--- /dev/null
+From 7fe32c324e8c6a198a3bb285d3b6ca5f67009402 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 2 Jan 2024 20:33:17 +0000
+Subject: 9p: Fix initialisation of netfs_inode for 9p
+
+From: David Howells <dhowells@redhat.com>
+
+[ Upstream commit 9546ac78b232bac56ff975072b1965e0e755ebd4 ]
+
+The 9p filesystem is calling netfs_inode_init() in v9fs_init_inode() -
+before the struct inode fields have been initialised from the obtained file
+stats (ie. after v9fs_stat2inode*() has been called), but netfslib wants to
+set a couple of its fields from i_size.
+
+Reported-by: Marc Dionne <marc.dionne@auristor.com>
+Signed-off-by: David Howells <dhowells@redhat.com>
+Tested-by: Marc Dionne <marc.dionne@auristor.com>
+Tested-by: Dominique Martinet <asmadeus@codewreck.org>
+Acked-by: Dominique Martinet <asmadeus@codewreck.org>
+cc: Eric Van Hensbergen <ericvh@kernel.org>
+cc: Latchesar Ionkov <lucho@ionkov.net>
+cc: Dominique Martinet <asmadeus@codewreck.org>
+cc: Christian Schoenebeck <linux_oss@crudebyte.com>
+cc: v9fs@lists.linux.dev
+cc: linux-cachefs@redhat.com
+cc: linux-fsdevel@vger.kernel.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/9p/v9fs_vfs.h | 1 +
+ fs/9p/vfs_inode.c | 6 +++---
+ fs/9p/vfs_inode_dotl.c | 1 +
+ 3 files changed, 5 insertions(+), 3 deletions(-)
+
+diff --git a/fs/9p/v9fs_vfs.h b/fs/9p/v9fs_vfs.h
+index 731e3d14b67d..0e8418066a48 100644
+--- a/fs/9p/v9fs_vfs.h
++++ b/fs/9p/v9fs_vfs.h
+@@ -42,6 +42,7 @@ struct inode *v9fs_alloc_inode(struct super_block *sb);
+ void v9fs_free_inode(struct inode *inode);
+ struct inode *v9fs_get_inode(struct super_block *sb, umode_t mode,
+ dev_t rdev);
++void v9fs_set_netfs_context(struct inode *inode);
+ int v9fs_init_inode(struct v9fs_session_info *v9ses,
+ struct inode *inode, umode_t mode, dev_t rdev);
+ void v9fs_evict_inode(struct inode *inode);
+diff --git a/fs/9p/vfs_inode.c b/fs/9p/vfs_inode.c
+index b845ee18a80b..90dc5ef75516 100644
+--- a/fs/9p/vfs_inode.c
++++ b/fs/9p/vfs_inode.c
+@@ -246,7 +246,7 @@ void v9fs_free_inode(struct inode *inode)
+ /*
+ * Set parameters for the netfs library
+ */
+-static void v9fs_set_netfs_context(struct inode *inode)
++void v9fs_set_netfs_context(struct inode *inode)
+ {
+ struct v9fs_inode *v9inode = V9FS_I(inode);
+ netfs_inode_init(&v9inode->netfs, &v9fs_req_ops);
+@@ -326,8 +326,6 @@ int v9fs_init_inode(struct v9fs_session_info *v9ses,
+ err = -EINVAL;
+ goto error;
+ }
+-
+- v9fs_set_netfs_context(inode);
+ error:
+ return err;
+
+@@ -359,6 +357,7 @@ struct inode *v9fs_get_inode(struct super_block *sb, umode_t mode, dev_t rdev)
+ iput(inode);
+ return ERR_PTR(err);
+ }
++ v9fs_set_netfs_context(inode);
+ return inode;
+ }
+
+@@ -464,6 +463,7 @@ static struct inode *v9fs_qid_iget(struct super_block *sb,
+ goto error;
+
+ v9fs_stat2inode(st, inode, sb, 0);
++ v9fs_set_netfs_context(inode);
+ v9fs_cache_inode_get_cookie(inode);
+ unlock_new_inode(inode);
+ return inode;
+diff --git a/fs/9p/vfs_inode_dotl.c b/fs/9p/vfs_inode_dotl.c
+index c7319af2f471..d0636b99f05b 100644
+--- a/fs/9p/vfs_inode_dotl.c
++++ b/fs/9p/vfs_inode_dotl.c
+@@ -128,6 +128,7 @@ static struct inode *v9fs_qid_iget_dotl(struct super_block *sb,
+ goto error;
+
+ v9fs_stat2inode_dotl(st, inode, 0);
++ v9fs_set_netfs_context(inode);
+ v9fs_cache_inode_get_cookie(inode);
+ retval = v9fs_get_acl(inode, fid);
+ if (retval)
+--
+2.43.0
+
--- /dev/null
+From 7c839ca612cf65e75693e3d93e627fbdba18038f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 30 Oct 2023 12:23:57 +0200
+Subject: accel/habanalabs: add support for Gaudi2C device
+
+From: Oded Gabbay <ogabbay@kernel.org>
+
+[ Upstream commit 42422993cf28d456778ee9168d73758ec037cd51 ]
+
+Gaudi2 with PCI revision ID with the value of '3' represents Gaudi2C
+device and should be detected and initialized as Gaudi2.
+
+Signed-off-by: Oded Gabbay <ogabbay@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/accel/habanalabs/common/device.c | 3 +++
+ drivers/accel/habanalabs/common/habanalabs.h | 2 ++
+ drivers/accel/habanalabs/common/habanalabs_drv.c | 3 +++
+ drivers/accel/habanalabs/common/mmu/mmu.c | 1 +
+ drivers/accel/habanalabs/common/sysfs.c | 3 +++
+ drivers/accel/habanalabs/include/hw_ip/pci/pci_general.h | 1 +
+ 6 files changed, 13 insertions(+)
+
+diff --git a/drivers/accel/habanalabs/common/device.c b/drivers/accel/habanalabs/common/device.c
+index 9711e8fc979d..9e461c03e705 100644
+--- a/drivers/accel/habanalabs/common/device.c
++++ b/drivers/accel/habanalabs/common/device.c
+@@ -853,6 +853,9 @@ static int device_early_init(struct hl_device *hdev)
+ gaudi2_set_asic_funcs(hdev);
+ strscpy(hdev->asic_name, "GAUDI2B", sizeof(hdev->asic_name));
+ break;
++ case ASIC_GAUDI2C:
++ gaudi2_set_asic_funcs(hdev);
++ strscpy(hdev->asic_name, "GAUDI2C", sizeof(hdev->asic_name));
+ break;
+ default:
+ dev_err(hdev->dev, "Unrecognized ASIC type %d\n",
+diff --git a/drivers/accel/habanalabs/common/habanalabs.h b/drivers/accel/habanalabs/common/habanalabs.h
+index 1655c101c705..d0fd77bb6a74 100644
+--- a/drivers/accel/habanalabs/common/habanalabs.h
++++ b/drivers/accel/habanalabs/common/habanalabs.h
+@@ -1262,6 +1262,7 @@ struct hl_dec {
+ * @ASIC_GAUDI_SEC: Gaudi secured device (HL-2000).
+ * @ASIC_GAUDI2: Gaudi2 device.
+ * @ASIC_GAUDI2B: Gaudi2B device.
++ * @ASIC_GAUDI2C: Gaudi2C device.
+ */
+ enum hl_asic_type {
+ ASIC_INVALID,
+@@ -1270,6 +1271,7 @@ enum hl_asic_type {
+ ASIC_GAUDI_SEC,
+ ASIC_GAUDI2,
+ ASIC_GAUDI2B,
++ ASIC_GAUDI2C,
+ };
+
+ struct hl_cs_parser;
+diff --git a/drivers/accel/habanalabs/common/habanalabs_drv.c b/drivers/accel/habanalabs/common/habanalabs_drv.c
+index 306a5bc9bf89..51fb04bbe376 100644
+--- a/drivers/accel/habanalabs/common/habanalabs_drv.c
++++ b/drivers/accel/habanalabs/common/habanalabs_drv.c
+@@ -141,6 +141,9 @@ static enum hl_asic_type get_asic_type(struct hl_device *hdev)
+ case REV_ID_B:
+ asic_type = ASIC_GAUDI2B;
+ break;
++ case REV_ID_C:
++ asic_type = ASIC_GAUDI2C;
++ break;
+ default:
+ break;
+ }
+diff --git a/drivers/accel/habanalabs/common/mmu/mmu.c b/drivers/accel/habanalabs/common/mmu/mmu.c
+index b2145716c605..b654302a68fc 100644
+--- a/drivers/accel/habanalabs/common/mmu/mmu.c
++++ b/drivers/accel/habanalabs/common/mmu/mmu.c
+@@ -596,6 +596,7 @@ int hl_mmu_if_set_funcs(struct hl_device *hdev)
+ break;
+ case ASIC_GAUDI2:
+ case ASIC_GAUDI2B:
++ case ASIC_GAUDI2C:
+ /* MMUs in Gaudi2 are always host resident */
+ hl_mmu_v2_hr_set_funcs(hdev, &hdev->mmu_func[MMU_HR_PGT]);
+ break;
+diff --git a/drivers/accel/habanalabs/common/sysfs.c b/drivers/accel/habanalabs/common/sysfs.c
+index 01f89f029355..278606373055 100644
+--- a/drivers/accel/habanalabs/common/sysfs.c
++++ b/drivers/accel/habanalabs/common/sysfs.c
+@@ -251,6 +251,9 @@ static ssize_t device_type_show(struct device *dev,
+ case ASIC_GAUDI2B:
+ str = "GAUDI2B";
+ break;
++ case ASIC_GAUDI2C:
++ str = "GAUDI2C";
++ break;
+ default:
+ dev_err(hdev->dev, "Unrecognized ASIC type %d\n",
+ hdev->asic_type);
+diff --git a/drivers/accel/habanalabs/include/hw_ip/pci/pci_general.h b/drivers/accel/habanalabs/include/hw_ip/pci/pci_general.h
+index f5d497dc9bdc..4f951cada077 100644
+--- a/drivers/accel/habanalabs/include/hw_ip/pci/pci_general.h
++++ b/drivers/accel/habanalabs/include/hw_ip/pci/pci_general.h
+@@ -25,6 +25,7 @@ enum hl_revision_id {
+ REV_ID_INVALID = 0x00,
+ REV_ID_A = 0x01,
+ REV_ID_B = 0x02,
++ REV_ID_C = 0x03
+ };
+
+ #endif /* INCLUDE_PCI_GENERAL_H_ */
+--
+2.43.0
+
--- /dev/null
+From a171f44f33338be6fa6ef814a8f2735b0aa3bf04 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 31 Oct 2023 12:20:36 +0200
+Subject: accel/habanalabs: fix EQ heartbeat mechanism
+
+From: Farah Kassabri <fkassabri@habana.ai>
+
+[ Upstream commit d1958dce5ab6a3e089c60cf474e8c9b7e96e70ad ]
+
+Stop rescheduling another heartbeat check when EQ heartbeat check fails
+as it generates confusing logs in dmesg that the heartbeat fails.
+
+Signed-off-by: Farah Kassabri <fkassabri@habana.ai>
+Reviewed-by: Oded Gabbay <ogabbay@kernel.org>
+Signed-off-by: Oded Gabbay <ogabbay@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/accel/habanalabs/common/device.c | 14 +++++++-------
+ 1 file changed, 7 insertions(+), 7 deletions(-)
+
+diff --git a/drivers/accel/habanalabs/common/device.c b/drivers/accel/habanalabs/common/device.c
+index 9e461c03e705..9290d4374551 100644
+--- a/drivers/accel/habanalabs/common/device.c
++++ b/drivers/accel/habanalabs/common/device.c
+@@ -1044,18 +1044,19 @@ static bool is_pci_link_healthy(struct hl_device *hdev)
+ return (vendor_id == PCI_VENDOR_ID_HABANALABS);
+ }
+
+-static void hl_device_eq_heartbeat(struct hl_device *hdev)
++static int hl_device_eq_heartbeat_check(struct hl_device *hdev)
+ {
+- u64 event_mask = HL_NOTIFIER_EVENT_DEVICE_RESET | HL_NOTIFIER_EVENT_DEVICE_UNAVAILABLE;
+ struct asic_fixed_properties *prop = &hdev->asic_prop;
+
+ if (!prop->cpucp_info.eq_health_check_supported)
+- return;
++ return 0;
+
+ if (hdev->eq_heartbeat_received)
+ hdev->eq_heartbeat_received = false;
+ else
+- hl_device_cond_reset(hdev, HL_DRV_RESET_HARD, event_mask);
++ return -EIO;
++
++ return 0;
+ }
+
+ static void hl_device_heartbeat(struct work_struct *work)
+@@ -1072,10 +1073,9 @@ static void hl_device_heartbeat(struct work_struct *work)
+ /*
+ * For EQ health check need to check if driver received the heartbeat eq event
+ * in order to validate the eq is working.
++ * Only if both the EQ is healthy and we managed to send the next heartbeat reschedule.
+ */
+- hl_device_eq_heartbeat(hdev);
+-
+- if (!hdev->asic_funcs->send_heartbeat(hdev))
++ if ((!hl_device_eq_heartbeat_check(hdev)) && (!hdev->asic_funcs->send_heartbeat(hdev)))
+ goto reschedule;
+
+ if (hl_device_operational(hdev, NULL))
+--
+2.43.0
+
--- /dev/null
+From d9da1328a96a18ea8f0bb3453f3d612387472ce6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 31 Oct 2023 13:51:10 +0200
+Subject: accel/habanalabs/gaudi2: fix undef opcode reporting
+
+From: Dafna Hirschfeld <dhirschfeld@habana.ai>
+
+[ Upstream commit 0ec346779644039c4c05cfa7f071b1a24e54d8d9 ]
+
+currently the undefined opcode event bit in set only for lower cp and
+only if 'write_enable' is true. It should be set anyway and for all
+streams in order to report that event to userspace.
+
+Signed-off-by: Dafna Hirschfeld <dhirschfeld@habana.ai>
+Reviewed-by: Oded Gabbay <ogabbay@kernel.org>
+Signed-off-by: Oded Gabbay <ogabbay@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/accel/habanalabs/gaudi2/gaudi2.c | 14 ++++++--------
+ 1 file changed, 6 insertions(+), 8 deletions(-)
+
+diff --git a/drivers/accel/habanalabs/gaudi2/gaudi2.c b/drivers/accel/habanalabs/gaudi2/gaudi2.c
+index 819660c684cf..bc6e338ef2fd 100644
+--- a/drivers/accel/habanalabs/gaudi2/gaudi2.c
++++ b/drivers/accel/habanalabs/gaudi2/gaudi2.c
+@@ -7929,21 +7929,19 @@ static int gaudi2_handle_qman_err_generic(struct hl_device *hdev, u16 event_type
+ error_count++;
+ }
+
+- if (i == QMAN_STREAMS && error_count) {
+- /* check for undefined opcode */
+- if (glbl_sts_val & PDMA0_QM_GLBL_ERR_STS_CP_UNDEF_CMD_ERR_MASK &&
+- hdev->captured_err_info.undef_opcode.write_enable) {
++ /* check for undefined opcode */
++ if (glbl_sts_val & PDMA0_QM_GLBL_ERR_STS_CP_UNDEF_CMD_ERR_MASK) {
++ *event_mask |= HL_NOTIFIER_EVENT_UNDEFINED_OPCODE;
++ if (hdev->captured_err_info.undef_opcode.write_enable) {
+ memset(&hdev->captured_err_info.undef_opcode, 0,
+ sizeof(hdev->captured_err_info.undef_opcode));
+-
+- hdev->captured_err_info.undef_opcode.write_enable = false;
+ hdev->captured_err_info.undef_opcode.timestamp = ktime_get();
+ hdev->captured_err_info.undef_opcode.engine_id =
+ gaudi2_queue_id_to_engine_id[qid_base];
+- *event_mask |= HL_NOTIFIER_EVENT_UNDEFINED_OPCODE;
+ }
+
+- handle_lower_qman_data_on_err(hdev, qman_base, *event_mask);
++ if (i == QMAN_STREAMS)
++ handle_lower_qman_data_on_err(hdev, qman_base, *event_mask);
+ }
+ }
+
+--
+2.43.0
+
--- /dev/null
+From b94abdf72c2b01ce39d92dc0fef583503dd5a2d1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 14:45:18 +0800
+Subject: ACPI: APEI: set memory failure flags as MF_ACTION_REQUIRED on
+ synchronous events
+
+From: Shuai Xue <xueshuai@linux.alibaba.com>
+
+[ Upstream commit a70297d2213253853e95f5b49651f924990c6d3b ]
+
+There are two major types of uncorrected recoverable (UCR) errors :
+
+ - Synchronous error: The error is detected and raised at the point of
+ the consumption in the execution flow, e.g. when a CPU tries to
+ access a poisoned cache line. The CPU will take a synchronous error
+ exception such as Synchronous External Abort (SEA) on Arm64 and
+ Machine Check Exception (MCE) on X86. OS requires to take action (for
+ example, offline failure page/kill failure thread) to recover this
+ uncorrectable error.
+
+ - Asynchronous error: The error is detected out of processor execution
+ context, e.g. when an error is detected by a background scrubber.
+ Some data in the memory are corrupted. But the data have not been
+ consumed. OS is optional to take action to recover this uncorrectable
+ error.
+
+When APEI firmware first is enabled, a platform may describe one error
+source for the handling of synchronous errors (e.g. MCE or SEA notification
+), or for handling asynchronous errors (e.g. SCI or External Interrupt
+notification). In other words, we can distinguish synchronous errors by
+APEI notification. For synchronous errors, kernel will kill the current
+process which accessing the poisoned page by sending SIGBUS with
+BUS_MCEERR_AR. In addition, for asynchronous errors, kernel will notify the
+process who owns the poisoned page by sending SIGBUS with BUS_MCEERR_AO in
+early kill mode. However, the GHES driver always sets mf_flags to 0 so that
+all synchronous errors are handled as asynchronous errors in memory failure.
+
+To this end, set memory failure flags as MF_ACTION_REQUIRED on synchronous
+events.
+
+Signed-off-by: Shuai Xue <xueshuai@linux.alibaba.com>
+Tested-by: Ma Wupeng <mawupeng1@huawei.com>
+Reviewed-by: Kefeng Wang <wangkefeng.wang@huawei.com>
+Reviewed-by: Xiaofei Tan <tanxiaofei@huawei.com>
+Reviewed-by: Baolin Wang <baolin.wang@linux.alibaba.com>
+Reviewed-by: James Morse <james.morse@arm.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/apei/ghes.c | 29 +++++++++++++++++++++++------
+ 1 file changed, 23 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/acpi/apei/ghes.c b/drivers/acpi/apei/ghes.c
+index 63ad0541db38..ab2a82cb1b0b 100644
+--- a/drivers/acpi/apei/ghes.c
++++ b/drivers/acpi/apei/ghes.c
+@@ -101,6 +101,20 @@ static inline bool is_hest_type_generic_v2(struct ghes *ghes)
+ return ghes->generic->header.type == ACPI_HEST_TYPE_GENERIC_ERROR_V2;
+ }
+
++/*
++ * A platform may describe one error source for the handling of synchronous
++ * errors (e.g. MCE or SEA), or for handling asynchronous errors (e.g. SCI
++ * or External Interrupt). On x86, the HEST notifications are always
++ * asynchronous, so only SEA on ARM is delivered as a synchronous
++ * notification.
++ */
++static inline bool is_hest_sync_notify(struct ghes *ghes)
++{
++ u8 notify_type = ghes->generic->notify.type;
++
++ return notify_type == ACPI_HEST_NOTIFY_SEA;
++}
++
+ /*
+ * This driver isn't really modular, however for the time being,
+ * continuing to use module_param is the easiest way to remain
+@@ -489,7 +503,7 @@ static bool ghes_do_memory_failure(u64 physical_addr, int flags)
+ }
+
+ static bool ghes_handle_memory_failure(struct acpi_hest_generic_data *gdata,
+- int sev)
++ int sev, bool sync)
+ {
+ int flags = -1;
+ int sec_sev = ghes_severity(gdata->error_severity);
+@@ -503,7 +517,7 @@ static bool ghes_handle_memory_failure(struct acpi_hest_generic_data *gdata,
+ (gdata->flags & CPER_SEC_ERROR_THRESHOLD_EXCEEDED))
+ flags = MF_SOFT_OFFLINE;
+ if (sev == GHES_SEV_RECOVERABLE && sec_sev == GHES_SEV_RECOVERABLE)
+- flags = 0;
++ flags = sync ? MF_ACTION_REQUIRED : 0;
+
+ if (flags != -1)
+ return ghes_do_memory_failure(mem_err->physical_addr, flags);
+@@ -511,9 +525,11 @@ static bool ghes_handle_memory_failure(struct acpi_hest_generic_data *gdata,
+ return false;
+ }
+
+-static bool ghes_handle_arm_hw_error(struct acpi_hest_generic_data *gdata, int sev)
++static bool ghes_handle_arm_hw_error(struct acpi_hest_generic_data *gdata,
++ int sev, bool sync)
+ {
+ struct cper_sec_proc_arm *err = acpi_hest_get_payload(gdata);
++ int flags = sync ? MF_ACTION_REQUIRED : 0;
+ bool queued = false;
+ int sec_sev, i;
+ char *p;
+@@ -538,7 +554,7 @@ static bool ghes_handle_arm_hw_error(struct acpi_hest_generic_data *gdata, int s
+ * and don't filter out 'corrected' error here.
+ */
+ if (is_cache && has_pa) {
+- queued = ghes_do_memory_failure(err_info->physical_fault_addr, 0);
++ queued = ghes_do_memory_failure(err_info->physical_fault_addr, flags);
+ p += err_info->length;
+ continue;
+ }
+@@ -666,6 +682,7 @@ static bool ghes_do_proc(struct ghes *ghes,
+ const guid_t *fru_id = &guid_null;
+ char *fru_text = "";
+ bool queued = false;
++ bool sync = is_hest_sync_notify(ghes);
+
+ sev = ghes_severity(estatus->error_severity);
+ apei_estatus_for_each_section(estatus, gdata) {
+@@ -683,13 +700,13 @@ static bool ghes_do_proc(struct ghes *ghes,
+ atomic_notifier_call_chain(&ghes_report_chain, sev, mem_err);
+
+ arch_apei_report_mem_error(sev, mem_err);
+- queued = ghes_handle_memory_failure(gdata, sev);
++ queued = ghes_handle_memory_failure(gdata, sev, sync);
+ }
+ else if (guid_equal(sec_type, &CPER_SEC_PCIE)) {
+ ghes_handle_aer(gdata);
+ }
+ else if (guid_equal(sec_type, &CPER_SEC_PROC_ARM)) {
+- queued = ghes_handle_arm_hw_error(gdata, sev);
++ queued = ghes_handle_arm_hw_error(gdata, sev, sync);
+ } else {
+ void *err = acpi_hest_get_payload(gdata);
+
+--
+2.43.0
+
--- /dev/null
+From bbd6e5f0be5b2ea3659949917996a8d74bdc1987 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 13:00:37 -0500
+Subject: ACPI: extlog: fix NULL pointer dereference check
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Prarit Bhargava <prarit@redhat.com>
+
+[ Upstream commit 72d9b9747e78979510e9aafdd32eb99c7aa30dd1 ]
+
+The gcc plugin -fanalyzer [1] tries to detect various
+patterns of incorrect behaviour. The tool reports:
+
+drivers/acpi/acpi_extlog.c: In function ‘extlog_exit’:
+drivers/acpi/acpi_extlog.c:307:12: warning: check of ‘extlog_l1_addr’ for NULL after already dereferencing it [-Wanalyzer-deref-before-check]
+ |
+ | 306 | ((struct extlog_l1_head *)extlog_l1_addr)->flags &= ~FLAG_OS_OPTIN;
+ | | ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~^~~~~~~
+ | | |
+ | | (1) pointer ‘extlog_l1_addr’ is dereferenced here
+ | 307 | if (extlog_l1_addr)
+ | | ~
+ | | |
+ | | (2) pointer ‘extlog_l1_addr’ is checked for NULL here but it was already dereferenced at (1)
+ |
+
+Fix the NULL pointer dereference check in extlog_exit().
+
+Link: https://gcc.gnu.org/onlinedocs/gcc-10.1.0/gcc/Static-Analyzer-Options.html # [1]
+
+Signed-off-by: Prarit Bhargava <prarit@redhat.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/acpi_extlog.c | 5 +++--
+ 1 file changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/acpi/acpi_extlog.c b/drivers/acpi/acpi_extlog.c
+index 71e8d4e7a36c..ca87a0939135 100644
+--- a/drivers/acpi/acpi_extlog.c
++++ b/drivers/acpi/acpi_extlog.c
+@@ -308,9 +308,10 @@ static int __init extlog_init(void)
+ static void __exit extlog_exit(void)
+ {
+ mce_unregister_decode_chain(&extlog_mce_dec);
+- ((struct extlog_l1_head *)extlog_l1_addr)->flags &= ~FLAG_OS_OPTIN;
+- if (extlog_l1_addr)
++ if (extlog_l1_addr) {
++ ((struct extlog_l1_head *)extlog_l1_addr)->flags &= ~FLAG_OS_OPTIN;
+ acpi_os_unmap_iomem(extlog_l1_addr, l1_size);
++ }
+ if (elog_addr)
+ acpi_os_unmap_iomem(elog_addr, elog_size);
+ release_mem_region(elog_base, elog_size);
+--
+2.43.0
+
--- /dev/null
+From 5b4854430213f12a824d87360910fd1a4750fb1a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 18:43:18 +0800
+Subject: ACPI: NUMA: Fix the logic of getting the fake_pxm value
+
+From: Yuntao Wang <ytcoode@gmail.com>
+
+[ Upstream commit e3f577830ce216b0ca21d4750cbbd64cfc21efff ]
+
+The for loop does not iterate over the last element of the node_to_pxm_map
+array. This could lead to a conflict between the final fake_pxm value and
+the existing pxm values. That is, the final fake_pxm value can not be
+guaranteed to be an unused pxm value.
+
+While at it, fix up white space in slit_valid().
+
+Signed-off-by: Yuntao Wang <ytcoode@gmail.com>
+[ rjw: Changelog edits ]
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/numa/srat.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/acpi/numa/srat.c b/drivers/acpi/numa/srat.c
+index 12f330b0eac0..b57de78fbf14 100644
+--- a/drivers/acpi/numa/srat.c
++++ b/drivers/acpi/numa/srat.c
+@@ -183,7 +183,7 @@ static int __init slit_valid(struct acpi_table_slit *slit)
+ int i, j;
+ int d = slit->locality_count;
+ for (i = 0; i < d; i++) {
+- for (j = 0; j < d; j++) {
++ for (j = 0; j < d; j++) {
+ u8 val = slit->entry[d*i + j];
+ if (i == j) {
+ if (val != LOCAL_DISTANCE)
+@@ -532,7 +532,7 @@ int __init acpi_numa_init(void)
+ */
+
+ /* fake_pxm is the next unused PXM value after SRAT parsing */
+- for (i = 0, fake_pxm = -1; i < MAX_NUMNODES - 1; i++) {
++ for (i = 0, fake_pxm = -1; i < MAX_NUMNODES; i++) {
+ if (node_to_pxm_map[i] > fake_pxm)
+ fake_pxm = node_to_pxm_map[i];
+ }
+--
+2.43.0
+
--- /dev/null
+From 3b73ba0d025a708d4c6fe9e20b7534059a32fcbb Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 6 Jan 2024 21:13:23 -0500
+Subject: ACPI: resource: Add DMI quirks for ASUS Vivobook E1504GA and E1504GAB
+
+From: Ben Mayo <benny1091@gmail.com>
+
+[ Upstream commit d2aaf19965045f70bb2ece514399cdc6fcce2e73 ]
+
+Asus Vivobook E1504GA and E1504GAB notebooks are affected by bug #216158
+(DSDT specifies the kbd IRQ as level active-low and using the override
+changes this to rising edge, stopping the keyboard from working).
+
+Users of these notebooks do not have a working keyboard unless they add
+their DMI information to the struct irq1_level_low_skip_override array
+and compile a custom kernel.
+
+Add support for these computers to the Linux kernel without requiring
+the end-user to recompile the kernel.
+
+Link: https://bugzilla.kernel.org/show_bug.cgi?id=216158
+Signed-off-by: Ben Mayo <benny1091@gmail.com>
+[ rjw: Link tag, subject and changelog edits ]
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/resource.c | 14 ++++++++++++++
+ 1 file changed, 14 insertions(+)
+
+diff --git a/drivers/acpi/resource.c b/drivers/acpi/resource.c
+index c3536c236be9..7d58d8b4ca76 100644
+--- a/drivers/acpi/resource.c
++++ b/drivers/acpi/resource.c
+@@ -482,6 +482,20 @@ static const struct dmi_system_id irq1_level_low_skip_override[] = {
+ DMI_MATCH(DMI_BOARD_NAME, "B2502CBA"),
+ },
+ },
++ {
++ /* Asus Vivobook E1504GA */
++ .matches = {
++ DMI_MATCH(DMI_SYS_VENDOR, "ASUSTeK COMPUTER INC."),
++ DMI_MATCH(DMI_BOARD_NAME, "E1504GA"),
++ },
++ },
++ {
++ /* Asus Vivobook E1504GAB */
++ .matches = {
++ DMI_MATCH(DMI_SYS_VENDOR, "ASUSTeK COMPUTER INC."),
++ DMI_MATCH(DMI_BOARD_NAME, "E1504GAB"),
++ },
++ },
+ {
+ /* LG Electronics 17U70P */
+ .matches = {
+--
+2.43.0
+
--- /dev/null
+From 0178ad99f0ef00a8bebf5ffa2e8779baf5b0a680 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 7 Jan 2024 13:53:07 +0500
+Subject: ACPI: resource: Skip IRQ override on ASUS ExpertBook B1502CGA
+
+From: Michael Maltsev <mekosko@projectyo.network>
+
+[ Upstream commit e315e8692f7922cd1b2a26bd7a1741cc8ce77085 ]
+
+Like the ASUS ExpertBook B1502CBA and various ASUS laptops, the
+ASUS ExpertBook B1502CGA has an ACPI DSDT table that describes IRQ 1 as
+ActiveLow while the kernel overrides it to Edge_High.
