsf.org) + + * Signals are now supposedly handled inside of SYSV compilation. + +Wed Jan 17 19:24:09 1990 Brian Fox (bfox at sbphy.ucsb.edu) + + * history.c: history_expand (); fixed overwriting memory error, + added needed argument to call to get_history_event (). + +Thu Jan 11 10:54:04 1990 Brian Fox (bfox at sbphy.ucsb.edu) + + * readline.c: added mark_modified_lines to control the + display of an asterisk on modified history lines. Also + added a user variable called mark-modified-lines to the + `set' command. + +Thu Jan 4 10:38:05 1990 Brian Fox (bfox at sbphy.ucsb.edu) + + * readline.c: start_insert (). Only use IC if we don't have an im + capability. + +Fri Sep 8 09:00:45 1989 Brian Fox (bfox at aurel) + + * readline.c: rl_prep_terminal (). Only turn on 8th bit + as meta-bit iff the terminal is not using parity. + +Sun Sep 3 08:57:40 1989 Brian Fox (bfox at aurel) + + * readline.c: start_insert (). Uses multiple + insertion call in cases where that makes sense. + + rl_insert (). Read type-ahead buffer for additional + keys that are bound to rl_insert, and insert them + all at once. Make insertion of single keys given + with an argument much more efficient. + +Tue Aug 8 18:13:57 1989 Brian Fox (bfox at aurel) + + * readline.c: Changed handling of EOF. readline () returns + (char *)EOF or consed string. The EOF character is read from the + tty, or if the tty doesn't have one, defaults to C-d. + + * readline.c: Added support for event driven programs. + rl_event_hook is the address of a function you want called + while Readline is waiting for input. + + * readline.c: Cleanup time. Functions without type declarations + do not use return with a value. + + * history.c: history_expand () has new variable which is the + characters to ignore immediately following history_expansion_char. + +Sun Jul 16 08:14:00 1989 Brian Fox (bfox at aurel) + + * rl_prep_terminal () + BSD version turns off C-s, C-q, C-y, C-v. + + * readline.c -- rl_prep_terminal () + SYSV version hacks readline_echoing_p. + BSD version turns on passing of the 8th bit for the duration + of reading the line. + +Tue Jul 11 06:25:01 1989 Brian Fox (bfox at aurel) + + * readline.c: new variable rl_tilde_expander. + If non-null, this contains the address of a function to call if + the standard meaning for expanding a tilde fails. The function is + called with the text sans tilde (as in "foo"), and returns a + malloc()'ed string which is the expansion, or a NULL pointer if + there is no expansion. + + * readline.h - new file chardefs.h + Separates things that only readline.c needs from the standard + header file publishing interesting things about readline. + + * readline.c: + readline_default_bindings () now looks at terminal chararacters + and binds those as well. + +Wed Jun 28 20:20:51 1989 Brian Fox (bfox at aurel) + + * Made readline and history into independent libraries. + diff --git a/INSTALL b/INSTALL new file mode 100644 index 0000000..8a7d026 --- /dev/null +++ b/INSTALL @@ -0,0 +1,146 @@ + This is a generic INSTALL file for utilities distributions. +If this package does not come with, e.g., installable documentation or +data files, please ignore the references to them below. + + The `configure' shell script attempts to guess correct values for +various system-dependent variables used during compilation, and +creates the Makefile(s) (one in each subdirectory of the source +directory). In some packages it creates a C header file containing +system-dependent definitions. It also creates a file `config.status' +that you can run in the future to recreate the current configuration. + +To compile this package: + +1. Configure the package for your system. + + Normally, you just `cd' to the directory containing the package's +source code and type `./configure'. If you're using `csh' on an old +version of System V, you might need to type `sh configure' instead to +prevent `csh' from trying to execute `configure' itself. + + Running `configure' takes awhile. While it is running, it +prints some messages that tell what it is doing. If you don't want to +see any messages, run `configure' with its standard output redirected +to `/dev/null'; for example, `./configure >/dev/null'. + + To compile the package in a different directory from the one +containing the source code, you must use a version of `make' that +supports the `VPATH' variable, such as GNU `make'. `cd' to the +directory where you want the object files and executables to go and run +the `configure' script. `configure' automatically checks for the +source code in the directory that `configure' is in and in `..'. If +for some reason `configure' is not in the source code directory that +you are configuring, then it will report that it can't find the source +code. In that case, run `configure' with the option `--srcdir=DIR', +where DIR is the directory that contains the source code. + + By default, `make install' will install the package's files in +`/usr/local/bin', `/usr/local/man', etc. You can specify an +installation prefix other than `/usr/local' by giving `configure' the +option `--prefix=PATH'. Alternately, you can do so by consistently +giving a value for the `prefix' variable when you run `make', e.g., + make prefix=/usr/gnu + make prefix=/usr/gnu install + + You can specify separate installation prefixes for +architecture-specific files and architecture-independent files. If you +give `configure' the option `--exec-prefix=PATH' or set the `make' +variable `exec_prefix' to PATH, the package will use PATH as the prefix +for installing programs and libraries. Data files and documentation +will still use the regular prefix. Normally, all files are installed +using the same prefix. + + Some packages pay attention to `--with-PACKAGE' options to +`configure', where PACKAGE is something like `gnu-as' or `x' (for the +X Window System). They may also pay attention to `--enable-FEATURE' +options, where FEATURE indicates an optional part of the package. The +README should mention any `--with-' and `--enable-' options that the +package recognizes. + + `configure' also recognizes the following options: + +`--help' + Print a summary of the options to `configure', and exit. + +`--quiet' +`--silent' + Do not print messages saying which checks are being made. + +`--verbose' + Print the results of the checks. + +`--version' + Print the version of Autoconf used to generate the `configure' + script, and exit. + +`--x-includes=DIR' + X include files are in DIR. + +`--x-libraries=DIR' + X library files are in DIR. + + `configure' also accepts and ignores some other options. + + On systems that require unusual options for compilation or linking +that the package's `configure' script does not know about, you can give +`configure' initial values for variables by setting them in the +environment. In Bourne-compatible shells, you can do that on the +command line like this: + + CC='gcc -traditional' LIBS=-lposix ./configure + +On systems that have the `env' program, you can do it like this: + + env CC='gcc -traditional' LIBS=-lposix ./configure + + Here are the `make' variables that you might want to override with +environment variables when running `configure'. + + For these variables, any value given in the environment overrides the +value that `configure' would choose: + + - Variable: CC + C compiler program. The default is `cc'. + + - Variable: INSTALL + Program to use to install files. The default is `install' if you + have it, `cp' otherwise. + + For these variables, any value given in the environment is added to +the value that `configure' chooses: + + - Variable: DEFS + Configuration options, in the form `-Dfoo -Dbar...'. Do not use + this variable in packages that create a configuration header file. + + - Variable: LIBS + Libraries to link with, in the form `-lfoo -lbar...'. + + If you need to do unusual things to compile the package, we encourage +you to figure out how `configure' could check whether to do them, and +mail diffs or instructions to the address given in the README so we +can include them in the next release. + +2. Type `make' to compile the package. If you want, you can override +the `make' variables CFLAGS and LDFLAGS like this: + + make CFLAGS=-O2 LDFLAGS=-s + +3. If the package comes with self-tests and you want to run them, +type `make check'. If you're not sure whether there are any, try it; +if `make' responds with something like + make: *** No way to make target `check'. Stop. +then the package does not come with self-tests. + +4. Type `make install' to install programs, data files, and +documentation. + +5. You can remove the program binaries and object files from the +source directory by typing `make clean'. To also remove the +Makefile(s), the header file containing system-dependent definitions +(if the package uses one), and `config.status' (all the files that +`configure' created), type `make distclean'. + + The file `configure.in' is used to create `configure' by a program +called `autoconf'. You only need it if you want to regenerate +`configure' using a newer version of `autoconf'. diff --git a/MANIFEST b/MANIFEST new file mode 100644 index 0000000..007a5ca --- /dev/null +++ b/MANIFEST @@ -0,0 +1,52 @@ +doc d +examples d +COPYING f +README f +STANDALONE f +MANIFEST f +INSTALL f +acconfig.h f +config.h.in f +configure f +configure.in f +Makefile.in f +ChangeLog f +ansi_stdlib.h f +chardefs.h f +keymaps.h f +memalloc.h f +posixstat.h f +history.h f +rlconf.h f +rldefs.h f +tilde.h f +bind.c f +complete.c f +display.c f +emacs_keymap.c f +funmap.c f +history.c f +isearch.c f +keymaps.c f +parens.c f +readline.c f +readline.h f +rltty.c f +search.c f +signals.c f +tilde.c f +vi_keymap.c f +vi_mode.c f +xmalloc.c f +doc/Makefile f +doc/rlman.texinfo f +doc/rltech.texinfo f +doc/rluser.texinfo f +doc/hist.texinfo f +doc/hstech.texinfo f +doc/hsuser.texinfo f +doc/readline.3 f +examples/Makefile f +examples/fileman.c f +examples/manexamp.c f +examples/Inputrc f diff --git a/Makefile b/Makefile new file mode 100644 index 0000000..afeab8b --- /dev/null +++ b/Makefile @@ -0,0 +1,205 @@ +# Generated automatically from Makefile.in by configure. +# Master Makefile for the GNU readline library. +# Copyright (C) 1994 Free Software Foundation, Inc. + +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. + +srcdir = . + +prefix = /usr/local +exec_prefix = $(prefix) +bindir = $(exec_prefix)/bin +libdir = $(exec_prefix)/lib +mandir = $(prefix)/man/man1 + +SHELL = /bin/sh + +INSTALL = /bin/install -c +INSTALL_PROGRAM = ${INSTALL} +INSTALL_DATA = ${INSTALL} -m 644 + +RANLIB = ranlib +AR = ar +RM = rm +CP = cp +MV = mv + +DEFS = -DHAVE_CONFIG_H +CFLAGS = -g +LDFLAGS = -g + +# For libraries which include headers from other libraries. +INCLUDES = -I. -I$(srcdir) + +CPPFLAGS = $(DEFS) $(INCLUDES) + +PICFLAG= -pic # -fpic for some versions of gcc +SHLIB_OPTS= -assert pure-text -ldl # -Bshareable for some versions of gcc +MAJOR= 2 +MINOR= .0 + +.SUFFIXES: .so +.c.o: + $(CC) -c $(CPPFLAGS) $(CFLAGS) $< + +.c.so: + -mv $*.o z$*.o + $(CC) -c $(PICFLAG) $(CPPFLAGS) $(CFLAGS) $< + mv $*.o $@ + -mv z$*.o $*.o + +# The name of the main library target. +LIBRARY_NAME = libreadline.a +SHARED_READLINE = libreadline.so.$(MAJOR)$(MINOR) +SHARED_HISTORY = libhistory.so.$(MAJOR)$(MINOR) +SHARED_LIBS = $(SHARED_READLINE) $(SHARED_HISTORY) + +# The C code source files for this library. +CSOURCES = $(srcdir)readline.c $(srcdir)funmap.c $(srcdir)keymaps.c \ + $(srcdir)vi_mode.c $(srcdir)parens.c $(srcdir)rltty.c \ + $(srcdir)complete.c $(srcdir)bind.c $(srcdir)isearch.c \ + $(srcdir)display.c $(srcdir)signals.c $(srcdir)emacs_keymap.c \ + $(srcdir)vi_keymap.c $(srcdir)history.c $(srcdir)tilde.c \ + $(srcdir)xmalloc.c + +# The header files for this library. +HSOURCES = readline.h rldefs.h chardefs.h keymaps.h history.h \ + posixstat.h tilde.h rlconf.h + +INSTALLED_HEADERS = readline.h chardefs.h keymaps.h history.h tilde.h + +OBJECTS = readline.o vi_mode.o funmap.o keymaps.o parens.o search.o \ + rltty.o complete.o bind.o isearch.o display.o signals.o \ + history.o tilde.o xmalloc.o + +SHARED_OBJ = readline.so vi_mode.so funmap.so keymaps.so parens.so search.so \ + rltty.so complete.so bind.so isearch.so display.so signals.so \ + history.so tilde.so xmalloc.so + +# The texinfo files which document this library. +DOCSOURCE = doc/rlman.texinfo doc/rltech.texinfo doc/rluser.texinfo +DOCOBJECT = doc/readline.dvi +DOCSUPPORT = doc/Makefile +DOCUMENTATION = $(DOCSOURCE) $(DOCOBJECT) $(DOCSUPPORT) + +SUPPORT = Makefile ChangeLog $(DOCSUPPORT) examples/[-a-z.]* + +SOURCES = $(CSOURCES) $(HSOURCES) $(DOCSOURCE) + +THINGS_TO_TAR = $(SOURCES) $(SUPPORT) + +########################################################################## + +all: libreadline.a libhistory.a +shared: $(SHARED_LIBS) + +libreadline.a: $(OBJECTS) + $(RM) -f $@ + $(AR) cq $@ $(OBJECTS) + -$(RANLIB) $@ + +libhistory.a: history.o + $(RM) -f $@ + $(AR) cq $@ history.o + -$(RANLIB) $@ + +$(SHARED_READLINE): $(SHARED_OBJ) + $(RM) -f $@ + ld ${SHLIB_OPTS} -o $@ $(SHARED_OBJ) + +$(SHARED_HISTORY): history.so + $(RM) -f $@ + ld ${SHLIB_OPTS} -o $@ history.so + +documentation: force + [ ! -d doc ] && mkdir doc + (if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS); fi) + +force: + +install: installdirs libreadline.a + $(INSTALL_DATA) $(INSTALLED_HEADERS) $(incdir)/readline + -$(MV) $(libdir)/libreadline.a $(libdir)/libreadline.old + $(INSTALL_DATA) libreadline.a $(libdir)/libreadline.a + -$(RANLIB) -t $(libdir)/libreadline.a + +installdirs: + [ ! -d $(incdir)/readline ] && { \ + mkdir $(incdir)/readline && chmod 755 $(incdir)/readline; } + [ ! -d $(libdir) ] && mkdir $(libdir) + +uninstall: + [ -n "$(incdir)" ] && cd $(incdir)/readline && \ + ${RM} -f ${INSTALLED_HEADERS} + [ -n "$(libdir)" ] && cd $(libdir) && \ + ${RM} -f libreadline.a libreadline.old $(SHARED_LIBS) + +clean:: + rm -f $(OBJECTS) *.a $(SHARED_OBJ) $(SHARED_LIBS) + (if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS) $@; fi) + +readline: readline.h rldefs.h chardefs.h +readline: $(OBJECTS) + $(CC) $(CFLAGS) $(CPPFLAGS) $(READLINE_DEFINES) \ + $(LOCAL_INCLUDES) -DTEST -o readline readline.c vi_mode.o funmap.o \ + keymaps.o -ltermcap + +info: +install-info: +dvi: +check: +installcheck: + +tags: force + etags $(CSOURCES) $(HSOURCES) + +TAGS: force + ctags -x $(CSOURCES) $(HSOURCES) > $@ + +Makefile: config.status $(srcdir)/Makefile.in + $(SHELL) config.status + +config.status: configure + $(SHELL) config.status --recheck + +configure: configure.in ## Comment-me-out in distribution + cd $(srcdir); autoconf ## Comment-me-out in distribution +config.h.in: configure.in ## Comment-me-out in distribution + cd $(srcdir); autoheader ## Comment-me-out in distribution + +mostlyclean: clean + +distclean realclean: clean + rm -f Makefile config.status config.h stamp-config + +# Tell versions [3.59,3.63) of GNU make not to export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: + +# Dependencies +readline.o: readline.c readline.h rldefs.h rlconf.h chardefs.h +readline.o: keymaps.h history.h +vi_mode.o: rldefs.h rlconf.h readline.h history.h +funmap.o: funmap.c readline.h rlconf.h +keymaps.o: keymaps.c emacs_keymap.c vi_keymap.c keymaps.h chardefs.h rlconf.h +history.o: history.h memalloc.h +isearch.o: memalloc.h readline.h history.h +search.o: memalloc.h readline.h history.h +display.o: readline.h history.h rldefs.h rlconf.h +complete.o: readline.h rldefs.h rlconf.h +rltty.o: rldefs.h rlconf.h readline.h +bind.o: rldefs.h rlconf.h readline.h history.h +signals.o: rldefs.h rlconf.h readline.h history.h +parens.o: readline.h diff --git a/Makefile.in b/Makefile.in new file mode 100644 index 0000000..02888bd --- /dev/null +++ b/Makefile.in @@ -0,0 +1,205 @@ +# Master Makefile for the GNU readline library. +# Copyright (C) 1994 Free Software Foundation, Inc. + +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. + +srcdir = @srcdir@ +VPATH = @srcdir@ + +prefix = /usr/local +exec_prefix = $(prefix) +bindir = $(exec_prefix)/bin +libdir = $(exec_prefix)/lib +mandir = $(prefix)/man/man1 + +SHELL = /bin/sh + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ + +RANLIB = @RANLIB@ +AR = ar +RM = rm +CP = cp +MV = mv + +DEFS = @DEFS@ +CFLAGS = -g +LDFLAGS = -g + +# For libraries which include headers from other libraries. +INCLUDES = -I. -I$(srcdir) + +CPPFLAGS = $(DEFS) $(INCLUDES) + +PICFLAG= -pic # -fpic for some versions of gcc +SHLIB_OPTS= -assert pure-text -ldl # -Bshareable for some versions of gcc +MAJOR= 2 +MINOR= .0 + +.SUFFIXES: .so +.c.o: + $(CC) -c $(CPPFLAGS) $(CFLAGS) $< + +.c.so: + -mv $*.o z$*.o + $(CC) -c $(PICFLAG) $(CPPFLAGS) $(CFLAGS) $< + mv $*.o $@ + -mv z$*.o $*.o + +# The name of the main library target. +LIBRARY_NAME = libreadline.a +SHARED_READLINE = libreadline.so.$(MAJOR)$(MINOR) +SHARED_HISTORY = libhistory.so.$(MAJOR)$(MINOR) +SHARED_LIBS = $(SHARED_READLINE) $(SHARED_HISTORY) + +# The C code source files for this library. +CSOURCES = $(srcdir)readline.c $(srcdir)funmap.c $(srcdir)keymaps.c \ + $(srcdir)vi_mode.c $(srcdir)parens.c $(srcdir)rltty.c \ + $(srcdir)complete.c $(srcdir)bind.c $(srcdir)isearch.c \ + $(srcdir)display.c $(srcdir)signals.c $(srcdir)emacs_keymap.c \ + $(srcdir)vi_keymap.c $(srcdir)history.c $(srcdir)tilde.c \ + $(srcdir)xmalloc.c + +# The header files for this library. +HSOURCES = readline.h rldefs.h chardefs.h keymaps.h history.h \ + posixstat.h tilde.h rlconf.h + +INSTALLED_HEADERS = readline.h chardefs.h keymaps.h history.h tilde.h + +OBJECTS = readline.o vi_mode.o funmap.o keymaps.o parens.o search.o \ + rltty.o complete.o bind.o isearch.o display.o signals.o \ + history.o tilde.o xmalloc.o + +SHARED_OBJ = readline.so vi_mode.so funmap.so keymaps.so parens.so search.so \ + rltty.so complete.so bind.so isearch.so display.so signals.so \ + history.so tilde.so xmalloc.so + +# The texinfo files which document this library. +DOCSOURCE = doc/rlman.texinfo doc/rltech.texinfo doc/rluser.texinfo +DOCOBJECT = doc/readline.dvi +DOCSUPPORT = doc/Makefile +DOCUMENTATION = $(DOCSOURCE) $(DOCOBJECT) $(DOCSUPPORT) + +SUPPORT = Makefile ChangeLog $(DOCSUPPORT) examples/[-a-z.]* + +SOURCES = $(CSOURCES) $(HSOURCES) $(DOCSOURCE) + +THINGS_TO_TAR = $(SOURCES) $(SUPPORT) + +########################################################################## + +all: libreadline.a libhistory.a +shared: $(SHARED_LIBS) + +libreadline.a: $(OBJECTS) + $(RM) -f $@ + $(AR) cq $@ $(OBJECTS) + -$(RANLIB) $@ + +libhistory.a: history.o + $(RM) -f $@ + $(AR) cq $@ history.o + -$(RANLIB) $@ + +$(SHARED_READLINE): $(SHARED_OBJ) + $(RM) -f $@ + ld ${SHLIB_OPTS} -o $@ $(SHARED_OBJ) + +$(SHARED_HISTORY): history.so + $(RM) -f $@ + ld ${SHLIB_OPTS} -o $@ history.so + +documentation: force + [ ! -d doc ] && mkdir doc + (if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS); fi) + +force: + +install: installdirs libreadline.a + $(INSTALL_DATA) $(INSTALLED_HEADERS) $(incdir)/readline + -$(MV) $(libdir)/libreadline.a $(libdir)/libreadline.old + $(INSTALL_DATA) libreadline.a $(libdir)/libreadline.a + -$(RANLIB) -t $(libdir)/libreadline.a + +installdirs: + [ ! -d $(incdir)/readline ] && { \ + mkdir $(incdir)/readline && chmod 755 $(incdir)/readline; } + [ ! -d $(libdir) ] && mkdir $(libdir) + +uninstall: + [ -n "$(incdir)" ] && cd $(incdir)/readline && \ + ${RM} -f ${INSTALLED_HEADERS} + [ -n "$(libdir)" ] && cd $(libdir) && \ + ${RM} -f libreadline.a libreadline.old $(SHARED_LIBS) + +clean:: + rm -f $(OBJECTS) *.a $(SHARED_OBJ) $(SHARED_LIBS) + (if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS) $@; fi) + +readline: readline.h rldefs.h chardefs.h +readline: $(OBJECTS) + $(CC) $(CFLAGS) $(CPPFLAGS) $(READLINE_DEFINES) \ + $(LOCAL_INCLUDES) -DTEST -o readline readline.c vi_mode.o funmap.o \ + keymaps.o -ltermcap + +info: +install-info: +dvi: +check: +installcheck: + +tags: force + etags $(CSOURCES) $(HSOURCES) + +TAGS: force + ctags -x $(CSOURCES) $(HSOURCES) > $@ + +Makefile: config.status $(srcdir)/Makefile.in + $(SHELL) config.status + +config.status: configure + $(SHELL) config.status --recheck + +configure: configure.in ## Comment-me-out in distribution + cd $(srcdir); autoconf ## Comment-me-out in distribution +config.h.in: configure.in ## Comment-me-out in distribution + cd $(srcdir); autoheader ## Comment-me-out in distribution + +mostlyclean: clean + +distclean realclean: clean + rm -f Makefile config.status config.h stamp-config + +# Tell versions [3.59,3.63) of GNU make not to export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: + +# Dependencies +readline.o: readline.c readline.h rldefs.h rlconf.h chardefs.h +readline.o: keymaps.h history.h +vi_mode.o: rldefs.h rlconf.h readline.h history.h +funmap.o: funmap.c readline.h rlconf.h +keymaps.o: keymaps.c emacs_keymap.c vi_keymap.c keymaps.h chardefs.h rlconf.h +history.o: history.h memalloc.h +isearch.o: memalloc.h readline.h history.h +search.o: memalloc.h readline.h history.h +display.o: readline.h history.h rldefs.h rlconf.h +complete.o: readline.h rldefs.h rlconf.h +rltty.o: rldefs.h rlconf.h readline.h +bind.o: rldefs.h rlconf.h readline.h history.h +signals.o: rldefs.h rlconf.h readline.h history.h +parens.o: readline.h diff --git a/README b/README new file mode 100644 index 0000000..131471c --- /dev/null +++ b/README @@ -0,0 +1,6 @@ +This is the distribution of the Gnu Readline library. See the file +STANDALONE for a description of the #defines that can be passed via +the makefile to build readline on different systems. + +The file rlconf.h contains defines that enable and disable certain +readline features. diff --git a/STANDALONE b/STANDALONE new file mode 100644 index 0000000..c1387f3 --- /dev/null +++ b/STANDALONE @@ -0,0 +1,31 @@ +This is a description of C preprocessor defines that readline accepts. +Most are passed in from the parent `make'; e.g. from the bash source +directory. + +NO_SYS_FILE is not present +HAVE_UNISTD_H exists +HAVE_STDLIB_H exists +HAVE_VARARGS_H exists and is usable +HAVE_STRING_H exists +HAVE_ALLOCA_H exists and is needed for alloca() +HAVE_ALLOCA alloca(3) or a define for it exists +PRAGMA_ALLOCA use of alloca() requires a #pragma, as in AIX 3.x +VOID_SIGHANDLER signal handlers are void functions +HAVE_DIRENT_H exists and is usable +HAVE_SYS_PTEM_H exists +HAVE_SYS_PTE_H exists +HAVE_SYS_STREAM_H exists + +System-specific options: + +GWINSZ_IN_SYS_IOCTL need to include for TIOCGWINSZ +HAVE_GETPW_DECLS the getpw* functions are declared in and cannot + be redeclared without compiler errors +HAVE_STRCASECMP the strcasecmp and strncasecmp functions are available + +USG Running a variant of System V +USGr3 Running System V.3 +XENIX_22 Xenix 2.2 +Linux Linux +CRAY running a recent version of Cray UNICOS +SunOS4 Running SunOS 4.x diff --git a/acconfig.h b/acconfig.h new file mode 100644 index 0000000..ebf44e9 --- /dev/null +++ b/acconfig.h @@ -0,0 +1,28 @@ +/* acconfig.h + This file is in the public domain. + + Descriptive text for the C preprocessor macros that + the distributed Autoconf macros can define. + No software package will use all of them; autoheader copies the ones + your configure.in uses into your configuration header file templates. + + The entries are in sort -df order: alphabetical, case insensitive, + ignoring punctuation (such as underscores). Although this order + can split up related entries, it makes it easier to check whether + a given entry is in the file. + + Leave the following blank line there!! Autoheader needs it. */ + + +/* Define if your system defines TIOCGWINSZ in sys/ioctl.h. */ +#undef GWINSZ_IN_SYS_IOCTL + +#undef HAVE_GETPW_DECLS + +#undef NO_SYS_FILE + + +/* Leave that blank line there!! Autoheader needs it. + If you're adding to this file, keep in mind: + The entries are in sort -df order: alphabetical, case insensitive, + ignoring punctuation (such as underscores). */ diff --git a/ansi_stdlib.h b/ansi_stdlib.h new file mode 100644 index 0000000..52339da --- /dev/null +++ b/ansi_stdlib.h @@ -0,0 +1,41 @@ +/* ansi_stdlib.h -- An ANSI Standard stdlib.h. */ +/* A minimal stdlib.h containing extern declarations for those functions + that bash uses. */ + +/* Copyright (C) 1993 Free Software Foundation, Inc. + + This file is part of GNU Bash, the Bourne Again SHell. + + Bash is free software; you can redistribute it and/or modify it under + the terms of the GNU General Public License as published by the Free + Software Foundation; either version 2, or (at your option) any later + version. + + Bash is distributed in the hope that it will be useful, but WITHOUT ANY + WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License along + with Bash; see the file COPYING. If not, write to the Free Software + Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (_STDLIB_H_) +#define _STDLIB_H_ 1 + +/* String conversion functions. */ +extern int atoi (); +extern long int atol (); + +/* Memory allocation functions. */ +extern char *malloc (); +extern char *realloc (); +extern void free (); + +/* Other miscellaneous functions. */ +extern void abort (); +extern void exit (); +extern char *getenv (); +extern void qsort (); + +#endif /* _STDLIB_H */ diff --git a/bind.c b/bind.c new file mode 100644 index 0000000..8821599 --- /dev/null +++ b/bind.c @@ -0,0 +1,1487 @@ +/* bind.c -- key binding and startup file support for the readline library. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include +#include +#if !defined (NO_SYS_FILE) +# include +#endif /* !NO_SYS_FILE */ +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif /* HAVE_UNISTD_H */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include +/* Not all systems declare ERRNO in errno.h... and some systems #define it! */ +#if !defined (errno) +extern int errno; +#endif /* !errno */ + +#include "posixstat.h" + +/* System-specific feature definitions and include files. */ +#include "rldefs.h" + +/* Some standard library routines. */ +#include "readline.h" +#include "history.h" + +#if !defined (strchr) && !defined (__STDC__) +extern char *strchr (), *strrchr (); +#endif /* !strchr && !__STDC__ */ + +extern int _rl_horizontal_scroll_mode; +extern int _rl_mark_modified_lines; +extern int _rl_bell_preference; +extern int _rl_meta_flag; +extern int _rl_convert_meta_chars_to_ascii; +extern int _rl_output_meta_chars; +extern int _rl_complete_show_all; +#if defined (PAREN_MATCHING) +extern int rl_blink_matching_paren; +#endif /* PAREN_MATCHING */ +#if defined (VISIBLE_STATS) +extern int rl_visible_stats; +#endif /* VISIBLE_STATS */ +extern int rl_complete_with_tilde_expansion; +extern int rl_completion_query_items; +#if defined (VI_MODE) +extern char *rl_vi_comment_begin; +#endif + +extern int rl_explicit_arg; +extern int rl_editing_mode; +extern unsigned short _rl_parsing_conditionalized_out; +extern Keymap _rl_keymap; + +extern char *possible_control_prefixes[], *possible_meta_prefixes[]; + +extern char **rl_funmap_names (); + +/* Forward declarations */ +void rl_set_keymap_from_edit_mode (); + +static int glean_key_from_name (); + +#if defined (HAVE_STRCASECMP) +#define stricmp strcasecmp +#define strnicmp strncasecmp +#else +static int stricmp (), strnicmp (); +#endif + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + +/* **************************************************************** */ +/* */ +/* Binding keys */ +/* */ +/* **************************************************************** */ + +/* rl_add_defun (char *name, Function *function, int key) + Add NAME to the list of named functions. Make FUNCTION be the function + that gets called. If KEY is not -1, then bind it. */ +rl_add_defun (name, function, key) + char *name; + Function *function; + int key; +{ + if (key != -1) + rl_bind_key (key, function); + rl_add_funmap_entry (name, function); + return 0; +} + +/* Bind KEY to FUNCTION. Returns non-zero if KEY is out of range. */ +int +rl_bind_key (key, function) + int key; + Function *function; +{ + if (key < 0) + return (key); + + if (META_CHAR (key) && _rl_convert_meta_chars_to_ascii) + { + if (_rl_keymap[ESC].type == ISKMAP) + { + Keymap escmap; + + escmap = FUNCTION_TO_KEYMAP (_rl_keymap, ESC); + key = UNMETA (key); + escmap[key].type = ISFUNC; + escmap[key].function = function; + return (0); + } + return (key); + } + + _rl_keymap[key].type = ISFUNC; + _rl_keymap[key].function = function; + return (0); +} + +/* Bind KEY to FUNCTION in MAP. Returns non-zero in case of invalid + KEY. */ +int +rl_bind_key_in_map (key, function, map) + int key; + Function *function; + Keymap map; +{ + int result; + Keymap oldmap = _rl_keymap; + + _rl_keymap = map; + result = rl_bind_key (key, function); + _rl_keymap = oldmap; + return (result); +} + +/* Make KEY do nothing in the currently selected keymap. + Returns non-zero in case of error. */ +int +rl_unbind_key (key) + int key; +{ + return (rl_bind_key (key, (Function *)NULL)); +} + +/* Make KEY do nothing in MAP. + Returns non-zero in case of error. */ +int +rl_unbind_key_in_map (key, map) + int key; + Keymap map; +{ + return (rl_bind_key_in_map (key, (Function *)NULL, map)); +} + +/* Bind the key sequence represented by the string KEYSEQ to + FUNCTION. This makes new keymaps as necessary. The initial + place to do bindings is in MAP. */ +rl_set_key (keyseq, function, map) + char *keyseq; + Function *function; + Keymap map; +{ + return (rl_generic_bind (ISFUNC, keyseq, function, map)); +} + +/* Bind the key sequence represented by the string KEYSEQ to + the string of characters MACRO. This makes new keymaps as + necessary. The initial place to do bindings is in MAP. */ +rl_macro_bind (keyseq, macro, map) + char *keyseq, *macro; + Keymap map; +{ + char *macro_keys; + int macro_keys_len; + + macro_keys = (char *)xmalloc ((2 * strlen (macro)) + 1); + + if (rl_translate_keyseq (macro, macro_keys, ¯o_keys_len)) + { + free (macro_keys); + return -1; + } + rl_generic_bind (ISMACR, keyseq, macro_keys, map); + return 0; +} + +/* Bind the key sequence represented by the string KEYSEQ to + the arbitrary pointer DATA. TYPE says what kind of data is + pointed to by DATA, right now this can be a function (ISFUNC), + a macro (ISMACR), or a keymap (ISKMAP). This makes new keymaps + as necessary. The initial place to do bindings is in MAP. */ +rl_generic_bind (type, keyseq, data, map) + int type; + char *keyseq, *data; + Keymap map; +{ + char *keys; + int keys_len; + register int i; + + /* If no keys to bind to, exit right away. */ + if (!keyseq || !*keyseq) + { + if (type == ISMACR) + free (data); + return -1; + } + + keys = xmalloc (1 + (2 * strlen (keyseq))); + + /* Translate the ASCII representation of KEYSEQ into an array of + characters. Stuff the characters into KEYS, and the length of + KEYS into KEYS_LEN. */ + if (rl_translate_keyseq (keyseq, keys, &keys_len)) + { + free (keys); + return -1; + } + + /* Bind keys, making new keymaps as necessary. */ + for (i = 0; i < keys_len; i++) + { + int ic = (int) ((unsigned char)keys[i]); + + if (_rl_convert_meta_chars_to_ascii && META_CHAR (ic)) + { + ic = UNMETA (ic); + if (map[ESC].type == ISKMAP) + map = FUNCTION_TO_KEYMAP (map, ESC); + } + + if ((i + 1) < keys_len) + { + if (map[ic].type != ISKMAP) + { + if (map[ic].type == ISMACR) + free ((char *)map[ic].function); + + map[ic].type = ISKMAP; + map[ic].function = KEYMAP_TO_FUNCTION (rl_make_bare_keymap()); + } + map = FUNCTION_TO_KEYMAP (map, ic); + } + else + { + if (map[ic].type == ISMACR) + free ((char *)map[ic].function); + + map[ic].function = KEYMAP_TO_FUNCTION (data); + map[ic].type = type; + } + } + free (keys); + return 0; +} + +/* Translate the ASCII representation of SEQ, stuffing the values into ARRAY, + an array of characters. LEN gets the final length of ARRAY. Return + non-zero if there was an error parsing SEQ. */ +rl_translate_keyseq (seq, array, len) + char *seq, *array; + int *len; +{ + register int i, c, l = 0; + + for (i = 0; c = seq[i]; i++) + { + if (c == '\\') + { + c = seq[++i]; + + if (!c) + break; + + if (((c == 'C' || c == 'M') && seq[i + 1] == '-') || + (c == 'e')) + { + /* Handle special case of backwards define. */ + if (strncmp (&seq[i], "C-\\M-", 5) == 0) + { + array[l++] = ESC; + i += 5; + array[l++] = CTRL (to_upper (seq[i])); + if (!seq[i]) + i--; + continue; + } + + switch (c) + { + case 'M': + i++; + array[l++] = ESC; + break; + + case 'C': + i += 2; + /* Special hack for C-?... */ + if (seq[i] == '?') + array[l++] = RUBOUT; + else + array[l++] = CTRL (to_upper (seq[i])); + break; + + case 'e': + array[l++] = ESC; + } + + continue; + } + } + array[l++] = c; + } + + *len = l; + array[l] = '\0'; + return (0); +} + +/* Return a pointer to the function that STRING represents. + If STRING doesn't have a matching function, then a NULL pointer + is returned. */ +Function * +rl_named_function (string) + char *string; +{ + register int i; + + rl_initialize_funmap (); + + for (i = 0; funmap[i]; i++) + if (stricmp (funmap[i]->name, string) == 0) + return (funmap[i]->function); + return ((Function *)NULL); +} + +/* Return the function (or macro) definition which would be invoked via + KEYSEQ if executed in MAP. If MAP is NULL, then the current keymap is + used. TYPE, if non-NULL, is a pointer to an int which will receive the + type of the object pointed to. One of ISFUNC (function), ISKMAP (keymap), + or ISMACR (macro). */ +Function * +rl_function_of_keyseq (keyseq, map, type) + char *keyseq; + Keymap map; + int *type; +{ + register int i; + + if (!map) + map = _rl_keymap; + + for (i = 0; keyseq && keyseq[i]; i++) + { + int ic = keyseq[i]; + + if (META_CHAR (ic) && _rl_convert_meta_chars_to_ascii) + { + if (map[ESC].type != ISKMAP) + { + if (type) + *type = map[ESC].type; + + return (map[ESC].function); + } + else + { + map = FUNCTION_TO_KEYMAP (map, ESC); + ic = UNMETA (ic); + } + } + + if (map[ic].type == ISKMAP) + { + /* If this is the last key in the key sequence, return the + map. */ + if (!keyseq[i + 1]) + { + if (type) + *type = ISKMAP; + + return (map[ic].function); + } + else + map = FUNCTION_TO_KEYMAP (map, ic); + } + else + { + if (type) + *type = map[ic].type; + + return (map[ic].function); + } + } + return ((Function *) NULL); +} + +/* The last key bindings file read. */ +static char *last_readline_init_file = (char *)NULL; + +/* Re-read the current keybindings file. */ +rl_re_read_init_file (count, ignore) + int count, ignore; +{ + int r; + r = rl_read_init_file ((char *)NULL); + rl_set_keymap_from_edit_mode (); + return r; +} + +/* Do key bindings from a file. If FILENAME is NULL it defaults + to the first non-null filename from this list: + 1. the filename used for the previous call + 2. the value of the shell variable `INPUTRC' + 3. ~/.inputrc + If the file existed and could be opened and read, 0 is returned, + otherwise errno is returned. */ +int +rl_read_init_file (filename) + char *filename; +{ + register int i; + char *buffer, *openname, *line, *end; + struct stat finfo; + int file; + + /* Default the filename. */ + if (!filename) + { + filename = last_readline_init_file; + if (!filename) + filename = getenv ("INPUTRC"); + if (!filename) + filename = DEFAULT_INPUTRC; + } + + if (!*filename) + filename = DEFAULT_INPUTRC; + + openname = tilde_expand (filename); + + if ((stat (openname, &finfo) < 0) || + (file = open (openname, O_RDONLY, 0666)) < 0) + { + free (openname); + return (errno); + } + else + free (openname); + + if (filename != last_readline_init_file) + { + if (last_readline_init_file) + free (last_readline_init_file); + + last_readline_init_file = savestring (filename); + } + + /* Read the file into BUFFER. */ + buffer = (char *)xmalloc ((int)finfo.st_size + 1); + i = read (file, buffer, finfo.st_size); + close (file); + + if (i != finfo.st_size) + return (errno); + + /* Loop over the lines in the file. Lines that start with `#' are + comments; all other lines are commands for readline initialization. */ + line = buffer; + end = buffer + finfo.st_size; + while (line < end) + { + /* Find the end of this line. */ + for (i = 0; line + i != end && line[i] != '\n'; i++); + + /* Mark end of line. */ + line[i] = '\0'; + + /* Skip leading whitespace. */ + while (*line && whitespace (*line)) + { + line++; + i--; + } + + /* If the line is not a comment, then parse it. */ + if (*line && *line != '#') + rl_parse_and_bind (line); + + /* Move to the next line. */ + line += i + 1; + } + free (buffer); + return (0); +} + +/* **************************************************************** */ +/* */ +/* Parser Directives */ +/* */ +/* **************************************************************** */ + +/* Conditionals. */ + +/* Calling programs set this to have their argv[0]. */ +char *rl_readline_name = "other"; + +/* Stack of previous values of parsing_conditionalized_out. */ +static unsigned char *if_stack = (unsigned char *)NULL; +static int if_stack_depth = 0; +static int if_stack_size = 0; + +/* Push _rl_parsing_conditionalized_out, and set parser state based + on ARGS. */ +static int +parser_if (args) + char *args; +{ + register int i; + + /* Push parser state. */ + if (if_stack_depth + 1 >= if_stack_size) + { + if (!if_stack) + if_stack = (unsigned char *)xmalloc (if_stack_size = 20); + else + if_stack = (unsigned char *)xrealloc (if_stack, if_stack_size += 20); + } + if_stack[if_stack_depth++] = _rl_parsing_conditionalized_out; + + /* If parsing is turned off, then nothing can turn it back on except + for finding the matching endif. In that case, return right now. */ + if (_rl_parsing_conditionalized_out) + return 0; + + /* Isolate first argument. */ + for (i = 0; args[i] && !whitespace (args[i]); i++); + + if (args[i]) + args[i++] = '\0'; + + /* Handle "if term=foo" and "if mode=emacs" constructs. If this + isn't term=foo, or mode=emacs, then check to see if the first + word in ARGS is the same as the value stored in rl_readline_name. */ + if (rl_terminal_name && strnicmp (args, "term=", 5) == 0) + { + char *tem, *tname; + + /* Terminals like "aaa-60" are equivalent to "aaa". */ + tname = savestring (rl_terminal_name); + tem = strchr (tname, '-'); + if (tem) + *tem = '\0'; + + /* Test the `long' and `short' forms of the terminal name so that + if someone has a `sun-cmd' and does not want to have bindings + that will be executed if the terminal is a `sun', they can put + `$if term=sun-cmd' into their .inputrc. */ + if ((stricmp (args + 5, tname) == 0) || + (stricmp (args + 5, rl_terminal_name) == 0)) + _rl_parsing_conditionalized_out = 0; + else + _rl_parsing_conditionalized_out = 1; + + free (tname); + } +#if defined (VI_MODE) + else if (strnicmp (args, "mode=", 5) == 0) + { + int mode; + + if (stricmp (args + 5, "emacs") == 0) + mode = emacs_mode; + else if (stricmp (args + 5, "vi") == 0) + mode = vi_mode; + else + mode = no_mode; + + if (mode == rl_editing_mode) + _rl_parsing_conditionalized_out = 0; + else + _rl_parsing_conditionalized_out = 1; + } +#endif /* VI_MODE */ + /* Check to see if the first word in ARGS is the same as the + value stored in rl_readline_name. */ + else if (stricmp (args, rl_readline_name) == 0) + _rl_parsing_conditionalized_out = 0; + else + _rl_parsing_conditionalized_out = 1; + return 0; +} + +/* Invert the current parser state if there is anything on the stack. */ +static int +parser_else (args) + char *args; +{ + register int i; + + if (!if_stack_depth) + { + /* Error message? */ + return 0; + } + + /* Check the previous (n - 1) levels of the stack to make sure that + we haven't previously turned off parsing. */ + for (i = 0; i < if_stack_depth - 1; i++) + if (if_stack[i] == 1) + return 0; + + /* Invert the state of parsing if at top level. */ + _rl_parsing_conditionalized_out = !_rl_parsing_conditionalized_out; + return 0; +} + +/* Terminate a conditional, popping the value of + _rl_parsing_conditionalized_out from the stack. */ +static int +parser_endif (args) + char *args; +{ + if (if_stack_depth) + _rl_parsing_conditionalized_out = if_stack[--if_stack_depth]; + else + { + /* *** What, no error message? *** */ + } + return 0; +} + +/* Associate textual names with actual functions. */ +static struct { + char *name; + Function *function; +} parser_directives [] = { + { "if", parser_if }, + { "endif", parser_endif }, + { "else", parser_else }, + { (char *)0x0, (Function *)0x0 } +}; + +/* Handle a parser directive. STATEMENT is the line of the directive + without any leading `$'. */ +static int +handle_parser_directive (statement) + char *statement; +{ + register int i; + char *directive, *args; + + /* Isolate the actual directive. */ + + /* Skip whitespace. */ + for (i = 0; whitespace (statement[i]); i++); + + directive = &statement[i]; + + for (; statement[i] && !whitespace (statement[i]); i++); + + if (statement[i]) + statement[i++] = '\0'; + + for (; statement[i] && whitespace (statement[i]); i++); + + args = &statement[i]; + + /* Lookup the command, and act on it. */ + for (i = 0; parser_directives[i].name; i++) + if (stricmp (directive, parser_directives[i].name) == 0) + { + (*parser_directives[i].function) (args); + return (0); + } + + /* *** Should an error message be output? */ + return (1); +} + +static int substring_member_of_array (); + +/* Read the binding command from STRING and perform it. + A key binding command looks like: Keyname: function-name\0, + a variable binding command looks like: set variable value. + A new-style keybinding looks like "\C-x\C-x": exchange-point-and-mark. */ +rl_parse_and_bind (string) + char *string; +{ + char *funname, *kname; + register int c, i; + int key, equivalency; + + while (string && whitespace (*string)) + string++; + + if (!string || !*string || *string == '#') + return 0; + + /* If this is a parser directive, act on it. */ + if (*string == '$') + { + handle_parser_directive (&string[1]); + return 0; + } + + /* If we aren't supposed to be parsing right now, then we're done. */ + if (_rl_parsing_conditionalized_out) + return 0; + + i = 0; + /* If this keyname is a complex key expression surrounded by quotes, + advance to after the matching close quote. This code allows the + backslash to quote characters in the key expression. */ + if (*string == '"') + { + int passc = 0; + + for (i = 1; c = string[i]; i++) + { + if (passc) + { + passc = 0; + continue; + } + + if (c == '\\') + { + passc++; + continue; + } + + if (c == '"') + break; + } + } + + /* Advance to the colon (:) or whitespace which separates the two objects. */ + for (; (c = string[i]) && c != ':' && c != ' ' && c != '\t'; i++ ); + + equivalency = (c == ':' && string[i + 1] == '='); + + /* Mark the end of the command (or keyname). */ + if (string[i]) + string[i++] = '\0'; + + /* If doing assignment, skip the '=' sign as well. */ + if (equivalency) + string[i++] = '\0'; + + /* If this is a command to set a variable, then do that. */ + if (stricmp (string, "set") == 0) + { + char *var = string + i; + char *value; + + /* Make VAR point to start of variable name. */ + while (*var && whitespace (*var)) var++; + + /* Make value point to start of value string. */ + value = var; + while (*value && !whitespace (*value)) value++; + if (*value) + *value++ = '\0'; + while (*value && whitespace (*value)) value++; + + rl_variable_bind (var, value); + return 0; + } + + /* Skip any whitespace between keyname and funname. */ + for (; string[i] && whitespace (string[i]); i++); + funname = &string[i]; + + /* Now isolate funname. + For straight function names just look for whitespace, since + that will signify the end of the string. But this could be a + macro definition. In that case, the string is quoted, so skip + to the matching delimiter. We allow the backslash to quote the + delimiter characters in the macro body. */ + /* This code exists to allow whitespace in macro expansions, which + would otherwise be gobbled up by the next `for' loop.*/ + /* XXX - it may be desirable to allow backslash quoting only if " is + the quoted string delimiter, like the shell. */ + if (*funname == '\'' || *funname == '"') + { + int delimiter = string[i++]; + int passc = 0; + + for (; c = string[i]; i++) + { + if (passc) + { + passc = 0; + continue; + } + + if (c == '\\') + { + passc = 1; + continue; + } + + if (c == delimiter) + break; + } + if (c) + i++; + } + + /* Advance to the end of the string. */ + for (; string[i] && !whitespace (string[i]); i++); + + /* No extra whitespace at the end of the string. */ + string[i] = '\0'; + + /* Handle equivalency bindings here. Make the left-hand side be exactly + whatever the right-hand evaluates to, including keymaps. */ + if (equivalency) + { + return 0; + } + + /* If this is a new-style key-binding, then do the binding with + rl_set_key (). Otherwise, let the older code deal with it. */ + if (*string == '"') + { + char *seq = xmalloc (1 + strlen (string)); + register int j, k = 0; + int passc = 0; + + for (j = 1; string[j]; j++) + { + /* Allow backslash to quote characters, but leave them in place. + This allows a string to end with a backslash quoting another + backslash, or with a backslash quoting a double quote. The + backslashes are left in place for rl_translate_keyseq (). */ + if (passc || (string[j] == '\\')) + { + seq[k++] = string[j]; + passc = !passc; + continue; + } + + if (string[j] == '"') + break; + + seq[k++] = string[j]; + } + seq[k] = '\0'; + + /* Binding macro? */ + if (*funname == '\'' || *funname == '"') + { + j = strlen (funname); + + /* Remove the delimiting quotes from each end of FUNNAME. */ + if (j && funname[j - 1] == *funname) + funname[j - 1] = '\0'; + + rl_macro_bind (seq, &funname[1], _rl_keymap); + } + else + rl_set_key (seq, rl_named_function (funname), _rl_keymap); + + free (seq); + return 0; + } + + /* Get the actual character we want to deal with. */ + kname = strrchr (string, '-'); + if (!kname) + kname = string; + else + kname++; + + key = glean_key_from_name (kname); + + /* Add in control and meta bits. */ + if (substring_member_of_array (string, possible_control_prefixes)) + key = CTRL (to_upper (key)); + + if (substring_member_of_array (string, possible_meta_prefixes)) + key = META (key); + + /* Temporary. Handle old-style keyname with macro-binding. */ + if (*funname == '\'' || *funname == '"') + { + char seq[2]; + int fl = strlen (funname); + + seq[0] = key; seq[1] = '\0'; + if (fl && funname[fl - 1] == *funname) + funname[fl - 1] = '\0'; + + rl_macro_bind (seq, &funname[1], _rl_keymap); + } +#if defined (PREFIX_META_HACK) + /* Ugly, but working hack to keep prefix-meta around. */ + else if (stricmp (funname, "prefix-meta") == 0) + { + char seq[2]; + + seq[0] = key; + seq[1] = '\0'; + rl_generic_bind (ISKMAP, seq, (char *)emacs_meta_keymap, _rl_keymap); + } +#endif /* PREFIX_META_HACK */ + else + rl_bind_key (key, rl_named_function (funname)); + return 0; +} + +/* Simple structure for boolean readline variables (i.e., those that can + have one of two values; either "On" or 1 for truth, or "Off" or 0 for + false. */ + +static struct { + char *name; + int *value; +} boolean_varlist [] = { + { "horizontal-scroll-mode", &_rl_horizontal_scroll_mode }, + { "mark-modified-lines", &_rl_mark_modified_lines }, + { "meta-flag", &_rl_meta_flag }, +#if defined (PAREN_MATCHING) + { "blink-matching-paren", &rl_blink_matching_paren }, +#endif + { "convert-meta", &_rl_convert_meta_chars_to_ascii }, + { "show-all-if-ambiguous", &_rl_complete_show_all }, + { "output-meta", &_rl_output_meta_chars }, +#if defined (VISIBLE_STATS) + { "visible-stats", &rl_visible_stats }, +#endif /* VISIBLE_STATS */ + { "expand-tilde", &rl_complete_with_tilde_expansion }, + { (char *)NULL, (int *)NULL } +}; + +rl_variable_bind (name, value) + char *name, *value; +{ + register int i; + + /* Check for simple variables first. */ + for (i = 0; boolean_varlist[i].name; i++) + { + if (stricmp (name, boolean_varlist[i].name) == 0) + { + /* A variable is TRUE if the "value" is "on", "1" or "". */ + if ((!*value) || + (stricmp (value, "On") == 0) || + (value[0] == '1' && value[1] == '\0')) + *boolean_varlist[i].value = 1; + else + *boolean_varlist[i].value = 0; + return 0; + } + } + + /* Not a boolean variable, so check for specials. */ + + /* Editing mode change? */ + if (stricmp (name, "editing-mode") == 0) + { + if (strnicmp (value, "vi", 2) == 0) + { +#if defined (VI_MODE) + _rl_keymap = vi_insertion_keymap; + rl_editing_mode = vi_mode; +#endif /* VI_MODE */ + } + else if (strnicmp (value, "emacs", 5) == 0) + { + _rl_keymap = emacs_standard_keymap; + rl_editing_mode = emacs_mode; + } + } + + /* Comment string change? */ + else if (stricmp (name, "comment-begin") == 0) + { +#if defined (VI_MODE) + if (*value) + { + if (rl_vi_comment_begin) + free (rl_vi_comment_begin); + + rl_vi_comment_begin = savestring (value); + } +#endif /* VI_MODE */ + } + else if (stricmp (name, "completion-query-items") == 0) + { + int nval = 100; + if (*value) + { + nval = atoi (value); + if (nval < 0) + nval = 0; + } + rl_completion_query_items = nval; + } + else if (stricmp (name, "keymap") == 0) + { + Keymap kmap; + kmap = rl_get_keymap_by_name (value); + if (kmap) + rl_set_keymap (kmap); + } + else if (stricmp (name, "bell-style") == 0) + { + if (!*value) + _rl_bell_preference = AUDIBLE_BELL; + else + { + if (stricmp (value, "none") == 0 || stricmp (value, "off") == 0) + _rl_bell_preference = NO_BELL; + else if (stricmp (value, "audible") == 0 || stricmp (value, "on") == 0) + _rl_bell_preference = AUDIBLE_BELL; + else if (stricmp (value, "visible") == 0) + _rl_bell_preference = VISIBLE_BELL; + } + } + else if (stricmp (name, "prefer-visible-bell") == 0) + { + /* Backwards compatibility. */ + if (*value && (stricmp (value, "on") == 0 || + (*value == '1' && !value[1]))) + _rl_bell_preference = VISIBLE_BELL; + else + _rl_bell_preference = AUDIBLE_BELL; + } + + return 0; +} + +/* Return the character which matches NAME. + For example, `Space' returns ' '. */ + +typedef struct { + char *name; + int value; +} assoc_list; + +static assoc_list name_key_alist[] = { + { "DEL", 0x7f }, + { "ESC", '\033' }, + { "Escape", '\033' }, + { "LFD", '\n' }, + { "Newline", '\n' }, + { "RET", '\r' }, + { "Return", '\r' }, + { "Rubout", 0x7f }, + { "SPC", ' ' }, + { "Space", ' ' }, + { "Tab", 0x09 }, + { (char *)0x0, 0 } +}; + +static int +glean_key_from_name (name) + char *name; +{ + register int i; + + for (i = 0; name_key_alist[i].name; i++) + if (stricmp (name, name_key_alist[i].name) == 0) + return (name_key_alist[i].value); + + return (*(unsigned char *)name); /* XXX was return (*name) */ +} + +/* Auxiliary functions to manage keymaps. */ +static struct { + char *name; + Keymap map; +} keymap_names[] = { + { "emacs", emacs_standard_keymap }, + { "emacs-standard", emacs_standard_keymap }, + { "emacs-meta", emacs_meta_keymap }, + { "emacs-ctlx", emacs_ctlx_keymap }, +#if defined (VI_MODE) + { "vi", vi_movement_keymap }, + { "vi-move", vi_movement_keymap }, + { "vi-command", vi_movement_keymap }, + { "vi-insert", vi_insertion_keymap }, +#endif /* VI_MODE */ + { (char *)0x0, (Keymap)0x0 } +}; + +Keymap +rl_get_keymap_by_name (name) + char *name; +{ + register int i; + + for (i = 0; keymap_names[i].name; i++) + if (strcmp (name, keymap_names[i].name) == 0) + return (keymap_names[i].map); + return ((Keymap) NULL); +} + +void +rl_set_keymap (map) + Keymap map; +{ + if (map) + _rl_keymap = map; +} + +Keymap +rl_get_keymap () +{ + return (_rl_keymap); +} + +void +rl_set_keymap_from_edit_mode () +{ + if (rl_editing_mode == emacs_mode) + _rl_keymap = emacs_standard_keymap; +#if defined (VI_MODE) + else if (rl_editing_mode == vi_mode) + _rl_keymap = vi_insertion_keymap; +#endif /* VI_MODE */ +} + +/* **************************************************************** */ +/* */ +/* Key Binding and Function Information */ +/* */ +/* **************************************************************** */ + +/* Each of the following functions produces information about the + state of keybindings and functions known to Readline. The info + is always printed to rl_outstream, and in such a way that it can + be read back in (i.e., passed to rl_parse_and_bind (). */ + +/* Print the names of functions known to Readline. */ +void +rl_list_funmap_names (count, ignore) + int count, ignore; +{ + register int i; + char **funmap_names; + + funmap_names = rl_funmap_names (); + + if (!funmap_names) + return; + + for (i = 0; funmap_names[i]; i++) + fprintf (rl_outstream, "%s\n", funmap_names[i]); + + free (funmap_names); +} + +/* Return a NULL terminated array of strings which represent the key + sequences that are used to invoke FUNCTION in MAP. */ +char ** +rl_invoking_keyseqs_in_map (function, map) + Function *function; + Keymap map; +{ + register int key; + char **result; + int result_index, result_size; + + result = (char **)NULL; + result_index = result_size = 0; + + for (key = 0; key < 128; key++) + { + switch (map[key].type) + { + case ISMACR: + /* Macros match, if, and only if, the pointers are identical. + Thus, they are treated exactly like functions in here. */ + case ISFUNC: + /* If the function in the keymap is the one we are looking for, + then add the current KEY to the list of invoking keys. */ + if (map[key].function == function) + { + char *keyname = (char *)xmalloc (5); + + if (CTRL_CHAR (key)) + sprintf (keyname, "\\C-%c", to_lower (UNCTRL (key))); + else if (key == RUBOUT) + sprintf (keyname, "\\C-?"); + else if (key == '\\' || key == '"') + { + keyname[0] = '\\'; + keyname[1] = (char) key; + keyname[2] = '\0'; + } + else + { + keyname[0] = (char) key; + keyname[1] = '\0'; + } + + if (result_index + 2 > result_size) + result = (char **) xrealloc + (result, (result_size += 10) * sizeof (char *)); + + result[result_index++] = keyname; + result[result_index] = (char *)NULL; + } + break; + + case ISKMAP: + { + char **seqs = (char **)NULL; + + /* Find the list of keyseqs in this map which have FUNCTION as + their target. Add the key sequences found to RESULT. */ + if (map[key].function) + seqs = + rl_invoking_keyseqs_in_map (function, FUNCTION_TO_KEYMAP (map, key)); + + if (seqs) + { + register int i; + + for (i = 0; seqs[i]; i++) + { + char *keyname = (char *)xmalloc (6 + strlen (seqs[i])); + + if (key == ESC) + sprintf (keyname, "\\e"); + else if (CTRL_CHAR (key)) + sprintf (keyname, "\\C-%c", to_lower (UNCTRL (key))); + else if (key == RUBOUT) + sprintf (keyname, "\\C-?"); + else if (key == '\\' || key == '"') + { + keyname[0] = '\\'; + keyname[1] = (char) key; + keyname[2] = '\0'; + } + else + { + keyname[0] = (char) key; + keyname[1] = '\0'; + } + + strcat (keyname, seqs[i]); + free (seqs[i]); + + if (result_index + 2 > result_size) + result = (char **) xrealloc + (result, (result_size += 10) * sizeof (char *)); + + result[result_index++] = keyname; + result[result_index] = (char *)NULL; + } + + free (seqs); + } + } + break; + } + } + return (result); +} + +/* Return a NULL terminated array of strings which represent the key + sequences that can be used to invoke FUNCTION using the current keymap. */ +char ** +rl_invoking_keyseqs (function) + Function *function; +{ + return (rl_invoking_keyseqs_in_map (function, _rl_keymap)); +} + +/* Print all of the current functions and their bindings to + rl_outstream. If an explicit argument is given, then print + the output in such a way that it can be read back in. */ +int +rl_dump_functions (count, key) + int count, key; +{ + rl_function_dumper (rl_explicit_arg); + rl_on_new_line (); + return (0); +} + +/* Print all of the functions and their bindings to rl_outstream. If + PRINT_READABLY is non-zero, then print the output in such a way + that it can be read back in. */ +void +rl_function_dumper (print_readably) + int print_readably; +{ + register int i; + char **names; + char *name; + + names = rl_funmap_names (); + + fprintf (rl_outstream, "\n"); + + for (i = 0; name = names[i]; i++) + { + Function *function; + char **invokers; + + function = rl_named_function (name); + invokers = rl_invoking_keyseqs_in_map (function, _rl_keymap); + + if (print_readably) + { + if (!invokers) + fprintf (rl_outstream, "# %s (not bound)\n", name); + else + { + register int j; + + for (j = 0; invokers[j]; j++) + { + fprintf (rl_outstream, "\"%s\": %s\n", + invokers[j], name); + free (invokers[j]); + } + + free (invokers); + } + } + else + { + if (!invokers) + fprintf (rl_outstream, "%s is not bound to any keys\n", + name); + else + { + register int j; + + fprintf (rl_outstream, "%s can be found on ", name); + + for (j = 0; invokers[j] && j < 5; j++) + { + fprintf (rl_outstream, "\"%s\"%s", invokers[j], + invokers[j + 1] ? ", " : ".\n"); + } + + if (j == 5 && invokers[j]) + fprintf (rl_outstream, "...\n"); + + for (j = 0; invokers[j]; j++) + free (invokers[j]); + + free (invokers); + } + } + } +} + +/* Bind key sequence KEYSEQ to DEFAULT_FUNC if KEYSEQ is unbound. */ +void +_rl_bind_if_unbound (keyseq, default_func) + char *keyseq; + Function *default_func; +{ + Function *func; + + if (keyseq) + { + func = rl_function_of_keyseq (keyseq, _rl_keymap, (int *)NULL); + if (!func || func == rl_do_lowercase_version) + rl_set_key (keyseq, default_func, _rl_keymap); + } +} + +/* **************************************************************** */ +/* */ +/* String Utility Functions */ +/* */ +/* **************************************************************** */ + +static char *strindex (); + +/* Return non-zero if any members of ARRAY are a substring in STRING. */ +static int +substring_member_of_array (string, array) + char *string, **array; +{ + while (*array) + { + if (strindex (string, *array)) + return (1); + array++; + } + return (0); +} + +#if !defined (HAVE_STRCASECMP) +/* Whoops, Unix doesn't have strnicmp. */ + +/* Compare at most COUNT characters from string1 to string2. Case + doesn't matter. */ +static int +strnicmp (string1, string2, count) + char *string1, *string2; + int count; +{ + register char ch1, ch2; + + while (count) + { + ch1 = *string1++; + ch2 = *string2++; + if (to_upper(ch1) == to_upper(ch2)) + count--; + else + break; + } + return (count); +} + +/* strcmp (), but caseless. */ +static int +stricmp (string1, string2) + char *string1, *string2; +{ + register char ch1, ch2; + + while (*string1 && *string2) + { + ch1 = *string1++; + ch2 = *string2++; + if (to_upper(ch1) != to_upper(ch2)) + return (1); + } + return (*string1 - *string2); +} +#endif /* !HAVE_STRCASECMP */ + +/* Determine if s2 occurs in s1. If so, return a pointer to the + match in s1. The compare is case insensitive. */ +static char * +strindex (s1, s2) + register char *s1, *s2; +{ + register int i, l = strlen (s2); + register int len = strlen (s1); + + for (i = 0; (len - i) >= l; i++) + if (strnicmp (s1 + i, s2, l) == 0) + return (s1 + i); + return ((char *)NULL); +} diff --git a/chardefs.h b/chardefs.h new file mode 100644 index 0000000..8c92811 --- /dev/null +++ b/chardefs.h @@ -0,0 +1,122 @@ +/* chardefs.h -- Character definitions for readline. */ + +/* Copyright (C) 1994 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#ifndef _CHARDEFS_H +#define _CHARDEFS_H + +#include + +#if defined (HAVE_STRING_H) +# include +#else +# include +#endif /* HAVE_STRING_H */ + +#ifndef whitespace +#define whitespace(c) (((c) == ' ') || ((c) == '\t')) +#endif + +#ifdef CTRL +#undef CTRL +#endif + +/* Some character stuff. */ +#define control_character_threshold 0x020 /* Smaller than this is control. */ +#define control_character_mask 0x1f /* 0x20 - 1 */ +#define meta_character_threshold 0x07f /* Larger than this is Meta. */ +#define control_character_bit 0x40 /* 0x000000, must be off. */ +#define meta_character_bit 0x080 /* x0000000, must be on. */ +#define largest_char 255 /* Largest character value. */ + +#define CTRL_CHAR(c) ((c) < control_character_threshold) +#define META_CHAR(c) ((c) > meta_character_threshold && (c) <= largest_char) + +#define CTRL(c) ((c) & control_character_mask) +#define META(c) ((c) | meta_character_bit) + +#define UNMETA(c) ((c) & (~meta_character_bit)) +#define UNCTRL(c) to_upper(((c)|control_character_bit)) + +/* Old versions +#define lowercase_p(c) (((c) > ('a' - 1) && (c) < ('z' + 1))) +#define uppercase_p(c) (((c) > ('A' - 1) && (c) < ('Z' + 1))) +#define digit_p(c) ((c) >= '0' && (c) <= '9') +*/ + +#define lowercase_p(c) (islower(c)) +#define uppercase_p(c) (isupper(c)) +#define digit_p(x) (isdigit (x)) + +#define pure_alphabetic(c) (lowercase_p(c) || uppercase_p(c)) + +/* Old versions +# define to_upper(c) (lowercase_p(c) ? ((c) - 32) : (c)) +# define to_lower(c) (uppercase_p(c) ? ((c) + 32) : (c)) +*/ + +#ifndef to_upper +# define to_upper(c) (islower(c) ? toupper(c) : (c)) +# define to_lower(c) (isupper(c) ? tolower(c) : (c)) +#endif + +#ifndef digit_value +#define digit_value(x) ((x) - '0') +#endif + +#ifndef NEWLINE +#define NEWLINE '\n' +#endif + +#ifndef RETURN +#define RETURN CTRL('M') +#endif + +#ifndef RUBOUT +#define RUBOUT 0x7f +#endif + +#ifndef TAB +#define TAB '\t' +#endif + +#ifdef ABORT_CHAR +#undef ABORT_CHAR +#endif +#define ABORT_CHAR CTRL('G') + +#ifdef PAGE +#undef PAGE +#endif +#define PAGE CTRL('L') + +#ifdef SPACE +#undef SPACE +#endif +#define SPACE ' ' /* XXX - was 0x20 */ + +#ifdef ESC +#undef ESC +#endif + +#define ESC CTRL('[') + +#endif /* _CHARDEFS_H */ diff --git a/complete.c b/complete.c new file mode 100644 index 0000000..2180132 --- /dev/null +++ b/complete.c @@ -0,0 +1,1417 @@ +/* complete.c -- filename completion for readline. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include +#include +#if !defined (NO_SYS_FILE) +# include +#endif /* !NO_SYS_FILE */ + +#if defined (HAVE_UNISTD_H) +# include +#endif /* HAVE_UNISTD_H */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include +/* Not all systems declare ERRNO in errno.h... and some systems #define it! */ +#if !defined (errno) +extern int errno; +#endif /* !errno */ + +#include +#if defined (USG) && !defined (HAVE_GETPW_DECLS) +extern struct passwd *getpwent (); +#endif /* USG && !HAVE_GETPW_DECLS */ + +/* ISC systems don't define getpwent() if _POSIX_SOURCE is defined. */ +#if defined (isc386) && defined (_POSIX_SOURCE) +# if defined (__STDC__) +extern struct passwd *getpwent (void); +# else +extern struct passwd *getpwent (); +# endif /* !__STDC__ */ +#endif /* isc386 && _POSIX_SOURCE */ + +#include "posixstat.h" + +/* System-specific feature definitions and include files. */ +#include "rldefs.h" + +/* Some standard library routines. */ +#include "readline.h" + +/* Possible values for do_replace in rl_complete_internal. */ +#define NO_MATCH 0 +#define SINGLE_MATCH 1 +#define MULT_MATCH 2 + +#if !defined (strchr) && !defined (__STDC__) +extern char *strchr (), *strrchr (); +#endif /* !strchr && !__STDC__ */ + +extern char *tilde_expand (); +extern char *rl_copy_text (); + +extern Function *rl_last_func; +extern int rl_editing_mode; +extern int screenwidth; + +/* Forward declarations for functions defined and used in this file. */ +char *filename_completion_function (); +char **completion_matches (); + +static int compare_strings (); +static char *rl_strpbrk (); + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + +/* If non-zero, then this is the address of a function to call when + completing on a directory name. The function is called with + the address of a string (the current directory name) as an arg. */ +Function *rl_directory_completion_hook = (Function *)NULL; + +/* Non-zero means readline completion functions perform tilde expansion. */ +int rl_complete_with_tilde_expansion = 0; + +/* If non-zero, non-unique completions always show the list of matches. */ +int _rl_complete_show_all = 0; + +#if defined (VISIBLE_STATS) +# if !defined (X_OK) +# define X_OK 1 +# endif + +static int stat_char (); + +/* Non-zero means add an additional character to each filename displayed + during listing completion iff rl_filename_completion_desired which helps + to indicate the type of file being listed. */ +int rl_visible_stats = 0; +#endif /* VISIBLE_STATS */ + +/* **************************************************************** */ +/* */ +/* Completion matching, from readline's point of view. */ +/* */ +/* **************************************************************** */ + +/* Pointer to the generator function for completion_matches (). + NULL means to use filename_entry_function (), the default filename + completer. */ +Function *rl_completion_entry_function = (Function *)NULL; + +/* Pointer to alternative function to create matches. + Function is called with TEXT, START, and END. + START and END are indices in RL_LINE_BUFFER saying what the boundaries + of TEXT are. + If this function exists and returns NULL then call the value of + rl_completion_entry_function to try to match, otherwise use the + array of strings returned. */ +CPPFunction *rl_attempted_completion_function = (CPPFunction *)NULL; + +/* Non-zero means to suppress normal filename completion after the + user-specified completion function has been called. */ +int rl_attempted_completion_over = 0; + +/* Local variable states what happened during the last completion attempt. */ +static int completion_changed_buffer = 0; + +/* Complete the word at or before point. You have supplied the function + that does the initial simple matching selection algorithm (see + completion_matches ()). The default is to do filename completion. */ + +rl_complete (ignore, invoking_key) + int ignore, invoking_key; +{ + if (rl_last_func == rl_complete && !completion_changed_buffer) + return (rl_complete_internal ('?')); + else if (_rl_complete_show_all) + return (rl_complete_internal ('!')); + else + return (rl_complete_internal (TAB)); +} + +/* List the possible completions. See description of rl_complete (). */ +rl_possible_completions (ignore, invoking_key) + int ignore, invoking_key; +{ + return (rl_complete_internal ('?')); +} + +rl_insert_completions (ignore, invoking_key) + int ignore, invoking_key; +{ + return (rl_complete_internal ('*')); +} + +/* The user must press "y" or "n". Non-zero return means "y" pressed. */ +get_y_or_n () +{ + int c; + + for (;;) + { + c = rl_read_key (); + if (c == 'y' || c == 'Y' || c == ' ') + return (1); + if (c == 'n' || c == 'N' || c == RUBOUT) + return (0); + if (c == ABORT_CHAR) + rl_abort (); + ding (); + } +} + +/* Up to this many items will be displayed in response to a + possible-completions call. After that, we ask the user if + she is sure she wants to see them all. */ +int rl_completion_query_items = 100; + +/* The basic list of characters that signal a break between words for the + completer routine. The contents of this variable is what breaks words + in the shell, i.e. " \t\n\"\\'`@$><=" */ +char *rl_basic_word_break_characters = " \t\n\"\\'`@$><=;|&{("; + +/* The list of characters that signal a break between words for + rl_complete_internal. The default list is the contents of + rl_basic_word_break_characters. */ +char *rl_completer_word_break_characters = (char *)NULL; + +/* List of characters which can be used to quote a substring of the line. + Completion occurs on the entire substring, and within the substring + rl_completer_word_break_characters are treated as any other character, + unless they also appear within this list. */ +char *rl_completer_quote_characters = (char *)NULL; + +/* List of characters that are word break characters, but should be left + in TEXT when it is passed to the completion function. The shell uses + this to help determine what kind of completing to do. */ +char *rl_special_prefixes = (char *)NULL; + +/* If non-zero, then disallow duplicates in the matches. */ +int rl_ignore_completion_duplicates = 1; + +/* Non-zero means that the results of the matches are to be treated + as filenames. This is ALWAYS zero on entry, and can only be changed + within a completion entry finder function. */ +int rl_filename_completion_desired = 0; + +/* Non-zero means that the results of the matches are to be quoted using + double quotes (or an application-specific quoting mechanism) if the + filename contains any characters in rl_word_break_chars. This is + ALWAYS non-zero on entry, and can only be changed within a completion + entry finder function. */ +int rl_filename_quoting_desired = 1; + +/* This function, if defined, is called by the completer when real + filename completion is done, after all the matching names have been + generated. It is passed a (char**) known as matches in the code below. + It consists of a NULL-terminated array of pointers to potential + matching strings. The 1st element (matches[0]) is the maximal + substring that is common to all matches. This function can re-arrange + the list of matches as required, but all elements of the array must be + free()'d if they are deleted. The main intent of this function is + to implement FIGNORE a la SunOS csh. */ +Function *rl_ignore_some_completions_function = (Function *)NULL; + +#if defined (SHELL) +/* A function to strip quotes that are not protected by backquotes. It + allows single quotes to appear within double quotes, and vice versa. + It should be smarter. It's fairly shell-specific, hence the SHELL + definition wrapper. */ +static char * +_delete_quotes (text) + char *text; +{ + char *ret, *p, *r; + int l, quoted; + + l = strlen (text); + ret = xmalloc (l + 1); + for (quoted = 0, p = text, r = ret; p && *p; p++) + { + /* Allow backslash-quoted characters to pass through unscathed. */ + if (*p == '\\') + continue; + /* Close quote. */ + if (quoted && *p == quoted) + { + quoted = 0; + continue; + } + /* Open quote. */ + if (quoted == 0 && (*p == '\'' || *p == '"')) + { + quoted = *p; + continue; + } + *r++ = *p; + } + *r = '\0'; + return ret; +} +#endif /* SHELL */ + +/* Return the portion of PATHNAME that should be output when listing + possible completions. If we are hacking filename completion, we + are only interested in the basename, the portion following the + final slash. Otherwise, we return what we were passed. */ +static char * +printable_part (pathname) + char *pathname; +{ + char *temp = (char *)NULL; + + if (rl_filename_completion_desired) + temp = strrchr (pathname, '/'); + + if (!temp) + return (pathname); + else + return (++temp); +} + +/* Output TO_PRINT to rl_outstream. If VISIBLE_STATS is defined and we + are using it, check for and output a single character for `special' + filenames. Return 1 if we printed an extension character, 0 if not. */ +static int +print_filename (to_print, full_pathname) + char *to_print, *full_pathname; +{ +#if !defined (VISIBLE_STATS) + fputs (to_print, rl_outstream); + return 0; +#else + char *s, c, *new_full_pathname; + int extension_char = 0, slen, tlen; + + fputs (to_print, rl_outstream); + if (rl_filename_completion_desired && rl_visible_stats) + { + /* If to_print != full_pathname, to_print is the basename of the + path passed. In this case, we try to expand the directory + name before checking for the stat character. */ + if (to_print != full_pathname) + { + /* Terminate the directory name. */ + c = to_print[-1]; + to_print[-1] = '\0'; + + s = tilde_expand (full_pathname); + if (rl_directory_completion_hook) + (*rl_directory_completion_hook) (&s); + + slen = strlen (s); + tlen = strlen (to_print); + new_full_pathname = xmalloc (slen + tlen + 2); + strcpy (new_full_pathname, s); + new_full_pathname[slen] = '/'; + strcpy (new_full_pathname + slen + 1, to_print); + + extension_char = stat_char (new_full_pathname); + + free (new_full_pathname); + to_print[-1] = c; + } + else + { + s = tilde_expand (full_pathname); + extension_char = stat_char (s); + } + + free (s); + if (extension_char) + putc (extension_char, rl_outstream); + return (extension_char != 0); + } + else + return 0; +#endif /* VISIBLE_STATS */ +} + +/* Complete the word at or before point. + WHAT_TO_DO says what to do with the completion. + `?' means list the possible completions. + TAB means do standard completion. + `*' means insert all of the possible completions. + `!' means to do standard completion, and list all possible completions if + there is more than one. */ +rl_complete_internal (what_to_do) + int what_to_do; +{ + char **matches; + Function *our_func; + int start, scan, end, delimiter = 0, pass_next; + char *text, *saved_line_buffer; + char *replacement; + char quote_char = '\0'; + int found_quote = 0; + + if (rl_line_buffer) + saved_line_buffer = savestring (rl_line_buffer); + else + saved_line_buffer = (char *)NULL; + + if (rl_completion_entry_function) + our_func = rl_completion_entry_function; + else + our_func = (Function *)filename_completion_function; + + /* Only the completion entry function can change these. */ + rl_filename_completion_desired = 0; + rl_filename_quoting_desired = 1; + + /* We now look backwards for the start of a filename/variable word. */ + end = rl_point; + + if (rl_point) + { + if (rl_completer_quote_characters) + { + /* We have a list of characters which can be used in pairs to + quote substrings for the completer. Try to find the start + of an unclosed quoted substring. */ + /* FOUND_QUOTE is set so we know what kind of quotes we found. */ + for (scan = pass_next = 0; scan < end; scan++) + { + if (pass_next) + { + pass_next = 0; + continue; + } + + if (rl_line_buffer[scan] == '\\') + { + pass_next = 1; + found_quote |= 4; + continue; + } + + if (quote_char != '\0') + { + /* Ignore everything until the matching close quote char. */ + if (rl_line_buffer[scan] == quote_char) + { + /* Found matching close. Abandon this substring. */ + quote_char = '\0'; + rl_point = end; + } + } + else if (strchr (rl_completer_quote_characters, rl_line_buffer[scan])) + { + /* Found start of a quoted substring. */ + quote_char = rl_line_buffer[scan]; + rl_point = scan + 1; + /* Shell-like quoting conventions. */ + if (quote_char == '\'') + found_quote |= 1; + else if (quote_char == '"') + found_quote |= 2; + } + } + } + + if (rl_point == end) + { + int quoted = 0; + /* We didn't find an unclosed quoted substring upon which to do + completion, so use the word break characters to find the + substring on which to complete. */ + while (--rl_point) + { + scan = rl_line_buffer[rl_point]; + + if (strchr (rl_completer_word_break_characters, scan) == 0) + continue; + +#if defined (SHELL) + /* Don't let word break characters in quoted substrings break + words for the completer. */ + if (found_quote && char_is_quoted (rl_line_buffer, rl_point)) + continue; +#endif /* SHELL */ + + /* Convoluted code, but it avoids an n^2 algorithm with calls + to char_is_quoted. */ + break; + } + } + + /* If we are at an unquoted word break, then advance past it. */ + scan = rl_line_buffer[rl_point]; +#if defined (SHELL) + if ((found_quote == 0 || char_is_quoted (rl_line_buffer, rl_point) == 0) && + strchr (rl_completer_word_break_characters, scan)) +#else + if (strchr (rl_completer_word_break_characters, scan)) +#endif + { + /* If the character that caused the word break was a quoting + character, then remember it as the delimiter. */ + if (strchr ("\"'", scan) && (end - rl_point) > 1) + delimiter = scan; + + /* If the character isn't needed to determine something special + about what kind of completion to perform, then advance past it. */ + if (!rl_special_prefixes || strchr (rl_special_prefixes, scan) == 0) + rl_point++; + } + } + + /* At this point, we know we have an open quote if quote_char != '\0'. */ + start = rl_point; + rl_point = end; + text = rl_copy_text (start, end); + + /* If the user wants to TRY to complete, but then wants to give + up and use the default completion function, they set the + variable rl_attempted_completion_function. */ + if (rl_attempted_completion_function) + { + matches = (*rl_attempted_completion_function) (text, start, end); + + if (matches || rl_attempted_completion_over) + { + rl_attempted_completion_over = 0; + our_func = (Function *)NULL; + goto after_usual_completion; + } + } + +#if defined (SHELL) + /* Beware -- we're stripping the quotes here. Do this only if we know + we are doing filename completion. */ + if (found_quote && our_func == (Function *)filename_completion_function) + { + /* delete single and double quotes */ + replacement = _delete_quotes (text); + free (text); + text = replacement; + replacement = (char *)0; + } +#endif /* SHELL */ + + matches = completion_matches (text, our_func); + + after_usual_completion: + free (text); + + if (!matches) + ding (); + else + { + register int i; + int should_quote; + + /* It seems to me that in all the cases we handle we would like + to ignore duplicate possiblilities. Scan for the text to + insert being identical to the other completions. */ + if (rl_ignore_completion_duplicates) + { + char *lowest_common; + int j, newlen = 0; + char dead_slot; + char **temp_array; + + /* Sort the items. */ + /* It is safe to sort this array, because the lowest common + denominator found in matches[0] will remain in place. */ + for (i = 0; matches[i]; i++); + qsort (matches, i, sizeof (char *), compare_strings); + + /* Remember the lowest common denominator for it may be unique. */ + lowest_common = savestring (matches[0]); + + for (i = 0; matches[i + 1]; i++) + { + if (strcmp (matches[i], matches[i + 1]) == 0) + { + free (matches[i]); + matches[i] = (char *)&dead_slot; + } + else + newlen++; + } + + /* We have marked all the dead slots with (char *)&dead_slot. + Copy all the non-dead entries into a new array. */ + temp_array = (char **)xmalloc ((3 + newlen) * sizeof (char *)); + for (i = j = 1; matches[i]; i++) + { + if (matches[i] != (char *)&dead_slot) + temp_array[j++] = matches[i]; + } + temp_array[j] = (char *)NULL; + + if (matches[0] != (char *)&dead_slot) + free (matches[0]); + free (matches); + + matches = temp_array; + + /* Place the lowest common denominator back in [0]. */ + matches[0] = lowest_common; + + /* If there is one string left, and it is identical to the + lowest common denominator, then the LCD is the string to + insert. */ + if (j == 2 && strcmp (matches[0], matches[1]) == 0) + { + free (matches[1]); + matches[1] = (char *)NULL; + } + } + + switch (what_to_do) + { + case TAB: + case '!': + /* If we are matching filenames, then here is our chance to + do clever processing by re-examining the list. Call the + ignore function with the array as a parameter. It can + munge the array, deleting matches as it desires. */ + if (rl_ignore_some_completions_function && + our_func == (Function *)filename_completion_function) + (void)(*rl_ignore_some_completions_function)(matches); + + /* If we are doing completion on quoted substrings, and any matches + contain any of the completer_word_break_characters, then auto- + matically prepend the substring with a quote character (just pick + the first one from the list of such) if it does not already begin + with a quote string. FIXME: Need to remove any such automatically + inserted quote character when it no longer is necessary, such as + if we change the string we are completing on and the new set of + matches don't require a quoted substring. */ + replacement = matches[0]; + + should_quote = matches[0] && rl_completer_quote_characters && + rl_filename_completion_desired && + rl_filename_quoting_desired; + + if (should_quote) +#if defined (SHELL) + should_quote = should_quote && (!quote_char || quote_char == '"'); +#else + should_quote = should_quote && !quote_char; +#endif + + if (should_quote) + { + int do_replace; + + do_replace = NO_MATCH; + + /* If there is a single match, see if we need to quote it. + This also checks whether the common prefix of several + matches needs to be quoted. If the common prefix should + not be checked, add !matches[1] to the if clause. */ + should_quote = rl_strpbrk (matches[0], rl_completer_word_break_characters) != 0; +#if defined (SHELL) + should_quote = should_quote || rl_strpbrk (matches[0], "#$`") != 0; +#endif + + if (should_quote) + do_replace = matches[1] ? MULT_MATCH : SINGLE_MATCH; + + if (do_replace != NO_MATCH) + { +#if defined (SHELL) + /* Quote the replacement, since we found an + embedded word break character in a potential + match. */ + char *rtext, *mtext; + int rlen; + extern char *double_quote (); /* in builtins/common.c */ + + /* If DO_REPLACE == MULT_MATCH, it means that there is + more than one match. In this case, we do not add + the closing quote or attempt to perform tilde + expansion. If DO_REPLACE == SINGLE_MATCH, we try + to perform tilde expansion, because double quotes + inhibit tilde expansion by the shell. */ + + mtext = matches[0]; + if (mtext[0] == '~' && do_replace == SINGLE_MATCH) + mtext = tilde_expand (matches[0]); + rtext = double_quote (mtext); + if (mtext != matches[0]) + free (mtext); + + rlen = strlen (rtext); + replacement = xmalloc (rlen + 1); + /* If we're completing on a quoted string where the user + has already supplied the opening quote, we don't want + the quote in the replacement text, and we reset + QUOTE_CHAR to 0 to avoid an extra closing quote. */ + if (quote_char == '"') + { + strcpy (replacement, rtext + 1); + rlen--; + quote_char = 0; + } + else + strcpy (replacement, rtext); + if (do_replace == MULT_MATCH) + replacement[rlen - 1] = '\0'; + free (rtext); +#else /* !SHELL */ + /* Found an embedded word break character in a potential + match, so we need to prepend a quote character if we + are replacing the completion string. */ + replacement = xmalloc (strlen (matches[0]) + 2); + quote_char = *rl_completer_quote_characters; + *replacement = quote_char; + strcpy (replacement + 1, matches[0]); +#endif /* SHELL */ + } + } + + if (replacement) + { + rl_begin_undo_group (); + rl_delete_text (start, rl_point); + rl_point = start; + rl_insert_text (replacement); + rl_end_undo_group (); + if (replacement != matches[0]) + free (replacement); + } + + /* If there are more matches, ring the bell to indicate. + If this was the only match, and we are hacking files, + check the file to see if it was a directory. If so, + add a '/' to the name. If not, and we are at the end + of the line, then add a space. */ + if (matches[1]) + { + if (what_to_do == '!') + goto display_matches; /* XXX */ + else if (rl_editing_mode != vi_mode) + ding (); /* There are other matches remaining. */ + } + else + { + char temp_string[4]; + int temp_string_index = 0; + + if (quote_char) + temp_string[temp_string_index++] = quote_char; + + temp_string[temp_string_index++] = delimiter ? delimiter : ' '; + temp_string[temp_string_index++] = '\0'; + + if (rl_filename_completion_desired) + { + struct stat finfo; + char *filename = tilde_expand (matches[0]); + + if ((stat (filename, &finfo) == 0) && S_ISDIR (finfo.st_mode)) + { + if (rl_line_buffer[rl_point] != '/') + rl_insert_text ("/"); + } + else + { + if (rl_point == rl_end) + rl_insert_text (temp_string); + } + free (filename); + } + else + { + if (rl_point == rl_end) + rl_insert_text (temp_string); + } + } + break; + + case '*': + { + int i = 1; + + rl_begin_undo_group (); + rl_delete_text (start, rl_point); + rl_point = start; + if (matches[1]) + { + while (matches[i]) + { + rl_insert_text (matches[i++]); + rl_insert_text (" "); + } + } + else + { + rl_insert_text (matches[0]); + rl_insert_text (" "); + } + rl_end_undo_group (); + } + break; + + case '?': + { + int len, count, limit, max; + int j, k, l; + + /* Handle simple case first. What if there is only one answer? */ + if (!matches[1]) + { + char *temp; + + temp = printable_part (matches[0]); + crlf (); + print_filename (temp, matches[0]); + crlf (); + goto restart; + } + + /* There is more than one answer. Find out how many there are, + and find out what the maximum printed length of a single entry + is. */ + display_matches: + for (max = 0, i = 1; matches[i]; i++) + { + char *temp; + int name_length; + + temp = printable_part (matches[i]); + name_length = strlen (temp); + + if (name_length > max) + max = name_length; + } + + len = i - 1; + + /* If there are many items, then ask the user if she + really wants to see them all. */ + if (len >= rl_completion_query_items) + { + crlf (); + fprintf (rl_outstream, + "There are %d possibilities. Do you really", len); + crlf (); + fprintf (rl_outstream, "wish to see them all? (y or n)"); + fflush (rl_outstream); + if (!get_y_or_n ()) + { + crlf (); + goto restart; + } + } + + /* How many items of MAX length can we fit in the screen window? */ + max += 2; + limit = screenwidth / max; + if (limit != 1 && (limit * max == screenwidth)) + limit--; + + /* Avoid a possible floating exception. If max > screenwidth, + limit will be 0 and a divide-by-zero fault will result. */ + if (limit == 0) + limit = 1; + + /* How many iterations of the printing loop? */ + count = (len + (limit - 1)) / limit; + + /* Watch out for special case. If LEN is less than LIMIT, then + just do the inner printing loop. */ + if (len < limit) + count = 1; + + /* Sort the items if they are not already sorted. */ + if (!rl_ignore_completion_duplicates) + qsort (matches, len, sizeof (char *), compare_strings); + + /* Print the sorted items, up-and-down alphabetically, like + ls might. */ + crlf (); + + for (i = 1; i < count + 1; i++) + { + for (j = 0, l = i; j < limit; j++) + { + if (l > len || !matches[l]) + break; + else + { + char *temp; + int printed_length; + + temp = printable_part (matches[l]); + printed_length = strlen (temp); + printed_length += print_filename (temp, matches[l]); + + if (j + 1 < limit) + { + for (k = 0; k < max - printed_length; k++) + putc (' ', rl_outstream); + } + } + l += count; + } + crlf (); + } + restart: + + rl_on_new_line (); + } + break; + + default: + fprintf (stderr, "\r\nreadline: bad value for what_to_do in rl_complete\n"); + abort (); + } + + for (i = 0; matches[i]; i++) + free (matches[i]); + free (matches); + } + + /* Check to see if the line has changed through all of this manipulation. */ + if (saved_line_buffer) + { + if (strcmp (rl_line_buffer, saved_line_buffer) != 0) + completion_changed_buffer = 1; + else + completion_changed_buffer = 0; + + free (saved_line_buffer); + } + return 0; +} + +#if defined (VISIBLE_STATS) +/* Return the character which best describes FILENAME. + `@' for symbolic links + `/' for directories + `*' for executables + `=' for sockets */ +static int +stat_char (filename) + char *filename; +{ + struct stat finfo; + int character, r; + +#if defined (S_ISLNK) + r = lstat (filename, &finfo); +#else + r = stat (filename, &finfo); +#endif + + if (r == -1) + return (0); + + character = 0; + if (S_ISDIR (finfo.st_mode)) + character = '/'; +#if defined (S_ISLNK) + else if (S_ISLNK (finfo.st_mode)) + character = '@'; +#endif /* S_ISLNK */ +#if defined (S_ISSOCK) + else if (S_ISSOCK (finfo.st_mode)) + character = '='; +#endif /* S_ISSOCK */ + else if (S_ISREG (finfo.st_mode)) + { + if (access (filename, X_OK) == 0) + character = '*'; + } + return (character); +} +#endif /* VISIBLE_STATS */ + +/* Stupid comparison routine for qsort () ing strings. */ +static int +compare_strings (s1, s2) + char **s1, **s2; +{ + int result; + + result = **s1 - **s2; + if (result == 0) + result = strcmp (*s1, *s2); + + return result; +} + +/* A completion function for usernames. + TEXT contains a partial username preceded by a random + character (usually `~'). */ +char * +username_completion_function (text, state) + int state; + char *text; +{ +#if defined (__GO32__) + return (char *)NULL; +#else /* !__GO32__ */ + static char *username = (char *)NULL; + static struct passwd *entry; + static int namelen, first_char, first_char_loc; + + if (!state) + { + if (username) + free (username); + + first_char = *text; + + if (first_char == '~') + first_char_loc = 1; + else + first_char_loc = 0; + + username = savestring (&text[first_char_loc]); + namelen = strlen (username); + setpwent (); + } + + while (entry = getpwent ()) + { + if ((username[0] == entry->pw_name[0]) && + (strncmp (username, entry->pw_name, namelen) == 0)) + break; + } + + if (!entry) + { + endpwent (); + return ((char *)NULL); + } + else + { + char *value = xmalloc (2 + strlen (entry->pw_name)); + + *value = *text; + + strcpy (value + first_char_loc, entry->pw_name); + + if (first_char == '~') + rl_filename_completion_desired = 1; + + return (value); + } +#endif /* !__GO32__ */ +} + +/* **************************************************************** */ +/* */ +/* Completion */ +/* */ +/* **************************************************************** */ + +/* Non-zero means that case is not significant in completion. */ +int completion_case_fold = 0; + +/* Return an array of (char *) which is a list of completions for TEXT. + If there are no completions, return a NULL pointer. + The first entry in the returned array is the substitution for TEXT. + The remaining entries are the possible completions. + The array is terminated with a NULL pointer. + + ENTRY_FUNCTION is a function of two args, and returns a (char *). + The first argument is TEXT. + The second is a state argument; it should be zero on the first call, and + non-zero on subsequent calls. It returns a NULL pointer to the caller + when there are no more matches. + */ +char ** +completion_matches (text, entry_function) + char *text; + CPFunction *entry_function; +{ + /* Number of slots in match_list. */ + int match_list_size; + + /* The list of matches. */ + char **match_list = + (char **)xmalloc (((match_list_size = 10) + 1) * sizeof (char *)); + + /* Number of matches actually found. */ + int matches = 0; + + /* Temporary string binder. */ + char *string; + + match_list[1] = (char *)NULL; + + while (string = (*entry_function) (text, matches)) + { + if (matches + 1 == match_list_size) + match_list = (char **)xrealloc + (match_list, ((match_list_size += 10) + 1) * sizeof (char *)); + + match_list[++matches] = string; + match_list[matches + 1] = (char *)NULL; + } + + /* If there were any matches, then look through them finding out the + lowest common denominator. That then becomes match_list[0]. */ + if (matches) + { + register int i = 1; + int low = 100000; /* Count of max-matched characters. */ + + /* If only one match, just use that. */ + if (matches == 1) + { + match_list[0] = match_list[1]; + match_list[1] = (char *)NULL; + } + else + { + /* Otherwise, compare each member of the list with + the next, finding out where they stop matching. */ + + while (i < matches) + { + register int c1, c2, si; + + if (completion_case_fold) + { + for (si = 0; + (c1 = to_lower(match_list[i][si])) && + (c2 = to_lower(match_list[i + 1][si])); + si++) + if (c1 != c2) break; + } + else + { + for (si = 0; + (c1 = match_list[i][si]) && + (c2 = match_list[i + 1][si]); + si++) + if (c1 != c2) break; + } + + if (low > si) low = si; + i++; + } + match_list[0] = xmalloc (low + 1); + strncpy (match_list[0], match_list[1], low); + match_list[0][low] = '\0'; + } + } + else /* There were no matches. */ + { + free (match_list); + match_list = (char **)NULL; + } + return (match_list); +} + +/* Okay, now we write the entry_function for filename completion. In the + general case. Note that completion in the shell is a little different + because of all the pathnames that must be followed when looking up the + completion for a command. */ +char * +filename_completion_function (text, state) + int state; + char *text; +{ + static DIR *directory; + static char *filename = (char *)NULL; + static char *dirname = (char *)NULL; + static char *users_dirname = (char *)NULL; + static int filename_len; + + struct dirent *entry = (struct dirent *)NULL; + + /* If we don't have any state, then do some initialization. */ + if (!state) + { + char *temp; + + if (dirname) free (dirname); + if (filename) free (filename); + if (users_dirname) free (users_dirname); + + filename = savestring (text); + if (!*text) text = "."; + dirname = savestring (text); + + temp = strrchr (dirname, '/'); + + if (temp) + { + strcpy (filename, ++temp); + *temp = '\0'; + } + else + strcpy (dirname, "."); + + /* We aren't done yet. We also support the "~user" syntax. */ + + /* Save the version of the directory that the user typed. */ + users_dirname = savestring (dirname); + { + char *temp_dirname; + int replace_dirname; + + temp_dirname = tilde_expand (dirname); + free (dirname); + dirname = temp_dirname; + + replace_dirname = 0; + if (rl_directory_completion_hook) + replace_dirname = (*rl_directory_completion_hook) (&dirname); + if (replace_dirname) + { + free (users_dirname); + users_dirname = savestring (dirname); + } + } + directory = opendir (dirname); + filename_len = strlen (filename); + + rl_filename_completion_desired = 1; + } + + /* At this point we should entertain the possibility of hacking wildcarded + filenames, like /usr/man/man/te. If the directory name + contains globbing characters, then build an array of directories, and + then map over that list while completing. */ + /* *** UNIMPLEMENTED *** */ + + /* Now that we have some state, we can read the directory. */ + + while (directory && (entry = readdir (directory))) + { + /* Special case for no filename. + All entries except "." and ".." match. */ + if (!filename_len) + { + if ((strcmp (entry->d_name, ".") != 0) && + (strcmp (entry->d_name, "..") != 0)) + break; + } + else + { + /* Otherwise, if these match up to the length of filename, then + it is a match. */ + if ((entry->d_name[0] == filename[0]) && + (((int)D_NAMLEN (entry)) >= filename_len) && + (strncmp (filename, entry->d_name, filename_len) == 0)) + break; + } + } + + if (!entry) + { + if (directory) + { + closedir (directory); + directory = (DIR *)NULL; + } + if (dirname) + { + free (dirname); + dirname = (char *)NULL; + } + if (filename) + { + free (filename); + filename = (char *)NULL; + } + if (users_dirname) + { + free (users_dirname); + users_dirname = (char *)NULL; + } + + return (char *)NULL; + } + else + { + char *temp; + + /* dirname && (strcmp (dirname, ".") != 0) */ + if (dirname && (dirname[0] != '.' || dirname[1])) + { + if (rl_complete_with_tilde_expansion && *users_dirname == '~') + { + int dirlen = strlen (dirname); + temp = xmalloc (2 + dirlen + D_NAMLEN (entry)); + strcpy (temp, dirname); + /* Canonicalization cuts off any final slash present. We need + to add it back. */ + if (dirname[dirlen - 1] != '/') + { + temp[dirlen] = '/'; + temp[dirlen + 1] = '\0'; + } + } + else + { + temp = xmalloc (1 + strlen (users_dirname) + D_NAMLEN (entry)); + strcpy (temp, users_dirname); + } + + strcat (temp, entry->d_name); + } + else + temp = (savestring (entry->d_name)); + + return (temp); + } +} + +/* A function for simple tilde expansion. */ +int +rl_tilde_expand (ignore, key) + int ignore, key; +{ + register int start, end; + char *homedir; + + end = rl_point; + start = end - 1; + + if (rl_point == rl_end && rl_line_buffer[rl_point] == '~') + { + homedir = tilde_expand ("~"); + goto insert; + } + else if (rl_line_buffer[start] != '~') + { + for (; !whitespace (rl_line_buffer[start]) && start >= 0; start--); + start++; + } + + end = start; + do + { + end++; + } + while (!whitespace (rl_line_buffer[end]) && end < rl_end); + + if (whitespace (rl_line_buffer[end]) || end >= rl_end) + end--; + + /* If the first character of the current word is a tilde, perform + tilde expansion and insert the result. If not a tilde, do + nothing. */ + if (rl_line_buffer[start] == '~') + { + char *temp; + int len; + + len = end - start + 1; + temp = xmalloc (len + 1); + strncpy (temp, rl_line_buffer + start, len); + temp[len] = '\0'; + homedir = tilde_expand (temp); + free (temp); + + insert: + rl_begin_undo_group (); + rl_delete_text (start, end + 1); + rl_point = start; + rl_insert_text (homedir); + rl_end_undo_group (); + } + + return (0); +} + +/* Find the first occurrence in STRING1 of any character from STRING2. + Return a pointer to the character in STRING1. */ +static char * +rl_strpbrk (string1, string2) + char *string1, *string2; +{ + register char *scan; + + for (; *string1; string1++) + { + for (scan = string2; *scan; scan++) + { + if (*string1 == *scan) + { + return (string1); + } + } + } + return ((char *)NULL); +} + +#if defined (STATIC_MALLOC) + +/* **************************************************************** */ +/* */ +/* xmalloc and xrealloc () */ +/* */ +/* **************************************************************** */ + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)malloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "readline: Out of virtual memory!\n"); + abort (); +} +#endif /* STATIC_MALLOC */ diff --git a/config.h b/config.h new file mode 100644 index 0000000..045ea22 --- /dev/null +++ b/config.h @@ -0,0 +1,71 @@ +/* config.h. Generated automatically by configure. */ +/* config.h.in. Generated automatically from configure.in by autoheader. */ + +#ifndef _RL_CONFIG_H +#define _RL_CONFIG_H + +/* Define if using alloca.c. */ +/* #undef C_ALLOCA */ + +/* Define to one of _getb67, GETB67, getb67 for Cray-2 and Cray-YMP systems. + This function is required for alloca.c support on those systems. */ +/* #undef CRAY_STACKSEG_END */ + +/* Define if you have alloca.h and it should be used (not Ultrix). */ +#define HAVE_ALLOCA_H 1 + +/* If using the C implementation of alloca, define if you know the + direction of stack growth for your system; otherwise it will be + automatically deduced at run-time. + STACK_DIRECTION > 0 => grows toward higher addresses + STACK_DIRECTION < 0 => grows toward lower addresses + STACK_DIRECTION = 0 => direction of growth unknown + */ +/* #undef STACK_DIRECTION */ + +/* Define if you do not have strings.h, index, bzero, etc.. */ +/* #undef USG */ + +/* Define if your system defines TIOCGWINSZ in sys/ioctl.h. */ +#define GWINSZ_IN_SYS_IOCTL 1 + +/* #undef HAVE_GETPW_DECLS */ +#define NO_SYS_FILE 1 + +/* Define if you have strcasecmp. */ +#define HAVE_STRCASECMP 1 + +/* Define if you have the header file. */ +#define HAVE_ALLOCA_H 1 + +/* Define if you have the header file. */ +/* #undef HAVE_DIRENT_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_STDLIB_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_STRING_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_SYS_PTE_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_SYS_PTEM_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_SYS_STREAM_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_TERMCAP_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_TERMIO_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_UNISTD_H */ + +/* Define if you have the header file. */ +/* #undef HAVE_VARARGS_H */ + +#endif diff --git a/config.h.in b/config.h.in new file mode 100644 index 0000000..7d7525d --- /dev/null +++ b/config.h.in @@ -0,0 +1,70 @@ +/* config.h.in. Generated automatically from configure.in by autoheader. */ + +#ifndef _RL_CONFIG_H +#define _RL_CONFIG_H + +/* Define if using alloca.c. */ +#undef C_ALLOCA + +/* Define to one of _getb67, GETB67, getb67 for Cray-2 and Cray-YMP systems. + This function is required for alloca.c support on those systems. */ +#undef CRAY_STACKSEG_END + +/* Define if you have alloca.h and it should be used (not Ultrix). */ +#undef HAVE_ALLOCA_H + +/* If using the C implementation of alloca, define if you know the + direction of stack growth for your system; otherwise it will be + automatically deduced at run-time. + STACK_DIRECTION > 0 => grows toward higher addresses + STACK_DIRECTION < 0 => grows toward lower addresses + STACK_DIRECTION = 0 => direction of growth unknown + */ +#undef STACK_DIRECTION + +/* Define if you do not have strings.h, index, bzero, etc.. */ +#undef USG + +/* Define if your system defines TIOCGWINSZ in sys/ioctl.h. */ +#undef GWINSZ_IN_SYS_IOCTL + +#undef HAVE_GETPW_DECLS +#undef NO_SYS_FILE + +/* Define if you have strcasecmp. */ +#undef HAVE_STRCASECMP + +/* Define if you have the header file. */ +#undef HAVE_ALLOCA_H + +/* Define if you have the header file. */ +#undef HAVE_DIRENT_H + +/* Define if you have the header file. */ +#undef HAVE_STDLIB_H + +/* Define if you have the header file. */ +#undef HAVE_STRING_H + +/* Define if you have the header file. */ +#undef HAVE_SYS_PTE_H + +/* Define if you have the header file. */ +#undef HAVE_SYS_PTEM_H + +/* Define if you have the header file. */ +#undef HAVE_SYS_STREAM_H + +/* Define if you have the header file. */ +#undef HAVE_TERMCAP_H + +/* Define if you have the header file. */ +#undef HAVE_TERMIO_H + +/* Define if you have the header file. */ +#undef HAVE_UNISTD_H + +/* Define if you have the header file. */ +#undef HAVE_VARARGS_H + +#endif diff --git a/config.status b/config.status new file mode 100755 index 0000000..b6bc9ee --- /dev/null +++ b/config.status @@ -0,0 +1,190 @@ +#!/bin/sh +# Generated automatically by configure. +# Run this file to recreate the current configuration. +# This directory was configured as follows, +# on host odin: +# +# ./configure --with-gcc + +ac_cs_usage="Usage: config.status [--recheck] [--version] [--help]" +for ac_option +do + case "$ac_option" in + -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) + echo running ${CONFIG_SHELL-/bin/sh} ./configure --with-gcc --no-create + exec ${CONFIG_SHELL-/bin/sh} ./configure --with-gcc --no-create ;; + -version | --version | --versio | --versi | --vers | --ver | --ve | --v) + echo "config.status generated by autoconf version 1.11" + exit 0 ;; + -help | --help | --hel | --he | --h) + echo "$ac_cs_usage"; exit 0 ;; + *) echo "$ac_cs_usage"; exit 1 ;; + esac +done + +trap 'rm -fr Makefile config.h conftest*; exit 1' 1 2 15 +CC='gcc' +CFLAGS='-g -O' +LDFLAGS='' +CPP='/lib/cpp' +INSTALL='/bin/install -c' +INSTALL_PROGRAM='${INSTALL}' +INSTALL_DATA='${INSTALL} -m 644' +RANLIB='ranlib' +ALLOCA='' +LIBS='' +srcdir='.' +top_srcdir='' +prefix='/usr/local' +exec_prefix='${prefix}' +ac_prsub='' +ac_vpsub='/^[ ]*VPATH[ ]*=[^:]*$/d' +extrasub='' + +ac_given_srcdir=$srcdir + +CONFIG_FILES=${CONFIG_FILES-"Makefile"} +for ac_file in .. ${CONFIG_FILES}; do if test "x$ac_file" != x..; then + # Remove last slash and all that follows it. Not all systems have dirname. + ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'` + if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then + # The file is in a subdirectory. + test ! -d "$ac_dir" && mkdir "$ac_dir" + ac_dir_suffix="/$ac_dir" + else + ac_dir_suffix= + fi + + # A "../" for each directory in $ac_dir_suffix. + ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'` + case "$ac_given_srcdir" in + .) srcdir=. + if test -z "$ac_dir_suffix"; then top_srcdir=. + else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;; + /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;; + *) # Relative path. + srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix" + top_srcdir="$ac_dots$ac_given_srcdir" ;; + esac + + echo creating "$ac_file" + rm -f "$ac_file" + comment_str="Generated automatically from `echo $ac_file|sed 's|.*/||'`.in by configure." + case "$ac_file" in + *.c | *.h | *.C | *.cc | *.m ) echo "/* $comment_str */" > "$ac_file" ;; + * ) echo "# $comment_str" > "$ac_file" ;; + esac + sed -e " +$ac_prsub +$ac_vpsub +$extrasub +s%@CC@%$CC%g +s%@CFLAGS@%$CFLAGS%g +s%@LDFLAGS@%$LDFLAGS%g +s%@CPP@%$CPP%g +s%@INSTALL@%$INSTALL%g +s%@INSTALL_PROGRAM@%$INSTALL_PROGRAM%g +s%@INSTALL_DATA@%$INSTALL_DATA%g +s%@RANLIB@%$RANLIB%g +s%@ALLOCA@%$ALLOCA%g +s%@LIBS@%$LIBS%g +s%@srcdir@%$srcdir%g +s%@top_srcdir@%$top_srcdir%g +s%@prefix@%$prefix%g +s%@exec_prefix@%$exec_prefix%g +s%@DEFS@%-DHAVE_CONFIG_H%" $ac_given_srcdir/${ac_file}.in >> $ac_file +fi; done + +# These sed commands are put into ac_sed_defs when defining a macro. +# They are broken into pieces to make the sed script easier to manage. +# They are passed to sed as "A NAME B NAME C VALUE D", where NAME +# is the cpp macro being defined and VALUE is the value it is being given. +# Each defining turns into a single global substitution command. +# Hopefully no one uses "!" as a variable value. +# Other candidates for the sed separators, like , and @, do get used. +# +# ac_d sets the value in "#define NAME VALUE" lines. +ac_dA='s!^\([ ]*\)#\([ ]*define[ ][ ]*\)' +ac_dB='\([ ][ ]*\)[^ ]*!\1#\2' +ac_dC='\3' +ac_dD='!g' +# ac_u turns "#undef NAME" with trailing blanks into "#define NAME VALUE". +ac_uA='s!^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' +ac_uB='\([ ]\)!\1#\2define\3' +ac_uC=' ' +ac_uD='\4!g' +# ac_e turns "#undef NAME" without trailing blanks into "#define NAME VALUE". +ac_eA='s!^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' +ac_eB='$!\1#\2define\3' +ac_eC=' ' +ac_eD='!g' +rm -f conftest.sed +cat >> conftest.sed <> conftest.sed <> conftest.sed <<\CONFEOF +s,^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */, +CONFEOF +rm -f conftest.h +# Break up the sed commands because old seds have small limits. +ac_max_sed_lines=20 + +CONFIG_HEADERS=${CONFIG_HEADERS-"config.h"} +for ac_file in .. ${CONFIG_HEADERS}; do if test "x$ac_file" != x..; then + echo creating $ac_file + + cp $ac_given_srcdir/$ac_file.in conftest.h1 + cp conftest.sed conftest.stm + while : + do + ac_lines=`grep -c . conftest.stm` + if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi + rm -f conftest.s1 conftest.s2 conftest.h2 + sed ${ac_max_sed_lines}q conftest.stm > conftest.s1 # Like head -20. + sed 1,${ac_max_sed_lines}d conftest.stm > conftest.s2 # Like tail +21. + sed -f conftest.s1 < conftest.h1 > conftest.h2 + rm -f conftest.s1 conftest.h1 conftest.stm + mv conftest.h2 conftest.h1 + mv conftest.s2 conftest.stm + done + rm -f conftest.stm conftest.h + echo "/* $ac_file. Generated automatically by configure. */" > conftest.h + cat conftest.h1 >> conftest.h + rm -f conftest.h1 + if cmp -s $ac_file conftest.h 2>/dev/null; then + # The file exists and we would not be changing it. + echo "$ac_file is unchanged" + rm -f conftest.h + else + rm -f $ac_file + mv conftest.h $ac_file + fi +fi; done +rm -f conftest.sed + + + +# Makefile uses this timestamp file to record whether config.h is up to date. +touch stamp-config +exit 0 diff --git a/configure b/configure new file mode 100755 index 0000000..c1b0a63 --- /dev/null +++ b/configure @@ -0,0 +1,1240 @@ +#!/bin/sh +# Guess values for system-dependent variables and create Makefiles. +# Generated automatically using autoconf version 1.11 +# Copyright (C) 1991, 1992, 1993, 1994 Free Software Foundation, Inc. + +# This configure script is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as published +# by the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This script is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General +# Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. + +# Save the original args to write them into config.status later. +configure_args="$*" + +# Only options that might do something get documented. +ac_usage="Usage: configure [options] [host] +Options: [defaults in brackets after descriptions] +--build=BUILD configure for building on BUILD [BUILD=HOST] +--disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no) +--enable-FEATURE[=ARG] include FEATURE [ARG=yes] +--exec-prefix=PREFIX install host dependent files in PREFIX [/usr/local] +--help print this message +--host=HOST configure for HOST [guessed] +--prefix=PREFIX install host independent files in PREFIX [/usr/local] +--quiet, --silent do not print \`checking for...' messages +--srcdir=DIR find the sources in DIR [configure dir or ..] +--target=TARGET configure for TARGET [TARGET=HOST] +--verbose print results of checks +--version print the version of autoconf that created configure +--with-PACKAGE[=ARG] use PACKAGE [ARG=yes] +--without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) +--x-includes=DIR X include files are in DIR +--x-libraries=DIR X library files are in DIR" + +# Initialize some variables set by options. +# The variables have the same names as the options, with +# dashes changed to underlines. +build=NONE +exec_prefix= +host=NONE +no_create= +nonopt=NONE +norecursion= +prefix= +program_prefix= +program_suffix= +program_transform_name= +silent= +srcdir= +target=NONE +verbose= +x_includes= +x_libraries= + +ac_prev= +for ac_option +do + + # If the previous option needs an argument, assign it. + if test -n "$ac_prev"; then + eval "$ac_prev=\$ac_option" + ac_prev= + continue + fi + + # Accept (but ignore some of) the important Cygnus configure + # options, so we can diagnose typos. + + case "$ac_option" in + -*=*) ac_optarg=`echo "$ac_option" | sed 's/[-_a-zA-Z0-9]*=//'` ;; + *) ac_optarg= ;; + esac + + case "$ac_option" in + + -build | --build | --buil | --bui | --bu | --b) + ac_prev=build ;; + -build=* | --build=* | --buil=* | --bui=* | --bu=* | --b=*) + build="$ac_optarg" ;; + + -disable-* | --disable-*) + ac_feature=`echo $ac_option|sed -e 's/-*disable-//'` + # Reject names that aren't valid shell variable names. + if test -n "`echo $ac_feature| sed 's/[-a-zA-Z0-9_]//g'`"; then + echo "configure: $ac_feature: invalid feature name" >&2; exit 1 + fi + ac_feature=`echo $ac_feature| sed 's/-/_/g'` + eval "enable_${ac_feature}=no" ;; + + -enable-* | --enable-*) + ac_feature=`echo $ac_option|sed -e 's/-*enable-//' -e 's/=.*//'` + # Reject names that aren't valid shell variable names. + if test -n "`echo $ac_feature| sed 's/[-_a-zA-Z0-9]//g'`"; then + echo "configure: $ac_feature: invalid feature name" >&2; exit 1 + fi + ac_feature=`echo $ac_feature| sed 's/-/_/g'` + case "$ac_option" in + *=*) ;; + *) ac_optarg=yes ;; + esac + eval "enable_${ac_feature}='$ac_optarg'" ;; + + # For backward compatibility, recognize -exec-prefix and --exec_prefix. + -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \ + | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \ + | --exec | --exe | --ex) + ac_prev=exec_prefix ;; + -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \ + | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \ + | --exec=* | --exe=* | --ex=*) + exec_prefix="$ac_optarg" ;; + + -gas | --gas | --ga | --g) + with_gas=yes ;; # Obsolete; use --with-gas. + + -help | --help | --hel | --he) + cat << EOF +$ac_usage +EOF + exit 0 ;; + + -host | --host | --hos | --ho) + ac_prev=host ;; + -host=* | --host=* | --hos=* | --ho=*) + host="$ac_optarg" ;; + + -nfp | --nfp | --nf) + with_fp=no ;; # Obsolete; use --without-fp. + + -no-create | --no-create | --no-creat | --no-crea | --no-cre \ + | --no-cr | --no-c) + no_create=yes ;; + + -norecursion | --norecursion | --norecursio | --norecursi \ + | --norecurs | --norecur | --norecu | --norec | --nore | --nor) + norecursion=yes ;; + + -prefix | --prefix | --prefi | --pref | --pre | --pr | --p) + ac_prev=prefix ;; + -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*) + prefix="$ac_optarg" ;; + + -program-prefix | --program-prefix | --program-prefi | --program-pref \ + | --program-pre | --program-pr | --program-p) + ac_prev=program_prefix ;; + -program-prefix=* | --program-prefix=* | --program-prefi=* \ + | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*) + program_prefix="$ac_optarg" ;; + + -program-suffix | --program-suffix | --program-suffi | --program-suff \ + | --program-suf | --program-su | --program-s) + ac_prev=program_suffix ;; + -program-suffix=* | --program-suffix=* | --program-suffi=* \ + | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*) + program_suffix="$ac_optarg" ;; + + -program-transform-name | --program-transform-name \ + | --program-transform-nam | --program-transform-na \ + | --program-transform-n | --program-transform- \ + | --program-transform | --program-transfor \ + | --program-transfo | --program-transf \ + | --program-trans | --program-tran \ + | --progr-tra | --program-tr | --program-t) + ac_prev=program_transform_name ;; + -program-transform-name=* | --program-transform-name=* \ + | --program-transform-nam=* | --program-transform-na=* \ + | --program-transform-n=* | --program-transform-=* \ + | --program-transform=* | --program-transfor=* \ + | --program-transfo=* | --program-transf=* \ + | --program-trans=* | --program-tran=* \ + | --progr-tra=* | --program-tr=* | --program-t=*) + program_transform_name="$ac_optarg" ;; + + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + silent=yes ;; + + -srcdir | --srcdir | --srcdi | --srcd | --src | --sr) + ac_prev=srcdir ;; + -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*) + srcdir="$ac_optarg" ;; + + -target | --target | --targe | --targ | --tar | --ta | --t) + ac_prev=target ;; + -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*) + target="$ac_optarg" ;; + + -v | -verbose | --verbose | --verbos | --verbo | --verb) + verbose=yes ;; + + -version | --version | --versio | --versi | --vers) + echo "configure generated by autoconf version 1.11" + exit 0 ;; + + -with-* | --with-*) + ac_package=`echo $ac_option|sed -e 's/-*with-//' -e 's/=.*//'` + # Reject names that aren't valid shell variable names. + if test -n "`echo $ac_package| sed 's/[-_a-zA-Z0-9]//g'`"; then + echo "configure: $ac_package: invalid package name" >&2; exit 1 + fi + ac_package=`echo $ac_package| sed 's/-/_/g'` + case "$ac_option" in + *=*) ;; + *) ac_optarg=yes ;; + esac + eval "with_${ac_package}='$ac_optarg'" ;; + + -without-* | --without-*) + ac_package=`echo $ac_option|sed -e 's/-*without-//'` + # Reject names that aren't valid shell variable names. + if test -n "`echo $ac_package| sed 's/[-a-zA-Z0-9_]//g'`"; then + echo "configure: $ac_package: invalid package name" >&2; exit 1 + fi + ac_package=`echo $ac_package| sed 's/-/_/g'` + eval "with_${ac_package}=no" ;; + + --x) with_x=yes ;; # Obsolete; use --with-x. + + -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \ + | --x-incl | --x-inc | --x-in | --x-i) + ac_prev=x_includes ;; + -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \ + | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*) + x_includes="$ac_optarg" ;; + + -x-libraries | --x-libraries | --x-librarie | --x-librari \ + | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l) + ac_prev=x_libraries ;; + -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \ + | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*) + x_libraries="$ac_optarg" ;; + + -*) echo "configure: $ac_option: invalid option; use --help to show usage" >&2; exit 1 + ;; + + *) + if test -n "`echo $ac_option| sed 's/[-a-z0-9.]//g'`"; then + echo "configure: warning: $ac_option: invalid host type" >&2 + fi + if test "x$nonopt" != xNONE; then + echo "configure: can only configure for one host and one target at a time" >&2; exit 1 + fi + nonopt="$ac_option" + ;; + + esac +done + +if test -n "$ac_prev"; then + echo "configure: missing argument to --`echo $ac_prev | sed 's/_/-/g'`" >&2; exit 1 +fi + +trap 'rm -fr conftest* confdefs* core $ac_clean_files; exit 1' 1 2 15 +trap 'rm -fr confdefs* $ac_clean_files' 0 + +# Save the original args if we used an alternate arg parser. +ac_configure_temp="${configure_args-$*}" +# Strip out --no-create and --norecursion so they don't pile up. +configure_args= +for ac_arg in $ac_configure_temp; do + case "$ac_arg" in + -no-create | --no-create | --no-creat | --no-crea | --no-cre \ + | --no-cr | --no-c) ;; + -norecursion | --norecursion | --norecursio | --norecursi \ + | --norecurs | --norecur | --norecu | --norec | --nore | --nor) ;; + *) configure_args="$configure_args $ac_arg" ;; + esac +done + +# NLS nuisances. +# These must not be set unconditionally because not all systems understand +# e.g. LANG=C (notably SCO). +if test "${LC_ALL+set}" = 'set'; then LC_ALL=C; export LC_ALL; fi +if test "${LANG+set}" = 'set'; then LANG=C; export LANG; fi + +# confdefs.h avoids OS command line length limits that DEFS can exceed. +rm -rf conftest* confdefs.h +# AIX cpp loses on an empty file, so make sure it contains at least a newline. +echo > confdefs.h + +# A filename unique to this package, relative to the directory that +# configure is in, which we can look for to find out if srcdir is correct. +ac_unique_file=readline.h + +# Find the source files, if location was not specified. +if test -z "$srcdir"; then + ac_srcdir_defaulted=yes + # Try the directory containing this script, then `..'. + ac_prog=$0 + ac_confdir=`echo $ac_prog|sed 's%/[^/][^/]*$%%'` + test "x$ac_confdir" = "x$ac_prog" && ac_confdir=. + srcdir=$ac_confdir + if test ! -r $srcdir/$ac_unique_file; then + srcdir=.. + fi +fi +if test ! -r $srcdir/$ac_unique_file; then + if test x$ac_srcdir_defaulted = xyes; then + echo "configure: can not find sources in ${ac_confdir} or .." >&2; exit 1 + else + echo "configure: can not find sources in ${srcdir}" >&2; exit 1 + fi +fi +ac_ext=c +# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options. +ac_cpp='${CPP}' +ac_compile='${CC-cc} $CFLAGS $LDFLAGS conftest.${ac_ext} -o conftest $LIBS >/dev/null 2>&1' + + + +#!/bin/sh +# From configure.in Configure for Readline 2.0 + + +# We want these before the checks, so the checks can modify their values. +test -z "$CFLAGS" && CFLAGS=-g auto_cflags=1 + +if test -z "$CC"; then + # Extract the first word of `gcc', so it can be a program name with args. + set ac_dummy gcc; ac_word=$2 + test -n "$silent" || echo "checking for $ac_word" + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/$ac_word; then + CC="gcc" + break + fi + done + IFS="$ac_save_ifs" +fi +test -z "$CC" && CC="cc" +test -n "$CC" && test -n "$verbose" && echo " setting CC to $CC" + +# Find out if we are using GNU C, under whatever name. +cat > conftest.c < conftest.out 2>&1 +if egrep yes conftest.out >/dev/null 2>&1; then + GCC=1 # For later tests. +fi +rm -f conftest* + + +# If we're using gcc and the user hasn't specified CFLAGS, add -O to CFLAGS. +test -n "$GCC" && test -n "$auto_cflags" && CFLAGS="$CFLAGS -O" + + +test -n "$silent" || echo "checking how to run the C preprocessor" +if test -z "$CPP"; then + # This must be in double quotes, not single quotes, because CPP may get + # substituted into the Makefile and ``${CC-cc}'' will simply confuse + # make. It must be expanded now. + CPP="${CC-cc} -E" + cat > conftest.${ac_ext} < +Syntax Error +EOF +# Some shells (Coherent) do redirections in the wrong order, so need +# the parens. +ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"` +if test -z "$ac_err"; then + : +else + rm -rf conftest* + CPP="${CC-cc} -E -traditional-cpp" + cat > conftest.${ac_ext} < +Syntax Error +EOF +# Some shells (Coherent) do redirections in the wrong order, so need +# the parens. +ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"` +if test -z "$ac_err"; then + : +else + rm -rf conftest* + CPP=/lib/cpp +fi +rm -f conftest* +fi +rm -f conftest* +fi +test -n "$verbose" && echo " setting CPP to $CPP" + +if test -n "$GCC"; then + test -n "$silent" || echo "checking whether -traditional is needed" + ac_pattern="Autoconf.*'x'" + ac_prog='#include +Autoconf TIOCGETP' + cat > conftest.${ac_ext} < conftest.out 2>&1" +if egrep "$ac_pattern" conftest.out >/dev/null 2>&1; then + rm -rf conftest* + ac_need_trad=1 + +fi +rm -f conftest* + + + if test -z "$ac_need_trad"; then + ac_prog='#include +Autoconf TCGETA' + cat > conftest.${ac_ext} < conftest.out 2>&1" +if egrep "$ac_pattern" conftest.out >/dev/null 2>&1; then + rm -rf conftest* + ac_need_trad=1 + +fi +rm -f conftest* + + fi + test -n "$ac_need_trad" && CC="$CC -traditional" +fi + +# Make sure to not get the incompatible SysV /etc/install and +# /usr/sbin/install, which might be in PATH before a BSD-like install, +# or the SunOS /usr/etc/install directory, or the AIX /bin/install, +# or the AFS install, which mishandles nonexistent args, or +# /usr/ucb/install on SVR4, which tries to use the nonexistent group +# `staff', or /sbin/install on IRIX which has incompatible command-line +# syntax. Sigh. +# +# On most BSDish systems install is in /usr/bin, not /usr/ucb +# anyway. +# This turns out not to be true, so the mere pathname isn't an indication +# of whether the program works. What we really need is a set of tests for +# the install program to see if it actually works in all the required ways. +# +# Avoid using ./install, which might have been erroneously created +# by make from ./install.sh. +if test -z "${INSTALL}"; then + test -n "$silent" || echo "checking for a BSD compatible install" + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + case "$ac_dir" in + ''|.|/etc|/sbin|/usr/sbin|/usr/etc|/usr/afsws/bin|/usr/ucb) ;; + *) + # OSF1 and SCO ODT 3.0 have their own names for install. + for ac_prog in installbsd scoinst install; do + if test -f $ac_dir/$ac_prog; then + if test $ac_prog = install && + grep dspmsg $ac_dir/$ac_prog >/dev/null 2>&1; then + # AIX install. It has an incompatible calling convention. + # OSF/1 installbsd also uses dspmsg, but is usable. + : + else + INSTALL="$ac_dir/$ac_prog -c" + break 2 + fi + fi + done + ;; + esac + done + IFS="$ac_save_ifs" +fi + +if test -z "$INSTALL"; then + # As a last resort, use the slow shell script. + for ac_dir in ${srcdir} ${srcdir}/.. ${srcdir}/../..; do + if test -f $ac_dir/install.sh; then + INSTALL="$ac_dir/install.sh -c"; break + fi + done +fi +if test -z "$INSTALL"; then + echo "configure: can not find install.sh in ${srcdir} or ${srcdir}/.. or ${srcdir}/../.." >&2; exit 1 +fi +test -n "$verbose" && echo " setting INSTALL to $INSTALL" + +# Use test -z because SunOS4 sh mishandles ${INSTALL_PROGRAM-'${INSTALL}'}. +# It thinks the first close brace ends the variable substitution. +test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}' +test -n "$verbose" && echo " setting INSTALL_PROGRAM to $INSTALL_PROGRAM" + +test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' +test -n "$verbose" && echo " setting INSTALL_DATA to $INSTALL_DATA" + +if test -z "$RANLIB"; then + # Extract the first word of `ranlib', so it can be a program name with args. + set ac_dummy ranlib; ac_word=$2 + test -n "$silent" || echo "checking for $ac_word" + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/$ac_word; then + RANLIB="ranlib" + break + fi + done + IFS="$ac_save_ifs" +fi +test -z "$RANLIB" && RANLIB=":" +test -n "$RANLIB" && test -n "$verbose" && echo " setting RANLIB to $RANLIB" + + +test -n "$silent" || echo "checking for BSD string and memory functions" +cat > conftest.${ac_ext} < +int main() { return 0; } +int t() { rindex(0, 0); bzero(0, 0);; return 0; } +EOF +if eval $ac_compile; then + : +else + rm -rf conftest* + +{ +test -n "$verbose" && \ +echo " defining USG" +echo "#define" USG "1" >> confdefs.h +DEFS="$DEFS -DUSG=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}USG\${ac_dB}USG\${ac_dC}1\${ac_dD} +\${ac_uA}USG\${ac_uB}USG\${ac_uC}1\${ac_uD} +\${ac_eA}USG\${ac_eB}USG\${ac_eC}1\${ac_eD} +" +} + +fi +rm -f conftest* + + +for ac_func in strcasecmp sighold +do +ac_tr_func=HAVE_`echo $ac_func | tr '[a-z]' '[A-Z]'` +test -n "$silent" || echo "checking for ${ac_func}" +cat > conftest.${ac_ext} < +int main() { return 0; } +int t() { +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_${ac_func}) || defined (__stub___${ac_func}) +choke me +#else +/* Override any gcc2 internal prototype to avoid an error. */ +extern char ${ac_func}(); ${ac_func}(); +#endif +; return 0; } +EOF +if eval $ac_compile; then + rm -rf conftest* + { +test -n "$verbose" && \ +echo " defining ${ac_tr_func}" +echo "#define" ${ac_tr_func} "1" >> confdefs.h +DEFS="$DEFS -D${ac_tr_func}=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}${ac_tr_func}\${ac_dB}${ac_tr_func}\${ac_dC}1\${ac_dD} +\${ac_uA}${ac_tr_func}\${ac_uB}${ac_tr_func}\${ac_uC}1\${ac_uD} +\${ac_eA}${ac_tr_func}\${ac_eB}${ac_tr_func}\${ac_eC}1\${ac_eD} +" +} + + +fi +rm -f conftest* +done + + +for ac_hdr in unistd.h stdlib.h varargs.h string.h alloca.h \ + dirent.h sys/ptem.h sys/pte.h sys/stream.h termcap.h \ + termio.h +do +ac_tr_hdr=HAVE_`echo $ac_hdr | tr '[a-z]./' '[A-Z]__'` +test -n "$silent" || echo "checking for ${ac_hdr}" +cat > conftest.${ac_ext} < +EOF +# Some shells (Coherent) do redirections in the wrong order, so need +# the parens. +ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"` +if test -z "$ac_err"; then + rm -rf conftest* + +{ +test -n "$verbose" && \ +echo " defining ${ac_tr_hdr}" +echo "#define" ${ac_tr_hdr} "1" >> confdefs.h +DEFS="$DEFS -D${ac_tr_hdr}=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}${ac_tr_hdr}\${ac_dB}${ac_tr_hdr}\${ac_dC}1\${ac_dD} +\${ac_uA}${ac_tr_hdr}\${ac_uB}${ac_tr_hdr}\${ac_uC}1\${ac_uD} +\${ac_eA}${ac_tr_hdr}\${ac_eB}${ac_tr_hdr}\${ac_eC}1\${ac_eD} +" +} + + +fi +rm -f conftest* +done + + +test -n "$silent" || echo "checking for sys/file.h" +cat > conftest.${ac_ext} < +EOF +# Some shells (Coherent) do redirections in the wrong order, so need +# the parens. +ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"` +if test -z "$ac_err"; then + : +else + rm -rf conftest* + +{ +test -n "$verbose" && \ +echo " defining NO_SYS_FILE" +echo "#define" NO_SYS_FILE "1" >> confdefs.h +DEFS="$DEFS -DNO_SYS_FILE=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}NO_SYS_FILE\${ac_dB}NO_SYS_FILE\${ac_dC}1\${ac_dD} +\${ac_uA}NO_SYS_FILE\${ac_uB}NO_SYS_FILE\${ac_uC}1\${ac_uD} +\${ac_eA}NO_SYS_FILE\${ac_eB}NO_SYS_FILE\${ac_eC}1\${ac_eD} +" +} + +fi +rm -f conftest* + + +if test -z "$have_tiocgwinsz"; then +test -n "$silent" || echo "checking for TIOCGWINSZ in sys/ioctl.h" +cat > conftest.${ac_ext} < +#include +int main() { return 0; } +int t() { int x = TIOCGWINSZ;; return 0; } +EOF +if eval $ac_compile; then + rm -rf conftest* + +{ +test -n "$verbose" && \ +echo " defining GWINSZ_IN_SYS_IOCTL" +echo "#define" GWINSZ_IN_SYS_IOCTL "1" >> confdefs.h +DEFS="$DEFS -DGWINSZ_IN_SYS_IOCTL=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}GWINSZ_IN_SYS_IOCTL\${ac_dB}GWINSZ_IN_SYS_IOCTL\${ac_dC}1\${ac_dD} +\${ac_uA}GWINSZ_IN_SYS_IOCTL\${ac_uB}GWINSZ_IN_SYS_IOCTL\${ac_uC}1\${ac_uD} +\${ac_eA}GWINSZ_IN_SYS_IOCTL\${ac_eB}GWINSZ_IN_SYS_IOCTL\${ac_eC}1\${ac_eD} +" +} + + +fi +rm -f conftest* + +fi + +test -n "$silent" || echo "checking for programs able to redeclare getpw functions" +cat > conftest.${ac_ext} < +#include +extern struct passwd *getpwuid(); +int main() { return 0; } +int t() { struct passwd *z; z = getpwuid(0);; return 0; } +EOF +if eval $ac_compile; then + : +else + rm -rf conftest* + +{ +test -n "$verbose" && \ +echo " defining HAVE_GETPW_DECLS" +echo "#define" HAVE_GETPW_DECLS "1" >> confdefs.h +DEFS="$DEFS -DHAVE_GETPW_DECLS=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}HAVE_GETPW_DECLS\${ac_dB}HAVE_GETPW_DECLS\${ac_dC}1\${ac_dD} +\${ac_uA}HAVE_GETPW_DECLS\${ac_uB}HAVE_GETPW_DECLS\${ac_uC}1\${ac_uD} +\${ac_eA}HAVE_GETPW_DECLS\${ac_eB}HAVE_GETPW_DECLS\${ac_eC}1\${ac_eD} +" +} + +fi +rm -f conftest* + + +# The Ultrix 4.2 mips builtin alloca declared by alloca.h only works +# for constant arguments. Useless! +test -n "$silent" || echo "checking for working alloca.h" +cat > conftest.${ac_ext} < +int main() { return 0; } +int t() { char *p = alloca(2 * sizeof(int));; return 0; } +EOF +if eval $ac_compile; then + rm -rf conftest* + +{ +test -n "$verbose" && \ +echo " defining HAVE_ALLOCA_H" +echo "#define" HAVE_ALLOCA_H "1" >> confdefs.h +DEFS="$DEFS -DHAVE_ALLOCA_H=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}HAVE_ALLOCA_H\${ac_dB}HAVE_ALLOCA_H\${ac_dC}1\${ac_dD} +\${ac_uA}HAVE_ALLOCA_H\${ac_uB}HAVE_ALLOCA_H\${ac_uC}1\${ac_uD} +\${ac_eA}HAVE_ALLOCA_H\${ac_eB}HAVE_ALLOCA_H\${ac_eC}1\${ac_eD} +" +} + + +fi +rm -f conftest* + +ac_decl="#ifdef __GNUC__ +#define alloca __builtin_alloca +#else +#if HAVE_ALLOCA_H +#include +#else +#ifdef _AIX + #pragma alloca +#else +char *alloca (); +#endif +#endif +#endif +" +test -n "$silent" || echo "checking for alloca" +cat > conftest.${ac_ext} <> confdefs.h +DEFS="$DEFS -DHAVE_ALLOCA=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}HAVE_ALLOCA\${ac_dB}HAVE_ALLOCA\${ac_dC}1\${ac_dD} +\${ac_uA}HAVE_ALLOCA\${ac_uB}HAVE_ALLOCA\${ac_uC}1\${ac_uD} +\${ac_eA}HAVE_ALLOCA\${ac_eB}HAVE_ALLOCA\${ac_eC}1\${ac_eD} +" +} + + +else + rm -rf conftest* + ac_alloca_missing=1 +cat > conftest.${ac_ext} < conftest.out 2>&1" +if egrep "winnitude" conftest.out >/dev/null 2>&1; then + rm -rf conftest* + test -n "$silent" || echo "checking for _getb67" +cat > conftest.${ac_ext} < +int main() { return 0; } +int t() { +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub__getb67) || defined (__stub____getb67) +choke me +#else +/* Override any gcc2 internal prototype to avoid an error. */ +extern char _getb67(); _getb67(); +#endif +; return 0; } +EOF +if eval $ac_compile; then + rm -rf conftest* + { +test -n "$verbose" && \ +echo " defining" CRAY_STACKSEG_END to be "_getb67" +echo "#define" CRAY_STACKSEG_END "_getb67" >> confdefs.h +DEFS="$DEFS -DCRAY_STACKSEG_END=_getb67" +ac_sed_defs="${ac_sed_defs}\${ac_dA}CRAY_STACKSEG_END\${ac_dB}CRAY_STACKSEG_END\${ac_dC}_getb67\${ac_dD} +\${ac_uA}CRAY_STACKSEG_END\${ac_uB}CRAY_STACKSEG_END\${ac_uC}_getb67\${ac_uD} +\${ac_eA}CRAY_STACKSEG_END\${ac_eB}CRAY_STACKSEG_END\${ac_eC}_getb67\${ac_eD} +" +} + + +else + rm -rf conftest* + test -n "$silent" || echo "checking for GETB67" +cat > conftest.${ac_ext} < +int main() { return 0; } +int t() { +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_GETB67) || defined (__stub___GETB67) +choke me +#else +/* Override any gcc2 internal prototype to avoid an error. */ +extern char GETB67(); GETB67(); +#endif +; return 0; } +EOF +if eval $ac_compile; then + rm -rf conftest* + { +test -n "$verbose" && \ +echo " defining" CRAY_STACKSEG_END to be "GETB67" +echo "#define" CRAY_STACKSEG_END "GETB67" >> confdefs.h +DEFS="$DEFS -DCRAY_STACKSEG_END=GETB67" +ac_sed_defs="${ac_sed_defs}\${ac_dA}CRAY_STACKSEG_END\${ac_dB}CRAY_STACKSEG_END\${ac_dC}GETB67\${ac_dD} +\${ac_uA}CRAY_STACKSEG_END\${ac_uB}CRAY_STACKSEG_END\${ac_uC}GETB67\${ac_uD} +\${ac_eA}CRAY_STACKSEG_END\${ac_eB}CRAY_STACKSEG_END\${ac_eC}GETB67\${ac_eD} +" +} + + +else + rm -rf conftest* + test -n "$silent" || echo "checking for getb67" +cat > conftest.${ac_ext} < +int main() { return 0; } +int t() { +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_getb67) || defined (__stub___getb67) +choke me +#else +/* Override any gcc2 internal prototype to avoid an error. */ +extern char getb67(); getb67(); +#endif +; return 0; } +EOF +if eval $ac_compile; then + rm -rf conftest* + { +test -n "$verbose" && \ +echo " defining" CRAY_STACKSEG_END to be "getb67" +echo "#define" CRAY_STACKSEG_END "getb67" >> confdefs.h +DEFS="$DEFS -DCRAY_STACKSEG_END=getb67" +ac_sed_defs="${ac_sed_defs}\${ac_dA}CRAY_STACKSEG_END\${ac_dB}CRAY_STACKSEG_END\${ac_dC}getb67\${ac_dD} +\${ac_uA}CRAY_STACKSEG_END\${ac_uB}CRAY_STACKSEG_END\${ac_uC}getb67\${ac_uD} +\${ac_eA}CRAY_STACKSEG_END\${ac_eB}CRAY_STACKSEG_END\${ac_eC}getb67\${ac_eD} +" +} + + +fi +rm -f conftest* + +fi +rm -f conftest* + +fi +rm -f conftest* + + +fi +rm -f conftest* + + +fi +rm -f conftest* + +if test -n "$ac_alloca_missing"; then + # The SVR3 libPW and SVR4 libucb both contain incompatible functions + # that cause trouble. Some versions do not even contain alloca or + # contain a buggy version. If you still want to use their alloca, + # use ar to extract alloca.o from them instead of compiling alloca.c. + ALLOCA=alloca.o + +{ +test -n "$verbose" && \ +echo " defining C_ALLOCA" +echo "#define" C_ALLOCA "1" >> confdefs.h +DEFS="$DEFS -DC_ALLOCA=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}C_ALLOCA\${ac_dB}C_ALLOCA\${ac_dC}1\${ac_dD} +\${ac_uA}C_ALLOCA\${ac_uB}C_ALLOCA\${ac_uC}1\${ac_uD} +\${ac_eA}C_ALLOCA\${ac_eB}C_ALLOCA\${ac_eC}1\${ac_eD} +" +} + + + test -n "$silent" || echo "checking stack direction for C alloca" + test -n "$silent" || echo "checking whether cross-compiling" +# If we cannot run a trivial program, we must be cross compiling. +cat > conftest.${ac_ext} </dev/null; then + : +else + cross_compiling=1 +fi +rm -fr conftest* + +if test -n "$cross_compiling" +then + +{ +test -n "$verbose" && \ +echo " defining" STACK_DIRECTION to be "0" +echo "#define" STACK_DIRECTION "0" >> confdefs.h +DEFS="$DEFS -DSTACK_DIRECTION=0" +ac_sed_defs="${ac_sed_defs}\${ac_dA}STACK_DIRECTION\${ac_dB}STACK_DIRECTION\${ac_dC}0\${ac_dD} +\${ac_uA}STACK_DIRECTION\${ac_uB}STACK_DIRECTION\${ac_uC}0\${ac_uD} +\${ac_eA}STACK_DIRECTION\${ac_eB}STACK_DIRECTION\${ac_eC}0\${ac_eD} +" +} + +else +cat > conftest.${ac_ext} < addr) ? 1 : -1; +} +main () +{ + exit (find_stack_direction() < 0); +} +EOF +eval $ac_compile +if test -s conftest && (./conftest; exit) 2>/dev/null; then + +{ +test -n "$verbose" && \ +echo " defining" STACK_DIRECTION to be "1" +echo "#define" STACK_DIRECTION "1" >> confdefs.h +DEFS="$DEFS -DSTACK_DIRECTION=1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}STACK_DIRECTION\${ac_dB}STACK_DIRECTION\${ac_dC}1\${ac_dD} +\${ac_uA}STACK_DIRECTION\${ac_uB}STACK_DIRECTION\${ac_uC}1\${ac_uD} +\${ac_eA}STACK_DIRECTION\${ac_eB}STACK_DIRECTION\${ac_eC}1\${ac_eD} +" +} + + +else + +{ +test -n "$verbose" && \ +echo " defining" STACK_DIRECTION to be "-1" +echo "#define" STACK_DIRECTION "-1" >> confdefs.h +DEFS="$DEFS -DSTACK_DIRECTION=-1" +ac_sed_defs="${ac_sed_defs}\${ac_dA}STACK_DIRECTION\${ac_dB}STACK_DIRECTION\${ac_dC}-1\${ac_dD} +\${ac_uA}STACK_DIRECTION\${ac_uB}STACK_DIRECTION\${ac_uC}-1\${ac_uD} +\${ac_eA}STACK_DIRECTION\${ac_eB}STACK_DIRECTION\${ac_eC}-1\${ac_eD} +" +} + +fi +fi +rm -fr conftest* +fi + + + +# The preferred way to propogate these variables is regular @ substitutions. +if test -n "$prefix"; then + ac_prsub="s%^prefix\\([ ]*\\)=\\([ ]*\\).*$%prefix\\1=\\2$prefix%" +else + prefix=/usr/local +fi +if test -n "$exec_prefix"; then + ac_prsub="$ac_prsub +s%^exec_prefix\\([ ]*\\)=\\([ ]*\\).*$%exec_prefix\\1=\\2$exec_prefix%" +else + exec_prefix='${prefix}' # Let make expand it. +fi + +# Any assignment to VPATH causes Sun make to only execute +# the first set of double-colon rules, so remove it if not needed. +# If there is a colon in the path, we need to keep it. +if test "x$srcdir" = x.; then + ac_vpsub='/^[ ]*VPATH[ ]*=[^:]*$/d' +fi + +# Quote sed substitution magic chars in DEFS. +cat >conftest.def < config.status </dev/null | sed 1q`: +# +# $0 $configure_args + +ac_cs_usage="Usage: config.status [--recheck] [--version] [--help]" +for ac_option +do + case "\$ac_option" in + -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) + echo running \${CONFIG_SHELL-/bin/sh} $0 $configure_args --no-create + exec \${CONFIG_SHELL-/bin/sh} $0 $configure_args --no-create ;; + -version | --version | --versio | --versi | --vers | --ver | --ve | --v) + echo "config.status generated by autoconf version 1.11" + exit 0 ;; + -help | --help | --hel | --he | --h) + echo "\$ac_cs_usage"; exit 0 ;; + *) echo "\$ac_cs_usage"; exit 1 ;; + esac +done + +trap 'rm -fr Makefile config.h conftest*; exit 1' 1 2 15 +CC='$CC' +CFLAGS='$CFLAGS' +LDFLAGS='$LDFLAGS' +CPP='$CPP' +INSTALL='$INSTALL' +INSTALL_PROGRAM='$INSTALL_PROGRAM' +INSTALL_DATA='$INSTALL_DATA' +RANLIB='$RANLIB' +ALLOCA='$ALLOCA' +LIBS='$LIBS' +srcdir='$srcdir' +top_srcdir='$top_srcdir' +prefix='$prefix' +exec_prefix='$exec_prefix' +ac_prsub='$ac_prsub' +ac_vpsub='$ac_vpsub' +extrasub='$extrasub' +EOF +cat >> config.status <<\EOF + +ac_given_srcdir=$srcdir + +CONFIG_FILES=${CONFIG_FILES-"Makefile"} +for ac_file in .. ${CONFIG_FILES}; do if test "x$ac_file" != x..; then + # Remove last slash and all that follows it. Not all systems have dirname. + ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'` + if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then + # The file is in a subdirectory. + test ! -d "$ac_dir" && mkdir "$ac_dir" + ac_dir_suffix="/$ac_dir" + else + ac_dir_suffix= + fi + + # A "../" for each directory in $ac_dir_suffix. + ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'` + case "$ac_given_srcdir" in + .) srcdir=. + if test -z "$ac_dir_suffix"; then top_srcdir=. + else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;; + /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;; + *) # Relative path. + srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix" + top_srcdir="$ac_dots$ac_given_srcdir" ;; + esac + + echo creating "$ac_file" + rm -f "$ac_file" + comment_str="Generated automatically from `echo $ac_file|sed 's|.*/||'`.in by configure." + case "$ac_file" in + *.c | *.h | *.C | *.cc | *.m ) echo "/* $comment_str */" > "$ac_file" ;; + * ) echo "# $comment_str" > "$ac_file" ;; + esac + sed -e " +$ac_prsub +$ac_vpsub +$extrasub +s%@CC@%$CC%g +s%@CFLAGS@%$CFLAGS%g +s%@LDFLAGS@%$LDFLAGS%g +s%@CPP@%$CPP%g +s%@INSTALL@%$INSTALL%g +s%@INSTALL_PROGRAM@%$INSTALL_PROGRAM%g +s%@INSTALL_DATA@%$INSTALL_DATA%g +s%@RANLIB@%$RANLIB%g +s%@ALLOCA@%$ALLOCA%g +s%@LIBS@%$LIBS%g +s%@srcdir@%$srcdir%g +s%@top_srcdir@%$top_srcdir%g +s%@prefix@%$prefix%g +s%@exec_prefix@%$exec_prefix%g +s%@DEFS@%-DHAVE_CONFIG_H%" $ac_given_srcdir/${ac_file}.in >> $ac_file +fi; done + +# These sed commands are put into ac_sed_defs when defining a macro. +# They are broken into pieces to make the sed script easier to manage. +# They are passed to sed as "A NAME B NAME C VALUE D", where NAME +# is the cpp macro being defined and VALUE is the value it is being given. +# Each defining turns into a single global substitution command. +# Hopefully no one uses "!" as a variable value. +# Other candidates for the sed separators, like , and @, do get used. +# +# ac_d sets the value in "#define NAME VALUE" lines. +ac_dA='s!^\([ ]*\)#\([ ]*define[ ][ ]*\)' +ac_dB='\([ ][ ]*\)[^ ]*!\1#\2' +ac_dC='\3' +ac_dD='!g' +# ac_u turns "#undef NAME" with trailing blanks into "#define NAME VALUE". +ac_uA='s!^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' +ac_uB='\([ ]\)!\1#\2define\3' +ac_uC=' ' +ac_uD='\4!g' +# ac_e turns "#undef NAME" without trailing blanks into "#define NAME VALUE". +ac_eA='s!^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' +ac_eB='$!\1#\2define\3' +ac_eC=' ' +ac_eD='!g' +rm -f conftest.sed +EOF +# Turn off quoting long enough to insert the sed commands. +rm -f conftest.sh +cat > conftest.sh < conftest.s1 # Like head -9. + sed 1,${ac_max_sh_lines}d conftest.sh > conftest.s2 # Like tail +10. + # Write a limited-size here document to append to conftest.sed. + echo 'cat >> conftest.sed <> config.status + cat conftest.s1 >> config.status + echo 'CONFEOF' >> config.status + rm -f conftest.s1 conftest.sh + mv conftest.s2 conftest.sh +done +rm -f conftest.sh + +# Now back to your regularly scheduled config.status. +cat >> config.status <<\EOF +# This sed command replaces #undef's with comments. This is necessary, for +# example, in the case of _POSIX_SOURCE, which is predefined and required +# on some systems where configure will not decide to define it in +# config.h. +cat >> conftest.sed <<\CONFEOF +s,^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */, +CONFEOF +rm -f conftest.h +# Break up the sed commands because old seds have small limits. +ac_max_sed_lines=20 + +CONFIG_HEADERS=${CONFIG_HEADERS-"config.h"} +for ac_file in .. ${CONFIG_HEADERS}; do if test "x$ac_file" != x..; then + echo creating $ac_file + + cp $ac_given_srcdir/$ac_file.in conftest.h1 + cp conftest.sed conftest.stm + while : + do + ac_lines=`grep -c . conftest.stm` + if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi + rm -f conftest.s1 conftest.s2 conftest.h2 + sed ${ac_max_sed_lines}q conftest.stm > conftest.s1 # Like head -20. + sed 1,${ac_max_sed_lines}d conftest.stm > conftest.s2 # Like tail +21. + sed -f conftest.s1 < conftest.h1 > conftest.h2 + rm -f conftest.s1 conftest.h1 conftest.stm + mv conftest.h2 conftest.h1 + mv conftest.s2 conftest.stm + done + rm -f conftest.stm conftest.h + echo "/* $ac_file. Generated automatically by configure. */" > conftest.h + cat conftest.h1 >> conftest.h + rm -f conftest.h1 + if cmp -s $ac_file conftest.h 2>/dev/null; then + # The file exists and we would not be changing it. + echo "$ac_file is unchanged" + rm -f conftest.h + else + rm -f $ac_file + mv conftest.h $ac_file + fi +fi; done +rm -f conftest.sed + + + +# Makefile uses this timestamp file to record whether config.h is up to date. +touch stamp-config +exit 0 +EOF +chmod +x config.status +# Some shells look in PATH for config.status without the "./". +test -n "$no_create" || ${CONFIG_SHELL-/bin/sh} ./config.status + diff --git a/configure.in b/configure.in new file mode 100644 index 0000000..febcbab --- /dev/null +++ b/configure.in @@ -0,0 +1,48 @@ +dnl Process this file with autoconf to produce a configure script. +AC_INIT(readline.h) +AC_CONFIG_HEADER(config.h) +AC_REVISION(Configure for Readline 2.0) + +# We want these before the checks, so the checks can modify their values. +test -z "$CFLAGS" && CFLAGS=-g auto_cflags=1 + +AC_PROG_CC + +# If we're using gcc and the user hasn't specified CFLAGS, add -O to CFLAGS. +test -n "$GCC" && test -n "$auto_cflags" && CFLAGS="$CFLAGS -O" + +AC_SUBST(CFLAGS)dnl +AC_SUBST(LDFLAGS)dnl + +AC_GCC_TRADITIONAL +AC_PROG_INSTALL +AC_PROG_RANLIB + +AC_USG + +AC_HAVE_FUNCS(strcasecmp sighold) + +AC_HAVE_HEADERS(unistd.h stdlib.h varargs.h string.h alloca.h \ + dirent.h sys/ptem.h sys/pte.h sys/stream.h termcap.h \ + termio.h) + +AC_HEADER_CHECK(sys/file.h, ,AC_DEFINE(NO_SYS_FILE)) + +if test -z "$have_tiocgwinsz"; then +AC_COMPILE_CHECK(TIOCGWINSZ in sys/ioctl.h, +[#include +#include ], [int x = TIOCGWINSZ;], +AC_DEFINE(GWINSZ_IN_SYS_IOCTL)) +fi + +AC_COMPILE_CHECK(programs able to redeclare getpw functions, +[#include +#include +extern struct passwd *getpwuid();], [struct passwd *z; z = getpwuid(0);], , +AC_DEFINE(HAVE_GETPW_DECLS)) + +AC_ALLOCA + +AC_OUTPUT(Makefile, [ +# Makefile uses this timestamp file to record whether config.h is up to date. +touch stamp-config]) diff --git a/display.c b/display.c new file mode 100644 index 0000000..8204570 --- /dev/null +++ b/display.c @@ -0,0 +1,1219 @@ +/* display.c -- readline redisplay facility. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif /* HAVE_UNISTD_H */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include "posixstat.h" + +/* System-specific feature definitions and include files. */ +#include "rldefs.h" + +/* Some standard library routines. */ +#include "readline.h" +#include "history.h" + +#if !defined (strchr) && !defined (__STDC__) +extern char *strchr (), *strrchr (); +#endif /* !strchr && !__STDC__ */ + +/* Global and pseudo-global variables and functions + imported from readline.c. */ +extern char *rl_prompt; +extern int readline_echoing_p; +extern char *term_clreol, *term_im, *term_ic, *term_ei, *term_DC; +/* Termcap variables. */ +extern char *term_up, *term_dc, *term_cr, *term_IC; +extern int screenheight, screenwidth, screenchars; +extern int terminal_can_insert, term_xn; + +extern void _rl_output_some_chars (); +extern int _rl_output_character_function (); + +extern int _rl_output_meta_chars; +extern int _rl_horizontal_scroll_mode; +extern int _rl_mark_modified_lines; +extern int _rl_prefer_visible_bell; + +/* Pseudo-global functions (local to the readline library) exported + by this file. */ +void _rl_move_cursor_relative (), _rl_output_some_chars (); +void _rl_move_vert (); + +static void update_line (), clear_to_eol (), space_to_eol (); +static void delete_chars (), insert_some_chars (); + +extern char *xmalloc (), *xrealloc (); + +/* Heuristic used to decide whether it is faster to move from CUR to NEW + by backing up or outputting a carriage return and moving forward. */ +#define CR_FASTER(new, cur) (((new) + 1) < ((cur) - (new))) + +/* **************************************************************** */ +/* */ +/* Display stuff */ +/* */ +/* **************************************************************** */ + +/* This is the stuff that is hard for me. I never seem to write good + display routines in C. Let's see how I do this time. */ + +/* (PWP) Well... Good for a simple line updater, but totally ignores + the problems of input lines longer than the screen width. + + update_line and the code that calls it makes a multiple line, + automatically wrapping line update. Careful attention needs + to be paid to the vertical position variables. */ + +/* Keep two buffers; one which reflects the current contents of the + screen, and the other to draw what we think the new contents should + be. Then compare the buffers, and make whatever changes to the + screen itself that we should. Finally, make the buffer that we + just drew into be the one which reflects the current contents of the + screen, and place the cursor where it belongs. + + Commands that want to can fix the display themselves, and then let + this function know that the display has been fixed by setting the + RL_DISPLAY_FIXED variable. This is good for efficiency. */ + +/* Global variables declared here. */ +/* What YOU turn on when you have handled all redisplay yourself. */ +int rl_display_fixed = 0; + +/* The stuff that gets printed out before the actual text of the line. + This is usually pointing to rl_prompt. */ +char *rl_display_prompt = (char *)NULL; + +/* Pseudo-global variables declared here. */ +/* The visible cursor position. If you print some text, adjust this. */ +int _rl_last_c_pos = 0; +int _rl_last_v_pos = 0; + +/* Number of lines currently on screen minus 1. */ +int _rl_vis_botlin = 0; + +/* Variables used only in this file. */ +/* The last left edge of text that was displayed. This is used when + doing horizontal scrolling. It shifts in thirds of a screenwidth. */ +static int last_lmargin = 0; + +/* The line display buffers. One is the line currently displayed on + the screen. The other is the line about to be displayed. */ +static char *visible_line = (char *)NULL; +static char *invisible_line = (char *)NULL; + +/* A buffer for `modeline' messages. */ +static char msg_buf[128]; + +/* Non-zero forces the redisplay even if we thought it was unnecessary. */ +static int forced_display = 0; + +/* Default and initial buffer size. Can grow. */ +static int line_size = 1024; + +static char *last_prompt_string = (char *)NULL; +static char *local_prompt, *local_prompt_prefix; +static int visible_length, prefix_length; + +/* The number of invisible characters in the line currently being + displayed on the screen. */ +static int visible_wrap_offset = 0; + +/* The length (buffer offset) of the first line of the last (possibly + multi-line) buffer displayed on the screen. */ +static int visible_first_line_len = 0; + +/* Expand the prompt string S and return the number of visible + characters in *LP, if LP is not null. This is currently more-or-less + a placeholder for expansion. */ + +/* Current implementation: + \001 (^A) start non-visible characters + \002 (^B) end non-visible characters + all characters except \001 and \002 (following a \001) are copied to + the returned string; all characters except those between \001 and + \002 are assumed to be `visible'. */ + +static char * +expand_prompt (pmt, lp) + char *pmt; + int *lp; +{ + char *r, *ret, *p; + int l, rl, ignoring; + + /* Short-circuit if we can. */ + if (strchr (pmt, RL_PROMPT_START_IGNORE) == 0) + { + r = savestring (pmt); + if (lp) + *lp = strlen (r); + return r; + } + + l = strlen (pmt); + r = ret = xmalloc (l + 1); + + for (rl = ignoring = 0, p = pmt; p && *p; p++) + { + /* This code strips the invisible character string markers + RL_PROMPT_START_IGNORE and RL_PROMPT_END_IGNORE */ + if (*p == RL_PROMPT_START_IGNORE) + { + ignoring++; + continue; + } + else if (ignoring && *p == RL_PROMPT_END_IGNORE) + { + ignoring = 0; + continue; + } + else + { + *r++ = *p; + if (!ignoring) + rl++; + } + } + + *r = '\0'; + if (lp) + *lp = rl; + return ret; +} + +/* + * Expand the prompt string into the various display components, if + * necessary. + * + * local_prompt = expanded last line of string in rl_display_prompt + * (portion after the final newline) + * local_prompt_prefix = portion before last newline of rl_display_prompt, + * expanded via expand_prompt + * visible_length = number of visible characters in local_prompt + * prefix_length = number of visible characters in local_prompt_prefix + * + * This function is called once per call to readline(). It may also be + * called arbitrarily to expand the primary prompt. + * + * The return value is the number of visible characters on the last line + * of the (possibly multi-line) prompt. + */ +int +rl_expand_prompt (prompt) + char *prompt; +{ + char *p, *t; + int c; + + /* Clear out any saved values. */ + if (local_prompt) + free (local_prompt); + if (local_prompt_prefix) + free (local_prompt_prefix); + local_prompt = local_prompt_prefix = (char *)0; + + p = strrchr (prompt, '\n'); + if (!p) + { + /* The prompt is only one line. */ + local_prompt = expand_prompt (prompt, &visible_length); + local_prompt_prefix = (char *)0; + return (visible_length); + } + else + { + /* The prompt spans multiple lines. */ + t = ++p; + local_prompt = expand_prompt (p, &visible_length); + c = *t; *t = '\0'; + /* The portion of the prompt string up to and including the + final newline is now null-terminated. */ + local_prompt_prefix = expand_prompt (prompt, &prefix_length); + *t = c; + return (prefix_length); + } +} + +/* Basic redisplay algorithm. */ +void +rl_redisplay () +{ + register int in, out, c, linenum; + register char *line = invisible_line; + int c_pos = 0, inv_botlin = 0, wrap_offset, wrap_column; + char *prompt_this_line; + + if (!readline_echoing_p) + return; + + if (!rl_display_prompt) + rl_display_prompt = ""; + + if (!invisible_line) + { + visible_line = xmalloc (line_size); + invisible_line = xmalloc (line_size); + line = invisible_line; + for (in = 0; in < line_size; in++) + { + visible_line[in] = 0; + invisible_line[in] = 1; + } + rl_on_new_line (); + } + + /* Draw the line into the buffer. */ + c_pos = -1; + + /* Mark the line as modified or not. We only do this for history + lines. */ + out = 0; + if (_rl_mark_modified_lines && current_history () && rl_undo_list) + { + line[out++] = '*'; + line[out] = '\0'; + } + + /* If someone thought that the redisplay was handled, but the currently + visible line has a different modification state than the one about + to become visible, then correct the caller's misconception. */ + if (visible_line[0] != invisible_line[0]) + rl_display_fixed = 0; + + /* If the prompt to be displayed is the `primary' readline prompt (the + one passed to readline()), use the values we have already expanded. + If not, use what's already in rl_display_prompt. WRAP_OFFSET is the + number of non-visible characters in the prompt string. */ + if (rl_display_prompt == rl_prompt) + { + int local_len = local_prompt ? strlen (local_prompt) : 0; + if (local_prompt_prefix && forced_display) + _rl_output_some_chars (local_prompt_prefix, strlen (local_prompt_prefix)); + + if (local_len > 0) + strncpy (line + out, local_prompt, local_len); + out += local_len; + line[out] = '\0'; + wrap_offset = local_len - visible_length; + } + else + { + int pmtlen; + prompt_this_line = strrchr (rl_display_prompt, '\n'); + if (!prompt_this_line) + prompt_this_line = rl_display_prompt; + else + { + prompt_this_line++; + if (forced_display) + _rl_output_some_chars (rl_display_prompt, prompt_this_line - rl_display_prompt); + } + + pmtlen = strlen (prompt_this_line); + strncpy (line + out, prompt_this_line, pmtlen); + out += pmtlen; + line[out] = '\0'; + wrap_offset = 0; + } + + for (in = 0; in < rl_end; in++) + { + c = (unsigned char)rl_line_buffer[in]; + + if (out + 8 >= line_size) /* XXX - 8 for \t */ + { + line_size *= 2; + visible_line = xrealloc (visible_line, line_size); + invisible_line = xrealloc (invisible_line, line_size); + line = invisible_line; + } + + if (in == rl_point) + c_pos = out; + + if (META_CHAR (c)) + { + if (_rl_output_meta_chars == 0) + { + sprintf (line + out, "\\%o", c); + out += 4; + } + else + line[out++] = c; + } +#if defined (DISPLAY_TABS) + else if (c == '\t') + { + register int newout = (out | (int)7) + 1; + while (out < newout) + line[out++] = ' '; + } +#endif + else if (c < ' ') + { + line[out++] = '^'; + line[out++] = UNCTRL (c); /* XXX was c ^ 0x40 */ + } + else if (c == 127) + { + line[out++] = '^'; + line[out++] = '?'; + } + else + line[out++] = c; + } + line[out] = '\0'; + if (c_pos < 0) + c_pos = out; + + /* C_POS == position in buffer where cursor should be placed. */ + + /* PWP: now is when things get a bit hairy. The visible and invisible + line buffers are really multiple lines, which would wrap every + (screenwidth - 1) characters. Go through each in turn, finding + the changed region and updating it. The line order is top to bottom. */ + + /* If we can move the cursor up and down, then use multiple lines, + otherwise, let long lines display in a single terminal line, and + horizontally scroll it. */ + + if (!