Document changes in current snapshot since June.

If we're responding to a BOOTP request, hunt for a lease that's applicable - there might be more than one lease matching the network and the hardware address.

Copy the hardware address into the static lease structure so that it can be used later.

Create database with mode 0664 & ~umask, not 0666 & ~umask.

If we find more than one lease for the same client on the same network, give it the one it asked for.

Document Linux 2.1.x bootp agent screw

Fix DHCPRELEASE handling to conform to spec

Always print two digits for day and month in leases.

If AF_LINK is defined, need to include if_dl.h

Don't use sun_len on systems that don't support it

%02x, not %2.2x

Test return value of socket for <0, not ==0 to indicate failure.

Use ifp -> ifr_name, not ifr.ifr_name, which isn't yet initialized.   errno, not ERRNO.

Update README

Add a caveat that this doesn't include everything

Update release notes (lose obsolete cruft about old lease database formats)

new catted man page

Document -q.  Fix typos/pastos.   Reword some bad stuff.   Fix SEE ALSO

Daemonize by default.   Fix a couple of uninitialized automatic variables.   Add -q flag which shuts up interface status printout.   Write a pid file.

Name server definitions

Override default value for _PATH_DHCRELAY_PID

Set a default value for _PATH_DHCRELAY_PID

Fix typo in comment.

new catted man page

new catted man pages

Add dhcpd.leases man page.   Globalize sed scripts on man pages.

new catted man pages

Fix errors mentioned by cgd.   s/dhcp(5)/dhcp-options(5)/   Fix SEE ALSO.

Move BUGS up.   Add FILES section documenting location of script files in distribution

globalize sed commands on man pages

catted man page for nroff-less systems

catted man pages, for machines that don't have troff/nroff

DHCP lease database description

Build and install dhclient.leases man page

DHCP Client lease database description

Don't echo ifconfig parameters - that was for debugging.

DHCP client configuration script

Write an actual manual page

Add prototype for broadcast_addr()

Add broadcast_addr function which produces the broadcast address of a subnet given the subnet number and subnet mask.

Move dhcp option documentation to dhcp-options(5)

Build and install dhcp-options.5

Documentation for DHCP option declaration syntax

bsd/os client script (pretty much identical to NetBSD)

Check if variables have value before doing set $variable

Don't need to compute network number or broadcast address anymore

Compute network number and (if not offered by server) broadcast address for linux client script

Fix up references

fix up name

Support hostname keyword

Fix up handling of hostname

Fix up handling of hostname

Fix spelling

Don't ping static leases - there's no persistent structure for them!

Add notice of 2.0.31 release of Linux

systat -> sysconf

systat -> sysconf

System Configuration notification protocol

Use local quiet flag and also set global quiet_interface_discovery flag with -q option

Add quiet_interface_discovery variable

Define quiet_interface_discovery.   Don't consider EAGAIN or EINTR to be fatal in poll().

Don't print startup banner if quiet_interface_discovery is set

Document -q flag

Rearrange startup code so as to print everything before daemonizing; Don't spew copyright message if quiet is set.

By default, do not leave scripts lying around in /tmp

Add support for static routes

Put hostname in quotes

Clarify single interface restriction

Add NeXTSTEP documentation

NextStep client script

NeXTstep configuration

Add nextstep configuration

System status message relay daemon

Status message transmitter

Pass flag to cons_options indicating whether this is BOOTP or DHCP.   Change handling of dynamic BOOTP packets.   Allow or deny booting based on vendor class if enabled.

Pass flag to cons_options indicating that this is a BOOTP packet

Add HAVE_MKSTEMP flag

Prototype new functions.   New argument for cons_options.   New definitions for automatic/manual interface selection.

System status message protocol

Only use 64-byte option buffer for BOOTP packets

Don't exclude dynamic BOOTP from uid test (?)

If sa_len is zero, skip interface.   Add remove_protocol.   Fix automatic/manual interface selection.

Add systat.c

Chmod resolv.conf in case umask is bogus

Add support for interfaces_requested flag.   NUL-terminate copied lease options.   Add cons_option parameter.   Support system status messages

Add support for interfaces_requested flag

Install dhcp client in CLIENTBINDIR

Add statmsg and systatd directories

Document HP-UX broadcast hack and need for packet filter on some systems.

Add CLIENTBINDIR

parse_string eats the semicolon

Document 970609 changes

SunOS 4.1 doesn't define ssize_t

Don't trust client to provide a valid hostname.  Be lenient in parsing client hostnames from lease file

Don't do any DNS testing

Document SO_BINDTODEVICE for Linux

Adjust call to find_lease

Only store through ours if it's nonzero

size_t -> ssize_t in return values where < 0 == error

Make it a warning rather than an error if resolv.conf is missing.