+
+ $ sudo dmesg | grep DMI
+ [ 0.000000] DMI: ASUSTeK COMPUTER INC. ASUS EXPERTBOOK B1502CGA_B1502CGA/B1502CGA, BIOS B1502CGA.303 06/05/2023
+ $ grep -A 40 PS2K dsdt.dsl | grep IRQ -A 1
+ IRQ (Level, ActiveLow, Exclusive, )
+ {1}
+
+This prevents the keyboard from working. To fix this issue, add this laptop
+to the skip_override_table so that the kernel does not override IRQ 1.
+
+Signed-off-by: Michael Maltsev <mekosko@projectyo.network>
+[ rjw: rebase, replace .ident field with a comment ]
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/resource.c | 7 +++++++
+ 1 file changed, 7 insertions(+)
+
+diff --git a/drivers/acpi/resource.c b/drivers/acpi/resource.c
+index 7d58d8b4ca76..03b52d31a3e3 100644
+--- a/drivers/acpi/resource.c
++++ b/drivers/acpi/resource.c
+@@ -461,6 +461,13 @@ static const struct dmi_system_id irq1_level_low_skip_override[] = {
+ DMI_MATCH(DMI_BOARD_NAME, "B1502CBA"),
+ },
+ },
++ {
++ /* Asus ExpertBook B1502CGA */
++ .matches = {
++ DMI_MATCH(DMI_SYS_VENDOR, "ASUSTeK COMPUTER INC."),
++ DMI_MATCH(DMI_BOARD_NAME, "B1502CGA"),
++ },
++ },
+ {
+ /* Asus ExpertBook B2402CBA */
+ .matches = {
+--
+2.43.0
+
--- /dev/null
+From 068ffeca7aa5c3b299d5fb1009041ad864efe938 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 20 Nov 2023 19:41:43 +0800
+Subject: ACPI: tables: Correct and clean up the logic of
+ acpi_parse_entries_array()
+
+From: Yuntao Wang <ytcoode@gmail.com>
+
+[ Upstream commit 4b3805daaacb2168665c6222f261e68accb120dc ]
+
+The original intention of acpi_parse_entries_array() is to return the
+number of all matching entries on success. This number may be greater than
+the value of the max_entries parameter. When this happens, the function
+will output a warning message, indicating that `count - max_entries`
+matching entries remain unprocessed and have been ignored.
+
+However, commit 4ceacd02f5a1 ("ACPI / table: Always count matched and
+successfully parsed entries") changed this logic to return the number of
+entries successfully processed by the handler. In this case, when the
+max_entries parameter is not zero, the number of entries successfully
+processed can never be greater than the value of max_entries. In other
+words, the expression `count > max_entries` will always evaluate to false.
+This means that the logic in the final if statement will never be executed.
+
+Commit 99b0efd7c886 ("ACPI / tables: do not report the number of entries
+ignored by acpi_parse_entries()") mentioned this issue, but it tried to fix
+it by removing part of the warning message. This is meaningless because the
+pr_warn statement will never be executed in the first place.
+
+Commit 8726d4f44150 ("ACPI / tables: fix acpi_parse_entries_array() so it
+traverses all subtables") introduced an errs variable, which is intended to
+make acpi_parse_entries_array() always traverse all of the subtables,
+calling as many of the callbacks as possible. However, it seems that the
+commit does not achieve this goal. For example, when a handler returns an
+error, none of the handlers will be called again in the subsequent
+iterations. This result appears to be no different from before the change.
+
+This patch corrects and cleans up the logic of acpi_parse_entries_array(),
+making it return the number of all matching entries, rather than the number
+of entries successfully processed by handlers. Additionally, if an error
+occurs when executing a handler, the function will return -EINVAL immediately.
+
+This patch should not affect existing users of acpi_parse_entries_array().
+
+Signed-off-by: Yuntao Wang <ytcoode@gmail.com>
+Reviewed-by: Dave Jiang <dave.jiang@intel.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ lib/fw_table.c | 30 +++++++++---------------------
+ 1 file changed, 9 insertions(+), 21 deletions(-)
+
+diff --git a/lib/fw_table.c b/lib/fw_table.c
+index 294df54e33b6..c49a09ee3853 100644
+--- a/lib/fw_table.c
++++ b/lib/fw_table.c
+@@ -85,11 +85,6 @@ acpi_get_subtable_type(char *id)
+ return ACPI_SUBTABLE_COMMON;
+ }
+
+-static __init_or_acpilib bool has_handler(struct acpi_subtable_proc *proc)
+-{
+- return proc->handler || proc->handler_arg;
+-}
+-
+ static __init_or_acpilib int call_handler(struct acpi_subtable_proc *proc,
+ union acpi_subtable_headers *hdr,
+ unsigned long end)
+@@ -133,7 +128,6 @@ acpi_parse_entries_array(char *id, unsigned long table_size,
+ unsigned long table_end, subtable_len, entry_len;
+ struct acpi_subtable_entry entry;
+ int count = 0;
+- int errs = 0;
+ int i;
+
+ table_end = (unsigned long)table_header + table_header->length;
+@@ -145,25 +139,19 @@ acpi_parse_entries_array(char *id, unsigned long table_size,
+ ((unsigned long)table_header + table_size);
+ subtable_len = acpi_get_subtable_header_length(&entry);
+
+- while (((unsigned long)entry.hdr) + subtable_len < table_end) {
+- if (max_entries && count >= max_entries)
+- break;
+-
++ while (((unsigned long)entry.hdr) + subtable_len < table_end) {
+ for (i = 0; i < proc_num; i++) {
+ if (acpi_get_entry_type(&entry) != proc[i].id)
+ continue;
+- if (!has_handler(&proc[i]) ||
+- (!errs &&
+- call_handler(&proc[i], entry.hdr, table_end))) {
+- errs++;
+- continue;
+- }
++
++ if (!max_entries || count < max_entries)
++ if (call_handler(&proc[i], entry.hdr, table_end))
++ return -EINVAL;
+
+ proc[i].count++;
++ count++;
+ break;
+ }
+- if (i != proc_num)
+- count++;
+
+ /*
+ * If entry->length is 0, break from this loop to avoid
+@@ -180,9 +168,9 @@ acpi_parse_entries_array(char *id, unsigned long table_size,
+ }
+
+ if (max_entries && count > max_entries) {
+- pr_warn("[%4.4s:0x%02x] found the maximum %i entries\n",
+- id, proc->id, count);
++ pr_warn("[%4.4s:0x%02x] ignored %i entries of %i found\n",
++ id, proc->id, count - max_entries, count);
+ }
+
+- return errs ? -EINVAL : count;
++ return count;
+ }
+--
+2.43.0
+
--- /dev/null
+From e7af5c438715ed14a980f4d602932e7460d13ca2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 26 Nov 2023 21:59:13 +0800
+Subject: ACPI: video: Add quirk for the Colorful X15 AT 23 Laptop
+
+From: Yuluo Qiu <qyl27@outlook.com>
+
+[ Upstream commit 143176a46bdd3bfbe9ba2462bf94458e80d65ebf ]
+
+The Colorful X15 AT 23 ACPI video-bus device report spurious
+ACPI_VIDEO_NOTIFY_CYCLE events resulting in spurious KEY_SWITCHVIDEOMODE
+events being reported to userspace (and causing trouble there) when
+an external screen plugged in.
+
+Add a quirk setting the report_key_events mask to
+REPORT_BRIGHTNESS_KEY_EVENTS so that the ACPI_VIDEO_NOTIFY_CYCLE
+events will be ignored, while still reporting brightness up/down
+hotkey-presses to userspace normally.
+
+Signed-off-by: Yuluo Qiu <qyl27@outlook.com>
+Co-developed-by: Celeste Liu <CoelacanthusHex@gmail.com>
+Signed-off-by: Celeste Liu <CoelacanthusHex@gmail.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/acpi_video.c | 9 +++++++++
+ 1 file changed, 9 insertions(+)
+
+diff --git a/drivers/acpi/acpi_video.c b/drivers/acpi/acpi_video.c
+index 375010e575d0..33ddb447747e 100644
+--- a/drivers/acpi/acpi_video.c
++++ b/drivers/acpi/acpi_video.c
+@@ -500,6 +500,15 @@ static const struct dmi_system_id video_dmi_table[] = {
+ DMI_MATCH(DMI_PRODUCT_NAME, "Vostro 3350"),
+ },
+ },
++ {
++ .callback = video_set_report_key_events,
++ .driver_data = (void *)((uintptr_t)REPORT_BRIGHTNESS_KEY_EVENTS),
++ .ident = "COLORFUL X15 AT 23",
++ .matches = {
++ DMI_MATCH(DMI_SYS_VENDOR, "COLORFUL"),
++ DMI_MATCH(DMI_PRODUCT_NAME, "X15 AT 23"),
++ },
++ },
+ /*
+ * Some machines change the brightness themselves when a brightness
+ * hotkey gets pressed, despite us telling them not to. In this case
+--
+2.43.0
+
--- /dev/null
+From 564b6b9f70174c8aeb090b032522650cee3cd29b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 12:56:06 +0100
+Subject: afs: fix the usage of read_seqbegin_or_lock() in
+ afs_lookup_volume_rcu()
+
+From: Oleg Nesterov <oleg@redhat.com>
+
+[ Upstream commit 4121b4337146b64560d1e46ebec77196d9287802 ]
+
+David Howells says:
+
+ (2) afs_lookup_volume_rcu().
+
+ There can be a lot of volumes known by a system. A thousand would
+ require a 10-step walk and this is drivable by remote operation, so I
+ think this should probably take a lock on the second pass too.
+
+Make the "seq" counter odd on the 2nd pass, otherwise read_seqbegin_or_lock()
+never takes the lock.
+
+Signed-off-by: Oleg Nesterov <oleg@redhat.com>
+Signed-off-by: David Howells <dhowells@redhat.com>
+cc: Marc Dionne <marc.dionne@auristor.com>
+cc: linux-afs@lists.infradead.org
+Link: https://lore.kernel.org/r/20231130115606.GA21571@redhat.com/
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/afs/callback.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/fs/afs/callback.c b/fs/afs/callback.c
+index a484fa642808..90f9b2a46ff4 100644
+--- a/fs/afs/callback.c
++++ b/fs/afs/callback.c
+@@ -110,13 +110,14 @@ static struct afs_volume *afs_lookup_volume_rcu(struct afs_cell *cell,
+ {
+ struct afs_volume *volume = NULL;
+ struct rb_node *p;
+- int seq = 0;
++ int seq = 1;
+
+ do {
+ /* Unfortunately, rbtree walking doesn't give reliable results
+ * under just the RCU read lock, so we have to check for
+ * changes.
+ */
++ seq++; /* 2 on the 1st/lockless path, otherwise odd */
+ read_seqbegin_or_lock(&cell->volume_lock, &seq);
+
+ p = rcu_dereference_raw(cell->volumes.rb_node);
+--
+2.43.0
+
--- /dev/null
+From ea7c01ae21d13dfd64ac2f32e210c09ec9e8e5b4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 8 Jan 2024 19:02:35 +0800
+Subject: ALSA: hda/conexant: Fix headset auto detect fail in cx8070 and SN6140
+
+From: bo liu <bo.liu@senarytech.com>
+
+[ Upstream commit 7aeb259086487417f0fecf66e325bee133e8813a ]
+
+When OMTP headset plugin the headset jack of CX8070 and SN6160 sound cards,
+the headset type detection circuit will recognize the headset type as CTIA.
+At this point, plugout and plugin the headset will get the correct headset
+type as OMTP.
+The reason for the failure of headset type recognition is that the sound
+card creation will enable the VREF voltage of the headset mic, which
+interferes with the headset type automatic detection circuit. Plugout and
+plugin the headset will restart the headset detection and get the correct
+headset type.
+The patch is disable the VREF voltage when the headset is not present, and
+will enable the VREF voltage when the headset is present.
+
+Signed-off-by: bo liu <bo.liu@senarytech.com>
+Link: https://lore.kernel.org/r/20240108110235.3867-1-bo.liu@senarytech.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/pci/hda/patch_conexant.c | 115 ++++++++++++++++++++++++++++++++-
+ 1 file changed, 113 insertions(+), 2 deletions(-)
+
+diff --git a/sound/pci/hda/patch_conexant.c b/sound/pci/hda/patch_conexant.c
+index a889cccdd607..e8819e8a9876 100644
+--- a/sound/pci/hda/patch_conexant.c
++++ b/sound/pci/hda/patch_conexant.c
+@@ -21,6 +21,12 @@
+ #include "hda_jack.h"
+ #include "hda_generic.h"
+
++enum {
++ CX_HEADSET_NOPRESENT = 0,
++ CX_HEADSET_PARTPRESENT,
++ CX_HEADSET_ALLPRESENT,
++};
++
+ struct conexant_spec {
+ struct hda_gen_spec gen;
+
+@@ -42,7 +48,8 @@ struct conexant_spec {
+ unsigned int gpio_led;
+ unsigned int gpio_mute_led_mask;
+ unsigned int gpio_mic_led_mask;
+-
++ unsigned int headset_present_flag;
++ bool is_cx8070_sn6140;
+ };
+
+
+@@ -164,6 +171,27 @@ static void cxt_init_gpio_led(struct hda_codec *codec)
+ }
+ }
+
++static void cx_fixup_headset_recog(struct hda_codec *codec)
++{
++ unsigned int mic_persent;
++
++ /* fix some headset type recognize fail issue, such as EDIFIER headset */
++ /* set micbiasd output current comparator threshold from 66% to 55%. */
++ snd_hda_codec_write(codec, 0x1c, 0, 0x320, 0x010);
++ /* set OFF voltage for DFET from -1.2V to -0.8V, set headset micbias registor
++ * value adjustment trim from 2.2K ohms to 2.0K ohms.
++ */
++ snd_hda_codec_write(codec, 0x1c, 0, 0x3b0, 0xe10);
++ /* fix reboot headset type recognize fail issue */
++ mic_persent = snd_hda_codec_read(codec, 0x19, 0, AC_VERB_GET_PIN_SENSE, 0x0);
++ if (mic_persent & AC_PINSENSE_PRESENCE)
++ /* enable headset mic VREF */
++ snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x24);
++ else
++ /* disable headset mic VREF */
++ snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x20);
++}
++
+ static int cx_auto_init(struct hda_codec *codec)
+ {
+ struct conexant_spec *spec = codec->spec;
+@@ -174,6 +202,9 @@ static int cx_auto_init(struct hda_codec *codec)
+ cxt_init_gpio_led(codec);
+ snd_hda_apply_fixup(codec, HDA_FIXUP_ACT_INIT);
+
++ if (spec->is_cx8070_sn6140)
++ cx_fixup_headset_recog(codec);
++
+ return 0;
+ }
+
+@@ -192,6 +223,77 @@ static void cx_auto_free(struct hda_codec *codec)
+ snd_hda_gen_free(codec);
+ }
+
++static void cx_process_headset_plugin(struct hda_codec *codec)
++{
++ unsigned int val;
++ unsigned int count = 0;
++
++ /* Wait headset detect done. */
++ do {
++ val = snd_hda_codec_read(codec, 0x1c, 0, 0xca0, 0x0);
++ if (val & 0x080) {
++ codec_dbg(codec, "headset type detect done!\n");
++ break;
++ }
++ msleep(20);
++ count++;
++ } while (count < 3);
++ val = snd_hda_codec_read(codec, 0x1c, 0, 0xcb0, 0x0);
++ if (val & 0x800) {
++ codec_dbg(codec, "headset plugin, type is CTIA\n");
++ snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x24);
++ } else if (val & 0x400) {
++ codec_dbg(codec, "headset plugin, type is OMTP\n");
++ snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x24);
++ } else {
++ codec_dbg(codec, "headphone plugin\n");
++ }
++}
++
++static void cx_update_headset_mic_vref(struct hda_codec *codec, unsigned int res)
++{
++ unsigned int phone_present, mic_persent, phone_tag, mic_tag;
++ struct conexant_spec *spec = codec->spec;
++
++ /* In cx8070 and sn6140, the node 16 can only be config to headphone or disabled,
++ * the node 19 can only be config to microphone or disabled.
++ * Check hp&mic tag to process headset pulgin&plugout.
++ */
++ phone_tag = snd_hda_codec_read(codec, 0x16, 0, AC_VERB_GET_UNSOLICITED_RESPONSE, 0x0);
++ mic_tag = snd_hda_codec_read(codec, 0x19, 0, AC_VERB_GET_UNSOLICITED_RESPONSE, 0x0);
++ if ((phone_tag & (res >> AC_UNSOL_RES_TAG_SHIFT)) ||
++ (mic_tag & (res >> AC_UNSOL_RES_TAG_SHIFT))) {
++ phone_present = snd_hda_codec_read(codec, 0x16, 0, AC_VERB_GET_PIN_SENSE, 0x0);
++ if (!(phone_present & AC_PINSENSE_PRESENCE)) {/* headphone plugout */
++ spec->headset_present_flag = CX_HEADSET_NOPRESENT;
++ snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x20);
++ return;
++ }
++ if (spec->headset_present_flag == CX_HEADSET_NOPRESENT) {
++ spec->headset_present_flag = CX_HEADSET_PARTPRESENT;
++ } else if (spec->headset_present_flag == CX_HEADSET_PARTPRESENT) {
++ mic_persent = snd_hda_codec_read(codec, 0x19, 0,
++ AC_VERB_GET_PIN_SENSE, 0x0);
++ /* headset is present */
++ if ((phone_present & AC_PINSENSE_PRESENCE) &&
++ (mic_persent & AC_PINSENSE_PRESENCE)) {
++ cx_process_headset_plugin(codec);
++ spec->headset_present_flag = CX_HEADSET_ALLPRESENT;
++ }
++ }
++ }
++}
++
++static void cx_jack_unsol_event(struct hda_codec *codec, unsigned int res)
++{
++ struct conexant_spec *spec = codec->spec;
++
++ if (spec->is_cx8070_sn6140)
++ cx_update_headset_mic_vref(codec, res);
++
++ snd_hda_jack_unsol_event(codec, res);
++}
++
+ #ifdef CONFIG_PM
+ static int cx_auto_suspend(struct hda_codec *codec)
+ {
+@@ -205,7 +307,7 @@ static const struct hda_codec_ops cx_auto_patch_ops = {
+ .build_pcms = snd_hda_gen_build_pcms,
+ .init = cx_auto_init,
+ .free = cx_auto_free,
+- .unsol_event = snd_hda_jack_unsol_event,
++ .unsol_event = cx_jack_unsol_event,
+ #ifdef CONFIG_PM
+ .suspend = cx_auto_suspend,
+ .check_power_status = snd_hda_gen_check_power_status,
+@@ -1042,6 +1144,15 @@ static int patch_conexant_auto(struct hda_codec *codec)
+ codec->spec = spec;
+ codec->patch_ops = cx_auto_patch_ops;
+
++ /* init cx8070/sn6140 flag and reset headset_present_flag */
++ switch (codec->core.vendor_id) {
++ case 0x14f11f86:
++ case 0x14f11f87:
++ spec->is_cx8070_sn6140 = true;
++ spec->headset_present_flag = CX_HEADSET_NOPRESENT;
++ break;
++ }
++
+ cx_auto_parse_eapd(codec);
+ spec->gen.own_eapd_ctl = 1;
+
+--
+2.43.0
+
--- /dev/null
+From 5303b24f8619e87dc2e0eb72489b3f01bc3650dd Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 15:27:07 -0600
+Subject: ALSA: hda: Intel: add HDA_ARL PCI ID support
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+
+[ Upstream commit a31014ebad617868c246d3985ff80d891f03711e ]
+
+Yet another PCI ID.
+
+Signed-off-by: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+Reviewed-by: Péter Ujfalusi <peter.ujfalusi@linux.intel.com>
+Reviewed-by: Kai Vehmanen <kai.vehmanen@linux.intel.com>
+Acked-by: Mark Brown <broonie@kernel.org>
+Link: https://lore.kernel.org/r/20231204212710.185976-3-pierre-louis.bossart@linux.intel.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/pci/hda/hda_intel.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/sound/pci/hda/hda_intel.c b/sound/pci/hda/hda_intel.c
+index 2d1df3654424..2276adc84478 100644
+--- a/sound/pci/hda/hda_intel.c
++++ b/sound/pci/hda/hda_intel.c
+@@ -2504,6 +2504,8 @@ static const struct pci_device_id azx_ids[] = {
+ { PCI_DEVICE_DATA(INTEL, HDA_LNL_P, AZX_DRIVER_SKL | AZX_DCAPS_INTEL_SKYLAKE) },
+ /* Arrow Lake-S */
+ { PCI_DEVICE_DATA(INTEL, HDA_ARL_S, AZX_DRIVER_SKL | AZX_DCAPS_INTEL_SKYLAKE) },
++ /* Arrow Lake */
++ { PCI_DEVICE_DATA(INTEL, HDA_ARL, AZX_DRIVER_SKL | AZX_DCAPS_INTEL_SKYLAKE) },
+ /* Apollolake (Broxton-P) */
+ { PCI_DEVICE_DATA(INTEL, HDA_APL, AZX_DRIVER_SKL | AZX_DCAPS_INTEL_BROXTON) },
+ /* Gemini-Lake */
+--
+2.43.0
+
--- /dev/null
+From 9a357e7549a6d21c62f977d2ae0f7050ec34ba2c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 15:27:08 -0600
+Subject: ALSA: hda: intel-dspcfg: add filters for ARL-S and ARL
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+
+[ Upstream commit 7a9d6bbe8a663c817080be55d9fecf19a4a8fd8f ]
+
+Same usual filters, SOF is required for DMIC and/or SoundWire support.
+
+Signed-off-by: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+Reviewed-by: Péter Ujfalusi <peter.ujfalusi@linux.intel.com>
+Reviewed-by: Kai Vehmanen <kai.vehmanen@linux.intel.com>
+Acked-by: Mark Brown <broonie@kernel.org>
+Link: https://lore.kernel.org/r/20231204212710.185976-4-pierre-louis.bossart@linux.intel.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/hda/intel-dsp-config.c | 10 ++++++++++
+ 1 file changed, 10 insertions(+)
+
+diff --git a/sound/hda/intel-dsp-config.c b/sound/hda/intel-dsp-config.c
+index 756fa0aa69bb..6a384b922e4f 100644
+--- a/sound/hda/intel-dsp-config.c
++++ b/sound/hda/intel-dsp-config.c
+@@ -521,6 +521,16 @@ static const struct config_entry config_table[] = {
+ .flags = FLAG_SOF | FLAG_SOF_ONLY_IF_DMIC_OR_SOUNDWIRE,
+ .device = PCI_DEVICE_ID_INTEL_HDA_MTL,
+ },
++ /* ArrowLake-S */
++ {
++ .flags = FLAG_SOF | FLAG_SOF_ONLY_IF_DMIC_OR_SOUNDWIRE,
++ .device = PCI_DEVICE_ID_INTEL_HDA_ARL_S,
++ },
++ /* ArrowLake */
++ {
++ .flags = FLAG_SOF | FLAG_SOF_ONLY_IF_DMIC_OR_SOUNDWIRE,
++ .device = PCI_DEVICE_ID_INTEL_HDA_ARL,
++ },
+ #endif
+
+ /* Lunar Lake */
+--
+2.43.0
+
--- /dev/null
+From 842fadaacc2a864a139182ee8ce33553c0d01319 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 16:41:25 +0100
+Subject: ALSA: hda: Refer to correct stream index at loops
+
+From: Takashi Iwai <tiwai@suse.de>
+
+[ Upstream commit 26257869672fd4a06a60c2da841e15fb2cb47bbe ]
+
+In a couple of loops over the all streams, we check the bitmap against
+the loop counter. A more correct reference would be, however, the
+index of each stream, instead.
+
+This patch corrects the check of bitmaps to the stream index.
+
+Note that this change doesn't fix anything for now; all existing
+drivers set up the stream indices properly, hence the loop count is
+always equal with the stream index. That said, this change is only
+for consistency.
+
+Link: https://lore.kernel.org/r/20231121154125.4888-1-tiwai@suse.de
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/hda/hdac_stream.c | 9 +++------
+ 1 file changed, 3 insertions(+), 6 deletions(-)
+
+diff --git a/sound/hda/hdac_stream.c b/sound/hda/hdac_stream.c
+index 6ce24e248f8e..610ea7a33cd8 100644
+--- a/sound/hda/hdac_stream.c
++++ b/sound/hda/hdac_stream.c
+@@ -671,17 +671,15 @@ void snd_hdac_stream_timecounter_init(struct hdac_stream *azx_dev,
+ struct hdac_stream *s;
+ bool inited = false;
+ u64 cycle_last = 0;
+- int i = 0;
+
+ list_for_each_entry(s, &bus->stream_list, list) {
+- if (streams & (1 << i)) {
++ if ((streams & (1 << s->index))) {
+ azx_timecounter_init(s, inited, cycle_last);
+ if (!inited) {
+ inited = true;
+ cycle_last = s->tc.cycle_last;
+ }
+ }
+- i++;
+ }
+
+ snd_pcm_gettime(runtime, &runtime->trigger_tstamp);
+@@ -726,14 +724,13 @@ void snd_hdac_stream_sync(struct hdac_stream *azx_dev, bool start,
+ unsigned int streams)
+ {
+ struct hdac_bus *bus = azx_dev->bus;
+- int i, nwait, timeout;
++ int nwait, timeout;
+ struct hdac_stream *s;
+
+ for (timeout = 5000; timeout; timeout--) {
+ nwait = 0;
+- i = 0;
+ list_for_each_entry(s, &bus->stream_list, list) {
+- if (!(streams & (1 << i++)))
++ if (!(streams & (1 << s->index)))
+ continue;
+
+ if (start) {
+--
+2.43.0
+
--- /dev/null
+From 2e78a744db53c1d00b297ed1feee0ff504ad3197 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 8 Nov 2023 13:58:29 +0100
+Subject: arch: consolidate arch_irq_work_raise prototypes
+
+From: Arnd Bergmann <arnd@arndb.de>
+
+[ Upstream commit 64bac5ea17d527872121adddfee869c7a0618f8f ]
+
+The prototype was hidden in an #ifdef on x86, which causes a warning:
+
+kernel/irq_work.c:72:13: error: no previous prototype for 'arch_irq_work_raise' [-Werror=missing-prototypes]
+
+Some architectures have a working prototype, while others don't.
+Fix this by providing it in only one place that is always visible.