_rl_horizontal_scroll_mode && term_up && *term_up) + { + int total_screen_chars = screenchars; + int nleft, cursor_linenum, pos, changed_screen_line; + + if (!rl_display_fixed || forced_display) + { + forced_display = 0; + + /* If we have more than a screenful of material to display, then + only display a screenful. We should display the last screen, + not the first. I'll fix this in a minute. */ + if (out >= total_screen_chars) + out = total_screen_chars - 1; + + /* Number of screen lines to display. The first line wraps at + (screenwidth + wrap_offset) chars, the rest of the lines have + screenwidth chars. */ + nleft = out - wrap_offset + term_xn - 1; + inv_botlin = (nleft > 0) ? nleft / screenwidth : 0; + + /* The first line is at character position 0 in the buffer. The + second and subsequent lines start at N * screenwidth, offset by + OFFSET. OFFSET is wrap_offset for the invisible line and + visible_wrap_offset for the line currently displayed. */ + +#define W_OFFSET(line, offset) ((line) == 0 ? offset : 0) +#define L_OFFSET(n, offset) ((n) > 0 ? ((n) * screenwidth) + (offset) : 0) +#define VIS_CHARS(line) &visible_line[L_OFFSET((line), visible_wrap_offset)] +#define VIS_LINE(line) ((line) > _rl_vis_botlin) ? "" : VIS_CHARS(line) +#define INV_LINE(line) &invisible_line[L_OFFSET((line), wrap_offset)] + + /* For each line in the buffer, do the updating display. */ + for (linenum = 0; linenum <= inv_botlin; linenum++) + { + update_line (VIS_LINE(linenum), INV_LINE(linenum), linenum, + screenwidth + W_OFFSET(linenum, visible_wrap_offset), + screenwidth + W_OFFSET(linenum, wrap_offset), + inv_botlin); + + /* If this is the line with the prompt, we might need to + compensate for invisible characters in the new line. Do + this only if there is not more than one new line (which + implies that we completely overwrite the old visible line) + and the new line is shorter than the old. */ + if (linenum == 0 && + inv_botlin == 0 && + (wrap_offset > visible_wrap_offset) && + (_rl_last_c_pos < visible_first_line_len)) + { + nleft = screenwidth + wrap_offset - _rl_last_c_pos; + clear_to_eol (nleft); + } + + /* Since the new first line is now visible, save its length. */ + if (linenum == 0) + visible_first_line_len = (inv_botlin > 0) ? screenwidth : out - wrap_offset; + } + + /* We may have deleted some lines. If so, clear the left over + blank ones at the bottom out. */ + if (_rl_vis_botlin > inv_botlin) + { + char *tt; + for (; linenum <= _rl_vis_botlin; linenum++) + { + tt = VIS_CHARS (linenum); + _rl_move_vert (linenum); + _rl_move_cursor_relative (0, tt); + clear_to_eol + ((linenum == _rl_vis_botlin) ? strlen (tt) : screenwidth); + } + } + _rl_vis_botlin = inv_botlin; + + /* Move the cursor where it should be. */ + /* Which line? */ + nleft = c_pos - wrap_offset - term_xn + 1; + cursor_linenum = (nleft > 0) ? nleft / screenwidth : 0; + + /* CHANGED_SCREEN_LINE is set to 1 if we have moved to a + different screen line during this redisplay. */ + changed_screen_line = _rl_last_v_pos != cursor_linenum; + if (changed_screen_line) + { + _rl_move_vert (cursor_linenum); + /* If we moved up to the line with the prompt using term_up, + the physical cursor position on the screen stays the same, + but the buffer position needs to be adjusted to account + for invisible characters. */ + if (cursor_linenum == 0 && wrap_offset) + _rl_last_c_pos += wrap_offset; + } + + /* We have to reprint the prompt if it contains invisible + characters, since it's not generally OK to just reprint + the characters from the current cursor position. */ + nleft = visible_length + wrap_offset; + if (cursor_linenum == 0 && wrap_offset > 0 && _rl_last_c_pos > 0 && + _rl_last_c_pos <= nleft && local_prompt) + { + if (term_cr) + tputs (term_cr, 1, _rl_output_character_function); + _rl_output_some_chars (local_prompt, nleft); + _rl_last_c_pos = nleft; + } + + /* Where on that line? And where does that line start + in the buffer? */ + pos = L_OFFSET(cursor_linenum, wrap_offset); + /* nleft == number of characters in the line buffer between the + start of the line and the cursor position. */ + nleft = c_pos - pos; + + /* Since backspace() doesn't know about invisible characters in the + prompt, and there's no good way to tell it, we compensate for + those characters here and call backspace() directly. */ + if (wrap_offset && cursor_linenum == 0 && nleft < _rl_last_c_pos) + { + backspace (_rl_last_c_pos - nleft); + _rl_last_c_pos = nleft; + } + + if (nleft != _rl_last_c_pos) + _rl_move_cursor_relative (nleft, &invisible_line[pos]); + } + } + else /* Do horizontal scrolling. */ + { +#define M_OFFSET(margin, offset) ((margin) == 0 ? offset : 0) + int lmargin, ndisp, nleft, phys_c_pos, t; + + /* Always at top line. */ + _rl_last_v_pos = 0; + + /* Compute where in the buffer the displayed line should start. This + will be LMARGIN. */ + + /* The number of characters that will be displayed before the cursor. */ + ndisp = c_pos - wrap_offset; + nleft = visible_length + wrap_offset; + /* Where the new cursor position will be on the screen. This can be + longer than SCREENWIDTH; if it is, lmargin will be adjusted. */ + phys_c_pos = c_pos - (last_lmargin ? last_lmargin : wrap_offset); + t = screenwidth / 3; + + /* If the number of characters had already exceeded the screenwidth, + last_lmargin will be > 0. */ + + /* If the number of characters to be displayed is more than the screen + width, compute the starting offset so that the cursor is about + two-thirds of the way across the screen. */ + if (phys_c_pos > screenwidth - 2) + { + lmargin = c_pos - (2 * t); + if (lmargin < 0) + lmargin = 0; + /* If the left margin would be in the middle of a prompt with + invisible characters, don't display the prompt at all. */ + if (wrap_offset && lmargin > 0 && lmargin < nleft) + lmargin = nleft; + } + else if (ndisp < screenwidth - 2) /* XXX - was -1 */ + lmargin = 0; + else if (phys_c_pos < 1) + { + /* If we are moving back towards the beginning of the line and + the last margin is no longer correct, compute a new one. */ + lmargin = ((c_pos - 1) / t) * t; /* XXX */ + if (wrap_offset && lmargin > 0 && lmargin < nleft) + lmargin = nleft; + } + else + lmargin = last_lmargin; + + /* If the first character on the screen isn't the first character + in the display line, indicate this with a special character. */ + if (lmargin > 0) + line[lmargin] = '<'; + + /* If SCREENWIDTH characters starting at LMARGIN do not encompass + the whole line, indicate that with a special characters at the + right edge of the screen. If LMARGIN is 0, we need to take the + wrap offset into account. */ + t = lmargin + M_OFFSET (lmargin, wrap_offset) + screenwidth; + if (t < out) + line[t - 1] = '>'; + + if (!rl_display_fixed || forced_display || lmargin != last_lmargin) + { + forced_display = 0; + update_line (&visible_line[last_lmargin], + &invisible_line[lmargin], + 0, + screenwidth + visible_wrap_offset, + screenwidth + (lmargin ? 0 : wrap_offset), + 0); + + /* If the visible new line is shorter than the old, but the number + of invisible characters is greater, and we are at the end of + the new line, we need to clear to eol. */ + t = _rl_last_c_pos - M_OFFSET (lmargin, wrap_offset); + if ((M_OFFSET (lmargin, wrap_offset) > visible_wrap_offset) && + (_rl_last_c_pos == out) && + t < visible_first_line_len) + { + nleft = screenwidth - t; + clear_to_eol (nleft); + } + visible_first_line_len = out - lmargin - M_OFFSET (lmargin, wrap_offset); + if (visible_first_line_len > screenwidth) + visible_first_line_len = screenwidth; + + _rl_move_cursor_relative (c_pos - lmargin, &invisible_line[lmargin]); + last_lmargin = lmargin; + } + } + fflush (rl_outstream); + + /* Swap visible and non-visible lines. */ + { + char *temp = visible_line; + visible_line = invisible_line; + invisible_line = temp; + rl_display_fixed = 0; + /* If we are displaying on a single line, and last_lmargin is > 0, we + are not displaying any invisible characters, so set visible_wrap_offset + to 0. */ + if (_rl_horizontal_scroll_mode && last_lmargin) + visible_wrap_offset = 0; + else + visible_wrap_offset = wrap_offset; + } +} + +/* PWP: update_line() is based on finding the middle difference of each + line on the screen; vis: + + /old first difference + /beginning of line | /old last same /old EOL + v v v v +old: eddie> Oh, my little gruntle-buggy is to me, as lurgid as +new: eddie> Oh, my little buggy says to me, as lurgid as + ^ ^ ^ ^ + \beginning of line | \new last same \new end of line + \new first difference + + All are character pointers for the sake of speed. Special cases for + no differences, as well as for end of line additions must be handeled. + + Could be made even smarter, but this works well enough */ +static void +update_line (old, new, current_line, omax, nmax, inv_botlin) + register char *old, *new; + int current_line, omax, nmax; +{ + register char *ofd, *ols, *oe, *nfd, *nls, *ne; + int temp, lendiff, wsatend, od, nd; + + /* If we're at the right edge of a terminal that supports xn, we're + ready to wrap around, so do so. This fixes problems with knowing + the exact cursor position and cut-and-paste with certain terminal + emulators. In this calculation, TEMP is the physical screen + position of the cursor. */ + temp = _rl_last_c_pos - W_OFFSET(_rl_last_v_pos, visible_wrap_offset); + if (temp == screenwidth && term_xn && !_rl_horizontal_scroll_mode + && _rl_last_v_pos == current_line - 1) + { + if (new[0]) + putc (new[0], rl_outstream); + else + putc (' ', rl_outstream); + _rl_last_c_pos = 1; /* XXX */ + _rl_last_v_pos++; + if (old[0]) + old[0] = new[0]; + } + + /* Find first difference. */ + for (ofd = old, nfd = new; + (ofd - old < omax) && *ofd && (*ofd == *nfd); + ofd++, nfd++) + ; + + /* Move to the end of the screen line. ND and OD are used to keep track + of the distance between ne and new and oe and old, respectively, to + move a subtraction out of each loop. */ + for (od = ofd - old, oe = ofd; od < omax && *oe; oe++, od++); + for (nd = nfd - new, ne = nfd; nd < nmax && *ne; ne++, nd++); + + /* If no difference, continue to next line. */ + if (ofd == oe && nfd == ne) + return; + + wsatend = 1; /* flag for trailing whitespace */ + ols = oe - 1; /* find last same */ + nls = ne - 1; + while ((ols > ofd) && (nls > nfd) && (*ols == *nls)) + { + if (*ols != ' ') + wsatend = 0; + ols--; + nls--; + } + + if (wsatend) + { + ols = oe; + nls = ne; + } + else if (*ols != *nls) + { + if (*ols) /* don't step past the NUL */ + ols++; + if (*nls) + nls++; + } + + _rl_move_vert (current_line); + + /* If this is the first line and there are invisible characters in the + prompt string, and the prompt string has not changed, then redraw + the entire prompt string. We can only do this reliably if the + terminal supports a `cr' capability. + + This is more than just an efficiency hack -- there is a problem with + redrawing portions of the prompt string if they contain terminal + escape sequences (like drawing the `unbold' sequence without a + corresponding `bold') that manifests itself on certain terminals. */ + + lendiff = strlen (local_prompt); + if (current_line == 0 && !_rl_horizontal_scroll_mode && + lendiff > visible_length && + _rl_last_c_pos > 0 && (ofd - old) >= lendiff && term_cr) + { + tputs (term_cr, 1, _rl_output_character_function); + _rl_output_some_chars (local_prompt, lendiff); + _rl_last_c_pos = lendiff; + } + + _rl_move_cursor_relative (ofd - old, old); + + /* if (len (new) > len (old)) */ + lendiff = (nls - nfd) - (ols - ofd); + + /* Insert (diff (len (old), len (new)) ch. */ + temp = ne - nfd; + if (lendiff > 0) + { + /* Non-zero if we're increasing the number of lines. */ + int gl = current_line >= _rl_vis_botlin && inv_botlin > _rl_vis_botlin; + /* Sometimes it is cheaper to print the characters rather than + use the terminal's capabilities. If we're growing the number + of lines, make sure we actually cause the new line to wrap + around on auto-wrapping terminals. */ + if (terminal_can_insert && ((2 * temp) >= lendiff || term_IC) && (!term_xn || !gl)) + { + /* If lendiff > visible_length and _rl_last_c_pos == 0 and + _rl_horizontal_scroll_mode == 1, inserting the characters with + term_IC or term_ic will screw up the screen because of the + invisible characters. We need to just draw them. */ + if (*ols && (!_rl_horizontal_scroll_mode || _rl_last_c_pos > 0 || + lendiff <= visible_length)) + { + insert_some_chars (nfd, lendiff); + _rl_last_c_pos += lendiff; + } + else + { + /* At the end of a line the characters do not have to + be "inserted". They can just be placed on the screen. */ + _rl_output_some_chars (nfd, lendiff); + _rl_last_c_pos += lendiff; + } + /* Copy (new) chars to screen from first diff to last match. */ + temp = nls - nfd; + if ((temp - lendiff) > 0) + { + _rl_output_some_chars (nfd + lendiff, temp - lendiff); + _rl_last_c_pos += temp - lendiff; + } + } + else + { + /* cannot insert chars, write to EOL */ + _rl_output_some_chars (nfd, temp); + _rl_last_c_pos += temp; + } + } + else /* Delete characters from line. */ + { + /* If possible and inexpensive to use terminal deletion, then do so. */ + if (term_dc && (2 * temp) >= -lendiff) + { + /* If all we're doing is erasing the invisible characters in the + prompt string, don't bother. It screws up the assumptions + about what's on the screen. */ + if (_rl_horizontal_scroll_mode && _rl_last_c_pos == 0 && + -lendiff == visible_wrap_offset) + lendiff = 0; + + if (lendiff) + delete_chars (-lendiff); /* delete (diff) characters */ + + /* Copy (new) chars to screen from first diff to last match */ + temp = nls - nfd; + if (temp > 0) + { + _rl_output_some_chars (nfd, temp); + _rl_last_c_pos += temp; + } + } + /* Otherwise, print over the existing material. */ + else + { + if (temp > 0) + { + _rl_output_some_chars (nfd, temp); + _rl_last_c_pos += temp; + } + lendiff = (oe - old) - (ne - new); + if (term_xn && current_line < inv_botlin) + space_to_eol (lendiff); + else + clear_to_eol (lendiff); + } + } +} + +/* Tell the update routines that we have moved onto a new (empty) line. */ +rl_on_new_line () +{ + if (visible_line) + visible_line[0] = '\0'; + + _rl_last_c_pos = _rl_last_v_pos = 0; + _rl_vis_botlin = last_lmargin = 0; + return 0; +} + +/* Actually update the display, period. */ +rl_forced_update_display () +{ + if (visible_line) + { + register char *temp = visible_line; + + while (*temp) *temp++ = '\0'; + } + rl_on_new_line (); + forced_display++; + rl_redisplay (); + return 0; +} + +/* Move the cursor from _rl_last_c_pos to NEW, which are buffer indices. + DATA is the contents of the screen line of interest; i.e., where + the movement is being done. */ +void +_rl_move_cursor_relative (new, data) + int new; + char *data; +{ + register int i; + + /* If we don't have to do anything, then return. */ + if (_rl_last_c_pos == new) return; + + /* It may be faster to output a CR, and then move forwards instead + of moving backwards. */ + /* i == current physical cursor position. */ + i = _rl_last_c_pos - W_OFFSET(_rl_last_v_pos, visible_wrap_offset); + if (CR_FASTER (new, _rl_last_c_pos) || (term_xn && i == screenwidth)) + { +#if defined (__MSDOS__) + putc ('\r', rl_outstream); +#else + tputs (term_cr, 1, _rl_output_character_function); +#endif /* !__MSDOS__ */ + _rl_last_c_pos = 0; + } + + if (_rl_last_c_pos < new) + { + /* Move the cursor forward. We do it by printing the command + to move the cursor forward if there is one, else print that + portion of the output buffer again. Which is cheaper? */ + + /* The above comment is left here for posterity. It is faster + to print one character (non-control) than to print a control + sequence telling the terminal to move forward one character. + That kind of control is for people who don't know what the + data is underneath the cursor. */ +#if defined (HACK_TERMCAP_MOTION) + extern char *term_forward_char; + + if (term_forward_char) + for (i = _rl_last_c_pos; i < new; i++) + tputs (term_forward_char, 1, _rl_output_character_function); + else + for (i = _rl_last_c_pos; i < new; i++) + putc (data[i], rl_outstream); +#else + for (i = _rl_last_c_pos; i < new; i++) + putc (data[i], rl_outstream); +#endif /* HACK_TERMCAP_MOTION */ + } + else if (_rl_last_c_pos != new) + backspace (_rl_last_c_pos - new); + _rl_last_c_pos = new; +} + +/* PWP: move the cursor up or down. */ +void +_rl_move_vert (to) + int to; +{ + register int delta, i; + + if (_rl_last_v_pos == to || to > screenheight) + return; + +#if defined (__GO32__) + { + int row, col; + + ScreenGetCursor (&row, &col); + ScreenSetCursor ((row + to - _rl_last_v_pos), col); + } +#else /* !__GO32__ */ + + if ((delta = to - _rl_last_v_pos) > 0) + { + for (i = 0; i < delta; i++) + putc ('\n', rl_outstream); + tputs (term_cr, 1, _rl_output_character_function); + _rl_last_c_pos = 0; + } + else + { /* delta < 0 */ + if (term_up && *term_up) + for (i = 0; i < -delta; i++) + tputs (term_up, 1, _rl_output_character_function); + } +#endif /* !__GO32__ */ + _rl_last_v_pos = to; /* Now TO is here */ +} + +/* Physically print C on rl_outstream. This is for functions which know + how to optimize the display. Return the number of characters output. */ +rl_show_char (c) + int c; +{ + int n = 1; + if (META_CHAR (c) && (_rl_output_meta_chars == 0)) + { + fprintf (rl_outstream, "M-"); + n += 2; + c = UNMETA (c); + } + +#if defined (DISPLAY_TABS) + if (c < 32 && c != '\t') +#else + if (c < 32) +#endif /* !DISPLAY_TABS */ + { + fprintf (rl_outstream, "C-"); + n += 2; + c += 64; + } + + putc (c, rl_outstream); + fflush (rl_outstream); + return n; +} + +int +rl_character_len (c, pos) + register int c, pos; +{ + unsigned char uc; + + uc = (unsigned char)c; + + if (META_CHAR (uc)) + return ((_rl_output_meta_chars == 0) ? 4 : 1); + + if (uc == '\t') + { +#if defined (DISPLAY_TABS) + return (((pos | 7) + 1) - pos); +#else + return (2); +#endif /* !DISPLAY_TABS */ + } + + return ((isprint (uc)) ? 1 : 2); +} + +/* How to print things in the "echo-area". The prompt is treated as a + mini-modeline. */ + +#if defined (HAVE_VARARGS_H) +rl_message (va_alist) + va_dcl +{ + char *format; + va_list args; + + va_start (args); + format = va_arg (args, char *); + vsprintf (msg_buf, format, args); + va_end (args); + + rl_display_prompt = msg_buf; + rl_redisplay (); + return 0; +} +#else /* !HAVE_VARARGS_H */ +rl_message (format, arg1, arg2) + char *format; +{ + sprintf (msg_buf, format, arg1, arg2); + rl_display_prompt = msg_buf; + rl_redisplay (); + return 0; +} +#endif /* !HAVE_VARARGS_H */ + +/* How to clear things from the "echo-area". */ +rl_clear_message () +{ + rl_display_prompt = rl_prompt; + rl_redisplay (); + return 0; +} + +rl_reset_line_state () +{ + rl_on_new_line (); + + rl_display_prompt = rl_prompt ? rl_prompt : ""; + forced_display = 1; + return 0; +} + +/* Quick redisplay hack when erasing characters at the end of the line. */ +void +_rl_erase_at_end_of_line (l) + int l; +{ + register int i; + + backspace (l); + for (i = 0; i < l; i++) + putc (' ', rl_outstream); + backspace (l); + for (i = 0; i < l; i++) + visible_line[--_rl_last_c_pos] = '\0'; + rl_display_fixed++; +} + +/* Clear to the end of the line. COUNT is the minimum + number of character spaces to clear, */ +static void +clear_to_eol (count) + int count; +{ +#if !defined (__GO32__) + if (term_clreol) + { + tputs (term_clreol, 1, _rl_output_character_function); + } + else +#endif /* !__GO32__ */ + space_to_eol (count); +} + +/* Clear to the end of the line using spaces. COUNT is the minimum + number of character spaces to clear, */ +static void +space_to_eol (count) + int count; +{ + register int i; + + for (i = 0; i < count; i++) + putc (' ', rl_outstream); + + _rl_last_c_pos += count; +} + +/* Insert COUNT characters from STRING to the output stream. */ +static void +insert_some_chars (string, count) + char *string; + int count; +{ +#if defined (__GO32__) + int row, col, width; + char *row_start; + + ScreenGetCursor (&row, &col); + width = ScreenCols (); + row_start = ScreenPrimary + (row * width); + + memcpy (row_start + col + count, row_start + col, width - col - count); + + /* Place the text on the screen. */ + _rl_output_some_chars (string, count); +#else /* !_GO32 */ + + /* If IC is defined, then we do not have to "enter" insert mode. */ + if (term_IC) + { + char *tgoto (), *buffer; + buffer = tgoto (term_IC, 0, count); + tputs (buffer, 1, _rl_output_character_function); + _rl_output_some_chars (string, count); + } + else + { + register int i; + + /* If we have to turn on insert-mode, then do so. */ + if (term_im && *term_im) + tputs (term_im, 1, _rl_output_character_function); + + /* If there is a special command for inserting characters, then + use that first to open up the space. */ + if (term_ic && *term_ic) + { + for (i = count; i--; ) + tputs (term_ic, 1, _rl_output_character_function); + } + + /* Print the text. */ + _rl_output_some_chars (string, count); + + /* If there is a string to turn off insert mode, we had best use + it now. */ + if (term_ei && *term_ei) + tputs (term_ei, 1, _rl_output_character_function); + } +#endif /* !__GO32__ */ +} + +/* Delete COUNT characters from the display line. */ +static void +delete_chars (count) + int count; +{ +#if defined (__GO32__) + int row, col, width; + char *row_start; + + ScreenGetCursor (&row, &col); + width = ScreenCols (); + row_start = ScreenPrimary + (row * width); + + memcpy (row_start + col, row_start + col + count, width - col - count); + memset (row_start + width - count, 0, count * 2); +#else /* !_GO32 */ + + if (count > screenwidth) /* XXX */ + return; + + if (term_DC && *term_DC) + { + char *tgoto (), *buffer; + buffer = tgoto (term_DC, count, count); + tputs (buffer, count, _rl_output_character_function); + } + else + { + if (term_dc && *term_dc) + while (count--) + tputs (term_dc, 1, _rl_output_character_function); + } +#endif /* !__GO32__ */ +} + +void +_rl_update_final () +{ + int full_lines; + + full_lines = 0; + if (_rl_vis_botlin && visible_line[screenwidth * _rl_vis_botlin] == 0) + { + _rl_vis_botlin--; + full_lines = 1; + } + _rl_move_vert (_rl_vis_botlin); + if (full_lines && term_xn) + { + /* Remove final line-wrap flag in xterm. */ + char *last_line; + last_line = &visible_line[screenwidth * _rl_vis_botlin]; + _rl_move_cursor_relative (screenwidth - 1, last_line); + clear_to_eol (0); + putc (last_line[screenwidth - 1], rl_outstream); + } + _rl_vis_botlin = 0; + crlf (); + fflush (rl_outstream); + rl_display_fixed++; +} diff --git a/doc/Makefile b/doc/Makefile new file mode 100644 index 0000000..ad5ef70 --- /dev/null +++ b/doc/Makefile @@ -0,0 +1,56 @@ +# This makefile for History library documentation is in -*- text -*- mode. +# Emacs likes it that way. + +DOC_SUPPORT = ../../doc-support/ +TEXINDEX = $(DOC_SUPPORT)/texindex + +TEX = tex + +DVIOBJ = readline.dvi history.dvi +INFOBJ = readline.info history.info +PSOBJ = readline.ps history.ps + +all: info dvi + +readline.dvi: rlman.texinfo rluser.texinfo rltech.texinfo + $(TEX) rlman.texinfo + $(TEXINDEX) rlman.?? + $(TEX) rlman.texinfo + mv rlman.dvi readline.dvi + +readline.info: rlman.texinfo rluser.texinfo rltech.texinfo + makeinfo rlman.texinfo + +history.dvi: hist.texinfo hsuser.texinfo hstech.texinfo + $(TEX) hist.texinfo + $(TEXINDEX) hist.?? + $(TEX) hist.texinfo + mv hist.dvi history.dvi + +history.info: hist.texinfo hsuser.texinfo hstech.texinfo + makeinfo hist.texinfo + +readline.ps: readline.dvi + dvips -D 300 -o $@ readline.dvi + +history.ps: history.dvi + dvips -D 300 -o $@ history.dvi + +info: $(INFOOBJ) +dvi: $(DVIOBJ) +ps: $(PSOBJ) + + +$(TEXINDEX): + (cd $(DOC_SUPPORT); $(MAKE) $(MFLAGS) CFLAGS='$(CFLAGS)' texindex) + +clean: + rm -f *.aux *.cp *.fn *.ky *.log *.pg *.toc *.tp *.vr *.cps *.pgs \ + *.fns *.kys *.tps *.vrs *.o core + +squeaky-clean: + rm -f *.aux *.cp *.fn *.ky *.log *.pg *.toc *.tp *.vr *.cps *.pgs \ + *.dvi *.info *.info-* *.fns *.kys *.tps *.vrs *.o core + +distclean: clean +realclean: clean diff --git a/doc/hist.texinfo b/doc/hist.texinfo new file mode 100644 index 0000000..cc80efa --- /dev/null +++ b/doc/hist.texinfo @@ -0,0 +1,113 @@ +\input texinfo @c -*-texinfo-*- +@c %**start of header (This is for running Texinfo on a region.) +@setfilename history.info +@settitle GNU History Library +@c %**end of header (This is for running Texinfo on a region.) + +@setchapternewpage odd + +@ignore +last change: Wed Jul 20 09:57:17 EDT 1994 +@end ignore + +@set EDITION 2.0 +@set VERSION 2.0 +@set UPDATED 20 July 1994 +@set UPDATE-MONTH July 1994 + +@ifinfo +This document describes the GNU History library, a programming tool that +provides a consistent user interface for recalling lines of previously +typed input. + +Copyright (C) 1988, 1991 Free Software Foundation, Inc. + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +pare preserved on all copies. + +@ignore +Permission is granted to process this file through TeX and print the +results, provided the printed document carries copying permission +notice identical to this one except for the removal of this paragraph +(this paragraph not being relevant to the printed manual). +@end ignore + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided that the entire +resulting derived work is distributed under the terms of a permission +notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation approved +by the Foundation. +@end ifinfo + +@titlepage +@sp 10 +@title GNU History Library +@subtitle Edition @value{EDITION}, for @code{History Library} Version @value{VERSION}. +@subtitle @value{UPDATE-MONTH} +@author Brian Fox, Free Software Foundation +@author Chet Ramey, Case Western Reserve University + +@page +This document describes the GNU History library, a programming tool that +provides a consistent user interface for recalling lines of previously +typed input. + +Published by the Free Software Foundation @* +675 Massachusetts Avenue, @* +Cambridge, MA 02139 USA + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +are preserved on all copies. + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided that the entire +resulting derived work is distributed under the terms of a permission +notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation approved +by the Foundation. + +@vskip 0pt plus 1filll +Copyright @copyright{} 1989, 1991 Free Software Foundation, Inc. +@end titlepage + +@ifinfo +@node Top +@top GNU History Library + +This document describes the GNU History library, a programming tool that +provides a consistent user interface for recalling lines of previously +typed input. + +@menu +* Using History Interactively:: GNU History User's Manual. +* Programming with GNU History:: GNU History Programmer's Manual. +* Concept Index:: Index of concepts described in this manual. +* Function and Variable Index:: Index of externally visible functions + and variables. +@end menu +@end ifinfo + +@syncodeindex fn vr + +@include hsuser.texinfo +@include hstech.texinfo + +@node Concept Index +@appendix Concept Index +@printindex cp + +@node Function and Variable Index +@appendix Function and Variable Index +@printindex vr + +@contents +@bye diff --git a/doc/history.dvi b/doc/history.dvi new file mode 100644 index 0000000..60d7376 Binary files /dev/null and b/doc/history.dvi differ diff --git a/doc/history.info b/doc/history.info new file mode 100644 index 0000000..6df0bd9 --- /dev/null +++ b/doc/history.info @@ -0,0 +1,744 @@ +This is Info file history.info, produced by Makeinfo-1.55 from the +input file hist.texinfo. + + This document describes the GNU History library, a programming tool +that provides a consistent user interface for recalling lines of +previously typed input. + + Copyright (C) 1988, 1991 Free Software Foundation, Inc. + + Permission is granted to make and distribute verbatim copies of this +manual provided the copyright notice and this permission notice pare +preserved on all copies. + + Permission is granted to copy and distribute modified versions of +this manual under the conditions for verbatim copying, provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + + Permission is granted to copy and distribute translations of this +manual into another language, under the above conditions for modified +versions, except that this permission notice may be stated in a +translation approved by the Foundation. + + +File: history.info, Node: Top, Next: Using History Interactively, Prev: (DIR), Up: (DIR) + +GNU History Library +******************* + + This document describes the GNU History library, a programming tool +that provides a consistent user interface for recalling lines of +previously typed input. + +* Menu: + +* Using History Interactively:: GNU History User's Manual. +* Programming with GNU History:: GNU History Programmer's Manual. +* Concept Index:: Index of concepts described in this manual. +* Function and Variable Index:: Index of externally visible functions + and variables. + + +File: history.info, Node: Using History Interactively, Next: Programming with GNU History, Prev: Top, Up: Top + +Using History Interactively +*************************** + + This chapter describes how to use the GNU History Library +interactively, from a user's standpoint. It should be considered a +user's guide. For information on using the GNU History Library in your +own programs, *note Programming with GNU History::.. + +* Menu: + +* History Interaction:: What it feels like using History as a user. + + +File: history.info, Node: History Interaction, Up: Using History Interactively + +History Interaction +=================== + + The History library provides a history expansion feature that is +similar to the history expansion provided by `csh'. The following text +describes the syntax used to manipulate the history information. + + History expansion takes place in two parts. The first is to +determine which line from the previous history should be used during +substitution. The second is to select portions of that line for +inclusion into the current one. The line selected from the previous +history is called the "event", and the portions of that line that are +acted upon are called "words". The line is broken into words in the +same fashion that Bash does, so that several English (or Unix) words +surrounded by quotes are considered as one word. + +* Menu: + +* Event Designators:: How to specify which history line to use. +* Word Designators:: Specifying which words are of interest. +* Modifiers:: Modifying the results of substitution. + + +File: history.info, Node: Event Designators, Next: Word Designators, Up: History Interaction + +Event Designators +----------------- + + An event designator is a reference to a command line entry in the +history list. + +`!' + Start a history substitution, except when followed by a space, tab, + the end of the line, = or (. + +`!!' + Refer to the previous command. This is a synonym for `!-1'. + +`!n' + Refer to command line N. + +`!-n' + Refer to the command N lines back. + +`!string' + Refer to the most recent command starting with STRING. + +`!?string'[`?'] + Refer to the most recent command containing STRING. + +`!#' + The entire command line typed so far. + +`^string1^string2^' + Quick Substitution. Repeat the last command, replacing STRING1 + with STRING2. Equivalent to `!!:s/string1/string2/'. + + +File: history.info, Node: Word Designators, Next: Modifiers, Prev: Event Designators, Up: History Interaction + +Word Designators +---------------- + + A : separates the event specification from the word designator. It +can be omitted if the word designator begins with a ^, $, * or %. +Words are numbered from the beginning of the line, with the first word +being denoted by a 0 (zero). + +`0 (zero)' + The `0'th word. For many applications, this is the command word. + +`n' + The Nth word. + +`^' + The first argument; that is, word 1. + +`$' + The last argument. + +`%' + The word matched by the most recent `?string?' search. + +`x-y' + A range of words; `-Y' abbreviates `0-Y'. + +`*' + All of the words, except the `0'th. This is a synonym for `1-$'. + It is not an error to use * if there is just one word in the event; + the empty string is returned in that case. + +`x*' + Abbreviates `x-$' + +`x-' + Abbreviates `x-$' like `x*', but omits the last word. + + +File: history.info, Node: Modifiers, Prev: Word Designators, Up: History Interaction + +Modifiers +--------- + + After the optional word designator, you can add a sequence of one or +more of the following modifiers, each preceded by a :. + +`h' + Remove a trailing pathname component, leaving only the head. + +`r' + Remove a trailing suffix of the form `.'SUFFIX, leaving the + basename. + +`e' + Remove all but the trailing suffix. + +`t' + Remove all leading pathname components, leaving the tail. + +`p' + Print the new command but do not execute it. + +`s/old/new/' + Substitute NEW for the first occurrence of OLD in the event line. + Any delimiter may be used in place of /. The delimiter may be + quoted in OLD and NEW with a single backslash. If & appears in + NEW, it is replaced by OLD. A single backslash will quote the &. + The final delimiter is optional if it is the last character on the + input line. + +`&' + Repeat the previous substitution. + +`g' + Cause changes to be applied over the entire event line. Used in + conjunction with `s', as in `gs/old/new/', or with `&'. + + +File: history.info, Node: Programming with GNU History, Next: Concept Index, Prev: Using History Interactively, Up: Top + +Programming with GNU History +**************************** + + This chapter describes how to interface programs that you write with +the GNU History Library. It should be considered a technical guide. +For information on the interactive use of GNU History, *note Using +History Interactively::.. + +* Menu: + +* Introduction to History:: What is the GNU History library for? +* History Storage:: How information is stored. +* History Functions:: Functions that you can use. +* History Variables:: Variables that control behaviour. +* History Programming Example:: Example of using the GNU History Library. + + +File: history.info, Node: Introduction to History, Next: History Storage, Up: Programming with GNU History + +Introduction to History +======================= + + Many programs read input from the user a line at a time. The GNU +History library is able to keep track of those lines, associate +arbitrary data with each line, and utilize information from previous +lines in composing new ones. + + The programmer using the History library has available functions for +remembering lines on a history list, associating arbitrary data with a +line, removing lines from the list, searching through the list for a +line containing an arbitrary text string, and referencing any line in +the list directly. In addition, a history "expansion" function is +available which provides for a consistent user interface across +different programs. + + The user using programs written with the History library has the +benefit of a consistent user interface with a set of well-known +commands for manipulating the text of previous lines and using that text +in new commands. The basic history manipulation commands are similar to +the history substitution provided by `csh'. + + If the programmer desires, he can use the Readline library, which +includes some history manipulation by default, and has the added +advantage of command line editing. + + +File: history.info, Node: History Storage, Next: History Functions, Prev: Introduction to History, Up: Programming with GNU History + +History Storage +=============== + + The history list is an array of history entries. A history entry is +declared as follows: + + typedef struct _hist_entry { + char *line; + char *data; + } HIST_ENTRY; + + The history list itself might therefore be declared as + + HIST_ENTRY **the_history_list; + + The state of the History library is encapsulated into a single +structure: + + /* A structure used to pass the current state of the history stuff around. */ + typedef struct _hist_state { + HIST_ENTRY **entries; /* Pointer to the entries themselves. */ + int offset; /* The location pointer within this array. */ + int length; /* Number of elements within this array. */ + int size; /* Number of slots allocated to this array. */ + int flags; + } HISTORY_STATE; + + If the flags member includes `HS_STIFLED', the history has been +stifled. + + +File: history.info, Node: History Functions, Next: History Variables, Prev: History Storage, Up: Programming with GNU History + +History Functions +================= + + This section describes the calling sequence for the various functions +present in GNU History. + +* Menu: + +* Initializing History and State Management:: Functions to call when you + want to use history in a + program. +* History List Management:: Functions used to manage the list + of history entries. +* Information About the History List:: Functions returning information about + the history list. +* Moving Around the History List:: Functions used to change the position + in the history list. +* Searching the History List:: Functions to search the history list + for entries containing a string. +* Managing the History File:: Functions that read and write a file + containing the history list. +* History Expansion:: Functions to perform csh-like history + expansion. + + +File: history.info, Node: Initializing History and State Management, Next: History List Management, Up: History Functions + +Initializing History and State Management +----------------------------------------- + + This section describes functions used to initialize and manage the +state of the History library when you want to use the history functions +in your program. + + - Function: void using_history () + Begin a session in which the history functions might be used. This + initializes the interactive variables. + + - Function: HISTORY_STATE * history_get_history_state () + Return a structure describing the current state of the input + history. + + - Function: void history_set_history_state (HISTORY_STATE *state) + Set the state of the history list according to STATE. + + +File: history.info, Node: History List Management, Next: Information About the History List, Prev: Initializing History and State Management, Up: History Functions + +History List Management +----------------------- + + These functions manage individual entries on the history list, or set +parameters managing the list itself. + + - Function: void add_history (char *string) + Place STRING at the end of the history list. The associated data + field (if any) is set to `NULL'. + + - Function: HIST_ENTRY * remove_history (int which) + Remove history entry at offset WHICH from the history. The + removed element is returned so you can free the line, data, and + containing structure. + + - Function: HIST_ENTRY * replace_history_entry (int which, char *line, + char *data) + Make the history entry at offset WHICH have LINE and DATA. This + returns the old entry so you can dispose of the data. In the case + of an invalid WHICH, a `NULL' pointer is returned. + + - Function: void stifle_history (int max) + Stifle the history list, remembering only the last MAX entries. + + - Function: int unstifle_history () + Stop stifling the history. This returns the previous amount the + history was stifled. The value is positive if the history was + stifled, negative if it wasn't. + + - Function: int history_is_stifled () + Returns non-zero if the history is stifled, zero if it is not. + + +File: history.info, Node: Information About the History List, Next: Moving Around the History List, Prev: History List Management, Up: History Functions + +Information About the History List +---------------------------------- + + These functions return information about the entire history list or +individual list entries. + + - Function: HIST_ENTRY ** history_list () + Return a `NULL' terminated array of `HIST_ENTRY' which is the + current input history. Element 0 of this list is the beginning of + time. If there is no history, return `NULL'. + + - Function: int where_history () + Returns the offset of the current history element. + + - Function: HIST_ENTRY * current_history () + Return the history entry at the current position, as determined by + `where_history ()'. If there is no entry there, return a `NULL' + pointer. + + - Function: HIST_ENTRY * history_get (int offset) + Return the history entry at position OFFSET, starting from + `history_base'. If there is no entry there, or if OFFSET is + greater than the history length, return a `NULL' pointer. + + - Function: int history_total_bytes () + Return the number of bytes that the primary history entries are + using. This function returns the sum of the lengths of all the + lines in the history. + + +File: history.info, Node: Moving Around the History List, Next: Searching the History List, Prev: Information About the History List, Up: History Functions + +Moving Around the History List +------------------------------ + + These functions allow the current index into the history list to be +set or changed. + + - Function: int history_set_pos (int pos) + Set the position in the history list to POS, an absolute index + into the list. + + - Function: HIST_ENTRY * previous_history () + Back up the current history offset to the previous history entry, + and return a pointer to that entry. If there is no previous + entry, return a `NULL' pointer. + + - Function: HIST_ENTRY * next_history () + Move the current history offset forward to the next history entry, + and return the a pointer to that entry. If there is no next + entry, return a `NULL' pointer. + + +File: history.info, Node: Searching the History List, Next: Managing the History File, Prev: Moving Around the History List, Up: History Functions + +Searching the History List +-------------------------- + + These functions allow searching of the history list for entries +containing a specific string. Searching may be performed both forward +and backward from the current history position. The search may be +"anchored", meaning that the string must match at the beginning of the +history entry. + + - Function: int history_search (char *string, int direction) + Search the history for STRING, starting at the current history + offset. If DIRECTION < 0, then the search is through previous + entries, else through subsequent. If STRING is found, then the + current history index is set to that history entry, and the value + returned is the offset in the line of the entry where STRING was + found. Otherwise, nothing is changed, and a -1 is returned. + + - Function: int history_search_prefix (char *string, int direction) + Search the history for STRING, starting at the current history + offset. The search is anchored: matching lines must begin with + STRING. If DIRECTION < 0, then the search is through previous + entries, else through subsequent. If STRING is found, then the + current history index is set to that entry, and the return value + is 0. Otherwise, nothing is changed, and a -1 is returned. + + - Function: int history_search_pos (char *string, int direction, int + pos) + Search for STRING in the history list, starting at POS, an + absolute index into the list. If DIRECTION is negative, the search + proceeds backward from POS, otherwise forward. Returns the + absolute index of the history element where STRING was found, or + -1 otherwise. + + +File: history.info, Node: Managing the History File, Next: History Expansion, Prev: Searching the History List, Up: History Functions + +Managing the History File +------------------------- + + The History library can read the history from and write it to a file. +This section documents the functions for managing a history file. + + - Function: int read_history (char *filename) + Add the contents of FILENAME to the history list, a line at a + time. If FILENAME is `NULL', then read from `~/.history'. + Returns 0 if successful, or errno if not. + + - Function: int read_history_range (char *filename, int from, int to) + Read a range of lines from FILENAME, adding them to the history + list. Start reading at line FROM and end at TO. If FROM is zero, + start at the beginning. If TO is less than FROM, then read until + the end of the file. If FILENAME is `NULL', then read from + `~/.history'. Returns 0 if successful, or `errno' if not. + + - Function: int write_history (char *filename) + Write the current history to FILENAME, overwriting FILENAME if + necessary. If FILENAME is `NULL', then write the history list to + `~/.history'. Values returned are as in `read_history ()'. + + - Function: int append_history (int nelements, char *filename) + Append the last NELEMENTS of the history list to FILENAME. + + - Function: int history_truncate_file (char *filename, int nlines) + Truncate the history file FILENAME, leaving only the last NLINES + lines. + + +File: history.info, Node: History Expansion, Prev: Managing the History File, Up: History Functions + +History Expansion +----------------- + + These functions implement `csh'-like history expansion. + + - Function: int history_expand (char *string, char **output) + Expand STRING, placing the result into OUTPUT, a pointer to a + string (*note History Interaction::.). Returns: + `0' + If no expansions took place (or, if the only change in the + text was the de-slashifying of the history expansion + character); + + `1' + if expansions did take place; + + `-1' + if there was an error in expansion; + + `2' + if the returned line should only be displayed, but not + executed, as with the `:p' modifier (*note Modifiers::.). + + If an error ocurred in expansion, then OUTPUT contains a + descriptive error message. + + - Function: char * history_arg_extract (int first, int last, char + *string) + Extract a string segment consisting of the FIRST through LAST + arguments present in STRING. Arguments are broken up as in Bash. + + - Function: char * get_history_event (char *string, int *cindex, int + qchar) + Returns the text of the history event beginning at STRING + + *CINDEX. *CINDEX is modified to point to after the event + specifier. At function entry, CINDEX points to the index into + STRING where the history event specification begins. QCHAR is a + character that is allowed to end the event specification in + addition to the "normal" terminating characters. + + - Function: char ** history_tokenize (char *string) + Return an array of tokens parsed out of STRING, much as the shell + might. The tokens are split on white space and on the characters + `()<>;&|$', and shell quoting conventions are obeyed. + + +File: history.info, Node: History Variables, Next: History Programming Example, Prev: History Functions, Up: Programming with GNU History + +History Variables +================= + + This section describes the externally visible variables exported by +the GNU History Library. + + - Variable: int history_base + The logical offset of the first entry in the history list. + + - Variable: int history_length + The number of entries currently stored in the history list. + + - Variable: int max_input_history + The maximum number of history entries. This must be changed using + `stifle_history ()'. + + - Variable: char history_expansion_char + The character that starts a history event. The default is `!'. + + - Variable: char history_subst_char + The character that invokes word substitution if found at the start + of a line. The default is `^'. + + - Variable: char history_comment_char + During tokenization, if this character is seen as the first + character of a word, then it and all subsequent characters up to a + newline are ignored, suppressing history expansion for the + remainder of the line. This is disabled by default. + + - Variable: char * history_no_expand_chars + The list of characters which inhibit history expansion if found + immediately following HISTORY_EXPANSION_CHAR. The default is + whitespace and `='. + + +File: history.info, Node: History Programming Example, Prev: History Variables, Up: Programming with GNU History + +History Programming Example +=========================== + + The following program demonstrates simple use of the GNU History +Library. + + main () + { + char line[1024], *t; + int len, done = 0; + + line[0] = 0; + + using_history (); + while (!done) + { + printf ("history$ "); + fflush (stdout); + t = fgets (line, sizeof (line) - 1, stdin); + if (t && *t) + { + len = strlen (t); + if (t[len - 1] == '\n') + t[len - 1] = '\0'; + } + + if (!t) + strcpy (line, "quit"); + + if (line[0]) + { + char *expansion; + int result; + + result = history_expand (line, &expansion); + if (result) + fprintf (stderr, "%s\n", expansion); + + if (result < 0 || result == 2) + { + free (expansion); + continue; + } + + add_history (expansion); + strncpy (line, expansion, sizeof (line) - 1); + free (expansion); + } + + if (strcmp (line, "quit") == 0) + done = 1; + else if (strcmp (line, "save") == 0) + write_history ("history_file"); + else if (strcmp (line, "read") == 0) + read_history ("history_file"); + else if (strcmp (line, "list") == 0) + { + register HIST_ENTRY **the_list; + register int i; + + the_list = history_list (); + if (the_list) + for (i = 0; the_list[i]; i++) + printf ("%d: %s\n", i + history_base, the_list[i]->line); + } + else if (strncmp (line, "delete", 6) == 0) + { + int which; + if ((sscanf (line + 6, "%d", &which)) == 1) + { + HIST_ENTRY *entry = remove_history (which); + if (!entry) + fprintf (stderr, "No such entry %d\n", which); + else + { + free (entry->line); + free (entry); + } + } + else + { + fprintf (stderr, "non-numeric arg given to `delete'\n"); + } + } + } + } + + +File: history.info, Node: Concept Index, Next: Function and Variable Index, Prev: Programming with GNU History, Up: Top + +Concept Index +************* + +* Menu: + +* anchored search: Searching the History List. +* event designators: Event Designators. +* expansion: History Interaction. +* history events: Event Designators. +* History Searching: Searching the History List. + + +File: history.info, Node: Function and Variable Index, Prev: Concept Index, Up: Top + +Function and Variable Index +*************************** + +* Menu: + +* add_history: History List Management. +* append_history: Managing the History File. +* current_history: Information About the History List. +* get_history_event: History Expansion. +* history_arg_extract: History Expansion. +* history_base: History Variables. +* history_comment_char: History Variables. +* history_expand: History Expansion. +* history_expansion_char: History Variables. +* history_get: Information About the History List. +* history_get_history_state: Initializing History and State Management. +* history_is_stifled: History List Management. +* history_length: History Variables. +* history_list: Information About the History List. +* history_no_expand_chars: History Variables. +* history_search: Searching the History List. +* history_search_pos: Searching the History List. +* history_search_prefix: Searching the History List. +* history_set_history_state: Initializing History and State Management. +* history_set_pos: Moving Around the History List. +* history_subst_char: History Variables. +* history_tokenize: History Expansion. +* history_total_bytes: Information About the History List. +* history_truncate_file: Managing the History File. +* max_input_history: History Variables. +* next_history: Moving Around the History List. +* previous_history: Moving Around the History List. +* read_history: Managing the History File. +* read_history_range: Managing the History File. +* remove_history: History List Management. +* replace_history_entry: History List Management. +* stifle_history: History List Management. +* unstifle_history: History List Management. +* using_history: Initializing History and State Management. +* where_history: Information About the History List. +* write_history: Managing the History File. + + + +Tag Table: +Node: Top975 +Node: Using History Interactively1569 +Node: History Interaction2077 +Node: Event Designators3122 +Node: Word Designators3952 +Node: Modifiers4936 +Node: Programming with GNU History6065 +Node: Introduction to History6791 +Node: History Storage8112 +Node: History Functions9205 +Node: Initializing History and State Management10176 +Node: History List Management10968 +Node: Information About the History List12396 +Node: Moving Around the History List13702 +Node: Searching the History List14587 +Node: Managing the History File16419 +Node: History Expansion17925 +Node: History Variables19769 +Node: History Programming Example21138 +Node: Concept Index23742 +Node: Function and Variable Index24223 + +End Tag Table diff --git a/doc/history.ps b/doc/history.ps new file mode 100644 index 0000000..839598f --- /dev/null +++ b/doc/history.ps @@ -0,0 +1,2037 @@ +%!PS-Adobe-2.0 +%%Creator: dvipsk 5.490s Copyright 1986, 1992 Radical Eye Software +%%Title: history.dvi +%%Pages: 22 1 +%%BoundingBox: 0 0 612 792 +%%EndComments +%DVIPSCommandLine: dvips -D 300 -o history.ps history.dvi +%%BeginProcSet: tex.pro +%! +/TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N} +B /TR{translate}N /isls false N /vsize 11 72 mul N /@rigin{isls{[0 -1 1 0 0 0] +concat}if 72 Resolution div 72 VResolution div neg scale isls{Resolution hsize +-72 div mul 0 TR}if Resolution VResolution vsize -72 div 1 add mul TR matrix +currentmatrix dup dup 4 get round 4 exch put dup dup 5 get round 5 exch put +setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed +true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N +/IE 0 N /ctr 0 N /df-tail{/nn 8 dict N nn begin /FontType 3 N /FontMatrix +fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{ +CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn +put /ctr 0 N[}B /df{/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 +0 sf neg 0 0]N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data +dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{128 +ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 +sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type +/stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N +/cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get +S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height +sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0 +-1 -.1 ch-xoff sub ch-yoff .1 add]{ch-image}imagemask restore}B /D{/cc X dup +type /stringtype ne{]}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 +ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N} +B /I{cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin +0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add +.99 lt{/FV}{/RV}ifelse load def pop}N /eop{SI restore showpage userdict +/eop-hook known{eop-hook}if}N /@start{userdict /start-hook known{start-hook} +if /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE +S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div +/hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley +0 N /v{/ruley X /rulex X V}B /V{}B /RV statusdict begin /product where{pop +product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval +(NeXT)eq or}{pop false}ifelse}{false}ifelse end{{gsave TR -.1 -.1 TR 1 1 scale +rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 -.1 TR rulex +ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /FV{gsave +transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg +rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail{dup +/delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}B /d{-3 M} +B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{4 M}B /w{0 +rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{p 1 w}B /r{p 2 w} +B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B +/eos{SS restore}B end +%%EndProcSet +TeXDict begin 40258431 52099146 1000 300 300 @start /Fa 1 59 +df<70F8F8F87005057C840D>58 D E /Fb 1 59 df<78FCFCFCFC7806067B8510>58 +D E /Fc 24 123 df<1FC0007FF000707800201800001C00001C0007FC001FFC003C1C00701C00 +E01C00E01C00E01C00707C003FFF800F8F8011107E8F14>97 DI<03F80FFC1C1C380870006000E000E0 +00E000E00060007000380E1C1E0FFC03F00F107E8F14>I<007E00007E00000E00000E00000E00 +000E00000E0007CE000FFE001C3E00301E00700E00E00E00E00E00E00E00E00E00E00E00E00E00 +700E00301E00383E001FEFC007CFC012177F9614>I<07E00FF01C38301C700CE00EE00EFFFEFF +FEE00060007000380E1C1E0FFC03F00F107E8F14>I<007C00FE01CE03840380038003807FFEFF +FE0380038003800380038003800380038003800380038003807FFC7FFC0F177F9614>I<07CF00 +1FFF80383B80301800701C00701C00701C003018003838003FF00037C0007000007000003FF800 +1FFC003FFE00700F00E00380E00380E00380E003807007003C1E001FFC0007F00011197F8F14> +II<03 +0007800780030000000000000000007F807F800380038003800380038003800380038003800380 +03800380FFFCFFFC0E187D9714>I107 DIII<07C01FF03C78701C701CE00EE00EE00EE0 +0EE00EE00E701C783C3C781FF007C00F107E8F14>II +114 D<0FD83FF86038C038C038F0007F803FF007F8001C6006E006F006F81CFFF8CFE00F107E8F +14>I<030007000700070007007FFCFFFC07000700070007000700070007000700070E070E070E +070C03FC00F00F157F9414>IIII<7E3F007E3F001E38000E780007700007E0 +0003E00001C00003C00003E0000770000E78000E38001C1C00FE3F80FE3F8011107F8F14>II< +3FFF7FFF700E701C7038007000E001C0038007000E001C0738077007FFFFFFFF10107F8F14>I +E /Fd 1 59 df<60F0F06004047D830B>58 D E /Fe 25 122 df<078018603030303060186018 +E01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01C6018601870383030186007800E187E +9713>48 D<03000700FF0007000700070007000700070007000700070007000700070007000700 +070007000700070007000700FFF00C187D9713>I<0F80106020304038803CC01CE01C401C003C +003800380070006000C001800100020004040804100430083FF87FF8FFF80E187E9713>I<01E0 +06100C1818383038300070006000E000E7C0E860F030F018E018E01CE01CE01C601C601C701830 +183030186007C00E187E9713>54 D<40007FFE7FFC7FFC40088010801080200040004000800180 +01800100030003000300030007000700070007000700070002000F197E9813>I<078018603030 +201860186018601870103C303E600F8007C019F030F86038401CC00CC00CC00CC00C6008201018 +600FC00E187E9713>I<07801860303070306018E018E018E01CE01CE01C601C603C303C185C0F +9C001C00180018003870307060604021801F000E187E9713>I72 +D<0FC21836200E6006C006C002C002C002E00070007E003FE01FF807FC003E000E000700038003 +80038003C002C006E004D81887E0101A7E9915>83 D<3F8070C070E020700070007007F01C7030 +707070E070E071E071E0F171FB1E3C10107E8F13>97 D<07F80C1C381C30087000E000E000E000 +E000E000E0007000300438080C1807E00E107F8F11>99 D<007E00000E00000E00000E00000E00 +000E00000E00000E00000E00000E0003CE000C3E00380E00300E00700E00E00E00E00E00E00E00 +E00E00E00E00E00E00600E00700E00381E001C2E0007CFC0121A7F9915>I<07C01C3030187018 +600CE00CFFFCE000E000E000E0006000300438080C1807E00E107F8F11>I<0FCE187330307038 +703870387038303018602FC02000600070003FF03FFC1FFE600FC003C003C003C0036006381C07 +E010187F8F13>103 DI<18003C003C001800000000000000000000000000FC00 +1C001C001C001C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A>I110 D<07E01C38300C700E6006E007E007E007E007E007E00760 +06700E381C1C3807E010107F8F13>II114 D<1F2060E04020C020C020F0007F003FC01FE000F0807080 +30C030C020F0408F800C107F8F0F>I<0400040004000C000C001C003C00FFC01C001C001C001C +001C001C001C001C001C201C201C201C201C200E4003800B177F960F>I118 D120 DI E /Ff 2 42 +df<007000E001C00380078007000E001E001E003C003C003C0078007800780078007000F000F0 +00F000F000F000F000F000F000F000F000F000F000700078007800780078003C003C003C001E00 +1E000E0007000780038001C000E000700C2E7EA112>40 DI E /Fg 25 123 df<0007F800007FFC0001FC0E0003F01F0007E03F000FC03F000F +C03F000FC03F000FC01E000FC00C000FC000000FC000000FC0FF80FFFFFF80FFFFFF800FC01F80 +0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F +800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F807FF8FFF07FF8FFF01C23 +7FA220>12 D<000FFF80007FFF8001FC1F8003F03F8007E03F800FC03F800FC01F800FC01F800F +C01F800FC01F800FC01F800FC01F800FC01F80FFFFFF80FFFFFF800FC01F800FC01F800FC01F80 +0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F +800FC01F800FC01F800FC01F800FC01F800FC01F807FF8FFF07FF8FFF01C237FA220>I<07FE00 +001FFF80003F07E0003F03F0003F01F0003F01F8001E01F8000001F8000001F800003FF80003FD +F8001F81F8003E01F8007C01F800F801F800F801F800F801F800F801F8007C02F8007E0CF8001F +F87F8007E03F8019167E951C>97 DI<00FF8007FFE00F83F01F03F03E03F07E03F07C01E07C0000FC0000FC0000FC0000 +FC0000FC0000FC00007C00007E00007E00003F00301F00600FC0E007FF8000FE0014167E9519> +I<0001FF000001FF0000003F0000003F0000003F0000003F0000003F0000003F0000003F000000 +3F0000003F0000003F0000003F0000FE3F0007FFBF000FC1FF001F007F003E003F007E003F007C +003F007C003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F007C003F00 +7E003F003E003F001F007F000F81FF0007FF3FE001FC3FE01B237EA220>I<00FE0007FF800F83 +C01F01E03E00F07E00F07C00F87C0078FC0078FFFFF8FFFFF8FC0000FC0000FC00007C00007C00 +003E00183E00181F00300F80E003FFC000FF0015167E951A>I<00FE0F8003FF9FC00F83E3C01F +01F3C01E00F0003E00F8003E00F8003E00F8003E00F8003E00F8001E00F0001F01F0000F83E000 +0BFF800008FE000018000000180000001C0000001FFFE0001FFFFC000FFFFF0007FFFF001FFFFF +807C001FC078000FC0F80007C0F80007C0F80007C07C000F803E001F001F807E000FFFFC0001FF +E0001A217F951D>103 DI<1E003F007F807F807F807F803F001E00000000000000000000000000FF80FF801F801F801F +801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80FFF0FFF00C247EA3 +0F>I107 +DI< +FF03F803F800FF0FFE0FFE001F183F183F001F201F201F001F401FC01F801F401FC01F801F801F +801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80 +1F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F +801F80FFF0FFF0FFF0FFF0FFF0FFF02C167D9531>II< +00FF0007FFE00F81F01F00F83E007C7C003E7C003E7C003EFC003FFC003FFC003FFC003FFC003F +FC003FFC003F7C003E7E007E3E007C1F00F80F81F007FFE000FF0018167E951D>II114 D<07F9801FFF80380780700380F00180F00180F80000FF0000FFF8007FFE +003FFF001FFF8007FF80003FC0C007C0C003C0E003C0E003C0F00380FC0F00EFFE00C3F8001216 +7E9517>I<00C00000C00000C00000C00001C00001C00003C00007C0000FC0001FC000FFFF00FF +FF000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC1800F +C1800FC1800FC1800FC18007C18007E30003FE0000FC0011207F9F16>IIIIII<7FFFE07FFFE0780FC0701FC0601F80E03F00 +C07F00C07E00C0FC0001FC0001F80003F00007F03007E0300FC0301FC0701F80703F00607F00E0 +7E03E0FFFFE0FFFFE014167E9519>I E /Fh 22 119 df<00E00000E00000E00000E00040E040 +F0E1E0F8E3E07EEFC01FFF0007FC0003F80007FC001FFF007EEFC0F8E3E0F0E1E040E04000E000 +00E00000E00000E00013157D991A>42 D<003800007C00007C00006C0000EE0000EE0000EE0000 +EE0000C60001C70001C70001C70001C7000383800383800383800383800783C00701C007FFC007 +FFC007FFC00E00E00E00E00E00E00E00E01C00707F83FCFF83FE7F83FC171E7F9D1A>65 +D<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C0E001C0E001C0E00000E00000E07000E07000E07 +000FFF000FFF000FFF000E07000E07000E07000E00000E00000E00000E000E0E000E0E000E0E00 +0E0E000E7FFFFEFFFFFE7FFFFE171E7F9D1A>69 D +72 DI78 D<0FFE003FFF807FFFC07C07C07001C0F001E0E000E0E000E0E000E0E000E0E000E0E000E0 +E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0F001E0F001E0 +7001C07C07C07FFFC03FFF800FFE00131E7D9D1A>I82 D<03F1C00FFDC03FFFC07C0FC07003C0E003C0E001C0E001C0E001C0E00000700000780000 +3F00001FF00007FE0000FF00000F800003C00001C00000E00000E06000E0E000E0E000E0E001C0 +F001C0FC0780FFFF80EFFE00E3F800131E7D9D1A>I<7FFFFEFFFFFEFFFFFEE0380EE0380EE038 +0EE0380EE0380E0038000038000038000038000038000038000038000038000038000038000038 +0000380000380000380000380000380000380000380000380003FF8007FFC003FF80171E7F9D1A +>I89 D<7FFFC0FFFFE0FFFFE07FFFC013047D7E1A +>95 D<1FF0003FFC007FFE00780F00300700000380000380007F8007FF801FFF803F8380780380 +700380E00380E00380E00380700780780F803FFFFC1FFDFC07F0FC16157D941A>97 +D<00FF8003FFC00FFFE01F01E03C00C0780000700000700000E00000E00000E00000E00000E000 +007000007000007800703C00701F01F00FFFE003FFC000FE0014157D941A>99 +D<001FC0001FC0001FC00001C00001C00001C00001C00001C00001C001F1C007FDC00FFFC01E0F +C03C07C07803C07001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C07003C07003C03807 +C03E0FC01FFFFC07FDFC01F1FC161E7E9D1A>I +104 D<01C00003E00003E00003E00001C0000000000000000000000000000000007FE000FFE000 +7FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000 +00E00000E00000E000FFFFC0FFFFC0FFFFC0121F7C9E1A>I110 D<01F00007FC001FFF003E0F803C07807803C07001 +C0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF0007FC +0001F00013157D941A>I114 D<00C00001C00001C00001C00001C00001C00001C0007FFFE0FFFFE0FFFFE001C00001 +C00001C00001C00001C00001C00001C00001C00001C00001C00001C07001C07001C07001C07000 +E0E000FFE0007FC0001F00141C7F9B1A>116 D<7FC7FCFFC7FE7FC7FC0E00E00E00E00F01E007 +01C00701C00783C003838003838003838001C70001C70001C70000EE0000EE0000EE00007C0000 +7C0000380017157F941A>118 D E /Fi 41 123 df<0003FC00003FFE00007E070001F80F8003 +F01F8003E01F8007E01F8007E01F8007E01F8007E0060007E0000007E0000007E0000007E0FFC0 +FFFFFFC0FFFFFFC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00F +C007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E0 +0FC007E00FC007E00FC07FFC7FFC7FFC7FFC1E267FA522>12 D<3C7EFFFFFFFF7E3C08087C8711 +>46 D<001C00003C0000FC00FFFC00FFFC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00 +00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00 +00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC007FFFFC7FFFFC16237CA21F>49 +D<01FF0007FFC01E07F03803F86001FC7C00FEFE00FEFE00FFFE007FFE007F7C007F3800FF0000 +FF0000FE0000FE0001FC0001F80003F00007E0000780000F00001E00003C0000700000E00301C0 +030380070700060600060FFFFE1FFFFE3FFFFE7FFFFCFFFFFCFFFFFC18237DA21F>I<01FF0007 +FFE01E03F03801F83C01FC7E00FE7E00FE7E00FE3E00FE1C01FE0001FC0001FC0003F80007F000 +0FC001FF0001FF000007E00001F00001F80000FC0000FE0000FF0000FF1000FF7C00FFFE00FFFE +00FFFE00FEFE00FE7C01FC7001F83E07F00FFFC001FF0018237DA21F>I<000038000000780000 +0078000000F8000001F8000003F8000007F8000006F800000CF800001CF8000038F8000030F800 +0060F80000E0F80001C0F8000180F8000300F8000700F8000E00F8001C00F8001800F8003000F8 +007000F800E000F800FFFFFFC0FFFFFFC00001F8000001F8000001F8000001F8000001F8000001 +F8000001F800007FFFC0007FFFC01A237EA21F>I<18000C1F007C1FFFF81FFFF01FFFE01FFFC0 +1FFF801FFE0018000018000018000018000018000018FF001BFFE01F01F01C00F80800FC00007E +00007E00007E00007F00007F78007FFC007FFC007FFC007FFC007EF8007E6000FC7000FC3801F8 +1E07E007FFC001FE0018237DA21F>I<001FC0007FF001F83803E00C07803E0F807E1F007E3F00 +7E3F007E7E003C7E00007E00007E0000FE3FC0FE7FF0FE80F8FF80FCFF007CFF007EFE007EFE00 +7FFE007FFE007FFE007F7E007F7E007F7E007F7E007F3E007E3F007E1F007C0F80F807C1F003FF +C0007F0018237DA21F>I<300000003C0000003FFFFFC03FFFFFC03FFFFF807FFFFF007FFFFE00 +7FFFFC006000180060001800E0003000C0006000C000C000000180000001800000030000000700 +0000060000000E0000001E0000001E0000001E0000003C0000003C0000007C0000007C0000007C +0000007C000000FC000000FC000000FC000000FC000000FC000000FC000000FC00000078000000 +3000001A257DA41F>I<00001C00000000001C00000000003E00000000003E00000000003E0000 +0000007F00000000007F0000000000FF8000000000FF8000000000FF80000000019FC000000001 +9FC0000000031FE0000000030FE0000000030FE00000000607F00000000607F00000000C07F800 +00000C03F80000001C03FC0000001801FC0000001801FC0000003001FE0000003000FE0000007F +FFFF0000007FFFFF00000060007F000000C0007F800000C0003F800001C0003FC0000180001FC0 +000180001FC0000300000FE0000300000FE0000780000FF000FFF801FFFF80FFF801FFFF802925 +7EA42E>65 D +68 DI< +FFFFFFFE00FFFFFFFE0003F800FE0003F8001F0003F8000F0003F800070003F800070003F80003 +0003F800030003F800030003F800018003F806018003F806018003F806000003F806000003F80E +000003F81E000003FFFE000003FFFE000003F81E000003F80E000003F806000003F806000003F8 +06000003F806000003F800000003F800000003F800000003F800000003F800000003F800000003 +F800000003F800000003F800000003F8000000FFFFF00000FFFFF0000021257EA427>I72 +DI +76 DI<00FF0080 +07FFE3800F80F7801E001F803C000F807800078078000380F8000380F8000180F8000180FC0001 +80FC000000FF0000007FE000007FFF00003FFFE0003FFFF8001FFFFE0007FFFF0003FFFF80007F +FF800003FFC000003FC000000FE0000007E0000007E0C00003E0C00003E0C00003E0C00003C0E0 +0003C0F00007C0F8000780FC000F00FFC03E00E3FFF800803FE0001B257DA422>83 +D87 +D<07FF00001FFFC0003E03E0003F01F0003F01F8003F00FC001E00FC000000FC000000FC000000 +FC00003FFC0003FCFC000FC0FC003F00FC007E00FC007E00FC00FC00FC00FC00FC00FC00FC00FC +017C007E017C003F067C001FFC3FE007F01FE01B187E971E>97 DI<007FE003FFF807C07C +1F80FC1F00FC3F00FC7E00787E0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000 +7E00007F00003F000C1F800C1FC01807E07003FFE0007F0016187E971B>I<0001FF800001FF80 +00001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F +8000001F8000001F80007F1F8003FFDF8007E0FF801F803F803F001F803F001F807E001F807E00 +1F80FE001F80FE001F80FE001F80FE001F80FE001F80FE001F80FE001F80FE001F807E001F807E +001F803F001F803F003F801F807F800FC0FF8003FF9FF800FE1FF81D267EA522>I<007F0003FF +C007C1F00F80F81F00F83F007C7E007C7E007EFE007EFE007EFFFFFEFFFFFEFE0000FE0000FE00 +007E00007E00007E00063F00061F000C0F801807E07003FFE0007F8017187E971C>I<000FC000 +7FF000F8F001F1F803F1F803E1F807E0F007E00007E00007E00007E00007E00007E00007E000FF +FF00FFFF0007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007 +E00007E00007E00007E00007E00007E00007E00007E00007E0007FFF007FFF0015267EA513>I< +01FF07C007FFDFE00F83F1E01F01F1E03E00F8007E00FC007E00FC007E00FC007E00FC007E00FC +007E00FC003E00F8001F01F0000F83E0000FFFC00011FF00003000000030000000380000003C00 +00003FFFE0001FFFFC001FFFFE000FFFFF001FFFFF803C003F8078000FC0F80007C0F80007C0F8 +0007C0F80007C07C000F803E001F001F807E0007FFF80000FFC0001B247E971F>II<0F00 +1F803FC03FC03FC03FC01F800F000000000000000000000000000000FFC0FFC00FC00FC00FC00F +C00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFF8FFF80D27 +7EA611>I108 DII<007F800003FFF0 +0007C0F8001F807E003F003F003F003F007E001F807E001F80FE001FC0FE001FC0FE001FC0FE00 +1FC0FE001FC0FE001FC0FE001FC0FE001FC07E001F807E001F803F003F003F003F001F807E000F +C0FC0003FFF000007F80001A187E971F>II114 D<07F9801FFF803C0F80700380F00180F00180F00180FC0000FF8000 +7FFC007FFE003FFF800FFFC003FFC0001FE00003E0C001E0C001E0E001E0E001C0F003C0FC0780 +EFFF00C3FC0013187E9718>I<00600000600000600000600000E00000E00001E00001E00003E0 +0007E0001FE000FFFFC0FFFFC007E00007E00007E00007E00007E00007E00007E00007E00007E0 +0007E00007E00007E00007E06007E06007E06007E06007E06007E06003E0C003F0C001FF80007E +0013237FA218>III120 DI<3FFF +F83FFFF83E03F03807F0300FE0700FC0701F80603F80603F00607E0000FE0000FC0001F80003F8 +1803F01807E0180FE0180FC0381F80303F80707F00707E01F0FFFFF0FFFFF015187E971B>I +E /Fj 29 122 df<0003F07C001E0DC600380F0F00701E0F00E01E0E00E00C0001C01C0001C01C +0001C01C0001C01C0001C01C00038038007FFFFFC0038038000380380003803800038038000700 +700007007000070070000700700007007000070070000E00E0000E00E0000E00E0000E00E0000E +00E0000E00E0001C01C0001E01E000FF8FFE0020207E9F1B>11 D<0003E0001C1800381800703C +00E03C00E03801C00001C00001C00001C00001C0000380007FFFF0038070038070038070038070 +0700E00700E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01C00E01C01C0380 +1E03C0FF0FF816207E9F19>I<0003F03F00001E09E08000380F80C000701F01E000E03E01E000 +E01E01C001C01C000001C01C000001C01C000001C01C000001C01C000003803800007FFFFFFF80 +038038038003803803800380380380038038038007007007000700700700070070070007007007 +00070070070007007007000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E0 +0E001C01C01C001E01E01E00FF8FF8FFC023207E9F26>14 D<0020000060000060000060000060 +007061C03843800E4E0007580001E00001E00006B8001C9C00708700E083800180000180000180 +0001800001000012147AA117>42 D45 D<000C001C00FC0F3800380038 +00380038003800700070007000700070007000E000E000E000E000E000E001C001C001C001C001 +C001C0038003C0FFFE0F1E7C9D17>49 D<003F8000C1E00100F00200780400780400780F007C0F +807C0F807C0F00780600780000F80000F00001E00001C0000380000700000E00001C0000380000 +600000C0000180000300200600200800401000403FFFC07FFF80FFFF80161E7E9D17>I<07F800 +0C0C001E06001E07001C070000070000070000070000FF0007C7001E07003C0E00780E00F00E10 +F00E10F00E10F01E10F02E20784F401F878014147D9317>97 D<01FC07060E0F1C0F380E780070 +00F000F000F000F000E000E000E000E000F0027004300818300FC010147C9314>99 +D<0000700003F00000F00000700000700000E00000E00000E00000E00000E00000E00001C000F9 +C00305C00E03C01C03C03801C0780380700380F00380F00380F00380F00380E00700E00700E007 +00E00700E00700700F00301E00186F000F8FE014207C9F19>I<00F800070E000E07001C070038 +0380780380700380F00380F00380FFFF80F00000E00000E00000E00000E00000F0010070020030 +04001C180007E00011147D9314>I<0007800018C00031E00061E000E1C000C00001C00001C000 +01C00001C00001C0000380007FF800038000038000038000038000070000070000070000070000 +0700000700000E00000E00000E00000E00000E00000E00001C00001E0000FFE00013207E9F0E> +I<00000E003E1100E1A301C1C20381E00780E00701E00F01E00F01E00F01E00703C00703800787 +0004FC000800000800001800001C00000FFF000FFFC007FFE01800F0300030600030C00030C000 +30C000306000603000C01C070007FC00181F809417>I<00E00007E00001E00000E00000E00001 +C00001C00001C00001C00001C00001C000038000038F800390E003A0E003C0600380600780E007 +00E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01C00E01C01C03801E03C0FF +CFF815207E9F19>I<01C003E003E003C0018000000000000000000000000003801F8007800380 +03800700070007000700070007000E000E000E000E000E000E001C001E00FF800B1F7F9E0C>I< +00E007E001E000E000E001C001C001C001C001C001C00380038003800380038003800700070007 +000700070007000E000E000E000E000E000E001C001E00FFC00B207F9F0C>108 +D<0387C07C001F9861860007A072070003C0340300038038030007807807000700700700070070 +07000700700700070070070007007007000E00E00E000E00E00E000E00E00E000E00E00E000E00 +E00E000E00E00E001C01C01C001E01E01E00FFCFFCFFC022147E9326>I<038F801F90E007A0E0 +03C0600380600780E00700E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01C0 +0E01C01C03801E03C0FFCFF815147E9319>I<00FC000387000E01801C00C03800E03800E07000 +F0F000F0F000F0F000F0F000F0E001E0E001E0E001C0E003C0F00380700700380E001C1C0007E0 +0014147D9317>I<00E3E007EC3800F01C00E01E00E00E01C00E01C00F01C00F01C00F01C00F01 +C00F03801E03801E03801C03803C0380380380700740E00721C0071F000700000700000700000E +00000E00000E00000E00001E0000FFC000181D809319>I<00F040038CC00E04C01C03C03C03C0 +780380780380F00380F00380F00380F00380E00700E00700E00700F00700F00F00700F00301E00 +186E000F8E00000E00000E00000E00001C00001C00001C00001C00003C0001FF80121D7C9318> +I<038E001FB38007C78003C7800383000780000700000700000700000700000700000E00000E00 +000E00000E00000E00000E00001C00001E0000FFE00011147E9312>I<01F2060E080618061802 +380438001E001FE00FF003F8003C401C400C400C600C6018E010D0608FC00F147E9312>I<0080 +010001000100030007000F001E00FFF80E000E000E000E001C001C001C001C001C001C00380038 +203820382038203840384018800F000D1C7C9B12>I<1C0380FC1F803C07801C03801C03803807 +00380700380700380700380700380700700E00700E00700E00700E00701E00701E00703C00305E +001F9FC012147B9319>II< +FF9FE1FC3E0780701C0300601C0300401C0380401C0380800E0780800E0581000E0981000E09C2 +000E11C2000731C4000721C4000760C8000740C8000780F0000780F0000300E000030060000200 +40001E147C9321>I<1FF0FF03C07801C06001C04000E08000E180007300007600003C00003C00 +001C00002E00004E000087000107000203800603800C01C03E03E0FF07FC18147F9318>I<0FF8 +3F8001E00E0001C00C0001C0080000E0180000E0100000E0200000E0200000F040000070400000 +708000007080000071000000390000003A0000003E0000003C0000003800000018000000100000 +0010000000200000002000000040000070C00000F0800000F1000000E20000007C000000191D80 +9318>I E /Fk 36 122 df<0001C0000003C000000FC000007FC0001FFFC000FFFFC000FFBFC0 +00E03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003F +C000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00000 +3FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000 +003FC000003FC000003FC000003FC000003FC000003FC000003FC0007FFFFFE07FFFFFE07FFFFF +E01B2E7AAD28>49 D<003FE00001FFFE0007FFFF800F80FFC01E003FE038001FF07C000FF87E00 +07FCFF0007FCFF8007FEFF8007FEFF8003FEFF8003FE7F0003FE3E0007FE000007FE000007FC00 +0007FC00000FF800000FF800000FF000001FE000001FC000003F8000007F0000007E000000F800 +0001F0000003E0000007C000000F0000001E000E003C000E0038000E0070001E00E0001C01C000 +1C0300003C07FFFFFC0FFFFFFC1FFFFFFC3FFFFFFC7FFFFFF8FFFFFFF8FFFFFFF8FFFFFFF81F2E +7CAD28>I<0000007800000000000078000000000000FC000000000000FC000000000000FC0000 +00000001FE000000000001FE000000000003FF000000000003FF000000000007FF800000000007 +FF800000000007FF80000000000FFFC0000000000E7FC0000000001E7FE0000000001C3FE00000 +00001C3FE000000000383FF000000000381FF000000000781FF800000000700FF800000000700F +F800000000E00FFC00000000E007FC00000001E007FE00000001C003FE00000001C003FE000000 +038003FF000000038001FF000000078001FF800000070000FF800000070000FF8000000FFFFFFF +C000000FFFFFFFC000001FFFFFFFE000001C00003FE000003C00003FF000003800001FF0000038 +00001FF000007000001FF800007000000FF80000F000000FFC0000E0000007FC0000E0000007FC +0001C0000007FE0003E0000003FE00FFFF8001FFFFFCFFFF8001FFFFFCFFFF8001FFFFFC36317D +B03D>65 DI<000003FF80018000003FFFF003800001FFFFFC07800007FF003F0F80001FF800079F80 +003FC00001FF8000FF800000FF8001FE0000007F8003FC0000003F8007FC0000001F8007F80000 +000F800FF00000000F801FF000000007801FF000000007803FE000000007803FE000000003807F +E000000003807FE000000003807FC000000000007FC00000000000FFC00000000000FFC0000000 +0000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0 +0000000000FFC000000000007FC000000000007FC000000000007FE000000000007FE000000003 +803FE000000003803FE000000003801FF000000003801FF000000007800FF0000000070007F800 +0000070007FC0000000E0003FC0000001E0001FE0000001C0000FF8000007800003FC00000F000 +001FF80003E0000007FF003F80000001FFFFFE000000003FFFF80000000003FF80000031317CB0 +3A>I70 +D<000003FF00030000007FFFF007000001FFFFFC0F000007FF007E1F00001FF0000FBF00007FC0 +0003FF0000FF800001FF0001FE0000007F0003FC0000007F0007FC0000003F000FF80000001F00 +0FF00000001F001FF00000000F001FF00000000F003FE000000007003FE000000007007FE00000 +0007007FE000000007007FC00000000000FFC00000000000FFC00000000000FFC00000000000FF +C00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0000000 +0000FFC00000000000FFC00007FFFFFC7FC00007FFFFFC7FE00007FFFFFC7FE0000001FF003FE0 +000001FF003FE0000001FF001FF0000001FF001FF0000001FF000FF0000001FF000FF8000001FF +0007FC000001FF0003FC000001FF0001FE000001FF0000FF800001FF00007FC00003FF00001FF8 +00077F000007FF003E3F000001FFFFFC1F0000007FFFF00F00000003FF80030036317CB03F>I< +FFFFFF807FFFFFC0FFFFFF807FFFFFC0FFFFFF807FFFFFC000FF8000007FC00000FF8000007FC0 +0000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007F +C00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF800000 +7FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000 +007FC00000FF8000007FC00000FF8000007FC00000FFFFFFFFFFC00000FFFFFFFFFFC00000FFFF +FFFFFFC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF +8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000 +FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC000 +00FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC0 +0000FF8000007FC00000FF8000007FC000FFFFFF807FFFFFC0FFFFFF807FFFFFC0FFFFFF807FFF +FFC03A317EB03F>II78 D80 D<7FFFFFFFFFFF007FFFFFFFFFFF007FFFFFFFFFFF007F +C00FF801FF007E000FF8003F007C000FF8001F0078000FF8000F0078000FF8000F0070000FF800 +0700F0000FF8000780F0000FF8000780F0000FF8000780E0000FF8000380E0000FF8000380E000 +0FF8000380E0000FF8000380E0000FF800038000000FF800000000000FF800000000000FF80000 +0000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000F +F800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF8000000 +00000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF8 +00000000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000 +000FF800000000000FF800000000000FF8000000007FFFFFFF0000007FFFFFFF0000007FFFFFFF +000031307DAF38>84 DII<00FFF0000003FFFE00000F803F80000FC00FE0001F +E007F0001FE007F0001FE003F8000FC003FC00078003FC00000003FC00000003FC00000003FC00 +000003FC000000FFFC00001FFFFC0000FFE3FC0003FC03FC000FF003FC001FC003FC003FC003FC +007F8003FC007F8003FC00FF0003FC00FF0003FC00FF0003FC00FF0007FC00FF0007FC007F800D +FC003FC019FE001FE070FFF007FFE07FF000FF803FF024207E9F27>97 D<01F8000000FFF80000 +00FFF8000000FFF80000000FF800000007F800000007F800000007F800000007F800000007F800 +000007F800000007F800000007F800000007F800000007F800000007F800000007F800000007F8 +00000007F83FE00007F8FFFC0007FBE07F0007FF001F8007FE000FC007FC000FE007F80007F007 +F80007F807F80007F807F80003FC07F80003FC07F80003FC07F80003FE07F80003FE07F80003FE +07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FC07F80003FC07F80003 +FC07F80007F807F80007F807F80007F007FC000FE007FE000FC007E7003F8007C3C0FE000780FF +F80007003FC00027327EB12D>I<000FFF00007FFFC001FC01F003F003F007E007F80FE007F81F +C007F83FC003F03FC001E07F8000007F8000007F800000FF800000FF800000FF800000FF800000 +FF800000FF800000FF800000FF8000007F8000007F8000007F8000003FC0001C3FC0001C1FC000 +380FE0003807E0007003F001E001FC07C0007FFF00000FF8001E207D9F24>I<0000000FC00000 +07FFC0000007FFC0000007FFC00000007FC00000003FC00000003FC00000003FC00000003FC000 +00003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC0 +0000003FC00007F83FC0003FFF3FC000FE07BFC003F801FFC007E0007FC00FE0007FC01FC0003F +C03FC0003FC03FC0003FC07F80003FC07F80003FC07F80003FC0FF80003FC0FF80003FC0FF8000 +3FC0FF80003FC0FF80003FC0FF80003FC0FF80003FC0FF80003FC07F80003FC07F80003FC07F80 +003FC03FC0003FC03FC0003FC01FC0003FC00FE0007FC007E000FFC003F003FFE001FC0F3FFE00 +7FFE3FFE000FF03FFE27327DB12D>I<000FFC00007FFF8001FC0FC003F003E007E001F00FE001 +F81FC000FC3FC000FE3FC000FE7F80007E7F80007F7F80007FFF80007FFF80007FFFFFFFFFFFFF +FFFFFF800000FF800000FF800000FF8000007F8000007F8000007F8000003FC000071FC000071F +C0000E0FE0000E07F0001C03F8007800FE03E0003FFFC00007FE0020207E9F25>I<0001FE0000 +0FFF80001FC3C0007F07E000FE0FF001FE0FF001FC0FF003FC0FF003FC07E003FC018003FC0000 +03FC000003FC000003FC000003FC000003FC000003FC000003FC0000FFFFFC00FFFFFC00FFFFFC +0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC +000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003 +FC000003FC000003FC000003FC000003FC000003FC000003FC00007FFFF0007FFFF0007FFFF000 +1C327EB119>I<001FF007C000FFFE3FE001F83F79F007E00FC3F00FE00FE1F00FC007E0E01FC0 +07F0001FC007F0003FC007F8003FC007F8003FC007F8003FC007F8003FC007F8001FC007F0001F +C007F0000FC007E0000FE00FE00007E00FC00003F83F000006FFFE00000E1FF000000E00000000 +1E000000001E000000001F000000001F800000001FFFFF80000FFFFFF0000FFFFFFC0007FFFFFE +0003FFFFFF0003FFFFFF800FFFFFFFC01F00007FC07E00001FE07C00000FE0FC000007E0FC0000 +07E0FC000007E0FC000007E07E00000FC03E00000F803F00001F800FC0007E0007F803FC0001FF +FFF000001FFF0000242F7E9F28>I<01F8000000FFF8000000FFF8000000FFF80000000FF80000 +0007F800000007F800000007F800000007F800000007F800000007F800000007F800000007F800 +000007F800000007F800000007F800000007F800000007F800000007F807F80007F83FFE0007F8 +783F0007F8C03F8007F9801FC007FB001FC007FE001FE007FC001FE007FC001FE007FC001FE007 +F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE0 +07F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001F +E007F8001FE007F8001FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF28327DB12D>I<03 +C00007E0000FF0001FF8001FF8001FF8001FF8000FF00007E00003C00000000000000000000000 +000000000000000000000000000000000001F800FFF800FFF800FFF8000FF80007F80007F80007 +F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007 +F80007F80007F80007F80007F80007F80007F80007F80007F800FFFF80FFFF80FFFF8011337DB2 +17>I<01F800FFF800FFF800FFF8000FF80007F80007F80007F80007F80007F80007F80007F800 +07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 +07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 +07F80007F80007F80007F80007F80007F80007F80007F80007F800FFFFC0FFFFC0FFFFC012327D +B117>108 D<03F007F8001FE000FFF03FFE00FFF800FFF0783F01E0FC00FFF0C03F8300FE000F +F1801FC6007F0007F3001FCC007F0007F6001FF8007F8007FC001FF0007F8007FC001FF0007F80 +07FC001FF0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F +8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE000 +7F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0 +007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001F +E0007F80FFFFC3FFFF0FFFFCFFFFC3FFFF0FFFFCFFFFC3FFFF0FFFFC3E207D9F43>I<03F007F8 +00FFF03FFE00FFF0783F00FFF0C03F800FF1801FC007F3001FC007F6001FE007FC001FE007FC00 +1FE007FC001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8 +001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007 +F8001FE007F8001FE007F8001FE007F8001FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF +28207D9F2D>I<0007FC0000007FFFC00001FC07F00003F001F80007E000FC000FC0007E001FC0 +007F003FC0007F803F80003F807F80003FC07F80003FC07F80003FC0FF80003FE0FF80003FE0FF +80003FE0FF80003FE0FF80003FE0FF80003FE0FF80003FE0FF80003FE07F80003FC07F80003FC0 +7F80003FC03FC0007F803FC0007F801FC0007F000FE000FE0007E000FC0003F803F80001FE0FF0 +00007FFFC0000007FC000023207E9F28>I<01F83FE000FFF8FFFC00FFFBE07F00FFFF003F8007 +FE001FC007FC000FE007F8000FF007F80007F807F80007F807F80007FC07F80003FC07F80003FC +07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003 +FE07F80003FC07F80007FC07F80007FC07F80007F807F80007F807F8000FF007FC000FE007FE00 +1FC007FF003F8007FBC0FE0007F8FFF80007F83FC00007F800000007F800000007F800000007F8 +00000007F800000007F800000007F800000007F800000007F800000007F800000007F8000000FF +FFC00000FFFFC00000FFFFC00000272E7E9F2D>I<03F03F00FFF07FC0FFF1C3E0FFF187E00FF3 +0FF007F60FF007F60FF007FC07E007FC03C007FC000007FC000007F8000007F8000007F8000007 +F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F80000 +07F8000007F8000007F8000007F8000007F80000FFFFE000FFFFE000FFFFE0001C207E9F21> +114 D<01FF860007FFFE001F00FE003C003E0078001E0078000E00F8000E00F8000E00F8000E00 +FC000000FF800000FFFC00007FFFC0007FFFF0003FFFF8001FFFFC0007FFFE0001FFFF00003FFF +000000FF8000003F8060001F80E0000F80E0000F80F0000F80F0000F00F8000F00FC001E00FE00 +1C00FF807800F3FFF000C07F800019207D9F20>I<001C0000001C0000001C0000001C0000001C +0000003C0000003C0000003C0000007C0000007C000000FC000001FC000003FC000007FC00001F +FFFE00FFFFFE00FFFFFE0003FC000003FC000003FC000003FC000003FC000003FC000003FC0000 +03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC03 +8003FC038003FC038003FC038003FC038003FC038003FC038001FC038001FC070000FE0700007F +0E00003FFC000007F000192E7FAD1F>I<01F80007E0FFF803FFE0FFF803FFE0FFF803FFE00FF8 +003FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007 +F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE0 +07F8001FE007F8001FE007F8001FE007F8001FE007F8003FE007F8003FE003F8007FE003F8007F +E001FC00DFF000FE039FFF007FFF1FFF000FFC1FFF28207D9F2D>II< +FFFF1FFFE07FF8FFFF1FFFE07FF8FFFF1FFFE07FF80FF000FE0007800FF800FE00078007F800FE +00070007F8007F00070003FC007F000E0003FC00FF800E0003FE00FF801E0001FE00FF801C0001 +FE01DFC01C0001FF01DFC03C0000FF03DFE0380000FF838FE07800007F838FE07000007F8707F0 +7000007FC707F0F000003FCF07F8E000003FCE03F8E000001FEE03F9C000001FFC01FDC000001F +FC01FFC000000FFC01FF8000000FF800FF80000007F800FF00000007F0007F00000007F0007F00 +000003F0007E00000003E0003E00000001E0003C00000001C0001C000035207E9F3A>I<7FFF80 +7FFC7FFF807FFC7FFF807FFC03FE000F0001FE001E0000FF003C0000FF807800007FC07800003F +E0F000001FE1E000000FF3C000000FFF80000007FF00000003FE00000001FE00000000FF000000 +00FF80000000FFC0000001FFC0000003DFE00000078FF00000078FF800000F07FC00001E03FC00 +003C01FE00007800FF0000F000FF8000E0007FC001E0003FC0FFFC01FFFFFFFC01FFFFFFFC01FF +FF28207F9F2B>II E /Fl 1 14 df<0001FE00000007FF8000001E01E000007800780000 +E0001C000180000600030000030006000001800C000000C00C000000C018000000603000000030 +30000000303000000030600000001860000000186000000018C00000000CC00000000CC0000000 +0CC00000000CC00000000CC00000000CC00000000CC00000000CC00000000C6000000018600000 +0018600000001830000000303000000030300000003018000000600C000000C00C000000C00600 +0001800300000300018000060000E0001C000078007800001E01E0000007FF80000001FE000026 +2B7DA02D>13 D E /Fm 46 122 df<3C007F00FF80FF80FFC0FFC0FFC07FC03EC000C000C00180 +018001800300030006000E001C00380030000A157B8813>44 D<1C007F007F00FF80FF80FF807F +007F001C0009097B8813>46 D<000E00001E00007E0007FE00FFFE00FFFE00F8FE0000FE0000FE +0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE +0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE +0000FE007FFFFE7FFFFE7FFFFE17277BA622>49 D<00FF800007FFF0000FFFFC001E03FE003800 +FF807C003F80FE003FC0FF001FC0FF001FE0FF000FE0FF000FE07E000FE03C001FE000001FE000 +001FC000001FC000003F8000003F0000007E000000FC000000F8000001F0000003E00000078000 +000F0000001E0000003C00E0007000E000E000E001C001C0038001C0060001C00FFFFFC01FFFFF +C03FFFFFC07FFFFFC0FFFFFF80FFFFFF80FFFFFF801B277DA622>I<007F800003FFF00007FFFC +000F80FE001F007F003F807F003F803F803F803F803F803F801F803F801F003F8000007F000000 +7F0000007E000000FC000001F8000007F00000FFC00000FFC0000001F80000007E0000003F0000 +003F8000001FC000001FC000001FE000001FE03C001FE07E001FE0FF001FE0FF001FE0FF001FC0 +FF003FC0FE003F807C007F003F00FE001FFFFC0007FFF00000FF80001B277DA622>I<00000E00 +00001E0000003E0000007E000000FE000000FE000001FE000003FE0000077E00000E7E00000E7E +00001C7E0000387E0000707E0000E07E0000E07E0001C07E0003807E0007007E000E007E000E00 +7E001C007E0038007E0070007E00E0007E00FFFFFFF8FFFFFFF8FFFFFFF80000FE000000FE0000 +00FE000000FE000000FE000000FE000000FE000000FE00007FFFF8007FFFF8007FFFF81D277EA6 +22>I<180003001F801F001FFFFE001FFFFC001FFFF8001FFFF0001FFFC0001FFF00001C000000 +1C0000001C0000001C0000001C0000001C0000001C0000001C7FC0001DFFF8001F80FC001E003F +0008003F0000001F8000001FC000001FC000001FE000001FE018001FE07C001FE0FE001FE0FE00 +1FE0FE001FE0FE001FC0FC001FC078003F8078003F803C007F001F01FE000FFFFC0003FFF00000 +FF80001B277DA622>I<380000003E0000003FFFFFF03FFFFFF03FFFFFF07FFFFFE07FFFFFC07F +FFFF807FFFFF0070000E0070000E0070001C00E0003800E0007000E000E0000001E0000001C000 +000380000007800000070000000F0000001F0000001E0000003E0000003E0000007E0000007C00 +00007C000000FC000000FC000000FC000000FC000001FC000001FC000001FC000001FC000001FC +000001FC000001FC000000F80000007000001C297CA822>55 D<00000780000000000780000000 +000FC0000000000FC0000000000FC0000000001FE0000000001FE0000000003FF0000000003FF0 +000000003FF00000000077F80000000077F800000000F7FC00000000E3FC00000000E3FC000000 +01C1FE00000001C1FE00000003C1FF0000000380FF0000000380FF00000007007F80000007007F +8000000F007FC000000E003FC000000E003FC000001C001FE000001C001FE000003FFFFFF00000 +3FFFFFF000003FFFFFF00000700007F80000700007F80000F00007FC0000E00003FC0000E00003 +FC0001C00001FE0001C00001FE0003C00001FF00FFFE003FFFFCFFFE003FFFFCFFFE003FFFFC2E +297EA833>65 DI<00007FE0030007FFFC07001FFFFF0F +007FF00F9F00FF0001FF01FC0000FF03F800007F07F000003F0FE000001F1FC000001F1FC00000 +0F3F8000000F3F800000077F800000077F800000077F00000000FF00000000FF00000000FF0000 +0000FF00000000FF00000000FF00000000FF00000000FF00000000FF000000007F000000007F80 +0000007F800000073F800000073F800000071FC00000071FC000000E0FE000000E07F000001C03 +F800003C01FC00007800FF0001F0007FF007C0001FFFFF800007FFFE0000007FF00028297CA831 +>I69 DI<0000 +7FE003000007FFFC0700001FFFFF0F00007FF00F9F0000FF0001FF0001FC0000FF0003F800007F +0007F000003F000FE000001F001FC000001F001FC000000F003F8000000F003F80000007007F80 +000007007F80000007007F0000000000FF0000000000FF0000000000FF0000000000FF00000000 +00FF0000000000FF0000000000FF0000000000FF0000000000FF0000FFFFF87F0000FFFFF87F80 +00FFFFF87F800000FF003F800000FF003F800000FF001FC00000FF001FC00000FF000FE00000FF +0007F00000FF0003F80000FF0001FC0000FF0000FF0001FF00007FF007FF00001FFFFF9F000007 +FFFE0F0000007FF003002D297CA835>III77 +DI80 +D82 D<00FF00C003FFE1C00FFFF9C01F80FFC03F00 +3FC03E000FC07C0007C07C0007C0FC0003C0FC0003C0FC0001C0FE0001C0FE0001C0FF000000FF +C000007FFC00007FFFE0003FFFF8001FFFFE001FFFFF0007FFFF8003FFFFC000FFFFC0000FFFE0 +00007FE000001FF000000FF0000007F0E00003F0E00003F0E00003F0E00003F0F00003E0F00003 +E0F80007E0FC0007C0FF000F80FFE01F80E3FFFF00E1FFFC00C01FF0001C297CA825>I85 DII<03FF80000FFFF0001F01FC003F80FE003F +807F003F803F003F803F801F003F8000003F8000003F8000003F8000003F80003FFF8001FC3F80 +0FE03F801F803F803F003F807E003F80FC003F80FC003F80FC003F80FC003F80FC005F807E00DF +803F839FFC1FFE0FFC03F803FC1E1B7E9A21>97 D +I<003FF00001FFFC0003F03E000FC07F001F807F003F007F003F007F007F003E007E0000007E00 +0000FE000000FE000000FE000000FE000000FE000000FE000000FE0000007E0000007E0000007F +0000003F0003803F8003801F8007000FE00E0003F83C0001FFF800003FC000191B7E9A1E>I<00 +007FF000007FF000007FF0000007F0000007F0000007F0000007F0000007F0000007F0000007F0 +000007F0000007F0000007F0000007F0000007F0003F87F001FFF7F007F03FF00FC00FF01F8007 +F03F0007F03F0007F07E0007F07E0007F07E0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE00 +07F0FE0007F0FE0007F0FE0007F07E0007F07E0007F03F0007F03F0007F01F800FF00FC01FF007 +E07FFF01FFE7FF007F87FF202A7EA925>I<003FC00001FFF00003E07C000F803E001F801F001F +001F003F000F807E000F807E000FC07E000FC0FE0007C0FE0007C0FFFFFFC0FFFFFFC0FE000000 +FE000000FE0000007E0000007E0000007F0000003F0001C01F0001C00F80038007C0070003F01E +0000FFFC00003FE0001A1B7E9A1F>I<0007F8003FFC007E3E01FC7F03F87F03F07F07F07F07F0 +3E07F00007F00007F00007F00007F00007F00007F000FFFFC0FFFFC0FFFFC007F00007F00007F0 +0007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0 +0007F00007F00007F00007F00007F0007FFF807FFF807FFF80182A7EA915>I<007F80F001FFE3 +F807C0FE1C0F807C7C1F003E7C1F003E103F003F003F003F003F003F003F003F003F003F003F00 +3F001F003E001F003E000F807C0007C0F80005FFE0000C7F8000180000001C0000001C0000001E +0000001FFFF8001FFFFF000FFFFFC007FFFFE003FFFFF00FFFFFF03E0007F07C0001F8F80000F8 +F80000F8F80000F8F80000F87C0001F07C0001F03F0007E00FC01F8007FFFF00007FF0001E287E +9A22>II<07000F801FC03FE03FE03FE01FC00F80 +07000000000000000000000000000000FFE0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00F +E00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0FFFEFFFEFFFE0F2B7EAA12>I108 DII<003FE00001FFFC0003F07E000FC01F801F800FC03F0007E03F00 +07E07E0003F07E0003F07E0003F0FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE +0003F8FE0003F87E0003F07E0003F03F0007E03F0007E01F800FC00FC01F8007F07F0001FFFC00 +003FE0001D1B7E9A22>II114 D<03FE300FFFF03E03F0 +7800F07000F0F00070F00070F80070FE0000FFE0007FFF007FFFC03FFFE01FFFF007FFF800FFF8 +0007FC0000FCE0007CE0003CF0003CF00038F80038FC0070FF01E0E7FFC0C1FF00161B7E9A1B> +I<00700000700000700000700000F00000F00000F00001F00003F00003F00007F0001FFFE0FFFF +E0FFFFE007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0 +0007F00007F07007F07007F07007F07007F07007F07007F07003F0E001F8C000FFC0003F001426 +7FA51A>II +IIII E /Fn 75 127 df<70F8F8F8F8F8F8F8F8F8F8F8 +F8F8F8F8F870000000000070F8F8F870051C779B18>33 D<4010E038F078E038E038E038E038E0 +38E038E038E038E038E03860300D0E7B9C18>I<030600078F00078F00078F00078F00078F0007 +8F007FFFC0FFFFE0FFFFE07FFFC00F1E000F1E000F1E000F1E000F1E000F1E007FFFC0FFFFE0FF +FFE07FFFC01E3C001E3C001E3C001E3C001E3C001E3C000C1800131C7E9B18>I<00C00001C000 +01C00001C00003F0000FFC003FFE007DCF0071C700E1C380E1C780E1C780E1C780F1C00079C000 +3DC0001FE0000FF80003FC0001DE0001CF0001C70061C380F1C380F1C380E1C380E1C70071C700 +79DE003FFE001FF80007E00001C00001C00001C00000C00011247D9F18>I<3803007C07807C07 +80EE0F80EE0F00EE0F00EE1F00EE1E00EE1E00EE3E007C3C007C3C00387C0000780000780000F8 +0000F00001F00001E00001E00003E00003C00003C00007C0000783800787C00F87C00F0EE00F0E +E01F0EE01E0EE01E0EE03E0EE03C07C03C07C018038013247E9F18>I<01C00007E0000FF0000E +70001C38001C38001C38001C38001C73F01C73F01CE3F00FE3800FC7000F87000F07001F0E003F +0E007B8E0073DC00E1DC00E0F800E0F800E07070E0787070FC707FFFE03FCFE00F03C0141C7F9B +18>I<387C7C7E3E0E0E0E1C1C38F8F0C0070E789B18>I<007000F001E003C007800F001E001C00 +380038007000700070007000E000E000E000E000E000E000E000E0007000700070007000380038 +001C001E000F00078003C001F000F000700C24799F18>I<6000F00078003C001E000F00078003 +8001C001C000E000E000E000E00070007000700070007000700070007000E000E000E000E001C0 +01C0038007800F001E003C007800F00060000C247C9F18>I<01C00001C00001C00001C000C1C1 +80F1C780F9CF807FFF001FFC0007F00007F0001FFC007FFF00F9CF80F1C780C1C18001C00001C0 +0001C00001C00011147D9718>I<00600000F00000F00000F00000F00000F00000F00000F0007F +FFC0FFFFE0FFFFE07FFFC000F00000F00000F00000F00000F00000F00000F00000600013147E97 +18>I<1C3E7E7F3F1F070E1E7CF860080C788518>I<7FFF00FFFF80FFFF807FFF0011047D8F18> +I<3078FCFC78300606778518>I<000300000780000780000F80000F00001F00001E00001E0000 +3E00003C00007C0000780000780000F80000F00001F00001E00003E00003C00003C00007C00007 +80000F80000F00000F00001F00001E00003E00003C00003C00007C0000780000F80000F00000F0 +000060000011247D9F18>I<01F00007FC000FFE001F1F001C07003803807803C07001C07001C0 +E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C07001C07803C0 +3803801C07001F1F000FFE0007FC0001F000131C7E9B18>I<01800380038007800F803F80FF80 +FB80438003800380038003800380038003800380038003800380038003800380038003807FFCFF +FE7FFC0F1C7B9B18>I<03F0000FFE003FFF007C0F807003C0E001C0F000E0F000E06000E00000 +E00000E00001C00001C00003C0000780000F00001E00003C0000780000F00001E00007C0000F80 +001E00E03C00E07FFFE0FFFFE07FFFE0131C7E9B18>I<001F00003F0000770000770000E70001 +E70001C7000387000787000707000E07001E07003C0700380700780700F00700FFFFF8FFFFF8FF +FFF8000700000700000700000700000700000700007FF000FFF8007FF0151C7F9B18>52 +D<007E0001FF0007FF800F83C01E03C01C03C0380180380000700000700000E1F800E7FE00FFFF +00FE0780F803C0F001C0F000E0E000E0F000E07000E07000E07000E03801C03C03C01E07800FFF +0007FE0001F800131C7E9B18>54 D<3078FCFC783000000000000000003078FCFC783006147793 +18>58 D<183C7E7E3C180000000000000000183C7E7E3E1E0E1C3C78F060071A789318>I<0003 +00000780001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000FC00007E00 +003F00001FC00007E00003F00001FC00007E00003F00001F8000078000030011187D9918>I<7F +FFC0FFFFE0FFFFE0FFFFE0000000000000000000000000FFFFE0FFFFE0FFFFE07FFFC0130C7E93 +18>I<600000F00000FC00007E00003F00001FC00007E00003F00001FC00007E00003F00001F80 +001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000F0000060000011187D +9918>I<0FF0003FFC007FFF00700F00F00380F00380600780000F00003E00007C0001F00001E0 +0003C00003C00003C00003C00003C00003800000000000000000000000000000000003800007C0 +0007C00007C000038000111C7D9B18>I<00700000F80000F80000D80000D80001DC0001DC0001 +DC00018C00038E00038E00038E00038E000306000707000707000707000707000FFF800FFF800F +FF800E03800E03801C01C01C01C07F07F0FF8FF87F07F0151C7F9B18>65 +D<7FF800FFFE007FFF001C0F801C03C01C03C01C01E01C00E01C00E01C00F01C00701C00701C00 +701C00701C00701C00701C00701C00701C00F01C00E01C00E01C01E01C01C01C03C01C0F807FFF +00FFFE007FF800141C7F9B18>68 DII<7F07F0FF8FF87F07F01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01F +FFC01FFFC01FFFC01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C07F +07F0FF8FF87F07F0151C7F9B18>72 D<7FFF00FFFF807FFF0001C00001C00001C00001C00001C0 +0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0 +0001C00001C00001C00001C0007FFF00FFFF807FFF00111C7D9B18>I<7FE000FFE0007FE0000E +00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E +00000E00000E00000E00000E00700E00700E00700E00700E00707FFFF0FFFFF07FFFF0141C7F9B +18>76 D<7E07F0FF0FF87F07F01D81C01D81C01D81C01DC1C01CC1C01CC1C01CE1C01CE1C01CE1 +C01C61C01C71C01C71C01C31C01C39C01C39C01C39C01C19C01C19C01C1DC01C0DC01C0DC01C0D +C07F07C0FF87C07F03C0151C7F9B18>78 D<0FF8003FFE007FFF00780F00700700F00780E00380 +E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380 +E00380E00380F00780700700780F007FFF003FFE000FF800111C7D9B18>II<7FF800FFFE007FFF001C0F801C03801C03C01C01C01C01C01C01C01C03C01C03801C +0F801FFF001FFE001FFE001C0F001C07001C03801C03801C03801C03801C03801C039C1C039C1C +039C7F01F8FF81F87F00F0161C7F9B18>82 D<03F3801FFF803FFF807C0F80700780E00380E003 +80E00380E000007000007800003F00001FF00007FE0000FF00000F800003C00001C00000E00000 +E06000E0E000E0E001E0F001C0F80780FFFF80FFFE00E7F800131C7E9B18>I<7FFFF8FFFFF8FF +FFF8E07038E07038E07038E0703800700000700000700000700000700000700000700000700000 +700000700000700000700000700000700000700000700000700000700007FF0007FF0007FF0015 +1C7F9B18>II89 +D91 D<600000F00000F00000F800007800007C00003C00003C00003E00001E00001F00000F0000 +0F00000F800007800007C00003C00003C00003E00001E00001F00000F00000F800007800007800 +007C00003C00003E00001E00001E00001F00000F00000F8000078000078000030011247D9F18> +II<018007C01FF07EFCF83EE00E0F067C9B18>I<7FFF00FFFF80FFFF807FFF0011047D7F18>I< +061E3E387070E0E0E0F8FC7C7C38070E789E18>I<1FE0003FF8007FFC00781E00300E00000700 +00070000FF0007FF001FFF007F0700780700E00700E00700E00700F00F00781F003FFFF01FFBF0 +07E1F014147D9318>I<7E0000FE00007E00000E00000E00000E00000E00000E00000E3E000EFF +800FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E00380F00700F00 +700F80E00FC1E00FFFC00EFF80063E00151C809B18>I<01FE0007FF001FFF803E078038030070 +0000700000E00000E00000E00000E00000E00000E000007000007001C03801C03E03C01FFF8007 +FF0001FC0012147D9318>I<001F80003F80001F8000038000038000038000038000038003E380 +0FFB801FFF803C1F80380F80700780700380E00380E00380E00380E00380E00380E00380700780 +700780380F803C1F801FFFF00FFBF803E3F0151C7E9B18>I<01F00007FC001FFE003E0F003807 +80700380700380E001C0E001C0FFFFC0FFFFC0FFFFC0E000007000007001C03801C03E03C01FFF +8007FF0001FC0012147D9318>I<001F80007FC000FFE000E1E001C0C001C00001C00001C0007F +FFC0FFFFC0FFFFC001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001 +C00001C00001C00001C0007FFF007FFF007FFF00131C7F9B18>I<01E1F007FFF80FFFF81E1E30 +1C0E003807003807003807003807003807001C0E001E1E001FFC001FF80039E0003800001C0000 +1FFE001FFFC03FFFE07801F0700070E00038E00038E00038E000387800F07E03F01FFFC00FFF80 +01FC00151F7F9318>I<7E0000FE00007E00000E00000E00000E00000E00000E00000E3E000EFF +800FFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00 +E00E00E00E00E07FC3FCFFE7FE7FC3FC171C809B18>I<03800007C00007C00007C00003800000 +00000000000000000000007FC000FFC0007FC00001C00001C00001C00001C00001C00001C00001 +C00001C00001C00001C00001C00001C00001C00001C000FFFF00FFFF80FFFF00111D7C9C18>I< +7FE000FFE0007FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000 +00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0007FFFC0 +FFFFE07FFFC0131C7E9B18>108 D<7CE0E000FFFBF8007FFFF8001F1F1C001E1E1C001E1E1C00 +1C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C +001C1C1C007F1F1F00FFBFBF807F1F1F001914819318>I<7E3E00FEFF807FFFC00FC1C00F80E0 +0F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FC +FFE7FE7FC3FC1714809318>I<01F0000FFE001FFF003E0F803803807001C07001C0E000E0E000 +E0E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF000FFE0001F00013147E9318 +>I<7E3E00FEFF807FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E +00380F00700F00700F80E00FC1E00FFFC00EFF800E3E000E00000E00000E00000E00000E00000E +00000E00007FC000FFE0007FC000151E809318>I<01E38007FB801FFF803E1F80380F80700780 +700780E00380E00380E00380E00380E00380E00380700780700780380F803C1F801FFF800FFB80 +03E380000380000380000380000380000380000380000380003FF8003FF8003FF8151E7E9318> +I<7F87E0FF9FF07FBFF803F87803F03003E00003C00003C0000380000380000380000380000380 +000380000380000380000380007FFE00FFFF007FFE0015147F9318>I<07F7003FFF007FFF0078 +0F00E00700E00700E007007C00007FE0001FFC0003FE00001F00600780E00380E00380F00380F8 +0F00FFFF00FFFC00E7F00011147D9318>I<0180000380000380000380000380007FFFC0FFFFC0 +FFFFC00380000380000380000380000380000380000380000380000380000380400380E00380E0 +0380E001C1C001FFC000FF80003E0013197F9818>I<7E07E0FE0FE07E07E00E00E00E00E00E00 +E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03E007FFFC03FF +FE01FCFC1714809318>I<7F8FF0FF8FF87F8FF01E03C00E03800E03800E038007070007070007 +0700038E00038E00038E00038E0001DC0001DC0001DC0000F80000F80000700015147F9318>I< +FF8FF8FF8FF8FF8FF83800E03800E03800E01C01C01C01C01C71C01CF9C01CF9C01CD9C01CD9C0 +0DDD800DDD800DDD800D8D800F8F800F8F8007070015147F9318>I<7F8FF07F9FF07F8FF00707 +00078E00039E0001DC0001F80000F80000700000F00000F80001DC00039E00038E000707000F07 +807F8FF0FF8FF87F8FF015147F9318>I<7F8FF0FF8FF87F8FF00E01C00E03800E038007038007 +0700070700038700038600038E0001CE0001CE0000CC0000CC0000DC0000780000780000780000 +700000700000700000F00000E00079E0007BC0007F80003F00001E0000151E7F9318>I<3FFFF0 +7FFFF07FFFF07001E07003C0700780000F00001E00003C0000F80001F00003C0000780000F0070 +1E00703C0070780070FFFFF0FFFFF0FFFFF014147F9318>I<0007E0001FE0007FE000780000E0 +0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00001E0007FC000FF80 +00FF80007FC00001E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0 +0000E000007800007FE0001FE00007E013247E9F18>I<60F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0 +F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0600424769F18>I<7C0000FF0000FFC00003C000 +00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000F000007FC0 +003FE0003FE0007FC000F00000E00000E00000E00000E00000E00000E00000E00000E00000E000 +00E00000E00003C000FFC000FF00007C000013247E9F18>I<060C1F1E3FBEFBF8F1F060C00F06 +7C9B18>I E /Fo 75 123 df<001F83E000F06E3001C078780380F8780300F030070070000700 +70000700700007007000070070000700700007007000FFFFFF8007007000070070000700700007 +007000070070000700700007007000070070000700700007007000070070000700700007007000 +07007000070070000700700007007000070070007FE3FF001D20809F1B>11 +D<003F0000E0C001C0C00381E00701E00701E0070000070000070000070000070000070000FFFF +E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700 +E00700E00700E00700E00700E00700E07FC3FE1720809F19>I<003FE000E0E001C1E00381E007 +00E00700E00700E00700E00700E00700E00700E00700E0FFFFE00700E00700E00700E00700E007 +00E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E007 +00E07FE7FE1720809F19>I<001F81F80000F04F040001C07C06000380F80F000300F00F000700 +F00F00070070000007007000000700700000070070000007007000000700700000FFFFFFFF0007 +007007000700700700070070070007007007000700700700070070070007007007000700700700 +070070070007007007000700700700070070070007007007000700700700070070070007007007 +00070070070007007007007FE3FE3FF02420809F26>I<7038F87CFC7EFC7E743A040204020402 +0804080410081008201040200F0E7E9F17>34 D<70F8FCFC74040404080810102040060E7C9F0D +>39 D<0020004000800100020006000C000C00180018003000300030007000600060006000E000 +E000E000E000E000E000E000E000E000E000E000E0006000600060007000300030003000180018 +000C000C000600020001000080004000200B2E7DA112>I<800040002000100008000C00060006 +000300030001800180018001C000C000C000C000E000E000E000E000E000E000E000E000E000E0 +00E000E000C000C000C001C001800180018003000300060006000C00080010002000400080000B +2E7DA112>I<70F8FCFC74040404080810102040060E7C840D>44 DI<70 +F8F8F87005057C840D>I<03F0000E1C001C0E00180600380700700380700380700380700380F0 +03C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C070 +03807003807003807807803807001806001C0E000E1C0003F000121F7E9D17>48 +D<018003800F80F380038003800380038003800380038003800380038003800380038003800380 +03800380038003800380038003800380038007C0FFFE0F1E7C9D17>I<03F0000C1C00100E0020 +0700400780800780F007C0F803C0F803C0F803C02007C00007C0000780000780000F00000E0000 +1C0000380000700000600000C0000180000300000600400C00401800401000803FFF807FFF80FF +FF80121E7E9D17>I<03F0000C1C00100E00200F00780F80780780780780380F80000F80000F00 +000F00000E00001C0000380003F000003C00000E00000F000007800007800007C02007C0F807C0 +F807C0F807C0F00780400780400F00200E001C3C0003F000121F7E9D17>I<000600000600000E +00000E00001E00002E00002E00004E00008E00008E00010E00020E00020E00040E00080E00080E +00100E00200E00200E00400E00C00E00FFFFF0000E00000E00000E00000E00000E00000E00000E +0000FFE0141E7F9D17>I<1803001FFE001FFC001FF8001FE00010000010000010000010000010 +000010000011F000161C00180E001007001007800003800003800003C00003C00003C07003C0F0 +03C0F003C0E00380400380400700200600100E000C380003E000121F7E9D17>I<007C00018200 +0701000E03800C07801C0780380300380000780000700000700000F1F000F21C00F40600F80700 +F80380F80380F003C0F003C0F003C0F003C0F003C07003C07003C0700380380380380700180700 +0C0E00061C0001F000121F7E9D17>I<4000007FFFC07FFF807FFF804001008002008002008004 +0000080000080000100000200000200000400000400000C00000C00001C0000180000380000380 +00038000038000078000078000078000078000078000078000078000030000121F7D9D17>I<03 +F0000C0C001006003003002001806001806001806001807001807803003E03003F06001FC8000F +F00003F80007FC000C7E00103F00300F806003804001C0C001C0C000C0C000C0C000C0C0008060 +01802001001002000C0C0003F000121F7E9D17>I<03F0000E18001C0C00380600380700700700 +700380F00380F00380F003C0F003C0F003C0F003C0F003C07007C07007C03807C0180BC00E13C0 +03E3C0000380000380000380000700300700780600780E00700C002018001070000FC000121F7E +9D17>I<70F8F8F8700000000000000000000070F8F8F87005147C930D>I<70F8F8F87000000000 +00000000000070F0F8F878080808101010202040051D7C930D>I<000100000003800000038000 +000380000007C0000007C0000007C0000009E0000009E0000009E0000010F0000010F0000010F0 +0000207800002078000020780000403C0000403C0000403C0000801E0000801E0000FFFE000100 +0F0001000F0001000F00020007800200078002000780040003C00E0003C01F0007E0FFC03FFE1F +207F9F22>65 DI<000FC040007030C001C009C0038005C00700 +03C00E0001C01E0000C01C0000C03C0000C07C0000407C00004078000040F8000000F8000000F8 +000000F8000000F8000000F8000000F8000000F8000000F8000000780000007C0000407C000040 +3C0000401C0000401E0000800E000080070001000380020001C0040000703800000FC0001A217D +9F21>IIII<000FE0200078186000E004E0038002E0070001E00F0000E01E0000601E000060 +3C0000603C0000207C00002078000020F8000000F8000000F8000000F8000000F8000000F80000 +00F8000000F8007FFCF80003E0780001E07C0001E03C0001E03C0001E01E0001E01E0001E00F00 +01E0070001E0038002E000E0046000781820000FE0001E217D9F24>III<0FFFC0007C +00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C +00003C00003C00003C00003C00003C00003C00003C00003C00203C00F83C00F83C00F83C00F038 +0040780040700030E0000F800012207E9E17>I76 DII<001F800000F0F00001C0380007801E +000F000F000E0007001E0007803C0003C03C0003C07C0003E0780001E0780001E0F80001F0F800 +01F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0780001E07C0003E07C +0003E03C0003C03C0003C01E0007800E0007000F000F0007801E0001C0380000F0F000001F8000 +1C217D9F23>II<001F800000F0F00001C0380007801E000F00 +0F000E0007001E0007803C0003C03C0003C07C0003E07C0003E0780001E0F80001F0F80001F0F8 +0001F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0780001E0780001E07C0003E0 +3C0003C03C0F03C01E1087800E2047000F204F0007A03E0001E0380000F0F010001FB010000030 +10000038300000387000003FF000001FE000001FE000000FC0000007801C297D9F23>II<07E0800C1980100780300380600180600180E00180E00080 +E00080E00080F00000F000007800007F00003FF0001FFC000FFE0003FF00001F800007800003C0 +0003C00001C08001C08001C08001C08001C0C00180C00380E00300F00600CE0C0081F80012217D +9F19>I<7FFFFFE0780F01E0600F0060400F0020400F0020C00F0030800F0010800F0010800F00 +10800F0010000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F +0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F000000 +0F0000001F800007FFFE001C1F7E9E21>IIII91 +D<080410082010201040204020804080408040B85CFC7EFC7E7C3E381C0F0E7B9F17>II<081020204040808080B8FCFC7C38060E7D9F0D>96 +D<1FE000303000781800781C00300E00000E00000E00000E0000FE00078E001E0E00380E00780E +00F00E10F00E10F00E10F01E10781E103867200F83C014147E9317>I<0E0000FE00000E00000E +00000E00000E00000E00000E00000E00000E00000E00000E00000E3E000EC3800F01C00F00E00E +00E00E00700E00700E00780E00780E00780E00780E00780E00780E00700E00700E00E00F00E00D +01C00CC300083E0015207F9F19>I<03F80E0C1C1E381E380C70007000F000F000F000F000F000 +F00070007000380138011C020E0C03F010147E9314>I<000380003F8000038000038000038000 +038000038000038000038000038000038000038003E380061B801C078038038038038070038070 +0380F00380F00380F00380F00380F00380F003807003807003803803803807801C07800E1B8003 +E3F815207E9F19>I<03F0000E1C001C0E00380700380700700700700380F00380F00380FFFF80 +F00000F00000F000007000007000003800801800800C010007060001F80011147F9314>I<007C +00C6018F038F07060700070007000700070007000700FFF0070007000700070007000700070007 +0007000700070007000700070007000700070007007FF01020809F0E>I<0000E003E3300E3C30 +1C1C30380E00780F00780F00780F00780F00780F00380E001C1C001E380033E000200000200000 +3000003000003FFE001FFF800FFFC03001E0600070C00030C00030C00030C000306000603000C0 +1C038003FC00141F7F9417>I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00 +000E00000E00000E00000E3E000E43000E81800F01C00F01C00E01C00E01C00E01C00E01C00E01 +C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC16207F9F19>I<1C +003E003E003E001C000000000000000000000000000E007E000E000E000E000E000E000E000E00 +0E000E000E000E000E000E000E000E000E000E00FFC00A1F809E0C>I<00E001F001F001F000E0 +000000000000000000000000007007F000F0007000700070007000700070007000700070007000 +7000700070007000700070007000700070007000706070F060F0C061803F000C28829E0E>I<0E +0000FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0FF00E +03C00E03000E02000E04000E08000E10000E30000E70000EF8000F38000E1C000E1E000E0E000E +07000E07800E03800E03C00E03E0FFCFF815207F9F18>I<0E00FE000E000E000E000E000E000E +000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00 +0E000E000E000E00FFE00B20809F0C>I<0E1F01F000FE618618000E81C81C000F00F00E000F00 +F00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E +00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E00FFE7FE7FE0 +23147F9326>I<0E3E00FE43000E81800F01C00F01C00E01C00E01C00E01C00E01C00E01C00E01 +C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC16147F9319>I<01F80007 +0E001C03803801C03801C07000E07000E0F000F0F000F0F000F0F000F0F000F0F000F07000E070 +00E03801C03801C01C0380070E0001F80014147F9317>I<0E3E00FEC3800F01C00F00E00E00E0 +0E00F00E00700E00780E00780E00780E00780E00780E00780E00700E00F00E00E00F01E00F01C0 +0EC3000E3E000E00000E00000E00000E00000E00000E00000E00000E0000FFE000151D7F9319> +I<03E0800619801C05803C0780380380780380700380F00380F00380F00380F00380F00380F003 +807003807803803803803807801C0B800E138003E3800003800003800003800003800003800003 +80000380000380003FF8151D7E9318>I<0E78FE8C0F1E0F1E0F0C0E000E000E000E000E000E00 +0E000E000E000E000E000E000E000E00FFE00F147F9312>I<1F9030704030C010C010C010E000 +78007F803FE00FF00070803880188018C018C018E030D0608F800D147E9312>I<020002000200 +060006000E000E003E00FFF80E000E000E000E000E000E000E000E000E000E000E000E080E080E +080E080E080610031001E00D1C7F9B12>I<0E01C0FE1FC00E01C00E01C00E01C00E01C00E01C0 +0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E03C00603C0030DC001F1FC +16147F9319>III<7FC3FC0F01E00701C007018003810001C20000E40000EC00007800003800003C0000 +7C00004E000087000107000303800201C00601E01E01E0FF07FE1714809318>II<3FFF380E200E201C40384078407000E001E001C00380078007010E011E +011C0338027006700EFFFE10147F9314>I E /Fp 13 122 df<0000001FFC0000C000000003FF +FFC001C00000001FFFFFF003C00000007FFFFFFC07C0000001FFFC00FE0FC0000007FFC0001F9F +C000000FFE000007FFC000003FF8000003FFC000007FF0000000FFC00000FFE00000007FC00001 +FFC00000007FC00001FF800000003FC00003FF000000001FC00007FE000000001FC0000FFE0000 +00000FC0000FFC000000000FC0001FFC0000000007C0001FFC0000000007C0003FF80000000007 +C0003FF80000000003C0003FF80000000003C0007FF80000000003C0007FF80000000003C0007F +F0000000000000007FF000000000000000FFF000000000000000FFF000000000000000FFF00000 +0000000000FFF000000000000000FFF000000000000000FFF000000000000000FFF00000000000 +0000FFF000000000000000FFF000000000000000FFF000000000000000FFF000001FFFFFFF807F +F000001FFFFFFF807FF000001FFFFFFF807FF800001FFFFFFF807FF800000001FFC0003FF80000 +0001FFC0003FF800000001FFC0003FF800000001FFC0001FFC00000001FFC0001FFC00000001FF +C0000FFE00000001FFC0000FFE00000001FFC00007FF00000001FFC00003FF00000001FFC00001 +FF80000001FFC00001FFC0000001FFC00000FFE0000001FFC000007FF0000003FFC000003FFC00 +0003FFC000000FFF000007FFC0000007FFC0001FBFC0000001FFFC00FF1FC00000007FFFFFFE0F +C00000001FFFFFF803C000000003FFFFE000C0000000001FFE00000000413D7BBB4C>71 +DI76 D78 D85 D<003FFE00000001FFFFE0000007FFFFF800000FE0 +07FC00000FF001FE00001FF800FF00001FF8007F80001FF8007FC0001FF8003FC0000FF0003FE0 +0007E0003FE00003C0003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000 +FFFFE000001FFFFFE000007FF83FE00003FF803FE00007FC003FE0000FF0003FE0001FE0003FE0 +003FE0003FE0007FC0003FE0007FC0003FE000FF80003FE000FF80003FE000FF80003FE000FF80 +003FE000FF80007FE0007FC0007FE0007FC000DFE0003FE0039FF0001FF80F0FFFE007FFFE0FFF +E001FFF807FFE0003FE000FFE02B267DA52F>97 D<00FE00000000FFFE00000000FFFE00000000 +FFFE00000000FFFE0000000007FE0000000003FE0000000003FE0000000003FE0000000003FE00 +00000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE00000000 +03FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE01 +FF000003FE1FFFF00003FE7FFFFC0003FEFC03FE0003FFF000FF0003FFC0003F8003FF00001FC0 +03FE00001FE003FE00000FF003FE00000FF803FE00000FF803FE000007FC03FE000007FC03FE00 +0007FC03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE +03FE000007FE03FE000007FE03FE000007FE03FE000007FC03FE000007FC03FE000007FC03FE00 +000FFC03FE00000FF803FE00000FF003FE00001FF003FF00001FE003FF80003FC003FFC0007F80 +03F9E000FF0003F0FC07FE0003F07FFFF80003E01FFFE00003C003FE00002F3C7DBB36>I<01E0 +0007F8000FFC000FFC001FFE001FFE001FFE001FFE000FFC000FFC0007F80001E0000000000000 +0000000000000000000000000000000000000000000000000000000000FE00FFFE00FFFE00FFFE +00FFFE0007FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE00FFFFF0FFFFF0FFFFF0FFFFF0143D7DBC1A>105 +D<0001FFC00000000FFFF80000007FFFFF000000FF80FF800003FE003FE00007F8000FF0000FF0 +0007F8000FF00007F8001FE00003FC003FE00003FE003FE00003FE007FC00001FF007FC00001FF +007FC00001FF007FC00001FF00FFC00001FF80FFC00001FF80FFC00001FF80FFC00001FF80FFC0 +0001FF80FFC00001FF80FFC00001FF80FFC00001FF80FFC00001FF807FC00001FF007FC00001FF +007FC00001FF003FE00003FE003FE00003FE001FE00003FC001FF00007FC000FF00007F80007F8 +000FF00003FE003FE00000FF80FF8000007FFFFF0000000FFFF800000001FFC0000029267DA530 +>111 D<01FC03F000FFFC0FFC00FFFC1FFF00FFFC3C3F80FFFC707F8007FCE0FFC003FCC0FFC0 +03FD80FFC003FD80FFC003FF807F8003FF003F0003FF001E0003FF00000003FE00000003FE0000 +0003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00 +000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE +00000003FE00000003FE00000003FE000000FFFFFC0000FFFFFC0000FFFFFC0000FFFFFC000022 +267DA528>114 D<003FF07003FFFEF007FFFFF01FC01FF03F0003F03E0001F07C0001F07C0000 +F0FC0000F0FC0000F0FE0000F0FF000000FFC00000FFFC00007FFFF0003FFFFE003FFFFF801FFF +FFC00FFFFFE003FFFFF000FFFFF8001FFFFC00007FFC000007FE700001FEF00000FEF000007EF8 +00007EF800007EFC00007EFC00007CFE0000FCFF0000F8FF8001F0FFF00FE0F9FFFFC0F07FFF00 +C01FF8001F267DA526>I<000F0000000F0000000F0000000F0000000F0000001F0000001F0000 +001F0000001F0000003F0000003F0000007F0000007F000000FF000001FF000003FF000007FF00 +001FFFFFF0FFFFFFF0FFFFFFF0FFFFFFF001FF000001FF000001FF000001FF000001FF000001FF +000001FF000001FF000001FF000001FF000001FF000001FF000001FF000001FF000001FF000001 +FF000001FF000001FF000001FF000001FF003C01FF003C01FF003C01FF003C01FF003C01FF003C +01FF003C01FF003C00FF007800FF8078007F80F0003FC1E0001FFFC0000FFF800001FE001E377E +B626>I121 +D E end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 300dpi +TeXDict begin + +%%EndSetup +%%Page: 1 1 +0 bop 0 1152 a Fp(GNU)33 b(History)f(Library)p 0 1201 1950 +17 v 1035 1250 a Fo(Edition)16 b(2.0,)e(for)h Fn(History)f(Library)g +Fo(V)l(ersion)i(2.0.)1759 1304 y(July)g(1994)0 2443 y Fm(Brian)23 +b(F)-6 b(o)n(x,)23 b(F)-6 b(ree)23 b(Soft)n(w)n(are)f(F)-6 +b(oundation)0 2509 y(Chet)22 b(Ramey)-6 b(,)23 b(Case)e(W)-6 +b(estern)23 b(Reserv)n(e)f(Univ)n(ersit)n(y)p 0 2545 1950 9 +v eop +%%Page: 2 2 +1 bop 0 295 a Fo(This)16 b(do)q(cumen)o(t)g(describ)q(es)h(the)f(GNU)f +(History)g(library)l(,)h(a)g(programming)e(to)q(ol)i(that)f(pro)o(vides)h(a)f +(consisten)o(t)0 358 y(user)g(in)o(terface)h(for)e(recalling)j(lines)g(of)e +(previously)h(t)o(yp)q(ed)g(input.)0 495 y(Published)h(b)o(y)f(the)f(F)l(ree) +g(Soft)o(w)o(are)f(F)l(oundation)0 557 y(675)g(Massac)o(h)o(usetts)g(Av)o(en) +o(ue,)0 619 y(Cam)o(bridge,)h(MA)g(02139)f(USA)0 756 y(P)o(ermission)f(is)g +(gran)o(ted)f(to)f(mak)o(e)h(and)h(distribute)h(v)o(erbatim)e(copies)h(of)f +(this)h(man)o(ual)g(pro)o(vided)g(the)f(cop)o(yrigh)o(t)0 818 +y(notice)k(and)f(this)h(p)q(ermission)h(notice)e(are)g(preserv)o(ed)h(on)f +(all)h(copies.)0 955 y(P)o(ermission)f(is)f(gran)o(ted)f(to)h(cop)o(y)g(and)g +(distribute)h(mo)q(di\014ed)h(v)o(ersions)e(of)f(this)i(man)o(ual)f(under)h +(the)f(conditions)0 1018 y(for)e(v)o(erbatim)g(cop)o(ying,)h(pro)o(vided)h +(that)d(the)i(en)o(tire)g(resulting)h(deriv)o(ed)f(w)o(ork)f(is)h +(distributed)h(under)f(the)g(terms)0 1080 y(of)i(a)g(p)q(ermission)h(notice)g +(iden)o(tical)h(to)e(this)g(one.)0 1217 y(P)o(ermission)20 +b(is)g(gran)o(ted)f(to)g(cop)o(y)h(and)f(distribute)i(translations)f(of)f +(this)h(man)o(ual)f(in)o(to)h(another)f(language,)0 1279 y(under)c(the)f(ab)q +(o)o(v)o(e)g(conditions)h(for)e(mo)q(di\014ed)j(v)o(ersions,)e(except)g(that) +g(this)g(p)q(ermission)i(notice)e(ma)o(y)g(b)q(e)h(stated)0 +1341 y(in)h(a)f(translation)g(appro)o(v)o(ed)g(b)o(y)g(the)g(F)l(oundation.)0 +2636 y(Cop)o(yrigh)o(t)226 2635 y(c)214 2636 y Fl(\015)g Fo(1989,)f(1991)g(F) +l(ree)h(Soft)o(w)o(are)f(F)l(oundation,)h(Inc.)p eop +%%Page: 1 3 +2 bop 0 -83 a Fo(Chapter)15 b(1:)k(Using)d(History)f(In)o(teractiv)o(ely)1157 +b(1)0 158 y Fk(1)41 b(Using)14 b(History)h(In)n(teractiv)n(ely)62 +330 y Fo(This)i(c)o(hapter)e(describ)q(es)j(ho)o(w)d(to)h(use)g(the)g(GNU)g +(History)f(Library)i(in)o(teractiv)o(ely)l(,)g(from)e(a)g(user's)h(stand-)0 +392 y(p)q(oin)o(t.)23 b(It)16 b(should)h(b)q(e)f(considered)i(a)d(user's)h +(guide.)23 b(F)l(or)15 b(information)h(on)g(using)h(the)f(GNU)g(History)f +(Library)0 454 y(in)h(y)o(our)f(o)o(wn)f(programs,)g(see)i(Chapter)e(2)h +([Programming)f(with)i(GNU)f(History],)f(page)h(5.)0 663 y +Fm(1.1)33 b(History)15 b(In)n(teraction)62 800 y Fo(The)j(History)g(library)g +(pro)o(vides)h(a)e(history)h(expansion)h(feature)e(that)g(is)i(similar)g(to)e +(the)h(history)f(expan-)0 862 y(sion)k(pro)o(vided)h(b)o(y)f +Fn(csh)p Fo(.)36 b(The)22 b(follo)o(wing)f(text)g(describ)q(es)h(the)f(syn)o +(tax)f(used)i(to)e(manipulate)i(the)f(history)0 924 y(information.)62 +1061 y(History)11 b(expansion)i(tak)o(es)d(place)i(in)h(t)o(w)o(o)d(parts.)18 +b(The)11 b(\014rst)g(is)h(to)f(determine)h(whic)o(h)g(line)h(from)e(the)g +(previous)0 1124 y(history)h(should)h(b)q(e)f(used)h(during)f(substitution.) +20 b(The)12 b(second)g(is)h(to)e(select)h(p)q(ortions)g(of)g(that)f(line)i +(for)f(inclusion)0 1186 y(in)o(to)f(the)h(curren)o(t)f(one.)18 +b(The)12 b(line)h(selected)f(from)f(the)g(previous)h(history)g(is)f(called)i +(the)e Fj(ev)o(en)o(t)p Fo(,)h(and)f(the)h(p)q(ortions)0 1248 +y(of)h(that)g(line)i(that)e(are)g(acted)g(up)q(on)h(are)g(called)h +Fj(w)o(ords)p Fo(.)j(The)c(line)h(is)f(brok)o(en)f(in)o(to)h(w)o(ords)f(in)h +(the)f(same)h(fashion)0 1310 y(that)j(Bash)h(do)q(es,)h(so)e(that)g(sev)o +(eral)h(English)i(\(or)d(Unix\))h(w)o(ords)f(surrounded)i(b)o(y)f(quotes)f +(are)h(considered)h(as)0 1373 y(one)c(w)o(ord.)0 1565 y Fi(1.1.1)30 +b(Ev)n(en)n(t)16 b(Designators)62 1702 y Fo(An)g(ev)o(en)o(t)f(designator)g +(is)g(a)g(reference)h(to)f(a)g(command)g(line)i(en)o(try)d(in)i(the)g +(history)f(list.)0 1847 y Fn(!)216 b Fo(Start)14 b(a)g(history)h +(substitution,)g(except)h(when)f(follo)o(w)o(ed)g(b)o(y)g(a)f(space,)h(tab,)f +(the)h(end)g(of)g(the)g(line,)240 1909 y Fn(=)g Fo(or)g Fn(\()p +Fo(.)0 1989 y Fn(!!)192 b Fo(Refer)16 b(to)e(the)i(previous)f(command.)20 +b(This)c(is)g(a)f(synon)o(ym)g(for)f Fn(!-1)p Fo(.)0 2068 y +Fn(!n)192 b Fo(Refer)16 b(to)e(command)h(line)i Fj(n)p Fo(.)0 +2148 y Fn(!-n)168 b Fo(Refer)16 b(to)e(the)i(command)f Fj(n)g +Fo(lines)i(bac)o(k.)0 2227 y Fn(!string)72 b Fo(Refer)16 b(to)e(the)i(most)e +(recen)o(t)h(command)g(starting)g(with)g Fj(string)p Fo(.)0 +2298 y Fn(!?string)p Fo([)p Fn(?)p Fo(])240 2360 y(Refer)h(to)e(the)i(most)e +(recen)o(t)h(command)g(con)o(taining)h Fj(string)p Fo(.)0 2440 +y Fn(!#)192 b Fo(The)15 b(en)o(tire)h(command)f(line)i(t)o(yp)q(ed)f(so)e +(far.)0 2510 y Fn(^string1^string2^)240 2573 y Fo(Quic)o(k)j(Substitution.)22 +b(Rep)q(eat)16 b(the)g(last)f(command,)h(replacing)h Fj(string1)h +Fo(with)e Fj(string2)p Fo(.)21 b(Equiv-)240 2635 y(alen)o(t)15 +b(to)g Fn(!!:s/string1/string2/)p Fo(.)p eop +%%Page: 2 4 +3 bop 0 -83 a Fo(2)1497 b(GNU)15 b(History)g(Library)0 158 +y Fi(1.1.2)30 b(W)-5 b(ord)15 b(Designators)62 295 y Fo(A)i +Fn(:)g Fo(separates)f(the)h(ev)o(en)o(t)f(sp)q(eci\014cation)j(from)d(the)g +(w)o(ord)g(designator.)25 b(It)17 b(can)g(b)q(e)g(omitted)g(if)g(the)g(w)o +(ord)0 358 y(designator)d(b)q(egins)h(with)f(a)f Fn(^)p Fo(,)h +Fn($)p Fo(,)f Fn(*)h Fo(or)f Fn(\045)p Fo(.)20 b(W)l(ords)13 +b(are)h(n)o(um)o(b)q(ered)g(from)f(the)h(b)q(eginning)i(of)d(the)h(line,)i +(with)e(the)0 420 y(\014rst)h(w)o(ord)f(b)q(eing)j(denoted)f(b)o(y)f(a)g(0)f +(\(zero\).)0 569 y Fn(0)h(\(zero\))57 b Fo(The)15 b Fn(0)p +Fo(th)g(w)o(ord.)20 b(F)l(or)14 b(man)o(y)h(applications,)h(this)g(is)g(the)f +(command)g(w)o(ord.)0 656 y Fn(n)216 b Fo(The)15 b Fj(n)p Fo(th)h(w)o(ord.)0 +744 y Fn(^)216 b Fo(The)15 b(\014rst)g(argumen)o(t;)f(that)h(is,)g(w)o(ord)g +(1.)0 831 y Fn($)216 b Fo(The)15 b(last)h(argumen)o(t.)0 918 +y Fn(\045)216 b Fo(The)15 b(w)o(ord)g(matc)o(hed)g(b)o(y)g(the)g(most)g +(recen)o(t)g Fn(?string?)f Fo(searc)o(h.)0 1005 y Fn(x-y)168 +b Fo(A)15 b(range)g(of)g(w)o(ords;)f Fn(-)p Fj(y)19 b Fo(abbreviates)c +Fn(0-)p Fj(y)t Fo(.)0 1092 y Fn(*)216 b Fo(All)17 b(of)f(the)g(w)o(ords,)f +(except)i(the)f Fn(0)p Fo(th.)22 b(This)17 b(is)f(a)g(synon)o(ym)g(for)f +Fn(1-$)p Fo(.)22 b(It)17 b(is)f(not)g(an)g(error)f(to)h(use)240 +1155 y Fn(*)f Fo(if)h(there)f(is)h(just)f(one)g(w)o(ord)f(in)i(the)g(ev)o(en) +o(t;)e(the)i(empt)o(y)e(string)i(is)f(returned)h(in)g(that)e(case.)0 +1242 y Fn(x*)192 b Fo(Abbreviates)16 b Fn(x-$)0 1329 y(x-)192 +b Fo(Abbreviates)16 b Fn(x-$)f Fo(lik)o(e)h Fn(x*)p Fo(,)e(but)i(omits)f(the) +g(last)g(w)o(ord.)0 1537 y Fi(1.1.3)30 b(Mo)r(di\014ers)62 +1674 y Fo(After)20 b(the)f(optional)i(w)o(ord)e(designator,)h(y)o(ou)f(can)h +(add)g(a)g(sequence)h(of)e(one)h(or)f(more)g(of)g(the)h(follo)o(wing)0 +1736 y(mo)q(di\014ers,)c(eac)o(h)f(preceded)i(b)o(y)e(a)g Fn(:)p +Fo(.)0 1885 y Fn(h)216 b Fo(Remo)o(v)o(e)15 b(a)g(trailing)h(pathname)f(comp) +q(onen)o(t,)g(lea)o(ving)h(only)g(the)f(head.)0 1973 y Fn(r)216 +b Fo(Remo)o(v)o(e)15 b(a)g(trailing)h(su\016x)f(of)g(the)g(form)g(`)p +Fn(.)p Fo(')p Fj(su\016x)p Fo(,)f(lea)o(ving)i(the)f(basename.)0 +2060 y Fn(e)216 b Fo(Remo)o(v)o(e)15 b(all)h(but)g(the)f(trailing)h(su\016x.) +0 2147 y Fn(t)216 b Fo(Remo)o(v)o(e)15 b(all)h(leading)h(pathname)e(comp)q +(onen)o(ts,)g(lea)o(ving)h(the)f(tail.)0 2234 y Fn(p)216 b +Fo(Prin)o(t)15 b(the)g(new)h(command)f(but)g(do)g(not)g(execute)h(it.)0 +2309 y Fn(s/old/new/)240 2371 y Fo(Substitute)g Fj(new)k Fo(for)15 +b(the)h(\014rst)f(o)q(ccurrence)h(of)g Fj(old)h Fo(in)g(the)e(ev)o(en)o(t)h +(line.)22 b(An)o(y)16 b(delimiter)h(ma)o(y)e(b)q(e)240 2433 +y(used)e(in)f(place)h(of)f Fn(/)p Fo(.)19 b(The)12 b(delimiter)i(ma)o(y)d(b)q +(e)i(quoted)f(in)h Fj(old)h Fo(and)e Fj(new)17 b Fo(with)12 +b(a)g(single)h(bac)o(kslash.)240 2496 y(If)g Fn(&)h Fo(app)q(ears)f(in)h +Fj(new)p Fo(,)f(it)h(is)g(replaced)g(b)o(y)f Fj(old)p Fo(.)20 +b(A)13 b(single)i(bac)o(kslash)e(will)i(quote)e(the)h Fn(&)p +Fo(.)19 b(The)13 b(\014nal)240 2558 y(delimiter)k(is)f(optional)g(if)f(it)h +(is)f(the)h(last)f(c)o(haracter)f(on)h(the)h(input)g(line.)0 +2645 y Fn(&)216 b Fo(Rep)q(eat)16 b(the)f(previous)h(substitution.)p +eop +%%Page: 3 5 +4 bop 0 -83 a Fo(Chapter)15 b(1:)k(Using)d(History)f(In)o(teractiv)o(ely)1157 +b(3)0 158 y Fn(g)216 b Fo(Cause)15 b(c)o(hanges)g(to)f(b)q(e)i(applied)h(o)o +(v)o(er)d(the)h(en)o(tire)g(ev)o(en)o(t)g(line.)21 b(Used)16 +b(in)g(conjunction)g(with)f Fn(s)p Fo(,)f(as)240 221 y(in)i +Fn(gs/old/new/)p Fo(,)d(or)i(with)h Fn(&)p Fo(.)p eop +%%Page: 4 6 +5 bop 0 -83 a Fo(4)1497 b(GNU)15 b(History)g(Library)p eop +%%Page: 5 7 +6 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1039 +b(5)0 158 y Fk(2)41 b(Programming)16 b(with)f(GNU)h(History)62 +347 y Fo(This)e(c)o(hapter)f(describ)q(es)i(ho)o(w)d(to)h(in)o(terface)g +(programs)f(that)h(y)o(ou)g(write)g(with)g(the)h(GNU)f(History)g(Library)l(.) +0 409 y(It)j(should)g(b)q(e)g(considered)h(a)f(tec)o(hnical)h(guide.)22 +b(F)l(or)15 b(information)h(on)f(the)h(in)o(teractiv)o(e)g(use)g(of)f(GNU)g +(History)l(,)0 471 y(see)g(Chapter)g(1)g([Using)h(History)f(In)o(teractiv)o +(ely],)g(page)g(1.)0 698 y Fm(2.1)33 b(In)n(tro)r(duction)17 +b(to)e(History)62 835 y Fo(Man)o(y)j(programs)g(read)h(input)h(from)e(the)g +(user)h(a)g(line)h(at)f(a)f(time.)31 b(The)19 b(GNU)g(History)f(library)i(is) +f(able)0 897 y(to)e(k)o(eep)g(trac)o(k)f(of)h(those)g(lines,)i(asso)q(ciate)e +(arbitrary)g(data)g(with)g(eac)o(h)g(line,)j(and)d(utilize)i(information)f +(from)0 960 y(previous)e(lines)h(in)f(comp)q(osing)f(new)h(ones.)62 +1097 y(The)i(programmer)f(using)h(the)g(History)g(library)g(has)g(a)o(v)m +(ailable)h(functions)g(for)e(remem)o(b)q(ering)h(lines)i(on)d(a)0 +1159 y(history)f(list,)g(asso)q(ciating)g(arbitrary)g(data)f(with)h(a)f +(line,)j(remo)o(ving)d(lines)j(from)d(the)h(list,)g(searc)o(hing)g(through)0 +1221 y(the)h(list)h(for)e(a)h(line)h(con)o(taining)g(an)f(arbitrary)f(text)h +(string,)g(and)g(referencing)h(an)o(y)f(line)h(in)g(the)f(list)h(directly)l +(.)0 1284 y(In)d(addition,)h(a)e(history)h Fj(expansion)h Fo(function)g(is)f +(a)o(v)m(ailable)h(whic)o(h)g(pro)o(vides)f(for)f(a)h(consisten)o(t)g(user)g +(in)o(terface)0 1346 y(across)f(di\013eren)o(t)i(programs.)62 +1483 y(The)i(user)g(using)g(programs)f(written)g(with)h(the)g(History)f +(library)i(has)e(the)h(b)q(ene\014t)h(of)e(a)g(consisten)o(t)h(user)0 +1545 y(in)o(terface)d(with)g(a)f(set)h(of)f(w)o(ell-kno)o(wn)h(commands)g +(for)f(manipulating)i(the)f(text)f(of)g(previous)h(lines)h(and)f(using)0 +1608 y(that)g(text)g(in)i(new)e(commands.)22 b(The)15 b(basic)i(history)e +(manipulation)j(commands)d(are)g(similar)i(to)e(the)h(history)0 +1670 y(substitution)g(pro)o(vided)g(b)o(y)f Fn(csh)p Fo(.)62 +1807 y(If)g(the)g(programmer)e(desires,)i(he)g(can)g(use)g(the)f(Readline)j +(library)l(,)e(whic)o(h)h(includes)g(some)f(history)f(manip-)0 +1870 y(ulation)i(b)o(y)f(default,)h(and)f(has)g(the)g(added)h(adv)m(an)o +(tage)f(of)g(command)g(line)h(editing.)0 2096 y Fm(2.2)33 b(History)15 +b(Storage)62 2234 y Fo(The)h(history)f(list)h(is)g(an)f(arra)o(y)f(of)g +(history)i(en)o(tries.)k(A)15 b(history)g(en)o(try)g(is)h(declared)g(as)f +(follo)o(ws:)120 2358 y Fn(typedef)23 b(struct)g(_hist_entry)f({)168 +2408 y(char)h(*line;)168 2458 y(char)g(*data;)120 2508 y(})h(HIST_ENTRY;)62 +2645 y Fo(The)16 b(history)f(list)h(itself)g(migh)o(t)f(therefore)g(b)q(e)h +(declared)g(as)p eop +%%Page: 6 8 +7 bop 0 -83 a Fo(6)1497 b(GNU)15 b(History)g(Library)120 158 +y Fn(HIST_ENTRY)22 b(**the_history_list;)62 302 y Fo(The)16 +b(state)e(of)h(the)g(History)g(library)h(is)g(encapsulated)g(in)o(to)f(a)g +(single)i(structure:)120 434 y Fn(/*)24 b(A)f(structure)g(used)g(to)h(pass)f +(the)h(current)f(state)g(of)g(the)h(history)f(stuff)g(around.)g(*/)120 +484 y(typedef)g(struct)g(_hist_state)f({)168 534 y(HIST_ENTRY)g(**entries;) +214 b(/*)23 b(Pointer)g(to)h(the)f(entries)g(themselves.)f(*/)168 +584 y(int)h(offset;)453 b(/*)23 b(The)h(location)e(pointer)h(within)g(this)h +(array.)f(*/)168 633 y(int)g(length;)453 b(/*)23 b(Number)g(of)h(elements)f +(within)g(this)g(array.)g(*/)168 683 y(int)g(size;)501 b(/*)23 +b(Number)g(of)h(slots)f(allocated)g(to)g(this)h(array.)f(*/)168 +733 y(int)g(flags;)120 783 y(})h(HISTORY_STATE;)62 927 y Fo(If)16 +b(the)f(\015ags)g(mem)o(b)q(er)g(includes)j Fn(HS_STIFLED)p +Fo(,)13 b(the)i(history)h(has)f(b)q(een)h(sti\015ed.)0 1215 +y Fm(2.3)33 b(History)15 b(F)-6 b(unctions)62 1359 y Fo(This)16 +b(section)g(describ)q(es)h(the)e(calling)i(sequence)f(for)f(the)g(v)m(arious) +h(functions)g(presen)o(t)f(in)h(GNU)f(History)l(.)0 1631 y +Fi(2.3.1)30 b(Initializing)15 b(History)g(and)g(State)g(Managemen)n(t)62 +1775 y Fo(This)j(section)g(describ)q(es)h(functions)f(used)g(to)e(initialize) +21 b(and)c(manage)g(the)g(state)g(of)g(the)g(History)g(library)0 +1837 y(when)f(y)o(ou)f(w)o(an)o(t)f(to)g(use)i(the)f(history)g(functions)h +(in)g(y)o(our)f(program.)1725 2021 y(F)l(unction)-1899 b Fh(void)20 +b Fg(using)p 258 2021 18 3 v 20 w(history)j Ff(\(\))120 2083 +y Fo(Begin)g(a)f(session)g(in)h(whic)o(h)g(the)f(history)g(functions)g(migh)o +(t)g(b)q(e)h(used.)40 b(This)23 b(initializes)i(the)120 2145 +y(in)o(teractiv)o(e)16 b(v)m(ariables.)1725 2328 y(F)l(unction)-1899 +b Fh(HISTORY_STATE)21 b(*)e Fg(history)p 582 2328 V 21 w(get)p +680 2328 V 21 w(history)p 876 2328 V 21 w(state)j Ff(\(\))120 +2391 y Fo(Return)16 b(a)f(structure)g(describing)i(the)e(curren)o(t)g(state)f +(of)h(the)g(input)i(history)l(.)1725 2574 y(F)l(unction)-1899 +b Fh(void)20 b Fg(history)p 302 2574 V 20 w(set)p 393 2574 +V 21 w(history)p 589 2574 V 21 w(state)j Ff(\()p Fn(HISTORY_STATE)13 +b(*state)p Ff(\))120 2636 y Fo(Set)i(the)h(state)e(of)h(the)g(history)g(list) +h(according)g(to)e Fj(state)p Fo(.)p eop +%%Page: 7 9 +8 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1039 +b(7)0 158 y Fi(2.3.2)30 b(History)15 b(List)g(Managemen)n(t)62 +295 y Fo(These)i(functions)h(manage)e(individual)k(en)o(tries)d(on)f(the)h +(history)g(list,)g(or)f(set)h(parameters)e(managing)i(the)0 +358 y(list)f(itself.)1725 520 y(F)l(unction)-1899 b Fh(void)20 +b Fg(add)p 219 520 18 3 v 20 w(history)j Ff(\()p Fn(char)14 +b(*string)p Ff(\))120 582 y Fo(Place)j Fj(string)k Fo(at)16 +b(the)g(end)i(of)e(the)g(history)h(list.)25 b(The)17 b(asso)q(ciated)g(data)f +(\014eld)h(\(if)g(an)o(y\))f(is)h(set)g(to)120 644 y Fn(NULL)p +Fo(.)1725 806 y(F)l(unction)-1899 b Fh(HIST_ENTRY)21 b(*)e +Fg(remo)n(v)n(e)p 509 806 V 20 w(history)k Ff(\()p Fn(int)14 +b(which)p Ff(\))120 868 y Fo(Remo)o(v)o(e)d(history)g(en)o(try)g(at)g +(o\013set)f Fj(whic)o(h)i Fo(from)f(the)g(history)l(.)19 b(The)11 +b(remo)o(v)o(ed)g(elemen)o(t)h(is)g(returned)120 930 y(so)j(y)o(ou)g(can)g +(free)g(the)h(line,)g(data,)e(and)i(con)o(taining)g(structure.)1725 +1092 y(F)l(unction)-1899 b Fh(HIST_ENTRY)21 b(*)e Fg(replace)p +505 1092 V 22 w(history)p 702 1092 V 20 w(en)n(try)24 b Ff(\()p +Fn(int)14 b(which,)g(char)h(*line,)f(char)208 1155 y(*data)p +Ff(\))120 1217 y Fo(Mak)o(e)d(the)i(history)f(en)o(try)g(at)f(o\013set)h +Fj(whic)o(h)h Fo(ha)o(v)o(e)e Fj(line)17 b Fo(and)12 b Fj(data)p +Fo(.)19 b(This)12 b(returns)g(the)h(old)g(en)o(try)e(so)120 +1279 y(y)o(ou)i(can)g(disp)q(ose)h(of)e(the)h(data.)19 b(In)13 +b(the)g(case)g(of)f(an)h(in)o(v)m(alid)i Fj(whic)o(h)p Fo(,)f(a)f +Fn(NULL)f Fo(p)q(oin)o(ter)i(is)f(returned.)1725 1441 y(F)l(unction)-1899 +b Fh(void)20 b Fg(sti\015e)p 245 1441 V 21 w(history)j Ff(\()p +Fn(int)14 b(max)p Ff(\))120 1503 y Fo(Sti\015e)i(the)f(history)h(list,)f +(remem)o(b)q(ering)h(only)g(the)f(last)g Fj(max)j Fo(en)o(tries.)1725 +1665 y(F)l(unction)-1899 b Fh(int)20 b Fg(unsti\015e)p 283 +1665 V 21 w(history)i Ff(\(\))120 1728 y Fo(Stop)13 b(sti\015ing)h(the)f +(history)l(.)19 b(This)14 b(returns)f(the)g(previous)h(amoun)o(t)e(the)h +(history)g(w)o(as)g(sti\015ed.)20 b(The)120 1790 y(v)m(alue)c(is)g(p)q +(ositiv)o(e)g(if)g(the)f(history)g(w)o(as)g(sti\015ed,)h(negativ)o(e)f(if)g +(it)h(w)o(asn't.)1725 1952 y(F)l(unction)-1899 b Fh(int)20 +b Fg(history)p 276 1952 V 20 w(is)p 334 1952 V 21 w(sti\015ed)k +Ff(\(\))120 2014 y Fo(Returns)16 b(non-zero)f(if)h(the)f(history)g(is)h +(sti\015ed,)g(zero)f(if)g(it)h(is)g(not.)0 2222 y Fi(2.3.3)30 +b(Information)14 b(Ab)r(out)h(the)g(History)g(List)62 2359 +y Fo(These)h(functions)g(return)f(information)g(ab)q(out)g(the)h(en)o(tire)f +(history)g(list)h(or)f(individual)j(list)f(en)o(tries.)1725 +2521 y(F)l(unction)-1899 b Fh(HIST_ENTRY)21 b(**)e Fg(history)p +530 2521 V 21 w(list)24 b Ff(\(\))120 2583 y Fo(Return)e(a)e +Fn(NULL)h Fo(terminated)g(arra)o(y)f(of)g Fn(HIST_ENTRY)g Fo(whic)o(h)i(is)f +(the)g(curren)o(t)g(input)h(history)l(.)120 2645 y(Elemen)o(t)16 +b(0)f(of)f(this)i(list)g(is)g(the)f(b)q(eginning)i(of)e(time.)20 +b(If)c(there)f(is)h(no)f(history)l(,)g(return)g Fn(NULL)p Fo(.)p +eop +%%Page: 8 10 +9 bop 0 -83 a Fo(8)1497 b(GNU)15 b(History)g(Library)1725 158 +y(F)l(unction)-1899 b Fh(int)20 b Fg(where)p 250 158 18 3 v +20 w(history)j Ff(\(\))120 221 y Fo(Returns)16 b(the)f(o\013set)f(of)h(the)g +(curren)o(t)g(history)g(elemen)o(t.)1725 378 y(F)l(unction)-1899 +b Fh(HIST_ENTRY)21 b(*)e Fg(curren)n(t)p 512 378 V 21 w(history)k +Ff(\(\))120 440 y Fo(Return)14 b(the)g(history)g(en)o(try)f(at)h(the)g +(curren)o(t)f(p)q(osition,)i(as)e(determined)j(b)o(y)d Fn(where_history)h +(\(\))p Fo(.)120 502 y(If)h(there)h(is)f(no)h(en)o(try)e(there,)h(return)g(a) +g Fn(NULL)g Fo(p)q(oin)o(ter.)1725 660 y(F)l(unction)-1899 +b Fh(HIST_ENTRY)21 b(*)e Fg(history)p 504 660 V 21 w(get)j +Ff(\()p Fn(int)15 b(offset)p Ff(\))120 722 y Fo(Return)g(the)g(history)f(en)o +(try)g(at)g(p)q(osition)i Fj(o\013set)p Fo(,)d(starting)h(from)g +Fn(history_base)p Fo(.)k(If)c(there)h(is)g(no)120 784 y(en)o(try)g(there,)g +(or)f(if)i Fj(o\013set)f Fo(is)h(greater)e(than)h(the)h(history)f(length,)g +(return)g(a)g Fn(NULL)g Fo(p)q(oin)o(ter.)1725 942 y(F)l(unction)-1899 +b Fh(int)20 b Fg(history)p 276 942 V 20 w(total)p 412 942 V +22 w(b)n(ytes)j Ff(\(\))120 1004 y Fo(Return)17 b(the)f(n)o(um)o(b)q(er)g(of) +g(b)o(ytes)g(that)f(the)h(primary)g(history)g(en)o(tries)h(are)e(using.)23 +b(This)17 b(function)120 1066 y(returns)e(the)g(sum)h(of)e(the)i(lengths)f +(of)g(all)h(the)g(lines)g(in)g(the)g(history)l(.)0 1265 y Fi(2.3.4)30 +b(Mo)n(ving)15 b(Around)h(the)f(History)g(List)62 1402 y Fo(These)h +(functions)g(allo)o(w)f(the)g(curren)o(t)h(index)g(in)o(to)f(the)h(history)f +(list)h(to)e(b)q(e)i(set)f(or)g(c)o(hanged.)1725 1559 y(F)l(unction)-1899 +b Fh(int)20 b Fg(history)p 276 1559 V 20 w(set)p 367 1559 V +21 w(p)r(os)h Ff(\()p Fn(int)15 b(pos)p Ff(\))120 1621 y Fo(Set)g(the)h(p)q +(osition)g(in)g(the)f(history)g(list)h(to)f Fj(p)q(os)p Fo(,)g(an)g(absolute) +g(index)i(in)o(to)e(the)g(list.)1725 1779 y(F)l(unction)-1899 +b Fh(HIST_ENTRY)21 b(*)e Fg(previous)p 540 1779 V 20 w(history)k +Ff(\(\))120 1841 y Fo(Bac)o(k)16 b(up)h(the)g(curren)o(t)f(history)h +(o\013set)e(to)h(the)h(previous)g(history)g(en)o(try)l(,)f(and)h(return)f(a)g +(p)q(oin)o(ter)120 1903 y(to)f(that)f(en)o(try)l(.)20 b(If)15 +b(there)g(is)h(no)f(previous)h(en)o(try)l(,)f(return)g(a)g +Fn(NULL)g Fo(p)q(oin)o(ter.)1725 2061 y(F)l(unction)-1899 b +Fh(HIST_ENTRY)21 b(*)e Fg(next)p 439 2061 V 21 w(history)k +Ff(\(\))120 2123 y Fo(Mo)o(v)o(e)c(the)h(curren)o(t)g(history)f(o\013set)g +(forw)o(ard)g(to)g(the)h(next)g(history)g(en)o(try)l(,)g(and)g(return)g(the)g +(a)120 2185 y(p)q(oin)o(ter)c(to)e(that)h(en)o(try)l(.)k(If)d(there)f(is)h +(no)f(next)g(en)o(try)l(,)g(return)g(a)g Fn(NULL)g Fo(p)q(oin)o(ter.)0 +2384 y Fi(2.3.5)30 b(Searc)n(hing)15 b(the)h(History)f(List)62 +2521 y Fo(These)e(functions)g(allo)o(w)f(searc)o(hing)h(of)f(the)g(history)g +(list)h(for)f(en)o(tries)h(con)o(taining)g(a)f(sp)q(eci\014c)i(string.)19 +b(Searc)o(h-)0 2583 y(ing)e(ma)o(y)g(b)q(e)g(p)q(erformed)g(b)q(oth)g(forw)o +(ard)f(and)h(bac)o(kw)o(ard)f(from)g(the)h(curren)o(t)f(history)h(p)q +(osition.)26 b(The)17 b(searc)o(h)0 2645 y(ma)o(y)d(b)q(e)i +Fj(anc)o(hored)p Fo(,)f(meaning)h(that)f(the)g(string)g(m)o(ust)g(matc)o(h)f +(at)h(the)g(b)q(eginning)i(of)e(the)h(history)f(en)o(try)l(.)p +eop +%%Page: 9 11 +10 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1039 +b(9)1725 158 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p +276 158 18 3 v 20 w(searc)n(h)j Ff(\()p Fn(char)14 b(*string,)g(int)h +(direction)p Ff(\))120 221 y Fo(Searc)o(h)k(the)g(history)g(for)f +Fj(string)p Fo(,)i(starting)e(at)g(the)h(curren)o(t)g(history)g(o\013set.)30 +b(If)19 b Fj(direction)h Fn(<)f Fo(0,)120 283 y(then)14 b(the)f(searc)o(h)g +(is)h(through)e(previous)i(en)o(tries,)g(else)g(through)f(subsequen)o(t.)20 +b(If)13 b Fj(string)k Fo(is)d(found,)120 345 y(then)f(the)g(curren)o(t)g +(history)g(index)i(is)e(set)g(to)f(that)h(history)g(en)o(try)l(,)f(and)i(the) +f(v)m(alue)h(returned)f(is)h(the)120 407 y(o\013set)h(in)i(the)f(line)i(of)d +(the)h(en)o(try)g(where)g Fj(string)k Fo(w)o(as)c(found.)22 +b(Otherwise,)17 b(nothing)f(is)h(c)o(hanged,)120 470 y(and)e(a)g(-1)g(is)h +(returned.)1725 659 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p +276 659 V 20 w(searc)n(h)p 452 659 V 21 w(pre\014x)i Ff(\()p +Fn(char)15 b(*string,)f(int)g(direction)p Ff(\))120 721 y Fo(Searc)o(h)22 +b(the)h(history)f(for)f Fj(string)p Fo(,)j(starting)e(at)f(the)i(curren)o(t)f +(history)g(o\013set.)40 b(The)22 b(searc)o(h)g(is)120 783 y(anc)o(hored:)i +(matc)o(hing)18 b(lines)h(m)o(ust)d(b)q(egin)j(with)f Fj(string)p +Fo(.)26 b(If)17 b Fj(direction)i Fn(<)e Fo(0,)g(then)h(the)f(searc)o(h)g(is) +120 845 y(through)e(previous)h(en)o(tries,)f(else)i(through)d(subsequen)o(t.) +21 b(If)16 b Fj(string)j Fo(is)d(found,)f(then)h(the)f(curren)o(t)120 +908 y(history)20 b(index)i(is)e(set)g(to)g(that)f(en)o(try)l(,)i(and)f(the)g +(return)h(v)m(alue)g(is)g(0.)34 b(Otherwise,)22 b(nothing)e(is)120 +970 y(c)o(hanged,)15 b(and)h(a)e(-1)h(is)h(returned.)1725 1159 +y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p 276 1159 V 20 +w(searc)n(h)p 452 1159 V 21 w(p)r(os)h Ff(\()p Fn(char)15 b(*string,)f(int)g +(direction,)g(int)h(pos)p Ff(\))120 1221 y Fo(Searc)o(h)d(for)f +Fj(string)k Fo(in)d(the)g(history)f(list,)i(starting)e(at)g +Fj(p)q(os)p Fo(,)h(an)f(absolute)h(index)h(in)o(to)e(the)h(list.)19 +b(If)12 b Fj(di-)120 1283 y(rection)g Fo(is)h(negativ)o(e,)f(the)g(searc)o(h) +g(pro)q(ceeds)h(bac)o(kw)o(ard)e(from)g Fj(p)q(os)p Fo(,)i(otherwise)f(forw)o +(ard.)17 b(Returns)120 1345 y(the)e(absolute)h(index)g(of)f(the)g(history)h +(elemen)o(t)f(where)h Fj(string)j Fo(w)o(as)14 b(found,)h(or)g(-1)g +(otherwise.)0 1634 y Fi(2.3.6)30 b(Managing)14 b(the)i(History)f(File)62 +1780 y Fo(The)f(History)g(library)h(can)f(read)g(the)g(history)g(from)f(and)i +(write)f(it)g(to)f(a)h(\014le.)20 b(This)15 b(section)g(do)q(cumen)o(ts)f +(the)0 1842 y(functions)i(for)f(managing)g(a)f(history)i(\014le.)1725 +2031 y(F)l(unction)-1899 b Fh(int)20 b Fg(read)p 211 2031 V +20 w(history)i Ff(\()p Fn(char)15 b(*filename)p Ff(\))120 2093 +y Fo(Add)i(the)f(con)o(ten)o(ts)g(of)g Fj(\014lename)k Fo(to)c(the)h(history) +f(list,)h(a)f(line)i(at)e(a)g(time.)24 b(If)17 b Fj(\014lename)j +Fo(is)d Fn(NULL)p Fo(,)120 2155 y(then)f(read)f(from)f(`)p +Fn(~/.history)p Fo('.)k(Returns)e(0)e(if)i(successful,)g(or)f(errno)g(if)h +(not.)1725 2344 y(F)l(unction)-1899 b Fh(int)20 b Fg(read)p +211 2344 V 20 w(history)p 406 2344 V 20 w(range)i Ff(\()p Fn(char)15 +b(*filename,)e(int)i(from,)g(int)f(to)p Ff(\))120 2407 y Fo(Read)j(a)e(range) +h(of)f(lines)j(from)d Fj(\014lename)p Fo(,)i(adding)f(them)g(to)f(the)h +(history)g(list.)23 b(Start)15 b(reading)i(at)120 2469 y(line)f +Fj(from)f Fo(and)g(end)g(at)f Fj(to)p Fo(.)19 b(If)d Fj(from)e +Fo(is)h(zero,)f(start)g(at)g(the)h(b)q(eginning.)22 b(If)15 +b Fj(to)i Fo(is)e(less)g(than)g Fj(from)p Fo(,)120 2531 y(then)i(read)g(un)o +(til)h(the)f(end)g(of)g(the)g(\014le.)25 b(If)17 b Fj(\014lename)k +Fo(is)c Fn(NULL)p Fo(,)f(then)i(read)e(from)g(`)p Fn(~/.history)p +Fo('.)120 2593 y(Returns)g(0)f(if)g(successful,)h(or)f Fn(errno)g +Fo(if)g(not.)p eop +%%Page: 10 12 +11 bop 0 -83 a Fo(10)1474 b(GNU)15 b(History)g(Library)1725 +158 y(F)l(unction)-1899 b Fh(int)20 b Fg(write)p 229 158 18 +3 v 22 w(history)i Ff(\()p Fn(char)15 b(*filename)p Ff(\))120 +221 y Fo(W)l(rite)20 b(the)g(curren)o(t)f(history)h(to)f Fj(\014lename)p +Fo(,)i(o)o(v)o(erwriting)f Fj(\014lename)j Fo(if)d(necessary)l(.)34 +b(If)20 b Fj(\014lename)120 283 y Fo(is)d Fn(NULL)p Fo(,)g(then)g(write)g +(the)g(history)g(list)h(to)e(`)p Fn(~/.history)p Fo('.)23 b(V)l(alues)18 +b(returned)g(are)e(as)h(in)h Fn(read_)120 345 y(history)c(\(\))p +Fo(.)1725 504 y(F)l(unction)-1899 b Fh(int)20 b Fg(app)r(end)p +285 504 V 19 w(history)j Ff(\()p Fn(int)14 b(nelements,)g(char)h(*filename)p +Ff(\))120 566 y Fo(App)q(end)i(the)e(last)g Fj(nelemen)o(ts)j +Fo(of)d(the)g(history)g(list)h(to)f Fj(\014lename)p Fo(.)1725 +724 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p 276 724 +V 20 w(truncate)p 507 724 V 21 w(\014le)k Ff(\()p Fn(char)14 +b(*filename,)g(int)h(nlines)p Ff(\))120 787 y Fo(T)l(runcate)g(the)h(history) +f(\014le)h Fj(\014lename)p Fo(,)g(lea)o(ving)g(only)g(the)f(last)g +Fj(nlines)k Fo(lines.)0 988 y Fi(2.3.7)30 b(History)15 b(Expansion)62 +1125 y Fo(These)h(functions)g(implemen)o(t)g Fn(csh)p Fo(-lik)o(e)g(history)g +(expansion.)1725 1283 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p +276 1283 V 20 w(expand)j Ff(\()p Fn(char)14 b(*string,)g(char)h(**output)p +Ff(\))120 1345 y Fo(Expand)20 b Fj(string)p Fo(,)f(placing)i(the)e(result)h +(in)o(to)f Fj(output)p Fo(,)h(a)f(p)q(oin)o(ter)h(to)e(a)h(string)h(\(see)f +(Section)h(1.1)120 1408 y([History)15 b(In)o(teraction],)f(page)h(1\).)20 +b(Returns:)120 1555 y Fn(0)216 b Fo(If)21 b(no)g(expansions)h(to)q(ok)e +(place)h(\(or,)g(if)h(the)f(only)g(c)o(hange)g(in)h(the)f(text)f(w)o(as)g +(the)360 1618 y(de-slashifying)d(of)e(the)g(history)h(expansion)g(c)o +(haracter\);)120 1701 y Fn(1)216 b Fo(if)16 b(expansions)g(did)g(tak)o(e)e +(place;)120 1785 y Fn(-1)192 b Fo(if)16 b(there)f(w)o(as)f(an)h(error)g(in)h +(expansion;)120 1869 y Fn(2)216 b Fo(if)14 b(the)f(returned)h(line)h(should)f +(only)g(b)q(e)f(displa)o(y)o(ed,)i(but)e(not)g(executed,)h(as)f(with)h(the) +360 1931 y Fn(:p)h Fo(mo)q(di\014er)h(\(see)f(Section)h(1.1.3)e([Mo)q +(di\014ers],)h(page)g(2\).)120 2079 y(If)g(an)h(error)e(o)q(curred)i(in)g +(expansion,)f(then)h Fj(output)g Fo(con)o(tains)f(a)g(descriptiv)o(e)i(error) +d(message.)1725 2238 y(F)l(unction)-1899 b Fh(char)20 b(*)f +Fg(history)p 347 2238 V 21 w(arg)p 449 2238 V 19 w(extract)24 +b Ff(\()p Fn(int)14 b(first,)h(int)g(last,)f(char)h(*string)p +Ff(\))120 2300 y Fo(Extract)10 b(a)h(string)g(segmen)o(t)g(consisting)h(of)f +(the)g Fj(\014rst)h Fo(through)f Fj(last)h Fo(argumen)o(ts)e(presen)o(t)h(in) +h Fj(string)p Fo(.)120 2362 y(Argumen)o(ts)j(are)g(brok)o(en)g(up)g(as)g(in)h +(Bash.)1725 2521 y(F)l(unction)-1899 b Fh(char)20 b(*)f Fg(get)p +249 2521 V 21 w(history)p 445 2521 V 20 w(ev)n(en)n(t)25 b +Ff(\()p Fn(char)14 b(*string,)g(int)h(*cindex,)f(int)h(qchar)p +Ff(\))120 2583 y Fo(Returns)e(the)f(text)f(of)h(the)g(history)g(ev)o(en)o(t)f +(b)q(eginning)k(at)c Fj(string)16 b Fn(+)c Fj(*cindex)p Fo(.)20 +b Fj(*cindex)c Fo(is)d(mo)q(di\014ed)120 2645 y(to)h(p)q(oin)o(t)h(to)f +(after)h(the)f(ev)o(en)o(t)h(sp)q(eci\014er.)21 b(A)o(t)15 +b(function)g(en)o(try)l(,)f Fj(cindex)20 b Fo(p)q(oin)o(ts)15 +b(to)f(the)h(index)h(in)o(to)p eop +%%Page: 11 13 +12 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1017 +b(11)120 158 y Fj(string)17 b Fo(where)d(the)f(history)h(ev)o(en)o(t)f(sp)q +(eci\014cation)i(b)q(egins.)20 b Fj(qc)o(har)d Fo(is)c(a)g(c)o(haracter)g +(that)g(is)h(allo)o(w)o(ed)120 221 y(to)h(end)g(the)h(ev)o(en)o(t)f(sp)q +(eci\014cation)i(in)f(addition)g(to)f(the)g(\\normal")g(terminating)g(c)o +(haracters.)1725 394 y(F)l(unction)-1899 b Fh(char)20 b(**)f +Fg(history)p 373 394 18 3 v 21 w(tok)n(enize)25 b Ff(\()p Fn(char)14 +b(*string)p Ff(\))120 456 y Fo(Return)k(an)f(arra)o(y)f(of)h(tok)o(ens)f +(parsed)i(out)e(of)h Fj(string)p Fo(,)g(m)o(uc)o(h)h(as)e(the)i(shell)g(migh) +o(t.)26 b(The)17 b(tok)o(ens)120 519 y(are)c(split)h(on)f(white)g(space)h +(and)f(on)g(the)g(c)o(haracters)f Fn(\(\)<>;&|$)p Fo(,)g(and)h(shell)i +(quoting)e(con)o(v)o(en)o(tions)120 581 y(are)i(ob)q(ey)o(ed.)0 +840 y Fm(2.4)33 b(History)15 b(V)-6 b(ariables)62 981 y Fo(This)16 +b(section)g(describ)q(es)h(the)e(externally)h(visible)i(v)m(ariables)e(exp)q +(orted)g(b)o(y)f(the)g(GNU)g(History)g(Library)l(.)1736 1155 +y(V)l(ariable)-1899 b Fh(int)20 b Fg(history)p 276 1155 V 20 +w(base)120 1217 y Fo(The)15 b(logical)i(o\013set)d(of)h(the)g(\014rst)g(en)o +(try)g(in)h(the)f(history)g(list.)1736 1390 y(V)l(ariable)-1899 +b Fh(int)20 b Fg(history)p 276 1390 V 20 w(length)120 1453 +y Fo(The)15 b(n)o(um)o(b)q(er)h(of)f(en)o(tries)g(curren)o(tly)h(stored)f(in) +h(the)f(history)g(list.)1736 1626 y(V)l(ariable)-1899 b Fh(int)20 +b Fg(max)p 208 1626 V 19 w(input)p 360 1626 V 21 w(history)120 +1689 y Fo(The)12 b(maxim)o(um)g(n)o(um)o(b)q(er)g(of)f(history)h(en)o(tries.) +19 b(This)12 b(m)o(ust)f(b)q(e)h(c)o(hanged)g(using)h Fn(stifle_history)120 +1751 y(\(\))p Fo(.)1736 1924 y(V)l(ariable)-1899 b Fh(char)20 +b Fg(history)p 302 1924 V 20 w(expansion)p 569 1924 V 21 w(c)n(har)120 +1987 y Fo(The)15 b(c)o(haracter)g(that)f(starts)g(a)h(history)g(ev)o(en)o(t.) +20 b(The)15 b(default)h(is)g(`)p Fn(!)p Fo('.)1736 2160 y(V)l(ariable)-1899 +b Fh(char)20 b Fg(history)p 302 2160 V 20 w(subst)p 454 2160 +V 20 w(c)n(har)120 2222 y Fo(The)13 b(c)o(haracter)e(that)h(in)o(v)o(ok)o(es) +g(w)o(ord)g(substitution)h(if)g(found)g(at)e(the)i(start)e(of)h(a)g(line.)21 +b(The)12 b(default)120 2285 y(is)k(`)p Fn(^)p Fo('.)1736 2458 +y(V)l(ariable)-1899 b Fh(char)20 b Fg(history)p 302 2458 V +20 w(commen)n(t)p 552 2458 V 19 w(c)n(har)120 2521 y Fo(During)12 +b(tok)o(enization,)h(if)f(this)h(c)o(haracter)e(is)i(seen)f(as)g(the)g +(\014rst)f(c)o(haracter)g(of)h(a)g(w)o(ord,)f(then)i(it)f(and)120 +2583 y(all)19 b(subsequen)o(t)g(c)o(haracters)e(up)h(to)g(a)f(newline)j(are)e +(ignored,)h(suppressing)g(history)f(expansion)120 2645 y(for)d(the)g +(remainder)h(of)f(the)g(line.)21 b(This)16 b(is)g(disabled)h(b)o(y)e +(default.)p eop +%%Page: 12 14 +13 bop 0 -83 a Fo(12)1474 b(GNU)15 b(History)g(Library)1736 +158 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(history)p 347 +158 18 3 v 21 w(no)p 429 158 V 20 w(expand)p 629 158 V 20 w(c)n(hars)120 +221 y Fo(The)f(list)g(of)g(c)o(haracters)e(whic)o(h)j(inhibit)h(history)d +(expansion)i(if)f(found)g(immediately)h(follo)o(wing)120 283 +y Fj(history)p 261 283 14 2 v 16 w(expansion)p 472 283 V 18 +w(c)o(har)p Fo(.)g(The)d(default)f(is)h(whitespace)g(and)g(`)p +Fn(=)p Fo('.)0 575 y Fm(2.5)33 b(History)15 b(Programming)h(Example)62 +720 y Fo(The)g(follo)o(wing)g(program)e(demonstrates)g(simple)j(use)e(of)g +(the)g(GNU)g(History)g(Library)l(.)120 852 y Fn(main)23 b(\(\))120 +902 y({)168 951 y(char)g(line[1024],)f(*t;)168 1001 y(int)h(len,)g(done)h(=)g +(0;)168 1101 y(line[0])f(=)g(0;)168 1201 y(using_history)f(\(\);)168 +1250 y(while)h(\(!done\))215 1300 y({)263 1350 y(printf)g(\("history$)g("\);) +263 1400 y(fflush)g(\(stdout\);)263 1450 y(t)h(=)g(fgets)f(\(line,)g(sizeof)g +(\(line\))g(-)h(1,)f(stdin\);)263 1499 y(if)h(\(t)f(&&)h(*t\))311 +1549 y({)359 1599 y(len)f(=)h(strlen)f(\(t\);)359 1649 y(if)g(\(t[len)g(-)h +(1])g(==)f('\\n'\))406 1699 y(t[len)h(-)f(1])h(=)g('\\0';)311 +1748 y(})263 1848 y(if)g(\(!t\))311 1898 y(strcpy)f(\(line,)g("quit"\);)263 +1998 y(if)h(\(line[0]\))311 2047 y({)359 2097 y(char)f(*expansion;)359 +2147 y(int)g(result;)359 2247 y(result)g(=)g(history_expand)f(\(line,)h +(&expansion\);)359 2296 y(if)g(\(result\))406 2346 y(fprintf)g(\(stderr,)g +("\045s\\n",)g(expansion\);)359 2446 y(if)g(\(result)g(<)h(0)g(||)f(result)g +(==)h(2\))406 2496 y({)454 2545 y(free)f(\(expansion\);)454 +2595 y(continue;)406 2645 y(})p eop +%%Page: 13 15 +14 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1017 +b(13)359 208 y Fn(add_history)22 b(\(expansion\);)359 258 y(strncpy)h +(\(line,)g(expansion,)f(sizeof)h(\(line\))g(-)h(1\);)359 308 +y(free)f(\(expansion\);)311 358 y(})263 457 y(if)h(\(strcmp)f(\(line,)g +("quit"\))g(==)g(0\))311 507 y(done)g(=)h(1;)263 557 y(else)f(if)h(\(strcmp)f +(\(line,)g("save"\))g(==)h(0\))311 607 y(write_history)e(\("history_file"\);) +263 656 y(else)h(if)h(\(strcmp)f(\(line,)g("read"\))g(==)h(0\))311 +706 y(read_history)e(\("history_file"\);)263 756 y(else)h(if)h(\(strcmp)f +(\(line,)g("list"\))g(==)h(0\))311 806 y({)359 856 y(register)e(HIST_ENTRY)h +(**the_list;)359 906 y(register)f(int)i(i;)359 1005 y(the_list)e(=)i +(history_list)e(\(\);)359 1055 y(if)h(\(the_list\))406 1105 +y(for)h(\(i)f(=)h(0;)g(the_list[i];)e(i++\))454 1155 y(printf)h(\("\045d:)g +(\045s\\n",)g(i)h(+)g(history_base,)e(the_list[i]->line\);)311 +1204 y(})263 1254 y(else)h(if)h(\(strncmp)f(\(line,)g("delete",)g(6\))g(==)h +(0\))311 1304 y({)359 1354 y(int)f(which;)359 1404 y(if)g(\(\(sscanf)g +(\(line)g(+)h(6,)f("\045d",)h(&which\)\))e(==)i(1\))406 1453 +y({)454 1503 y(HIST_ENTRY)f(*entry)g(=)g(remove_history)f(\(which\);)454 +1553 y(if)i(\(!entry\))502 1603 y(fprintf)f(\(stderr,)f("No)i(such)f(entry)g +(\045d\\n",)g(which\);)454 1653 y(else)502 1703 y({)550 1752 +y(free)g(\(entry->line\);)550 1802 y(free)g(\(entry\);)502 +1852 y(})406 1902 y(})359 1952 y(else)406 2001 y({)454 2051 +y(fprintf)g(\(stderr,)g("non-numeric)f(arg)h(given)h(to)f(`delete'\\n"\);)406 +2101 y(})311 2151 y(})215 2201 y(})120 2250 y(})p eop +%%Page: 14 16 +15 bop 0 -83 a Fo(14)1474 b(GNU)15 b(History)g(Library)p eop +%%Page: 15 17 +16 bop 0 -83 a Fo(App)q(endix)17 b(A:)e(Concept)g(Index)1346 +b(15)0 158 y Fk(App)r(endix)13 b(A)41 b(Concept)15 b(Index)0 +405 y Fm(A)0 471 y Fe(anc)o(hored)f(searc)o(h)5 b Fd(:)i(:)f(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(8)0 +579 y Fm(E)0 646 y Fe(ev)o(en)o(t)13 b(designators)g Fd(:)6 +b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 +b Fe(1)1015 405 y(expansion)5 b Fd(:)k(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(1)1015 +521 y Fm(H)1015 587 y Fe(history)d(ev)o(en)o(ts)5 b Fd(:)i(:)f(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b +Fe(1)1015 646 y(History)c(Searc)o(hing)7 b Fd(:)h(:)e(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(8)p eop +%%Page: 16 18 +17 bop 0 -83 a Fo(16)1474 b(GNU)15 b(History)g(Library)p eop +%%Page: 17 19 +18 bop 0 -83 a Fo(App)q(endix)17 b(B:)e(F)l(unction)h(and)g(V)l(ariable)g +(Index)1069 b(17)0 158 y Fk(App)r(endix)13 b(B)41 b(F)-7 b(unction)15 +b(and)g(V)-7 b(ariable)14 b(Index)0 405 y Fm(A)0 471 y Fc(add)p +62 471 12 2 v 13 w(history)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fe(7)0 529 y Fc(append)p +122 529 V 12 w(history)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)24 b Fe(10)0 654 y Fm(C)0 720 y Fc(current)p +142 720 V 11 w(history)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)24 b Fe(8)0 845 y Fm(G)0 911 y Fc(get)p 62 911 +V 13 w(history)p 215 911 V 11 w(event)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)23 b Fe(10)0 1036 y Fm(H)0 1102 y Fc(history)p +142 1102 V 11 w(arg)p 213 1102 V 13 w(extract)8 b Fd(:)t(:)e(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)21 b Fe(10)0 1160 y Fc(history)p 142 1160 +V 11 w(base)e Fd(:)6 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)20 b Fe(11)0 1218 y Fc(history)p 142 1218 V 11 w(comment)p +293 1218 V 12 w(char)g Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21 +b Fe(11)0 1276 y Fc(history)p 142 1276 V 11 w(expand)10 b Fd(:)c(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fe(10)0 +1335 y Fc(history)p 142 1335 V 11 w(expansion)p 333 1335 V +11 w(char)17 b Fd(:)7 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(11)0 +1393 y Fc(history)p 142 1393 V 11 w(get)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)h(:) +f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fe(8)0 +1451 y Fc(history)p 142 1451 V 11 w(get)p 213 1451 V 13 w(history)p +366 1451 V 12 w(state)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(6)0 +1509 y Fc(history)p 142 1509 V 11 w(is)p 193 1509 V 14 w(stifled)7 +b Fd(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 b +Fe(7)0 1567 y Fc(history)p 142 1567 V 11 w(length)16 b Fd(:)6 +b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 +b Fe(11)0 1625 y Fc(history)p 142 1625 V 11 w(list)7 b Fd(:)t(:)g(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)19 +b Fe(7)0 1683 y Fc(history)p 142 1683 V 11 w(no)p 193 1683 +V 14 w(expand)p 327 1683 V 12 w(chars)f Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 +b Fe(12)0 1741 y Fc(history)p 142 1741 V 11 w(search)t Fd(:)t(:)6 +b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 +b Fe(9)0 1800 y Fc(history)p 142 1800 V 11 w(search)p 273 1800 +V 12 w(pos)9 b Fd(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 +b Fe(9)0 1858 y Fc(history)p 142 1858 V 11 w(search)p 273 1858 +V 12 w(prefix)6 b Fd(:)t(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 +b Fe(9)0 1916 y Fc(history)p 142 1916 V 11 w(set)p 213 1916 +V 13 w(history)p 366 1916 V 12 w(state)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 +b Fe(6)0 1974 y Fc(history)p 142 1974 V 11 w(set)p 213 1974 +V 13 w(pos)5 b Fd(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)18 b Fe(8)0 2032 y Fc(history)p 142 2032 V 11 w(subst)p +253 2032 V 13 w(char)k Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)24 +b Fe(11)1015 405 y Fc(history)p 1157 405 V 12 w(tokenize)9 +b Fd(:)s(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)22 +b Fe(11)1015 463 y Fc(history)p 1157 463 V 12 w(total)p 1269 +463 V 12 w(bytes)9 b Fd(:)t(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 +b Fe(8)1015 521 y Fc(history)p 1157 521 V 12 w(truncate)p 1329 +521 V 11 w(file)5 b Fd(:)g(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) +f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 +b Fe(10)1015 629 y Fm(M)1015 695 y Fc(max)p 1077 695 V 13 w(input)p +1190 695 V 13 w(history)14 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)17 b Fe(11)1015 803 y Fm(N)1015 870 y Fc(next)p 1097 +870 V 13 w(history)7 b Fd(:)s(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(8)1015 978 y Fm(P)1015 1044 +y Fc(previous)p 1177 1044 V 12 w(history)7 b Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(8)1015 1152 y Fm(R)1015 +1218 y Fc(read)p 1097 1218 V 13 w(history)7 b Fd(:)s(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(9)1015 +1276 y Fc(read)p 1097 1276 V 13 w(history)p 1250 1276 V 11 +w(range)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 +b Fe(9)1015 1335 y Fc(remove)p 1137 1335 V 12 w(history)t Fd(:)t(:)6 +b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)17 +b Fe(7)1015 1393 y Fc(replace)p 1157 1393 V 12 w(history)p +1309 1393 V 11 w(entry)6 b Fd(:)f(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)19 +b Fe(7)1015 1501 y Fm(S)1015 1567 y Fc(stifle)p 1137 1567 V +12 w(history)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)17 b Fe(7)1015 1675 y Fm(U)1015 1741 y Fc(unstifle)p +1177 1741 V 12 w(history)7 b Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)23 b Fe(7)1015 1800 y Fc(using)p 1117 1800 V +13 w(history)5 b Fd(:)s(:)h(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)18 b Fe(6)1015 1907 y Fm(W)1015 1974 y Fc(where)p +1117 1974 V 13 w(history)5 b Fd(:)s(:)h(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)18 b Fe(8)1015 2032 y Fc(write)p +1117 2032 V 13 w(history)5 b Fd(:)s(:)h(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)18 b Fe(9)p eop +%%Page: 18 20 +19 bop 0 -83 a Fo(18)1474 b(GNU)15 b(History)g(Library)p eop +%%Page: -1 21 +20 bop 1937 -83 a Fo(i)0 158 y Fk(T)-7 b(able)15 b(of)g(Con)n(ten)n(ts)0 +333 y Fm(1)67 b(Using)22 b(History)h(In)n(teractiv)n(ely)9 +b Fb(:)k(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)31 b Fm(1)149 411 y Fo(1.1)45 +b(History)15 b(In)o(teraction)9 b Fa(:)f(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23 +b Fo(1)299 473 y(1.1.1)44 b(Ev)o(en)o(t)14 b(Designators)6 +b Fa(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)20 b Fo(1)299 535 y(1.1.2)44 b(W)l(ord)15 b(Designators)9 +b Fa(:)d(:)h(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)23 b Fo(2)299 597 y(1.1.3)44 b(Mo)q(di\014ers)14 +b Fa(:)8 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:) +g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)28 b Fo(2)0 722 +y Fm(2)67 b(Programming)23 b(with)g(GNU)f(History)13 b Fb(:)e(:)f(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 b +Fm(5)149 800 y Fo(2.1)45 b(In)o(tro)q(duction)16 b(to)f(History)6 +b Fa(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)20 b Fo(5)149 862 y(2.2)45 b(History)15 +b(Storage)d Fa(:)7 b(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)27 +b Fo(5)149 924 y(2.3)45 b(History)15 b(F)l(unctions)c Fa(:)d(:)f(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)25 b Fo(6)299 986 y(2.3.1)44 b(Initializing)18 +b(History)d(and)h(State)e(Managemen)o(t)f Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)h(:)27 b Fo(6)299 1049 y(2.3.2)44 b(History)15 +b(List)h(Managemen)o(t)c Fa(:)7 b(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)28 b Fo(7)299 1111 y(2.3.3)44 b(Information)15 b(Ab)q(out)g(the)h(History) +f(List)5 b Fa(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)19 b Fo(7)299 1173 y(2.3.4)44 b(Mo)o(ving)15 +b(Around)g(the)g(History)g(List)6 b Fa(:)i(:)f(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:) +g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)20 +b Fo(8)299 1236 y(2.3.5)44 b(Searc)o(hing)16 b(the)f(History)g(List)7 +b Fa(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)21 b +Fo(8)299 1298 y(2.3.6)44 b(Managing)15 b(the)g(History)g(File)5 +b Fa(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)19 b +Fo(9)299 1360 y(2.3.7)44 b(History)15 b(Expansion)d Fa(:)7 +b(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)26 +b Fo(10)149 1422 y(2.4)45 b(History)15 b(V)l(ariables)5 b Fa(:)k(:)e(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)20 b Fo(11)149 1485 y(2.5)45 b(History)15 +b(Programming)f(Example)8 b Fa(:)g(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:) +g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)23 b Fo(12)0 1609 y Fm(App)r(endix)h(A)67 b(Concept)22 +b(Index)15 b Fb(:)c(:)f(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)37 b Fm(15)0 1749 +y(App)r(endix)24 b(B)67 b(F)-6 b(unction)25 b(and)e(V)-6 b(ariable)24 +b(Index)8 b Fb(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)31 +b Fm(17)p eop +%%Page: -2 22 +21 bop 0 -83 a Fo(ii)1496 b(GNU)15 b(History)g(Library)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/doc/hstech.texinfo b/doc/hstech.texinfo new file mode 100644 index 0000000..5f0f600 --- /dev/null +++ b/doc/hstech.texinfo @@ -0,0 +1,489 @@ +@ignore +This file documents the user interface to the GNU History library. + +Copyright (C) 1988, 1991 Free Software Foundation, Inc. +Authored by Brian Fox and Chet Ramey. + +Permission is granted to make and distribute verbatim copies of this manual +provided the copyright notice and this permission notice are preserved on +all copies. + +Permission is granted to process this file through Tex and print the +results, provided the printed document carries copying permission notice +identical to this one except for the removal of this paragraph (this +paragraph not being relevant to the printed manual). + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided also that the +GNU Copyright statement is available to the distributee, and provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions. +@end ignore + +@node Programming with GNU History +@chapter Programming with GNU History + +This chapter describes how to interface programs that you write +with the GNU History Library. +It should be considered a technical guide. +For information on the interactive use of GNU History, @pxref{Using +History Interactively}. + +@menu +* Introduction to History:: What is the GNU History library for? +* History Storage:: How information is stored. +* History Functions:: Functions that you can use. +* History Variables:: Variables that control behaviour. +* History Programming Example:: Example of using the GNU History Library. +@end menu + +@node Introduction to History +@section Introduction to History + +Many programs read input from the user a line at a time. The GNU History +library is able to keep track of those lines, associate arbitrary data with +each line, and utilize information from previous lines in composing new +ones. + +The programmer using the History library has available functions +for remembering lines on a history list, associating arbitrary data +with a line, removing lines from the list, searching through the list +for a line containing an arbitrary text string, and referencing any line +in the list directly. In addition, a history @dfn{expansion} function +is available which provides for a consistent user interface across +different programs. + +The user using programs written with the History library has the +benefit of a consistent user interface with a set of well-known +commands for manipulating the text of previous lines and using that text +in new commands. The basic history manipulation commands are similar to +the history substitution provided by @code{csh}. + +If the programmer desires, he can use the Readline library, which +includes some history manipulation by default, and has the added +advantage of command line editing. + +@node History Storage +@section History Storage + +The history list is an array of history entries. A history entry is +declared as follows: + +@example +typedef struct _hist_entry @{ + char *line; + char *data; +@} HIST_ENTRY; +@end example + +The history list itself might therefore be declared as + +@example +HIST_ENTRY **the_history_list; +@end example + +The state of the History library is encapsulated into a single structure: + +@example +/* A structure used to pass the current state of the history stuff around. */ +typedef struct _hist_state @{ + HIST_ENTRY **entries; /* Pointer to the entries themselves. */ + int offset; /* The location pointer within this array. */ + int length; /* Number of elements within this array. */ + int size; /* Number of slots allocated to this array. */ + int flags; +@} HISTORY_STATE; +@end example + +If the flags member includes @code{HS_STIFLED}, the history has been +stifled. + +@node History Functions +@section History Functions + +This section describes the calling sequence for the various functions +present in GNU History. + +@menu +* Initializing History and State Management:: Functions to call when you + want to use history in a + program. +* History List Management:: Functions used to manage the list + of history entries. +* Information About the History List:: Functions returning information about + the history list. +* Moving Around the History List:: Functions used to change the position + in the history list. +* Searching the History List:: Functions to search the history list + for entries containing a string. +* Managing the History File:: Functions that read and write a file + containing the history list. +* History Expansion:: Functions to perform csh-like history + expansion. +@end menu + +@node Initializing History and State Management +@subsection Initializing History and State Management + +This section describes functions used to initialize and manage +the state of the History library when you want to use the history +functions in your program. + +@deftypefun void using_history () +Begin a session in which the history functions might be used. This +initializes the interactive variables. +@end deftypefun + +@deftypefun {HISTORY_STATE *} history_get_history_state () +Return a structure describing the current state of the input history. +@end deftypefun + +@deftypefun void history_set_history_state (HISTORY_STATE *state) +Set the state of the history list according to @var{state}. +@end deftypefun + +@node History List Management +@subsection History List Management + +These functions manage individual entries on the history list, or set +parameters managing the list itself. + +@deftypefun void add_history (char *string) +Place @var{string} at the end of the history list. The associated data +field (if any) is set to @code{NULL}. +@end deftypefun + +@deftypefun {HIST_ENTRY *} remove_history (int which) +Remove history entry at offset @var{which} from the history. The +removed element is returned so you can free the line, data, +and containing structure. +@end deftypefun + +@deftypefun {HIST_ENTRY *} replace_history_entry (int which, char *line, char *data) +Make the history entry at offset @var{which} have @var{line} and @var{data}. +This returns the old entry so you can dispose of the data. In the case +of an invalid @var{which}, a @code{NULL} pointer is returned. +@end deftypefun + +@deftypefun void stifle_history (int max) +Stifle the history list, remembering only the last @var{max} entries. +@end deftypefun + +@deftypefun int unstifle_history () +Stop stifling the history. This returns the previous amount the +history was stifled. The value is positive if the history was +stifled, negative if it wasn't. +@end deftypefun + +@deftypefun int history_is_stifled () +Returns non-zero if the history is stifled, zero if it is not. +@end deftypefun + +@node Information About the History List +@subsection Information About the History List + +These functions return information about the entire history list or +individual list entries. + +@deftypefun {HIST_ENTRY **} history_list () +Return a @code{NULL} terminated array of @code{HIST_ENTRY} which is the +current input history. Element 0 of this list is the beginning of time. +If there is no history, return @code{NULL}. +@end deftypefun + +@deftypefun int where_history () +Returns the offset of the current history element. +@end deftypefun + +@deftypefun {HIST_ENTRY *} current_history () +Return the history entry at the current position, as determined by +@code{where_history ()}. If there is no entry there, return a @code{NULL} +pointer. +@end deftypefun + +@deftypefun {HIST_ENTRY *} history_get (int offset) +Return the history entry at position @var{offset}, starting from +@code{history_base}. If there is no entry there, or if @var{offset} +is greater than the history length, return a @code{NULL} pointer. +@end deftypefun + +@deftypefun int history_total_bytes () +Return the number of bytes that the primary history entries are using. +This function returns the sum of the lengths of all the lines in the +history. +@end deftypefun + +@node Moving Around the History List +@subsection Moving Around the History List + +These functions allow the current index into the history list to be +set or changed. + +@deftypefun int history_set_pos (int pos) +Set the position in the history list to @var{pos}, an absolute index +into the list. +@end deftypefun + +@deftypefun {HIST_ENTRY *} previous_history () +Back up the current history offset to the previous history entry, and +return a pointer to that entry. If there is no previous entry, return +a @code{NULL} pointer. +@end deftypefun + +@deftypefun {HIST_ENTRY *} next_history () +Move the current history offset forward to the next history entry, and +return the a pointer to that entry. If there is no next entry, return +a @code{NULL} pointer. +@end deftypefun + +@node Searching the History List +@subsection Searching the History List +@cindex History Searching + +These functions allow searching of the history list for entries containing +a specific string. Searching may be performed both forward and backward +from the current history position. The search may be @dfn{anchored}, +meaning that the string must match at the beginning of the history entry. +@cindex anchored search + +@deftypefun int history_search (char *string, int direction) +Search the history for @var{string}, starting at the current history +offset. If @var{direction} < 0, then the search is through previous entries, +else through subsequent. If @var{string} is found, then +the current history index is set to that history entry, and the value +returned is the offset in the line of the entry where +@var{string} was found. Otherwise, nothing is changed, and a -1 is +returned. +@end deftypefun + +@deftypefun int history_search_prefix (char *string, int direction) +Search the history for @var{string}, starting at the current history +offset. The search is anchored: matching lines must begin with +@var{string}. If @var{direction} < 0, then the search is through previous +entries, else through subsequent. If @var{string} is found, then the +current history index is set to that entry, and the return value is 0. +Otherwise, nothing is changed, and a -1 is returned. +@end deftypefun + +@deftypefun int history_search_pos (char *string, int direction, int pos) +Search for @var{string} in the history list, starting at @var{pos}, an +absolute index into the list. If @var{direction} is negative, the search +proceeds backward from @var{pos}, otherwise forward. Returns the absolute +index of the history element where @var{string} was found, or -1 otherwise. +@end deftypefun + +@node Managing the History File +@subsection Managing the History File + +The History library can read the history from and write it to a file. +This section documents the functions for managing a history file. + +@deftypefun int read_history (char *filename) +Add the contents of @var{filename} to the history list, a line at a +time. If @var{filename} is @code{NULL}, then read from +@file{~/.history}. Returns 0 if successful, or errno if not. +@end deftypefun + +@deftypefun int read_history_range (char *filename, int from, int to) +Read a range of lines from @var{filename}, adding them to the history list. +Start reading at line @var{from} and end at @var{to}. If +@var{from} is zero, start at the beginning. If @var{to} is less than +@var{from}, then read until the end of the file. If @var{filename} is +@code{NULL}, then read from @file{~/.history}. Returns 0 if successful, +or @code{errno} if not. +@end deftypefun + +@deftypefun int write_history (char *filename) +Write the current history to @var{filename}, overwriting @var{filename} +if necessary. If @var{filename} is +@code{NULL}, then write the history list to @file{~/.history}. Values +returned are as in @code{read_history ()}. +@end deftypefun + +@deftypefun int append_history (int nelements, char *filename) +Append the last @var{nelements} of the history list to @var{filename}. +@end deftypefun + +@deftypefun int history_truncate_file (char *filename, int nlines) +Truncate the history file @var{filename}, leaving only the last +@var{nlines} lines. +@end deftypefun + +@node History Expansion +@subsection History Expansion + +These functions implement @code{csh}-like history expansion. + +@deftypefun int history_expand (char *string, char **output) +Expand @var{string}, placing the result into @var{output}, a pointer +to a string (@pxref{History Interaction}). Returns: +@table @code +@item 0 +If no expansions took place (or, if the only change in +the text was the de-slashifying of the history expansion +character); +@item 1 +if expansions did take place; +@item -1 +if there was an error in expansion; +@item 2 +if the returned line should only be displayed, but not executed, +as with the @code{:p} modifier (@pxref{Modifiers}). +@end table + +If an error ocurred in expansion, then @var{output} contains a descriptive +error message. +@end deftypefun + +@deftypefun {char *} history_arg_extract (int first, int last, char *string) +Extract a string segment consisting of the @var{first} through @var{last} +arguments present in @var{string}. Arguments are broken up as in Bash. +@end deftypefun + +@deftypefun {char *} get_history_event (char *string, int *cindex, int qchar) +Returns the text of the history event beginning at @var{string} + +@var{*cindex}. @var{*cindex} is modified to point to after the event +specifier. At function entry, @var{cindex} points to the index into +@var{string} where the history event specification begins. @var{qchar} +is a character that is allowed to end the event specification in addition +to the ``normal'' terminating characters. +@end deftypefun + +@deftypefun {char **} history_tokenize (char *string) +Return an array of tokens parsed out of @var{string}, much as the +shell might. The tokens are split on white space and on the +characters @code{()<>;&|$}, and shell quoting conventions are +obeyed. +@end deftypefun + +@node History Variables +@section History Variables + +This section describes the externally visible variables exported by +the GNU History Library. + +@deftypevar int history_base +The logical offset of the first entry in the history list. +@end deftypevar + +@deftypevar int history_length +The number of entries currently stored in the history list. +@end deftypevar + +@deftypevar int max_input_history +The maximum number of history entries. This must be changed using +@code{stifle_history ()}. +@end deftypevar + +@deftypevar char history_expansion_char +The character that starts a history event. The default is @samp{!}. +@end deftypevar + +@deftypevar char history_subst_char +The character that invokes word substitution if found at the start of +a line. The default is @samp{^}. +@end deftypevar + +@deftypevar char history_comment_char +During tokenization, if this character is seen as the first character +of a word, then it and all subsequent characters up to a newline are +ignored, suppressing history expansion for the remainder of the line. +This is disabled by default. +@end deftypevar + +@deftypevar {char *} history_no_expand_chars +The list of characters which inhibit history expansion if found immediately +following @var{history_expansion_char}. The default is whitespace and +@samp{=}. +@end deftypevar + +@node History Programming Example +@section History Programming Example + +The following program demonstrates simple use of the GNU History Library. + +@smallexample +main () +@{ + char line[1024], *t; + int len, done = 0; + + line[0] = 0; + + using_history (); + while (!done) + @{ + printf ("history$ "); + fflush (stdout); + t = fgets (line, sizeof (line) - 1, stdin); + if (t && *t) + @{ + len = strlen (t); + if (t[len - 1] == '\n') + t[len - 1] = '\0'; + @} + + if (!t) + strcpy (line, "quit"); + + if (line[0]) + @{ + char *expansion; + int result; + + result = history_expand (line, &expansion); + if (result) + fprintf (stderr, "%s\n", expansion); + + if (result < 0 || result == 2) + @{ + free (expansion); + continue; + @} + + add_history (expansion); + strncpy (line, expansion, sizeof (line) - 1); + free (expansion); + @} + + if (strcmp (line, "quit") == 0) + done = 1; + else if (strcmp (line, "save") == 0) + write_history ("history_file"); + else if (strcmp (line, "read") == 0) + read_history ("history_file"); + else if (strcmp (line, "list") == 0) + @{ + register HIST_ENTRY **the_list; + register int i; + + the_list = history_list (); + if (the_list) + for (i = 0; the_list[i]; i++) + printf ("%d: %s\n", i + history_base, the_list[i]->line); + @} + else if (strncmp (line, "delete", 6) == 0) + @{ + int which; + if ((sscanf (line + 6, "%d", &which)) == 1) + @{ + HIST_ENTRY *entry = remove_history (which); + if (!entry) + fprintf (stderr, "No such entry %d\n", which); + else + @{ + free (entry->line); + free (entry); + @} + @} + else + @{ + fprintf (stderr, "non-numeric arg given to `delete'\n"); + @} + @} + @} +@} +@end smallexample diff --git a/doc/hsuser.texinfo b/doc/hsuser.texinfo new file mode 100644 index 0000000..51327a3 --- /dev/null +++ b/doc/hsuser.texinfo @@ -0,0 +1,198 @@ +@ignore +This file documents the user interface to the GNU History library. + +Copyright (C) 1988, 1991 Free Software Foundation, Inc. +Authored by Brian Fox and Chet Ramey. + +Permission is granted to make and distribute verbatim copies of this manual +provided the copyright notice and this permission notice are preserved on +all copies. + +Permission is granted to process this file through Tex and print the +results, provided the printed document carries copying permission notice +identical to this one except for the removal of this paragraph (this +paragraph not being relevant to the printed manual). + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided also that the +GNU Copyright statement is available to the distributee, and provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions. +@end ignore + +@node Using History Interactively +@chapter Using History Interactively + +@ifset BashFeatures +This chapter describes how to use the GNU History Library interactively, +from a user's standpoint. It should be considered a user's guide. For +information on using the GNU History Library in your own programs, +see the GNU Readline Library Manual. +@end ifset +@ifclear BashFeatures +This chapter describes how to use the GNU History Library interactively, +from a user's standpoint. It should be considered a user's guide. For +information on using the GNU History Library in your own programs, +@pxref{Programming with GNU History}. +@end ifclear + +@menu +* History Interaction:: What it feels like using History as a user. +@end menu + +@node History Interaction +@section History Interaction +@cindex expansion + +The History library provides a history expansion feature that is similar +to the history expansion provided by @code{csh}. The following text +describes the syntax used to manipulate the history information. + +History expansion takes place in two parts. The first is to determine +which line from the previous history should be used during substitution. +The second is to select portions of that line for inclusion into the +current one. The line selected from the previous history is called the +@dfn{event}, and the portions of that line that are acted upon are +called @dfn{words}. The line is broken into words in the same fashion +that Bash does, so that several English (or Unix) words +surrounded by quotes are considered as one word. + +@menu +* Event Designators:: How to specify which history line to use. +* Word Designators:: Specifying which words are of interest. +* Modifiers:: Modifying the results of substitution. +@end menu + +@node Event Designators +@subsection Event Designators +@cindex event designators + +An event designator is a reference to a command line entry in the +history list. +@cindex history events + +@table @asis + +@item @code{!} +Start a history substitution, except when followed by a space, tab, +the end of the line, @key{=} or @key{(}. + +@item @code{!!} +Refer to the previous command. This is a synonym for @code{!-1}. + +@item @code{!n} +Refer to command line @var{n}. + +@item @code{!-n} +Refer to the command @var{n} lines back. + +@item @code{!string} +Refer to the most recent command starting with @var{string}. + +@item @code{!?string}[@code{?}] +Refer to the most recent command containing @var{string}. + +@item @code{!#} +The entire command line typed so far. + +@item @code{^string1^string2^} +Quick Substitution. Repeat the last command, replacing @var{string1} +with @var{string2}. Equivalent to +@code{!!:s/string1/string2/}. + +@end table + +@node Word Designators +@subsection Word Designators + +A @key{:} separates the event specification from the word designator. It +can be omitted if the word designator begins with a @key{^}, @key{$}, +@key{*} or @key{%}. Words are numbered from the beginning of the line, +with the first word being denoted by a 0 (zero). + +@table @code + +@item 0 (zero) +The @code{0}th word. For many applications, this is the command word. + +@item n +The @var{n}th word. + +@item ^ +The first argument; that is, word 1. + +@item $ +The last argument. + +@item % +The word matched by the most recent @code{?string?} search. + +@item x-y +A range of words; @code{-@var{y}} abbreviates @code{0-@var{y}}. + +@item * +All of the words, except the @code{0}th. This is a synonym for @code{1-$}. +It is not an error to use @key{*} if there is just one word in the event; +the empty string is returned in that case. + +@item x* +Abbreviates @code{x-$} + +@item x- +Abbreviates @code{x-$} like @code{x*}, but omits the last word. + +@end table + +@node Modifiers +@subsection Modifiers + +After the optional word designator, you can add a sequence of one or more +of the following modifiers, each preceded by a @key{:}. + +@table @code + +@item h +Remove a trailing pathname component, leaving only the head. + +@item r +Remove a trailing suffix of the form @samp{.}@var{suffix}, leaving the basename. + +@item e +Remove all but the trailing suffix. + +@item t +Remove all leading pathname components, leaving the tail. + +@item p +Print the new command but do not execute it. + +@ifset BashFeatures +@item q +Quote the substituted words, escaping further substitutions. + +@item x +Quote the substituted words as with @code{q}, +but break into words at spaces, tabs, and newlines. +@end ifset + +@item s/old/new/ +Substitute @var{new} for the first occurrence of @var{old} in the +event line. Any delimiter may be used in place of @key{/}. +The delimiter may be quoted in @var{old} and @var{new} +with a single backslash. If @key{&} appears in @var{new}, +it is replaced by @var{old}. A single backslash will quote +the @key{&}. The final delimiter is optional if it is the last +character on the input line. + +@item & +Repeat the previous substitution. + +@item g +Cause changes to be applied over the entire event line. Used in +conjunction with @code{s}, as in @code{gs/old/new/}, or with +@code{&}. + +@end table diff --git a/doc/readline.3 b/doc/readline.3 new file mode 100644 index 0000000..e3da7cc --- /dev/null +++ b/doc/readline.3 @@ -0,0 +1,1210 @@ +.\" +.\" MAN PAGE COMMENTS to +.\" +.\" Chet Ramey +.\" Information Network Services +.\" Case Western Reserve University +.\" chet@ins.CWRU.Edu +.\" +.\" Last Change: Mon Jun 13 20:06:14 EDT 1994 +.\" +.TH READLINE 3 "1994 June 13" GNU +.\" +.\" File Name macro. This used to be `.PN', for Path Name, +.\" but Sun doesn't seem to like that very much. +.\" +.de FN +\fI\|\\$1\|\fP +.. +.SH NAME +readline \- get a line from a user with editing +.SH SYNOPSIS +.LP +.nf +.ft B +#include +#include +.ft +.fi +.LP +.nf +.ft B +typedef int Function (); +.LP +.nf +.ft B +char *readline (prompt) +char *prompt; +.ft +.fi +.LP +.nf +.ft B +int rl_add_defun (name, function, key) +char *name; +Function *function; +int key; +.ft +.fi +.LP +.nf +.ft B +int rl_bind_key (key, function) +int key; +Function *function; +.ft +.fi +.LP +.nf +.ft B +int rl_unbind_key (key) +int key; +.ft +.fi +.LP +.nf +.ft B +int rl_bind_key_in_map (key, function, keymap) +int key; +Function *function; +Keymap keymap; +.ft +.fi +.LP +.nf +.ft B +int rl_unbind_key_in_map (key, keymap) +int key; +Keymap keymap; +.ft +.fi +.ft B +int rl_macro_bind (keyseq, macro, keymap) +char *keyseq, *macro; +Keymap keymap; +.ft +.fi +.LP +.nf +.ft B +int rl_variable_bind (variable, value) +char *variable, *value; +.ft +.fi +.LP +.nf +.LP +.nf +.ft B +int rl_parse_and_bind (line) +char *line; +.ft +.fi +.LP +.nf +.ft B +int rl_translate_keyseq (keyseq, array, len) +char *keyseq, *array; +int *len; +.ft +.fi +.LP +.nf +.ft B +Function *rl_named_function (command) +char *command; +.ft +.fi +.LP +.nf +.ft B +Function *rl_function_of_keyseq (keyseq, keymap, type) +char *keyseq; +Keymap keymap; +int *type; +.ft +.fi +.LP +.nf +.ft B +char **rl_invoking_keyseqs (function) +Function *function; +.ft +.fi +.LP +.nf +.ft B +char **rl_invoking_keyseqs_in_map (function, keymap) +Function *function; +Keymap keymap; +.ft +.fi +.LP +.nf +.ft B +void rl_function_dumper (readable) +int readable; +.ft +.fi +.LP +.nf +.ft B +char **rl_funmap_names () +.ft +.fi +.SH COPYRIGHT +.if n Readline is Copyright (C) 1989, 1991 by the Free Software Foundation, Inc. +.if t Readline is Copyright \(co 1989, 1991 by the Free Software Foundation, Inc. +.SH DESCRIPTION +.LP +.B readline +will read a line from the terminal +and return it, using +.B prompt +as a prompt. If +.B prompt +is null, no prompt is issued. The line returned is allocated with +.IR malloc (3), +so the caller must free it when finished. The line returned +has the final newline removed, so only the text of the line +remains. +.LP +.B readline +offers editing capabilities while the user is entering the +line. +By default, the line editing commands +are similar to those of emacs. +A vi\-style line editing interface is also available. +.LP +In the following descriptions, +.B keymap +can be one of \fIemacs_keymap, emacs_meta_keymap, emacs_ctlx_keymap, +vi_insertion_keymap, or vi_movement_keymap\fP. +.LP +.B rl_add_defun +makes +.B name +appear as a bindable readline command, and makes +.B function +be the function called when that command is invoked. If +.B key +is not \-1, it is bound to +.B function +in the current keymap. +.LP +.B rl_bind_key +causes +.B key +to invoke +.BR function . +The binding is made in the current keymap. +.LP +.B rl_unbind_key +removes the binding for +.B key +in the current keymap. +.LP +.B rl_bind_key_in_map +makes the +.B key +entry in +.B keymap +invoke +.BR function . +.LP +.B rl_unbind_key_in_map +removes the binding for +.B key +in keymap +.BR keymap . +.LP +.B rl_macro_bind +makes +.B keyseq +insert the string +.BR macro . +The binding is performed in +.BR keymap . +.LP +.B rl_variable_bind +sets the value of the readline variable +.B variable +to +.BR value . +.LP +.B rl_parse_and_bind +takes as an argument a line of the same form as the readline startup +file (see +.SM +.B INITIALIZATION FILE +below) and executes the commands therein. +.LP +.B rl_translate_keyseq +converts +.B keyseq +into a new string, storing the result in +.BR array . +This translates control and meta prefixes and the readline +character escape sequences (see +.SM +.B Key Bindings +below). The length of the translated sequence is returned in +.BR *len . +.LP +.B rl_named_function +returns the function that is executed when the readline +command +.B command +is invoked. +.LP +.B rl_function_of_keyseq +returns the function that is executed when +.B keyseq +is read and +.B keymap +is the current keymap. +.B type +is set to indicate whether the return value corresponds to a +function, macro, or auxiliary keymap. +.LP +.B rl_invoking_keyseqs +returns all of the key sequences in the current keymap that +invoke +.BR function . +.LP +.B rl_invoking_keyseqs_in_map +returns all of the key sequences in +.B keymap +that invoke +.BR function . +.LP +.B rl_function_dumper +prints all of the readline functions and their bindings to the +readline output stream. If +.B readable +is non\-zero, the output is formattted so that it can be read +back in to restore the bindings. +.LP +.B rl_funmap_names +returns an array of all known readline bindable function names. +The array is sorted. +.SH RETURN VALUE +.LP +.B readline +returns the text of the line read. A blank line +returns the empty string. If +.B EOF +is encountered while reading a line, and the line is empty, +.B NULL +is returned. If an +.B EOF +is read with a non\-empty line, it is +treated as a newline. +.LP +Unless otherwise stated, +the other functions return 0 on success and non\-zero on failure. +.SH NOTATION +.LP +An emacs\-style notation is used to denote +keystrokes. Control keys are denoted by C\-\fIkey\fR, e.g., C\-n +means Control\-N. Similarly, +.I meta +keys are denoted by M\-\fIkey\fR, so M\-x means Meta\-X. (On keyboards +without a +.I meta +key, M\-\fIx\fP means ESC \fIx\fP, i.e., press the Escape key +then the +.I x +key. This makes ESC the \fImeta prefix\fP. +The combination M\-C\-\fIx\fP means ESC\-Control\-\fIx\fP, +or press the Escape key +then hold the Control key while pressing the +.I x +key.) +.PP +Readline commands may be given numeric +.IR arguments , +which normally act as a repeat count. Sometimes, however, it is the +sign of the argument that is significant. Passing a negative argument +to a command that acts in the forward direction (e.g., \fBkill\-line\fP) +causes that command to act in a backward direction. Commands whose +behavior with arguments deviates from this are noted. +.PP +When a command is described as \fIkilling\fP text, the text +deleted is saved for possible future retrieval +(\fIyanking\fP). The killed text is saved in a +\fIkill\-ring\fP. Consecutive kills cause the text to be +accumulated into one unit, which can be yanked all at once. +Commands which do not kill text separate the chunks of text +on the kill\-ring. +.SH INITIALIZATION FILE +.LP +Readline is customized by putting commands in an initialization +file. The name of this file is taken from the value of the +.B INPUTRC +variable. If that variable is unset, the default is +.IR ~/.inputrc . +When a program which uses the readline library starts up, the +init file is read, and the key bindings and variables are set. +There are only a few basic constructs allowed in the +readline init file. Blank lines are ignored. +Lines beginning with a \fB#\fP are comments. +Lines beginning with a \fB$\fP indicate conditional +constructs. Other lines +denote key bindings and variable settings. +Each program using this library may add its own commands +and bindings. +.PP +For example, placing +.RS +.PP +M\-Control\-u: universal\-argument +.RE +or +.RS +C\-Meta\-u: universal\-argument +.RE +into the +.FN ~/.inputrc +would make M\-C\-u execute the readline command +.IR universal\-argument . +.PP +The following symbolic character names are recognized while +processing key bindings: +.IR RUBOUT , +.IR DEL , +.IR ESC , +.IR LFD , +.IR NEWLINE , +.IR RET , +.IR RETURN , +.IR SPC , +.IR SPACE , +and +.IR TAB . +In addition to command names, readline allows keys to be bound +to a string that is inserted when the key is pressed (a \fImacro\fP). +.PP +.SS Key Bindings +.PP +The syntax for controlling key bindings in the +.I ~/.inputrc +file is simple. All that is required is the name of the +command or the text of a macro and a key sequence to which +it should be bound. The name may be specified in one of two ways: +as a symbolic key name, possibly with \fIMeta\-\fP or \fIControl\-\fP +prefixes, or as a key sequence. +When using the form \fBkeyname\fP:\fIfunction-name\fP or \fImacro\fP, +.I keyname +is the name of a key spelled out in English. For example: +.sp +.RS +Control\-u: universal\-argument +.br +Meta\-Rubout: backward\-kill\-word +.br +Control\-o: ">&output" +.RE +.LP +In the above example, +.I C\-u +is bound to the function +.BR universal\-argument , +.I M-DEL +is bound to the function +.BR backward\-kill\-word , +and +.I C\-o +is bound to run the macro +expressed on the right hand side (that is, to insert the text +.I >&output +into the line). +.PP +In the second form, \fB"keyseq"\fP:\fIfunction\-name\fP or \fImacro\fP, +.B keyseq +differs from +.B keyname +above in that strings denoting +an entire key sequence may be specified by placing the sequence +within double quotes. Some GNU Emacs style key escapes can be +used, as in the following example. +.sp +.RS +"\eC\-u": universal\-argument +.br +"\eC\-x\eC\-r": re\-read\-init\-file +.br +"\ee[11~": "Function Key 1" +.RE +.PP +In this example, +.I C-u +is again bound to the function +.BR universal\-argument . +.I "C-x C-r" +is bound to the function +.BR re\-read\-init\-file , +and +.I "ESC [ 1 1 ~" +is bound to insert the text +.BR "Function Key 1" . +The full set of escape sequences is +.RS +.TP +.B \eC- +control prefix +.TP +.B \eM- +meta prefix +.TP +.B \ee +an escape character +.TP +.B \e\e +backslash +.TP +.B \e" +literal " +.TP +.B \e' +literal ' +.RE +.PP +When entering the text of a macro, single or double quotes should +be used to indicate a macro definition. Unquoted text +is assumed to be a function name. Backslash +will quote any character in the macro text, including " and '. +.PP +.B Bash +allows the current readline key bindings to be displayed or modified +with the +.B bind +builtin command. The editing mode may be switched during interactive +use by using the +.B \-o +option to the +.B set +builtin command. Other programs using this library provide +similar mechanisms. The +.I inputrc +file may be edited and re\-read if a program does not provide +any other means to incorporate new bindings. +.SS Variables +.PP +Readline has variables that can be used to further customize its +behavior. A variable may be set in the +.I inputrc +file with a statement of the form +.RS +.PP +\fBset\fP \fIvariable\-name\fP \fIvalue\fP +.RE +.PP +Except where noted, readline variables can take the values +.B On +or +.BR Off . +The variables and their default values are: +.PP +.PD 0 +.TP +.B horizontal\-scroll\-mode (Off) +When set to \fBOn\fP, makes readline use a single line for display, +scrolling the input horizontally on a single screen line when it +becomes longer than the screen width rather than wrapping to a new line. +.TP +.B editing\-mode (emacs) +Controls whether readline begins with a set of key bindings similar +to \fIemacs\fP or \fIvi\fP. +.B editing\-mode +can be set to either +.B emacs +or +.BR vi . +.TP +.B mark\-modified\-lines (Off) +If set to \fBOn\fP, history lines that have been modified are displayed +with a preceding asterisk (\fB*\fP). +.TP +.B bell\-style (audible) +Controls what happens when readline wants to ring the terminal bell. +If set to \fBnone\fP, readline never rings the bell. If set to +\fBvisible\fP, readline uses a visible bell if one is available. +If set to \fBaudible\fP, readline attempts to ring the terminal's bell. +.TP +.B comment\-begin (``#'') +The string that is inserted in \fBvi\fP mode when the +.B vi\-comment +command is executed. +.TP +.B meta\-flag (Off) +If set to \fBOn\fP, readline will enable eight-bit input (that is, +it will not strip the high bit from the characters it reads), +regardless of what the terminal claims it can support. +.TP +.B convert\-meta (On) +If set to \fBOn\fP, readline will convert characters with the +eighth bit set to an ASCII key sequence +by stripping the eighth bit and prepending an +escape character (in effect, using escape as the \fImeta prefix\fP). +.TP +.B output\-meta (Off) +If set to \fBOn\fP, readline will display characters with the +eighth bit set directly rather than as a meta-prefixed escape +sequence. +.TP +.B completion\-query\-items (100) +This determines when the user is queried about viewing +the number of possible completions +generated by the \fBpossible\-completions\fP command. +It may be set to any integer value greater than or equal to +zero. If the number of possible completions is greater than +or equal to the value of this variable, the user is asked whether +or not he wishes to view them; otherwise they are simply listed +on the terminal. +.TP +.B keymap (emacs) +Set the current readline keymap. The set of legal keymap names is +\fIemacs, emacs-standard, emacs-meta, emacs-ctlx, vi, vi-move, +vi-command\fP, and +.IR vi-insert . +\fIvi\fP is equivalent to \fIvi-command\fP; \fIemacs\fP is +equivalent to \fIemacs-standard\fP. The default value is +.IR emacs ; +the value of +.B editing\-mode +also affects the default keymap. +.TP +.B show\-all\-if\-ambiguous (Off) +This alters the default behavior of the completion functions. If +set to +.BR on , +words which have more than one possible completion cause the +matches to be listed immediately instead of ringing the bell. +.TP +.B expand\-tilde (Off) +If set to \fBon\fP, tilde expansion is performed when readline +attempts word completion. +.PD +.SS Conditional Constructs +.PP +Readline implements a facility similar in spirit to the conditional +compilation features of the C preprocessor which allows key +bindings and variable settings to be performed as the result +of tests. There are three parser directives used. +.IP \fB$if\fP +The +.B $if +construct allows bindings to be made based on the +editing mode, the terminal being used, or the application using +readline. The text of the test extends to the end of the line; +no characters are required to isolate it. +.RS +.IP \fBmode\fP +The \fBmode=\fP form of the \fB$if\fP directive is used to test +whether readline is in emacs or vi mode. +This may be used in conjunction +with the \fBset keymap\fP command, for instance, to set bindings in +the \fIemacs-standard\fP and \fIemacs-ctlx\fP keymaps only if +readline is starting out in emacs mode. +.IP \fBterm\fP +The \fBterm=\fP form may be used to include terminal-specific +key bindings, perhaps to bind the key sequences output by the +terminal's function keys. The word on the right side of the +.B = +is tested against the full name of the terminal and the portion +of the terminal name before the first \fB\-\fP. This allows +.I sun +to match both +.I sun +and +.IR sun\-cmd , +for instance. +.IP \fBapplication\fP +The \fBapplication\fP construct is used to include +application\-specific settings. Each program using the readline +library sets the \fIapplication name\fP, and an initialization +file can test for a particular value. +This could be used to bind key sequences to functions useful for +a specific program. For instance, the following command adds a +key sequence that quotes the current or previous word in Bash: +.RS +.nf +\fB$if\fP bash +# Quote the current or previous word +"\eC-xq": "\eeb\e"\eef\e"" +\fB$endif\fP +.fi +.RE +.RE +.IP \fB$endif\fP +This command, as you saw in the previous example, terminates an +\fB$if\fP command. +.IP \fB$else\fP +Commands in this branch of the \fB$if\fP directive are executed if +the test fails. +.SH EDITING COMMANDS +.PP +The following is a list of the names of the commands and the default +key sequences to which they are bound. +.SS Commands for Moving +.PP +.PD 0 +.TP +.B beginning\-of\-line (C\-a) +Move to the start of the current line. +.TP +.B end\-of\-line (C\-e) +Move to the end of the line. +.TP +.B forward\-char (C\-f) +Move forward a character. +.TP +.B backward\-char (C\-b) +Move back a character. +.TP +.B forward\-word (M\-f) +Move forward to the end of the next word. Words are composed of +alphanumeric characters (letters and digits). +.TP +.B backward\-word (M\-b) +Move back to the start of this, or the previous, word. Words are +composed of alphanumeric characters (letters and digits). +.TP +.B clear\-screen (C\-l) +Clear the screen leaving the current line at the top of the screen. +With an argument, refresh the current line without clearing the +screen. +.TP +.B redraw\-current\-line +Refresh the current line. By default, this is unbound. +.PD +.SS Commands for Manipulating the History +.PP +.PD 0 +.TP +.B accept\-line (Newline, Return) +Accept the line regardless of where the cursor is. If this line is +non\-empty, add it to the history list. If the line is a modified +history line, then restore the history line to its original state. +.TP +.B previous\-history (C\-p) +Fetch the previous command from the history list, moving back in +the list. +.TP +.B next\-history (C\-n) +Fetch the next command from the history list, moving forward in the +list. +.TP +.B beginning\-of\-history (M\-<) +Move to the first line in the history. +.TP +.B end\-of\-history (M\->) +Move to the end of the input history, i.e., the line currently being +entered. +.TP +.B reverse\-search\-history (C\-r) +Search backward starting at the current line and moving `up' through +the history as necessary. This is an incremental search. +.TP +.B forward\-search\-history (C\-s) +Search forward starting at the current line and moving `down' through +the history as necessary. This is an incremental search. +.TP +.B non\-incremental\-reverse\-search\-history (M\-p) +Search backward through the history starting at the current line +using a non\-incremental search for a string supplied by the user. +.TP +.B non\-incremental\-forward\-search\-history (M\-n) +Search forward through the history using a non\-incremental search +for a string supplied by the user. +.TP +.B history\-search\-forward +Search forward through the history for the string of characters +between the start of the current line and the current point. This +is a non-incremental search. By default, this command is unbound. +.TP +.B history\-search\-backward +Search backward through the history for the string of characters +between the start of the current line and the current point. This +is a non-incremental search. By default, this command is unbound. +.TP +.B yank\-nth\-arg (M\-C\-y) +Insert the first argument to the previous command (usually +the second word on the previous line) at point (the current +cursor position). With an argument +.IR n , +insert the \fIn\fPth word from the previous command (the words +in the previous command begin with word 0). A negative argument +inserts the \fIn\fPth word from the end of the previous command. +.PD +.SS Commands for Changing Text +.PP +.PD 0 +.TP +.B delete\-char (C\-d) +Delete the character under the cursor. If point is at the +beginning of the line, there are no characters in the line, and +the last character typed was not +.BR C\-d , +then return +.SM +.BR EOF . +.TP +.B backward\-delete\-char (Rubout) +Delete the character behind the cursor. When given a numeric argument, +save the deleted text on the kill\-ring. +.TP +.B quoted\-insert (C\-q, C\-v) +Add the next character that you type to the line verbatim. This is +how to insert characters like \fBC\-q\fP, for example. +.TP +.B tab\-insert (M-TAB) +Insert a tab character. +.TP +.B self\-insert (a,\ b,\ A,\ 1,\ !,\ ...) +Insert the character typed. +.TP +.B transpose\-chars (C\-t) +Drag the character before point forward over the character at point. +Point moves forward as well. If point is at the end of the line, then +transpose the two characters before point. Negative arguments don't work. +.TP +.B transpose\-words (M\-t) +Drag the word behind the cursor past the word in front of the cursor +moving the cursor over that word as well. +.TP +.B upcase\-word (M\-u) +Uppercase the current (or following) word. With a negative argument, +do the previous word, but do not move point. +.TP +.B downcase\-word (M\-l) +Lowercase the current (or following) word. With a negative argument, +do the previous word, but do not move point. +.TP +.B capitalize\-word (M\-c) +Capitalize the current (or following) word. With a negative argument, +do the previous word, but do not move point. +.PD +.SS Killing and Yanking +.PP +.PD 0 +.TP +.B kill\-line (C\-k) +Kill the text from the current cursor position to the end of the line. +.TP +.B backward\-kill\-line (C\-x Rubout) +Kill backward to the beginning of the line. +.TP +.B unix\-line\-discard (C\-u) +Kill backward from point to the beginning of the line. +.\" There is no real difference between this and backward-kill-line +.TP +.B kill\-whole\-line +Kill all characters on the current line, no matter where the +cursor is. By default, this is unbound. +.TP +.B kill\-word (M\-d) +Kill from the cursor to the end of the current word, or if between +words, to the end of the next word. Word boundaries are the same as +those used by \fBforward\-word\fP. +.TP +.B backward\-kill\-word (M\-Rubout) +Kill the word behind the cursor. Word boundaries are the same as +those used by \fBbackward\-word\fP. +.TP +.B unix\-word\-rubout (C\-w) +Kill the word behind the cursor, using white space as a word boundary. +The word boundaries are different from +.BR backward\-kill\-word . +.TP +.B delete\-horizontal\-space +Delete all spaces and tabs around point. By default, this is unbound. +.TP +.B yank (C\-y) +Yank the top of the kill ring into the buffer at the cursor. +.TP +.B yank\-pop (M\-y) +Rotate the kill\-ring, and yank the new top. Only works following +.B yank +or +.BR yank\-pop . +.PD +.SS Numeric Arguments +.PP +.PD 0 +.TP +.B digit\-argument (M\-0, M\-1, ..., M\-\-) +Add this digit to the argument already accumulating, or start a new +argument. M\-\- starts a negative argument. +.TP +.B universal\-argument +Each time this is executed, the argument count is multiplied by four. +The argument count is initially one, so executing this function the +first time makes the argument count four. By default, this is not +bound to a key. +.PD +.SS Completing +.PP +.PD 0 +.TP +.B complete (TAB) +Attempt to perform completion on the text before point. +The actual completion performed is application-specific. +.BR Bash , +for instance, attempts completion treating the text as a variable +(if the text begins with \fB$\fP), username (if the text begins with +\fB~\fP), hostname (if the text begins with \fB@\fP), or +command (including aliases and functions) in turn. If none +of these produces a match, filename completion is attempted. +.BR Gdb , +on the other hand, +allows completion of program functions and variables, and +only attempts filename completion under certain circumstances. +.TP +.B possible\-completions (M-?) +List the possible completions of the text before point. +.TP +.B insert\-completions +Insert all completions of the text before point +that would have been generated by +\fBpossible\-completions\fP. By default, this +is not bound to a key. +.PD +.SS Keyboard Macros +.PP +.PD 0 +.TP +.B start\-kbd\-macro (C-x (\^) +Begin saving the characters typed into the current keyboard macro. +.TP +.B end\-kbd\-macro (C-x )\^) +Stop saving the characters typed into the current keyboard macro +and save the definition. +.TP +.B call\-last\-kbd\-macro (C-x e) +Re-execute the last keyboard macro defined, by making the characters +in the macro appear as if typed at the keyboard. +.PD +.SS Miscellaneous +.PP +.PD 0 +.TP +.B re-read-init-file (C\-x C\-r) +Read in the contents of your init file, and incorporate +any bindings or variable assignments found there. +.TP +.B abort (C\-g) +Abort the current editing command and +ring the terminal's bell (subject to the setting of +.BR bell\-style ). +.TP +.B do\-uppercase\-version (M\-a, M\-b, ...) +Run the command that is bound to the corresponding uppercase +character. +.TP +.B prefix\-meta (ESC) +Metafy the next character typed. +.SM +.B ESC +.B f +is equivalent to +.BR Meta\-f . +.TP +.B undo (C\-_, C\-x C\-u) +Incremental undo, separately remembered for each line. +.TP +.B revert\-line (M\-r) +Undo all changes made to this line. This is like typing the +.B undo +command enough times to return the line to its initial state. +.TP +.B tilde\-expand (M\-~) +Perform tilde expansion on the current word. +.TP +.B dump\-functions +Print all of the functions and their key bindings to the +readline output stream. If a numeric argument is supplied, +the output is formatted in such a way that it can be made part +of an \fIinputrc\fP file. +.TP +.B emacs\-editing\-mode (C\-e) +When in +.B vi +editing mode, this causes a switch to +.B emacs +editing mode. +.TP +.B vi\-editing\-mode (M\-C\-j) +When in +.B emacs +editing mode, this causes a switch to +.B vi +editing mode. +.PD +.SH DEFAULT KEY BINDINGS +.LP +The following is a list of the default emacs and vi bindings. +Characters with the 8th bit set are written as M-, and +are referred to as +.I metafied +characters. +The printable ASCII characters not mentioned in the list of emacs +standard bindings are bound to the +.I self\-insert +function, which just inserts the given character into the input line. +In vi insertion mode, all characters not specifically mentioned are +bound to +.IR self\-insert . +Characters assigned to signal generation by +.IR stty (1) +or the terminal driver, such as C-Z or C-C, +retain that function. +Upper and lower case +.I metafied +characters are bound to the same function in the emacs mode +meta keymap. +The remaining characters are unbound, which causes readline +to ring the bell (subject to the setting of the +.B bell\-style +variable). +.SS Emacs Mode +.RS +.6i +.nf +.ta 2.5i +.sp +Emacs Standard bindings +.sp +"C-A" -> beginning-of-line +"C-B" -> backward-char +"C-D" -> delete-char +"C-E" -> end-of-line +"C-F" -> forward-char +"C-G" -> abort +"C-H" -> backward-delete-char +"C-I" -> complete +"C-J" -> accept-line +"C-K" -> kill-line +"C-L" -> clear-screen +"C-M" -> accept-line +"C-N" -> next-history +"C-P" -> previous-history +"C-Q" -> quoted-insert +"C-R" -> reverse-search-history +"C-S" -> forward-search-history +"C-T" -> transpose-chars +"C-U" -> unix-line-discard +"C-V" -> quoted-insert +"C-W" -> unix-word-rubout +"C-Y" -> yank +"C-_" -> undo +"\^ " to "/" -> self-insert +"0" to "9" -> self-insert +":" to "~" -> self-insert +"C-?" -> backward-delete-char +.PP +Emacs Meta bindings +.sp +"M-C-H" -> backward-kill-word +"M-C-I" -> tab-insert +"M-C-J" -> vi-editing-mode +"M-C-M" -> vi-editing-mode +"M-C-R" -> revert-line +"M-C-Y" -> yank-nth-arg +"M-C-[" -> complete +"M-&" -> tilde-expand +"M--" -> digit-argument +"M-0" -> digit-argument +"M-1" -> digit-argument +"M-2" -> digit-argument +"M-3" -> digit-argument +"M-4" -> digit-argument +"M-5" -> digit-argument +"M-6" -> digit-argument +"M-7" -> digit-argument +"M-8" -> digit-argument +"M-9" -> digit-argument +"M-<" -> beginning-of-history +"M->" -> end-of-history +"M-?" -> possible-completions +"M-B" -> backward-word +"M-C" -> capitalize-word +"M-D" -> kill-word +"M-F" -> forward-word +"M-L" -> downcase-word +"M-N" -> non-incremental-forward-search-history +"M-O" -> arrow-key-prefix +"M-P" -> non-incremental-reverse-search-history +"M-R" -> revert-line +"M-T" -> transpose-words +"M-U" -> upcase-word +"M-Y" -> yank-pop +"M-C-Y" -> yank-nth-arg +"M-C-?" -> backward-delete-word +.PP +Emacs Control-X bindings +.sp +"C-XC-G" -> abort +"C-XC-R" -> re-read-init-file +"C-XC-U" -> undo +"C-X(" -> start-kbd-macro +"C-X)" -> end-kbd-macro +"C-Xe" -> call-last-kbd-macro +"C-XC-?" -> backward-kill-line +.sp +.RE +.SS VI Mode bindings +.RS +.6i +.nf +.ta 2.5i +.sp +.PP +VI Insert Mode functions +.sp +"C-D" -> vi-eof-maybe +"C-H" -> backward-delete-char +"C-I" -> complete +"C-J" -> accept-line +"C-K" -> kill-line +"C-L" -> clear-screen +"C-M" -> accept-line +"C-N" -> next-history +"C-P" -> previous-history +"C-Q" -> quoted-insert +"C-R" -> reverse-search-history +"C-S" -> forward-search-history +"C-T" -> transpose-chars +"C-U" -> unix-line-discard +"C-V" -> quoted-insert +"C-W" -> unix-word-rubout +"C-Y" -> yank +"C-[" -> vi-movement-mode +"\^ " to "~" -> self-insert +"C-?" -> backward-delete-char +.PP +VI Command Mode functions +.sp +"C-D" -> vi-eof-maybe +"C-E" -> emacs-editing-mode +"C-G" -> abort +"C-H" -> backward-char +"C-J" -> accept-line +"C-K" -> kill-line +"C-L" -> clear-screen +"C-M" -> accept-line +"C-N" -> next-history +"C-P" -> previous-history +"C-Q" -> quoted-insert +"C-R" -> reverse-search-history +"C-S" -> forward-search-history +"C-T" -> transpose-chars +"C-U" -> unix-line-discard +"C-V" -> quoted-insert +"C-W" -> unix-word-rubout +"C-Y" -> yank +"C-[" -> abort +"\^ " -> forward-char +"#" -> vi-comment +"$" -> end-of-line +"%" -> vi-match +"&" -> vi-tilde-expand +"*" -> vi-complete +"+" -> down-history +"," -> vi-char-search +"-" -> previous-history +"." -> vi-redo +"/" -> vi-search +"0" -> beginning-of-line +"1" to "9" -> vi-arg-digit +";" -> vi-char-search +"=" -> vi-complete +"?" -> vi-search +"@" -> is undefined +"A" -> vi-append-eol +"B" -> vi-prev-word +"C" -> vi-change-to +"D" -> vi-delete-to +"E" -> vi-end-word +"F" -> vi-char-search +"I" -> vi-insert-beg +"N" -> vi-search-again +"P" -> vi-put +"R" -> vi-replace +"S" -> vi-subst +"T" -> vi-char-search +"U" -> revert-line +"W" -> vi-next-word +"X" -> backward-delete-char +"Y" -> vi-yank-to +"\e" -> vi-complete +"^" -> vi-first-print +"_" -> vi-yank-arg +"a" -> vi-append-mode +"b" -> vi-prev-word +"c" -> vi-change-to +"d" -> vi-delete-to +"e" -> vi-end-word +"f" -> vi-char-search +"h" -> backward-char +"i" -> vi-insertion-mode +"j" -> next-history +"k" -> prev-history +"l" -> forward-char +"n" -> vi-search-again +"r" -> vi-change-char +"s" -> vi-subst +"t" -> vi-char-search +"u" -> undo +"w" -> vi-next-word +"x" -> vi-delete +"y" -> vi-yank-to +"|" -> vi-column +"~" -> vi-change-case +.RE +.SH "SEE ALSO" +.PD 0 +.TP +\fIThe Gnu Readline Library\fP, Brian Fox +.TP +\fIThe Gnu History Library\fP, Brian Fox +.TP +\fIbash\fP(1) +.PD +.SH FILES +.PD 0 +.TP +.FN ~/.inputrc +Individual \fBreadline\fP initialization file +.PD +.SH AUTHORS +.RS +Brian Fox, Free Software Foundation (primary author) +.br +bfox@ai.MIT.Edu +.PP +Chet Ramey, Case Western Reserve University +.br +chet@ins.CWRU.Edu +.SH BUG REPORTS +If you find a bug in +.B readline, +you should report it. But first, you should +make sure that it really is a bug, and that it appears in the latest +version of the +.B readline +library that you have. +.PP +Once you have determined that a bug actually exists, mail a +bug report to \fIbash\-maintainers\fP@\fIprep.ai.MIT.Edu\fP. +If you have a fix, you are welcome to mail that +as well! Suggestions and `philosophical' bug reports may be mailed +to \fPbug-bash\fP@\fIprep.ai.MIT.Edu\fP or posted to the Usenet +newsgroup +.BR gnu.bash.bug . +.PP +Comments and bug reports concerning +this manual page should be directed to +.IR chet@ins.CWRU.Edu . +.SH BUGS +.PP +It's too big and too slow. diff --git a/doc/readline.dvi b/doc/readline.dvi new file mode 100644 index 0000000..a967128 Binary files /dev/null and b/doc/readline.dvi differ diff --git a/doc/readline.info b/doc/readline.info new file mode 100644 index 0000000..f4882e9 --- /dev/null +++ b/doc/readline.info @@ -0,0 +1,74 @@ +This is Info file readline.info, produced by Makeinfo-1.55 from the +input file rlman.texinfo. + + This document describes the GNU Readline Library, a utility which +aids in the consistency of user interface across discrete programs that +need to provide a command line interface. + + Copyright (C) 1988, 1991 Free Software Foundation, Inc. + + Permission is granted to make and distribute verbatim copies of this +manual provided the copyright notice and this permission notice pare +preserved on all copies. + + Permission is granted to copy and distribute modified versions of +this manual under the conditions for verbatim copying, provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + + Permission is granted to copy and distribute translations of this +manual into another language, under the above conditions for modified +versions, except that this permission notice may be stated in a +translation approved by the Foundation. + + +Indirect: +readline.info-1: 1000 +readline.info-2: 50467 + +Tag Table: +(Indirect) +Node: Top1000 +Node: Command Line Editing1613 +Node: Introduction and Notation2264 +Node: Readline Interaction3284 +Node: Readline Bare Essentials4423 +Node: Readline Movement Commands5953 +Node: Readline Killing Commands6844 +Node: Readline Arguments8547 +Node: Readline Init File9498 +Node: Readline Init Syntax10502 +Node: Conditional Init Constructs17435 +Node: Bindable Readline Commands19681 +Node: Commands For Moving20351 +Node: Commands For History21199 +Node: Commands For Text23783 +Node: Commands For Killing25522 +Node: Numeric Arguments26971 +Node: Commands For Completion27598 +Node: Keyboard Macros28525 +Node: Miscellaneous Commands29084 +Node: Readline vi Mode30372 +Node: Programming with GNU Readline32122 +Node: Basic Behavior32919 +Node: Custom Functions36232 +Node: The Function Type36845 +Node: Function Writing37690 +Node: Readline Convenience Functions40453 +Node: Function Naming41118 +Node: Keymaps42345 +Node: Binding Keys43856 +Node: Associating Function Names and Bindings45650 +Node: Allowing Undoing46812 +Node: Redisplay49397 +Node: Modifying Text50467 +Node: Utility Functions51378 +Node: Custom Completers54444 +Node: How Completing Works55165 +Node: Completion Functions58156 +Node: Completion Variables61171 +Node: A Short Completion Example64996 +Node: Concept Index77230 +Node: Function and Variable Index77717 + +End Tag Table diff --git a/doc/readline.info-1 b/doc/readline.info-1 new file mode 100644 index 0000000..78bbd05 --- /dev/null +++ b/doc/readline.info-1 @@ -0,0 +1,1322 @@ +This is Info file readline.info, produced by Makeinfo-1.55 from the +input file rlman.texinfo. + + This document describes the GNU Readline Library, a utility which +aids in the consistency of user interface across discrete programs that +need to provide a command line interface. + + Copyright (C) 1988, 1991 Free Software Foundation, Inc. + + Permission is granted to make and distribute verbatim copies of this +manual provided the copyright notice and this permission notice pare +preserved on all copies. + + Permission is granted to copy and distribute modified versions of +this manual under the conditions for verbatim copying, provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + + Permission is granted to copy and distribute translations of this +manual into another language, under the above conditions for modified +versions, except that this permission notice may be stated in a +translation approved by the Foundation. + + +File: readline.info, Node: Top, Next: Command Line Editing, Prev: (DIR), Up: (DIR) + +GNU Readline Library +******************** + + This document describes the GNU Readline Library, a utility which +aids in the consistency of user interface across discrete programs that +need to provide a command line interface. + +* Menu: + +* Command Line Editing:: GNU Readline User's Manual. +* Programming with GNU Readline:: GNU Readline Programmer's Manual. +* Concept Index:: Index of concepts described in this manual. +* Function and Variable Index:: Index of externally visible functions + and variables. + + +File: readline.info, Node: Command Line Editing, Next: Programming with GNU Readline, Prev: Top, Up: Top + +Command Line Editing +******************** + + This chapter describes the basic features of the GNU command line +editing interface. + +* Menu: + +* Introduction and Notation:: Notation used in this text. +* Readline Interaction:: The minimum set of commands for editing a line. +* Readline Init File:: Customizing Readline from a user's view. +* Bindable Readline Commands:: A description of most of the Readline commands + available for binding +* Readline vi Mode:: A short description of how to make Readline + behave like the vi editor. + + +File: readline.info, Node: Introduction and Notation, Next: Readline Interaction, Up: Command Line Editing + +Introduction to Line Editing +============================ + + The following paragraphs describe the notation used to represent +keystrokes. + + The text C-k is read as `Control-K' and describes the character +produced when the Control key is depressed and the k key is struck. + + The text M-k is read as `Meta-K' and describes the character +produced when the meta key (if you have one) is depressed, and the k +key is struck. If you do not have a meta key, the identical keystroke +can be generated by typing ESC first, and then typing k. Either +process is known as "metafying" the k key. + + The text M-C-k is read as `Meta-Control-k' and describes the +character produced by "metafying" C-k. + + In addition, several keys have their own names. Specifically, DEL, +ESC, LFD, SPC, RET, and TAB all stand for themselves when seen in this +text, or in an init file (*note Readline Init File::., for more info). + + +File: readline.info, Node: Readline Interaction, Next: Readline Init File, Prev: Introduction and Notation, Up: Command Line Editing + +Readline Interaction +==================== + + Often during an interactive session you type in a long line of text, +only to notice that the first word on the line is misspelled. The +Readline library gives you a set of commands for manipulating the text +as you type it in, allowing you to just fix your typo, and not forcing +you to retype the majority of the line. Using these editing commands, +you move the cursor to the place that needs correction, and delete or +insert the text of the corrections. Then, when you are satisfied with +the line, you simply press RETURN. You do not have to be at the end of +the line to press RETURN; the entire line is accepted regardless of the +location of the cursor within the line. + +* Menu: + +* Readline Bare Essentials:: The least you need to know about Readline. +* Readline Movement Commands:: Moving about the input line. +* Readline Killing Commands:: How to delete text, and how to get it back! +* Readline Arguments:: Giving numeric arguments to commands. + + +File: readline.info, Node: Readline Bare Essentials, Next: Readline Movement Commands, Up: Readline Interaction + +Readline Bare Essentials +------------------------ + + In order to enter characters into the line, simply type them. The +typed character appears where the cursor was, and then the cursor moves +one space to the right. If you mistype a character, you can use your +erase character to back up and delete the mistyped character. + + Sometimes you may miss typing a character that you wanted to type, +and not notice your error until you have typed several other +characters. In that case, you can type C-b to move the cursor to the +left, and then correct your mistake. Afterwards, you can move the +cursor to the right with C-f. + + When you add text in the middle of a line, you will notice that +characters to the right of the cursor are `pushed over' to make room +for the text that you have inserted. Likewise, when you delete text +behind the cursor, characters to the right of the cursor are `pulled +back' to fill in the blank space created by the removal of the text. A +list of the basic bare essentials for editing the text of an input line +follows. + +C-b + Move back one character. + +C-f + Move forward one character. + +DEL + Delete the character to the left of the cursor. + +C-d + Delete the character underneath the cursor. + +Printing characters + Insert the character into the line at the cursor. + +C-_ + Undo the last thing that you did. You can undo all the way back + to an empty line. + + +File: readline.info, Node: Readline Movement Commands, Next: Readline Killing Commands, Prev: Readline Bare Essentials, Up: Readline Interaction + +Readline Movement Commands +-------------------------- + + The above table describes the most basic possible keystrokes that +you need in order to do editing of the input line. For your +convenience, many other commands have been added in addition to C-b, +C-f, C-d, and DEL. Here are some commands for moving more rapidly +about the line. + +C-a + Move to the start of the line. + +C-e + Move to the end of the line. + +M-f + Move forward a word. + +M-b + Move backward a word. + +C-l + Clear the screen, reprinting the current line at the top. + + Notice how C-f moves forward a character, while M-f moves forward a +word. It is a loose convention that control keystrokes operate on +characters while meta keystrokes operate on words. + + +File: readline.info, Node: Readline Killing Commands, Next: Readline Arguments, Prev: Readline Movement Commands, Up: Readline Interaction + +Readline Killing Commands +------------------------- + + "Killing" text means to delete the text from the line, but to save +it away for later use, usually by "yanking" (re-inserting) it back into +the line. If the description for a command says that it `kills' text, +then you can be sure that you can get the text back in a different (or +the same) place later. + + When you use a kill command, the text is saved in a "kill-ring". +Any number of consecutive kills save all of the killed text together, so +that when you yank it back, you get it all. The kill ring is not line +specific; the text that you killed on a previously typed line is +available to be yanked back later, when you are typing another line. + + Here is the list of commands for killing text. + +C-k + Kill the text from the current cursor position to the end of the + line. + +M-d + Kill from the cursor to the end of the current word, or if between + words, to the end of the next word. + +M-DEL + Kill from the cursor the start of the previous word, or if between + words, to the start of the previous word. + +C-w + Kill from the cursor to the previous whitespace. This is + different than M-DEL because the word boundaries differ. + + And, here is how to "yank" the text back into the line. Yanking +means to copy the most-recently-killed text from the kill buffer. + +C-y + Yank the most recently killed text back into the buffer at the + cursor. + +M-y + Rotate the kill-ring, and yank the new top. You can only do this + if the prior command is C-y or M-y. + + +File: readline.info, Node: Readline Arguments, Prev: Readline Killing Commands, Up: Readline Interaction + +Readline Arguments +------------------ + + You can pass numeric arguments to Readline commands. Sometimes the +argument acts as a repeat count, other times it is the sign of the +argument that is significant. If you pass a negative argument to a +command which normally acts in a forward direction, that command will +act in a backward direction. For example, to kill text back to the +start of the line, you might type M- C-k. + + The general way to pass numeric arguments to a command is to type +meta digits before the command. If the first `digit' you type is a +minus sign (-), then the sign of the argument will be negative. Once +you have typed one meta digit to get the argument started, you can type +the remainder of the digits, and then the command. For example, to give +the C-d command an argument of 10, you could type M-1 0 C-d. + + +File: readline.info, Node: Readline Init File, Next: Bindable Readline Commands, Prev: Readline Interaction, Up: Command Line Editing + +Readline Init File +================== + + Although the Readline library comes with a set of Emacs-like +keybindings installed by default, it is possible that you would like to +use a different set of keybindings. You can customize programs that +use Readline by putting commands in an "init" file in your home +directory. The name of this file is taken from the value of the +environment variable `INPUTRC'. If that variable is unset, the default +is `~/.inputrc'. + + When a program which uses the Readline library starts up, the init +file is read, and the key bindings are set. + + In addition, the `C-x C-r' command re-reads this init file, thus +incorporating any changes that you might have made to it. + +* Menu: + +* Readline Init Syntax:: Syntax for the commands in the inputrc file. +* Conditional Init Constructs:: Conditional key bindings in the inputrc file. + + +File: readline.info, Node: Readline Init Syntax, Next: Conditional Init Constructs, Up: Readline Init File + +Readline Init Syntax +-------------------- + + There are only a few basic constructs allowed in the Readline init +file. Blank lines are ignored. Lines beginning with a # are comments. +Lines beginning with a $ indicate conditional constructs (*note +Conditional Init Constructs::.). Other lines denote variable settings +and key bindings. + +Variable Settings + You can change the state of a few variables in Readline by using + the `set' command within the init file. Here is how you would + specify that you wish to use `vi' line editing commands: + + set editing-mode vi + + Right now, there are only a few variables which can be set; so + few, in fact, that we just list them here: + + `editing-mode' + The `editing-mode' variable controls which editing mode you + are using. By default, Readline starts up in Emacs editing + mode, where the keystrokes are most similar to Emacs. This + variable can be set to either `emacs' or `vi'. + + `horizontal-scroll-mode' + This variable can be set to either `On' or `Off'. Setting it + to `On' means that the text of the lines that you edit will + scroll horizontally on a single screen line when they are + longer than the width of the screen, instead of wrapping onto + a new screen line. By default, this variable is set to `Off'. + + `mark-modified-lines' + This variable, when set to `On', says to display an asterisk + (`*') at the start of history lines which have been modified. + This variable is `off' by default. + + `bell-style' + Controls what happens when Readline wants to ring the + terminal bell. If set to `none', Readline never rings the + bell. If set to `visible', Readline uses a visible bell if + one is available. If set to `audible' (the default), + Readline attempts to ring the terminal's bell. + + `comment-begin' + The string to insert at the beginning of the line when the + `vi-comment' command is executed. The default value is `"#"'. + + `meta-flag' + If set to `on', Readline will enable eight-bit input (it will + not strip the eighth bit from the characters it reads), + regardless of what the terminal claims it can support. The + default value is `off'. + + `convert-meta' + If set to `on', Readline will convert characters with the + eigth bit set to an ASCII key sequence by stripping the eigth + bit and prepending an ESC character, converting them to a + meta-prefixed key sequence. The default value is `on'. + + `output-meta' + If set to `on', Readline will display characters with the + eighth bit set directly rather than as a meta-prefixed escape + sequence. The default is `off'. + + `completion-query-items' + The number of possible completions that determines when the + user is asked whether he wants to see the list of + possibilities. If the number of possible completions is + greater than this value, Readline will ask the user whether + or not he wishes to view them; otherwise, they are simply + listed. The default limit is `100'. + + `keymap' + Sets Readline's idea of the current keymap for key binding + commands. Acceptable `keymap' names are `emacs', + `emacs-standard', `emacs-meta', `emacs-ctlx', `vi', `vi-move', + `vi-command', and `vi-insert'. `vi' is equivalent to + `vi-command'; `emacs' is equivalent to `emacs-standard'. The + default value is `emacs'. The value of the `editing-mode' + variable also affects the default keymap. + + `show-all-if-ambiguous' + This alters the default behavior of the completion functions. + If set to `on', words which have more than one possible + completion cause the matches to be listed immediately instead + of ringing the bell. The default value is `off'. + + `expand-tilde' + If set to `on', tilde expansion is performed when Readline + attempts word completion. The default is `off'. + +Key Bindings + The syntax for controlling key bindings in the init file is + simple. First you have to know the name of the command that you + want to change. The following pages contain tables of the command + name, the default keybinding, and a short description of what the + command does. + + Once you know the name of the command, simply place the name of + the key you wish to bind the command to, a colon, and then the + name of the command on a line in the init file. The name of the + key can be expressed in different ways, depending on which is most + comfortable for you. + + KEYNAME: FUNCTION-NAME or MACRO + KEYNAME is the name of a key spelled out in English. For + example: + Control-u: universal-argument + Meta-Rubout: backward-kill-word + Control-o: ">&output" + + In the above example, `C-u' is bound to the function + `universal-argument', and `C-o' is bound to run the macro + expressed on the right hand side (that is, to insert the text + `>&output' into the line). + + "KEYSEQ": FUNCTION-NAME or MACRO + KEYSEQ differs from KEYNAME above in that strings denoting an + entire key sequence can be specified, by placing the key + sequence in double quotes. Some GNU Emacs style key escapes + can be used, as in the following example, but the special + character names are not recognized. + + "\C-u": universal-argument + "\C-x\C-r": re-read-init-file + "\e[11~": "Function Key 1" + + In the above example, `C-u' is bound to the function + `universal-argument' (just as it was in the first example), + `C-x C-r' is bound to the function `re-read-init-file', and + `ESC [ 1 1 ~' is bound to insert the text `Function Key 1'. + The following escape sequences are available when specifying + key sequences: + + ``\C-'' + control prefix + + ``\M-'' + meta prefix + + ``\e'' + an escape character + + ``\\'' + backslash + + ``\"'' + " + + ``\''' + ' + + When entering the text of a macro, single or double quotes + should be used to indicate a macro definition. Unquoted text + is assumed to be a function name. Backslash will quote any + character in the macro text, including " and '. For example, + the following binding will make `C-x \' insert a single \ + into the line: + "\C-x\\": "\\" + + +File: readline.info, Node: Conditional Init Constructs, Prev: Readline Init Syntax, Up: Readline Init File + +Conditional Init Constructs +--------------------------- + + Readline implements a facility similar in spirit to the conditional +compilation features of the C preprocessor which allows key bindings +and variable settings to be performed as the result of tests. There +are three parser directives used. + +`$if' + The `$if' construct allows bindings to be made based on the + editing mode, the terminal being used, or the application using + Readline. The text of the test extends to the end of the line; no + characters are required to isolate it. + + `mode' + The `mode=' form of the `$if' directive is used to test + whether Readline is in `emacs' or `vi' mode. This may be + used in conjunction with the `set keymap' command, for + instance, to set bindings in the `emacs-standard' and + `emacs-ctlx' keymaps only if Readline is starting out in + `emacs' mode. + + `term' + The `term=' form may be used to include terminal-specific key + bindings, perhaps to bind the key sequences output by the + terminal's function keys. The word on the right side of the + `=' is tested against the full name of the terminal and the + portion of the terminal name before the first `-'. This + allows SUN to match both SUN and SUN-CMD, for instance. + + `application' + The APPLICATION construct is used to include + application-specific settings. Each program using the + Readline library sets the APPLICATION NAME, and you can test + for it. This could be used to bind key sequences to + functions useful for a specific program. For instance, the + following command adds a key sequence that quotes the current + or previous word in Bash: + $if bash + # Quote the current or previous word + "\C-xq": "\eb\"\ef\"" + $endif + +`$endif' + This command, as you saw in the previous example, terminates an + `$if' command. + +`$else' + Commands in this branch of the `$if' directive are executed if the + test fails. + + +File: readline.info, Node: Bindable Readline Commands, Next: Readline vi Mode, Prev: Readline Init File, Up: Command Line Editing + +Bindable Readline Commands +========================== + +* Menu: + +* Commands For Moving:: Moving about the line. +* Commands For History:: Getting at previous lines. +* Commands For Text:: Commands for changing text. +* Commands For Killing:: Commands for killing and yanking. +* Numeric Arguments:: Specifying numeric arguments, repeat counts. +* Commands For Completion:: Getting Readline to do the typing for you. +* Keyboard Macros:: Saving and re-executing typed characters +* Miscellaneous Commands:: Other miscellaneous commands. + + +File: readline.info, Node: Commands For Moving, Next: Commands For History, Up: Bindable Readline Commands + +Commands For Moving +------------------- + +`beginning-of-line (C-a)' + Move to the start of the current line. + +`end-of-line (C-e)' + Move to the end of the line. + +`forward-char (C-f)' + Move forward a character. + +`backward-char (C-b)' + Move back a character. + +`forward-word (M-f)' + Move forward to the end of the next word. Words are composed of + letters and digits. + +`backward-word (M-b)' + Move back to the start of this, or the previous, word. Words are + composed of letters and digits. + +`clear-screen (C-l)' + Clear the screen and redraw the current line, leaving the current + line at the top of the screen. + +`redraw-current-line ()' + Refresh the current line. By default, this is unbound. + + +File: readline.info, Node: Commands For History, Next: Commands For Text, Prev: Commands For Moving, Up: Bindable Readline Commands + +Commands For Manipulating The History +------------------------------------- + +`accept-line (Newline, Return)' + Accept the line regardless of where the cursor is. If this line is + non-empty, add it to the history list. If this line was a history + line, then restore the history line to its original state. + +`previous-history (C-p)' + Move `up' through the history list. + +`next-history (C-n)' + Move `down' through the history list. + +`beginning-of-history (M-<)' + Move to the first line in the history. + +`end-of-history (M->)' + Move to the end of the input history, i.e., the line you are + entering. + +`reverse-search-history (C-r)' + Search backward starting at the current line and moving `up' + through the history as necessary. This is an incremental search. + +`forward-search-history (C-s)' + Search forward starting at the current line and moving `down' + through the the history as necessary. This is an incremental + search. + +`non-incremental-reverse-search-history (M-p)' + Search backward starting at the current line and moving `up' + through the history as necessary using a non-incremental search + for a string supplied by the user. + +`non-incremental-forward-search-history (M-n)' + Search forward starting at the current line and moving `down' + through the the history as necessary using a non-incremental search + for a string supplied by the user. + +`history-search-forward ()' + Search forward through the history for the string of characters + between the start of the current line and the current point. This + is a non-incremental search. By default, this command is unbound. + +`history-search-backward ()' + Search backward through the history for the string of characters + between the start of the current line and the current point. This + is a non-incremental search. By default, this command is unbound. + +`yank-nth-arg (M-C-y)' + Insert the first argument to the previous command (usually the + second word on the previous line). With an argument N, insert the + Nth word from the previous command (the words in the previous + command begin with word 0). A negative argument inserts the Nth + word from the end of the previous command. + +`yank-last-arg (M-., M-_)' + Insert last argument to the previous command (the last word on the + previous line). With an argument, behave exactly like + `yank-nth-arg'. + + +File: readline.info, Node: Commands For Text, Next: Commands For Killing, Prev: Commands For History, Up: Bindable Readline Commands + +Commands For Changing Text +-------------------------- + +`delete-char (C-d)' + Delete the character under the cursor. If the cursor is at the + beginning of the line, there are no characters in the line, and + the last character typed was not C-d, then return EOF. + +`backward-delete-char (Rubout)' + Delete the character behind the cursor. A numeric arg says to kill + the characters instead of deleting them. + +`quoted-insert (C-q, C-v)' + Add the next character that you type to the line verbatim. This is + how to insert key sequences like C-q, for example. + +`tab-insert (M-TAB)' + Insert a tab character. + +`self-insert (a, b, A, 1, !, ...)' + Insert yourself. + +`transpose-chars (C-t)' + Drag the character before the cursor forward over the character at + the cursor, moving the cursor forward as well. If the insertion + point is at the end of the line, then this transposes the last two + characters of the line. Negative argumentss don't work. + +`transpose-words (M-t)' + Drag the word behind the cursor past the word in front of the + cursor moving the cursor over that word as well. + +`upcase-word (M-u)' + Uppercase the current (or following) word. With a negative + argument, do the previous word, but do not move the cursor. + +`downcase-word (M-l)' + Lowercase the current (or following) word. With a negative + argument, do the previous word, but do not move the cursor. + +`capitalize-word (M-c)' + Capitalize the current (or following) word. With a negative + argument, do the previous word, but do not move the cursor. + + +File: readline.info, Node: Commands For Killing, Next: Numeric Arguments, Prev: Commands For Text, Up: Bindable Readline Commands + +Killing And Yanking +------------------- + +`kill-line (C-k)' + Kill the text from the current cursor position to the end of the + line. + +`backward-kill-line (C-x Rubout)' + Kill backward to the beginning of the line. + +`unix-line-discard (C-u)' + Kill backward from the cursor to the beginning of the current line. + Save the killed text on the kill-ring. + +`kill-whole-line ()' + Kill all characters on the current line, no matter where the + cursor is. By default, this is unbound. + +`kill-word (M-d)' + Kill from the cursor to the end of the current word, or if between + words, to the end of the next word. Word boundaries are the same + as `forward-word'. + +`backward-kill-word (M-DEL)' + Kill the word behind the cursor. Word boundaries are the same as + `backward-word'. + +`unix-word-rubout (C-w)' + Kill the word behind the cursor, using white space as a word + boundary. The killed text is saved on the kill-ring. + +`delete-horizontal-space ()' + Delete all spaces and tabs around point. By default, this is + unbound. + +`yank (C-y)' + Yank the top of the kill ring into the buffer at the current + cursor position. + +`yank-pop (M-y)' + Rotate the kill-ring, and yank the new top. You can only do this + if the prior command is yank or yank-pop. + + +File: readline.info, Node: Numeric Arguments, Next: Commands For Completion, Prev: Commands For Killing, Up: Bindable Readline Commands + +Specifying Numeric Arguments +---------------------------- + +`digit-argument (M-0, M-1, ... M--)' + Add this digit to the argument already accumulating, or start a new + argument. M- starts a negative argument. + +`universal-argument ()' + Each time this is executed, the argument count is multiplied by + four. The argument count is initially one, so executing this + function the first time makes the argument count four. By + default, this is not bound to a key. + + +File: readline.info, Node: Commands For Completion, Next: Keyboard Macros, Prev: Numeric Arguments, Up: Bindable Readline Commands + +Letting Readline Type For You +----------------------------- + +`complete (TAB)' + Attempt to do completion on the text before the cursor. This is + application-specific. Generally, if you are typing a filename + argument, you can do filename completion; if you are typing a + command, you can do command completion, if you are typing in a + symbol to GDB, you can do symbol name completion, if you are + typing in a variable to Bash, you can do variable name completion, + and so on. + +`possible-completions (M-?)' + List the possible completions of the text before the cursor. + +`insert-completions ()' + Insert all completions of the text before point that would have + been generated by `possible-completions'. By default, this is not + bound to a key. + + +File: readline.info, Node: Keyboard Macros, Next: Miscellaneous Commands, Prev: Commands For Completion, Up: Bindable Readline Commands + +Keyboard Macros +--------------- + +`start-kbd-macro (C-x ()' + Begin saving the characters typed into the current keyboard macro. + +`end-kbd-macro (C-x ))' + Stop saving the characters typed into the current keyboard macro + and save the definition. + +`call-last-kbd-macro (C-x e)' + Re-execute the last keyboard macro defined, by making the + characters in the macro appear as if typed at the keyboard. + + +File: readline.info, Node: Miscellaneous Commands, Prev: Keyboard Macros, Up: Bindable Readline Commands + +Some Miscellaneous Commands +--------------------------- + +`re-read-init-file (C-x C-r)' + Read in the contents of your init file, and incorporate any + bindings or variable assignments found there. + +`abort (C-g)' + Abort the current editing command and ring the terminal's bell + (subject to the setting of `bell-style'). + +`do-uppercase-version (M-a, M-b, ...)' + Run the command that is bound to the corresoponding uppercase + character. + +`prefix-meta (ESC)' + Make the next character that you type be metafied. This is for + people without a meta key. Typing `ESC f' is equivalent to typing + `M-f'. + +`undo (C-_, C-x C-u)' + Incremental undo, separately remembered for each line. + +`revert-line (M-r)' + Undo all changes made to this line. This is like typing the `undo' + command enough times to get back to the beginning. + +`tilde-expand (M-~)' + Perform tilde expansion on the current word. + +`dump-functions ()' + Print all of the functions and their key bindings to the readline + output stream. If a numeric argument is supplied, the output is + formatted in such a way that it can be made part of an INPUTRC + file. + + +File: readline.info, Node: Readline vi Mode, Prev: Bindable Readline Commands, Up: Command Line Editing + +Readline vi Mode +================ + + While the Readline library does not have a full set of `vi' editing +functions, it does contain enough to allow simple editing of the line. +The Readline `vi' mode behaves as specified in the Posix 1003.2 +standard. + + In order to switch interactively between `Emacs' and `Vi' editing +modes, use the command M-C-j (toggle-editing-mode). The Readline +default is `emacs' mode. + + When you enter a line in `vi' mode, you are already placed in +`insertion' mode, as if you had typed an `i'. Pressing ESC switches +you into `command' mode, where you can edit the text of the line with +the standard `vi' movement keys, move to previous history lines with +`k', and following lines with `j', and so forth. + + This document describes the GNU Readline Library, a utility for +aiding in the consitency of user interface across discrete programs +that need to provide a command line interface. + + Copyright (C) 1988, 1994 Free Software Foundation, Inc. + + Permission is granted to make and distribute verbatim copies of this +manual provided the copyright notice and this permission notice pare +preserved on all copies. + + Permission is granted to copy and distribute modified versions of +this manual under the conditions for verbatim copying, provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + + Permission is granted to copy and distribute translations of this +manual into another language, under the above conditions for modified +versions, except that this permission notice may be stated in a +translation approved by the Foundation. + + +File: readline.info, Node: Programming with GNU Readline, Next: Concept Index, Prev: Command Line Editing, Up: Top + +Programming with GNU Readline +***************************** + + This chapter describes the interface between the GNU Readline +Library and other programs. If you are a programmer, and you wish to +include the features found in GNU Readline such as completion, line +editing, and interactive history manipulation in your own programs, +this section is for you. + +* Menu: + +* Basic Behavior:: Using the default behavior of Readline. +* Custom Functions:: Adding your own functions to Readline. +* Readline Convenience Functions:: Functions which Readline supplies to + aid in writing your own +* Custom Completers:: Supplanting or supplementing Readline's + completion functions. + + +File: readline.info, Node: Basic Behavior, Next: Custom Functions, Up: Programming with GNU Readline + +Basic Behavior +============== + + Many programs provide a command line interface, such as `mail', +`ftp', and `sh'. For such programs, the default behaviour of Readline +is sufficient. This section describes how to use Readline in the +simplest way possible, perhaps to replace calls in your code to +`gets()' or `fgets ()'. + + The function `readline ()' prints a prompt and then reads and returns +a single line of text from the user. The line `readline' returns is +allocated with `malloc ()'; you should `free ()' the line when you are +done with it. The declaration for `readline' in ANSI C is + + `char *readline (char *PROMPT);' + +So, one might say + `char *line = readline ("Enter a line: ");' + +in order to read a line of text from the user. The line returned has +the final newline removed, so only the text remains. + + If `readline' encounters an `EOF' while reading the line, and the +line is empty at that point, then `(char *)NULL' is returned. +Otherwise, the line is ended just as if a newline had been typed. + + If you want the user to be able to get at the line later, (with C-p +for example), you must call `add_history ()' to save the line away in a +"history" list of such lines. + + `add_history (line)'; + +For full details on the GNU History Library, see the associated manual. + + It is preferable to avoid saving empty lines on the history list, +since users rarely have a burning need to reuse a blank line. Here is +a function which usefully replaces the standard `gets ()' library +function, and has the advantage of no static buffer to overflow: + + /* A static variable for holding the line. */ + static char *line_read = (char *)NULL; + + /* Read a string, and return a pointer to it. Returns NULL on EOF. */ + char * + rl_gets () + { + /* If the buffer has already been allocated, return the memory + to the free pool. */ + if (line_read) + { + free (line_read); + line_read = (char *)NULL; + } + + /* Get a line from the user. */ + line_read = readline (""); + + /* If the line has any text in it, save it on the history. */ + if (line_read && *line_read) + add_history (line_read); + + return (line_read); + } + + This function gives the user the default behaviour of TAB +completion: completion on file names. If you do not want Readline to +complete on filenames, you can change the binding of the TAB key with +`rl_bind_key ()'. + + `int rl_bind_key (int KEY, int (*FUNCTION)());' + + `rl_bind_key ()' takes two arguments: KEY is the character that you +want to bind, and FUNCTION is the address of the function to call when +KEY is pressed. Binding TAB to `rl_insert ()' makes TAB insert itself. +`rl_bind_key ()' returns non-zero if KEY is not a valid ASCII character +code (between 0 and 255). + + Thus, to disable the default TAB behavior, the following suffices: + `rl_bind_key ('\t', rl_insert);' + + This code should be executed once at the start of your program; you +might write a function called `initialize_readline ()' which performs +this and other desired initializations, such as installing custom +completers (*note Custom Completers::.). + + +File: readline.info, Node: Custom Functions, Next: Readline Convenience Functions, Prev: Basic Behavior, Up: Programming with GNU Readline + +Custom Functions +================ + + Readline provides many functions for manipulating the text of the +line, but it isn't possible to anticipate the needs of all programs. +This section describes the various functions and variables defined +within the Readline library which allow a user program to add +customized functionality to Readline. + +* Menu: + +* The Function Type:: C declarations to make code readable. +* Function Writing:: Variables and calling conventions. + + +File: readline.info, Node: The Function Type, Next: Function Writing, Up: Custom Functions + +The Function Type +----------------- + + For readabilty, we declare a new type of object, called "Function". +A `Function' is a C function which returns an `int'. The type +declaration for `Function' is: + +`typedef int Function ();' + + The reason for declaring this new type is to make it easier to write +code describing pointers to C functions. Let us say we had a variable +called FUNC which was a pointer to a function. Instead of the classic +C declaration + + `int (*)()func;' + +we may write + + `Function *func;' + +Similarly, there are + + typedef void VFunction (); + typedef char *CPFunction (); and + typedef char **CPPFunction (); + +for functions returning no value, `pointer to char', and `pointer to +pointer to char', respectively. + + +File: readline.info, Node: Function Writing, Prev: The Function Type, Up: Custom Functions + +Writing a New Function +---------------------- + + In order to write new functions for Readline, you need to know the +calling conventions for keyboard-invoked functions, and the names of the +variables that describe the current state of the line read so far. + + The calling sequence for a command `foo' looks like + + `foo (int count, int key)' + +where COUNT is the numeric argument (or 1 if defaulted) and KEY is the +key that invoked this function. + + It is completely up to the function as to what should be done with +the numeric argument. Some functions use it as a repeat count, some as +a flag, and others to choose alternate behavior (refreshing the current +line as opposed to refreshing the screen, for example). Some choose to +ignore it. In general, if a function uses the numeric argument as a +repeat count, it should be able to do something useful with both +negative and positive arguments. At the very least, it should be aware +that it can be passed a negative argument. + + - Variable: char * rl_line_buffer + This is the line gathered so far. You are welcome to modify the + contents of the line, but see *Note Allowing Undoing::. + + - Variable: int rl_point + The offset of the current cursor position in `rl_line_buffer' (the + *point*). + + - Variable: int rl_end + The number of characters present in `rl_line_buffer'. When + `rl_point' is at the end of the line, `rl_point' and `rl_end' are + equal. + + - Variable: int rl_mark + The mark (saved position) in the current line. If set, the mark + and point define a *region*. + + - Variable: int rl_done + Setting this to a non-zero value causes Readline to return the + current line immediately. + + - Variable: int rl_pending_input + Setting this to a value makes it the next keystroke read. This is + a way to stuff a single character into the input stream. + + - Variable: char * rl_prompt + The prompt Readline uses. This is set from the argument to + `readline ()', and should not be assigned to directly. + + - Variable: char * rl_terminal_name + The terminal type, used for initialization. + + - Variable: char * rl_readline_name + This variable is set to a unique name by each application using + Readline. The value allows conditional parsing of the inputrc file + (*note Conditional Init Constructs::.). + + - Variable: FILE * rl_instream + The stdio stream from which Readline reads input. + + - Variable: FILE * rl_outstream + The stdio stream to which Readline performs output. + + - Variable: Function * rl_startup_hook + If non-zero, this is the address of a function to call just before + `readline' prints the first prompt. + + +File: readline.info, Node: Readline Convenience Functions, Next: Custom Completers, Prev: Custom Functions, Up: Programming with GNU Readline + +Readline Convenience Functions +============================== + +* Menu: + +* Function Naming:: How to give a function you write a name. +* Keymaps:: Making keymaps. +* Binding Keys:: Changing Keymaps. +* Associating Function Names and Bindings:: Translate function names to + key sequences. +* Allowing Undoing:: How to make your functions undoable. +* Redisplay:: Functions to control line display. +* Modifying Text:: Functions to modify `rl_line_buffer'. +* Utility Functions:: Generally useful functions and hooks. + + +File: readline.info, Node: Function Naming, Next: Keymaps, Up: Readline Convenience Functions + +Naming a Function +----------------- + + The user can dynamically change the bindings of keys while using +Readline. This is done by representing the function with a descriptive +name. The user is able to type the descriptive name when referring to +the function. Thus, in an init file, one might find + + Meta-Rubout: backward-kill-word + + This binds the keystroke Meta-Rubout to the function *descriptively* +named `backward-kill-word'. You, as the programmer, should bind the +functions you write to descriptive names as well. Readline provides a +function for doing that: + + - Function: int rl_add_defun (char *name, Function *function, int key) + Add NAME to the list of named functions. Make FUNCTION be the + function that gets called. If KEY is not -1, then bind it to + FUNCTION using `rl_bind_key ()'. + + Using this function alone is sufficient for most applications. It is +the recommended way to add a few functions to the default functions that +Readline has built in. If you need to do something other than adding a +function to Readline, you may need to use the underlying functions +described below. + + +File: readline.info, Node: Keymaps, Next: Binding Keys, Prev: Function Naming, Up: Readline Convenience Functions + +Selecting a Keymap +------------------ + + Key bindings take place on a "keymap". The keymap is the +association between the keys that the user types and the functions that +get run. You can make your own keymaps, copy existing keymaps, and tell +Readline which keymap to use. + + - Function: Keymap rl_make_bare_keymap () + Returns a new, empty keymap. The space for the keymap is + allocated with `malloc ()'; you should `free ()' it when you are + done. + + - Function: Keymap rl_copy_keymap (Keymap map) + Return a new keymap which is a copy of MAP. + + - Function: Keymap rl_make_keymap () + Return a new keymap with the printing characters bound to + rl_insert, the lowercase Meta characters bound to run their + equivalents, and the Meta digits bound to produce numeric + arguments. + + - Function: void rl_discard_keymap (Keymap keymap) + Free the storage associated with KEYMAP. + + Readline has several internal keymaps. These functions allow you to +change which keymap is active. + + - Function: Keymap rl_get_keymap () + Returns the currently active keymap. + + - Function: void rl_set_keymap (Keymap keymap) + Makes KEYMAP the currently active keymap. + + - Function: Keymap rl_get_keymap_by_name (char *name) + Return the keymap matching NAME. NAME is one which would be + supplied in a `set keymap' inputrc line (*note Readline Init + File::.). + + +File: readline.info, Node: Binding Keys, Next: Associating Function Names and Bindings, Prev: Keymaps, Up: Readline Convenience Functions + +Binding Keys +------------ + + You associate keys with functions through the keymap. Readline has +several internal keymaps: `emacs_standard_keymap', `emacs_meta_keymap', +`emacs_ctlx_keymap', `vi_movement_keymap', and `vi_insertion_keymap'. +`emacs_standard_keymap' is the default, and the examples in this manual +assume that. + + These functions manage key bindings. + + - Function: int rl_bind_key (int key, Function *function) + Binds KEY to FUNCTION in the currently active keymap. Returns + non-zero in the case of an invalid KEY. + + - Function: int rl_bind_key_in_map (int key, Function *function, + Keymap map) + Bind KEY to FUNCTION in MAP. Returns non-zero in the case of an + invalid KEY. + + - Function: int rl_unbind_key (int key) + Bind KEY to the null function in the currently active keymap. + Returns non-zero in case of error. + + - Function: int rl_unbind_key_in_map (int key, Keymap map) + Bind KEY to the null function in MAP. Returns non-zero in case of + error. + + - Function: int rl_generic_bind (int type, char *keyseq, char *data, + Keymap map) + Bind the key sequence represented by the string KEYSEQ to the + arbitrary pointer DATA. TYPE says what kind of data is pointed to + by DATA; this can be a function (`ISFUNC'), a macro (`ISMACR'), or + a keymap (`ISKMAP'). This makes new keymaps as necessary. The + initial keymap in which to do bindings is MAP. + + - Function: int rl_parse_and_bind (char *line) + Parse LINE as if it had been read from the `inputrc' file and + perform any key bindings and variable assignments found (*note + Readline Init File::.). + + +File: readline.info, Node: Associating Function Names and Bindings, Next: Allowing Undoing, Prev: Binding Keys, Up: Readline Convenience Functions + +Associating Function Names and Bindings +--------------------------------------- + + These functions allow you to find out what keys invoke named +functions and the functions invoked by a particular key sequence. + + - Function: Function * rl_named_function (char *name) + Return the function with name NAME. + + - Function: Function * rl_function_of_keyseq (char *keyseq, Keymap + map, int *type) + Return the function invoked by KEYSEQ in keymap MAP. If MAP is + NULL, the current keymap is used. If TYPE is not NULL, the type + of the object is returned in it (one of `ISFUNC', `ISKMAP', or + `ISMACR'). + + - Function: char ** rl_invoking_keyseqs (Function *function) + Return an array of strings representing the key sequences used to + invoke FUNCTION in the current keymap. + + - Function: char ** rl_invoking_keyseqs_in_map (Function *function, + Keymap map) + Return an array of strings representing the key sequences used to + invoke FUNCTION in the keymap MAP. + + +File: readline.info, Node: Allowing Undoing, Next: Redisplay, Prev: Associating Function Names and Bindings, Up: Readline Convenience Functions + +Allowing Undoing +---------------- + + Supporting the undo command is a painless thing, and makes your +functions much more useful. It is certainly easy to try something if +you know you can undo it. I could use an undo function for the stock +market. + + If your function simply inserts text once, or deletes text once, and +uses `rl_insert_text ()' or `rl_delete_text ()' to do it, then undoing +is already done for you automatically. + + If you do multiple insertions or multiple deletions, or any +combination of these operations, you should group them together into +one operation. This is done with `rl_begin_undo_group ()' and +`rl_end_undo_group ()'. + + The types of events that can be undone are: + + enum undo_code { UNDO_DELETE, UNDO_INSERT, UNDO_BEGIN, UNDO_END }; + + Notice that `UNDO_DELETE' means to insert some text, and +`UNDO_INSERT' means to delete some text. That is, the undo code tells +undo what to undo, not how to undo it. `UNDO_BEGIN' and `UNDO_END' are +tags added by `rl_begin_undo_group ()' and `rl_end_undo_group ()'. + + - Function: int rl_begin_undo_group () + Begins saving undo information in a group construct. The undo + information usually comes from calls to `rl_insert_text ()' and + `rl_delete_text ()', but could be the result of calls to + `rl_add_undo ()'. + + - Function: int rl_end_undo_group () + Closes the current undo group started with `rl_begin_undo_group + ()'. There should be one call to `rl_end_undo_group ()' for each + call to `rl_begin_undo_group ()'. + + - Function: void rl_add_undo (enum undo_code what, int start, int end, + char *text) + Remember how to undo an event (according to WHAT). The affected + text runs from START to END, and encompasses TEXT. + + - Function: void free_undo_list () + Free the existing undo list. + + - Function: int rl_do_undo () + Undo the first thing on the undo list. Returns `0' if there was + nothing to undo, non-zero if something was undone. + + Finally, if you neither insert nor delete text, but directly modify +the existing text (e.g., change its case), call `rl_modifying ()' once, +just before you modify the text. You must supply the indices of the +text range that you are going to modify. + + - Function: int rl_modifying (int start, int end) + Tell Readline to save the text between START and END as a single + undo unit. It is assumed that you will subsequently modify that + text. + + +File: readline.info, Node: Redisplay, Next: Modifying Text, Prev: Allowing Undoing, Up: Readline Convenience Functions + +Redisplay +--------- + + - Function: int rl_redisplay () + Change what's displayed on the screen to reflect the current + contents of `rl_line_buffer'. + + - Function: int rl_forced_update_display () + Force the line to be updated and redisplayed, whether or not + Readline thinks the screen display is correct. + + - Function: int rl_on_new_line () + Tell the update routines that we have moved onto a new (empty) + line, usually after ouputting a newline. + + - Function: int rl_reset_line_state () + Reset the display state to a clean state and redisplay the current + line starting on a new line. + + - Function: int rl_message (va_alist) + The arguments are a string as would be supplied to `printf'. The + resulting string is displayed in the "echo area". The echo area + is also used to display numeric arguments and search strings. + + - Function: int rl_clear_message () + Clear the message in the echo area. + diff --git a/doc/readline.info-2 b/doc/readline.info-2 new file mode 100644 index 0000000..35681aa --- /dev/null +++ b/doc/readline.info-2 @@ -0,0 +1,978 @@ +This is Info file readline.info, produced by Makeinfo-1.55 from the +input file rlman.texinfo. + + This document describes the GNU Readline Library, a utility which +aids in the consistency of user interface across discrete programs that +need to provide a command line interface. + + Copyright (C) 1988, 1991 Free Software Foundation, Inc. + + Permission is granted to make and distribute verbatim copies of this +manual provided the copyright notice and this permission notice pare +preserved on all copies. + + Permission is granted to copy and distribute modified versions of +this manual under the conditions for verbatim copying, provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + + Permission is granted to copy and distribute translations of this +manual into another language, under the above conditions for modified +versions, except that this permission notice may be stated in a +translation approved by the Foundation. + + +File: readline.info, Node: Modifying Text, Next: Utility Functions, Prev: Redisplay, Up: Readline Convenience Functions + +Modifying Text +-------------- + + - Function: int rl_insert_text (char *text) + Insert TEXT into the line at the current cursor position. + + - Function: int rl_delete_text (int start, int end) + Delete the text between START and END in the current line. + + - Function: char * rl_copy_text (int start, int end) + Return a copy of the text between START and END in the current + line. + + - Function: int rl_kill_text (int start, int end) + Copy the text between START and END in the current line to the + kill ring, appending or prepending to the last kill if the last + command was a kill command. The text is deleted. If START is + less than END, the text is appended, otherwise prepended. If the + last command was not a kill, a new kill ring slot is used. + + +File: readline.info, Node: Utility Functions, Prev: Modifying Text, Up: Readline Convenience Functions + +Utility Functions +----------------- + + - Function: int rl_reset_terminal (char *terminal_name) + Reinitialize Readline's idea of the terminal settings using + TERMINAL_NAME as the terminal type (e.g., `vt100'). + + - Function: int alphabetic (int c) + Return 1 if C is an alphabetic character. + + - Function: int numeric (int c) + Return 1 if C is a numeric character. + + - Function: int ding () + Ring the terminal bell, obeying the setting of `bell-style'. + + The following are implemented as macros, defined in `chartypes.h'. + + - Function: int uppercase_p (int c) + Return 1 if C is an uppercase alphabetic character. + + - Function: int lowercase_p (int c) + Return 1 if C is a lowercase alphabetic character. + + - Function: int digit_p (int c) + Return 1 if C is a numeric character. + + - Function: int to_upper (int c) + If C is a lowercase alphabetic character, return the corresponding + uppercase character. + + - Function: int to_lower (int c) + If C is an uppercase alphabetic character, return the corresponding + lowercase character. + + - Function: int digit_value (int c) + If C is a number, return the value it represents. + +An Example +---------- + + Here is a function which changes lowercase characters to their +uppercase equivalents, and uppercase characters to lowercase. If this +function was bound to `M-c', then typing `M-c' would change the case of +the character under point. Typing `M-1 0 M-c' would change the case of +the following 10 characters, leaving the cursor on the last character +changed. + + /* Invert the case of the COUNT following characters. */ + int + invert_case_line (count, key) + int count, key; + { + register int start, end, i; + + start = rl_point; + + if (rl_point >= rl_end) + return (0); + + if (count < 0) + { + direction = -1; + count = -count; + } + else + direction = 1; + + /* Find the end of the range to modify. */ + end = start + (count * direction); + + /* Force it to be within range. */ + if (end > rl_end) + end = rl_end; + else if (end < 0) + end = 0; + + if (start == end) + return (0); + + if (start > end) + { + int temp = start; + start = end; + end = temp; + } + + /* Tell readline that we are modifying the line, so it will save + the undo information. */ + rl_modifying (start, end); + + for (i = start; i != end; i++) + { + if (uppercase_p (rl_line_buffer[i])) + rl_line_buffer[i] = to_lower (rl_line_buffer[i]); + else if (lowercase_p (rl_line_buffer[i])) + rl_line_buffer[i] = to_upper (rl_line_buffer[i]); + } + /* Move point to on top of the last character changed. */ + rl_point = (direction == 1) ? end - 1 : start; + return (0); + } + + +File: readline.info, Node: Custom Completers, Prev: Readline Convenience Functions, Up: Programming with GNU Readline + +Custom Completers +================= + + Typically, a program that reads commands from the user has a way of +disambiguating commands and data. If your program is one of these, then +it can provide completion for commands, data, or both. The following +sections describe how your program and Readline cooperate to provide +this service. + +* Menu: + +* How Completing Works:: The logic used to do completion. +* Completion Functions:: Functions provided by Readline. +* Completion Variables:: Variables which control completion. +* A Short Completion Example:: An example of writing completer subroutines. + + +File: readline.info, Node: How Completing Works, Next: Completion Functions, Up: Custom Completers + +How Completing Works +-------------------- + + In order to complete some text, the full list of possible completions +must be available. That is, it is not possible to accurately expand a +partial word without knowing all of the possible words which make sense +in that context. The Readline library provides the user interface to +completion, and two of the most common completion functions: filename +and username. For completing other types of text, you must write your +own completion function. This section describes exactly what such +functions must do, and provides an example. + + There are three major functions used to perform completion: + + 1. The user-interface function `rl_complete ()'. This function is + called with the same arguments as other Readline functions + intended for interactive use: COUNT and INVOKING_KEY. It + isolates the word to be completed and calls `completion_matches + ()' to generate a list of possible completions. It then either + lists the possible completions, inserts the possible completions, + or actually performs the completion, depending on which behavior + is desired. + + 2. The internal function `completion_matches ()' uses your + "generator" function to generate the list of possible matches, and + then returns the array of these matches. You should place the + address of your generator function in + `rl_completion_entry_function'. + + 3. The generator function is called repeatedly from + `completion_matches ()', returning a string each time. The + arguments to the generator function are TEXT and STATE. TEXT is + the partial word to be completed. STATE is zero the first time + the function is called, allowing the generator to perform any + necessary initialization, and a positive non-zero integer for each + subsequent call. When the generator function returns `(char + *)NULL' this signals `completion_matches ()' that there are no + more possibilities left. Usually the generator function computes + the list of possible completions when STATE is zero, and returns + them one at a time on subsequent calls. Each string the generator + function returns as a match must be allocated with `malloc()'; + Readline frees the strings when it has finished with them. + + + - Function: int rl_complete (int ignore, int invoking_key) + Complete the word at or before point. You have supplied the + function that does the initial simple matching selection algorithm + (see `completion_matches ()'). The default is to do filename + completion. + + - Variable: Function * rl_completion_entry_function + This is a pointer to the generator function for `completion_matches + ()'. If the value of `rl_completion_entry_function' is `(Function + *)NULL' then the default filename generator function, + `filename_entry_function ()', is used. + + +File: readline.info, Node: Completion Functions, Next: Completion Variables, Prev: How Completing Works, Up: Custom Completers + +Completion Functions +-------------------- + + Here is the complete list of callable completion functions present in +Readline. + + - Function: int rl_complete_internal (int what_to_do) + Complete the word at or before point. WHAT_TO_DO says what to do + with the completion. A value of `?' means list the possible + completions. `TAB' means do standard completion. `*' means + insert all of the possible completions. `!' means to display all + of the possible completions, if there is more than one, as well as + performing partial completion. + + - Function: int rl_complete (int ignore, int invoking_key) + Complete the word at or before point. You have supplied the + function that does the initial simple matching selection algorithm + (see `completion_matches ()' and `rl_completion_entry_function'). + The default is to do filename completion. This calls + `rl_complete_internal ()' with an argument depending on + INVOKING_KEY. + + - Function: int rl_possible_completions (int count, int invoking_key)) + List the possible completions. See description of `rl_complete + ()'. This calls `rl_complete_internal ()' with an argument of `?'. + + - Function: int rl_insert_completions (int count, int invoking_key)) + Insert the list of possible completions into the line, deleting the + partially-completed word. See description of `rl_complete ()'. + This calls `rl_complete_internal ()' with an argument of `*'. + + - Function: char ** completion_matches (char *text, CPFunction + *entry_func) + Returns an array of `(char *)' which is a list of completions for + TEXT. If there are no completions, returns `(char **)NULL'. The + first entry in the returned array is the substitution for TEXT. + The remaining entries are the possible completions. The array is + terminated with a `NULL' pointer. + + ENTRY_FUNC is a function of two args, and returns a `(char *)'. + The first argument is TEXT. The second is a state argument; it is + zero on the first call, and non-zero on subsequent calls. + eNTRY_FUNC returns a `NULL' pointer to the caller when there are + no more matches. + + - Function: char * filename_completion_function (char *text, int state) + A generator function for filename completion in the general case. + Note that completion in Bash is a little different because of all + the pathnames that must be followed when looking up completions + for a command. The Bash source is a useful reference for writing + custom completion functions. + + - Function: char * username_completion_function (char *text, int state) + A completion generator for usernames. TEXT contains a partial + username preceded by a random character (usually `~'). As with all + completion generators, STATE is zero on the first call and non-zero + for subsequent calls. + + +File: readline.info, Node: Completion Variables, Next: A Short Completion Example, Prev: Completion Functions, Up: Custom Completers + +Completion Variables +-------------------- + + - Variable: Function * rl_completion_entry_function + A pointer to the generator function for `completion_matches ()'. + `NULL' means to use `filename_entry_function ()', the default + filename completer. + + - Variable: CPPFunction * rl_attempted_completion_function + A pointer to an alternative function to create matches. The + function is called with TEXT, START, and END. START and END are + indices in `rl_line_buffer' saying what the boundaries of TEXT + are. If this function exists and returns `NULL', or if this + variable is set to `NULL', then `rl_complete ()' will call the + value of `rl_completion_entry_function' to generate matches, + otherwise the array of strings returned will be used. + + - Variable: int rl_completion_query_items + Up to this many items will be displayed in response to a + possible-completions call. After that, we ask the user if she is + sure she wants to see them all. The default value is 100. + + - Variable: char * rl_basic_word_break_characters + The basic list of characters that signal a break between words for + the completer routine. The default value of this variable is the + characters which break words for completion in Bash, i.e., `" + \t\n\"\\'`@$><=;|&{("'. + + - Variable: char * rl_completer_word_break_characters + The list of characters that signal a break between words for + `rl_complete_internal ()'. The default list is the value of + `rl_basic_word_break_characters'. + + - Variable: char * rl_special_prefixes + The list of characters that are word break characters, but should + be left in TEXT when it is passed to the completion function. + Programs can use this to help determine what kind of completing to + do. For instance, Bash sets this variable to "$@" so that it can + complete shell variables and hostnames. + + - Variable: int rl_ignore_completion_duplicates + If non-zero, then disallow duplicates in the matches. Default is + 1. + + - Variable: int rl_filename_completion_desired + Non-zero means that the results of the matches are to be treated as + filenames. This is *always* zero on entry, and can only be changed + within a completion entry generator function. If it is set to a + non-zero value, directory names have a slash appended and Readline + attempts to quote completed filenames if they contain any embedded + word break characters. + + - Variable: int rl_filename_quoting_desired + Non-zero means that the results of the matches are to be quoted + using double quotes (or an application-specific quoting mechanism) + if the completed filename contains any characters in + `rl_completer_word_break_chars'. This is *always* non-zero on + entry, and can only be changed within a completion entry generator + function. + + - Variable: Function * rl_ignore_some_completions_function + This function, if defined, is called by the completer when real + filename completion is done, after all the matching names have + been generated. It is passed a `NULL' terminated array of matches. + The first element (`matches[0]') is the maximal substring common + to all matches. This function can re-arrange the list of matches + as required, but each element deleted from the array must be freed. + + - Variable: char * rl_completer_quote_characters + List of characters which can be used to quote a substring of the + line. Completion occurs on the entire substring, and within the + substring `rl_completer_word_break_characters' are treated as any + other character, unless they also appear within this list. + + +File: readline.info, Node: A Short Completion Example, Prev: Completion Variables, Up: Custom Completers + +A Short Completion Example +-------------------------- + + Here is a small application demonstrating the use of the GNU Readline +library. It is called `fileman', and the source code resides in +`examples/fileman.c'. This sample application provides completion of +command names, line editing features, and access to the history list. + + /* fileman.c -- A tiny application which demonstrates how to use the + GNU Readline library. This application interactively allows users + to manipulate files and their modes. */ + + #include + #include + #include + #include + #include + + #include + #include + + extern char *getwd (); + extern char *xmalloc (); + + /* The names of functions that actually do the manipulation. */ + int com_list (), com_view (), com_rename (), com_stat (), com_pwd (); + int com_delete (), com_help (), com_cd (), com_quit (); + + /* A structure which contains information on the commands this program + can understand. */ + + typedef struct { + char *name; /* User printable name of the function. */ + Function *func; /* Function to call to do the job. */ + char *doc; /* Documentation for this function. */ + } COMMAND; + + COMMAND commands[] = { + { "cd", com_cd, "Change to directory DIR" }, + { "delete", com_delete, "Delete FILE" }, + { "help", com_help, "Display this text" }, + { "?", com_help, "Synonym for `help'" }, + { "list", com_list, "List files in DIR" }, + { "ls", com_list, "Synonym for `list'" }, + { "pwd", com_pwd, "Print the current working directory" }, + { "quit", com_quit, "Quit using Fileman" }, + { "rename", com_rename, "Rename FILE to NEWNAME" }, + { "stat", com_stat, "Print out statistics on FILE" }, + { "view", com_view, "View the contents of FILE" }, + { (char *)NULL, (Function *)NULL, (char *)NULL } + }; + + /* Forward declarations. */ + char *stripwhite (); + COMMAND *find_command (); + + /* The name of this program, as taken from argv[0]. */ + char *progname; + + /* When non-zero, this global means the user is done using this program. */ + int done; + + char * + dupstr (s) + int s; + { + char *r; + + r = xmalloc (strlen (s) + 1); + strcpy (r, s); + return (r); + } + + main (argc, argv) + int argc; + char **argv; + { + char *line, *s; + + progname = argv[0]; + + initialize_readline (); /* Bind our completer. */ + + /* Loop reading and executing lines until the user quits. */ + for ( ; done == 0; ) + { + line = readline ("FileMan: "); + + if (!line) + break; + + /* Remove leading and trailing whitespace from the line. + Then, if there is anything left, add it to the history list + and execute it. */ + s = stripwhite (line); + + if (*s) + { + add_history (s); + execute_line (s); + } + + free (line); + } + exit (0); + } + + /* Execute a command line. */ + int + execute_line (line) + char *line; + { + register int i; + COMMAND *command; + char *word; + + /* Isolate the command word. */ + i = 0; + while (line[i] && whitespace (line[i])) + i++; + word = line + i; + + while (line[i] && !whitespace (line[i])) + i++; + + if (line[i]) + line[i++] = '\0'; + + command = find_command (word); + + if (!command) + { + fprintf (stderr, "%s: No such command for FileMan.\n", word); + return (-1); + } + + /* Get argument to command, if any. */ + while (whitespace (line[i])) + i++; + + word = line + i; + + /* Call the function. */ + return ((*(command->func)) (word)); + } + + /* Look up NAME as the name of a command, and return a pointer to that + command. Return a NULL pointer if NAME isn't a command name. */ + COMMAND * + find_command (name) + char *name; + { + register int i; + + for (i = 0; commands[i].name; i++) + if (strcmp (name, commands[i].name) == 0) + return (&commands[i]); + + return ((COMMAND *)NULL); + } + + /* Strip whitespace from the start and end of STRING. Return a pointer + into STRING. */ + char * + stripwhite (string) + char *string; + { + register char *s, *t; + + for (s = string; whitespace (*s); s++) + ; + + if (*s == 0) + return (s); + + t = s + strlen (s) - 1; + while (t > s && whitespace (*t)) + t--; + *++t = '\0'; + + return s; + } + + /* **************************************************************** */ + /* */ + /* Interface to Readline Completion */ + /* */ + /* **************************************************************** */ + + char *command_generator (); + char **fileman_completion (); + + /* Tell the GNU Readline library how to complete. We want to try to complete + on command names if this is the first word in the line, or on filenames + if not. */ + initialize_readline () + { + /* Allow conditional parsing of the ~/.inputrc file. */ + rl_readline_name = "FileMan"; + + /* Tell the completer that we want a crack first. */ + rl_attempted_completion_function = (CPPFunction *)fileman_completion; + } + + /* Attempt to complete on the contents of TEXT. START and END show the + region of TEXT that contains the word to complete. We can use the + entire line in case we want to do some simple parsing. Return the + array of matches, or NULL if there aren't any. */ + char ** + fileman_completion (text, start, end) + char *text; + int start, end; + { + char **matches; + + matches = (char **)NULL; + + /* If this word is at the start of the line, then it is a command + to complete. Otherwise it is the name of a file in the current + directory. */ + if (start == 0) + matches = completion_matches (text, command_generator); + + return (matches); + } + + /* Generator function for command completion. STATE lets us know whether + to start from scratch; without any state (i.e. STATE == 0), then we + start at the top of the list. */ + char * + command_generator (text, state) + char *text; + int state; + { + static int list_index, len; + char *name; + + /* If this is a new word to complete, initialize now. This includes + saving the length of TEXT for efficiency, and initializing the index + variable to 0. */ + if (!state) + { + list_index = 0; + len = strlen (text); + } + + /* Return the next name which partially matches from the command list. */ + while (name = commands[list_index].name) + { + list_index++; + + if (strncmp (name, text, len) == 0) + return (dupstr(name)); + } + + /* If no names matched, then return NULL. */ + return ((char *)NULL); + } + + /* **************************************************************** */ + /* */ + /* FileMan Commands */ + /* */ + /* **************************************************************** */ + + /* String to pass to system (). This is for the LIST, VIEW and RENAME + commands. */ + static char syscom[1024]; + + /* List the file(s) named in arg. */ + com_list (arg) + char *arg; + { + if (!arg) + arg = ""; + + sprintf (syscom, "ls -FClg %s", arg); + return (system (syscom)); + } + + com_view (arg) + char *arg; + { + if (!valid_argument ("view", arg)) + return 1; + + sprintf (syscom, "more %s", arg); + return (system (syscom)); + } + + com_rename (arg) + char *arg; + { + too_dangerous ("rename"); + return (1); + } + + com_stat (arg) + char *arg; + { + struct stat finfo; + + if (!valid_argument ("stat", arg)) + return (1); + + if (stat (arg, &finfo) == -1) + { + perror (arg); + return (1); + } + + printf ("Statistics for `%s':\n", arg); + + printf ("%s has %d link%s, and is %d byte%s in length.\n", arg, + finfo.st_nlink, + (finfo.st_nlink == 1) ? "" : "s", + finfo.st_size, + (finfo.st_size == 1) ? "" : "s"); + printf ("Inode Last Change at: %s", ctime (&finfo.st_ctime)); + printf (" Last access at: %s", ctime (&finfo.st_atime)); + printf (" Last modified at: %s", ctime (&finfo.st_mtime)); + return (0); + } + + com_delete (arg) + char *arg; + { + too_dangerous ("delete"); + return (1); + } + + /* Print out help for ARG, or for all of the commands if ARG is + not present. */ + com_help (arg) + char *arg; + { + register int i; + int printed = 0; + + for (i = 0; commands[i].name; i++) + { + if (!*arg || (strcmp (arg, commands[i].name) == 0)) + { + printf ("%s\t\t%s.\n", commands[i].name, commands[i].doc); + printed++; + } + } + + if (!printed) + { + printf ("No commands match `%s'. Possibilties are:\n", arg); + + for (i = 0; commands[i].name; i++) + { + /* Print in six columns. */ + if (printed == 6) + { + printed = 0; + printf ("\n"); + } + + printf ("%s\t", commands[i].name); + printed++; + } + + if (printed) + printf ("\n"); + } + return (0); + } + + /* Change to the directory ARG. */ + com_cd (arg) + char *arg; + { + if (chdir (arg) == -1) + { + perror (arg); + return 1; + } + + com_pwd (""); + return (0); + } + + /* Print out the current working directory. */ + com_pwd (ignore) + char *ignore; + { + char dir[1024], *s; + + s = getwd (dir); + if (s == 0) + { + printf ("Error getting pwd: %s\n", dir); + return 1; + } + + printf ("Current directory is %s\n", dir); + return 0; + } + + /* The user wishes to quit using this program. Just set DONE non-zero. */ + com_quit (arg) + char *arg; + { + done = 1; + return (0); + } + + /* Function which tells you that you can't do this. */ + too_dangerous (caller) + char *caller; + { + fprintf (stderr, + "%s: Too dangerous for me to distribute. Write it yourself.\n", + caller); + } + + /* Return non-zero if ARG is a valid argument for CALLER, else print + an error message and return zero. */ + int + valid_argument (caller, arg) + char *caller, *arg; + { + if (!arg || !*arg) + { + fprintf (stderr, "%s: Argument required.