+
+Reviewed-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Acked-by: Catalin Marinas <catalin.marinas@arm.com>
+Acked-by: Palmer Dabbelt <palmer@rivosinc.com>
+Acked-by: Guo Ren <guoren@kernel.org>
+Signed-off-by: Arnd Bergmann <arnd@arndb.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/include/asm/irq_work.h | 2 --
+ arch/arm64/include/asm/irq_work.h | 2 --
+ arch/csky/include/asm/irq_work.h | 2 +-
+ arch/powerpc/include/asm/irq_work.h | 1 -
+ arch/riscv/include/asm/irq_work.h | 2 +-
+ arch/s390/include/asm/irq_work.h | 2 --
+ arch/x86/include/asm/irq_work.h | 1 -
+ include/linux/irq_work.h | 3 +++
+ 8 files changed, 5 insertions(+), 10 deletions(-)
+
+diff --git a/arch/arm/include/asm/irq_work.h b/arch/arm/include/asm/irq_work.h
+index 3149e4dc1b54..8895999834cc 100644
+--- a/arch/arm/include/asm/irq_work.h
++++ b/arch/arm/include/asm/irq_work.h
+@@ -9,6 +9,4 @@ static inline bool arch_irq_work_has_interrupt(void)
+ return is_smp();
+ }
+
+-extern void arch_irq_work_raise(void);
+-
+ #endif /* _ASM_ARM_IRQ_WORK_H */
+diff --git a/arch/arm64/include/asm/irq_work.h b/arch/arm64/include/asm/irq_work.h
+index 81bbfa3a035b..a1020285ea75 100644
+--- a/arch/arm64/include/asm/irq_work.h
++++ b/arch/arm64/include/asm/irq_work.h
+@@ -2,8 +2,6 @@
+ #ifndef __ASM_IRQ_WORK_H
+ #define __ASM_IRQ_WORK_H
+
+-extern void arch_irq_work_raise(void);
+-
+ static inline bool arch_irq_work_has_interrupt(void)
+ {
+ return true;
+diff --git a/arch/csky/include/asm/irq_work.h b/arch/csky/include/asm/irq_work.h
+index 33aaf39d6f94..d39fcc1f5395 100644
+--- a/arch/csky/include/asm/irq_work.h
++++ b/arch/csky/include/asm/irq_work.h
+@@ -7,5 +7,5 @@ static inline bool arch_irq_work_has_interrupt(void)
+ {
+ return true;
+ }
+-extern void arch_irq_work_raise(void);
++
+ #endif /* __ASM_CSKY_IRQ_WORK_H */
+diff --git a/arch/powerpc/include/asm/irq_work.h b/arch/powerpc/include/asm/irq_work.h
+index b8b0be8f1a07..c6d3078bd8c3 100644
+--- a/arch/powerpc/include/asm/irq_work.h
++++ b/arch/powerpc/include/asm/irq_work.h
+@@ -6,6 +6,5 @@ static inline bool arch_irq_work_has_interrupt(void)
+ {
+ return true;
+ }
+-extern void arch_irq_work_raise(void);
+
+ #endif /* _ASM_POWERPC_IRQ_WORK_H */
+diff --git a/arch/riscv/include/asm/irq_work.h b/arch/riscv/include/asm/irq_work.h
+index b53891964ae0..b27a4d64fc6a 100644
+--- a/arch/riscv/include/asm/irq_work.h
++++ b/arch/riscv/include/asm/irq_work.h
+@@ -6,5 +6,5 @@ static inline bool arch_irq_work_has_interrupt(void)
+ {
+ return IS_ENABLED(CONFIG_SMP);
+ }
+-extern void arch_irq_work_raise(void);
++
+ #endif /* _ASM_RISCV_IRQ_WORK_H */
+diff --git a/arch/s390/include/asm/irq_work.h b/arch/s390/include/asm/irq_work.h
+index 603783766d0a..f00c9f610d5a 100644
+--- a/arch/s390/include/asm/irq_work.h
++++ b/arch/s390/include/asm/irq_work.h
+@@ -7,6 +7,4 @@ static inline bool arch_irq_work_has_interrupt(void)
+ return true;
+ }
+
+-void arch_irq_work_raise(void);
+-
+ #endif /* _ASM_S390_IRQ_WORK_H */
+diff --git a/arch/x86/include/asm/irq_work.h b/arch/x86/include/asm/irq_work.h
+index 800ffce0db29..6b4d36c95165 100644
+--- a/arch/x86/include/asm/irq_work.h
++++ b/arch/x86/include/asm/irq_work.h
+@@ -9,7 +9,6 @@ static inline bool arch_irq_work_has_interrupt(void)
+ {
+ return boot_cpu_has(X86_FEATURE_APIC);
+ }
+-extern void arch_irq_work_raise(void);
+ #else
+ static inline bool arch_irq_work_has_interrupt(void)
+ {
+diff --git a/include/linux/irq_work.h b/include/linux/irq_work.h
+index 8cd11a223260..136f2980cba3 100644
+--- a/include/linux/irq_work.h
++++ b/include/linux/irq_work.h
+@@ -66,6 +66,9 @@ void irq_work_sync(struct irq_work *work);
+ void irq_work_run(void);
+ bool irq_work_needs_cpu(void);
+ void irq_work_single(void *arg);
++
++void arch_irq_work_raise(void);
++
+ #else
+ static inline bool irq_work_needs_cpu(void) { return false; }
+ static inline void irq_work_run(void) { }
+--
+2.43.0
+
--- /dev/null
+From dc71ab4ddbb6a921ca240f541750744752c1550b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 8 Nov 2023 13:58:30 +0100
+Subject: arch: fix asm-offsets.c building with -Wmissing-prototypes
+
+From: Arnd Bergmann <arnd@arndb.de>
+
+[ Upstream commit 4d86896793dd6eeacdf32b85af1ef130349db4be ]
+
+When -Wmissing-prototypes is enabled, the some asm-offsets.c files fail
+to build, even when this warning is disabled in the Makefile for normal
+files:
+
+arch/sparc/kernel/asm-offsets.c:22:5: error: no previous prototype for 'sparc32_foo' [-Werror=missing-prototypes]
+arch/sparc/kernel/asm-offsets.c:48:5: error: no previous prototype for 'foo' [-Werror=missing-prototypes]
+
+Address this by making use of the same trick as x86, marking these
+functions as 'static __used' to avoid the need for a prototype
+by not drop them in dead-code elimination.
+
+Suggested-by: Masahiro Yamada <masahiroy@kernel.org>
+Reviewed-by: Sam Ravnborg <sam@ravnborg.org>
+Link: https://lore.kernel.org/lkml/CAK7LNARfEmFk0Du4Hed19eX_G6tUC5wG0zP+L1AyvdpOF4ybXQ@mail.gmail.com/
+Signed-off-by: Arnd Bergmann <arnd@arndb.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/alpha/kernel/asm-offsets.c | 2 +-
+ arch/loongarch/kernel/asm-offsets.c | 26 +++++++++++++-------------
+ arch/sparc/kernel/asm-offsets.c | 6 +++---
+ 3 files changed, 17 insertions(+), 17 deletions(-)
+
+diff --git a/arch/alpha/kernel/asm-offsets.c b/arch/alpha/kernel/asm-offsets.c
+index b121294bee26..bf1eedd27cf7 100644
+--- a/arch/alpha/kernel/asm-offsets.c
++++ b/arch/alpha/kernel/asm-offsets.c
+@@ -12,7 +12,7 @@
+ #include <linux/kbuild.h>
+ #include <asm/io.h>
+
+-void foo(void)
++static void __used foo(void)
+ {
+ DEFINE(TI_TASK, offsetof(struct thread_info, task));
+ DEFINE(TI_FLAGS, offsetof(struct thread_info, flags));
+diff --git a/arch/loongarch/kernel/asm-offsets.c b/arch/loongarch/kernel/asm-offsets.c
+index 173fe514fc9e..bee9f7a3108f 100644
+--- a/arch/loongarch/kernel/asm-offsets.c
++++ b/arch/loongarch/kernel/asm-offsets.c
+@@ -15,7 +15,7 @@
+ #include <asm/processor.h>
+ #include <asm/ftrace.h>
+
+-void output_ptreg_defines(void)
++static void __used output_ptreg_defines(void)
+ {
+ COMMENT("LoongArch pt_regs offsets.");
+ OFFSET(PT_R0, pt_regs, regs[0]);
+@@ -62,7 +62,7 @@ void output_ptreg_defines(void)
+ BLANK();
+ }
+
+-void output_task_defines(void)
++static void __used output_task_defines(void)
+ {
+ COMMENT("LoongArch task_struct offsets.");
+ OFFSET(TASK_STATE, task_struct, __state);
+@@ -77,7 +77,7 @@ void output_task_defines(void)
+ BLANK();
+ }
+
+-void output_thread_info_defines(void)
++static void __used output_thread_info_defines(void)
+ {
+ COMMENT("LoongArch thread_info offsets.");
+ OFFSET(TI_TASK, thread_info, task);
+@@ -93,7 +93,7 @@ void output_thread_info_defines(void)
+ BLANK();
+ }
+
+-void output_thread_defines(void)
++static void __used output_thread_defines(void)
+ {
+ COMMENT("LoongArch specific thread_struct offsets.");
+ OFFSET(THREAD_REG01, task_struct, thread.reg01);
+@@ -129,7 +129,7 @@ void output_thread_defines(void)
+ BLANK();
+ }
+
+-void output_thread_fpu_defines(void)
++static void __used output_thread_fpu_defines(void)
+ {
+ OFFSET(THREAD_FPR0, loongarch_fpu, fpr[0]);
+ OFFSET(THREAD_FPR1, loongarch_fpu, fpr[1]);
+@@ -170,7 +170,7 @@ void output_thread_fpu_defines(void)
+ BLANK();
+ }
+
+-void output_thread_lbt_defines(void)
++static void __used output_thread_lbt_defines(void)
+ {
+ OFFSET(THREAD_SCR0, loongarch_lbt, scr0);
+ OFFSET(THREAD_SCR1, loongarch_lbt, scr1);
+@@ -180,7 +180,7 @@ void output_thread_lbt_defines(void)
+ BLANK();
+ }
+
+-void output_mm_defines(void)
++static void __used output_mm_defines(void)
+ {
+ COMMENT("Size of struct page");
+ DEFINE(STRUCT_PAGE_SIZE, sizeof(struct page));
+@@ -212,7 +212,7 @@ void output_mm_defines(void)
+ BLANK();
+ }
+
+-void output_sc_defines(void)
++static void __used output_sc_defines(void)
+ {
+ COMMENT("Linux sigcontext offsets.");
+ OFFSET(SC_REGS, sigcontext, sc_regs);
+@@ -220,7 +220,7 @@ void output_sc_defines(void)
+ BLANK();
+ }
+
+-void output_signal_defines(void)
++static void __used output_signal_defines(void)
+ {
+ COMMENT("Linux signal numbers.");
+ DEFINE(_SIGHUP, SIGHUP);
+@@ -258,7 +258,7 @@ void output_signal_defines(void)
+ }
+
+ #ifdef CONFIG_SMP
+-void output_smpboot_defines(void)
++static void __used output_smpboot_defines(void)
+ {
+ COMMENT("Linux smp cpu boot offsets.");
+ OFFSET(CPU_BOOT_STACK, secondary_data, stack);
+@@ -268,7 +268,7 @@ void output_smpboot_defines(void)
+ #endif
+
+ #ifdef CONFIG_HIBERNATION
+-void output_pbe_defines(void)
++static void __used output_pbe_defines(void)
+ {
+ COMMENT("Linux struct pbe offsets.");
+ OFFSET(PBE_ADDRESS, pbe, address);
+@@ -280,7 +280,7 @@ void output_pbe_defines(void)
+ #endif
+
+ #ifdef CONFIG_FUNCTION_GRAPH_TRACER
+-void output_fgraph_ret_regs_defines(void)
++static void __used output_fgraph_ret_regs_defines(void)
+ {
+ COMMENT("LoongArch fgraph_ret_regs offsets.");
+ OFFSET(FGRET_REGS_A0, fgraph_ret_regs, regs[0]);
+@@ -291,7 +291,7 @@ void output_fgraph_ret_regs_defines(void)
+ }
+ #endif
+
+-void output_kvm_defines(void)
++static void __used output_kvm_defines(void)
+ {
+ COMMENT("KVM/LoongArch Specific offsets.");
+
+diff --git a/arch/sparc/kernel/asm-offsets.c b/arch/sparc/kernel/asm-offsets.c
+index 5784f2df489a..3d9b9855dce9 100644
+--- a/arch/sparc/kernel/asm-offsets.c
++++ b/arch/sparc/kernel/asm-offsets.c
+@@ -19,14 +19,14 @@
+ #include <asm/hibernate.h>
+
+ #ifdef CONFIG_SPARC32
+-int sparc32_foo(void)
++static int __used sparc32_foo(void)
+ {
+ DEFINE(AOFF_thread_fork_kpsr,
+ offsetof(struct thread_struct, fork_kpsr));
+ return 0;
+ }
+ #else
+-int sparc64_foo(void)
++static int __used sparc64_foo(void)
+ {
+ #ifdef CONFIG_HIBERNATION
+ BLANK();
+@@ -45,7 +45,7 @@ int sparc64_foo(void)
+ }
+ #endif
+
+-int foo(void)
++static int __used foo(void)
+ {
+ BLANK();
+ DEFINE(AOFF_task_thread, offsetof(struct task_struct, thread));
+--
+2.43.0
+
--- /dev/null
+From 88865c9b1c103e3281326088d0a4a2ff69f8109b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:36:05 -0300
+Subject: ARM: dts: imx: Use flash@0,0 pattern
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 1e1d7cc478fb16816de09740e3c323c0c188d58f ]
+
+Per mtd-physmap.yaml, 'nor@0,0' is not a valid node pattern.
+
+Change it to 'flash@0,0' to fix the following dt-schema warning:
+
+imx1-ads.dtb: nor@0,0: $nodename:0: 'nor@0,0' does not match '^(flash|.*sram|nand)(@.*)?$'
+ from schema $id: http://devicetree.org/schemas/mtd/mtd-physmap.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx1-ads.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx1-apf9328.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-som.dtsi | 2 +-
+ 4 files changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx1-ads.dts b/arch/arm/boot/dts/nxp/imx/imx1-ads.dts
+index 5833fb6f15d8..2c817c4a4c68 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx1-ads.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx1-ads.dts
+@@ -65,7 +65,7 @@
+ pinctrl-0 = <&pinctrl_weim>;
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ compatible = "cfi-flash";
+ reg = <0 0x00000000 0x02000000>;
+ bank-width = <4>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx1-apf9328.dts b/arch/arm/boot/dts/nxp/imx/imx1-apf9328.dts
+index 1f11e9542a72..e66eef87a7a4 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx1-apf9328.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx1-apf9328.dts
+@@ -45,7 +45,7 @@
+ pinctrl-0 = <&pinctrl_weim>;
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ compatible = "cfi-flash";
+ reg = <0 0x00000000 0x02000000>;
+ bank-width = <2>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi b/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi
+index 4b83e2918b55..c7e923584878 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi
+@@ -90,7 +90,7 @@
+ &weim {
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "cfi-flash";
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-som.dtsi b/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-som.dtsi
+index 7b2ea4cdae58..8d428c844666 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-som.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-som.dtsi
+@@ -314,7 +314,7 @@
+ &weim {
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ compatible = "cfi-flash";
+ reg = <0 0x00000000 0x02000000>;
+ bank-width = <2>;
+--
+2.43.0
+
--- /dev/null
+From 18b45b2f36bfd3bdd0b87220aacf3a125faa3ef8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:39:21 -0300
+Subject: ARM: dts: imx1: Fix sram node
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit c248e535973088ba7071ff6f26ab7951143450af ]
+
+Per sram.yaml, address-cells, size-cells and ranges are mandatory.
+
+The node name should be sram.
+
+Change the node name and pass the required properties to fix the
+following dt-schema warnings:
+
+imx1-apf9328.dtb: esram@300000: $nodename:0: 'esram@300000' does not match '^sram(@.*)?'
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+imx1-apf9328.dtb: esram@300000: '#address-cells' is a required property
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+imx1-apf9328.dtb: esram@300000: '#size-cells' is a required property
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+imx1-apf9328.dtb: esram@300000: 'ranges' is a required property
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx1.dtsi | 5 ++++-
+ 1 file changed, 4 insertions(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx1.dtsi b/arch/arm/boot/dts/nxp/imx/imx1.dtsi
+index e312f1e74e2f..4aeb74479f44 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx1.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx1.dtsi
+@@ -268,9 +268,12 @@
+ status = "disabled";
+ };
+
+- esram: esram@300000 {
++ esram: sram@300000 {
+ compatible = "mmio-sram";
+ reg = <0x00300000 0x20000>;
++ ranges = <0 0x00300000 0x20000>;
++ #address-cells = <1>;
++ #size-cells = <1>;
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From e005fbcd52067d330d56e77fc862f537cbbf1afa Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 07:26:31 -0300
+Subject: ARM: dts: imx23/28: Fix the DMA controller node name
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 858d83ca4b50bbc8693d95cc94310e6d791fb2e6 ]
+
+Per fsl,mxs-dma.yaml, the node name should be 'dma-controller'.
+
+Change it to fix the following dt-schema warning.
+
+imx28-apf28.dtb: dma-apbx@80024000: $nodename:0: 'dma-apbx@80024000' does not match '^dma-controller(@.*)?$'
+ from schema $id: http://devicetree.org/schemas/dma/fsl,mxs-dma.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/mxs/imx23.dtsi | 2 +-
+ arch/arm/boot/dts/nxp/mxs/imx28.dtsi | 2 +-
+ 2 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/arch/arm/boot/dts/nxp/mxs/imx23.dtsi b/arch/arm/boot/dts/nxp/mxs/imx23.dtsi
+index fdf18b7cb2f6..9cba1d0224f4 100644
+--- a/arch/arm/boot/dts/nxp/mxs/imx23.dtsi
++++ b/arch/arm/boot/dts/nxp/mxs/imx23.dtsi
+@@ -412,7 +412,7 @@
+ status = "disabled";
+ };
+
+- dma_apbx: dma-apbx@80024000 {
++ dma_apbx: dma-controller@80024000 {
+ compatible = "fsl,imx23-dma-apbx";
+ reg = <0x80024000 0x2000>;
+ interrupts = <7>, <5>, <9>, <26>,
+diff --git a/arch/arm/boot/dts/nxp/mxs/imx28.dtsi b/arch/arm/boot/dts/nxp/mxs/imx28.dtsi
+index 6932d23fb29d..37b9d409a5cd 100644
+--- a/arch/arm/boot/dts/nxp/mxs/imx28.dtsi
++++ b/arch/arm/boot/dts/nxp/mxs/imx28.dtsi
+@@ -990,7 +990,7 @@
+ status = "disabled";
+ };
+
+- dma_apbx: dma-apbx@80024000 {
++ dma_apbx: dma-controller@80024000 {
+ compatible = "fsl,imx28-dma-apbx";
+ reg = <0x80024000 0x2000>;
+ interrupts = <78>, <79>, <66>, <0>,
+--
+2.43.0
+
--- /dev/null
+From 1536724d17459438dab348d14caa984c68b5aba7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 07:12:12 -0300
+Subject: ARM: dts: imx23-sansa: Use preferred i2c-gpios properties
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit e3aa1a82fb20ee97597022f6528823a8ab82bde6 ]
+
+The 'gpios' property to describe the SDA and SCL GPIOs is considered
+deprecated according to i2c-gpio.yaml.
+
+Switch to the preferred 'sda-gpios' and 'scl-gpios' properties.
+
+This fixes the following schema warnings:
+
+imx23-sansa.dtb: i2c-0: 'sda-gpios' is a required property
+ from schema $id: http://devicetree.org/schemas/i2c/i2c-gpio.yaml#
+imx23-sansa.dtb: i2c-0: 'scl-gpios' is a required property
+ from schema $id: http://devicetree.org/schemas/i2c/i2c-gpio.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/mxs/imx23-sansa.dts | 12 ++++--------
+ 1 file changed, 4 insertions(+), 8 deletions(-)
+
+diff --git a/arch/arm/boot/dts/nxp/mxs/imx23-sansa.dts b/arch/arm/boot/dts/nxp/mxs/imx23-sansa.dts
+index 636cf09a2b37..b23e7ada9c80 100644
+--- a/arch/arm/boot/dts/nxp/mxs/imx23-sansa.dts
++++ b/arch/arm/boot/dts/nxp/mxs/imx23-sansa.dts
+@@ -175,10 +175,8 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+ compatible = "i2c-gpio";
+- gpios = <
+- &gpio1 24 0 /* SDA */
+- &gpio1 22 0 /* SCL */
+- >;
++ sda-gpios = <&gpio1 24 0>;
++ scl-gpios = <&gpio1 22 0>;
+ i2c-gpio,delay-us = <2>; /* ~100 kHz */
+ };
+
+@@ -186,10 +184,8 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+ compatible = "i2c-gpio";
+- gpios = <
+- &gpio0 31 0 /* SDA */
+- &gpio0 30 0 /* SCL */
+- >;
++ sda-gpios = <&gpio0 31 0>;
++ scl-gpios = <&gpio0 30 0>;
+ i2c-gpio,delay-us = <2>; /* ~100 kHz */
+
+ touch: touch@20 {
+--
+2.43.0
+
--- /dev/null
+From dd5fe451a265b98f70ddbc4d940ff6a1999581d2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 08:58:26 -0300
+Subject: ARM: dts: imx25/27-eukrea: Fix RTC node name
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 68c711b882c262e36895547cddea2c2d56ce611d ]
+
+Node names should be generic. Use 'rtc' as node name to fix
+the following dt-schema warning:
+
+imx25-eukrea-mbimxsd25-baseboard.dtb: pcf8563@51: $nodename:0: 'pcf8563@51' does not match '^rtc(@.*|-([0-9]|[1-9][0-9]+))?$'
+ from schema $id: http://devicetree.org/schemas/rtc/nxp,pcf8563.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx25-eukrea-cpuimx25.dtsi | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi | 2 +-
+ 2 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-cpuimx25.dtsi b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-cpuimx25.dtsi
+index 0703f62d10d1..93a6e4e680b4 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-cpuimx25.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-cpuimx25.dtsi
+@@ -27,7 +27,7 @@
+ pinctrl-0 = <&pinctrl_i2c1>;
+ status = "okay";
+
+- pcf8563@51 {
++ rtc@51 {
+ compatible = "nxp,pcf8563";
+ reg = <0x51>;
+ };
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi b/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi
+index 74110bbcd9d4..4b83e2918b55 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx27-eukrea-cpuimx27.dtsi
+@@ -33,7 +33,7 @@
+ pinctrl-0 = <&pinctrl_i2c1>;
+ status = "okay";
+
+- pcf8563@51 {
++ rtc@51 {
+ compatible = "nxp,pcf8563";
+ reg = <0x51>;
+ };
+--
+2.43.0
+
--- /dev/null
+From 9ac2b943d2aa2ff39f9ebcc67bdaea662fa9d47b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:14:05 -0300
+Subject: ARM: dts: imx25/27: Pass timing0
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 11ab7ad6f795ae23c398a4a5c56505d3dab27c4c ]
+
+Per display-timings.yaml, the 'timing' pattern should be used to
+describe the display timings.
+
+Change it accordingly to fix the following dt-schema warning:
+
+imx27-apf27dev.dtb: display-timings: '800x480' does not match any of the regexes: '^timing', 'pinctrl-[0-9]+'
+ from schema $id: http://devicetree.org/schemas/display/panel/display-timings.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts | 2 +-
+ .../dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts | 2 +-
+ .../dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx25-pdk.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-eukrea-mbimxsd27-baseboard.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-phytec-phycard-s-rdk.dts | 2 +-
+ arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-rdk.dts | 2 +-
+ 8 files changed, 8 insertions(+), 8 deletions(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts
+index fc8a502fc957..6cddb2cc36fe 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts
+@@ -16,7 +16,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&qvga_timings>;
+- qvga_timings: 320x240 {
++ qvga_timings: timing0 {
+ clock-frequency = <6500000>;
+ hactive = <320>;
+ vactive = <240>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts
+index 80a7f96de4c6..64b2ffac463b 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts
+@@ -16,7 +16,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&dvi_svga_timings>;
+- dvi_svga_timings: 800x600 {
++ dvi_svga_timings: timing0 {
+ clock-frequency = <40000000>;
+ hactive = <800>;
+ vactive = <600>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts
+index 24027a1fb46d..fb074bfdaa8d 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts
+@@ -16,7 +16,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&dvi_vga_timings>;
+- dvi_vga_timings: 640x480 {
++ dvi_vga_timings: timing0 {
+ clock-frequency = <31250000>;
+ hactive = <640>;
+ vactive = <480>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx25-pdk.dts b/arch/arm/boot/dts/nxp/imx/imx25-pdk.dts
+index 04f4b127a172..e93bf3b7115f 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx25-pdk.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx25-pdk.dts
+@@ -68,7 +68,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&wvga_timings>;
+- wvga_timings: 640x480 {
++ wvga_timings: timing0 {
+ hactive = <640>;
+ vactive = <480>;
+ hback-porch = <45>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts b/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts
+index a21f1f7c24b8..f047a8487073 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts
+@@ -16,7 +16,7 @@
+ fsl,pcr = <0xfae80083>; /* non-standard but required */
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 800x480 {
++ timing0: timing0 {
+ clock-frequency = <33000033>;
+ hactive = <800>;
+ vactive = <480>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-eukrea-mbimxsd27-baseboard.dts b/arch/arm/boot/dts/nxp/imx/imx27-eukrea-mbimxsd27-baseboard.dts
+index 145e459625b3..d78793601306 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-eukrea-mbimxsd27-baseboard.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx27-eukrea-mbimxsd27-baseboard.dts
+@@ -16,7 +16,7 @@
+
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 320x240 {
++ timing0: timing0 {
+ clock-frequency = <6500000>;
+ hactive = <320>;
+ vactive = <240>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycard-s-rdk.dts b/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycard-s-rdk.dts
+index 25442eba21c1..27c93b9fe049 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycard-s-rdk.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycard-s-rdk.dts
+@@ -19,7 +19,7 @@
+ fsl,pcr = <0xf0c88080>; /* non-standard but required */
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 640x480 {
++ timing0: timing0 {
+ hactive = <640>;
+ vactive = <480>;
+ hback-porch = <112>;
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-rdk.dts b/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-rdk.dts
+index 7f0cd4d3ec2d..67b235044b70 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-rdk.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx27-phytec-phycore-rdk.dts
+@@ -19,7 +19,7 @@
+
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 240x320 {
++ timing0: timing0 {
+ clock-frequency = <5500000>;
+ hactive = <240>;
+ vactive = <320>;
+--
+2.43.0
+
--- /dev/null
+From d1ba9e0f7565f424ad4e0cc08d113dcdd5d1326c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:00:33 -0300
+Subject: ARM: dts: imx25: Fix the iim compatible string
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit f0b929f58719fc57a4926ab4fc972f185453d6a5 ]
+
+Per imx-iim.yaml, the compatible string should only contain a single
+entry.
+
+Use it as "fsl,imx25-iim" to fix the following dt-schema warning:
+
+imx25-karo-tx25.dtb: efuse@53ff0000: compatible: ['fsl,imx25-iim', 'fsl,imx27-iim'] is too long
+ from schema $id: http://devicetree.org/schemas/nvmem/imx-iim.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx25.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx25.dtsi b/arch/arm/boot/dts/nxp/imx/imx25.dtsi
+index 534c70b8d79d..f65c7234f9e7 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx25.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx25.dtsi
+@@ -542,7 +542,7 @@
+ };
+
+ iim: efuse@53ff0000 {
+- compatible = "fsl,imx25-iim", "fsl,imx27-iim";
++ compatible = "fsl,imx25-iim";
+ reg = <0x53ff0000 0x4000>;
+ interrupts = <19>;
+ clocks = <&clks 99>;
+--
+2.43.0
+
--- /dev/null
+From 4b64b5668529d627f55149a42863d05bf7dcdc19 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:19:05 -0300
+Subject: ARM: dts: imx27-apf27dev: Fix LED name
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit dc35e253d032b959d92e12f081db5b00db26ae64 ]
+
+Per leds-gpio.yaml, the led names should start with 'led'.
+
+Change it to fix the following dt-schema warning:
+
+imx27-apf27dev.dtb: leds: 'user' does not match any of the regexes: '(^led-[0-9a-f]$|led)', 'pinctrl-[0-9]+'
+ from schema $id: http://devicetree.org/schemas/leds/leds-gpio.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts b/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts
+index f047a8487073..849306cb4532 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts
++++ b/arch/arm/boot/dts/nxp/imx/imx27-apf27dev.dts
+@@ -47,7 +47,7 @@
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_gpio_leds>;
+
+- user {
++ led-user {
+ label = "Heartbeat";
+ gpios = <&gpio6 14 GPIO_ACTIVE_HIGH>;
+ linux,default-trigger = "heartbeat";
+--
+2.43.0
+
--- /dev/null
+From fcb6794416f8a9b05f2b486ad4237e86c2287114 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:39:20 -0300
+Subject: ARM: dts: imx27: Fix sram node
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 2fb7b2a2f06bb3f8321cf26c33e4e820c5b238b6 ]
+
+Per sram.yaml, address-cells, size-cells and ranges are mandatory.
+
+Pass them to fix the following dt-schema warnings:
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx27.dtsi | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx27.dtsi b/arch/arm/boot/dts/nxp/imx/imx27.dtsi
+index faba12ee7465..cac4b3d68986 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx27.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx27.dtsi
+@@ -588,6 +588,9 @@
+ iram: sram@ffff4c00 {
+ compatible = "mmio-sram";
+ reg = <0xffff4c00 0xb400>;
++ ranges = <0 0xffff4c00 0xb400>;
++ #address-cells = <1>;
++ #size-cells = <1>;
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From 7163d0e56d8abe3e37baeb33885e241412d613b3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 10:15:53 +0200
+Subject: ARM: dts: imx7d: Fix coresight funnel ports
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 0d4ac04fa7c3f6dc263dba6f575a2ec7a2d4eca8 ]
+
+imx7d uses two ports for 'in-ports', so the syntax port@<num> has to
+be used. imx7d has both port and port@1 nodes present, raising these
+error:
+funnel@30041000: in-ports: More than one condition true in oneOf schema
+funnel@30041000: Unevaluated properties are not allowed
+('in-ports' was unexpected)
+
+Fix this by also using port@0 for imx7s as well.
+
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx7d.dtsi | 3 ---
+ arch/arm/boot/dts/nxp/imx/imx7s.dtsi | 6 +++++-
+ 2 files changed, 5 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx7d.dtsi b/arch/arm/boot/dts/nxp/imx/imx7d.dtsi
+index 4b94b8afb55d..0484e349e064 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx7d.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx7d.dtsi
+@@ -217,9 +217,6 @@
+ };
+
+ &ca_funnel_in_ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+-
+ port@1 {
+ reg = <1>;
+ ca_funnel_in_port1: endpoint {
+diff --git a/arch/arm/boot/dts/nxp/imx/imx7s.dtsi b/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
+index 5387da8a2a0a..9f216d11a396 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
+@@ -190,7 +190,11 @@
+ clock-names = "apb_pclk";
+
+ ca_funnel_in_ports: in-ports {
+- port {
++ #address-cells = <1>;
++ #size-cells = <0>;
++
++ port@0 {
++ reg = <0>;
+ ca_funnel_in_port0: endpoint {
+ remote-endpoint = <&etm0_out_port>;
+ };
+--
+2.43.0
+
--- /dev/null
+From e5603718663674da78045218a7286ff60b89de25 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 10:15:54 +0200
+Subject: ARM: dts: imx7s: Fix lcdif compatible
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 5f55da4cc37051cda600ea870ce8cf29f1297715 ]
+
+imx7d-lcdif is compatible to imx6sx-lcdif. MXSFB_V6 supports overlay
+by using LCDC_AS_CTRL register. This registers used by overlay plane:
+* LCDC_AS_CTRL
+* LCDC_AS_BUF
+* LCDC_AS_NEXT_BUF
+are listed in i.MX7D RM as well.
+
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx7s.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx7s.dtsi b/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
+index 9f216d11a396..3bd33255266e 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
+@@ -815,7 +815,7 @@
+ };
+
+ lcdif: lcdif@30730000 {
+- compatible = "fsl,imx7d-lcdif", "fsl,imx28-lcdif";
++ compatible = "fsl,imx7d-lcdif", "fsl,imx6sx-lcdif";
+ reg = <0x30730000 0x10000>;
+ interrupts = <GIC_SPI 5 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clks IMX7D_LCDIF_PIXEL_ROOT_CLK>,
+--
+2.43.0
+
--- /dev/null
+From 0b63ee406643780efcd38ee150898ed3c2162a4f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 10:15:55 +0200
+Subject: ARM: dts: imx7s: Fix nand-controller #size-cells
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 4aadb841ed49bada1415c48c44d21f5b69e01299 ]
+
+nand-controller.yaml bindings says #size-cells shall be set to 0.
+Fixes the dtbs_check warning:
+arch/arm/boot/dts/nxp/imx/imx7s-mba7.dtb: nand-controller@33002000:
+ #size-cells:0:0: 0 was expected
+ from schema $id: http://devicetree.org/schemas/mtd/gpmi-nand.yaml#
+
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/nxp/imx/imx7s.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/nxp/imx/imx7s.dtsi b/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
+index 3bd33255266e..4569d2b8edef 100644
+--- a/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
++++ b/arch/arm/boot/dts/nxp/imx/imx7s.dtsi
+@@ -1279,7 +1279,7 @@
+ gpmi: nand-controller@33002000 {
+ compatible = "fsl,imx7d-gpmi-nand";
+ #address-cells = <1>;
+- #size-cells = <1>;
++ #size-cells = <0>;
+ reg = <0x33002000 0x2000>, <0x33004000 0x4000>;
+ reg-names = "gpmi-nand", "bch";
+ interrupts = <GIC_SPI 14 IRQ_TYPE_LEVEL_HIGH>;
+--
+2.43.0
+
--- /dev/null
+From 611158ac6a3a2b587f308e6905fb3818da0b56b6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 27 Nov 2023 16:51:00 +0100
+Subject: ARM: dts: marvell: Fix some common switch mistakes
+
+From: Linus Walleij <linus.walleij@linaro.org>
+
+[ Upstream commit 6e75ac5a824e1551764cd4bfce5ede3d5fafc407 ]
+
+Fix some errors in the Marvell MV88E6xxx switch descriptions:
+- The top node had no address size or cells.
+- switch0@0 is not OK, should be ethernet-switch@0.
+- The ports node should be named ethernet-ports
+- The ethernet-ports node should have port@0 etc children, no
+ plural "ports" in the children.
+- Ports should be named ethernet-port@0 etc
+- PHYs should be named ethernet-phy@0 etc
+
+This serves as an example of fixes needed for introducing a
+schema for the bindings, but the patch can simply be applied.
+
+Reviewed-by: Andrew Lunn <andrew@lunn.ch>
+Reviewed-by: Florian Fainelli <florian.fainelli@broadcom.com>
+Signed-off-by: Linus Walleij <linus.walleij@linaro.org>
+Signed-off-by: Gregory CLEMENT <gregory.clement@bootlin.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/marvell/armada-370-rd.dts | 24 +++++-----
+ .../marvell/armada-381-netgear-gs110emx.dts | 44 +++++++++----------
+ .../marvell/armada-385-clearfog-gtr-l8.dts | 38 ++++++++--------
+ .../marvell/armada-385-clearfog-gtr-s4.dts | 22 +++++-----
+ .../boot/dts/marvell/armada-385-linksys.dtsi | 18 ++++----
+ .../dts/marvell/armada-385-turris-omnia.dts | 20 ++++-----
+ .../boot/dts/marvell/armada-388-clearfog.dts | 20 ++++-----
+ .../dts/marvell/armada-xp-linksys-mamba.dts | 18 ++++----
+ 8 files changed, 96 insertions(+), 108 deletions(-)
+
+diff --git a/arch/arm/boot/dts/marvell/armada-370-rd.dts b/arch/arm/boot/dts/marvell/armada-370-rd.dts
+index b459a670f615..1b241da11e94 100644
+--- a/arch/arm/boot/dts/marvell/armada-370-rd.dts
++++ b/arch/arm/boot/dts/marvell/armada-370-rd.dts
+@@ -149,39 +149,37 @@
+ };
+ };
+
+- switch: switch@10 {
++ switch: ethernet-switch@10 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <0x10>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@0 {
++ ethernet-port@0 {
+ reg = <0>;
+ label = "lan0";
+ };
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan1";
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan2";
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan3";
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ ethernet = <ð1>;
+ phy-mode = "rgmii-id";
+@@ -196,25 +194,25 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switchphy0: switchphy@0 {
++ switchphy0: ethernet-phy@0 {
+ reg = <0>;
+ interrupt-parent = <&switch>;
+ interrupts = <0 IRQ_TYPE_LEVEL_HIGH>;
+ };
+
+- switchphy1: switchphy@1 {
++ switchphy1: ethernet-phy@1 {
+ reg = <1>;
+ interrupt-parent = <&switch>;
+ interrupts = <1 IRQ_TYPE_LEVEL_HIGH>;
+ };
+
+- switchphy2: switchphy@2 {
++ switchphy2: ethernet-phy@2 {
+ reg = <2>;
+ interrupt-parent = <&switch>;
+ interrupts = <2 IRQ_TYPE_LEVEL_HIGH>;
+ };
+
+- switchphy3: switchphy@3 {
++ switchphy3: ethernet-phy@3 {
+ reg = <3>;
+ interrupt-parent = <&switch>;
+ interrupts = <3 IRQ_TYPE_LEVEL_HIGH>;
+diff --git a/arch/arm/boot/dts/marvell/armada-381-netgear-gs110emx.dts b/arch/arm/boot/dts/marvell/armada-381-netgear-gs110emx.dts
+index f4c4b213ef4e..5baf83e5253d 100644
+--- a/arch/arm/boot/dts/marvell/armada-381-netgear-gs110emx.dts
++++ b/arch/arm/boot/dts/marvell/armada-381-netgear-gs110emx.dts
+@@ -77,51 +77,49 @@
+ pinctrl-0 = <&mdio_pins>;
+ status = "okay";
+
+- switch@0 {
++ ethernet-switch@0 {
+ compatible = "marvell,mv88e6190";
+- #address-cells = <1>;
+ #interrupt-cells = <2>;
+ interrupt-controller;
+ interrupt-parent = <&gpio1>;
+ interrupts = <7 IRQ_TYPE_LEVEL_LOW>;
+ pinctrl-0 = <&switch_interrupt_pins>;
+ pinctrl-names = "default";
+- #size-cells = <0>;
+ reg = <0>;
+
+ mdio {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy1: switch0phy1@1 {
++ switch0phy1: ethernet-phy@1 {
+ reg = <0x1>;
+ };
+
+- switch0phy2: switch0phy2@2 {
++ switch0phy2: ethernet-phy@2 {
+ reg = <0x2>;
+ };
+
+- switch0phy3: switch0phy3@3 {
++ switch0phy3: ethernet-phy@3 {
+ reg = <0x3>;
+ };
+
+- switch0phy4: switch0phy4@4 {
++ switch0phy4: ethernet-phy@4 {
+ reg = <0x4>;
+ };
+
+- switch0phy5: switch0phy5@5 {
++ switch0phy5: ethernet-phy@5 {
+ reg = <0x5>;
+ };
+
+- switch0phy6: switch0phy6@6 {
++ switch0phy6: ethernet-phy@6 {
+ reg = <0x6>;
+ };
+
+- switch0phy7: switch0phy7@7 {
++ switch0phy7: ethernet-phy@7 {
+ reg = <0x7>;
+ };
+
+- switch0phy8: switch0phy8@8 {
++ switch0phy8: ethernet-phy@8 {
+ reg = <0x8>;
+ };
+ };
+@@ -142,11 +140,11 @@
+ };
+ };
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@0 {
++ ethernet-port@0 {
+ ethernet = <ð0>;
+ phy-mode = "rgmii";
+ reg = <0>;
+@@ -158,55 +156,55 @@
+ };
+ };
+
+- port@1 {
++ ethernet-port@1 {
+ label = "lan1";
+ phy-handle = <&switch0phy1>;
+ reg = <1>;
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ label = "lan2";
+ phy-handle = <&switch0phy2>;
+ reg = <2>;
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ label = "lan3";
+ phy-handle = <&switch0phy3>;
+ reg = <3>;
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ label = "lan4";
+ phy-handle = <&switch0phy4>;
+ reg = <4>;
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ label = "lan5";
+ phy-handle = <&switch0phy5>;
+ reg = <5>;
+ };
+
+- port@6 {
++ ethernet-port@6 {
+ label = "lan6";
+ phy-handle = <&switch0phy6>;
+ reg = <6>;
+ };
+
+- port@7 {
++ ethernet-port@7 {
+ label = "lan7";
+ phy-handle = <&switch0phy7>;
+ reg = <7>;
+ };
+
+- port@8 {
++ ethernet-port@8 {
+ label = "lan8";
+ phy-handle = <&switch0phy8>;
+ reg = <8>;
+ };
+
+- port@9 {
++ ethernet-port@9 {
+ /* 88X3310P external phy */
+ label = "lan9";
+ phy-handle = <&phy1>;
+@@ -214,7 +212,7 @@
+ reg = <9>;
+ };
+
+- port@a {
++ ethernet-port@a {
+ /* 88X3310P external phy */
+ label = "lan10";
+ phy-handle = <&phy2>;
+diff --git a/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-l8.dts b/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-l8.dts
+index 1990f7d0cc79..1707d1b01545 100644
+--- a/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-l8.dts
++++ b/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-l8.dts
+@@ -7,66 +7,66 @@
+ };
+
+ &mdio {
+- switch0: switch0@4 {
++ switch0: ethernet-switch@4 {
+ compatible = "marvell,mv88e6190";
+ reg = <4>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&cf_gtr_switch_reset_pins>;
+ reset-gpios = <&gpio0 18 GPIO_ACTIVE_LOW>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan8";
+ phy-handle = <&switch0phy0>;
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan7";
+ phy-handle = <&switch0phy1>;
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan6";
+ phy-handle = <&switch0phy2>;
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "lan5";
+ phy-handle = <&switch0phy3>;
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ label = "lan4";
+ phy-handle = <&switch0phy4>;
+ };
+
+- port@6 {
++ ethernet-port@6 {
+ reg = <6>;
+ label = "lan3";
+ phy-handle = <&switch0phy5>;
+ };
+
+- port@7 {
++ ethernet-port@7 {
+ reg = <7>;
+ label = "lan2";
+ phy-handle = <&switch0phy6>;
+ };
+
+- port@8 {
++ ethernet-port@8 {
+ reg = <8>;
+ label = "lan1";
+ phy-handle = <&switch0phy7>;
+ };
+
+- port@10 {
++ ethernet-port@10 {
+ reg = <10>;
+ phy-mode = "2500base-x";
+
+@@ -83,35 +83,35 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy0: switch0phy0@1 {
++ switch0phy0: ethernet-phy@1 {
+ reg = <0x1>;
+ };
+
+- switch0phy1: switch0phy1@2 {
++ switch0phy1: ethernet-phy@2 {
+ reg = <0x2>;
+ };
+
+- switch0phy2: switch0phy2@3 {
++ switch0phy2: ethernet-phy@3 {
+ reg = <0x3>;
+ };
+
+- switch0phy3: switch0phy3@4 {
++ switch0phy3: ethernet-phy@4 {
+ reg = <0x4>;
+ };
+
+- switch0phy4: switch0phy4@5 {
++ switch0phy4: ethernet-phy@5 {
+ reg = <0x5>;
+ };
+
+- switch0phy5: switch0phy5@6 {
++ switch0phy5: ethernet-phy@6 {
+ reg = <0x6>;
+ };
+
+- switch0phy6: switch0phy6@7 {
++ switch0phy6: ethernet-phy@7 {
+ reg = <0x7>;
+ };
+
+- switch0phy7: switch0phy7@8 {
++ switch0phy7: ethernet-phy@8 {
+ reg = <0x8>;
+ };
+ };
+diff --git a/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-s4.dts b/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-s4.dts
+index b795ad573891..a7678a784c18 100644
+--- a/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-s4.dts
++++ b/arch/arm/boot/dts/marvell/armada-385-clearfog-gtr-s4.dts
+@@ -11,42 +11,42 @@
+ };
+
+ &mdio {
+- switch0: switch0@4 {
++ switch0: ethernet-switch@4 {
+ compatible = "marvell,mv88e6085";
+ reg = <4>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&cf_gtr_switch_reset_pins>;
+ reset-gpios = <&gpio0 18 GPIO_ACTIVE_LOW>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan2";
+ phy-handle = <&switch0phy0>;
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan1";
+ phy-handle = <&switch0phy1>;
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan4";
+ phy-handle = <&switch0phy2>;
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "lan3";
+ phy-handle = <&switch0phy3>;
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ phy-mode = "2500base-x";
+ ethernet = <ð1>;
+@@ -63,19 +63,19 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy0: switch0phy0@11 {
++ switch0phy0: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+
+- switch0phy1: switch0phy1@12 {
++ switch0phy1: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+
+- switch0phy2: switch0phy2@13 {
++ switch0phy2: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+
+- switch0phy3: switch0phy3@14 {
++ switch0phy3: ethernet-phy@14 {
+ reg = <0x14>;
+ };
+ };
+diff --git a/arch/arm/boot/dts/marvell/armada-385-linksys.dtsi b/arch/arm/boot/dts/marvell/armada-385-linksys.dtsi
+index fc8216fd9f60..4116ed60f709 100644
+--- a/arch/arm/boot/dts/marvell/armada-385-linksys.dtsi
++++ b/arch/arm/boot/dts/marvell/armada-385-linksys.dtsi
+@@ -158,42 +158,40 @@
+ &mdio {
+ status = "okay";
+
+- switch@0 {
++ ethernet-switch@0 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <0>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@0 {
++ ethernet-port@0 {
+ reg = <0>;
+ label = "lan4";
+ };
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan3";
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan2";
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan1";
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "wan";
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ phy-mode = "sgmii";
+ ethernet = <ð2>;
+diff --git a/arch/arm/boot/dts/marvell/armada-385-turris-omnia.dts b/arch/arm/boot/dts/marvell/armada-385-turris-omnia.dts
+index 2d8d319bec83..7b755bb4e4e7 100644
+--- a/arch/arm/boot/dts/marvell/armada-385-turris-omnia.dts
++++ b/arch/arm/boot/dts/marvell/armada-385-turris-omnia.dts
+@@ -435,12 +435,10 @@
+ };
+
+ /* Switch MV88E6176 at address 0x10 */
+- switch@10 {
++ ethernet-switch@10 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&swint_pins>;
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+
+ dsa,member = <0 0>;
+ reg = <0x10>;
+@@ -448,36 +446,36 @@
+ interrupt-parent = <&gpio1>;
+ interrupts = <13 IRQ_TYPE_LEVEL_LOW>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- ports@0 {
++ ethernet-port@0 {
+ reg = <0>;
+ label = "lan0";
+ };
+
+- ports@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan1";
+ };
+
+- ports@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan2";
+ };
+
+- ports@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan3";
+ };
+
+- ports@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "lan4";
+ };
+
+- ports@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ ethernet = <ð1>;
+ phy-mode = "rgmii-id";
+@@ -488,7 +486,7 @@
+ };
+ };
+
+- ports@6 {
++ ethernet-port@6 {
+ reg = <6>;
+ ethernet = <ð0>;
+ phy-mode = "rgmii-id";
+diff --git a/arch/arm/boot/dts/marvell/armada-388-clearfog.dts b/arch/arm/boot/dts/marvell/armada-388-clearfog.dts
+index 32c569df142f..3290ccad2374 100644
+--- a/arch/arm/boot/dts/marvell/armada-388-clearfog.dts
++++ b/arch/arm/boot/dts/marvell/armada-388-clearfog.dts
+@@ -92,44 +92,42 @@
+ &mdio {
+ status = "okay";
+
+- switch@4 {
++ ethernet-switch@4 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <4>;
+ pinctrl-0 = <&clearfog_dsa0_clk_pins &clearfog_dsa0_pins>;
+ pinctrl-names = "default";
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@0 {
++ ethernet-port@0 {
+ reg = <0>;
+ label = "lan5";
+ };
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan4";
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan3";
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan2";
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "lan1";
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ ethernet = <ð1>;
+ phy-mode = "1000base-x";
+@@ -140,7 +138,7 @@
+ };
+ };
+
+- port@6 {
++ ethernet-port@6 {
+ /* 88E1512 external phy */
+ reg = <6>;
+ label = "lan6";
+diff --git a/arch/arm/boot/dts/marvell/armada-xp-linksys-mamba.dts b/arch/arm/boot/dts/marvell/armada-xp-linksys-mamba.dts
+index 7a0614fd0c93..ea859f7ea042 100644
+--- a/arch/arm/boot/dts/marvell/armada-xp-linksys-mamba.dts
++++ b/arch/arm/boot/dts/marvell/armada-xp-linksys-mamba.dts
+@@ -265,42 +265,40 @@
+ &mdio {
+ status = "okay";
+
+- switch@0 {
++ ethernet-switch@0 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <0>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@0 {
++ ethernet-port@0 {
+ reg = <0>;
+ label = "lan4";
+ };
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan3";
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan2";
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan1";
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "internet";
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ phy-mode = "rgmii-id";
+ ethernet = <ð0>;
+--
+2.43.0
+
--- /dev/null
+From d1a8746ef0198e33519e65af76f5bb35c2e957f4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 28 Sep 2023 14:02:42 +0300
+Subject: ARM: dts: qcom: mdm9615: fix PMIC node labels
+
+From: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+
+[ Upstream commit 0e4688cd4ee6efbeae2b31f75e16961fd7f72735 ]
+
+Change PM8018 node labels to start with pm8018_ prefix, following other
+Qualcomm PMIC device nodes.
+
+Reviewed-by: Konrad Dybcio <konrad.dybcio@linaro.org>
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Link: https://lore.kernel.org/r/20230928110309.1212221-10-dmitry.baryshkov@linaro.org
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/qcom/qcom-mdm9615-wp8548.dtsi | 2 +-
+ arch/arm/boot/dts/qcom/qcom-mdm9615.dtsi | 14 +++++++-------
+ 2 files changed, 8 insertions(+), 8 deletions(-)
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-mdm9615-wp8548.dtsi b/arch/arm/boot/dts/qcom/qcom-mdm9615-wp8548.dtsi
+index 92c8003dac25..dac3aa793f71 100644
+--- a/arch/arm/boot/dts/qcom/qcom-mdm9615-wp8548.dtsi
++++ b/arch/arm/boot/dts/qcom/qcom-mdm9615-wp8548.dtsi
+@@ -76,7 +76,7 @@
+ };
+ };
+
+-&pmicgpio {
++&pm8018_gpio {
+ usb_vbus_5v_pins: usb-vbus-5v-state {
+ pins = "gpio4";
+ function = "normal";
+diff --git a/arch/arm/boot/dts/qcom/qcom-mdm9615.dtsi b/arch/arm/boot/dts/qcom/qcom-mdm9615.dtsi
+index 63e21aa23642..c0a60bae703b 100644
+--- a/arch/arm/boot/dts/qcom/qcom-mdm9615.dtsi
++++ b/arch/arm/boot/dts/qcom/qcom-mdm9615.dtsi
+@@ -261,7 +261,7 @@
+ reg = <0x500000 0x1000>;
+ qcom,controller-type = "pmic-arbiter";
+
+- pmicintc: pmic {
++ pm8018: pmic {
+ compatible = "qcom,pm8018", "qcom,pm8921";
+ interrupts = <GIC_PPI 226 IRQ_TYPE_LEVEL_HIGH>;
+ #interrupt-cells = <2>;
+@@ -272,38 +272,38 @@
+ pwrkey@1c {
+ compatible = "qcom,pm8018-pwrkey", "qcom,pm8921-pwrkey";
+ reg = <0x1c>;
+- interrupt-parent = <&pmicintc>;
++ interrupt-parent = <&pm8018>;
+ interrupts = <50 IRQ_TYPE_EDGE_RISING>,
+ <51 IRQ_TYPE_EDGE_RISING>;
+ debounce = <15625>;
+ pull-up;
+ };
+
+- pmicmpp: mpps@50 {
++ pm8018_mpps: mpps@50 {
+ compatible = "qcom,pm8018-mpp", "qcom,ssbi-mpp";
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ reg = <0x50>;
+ gpio-controller;
+ #gpio-cells = <2>;
+- gpio-ranges = <&pmicmpp 0 0 6>;
++ gpio-ranges = <&pm8018_mpps 0 0 6>;
+ };
+
+ rtc@11d {
+ compatible = "qcom,pm8018-rtc", "qcom,pm8921-rtc";
+- interrupt-parent = <&pmicintc>;
++ interrupt-parent = <&pm8018>;
+ interrupts = <39 IRQ_TYPE_EDGE_RISING>;
+ reg = <0x11d>;
+ allow-set-time;
+ };
+
+- pmicgpio: gpio@150 {
++ pm8018_gpio: gpio@150 {
+ compatible = "qcom,pm8018-gpio", "qcom,ssbi-gpio";
+ reg = <0x150>;
+ interrupt-controller;
+ #interrupt-cells = <2>;
+ gpio-controller;
+- gpio-ranges = <&pmicgpio 0 0 6>;
++ gpio-ranges = <&pm8018_gpio 0 0 6>;
+ #gpio-cells = <2>;
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From 02e815c0b01f74468d67cac87752ecbe37931bd9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 28 Sep 2023 14:02:43 +0300
+Subject: ARM: dts: qcom: msm8660: fix PMIC node labels
+
+From: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+
+[ Upstream commit c6d86aa8a12194d1c9c2f9108910a46c8a3ddc90 ]
+
+Change PM8058 node labels to start with pm8058_ prefix, following other
+Qualcomm PMIC device nodes.
+
+Reviewed-by: Konrad Dybcio <konrad.dybcio@linaro.org>
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Link: https://lore.kernel.org/r/20230928110309.1212221-11-dmitry.baryshkov@linaro.org
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../boot/dts/qcom/qcom-apq8060-dragonboard.dts | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-msm8660.dtsi | 16 ++++++++--------
+ 2 files changed, 10 insertions(+), 10 deletions(-)
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8060-dragonboard.dts b/arch/arm/boot/dts/qcom/qcom-apq8060-dragonboard.dts
+index 569cbf0d8df8..94351c9bf94b 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8060-dragonboard.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8060-dragonboard.dts
+@@ -71,7 +71,7 @@
+ /* Trig on both edges - getting close or far away */
+ interrupts-extended = <&pm8058_gpio 34 IRQ_TYPE_EDGE_BOTH>;
+ /* MPP05 analog input to the XOADC */
+- io-channels = <&xoadc 0x00 0x05>;
++ io-channels = <&pm8058_xoadc 0x00 0x05>;
+ io-channel-names = "aout";
+ pinctrl-names = "default";
+ pinctrl-0 = <&dragon_cm3605_gpios>, <&dragon_cm3605_mpps>;
+@@ -944,7 +944,7 @@
+ };
+ };
+
+-&xoadc {
++&pm8058_xoadc {
+ /* Reference voltage 2.2 V */
+ xoadc-ref-supply = <&pm8058_l18>;
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8660.dtsi b/arch/arm/boot/dts/qcom/qcom-msm8660.dtsi
+index 78023ed2fdf7..9217ced108c4 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8660.dtsi
++++ b/arch/arm/boot/dts/qcom/qcom-msm8660.dtsi
+@@ -80,13 +80,13 @@
+ */
+ iio-hwmon {
+ compatible = "iio-hwmon";
+- io-channels = <&xoadc 0x00 0x01>, /* Battery */
+- <&xoadc 0x00 0x02>, /* DC in (charger) */
+- <&xoadc 0x00 0x04>, /* VPH the main system voltage */
+- <&xoadc 0x00 0x0b>, /* Die temperature */
+- <&xoadc 0x00 0x0c>, /* Reference voltage 1.25V */
+- <&xoadc 0x00 0x0d>, /* Reference voltage 0.625V */
+- <&xoadc 0x00 0x0e>; /* Reference voltage 0.325V */
++ io-channels = <&pm8058_xoadc 0x00 0x01>, /* Battery */
++ <&pm8058_xoadc 0x00 0x02>, /* DC in (charger) */
++ <&pm8058_xoadc 0x00 0x04>, /* VPH the main system voltage */
++ <&pm8058_xoadc 0x00 0x0b>, /* Die temperature */
++ <&pm8058_xoadc 0x00 0x0c>, /* Reference voltage 1.25V */
++ <&pm8058_xoadc 0x00 0x0d>, /* Reference voltage 0.625V */
++ <&pm8058_xoadc 0x00 0x0e>; /* Reference voltage 0.325V */
+ };
+
+ soc: soc {
+@@ -390,7 +390,7 @@
+ row-hold = <91500>;
+ };
+
+- xoadc: xoadc@197 {
++ pm8058_xoadc: xoadc@197 {
+ compatible = "qcom,pm8058-adc";
+ reg = <0x197>;
+ interrupts-extended = <&pm8058 76 IRQ_TYPE_EDGE_RISING>;
+--
+2.43.0
+
--- /dev/null
+From f467ef980c7ee18f9e33d97783fbfb4bd40e97c9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 28 Sep 2023 14:02:44 +0300
+Subject: ARM: dts: qcom: msm8960: fix PMIC node labels
+
+From: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+
+[ Upstream commit a10a09f34eb80b83ca7275e23bf982dae2aa7632 ]
+
+Change PM8921 node labels to start with pm8921_ prefix, following other
+Qualcomm PMIC device nodes.
+
+Reviewed-by: Konrad Dybcio <konrad.dybcio@linaro.org>
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Link: https://lore.kernel.org/r/20230928110309.1212221-12-dmitry.baryshkov@linaro.org
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/qcom/qcom-msm8960.dtsi | 8 ++++----
+ 1 file changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8960.dtsi b/arch/arm/boot/dts/qcom/qcom-msm8960.dtsi
+index d13080fcbeea..9099b858a76f 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8960.dtsi
++++ b/arch/arm/boot/dts/qcom/qcom-msm8960.dtsi
+@@ -264,7 +264,7 @@
+ reg = <0x500000 0x1000>;
+ qcom,controller-type = "pmic-arbiter";
+
+- pmicintc: pmic {
++ pm8921: pmic {
+ compatible = "qcom,pm8921";
+ interrupt-parent = <&msmgpio>;
+ interrupts = <104 IRQ_TYPE_LEVEL_LOW>;
+@@ -276,7 +276,7 @@
+ pwrkey@1c {
+ compatible = "qcom,pm8921-pwrkey";
+ reg = <0x1c>;
+- interrupt-parent = <&pmicintc>;
++ interrupt-parent = <&pm8921>;
+ interrupts = <50 IRQ_TYPE_EDGE_RISING>,
+ <51 IRQ_TYPE_EDGE_RISING>;
+ debounce = <15625>;
+@@ -286,7 +286,7 @@
+ keypad@148 {
+ compatible = "qcom,pm8921-keypad";
+ reg = <0x148>;
+- interrupt-parent = <&pmicintc>;
++ interrupt-parent = <&pm8921>;
+ interrupts = <74 IRQ_TYPE_EDGE_RISING>,
+ <75 IRQ_TYPE_EDGE_RISING>;
+ debounce = <15>;
+@@ -296,7 +296,7 @@
+
+ rtc@11d {
+ compatible = "qcom,pm8921-rtc";
+- interrupt-parent = <&pmicintc>;
++ interrupt-parent = <&pm8921>;
+ interrupts = <39 IRQ_TYPE_EDGE_RISING>;
+ reg = <0x11d>;
+ allow-set-time;
+--
+2.43.0
+
--- /dev/null
+From 43b239e7a34d0c83a8251a7a9814f6bbe4164c2a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 28 Sep 2023 14:02:40 +0300
+Subject: ARM: dts: qcom: strip prefix from PMIC files
+
+From: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+
+[ Upstream commit 455a4c46e023ab84263eae0fc7acca9a5ee8b7ac ]
+
+As the vendor DTS files were moved to per-vendor subdirs, there no need
+to use common prefixes. Drop the `qcom-' prefix from PMIC dtsi file.
+This makes 32-bit qcom/ dts files closer to arm64 ones.