\n", caller); + return (0); + } + + return (1); + } + + +File: readline.info, Node: Concept Index, Next: Function and Variable Index, Prev: Programming with GNU Readline, Up: Top + +Concept Index +************* + +* Menu: + +* interaction, readline: Readline Interaction. +* Kill ring: Readline Killing Commands. +* Killing text: Readline Killing Commands. +* readline, function: Basic Behavior. +* Yanking text: Readline Killing Commands. + + +File: readline.info, Node: Function and Variable Index, Prev: Concept Index, Up: Top + +Function and Variable Index +*************************** + +* Menu: + +* $else: Conditional Init Constructs. +* $endif: Conditional Init Constructs. +* $if: Conditional Init Constructs. +* abort (C-g): Miscellaneous Commands. +* accept-line (Newline, Return): Commands For History. +* alphabetic: Utility Functions. +* backward-char (C-b): Commands For Moving. +* backward-delete-char (Rubout): Commands For Text. +* backward-kill-line (C-x Rubout): Commands For Killing. +* backward-kill-word (M-DEL): Commands For Killing. +* backward-word (M-b): Commands For Moving. +* beginning-of-history (M-<): Commands For History. +* beginning-of-line (C-a): Commands For Moving. +* bell-style: Readline Init Syntax. +* call-last-kbd-macro (C-x e): Keyboard Macros. +* capitalize-word (M-c): Commands For Text. +* clear-screen (C-l): Commands For Moving. +* comment-begin: Readline Init Syntax. +* complete (TAB): Commands For Completion. +* completion-query-items: Readline Init Syntax. +* completion_matches: Completion Functions. +* convert-meta: Readline Init Syntax. +* delete-char (C-d): Commands For Text. +* delete-horizontal-space (): Commands For Killing. +* digit-argument (M-0, M-1, ... M-): Numeric Arguments. +* digit_p: Utility Functions. +* digit_value: Utility Functions. +* ding: Utility Functions. +* do-uppercase-version (M-a, M-b, ...): Miscellaneous Commands. +* downcase-word (M-l): Commands For Text. +* dump-functions (): Miscellaneous Commands. +* editing-mode: Readline Init Syntax. +* end-kbd-macro (C-x )): Keyboard Macros. +* end-of-history (M->): Commands For History. +* end-of-line (C-e): Commands For Moving. +* expand-tilde: Readline Init Syntax. +* filename_completion_function: Completion Functions. +* forward-char (C-f): Commands For Moving. +* forward-search-history (C-s): Commands For History. +* forward-word (M-f): Commands For Moving. +* free_undo_list: Allowing Undoing. +* history-search-backward (): Commands For History. +* history-search-forward (): Commands For History. +* horizontal-scroll-mode: Readline Init Syntax. +* insert-completions (): Commands For Completion. +* keymap: Readline Init Syntax. +* kill-line (C-k): Commands For Killing. +* kill-whole-line (): Commands For Killing. +* kill-word (M-d): Commands For Killing. +* lowercase_p: Utility Functions. +* mark-modified-lines: Readline Init Syntax. +* meta-flag: Readline Init Syntax. +* next-history (C-n): Commands For History. +* non-incremental-forward-search-history (M-n): Commands For History. +* non-incremental-reverse-search-history (M-p): Commands For History. +* numeric: Utility Functions. +* output-meta: Readline Init Syntax. +* possible-completions (M-?): Commands For Completion. +* prefix-meta (ESC): Miscellaneous Commands. +* previous-history (C-p): Commands For History. +* quoted-insert (C-q, C-v): Commands For Text. +* re-read-init-file (C-x C-r): Miscellaneous Commands. +* readline: Basic Behavior. +* redraw-current-line (): Commands For Moving. +* reverse-search-history (C-r): Commands For History. +* revert-line (M-r): Miscellaneous Commands. +* rl_add_defun: Function Naming. +* rl_add_undo: Allowing Undoing. +* rl_attempted_completion_function: Completion Variables. +* rl_basic_word_break_characters: Completion Variables. +* rl_begin_undo_group: Allowing Undoing. +* rl_bind_key: Binding Keys. +* rl_bind_key_in_map: Binding Keys. +* rl_clear_message: Redisplay. +* rl_complete: How Completing Works. +* rl_complete: Completion Functions. +* rl_completer_quote_characters: Completion Variables. +* rl_completer_word_break_characters: Completion Variables. +* rl_complete_internal: Completion Functions. +* rl_completion_entry_function: Completion Variables. +* rl_completion_entry_function: How Completing Works. +* rl_completion_query_items: Completion Variables. +* rl_copy_keymap: Keymaps. +* rl_copy_text: Modifying Text. +* rl_delete_text: Modifying Text. +* rl_discard_keymap: Keymaps. +* rl_done: Function Writing. +* rl_do_undo: Allowing Undoing. +* rl_end: Function Writing. +* rl_end_undo_group: Allowing Undoing. +* rl_filename_completion_desired: Completion Variables. +* rl_filename_quoting_desired: Completion Variables. +* rl_forced_update_display: Redisplay. +* rl_function_of_keyseq: Associating Function Names and Bindings. +* rl_generic_bind: Binding Keys. +* rl_get_keymap: Keymaps. +* rl_get_keymap_by_name: Keymaps. +* rl_ignore_completion_duplicates: Completion Variables. +* rl_ignore_some_completions_function: Completion Variables. +* rl_insert_completions: Completion Functions. +* rl_insert_text: Modifying Text. +* rl_instream: Function Writing. +* rl_invoking_keyseqs: Associating Function Names and Bindings. +* rl_invoking_keyseqs_in_map: Associating Function Names and Bindings. +* rl_kill_text: Modifying Text. +* rl_line_buffer: Function Writing. +* rl_make_bare_keymap: Keymaps. +* rl_make_keymap: Keymaps. +* rl_mark: Function Writing. +* rl_message: Redisplay. +* rl_modifying: Allowing Undoing. +* rl_named_function: Associating Function Names and Bindings. +* rl_on_new_line: Redisplay. +* rl_outstream: Function Writing. +* rl_parse_and_bind: Binding Keys. +* rl_pending_input: Function Writing. +* rl_point: Function Writing. +* rl_possible_completions: Completion Functions. +* rl_prompt: Function Writing. +* rl_readline_name: Function Writing. +* rl_redisplay: Redisplay. +* rl_reset_line_state: Redisplay. +* rl_reset_terminal: Utility Functions. +* rl_set_keymap: Keymaps. +* rl_special_prefixes: Completion Variables. +* rl_startup_hook: Function Writing. +* rl_terminal_name: Function Writing. +* rl_unbind_key: Binding Keys. +* rl_unbind_key_in_map: Binding Keys. +* self-insert (a, b, A, 1, !, ...): Commands For Text. +* show-all-if-ambiguous: Readline Init Syntax. +* start-kbd-macro (C-x (): Keyboard Macros. +* tab-insert (M-TAB): Commands For Text. +* tilde-expand (M-~): Miscellaneous Commands. +* to_lower: Utility Functions. +* to_upper: Utility Functions. +* transpose-chars (C-t): Commands For Text. +* transpose-words (M-t): Commands For Text. +* undo (C-_, C-x C-u): Miscellaneous Commands. +* universal-argument (): Numeric Arguments. +* unix-line-discard (C-u): Commands For Killing. +* unix-word-rubout (C-w): Commands For Killing. +* upcase-word (M-u): Commands For Text. +* uppercase_p: Utility Functions. +* username_completion_function: Completion Functions. +* yank (C-y): Commands For Killing. +* yank-last-arg (M-., M-_): Commands For History. +* yank-nth-arg (M-C-y): Commands For History. +* yank-pop (M-y): Commands For Killing. + + diff --git a/doc/readline.ps b/doc/readline.ps new file mode 100644 index 0000000..e96ac47 --- /dev/null +++ b/doc/readline.ps @@ -0,0 +1,3766 @@ +%!PS-Adobe-2.0 +%%Creator: dvipsk 5.490s Copyright 1986, 1992 Radical Eye Software +%%Title: readline.dvi +%%Pages: 52 1 +%%BoundingBox: 0 0 612 792 +%%EndComments +%DVIPSCommandLine: dvips -D 300 -o readline.ps readline.dvi +%%BeginProcSet: tex.pro +%! +/TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N} +B /TR{translate}N /isls false N /vsize 11 72 mul N /@rigin{isls{[0 -1 1 0 0 0] +concat}if 72 Resolution div 72 VResolution div neg scale isls{Resolution hsize +-72 div mul 0 TR}if Resolution VResolution vsize -72 div 1 add mul TR matrix +currentmatrix dup dup 4 get round 4 exch put dup dup 5 get round 5 exch put +setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed +true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N +/IE 0 N /ctr 0 N /df-tail{/nn 8 dict N nn begin /FontType 3 N /FontMatrix +fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{ +CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn +put /ctr 0 N[}B /df{/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 +0 sf neg 0 0]N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data +dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{128 +ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 +sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type +/stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N +/cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get +S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height +sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0 +-1 -.1 ch-xoff sub ch-yoff .1 add]{ch-image}imagemask restore}B /D{/cc X dup +type /stringtype ne{]}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 +ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N} +B /I{cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin +0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add +.99 lt{/FV}{/RV}ifelse load def pop}N /eop{SI restore showpage userdict +/eop-hook known{eop-hook}if}N /@start{userdict /start-hook known{start-hook} +if /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE +S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div +/hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley +0 N /v{/ruley X /rulex X V}B /V{}B /RV statusdict begin /product where{pop +product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval +(NeXT)eq or}{pop false}ifelse}{false}ifelse end{{gsave TR -.1 -.1 TR 1 1 scale +rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 -.1 TR rulex +ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /FV{gsave +transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg +rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail{dup +/delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}B /d{-3 M} +B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{4 M}B /w{0 +rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{p 1 w}B /r{p 2 w} +B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B +/eos{SS restore}B end +%%EndProcSet +TeXDict begin 40258431 52099146 1000 300 300 @start /Fa 1 59 +df<70F8F8F87005057C840D>58 D E /Fb 1 59 df<78FCFCFCFC7806067B8510>58 +D E /Fc 49 127 df<60F0F0F0F0F0F0F0F0F0F0F0F0F0600000000060F0F0600417789614>33 +D<00800180018007E01FF039BC619CC18EC18EC18EC18471807F803FE00FF001F8019C018E4186 +E186E186E186718C39B81FF00FC00180018000800F1D7E9914>36 D<00C001C0030006000C001C +0038003000700070006000E000E000E000E000E000E000E000600070007000300038001C000C00 +0600030001C000C00A1D7A9914>40 D<8000C0006000300018001C000E00060007000700030003 +8003800380038003800380038003000700070006000E001C00180030006000C0008000091D7C99 +14>I<70F8FCFC7C0C1830E0C0060A798414>44 DI<70F8F8F87005 +05798414>I<07C00FE01C7038383018701C701CE00EE00EE00EE00EE00EE00EE00EE00EE00E70 +1C701C383838381C700FE007C00F177E9614>48 D<0300030007000F003F00F700470007000700 +0700070007000700070007000700070007000700070007007FF07FF00C177C9614>I<000E003E +007C00F003E007C01F003E00F800F000F8003E001F0007C003E000F0007C003E000E0F137E9414 +>60 D<4000E000F8007C001E000F8007C001F000F8003E001E003E00F801F007C00F801E007C00 +F800E00040000F157E9514>62 D<1FE03FF8701CE00EE00E400E003C007000E001C00380038003 +8003800300000000000000000003000780078003000F177E9614>I<01C00003E00003E0000360 +000360000770000770000770000770000630000E38000E38000E38000E38000E38001FFC001FFC +001C1C001C1C003C1E00380E00FE3F80FE3F8011177F9614>65 DI<03C60FFE1C3E181E381E700E700E600EE000E000E000E000E000E000E000600E700E700E38 +0C181C1C380FF003C00F177E9614>III76 DII82 D<0FCC1FFC307C603CE01CE01CE01CE00070 +007E003FE00FF001F8001C001E000E600EE00EE00EF01CF838FFF0C7E00F177E9614>I<7FFF80 +FFFF80E1C380E1C380E1C380E1C38001C00001C00001C00001C00001C00001C00001C00001C000 +01C00001C00001C00001C00001C00001C00001C0000FF8000FF80011177F9614>I<1FC0007FF0 +00707800201800001C00001C0007FC001FFC003C1C00701C00E01C00E01C00E01C00707C003FFF +800F8F8011107E8F14>97 DI<03F80FFC1C1C380870006000E000E000E000E00060007000380E1C1E0F +FC03F00F107E8F14>I<007E00007E00000E00000E00000E00000E00000E0007CE000FFE001C3E +00301E00700E00E00E00E00E00E00E00E00E00E00E00E00E00700E00301E00383E001FEFC007CF +C012177F9614>I<07E00FF01C38301C700CE00EE00EFFFEFFFEE00060007000380E1C1E0FFC03 +F00F107E8F14>I<007C00FE01CE03840380038003807FFEFFFE03800380038003800380038003 +80038003800380038003807FFC7FFC0F177F9614>I<07CF001FFF80383B80301800701C00701C +00701C003018003838003FF00037C0007000007000003FF8001FFC003FFE00700F00E00380E003 +80E00380E003807007003C1E001FFC0007F00011197F8F14>II<030007800780030000000000000000 +007F807F80038003800380038003800380038003800380038003800380FFFCFFFC0E187D9714> +I107 +DIII<07C01FF03C78701C701CE00EE00EE00EE00EE00EE00E701C783C3C781FF007 +C00F107E8F14>II<03CE000FFE001C3E00301E00700E00E00E00E00E00E00E00E00E00E00E00 +E00E00700E00301E001C3E000FEE0007CE00000E00000E00000E00000E00000E00000E00007FC0 +007FC012187F8F14>II<0FD83FF86038C038C038F0007F +803FF007F8001C6006E006F006F81CFFF8CFE00F107E8F14>I<030007000700070007007FFCFF +FC07000700070007000700070007000700070E070E070E070C03FC00F00F157F9414>IIII<7E3F007E3F001E38000E780007700007E00003E00001C00003C00003E000077000 +0E78000E38001C1C00FE3F80FE3F8011107F8F14>II<3FFF7FFF700E701C7038007000E001C0 +038007000E001C0738077007FFFFFFFF10107F8F14>I<1C103F38E7E041C00D047D9614>126 +D E /Fd 1 59 df<60F0F06004047D830B>58 D E /Fe 41 123 df<00FC000182000703000607 +000E02000E00000E00000E00000E00000E0000FFFF000E07000E07000E07000E07000E07000E07 +000E07000E07000E07000E07000E07000E07000E07000E07007F0FE0131A809915>12 +D<00FF000387000707000607000E07000E07000E07000E07000E07000E0700FFFF000E07000E07 +000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07007F9F +E0131A809915>I<60F0F07010101020204080040B7D830B>44 DI<0780 +18603030303060186018E01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01C6018601870 +383030186007800E187E9713>48 D<03000700FF00070007000700070007000700070007000700 +07000700070007000700070007000700070007000700FFF00C187D9713>I<0F80106020304038 +803CC01CE01C401C003C003800380070006000C001800100020004040804100430083FF87FF8FF +F80E187E9713>I<0F8010E02070607870382038007800700070006000C00F8000E00070003800 +3C003CE03CE03CC03C4038407030E00F800E187E9713>I<00300030007000F000F00170037002 +7004700C7008701070307020704070C070FFFF00700070007000700070007007FF10187F9713> +I<30183FF03FE03FC02000200020002000200027C03860203000380018001C001C401CE01CE01C +80184038403030E00F800E187E9713>I<01E006100C1818383038300070006000E000E7C0E860 +F030F018E018E01CE01CE01C601C601C701830183030186007C00E187E9713>I<40007FFE7FFC +7FFC40088010801080200040004000800180018001000300030003000300070007000700070007 +00070002000F197E9813>I<078018603030201860186018601870103C303E600F8007C019F030 +F86038401CC00CC00CC00CC00C6008201018600FC00E187E9713>I<07801860303070306018E0 +18E018E01CE01CE01C601C603C303C185C0F9C001C00180018003870307060604021801F000E18 +7E9713>I75 +D89 +D<3F8070C070E020700070007007F01C7030707070E070E071E071E0F171FB1E3C10107E8F13> +97 DI<07F80C1C381C30087000E000E000E000E000E000E0007000300438080C +1807E00E107F8F11>I<007E00000E00000E00000E00000E00000E00000E00000E00000E00000E +0003CE000C3E00380E00300E00700E00E00E00E00E00E00E00E00E00E00E00E00E00600E00700E +00381E001C2E0007CFC0121A7F9915>I<07C01C3030187018600CE00CFFFCE000E000E000E000 +6000300438080C1807E00E107F8F11>I<01F0031807380E100E000E000E000E000E000E00FFC0 +0E000E000E000E000E000E000E000E000E000E000E000E000E000E007FE00D1A80990C>I<0FCE +187330307038703870387038303018602FC02000600070003FF03FFC1FFE600FC003C003C003C0 +036006381C07E010187F8F13>II<18003C003C00180000000000000000000000 +0000FC001C001C001C001C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A +>I107 DII +I<07E01C38300C700E6006E007E007E007E007E007E0076006700E381C1C3807E010107F8F13> +II<03 +C2000C2600381E00300E00700E00E00E00E00E00E00E00E00E00E00E00E00E00700E00700E0038 +1E001C2E0007CE00000E00000E00000E00000E00000E00000E00007FC012177F8F14>II<1F2060 +E04020C020C020F0007F003FC01FE000F080708030C030C020F0408F800C107F8F0F>I<040004 +0004000C000C001C003C00FFC01C001C001C001C001C001C001C001C001C201C201C201C201C20 +0E4003800B177F960F>IIIIII<7FF86070407040E041C041C00380070007000E081C081C0838107010 +7030FFF00D107F8F11>I E /Ff 2 42 df<007000E001C00380078007000E001E001E003C003C +003C0078007800780078007000F000F000F000F000F000F000F000F000F000F000F000F0007000 +78007800780078003C003C003C001E001E000E0007000780038001C000E000700C2E7EA112>40 +DI E /Fg 26 122 df<000FF07F00007FFBFF +C001F83FE3C003F07F87E007E07F87E00FC07F07E00FC07F03C00FC03F00000FC03F00000FC03F +00000FC03F00000FC03F00000FC03F0000FFFFFFFC00FFFFFFFC000FC03F00000FC03F00000FC0 +3F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000F +C03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F0000 +7FF9FFF0007FF9FFF00023237FA221>11 D<0007F800007FFC0001FC0E0003F01F0007E03F000F +C03F000FC03F000FC03F000FC01E000FC00C000FC000000FC000000FC0FF80FFFFFF80FFFFFF80 +0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F +800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F807FF8FFF07FF8 +FFF01C237FA220>I<07FE00001FFF80003F07E0003F03F0003F01F0003F01F8001E01F8000001 +F8000001F800003FF80003FDF8001F81F8003E01F8007C01F800F801F800F801F800F801F800F8 +01F8007C02F8007E0CF8001FF87F8007E03F8019167E951C>97 DI<00FF8007FFE00F83F01F03F03E03F07E03F07C01E0 +7C0000FC0000FC0000FC0000FC0000FC0000FC00007C00007E00007E00003F00301F00600FC0E0 +07FF8000FE0014167E9519>I<0001FF000001FF0000003F0000003F0000003F0000003F000000 +3F0000003F0000003F0000003F0000003F0000003F0000003F0000FE3F0007FFBF000FC1FF001F +007F003E003F007E003F007C003F007C003F00FC003F00FC003F00FC003F00FC003F00FC003F00 +FC003F00FC003F007C003F007E003F003E003F001F007F000F81FF0007FF3FE001FC3FE01B237E +A220>I<00FE0007FF800F83C01F01E03E00F07E00F07C00F87C0078FC0078FFFFF8FFFFF8FC00 +00FC0000FC00007C00007C00003E00183E00181F00300F80E003FFC000FF0015167E951A>I<00 +1F8000FFE001F1F003E3F007E3F00FC3F00FC1E00FC0000FC0000FC0000FC0000FC0000FC000FF +FE00FFFE000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000F +C0000FC0000FC0000FC0000FC0000FC0000FC0007FFC007FFC0014237EA212>I<00FE0F8003FF +9FC00F83E3C01F01F3C01E00F0003E00F8003E00F8003E00F8003E00F8003E00F8001E00F0001F +01F0000F83E0000BFF800008FE000018000000180000001C0000001FFFE0001FFFFC000FFFFF00 +07FFFF001FFFFF807C001FC078000FC0F80007C0F80007C0F80007C07C000F803E001F001F807E +000FFFFC0001FFE0001A217F951D>II<1E003F007F807F807F807F803F001E00000000000000000000000000FF80FF80 +1F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80FFF0FF +F00C247EA30F>I107 +DI< +FF03F803F800FF0FFE0FFE001F183F183F001F201F201F001F401FC01F801F401FC01F801F801F +801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80 +1F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F +801F80FFF0FFF0FFF0FFF0FFF0FFF02C167D9531>II< +00FF0007FFE00F81F01F00F83E007C7C003E7C003E7C003EFC003FFC003FFC003FFC003FFC003F +FC003FFC003F7C003E7E007E3E007C1F00F80F81F007FFE000FF0018167E951D>II<00FE030007FF07000FC1CF001F00DF003F007F007E003F007E00 +3F007C003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F007E003F007E +003F003E007F001F00FF000FC1FF0007FF3F0001FC3F0000003F0000003F0000003F0000003F00 +00003F0000003F0000003F0000003F000001FFE00001FFE01B207E951E>II<07F9801FFF80380780700380F0 +0180F00180F80000FF0000FFF8007FFE003FFF001FFF8007FF80003FC0C007C0C003C0E003C0E0 +03C0F00380FC0F00EFFE00C3F80012167E9517>I<00C00000C00000C00000C00001C00001C000 +03C00007C0000FC0001FC000FFFF00FFFF000FC0000FC0000FC0000FC0000FC0000FC0000FC000 +0FC0000FC0000FC0000FC0000FC1800FC1800FC1800FC1800FC18007C18007E30003FE0000FC00 +11207F9F16>IIIIII +E /Fh 23 122 df<00E00000E00000E00000E00040E040F0E1E0F8E3E07EEFC01FFF0007FC0003 +F80007FC001FFF007EEFC0F8E3E0F0E1E040E04000E00000E00000E00000E00013157D991A>42 +D<007C3801FF3807FFF80F83F81E00F81C0078380078380038700038700038700000E00000E000 +00E00000E00000E00000E00000E00000E000007000007000387000383800383800381C00701E00 +F00F83E007FFC001FF80007C00151E7E9D1A>67 D<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C +0E001C0E001C0E00000E00000E07000E07000E07000FFF000FFF000FFF000E07000E07000E0700 +0E00000E00000E00000E000E0E000E0E000E0E000E0E000E7FFFFEFFFFFE7FFFFE171E7F9D1A> +69 D<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C0E001C0E001C0E00000E00000E07000E0700 +0E07000FFF000FFF000FFF000E07000E07000E07000E00000E00000E00000E00000E00000E0000 +0E00000E00007FE000FFF0007FE000161E7F9D1A>I73 D75 D<7FE000FFF0007FE0000E00000E00000E +00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E +00000E00000E00000E00000E00380E00380E00380E00380E00387FFFF8FFFFF87FFFF8151E7E9D +1A>I<7FFF00FFFFC07FFFE00E01F00E00780E00380E003C0E001C0E001C0E001C0E001C0E003C +0E00380E00780E01F00FFFE00FFFC00FFF000E00000E00000E00000E00000E00000E00000E0000 +0E00000E00007FC000FFE0007FC000161E7F9D1A>80 D<1FF0003FFC007FFE00780F0030070000 +0380000380007F8007FF801FFF803F8380780380700380E00380E00380E00380700780780F803F +FFFC1FFDFC07F0FC16157D941A>97 D<00FF8003FFC00FFFE01F01E03C00C07800007000007000 +00E00000E00000E00000E00000E000007000007000007800703C00701F01F00FFFE003FFC000FE +0014157D941A>99 D<001FC0001FC0001FC00001C00001C00001C00001C00001C00001C001F1C0 +07FDC00FFFC01E0FC03C07C07803C07001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0 +7003C07003C03807C03E0FC01FFFFC07FDFC01F1FC161E7E9D1A>I<01F80007FF000FFF801E07 +C03C01C07800E07000E0E00070E00070FFFFF0FFFFF0FFFFF0E000007000007000007800703C00 +701F01F00FFFE003FFC000FE0014157D941A>I +104 D<01C00003E00003E00003E00001C0000000000000000000000000000000007FE000FFE000 +7FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000 +00E00000E00000E000FFFFC0FFFFC0FFFFC0121F7C9E1A>I<7CE0E000FFFBF8007FFFF8001F1F +1C001E1E1C001E1E1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C +1C1C001C1C1C001C1C1C001C1C1C001C1C1C007F1F1F00FF9F9F807F1F1F00191580941A>109 +DI<01F00007FC001F +FF003E0F803C07807803C07001C0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C078 +03C03C07803E0F801FFF0007FC0001F00013157D941A>II114 D<00C00001C00001C00001C00001C00001C00001C0007FFFE0FFFFE0FFFFE001C00001C0 +0001C00001C00001C00001C00001C00001C00001C00001C00001C07001C07001C07001C07000E0 +E000FFE0007FC0001F00141C7F9B1A>116 DI<7FC7FCFFC7FE7FC7FC0E00E00E00E00F01E00701C00701C00783C003 +838003838003838001C70001C70001C70000EE0000EE0000EE00007C00007C0000380017157F94 +1A>I<7FC7FCFFC7FE7FC7FC0E00E00F00E00701E00701C00781C00381C003838001C38001C380 +01C70000E70000E70000E600006600006E00003C00003C00003C00003C00003800003800007800 +00700030700078E00079E0007FC0003F80001E000017207F941A>121 D +E /Fi 51 122 df<3C7EFFFFFFFF7E3C08087C8711>46 D<001C00003C0000FC00FFFC00FFFC00 +00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00 +00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00 +00FC0000FC007FFFFC7FFFFC16237CA21F>49 D<01FF0007FFC01E07F03803F86001FC7C00FEFE +00FEFE00FFFE007FFE007F7C007F3800FF0000FF0000FE0000FE0001FC0001F80003F00007E000 +0780000F00001E00003C0000700000E00301C0030380070700060600060FFFFE1FFFFE3FFFFE7F +FFFCFFFFFCFFFFFC18237DA21F>I<01FF0007FFE01E03F03801F83C01FC7E00FE7E00FE7E00FE +3E00FE1C01FE0001FC0001FC0003F80007F0000FC001FF0001FF000007E00001F00001F80000FC +0000FE0000FF0000FF1000FF7C00FFFE00FFFE00FFFE00FEFE00FE7C01FC7001F83E07F00FFFC0 +01FF0018237DA21F>I<0000380000007800000078000000F8000001F8000003F8000007F80000 +06F800000CF800001CF8000038F8000030F8000060F80000E0F80001C0F8000180F8000300F800 +0700F8000E00F8001C00F8001800F8003000F8007000F800E000F800FFFFFFC0FFFFFFC00001F8 +000001F8000001F8000001F8000001F8000001F8000001F800007FFFC0007FFFC01A237EA21F> +I<18000C1F007C1FFFF81FFFF01FFFE01FFFC01FFF801FFE001800001800001800001800001800 +0018FF001BFFE01F01F01C00F80800FC00007E00007E00007E00007F00007F78007FFC007FFC00 +7FFC007FFC007EF8007E6000FC7000FC3801F81E07E007FFC001FE0018237DA21F>I<001FC000 +7FF001F83803E00C07803E0F807E1F007E3F007E3F007E7E003C7E00007E00007E0000FE3FC0FE +7FF0FE80F8FF80FCFF007CFF007EFE007EFE007FFE007FFE007FFE007F7E007F7E007F7E007F7E +007F3E007E3F007E1F007C0F80F807C1F003FFC0007F0018237DA21F>I<300000003C0000003F +FFFFC03FFFFFC03FFFFF807FFFFF007FFFFE007FFFFC006000180060001800E0003000C0006000 +C000C0000001800000018000000300000007000000060000000E0000001E0000001E0000001E00 +00003C0000003C0000007C0000007C0000007C0000007C000000FC000000FC000000FC000000FC +000000FC000000FC000000FC000000780000003000001A257DA41F>I<00FF8003FFE00F01F81C +007C38003C38001E78001E78001E7C001E7E001E7F803C7FE03C3FF8781FFCF01FFFC00FFFC003 +FFE003FFF80FFFFC1E1FFC3C07FE7801FE7800FFF0003FF0001FF0000FF0000FF0000FF0000E78 +000E78001C3E00381F80F007FFE000FF0018237DA21F>I<00FF0003FFC00F83E01F00F03F00F8 +7E007C7E007C7E007EFE007EFE007EFE007EFE007FFE007FFE007FFE007F7E007F7E00FF3E00FF +3F01FF1F017F0FFE7F03FC7F00007F00007E00007E3C007E7E00FC7E00FC7E00F87E00F07C01F0 +3003E01C0F800FFF0003F80018237DA21F>I<00001C00000000001C00000000003E0000000000 +3E00000000003E00000000007F00000000007F0000000000FF8000000000FF8000000000FF8000 +0000019FC0000000019FC0000000031FE0000000030FE0000000030FE00000000607F000000006 +07F00000000C07F80000000C03F80000001C03FC0000001801FC0000001801FC0000003001FE00 +00003000FE0000007FFFFF0000007FFFFF00000060007F000000C0007F800000C0003F800001C0 +003FC0000180001FC0000180001FC0000300000FE0000300000FE0000780000FF000FFF801FFFF +80FFF801FFFF8029257EA42E>65 DI<0000FF8008000FFFF018003FC03C7800FE0006F801F80003F803F0 +0001F807E00000F80FC00000781FC00000783F800000383F800000387F800000187F000000187F +00000018FF00000000FF00000000FF00000000FF00000000FF00000000FF00000000FF00000000 +FF00000000FF000000007F000000007F000000187F800000183F800000183F800000181FC00000 +300FC000003007E000006003F00000C001F800018000FE000700003FC01E00000FFFF8000000FF +C00025257DA42C>I69 DI72 +DI75 +DI< +FFF8000000FFF8FFFC000001FFF803FC000001FE00037E0000037E00037E0000037E00037E0000 +037E00033F0000067E00033F0000067E00031F80000C7E00031F80000C7E00030FC000187E0003 +0FC000187E000307E000307E000307E000307E000307E000307E000303F000607E000303F00060 +7E000301F800C07E000301F800C07E000300FC01807E000300FC01807E0003007E03007E000300 +7E03007E0003007E03007E0003003F06007E0003003F06007E0003001F8C007E0003001F8C007E +0003000FD8007E0003000FD8007E00030007F0007E00030007F0007E00030007F0007E00030003 +E0007E00078003E0007E00FFFC01C01FFFF8FFFC01C01FFFF835257EA43A>II82 D<00FF008007FFE3800F80F7801E001F80 +3C000F807800078078000380F8000380F8000180F8000180FC000180FC000000FF0000007FE000 +007FFF00003FFFE0003FFFF8001FFFFE0007FFFF0003FFFF80007FFF800003FFC000003FC00000 +0FE0000007E0000007E0C00003E0C00003E0C00003E0C00003C0E00003C0F00007C0F8000780FC +000F00FFC03E00E3FFF800803FE0001B257DA422>I<7FFFFFFFF87FFFFFFFF87E00FE01F87800 +FE00787000FE00386000FE00186000FE0018E000FE001CE000FE000CC000FE000CC000FE000CC0 +00FE000CC000FE000C0000FE00000000FE00000000FE00000000FE00000000FE00000000FE0000 +0000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00 +000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE000000FFFF +FE0000FFFFFE0026247EA32B>IIII89 D<07FF00001FFFC0003E +03E0003F01F0003F01F8003F00FC001E00FC000000FC000000FC000000FC00003FFC0003FCFC00 +0FC0FC003F00FC007E00FC007E00FC00FC00FC00FC00FC00FC00FC00FC017C007E017C003F067C +001FFC3FE007F01FE01B187E971E>97 DI<007FE003FFF807C07C1F80FC1F00FC3F00FC7E +00787E0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00007E00007F00003F000C1F +800C1FC01807E07003FFE0007F0016187E971B>I<0001FF800001FF8000001F8000001F800000 +1F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000 +7F1F8003FFDF8007E0FF801F803F803F001F803F001F807E001F807E001F80FE001F80FE001F80 +FE001F80FE001F80FE001F80FE001F80FE001F80FE001F807E001F807E001F803F001F803F003F +801F807F800FC0FF8003FF9FF800FE1FF81D267EA522>I<007F0003FFC007C1F00F80F81F00F8 +3F007C7E007C7E007EFE007EFE007EFFFFFEFFFFFEFE0000FE0000FE00007E00007E00007E0006 +3F00061F000C0F801807E07003FFE0007F8017187E971C>I<000FC0007FF000F8F001F1F803F1 +F803E1F807E0F007E00007E00007E00007E00007E00007E00007E000FFFF00FFFF0007E00007E0 +0007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E0 +0007E00007E00007E00007E00007E0007FFF007FFF0015267EA513>I<01FF07C007FFDFE00F83 +F1E01F01F1E03E00F8007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC003E00F8001F +01F0000F83E0000FFFC00011FF00003000000030000000380000003C0000003FFFE0001FFFFC00 +1FFFFE000FFFFF001FFFFF803C003F8078000FC0F80007C0F80007C0F80007C0F80007C07C000F +803E001F001F807E0007FFF80000FFC0001B247E971F>II<0F001F803FC03FC03FC03FC0 +1F800F000000000000000000000000000000FFC0FFC00FC00FC00FC00FC00FC00FC00FC00FC00F +C00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFF8FFF80D277EA611>I107 +DI +II<007F800003FFF00007C0F8001F +807E003F003F003F003F007E001F807E001F80FE001FC0FE001FC0FE001FC0FE001FC0FE001FC0 +FE001FC0FE001FC0FE001FC07E001F807E001F803F003F003F003F001F807E000FC0FC0003FFF0 +00007F80001A187E971F>II114 D<07F9801FFF803C0F80700380F00180F00180F00180FC0000FF80007FFC007FFE00 +3FFF800FFFC003FFC0001FE00003E0C001E0C001E0E001E0E001C0F003C0FC0780EFFF00C3FC00 +13187E9718>I<00600000600000600000600000E00000E00001E00001E00003E00007E0001FE0 +00FFFFC0FFFFC007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E0 +0007E00007E06007E06007E06007E06007E06007E06003E0C003F0C001FF80007E0013237FA218 +>IIIIII E /Fj 27 122 +df<0003E0001C1800381800703C00E03C00E03801C00001C00001C00001C00001C0000380007F +FFF00380700380700380700380700700E00700E00700E00700E00700E00700E00E01C00E01C00E +01C00E01C00E01C00E01C01C03801E03C0FF0FF816207E9F19>12 D45 +D<07FFFFF8007C0078003C0038003C001800780018007800080078000800780008007800080078 +000800F0100000F0100000F0100000F0300000F0700000FFF00001E0600001E0200001E0200001 +E0200001E0200001E0000003C0000003C0000003C0000003C0000003C0000003C0000007800000 +07C00000FFFE00001D1F7E9E1E>70 D<07FFE07FE0007C001F00003C000C00003C001800007800 +10000078004000007800800000780100000078020000007804000000F008000000F010000000F0 +60000000F0F0000000F1F0000000F278000001E478000001E878000001F03C000001E03C000001 +E01E000001E01E000003C00F000003C00F000003C00F000003C007800003C007800003C003C000 +078003C00007C007E000FFFC3FFC00231F7E9E23>75 D<07F8000C0C001E06001E07001C070000 +070000070000070000FF0007C7001E07003C0E00780E00F00E10F00E10F00E10F01E10F02E2078 +4F401F878014147D9317>97 D<01FC07060E0F1C0F380E78007000F000F000F000F000E000E000 +E000E000F0027004300818300FC010147C9314>99 D<0000700003F00000F00000700000700000 +E00000E00000E00000E00000E00000E00001C000F9C00305C00E03C01C03C03801C07803807003 +80F00380F00380F00380F00380E00700E00700E00700E00700E00700700F00301E00186F000F8F +E014207C9F19>I<00F800070E000E07001C0700380380780380700380F00380F00380FFFF80F0 +0000E00000E00000E00000E00000F001007002003004001C180007E00011147D9314>I<000780 +0018C00031E00061E000E1C000C00001C00001C00001C00001C00001C0000380007FF800038000 +0380000380000380000700000700000700000700000700000700000E00000E00000E00000E0000 +0E00000E00001C00001E0000FFE00013207E9F0E>I<00000E003E1100E1A301C1C20381E00780 +E00701E00F01E00F01E00F01E00703C007038007870004FC000800000800001800001C00000FFF +000FFFC007FFE01800F0300030600030C00030C00030C000306000603000C01C070007FC00181F +809417>I<00E00007E00001E00000E00000E00001C00001C00001C00001C00001C00001C00003 +8000038F800390E003A0E003C0600380600780E00700E00700E00700E00700E00700E00E01C00E +01C00E01C00E01C00E01C00E01C01C03801E03C0FFCFF815207E9F19>I<01C003E003E003C001 +8000000000000000000000000003801F800780038003800700070007000700070007000E000E00 +0E000E000E000E001C001E00FF800B1F7F9E0C>I<00E00007E00001E00000E00000E00001C000 +01C00001C00001C00001C00001C0000380000383FC0380F00380C0038180038100070400070800 +071800073800077C00071C000E1C000E0E000E0E000E0F000E07000E07801C03801E07C0FF8FF0 +16207E9F18>107 D<00E007E001E000E000E001C001C001C001C001C001C00380038003800380 +038003800700070007000700070007000E000E000E000E000E000E001C001E00FFC00B207F9F0C +>I<0387C07C001F9861860007A072070003C03403000380380300078078070007007007000700 +7007000700700700070070070007007007000E00E00E000E00E00E000E00E00E000E00E00E000E +00E00E000E00E00E001C01C01C001E01E01E00FFCFFCFFC022147E9326>I<038F801F90E007A0 +E003C0600380600780E00700E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01 +C00E01C01C03801E03C0FFCFF815147E9319>I<00FC000387000E01801C00C03800E03800E070 +00F0F000F0F000F0F000F0F000F0E001E0E001E0E001C0E003C0F00380700700380E001C1C0007 +E00014147D9317>I<00E3E007EC3800F01C00E01E00E00E01C00E01C00F01C00F01C00F01C00F +01C00F03801E03801E03801C03803C0380380380700740E00721C0071F00070000070000070000 +0E00000E00000E00000E00001E0000FFC000181D809319>I<00F040038CC00E04C01C03C03C03 +C0780380780380F00380F00380F00380F00380E00700E00700E00700F00700F00F00700F00301E +00186E000F8E00000E00000E00000E00001C00001C00001C00001C00003C0001FF80121D7C9318 +>I<038E001FB38007C78003C7800383000780000700000700000700000700000700000E00000E +00000E00000E00000E00000E00001C00001E0000FFE00011147E9312>I<01F2060E0806180618 +02380438001E001FE00FF003F8003C401C400C400C600C6018E010D0608FC00F147E9312>I<00 +80010001000100030007000F001E00FFF80E000E000E000E001C001C001C001C001C001C003800 +38203820382038203840384018800F000D1C7C9B12>I<1C0380FC1F803C07801C03801C038038 +0700380700380700380700380700380700700E00700E00700E00700E00701E00701E00703C0030 +5E001F9FC012147B9319>I +II<1FF0FF03C07801C06001C04000E08000E180007300007600003C00003C +00001C00002E00004E000087000107000203800603800C01C03E03E0FF07FC18147F9318>I<0F +F83F8001E00E0001C00C0001C0080000E0180000E0100000E0200000E0200000F0400000704000 +00708000007080000071000000390000003A0000003E0000003C00000038000000180000001000 +000010000000200000002000000040000070C00000F0800000F1000000E20000007C000000191D +809318>I E /Fk 34 121 df<0001C0000003C000000FC000007FC0001FFFC000FFFFC000FFBF +C000E03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00000 +3FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000 +003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC0 +00003FC000003FC000003FC000003FC000003FC000003FC000003FC0007FFFFFE07FFFFFE07FFF +FFE01B2E7AAD28>49 D<003FE00001FFFE0007FFFF800F80FFC01E003FE038001FF07C000FF87E +0007FCFF0007FCFF8007FEFF8007FEFF8003FEFF8003FE7F0003FE3E0007FE000007FE000007FC +000007FC00000FF800000FF800000FF000001FE000001FC000003F8000007F0000007E000000F8 +000001F0000003E0000007C000000F0000001E000E003C000E0038000E0070001E00E0001C01C0 +001C0300003C07FFFFFC0FFFFFFC1FFFFFFC3FFFFFFC7FFFFFF8FFFFFFF8FFFFFFF8FFFFFFF81F +2E7CAD28>I<000003FF80018000003FFFF003800001FFFFFC07800007FF003F0F80001FF80007 +9F80003FC00001FF8000FF800000FF8001FE0000007F8003FC0000003F8007FC0000001F8007F8 +0000000F800FF00000000F801FF000000007801FF000000007803FE000000007803FE000000003 +807FE000000003807FE000000003807FC000000000007FC00000000000FFC00000000000FFC000 +00000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000 +FFC00000000000FFC000000000007FC000000000007FC000000000007FE000000000007FE00000 +0003803FE000000003803FE000000003801FF000000003801FF000000007800FF0000000070007 +F8000000070007FC0000000E0003FC0000001E0001FE0000001C0000FF8000007800003FC00000 +F000001FF80003E0000007FF003F80000001FFFFFE000000003FFFF80000000003FF8000003131 +7CB03A>67 D69 +DI<000003FF00030000007F +FFF007000001FFFFFC0F000007FF007E1F00001FF0000FBF00007FC00003FF0000FF800001FF00 +01FE0000007F0003FC0000007F0007FC0000003F000FF80000001F000FF00000001F001FF00000 +000F001FF00000000F003FE000000007003FE000000007007FE000000007007FE000000007007F +C00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0000000 +0000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0 +0007FFFFFC7FC00007FFFFFC7FE00007FFFFFC7FE0000001FF003FE0000001FF003FE0000001FF +001FF0000001FF001FF0000001FF000FF0000001FF000FF8000001FF0007FC000001FF0003FC00 +0001FF0001FE000001FF0000FF800001FF00007FC00003FF00001FF800077F000007FF003E3F00 +0001FFFFFC1F0000007FFFF00F00000003FF80030036317CB03F>I73 +D76 D78 +D80 D82 +D<7FFFFFFFFFFF007FFFFFFFFFFF007FFFFFFFFFFF007FC00FF801FF007E000FF8003F007C000F +F8001F0078000FF8000F0078000FF8000F0070000FF8000700F0000FF8000780F0000FF8000780 +F0000FF8000780E0000FF8000380E0000FF8000380E0000FF8000380E0000FF8000380E0000FF8 +00038000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000 +000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF800 +000000000FF800000000000FF800000000000FF800000000000FF800000000000FF80000000000 +0FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF80000 +0000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000F +F8000000007FFFFFFF0000007FFFFFFF0000007FFFFFFF000031307DAF38>84 +DII<00FFF0000003FFFE00000F803F80000FC00FE0001FE007F0001FE007F000 +1FE003F8000FC003FC00078003FC00000003FC00000003FC00000003FC00000003FC000000FFFC +00001FFFFC0000FFE3FC0003FC03FC000FF003FC001FC003FC003FC003FC007F8003FC007F8003 +FC00FF0003FC00FF0003FC00FF0003FC00FF0007FC00FF0007FC007F800DFC003FC019FE001FE0 +70FFF007FFE07FF000FF803FF024207E9F27>97 D<01F8000000FFF8000000FFF8000000FFF800 +00000FF800000007F800000007F800000007F800000007F800000007F800000007F800000007F8 +00000007F800000007F800000007F800000007F800000007F800000007F800000007F83FE00007 +F8FFFC0007FBE07F0007FF001F8007FE000FC007FC000FE007F80007F007F80007F807F80007F8 +07F80003FC07F80003FC07F80003FC07F80003FE07F80003FE07F80003FE07F80003FE07F80003 +FE07F80003FE07F80003FE07F80003FE07F80003FC07F80003FC07F80003FC07F80007F807F800 +07F807F80007F007FC000FE007FE000FC007E7003F8007C3C0FE000780FFF80007003FC0002732 +7EB12D>I<000FFF00007FFFC001FC01F003F003F007E007F80FE007F81FC007F83FC003F03FC0 +01E07F8000007F8000007F800000FF800000FF800000FF800000FF800000FF800000FF800000FF +800000FF8000007F8000007F8000007F8000003FC0001C3FC0001C1FC000380FE0003807E00070 +03F001E001FC07C0007FFF00000FF8001E207D9F24>I<0000000FC0000007FFC0000007FFC000 +0007FFC00000007FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC0 +0000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00007F83F +C0003FFF3FC000FE07BFC003F801FFC007E0007FC00FE0007FC01FC0003FC03FC0003FC03FC000 +3FC07F80003FC07F80003FC07F80003FC0FF80003FC0FF80003FC0FF80003FC0FF80003FC0FF80 +003FC0FF80003FC0FF80003FC0FF80003FC07F80003FC07F80003FC07F80003FC03FC0003FC03F +C0003FC01FC0003FC00FE0007FC007E000FFC003F003FFE001FC0F3FFE007FFE3FFE000FF03FFE +27327DB12D>I<000FFC00007FFF8001FC0FC003F003E007E001F00FE001F81FC000FC3FC000FE +3FC000FE7F80007E7F80007F7F80007FFF80007FFF80007FFFFFFFFFFFFFFFFFFF800000FF8000 +00FF800000FF8000007F8000007F8000007F8000003FC000071FC000071FC0000E0FE0000E07F0 +001C03F8007800FE03E0003FFFC00007FE0020207E9F25>I<0001FE00000FFF80001FC3C0007F +07E000FE0FF001FE0FF001FC0FF003FC0FF003FC07E003FC018003FC000003FC000003FC000003 +FC000003FC000003FC000003FC000003FC0000FFFFFC00FFFFFC00FFFFFC0003FC000003FC0000 +03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00 +0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC +000003FC000003FC000003FC000003FC00007FFFF0007FFFF0007FFFF0001C327EB119>I<001F +F007C000FFFE3FE001F83F79F007E00FC3F00FE00FE1F00FC007E0E01FC007F0001FC007F0003F +C007F8003FC007F8003FC007F8003FC007F8003FC007F8001FC007F0001FC007F0000FC007E000 +0FE00FE00007E00FC00003F83F000006FFFE00000E1FF000000E000000001E000000001E000000 +001F000000001F800000001FFFFF80000FFFFFF0000FFFFFFC0007FFFFFE0003FFFFFF0003FFFF +FF800FFFFFFFC01F00007FC07E00001FE07C00000FE0FC000007E0FC000007E0FC000007E0FC00 +0007E07E00000FC03E00000F803F00001F800FC0007E0007F803FC0001FFFFF000001FFF000024 +2F7E9F28>I<01F8000000FFF8000000FFF8000000FFF80000000FF800000007F800000007F800 +000007F800000007F800000007F800000007F800000007F800000007F800000007F800000007F8 +00000007F800000007F800000007F800000007F807F80007F83FFE0007F8783F0007F8C03F8007 +F9801FC007FB001FC007FE001FE007FC001FE007FC001FE007FC001FE007F8001FE007F8001FE0 +07F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001F +E007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F800 +1FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF28327DB12D>I<03C00007E0000FF0001F +F8001FF8001FF8001FF8000FF00007E00003C00000000000000000000000000000000000000000 +000000000000000001F800FFF800FFF800FFF8000FF80007F80007F80007F80007F80007F80007 +F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007 +F80007F80007F80007F80007F80007F800FFFF80FFFF80FFFF8011337DB217>I<01F800FFF800 +FFF800FFF8000FF80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 +07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 +07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800 +07F80007F80007F80007F80007F80007F800FFFFC0FFFFC0FFFFC012327DB117>108 +D<03F007F8001FE000FFF03FFE00FFF800FFF0783F01E0FC00FFF0C03F8300FE000FF1801FC600 +7F0007F3001FCC007F0007F6001FF8007F8007FC001FF0007F8007FC001FF0007F8007FC001FF0 +007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001F +E0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F800 +1FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8 +001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F80FF +FFC3FFFF0FFFFCFFFFC3FFFF0FFFFCFFFFC3FFFF0FFFFC3E207D9F43>I<03F007F800FFF03FFE +00FFF0783F00FFF0C03F800FF1801FC007F3001FC007F6001FE007FC001FE007FC001FE007FC00 +1FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8 +001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007 +F8001FE007F8001FE007F8001FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF28207D9F2D +>I<0007FC0000007FFFC00001FC07F00003F001F80007E000FC000FC0007E001FC0007F003FC0 +007F803F80003F807F80003FC07F80003FC07F80003FC0FF80003FE0FF80003FE0FF80003FE0FF +80003FE0FF80003FE0FF80003FE0FF80003FE0FF80003FE07F80003FC07F80003FC07F80003FC0 +3FC0007F803FC0007F801FC0007F000FE000FE0007E000FC0003F803F80001FE0FF000007FFFC0 +000007FC000023207E9F28>I<01F83FE000FFF8FFFC00FFFBE07F00FFFF003F8007FE001FC007 +FC000FE007F8000FF007F80007F807F80007F807F80007FC07F80003FC07F80003FC07F80003FE +07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003 +FC07F80007FC07F80007FC07F80007F807F80007F807F8000FF007FC000FE007FE001FC007FF00 +3F8007FBC0FE0007F8FFF80007F83FC00007F800000007F800000007F800000007F800000007F8 +00000007F800000007F800000007F800000007F800000007F800000007F8000000FFFFC00000FF +FFC00000FFFFC00000272E7E9F2D>I<03F03F00FFF07FC0FFF1C3E0FFF187E00FF30FF007F60F +F007F60FF007FC07E007FC03C007FC000007FC000007F8000007F8000007F8000007F8000007F8 +000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007 +F8000007F8000007F8000007F80000FFFFE000FFFFE000FFFFE0001C207E9F21>114 +D<01FF860007FFFE001F00FE003C003E0078001E0078000E00F8000E00F8000E00F8000E00FC00 +0000FF800000FFFC00007FFFC0007FFFF0003FFFF8001FFFFC0007FFFE0001FFFF00003FFF0000 +00FF8000003F8060001F80E0000F80E0000F80F0000F80F0000F00F8000F00FC001E00FE001C00 +FF807800F3FFF000C07F800019207D9F20>I<001C0000001C0000001C0000001C0000001C0000 +003C0000003C0000003C0000007C0000007C000000FC000001FC000003FC000007FC00001FFFFE +00FFFFFE00FFFFFE0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC +000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC038003 +FC038003FC038003FC038003FC038003FC038003FC038001FC038001FC070000FE0700007F0E00 +003FFC000007F000192E7FAD1F>I<01F80007E0FFF803FFE0FFF803FFE0FFF803FFE00FF8003F +E007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F800 +1FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8 +001FE007F8001FE007F8001FE007F8001FE007F8003FE007F8003FE003F8007FE003F8007FE001 +FC00DFF000FE039FFF007FFF1FFF000FFC1FFF28207D9F2D>I119 D<7FFF807FFC7FFF807FFC7FFF807F +FC03FE000F0001FE001E0000FF003C0000FF807800007FC07800003FE0F000001FE1E000000FF3 +C000000FFF80000007FF00000003FE00000001FE00000000FF00000000FF80000000FFC0000001 +FFC0000003DFE00000078FF00000078FF800000F07FC00001E03FC00003C01FE00007800FF0000 +F000FF8000E0007FC001E0003FC0FFFC01FFFFFFFC01FFFFFFFC01FFFF28207F9F2B>I +E /Fl 1 14 df<0001FE00000007FF8000001E01E000007800780000E0001C0001800006000300 +00030006000001800C000000C00C000000C0180000006030000000303000000030300000003060 +0000001860000000186000000018C00000000CC00000000CC00000000CC00000000CC00000000C +C00000000CC00000000CC00000000CC00000000C60000000186000000018600000001830000000 +303000000030300000003018000000600C000000C00C000000C006000001800300000300018000 +060000E0001C000078007800001E01E0000007FF80000001FE0000262B7DA02D>13 +D E /Fm 53 122 df<001C0000001C0000001C0000007F800003FFE0000FFFF8001F9CFC003E1C +1E003C1C0F007C1C0700781C0F80F81C1F80F81C3F80F81C3F80F81C3F80FC1C3F80FE1C1F00FF +1C00007FDC00007FFC00007FFFC0003FFFE0001FFFF8000FFFFC0007FFFC0001FFFE00007FFF00 +001FFF00001C7F00001C3F80381C1F807C1C1F80FE1C0F80FE1C0F80FE1C0F80FC1C0F80F81C0F +00701C0F00701C1F00381C1E003C1C3C001F9CF8000FFFF00003FFE00000FF0000001C0000001C +0000001C000019307CAC22>36 D<3C007F00FF80FF80FFC0FFC0FFC07FC03EC000C000C0018001 +8001800300030006000E001C00380030000A157B8813>44 D<1C007F007F00FF80FF80FF807F00 +7F001C0009097B8813>46 D<000E00001E00007E0007FE00FFFE00FFFE00F8FE0000FE0000FE00 +00FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00 +00FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00 +00FE007FFFFE7FFFFE7FFFFE17277BA622>49 D<00FF800007FFF0000FFFFC001E03FE003800FF +807C003F80FE003FC0FF001FC0FF001FE0FF000FE0FF000FE07E000FE03C001FE000001FE00000 +1FC000001FC000003F8000003F0000007E000000FC000000F8000001F0000003E0000007800000 +0F0000001E0000003C00E0007000E000E000E001C001C0038001C0060001C00FFFFFC01FFFFFC0 +3FFFFFC07FFFFFC0FFFFFF80FFFFFF80FFFFFF801B277DA622>I<007F800003FFF00007FFFC00 +0F80FE001F007F003F807F003F803F803F803F803F803F801F803F801F003F8000007F0000007F +0000007E000000FC000001F8000007F00000FFC00000FFC0000001F80000007E0000003F000000 +3F8000001FC000001FC000001FE000001FE03C001FE07E001FE0FF001FE0FF001FE0FF001FC0FF +003FC0FE003F807C007F003F00FE001FFFFC0007FFF00000FF80001B277DA622>I<00000E0000 +001E0000003E0000007E000000FE000000FE000001FE000003FE0000077E00000E7E00000E7E00 +001C7E0000387E0000707E0000E07E0000E07E0001C07E0003807E0007007E000E007E000E007E +001C007E0038007E0070007E00E0007E00FFFFFFF8FFFFFFF8FFFFFFF80000FE000000FE000000 +FE000000FE000000FE000000FE000000FE000000FE00007FFFF8007FFFF8007FFFF81D277EA622 +>I<180003001F801F001FFFFE001FFFFC001FFFF8001FFFF0001FFFC0001FFF00001C0000001C +0000001C0000001C0000001C0000001C0000001C0000001C7FC0001DFFF8001F80FC001E003F00 +08003F0000001F8000001FC000001FC000001FE000001FE018001FE07C001FE0FE001FE0FE001F +E0FE001FE0FE001FC0FC001FC078003F8078003F803C007F001F01FE000FFFFC0003FFF00000FF +80001B277DA622>I<00000780000000000780000000000FC0000000000FC0000000000FC00000 +00001FE0000000001FE0000000003FF0000000003FF0000000003FF00000000077F80000000077 +F800000000F7FC00000000E3FC00000000E3FC00000001C1FE00000001C1FE00000003C1FF0000 +000380FF0000000380FF00000007007F80000007007F8000000F007FC000000E003FC000000E00 +3FC000001C001FE000001C001FE000003FFFFFF000003FFFFFF000003FFFFFF00000700007F800 +00700007F80000F00007FC0000E00003FC0000E00003FC0001C00001FE0001C00001FE0003C000 +01FF00FFFE003FFFFCFFFE003FFFFCFFFE003FFFFC2E297EA833>65 DI<00007FE0030007FFFC07001FFFFF0F007FF00F9F00FF0001FF01FC0000FF03F8 +00007F07F000003F0FE000001F1FC000001F1FC000000F3F8000000F3F800000077F800000077F +800000077F00000000FF00000000FF00000000FF00000000FF00000000FF00000000FF00000000 +FF00000000FF00000000FF000000007F000000007F800000007F800000073F800000073F800000 +071FC00000071FC000000E0FE000000E07F000001C03F800003C01FC00007800FF0001F0007FF0 +07C0001FFFFF800007FFFE0000007FF00028297CA831>IIII<00 +007FE003000007FFFC0700001FFFFF0F00007FF00F9F0000FF0001FF0001FC0000FF0003F80000 +7F0007F000003F000FE000001F001FC000001F001FC000000F003F8000000F003F80000007007F +80000007007F80000007007F0000000000FF0000000000FF0000000000FF0000000000FF000000 +0000FF0000000000FF0000000000FF0000000000FF0000000000FF0000FFFFF87F0000FFFFF87F +8000FFFFF87F800000FF003F800000FF003F800000FF001FC00000FF001FC00000FF000FE00000 +FF0007F00000FF0003F80000FF0001FC0000FF0000FF0001FF00007FF007FF00001FFFFF9F0000 +07FFFE0F0000007FF003002D297CA835>III75 +DIII<0000FFC00000000FFFFC0000003F807F0000 +00FE001FC00001F80007E00003F00003F00007E00001F8000FE00001FC001FC00000FE001FC000 +00FE003F8000007F003F8000007F007F8000007F807F0000003F807F0000003F807F0000003F80 +FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000 +003FC0FF0000003FC0FF0000003FC0FF0000003FC07F0000003F807F8000007F807F8000007F80 +3F8000007F003F8000007F001FC00000FE001FC00000FE000FE00001FC0007F00003F80003F800 +07F00001FC000FE00000FE001FC000003FC0FF0000000FFFFC00000000FFC000002A297CA833> +II<0000FFC00000000FFFFC0000003FC0FF000000FE00 +1FC00001FC000FE00003F00003F00007F00003F8000FE00001FC001FC00000FE001FC00000FE00 +3F8000007F003F8000007F007F8000007F807F8000007F807F0000003F807F0000003F80FF0000 +003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0 +FF0000003FC0FF0000003FC0FF0000003FC07F0000003F807F8000007F807F8000007F803F8000 +007F003F8000007F001FC00000FE001FC03E00FE000FE07F81FC0007E0C1C1F80003F18063F000 +01F98067E00000FF803FC000003FC07F0000000FFFFC00000000FFF800C00000003C00C0000000 +1E00C00000001E01C00000001F83C00000001FFFC00000000FFF800000000FFF800000000FFF00 +00000007FF0000000003FE0000000001FC0000000000F8002A357CA833>II<00FF00C003FFE1C00FFFF9C01F80FFC03F003FC03E000FC07C0007C0 +7C0007C0FC0003C0FC0003C0FC0001C0FE0001C0FE0001C0FF000000FFC000007FFC00007FFFE0 +003FFFF8001FFFFE001FFFFF0007FFFF8003FFFFC000FFFFC0000FFFE000007FE000001FF00000 +0FF0000007F0E00003F0E00003F0E00003F0E00003F0F00003E0F00003E0F80007E0FC0007C0FF +000F80FFE01F80E3FFFF00E1FFFC00C01FF0001C297CA825>I<7FFFFFFFFF807FFFFFFFFF807F +FFFFFFFF807F807F807F807C007F800F8078007F80078078007F80078070007F800380F0007F80 +03C0F0007F8003C0E0007F8001C0E0007F8001C0E0007F8001C0E0007F8001C0E0007F8001C000 +007F80000000007F80000000007F80000000007F80000000007F80000000007F80000000007F80 +000000007F80000000007F80000000007F80000000007F80000000007F80000000007F80000000 +007F80000000007F80000000007F80000000007F80000000007F80000000007F80000000007F80 +000000007F80000000007F80000000FFFFFFC00000FFFFFFC00000FFFFFFC0002A287EA72F>I< +FFFFF000FFFEFFFFF000FFFEFFFFF000FFFE03FC0000038003FC0000038003FC0000038003FC00 +00038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00000380 +03FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00 +00038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00000380 +03FC0000038003FC0000038003FC0000038003FC0000038003FC0000038001FC0000070001FE00 +00070000FE00000E00007F00000E00003F00003C00001FC0007800000FF003F0000007FFFFE000 +0000FFFF800000001FFC00002F297EA834>III89 D<03FF80000FFFF0001F01FC003F80FE003F807F003F803F003F803F801F003F800000 +3F8000003F8000003F8000003F80003FFF8001FC3F800FE03F801F803F803F003F807E003F80FC +003F80FC003F80FC003F80FC003F80FC005F807E00DF803F839FFC1FFE0FFC03F803FC1E1B7E9A +21>97 DI<003FF00001FFFC0003F03E000FC07F00 +1F807F003F007F003F007F007F003E007E0000007E000000FE000000FE000000FE000000FE0000 +00FE000000FE000000FE0000007E0000007E0000007F0000003F0003803F8003801F8007000FE0 +0E0003F83C0001FFF800003FC000191B7E9A1E>I<00007FF000007FF000007FF0000007F00000 +07F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F000 +0007F0003F87F001FFF7F007F03FF00FC00FF01F8007F03F0007F03F0007F07E0007F07E0007F0 +7E0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F07E0007 +F07E0007F03F0007F03F0007F01F800FF00FC01FF007E07FFF01FFE7FF007F87FF202A7EA925> +I<003FC00001FFF00003E07C000F803E001F801F001F001F003F000F807E000F807E000FC07E00 +0FC0FE0007C0FE0007C0FFFFFFC0FFFFFFC0FE000000FE000000FE0000007E0000007E0000007F +0000003F0001C01F0001C00F80038007C0070003F01E0000FFFC00003FE0001A1B7E9A1F>I<00 +07F8003FFC007E3E01FC7F03F87F03F07F07F07F07F03E07F00007F00007F00007F00007F00007 +F00007F000FFFFC0FFFFC0FFFFC007F00007F00007F00007F00007F00007F00007F00007F00007 +F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0007F +FF807FFF807FFF80182A7EA915>I<007F80F001FFE3F807C0FE1C0F807C7C1F003E7C1F003E10 +3F003F003F003F003F003F003F003F003F003F003F003F001F003E001F003E000F807C0007C0F8 +0005FFE0000C7F8000180000001C0000001C0000001E0000001FFFF8001FFFFF000FFFFFC007FF +FFE003FFFFF00FFFFFF03E0007F07C0001F8F80000F8F80000F8F80000F8F80000F87C0001F07C +0001F03F0007E00FC01F8007FFFF00007FF0001E287E9A22>II<07000F801FC03FE03FE03FE01FC00F8007000000000000000000000000000000FF +E0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0 +0FE00FE00FE00FE0FFFEFFFEFFFE0F2B7EAA12>I108 +DII< +003FE00001FFFC0003F07E000FC01F801F800FC03F0007E03F0007E07E0003F07E0003F07E0003 +F0FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F87E0003F07E00 +03F03F0007E03F0007E01F800FC00FC01F8007F07F0001FFFC00003FE0001D1B7E9A22>II114 D<03FE300FFFF03E03F07800F07000F0F00070F00070F8 +0070FE0000FFE0007FFF007FFFC03FFFE01FFFF007FFF800FFF80007FC0000FCE0007CE0003CF0 +003CF00038F80038FC0070FF01E0E7FFC0C1FF00161B7E9A1B>I<007000007000007000007000 +00F00000F00000F00001F00003F00003F00007F0001FFFE0FFFFE0FFFFE007F00007F00007F000 +07F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F07007F07007F070 +07F07007F07007F07007F07003F0E001F8C000FFC0003F0014267FA51A>III +III E /Fn 86 127 df<70F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F870000000000070F8 +F8F870051C779B18>33 D<4010E038F078E038E038E038E038E038E038E038E038E038E0386030 +0D0E7B9C18>I<030600078F00078F00078F00078F00078F00078F007FFFC0FFFFE0FFFFE07FFF +C00F1E000F1E000F1E000F1E000F1E000F1E007FFFC0FFFFE0FFFFE07FFFC01E3C001E3C001E3C +001E3C001E3C001E3C000C1800131C7E9B18>I<00C00001C00001C00001C00003F0000FFC003F +FE007DCF0071C700E1C380E1C780E1C780E1C780F1C00079C0003DC0001FE0000FF80003FC0001 +DE0001CF0001C70061C380F1C380F1C380E1C380E1C70071C70079DE003FFE001FF80007E00001 +C00001C00001C00000C00011247D9F18>I<3803007C07807C0780EE0F80EE0F00EE0F00EE1F00 +EE1E00EE1E00EE3E007C3C007C3C00387C0000780000780000F80000F00001F00001E00001E000 +03E00003C00003C00007C0000783800787C00F87C00F0EE00F0EE01F0EE01E0EE01E0EE03E0EE0 +3C07C03C07C018038013247E9F18>I<01C00007E0000FF0000E70001C38001C38001C38001C38 +001C73F01C73F01CE3F00FE3800FC7000F87000F07001F0E003F0E007B8E0073DC00E1DC00E0F8 +00E0F800E07070E0787070FC707FFFE03FCFE00F03C0141C7F9B18>I<387C7C7E3E0E0E0E1C1C +38F8F0C0070E789B18>I<007000F001E003C007800F001E001C00380038007000700070007000 +E000E000E000E000E000E000E000E0007000700070007000380038001C001E000F00078003C001 +F000F000700C24799F18>I<6000F00078003C001E000F000780038001C001C000E000E000E000 +E00070007000700070007000700070007000E000E000E000E001C001C0038007800F001E003C00 +7800F00060000C247C9F18>I<01C00001C00001C00001C000C1C180F1C780F9CF807FFF001FFC +0007F00007F0001FFC007FFF00F9CF80F1C780C1C18001C00001C00001C00001C00011147D9718 +>I<00600000F00000F00000F00000F00000F00000F00000F0007FFFC0FFFFE0FFFFE07FFFC000 +F00000F00000F00000F00000F00000F00000F00000600013147E9718>I<1C3E7E7F3F1F070E1E +7CF860080C788518>I<7FFF00FFFF80FFFF807FFF0011047D8F18>I<3078FCFC78300606778518 +>I<000300000780000780000F80000F00001F00001E00001E00003E00003C00007C0000780000 +780000F80000F00001F00001E00003E00003C00003C00007C0000780000F80000F00000F00001F +00001E00003E00003C00003C00007C0000780000F80000F00000F0000060000011247D9F18>I< +01F00007FC000FFE001F1F001C07003803807803C07001C07001C0E000E0E000E0E000E0E000E0 +E000E0E000E0E000E0E000E0E000E0F001E07001C07001C07803C03803801C07001F1F000FFE00 +07FC0001F000131C7E9B18>I<01800380038007800F803F80FF80FB8043800380038003800380 +0380038003800380038003800380038003800380038003807FFCFFFE7FFC0F1C7B9B18>I<03F0 +000FFE003FFF007C0F807003C0E001C0F000E0F000E06000E00000E00000E00001C00001C00003 +C0000780000F00001E00003C0000780000F00001E00007C0000F80001E00E03C00E07FFFE0FFFF +E07FFFE0131C7E9B18>I<001F00003F0000770000770000E70001E70001C70003870007870007 +07000E07001E07003C0700380700780700F00700FFFFF8FFFFF8FFFFF800070000070000070000 +0700000700000700007FF000FFF8007FF0151C7F9B18>52 D<007E0001FF0007FF800F83C01E03 +C01C03C0380180380000700000700000E1F800E7FE00FFFF00FE0780F803C0F001C0F000E0E000 +E0F000E07000E07000E07000E03801C03C03C01E07800FFF0007FE0001F800131C7E9B18>54 +D<3078FCFC783000000000000000003078FCFC78300614779318>58 D<183C7E7E3C1800000000 +00000000183C7E7E3E1E0E1C3C78F060071A789318>I<000300000780001F80003F00007E0001 +FC0003F00007E0001FC0003F00007E0000FC0000FC00007E00003F00001FC00007E00003F00001 +FC00007E00003F00001F8000078000030011187D9918>I<7FFFC0FFFFE0FFFFE0FFFFE0000000 +000000000000000000FFFFE0FFFFE0FFFFE07FFFC0130C7E9318>I<600000F00000FC00007E00 +003F00001FC00007E00003F00001FC00007E00003F00001F80001F80003F00007E0001FC0003F0 +0007E0001FC0003F00007E0000FC0000F0000060000011187D9918>I<0FF0003FFC007FFF0070 +0F00F00380F00380600780000F00003E00007C0001F00001E00003C00003C00003C00003C00003 +C00003800000000000000000000000000000000003800007C00007C00007C000038000111C7D9B +18>I<007C0001FE0007FF000F87801E03C03C1DC0387FC070FFE071E3E071C1E0E1C1E0E380E0 +E380E0E380E0E380E0E380E0E380E0E1C1C071C1C071E3C070FF80387F003C1C001E00E00F83E0 +07FFC001FF80007E00131C7E9B18>I<00700000F80000F80000D80000D80001DC0001DC0001DC +00018C00038E00038E00038E00038E000306000707000707000707000707000FFF800FFF800FFF +800E03800E03801C01C01C01C07F07F0FF8FF87F07F0151C7F9B18>II<00F8E003FEE007FFE00F07E01E03E03C01E03800E07000E07000E0700000E00000E00000 +E00000E00000E00000E00000E00000E000007000007000E07000E03800E03C00E01E01C00F07C0 +07FF8003FE0000F800131C7E9B18>I<7FF800FFFE007FFF001C0F801C03C01C03C01C01E01C00 +E01C00E01C00F01C00701C00701C00701C00701C00701C00701C00701C00701C00F01C00E01C00 +E01C01E01C01C01C03C01C0F807FFF00FFFE007FF800141C7F9B18>III<01F1C003FDC00FFFC01F0FC01C03C03803C03801C07001 +C07001C0700000E00000E00000E00000E00000E00000E00FF0E01FF0E00FF07001C07001C07003 +C03803C03803C01C07C01F0FC00FFFC003FDC001F1C0141C7E9B18>I<7FFF00FFFF807FFF0001 +C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001 +C00001C00001C00001C00001C00001C00001C00001C00001C0007FFF00FFFF807FFF00111C7D9B +18>73 D<01FFC003FFC001FFC0000E00000E00000E00000E00000E00000E00000E00000E00000E +00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00F00E00F00E00F03C +007FFC003FF0000FC000121C7D9B18>I<7F07F0FF87F87F07F01C03C01C07801C07001C0E001C +1E001C3C001C38001C70001CF0001DF0001DF0001FB8001FB8001F1C001E1C001C0E001C0E001C +07001C07001C03801C03801C01C07F03F0FF87F87F03F0151C7F9B18>I<7FE000FFE0007FE000 +0E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0000 +0E00000E00000E00000E00000E00700E00700E00700E00700E00707FFFF0FFFFF07FFFF0141C7F +9B18>II<7E07F0FF0FF87F07F01D81C01D81C01D81C01DC1C01C +C1C01CC1C01CE1C01CE1C01CE1C01C61C01C71C01C71C01C31C01C39C01C39C01C39C01C19C01C +19C01C1DC01C0DC01C0DC01C0DC07F07C0FF87C07F03C0151C7F9B18>I<0FF8003FFE007FFF00 +780F00700700F00780E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380 +E00380E00380E00380E00380E00380E00380F00780700700780F007FFF003FFE000FF800111C7D +9B18>II<0FF8003FFE007FFF00780F00700700F00780E00380E0 +0380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E1 +E380E1E380F0E78070F700787F007FFF003FFE000FFC00001C00001E00000E00000F0000070000 +070011227D9B18>I<7FF800FFFE007FFF001C0F801C03801C03C01C01C01C01C01C01C01C03C0 +1C03801C0F801FFF001FFE001FFE001C0F001C07001C03801C03801C03801C03801C03801C039C +1C039C1C039C7F01F8FF81F87F00F0161C7F9B18>I<03F3801FFF803FFF807C0F80700780E003 +80E00380E00380E000007000007800003F00001FF00007FE0000FF00000F800003C00001C00000 +E00000E06000E0E000E0E001E0F001C0F80780FFFF80FFFE00E7F800131C7E9B18>I<7FFFF8FF +FFF8FFFFF8E07038E07038E07038E0703800700000700000700000700000700000700000700000 +700000700000700000700000700000700000700000700000700000700000700007FF0007FF0007 +FF00151C7F9B18>IIII<7F8FE07F9FE07F8FE00E07000F0700070E00078E00039C0003DC0001F800 +01F80000F00000F00000700000F00000F80001F80001DC00039E00038E00070F000707000E0780 +0E03801E03C07F07F0FF8FF87F07F0151C7F9B18>II91 +D<600000F00000F00000F800007800007C00003C00003C00003E00001E00001F00000F00000F00 +000F800007800007C00003C00003C00003E00001E00001F00000F00000F800007800007800007C +00003C00003E00001E00001E00001F00000F00000F8000078000078000030011247D9F18>II< +7FFF00FFFF80FFFF807FFF0011047D7F18>95 D<061E3E387070E0E0E0F8FC7C7C38070E789E18 +>I<1FE0003FF8007FFC00781E00300E0000070000070000FF0007FF001FFF007F0700780700E0 +0700E00700E00700F00F00781F003FFFF01FFBF007E1F014147D9318>I<7E0000FE00007E0000 +0E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1E00F80E00F00700E00700E0038 +0E00380E00380E00380E00380E00380F00700F00700F80E00FC1E00FFFC00EFF80063E00151C80 +9B18>I<01FE0007FF001FFF803E0780380300700000700000E00000E00000E00000E00000E000 +00E000007000007001C03801C03E03C01FFF8007FF0001FC0012147D9318>I<001F80003F8000 +1F8000038000038000038000038000038003E3800FFB801FFF803C1F80380F80700780700380E0 +0380E00380E00380E00380E00380E00380700780700780380F803C1F801FFFF00FFBF803E3F015 +1C7E9B18>I<01F00007FC001FFE003E0F00380780700380700380E001C0E001C0FFFFC0FFFFC0 +FFFFC0E000007000007001C03801C03E03C01FFF8007FF0001FC0012147D9318>I<001F80007F +C000FFE000E1E001C0C001C00001C00001C0007FFFC0FFFFC0FFFFC001C00001C00001C00001C0 +0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0007FFF007FFF007FFF +00131C7F9B18>I<01E1F007FFF80FFFF81E1E301C0E003807003807003807003807003807001C +0E001E1E001FFC001FF80039E0003800001C00001FFE001FFFC03FFFE07801F0700070E00038E0 +0038E00038E000387800F07E03F01FFFC00FFF8001FC00151F7F9318>I<7E0000FE00007E0000 +0E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1C00F80E00F00E00E00E00E00E0 +0E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FCFFE7FE7FC3FC171C80 +9B18>I<03800007C00007C00007C0000380000000000000000000000000007FC000FFC0007FC0 +0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0 +0001C000FFFF00FFFF80FFFF00111D7C9C18>I<0038007C007C007C003800000000000000000F +FC1FFC0FFC001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C +001C001C001C001C001C6038F078FFF07FE03F800E277E9C18>I +I<7FE000FFE0007FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0 +0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0007FFF +C0FFFFE07FFFC0131C7E9B18>I<7CE0E000FFFBF8007FFFF8001F1F1C001E1E1C001E1E1C001C +1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C00 +1C1C1C007F1F1F00FFBFBF807F1F1F001914819318>I<7E3E00FEFF807FFFC00FC1C00F80E00F +00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FCFF +E7FE7FC3FC1714809318>I<01F0000FFE001FFF003E0F803803807001C07001C0E000E0E000E0 +E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF000FFE0001F00013147E9318> +I<7E3E00FEFF807FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E00 +380F00700F00700F80E00FC1E00FFFC00EFF800E3E000E00000E00000E00000E00000E00000E00 +000E00007FC000FFE0007FC000151E809318>I<01E38007FB801FFF803E1F80380F8070078070 +0780E00380E00380E00380E00380E00380E00380700780700780380F803C1F801FFF800FFB8003 +E380000380000380000380000380000380000380000380003FF8003FF8003FF8151E7E9318>I< +7F87E0FF9FF07FBFF803F87803F03003E00003C00003C000038000038000038000038000038000 +0380000380000380000380007FFE00FFFF007FFE0015147F9318>I<07F7003FFF007FFF00780F +00E00700E00700E007007C00007FE0001FFC0003FE00001F00600780E00380E00380F00380F80F +00FFFF00FFFC00E7F00011147D9318>I<0180000380000380000380000380007FFFC0FFFFC0FF +FFC00380000380000380000380000380000380000380000380000380000380400380E00380E003 +80E001C1C001FFC000FF80003E0013197F9818>I<7E07E0FE0FE07E07E00E00E00E00E00E00E0 +0E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03E007FFFC03FFFE +01FCFC1714809318>I<7F8FF0FF8FF87F8FF01E03C00E03800E03800E03800707000707000707 +00038E00038E00038E00038E0001DC0001DC0001DC0000F80000F80000700015147F9318>II<7F8FF07F9FF07F8FF0070700 +078E00039E0001DC0001F80000F80000700000F00000F80001DC00039E00038E000707000F0780 +7F8FF0FF8FF87F8FF015147F9318>I<7F8FF0FF8FF87F8FF00E01C00E03800E03800703800707 +00070700038700038600038E0001CE0001CE0000CC0000CC0000DC000078000078000078000070 +0000700000700000F00000E00079E0007BC0007F80003F00001E0000151E7F9318>I<3FFFF07F +FFF07FFFF07001E07003C0700780000F00001E00003C0000F80001F00003C0000780000F00701E +00703C0070780070FFFFF0FFFFF0FFFFF014147F9318>I<0007E0001FE0007FE000780000E000 +00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00001E0007FC000FF8000 +FF80007FC00001E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000 +00E000007800007FE0001FE00007E013247E9F18>I<60F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0 +F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0600424769F18>I<7C0000FF0000FFC00003C00000 +E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000F000007FC000 +3FE0003FE0007FC000F00000E00000E00000E00000E00000E00000E00000E00000E00000E00000 +E00000E00003C000FFC000FF00007C000013247E9F18>I<060C1F1E3FBEFBF8F1F060C00F067C +9B18>I E /Fo 76 124 df<001F83E000F06E3001C078780380F8780300F03007007000070070 +000700700007007000070070000700700007007000FFFFFF800700700007007000070070000700 +700007007000070070000700700007007000070070000700700007007000070070000700700007 +007000070070000700700007007000070070007FE3FF001D20809F1B>11 +D<003F0000E0C001C0C00381E00701E00701E0070000070000070000070000070000070000FFFF +E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700 +E00700E00700E00700E00700E00700E07FC3FE1720809F19>I<003FE000E0E001C1E00381E007 +00E00700E00700E00700E00700E00700E00700E00700E0FFFFE00700E00700E00700E00700E007 +00E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E007 +00E07FE7FE1720809F19>I<001F81F80000F04F040001C07C06000380F80F000300F00F000700 +F00F00070070000007007000000700700000070070000007007000000700700000FFFFFFFF0007 +007007000700700700070070070007007007000700700700070070070007007007000700700700 +070070070007007007000700700700070070070007007007000700700700070070070007007007 +00070070070007007007007FE3FE3FF02420809F26>I<0080008007E00C981084208260824081 +C087C08FC08FC086E080F08078803F803FE01FF807FC00FE009E008E00870087F083F083F08380 +83808240864084208818B007C000800080008010257DA117>36 D<70F8FCFC7404040408081010 +2040060E7C9F0D>39 D<0020004000800100020006000C000C0018001800300030003000700060 +0060006000E000E000E000E000E000E000E000E000E000E000E000E00060006000600070003000 +30003000180018000C000C000600020001000080004000200B2E7DA112>I<8000400020001000 +08000C00060006000300030001800180018001C000C000C000C000E000E000E000E000E000E000 +E000E000E000E000E000E000C000C000C001C001800180018003000300060006000C0008001000 +2000400080000B2E7DA112>I<70F8FCFC74040404080810102040060E7C840D>44 +DI<70F8F8F87005057C840D>I<03F0000E1C001C0E0018060038070070 +0380700380700380700380F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F0 +03C0F003C0F003C0F003C07003807003807003807807803807001806001C0E000E1C0003F00012 +1F7E9D17>48 D<018003800F80F380038003800380038003800380038003800380038003800380 +03800380038003800380038003800380038003800380038007C0FFFE0F1E7C9D17>I<03F0000C +1C00100E00200700400780800780F007C0F803C0F803C0F803C02007C00007C000078000078000 +0F00000E00001C0000380000700000600000C0000180000300000600400C00401800401000803F +FF807FFF80FFFF80121E7E9D17>I<03F0000C1C00100E00200F00780F80780780780780380F80 +000F80000F00000F00000E00001C0000380003F000003C00000E00000F000007800007800007C0 +2007C0F807C0F807C0F807C0F00780400780400F00200E001C3C0003F000121F7E9D17>I<0006 +00000600000E00000E00001E00002E00002E00004E00008E00008E00010E00020E00020E00040E +00080E00080E00100E00200E00200E00400E00C00E00FFFFF0000E00000E00000E00000E00000E +00000E00000E0000FFE0141E7F9D17>I<1803001FFE001FFC001FF8001FE00010000010000010 +000010000010000010000011F000161C00180E001007001007800003800003800003C00003C000 +03C07003C0F003C0F003C0E00380400380400700200600100E000C380003E000121F7E9D17>I< +007C000182000701000E03800C07801C0780380300380000780000700000700000F1F000F21C00 +F40600F80700F80380F80380F003C0F003C0F003C0F003C0F003C07003C07003C0700380380380 +3807001807000C0E00061C0001F000121F7E9D17>I<4000007FFFC07FFF807FFF804001008002 +0080020080040000080000080000100000200000200000400000400000C00000C00001C0000180 +00038000038000038000038000078000078000078000078000078000078000078000030000121F +7D9D17>I<03F0000C0C001006003003002001806001806001806001807001807803003E03003F +06001FC8000FF00003F80007FC000C7E00103F00300F806003804001C0C001C0C000C0C000C0C0 +00C0C000806001802001001002000C0C0003F000121F7E9D17>I<03F0000E18001C0C00380600 +380700700700700380F00380F00380F003C0F003C0F003C0F003C0F003C07007C07007C03807C0 +180BC00E13C003E3C0000380000380000380000700300700780600780E00700C00201800107000 +0FC000121F7E9D17>I<70F8F8F8700000000000000000000070F8F8F87005147C930D>I<70F8F8 +F8700000000000000000000070F0F8F878080808101010202040051D7C930D>I<000100000003 +800000038000000380000007C0000007C0000007C0000009E0000009E0000009E0000010F00000 +10F0000010F00000207800002078000020780000403C0000403C0000403C0000801E0000801E00 +00FFFE0001000F0001000F0001000F00020007800200078002000780040003C00E0003C01F0007 +E0FFC03FFE1F207F9F22>65 DI<000FC040007030C001C009C0 +038005C0070003C00E0001C01E0000C01C0000C03C0000C07C0000407C00004078000040F80000 +00F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000780000007C00 +00407C0000403C0000401C0000401E0000800E000080070001000380020001C004000070380000 +0FC0001A217D9F21>IIII<000FE0200078186000E004E0038002E0070001E00F0000E01E00 +00601E0000603C0000603C0000207C00002078000020F8000000F8000000F8000000F8000000F8 +000000F8000000F8000000F8007FFCF80003E0780001E07C0001E03C0001E03C0001E01E0001E0 +1E0001E00F0001E0070001E0038002E000E0046000781820000FE0001E217D9F24>II +I<0FFFC0007C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C +00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00203C00F83C00F83C +00F83C00F0380040780040700030E0000F800012207E9E17>I +IIII<001F800000F0F00001C0380007801E000F000F000E0007001E0007803C0003C03C0003 +C07C0003E0780001E0780001E0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0F800 +01F0F80001F0F80001F0780001E07C0003E07C0003E03C0003C03C0003C01E0007800E0007000F +000F0007801E0001C0380000F0F000001F80001C217D9F23>I +I82 D<07E0800C1980100780300380600180600180E0 +0180E00080E00080E00080F00000F000007800007F00003FF0001FFC000FFE0003FF00001F8000 +07800003C00003C00001C08001C08001C08001C08001C0C00180C00380E00300F00600CE0C0081 +F80012217D9F19>I<7FFFFFE0780F01E0600F0060400F0020400F0020C00F0030800F0010800F +0010800F0010800F0010000F0000000F0000000F0000000F0000000F0000000F0000000F000000 +0F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000 +000F0000000F0000001F800007FFFE001C1F7E9E21>IIII89 +D91 D93 D<081020204040808080B8 +FCFC7C38060E7D9F0D>96 D<1FE000303000781800781C00300E00000E00000E00000E0000FE00 +078E001E0E00380E00780E00F00E10F00E10F00E10F01E10781E103867200F83C014147E9317> +I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E3E +000EC3800F01C00F00E00E00E00E00700E00700E00780E00780E00780E00780E00780E00780E00 +700E00700E00E00F00E00D01C00CC300083E0015207F9F19>I<03F80E0C1C1E381E380C700070 +00F000F000F000F000F000F00070007000380138011C020E0C03F010147E9314>I<000380003F +8000038000038000038000038000038000038000038000038000038000038003E380061B801C07 +80380380380380700380700380F00380F00380F00380F00380F00380F003807003807003803803 +803807801C07800E1B8003E3F815207E9F19>I<03F0000E1C001C0E0038070038070070070070 +0380F00380F00380FFFF80F00000F00000F000007000007000003800801800800C010007060001 +F80011147F9314>I<007C00C6018F038F07060700070007000700070007000700FFF007000700 +07000700070007000700070007000700070007000700070007000700070007007FF01020809F0E +>I<0000E003E3300E3C301C1C30380E00780F00780F00780F00780F00780F00380E001C1C001E +380033E0002000002000003000003000003FFE001FFF800FFFC03001E0600070C00030C00030C0 +0030C000306000603000C01C038003FC00141F7F9417>I<0E0000FE00000E00000E00000E0000 +0E00000E00000E00000E00000E00000E00000E00000E3E000E43000E81800F01C00F01C00E01C0 +0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0 +FFE7FC16207F9F19>I<1C003E003E003E001C000000000000000000000000000E007E000E000E +000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00FFC00A1F809E0C> +I<00E001F001F001F000E0000000000000000000000000007007F000F000700070007000700070 +00700070007000700070007000700070007000700070007000700070007000706070F060F0C061 +803F000C28829E0E>I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00 +000E00000E00000E0FF00E03C00E03000E02000E04000E08000E10000E30000E70000EF8000F38 +000E1C000E1E000E0E000E07000E07800E03800E03C00E03E0FFCFF815207F9F18>I<0E00FE00 +0E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E +000E000E000E000E000E000E000E000E000E00FFE00B20809F0C>I<0E1F01F000FE618618000E +81C81C000F00F00E000F00F00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E00 +0E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E +000E00E00E00FFE7FE7FE023147F9326>I<0E3E00FE43000E81800F01C00F01C00E01C00E01C0 +0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC +16147F9319>I<01F800070E001C03803801C03801C07000E07000E0F000F0F000F0F000F0F000 +F0F000F0F000F07000E07000E03801C03801C01C0380070E0001F80014147F9317>I<0E3E00FE +C3800F01C00F00E00E00E00E00F00E00700E00780E00780E00780E00780E00780E00780E00700E +00F00E00E00F01E00F01C00EC3000E3E000E00000E00000E00000E00000E00000E00000E00000E +0000FFE000151D7F9319>I<03E0800619801C05803C0780380380780380700380F00380F00380 +F00380F00380F00380F003807003807803803803803807801C0B800E138003E380000380000380 +000380000380000380000380000380000380003FF8151D7E9318>I<0E78FE8C0F1E0F1E0F0C0E +000E000E000E000E000E000E000E000E000E000E000E000E000E00FFE00F147F9312>I<1F9030 +704030C010C010C010E00078007F803FE00FF00070803880188018C018C018E030D0608F800D14 +7E9312>I<020002000200060006000E000E003E00FFF80E000E000E000E000E000E000E000E00 +0E000E000E000E080E080E080E080E080610031001E00D1C7F9B12>I<0E01C0FE1FC00E01C00E +01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E +03C00603C0030DC001F1FC16147F9319>III<7FC3FC0F01E00701C007018003810001C20000E40000EC +00007800003800003C00007C00004E000087000107000303800201C00601E01E01E0FF07FE1714 +809318>II<3FFF380E200E201C40384078407000E001E0 +01C00380078007010E011E011C0338027006700EFFFE10147F9314>II +E /Fp 14 122 df<0000001FFC0000C000000003FFFFC001C00000001FFFFFF003C00000007FFF +FFFC07C0000001FFFC00FE0FC0000007FFC0001F9FC000000FFE000007FFC000003FF8000003FF +C000007FF0000000FFC00000FFE00000007FC00001FFC00000007FC00001FF800000003FC00003 +FF000000001FC00007FE000000001FC0000FFE000000000FC0000FFC000000000FC0001FFC0000 +000007C0001FFC0000000007C0003FF80000000007C0003FF80000000003C0003FF80000000003 +C0007FF80000000003C0007FF80000000003C0007FF0000000000000007FF000000000000000FF +F000000000000000FFF000000000000000FFF000000000000000FFF000000000000000FFF00000 +0000000000FFF000000000000000FFF000000000000000FFF000000000000000FFF00000000000 +0000FFF000000000000000FFF000001FFFFFFF807FF000001FFFFFFF807FF000001FFFFFFF807F +F800001FFFFFFF807FF800000001FFC0003FF800000001FFC0003FF800000001FFC0003FF80000 +0001FFC0001FFC00000001FFC0001FFC00000001FFC0000FFE00000001FFC0000FFE00000001FF +C00007FF00000001FFC00003FF00000001FFC00001FF80000001FFC00001FFC0000001FFC00000 +FFE0000001FFC000007FF0000003FFC000003FFC000003FFC000000FFF000007FFC0000007FFC0 +001FBFC0000001FFFC00FF1FC00000007FFFFFFE0FC00000001FFFFFF803C000000003FFFFE000 +C0000000001FFE00000000413D7BBB4C>71 D76 D78 D82 D85 D<003FFE00000001FFFFE0000007FFFFF800000FE007FC00000FF001FE00001F +F800FF00001FF8007F80001FF8007FC0001FF8003FC0000FF0003FE00007E0003FE00003C0003F +E0000000003FE0000000003FE0000000003FE0000000003FE0000000FFFFE000001FFFFFE00000 +7FF83FE00003FF803FE00007FC003FE0000FF0003FE0001FE0003FE0003FE0003FE0007FC0003F +E0007FC0003FE000FF80003FE000FF80003FE000FF80003FE000FF80003FE000FF80007FE0007F +C0007FE0007FC000DFE0003FE0039FF0001FF80F0FFFE007FFFE0FFFE001FFF807FFE0003FE000 +FFE02B267DA52F>97 D<00FE00000000FFFE00000000FFFE00000000FFFE00000000FFFE000000 +0007FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE +0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE000000 +0003FE0000000003FE0000000003FE0000000003FE0000000003FE01FF000003FE1FFFF00003FE +7FFFFC0003FEFC03FE0003FFF000FF0003FFC0003F8003FF00001FC003FE00001FE003FE00000F +F003FE00000FF803FE00000FF803FE000007FC03FE000007FC03FE000007FC03FE000007FE03FE +000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007 +FE03FE000007FE03FE000007FC03FE000007FC03FE000007FC03FE00000FFC03FE00000FF803FE +00000FF003FE00001FF003FF00001FE003FF80003FC003FFC0007F8003F9E000FF0003F0FC07FE +0003F07FFFF80003E01FFFE00003C003FE00002F3C7DBB36>I<000000003F800000003FFF8000 +00003FFF800000003FFF800000003FFF8000000001FF8000000000FF8000000000FF8000000000 +FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000 +000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000 +FF800000FF80FF80000FFFF0FF80003FFFFCFF8000FFC03FFF8001FE000FFF8003FC0003FF8007 +F80001FF800FF00000FF801FF00000FF803FE00000FF803FE00000FF807FE00000FF807FC00000 +FF807FC00000FF807FC00000FF80FFC00000FF80FFC00000FF80FFC00000FF80FFC00000FF80FF +C00000FF80FFC00000FF80FFC00000FF80FFC00000FF80FFC00000FF807FC00000FF807FC00000 +FF807FC00000FF803FE00000FF803FE00000FF801FE00000FF800FF00001FF8007F00003FF8003 +F80007FF8001FE001FFFC000FF807EFFFE007FFFF8FFFE000FFFE0FFFE0001FF00FFFE2F3C7DBB +36>100 D<0001FF8000000FFFF000003FFFFC0000FF81FE0003FE007F8007F8003F800FF8001F +C00FF0000FE01FE0000FE03FE0000FF03FE00007F07FC00007F07FC00007F87FC00007F8FFC000 +07F8FFC00007F8FFFFFFFFF8FFFFFFFFF8FFFFFFFFF8FFC0000000FFC0000000FFC0000000FFC0 +0000007FC00000007FC00000007FC00000003FE00000003FE00000781FE00000781FF00000780F +F00000F007F80001F003FC0003E001FE000FC000FFC07F80003FFFFE00000FFFF8000000FFC000 +25267DA52C>I<01E00007F8000FFC000FFC001FFE001FFE001FFE001FFE000FFC000FFC0007F8 +0001E00000000000000000000000000000000000000000000000000000000000000000000000FE +00FFFE00FFFE00FFFE00FFFE0007FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE0003FE0003FE00FFFFF0FFFFF0FFFFF0FFFFF0143D7DBC1A +>105 D<00FE00FFFE00FFFE00FFFE00FFFE0007FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE +0003FE0003FE0003FE0003FE0003FE00FFFFF8FFFFF8FFFFF8FFFFF8153C7DBB1A>108 +D<01FC00FF8000FFFC03FFF000FFFC0FFFF800FFFC1E03FC00FFFC3801FE0007FC6001FF0003FC +C000FF0003FDC000FF8003FD8000FF8003FF0000FF8003FF0000FF8003FF0000FF8003FE0000FF +8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE +0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF +8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE +0000FF8003FE0000FF80FFFFF83FFFFEFFFFF83FFFFEFFFFF83FFFFEFFFFF83FFFFE2F267CA536 +>110 D<01FC03F000FFFC0FFC00FFFC1FFF00FFFC3C3F80FFFC707F8007FCE0FFC003FCC0FFC0 +03FD80FFC003FD80FFC003FF807F8003FF003F0003FF001E0003FF00000003FE00000003FE0000 +0003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00 +000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE +00000003FE00000003FE00000003FE000000FFFFFC0000FFFFFC0000FFFFFC0000FFFFFC000022 +267DA528>114 D121 +D E end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 300dpi +TeXDict begin + +%%EndSetup +%%Page: 1 1 +0 bop 0 1152 a Fp(GNU)33 b(Readline)h(Library)p 0 1201 1950 +17 v 1011 1250 a Fo(Edition)17 b(2.0,)c(for)i Fn(Readline)f(Library)g +Fo(V)l(ersion)i(2.0.)1759 1304 y(July)g(1994)0 2443 y Fm(Brian)23 +b(F)-6 b(o)n(x,)23 b(F)-6 b(ree)23 b(Soft)n(w)n(are)f(F)-6 +b(oundation)0 2509 y(Chet)22 b(Ramey)-6 b(,)23 b(Case)e(W)-6 +b(estern)23 b(Reserv)n(e)f(Univ)n(ersit)n(y)p 0 2545 1950 9 +v eop +%%Page: 2 2 +1 bop 0 295 a Fo(This)15 b(do)q(cumen)o(t)f(describ)q(es)i(the)e(GNU)g +(Readline)j(Library)l(,)d(a)g(utilit)o(y)h(whic)o(h)g(aids)g(in)g(the)f +(consistency)h(of)f(user)0 358 y(in)o(terface)h(across)g(discrete)h(programs) +e(that)g(need)j(to)d(pro)o(vide)i(a)f(command)g(line)i(in)o(terface.)0 +495 y(Published)g(b)o(y)f(the)f(F)l(ree)g(Soft)o(w)o(are)f(F)l(oundation)0 +557 y(675)g(Massac)o(h)o(usetts)g(Av)o(en)o(ue,)0 619 y(Cam)o(bridge,)h(MA)g +(02139)f(USA)0 756 y(P)o(ermission)f(is)g(gran)o(ted)f(to)f(mak)o(e)h(and)h +(distribute)h(v)o(erbatim)e(copies)h(of)f(this)h(man)o(ual)g(pro)o(vided)g +(the)f(cop)o(yrigh)o(t)0 818 y(notice)k(and)f(this)h(p)q(ermission)h(notice)e +(are)g(preserv)o(ed)h(on)f(all)h(copies.)0 955 y(P)o(ermission)f(is)f(gran)o +(ted)f(to)h(cop)o(y)g(and)g(distribute)h(mo)q(di\014ed)h(v)o(ersions)e(of)f +(this)i(man)o(ual)f(under)h(the)f(conditions)0 1018 y(for)e(v)o(erbatim)g +(cop)o(ying,)h(pro)o(vided)h(that)d(the)i(en)o(tire)g(resulting)h(deriv)o(ed) +f(w)o(ork)f(is)h(distributed)h(under)f(the)g(terms)0 1080 y(of)i(a)g(p)q +(ermission)h(notice)g(iden)o(tical)h(to)e(this)g(one.)0 1217 +y(P)o(ermission)20 b(is)g(gran)o(ted)f(to)g(cop)o(y)h(and)f(distribute)i +(translations)f(of)f(this)h(man)o(ual)f(in)o(to)h(another)f(language,)0 +1279 y(under)c(the)f(ab)q(o)o(v)o(e)g(conditions)h(for)e(mo)q(di\014ed)j(v)o +(ersions,)e(except)g(that)g(this)g(p)q(ermission)i(notice)e(ma)o(y)g(b)q(e)h +(stated)0 1341 y(in)h(a)f(translation)g(appro)o(v)o(ed)g(b)o(y)g(the)g(F)l +(oundation.)0 2636 y(Cop)o(yrigh)o(t)226 2635 y(c)214 2636 +y Fl(\015)g Fo(1989,)f(1991)g(F)l(ree)h(Soft)o(w)o(are)f(F)l(oundation,)h +(Inc.)p eop +%%Page: 1 3 +2 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227 +b(1)0 158 y Fk(1)41 b(Command)16 b(Line)f(Editing)62 383 y +Fo(This)h(c)o(hapter)f(describ)q(es)i(the)e(basic)h(features)f(of)g(the)g +(GNU)g(command)g(line)i(editing)f(in)o(terface.)0 676 y Fm(1.1)33 +b(In)n(tro)r(duction)17 b(to)e(Line)h(Editing)62 820 y Fo(The)g(follo)o(wing) +g(paragraphs)e(describ)q(e)j(the)e(notation)g(used)h(to)e(represen)o(t)i(k)o +(eystrok)o(es.)62 965 y(The)f(text)e Fn(C-K)h Fo(is)g(read)g(as)g(`Con)o +(trol-K')f(and)h(describ)q(es)i(the)e(c)o(haracter)f(pro)q(duced)i(when)g +(the)f(Con)o(trol)f(k)o(ey)0 1027 y(is)j(depressed)g(and)f(the)h +Fn(K)f Fo(k)o(ey)g(is)g(struc)o(k.)62 1172 y(The)i(text)f Fn(M-K)g +Fo(is)i(read)e(as)g(`Meta-K')g(and)h(describ)q(es)h(the)f(c)o(haracter)f(pro) +q(duced)h(when)h(the)e(meta)g(k)o(ey)h(\(if)0 1234 y(y)o(ou)g(ha)o(v)o(e)f +(one\))h(is)g(depressed,)h(and)f(the)g Fn(K)g Fo(k)o(ey)g(is)g(struc)o(k.)25 +b(If)17 b(y)o(ou)f(do)h(not)g(ha)o(v)o(e)f(a)h(meta)f(k)o(ey)l(,)h(the)g +(iden)o(tical)0 1296 y(k)o(eystrok)o(e)i(can)g(b)q(e)i(generated)e(b)o(y)h(t) +o(yping)f Fn(ESC)h Fj(\014rst)p Fo(,)g(and)f(then)h(t)o(yping)g +Fn(K)p Fo(.)33 b(Either)20 b(pro)q(cess)g(is)g(kno)o(wn)f(as)0 +1358 y Fj(metafying)g Fo(the)c Fn(K)g Fo(k)o(ey)l(.)62 1503 +y(The)h(text)e Fn(M-C-K)g Fo(is)i(read)f(as)f(`Meta-Con)o(trol-k')g(and)h +(describ)q(es)h(the)g(c)o(haracter)e(pro)q(duced)i(b)o(y)f +Fj(metafying)0 1565 y Fn(C-K)p Fo(.)62 1710 y(In)i(addition,)h(sev)o(eral)e +(k)o(eys)g(ha)o(v)o(e)g(their)h(o)o(wn)f(names.)23 b(Sp)q(eci\014cally)m(,)c +Fn(DEL)p Fo(,)d Fn(ESC)p Fo(,)f Fn(LFD)p Fo(,)h Fn(SPC)p Fo(,)g +Fn(RET)p Fo(,)g(and)g Fn(TAB)0 1772 y Fo(all)e(stand)f(for)f(themselv)o(es)i +(when)f(seen)h(in)g(this)f(text,)g(or)g(in)g(an)g(init)i(\014le)f(\(see)f +(Section)h(1.3)e([Readline)j(Init)f(File],)0 1834 y(page)h(4,)g(for)f(more)h +(info\).)0 2127 y Fm(1.2)33 b(Readline)16 b(In)n(teraction)62 +2271 y Fo(Often)g(during)h(an)f(in)o(teractiv)o(e)g(session)h(y)o(ou)e(t)o +(yp)q(e)h(in)h(a)f(long)g(line)h(of)f(text,)f(only)h(to)g(notice)g(that)f +(the)h(\014rst)0 2334 y(w)o(ord)d(on)i(the)f(line)i(is)e(missp)q(elled.)23 +b(The)14 b(Readline)i(library)f(giv)o(es)g(y)o(ou)e(a)h(set)g(of)g(commands)g +(for)f(manipulating)0 2396 y(the)18 b(text)g(as)g(y)o(ou)g(t)o(yp)q(e)g(it)h +(in,)g(allo)o(wing)g(y)o(ou)f(to)g(just)g(\014x)g(y)o(our)g(t)o(yp)q(o,)g +(and)h(not)f(forcing)g(y)o(ou)g(to)g(ret)o(yp)q(e)g(the)0 2458 +y(ma)s(jorit)o(y)d(of)h(the)g(line.)25 b(Using)17 b(these)g(editing)h +(commands,)e(y)o(ou)g(mo)o(v)o(e)f(the)i(cursor)f(to)g(the)g(place)h(that)f +(needs)0 2521 y(correction,)g(and)h(delete)g(or)f(insert)g(the)h(text)e(of)h +(the)g(corrections.)23 b(Then,)17 b(when)g(y)o(ou)f(are)g(satis\014ed)g(with) +h(the)0 2583 y(line,)h(y)o(ou)e(simply)i(press)f Fn(RETURN)p +Fo(.)23 b(Y)l(ou)17 b(do)f(not)g(ha)o(v)o(e)g(to)g(b)q(e)i(at)e(the)g(end)h +(of)f(the)h(line)h(to)e(press)h Fn(RETURN)p Fo(;)f(the)0 2645 +y(en)o(tire)g(line)h(is)e(accepted)h(regardless)f(of)g(the)g(lo)q(cation)h +(of)f(the)h(cursor)e(within)j(the)e(line.)p eop +%%Page: 2 4 +3 bop 0 -83 a Fo(2)1472 b(GNU)15 b(Readline)i(Library)0 158 +y Fi(1.2.1)30 b(Readline)15 b(Bare)g(Essen)n(tials)62 295 y +Fo(In)f(order)f(to)f(en)o(ter)h(c)o(haracters)g(in)o(to)g(the)g(line,)i +(simply)f(t)o(yp)q(e)f(them.)19 b(The)14 b(t)o(yp)q(ed)f(c)o(haracter)f(app)q +(ears)i(where)0 358 y(the)h(cursor)h(w)o(as,)e(and)h(then)h(the)g(cursor)f +(mo)o(v)o(es)f(one)i(space)g(to)e(the)i(righ)o(t.)k(If)c(y)o(ou)f(mist)o(yp)q +(e)h(a)f(c)o(haracter,)f(y)o(ou)0 420 y(can)h(use)h(y)o(our)f(erase)g(c)o +(haracter)f(to)h(bac)o(k)g(up)g(and)h(delete)g(the)f(mist)o(yp)q(ed)h(c)o +(haracter.)62 557 y(Sometimes)f(y)o(ou)e(ma)o(y)h(miss)g(t)o(yping)g(a)g(c)o +(haracter)g(that)f(y)o(ou)h(w)o(an)o(ted)f(to)g(t)o(yp)q(e,)h(and)h(not)e +(notice)i(y)o(our)f(error)0 619 y(un)o(til)k(y)o(ou)e(ha)o(v)o(e)g(t)o(yp)q +(ed)h(sev)o(eral)g(other)f(c)o(haracters.)23 b(In)18 b(that)d(case,)i(y)o(ou) +f(can)h(t)o(yp)q(e)g Fn(C-B)f Fo(to)g(mo)o(v)o(e)g(the)g(cursor)0 +681 y(to)f(the)h(left,)g(and)g(then)g(correct)f(y)o(our)h(mistak)o(e.)21 +b(Afterw)o(ards,)14 b(y)o(ou)i(can)g(mo)o(v)o(e)f(the)h(cursor)f(to)g(the)h +(righ)o(t)g(with)0 744 y Fn(C-F)p Fo(.)62 881 y(When)i(y)o(ou)f(add)g(text)g +(in)h(the)f(middle)i(of)e(a)g(line,)i(y)o(ou)e(will)i(notice)e(that)g(c)o +(haracters)f(to)h(the)g(righ)o(t)g(of)g(the)0 943 y(cursor)h(are)h(`pushed)g +(o)o(v)o(er')e(to)h(mak)o(e)g(ro)q(om)g(for)g(the)h(text)f(that)g(y)o(ou)g +(ha)o(v)o(e)h(inserted.)31 b(Lik)o(ewise,)20 b(when)f(y)o(ou)0 +1005 y(delete)f(text)f(b)q(ehind)i(the)f(cursor,)f(c)o(haracters)f(to)h(the)g +(righ)o(t)g(of)g(the)h(cursor)f(are)g(`pulled)i(bac)o(k')d(to)h(\014ll)i(in)f +(the)0 1067 y(blank)g(space)f(created)g(b)o(y)g(the)h(remo)o(v)m(al)f(of)f +(the)i(text.)25 b(A)17 b(list)h(of)e(the)h(basic)h(bare)f(essen)o(tials)h +(for)e(editing)j(the)0 1130 y(text)c(of)f(an)i(input)g(line)h(follo)o(ws.)0 +1279 y Fn(C-B)168 b Fo(Mo)o(v)o(e)14 b(bac)o(k)h(one)h(c)o(haracter.)0 +1366 y Fn(C-F)168 b Fo(Mo)o(v)o(e)14 b(forw)o(ard)g(one)h(c)o(haracter.)0 +1454 y Fn(DEL)168 b Fo(Delete)16 b(the)f(c)o(haracter)g(to)f(the)h(left)h(of) +f(the)g(cursor.)0 1541 y Fn(C-D)168 b Fo(Delete)16 b(the)f(c)o(haracter)g +(underneath)h(the)f(cursor.)0 1615 y(Prin)o(ting)h(c)o(haracters)240 +1678 y(Insert)f(the)h(c)o(haracter)e(in)o(to)h(the)h(line)h(at)d(the)h +(cursor.)0 1765 y Fn(C-_)168 b Fo(Undo)15 b(the)h(last)f(thing)h(that)e(y)o +(ou)h(did.)21 b(Y)l(ou)15 b(can)h(undo)f(all)h(the)g(w)o(a)o(y)e(bac)o(k)h +(to)f(an)i(empt)o(y)e(line.)0 1973 y Fi(1.2.2)30 b(Readline)15 +b(Mo)n(v)n(emen)n(t)h(Commands)62 2110 y Fo(The)c(ab)q(o)o(v)o(e)g(table)g +(describ)q(es)i(the)e(most)f(basic)h(p)q(ossible)i(k)o(eystrok)o(es)d(that)g +(y)o(ou)g(need)i(in)g(order)f(to)f(do)h(editing)0 2172 y(of)g(the)h(input)h +(line.)21 b(F)l(or)12 b(y)o(our)g(con)o(v)o(enience,)i(man)o(y)f(other)f +(commands)h(ha)o(v)o(e)f(b)q(een)i(added)f(in)h(addition)g(to)e +Fn(C-B)p Fo(,)0 2234 y Fn(C-F)p Fo(,)i Fn(C-D)p Fo(,)h(and)g +Fn(DEL)p Fo(.)20 b(Here)15 b(are)g(some)g(commands)g(for)f(mo)o(ving)h(more)g +(rapidly)i(ab)q(out)e(the)g(line.)0 2384 y Fn(C-A)168 b Fo(Mo)o(v)o(e)14 +b(to)h(the)g(start)f(of)h(the)g(line.)0 2471 y Fn(C-E)168 b +Fo(Mo)o(v)o(e)14 b(to)h(the)g(end)h(of)f(the)g(line.)0 2558 +y Fn(M-F)168 b Fo(Mo)o(v)o(e)14 b(forw)o(ard)g(a)h(w)o(ord.)0 +2645 y Fn(M-B)168 b Fo(Mo)o(v)o(e)14 b(bac)o(kw)o(ard)h(a)g(w)o(ord.)p +eop +%%Page: 3 5 +4 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227 +b(3)0 158 y Fn(C-L)168 b Fo(Clear)15 b(the)h(screen,)f(reprin)o(ting)h(the)f +(curren)o(t)g(line)i(at)e(the)g(top.)62 325 y(Notice)22 b(ho)o(w)e +Fn(C-F)h Fo(mo)o(v)o(es)f(forw)o(ard)g(a)g(c)o(haracter,)i(while)g +Fn(M-F)f Fo(mo)o(v)o(es)f(forw)o(ard)g(a)h(w)o(ord.)36 b(It)21 +b(is)h(a)f(lo)q(ose)0 387 y(con)o(v)o(en)o(tion)15 b(that)g(con)o(trol)g(k)o +(eystrok)o(es)f(op)q(erate)h(on)g(c)o(haracters)f(while)j(meta)e(k)o(eystrok) +o(es)f(op)q(erate)h(on)g(w)o(ords.)0 671 y Fi(1.2.3)30 b(Readline)15 +b(Killing)g(Commands)62 816 y Fj(Killing)25 b Fo(text)18 b(means)g(to)f +(delete)i(the)g(text)e(from)h(the)g(line,)i(but)e(to)g(sa)o(v)o(e)f(it)i(a)o +(w)o(a)o(y)d(for)i(later)g(use,)h(usually)0 878 y(b)o(y)c Fj(y)o(anking)k +Fo(\(re-inserting\))c(it)g(bac)o(k)g(in)o(to)g(the)g(line.)21 +b(If)16 b(the)f(description)h(for)e(a)h(command)f(sa)o(ys)h(that)f(it)h +(`kills')0 941 y(text,)f(then)i(y)o(ou)f(can)g(b)q(e)h(sure)f(that)g(y)o(ou)g +(can)g(get)g(the)g(text)g(bac)o(k)g(in)h(a)f(di\013eren)o(t)g(\(or)f(the)i +(same\))e(place)i(later.)62 1086 y(When)g(y)o(ou)f(use)g(a)g(kill)i(command,) +e(the)h(text)e(is)i(sa)o(v)o(ed)f(in)h(a)f Fj(kill-ring)p Fo(.)22 +b(An)o(y)16 b(n)o(um)o(b)q(er)f(of)g(consecutiv)o(e)h(kills)0 +1148 y(sa)o(v)o(e)g(all)i(of)e(the)h(killed)i(text)d(together,)g(so)g(that)g +(when)h(y)o(ou)f(y)o(ank)h(it)g(bac)o(k,)f(y)o(ou)h(get)f(it)h(all.)25 +b(The)17 b(kill)h(ring)f(is)0 1211 y(not)e(line)i(sp)q(eci\014c;)g(the)f +(text)f(that)g(y)o(ou)g(killed)j(on)d(a)h(previously)g(t)o(yp)q(ed)g(line)h +(is)f(a)o(v)m(ailable)i(to)d(b)q(e)h(y)o(ank)o(ed)f(bac)o(k)0 +1273 y(later,)g(when)h(y)o(ou)e(are)h(t)o(yping)h(another)e(line.)62 +1418 y(Here)i(is)f(the)h(list)g(of)e(commands)h(for)g(killing)j(text.)0 +1585 y Fn(C-K)168 b Fo(Kill)17 b(the)f(text)e(from)h(the)g(curren)o(t)g +(cursor)g(p)q(osition)h(to)f(the)g(end)h(of)f(the)g(line.)0 +1689 y Fn(M-D)168 b Fo(Kill)17 b(from)d(the)h(cursor)g(to)f(the)h(end)g(of)g +(the)g(curren)o(t)f(w)o(ord,)g(or)g(if)i(b)q(et)o(w)o(een)f(w)o(ords,)f(to)g +(the)h(end)g(of)240 1751 y(the)g(next)h(w)o(ord.)0 1855 y Fn(M-DEL)120 +b Fo(Kill)16 b(from)d(the)i(cursor)e(the)h(start)f(of)h(the)g(previous)h(w)o +(ord,)e(or)g(if)i(b)q(et)o(w)o(een)f(w)o(ords,)f(to)h(the)g(start)e(of)240 +1917 y(the)j(previous)h(w)o(ord.)0 2021 y Fn(C-W)168 b Fo(Kill)18 +b(from)e(the)g(cursor)g(to)f(the)h(previous)h(whitespace.)24 +b(This)17 b(is)f(di\013eren)o(t)h(than)f Fn(M-DEL)f Fo(b)q(ecause)240 +2084 y(the)g(w)o(ord)g(b)q(oundaries)h(di\013er.)62 2250 y(And,)e(here)g(is)h +(ho)o(w)e(to)g Fj(y)o(ank)j Fo(the)e(text)f(bac)o(k)g(in)o(to)h(the)f(line.) +22 b(Y)l(anking)14 b(means)g(to)f(cop)o(y)g(the)h(most-recen)o(tly-)0 +2312 y(killed)j(text)e(from)g(the)g(kill)i(bu\013er.)0 2479 +y Fn(C-Y)168 b Fo(Y)l(ank)15 b(the)h(most)e(recen)o(tly)i(killed)h(text)e +(bac)o(k)g(in)o(to)g(the)h(bu\013er)f(at)f(the)i(cursor.)0 +2583 y Fn(M-Y)168 b Fo(Rotate)13 b(the)h(kill-ring,)i(and)e(y)o(ank)g(the)g +(new)g(top.)19 b(Y)l(ou)14 b(can)g(only)g(do)g(this)g(if)g(the)g(prior)g +(command)240 2645 y(is)i Fn(C-Y)e Fo(or)h Fn(M-Y)p Fo(.)p eop +%%Page: 4 6 +5 bop 0 -83 a Fo(4)1472 b(GNU)15 b(Readline)i(Library)0 158 +y Fi(1.2.4)30 b(Readline)15 b(Argumen)n(ts)62 305 y Fo(Y)l(ou)k(can)g(pass)f +(n)o(umeric)i(argumen)o(ts)d(to)h(Readline)j(commands.)30 b(Sometimes)19 +b(the)f(argumen)o(t)g(acts)g(as)g(a)0 367 y(rep)q(eat)f(coun)o(t,)f(other)g +(times)g(it)h(is)g(the)g Fj(sign)f Fo(of)g(the)h(argumen)o(t)f(that)f(is)i +(signi\014can)o(t.)25 b(If)16 b(y)o(ou)h(pass)f(a)g(negativ)o(e)0 +430 y(argumen)o(t)g(to)g(a)h(command)g(whic)o(h)h(normally)f(acts)g(in)h(a)e +(forw)o(ard)g(direction,)i(that)f(command)f(will)j(act)d(in)i(a)0 +492 y(bac)o(kw)o(ard)13 b(direction.)21 b(F)l(or)13 b(example,)h(to)f(kill)i +(text)e(bac)o(k)h(to)f(the)h(start)e(of)h(the)h(line,)h(y)o(ou)e(migh)o(t)h +(t)o(yp)q(e)g Fn(M--)f(C-K)p Fo(.)62 639 y(The)19 b(general)g(w)o(a)o(y)f(to) +g(pass)g(n)o(umeric)i(argumen)o(ts)e(to)g(a)g(command)h(is)g(to)f(t)o(yp)q(e) +g(meta)g(digits)i(b)q(efore)f(the)0 701 y(command.)36 b(If)21 +b(the)g(\014rst)f(`digit')h(y)o(ou)g(t)o(yp)q(e)f(is)i(a)e(min)o(us)h(sign)g +(\()p Fn(-)p Fo(\),)g(then)g(the)g(sign)g(of)g(the)f(argumen)o(t)g(will)0 +763 y(b)q(e)i(negativ)o(e.)40 b(Once)22 b(y)o(ou)f(ha)o(v)o(e)h(t)o(yp)q(ed)g +(one)f(meta)g(digit)i(to)e(get)g(the)h(argumen)o(t)f(started,)h(y)o(ou)f(can) +h(t)o(yp)q(e)0 826 y(the)c(remainder)h(of)f(the)g(digits,)h(and)f(then)h(the) +f(command.)29 b(F)l(or)17 b(example,)i(to)f(giv)o(e)g(the)g +Fn(C-D)g Fo(command)g(an)0 888 y(argumen)o(t)c(of)h(10,)f(y)o(ou)h(could)h(t) +o(yp)q(e)g Fn(M-1)23 b(0)h(C-D)p Fo(.)0 1201 y Fm(1.3)33 b(Readline)16 +b(Init)g(File)62 1348 y Fo(Although)g(the)g(Readline)h(library)g(comes)e +(with)h(a)f(set)g(of)g(Emacs-lik)o(e)h(k)o(eybindings)h(installed)g(b)o(y)f +(default,)0 1410 y(it)e(is)g(p)q(ossible)i(that)d(y)o(ou)g(w)o(ould)h(lik)o +(e)h(to)e(use)h(a)f(di\013eren)o(t)h(set)g(of)f(k)o(eybindings.)21 +b(Y)l(ou)14 b(can)g(customize)g(programs)0 1472 y(that)e(use)i(Readline)h(b)o +(y)e(putting)h(commands)f(in)h(an)f Fj(init)i Fo(\014le)f(in)g(y)o(our)f +(home)g(directory)l(.)19 b(The)14 b(name)f(of)f(this)i(\014le)0 +1535 y(is)i(tak)o(en)f(from)g(the)g(v)m(alue)i(of)e(the)h(en)o(vironmen)o(t)f +(v)m(ariable)i Fn(INPUTRC)p Fo(.)j(If)c(that)f(v)m(ariable)h(is)g(unset,)g +(the)f(default)0 1597 y(is)h(`)p Fn(~/.inputrc)p Fo('.)62 1744 +y(When)j(a)g(program)e(whic)o(h)j(uses)f(the)g(Readline)i(library)e(starts)f +(up,)h(the)g(init)h(\014le)g(is)f(read,)g(and)g(the)g(k)o(ey)0 +1806 y(bindings)e(are)e(set.)62 1953 y(In)j(addition,)h(the)f +Fn(C-x)c(C-r)k Fo(command)f(re-reads)g(this)h(init)h(\014le,)g(th)o(us)e +(incorp)q(orating)h(an)o(y)f(c)o(hanges)h(that)0 2015 y(y)o(ou)d(migh)o(t)g +(ha)o(v)o(e)g(made)g(to)f(it.)0 2311 y Fi(1.3.1)30 b(Readline)15 +b(Init)g(Syn)n(tax)62 2458 y Fo(There)h(are)f(only)h(a)f(few)g(basic)h +(constructs)f(allo)o(w)o(ed)h(in)g(the)g(Readline)i(init)e(\014le.)22 +b(Blank)16 b(lines)h(are)e(ignored.)0 2521 y(Lines)j(b)q(eginning)g(with)f(a) +f Fn(#)g Fo(are)g(commen)o(ts.)22 b(Lines)c(b)q(eginning)g(with)f(a)f +Fn($)g Fo(indicate)h(conditional)h(constructs)0 2583 y(\(see)e(Section)h +(1.3.2)e([Conditional)i(Init)g(Constructs],)e(page)i(7\).)22 +b(Other)16 b(lines)i(denote)f(v)m(ariable)h(settings)e(and)0 +2645 y(k)o(ey)f(bindings.)p eop +%%Page: 5 7 +6 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227 +b(5)0 158 y(V)l(ariable)16 b(Settings)240 221 y(Y)l(ou)j(can)g(c)o(hange)g +(the)g(state)f(of)g(a)g(few)h(v)m(ariables)h(in)g(Readline)h(b)o(y)d(using)i +(the)f Fn(set)f Fo(command)240 283 y(within)e(the)f(init)h(\014le.)k(Here)15 +b(is)g(ho)o(w)g(y)o(ou)f(w)o(ould)h(sp)q(ecify)h(that)e(y)o(ou)g(wish)i(to)e +(use)h Fn(vi)f Fo(line)j(editing)240 345 y(commands:)360 408 +y Fn(set)23 b(editing-mode)g(vi)240 484 y Fo(Righ)o(t)14 b(no)o(w,)f(there)h +(are)f(only)h(a)f(few)h(v)m(ariables)g(whic)o(h)h(can)f(b)q(e)g(set;)f(so)g +(few,)h(in)g(fact,)f(that)g(w)o(e)g(just)240 546 y(list)j(them)f(here:)240 +622 y Fn(editing-mode)480 684 y Fo(The)e Fn(editing-mode)e +Fo(v)m(ariable)j(con)o(trols)e(whic)o(h)h(editing)h(mo)q(de)f(y)o(ou)f(are)g +(using.)20 b(By)480 746 y(default,)f(Readline)h(starts)c(up)i(in)h(Emacs)e +(editing)i(mo)q(de,)f(where)g(the)g(k)o(eystrok)o(es)480 808 +y(are)c(most)g(similar)h(to)f(Emacs.)19 b(This)c(v)m(ariable)h(can)f(b)q(e)g +(set)f(to)g(either)h Fn(emacs)f Fo(or)g Fn(vi)p Fo(.)240 884 +y Fn(horizontal-scroll-mode)480 946 y Fo(This)k(v)m(ariable)g(can)f(b)q(e)g +(set)g(to)f(either)i Fn(On)f Fo(or)f Fn(Off)p Fo(.)25 b(Setting)17 +b(it)g(to)f Fn(On)h Fo(means)g(that)480 1009 y(the)d(text)g(of)f(the)h(lines) +i(that)d(y)o(ou)h(edit)h(will)g(scroll)g(horizon)o(tally)g(on)f(a)g(single)h +(screen)480 1071 y(line)f(when)f(they)g(are)f(longer)h(than)f(the)h(width)g +(of)f(the)g(screen,)h(instead)g(of)g(wrapping)480 1133 y(on)o(to)h(a)h(new)h +(screen)f(line.)22 b(By)15 b(default,)h(this)f(v)m(ariable)i(is)f(set)e(to)h +Fn(Off)p Fo(.)240 1209 y Fn(mark-modified-lines)480 1271 y +Fo(This)h(v)m(ariable,)g(when)g(set)f(to)f Fn(On)p Fo(,)h(sa)o(ys)f(to)g +(displa)o(y)j(an)e(asterisk)g(\(`)p Fn(*)p Fo('\))e(at)i(the)g(start)480 +1333 y(of)f(history)h(lines)i(whic)o(h)e(ha)o(v)o(e)g(b)q(een)h(mo)q +(di\014ed.)21 b(This)15 b(v)m(ariable)h(is)g Fn(off)e Fo(b)o(y)h(default.)240 +1409 y Fn(bell-style)480 1471 y Fo(Con)o(trols)h(what)f(happ)q(ens)j(when)f +(Readline)h(w)o(an)o(ts)e(to)f(ring)i(the)f(terminal)h(b)q(ell.)26 +b(If)480 1533 y(set)13 b(to)g Fn(none)p Fo(,)g(Readline)j(nev)o(er)e(rings)g +(the)g(b)q(ell.)21 b(If)14 b(set)f(to)g Fn(visible)p Fo(,)g(Readline)j(uses) +480 1596 y(a)g(visible)j(b)q(ell)g(if)e(one)g(is)g(a)o(v)m(ailable.)27 +b(If)17 b(set)f(to)g Fn(audible)g Fo(\(the)h(default\),)g(Readline)480 +1658 y(attempts)d(to)h(ring)g(the)h(terminal's)f(b)q(ell.)240 +1733 y Fn(comment-begin)480 1796 y Fo(The)21 b(string)h(to)e(insert)i(at)e +(the)h(b)q(eginning)j(of)c(the)i(line)g(when)g(the)f Fn(vi-comment)480 +1858 y Fo(command)15 b(is)h(executed.)21 b(The)15 b(default)h(v)m(alue)g(is)g +Fn("#")p Fo(.)240 1934 y Fn(meta-flag)480 1996 y Fo(If)d(set)g(to)f +Fn(on)p Fo(,)g(Readline)j(will)g(enable)f(eigh)o(t-bit)f(input)h(\(it)f(will) +h(not)f(strip)g(the)g(eigh)o(th)480 2058 y(bit)i(from)g(the)g(c)o(haracters)f +(it)h(reads\),)f(regardless)h(of)g(what)f(the)h(terminal)h(claims)g(it)480 +2120 y(can)f(supp)q(ort.)20 b(The)c(default)g(v)m(alue)g(is)g +Fn(off)p Fo(.)240 2196 y Fn(convert-meta)480 2258 y Fo(If)23 +b(set)f(to)f Fn(on)p Fo(,)j(Readline)h(will)f(con)o(v)o(ert)d(c)o(haracters)h +(with)g(the)h(eigth)g(bit)f(set)h(to)480 2320 y(an)17 b(ASCI)q(I)g(k)o(ey)g +(sequence)h(b)o(y)e(stripping)i(the)f(eigth)g(bit)g(and)g(prep)q(ending)i(an) +d Fn(ESC)480 2383 y Fo(c)o(haracter,)h(con)o(v)o(erting)g(them)g(to)f(a)h +(meta-pre\014xed)h(k)o(ey)f(sequence.)27 b(The)17 b(default)480 +2445 y(v)m(alue)f(is)g Fn(on)p Fo(.)240 2521 y Fn(output-meta)480 +2583 y Fo(If)d(set)f(to)g Fn(on)p Fo(,)h(Readline)i(will)f(displa)o(y)g(c)o +(haracters)d(with)i(the)g(eigh)o(th)g(bit)g(set)g(directly)480 +2645 y(rather)i(than)g(as)f(a)h(meta-pre\014xed)h(escap)q(e)g(sequence.)21 +b(The)16 b(default)f(is)h Fn(off)p Fo(.)p eop +%%Page: 6 8 +7 bop 0 -83 a Fo(6)1472 b(GNU)15 b(Readline)i(Library)240 158 +y Fn(completion-query-items)480 221 y Fo(The)12 b(n)o(um)o(b)q(er)g(of)f(p)q +(ossible)j(completions)e(that)f(determines)i(when)f(the)g(user)g(is)g(ask)o +(ed)480 283 y(whether)k(he)h(w)o(an)o(ts)d(to)i(see)g(the)g(list)h(of)e(p)q +(ossibiliti)q(es.)25 b(If)16 b(the)g(n)o(um)o(b)q(er)h(of)e(p)q(ossible)480 +345 y(completions)i(is)f(greater)f(than)h(this)h(v)m(alue,)f(Readline)j(will) +e(ask)f(the)g(user)g(whether)480 407 y(or)k(not)h(he)h(wishes)f(to)g(view)g +(them;)j(otherwise,)e(they)f(are)g(simply)h(listed.)39 b(The)480 +470 y(default)16 b(limit)g(is)g Fn(100)p Fo(.)240 564 y Fn(keymap)96 +b Fo(Sets)13 b(Readline's)i(idea)e(of)g(the)g(curren)o(t)f(k)o(eymap)h(for)f +(k)o(ey)h(binding)i(commands.)k(Ac-)480 626 y(ceptable)d Fn(keymap)e +Fo(names)h(are)g Fn(emacs)p Fo(,)f Fn(emacs-standard)p Fo(,)f +Fn(emacs-meta)p Fo(,)g Fn(emacs-)480 688 y(ctlx)p Fo(,)j Fn(vi)p +Fo(,)h Fn(vi-move)p Fo(,)f Fn(vi-command)p Fo(,)g(and)h Fn(vi-insert)p +Fo(.)23 b Fn(vi)17 b Fo(is)g(equiv)m(alen)o(t)i(to)d Fn(vi-)480 +750 y(command)p Fo(;)22 b Fn(emacs)e Fo(is)h(equiv)m(alen)o(t)h(to)e +Fn(emacs-standard)p Fo(.)35 b(The)20 b(default)i(v)m(alue)f(is)480 +813 y Fn(emacs)p Fo(.)33 b(The)21 b(v)m(alue)g(of)e(the)i Fn(editing-mode)d +Fo(v)m(ariable)j(also)f(a\013ects)f(the)h(default)480 875 y(k)o(eymap.)240 +953 y Fn(show-all-if-ambiguous)480 1015 y Fo(This)d(alters)f(the)h(default)g +(b)q(eha)o(vior)g(of)f(the)g(completion)i(functions.)24 b(If)17 +b(set)f(to)g Fn(on)p Fo(,)480 1077 y(w)o(ords)d(whic)o(h)h(ha)o(v)o(e)f(more) +h(than)f(one)h(p)q(ossible)h(completion)g(cause)f(the)f(matc)o(hes)h(to)480 +1140 y(b)q(e)h(listed)g(immediately)h(instead)f(of)f(ringing)h(the)f(b)q +(ell.)22 b(The)14 b(default)h(v)m(alue)g(is)g Fn(off)p Fo(.)240 +1218 y Fn(expand-tilde)480 1280 y Fo(If)20 b(set)f(to)g Fn(on)p +Fo(,)h(tilde)h(expansion)f(is)g(p)q(erformed)g(when)g(Readline)i(attempts)d +(w)o(ord)480 1342 y(completion.)i(The)15 b(default)h(is)g Fn(off)p +Fo(.)0 1420 y(Key)g(Bindings)240 1483 y(The)k(syn)o(tax)f(for)g(con)o +(trolling)i(k)o(ey)e(bindings)j(in)e(the)g(init)h(\014le)g(is)f(simple.)35 +b(First)19 b(y)o(ou)g(ha)o(v)o(e)h(to)240 1545 y(kno)o(w)13 +b(the)h(name)g(of)f(the)h(command)g(that)f(y)o(ou)g(w)o(an)o(t)g(to)g(c)o +(hange.)20 b(The)14 b(follo)o(wing)g(pages)g(con)o(tain)240 +1607 y(tables)i(of)f(the)h(command)g(name,)f(the)h(default)g(k)o(eybinding,)i +(and)e(a)f(short)g(description)i(of)f(what)240 1669 y(the)f(command)g(do)q +(es.)240 1748 y(Once)h(y)o(ou)e(kno)o(w)g(the)h(name)g(of)f(the)h(command,)f +(simply)i(place)g(the)f(name)f(of)h(the)f(k)o(ey)h(y)o(ou)f(wish)240 +1810 y(to)g(bind)j(the)e(command)g(to,)f(a)g(colon,)i(and)f(then)g(the)g +(name)g(of)g(the)g(command)g(on)g(a)f(line)j(in)f(the)240 1872 +y(init)h(\014le.)22 b(The)16 b(name)g(of)f(the)h(k)o(ey)f(can)h(b)q(e)g +(expressed)h(in)f(di\013eren)o(t)g(w)o(a)o(ys,)f(dep)q(ending)i(on)f(whic)o +(h)240 1934 y(is)g(most)e(comfortable)h(for)g(y)o(ou.)240 2012 +y Fj(k)o(eyname)s Fo(:)k Fj(function-name)g Fo(or)c Fj(macro)480 +2075 y(k)o(eyname)j Fo(is)d(the)h(name)f(of)g(a)g(k)o(ey)g(sp)q(elled)i(out)e +(in)h(English.)21 b(F)l(or)15 b(example:)600 2140 y Fn(Control-u:)22 +b(universal-argument)600 2190 y(Meta-Rubout:)g(backward-kill-word)600 +2240 y(Control-o:)g(">&output")480 2318 y Fo(In)12 b(the)g(ab)q(o)o(v)o(e)f +(example,)h(`)p Fn(C-u)p Fo(')f(is)h(b)q(ound)g(to)f(the)h(function)g +Fn(universal-argument)p Fo(,)480 2380 y(and)h(`)p Fn(C-o)p +Fo(')f(is)h(b)q(ound)h(to)f(run)g(the)g(macro)f(expressed)i(on)f(the)g(righ)o +(t)g(hand)g(side)h(\(that)480 2442 y(is,)h(to)g(insert)h(the)f(text)g(`)p +Fn(>&output)p Fo(')e(in)o(to)i(the)g(line\).)240 2521 y Fn(")p +Fj(k)o(eyseq)q Fn(")p Fo(:)20 b Fj(function-name)e Fo(or)d +Fj(macro)480 2583 y(k)o(eyseq)j Fo(di\013ers)f(from)f Fj(k)o(eyname)k +Fo(ab)q(o)o(v)o(e)c(in)i(that)e(strings)h(denoting)h(an)f(en)o(tire)g(k)o(ey) +480 2645 y(sequence)i(can)f(b)q(e)h(sp)q(eci\014ed,)i(b)o(y)d(placing)h(the)f +(k)o(ey)g(sequence)h(in)g(double)h(quotes.)p eop +%%Page: 7 9 +8 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227 +b(7)480 158 y(Some)18 b(GNU)g(Emacs)f(st)o(yle)h(k)o(ey)g(escap)q(es)g(can)g +(b)q(e)h(used,)g(as)e(in)i(the)f(follo)o(wing)h(ex-)480 221 +y(ample,)c(but)h(the)f(sp)q(ecial)i(c)o(haracter)e(names)g(are)g(not)f +(recognized.)600 283 y Fn("\\C-u":)23 b(universal-argument)600 +333 y("\\C-x\\C-r":)f(re-read-init-file)600 383 y("\\e[11~":)h("Function)f +(Key)i(1")480 457 y Fo(In)13 b(the)g(ab)q(o)o(v)o(e)g(example,)g(`)p +Fn(C-u)p Fo(')f(is)h(b)q(ound)h(to)e(the)h(function)g Fn(universal-argument) +480 519 y Fo(\(just)g(as)f(it)i(w)o(as)e(in)i(the)f(\014rst)g(example\),)h(`) +p Fn(C-x)g(C-r)p Fo(')f(is)g(b)q(ound)i(to)d(the)h(function)h +Fn(re-)480 582 y(read-init-file)p Fo(,)g(and)i(`)p Fn(ESC)e([)h(1)g(1)g(~)p +Fo(')h(is)g(b)q(ound)h(to)f(insert)g(the)g(text)f(`)p Fn(Function)480 +644 y(Key)g(1)p Fo('.)24 b(The)18 b(follo)o(wing)f(escap)q(e)h(sequences)g +(are)f(a)o(v)m(ailable)i(when)e(sp)q(ecifying)i(k)o(ey)480 +706 y(sequences:)480 793 y Fn(\\C-)168 b Fo(con)o(trol)15 b(pre\014x)480 +881 y Fn(\\M-)168 b Fo(meta)15 b(pre\014x)480 968 y Fn(\\e)192 +b Fo(an)15 b(escap)q(e)h(c)o(haracter)480 1055 y Fn(\\\\)192 +b Fo(bac)o(kslash)480 1142 y Fn(\\")g(")480 1229 y(\\')g(')480 +1317 y Fo(When)14 b(en)o(tering)h(the)f(text)f(of)h(a)f(macro,)g(single)j(or) +d(double)i(quotes)f(should)h(b)q(e)f(used)480 1379 y(to)g(indicate)j(a)e +(macro)f(de\014nition.)22 b(Unquoted)15 b(text)g(is)g(assumed)g(to)g(b)q(e)g +(a)g(function)480 1441 y(name.)27 b(Bac)o(kslash)18 b(will)h(quote)e(an)o(y)g +(c)o(haracter)g(in)h(the)g(macro)f(text,)g(including)j Fn(")480 +1503 y Fo(and)c Fn(')p Fo(.)22 b(F)l(or)16 b(example,)h(the)f(follo)o(wing)h +(binding)h(will)f(mak)o(e)f Fn(C-x)f(\\)g Fo(insert)i(a)f(single)480 +1566 y Fn(\\)f Fo(in)o(to)g(the)g(line:)600 1628 y Fn("\\C-x\\\\":)23 +b("\\\\")0 1836 y Fi(1.3.2)30 b(Conditional)15 b(Init)g(Constructs)62 +1973 y Fo(Readline)j(implemen)o(ts)e(a)f(facilit)o(y)h(similar)g(in)g(spirit) +g(to)f(the)g(conditional)i(compilation)f(features)f(of)g(the)g(C)0 +2035 y(prepro)q(cessor)f(whic)o(h)h(allo)o(ws)f(k)o(ey)g(bindings)h(and)f(v)m +(ariable)i(settings)e(to)f(b)q(e)h(p)q(erformed)h(as)e(the)h(result)g(of)g +(tests.)0 2097 y(There)h(are)g(three)h(parser)e(directiv)o(es)j(used.)0 +2247 y Fn($if)168 b Fo(The)14 b Fn($if)e Fo(construct)h(allo)o(ws)h(bindings) +h(to)e(b)q(e)h(made)f(based)h(on)f(the)h(editing)g(mo)q(de,)g(the)f(terminal) +240 2309 y(b)q(eing)k(used,)e(or)g(the)g(application)i(using)f(Readline.)22 +b(The)16 b(text)f(of)g(the)g(test)g(extends)g(to)g(the)g(end)240 +2371 y(of)g(the)g(line;)i(no)e(c)o(haracters)f(are)h(required)h(to)f(isolate) +g(it.)240 2458 y Fn(mode)144 b Fo(The)19 b Fn(mode=)f Fo(form)g(of)h(the)g +Fn($if)f Fo(directiv)o(e)i(is)f(used)h(to)e(test)g(whether)h(Readline)i(is) +480 2521 y(in)h Fn(emacs)f Fo(or)f Fn(vi)h Fo(mo)q(de.)38 b(This)22 +b(ma)o(y)f(b)q(e)h(used)g(in)g(conjunction)g(with)f(the)h(`)p +Fn(set)480 2583 y(keymap)p Fo(')d(command,)i(for)e(instance,)j(to)d(set)h +(bindings)i(in)f(the)f Fn(emacs-standard)480 2645 y Fo(and)15 +b Fn(emacs-ctlx)f Fo(k)o(eymaps)h(only)h(if)f(Readline)j(is)e(starting)e(out) +h(in)h Fn(emacs)f Fo(mo)q(de.)p eop +%%Page: 8 10 +9 bop 0 -83 a Fo(8)1472 b(GNU)15 b(Readline)i(Library)240 158 +y Fn(term)144 b Fo(The)21 b Fn(term=)f Fo(form)g(ma)o(y)h(b)q(e)g(used)h(to)e +(include)j(terminal-sp)q(eci\014c)h(k)o(ey)c(bindings,)480 +221 y(p)q(erhaps)15 b(to)f(bind)j(the)d(k)o(ey)h(sequences)h(output)e(b)o(y)h +(the)g(terminal's)g(function)h(k)o(eys.)480 283 y(The)f(w)o(ord)g(on)f(the)i +(righ)o(t)e(side)i(of)f(the)g(`)p Fn(=)p Fo(')f(is)h(tested)g(against)g(the)g +(full)h(name)f(of)g(the)480 345 y(terminal)k(and)g(the)g(p)q(ortion)g(of)f +(the)h(terminal)g(name)g(b)q(efore)g(the)g(\014rst)f(`)p Fn(-)p +Fo('.)29 b(This)480 407 y(allo)o(ws)15 b Fj(sun)h Fo(to)e(matc)o(h)h(b)q(oth) +g Fj(sun)h Fo(and)f Fj(sun-cmd)p Fo(,)h(for)f(instance.)240 +485 y Fn(application)480 547 y Fo(The)j Fj(application)i Fo(construct)e(is)g +(used)h(to)e(include)k(application-sp)q(eci\014c)g(settings.)480 +610 y(Eac)o(h)d(program)g(using)h(the)f(Readline)j(library)e(sets)f(the)h +Fj(application)h(name)p Fo(,)f(and)480 672 y(y)o(ou)c(can)h(test)f(for)g(it.) +21 b(This)16 b(could)g(b)q(e)h(used)f(to)e(bind)j(k)o(ey)f(sequences)g(to)f +(functions)480 734 y(useful)h(for)e(a)h(sp)q(eci\014c)i(program.)h(F)l(or)d +(instance,)g(the)g(follo)o(wing)h(command)e(adds)h(a)480 796 +y(k)o(ey)g(sequence)h(that)f(quotes)g(the)g(curren)o(t)g(or)g(previous)h(w)o +(ord)e(in)i(Bash:)600 862 y Fn($if)23 b(bash)600 911 y(#)h(Quote)f(the)g +(current)g(or)h(previous)f(word)600 961 y("\\C-xq":)g("\\eb\\"\\ef\\"")600 +1011 y($endif)0 1104 y($endif)96 b Fo(This)16 b(command,)e(as)h(y)o(ou)g(sa)o +(w)g(in)h(the)f(previous)h(example,)f(terminates)h(an)f Fn($if)f +Fo(command.)0 1197 y Fn($else)120 b Fo(Commands)15 b(in)h(this)f(branc)o(h)h +(of)e(the)i Fn($if)e Fo(directiv)o(e)j(are)e(executed)h(if)g(the)f(test)g +(fails.)0 1447 y Fm(1.4)33 b(Bindable)16 b(Readline)h(Commands)0 +1681 y Fi(1.4.1)30 b(Commands)15 b(F)-5 b(or)15 b(Mo)n(ving)0 +1821 y Fn(beginning-of-line)e(\(C-a\))240 1883 y Fo(Mo)o(v)o(e)h(to)h(the)g +(start)f(of)h(the)g(curren)o(t)g(line.)0 1961 y Fn(end-of-line)f(\(C-e\))240 +2023 y Fo(Mo)o(v)o(e)g(to)h(the)g(end)h(of)f(the)g(line.)0 +2101 y Fn(forward-char)f(\(C-f\))240 2163 y Fo(Mo)o(v)o(e)g(forw)o(ard)g(a)h +(c)o(haracter.)0 2241 y Fn(backward-char)e(\(C-b\))240 2303 +y Fo(Mo)o(v)o(e)h(bac)o(k)h(a)g(c)o(haracter.)0 2381 y Fn(forward-word)f +(\(M-f\))240 2443 y Fo(Mo)o(v)o(e)g(forw)o(ard)g(to)h(the)g(end)h(of)f(the)g +(next)g(w)o(ord.)k(W)l(ords)c(are)g(comp)q(osed)h(of)e(letters)i(and)f +(digits.)0 2521 y Fn(backward-word)e(\(M-b\))240 2583 y Fo(Mo)o(v)o(e)j(bac)o +(k)g(to)g(the)h(start)f(of)g(this,)h(or)g(the)f(previous,)i(w)o(ord.)24 +b(W)l(ords)16 b(are)g(comp)q(osed)i(of)e(letters)240 2645 y(and)f(digits.)p +eop +%%Page: 9 11 +10 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227 +b(9)0 158 y Fn(clear-screen)14 b(\(C-l\))240 221 y Fo(Clear)h(the)g(screen)g +(and)g(redra)o(w)f(the)h(curren)o(t)g(line,)h(lea)o(ving)g(the)f(curren)o(t)f +(line)j(at)d(the)h(top)f(of)h(the)240 283 y(screen.)0 361 y +Fn(redraw-current-line)e(\(\))240 423 y Fo(Refresh)j(the)f(curren)o(t)g +(line.)22 b(By)15 b(default,)h(this)f(is)h(un)o(b)q(ound.)0 +663 y Fi(1.4.2)30 b(Commands)15 b(F)-5 b(or)15 b(Manipulating)g(The)g +(History)0 804 y Fn(accept-line)f(\(Newline,)g(Return\))240 +866 y Fo(Accept)g(the)f(line)i(regardless)e(of)g(where)g(the)g(cursor)g(is.) +20 b(If)13 b(this)h(line)h(is)e(non-empt)o(y)l(,)h(add)f(it)g(to)g(the)240 +928 y(history)k(list.)25 b(If)17 b(this)g(line)i(w)o(as)c(a)i(history)g +(line,)h(then)f(restore)f(the)h(history)f(line)j(to)d(its)h(original)240 +990 y(state.)0 1069 y Fn(previous-history)c(\(C-p\))240 1131 +y Fo(Mo)o(v)o(e)h(`up')h(through)g(the)g(history)g(list.)0 +1209 y Fn(next-history)f(\(C-n\))240 1272 y Fo(Mo)o(v)o(e)g(`do)o(wn')g +(through)h(the)h(history)f(list.)0 1350 y Fn(beginning-of-history)d(\(M-<\)) +240 1412 y Fo(Mo)o(v)o(e)i(to)h(the)g(\014rst)g(line)i(in)f(the)f(history)l +(.)0 1490 y Fn(end-of-history)e(\(M->\))240 1553 y Fo(Mo)o(v)o(e)h(to)h(the)g +(end)h(of)f(the)g(input)h(history)l(,)f(i.e.,)g(the)g(line)i(y)o(ou)e(are)g +(en)o(tering.)0 1631 y Fn(reverse-search-history)d(\(C-r\))240 +1693 y Fo(Searc)o(h)18 b(bac)o(kw)o(ard)f(starting)g(at)g(the)g(curren)o(t)h +(line)h(and)f(mo)o(ving)f(`up')h(through)f(the)h(history)f(as)240 +1756 y(necessary)l(.)j(This)c(is)g(an)f(incremen)o(tal)h(searc)o(h.)0 +1834 y Fn(forward-search-history)c(\(C-s\))240 1896 y Fo(Searc)o(h)j(forw)o +(ard)e(starting)h(at)g(the)g(curren)o(t)h(line)h(and)f(mo)o(ving)f(`do)o(wn') +g(through)g(the)g(the)h(history)240 1958 y(as)g(necessary)l(.)20 +b(This)c(is)g(an)f(incremen)o(tal)h(searc)o(h.)0 2037 y Fn +(non-incremental-reverse-se)o(arch-hi)o(story)c(\(M-p\))240 +2099 y Fo(Searc)o(h)18 b(bac)o(kw)o(ard)f(starting)g(at)g(the)g(curren)o(t)h +(line)h(and)f(mo)o(ving)f(`up')h(through)f(the)h(history)f(as)240 +2161 y(necessary)e(using)h(a)f(non-incremen)o(tal)i(searc)o(h)e(for)g(a)f +(string)i(supplied)h(b)o(y)e(the)h(user.)0 2239 y Fn +(non-incremental-forward-se)o(arch-hi)o(story)c(\(M-n\))240 +2302 y Fo(Searc)o(h)j(forw)o(ard)e(starting)h(at)g(the)g(curren)o(t)h(line)h +(and)f(mo)o(ving)f(`do)o(wn')g(through)g(the)g(the)h(history)240 +2364 y(as)g(necessary)g(using)h(a)f(non-incremen)o(tal)i(searc)o(h)e(for)f(a) +h(string)g(supplied)j(b)o(y)d(the)g(user.)0 2442 y Fn(history-search-forward) +d(\(\))240 2505 y Fo(Searc)o(h)h(forw)o(ard)f(through)h(the)g(history)g(for)g +(the)g(string)g(of)g(c)o(haracters)f(b)q(et)o(w)o(een)i(the)f(start)f(of)h +(the)240 2567 y(curren)o(t)j(line)i(and)e(the)h(curren)o(t)f(p)q(oin)o(t.)23 +b(This)17 b(is)f(a)g(non-incremen)o(tal)i(searc)o(h.)23 b(By)16 +b(default,)h(this)240 2629 y(command)e(is)h(un)o(b)q(ound.)p +eop +%%Page: 10 12 +11 bop 0 -83 a Fo(10)1449 b(GNU)15 b(Readline)i(Library)0 158 +y Fn(history-search-backward)12 b(\(\))240 221 y Fo(Searc)o(h)k(bac)o(kw)o +(ard)g(through)g(the)g(history)g(for)g(the)g(string)g(of)g(c)o(haracters)g(b) +q(et)o(w)o(een)g(the)g(start)f(of)240 283 y(the)i(curren)o(t)g(line)h(and)f +(the)g(curren)o(t)g(p)q(oin)o(t.)25 b(This)17 b(is)g(a)g(non-incremen)o(tal)h +(searc)o(h.)25 b(By)17 b(default,)240 345 y(this)f(command)f(is)g(un)o(b)q +(ound.)0 425 y Fn(yank-nth-arg)f(\(M-C-y\))240 487 y Fo(Insert)19 +b(the)g(\014rst)f(argumen)o(t)g(to)g(the)h(previous)g(command)g(\(usually)g +(the)g(second)g(w)o(ord)f(on)h(the)240 550 y(previous)e(line\).)23 +b(With)16 b(an)g(argumen)o(t)f Fj(n)p Fo(,)h(insert)h(the)f +Fj(n)p Fo(th)g(w)o(ord)f(from)g(the)h(previous)h(command)240 +612 y(\(the)d(w)o(ords)g(in)h(the)g(previous)g(command)f(b)q(egin)i(with)f(w) +o(ord)f(0\).)19 b(A)14 b(negativ)o(e)h(argumen)o(t)f(inserts)240 +674 y(the)h Fj(n)p Fo(th)h(w)o(ord)e(from)h(the)g(end)h(of)e(the)i(previous)g +(command.)0 754 y Fn(yank-last-arg)d(\(M-.,)i(M-_\))240 816 +y Fo(Insert)k(last)g(argumen)o(t)g(to)f(the)h(previous)h(command)f(\(the)g +(last)g(w)o(ord)f(on)h(the)g(previous)h(line\).)240 879 y(With)15 +b(an)h(argumen)o(t,)e(b)q(eha)o(v)o(e)h(exactly)h(lik)o(e)g +Fn(yank-nth-arg)p Fo(.)0 1134 y Fi(1.4.3)30 b(Commands)15 b(F)-5 +b(or)15 b(Changing)g(T)-5 b(ext)0 1276 y Fn(delete-char)14 +b(\(C-d\))240 1338 y Fo(Delete)f(the)f(c)o(haracter)f(under)i(the)f(cursor.) +19 b(If)12 b(the)g(cursor)g(is)g(at)g(the)g(b)q(eginning)i(of)e(the)g(line,)i +(there)240 1400 y(are)k(no)g(c)o(haracters)g(in)h(the)g(line,)h(and)f(the)f +(last)g(c)o(haracter)g(t)o(yp)q(ed)h(w)o(as)e(not)h(C-d,)h(then)g(return)240 +1463 y(EOF.)0 1543 y Fn(backward-delete-char)12 b(\(Rubout\))240 +1605 y Fo(Delete)g(the)f(c)o(haracter)f(b)q(ehind)j(the)e(cursor.)18 +b(A)11 b(n)o(umeric)h(arg)e(sa)o(ys)g(to)g(kill)j(the)e(c)o(haracters)f +(instead)240 1667 y(of)15 b(deleting)h(them.)0 1747 y Fn(quoted-insert)d +(\(C-q,)i(C-v\))240 1809 y Fo(Add)i(the)f(next)h(c)o(haracter)f(that)f(y)o +(ou)h(t)o(yp)q(e)h(to)f(the)g(line)i(v)o(erbatim.)24 b(This)17 +b(is)g(ho)o(w)e(to)h(insert)h(k)o(ey)240 1872 y(sequences)f(lik)o(e)h +Fn(C-Q)p Fo(,)d(for)h(example.)0 1952 y Fn(tab-insert)f(\(M-TAB\))240 +2014 y Fo(Insert)h(a)g(tab)g(c)o(haracter.)0 2094 y Fn(self-insert)f(\(a,)g +(b,)h(A,)g(1,)g(!,)g(...\))240 2156 y Fo(Insert)g(y)o(ourself.)0 +2236 y Fn(transpose-chars)e(\(C-t\))240 2298 y Fo(Drag)h(the)h(c)o(haracter)g +(b)q(efore)g(the)h(cursor)f(forw)o(ard)f(o)o(v)o(er)g(the)h(c)o(haracter)g +(at)f(the)i(cursor,)e(mo)o(ving)240 2361 y(the)k(cursor)h(forw)o(ard)e(as)h +(w)o(ell.)30 b(If)19 b(the)f(insertion)i(p)q(oin)o(t)f(is)g(at)e(the)i(end)g +(of)f(the)g(line,)j(then)e(this)240 2423 y(transp)q(oses)c(the)g(last)g(t)o +(w)o(o)f(c)o(haracters)h(of)f(the)i(line.)21 b(Negativ)o(e)15 +b(argumen)o(tss)f(don't)h(w)o(ork.)0 2503 y Fn(transpose-words)e(\(M-t\))240 +2565 y Fo(Drag)f(the)h(w)o(ord)f(b)q(ehind)i(the)f(cursor)g(past)f(the)h(w)o +(ord)f(in)h(fron)o(t)f(of)h(the)f(cursor)h(mo)o(ving)f(the)h(cursor)240 +2627 y(o)o(v)o(er)h(that)h(w)o(ord)f(as)h(w)o(ell.)p eop +%%Page: 11 13 +12 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1205 +b(11)0 158 y Fn(upcase-word)14 b(\(M-u\))240 221 y Fo(Upp)q(ercase)h(the)e +(curren)o(t)h(\(or)f(follo)o(wing\))h(w)o(ord.)k(With)c(a)f(negativ)o(e)h +(argumen)o(t,)f(do)g(the)h(previous)240 283 y(w)o(ord,)g(but)h(do)h(not)e(mo) +o(v)o(e)h(the)g(cursor.)0 358 y Fn(downcase-word)e(\(M-l\))240 +420 y Fo(Lo)o(w)o(ercase)g(the)i(curren)o(t)f(\(or)f(follo)o(wing\))h(w)o +(ord.)19 b(With)14 b(a)g(negativ)o(e)g(argumen)o(t,)f(do)h(the)g(previous)240 +482 y(w)o(ord,)g(but)h(do)h(not)e(mo)o(v)o(e)h(the)g(cursor.)0 +557 y Fn(capitalize-word)e(\(M-c\))240 619 y Fo(Capitalize)j(the)e(curren)o +(t)g(\(or)f(follo)o(wing\))i(w)o(ord.)j(With)d(a)f(negativ)o(e)g(argumen)o +(t,)f(do)h(the)g(previous)240 682 y(w)o(ord,)g(but)h(do)h(not)e(mo)o(v)o(e)h +(the)g(cursor.)0 891 y Fi(1.4.4)30 b(Killing)15 b(And)h(Y)-5 +b(anking)0 1028 y Fn(kill-line)14 b(\(C-k\))240 1090 y Fo(Kill)j(the)f(text)e +(from)h(the)g(curren)o(t)g(cursor)g(p)q(osition)h(to)f(the)g(end)h(of)f(the)g +(line.)0 1165 y Fn(backward-kill-line)e(\(C-x)h(Rubout\))240 +1228 y Fo(Kill)j(bac)o(kw)o(ard)e(to)f(the)i(b)q(eginning)h(of)e(the)g(line.) +0 1302 y Fn(unix-line-discard)e(\(C-u\))240 1365 y Fo(Kill)j(bac)o(kw)o(ard)d +(from)f(the)i(cursor)f(to)g(the)h(b)q(eginning)i(of)d(the)g(curren)o(t)h +(line.)21 b(Sa)o(v)o(e)13 b(the)h(killed)h(text)240 1427 y(on)g(the)g +(kill-ring.)0 1502 y Fn(kill-whole-line)e(\(\))240 1564 y Fo(Kill)18 +b(all)f(c)o(haracters)e(on)h(the)g(curren)o(t)f(line,)j(no)e(matter)e(where)i +(the)g(cursor)g(is.)22 b(By)16 b(default,)h(this)240 1626 y(is)f(un)o(b)q +(ound.)0 1701 y Fn(kill-word)e(\(M-d\))240 1764 y Fo(Kill)j(from)d(the)h +(cursor)g(to)f(the)h(end)g(of)g(the)g(curren)o(t)f(w)o(ord,)g(or)g(if)i(b)q +(et)o(w)o(een)f(w)o(ords,)f(to)g(the)h(end)g(of)240 1826 y(the)g(next)h(w)o +(ord.)j(W)l(ord)c(b)q(oundaries)h(are)f(the)g(same)g(as)g Fn(forward-word)p +Fo(.)0 1901 y Fn(backward-kill-word)e(\(M-DEL\))240 1963 y +Fo(Kill)k(the)f(w)o(ord)e(b)q(ehind)j(the)f(cursor.)j(W)l(ord)c(b)q +(oundaries)i(are)d(the)i(same)f(as)f Fn(backward-word)p Fo(.)0 +2038 y Fn(unix-word-rubout)f(\(C-w\))240 2100 y Fo(Kill)i(the)e(w)o(ord)f(b)q +(ehind)j(the)f(cursor,)e(using)i(white)f(space)h(as)e(a)h(w)o(ord)f(b)q +(oundary)l(.)20 b(The)13 b(killed)i(text)240 2162 y(is)h(sa)o(v)o(ed)e(on)i +(the)f(kill-ring.)0 2237 y Fn(delete-horizontal-space)d(\(\))240 +2300 y Fo(Delete)k(all)g(spaces)f(and)h(tabs)e(around)i(p)q(oin)o(t.)k(By)15 +b(default,)h(this)f(is)h(un)o(b)q(ound.)0 2375 y Fn(yank)f(\(C-y\))240 +2437 y Fo(Y)l(ank)g(the)h(top)f(of)f(the)i(kill)h(ring)e(in)o(to)g(the)h +(bu\013er)f(at)f(the)i(curren)o(t)f(cursor)g(p)q(osition.)0 +2512 y Fn(yank-pop)f(\(M-y\))240 2574 y Fo(Rotate)f(the)h(kill-ring,)i(and)e +(y)o(ank)g(the)g(new)g(top.)19 b(Y)l(ou)14 b(can)g(only)g(do)g(this)g(if)g +(the)g(prior)g(command)240 2636 y(is)i(y)o(ank)f(or)f(y)o(ank-p)q(op.)p +eop +%%Page: 12 14 +13 bop 0 -83 a Fo(12)1449 b(GNU)15 b(Readline)i(Library)0 158 +y Fi(1.4.5)30 b(Sp)r(ecifying)15 b(Numeric)h(Argumen)n(ts)0 +301 y Fn(digit-argument)d(\(M-0,)i(M-1,)f(...)h(M--\))240 364 +y Fo(Add)k(this)f(digit)h(to)f(the)g(argumen)o(t)f(already)i(accum)o +(ulating,)g(or)f(start)f(a)g(new)i(argumen)o(t.)28 b(M{)240 +426 y(starts)14 b(a)h(negativ)o(e)g(argumen)o(t.)0 507 y Fn +(universal-argument)e(\(\))240 569 y Fo(Eac)o(h)k(time)h(this)g(is)f +(executed,)i(the)e(argumen)o(t)g(coun)o(t)g(is)h(m)o(ultiplied)i(b)o(y)d +(four.)26 b(The)18 b(argumen)o(t)240 631 y(coun)o(t)i(is)h(initially)j(one,)d +(so)f(executing)i(this)f(function)g(the)g(\014rst)f(time)h(mak)o(es)f(the)h +(argumen)o(t)240 693 y(coun)o(t)15 b(four.)20 b(By)15 b(default,)g(this)h(is) +g(not)e(b)q(ound)j(to)d(a)h(k)o(ey)l(.)0 956 y Fi(1.4.6)30 +b(Letting)14 b(Readline)h(T)n(yp)r(e)h(F)-5 b(or)14 b(Y)-5 +b(ou)0 1099 y Fn(complete)14 b(\(TAB\))240 1161 y Fo(A)o(ttempt)i(to)h(do)g +(completion)i(on)e(the)g(text)g(b)q(efore)h(the)f(cursor.)26 +b(This)18 b(is)g(application-sp)q(eci\014c.)240 1223 y(Generally)l(,)h(if)f +(y)o(ou)f(are)h(t)o(yping)g(a)f(\014lename)i(argumen)o(t,)e(y)o(ou)g(can)h +(do)f(\014lename)i(completion;)g(if)240 1285 y(y)o(ou)f(are)f(t)o(yping)i(a)e +(command,)i(y)o(ou)e(can)i(do)f(command)g(completion,)h(if)g(y)o(ou)e(are)h +(t)o(yping)g(in)h(a)240 1348 y(sym)o(b)q(ol)e(to)f(GDB,)g(y)o(ou)g(can)h(do)g +(sym)o(b)q(ol)g(name)g(completion,)h(if)f(y)o(ou)f(are)h(t)o(yping)g(in)g(a)g +(v)m(ariable)240 1410 y(to)e(Bash,)f(y)o(ou)h(can)h(do)f(v)m(ariable)h(name)g +(completion,)g(and)f(so)g(on.)0 1491 y Fn(possible-completions)d(\(M-?\))240 +1553 y Fo(List)k(the)f(p)q(ossible)i(completions)f(of)f(the)g(text)g(b)q +(efore)h(the)f(cursor.)0 1634 y Fn(insert-completions)e(\(\))240 +1696 y Fo(Insert)22 b(all)h(completions)g(of)f(the)g(text)f(b)q(efore)h(p)q +(oin)o(t)h(that)e(w)o(ould)h(ha)o(v)o(e)g(b)q(een)h(generated)f(b)o(y)240 +1758 y Fn(possible-completions)p Fo(.)17 b(By)e(default,)h(this)f(is)h(not)f +(b)q(ound)h(to)f(a)g(k)o(ey)l(.)0 2020 y Fi(1.4.7)30 b(Keyb)r(oard)15 +b(Macros)0 2163 y Fn(start-kbd-macro)e(\(C-x)i(\(\))240 2226 +y Fo(Begin)h(sa)o(ving)f(the)h(c)o(haracters)e(t)o(yp)q(ed)i(in)o(to)f(the)g +(curren)o(t)g(k)o(eyb)q(oard)g(macro.)0 2306 y Fn(end-kbd-macro)e(\(C-x)i +(\)\))240 2369 y Fo(Stop)f(sa)o(ving)h(the)g(c)o(haracters)f(t)o(yp)q(ed)h +(in)o(to)f(the)h(curren)o(t)f(k)o(eyb)q(oard)h(macro)f(and)h(sa)o(v)o(e)f +(the)g(de\014ni-)240 2431 y(tion.)0 2512 y Fn(call-last-kbd-macro)f(\(C-x)h +(e\))240 2574 y Fo(Re-execute)20 b(the)f(last)f(k)o(eyb)q(oard)g(macro)g +(de\014ned,)i(b)o(y)f(making)f(the)h(c)o(haracters)f(in)h(the)g(macro)240 +2636 y(app)q(ear)c(as)g(if)h(t)o(yp)q(ed)f(at)g(the)g(k)o(eyb)q(oard.)p +eop +%%Page: 13 15 +14 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1205 +b(13)0 158 y Fi(1.4.8)30 b(Some)15 b(Miscellaneous)h(Commands)0 +299 y Fn(re-read-init-file)d(\(C-x)h(C-r\))240 361 y Fo(Read)i(in)g(the)f +(con)o(ten)o(ts)f(of)h(y)o(our)g(init)h(\014le,)g(and)f(incorp)q(orate)h(an)o +(y)e(bindings)j(or)e(v)m(ariable)i(assign-)240 423 y(men)o(ts)e(found)g +(there.)0 502 y Fn(abort)f(\(C-g\))240 564 y Fo(Ab)q(ort)f(the)h(curren)o(t)f +(editing)i(command)e(and)h(ring)g(the)f(terminal's)h(b)q(ell)h(\(sub)s(ject)f +(to)e(the)i(setting)240 626 y(of)h Fn(bell-style)p Fo(\).)0 +704 y Fn(do-uppercase-version)d(\(M-a,)j(M-b,)f(...\))240 767 +y Fo(Run)i(the)f(command)g(that)g(is)h(b)q(ound)g(to)e(the)i(corresop)q +(onding)g(upp)q(ercase)g(c)o(haracter.)0 845 y Fn(prefix-meta)e(\(ESC\))240 +907 y Fo(Mak)o(e)g(the)g(next)h(c)o(haracter)f(that)g(y)o(ou)g(t)o(yp)q(e)h +(b)q(e)g(meta\014ed.)20 b(This)15 b(is)g(for)f(p)q(eople)i(without)e(a)h +(meta)240 970 y(k)o(ey)l(.)20 b(T)o(yping)c(`)p Fn(ESC)e(f)p +Fo(')h(is)g(equiv)m(alen)o(t)i(to)e(t)o(yping)g(`)p Fn(M-f)p +Fo('.)0 1048 y Fn(undo)g(\(C-_,)f(C-x)h(C-u\))240 1110 y Fo(Incremen)o(tal)h +(undo,)f(separately)h(remem)o(b)q(ered)g(for)e(eac)o(h)h(line.)0 +1188 y Fn(revert-line)f(\(M-r\))240 1251 y Fo(Undo)20 b(all)h(c)o(hanges)f +(made)g(to)f(this)i(line.)35 b(This)21 b(is)f(lik)o(e)h(t)o(yping)f(the)g +Fn(undo)g Fo(command)g(enough)240 1313 y(times)15 b(to)g(get)g(bac)o(k)g(to)f +(the)i(b)q(eginning.)0 1391 y Fn(tilde-expand)e(\(M-~\))240 +1453 y Fo(P)o(erform)g(tilde)j(expansion)f(on)f(the)g(curren)o(t)g(w)o(ord.)0 +1532 y Fn(dump-functions)e(\(\))240 1594 y Fo(Prin)o(t)18 b(all)h(of)f(the)g +(functions)h(and)g(their)g(k)o(ey)f(bindings)i(to)d(the)i(readline)h(output)e +(stream.)28 b(If)18 b(a)240 1656 y(n)o(umeric)i(argumen)o(t)d(is)i(supplied,) +j(the)d(output)f(is)h(formatted)f(in)h(suc)o(h)g(a)f(w)o(a)o(y)g(that)g(it)h +(can)f(b)q(e)240 1718 y(made)d(part)g(of)g(an)g Fj(inputrc)k +Fo(\014le.)0 1974 y Fm(1.5)33 b(Readline)16 b(vi)g(Mo)r(de)62 +2115 y Fo(While)d(the)f(Readline)i(library)e(do)q(es)g(not)g(ha)o(v)o(e)f(a)g +(full)i(set)f(of)f Fn(vi)g Fo(editing)i(functions,)g(it)f(do)q(es)g(con)o +(tain)g(enough)0 2177 y(to)i(allo)o(w)h(simple)i(editing)f(of)f(the)g(line.) +21 b(The)15 b(Readline)i Fn(vi)e Fo(mo)q(de)g(b)q(eha)o(v)o(es)h(as)e(sp)q +(eci\014ed)j(in)f(the)f(P)o(osix)g(1003.2)0 2240 y(standard.)62 +2380 y(In)i(order)e(to)g(switc)o(h)h(in)o(teractiv)o(ely)h(b)q(et)o(w)o(een)f +Fn(Emacs)f Fo(and)h Fn(Vi)f Fo(editing)i(mo)q(des,)f(use)g(the)g(command)f +(M-C-j)0 2442 y(\(toggle-editing-mo)q(de\).)21 b(The)15 b(Readline)j(default) +e(is)f Fn(emacs)g Fo(mo)q(de.)62 2583 y(When)k(y)o(ou)f(en)o(ter)g(a)g(line)i +(in)g Fn(vi)e Fo(mo)q(de,)h(y)o(ou)f(are)g(already)g(placed)i(in)f +(`insertion')g(mo)q(de,)g(as)f(if)h(y)o(ou)f(had)0 2645 y(t)o(yp)q(ed)e(an)f +(`)p Fn(i)p Fo('.)20 b(Pressing)c Fn(ESC)f Fo(switc)o(hes)h(y)o(ou)f(in)o(to) +h(`command')f(mo)q(de,)g(where)h(y)o(ou)f(can)h(edit)g(the)g(text)f(of)g(the) +p eop +%%Page: 14 16 +15 bop 0 -83 a Fo(14)1449 b(GNU)15 b(Readline)i(Library)0 158 +y(line)j(with)e(the)g(standard)g Fn(vi)f Fo(mo)o(v)o(emen)o(t)g(k)o(eys,)h +(mo)o(v)o(e)g(to)f(previous)i(history)f(lines)h(with)g(`)p +Fn(k)p Fo(',)e(and)h(follo)o(wing)0 221 y(lines)f(with)e(`)p +Fn(j)p Fo(',)f(and)i(so)e(forth.)p eop +%%Page: 15 17 +16 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(15)0 158 y Fk(2)41 b(Programming)16 b(with)f(GNU)h(Readline)62 +370 y Fo(This)j(c)o(hapter)f(describ)q(es)i(the)e(in)o(terface)g(b)q(et)o(w)o +(een)h(the)f(GNU)g(Readline)j(Library)d(and)h(other)f(programs.)0 +433 y(If)h(y)o(ou)g(are)f(a)h(programmer,)f(and)i(y)o(ou)e(wish)i(to)e +(include)j(the)e(features)g(found)g(in)h(GNU)f(Readline)i(suc)o(h)e(as)0 +495 y(completion,)f(line)h(editing,)f(and)f(in)o(teractiv)o(e)h(history)f +(manipulation)h(in)g(y)o(our)f(o)o(wn)f(programs,)g(this)h(section)0 +557 y(is)f(for)e(y)o(ou.)0 826 y Fm(2.1)33 b(Basic)14 b(Beha)n(vior)62 +968 y Fo(Man)o(y)c(programs)g(pro)o(vide)h(a)g(command)f(line)j(in)o +(terface,)e(suc)o(h)g(as)g Fn(mail)p Fo(,)f Fn(ftp)p Fo(,)h(and)g +Fn(sh)p Fo(.)18 b(F)l(or)10 b(suc)o(h)i(programs,)0 1031 y(the)17 +b(default)h(b)q(eha)o(viour)g(of)e(Readline)k(is)e(su\016cien)o(t.)26 +b(This)18 b(section)f(describ)q(es)i(ho)o(w)e(to)f(use)i(Readline)h(in)f(the) +0 1093 y(simplest)e(w)o(a)o(y)e(p)q(ossible,)j(p)q(erhaps)f(to)e(replace)j +(calls)f(in)g(y)o(our)f(co)q(de)g(to)g Fn(gets\(\))f Fo(or)h +Fn(fgets)f(\(\))p Fo(.)62 1235 y(The)g(function)g Fn(readline)g(\(\))f +Fo(prin)o(ts)h(a)f(prompt)g(and)h(then)g(reads)f(and)g(returns)h(a)f(single)i +(line)g(of)e(text)g(from)0 1297 y(the)g(user.)19 b(The)13 b(line)i +Fn(readline)d Fo(returns)g(is)i(allo)q(cated)g(with)f Fn(malloc)h(\(\))p +Fo(;)f(y)o(ou)g(should)h Fn(free)g(\(\))f Fo(the)g(line)h(when)0 +1360 y(y)o(ou)h(are)g(done)g(with)h(it.)k(The)15 b(declaration)h(for)f +Fn(readline)f Fo(in)i(ANSI)g(C)f(is)120 1489 y Fn(char)23 b(*readline)g +(\(char)g(*)p Fj(prompt)q Fn(\);)0 1631 y Fo(So,)15 b(one)g(migh)o(t)g(sa)o +(y)120 1761 y Fn(char)23 b(*line)g(=)h(readline)f(\("Enter)g(a)h(line:)f +("\);)0 1903 y Fo(in)17 b(order)g(to)f(read)g(a)g(line)j(of)d(text)g(from)g +(the)g(user.)24 b(The)17 b(line)h(returned)f(has)g(the)f(\014nal)i(newline)g +(remo)o(v)o(ed,)e(so)0 1965 y(only)g(the)f(text)g(remains.)62 +2107 y(If)g Fn(readline)f Fo(encoun)o(ters)h(an)f Fn(EOF)h +Fo(while)h(reading)f(the)g(line,)h(and)f(the)g(line)h(is)f(empt)o(y)g(at)f +(that)g(p)q(oin)o(t,)h(then)0 2169 y Fn(\(char)f(*\)NULL)h +Fo(is)h(returned.)k(Otherwise,)15 b(the)h(line)h(is)e(ended)i(just)d(as)h(if) +h(a)f(newline)i(had)e(b)q(een)i(t)o(yp)q(ed.)62 2311 y(If)g(y)o(ou)g(w)o(an)o +(t)f(the)h(user)g(to)f(b)q(e)i(able)f(to)g(get)f(at)g(the)h(line)i(later,)e +(\(with)g Fn(C-P)f Fo(for)g(example\),)i(y)o(ou)e(m)o(ust)h(call)0 +2374 y Fn(add_history)d(\(\))h Fo(to)f(sa)o(v)o(e)h(the)g(line)i(a)o(w)o(a)o +(y)c(in)j(a)f Fj(history)k Fo(list)d(of)f(suc)o(h)h(lines.)120 +2503 y Fn(add_history)22 b(\(line\);)0 2645 y Fo(F)l(or)15 +b(full)h(details)g(on)f(the)h(GNU)f(History)g(Library)l(,)g(see)h(the)f(asso) +q(ciated)g(man)o(ual.)p eop +%%Page: 16 18 +17 bop 0 -83 a Fo(16)1449 b(GNU)15 b(Readline)i(Library)62 +158 y(It)e(is)g(preferable)g(to)f(a)o(v)o(oid)g(sa)o(ving)h(empt)o(y)f(lines) +i(on)f(the)f(history)h(list,)g(since)g(users)g(rarely)g(ha)o(v)o(e)f(a)g +(burning)0 221 y(need)i(to)e(reuse)h(a)f(blank)i(line.)21 b(Here)15 +b(is)g(a)g(function)g(whic)o(h)h(usefully)g(replaces)g(the)f(standard)f +Fn(gets)h(\(\))f Fo(library)0 283 y(function,)i(and)f(has)g(the)g(adv)m(an)o +(tage)g(of)g(no)g(static)g(bu\013er)g(to)g(o)o(v)o(er\015o)o(w:)120 +428 y Fn(/*)24 b(A)f(static)g(variable)g(for)h(holding)e(the)i(line.)f(*/)120 +477 y(static)g(char)g(*line_read)g(=)h(\(char)f(*\)NULL;)120 +577 y(/*)h(Read)f(a)h(string,)f(and)g(return)g(a)h(pointer)f(to)g(it.)48 +b(Returns)22 b(NULL)i(on)f(EOF.)h(*/)120 627 y(char)f(*)120 +677 y(rl_gets)g(\(\))120 726 y({)168 776 y(/*)g(If)h(the)f(buffer)g(has)h +(already)f(been)g(allocated,)g(return)g(the)g(memory)239 826 +y(to)h(the)f(free)h(pool.)f(*/)168 876 y(if)g(\(line_read\))215 +926 y({)263 975 y(free)g(\(line_read\);)263 1025 y(line_read)g(=)h(\(char)f +(*\)NULL;)215 1075 y(})168 1175 y(/*)g(Get)h(a)f(line)h(from)f(the)h(user.)f +(*/)168 1225 y(line_read)f(=)i(readline)f(\(""\);)168 1324 +y(/*)g(If)h(the)f(line)h(has)f(any)h(text)f(in)g(it,)h(save)f(it)h(on)f(the)h +(history.)f(*/)168 1374 y(if)g(\(line_read)g(&&)g(*line_read\))215 +1424 y(add_history)g(\(line_read\);)168 1523 y(return)g(\(line_read\);)120 +1573 y(})62 1730 y Fo(This)15 b(function)g(giv)o(es)f(the)g(user)g(the)g +(default)h(b)q(eha)o(viour)g(of)e Fn(TAB)h Fo(completion:)20 +b(completion)15 b(on)f(\014le)h(names.)0 1793 y(If)h(y)o(ou)f(do)h(not)f(w)o +(an)o(t)g(Readline)j(to)d(complete)i(on)e(\014lenames,)i(y)o(ou)e(can)h(c)o +(hange)g(the)g(binding)i(of)d(the)h Fn(TAB)f Fo(k)o(ey)0 1855 +y(with)h Fn(rl_bind_key)d(\(\))p Fo(.)120 1999 y Fn(int)23 +b(rl_bind_key)g(\(int)g Fj(k)o(ey)p Fn(,)h(int)f(\(*)p Fj(function)p +Fn(\)\(\)\);)62 2157 y(rl_bind_key)14 b(\(\))f Fo(tak)o(es)g(t)o(w)o(o)f +(argumen)o(ts:)19 b Fj(k)o(ey)e Fo(is)d(the)g(c)o(haracter)f(that)g(y)o(ou)g +(w)o(an)o(t)f(to)h(bind,)i(and)f Fj(function)0 2219 y Fo(is)g(the)g(address)g +(of)f(the)h(function)g(to)f(call)i(when)f Fj(k)o(ey)j Fo(is)d(pressed.)20 +b(Binding)c Fn(TAB)d Fo(to)g Fn(rl_insert)h(\(\))f Fo(mak)o(es)g +Fn(TAB)0 2281 y Fo(insert)i(itself.)20 b Fn(rl_bind_key)14 +b(\(\))g Fo(returns)g(non-zero)h(if)g Fj(k)o(ey)j Fo(is)d(not)f(a)g(v)m(alid) +i(ASCI)q(I)f(c)o(haracter)f(co)q(de)h(\(b)q(et)o(w)o(een)0 +2343 y(0)g(and)g(255\).)62 2500 y(Th)o(us,)g(to)g(disable)h(the)g(default)f +Fn(TAB)g Fo(b)q(eha)o(vior,)h(the)f(follo)o(wing)h(su\016ces:)120 +2645 y Fn(rl_bind_key)22 b(\('\\t',)h(rl_insert\);)p eop +%%Page: 17 19 +18 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(17)62 158 y(This)12 b(co)q(de)f(should)h(b)q(e)f(executed)h(once)f(at)f +(the)h(start)f(of)g(y)o(our)g(program;)h(y)o(ou)g(migh)o(t)f(write)h(a)g +(function)g(called)0 221 y Fn(initialize_readline)i(\(\))j +Fo(whic)o(h)h(p)q(erforms)f(this)h(and)f(other)g(desired)i(initializations,)h +(suc)o(h)e(as)f(installing)0 283 y(custom)f(completers)g(\(see)h(Section)g +(2.4)e([Custom)g(Completers],)h(page)g(28\).)0 539 y Fm(2.2)33 +b(Custom)14 b(F)-6 b(unctions)62 680 y Fo(Readline)18 b(pro)o(vides)f(man)o +(y)e(functions)i(for)e(manipulating)j(the)e(text)f(of)g(the)h(line,)i(but)e +(it)g(isn't)g(p)q(ossible)i(to)0 742 y(an)o(ticipate)i(the)g(needs)g(of)f +(all)h(programs.)31 b(This)20 b(section)g(describ)q(es)h(the)f(v)m(arious)g +(functions)g(and)g(v)m(ariables)0 804 y(de\014ned)c(within)f(the)g(Readline)i +(library)e(whic)o(h)g(allo)o(w)g(a)f(user)g(program)f(to)h(add)h(customized)g +(functionalit)o(y)h(to)0 866 y(Readline.)0 1106 y Fi(2.2.1)30 +b(The)15 b(F)-5 b(unction)14 b(T)n(yp)r(e)62 1247 y Fo(F)l(or)j(readabilt)o +(y)l(,)h(w)o(e)f(declare)i(a)e(new)g(t)o(yp)q(e)h(of)f(ob)s(ject,)f(called)j +Fj(F)l(unction)p Fo(.)28 b(A)17 b Fn(Function)f Fo(is)i(a)f(C)g(function)0 +1309 y(whic)o(h)f(returns)f(an)g Fn(int)p Fo(.)20 b(The)15 +b(t)o(yp)q(e)g(declaration)h(for)f Fn(Function)f Fo(is:)0 1450 +y Fn(typedef)g(int)h(Function)f(\(\);)62 1590 y Fo(The)i(reason)f(for)g +(declaring)i(this)f(new)g(t)o(yp)q(e)f(is)h(to)f(mak)o(e)g(it)h(easier)g(to)f +(write)g(co)q(de)h(describing)i(p)q(oin)o(ters)e(to)0 1652 +y(C)g(functions.)25 b(Let)17 b(us)f(sa)o(y)g(w)o(e)g(had)h(a)f(v)m(ariable)i +(called)g Fj(func)i Fo(whic)o(h)d(w)o(as)f(a)g(p)q(oin)o(ter)h(to)f(a)g +(function.)25 b(Instead)0 1715 y(of)15 b(the)g(classic)h(C)f(declaration)62 +1855 y Fn(int)g(\(*\)\(\)func;)0 1996 y Fo(w)o(e)g(ma)o(y)f(write)62 +2136 y Fn(Function)g(*func;)0 2277 y Fo(Similarly)l(,)j(there)e(are)120 +2405 y Fn(typedef)23 b(void)g(VFunction)g(\(\);)120 2455 y(typedef)g(char)g +(*CPFunction)g(\(\);)g Fo(and)120 2505 y Fn(typedef)g(char)g(**CPPFunction)f +(\(\);)0 2645 y Fo(for)12 b(functions)h(returning)g(no)g(v)m(alue,)g +Fn(pointer)i(to)g(char)p Fo(,)d(and)g Fn(pointer)i(to)h(pointer)g(to)f(char)p +Fo(,)e(resp)q(ectiv)o(ely)l(.)p eop +%%Page: 18 20 +19 bop 0 -83 a Fo(18)1449 b(GNU)15 b(Readline)i(Library)0 158 +y Fi(2.2.2)30 b(W)-5 b(riting)15 b(a)g(New)g(F)-5 b(unction)62 +296 y Fo(In)22 b(order)f(to)g(write)g(new)h(functions)g(for)f(Readline,)j(y)o +(ou)d(need)h(to)f(kno)o(w)g(the)g(calling)i(con)o(v)o(en)o(tions)f(for)0 +358 y(k)o(eyb)q(oard-in)o(v)o(ok)o(ed)17 b(functions,)g(and)f(the)h(names)f +(of)g(the)h(v)m(ariables)h(that)d(describ)q(e)j(the)f(curren)o(t)f(state)g +(of)g(the)0 420 y(line)h(read)e(so)g(far.)62 558 y(The)h(calling)h(sequence)f +(for)f(a)f(command)i Fn(foo)e Fo(lo)q(oks)i(lik)o(e)120 683 +y Fn(foo)23 b(\(int)h(count,)f(int)g(key\))0 820 y Fo(where)f +Fj(coun)o(t)g Fo(is)g(the)f(n)o(umeric)i(argumen)o(t)d(\(or)h(1)g(if)h +(defaulted\))g(and)f Fj(k)o(ey)26 b Fo(is)21 b(the)h(k)o(ey)f(that)g(in)o(v)o +(ok)o(ed)h(this)0 882 y(function.)62 1020 y(It)f(is)h(completely)g(up)f(to)f +(the)h(function)h(as)f(to)f(what)g(should)i(b)q(e)g(done)f(with)g(the)g(n)o +(umeric)h(argumen)o(t.)0 1082 y(Some)c(functions)g(use)g(it)g(as)f(a)h(rep)q +(eat)g(coun)o(t,)f(some)h(as)f(a)g(\015ag,)h(and)g(others)f(to)g(c)o(ho)q +(ose)h(alternate)f(b)q(eha)o(vior)0 1144 y(\(refreshing)12 +b(the)g(curren)o(t)g(line)h(as)f(opp)q(osed)g(to)f(refreshing)i(the)f +(screen,)g(for)g(example\).)19 b(Some)12 b(c)o(ho)q(ose)f(to)h(ignore)0 +1207 y(it.)24 b(In)17 b(general,)g(if)g(a)g(function)g(uses)g(the)g(n)o +(umeric)g(argumen)o(t)f(as)g(a)g(rep)q(eat)h(coun)o(t,)f(it)h(should)h(b)q(e) +f(able)g(to)f(do)0 1269 y(something)f(useful)g(with)g(b)q(oth)f(negativ)o(e)h +(and)f(p)q(ositiv)o(e)i(argumen)o(ts.)i(A)o(t)c(the)h(v)o(ery)f(least,)g(it)h +(should)g(b)q(e)g(a)o(w)o(are)0 1331 y(that)f(it)i(can)f(b)q(e)h(passed)g(a)e +(negativ)o(e)i(argumen)o(t.)1736 1494 y(V)l(ariable)-1899 b +Fh(char)20 b(*)f Fg(rl)p 211 1494 18 3 v 21 w(line)p 320 1494 +V 23 w(bu\013er)120 1557 y Fo(This)f(is)g(the)f(line)i(gathered)e(so)g(far.) +25 b(Y)l(ou)18 b(are)f(w)o(elcome)g(to)g(mo)q(dify)h(the)f(con)o(ten)o(ts)g +(of)f(the)i(line,)120 1619 y(but)d(see)h(Section)g(2.3.5)d([Allo)o(wing)k +(Undoing],)e(page)g(23.)1736 1782 y(V)l(ariable)-1899 b Fh(int)20 +b Fg(rl)p 140 1782 V 21 w(p)r(oin)n(t)120 1844 y Fo(The)15 +b(o\013set)g(of)f(the)i(curren)o(t)f(cursor)g(p)q(osition)h(in)g +Fn(rl_line_buffer)d Fo(\(the)i Fj(p)q(oin)o(t)q Fo(\).)1736 +2007 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 2007 V 21 +w(end)120 2070 y Fo(The)d(n)o(um)o(b)q(er)f(of)g(c)o(haracters)g(presen)o(t)g +(in)h Fn(rl_line_buffer)p Fo(.)k(When)c Fn(rl_point)e Fo(is)i(at)f(the)g(end) +120 2132 y(of)f(the)g(line,)i Fn(rl_point)d Fo(and)h Fn(rl_end)f +Fo(are)h(equal.)1736 2295 y(V)l(ariable)-1899 b Fh(int)20 b +Fg(rl)p 140 2295 V 21 w(mark)120 2357 y Fo(The)h(mark)e(\(sa)o(v)o(ed)h(p)q +(osition\))h(in)g(the)f(curren)o(t)h(line.)37 b(If)20 b(set,)h(the)g(mark)e +(and)i(p)q(oin)o(t)g(de\014ne)g(a)120 2420 y Fj(region)p Fo(.)1736 +2583 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 2583 V 21 +w(done)120 2645 y Fo(Setting)13 b(this)h(to)f(a)f(non-zero)i(v)m(alue)g +(causes)f(Readline)j(to)c(return)h(the)h(curren)o(t)f(line)h(immediately)l(.) +p eop +%%Page: 19 21 +20 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(19)1736 158 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 +158 18 3 v 21 w(p)r(ending)p 361 158 V 20 w(input)120 221 y +Fo(Setting)15 b(this)f(to)g(a)g(v)m(alue)i(mak)o(es)d(it)i(the)f(next)h(k)o +(eystrok)o(e)e(read.)19 b(This)c(is)g(a)f(w)o(a)o(y)f(to)h(stu\013)g(a)g +(single)120 283 y(c)o(haracter)g(in)o(to)i(the)f(input)h(stream.)1736 +451 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p 211 451 +V 21 w(prompt)120 513 y Fo(The)c(prompt)e(Readline)k(uses.)j(This)15 +b(is)f(set)h(from)e(the)h(argumen)o(t)g(to)g Fn(readline)g(\(\))p +Fo(,)f(and)i(should)120 575 y(not)g(b)q(e)h(assigned)f(to)g(directly)l(.)1736 +743 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p 211 743 +V 21 w(terminal)p 443 743 V 21 w(name)120 806 y Fo(The)c(terminal)h(t)o(yp)q +(e,)f(used)h(for)f(initialization.)1736 974 y(V)l(ariable)-1899 +b Fh(char)20 b(*)f Fg(rl)p 211 974 V 21 w(readline)p 430 974 +V 22 w(name)120 1036 y Fo(This)f(v)m(ariable)h(is)f(set)f(to)g(a)g(unique)i +(name)f(b)o(y)f(eac)o(h)h(application)h(using)f(Readline.)29 +b(The)18 b(v)m(alue)120 1098 y(allo)o(ws)f(conditional)h(parsing)f(of)f(the)g +(inputrc)i(\014le)f(\(see)g(Section)g(1.3.2)e([Conditional)j(Init)f(Con-)120 +1160 y(structs],)d(page)h(7\).)1736 1328 y(V)l(ariable)-1899 +b Fh(FILE)20 b(*)f Fg(rl)p 211 1328 V 21 w(instream)120 1391 +y Fo(The)c(stdio)h(stream)e(from)h(whic)o(h)h(Readline)h(reads)e(input.)1736 +1559 y(V)l(ariable)-1899 b Fh(FILE)20 b(*)f Fg(rl)p 211 1559 +V 21 w(outstream)120 1621 y Fo(The)c(stdio)h(stream)e(to)h(whic)o(h)h +(Readline)h(p)q(erforms)e(output.)1736 1789 y(V)l(ariable)-1899 +b Fh(Function)20 b(*)g Fg(rl)p 316 1789 V 21 w(startup)p 520 +1789 V 20 w(ho)r(ok)120 1851 y Fo(If)13 b(non-zero,)h(this)f(is)h(the)f +(address)g(of)g(a)f(function)i(to)f(call)h(just)f(b)q(efore)g +Fn(readline)f Fo(prin)o(ts)h(the)g(\014rst)120 1913 y(prompt.)0 +2156 y Fm(2.3)33 b(Readline)16 b(Con)n(v)n(enience)g(F)-6 b(unctions)0 +2382 y Fi(2.3.1)30 b(Naming)15 b(a)g(F)-5 b(unction)62 2521 +y Fo(The)19 b(user)f(can)g(dynamically)i(c)o(hange)e(the)g(bindings)i(of)e(k) +o(eys)f(while)j(using)f(Readline.)30 b(This)19 b(is)g(done)f(b)o(y)0 +2583 y(represen)o(ting)f(the)g(function)h(with)f(a)g(descriptiv)o(e)h(name.) +25 b(The)17 b(user)g(is)g(able)h(to)e(t)o(yp)q(e)h(the)g(descriptiv)o(e)h +(name)0 2645 y(when)e(referring)f(to)g(the)g(function.)21 b(Th)o(us,)14 +b(in)j(an)e(init)h(\014le,)g(one)f(migh)o(t)g(\014nd)p eop +%%Page: 20 22 +21 bop 0 -83 a Fo(20)1449 b(GNU)15 b(Readline)i(Library)120 +158 y Fn(Meta-Rubout:)46 b(backward-kill-word)62 297 y Fo(This)21 +b(binds)f(the)g(k)o(eystrok)o(e)f Fn(META-RUBOUT)f Fo(to)h(the)h(function)g +Fj(descriptiv)o(ely)26 b Fo(named)20 b Fn(backward-kill-)0 +359 y(word)p Fo(.)j(Y)l(ou,)16 b(as)g(the)g(programmer,)f(should)i(bind)h +(the)e(functions)i(y)o(ou)d(write)i(to)e(descriptiv)o(e)j(names)e(as)g(w)o +(ell.)0 421 y(Readline)i(pro)o(vides)d(a)g(function)h(for)f(doing)g(that:) +1725 587 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 587 +18 3 v 21 w(add)p 253 587 V 20 w(defun)i Ff(\()p Fn(char)14 +b(*name,)g(Function)g(*function,)g(int)h(key)p Ff(\))120 649 +y Fo(Add)20 b Fj(name)i Fo(to)d(the)h(list)g(of)f(named)h(functions.)33 +b(Mak)o(e)19 b Fj(function)i Fo(b)q(e)f(the)f(function)i(that)d(gets)120 +711 y(called.)j(If)16 b Fj(k)o(ey)j Fo(is)d(not)e(-1,)h(then)h(bind)g(it)g +(to)e Fj(function)i Fo(using)g Fn(rl_bind_key)e(\(\))p Fo(.)62 +877 y(Using)i(this)g(function)g(alone)g(is)g(su\016cien)o(t)h(for)d(most)h +(applications.)22 b(It)16 b(is)g(the)f(recommended)i(w)o(a)o(y)d(to)h(add)0 +940 y(a)i(few)h(functions)g(to)f(the)h(default)g(functions)h(that)e(Readline) +j(has)d(built)i(in.)28 b(If)18 b(y)o(ou)g(need)g(to)f(do)h(something)0 +1002 y(other)c(than)h(adding)h(a)e(function)i(to)e(Readline,)j(y)o(ou)d(ma)o +(y)g(need)i(to)e(use)h(the)g(underlying)h(functions)g(describ)q(ed)0 +1064 y(b)q(elo)o(w.)0 1283 y Fi(2.3.2)30 b(Selecting)15 b(a)g(Keymap)62 +1422 y Fo(Key)k(bindings)i(tak)o(e)c(place)j(on)e(a)g Fj(k)o(eymap)p +Fo(.)30 b(The)18 b(k)o(eymap)h(is)g(the)f(asso)q(ciation)h(b)q(et)o(w)o(een)g +(the)f(k)o(eys)h(that)0 1484 y(the)g(user)g(t)o(yp)q(es)g(and)g(the)g +(functions)g(that)f(get)h(run.)30 b(Y)l(ou)20 b(can)e(mak)o(e)h(y)o(our)f(o)o +(wn)g(k)o(eymaps,)h(cop)o(y)g(existing)0 1546 y(k)o(eymaps,)14 +b(and)i(tell)g(Readline)i(whic)o(h)e(k)o(eymap)f(to)f(use.)1725 +1712 y(F)l(unction)-1899 b Fh(Keymap)20 b Fg(rl)p 218 1712 +V 21 w(mak)n(e)p 370 1712 V 20 w(bare)p 500 1712 V 20 w(k)n(eymap)j +Ff(\(\))120 1774 y Fo(Returns)14 b(a)f(new,)g(empt)o(y)g(k)o(eymap.)19 +b(The)14 b(space)f(for)g(the)h(k)o(eymap)f(is)g(allo)q(cated)i(with)e +Fn(malloc)i(\(\))p Fo(;)120 1836 y(y)o(ou)g(should)h Fn(free)f(\(\))g +Fo(it)g(when)h(y)o(ou)f(are)f(done.)1725 2002 y(F)l(unction)-1899 +b Fh(Keymap)20 b Fg(rl)p 218 2002 V 21 w(cop)n(y)p 353 2002 +V 21 w(k)n(eymap)j Ff(\()p Fn(Keymap)14 b(map)p Ff(\))120 2064 +y Fo(Return)i(a)f(new)g(k)o(eymap)g(whic)o(h)h(is)g(a)f(cop)o(y)g(of)g +Fj(map)p Fo(.)1725 2230 y(F)l(unction)-1899 b Fh(Keymap)20 +b Fg(rl)p 218 2230 V 21 w(mak)n(e)p 370 2230 V 20 w(k)n(eymap)j +Ff(\(\))120 2293 y Fo(Return)c(a)f(new)h(k)o(eymap)f(with)h(the)f(prin)o +(ting)i(c)o(haracters)d(b)q(ound)j(to)e(rl)p 1407 2293 14 2 +v 16 w(insert,)i(the)e(lo)o(w)o(ercase)120 2355 y(Meta)13 b(c)o(haracters)g +(b)q(ound)h(to)f(run)h(their)g(equiv)m(alen)o(ts,)i(and)d(the)h(Meta)f +(digits)h(b)q(ound)h(to)e(pro)q(duce)120 2417 y(n)o(umeric)j(argumen)o(ts.) +1725 2583 y(F)l(unction)-1899 b Fh(void)20 b Fg(rl)p 166 2583 +18 3 v 21 w(discard)p 366 2583 V 21 w(k)n(eymap)i Ff(\()p Fn(Keymap)14 +b(keymap)p Ff(\))120 2645 y Fo(F)l(ree)h(the)h(storage)d(asso)q(ciated)j +(with)f Fj(k)o(eymap)p Fo(.)p eop +%%Page: 21 23 +22 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(21)62 158 y(Readline)20 b(has)d(sev)o(eral)h(in)o(ternal)g(k)o(eymaps.)26 +b(These)18 b(functions)g(allo)o(w)g(y)o(ou)f(to)g(c)o(hange)g(whic)o(h)h(k)o +(eymap)f(is)0 221 y(activ)o(e.)1725 383 y(F)l(unction)-1899 +b Fh(Keymap)20 b Fg(rl)p 218 383 18 3 v 21 w(get)p 316 383 +V 21 w(k)n(eymap)i Ff(\(\))120 445 y Fo(Returns)16 b(the)f(curren)o(tly)h +(activ)o(e)f(k)o(eymap.)1725 607 y(F)l(unction)-1899 b Fh(void)20 +b Fg(rl)p 166 607 V 21 w(set)p 258 607 V 21 w(k)n(eymap)i Ff(\()p +Fn(Keymap)14 b(keymap)p Ff(\))120 669 y Fo(Mak)o(es)g Fj(k)o(eymap)j +Fo(the)e(curren)o(tly)h(activ)o(e)f(k)o(eymap.)1725 831 y(F)l(unction)-1899 +b Fh(Keymap)20 b Fg(rl)p 218 831 V 21 w(get)p 316 831 V 21 +w(k)n(eymap)p 530 831 V 20 w(b)n(y)p 610 831 V 21 w(name)i +Ff(\()p Fn(char)14 b(*name)p Ff(\))120 893 y Fo(Return)19 b(the)g(k)o(eymap)f +(matc)o(hing)g Fj(name)p Fo(.)30 b Fj(name)21 b Fo(is)e(one)g(whic)o(h)g(w)o +(ould)g(b)q(e)g(supplied)i(in)e(a)f Fn(set)120 955 y(keymap)c +Fo(inputrc)j(line)f(\(see)g(Section)g(1.3)e([Readline)j(Init)f(File],)g(page) +f(4\).)0 1163 y Fi(2.3.3)30 b(Binding)15 b(Keys)62 1300 y Fo(Y)l(ou)h(asso)q +(ciate)f(k)o(eys)f(with)i(functions)g(through)e(the)i(k)o(eymap.)j(Readline)f +(has)c(sev)o(eral)i(in)o(ternal)g(k)o(eymaps:)0 1362 y Fn +(emacs_standard_keymap)p Fo(,)i Fn(emacs_meta_keymap)p Fo(,)g +Fn(emacs_ctlx_keymap)p Fo(,)h Fn(vi_movement_keymap)p Fo(,)f(and)0 +1425 y Fn(vi_insertion_keymap)p Fo(.)h Fn(emacs_standard_keymap)13 +b Fo(is)k(the)f(default,)g(and)g(the)g(examples)h(in)f(this)h(man)o(ual)0 +1487 y(assume)e(that.)62 1624 y(These)h(functions)g(manage)e(k)o(ey)i +(bindings.)1725 1786 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p +140 1786 V 21 w(bind)p 272 1786 V 21 w(k)n(ey)k Ff(\()p Fn(int)14 +b(key,)h(Function)f(*function)p Ff(\))120 1848 y Fo(Binds)i +Fj(k)o(ey)j Fo(to)14 b Fj(function)i Fo(in)g(the)f(curren)o(tly)h(activ)o(e)f +(k)o(eymap.)k(Returns)d(non-zero)f(in)h(the)f(case)g(of)120 +1910 y(an)g(in)o(v)m(alid)j Fj(k)o(ey)p Fo(.)1725 2072 y(F)l(unction)-1899 +b Fh(int)19 b Fg(rl)p 139 2072 V 21 w(bind)p 271 2072 V 21 +w(k)n(ey)p 376 2072 V 21 w(in)p 444 2072 V 22 w(map)i Ff(\()p +Fn(int)14 b(key,)h(Function)f(*function,)g(Keymap)g(map)p Ff(\))120 +2134 y Fo(Bind)i Fj(k)o(ey)j Fo(to)c Fj(function)h Fo(in)g +Fj(map)p Fo(.)k(Returns)15 b(non-zero)h(in)g(the)f(case)g(of)g(an)g(in)o(v)m +(alid)j Fj(k)o(ey)p Fo(.)1725 2296 y(F)l(unction)-1899 b Fh(int)20 +b Fg(rl)p 140 2296 V 21 w(un)n(bind)p 334 2296 V 21 w(k)n(ey)k +Ff(\()p Fn(int)14 b(key)p Ff(\))120 2359 y Fo(Bind)h Fj(k)o(ey)i +Fo(to)c(the)h(n)o(ull)h(function)f(in)g(the)g(curren)o(tly)g(activ)o(e)g(k)o +(eymap.)19 b(Returns)14 b(non-zero)g(in)g(case)120 2421 y(of)h(error.)1725 +2583 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 2583 V 21 +w(un)n(bind)p 334 2583 V 21 w(k)n(ey)p 439 2583 V 21 w(in)p +507 2583 V 22 w(map)h Ff(\()p Fn(int)14 b(key,)h(Keymap)f(map)p +Ff(\))120 2645 y Fo(Bind)i Fj(k)o(ey)j Fo(to)c(the)g(n)o(ull)i(function)f(in) +g Fj(map)p Fo(.)k(Returns)15 b(non-zero)h(in)g(case)f(of)g(error.)p +eop +%%Page: 22 24 +23 bop 0 -83 a Fo(22)1449 b(GNU)15 b(Readline)i(Library)1725 +158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 158 18 3 +v 21 w(generic)p 338 158 V 21 w(bind)j Ff(\()p Fn(int)15 b(type,)f(char)h +(*keyseq,)f(char)h(*data,)f(Keymap)208 221 y(map)p Ff(\))120 +283 y Fo(Bind)j(the)f(k)o(ey)g(sequence)h(represen)o(ted)f(b)o(y)g(the)g +(string)g Fj(k)o(eyseq)g Fo(to)g(the)f(arbitrary)h(p)q(oin)o(ter)g +Fj(data)p Fo(.)120 345 y Fj(t)o(yp)q(e)j Fo(sa)o(ys)c(what)g(kind)i(of)f +(data)f(is)i(p)q(oin)o(ted)g(to)e(b)o(y)h Fj(data)p Fo(;)f(this)i(can)f(b)q +(e)g(a)g(function)h(\()p Fn(ISFUNC)p Fo(\),)d(a)120 407 y(macro)i(\()p +Fn(ISMACR)p Fo(\),)f(or)i(a)f(k)o(eymap)g(\()p Fn(ISKMAP)p +Fo(\).)23 b(This)18 b(mak)o(es)e(new)h(k)o(eymaps)f(as)h(necessary)l(.)25 +b(The)120 470 y(initial)17 b(k)o(eymap)e(in)h(whic)o(h)g(to)f(do)g(bindings)i +(is)f Fj(map)p Fo(.)1725 656 y(F)l(unction)-1899 b Fh(int)20 +b Fg(rl)p 140 656 V 21 w(parse)p 294 656 V 19 w(and)p 405 656 +V 21 w(bind)j Ff(\()p Fn(char)14 b(*line)p Ff(\))120 718 y +Fo(P)o(arse)i Fj(line)21 b Fo(as)16 b(if)h(it)g(had)f(b)q(een)i(read)f(from)e +(the)i Fn(inputrc)f Fo(\014le)h(and)g(p)q(erform)f(an)o(y)h(k)o(ey)f +(bindings)120 780 y(and)f(v)m(ariable)i(assignmen)o(ts)e(found)h(\(see)f +(Section)h(1.3)e([Readline)j(Init)f(File],)g(page)f(4\).)0 +1061 y Fi(2.3.4)30 b(Asso)r(ciating)15 b(F)-5 b(unction)15 +b(Names)g(and)g(Bindings)62 1206 y Fo(These)22 b(functions)g(allo)o(w)g(y)o +(ou)f(to)f(\014nd)i(out)f(what)g(k)o(eys)g(in)o(v)o(ok)o(e)h(named)f +(functions)h(and)g(the)f(functions)0 1269 y(in)o(v)o(ok)o(ed)15 +b(b)o(y)h(a)e(particular)i(k)o(ey)f(sequence.)1725 1455 y(F)l(unction)-1899 +b Fh(Function)20 b(*)g Fg(rl)p 316 1455 V 21 w(named)p 504 +1455 V 19 w(function)j Ff(\()p Fn(char)14 b(*name)p Ff(\))120 +1517 y Fo(Return)i(the)f(function)h(with)g(name)f Fj(name)p +Fo(.)1725 1703 y(F)l(unction)-1899 b Fh(Function)20 b(*)g Fg(rl)p +316 1703 V 21 w(function)p 542 1703 V 21 w(of)p 610 1703 V +19 w(k)n(eyseq)k Ff(\()p Fn(char)15 b(*keyseq,)f(Keymap)g(map,)h(int)208 +1766 y(*type)p Ff(\))120 1828 y Fo(Return)i(the)f(function)h(in)o(v)o(ok)o +(ed)g(b)o(y)f Fj(k)o(eyseq)i Fo(in)f(k)o(eymap)f Fj(map)p Fo(.)23 +b(If)16 b Fj(map)i Fo(is)f(NULL,)g(the)f(curren)o(t)120 1890 +y(k)o(eymap)g(is)i(used.)25 b(If)17 b Fj(t)o(yp)q(e)i Fo(is)e(not)g(NULL,)g +(the)g(t)o(yp)q(e)g(of)f(the)h(ob)s(ject)f(is)h(returned)g(in)h(it)f(\(one)f +(of)120 1952 y Fn(ISFUNC)p Fo(,)e Fn(ISKMAP)p Fo(,)g(or)h Fn(ISMACR)p +Fo(\).)1725 2139 y(F)l(unction)-1899 b Fh(char)20 b(**)f Fg(rl)p +237 2139 V 21 w(in)n(v)n(oking)p 466 2139 V 23 w(k)n(eyseqs)k +Ff(\()p Fn(Function)14 b(*function)p Ff(\))120 2201 y Fo(Return)19 +b(an)e(arra)o(y)g(of)h(strings)f(represen)o(ting)i(the)f(k)o(ey)g(sequences)h +(used)f(to)f(in)o(v)o(ok)o(e)h Fj(function)h Fo(in)120 2263 +y(the)c(curren)o(t)g(k)o(eymap.)1725 2449 y(F)l(unction)-1899 +b Fh(char)20 b(**)f Fg(rl)p 237 2449 V 21 w(in)n(v)n(oking)p +466 2449 V 23 w(k)n(eyseqs)p 675 2449 V 21 w(in)p 743 2449 +V 22 w(map)i Ff(\()p Fn(Function)14 b(*function,)f(Keymap)208 +2512 y(map)p Ff(\))120 2574 y Fo(Return)19 b(an)e(arra)o(y)g(of)h(strings)f +(represen)o(ting)i(the)f(k)o(ey)g(sequences)h(used)f(to)f(in)o(v)o(ok)o(e)h +Fj(function)h Fo(in)120 2636 y(the)c(k)o(eymap)g Fj(map)p Fo(.)p +eop +%%Page: 23 25 +24 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(23)0 158 y Fi(2.3.5)30 b(Allo)n(wing)16 b(Undoing)62 297 +y Fo(Supp)q(orting)f(the)f(undo)g(command)g(is)g(a)g(painless)h(thing,)f(and) +g(mak)o(es)f(y)o(our)h(functions)g(m)o(uc)o(h)g(more)f(useful.)0 +359 y(It)i(is)g(certainly)g(easy)f(to)g(try)g(something)h(if)g(y)o(ou)f(kno)o +(w)g(y)o(ou)g(can)h(undo)g(it.)20 b(I)15 b(could)g(use)g(an)f(undo)h +(function)h(for)0 422 y(the)f(sto)q(c)o(k)g(mark)o(et.)62 561 +y(If)h(y)o(our)f(function)i(simply)g(inserts)f(text)f(once,)h(or)f(deletes)h +(text)f(once,)h(and)g(uses)g Fn(rl_insert_text)d(\(\))i Fo(or)0 +623 y Fn(rl_delete_text)e(\(\))i Fo(to)g(do)g(it,)g(then)g(undoing)i(is)e +(already)h(done)f(for)g(y)o(ou)g(automatically)l(.)62 762 y(If)h(y)o(ou)f(do) +g(m)o(ultiple)i(insertions)f(or)f(m)o(ultiple)i(deletions,)f(or)f(an)o(y)g +(com)o(bination)h(of)f(these)g(op)q(erations,)g(y)o(ou)0 824 +y(should)j(group)e(them)g(together)g(in)o(to)g(one)h(op)q(eration.)24 +b(This)17 b(is)g(done)g(with)g Fn(rl_begin_undo_group)c(\(\))j +Fo(and)0 886 y Fn(rl_end_undo_group)d(\(\))p Fo(.)62 1025 y(The)j(t)o(yp)q +(es)f(of)g(ev)o(en)o(ts)g(that)f(can)h(b)q(e)h(undone)g(are:)120 +1151 y Fn(enum)23 b(undo_code)g({)h(UNDO_DELETE,)e(UNDO_INSERT,)g +(UNDO_BEGIN,)g(UNDO_END)h(};)62 1290 y Fo(Notice)c(that)e Fn(UNDO_DELETE)f +Fo(means)i(to)f(insert)i(some)e(text,)h(and)g Fn(UNDO_INSERT)e +Fo(means)i(to)f(delete)i(some)0 1353 y(text.)37 b(That)21 b(is,)i(the)e(undo) +h(co)q(de)f(tells)i(undo)e(what)g(to)f(undo,)j(not)e(ho)o(w)g(to)f(undo)i +(it.)38 b Fn(UNDO_BEGIN)20 b Fo(and)0 1415 y Fn(UNDO_END)14 +b Fo(are)h(tags)f(added)i(b)o(y)f Fn(rl_begin_undo_group)e(\(\))i +Fo(and)g Fn(rl_end_undo_group)e(\(\))p Fo(.)1725 1582 y(F)l(unction)-1899 +b Fh(int)20 b Fg(rl)p 140 1582 18 3 v 21 w(b)r(egin)p 297 1582 +V 20 w(undo)p 442 1582 V 20 w(group)h Ff(\(\))120 1645 y Fo(Begins)e(sa)o +(ving)e(undo)i(information)f(in)g(a)g(group)f(construct.)27 +b(The)18 b(undo)h(information)f(usually)120 1707 y(comes)j(from)f(calls)h(to) +g Fn(rl_insert_text)13 b(\(\))20 b Fo(and)h Fn(rl_delete_text)13 +b(\(\))p Fo(,)22 b(but)f(could)g(b)q(e)h(the)120 1769 y(result)16 +b(of)e(calls)j(to)d Fn(rl_add_undo)g(\(\))p Fo(.)1725 1937 +y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1937 V 21 w(end)p +251 1937 V 20 w(undo)p 396 1937 V 20 w(group)h Ff(\(\))120 +1999 y Fo(Closes)d(the)f(curren)o(t)g(undo)h(group)f(started)g(with)h +Fn(rl_begin_undo_group)12 b(\(\))p Fo(.)26 b(There)18 b(should)120 +2061 y(b)q(e)e(one)f(call)i(to)d Fn(rl_end_undo_group)f(\(\))i +Fo(for)f(eac)o(h)i(call)g(to)f Fn(rl_begin_undo_group)d(\(\))p +Fo(.)1725 2229 y(F)l(unction)-1899 b Fh(void)20 b Fg(rl)p 166 +2229 V 21 w(add)p 279 2229 V 20 w(undo)i Ff(\()p Fn(enum)14 +b(undo_code)g(what,)g(int)h(start,)g(int)f(end,)h(char)208 +2291 y(*text)p Ff(\))120 2353 y Fo(Remem)o(b)q(er)20 b(ho)o(w)e(to)h(undo)g +(an)g(ev)o(en)o(t)g(\(according)g(to)g Fj(what)q Fo(\).)30 +b(The)19 b(a\013ected)g(text)f(runs)i(from)120 2415 y Fj(start)15 +b Fo(to)g Fj(end)p Fo(,)g(and)g(encompasses)h Fj(text)p Fo(.)1725 +2583 y(F)l(unction)-1899 b Fh(void)20 b Fg(free)p 221 2583 +V 20 w(undo)p 366 2583 V 20 w(list)k Ff(\(\))120 2645 y Fo(F)l(ree)15 +b(the)h(existing)g(undo)f(list.)p eop +%%Page: 24 26 +25 bop 0 -83 a Fo(24)1449 b(GNU)15 b(Readline)i(Library)1725 +158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 158 18 3 +v 21 w(do)p 222 158 V 20 w(undo)i Ff(\(\))120 221 y Fo(Undo)14 +b(the)f(\014rst)g(thing)h(on)g(the)f(undo)h(list.)20 b(Returns)14 +b Fn(0)f Fo(if)h(there)g(w)o(as)e(nothing)i(to)f(undo,)h(non-zero)120 +283 y(if)i(something)f(w)o(as)f(undone.)62 454 y(Finally)l(,)j(if)f(y)o(ou)f +(neither)i(insert)f(nor)f(delete)i(text,)d(but)i(directly)h(mo)q(dify)f(the)f +(existing)i(text)e(\(e.g.,)f(c)o(hange)0 516 y(its)g(case\),)f(call)i +Fn(rl_modifying)e(\(\))g Fo(once,)h(just)f(b)q(efore)h(y)o(ou)f(mo)q(dify)h +(the)g(text.)19 b(Y)l(ou)14 b(m)o(ust)f(supply)h(the)g(indices)0 +578 y(of)h(the)g(text)g(range)g(that)f(y)o(ou)h(are)g(going)g(to)g(mo)q(dify) +l(.)1725 749 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 +749 V 21 w(mo)r(difying)h Ff(\()p Fn(int)15 b(start,)f(int)h(end)p +Ff(\))120 811 y Fo(T)l(ell)e(Readline)g(to)e(sa)o(v)o(e)f(the)i(text)f(b)q +(et)o(w)o(een)g Fj(start)g Fo(and)h Fj(end)h Fo(as)e(a)g(single)i(undo)e +(unit.)20 b(It)11 b(is)h(assumed)120 873 y(that)i(y)o(ou)h(will)i(subsequen)o +(tly)g(mo)q(dify)e(that)g(text.)0 1107 y Fi(2.3.6)30 b(Redispla)n(y)1725 +1278 y Fo(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1278 +V 21 w(redispla)n(y)k Ff(\(\))120 1340 y Fo(Change)d(what's)g(displa)o(y)o +(ed)h(on)g(the)f(screen)h(to)f(re\015ect)h(the)f(curren)o(t)g(con)o(ten)o(ts) +g(of)g Fn(rl_line_)120 1402 y(buffer)p Fo(.)1725 1573 y(F)l(unction)-1899 +b Fh(int)20 b Fg(rl)p 140 1573 V 21 w(forced)p 315 1573 V 20 +w(up)r(date)p 509 1573 V 20 w(displa)n(y)k Ff(\(\))120 1635 +y Fo(F)l(orce)12 b(the)g(line)h(to)f(b)q(e)g(up)q(dated)h(and)f(redispla)o(y) +o(ed,)i(whether)e(or)f(not)h(Readline)i(thinks)e(the)g(screen)120 +1697 y(displa)o(y)k(is)g(correct.)1725 1868 y(F)l(unction)-1899 +b Fh(int)20 b Fg(rl)p 140 1868 V 21 w(on)p 222 1868 V 20 w(new)p +341 1868 V 21 w(line)k Ff(\(\))120 1930 y Fo(T)l(ell)c(the)f(up)q(date)g +(routines)g(that)f(w)o(e)g(ha)o(v)o(e)g(mo)o(v)o(ed)g(on)o(to)g(a)g(new)h +(\(empt)o(y\))e(line,)k(usually)f(after)120 1992 y(ouputting)c(a)e(newline.) +1725 2163 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 2163 +V 21 w(reset)p 282 2163 V 20 w(line)p 390 2163 V 23 w(state)j +Ff(\(\))120 2225 y Fo(Reset)14 b(the)f(displa)o(y)h(state)f(to)f(a)h(clean)h +(state)f(and)g(redispla)o(y)i(the)e(curren)o(t)g(line)i(starting)e(on)g(a)g +(new)120 2288 y(line.)1725 2458 y(F)l(unction)-1899 b Fh(int)20 +b Fg(rl)p 140 2458 V 21 w(message)g Ff(\()p Fn(va_alist)p Ff(\))120 +2521 y Fo(The)f(argumen)o(ts)e(are)h(a)g(string)g(as)g(w)o(ould)h(b)q(e)g +(supplied)i(to)d Fn(printf)p Fo(.)28 b(The)19 b(resulting)g(string)f(is)120 +2583 y(displa)o(y)o(ed)h(in)f(the)g Fj(ec)o(ho)f(area)p Fo(.)27 +b(The)18 b(ec)o(ho)f(area)g(is)h(also)g(used)g(to)f(displa)o(y)h(n)o(umeric)h +(argumen)o(ts)120 2645 y(and)c(searc)o(h)g(strings.)p eop +%%Page: 25 27 +26 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(25)1725 158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 +158 18 3 v 21 w(clear)p 279 158 V 21 w(message)h Ff(\(\))120 +221 y Fo(Clear)15 b(the)h(message)e(in)i(the)g(ec)o(ho)f(area.)0 +423 y Fi(2.3.7)30 b(Mo)r(difying)15 b(T)-5 b(ext)1725 582 y +Fo(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 582 V 21 w(insert)p +303 582 V 21 w(text)k Ff(\()p Fn(char)14 b(*text)p Ff(\))120 +644 y Fo(Insert)h Fj(text)h Fo(in)o(to)f(the)h(line)g(at)f(the)g(curren)o(t)g +(cursor)g(p)q(osition.)1725 803 y(F)l(unction)-1899 b Fh(int)20 +b Fg(rl)p 140 803 V 21 w(delete)p 308 803 V 22 w(text)k Ff(\()p +Fn(int)14 b(start,)h(int)f(end)p Ff(\))120 865 y Fo(Delete)i(the)f(text)g(b)q +(et)o(w)o(een)g Fj(start)g Fo(and)h Fj(end)h Fo(in)f(the)g(curren)o(t)f +(line.)1725 1025 y(F)l(unction)-1899 b Fh(char)20 b(*)f Fg(rl)p +211 1025 V 21 w(cop)n(y)p 346 1025 V 21 w(text)24 b Ff(\()p +Fn(int)14 b(start,)h(int)g(end)p Ff(\))120 1087 y Fo(Return)h(a)f(cop)o(y)g +(of)g(the)g(text)f(b)q(et)o(w)o(een)i Fj(start)f Fo(and)g Fj(end)j +Fo(in)e(the)f(curren)o(t)g(line.)1725 1246 y(F)l(unction)-1899 +b Fh(int)20 b Fg(rl)p 140 1246 V 21 w(kill)p 236 1246 V 23 +w(text)k Ff(\()p Fn(int)14 b(start,)h(int)g(end)p Ff(\))120 +1308 y Fo(Cop)o(y)k(the)g(text)f(b)q(et)o(w)o(een)i Fj(start)e +Fo(and)i Fj(end)h Fo(in)f(the)f(curren)o(t)g(line)i(to)d(the)h(kill)i(ring,)f +(app)q(ending)120 1371 y(or)e(prep)q(ending)j(to)d(the)h(last)f(kill)j(if)e +(the)g(last)f(command)h(w)o(as)e(a)i(kill)h(command.)30 b(The)19 +b(text)f(is)120 1433 y(deleted.)j(If)13 b Fj(start)g Fo(is)h(less)f(than)h +Fj(end)p Fo(,)f(the)h(text)e(is)i(app)q(ended,)h(otherwise)e(prep)q(ended.)21 +b(If)14 b(the)f(last)120 1495 y(command)i(w)o(as)f(not)h(a)g(kill,)i(a)e(new) +g(kill)i(ring)f(slot)f(is)g(used.)0 1697 y Fi(2.3.8)30 b(Utilit)n(y)16 +b(F)-5 b(unctions)1725 1856 y Fo(F)l(unction)-1899 b Fh(int)20 +b Fg(rl)p 140 1856 V 21 w(reset)p 282 1856 V 20 w(terminal)j +Ff(\()p Fn(char)15 b(*terminal_name)p Ff(\))120 1919 y Fo(Reinitializ)q(e)f +(Readline's)e(idea)g(of)e(the)h(terminal)h(settings)f(using)g +Fj(terminal)p 1404 1919 14 2 v 17 w(name)j Fo(as)c(the)h(terminal)120 +1981 y(t)o(yp)q(e)k(\(e.g.,)f Fn(vt100)p Fo(\).)1725 2140 y(F)l(unction)-1899 +b Fh(int)20 b Fg(alphab)r(etic)k Ff(\()p Fn(int)14 b(c)p Ff(\))120 +2202 y Fo(Return)i(1)f(if)g Fj(c)j Fo(is)e(an)f(alphab)q(etic)i(c)o +(haracter.)1725 2361 y(F)l(unction)-1899 b Fh(int)20 b Fg(n)n(umeric)i +Ff(\()p Fn(int)15 b(c)p Ff(\))120 2424 y Fo(Return)h(1)f(if)g +Fj(c)j Fo(is)e(a)f(n)o(umeric)h(c)o(haracter.)1725 2583 y(F)l(unction)-1899 +b Fh(int)20 b Fg(ding)i Ff(\(\))120 2645 y Fo(Ring)16 b(the)f(terminal)h(b)q +(ell,)h(ob)q(eying)f(the)g(setting)f(of)g Fn(bell-style)p Fo(.)p +eop +%%Page: 26 28 +27 bop 0 -83 a Fo(26)1449 b(GNU)15 b(Readline)i(Library)62 +158 y(The)f(follo)o(wing)g(are)f(implemen)o(ted)h(as)f(macros,)f(de\014ned)j +(in)f Fn(chartypes.h)p Fo(.)1725 319 y(F)l(unction)-1899 b +Fh(int)20 b Fg(upp)r(ercase)p 351 319 18 3 v 19 w(p)j Ff(\()p +Fn(int)14 b(c)p Ff(\))120 381 y Fo(Return)i(1)f(if)g Fj(c)j +Fo(is)e(an)f(upp)q(ercase)i(alphab)q(etic)f(c)o(haracter.)1725 +541 y(F)l(unction)-1899 b Fh(int)20 b Fg(lo)n(w)n(ercase)p +334 541 V 22 w(p)i Ff(\()p Fn(int)15 b(c)p Ff(\))120 604 y +Fo(Return)h(1)f(if)g Fj(c)j Fo(is)e(a)f(lo)o(w)o(ercase)g(alphab)q(etic)i(c)o +(haracter.)1725 764 y(F)l(unction)-1899 b Fh(int)20 b Fg(digit)p +214 764 V 22 w(p)i Ff(\()p Fn(int)15 b(c)p Ff(\))120 826 y +Fo(Return)h(1)f(if)g Fj(c)j Fo(is)e(a)f(n)o(umeric)h(c)o(haracter.)1725 +987 y(F)l(unction)-1899 b Fh(int)20 b Fg(to)p 152 987 V 20 +w(upp)r(er)i Ff(\()p Fn(int)14 b(c)p Ff(\))120 1049 y Fo(If)h +Fj(c)i Fo(is)f(a)e(lo)o(w)o(ercase)g(alphab)q(etic)j(c)o(haracter,)c(return)i +(the)g(corresp)q(onding)g(upp)q(ercase)h(c)o(haracter.)1725 +1209 y(F)l(unction)-1899 b Fh(int)20 b Fg(to)p 152 1209 V 20 +w(lo)n(w)n(er)k Ff(\()p Fn(int)15 b(c)p Ff(\))120 1272 y Fo(If)e +Fj(c)i Fo(is)e(an)f(upp)q(ercase)h(alphab)q(etic)h(c)o(haracter,)e(return)g +(the)h(corresp)q(onding)g(lo)o(w)o(ercase)f(c)o(haracter.)1725 +1432 y(F)l(unction)-1899 b Fh(int)20 b Fg(digit)p 214 1432 +V 22 w(v)m(alue)j Ff(\()p Fn(int)15 b(c)p Ff(\))120 1494 y +Fo(If)g Fj(c)k Fo(is)c(a)g(n)o(um)o(b)q(er,)g(return)g(the)h(v)m(alue)g(it)g +(represen)o(ts.)0 1699 y Fi(2.3.9)30 b(An)15 b(Example)62 1836 +y Fo(Here)e(is)g(a)f(function)h(whic)o(h)g(c)o(hanges)g(lo)o(w)o(ercase)f(c)o +(haracters)f(to)h(their)h(upp)q(ercase)g(equiv)m(alen)o(ts,)h(and)f(upp)q +(er-)0 1898 y(case)j(c)o(haracters)g(to)g(lo)o(w)o(ercase.)23 +b(If)16 b(this)h(function)g(w)o(as)f(b)q(ound)h(to)f(`)p Fn(M-c)p +Fo(',)f(then)h(t)o(yping)h(`)p Fn(M-c)p Fo(')e(w)o(ould)i(c)o(hange)0 +1960 y(the)g(case)f(of)g(the)h(c)o(haracter)f(under)h(p)q(oin)o(t.)25 +b(T)o(yping)17 b(`)p Fn(M-1)d(0)h(M-c)p Fo(')h(w)o(ould)h(c)o(hange)f(the)h +(case)f(of)h(the)f(follo)o(wing)0 2022 y(10)f(c)o(haracters,)f(lea)o(ving)i +(the)f(cursor)g(on)g(the)g(last)g(c)o(haracter)g(c)o(hanged.)120 +2147 y Fn(/*)24 b(Invert)f(the)g(case)g(of)h(the)f(COUNT)h(following)e +(characters.)h(*/)120 2197 y(int)120 2247 y(invert_case_line)f(\(count,)h +(key\))239 2296 y(int)h(count,)f(key;)120 2346 y({)168 2396 +y(register)f(int)i(start,)f(end,)g(i;)168 2496 y(start)g(=)h(rl_point;)168 +2595 y(if)f(\(rl_point)g(>=)h(rl_end\))215 2645 y(return)f(\(0\);)p +eop +%%Page: 27 29 +28 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(27)168 208 y Fn(if)23 b(\(count)g(<)h(0\))215 258 y({)263 +308 y(direction)f(=)h(-1;)263 358 y(count)f(=)h(-count;)215 +407 y(})168 457 y(else)215 507 y(direction)f(=)h(1;)168 607 +y(/*)f(Find)h(the)f(end)h(of)f(the)h(range)f(to)g(modify.)g(*/)168 +656 y(end)g(=)h(start)f(+)h(\(count)f(*)h(direction\);)168 +756 y(/*)f(Force)g(it)h(to)g(be)f(within)g(range.)g(*/)168 +806 y(if)g(\(end)h(>)f(rl_end\))215 856 y(end)h(=)g(rl_end;)168 +906 y(else)f(if)h(\(end)f(<)h(0\))215 955 y(end)g(=)g(0;)168 +1055 y(if)f(\(start)g(==)h(end\))215 1105 y(return)f(\(0\);)168 +1204 y(if)g(\(start)g(>)h(end\))215 1254 y({)263 1304 y(int)g(temp)f(=)h +(start;)263 1354 y(start)f(=)h(end;)263 1404 y(end)g(=)f(temp;)215 +1453 y(})168 1553 y(/*)g(Tell)h(readline)e(that)i(we)f(are)h(modifying)e(the) +i(line,)f(so)h(it)f(will)h(save)239 1603 y(the)g(undo)f(information.)f(*/)168 +1653 y(rl_modifying)g(\(start,)h(end\);)168 1752 y(for)g(\(i)h(=)f(start;)h +(i)f(!