+
+Reviewed-by: Konrad Dybcio <konrad.dybcio@linaro.org>
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Link: https://lore.kernel.org/r/20230928110309.1212221-8-dmitry.baryshkov@linaro.org
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/qcom/{qcom-pm8226.dtsi => pm8226.dtsi} | 0
+ arch/arm/boot/dts/qcom/{qcom-pm8841.dtsi => pm8841.dtsi} | 0
+ arch/arm/boot/dts/qcom/{qcom-pm8941.dtsi => pm8941.dtsi} | 0
+ arch/arm/boot/dts/qcom/{qcom-pma8084.dtsi => pma8084.dtsi} | 0
+ arch/arm/boot/dts/qcom/{qcom-pmx55.dtsi => pmx55.dtsi} | 0
+ arch/arm/boot/dts/qcom/{qcom-pmx65.dtsi => pmx65.dtsi} | 0
+ arch/arm/boot/dts/qcom/qcom-apq8026-asus-sparrow.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-apq8026-huawei-sturgeon.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-apq8026-lg-lenok.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-apq8026-samsung-matisse-wifi.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-apq8074-dragonboard.dts | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-apq8084-ifc6540.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-apq8084-mtp.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-msm8974-lge-nexus5-hammerhead.dts | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-msm8974-sony-xperia-rhine.dtsi | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-msm8974pro-fairphone-fp2.dts | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-msm8974pro-oneplus-bacon.dts | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-msm8974pro-samsung-klte.dts | 2 +-
+ .../dts/qcom/qcom-msm8974pro-sony-xperia-shinano-castor.dts | 4 ++--
+ arch/arm/boot/dts/qcom/qcom-sdx55-mtp.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-sdx55-t55.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-sdx55-telit-fn980-tlb.dts | 2 +-
+ arch/arm/boot/dts/qcom/qcom-sdx65-mtp.dts | 2 +-
+ 23 files changed, 23 insertions(+), 23 deletions(-)
+ rename arch/arm/boot/dts/qcom/{qcom-pm8226.dtsi => pm8226.dtsi} (100%)
+ rename arch/arm/boot/dts/qcom/{qcom-pm8841.dtsi => pm8841.dtsi} (100%)
+ rename arch/arm/boot/dts/qcom/{qcom-pm8941.dtsi => pm8941.dtsi} (100%)
+ rename arch/arm/boot/dts/qcom/{qcom-pma8084.dtsi => pma8084.dtsi} (100%)
+ rename arch/arm/boot/dts/qcom/{qcom-pmx55.dtsi => pmx55.dtsi} (100%)
+ rename arch/arm/boot/dts/qcom/{qcom-pmx65.dtsi => pmx65.dtsi} (100%)
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-pm8226.dtsi b/arch/arm/boot/dts/qcom/pm8226.dtsi
+similarity index 100%
+rename from arch/arm/boot/dts/qcom/qcom-pm8226.dtsi
+rename to arch/arm/boot/dts/qcom/pm8226.dtsi
+diff --git a/arch/arm/boot/dts/qcom/qcom-pm8841.dtsi b/arch/arm/boot/dts/qcom/pm8841.dtsi
+similarity index 100%
+rename from arch/arm/boot/dts/qcom/qcom-pm8841.dtsi
+rename to arch/arm/boot/dts/qcom/pm8841.dtsi
+diff --git a/arch/arm/boot/dts/qcom/qcom-pm8941.dtsi b/arch/arm/boot/dts/qcom/pm8941.dtsi
+similarity index 100%
+rename from arch/arm/boot/dts/qcom/qcom-pm8941.dtsi
+rename to arch/arm/boot/dts/qcom/pm8941.dtsi
+diff --git a/arch/arm/boot/dts/qcom/qcom-pma8084.dtsi b/arch/arm/boot/dts/qcom/pma8084.dtsi
+similarity index 100%
+rename from arch/arm/boot/dts/qcom/qcom-pma8084.dtsi
+rename to arch/arm/boot/dts/qcom/pma8084.dtsi
+diff --git a/arch/arm/boot/dts/qcom/qcom-pmx55.dtsi b/arch/arm/boot/dts/qcom/pmx55.dtsi
+similarity index 100%
+rename from arch/arm/boot/dts/qcom/qcom-pmx55.dtsi
+rename to arch/arm/boot/dts/qcom/pmx55.dtsi
+diff --git a/arch/arm/boot/dts/qcom/qcom-pmx65.dtsi b/arch/arm/boot/dts/qcom/pmx65.dtsi
+similarity index 100%
+rename from arch/arm/boot/dts/qcom/qcom-pmx65.dtsi
+rename to arch/arm/boot/dts/qcom/pmx65.dtsi
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8026-asus-sparrow.dts b/arch/arm/boot/dts/qcom/qcom-apq8026-asus-sparrow.dts
+index aa0e0e8d2a97..a39f5a161b03 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8026-asus-sparrow.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8026-asus-sparrow.dts
+@@ -6,7 +6,7 @@
+ /dts-v1/;
+
+ #include "qcom-msm8226.dtsi"
+-#include "qcom-pm8226.dtsi"
++#include "pm8226.dtsi"
+
+ /delete-node/ &adsp_region;
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8026-huawei-sturgeon.dts b/arch/arm/boot/dts/qcom/qcom-apq8026-huawei-sturgeon.dts
+index de19640efe55..59b218042d32 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8026-huawei-sturgeon.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8026-huawei-sturgeon.dts
+@@ -6,7 +6,7 @@
+ /dts-v1/;
+
+ #include "qcom-msm8226.dtsi"
+-#include "qcom-pm8226.dtsi"
++#include "pm8226.dtsi"
+ #include <dt-bindings/input/ti-drv260x.h>
+
+ /delete-node/ &adsp_region;
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8026-lg-lenok.dts b/arch/arm/boot/dts/qcom/qcom-apq8026-lg-lenok.dts
+index b887e5361ec3..feb78afef3a6 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8026-lg-lenok.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8026-lg-lenok.dts
+@@ -6,7 +6,7 @@
+ /dts-v1/;
+
+ #include "qcom-msm8226.dtsi"
+-#include "qcom-pm8226.dtsi"
++#include "pm8226.dtsi"
+
+ /delete-node/ &adsp_region;
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8026-samsung-matisse-wifi.dts b/arch/arm/boot/dts/qcom/qcom-apq8026-samsung-matisse-wifi.dts
+index f516e0426bb9..cffc069712b2 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8026-samsung-matisse-wifi.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8026-samsung-matisse-wifi.dts
+@@ -7,7 +7,7 @@
+
+ #include <dt-bindings/input/input.h>
+ #include "qcom-msm8226.dtsi"
+-#include "qcom-pm8226.dtsi"
++#include "pm8226.dtsi"
+
+ /delete-node/ &adsp_region;
+ /delete-node/ &smem_region;
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8074-dragonboard.dts b/arch/arm/boot/dts/qcom/qcom-apq8074-dragonboard.dts
+index 6d1b2439ae3a..950fa652f985 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8074-dragonboard.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8074-dragonboard.dts
+@@ -4,8 +4,8 @@
+ #include <dt-bindings/leds/common.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+ #include "qcom-msm8974.dtsi"
+-#include "qcom-pm8841.dtsi"
+-#include "qcom-pm8941.dtsi"
++#include "pm8841.dtsi"
++#include "pm8941.dtsi"
+
+ /delete-node/ &mpss_region;
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8084-ifc6540.dts b/arch/arm/boot/dts/qcom/qcom-apq8084-ifc6540.dts
+index 116e59a3b76d..1df24c922be9 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8084-ifc6540.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8084-ifc6540.dts
+@@ -1,6 +1,6 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-apq8084.dtsi"
+-#include "qcom-pma8084.dtsi"
++#include "pma8084.dtsi"
+
+ / {
+ model = "Qualcomm APQ8084/IFC6540";
+diff --git a/arch/arm/boot/dts/qcom/qcom-apq8084-mtp.dts b/arch/arm/boot/dts/qcom/qcom-apq8084-mtp.dts
+index c6b6680248a6..d4e6aee034af 100644
+--- a/arch/arm/boot/dts/qcom/qcom-apq8084-mtp.dts
++++ b/arch/arm/boot/dts/qcom/qcom-apq8084-mtp.dts
+@@ -1,6 +1,6 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-apq8084.dtsi"
+-#include "qcom-pma8084.dtsi"
++#include "pma8084.dtsi"
+
+ / {
+ model = "Qualcomm APQ 8084-MTP";
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8974-lge-nexus5-hammerhead.dts b/arch/arm/boot/dts/qcom/qcom-msm8974-lge-nexus5-hammerhead.dts
+index 60bdfddeae69..da99f770d4f5 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8974-lge-nexus5-hammerhead.dts
++++ b/arch/arm/boot/dts/qcom/qcom-msm8974-lge-nexus5-hammerhead.dts
+@@ -1,7 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-msm8974.dtsi"
+-#include "qcom-pm8841.dtsi"
+-#include "qcom-pm8941.dtsi"
++#include "pm8841.dtsi"
++#include "pm8941.dtsi"
+ #include <dt-bindings/input/input.h>
+ #include <dt-bindings/leds/common.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8974-sony-xperia-rhine.dtsi b/arch/arm/boot/dts/qcom/qcom-msm8974-sony-xperia-rhine.dtsi
+index 68a2f9094e53..23ae474698aa 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8974-sony-xperia-rhine.dtsi
++++ b/arch/arm/boot/dts/qcom/qcom-msm8974-sony-xperia-rhine.dtsi
+@@ -1,7 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-msm8974.dtsi"
+-#include "qcom-pm8841.dtsi"
+-#include "qcom-pm8941.dtsi"
++#include "pm8841.dtsi"
++#include "pm8941.dtsi"
+ #include <dt-bindings/input/input.h>
+ #include <dt-bindings/leds/common.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8974pro-fairphone-fp2.dts b/arch/arm/boot/dts/qcom/qcom-msm8974pro-fairphone-fp2.dts
+index 42d253b75dad..6c4153689b39 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8974pro-fairphone-fp2.dts
++++ b/arch/arm/boot/dts/qcom/qcom-msm8974pro-fairphone-fp2.dts
+@@ -1,7 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-msm8974pro.dtsi"
+-#include "qcom-pm8841.dtsi"
+-#include "qcom-pm8941.dtsi"
++#include "pm8841.dtsi"
++#include "pm8941.dtsi"
+ #include <dt-bindings/input/input.h>
+ #include <dt-bindings/leds/common.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8974pro-oneplus-bacon.dts b/arch/arm/boot/dts/qcom/qcom-msm8974pro-oneplus-bacon.dts
+index 8230d0e1d95d..c0ca264d8140 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8974pro-oneplus-bacon.dts
++++ b/arch/arm/boot/dts/qcom/qcom-msm8974pro-oneplus-bacon.dts
+@@ -1,7 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-msm8974pro.dtsi"
+-#include "qcom-pm8841.dtsi"
+-#include "qcom-pm8941.dtsi"
++#include "pm8841.dtsi"
++#include "pm8941.dtsi"
+ #include <dt-bindings/input/input.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8974pro-samsung-klte.dts b/arch/arm/boot/dts/qcom/qcom-msm8974pro-samsung-klte.dts
+index 3e2c86591ee2..325feb89b343 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8974pro-samsung-klte.dts
++++ b/arch/arm/boot/dts/qcom/qcom-msm8974pro-samsung-klte.dts
+@@ -1,6 +1,6 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-msm8974pro.dtsi"
+-#include "qcom-pma8084.dtsi"
++#include "pma8084.dtsi"
+ #include <dt-bindings/input/input.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+ #include <dt-bindings/leds/common.h>
+diff --git a/arch/arm/boot/dts/qcom/qcom-msm8974pro-sony-xperia-shinano-castor.dts b/arch/arm/boot/dts/qcom/qcom-msm8974pro-sony-xperia-shinano-castor.dts
+index 11468d1409f7..0798cce3dbea 100644
+--- a/arch/arm/boot/dts/qcom/qcom-msm8974pro-sony-xperia-shinano-castor.dts
++++ b/arch/arm/boot/dts/qcom/qcom-msm8974pro-sony-xperia-shinano-castor.dts
+@@ -1,7 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ #include "qcom-msm8974pro.dtsi"
+-#include "qcom-pm8841.dtsi"
+-#include "qcom-pm8941.dtsi"
++#include "pm8841.dtsi"
++#include "pm8941.dtsi"
+ #include <dt-bindings/input/input.h>
+ #include <dt-bindings/leds/common.h>
+ #include <dt-bindings/pinctrl/qcom,pmic-gpio.h>
+diff --git a/arch/arm/boot/dts/qcom/qcom-sdx55-mtp.dts b/arch/arm/boot/dts/qcom/qcom-sdx55-mtp.dts
+index 7e97ad5803d8..247069361909 100644
+--- a/arch/arm/boot/dts/qcom/qcom-sdx55-mtp.dts
++++ b/arch/arm/boot/dts/qcom/qcom-sdx55-mtp.dts
+@@ -9,7 +9,7 @@
+ #include "qcom-sdx55.dtsi"
+ #include <dt-bindings/regulator/qcom,rpmh-regulator.h>
+ #include <arm64/qcom/pm8150b.dtsi>
+-#include "qcom-pmx55.dtsi"
++#include "pmx55.dtsi"
+
+ / {
+ model = "Qualcomm Technologies, Inc. SDX55 MTP";
+diff --git a/arch/arm/boot/dts/qcom/qcom-sdx55-t55.dts b/arch/arm/boot/dts/qcom/qcom-sdx55-t55.dts
+index 51058b065279..082f7ed1a01f 100644
+--- a/arch/arm/boot/dts/qcom/qcom-sdx55-t55.dts
++++ b/arch/arm/boot/dts/qcom/qcom-sdx55-t55.dts
+@@ -8,7 +8,7 @@
+ #include <dt-bindings/gpio/gpio.h>
+ #include <dt-bindings/regulator/qcom,rpmh-regulator.h>
+ #include "qcom-sdx55.dtsi"
+-#include "qcom-pmx55.dtsi"
++#include "pmx55.dtsi"
+
+ / {
+ model = "Thundercomm T55 Development Kit";
+diff --git a/arch/arm/boot/dts/qcom/qcom-sdx55-telit-fn980-tlb.dts b/arch/arm/boot/dts/qcom/qcom-sdx55-telit-fn980-tlb.dts
+index 8fadc6e70692..e336a15b45c4 100644
+--- a/arch/arm/boot/dts/qcom/qcom-sdx55-telit-fn980-tlb.dts
++++ b/arch/arm/boot/dts/qcom/qcom-sdx55-telit-fn980-tlb.dts
+@@ -8,7 +8,7 @@
+ #include <dt-bindings/gpio/gpio.h>
+ #include <dt-bindings/regulator/qcom,rpmh-regulator.h>
+ #include "qcom-sdx55.dtsi"
+-#include "qcom-pmx55.dtsi"
++#include "pmx55.dtsi"
+
+ / {
+ model = "Telit FN980 TLB";
+diff --git a/arch/arm/boot/dts/qcom/qcom-sdx65-mtp.dts b/arch/arm/boot/dts/qcom/qcom-sdx65-mtp.dts
+index 9649c859a2c3..07c10c84eefa 100644
+--- a/arch/arm/boot/dts/qcom/qcom-sdx65-mtp.dts
++++ b/arch/arm/boot/dts/qcom/qcom-sdx65-mtp.dts
+@@ -12,7 +12,7 @@
+ #include <dt-bindings/regulator/qcom,rpmh-regulator.h>
+ #include <arm64/qcom/pmk8350.dtsi>
+ #include <arm64/qcom/pm7250b.dtsi>
+-#include "qcom-pmx65.dtsi"
++#include "pmx65.dtsi"
+
+ / {
+ model = "Qualcomm Technologies, Inc. SDX65 MTP";
+--
+2.43.0
+
--- /dev/null
+From 374043fa95cf64ab98e4de48fa7ebbdca3effb40 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 18:40:27 +0100
+Subject: ARM: dts: rockchip: fix rk3036 hdmi ports node
+
+From: Johan Jonker <jbx6244@gmail.com>
+
+[ Upstream commit 27ded76ef0fcfcf939914532aae575cf23c221b4 ]
+
+Fix hdmi ports node so that it matches the
+rockchip,inno-hdmi.yaml binding.
+
+Signed-off-by: Johan Jonker <jbx6244@gmail.com>
+Link: https://lore.kernel.org/r/9a2afac1-ed5c-382d-02b0-b2f5f1af3abb@gmail.com
+Signed-off-by: Heiko Stuebner <heiko@sntech.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/rockchip/rk3036.dtsi | 14 +++++++++++---
+ 1 file changed, 11 insertions(+), 3 deletions(-)
+
+diff --git a/arch/arm/boot/dts/rockchip/rk3036.dtsi b/arch/arm/boot/dts/rockchip/rk3036.dtsi
+index 78686fc72ce6..c420c7c642cb 100644
+--- a/arch/arm/boot/dts/rockchip/rk3036.dtsi
++++ b/arch/arm/boot/dts/rockchip/rk3036.dtsi
+@@ -402,12 +402,20 @@
+ pinctrl-0 = <&hdmi_ctl>;
+ status = "disabled";
+
+- hdmi_in: port {
++ ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+- hdmi_in_vop: endpoint@0 {
++
++ hdmi_in: port@0 {
+ reg = <0>;
+- remote-endpoint = <&vop_out_hdmi>;
++
++ hdmi_in_vop: endpoint {
++ remote-endpoint = <&vop_out_hdmi>;
++ };
++ };
++
++ hdmi_out: port@1 {
++ reg = <1>;
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From 96ae1e4cb2fbefa4eaba50825453038e5010c8d0 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 22 Jul 2023 14:17:18 +0200
+Subject: ARM: dts: samsung: exynos4: fix camera unit addresses/ranges
+
+From: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+
+[ Upstream commit ba2a45a48503665f7e8eeec51f8b40456566b0cd ]
+
+The camera node has both unit address and children within the same bus
+mapping, thus needs proper ranges property to fix dtc W=1 warnings:
+
+ Warning (unit_address_vs_reg): /soc/camera@11800000: node has a unit name, but no reg or ranges property
+ Warning (simple_bus_reg): /soc/camera@11800000: missing or empty reg/ranges property
+
+Subtract 0x11800000 from all its children nodes. No functional impact
+expected.
+
+Link: https://lore.kernel.org/r/20230722121719.150094-2-krzysztof.kozlowski@linaro.org
+Signed-off-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/samsung/exynos4.dtsi | 26 +++++++++++------------
+ arch/arm/boot/dts/samsung/exynos4x12.dtsi | 17 ++++++++-------
+ 2 files changed, 22 insertions(+), 21 deletions(-)
+
+diff --git a/arch/arm/boot/dts/samsung/exynos4.dtsi b/arch/arm/boot/dts/samsung/exynos4.dtsi
+index f775b9377a38..7f981b5c0d64 100644
+--- a/arch/arm/boot/dts/samsung/exynos4.dtsi
++++ b/arch/arm/boot/dts/samsung/exynos4.dtsi
+@@ -203,16 +203,16 @@
+
+ camera: camera@11800000 {
+ compatible = "samsung,fimc";
++ ranges = <0x0 0x11800000 0xa0000>;
+ status = "disabled";
+ #address-cells = <1>;
+ #size-cells = <1>;
+ #clock-cells = <1>;
+ clock-output-names = "cam_a_clkout", "cam_b_clkout";
+- ranges;
+
+- fimc_0: fimc@11800000 {
++ fimc_0: fimc@0 {
+ compatible = "samsung,exynos4210-fimc";
+- reg = <0x11800000 0x1000>;
++ reg = <0x0 0x1000>;
+ interrupts = <GIC_SPI 84 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clock CLK_FIMC0>,
+ <&clock CLK_SCLK_FIMC0>;
+@@ -223,9 +223,9 @@
+ status = "disabled";
+ };
+
+- fimc_1: fimc@11810000 {
++ fimc_1: fimc@10000 {
+ compatible = "samsung,exynos4210-fimc";
+- reg = <0x11810000 0x1000>;
++ reg = <0x00010000 0x1000>;
+ interrupts = <GIC_SPI 85 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clock CLK_FIMC1>,
+ <&clock CLK_SCLK_FIMC1>;
+@@ -236,9 +236,9 @@
+ status = "disabled";
+ };
+
+- fimc_2: fimc@11820000 {
++ fimc_2: fimc@20000 {
+ compatible = "samsung,exynos4210-fimc";
+- reg = <0x11820000 0x1000>;
++ reg = <0x00020000 0x1000>;
+ interrupts = <GIC_SPI 86 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clock CLK_FIMC2>,
+ <&clock CLK_SCLK_FIMC2>;
+@@ -249,9 +249,9 @@
+ status = "disabled";
+ };
+
+- fimc_3: fimc@11830000 {
++ fimc_3: fimc@30000 {
+ compatible = "samsung,exynos4210-fimc";
+- reg = <0x11830000 0x1000>;
++ reg = <0x00030000 0x1000>;
+ interrupts = <GIC_SPI 87 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clock CLK_FIMC3>,
+ <&clock CLK_SCLK_FIMC3>;
+@@ -262,9 +262,9 @@
+ status = "disabled";
+ };
+
+- csis_0: csis@11880000 {
++ csis_0: csis@80000 {
+ compatible = "samsung,exynos4210-csis";
+- reg = <0x11880000 0x4000>;
++ reg = <0x00080000 0x4000>;
+ interrupts = <GIC_SPI 78 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clock CLK_CSIS0>,
+ <&clock CLK_SCLK_CSIS0>;
+@@ -278,9 +278,9 @@
+ #size-cells = <0>;
+ };
+
+- csis_1: csis@11890000 {
++ csis_1: csis@90000 {
+ compatible = "samsung,exynos4210-csis";
+- reg = <0x11890000 0x4000>;
++ reg = <0x00090000 0x4000>;
+ interrupts = <GIC_SPI 80 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clock CLK_CSIS1>,
+ <&clock CLK_SCLK_CSIS1>;
+diff --git a/arch/arm/boot/dts/samsung/exynos4x12.dtsi b/arch/arm/boot/dts/samsung/exynos4x12.dtsi
+index 84c1db221c98..83d9d0a0a617 100644
+--- a/arch/arm/boot/dts/samsung/exynos4x12.dtsi
++++ b/arch/arm/boot/dts/samsung/exynos4x12.dtsi
+@@ -451,14 +451,15 @@
+ };
+
+ &camera {
++ ranges = <0x0 0x11800000 0xba1000>;
+ clocks = <&clock CLK_SCLK_CAM0>, <&clock CLK_SCLK_CAM1>,
+ <&clock CLK_PIXELASYNCM0>, <&clock CLK_PIXELASYNCM1>;
+ clock-names = "sclk_cam0", "sclk_cam1", "pxl_async0", "pxl_async1";
+
+ /* fimc_[0-3] are configured outside, under phandles */
+- fimc_lite_0: fimc-lite@12390000 {
++ fimc_lite_0: fimc-lite@b90000 {
+ compatible = "samsung,exynos4212-fimc-lite";
+- reg = <0x12390000 0x1000>;
++ reg = <0x00b90000 0x1000>;
+ interrupts = <GIC_SPI 105 IRQ_TYPE_LEVEL_HIGH>;
+ power-domains = <&pd_isp>;
+ clocks = <&isp_clock CLK_ISP_FIMC_LITE0>;
+@@ -467,9 +468,9 @@
+ status = "disabled";
+ };
+
+- fimc_lite_1: fimc-lite@123a0000 {
++ fimc_lite_1: fimc-lite@ba0000 {
+ compatible = "samsung,exynos4212-fimc-lite";
+- reg = <0x123a0000 0x1000>;
++ reg = <0x00ba0000 0x1000>;
+ interrupts = <GIC_SPI 106 IRQ_TYPE_LEVEL_HIGH>;
+ power-domains = <&pd_isp>;
+ clocks = <&isp_clock CLK_ISP_FIMC_LITE1>;
+@@ -478,9 +479,9 @@
+ status = "disabled";
+ };
+
+- fimc_is: fimc-is@12000000 {
++ fimc_is: fimc-is@800000 {
+ compatible = "samsung,exynos4212-fimc-is";
+- reg = <0x12000000 0x260000>;
++ reg = <0x00800000 0x260000>;
+ interrupts = <GIC_SPI 90 IRQ_TYPE_LEVEL_HIGH>,
+ <GIC_SPI 95 IRQ_TYPE_LEVEL_HIGH>;
+ power-domains = <&pd_isp>;
+@@ -525,9 +526,9 @@
+ reg = <0x10020000 0x3000>;
+ };
+
+- i2c1_isp: i2c-isp@12140000 {
++ i2c1_isp: i2c-isp@940000 {
+ compatible = "samsung,exynos4212-i2c-isp";
+- reg = <0x12140000 0x100>;
++ reg = <0x00940000 0x100>;
+ clocks = <&isp_clock CLK_ISP_I2C1_ISP>;
+ clock-names = "i2c_isp";
+ #address-cells = <1>;
+--
+2.43.0
+
--- /dev/null
+From da9463371560c1ac7130ab1f0d53210fc90450d5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 22 Jul 2023 14:17:19 +0200
+Subject: ARM: dts: samsung: s5pv210: fix camera unit addresses/ranges
+
+From: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+
+[ Upstream commit 07e6a553c2f1d385edfc9185081dee442a9dd38d ]
+
+The camera node has both unit address and children within the same bus
+mapping, thus needs proper ranges property to fix dtc W=1 warnings:
+
+ Warning (unit_address_vs_reg): /soc/camera@fa600000: node has a unit name, but no reg or ranges property
+ Warning (simple_bus_reg): /soc/camera@fa600000: missing or empty reg/ranges property
+
+Subtract 0xfa600000 from all its children nodes. No functional impact
+expected.
+
+Link: https://lore.kernel.org/r/20230722121719.150094-3-krzysztof.kozlowski@linaro.org
+Signed-off-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/samsung/s5pv210.dtsi | 18 +++++++++---------
+ 1 file changed, 9 insertions(+), 9 deletions(-)
+
+diff --git a/arch/arm/boot/dts/samsung/s5pv210.dtsi b/arch/arm/boot/dts/samsung/s5pv210.dtsi
+index f7de5b5f2f38..ed560c9a3aa1 100644
+--- a/arch/arm/boot/dts/samsung/s5pv210.dtsi
++++ b/arch/arm/boot/dts/samsung/s5pv210.dtsi
+@@ -549,17 +549,17 @@
+
+ camera: camera@fa600000 {
+ compatible = "samsung,fimc";
++ ranges = <0x0 0xfa600000 0xe01000>;
+ clocks = <&clocks SCLK_CAM0>, <&clocks SCLK_CAM1>;
+ clock-names = "sclk_cam0", "sclk_cam1";
+ #address-cells = <1>;
+ #size-cells = <1>;
+ #clock-cells = <1>;
+ clock-output-names = "cam_a_clkout", "cam_b_clkout";
+- ranges;
+
+- csis0: csis@fa600000 {
++ csis0: csis@0 {
+ compatible = "samsung,s5pv210-csis";
+- reg = <0xfa600000 0x4000>;
++ reg = <0x00000000 0x4000>;
+ interrupt-parent = <&vic2>;
+ interrupts = <29>;
+ clocks = <&clocks CLK_CSIS>,
+@@ -572,9 +572,9 @@
+ #size-cells = <0>;
+ };
+
+- fimc0: fimc@fb200000 {
++ fimc0: fimc@c00000 {
+ compatible = "samsung,s5pv210-fimc";
+- reg = <0xfb200000 0x1000>;
++ reg = <0x00c00000 0x1000>;
+ interrupts = <5>;
+ interrupt-parent = <&vic2>;
+ clocks = <&clocks CLK_FIMC0>,
+@@ -586,9 +586,9 @@
+ samsung,cam-if;
+ };
+
+- fimc1: fimc@fb300000 {
++ fimc1: fimc@d00000 {
+ compatible = "samsung,s5pv210-fimc";
+- reg = <0xfb300000 0x1000>;
++ reg = <0x00d00000 0x1000>;
+ interrupt-parent = <&vic2>;
+ interrupts = <6>;
+ clocks = <&clocks CLK_FIMC1>,
+@@ -602,9 +602,9 @@
+ samsung,lcd-wb;
+ };
+
+- fimc2: fimc@fb400000 {
++ fimc2: fimc@e00000 {
+ compatible = "samsung,s5pv210-fimc";
+- reg = <0xfb400000 0x1000>;
++ reg = <0x00e00000 0x1000>;
+ interrupt-parent = <&vic2>;
+ interrupts = <7>;
+ clocks = <&clocks CLK_FIMC2>,
+--
+2.43.0
+
--- /dev/null
+From d7f378e5249c79917e2d40e4686749a7f6f83e4b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 20 Oct 2023 15:11:41 +0200
+Subject: ARM: dts: usr8200: Fix phy registers
+
+From: Linus Walleij <linus.walleij@linaro.org>
+
+[ Upstream commit 18a1ee9d716d355361da2765f87dbbadcdea03bf ]
+
+The MV88E6060 switch has internal PHY registers at MDIO
+addresses 0x00..0x04. Tie each port to the corresponding
+PHY.