=)h(end;)f(i++\))215 1802 y({)263 1852 y(if)h(\(uppercase_p)e +(\(rl_line_buffer[i]\)\))311 1902 y(rl_line_buffer[i])f(=)j(to_lower)f +(\(rl_line_buffer[i]\);)263 1952 y(else)g(if)h(\(lowercase_p)e +(\(rl_line_buffer[i]\)\))311 2001 y(rl_line_buffer[i])f(=)j(to_upper)f +(\(rl_line_buffer[i]\);)215 2051 y(})168 2101 y(/*)g(Move)h(point)f(to)g(on)h +(top)f(of)h(the)f(last)h(character)e(changed.)h(*/)168 2151 +y(rl_point)f(=)i(\(direction)f(==)g(1\))h(?)g(end)f(-)h(1)g(:)f(start;)168 +2201 y(return)g(\(0\);)120 2250 y(})p eop +%%Page: 28 30 +29 bop 0 -83 a Fo(28)1449 b(GNU)15 b(Readline)i(Library)0 158 +y Fm(2.4)33 b(Custom)14 b(Completers)62 306 y Fo(T)o(ypically)l(,)g(a)c +(program)g(that)h(reads)g(commands)g(from)f(the)h(user)h(has)e(a)h(w)o(a)o(y) +f(of)h(disam)o(biguating)h(commands)0 368 y(and)k(data.)k(If)c(y)o(our)f +(program)g(is)h(one)g(of)f(these,)h(then)g(it)g(can)g(pro)o(vide)g +(completion)g(for)g(commands,)f(data,)f(or)0 430 y(b)q(oth.)28 +b(The)18 b(follo)o(wing)h(sections)f(describ)q(e)h(ho)o(w)f(y)o(our)f +(program)g(and)h(Readline)i(co)q(op)q(erate)e(to)f(pro)o(vide)i(this)0 +493 y(service.)0 795 y Fi(2.4.1)30 b(Ho)n(w)15 b(Completing)g(W)-5 +b(orks)62 942 y Fo(In)16 b(order)f(to)g(complete)h(some)f(text,)f(the)h(full) +i(list)f(of)f(p)q(ossible)i(completions)f(m)o(ust)f(b)q(e)h(a)o(v)m(ailable.) +21 b(That)15 b(is,)0 1004 y(it)k(is)f(not)g(p)q(ossible)i(to)e(accurately)h +(expand)g(a)f(partial)h(w)o(ord)e(without)i(kno)o(wing)f(all)h(of)f(the)h(p)q +(ossible)h(w)o(ords)0 1067 y(whic)o(h)c(mak)o(e)f(sense)h(in)g(that)e(con)o +(text.)20 b(The)15 b(Readline)j(library)e(pro)o(vides)f(the)h(user)f(in)o +(terface)h(to)e(completion,)0 1129 y(and)h(t)o(w)o(o)f(of)h(the)h(most)e +(common)h(completion)h(functions:)21 b(\014lename)c(and)e(username.)20 +b(F)l(or)15 b(completing)h(other)0 1191 y(t)o(yp)q(es)h(of)f(text,)g(y)o(ou)h +(m)o(ust)f(write)h(y)o(our)f(o)o(wn)g(completion)i(function.)25 +b(This)18 b(section)f(describ)q(es)h(exactly)g(what)0 1253 +y(suc)o(h)e(functions)f(m)o(ust)g(do,)g(and)g(pro)o(vides)h(an)f(example.)62 +1401 y(There)h(are)f(three)g(ma)s(jor)f(functions)i(used)f(to)g(p)q(erform)g +(completion:)25 1548 y(1.)29 b(The)15 b(user-in)o(terface)g(function)g +Fn(rl_complete)e(\(\))p Fo(.)20 b(This)15 b(function)g(is)g(called)h(with)e +(the)h(same)f(argumen)o(ts)90 1611 y(as)j(other)g(Readline)j(functions)f(in)o +(tended)g(for)e(in)o(teractiv)o(e)h(use:)25 b Fj(coun)o(t)18 +b Fo(and)g Fj(in)o(v)o(oking)p 1633 1611 14 2 v 17 w(k)o(ey)p +Fo(.)27 b(It)18 b(isolates)90 1673 y(the)j(w)o(ord)g(to)f(b)q(e)i(completed)h +(and)e(calls)h Fn(completion_matches)13 b(\(\))21 b Fo(to)f(generate)h(a)g +(list)h(of)f(p)q(ossible)90 1735 y(completions.)h(It)16 b(then)g(either)h +(lists)f(the)g(p)q(ossible)h(completions,)g(inserts)f(the)g(p)q(ossible)h +(completions,)f(or)90 1797 y(actually)g(p)q(erforms)f(the)g(completion,)h +(dep)q(ending)i(on)d(whic)o(h)h(b)q(eha)o(vior)f(is)h(desired.)25 +1883 y(2.)29 b(The)18 b(in)o(ternal)h(function)g Fn(completion_matches)13 +b(\(\))18 b Fo(uses)g(y)o(our)f Fj(generator)k Fo(function)e(to)e(generate)h +(the)90 1945 y(list)h(of)e(p)q(ossible)j(matc)o(hes,)e(and)g(then)g(returns)g +(the)g(arra)o(y)f(of)h(these)g(matc)o(hes.)28 b(Y)l(ou)18 b(should)h(place)g +(the)90 2007 y(address)c(of)g(y)o(our)g(generator)f(function)i(in)g +Fn(rl_completion_entry_functi)o(on)p Fo(.)25 2092 y(3.)29 b(The)16 +b(generator)g(function)h(is)f(called)i(rep)q(eatedly)g(from)d +Fn(completion_matches)e(\(\))p Fo(,)i(returning)i(a)f(string)90 +2155 y(eac)o(h)j(time.)31 b(The)19 b(argumen)o(ts)f(to)g(the)h(generator)e +(function)j(are)e Fj(text)i Fo(and)f Fj(state)p Fo(.)29 b Fj(text)19 +b Fo(is)h(the)f(partial)90 2217 y(w)o(ord)13 b(to)g(b)q(e)h(completed.)21 +b Fj(state)15 b Fo(is)f(zero)g(the)g(\014rst)f(time)h(the)g(function)g(is)g +(called,)i(allo)o(wing)e(the)g(generator)90 2279 y(to)19 b(p)q(erform)f(an)o +(y)h(necessary)h(initialization,)i(and)e(a)f(p)q(ositiv)o(e)h(non-zero)f(in)o +(teger)h(for)e(eac)o(h)h(subsequen)o(t)90 2341 y(call.)35 b(When)21 +b(the)f(generator)f(function)i(returns)f Fn(\(char)14 b(*\)NULL)19 +b Fo(this)i(signals)f Fn(completion_matches)90 2404 y(\(\))c +Fo(that)g(there)h(are)f(no)h(more)f(p)q(ossibilitie)q(s)j(left.)25 +b(Usually)18 b(the)e(generator)g(function)i(computes)e(the)h(list)90 +2466 y(of)j(p)q(ossible)i(completions)f(when)g Fj(state)h Fo(is)f(zero,)g +(and)f(returns)g(them)h(one)f(at)g(a)g(time)g(on)g(subsequen)o(t)90 +2528 y(calls.)g(Eac)o(h)14 b(string)f(the)h(generator)e(function)j(returns)e +(as)g(a)g(matc)o(h)g(m)o(ust)g(b)q(e)h(allo)q(cated)h(with)e +Fn(malloc\(\))p Fo(;)90 2590 y(Readline)18 b(frees)d(the)g(strings)g(when)h +(it)f(has)g(\014nished)i(with)f(them.)p eop +%%Page: 29 31 +30 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(29)1725 158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 +158 18 3 v 21 w(complete)j Ff(\()p Fn(int)14 b(ignore,)g(int)h(invoking_key)p +Ff(\))120 221 y Fo(Complete)j(the)f(w)o(ord)f(at)h(or)g(b)q(efore)g(p)q(oin)o +(t.)27 b(Y)l(ou)17 b(ha)o(v)o(e)g(supplied)i(the)f(function)g(that)e(do)q(es) +i(the)120 283 y(initial)d(simple)f(matc)o(hing)f(selection)h(algorithm)f +(\(see)f Fn(completion_matches)h(\(\))p Fo(\).)18 b(The)13 +b(default)120 345 y(is)j(to)e(do)h(\014lename)i(completion.)1736 +520 y(V)l(ariable)-1899 b Fh(Function)20 b(*)g Fg(rl)p 316 +520 V 21 w(completion)p 611 520 V 21 w(en)n(try)p 764 520 V +21 w(function)120 582 y Fo(This)e(is)g(a)f(p)q(oin)o(ter)h(to)f(the)g +(generator)g(function)h(for)f Fn(completion_matches)12 b(\(\))p +Fo(.)27 b(If)17 b(the)h(v)m(alue)120 644 y(of)j Fn(rl_completion_entry_funct) +o(ion)d Fo(is)k Fn(\(Function)14 b(*\)NULL)20 b Fo(then)i(the)f(default)h +(\014lename)120 707 y(generator)14 b(function,)i Fn(filename_entry_function)c +(\(\))p Fo(,)i(is)i(used.)0 953 y Fi(2.4.2)30 b(Completion)15 +b(F)-5 b(unctions)62 1094 y Fo(Here)16 b(is)f(the)h(complete)g(list)g(of)e +(callable)k(completion)e(functions)g(presen)o(t)f(in)h(Readline.)1725 +1269 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1269 V 21 +w(complete)p 385 1269 V 21 w(in)n(ternal)k Ff(\()p Fn(int)15 +b(what_to_do)p Ff(\))120 1331 y Fo(Complete)d(the)g(w)o(ord)f(at)g(or)g(b)q +(efore)h(p)q(oin)o(t.)19 b Fj(what)p 979 1331 14 2 v 16 w(to)p +1036 1331 V 16 w(do)14 b Fo(sa)o(ys)d(what)g(to)g(do)g(with)h(the)g +(completion.)120 1394 y(A)g(v)m(alue)h(of)f(`)p Fn(?)p Fo(')f(means)h(list)h +(the)f(p)q(ossible)i(completions.)20 b(`)p Fn(TAB)p Fo(')11 +b(means)h(do)g(standard)f(completion.)120 1456 y(`)p Fn(*)p +Fo(')i(means)h(insert)h(all)g(of)f(the)g(p)q(ossible)i(completions.)21 +b(`)p Fn(!)p Fo(')13 b(means)h(to)g(displa)o(y)h(all)g(of)f(the)g(p)q +(ossible)120 1518 y(completions,)i(if)g(there)f(is)h(more)e(than)h(one,)g(as) +g(w)o(ell)h(as)f(p)q(erforming)h(partial)f(completion.)1725 +1693 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1693 18 +3 v 21 w(complete)j Ff(\()p Fn(int)14 b(ignore,)g(int)h(invoking_key)p +Ff(\))120 1755 y Fo(Complete)23 b(the)g(w)o(ord)e(at)h(or)g(b)q(efore)h(p)q +(oin)o(t.)43 b(Y)l(ou)23 b(ha)o(v)o(e)f(supplied)j(the)d(function)i(that)e +(do)q(es)120 1817 y(the)16 b(initial)j(simple)f(matc)o(hing)e(selection)i +(algorithm)e(\(see)g Fn(completion_matches)d(\(\))j Fo(and)g +Fn(rl_)120 1880 y(completion_entry_function)p Fo(\))o(.)25 +b(The)18 b(default)g(is)g(to)f(do)h(\014lename)h(completion.)29 +b(This)18 b(calls)120 1942 y Fn(rl_complete_internal)12 b(\(\))j +Fo(with)h(an)f(argumen)o(t)f(dep)q(ending)k(on)d Fj(in)o(v)o(oking)p +1496 1942 14 2 v 17 w(k)o(ey)p Fo(.)1725 2117 y(F)l(unction)-1899 +b Fh(int)20 b Fg(rl)p 140 2117 18 3 v 21 w(p)r(ossible)p 358 +2117 V 20 w(completions)j Ff(\()p Fn(int)15 b(count,)f(int)h(invoking_key)p +Ff(\)\))120 2179 y Fo(List)23 b(the)f(p)q(ossible)j(completions.)42 +b(See)23 b(description)h(of)e Fn(rl_complete)14 b(\(\))p Fo(.)41 +b(This)23 b(calls)g Fn(rl_)120 2241 y(complete_internal)13 +b(\(\))i Fo(with)g(an)g(argumen)o(t)g(of)g(`)p Fn(?)p Fo('.)1725 +2416 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 2416 V 21 +w(insert)p 303 2416 V 21 w(completions)j Ff(\()p Fn(int)14 +b(count,)g(int)h(invoking_key)p Ff(\)\))120 2478 y Fo(Insert)20 +b(the)f(list)i(of)e(p)q(ossible)i(completions)f(in)o(to)g(the)f(line,)j +(deleting)f(the)f(partially-completed)120 2540 y(w)o(ord.)h(See)c +(description)g(of)e Fn(rl_complete)f(\(\))p Fo(.)21 b(This)c(calls)g +Fn(rl_complete_internal)12 b(\(\))k Fo(with)120 2603 y(an)f(argumen)o(t)g(of) +f(`)p Fn(*)p Fo('.)p eop +%%Page: 30 32 +31 bop 0 -83 a Fo(30)1449 b(GNU)15 b(Readline)i(Library)1725 +158 y(F)l(unction)-1899 b Fh(char)20 b(**)f Fg(completion)p +472 158 18 3 v 21 w(matc)n(hes)j Ff(\()p Fn(char)15 b(*text,)f(CPFunction)208 +221 y(*entry_func)p Ff(\))120 283 y Fo(Returns)22 b(an)g(arra)o(y)e(of)h +Fn(\(char)15 b(*\))21 b Fo(whic)o(h)i(is)f(a)f(list)i(of)e(completions)i(for) +e Fj(text)p Fo(.)39 b(If)22 b(there)f(are)120 345 y(no)d(completions,)i +(returns)e Fn(\(char)c(**\)NULL)p Fo(.)28 b(The)19 b(\014rst)e(en)o(try)h(in) +h(the)g(returned)f(arra)o(y)f(is)i(the)120 407 y(substitution)c(for)e +Fj(text)p Fo(.)19 b(The)c(remaining)g(en)o(tries)f(are)g(the)g(p)q(ossible)i +(completions.)k(The)15 b(arra)o(y)d(is)120 470 y(terminated)j(with)h(a)f +Fn(NULL)f Fo(p)q(oin)o(ter.)120 613 y Fj(en)o(try)p 227 613 +14 2 v 16 w(func)h Fo(is)d(a)g(function)h(of)e(t)o(w)o(o)g(args,)g(and)h +(returns)g(a)f Fn(\(char)k(*\))p Fo(.)j(The)12 b(\014rst)f(argumen)o(t)g(is)i +Fj(text)p Fo(.)120 675 y(The)i(second)f(is)h(a)f(state)g(argumen)o(t;)f(it)i +(is)g(zero)f(on)g(the)h(\014rst)f(call,)h(and)f(non-zero)h(on)f(subsequen)o +(t)120 738 y(calls.)21 b Fj(en)o(try)p 346 738 V 16 w(func)c +Fo(returns)e(a)f Fn(NULL)g Fo(p)q(oin)o(ter)h(to)f(the)g(caller)i(when)f +(there)f(are)g(no)h(more)f(matc)o(hes.)1725 919 y(F)l(unction)-1899 +b Fh(char)20 b(*)f Fg(\014lename)p 380 919 18 3 v 20 w(completion)p +674 919 V 21 w(function)k Ff(\()p Fn(char)15 b(*text,)f(int)h(state)p +Ff(\))120 981 y Fo(A)e(generator)f(function)h(for)f(\014lename)i(completion)g +(in)f(the)g(general)g(case.)19 b(Note)13 b(that)f(completion)120 +1043 y(in)18 b(Bash)f(is)h(a)f(little)h(di\013eren)o(t)f(b)q(ecause)h(of)f +(all)h(the)f(pathnames)g(that)g(m)o(ust)f(b)q(e)i(follo)o(w)o(ed)f(when)120 +1105 y(lo)q(oking)23 b(up)f(completions)h(for)e(a)g(command.)39 +b(The)22 b(Bash)g(source)g(is)g(a)f(useful)i(reference)g(for)120 +1168 y(writing)16 b(custom)f(completion)h(functions.)1725 1349 +y(F)l(unction)-1899 b Fh(char)20 b(*)f Fg(username)p 412 1349 +V 19 w(completion)p 705 1349 V 21 w(function)k Ff(\()p Fn(char)14 +b(*text,)g(int)h(state)p Ff(\))120 1411 y Fo(A)i(completion)h(generator)e +(for)g(usernames.)24 b Fj(text)18 b Fo(con)o(tains)e(a)h(partial)g(username)g +(preceded)h(b)o(y)120 1473 y(a)f(random)g(c)o(haracter)f(\(usually)j(`)p +Fn(~)p Fo('\).)24 b(As)18 b(with)f(all)h(completion)h(generators,)d +Fj(state)j Fo(is)f(zero)f(on)120 1536 y(the)e(\014rst)g(call)h(and)g +(non-zero)f(for)g(subsequen)o(t)h(calls.)0 1801 y Fi(2.4.3)30 +b(Completion)15 b(V)-5 b(ariables)1736 1982 y Fo(V)l(ariable)-1899 +b Fh(Function)20 b(*)g Fg(rl)p 316 1982 V 21 w(completion)p +611 1982 V 21 w(en)n(try)p 764 1982 V 21 w(function)120 2044 +y Fo(A)d(p)q(oin)o(ter)h(to)f(the)g(generator)f(function)i(for)f +Fn(completion_matches)c(\(\))p Fo(.)25 b Fn(NULL)17 b Fo(means)g(to)g(use)120 +2106 y Fn(filename_entry_function)12 b(\(\))p Fo(,)j(the)g(default)h +(\014lename)g(completer.)1736 2287 y(V)l(ariable)-1899 b Fh(CPPFunction)21 +b(*)e Fg(rl)p 394 2287 V 21 w(attempted)p 674 2287 V 20 w(completion)p +968 2287 V 21 w(function)120 2350 y Fo(A)g(p)q(oin)o(ter)h(to)f(an)g +(alternativ)o(e)h(function)g(to)f(create)g(matc)o(hes.)32 b(The)20 +b(function)g(is)g(called)h(with)120 2412 y Fj(text)p Fo(,)e +Fj(start)p Fo(,)g(and)g Fj(end)p Fo(.)32 b Fj(start)19 b Fo(and)g +Fj(end)j Fo(are)c(indices)j(in)f Fn(rl_line_buffer)d Fo(sa)o(ying)i(what)g +(the)120 2474 y(b)q(oundaries)c(of)e Fj(text)h Fo(are.)19 b(If)13 +b(this)h(function)g(exists)g(and)g(returns)f Fn(NULL)p Fo(,)g(or)g(if)h(this) +f(v)m(ariable)i(is)f(set)120 2536 y(to)h Fn(NULL)p Fo(,)f(then)i +Fn(rl_complete)e(\(\))h Fo(will)i(call)g(the)e(v)m(alue)i(of)e +Fn(rl_completion_entry_funct)o(ion)120 2599 y Fo(to)g(generate)f(matc)o(hes,) +h(otherwise)g(the)h(arra)o(y)e(of)g(strings)h(returned)h(will)h(b)q(e)f +(used.)p eop +%%Page: 31 33 +32 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(31)1736 158 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 +158 18 3 v 21 w(completion)p 435 158 V 21 w(query)p 598 158 +V 21 w(items)120 221 y Fo(Up)h(to)e(this)i(man)o(y)f(items)h(will)h(b)q(e)f +(displa)o(y)o(ed)h(in)f(resp)q(onse)g(to)f(a)g(p)q(ossible-completions)j +(call.)120 283 y(After)16 b(that,)f(w)o(e)g(ask)h(the)g(user)g(if)g(she)g(is) +h(sure)f(she)g(w)o(an)o(ts)f(to)g(see)h(them)g(all.)23 b(The)16 +b(default)h(v)m(alue)120 345 y(is)f(100.)1736 524 y(V)l(ariable)-1899 +b Fh(char)20 b(*)f Fg(rl)p 211 524 V 21 w(basic)p 355 524 V +21 w(w)n(ord)p 500 524 V 21 w(break)p 661 524 V 20 w(c)n(haracters)120 +586 y Fo(The)12 b(basic)g(list)h(of)e(c)o(haracters)g(that)g(signal)h(a)g +(break)f(b)q(et)o(w)o(een)h(w)o(ords)f(for)g(the)h(completer)g(routine.)120 +648 y(The)17 b(default)h(v)m(alue)g(of)e(this)i(v)m(ariable)g(is)g(the)f(c)o +(haracters)f(whic)o(h)h(break)g(w)o(ords)g(for)f(completion)120 +711 y(in)g(Bash,)f(i.e.,)g Fn(")g(\\t\\n\\"\\\\'`@$><=;|&{\(")p +Fo(.)1736 889 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p +211 889 V 21 w(completer)p 480 889 V 21 w(w)n(ord)p 625 889 +V 20 w(break)p 785 889 V 20 w(c)n(haracters)120 952 y Fo(The)f(list)h(of)e(c) +o(haracters)g(that)g(signal)i(a)f(break)f(b)q(et)o(w)o(een)h(w)o(ords)g(for)f +Fn(rl_complete_internal)120 1014 y(\(\))p Fo(.)j(The)15 b(default)h(list)g +(is)f(the)h(v)m(alue)g(of)f Fn(rl_basic_word_break_charac)o(ters)p +Fo(.)1736 1192 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p +211 1192 V 21 w(sp)r(ecial)p 398 1192 V 22 w(pre\014xes)120 +1255 y Fo(The)d(list)h(of)e(c)o(haracters)g(that)g(are)h(w)o(ord)f(break)h(c) +o(haracters,)f(but)h(should)h(b)q(e)f(left)g(in)h Fj(text)f +Fo(when)120 1317 y(it)f(is)g(passed)g(to)f(the)g(completion)i(function.)k +(Programs)14 b(can)g(use)h(this)g(to)f(help)i(determine)g(what)120 +1379 y(kind)h(of)f(completing)i(to)e(do.)23 b(F)l(or)16 b(instance,)h(Bash)f +(sets)g(this)h(v)m(ariable)h(to)e Fn(")p Fo($)p Fn(@")f Fo(so)h(that)g(it)h +(can)120 1442 y(complete)f(shell)h(v)m(ariables)f(and)g(hostnames.)1736 +1620 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 1620 V 21 +w(ignore)p 316 1620 V 20 w(completion)p 610 1620 V 21 w(duplicates)120 +1682 y Fo(If)15 b(non-zero,)h(then)f(disallo)o(w)h(duplicates)h(in)f(the)g +(matc)o(hes.)j(Default)c(is)h(1.)1736 1861 y(V)l(ariable)-1899 +b Fh(int)20 b Fg(rl)p 140 1861 V 21 w(\014lename)p 369 1861 +V 20 w(completion)p 663 1861 V 21 w(desired)120 1923 y Fo(Non-zero)e(means)g +(that)f(the)g(results)i(of)e(the)h(matc)o(hes)f(are)h(to)f(b)q(e)h(treated)f +(as)h(\014lenames.)28 b(This)120 1986 y(is)16 b Fj(alw)o(a)o(ys)h +Fo(zero)e(on)g(en)o(try)l(,)g(and)h(can)g(only)g(b)q(e)g(c)o(hanged)f(within) +i(a)e(completion)i(en)o(try)e(generator)120 2048 y(function.)26 +b(If)18 b(it)f(is)h(set)f(to)f(a)h(non-zero)g(v)m(alue,)i(directory)e(names)g +(ha)o(v)o(e)g(a)g(slash)g(app)q(ended)i(and)120 2110 y(Readline)i(attempts)c +(to)g(quote)h(completed)i(\014lenames)f(if)f(they)h(con)o(tain)f(an)o(y)g(em) +o(b)q(edded)i(w)o(ord)120 2172 y(break)15 b(c)o(haracters.)1736 +2351 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 2351 V 21 +w(\014lename)p 369 2351 V 20 w(quoting)p 578 2351 V 21 w(desired)120 +2413 y Fo(Non-zero)c(means)g(that)g(the)g(results)h(of)e(the)i(matc)o(hes)e +(are)h(to)g(b)q(e)h(quoted)f(using)h(double)g(quotes)120 2476 +y(\(or)d(an)h(application-sp)q(eci\014)q(c)j(quoting)d(mec)o(hanism\))g(if)h +(the)f(completed)h(\014lename)g(con)o(tains)f(an)o(y)120 2538 +y(c)o(haracters)c(in)h Fn(rl_completer_word_break_cha)o(rs)p +Fo(.)k(This)c(is)g Fj(alw)o(a)o(ys)h Fo(non-zero)f(on)f(en)o(try)l(,)h(and) +120 2600 y(can)j(only)h(b)q(e)g(c)o(hanged)f(within)i(a)e(completion)h(en)o +(try)f(generator)f(function.)p eop +%%Page: 32 34 +33 bop 0 -83 a Fo(32)1449 b(GNU)15 b(Readline)i(Library)1736 +158 y(V)l(ariable)-1899 b Fh(Function)20 b(*)g Fg(rl)p 316 +158 18 3 v 21 w(ignore)p 492 158 V 20 w(some)p 639 158 V 19 +w(completions)p 955 158 V 21 w(function)120 221 y Fo(This)e(function,)g(if)g +(de\014ned,)h(is)f(called)h(b)o(y)e(the)h(completer)g(when)g(real)f +(\014lename)i(completion)f(is)120 283 y(done,)13 b(after)e(all)i(the)g(matc)o +(hing)f(names)g(ha)o(v)o(e)g(b)q(een)h(generated.)19 b(It)12 +b(is)h(passed)f(a)g Fn(NULL)g Fo(terminated)120 345 y(arra)o(y)k(of)h(matc)o +(hes.)26 b(The)17 b(\014rst)g(elemen)o(t)h(\()p Fn(matches[0])p +Fo(\))e(is)h(the)h(maximal)g(substring)f(common)120 407 y(to)f(all)h(matc)o +(hes.)22 b(This)17 b(function)g(can)f(re-arrange)g(the)g(list)h(of)f(matc)o +(hes)g(as)f(required,)j(but)e(eac)o(h)120 470 y(elemen)o(t)g(deleted)g(from)f +(the)g(arra)o(y)f(m)o(ust)h(b)q(e)h(freed.)1736 632 y(V)l(ariable)-1899 +b Fh(char)20 b(*)f Fg(rl)p 211 632 V 21 w(completer)p 480 632 +V 21 w(quote)p 640 632 V 21 w(c)n(haracters)120 694 y Fo(List)j(of)e(c)o +(haracters)g(whic)o(h)i(can)f(b)q(e)h(used)f(to)f(quote)h(a)g(substring)g(of) +f(the)h(line.)39 b(Completion)120 756 y(o)q(ccurs)17 b(on)f(the)h(en)o(tire)g +(substring,)g(and)f(within)i(the)e(substring)h Fn(rl_completer_word_break_) +120 818 y(characters)i Fo(are)g(treated)h(as)f(an)o(y)h(other)g(c)o +(haracter,)g(unless)h(they)f(also)g(app)q(ear)g(within)i(this)120 +881 y(list.)0 1088 y Fi(2.4.4)30 b(A)15 b(Short)g(Completion)g(Example)62 +1225 y Fo(Here)20 b(is)h(a)e(small)i(application)g(demonstrating)f(the)f(use) +i(of)e(the)h(GNU)f(Readline)k(library)l(.)34 b(It)20 b(is)g(called)0 +1287 y Fn(fileman)p Fo(,)14 b(and)i(the)f(source)g(co)q(de)h(resides)g(in)h +(`)p Fn(examples/fileman.c)p Fo(')o(.)h(This)e(sample)f(application)i(pro)o +(vides)0 1350 y(completion)f(of)f(command)g(names,)g(line)i(editing)f +(features,)f(and)g(access)g(to)g(the)g(history)g(list.)p eop +%%Page: 33 35 +34 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(33)120 158 y Fn(/*)24 b(fileman.c)e(--)i(A)g(tiny)f(application)f(which)h +(demonstrates)g(how)g(to)h(use)f(the)192 208 y(GNU)g(Readline)g(library.)46 +b(This)24 b(application)e(interactively)g(allows)h(users)192 +258 y(to)g(manipulate)g(files)g(and)g(their)g(modes.)h(*/)120 +358 y(#include)f()120 407 y(#include)g()120 +457 y(#include)g()120 507 y(#include)g()120 +557 y(#include)g()120 656 y(#include)g()120 +706 y(#include)g()120 806 y(extern)g(char)g(*getwd)g +(\(\);)120 856 y(extern)g(char)g(*xmalloc)g(\(\);)120 955 y(/*)h(The)f(names) +g(of)h(functions)e(that)i(actually)f(do)g(the)h(manipulation.)e(*/)120 +1005 y(int)h(com_list)g(\(\),)h(com_view)e(\(\),)i(com_rename)e(\(\),)i +(com_stat)f(\(\),)g(com_pwd)g(\(\);)120 1055 y(int)g(com_delete)g(\(\),)g +(com_help)g(\(\),)h(com_cd)f(\(\),)g(com_quit)g(\(\);)120 1155 +y(/*)h(A)f(structure)g(which)g(contains)g(information)f(on)i(the)f(commands)g +(this)g(program)192 1204 y(can)g(understand.)f(*/)120 1304 +y(typedef)h(struct)g({)168 1354 y(char)g(*name;)g(/*)h(User)f(printable)g +(name)g(of)h(the)f(function.)g(*/)168 1404 y(Function)f(*func;)i(/*)f +(Function)g(to)g(call)h(to)f(do)h(the)f(job.)h(*/)168 1453 +y(char)f(*doc;)g(/*)h(Documentation)e(for)h(this)h(function.)46 +b(*/)120 1503 y(})24 b(COMMAND;)120 1603 y(COMMAND)f(commands[])f(=)i({)168 +1653 y({)f("cd",)h(com_cd,)f("Change)f(to)i(directory)f(DIR")g(},)168 +1703 y({)g("delete",)g(com_delete,)f("Delete)h(FILE")h(},)168 +1752 y({)f("help",)g(com_help,)g("Display)g(this)g(text")g(},)168 +1802 y({)g("?",)h(com_help,)e("Synonym)h(for)h(`help'")f(},)168 +1852 y({)g("list",)g(com_list,)g("List)g(files)g(in)h(DIR")f(},)168 +1902 y({)g("ls",)h(com_list,)e("Synonym)h(for)g(`list'")g(},)168 +1952 y({)g("pwd",)g(com_pwd,)g("Print)g(the)h(current)f(working)g(directory") +f(},)168 2001 y({)h("quit",)g(com_quit,)g("Quit)g(using)g(Fileman")g(},)168 +2051 y({)g("rename",)g(com_rename,)f("Rename)h(FILE)h(to)f(NEWNAME")g(},)168 +2101 y({)g("stat",)g(com_stat,)g("Print)g(out)g(statistics)g(on)h(FILE")f(},) +168 2151 y({)g("view",)g(com_view,)g("View)g(the)h(contents)e(of)i(FILE")f +(},)168 2201 y({)g(\(char)h(*\)NULL,)f(\(Function)f(*\)NULL,)h(\(char)g +(*\)NULL)g(})120 2250 y(};)120 2350 y(/*)h(Forward)e(declarations.)h(*/)120 +2400 y(char)g(*stripwhite)g(\(\);)120 2450 y(COMMAND)g(*find_command)f(\(\);) +120 2549 y(/*)i(The)f(name)g(of)h(this)f(program,)g(as)h(taken)f(from)g +(argv[0].)g(*/)120 2599 y(char)g(*progname;)p eop +%%Page: 34 36 +35 bop 0 -83 a Fo(34)1449 b(GNU)15 b(Readline)i(Library)120 +208 y Fn(/*)24 b(When)f(non-zero,)g(this)g(global)g(means)g(the)h(user)f(is)g +(done)h(using)f(this)g(program.)g(*/)120 258 y(int)g(done;)120 +358 y(char)g(*)120 407 y(dupstr)g(\(s\))239 457 y(int)h(s;)120 +507 y({)168 557 y(char)f(*r;)168 656 y(r)g(=)h(xmalloc)f(\(strlen)g(\(s\))g +(+)h(1\);)168 706 y(strcpy)f(\(r,)g(s\);)168 756 y(return)g(\(r\);)120 +806 y(})120 906 y(main)g(\(argc,)g(argv\))239 955 y(int)h(argc;)239 +1005 y(char)g(**argv;)120 1055 y({)168 1105 y(char)f(*line,)g(*s;)168 +1204 y(progname)f(=)i(argv[0];)168 1304 y(initialize_readline)d(\(\);)i(/*)h +(Bind)f(our)h(completer.)e(*/)168 1404 y(/*)h(Loop)h(reading)f(and)g +(executing)g(lines)g(until)g(the)g(user)h(quits.)f(*/)168 1453 +y(for)g(\()h(;)g(done)f(==)h(0;)f(\))215 1503 y({)263 1553 +y(line)g(=)h(readline)f(\("FileMan:)f("\);)263 1653 y(if)i(\(!line\))311 +1703 y(break;)263 1802 y(/*)g(Remove)f(leading)g(and)g(trailing)g(whitespace) +f(from)i(the)f(line.)335 1852 y(Then,)g(if)h(there)f(is)g(anything)g(left,)g +(add)h(it)f(to)h(the)f(history)g(list)335 1902 y(and)g(execute)g(it.)h(*/)263 +1952 y(s)g(=)g(stripwhite)e(\(line\);)263 2051 y(if)i(\(*s\))311 +2101 y({)359 2151 y(add_history)e(\(s\);)359 2201 y(execute_line)g(\(s\);)311 +2250 y(})263 2350 y(free)h(\(line\);)215 2400 y(})168 2450 +y(exit)g(\(0\);)120 2500 y(})120 2599 y(/*)h(Execute)e(a)i(command)f(line.)g +(*/)p eop +%%Page: 35 37 +36 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(35)120 158 y Fn(int)120 208 y(execute_line)22 b(\(line\))239 +258 y(char)i(*line;)120 308 y({)168 358 y(register)e(int)i(i;)168 +407 y(COMMAND)f(*command;)168 457 y(char)g(*word;)168 557 y(/*)g(Isolate)g +(the)h(command)f(word.)g(*/)168 607 y(i)g(=)h(0;)168 656 y(while)f(\(line[i]) +g(&&)g(whitespace)g(\(line[i]\)\))215 706 y(i++;)168 756 y(word)g(=)h(line)f +(+)h(i;)168 856 y(while)f(\(line[i])g(&&)g(!whitespace)g(\(line[i]\)\))215 +906 y(i++;)168 1005 y(if)g(\(line[i]\))215 1055 y(line[i++])g(=)h('\\0';)168 +1155 y(command)f(=)g(find_command)g(\(word\);)168 1254 y(if)g(\(!command\)) +215 1304 y({)263 1354 y(fprintf)g(\(stderr,)g("\045s:)g(No)h(such)f(command)g +(for)g(FileMan.\\n",)g(word\);)263 1404 y(return)g(\(-1\);)215 +1453 y(})168 1553 y(/*)g(Get)h(argument)f(to)g(command,)g(if)g(any.)h(*/)168 +1603 y(while)f(\(whitespace)f(\(line[i]\)\))215 1653 y(i++;)168 +1752 y(word)h(=)h(line)f(+)h(i;)168 1852 y(/*)f(Call)h(the)f(function.)g(*/) +168 1902 y(return)g(\(\(*\(command->func\)\))e(\(word\)\);)120 +1952 y(})120 2051 y(/*)j(Look)f(up)g(NAME)h(as)f(the)h(name)f(of)h(a)f +(command,)g(and)h(return)f(a)g(pointer)g(to)h(that)192 2101 +y(command.)46 b(Return)23 b(a)h(NULL)f(pointer)g(if)h(NAME)f(isn't)g(a)h +(command)f(name.)g(*/)120 2151 y(COMMAND)g(*)120 2201 y(find_command)f +(\(name\))239 2250 y(char)i(*name;)120 2300 y({)168 2350 y(register)e(int)i +(i;)168 2450 y(for)f(\(i)h(=)f(0;)h(commands[i].name;)e(i++\))215 +2500 y(if)i(\(strcmp)f(\(name,)g(commands[i].name\))f(==)h(0\))263 +2549 y(return)g(\(&commands[i]\);)p eop +%%Page: 36 38 +37 bop 0 -83 a Fo(36)1449 b(GNU)15 b(Readline)i(Library)168 +208 y Fn(return)23 b(\(\(COMMAND)f(*\)NULL\);)120 258 y(})120 +358 y(/*)i(Strip)f(whitespace)f(from)i(the)f(start)g(and)h(end)f(of)h +(STRING.)46 b(Return)24 b(a)f(pointer)192 407 y(into)g(STRING.)g(*/)120 +457 y(char)g(*)120 507 y(stripwhite)f(\(string\))239 557 y(char)i(*string;) +120 607 y({)168 656 y(register)e(char)i(*s,)f(*t;)168 756 y(for)g(\(s)h(=)f +(string;)g(whitespace)g(\(*s\);)g(s++\))215 806 y(;)168 906 +y(if)g(\(*s)h(==)f(0\))215 955 y(return)g(\(s\);)168 1055 y(t)g(=)h(s)g(+)g +(strlen)f(\(s\))g(-)h(1;)168 1105 y(while)f(\(t)g(>)h(s)g(&&)g(whitespace)e +(\(*t\)\))215 1155 y(t--;)168 1204 y(*++t)h(=)h('\\0';)168 +1304 y(return)f(s;)120 1354 y(})120 1453 y(/*)h(***********************)o +(*******)o(********)o(*******)o(*******)o(********)o(****)d(*/)120 +1503 y(/*)1575 b(*/)120 1553 y(/*)429 b(Interface)23 b(to)g(Readline)g +(Completion)381 b(*/)120 1603 y(/*)1575 b(*/)120 1653 y(/*)24 +b(***********************)o(*******)o(********)o(*******)o(*******)o +(********)o(****)d(*/)120 1752 y(char)i(*command_generator)f(\(\);)120 +1802 y(char)h(**fileman_completion)e(\(\);)120 1902 y(/*)j(Tell)f(the)g(GNU)h +(Readline)f(library)f(how)i(to)g(complete.)46 b(We)24 b(want)f(to)h(try)f(to) +h(complete)192 1952 y(on)f(command)g(names)g(if)h(this)f(is)h(the)f(first)g +(word)h(in)f(the)h(line,)f(or)h(on)f(filenames)192 2001 y(if)g(not.)g(*/)120 +2051 y(initialize_readline)e(\(\))120 2101 y({)168 2151 y(/*)i(Allow)g +(conditional)g(parsing)g(of)g(the)h(~/.inputrc)e(file.)h(*/)168 +2201 y(rl_readline_name)e(=)j("FileMan";)168 2300 y(/*)f(Tell)h(the)f +(completer)g(that)g(we)h(want)f(a)h(crack)f(first.)g(*/)168 +2350 y(rl_attempted_completion_)o(functio)o(n)e(=)j(\(CPPFunction)e +(*\)fileman_completion;)120 2400 y(})p eop +%%Page: 37 39 +38 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(37)120 158 y Fn(/*)24 b(Attempt)e(to)i(complete)f(on)g(the)h(contents)f(of) +g(TEXT.)47 b(START)23 b(and)h(END)f(show)h(the)192 208 y(region)f(of)g(TEXT)h +(that)f(contains)g(the)g(word)g(to)h(complete.)46 b(We)24 b(can)g(use)f(the) +192 258 y(entire)g(line)g(in)h(case)f(we)g(want)h(to)f(do)h(some)f(simple)g +(parsing.)47 b(Return)23 b(the)192 308 y(array)g(of)g(matches,)g(or)h(NULL)f +(if)h(there)f(aren't)g(any.)g(*/)120 358 y(char)g(**)120 407 +y(fileman_completion)e(\(text,)i(start,)g(end\))239 457 y(char)h(*text;)239 +507 y(int)g(start,)f(end;)120 557 y({)168 607 y(char)g(**matches;)168 +706 y(matches)g(=)g(\(char)h(**\)NULL;)168 806 y(/*)f(If)h(this)f(word)h(is)f +(at)h(the)f(start)g(of)h(the)f(line,)h(then)f(it)g(is)h(a)g(command)239 +856 y(to)g(complete.)46 b(Otherwise)23 b(it)h(is)f(the)h(name)f(of)h(a)f +(file)h(in)f(the)h(current)239 906 y(directory.)f(*/)168 955 +y(if)g(\(start)g(==)h(0\))215 1005 y(matches)f(=)h(completion_matches)d +(\(text,)j(command_generator\);)168 1105 y(return)f(\(matches\);)120 +1155 y(})120 1254 y(/*)h(Generator)e(function)h(for)g(command)g(completion.) +47 b(STATE)23 b(lets)g(us)h(know)f(whether)192 1304 y(to)g(start)g(from)h +(scratch;)e(without)h(any)h(state)f(\(i.e.)g(STATE)g(==)h(0\),)f(then)h(we) +192 1354 y(start)f(at)g(the)h(top)f(of)h(the)f(list.)g(*/)120 +1404 y(char)g(*)120 1453 y(command_generator)f(\(text,)h(state\))239 +1503 y(char)h(*text;)239 1553 y(int)g(state;)120 1603 y({)168 +1653 y(static)f(int)g(list_index,)g(len;)168 1703 y(char)g(*name;)168 +1802 y(/*)g(If)h(this)f(is)h(a)g(new)f(word)g(to)h(complete,)f(initialize)f +(now.)47 b(This)24 b(includes)239 1852 y(saving)f(the)h(length)f(of)g(TEXT)h +(for)f(efficiency,)g(and)g(initializing)f(the)i(index)239 1902 +y(variable)f(to)h(0.)f(*/)168 1952 y(if)g(\(!state\))215 2001 +y({)263 2051 y(list_index)g(=)g(0;)263 2101 y(len)h(=)f(strlen)g(\(text\);) +215 2151 y(})168 2250 y(/*)g(Return)g(the)h(next)f(name)g(which)h(partially)e +(matches)h(from)g(the)h(command)f(list.)g(*/)168 2300 y(while)g(\(name)g(=)h +(commands[list_index].name)o(\))215 2350 y({)263 2400 y(list_index++;)263 +2500 y(if)g(\(strncmp)f(\(name,)g(text,)g(len\))g(==)h(0\))311 +2549 y(return)f(\(dupstr\(name\)\);)215 2599 y(})p eop +%%Page: 38 40 +39 bop 0 -83 a Fo(38)1449 b(GNU)15 b(Readline)i(Library)168 +208 y Fn(/*)23 b(If)h(no)f(names)h(matched,)e(then)i(return)f(NULL.)g(*/)168 +258 y(return)g(\(\(char)g(*\)NULL\);)120 308 y(})120 407 y(/*)h +(***********************)o(*******)o(********)o(*******)o(*******)o(********) +o(****)d(*/)120 457 y(/*)1575 b(*/)120 507 y(/*)549 b(FileMan)22 +b(Commands)644 b(*/)120 557 y(/*)1575 b(*/)120 607 y(/*)24 +b(***********************)o(*******)o(********)o(*******)o(*******)o +(********)o(****)d(*/)120 706 y(/*)j(String)f(to)g(pass)h(to)f(system)g +(\(\).)47 b(This)24 b(is)f(for)h(the)f(LIST,)g(VIEW)h(and)f(RENAME)192 +756 y(commands.)f(*/)120 806 y(static)h(char)g(syscom[1024];)120 +906 y(/*)h(List)f(the)g(file\(s\))g(named)g(in)h(arg.)f(*/)120 +955 y(com_list)g(\(arg\))239 1005 y(char)h(*arg;)120 1055 y({)168 +1105 y(if)f(\(!arg\))215 1155 y(arg)h(=)g("";)168 1254 y(sprintf)f(\(syscom,) +f("ls)i(-FClg)f(\045s",)g(arg\);)168 1304 y(return)g(\(system)g +(\(syscom\)\);)120 1354 y(})120 1453 y(com_view)g(\(arg\))239 +1503 y(char)h(*arg;)120 1553 y({)168 1603 y(if)f(\(!valid_argument)f +(\("view",)h(arg\)\))215 1653 y(return)g(1;)168 1752 y(sprintf)g(\(syscom,)f +("more)i(\045s",)f(arg\);)168 1802 y(return)g(\(system)g(\(syscom\)\);)120 +1852 y(})120 1952 y(com_rename)f(\(arg\))239 2001 y(char)i(*arg;)120 +2051 y({)168 2101 y(too_dangerous)e(\("rename"\);)168 2151 +y(return)h(\(1\);)120 2201 y(})120 2300 y(com_stat)g(\(arg\))239 +2350 y(char)h(*arg;)120 2400 y({)168 2450 y(struct)f(stat)g(finfo;)168 +2549 y(if)g(\(!valid_argument)f(\("stat",)h(arg\)\))215 2599 +y(return)g(\(1\);)p eop +%%Page: 39 41 +40 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(39)168 208 y Fn(if)23 b(\(stat)g(\(arg,)h(&finfo\))f(==)g(-1\))215 +258 y({)263 308 y(perror)g(\(arg\);)263 358 y(return)g(\(1\);)215 +407 y(})168 507 y(printf)g(\("Statistics)f(for)h(`\045s':\\n",)g(arg\);)168 +607 y(printf)g(\("\045s)g(has)h(\045d)f(link\045s,)g(and)g(is)h(\045d)g +(byte\045s)f(in)g(length.\\n",)g(arg,)359 656 y(finfo.st_nlink,)359 +706 y(\(finfo.st_nlink)e(==)j(1\))g(?)f("")h(:)g("s",)359 756 +y(finfo.st_size,)359 806 y(\(finfo.st_size)e(==)h(1\))h(?)f("")h(:)g("s"\);) +168 856 y(printf)f(\("Inode)g(Last)g(Change)g(at:)g(\045s",)h(ctime)f +(\(&finfo.st_ctime\)\);)168 906 y(printf)g(\(")143 b(Last)23 +b(access)g(at:)g(\045s",)h(ctime)f(\(&finfo.st_atime\)\);)168 +955 y(printf)g(\(")95 b(Last)23 b(modified)g(at:)g(\045s",)h(ctime)f +(\(&finfo.st_mtime\)\);)168 1005 y(return)g(\(0\);)120 1055 +y(})120 1155 y(com_delete)f(\(arg\))239 1204 y(char)i(*arg;)120 +1254 y({)168 1304 y(too_dangerous)e(\("delete"\);)168 1354 +y(return)h(\(1\);)120 1404 y(})120 1503 y(/*)h(Print)f(out)g(help)h(for)f +(ARG,)g(or)h(for)f(all)h(of)f(the)h(commands)f(if)g(ARG)h(is)192 +1553 y(not)f(present.)g(*/)120 1603 y(com_help)g(\(arg\))239 +1653 y(char)h(*arg;)120 1703 y({)168 1752 y(register)e(int)i(i;)168 +1802 y(int)f(printed)g(=)h(0;)168 1902 y(for)f(\(i)h(=)f(0;)h +(commands[i].name;)e(i++\))215 1952 y({)263 2001 y(if)i(\(!*arg)f(||)g +(\(strcmp)g(\(arg,)g(commands[i].name\))f(==)i(0\)\))311 2051 +y({)359 2101 y(printf)f(\("\045s\\t\\t\045s.\\n",)e(commands[i].name,)h +(commands[i].doc\);)359 2151 y(printed++;)311 2201 y(})215 +2250 y(})168 2350 y(if)h(\(!printed\))215 2400 y({)263 2450 +y(printf)g(\("No)h(commands)e(match)h(`\045s'.)48 b(Possibilties)22 +b(are:\\n",)h(arg\);)p eop +%%Page: 40 42 +41 bop 0 -83 a Fo(40)1449 b(GNU)15 b(Readline)i(Library)263 +208 y Fn(for)24 b(\(i)f(=)h(0;)g(commands[i].name;)d(i++\))311 +258 y({)359 308 y(/*)i(Print)g(in)h(six)f(columns.)g(*/)359 +358 y(if)g(\(printed)g(==)h(6\))406 407 y({)454 457 y(printed)f(=)h(0;)454 +507 y(printf)f(\("\\n"\);)406 557 y(})359 656 y(printf)g(\("\045s\\t",)f +(commands[i].name\);)359 706 y(printed++;)311 756 y(})263 856 +y(if)i(\(printed\))311 906 y(printf)f(\("\\n"\);)215 955 y(})168 +1005 y(return)g(\(0\);)120 1055 y(})120 1155 y(/*)h(Change)f(to)g(the)h +(directory)e(ARG.)i(*/)120 1204 y(com_cd)f(\(arg\))239 1254 +y(char)h(*arg;)120 1304 y({)168 1354 y(if)f(\(chdir)g(\(arg\))h(==)f(-1\))215 +1404 y({)263 1453 y(perror)g(\(arg\);)263 1503 y(return)g(1;)215 +1553 y(})168 1653 y(com_pwd)g(\(""\);)168 1703 y(return)g(\(0\);)120 +1752 y(})120 1852 y(/*)h(Print)f(out)g(the)h(current)f(working)f(directory.)h +(*/)120 1902 y(com_pwd)g(\(ignore\))239 1952 y(char)h(*ignore;)120 +2001 y({)168 2051 y(char)f(dir[1024],)g(*s;)168 2151 y(s)g(=)h(getwd)f +(\(dir\);)168 2201 y(if)g(\(s)h(==)f(0\))215 2250 y({)263 2300 +y(printf)g(\("Error)g(getting)g(pwd:)g(\045s\\n",)g(dir\);)263 +2350 y(return)g(1;)215 2400 y(})168 2500 y(printf)g(\("Current)f(directory)h +(is)h(\045s\\n",)f(dir\);)168 2549 y(return)g(0;)120 2599 y(})p +eop +%%Page: 41 43 +42 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994 +b(41)120 208 y Fn(/*)24 b(The)f(user)g(wishes)g(to)h(quit)f(using)g(this)h +(program.)46 b(Just)24 b(set)f(DONE)h(non-zero.)e(*/)120 258 +y(com_quit)h(\(arg\))239 308 y(char)h(*arg;)120 358 y({)168 +407 y(done)f(=)h(1;)168 457 y(return)f(\(0\);)120 507 y(})120 +607 y(/*)h(Function)e(which)i(tells)f(you)g(that)g(you)h(can't)f(do)h(this.)f +(*/)120 656 y(too_dangerous)f(\(caller\))239 706 y(char)i(*caller;)120 +756 y({)168 806 y(fprintf)f(\(stderr,)382 856 y("\045s:)h(Too)f(dangerous)g +(for)g(me)h(to)g(distribute.)46 b(Write)23 b(it)h(yourself.\\n",)382 +906 y(caller\);)120 955 y(})120 1055 y(/*)g(Return)f(non-zero)f(if)i(ARG)f +(is)h(a)g(valid)f(argument)g(for)g(CALLER,)g(else)g(print)192 +1105 y(an)g(error)g(message)g(and)h(return)f(zero.)g(*/)120 +1155 y(int)120 1204 y(valid_argument)f(\(caller,)h(arg\))239 +1254 y(char)h(*caller,)e(*arg;)120 1304 y({)168 1354 y(if)h(\(!arg)g(||)h +(!*arg\))215 1404 y({)263 1453 y(fprintf)f(\(stderr,)g("\045s:)g(Argument)g +(required.\\n",)f(caller\);)263 1503 y(return)h(\(0\);)215 +1553 y(})168 1653 y(return)g(\(1\);)120 1703 y(})p eop +%%Page: 42 44 +43 bop 0 -83 a Fo(42)1449 b(GNU)15 b(Readline)i(Library)p eop +%%Page: 43 45 +44 bop 0 -83 a Fo(Concept)15 b(Index)1616 b(43)0 158 y Fk(Concept)16 +b(Index)0 405 y Fm(I)0 471 y Fe(in)o(teraction,)f(readline)5 +b Fd(:)j(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)17 +b Fe(1)0 579 y Fm(K)0 646 y Fe(Kill)e(ring)8 b Fd(:)f(:)f(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 +b Fe(3)0 704 y(Killing)16 b(text)8 b Fd(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)20 b Fe(3)1015 +405 y Fm(R)1015 471 y Fe(readline,)15 b(function)8 b Fd(:)g(:)e(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(15)1015 637 +y Fm(Y)1015 704 y Fe(Y)m(anking)15 b(text)t Fd(:)6 b(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)17 b +Fe(3)p eop +%%Page: 44 46 +45 bop 0 -83 a Fo(44)1449 b(GNU)15 b(Readline)i(Library)p eop +%%Page: 45 47 +46 bop 0 -83 a Fo(F)l(unction)16 b(and)f(V)l(ariable)i(Index)1337 +b(45)0 158 y Fk(F)-7 b(unction)15 b(and)g(V)-7 b(ariable)14 +b(Index)0 399 y Fm($)0 466 y Fc($else)t Fd(:)t(:)6 b(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)17 b Fe(8)0 524 y Fc($endif)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)24 +b Fe(8)0 582 y Fc($if)7 b Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)19 +b Fe(7)0 699 y Fm(A)0 765 y Fc(abort)11 b(\(C-g\))c Fd(:)t(:)f(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)20 b +Fe(13)0 824 y Fc(accept-lin)o(e)10 b(\(Newline)o(,)g(Return\))c +Fd(:)s(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)19 b Fe(9)0 882 y Fc(alphabetic)t Fd(:)s(:)7 b(:)f(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(25)0 +999 y Fm(B)0 1065 y Fc(backward-c)o(ha)o(r)10 b(\(C-b\))d Fd(:)t(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)19 b Fe(8)0 1124 y Fc(backward-d)o(el)o(ete)o +(-c)o(har)9 b(\(Rubout\))e Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(10)0 1182 y Fc(backward-k)o(il)o(l-l)o(in)o(e) +10 b(\(C-x)h(Rubout\))d Fd(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)24 b Fe(11)0 1240 y Fc(backward-k)o(il)o(l-w)o(or)o(d)10 +b(\(M-DEL\))5 b Fd(:)t(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(11)0 1298 y Fc(backward-w)o(or)o(d)10 +b(\(M-b\))d Fd(:)t(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)19 +b Fe(8)0 1356 y Fc(beginning-)o(of)o(-hi)o(st)o(ory)9 b(\(M-<\))d +Fd(:)f(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)g(:)g(:)g(:)19 b Fe(9)0 1414 y Fc(beginning-)o(of)o(-li)o(ne)9 +b(\(C-a\))g Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) +f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(8)0 1472 y(b)q(ell-st)o(yle)s +Fd(:)9 b(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)16 b Fe(5)0 1590 y Fm(C)0 1656 y +Fc(call-last-)o(kb)o(d-m)o(ac)o(ro)9 b(\(C-x)j(e\))7 b Fd(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)20 +b Fe(12)0 1714 y Fc(capitalize)o(-w)o(ord)9 b(\(M-c\))s Fd(:)t(:)d(:)g(:)h(:) +f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)16 b Fe(11)0 1772 y Fc(clear-scre)o(en)9 b(\(C-l\))f +Fd(:)t(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:) +f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(9)0 +1830 y(commen)o(t-b)q(egin)13 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(5)0 1888 y Fc(complete)10 +b(\(TAB\))t Fd(:)s(:)c(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)16 b Fe(12)0 1947 y(completion-query-i)q(tems)d Fd(:)6 b(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)23 b Fe(6)0 2005 y Fc(completion)p 201 2005 +12 2 v 10 w(matches)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)19 +b Fe(29)0 2063 y(con)o(v)o(ert-meta)t Fd(:)6 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)16 b Fe(5)0 +2180 y Fm(D)0 2247 y Fc(delete-cha)o(r)10 b(\(C-d\))e Fd(:)t(:)e(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(10)0 2305 y Fc(delete-hor)o(iz)o(ont)o +(al)o(-sp)o(ace)9 b(\(\))c Fd(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(11)0 2363 y +Fc(digit-argu)o(me)o(nt)9 b(\(M-0,)i(M-1,)h(...)f(M--\))5 b +Fd(:)g(:)h(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 +b Fe(12)0 2421 y Fc(digit)p 102 2421 V 12 w(p)s Fd(:)6 b(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)16 +b Fe(26)0 2479 y Fc(digit)p 102 2479 V 12 w(value)7 b Fd(:)t(:)f(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 +b Fe(26)0 2537 y Fc(ding)t Fd(:)5 b(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)17 +b Fe(25)0 2595 y Fc(do-upperca)o(se)o(-ve)o(rs)o(ion)9 b(\(M-a,)i(M-b,)g +(...\))d Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b +Fe(13)0 2653 y Fc(downcase-w)o(or)o(d)10 b(\(M-l\))c Fd(:)t(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(11)1015 399 y Fc(dump-functi)o(on)o(s)10 +b(\(\))e Fd(:)d(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 +b Fe(13)1015 513 y Fm(E)1015 579 y Fe(editing-mo)q(de)t Fd(:)9 +b(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)17 b Fe(5)1015 637 y Fc(end-kbd-mac)o(ro)9 b(\(C-x)j(\)\))7 +b Fd(:)t(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(12)1015 695 +y Fc(end-of-hist)o(or)o(y)10 b(\(M->\))c Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)19 b Fe(9)1015 754 y Fc(end-of-line)9 b(\(C-e\))e +Fd(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)22 +b Fe(8)1015 812 y(expand-tilde)10 b Fd(:)f(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(6)1015 925 +y Fm(F)1015 992 y Fc(filename)p 1177 992 V 12 w(completi)o(on)p +1388 992 V 11 w(function)5 b Fd(:)s(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(30)1015 1050 y Fc(forward-cha)o(r) +10 b(\(C-f\))e Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21 +b Fe(8)1015 1108 y Fc(forward-sea)o(rc)o(h-h)o(ist)o(or)o(y)10 +b(\(C-s\))t Fd(:)t(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)17 b Fe(9)1015 1166 y Fc(forward-wor)o(d)10 +b(\(M-f\))e Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21 +b Fe(8)1015 1224 y Fc(free)p 1097 1224 V 13 w(undo)p 1190 1224 +V 13 w(list)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)19 b Fe(23)1015 1338 y Fm(H)1015 1404 y Fc(history-sea)o(rc)o(h-b)o +(ack)o(wa)o(rd)9 b(\(\))d Fd(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)19 b Fe(9)1015 1462 +y Fc(history-sea)o(rc)o(h-f)o(orw)o(ar)o(d)10 b(\(\))e Fd(:)d(:)h(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 +b Fe(9)1015 1521 y(horizon)o(tal-scrol)q(l)q(-mo)q(de)t Fd(:)9 +b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(5)1015 1634 +y Fm(I)1015 1701 y Fc(insert-comp)o(le)o(tio)o(ns)9 b(\(\))s +Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)16 b Fe(12)1015 1814 y +Fm(K)1015 1881 y Fe(k)o(eymap)6 b Fd(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 +b Fe(6)1015 1939 y Fc(kill-line)10 b(\(C-k\))f Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(11)1015 1997 y Fc(kill-whole-)o(li)o +(ne)10 b(\(\))d Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)20 +b Fe(11)1015 2055 y Fc(kill-word)10 b(\(M-d\))f Fd(:)d(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(11)1015 2169 y Fm(L)1015 +2235 y Fc(lowercase)p 1197 2235 V 11 w(p)7 b Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(26)1015 +2349 y Fm(M)1015 2415 y Fe(mark-mo)q(di\014ed-li)q(nes)8 b +Fd(:)h(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)20 +b Fe(5)1015 2473 y(meta-\015ag)11 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 +b Fe(5)1015 2587 y Fm(N)1015 2653 y Fc(next-histor)o(y)10 b(\(C-n\))e +Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21 b Fe(9)p +eop +%%Page: 46 48 +47 bop 0 -83 a Fo(46)1449 b(GNU)15 b(Readline)i(Library)0 158 +y Fc(non-increm)o(en)o(tal)o(-f)o(orw)o(ard)o(-s)o(ear)o(ch)o(-hi)o(st)o(ory) +9 b(\(M-n\))g Fd(:)t(:)22 b Fe(9)0 216 y Fc(non-increm)o(en)o(tal)o(-r)o(eve) +o(rse)o(-s)o(ear)o(ch)o(-hi)o(st)o(ory)9 b(\(M-p\))g Fd(:)t(:)22 +b Fe(9)0 275 y Fc(numeric)9 b Fd(:)s(:)e(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(25)0 +394 y Fm(O)0 460 y Fe(output-meta)8 b Fd(:)g(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(5)0 +580 y Fm(P)0 646 y Fc(possible-c)o(om)o(ple)o(ti)o(ons)9 b(\(M-?\))c +Fd(:)g(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)18 b Fe(12)0 704 y Fc(prefix-met)o(a)10 b(\(ESC\))e +Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(13)0 +762 y Fc(previous-h)o(is)o(tor)o(y)10 b(\(C-p\))f Fd(:)d(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)24 b Fe(9)0 882 y Fm(Q)0 948 y Fc(quoted-ins)o(er)o(t)10 +b(\(C-q,)h(C-v\))e Fd(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(10)0 1068 y +Fm(R)0 1134 y Fc(re-read-in)o(it)o(-fi)o(le)9 b(\(C-x)i(C-r\))c +Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:) +g(:)g(:)20 b Fe(13)0 1192 y Fc(readline)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 +b Fe(15)0 1250 y Fc(redraw-cur)o(re)o(nt-)o(li)o(ne)9 b(\(\))i +Fd(:)6 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(9)0 1308 y Fc(reverse-se)o(ar)o +(ch-)o(hi)o(sto)o(ry)9 b(\(C-r\))t Fd(:)t(:)d(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)16 b Fe(9)0 1367 +y Fc(revert-lin)o(e)10 b(\(M-r\))e Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)21 b Fe(13)0 1425 y Fc(rl)p 42 1425 12 2 v 13 w(add)p +115 1425 V 13 w(defun)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(20)0 1483 y Fc(rl)p 42 1483 +V 13 w(add)p 115 1483 V 13 w(undo)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 b Fe(23)0 1541 +y Fc(rl)p 42 1541 V 13 w(attempted)p 235 1541 V 11 w(completion)p +445 1541 V 10 w(function)15 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)h(:)17 b Fe(30)0 1599 y Fc(rl)p 42 1599 V 13 w(basic)p +155 1599 V 13 w(word)p 248 1599 V 12 w(break)p 360 1599 V 12 +w(characters)i Fd(:)6 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)23 b Fe(31)0 1657 y Fc(rl)p 42 1657 V 13 w(begin)p +155 1657 V 13 w(undo)p 248 1657 V 12 w(group)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)23 b Fe(23)0 1715 y Fc(rl)p 42 1715 V 13 +w(bind)p 135 1715 V 13 w(key)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 b Fe(21)0 1773 y +Fc(rl)p 42 1773 V 13 w(bind)p 135 1773 V 13 w(key)p 208 1773 +V 13 w(in)p 261 1773 V 13 w(map)6 b Fd(:)f(:)h(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)19 b Fe(21)0 1831 y Fc(rl)p 42 1831 V 13 w(clear)p +155 1831 V 13 w(message)s Fd(:)s(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)16 b Fe(25)0 1890 y Fc(rl)p 42 1890 V 13 w(complete)7 +b Fd(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 +b Fe(28,)13 b(29)0 1948 y Fc(rl)p 42 1948 V 13 w(complete)p +215 1948 V 11 w(internal)7 b Fd(:)s(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)19 +b Fe(29)0 2006 y Fc(rl)p 42 2006 V 13 w(completer)p 235 2006 +V 11 w(quote)p 346 2006 V 12 w(characters)f Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)21 b Fe(32)0 2064 +y Fc(rl)p 42 2064 V 13 w(completer)p 235 2064 V 11 w(word)p +326 2064 V 13 w(break)p 439 2064 V 12 w(character)o(s)15 b +Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b +Fe(31)0 2122 y Fc(rl)p 42 2122 V 13 w(completion)p 254 2122 +V 11 w(entry)p 366 2122 V 12 w(function)c Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(29,)c(30)0 2180 y Fc(rl)p +42 2180 V 13 w(completion)p 254 2180 V 11 w(query)p 366 2180 +V 12 w(items)j Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(30)0 2238 y Fc(rl)p +42 2238 V 13 w(copy)p 135 2238 V 13 w(keymap)6 b Fd(:)s(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)18 b Fe(20)0 2296 +y Fc(rl)p 42 2296 V 13 w(copy)p 135 2296 V 13 w(text)8 b Fd(:)d(:)h(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)21 +b Fe(25)0 2355 y Fc(rl)p 42 2355 V 13 w(delete)p 175 2355 V +12 w(text)6 b Fd(:)t(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)18 b Fe(25)0 2413 y Fc(rl)p 42 2413 V 13 w(discard)p +195 2413 V 12 w(keymap)8 b Fd(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)23 b Fe(20)0 2471 y Fc(rl)p 42 2471 V 13 w(do)p 95 2471 +V 14 w(undo)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(24)0 2529 y Fc(rl)p 42 2529 +V 13 w(done)17 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)18 b Fe(18)0 2587 y +Fc(rl)p 42 2587 V 13 w(end)h Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)19 b +Fe(18)0 2645 y Fc(rl)p 42 2645 V 13 w(end)p 115 2645 V 13 w(undo)p +208 2645 V 13 w(group)5 b Fd(:)t(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)17 b Fe(23)1015 158 y Fc(rl)p 1057 158 V 14 w(filename)p +1231 158 V 11 w(completio)o(n)p 1441 158 V 11 w(desired)g Fd(:)7 +b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)20 +b Fe(31)1015 216 y Fc(rl)p 1057 216 V 14 w(filename)p 1231 +216 V 11 w(quoting)p 1382 216 V 11 w(desired)h Fd(:)7 b(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)24 b +Fe(31)1015 275 y Fc(rl)p 1057 275 V 14 w(forced)p 1191 275 +V 12 w(update)p 1323 275 V 11 w(display)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)17 +b Fe(24)1015 333 y Fc(rl)p 1057 333 V 14 w(function)p 1231 +333 V 11 w(of)p 1282 333 V 13 w(keyseq)8 b Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)21 b Fe(22)1015 391 y Fc(rl)p 1057 391 V 14 w(generic)p +1211 391 V 11 w(bind)t Fd(:)5 b(:)h(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)18 b Fe(22)1015 449 y Fc(rl)p 1057 449 V 14 +w(get)p 1131 449 V 13 w(keymap)7 b Fd(:)t(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)20 b Fe(21)1015 507 y Fc(rl)p +1057 507 V 14 w(get)p 1131 507 V 13 w(keymap)p 1264 507 V 12 +w(by)p 1316 507 V 13 w(name)9 b Fd(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)24 +b Fe(21)1015 565 y Fc(rl)p 1057 565 V 14 w(ignore)p 1191 565 +V 12 w(completio)o(n)p 1402 565 V 11 w(duplicate)o(s)16 b Fd(:)6 +b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)19 +b Fe(31)1015 623 y Fc(rl)p 1057 623 V 14 w(ignore)p 1191 623 +V 12 w(some)p 1283 623 V 12 w(completion)o(s)p 1514 623 V 11 +w(function)13 b Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 +b Fe(31)1015 681 y Fc(rl)p 1057 681 V 14 w(insert)p 1191 681 +V 12 w(completio)o(ns)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 +b Fe(29)1015 739 y Fc(rl)p 1057 739 V 14 w(insert)p 1191 739 +V 12 w(text)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)19 b Fe(25)1015 798 y Fc(rl)p 1057 798 V 14 w(instream)f +Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)22 b Fe(19)1015 856 y Fc(rl)p 1057 856 V 14 w(invoking)p +1231 856 V 11 w(keyseqs)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 +b Fe(22)1015 914 y Fc(rl)p 1057 914 V 14 w(invoking)p 1231 +914 V 11 w(keyseqs)p 1382 914 V 11 w(in)p 1433 914 V 14 w(map)t +Fd(:)5 b(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)18 b Fe(22)1015 972 y Fc(rl)p 1057 972 V +14 w(kill)p 1151 972 V 12 w(text)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21 b Fe(25)1015 1030 +y Fc(rl)p 1057 1030 V 14 w(line)p 1151 1030 V 12 w(buffer)e +Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 +b Fe(18)1015 1088 y Fc(rl)p 1057 1088 V 14 w(make)p 1151 1088 +V 12 w(bare)p 1243 1088 V 13 w(keymap)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)24 b Fe(20)1015 1146 y Fc(rl)p 1057 1146 V 14 w(make)p +1151 1146 V 12 w(keymap)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)19 b Fe(20)1015 1204 y Fc(rl)p 1057 1204 +V 14 w(mark)e Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(18)1015 1263 y Fc(rl)p +1057 1263 V 14 w(message)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)21 b Fe(24)1015 1321 +y Fc(rl)p 1057 1321 V 14 w(modifying)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(24)1015 +1379 y Fc(rl)p 1057 1379 V 14 w(named)p 1171 1379 V 12 w(function)7 +b Fd(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)24 b +Fe(22)1015 1437 y Fc(rl)p 1057 1437 V 14 w(on)p 1111 1437 V +13 w(new)p 1184 1437 V 13 w(line)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(24)1015 1495 y Fc(rl)p +1057 1495 V 14 w(outstream)17 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(19)1015 1553 y Fc(rl)p +1057 1553 V 14 w(parse)p 1171 1553 V 12 w(and)p 1243 1553 V +13 w(bind)5 b Fd(:)t(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 +b Fe(22)1015 1611 y Fc(rl)p 1057 1611 V 14 w(pending)p 1211 +1611 V 11 w(input)e Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)19 b Fe(19)1015 1669 y Fc(rl)p 1057 1669 V 14 w(point)c +Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)17 b Fe(18)1015 1727 y Fc(rl)p 1057 1727 +V 14 w(possible)p 1231 1727 V 11 w(completio)o(ns)8 b Fd(:)e(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)25 b Fe(29)1015 1786 y Fc(rl)p 1057 1786 V 14 w(prompt)d +Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)25 b Fe(19)1015 1844 y Fc(rl)p 1057 1844 V 14 w(readline)p +1231 1844 V 11 w(name)16 b Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)19 b Fe(19)1015 1902 y Fc(rl)p 1057 1902 V 14 w(redisplay)t +Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)19 b Fe(24)1015 1960 y Fc(rl)p 1057 1960 V 14 w(reset)p +1171 1960 V 12 w(line)p 1263 1960 V 13 w(state)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)24 b Fe(24)1015 2018 y Fc(rl)p 1057 2018 +V 14 w(reset)p 1171 2018 V 12 w(terminal)7 b Fd(:)f(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(25)1015 2076 y Fc(rl)p 1057 +2076 V 14 w(set)p 1131 2076 V 13 w(keymap)7 b Fd(:)t(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)20 b Fe(21)1015 +2134 y Fc(rl)p 1057 2134 V 14 w(special)p 1211 2134 V 11 w(prefixes)g +Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fe(31)1015 +2192 y Fc(rl)p 1057 2192 V 14 w(startup)p 1211 2192 V 11 w(hook)18 +b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 +b Fe(19)1015 2250 y Fc(rl)p 1057 2250 V 14 w(terminal)p 1231 +2250 V 11 w(name)c Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)19 b Fe(19)1015 2309 y Fc(rl)p 1057 2309 V 14 w(unbind)p +1191 2309 V 12 w(key)7 b Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)20 b Fe(21)1015 2367 y Fc(rl)p 1057 +2367 V 14 w(unbind)p 1191 2367 V 12 w(key)p 1263 2367 V 13 +w(in)p 1316 2367 V 13 w(map)t Fd(:)t(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +17 b Fe(21)1015 2521 y Fm(S)1015 2587 y Fc(self-insert)9 b(\(a,)j(b,)g(A,)g +(1,)g(!,)g(...\))6 b Fd(:)f(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)19 b Fe(10)1015 2645 y(sho)o(w-all-if-am)o(bigu)q(ous)9 +b Fd(:)g(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(6)p +eop +%%Page: 47 49 +48 bop 0 -83 a Fo(F)l(unction)16 b(and)f(V)l(ariable)i(Index)1337 +b(47)0 158 y Fc(start-kbd-)o(ma)o(cro)9 b(\(C-x)i(\(\))t Fd(:)6 +b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(12)0 266 y Fm(T)0 333 y Fc(tab-insert)9 +b(\(M-TAB\))e Fd(:)s(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 +b Fe(10)0 391 y Fc(tilde-expa)o(nd)9 b(\(M-~\))e Fd(:)t(:)f(:)g(:)h(:)f(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(13)0 449 y Fc(to)p 42 449 12 +2 v 13 w(lower)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fe(26)0 507 y Fc(to)p +42 507 V 13 w(upper)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fe(26)0 565 y Fc(transpose-)o(ch) +o(ars)9 b(\(C-t\))s Fd(:)t(:)d(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)16 +b Fe(10)0 623 y Fc(transpose-)o(wo)o(rds)9 b(\(M-t\))s Fd(:)t(:)d(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)16 b Fe(10)0 731 y Fm(U)0 798 y Fc(undo)11 b(\(C-)p +153 798 V 13 w(,)i(C-x)e(C-u\))c Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)20 b Fe(13)1015 158 y Fc(universal-a)o(rg)o(ume)o(nt)9 +b(\(\))s Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)16 b Fe(12)1015 +216 y Fc(unix-line-d)o(is)o(car)o(d)10 b(\(C-u\))f Fd(:)t(:)d(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22 +b Fe(11)1015 275 y Fc(unix-word-r)o(ub)o(out)9 b(\(C-w\))g +Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(11)1015 333 y Fc(upcase-word)9 +b(\(M-u\))f Fd(:)t(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 +b Fe(10)1015 391 y Fc(uppercase)p 1197 391 V 11 w(p)7 b Fd(:)f(:)g(:)g(:)g(:) +g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)20 +b Fe(26)1015 449 y Fc(username)p 1177 449 V 12 w(completi)o(on)p +1388 449 V 11 w(function)5 b Fd(:)s(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(30)1015 557 y Fm(Y)1015 +623 y Fc(yank)12 b(\(C-y\))d Fd(:)t(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(11)1015 681 +y Fc(yank-last-a)o(rg)9 b(\(M-.,)i(M-)p 1436 681 V 13 w(\))6 +b Fd(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(10)1015 739 y Fc(yank-nth-ar)o(g)10 +b(\(M-C-y\))t Fd(:)s(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b +Fe(10)1015 798 y Fc(yank-pop)10 b(\(M-y\))t Fd(:)t(:)c(:)g(:)g(:)g(:)g(:)g(:) +g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(11)p eop +%%Page: 48 50 +49 bop 0 -83 a Fo(48)1449 b(GNU)15 b(Readline)i(Library)p eop +%%Page: -1 51 +50 bop 1937 -83 a Fo(i)0 158 y Fk(T)-7 b(able)15 b(of)g(Con)n(ten)n(ts)0 +333 y Fm(1)67 b(Command)22 b(Line)i(Editing)13 b Fb(:)f(:)e(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)36 b Fm(1)149 411 y Fo(1.1)45 b(In)o(tro)q(duction)16 +b(to)f(Line)h(Editing)5 b Fa(:)k(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)20 b Fo(1)149 473 y(1.2)45 b(Readline)17 +b(In)o(teraction)6 b Fa(:)i(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)21 +b Fo(1)299 535 y(1.2.1)44 b(Readline)17 b(Bare)e(Essen)o(tials)f +Fa(:)7 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)27 +b Fo(2)299 597 y(1.2.2)44 b(Readline)17 b(Mo)o(v)o(emen)o(t)d(Commands)f +Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)27 b Fo(2)299 660 y(1.2.3)44 +b(Readline)17 b(Killing)h(Commands)9 b Fa(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)23 b Fo(3)299 722 y(1.2.4)44 b(Readline)17 b(Argumen)o(ts)5 +b Fa(:)i(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)19 b Fo(4)149 784 y(1.3)45 b(Readline)17 b(Init)g(File)d +Fa(:)8 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 b Fo(4)299 +846 y(1.3.1)44 b(Readline)17 b(Init)f(Syn)o(tax)11 b Fa(:)d(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)25 b Fo(4)299 +909 y(1.3.2)44 b(Conditional)16 b(Init)g(Constructs)d Fa(:)7 +b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)27 b Fo(7)149 971 y(1.4)45 +b(Bindable)17 b(Readline)h(Commands)9 b Fa(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23 b Fo(8)299 1033 y(1.4.1)44 +b(Commands)14 b(F)l(or)h(Mo)o(ving)t Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)18 b Fo(8)299 1095 y(1.4.2)44 b(Commands)14 +b(F)l(or)h(Manipulating)i(The)e(History)9 b Fa(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23 b Fo(9)299 1158 y(1.4.3)44 +b(Commands)14 b(F)l(or)h(Changing)h(T)l(ext)10 b Fa(:)c(:)i(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)25 b Fo(10)299 1220 y(1.4.4)44 b(Killing)18 b(And)e(Y)l(anking)10 +b Fa(:)e(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)25 +b Fo(11)299 1282 y(1.4.5)44 b(Sp)q(ecifying)17 b(Numeric)f(Argumen)o(ts)8 +b Fa(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)22 b Fo(12)299 1345 y(1.4.6)44 +b(Letting)15 b(Readline)j(T)o(yp)q(e)d(F)l(or)g(Y)l(ou)5 b +Fa(:)i(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:) +g(:)g(:)g(:)h(:)f(:)g(:)g(:)20 b Fo(12)299 1407 y(1.4.7)44 +b(Keyb)q(oard)15 b(Macros)9 b Fa(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)24 b Fo(12)299 1469 y(1.4.8)44 +b(Some)15 b(Miscellaneous)i(Commands)11 b Fa(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)27 +b Fo(13)149 1531 y(1.5)45 b(Readline)17 b(vi)f(Mo)q(de)d Fa(:)7 +b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fo(13)0 1656 y Fm(2)67 +b(Programming)23 b(with)g(GNU)f(Readline)d Fb(:)10 b(:)g(:)g(:)h(:)f(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)41 b Fm(15)149 1734 y Fo(2.1)k(Basic)16 +b(Beha)o(vior)9 b Fa(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)23 +b Fo(15)149 1796 y(2.2)45 b(Custom)14 b(F)l(unctions)6 b Fa(:)j(:)e(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)21 b Fo(17)299 1858 y(2.2.1)44 b(The)15 +b(F)l(unction)h(T)o(yp)q(e)e Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)28 b Fo(17)299 1920 y(2.2.2)44 b(W)l(riting)16 +b(a)e(New)i(F)l(unction)6 b Fa(:)h(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:) +h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)20 b Fo(18)149 1983 y(2.3)45 b(Readline)17 b(Con)o(v)o(enience)g(F)l +(unctions)8 b Fa(:)g(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)23 +b Fo(19)299 2045 y(2.3.1)44 b(Naming)15 b(a)g(F)l(unction)t +Fa(:)9 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)19 b Fo(19)299 2107 y(2.3.2)44 b(Selecting)17 b(a)e(Keymap)8 +b Fa(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23 +b Fo(20)299 2170 y(2.3.3)44 b(Binding)17 b(Keys)11 b Fa(:)d(:)f(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)26 +b Fo(21)299 2232 y(2.3.4)44 b(Asso)q(ciating)16 b(F)l(unction)g(Names)f(and)g +(Bindings)7 b Fa(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)22 +b Fo(22)299 2294 y(2.3.5)44 b(Allo)o(wing)16 b(Undoing)7 b +Fa(:)i(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:) +g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)22 b Fo(23)299 2356 y(2.3.6)44 b(Redispla)o(y)9 b Fa(:)f(:)g(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)23 b Fo(24)299 2419 y(2.3.7)44 b(Mo)q(difying)16 +b(T)l(ext)11 b Fa(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h +(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)26 b Fo(25)299 2481 y(2.3.8)44 b(Utilit)o(y)16 +b(F)l(unctions)7 b Fa(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)22 b Fo(25)299 2543 y(2.3.9)44 b(An)15 +b(Example)c Fa(:)d(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:) +g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)26 b Fo(26)149 2605 y(2.4)45 +b(Custom)14 b(Completers)c Fa(:)e(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)25 +b Fo(28)p eop +%%Page: -2 52 +51 bop 0 -83 a Fo(ii)1471 b(GNU)15 b(Readline)i(Library)299 +17 y(2.4.1)44 b(Ho)o(w)14 b(Completing)i(W)l(orks)10 b Fa(:)c(:)i(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)24 b Fo(28)299 79 y(2.4.2)44 +b(Completion)16 b(F)l(unctions)7 b Fa(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g +(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)22 b Fo(29)299 141 y(2.4.3)44 b(Completion)16 +b(V)l(ariables)e Fa(:)7 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)28 b Fo(30)299 203 y(2.4.4)44 b(A)15 b(Short)g(Completion)h(Example)11 +b Fa(:)d(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)26 b Fo(32)0 328 y Fm(Concept)c(Index)5 +b Fb(:)12 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g +(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g +(:)h(:)f(:)g(:)g(:)g(:)h(:)28 b Fm(43)0 468 y(F)-6 b(unction)25 +b(and)d(V)-6 b(ariable)24 b(Index)11 b Fb(:)g(:)f(:)g(:)h(:)f(:)g(:)g(:)h(:)f +(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)34 +b Fm(45)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/doc/rlman.texinfo b/doc/rlman.texinfo new file mode 100644 index 0000000..ec14066 --- /dev/null +++ b/doc/rlman.texinfo @@ -0,0 +1,111 @@ +\input texinfo @c -*-texinfo-*- +@comment %**start of header (This is for running Texinfo on a region.) +@setfilename readline.info +@settitle GNU Readline Library +@comment %**end of header (This is for running Texinfo on a region.) +@synindex vr fn +@setchapternewpage odd + +@ignore +last change: Thu Jul 21 16:02:40 EDT 1994 +@end ignore + +@set EDITION 2.0 +@set VERSION 2.0 +@set UPDATED 21 July 1994 +@set UPDATE-MONTH July 1994 + +@ifinfo +This document describes the GNU Readline Library, a utility which aids +in the consistency of user interface across discrete programs that need +to provide a command line interface. + +Copyright (C) 1988, 1991 Free Software Foundation, Inc. + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +pare preserved on all copies. + +@ignore +Permission is granted to process this file through TeX and print the +results, provided the printed document carries copying permission +notice identical to this one except for the removal of this paragraph +(this paragraph not being relevant to the printed manual). +@end ignore + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided that the entire +resulting derived work is distributed under the terms of a permission +notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation approved +by the Foundation. +@end ifinfo + +@titlepage +@sp 10 +@title GNU Readline Library +@subtitle Edition @value{EDITION}, for @code{Readline Library} Version @value{VERSION}. +@subtitle @value{UPDATE-MONTH} +@author Brian Fox, Free Software Foundation +@author Chet Ramey, Case Western Reserve University + +@page +This document describes the GNU Readline Library, a utility which aids +in the consistency of user interface across discrete programs that need +to provide a command line interface. + +Published by the Free Software Foundation @* +675 Massachusetts Avenue, @* +Cambridge, MA 02139 USA + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +are preserved on all copies. + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided that the entire +resulting derived work is distributed under the terms of a permission +notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation approved +by the Foundation. + +@vskip 0pt plus 1filll +Copyright @copyright{} 1989, 1991 Free Software Foundation, Inc. +@end titlepage + +@ifinfo +@node Top +@top GNU Readline Library + +This document describes the GNU Readline Library, a utility which aids +in the consistency of user interface across discrete programs that need +to provide a command line interface. + +@menu +* Command Line Editing:: GNU Readline User's Manual. +* Programming with GNU Readline:: GNU Readline Programmer's Manual. +* Concept Index:: Index of concepts described in this manual. +* Function and Variable Index:: Index of externally visible functions + and variables. +@end menu +@end ifinfo + +@include rluser.texinfo +@include rltech.texinfo + +@node Concept Index +@unnumbered Concept Index +@printindex cp + +@node Function and Variable Index +@unnumbered Function and Variable Index +@printindex fn + +@contents +@bye diff --git a/doc/rltech.texinfo b/doc/rltech.texinfo new file mode 100644 index 0000000..f24ac1f --- /dev/null +++ b/doc/rltech.texinfo @@ -0,0 +1,1356 @@ +@comment %**start of header (This is for running Texinfo on a region.) +@setfilename rltech.info +@comment %**end of header (This is for running Texinfo on a region.) +@setchapternewpage odd + +@ifinfo +This document describes the GNU Readline Library, a utility for aiding +in the consitency of user interface across discrete programs that need +to provide a command line interface. + +Copyright (C) 1988, 1994 Free Software Foundation, Inc. + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +pare preserved on all copies. + +@ignore +Permission is granted to process this file through TeX and print the +results, provided the printed document carries copying permission +notice identical to this one except for the removal of this paragraph +(this paragraph not being relevant to the printed manual). +@end ignore + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided that the entire +resulting derived work is distributed under the terms of a permission +notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions, +except that this permission notice may be stated in a translation approved +by the Foundation. +@end ifinfo + +@node Programming with GNU Readline +@chapter Programming with GNU Readline + +This chapter describes the interface between the GNU Readline Library and +other programs. If you are a programmer, and you wish to include the +features found in GNU Readline +such as completion, line editing, and interactive history manipulation +in your own programs, this section is for you. + +@menu +* Basic Behavior:: Using the default behavior of Readline. +* Custom Functions:: Adding your own functions to Readline. +* Readline Convenience Functions:: Functions which Readline supplies to + aid in writing your own +* Custom Completers:: Supplanting or supplementing Readline's + completion functions. +@end menu + +@node Basic Behavior +@section Basic Behavior + +Many programs provide a command line interface, such as @code{mail}, +@code{ftp}, and @code{sh}. For such programs, the default behaviour of +Readline is sufficient. This section describes how to use Readline in +the simplest way possible, perhaps to replace calls in your code to +@code{gets()} or @code{fgets ()}. + +@findex readline +@cindex readline, function +The function @code{readline ()} prints a prompt and then reads and returns +a single line of text from the user. The line @code{readline} +returns is allocated with @code{malloc ()}; you should @code{free ()} +the line when you are done with it. The declaration for @code{readline} +in ANSI C is + +@example +@code{char *readline (char *@var{prompt});} +@end example + +@noindent +So, one might say +@example +@code{char *line = readline ("Enter a line: ");} +@end example +@noindent +in order to read a line of text from the user. +The line returned has the final newline removed, so only the +text remains. + +If @code{readline} encounters an @code{EOF} while reading the line, and the +line is empty at that point, then @code{(char *)NULL} is returned. +Otherwise, the line is ended just as if a newline had been typed. + +If you want the user to be able to get at the line later, (with +@key{C-p} for example), you must call @code{add_history ()} to save the +line away in a @dfn{history} list of such lines. + +@example +@code{add_history (line)}; +@end example + +@noindent +For full details on the GNU History Library, see the associated manual. + +It is preferable to avoid saving empty lines on the history list, since +users rarely have a burning need to reuse a blank line. Here is +a function which usefully replaces the standard @code{gets ()} library +function, and has the advantage of no static buffer to overflow: + +@example +/* A static variable for holding the line. */ +static char *line_read = (char *)NULL; + +/* Read a string, and return a pointer to it. Returns NULL on EOF. */ +char * +rl_gets () +@{ + /* If the buffer has already been allocated, return the memory + to the free pool. */ + if (line_read) + @{ + free (line_read); + line_read = (char *)NULL; + @} + + /* Get a line from the user. */ + line_read = readline (""); + + /* If the line has any text in it, save it on the history. */ + if (line_read && *line_read) + add_history (line_read); + + return (line_read); +@} +@end example + +This function gives the user the default behaviour of @key{TAB} +completion: completion on file names. If you do not want Readline to +complete on filenames, you can change the binding of the @key{TAB} key +with @code{rl_bind_key ()}. + +@example +@code{int rl_bind_key (int @var{key}, int (*@var{function})());} +@end example + +@code{rl_bind_key ()} takes two arguments: @var{key} is the character that +you want to bind, and @var{function} is the address of the function to +call when @var{key} is pressed. Binding @key{TAB} to @code{rl_insert ()} +makes @key{TAB} insert itself. +@code{rl_bind_key ()} returns non-zero if @var{key} is not a valid +ASCII character code (between 0 and 255). + +Thus, to disable the default @key{TAB} behavior, the following suffices: +@example +@code{rl_bind_key ('\t', rl_insert);} +@end example + +This code should be executed once at the start of your program; you +might write a function called @code{initialize_readline ()} which +performs this and other desired initializations, such as installing +custom completers (@pxref{Custom Completers}). + +@node Custom Functions +@section Custom Functions + +Readline provides many functions for manipulating the text of +the line, but it isn't possible to anticipate the needs of all +programs. This section describes the various functions and variables +defined within the Readline library which allow a user program to add +customized functionality to Readline. + +@menu +* The Function Type:: C declarations to make code readable. +* Function Writing:: Variables and calling conventions. +@end menu + +@node The Function Type +@subsection The Function Type + +For readabilty, we declare a new type of object, called +@dfn{Function}. A @code{Function} is a C function which +returns an @code{int}. The type declaration for @code{Function} is: + +@noindent +@code{typedef int Function ();} + +The reason for declaring this new type is to make it easier to write +code describing pointers to C functions. Let us say we had a variable +called @var{func} which was a pointer to a function. Instead of the +classic C declaration + +@code{int (*)()func;} + +@noindent +we may write + +@code{Function *func;} + +@noindent +Similarly, there are + +@example +typedef void VFunction (); +typedef char *CPFunction (); @r{and} +typedef char **CPPFunction (); +@end example + +@noindent +for functions returning no value, @code{pointer to char}, and +@code{pointer to pointer to char}, respectively. + +@node Function Writing +@subsection Writing a New Function + +In order to write new functions for Readline, you need to know the +calling conventions for keyboard-invoked functions, and the names of the +variables that describe the current state of the line read so far. + +The calling sequence for a command @code{foo} looks like + +@example +@code{foo (int count, int key)} +@end example + +@noindent +where @var{count} is the numeric argument (or 1 if defaulted) and +@var{key} is the key that invoked this function. + +It is completely up to the function as to what should be done with the +numeric argument. Some functions use it as a repeat count, some +as a flag, and others to choose alternate behavior (refreshing the current +line as opposed to refreshing the screen, for example). Some choose to +ignore it. In general, if a +function uses the numeric argument as a repeat count, it should be able +to do something useful with both negative and positive arguments. +At the very least, it should be aware that it can be passed a +negative argument. + +@deftypevar {char *} rl_line_buffer +This is the line gathered so far. You are welcome to modify the +contents of the line, but see @ref{Allowing Undoing}. +@end deftypevar + +@deftypevar int rl_point +The offset of the current cursor position in @code{rl_line_buffer} +(the @emph{point}). +@end deftypevar + +@deftypevar int rl_end +The number of characters present in @code{rl_line_buffer}. When +@code{rl_point} is at the end of the line, @code{rl_point} and +@code{rl_end} are equal. +@end deftypevar + +@deftypevar int rl_mark +The mark (saved position) in the current line. If set, the mark +and point define a @emph{region}. +@end deftypevar + +@deftypevar int rl_done +Setting this to a non-zero value causes Readline to return the current +line immediately. +@end deftypevar + +@deftypevar int rl_pending_input +Setting this to a value makes it the next keystroke read. This is a +way to stuff a single character into the input stream. +@end deftypevar + +@deftypevar {char *} rl_prompt +The prompt Readline uses. This is set from the argument to +@code{readline ()}, and should not be assigned to directly. +@end deftypevar + +@deftypevar {char *} rl_terminal_name +The terminal type, used for initialization. +@end deftypevar + +@deftypevar {char *} rl_readline_name +This variable is set to a unique name by each application using Readline. +The value allows conditional parsing of the inputrc file +(@pxref{Conditional Init Constructs}). +@end deftypevar + +@deftypevar {FILE *} rl_instream +The stdio stream from which Readline reads input. +@end deftypevar + +@deftypevar {FILE *} rl_outstream +The stdio stream to which Readline performs output. +@end deftypevar + +@deftypevar {Function *} rl_startup_hook +If non-zero, this is the address of a function to call just +before @code{readline} prints the first prompt. +@end deftypevar + +@node Readline Convenience Functions +@section Readline Convenience Functions + +@menu +* Function Naming:: How to give a function you write a name. +* Keymaps:: Making keymaps. +* Binding Keys:: Changing Keymaps. +* Associating Function Names and Bindings:: Translate function names to + key sequences. +* Allowing Undoing:: How to make your functions undoable. +* Redisplay:: Functions to control line display. +* Modifying Text:: Functions to modify @code{rl_line_buffer}. +* Utility Functions:: Generally useful functions and hooks. +@end menu + +@node Function Naming +@subsection Naming a Function + +The user can dynamically change the bindings of keys while using +Readline. This is done by representing the function with a descriptive +name. The user is able to type the descriptive name when referring to +the function. Thus, in an init file, one might find + +@example +Meta-Rubout: backward-kill-word +@end example + +This binds the keystroke @key{Meta-Rubout} to the function +@emph{descriptively} named @code{backward-kill-word}. You, as the +programmer, should bind the functions you write to descriptive names as +well. Readline provides a function for doing that: + +@deftypefun int rl_add_defun (char *name, Function *function, int key) +Add @var{name} to the list of named functions. Make @var{function} be +the function that gets called. If @var{key} is not -1, then bind it to +@var{function} using @code{rl_bind_key ()}. +@end deftypefun + +Using this function alone is sufficient for most applications. It is +the recommended way to add a few functions to the default functions that +Readline has built in. If you need to do something other +than adding a function to Readline, you may need to use the +underlying functions described below. + +@node Keymaps +@subsection Selecting a Keymap + +Key bindings take place on a @dfn{keymap}. The keymap is the +association between the keys that the user types and the functions that +get run. You can make your own keymaps, copy existing keymaps, and tell +Readline which keymap to use. + +@deftypefun Keymap rl_make_bare_keymap () +Returns a new, empty keymap. The space for the keymap is allocated with +@code{malloc ()}; you should @code{free ()} it when you are done. +@end deftypefun + +@deftypefun Keymap rl_copy_keymap (Keymap map) +Return a new keymap which is a copy of @var{map}. +@end deftypefun + +@deftypefun Keymap rl_make_keymap () +Return a new keymap with the printing characters bound to rl_insert, +the lowercase Meta characters bound to run their equivalents, and +the Meta digits bound to produce numeric arguments. +@end deftypefun + +@deftypefun void rl_discard_keymap (Keymap keymap) +Free the storage associated with @var{keymap}. +@end deftypefun + +Readline has several internal keymaps. These functions allow you to +change which keymap is active. + +@deftypefun Keymap rl_get_keymap () +Returns the currently active keymap. +@end deftypefun + +@deftypefun void rl_set_keymap (Keymap keymap) +Makes @var{keymap} the currently active keymap. +@end deftypefun + +@deftypefun Keymap rl_get_keymap_by_name (char *name) +Return the keymap matching @var{name}. @var{name} is one which would +be supplied in a @code{set keymap} inputrc line (@pxref{Readline Init File}). +@end deftypefun + +@node Binding Keys +@subsection Binding Keys + +You associate keys with functions through the keymap. Readline has +several internal keymaps: @code{emacs_standard_keymap}, +@code{emacs_meta_keymap}, @code{emacs_ctlx_keymap}, +@code{vi_movement_keymap}, and @code{vi_insertion_keymap}. +@code{emacs_standard_keymap} is the default, and the examples in +this manual assume that. + +These functions manage key bindings. + +@deftypefun int rl_bind_key (int key, Function *function) +Binds @var{key} to @var{function} in the currently active keymap. +Returns non-zero in the case of an invalid @var{key}. +@end deftypefun + +@deftypefun int rl_bind_key_in_map (int key, Function *function, Keymap map) +Bind @var{key} to @var{function} in @var{map}. Returns non-zero in the case +of an invalid @var{key}. +@end deftypefun + +@deftypefun int rl_unbind_key (int key) +Bind @var{key} to the null function in the currently active keymap. +Returns non-zero in case of error. +@end deftypefun + +@deftypefun int rl_unbind_key_in_map (int key, Keymap map) +Bind @var{key} to the null function in @var{map}. +Returns non-zero in case of error. +@end deftypefun + +@deftypefun int rl_generic_bind (int type, char *keyseq, char *data, Keymap map) +Bind the key sequence represented by the string @var{keyseq} to the arbitrary +pointer @var{data}. @var{type} says what kind of data is pointed to by +@var{data}; this can be a function (@code{ISFUNC}), a macro +(@code{ISMACR}), or a keymap (@code{ISKMAP}). This makes new keymaps as +necessary. The initial keymap in which to do bindings is @var{map}. +@end deftypefun + +@deftypefun int rl_parse_and_bind (char *line) +Parse @var{line} as if it had been read from the @code{inputrc} file and +perform any key bindings and variable assignments found +(@pxref{Readline Init File}). +@end deftypefun + +@node Associating Function Names and Bindings +@subsection Associating Function Names and Bindings + +These functions allow you to find out what keys invoke named functions +and the functions invoked by a particular key sequence. + +@deftypefun {Function *} rl_named_function (char *name) +Return the function with name @var{name}. +@end deftypefun + +@deftypefun {Function *} rl_function_of_keyseq (char *keyseq, Keymap map, int *type) +Return the function invoked by @var{keyseq} in keymap @var{map}. +If @var{map} is NULL, the current keymap is used. If @var{type} is +not NULL, the type of the object is returned in it (one of @code{ISFUNC}, +@code{ISKMAP}, or @code{ISMACR}). +@end deftypefun + +@deftypefun {char **} rl_invoking_keyseqs (Function *function) +Return an array of strings representing the key sequences used to +invoke @var{function} in the current keymap. +@end deftypefun + +@deftypefun {char **} rl_invoking_keyseqs_in_map (Function *function, Keymap map) +Return an array of strings representing the key sequences used to +invoke @var{function} in the keymap @var{map}. +@end deftypefun + +@node Allowing Undoing +@subsection Allowing Undoing + +Supporting the undo command is a painless thing, and makes your +functions much more useful. It is certainly easy to try +something if you know you can undo it. I could use an undo function for +the stock market. + +If your function simply inserts text once, or deletes text once, and +uses @code{rl_insert_text ()} or @code{rl_delete_text ()} to do it, then +undoing is already done for you automatically. + +If you do multiple insertions or multiple deletions, or any combination +of these operations, you should group them together into one operation. +This is done with @code{rl_begin_undo_group ()} and +@code{rl_end_undo_group ()}. + +The types of events that can be undone are: + +@example +enum undo_code @{ UNDO_DELETE, UNDO_INSERT, UNDO_BEGIN, UNDO_END @}; +@end example + +Notice that @code{UNDO_DELETE} means to insert some text, and +@code{UNDO_INSERT} means to delete some text. That is, the undo code +tells undo what to undo, not how to undo it. @code{UNDO_BEGIN} and +@code{UNDO_END} are tags added by @code{rl_begin_undo_group ()} and +@code{rl_end_undo_group ()}. + +@deftypefun int rl_begin_undo_group () +Begins saving undo information in a group construct. The undo +information usually comes from calls to @code{rl_insert_text ()} and +@code{rl_delete_text ()}, but could be the result of calls to +@code{rl_add_undo ()}. +@end deftypefun + +@deftypefun int rl_end_undo_group () +Closes the current undo group started with @code{rl_begin_undo_group +()}. There should be one call to @code{rl_end_undo_group ()} +for each call to @code{rl_begin_undo_group ()}. +@end deftypefun + +@deftypefun void rl_add_undo (enum undo_code what, int start, int end, char *text) +Remember how to undo an event (according to @var{what}). The affected +text runs from @var{start} to @var{end}, and encompasses @var{text}. +@end deftypefun + +@deftypefun void free_undo_list () +Free the existing undo list. +@end deftypefun + +@deftypefun int rl_do_undo () +Undo the first thing on the undo list. Returns @code{0} if there was +nothing to undo, non-zero if something was undone. +@end deftypefun + +Finally, if you neither insert nor delete text, but directly modify the +existing text (e.g., change its case), call @code{rl_modifying ()} +once, just before you modify the text. You must supply the indices of +the text range that you are going to modify. + +@deftypefun int rl_modifying (int start, int end) +Tell Readline to save the text between @var{start} and @var{end} as a +single undo unit. It is assumed that you will subsequently modify +that text. +@end deftypefun + +@node Redisplay +@subsection Redisplay + +@deftypefun int rl_redisplay () +Change what's displayed on the screen to reflect the current contents +of @code{rl_line_buffer}. +@end deftypefun + +@deftypefun int rl_forced_update_display () +Force the line to be updated and redisplayed, whether or not +Readline thinks the screen display is correct. +@end deftypefun + +@deftypefun int rl_on_new_line () +Tell the update routines that we have moved onto a new (empty) line, +usually after ouputting a newline. +@end deftypefun + +@deftypefun int rl_reset_line_state () +Reset the display state to a clean state and redisplay the current line +starting on a new line. +@end deftypefun + +@deftypefun int rl_message (va_alist) +The arguments are a string as would be supplied to @code{printf}. The +resulting string is displayed in the @dfn{echo area}. The echo area +is also used to display numeric arguments and search strings. +@end deftypefun + +@deftypefun int rl_clear_message () +Clear the message in the echo area. +@end deftypefun + +@node Modifying Text +@subsection Modifying Text + +@deftypefun int rl_insert_text (char *text) +Insert @var{text} into the line at the current cursor position. +@end deftypefun + +@deftypefun int rl_delete_text (int start, int end) +Delete the text between @var{start} and @var{end} in the current line. +@end deftypefun + +@deftypefun {char *} rl_copy_text (int start, int end) +Return a copy of the text between @var{start} and @var{end} in +the current line. +@end deftypefun + +@deftypefun int rl_kill_text (int start, int end) +Copy the text between @var{start} and @var{end} in the current line +to the kill ring, appending or prepending to the last kill if the +last command was a kill command. The text is deleted. +If @var{start} is less than @var{end}, +the text is appended, otherwise prepended. If the last command was +not a kill, a new kill ring slot is used. +@end deftypefun + +@node Utility Functions +@subsection Utility Functions + +@deftypefun int rl_reset_terminal (char *terminal_name) +Reinitialize Readline's idea of the terminal settings using +@var{terminal_name} as the terminal type (e.g., @code{vt100}). +@end deftypefun + +@deftypefun int alphabetic (int c) +Return 1 if @var{c} is an alphabetic character. +@end deftypefun + +@deftypefun int numeric (int c) +Return 1 if @var{c} is a numeric character. +@end deftypefun + +@deftypefun int ding () +Ring the terminal bell, obeying the setting of @code{bell-style}. +@end deftypefun + +The following are implemented as macros, defined in @code{chartypes.h}. + +@deftypefun int uppercase_p (int c) +Return 1 if @var{c} is an uppercase alphabetic character. +@end deftypefun + +@deftypefun int lowercase_p (int c) +Return 1 if @var{c} is a lowercase alphabetic character. +@end deftypefun + +@deftypefun int digit_p (int c) +Return 1 if @var{c} is a numeric character. +@deftypefun + +@deftypefun int to_upper (int c) +If @var{c} is a lowercase alphabetic character, return the corresponding +uppercase character. +@end deftypefun + +@deftypefun int to_lower (int c) +If @var{c} is an uppercase alphabetic character, return the corresponding +lowercase character. +@end deftypefun + +@deftypefun int digit_value (int c) +If @var{c} is a number, return the value it represents. +@end deftypefun + +@subsection An Example + +Here is a function which changes lowercase characters to their uppercase +equivalents, and uppercase characters to lowercase. If +this function was bound to @samp{M-c}, then typing @samp{M-c} would +change the case of the character under point. Typing @samp{M-1 0 M-c} +would change the case of the following 10 characters, leaving the cursor on +the last character changed. + +@example +/* Invert the case of the COUNT following characters. */ +int +invert_case_line (count, key) + int count, key; +@{ + register int start, end, i; + + start = rl_point; + + if (rl_point >= rl_end) + return (0); + + if (count < 0) + @{ + direction = -1; + count = -count; + @} + else + direction = 1; + + /* Find the end of the range to modify. */ + end = start + (count * direction); + + /* Force it to be within range. */ + if (end > rl_end) + end = rl_end; + else if (end < 0) + end = 0; + + if (start == end) + return (0); + + if (start > end) + @{ + int temp = start; + start = end; + end = temp; + @} + + /* Tell readline that we are modifying the line, so it will save + the undo information. */ + rl_modifying (start, end); + + for (i = start; i != end; i++) + @{ + if (uppercase_p (rl_line_buffer[i])) + rl_line_buffer[i] = to_lower (rl_line_buffer[i]); + else if (lowercase_p (rl_line_buffer[i])) + rl_line_buffer[i] = to_upper (rl_line_buffer[i]); + @} + /* Move point to on top of the last character changed. */ + rl_point = (direction == 1) ? end - 1 : start; + return (0); +@} +@end example + +@node Custom Completers +@section Custom Completers + +Typically, a program that reads commands from the user has a way of +disambiguating commands and data. If your program is one of these, then +it can provide completion for commands, data, or both. +The following sections describe how your program and Readline +cooperate to provide this service. + +@menu +* How Completing Works:: The logic used to do completion. +* Completion Functions:: Functions provided by Readline. +* Completion Variables:: Variables which control completion. +* A Short Completion Example:: An example of writing completer subroutines. +@end menu + +@node How Completing Works +@subsection How Completing Works + +In order to complete some text, the full list of possible completions +must be available. That is, it is not possible to accurately +expand a partial word without knowing all of the possible words +which make sense in that context. The Readline library provides +the user interface to completion, and two of the most common +completion functions: filename and username. For completing other types +of text, you must write your own completion function. This section +describes exactly what such functions must do, and provides an example. + +There are three major functions used to perform completion: + +@enumerate +@item +The user-interface function @code{rl_complete ()}. This function is +called with the same arguments as other Readline +functions intended for interactive use: @var{count} and +@var{invoking_key}. It isolates the word to be completed and calls +@code{completion_matches ()} to generate a list of possible completions. +It then either lists the possible completions, inserts the possible +completions, or actually performs the +completion, depending on which behavior is desired. + +@item +The internal function @code{completion_matches ()} uses your +@dfn{generator} function to generate the list of possible matches, and +then returns the array of these matches. You should place the address +of your generator function in @code{rl_completion_entry_function}. + +@item +The generator function is called repeatedly from +@code{completion_matches ()}, returning a string each time. The +arguments to the generator function are @var{text} and @var{state}. +@var{text} is the partial word to be completed. @var{state} is zero the +first time the function is called, allowing the generator to perform +any necessary initialization, and a positive non-zero integer for +each subsequent call. When the generator function returns +@code{(char *)NULL} this signals @code{completion_matches ()} that there are +no more possibilities left. Usually the generator function computes the +list of possible completions when @var{state} is zero, and returns them +one at a time on subsequent calls. Each string the generator function +returns as a match must be allocated with @code{malloc()}; Readline +frees the strings when it has finished with them. + +@end enumerate + +@deftypefun int rl_complete (int ignore, int invoking_key) +Complete the word at or before point. You have supplied the function +that does the initial simple matching selection algorithm (see +@code{completion_matches ()}). The default is to do filename completion. +@end deftypefun + +@deftypevar {Function *} rl_completion_entry_function +This is a pointer to the generator function for @code{completion_matches +()}. If the value of @code{rl_completion_entry_function} is +@code{(Function *)NULL} then the default filename generator function, +@code{filename_entry_function ()}, is used. +@end deftypevar + +@node Completion Functions +@subsection Completion Functions + +Here is the complete list of callable completion functions present in +Readline. + +@deftypefun int rl_complete_internal (int what_to_do) +Complete the word at or before point. @var{what_to_do} says what to do +with the completion. A value of @samp{?} means list the possible +completions. @samp{TAB} means do standard completion. @samp{*} means +insert all of the possible completions. @samp{!} means to display +all of the possible completions, if there is more than one, as well as +performing partial completion. +@end deftypefun + +@deftypefun int rl_complete (int ignore, int invoking_key) +Complete the word at or before point. You have supplied the function +that does the initial simple matching selection algorithm (see +@code{completion_matches ()} and @code{rl_completion_entry_function}). +The default is to do filename +completion. This calls @code{rl_complete_internal ()} with an +argument depending on @var{invoking_key}. +@end deftypefun + +@deftypefun int rl_possible_completions (int count, int invoking_key)) +List the possible completions. See description of @code{rl_complete +()}. This calls @code{rl_complete_internal ()} with an argument of +@samp{?}. +@end deftypefun + +@deftypefun int rl_insert_completions (int count, int invoking_key)) +Insert the list of possible completions into the line, deleting the +partially-completed word. See description of @code{rl_complete ()}. +This calls @code{rl_complete_internal ()} with an argument of @samp{*}. +@end deftypefun + +@deftypefun {char **} completion_matches (char *text, CPFunction *entry_func) +Returns an array of @code{(char *)} which is a list of completions for +@var{text}. If there are no completions, returns @code{(char **)NULL}. +The first entry in the returned array is the substitution for @var{text}. +The remaining entries are the possible completions. The array is +terminated with a @code{NULL} pointer. + +@var{entry_func} is a function of two args, and returns a +@code{(char *)}. The first argument is @var{text}. The second is a +state argument; it is zero on the first call, and non-zero on subsequent +calls. @var{entry_func} returns a @code{NULL} pointer to the caller +when there are no more matches. +@end deftypefun + +@deftypefun {char *} filename_completion_function (char *text, int state) +A generator function for filename completion in the general case. Note +that completion in Bash is a little different because of all +the pathnames that must be followed when looking up completions for a +command. The Bash source is a useful reference for writing custom +completion functions. +@end deftypefun + +@deftypefun {char *} username_completion_function (char *text, int state) +A completion generator for usernames. @var{text} contains a partial +username preceded by a random character (usually @samp{~}). As with all +completion generators, @var{state} is zero on the first call and non-zero +for subsequent calls. +@end deftypefun + +@node Completion Variables +@subsection Completion Variables + +@deftypevar {Function *} rl_completion_entry_function +A pointer to the generator function for @code{completion_matches ()}. +@code{NULL} means to use @code{filename_entry_function ()}, the default +filename completer. +@end deftypevar + +@deftypevar {CPPFunction *} rl_attempted_completion_function +A pointer to an alternative function to create matches. +The function is called with @var{text}, @var{start}, and @var{end}. +@var{start} and @var{end} are indices in @code{rl_line_buffer} saying +what the boundaries of @var{text} are. If this function exists and +returns @code{NULL}, or if this variable is set to @code{NULL}, then +@code{rl_complete ()} will call the value of +@code{rl_completion_entry_function} to generate matches, otherwise the +array of strings returned will be used. +@end deftypevar + +@deftypevar int rl_completion_query_items +Up to this many items will be displayed in response to a +possible-completions call. After that, we ask the user if she is sure +she wants to see them all. The default value is 100. +@end deftypevar + +@deftypevar {char *} rl_basic_word_break_characters +The basic list of characters that signal a break between words for the +completer routine. The default value of this variable is the characters +which break words for completion in Bash, i.e., +@code{" \t\n\"\\'`@@$><=;|&@{("}. +@end deftypevar + +@deftypevar {char *} rl_completer_word_break_characters +The list of characters that signal a break between words for +@code{rl_complete_internal ()}. The default list is the value of +@code{rl_basic_word_break_characters}. +@end deftypevar + +@deftypevar {char *} rl_special_prefixes +The list of characters that are word break characters, but should be +left in @var{text} when it is passed to the completion function. +Programs can use this to help determine what kind of completing to do. +For instance, Bash sets this variable to "$@@" so that it can complete +shell variables and hostnames. +@end deftypevar + +@deftypevar int rl_ignore_completion_duplicates +If non-zero, then disallow duplicates in the matches. Default is 1. +@end deftypevar + +@deftypevar int rl_filename_completion_desired +Non-zero means that the results of the matches are to be treated as +filenames. This is @emph{always} zero on entry, and can only be changed +within a completion entry generator function. If it is set to a non-zero +value, directory names have a slash appended and Readline attempts to +quote completed filenames if they contain any embedded word break +characters. +@end deftypevar + +@deftypevar int rl_filename_quoting_desired +Non-zero means that the results of the matches are to be quoted using +double quotes (or an application-specific quoting mechanism) if the +completed filename contains any characters in +@code{rl_completer_word_break_chars}. This is @emph{always} non-zero +on entry, and can only be changed within a completion entry generator +function. +@end deftypevar + +@deftypevar {Function *} rl_ignore_some_completions_function +This function, if defined, is called by the completer when real filename +completion is done, after all the matching names have been generated. +It is passed a @code{NULL} terminated array of matches. +The first element (@code{matches[0]}) is the +maximal substring common to all matches. This function can +re-arrange the list of matches as required, but each element deleted +from the array must be freed. +@end deftypevar + +@deftypevar {char *} rl_completer_quote_characters +List of characters which can be used to quote a substring of the line. +Completion occurs on the entire substring, and within the substring +@code{rl_completer_word_break_characters} are treated as any other character, +unless they also appear within this list. +@end deftypevar + + +@node A Short Completion Example +@subsection A Short Completion Example + +Here is a small application demonstrating the use of the GNU Readline +library. It is called @code{fileman}, and the source code resides in +@file{examples/fileman.c}. This sample application provides +completion of command names, line editing features, and access to the +history list. + +@page +@smallexample +/* fileman.c -- A tiny application which demonstrates how to use the + GNU Readline library. This application interactively allows users + to manipulate files and their modes. */ + +#include +#include +#include +#include +#include + +#include +#include + +extern char *getwd (); +extern char *xmalloc (); + +/* The names of functions that actually do the manipulation. */ +int com_list (), com_view (), com_rename (), com_stat (), com_pwd (); +int com_delete (), com_help (), com_cd (), com_quit (); + +/* A structure which contains information on the commands this program + can understand. */ + +typedef struct @{ + char *name; /* User printable name of the function. */ + Function *func; /* Function to call to do the job. */ + char *doc; /* Documentation for this function. */ +@} COMMAND; + +COMMAND commands[] = @{ + @{ "cd", com_cd, "Change to directory DIR" @}, + @{ "delete", com_delete, "Delete FILE" @}, + @{ "help", com_help, "Display this text" @}, + @{ "?", com_help, "Synonym for `help'" @}, + @{ "list", com_list, "List files in DIR" @}, + @{ "ls", com_list, "Synonym for `list'" @}, + @{ "pwd", com_pwd, "Print the current working directory" @}, + @{ "quit", com_quit, "Quit using Fileman" @}, + @{ "rename", com_rename, "Rename FILE to NEWNAME" @}, + @{ "stat", com_stat, "Print out statistics on FILE" @}, + @{ "view", com_view, "View the contents of FILE" @}, + @{ (char *)NULL, (Function *)NULL, (char *)NULL @} +@}; + +/* Forward declarations. */ +char *stripwhite (); +COMMAND *find_command (); + +/* The name of this program, as taken from argv[0]. */ +char *progname; + +/* When non-zero, this global means the user is done using this program. */ +int done; + +char * +dupstr (s) + int s; +@{ + char *r; + + r = xmalloc (strlen (s) + 1); + strcpy (r, s); + return (r); +@} + +main (argc, argv) + int argc; + char **argv; +@{ + char *line, *s; + + progname = argv[0]; + + initialize_readline (); /* Bind our completer. */ + + /* Loop reading and executing lines until the user quits. */ + for ( ; done == 0; ) + @{ + line = readline ("FileMan: "); + + if (!line) + break; + + /* Remove leading and trailing whitespace from the line. + Then, if there is anything left, add it to the history list + and execute it. */ + s = stripwhite (line); + + if (*s) + @{ + add_history (s); + execute_line (s); + @} + + free (line); + @} + exit (0); +@} + +/* Execute a command line. */ +int +execute_line (line) + char *line; +@{ + register int i; + COMMAND *command; + char *word; + + /* Isolate the command word. */ + i = 0; + while (line[i] && whitespace (line[i])) + i++; + word = line + i; + + while (line[i] && !whitespace (line[i])) + i++; + + if (line[i]) + line[i++] = '\0'; + + command = find_command (word); + + if (!command) + @{ + fprintf (stderr, "%s: No such command for FileMan.\n", word); + return (-1); + @} + + /* Get argument to command, if any. */ + while (whitespace (line[i])) + i++; + + word = line + i; + + /* Call the function. */ + return ((*(command->func)) (word)); +@} + +/* Look up NAME as the name of a command, and return a pointer to that + command. Return a NULL pointer if NAME isn't a command name. */ +COMMAND * +find_command (name) + char *name; +@{ + register int i; + + for (i = 0; commands[i].name; i++) + if (strcmp (name, commands[i].name) == 0) + return (&commands[i]); + + return ((COMMAND *)NULL); +@} + +/* Strip whitespace from the start and end of STRING. Return a pointer + into STRING. */ +char * +stripwhite (string) + char *string; +@{ + register char *s, *t; + + for (s = string; whitespace (*s); s++) + ; + + if (*s == 0) + return (s); + + t = s + strlen (s) - 1; + while (t > s && whitespace (*t)) + t--; + *++t = '\0'; + + return s; +@} + +/* **************************************************************** */ +/* */ +/* Interface to Readline Completion */ +/* */ +/* **************************************************************** */ + +char *command_generator (); +char **fileman_completion (); + +/* Tell the GNU Readline library how to complete. We want to try to complete + on command names if this is the first word in the line, or on filenames + if not. */ +initialize_readline () +@{ + /* Allow conditional parsing of the ~/.inputrc file. */ + rl_readline_name = "FileMan"; + + /* Tell the completer that we want a crack first. */ + rl_attempted_completion_function = (CPPFunction *)fileman_completion; +@} + +/* Attempt to complete on the contents of TEXT. START and END show the + region of TEXT that contains the word to complete. We can use the + entire line in case we want to do some simple parsing. Return the + array of matches, or NULL if there aren't any. */ +char ** +fileman_completion (text, start, end) + char *text; + int start, end; +@{ + char **matches; + + matches = (char **)NULL; + + /* If this word is at the start of the line, then it is a command + to complete. Otherwise it is the name of a file in the current + directory. */ + if (start == 0) + matches = completion_matches (text, command_generator); + + return (matches); +@} + +/* Generator function for command completion. STATE lets us know whether + to start from scratch; without any state (i.e. STATE == 0), then we + start at the top of the list. */ +char * +command_generator (text, state) + char *text; + int state; +@{ + static int list_index, len; + char *name; + + /* If this is a new word to complete, initialize now. This includes + saving the length of TEXT for efficiency, and initializing the index + variable to 0. */ + if (!state) + @{ + list_index = 0; + len = strlen (text); + @} + + /* Return the next name which partially matches from the command list. */ + while (name = commands[list_index].name) + @{ + list_index++; + + if (strncmp (name, text, len) == 0) + return (dupstr(name)); + @} + + /* If no names matched, then return NULL. */ + return ((char *)NULL); +@} + +/* **************************************************************** */ +/* */ +/* FileMan Commands */ +/* */ +/* **************************************************************** */ + +/* String to pass to system (). This is for the LIST, VIEW and RENAME + commands. */ +static char syscom[1024]; + +/* List the file(s) named in arg. */ +com_list (arg) + char *arg; +@{ + if (!arg) + arg = ""; + + sprintf (syscom, "ls -FClg %s", arg); + return (system (syscom)); +@} + +com_view (arg) + char *arg; +@{ + if (!valid_argument ("view", arg)) + return 1; + + sprintf (syscom, "more %s", arg); + return (system (syscom)); +@} + +com_rename (arg) + char *arg; +@{ + too_dangerous ("rename"); + return (1); +@} + +com_stat (arg) + char *arg; +@{ + struct stat finfo; + + if (!valid_argument ("stat", arg)) + return (1); + + if (stat (arg, &finfo) == -1) + @{ + perror (arg); + return (1); + @} + + printf ("Statistics for `%s':\n", arg); + + printf ("%s has %d link%s, and is %d byte%s in length.\n", arg, + finfo.st_nlink, + (finfo.st_nlink == 1) ? "" : "s", + finfo.st_size, + (finfo.st_size == 1) ? "" : "s"); + printf ("Inode Last Change at: %s", ctime (&finfo.st_ctime)); + printf (" Last access at: %s", ctime (&finfo.st_atime)); + printf (" Last modified at: %s", ctime (&finfo.st_mtime)); + return (0); +@} + +com_delete (arg) + char *arg; +@{ + too_dangerous ("delete"); + return (1); +@} + +/* Print out help for ARG, or for all of the commands if ARG is + not present. */ +com_help (arg) + char *arg; +@{ + register int i; + int printed = 0; + + for (i = 0; commands[i].name; i++) + @{ + if (!*arg || (strcmp (arg, commands[i].name) == 0)) + @{ + printf ("%s\t\t%s.\n", commands[i].name, commands[i].doc); + printed++; + @} + @} + + if (!printed) + @{ + printf ("No commands match `%s'. Possibilties are:\n", arg); + + for (i = 0; commands[i].name; i++) + @{ + /* Print in six columns. */ + if (printed == 6) + @{ + printed = 0; + printf ("\n"); + @} + + printf ("%s\t", commands[i].name); + printed++; + @} + + if (printed) + printf ("\n"); + @} + return (0); +@} + +/* Change to the directory ARG. */ +com_cd (arg) + char *arg; +@{ + if (chdir (arg) == -1) + @{ + perror (arg); + return 1; + @} + + com_pwd (""); + return (0); +@} + +/* Print out the current working directory. */ +com_pwd (ignore) + char *ignore; +@{ + char dir[1024], *s; + + s = getwd (dir); + if (s == 0) + @{ + printf ("Error getting pwd: %s\n", dir); + return 1; + @} + + printf ("Current directory is %s\n", dir); + return 0; +@} + +/* The user wishes to quit using this program. Just set DONE non-zero. */ +com_quit (arg) + char *arg; +@{ + done = 1; + return (0); +@} + +/* Function which tells you that you can't do this. */ +too_dangerous (caller) + char *caller; +@{ + fprintf (stderr, + "%s: Too dangerous for me to distribute. Write it yourself.\n", + caller); +@} + +/* Return non-zero if ARG is a valid argument for CALLER, else print + an error message and return zero. */ +int +valid_argument (caller, arg) + char *caller, *arg; +@{ + if (!arg || !*arg) + @{ + fprintf (stderr, "%s: Argument required.\n", caller); + return (0); + @} + + return (1); +@} +@end smallexample diff --git a/doc/rluser.texinfo b/doc/rluser.texinfo new file mode 100644 index 0000000..3567549 --- /dev/null +++ b/doc/rluser.texinfo @@ -0,0 +1,875 @@ +@comment %**start of header (This is for running Texinfo on a region.) +@setfilename rluser.info +@comment %**end of header (This is for running Texinfo on a region.) +@setchapternewpage odd + +@ignore +This file documents the end user interface to the GNU command line +editing features. It is to be an appendix to manuals for programs which +use these features. There is a document entitled "readline.texinfo" +which contains both end-user and programmer documentation for the GNU +Readline Library. + +Copyright (C) 1988 Free Software Foundation, Inc. + +Authored by Brian Fox and Chet Ramey. + +Permission is granted to process this file through Tex and print the +results, provided the printed document carries copying permission notice +identical to this one except for the removal of this paragraph (this +paragraph not being relevant to the printed manual). + +Permission is granted to make and distribute verbatim copies of this manual +provided the copyright notice and this permission notice are preserved on +all copies. + +Permission is granted to copy and distribute modified versions of this +manual under the conditions for verbatim copying, provided also that the +GNU Copyright statement is available to the distributee, and provided that +the entire resulting derived work is distributed under the terms of a +permission notice identical to this one. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for modified versions. +@end ignore + +@comment If you are including this manual as an appendix, then set the +@comment variable readline-appendix. + +@node Command Line Editing +@chapter Command Line Editing + +This chapter describes the basic features of the GNU +command line editing interface. + +@menu +* Introduction and Notation:: Notation used in this text. +* Readline Interaction:: The minimum set of commands for editing a line. +* Readline Init File:: Customizing Readline from a user's view. +* Bindable Readline Commands:: A description of most of the Readline commands + available for binding +* Readline vi Mode:: A short description of how to make Readline + behave like the vi editor. +@end menu + +@node Introduction and Notation +@section Introduction to Line Editing + +The following paragraphs describe the notation used to represent +keystrokes. + +The text @key{C-k} is read as `Control-K' and describes the character +produced when the Control key is depressed and the @key{k} key is struck. + +The text @key{M-k} is read as `Meta-K' and describes the character +produced when the meta key (if you have one) is depressed, and the @key{k} +key is struck. If you do not have a meta key, the identical keystroke +can be generated by typing @key{ESC} @i{first}, and then typing @key{k}. +Either process is known as @dfn{metafying} the @key{k} key. + +The text @key{M-C-k} is read as `Meta-Control-k' and describes the +character produced by @dfn{metafying} @key{C-k}. + +In addition, several keys have their own names. Specifically, +@key{DEL}, @key{ESC}, @key{LFD}, @key{SPC}, @key{RET}, and @key{TAB} all +stand for themselves when seen in this text, or in an init file +(@pxref{Readline Init File}, for more info). + +@node Readline Interaction +@section Readline Interaction +@cindex interaction, readline + +Often during an interactive session you type in a long line of text, +only to notice that the first word on the line is misspelled. The +Readline library gives you a set of commands for manipulating the text +as you type it in, allowing you to just fix your typo, and not forcing +you to retype the majority of the line. Using these editing commands, +you move the cursor to the place that needs correction, and delete or +insert the text of the corrections. Then, when you are satisfied with +the line, you simply press @key{RETURN}. You do not have to be at the +end of the line to press @key{RETURN}; the entire line is accepted +regardless of the location of the cursor within the line. + +@menu +* Readline Bare Essentials:: The least you need to know about Readline. +* Readline Movement Commands:: Moving about the input line. +* Readline Killing Commands:: How to delete text, and how to get it back! +* Readline Arguments:: Giving numeric arguments to commands. +@end menu + +@node Readline Bare Essentials +@subsection Readline Bare Essentials + +In order to enter characters into the line, simply type them. The typed +character appears where the cursor was, and then the cursor moves one +space to the right. If you mistype a character, you can use your +erase character to back up and delete the mistyped character. + +Sometimes you may miss typing a character that you wanted to type, and +not notice your error until you have typed several other characters. In +that case, you can type @key{C-b} to move the cursor to the left, and then +correct your mistake. Afterwards, you can move the cursor to the right +with @key{C-f}. + +When you add text in the middle of a line, you will notice that characters +to the right of the cursor are `pushed over' to make room for the text +that you have inserted. Likewise, when you delete text behind the cursor, +characters to the right of the cursor are `pulled back' to fill in the +blank space created by the removal of the text. A list of the basic bare +essentials for editing the text of an input line follows. + +@table @asis +@item @key{C-b} +Move back one character. +@item @key{C-f} +Move forward one character. +@item @key{DEL} +Delete the character to the left of the cursor. +@item @key{C-d} +Delete the character underneath the cursor. +@item @w{Printing characters} +Insert the character into the line at the cursor. +@item @key{C-_} +Undo the last thing that you did. You can undo all the way back to an +empty line. +@end table + +@node Readline Movement Commands +@subsection Readline Movement Commands + + +The above table describes the most basic possible keystrokes that you need +in order to do editing of the input line. For your convenience, many +other commands have been added in addition to @key{C-b}, @key{C-f}, +@key{C-d}, and @key{DEL}. Here are some commands for moving more rapidly +about the line. + +@table @key +@item C-a +Move to the start of the line. +@item C-e +Move to the end of the line. +@item M-f +Move forward a word. +@item M-b +Move backward a word. +@item C-l +Clear the screen, reprinting the current line at the top. +@end table + +Notice how @key{C-f} moves forward a character, while @key{M-f} moves +forward a word. It is a loose convention that control keystrokes +operate on characters while meta keystrokes operate on words. + +@node Readline Killing Commands +@subsection Readline Killing Commands + +@cindex Killing text +@cindex Yanking text + +@dfn{Killing} text means to delete the text from the line, but to save +it away for later use, usually by @dfn{yanking} (re-inserting) +it back into the line. +If the description for a command says that it `kills' text, then you can +be sure that you can get the text back in a different (or the same) +place later. + +When you use a kill command, the text is saved in a @dfn{kill-ring}. +Any number of consecutive kills save all of the killed text together, so +that when you yank it back, you get it all. The kill +ring is not line specific; the text that you killed on a previously +typed line is available to be yanked back later, when you are typing +another line. +@cindex Kill ring + +Here is the list of commands for killing text. + +@table @key +@item C-k +Kill the text from the current cursor position to the end of the line. + +@item M-d +Kill from the cursor to the end of the current word, or if between +words, to the end of the next word. + +@item M-DEL +Kill from the cursor the start of the previous word, or if between +words, to the start of the previous word. + +@item C-w +Kill from the cursor to the previous whitespace. This is different than +@key{M-DEL} because the word boundaries differ. + +@end table + +And, here is how to @dfn{yank} the text back into the line. Yanking +means to copy the most-recently-killed text from the kill buffer. + +@table @key +@item C-y +Yank the most recently killed text back into the buffer at the cursor. + +@item M-y +Rotate the kill-ring, and yank the new top. You can only do this if +the prior command is @key{C-y} or @key{M-y}. +@end table + +@node Readline Arguments +@subsection Readline Arguments + +You can pass numeric arguments to Readline commands. Sometimes the +argument acts as a repeat count, other times it is the @i{sign} of the +argument that is significant. If you pass a negative argument to a +command which normally acts in a forward direction, that command will +act in a backward direction. For example, to kill text back to the +start of the line, you might type @key{M--} @key{C-k}. + +The general way to pass numeric arguments to a command is to type meta +digits before the command. If the first `digit' you type is a minus +sign (@key{-}), then the sign of the argument will be negative. Once +you have typed one meta digit to get the argument started, you can type +the remainder of the digits, and then the command. For example, to give +the @key{C-d} command an argument of 10, you could type @key{M-1 0 C-d}. + + +@node Readline Init File +@section Readline Init File + +Although the Readline library comes with a set of Emacs-like +keybindings installed by default, +it is possible that you would like to use a different set +of keybindings. You can customize programs that use Readline by putting +commands in an @dfn{init} file in your home directory. The name of this +@ifset BashFeatures +file is taken from the value of the shell variable @code{INPUTRC}. If +@end ifset +@ifclear BashFeatures +file is taken from the value of the environment variable @code{INPUTRC}. If +@end ifclear +that variable is unset, the default is @file{~/.inputrc}. + +When a program which uses the Readline library starts up, the +init file is read, and the key bindings are set. + +In addition, the @code{C-x C-r} command re-reads this init file, thus +incorporating any changes that you might have made to it. + +@menu +* Readline Init Syntax:: Syntax for the commands in the inputrc file. +* Conditional Init Constructs:: Conditional key bindings in the inputrc file. +@end menu + +@node Readline Init Syntax +@subsection Readline Init Syntax + +There are only a few basic constructs allowed in the +Readline init file. Blank lines are ignored. +Lines beginning with a @key{#} are comments. +Lines beginning with a @key{$} indicate conditional +constructs (@pxref{Conditional Init Constructs}). Other lines +denote variable settings and key bindings. + +@table @asis +@item Variable Settings +You can change the state of a few variables in Readline by +using the @code{set} command within the init file. Here is how you +would specify that you wish to use @code{vi} line editing commands: + +@example +set editing-mode vi +@end example + +Right now, there are only a few variables which can be set; +so few, in fact, that we just list them here: + +@table @code + +@item editing-mode +@vindex editing-mode +The @code{editing-mode} variable controls which editing mode you are +using. By default, Readline starts up in Emacs editing mode, where +the keystrokes are most similar to Emacs. This variable can be +set to either @code{emacs} or @code{vi}. + +@item horizontal-scroll-mode +@vindex horizontal-scroll-mode +This variable can be set to either @code{On} or @code{Off}. Setting it +to @code{On} means that the text of the lines that you edit will scroll +horizontally on a single screen line when they are longer than the width +of the screen, instead of wrapping onto a new screen line. By default, +this variable is set to @code{Off}. + +@item mark-modified-lines +@vindex mark-modified-lines +This variable, when set to @code{On}, says to display an asterisk +(@samp{*}) at the start of history lines which have been modified. +This variable is @code{off} by default. + +@item bell-style +@vindex bell-style +Controls what happens when Readline wants to ring the terminal bell. +If set to @code{none}, Readline never rings the bell. If set to +@code{visible}, Readline uses a visible bell if one is available. +If set to @code{audible} (the default), Readline attempts to ring +the terminal's bell. + +@item comment-begin +@vindex comment-begin +The string to insert at the beginning of the line when the +@code{vi-comment} command is executed. The default value +is @code{"#"}. + +@item meta-flag +@vindex meta-flag +If set to @code{on}, Readline will enable eight-bit input (it +will not strip the eighth bit from the characters it reads), +regardless of what the terminal claims it can support. The +default value is @code{off}. + +@item convert-meta +@vindex convert-meta +If set to @code{on}, Readline will convert characters with the +eigth bit set to an ASCII key sequence by stripping the eigth +bit and prepending an @key{ESC} character, converting them to a +meta-prefixed key sequence. The default value is @code{on}. + +@item output-meta +@vindex output-meta +If set to @code{on}, Readline will display characters with the +eighth bit set directly rather than as a meta-prefixed escape +sequence. The default is @code{off}. + +@item completion-query-items +@vindex completion-query-items +The number of possible completions that determines when the user is +asked whether he wants to see the list of possibilities. If the +number of possible completions is greater than this value, +Readline will ask the user whether or not he wishes to view +them; otherwise, they are simply listed. The default limit is +@code{100}. + +@item keymap +@vindex keymap +Sets Readline's idea of the current keymap for key binding commands. +Acceptable @code{keymap} names are +@code{emacs}, +@code{emacs-standard}, +@code{emacs-meta}, +@code{emacs-ctlx}, +@code{vi}, +@code{vi-move}, +@code{vi-command}, and +@code{vi-insert}. +@code{vi} is equivalent to @code{vi-command}; @code{emacs} is +equivalent to @code{emacs-standard}. The default value is @code{emacs}. +The value of the @code{editing-mode} variable also affects the +default keymap. + +@item show-all-if-ambiguous +@vindex show-all-if-ambiguous +This alters the default behavior of the completion functions. If +set to @code{on}, +words which have more than one possible completion cause the +matches to be listed immediately instead of ringing the bell. +The default value is @code{off}. + +@item expand-tilde +@vindex expand-tilde +If set to @code{on}, tilde expansion is performed when Readline +attempts word completion. The default is @code{off}. + +@end table + +@item Key Bindings +The syntax for controlling key bindings in the init file is +simple. First you have to know the name of the command that you +want to change. The following pages contain tables of the command name, +the default keybinding, and a short description of what the command +does. + +Once you know the name of the command, simply place the name of the key +you wish to bind the command to, a colon, and then the name of the +command on a line in the init file. The name of the key +can be expressed in different ways, depending on which is most +comfortable for you. + +@table @asis +@item @w{@var{keyname}: @var{function-name} or @var{macro}} +@var{keyname} is the name of a key spelled out in English. For example: +@example +Control-u: universal-argument +Meta-Rubout: backward-kill-word +Control-o: ">&output" +@end example + +In the above example, @samp{C-u} is bound to the function +@code{universal-argument}, and @samp{C-o} is bound to run the macro +expressed on the right hand side (that is, to insert the text +@samp{>&output} into the line). + +@item @w{"@var{keyseq}": @var{function-name} or @var{macro}} +@var{keyseq} differs from @var{keyname} above in that strings +denoting an entire key sequence can be specified, by placing +the key sequence in double quotes. Some GNU Emacs style key +escapes can be used, as in the following example, but the +special character names are not recognized. + +@example +"\C-u": universal-argument +"\C-x\C-r": re-read-init-file +"\e[11~": "Function Key 1" +@end example + +In the above example, @samp{C-u} is bound to the function +@code{universal-argument} (just as it was in the first example), +@samp{C-x C-r} is bound to the function @code{re-read-init-file}, and +@samp{ESC [ 1 1 ~} is bound to insert the text @samp{Function Key 1}. +The following escape sequences are available when specifying key +sequences: + +@table @code +@item @kbd{\C-} +control prefix +@item @kbd{\M-} +meta prefix +@item @kbd{\e} +an escape character +@item @kbd{\\} +backslash +@item @kbd{\"} +@key{"} +@item @kbd{\'} +@key{'} +@end table + +When entering the text of a macro, single or double quotes should +be used to indicate a macro definition. Unquoted text +is assumed to be a function name. Backslash +will quote any character in the macro text, including @key{"} +and @key{'}. +For example, the following binding will make @kbd{C-x \} +insert a single @key{\} into the line: +@example +"\C-x\\": "\\" +@end example + +@end table +@end table + +@node Conditional Init Constructs +@subsection Conditional Init Constructs + +Readline implements a facility similar in spirit to the conditional +compilation features of the C preprocessor which allows key +bindings and variable settings to be performed as the result +of tests. There are three parser directives used. + +@ftable @code +@item $if +The @code{$if} construct allows bindings to be made based on the +editing mode, the terminal being used, or the application using +Readline. The text of the test extends to the end of the line; +no characters are required to isolate it. + +@table @code +@item mode +The @code{mode=} form of the @code{$if} directive is used to test +whether Readline is in @code{emacs} or @code{vi} mode. +This may be used in conjunction +with the @samp{set keymap} command, for instance, to set bindings in +the @code{emacs-standard} and @code{emacs-ctlx} keymaps only if +Readline is starting out in @code{emacs} mode. + +@item term +The @code{term=} form may be used to include terminal-specific +key bindings, perhaps to bind the key sequences output by the +terminal's function keys. The word on the right side of the +@samp{=} is tested against the full name of the terminal and the +portion of the terminal name before the first @samp{-}. This +allows @var{sun} to match both @var{sun} and @var{sun-cmd}, +for instance. + +@item application +The @var{application} construct is used to include +application-specific settings. Each program using the Readline +library sets the @var{application name}, and you can test for it. +This could be used to bind key sequences to functions useful for +a specific program. For instance, the following command adds a +key sequence that quotes the current or previous word in Bash: +@example +$if bash +# Quote the current or previous word +"\C-xq": "\eb\"\ef\"" +$endif +@end example +@end table + +@item $endif +This command, as you saw in the previous example, terminates an +@code{$if} command. + +@item $else +Commands in this branch of the @code{$if} directive are executed if +the test fails. +@end ftable + +@node Bindable Readline Commands +@section Bindable Readline Commands + +@menu +* Commands For Moving:: Moving about the line. +* Commands For History:: Getting at previous lines. +* Commands For Text:: Commands for changing text. +* Commands For Killing:: Commands for killing and yanking. +* Numeric Arguments:: Specifying numeric arguments, repeat counts. +* Commands For Completion:: Getting Readline to do the typing for you. +* Keyboard Macros:: Saving and re-executing typed characters +* Miscellaneous Commands:: Other miscellaneous commands. +@end menu + +@node Commands For Moving +@subsection Commands For Moving +@ftable @code +@item beginning-of-line (C-a) +Move to the start of the current line. + +@item end-of-line (C-e) +Move to the end of the line. + +@item forward-char (C-f) +Move forward a character. + +@item backward-char (C-b) +Move back a character. + +@item forward-word (M-f) +Move forward to the end of the next word. Words are composed of +letters and digits. + +@item backward-word (M-b) +Move back to the start of this, or the previous, word. Words are +composed of letters and digits. + +@item clear-screen (C-l) +Clear the screen and redraw the current line, +leaving the current line at the top of the screen. + +@item redraw-current-line () +Refresh the current line. By default, this is unbound. + +@end ftable + +@node Commands For History +@subsection Commands For Manipulating The History + +@ftable @code +@item accept-line (Newline, Return) +@ifset BashFeatures +Accept the line regardless of where the cursor is. If this line is +non-empty, add it to the history list according to the setting of +the @code{HISTCONTROL} variable. If this line was a history +line, then restore the history line to its original state. +@end ifset +@ifclear BashFeatures +Accept the line regardless of where the cursor is. If this line is +non-empty, add it to the history list. If this line was a history +line, then restore the history line to its original state. +@end ifclear + +@item previous-history (C-p) +Move `up' through the history list. + +@item next-history (C-n) +Move `down' through the history list. + +@item beginning-of-history (M-<) +Move to the first line in the history. + +@item end-of-history (M->) +Move to the end of the input history, i.e., the line you are entering. + +@item reverse-search-history (C-r) +Search backward starting at the current line and moving `up' through +the history as necessary. This is an incremental search. + +@item forward-search-history (C-s) +Search forward starting at the current line and moving `down' through +the the history as necessary. This is an incremental search. + +@item non-incremental-reverse-search-history (M-p) +Search backward starting at the current line and moving `up' +through the history as necessary using a non-incremental search +for a string supplied by the user. + +@item non-incremental-forward-search-history (M-n) +Search forward starting at the current line and moving `down' +through the the history as necessary using a non-incremental search +for a string supplied by the user. + +@item history-search-forward () +Search forward through the history for the string of characters +between the start of the current line and the current point. This +is a non-incremental search. By default, this command is unbound. + +@item history-search-backward () +Search backward through the history for the string of characters +between the start of the current line and the current point. This +is a non-incremental search. By default, this command is unbound. + +@item yank-nth-arg (M-C-y) +Insert the first argument to the previous command (usually +the second word on the previous line). With an argument @var{n}, +insert the @var{n}th word from the previous command (the words +in the previous command begin with word 0). A negative argument +inserts the @var{n}th word from the end of the previous command. + +@item yank-last-arg (M-., M-_) +Insert last argument to the previous command (the last word on the +previous line). With an +argument, behave exactly like @code{yank-nth-arg}. + +@end ftable + +@node Commands For Text +@subsection Commands For Changing Text + +@ftable @code +@item delete-char (C-d) +Delete the character under the cursor. If the cursor is at the +beginning of the line, there are no characters in the line, and +the last character typed was not C-d, then return EOF. + +@item backward-delete-char (Rubout) +Delete the character behind the cursor. A numeric arg says to kill +the characters instead of deleting them. + +@item quoted-insert (C-q, C-v) +Add the next character that you type to the line verbatim. This is +how to insert key sequences like @key{C-q}, for example. + +@item tab-insert (M-TAB) +Insert a tab character. + +@item self-insert (a, b, A, 1, !, ...) +Insert yourself. + +@item transpose-chars (C-t) +Drag the character before the cursor forward over +the character at the cursor, moving the +cursor forward as well. If the insertion point +is at the end of the line, then this +transposes the last two characters of the line. +Negative argumentss don't work. + +@item transpose-words (M-t) +Drag the word behind the cursor past the word in front of the cursor +moving the cursor over that word as well. + +@item upcase-word (M-u) +Uppercase the current (or following) word. With a negative argument, +do the previous word, but do not move the cursor. + +@item downcase-word (M-l) +Lowercase the current (or following) word. With a negative argument, +do the previous word, but do not move the cursor. + +@item capitalize-word (M-c) +Capitalize the current (or following) word. With a negative argument, +do the previous word, but do not move the cursor. + +@end ftable + +@node Commands For Killing +@subsection Killing And Yanking + +@ftable @code + +@item kill-line (C-k) +Kill the text from the current cursor position to the end of the line. + +@item backward-kill-line (C-x Rubout) +Kill backward to the beginning of the line. + +@item unix-line-discard (C-u) +Kill backward from the cursor to the beginning of the current line. +Save the killed text on the kill-ring. + +@item kill-whole-line () +Kill all characters on the current line, no matter where the +cursor is. By default, this is unbound. + +@item kill-word (M-d) +Kill from the cursor to the end of the current word, or if between +words, to the end of the next word. Word boundaries are the same +as @code{forward-word}. + +@item backward-kill-word (M-DEL) +Kill the word behind the cursor. Word boundaries are the same +as @code{backward-word}. + +@item unix-word-rubout (C-w) +Kill the word behind the cursor, using white space as a word +boundary. The killed text is saved on the kill-ring. + +@item delete-horizontal-space () +Delete all spaces and tabs around point. By default, this is unbound. + +@item yank (C-y) +Yank the top of the kill ring into the buffer at the current +cursor position. + +@item yank-pop (M-y) +Rotate the kill-ring, and yank the new top. You can only do this if +the prior command is yank or yank-pop. +@end ftable + +@node Numeric Arguments +@subsection Specifying Numeric Arguments +@ftable @code + +@item digit-argument (M-0, M-1, ... M--) +Add this digit to the argument already accumulating, or start a new +argument. M-- starts a negative argument. + +@item universal-argument () +Each time this is executed, the argument count is multiplied by four. +The argument count is initially one, so executing this function the +first time makes the argument count four. By default, this is not +bound to a key. +@end ftable + +@node Commands For Completion +@subsection Letting Readline Type For You + +@ftable @code +@item complete (TAB) +Attempt to do completion on the text before the cursor. This is +application-specific. Generally, if you are typing a filename +argument, you can do filename completion; if you are typing a command, +you can do command completion, if you are typing in a symbol to GDB, you +can do symbol name completion, if you are typing in a variable to Bash, +you can do variable name completion, and so on. +@ifset BashFeatures +See the Bash manual page for a complete list of available completion +functions. +@end ifset + +@item possible-completions (M-?) +List the possible completions of the text before the cursor. + +@item insert-completions () +Insert all completions of the text before point that would have +been generated by @code{possible-completions}. By default, this +is not bound to a key. + +@end ftable + +@node Keyboard Macros +@subsection Keyboard Macros +@ftable @code + +@item start-kbd-macro (C-x () +Begin saving the characters typed into the current keyboard macro. + +@item end-kbd-macro (C-x )) +Stop saving the characters typed into the current keyboard macro +and save the definition. + +@item call-last-kbd-macro (C-x e) +Re-execute the last keyboard macro defined, by making the characters +in the macro appear as if typed at the keyboard. + +@end ftable + +@node Miscellaneous Commands +@subsection Some Miscellaneous Commands +@ftable @code + +@item re-read-init-file (C-x C-r) +Read in the contents of your init file, and incorporate +any bindings or variable assignments found there. + +@item abort (C-g) +Abort the current editing command and +ring the terminal's bell (subject to the setting of +@code{bell-style}). + +@item do-uppercase-version (M-a, M-b, ...) +Run the command that is bound to the corresoponding uppercase +character. + +@item prefix-meta (ESC) +Make the next character that you type be metafied. This is for people +without a meta key. Typing @samp{ESC f} is equivalent to typing +@samp{M-f}. + +@item undo (C-_, C-x C-u) +Incremental undo, separately remembered for each line. + +@item revert-line (M-r) +Undo all changes made to this line. This is like typing the @code{undo} +command enough times to get back to the beginning. + +@item tilde-expand (M-~) +Perform tilde expansion on the current word. + +@item dump-functions () +Print all of the functions and their key bindings to the +readline output stream. If a numeric argument is supplied, +the output is formatted in such a way that it can be made part +of an @var{inputrc} file. + +@ifset BashFeatures +@item display-shell-version (C-x C-v) +Display version information about the current instance of Bash. + +@item shell-expand-line (M-C-e) +Expand the line the way the shell does when it reads it. This +performs alias and history expansion as well as all of the shell +word expansions. + +@item history-expand-line (M-^) +Perform history expansion on the current line. + +@item insert-last-argument (M-., M-_) +A synonym for @code{yank-last-arg}. + +@item operate-and-get-next (C-o) +Accept the current line for execution and fetch the next line +relative to the current line from the history for editing. Any +argument is ignored. + +@item emacs-editing-mode (C-e) +When in @code{vi} editing mode, this causes a switch back to +emacs editing mode, as if the command @code{set -o emacs} had +been executed. + +@end ifset + +@end ftable + +@node Readline vi Mode +@section Readline vi Mode + +While the Readline library does not have a full set of @code{vi} +editing functions, it does contain enough to allow simple editing +of the line. The Readline @code{vi} mode behaves as specified in +the Posix 1003.2 standard. + +@ifset BashFeatures +In order to switch interactively between @code{Emacs} and @code{Vi} +editing modes, use the @code{set -o emacs} and @code{set -o vi} +commands (@pxref{The Set Builtin}). +@end ifset +@ifclear BashFeatures +In order to switch interactively between @code{Emacs} and @code{Vi} +editing modes, use the command M-C-j (toggle-editing-mode). +@end ifclear +The Readline default is @code{emacs} mode. + +When you enter a line in @code{vi} mode, you are already placed in +`insertion' mode, as if you had typed an @samp{i}. Pressing @key{ESC} +switches you into `command' mode, where you can edit the text of the +line with the standard @code{vi} movement keys, move to previous +history lines with @samp{k}, and following lines with @samp{j}, and +so forth. diff --git a/doc/texinfo.tex b/doc/texinfo.tex new file mode 100644 index 0000000..ce8124e --- /dev/null +++ b/doc/texinfo.tex @@ -0,0 +1,4003 @@ +%% TeX macros to handle texinfo files + +% Copyright (C) 1985, 86, 88, 90, 91, 92, 1993 Free Software Foundation, Inc. + +%This texinfo.tex file is free software; you can redistribute it and/or +%modify it under the terms of the GNU General Public License as +%published by the Free Software Foundation; either version 2, or (at +%your option) any later version. + +%This texinfo.tex file is distributed in the hope that it will be +%useful, but WITHOUT ANY WARRANTY; without even the implied warranty +%of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +%General Public License for more details. + +%You should have received a copy of the GNU General Public License +%along with this texinfo.tex file; see the file COPYING. If not, write +%to the Free Software Foundation, 675 Mass Ave, Cambridge, MA 02139, +%USA. + + +%In other words, you are welcome to use, share and improve this program. +%You are forbidden to forbid anyone else to use, share and improve +%what you give them. Help stamp out software-hoarding! + +\def\texinfoversion{2.108} +\message{Loading texinfo package [Version \texinfoversion]:} + +% Print the version number if in a .fmt file. +\everyjob{\message{[Texinfo version \texinfoversion]}\message{}} + +% Save some parts of plain tex whose names we will redefine. + +\let\ptexlbrace=\{ +\let\ptexrbrace=\} +\let\ptexdots=\dots +\let\ptexdot=\. +\let\ptexstar=\* +\let\ptexend=\end +\let\ptexbullet=\bullet +\let\ptexb=\b +\let\ptexc=\c +\let\ptexi=\i +\let\ptext=\t +\let\ptexl=\l +\let\ptexL=\L + +\def\tie{\penalty 10000\ } % Save plain tex definition of ~. + +\message{Basics,} +\chardef\other=12 + +% If this character appears in an error message or help string, it +% starts a new line in the output. +\newlinechar = `^^J + +% Ignore a token. +% +\def\gobble#1{} + +\hyphenation{ap-pen-dix} +\hyphenation{mini-buf-fer mini-buf-fers} +\hyphenation{eshell} + +% Margin to add to right of even pages, to left of odd pages. +\newdimen \bindingoffset \bindingoffset=0pt +\newdimen \normaloffset \normaloffset=\hoffset +\newdimen\pagewidth \newdimen\pageheight +\pagewidth=\hsize \pageheight=\vsize + +% Sometimes it is convenient to have everything in the transcript file +% and nothing on the terminal. We don't just call \tracingall here, +% since that produces some useless output on the terminal. +% +\def\gloggingall{\begingroup \globaldefs = 1 \loggingall \endgroup}% +\def\loggingall{\tracingcommands2 \tracingstats2 + \tracingpages1 \tracingoutput1 \tracinglostchars1 + \tracingmacros2 \tracingparagraphs1 \tracingrestores1 + \showboxbreadth\maxdimen\showboxdepth\maxdimen +}% + +%---------------------Begin change----------------------- +% +%%%% For @cropmarks command. +% Dimensions to add cropmarks at corners Added by P. A. MacKay, 12 Nov. 1986 +% +\newdimen\cornerlong \newdimen\cornerthick +\newdimen \topandbottommargin +\newdimen \outerhsize \newdimen \outervsize +\cornerlong=1pc\cornerthick=.3pt % These set size of cropmarks +\outerhsize=7in +%\outervsize=9.5in +% Alternative @smallbook page size is 9.25in +\outervsize=9.25in +\topandbottommargin=.75in +% +%---------------------End change----------------------- + +% \onepageout takes a vbox as an argument. Note that \pagecontents +% does insertions itself, but you have to call it yourself. +\chardef\PAGE=255 \output={\onepageout{\pagecontents\PAGE}} +\def\onepageout#1{\hoffset=\normaloffset +\ifodd\pageno \advance\hoffset by \bindingoffset +\else \advance\hoffset by -\bindingoffset\fi +{\escapechar=`\\\relax % makes sure backslash is used in output files. +\shipout\vbox{{\let\hsize=\pagewidth \makeheadline} \pagebody{#1}% +{\let\hsize=\pagewidth \makefootline}}}% +\advancepageno \ifnum\outputpenalty>-20000 \else\dosupereject\fi} + +%%%% For @cropmarks command %%%% + +% Here is a modification of the main output routine for Near East Publications +% This provides right-angle cropmarks at all four corners. +% The contents of the page are centerlined into the cropmarks, +% and any desired binding offset is added as an \hskip on either +% site of the centerlined box. (P. A. MacKay, 12 November, 1986) +% +\def\croppageout#1{\hoffset=0pt % make sure this doesn't mess things up +{\escapechar=`\\\relax % makes sure backslash is used in output files. + \shipout + \vbox to \outervsize{\hsize=\outerhsize + \vbox{\line{\ewtop\hfill\ewtop}} + \nointerlineskip + \line{\vbox{\moveleft\cornerthick\nstop} + \hfill + \vbox{\moveright\cornerthick\nstop}} + \vskip \topandbottommargin + \centerline{\ifodd\pageno\hskip\bindingoffset\fi + \vbox{ + {\let\hsize=\pagewidth \makeheadline} + \pagebody{#1} + {\let\hsize=\pagewidth \makefootline}} + \ifodd\pageno\else\hskip\bindingoffset\fi} + \vskip \topandbottommargin plus1fill minus1fill + \boxmaxdepth\cornerthick + \line{\vbox{\moveleft\cornerthick\nsbot} + \hfill + \vbox{\moveright\cornerthick\nsbot}} + \nointerlineskip + \vbox{\line{\ewbot\hfill\ewbot}} + }} + \advancepageno + \ifnum\outputpenalty>-20000 \else\dosupereject\fi} +% +% Do @cropmarks to get crop marks +\def\cropmarks{\let\onepageout=\croppageout } + +\def\pagebody#1{\vbox to\pageheight{\boxmaxdepth=\maxdepth #1}} +{\catcode`\@ =11 +\gdef\pagecontents#1{\ifvoid\topins\else\unvbox\topins\fi +\dimen@=\dp#1 \unvbox#1 +\ifvoid\footins\else\vskip\skip\footins\footnoterule \unvbox\footins\fi +\ifr@ggedbottom \kern-\dimen@ \vfil \fi} +} + +% +% Here are the rules for the cropmarks. Note that they are +% offset so that the space between them is truly \outerhsize or \outervsize +% (P. A. MacKay, 12 November, 1986) +% +\def\ewtop{\vrule height\cornerthick depth0pt width\cornerlong} +\def\nstop{\vbox + {\hrule height\cornerthick depth\cornerlong width\cornerthick}} +\def\ewbot{\vrule height0pt depth\cornerthick width\cornerlong} +\def\nsbot{\vbox + {\hrule height\cornerlong depth\cornerthick width\cornerthick}} + +% Parse an argument, then pass it to #1. The argument is the rest of +% the input line (except we remove a trailing comment). #1 should be a +% macro which expects an ordinary undelimited TeX argument. +% +\def\parsearg#1{% + \let\next = #1% + \begingroup + \obeylines + \futurelet\temp\parseargx +} + +% If the next token is an obeyed space (from an @example environment or +% the like), remove it and recurse. Otherwise, we're done. +\def\parseargx{% + % \obeyedspace is defined far below, after the definition of \sepspaces. + \ifx\obeyedspace\temp + \expandafter\parseargdiscardspace + \else + \expandafter\parseargline + \fi +} + +% Remove a single space (as the delimiter token to the macro call). +{\obeyspaces % + \gdef\parseargdiscardspace {\futurelet\temp\parseargx}} + +{\obeylines % + \gdef\parseargline#1^^M{% + \endgroup % End of the group started in \parsearg. + % + % First remove any @c comment, then any @comment. + % Result of each macro is put in \toks0. + \argremovec #1\c\relax % + \expandafter\argremovecomment \the\toks0 \comment\relax % + % + % Call the caller's macro, saved as \next in \parsearg. + \expandafter\next\expandafter{\the\toks0}% + }% +} + +% Since all \c{,omment} does is throw away the argument, we can let TeX +% do that for us. The \relax here is matched by the \relax in the call +% in \parseargline; it could be more or less anything, its purpose is +% just to delimit the argument to the \c. +\def\argremovec#1\c#2\relax{\toks0 = {#1}} +\def\argremovecomment#1\comment#2\relax{\toks0 = {#1}} + +% \argremovec{,omment} might leave us with trailing spaces, though; e.g., +% @end itemize @c foo +% will have two active spaces as part of the argument with the +% `itemize'. Here we remove all active spaces from #1, and assign the +% result to \toks0. +% +% This loses if there are any *other* active characters besides spaces +% in the argument -- _ ^ +, for example -- since they get expanded. +% Fortunately, Texinfo does not define any such commands. (If it ever +% does, the catcode of the characters in questionwill have to be changed +% here.) But this means we cannot call \removeactivespaces as part of +% \argremovec{,omment}, since @c uses \parsearg, and thus the argument +% that \parsearg gets might well have any character at all in it. +% +\def\removeactivespaces#1{% + \begingroup + \ignoreactivespaces + \edef\temp{#1}% + \global\toks0 = \expandafter{\temp}% + \endgroup +} + +% Change the active space to expand to nothing. +% +\begingroup + \obeyspaces + \gdef\ignoreactivespaces{\obeyspaces\let =\empty} +\endgroup + + +\def\flushcr{\ifx\par\lisppar \def\next##1{}\else \let\next=\relax \fi \next} + +%% These are used to keep @begin/@end levels from running away +%% Call \inENV within environments (after a \begingroup) +\newif\ifENV \ENVfalse \def\inENV{\ifENV\relax\else\ENVtrue\fi} +\def\ENVcheck{% +\ifENV\errmessage{Still within an environment. Type Return to continue.