+
+Signed-off-by: Linus Walleij <linus.walleij@linaro.org>
+Link: https://lore.kernel.org/r/20231020-ixp4xx-usr8200-dtsfix-v1-1-3a8591dea259@linaro.org
+Signed-off-by: Arnd Bergmann <arnd@arndb.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../ixp/intel-ixp42x-usrobotics-usr8200.dts | 22 +++++++++++++++++++
+ 1 file changed, 22 insertions(+)
+
+diff --git a/arch/arm/boot/dts/intel/ixp/intel-ixp42x-usrobotics-usr8200.dts b/arch/arm/boot/dts/intel/ixp/intel-ixp42x-usrobotics-usr8200.dts
+index 90fd51b36e7d..2c89db34c8d8 100644
+--- a/arch/arm/boot/dts/intel/ixp/intel-ixp42x-usrobotics-usr8200.dts
++++ b/arch/arm/boot/dts/intel/ixp/intel-ixp42x-usrobotics-usr8200.dts
+@@ -165,6 +165,24 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
++ /*
++ * PHY 0..4 are internal to the MV88E6060 switch but appear
++ * as independent devices.
++ */
++ phy0: ethernet-phy@0 {
++ reg = <0>;
++ };
++ phy1: ethernet-phy@1 {
++ reg = <1>;
++ };
++ phy2: ethernet-phy@2 {
++ reg = <2>;
++ };
++ phy3: ethernet-phy@3 {
++ reg = <3>;
++ };
++
++ /* Altima AMI101L used by the WAN port */
+ phy9: ethernet-phy@9 {
+ reg = <9>;
+ };
+@@ -181,21 +199,25 @@
+ port@0 {
+ reg = <0>;
+ label = "lan1";
++ phy-handle = <&phy0>;
+ };
+
+ port@1 {
+ reg = <1>;
+ label = "lan2";
++ phy-handle = <&phy1>;
+ };
+
+ port@2 {
+ reg = <2>;
+ label = "lan3";
++ phy-handle = <&phy2>;
+ };
+
+ port@3 {
+ reg = <3>;
+ label = "lan4";
++ phy-handle = <&phy3>;
+ };
+
+ port@5 {
+--
+2.43.0
+
--- /dev/null
+From e894a86c2fccd70941b54d1ed01337cd024d847a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 16:28:00 +0800
+Subject: arm64: dts: amlogic: fix format for s4 uart node
+
+From: Xianwei Zhao <xianwei.zhao@amlogic.com>
+
+[ Upstream commit eb54ef36282f670c704ed5af8593da62bebba80d ]
+
+Aliases use lowercase letters and place status in end.
+
+Signed-off-by: Xianwei Zhao <xianwei.zhao@amlogic.com>
+Reviewed-by: Neil Armstrong <neil.armstrong@linaro.org>
+Link: https://lore.kernel.org/r/20231215-s4-dts-v1-1-7831ab6972be@amlogic.com
+Signed-off-by: Neil Armstrong <neil.armstrong@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/amlogic/meson-s4-s805x2-aq222.dts | 4 ++--
+ arch/arm64/boot/dts/amlogic/meson-s4.dtsi | 4 ++--
+ 2 files changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/amlogic/meson-s4-s805x2-aq222.dts b/arch/arm64/boot/dts/amlogic/meson-s4-s805x2-aq222.dts
+index c1f322c73982..b1b81ac03200 100644
+--- a/arch/arm64/boot/dts/amlogic/meson-s4-s805x2-aq222.dts
++++ b/arch/arm64/boot/dts/amlogic/meson-s4-s805x2-aq222.dts
+@@ -15,7 +15,7 @@
+ #size-cells = <2>;
+
+ aliases {
+- serial0 = &uart_B;
++ serial0 = &uart_b;
+ };
+
+ memory@0 {
+@@ -25,7 +25,7 @@
+
+ };
+
+-&uart_B {
++&uart_b {
+ status = "okay";
+ };
+
+diff --git a/arch/arm64/boot/dts/amlogic/meson-s4.dtsi b/arch/arm64/boot/dts/amlogic/meson-s4.dtsi
+index e0cfc54ebccb..dac18eb634d7 100644
+--- a/arch/arm64/boot/dts/amlogic/meson-s4.dtsi
++++ b/arch/arm64/boot/dts/amlogic/meson-s4.dtsi
+@@ -126,14 +126,14 @@
+ <10 11 12 13 14 15 16 17 18 19 20 21>;
+ };
+
+- uart_B: serial@7a000 {
++ uart_b: serial@7a000 {
+ compatible = "amlogic,meson-s4-uart",
+ "amlogic,meson-ao-uart";
+ reg = <0x0 0x7a000 0x0 0x18>;
+ interrupts = <GIC_SPI 169 IRQ_TYPE_EDGE_RISING>;
+- status = "disabled";
+ clocks = <&xtal>, <&xtal>, <&xtal>;
+ clock-names = "xtal", "pclk", "baud";
++ status = "disabled";
+ };
+
+ reset: reset-controller@2000 {
+--
+2.43.0
+
--- /dev/null
+From fb004838b30dd4adbc95ce239b29fc633b7a1916 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 27 Nov 2023 16:51:01 +0100
+Subject: ARM64: dts: marvell: Fix some common switch mistakes
+
+From: Linus Walleij <linus.walleij@linaro.org>
+
+[ Upstream commit fedb923aaf611e36adad4cd8c91d35bc283d3eea ]
+
+Fix some errors in the Marvell MV88E6xxx switch descriptions:
+- The top node had no address size or cells.
+- switch0@0 is not OK, should be ethernet-switch@0.
+- ports should be ethernet-ports
+- port@0 should be ethernet-port@0
+- PHYs should be named ethernet-phy@
+
+Reviewed-by: Andrew Lunn <andrew@lunn.ch>
+Reviewed-by: Florian Fainelli <florian.fainelli@broadcom.com>
+Signed-off-by: Linus Walleij <linus.walleij@linaro.org>
+Signed-off-by: Gregory CLEMENT <gregory.clement@bootlin.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../marvell/armada-3720-espressobin-ultra.dts | 14 +--
+ .../dts/marvell/armada-3720-espressobin.dtsi | 20 ++---
+ .../dts/marvell/armada-3720-gl-mv1000.dts | 20 ++---
+ .../dts/marvell/armada-3720-turris-mox.dts | 85 +++++++++++--------
+ .../boot/dts/marvell/armada-7040-mochabin.dts | 24 +++---
+ .../marvell/armada-8040-clearfog-gt-8k.dts | 22 ++---
+ arch/arm64/boot/dts/marvell/cn9130-crb.dtsi | 42 +++++----
+ 7 files changed, 115 insertions(+), 112 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/marvell/armada-3720-espressobin-ultra.dts b/arch/arm64/boot/dts/marvell/armada-3720-espressobin-ultra.dts
+index f9abef8dcc94..870bb380a40a 100644
+--- a/arch/arm64/boot/dts/marvell/armada-3720-espressobin-ultra.dts
++++ b/arch/arm64/boot/dts/marvell/armada-3720-espressobin-ultra.dts
+@@ -126,32 +126,32 @@
+
+ reset-gpios = <&gpiosb 23 GPIO_ACTIVE_LOW>;
+
+- ports {
+- switch0port1: port@1 {
++ ethernet-ports {
++ switch0port1: ethernet-port@1 {
+ reg = <1>;
+ label = "lan0";
+ phy-handle = <&switch0phy0>;
+ };
+
+- switch0port2: port@2 {
++ switch0port2: ethernet-port@2 {
+ reg = <2>;
+ label = "lan1";
+ phy-handle = <&switch0phy1>;
+ };
+
+- switch0port3: port@3 {
++ switch0port3: ethernet-port@3 {
+ reg = <3>;
+ label = "lan2";
+ phy-handle = <&switch0phy2>;
+ };
+
+- switch0port4: port@4 {
++ switch0port4: ethernet-port@4 {
+ reg = <4>;
+ label = "lan3";
+ phy-handle = <&switch0phy3>;
+ };
+
+- switch0port5: port@5 {
++ switch0port5: ethernet-port@5 {
+ reg = <5>;
+ label = "wan";
+ phy-handle = <&extphy>;
+@@ -160,7 +160,7 @@
+ };
+
+ mdio {
+- switch0phy3: switch0phy3@14 {
++ switch0phy3: ethernet-phy@14 {
+ reg = <0x14>;
+ };
+ };
+diff --git a/arch/arm64/boot/dts/marvell/armada-3720-espressobin.dtsi b/arch/arm64/boot/dts/marvell/armada-3720-espressobin.dtsi
+index 49cbdb55b4b3..fed2dcecb323 100644
+--- a/arch/arm64/boot/dts/marvell/armada-3720-espressobin.dtsi
++++ b/arch/arm64/boot/dts/marvell/armada-3720-espressobin.dtsi
+@@ -145,19 +145,17 @@
+ };
+
+ &mdio {
+- switch0: switch0@1 {
++ switch0: ethernet-switch@1 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <1>;
+
+ dsa,member = <0 0>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0port0: port@0 {
++ switch0port0: ethernet-port@0 {
+ reg = <0>;
+ label = "cpu";
+ ethernet = <ð0>;
+@@ -168,19 +166,19 @@
+ };
+ };
+
+- switch0port1: port@1 {
++ switch0port1: ethernet-port@1 {
+ reg = <1>;
+ label = "wan";
+ phy-handle = <&switch0phy0>;
+ };
+
+- switch0port2: port@2 {
++ switch0port2: ethernet-port@2 {
+ reg = <2>;
+ label = "lan0";
+ phy-handle = <&switch0phy1>;
+ };
+
+- switch0port3: port@3 {
++ switch0port3: ethernet-port@3 {
+ reg = <3>;
+ label = "lan1";
+ phy-handle = <&switch0phy2>;
+@@ -192,13 +190,13 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy0: switch0phy0@11 {
++ switch0phy0: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+- switch0phy1: switch0phy1@12 {
++ switch0phy1: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+- switch0phy2: switch0phy2@13 {
++ switch0phy2: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+ };
+diff --git a/arch/arm64/boot/dts/marvell/armada-3720-gl-mv1000.dts b/arch/arm64/boot/dts/marvell/armada-3720-gl-mv1000.dts
+index b1b45b4fa9d4..63fbc8352161 100644
+--- a/arch/arm64/boot/dts/marvell/armada-3720-gl-mv1000.dts
++++ b/arch/arm64/boot/dts/marvell/armada-3720-gl-mv1000.dts
+@@ -152,31 +152,29 @@
+ };
+
+ &mdio {
+- switch0: switch0@1 {
++ switch0: ethernet-switch@1 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <1>;
+
+ dsa,member = <0 0>;
+
+- ports: ports {
++ ports: ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@0 {
++ ethernet-port@0 {
+ reg = <0>;
+ label = "cpu";
+ ethernet = <ð0>;
+ };
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "wan";
+ phy-handle = <&switch0phy0>;
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan0";
+ phy-handle = <&switch0phy1>;
+@@ -185,7 +183,7 @@
+ nvmem-cell-names = "mac-address";
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan1";
+ phy-handle = <&switch0phy2>;
+@@ -199,13 +197,13 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy0: switch0phy0@11 {
++ switch0phy0: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+- switch0phy1: switch0phy1@12 {
++ switch0phy1: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+- switch0phy2: switch0phy2@13 {
++ switch0phy2: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+ };
+diff --git a/arch/arm64/boot/dts/marvell/armada-3720-turris-mox.dts b/arch/arm64/boot/dts/marvell/armada-3720-turris-mox.dts
+index 805ef2d79b40..4249acdec5ae 100644
+--- a/arch/arm64/boot/dts/marvell/armada-3720-turris-mox.dts
++++ b/arch/arm64/boot/dts/marvell/armada-3720-turris-mox.dts
+@@ -304,7 +304,13 @@
+ reg = <1>;
+ };
+
+- /* switch nodes are enabled by U-Boot if modules are present */
++ /*
++ * NOTE: switch nodes are enabled by U-Boot if modules are present
++ * DO NOT change this node name (switch0@10) even if it is not following
++ * conventions! Deployed U-Boot binaries are explicitly looking for
++ * this node in order to augment the device tree!
++ * Also do not touch the "ports" or "port@n" nodes. These are also ABI.
++ */
+ switch0@10 {
+ compatible = "marvell,mv88e6190";
+ reg = <0x10>;
+@@ -317,35 +323,35 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy1: switch0phy1@1 {
++ switch0phy1: ethernet-phy@1 {
+ reg = <0x1>;
+ };
+
+- switch0phy2: switch0phy2@2 {
++ switch0phy2: ethernet-phy@2 {
+ reg = <0x2>;
+ };
+
+- switch0phy3: switch0phy3@3 {
++ switch0phy3: ethernet-phy@3 {
+ reg = <0x3>;
+ };
+
+- switch0phy4: switch0phy4@4 {
++ switch0phy4: ethernet-phy@4 {
+ reg = <0x4>;
+ };
+
+- switch0phy5: switch0phy5@5 {
++ switch0phy5: ethernet-phy@5 {
+ reg = <0x5>;
+ };
+
+- switch0phy6: switch0phy6@6 {
++ switch0phy6: ethernet-phy@6 {
+ reg = <0x6>;
+ };
+
+- switch0phy7: switch0phy7@7 {
++ switch0phy7: ethernet-phy@7 {
+ reg = <0x7>;
+ };
+
+- switch0phy8: switch0phy8@8 {
++ switch0phy8: ethernet-phy@8 {
+ reg = <0x8>;
+ };
+ };
+@@ -430,6 +436,7 @@
+ };
+ };
+
++ /* NOTE: this node name is ABI, don't change it! */
+ switch0@2 {
+ compatible = "marvell,mv88e6085";
+ reg = <0x2>;
+@@ -442,19 +449,19 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy1_topaz: switch0phy1@11 {
++ switch0phy1_topaz: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+
+- switch0phy2_topaz: switch0phy2@12 {
++ switch0phy2_topaz: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+
+- switch0phy3_topaz: switch0phy3@13 {
++ switch0phy3_topaz: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+
+- switch0phy4_topaz: switch0phy4@14 {
++ switch0phy4_topaz: ethernet-phy@14 {
+ reg = <0x14>;
+ };
+ };
+@@ -497,6 +504,7 @@
+ };
+ };
+
++ /* NOTE: this node name is ABI, don't change it! */
+ switch1@11 {
+ compatible = "marvell,mv88e6190";
+ reg = <0x11>;
+@@ -509,35 +517,35 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch1phy1: switch1phy1@1 {
++ switch1phy1: ethernet-phy@1 {
+ reg = <0x1>;
+ };
+
+- switch1phy2: switch1phy2@2 {
++ switch1phy2: ethernet-phy@2 {
+ reg = <0x2>;
+ };
+
+- switch1phy3: switch1phy3@3 {
++ switch1phy3: ethernet-phy@3 {
+ reg = <0x3>;
+ };
+
+- switch1phy4: switch1phy4@4 {
++ switch1phy4: ethernet-phy@4 {
+ reg = <0x4>;
+ };
+
+- switch1phy5: switch1phy5@5 {
++ switch1phy5: ethernet-phy@5 {
+ reg = <0x5>;
+ };
+
+- switch1phy6: switch1phy6@6 {
++ switch1phy6: ethernet-phy@6 {
+ reg = <0x6>;
+ };
+
+- switch1phy7: switch1phy7@7 {
++ switch1phy7: ethernet-phy@7 {
+ reg = <0x7>;
+ };
+
+- switch1phy8: switch1phy8@8 {
++ switch1phy8: ethernet-phy@8 {
+ reg = <0x8>;
+ };
+ };
+@@ -622,6 +630,7 @@
+ };
+ };
+
++ /* NOTE: this node name is ABI, don't change it! */
+ switch1@2 {
+ compatible = "marvell,mv88e6085";
+ reg = <0x2>;
+@@ -634,19 +643,19 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch1phy1_topaz: switch1phy1@11 {
++ switch1phy1_topaz: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+
+- switch1phy2_topaz: switch1phy2@12 {
++ switch1phy2_topaz: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+
+- switch1phy3_topaz: switch1phy3@13 {
++ switch1phy3_topaz: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+
+- switch1phy4_topaz: switch1phy4@14 {
++ switch1phy4_topaz: ethernet-phy@14 {
+ reg = <0x14>;
+ };
+ };
+@@ -689,6 +698,7 @@
+ };
+ };
+
++ /* NOTE: this node name is ABI, don't change it! */
+ switch2@12 {
+ compatible = "marvell,mv88e6190";
+ reg = <0x12>;
+@@ -701,35 +711,35 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch2phy1: switch2phy1@1 {
++ switch2phy1: ethernet-phy@1 {
+ reg = <0x1>;
+ };
+
+- switch2phy2: switch2phy2@2 {
++ switch2phy2: ethernet-phy@2 {
+ reg = <0x2>;
+ };
+
+- switch2phy3: switch2phy3@3 {
++ switch2phy3: ethernet-phy@3 {
+ reg = <0x3>;
+ };
+
+- switch2phy4: switch2phy4@4 {
++ switch2phy4: ethernet-phy@4 {
+ reg = <0x4>;
+ };
+
+- switch2phy5: switch2phy5@5 {
++ switch2phy5: ethernet-phy@5 {
+ reg = <0x5>;
+ };
+
+- switch2phy6: switch2phy6@6 {
++ switch2phy6: ethernet-phy@6 {
+ reg = <0x6>;
+ };
+
+- switch2phy7: switch2phy7@7 {
++ switch2phy7: ethernet-phy@7 {
+ reg = <0x7>;
+ };
+
+- switch2phy8: switch2phy8@8 {
++ switch2phy8: ethernet-phy@8 {
+ reg = <0x8>;
+ };
+ };
+@@ -805,6 +815,7 @@
+ };
+ };
+
++ /* NOTE: this node name is ABI, don't change it! */
+ switch2@2 {
+ compatible = "marvell,mv88e6085";
+ reg = <0x2>;
+@@ -817,19 +828,19 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch2phy1_topaz: switch2phy1@11 {
++ switch2phy1_topaz: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+
+- switch2phy2_topaz: switch2phy2@12 {
++ switch2phy2_topaz: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+
+- switch2phy3_topaz: switch2phy3@13 {
++ switch2phy3_topaz: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+
+- switch2phy4_topaz: switch2phy4@14 {
++ switch2phy4_topaz: ethernet-phy@14 {
+ reg = <0x14>;
+ };
+ };
+diff --git a/arch/arm64/boot/dts/marvell/armada-7040-mochabin.dts b/arch/arm64/boot/dts/marvell/armada-7040-mochabin.dts
+index 48202810bf78..40b7ee7ead72 100644
+--- a/arch/arm64/boot/dts/marvell/armada-7040-mochabin.dts
++++ b/arch/arm64/boot/dts/marvell/armada-7040-mochabin.dts
+@@ -301,10 +301,8 @@
+ };
+
+ /* 88E6141 Topaz switch */
+- switch: switch@3 {
++ switch: ethernet-switch@3 {
+ compatible = "marvell,mv88e6085";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <3>;
+
+ pinctrl-names = "default";
+@@ -314,35 +312,35 @@
+ interrupt-parent = <&cp0_gpio1>;
+ interrupts = <1 IRQ_TYPE_LEVEL_LOW>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- swport1: port@1 {
++ swport1: ethernet-port@1 {
+ reg = <1>;
+ label = "lan0";
+ phy-handle = <&swphy1>;
+ };
+
+- swport2: port@2 {
++ swport2: ethernet-port@2 {
+ reg = <2>;
+ label = "lan1";
+ phy-handle = <&swphy2>;
+ };
+
+- swport3: port@3 {
++ swport3: ethernet-port@3 {
+ reg = <3>;
+ label = "lan2";
+ phy-handle = <&swphy3>;
+ };
+
+- swport4: port@4 {
++ swport4: ethernet-port@4 {
+ reg = <4>;
+ label = "lan3";
+ phy-handle = <&swphy4>;
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ label = "cpu";
+ ethernet = <&cp0_eth1>;
+@@ -355,19 +353,19 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- swphy1: swphy1@17 {
++ swphy1: ethernet-phy@17 {
+ reg = <17>;
+ };
+
+- swphy2: swphy2@18 {
++ swphy2: ethernet-phy@18 {
+ reg = <18>;
+ };
+
+- swphy3: swphy3@19 {
++ swphy3: ethernet-phy@19 {
+ reg = <19>;
+ };
+
+- swphy4: swphy4@20 {
++ swphy4: ethernet-phy@20 {
+ reg = <20>;
+ };
+ };
+diff --git a/arch/arm64/boot/dts/marvell/armada-8040-clearfog-gt-8k.dts b/arch/arm64/boot/dts/marvell/armada-8040-clearfog-gt-8k.dts
+index 4125202028c8..67892f0d2863 100644
+--- a/arch/arm64/boot/dts/marvell/armada-8040-clearfog-gt-8k.dts
++++ b/arch/arm64/boot/dts/marvell/armada-8040-clearfog-gt-8k.dts
+@@ -497,42 +497,42 @@
+ reset-deassert-us = <10000>;
+ };
+
+- switch0: switch0@4 {
++ switch0: ethernet-switch@4 {
+ compatible = "marvell,mv88e6085";
+ reg = <4>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&cp1_switch_reset_pins>;
+ reset-gpios = <&cp1_gpio1 24 GPIO_ACTIVE_LOW>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "lan2";
+ phy-handle = <&switch0phy0>;
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "lan1";
+ phy-handle = <&switch0phy1>;
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "lan4";
+ phy-handle = <&switch0phy2>;
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "lan3";
+ phy-handle = <&switch0phy3>;
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ label = "cpu";
+ ethernet = <&cp1_eth2>;
+@@ -545,19 +545,19 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy0: switch0phy0@11 {
++ switch0phy0: ethernet-phy@11 {
+ reg = <0x11>;
+ };
+
+- switch0phy1: switch0phy1@12 {
++ switch0phy1: ethernet-phy@12 {
+ reg = <0x12>;
+ };
+
+- switch0phy2: switch0phy2@13 {
++ switch0phy2: ethernet-phy@13 {
+ reg = <0x13>;
+ };
+
+- switch0phy3: switch0phy3@14 {
++ switch0phy3: ethernet-phy@14 {
+ reg = <0x14>;
+ };
+ };
+diff --git a/arch/arm64/boot/dts/marvell/cn9130-crb.dtsi b/arch/arm64/boot/dts/marvell/cn9130-crb.dtsi
+index 47d45ff3d6f5..6fcc34f7b464 100644
+--- a/arch/arm64/boot/dts/marvell/cn9130-crb.dtsi
++++ b/arch/arm64/boot/dts/marvell/cn9130-crb.dtsi
+@@ -207,11 +207,9 @@
+ reg = <0>;
+ };
+
+- switch6: switch0@6 {
++ switch6: ethernet-switch@6 {
+ /* Actual device is MV88E6393X */
+ compatible = "marvell,mv88e6190";
+- #address-cells = <1>;
+- #size-cells = <0>;
+ reg = <6>;
+ interrupt-parent = <&cp0_gpio1>;
+ interrupts = <28 IRQ_TYPE_LEVEL_LOW>;
+@@ -220,59 +218,59 @@
+
+ dsa,member = <0 0>;
+
+- ports {
++ ethernet-ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- port@1 {
++ ethernet-port@1 {
+ reg = <1>;
+ label = "p1";
+ phy-handle = <&switch0phy1>;
+ };
+
+- port@2 {
++ ethernet-port@2 {
+ reg = <2>;
+ label = "p2";
+ phy-handle = <&switch0phy2>;
+ };
+
+- port@3 {
++ ethernet-port@3 {
+ reg = <3>;
+ label = "p3";
+ phy-handle = <&switch0phy3>;
+ };
+
+- port@4 {
++ ethernet-port@4 {
+ reg = <4>;
+ label = "p4";
+ phy-handle = <&switch0phy4>;
+ };
+
+- port@5 {
++ ethernet-port@5 {
+ reg = <5>;
+ label = "p5";
+ phy-handle = <&switch0phy5>;
+ };
+
+- port@6 {
++ ethernet-port@6 {
+ reg = <6>;
+ label = "p6";
+ phy-handle = <&switch0phy6>;
+ };
+
+- port@7 {
++ ethernet-port@7 {
+ reg = <7>;
+ label = "p7";
+ phy-handle = <&switch0phy7>;
+ };
+
+- port@8 {
++ ethernet-port@8 {
+ reg = <8>;
+ label = "p8";
+ phy-handle = <&switch0phy8>;
+ };
+
+- port@9 {
++ ethernet-port@9 {
+ reg = <9>;
+ label = "p9";
+ phy-mode = "10gbase-r";
+@@ -280,7 +278,7 @@
+ managed = "in-band-status";
+ };
+
+- port@a {
++ ethernet-port@a {
+ reg = <10>;
+ ethernet = <&cp0_eth0>;
+ phy-mode = "10gbase-r";
+@@ -293,35 +291,35 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+- switch0phy1: switch0phy1@1 {
++ switch0phy1: ethernet-phy@1 {
+ reg = <0x1>;
+ };
+
+- switch0phy2: switch0phy2@2 {
++ switch0phy2: ethernet-phy@2 {
+ reg = <0x2>;
+ };
+
+- switch0phy3: switch0phy3@3 {
++ switch0phy3: ethernet-phy@3 {
+ reg = <0x3>;
+ };
+
+- switch0phy4: switch0phy4@4 {
++ switch0phy4: ethernet-phy@4 {
+ reg = <0x4>;
+ };
+
+- switch0phy5: switch0phy5@5 {
++ switch0phy5: ethernet-phy@5 {
+ reg = <0x5>;
+ };
+
+- switch0phy6: switch0phy6@6 {
++ switch0phy6: ethernet-phy@6 {
+ reg = <0x6>;
+ };
+
+- switch0phy7: switch0phy7@7 {
++ switch0phy7: ethernet-phy@7 {
+ reg = <0x7>;
+ };
+
+- switch0phy8: switch0phy8@8 {
++ switch0phy8: ethernet-phy@8 {
+ reg = <0x8>;
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From f8761086fdc9fe63b9412fe5036dbab25286bb27 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 9 Dec 2023 23:26:31 -0800
+Subject: arm64: dts: qcom: Fix coresight warnings in in-ports and out-ports
+
+From: Mao Jinlong <quic_jinlmao@quicinc.com>
+
+[ Upstream commit bdb6339fd46b8702ea7411b0b414587b86a40562 ]
+
+When a node is only one in port or one out port, address-cells and
+size-cells are not required in in-ports and out-ports. And the number
+and reg of the port need to be removed.
+
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Mao Jinlong <quic_jinlmao@quicinc.com>
+Link: https://lore.kernel.org/r/20231210072633.4243-5-quic_jinlmao@quicinc.com
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/sdm845.dtsi | 5 +----
+ arch/arm64/boot/dts/qcom/sm8150.dtsi | 5 +----
+ arch/arm64/boot/dts/qcom/sm8250.dtsi | 24 ++++--------------------
+ 3 files changed, 6 insertions(+), 28 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi
+index 91169e438b46..9e594d21ecd8 100644
+--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi
++++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi
+@@ -3545,11 +3545,8 @@
+ };
+
+ in-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+
+- port@1 {
+- reg = <1>;
++ port {
+ etf_in: endpoint {
+ remote-endpoint =
+ <&merge_funnel_out>;
+diff --git a/arch/arm64/boot/dts/qcom/sm8150.dtsi b/arch/arm64/boot/dts/qcom/sm8150.dtsi
+index e302eb7821af..3221478663ac 100644
+--- a/arch/arm64/boot/dts/qcom/sm8150.dtsi
++++ b/arch/arm64/boot/dts/qcom/sm8150.dtsi
+@@ -2957,11 +2957,8 @@
+ };
+
+ in-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+
+- port@1 {
+- reg = <1>;
++ port {
+ replicator1_in: endpoint {
+ remote-endpoint = <&replicator_out1>;
+ };
+diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi
+index 72db75ca7731..d59a99ca872c 100644
+--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi
++++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi
+@@ -3095,11 +3095,8 @@
+ clock-names = "apb_pclk";
+
+ out-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+
+- port@0 {
+- reg = <0>;
++ port {
+ tpda_out_funnel_qatb: endpoint {
+ remote-endpoint = <&funnel_qatb_in_tpda>;
+ };
+@@ -3142,11 +3139,7 @@
+ };
+
+ in-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+-
+- port@0 {
+- reg = <0>;
++ port {
+ funnel_qatb_in_tpda: endpoint {
+ remote-endpoint = <&tpda_out_funnel_qatb>;
+ };
+@@ -3355,11 +3348,8 @@
+ };
+
+ in-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+
+- port@0 {
+- reg = <0>;
++ port {
+ etf_in_funnel_swao_out: endpoint {
+ remote-endpoint = <&funnel_swao_out_etf>;
+ };
+@@ -3443,8 +3433,6 @@
+ clock-names = "apb_pclk";
+
+ out-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+ port {
+ tpdm_mm_out_tpda9: endpoint {
+ remote-endpoint = <&tpda_9_in_tpdm_mm>;
+@@ -3710,11 +3698,7 @@
+ };
+
+ in-ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+-
+- port@0 {
+- reg = <0>;
++ port {
+ funnel_apss_merg_in_funnel_apss: endpoint {
+ remote-endpoint = <&funnel_apss_out_funnel_apss_merg>;
+ };
+--
+2.43.0
+
--- /dev/null
+From 8898d4c8d2f1a95108fba48741b87469a48f7647 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 9 Dec 2023 23:26:29 -0800
+Subject: arm64: dts: qcom: msm8996: Fix 'in-ports' is a required property
+
+From: Mao Jinlong <quic_jinlmao@quicinc.com>
+
+[ Upstream commit 9a6fc510a6a3ec150cb7450aec1e5f257e6fc77b ]
+
+Add the inport of funnel@3023000 to fix 'in-ports' is a required property
+warning.