} +\endgroup\fi} % This is not perfect, but it should reduce lossage + +% @begin foo is the same as @foo, for now. +\newhelp\EMsimple{Type to continue.} + +\outer\def\begin{\parsearg\beginxxx} + +\def\beginxxx #1{% +\expandafter\ifx\csname #1\endcsname\relax +{\errhelp=\EMsimple \errmessage{Undefined command @begin #1}}\else +\csname #1\endcsname\fi} + +% @end foo executes the definition of \Efoo. +% +\def\end{\parsearg\endxxx} +\def\endxxx #1{% + \removeactivespaces{#1}% + \edef\endthing{\the\toks0}% + % + \expandafter\ifx\csname E\endthing\endcsname\relax + \expandafter\ifx\csname \endthing\endcsname\relax + % There's no \foo, i.e., no ``environment'' foo. + \errhelp = \EMsimple + \errmessage{Undefined command `@end \endthing'}% + \else + \unmatchedenderror\endthing + \fi + \else + % Everything's ok; the right environment has been started. + \csname E\endthing\endcsname + \fi +} + +% There is an environment #1, but it hasn't been started. Give an error. +% +\def\unmatchedenderror#1{% + \errhelp = \EMsimple + \errmessage{This `@end #1' doesn't have a matching `@#1'}% +} + +% Define the control sequence \E#1 to give an unmatched @end error. +% +\def\defineunmatchedend#1{% + \expandafter\def\csname E#1\endcsname{\unmatchedenderror{#1}}% +} + + +% Single-spacing is done by various environments (specifically, in +% \nonfillstart and \quotations). +\newskip\singlespaceskip \singlespaceskip = \baselineskip +\def\singlespace{% +% Why was this kern here? It messes up equalizing space above and below +% environments. --karl, 6may93 +%{\advance \baselineskip by -\singlespaceskip +%\kern \baselineskip}% +\baselineskip=\singlespaceskip +} + +%% Simple single-character @ commands + +% @@ prints an @ +% Kludge this until the fonts are right (grr). +\def\@{{\tt \char '100}} + +% This is turned off because it was never documented +% and you can use @w{...} around a quote to suppress ligatures. +%% Define @` and @' to be the same as ` and ' +%% but suppressing ligatures. +%\def\`{{`}} +%\def\'{{'}} + +% Used to generate quoted braces. + +\def\mylbrace {{\tt \char '173}} +\def\myrbrace {{\tt \char '175}} +\let\{=\mylbrace +\let\}=\myrbrace + +% @: forces normal size whitespace following. +\def\:{\spacefactor=1000 } + +% @* forces a line break. +\def\*{\hfil\break\hbox{}\ignorespaces} + +% @. is an end-of-sentence period. +\def\.{.\spacefactor=3000 } + +% @w prevents a word break. Without the \leavevmode, @w at the +% beginning of a paragraph, when TeX is still in vertical mode, would +% produce a whole line of output instead of starting the paragraph. +\def\w#1{\leavevmode\hbox{#1}} + +% @group ... @end group forces ... to be all on one page, by enclosing +% it in a TeX vbox. We use \vtop instead of \vbox to construct the box +% to keep its height that of a normal line. According to the rules for +% \topskip (p.114 of the TeXbook), the glue inserted is +% max (\topskip - \ht (first item), 0). If that height is large, +% therefore, no glue is inserted, and the space between the headline and +% the text is small, which looks bad. +% +\def\group{\begingroup + \ifnum\catcode13=\active \else + \errhelp = \groupinvalidhelp + \errmessage{@group invalid in context where filling is enabled}% + \fi + % + % The \vtop we start below produces a box with normal height and large + % depth; thus, TeX puts \baselineskip glue before it, and (when the + % next line of text is done) \lineskip glue after it. (See p.82 of + % the TeXbook.) Thus, space below is not quite equal to space + % above. But it's pretty close. + \def\Egroup{% + \egroup % End the \vtop. + \endgroup % End the \group. + }% + % + \vtop\bgroup + % We have to put a strut on the last line in case the @group is in + % the midst of an example, rather than completely enclosing it. + % Otherwise, the interline space between the last line of the group + % and the first line afterwards is too small. But we can't put the + % strut in \Egroup, since there it would be on a line by itself. + % Hence this just inserts a strut at the beginning of each line. + \everypar = {\strut}% + % + % Since we have a strut on every line, we don't need any of TeX's + % normal interline spacing. + \offinterlineskip + % + % OK, but now we have to do something about blank + % lines in the input in @example-like environments, which normally + % just turn into \lisppar, which will insert no space now that we've + % turned off the interline space. Simplest is to make them be an + % empty paragraph. + \ifx\par\lisppar + \edef\par{\leavevmode \par}% + % + % Reset ^^M's definition to new definition of \par. + \obeylines + \fi + % + % We do @comment here in case we are called inside an environment, + % such as @example, where each end-of-line in the input causes an + % end-of-line in the output. We don't want the end-of-line after + % the `@group' to put extra space in the output. Since @group + % should appear on a line by itself (according to the Texinfo + % manual), we don't worry about eating any user text. + \comment +} +% +% TeX puts in an \escapechar (i.e., `@') at the beginning of the help +% message, so this ends up printing `@group can only ...'. +% +\newhelp\groupinvalidhelp{% +group can only be used in environments such as @example,^^J% +where each line of input produces a line of output.} + +% @need space-in-mils +% forces a page break if there is not space-in-mils remaining. + +\newdimen\mil \mil=0.001in + +\def\need{\parsearg\needx} + +% Old definition--didn't work. +%\def\needx #1{\par % +%% This method tries to make TeX break the page naturally +%% if the depth of the box does not fit. +%{\baselineskip=0pt% +%\vtop to #1\mil{\vfil}\kern -#1\mil\penalty 10000 +%\prevdepth=-1000pt +%}} + +\def\needx#1{% + % Go into vertical mode, so we don't make a big box in the middle of a + % paragraph. + \par + % + % Don't add any leading before our big empty box, but allow a page + % break, since the best break might be right here. + \allowbreak + \nointerlineskip + \vtop to #1\mil{\vfil}% + % + % TeX does not even consider page breaks if a penalty added to the + % main vertical list is 10000 or more. But in order to see if the + % empty box we just added fits on the page, we must make it consider + % page breaks. On the other hand, we don't want to actually break the + % page after the empty box. So we use a penalty of 9999. + % + % There is an extremely small chance that TeX will actually break the + % page at this \penalty, if there are no other feasible breakpoints in + % sight. (If the user is using lots of big @group commands, which + % almost-but-not-quite fill up a page, TeX will have a hard time doing + % good page breaking, for example.) However, I could not construct an + % example where a page broke at this \penalty; if it happens in a real + % document, then we can reconsider our strategy. + \penalty9999 + % + % Back up by the size of the box, whether we did a page break or not. + \kern -#1\mil + % + % Do not allow a page break right after this kern. + \nobreak +} + +% @br forces paragraph break + +\let\br = \par + +% @dots{} output some dots + +\def\dots{$\ldots$} + +% @page forces the start of a new page + +\def\page{\par\vfill\supereject} + +% @exdent text.... +% outputs text on separate line in roman font, starting at standard page margin + +% This records the amount of indent in the innermost environment. +% That's how much \exdent should take out. +\newskip\exdentamount + +% This defn is used inside fill environments such as @defun. +\def\exdent{\parsearg\exdentyyy} +\def\exdentyyy #1{{\hfil\break\hbox{\kern -\exdentamount{\rm#1}}\hfil\break}} + +% This defn is used inside nofill environments such as @example. +\def\nofillexdent{\parsearg\nofillexdentyyy} +\def\nofillexdentyyy #1{{\advance \leftskip by -\exdentamount +\leftline{\hskip\leftskip{\rm#1}}}} + +%\hbox{{\rm#1}}\hfil\break}} + +% @include file insert text of that file as input. + +\def\include{\parsearg\includezzz} +%Use \input\thisfile to avoid blank after \input, which may be an active +%char (in which case the blank would become the \input argument). +%The grouping keeps the value of \thisfile correct even when @include +%is nested. +\def\includezzz #1{\begingroup +\def\thisfile{#1}\input\thisfile +\endgroup} + +\def\thisfile{} + +% @center line outputs that line, centered + +\def\center{\parsearg\centerzzz} +\def\centerzzz #1{{\advance\hsize by -\leftskip +\advance\hsize by -\rightskip +\centerline{#1}}} + +% @sp n outputs n lines of vertical space + +\def\sp{\parsearg\spxxx} +\def\spxxx #1{\par \vskip #1\baselineskip} + +% @comment ...line which is ignored... +% @c is the same as @comment +% @ignore ... @end ignore is another way to write a comment + +\def\comment{\catcode 64=\other \catcode 123=\other \catcode 125=\other% +\parsearg \commentxxx} + +\def\commentxxx #1{\catcode 64=0 \catcode 123=1 \catcode 125=2 } + +\let\c=\comment + +% Prevent errors for section commands. +% Used in @ignore and in failing conditionals. +\def\ignoresections{% +\let\chapter=\relax +\let\unnumbered=\relax +\let\top=\relax +\let\unnumberedsec=\relax +\let\unnumberedsection=\relax +\let\unnumberedsubsec=\relax +\let\unnumberedsubsection=\relax +\let\unnumberedsubsubsec=\relax +\let\unnumberedsubsubsection=\relax +\let\section=\relax +\let\subsec=\relax +\let\subsubsec=\relax +\let\subsection=\relax +\let\subsubsection=\relax +\let\appendix=\relax +\let\appendixsec=\relax +\let\appendixsection=\relax +\let\appendixsubsec=\relax +\let\appendixsubsection=\relax +\let\appendixsubsubsec=\relax +\let\appendixsubsubsection=\relax +\let\contents=\relax +\let\smallbook=\relax +\let\titlepage=\relax +} + +% Used in nested conditionals, where we have to parse the Texinfo source +% and so want to turn off most commands, in case they are used +% incorrectly. +% +\def\ignoremorecommands{% + \let\defcv = \relax + \let\deffn = \relax + \let\deffnx = \relax + \let\defindex = \relax + \let\defivar = \relax + \let\defmac = \relax + \let\defmethod = \relax + \let\defop = \relax + \let\defopt = \relax + \let\defspec = \relax + \let\deftp = \relax + \let\deftypefn = \relax + \let\deftypefun = \relax + \let\deftypevar = \relax + \let\deftypevr = \relax + \let\defun = \relax + \let\defvar = \relax + \let\defvr = \relax + \let\ref = \relax + \let\xref = \relax + \let\printindex = \relax + \let\pxref = \relax + \let\settitle = \relax + \let\include = \relax + \let\lowersections = \relax + \let\down = \relax + \let\raisesections = \relax + \let\up = \relax + \let\set = \relax + \let\clear = \relax +} + +% Ignore @ignore ... @end ignore. +% +\def\ignore{\doignore{ignore}} + +% Also ignore @ifinfo, @menu, and @direntry text. +% +\def\ifinfo{\doignore{ifinfo}} +\def\menu{\doignore{menu}} +\def\direntry{\doignore{direntry}} + +% Ignore text until a line `@end #1'. +% +\def\doignore#1{\begingroup + % Don't complain about control sequences we have declared \outer. + \ignoresections + % + % Define a command to swallow text until we reach `@end #1'. + \long\def\doignoretext##1\end #1{\enddoignore}% + % + % Make sure that spaces turn into tokens that match what \doignoretext wants. + \catcode32 = 10 + % + % And now expand that command. + \doignoretext +} + +% What we do to finish off ignored text. +% +\def\enddoignore{\endgroup\ignorespaces}% + +\newif\ifwarnedobs\warnedobsfalse +\def\obstexwarn{% + \ifwarnedobs\relax\else + % We need to warn folks that they may have trouble with TeX 3.0. + % This uses \immediate\write16 rather than \message to get newlines. + \immediate\write16{} + \immediate\write16{***WARNING*** for users of Unix TeX 3.0!} + \immediate\write16{This manual trips a bug in TeX version 3.0 (tex hangs).} + \immediate\write16{If you are running another version of TeX, relax.} + \immediate\write16{If you are running Unix TeX 3.0, kill this TeX process.} + \immediate\write16{ Then upgrade your TeX installation if you can.} + \immediate\write16{If you are stuck with version 3.0, run the} + \immediate\write16{ script ``tex3patch'' from the Texinfo distribution} + \immediate\write16{ to use a workaround.} + \immediate\write16{} + \warnedobstrue + \fi +} + +% **In TeX 3.0, setting text in \nullfont hangs tex. For a +% workaround (which requires the file ``dummy.tfm'' to be installed), +% uncomment the following line: +%%%%%\font\nullfont=dummy\let\obstexwarn=\relax + +% Ignore text, except that we keep track of conditional commands for +% purposes of nesting, up to an `@end #1' command. +% +\def\nestedignore#1{% + \obstexwarn + % We must actually expand the ignored text to look for the @end + % command, so that nested ignore constructs work. Thus, we put the + % text into a \vbox and then do nothing with the result. To minimize + % the change of memory overflow, we follow the approach outlined on + % page 401 of the TeXbook: make the current font be a dummy font. + % + \setbox0 = \vbox\bgroup + % Don't complain about control sequences we have declared \outer. + \ignoresections + % + % Define `@end #1' to end the box, which will in turn undefine the + % @end command again. + \expandafter\def\csname E#1\endcsname{\egroup\ignorespaces}% + % + % We are going to be parsing Texinfo commands. Most cause no + % trouble when they are used incorrectly, but some commands do + % complicated argument parsing or otherwise get confused, so we + % undefine them. + % + % We can't do anything about stray @-signs, unfortunately; + % they'll produce `undefined control sequence' errors. + \ignoremorecommands + % + % Set the current font to be \nullfont, a TeX primitive, and define + % all the font commands to also use \nullfont. We don't use + % dummy.tfm, as suggested in the TeXbook, because not all sites + % might have that installed. Therefore, math mode will still + % produce output, but that should be an extremely small amount of + % stuff compared to the main input. + % + \nullfont + \let\tenrm = \nullfont \let\tenit = \nullfont \let\tensl = \nullfont + \let\tenbf = \nullfont \let\tentt = \nullfont \let\smallcaps = \nullfont + \let\tensf = \nullfont + % + % Don't complain when characters are missing from the fonts. + \tracinglostchars = 0 + % + % Don't bother to do space factor calculations. + \frenchspacing + % + % Don't report underfull hboxes. + \hbadness = 10000 + % + % Do minimal line-breaking. + \pretolerance = 10000 + % + % Do not execute instructions in @tex + \def\tex{\doignore{tex}} +} + +% @set VAR sets the variable VAR to an empty value. +% @set VAR REST-OF-LINE sets VAR to the value REST-OF-LINE. +% +% Since we want to separate VAR from REST-OF-LINE (which might be +% empty), we can't just use \parsearg; we have to insert a space of our +% own to delimit the rest of the line, and then take it out again if we +% didn't need it. +% +\def\set{\parsearg\setxxx} +\def\setxxx#1{\setyyy#1 \endsetyyy} +\def\setyyy#1 #2\endsetyyy{% + \def\temp{#2}% + \ifx\temp\empty \global\expandafter\let\csname SET#1\endcsname = \empty + \else \setzzz{#1}#2\endsetzzz % Remove the trailing space \setxxx inserted. + \fi +} +\def\setzzz#1#2 \endsetzzz{\expandafter\xdef\csname SET#1\endcsname{#2}} + +% @clear VAR clears (i.e., unsets) the variable VAR. +% +\def\clear{\parsearg\clearxxx} +\def\clearxxx#1{\global\expandafter\let\csname SET#1\endcsname=\relax} + +% @value{foo} gets the text saved in variable foo. +% +\def\value#1{\expandafter + \ifx\csname SET#1\endcsname\relax + {\{No value for ``#1''\}} + \else \csname SET#1\endcsname \fi} + +% @ifset VAR ... @end ifset reads the `...' iff VAR has been defined +% with @set. +% +\def\ifset{\parsearg\ifsetxxx} +\def\ifsetxxx #1{% + \expandafter\ifx\csname SET#1\endcsname\relax + \expandafter\ifsetfail + \else + \expandafter\ifsetsucceed + \fi +} +\def\ifsetsucceed{\conditionalsucceed{ifset}} +\def\ifsetfail{\nestedignore{ifset}} +\defineunmatchedend{ifset} + +% @ifclear VAR ... @end ifclear reads the `...' iff VAR has never been +% defined with @set, or has been undefined with @clear. +% +\def\ifclear{\parsearg\ifclearxxx} +\def\ifclearxxx #1{% + \expandafter\ifx\csname SET#1\endcsname\relax + \expandafter\ifclearsucceed + \else + \expandafter\ifclearfail + \fi +} +\def\ifclearsucceed{\conditionalsucceed{ifclear}} +\def\ifclearfail{\nestedignore{ifclear}} +\defineunmatchedend{ifclear} + +% @iftex always succeeds; we read the text following, through @end +% iftex). But `@end iftex' should be valid only after an @iftex. +% +\def\iftex{\conditionalsucceed{iftex}} +\defineunmatchedend{iftex} + +% We can't just want to start a group at @iftex (for example) and end it +% at @end iftex, since then @set commands inside the conditional have no +% effect (they'd get reverted at the end of the group). So we must +% define \Eiftex to redefine itself to be its previous value. (We can't +% just define it to fail again with an ``unmatched end'' error, since +% the @ifset might be nested.) +% +\def\conditionalsucceed#1{% + \edef\temp{% + % Remember the current value of \E#1. + \let\nece{prevE#1} = \nece{E#1}% + % + % At the `@end #1', redefine \E#1 to be its previous value. + \def\nece{E#1}{\let\nece{E#1} = \nece{prevE#1}}% + }% + \temp +} + +% We need to expand lots of \csname's, but we don't want to expand the +% control sequences after we've constructed them. +% +\def\nece#1{\expandafter\noexpand\csname#1\endcsname} + +% @asis just yields its argument. Used with @table, for example. +% +\def\asis#1{#1} + +% @math means output in math mode. +% We don't use $'s directly in the definition of \math because control +% sequences like \math are expanded when the toc file is written. Then, +% we read the toc file back, the $'s will be normal characters (as they +% should be, according to the definition of Texinfo). So we must use a +% control sequence to switch into and out of math mode. +% +% This isn't quite enough for @math to work properly in indices, but it +% seems unlikely it will ever be needed there. +% +\let\implicitmath = $ +\def\math#1{\implicitmath #1\implicitmath} + +% @bullet and @minus need the same treatment as @math, just above. +\def\bullet{\implicitmath\ptexbullet\implicitmath} +\def\minus{\implicitmath-\implicitmath} + +\def\node{\ENVcheck\parsearg\nodezzz} +\def\nodezzz#1{\nodexxx [#1,]} +\def\nodexxx[#1,#2]{\gdef\lastnode{#1}} +\let\nwnode=\node +\let\lastnode=\relax + +\def\donoderef{\ifx\lastnode\relax\else +\expandafter\expandafter\expandafter\setref{\lastnode}\fi +\let\lastnode=\relax} + +\def\unnumbnoderef{\ifx\lastnode\relax\else +\expandafter\expandafter\expandafter\unnumbsetref{\lastnode}\fi +\let\lastnode=\relax} + +\def\appendixnoderef{\ifx\lastnode\relax\else +\expandafter\expandafter\expandafter\appendixsetref{\lastnode}\fi +\let\lastnode=\relax} + +\let\refill=\relax + +% @setfilename is done at the beginning of every texinfo file. +% So open here the files we need to have open while reading the input. +% This makes it possible to make a .fmt file for texinfo. +\def\setfilename{% + \readauxfile + \opencontents + \openindices + \fixbackslash % Turn off hack to swallow `\input texinfo'. + \global\let\setfilename=\comment % Ignore extra @setfilename cmds. + \comment % Ignore the actual filename. +} + +\outer\def\bye{\pagealignmacro\tracingstats=1\ptexend} + +\def\inforef #1{\inforefzzz #1,,,,**} +\def\inforefzzz #1,#2,#3,#4**{See Info file \file{\ignorespaces #3{}}, + node \samp{\ignorespaces#1{}}} + +\message{fonts,} + +% Font-change commands. + +% Texinfo supports the sans serif font style, which plain TeX does not. +% So we set up a \sf analogous to plain's \rm, etc. +\newfam\sffam +\def\sf{\fam=\sffam \tensf} +\let\li = \sf % Sometimes we call it \li, not \sf. + +%% Try out Computer Modern fonts at \magstephalf +\let\mainmagstep=\magstephalf + +\ifx\bigger\relax +\let\mainmagstep=\magstep1 +\font\textrm=cmr12 +\font\texttt=cmtt12 +\else +\font\textrm=cmr10 scaled \mainmagstep +\font\texttt=cmtt10 scaled \mainmagstep +\fi +% Instead of cmb10, you many want to use cmbx10. +% cmbx10 is a prettier font on its own, but cmb10 +% looks better when embedded in a line with cmr10. +\font\textbf=cmb10 scaled \mainmagstep +\font\textit=cmti10 scaled \mainmagstep +\font\textsl=cmsl10 scaled \mainmagstep +\font\textsf=cmss10 scaled \mainmagstep +\font\textsc=cmcsc10 scaled \mainmagstep +\font\texti=cmmi10 scaled \mainmagstep +\font\textsy=cmsy10 scaled \mainmagstep + +% A few fonts for @defun, etc. +\font\defbf=cmbx10 scaled \magstep1 %was 1314 +\font\deftt=cmtt10 scaled \magstep1 +\def\df{\let\tentt=\deftt \let\tenbf = \defbf \bf} + +% Fonts for indices and small examples. +% We actually use the slanted font rather than the italic, +% because texinfo normally uses the slanted fonts for that. +% Do not make many font distinctions in general in the index, since they +% aren't very useful. +\font\ninett=cmtt9 +\font\indrm=cmr9 +\font\indit=cmsl9 +\let\indsl=\indit +\let\indtt=\ninett +\let\indsf=\indrm +\let\indbf=\indrm +\let\indsc=\indrm +\font\indi=cmmi9 +\font\indsy=cmsy9 + +% Fonts for headings +\font\chaprm=cmbx12 scaled \magstep2 +\font\chapit=cmti12 scaled \magstep2 +\font\chapsl=cmsl12 scaled \magstep2 +\font\chaptt=cmtt12 scaled \magstep2 +\font\chapsf=cmss12 scaled \magstep2 +\let\chapbf=\chaprm +\font\chapsc=cmcsc10 scaled\magstep3 +\font\chapi=cmmi12 scaled \magstep2 +\font\chapsy=cmsy10 scaled \magstep3 + +\font\secrm=cmbx12 scaled \magstep1 +\font\secit=cmti12 scaled \magstep1 +\font\secsl=cmsl12 scaled \magstep1 +\font\sectt=cmtt12 scaled \magstep1 +\font\secsf=cmss12 scaled \magstep1 +\font\secbf=cmbx12 scaled \magstep1 +\font\secsc=cmcsc10 scaled\magstep2 +\font\seci=cmmi12 scaled \magstep1 +\font\secsy=cmsy10 scaled \magstep2 + +% \font\ssecrm=cmbx10 scaled \magstep1 % This size an font looked bad. +% \font\ssecit=cmti10 scaled \magstep1 % The letters were too crowded. +% \font\ssecsl=cmsl10 scaled \magstep1 +% \font\ssectt=cmtt10 scaled \magstep1 +% \font\ssecsf=cmss10 scaled \magstep1 + +%\font\ssecrm=cmb10 scaled 1315 % Note the use of cmb rather than cmbx. +%\font\ssecit=cmti10 scaled 1315 % Also, the size is a little larger than +%\font\ssecsl=cmsl10 scaled 1315 % being scaled magstep1. +%\font\ssectt=cmtt10 scaled 1315 +%\font\ssecsf=cmss10 scaled 1315 + +%\let\ssecbf=\ssecrm + +\font\ssecrm=cmbx12 scaled \magstephalf +\font\ssecit=cmti12 scaled \magstephalf +\font\ssecsl=cmsl12 scaled \magstephalf +\font\ssectt=cmtt12 scaled \magstephalf +\font\ssecsf=cmss12 scaled \magstephalf +\font\ssecbf=cmbx12 scaled \magstephalf +\font\ssecsc=cmcsc10 scaled \magstep1 +\font\sseci=cmmi12 scaled \magstephalf +\font\ssecsy=cmsy10 scaled \magstep1 +% The smallcaps and symbol fonts should actually be scaled \magstep1.5, +% but that is not a standard magnification. + +% Fonts for title page: +\font\titlerm = cmbx12 scaled \magstep3 +\let\authorrm = \secrm + +% In order for the font changes to affect most math symbols and letters, +% we have to define the \textfont of the standard families. Since +% texinfo doesn't allow for producing subscripts and superscripts, we +% don't bother to reset \scriptfont and \scriptscriptfont (which would +% also require loading a lot more fonts). +% +\def\resetmathfonts{% + \textfont0 = \tenrm \textfont1 = \teni \textfont2 = \tensy + \textfont\itfam = \tenit \textfont\slfam = \tensl \textfont\bffam = \tenbf + \textfont\ttfam = \tentt \textfont\sffam = \tensf +} + + +% The font-changing commands redefine the meanings of \tenSTYLE, instead +% of just \STYLE. We do this so that font changes will continue to work +% in math mode, where it is the current \fam that is relevant in most +% cases, not the current. Plain TeX does, for example, +% \def\bf{\fam=\bffam \tenbf} By redefining \tenbf, we obviate the need +% to redefine \bf itself. +\def\textfonts{% + \let\tenrm=\textrm \let\tenit=\textit \let\tensl=\textsl + \let\tenbf=\textbf \let\tentt=\texttt \let\smallcaps=\textsc + \let\tensf=\textsf \let\teni=\texti \let\tensy=\textsy + \resetmathfonts} +\def\chapfonts{% + \let\tenrm=\chaprm \let\tenit=\chapit \let\tensl=\chapsl + \let\tenbf=\chapbf \let\tentt=\chaptt \let\smallcaps=\chapsc + \let\tensf=\chapsf \let\teni=\chapi \let\tensy=\chapsy + \resetmathfonts} +\def\secfonts{% + \let\tenrm=\secrm \let\tenit=\secit \let\tensl=\secsl + \let\tenbf=\secbf \let\tentt=\sectt \let\smallcaps=\secsc + \let\tensf=\secsf \let\teni=\seci \let\tensy=\secsy + \resetmathfonts} +\def\subsecfonts{% + \let\tenrm=\ssecrm \let\tenit=\ssecit \let\tensl=\ssecsl + \let\tenbf=\ssecbf \let\tentt=\ssectt \let\smallcaps=\ssecsc + \let\tensf=\ssecsf \let\teni=\sseci \let\tensy=\ssecsy + \resetmathfonts} +\def\indexfonts{% + \let\tenrm=\indrm \let\tenit=\indit \let\tensl=\indsl + \let\tenbf=\indbf \let\tentt=\indtt \let\smallcaps=\indsc + \let\tensf=\indsf \let\teni=\indi \let\tensy=\indsy + \resetmathfonts} + +% Set up the default fonts, so we can use them for creating boxes. +% +\textfonts + +% Count depth in font-changes, for error checks +\newcount\fontdepth \fontdepth=0 + +% Fonts for short table of contents. +\font\shortcontrm=cmr12 +\font\shortcontbf=cmbx12 +\font\shortcontsl=cmsl12 + +%% Add scribe-like font environments, plus @l for inline lisp (usually sans +%% serif) and @ii for TeX italic + +% \smartitalic{ARG} outputs arg in italics, followed by an italic correction +% unless the following character is such as not to need one. +\def\smartitalicx{\ifx\next,\else\ifx\next-\else\ifx\next.\else\/\fi\fi\fi} +\def\smartitalic#1{{\sl #1}\futurelet\next\smartitalicx} + +\let\i=\smartitalic +\let\var=\smartitalic +\let\dfn=\smartitalic +\let\emph=\smartitalic +\let\cite=\smartitalic + +\def\b#1{{\bf #1}} +\let\strong=\b + +% We can't just use \exhyphenpenalty, because that only has effect at +% the end of a paragraph. Restore normal hyphenation at the end of the +% group within which \nohyphenation is presumably called. +% +\def\nohyphenation{\hyphenchar\font = -1 \aftergroup\restorehyphenation} +\def\restorehyphenation{\hyphenchar\font = `- } + +\def\t#1{% + {\tt \nohyphenation \rawbackslash \frenchspacing #1}% + \null +} +\let\ttfont = \t +%\def\samp #1{`{\tt \rawbackslash \frenchspacing #1}'\null} +\def\samp #1{`\tclose{#1}'\null} +\def\key #1{{\tt \nohyphenation \uppercase{#1}}\null} +\def\ctrl #1{{\tt \rawbackslash \hat}#1} + +\let\file=\samp + +% @code is a modification of @t, +% which makes spaces the same size as normal in the surrounding text. +\def\tclose#1{% + {% + % Change normal interword space to be same as for the current font. + \spaceskip = \fontdimen2\font + % + % Switch to typewriter. + \tt + % + % But `\ ' produces the large typewriter interword space. + \def\ {{\spaceskip = 0pt{} }}% + % + % Turn off hyphenation. + \nohyphenation + % + \rawbackslash + \frenchspacing + #1% + }% + \null +} + +% We *must* turn on hyphenation at `-' and `_' in \code. +% Otherwise, it is too hard to avoid overful hboxes +% in the Emacs manual, the Library manual, etc. + +% Unfortunately, TeX uses one parameter (\hyphenchar) to control +% both hyphenation at - and hyphenation within words. +% We must therefore turn them both off (\tclose does that) +% and arrange explicitly to hyphenate an a dash. +% -- rms. +{ +\catcode `\-=\active +\catcode `\_=\active +\global\def\code{\begingroup \catcode `\-=\active \let-\codedash \let_\codeunder \codex} +} +\def\codedash{-\discretionary{}{}{}} +\def\codeunder{\normalunderscore\discretionary{}{}{}} +\def\codex #1{\tclose{#1}\endgroup} + +%\let\exp=\tclose %Was temporary + +% @kbd is like @code, except that if the argument is just one @key command, +% then @kbd has no effect. + +\def\xkey{\key} +\def\kbdfoo#1#2#3\par{\def\one{#1}\def\three{#3}\def\threex{??}% +\ifx\one\xkey\ifx\threex\three \key{#2}% +\else\tclose{\look}\fi +\else\tclose{\look}\fi} + +% Typeset a dimension, e.g., `in' or `pt'. The only reason for the +% argument is to make the input look right: @dmn{pt} instead of +% @dmn{}pt. +% +\def\dmn#1{\thinspace #1} + +\def\kbd#1{\def\look{#1}\expandafter\kbdfoo\look??\par} + +\def\l#1{{\li #1}\null} % + +\def\r#1{{\rm #1}} % roman font +% Use of \lowercase was suggested. +\def\sc#1{{\smallcaps#1}} % smallcaps font +\def\ii#1{{\it #1}} % italic font + +\message{page headings,} + +\newskip\titlepagetopglue \titlepagetopglue = 1.5in +\newskip\titlepagebottomglue \titlepagebottomglue = 2pc + +% First the title page. Must do @settitle before @titlepage. +\def\titlefont#1{{\titlerm #1}} + +\newif\ifseenauthor +\newif\iffinishedtitlepage + +\def\shorttitlepage{\parsearg\shorttitlepagezzz} +\def\shorttitlepagezzz #1{\begingroup\hbox{}\vskip 1.5in \chaprm \centerline{#1}% + \endgroup\page\hbox{}\page} + +\def\titlepage{\begingroup \parindent=0pt \textfonts + \let\subtitlerm=\tenrm +% I deinstalled the following change because \cmr12 is undefined. +% This change was not in the ChangeLog anyway. --rms. +% \let\subtitlerm=\cmr12 + \def\subtitlefont{\subtitlerm \normalbaselineskip = 13pt \normalbaselines}% + % + \def\authorfont{\authorrm \normalbaselineskip = 16pt \normalbaselines}% + % + % Leave some space at the very top of the page. + \vglue\titlepagetopglue + % + % Now you can print the title using @title. + \def\title{\parsearg\titlezzz}% + \def\titlezzz##1{\leftline{\titlefont{##1}} + % print a rule at the page bottom also. + \finishedtitlepagefalse + \vskip4pt \hrule height 4pt \vskip4pt}% + % No rule at page bottom unless we print one at the top with @title. + \finishedtitlepagetrue + % + % Now you can put text using @subtitle. + \def\subtitle{\parsearg\subtitlezzz}% + \def\subtitlezzz##1{{\subtitlefont \rightline{##1}}}% + % + % @author should come last, but may come many times. + \def\author{\parsearg\authorzzz}% + \def\authorzzz##1{\ifseenauthor\else\vskip 0pt plus 1filll\seenauthortrue\fi + {\authorfont \leftline{##1}}}% + % + % Most title ``pages'' are actually two pages long, with space + % at the top of the second. We don't want the ragged left on the second. + \let\oldpage = \page + \def\page{% + \iffinishedtitlepage\else + \finishtitlepage + \fi + \oldpage + \let\page = \oldpage + \hbox{}}% +% \def\page{\oldpage \hbox{}} +} + +\def\Etitlepage{% + \iffinishedtitlepage\else + \finishtitlepage + \fi + % It is important to do the page break before ending the group, + % because the headline and footline are only empty inside the group. + % If we use the new definition of \page, we always get a blank page + % after the title page, which we certainly don't want. + \oldpage + \endgroup + \HEADINGSon +} + +\def\finishtitlepage{% + \vskip4pt \hrule height 2pt + \vskip\titlepagebottomglue + \finishedtitlepagetrue +} + +%%% Set up page headings and footings. + +\let\thispage=\folio + +\newtoks \evenheadline % Token sequence for heading line of even pages +\newtoks \oddheadline % Token sequence for heading line of odd pages +\newtoks \evenfootline % Token sequence for footing line of even pages +\newtoks \oddfootline % Token sequence for footing line of odd pages + +% Now make Tex use those variables +\headline={{\textfonts\rm \ifodd\pageno \the\oddheadline + \else \the\evenheadline \fi}} +\footline={{\textfonts\rm \ifodd\pageno \the\oddfootline + \else \the\evenfootline \fi}\HEADINGShook} +\let\HEADINGShook=\relax + +% Commands to set those variables. +% For example, this is what @headings on does +% @evenheading @thistitle|@thispage|@thischapter +% @oddheading @thischapter|@thispage|@thistitle +% @evenfooting @thisfile|| +% @oddfooting ||@thisfile + +\def\evenheading{\parsearg\evenheadingxxx} +\def\oddheading{\parsearg\oddheadingxxx} +\def\everyheading{\parsearg\everyheadingxxx} + +\def\evenfooting{\parsearg\evenfootingxxx} +\def\oddfooting{\parsearg\oddfootingxxx} +\def\everyfooting{\parsearg\everyfootingxxx} + +{\catcode`\@=0 % + +\gdef\evenheadingxxx #1{\evenheadingyyy #1@|@|@|@|\finish} +\gdef\evenheadingyyy #1@|#2@|#3@|#4\finish{% +\global\evenheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}} + +\gdef\oddheadingxxx #1{\oddheadingyyy #1@|@|@|@|\finish} +\gdef\oddheadingyyy #1@|#2@|#3@|#4\finish{% +\global\oddheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}} + +\gdef\everyheadingxxx #1{\everyheadingyyy #1@|@|@|@|\finish} +\gdef\everyheadingyyy #1@|#2@|#3@|#4\finish{% +\global\evenheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}} +\global\oddheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}} + +\gdef\evenfootingxxx #1{\evenfootingyyy #1@|@|@|@|\finish} +\gdef\evenfootingyyy #1@|#2@|#3@|#4\finish{% +\global\evenfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}} + +\gdef\oddfootingxxx #1{\oddfootingyyy #1@|@|@|@|\finish} +\gdef\oddfootingyyy #1@|#2@|#3@|#4\finish{% +\global\oddfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}} + +\gdef\everyfootingxxx #1{\everyfootingyyy #1@|@|@|@|\finish} +\gdef\everyfootingyyy #1@|#2@|#3@|#4\finish{% +\global\evenfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}} +\global\oddfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}} +% +}% unbind the catcode of @. + +% @headings double turns headings on for double-sided printing. +% @headings single turns headings on for single-sided printing. +% @headings off turns them off. +% @headings on same as @headings double, retained for compatibility. +% @headings after turns on double-sided headings after this page. +% @headings doubleafter turns on double-sided headings after this page. +% @headings singleafter turns on single-sided headings after this page. +% By default, they are off. + +\def\headings #1 {\csname HEADINGS#1\endcsname} + +\def\HEADINGSoff{ +\global\evenheadline={\hfil} \global\evenfootline={\hfil} +\global\oddheadline={\hfil} \global\oddfootline={\hfil}} +\HEADINGSoff +% When we turn headings on, set the page number to 1. +% For double-sided printing, put current file name in lower left corner, +% chapter name on inside top of right hand pages, document +% title on inside top of left hand pages, and page numbers on outside top +% edge of all pages. +\def\HEADINGSdouble{ +%\pagealignmacro +\global\pageno=1 +\global\evenfootline={\hfil} +\global\oddfootline={\hfil} +\global\evenheadline={\line{\folio\hfil\thistitle}} +\global\oddheadline={\line{\thischapter\hfil\folio}} +} +% For single-sided printing, chapter title goes across top left of page, +% page number on top right. +\def\HEADINGSsingle{ +%\pagealignmacro +\global\pageno=1 +\global\evenfootline={\hfil} +\global\oddfootline={\hfil} +\global\evenheadline={\line{\thischapter\hfil\folio}} +\global\oddheadline={\line{\thischapter\hfil\folio}} +} +\def\HEADINGSon{\HEADINGSdouble} + +\def\HEADINGSafter{\let\HEADINGShook=\HEADINGSdoublex} +\let\HEADINGSdoubleafter=\HEADINGSafter +\def\HEADINGSdoublex{% +\global\evenfootline={\hfil} +\global\oddfootline={\hfil} +\global\evenheadline={\line{\folio\hfil\thistitle}} +\global\oddheadline={\line{\thischapter\hfil\folio}} +} + +\def\HEADINGSsingleafter{\let\HEADINGShook=\HEADINGSsinglex} +\def\HEADINGSsinglex{% +\global\evenfootline={\hfil} +\global\oddfootline={\hfil} +\global\evenheadline={\line{\thischapter\hfil\folio}} +\global\oddheadline={\line{\thischapter\hfil\folio}} +} + +% Subroutines used in generating headings +% Produces Day Month Year style of output. +\def\today{\number\day\space +\ifcase\month\or +January\or February\or March\or April\or May\or June\or +July\or August\or September\or October\or November\or December\fi +\space\number\year} + +% Use this if you want the Month Day, Year style of output. +%\def\today{\ifcase\month\or +%January\or February\or March\or April\or May\or June\or +%July\or August\or September\or October\or November\or December\fi +%\space\number\day, \number\year} + +% @settitle line... specifies the title of the document, for headings +% It generates no output of its own + +\def\thistitle{No Title} +\def\settitle{\parsearg\settitlezzz} +\def\settitlezzz #1{\gdef\thistitle{#1}} + +\message{tables,} + +% @tabs -- simple alignment + +% These don't work. For one thing, \+ is defined as outer. +% So these macros cannot even be defined. + +%\def\tabs{\parsearg\tabszzz} +%\def\tabszzz #1{\settabs\+#1\cr} +%\def\tabline{\parsearg\tablinezzz} +%\def\tablinezzz #1{\+#1\cr} +%\def\&{&} + +% Tables -- @table, @ftable, @vtable, @item(x), @kitem(x), @xitem(x). + +% default indentation of table text +\newdimen\tableindent \tableindent=.8in +% default indentation of @itemize and @enumerate text +\newdimen\itemindent \itemindent=.3in +% margin between end of table item and start of table text. +\newdimen\itemmargin \itemmargin=.1in + +% used internally for \itemindent minus \itemmargin +\newdimen\itemmax + +% Note @table, @vtable, and @vtable define @item, @itemx, etc., with +% these defs. +% They also define \itemindex +% to index the item name in whatever manner is desired (perhaps none). + +\def\internalBitem{\smallbreak \parsearg\itemzzz} +\def\internalBitemx{\par \parsearg\itemzzz} + +\def\internalBxitem "#1"{\def\xitemsubtopix{#1} \smallbreak \parsearg\xitemzzz} +\def\internalBxitemx "#1"{\def\xitemsubtopix{#1} \par \parsearg\xitemzzz} + +\def\internalBkitem{\smallbreak \parsearg\kitemzzz} +\def\internalBkitemx{\par \parsearg\kitemzzz} + +\def\kitemzzz #1{\dosubind {kw}{\code{#1}}{for {\bf \lastfunction}}% + \itemzzz {#1}} + +\def\xitemzzz #1{\dosubind {kw}{\code{#1}}{for {\bf \xitemsubtopic}}% + \itemzzz {#1}} + +\def\itemzzz #1{\begingroup % + \advance\hsize by -\rightskip + \advance\hsize by -\tableindent + \setbox0=\hbox{\itemfont{#1}}% + \itemindex{#1}% + \nobreak % This prevents a break before @itemx. + % + % Be sure we are not still in the middle of a paragraph. + {\parskip = 0in + \par + }% + % + % If the item text does not fit in the space we have, put it on a line + % by itself, and do not allow a page break either before or after that + % line. We do not start a paragraph here because then if the next + % command is, e.g., @kindex, the whatsit would get put into the + % horizontal list on a line by itself, resulting in extra blank space. + \ifdim \wd0>\itemmax + \setbox0=\hbox{\hskip \leftskip \hskip -\tableindent \unhbox0}\box0 + % + % We're going to be starting a paragraph, but we don't want the + % \parskip glue -- logically it's part of the @item we just started. + \nobreak \vskip-\parskip + % + % Stop a page break at the \parskip glue coming up. Unfortunately + % we can't prevent a possible page break at the following + % \baselineskip glue. + \nobreak + \else + % The item text fits into the space. Start a paragraph, so that the + % following text (if any) will end up on the same line. Since that + % text will be indented by \tableindent, we make the item text be in + % a zero-width box. + \noindent + \rlap{\hskip -\tableindent\box0}% + \fi + \endgroup +} + +\def\item{\errmessage{@item while not in a table}} +\def\itemx{\errmessage{@itemx while not in a table}} +\def\kitem{\errmessage{@kitem while not in a table}} +\def\kitemx{\errmessage{@kitemx while not in a table}} +\def\xitem{\errmessage{@xitem while not in a table}} +\def\xitemx{\errmessage{@xitemx while not in a table}} + +%% Contains a kludge to get @end[description] to work +\def\description{\tablez{\dontindex}{1}{}{}{}{}} + +\def\table{\begingroup\inENV\obeylines\obeyspaces\tablex} +{\obeylines\obeyspaces% +\gdef\tablex #1^^M{% +\tabley\dontindex#1 \endtabley}} + +\def\ftable{\begingroup\inENV\obeylines\obeyspaces\ftablex} +{\obeylines\obeyspaces% +\gdef\ftablex #1^^M{% +\tabley\fnitemindex#1 \endtabley +\def\Eftable{\endgraf\afterenvbreak\endgroup}% +\let\Etable=\relax}} + +\def\vtable{\begingroup\inENV\obeylines\obeyspaces\vtablex} +{\obeylines\obeyspaces% +\gdef\vtablex #1^^M{% +\tabley\vritemindex#1 \endtabley +\def\Evtable{\endgraf\afterenvbreak\endgroup}% +\let\Etable=\relax}} + +\def\dontindex #1{} +\def\fnitemindex #1{\doind {fn}{\code{#1}}}% +\def\vritemindex #1{\doind {vr}{\code{#1}}}% + +{\obeyspaces % +\gdef\tabley#1#2 #3 #4 #5 #6 #7\endtabley{\endgroup% +\tablez{#1}{#2}{#3}{#4}{#5}{#6}}} + +\def\tablez #1#2#3#4#5#6{% +\aboveenvbreak % +\begingroup % +\def\Edescription{\Etable}% Neccessary kludge. +\let\itemindex=#1% +\ifnum 0#3>0 \advance \leftskip by #3\mil \fi % +\ifnum 0#4>0 \tableindent=#4\mil \fi % +\ifnum 0#5>0 \advance \rightskip by #5\mil \fi % +\def\itemfont{#2}% +\itemmax=\tableindent % +\advance \itemmax by -\itemmargin % +\advance \leftskip by \tableindent % +\exdentamount=\tableindent +\parindent = 0pt +\parskip = \smallskipamount +\ifdim \parskip=0pt \parskip=2pt \fi% +\def\Etable{\endgraf\afterenvbreak\endgroup}% +\let\item = \internalBitem % +\let\itemx = \internalBitemx % +\let\kitem = \internalBkitem % +\let\kitemx = \internalBkitemx % +\let\xitem = \internalBxitem % +\let\xitemx = \internalBxitemx % +} + +% This is the counter used by @enumerate, which is really @itemize + +\newcount \itemno + +\def\itemize{\parsearg\itemizezzz} + +\def\itemizezzz #1{% + \begingroup % ended by the @end itemsize + \itemizey {#1}{\Eitemize} +} + +\def\itemizey #1#2{% +\aboveenvbreak % +\itemmax=\itemindent % +\advance \itemmax by -\itemmargin % +\advance \leftskip by \itemindent % +\exdentamount=\itemindent +\parindent = 0pt % +\parskip = \smallskipamount % +\ifdim \parskip=0pt \parskip=2pt \fi% +\def#2{\endgraf\afterenvbreak\endgroup}% +\def\itemcontents{#1}% +\let\item=\itemizeitem} + +% Set sfcode to normal for the chars that usually have another value. +% These are `.?!:;,' +\def\frenchspacing{\sfcode46=1000 \sfcode63=1000 \sfcode33=1000 + \sfcode58=1000 \sfcode59=1000 \sfcode44=1000 } + +% \splitoff TOKENS\endmark defines \first to be the first token in +% TOKENS, and \rest to be the remainder. +% +\def\splitoff#1#2\endmark{\def\first{#1}\def\rest{#2}}% + +% Allow an optional argument of an uppercase letter, lowercase letter, +% or number, to specify the first label in the enumerated list. No +% argument is the same as `1'. +% +\def\enumerate{\parsearg\enumeratezzz} +\def\enumeratezzz #1{\enumeratey #1 \endenumeratey} +\def\enumeratey #1 #2\endenumeratey{% + \begingroup % ended by the @end enumerate + % + % If we were given no argument, pretend we were given `1'. + \def\thearg{#1}% + \ifx\thearg\empty \def\thearg{1}\fi + % + % Detect if the argument is a single token. If so, it might be a + % letter. Otherwise, the only valid thing it can be is a number. + % (We will always have one token, because of the test we just made. + % This is a good thing, since \splitoff doesn't work given nothing at + % all -- the first parameter is undelimited.) + \expandafter\splitoff\thearg\endmark + \ifx\rest\empty + % Only one token in the argument. It could still be anything. + % A ``lowercase letter'' is one whose \lccode is nonzero. + % An ``uppercase letter'' is one whose \lccode is both nonzero, and + % not equal to itself. + % Otherwise, we assume it's a number. + % + % We need the \relax at the end of the \ifnum lines to stop TeX from + % continuing to look for a . + % + \ifnum\lccode\expandafter`\thearg=0\relax + \numericenumerate % a number (we hope) + \else + % It's a letter. + \ifnum\lccode\expandafter`\thearg=\expandafter`\thearg\relax + \lowercaseenumerate % lowercase letter + \else + \uppercaseenumerate % uppercase letter + \fi + \fi + \else + % Multiple tokens in the argument. We hope it's a number. + \numericenumerate + \fi +} + +% An @enumerate whose labels are integers. The starting integer is +% given in \thearg. +% +\def\numericenumerate{% + \itemno = \thearg + \startenumeration{\the\itemno}% +} + +% The starting (lowercase) letter is in \thearg. +\def\lowercaseenumerate{% + \itemno = \expandafter`\thearg + \startenumeration{% + % Be sure we're not beyond the end of the alphabet. + \ifnum\itemno=0 + \errmessage{No more lowercase letters in @enumerate; get a bigger + alphabet}% + \fi + \char\lccode\itemno + }% +} + +% The starting (uppercase) letter is in \thearg. +\def\uppercaseenumerate{% + \itemno = \expandafter`\thearg + \startenumeration{% + % Be sure we're not beyond the end of the alphabet. + \ifnum\itemno=0 + \errmessage{No more uppercase letters in @enumerate; get a bigger + alphabet} + \fi + \char\uccode\itemno + }% +} + +% Call itemizey, adding a period to the first argument and supplying the +% common last two arguments. Also subtract one from the initial value in +% \itemno, since @item increments \itemno. +% +\def\startenumeration#1{% + \advance\itemno by -1 + \itemizey{#1.}\Eenumerate\flushcr +} + +% @alphaenumerate and @capsenumerate are abbreviations for giving an arg +% to @enumerate. +% +\def\alphaenumerate{\enumerate{a}} +\def\capsenumerate{\enumerate{A}} +\def\Ealphaenumerate{\Eenumerate} +\def\Ecapsenumerate{\Eenumerate} + +% Definition of @item while inside @itemize. + +\def\itemizeitem{% +\advance\itemno by 1 +{\let\par=\endgraf \smallbreak}% +\ifhmode \errmessage{\in hmode at itemizeitem}\fi +{\parskip=0in \hskip 0pt +\hbox to 0pt{\hss \itemcontents\hskip \itemmargin}% +\vadjust{\penalty 1200}}% +\flushcr} + +\message{indexing,} +% Index generation facilities + +% Define \newwrite to be identical to plain tex's \newwrite +% except not \outer, so it can be used within \newindex. +{\catcode`\@=11 +\gdef\newwrite{\alloc@7\write\chardef\sixt@@n}} + +% \newindex {foo} defines an index named foo. +% It automatically defines \fooindex such that +% \fooindex ...rest of line... puts an entry in the index foo. +% It also defines \fooindfile to be the number of the output channel for +% the file that accumulates this index. The file's extension is foo. +% The name of an index should be no more than 2 characters long +% for the sake of vms. + +\def\newindex #1{ +\expandafter\newwrite \csname#1indfile\endcsname% Define number for output file +\openout \csname#1indfile\endcsname \jobname.#1 % Open the file +\expandafter\xdef\csname#1index\endcsname{% % Define \xxxindex +\noexpand\doindex {#1}} +} + +% @defindex foo == \newindex{foo} + +\def\defindex{\parsearg\newindex} + +% Define @defcodeindex, like @defindex except put all entries in @code. + +\def\newcodeindex #1{ +\expandafter\newwrite \csname#1indfile\endcsname% Define number for output file +\openout \csname#1indfile\endcsname \jobname.#1 % Open the file +\expandafter\xdef\csname#1index\endcsname{% % Define \xxxindex +\noexpand\docodeindex {#1}} +} + +\def\defcodeindex{\parsearg\newcodeindex} + +% @synindex foo bar makes index foo feed into index bar. +% Do this instead of @defindex foo if you don't want it as a separate index. +\def\synindex #1 #2 {% +\expandafter\let\expandafter\synindexfoo\expandafter=\csname#2indfile\endcsname +\expandafter\let\csname#1indfile\endcsname=\synindexfoo +\expandafter\xdef\csname#1index\endcsname{% % Define \xxxindex +\noexpand\doindex {#2}}% +} + +% @syncodeindex foo bar similar, but put all entries made for index foo +% inside @code. +\def\syncodeindex #1 #2 {% +\expandafter\let\expandafter\synindexfoo\expandafter=\csname#2indfile\endcsname +\expandafter\let\csname#1indfile\endcsname=\synindexfoo +\expandafter\xdef\csname#1index\endcsname{% % Define \xxxindex +\noexpand\docodeindex {#2}}% +} + +% Define \doindex, the driver for all \fooindex macros. +% Argument #1 is generated by the calling \fooindex macro, +% and it is "foo", the name of the index. + +% \doindex just uses \parsearg; it calls \doind for the actual work. +% This is because \doind is more useful to call from other macros. + +% There is also \dosubind {index}{topic}{subtopic} +% which makes an entry in a two-level index such as the operation index. + +\def\doindex#1{\edef\indexname{#1}\parsearg\singleindexer} +\def\singleindexer #1{\doind{\indexname}{#1}} + +% like the previous two, but they put @code around the argument. +\def\docodeindex#1{\edef\indexname{#1}\parsearg\singlecodeindexer} +\def\singlecodeindexer #1{\doind{\indexname}{\code{#1}}} + +\def\indexdummies{% +\def\_{{\realbackslash _}}% +\def\w{\realbackslash w }% +\def\bf{\realbackslash bf }% +\def\rm{\realbackslash rm }% +\def\sl{\realbackslash sl }% +\def\sf{\realbackslash sf}% +\def\tt{\realbackslash tt}% +\def\gtr{\realbackslash gtr}% +\def\less{\realbackslash less}% +\def\hat{\realbackslash hat}% +\def\char{\realbackslash char}% +\def\TeX{\realbackslash TeX}% +\def\dots{\realbackslash dots }% +\def\copyright{\realbackslash copyright }% +\def\tclose##1{\realbackslash tclose {##1}}% +\def\code##1{\realbackslash code {##1}}% +\def\samp##1{\realbackslash samp {##1}}% +\def\t##1{\realbackslash r {##1}}% +\def\r##1{\realbackslash r {##1}}% +\def\i##1{\realbackslash i {##1}}% +\def\b##1{\realbackslash b {##1}}% +\def\cite##1{\realbackslash cite {##1}}% +\def\key##1{\realbackslash key {##1}}% +\def\file##1{\realbackslash file {##1}}% +\def\var##1{\realbackslash var {##1}}% +\def\kbd##1{\realbackslash kbd {##1}}% +\def\dfn##1{\realbackslash dfn {##1}}% +\def\emph##1{\realbackslash emph {##1}}% +} + +% \indexnofonts no-ops all font-change commands. +% This is used when outputting the strings to sort the index by. +\def\indexdummyfont#1{#1} +\def\indexdummytex{TeX} +\def\indexdummydots{...} + +\def\indexnofonts{% +\let\w=\indexdummyfont +\let\t=\indexdummyfont +\let\r=\indexdummyfont +\let\i=\indexdummyfont +\let\b=\indexdummyfont +\let\emph=\indexdummyfont +\let\strong=\indexdummyfont +\let\cite=\indexdummyfont +\let\sc=\indexdummyfont +%Don't no-op \tt, since it isn't a user-level command +% and is used in the definitions of the active chars like <, >, |... +%\let\tt=\indexdummyfont +\let\tclose=\indexdummyfont +\let\code=\indexdummyfont +\let\file=\indexdummyfont +\let\samp=\indexdummyfont +\let\kbd=\indexdummyfont +\let\key=\indexdummyfont +\let\var=\indexdummyfont +\let\TeX=\indexdummytex +\let\dots=\indexdummydots +} + +% To define \realbackslash, we must make \ not be an escape. +% We must first make another character (@) an escape +% so we do not become unable to do a definition. + +{\catcode`\@=0 \catcode`\\=\other +@gdef@realbackslash{\}} + +\let\indexbackslash=0 %overridden during \printindex. + +\def\doind #1#2{% +{\count10=\lastpenalty % +{\indexdummies % Must do this here, since \bf, etc expand at this stage +\escapechar=`\\% +{\let\folio=0% Expand all macros now EXCEPT \folio +\def\rawbackslashxx{\indexbackslash}% \indexbackslash isn't defined now +% so it will be output as is; and it will print as backslash in the indx. +% +% Now process the index-string once, with all font commands turned off, +% to get the string to sort the index by. +{\indexnofonts +\xdef\temp1{#2}% +}% +% Now produce the complete index entry. We process the index-string again, +% this time with font commands expanded, to get what to print in the index. +\edef\temp{% +\write \csname#1indfile\endcsname{% +\realbackslash entry {\temp1}{\folio}{#2}}}% +\temp }% +}\penalty\count10}} + +\def\dosubind #1#2#3{% +{\count10=\lastpenalty % +{\indexdummies % Must do this here, since \bf, etc expand at this stage +\escapechar=`\\% +{\let\folio=0% +\def\rawbackslashxx{\indexbackslash}% +% +% Now process the index-string once, with all font commands turned off, +% to get the string to sort the index by. +{\indexnofonts +\xdef\temp1{#2 #3}% +}% +% Now produce the complete index entry. We process the index-string again, +% this time with font commands expanded, to get what to print in the index. +\edef\temp{% +\write \csname#1indfile\endcsname{% +\realbackslash entry {\temp1}{\folio}{#2}{#3}}}% +\temp }% +}\penalty\count10}} + +% The index entry written in the file actually looks like +% \entry {sortstring}{page}{topic} +% or +% \entry {sortstring}{page}{topic}{subtopic} +% The texindex program reads in these files and writes files +% containing these kinds of lines: +% \initial {c} +% before the first topic whose initial is c +% \entry {topic}{pagelist} +% for a topic that is used without subtopics +% \primary {topic} +% for the beginning of a topic that is used with subtopics +% \secondary {subtopic}{pagelist} +% for each subtopic. + +% Define the user-accessible indexing commands +% @findex, @vindex, @kindex, @cindex. + +\def\findex {\fnindex} +\def\kindex {\kyindex} +\def\cindex {\cpindex} +\def\vindex {\vrindex} +\def\tindex {\tpindex} +\def\pindex {\pgindex} + +\def\cindexsub {\begingroup\obeylines\cindexsub} +{\obeylines % +\gdef\cindexsub "#1" #2^^M{\endgroup % +\dosubind{cp}{#2}{#1}}} + +% Define the macros used in formatting output of the sorted index material. + +% This is what you call to cause a particular index to get printed. +% Write +% @unnumbered Function Index +% @printindex fn + +\def\printindex{\parsearg\doprintindex} + +\def\doprintindex#1{% + \tex + \dobreak \chapheadingskip {10000} + \catcode`\%=\other\catcode`\&=\other\catcode`\#=\other + \catcode`\$=\other\catcode`\_=\other + \catcode`\~=\other + % + % The following don't help, since the chars were translated + % when the raw index was written, and their fonts were discarded + % due to \indexnofonts. + %\catcode`\"=\active + %\catcode`\^=\active + %\catcode`\_=\active + %\catcode`\|=\active + %\catcode`\<=\active + %\catcode`\>=\active + % % + \def\indexbackslash{\rawbackslashxx} + \indexfonts\rm \tolerance=9500 \advance\baselineskip -1pt + \begindoublecolumns + % + % See if the index file exists and is nonempty. + \openin 1 \jobname.#1s + \ifeof 1 + % \enddoublecolumns gets confused if there is no text in the index, + % and it loses the chapter title and the aux file entries for the + % index. The easiest way to prevent this problem is to make sure + % there is some text. + (Index is nonexistent) + \else + % + % If the index file exists but is empty, then \openin leaves \ifeof + % false. We have to make TeX try to read something from the file, so + % it can discover if there is anything in it. + \read 1 to \temp + \ifeof 1 + (Index is empty) + \else + \input \jobname.#1s + \fi + \fi + \closein 1 + \enddoublecolumns + \Etex +} + +% These macros are used by the sorted index file itself. +% Change them to control the appearance of the index. + +% Same as \bigskipamount except no shrink. +% \balancecolumns gets confused if there is any shrink. +\newskip\initialskipamount \initialskipamount 12pt plus4pt + +\def\initial #1{% +{\let\tentt=\sectt \let\tt=\sectt \let\sf=\sectt +\ifdim\lastskip<\initialskipamount +\removelastskip \penalty-200 \vskip \initialskipamount\fi +\line{\secbf#1\hfill}\kern 2pt\penalty10000}} + +% This typesets a paragraph consisting of #1, dot leaders, and then #2 +% flush to the right margin. It is used for index and table of contents +% entries. The paragraph is indented by \leftskip. +% +\def\entry #1#2{\begingroup + % + % Start a new paragraph if necessary, so our assignments below can't + % affect previous text. + \par + % + % Do not fill out the last line with white space. + \parfillskip = 0in + % + % No extra space above this paragraph. + \parskip = 0in + % + % Do not prefer a separate line ending with a hyphen to fewer lines. + \finalhyphendemerits = 0 + % + % \hangindent is only relevant when the entry text and page number + % don't both fit on one line. In that case, bob suggests starting the + % dots pretty far over on the line. Unfortunately, a large + % indentation looks wrong when the entry text itself is broken across + % lines. So we use a small indentation and put up with long leaders. + % + % \hangafter is reset to 1 (which is the value we want) at the start + % of each paragraph, so we need not do anything with that. + \hangindent=2em + % + % When the entry text needs to be broken, just fill out the first line + % with blank space. + \rightskip = 0pt plus1fil + % + % Start a ``paragraph'' for the index entry so the line breaking + % parameters we've set above will have an effect. + \noindent + % + % Insert the text of the index entry. TeX will do line-breaking on it. + #1% + % + % If we must, put the page number on a line of its own, and fill out + % this line with blank space. (The \hfil is overwhelmed with the + % fill leaders glue in \indexdotfill if the page number does fit.) + \hfil\penalty50 + \null\nobreak\indexdotfill % Have leaders before the page number. + % + % The `\ ' here is removed by the implicit \unskip that TeX does as + % part of (the primitive) \par. Without it, a spurious underfull + % \hbox ensues. + \ #2% The page number ends the paragraph. + \par +\endgroup} + +% Like \dotfill except takes at least 1 em. +\def\indexdotfill{\cleaders + \hbox{$\mathsurround=0pt \mkern1.5mu . \mkern1.5mu$}\hskip 1em plus 1fill} + +\def\primary #1{\line{#1\hfil}} + +\newskip\secondaryindent \secondaryindent=0.5cm + +\def\secondary #1#2{ +{\parfillskip=0in \parskip=0in +\hangindent =1in \hangafter=1 +\noindent\hskip\secondaryindent\hbox{#1}\indexdotfill #2\par +}} + +%% Define two-column mode, which is used in indexes. +%% Adapted from the TeXbook, page 416. +\catcode `\@=11 + +\newbox\partialpage + +\newdimen\doublecolumnhsize + +\def\begindoublecolumns{\begingroup + % Grab any single-column material above us. + \output = {\global\setbox\partialpage + =\vbox{\unvbox255\kern -\topskip \kern \baselineskip}}% + \eject + % + % Now switch to the double-column output routine. + \output={\doublecolumnout}% + % + % Change the page size parameters. We could do this once outside this + % routine, in each of @smallbook, @afourpaper, and the default 8.5x11 + % format, but then we repeat the same computation. Repeating a couple + % of assignments once per index is clearly meaningless for the + % execution time, so we may as well do it once. + % + % First we halve the line length, less a little for the gutter between + % the columns. We compute the gutter based on the line length, so it + % changes automatically with the paper format. The magic constant + % below is chosen so that the gutter has the same value (well, +- < + % 1pt) as it did when we hard-coded it. + % + % We put the result in a separate register, \doublecolumhsize, so we + % can restore it in \pagesofar, after \hsize itself has (potentially) + % been clobbered. + % + \doublecolumnhsize = \hsize + \advance\doublecolumnhsize by -.04154\hsize + \divide\doublecolumnhsize by 2 + \hsize = \doublecolumnhsize + % + % Double the \vsize as well. (We don't need a separate register here, + % since nobody clobbers \vsize.) + \vsize = 2\vsize + \doublecolumnpagegoal +} + +\def\enddoublecolumns{\eject \endgroup \pagegoal=\vsize \unvbox\partialpage} + +\def\doublecolumnsplit{\splittopskip=\topskip \splitmaxdepth=\maxdepth + \global\dimen@=\pageheight \global\advance\dimen@ by-\ht\partialpage + \global\setbox1=\vsplit255 to\dimen@ \global\setbox0=\vbox{\unvbox1} + \global\setbox3=\vsplit255 to\dimen@ \global\setbox2=\vbox{\unvbox3} + \ifdim\ht0>\dimen@ \setbox255=\vbox{\unvbox0\unvbox2} \global\setbox255=\copy5 \fi + \ifdim\ht2>\dimen@ \setbox255=\vbox{\unvbox0\unvbox2} \global\setbox255=\copy5 \fi +} +\def\doublecolumnpagegoal{% + \dimen@=\vsize \advance\dimen@ by-2\ht\partialpage \global\pagegoal=\dimen@ +} +\def\pagesofar{\unvbox\partialpage % + \hsize=\doublecolumnhsize % have to restore this since output routine + \wd0=\hsize \wd2=\hsize \hbox to\pagewidth{\box0\hfil\box2}} +\def\doublecolumnout{% + \setbox5=\copy255 + {\vbadness=10000 \doublecolumnsplit} + \ifvbox255 + \setbox0=\vtop to\dimen@{\unvbox0} + \setbox2=\vtop to\dimen@{\unvbox2} + \onepageout\pagesofar \unvbox255 \penalty\outputpenalty + \else + \setbox0=\vbox{\unvbox5} + \ifvbox0 + \dimen@=\ht0 \advance\dimen@ by\topskip \advance\dimen@ by-\baselineskip + \divide\dimen@ by2 \splittopskip=\topskip \splitmaxdepth=\maxdepth + {\vbadness=10000 + \loop \global\setbox5=\copy0 + \setbox1=\vsplit5 to\dimen@ + \setbox3=\vsplit5 to\dimen@ + \ifvbox5 \global\advance\dimen@ by1pt \repeat + \setbox0=\vbox to\dimen@{\unvbox1} + \setbox2=\vbox to\dimen@{\unvbox3} + \global\setbox\partialpage=\vbox{\pagesofar} + \doublecolumnpagegoal + } + \fi + \fi +} + +\catcode `\@=\other +\message{sectioning,} +% Define chapters, sections, etc. + +\newcount \chapno +\newcount \secno \secno=0 +\newcount \subsecno \subsecno=0 +\newcount \subsubsecno \subsubsecno=0 + +% This counter is funny since it counts through charcodes of letters A, B, ... +\newcount \appendixno \appendixno = `\@ +\def\appendixletter{\char\the\appendixno} + +\newwrite \contentsfile +% This is called from \setfilename. +\def\opencontents{\openout \contentsfile = \jobname.toc} + +% Each @chapter defines this as the name of the chapter. +% page headings and footings can use it. @section does likewise + +\def\thischapter{} \def\thissection{} +\def\seccheck#1{\if \pageno<0 % +\errmessage{@#1 not allowed after generating table of contents}\fi +% +} + +\def\chapternofonts{% +\let\rawbackslash=\relax% +\let\frenchspacing=\relax% +\def\result{\realbackslash result} +\def\equiv{\realbackslash equiv} +\def\expansion{\realbackslash expansion} +\def\print{\realbackslash print} +\def\TeX{\realbackslash TeX} +\def\dots{\realbackslash dots} +\def\copyright{\realbackslash copyright} +\def\tt{\realbackslash tt} +\def\bf{\realbackslash bf } +\def\w{\realbackslash w} +\def\less{\realbackslash less} +\def\gtr{\realbackslash gtr} +\def\hat{\realbackslash hat} +\def\char{\realbackslash char} +\def\tclose##1{\realbackslash tclose {##1}} +\def\code##1{\realbackslash code {##1}} +\def\samp##1{\realbackslash samp {##1}} +\def\r##1{\realbackslash r {##1}} +\def\b##1{\realbackslash b {##1}} +\def\key##1{\realbackslash key {##1}} +\def\file##1{\realbackslash file {##1}} +\def\kbd##1{\realbackslash kbd {##1}} +% These are redefined because @smartitalic wouldn't work inside xdef. +\def\i##1{\realbackslash i {##1}} +\def\cite##1{\realbackslash cite {##1}} +\def\var##1{\realbackslash var {##1}} +\def\emph##1{\realbackslash emph {##1}} +\def\dfn##1{\realbackslash dfn {##1}} +} + +\newcount\absseclevel % used to calculate proper heading level +\newcount\secbase\secbase=0 % @raise/lowersections modify this count + +% @raisesections: treat @section as chapter, @subsection as section, etc. +\def\raisesections{\global\advance\secbase by -1} +\let\up=\raisesections % original BFox name + +% @lowersections: treat @chapter as section, @section as subsection, etc. +\def\lowersections{\global\advance\secbase by 1} +\let\down=\lowersections % original BFox name + +% Choose a numbered-heading macro +% #1 is heading level if unmodified by @raisesections or @lowersections +% #2 is text for heading +\def\numhead#1#2{\absseclevel=\secbase\advance\absseclevel by #1 +\ifcase\absseclevel + \chapterzzz{#2} +\or + \seczzz{#2} +\or + \numberedsubseczzz{#2} +\or + \numberedsubsubseczzz{#2} +\else + \ifnum \absseclevel<0 + \chapterzzz{#2} + \else + \numberedsubsubseczzz{#2} + \fi +\fi +} + +% like \numhead, but chooses appendix heading levels +\def\apphead#1#2{\absseclevel=\secbase\advance\absseclevel by #1 +\ifcase\absseclevel + \appendixzzz{#2} +\or + \appendixsectionzzz{#2} +\or + \appendixsubseczzz{#2} +\or + \appendixsubsubseczzz{#2} +\else + \ifnum \absseclevel<0 + \appendixzzz{#2} + \else + \appendixsubsubseczzz{#2} + \fi +\fi +} + +% like \numhead, but chooses numberless heading levels +\def\unnmhead#1#2{\absseclevel=\secbase\advance\absseclevel by #1 +\ifcase\absseclevel + \unnumberedzzz{#2} +\or + \unnumberedseczzz{#2} +\or + \unnumberedsubseczzz{#2} +\or + \unnumberedsubsubseczzz{#2} +\else + \ifnum \absseclevel<0 + \unnumberedzzz{#2} + \else + \unnumberedsubsubseczzz{#2} + \fi +\fi +} + + +\def\thischaptername{No Chapter Title} +\outer\def\chapter{\parsearg\chapteryyy} +\def\chapteryyy #1{\numhead0{#1}} % normally numhead0 calls chapterzzz +\def\chapterzzz #1{\seccheck{chapter}% +\secno=0 \subsecno=0 \subsubsecno=0 +\global\advance \chapno by 1 \message{Chapter \the\chapno}% +\chapmacro {#1}{\the\chapno}% +\gdef\thissection{#1}% +\gdef\thischaptername{#1}% +% We don't substitute the actual chapter name into \thischapter +% because we don't want its macros evaluated now. +\xdef\thischapter{Chapter \the\chapno: \noexpand\thischaptername}% +{\chapternofonts% +\edef\temp{{\realbackslash chapentry {#1}{\the\chapno}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\donoderef % +\global\let\section = \numberedsec +\global\let\subsection = \numberedsubsec +\global\let\subsubsection = \numberedsubsubsec +}} + +\outer\def\appendix{\parsearg\appendixyyy} +\def\appendixyyy #1{\apphead0{#1}} % normally apphead0 calls appendixzzz +\def\appendixzzz #1{\seccheck{appendix}% +\secno=0 \subsecno=0 \subsubsecno=0 +\global\advance \appendixno by 1 \message{Appendix \appendixletter}% +\chapmacro {#1}{Appendix \appendixletter}% +\gdef\thissection{#1}% +\gdef\thischaptername{#1}% +\xdef\thischapter{Appendix \appendixletter: \noexpand\thischaptername}% +{\chapternofonts% +\edef\temp{{\realbackslash chapentry + {#1}{Appendix \appendixletter}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\appendixnoderef % +\global\let\section = \appendixsec +\global\let\subsection = \appendixsubsec +\global\let\subsubsection = \appendixsubsubsec +}} + +\outer\def\top{\parsearg\unnumberedyyy} +\outer\def\unnumbered{\parsearg\unnumberedyyy} +\def\unnumberedyyy #1{\unnmhead0{#1}} % normally unnmhead0 calls unnumberedzzz +\def\unnumberedzzz #1{\seccheck{unnumbered}% +\secno=0 \subsecno=0 \subsubsecno=0 +% +% This used to be simply \message{#1}, but TeX fully expands the +% argument to \message. Therefore, if #1 contained @-commands, TeX +% expanded them. For example, in `@unnumbered The @cite{Book}', TeX +% expanded @cite (which turns out to cause errors because \cite is meant +% to be executed, not expanded). +% +% Anyway, we don't want the fully-expanded definition of @cite to appear +% as a result of the \message, we just want `@cite' itself. We use +% \the to achieve this: TeX expands \the only once, +% simply yielding the contents of the . +\toks0 = {#1}\message{(\the\toks0)}% +% +\unnumbchapmacro {#1}% +\gdef\thischapter{#1}\gdef\thissection{#1}% +{\chapternofonts% +\edef\temp{{\realbackslash unnumbchapentry {#1}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\unnumbnoderef % +\global\let\section = \unnumberedsec +\global\let\subsection = \unnumberedsubsec +\global\let\subsubsection = \unnumberedsubsubsec +}} + +\outer\def\numberedsec{\parsearg\secyyy} +\def\secyyy #1{\numhead1{#1}} % normally calls seczzz +\def\seczzz #1{\seccheck{section}% +\subsecno=0 \subsubsecno=0 \global\advance \secno by 1 % +\gdef\thissection{#1}\secheading {#1}{\the\chapno}{\the\secno}% +{\chapternofonts% +\edef\temp{{\realbackslash secentry % +{#1}{\the\chapno}{\the\secno}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\donoderef % +\penalty 10000 % +}} + +\outer\def\appenixsection{\parsearg\appendixsecyyy} +\outer\def\appendixsec{\parsearg\appendixsecyyy} +\def\appendixsecyyy #1{\apphead1{#1}} % normally calls appendixsectionzzz +\def\appendixsectionzzz #1{\seccheck{appendixsection}% +\subsecno=0 \subsubsecno=0 \global\advance \secno by 1 % +\gdef\thissection{#1}\secheading {#1}{\appendixletter}{\the\secno}% +{\chapternofonts% +\edef\temp{{\realbackslash secentry % +{#1}{\appendixletter}{\the\secno}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\appendixnoderef % +\penalty 10000 % +}} + +\outer\def\unnumberedsec{\parsearg\unnumberedsecyyy} +\def\unnumberedsecyyy #1{\unnmhead1{#1}} % normally calls unnumberedseczzz +\def\unnumberedseczzz #1{\seccheck{unnumberedsec}% +\plainsecheading {#1}\gdef\thissection{#1}% +{\chapternofonts% +\edef\temp{{\realbackslash unnumbsecentry{#1}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\unnumbnoderef % +\penalty 10000 % +}} + +\outer\def\numberedsubsec{\parsearg\numberedsubsecyyy} +\def\numberedsubsecyyy #1{\numhead2{#1}} % normally calls numberedsubseczzz +\def\numberedsubseczzz #1{\seccheck{subsection}% +\gdef\thissection{#1}\subsubsecno=0 \global\advance \subsecno by 1 % +\subsecheading {#1}{\the\chapno}{\the\secno}{\the\subsecno}% +{\chapternofonts% +\edef\temp{{\realbackslash subsecentry % +{#1}{\the\chapno}{\the\secno}{\the\subsecno}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\donoderef % +\penalty 10000 % +}} + +\outer\def\appendixsubsec{\parsearg\appendixsubsecyyy} +\def\appendixsubsecyyy #1{\apphead2{#1}} % normally calls appendixsubseczzz +\def\appendixsubseczzz #1{\seccheck{appendixsubsec}% +\gdef\thissection{#1}\subsubsecno=0 \global\advance \subsecno by 1 % +\subsecheading {#1}{\appendixletter}{\the\secno}{\the\subsecno}% +{\chapternofonts% +\edef\temp{{\realbackslash subsecentry % +{#1}{\appendixletter}{\the\secno}{\the\subsecno}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\appendixnoderef % +\penalty 10000 % +}} + +\outer\def\unnumberedsubsec{\parsearg\unnumberedsubsecyyy} +\def\unnumberedsubsecyyy #1{\unnmhead2{#1}} %normally calls unnumberedsubseczzz +\def\unnumberedsubseczzz #1{\seccheck{unnumberedsubsec}% +\plainsecheading {#1}\gdef\thissection{#1}% +{\chapternofonts% +\edef\temp{{\realbackslash unnumbsubsecentry{#1}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\unnumbnoderef % +\penalty 10000 % +}} + +\outer\def\numberedsubsubsec{\parsearg\numberedsubsubsecyyy} +\def\numberedsubsubsecyyy #1{\numhead3{#1}} % normally numberedsubsubseczzz +\def\numberedsubsubseczzz #1{\seccheck{subsubsection}% +\gdef\thissection{#1}\global\advance \subsubsecno by 1 % +\subsubsecheading {#1} + {\the\chapno}{\the\secno}{\the\subsecno}{\the\subsubsecno}% +{\chapternofonts% +\edef\temp{{\realbackslash subsubsecentry % + {#1} + {\the\chapno}{\the\secno}{\the\subsecno}{\the\subsubsecno} + {\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\donoderef % +\penalty 10000 % +}} + +\outer\def\appendixsubsubsec{\parsearg\appendixsubsubsecyyy} +\def\appendixsubsubsecyyy #1{\apphead3{#1}} % normally appendixsubsubseczzz +\def\appendixsubsubseczzz #1{\seccheck{appendixsubsubsec}% +\gdef\thissection{#1}\global\advance \subsubsecno by 1 % +\subsubsecheading {#1} + {\appendixletter}{\the\secno}{\the\subsecno}{\the\subsubsecno}% +{\chapternofonts% +\edef\temp{{\realbackslash subsubsecentry{#1}% + {\appendixletter} + {\the\secno}{\the\subsecno}{\the\subsubsecno}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\appendixnoderef % +\penalty 10000 % +}} + +\outer\def\unnumberedsubsubsec{\parsearg\unnumberedsubsubsecyyy} +\def\unnumberedsubsubsecyyy #1{\unnmhead3{#1}} %normally unnumberedsubsubseczzz +\def\unnumberedsubsubseczzz #1{\seccheck{unnumberedsubsubsec}% +\plainsecheading {#1}\gdef\thissection{#1}% +{\chapternofonts% +\edef\temp{{\realbackslash unnumbsubsubsecentry{#1}{\noexpand\folio}}}% +\escapechar=`\\% +\write \contentsfile \temp % +\unnumbnoderef % +\penalty 10000 % +}} + +% These are variants which are not "outer", so they can appear in @ifinfo. +% Actually, they should now be obsolete; ordinary section commands should work. +\def\infotop{\parsearg\unnumberedzzz} +\def\infounnumbered{\parsearg\unnumberedzzz} +\def\infounnumberedsec{\parsearg\unnumberedseczzz} +\def\infounnumberedsubsec{\parsearg\unnumberedsubseczzz} +\def\infounnumberedsubsubsec{\parsearg\unnumberedsubsubseczzz} + +\def\infoappendix{\parsearg\appendixzzz} +\def\infoappendixsec{\parsearg\appendixseczzz} +\def\infoappendixsubsec{\parsearg\appendixsubseczzz} +\def\infoappendixsubsubsec{\parsearg\appendixsubsubseczzz} + +\def\infochapter{\parsearg\chapterzzz} +\def\infosection{\parsearg\sectionzzz} +\def\infosubsection{\parsearg\subsectionzzz} +\def\infosubsubsection{\parsearg\subsubsectionzzz} + +% These macros control what the section commands do, according +% to what kind of chapter we are in (ordinary, appendix, or unnumbered). +% Define them by default for a numbered chapter. +\global\let\section = \numberedsec +\global\let\subsection = \numberedsubsec +\global\let\subsubsection = \numberedsubsubsec + +% Define @majorheading, @heading and @subheading + +% NOTE on use of \vbox for chapter headings, section headings, and +% such: +% 1) We use \vbox rather than the earlier \line to permit +% overlong headings to fold. +% 2) \hyphenpenalty is set to 10000 because hyphenation in a +% heading is obnoxious; this forbids it. +% 3) Likewise, headings look best if no \parindent is used, and +% if justification is not attempted. Hence \raggedright. + + +\def\majorheading{\parsearg\majorheadingzzz} +\def\majorheadingzzz #1{% +{\advance\chapheadingskip by 10pt \chapbreak }% +{\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}\bigskip \par\penalty 200} + +\def\chapheading{\parsearg\chapheadingzzz} +\def\chapheadingzzz #1{\chapbreak % +{\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}\bigskip \par\penalty 200} + +\def\heading{\parsearg\secheadingi} + +\def\subheading{\parsearg\subsecheadingi} + +\def\subsubheading{\parsearg\subsubsecheadingi} + +% These macros generate a chapter, section, etc. heading only +% (including whitespace, linebreaking, etc. around it), +% given all the information in convenient, parsed form. + +%%% Args are the skip and penalty (usually negative) +\def\dobreak#1#2{\par\ifdim\lastskip<#1\removelastskip\penalty#2\vskip#1\fi} + +\def\setchapterstyle #1 {\csname CHAPF#1\endcsname} + +%%% Define plain chapter starts, and page on/off switching for it +% Parameter controlling skip before chapter headings (if needed) + +\newskip \chapheadingskip \chapheadingskip = 30pt plus 8pt minus 4pt + +\def\chapbreak{\dobreak \chapheadingskip {-4000}} +\def\chappager{\par\vfill\supereject} +\def\chapoddpage{\chappager \ifodd\pageno \else \hbox to 0pt{} \chappager\fi} + +\def\setchapternewpage #1 {\csname CHAPPAG#1\endcsname} + +\def\CHAPPAGoff{ +\global\let\pchapsepmacro=\chapbreak +\global\let\pagealignmacro=\chappager} + +\def\CHAPPAGon{ +\global\let\pchapsepmacro=\chappager +\global\let\pagealignmacro=\chappager +\global\def\HEADINGSon{\HEADINGSsingle}} + +\def\CHAPPAGodd{ +\global\let\pchapsepmacro=\chapoddpage +\global\let\pagealignmacro=\chapoddpage +\global\def\HEADINGSon{\HEADINGSdouble}} + +\CHAPPAGon + +\def\CHAPFplain{ +\global\let\chapmacro=\chfplain +\global\let\unnumbchapmacro=\unnchfplain} + +\def\chfplain #1#2{% + \pchapsepmacro + {% + \chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #2\enspace #1}% + }% + \bigskip + \penalty5000 +} + +\def\unnchfplain #1{% +\pchapsepmacro % +{\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}\bigskip \par\penalty 10000 % +} +\CHAPFplain % The default + +\def\unnchfopen #1{% +\chapoddpage {\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}\bigskip \par\penalty 10000 % +} + +\def\chfopen #1#2{\chapoddpage {\chapfonts +\vbox to 3in{\vfil \hbox to\hsize{\hfil #2} \hbox to\hsize{\hfil #1} \vfil}}% +\par\penalty 5000 % +} + +\def\CHAPFopen{ +\global\let\chapmacro=\chfopen +\global\let\unnumbchapmacro=\unnchfopen} + +% Parameter controlling skip before section headings. + +\newskip \subsecheadingskip \subsecheadingskip = 17pt plus 8pt minus 4pt +\def\subsecheadingbreak{\dobreak \subsecheadingskip {-500}} + +\newskip \secheadingskip \secheadingskip = 21pt plus 8pt minus 4pt +\def\secheadingbreak{\dobreak \secheadingskip {-1000}} + +% @paragraphindent is defined for the Info formatting commands only. +\let\paragraphindent=\comment + +% Section fonts are the base font at magstep2, which produces +% a size a bit more than 14 points in the default situation. + +\def\secheading #1#2#3{\secheadingi {#2.#3\enspace #1}} +\def\plainsecheading #1{\secheadingi {#1}} +\def\secheadingi #1{{\advance \secheadingskip by \parskip % +\secheadingbreak}% +{\secfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}% +\ifdim \parskip<10pt \kern 10pt\kern -\parskip\fi \penalty 10000 } + + +% Subsection fonts are the base font at magstep1, +% which produces a size of 12 points. + +\def\subsecheading #1#2#3#4{\subsecheadingi {#2.#3.#4\enspace #1}} +\def\subsecheadingi #1{{\advance \subsecheadingskip by \parskip % +\subsecheadingbreak}% +{\subsecfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}% +\ifdim \parskip<10pt \kern 10pt\kern -\parskip\fi \penalty 10000 } + +\def\subsubsecfonts{\subsecfonts} % Maybe this should change: + % Perhaps make sssec fonts scaled + % magstep half +\def\subsubsecheading #1#2#3#4#5{\subsubsecheadingi {#2.#3.#4.#5\enspace #1}} +\def\subsubsecheadingi #1{{\advance \subsecheadingskip by \parskip % +\subsecheadingbreak}% +{\subsubsecfonts \vbox{\hyphenpenalty=10000\tolerance=5000 + \parindent=0pt\raggedright + \rm #1\hfill}}% +\ifdim \parskip<10pt \kern 10pt\kern -\parskip\fi \penalty 10000} + + +\message{toc printing,} + +% Finish up the main text and prepare to read what we've written +% to \contentsfile. + +\newskip\contentsrightmargin \contentsrightmargin=1in +\def\startcontents#1{% + \pagealignmacro + \immediate\closeout \contentsfile + \ifnum \pageno>0 + \pageno = -1 % Request roman numbered pages. + \fi + % Don't need to put `Contents' or `Short Contents' in the headline. + % It is abundantly clear what they are. + \unnumbchapmacro{#1}\def\thischapter{}% + \begingroup % Set up to handle contents files properly. + \catcode`\\=0 \catcode`\{=1 \catcode`\}=2 \catcode`\@=11 + \raggedbottom % Worry more about breakpoints than the bottom. + \advance\hsize by -\contentsrightmargin % Don't use the full line length. +} + + +% Normal (long) toc. +\outer\def\contents{% + \startcontents{Table of Contents}% + \input \jobname.toc + \endgroup + \vfill \eject +} + +% And just the chapters. +\outer\def\summarycontents{% + \startcontents{Short Contents}% + % + \let\chapentry = \shortchapentry + \let\unnumbchapentry = \shortunnumberedentry + % We want a true roman here for the page numbers. + \secfonts + \let\rm=\shortcontrm \let\bf=\shortcontbf \let\sl=\shortcontsl + \rm + \advance\baselineskip by 1pt % Open it up a little. + \def\secentry ##1##2##3##4{} + \def\unnumbsecentry ##1##2{} + \def\subsecentry ##1##2##3##4##5{} + \def\unnumbsubsecentry ##1##2{} + \def\subsubsecentry ##1##2##3##4##5##6{} + \def\unnumbsubsubsecentry ##1##2{} + \input \jobname.toc + \endgroup + \vfill \eject +} +\let\shortcontents = \summarycontents + +% These macros generate individual entries in the table of contents. +% The first argument is the chapter or section name. +% The last argument is the page number. +% The arguments in between are the chapter number, section number, ... + +% Chapter-level things, for both the long and short contents. +\def\chapentry#1#2#3{\dochapentry{#2\labelspace#1}{#3}} + +% See comments in \dochapentry re vbox and related settings +\def\shortchapentry#1#2#3{% + \tocentry{\shortchaplabel{#2}\labelspace #1}{\doshortpageno{#3}}% +} + +% Typeset the label for a chapter or appendix for the short contents. +% The arg is, e.g. `Appendix A' for an appendix, or `3' for a chapter. +% We could simplify the code here by writing out an \appendixentry +% command in the toc file for appendices, instead of using \chapentry +% for both, but it doesn't seem worth it. +\setbox0 = \hbox{\shortcontrm Appendix } +\newdimen\shortappendixwidth \shortappendixwidth = \wd0 + +\def\shortchaplabel#1{% + % We typeset #1 in a box of constant width, regardless of the text of + % #1, so the chapter titles will come out aligned. + \setbox0 = \hbox{#1}% + \dimen0 = \ifdim\wd0 > \shortappendixwidth \shortappendixwidth \else 0pt \fi + % + % This space should be plenty, since a single number is .5em, and the + % widest letter (M) is 1em, at least in the Computer Modern fonts. + % (This space doesn't include the extra space that gets added after + % the label; that gets put in in \shortchapentry above.) + \advance\dimen0 by 1.1em + \hbox to \dimen0{#1\hfil}% +} + +\def\unnumbchapentry#1#2{\dochapentry{#1}{#2}} +\def\shortunnumberedentry#1#2{\tocentry{#1}{\doshortpageno{#2}}} + +% Sections. +\def\secentry#1#2#3#4{\dosecentry{#2.#3\labelspace#1}{#4}} +\def\unnumbsecentry#1#2{\dosecentry{#1}{#2}} + +% Subsections. +\def\subsecentry#1#2#3#4#5{\dosubsecentry{#2.#3.#4\labelspace#1}{#5}} +\def\unnumbsubsecentry#1#2{\dosubsecentry{#1}{#2}} + +% And subsubsections. +\def\subsubsecentry#1#2#3#4#5#6{% + \dosubsubsecentry{#2.#3.#4.#5\labelspace#1}{#6}} +\def\unnumbsubsubsecentry#1#2{\dosubsubsecentry{#1}{#2}} + + +% This parameter controls the indentation of the various levels. +\newdimen\tocindent \tocindent = 3pc + +% Now for the actual typesetting. In all these, #1 is the text and #2 is the +% page number. +% +% If the toc has to be broken over pages, we would want to be at chapters +% if at all possible; hence the \penalty. +\def\dochapentry#1#2{% + \penalty-300 \vskip\baselineskip + \begingroup + \chapentryfonts + \tocentry{#1}{\dopageno{#2}}% + \endgroup + \nobreak\vskip .25\baselineskip +} + +\def\dosecentry#1#2{\begingroup + \secentryfonts \leftskip=\tocindent + \tocentry{#1}{\dopageno{#2}}% +\endgroup} + +\def\dosubsecentry#1#2{\begingroup + \subsecentryfonts \leftskip=2\tocindent + \tocentry{#1}{\dopageno{#2}}% +\endgroup} + +\def\dosubsubsecentry#1#2{\begingroup + \subsubsecentryfonts \leftskip=3\tocindent + \tocentry{#1}{\dopageno{#2}}% +\endgroup} + +% Final typesetting of a toc entry; we use the same \entry macro as for +% the index entries, but we want to suppress hyphenation here. (We +% can't do that in the \entry macro, since index entries might consist +% of hyphenated-identifiers-that-do-not-fit-on-a-line-and-nothing-else.) +% +\def\tocentry#1#2{\begingroup + \hyphenpenalty = 10000 + \entry{#1}{#2}% +\endgroup} + +% Space between chapter (or whatever) number and the title. +\def\labelspace{\hskip1em \relax} + +\def\dopageno#1{{\rm #1}} +\def\doshortpageno#1{{\rm #1}} + +\def\chapentryfonts{\secfonts \rm} +\def\secentryfonts{\textfonts} +\let\subsecentryfonts = \textfonts +\let\subsubsecentryfonts = \textfonts + + +\message{environments,} + +% Since these characters are used in examples, it should be an even number of +% \tt widths. Each \tt character is 1en, so two makes it 1em. +% Furthermore, these definitions must come after we define our fonts. +\newbox\dblarrowbox \newbox\longdblarrowbox +\newbox\pushcharbox \newbox\bullbox +\newbox\equivbox \newbox\errorbox + +\let\ptexequiv = \equiv + +%{\tentt +%\global\setbox\dblarrowbox = \hbox to 1em{\hfil$\Rightarrow$\hfil} +%\global\setbox\longdblarrowbox = \hbox to 1em{\hfil$\mapsto$\hfil} +%\global\setbox\pushcharbox = \hbox to 1em{\hfil$\dashv$\hfil} +%\global\setbox\equivbox = \hbox to 1em{\hfil$\ptexequiv$\hfil} +% Adapted from the manmac format (p.420 of TeXbook) +%\global\setbox\bullbox = \hbox to 1em{\kern.15em\vrule height .75ex width .85ex +% depth .1ex\hfil} +%} + +\def\point{$\star$} + +\def\result{\leavevmode\raise.15ex\hbox to 1em{\hfil$\Rightarrow$\hfil}} +\def\expansion{\leavevmode\raise.1ex\hbox to 1em{\hfil$\mapsto$\hfil}} +\def\print{\leavevmode\lower.1ex\hbox to 1em{\hfil$\dashv$\hfil}} + +\def\equiv{\leavevmode\lower.1ex\hbox to 1em{\hfil$\ptexequiv$\hfil}} + +% Adapted from the TeXbook's \boxit. +{\tentt \global\dimen0 = 3em}% Width of the box. +\dimen2 = .55pt % Thickness of rules +% The text. (`r' is open on the right, `e' somewhat less so on the left.) +\setbox0 = \hbox{\kern-.75pt \tensf error\kern-1.5pt} + +\global\setbox\errorbox=\hbox to \dimen0{\hfil + \hsize = \dimen0 \advance\hsize by -5.8pt % Space to left+right. + \advance\hsize by -2\dimen2 % Rules. + \vbox{ + \hrule height\dimen2 + \hbox{\vrule width\dimen2 \kern3pt % Space to left of text. + \vtop{\kern2.4pt \box0 \kern2.4pt}% Space above/below. + \kern3pt\vrule width\dimen2}% Space to right. + \hrule height\dimen2} + \hfil} + +% The @error{} command. +\def\error{\leavevmode\lower.7ex\copy\errorbox} + +% @tex ... @end tex escapes into raw Tex temporarily. +% One exception: @ is still an escape character, so that @end tex works. +% But \@ or @@ will get a plain tex @ character. + +\def\tex{\begingroup +\catcode `\\=0 \catcode `\{=1 \catcode `\}=2 +\catcode `\$=3 \catcode `\&=4 \catcode `\#=6 +\catcode `\^=7 \catcode `\_=8 \catcode `\~=13 \let~=\tie +\catcode `\%=14 +\catcode 43=12 +\catcode`\"=12 +\catcode`\==12 +\catcode`\|=12 +\catcode`\<=12 +\catcode`\>=12 +\escapechar=`\\ +% +\let\{=\ptexlbrace +\let\}=\ptexrbrace +\let\.=\ptexdot +\let\*=\ptexstar +\let\dots=\ptexdots +\def\@{@}% +\let\bullet=\ptexbullet +\let\b=\ptexb \let\c=\ptexc \let\i=\ptexi \let\t=\ptext \let\l=\ptexl +\let\L=\ptexL +% +\let\Etex=\endgroup} + +% Define @lisp ... @endlisp. +% @lisp does a \begingroup so it can rebind things, +% including the definition of @endlisp (which normally is erroneous). + +% Amount to narrow the margins by for @lisp. +\newskip\lispnarrowing \lispnarrowing=0.4in + +% This is the definition that ^^M gets inside @lisp, @example, and other +% such environments. \null is better than a space, since it doesn't +% have any width. +\def\lisppar{\null\endgraf} + +% Make each space character in the input produce a normal interword +% space in the output. Don't allow a line break at this space, as this +% is used only in environments like @example, where each line of input +% should produce a line of output anyway. +% +{\obeyspaces % +\gdef\sepspaces{\obeyspaces\let =\tie}} + +% Define \obeyedspace to be our active space, whatever it is. This is +% for use in \parsearg. +{\sepspaces % +\global\let\obeyedspace= } + +% This space is always present above and below environments. +\newskip\envskipamount \envskipamount = 0pt + +% Make spacing and below environment symmetrical. We use \parskip here +% to help in doing that, since in @example-like environments \parskip +% is reset to zero; thus the \afterenvbreak inserts no space -- but the +% start of the next paragraph will insert \parskip +% +\def\aboveenvbreak{{\advance\envskipamount by \parskip +\endgraf \ifdim\lastskip<\envskipamount +\removelastskip \penalty-50 \vskip\envskipamount \fi}} + +\let\afterenvbreak = \aboveenvbreak + +% \nonarrowing is a flag. If "set", @lisp etc don't narrow margins. +\let\nonarrowing=\relax + +%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% +% \cartouche: draw rectangle w/rounded corners around argument +\font\circle=lcircle10 +\newdimen\circthick +\newdimen\cartouter\newdimen\cartinner +\newskip\normbskip\newskip\normpskip\newskip\normlskip +\circthick=\fontdimen8\circle +% +\def\ctl{{\circle\char'013\hskip -6pt}}% 6pt from pl file: 1/2charwidth +\def\ctr{{\hskip 6pt\circle\char'010}} +\def\cbl{{\circle\char'012\hskip -6pt}} +\def\cbr{{\hskip 6pt\circle\char'011}} +\def\carttop{\hbox to \cartouter{\hskip\lskip + \ctl\leaders\hrule height\circthick\hfil\ctr + \hskip\rskip}} +\def\cartbot{\hbox to \cartouter{\hskip\lskip + \cbl\leaders\hrule height\circthick\hfil\cbr + \hskip\rskip}} +% +\newskip\lskip\newskip\rskip + +\long\def\cartouche{% +\begingroup + \lskip=\leftskip \rskip=\rightskip + \leftskip=0pt\rightskip=0pt %we want these *outside*. + \cartinner=\hsize \advance\cartinner by-\lskip + \advance\cartinner by-\rskip + \cartouter=\hsize + \advance\cartouter by 18pt % allow for 3pt kerns on either +% side, and for 6pt waste from +% each corner char + \normbskip=\baselineskip \normpskip=\parskip \normlskip=\lineskip + % Flag to tell @lisp, etc., not to narrow margin. + \let\nonarrowing=\comment + \vbox\bgroup + \baselineskip=0pt\parskip=0pt\lineskip=0pt + \carttop + \hbox\bgroup + \hskip\lskip + \vrule\kern3pt + \vbox\bgroup + \hsize=\cartinner + \kern3pt + \begingroup + \baselineskip=\normbskip + \lineskip=\normlskip + \parskip=\normpskip + \vskip -\parskip +\def\Ecartouche{% + \endgroup + \kern3pt + \egroup + \kern3pt\vrule + \hskip\rskip + \egroup + \cartbot + \egroup +\endgroup +}} + + +% This macro is called at the beginning of all the @example variants, +% inside a group. +\def\nonfillstart{% + \aboveenvbreak + \inENV % This group ends at the end of the body + \hfuzz = 12pt % Don't be fussy + \sepspaces % Make spaces be word-separators rather than space tokens. + \singlespace + \let\par = \lisppar % don't ignore blank lines + \obeylines % each line of input is a line of output + \parskip = 0pt + \parindent = 0pt + \emergencystretch = 0pt % don't try to avoid overfull boxes + % @cartouche defines \nonarrowing to inhibit narrowing + % at next level down. + \ifx\nonarrowing\relax + \advance \leftskip by \lispnarrowing + \exdentamount=\lispnarrowing + \let\exdent=\nofillexdent + \let\nonarrowing=\relax + \fi +} + +% To ending an @example-like environment, we first end the paragraph +% (via \afterenvbreak's vertical glue), and then the group. That way we +% keep the zero \parskip that the environments set -- \parskip glue +% will be inserted at the beginning of the next paragraph in the +% document, after the environment. +% +\def\nonfillfinish{\afterenvbreak\endgroup}% + +% This macro is +\def\lisp{\begingroup + \nonfillstart + \let\Elisp = \nonfillfinish + \tt + \rawbackslash % have \ input char produce \ char from current font + \gobble +} + +% Define the \E... control sequence only if we are inside the +% environment, so the error checking in \end will work. +% +% We must call \lisp last in the definition, since it reads the +% return following the @example (or whatever) command. +% +\def\example{\begingroup \def\Eexample{\nonfillfinish\endgroup}\lisp} +\def\smallexample{\begingroup \def\Esmallexample{\nonfillfinish\endgroup}\lisp} +\def\smalllisp{\begingroup \def\Esmalllisp{\nonfillfinish\endgroup}\lisp} + +% @smallexample and @smalllisp. This is not used unless the @smallbook +% command is given. Originally contributed by Pavel@xerox. +% +\def\smalllispx{\begingroup + \nonfillstart + \let\Esmalllisp = \nonfillfinish + \let\Esmallexample = \nonfillfinish + % + % Smaller interline space and fonts for small examples. + \baselineskip 10pt + \indexfonts \tt + \rawbackslash % output the \ character from the current font + \gobble +} + +% This is @display; same as @lisp except use roman font. +% +\def\display{\begingroup + \nonfillstart + \let\Edisplay = \nonfillfinish + \gobble +} + +% This is @format; same as @display except don't narrow margins. +% +\def\format{\begingroup + \let\nonarrowing = t + \nonfillstart + \let\Eformat = \nonfillfinish + \gobble +} + +% @flushleft (same as @format) and @flushright. +% +\def\flushleft{\begingroup + \let\nonarrowing = t + \nonfillstart + \let\Eflushleft = \nonfillfinish + \gobble +} +\def\flushright{\begingroup + \let\nonarrowing = t + \nonfillstart + \let\Eflushright = \nonfillfinish + \advance\leftskip by 0pt plus 1fill + \gobble} + +% @quotation does normal linebreaking and narrows the margins. +% +\def\quotation{% +\begingroup\inENV %This group ends at the end of the @quotation body +{\parskip=0pt % because we will skip by \parskip too, later +\aboveenvbreak}% +\singlespace +\parindent=0pt +\let\Equotation = \nonfillfinish +% @cartouche defines \nonarrowing to inhibit narrowing +% at next level down. +\ifx\nonarrowing\relax +\advance \leftskip by \lispnarrowing +\advance \rightskip by \lispnarrowing +\exdentamount=\lispnarrowing +\let\nonarrowing=\relax +\fi} + +\message{defuns,} +% Define formatter for defuns +% First, allow user to change definition object font (\df) internally +\def\setdeffont #1 {\csname DEF#1\endcsname} + +\newskip\defbodyindent \defbodyindent=.4in +\newskip\defargsindent \defargsindent=50pt +\newskip\deftypemargin \deftypemargin=12pt +\newskip\deflastargmargin \deflastargmargin=18pt + +\newcount\parencount +% define \functionparens, which makes ( and ) and & do special things. +% \functionparens affects the group it is contained in. +\def\activeparens{% +\catcode`\(=\active \catcode`\)=\active \catcode`\&=\active +\catcode`\[=\active \catcode`\]=\active} + +% Make control sequences which act like normal parenthesis chars. +\let\lparen = ( \let\rparen = ) + +{\activeparens % Now, smart parens don't turn on until &foo (see \amprm) + +% Be sure that we always have a definition for `(', etc. For example, +% if the fn name has parens in it, \boldbrax will not be in effect yet, +% so TeX would otherwise complain about undefined control sequence. +\global\let(=\lparen \global\let)=\rparen +\global\let[=\lbrack \global\let]=\rbrack + +\gdef\functionparens{\boldbrax\let&=\amprm\parencount=0 } +\gdef\boldbrax{\let(=\opnr\let)=\clnr\let[=\lbrb\let]=\rbrb} + +% Definitions of (, ) and & used in args for functions. +% This is the definition of ( outside of all parentheses. +\gdef\oprm#1 {{\rm\char`\(}#1 \bf \let(=\opnested % +\global\advance\parencount by 1 } +% +% This is the definition of ( when already inside a level of parens. +\gdef\opnested{\char`\(\global\advance\parencount by 1 } +% +\gdef\clrm{% Print a paren in roman if it is taking us back to depth of 0. +% also in that case restore the outer-level definition of (. +\ifnum \parencount=1 {\rm \char `\)}\sl \let(=\oprm \else \char `\) \fi +\global\advance \parencount by -1 } +% If we encounter &foo, then turn on ()-hacking afterwards +\gdef\amprm#1 {{\rm\}\let(=\oprm \let)=\clrm\ } +% +\gdef\normalparens{\boldbrax\let&=\ampnr} +} % End of definition inside \activeparens +%% These parens (in \boldbrax) actually are a little bolder than the +%% contained text. This is especially needed for [ and ] +\def\opnr{{\sf\char`\(}} \def\clnr{{\sf\char`\)}} \def\ampnr{\&} +\def\lbrb{{\bf\char`\[}} \def\rbrb{{\bf\char`\]}} + +% First, defname, which formats the header line itself. +% #1 should be the function name. +% #2 should be the type of definition, such as "Function". + +\def\defname #1#2{% +% Get the values of \leftskip and \rightskip as they were +% outside the @def... +\dimen2=\leftskip +\advance\dimen2 by -\defbodyindent +\dimen3=\rightskip +\advance\dimen3 by -\defbodyindent +\noindent % +\setbox0=\hbox{\hskip \deflastargmargin{\rm #2}\hskip \deftypemargin}% +\dimen0=\hsize \advance \dimen0 by -\wd0 % compute size for first line +\dimen1=\hsize \advance \dimen1 by -\defargsindent %size for continuations +\parshape 2 0in \dimen0 \defargsindent \dimen1 % +% Now output arg 2 ("Function" or some such) +% ending at \deftypemargin from the right margin, +% but stuck inside a box of width 0 so it does not interfere with linebreaking +{% Adjust \hsize to exclude the ambient margins, +% so that \rightline will obey them. +\advance \hsize by -\dimen2 \advance \hsize by -\dimen3 +\rlap{\rightline{{\rm #2}\hskip \deftypemargin}}}% +% Make all lines underfull and no complaints: +\tolerance=10000 \hbadness=10000 +\advance\leftskip by -\defbodyindent +\exdentamount=\defbodyindent +{\df #1}\enskip % Generate function name +} + +% Actually process the body of a definition +% #1 should be the terminating control sequence, such as \Edefun. +% #2 should be the "another name" control sequence, such as \defunx. +% #3 should be the control sequence that actually processes the header, +% such as \defunheader. + +\def\defparsebody #1#2#3{\begingroup\inENV% Environment for definitionbody +\medbreak % +% Define the end token that this defining construct specifies +% so that it will exit this group. +\def#1{\endgraf\endgroup\medbreak}% +\def#2{\begingroup\obeylines\activeparens\spacesplit#3}% +\parindent=0in +\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +\exdentamount=\defbodyindent +\begingroup % +\catcode 61=\active % +\obeylines\activeparens\spacesplit#3} + +\def\defmethparsebody #1#2#3#4 {\begingroup\inENV % +\medbreak % +% Define the end token that this defining construct specifies +% so that it will exit this group. +\def#1{\endgraf\endgroup\medbreak}% +\def#2##1 {\begingroup\obeylines\activeparens\spacesplit{#3{##1}}}% +\parindent=0in +\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +\exdentamount=\defbodyindent +\begingroup\obeylines\activeparens\spacesplit{#3{#4}}} + +\def\defopparsebody #1#2#3#4#5 {\begingroup\inENV % +\medbreak % +% Define the end token that this defining construct specifies +% so that it will exit this group. +\def#1{\endgraf\endgroup\medbreak}% +\def#2##1 ##2 {\def#4{##1}% +\begingroup\obeylines\activeparens\spacesplit{#3{##2}}}% +\parindent=0in +\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +\exdentamount=\defbodyindent +\begingroup\obeylines\activeparens\spacesplit{#3{#5}}} + +% These parsing functions are similar to the preceding ones +% except that they do not make parens into active characters. +% These are used for "variables" since they have no arguments. + +\def\defvarparsebody #1#2#3{\begingroup\inENV% Environment for definitionbody +\medbreak % +% Define the end token that this defining construct specifies +% so that it will exit this group. +\def#1{\endgraf\endgroup\medbreak}% +\def#2{\begingroup\obeylines\spacesplit#3}% +\parindent=0in +\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +\exdentamount=\defbodyindent +\begingroup % +\catcode 61=\active % +\obeylines\spacesplit#3} + +\def\defvrparsebody #1#2#3#4 {\begingroup\inENV % +\medbreak % +% Define the end token that this defining construct specifies +% so that it will exit this group. +\def#1{\endgraf\endgroup\medbreak}% +\def#2##1 {\begingroup\obeylines\spacesplit{#3{##1}}}% +\parindent=0in +\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +\exdentamount=\defbodyindent +\begingroup\obeylines\spacesplit{#3{#4}}} + +% This seems to work right in all cases. +\let\deftpparsebody=\defvrparsebody +% This fails to work. When given `@deftp {Data Type} foo_t', +% it thinks the type name is just `f'. +%%% This is the same as all the others except for the last line. We need +%%% to parse the arguments differently for @deftp, since the ``attributes'' +%%% there are optional. +%%% +%%\def\deftpparsebody #1#2#3#4 {\begingroup\inENV % +%%\medbreak % +%%% Define the end token that this defining construct specifies +%%% so that it will exit this group. +%%\def#1{\endgraf\endgroup\medbreak}% +%%\def#2##1 {\begingroup\obeylines\spacesplit{#3{##1}}}% +%%\parindent=0in +%%\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +%%\exdentamount=\defbodyindent +%%\begingroup\obeylines\parsetpheaderline{#3{#4}}} + +%%{\obeylines % +%% % Parse the type name and any attributes (field names, etc.). +%% % #1 is the beginning of the macro call that will produce the output, +%% % i.e., \deftpheader{CLASS}; this is passed from \deftpparsebody. +%% % #2 is the type name, e.g., `struct termios'. +%% % #3 is the (possibly empty) attribute list. +%% % +%% \gdef\parsetpheaderline#1#2#3^^M{% +%% \endgroup % Started in \deftpparsebody. +%% % +%% % If the attribute list is in fact empty, there will be no space after +%% % #2; so we can't put a space in our TeX parameter list. But if it +%% % isn't empty, then #3 will begin with an unwanted space. +%% \def\theargs{\ignorespaces #3}% +%% % +%% % Call the macro to produce the output. +%% #1{#2}\theargs % +%% }% +%%} + +\def\defopvarparsebody #1#2#3#4#5 {\begingroup\inENV % +\medbreak % +% Define the end token that this defining construct specifies +% so that it will exit this group. +\def#1{\endgraf\endgroup\medbreak}% +\def#2##1 ##2 {\def#4{##1}% +\begingroup\obeylines\spacesplit{#3{##2}}}% +\parindent=0in +\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent +\exdentamount=\defbodyindent +\begingroup\obeylines\spacesplit{#3{#5}}} + +% Split up #2 at the first space token. +% call #1 with two arguments: +% the first is all of #2 before the space token, +% the second is all of #2 after that space token. +% If #2 contains no space token, all of it is passed as the first arg +% and the second is passed as empty. + +{\obeylines +\gdef\spacesplit#1#2^^M{\endgroup\spacesplitfoo{#1}#2 \relax\spacesplitfoo}% +\long\gdef\spacesplitfoo#1#2 #3#4\spacesplitfoo{% +\ifx\relax #3% +#1{#2}{}\else #1{#2}{#3#4}\fi}} + +% So much for the things common to all kinds of definitions. + +% Define @defun. + +% First, define the processing that is wanted for arguments of \defun +% Use this to expand the args and terminate the paragraph they make up + +\def\defunargs #1{\functionparens \sl +% Expand, preventing hyphenation at `-' chars. +% Note that groups don't affect changes in \hyphenchar. +\hyphenchar\tensl=0 +#1% +\hyphenchar\tensl=45 +\ifnum\parencount=0 \else \errmessage{unbalanced parens in @def arguments}\fi% +\interlinepenalty=10000 +\advance\rightskip by 0pt plus 1fil +\endgraf\penalty 10000\vskip -\parskip\penalty 10000% +} + +\def\deftypefunargs #1{% +% Expand, preventing hyphenation at `-' chars. +% Note that groups don't affect changes in \hyphenchar. +\functionparens +\code{#1}% +\interlinepenalty=10000 +\advance\rightskip by 0pt plus 1fil +\endgraf\penalty 10000\vskip -\parskip\penalty 10000% +} + +% Do complete processing of one @defun or @defunx line already parsed. + +% @deffn Command forward-char nchars + +\def\deffn{\defmethparsebody\Edeffn\deffnx\deffnheader} + +\def\deffnheader #1#2#3{\doind {fn}{\code{#2}}% +\begingroup\defname {#2}{#1}\defunargs{#3}\endgroup % +\catcode 61=\other % Turn off change made in \defparsebody +} + +% @defun == @deffn Function + +\def\defun{\defparsebody\Edefun\defunx\defunheader} + +\def\defunheader #1#2{\doind {fn}{\code{#1}}% Make entry in function index +\begingroup\defname {#1}{Function}% +\defunargs {#2}\endgroup % +\catcode 61=\other % Turn off change made in \defparsebody +} + +% @deftypefun int foobar (int @var{foo}, float @var{bar}) + +\def\deftypefun{\defparsebody\Edeftypefun\deftypefunx\deftypefunheader} + +% #1 is the data type. #2 is the name and args. +\def\deftypefunheader #1#2{\deftypefunheaderx{#1}#2 \relax} +% #1 is the data type, #2 the name, #3 the args. +\def\deftypefunheaderx #1#2 #3\relax{% +\doind {fn}{\code{#2}}% Make entry in function index +\begingroup\defname {\code{#1} #2}{Function}% +\deftypefunargs {#3}\endgroup % +\catcode 61=\other % Turn off change made in \defparsebody +} + +% @deftypefn {Library Function} int foobar (int @var{foo}, float @var{bar}) + +\def\deftypefn{\defmethparsebody\Edeftypefn\deftypefnx\deftypefnheader} + +% #1 is the classification. #2 is the data type. #3 is the name and args. +\def\deftypefnheader #1#2#3{\deftypefnheaderx{#1}{#2}#3 \relax} +% #1 is the classification, #2 the data type, #3 the name, #4 the args. +\def\deftypefnheaderx #1#2#3 #4\relax{% +\doind {fn}{\code{#3}}% Make entry in function index +\begingroup\defname {\code{#2} #3}{#1}% +\deftypefunargs {#4}\endgroup % +\catcode 61=\other % Turn off change made in \defparsebody +} + +% @defmac == @deffn Macro + +\def\defmac{\defparsebody\Edefmac\defmacx\defmacheader} + +\def\defmacheader #1#2{\doind {fn}{\code{#1}}% Make entry in function index +\begingroup\defname {#1}{Macro}% +\defunargs {#2}\endgroup % +\catcode 61=\other % Turn off change made in \defparsebody +} + +% @defspec == @deffn Special Form + +\def\defspec{\defparsebody\Edefspec\defspecx\defspecheader} + +\def\defspecheader #1#2{\doind {fn}{\code{#1}}% Make entry in function index +\begingroup\defname {#1}{Special Form}% +\defunargs {#2}\endgroup % +\catcode 61=\other % Turn off change made in \defparsebody +} + +% This definition is run if you use @defunx +% anywhere other than immediately after a @defun or @defunx. + +\def\deffnx #1 {\errmessage{@deffnx in invalid context}} +\def\defunx #1 {\errmessage{@defunx in invalid context}} +\def\defmacx #1 {\errmessage{@defmacx in invalid context}} +\def\defspecx #1 {\errmessage{@defspecx in invalid context}} +\def\deftypefnx #1 {\errmessage{@deftypefnx in invalid context}} +\def\deftypeunx #1 {\errmessage{@deftypeunx in invalid context}} + +% @defmethod, and so on + +% @defop {Funny Method} foo-class frobnicate argument + +\def\defop #1 {\def\defoptype{#1}% +\defopparsebody\Edefop\defopx\defopheader\defoptype} + +\def\defopheader #1#2#3{% +\dosubind {fn}{\code{#2}}{on #1}% Make entry in function index +\begingroup\defname {#2}{\defoptype{} on #1}% +\defunargs {#3}\endgroup % +} + +% @defmethod == @defop Method + +\def\defmethod{\defmethparsebody\Edefmethod\defmethodx\defmethodheader} + +\def\defmethodheader #1#2#3{% +\dosubind {fn}{\code{#2}}{on #1}% entry in function index +\begingroup\defname {#2}{Method on #1}% +\defunargs {#3}\endgroup % +} + +% @defcv {Class Option} foo-class foo-flag + +\def\defcv #1 {\def\defcvtype{#1}% +\defopvarparsebody\Edefcv\defcvx\defcvarheader\defcvtype} + +\def\defcvarheader #1#2#3{% +\dosubind {vr}{\code{#2}}{of #1}% Make entry in var index +\begingroup\defname {#2}{\defcvtype{} of #1}% +\defvarargs {#3}\endgroup % +} + +% @defivar == @defcv {Instance Variable} + +\def\defivar{\defvrparsebody\Edefivar\defivarx\defivarheader} + +\def\defivarheader #1#2#3{% +\dosubind {vr}{\code{#2}}{of #1}% Make entry in var index +\begingroup\defname {#2}{Instance Variable of #1}% +\defvarargs {#3}\endgroup % +} + +% These definitions are run if you use @defmethodx, etc., +% anywhere other than immediately after a @defmethod, etc. + +\def\defopx #1 {\errmessage{@defopx in invalid context}} +\def\defmethodx #1 {\errmessage{@defmethodx in invalid context}} +\def\defcvx #1 {\errmessage{@defcvx in invalid context}} +\def\defivarx #1 {\errmessage{@defivarx in invalid context}} + +% Now @defvar + +% First, define the processing that is wanted for arguments of @defvar. +% This is actually simple: just print them in roman. +% This must expand the args and terminate the paragraph they make up +\def\defvarargs #1{\normalparens #1% +\interlinepenalty=10000 +\endgraf\penalty 10000\vskip -\parskip\penalty 10000} + +% @defvr Counter foo-count + +\def\defvr{\defvrparsebody\Edefvr\defvrx\defvrheader} + +\def\defvrheader #1#2#3{\doind {vr}{\code{#2}}% +\begingroup\defname {#2}{#1}\defvarargs{#3}\endgroup} + +% @defvar == @defvr Variable + +\def\defvar{\defvarparsebody\Edefvar\defvarx\defvarheader} + +\def\defvarheader #1#2{\doind {vr}{\code{#1}}% Make entry in var index +\begingroup\defname {#1}{Variable}% +\defvarargs {#2}\endgroup % +} + +% @defopt == @defvr {User Option} + +\def\defopt{\defvarparsebody\Edefopt\defoptx\defoptheader} + +\def\defoptheader #1#2{\doind {vr}{\code{#1}}% Make entry in var index +\begingroup\defname {#1}{User Option}% +\defvarargs {#2}\endgroup % +} + +% @deftypevar int foobar + +\def\deftypevar{\defvarparsebody\Edeftypevar\deftypevarx\deftypevarheader} + +% #1 is the data type. #2 is the name. +\def\deftypevarheader #1#2{% +\doind {vr}{\code{#2}}% Make entry in variables index +\begingroup\defname {\code{#1} #2}{Variable}% +\interlinepenalty=10000 +\endgraf\penalty 10000\vskip -\parskip\penalty 10000 +\endgroup} + +% @deftypevr {Global Flag} int enable + +\def\deftypevr{\defvrparsebody\Edeftypevr\deftypevrx\deftypevrheader} + +\def\deftypevrheader #1#2#3{\doind {vr}{\code{#3}}% +\begingroup\defname {\code{#2} #3}{#1} +\interlinepenalty=10000 +\endgraf\penalty 10000\vskip -\parskip\penalty 10000 +\endgroup} + +% This definition is run if you use @defvarx +% anywhere other than immediately after a @defvar or @defvarx. + +\def\defvrx #1 {\errmessage{@defvrx in invalid context}} +\def\defvarx #1 {\errmessage{@defvarx in invalid context}} +\def\defoptx #1 {\errmessage{@defoptx in invalid context}} +\def\deftypevarx #1 {\errmessage{@deftypevarx in invalid context}} +\def\deftypevrx #1 {\errmessage{@deftypevrx in invalid context}} + +% Now define @deftp +% Args are printed in bold, a slight difference from @defvar. + +\def\deftpargs #1{\bf \defvarargs{#1}} + +% @deftp Class window height width ... + +\def\deftp{\deftpparsebody\Edeftp\deftpx\deftpheader} + +\def\deftpheader #1#2#3{\doind {tp}{\code{#2}}% +\begingroup\defname {#2}{#1}\deftpargs{#3}\endgroup} + +% This definition is run if you use @deftpx, etc +% anywhere other than immediately after a @deftp, etc. + +\def\deftpx #1 {\errmessage{@deftpx in invalid context}} + +\message{cross reference,} +% Define cross-reference macros +\newwrite \auxfile + +\newif\ifhavexrefs % True if xref values are known. +\newif\ifwarnedxrefs % True if we warned once that they aren't known. + +% \setref{foo} defines a cross-reference point named foo. + +\def\setref#1{% +%\dosetq{#1-title}{Ytitle}% +\dosetq{#1-pg}{Ypagenumber}% +\dosetq{#1-snt}{Ysectionnumberandtype}} + +\def\unnumbsetref#1{% +%\dosetq{#1-title}{Ytitle}% +\dosetq{#1-pg}{Ypagenumber}% +\dosetq{#1-snt}{Ynothing}} + +\def\appendixsetref#1{% +%\dosetq{#1-title}{Ytitle}% +\dosetq{#1-pg}{Ypagenumber}% +\dosetq{#1-snt}{Yappendixletterandtype}} + +% \xref, \pxref, and \ref generate cross-references to specified points. +% For \xrefX, #1 is the node name, #2 the name of the Info +% cross-reference, #3 the printed node name, #4 the name of the Info +% file, #5 the name of the printed manual. All but the node name can be +% omitted. +% +\def\pxref#1{see \xrefX[#1,,,,,,,]} +\def\xref#1{See \xrefX[#1,,,,,,,]} +\def\ref#1{\xrefX[#1,,,,,,,]} +\def\xrefX[#1,#2,#3,#4,#5,#6]{\begingroup% +\def\printedmanual{\ignorespaces #5}% +\def\printednodename{\ignorespaces #3}% +% +\setbox1=\hbox{\printedmanual}% +\setbox0=\hbox{\printednodename}% +\ifdim \wd0=0pt% +\def\printednodename{\ignorespaces #1}% +%%% Uncommment the following line to make the actual chapter or section title +%%% appear inside the square brackets. +%\def\printednodename{#1-title}% +\fi% +% +% +% If we use \unhbox0 and \unhbox1 to print the node names, TeX does +% not insert empty discretionaries after hyphens, which means that it +% will not find a line break at a hyphen in a node names. Since some +% manuals are best written with fairly long node names, containing +% hyphens, this is a loss. Therefore, we simply give the text of +% the node name again, so it is as if TeX is seeing it for the first +% time. +\ifdim \wd1>0pt +section ``\printednodename'' in \cite{\printedmanual}% +\else% +\turnoffactive% +\refx{#1-snt}{} [\printednodename], page\tie\refx{#1-pg}{}% +\fi +\endgroup} + +% \dosetq is the interface for calls from other macros + +% Use \turnoffactive so that punctuation chars such as underscore +% work in node names. +\def\dosetq #1#2{{\let\folio=0 \turnoffactive% +\edef\next{\write\auxfile{\internalsetq {#1}{#2}}}% +\next}} + +% \internalsetq {foo}{page} expands into +% CHARACTERS 'xrdef {foo}{...expansion of \Ypage...} +% When the aux file is read, ' is the escape character + +\def\internalsetq #1#2{'xrdef {#1}{\csname #2\endcsname}} + +% Things to be expanded by \internalsetq + +\def\Ypagenumber{\folio} + +\def\Ytitle{\thischapter} + +\def\Ynothing{} + +\def\Ysectionnumberandtype{% +\ifnum\secno=0 Chapter\xreftie\the\chapno % +\else \ifnum \subsecno=0 Section\xreftie\the\chapno.\the\secno % +\else \ifnum \subsubsecno=0 % +Section\xreftie\the\chapno.\the\secno.\the\subsecno % +\else % +Section\xreftie\the\chapno.\the\secno.\the\subsecno.\the\subsubsecno % +\fi \fi \fi } + +\def\Yappendixletterandtype{% +\ifnum\secno=0 Appendix\xreftie'char\the\appendixno{}% +\else \ifnum \subsecno=0 Section\xreftie'char\the\appendixno.\the\secno % +\else \ifnum \subsubsecno=0 % +Section\xreftie'char\the\appendixno.\the\secno.\the\subsecno % +\else % +Section\xreftie'char\the\appendixno.\the\secno.\the\subsecno.\the\subsubsecno % +\fi \fi \fi } + +\gdef\xreftie{'tie} + +% Use TeX 3.0's \inputlineno to get the line number, for better error +% messages, but if we're using an old version of TeX, don't do anything. +% +\ifx\inputlineno\thisisundefined + \let\linenumber = \empty % Non-3.0. +\else + \def\linenumber{\the\inputlineno:\space} +\fi + +% Define \refx{NAME}{SUFFIX} to reference a cross-reference string named NAME. +% If its value is nonempty, SUFFIX is output afterward. + +\def\refx#1#2{% + \expandafter\ifx\csname X#1\endcsname\relax + % If not defined, say something at least. + $\langle$un\-de\-fined$\rangle$% + \ifhavexrefs + \message{\linenumber Undefined cross reference `#1'.}% + \else + \ifwarnedxrefs\else + \global\warnedxrefstrue + \message{Cross reference values unknown; you must run TeX again.}% + \fi + \fi + \else + % It's defined, so just use it. + \csname X#1\endcsname + \fi + #2% Output the suffix in any case. +} + +% Read the last existing aux file, if any. No error if none exists. + +% This is the macro invoked by entries in the aux file. +\def\xrdef #1#2{ +{\catcode`\'=\other\expandafter \gdef \csname X#1\endcsname {#2}}} + +\def\readauxfile{% +\begingroup +\catcode `\^^@=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\^^C=\other +\catcode `\^^D=\other +\catcode `\^^E=\other +\catcode `\^^F=\other +\catcode `\^^G=\other +\catcode `\^^H=\other +\catcode `\ =\other +\catcode `\^^L=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode `\=\other +\catcode 26=\other +\catcode `\^^[=\other +\catcode `\^^\=\other +\catcode `\^^]=\other +\catcode `\^^^=\other +\catcode `\^^_=\other +\catcode `\@=\other +\catcode `\^=\other +\catcode `\~=\other +\catcode `\[=\other +\catcode `\]=\other +\catcode`\"=\other +\catcode`\_=\other +\catcode`\|=\other +\catcode`\<=\other +\catcode`\>=\other +\catcode `\$=\other +\catcode `\#=\other +\catcode `\&=\other +% `\+ does not work, so use 43. +\catcode 43=\other +% the aux file uses ' as the escape. +% Turn off \ as an escape so we do not lose on +% entries which were dumped with control sequences in their names. +% For example, 'xrdef {$\leq $-fun}{page ...} made by @defun ^^ +% Reference to such entries still does not work the way one would wish, +% but at least they do not bomb out when the aux file is read in. +\catcode `\{=1 \catcode `\}=2 +\catcode `\%=\other +\catcode `\'=0 +\catcode `\\=\other +\openin 1 \jobname.aux +\ifeof 1 \else \closein 1 \input \jobname.aux \global\havexrefstrue +\global\warnedobstrue +\fi +% Open the new aux file. Tex will close it automatically at exit. +\openout \auxfile=\jobname.aux +\endgroup} + + +% Footnotes. + +\newcount \footnoteno + +% The trailing space in the following definition for supereject is +% vital for proper filling; pages come out unaligned when you do a +% pagealignmacro call if that space before the closing brace is +% removed. +\def\supereject{\par\penalty -20000\footnoteno =0 } + +% @footnotestyle is meaningful for info output only.. +\let\footnotestyle=\comment + +\let\ptexfootnote=\footnote + +{\catcode `\@=11 +% +% Auto-number footnotes. Otherwise like plain. +\gdef\footnote{% + \global\advance\footnoteno by \@ne + \edef\thisfootno{$^{\the\footnoteno}$}% + % + % In case the footnote comes at the end of a sentence, preserve the + % extra spacing after we do the footnote number. + \let\@sf\empty + \ifhmode\edef\@sf{\spacefactor\the\spacefactor}\/\fi + % + % Remove inadvertent blank space before typesetting the footnote number. + \unskip + \thisfootno\@sf + \footnotezzz +}% + +% Don't bother with the trickery in plain.tex to not require the +% footnote text as a parameter. Our footnotes don't need to be so general. +% +\long\gdef\footnotezzz#1{\insert\footins{% + % We want to typeset this text as a normal paragraph, even if the + % footnote reference occurs in (for example) a display environment. + % So reset some parameters. + \interlinepenalty\interfootnotelinepenalty + \splittopskip\ht\strutbox % top baseline for broken footnotes + \splitmaxdepth\dp\strutbox + \floatingpenalty\@MM + \leftskip\z@skip + \rightskip\z@skip + \spaceskip\z@skip + \xspaceskip\z@skip + \parindent\defaultparindent + % + % Hang the footnote text off the number. + \hang + \textindent{\thisfootno}% + % + % Don't crash into the line above the footnote text. Since this + % expands into a box, it must come within the paragraph, lest it + % provide a place where TeX can split the footnote. + \footstrut + #1\strut}% +} + +}%end \catcode `\@=11 + +% Set the baselineskip to #1, and the lineskip and strut size +% correspondingly. There is no deep meaning behind these magic numbers +% used as factors; they just match (closely enough) what Knuth defined. +% +\def\lineskipfactor{.08333} +\def\strutheightpercent{.70833} +\def\strutdepthpercent {.29167} +% +\def\setleading#1{% + \normalbaselineskip = #1\relax + \normallineskip = \lineskipfactor\normalbaselineskip + \normalbaselines + \setbox\strutbox =\hbox{% + \vrule width0pt height\strutheightpercent\baselineskip + depth \strutdepthpercent \baselineskip + }% +} + +% @| inserts a changebar to the left of the current line. It should +% surround any changed text. This approach does *not* work if the +% change spans more than two lines of output. To handle that, we would +% have adopt a much more difficult approach (putting marks into the main +% vertical list for the beginning and end of each change). +% +\def\|{% + % \vadjust can only be used in horizontal mode. + \leavevmode + % + % Append this vertical mode material after the current line in the output. + \vadjust{% + % We want to insert a rule with the height and depth of the current + % leading; that is exactly what \strutbox is supposed to record. + \vskip-\baselineskip + % + % \vadjust-items are inserted at the left edge of the type. So + % the \llap here moves out into the left-hand margin. + \llap{% + % + % For a thicker or thinner bar, change the `1pt'. + \vrule height\baselineskip width1pt + % + % This is the space between the bar and the text. + \hskip 12pt + }% + }% +} + +% For a final copy, take out the rectangles +% that mark overfull boxes (in case you have decided +% that the text looks ok even though it passes the margin). +% +\def\finalout{\overfullrule=0pt} + + +% End of control word definitions. + +\message{and turning on texinfo input format.} + +\def\openindices{% + \newindex{cp}% + \newcodeindex{fn}% + \newcodeindex{vr}% + \newcodeindex{tp}% + \newcodeindex{ky}% + \newcodeindex{pg}% +} + +% Set some numeric style parameters, for 8.5 x 11 format. + +%\hsize = 6.5in +\newdimen\defaultparindent \defaultparindent = 15pt +\parindent = \defaultparindent +\parskip 18pt plus 1pt +\setleading{15pt} +\advance\topskip by 1.2cm + +% Prevent underfull vbox error messages. +\vbadness=10000 + +% Following George Bush, just get rid of widows and orphans. +\widowpenalty=10000 +\clubpenalty=10000 + +% Use TeX 3.0's \emergencystretch to help line breaking, but if we're +% using an old version of TeX, don't do anything. We want the amount of +% stretch added to depend on the line length, hence the dependence on +% \hsize. This makes it come to about 9pt for the 8.5x11 format. +% +\ifx\emergencystretch\thisisundefined + % Allow us to assign to \emergencystretch anyway. + \def\emergencystretch{\dimen0}% +\else + \emergencystretch = \hsize + \divide\emergencystretch by 45 +\fi + +% Use @smallbook to reset parameters for 7x9.5 format (or else 7x9.25) +\def\smallbook{ + +% These values for secheadingskip and subsecheadingskip are +% experiments. RJC 7 Aug 1992 +\global\secheadingskip = 17pt plus 6pt minus 3pt +\global\subsecheadingskip = 14pt plus 6pt minus 3pt + +\global\lispnarrowing = 0.3in +\setleading{12pt} +\advance\topskip by -1cm +\global\parskip 3pt plus 1pt +\global\hsize = 5in +\global\vsize=7.5in +\global\tolerance=700 +\global\hfuzz=1pt +\global\contentsrightmargin=0pt + +\global\pagewidth=\hsize +\global\pageheight=\vsize + +\global\let\smalllisp=\smalllispx +\global\let\smallexample=\smalllispx +\global\def\Esmallexample{\Esmalllisp} +} + +% Use @afourpaper to print on European A4 paper. +\def\afourpaper{ +\global\tolerance=700 +\global\hfuzz=1pt +\setleading{12pt} +\global\parskip 15pt plus 1pt + +\global\vsize= 53\baselineskip +\advance\vsize by \topskip +%\global\hsize= 5.85in % A4 wide 10pt +\global\hsize= 6.5in +\global\outerhsize=\hsize +\global\advance\outerhsize by 0.5in +\global\outervsize=\vsize +\global\advance\outervsize by 0.6in + +\global\pagewidth=\hsize +\global\pageheight=\vsize +} + +% Define macros to output various characters with catcode for normal text. +\catcode`\"=\other +\catcode`\~=\other +\catcode`\^=\other +\catcode`\_=\other +\catcode`\|=\other +\catcode`\<=\other +\catcode`\>=\other +\catcode`\+=\other +\def\normaldoublequote{"} +\def\normaltilde{~} +\def\normalcaret{^} +\def\normalunderscore{_} +\def\normalverticalbar{|} +\def\normalless{<} +\def\normalgreater{>} +\def\normalplus{+} + +% This macro is used to make a character print one way in ttfont +% where it can probably just be output, and another way in other fonts, +% where something hairier probably needs to be done. +% +% #1 is what to print if we are indeed using \tt; #2 is what to print +% otherwise. Since all the Computer Modern typewriter fonts have zero +% interword stretch (and shrink), and it is reasonable to expect all +% typewriter fonts to have this, we can check that font parameter. +% +\def\ifusingtt#1#2{\ifdim \fontdimen3\the\font=0pt #1\else #2\fi} + +% Turn off all special characters except @ +% (and those which the user can use as if they were ordinary). +% Most of these we simply print from the \tt font, but for some, we can +% use math or other variants that look better in normal text. + +\catcode`\"=\active +\def\activedoublequote{{\tt \char '042}} +\let"=\activedoublequote +\catcode`\~=\active +\def~{{\tt \char '176}} +\chardef\hat=`\^ +\catcode`\^=\active +\def^{{\tt \hat}} + +\catcode`\_=\active +\def_{\ifusingtt\normalunderscore\_} +% Subroutine for the previous macro. +\def\_{\lvvmode \kern.06em \vbox{\hrule width.3em height.1ex}} + +% \lvvmode is equivalent in function to \leavevmode. +% Using \leavevmode runs into trouble when written out to +% an index file due to the expansion of \leavevmode into ``\unhbox +% \voidb@x'' ---which looks to TeX like ``\unhbox \voidb\x'' due to our +% magic tricks with @. +\def\lvvmode{\vbox to 0pt{}} + +\catcode`\|=\active +\def|{{\tt \char '174}} +\chardef \less=`\< +\catcode`\<=\active +\def<{{\tt \less}} +\chardef \gtr=`\> +\catcode`\>=\active +\def>{{\tt \gtr}} +\catcode`\+=\active +\def+{{\tt \char 43}} +%\catcode 27=\active +%\def^^[{$\diamondsuit$} + +% Used sometimes to turn off (effectively) the active characters +% even after parsing them. +\def\turnoffactive{\let"=\normaldoublequote +\let~=\normaltilde +\let^=\normalcaret +\let_=\normalunderscore +\let|=\normalverticalbar +\let<=\normalless +\let>=\normalgreater +\let+=\normalplus} + +% Set up an active definition for =, but don't enable it most of the time. +{\catcode`\==\active +\global\def={{\tt \char 61}}} + +\catcode`\@=0 + +% \rawbackslashxx output one backslash character in current font +\global\chardef\rawbackslashxx=`\\ +%{\catcode`\\=\other +%@gdef@rawbackslashxx{\}} + +% \rawbackslash redefines \ as input to do \rawbackslashxx. +{\catcode`\\=\active +@gdef@rawbackslash{@let\=@rawbackslashxx }} + +% \normalbackslash outputs one backslash in fixed width font. +\def\normalbackslash{{\tt\rawbackslashxx}} + +% Say @foo, not \foo, in error messages. +\escapechar=`\@ + +% \catcode 17=0 % Define control-q +\catcode`\\=\active + +% If a .fmt file is being used, we don't want the `\input texinfo' to show up. +% That is what \eatinput is for; after that, the `\' should revert to printing +% a backslash. +% +@gdef@eatinput input texinfo{@fixbackslash} +@global@let\ = @eatinput + +% On the other hand, perhaps the file did not have a `\input texinfo'. Then +% the first `\{ in the file would cause an error. This macro tries to fix +% that, assuming it is called before the first `\' could plausibly occur. +% +@gdef@fixbackslash{@ifx\@eatinput @let\ = @normalbackslash @fi} + +%% These look ok in all fonts, so just make them not special. The @rm below +%% makes sure that the current font starts out as the newly loaded cmr10 +@catcode`@$=@other @catcode`@%=@other @catcode`@&=@other @catcode`@#=@other + +@textfonts +@rm + +@c Local variables: +@c page-delimiter: "^\\\\message" +@c End: diff --git a/emacs_keymap.c b/emacs_keymap.c new file mode 100644 index 0000000..849d85f --- /dev/null +++ b/emacs_keymap.c @@ -0,0 +1,885 @@ +/* emacs_keymap.c -- the keymap for emacs_mode in readline (). */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (BUFSIZ) +#include +#endif /* !BUFSIZ */ + +#include "readline.h" + +/* An array of function pointers, one for each possible key. + If the type byte is ISKMAP, then the pointer is the address of + a keymap. */ + +KEYMAP_ENTRY_ARRAY emacs_standard_keymap = { + + /* Control keys. */ + { ISFUNC, (Function *)0x0 }, /* Control-@ */ + { ISFUNC, rl_beg_of_line }, /* Control-a */ + { ISFUNC, rl_backward }, /* Control-b */ + { ISFUNC, (Function *)0x0 }, /* Control-c */ + { ISFUNC, rl_delete }, /* Control-d */ + { ISFUNC, rl_end_of_line }, /* Control-e */ + { ISFUNC, rl_forward }, /* Control-f */ + { ISFUNC, rl_abort }, /* Control-g */ + { ISFUNC, rl_rubout }, /* Control-h */ + { ISFUNC, rl_complete }, /* Control-i */ + { ISFUNC, rl_newline }, /* Control-j */ + { ISFUNC, rl_kill_line }, /* Control-k */ + { ISFUNC, rl_clear_screen }, /* Control-l */ + { ISFUNC, rl_newline }, /* Control-m */ + { ISFUNC, rl_get_next_history }, /* Control-n */ + { ISFUNC, (Function *)0x0 }, /* Control-o */ + { ISFUNC, rl_get_previous_history }, /* Control-p */ + { ISFUNC, rl_quoted_insert }, /* Control-q */ + { ISFUNC, rl_reverse_search_history }, /* Control-r */ + { ISFUNC, rl_forward_search_history }, /* Control-s */ + { ISFUNC, rl_transpose_chars }, /* Control-t */ + { ISFUNC, rl_unix_line_discard }, /* Control-u */ + { ISFUNC, rl_quoted_insert }, /* Control-v */ + { ISFUNC, rl_unix_word_rubout }, /* Control-w */ + { ISKMAP, (Function *)emacs_ctlx_keymap }, /* Control-x */ + { ISFUNC, rl_yank }, /* Control-y */ + { ISFUNC, (Function *)0x0 }, /* Control-z */ + { ISKMAP, (Function *)emacs_meta_keymap }, /* Control-[ */ + { ISFUNC, (Function *)0x0 }, /* Control-\ */ + { ISFUNC, (Function *)0x0 }, /* Control-] */ + { ISFUNC, (Function *)0x0 }, /* Control-^ */ + { ISFUNC, rl_undo_command }, /* Control-_ */ + + /* The start of printing characters. */ + { ISFUNC, rl_insert }, /* SPACE */ + { ISFUNC, rl_insert }, /* ! */ + { ISFUNC, rl_insert }, /* " */ + { ISFUNC, rl_insert }, /* # */ + { ISFUNC, rl_insert }, /* $ */ + { ISFUNC, rl_insert }, /* % */ + { ISFUNC, rl_insert }, /* & */ + { ISFUNC, rl_insert }, /* ' */ + { ISFUNC, rl_insert }, /* ( */ +#if defined (PAREN_MATCHING) + { ISFUNC, rl_insert_close }, /* ) */ +#else + { ISFUNC, rl_insert }, /* ) */ +#endif /* !PAREN_MATCHING */ + { ISFUNC, rl_insert }, /* * */ + { ISFUNC, rl_insert }, /* + */ + { ISFUNC, rl_insert }, /* , */ + { ISFUNC, rl_insert }, /* - */ + { ISFUNC, rl_insert }, /* . */ + { ISFUNC, rl_insert }, /* / */ + + /* Regular digits. */ + { ISFUNC, rl_insert }, /* 0 */ + { ISFUNC, rl_insert }, /* 1 */ + { ISFUNC, rl_insert }, /* 2 */ + { ISFUNC, rl_insert }, /* 3 */ + { ISFUNC, rl_insert }, /* 4 */ + { ISFUNC, rl_insert }, /* 5 */ + { ISFUNC, rl_insert }, /* 6 */ + { ISFUNC, rl_insert }, /* 7 */ + { ISFUNC, rl_insert }, /* 8 */ + { ISFUNC, rl_insert }, /* 9 */ + + /* A little more punctuation. */ + { ISFUNC, rl_insert }, /* : */ + { ISFUNC, rl_insert }, /* ; */ + { ISFUNC, rl_insert }, /* < */ + { ISFUNC, rl_insert }, /* = */ + { ISFUNC, rl_insert }, /* > */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* @ */ + + /* Uppercase alphabet. */ + { ISFUNC, rl_insert }, /* A */ + { ISFUNC, rl_insert }, /* B */ + { ISFUNC, rl_insert }, /* C */ + { ISFUNC, rl_insert }, /* D */ + { ISFUNC, rl_insert }, /* E */ + { ISFUNC, rl_insert }, /* F */ + { ISFUNC, rl_insert }, /* G */ + { ISFUNC, rl_insert }, /* H */ + { ISFUNC, rl_insert }, /* I */ + { ISFUNC, rl_insert }, /* J */ + { ISFUNC, rl_insert }, /* K */ + { ISFUNC, rl_insert }, /* L */ + { ISFUNC, rl_insert }, /* M */ + { ISFUNC, rl_insert }, /* N */ + { ISFUNC, rl_insert }, /* O */ + { ISFUNC, rl_insert }, /* P */ + { ISFUNC, rl_insert }, /* Q */ + { ISFUNC, rl_insert }, /* R */ + { ISFUNC, rl_insert }, /* S */ + { ISFUNC, rl_insert }, /* T */ + { ISFUNC, rl_insert }, /* U */ + { ISFUNC, rl_insert }, /* V */ + { ISFUNC, rl_insert }, /* W */ + { ISFUNC, rl_insert }, /* X */ + { ISFUNC, rl_insert }, /* Y */ + { ISFUNC, rl_insert }, /* Z */ + + /* Some more punctuation. */ + { ISFUNC, rl_insert }, /* [ */ + { ISFUNC, rl_insert }, /* \ */ +#if defined (PAREN_MATCHING) + { ISFUNC, rl_insert_close }, /* ] */ +#else + { ISFUNC, rl_insert }, /* ] */ +#endif /* !PAREN_MATCHING */ + { ISFUNC, rl_insert }, /* ^ */ + { ISFUNC, rl_insert }, /* _ */ + { ISFUNC, rl_insert }, /* ` */ + + /* Lowercase alphabet. */ + { ISFUNC, rl_insert }, /* a */ + { ISFUNC, rl_insert }, /* b */ + { ISFUNC, rl_insert }, /* c */ + { ISFUNC, rl_insert }, /* d */ + { ISFUNC, rl_insert }, /* e */ + { ISFUNC, rl_insert }, /* f */ + { ISFUNC, rl_insert }, /* g */ + { ISFUNC, rl_insert }, /* h */ + { ISFUNC, rl_insert }, /* i */ + { ISFUNC, rl_insert }, /* j */ + { ISFUNC, rl_insert }, /* k */ + { ISFUNC, rl_insert }, /* l */ + { ISFUNC, rl_insert }, /* m */ + { ISFUNC, rl_insert }, /* n */ + { ISFUNC, rl_insert }, /* o */ + { ISFUNC, rl_insert }, /* p */ + { ISFUNC, rl_insert }, /* q */ + { ISFUNC, rl_insert }, /* r */ + { ISFUNC, rl_insert }, /* s */ + { ISFUNC, rl_insert }, /* t */ + { ISFUNC, rl_insert }, /* u */ + { ISFUNC, rl_insert }, /* v */ + { ISFUNC, rl_insert }, /* w */ + { ISFUNC, rl_insert }, /* x */ + { ISFUNC, rl_insert }, /* y */ + { ISFUNC, rl_insert }, /* z */ + + /* Final punctuation. */ + { ISFUNC, rl_insert }, /* { */ + { ISFUNC, rl_insert }, /* | */ +#if defined (PAREN_MATCHING) + { ISFUNC, rl_insert_close }, /* } */ +#else + { ISFUNC, rl_insert }, /* } */ +#endif /* !PAREN_MATCHING */ + { ISFUNC, rl_insert }, /* ~ */ + { ISFUNC, rl_rubout }, /* RUBOUT */ + +#if KEYMAP_SIZE > 128 + /* Pure 8-bit characters (128 - 159). + These might be used in some + character sets. */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + + /* ISO Latin-1 characters (160 - 255) */ + { ISFUNC, rl_insert }, /* No-break space */ + { ISFUNC, rl_insert }, /* Inverted exclamation mark */ + { ISFUNC, rl_insert }, /* Cent sign */ + { ISFUNC, rl_insert }, /* Pound sign */ + { ISFUNC, rl_insert }, /* Currency sign */ + { ISFUNC, rl_insert }, /* Yen sign */ + { ISFUNC, rl_insert }, /* Broken bar */ + { ISFUNC, rl_insert }, /* Section sign */ + { ISFUNC, rl_insert }, /* Diaeresis */ + { ISFUNC, rl_insert }, /* Copyright sign */ + { ISFUNC, rl_insert }, /* Feminine ordinal indicator */ + { ISFUNC, rl_insert }, /* Left pointing double angle quotation mark */ + { ISFUNC, rl_insert }, /* Not sign */ + { ISFUNC, rl_insert }, /* Soft hyphen */ + { ISFUNC, rl_insert }, /* Registered sign */ + { ISFUNC, rl_insert }, /* Macron */ + { ISFUNC, rl_insert }, /* Degree sign */ + { ISFUNC, rl_insert }, /* Plus-minus sign */ + { ISFUNC, rl_insert }, /* Superscript two */ + { ISFUNC, rl_insert }, /* Superscript three */ + { ISFUNC, rl_insert }, /* Acute accent */ + { ISFUNC, rl_insert }, /* Micro sign */ + { ISFUNC, rl_insert }, /* Pilcrow sign */ + { ISFUNC, rl_insert }, /* Middle dot */ + { ISFUNC, rl_insert }, /* Cedilla */ + { ISFUNC, rl_insert }, /* Superscript one */ + { ISFUNC, rl_insert }, /* Masculine ordinal indicator */ + { ISFUNC, rl_insert }, /* Right pointing double angle quotation mark */ + { ISFUNC, rl_insert }, /* Vulgar fraction one quarter */ + { ISFUNC, rl_insert }, /* Vulgar fraction one half */ + { ISFUNC, rl_insert }, /* Vulgar fraction three quarters */ + { ISFUNC, rl_insert }, /* Inverted questionk mark */ + { ISFUNC, rl_insert }, /* Latin capital letter a with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter a with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter a with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter a with tilde */ + { ISFUNC, rl_insert }, /* Latin capital letter a with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter a with ring above */ + { ISFUNC, rl_insert }, /* Latin capital letter ae */ + { ISFUNC, rl_insert }, /* Latin capital letter c with cedilla */ + { ISFUNC, rl_insert }, /* Latin capital letter e with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter e with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter e with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter e with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter i with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter i with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter i with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter i with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter eth (Icelandic) */ + { ISFUNC, rl_insert }, /* Latin capital letter n with tilde */ + { ISFUNC, rl_insert }, /* Latin capital letter o with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter o with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter o with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter o with tilde */ + { ISFUNC, rl_insert }, /* Latin capital letter o with diaeresis */ + { ISFUNC, rl_insert }, /* Multiplication sign */ + { ISFUNC, rl_insert }, /* Latin capital letter o with stroke */ + { ISFUNC, rl_insert }, /* Latin capital letter u with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter u with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter u with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter u with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter Y with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter thorn (Icelandic) */ + { ISFUNC, rl_insert }, /* Latin small letter sharp s (German) */ + { ISFUNC, rl_insert }, /* Latin small letter a with grave */ + { ISFUNC, rl_insert }, /* Latin small letter a with acute */ + { ISFUNC, rl_insert }, /* Latin small letter a with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter a with tilde */ + { ISFUNC, rl_insert }, /* Latin small letter a with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter a with ring above */ + { ISFUNC, rl_insert }, /* Latin small letter ae */ + { ISFUNC, rl_insert }, /* Latin small letter c with cedilla */ + { ISFUNC, rl_insert }, /* Latin small letter e with grave */ + { ISFUNC, rl_insert }, /* Latin small letter e with acute */ + { ISFUNC, rl_insert }, /* Latin small letter e with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter e with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter i with grave */ + { ISFUNC, rl_insert }, /* Latin small letter i with acute */ + { ISFUNC, rl_insert }, /* Latin small letter i with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter i with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter eth (Icelandic) */ + { ISFUNC, rl_insert }, /* Latin small letter n with tilde */ + { ISFUNC, rl_insert }, /* Latin small letter o with grave */ + { ISFUNC, rl_insert }, /* Latin small letter o with acute */ + { ISFUNC, rl_insert }, /* Latin small letter o with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter o with tilde */ + { ISFUNC, rl_insert }, /* Latin small letter o with diaeresis */ + { ISFUNC, rl_insert }, /* Division sign */ + { ISFUNC, rl_insert }, /* Latin small letter o with stroke */ + { ISFUNC, rl_insert }, /* Latin small letter u with grave */ + { ISFUNC, rl_insert }, /* Latin small letter u with acute */ + { ISFUNC, rl_insert }, /* Latin small letter u with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter u with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter y with acute */ + { ISFUNC, rl_insert }, /* Latin small letter thorn (Icelandic) */ + { ISFUNC, rl_insert } /* Latin small letter y with diaeresis */ +#endif /* KEYMAP_SIZE > 128 */ +}; + +KEYMAP_ENTRY_ARRAY emacs_meta_keymap = { + + /* Meta keys. Just like above, but the high bit is set. */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-@ */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-a */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-b */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-c */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-d */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-e */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-f */ + { ISFUNC, rl_abort }, /* Meta-Control-g */ + { ISFUNC, rl_backward_kill_word }, /* Meta-Control-h */ + { ISFUNC, rl_tab_insert }, /* Meta-Control-i */ + { ISFUNC, rl_vi_editing_mode }, /* Meta-Control-j */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-k */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-l */ + { ISFUNC, rl_vi_editing_mode }, /* Meta-Control-m */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-n */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-o */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-p */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-q */ + { ISFUNC, rl_revert_line }, /* Meta-Control-r */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-s */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-t */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-u */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-v */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-w */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-x */ + { ISFUNC, rl_yank_nth_arg }, /* Meta-Control-y */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-z */ + + { ISFUNC, rl_complete }, /* Meta-Control-[ */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-\ */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-] */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-^ */ + { ISFUNC, (Function *)0x0 }, /* Meta-Control-_ */ + + /* The start of printing characters. */ + { ISFUNC, (Function *)0x0 }, /* Meta-SPACE */ + { ISFUNC, (Function *)0x0 }, /* Meta-! */ + { ISFUNC, (Function *)0x0 }, /* Meta-" */ + { ISFUNC, (Function *)0x0 }, /* Meta-# */ + { ISFUNC, (Function *)0x0 }, /* Meta-$ */ + { ISFUNC, (Function *)0x0 }, /* Meta-% */ + { ISFUNC, rl_tilde_expand }, /* Meta-& */ + { ISFUNC, (Function *)0x0 }, /* Meta-' */ + { ISFUNC, (Function *)0x0 }, /* Meta-( */ + { ISFUNC, (Function *)0x0 }, /* Meta-) */ + { ISFUNC, (Function *)0x0 }, /* Meta-* */ + { ISFUNC, (Function *)0x0 }, /* Meta-+ */ + { ISFUNC, (Function *)0x0 }, /* Meta-, */ + { ISFUNC, rl_digit_argument }, /* Meta-- */ + { ISFUNC, rl_yank_last_arg}, /* Meta-. */ + { ISFUNC, (Function *)0x0 }, /* Meta-/ */ + + /* Regular digits. */ + { ISFUNC, rl_digit_argument }, /* Meta-0 */ + { ISFUNC, rl_digit_argument }, /* Meta-1 */ + { ISFUNC, rl_digit_argument }, /* Meta-2 */ + { ISFUNC, rl_digit_argument }, /* Meta-3 */ + { ISFUNC, rl_digit_argument }, /* Meta-4 */ + { ISFUNC, rl_digit_argument }, /* Meta-5 */ + { ISFUNC, rl_digit_argument }, /* Meta-6 */ + { ISFUNC, rl_digit_argument }, /* Meta-7 */ + { ISFUNC, rl_digit_argument }, /* Meta-8 */ + { ISFUNC, rl_digit_argument }, /* Meta-9 */ + + /* A little more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* Meta-: */ + { ISFUNC, (Function *)0x0 }, /* Meta-; */ + { ISFUNC, rl_beginning_of_history }, /* Meta-< */ + { ISFUNC, (Function *)0x0 }, /* Meta-= */ + { ISFUNC, rl_end_of_history }, /* Meta-> */ + { ISFUNC, rl_possible_completions }, /* Meta-? */ + { ISFUNC, (Function *)0x0 }, /* Meta-@ */ + + /* Uppercase alphabet. */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-A */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-B */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-C */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-D */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-E */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-F */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-G */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-H */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-I */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-J */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-K */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-L */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-M */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-N */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-O */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-P */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-Q */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-R */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-S */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-T */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-U */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-V */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-W */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-X */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-Y */ + { ISFUNC, rl_do_lowercase_version }, /* Meta-Z */ + + /* Some more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* Meta-[ */ /* was rl_arrow_keys */ + { ISFUNC, rl_delete_horizontal_space }, /* Meta-\ */ + { ISFUNC, (Function *)0x0 }, /* Meta-] */ + { ISFUNC, (Function *)0x0 }, /* Meta-^ */ + { ISFUNC, rl_yank_last_arg }, /* Meta-_ */ + { ISFUNC, (Function *)0x0 }, /* Meta-` */ + + /* Lowercase alphabet. */ + { ISFUNC, (Function *)0x0 }, /* Meta-a */ + { ISFUNC, rl_backward_word }, /* Meta-b */ + { ISFUNC, rl_capitalize_word }, /* Meta-c */ + { ISFUNC, rl_kill_word }, /* Meta-d */ + { ISFUNC, (Function *)0x0 }, /* Meta-e */ + { ISFUNC, rl_forward_word }, /* Meta-f */ + { ISFUNC, (Function *)0x0 }, /* Meta-g */ + { ISFUNC, (Function *)0x0 }, /* Meta-h */ + { ISFUNC, (Function *)0x0 }, /* Meta-i */ + { ISFUNC, (Function *)0x0 }, /* Meta-j */ + { ISFUNC, (Function *)0x0 }, /* Meta-k */ + { ISFUNC, rl_downcase_word }, /* Meta-l */ + { ISFUNC, (Function *)0x0 }, /* Meta-m */ + { ISFUNC, rl_noninc_forward_search }, /* Meta-n */ + { ISFUNC, (Function *)0x0 }, /* Meta-o */ /* was rl_arrow_keys */ + { ISFUNC, rl_noninc_reverse_search }, /* Meta-p */ + { ISFUNC, (Function *)0x0 }, /* Meta-q */ + { ISFUNC, rl_revert_line }, /* Meta-r */ + { ISFUNC, (Function *)0x0 }, /* Meta-s */ + { ISFUNC, rl_transpose_words }, /* Meta-t */ + { ISFUNC, rl_upcase_word }, /* Meta-u */ + { ISFUNC, (Function *)0x0 }, /* Meta-v */ + { ISFUNC, (Function *)0x0 }, /* Meta-w */ + { ISFUNC, (Function *)0x0 }, /* Meta-x */ + { ISFUNC, rl_yank_pop }, /* Meta-y */ + { ISFUNC, (Function *)0x0 }, /* Meta-z */ + + /* Final punctuation. */ + { ISFUNC, (Function *)0x0 }, /* Meta-{ */ + { ISFUNC, (Function *)0x0 }, /* Meta-| */ + { ISFUNC, (Function *)0x0 }, /* Meta-} */ + { ISFUNC, rl_tilde_expand }, /* Meta-~ */ + { ISFUNC, rl_backward_kill_word }, /* Meta-rubout */ + +#if KEYMAP_SIZE > 128 + /* Undefined keys. */ + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 } +#endif /* KEYMAP_SIZE > 128 */ +}; + +KEYMAP_ENTRY_ARRAY emacs_ctlx_keymap = { + + /* Control keys. */ + { ISFUNC, (Function *)0x0 }, /* Control-@ */ + { ISFUNC, (Function *)0x0 }, /* Control-a */ + { ISFUNC, (Function *)0x0 }, /* Control-b */ + { ISFUNC, (Function *)0x0 }, /* Control-c */ + { ISFUNC, (Function *)0x0 }, /* Control-d */ + { ISFUNC, (Function *)0x0 }, /* Control-e */ + { ISFUNC, (Function *)0x0 }, /* Control-f */ + { ISFUNC, rl_abort }, /* Control-g */ + { ISFUNC, (Function *)0x0 }, /* Control-h */ + { ISFUNC, (Function *)0x0 }, /* Control-i */ + { ISFUNC, (Function *)0x0 }, /* Control-j */ + { ISFUNC, (Function *)0x0 }, /* Control-k */ + { ISFUNC, (Function *)0x0 }, /* Control-l */ + { ISFUNC, (Function *)0x0 }, /* Control-m */ + { ISFUNC, (Function *)0x0 }, /* Control-n */ + { ISFUNC, (Function *)0x0 }, /* Control-o */ + { ISFUNC, (Function *)0x0 }, /* Control-p */ + { ISFUNC, (Function *)0x0 }, /* Control-q */ + { ISFUNC, rl_re_read_init_file }, /* Control-r */ + { ISFUNC, (Function *)0x0 }, /* Control-s */ + { ISFUNC, (Function *)0x0 }, /* Control-t */ + { ISFUNC, rl_undo_command }, /* Control-u */ + { ISFUNC, (Function *)0x0 }, /* Control-v */ + { ISFUNC, (Function *)0x0 }, /* Control-w */ + { ISFUNC, (Function *)0x0 }, /* Control-x */ + { ISFUNC, (Function *)0x0 }, /* Control-y */ + { ISFUNC, (Function *)0x0 }, /* Control-z */ + { ISFUNC, (Function *)0x0 }, /* Control-[ */ + { ISFUNC, (Function *)0x0 }, /* Control-\ */ + { ISFUNC, (Function *)0x0 }, /* Control-] */ + { ISFUNC, (Function *)0x0 }, /* Control-^ */ + { ISFUNC, (Function *)0x0 }, /* Control-_ */ + + /* The start of printing characters. */ + { ISFUNC, (Function *)0x0 }, /* SPACE */ + { ISFUNC, (Function *)0x0 }, /* ! */ + { ISFUNC, (Function *)0x0 }, /* " */ + { ISFUNC, (Function *)0x0 }, /* # */ + { ISFUNC, (Function *)0x0 }, /* $ */ + { ISFUNC, (Function *)0x0 }, /* % */ + { ISFUNC, (Function *)0x0 }, /* & */ + { ISFUNC, (Function *)0x0 }, /* ' */ + { ISFUNC, rl_start_kbd_macro }, /* ( */ + { ISFUNC, rl_end_kbd_macro }, /* ) */ + { ISFUNC, (Function *)0x0 }, /* * */ + { ISFUNC, (Function *)0x0 }, /* + */ + { ISFUNC, (Function *)0x0 }, /* , */ + { ISFUNC, (Function *)0x0 }, /* - */ + { ISFUNC, (Function *)0x0 }, /* . */ + { ISFUNC, (Function *)0x0 }, /* / */ + + /* Regular digits. */ + { ISFUNC, (Function *)0x0 }, /* 0 */ + { ISFUNC, (Function *)0x0 }, /* 1 */ + { ISFUNC, (Function *)0x0 }, /* 2 */ + { ISFUNC, (Function *)0x0 }, /* 3 */ + { ISFUNC, (Function *)0x0 }, /* 4 */ + { ISFUNC, (Function *)0x0 }, /* 5 */ + { ISFUNC, (Function *)0x0 }, /* 6 */ + { ISFUNC, (Function *)0x0 }, /* 7 */ + { ISFUNC, (Function *)0x0 }, /* 8 */ + { ISFUNC, (Function *)0x0 }, /* 9 */ + + /* A little more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* : */ + { ISFUNC, (Function *)0x0 }, /* ; */ + { ISFUNC, (Function *)0x0 }, /* < */ + { ISFUNC, (Function *)0x0 }, /* = */ + { ISFUNC, (Function *)0x0 }, /* > */ + { ISFUNC, (Function *)0x0 }, /* ? */ + { ISFUNC, (Function *)0x0 }, /* @ */ + + /* Uppercase alphabet. */ + { ISFUNC, rl_do_lowercase_version }, /* A */ + { ISFUNC, rl_do_lowercase_version }, /* B */ + { ISFUNC, rl_do_lowercase_version }, /* C */ + { ISFUNC, rl_do_lowercase_version }, /* D */ + { ISFUNC, rl_do_lowercase_version }, /* E */ + { ISFUNC, rl_do_lowercase_version }, /* F */ + { ISFUNC, rl_do_lowercase_version }, /* G */ + { ISFUNC, rl_do_lowercase_version }, /* H */ + { ISFUNC, rl_do_lowercase_version }, /* I */ + { ISFUNC, rl_do_lowercase_version }, /* J */ + { ISFUNC, rl_do_lowercase_version }, /* K */ + { ISFUNC, rl_do_lowercase_version }, /* L */ + { ISFUNC, rl_do_lowercase_version }, /* M */ + { ISFUNC, rl_do_lowercase_version }, /* N */ + { ISFUNC, rl_do_lowercase_version }, /* O */ + { ISFUNC, rl_do_lowercase_version }, /* P */ + { ISFUNC, rl_do_lowercase_version }, /* Q */ + { ISFUNC, rl_do_lowercase_version }, /* R */ + { ISFUNC, rl_do_lowercase_version }, /* S */ + { ISFUNC, rl_do_lowercase_version }, /* T */ + { ISFUNC, rl_do_lowercase_version }, /* U */ + { ISFUNC, rl_do_lowercase_version }, /* V */ + { ISFUNC, rl_do_lowercase_version }, /* W */ + { ISFUNC, rl_do_lowercase_version }, /* X */ + { ISFUNC, rl_do_lowercase_version }, /* Y */ + { ISFUNC, rl_do_lowercase_version }, /* Z */ + + /* Some more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* [ */ + { ISFUNC, (Function *)0x0 }, /* \ */ + { ISFUNC, (Function *)0x0 }, /* ] */ + { ISFUNC, (Function *)0x0 }, /* ^ */ + { ISFUNC, (Function *)0x0 }, /* _ */ + { ISFUNC, (Function *)0x0 }, /* ` */ + + /* Lowercase alphabet. */ + { ISFUNC, (Function *)0x0 }, /* a */ + { ISFUNC, (Function *)0x0 }, /* b */ + { ISFUNC, (Function *)0x0 }, /* c */ + { ISFUNC, (Function *)0x0 }, /* d */ + { ISFUNC, rl_call_last_kbd_macro }, /* e */ + { ISFUNC, (Function *)0x0 }, /* f */ + { ISFUNC, (Function *)0x0 }, /* g */ + { ISFUNC, (Function *)0x0 }, /* h */ + { ISFUNC, (Function *)0x0 }, /* i */ + { ISFUNC, (Function *)0x0 }, /* j */ + { ISFUNC, (Function *)0x0 }, /* k */ + { ISFUNC, (Function *)0x0 }, /* l */ + { ISFUNC, (Function *)0x0 }, /* m */ + { ISFUNC, (Function *)0x0 }, /* n */ + { ISFUNC, (Function *)0x0 }, /* o */ + { ISFUNC, (Function *)0x0 }, /* p */ + { ISFUNC, (Function *)0x0 }, /* q */ + { ISFUNC, (Function *)0x0 }, /* r */ + { ISFUNC, (Function *)0x0 }, /* s */ + { ISFUNC, (Function *)0x0 }, /* t */ + { ISFUNC, (Function *)0x0 }, /* u */ + { ISFUNC, (Function *)0x0 }, /* v */ + { ISFUNC, (Function *)0x0 }, /* w */ + { ISFUNC, (Function *)0x0 }, /* x */ + { ISFUNC, (Function *)0x0 }, /* y */ + { ISFUNC, (Function *)0x0 }, /* z */ + + /* Final punctuation. */ + { ISFUNC, (Function *)0x0 }, /* { */ + { ISFUNC, (Function *)0x0 }, /* | */ + { ISFUNC, (Function *)0x0 }, /* } */ + { ISFUNC, (Function *)0x0 }, /* ~ */ + { ISFUNC, rl_backward_kill_line }, /* RUBOUT */ + +#if KEYMAP_SIZE > 128 + /* Undefined keys. */ + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 } +#endif /* KEYMAP_SIZE > 128 */ +}; diff --git a/examples/Inputrc b/examples/Inputrc new file mode 100644 index 0000000..5b71bd7 --- /dev/null +++ b/examples/Inputrc @@ -0,0 +1,65 @@ +# My ~/.inputrc file is in -*- text -*- for easy editing with Emacs. +# +# Notice the various bindings which are conditionalized depending +# on which program is running, or what terminal is active. +# + +# In all programs, all terminals, make sure this is bound. +"\C-x\C-r": re-read-init-file + +# Hp terminals (and some others) have ugly default behaviour for C-h. +"\C-h": backward-delete-char +"\e\C-h": backward-kill-word +"\C-xd": dump-functions + +# In xterm windows, make the arrow keys do the right thing. +$if TERM=xterm +"\e[A": previous-history +"\e[B": next-history +"\e[C": forward-char +"\e[D": backward-char + +# alternate arrow key prefix +"\eOA": previous-history +"\eOB": next-history +"\eOC": forward-char +"\eOD": backward-char + +# Under Xterm in Bash, we bind local Function keys to do something useful. +$if Bash +"\e[11~": "Function Key 1" +"\e[12~": "Function Key 2" +"\e[13~": "Function Key 3" +"\e[14~": "Function Key 4" +"\e[15~": "Function Key 5" + +# I know the following escape sequence numbers are 1 greater than +# the function key. Don't ask me why, I didn't design the xterm terminal. +"\e[17~": "Function Key 6" +"\e[18~": "Function Key 7" +"\e[19~": "Function Key 8" +"\e[20~": "Function Key 9" +"\e[21~": "Function Key 10" +$endif +$endif + +# For Bash, all terminals, add some Bash specific hacks. +$if Bash +"\C-xv": show-bash-version +"\C-x\C-e": shell-expand-line + +# Here is one for editing my path. +"\C-xp": "$PATH\C-x\C-e\C-e\"\C-aPATH=\":\C-b" + +# Make C-x r read my mail in emacs. +# "\C-xr": "emacs -f rmail\C-j" +$endif + +# For FTP, different hacks: +$if Ftp +"\C-xg": "get \M-?" +"\C-xt": "put \M-?" +"\M-.": yank-last-arg +$endif + +" ": self-insert diff --git a/examples/Makefile b/examples/Makefile new file mode 100644 index 0000000..55ebffc --- /dev/null +++ b/examples/Makefile @@ -0,0 +1,12 @@ +# This is the Makefile for the examples subdirectory of readline. -*- text -*- +# + +EXECUTABLES = fileman +CFLAGS = -g -I.. +LDFLAGS = -g -L.. + +fileman: fileman.o + $(CC) $(LDFLAGS) -o fileman fileman.o -lreadline -ltermcap + +fileman.o: fileman.c + diff --git a/examples/fileman.c b/examples/fileman.c new file mode 100644 index 0000000..3ecb9f1 --- /dev/null +++ b/examples/fileman.c @@ -0,0 +1,425 @@ +/* fileman.c -- A tiny application which demonstrates how to use the + GNU Readline library. This application interactively allows users + to manipulate files and their modes. */ + +#include +#include +#include +#include +#include + +#include +#include + +extern char *getwd (); +extern char *xmalloc (); + +/* The names of functions that actually do the manipulation. */ +int com_list (), com_view (), com_rename (), com_stat (), com_pwd (); +int com_delete (), com_help (), com_cd (), com_quit (); + +/* A structure which contains information on the commands this program + can understand. */ + +typedef struct { + char *name; /* User printable name of the function. */ + Function *func; /* Function to call to do the job. */ + char *doc; /* Documentation for this function. */ +} COMMAND; + +COMMAND commands[] = { + { "cd", com_cd, "Change to directory DIR" }, + { "delete", com_delete, "Delete FILE" }, + { "help", com_help, "Display this text" }, + { "?", com_help, "Synonym for `help'" }, + { "list", com_list, "List files in DIR" }, + { "ls", com_list, "Synonym for `list'" }, + { "pwd", com_pwd, "Print the current working directory" }, + { "quit", com_quit, "Quit using Fileman" }, + { "rename", com_rename, "Rename FILE to NEWNAME" }, + { "stat", com_stat, "Print out statistics on FILE" }, + { "view", com_view, "View the contents of FILE" }, + { (char *)NULL, (Function *)NULL, (char *)NULL } +}; + +/* Forward declarations. */ +char *stripwhite (); +COMMAND *find_command (); + +/* The name of this program, as taken from argv[0]. */ +char *progname; + +/* When non-zero, this global means the user is done using this program. */ +int done; + +char * +dupstr (s) + int s; +{ + char *r; + + r = xmalloc (strlen (s) + 1); + strcpy (r, s); + return (r); +} + +main (argc, argv) + int argc; + char **argv; +{ + char *line, *s; + + progname = argv[0]; + + initialize_readline (); /* Bind our completer. */ + + /* Loop reading and executing lines until the user quits. */ + for ( ; done == 0; ) + { + line = readline ("FileMan: "); + + if (!line) + break; + + /* Remove leading and trailing whitespace from the line. + Then, if there is anything left, add it to the history list + and execute it. */ + s = stripwhite (line); + + if (*s) + { + add_history (s); + execute_line (s); + } + + free (line); + } + exit (0); +} + +/* Execute a command line. */ +int +execute_line (line) + char *line; +{ + register int i; + COMMAND *command; + char *word; + + /* Isolate the command word. */ + i = 0; + while (line[i] && whitespace (line[i])) + i++; + word = line + i; + + while (line[i] && !whitespace (line[i])) + i++; + + if (line[i]) + line[i++] = '\0'; + + command = find_command (word); + + if (!command) + { + fprintf (stderr, "%s: No such command for FileMan.\n", word); + return (-1); + } + + /* Get argument to command, if any. */ + while (whitespace (line[i])) + i++; + + word = line + i; + + /* Call the function. */ + return ((*(command->func)) (word)); +} + +/* Look up NAME as the name of a command, and return a pointer to that + command. Return a NULL pointer if NAME isn't a command name. */ +COMMAND * +find_command (name) + char *name; +{ + register int i; + + for (i = 0; commands[i].name; i++) + if (strcmp (name, commands[i].name) == 0) + return (&commands[i]); + + return ((COMMAND *)NULL); +} + +/* Strip whitespace from the start and end of STRING. Return a pointer + into STRING. */ +char * +stripwhite (string) + char *string; +{ + register char *s, *t; + + for (s = string; whitespace (*s); s++) + ; + + if (*s == 0) + return (s); + + t = s + strlen (s) - 1; + while (t > s && whitespace (*t)) + t--; + *++t = '\0'; + + return s; +} + +/* **************************************************************** */ +/* */ +/* Interface to Readline Completion */ +/* */ +/* **************************************************************** */ + +char *command_generator (); +char **fileman_completion (); + +/* Tell the GNU Readline library how to complete. We want to try to complete + on command names if this is the first word in the line, or on filenames + if not. */ +initialize_readline () +{ + /* Allow conditional parsing of the ~/.inputrc file. */ + rl_readline_name = "FileMan"; + + /* Tell the completer that we want a crack first. */ + rl_attempted_completion_function = (CPPFunction *)fileman_completion; +} + +/* Attempt to complete on the contents of TEXT. START and END show the + region of TEXT that contains the word to complete. We can use the + entire line in case we want to do some simple parsing. Return the + array of matches, or NULL if there aren't any. */ +char ** +fileman_completion (text, start, end) + char *text; + int start, end; +{ + char **matches; + + matches = (char **)NULL; + + /* If this word is at the start of the line, then it is a command + to complete. Otherwise it is the name of a file in the current + directory. */ + if (start == 0) + matches = completion_matches (text, command_generator); + + return (matches); +} + +/* Generator function for command completion. STATE lets us know whether + to start from scratch; without any state (i.e. STATE == 0), then we + start at the top of the list. */ +char * +command_generator (text, state) + char *text; + int state; +{ + static int list_index, len; + char *name; + + /* If this is a new word to complete, initialize now. This includes + saving the length of TEXT for efficiency, and initializing the index + variable to 0. */ + if (!state) + { + list_index = 0; + len = strlen (text); + } + + /* Return the next name which partially matches from the command list. */ + while (name = commands[list_index].name) + { + list_index++; + + if (strncmp (name, text, len) == 0) + return (dupstr(name)); + } + + /* If no names matched, then return NULL. */ + return ((char *)NULL); +} + +/* **************************************************************** */ +/* */ +/* FileMan Commands */ +/* */ +/* **************************************************************** */ + +/* String to pass to system (). This is for the LIST, VIEW and RENAME + commands. */ +static char syscom[1024]; + +/* List the file(s) named in arg. */ +com_list (arg) + char *arg; +{ + if (!arg) + arg = ""; + + sprintf (syscom, "ls -FClg %s", arg); + return (system (syscom)); +} + +com_view (arg) + char *arg; +{ + if (!valid_argument ("view", arg)) + return 1; + + sprintf (syscom, "more %s", arg); + return (system (syscom)); +} + +com_rename (arg) + char *arg; +{ + too_dangerous ("rename"); + return (1); +} + +com_stat (arg) + char *arg; +{ + struct stat finfo; + + if (!valid_argument ("stat", arg)) + return (1); + + if (stat (arg, &finfo) == -1) + { + perror (arg); + return (1); + } + + printf ("Statistics for `%s':\n", arg); + + printf ("%s has %d link%s, and is %d byte%s in length.\n", arg, + finfo.st_nlink, + (finfo.st_nlink == 1) ? "" : "s", + finfo.st_size, + (finfo.st_size == 1) ? "" : "s"); + printf ("Inode Last Change at: %s", ctime (&finfo.st_ctime)); + printf (" Last access at: %s", ctime (&finfo.st_atime)); + printf (" Last modified at: %s", ctime (&finfo.st_mtime)); + return (0); +} + +com_delete (arg) + char *arg; +{ + too_dangerous ("delete"); + return (1); +} + +/* Print out help for ARG, or for all of the commands if ARG is + not present. */ +com_help (arg) + char *arg; +{ + register int i; + int printed = 0; + + for (i = 0; commands[i].name; i++) + { + if (!*arg || (strcmp (arg, commands[i].name) == 0)) + { + printf ("%s\t\t%s.\n", commands[i].name, commands[i].doc); + printed++; + } + } + + if (!printed) + { + printf ("No commands match `%s'. Possibilties are:\n", arg); + + for (i = 0; commands[i].name; i++) + { + /* Print in six columns. */ + if (printed == 6) + { + printed = 0; + printf ("\n"); + } + + printf ("%s\t", commands[i].name); + printed++; + } + + if (printed) + printf ("\n"); + } + return (0); +} + +/* Change to the directory ARG. */ +com_cd (arg) + char *arg; +{ + if (chdir (arg) == -1) + { + perror (arg); + return 1; + } + + com_pwd (""); + return (0); +} + +/* Print out the current working directory. */ +com_pwd (ignore) + char *ignore; +{ + char dir[1024], *s; + + s = getwd (dir); + if (s == 0) + { + printf ("Error getting pwd: %s\n", dir); + return 1; + } + + printf ("Current directory is %s\n", dir); + return 0; +} + +/* The user wishes to quit using this program. Just set DONE non-zero. */ +com_quit (arg) + char *arg; +{ + done = 1; + return (0); +} + +/* Function which tells you that you can't do this. */ +too_dangerous (caller) + char *caller; +{ + fprintf (stderr, + "%s: Too dangerous for me to distribute. Write it yourself.\n", + caller); +} + +/* Return non-zero if ARG is a valid argument for CALLER, else print + an error message and return zero. */ +int +valid_argument (caller, arg) + char *caller, *arg; +{ + if (!arg || !*arg) + { + fprintf (stderr, "%s: Argument required.\n", caller); + return (0); + } + + return (1); +} diff --git a/examples/histexamp.c b/examples/histexamp.c new file mode 100644 index 0000000..eceb66d --- /dev/null +++ b/examples/histexamp.c @@ -0,0 +1,82 @@ +main () +{ + char line[1024], *t; + int len, done = 0; + + line[0] = 0; + + using_history (); + while (!done) + { + printf ("history$ "); + fflush (stdout); + t = fgets (line, sizeof (line) - 1, stdin); + if (t && *t) + { + len = strlen (t); + if (t[len - 1] == '\n') + t[len - 1] = '\0'; + } + + if (!t) + strcpy (line, "quit"); + + if (line[0]) + { + char *expansion; + int result; + + using_history (); + + result = history_expand (line, &expansion); + if (result) + fprintf (stderr, "%s\n", expansion); + + if (result < 0 || result == 2) + { + free (expansion); + continue; + } + + add_history (expansion); + strncpy (line, expansion, sizeof (line) - 1); + free (expansion); + } + + if (strcmp (line, "quit") == 0) + done = 1; + else if (strcmp (line, "save") == 0) + write_history ("history_file"); + else if (strcmp (line, "read") == 0) + read_history ("history_file"); + else if (strcmp (line, "list") == 0) + { + register HIST_ENTRY **the_list; + register int i; + + the_list = history_list (); + if (the_list) + for (i = 0; the_list[i]; i++) + printf ("%d: %s\n", i + history_base, the_list[i]->line); + } + else if (strncmp (line, "delete", 6) == 0) + { + int which; + if ((sscanf (line + 6, "%d", &which)) == 1) + { + HIST_ENTRY *entry = remove_history (which); + if (!entry) + fprintf (stderr, "No such entry %d\n", which); + else + { + free (entry->line); + free (entry); + } + } + else + { + fprintf (stderr, "non-numeric arg given to `delete'\n"); + } + } + } +} diff --git a/examples/manexamp.c b/examples/manexamp.c new file mode 100644 index 0000000..3496efa --- /dev/null +++ b/examples/manexamp.c @@ -0,0 +1,94 @@ +/* manexamp.c -- The examples which appear in the documentation are here. */ + +#include +#include + + +/* **************************************************************** */ +/* */ +* How to Emulate gets () */ +/* */ +/* **************************************************************** */ + +/* A static variable for holding the line. */ +static char *line_read = (char *)NULL; + +/* Read a string, and return a pointer to it. Returns NULL on EOF. */ +char * +rl_gets () +{ + /* If the buffer has already been allocated, return the memory + to the free pool. */ + if (line_read) + { + free (line_read); + line_read = (char *)NULL; + } + + /* Get a line from the user. */ + line_read = readline (""); + + /* If the line has any text in it, save it on the history. */ + if (line_read && *line_read) + add_history (line_read); + + return (line_read); +} + +/* **************************************************************** */ +/* */ +/* Writing a Function to be Called by Readline. */ +/* */ +/* **************************************************************** */ + +/* Invert the case of the COUNT following characters. */ +invert_case_line (count, key) + int count, key; +{ + register int start, end; + + start = rl_point; + + if (count < 0) + { + direction = -1; + count = -count; + } + else + direction = 1; + + /* Find the end of the range to modify. */ + end = start + (count * direction); + + /* Force it to be within range. */ + if (end > rl_end) + end = rl_end; + else if (end < 0) + end = -1; + + if (start > end) + { + int temp = start; + start = end; + end = temp; + } + + if (start == end) + return; + + /* Tell readline that we are modifying the line, so save the undo + information. */ + rl_modifying (start, end); + + for (; start != end; start += direction) + { + if (uppercase_p (rl_line_buffer[start])) + rl_line_buffer[start] = to_lower (rl_line_buffer[start]); + else if (lowercase_p (rl_line_buffer[start])) + rl_line_buffer[start] = to_upper (rl_line_buffer[start]); + } + + /* Move point to on top of the last character changed. */ + rl_point = end - direction; +} + diff --git a/funmap.c b/funmap.c new file mode 100644 index 0000000..9255974 --- /dev/null +++ b/funmap.c @@ -0,0 +1,299 @@ +/* funmap.c -- attach names to functions. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + +#if !defined (BUFSIZ) +#include +#endif /* BUFSIZ */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include "rlconf.h" +#include "readline.h" + +static int qsort_string_compare (); + +FUNMAP **funmap = (FUNMAP **)NULL; +static int funmap_size = 0; +static int funmap_entry = 0; + +/* After initializing the function map, this is the index of the first + program specific function. */ +int funmap_program_specific_entry_start; + +static FUNMAP default_funmap[] = { + + { "abort", rl_abort }, + { "accept-line", rl_newline }, + { "arrow-key-prefix", rl_arrow_keys }, + { "backward-char", rl_backward }, + { "backward-delete-char", rl_rubout }, + { "backward-kill-line", rl_backward_kill_line }, + { "backward-kill-word", rl_backward_kill_word }, + { "backward-word", rl_backward_word }, + { "beginning-of-history", rl_beginning_of_history }, + { "beginning-of-line", rl_beg_of_line }, + { "call-last-kbd-macro", rl_call_last_kbd_macro }, + { "capitalize-word", rl_capitalize_word }, + { "clear-screen", rl_clear_screen }, + { "complete", rl_complete }, + { "delete-char", rl_delete }, + { "delete-horizontal-space", rl_delete_horizontal_space }, + { "digit-argument", rl_digit_argument }, + { "do-lowercase-version", rl_do_lowercase_version }, + { "downcase-word", rl_downcase_word }, + { "dump-functions", rl_dump_functions }, + { "emacs-editing-mode", rl_emacs_editing_mode }, + { "end-kbd-macro", rl_end_kbd_macro }, + { "end-of-history", rl_end_of_history }, + { "end-of-line", rl_end_of_line }, + { "forward-char", rl_forward }, + { "forward-search-history", rl_forward_search_history }, + { "forward-word", rl_forward_word }, + { "history-search-backward", rl_history_search_backward }, + { "history-search-forward", rl_history_search_forward }, + { "insert-completions", rl_insert_completions }, + { "kill-whole-line", rl_kill_full_line }, + { "kill-line", rl_kill_line }, + { "kill-word", rl_kill_word }, + { "next-history", rl_get_next_history }, + { "non-incremental-forward-search-history", rl_noninc_forward_search }, + { "non-incremental-reverse-search-history", rl_noninc_reverse_search }, + { "non-incremental-forward-search-history-again", rl_noninc_forward_search_again }, + { "non-incremental-reverse-search-history-again", rl_noninc_reverse_search_again }, + { "possible-completions", rl_possible_completions }, + { "previous-history", rl_get_previous_history }, + { "quoted-insert", rl_quoted_insert }, + { "re-read-init-file", rl_re_read_init_file }, + { "redraw-current-line", rl_refresh_line}, + { "reverse-search-history", rl_reverse_search_history }, + { "revert-line", rl_revert_line }, + { "self-insert", rl_insert }, + { "start-kbd-macro", rl_start_kbd_macro }, + { "tab-insert", rl_tab_insert }, + { "tilde-expand", rl_tilde_expand }, + { "transpose-chars", rl_transpose_chars }, + { "transpose-words", rl_transpose_words }, + { "tty-status", rl_tty_status }, + { "undo", rl_undo_command }, + { "universal-argument", rl_universal_argument }, + { "unix-line-discard", rl_unix_line_discard }, + { "unix-word-rubout", rl_unix_word_rubout }, + { "upcase-word", rl_upcase_word }, + { "yank", rl_yank }, + { "yank-last-arg", rl_yank_last_arg }, + { "yank-nth-arg", rl_yank_nth_arg }, + { "yank-pop", rl_yank_pop }, + +#if defined (VI_MODE) + { "vi-append-eol", rl_vi_append_eol }, + { "vi-append-mode", rl_vi_append_mode }, + { "vi-arg-digit", rl_vi_arg_digit }, + { "vi-bWord", rl_vi_bWord }, + { "vi-bracktype", rl_vi_bracktype }, + { "vi-bword", rl_vi_bword }, + { "vi-change-case", rl_vi_change_case }, + { "vi-change-char", rl_vi_change_char }, + { "vi-change-to", rl_vi_change_to }, + { "vi-char-search", rl_vi_char_search }, + { "vi-column", rl_vi_column }, + { "vi-comment", rl_vi_comment }, + { "vi-complete", rl_vi_complete }, + { "vi-delete", rl_vi_delete }, + { "vi-delete-to", rl_vi_delete_to }, + { "vi-eWord", rl_vi_eWord }, + { "vi-editing-mode", rl_vi_editing_mode }, + { "vi-end-word", rl_vi_end_word }, + { "vi-eof-maybe", rl_vi_eof_maybe }, + { "vi-eword", rl_vi_eword }, + { "vi-fWord", rl_vi_fWord }, + { "vi-first-print", rl_vi_first_print }, + { "vi-fword", rl_vi_fword }, + { "vi-insert-beg", rl_vi_insert_beg }, + { "vi-insertion-mode", rl_vi_insertion_mode }, + { "vi-match", rl_vi_match }, + { "vi-movement-mode", rl_vi_movement_mode }, + { "vi-next-word", rl_vi_next_word }, + { "vi-overstrike", rl_vi_overstrike }, + { "vi-overstrike-delete", rl_vi_overstrike_delete }, + { "vi-prev-word", rl_vi_prev_word }, + { "vi-put", rl_vi_put }, + { "vi-redo", rl_vi_redo }, + { "vi-replace", rl_vi_replace }, + { "vi-search", rl_vi_search }, + { "vi-search-again", rl_vi_search_again }, + { "vi-subst", rl_vi_subst }, + { "vi-tilde-expand", rl_vi_tilde_expand }, + { "vi-yank-arg", rl_vi_yank_arg }, + { "vi-yank-to", rl_vi_yank_to }, +#endif /* VI_MODE */ + + {(char *)NULL, (Function *)NULL } +}; + +rl_add_funmap_entry (name, function) + char *name; + Function *function; +{ + if (funmap_entry + 2 >= funmap_size) + if (!funmap) + funmap = (FUNMAP **)xmalloc ((funmap_size = 80) * sizeof (FUNMAP *)); + else + funmap = + (FUNMAP **)xrealloc (funmap, (funmap_size += 80) * sizeof (FUNMAP *)); + + funmap[funmap_entry] = (FUNMAP *)xmalloc (sizeof (FUNMAP)); + funmap[funmap_entry]->name = name; + funmap[funmap_entry]->function = function; + + funmap[++funmap_entry] = (FUNMAP *)NULL; + return funmap_entry; +} + +static int funmap_initialized = 0; + +/* Make the funmap contain all of the default entries. */ +void +rl_initialize_funmap () +{ + register int i; + + if (funmap_initialized) + return; + + for (i = 0; default_funmap[i].name; i++) + rl_add_funmap_entry (default_funmap[i].name, default_funmap[i].function); + + funmap_initialized = 1; + funmap_program_specific_entry_start = i; +} + +/* Produce a NULL terminated array of known function names. The array + is sorted. The array itself is allocated, but not the strings inside. + You should free () the array when you done, but not the pointrs. */ +char ** +rl_funmap_names () +{ + char **result = (char **)NULL; + int result_size, result_index; + + result_size = result_index = 0; + + /* Make sure that the function map has been initialized. */ + rl_initialize_funmap (); + + for (result_index = 0; funmap[result_index]; result_index++) + { + if (result_index + 2 > result_size) + { + if (!result) + result = (char **)xmalloc ((result_size = 20) * sizeof (char *)); + else + result = (char **) + xrealloc (result, (result_size += 20) * sizeof (char *)); + } + + result[result_index] = funmap[result_index]->name; + result[result_index + 1] = (char *)NULL; + } + + qsort (result, result_index, sizeof (char *), qsort_string_compare); + return (result); +} + +/* Stupid comparison routine for qsort () ing strings. */ +static int +qsort_string_compare (s1, s2) + register char **s1, **s2; +{ + int r; + + r = **s1 - **s2; + if (r == 0) + r = strcmp (*s1, *s2); + return r; +} + +/* Things that mean `Control'. */ +char *possible_control_prefixes[] = { + "Control-", "C-", "CTRL-", (char *)NULL +}; + +char *possible_meta_prefixes[] = { + "Meta", "M-", (char *)NULL +}; + +#if defined (STATIC_MALLOC) + +/* **************************************************************** */ +/* */ +/* xmalloc and xrealloc () */ +/* */ +/* **************************************************************** */ + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)malloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "history: Out of virtual memory!\n"); + abort (); +} +#endif /* STATIC_MALLOC */ diff --git a/history.c b/history.c new file mode 100644 index 0000000..68e99cf --- /dev/null +++ b/history.c @@ -0,0 +1,2171 @@ +/* History.c -- standalone history library */ + +/* Copyright (C) 1989, 1992 Free Software Foundation, Inc. + + This file contains the GNU History Library (the Library), a set of + routines for managing the text of previously typed lines. + + The Library is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + The Library is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +/* The goal is to make the implementation transparent, so that you + don't have to know what data types are used, just what functions + you can call. I think I have done that. */ +#define READLINE_LIBRARY + +#if defined (HAVE_CONFIG_H) +# include "config.h" +#endif + +#include +#include +#include +#include +#include +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ +#if defined (HAVE_UNISTD_H) +# include +#endif +#if defined (HAVE_STRING_H) +# include +#else +# include +#endif /* !HAVE_STRING_H */ +#include + +/* Not all systems declare ERRNO in errno.h... and some systems #define it! */ +#if !defined (errno) +extern int errno; +#endif /* !errno */ + +#include "memalloc.h" +#include "history.h" + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + +#define STREQ(a, b) (((a)[0] == (b)[0]) && (strcmp ((a), (b)) == 0)) +#define STREQN(a, b, n) (((a)[0] == (b)[0]) && (strncmp ((a), (b), (n)) == 0)) + +#ifndef savestring +# ifndef strcpy +extern char *strcpy (); +# endif +#define savestring(x) strcpy (xmalloc (1 + strlen (x)), (x)) +#endif + +#ifndef whitespace +#define whitespace(c) (((c) == ' ') || ((c) == '\t')) +#endif + +#ifndef digit_p +#define digit_p(c) ((c) >= '0' && (c) <= '9') +#endif + +#ifndef digit_value +#define digit_value(c) ((c) - '0') +#endif + +#ifndef member +# ifndef strchr +extern char *strchr (); +# endif +#define member(c, s) ((c) ? ((char *)strchr ((s), (c)) != (char *)NULL) : 0) +#endif + +/* Possible history errors passed to hist_error. */ +#define EVENT_NOT_FOUND 0 +#define BAD_WORD_SPEC 1 +#define SUBST_FAILED 2 +#define BAD_MODIFIER 3 + +static char error_pointer; + +static char *subst_lhs; +static char *subst_rhs; +static int subst_lhs_len = 0; +static int subst_rhs_len = 0; + +static char *get_history_word_specifier (); + +#if defined (SHELL) +extern char *single_quote (); +#endif + +/* **************************************************************** */ +/* */ +/* History Functions */ +/* */ +/* **************************************************************** */ + +/* An array of HIST_ENTRY. This is where we store the history. */ +static HIST_ENTRY **the_history = (HIST_ENTRY **)NULL; + +/* Non-zero means that we have enforced a limit on the amount of + history that we save. */ +static int history_stifled = 0; + +/* If HISTORY_STIFLED is non-zero, then this is the maximum number of + entries to remember. */ +int max_input_history; + +/* The current location of the interactive history pointer. Just makes + life easier for outside callers. */ +static int history_offset = 0; + +/* The number of strings currently stored in the input_history list. */ +int history_length = 0; + +/* The current number of slots allocated to the input_history. */ +static int history_size = 0; + +/* The number of slots to increase the_history by. */ +#define DEFAULT_HISTORY_GROW_SIZE 50 + +/* The character that represents the start of a history expansion + request. This is usually `!'. */ +char history_expansion_char = '!'; + +/* The character that invokes word substitution if found at the start of + a line. This is usually `^'. */ +char history_subst_char = '^'; + +/* During tokenization, if this character is seen as the first character + of a word, then it, and all subsequent characters upto a newline are + ignored. For a Bourne shell, this should be '#'. Bash special cases + the interactive comment character to not be a comment delimiter. */ +char history_comment_char = '\0'; + +/* The list of characters which inhibit the expansion of text if found + immediately following history_expansion_char. */ +char *history_no_expand_chars = " \t\n\r="; + +/* The logical `base' of the history array. It defaults to 1. */ +int history_base = 1; + +/* Return the current HISTORY_STATE of the history. */ +HISTORY_STATE * +history_get_history_state () +{ + HISTORY_STATE *state; + + state = (HISTORY_STATE *)xmalloc (sizeof (HISTORY_STATE)); + state->entries = the_history; + state->offset = history_offset; + state->length = history_length; + state->size = history_size; + state->flags = 0; + if (history_stifled) + state->flags |= HS_STIFLED; + + return (state); +} + +/* Set the state of the current history array to STATE. */ +void +history_set_history_state (state) + HISTORY_STATE *state; +{ + the_history = state->entries; + history_offset = state->offset; + history_length = state->length; + history_size = state->size; + if (state->flags & HS_STIFLED) + history_stifled = 1; +} + +/* Begin a session in which the history functions might be used. This + initializes interactive variables. */ +void +using_history () +{ + history_offset = history_length; +} + +/* Return the number of bytes that the primary history entries are using. + This just adds up the lengths of the_history->lines. */ +int +history_total_bytes () +{ + register int i, result; + + result = 0; + + for (i = 0; the_history && the_history[i]; i++) + result += strlen (the_history[i]->line); + + return (result); +} + +/* Place STRING at the end of the history list. The data field + is set to NULL. */ +void +add_history (string) + char *string; +{ + HIST_ENTRY *temp; + + if (history_stifled && (history_length == max_input_history)) + { + register int i; + + /* If the history is stifled, and history_length is zero, + and it equals max_input_history, we don't save items. */ + if (history_length == 0) + return; + + /* If there is something in the slot, then remove it. */ + if (the_history[0]) + { + free (the_history[0]->line); + free (the_history[0]); + } + + /* Copy the rest of the entries, moving down one slot. */ + for (i = 0; i < history_length; i++) + the_history[i] = the_history[i + 1]; + + history_base++; + + } + else + { + if (!history_size) + { + history_size = DEFAULT_HISTORY_GROW_SIZE; + the_history = (HIST_ENTRY **)xmalloc (history_size * sizeof (HIST_ENTRY *)); + history_length = 1; + + } + else + { + if (history_length == (history_size - 1)) + { + history_size += DEFAULT_HISTORY_GROW_SIZE; + the_history = (HIST_ENTRY **) + xrealloc (the_history, history_size * sizeof (HIST_ENTRY *)); + } + history_length++; + } + } + + temp = (HIST_ENTRY *)xmalloc (sizeof (HIST_ENTRY)); + temp->line = savestring (string); + temp->data = (char *)NULL; + + the_history[history_length] = (HIST_ENTRY *)NULL; + the_history[history_length - 1] = temp; +} + +/* Make the history entry at WHICH have LINE and DATA. This returns + the old entry so you can dispose of the data. In the case of an + invalid WHICH, a NULL pointer is returned. */ +HIST_ENTRY * +replace_history_entry (which, line, data) + int which; + char *line; + char *data; +{ + HIST_ENTRY *temp = (HIST_ENTRY *)xmalloc (sizeof (HIST_ENTRY)); + HIST_ENTRY *old_value; + + if (which >= history_length) + return ((HIST_ENTRY *)NULL); + + old_value = the_history[which]; + + temp->line = savestring (line); + temp->data = data; + the_history[which] = temp; + + return (old_value); +} + +/* Returns the magic number which says what history element we are + looking at now. In this implementation, it returns history_offset. */ +int +where_history () +{ + return (history_offset); +} + +/* Search the history for STRING, starting at history_offset. + If DIRECTION < 0, then the search is through previous entries, else + through subsequent. If ANCHORED is non-zero, the string must + appear at the beginning of a history line, otherwise, the string + may appear anywhere in the line. If the string is found, then + current_history () is the history entry, and the value of this + function is the offset in the line of that history entry that the + string was found in. Otherwise, nothing is changed, and a -1 is + returned. */ + +#define ANCHORED_SEARCH 1 +#define NON_ANCHORED_SEARCH 0 + +static int +history_search_internal (string, direction, anchored) + char *string; + int direction, anchored; +{ + register int i, reverse; + register char *line; + register int line_index; + int string_len; + + i = history_offset; + reverse = (direction < 0); + + /* Take care of trivial cases first. */ + + if (!history_length || ((i == history_length) && !reverse)) + return (-1); + + if (reverse && (i == history_length)) + i--; + +#define NEXT_LINE() do { if (reverse) i--; else i++; } while (0) + + string_len = strlen (string); + while (1) + { + /* Search each line in the history list for STRING. */ + + /* At limit for direction? */ + if ((reverse && i < 0) || (!reverse && i == history_length)) + return (-1); + + line = the_history[i]->line; + line_index = strlen (line); + + /* If STRING is longer than line, no match. */ + if (string_len > line_index) + { + NEXT_LINE (); + continue; + } + + /* Handle anchored searches first. */ + if (anchored == ANCHORED_SEARCH) + { + if (STREQN (string, line, string_len)) + { + history_offset = i; + return (0); + } + + NEXT_LINE (); + continue; + } + + /* Do substring search. */ + if (reverse) + { + line_index -= string_len; + + while (line_index >= 0) + { + if (STREQN (string, line + line_index, string_len)) + { + history_offset = i; + return (line_index); + } + line_index--; + } + } + else + { + register int limit = line_index - string_len + 1; + line_index = 0; + + while (line_index < limit) + { + if (STREQN (string, line + line_index, string_len)) + { + history_offset = i; + return (line_index); + } + line_index++; + } + } + NEXT_LINE (); + } +} + +/* Do a non-anchored search for STRING through the history in DIRECTION. */ +int +history_search (string, direction) + char *string; + int direction; +{ + return (history_search_internal (string, direction, NON_ANCHORED_SEARCH)); +} + +/* Do an anchored search for string through the history in DIRECTION. */ +int +history_search_prefix (string, direction) + char *string; + int direction; +{ + return (history_search_internal (string, direction, ANCHORED_SEARCH)); +} + +/* Remove history element WHICH from the history. The removed + element is returned to you so you can free the line, data, + and containing structure. */ +HIST_ENTRY * +remove_history (which) + int which; +{ + HIST_ENTRY *return_value; + + if (which >= history_length || !history_length) + return_value = (HIST_ENTRY *)NULL; + else + { + register int i; + return_value = the_history[which]; + + for (i = which; i < history_length; i++) + the_history[i] = the_history[i + 1]; + + history_length--; + } + + return (return_value); +} + +/* Stifle the history list, remembering only MAX number of lines. */ +void +stifle_history (max) + int max; +{ + if (max < 0) + max = 0; + + if (history_length > max) + { + register int i, j; + + /* This loses because we cannot free the data. */ + for (i = 0; i < (history_length - max); i++) + { + free (the_history[i]->line); + free (the_history[i]); + } + + history_base = i; + for (j = 0, i = history_length - max; j < max; i++, j++) + the_history[j] = the_history[i]; + the_history[j] = (HIST_ENTRY *)NULL; + history_length = j; + } + + history_stifled = 1; + max_input_history = max; +} + +/* Stop stifling the history. This returns the previous amount the history + was stifled by. The value is positive if the history was stifled, negative + if it wasn't. */ +int +unstifle_history () +{ + int result = max_input_history; + + if (history_stifled) + { + result = -result; + history_stifled = 0; + } + + return (result); +} + +int +history_is_stifled () +{ + return (history_stifled); +} + +/* Return the string that should be used in the place of this + filename. This only matters when you don't specify the + filename to read_history (), or write_history (). */ +static char * +history_filename (filename) + char *filename; +{ + char *return_val = filename ? savestring (filename) : (char *)NULL; + + if (!return_val) + { + char *home; + int home_len; + + home = getenv ("HOME"); + + if (!home) + home = "."; + + home_len = strlen (home); + /* strlen(".history") == 8 */ + return_val = xmalloc (2 + home_len + 8); + + strcpy (return_val, home); + return_val[home_len] = '/'; + strcpy (return_val + home_len + 1, ".history"); + } + + return (return_val); +} + +/* Add the contents of FILENAME to the history list, a line at a time. + If FILENAME is NULL, then read from ~/.history. Returns 0 if + successful, or errno if not. */ +int +read_history (filename) + char *filename; +{ + return (read_history_range (filename, 0, -1)); +} + +/* Read a range of lines from FILENAME, adding them to the history list. + Start reading at the FROM'th line and end at the TO'th. If FROM + is zero, start at the beginning. If TO is less than FROM, read + until the end of the file. If FILENAME is NULL, then read from + ~/.history. Returns 0 if successful, or errno if not. */ +int +read_history_range (filename, from, to) + char *filename; + int from, to; +{ + register int line_start, line_end; + char *input, *buffer = (char *)NULL; + int file, current_line; + struct stat finfo; + + input = history_filename (filename); + file = open (input, O_RDONLY, 0666); + + if ((file < 0) || (fstat (file, &finfo) == -1)) + goto error_and_exit; + + buffer = xmalloc ((int)finfo.st_size + 1); + + if (read (file, buffer, finfo.st_size) != finfo.st_size) + { + error_and_exit: + if (file >= 0) + close (file); + + if (input) + free (input); + + if (buffer) + free (buffer); + + return (errno); + } + + close (file); + + /* Set TO to larger than end of file if negative. */ + if (to < 0) + to = finfo.st_size; + + /* Start at beginning of file, work to end. */ + line_start = line_end = current_line = 0; + + /* Skip lines until we are at FROM. */ + while (line_start < finfo.st_size && current_line < from) + { + for (line_end = line_start; line_end < finfo.st_size; line_end++) + if (buffer[line_end] == '\n') + { + current_line++; + line_start = line_end + 1; + if (current_line == from) + break; + } + } + + /* If there are lines left to gobble, then gobble them now. */ + for (line_end = line_start; line_end < finfo.st_size; line_end++) + if (buffer[line_end] == '\n') + { + buffer[line_end] = '\0'; + + if (buffer[line_start]) + add_history (buffer + line_start); + + current_line++; + + if (current_line >= to) + break; + + line_start = line_end + 1; + } + + if (input) + free (input); + + if (buffer) + free (buffer); + + return (0); +} + +/* Truncate the history file FNAME, leaving only LINES trailing lines. + If FNAME is NULL, then use ~/.history. */ +int +history_truncate_file (fname, lines) + char *fname; + register int lines; +{ + register int i; + int file, chars_read; + char *buffer = (char *)NULL, *filename; + struct stat finfo; + + filename = history_filename (fname); + file = open (filename, O_RDONLY, 0666); + + if (file == -1 || fstat (file, &finfo) == -1) + goto truncate_exit; + + buffer = xmalloc ((int)finfo.st_size + 1); + chars_read = read (file, buffer, finfo.st_size); + close (file); + + if (chars_read <= 0) + goto truncate_exit; + + /* Count backwards from the end of buffer until we have passed + LINES lines. */ + for (i = chars_read - 1; lines && i; i--) + { + if (buffer[i] == '\n') + lines--; + } + + /* If this is the first line, then the file contains exactly the + number of lines we want to truncate to, so we don't need to do + anything. It's the first line if we don't find a newline between + the current value of i and 0. Otherwise, write from the start of + this line until the end of the buffer. */ + for ( ; i; i--) + if (buffer[i] == '\n') + { + i++; + break; + } + + /* Write only if there are more lines in the file than we want to + truncate to. */ + if (i && ((file = open (filename, O_WRONLY|O_TRUNC, 0666)) != -1)) + { + write (file, buffer + i, finfo.st_size - i); + close (file); + } + + truncate_exit: + if (buffer) + free (buffer); + + free (filename); + return 0; +} + +#define HISTORY_APPEND 0 +#define HISTORY_OVERWRITE 1 + +/* Workhorse function for writing history. Writes NELEMENT entries + from the history list to FILENAME. OVERWRITE is non-zero if you + wish to replace FILENAME with the entries. */ +static int +history_do_write (filename, nelements, overwrite) + char *filename; + int nelements, overwrite; +{ + register int i; + char *output = history_filename (filename); + int file, mode; + + mode = overwrite ? O_WRONLY | O_CREAT | O_TRUNC : O_WRONLY | O_APPEND; + + if ((file = open (output, mode, 0666)) == -1) + { + if (output) + free (output); + + return (errno); + } + + if (nelements > history_length) + nelements = history_length; + + /* Build a buffer of all the lines to write, and write them in one syscall. + Suggested by Peter Ho (peter@robosts.oxford.ac.uk). */ + { + register int j = 0; + int buffer_size = 0; + char *buffer; + + /* Calculate the total number of bytes to write. */ + for (i = history_length - nelements; i < history_length; i++) + buffer_size += 1 + strlen (the_history[i]->line); + + /* Allocate the buffer, and fill it. */ + buffer = xmalloc (buffer_size); + + for (i = history_length - nelements; i < history_length; i++) + { + strcpy (buffer + j, the_history[i]->line); + j += strlen (the_history[i]->line); + buffer[j++] = '\n'; + } + + write (file, buffer, buffer_size); + free (buffer); + } + + close (file); + + if (output) + free (output); + + return (0); +} + +/* Append NELEMENT entries to FILENAME. The entries appended are from + the end of the list minus NELEMENTs up to the end of the list. */ +int +append_history (nelements, filename) + int nelements; + char *filename; +{ + return (history_do_write (filename, nelements, HISTORY_APPEND)); +} + +/* Overwrite FILENAME with the current history. If FILENAME is NULL, + then write the history list to ~/.history. Values returned + are as in read_history ().*/ +int +write_history (filename) + char *filename; +{ + return (history_do_write (filename, history_length, HISTORY_OVERWRITE)); +} + +/* Return the history entry at the current position, as determined by + history_offset. If there is no entry there, return a NULL pointer. */ +HIST_ENTRY * +current_history () +{ + if ((history_offset == history_length) || !the_history) + return ((HIST_ENTRY *)NULL); + else + return (the_history[history_offset]); +} + +/* Back up history_offset to the previous history entry, and return + a pointer to that entry. If there is no previous entry then return + a NULL pointer. */ +HIST_ENTRY * +previous_history () +{ + if (!history_offset) + return ((HIST_ENTRY *)NULL); + else + return (the_history[--history_offset]); +} + +/* Move history_offset forward to the next history entry, and return + a pointer to that entry. If there is no next entry then return a + NULL pointer. */ +HIST_ENTRY * +next_history () +{ + if (history_offset == history_length) + return ((HIST_ENTRY *)NULL); + else + return (the_history[++history_offset]); +} + +/* Return the current history array. The caller has to be carefull, since this + is the actual array of data, and could be bashed or made corrupt easily. + The array is terminated with a NULL pointer. */ +HIST_ENTRY ** +history_list () +{ + return (the_history); +} + +/* Return the history entry which is logically at OFFSET in the history array. + OFFSET is relative to history_base. */ +HIST_ENTRY * +history_get (offset) + int offset; +{ + int local_index = offset - history_base; + + if (local_index >= history_length || + local_index < 0 || + !the_history) + return ((HIST_ENTRY *)NULL); + return (the_history[local_index]); +} + +/* Search for STRING in the history list. DIR is < 0 for searching + backwards. POS is an absolute index into the history list at + which point to begin searching. */ +int +history_search_pos (string, dir, pos) + char *string; + int dir, pos; +{ + int ret, old = where_history (); + history_set_pos (pos); + if (history_search (string, dir) == -1) + { + history_set_pos (old); + return (-1); + } + ret = where_history (); + history_set_pos (old); + return ret; +} + +/* Make the current history item be the one at POS, an absolute index. + Returns zero if POS is out of range, else non-zero. */ +int +history_set_pos (pos) + int pos; +{ + if (pos > history_length || pos < 0 || !the_history) + return (0); + history_offset = pos; + return (1); +} + + +/* **************************************************************** */ +/* */ +/* History Expansion */ +/* */ +/* **************************************************************** */ + +/* Hairy history expansion on text, not tokens. This is of general + use, and thus belongs in this library. */ + +/* The last string searched for in a !?string? search. */ +static char *search_string = (char *)NULL; + +/* Return the event specified at TEXT + OFFSET modifying OFFSET to + point to after the event specifier. Just a pointer to the history + line is returned; NULL is returned in the event of a bad specifier. + You pass STRING with *INDEX equal to the history_expansion_char that + begins this specification. + DELIMITING_QUOTE is a character that is allowed to end the string + specification for what to search for in addition to the normal + characters `:', ` ', `\t', `\n', and sometimes `?'. + So you might call this function like: + line = get_history_event ("!echo:p", &index, 0); */ +char * +get_history_event (string, caller_index, delimiting_quote) + char *string; + int *caller_index; + int delimiting_quote; +{ + register int i = *caller_index; + register char c; + HIST_ENTRY *entry; + int which, sign = 1; + int local_index, search_mode, substring_okay = 0; + char *temp; + + /* The event can be specified in a number of ways. + + !! the previous command + !n command line N + !-n current command-line minus N + !str the most recent command starting with STR + !?str[?] + the most recent command containing STR + + All values N are determined via HISTORY_BASE. */ + + if (string[i] != history_expansion_char) + return ((char *)NULL); + + /* Move on to the specification. */ + i++; + +#define RETURN_ENTRY(e, w) \ + return ((e = history_get (w)) ? e->line : (char *)NULL) + + /* Handle !! case. */ + if (string[i] == history_expansion_char) + { + i++; + which = history_base + (history_length - 1); + *caller_index = i; + RETURN_ENTRY (entry, which); + } + + /* Hack case of numeric line specification. */ + if (string[i] == '-') + { + sign = -1; + i++; + } + + if (digit_p (string[i])) + { + /* Get the extent of the digits and compute the value. */ + for (which = 0; digit_p (string[i]); i++) + which = (which * 10) + digit_value (string[i]); + + *caller_index = i; + + if (sign < 0) + which = (history_length + history_base) - which; + + RETURN_ENTRY (entry, which); + } + + /* This must be something to search for. If the spec begins with + a '?', then the string may be anywhere on the line. Otherwise, + the string must be found at the start of a line. */ + if (string[i] == '?') + { + substring_okay++; + i++; + } + + /* Only a closing `?' or a newline delimit a substring search string. */ + for (local_index = i; c = string[i]; i++) + if ((!substring_okay && (whitespace (c) || c == ':' || +#if defined (SHELL) + member (c, ";&()|<>") || +#endif /* SHELL */ + string[i] == delimiting_quote)) || + string[i] == '\n' || + (substring_okay && string[i] == '?')) + break; + + temp = xmalloc (1 + (i - local_index)); + strncpy (temp, &string[local_index], (i - local_index)); + temp[i - local_index] = '\0'; + + if (substring_okay && string[i] == '?') + i++; + + *caller_index = i; + +#define FAIL_SEARCH() \ + do { history_offset = history_length; free (temp) ; return (char *)NULL; } while (0) + + search_mode = substring_okay ? NON_ANCHORED_SEARCH : ANCHORED_SEARCH; + while (1) + { + local_index = history_search_internal (temp, -1, search_mode); + + if (local_index < 0) + FAIL_SEARCH (); + + if (local_index == 0 || substring_okay) + { + entry = current_history (); + history_offset = history_length; + + /* If this was a substring search, then remember the + string that we matched for word substitution. */ + if (substring_okay) + { + if (search_string) + free (search_string); + search_string = temp; + } + else + free (temp); + return (entry->line); + } + + if (history_offset) + history_offset--; + else + FAIL_SEARCH (); + } +#undef FAIL_SEARCH +#undef RETURN_ENTRY +} +#if defined (SHELL) +/* Function for extracting single-quoted strings. Used for inhibiting + history expansion within single quotes. */ + +/* Extract the contents of STRING as if it is enclosed in single quotes. + SINDEX, when passed in, is the offset of the character immediately + following the opening single quote; on exit, SINDEX is left pointing + to the closing single quote. */ +static void +rl_string_extract_single_quoted (string, sindex) + char *string; + int *sindex; +{ + register int i = *sindex; + + while (string[i] && string[i] != '\'') + i++; + + *sindex = i; +} + +static char * +quote_breaks (s) + char *s; +{ + register char *p, *r; + char *ret; + int len = 3; + + for (p = s; p && *p; p++, len++) + { + if (*p == '\'') + len += 3; + else if (whitespace (*p) || *p == '\n') + len += 2; + } + + r = ret = xmalloc (len); + *r++ = '\''; + for (p = s; p && *p; ) + { + if (*p == '\'') + { + *r++ = '\''; + *r++ = '\\'; + *r++ = '\''; + *r++ = '\''; + p++; + } + else if (whitespace (*p) || *p == '\n') + { + *r++ = '\''; + *r++ = *p++; + *r++ = '\''; + } + else + *r++ = *p++; + } + *r++ = '\''; + *r = '\0'; + return ret; +} +#endif /* SHELL */ + +static char * +hist_error(s, start, current, errtype) + char *s; + int start, current, errtype; +{ + char *temp, *emsg; + int ll, elen; + + ll = current - start; + + switch (errtype) + { + case EVENT_NOT_FOUND: + emsg = "event not found"; + elen = 15; + break; + case BAD_WORD_SPEC: + emsg = "bad word specifier"; + elen = 18; + break; + case SUBST_FAILED: + emsg = "substitution failed"; + elen = 19; + break; + case BAD_MODIFIER: + emsg = "unrecognized history modifier"; + elen = 29; + break; + default: + emsg = "unknown expansion error"; + elen = 23; + break; + } + + temp = xmalloc (ll + elen + 3); + strncpy (temp, s + start, ll); + temp[ll] = ':'; + temp[ll + 1] = ' '; + strcpy (temp + ll + 2, emsg); + return (temp); +} + +/* Get a history substitution string from STR starting at *IPTR + and return it. The length is returned in LENPTR. + + A backslash can quote the delimiter. If the string is the + empty string, the previous pattern is used. If there is + no previous pattern for the lhs, the last history search + string is used. + + If IS_RHS is 1, we ignore empty strings and set the pattern + to "" anyway. subst_lhs is not changed if the lhs is empty; + subst_rhs is allowed to be set to the empty string. */ + +static char * +get_subst_pattern (str, iptr, delimiter, is_rhs, lenptr) + char *str; + int *iptr, delimiter, is_rhs, *lenptr; +{ + register int si, i, j, k; + char *s = (char *) NULL; + + i = *iptr; + + for (si = i; str[si] && str[si] != delimiter; si++) + if (str[si] == '\\' && str[si + 1] == delimiter) + si++; + + if (si > i || is_rhs) + { + s = xmalloc (si - i + 1); + for (j = 0, k = i; k < si; j++, k++) + { + /* Remove a backslash quoting the search string delimiter. */ + if (str[k] == '\\' && str[k + 1] == delimiter) + k++; + s[j] = str[k]; + } + s[j] = '\0'; + if (lenptr) + *lenptr = j; + } + + i = si; + if (str[i]) + i++; + *iptr = i; + + return s; +} + +static void +postproc_subst_rhs () +{ + char *new; + int i, j, new_size; + + new = xmalloc (new_size = subst_rhs_len + subst_lhs_len); + for (i = j = 0; i < subst_rhs_len; i++) + { + if (subst_rhs[i] == '&') + { + if (j + subst_lhs_len >= new_size) + new = xrealloc (new, (new_size = new_size * 2 + subst_lhs_len)); + strcpy (new + j, subst_lhs); + j += subst_lhs_len; + } + else + { + /* a single backslash protects the `&' from lhs interpolation */ + if (subst_rhs[i] == '\\' && subst_rhs[i + 1] == '&') + i++; + if (j >= new_size) + new = xrealloc (new, new_size *= 2); + new[j++] = subst_rhs[i]; + } + } + new[j] = '\0'; + free (subst_rhs); + subst_rhs = new; + subst_rhs_len = j; +} + +/* Expand the bulk of a history specifier starting at STRING[START]. + Returns 0 if everything is OK, -1 if an error occurred, and 1 + if the `p' modifier was supplied and the caller should just print + the returned string. Returns the new index into string in + *END_INDEX_PTR, and the expanded specifier in *RET_STRING. */ +static int +history_expand_internal (string, start, end_index_ptr, ret_string, current_line) + char *string; + int start, *end_index_ptr; + char **ret_string; + char *current_line; /* for !# */ +{ + int i, n, starting_index; + int substitute_globally, want_quotes, print_only; + char *event, *temp, *result, *tstr, *t, c, *word_spec; + int result_len; + + result = xmalloc (result_len = 128); + + i = start; + + /* If it is followed by something that starts a word specifier, + then !! is implied as the event specifier. */ + + if (member (string[i + 1], ":$*%^")) + { + char fake_s[3]; + int fake_i = 0; + i++; + fake_s[0] = fake_s[1] = history_expansion_char; + fake_s[2] = '\0'; + event = get_history_event (fake_s, &fake_i, 0); + } + else if (string[i + 1] == '#') + { + i += 2; + event = current_line; + } + else + { + int quoted_search_delimiter = 0; + + /* If the character before this `!' is a double or single + quote, then this expansion takes place inside of the + quoted string. If we have to search for some text ("!foo"), + allow the delimiter to end the search string. */ + if (i && (string[i - 1] == '\'' || string[i - 1] == '"')) + quoted_search_delimiter = string[i - 1]; + event = get_history_event (string, &i, quoted_search_delimiter); + } + + if (!event) + { + *ret_string = hist_error (string, start, i, EVENT_NOT_FOUND); + free (result); + return (-1); + } + + /* If a word specifier is found, then do what that requires. */ + starting_index = i; + word_spec = get_history_word_specifier (string, event, &i); + + /* There is no such thing as a `malformed word specifier'. However, + it is possible for a specifier that has no match. In that case, + we complain. */ + if (word_spec == (char *)&error_pointer) + { + *ret_string = hist_error (string, starting_index, i, BAD_WORD_SPEC); + free (result); + return (-1); + } + + /* If no word specifier, than the thing of interest was the event. */ + if (!word_spec) + temp = savestring (event); + else + { + temp = savestring (word_spec); + free (word_spec); + } + + /* Perhaps there are other modifiers involved. Do what they say. */ + want_quotes = substitute_globally = print_only = 0; + starting_index = i; + + while (string[i] == ':') + { + c = string[i + 1]; + + if (c == 'g') + { + substitute_globally = 1; + i++; + c = string[i + 1]; + } + + switch (c) + { + default: + *ret_string = hist_error (string, i+1, i+2, BAD_MODIFIER); + free (result); + free (temp); + return -1; + +#if defined (SHELL) + case 'q': + want_quotes = 'q'; + break; + + case 'x': + want_quotes = 'x'; + break; +#endif /* SHELL */ + + /* :p means make this the last executed line. So we + return an error state after adding this line to the + history. */ + case 'p': + print_only++; + break; + + /* :t discards all but the last part of the pathname. */ + case 't': + tstr = strrchr (temp, '/'); + if (tstr) + { + tstr++; + t = savestring (tstr); + free (temp); + temp = t; + } + break; + + /* :h discards the last part of a pathname. */ + case 'h': + tstr = strrchr (temp, '/'); + if (tstr) + *tstr = '\0'; + break; + + /* :r discards the suffix. */ + case 'r': + tstr = strrchr (temp, '.'); + if (tstr) + *tstr = '\0'; + break; + + /* :e discards everything but the suffix. */ + case 'e': + tstr = strrchr (temp, '.'); + if (tstr) + { + t = savestring (tstr); + free (temp); + temp = t; + } + break; + + /* :s/this/that substitutes `that' for the first + occurrence of `this'. :gs/this/that substitutes `that' + for each occurrence of `this'. :& repeats the last + substitution. :g& repeats the last substitution + globally. */ + + case '&': + case 's': + { + char *new_event, *t; + int delimiter, failed, si, l_temp; + + if (c == 's') + { + if (i + 2 < (int)strlen (string)) + delimiter = string[i + 2]; + else + break; /* no search delimiter */ + + i += 3; + + t = get_subst_pattern (string, &i, delimiter, 0, &subst_lhs_len); + /* An empty substitution lhs with no previous substitution + uses the last search string as the lhs. */ + if (t) + { + if (subst_lhs) + free (subst_lhs); + subst_lhs = t; + } + else if (!subst_lhs) + { + if (search_string && *search_string) + { + subst_lhs = savestring (search_string); + subst_lhs_len = strlen (subst_lhs); + } + else + { + subst_lhs = (char *) NULL; + subst_lhs_len = 0; + } + } + + /* If there is no lhs, the substitution can't succeed. */ + if (subst_lhs_len == 0) + { + *ret_string = hist_error (string, starting_index, i, SUBST_FAILED); + free (result); + free (temp); + return -1; + } + + if (subst_rhs) + free (subst_rhs); + subst_rhs = get_subst_pattern (string, &i, delimiter, 1, &subst_rhs_len); + + /* If `&' appears in the rhs, it's supposed to be replaced + with the lhs. */ + if (member ('&', subst_rhs)) + postproc_subst_rhs (); + } + else + i += 2; + + l_temp = strlen (temp); + /* Ignore impossible cases. */ + if (subst_lhs_len > l_temp) + { + *ret_string = hist_error (string, starting_index, i, SUBST_FAILED); + free (result); + free (temp); + return (-1); + } + + /* Find the first occurrence of THIS in TEMP. */ + si = 0; + for (failed = 1; (si + subst_lhs_len) <= l_temp; si++) + if (STREQN (temp+si, subst_lhs, subst_lhs_len)) + { + int len = subst_rhs_len - subst_lhs_len + l_temp; + new_event = xmalloc (1 + len); + strncpy (new_event, temp, si); + strncpy (new_event + si, subst_rhs, subst_rhs_len); + strncpy (new_event + si + subst_rhs_len, + temp + si + subst_lhs_len, + l_temp - (si + subst_lhs_len)); + new_event[len] = '\0'; + free (temp); + temp = new_event; + + failed = 0; + + if (substitute_globally) + { + si += subst_rhs_len; + l_temp = strlen (temp); + substitute_globally++; + continue; + } + else + break; + } + + if (substitute_globally > 1) + { + substitute_globally = 0; + continue; /* don't want to increment i */ + } + + if (failed == 0) + continue; /* don't want to increment i */ + + *ret_string = hist_error (string, starting_index, i, SUBST_FAILED); + free (result); + free (temp); + return (-1); + } + } + i += 2; + } + /* Done with modfiers. */ + /* Believe it or not, we have to back the pointer up by one. */ + --i; + +#if defined (SHELL) + if (want_quotes) + { + char *x; + + if (want_quotes == 'q') + x = single_quote (temp); + else if (want_quotes == 'x') + x = quote_breaks (temp); + else + x = savestring (temp); + + free (temp); + temp = x; + } +#endif /* SHELL */ + + n = strlen (temp); + if (n > result_len) + result = xrealloc (result, n + 2); + strcpy (result, temp); + free (temp); + + *end_index_ptr = i; + *ret_string = result; + return (print_only); +} + +/* Expand the string STRING, placing the result into OUTPUT, a pointer + to a string. Returns: + + -1) If there was an error in expansion. + 0) If no expansions took place (or, if the only change in + the text was the de-slashifying of the history expansion + character) + 1) If expansions did take place + 2) If the `p' modifier was given and the caller should print the result + + If an error ocurred in expansion, then OUTPUT contains a descriptive + error message. */ + +#define ADD_STRING(s) \ + do \ + { \ + int sl = strlen (s); \ + j += sl; \ + if (j >= result_len) \ + { \ + while (j >= result_len) \ + result_len += 128; \ + result = xrealloc (result, result_len); \ + } \ + strcpy (result + j - sl, s); \ + } \ + while (0) + +#define ADD_CHAR(c) \ + do \ + { \ + if (j >= result_len - 1) \ + result = xrealloc (result, result_len += 64); \ + result[j++] = c; \ + result[j] = '\0'; \ + } \ + while (0) + +int +history_expand (hstring, output) + char *hstring; + char **output; +{ + register int j; + int i, r, l, passc, cc, modified, eindex, only_printing; + char *string; + + /* The output string, and its length. */ + int result_len; + char *result; + + /* Used when adding the string. */ + char *temp; + + /* Setting the history expansion character to 0 inhibits all + history expansion. */ + if (history_expansion_char == 0) + { + *output = savestring (hstring); + return (0); + } + + /* Prepare the buffer for printing error messages. */ + result = xmalloc (result_len = 256); + result[0] = '\0'; + + only_printing = modified = 0; + l = strlen (hstring); + + /* Grovel the string. Only backslash can quote the history escape + character. We also handle arg specifiers. */ + + /* Before we grovel forever, see if the history_expansion_char appears + anywhere within the text. */ + + /* The quick substitution character is a history expansion all right. That + is to say, "^this^that^" is equivalent to "!!:s^this^that^", and in fact, + that is the substitution that we do. */ + if (hstring[0] == history_subst_char) + { + string = xmalloc (l + 5); + + string[0] = string[1] = history_expansion_char; + string[2] = ':'; + string[3] = 's'; + strcpy (string + 4, hstring); + l += 4; + } + else + { + string = hstring; + /* If not quick substitution, still maybe have to do expansion. */ + + /* `!' followed by one of the characters in history_no_expand_chars + is NOT an expansion. */ + for (i = 0; string[i]; i++) + { + cc = string[i + 1]; + if (string[i] == history_expansion_char) + { + if (!cc || member (cc, history_no_expand_chars)) + continue; +#if defined (SHELL) + /* The shell uses ! as a pattern negation character + in globbing [...] expressions, so let those pass + without expansion. */ + else if (i > 0 && (string[i - 1] == '[') && + member (']', string + i + 1)) + continue; +#endif /* SHELL */ + else + break; + } +#if defined (SHELL) + else if (string[i] == '\'') + { + /* If this is bash, single quotes inhibit history expansion. */ + i++; + rl_string_extract_single_quoted (string, &i); + } + else if (string[i] == '\\') + { + /* If this is bash, allow backslashes to quote single + quotes and + the history expansion character. */ + if (cc == '\'' || cc == history_expansion_char) + i++; + } +#endif /* SHELL */ + } + + if (string[i] != history_expansion_char) + { + free (result); + *output = savestring (string); + return (0); + } + } + + /* Extract and perform the substitution. */ + for (passc = i = j = 0; i < l; i++) + { + int tchar = string[i]; + + if (passc) + { + passc = 0; + ADD_CHAR (tchar); + continue; + } + + if (tchar == history_expansion_char) + tchar = -3; + + switch (tchar) + { + default: + ADD_CHAR (string[i]); + break; + + case '\\': + passc++; + ADD_CHAR (tchar); + break; + +#if defined (SHELL) + case '\'': + { + /* If this is bash, single quotes inhibit history expansion. */ + int quote, slen; + + quote = i++; + rl_string_extract_single_quoted (string, &i); + + slen = i - quote + 2; + temp = xmalloc (slen); + strncpy (temp, string + quote, slen); + temp[slen - 1] = '\0'; + ADD_STRING (temp); + free (temp); + break; + } +#endif /* SHELL */ + + case -3: /* history_expansion_char */ + cc = string[i + 1]; + + /* If the history_expansion_char is followed by one of the + characters in history_no_expand_chars, then it is not a + candidate for expansion of any kind. */ + if (member (cc, history_no_expand_chars)) + { + ADD_CHAR (string[i]); + break; + } + +#if defined (NO_BANG_HASH_MODIFIERS) + /* There is something that is listed as a `word specifier' in csh + documentation which means `the expanded text to this point'. + That is not a word specifier, it is an event specifier. If we + don't want to allow modifiers with `!#', just stick the current + output line in again. */ + if (cc == '#') + { + if (result) + { + temp = xmalloc (1 + strlen (result)); + strcpy (temp, result); + ADD_STRING (temp); + free (temp); + } + i++; + break; + } +#endif + + r = history_expand_internal (string, i, &eindex, &temp, result); + if (r < 0) + { + *output = temp; + free (result); + if (string != hstring) + free (string); + return -1; + } + else + { + if (temp) + { + modified++; + if (*temp) + ADD_STRING (temp); + free (temp); + } + only_printing = r == 1; + i = eindex; + } + break; + } + } + + *output = result; + if (string != hstring) + free (string); + + if (only_printing) + { + add_history (result); + return (2); + } + + return (modified != 0); +} + +/* Return a consed string which is the word specified in SPEC, and found + in FROM. NULL is returned if there is no spec. The address of + ERROR_POINTER is returned if the word specified cannot be found. + CALLER_INDEX is the offset in SPEC to start looking; it is updated + to point to just after the last character parsed. */ +static char * +get_history_word_specifier (spec, from, caller_index) + char *spec, *from; + int *caller_index; +{ + register int i = *caller_index; + int first, last; + int expecting_word_spec = 0; + char *result; + + /* The range of words to return doesn't exist yet. */ + first = last = 0; + result = (char *)NULL; + + /* If we found a colon, then this *must* be a word specification. If + it isn't, then it is an error. */ + if (spec[i] == ':') + { + i++; + expecting_word_spec++; + } + + /* Handle special cases first. */ + + /* `%' is the word last searched for. */ + if (spec[i] == '%') + { + *caller_index = i + 1; + return (search_string ? savestring (search_string) : savestring ("")); + } + + /* `*' matches all of the arguments, but not the command. */ + if (spec[i] == '*') + { + *caller_index = i + 1; + result = history_arg_extract (1, '$', from); + return (result ? result : savestring ("")); + } + + /* `$' is last arg. */ + if (spec[i] == '$') + { + *caller_index = i + 1; + return (history_arg_extract ('$', '$', from)); + } + + /* Try to get FIRST and LAST figured out. */ + + if (spec[i] == '-') + first = 0; + else if (spec[i] == '^') + first = 1; + else if (digit_p (spec[i]) && expecting_word_spec) + { + for (first = 0; digit_p (spec[i]); i++) + first = (first * 10) + digit_value (spec[i]); + } + else + return ((char *)NULL); /* no valid `first' for word specifier */ + + if (spec[i] == '^' || spec[i] == '*') + { + last = (spec[i] == '^') ? 1 : '$'; /* x* abbreviates x-$ */ + i++; + } + else if (spec[i] != '-') + last = first; + else + { + i++; + + if (digit_p (spec[i])) + { + for (last = 0; digit_p (spec[i]); i++) + last = (last * 10) + digit_value (spec[i]); + } + else if (spec[i] == '$') + { + i++; + last = '$'; + } + else if (!spec[i] || spec[i] == ':') /* could be modifier separator */ + last = -1; /* x- abbreviates x-$ omitting word `$' */ + } + + *caller_index = i; + + if (last >= first || last == '$' || last < 0) + result = history_arg_extract (first, last, from); + + return (result ? result : (char *)&error_pointer); +} + +/* Extract the args specified, starting at FIRST, and ending at LAST. + The args are taken from STRING. If either FIRST or LAST is < 0, + then make that arg count from the right (subtract from the number of + tokens, so that FIRST = -1 means the next to last token on the line). + If LAST is `$' the last arg from STRING is used. */ +char * +history_arg_extract (first, last, string) + int first, last; + char *string; +{ + register int i, len; + char *result = (char *)NULL; + int size = 0, offset = 0; + char **list; + + /* XXX - think about making history_tokenize return a struct array, + each struct in array being a string and a length to avoid the + calls to strlen below. */ + if ((list = history_tokenize (string)) == NULL) + return ((char *)NULL); + + for (len = 0; list[len]; len++) + ; + + if (last < 0) + last = len + last - 1; + + if (first < 0) + first = len + first - 1; + + if (last == '$') + last = len - 1; + + if (first == '$') + first = len - 1; + + last++; + + if (first > len || last > len || first < 0 || last < 0) + result = ((char *)NULL); + else + { + for (size = 0, i = first; i < last; i++) + size += strlen (list[i]) + 1; + result = xmalloc (size + 1); + + for (i = first; i < last; i++) + { + strcpy (result + offset, list[i]); + offset += strlen (list[i]); + if (i + 1 < last) + { + result[offset++] = ' '; + result[offset] = 0; + } + } + } + + for (i = 0; i < len; i++) + free (list[i]); + free (list); + + return (result); +} + +#define slashify_in_quotes "\\`\"$" + +/* Return an array of tokens, much as the shell might. The tokens are + parsed out of STRING. */ +char ** +history_tokenize (string) + char *string; +{ + char **result = (char **)NULL; + register int i, start, result_index, size; + int len; + + i = result_index = size = 0; + + /* Get a token, and stuff it into RESULT. The tokens are split + exactly where the shell would split them. */ + while (string[i]) + { + int delimiter = 0; + + /* Skip leading whitespace. */ + for (; string[i] && whitespace (string[i]); i++) + ; + if (!string[i] || string[i] == history_comment_char) + return (result); + + start = i; + + if (member (string[i], "()\n")) + { + i++; + goto got_token; + } + + if (member (string[i], "<>;&|$")) + { + int peek = string[i + 1]; + + if (peek == string[i] && peek != '$') + { + if (peek == '<' && string[i + 2] == '-') + i++; + i += 2; + goto got_token; + } + else + { + if ((peek == '&' && (string[i] == '>' || string[i] == '<')) || + ((peek == '>') && (string[i] == '&')) || + ((peek == '(') && (string[i] == '$'))) + { + i += 2; + goto got_token; + } + } + if (string[i] != '$') + { + i++; + goto got_token; + } + } + + /* Get word from string + i; */ + + if (member (string[i], "\"'`")) + delimiter = string[i++]; + + for (; string[i]; i++) + { + if (string[i] == '\\' && string[i + 1] == '\n') + { + i++; + continue; + } + + if (string[i] == '\\' && delimiter != '\'' && + (delimiter != '"' || member (string[i], slashify_in_quotes))) + { + i++; + continue; + } + + if (delimiter && string[i] == delimiter) + { + delimiter = 0; + continue; + } + + if (!delimiter && (member (string[i], " \t\n;&()|<>"))) + break; + + if (!delimiter && member (string[i], "\"'`")) + delimiter = string[i]; + } + got_token: + + len = i - start; + if (result_index + 2 >= size) + result = (char **)xrealloc (result, ((size += 10) * sizeof (char *))); + result[result_index] = xmalloc (1 + len); + strncpy (result[result_index], string + start, len); + result[result_index][len] = '\0'; + result[++result_index] = (char *)NULL; + } + + return (result); +} + +#if defined (STATIC_MALLOC) + +/* **************************************************************** */ +/* */ +/* xmalloc and xrealloc () */ +/* */ +/* **************************************************************** */ + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)xmalloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "history: Out of virtual memory!\n"); + abort (); +} +#endif /* STATIC_MALLOC */ + +/* **************************************************************** */ +/* */ +/* Test Code */ +/* */ +/* **************************************************************** */ +#ifdef TEST +main () +{ + char line[1024], *t; + int done = 0; + + line[0] = 0; + + while (!done) + { + fprintf (stdout, "history%% "); + t = gets (line); + + if (!t) + strcpy (line, "quit"); + + if (line[0]) + { + char *expansion; + int result; + + using_history (); + + result = history_expand (line, &expansion); + strcpy (line, expansion); + free (expansion); + if (result) + fprintf (stderr, "%s\n", line); + + if (result < 0) + continue; + + add_history (line); + } + + if (strcmp (line, "quit") == 0) done = 1; + if (strcmp (line, "save") == 0) write_history (0); + if (strcmp (line, "read") == 0) read_history (0); + if (strcmp (line, "list") == 0) + { + register HIST_ENTRY **the_list = history_list (); + register int i; + + if (the_list) + for (i = 0; the_list[i]; i++) + fprintf (stdout, "%d: %s\n", i + history_base, the_list[i]->line); + } + if (strncmp (line, "delete", strlen ("delete")) == 0) + { + int which; + if ((sscanf (line + strlen ("delete"), "%d", &which)) == 1) + { + HIST_ENTRY *entry = remove_history (which); + if (!entry) + fprintf (stderr, "No such entry %d\n", which); + else + { + free (entry->line); + free (entry); + } + } + else + { + fprintf (stderr, "non-numeric arg given to `delete'\n"); + } + } + } +} + +#endif /* TEST */ + +/* +* Local variables: +* compile-command: "gcc -g -DTEST -o history history.c" +* end: +*/ diff --git a/history.h b/history.h new file mode 100644 index 0000000..745e61c --- /dev/null +++ b/history.h @@ -0,0 +1,180 @@ +/* History.h -- the names of functions that you can call in history. */ + +/* The structure used to store a history entry. */ +typedef struct _hist_entry { + char *line; + char *data; +} HIST_ENTRY; + +/* A structure used to pass the current state of the history stuff around. */ +typedef struct _hist_state { + HIST_ENTRY **entries; /* Pointer to the entries themselves. */ + int offset; /* The location pointer within this array. */ + int length; /* Number of elements within this array. */ + int size; /* Number of slots allocated to this array. */ + int flags; +} HISTORY_STATE; + +/* Flag values for the `flags' member of HISTORY_STATE. */ +#define HS_STIFLED 0x01 + +/* Initialization and state management. */ + +/* Begin a session in which the history functions might be used. This + just initializes the interactive variables. */ +extern void using_history (); + +/* Return the current HISTORY_STATE of the history. */ +extern HISTORY_STATE *history_get_history_state (); + +/* Set the state of the current history array to STATE. */ +extern void history_set_history_state (); + +/* Manage the history list. */ + +/* Place STRING at the end of the history list. + The associated data field (if any) is set to NULL. */ +extern void add_history (); + +/* A reasonably useless function, only here for completeness. WHICH + is the magic number that tells us which element to delete. The + elements are numbered from 0. */ +extern HIST_ENTRY *remove_history (); + +/* Make the history entry at WHICH have LINE and DATA. This returns + the old entry so you can dispose of the data. In the case of an + invalid WHICH, a NULL pointer is returned. */ +extern HIST_ENTRY *replace_history_entry (); + +/* Stifle the history list, remembering only MAX number of entries. */ +extern void stifle_history (); + +/* Stop stifling the history. This returns the previous amount the + history was stifled by. The value is positive if the history was + stifled, negative if it wasn't. */ +extern int unstifle_history (); + +/* Return 1 if the history is stifled, 0 if it is not. */ +extern int history_is_stifled (); + +/* Information about the history list. */ + +/* Return a NULL terminated array of HIST_ENTRY which is the current input + history. Element 0 of this list is the beginning of time. If there + is no history, return NULL. */ +extern HIST_ENTRY **history_list (); + +/* Returns the number which says what history element we are now + looking at. */ +extern int where_history (); + +/* Return the history entry at the current position, as determined by + history_offset. If there is no entry there, return a NULL pointer. */ +HIST_ENTRY *current_history (); + +/* Return the history entry which is logically at OFFSET in the history + array. OFFSET is relative to history_base. */ +extern HIST_ENTRY *history_get (); + +/* Return the number of bytes that the primary history entries are using. + This just adds up the lengths of the_history->lines. */ +extern int history_total_bytes (); + +/* Moving around the history list. */ + +/* Set the position in the history list to POS. */ +int history_set_pos (); + +/* Back up history_offset to the previous history entry, and return + a pointer to that entry. If there is no previous entry, return + a NULL pointer. */ +extern HIST_ENTRY *previous_history (); + +/* Move history_offset forward to the next item in the input_history, + and return the a pointer to that entry. If there is no next entry, + return a NULL pointer. */ +extern HIST_ENTRY *next_history (); + +/* Searching the history list. */ + +/* Search the history for STRING, starting at history_offset. + If DIRECTION < 0, then the search is through previous entries, + else through subsequent. If the string is found, then + current_history () is the history entry, and the value of this function + is the offset in the line of that history entry that the string was + found in. Otherwise, nothing is changed, and a -1 is returned. */ +extern int history_search (); + +extern int history_search_prefix (); +/* Search the history for @var{string}, starting at history_offset. + The search is anchored: matching lines must begin with string. */ +/* Search for STRING in the history list, starting at POS, an + absolute index into the list. DIR, if negative, says to search + backwards from POS, else forwards. + Returns the absolute index of the history element where STRING + was found, or -1 otherwise. */ +extern int history_search_pos (); + +/* Managing the history file. */ + +/* Add the contents of FILENAME to the history list, a line at a time. + If FILENAME is NULL, then read from ~/.history. Returns 0 if + successful, or errno if not. */ +extern int read_history (); + +/* Read a range of lines from FILENAME, adding them to the history list. + Start reading at the FROM'th line and end at the TO'th. If FROM + is zero, start at the beginning. If TO is less than FROM, read + until the end of the file. If FILENAME is NULL, then read from + ~/.history. Returns 0 if successful, or errno if not. */ +extern int read_history_range (); + +/* Write the current history to FILENAME. If FILENAME is NULL, + then write the history list to ~/.history. Values returned + are as in read_history (). */ +extern int write_history (); + +/* Append NELEMENT entries to FILENAME. The entries appended are from + the end of the list minus NELEMENTs up to the end of the list. */ +int append_history (); + +/* Truncate the history file, leaving only the last NLINES lines. */ +extern int history_truncate_file (); + +/* History expansion. */ + +/* Expand the string STRING, placing the result into OUTPUT, a pointer + to a string. Returns: + + 0) If no expansions took place (or, if the only change in + the text was the de-slashifying of the history expansion + character) + 1) If expansions did take place + -1) If there was an error in expansion. + 2) If the returned line should just be printed. + + If an error ocurred in expansion, then OUTPUT contains a descriptive + error message. */ +extern int history_expand (); + +/* Extract a string segment consisting of the FIRST through LAST + arguments present in STRING. Arguments are broken up as in + the shell. */ +extern char *history_arg_extract (); + +/* Return the text of the history event beginning at the current + offset into STRING. */ +extern char *get_history_event (); + +/* Return an array of tokens, much as the shell might. The tokens are + parsed out of STRING. */ +extern char **history_tokenize (); + +/* Exported history variables. */ +extern int history_base; +extern int history_length; +extern int max_input_history; +extern char history_expansion_char; +extern char history_subst_char; +extern char history_comment_char; +extern char *history_no_expand_chars; diff --git a/isearch.c b/isearch.c new file mode 100644 index 0000000..1a0193f --- /dev/null +++ b/isearch.c @@ -0,0 +1,378 @@ +/* **************************************************************** */ +/* */ +/* I-Search and Searching */ +/* */ +/* **************************************************************** */ + +/* Copyright (C) 1987,1989 Free Software Foundation, Inc. + + This file contains the Readline Library (the Library), a set of + routines for providing Emacs style line input to programs that ask + for it. + + The Library is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + The Library is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif + +#include "memalloc.h" +#include "readline.h" +#include "history.h" + +#define STREQ(a, b) (((a)[0] == (b)[0]) && (strcmp ((a), (b)) == 0)) +#define STREQN(a, b, n) (((a)[0] == (b)[0]) && (strncmp ((a), (b), (n)) == 0)) + +/* Variables imported from other files in the readline library. */ +extern Keymap _rl_keymap; +extern HIST_ENTRY *saved_line_for_history; +extern int rl_line_buffer_len; +extern int rl_point, rl_end; +extern char *rl_line_buffer; + +extern char *xmalloc (), *xrealloc (); + +static int rl_search_history (); + +/* Last line found by the current incremental search, so we don't `find' + identical lines many times in a row. */ +static char *prev_line_found; + +/* Search backwards through the history looking for a string which is typed + interactively. Start with the current line. */ +rl_reverse_search_history (sign, key) + int sign; + int key; +{ + return (rl_search_history (-sign, key)); +} + +/* Search forwards through the history looking for a string which is typed + interactively. Start with the current line. */ +rl_forward_search_history (sign, key) + int sign; + int key; +{ + return (rl_search_history (sign, key)); +} + +/* Display the current state of the search in the echo-area. + SEARCH_STRING contains the string that is being searched for, + DIRECTION is zero for forward, or 1 for reverse, + WHERE is the history list number of the current line. If it is + -1, then this line is the starting one. */ +static void +rl_display_search (search_string, reverse_p, where) + char *search_string; + int reverse_p, where; +{ + char *message; + + message = xmalloc (1 + (search_string ? strlen (search_string) : 0) + 30); + *message = '\0'; + +#if defined (NOTDEF) + if (where != -1) + sprintf (message, "[%d]", where + history_base); +#endif /* NOTDEF */ + + strcat (message, "("); + + if (reverse_p) + strcat (message, "reverse-"); + + strcat (message, "i-search)`"); + + if (search_string) + strcat (message, search_string); + + strcat (message, "': "); + rl_message ("%s", message, 0); + free (message); + rl_redisplay (); +} + +/* Search through the history looking for an interactively typed string. + This is analogous to i-search. We start the search in the current line. + DIRECTION is which direction to search; >= 0 means forward, < 0 means + backwards. */ +static int +rl_search_history (direction, invoking_key) + int direction; + int invoking_key; +{ + /* The string that the user types in to search for. */ + char *search_string; + + /* The current length of SEARCH_STRING. */ + int search_string_index; + + /* The amount of space that SEARCH_STRING has allocated to it. */ + int search_string_size; + + /* The list of lines to search through. */ + char **lines, *allocated_line = (char *)NULL; + + /* The length of LINES. */ + int hlen; + + /* Where we get LINES from. */ + HIST_ENTRY **hlist = history_list (); + + register int i = 0; + int orig_point = rl_point; + int orig_line = where_history (); + int last_found_line = orig_line; + int c, done = 0, found, failed, sline_len; + + /* The line currently being searched. */ + char *sline; + + /* Offset in that line. */ + int line_index; + + /* Non-zero if we are doing a reverse search. */ + int reverse = (direction < 0); + + /* Create an arrary of pointers to the lines that we want to search. */ + maybe_replace_line (); + if (hlist) + for (i = 0; hlist[i]; i++); + + /* Allocate space for this many lines, +1 for the current input line, + and remember those lines. */ + lines = (char **)xmalloc ((1 + (hlen = i)) * sizeof (char *)); + for (i = 0; i < hlen; i++) + lines[i] = hlist[i]->line; + + if (saved_line_for_history) + lines[i] = saved_line_for_history->line; + else + { + /* Keep track of this so we can free it. */ + allocated_line = xmalloc (1 + strlen (rl_line_buffer)); + strcpy (allocated_line, &rl_line_buffer[0]); + lines[i] = allocated_line; + } + + hlen++; + + /* The line where we start the search. */ + i = orig_line; + + /* Initialize search parameters. */ + search_string = xmalloc (search_string_size = 128); + *search_string = '\0'; + search_string_index = 0; + prev_line_found = (char *)0; /* XXX */ + + /* Normalize DIRECTION into 1 or -1. */ + direction = (direction >= 0) ? 1 : -1; + + rl_display_search (search_string, reverse, -1); + + sline = rl_line_buffer; + sline_len = strlen (sline); + line_index = rl_point; + + found = failed = 0; + while (!done) + { + Function *f = (Function *)NULL; + + /* Read a key and decide how to proceed. */ + c = rl_read_key (); + + /* Hack C to Do What I Mean. */ + if (_rl_keymap[c].type == ISFUNC) + { + f = _rl_keymap[c].function; + + if (f == rl_reverse_search_history) + c = reverse ? -1 : -2; + else if (f == rl_forward_search_history) + c = !reverse ? -1 : -2; + } + + switch (c) + { + case ESC: + done = 1; + continue; + + case -1: + if (!search_string_index) + continue; + else + { + if (reverse) + --line_index; + else + { + if (line_index != sline_len) + ++line_index; + else + ding (); + } + } + break; + + /* switch directions */ + case -2: + direction = -direction; + reverse = (direction < 0); + break; + + case CTRL ('G'): + strcpy (rl_line_buffer, lines[orig_line]); + rl_point = orig_point; + rl_end = strlen (rl_line_buffer); + rl_clear_message (); + free (allocated_line); + free (lines); + return 0; + + default: + if (CTRL_CHAR (c) || META_CHAR (c) || c == RUBOUT) + { + rl_execute_next (c); + done = 1; + continue; + } + else + { + /* Add character to search string and continue search. */ + if (search_string_index + 2 >= search_string_size) + { + search_string_size += 128; + search_string = xrealloc (search_string, search_string_size); + } + search_string[search_string_index++] = c; + search_string[search_string_index] = '\0'; + break; + } + } + + found = failed = 0; + while (1) + { + int limit = sline_len - search_string_index + 1; + + /* Search the current line. */ + while (reverse ? (line_index >= 0) : (line_index < limit)) + { + if (STREQN(search_string, sline + line_index, search_string_index)) + { + found++; + break; + } + else + line_index += direction; + } + if (found) + break; + + /* Move to the next line, but skip new copies of the line + we just found and lines shorter than the string we're + searching for. */ + do + { + /* Move to the next line. */ + i += direction; + + /* At limit for direction? */ + if (reverse ? (i < 0) : (i == hlen)) + { + failed++; + break; + } + + /* We will need these later. */ + sline = lines[i]; + sline_len = strlen (sline); + } + while ((prev_line_found && STREQ (prev_line_found, lines[i])) || + (search_string_index > sline_len)); + + if (failed) + break; + + /* Now set up the line for searching... */ + if (reverse) + line_index = sline_len - search_string_index; + else + line_index = 0; + } + + if (failed) + { + /* We cannot find the search string. Ding the bell. */ + ding (); + i = last_found_line; + continue; /* XXX - was break */ + } + + /* We have found the search string. Just display it. But don't + actually move there in the history list until the user accepts + the location. */ + if (found) + { + int line_len; + + prev_line_found = lines[i]; + line_len = strlen (lines[i]); + + if (line_len >= rl_line_buffer_len) + rl_extend_line_buffer (line_len); + + strcpy (rl_line_buffer, lines[i]); + rl_point = line_index; + rl_end = line_len; + last_found_line = i; + rl_display_search (search_string, reverse, (i == orig_line) ? -1 : i); + } + } + + /* The searching is over. The user may have found the string that she + was looking for, or else she may have exited a failing search. If + LINE_INDEX is -1, then that shows that the string searched for was + not found. We use this to determine where to place rl_point. */ + + /* First put back the original state. */ + strcpy (rl_line_buffer, lines[orig_line]); + + /* Free the search string. */ + free (search_string); + + if (last_found_line < orig_line) + rl_get_previous_history (orig_line - last_found_line); + else + rl_get_next_history (last_found_line - orig_line); + + /* If the string was not found, put point at the end of the line. */ + if (line_index < 0) + line_index = strlen (rl_line_buffer); + rl_point = line_index; + rl_clear_message (); + + free (allocated_line); + free (lines); + + return 0; +} diff --git a/keymaps.c b/keymaps.c new file mode 100644 index 0000000..da59b69 --- /dev/null +++ b/keymaps.c @@ -0,0 +1,196 @@ +/* keymaps.c -- Functions and keymaps for the GNU Readline library. */ + +/* Copyright (C) 1988,1989 Free Software Foundation, Inc. + + This file is part of GNU Readline, a library for reading lines + of text with interactive input and history editing. + + Readline is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 1, or (at your option) any + later version. + + Readline is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + You should have received a copy of the GNU General Public License + along with Readline; see the file COPYING. If not, write to the Free + Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include "rlconf.h" +#include "keymaps.h" +#include "emacs_keymap.c" + +#if defined (VI_MODE) +#include "vi_keymap.c" +#endif + +extern int rl_do_lowercase_version (); +extern int rl_rubout (), rl_insert (); + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + +/* **************************************************************** */ +/* */ +/* Functions for manipulating Keymaps. */ +/* */ +/* **************************************************************** */ + + +/* Return a new, empty keymap. + Free it with free() when you are done. */ +Keymap +rl_make_bare_keymap () +{ + register int i; + Keymap keymap = (Keymap)xmalloc (KEYMAP_SIZE * sizeof (KEYMAP_ENTRY)); + + for (i = 0; i < KEYMAP_SIZE; i++) + { + keymap[i].type = ISFUNC; + keymap[i].function = (Function *)NULL; + } + + for (i = 'A'; i < ('Z' + 1); i++) + { + keymap[i].type = ISFUNC; + keymap[i].function = rl_do_lowercase_version; + } + + return (keymap); +} + +/* Return a new keymap which is a copy of MAP. */ +Keymap +rl_copy_keymap (map) + Keymap map; +{ + register int i; + Keymap temp = rl_make_bare_keymap (); + + for (i = 0; i < KEYMAP_SIZE; i++) + { + temp[i].type = map[i].type; + temp[i].function = map[i].function; + } + return (temp); +} + +/* Return a new keymap with the printing characters bound to rl_insert, + the uppercase Meta characters bound to run their lowercase equivalents, + and the Meta digits bound to produce numeric arguments. */ +Keymap +rl_make_keymap () +{ + register int i; + Keymap newmap; + + newmap = rl_make_bare_keymap (); + + /* All ASCII printing characters are self-inserting. */ + for (i = ' '; i < 126; i++) + newmap[i].function = rl_insert; + + newmap[TAB].function = rl_insert; + newmap[RUBOUT].function = rl_rubout; + newmap[CTRL('H')].function = rl_rubout; + +#if KEYMAP_SIZE > 128 + /* Printing characters in some 8-bit character sets. */ + for (i = 128; i < 160; i++) + newmap[i].function = rl_insert; + + /* ISO Latin-1 printing characters should self-insert. */ + for (i = 160; i < 256; i++) + newmap[i].function = rl_insert; +#endif /* KEYMAP_SIZE > 128 */ + + return (newmap); +} + +/* Free the storage associated with MAP. */ +void +rl_discard_keymap (map) + Keymap (map); +{ + int i; + + if (!map) + return; + + for (i = 0; i < KEYMAP_SIZE; i++) + { + switch (map[i].type) + { + case ISFUNC: + break; + + case ISKMAP: + rl_discard_keymap ((Keymap)map[i].function); + break; + + case ISMACR: + free ((char *)map[i].function); + break; + } + } +} + +#if defined (STATIC_MALLOC) + +/* **************************************************************** */ +/* */ +/* xmalloc and xrealloc () */ +/* */ +/* **************************************************************** */ + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)malloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "readline: Out of virtual memory!\n"); + abort (); +} +#endif /* STATIC_MALLOC */ diff --git a/keymaps.h b/keymaps.h new file mode 100644 index 0000000..f0eda3d --- /dev/null +++ b/keymaps.h @@ -0,0 +1,95 @@ +/* keymaps.h -- Manipulation of readline keymaps. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#ifndef _KEYMAPS_H_ +#define _KEYMAPS_H_ + +#if defined (READLINE_LIBRARY) +# include "chardefs.h" +#else +# include +#endif + +#if !defined (__FUNCTION_DEF) +# define __FUNCTION_DEF +typedef int Function (); +typedef void VFunction (); +typedef char *CPFunction (); +typedef char **CPPFunction (); +#endif + +/* A keymap contains one entry for each key in the ASCII set. + Each entry consists of a type and a pointer. + POINTER is the address of a function to run, or the + address of a keymap to indirect through. + TYPE says which kind of thing POINTER is. */ +typedef struct _keymap_entry { + char type; + Function *function; +} KEYMAP_ENTRY; + +/* This must be large enough to hold bindings for all of the characters + in a desired character set (e.g, 128 for ASCII, 256 for ISO Latin-x, + and so on). */ +#define KEYMAP_SIZE 256 + +/* I wanted to make the above structure contain a union of: + union { Function *function; struct _keymap_entry *keymap; } value; + but this made it impossible for me to create a static array. + Maybe I need C lessons. */ + +typedef KEYMAP_ENTRY KEYMAP_ENTRY_ARRAY[KEYMAP_SIZE]; +typedef KEYMAP_ENTRY *Keymap; + +/* The values that TYPE can have in a keymap entry. */ +#define ISFUNC 0 +#define ISKMAP 1 +#define ISMACR 2 + +extern KEYMAP_ENTRY_ARRAY emacs_standard_keymap, emacs_meta_keymap, emacs_ctlx_keymap; +extern KEYMAP_ENTRY_ARRAY vi_insertion_keymap, vi_movement_keymap; + +/* Return a new, empty keymap. + Free it with free() when you are done. */ +extern Keymap rl_make_bare_keymap (); + +/* Return a new keymap which is a copy of MAP. */ +extern Keymap rl_copy_keymap (); + +/* Return a new keymap with the printing characters bound to rl_insert, + the lowercase Meta characters bound to run their equivalents, and + the Meta digits bound to produce numeric arguments. */ +extern Keymap rl_make_keymap (); + +extern void rl_discard_keymap (); + +/* Return the keymap corresponding to a given name. Names look like + `emacs' or `emacs-meta' or `vi-insert'. */ +extern Keymap rl_get_keymap_by_name (); + +/* Return the current keymap. */ +extern Keymap rl_get_keymap (); + +/* Set the current keymap to MAP. */ +extern void rl_set_keymap (); + +#endif /* _KEYMAPS_H_ */ diff --git a/memalloc.h b/memalloc.h new file mode 100644 index 0000000..750d53d --- /dev/null +++ b/memalloc.h @@ -0,0 +1,56 @@ +/* memalloc.h -- consolidate code for including alloca.h or malloc.h and + defining alloca. */ + +/* Copyright (C) 1993 Free Software Foundation, Inc. + + This file is part of GNU Bash, the Bourne Again SHell. + + Bash is free software; you can redistribute it and/or modify it under + the terms of the GNU General Public License as published by the Free + Software Foundation; either version 2, or (at your option) any later + version. + + Bash is distributed in the hope that it will be useful, but WITHOUT ANY + WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License along + with Bash; see the file COPYING. If not, write to the Free Software + Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (__MEMALLOC_H__) +# define __MEMALLOC_H__ + +#if defined (sparc) && defined (sun) && !defined (HAVE_ALLOCA_H) +# define HAVE_ALLOCA_H +#endif + +#if defined (__GNUC__) && !defined (HAVE_ALLOCA) +# define HAVE_ALLOCA +#endif + +#if defined (HAVE_ALLOCA_H) && !defined (HAVE_ALLOCA) +# define HAVE_ALLOCA +#endif /* HAVE_ALLOCA_H && !HAVE_ALLOCA */ + +#if !defined (BUILDING_MAKEFILE) + +#if defined (__GNUC__) +# undef alloca +# define alloca __builtin_alloca +#else /* !__GNUC__ */ +# if defined (HAVE_ALLOCA_H) +# if defined (IBMESA) +# include +# else /* !IBMESA */ +# include +# endif /* !IBMESA */ +# else +extern char *alloca (); +# endif /* !HAVE_ALLOCA_H */ +#endif /* !__GNUC__ */ + +#endif /* !BUILDING_MAKEFILE */ + +#endif /* __MEMALLOC_H__ */ diff --git a/parens.c b/parens.c new file mode 100644 index 0000000..57a9777 --- /dev/null +++ b/parens.c @@ -0,0 +1,130 @@ +/* parens.c -- Implemenation of matching parenthesis feature. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include "rlconf.h" + +#if !defined (PAREN_MATCHING) + +rl_insert_close (count, invoking_key) + int count, invoking_key; +{ + return (rl_insert (count, invoking_key)); +} + +#else /* PAREN_MATCHING */ + +#include +#include +#if defined (FD_SET) +# include +#endif /* FD_SET */ +#include "readline.h" + +extern int rl_explicit_arg; + +/* Non-zero means try to blink the matching open parenthesis when the + close parenthesis is inserted. */ +#if defined (FD_SET) +int rl_blink_matching_paren = 1; +#else /* !FD_SET */ +int rl_blink_matching_paren = 0; +#endif /* !FD_SET */ + +static int find_matching_open (); + +rl_insert_close (count, invoking_key) + int count, invoking_key; +{ + if (rl_explicit_arg || !rl_blink_matching_paren) + rl_insert (count, invoking_key); + else + { +#if defined (FD_SET) + int orig_point, match_point, ready; + struct timeval timer; + fd_set readfds; + + rl_insert (1, invoking_key); + rl_redisplay (); + match_point = + find_matching_open (rl_line_buffer, rl_point - 2, invoking_key); + + /* Emacs might message or ring the bell here, but I don't. */ + if (match_point < 0) + return -1; + + FD_ZERO (&readfds); + FD_SET (fileno (rl_instream), &readfds); + timer.tv_sec = 1; + timer.tv_usec = 500; + + orig_point = rl_point; + rl_point = match_point; + rl_redisplay (); + ready = select (1, &readfds, (fd_set *)NULL, (fd_set *)NULL, &timer); + rl_point = orig_point; +#else /* !FD_SET */ + rl_insert (count, invoking_key); +#endif /* !FD_SET */ + } + return 0; +} + +static int +find_matching_open (string, from, closer) + char *string; + int from, closer; +{ + register int i; + int opener, level, delimiter; + + switch (closer) + { + case ']': opener = '['; break; + case '}': opener = '{'; break; + case ')': opener = '('; break; + default: + return (-1); + } + + level = 1; /* The closer passed in counts as 1. */ + delimiter = 0; /* Delimited state unknown. */ + + for (i = from; i > -1; i--) + { + if (delimiter && (string[i] == delimiter)) + delimiter = 0; + else if ((string[i] == '\'') || (string[i] == '"')) + delimiter = rl_line_buffer[i]; + else if (!delimiter && (string[i] == closer)) + level++; + else if (!delimiter && (string[i] == opener)) + level--; + + if (!level) + break; + } + return (i); +} + +#endif /* PAREN_MATCHING */ diff --git a/posixstat.h b/posixstat.h new file mode 100644 index 0000000..7d1cece --- /dev/null +++ b/posixstat.h @@ -0,0 +1,149 @@ +/* posixstat.h -- Posix stat(2) definitions for systems that + don't have them. */ + +/* Copyright (C) 1987,1991 Free Software Foundation, Inc. + + This file is part of GNU Bash, the Bourne Again SHell. + + Bash is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + Bash is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY + or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public + License for more details. + + You should have received a copy of the GNU General Public License + along with Bash; see the file COPYING. If not, write to the Free + Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */ + +/* This file should be included instead of . + It relies on the local sys/stat.h to work though. */ +#if !defined (_POSIXSTAT_H) +#define _POSIXSTAT_H + +#include + +#if defined (isc386) +# if !defined (S_IFDIR) +# define S_IFDIR 0040000 +# endif /* !S_IFDIR */ +# if !defined (S_IFMT) +# define S_IFMT 0170000 +# endif /* !S_IFMT */ +#endif /* isc386 */ + +/* This text is taken directly from the Cadmus I was trying to + compile on: + the following MACROs are defined for X/OPEN compatibility + however, is the param correct ?? + #define S_ISBLK(s) ((s.st_mode & S_IFMT) == S_IFBLK) + + Well, the answer is no. Thus... */ +#if defined (BrainDeath) +# undef S_ISBLK +# undef S_ISCHR +# undef S_ISDIR +# undef S_ISFIFO +# undef S_ISREG +#endif /* BrainDeath */ + +/* Posix 1003.1 5.6.1.1 file types */ + +/* Some Posix-wannabe systems define _S_IF* macros instead of S_IF*, but + do not provide the S_IS* macros that Posix requires. */ + +#if defined (_S_IFMT) && !defined (S_IFMT) +#define S_IFMT _S_IFMT +#endif +#if defined (_S_IFIFO) && !defined (S_IFIFO) +#define S_IFIFO _S_IFIFO +#endif +#if defined (_S_IFCHR) && !defined (S_IFCHR) +#define S_IFCHR _S_IFCHR +#endif +#if defined (_S_IFDIR) && !defined (S_IFDIR) +#define S_IFDIR _S_IFDIR +#endif +#if defined (_S_IFBLK) && !defined (S_IFBLK) +#define S_IFBLK _S_IFBLK +#endif +#if defined (_S_IFREG) && !defined (S_IFREG) +#define S_IFREG _S_IFREG +#endif +#if defined (_S_IFLNK) && !defined (S_IFLNK) +#define S_IFLNK _S_IFLNK +#endif +#if defined (_S_IFSOCK) && !defined (S_IFSOCK) +#define S_IFSOCK _S_IFSOCK +#endif + +/* Test for each symbol individually and define the ones necessary (some + systems claiming Posix compatibility define some but not all). */ + +#if defined (S_IFBLK) && !defined (S_ISBLK) +#define S_ISBLK(m) (((m)&S_IFMT) == S_IFBLK) /* block device */ +#endif + +#if defined (S_IFCHR) && !defined (S_ISCHR) +#define S_ISCHR(m) (((m)&S_IFMT) == S_IFCHR) /* character device */ +#endif + +#if defined (S_IFDIR) && !defined (S_ISDIR) +#define S_ISDIR(m) (((m)&S_IFMT) == S_IFDIR) /* directory */ +#endif + +#if defined (S_IFREG) && !defined (S_ISREG) +#define S_ISREG(m) (((m)&S_IFMT) == S_IFREG) /* file */ +#endif + +#if defined (S_IFIFO) && !defined (S_ISFIFO) +#define S_ISFIFO(m) (((m)&S_IFMT) == S_IFIFO) /* fifo - named pipe */ +#endif + +#if defined (S_IFLNK) && !defined (S_ISLNK) +#define S_ISLNK(m) (((m)&S_IFMT) == S_IFLNK) /* symbolic link */ +#endif + +#if defined (S_IFSOCK) && !defined (S_ISSOCK) +#define S_ISSOCK(m) (((m)&S_IFMT) == S_IFSOCK) /* socket */ +#endif + +/* + * POSIX 1003.1 5.6.1.2 File Modes + */ + +#if !defined (S_IRWXU) +# if !defined (S_IREAD) +# define S_IREAD 00400 +# define S_IWRITE 00200 +# define S_IEXEC 00100 +# endif /* S_IREAD */ + +# if !defined (S_IRUSR) +# define S_IRUSR S_IREAD /* read, owner */ +# define S_IWUSR S_IWRITE /* write, owner */ +# define S_IXUSR S_IEXEC /* execute, owner */ + +# define S_IRGRP (S_IREAD >> 3) /* read, group */ +# define S_IWGRP (S_IWRITE >> 3) /* write, group */ +# define S_IXGRP (S_IEXEC >> 3) /* execute, group */ + +# define S_IROTH (S_IREAD >> 6) /* read, other */ +# define S_IWOTH (S_IWRITE >> 6) /* write, other */ +# define S_IXOTH (S_IEXEC >> 6) /* execute, other */ +# endif /* !S_IRUSR */ + +# define S_IRWXU (S_IRUSR | S_IWUSR | S_IXUSR) +# define S_IRWXG (S_IRGRP | S_IWGRP | S_IXGRP) +# define S_IRWXO (S_IROTH | S_IWOTH | S_IXOTH) +#endif /* !S_IRWXU */ + +/* These are non-standard, but are used in builtins.c$symbolic_umask() */ +#define S_IRUGO (S_IRUSR | S_IRGRP | S_IROTH) +#define S_IWUGO (S_IWUSR | S_IWGRP | S_IWOTH) +#define S_IXUGO (S_IXUSR | S_IXGRP | S_IXOTH) + +#endif /* _POSIXSTAT_H */ diff --git a/readline.c b/readline.c new file mode 100644 index 0000000..e15a037 --- /dev/null +++ b/readline.c @@ -0,0 +1,3527 @@ +/* readline.c -- a general facility for reading lines of input + with emacs style editing and completion. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include +#include +#if !defined (NO_SYS_FILE) +# include +#endif /* !NO_SYS_FILE */ +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif /* HAVE_UNISTD_H */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include +/* Not all systems declare ERRNO in errno.h... and some systems #define it! */ +#if !defined (errno) +extern int errno; +#endif /* !errno */ + +#include + +#include "posixstat.h" + +/* System-specific feature definitions and include files. */ +#include "rldefs.h" + +#if defined (GWINSZ_IN_SYS_IOCTL) || (defined (VSTATUS) && !defined (SunOS4)) +# include +#endif /* GWINSZ_IN_SYS_IOCTL || VSTATUS */ + +/* Some standard library routines. */ +#include "readline.h" +#include "history.h" + +/* NOTE: Functions and variables prefixed with `_rl_' are + pseudo-global: they are global so they can be shared + between files in the readline library, but are not intended + to be visible to readline callers. */ + +/* Functions imported from other files in the library. */ +extern char *tgetstr (); +extern void rl_prep_terminal (), rl_deprep_terminal (); + +extern void _rl_bind_if_unbound (); + +/* External redisplay functions and variables from display.c */ +extern void _rl_move_vert (); +extern void _rl_update_final (); + +extern void _rl_erase_at_end_of_line (); +extern void _rl_move_cursor_relative (); + +extern int _rl_vis_botlin; +extern int _rl_last_c_pos; +extern int _rl_horizontal_scroll_mode; +extern int rl_display_fixed; +extern char *rl_display_prompt; + +/* Variables imported from complete.c. */ +extern char *rl_completer_word_break_characters; +extern char *rl_basic_word_break_characters; +extern int rl_completion_query_items; +extern int rl_complete_with_tilde_expansion; + +#if defined (VI_MODE) +extern void _rl_vi_set_last (); +extern void _rl_vi_reset_last (); +extern void _rl_vi_done_inserting (); +#endif /* VI_MODE */ + +/* Forward declarations used in this file. */ +void _rl_free_history_entry (); + +int _rl_dispatch (); +void _rl_set_screen_size (); +int _rl_output_character_function (); + +static char *readline_internal (); +static void readline_initialize_everything (); +static int init_terminal_io (); +static void start_using_history (); +static void bind_arrow_keys (); + +#if !defined (__GO32__) +static void readline_default_bindings (); +#endif /* !__GO32__ */ + +#if defined (__GO32__) +# include +# undef HANDLE_SIGNALS +#endif /* __GO32__ */ + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + + +/* **************************************************************** */ +/* */ +/* Line editing input utility */ +/* */ +/* **************************************************************** */ + +static char *LibraryVersion = "2.0"; + +/* A pointer to the keymap that is currently in use. + By default, it is the standard emacs keymap. */ +Keymap _rl_keymap = emacs_standard_keymap; + +/* The current style of editing. */ +int rl_editing_mode = emacs_mode; + +/* Non-zero if the previous command was a kill command. */ +static int last_command_was_kill = 0; + +/* The current value of the numeric argument specified by the user. */ +int rl_numeric_arg = 1; + +/* Non-zero if an argument was typed. */ +int rl_explicit_arg = 0; + +/* Temporary value used while generating the argument. */ +int rl_arg_sign = 1; + +/* Non-zero means we have been called at least once before. */ +static int rl_initialized = 0; + +/* If non-zero, this program is running in an EMACS buffer. */ +static int running_in_emacs = 0; + +/* The current offset in the current input line. */ +int rl_point; + +/* Mark in the current input line. */ +int rl_mark; + +/* Length of the current input line. */ +int rl_end; + +/* Make this non-zero to return the current input_line. */ +int rl_done; + +/* The last function executed by readline. */ +Function *rl_last_func = (Function *)NULL; + +/* Top level environment for readline_internal (). */ +static jmp_buf readline_top_level; + +/* The streams we interact with. */ +static FILE *in_stream, *out_stream; + +/* The names of the streams that we do input and output to. */ +FILE *rl_instream = (FILE *)NULL; +FILE *rl_outstream = (FILE *)NULL; + +/* Non-zero means echo characters as they are read. */ +int readline_echoing_p = 1; + +/* Current prompt. */ +char *rl_prompt; +int rl_visible_prompt_length = 0; + +/* The number of characters read in order to type this complete command. */ +int rl_key_sequence_length = 0; + +/* If non-zero, then this is the address of a function to call just + before readline_internal () prints the first prompt. */ +Function *rl_startup_hook = (Function *)NULL; + +/* What we use internally. You should always refer to RL_LINE_BUFFER. */ +static char *the_line; + +/* The character that can generate an EOF. Really read from + the terminal driver... just defaulted here. */ +int _rl_eof_char = CTRL ('D'); + +/* Non-zero makes this the next keystroke to read. */ +int rl_pending_input = 0; + +/* Pointer to a useful terminal name. */ +char *rl_terminal_name = (char *)NULL; + +/* Non-zero means to always use horizontal scrolling in line display. */ +int _rl_horizontal_scroll_mode = 0; + +/* Non-zero means to display an asterisk at the starts of history lines + which have been modified. */ +int _rl_mark_modified_lines = 0; + +/* The style of `bell' notification preferred. This can be set to NO_BELL, + AUDIBLE_BELL, or VISIBLE_BELL. */ +int _rl_bell_preference = AUDIBLE_BELL; + +/* Line buffer and maintenence. */ +char *rl_line_buffer = (char *)NULL; +int rl_line_buffer_len = 0; +#define DEFAULT_BUFFER_SIZE 256 + +/* Forward declarations used by the display and termcap code. */ +int term_xn; +int screenwidth, screenheight, screenchars; + + +/* **************************************************************** */ +/* */ +/* `Forward' declarations */ +/* */ +/* **************************************************************** */ + +/* Non-zero means do not parse any lines other than comments and + parser directives. */ +unsigned char _rl_parsing_conditionalized_out = 0; + +/* Non-zero means to save keys that we dispatch on in a kbd macro. */ +static int defining_kbd_macro = 0; + +/* Non-zero means to convert characters with the meta bit set to + escape-prefixed characters so we can indirect through + emacs_meta_keymap or vi_escape_keymap. */ +int _rl_convert_meta_chars_to_ascii = 1; + +/* Non-zero means to output characters with the meta bit set directly + rather than as a meta-prefixed escape sequence. */ +int _rl_output_meta_chars = 0; + +/* Non-zero tells rl_delete_text and rl_insert_text to not add to + the undo list. */ +static int doing_an_undo = 0; + +/* **************************************************************** */ +/* */ +/* Top Level Functions */ +/* */ +/* **************************************************************** */ + +/* Non-zero means treat 0200 bit in terminal input as Meta bit. */ +int _rl_meta_flag = 0; /* Forward declaration */ + +/* Read a line of input. Prompt with PROMPT. A NULL PROMPT means + none. A return value of NULL means that EOF was encountered. */ +char * +readline (prompt) + char *prompt; +{ + char *value; + + rl_prompt = prompt; + + /* If we are at EOF return a NULL string. */ + if (rl_pending_input == EOF) + { + rl_pending_input = 0; + return ((char *)NULL); + } + + rl_visible_prompt_length = rl_expand_prompt (rl_prompt); + + rl_initialize (); + rl_prep_terminal (_rl_meta_flag); + +#if defined (HANDLE_SIGNALS) + rl_set_signals (); +#endif + + value = readline_internal (); + rl_deprep_terminal (); + +#if defined (HANDLE_SIGNALS) + rl_clear_signals (); +#endif + + return (value); +} + +/* Read a line of input from the global rl_instream, doing output on + the global rl_outstream. + If rl_prompt is non-null, then that is our prompt. */ +static char * +readline_internal () +{ + int lastc, c, eof_found; + + in_stream = rl_instream; + out_stream = rl_outstream; + + lastc = -1; + eof_found = 0; + + if (rl_startup_hook) + (*rl_startup_hook) (); + + if (!readline_echoing_p) + { + if (rl_prompt) + { + fprintf (out_stream, "%s", rl_prompt); + fflush (out_stream); + } + } + else + { + rl_on_new_line (); + rl_redisplay (); +#if defined (VI_MODE) + if (rl_editing_mode == vi_mode) + rl_vi_insertion_mode (); +#endif /* VI_MODE */ + } + + while (!rl_done) + { + int lk = last_command_was_kill; + int code; + + code = setjmp (readline_top_level); + + if (code) + rl_redisplay (); + + if (!rl_pending_input) + { + /* Then initialize the argument and number of keys read. */ + rl_init_argument (); + rl_key_sequence_length = 0; + } + + c = rl_read_key (); + + /* EOF typed to a non-blank line is a . */ + if (c == EOF && rl_end) + c = NEWLINE; + + /* The character _rl_eof_char typed to blank line, and not as the + previous character is interpreted as EOF. */ + if (((c == _rl_eof_char && lastc != c) || c == EOF) && !rl_end) + { + eof_found = 1; + break; + } + + lastc = c; + _rl_dispatch (c, _rl_keymap); + + /* If there was no change in last_command_was_kill, then no kill + has taken place. Note that if input is pending we are reading + a prefix command, so nothing has changed yet. */ + if (!rl_pending_input) + { + if (lk == last_command_was_kill) + last_command_was_kill = 0; + } + +#if defined (VI_MODE) + /* In vi mode, when you exit insert mode, the cursor moves back + over the previous character. We explicitly check for that here. */ + if (rl_editing_mode == vi_mode && _rl_keymap == vi_movement_keymap) + rl_vi_check (); +#endif /* VI_MODE */ + + if (!rl_done) + rl_redisplay (); + } + + /* Restore the original of this history line, iff the line that we + are editing was originally in the history, AND the line has changed. */ + { + HIST_ENTRY *entry = current_history (); + + if (entry && rl_undo_list) + { + char *temp = savestring (the_line); + rl_revert_line (); + entry = replace_history_entry (where_history (), the_line, + (HIST_ENTRY *)NULL); + _rl_free_history_entry (entry); + + strcpy (the_line, temp); + free (temp); + } + } + + /* At any rate, it is highly likely that this line has an undo list. Get + rid of it now. */ + if (rl_undo_list) + free_undo_list (); + + if (eof_found) + return (char *)NULL; + else + return (savestring (the_line)); +} + +/* **************************************************************** */ +/* */ +/* Character Input Buffering */ +/* */ +/* **************************************************************** */ + +static int pop_index = 0, push_index = 0, ibuffer_len = 511; +static unsigned char ibuffer[512]; + +/* Non-null means it is a pointer to a function to run while waiting for + character input. */ +Function *rl_event_hook = (Function *)NULL; + +#define any_typein (push_index != pop_index) + +/* Add KEY to the buffer of characters to be read. */ +rl_stuff_char (key) + int key; +{ + if (key == EOF) + { + key = NEWLINE; + rl_pending_input = EOF; + } + ibuffer[push_index++] = key; + if (push_index >= ibuffer_len) + push_index = 0; + return push_index; +} + +/* Return the amount of space available in the + buffer for stuffing characters. */ +int +ibuffer_space () +{ + if (pop_index > push_index) + return (pop_index - push_index); + else + return (ibuffer_len - (push_index - pop_index)); +} + +/* Get a key from the buffer of characters to be read. + Return the key in KEY. + Result is KEY if there was a key, or 0 if there wasn't. */ +int +rl_get_char (key) + int *key; +{ + if (push_index == pop_index) + return (0); + + *key = ibuffer[pop_index++]; + + if (pop_index >= ibuffer_len) + pop_index = 0; + + return (1); +} + +/* Stuff KEY into the *front* of the input buffer. + Returns non-zero if successful, zero if there is + no space left in the buffer. */ +int +rl_unget_char (key) + int key; +{ + if (ibuffer_space ()) + { + pop_index--; + if (pop_index < 0) + pop_index = ibuffer_len - 1; + ibuffer[pop_index] = key; + return (1); + } + return (0); +} + +/* If a character is available to be read, then read it + and stuff it into IBUFFER. Otherwise, just return. */ +void +rl_gather_tyi () +{ +#if defined (__GO32__) + char input; + + if (isatty (0)) + { + int i = rl_getc (); + + if (i != EOF) + rl_stuff_char (i); + } + else if (kbhit () && ibuffer_space ()) + rl_stuff_char (getkey ()); +#else /* !__GO32__ */ + + int tty = fileno (in_stream); + register int tem, result = -1; + int chars_avail; + char input; + +#if defined (FIONREAD) + result = ioctl (tty, FIONREAD, &chars_avail); +#endif + +#if defined (O_NDELAY) + if (result == -1) + { + int flags; + + flags = fcntl (tty, F_GETFL, 0); + + fcntl (tty, F_SETFL, (flags | O_NDELAY)); + chars_avail = read (tty, &input, 1); + + fcntl (tty, F_SETFL, flags); + if (chars_avail == -1 && errno == EAGAIN) + return; + } +#endif /* O_NDELAY */ + + /* If there's nothing available, don't waste time trying to read + something. */ + if (chars_avail == 0) + return; + + tem = ibuffer_space (); + + if (chars_avail > tem) + chars_avail = tem; + + /* One cannot read all of the available input. I can only read a single + character at a time, or else programs which require input can be + thwarted. If the buffer is larger than one character, I lose. + Damn! */ + if (tem < ibuffer_len) + chars_avail = 0; + + if (result != -1) + { + while (chars_avail--) + rl_stuff_char (rl_getc (in_stream)); + } + else + { + if (chars_avail) + rl_stuff_char (input); + } +#endif /* !__GO32__ */ +} + +static int next_macro_key (); +/* Read a key, including pending input. */ +int +rl_read_key () +{ + int c; + + rl_key_sequence_length++; + + if (rl_pending_input) + { + c = rl_pending_input; + rl_pending_input = 0; + } + else + { + /* If input is coming from a macro, then use that. */ + if (c = next_macro_key ()) + return (c); + + /* If the user has an event function, then call it periodically. */ + if (rl_event_hook) + { + while (rl_event_hook && !rl_get_char (&c)) + { + (*rl_event_hook) (); + rl_gather_tyi (); + } + } + else + { + if (!rl_get_char (&c)) + c = rl_getc (in_stream); + } + } + + return (c); +} + +/* Found later in this file. */ +static void add_macro_char (), with_macro_input (); + +/* Do the command associated with KEY in MAP. + If the associated command is really a keymap, then read + another key, and dispatch into that map. */ +int +_rl_dispatch (key, map) + register int key; + Keymap map; +{ + int r = 0; + + if (defining_kbd_macro) + add_macro_char (key); + + if (META_CHAR (key) && _rl_convert_meta_chars_to_ascii) + { + if (map[ESC].type == ISKMAP) + { + map = FUNCTION_TO_KEYMAP (map, ESC); + key = UNMETA (key); + rl_key_sequence_length += 2; + return (_rl_dispatch (key, map)); + } + else + ding (); + return 0; + } + + switch (map[key].type) + { + case ISFUNC: + { + Function *func = map[key].function; + + if (func != (Function *)NULL) + { + /* Special case rl_do_lowercase_version (). */ + if (func == rl_do_lowercase_version) + return (_rl_dispatch (to_lower (key), map)); + + r = (*map[key].function)(rl_numeric_arg * rl_arg_sign, key); + + /* If we have input pending, then the last command was a prefix + command. Don't change the state of rl_last_func. Otherwise, + remember the last command executed in this variable. */ + if (!rl_pending_input) + rl_last_func = map[key].function; + } + else + { + rl_abort (); + return -1; + } + } + break; + + case ISKMAP: + if (map[key].function != (Function *)NULL) + { + int newkey; + + rl_key_sequence_length++; + newkey = rl_read_key (); + r = _rl_dispatch (newkey, FUNCTION_TO_KEYMAP (map, key)); + } + else + { + rl_abort (); + return -1; + } + break; + + case ISMACR: + if (map[key].function != (Function *)NULL) + { + char *macro; + + macro = savestring ((char *)map[key].function); + with_macro_input (macro); + return 0; + } + break; + } +#if defined (VI_MODE) + if (rl_editing_mode == vi_mode && _rl_keymap == vi_movement_keymap && + rl_vi_textmod_command (key)) + _rl_vi_set_last (key, rl_numeric_arg, rl_arg_sign); +#endif + return (r); +} + + +/* **************************************************************** */ +/* */ +/* Hacking Keyboard Macros */ +/* */ +/* **************************************************************** */ + +/* The currently executing macro string. If this is non-zero, + then it is a malloc ()'ed string where input is coming from. */ +static char *executing_macro = (char *)NULL; + +/* The offset in the above string to the next character to be read. */ +static int executing_macro_index = 0; + +/* The current macro string being built. Characters get stuffed + in here by add_macro_char (). */ +static char *current_macro = (char *)NULL; + +/* The size of the buffer allocated to current_macro. */ +static int current_macro_size = 0; + +/* The index at which characters are being added to current_macro. */ +static int current_macro_index = 0; + +/* A structure used to save nested macro strings. + It is a linked list of string/index for each saved macro. */ +struct saved_macro { + struct saved_macro *next; + char *string; + int sindex; +}; + +/* The list of saved macros. */ +struct saved_macro *macro_list = (struct saved_macro *)NULL; + +/* Forward declarations of static functions. Thank you C. */ +static void push_executing_macro (), pop_executing_macro (); + +/* This one has to be declared earlier in the file. */ +/* static void add_macro_char (); */ + +/* Set up to read subsequent input from STRING. + STRING is free ()'ed when we are done with it. */ +static void +with_macro_input (string) + char *string; +{ + push_executing_macro (); + executing_macro = string; + executing_macro_index = 0; +} + +/* Return the next character available from a macro, or 0 if + there are no macro characters. */ +static int +next_macro_key () +{ + if (!executing_macro) + return (0); + + if (!executing_macro[executing_macro_index]) + { + pop_executing_macro (); + return (next_macro_key ()); + } + + return (executing_macro[executing_macro_index++]); +} + +/* Save the currently executing macro on a stack of saved macros. */ +static void +push_executing_macro () +{ + struct saved_macro *saver; + + saver = (struct saved_macro *)xmalloc (sizeof (struct saved_macro)); + saver->next = macro_list; + saver->sindex = executing_macro_index; + saver->string = executing_macro; + + macro_list = saver; +} + +/* Discard the current macro, replacing it with the one + on the top of the stack of saved macros. */ +static void +pop_executing_macro () +{ + if (executing_macro) + free (executing_macro); + + executing_macro = (char *)NULL; + executing_macro_index = 0; + + if (macro_list) + { + struct saved_macro *disposer = macro_list; + executing_macro = macro_list->string; + executing_macro_index = macro_list->sindex; + macro_list = macro_list->next; + free (disposer); + } +} + +/* Add a character to the macro being built. */ +static void +add_macro_char (c) + int c; +{ + if (current_macro_index + 1 >= current_macro_size) + { + if (!current_macro) + current_macro = xmalloc (current_macro_size = 25); + else + current_macro = xrealloc (current_macro, current_macro_size += 25); + } + + current_macro[current_macro_index++] = c; + current_macro[current_macro_index] = '\0'; +} + +/* Begin defining a keyboard macro. + Keystrokes are recorded as they are executed. + End the definition with rl_end_kbd_macro (). + If a numeric argument was explicitly typed, then append this + definition to the end of the existing macro, and start by + re-executing the existing macro. */ +rl_start_kbd_macro (ignore1, ignore2) + int ignore1, ignore2; +{ + if (defining_kbd_macro) + { + rl_abort (); + return -1; + } + + if (rl_explicit_arg) + { + if (current_macro) + with_macro_input (savestring (current_macro)); + } + else + current_macro_index = 0; + + defining_kbd_macro = 1; + return 0; +} + +/* Stop defining a keyboard macro. + A numeric argument says to execute the macro right now, + that many times, counting the definition as the first time. */ +rl_end_kbd_macro (count, ignore) + int count, ignore; +{ + if (!defining_kbd_macro) + { + rl_abort (); + return -1; + } + + current_macro_index -= (rl_key_sequence_length - 1); + current_macro[current_macro_index] = '\0'; + + defining_kbd_macro = 0; + + return (rl_call_last_kbd_macro (--count, 0)); +} + +/* Execute the most recently defined keyboard macro. + COUNT says how many times to execute it. */ +rl_call_last_kbd_macro (count, ignore) + int count, ignore; +{ + if (!current_macro) + rl_abort (); + + if (defining_kbd_macro) + { + ding (); /* no recursive macros */ + current_macro[--current_macro_index] = '\0'; /* erase this char */ + return 0; + } + + while (count--) + with_macro_input (savestring (current_macro)); + return 0; +} + +void +_rl_kill_kbd_macro () +{ + if (current_macro) + { + free (current_macro); + current_macro = (char *) NULL; + } + current_macro_size = current_macro_index = 0; + + if (executing_macro) + { + free (executing_macro); + executing_macro = (char *) NULL; + } + executing_macro_index = 0; + + defining_kbd_macro = 0; +} + +/* **************************************************************** */ +/* */ +/* Initializations */ +/* */ +/* **************************************************************** */ + +/* Initliaze readline (and terminal if not already). */ +rl_initialize () +{ + char *t; + + /* If we have never been called before, initialize the + terminal and data structures. */ + if (!rl_initialized) + { + readline_initialize_everything (); + rl_initialized++; + } + + /* Initalize the current line information. */ + rl_point = rl_end = 0; + the_line = rl_line_buffer; + the_line[0] = 0; + + /* We aren't done yet. We haven't even gotten started yet! */ + rl_done = 0; + + /* Check for LC_CTYPE and use its value to decide the defaults for + 8-bit character input and output. */ + t = getenv ("LC_CTYPE"); + if (t && (strcmp (t, "iso-8859-1") == 0 || strcmp (t, "iso_8859_1") == 0)) + { + _rl_meta_flag = 1; + _rl_convert_meta_chars_to_ascii = 0; + _rl_output_meta_chars = 1; + } + + /* Tell the history routines what is going on. */ + start_using_history (); + + /* Make the display buffer match the state of the line. */ + rl_reset_line_state (); + + /* No such function typed yet. */ + rl_last_func = (Function *)NULL; + + /* Parsing of key-bindings begins in an enabled state. */ + _rl_parsing_conditionalized_out = 0; + + return 0; +} + +/* Initialize the entire state of the world. */ +static void +readline_initialize_everything () +{ + /* Find out if we are running in Emacs. */ + running_in_emacs = getenv ("EMACS") != (char *)0; + + /* Set up input and output if they are not already set up. */ + if (!rl_instream) + rl_instream = stdin; + + if (!rl_outstream) + rl_outstream = stdout; + + /* Bind in_stream and out_stream immediately. These values may change, + but they may also be used before readline_internal () is called. */ + in_stream = rl_instream; + out_stream = rl_outstream; + + /* Allocate data structures. */ + if (!rl_line_buffer) + rl_line_buffer = xmalloc (rl_line_buffer_len = DEFAULT_BUFFER_SIZE); + + /* Initialize the terminal interface. */ + init_terminal_io ((char *)NULL); + +#if !defined (__GO32__) + /* Bind tty characters to readline functions. */ + readline_default_bindings (); +#endif /* !__GO32__ */ + + /* Initialize the function names. */ + rl_initialize_funmap (); + + /* Read in the init file. */ + rl_read_init_file ((char *)NULL); + + /* XXX */ + if (_rl_horizontal_scroll_mode && term_xn) + { + screenwidth--; + screenchars -= screenheight; + } + + /* Override the effect of any `set keymap' assignments in the + inputrc file. */ + rl_set_keymap_from_edit_mode (); + + /* Try to bind a common arrow key prefix, if not already bound. */ + bind_arrow_keys (); + + /* If the completion parser's default word break characters haven't + been set yet, then do so now. */ + if (rl_completer_word_break_characters == (char *)NULL) + rl_completer_word_break_characters = rl_basic_word_break_characters; +} + +/* If this system allows us to look at the values of the regular + input editing characters, then bind them to their readline + equivalents, iff the characters are not bound to keymaps. */ +static void +readline_default_bindings () +{ + rltty_set_default_bindings (_rl_keymap); +} + +static void +bind_arrow_keys_internal () +{ + Function *f; + + f = rl_function_of_keyseq ("\033[A", _rl_keymap, (int *)NULL); + if (!f || f == rl_do_lowercase_version) + { + _rl_bind_if_unbound ("\033[A", rl_get_previous_history); + _rl_bind_if_unbound ("\033[B", rl_get_next_history); + _rl_bind_if_unbound ("\033[C", rl_forward); + _rl_bind_if_unbound ("\033[D", rl_backward); + } + + f = rl_function_of_keyseq ("\033OA", _rl_keymap, (int *)NULL); + if (!f || f == rl_do_lowercase_version) + { + _rl_bind_if_unbound ("\033OA", rl_get_previous_history); + _rl_bind_if_unbound ("\033OB", rl_get_next_history); + _rl_bind_if_unbound ("\033OC", rl_forward); + _rl_bind_if_unbound ("\033OD", rl_backward); + } +} + +/* Try and bind the common arrow key prefix after giving termcap and + the inputrc file a chance to bind them and create `real' keymaps + for the arrow key prefix. */ +static void +bind_arrow_keys () +{ + Keymap xkeymap; + + xkeymap = _rl_keymap; + + _rl_keymap = emacs_standard_keymap; + bind_arrow_keys_internal (); + +#if defined (VI_MODE) + _rl_keymap = vi_movement_keymap; + bind_arrow_keys_internal (); +#endif + + _rl_keymap = xkeymap; +} + + +/* **************************************************************** */ +/* */ +/* Numeric Arguments */ +/* */ +/* **************************************************************** */ + +/* Handle C-u style numeric args, as well as M--, and M-digits. */ +static int +rl_digit_loop () +{ + int key, c; + + while (1) + { + rl_message ("(arg: %d) ", rl_arg_sign * rl_numeric_arg); + key = c = rl_read_key (); + + if (_rl_keymap[c].type == ISFUNC && + _rl_keymap[c].function == rl_universal_argument) + { + rl_numeric_arg *= 4; + continue; + } + c = UNMETA (c); + if (digit_p (c)) + { + if (rl_explicit_arg) + rl_numeric_arg = (rl_numeric_arg * 10) + (c - '0'); + else + rl_numeric_arg = (c - '0'); + rl_explicit_arg = 1; + } + else + { + if (c == '-' && !rl_explicit_arg) + { + rl_numeric_arg = 1; + rl_arg_sign = -1; + } + else + { + rl_clear_message (); + return (_rl_dispatch (key, _rl_keymap)); + } + } + } + return 0; +} + +/* Add the current digit to the argument in progress. */ +rl_digit_argument (ignore, key) + int ignore, key; +{ + rl_pending_input = key; + return (rl_digit_loop ()); +} + +/* What to do when you abort reading an argument. */ +rl_discard_argument () +{ + ding (); + rl_clear_message (); + rl_init_argument (); + return 0; +} + +/* Create a default argument. */ +rl_init_argument () +{ + rl_numeric_arg = rl_arg_sign = 1; + rl_explicit_arg = 0; + return 0; +} + +/* C-u, universal argument. Multiply the current argument by 4. + Read a key. If the key has nothing to do with arguments, then + dispatch on it. If the key is the abort character then abort. */ +rl_universal_argument () +{ + rl_numeric_arg *= 4; + return (rl_digit_loop ()); +} + +/* **************************************************************** */ +/* */ +/* Terminal and Termcap */ +/* */ +/* **************************************************************** */ + +static char *term_buffer = (char *)NULL; +static char *term_string_buffer = (char *)NULL; + +static int tcap_initialized = 0; + +/* Non-zero means this terminal can't really do anything. */ +int dumb_term = 0; +/* On Solaris2, sys/types.h #includes sys/reg.h, which #defines PC. + Unfortunately, PC is a global variable used by the termcap library. */ +#undef PC + +#if !defined (__linux__) +/* If this causes problems, remove the `extern'. */ +extern char PC, *BC, *UP; +#endif /* __linux__ */ + +/* Some strings to control terminal actions. These are output by tputs (). */ +char *term_goto, *term_clreol, *term_cr, *term_clrpag, *term_backspace; +char *term_pc; + +/* Non-zero if we determine that the terminal can do character insertion. */ +int terminal_can_insert = 0; + +/* How to insert characters. */ +char *term_im, *term_ei, *term_ic, *term_ip, *term_IC; + +/* How to delete characters. */ +char *term_dc, *term_DC; + +#if defined (HACK_TERMCAP_MOTION) +char *term_forward_char; +#endif /* HACK_TERMCAP_MOTION */ + +/* How to go up a line. */ +char *term_up; + +/* A visible bell, if the terminal can be made to flash the screen. */ +char *visible_bell; + +/* Non-zero means that this terminal has a meta key. */ +int term_has_meta; + +/* The string to write to turn on the meta key, if this term has one. */ +char *term_mm; + +/* The string to write to turn off the meta key, if this term has one. */ +char *term_mo; + +/* The key sequences output by the arrow keys, if this terminal has any. */ +char *term_ku, *term_kd, *term_kr, *term_kl; + +/* How to initialize and reset the arrow keys, if this terminal has any. */ +char *term_ks, *term_ke; + +/* Re-initialize the terminal considering that the TERM/TERMCAP variable + has changed. */ +rl_reset_terminal (terminal_name) + char *terminal_name; +{ + init_terminal_io (terminal_name); + return 0; +} + +/* Set readline's idea of the screen size. TTY is a file descriptor open + to the terminal. If IGNORE_ENV is true, we do not pay attention to the + values of $LINES and $COLUMNS. The tests for TERM_STRING_BUFFER being + non-null serve to check whether or not we have initialized termcap. */ +void +_rl_set_screen_size (tty, ignore_env) + int tty, ignore_env; +{ +#if defined (TIOCGWINSZ) + struct winsize window_size; +#endif /* TIOCGWINSZ */ + +#if defined (TIOCGWINSZ) + if (ioctl (tty, TIOCGWINSZ, &window_size) == 0) + { + screenwidth = (int) window_size.ws_col; + screenheight = (int) window_size.ws_row; + } +#endif /* TIOCGWINSZ */ + + /* Environment variable COLUMNS overrides setting of "co" if IGNORE_ENV + is unset. */ + if (screenwidth <= 0) + { + char *sw; + + if (!ignore_env && (sw = getenv ("COLUMNS"))) + screenwidth = atoi (sw); + + if (screenwidth <= 0 && term_string_buffer) + screenwidth = tgetnum ("co"); + } + + /* Environment variable LINES overrides setting of "li" if IGNORE_ENV + is unset. */ + if (screenheight <= 0) + { + char *sh; + + if (!ignore_env && (sh = getenv ("LINES"))) + screenheight = atoi (sh); + + if (screenheight <= 0 && term_string_buffer) + screenheight = tgetnum ("li"); + } + + /* If all else fails, default to 80x24 terminal. */ + if (screenwidth <= 1) + screenwidth = 80; + + if (screenheight <= 0) + screenheight = 24; + +#if defined (SHELL) + /* If we're being compiled as part of bash, set the environment + variables $LINES and $COLUMNS to new values. */ + set_lines_and_columns (screenheight, screenwidth); +#endif + + if (!term_xn) + screenwidth--; + + screenchars = screenwidth * screenheight; +} + +struct _tc_string { + char *tc_var; + char **tc_value; +}; + +/* This should be kept sorted, just in case we decide to change the + search algorithm to something smarter. */ +static struct _tc_string tc_strings[] = +{ + "DC", &term_DC, + "IC", &term_IC, + "ce", &term_clreol, + "cl", &term_clrpag, + "cr", &term_cr, + "dc", &term_dc, + "ei", &term_ei, + "ic", &term_ic, + "im", &term_im, + "kd", &term_kd, + "kl", &term_kl, + "kr", &term_kr, + "ku", &term_ku, + "ks", &term_ks, + "ke", &term_ke, + "le", &term_backspace, + "mm", &term_mm, + "mo", &term_mo, +#if defined (HACK_TERMCAP_MOTION) + "nd", &term_forward_char, +#endif + "pc", &term_pc, + "up", &term_up, + "vb", &visible_bell, +}; + +#define NUM_TC_STRINGS (sizeof (tc_strings) / sizeof (struct _tc_string)) + +/* Read the desired terminal capability strings into BP. The capabilities + are described in the TC_STRINGS table. */ +static void +get_term_capabilities (bp) + char **bp; +{ + register int i; + + for (i = 0; i < NUM_TC_STRINGS; i++) + *(tc_strings[i].tc_value) = tgetstr (tc_strings[i].tc_var, bp); + tcap_initialized = 1; +} + +static int +init_terminal_io (terminal_name) + char *terminal_name; +{ +#if defined (__GO32__) + screenwidth = ScreenCols (); + screenheight = ScreenRows (); + screenchars = screenwidth * screenheight; + term_cr = "\r"; + term_im = term_ei = term_ic = term_IC = (char *)NULL; + term_up = term_dc = term_DC = visible_bell = (char *)NULL; + + /* Does the __GO32__ have a meta key? I don't know. */ + term_has_meta = 0; + term_mm = term_mo = (char *)NULL; + + /* It probably has arrow keys, but I don't know what they are. */ + term_ku = term_kd = term_kr = term_kl = (char *)NULL; + +#if defined (HACK_TERMCAP_MOTION) + term_forward_char = (char *)NULL; +#endif /* HACK_TERMCAP_MOTION */ + terminal_can_insert = term_xn = 0; + return; +#else /* !__GO32__ */ + + char *term, *buffer; + int tty; + Keymap xkeymap; + + term = terminal_name ? terminal_name : getenv ("TERM"); + + if (!term_string_buffer) + term_string_buffer = xmalloc (2048); + + if (!term_buffer) + term_buffer = xmalloc (2048); + + buffer = term_string_buffer; + + term_clrpag = term_cr = term_clreol = (char *)NULL; + + if (!term) + term = "dumb"; + + if (tgetent (term_buffer, term) <= 0) + { + dumb_term = 1; + screenwidth = 79; + screenheight = 24; + screenchars = 79 * 24; + term_cr = "\r"; + term_im = term_ei = term_ic = term_IC = (char *)NULL; + term_up = term_dc = term_DC = visible_bell = (char *)NULL; + term_ku = term_kd = term_kl = term_kr = (char *)NULL; +#if defined (HACK_TERMCAP_MOTION) + term_forward_char = (char *)NULL; +#endif + terminal_can_insert = 0; + return 0; + } + + get_term_capabilities (&buffer); + + /* Set up the variables that the termcap library expects the application + to provide. */ + PC = term_pc ? *term_pc : 0; + BC = term_backspace; + UP = term_up; + + if (!term_cr) + term_cr = "\r"; + + if (rl_instream) + tty = fileno (rl_instream); + else + tty = 0; + + screenwidth = screenheight = 0; + + term_xn = tgetflag ("am") && tgetflag ("xn"); + + _rl_set_screen_size (tty, 0); + + /* "An application program can assume that the terminal can do + character insertion if *any one of* the capabilities `IC', + `im', `ic' or `ip' is provided." But we can't do anything if + only `ip' is provided, so... */ + terminal_can_insert = (term_IC || term_im || term_ic); + + /* Check to see if this terminal has a meta key and clear the capability + variables if there is none. */ + term_has_meta = (tgetflag ("km") || tgetflag ("MT")); + if (!term_has_meta) + { + term_mm = (char *)NULL; + term_mo = (char *)NULL; + } + + /* Attempt to find and bind the arrow keys. Do not override already + bound keys in an overzealous attempt, however. */ + xkeymap = _rl_keymap; + + _rl_keymap = emacs_standard_keymap; + _rl_bind_if_unbound (term_ku, rl_get_previous_history); + _rl_bind_if_unbound (term_kd, rl_get_next_history); + _rl_bind_if_unbound (term_kr, rl_forward); + _rl_bind_if_unbound (term_kl, rl_backward); + +#if defined (VI_MODE) + _rl_keymap = vi_movement_keymap; + _rl_bind_if_unbound (term_ku, rl_get_previous_history); + _rl_bind_if_unbound (term_kd, rl_get_next_history); + _rl_bind_if_unbound (term_kr, rl_forward); + _rl_bind_if_unbound (term_kl, rl_backward); +#endif /* VI_MODE */ + + _rl_keymap = xkeymap; + +#endif /* !__GO32__ */ + return 0; +} + +char * +rl_get_termcap (cap) + char *cap; +{ + register int i; + + if (tcap_initialized == 0) + return ((char *)NULL); + for (i = 0; i < NUM_TC_STRINGS; i++) + { + if (tc_strings[i].tc_var[0] == cap[0] && strcmp (tc_strings[i].tc_var, cap) == 0) + return *(tc_strings[i].tc_value); + } + return ((char *)NULL); +} + +/* A function for the use of tputs () */ +int +_rl_output_character_function (c) + int c; +{ + return putc (c, out_stream); +} + +/* Write COUNT characters from STRING to the output stream. */ +void +_rl_output_some_chars (string, count) + char *string; + int count; +{ + fwrite (string, 1, count, out_stream); +} + +/* Move the cursor back. */ +backspace (count) + int count; +{ + register int i; + +#if !defined (__GO32__) + if (term_backspace) + for (i = 0; i < count; i++) + tputs (term_backspace, 1, _rl_output_character_function); + else +#endif /* !__GO32__ */ + for (i = 0; i < count; i++) + putc ('\b', out_stream); + return 0; +} + +/* Move to the start of the next line. */ +crlf () +{ +#if defined (NEW_TTY_DRIVER) + tputs (term_cr, 1, _rl_output_character_function); +#endif /* NEW_TTY_DRIVER */ + putc ('\n', out_stream); + return 0; +} + +rl_tty_status (count, key) + int count, key; +{ +#if defined (TIOCSTAT) + ioctl (1, TIOCSTAT, (char *)0); + rl_refresh_line (); +#else + ding (); +#endif + return 0; +} + + +/* **************************************************************** */ +/* */ +/* Utility Functions */ +/* */ +/* **************************************************************** */ + +/* Return 0 if C is not a member of the class of characters that belong + in words, or 1 if it is. */ + +int allow_pathname_alphabetic_chars = 0; +char *pathname_alphabetic_chars = "/-_=~.