+
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Mao Jinlong <quic_jinlmao@quicinc.com>
+Link: https://lore.kernel.org/r/20231210072633.4243-3-quic_jinlmao@quicinc.com
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/msm8996.dtsi | 21 +++++++++++++++++++++
+ 1 file changed, 21 insertions(+)
+
+diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
+index 6ba9da9e6a8b..fa8ec92ce490 100644
+--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
++++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
+@@ -444,6 +444,19 @@
+ reg = <0x0 0x80000000 0x0 0x0>;
+ };
+
++ etm {
++ compatible = "qcom,coresight-remote-etm";
++
++ out-ports {
++ port {
++ modem_etm_out_funnel_in2: endpoint {
++ remote-endpoint =
++ <&funnel_in2_in_modem_etm>;
++ };
++ };
++ };
++ };
++
+ psci {
+ compatible = "arm,psci-1.0";
+ method = "smc";
+@@ -2644,6 +2657,14 @@
+ clocks = <&rpmcc RPM_QDSS_CLK>, <&rpmcc RPM_QDSS_A_CLK>;
+ clock-names = "apb_pclk", "atclk";
+
++ in-ports {
++ port {
++ funnel_in2_in_modem_etm: endpoint {
++ remote-endpoint =
++ <&modem_etm_out_funnel_in2>;
++ };
++ };
++ };
+
+ out-ports {
+ port {
+--
+2.43.0
+
--- /dev/null
+From 914b89fcf0d4836963b70845f7d2d119d8f1ebb1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 9 Dec 2023 23:26:30 -0800
+Subject: arm64: dts: qcom: msm8998: Fix 'out-ports' is a required property
+
+From: Mao Jinlong <quic_jinlmao@quicinc.com>
+
+[ Upstream commit ae5ee3562a2519214b12228545e88a203dd68bbd ]
+
+out-ports is a required property for coresight ETM. Add out-ports for
+ETM nodes to fix the warning.
+
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Mao Jinlong <quic_jinlmao@quicinc.com>
+Link: https://lore.kernel.org/r/20231210072633.4243-4-quic_jinlmao@quicinc.com
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/msm8998.dtsi | 32 +++++++++++++++++----------
+ 1 file changed, 20 insertions(+), 12 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
+index b485bf925ce6..ebc5ba1b369e 100644
+--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
++++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
+@@ -2031,9 +2031,11 @@
+
+ cpu = <&CPU4>;
+
+- port {
+- etm4_out: endpoint {
+- remote-endpoint = <&apss_funnel_in4>;
++ out-ports {
++ port {
++ etm4_out: endpoint {
++ remote-endpoint = <&apss_funnel_in4>;
++ };
+ };
+ };
+ };
+@@ -2048,9 +2050,11 @@
+
+ cpu = <&CPU5>;
+
+- port {
+- etm5_out: endpoint {
+- remote-endpoint = <&apss_funnel_in5>;
++ out-ports {
++ port {
++ etm5_out: endpoint {
++ remote-endpoint = <&apss_funnel_in5>;
++ };
+ };
+ };
+ };
+@@ -2065,9 +2069,11 @@
+
+ cpu = <&CPU6>;
+
+- port {
+- etm6_out: endpoint {
+- remote-endpoint = <&apss_funnel_in6>;
++ out-ports {
++ port {
++ etm6_out: endpoint {
++ remote-endpoint = <&apss_funnel_in6>;
++ };
+ };
+ };
+ };
+@@ -2082,9 +2088,11 @@
+
+ cpu = <&CPU7>;
+
+- port {
+- etm7_out: endpoint {
+- remote-endpoint = <&apss_funnel_in7>;
++ out-ports {
++ port {
++ etm7_out: endpoint {
++ remote-endpoint = <&apss_funnel_in7>;
++ };
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From 275e84d7ec79b63b9ba5094db6c818c79dd77654 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 11 Nov 2023 23:07:42 +0100
+Subject: arm64: dts: qcom: sm8350: Fix remoteproc interrupt type
+
+From: Nia Espera <nespera@igalia.com>
+
+[ Upstream commit 54ee322f845c7f25fbf6e43e11147b6cae8eff56 ]
+
+In a similar vein to
+https://lore.kernel.org/lkml/20220530080842.37024-3-manivannan.sadhasivam@linaro.org/,
+the remote processors on sm8350 fail to initialize with the 'correct'
+(i.e., specified in downstream) IRQ type. Change this to EDGE_RISING.
+
+Signed-off-by: Nia Espera <nespera@igalia.com>
+Acked-by: Konrad Dybcio <konrad.dybcio@linaro.org>
+Link: https://lore.kernel.org/r/20231111-nia-sm8350-for-upstream-v4-4-3a638b02eea5@igalia.com
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/sm8350.dtsi | 8 ++++----
+ 1 file changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/qcom/sm8350.dtsi b/arch/arm64/boot/dts/qcom/sm8350.dtsi
+index 1d597af15bb3..a72f3c470089 100644
+--- a/arch/arm64/boot/dts/qcom/sm8350.dtsi
++++ b/arch/arm64/boot/dts/qcom/sm8350.dtsi
+@@ -2021,7 +2021,7 @@
+ compatible = "qcom,sm8350-mpss-pas";
+ reg = <0x0 0x04080000 0x0 0x4040>;
+
+- interrupts-extended = <&intc GIC_SPI 264 IRQ_TYPE_LEVEL_HIGH>,
++ interrupts-extended = <&intc GIC_SPI 264 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_modem_in 0 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_modem_in 1 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_modem_in 2 IRQ_TYPE_EDGE_RISING>,
+@@ -2063,7 +2063,7 @@
+ compatible = "qcom,sm8350-slpi-pas";
+ reg = <0 0x05c00000 0 0x4000>;
+
+- interrupts-extended = <&pdc 9 IRQ_TYPE_LEVEL_HIGH>,
++ interrupts-extended = <&pdc 9 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_slpi_in 0 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_slpi_in 1 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_slpi_in 2 IRQ_TYPE_EDGE_RISING>,
+@@ -3207,7 +3207,7 @@
+ compatible = "qcom,sm8350-adsp-pas";
+ reg = <0 0x17300000 0 0x100>;
+
+- interrupts-extended = <&pdc 6 IRQ_TYPE_LEVEL_HIGH>,
++ interrupts-extended = <&pdc 6 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_adsp_in 0 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_adsp_in 1 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_adsp_in 2 IRQ_TYPE_EDGE_RISING>,
+@@ -3512,7 +3512,7 @@
+ compatible = "qcom,sm8350-cdsp-pas";
+ reg = <0 0x98900000 0 0x1400000>;
+
+- interrupts-extended = <&intc GIC_SPI 578 IRQ_TYPE_LEVEL_HIGH>,
++ interrupts-extended = <&intc GIC_SPI 578 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_cdsp_in 0 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_cdsp_in 1 IRQ_TYPE_EDGE_RISING>,
+ <&smp2p_cdsp_in 2 IRQ_TYPE_EDGE_RISING>,
+--
+2.43.0
+
--- /dev/null
+From 1f6bb7a2e4c10e71881575cee00eb63dea33216e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 6 Nov 2023 16:58:33 +0100
+Subject: arm64: dts: qcom: sm8450: fix soundwire controllers node name
+
+From: Neil Armstrong <neil.armstrong@linaro.org>
+
+[ Upstream commit 11fcb81373de52eeb1d3ff135a8d24a4b18978d3 ]
+
+Fix the following dt bindings check:
+arch/arm64/boot/dts/qcom/sm8450-hdk.dtb: soundwire-controller@31f0000: $nodename:0: 'soundwire-controller@31f0000' does not match '^soundwire(@.*)?$'
+ from schema $id: http://devicetree.org/schemas/soundwire/qcom,soundwire.yaml#
+
+Signed-off-by: Neil Armstrong <neil.armstrong@linaro.org>
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Link: https://lore.kernel.org/r/20231106-topic-sm8450-upstream-soundwire-bindings-fix-v1-1-41d4844a5a7d@linaro.org
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/sm8450.dtsi | 8 ++++----
+ 1 file changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/qcom/sm8450.dtsi b/arch/arm64/boot/dts/qcom/sm8450.dtsi
+index dc904ccb3d6c..f82480570d4b 100644
+--- a/arch/arm64/boot/dts/qcom/sm8450.dtsi
++++ b/arch/arm64/boot/dts/qcom/sm8450.dtsi
+@@ -2160,7 +2160,7 @@
+ #sound-dai-cells = <1>;
+ };
+
+- swr4: soundwire-controller@31f0000 {
++ swr4: soundwire@31f0000 {
+ compatible = "qcom,soundwire-v1.7.0";
+ reg = <0 0x031f0000 0 0x2000>;
+ interrupts = <GIC_SPI 171 IRQ_TYPE_LEVEL_HIGH>;
+@@ -2208,7 +2208,7 @@
+ #sound-dai-cells = <1>;
+ };
+
+- swr1: soundwire-controller@3210000 {
++ swr1: soundwire@3210000 {
+ compatible = "qcom,soundwire-v1.7.0";
+ reg = <0 0x03210000 0 0x2000>;
+ interrupts = <GIC_SPI 155 IRQ_TYPE_LEVEL_HIGH>;
+@@ -2275,7 +2275,7 @@
+ #sound-dai-cells = <1>;
+ };
+
+- swr0: soundwire-controller@3250000 {
++ swr0: soundwire@3250000 {
+ compatible = "qcom,soundwire-v1.7.0";
+ reg = <0 0x03250000 0 0x2000>;
+ interrupts = <GIC_SPI 170 IRQ_TYPE_LEVEL_HIGH>;
+@@ -2302,7 +2302,7 @@
+ status = "disabled";
+ };
+
+- swr2: soundwire-controller@33b0000 {
++ swr2: soundwire@33b0000 {
+ compatible = "qcom,soundwire-v1.7.0";
+ reg = <0 0x033b0000 0 0x2000>;
+ interrupts = <GIC_SPI 496 IRQ_TYPE_LEVEL_HIGH>,
+--
+2.43.0
+
--- /dev/null
+From 598d18de5490086d2fbe4d313edd20b469a2eded Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 6 Nov 2023 15:23:57 +0100
+Subject: arm64: dts: qcom: sm8550: fix soundwire controllers node name
+
+From: Neil Armstrong <neil.armstrong@linaro.org>
+
+[ Upstream commit 07c88da81caf0e72c3690b689d30f0d325cfeff4 ]
+
+Fix the following dt bindings check:
+arch/arm64/boot/dts/qcom/sm8550-mtp.dtb: soundwire-controller@6ab0000: $nodename:0: 'soundwire-controller@6ab0000' does not match '^soundwire(@.*)?$'
+from schema $id: http://devicetree.org/schemas/soundwire/qcom,soundwire.yaml#
+
+Signed-off-by: Neil Armstrong <neil.armstrong@linaro.org>
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Link: https://lore.kernel.org/r/20231106-topic-sm8550-upstream-soundwire-bindings-fix-v1-1-4ded91c805a1@linaro.org
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/sm8550.dtsi | 8 ++++----
+ 1 file changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/qcom/sm8550.dtsi b/arch/arm64/boot/dts/qcom/sm8550.dtsi
+index 5cf813a579d5..e15564ed54ce 100644
+--- a/arch/arm64/boot/dts/qcom/sm8550.dtsi
++++ b/arch/arm64/boot/dts/qcom/sm8550.dtsi
+@@ -2060,7 +2060,7 @@
+ #sound-dai-cells = <1>;
+ };
+
+- swr3: soundwire-controller@6ab0000 {
++ swr3: soundwire@6ab0000 {
+ compatible = "qcom,soundwire-v2.0.0";
+ reg = <0 0x06ab0000 0 0x10000>;
+ interrupts = <GIC_SPI 171 IRQ_TYPE_LEVEL_HIGH>;
+@@ -2106,7 +2106,7 @@
+ #sound-dai-cells = <1>;
+ };
+
+- swr1: soundwire-controller@6ad0000 {
++ swr1: soundwire@6ad0000 {
+ compatible = "qcom,soundwire-v2.0.0";
+ reg = <0 0x06ad0000 0 0x10000>;
+ interrupts = <GIC_SPI 155 IRQ_TYPE_LEVEL_HIGH>;
+@@ -2171,7 +2171,7 @@
+ #sound-dai-cells = <1>;
+ };
+
+- swr0: soundwire-controller@6b10000 {
++ swr0: soundwire@6b10000 {
+ compatible = "qcom,soundwire-v2.0.0";
+ reg = <0 0x06b10000 0 0x10000>;
+ interrupts = <GIC_SPI 170 IRQ_TYPE_LEVEL_HIGH>;
+@@ -2198,7 +2198,7 @@
+ status = "disabled";
+ };
+
+- swr2: soundwire-controller@6d30000 {
++ swr2: soundwire@6d30000 {
+ compatible = "qcom,soundwire-v2.0.0";
+ reg = <0 0x06d30000 0 0x10000>;
+ interrupts = <GIC_SPI 496 IRQ_TYPE_LEVEL_HIGH>,
+--
+2.43.0
+
--- /dev/null
+From aff09555ff1183bcc62ac91a748d6518612f2ca8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 17:28:23 +0800
+Subject: arm64: dts: sprd: Add clock reference for pll2 on UMS512
+
+From: Chunyan Zhang <chunyan.zhang@unisoc.com>
+
+[ Upstream commit 829e3e70fe72edc084fbfc4964669594ebe427ce ]
+
+Fix below dtbs_check warning:
+
+'clocks' is a dependency of 'clock-names'
+
+Link: https://lore.kernel.org/r/20231221092824.1169453-2-chunyan.zhang@unisoc.com
+Signed-off-by: Chunyan Zhang <chunyan.zhang@unisoc.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/sprd/ums512.dtsi | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/arch/arm64/boot/dts/sprd/ums512.dtsi b/arch/arm64/boot/dts/sprd/ums512.dtsi
+index 97ac550af2f1..91c22667d40f 100644
+--- a/arch/arm64/boot/dts/sprd/ums512.dtsi
++++ b/arch/arm64/boot/dts/sprd/ums512.dtsi
+@@ -291,6 +291,7 @@
+ pll2: clock-controller@0 {
+ compatible = "sprd,ums512-gc-pll";
+ reg = <0x0 0x100>;
++ clocks = <&ext_26m>;
+ clock-names = "ext-26m";
+ #clock-cells = <1>;
+ };
+--
+2.43.0
+
--- /dev/null
+From 451f5289083b1b6e9caad1d457bcbd4576467650 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 17:28:24 +0800
+Subject: arm64: dts: sprd: Change UMS512 idle-state nodename to match bindings
+
+From: Chunyan Zhang <chunyan.zhang@unisoc.com>
+
+[ Upstream commit 1cff7243334f851b7dddf450abdaa6223a7a28e3 ]
+
+Fix below dtbs_check warning:
+
+idle-states: 'core-pd' does not match any of the regexes: '^(cpu|cluster)-', 'pinctrl-[0-9]+'
+
+Link: https://lore.kernel.org/r/20231221092824.1169453-3-chunyan.zhang@unisoc.com
+Signed-off-by: Chunyan Zhang <chunyan.zhang@unisoc.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/sprd/ums512.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm64/boot/dts/sprd/ums512.dtsi b/arch/arm64/boot/dts/sprd/ums512.dtsi
+index 91c22667d40f..cc4459551e05 100644
+--- a/arch/arm64/boot/dts/sprd/ums512.dtsi
++++ b/arch/arm64/boot/dts/sprd/ums512.dtsi
+@@ -113,7 +113,7 @@
+
+ idle-states {
+ entry-method = "psci";
+- CORE_PD: core-pd {
++ CORE_PD: cpu-pd {
+ compatible = "arm,idle-state";
+ entry-latency-us = <4000>;
+ exit-latency-us = <4000>;
+--
+2.43.0
+
--- /dev/null
+From 100de9bf09df05fa61d39f4c0a80e09a5518bd83 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 24 Nov 2023 11:15:13 +0800
+Subject: arm64: irq: set the correct node for VMAP stack
+
+From: Huang Shijie <shijie@os.amperecomputing.com>
+
+[ Upstream commit 75b5e0bf90bffaca4b1f19114065dc59f5cc161f ]
+
+In current code, init_irq_stacks() will call cpu_to_node().
+The cpu_to_node() depends on percpu "numa_node" which is initialized in:
+ arch_call_rest_init() --> rest_init() -- kernel_init()
+ --> kernel_init_freeable() --> smp_prepare_cpus()
+
+But init_irq_stacks() is called in init_IRQ() which is before
+arch_call_rest_init().
+
+So in init_irq_stacks(), the cpu_to_node() does not work, it
+always return 0. In NUMA, it makes the node 1 cpu accesses the IRQ stack which
+is in the node 0.
+
+This patch fixes it by:
+ 1.) export the early_cpu_to_node(), and use it in the init_irq_stacks().
+ 2.) change init_irq_stacks() to __init function.
+
+Reviewed-by: Catalin Marinas <catalin.marinas@arm.com>
+Signed-off-by: Huang Shijie <shijie@os.amperecomputing.com>
+Link: https://lore.kernel.org/r/20231124031513.81548-1-shijie@os.amperecomputing.com
+Signed-off-by: Will Deacon <will@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/kernel/irq.c | 5 +++--
+ drivers/base/arch_numa.c | 2 +-
+ include/asm-generic/numa.h | 2 ++
+ 3 files changed, 6 insertions(+), 3 deletions(-)
+
+diff --git a/arch/arm64/kernel/irq.c b/arch/arm64/kernel/irq.c
+index 6ad5c6ef5329..9f253d8efe90 100644
+--- a/arch/arm64/kernel/irq.c
++++ b/arch/arm64/kernel/irq.c
+@@ -22,6 +22,7 @@
+ #include <linux/vmalloc.h>
+ #include <asm/daifflags.h>
+ #include <asm/exception.h>
++#include <asm/numa.h>
+ #include <asm/softirq_stack.h>
+ #include <asm/stacktrace.h>
+ #include <asm/vmap_stack.h>
+@@ -51,13 +52,13 @@ static void init_irq_scs(void)
+ }
+
+ #ifdef CONFIG_VMAP_STACK
+-static void init_irq_stacks(void)
++static void __init init_irq_stacks(void)
+ {
+ int cpu;
+ unsigned long *p;
+
+ for_each_possible_cpu(cpu) {
+- p = arch_alloc_vmap_stack(IRQ_STACK_SIZE, cpu_to_node(cpu));
++ p = arch_alloc_vmap_stack(IRQ_STACK_SIZE, early_cpu_to_node(cpu));
+ per_cpu(irq_stack_ptr, cpu) = p;
+ }
+ }
+diff --git a/drivers/base/arch_numa.c b/drivers/base/arch_numa.c
+index eaa31e567d1e..5b59d133b6af 100644
+--- a/drivers/base/arch_numa.c
++++ b/drivers/base/arch_numa.c
+@@ -144,7 +144,7 @@ void __init early_map_cpu_to_node(unsigned int cpu, int nid)
+ unsigned long __per_cpu_offset[NR_CPUS] __read_mostly;
+ EXPORT_SYMBOL(__per_cpu_offset);
+
+-static int __init early_cpu_to_node(int cpu)
++int __init early_cpu_to_node(int cpu)
+ {
+ return cpu_to_node_map[cpu];
+ }
+diff --git a/include/asm-generic/numa.h b/include/asm-generic/numa.h
+index 1a3ad6d29833..c32e0cf23c90 100644
+--- a/include/asm-generic/numa.h
++++ b/include/asm-generic/numa.h
+@@ -35,6 +35,7 @@ int __init numa_add_memblk(int nodeid, u64 start, u64 end);
+ void __init numa_set_distance(int from, int to, int distance);
+ void __init numa_free_distance(void);
+ void __init early_map_cpu_to_node(unsigned int cpu, int nid);
++int __init early_cpu_to_node(int cpu);
+ void numa_store_cpu_info(unsigned int cpu);
+ void numa_add_cpu(unsigned int cpu);
+ void numa_remove_cpu(unsigned int cpu);
+@@ -46,6 +47,7 @@ static inline void numa_add_cpu(unsigned int cpu) { }
+ static inline void numa_remove_cpu(unsigned int cpu) { }
+ static inline void arch_numa_init(void) { }
+ static inline void early_map_cpu_to_node(unsigned int cpu, int nid) { }
++static inline int early_cpu_to_node(int cpu) { return 0; }
+
+ #endif /* CONFIG_NUMA */
+
+--
+2.43.0
+
--- /dev/null
+From 0a2faf52f6e7019f4ebf67921ebe935274901a39 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 10:59:16 +0100
+Subject: arm64: zynqmp: Fix clock node name in kv260 cards
+
+From: Michal Simek <michal.simek@amd.com>
+
+[ Upstream commit 0bfb7950cc1975372c4c58c3d3f9803f05245d46 ]
+
+node name shouldn't use '_' that's why convert it to '-'.
+
+Signed-off-by: Michal Simek <michal.simek@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso | 12 ++++++------
+ arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso | 12 ++++++------
+ 2 files changed, 12 insertions(+), 12 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso
+index dee238739290..92f4190d564d 100644
+--- a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso
++++ b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso
+@@ -22,37 +22,37 @@
+ /plugin/;
+
+ &{/} {
+- si5332_0: si5332_0 { /* u17 */
++ si5332_0: si5332-0 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <125000000>;
+ };
+
+- si5332_1: si5332_1 { /* u17 */
++ si5332_1: si5332-1 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <25000000>;
+ };
+
+- si5332_2: si5332_2 { /* u17 */
++ si5332_2: si5332-2 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <48000000>;
+ };
+
+- si5332_3: si5332_3 { /* u17 */
++ si5332_3: si5332-3 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <24000000>;
+ };
+
+- si5332_4: si5332_4 { /* u17 */
++ si5332_4: si5332-4 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <26000000>;
+ };
+
+- si5332_5: si5332_5 { /* u17 */
++ si5332_5: si5332-5 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <27000000>;
+diff --git a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso
+index 73c5cb156caf..f88b71f5b07a 100644
+--- a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso
++++ b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso
+@@ -17,37 +17,37 @@
+ /plugin/;
+
+ &{/} {
+- si5332_0: si5332_0 { /* u17 */
++ si5332_0: si5332-0 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <125000000>;
+ };
+
+- si5332_1: si5332_1 { /* u17 */
++ si5332_1: si5332-1 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <25000000>;
+ };
+
+- si5332_2: si5332_2 { /* u17 */
++ si5332_2: si5332-2 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <48000000>;
+ };
+
+- si5332_3: si5332_3 { /* u17 */
++ si5332_3: si5332-3 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <24000000>;
+ };
+
+- si5332_4: si5332_4 { /* u17 */
++ si5332_4: si5332-4 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <26000000>;
+ };
+
+- si5332_5: si5332_5 { /* u17 */
++ si5332_5: si5332-5 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+ clock-frequency = <27000000>;
+--
+2.43.0
+
--- /dev/null
+From 398d665395b7e951111655b10e784a1ccc065ccc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 10:59:15 +0100
+Subject: arm64: zynqmp: Move fixed clock to / for kv260
+
+From: Michal Simek <michal.simek@amd.com>
+
+[ Upstream commit 6a10a19a6bd2fd8d27a510678bf87bd9408f51d8 ]
+
+fixed clock nodes can't be on the bus because they are missing reg
+property. That's why move them to root.
+And because it is root it is good to have it as the first node in a file.
+
+Signed-off-by: Michal Simek <michal.simek@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso | 28 ++++++++---------
+ .../boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso | 30 +++++++++----------
+ 2 files changed, 29 insertions(+), 29 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso
+index ae1b9b2bdbee..dee238739290 100644
+--- a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso
++++ b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revA.dtso
+@@ -21,20 +21,7 @@
+ /dts-v1/;
+ /plugin/;
+
+-&i2c1 { /* I2C_SCK C23/C24 - MIO from SOM */
+- #address-cells = <1>;
+- #size-cells = <0>;
+- pinctrl-names = "default", "gpio";
+- pinctrl-0 = <&pinctrl_i2c1_default>;
+- pinctrl-1 = <&pinctrl_i2c1_gpio>;
+- scl-gpios = <&gpio 24 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
+- sda-gpios = <&gpio 25 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
+-
+- /* u14 - 0x40 - ina260 */
+- /* u27 - 0xe0 - STDP4320 DP/HDMI splitter */
+-};
+-
+-&amba {
++&{/} {
+ si5332_0: si5332_0 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+@@ -72,6 +59,19 @@
+ };
+ };
+
++&i2c1 { /* I2C_SCK C23/C24 - MIO from SOM */
++ #address-cells = <1>;
++ #size-cells = <0>;
++ pinctrl-names = "default", "gpio";
++ pinctrl-0 = <&pinctrl_i2c1_default>;
++ pinctrl-1 = <&pinctrl_i2c1_gpio>;
++ scl-gpios = <&gpio 24 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
++ sda-gpios = <&gpio 25 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
++
++ /* u14 - 0x40 - ina260 */
++ /* u27 - 0xe0 - STDP4320 DP/HDMI splitter */
++};
++
+ /* DP/USB 3.0 and SATA */
+ &psgtr {
+ status = "okay";
+diff --git a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso
+index b59e48be6465..73c5cb156caf 100644
+--- a/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso
++++ b/arch/arm64/boot/dts/xilinx/zynqmp-sck-kv-g-revB.dtso
+@@ -16,21 +16,7 @@
+ /dts-v1/;
+ /plugin/;
+
+-&i2c1 { /* I2C_SCK C23/C24 - MIO from SOM */
+- #address-cells = <1>;
+- #size-cells = <0>;
+- pinctrl-names = "default", "gpio";
+- pinctrl-0 = <&pinctrl_i2c1_default>;
+- pinctrl-1 = <&pinctrl_i2c1_gpio>;
+- scl-gpios = <&gpio 24 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
+- sda-gpios = <&gpio 25 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
+-
+- /* u14 - 0x40 - ina260 */
+- /* u43 - 0x2d - usb5744 */
+- /* u27 - 0xe0 - STDP4320 DP/HDMI splitter */
+-};
+-
+-&amba {
++&{/} {
+ si5332_0: si5332_0 { /* u17 */
+ compatible = "fixed-clock";
+ #clock-cells = <0>;
+@@ -68,6 +54,20 @@
+ };
+ };
+
++&i2c1 { /* I2C_SCK C23/C24 - MIO from SOM */
++ #address-cells = <1>;
++ #size-cells = <0>;
++ pinctrl-names = "default", "gpio";
++ pinctrl-0 = <&pinctrl_i2c1_default>;
++ pinctrl-1 = <&pinctrl_i2c1_gpio>;
++ scl-gpios = <&gpio 24 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
++ sda-gpios = <&gpio 25 (GPIO_ACTIVE_HIGH | GPIO_OPEN_DRAIN)>;
++
++ /* u14 - 0x40 - ina260 */
++ /* u43 - 0x2d - usb5744 */
++ /* u27 - 0xe0 - STDP4320 DP/HDMI splitter */
++};
++
+ /* DP/USB 3.0 */
+ &psgtr {
+ status = "okay";
+--
+2.43.0
+
--- /dev/null
+From f132321a72c75e791bd338a966b6de41754a6d8c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 7 Jan 2024 22:16:45 -0800
+Subject: asm-generic: make sparse happy with odd-sized put_unaligned_*()
+
+From: Dmitry Torokhov <dmitry.torokhov@gmail.com>
+
+[ Upstream commit 1ab33c03145d0f6c345823fc2da935d9a1a9e9fc ]
+
+__put_unaligned_be24() and friends use implicit casts to convert
+larger-sized data to bytes, which trips sparse truncation warnings when
+the argument is a constant:
+
+ CC [M] drivers/input/touchscreen/hynitron_cstxxx.o
+ CHECK drivers/input/touchscreen/hynitron_cstxxx.c
+ drivers/input/touchscreen/hynitron_cstxxx.c: note: in included file (through arch/x86/include/generated/asm/unaligned.h):
+ include/asm-generic/unaligned.h:119:16: warning: cast truncates bits from constant value (aa01a0 becomes a0)
+ include/asm-generic/unaligned.h:120:20: warning: cast truncates bits from constant value (aa01 becomes 1)
+ include/asm-generic/unaligned.h:119:16: warning: cast truncates bits from constant value (ab00d0 becomes d0)
+ include/asm-generic/unaligned.h:120:20: warning: cast truncates bits from constant value (ab00 becomes 0)
+
+To avoid this let's mask off upper bits explicitly, the resulting code
+should be exactly the same, but it will keep sparse happy.