#$"; + +int +alphabetic (c) + int c; +{ + if (pure_alphabetic (c) || (digit_p (c))) + return (1); + + if (allow_pathname_alphabetic_chars) + return (strchr (pathname_alphabetic_chars, c) != NULL); + else + return (0); +} + +/* Ring the terminal bell. */ +int +ding () +{ + if (readline_echoing_p) + { +#if !defined (__GO32__) + switch (_rl_bell_preference) + { + case NO_BELL: + default: + break; + case VISIBLE_BELL: + if (visible_bell) + { + tputs (visible_bell, 1, _rl_output_character_function); + break; + } + /* FALLTHROUGH */ + case AUDIBLE_BELL: + fprintf (stderr, "\007"); + fflush (stderr); + break; + } +#else /* __GO32__ */ + fprintf (stderr, "\007"); + fflush (stderr); +#endif /* __GO32__ */ + return (0); + } + return (-1); +} + +/* How to abort things. */ +rl_abort (count, key) + int count, key; +{ + ding (); + rl_clear_message (); + rl_init_argument (); + rl_pending_input = 0; + + defining_kbd_macro = 0; + while (executing_macro) + pop_executing_macro (); + + rl_last_func = (Function *)NULL; + longjmp (readline_top_level, 1); +} + +/* Return a copy of the string between FROM and TO. + FROM is inclusive, TO is not. */ +char * +rl_copy_text (from, to) + int from, to; +{ + register int length; + char *copy; + + /* Fix it if the caller is confused. */ + if (from > to) + { + int t = from; + from = to; + to = t; + } + + length = to - from; + copy = xmalloc (1 + length); + strncpy (copy, the_line + from, length); + copy[length] = '\0'; + return (copy); +} + +/* Increase the size of RL_LINE_BUFFER until it has enough space to hold + LEN characters. */ +void +rl_extend_line_buffer (len) + int len; +{ + while (len >= rl_line_buffer_len) + { + rl_line_buffer_len += DEFAULT_BUFFER_SIZE; + rl_line_buffer = xrealloc (rl_line_buffer, rl_line_buffer_len); + } + + the_line = rl_line_buffer; +} + + +/* **************************************************************** */ +/* */ +/* Insert and Delete */ +/* */ +/* **************************************************************** */ + +/* Insert a string of text into the line at point. This is the only + way that you should do insertion. rl_insert () calls this + function. */ +rl_insert_text (string) + char *string; +{ + register int i, l = strlen (string); + + if (rl_end + l >= rl_line_buffer_len) + rl_extend_line_buffer (rl_end + l); + + for (i = rl_end; i >= rl_point; i--) + the_line[i + l] = the_line[i]; + strncpy (the_line + rl_point, string, l); + + /* Remember how to undo this if we aren't undoing something. */ + if (!doing_an_undo) + { + /* If possible and desirable, concatenate the undos. */ + if ((l == 1) && + rl_undo_list && + (rl_undo_list->what == UNDO_INSERT) && + (rl_undo_list->end == rl_point) && + (rl_undo_list->end - rl_undo_list->start < 20)) + rl_undo_list->end++; + else + rl_add_undo (UNDO_INSERT, rl_point, rl_point + l, (char *)NULL); + } + rl_point += l; + rl_end += l; + the_line[rl_end] = '\0'; + return l; +} + +/* Delete the string between FROM and TO. FROM is + inclusive, TO is not. */ +rl_delete_text (from, to) + int from, to; +{ + register char *text; + register int diff, i; + + /* Fix it if the caller is confused. */ + if (from > to) + { + int t = from; + from = to; + to = t; + } + text = rl_copy_text (from, to); + + /* Some versions of strncpy() can't handle overlapping arguments. */ + diff = to - from; + for (i = from; i < rl_end - diff; i++) + the_line[i] = the_line[i + diff]; + + /* Remember how to undo this delete. */ + if (!doing_an_undo) + rl_add_undo (UNDO_DELETE, from, to, text); + else + free (text); + + rl_end -= diff; + the_line[rl_end] = '\0'; + return (diff); +} + + +/* **************************************************************** */ +/* */ +/* Readline character functions */ +/* */ +/* **************************************************************** */ + +/* This is not a gap editor, just a stupid line input routine. No hair + is involved in writing any of the functions, and none should be. */ + +/* Note that: + + rl_end is the place in the string that we would place '\0'; + i.e., it is always safe to place '\0' there. + + rl_point is the place in the string where the cursor is. Sometimes + this is the same as rl_end. + + Any command that is called interactively receives two arguments. + The first is a count: the numeric arg pased to this command. + The second is the key which invoked this command. +*/ + + +/* **************************************************************** */ +/* */ +/* Movement Commands */ +/* */ +/* **************************************************************** */ + +/* Note that if you `optimize' the display for these functions, you cannot + use said functions in other functions which do not do optimizing display. + I.e., you will have to update the data base for rl_redisplay, and you + might as well let rl_redisplay do that job. */ + +/* Move forward COUNT characters. */ +rl_forward (count, key) + int count, key; +{ + if (count < 0) + rl_backward (-count); + else if (count > 0) + { + int end = rl_point + count; +#if defined (VI_MODE) + int lend = rl_end - (rl_editing_mode == vi_mode); +#else + int lend = rl_end; +#endif + + if (end > lend) + { + rl_point = lend; + ding (); + } + else + rl_point = end; + } + return 0; +} + +/* Move backward COUNT characters. */ +rl_backward (count, key) + int count, key; +{ + if (count < 0) + rl_forward (-count); + else if (count > 0) + { + if (rl_point < count) + { + rl_point = 0; + ding (); + } + else + rl_point -= count; + } + return 0; +} + +/* Move to the beginning of the line. */ +rl_beg_of_line (count, key) + int count, key; +{ + rl_point = 0; + return 0; +} + +/* Move to the end of the line. */ +rl_end_of_line (count, key) + int count, key; +{ + rl_point = rl_end; + return 0; +} + +/* Move forward a word. We do what Emacs does. */ +rl_forward_word (count, key) + int count, key; +{ + int c; + + if (count < 0) + { + rl_backward_word (-count); + return 0; + } + + while (count) + { + if (rl_point == rl_end) + return 0; + + /* If we are not in a word, move forward until we are in one. + Then, move forward until we hit a non-alphabetic character. */ + c = the_line[rl_point]; + if (!alphabetic (c)) + { + while (++rl_point < rl_end) + { + c = the_line[rl_point]; + if (alphabetic (c)) + break; + } + } + if (rl_point == rl_end) + return 0; + while (++rl_point < rl_end) + { + c = the_line[rl_point]; + if (!alphabetic (c)) + break; + } + --count; + } + return 0; +} + +/* Move backward a word. We do what Emacs does. */ +rl_backward_word (count, key) + int count, key; +{ + int c; + + if (count < 0) + { + rl_forward_word (-count); + return 0; + } + + while (count) + { + if (!rl_point) + return 0; + + /* Like rl_forward_word (), except that we look at the characters + just before point. */ + + c = the_line[rl_point - 1]; + if (!alphabetic (c)) + { + while (--rl_point) + { + c = the_line[rl_point - 1]; + if (alphabetic (c)) + break; + } + } + + while (rl_point) + { + c = the_line[rl_point - 1]; + if (!alphabetic (c)) + break; + else + --rl_point; + } + --count; + } + return 0; +} + +/* Clear the current line. Numeric argument to C-l does this. */ +rl_refresh_line () +{ + int curr_line, nleft; + + /* Find out whether or not there might be invisible characters in the + editing buffer. */ + if (rl_display_prompt == rl_prompt) + nleft = _rl_last_c_pos - screenwidth - rl_visible_prompt_length; + else + nleft = _rl_last_c_pos - screenwidth; + + if (nleft > 0) + curr_line = 1 + nleft / screenwidth; + else + curr_line = 0; + + _rl_move_vert (curr_line); + _rl_move_cursor_relative (0, the_line); /* XXX is this right */ + +#if defined (__GO32__) + { + int row, col, width, row_start; + + ScreenGetCursor (&row, &col); + width = ScreenCols (); + row_start = ScreenPrimary + (row * width); + memset (row_start + col, 0, (width - col) * 2); + } +#else /* !__GO32__ */ + if (term_clreol) + tputs (term_clreol, 1, _rl_output_character_function); +#endif /* !__GO32__ */ + + rl_forced_update_display (); + rl_display_fixed = 1; + + return 0; +} + +/* C-l typed to a line without quoting clears the screen, and then reprints + the prompt and the current input line. Given a numeric arg, redraw only + the current line. */ +rl_clear_screen (count, key) + int count, key; +{ + if (rl_explicit_arg) + { + rl_refresh_line (); + return 0; + } + +#if !defined (__GO32__) + if (term_clrpag) + tputs (term_clrpag, 1, _rl_output_character_function); + else +#endif /* !__GO32__ */ + crlf (); + + rl_forced_update_display (); + rl_display_fixed = 1; + + return 0; +} + +rl_arrow_keys (count, c) + int count, c; +{ + int ch; + + ch = rl_read_key (); + + switch (to_upper (ch)) + { + case 'A': + rl_get_previous_history (count); + break; + + case 'B': + rl_get_next_history (count); + break; + + case 'C': + rl_forward (count); + break; + + case 'D': + rl_backward (count); + break; + + default: + ding (); + } + return 0; +} + + +/* **************************************************************** */ +/* */ +/* Text commands */ +/* */ +/* **************************************************************** */ + +/* Insert the character C at the current location, moving point forward. */ +rl_insert (count, c) + int count, c; +{ + register int i; + char *string; + + if (count <= 0) + return 0; + + /* If we can optimize, then do it. But don't let people crash + readline because of extra large arguments. */ + if (count > 1 && count < 1024) + { + string = xmalloc (1 + count); + + for (i = 0; i < count; i++) + string[i] = c; + + string[i] = '\0'; + rl_insert_text (string); + free (string); + + return 0; + } + + if (count > 1024) + { + int decreaser; + char str[1024+1]; + + for (i = 0; i < 1024; i++) + str[i] = c; + + while (count) + { + decreaser = (count > 1024 ? 1024 : count); + str[decreaser] = '\0'; + rl_insert_text (str); + count -= decreaser; + } + + return 0; + } + + /* We are inserting a single character. + If there is pending input, then make a string of all of the + pending characters that are bound to rl_insert, and insert + them all. */ + if (any_typein) + { + int key = 0, t; + + i = 0; + string = xmalloc (ibuffer_len + 1); + string[i++] = c; + + while ((t = rl_get_char (&key)) && + (_rl_keymap[key].type == ISFUNC && + _rl_keymap[key].function == rl_insert)) + string[i++] = key; + + if (t) + rl_unget_char (key); + + string[i] = '\0'; + rl_insert_text (string); + free (string); + } + else + { + /* Inserting a single character. */ + char str[2]; + + str[1] = '\0'; + str[0] = c; + rl_insert_text (str); + } + return 0; +} + +/* Insert the next typed character verbatim. */ +rl_quoted_insert (count, key) + int count, key; +{ + int c; + + c = rl_read_key (); + return (rl_insert (count, c)); +} + +/* Insert a tab character. */ +rl_tab_insert (count, key) + int count, key; +{ + return (rl_insert (count, '\t')); +} + +/* What to do when a NEWLINE is pressed. We accept the whole line. + KEY is the key that invoked this command. I guess it could have + meaning in the future. */ +rl_newline (count, key) + int count, key; +{ + rl_done = 1; + +#if defined (VI_MODE) + _rl_vi_done_inserting (); + _rl_vi_reset_last (); + +#endif /* VI_MODE */ + + if (readline_echoing_p) + _rl_update_final (); + return 0; +} + +rl_clean_up_for_exit () +{ + if (readline_echoing_p) + { + _rl_move_vert (_rl_vis_botlin); + _rl_vis_botlin = 0; + fflush (out_stream); + rl_restart_output (); + } + return 0; +} + +/* What to do for some uppercase characters, like meta characters, + and some characters appearing in emacs_ctlx_keymap. This function + is just a stub, you bind keys to it and the code in _rl_dispatch () + is special cased. */ +rl_do_lowercase_version (ignore1, ignore2) + int ignore1, ignore2; +{ + return 0; +} + +/* Rubout the character behind point. */ +rl_rubout (count, key) + int count, key; +{ + if (count < 0) + { + rl_delete (-count); + return 0; + } + + if (!rl_point) + { + ding (); + return -1; + } + + if (count > 1 || rl_explicit_arg) + { + int orig_point = rl_point; + rl_backward (count); + rl_kill_text (orig_point, rl_point); + } + else + { + int c = the_line[--rl_point]; + rl_delete_text (rl_point, rl_point + 1); + + if (rl_point == rl_end && isprint (c) && _rl_last_c_pos) + { + int l; + l = rl_character_len (c, rl_point); + _rl_erase_at_end_of_line (l); + } + } + return 0; +} + +/* Delete the character under the cursor. Given a numeric argument, + kill that many characters instead. */ +rl_delete (count, invoking_key) + int count, invoking_key; +{ + if (count < 0) + { + return (rl_rubout (-count)); + } + + if (rl_point == rl_end) + { + ding (); + return -1; + } + + if (count > 1 || rl_explicit_arg) + { + int orig_point = rl_point; + rl_forward (count); + rl_kill_text (orig_point, rl_point); + rl_point = orig_point; + return 0; + } + else + return (rl_delete_text (rl_point, rl_point + 1)); + +} + +/* Delete all spaces and tabs around point. */ +rl_delete_horizontal_space (count, ignore) + int count, ignore; +{ + int start = rl_point; + + while (rl_point && whitespace (the_line[rl_point - 1])) + rl_point--; + + start = rl_point; + + while (rl_point < rl_end && whitespace (the_line[rl_point])) + rl_point++; + + if (start != rl_point) + { + rl_delete_text (start, rl_point); + rl_point = start; + } + return 0; +} + + +/* **************************************************************** */ +/* */ +/* Kill commands */ +/* */ +/* **************************************************************** */ + +/* The next two functions mimic unix line editing behaviour, except they + save the deleted text on the kill ring. This is safer than not saving + it, and since we have a ring, nobody should get screwed. */ + +/* This does what C-w does in Unix. We can't prevent people from + using behaviour that they expect. */ +rl_unix_word_rubout (count, key) + int count, key; +{ + if (!rl_point) + ding (); + else + { + int orig_point = rl_point; + + while (rl_point && whitespace (the_line[rl_point - 1])) + rl_point--; + + while (rl_point && !whitespace (the_line[rl_point - 1])) + rl_point--; + + rl_kill_text (orig_point, rl_point); + } + return 0; +} + +/* Here is C-u doing what Unix does. You don't *have* to use these + key-bindings. We have a choice of killing the entire line, or + killing from where we are to the start of the line. We choose the + latter, because if you are a Unix weenie, then you haven't backspaced + into the line at all, and if you aren't, then you know what you are + doing. */ +rl_unix_line_discard (count, key) + int count, key; +{ + if (!rl_point) + ding (); + else + { + rl_kill_text (rl_point, 0); + rl_point = 0; + } + return 0; +} + + +/* **************************************************************** */ +/* */ +/* Commands For Typos */ +/* */ +/* **************************************************************** */ + +/* Random and interesting things in here. */ + +/* **************************************************************** */ +/* */ +/* Changing Case */ +/* */ +/* **************************************************************** */ + +/* The three kinds of things that we know how to do. */ +#define UpCase 1 +#define DownCase 2 +#define CapCase 3 + +static int rl_change_case (); + +/* Uppercase the word at point. */ +rl_upcase_word (count, key) + int count, key; +{ + return (rl_change_case (count, UpCase)); +} + +/* Lowercase the word at point. */ +rl_downcase_word (count, key) + int count, key; +{ + return (rl_change_case (count, DownCase)); +} + +/* Upcase the first letter, downcase the rest. */ +rl_capitalize_word (count, key) + int count, key; +{ + return (rl_change_case (count, CapCase)); +} + +/* The meaty function. + Change the case of COUNT words, performing OP on them. + OP is one of UpCase, DownCase, or CapCase. + If a negative argument is given, leave point where it started, + otherwise, leave it where it moves to. */ +static int +rl_change_case (count, op) + int count, op; +{ + register int start = rl_point, end; + int state = 0; + + rl_forward_word (count); + end = rl_point; + + if (count < 0) + { + int temp = start; + start = end; + end = temp; + } + + /* We are going to modify some text, so let's prepare to undo it. */ + rl_modifying (start, end); + + for (; start < end; start++) + { + switch (op) + { + case UpCase: + the_line[start] = to_upper (the_line[start]); + break; + + case DownCase: + the_line[start] = to_lower (the_line[start]); + break; + + case CapCase: + if (state == 0) + { + the_line[start] = to_upper (the_line[start]); + state = 1; + } + else + { + the_line[start] = to_lower (the_line[start]); + } + if (!pure_alphabetic (the_line[start])) + state = 0; + break; + + default: + abort (); + return -1; + } + } + rl_point = end; + return 0; +} + +/* **************************************************************** */ +/* */ +/* Transposition */ +/* */ +/* **************************************************************** */ + +/* Transpose the words at point. */ +rl_transpose_words (count, key) + int count, key; +{ + char *word1, *word2; + int w1_beg, w1_end, w2_beg, w2_end; + int orig_point = rl_point; + + if (!count) + return 0; + + /* Find the two words. */ + rl_forward_word (count); + w2_end = rl_point; + rl_backward_word (1); + w2_beg = rl_point; + rl_backward_word (count); + w1_beg = rl_point; + rl_forward_word (1); + w1_end = rl_point; + + /* Do some check to make sure that there really are two words. */ + if ((w1_beg == w2_beg) || (w2_beg < w1_end)) + { + ding (); + rl_point = orig_point; + return -1; + } + + /* Get the text of the words. */ + word1 = rl_copy_text (w1_beg, w1_end); + word2 = rl_copy_text (w2_beg, w2_end); + + /* We are about to do many insertions and deletions. Remember them + as one operation. */ + rl_begin_undo_group (); + + /* Do the stuff at word2 first, so that we don't have to worry + about word1 moving. */ + rl_point = w2_beg; + rl_delete_text (w2_beg, w2_end); + rl_insert_text (word1); + + rl_point = w1_beg; + rl_delete_text (w1_beg, w1_end); + rl_insert_text (word2); + + /* This is exactly correct since the text before this point has not + changed in length. */ + rl_point = w2_end; + + /* I think that does it. */ + rl_end_undo_group (); + free (word1); + free (word2); + + return 0; +} + +/* Transpose the characters at point. If point is at the end of the line, + then transpose the characters before point. */ +rl_transpose_chars (count, key) + int count, key; +{ + char dummy[2]; + + if (!count) + return 0; + + if (!rl_point || rl_end < 2) + { + ding (); + return -1; + } + + rl_begin_undo_group (); + + if (rl_point == rl_end) + { + --rl_point; + count = 1; + } + rl_point--; + + dummy[0] = the_line[rl_point]; + dummy[1] = '\0'; + + rl_delete_text (rl_point, rl_point + 1); + + rl_point += count; + if (rl_point > rl_end) + rl_point = rl_end; + else if (rl_point < 0) + rl_point = 0; + rl_insert_text (dummy); + + rl_end_undo_group (); + return 0; +} + +/* **************************************************************** */ +/* */ +/* Undo, and Undoing */ +/* */ +/* **************************************************************** */ + +/* The current undo list for THE_LINE. */ +UNDO_LIST *rl_undo_list = (UNDO_LIST *)NULL; + +/* Remember how to undo something. Concatenate some undos if that + seems right. */ +void +rl_add_undo (what, start, end, text) + enum undo_code what; + int start, end; + char *text; +{ + UNDO_LIST *temp = (UNDO_LIST *)xmalloc (sizeof (UNDO_LIST)); + temp->what = what; + temp->start = start; + temp->end = end; + temp->text = text; + temp->next = rl_undo_list; + rl_undo_list = temp; +} + +/* Free the existing undo list. */ +void +free_undo_list () +{ + while (rl_undo_list) + { + UNDO_LIST *release = rl_undo_list; + rl_undo_list = rl_undo_list->next; + + if (release->what == UNDO_DELETE) + free (release->text); + + free (release); + } + rl_undo_list = (UNDO_LIST *)NULL; +} + +/* Undo the next thing in the list. Return 0 if there + is nothing to undo, or non-zero if there was. */ +int +rl_do_undo () +{ + UNDO_LIST *release; + int waiting_for_begin = 0; + +undo_thing: + if (!rl_undo_list) + return (0); + + doing_an_undo = 1; + + switch (rl_undo_list->what) { + + /* Undoing deletes means inserting some text. */ + case UNDO_DELETE: + rl_point = rl_undo_list->start; + rl_insert_text (rl_undo_list->text); + free (rl_undo_list->text); + break; + + /* Undoing inserts means deleting some text. */ + case UNDO_INSERT: + rl_delete_text (rl_undo_list->start, rl_undo_list->end); + rl_point = rl_undo_list->start; + break; + + /* Undoing an END means undoing everything 'til we get to + a BEGIN. */ + case UNDO_END: + waiting_for_begin++; + break; + + /* Undoing a BEGIN means that we are done with this group. */ + case UNDO_BEGIN: + if (waiting_for_begin) + waiting_for_begin--; + else + ding (); + break; + } + + doing_an_undo = 0; + + release = rl_undo_list; + rl_undo_list = rl_undo_list->next; + free (release); + + if (waiting_for_begin) + goto undo_thing; + + return (1); +} + +/* Begin a group. Subsequent undos are undone as an atomic operation. */ +int +rl_begin_undo_group () +{ + rl_add_undo (UNDO_BEGIN, 0, 0, 0); + return 0; +} + +/* End an undo group started with rl_begin_undo_group (). */ +int +rl_end_undo_group () +{ + rl_add_undo (UNDO_END, 0, 0, 0); + return 0; +} + +/* Save an undo entry for the text from START to END. */ +rl_modifying (start, end) + int start, end; +{ + if (start > end) + { + int t = start; + start = end; + end = t; + } + + if (start != end) + { + char *temp = rl_copy_text (start, end); + rl_begin_undo_group (); + rl_add_undo (UNDO_DELETE, start, end, temp); + rl_add_undo (UNDO_INSERT, start, end, (char *)NULL); + rl_end_undo_group (); + } + return 0; +} + +/* Revert the current line to its previous state. */ +int +rl_revert_line (count, key) + int count, key; +{ + if (!rl_undo_list) + ding (); + else + { + while (rl_undo_list) + rl_do_undo (); + } + return 0; +} + +/* Do some undoing of things that were done. */ +int +rl_undo_command (count, key) + int count, key; +{ + if (count < 0) + return 0; /* Nothing to do. */ + + while (count) + { + if (rl_do_undo ()) + count--; + else + { + ding (); + break; + } + } + return 0; +} + +/* **************************************************************** */ +/* */ +/* History Utilities */ +/* */ +/* **************************************************************** */ + +/* We already have a history library, and that is what we use to control + the history features of readline. However, this is our local interface + to the history mechanism. */ + +/* While we are editing the history, this is the saved + version of the original line. */ +HIST_ENTRY *saved_line_for_history = (HIST_ENTRY *)NULL; + +/* Set the history pointer back to the last entry in the history. */ +static void +start_using_history () +{ + using_history (); + if (saved_line_for_history) + _rl_free_history_entry (saved_line_for_history); + + saved_line_for_history = (HIST_ENTRY *)NULL; +} + +/* Free the contents (and containing structure) of a HIST_ENTRY. */ +void +_rl_free_history_entry (entry) + HIST_ENTRY *entry; +{ + if (!entry) + return; + if (entry->line) + free (entry->line); + free (entry); +} + +/* Perhaps put back the current line if it has changed. */ +maybe_replace_line () +{ + HIST_ENTRY *temp = current_history (); + + /* If the current line has changed, save the changes. */ + if (temp && ((UNDO_LIST *)(temp->data) != rl_undo_list)) + { + temp = replace_history_entry (where_history (), the_line, rl_undo_list); + free (temp->line); + free (temp); + } + return 0; +} + +/* Put back the saved_line_for_history if there is one. */ +maybe_unsave_line () +{ + if (saved_line_for_history) + { + int line_len; + + line_len = strlen (saved_line_for_history->line); + + if (line_len >= rl_line_buffer_len) + rl_extend_line_buffer (line_len); + + strcpy (the_line, saved_line_for_history->line); + rl_undo_list = (UNDO_LIST *)saved_line_for_history->data; + _rl_free_history_entry (saved_line_for_history); + saved_line_for_history = (HIST_ENTRY *)NULL; + rl_end = rl_point = strlen (the_line); + } + else + ding (); + return 0; +} + +/* Save the current line in saved_line_for_history. */ +maybe_save_line () +{ + if (!saved_line_for_history) + { + saved_line_for_history = (HIST_ENTRY *)xmalloc (sizeof (HIST_ENTRY)); + saved_line_for_history->line = savestring (the_line); + saved_line_for_history->data = (char *)rl_undo_list; + } + return 0; +} + +/* **************************************************************** */ +/* */ +/* History Commands */ +/* */ +/* **************************************************************** */ + +/* Meta-< goes to the start of the history. */ +rl_beginning_of_history (count, key) + int count, key; +{ + return (rl_get_previous_history (1 + where_history ())); +} + +/* Meta-> goes to the end of the history. (The current line). */ +rl_end_of_history (count, key) + int count, key; +{ + maybe_replace_line (); + using_history (); + maybe_unsave_line (); + return 0; +} + +/* Move down to the next history line. */ +rl_get_next_history (count, key) + int count, key; +{ + HIST_ENTRY *temp = (HIST_ENTRY *)NULL; + + if (count < 0) + return (rl_get_previous_history (-count)); + + if (!count) + return 0; + + maybe_replace_line (); + + while (count) + { + temp = next_history (); + if (!temp) + break; + --count; + } + + if (!temp) + maybe_unsave_line (); + else + { + int line_len; + + line_len = strlen (temp->line); + + if (line_len >= rl_line_buffer_len) + rl_extend_line_buffer (line_len); + + strcpy (the_line, temp->line); + rl_undo_list = (UNDO_LIST *)temp->data; + rl_end = rl_point = strlen (the_line); +#if defined (VI_MODE) + if (rl_editing_mode == vi_mode) + rl_point = 0; +#endif /* VI_MODE */ + } + return 0; +} + +/* Get the previous item out of our interactive history, making it the current + line. If there is no previous history, just ding. */ +rl_get_previous_history (count, key) + int count, key; +{ + HIST_ENTRY *old_temp = (HIST_ENTRY *)NULL; + HIST_ENTRY *temp = (HIST_ENTRY *)NULL; + + if (count < 0) + return (rl_get_next_history (-count)); + + if (!count) + return 0; + + /* If we don't have a line saved, then save this one. */ + maybe_save_line (); + + /* If the current line has changed, save the changes. */ + maybe_replace_line (); + + while (count) + { + temp = previous_history (); + if (!temp) + break; + else + old_temp = temp; + --count; + } + + /* If there was a large argument, and we moved back to the start of the + history, that is not an error. So use the last value found. */ + if (!temp && old_temp) + temp = old_temp; + + if (!temp) + ding (); + else + { + int line_len; + + line_len = strlen (temp->line); + + if (line_len >= rl_line_buffer_len) + rl_extend_line_buffer (line_len); + + strcpy (the_line, temp->line); + rl_undo_list = (UNDO_LIST *)temp->data; + rl_end = rl_point = line_len; + +#if defined (VI_MODE) + if (rl_editing_mode == vi_mode) + rl_point = 0; +#endif /* VI_MODE */ + } + return 0; +} + +/* Make C be the next command to be executed. */ +rl_execute_next (c) + int c; +{ + rl_pending_input = c; + return 0; +} + +/* **************************************************************** */ +/* */ +/* The Mark and the Region. */ +/* */ +/* **************************************************************** */ + +/* Set the mark at POSITION. */ +rl_set_mark (position) + int position; +{ + if (position > rl_end) + return -1; + + rl_mark = position; + return 0; +} + +/* Exchange the position of mark and point. */ +rl_exchange_mark_and_point (count, key) + int count, key; +{ + if (rl_mark > rl_end) + rl_mark = -1; + + if (rl_mark == -1) + { + ding (); + return -1; + } + else + { + int temp = rl_point; + + rl_point = rl_mark; + rl_mark = temp; + } + return 0; +} + + +/* **************************************************************** */ +/* */ +/* Killing Mechanism */ +/* */ +/* **************************************************************** */ + +/* What we assume for a max number of kills. */ +#define DEFAULT_MAX_KILLS 10 + +/* The real variable to look at to find out when to flush kills. */ +int rl_max_kills = DEFAULT_MAX_KILLS; + +/* Where to store killed text. */ +char **rl_kill_ring = (char **)NULL; + +/* Where we are in the kill ring. */ +int rl_kill_index = 0; + +/* How many slots we have in the kill ring. */ +int rl_kill_ring_length = 0; + +/* How to say that you only want to save a certain amount + of kill material. */ +rl_set_retained_kills (num) + int num; +{ + return 0; +} + +/* The way to kill something. This appends or prepends to the last + kill, if the last command was a kill command. if FROM is less + than TO, then the text is appended, otherwise prepended. If the + last command was not a kill command, then a new slot is made for + this kill. */ +rl_kill_text (from, to) + int from, to; +{ + int slot; + char *text; + + /* Is there anything to kill? */ + if (from == to) + { + last_command_was_kill++; + return 0; + } + + text = rl_copy_text (from, to); + + /* Delete the copied text from the line. */ + rl_delete_text (from, to); + + /* First, find the slot to work with. */ + if (!last_command_was_kill) + { + /* Get a new slot. */ + if (!rl_kill_ring) + { + /* If we don't have any defined, then make one. */ + rl_kill_ring = (char **) + xmalloc (((rl_kill_ring_length = 1) + 1) * sizeof (char *)); + rl_kill_ring[slot = 0] = (char *)NULL; + } + else + { + /* We have to add a new slot on the end, unless we have + exceeded the max limit for remembering kills. */ + slot = rl_kill_ring_length; + if (slot == rl_max_kills) + { + register int i; + free (rl_kill_ring[0]); + for (i = 0; i < slot; i++) + rl_kill_ring[i] = rl_kill_ring[i + 1]; + } + else + { + slot = rl_kill_ring_length += 1; + rl_kill_ring = (char **)xrealloc (rl_kill_ring, slot * sizeof (char *)); + } + rl_kill_ring[--slot] = (char *)NULL; + } + } + else + slot = rl_kill_ring_length - 1; + + /* If the last command was a kill, prepend or append. */ + if (last_command_was_kill && rl_editing_mode != vi_mode) + { + char *old = rl_kill_ring[slot]; + char *new = xmalloc (1 + strlen (old) + strlen (text)); + + if (from < to) + { + strcpy (new, old); + strcat (new, text); + } + else + { + strcpy (new, text); + strcat (new, old); + } + free (old); + free (text); + rl_kill_ring[slot] = new; + } + else + { + rl_kill_ring[slot] = text; + } + rl_kill_index = slot; + last_command_was_kill++; + return 0; +} + +/* Now REMEMBER! In order to do prepending or appending correctly, kill + commands always make rl_point's original position be the FROM argument, + and rl_point's extent be the TO argument. */ + +/* **************************************************************** */ +/* */ +/* Killing Commands */ +/* */ +/* **************************************************************** */ + +/* Delete the word at point, saving the text in the kill ring. */ +rl_kill_word (count, key) + int count, key; +{ + int orig_point = rl_point; + + if (count < 0) + return (rl_backward_kill_word (-count)); + else + { + rl_forward_word (count); + + if (rl_point != orig_point) + rl_kill_text (orig_point, rl_point); + + rl_point = orig_point; + } + return 0; +} + +/* Rubout the word before point, placing it on the kill ring. */ +rl_backward_kill_word (count, ignore) + int count, ignore; +{ + int orig_point = rl_point; + + if (count < 0) + return (rl_kill_word (-count)); + else + { + rl_backward_word (count); + + if (rl_point != orig_point) + rl_kill_text (orig_point, rl_point); + } + return 0; +} + +/* Kill from here to the end of the line. If DIRECTION is negative, kill + back to the line start instead. */ +rl_kill_line (direction, ignore) + int direction, ignore; +{ + int orig_point = rl_point; + + if (direction < 0) + return (rl_backward_kill_line (1)); + else + { + rl_end_of_line (); + if (orig_point != rl_point) + rl_kill_text (orig_point, rl_point); + rl_point = orig_point; + } + return 0; +} + +/* Kill backwards to the start of the line. If DIRECTION is negative, kill + forwards to the line end instead. */ +rl_backward_kill_line (direction, ignore) + int direction, ignore; +{ + int orig_point = rl_point; + + if (direction < 0) + return (rl_kill_line (1)); + else + { + if (!rl_point) + ding (); + else + { + rl_beg_of_line (); + rl_kill_text (orig_point, rl_point); + } + } + return 0; +} + +/* Kill the whole line, no matter where point is. */ +rl_kill_full_line (count, ignore) + int count, ignore; +{ + rl_begin_undo_group (); + rl_point = 0; + rl_kill_text (rl_point, rl_end); + rl_end_undo_group (); + return 0; +} + +/* Yank back the last killed text. This ignores arguments. */ +rl_yank (count, ignore) + int count, ignore; +{ + if (!rl_kill_ring) + { + rl_abort (); + return -1; + } + + rl_set_mark (rl_point); + rl_insert_text (rl_kill_ring[rl_kill_index]); + return 0; +} + +/* If the last command was yank, or yank_pop, and the text just + before point is identical to the current kill item, then + delete that text from the line, rotate the index down, and + yank back some other text. */ +rl_yank_pop (count, key) + int count, key; +{ + int l; + + if (((rl_last_func != rl_yank_pop) && (rl_last_func != rl_yank)) || + !rl_kill_ring) + { + rl_abort (); + return -1; + } + + l = strlen (rl_kill_ring[rl_kill_index]); + if (((rl_point - l) >= 0) && + (strncmp (the_line + (rl_point - l), + rl_kill_ring[rl_kill_index], l) == 0)) + { + rl_delete_text ((rl_point - l), rl_point); + rl_point -= l; + rl_kill_index--; + if (rl_kill_index < 0) + rl_kill_index = rl_kill_ring_length - 1; + rl_yank (1, 0); + return 0; + } + else + { + rl_abort (); + return -1; + } +} + +/* Yank the COUNTth argument from the previous history line. */ +rl_yank_nth_arg (count, ignore) + int count, ignore; +{ + register HIST_ENTRY *entry = previous_history (); + char *arg; + + if (entry) + next_history (); + else + { + ding (); + return -1; + } + + arg = history_arg_extract (count, count, entry->line); + if (!arg || !*arg) + { + ding (); + return -1; + } + + rl_begin_undo_group (); + +#if defined (VI_MODE) + /* Vi mode always inserts a space before yanking the argument, and it + inserts it right *after* rl_point. */ + if (rl_editing_mode == vi_mode) + { + rl_vi_append_mode (); + rl_insert_text (" "); + } +#endif /* VI_MODE */ + + rl_insert_text (arg); + free (arg); + + rl_end_undo_group (); + return 0; +} + +/* Yank the last argument from the previous history line. This `knows' + how rl_yank_nth_arg treats a count of `$'. With an argument, this + behaves the same as rl_yank_nth_arg. */ +int +rl_yank_last_arg (count, key) + int count, key; +{ + if (rl_explicit_arg) + return (rl_yank_nth_arg (count, key)); + else + return (rl_yank_nth_arg ('$', key)); +} + +/* How to toggle back and forth between editing modes. */ +rl_vi_editing_mode (count, key) + int count, key; +{ +#if defined (VI_MODE) + rl_editing_mode = vi_mode; + rl_vi_insertion_mode (); + return 0; +#endif /* VI_MODE */ +} + +rl_emacs_editing_mode (count, key) + int count, key; +{ + rl_editing_mode = emacs_mode; + _rl_keymap = emacs_standard_keymap; + return 0; +} + + +/* **************************************************************** */ +/* */ +/* USG (System V) Support */ +/* */ +/* **************************************************************** */ + +int +rl_getc (stream) + FILE *stream; +{ + int result; + unsigned char c; + +#if defined (__GO32__) + if (isatty (0)) + return (getkey () & 0x7F); +#endif /* __GO32__ */ + + while (1) + { + result = read (fileno (stream), &c, sizeof (unsigned char)); + + if (result == sizeof (unsigned char)) + return (c); + + /* If zero characters are returned, then the file that we are + reading from is empty! Return EOF in that case. */ + if (result == 0) + return (EOF); + +#if defined (EWOULDBLOCK) + if (errno == EWOULDBLOCK) + { + int flags; + + if ((flags = fcntl (fileno (stream), F_GETFL, 0)) < 0) + return (EOF); + if (flags & O_NDELAY) + { + flags &= ~O_NDELAY; + fcntl (fileno (stream), F_SETFL, flags); + continue; + } + continue; + } +#endif /* EWOULDBLOCK */ + +#if defined (_POSIX_VERSION) && defined (EAGAIN) && defined (O_NONBLOCK) + if (errno == EAGAIN) + { + int flags; + + if ((flags = fcntl (fileno (stream), F_GETFL, 0)) < 0) + return (EOF); + if (flags & O_NONBLOCK) + { + flags &= ~O_NONBLOCK; + fcntl (fileno (stream), F_SETFL, flags); + continue; + } + } +#endif /* _POSIX_VERSION && EAGAIN && O_NONBLOCK */ + +#if !defined (__GO32__) + /* If the error that we received was SIGINT, then try again, + this is simply an interrupted system call to read (). + Otherwise, some error ocurred, also signifying EOF. */ + if (errno != EINTR) + return (EOF); +#endif /* !__GO32__ */ + } +} + +#if !defined (SHELL) +#ifdef savestring +#undef savestring +#endif +/* Backwards compatibilty, now that savestring has been removed from + all `public' readline header files. */ +char * +savestring (s) + char *s; +{ + return ((char *)strcpy (xmalloc (1 + (int)strlen (s)), (s))); +} +#endif + +/* Function equivalents for the macros defined in chartypes.h. */ +#undef uppercase_p +int +uppercase_p (c) + int c; +{ + return (isupper (c)); +} + +#undef lowercase_p +int +lowercase_p (c) + int c; +{ + return (islower (c)); +} + +#undef pure_alphabetic +int +pure_alphabetic (c) + int c; +{ + return (isupper (c) || islower (c)); +} + +#undef digit_p +int +digit_p (c) + int c; +{ + return (isdigit (c)); +} + +#undef to_lower +int +to_lower (c) + int c; +{ + return (isupper (c) ? tolower (c) : c); +} + +#undef to_upper +int +to_upper (c) + int c; +{ + return (islower (c) ? toupper (c) : c); +} + +#undef digit_value +int +digit_value (c) + int c; +{ + return (isdigit (c) ? c - '0' : c); +} + +#if defined (STATIC_MALLOC) + +/* **************************************************************** */ +/* */ +/* xmalloc and xrealloc () */ +/* */ +/* **************************************************************** */ + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)malloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "readline: Out of virtual memory!\n"); + abort (); +} +#endif /* STATIC_MALLOC */ + + +/* **************************************************************** */ +/* */ +/* Testing Readline */ +/* */ +/* **************************************************************** */ + +#if defined (TEST) + +main () +{ + HIST_ENTRY **history_list (); + char *temp = (char *)NULL; + char *prompt = "readline% "; + int done = 0; + + while (!done) + { + temp = readline (prompt); + + /* Test for EOF. */ + if (!temp) + exit (1); + + /* If there is anything on the line, print it and remember it. */ + if (*temp) + { + fprintf (stderr, "%s\r\n", temp); + add_history (temp); + } + + /* Check for `command' that we handle. */ + if (strcmp (temp, "quit") == 0) + done = 1; + + if (strcmp (temp, "list") == 0) + { + HIST_ENTRY **list = history_list (); + register int i; + if (list) + { + for (i = 0; list[i]; i++) + { + fprintf (stderr, "%d: %s\r\n", i, list[i]->line); + free (list[i]->line); + } + free (list); + } + } + free (temp); + } +} + +#endif /* TEST */ + + +/* + * Local variables: + * compile-command: "gcc -g -traditional -I. -I.. -DTEST -o readline readline.c keymaps.o funmap.o history.o -ltermcap" + * end: + */ diff --git a/readline.h b/readline.h new file mode 100644 index 0000000..b397177 --- /dev/null +++ b/readline.h @@ -0,0 +1,289 @@ +/* Readline.h -- the names of functions callable from within readline. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (_READLINE_H_) +#define _READLINE_H_ + +#if defined (READLINE_LIBRARY) +# include "keymaps.h" +# include "tilde.h" +#else +# include +# include +#endif + +/* The functions for manipulating the text of the line within readline. +Most of these functions are bound to keys by default. */ +extern int + rl_tilde_expand (), + rl_beg_of_line (), rl_backward (), rl_delete (), rl_end_of_line (), + rl_forward (), ding (), rl_backward (), rl_newline (), rl_kill_line (), + rl_clear_screen (), rl_get_next_history (), rl_get_previous_history (), + rl_quoted_insert (), rl_reverse_search_history (), rl_transpose_chars (), + rl_unix_line_discard (), rl_quoted_insert (), rl_unix_word_rubout (), + rl_yank (), rl_rubout (), rl_backward_word (), rl_kill_word (), + rl_forward_word (), rl_tab_insert (), rl_yank_pop (), rl_yank_nth_arg (), + rl_backward_kill_word (), rl_backward_kill_line (), rl_transpose_words (), + rl_complete (), rl_possible_completions (), rl_insert_completions (), + rl_do_lowercase_version (), rl_kill_full_line (), + rl_digit_argument (), rl_universal_argument (), rl_abort (), + rl_undo_command (), rl_revert_line (), rl_beginning_of_history (), + rl_end_of_history (), rl_forward_search_history (), rl_insert (), + rl_upcase_word (), rl_downcase_word (), rl_capitalize_word (), + rl_restart_output (), rl_re_read_init_file (), rl_dump_functions (), + rl_delete_horizontal_space (), rl_history_search_forward (), + rl_history_search_backward (), rl_tty_status (), rl_yank_last_arg (); + +/* `Public' utility functions. */ +extern int rl_insert_text (), rl_delete_text (), rl_kill_text (); +extern int rl_complete_internal (); +extern int rl_expand_prompt (); +extern int rl_initialize (); +extern int rl_set_signals (), rl_clear_signals (); +extern int rl_init_argument (), rl_digit_argument (); +extern int rl_read_key (), rl_getc (), rl_stuff_char (); +extern int maybe_save_line (), maybe_unsave_line (), maybe_replace_line (); +extern int rl_modifying (); + +extern int rl_begin_undo_group (), rl_end_undo_group (); +extern void rl_add_undo (), free_undo_list (); +extern int rl_do_undo (); + +/* Not available unless readline is compiled -DPAREN_MATCHING. */ +extern int rl_insert_close (); + +/* These are *both* defined even when VI_MODE is not. */ +extern int rl_vi_editing_mode (), rl_emacs_editing_mode (); + +/* Non incremental history searching. */ +extern int + rl_noninc_forward_search (), rl_noninc_reverse_search (), + rl_noninc_forward_search_again (), rl_noninc_reverse_search_again (); + +/* Things for vi mode. Not available unless readline is compiled -DVI_MODE. */ +extern int rl_vi_check (), rl_vi_textmod_command (); +extern int + rl_vi_redo (), rl_vi_tilde_expand (), + rl_vi_movement_mode (), rl_vi_insertion_mode (), rl_vi_arg_digit (), + rl_vi_prev_word (), rl_vi_next_word (), rl_vi_char_search (), + rl_vi_eof_maybe (), rl_vi_append_mode (), rl_vi_put (), + rl_vi_append_eol (), rl_vi_insert_beg (), rl_vi_delete (), rl_vi_comment (), + rl_vi_first_print (), rl_vi_fword (), rl_vi_fWord (), rl_vi_bword (), + rl_vi_bWord (), rl_vi_eword (), rl_vi_eWord (), rl_vi_end_word (), + rl_vi_change_case (), rl_vi_match (), rl_vi_bracktype (), + rl_vi_change_char (), rl_vi_yank_arg (), rl_vi_search (), + rl_vi_search_again (), rl_vi_subst (), rl_vi_overstrike (), + rl_vi_overstrike_delete (), rl_vi_replace(), rl_vi_column (), + rl_vi_delete_to (), rl_vi_change_to (), rl_vi_yank_to (), + rl_vi_complete (), rl_vi_fetch_history (); + +/* Keyboard macro commands. */ +extern int rl_start_kbd_macro (), rl_end_kbd_macro (); +extern int rl_call_last_kbd_macro (); + +extern int rl_arrow_keys(), rl_refresh_line (); + +/* Maintaining the state of undo. We remember individual deletes and inserts + on a chain of things to do. */ + +/* The actions that undo knows how to undo. Notice that UNDO_DELETE means + to insert some text, and UNDO_INSERT means to delete some text. I.e., + the code tells undo what to undo, not how to undo it. */ +enum undo_code { UNDO_DELETE, UNDO_INSERT, UNDO_BEGIN, UNDO_END }; + +/* What an element of THE_UNDO_LIST looks like. */ +typedef struct undo_list { + struct undo_list *next; + int start, end; /* Where the change took place. */ + char *text; /* The text to insert, if undoing a delete. */ + enum undo_code what; /* Delete, Insert, Begin, End. */ +} UNDO_LIST; + +/* The current undo list for RL_LINE_BUFFER. */ +extern UNDO_LIST *rl_undo_list; + +/* The data structure for mapping textual names to code addresses. */ +typedef struct { + char *name; + Function *function; +} FUNMAP; + +extern FUNMAP **funmap; + +/* **************************************************************** */ +/* */ +/* Well Published Variables */ +/* */ +/* **************************************************************** */ + +/* The name of the calling program. You should initialize this to + whatever was in argv[0]. It is used when parsing conditionals. */ +extern char *rl_readline_name; + +/* The line buffer that is in use. */ +extern char *rl_line_buffer; + +/* The location of point, and end. */ +extern int rl_point, rl_end; + +/* The name of the terminal to use. */ +extern char *rl_terminal_name; + +/* The input and output streams. */ +extern FILE *rl_instream, *rl_outstream; + +/* The basic list of characters that signal a break between words for the + completer routine. The initial contents of this variable is what + breaks words in the shell, i.e. "n\"\\'`@$>". */ +extern char *rl_basic_word_break_characters; + +/* The list of characters that signal a break between words for + rl_complete_internal. The default list is the contents of + rl_basic_word_break_characters. */ +extern char *rl_completer_word_break_characters; + +/* List of characters which can be used to quote a substring of the line. + Completion occurs on the entire substring, and within the substring + rl_completer_word_break_characters are treated as any other character, + unless they also appear within this list. */ +extern char *rl_completer_quote_characters; + +/* List of characters that are word break characters, but should be left + in TEXT when it is passed to the completion function. The shell uses + this to help determine what kind of completing to do. */ +extern char *rl_special_prefixes; + +/* Pointer to the generator function for completion_matches (). + NULL means to use filename_entry_function (), the default filename + completer. */ +extern Function *rl_completion_entry_function; + +/* If rl_ignore_some_completions_function is non-NULL it is the address + of a function to call after all of the possible matches have been + generated, but before the actual completion is done to the input line. + The function is called with one argument; a NULL terminated array + of (char *). If your function removes any of the elements, they + must be free()'ed. */ +extern Function *rl_ignore_some_completions_function; + +/* Pointer to alternative function to create matches. + Function is called with TEXT, START, and END. + START and END are indices in RL_LINE_BUFFER saying what the boundaries + of TEXT are. + If this function exists and returns NULL then call the value of + rl_completion_entry_function to try to match, otherwise use the + array of strings returned. */ +extern CPPFunction *rl_attempted_completion_function; + +/* If non-zero, then this is the address of a function to call just + before readline_internal () prints the first prompt. */ +extern Function *rl_startup_hook; + +/* If non-zero, then this is the address of a function to call when + completing on a directory name. The function is called with + the address of a string (the current directory name) as an arg. */ +extern Function *rl_directory_completion_hook; + +/* Backwards compatibility with previous versions of readline. */ +#define rl_symbolic_link_hook rl_directory_completion_hook + +/* The address of a function to call periodically while Readline is + awaiting character input, or NULL, for no event handling. */ +extern Function *rl_event_hook; + +/* Non-zero means that modified history lines are preceded + with an asterisk. */ +extern int rl_show_star; + +/* Non-zero means that the results of the matches are to be treated + as filenames. This is ALWAYS zero on entry, and can only be changed + within a completion entry finder function. */ +extern int rl_filename_completion_desired; + +/* Non-zero means that the results of the matches are to be quoted using + double quotes (or an application-specific quoting mechanism) if the + filename contains any characters in rl_word_break_chars. This is + ALWAYS non-zero on entry, and can only be changed within a completion + entry finder function. */ +extern int rl_filename_quoting_desired; + +/* Non-zero means to suppress normal filename completion after the + user-specified completion function has been called. */ +extern int rl_attempted_completion_over; + +/* **************************************************************** */ +/* */ +/* Well Published Functions */ +/* */ +/* **************************************************************** */ + +/* Read a line of input. Prompt with PROMPT. A NULL PROMPT means none. */ +extern char *readline (); + +/* These functions are from complete.c. */ +/* Return an array of strings which are the result of repeatadly calling + FUNC with TEXT. */ +extern char **completion_matches (); +extern char *username_completion_function (); +extern char *filename_completion_function (); + +/* These functions are from bind.c. */ +/* rl_add_defun (char *name, Function *function, int key) + Add NAME to the list of named functions. Make FUNCTION + be the function that gets called. + If KEY is not -1, then bind it. */ +extern int rl_add_defun (); +extern int rl_bind_key (), rl_bind_key_in_map (); +extern int rl_unbind_key (), rl_unbind_key_in_map (); +extern int rl_set_key (); +extern int rl_macro_bind (), rl_generic_bind (), rl_variable_bind (); +extern int rl_translate_keyseq (); +extern Function *rl_named_function (), *rl_function_of_keyseq (); +extern int rl_parse_and_bind (); +extern Keymap rl_get_keymap (), rl_get_keymap_by_name (); +extern void rl_set_keymap (); +extern char **rl_invoking_keyseqs (), **rl_invoking_keyseqs_in_map (); +extern void rl_function_dumper (); +extern int rl_read_init_file (); + +/* Functions in funmap.c */ +extern void rl_list_funmap_names (); +extern void rl_initialize_funmap (); + +/* Functions in display.c */ +extern void rl_redisplay (); +extern int rl_message (), rl_clear_message (); +extern int rl_reset_line_state (); +extern int rl_character_len (); +extern int rl_show_char (); +extern int crlf (), rl_on_new_line (); +extern int rl_forced_update_display (); + +/* Definitions available for use by readline clients. */ +#define RL_PROMPT_START_IGNORE '\001' +#define RL_PROMPT_END_IGNORE '\002' + +#if !defined (savestring) +extern char *savestring (); /* XXX backwards compatibility */ +#endif + +#endif /* _READLINE_H_ */ diff --git a/rlconf.h b/rlconf.h new file mode 100644 index 0000000..0035b93 --- /dev/null +++ b/rlconf.h @@ -0,0 +1,57 @@ +/* rlconf.h -- readline configuration definitions */ + +/* Copyright (C) 1994 Free Software Foundation, Inc. + + This file contains the Readline Library (the Library), a set of + routines for providing Emacs style line input to programs that ask + for it. + + The Library is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + The Library is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (_RLCONF_H_) +#define _RLCONF_H_ + +/* Define this if you want the vi-mode editing available. */ +#define VI_MODE + +/* Define this to get an indication of file type when listing completions. */ +#define VISIBLE_STATS + +/* If defined, readline shows opening parens and braces when closing + paren or brace entered. */ +/* #define PAREN_MATCHING */ + +/* This definition is needed by readline.c, rltty.c, and signals.c. */ +/* If on, then readline handles signals in a way that doesn't screw. */ +#define HANDLE_SIGNALS + +/* Ugly but working hack for binding prefix meta. */ +#define PREFIX_META_HACK + +/* The final, last-ditch effort file name for an init file. */ +#define DEFAULT_INPUTRC "~/.inputrc" + +/* If defined, expand tabs to spaces. */ +#define DISPLAY_TABS + +/* If defined, use the terminal escape sequence to move the cursor forward + over a character when updating the line rather than rewriting it. */ +/* #define HACK_TERMCAP_MOTION */ + +/* The string inserted by the vi-mode `insert comment' command. */ +#define VI_COMMENT_BEGIN_DEFAULT "#" + +#endif /* _RLCONF_H_ */ diff --git a/rldefs.h b/rldefs.h new file mode 100644 index 0000000..249c927 --- /dev/null +++ b/rldefs.h @@ -0,0 +1,207 @@ +/* rldefs.h -- an attempt to isolate some of the system-specific defines + for readline. This should be included after any files that define + system-specific constants like _POSIX_VERSION or USG. */ + +/* Copyright (C) 1987,1989 Free Software Foundation, Inc. + + This file contains the Readline Library (the Library), a set of + routines for providing Emacs style line input to programs that ask + for it. + + The Library is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + The Library is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (_RLDEFS_H) +#define _RLDEFS_H + +#if defined (HAVE_CONFIG_H) +# include "config.h" +#endif + +#if !defined (PRAGMA_ALLOCA) +# include "memalloc.h" +#endif + +#define NEW_TTY_DRIVER +#define HAVE_BSD_SIGNALS +/* #define USE_XON_XOFF */ + +#if defined (__linux__) || defined (HAVE_TERMCAP_H) +# include +#endif /* __linux__ || HAVE_TERMCAP_H */ + +/* Some USG machines have BSD signal handling (sigblock, sigsetmask, etc.) */ +#if defined (USG) && !defined (hpux) +# undef HAVE_BSD_SIGNALS +#endif + +/* System V machines use termio. */ +#if !defined (_POSIX_VERSION) +# if defined (USG) || defined (hpux) || defined (Xenix) || defined (sgi) || \ + defined (DGUX) || defined (HAVE_TERMIO_H) +# undef NEW_TTY_DRIVER +# define TERMIO_TTY_DRIVER +# include +# if !defined (TCOON) +# define TCOON 1 +# endif +# endif /* USG || hpux || Xenix || sgi || DUGX || HAVE_TERMIO_H */ +#endif /* !_POSIX_VERSION */ + +/* Posix systems use termios and the Posix signal functions. */ +#if defined (_POSIX_VERSION) +# if !defined (TERMIOS_MISSING) +# undef NEW_TTY_DRIVER +# define TERMIOS_TTY_DRIVER +# include +# endif /* !TERMIOS_MISSING */ +# define HAVE_POSIX_SIGNALS +# if !defined (O_NDELAY) +# define O_NDELAY O_NONBLOCK /* Posix-style non-blocking i/o */ +# endif /* O_NDELAY */ +#endif /* _POSIX_VERSION */ + +/* System V.3 machines have the old 4.1 BSD `reliable' signal interface. */ +#if !defined (HAVE_BSD_SIGNALS) && !defined (HAVE_POSIX_SIGNALS) +# if defined (USGr3) && !defined (XENIX_22) +# if !defined (HAVE_USG_SIGHOLD) +# define HAVE_USG_SIGHOLD +# endif /* !HAVE_USG_SIGHOLD */ +# endif /* USGr3 && !XENIX_22 */ +#endif /* !HAVE_BSD_SIGNALS && !HAVE_POSIX_SIGNALS */ + +/* Other (BSD) machines use sgtty. */ +#if defined (NEW_TTY_DRIVER) +# include +#endif + +/* Define _POSIX_VDISABLE if we are not using the `new' tty driver and + it is not already defined. It is used both to determine if a + special character is disabled and to disable certain special + characters. Posix systems should set to 0, USG systems to -1. */ +#if !defined (NEW_TTY_DRIVER) && !defined (_POSIX_VDISABLE) +# if defined (_POSIX_VERSION) +# define _POSIX_VDISABLE 0 +# else /* !_POSIX_VERSION */ +# define _POSIX_VDISABLE -1 +# endif /* !_POSIX_VERSION */ +#endif /* !NEW_TTY_DRIVER && !_POSIX_VDISABLE */ + +#if !defined (SHELL) && (defined (_POSIX_VERSION) || defined (USGr3)) +# if !defined (HAVE_DIRENT_H) +# define HAVE_DIRENT_H +# endif /* !HAVE_DIRENT_H */ +#endif /* !SHELL && (_POSIX_VERSION || USGr3) */ + +#if defined (HAVE_DIRENT_H) +# include +# define D_NAMLEN(d) strlen ((d)->d_name) +#else /* !HAVE_DIRENT_H */ +# define D_NAMLEN(d) ((d)->d_namlen) +# if defined (USG) +# if defined (Xenix) +# include +# else /* !Xenix (but USG...) */ +# include "ndir.h" +# endif /* !Xenix */ +# else /* !USG */ +# include +# endif /* !USG */ +# if !defined (dirent) +# define dirent direct +# endif /* !dirent */ +#endif /* !HAVE_DIRENT_H */ + +#if defined (USG) && defined (TIOCGWINSZ) && !defined (Linux) +# if defined (HAVE_SYS_STREAM_H) +# include +# endif /* HAVE_SYS_STREAM_H */ +# if defined (HAVE_SYS_PTEM_H) +# include +# endif /* HAVE_SYS_PTEM_H */ +# if defined (HAVE_SYS_PTE_H) +# include +# endif /* HAVE_SYS_PTE_H */ +#endif /* USG && TIOCGWINSZ && !Linux */ + +/* Posix macro to check file in statbuf for directory-ness. + This requires that be included before this test. */ +#if defined (S_IFDIR) && !defined (S_ISDIR) +# define S_ISDIR(m) (((m)&S_IFMT) == S_IFDIR) +#endif + +/* Decide which flavor of the header file describing the C library + string functions to include and include it. */ + +#if defined (USG) || defined (NeXT) +# if !defined (HAVE_STRING_H) +# define HAVE_STRING_H +# endif /* !HAVE_STRING_H */ +#endif /* USG || NeXT */ + +#if defined (HAVE_STRING_H) +# include +#else /* !HAVE_STRING_H */ +# include +#endif /* !HAVE_STRING_H */ + +#if !defined (strchr) && !defined (__STDC__) +extern char *strchr (), *strrchr (); +#endif /* !strchr && !__STDC__ */ + +#if defined (HAVE_VARARGS_H) +# include +#endif /* HAVE_VARARGS_H */ + +/* This is needed to include support for TIOCGWINSZ and window resizing. */ +#if defined (OSF1) || defined (BSD386) || defined (NetBSD) || \ + defined (__BSD_4_4__) || defined (FreeBSD) || defined (_386BSD) || \ + defined (AIX) +# define GWINSZ_IN_SYS_IOCTL +#endif + +#if !defined (emacs_mode) +# define no_mode -1 +# define vi_mode 0 +# define emacs_mode 1 +#endif + +/* If you cast map[key].function to type (Keymap) on a Cray, + the compiler takes the value of map[key].function and + divides it by 4 to convert between pointer types (pointers + to functions and pointers to structs are different sizes). + This is not what is wanted. */ +#if defined (CRAY) +# define FUNCTION_TO_KEYMAP(map, key) (Keymap)((int)map[key].function) +# define KEYMAP_TO_FUNCTION(data) (Function *)((int)(data)) +#else +# define FUNCTION_TO_KEYMAP(map, key) (Keymap)(map[key].function) +# define KEYMAP_TO_FUNCTION(data) (Function *)(data) +#endif + +#ifndef savestring +extern char *xmalloc (); +#define savestring(x) strcpy (xmalloc (1 + strlen (x)), (x)) +#endif + +/* Possible values for _rl_bell_preference. */ +#define NO_BELL 0 +#define AUDIBLE_BELL 1 +#define VISIBLE_BELL 2 + +/* CONFIGURATION SECTION */ +#include "rlconf.h" + +#endif /* !_RLDEFS_H */ diff --git a/rltty.c b/rltty.c new file mode 100644 index 0000000..ebb8413 --- /dev/null +++ b/rltty.c @@ -0,0 +1,697 @@ +/* rltty.c -- functions to prepare and restore the terminal for readline's + use. */ + +/* Copyright (C) 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include +#include +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif /* HAVE_UNISTD_H */ + +#include "rldefs.h" +#include "readline.h" + +#if !defined (errno) +extern int errno; +#endif /* !errno */ + +extern int readline_echoing_p; +extern int _rl_eof_char; + +#if defined (__GO32__) +# include +# undef HANDLE_SIGNALS +#endif /* __GO32__ */ + +static int output_was_flushed; + +/* **************************************************************** */ +/* */ +/* Signal Management */ +/* */ +/* **************************************************************** */ + +#if defined (HAVE_POSIX_SIGNALS) +static sigset_t sigint_set, sigint_oset; +#else /* !HAVE_POSIX_SIGNALS */ +# if defined (HAVE_BSD_SIGNALS) +static int sigint_oldmask; +# endif /* HAVE_BSD_SIGNALS */ +#endif /* !HAVE_POSIX_SIGNALS */ + +static int sigint_blocked = 0; + +/* Cause SIGINT to not be delivered until the corresponding call to + release_sigint(). */ +static void +block_sigint () +{ + if (sigint_blocked) + return; + +#if defined (HAVE_POSIX_SIGNALS) + sigemptyset (&sigint_set); + sigemptyset (&sigint_oset); + sigaddset (&sigint_set, SIGINT); + sigprocmask (SIG_BLOCK, &sigint_set, &sigint_oset); +#else /* !HAVE_POSIX_SIGNALS */ +# if defined (HAVE_BSD_SIGNALS) + sigint_oldmask = sigblock (sigmask (SIGINT)); +# else /* !HAVE_BSD_SIGNALS */ +# if defined (HAVE_USG_SIGHOLD) + sighold (SIGINT); +# endif /* HAVE_USG_SIGHOLD */ +# endif /* !HAVE_BSD_SIGNALS */ +#endif /* !HAVE_POSIX_SIGNALS */ + sigint_blocked = 1; +} + +/* Allow SIGINT to be delivered. */ +static void +release_sigint () +{ + if (!sigint_blocked) + return; + +#if defined (HAVE_POSIX_SIGNALS) + sigprocmask (SIG_SETMASK, &sigint_oset, (sigset_t *)NULL); +#else +# if defined (HAVE_BSD_SIGNALS) + sigsetmask (sigint_oldmask); +# else /* !HAVE_BSD_SIGNALS */ +# if defined (HAVE_USG_SIGHOLD) + sigrelse (SIGINT); +# endif /* HAVE_USG_SIGHOLD */ +# endif /* !HAVE_BSD_SIGNALS */ +#endif /* !HAVE_POSIX_SIGNALS */ + + sigint_blocked = 0; +} + +/* **************************************************************** */ +/* */ +/* Controlling the Meta Key and Keypad */ +/* */ +/* **************************************************************** */ + +extern int term_has_meta; +extern char *term_mm; +extern char *term_mo; + +extern char *term_ks; +extern char *term_ke; + +static int +outchar (c) + int c; +{ + return putc (c, rl_outstream); +} + +/* Turn on/off the meta key depending on ON. */ +static void +control_meta_key (on) + int on; +{ + if (term_has_meta) + { + if (on && term_mm) + tputs (term_mm, 1, outchar); + else if (!on && term_mo) + tputs (term_mo, 1, outchar); + } +} + +static void +control_keypad (on) + int on; +{ + if (on && term_ks) + tputs (term_ks, 1, outchar); + else if (!on && term_ke) + tputs (term_ke, 1, outchar); +} + +/* **************************************************************** */ +/* */ +/* Saving and Restoring the TTY */ +/* */ +/* **************************************************************** */ + +/* Non-zero means that the terminal is in a prepped state. */ +static int terminal_prepped = 0; + +/* If non-zero, means that this process has called tcflow(fd, TCOOFF) + and output is suspended. */ +#if defined (__ksr1__) +static int ksrflow = 0; +#endif +#if defined (NEW_TTY_DRIVER) + +/* Values for the `flags' field of a struct bsdtty. This tells which + elements of the struct bsdtty have been fetched from the system and + are valid. */ +#define SGTTY_SET 0x01 +#define LFLAG_SET 0x02 +#define TCHARS_SET 0x04 +#define LTCHARS_SET 0x08 + +struct bsdtty { + struct sgttyb sgttyb; /* Basic BSD tty driver information. */ + int lflag; /* Local mode flags, like LPASS8. */ +#if defined (TIOCGETC) + struct tchars tchars; /* Terminal special characters, including ^S and ^Q. */ +#endif +#if defined (TIOCGLTC) + struct ltchars ltchars; /* 4.2 BSD editing characters */ +#endif + int flags; /* Bitmap saying which parts of the struct are valid. */ +}; + +#define TIOTYPE struct bsdtty + +static TIOTYPE otio; + +static int +get_tty_settings (tty, tiop) + int tty; + TIOTYPE *tiop; +{ +#if !defined (SHELL) && defined (TIOCGWINSZ) + struct winsize w; + + if (ioctl (tty, TIOCGWINSZ, &w) == 0) + (void) ioctl (tty, TIOCSWINSZ, &w); +#endif + + tiop->flags = tiop->lflag = 0; + + ioctl (tty, TIOCGETP, &(tiop->sgttyb)); + tiop->flags |= SGTTY_SET; + +#if defined (TIOCLGET) + ioctl (tty, TIOCLGET, &(tiop->lflag)); + tiop->flags |= LFLAG_SET; +#endif + +#if defined (TIOCGETC) + ioctl (tty, TIOCGETC, &(tiop->tchars)); + tiop->flags |= TCHARS_SET; +#endif + +#if defined (TIOCGLTC) + ioctl (tty, TIOCGLTC, &(tiop->ltchars)); + tiop->flags |= LTCHARS_SET; +#endif + + return 0; +} + +set_tty_settings (tty, tiop) + int tty; + TIOTYPE *tiop; +{ + if (tiop->flags & SGTTY_SET) + { + ioctl (tty, TIOCSETN, &(tiop->sgttyb)); + tiop->flags &= ~SGTTY_SET; + } + readline_echoing_p = 1; + +#if defined (TIOCLSET) + if (tiop->flags & LFLAG_SET) + { + ioctl (tty, TIOCLSET, &(tiop->lflag)); + tiop->flags &= ~LFLAG_SET; + } +#endif + +#if defined (TIOCSETC) + if (tiop->flags & TCHARS_SET) + { + ioctl (tty, TIOCSETC, &(tiop->tchars)); + tiop->flags &= ~TCHARS_SET; + } +#endif + +#if defined (TIOCSLTC) + if (tiop->flags & LTCHARS_SET) + { + ioctl (tty, TIOCSLTC, &(tiop->ltchars)); + tiop->flags &= ~LTCHARS_SET; + } +#endif + + return 0; +} + +static void +prepare_terminal_settings (meta_flag, otio, tiop) + int meta_flag; + TIOTYPE otio, *tiop; +{ +#if !defined (__GO32__) + readline_echoing_p = (otio.sgttyb.sg_flags & ECHO); + + /* Copy the original settings to the structure we're going to use for + our settings. */ + tiop->sgttyb = otio.sgttyb; + tiop->lflag = otio.lflag; +#if defined (TIOCGETC) + tiop->tchars = otio.tchars; +#endif +#if defined (TIOCGLTC) + tiop->ltchars = otio.ltchars; +#endif + tiop->flags = otio.flags; + + /* First, the basic settings to put us into character-at-a-time, no-echo + input mode. */ + tiop->sgttyb.sg_flags &= ~(ECHO | CRMOD); + tiop->sgttyb.sg_flags |= CBREAK; + + /* If this terminal doesn't care how the 8th bit is used, then we can + use it for the meta-key. If only one of even or odd parity is + specified, then the terminal is using parity, and we cannot. */ +#if !defined (ANYP) +# define ANYP (EVENP | ODDP) +#endif + if (((otio.sgttyb.sg_flags & ANYP) == ANYP) || + ((otio.sgttyb.sg_flags & ANYP) == 0)) + { + tiop->sgttyb.sg_flags |= ANYP; + + /* Hack on local mode flags if we can. */ +#if defined (TIOCLGET) +# if defined (LPASS8) + tiop->lflag |= LPASS8; +# endif /* LPASS8 */ +#endif /* TIOCLGET */ + } + +#if defined (TIOCGETC) +# if defined (USE_XON_XOFF) + /* Get rid of terminal output start and stop characters. */ + tiop->tchars.t_stopc = -1; /* C-s */ + tiop->tchars.t_startc = -1; /* C-q */ + + /* If there is an XON character, bind it to restart the output. */ + if (otio.tchars.t_startc != -1) + rl_bind_key (otio.tchars.t_startc, rl_restart_output); +# endif /* USE_XON_XOFF */ + + /* If there is an EOF char, bind _rl_eof_char to it. */ + if (otio.tchars.t_eofc != -1) + _rl_eof_char = otio.tchars.t_eofc; + +# if defined (NO_KILL_INTR) + /* Get rid of terminal-generated SIGQUIT and SIGINT. */ + tiop->tchars.t_quitc = -1; /* C-\ */ + tiop->tchars.t_intrc = -1; /* C-c */ +# endif /* NO_KILL_INTR */ +#endif /* TIOCGETC */ + +#if defined (TIOCGLTC) + /* Make the interrupt keys go away. Just enough to make people happy. */ + tiop->ltchars.t_dsuspc = -1; /* C-y */ + tiop->ltchars.t_lnextc = -1; /* C-v */ +#endif /* TIOCGLTC */ +#endif /* !__GO32__ */ +} + +#else /* !defined (NEW_TTY_DRIVER) */ + +#if !defined (VMIN) +# define VMIN VEOF +#endif + +#if !defined (VTIME) +# define VTIME VEOL +#endif + +#if defined (TERMIOS_TTY_DRIVER) +# define TIOTYPE struct termios +# define DRAIN_OUTPUT(fd) tcdrain (fd) +# define GETATTR(tty, tiop) (tcgetattr (tty, tiop)) +# define SETATTR(tty, tiop) (tcsetattr (tty, TCSANOW, tiop)) +#else +# define TIOTYPE struct termio +# define DRAIN_OUTPUT(fd) +# define GETATTR(tty, tiop) (ioctl (tty, TCGETA, tiop)) +# define SETATTR(tty, tiop) (ioctl (tty, TCSETA, tiop)) +#endif /* !TERMIOS_TTY_DRIVER */ + +static TIOTYPE otio; + +#if defined (FLUSHO) +# define OUTPUT_BEING_FLUSHED(tp) (tp->c_lflag & FLUSHO) +#else +# define OUTPUT_BEING_FLUSHED(tp) 0 +#endif + +static int +get_tty_settings (tty, tiop) + int tty; + TIOTYPE *tiop; +{ +#if !defined (SHELL) && defined (TIOCGWINSZ) + struct winsize w; + + if (ioctl (tty, TIOCGWINSZ, &w) == 0) + (void) ioctl (tty, TIOCSWINSZ, &w); +#endif + + /* Keep looping if output is being flushed after a ^O (or whatever + the flush character is). */ + while (GETATTR (tty, tiop) < 0 || OUTPUT_BEING_FLUSHED (tiop)) + { + if (OUTPUT_BEING_FLUSHED (tiop)) + continue; + if (errno != EINTR) + return -1; + errno = 0; + } + return 0; +} + +static int +set_tty_settings (tty, tiop) + int tty; + TIOTYPE *tiop; +{ + while (SETATTR (tty, tiop) < 0) + { + if (errno != EINTR) + return -1; + errno = 0; + } + +#if 0 + +#if defined (TERMIOS_TTY_DRIVER) +# if defined (__ksr1__) + if (ksrflow) + { + ksrflow = 0; + tcflow (tty, TCOON); + } +# else /* !ksr1 */ + tcflow (tty, TCOON); /* Simulate a ^Q. */ +# endif /* !ksr1 */ +#else + ioctl (tty, TCXONC, 1); /* Simulate a ^Q. */ +#endif /* !TERMIOS_TTY_DRIVER */ + +#endif + + return 0; +} + +static void +prepare_terminal_settings (meta_flag, otio, tiop) + int meta_flag; + TIOTYPE otio, *tiop; +{ + readline_echoing_p = (otio.c_lflag & ECHO); + + tiop->c_lflag &= ~(ICANON | ECHO); + + if ((unsigned char) otio.c_cc[VEOF] != (unsigned char) _POSIX_VDISABLE) + _rl_eof_char = otio.c_cc[VEOF]; + +#if defined (USE_XON_XOFF) +#if defined (IXANY) + tiop->c_iflag &= ~(IXON | IXOFF | IXANY); +#else + /* `strict' Posix systems do not define IXANY. */ + tiop->c_iflag &= ~(IXON | IXOFF); +#endif /* IXANY */ +#endif /* USE_XON_XOFF */ + + /* Only turn this off if we are using all 8 bits. */ + if (((tiop->c_cflag & CSIZE) == CS8) || meta_flag) + tiop->c_iflag &= ~(ISTRIP | INPCK); + + /* Make sure we differentiate between CR and NL on input. */ + tiop->c_iflag &= ~(ICRNL | INLCR); + +#if !defined (HANDLE_SIGNALS) + tiop->c_lflag &= ~ISIG; +#else + tiop->c_lflag |= ISIG; +#endif + + tiop->c_cc[VMIN] = 1; + tiop->c_cc[VTIME] = 0; + + if (tiop->c_lflag & FLUSHO) + { + output_was_flushed = 1; + tiop->c_lflag &= ~FLUSHO; + otio.c_lflag &= ~FLUSHO; + } + + /* Turn off characters that we need on Posix systems with job control, + just to be sure. This includes ^Y and ^V. This should not really + be necessary. */ +#if defined (TERMIOS_TTY_DRIVER) && defined (_POSIX_VDISABLE) + +#if defined (VLNEXT) + tiop->c_cc[VLNEXT] = _POSIX_VDISABLE; +#endif + +#if defined (VDSUSP) + tiop->c_cc[VDSUSP] = _POSIX_VDISABLE; +#endif + +#endif /* TERMIOS_TTY_DRIVER && _POSIX_VDISABLE */ +} +#endif /* NEW_TTY_DRIVER */ + +/* Put the terminal in CBREAK mode so that we can detect key presses. */ +void +rl_prep_terminal (meta_flag) + int meta_flag; +{ +#if !defined (__GO32__) + int tty = fileno (rl_instream); + TIOTYPE tio; + + if (terminal_prepped) + return; + + /* Try to keep this function from being INTerrupted. */ + block_sigint (); + + if (get_tty_settings (tty, &tio) < 0) + { + release_sigint (); + return; + } + + otio = tio; + + prepare_terminal_settings (meta_flag, otio, &tio); + + if (set_tty_settings (tty, &tio) < 0) + { + release_sigint (); + return; + } + + if (output_was_flushed) + output_was_flushed = 0; + + control_meta_key (1); + control_keypad (1); + fflush (rl_outstream); + terminal_prepped = 1; + + release_sigint (); +#endif /* !__GO32__ */ +} + +/* Restore the terminal's normal settings and modes. */ +void +rl_deprep_terminal () +{ +#if !defined (__GO32__) + int tty = fileno (rl_instream); + + if (!terminal_prepped) + return; + + /* Try to keep this function from being INTerrupted. */ + block_sigint (); + + if (set_tty_settings (tty, &otio) < 0) + { + release_sigint (); + return; + } + + control_meta_key (0); + control_keypad (0); + fflush (rl_outstream); + terminal_prepped = 0; + + release_sigint (); +#endif /* !__GO32__ */ +} + +/* **************************************************************** */ +/* */ +/* Bogus Flow Control */ +/* */ +/* **************************************************************** */ + +rl_restart_output (count, key) + int count, key; +{ + int fildes = fileno (rl_outstream); +#if defined (TIOCSTART) +#if defined (apollo) + ioctl (&fildes, TIOCSTART, 0); +#else + ioctl (fildes, TIOCSTART, 0); +#endif /* apollo */ + +#else /* !TIOCSTART */ +# if defined (TERMIOS_TTY_DRIVER) +# if defined (__ksr1__) + if (ksrflow) + { + ksrflow = 0; + tcflow (fildes, TCOON); + } +# else /* !ksr1 */ + tcflow (fildes, TCOON); /* Simulate a ^Q. */ +# endif /* !ksr1 */ +# else /* !TERMIOS_TTY_DRIVER */ +# if defined (TCXONC) + ioctl (fildes, TCXONC, TCOON); +# endif /* TCXONC */ +# endif /* !TERMIOS_TTY_DRIVER */ +#endif /* !TIOCSTART */ + + return 0; +} + +rl_stop_output (count, key) + int count, key; +{ + int fildes = fileno (rl_instream); + +#if defined (TIOCSTOP) +# if defined (apollo) + ioctl (&fildes, TIOCSTOP, 0); +# else + ioctl (fildes, TIOCSTOP, 0); +# endif /* apollo */ +#else /* !TIOCSTOP */ +# if defined (TERMIOS_TTY_DRIVER) +# if defined (__ksr1__) + ksrflow = 1; +# endif /* ksr1 */ + tcflow (fildes, TCOOFF); +# else +# if defined (TCXONC) + ioctl (fildes, TCXONC, TCOON); +# endif /* TCXONC */ +# endif /* !TERMIOS_TTY_DRIVER */ +#endif /* !TIOCSTOP */ + + return 0; +} + +/* **************************************************************** */ +/* */ +/* Default Key Bindings */ +/* */ +/* **************************************************************** */ +void +rltty_set_default_bindings (kmap) + Keymap kmap; +{ + TIOTYPE ttybuff; + int tty = fileno (rl_instream); + +#if defined (NEW_TTY_DRIVER) + +#define SET_SPECIAL(sc, func) \ + do \ + { \ + int ic; \ + ic = sc; \ + if (ic != -1 && kmap[ic].type == ISFUNC) \ + kmap[ic].function = func; \ + } \ + while (0) + + if (get_tty_settings (tty, &ttybuff) == 0) + { + if (ttybuff.flags & SGTTY_SET) + { + SET_SPECIAL (ttybuff.sgttyb.sg_erase, rl_rubout); + SET_SPECIAL (ttybuff.sgttyb.sg_kill, rl_unix_line_discard); + } + +# if defined (TIOCGLTC) + if (ttybuff.flags & LTCHARS_SET) + { + SET_SPECIAL (ttybuff.ltchars.t_werasc, rl_unix_word_rubout); + SET_SPECIAL (ttybuff.ltchars.t_lnextc, rl_quoted_insert); + } +# endif /* TIOCGLTC */ + } + +#else /* !NEW_TTY_DRIVER */ + +#define SET_SPECIAL(sc, func) \ + do \ + { \ + unsigned char uc; \ + uc = ttybuff.c_cc[sc]; \ + if (uc != (unsigned char)_POSIX_VDISABLE && kmap[uc].type == ISFUNC) \ + kmap[uc].function = func; \ + } \ + while (0) + + if (get_tty_settings (tty, &ttybuff) == 0) + { + SET_SPECIAL (VERASE, rl_rubout); + SET_SPECIAL (VKILL, rl_unix_line_discard); + +# if defined (VLNEXT) && defined (TERMIOS_TTY_DRIVER) + SET_SPECIAL (VLNEXT, rl_quoted_insert); +# endif /* VLNEXT && TERMIOS_TTY_DRIVER */ + +# if defined (VWERASE) && defined (TERMIOS_TTY_DRIVER) + SET_SPECIAL (VWERASE, rl_unix_word_rubout); +# endif /* VWERASE && TERMIOS_TTY_DRIVER */ + } +#endif /* !NEW_TTY_DRIVER */ +} diff --git a/search.c b/search.c new file mode 100644 index 0000000..a2b8c5e --- /dev/null +++ b/search.c @@ -0,0 +1,367 @@ +/* search.c - code for non-incremental searching in emacs and vi modes. */ + +/* Copyright (C) 1992 Free Software Foundation, Inc. + + This file is part of the Readline Library (the Library), a set of + routines for providing Emacs style line input to programs that ask + for it. + + The Library is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 1, or (at your option) + any later version. + + The Library is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif + +#include "memalloc.h" +#include "rldefs.h" +#include "readline.h" +#include "history.h" + +#define STREQ(a, b) (((a)[0] == (b)[0]) && (strcmp ((a), (b)) == 0)) +#define STREQN(a, b, n) (((a)[0] == (b)[0]) && (strncmp ((a), (b), (n)) == 0)) + +#define abs(x) (((x) > 0) ? (x) : -(x)) + +extern char *xmalloc (), *xrealloc (); + +/* Variables imported from readline.c */ +extern int rl_point, rl_end, rl_line_buffer_len; +extern Keymap _rl_keymap; +extern char *rl_prompt; +extern char *rl_line_buffer; +extern HIST_ENTRY *saved_line_for_history; +extern Function *rl_last_func; + +/* Functions imported from the rest of the library. */ +extern int _rl_free_history_entry (); + +static char *noninc_search_string = (char *) NULL; +static int noninc_history_pos = 0; +static char *prev_line_found = (char *) NULL; + +/* Search the history list for STRING starting at absolute history position + POS. If STRING begins with `^', the search must match STRING at the + beginning of a history line, otherwise a full substring match is performed + for STRING. DIR < 0 means to search backwards through the history list, + DIR >= 0 means to search forward. */ +static int +noninc_search_from_pos (string, pos, dir) + char *string; + int pos, dir; +{ + int ret, old; + + old = where_history (); + history_set_pos (pos); + + if (*string == '^') + ret = history_search_prefix (string + 1, dir); + else + ret = history_search (string, dir); + + if (ret != -1) + ret = where_history (); + + history_set_pos (old); + return (ret); +} + +/* Search for a line in the history containing STRING. If DIR is < 0, the + search is backwards through previous entries, else through subsequent + entries. */ +static void +noninc_dosearch (string, dir) + char *string; + int dir; +{ + int oldpos, pos; + HIST_ENTRY *entry; + + if (string == 0 || *string == 0 || noninc_history_pos < 0) + { + ding (); + return; + } + + pos = noninc_search_from_pos (string, noninc_history_pos + dir, dir); + if (pos == -1) + { + /* Search failed, current history position unchanged. */ + maybe_unsave_line (); + rl_clear_message (); + rl_point = 0; + ding (); + return; + } + + noninc_history_pos = pos; + + oldpos = where_history (); + history_set_pos (noninc_history_pos); + entry = current_history (); + history_set_pos (oldpos); + + { + int line_len; + + line_len = strlen (entry->line); + if (line_len >= rl_line_buffer_len) + rl_extend_line_buffer (line_len); + strcpy (rl_line_buffer, entry->line); + } + + rl_undo_list = (UNDO_LIST *)entry->data; + rl_end = strlen (rl_line_buffer); + rl_point = 0; + rl_clear_message (); + + if (saved_line_for_history) + _rl_free_history_entry (saved_line_for_history); + saved_line_for_history = (HIST_ENTRY *)NULL; +} + +/* Search non-interactively through the history list. DIR < 0 means to + search backwards through the history of previous commands; otherwise + the search is for commands subsequent to the current position in the + history list. PCHAR is the character to use for prompting when reading + the search string; if not specified (0), it defaults to `:'. */ +static void +noninc_search (dir, pchar) + int dir; + int pchar; +{ + int saved_point, c, pmtlen; + char *p; + + maybe_save_line (); + saved_point = rl_point; + + /* Use the line buffer to read the search string. */ + rl_line_buffer[0] = 0; + rl_end = rl_point = 0; + + /* XXX - this needs fixing to work with the prompt expansion stuff - XXX */ + pmtlen = (rl_prompt && *rl_prompt) ? strlen (rl_prompt) : 0; + p = xmalloc (2 + pmtlen); + if (pmtlen) + strcpy (p, rl_prompt); + p[pmtlen] = pchar ? pchar : ':'; + p[pmtlen + 1] = '\0'; + + rl_message (p, 0, 0); + free (p); + + /* Read the search string. */ + while (c = rl_read_key ()) + { + switch (c) + { + case CTRL('H'): + case RUBOUT: + if (rl_point == 0) + { + maybe_unsave_line (); + rl_clear_message (); + rl_point = saved_point; + return; + } + rl_rubout (1); + break; + + case CTRL('W'): + rl_unix_word_rubout (); + break; + + case CTRL('U'): + rl_unix_line_discard (); + break; + + case RETURN: + case NEWLINE: + goto dosearch; + /* NOTREACHED */ + break; + + case CTRL('C'): + case CTRL('G'): + maybe_unsave_line (); + rl_clear_message (); + rl_point = saved_point; + ding (); + return; + + default: + rl_insert (1, c); + break; + } + rl_redisplay (); + } + + dosearch: + /* If rl_point == 0, we want to re-use the previous search string and + start from the saved history position. If there's no previous search + string, punt. */ + if (rl_point == 0) + { + if (!noninc_search_string) + { + ding (); + return; + } + } + else + { + /* We want to start the search from the current history position. */ + noninc_history_pos = where_history (); + if (noninc_search_string) + free (noninc_search_string); + noninc_search_string = savestring (rl_line_buffer); + } + + noninc_dosearch (noninc_search_string, dir); +} + +/* Search forward through the history list for a string. If the vi-mode + code calls this, KEY will be `?'. */ +rl_noninc_forward_search (count, key) + int count, key; +{ + if (key == '?') + noninc_search (1, '?'); + else + noninc_search (1, 0); + return 0; +} + +/* Reverse search the history list for a string. If the vi-mode code + calls this, KEY will be `/'. */ +rl_noninc_reverse_search (count, key) + int count, key; +{ + if (key == '/') + noninc_search (-1, '/'); + else + noninc_search (-1, 0); + return 0; +} + +/* Search forward through the history list for the last string searched + for. If there is no saved search string, abort. */ +rl_noninc_forward_search_again (count, key) + int count, key; +{ + if (!noninc_search_string) + { + ding (); + return (-1); + } + noninc_dosearch (noninc_search_string, 1); + return 0; +} + +/* Reverse search in the history list for the last string searched + for. If there is no saved search string, abort. */ +rl_noninc_reverse_search_again (count, key) + int count, key; +{ + if (!noninc_search_string) + { + ding (); + return (-1); + } + noninc_dosearch (noninc_search_string, -1); + return 0; +} + +static int +rl_history_search_internal (count, direction) + int count, direction; +{ + HIST_ENTRY *temp, *old_temp; + int line_len; + + maybe_save_line (); + + temp = old_temp = (HIST_ENTRY *)NULL; + while (count) + { + temp = (direction < 0) ? previous_history () : next_history (); + if (!temp) + break; + if (STREQN (rl_line_buffer, temp->line, rl_point)) + { + /* Don't find multiple instances of the same line. */ + if (prev_line_found && STREQ (prev_line_found, temp->line)) + continue; + if (direction < 0) + old_temp = temp; + prev_line_found = temp->line; + count--; + } + } + + if (!temp) + { + if (direction < 0 && old_temp) + temp = old_temp; + else + { + maybe_unsave_line (); + ding (); + return 1; + } + } + + line_len = strlen (temp->line); + if (line_len >= rl_line_buffer_len) + rl_extend_line_buffer (line_len); + strcpy (rl_line_buffer, temp->line); + rl_undo_list = (UNDO_LIST *)temp->data; + rl_end = line_len; + return 0; +} + +/* Search forward in the history for the string of characters + from the start of the line to rl_point. This is a non-incremental + search. */ +int +rl_history_search_forward (count, ignore) + int count, ignore; +{ + if (count == 0) + return (0); + if (rl_last_func != rl_history_search_forward) + prev_line_found = (char *)NULL; + return (rl_history_search_internal (abs (count), (count > 0) ? 1 : -1)); +} + +/* Search backward through the history for the string of characters + from the start of the line to rl_point. This is a non-incremental + search. */ +int +rl_history_search_backward (count, ignore) + int count, ignore; +{ + if (count == 0) + return (0); + if (rl_last_func != rl_history_search_backward) + prev_line_found = (char *)NULL; + return (rl_history_search_internal (abs (count), (count > 0) ? -1 : 1)); +} diff --git a/signals.c b/signals.c new file mode 100644 index 0000000..a9fda5c --- /dev/null +++ b/signals.c @@ -0,0 +1,303 @@ +/* signals.c -- signal handling support for readline. */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +#include +#include +#include +#if !defined (NO_SYS_FILE) +# include +#endif /* !NO_SYS_FILE */ +#include + +#if defined (HAVE_UNISTD_H) +# include +#endif /* HAVE_UNISTD_H */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include +/* Not all systems declare ERRNO in errno.h... and some systems #define it! */ +#if !defined (errno) +extern int errno; +#endif /* !errno */ + +#include "posixstat.h" + +/* System-specific feature definitions and include files. */ +#include "rldefs.h" + +#if defined (GWINSZ_IN_SYS_IOCTL) +# include +#endif /* GWINSZ_IN_SYS_IOCTL */ + +/* Some standard library routines. */ +#include "readline.h" +#include "history.h" + +static void cr (); + +extern int readline_echoing_p; +extern int rl_pending_input; +extern char *term_cr; + +extern int _rl_meta_flag; + +extern int _rl_output_character_function (); + +extern void free_undo_list (); + +#if defined (VOID_SIGHANDLER) +# define sighandler void +#else +# define sighandler int +#endif /* VOID_SIGHANDLER */ + +/* This typedef is equivalant to the one for Function; it allows us + to say SigHandler *foo = signal (SIGKILL, SIG_IGN); */ +typedef sighandler SigHandler (); + +#if defined (__GO32__) +# undef HANDLE_SIGNALS +#endif /* __GO32__ */ + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + + +/* **************************************************************** */ +/* */ +/* Signal Handling */ +/* */ +/* **************************************************************** */ + +#if defined (SIGWINCH) +static SigHandler *old_sigwinch = (SigHandler *)NULL; + +static sighandler +rl_handle_sigwinch (sig) + int sig; +{ + if (readline_echoing_p) + { + _rl_set_screen_size (fileno (rl_instream), 1); + + cr (); /* was crlf () */ + rl_forced_update_display (); + } + + if (old_sigwinch && + old_sigwinch != (SigHandler *)SIG_IGN && + old_sigwinch != (SigHandler *)SIG_DFL) + (*old_sigwinch) (sig); +#if !defined (VOID_SIGHANDLER) + return (0); +#endif /* VOID_SIGHANDLER */ +} +#endif /* SIGWINCH */ + +#if defined (HANDLE_SIGNALS) +/* Interrupt handling. */ +static SigHandler + *old_int = (SigHandler *)NULL, + *old_alrm = (SigHandler *)NULL; +#if !defined (SHELL) +static SigHandler + *old_tstp = (SigHandler *)NULL, + *old_ttou = (SigHandler *)NULL, + *old_ttin = (SigHandler *)NULL, + *old_cont = (SigHandler *)NULL; +#endif /* !SHELL */ + +/* Handle an interrupt character. */ +static sighandler +rl_signal_handler (sig) + int sig; +{ +#if defined (HAVE_POSIX_SIGNALS) + sigset_t set; +#else /* !HAVE_POSIX_SIGNALS */ +# if defined (HAVE_BSD_SIGNALS) + long omask; +# endif /* HAVE_BSD_SIGNALS */ +#endif /* !HAVE_POSIX_SIGNALS */ + +#if !defined (HAVE_BSD_SIGNALS) && !defined (HAVE_POSIX_SIGNALS) + /* Since the signal will not be blocked while we are in the signal + handler, ignore it until rl_clear_signals resets the catcher. */ + if (sig == SIGINT) + signal (sig, SIG_IGN); +#endif /* !HAVE_BSD_SIGNALS */ + + switch (sig) + { + case SIGINT: + { + register HIST_ENTRY *entry; + + free_undo_list (); + + entry = current_history (); + if (entry) + entry->data = (char *)NULL; + } + _rl_kill_kbd_macro (); + rl_clear_message (); + rl_init_argument (); + +#if defined (SIGTSTP) + case SIGTSTP: + case SIGTTOU: + case SIGTTIN: +#endif /* SIGTSTP */ + case SIGALRM: + rl_clean_up_for_exit (); + rl_deprep_terminal (); + rl_clear_signals (); + rl_pending_input = 0; + +#if defined (HAVE_POSIX_SIGNALS) + sigprocmask (SIG_BLOCK, (sigset_t *)NULL, &set); + sigdelset (&set, sig); +#else /* !HAVE_POSIX_SIGNALS */ +# if defined (HAVE_BSD_SIGNALS) + omask = sigblock (0); +# endif /* HAVE_BSD_SIGNALS */ +#endif /* !HAVE_POSIX_SIGNALS */ + + kill (getpid (), sig); + + /* Let the signal that we just sent through. */ +#if defined (HAVE_POSIX_SIGNALS) + sigprocmask (SIG_SETMASK, &set, (sigset_t *)NULL); +#else /* !HAVE_POSIX_SIGNALS */ +# if defined (HAVE_BSD_SIGNALS) + sigsetmask (omask & ~(sigmask (sig))); +# endif /* HAVE_BSD_SIGNALS */ +#endif /* !HAVE_POSIX_SIGNALS */ + + rl_prep_terminal (_rl_meta_flag); + rl_set_signals (); + } + +#if !defined (VOID_SIGHANDLER) + return (0); +#endif /* !VOID_SIGHANDLER */ +} + +#if defined (HAVE_POSIX_SIGNALS) +static SigHandler * +rl_set_sighandler (sig, handler) + int sig; + SigHandler *handler; +{ + struct sigaction act, oact; + + act.sa_handler = handler; + act.sa_flags = 0; + sigemptyset (&act.sa_mask); + sigemptyset (&oact.sa_mask); + sigaction (sig, &act, &oact); + return (oact.sa_handler); +} + +#else /* !HAVE_POSIX_SIGNALS */ +# define rl_set_sighandler(sig, handler) (SigHandler *)signal (sig, handler) +#endif /* !HAVE_POSIX_SIGNALS */ + +rl_set_signals () +{ + old_int = (SigHandler *)rl_set_sighandler (SIGINT, rl_signal_handler); + if (old_int == (SigHandler *)SIG_IGN) + signal (SIGINT, SIG_IGN); + + old_alrm = (SigHandler *)rl_set_sighandler (SIGALRM, rl_signal_handler); + if (old_alrm == (SigHandler *)SIG_IGN) + signal (SIGALRM, SIG_IGN); + +#if !defined (SHELL) + +#if defined (SIGTSTP) + old_tstp = (SigHandler *)rl_set_sighandler (SIGTSTP, rl_signal_handler); + if (old_tstp == (SigHandler *)SIG_IGN) + signal (SIGTSTP, SIG_IGN); +#endif /* SIGTSTP */ +#if defined (SIGTTOU) + old_ttou = (SigHandler *)rl_set_sighandler (SIGTTOU, rl_signal_handler); + old_ttin = (SigHandler *)rl_set_sighandler (SIGTTIN, rl_signal_handler); + + if (old_tstp == (SigHandler *)SIG_IGN) + { + signal (SIGTTOU, SIG_IGN); + signal (SIGTTIN, SIG_IGN); + } +#endif /* SIGTTOU */ + +#endif /* !SHELL */ + +#if defined (SIGWINCH) + old_sigwinch = + (SigHandler *) rl_set_sighandler (SIGWINCH, rl_handle_sigwinch); +#endif /* SIGWINCH */ + return 0; +} + +rl_clear_signals () +{ + rl_set_sighandler (SIGINT, old_int); + rl_set_sighandler (SIGALRM, old_alrm); + +#if !defined (SHELL) + +#if defined (SIGTSTP) + signal (SIGTSTP, old_tstp); +#endif + +#if defined (SIGTTOU) + signal (SIGTTOU, old_ttou); + signal (SIGTTIN, old_ttin); +#endif /* SIGTTOU */ + +#endif /* !SHELL */ + +#if defined (SIGWINCH) + signal (SIGWINCH, old_sigwinch); +#endif + + return 0; +} + +/* Move to the start of the current line. */ +static void +cr () +{ + if (term_cr) + tputs (term_cr, 1, _rl_output_character_function); +} +#endif /* HANDLE_SIGNALS */ diff --git a/stamp-config b/stamp-config new file mode 100644 index 0000000..e69de29 diff --git a/tilde.c b/tilde.c new file mode 100644 index 0000000..89168a0 --- /dev/null +++ b/tilde.c @@ -0,0 +1,386 @@ +/* tilde.c -- Tilde expansion code (~/foo := $HOME/foo). */ + +/* Copyright (C) 1988,1989 Free Software Foundation, Inc. + + This file is part of GNU Readline, a library for reading lines + of text with interactive input and history editing. + + Readline is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 1, or (at your option) any + later version. + + Readline is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + You should have received a copy of the GNU General Public License + along with Readline; see the file COPYING. If not, write to the Free + Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#include "memalloc.h" + +#if defined (HAVE_STRING_H) +# include +#else /* !HAVE_STRING_H */ +# include +#endif /* !HAVE_STRING_H */ + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#include "tilde.h" +#include + +#if defined (USG) && !defined (HAVE_GETPW_DECLS) +extern struct passwd *getpwuid (), *getpwnam (); +#endif /* USG && !defined (HAVE_GETPW_DECLS) */ + +#if !defined (savestring) +extern char *xmalloc (); +# ifndef strcpy +extern char *strcpy (); +# endif +#define savestring(x) strcpy (xmalloc (1 + strlen (x)), (x)) +#endif /* !savestring */ + +#if !defined (NULL) +# if defined (__STDC__) +# define NULL ((void *) 0) +# else +# define NULL 0x0 +# endif /* !__STDC__ */ +#endif /* !NULL */ + +#if defined (TEST) || defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* TEST || STATIC_MALLOC */ + +/* The default value of tilde_additional_prefixes. This is set to + whitespace preceding a tilde so that simple programs which do not + perform any word separation get desired behaviour. */ +static char *default_prefixes[] = + { " ~", "\t~", (char *)NULL }; + +/* The default value of tilde_additional_suffixes. This is set to + whitespace or newline so that simple programs which do not + perform any word separation get desired behaviour. */ +static char *default_suffixes[] = + { " ", "\n", (char *)NULL }; + +/* If non-null, this contains the address of a function to call if the + standard meaning for expanding a tilde fails. The function is called + with the text (sans tilde, as in "foo"), and returns a malloc()'ed string + which is the expansion, or a NULL pointer if there is no expansion. */ +CPFunction *tilde_expansion_failure_hook = (CPFunction *)NULL; + +/* When non-null, this is a NULL terminated array of strings which + are duplicates for a tilde prefix. Bash uses this to expand + `=~' and `:~'. */ +char **tilde_additional_prefixes = default_prefixes; + +/* When non-null, this is a NULL terminated array of strings which match + the end of a username, instead of just "/". Bash sets this to + `:' and `=~'. */ +char **tilde_additional_suffixes = default_suffixes; + +/* Find the start of a tilde expansion in STRING, and return the index of + the tilde which starts the expansion. Place the length of the text + which identified this tilde starter in LEN, excluding the tilde itself. */ +static int +tilde_find_prefix (string, len) + char *string; + int *len; +{ + register int i, j, string_len; + register char **prefixes = tilde_additional_prefixes; + + string_len = strlen (string); + *len = 0; + + if (!*string || *string == '~') + return (0); + + if (prefixes) + { + for (i = 0; i < string_len; i++) + { + for (j = 0; prefixes[j]; j++) + { + if (strncmp (string + i, prefixes[j], strlen (prefixes[j])) == 0) + { + *len = strlen (prefixes[j]) - 1; + return (i + *len); + } + } + } + } + return (string_len); +} + +/* Find the end of a tilde expansion in STRING, and return the index of + the character which ends the tilde definition. */ +static int +tilde_find_suffix (string) + char *string; +{ + register int i, j, string_len; + register char **suffixes = tilde_additional_suffixes; + + string_len = strlen (string); + + for (i = 0; i < string_len; i++) + { + if (string[i] == '/' || !string[i]) + break; + + for (j = 0; suffixes && suffixes[j]; j++) + { + if (strncmp (string + i, suffixes[j], strlen (suffixes[j])) == 0) + return (i); + } + } + return (i); +} + +/* Return a new string which is the result of tilde expanding STRING. */ +char * +tilde_expand (string) + char *string; +{ + char *result, *tilde_expand_word (); + int result_size, result_index; + + result_size = result_index = 0; + result = (char *)NULL; + + /* Scan through STRING expanding tildes as we come to them. */ + while (1) + { + register int start, end; + char *tilde_word, *expansion; + int len; + + /* Make START point to the tilde which starts the expansion. */ + start = tilde_find_prefix (string, &len); + + /* Copy the skipped text into the result. */ + if ((result_index + start + 1) > result_size) + result = (char *)xrealloc (result, 1 + (result_size += (start + 20))); + + strncpy (result + result_index, string, start); + result_index += start; + + /* Advance STRING to the starting tilde. */ + string += start; + + /* Make END be the index of one after the last character of the + username. */ + end = tilde_find_suffix (string); + + /* If both START and END are zero, we are all done. */ + if (!start && !end) + break; + + /* Expand the entire tilde word, and copy it into RESULT. */ + tilde_word = (char *)xmalloc (1 + end); + strncpy (tilde_word, string, end); + tilde_word[end] = '\0'; + string += end; + + expansion = tilde_expand_word (tilde_word); + free (tilde_word); + + len = strlen (expansion); + if ((result_index + len + 1) > result_size) + result = (char *)xrealloc (result, 1 + (result_size += (len + 20))); + + strcpy (result + result_index, expansion); + result_index += len; + free (expansion); + } + + result[result_index] = '\0'; + + return (result); +} + +/* Do the work of tilde expansion on FILENAME. FILENAME starts with a + tilde. If there is no expansion, call tilde_expansion_failure_hook. */ +char * +tilde_expand_word (filename) + char *filename; +{ + char *dirname; + + dirname = filename ? savestring (filename) : (char *)NULL; + + if (dirname && *dirname == '~') + { + char *temp_name; + if (!dirname[1] || dirname[1] == '/') + { + /* Prepend $HOME to the rest of the string. */ + char *temp_home = (char *)getenv ("HOME"); + + /* If there is no HOME variable, look up the directory in + the password database. */ + if (!temp_home) + { + struct passwd *entry; + + entry = getpwuid (getuid ()); + if (entry) + temp_home = entry->pw_dir; + } + + temp_name = xmalloc (1 + strlen (&dirname[1]) + + (temp_home ? strlen (temp_home) : 0)); + temp_name[0] = '\0'; + if (temp_home) + strcpy (temp_name, temp_home); + strcat (temp_name, dirname + 1); + free (dirname); + dirname = temp_name; + } + else + { + char u_name[257]; + struct passwd *user_entry; + char *username; + int i, c; + + username = u_name; + for (i = 1; c = dirname[i]; i++) + { + if (c == '/') + break; + else + username[i - 1] = c; + } + username[i - 1] = '\0'; + + if (!(user_entry = getpwnam (username))) + { + /* If the calling program has a special syntax for + expanding tildes, and we couldn't find a standard + expansion, then let them try. */ + if (tilde_expansion_failure_hook) + { + char *expansion; + + expansion = (*tilde_expansion_failure_hook) (username); + + if (expansion) + { + temp_name = xmalloc (1 + strlen (expansion) + + strlen (&dirname[i])); + strcpy (temp_name, expansion); + strcat (temp_name, &dirname[i]); + free (expansion); + free (dirname); + dirname = temp_name; + } + } + /* We shouldn't report errors. */ + } + else + { + temp_name = xmalloc (1 + strlen (user_entry->pw_dir) + + strlen (&dirname[i])); + strcpy (temp_name, user_entry->pw_dir); + strcat (temp_name, &dirname[i]); + free (dirname); + dirname = temp_name; + } + endpwent (); + } + } + return (dirname); +} + + +#if defined (TEST) +#undef NULL +#include + +main (argc, argv) + int argc; + char **argv; +{ + char *result, line[512]; + int done = 0; + + while (!done) + { + printf ("~expand: "); + fflush (stdout); + + if (!gets (line)) + strcpy (line, "done"); + + if ((strcmp (line, "done") == 0) || + (strcmp (line, "quit") == 0) || + (strcmp (line, "exit") == 0)) + { + done = 1; + break; + } + + result = tilde_expand (line); + printf (" --> %s\n", result); + free (result); + } + exit (0); +} + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)malloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "readline: Out of virtual memory!\n"); + abort (); +} + +/* + * Local variables: + * compile-command: "gcc -g -DTEST -o tilde tilde.c" + * end: + */ +#endif /* TEST */ diff --git a/tilde.h b/tilde.h new file mode 100644 index 0000000..726d081 --- /dev/null +++ b/tilde.h @@ -0,0 +1,38 @@ +/* tilde.h: Externally available variables and function in libtilde.a. */ + +#if !defined (__TILDE_H__) +# define __TILDE_H__ + +/* Function pointers can be declared as (Function *)foo. */ +#if !defined (__FUNCTION_DEF) +# define __FUNCTION_DEF +typedef int Function (); +typedef void VFunction (); +typedef char *CPFunction (); +typedef char **CPPFunction (); +#endif /* _FUNCTION_DEF */ + +/* If non-null, this contains the address of a function to call if the + standard meaning for expanding a tilde fails. The function is called + with the text (sans tilde, as in "foo"), and returns a malloc()'ed string + which is the expansion, or a NULL pointer if there is no expansion. */ +extern CPFunction *tilde_expansion_failure_hook; + +/* When non-null, this is a NULL terminated array of strings which + are duplicates for a tilde prefix. Bash uses this to expand + `=~' and `:~'. */ +extern char **tilde_additional_prefixes; + +/* When non-null, this is a NULL terminated array of strings which match + the end of a username, instead of just "/". Bash sets this to + `:' and `=~'. */ +extern char **tilde_additional_suffixes; + +/* Return a new string which is the result of tilde expanding STRING. */ +extern char *tilde_expand (); + +/* Do the work of tilde expansion on FILENAME. FILENAME starts with a + tilde. If there is no expansion, call tilde_expansion_failure_hook. */ +extern char *tilde_expand_word (); + +#endif /* __TILDE_H__ */ diff --git a/vi_keymap.c b/vi_keymap.c new file mode 100644 index 0000000..b8b3123 --- /dev/null +++ b/vi_keymap.c @@ -0,0 +1,877 @@ +/* vi_keymap.c -- the keymap for vi_mode in readline (). */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if !defined (BUFSIZ) +#include +#endif /* !BUFSIZ */ + +#include "readline.h" + +#if 0 +extern KEYMAP_ENTRY_ARRAY vi_escape_keymap; +#endif + +/* The keymap arrays for handling vi mode. */ +KEYMAP_ENTRY_ARRAY vi_movement_keymap = { + /* The regular control keys come first. */ + { ISFUNC, (Function *)0x0 }, /* Control-@ */ + { ISFUNC, (Function *)0x0 }, /* Control-a */ + { ISFUNC, (Function *)0x0 }, /* Control-b */ + { ISFUNC, (Function *)0x0 }, /* Control-c */ + { ISFUNC, rl_vi_eof_maybe }, /* Control-d */ + { ISFUNC, rl_emacs_editing_mode }, /* Control-e */ + { ISFUNC, (Function *)0x0 }, /* Control-f */ + { ISFUNC, rl_abort }, /* Control-g */ + { ISFUNC, rl_backward }, /* Control-h */ + { ISFUNC, (Function *)0x0 }, /* Control-i */ + { ISFUNC, rl_newline }, /* Control-j */ + { ISFUNC, rl_kill_line }, /* Control-k */ + { ISFUNC, rl_clear_screen }, /* Control-l */ + { ISFUNC, rl_newline }, /* Control-m */ + { ISFUNC, rl_get_next_history }, /* Control-n */ + { ISFUNC, (Function *)0x0 }, /* Control-o */ + { ISFUNC, rl_get_previous_history }, /* Control-p */ + { ISFUNC, rl_quoted_insert }, /* Control-q */ + { ISFUNC, rl_reverse_search_history }, /* Control-r */ + { ISFUNC, rl_forward_search_history }, /* Control-s */ + { ISFUNC, rl_transpose_chars }, /* Control-t */ + { ISFUNC, rl_unix_line_discard }, /* Control-u */ + { ISFUNC, rl_quoted_insert }, /* Control-v */ + { ISFUNC, rl_unix_word_rubout }, /* Control-w */ + { ISFUNC, (Function *)0x0 }, /* Control-x */ + { ISFUNC, rl_yank }, /* Control-y */ + { ISFUNC, (Function *)0x0 }, /* Control-z */ + + { ISFUNC, (Function *)0x0 }, /* Control-[ */ /* vi_escape_keymap */ + { ISFUNC, (Function *)0x0 }, /* Control-\ */ + { ISFUNC, (Function *)0x0 }, /* Control-] */ + { ISFUNC, (Function *)0x0 }, /* Control-^ */ + { ISFUNC, rl_undo_command }, /* Control-_ */ + + /* The start of printing characters. */ + { ISFUNC, rl_forward }, /* SPACE */ + { ISFUNC, (Function *)0x0 }, /* ! */ + { ISFUNC, (Function *)0x0 }, /* " */ + { ISFUNC, rl_vi_comment }, /* # */ + { ISFUNC, rl_end_of_line }, /* $ */ + { ISFUNC, rl_vi_match }, /* % */ + { ISFUNC, rl_vi_tilde_expand }, /* & */ + { ISFUNC, (Function *)0x0 }, /* ' */ + { ISFUNC, (Function *)0x0 }, /* ( */ + { ISFUNC, (Function *)0x0 }, /* ) */ + { ISFUNC, rl_vi_complete }, /* * */ + { ISFUNC, rl_get_next_history}, /* + */ + { ISFUNC, rl_vi_char_search }, /* , */ + { ISFUNC, rl_get_previous_history }, /* - */ + { ISFUNC, rl_vi_redo }, /* . */ + { ISFUNC, rl_vi_search }, /* / */ + + /* Regular digits. */ + { ISFUNC, rl_beg_of_line }, /* 0 */ + { ISFUNC, rl_vi_arg_digit }, /* 1 */ + { ISFUNC, rl_vi_arg_digit }, /* 2 */ + { ISFUNC, rl_vi_arg_digit }, /* 3 */ + { ISFUNC, rl_vi_arg_digit }, /* 4 */ + { ISFUNC, rl_vi_arg_digit }, /* 5 */ + { ISFUNC, rl_vi_arg_digit }, /* 6 */ + { ISFUNC, rl_vi_arg_digit }, /* 7 */ + { ISFUNC, rl_vi_arg_digit }, /* 8 */ + { ISFUNC, rl_vi_arg_digit }, /* 9 */ + + /* A little more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* : */ + { ISFUNC, rl_vi_char_search }, /* ; */ + { ISFUNC, (Function *)0x0 }, /* < */ + { ISFUNC, rl_vi_complete }, /* = */ + { ISFUNC, (Function *)0x0 }, /* > */ + { ISFUNC, rl_vi_search }, /* ? */ + { ISFUNC, (Function *)0x0 }, /* @ */ + + /* Uppercase alphabet. */ + { ISFUNC, rl_vi_append_eol }, /* A */ + { ISFUNC, rl_vi_prev_word}, /* B */ + { ISFUNC, rl_vi_change_to }, /* C */ + { ISFUNC, rl_vi_delete_to }, /* D */ + { ISFUNC, rl_vi_end_word }, /* E */ + { ISFUNC, rl_vi_char_search }, /* F */ + { ISFUNC, rl_vi_fetch_history }, /* G */ + { ISFUNC, (Function *)0x0 }, /* H */ + { ISFUNC, rl_vi_insert_beg }, /* I */ + { ISFUNC, (Function *)0x0 }, /* J */ + { ISFUNC, (Function *)0x0 }, /* K */ + { ISFUNC, (Function *)0x0 }, /* L */ + { ISFUNC, (Function *)0x0 }, /* M */ + { ISFUNC, rl_vi_search_again }, /* N */ + { ISFUNC, (Function *)0x0 }, /* O */ + { ISFUNC, rl_vi_put }, /* P */ + { ISFUNC, (Function *)0x0 }, /* Q */ + { ISFUNC, rl_vi_replace }, /* R */ + { ISFUNC, rl_vi_subst }, /* S */ + { ISFUNC, rl_vi_char_search }, /* T */ + { ISFUNC, rl_revert_line }, /* U */ + { ISFUNC, (Function *)0x0 }, /* V */ + { ISFUNC, rl_vi_next_word }, /* W */ + { ISFUNC, rl_rubout }, /* X */ + { ISFUNC, rl_vi_yank_to }, /* Y */ + { ISFUNC, (Function *)0x0 }, /* Z */ + + /* Some more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* [ */ + { ISFUNC, rl_vi_complete }, /* \ */ + { ISFUNC, (Function *)0x0 }, /* ] */ + { ISFUNC, rl_vi_first_print }, /* ^ */ + { ISFUNC, rl_vi_yank_arg }, /* _ */ + { ISFUNC, (Function *)0x0 }, /* ` */ + + /* Lowercase alphabet. */ + { ISFUNC, rl_vi_append_mode }, /* a */ + { ISFUNC, rl_vi_prev_word }, /* b */ + { ISFUNC, rl_vi_change_to }, /* c */ + { ISFUNC, rl_vi_delete_to }, /* d */ + { ISFUNC, rl_vi_end_word }, /* e */ + { ISFUNC, rl_vi_char_search }, /* f */ + { ISFUNC, (Function *)0x0 }, /* g */ + { ISFUNC, rl_backward }, /* h */ + { ISFUNC, rl_vi_insertion_mode }, /* i */ + { ISFUNC, rl_get_next_history }, /* j */ + { ISFUNC, rl_get_previous_history }, /* k */ + { ISFUNC, rl_forward }, /* l */ + { ISFUNC, (Function *)0x0 }, /* m */ + { ISFUNC, rl_vi_search_again }, /* n */ + { ISFUNC, (Function *)0x0 }, /* o */ + { ISFUNC, rl_vi_put }, /* p */ + { ISFUNC, (Function *)0x0 }, /* q */ + { ISFUNC, rl_vi_change_char }, /* r */ + { ISFUNC, rl_vi_subst }, /* s */ + { ISFUNC, rl_vi_char_search }, /* t */ + { ISFUNC, rl_undo_command }, /* u */ + { ISFUNC, (Function *)0x0 }, /* v */ + { ISFUNC, rl_vi_next_word }, /* w */ + { ISFUNC, rl_vi_delete }, /* x */ + { ISFUNC, rl_vi_yank_to }, /* y */ + { ISFUNC, (Function *)0x0 }, /* z */ + + /* Final punctuation. */ + { ISFUNC, (Function *)0x0 }, /* { */ + { ISFUNC, rl_vi_column }, /* | */ + { ISFUNC, (Function *)0x0 }, /* } */ + { ISFUNC, rl_vi_change_case }, /* ~ */ + { ISFUNC, (Function *)0x0 }, /* RUBOUT */ + +#if KEYMAP_SIZE > 128 + /* Undefined keys. */ + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 } +#endif /* KEYMAP_SIZE > 128 */ +}; + + +KEYMAP_ENTRY_ARRAY vi_insertion_keymap = { + /* The regular control keys come first. */ + { ISFUNC, (Function *)0x0 }, /* Control-@ */ + { ISFUNC, rl_insert }, /* Control-a */ + { ISFUNC, rl_insert }, /* Control-b */ + { ISFUNC, rl_insert }, /* Control-c */ + { ISFUNC, rl_vi_eof_maybe }, /* Control-d */ + { ISFUNC, rl_insert }, /* Control-e */ + { ISFUNC, rl_insert }, /* Control-f */ + { ISFUNC, rl_insert }, /* Control-g */ + { ISFUNC, rl_rubout }, /* Control-h */ + { ISFUNC, rl_complete }, /* Control-i */ + { ISFUNC, rl_newline }, /* Control-j */ + { ISFUNC, rl_insert }, /* Control-k */ + { ISFUNC, rl_insert }, /* Control-l */ + { ISFUNC, rl_newline }, /* Control-m */ + { ISFUNC, rl_insert }, /* Control-n */ + { ISFUNC, rl_insert }, /* Control-o */ + { ISFUNC, rl_insert }, /* Control-p */ + { ISFUNC, rl_insert }, /* Control-q */ + { ISFUNC, rl_reverse_search_history }, /* Control-r */ + { ISFUNC, rl_forward_search_history }, /* Control-s */ + { ISFUNC, rl_transpose_chars }, /* Control-t */ + { ISFUNC, rl_unix_line_discard }, /* Control-u */ + { ISFUNC, rl_quoted_insert }, /* Control-v */ + { ISFUNC, rl_unix_word_rubout }, /* Control-w */ + { ISFUNC, rl_insert }, /* Control-x */ + { ISFUNC, rl_yank }, /* Control-y */ + { ISFUNC, rl_insert }, /* Control-z */ + + { ISFUNC, rl_vi_movement_mode }, /* Control-[ */ + { ISFUNC, rl_insert }, /* Control-\ */ + { ISFUNC, rl_insert }, /* Control-] */ + { ISFUNC, rl_insert }, /* Control-^ */ + { ISFUNC, rl_undo_command }, /* Control-_ */ + + /* The start of printing characters. */ + { ISFUNC, rl_insert }, /* SPACE */ + { ISFUNC, rl_insert }, /* ! */ + { ISFUNC, rl_insert }, /* " */ + { ISFUNC, rl_insert }, /* # */ + { ISFUNC, rl_insert }, /* $ */ + { ISFUNC, rl_insert }, /* % */ + { ISFUNC, rl_insert }, /* & */ + { ISFUNC, rl_insert }, /* ' */ + { ISFUNC, rl_insert }, /* ( */ + { ISFUNC, rl_insert }, /* ) */ + { ISFUNC, rl_insert }, /* * */ + { ISFUNC, rl_insert }, /* + */ + { ISFUNC, rl_insert }, /* , */ + { ISFUNC, rl_insert }, /* - */ + { ISFUNC, rl_insert }, /* . */ + { ISFUNC, rl_insert }, /* / */ + + /* Regular digits. */ + { ISFUNC, rl_insert }, /* 0 */ + { ISFUNC, rl_insert }, /* 1 */ + { ISFUNC, rl_insert }, /* 2 */ + { ISFUNC, rl_insert }, /* 3 */ + { ISFUNC, rl_insert }, /* 4 */ + { ISFUNC, rl_insert }, /* 5 */ + { ISFUNC, rl_insert }, /* 6 */ + { ISFUNC, rl_insert }, /* 7 */ + { ISFUNC, rl_insert }, /* 8 */ + { ISFUNC, rl_insert }, /* 9 */ + + /* A little more punctuation. */ + { ISFUNC, rl_insert }, /* : */ + { ISFUNC, rl_insert }, /* ; */ + { ISFUNC, rl_insert }, /* < */ + { ISFUNC, rl_insert }, /* = */ + { ISFUNC, rl_insert }, /* > */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* @ */ + + /* Uppercase alphabet. */ + { ISFUNC, rl_insert }, /* A */ + { ISFUNC, rl_insert }, /* B */ + { ISFUNC, rl_insert }, /* C */ + { ISFUNC, rl_insert }, /* D */ + { ISFUNC, rl_insert }, /* E */ + { ISFUNC, rl_insert }, /* F */ + { ISFUNC, rl_insert }, /* G */ + { ISFUNC, rl_insert }, /* H */ + { ISFUNC, rl_insert }, /* I */ + { ISFUNC, rl_insert }, /* J */ + { ISFUNC, rl_insert }, /* K */ + { ISFUNC, rl_insert }, /* L */ + { ISFUNC, rl_insert }, /* M */ + { ISFUNC, rl_insert }, /* N */ + { ISFUNC, rl_insert }, /* O */ + { ISFUNC, rl_insert }, /* P */ + { ISFUNC, rl_insert }, /* Q */ + { ISFUNC, rl_insert }, /* R */ + { ISFUNC, rl_insert }, /* S */ + { ISFUNC, rl_insert }, /* T */ + { ISFUNC, rl_insert }, /* U */ + { ISFUNC, rl_insert }, /* V */ + { ISFUNC, rl_insert }, /* W */ + { ISFUNC, rl_insert }, /* X */ + { ISFUNC, rl_insert }, /* Y */ + { ISFUNC, rl_insert }, /* Z */ + + /* Some more punctuation. */ + { ISFUNC, rl_insert }, /* [ */ + { ISFUNC, rl_insert }, /* \ */ + { ISFUNC, rl_insert }, /* ] */ + { ISFUNC, rl_insert }, /* ^ */ + { ISFUNC, rl_insert }, /* _ */ + { ISFUNC, rl_insert }, /* ` */ + + /* Lowercase alphabet. */ + { ISFUNC, rl_insert }, /* a */ + { ISFUNC, rl_insert }, /* b */ + { ISFUNC, rl_insert }, /* c */ + { ISFUNC, rl_insert }, /* d */ + { ISFUNC, rl_insert }, /* e */ + { ISFUNC, rl_insert }, /* f */ + { ISFUNC, rl_insert }, /* g */ + { ISFUNC, rl_insert }, /* h */ + { ISFUNC, rl_insert }, /* i */ + { ISFUNC, rl_insert }, /* j */ + { ISFUNC, rl_insert }, /* k */ + { ISFUNC, rl_insert }, /* l */ + { ISFUNC, rl_insert }, /* m */ + { ISFUNC, rl_insert }, /* n */ + { ISFUNC, rl_insert }, /* o */ + { ISFUNC, rl_insert }, /* p */ + { ISFUNC, rl_insert }, /* q */ + { ISFUNC, rl_insert }, /* r */ + { ISFUNC, rl_insert }, /* s */ + { ISFUNC, rl_insert }, /* t */ + { ISFUNC, rl_insert }, /* u */ + { ISFUNC, rl_insert }, /* v */ + { ISFUNC, rl_insert }, /* w */ + { ISFUNC, rl_insert }, /* x */ + { ISFUNC, rl_insert }, /* y */ + { ISFUNC, rl_insert }, /* z */ + + /* Final punctuation. */ + { ISFUNC, rl_insert }, /* { */ + { ISFUNC, rl_insert }, /* | */ + { ISFUNC, rl_insert }, /* } */ + { ISFUNC, rl_insert }, /* ~ */ + { ISFUNC, rl_rubout }, /* RUBOUT */ + +#if KEYMAP_SIZE > 128 + /* Pure 8-bit characters (128 - 159). + These might be used in some + character sets. */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + { ISFUNC, rl_insert }, /* ? */ + + /* ISO Latin-1 characters (160 - 255) */ + { ISFUNC, rl_insert }, /* No-break space */ + { ISFUNC, rl_insert }, /* Inverted exclamation mark */ + { ISFUNC, rl_insert }, /* Cent sign */ + { ISFUNC, rl_insert }, /* Pound sign */ + { ISFUNC, rl_insert }, /* Currency sign */ + { ISFUNC, rl_insert }, /* Yen sign */ + { ISFUNC, rl_insert }, /* Broken bar */ + { ISFUNC, rl_insert }, /* Section sign */ + { ISFUNC, rl_insert }, /* Diaeresis */ + { ISFUNC, rl_insert }, /* Copyright sign */ + { ISFUNC, rl_insert }, /* Feminine ordinal indicator */ + { ISFUNC, rl_insert }, /* Left pointing double angle quotation mark */ + { ISFUNC, rl_insert }, /* Not sign */ + { ISFUNC, rl_insert }, /* Soft hyphen */ + { ISFUNC, rl_insert }, /* Registered sign */ + { ISFUNC, rl_insert }, /* Macron */ + { ISFUNC, rl_insert }, /* Degree sign */ + { ISFUNC, rl_insert }, /* Plus-minus sign */ + { ISFUNC, rl_insert }, /* Superscript two */ + { ISFUNC, rl_insert }, /* Superscript three */ + { ISFUNC, rl_insert }, /* Acute accent */ + { ISFUNC, rl_insert }, /* Micro sign */ + { ISFUNC, rl_insert }, /* Pilcrow sign */ + { ISFUNC, rl_insert }, /* Middle dot */ + { ISFUNC, rl_insert }, /* Cedilla */ + { ISFUNC, rl_insert }, /* Superscript one */ + { ISFUNC, rl_insert }, /* Masculine ordinal indicator */ + { ISFUNC, rl_insert }, /* Right pointing double angle quotation mark */ + { ISFUNC, rl_insert }, /* Vulgar fraction one quarter */ + { ISFUNC, rl_insert }, /* Vulgar fraction one half */ + { ISFUNC, rl_insert }, /* Vulgar fraction three quarters */ + { ISFUNC, rl_insert }, /* Inverted questionk mark */ + { ISFUNC, rl_insert }, /* Latin capital letter a with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter a with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter a with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter a with tilde */ + { ISFUNC, rl_insert }, /* Latin capital letter a with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter a with ring above */ + { ISFUNC, rl_insert }, /* Latin capital letter ae */ + { ISFUNC, rl_insert }, /* Latin capital letter c with cedilla */ + { ISFUNC, rl_insert }, /* Latin capital letter e with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter e with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter e with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter e with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter i with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter i with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter i with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter i with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter eth (Icelandic) */ + { ISFUNC, rl_insert }, /* Latin capital letter n with tilde */ + { ISFUNC, rl_insert }, /* Latin capital letter o with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter o with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter o with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter o with tilde */ + { ISFUNC, rl_insert }, /* Latin capital letter o with diaeresis */ + { ISFUNC, rl_insert }, /* Multiplication sign */ + { ISFUNC, rl_insert }, /* Latin capital letter o with stroke */ + { ISFUNC, rl_insert }, /* Latin capital letter u with grave */ + { ISFUNC, rl_insert }, /* Latin capital letter u with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter u with circumflex */ + { ISFUNC, rl_insert }, /* Latin capital letter u with diaeresis */ + { ISFUNC, rl_insert }, /* Latin capital letter Y with acute */ + { ISFUNC, rl_insert }, /* Latin capital letter thorn (Icelandic) */ + { ISFUNC, rl_insert }, /* Latin small letter sharp s (German) */ + { ISFUNC, rl_insert }, /* Latin small letter a with grave */ + { ISFUNC, rl_insert }, /* Latin small letter a with acute */ + { ISFUNC, rl_insert }, /* Latin small letter a with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter a with tilde */ + { ISFUNC, rl_insert }, /* Latin small letter a with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter a with ring above */ + { ISFUNC, rl_insert }, /* Latin small letter ae */ + { ISFUNC, rl_insert }, /* Latin small letter c with cedilla */ + { ISFUNC, rl_insert }, /* Latin small letter e with grave */ + { ISFUNC, rl_insert }, /* Latin small letter e with acute */ + { ISFUNC, rl_insert }, /* Latin small letter e with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter e with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter i with grave */ + { ISFUNC, rl_insert }, /* Latin small letter i with acute */ + { ISFUNC, rl_insert }, /* Latin small letter i with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter i with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter eth (Icelandic) */ + { ISFUNC, rl_insert }, /* Latin small letter n with tilde */ + { ISFUNC, rl_insert }, /* Latin small letter o with grave */ + { ISFUNC, rl_insert }, /* Latin small letter o with acute */ + { ISFUNC, rl_insert }, /* Latin small letter o with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter o with tilde */ + { ISFUNC, rl_insert }, /* Latin small letter o with diaeresis */ + { ISFUNC, rl_insert }, /* Division sign */ + { ISFUNC, rl_insert }, /* Latin small letter o with stroke */ + { ISFUNC, rl_insert }, /* Latin small letter u with grave */ + { ISFUNC, rl_insert }, /* Latin small letter u with acute */ + { ISFUNC, rl_insert }, /* Latin small letter u with circumflex */ + { ISFUNC, rl_insert }, /* Latin small letter u with diaeresis */ + { ISFUNC, rl_insert }, /* Latin small letter y with acute */ + { ISFUNC, rl_insert }, /* Latin small letter thorn (Icelandic) */ + { ISFUNC, rl_insert } /* Latin small letter y with diaeresis */ +#endif /* KEYMAP_SIZE > 128 */ +}; + +/* Unused for the time being. */ +#if 0 +KEYMAP_ENTRY_ARRAY vi_escape_keymap = { + /* The regular control keys come first. */ + { ISFUNC, (Function *)0x0 }, /* Control-@ */ + { ISFUNC, (Function *)0x0 }, /* Control-a */ + { ISFUNC, (Function *)0x0 }, /* Control-b */ + { ISFUNC, (Function *)0x0 }, /* Control-c */ + { ISFUNC, (Function *)0x0 }, /* Control-d */ + { ISFUNC, (Function *)0x0 }, /* Control-e */ + { ISFUNC, (Function *)0x0 }, /* Control-f */ + { ISFUNC, (Function *)0x0 }, /* Control-g */ + { ISFUNC, (Function *)0x0 }, /* Control-h */ + { ISFUNC, rl_tab_insert}, /* Control-i */ + { ISFUNC, rl_emacs_editing_mode}, /* Control-j */ + { ISFUNC, rl_kill_line }, /* Control-k */ + { ISFUNC, (Function *)0x0 }, /* Control-l */ + { ISFUNC, rl_emacs_editing_mode}, /* Control-m */ + { ISFUNC, (Function *)0x0 }, /* Control-n */ + { ISFUNC, (Function *)0x0 }, /* Control-o */ + { ISFUNC, (Function *)0x0 }, /* Control-p */ + { ISFUNC, (Function *)0x0 }, /* Control-q */ + { ISFUNC, (Function *)0x0 }, /* Control-r */ + { ISFUNC, (Function *)0x0 }, /* Control-s */ + { ISFUNC, (Function *)0x0 }, /* Control-t */ + { ISFUNC, (Function *)0x0 }, /* Control-u */ + { ISFUNC, (Function *)0x0 }, /* Control-v */ + { ISFUNC, (Function *)0x0 }, /* Control-w */ + { ISFUNC, (Function *)0x0 }, /* Control-x */ + { ISFUNC, (Function *)0x0 }, /* Control-y */ + { ISFUNC, (Function *)0x0 }, /* Control-z */ + + { ISFUNC, rl_vi_movement_mode }, /* Control-[ */ + { ISFUNC, (Function *)0x0 }, /* Control-\ */ + { ISFUNC, (Function *)0x0 }, /* Control-] */ + { ISFUNC, (Function *)0x0 }, /* Control-^ */ + { ISFUNC, rl_undo_command }, /* Control-_ */ + + /* The start of printing characters. */ + { ISFUNC, (Function *)0x0 }, /* SPACE */ + { ISFUNC, (Function *)0x0 }, /* ! */ + { ISFUNC, (Function *)0x0 }, /* " */ + { ISFUNC, (Function *)0x0 }, /* # */ + { ISFUNC, (Function *)0x0 }, /* $ */ + { ISFUNC, (Function *)0x0 }, /* % */ + { ISFUNC, (Function *)0x0 }, /* & */ + { ISFUNC, (Function *)0x0 }, /* ' */ + { ISFUNC, (Function *)0x0 }, /* ( */ + { ISFUNC, (Function *)0x0 }, /* ) */ + { ISFUNC, (Function *)0x0 }, /* * */ + { ISFUNC, (Function *)0x0 }, /* + */ + { ISFUNC, (Function *)0x0 }, /* , */ + { ISFUNC, (Function *)0x0 }, /* - */ + { ISFUNC, (Function *)0x0 }, /* . */ + { ISFUNC, (Function *)0x0 }, /* / */ + + /* Regular digits. */ + { ISFUNC, rl_vi_arg_digit }, /* 0 */ + { ISFUNC, rl_vi_arg_digit }, /* 1 */ + { ISFUNC, rl_vi_arg_digit }, /* 2 */ + { ISFUNC, rl_vi_arg_digit }, /* 3 */ + { ISFUNC, rl_vi_arg_digit }, /* 4 */ + { ISFUNC, rl_vi_arg_digit }, /* 5 */ + { ISFUNC, rl_vi_arg_digit }, /* 6 */ + { ISFUNC, rl_vi_arg_digit }, /* 7 */ + { ISFUNC, rl_vi_arg_digit }, /* 8 */ + { ISFUNC, rl_vi_arg_digit }, /* 9 */ + + /* A little more punctuation. */ + { ISFUNC, (Function *)0x0 }, /* : */ + { ISFUNC, (Function *)0x0 }, /* ; */ + { ISFUNC, (Function *)0x0 }, /* < */ + { ISFUNC, (Function *)0x0 }, /* = */ + { ISFUNC, (Function *)0x0 }, /* > */ + { ISFUNC, (Function *)0x0 }, /* ? */ + { ISFUNC, (Function *)0x0 }, /* @ */ + + /* Uppercase alphabet. */ + { ISFUNC, rl_do_lowercase_version }, /* A */ + { ISFUNC, rl_do_lowercase_version }, /* B */ + { ISFUNC, rl_do_lowercase_version }, /* C */ + { ISFUNC, rl_do_lowercase_version }, /* D */ + { ISFUNC, rl_do_lowercase_version }, /* E */ + { ISFUNC, rl_do_lowercase_version }, /* F */ + { ISFUNC, rl_do_lowercase_version }, /* G */ + { ISFUNC, rl_do_lowercase_version }, /* H */ + { ISFUNC, rl_do_lowercase_version }, /* I */ + { ISFUNC, rl_do_lowercase_version }, /* J */ + { ISFUNC, rl_do_lowercase_version }, /* K */ + { ISFUNC, rl_do_lowercase_version }, /* L */ + { ISFUNC, rl_do_lowercase_version }, /* M */ + { ISFUNC, rl_do_lowercase_version }, /* N */ + { ISFUNC, rl_do_lowercase_version }, /* O */ + { ISFUNC, rl_do_lowercase_version }, /* P */ + { ISFUNC, rl_do_lowercase_version }, /* Q */ + { ISFUNC, rl_do_lowercase_version }, /* R */ + { ISFUNC, rl_do_lowercase_version }, /* S */ + { ISFUNC, rl_do_lowercase_version }, /* T */ + { ISFUNC, rl_do_lowercase_version }, /* U */ + { ISFUNC, rl_do_lowercase_version }, /* V */ + { ISFUNC, rl_do_lowercase_version }, /* W */ + { ISFUNC, rl_do_lowercase_version }, /* X */ + { ISFUNC, rl_do_lowercase_version }, /* Y */ + { ISFUNC, rl_do_lowercase_version }, /* Z */ + + /* Some more punctuation. */ + { ISFUNC, rl_arrow_keys }, /* [ */ + { ISFUNC, (Function *)0x0 }, /* \ */ + { ISFUNC, (Function *)0x0 }, /* ] */ + { ISFUNC, (Function *)0x0 }, /* ^ */ + { ISFUNC, (Function *)0x0 }, /* _ */ + { ISFUNC, (Function *)0x0 }, /* ` */ + + /* Lowercase alphabet. */ + { ISFUNC, (Function *)0x0 }, /* a */ + { ISFUNC, (Function *)0x0 }, /* b */ + { ISFUNC, (Function *)0x0 }, /* c */ + { ISFUNC, (Function *)0x0 }, /* d */ + { ISFUNC, (Function *)0x0 }, /* e */ + { ISFUNC, (Function *)0x0 }, /* f */ + { ISFUNC, (Function *)0x0 }, /* g */ + { ISFUNC, (Function *)0x0 }, /* h */ + { ISFUNC, (Function *)0x0 }, /* i */ + { ISFUNC, (Function *)0x0 }, /* j */ + { ISFUNC, (Function *)0x0 }, /* k */ + { ISFUNC, (Function *)0x0 }, /* l */ + { ISFUNC, (Function *)0x0 }, /* m */ + { ISFUNC, (Function *)0x0 }, /* n */ + { ISFUNC, rl_arrow_keys }, /* o */ + { ISFUNC, (Function *)0x0 }, /* p */ + { ISFUNC, (Function *)0x0 }, /* q */ + { ISFUNC, (Function *)0x0 }, /* r */ + { ISFUNC, (Function *)0x0 }, /* s */ + { ISFUNC, (Function *)0x0 }, /* t */ + { ISFUNC, (Function *)0x0 }, /* u */ + { ISFUNC, (Function *)0x0 }, /* v */ + { ISFUNC, (Function *)0x0 }, /* w */ + { ISFUNC, (Function *)0x0 }, /* x */ + { ISFUNC, (Function *)0x0 }, /* y */ + { ISFUNC, (Function *)0x0 }, /* z */ + + /* Final punctuation. */ + { ISFUNC, (Function *)0x0 }, /* { */ + { ISFUNC, (Function *)0x0 }, /* | */ + { ISFUNC, (Function *)0x0 }, /* } */ + { ISFUNC, (Function *)0x0 }, /* ~ */ + { ISFUNC, rl_backward_kill_word }, /* RUBOUT */ + +#if KEYMAP_SIZE > 128 + /* Undefined keys. */ + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 }, + { ISFUNC, (Function *)0x0 } +#endif /* KEYMAP_SIZE > 128 */ +}; +#endif diff --git a/vi_mode.c b/vi_mode.c new file mode 100644 index 0000000..f8975f7 --- /dev/null +++ b/vi_mode.c @@ -0,0 +1,1329 @@ +/* vi_mode.c -- A vi emulation mode for Bash. + Derived from code written by Jeff Sparkes (jsparkes@bnr.ca). */ + +/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc. + + This file is part of the GNU Readline Library, a library for + reading lines of text with interactive input and history editing. + + The GNU Readline Library is free software; you can redistribute it + and/or modify it under the terms of the GNU General Public License + as published by the Free Software Foundation; either version 1, or + (at your option) any later version. + + The GNU Readline Library is distributed in the hope that it will be + useful, but WITHOUT ANY WARRANTY; without even the implied warranty + of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + The GNU General Public License is often shipped with GNU software, and + is generally kept in a file called COPYING or LICENSE. If you do not + have a copy of the license, write to the Free Software Foundation, + 675 Mass Ave, Cambridge, MA 02139, USA. */ +#define READLINE_LIBRARY + +/* **************************************************************** */ +/* */ +/* VI Emulation Mode */ +/* */ +/* **************************************************************** */ +#include "rlconf.h" + +#if defined (VI_MODE) + +#include + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +#if defined (HAVE_UNISTD_H) +# include +#endif + +#include + +/* Some standard library routines. */ +#include "rldefs.h" +#include "readline.h" +#include "history.h" + +#ifndef digit_p +#define digit_p(c) ((c) >= '0' && (c) <= '9') +#endif + +#ifndef digit_value +#define digit_value(c) ((c) - '0') +#endif + +#ifndef member +#define member(c, s) ((c) ? (char *)strchr ((s), (c)) != (char *)NULL : 0) +#endif + +#ifndef isident +#define isident(c) ((pure_alphabetic (c) || digit_p (c) || c == '_')) +#endif + +#ifndef exchange +#define exchange(x, y) do {int temp = x; x = y; y = temp;} while (0) +#endif + +#ifndef VI_COMMENT_BEGIN_DEFAULT +#define VI_COMMENT_BEGIN_DEFAULT "#" +#endif + +#if defined (STATIC_MALLOC) +static char *xmalloc (), *xrealloc (); +#else +extern char *xmalloc (), *xrealloc (); +#endif /* STATIC_MALLOC */ + +/* Variables imported from readline.c */ +extern int rl_point, rl_end, rl_mark, rl_done; +extern FILE *rl_instream; +extern int rl_line_buffer_len, rl_explicit_arg, rl_numeric_arg; +extern Keymap _rl_keymap; +extern char *rl_prompt; +extern char *rl_line_buffer; +extern int rl_arg_sign; + +extern void _rl_dispatch (); + +extern void rl_extend_line_buffer (); +extern int rl_vi_check (); + +/* Non-zero means enter insertion mode. */ +static int _rl_vi_doing_insert = 0; + +/* String inserted into the line by rl_vi_comment (). */ +char *rl_vi_comment_begin = (char *)NULL; + +/* *** UNCLEAN *** */ +/* Command keys which do movement for xxx_to commands. */ +static char *vi_motion = " hl^$0ftFt;,%wbeWBE|"; + +/* Keymap used for vi replace characters. Created dynamically since + rarely used. */ +static Keymap vi_replace_map = (Keymap)NULL; + +/* The number of characters inserted in the last replace operation. */ +static int vi_replace_count = 0; + +/* If non-zero, we have text inserted after a c[motion] command that put + us implicitly into insert mode. Some people want this text to be + attached to the command so that it is `redoable' with `.'. */ +static int vi_continued_command = 0; + +static int _rl_vi_last_command = 'i'; /* default `.' puts you in insert mode */ +static int _rl_vi_last_repeat = 1; +static int _rl_vi_last_arg_sign = 1; +static int _rl_vi_last_motion = 0; +static int _rl_vi_last_search_char = 0; +static int _rl_vi_last_replacement = 0; + +static int vi_redoing = 0; + +/* Text modification commands. These are the `redoable' commands. */ +static char *vi_textmod = "_*\\AaIiCcDdPpYyRrSsXx~"; + +static int rl_digit_loop1 (); + +void +_rl_vi_reset_last () +{ + _rl_vi_last_command = 'i'; + _rl_vi_last_repeat = 1; + _rl_vi_last_arg_sign = 1; + _rl_vi_last_motion = 0; +} + +void +_rl_vi_set_last (key, repeat, sign) + int key, repeat, sign; +{ + _rl_vi_last_command = key; + _rl_vi_last_repeat = repeat; + _rl_vi_last_arg_sign = sign; +} + +/* Is the command C a VI mode text modification command? */ +int +rl_vi_textmod_command (c) + int c; +{ + return (member (c, vi_textmod)); +} + +/* Bound to `.'. Called from command mode, so we know that we have to + redo a text modification command. The default for _rl_vi_last_command + puts you back into insert mode. */ +rl_vi_redo (count, c) + int count, c; +{ + if (!rl_explicit_arg) + { + rl_numeric_arg = _rl_vi_last_repeat; + rl_arg_sign = _rl_vi_last_arg_sign; + } + + vi_redoing = 1; + _rl_dispatch (_rl_vi_last_command, _rl_keymap); + vi_redoing = 0; + + return (0); +} + +/* Yank the nth arg from the previous line into this line at point. */ +rl_vi_yank_arg (count, key) + int count, key; +{ + /* Readline thinks that the first word on a line is the 0th, while vi + thinks the first word on a line is the 1st. Compensate. */ + if (rl_explicit_arg) + rl_yank_nth_arg (count - 1, 0); + else + rl_yank_nth_arg ('$', 0); + + return (0); +} + +/* With an argument, move back that many history lines, else move to the + beginning of history. */ +rl_vi_fetch_history (count, c) + int count, c; +{ + int current = where_history (); + + /* Giving an argument of n means we want the nth command in the history + file. The command number is interpreted the same way that the bash + `history' command does it -- that is, giving an argument count of 450 + to this command would get the command listed as number 450 in the + output of `history'. */ + if (rl_explicit_arg) + { + int wanted = history_base + current - count; + if (wanted <= 0) + rl_beginning_of_history (0, 0); + else + rl_get_previous_history (wanted); + } + else + rl_beginning_of_history (count, 0); + return (0); +} + +/* Search again for the last thing searched for. */ +rl_vi_search_again (count, key) + int count, key; +{ + switch (key) + { + case 'n': + rl_noninc_reverse_search_again (count, key); + break; + + case 'N': + rl_noninc_forward_search_again (count, key); + break; + } + return (0); +} + +/* Do a vi style search. */ +rl_vi_search (count, key) + int count, key; +{ + switch (key) + { + case '?': + rl_noninc_forward_search (count, key); + break; + + case '/': + rl_noninc_reverse_search (count, key); + break; + + default: + ding (); + break; + } + return (0); +} + +/* Completion, from vi's point of view. */ +rl_vi_complete (ignore, key) + int ignore, key; +{ + if ((rl_point < rl_end) && (!whitespace (rl_line_buffer[rl_point]))) + { + if (!whitespace (rl_line_buffer[rl_point + 1])) + rl_vi_end_word (1, 'E'); + rl_point++; + } + + if (key == '*') + rl_complete_internal ('*'); /* Expansion and replacement. */ + else if (key == '=') + rl_complete_internal ('?'); /* List possible completions. */ + else if (key == '\\') + rl_complete_internal (TAB); /* Standard Readline completion. */ + else + rl_complete (0, key); + + if (key == '*' || key == '\\') + { + _rl_vi_set_last (key, 1, rl_arg_sign); + rl_vi_insertion_mode (); + } + return (0); +} + +/* Tilde expansion for vi mode. */ +rl_vi_tilde_expand (ignore, key) + int ignore, key; +{ + rl_tilde_expand (0, key); + _rl_vi_set_last (key, 1, rl_arg_sign); /* XXX */ + rl_vi_insertion_mode (); + return (0); +} + +/* Previous word in vi mode. */ +rl_vi_prev_word (count, key) + int count, key; +{ + if (count < 0) + return (rl_vi_next_word (-count, key)); + + if (rl_point == 0) + { + ding (); + return (0); + } + + if (uppercase_p (key)) + rl_vi_bWord (count); + else + rl_vi_bword (count); + + return (0); +} + +/* Next word in vi mode. */ +rl_vi_next_word (count, key) + int count, key; +{ + if (count < 0) + return (rl_vi_prev_word (-count, key)); + + if (rl_point >= (rl_end - 1)) + { + ding (); + return (0); + } + + if (uppercase_p (key)) + rl_vi_fWord (count); + else + rl_vi_fword (count); + return (0); +} + +/* Move to the end of the ?next? word. */ +rl_vi_end_word (count, key) + int count, key; +{ + if (count < 0) + { + ding (); + return -1; + } + + if (uppercase_p (key)) + rl_vi_eWord (count); + else + rl_vi_eword (count); + return (0); +} + +/* Move forward a word the way that 'W' does. */ +rl_vi_fWord (count) + int count; +{ + while (count-- && rl_point < (rl_end - 1)) + { + /* Skip until whitespace. */ + while (!whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end) + rl_point++; + + /* Now skip whitespace. */ + while (whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end) + rl_point++; + } + return (0); +} + +rl_vi_bWord (count) + int count; +{ + while (count-- && rl_point > 0) + { + /* If we are at the start of a word, move back to whitespace so + we will go back to the start of the previous word. */ + if (!whitespace (rl_line_buffer[rl_point]) && + whitespace (rl_line_buffer[rl_point - 1])) + rl_point--; + + while (rl_point > 0 && whitespace (rl_line_buffer[rl_point])) + rl_point--; + + if (rl_point > 0) + { + while (--rl_point >= 0 && !whitespace (rl_line_buffer[rl_point])); + rl_point++; + } + } + return (0); +} + +rl_vi_eWord (count) + int count; +{ + while (count-- && rl_point < (rl_end - 1)) + { + if (!whitespace (rl_line_buffer[rl_point])) + rl_point++; + + /* Move to the next non-whitespace character (to the start of the + next word). */ + while (++rl_point < rl_end && whitespace (rl_line_buffer[rl_point])); + + if (rl_point && rl_point < rl_end) + { + /* Skip whitespace. */ + while (rl_point < rl_end && whitespace (rl_line_buffer[rl_point])) + rl_point++; + + /* Skip until whitespace. */ + while (rl_point < rl_end && !whitespace (rl_line_buffer[rl_point])) + rl_point++; + + /* Move back to the last character of the word. */ + rl_point--; + } + } + return (0); +} + +rl_vi_fword (count) + int count; +{ + while (count-- && rl_point < (rl_end - 1)) + { + /* Move to white space (really non-identifer). */ + if (isident (rl_line_buffer[rl_point])) + { + while (isident (rl_line_buffer[rl_point]) && rl_point < rl_end) + rl_point++; + } + else /* if (!whitespace (rl_line_buffer[rl_point])) */ + { + while (!isident (rl_line_buffer[rl_point]) && + !whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end) + rl_point++; + } + + /* Move past whitespace. */ + while (whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end) + rl_point++; + } + return (0); +} + +rl_vi_bword (count) + int count; +{ + while (count-- && rl_point > 0) + { + int last_is_ident; + + /* If we are at the start of a word, move back to whitespace + so we will go back to the start of the previous word. */ + if (!whitespace (rl_line_buffer[rl_point]) && + whitespace (rl_line_buffer[rl_point - 1])) + rl_point--; + + /* If this character and the previous character are `opposite', move + back so we don't get messed up by the rl_point++ down there in + the while loop. Without this code, words like `l;' screw up the + function. */ + last_is_ident = isident (rl_line_buffer[rl_point - 1]); + if ((isident (rl_line_buffer[rl_point]) && !last_is_ident) || + (!isident (rl_line_buffer[rl_point]) && last_is_ident)) + rl_point--; + + while (rl_point > 0 && whitespace (rl_line_buffer[rl_point])) + rl_point--; + + if (rl_point > 0) + { + if (isident (rl_line_buffer[rl_point])) + while (--rl_point >= 0 && isident (rl_line_buffer[rl_point])); + else + while (--rl_point >= 0 && !isident (rl_line_buffer[rl_point]) && + !whitespace (rl_line_buffer[rl_point])); + rl_point++; + } + } + return (0); +} + +rl_vi_eword (count) + int count; +{ + while (count-- && rl_point < rl_end - 1) + { + if (!whitespace (rl_line_buffer[rl_point])) + rl_point++; + + while (rl_point < rl_end && whitespace (rl_line_buffer[rl_point])) + rl_point++; + + if (rl_point < rl_end) + { + if (isident (rl_line_buffer[rl_point])) + while (++rl_point < rl_end && isident (rl_line_buffer[rl_point])); + else + while (++rl_point < rl_end && !isident (rl_line_buffer[rl_point]) + && !whitespace (rl_line_buffer[rl_point])); + } + rl_point--; + } + return (0); +} + +rl_vi_insert_beg (count, key) + int count, key; +{ + rl_beg_of_line (); + rl_vi_insertion_mode (); + return (0); +} + +rl_vi_append_mode (count, key) + int count, key; +{ + if (rl_point < rl_end) + rl_point++; + rl_vi_insertion_mode (); + return (0); +} + +rl_vi_append_eol (count, key) + int count, key; +{ + rl_end_of_line (); + rl_vi_append_mode (); + return (0); +} + +/* What to do in the case of C-d. */ +rl_vi_eof_maybe (count, c) + int count, c; +{ + return (rl_newline (1, '\n')); +} + +/* Insertion mode stuff. */ + +/* Switching from one mode to the other really just involves + switching keymaps. */ +rl_vi_insertion_mode (count, key) + int count, key; +{ + _rl_keymap = vi_insertion_keymap; + return (0); +} + +void +_rl_vi_done_inserting () +{ + if (_rl_vi_doing_insert) + { + rl_end_undo_group (); + /* Now, the text between rl_undo_list->next->start and + rl_undo_list->next->end is what was inserted while in insert + mode. */ + _rl_vi_doing_insert = 0; + vi_continued_command = 1; + } + else + vi_continued_command = 0; +} + +rl_vi_movement_mode (count, key) + int count, key; +{ + if (rl_point > 0) + rl_backward (1); + +#if 0 + _rl_vi_reset_last (); +#endif + + _rl_keymap = vi_movement_keymap; + _rl_vi_done_inserting (); + return (0); +} + +rl_vi_arg_digit (count, c) + int count, c; +{ + if (c == '0' && rl_numeric_arg == 1 && !rl_explicit_arg) + return (rl_beg_of_line ()); + else + return (rl_digit_argument (count, c)); +} + +rl_vi_change_case (count, ignore) + int count, ignore; +{ + char c = 0; + + /* Don't try this on an empty line. */ + if (rl_point >= rl_end) + return (0); + + while (count-- && rl_point < rl_end) + { + if (uppercase_p (rl_line_buffer[rl_point])) + c = to_lower (rl_line_buffer[rl_point]); + else if (lowercase_p (rl_line_buffer[rl_point])) + c = to_upper (rl_line_buffer[rl_point]); + else + { + /* Just skip over characters neither upper nor lower case. */ + rl_forward (1); + continue; + } + + /* Vi is kind of strange here. */ + if (c) + { + rl_begin_undo_group (); + rl_delete (1, c); + rl_insert (1, c); + rl_end_undo_group (); + rl_vi_check (); + } + else + rl_forward (1); + } + return (0); +} + +rl_vi_put (count, key) + int count, key; +{ + if (!uppercase_p (key) && (rl_point + 1 <= rl_end)) + rl_point++; + + rl_yank (); + rl_backward (1); + return (0); +} + +rl_vi_check () +{ + if (rl_point && rl_point == rl_end) + rl_point--; + return (0); +} + +rl_vi_column (count, key) + int count, key; +{ + if (count > rl_end) + rl_end_of_line (); + else + rl_point = count - 1; + return (0); +} + +int +rl_vi_domove (key, nextkey) + int key, *nextkey; +{ + int c, save; + int old_end; + + rl_mark = rl_point; + c = rl_read_key (); + *nextkey = c; + + if (!member (c, vi_motion)) + { + if (digit_p (c)) + { + save = rl_numeric_arg; + rl_numeric_arg = digit_value (c); + rl_digit_loop1 (); + rl_numeric_arg *= save; + c = rl_read_key (); /* real command */ + *nextkey = c; + } + else if (key == c && (key == 'd' || key == 'y' || key == 'c')) + { + rl_mark = rl_end; + rl_beg_of_line (); + _rl_vi_last_motion = c; + return (0); + } + else + return (-1); + } + + _rl_vi_last_motion = c; + + /* Append a blank character temporarily so that the motion routines + work right at the end of the line. */ + old_end = rl_end; + rl_line_buffer[rl_end++] = ' '; + rl_line_buffer[rl_end] = '\0'; + + _rl_dispatch (c, _rl_keymap); + + /* Remove the blank that we added. */ + rl_end = old_end; + rl_line_buffer[rl_end] = '\0'; + if (rl_point > rl_end) + rl_point = rl_end; + + /* No change in position means the command failed. */ + if (rl_mark == rl_point) + return (-1); + + /* rl_vi_f[wW]ord () leaves the cursor on the first character of the next + word. If we are not at the end of the line, and we are on a + non-whitespace character, move back one (presumably to whitespace). */ + if ((to_upper (c) == 'W') && rl_point < rl_end && rl_point > rl_mark && + !whitespace (rl_line_buffer[rl_point])) + rl_point--; + + /* If cw or cW, back up to the end of a word, so the behaviour of ce + or cE is the actual result. Brute-force, no subtlety. */ + if (key == 'c' && rl_point >= rl_mark && (to_upper (c) == 'W')) + { + /* Don't move farther back than where we started. */ + while (rl_point > rl_mark && whitespace (rl_line_buffer[rl_point])) + rl_point--; + + /* Posix.2 says that if cw or cW moves the cursor towards the end of + the line, the character under the cursor should be deleted. */ + if (rl_point == rl_mark) + rl_point++; + else + { + /* Move past the end of the word so that the kill doesn't + remove the last letter of the previous word. Only do this + if we are not at the end of the line. */ + if (rl_point >= 0 && rl_point < (rl_end - 1) && !whitespace (rl_line_buffer[rl_point])) + rl_point++; + } + } + + if (rl_mark < rl_point) + exchange (rl_point, rl_mark); + + return (0); +} + +/* A simplified loop for vi. Don't dispatch key at end. + Don't recognize minus sign? */ +static int +rl_digit_loop1 () +{ + int key, c; + + while (1) + { + rl_message ("(arg: %d) ", rl_arg_sign * rl_numeric_arg, 0); + key = c = rl_read_key (); + + if (_rl_keymap[c].type == ISFUNC && + _rl_keymap[c].function == rl_universal_argument) + { + rl_numeric_arg *= 4; + continue; + } + + c = UNMETA (c); + if (digit_p (c)) + { + if (rl_explicit_arg) + rl_numeric_arg = (rl_numeric_arg * 10) + digit_value (c); + else + rl_numeric_arg = digit_value (c); + rl_explicit_arg = 1; + } + else + { + rl_clear_message (); + rl_stuff_char (key); + break; + } + } + return (0); +} + +rl_vi_delete_to (count, key) + int count, key; +{ + int c; + + if (uppercase_p (key)) + rl_stuff_char ('$'); + else if (vi_redoing) + rl_stuff_char (_rl_vi_last_motion); + + if (rl_vi_domove (key, &c)) + { + ding (); + return -1; + } + + /* These are the motion commands that do not require adjusting the + mark. */ + if ((strchr (" l|h^0%bB", c) == 0) && (rl_mark < rl_end)) + rl_mark++; + + rl_kill_text (rl_point, rl_mark); + return (0); +} + +rl_vi_change_to (count, key) + int count, key; +{ + int c, start_pos; + + if (uppercase_p (key)) + rl_stuff_char ('$'); + else if (vi_redoing) + rl_stuff_char (_rl_vi_last_motion); + + start_pos = rl_point; + + if (rl_vi_domove (key, &c)) + { + ding (); + return -1; + } + + /* These are the motion commands that do not require adjusting the + mark. c[wW] are handled by special-case code in rl_vi_domove(), + and already leave the mark at the correct location. */ + if ((strchr (" l|hwW^0%bB", c) == 0) && (rl_mark < rl_end)) + rl_mark++; + + /* The cursor never moves with c[wW]. */ + if ((to_upper (c) == 'W') && rl_point < start_pos) + rl_point = start_pos; + + rl_kill_text (rl_point, rl_mark); + + rl_begin_undo_group (); + _rl_vi_doing_insert = 1; + _rl_vi_set_last (key, count, rl_arg_sign); + rl_vi_insertion_mode (); + + return (0); +} + +rl_vi_yank_to (count, key) + int count, key; +{ + int c, save = rl_point; + + if (uppercase_p (key)) + rl_stuff_char ('$'); + + if (rl_vi_domove (key, &c)) + { + ding (); + return -1; + } + + /* These are the motion commands that do not require adjusting the + mark. */ + if ((strchr (" l|h^0%bB", c) == 0) && (rl_mark < rl_end)) + rl_mark++; + + rl_begin_undo_group (); + rl_kill_text (rl_point, rl_mark); + rl_end_undo_group (); + rl_do_undo (); + rl_point = save; + + return (0); +} + +rl_vi_delete (count, key) + int count, key; +{ + int end; + + if (rl_end == 0) + { + ding (); + return -1; + } + + end = rl_point + count; + + if (end >= rl_end) + end = rl_end; + + rl_kill_text (rl_point, end); + + if (rl_point > 0 && rl_point == rl_end) + rl_backward (1); + return (0); +} + +/* Turn the current line into a comment in shell history. + A K*rn shell style function. */ +rl_vi_comment (count, key) + int count, key; +{ + rl_beg_of_line (); + + if (rl_vi_comment_begin != (char *)NULL) + rl_insert_text (rl_vi_comment_begin); + else + rl_insert_text (VI_COMMENT_BEGIN_DEFAULT); /* Default. */ + + rl_redisplay (); + rl_newline (1, '\010'); + return (0); +} + +rl_vi_first_print (count, key) + int count, key; +{ + return (rl_back_to_indent ()); +} + +rl_back_to_indent (ignore1, ignore2) + int ignore1, ignore2; +{ + rl_beg_of_line (); + while (rl_point < rl_end && whitespace (rl_line_buffer[rl_point])) + rl_point++; + return (0); +} + +/* NOTE: it is necessary that opposite directions are inverses */ +#define FTO 1 /* forward to */ +#define BTO -1 /* backward to */ +#define FFIND 2 /* forward find */ +#define BFIND -2 /* backward find */ + +rl_vi_char_search (count, key) + int count, key; +{ + static char target; + static int orig_dir, dir; + int pos; + + if (key == ';' || key == ',') + dir = (key == ';' ? orig_dir : -orig_dir); + else + { + if (vi_redoing) + target = _rl_vi_last_search_char; + else + _rl_vi_last_search_char = target = rl_getc (rl_instream); + + switch (key) + { + case 't': + orig_dir = dir = FTO; + break; + + case 'T': + orig_dir = dir = BTO; + break; + + case 'f': + orig_dir = dir = FFIND; + break; + + case 'F': + orig_dir = dir = BFIND; + break; + } + } + + pos = rl_point; + + while (count--) + { + if (dir < 0) + { + if (pos == 0) + { + ding (); + return -1; + } + + pos--; + do + { + if (rl_line_buffer[pos] == target) + { + if (dir == BTO) + rl_point = pos + 1; + else + rl_point = pos; + break; + } + } + while (pos--); + + if (pos < 0) + { + ding (); + return -1; + } + } + else + { /* dir > 0 */ + if (pos >= rl_end) + { + ding (); + return -1; + } + + pos++; + do + { + if (rl_line_buffer[pos] == target) + { + if (dir == FTO) + rl_point = pos - 1; + else + rl_point = pos; + break; + } + } + while (++pos < rl_end); + + if (pos >= (rl_end - 1)) + { + ding (); + return -1; + } + } + } + return (0); +} + +/* Match brackets */ +rl_vi_match (ignore, key) + int ignore, key; +{ + int count = 1, brack, pos; + + pos = rl_point; + if ((brack = rl_vi_bracktype (rl_line_buffer[rl_point])) == 0) + { + while ((brack = rl_vi_bracktype (rl_line_buffer[rl_point])) == 0 && + rl_point < rl_end - 1) + rl_forward (1); + + if (brack <= 0) + { + rl_point = pos; + ding (); + return -1; + } + } + + pos = rl_point; + + if (brack < 0) + { + while (count) + { + if (--pos >= 0) + { + int b = rl_vi_bracktype (rl_line_buffer[pos]); + if (b == -brack) + count--; + else if (b == brack) + count++; + } + else + { + ding (); + return -1; + } + } + } + else + { /* brack > 0 */ + while (count) + { + if (++pos < rl_end) + { + int b = rl_vi_bracktype (rl_line_buffer[pos]); + if (b == -brack) + count--; + else if (b == brack) + count++; + } + else + { + ding (); + return -1; + } + } + } + rl_point = pos; + return (0); +} + +int +rl_vi_bracktype (c) + int c; +{ + switch (c) + { + case '(': return 1; + case ')': return -1; + case '[': return 2; + case ']': return -2; + case '{': return 3; + case '}': return -3; + default: return 0; + } +} + +rl_vi_change_char (count, key) + int count, key; +{ + int c; + + if (vi_redoing) + c = _rl_vi_last_replacement; + else + _rl_vi_last_replacement = c = rl_getc (rl_instream); + + if (c == '\033' || c == CTRL ('C')) + return -1; + + while (count-- && rl_point < rl_end) + { + rl_begin_undo_group (); + + rl_delete (1, c); + rl_insert (1, c); + if (count == 0) + rl_backward (1); + + rl_end_undo_group (); + } + return (0); +} + +rl_vi_subst (count, key) + int count, key; +{ + rl_begin_undo_group (); + + if (uppercase_p (key)) + { + rl_beg_of_line (); + rl_kill_line (1); + } + else + rl_delete (count, key); + + rl_end_undo_group (); + + _rl_vi_set_last (key, count, rl_arg_sign); + + rl_begin_undo_group (); + _rl_vi_doing_insert = 1; + rl_vi_insertion_mode (); + + return (0); +} + +rl_vi_overstrike (count, key) + int count, key; +{ + int i; + + if (_rl_vi_doing_insert == 0) + { + _rl_vi_doing_insert = 1; + rl_begin_undo_group (); + } + + for (i = 0; i < count; i++) + { + vi_replace_count++; + rl_begin_undo_group (); + + if (rl_point < rl_end) + { + rl_delete (1, key); + rl_insert (1, key); + } + else + rl_insert (1, key); + + rl_end_undo_group (); + } + return (0); +} + +rl_vi_overstrike_delete (count) + int count; +{ + int i, s; + + for (i = 0; i < count; i++) + { + if (vi_replace_count == 0) + { + ding (); + break; + } + s = rl_point; + + if (rl_do_undo ()) + vi_replace_count--; + + if (rl_point == s) + rl_backward (1); + } + + if (vi_replace_count == 0 && _rl_vi_doing_insert) + { + rl_end_undo_group (); + rl_do_undo (); + _rl_vi_doing_insert = 0; + } + return (0); +} + +rl_vi_replace (count, key) + int count, key; +{ + int i; + + vi_replace_count = 0; + + if (!vi_replace_map) + { + vi_replace_map = rl_make_bare_keymap (); + + for (i = ' '; i < 127; i++) + vi_replace_map[i].function = rl_vi_overstrike; + + vi_replace_map[RUBOUT].function = rl_vi_overstrike_delete; + vi_replace_map[ESC].function = rl_vi_movement_mode; + vi_replace_map[RETURN].function = rl_newline; + vi_replace_map[NEWLINE].function = rl_newline; + + /* If the normal vi insertion keymap has ^H bound to erase, do the + same here. Probably should remove the assignment to RUBOUT up + there, but I don't think it will make a difference in real life. */ + if (vi_insertion_keymap[CTRL ('H')].type == ISFUNC && + vi_insertion_keymap[CTRL ('H')].function == rl_rubout) + vi_replace_map[CTRL ('H')].function = rl_vi_overstrike_delete; + + } + _rl_keymap = vi_replace_map; + return (0); +} + +#if 0 +/* Try to complete the word we are standing on or the word that ends with + the previous character. A space matches everything. Word delimiters are + space and ;. */ +rl_vi_possible_completions() +{ + int save_pos = rl_point; + + if (rl_line_buffer[rl_point] != ' ' && rl_line_buffer[rl_point] != ';') + { + while (rl_point < rl_end && rl_line_buffer[rl_point] != ' ' && + rl_line_buffer[rl_point] != ';') + rl_point++; + } + else if (rl_line_buffer[rl_point - 1] == ';') + { + ding (); + return (0); + } + + rl_possible_completions (); + rl_point = save_pos; + + return (0); +} +#endif + +#if defined (STATIC_MALLOC) + +/* **************************************************************** */ +/* */ +/* xmalloc and xrealloc () */ +/* */ +/* **************************************************************** */ + +static void memory_error_and_abort (); + +static char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort (); + return (temp); +} + +static char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)xmalloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort (); + + return (temp); +} + +static void +memory_error_and_abort () +{ + fprintf (stderr, "readline: Out of virtual memory!\n"); + abort (); +} +#endif /* STATIC_MALLOC */ + +#endif /* VI_MODE */ diff --git a/xmalloc.c b/xmalloc.c new file mode 100644 index 0000000..4f6dc76 --- /dev/null +++ b/xmalloc.c @@ -0,0 +1,78 @@ +/* xmalloc.c -- safe versions of malloc and realloc */ + +/* Copyright (C) 1991 Free Software Foundation, Inc. + + This file is part of GNU Readline, a library for reading lines + of text with interactive input and history editing. + + Readline is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 1, or (at your option) any + later version. + + Readline is distributed in the hope that it will be useful, but + WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + General Public License for more details. + + You should have received a copy of the GNU General Public License + along with Readline; see the file COPYING. If not, write to the Free + Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */ + +#if defined (ALREADY_HAVE_XMALLOC) +#else +#include + +#if defined (HAVE_STDLIB_H) +# include +#else +# include "ansi_stdlib.h" +#endif /* HAVE_STDLIB_H */ + +static void memory_error_and_abort (); + +/* **************************************************************** */ +/* */ +/* Memory Allocation and Deallocation. */ +/* */ +/* **************************************************************** */ + +/* Return a pointer to free()able block of memory large enough + to hold BYTES number of bytes. If the memory cannot be allocated, + print an error message and abort. */ +char * +xmalloc (bytes) + int bytes; +{ + char *temp = (char *)malloc (bytes); + + if (!temp) + memory_error_and_abort ("xmalloc"); + return (temp); +} + +char * +xrealloc (pointer, bytes) + char *pointer; + int bytes; +{ + char *temp; + + if (!pointer) + temp = (char *)malloc (bytes); + else + temp = (char *)realloc (pointer, bytes); + + if (!temp) + memory_error_and_abort ("xrealloc"); + return (temp); +} + +static void +memory_error_and_abort (fname) + char *fname; +{ + fprintf (stderr, "%s: Out of virtual memory!\n", fname); + abort (); +} +#endif /* !ALREADY_HAVE_XMALLOC */