+
+Reported-by: kernel test robot <lkp@intel.com>
+Suggested-by: Linus Torvalds <torvalds@linux-foundation.org>
+Closes: https://lore.kernel.org/oe-kbuild-all/202401070147.gqwVulOn-lkp@intel.com/
+Signed-off-by: Dmitry Torokhov <dmitry.torokhov@gmail.com>
+Signed-off-by: Linus Torvalds <torvalds@linux-foundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/asm-generic/unaligned.h | 24 ++++++++++++------------
+ 1 file changed, 12 insertions(+), 12 deletions(-)
+
+diff --git a/include/asm-generic/unaligned.h b/include/asm-generic/unaligned.h
+index 699650f81970..a84c64e5f11e 100644
+--- a/include/asm-generic/unaligned.h
++++ b/include/asm-generic/unaligned.h
+@@ -104,9 +104,9 @@ static inline u32 get_unaligned_le24(const void *p)
+
+ static inline void __put_unaligned_be24(const u32 val, u8 *p)
+ {
+- *p++ = val >> 16;
+- *p++ = val >> 8;
+- *p++ = val;
++ *p++ = (val >> 16) & 0xff;
++ *p++ = (val >> 8) & 0xff;
++ *p++ = val & 0xff;
+ }
+
+ static inline void put_unaligned_be24(const u32 val, void *p)
+@@ -116,9 +116,9 @@ static inline void put_unaligned_be24(const u32 val, void *p)
+
+ static inline void __put_unaligned_le24(const u32 val, u8 *p)
+ {
+- *p++ = val;
+- *p++ = val >> 8;
+- *p++ = val >> 16;
++ *p++ = val & 0xff;
++ *p++ = (val >> 8) & 0xff;
++ *p++ = (val >> 16) & 0xff;
+ }
+
+ static inline void put_unaligned_le24(const u32 val, void *p)
+@@ -128,12 +128,12 @@ static inline void put_unaligned_le24(const u32 val, void *p)
+
+ static inline void __put_unaligned_be48(const u64 val, u8 *p)
+ {
+- *p++ = val >> 40;
+- *p++ = val >> 32;
+- *p++ = val >> 24;
+- *p++ = val >> 16;
+- *p++ = val >> 8;
+- *p++ = val;
++ *p++ = (val >> 40) & 0xff;
++ *p++ = (val >> 32) & 0xff;
++ *p++ = (val >> 24) & 0xff;
++ *p++ = (val >> 16) & 0xff;
++ *p++ = (val >> 8) & 0xff;
++ *p++ = val & 0xff;
+ }
+
+ static inline void put_unaligned_be48(const u64 val, void *p)
+--
+2.43.0
+
--- /dev/null
+From a7d74e7183b300968016cfa1933ff71b6e38dcab Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 16:36:12 +0530
+Subject: ASoC: amd: Add new dmi entries for acp5x platform
+
+From: Venkata Prasad Potturu <venkataprasad.potturu@amd.com>
+
+[ Upstream commit c3ab23a10771bbe06300e5374efa809789c65455 ]
+
+Add sys_vendor and product_name dmi entries for acp5x platform.
+
+Signed-off-by: Venkata Prasad Potturu <venkataprasad.potturu@amd.com>
+Link: https://lore.kernel.org/r/20231206110620.1695591-1-venkataprasad.potturu@amd.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/soc/amd/acp-config.c | 15 ++++++++++++++-
+ 1 file changed, 14 insertions(+), 1 deletion(-)
+
+diff --git a/sound/soc/amd/acp-config.c b/sound/soc/amd/acp-config.c
+index 3bc4b2e41650..dea6d367b9e8 100644
+--- a/sound/soc/amd/acp-config.c
++++ b/sound/soc/amd/acp-config.c
+@@ -3,7 +3,7 @@
+ // This file is provided under a dual BSD/GPLv2 license. When using or
+ // redistributing this file, you may do so under either license.
+ //
+-// Copyright(c) 2021 Advanced Micro Devices, Inc.
++// Copyright(c) 2021, 2023 Advanced Micro Devices, Inc.
+ //
+ // Authors: Ajit Kumar Pandey <AjitKumar.Pandey@amd.com>
+ //
+@@ -47,6 +47,19 @@ static const struct config_entry config_table[] = {
+ {}
+ },
+ },
++ {
++ .flags = FLAG_AMD_LEGACY,
++ .device = ACP_PCI_DEV_ID,
++ .dmi_table = (const struct dmi_system_id []) {
++ {
++ .matches = {
++ DMI_MATCH(DMI_SYS_VENDOR, "Valve"),
++ DMI_MATCH(DMI_PRODUCT_NAME, "Jupiter"),
++ },
++ },
++ {}
++ },
++ },
+ {
+ .flags = FLAG_AMD_SOF,
+ .device = ACP_PCI_DEV_ID,
+--
+2.43.0
+
--- /dev/null
+From 22bd7c123e9a18840d286010ff2213ed7ff4af9d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 29 Dec 2023 09:46:01 +0800
+Subject: ASoC: codecs: rtq9128: Fix PM_RUNTIME usage
+
+From: ChiYuan Huang <cy_huang@richtek.com>
+
+[ Upstream commit 35040410372ca27a33cec8382d42c90b6b6c99f6 ]
+
+If 'pm_runtime_resume_and_get' is used, must check the return value to
+prevent the active count not matched problem.
+
+Signed-off-by: ChiYuan Huang <cy_huang@richtek.com>
+Link: https://msgid.link/r/bebd9e2bed9e0528a7fd9c528d785da02caf4f1a.1703813842.git.cy_huang@richtek.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/soc/codecs/rtq9128.c | 6 +++++-
+ 1 file changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/sound/soc/codecs/rtq9128.c b/sound/soc/codecs/rtq9128.c
+index c22b047115cc..bda64f9eeb62 100644
+--- a/sound/soc/codecs/rtq9128.c
++++ b/sound/soc/codecs/rtq9128.c
+@@ -391,7 +391,11 @@ static int rtq9128_component_probe(struct snd_soc_component *comp)
+ unsigned int val;
+ int i, ret;
+
+- pm_runtime_resume_and_get(comp->dev);
++ ret = pm_runtime_resume_and_get(comp->dev);
++ if (ret < 0) {
++ dev_err(comp->dev, "Failed to resume device (%d)\n", ret);
++ return ret;
++ }
+
+ val = snd_soc_component_read(comp, RTQ9128_REG_EFUSE_DATA);
+
+--
+2.43.0
+
--- /dev/null
+From b0b6cab33b7ecf054ec5c6966a79dfae9f5ab5bf Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 29 Dec 2023 09:46:02 +0800
+Subject: ASoC: codecs: rtq9128: Fix TDM enable and DAI format control flow
+
+From: ChiYuan Huang <cy_huang@richtek.com>
+
+[ Upstream commit 415d10ccef712f3ec73cd880c1fef3eb48601c3a ]
+
+To enable TDM mode, the current control flow limits the function
+calling order should be 'set_tdm_slot->set_dai_fmt'. But not all
+platform sound card like as simeple card to follow this design.
+To bypass this limit, adjust the DAI format setting in runtime
+'hw_param' callback.
+
+Signed-off-by: ChiYuan Huang <cy_huang@richtek.com>
+Link: https://msgid.link/r/c4c8df00d8d179b8b5b39a8521de3a85325c57e8.1703813842.git.cy_huang@richtek.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/soc/codecs/rtq9128.c | 67 ++++++++++++++++++++------------------
+ 1 file changed, 36 insertions(+), 31 deletions(-)
+
+diff --git a/sound/soc/codecs/rtq9128.c b/sound/soc/codecs/rtq9128.c
+index bda64f9eeb62..aa3eadecd974 100644
+--- a/sound/soc/codecs/rtq9128.c
++++ b/sound/soc/codecs/rtq9128.c
+@@ -59,6 +59,7 @@
+
+ struct rtq9128_data {
+ struct gpio_desc *enable;
++ unsigned int daifmt;
+ int tdm_slots;
+ int tdm_slot_width;
+ bool tdm_input_data2_select;
+@@ -441,10 +442,7 @@ static const struct snd_soc_component_driver rtq9128_comp_driver = {
+ static int rtq9128_dai_set_fmt(struct snd_soc_dai *dai, unsigned int fmt)
+ {
+ struct rtq9128_data *data = snd_soc_dai_get_drvdata(dai);
+- struct snd_soc_component *comp = dai->component;
+ struct device *dev = dai->dev;
+- unsigned int audfmt, fmtval;
+- int ret;
+
+ dev_dbg(dev, "%s: fmt 0x%8x\n", __func__, fmt);
+
+@@ -454,35 +452,10 @@ static int rtq9128_dai_set_fmt(struct snd_soc_dai *dai, unsigned int fmt)
+ return -EINVAL;
+ }
+
+- fmtval = fmt & SND_SOC_DAIFMT_FORMAT_MASK;
+- if (data->tdm_slots && fmtval != SND_SOC_DAIFMT_DSP_A && fmtval != SND_SOC_DAIFMT_DSP_B) {
+- dev_err(dev, "TDM is used, format only support DSP_A or DSP_B\n");
+- return -EINVAL;
+- }
++ /* Store here and will be used in runtime hw_params for DAI format setting */
++ data->daifmt = fmt;
+
+- switch (fmtval) {
+- case SND_SOC_DAIFMT_I2S:
+- audfmt = 8;
+- break;
+- case SND_SOC_DAIFMT_LEFT_J:
+- audfmt = 9;
+- break;
+- case SND_SOC_DAIFMT_RIGHT_J:
+- audfmt = 10;
+- break;
+- case SND_SOC_DAIFMT_DSP_A:
+- audfmt = data->tdm_slots ? 12 : 11;
+- break;
+- case SND_SOC_DAIFMT_DSP_B:
+- audfmt = data->tdm_slots ? 4 : 3;
+- break;
+- default:
+- dev_err(dev, "Unsupported format 0x%8x\n", fmt);
+- return -EINVAL;
+- }
+-
+- ret = snd_soc_component_write_field(comp, RTQ9128_REG_I2S_OPT, RTQ9128_AUDFMT_MASK, audfmt);
+- return ret < 0 ? ret : 0;
++ return 0;
+ }
+
+ static int rtq9128_dai_set_tdm_slot(struct snd_soc_dai *dai, unsigned int tx_mask,
+@@ -558,10 +531,38 @@ static int rtq9128_dai_hw_params(struct snd_pcm_substream *stream, struct snd_pc
+ unsigned int width, slot_width, bitrate, audbit, dolen;
+ struct snd_soc_component *comp = dai->component;
+ struct device *dev = dai->dev;
++ unsigned int fmtval, audfmt;
+ int ret;
+
+ dev_dbg(dev, "%s: width %d\n", __func__, params_width(param));
+
++ fmtval = FIELD_GET(SND_SOC_DAIFMT_FORMAT_MASK, data->daifmt);
++ if (data->tdm_slots && fmtval != SND_SOC_DAIFMT_DSP_A && fmtval != SND_SOC_DAIFMT_DSP_B) {
++ dev_err(dev, "TDM is used, format only support DSP_A or DSP_B\n");
++ return -EINVAL;
++ }
++
++ switch (fmtval) {
++ case SND_SOC_DAIFMT_I2S:
++ audfmt = 8;
++ break;
++ case SND_SOC_DAIFMT_LEFT_J:
++ audfmt = 9;
++ break;
++ case SND_SOC_DAIFMT_RIGHT_J:
++ audfmt = 10;
++ break;
++ case SND_SOC_DAIFMT_DSP_A:
++ audfmt = data->tdm_slots ? 12 : 11;
++ break;
++ case SND_SOC_DAIFMT_DSP_B:
++ audfmt = data->tdm_slots ? 4 : 3;
++ break;
++ default:
++ dev_err(dev, "Unsupported format 0x%8x\n", fmtval);
++ return -EINVAL;
++ }
++
+ switch (width = params_width(param)) {
+ case 16:
+ audbit = 0;
+@@ -615,6 +616,10 @@ static int rtq9128_dai_hw_params(struct snd_pcm_substream *stream, struct snd_pc
+ return -EINVAL;
+ }
+
++ ret = snd_soc_component_write_field(comp, RTQ9128_REG_I2S_OPT, RTQ9128_AUDFMT_MASK, audfmt);
++ if (ret < 0)
++ return ret;
++
+ ret = snd_soc_component_write_field(comp, RTQ9128_REG_I2S_OPT, RTQ9128_AUDBIT_MASK, audbit);
+ if (ret < 0)
+ return ret;
+--
+2.43.0
+
--- /dev/null
+From 27ae93b2d6ce3446f5ca290387a82ead5b359546 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 14:07:51 +0200
+Subject: ASoC: doc: Fix undefined SND_SOC_DAPM_NOPM argument
+
+From: Cristian Ciocaltea <cristian.ciocaltea@collabora.com>
+
+[ Upstream commit 67c7666fe808c3a7af3cc6f9d0a3dd3acfd26115 ]
+
+The virtual widget example makes use of an undefined SND_SOC_DAPM_NOPM
+argument passed to SND_SOC_DAPM_MIXER(). Replace with the correct
+SND_SOC_NOPM definition.
+
+Signed-off-by: Cristian Ciocaltea <cristian.ciocaltea@collabora.com>
+Link: https://lore.kernel.org/r/20231121120751.77355-1-cristian.ciocaltea@collabora.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ Documentation/sound/soc/dapm.rst | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/Documentation/sound/soc/dapm.rst b/Documentation/sound/soc/dapm.rst
+index 8e44107933ab..c3154ce6e1b2 100644
+--- a/Documentation/sound/soc/dapm.rst
++++ b/Documentation/sound/soc/dapm.rst
+@@ -234,7 +234,7 @@ corresponding soft power control. In this case it is necessary to create
+ a virtual widget - a widget with no control bits e.g.
+ ::
+
+- SND_SOC_DAPM_MIXER("AC97 Mixer", SND_SOC_DAPM_NOPM, 0, 0, NULL, 0),
++ SND_SOC_DAPM_MIXER("AC97 Mixer", SND_SOC_NOPM, 0, 0, NULL, 0),
+
+ This can be used to merge to signal paths together in software.
+
+--
+2.43.0
+
--- /dev/null
+From 43eafcd32748d975a8d2644c536d448d81c53ee8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 18 Oct 2023 09:23:51 +0000
+Subject: audit: Send netlink ACK before setting connection in auditd_set
+
+From: Chris Riches <chris.riches@nutanix.com>
+
+[ Upstream commit 022732e3d846e197539712e51ecada90ded0572a ]
+
+When auditd_set sets the auditd_conn pointer, audit messages can
+immediately be put on the socket by other kernel threads. If the backlog
+is large or the rate is high, this can immediately fill the socket
+buffer. If the audit daemon requested an ACK for this operation, a full
+socket buffer causes the ACK to get dropped, also setting ENOBUFS on the
+socket.
+
+To avoid this race and ensure ACKs get through, fast-track the ACK in
+this specific case to ensure it is sent before auditd_conn is set.
+
+Signed-off-by: Chris Riches <chris.riches@nutanix.com>
+[PM: fix some tab vs space damage]
+Signed-off-by: Paul Moore <paul@paul-moore.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/audit.c | 31 ++++++++++++++++++++++++-------
+ 1 file changed, 24 insertions(+), 7 deletions(-)
+
+diff --git a/kernel/audit.c b/kernel/audit.c
+index 16205dd29843..9c8e5f732c4c 100644
+--- a/kernel/audit.c
++++ b/kernel/audit.c
+@@ -487,15 +487,19 @@ static void auditd_conn_free(struct rcu_head *rcu)
+ * @pid: auditd PID
+ * @portid: auditd netlink portid
+ * @net: auditd network namespace pointer
++ * @skb: the netlink command from the audit daemon
++ * @ack: netlink ack flag, cleared if ack'd here
+ *
+ * Description:
+ * This function will obtain and drop network namespace references as
+ * necessary. Returns zero on success, negative values on failure.
+ */
+-static int auditd_set(struct pid *pid, u32 portid, struct net *net)
++static int auditd_set(struct pid *pid, u32 portid, struct net *net,
++ struct sk_buff *skb, bool *ack)
+ {
+ unsigned long flags;
+ struct auditd_connection *ac_old, *ac_new;
++ struct nlmsghdr *nlh;
+
+ if (!pid || !net)
+ return -EINVAL;
+@@ -507,6 +511,13 @@ static int auditd_set(struct pid *pid, u32 portid, struct net *net)
+ ac_new->portid = portid;
+ ac_new->net = get_net(net);
+
++ /* send the ack now to avoid a race with the queue backlog */
++ if (*ack) {
++ nlh = nlmsg_hdr(skb);
++ netlink_ack(skb, nlh, 0, NULL);
++ *ack = false;
++ }
++
+ spin_lock_irqsave(&auditd_conn_lock, flags);
+ ac_old = rcu_dereference_protected(auditd_conn,
+ lockdep_is_held(&auditd_conn_lock));
+@@ -1200,7 +1211,8 @@ static int audit_replace(struct pid *pid)
+ return auditd_send_unicast_skb(skb);
+ }
+
+-static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh)
++static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh,
++ bool *ack)
+ {
+ u32 seq;
+ void *data;
+@@ -1293,7 +1305,8 @@ static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh)
+ /* register a new auditd connection */
+ err = auditd_set(req_pid,
+ NETLINK_CB(skb).portid,
+- sock_net(NETLINK_CB(skb).sk));
++ sock_net(NETLINK_CB(skb).sk),
++ skb, ack);
+ if (audit_enabled != AUDIT_OFF)
+ audit_log_config_change("audit_pid",
+ new_pid,
+@@ -1538,9 +1551,10 @@ static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh)
+ * Parse the provided skb and deal with any messages that may be present,
+ * malformed skbs are discarded.
+ */
+-static void audit_receive(struct sk_buff *skb)
++static void audit_receive(struct sk_buff *skb)
+ {
+ struct nlmsghdr *nlh;
++ bool ack;
+ /*
+ * len MUST be signed for nlmsg_next to be able to dec it below 0
+ * if the nlmsg_len was not aligned
+@@ -1553,9 +1567,12 @@ static void audit_receive(struct sk_buff *skb)
+
+ audit_ctl_lock();
+ while (nlmsg_ok(nlh, len)) {
+- err = audit_receive_msg(skb, nlh);
+- /* if err or if this message says it wants a response */
+- if (err || (nlh->nlmsg_flags & NLM_F_ACK))
++ ack = nlh->nlmsg_flags & NLM_F_ACK;
++ err = audit_receive_msg(skb, nlh, &ack);
++
++ /* send an ack if the user asked for one and audit_receive_msg
++ * didn't already do it, or if there was an error. */
++ if (ack || err)
+ netlink_ack(skb, nlh, err, NULL);
+
+ nlh = nlmsg_next(nlh, &len);
+--
+2.43.0
+
--- /dev/null
+From 65ab63b9f3fe4df795e98c69d5fc8c4c1af4ff2c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 12 Jan 2024 20:26:26 +0800
+Subject: blk-mq: fix IO hang from sbitmap wakeup race
+
+From: Ming Lei <ming.lei@redhat.com>
+
+[ Upstream commit 5266caaf5660529e3da53004b8b7174cab6374ed ]
+
+In blk_mq_mark_tag_wait(), __add_wait_queue() may be re-ordered
+with the following blk_mq_get_driver_tag() in case of getting driver
+tag failure.
+
+Then in __sbitmap_queue_wake_up(), waitqueue_active() may not observe
+the added waiter in blk_mq_mark_tag_wait() and wake up nothing, meantime
+blk_mq_mark_tag_wait() can't get driver tag successfully.
+
+This issue can be reproduced by running the following test in loop, and
+fio hang can be observed in < 30min when running it on my test VM
+in laptop.
+
+ modprobe -r scsi_debug
+ modprobe scsi_debug delay=0 dev_size_mb=4096 max_queue=1 host_max_queue=1 submit_queues=4
+ dev=`ls -d /sys/bus/pseudo/drivers/scsi_debug/adapter*/host*/target*/*/block/* | head -1 | xargs basename`
+ fio --filename=/dev/"$dev" --direct=1 --rw=randrw --bs=4k --iodepth=1 \
+ --runtime=100 --numjobs=40 --time_based --name=test \
+ --ioengine=libaio
+
+Fix the issue by adding one explicit barrier in blk_mq_mark_tag_wait(), which
+is just fine in case of running out of tag.
+
+Cc: Jan Kara <jack@suse.cz>
+Cc: Kemeng Shi <shikemeng@huaweicloud.com>
+Reported-by: Changhui Zhong <czhong@redhat.com>
+Signed-off-by: Ming Lei <ming.lei@redhat.com>
+Link: https://lore.kernel.org/r/20240112122626.4181044-1-ming.lei@redhat.com
+Signed-off-by: Jens Axboe <axboe@kernel.dk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ block/blk-mq.c | 16 ++++++++++++++++
+ 1 file changed, 16 insertions(+)
+
+diff --git a/block/blk-mq.c b/block/blk-mq.c
+index 7e743ac58c31..a71974a5e57c 100644
+--- a/block/blk-mq.c
++++ b/block/blk-mq.c
+@@ -1858,6 +1858,22 @@ static bool blk_mq_mark_tag_wait(struct blk_mq_hw_ctx *hctx,
+ wait->flags &= ~WQ_FLAG_EXCLUSIVE;
+ __add_wait_queue(wq, wait);
+
++ /*
++ * Add one explicit barrier since blk_mq_get_driver_tag() may
++ * not imply barrier in case of failure.
++ *
++ * Order adding us to wait queue and allocating driver tag.
++ *
++ * The pair is the one implied in sbitmap_queue_wake_up() which
++ * orders clearing sbitmap tag bits and waitqueue_active() in
++ * __sbitmap_queue_wake_up(), since waitqueue_active() is lockless
++ *
++ * Otherwise, re-order of adding wait queue and getting driver tag
++ * may cause __sbitmap_queue_wake_up() to wake up nothing because
++ * the waitqueue_active() may not observe us in wait queue.
++ */
++ smp_mb();
++
+ /*
+ * It's possible that a tag was freed in the window between the
+ * allocation failure and adding the hardware queue to the wait
+--
+2.43.0
+
--- /dev/null
+From 9c8ef54da192780f7f598398fe976e118be69cc6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 18:34:18 +0100
+Subject: block: prevent an integer overflow in bvec_try_merge_hw_page
+
+From: Christoph Hellwig <hch@lst.de>
+
+[ Upstream commit 3f034c374ad55773c12dd8f3c1607328e17c0072 ]
+
+Reordered a check to avoid a possible overflow when adding len to bv_len.
+
+Signed-off-by: Christoph Hellwig <hch@lst.de>
+Reviewed-by: Johannes Thumshirn <johannes.thumshirn@wdc.com>
+Link: https://lore.kernel.org/r/20231204173419.782378-2-hch@lst.de
+Signed-off-by: Jens Axboe <axboe@kernel.dk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ block/bio.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/block/bio.c b/block/bio.c
+index 5eba53ca953b..270f6b99926e 100644
+--- a/block/bio.c
++++ b/block/bio.c
+@@ -944,7 +944,7 @@ bool bvec_try_merge_hw_page(struct request_queue *q, struct bio_vec *bv,
+
+ if ((addr1 | mask) != (addr2 | mask))
+ return false;
+- if (bv->bv_len + len > queue_max_segment_size(q))
++ if (len > queue_max_segment_size(q) - bv->bv_len)
+ return false;
+ return bvec_try_merge_page(bv, page, len, offset, same_page);
+ }
+--
+2.43.0
+
--- /dev/null
+From 6845298e6015f056a66c1d724da91dfb616fc273 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 13:47:42 -0800
+Subject: block/rnbd-srv: Check for unlikely string overflow
+
+From: Kees Cook <keescook@chromium.org>
+
+[ Upstream commit 9e4bf6a08d1e127bcc4bd72557f2dfafc6bc7f41 ]
+
+Since "dev_search_path" can technically be as large as PATH_MAX,
+there was a risk of truncation when copying it and a second string
+into "full_path" since it was also PATH_MAX sized. The W=1 builds were
+reporting this warning:
+
+drivers/block/rnbd/rnbd-srv.c: In function 'process_msg_open.isra':
+drivers/block/rnbd/rnbd-srv.c:616:51: warning: '%s' directive output may be truncated writing up to 254 bytes into a region of size between 0 and 4095 [-Wformat-truncation=]
+ 616 | snprintf(full_path, PATH_MAX, "%s/%s",
+ | ^~
+In function 'rnbd_srv_get_full_path',
+ inlined from 'process_msg_open.isra' at drivers/block/rnbd/rnbd-srv.c:721:14: drivers/block/rnbd/rnbd-srv.c:616:17: note: 'snprintf' output between 2 and 4351 bytes into a destination of size 4096
+ 616 | snprintf(full_path, PATH_MAX, "%s/%s",
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+ 617 | dev_search_path, dev_name);
+ | ~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+To fix this, unconditionally check for truncation (as was already done
+for the case where "%SESSNAME%" was present).
+
+Reported-by: kernel test robot <lkp@intel.com>
+Closes: https://lore.kernel.org/oe-kbuild-all/202312100355.lHoJPgKy-lkp@intel.com/
+Cc: Md. Haris Iqbal <haris.iqbal@ionos.com>
+Cc: Jack Wang <jinpu.wang@ionos.com>
+Cc: Jens Axboe <axboe@kernel.dk>
+Cc: <linux-block@vger.kernel.org>
+Signed-off-by: Kees Cook <keescook@chromium.org>
+Acked-by: Guoqing Jiang <guoqing.jiang@linux.dev>
+Acked-by: Jack Wang <jinpu.wang@ionos.com>
+Link: https://lore.kernel.org/r/20231212214738.work.169-kees@kernel.org
+Signed-off-by: Jens Axboe <axboe@kernel.dk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/block/rnbd/rnbd-srv.c | 19 ++++++++++---------
+ 1 file changed, 10 insertions(+), 9 deletions(-)
+
+diff --git a/drivers/block/rnbd/rnbd-srv.c b/drivers/block/rnbd/rnbd-srv.c
+index 65de51f3dfd9..ab78eab97d98 100644
+--- a/drivers/block/rnbd/rnbd-srv.c
++++ b/drivers/block/rnbd/rnbd-srv.c
+@@ -585,6 +585,7 @@ static char *rnbd_srv_get_full_path(struct rnbd_srv_session *srv_sess,
+ {
+ char *full_path;
+ char *a, *b;
++ int len;
+
+ full_path = kmalloc(PATH_MAX, GFP_KERNEL);
+ if (!full_path)
+@@ -596,19 +597,19 @@ static char *rnbd_srv_get_full_path(struct rnbd_srv_session *srv_sess,
+ */
+ a = strnstr(dev_search_path, "%SESSNAME%", sizeof(dev_search_path));
+ if (a) {
+- int len = a - dev_search_path;
++ len = a - dev_search_path;
+
+ len = snprintf(full_path, PATH_MAX, "%.*s/%s/%s", len,
+ dev_search_path, srv_sess->sessname, dev_name);
+- if (len >= PATH_MAX) {
+- pr_err("Too long path: %s, %s, %s\n",
+- dev_search_path, srv_sess->sessname, dev_name);
+- kfree(full_path);
+- return ERR_PTR(-EINVAL);
+- }
+ } else {
+- snprintf(full_path, PATH_MAX, "%s/%s",
+- dev_search_path, dev_name);
++ len = snprintf(full_path, PATH_MAX, "%s/%s",
++ dev_search_path, dev_name);
++ }
++ if (len >= PATH_MAX) {
++ pr_err("Too long path: %s, %s, %s\n",
++ dev_search_path, srv_sess->sessname, dev_name);
++ kfree(full_path);
++ return ERR_PTR(-EINVAL);
+ }
+
+ /* eliminitate duplicated slashes */
+--
+2.43.0
+
--- /dev/null
+From f794dab2ed4775a809fbd4fd663a402bb0209d04 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 18:24:17 +0800
+Subject: Bluetooth: hci_sync: fix BR/EDR wakeup bug
+
+From: clancy shang <clancy.shang@quectel.com>
+
+[ Upstream commit d4b70ba1eab450eff9c5ef536f07c01d424b7eda ]
+
+when Bluetooth set the event mask and enter suspend, the controller
+has hci mode change event coming, it cause controller can not enter
+sleep mode. so it should to set the hci mode change event mask before
+enter suspend.
+
+Signed-off-by: clancy shang <clancy.shang@quectel.com>
+Signed-off-by: Luiz Augusto von Dentz <luiz.von.dentz@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/bluetooth/hci_sync.c | 10 ++++++----
+ 1 file changed, 6 insertions(+), 4 deletions(-)
+
+diff --git a/net/bluetooth/hci_sync.c b/net/bluetooth/hci_sync.c
+index d85a7091a116..97284d9b2a2e 100644
+--- a/net/bluetooth/hci_sync.c
++++ b/net/bluetooth/hci_sync.c
+@@ -3800,12 +3800,14 @@ static int hci_set_event_mask_sync(struct hci_dev *hdev)
+ if (lmp_bredr_capable(hdev)) {
+ events[4] |= 0x01; /* Flow Specification Complete */
+
+- /* Don't set Disconnect Complete when suspended as that
+- * would wakeup the host when disconnecting due to
+- * suspend.
++ /* Don't set Disconnect Complete and mode change when
++ * suspended as that would wakeup the host when disconnecting
++ * due to suspend.
+ */
+- if (hdev->suspended)
++ if (hdev->suspended) {
+ events[0] &= 0xef;
++ events[2] &= 0xf7;
++ }
+ } else {
+ /* Use a different default for LE-only devices */
+ memset(events, 0, sizeof(events));
+--
+2.43.0
+
--- /dev/null
+From ad9d99def91799539cc438cf6edcf91fc222c05e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 18:11:40 +0200
+Subject: Bluetooth: ISO: Avoid creating child socket if PA sync is terminating
+
+From: Iulia Tanasescu <iulia.tanasescu@nxp.com>
+
+[ Upstream commit 9f150019f176078144b02c4b9b9dbe7fd5a2fcc3 ]
+
+When a PA sync socket is closed, the associated hcon is also unlinked
+and cleaned up. If there are no other hcons marked with the
+HCI_CONN_PA_SYNC flag, HCI_OP_LE_PA_TERM_SYNC is sent to controller.
+
+Between the time of the command and the moment PA sync is terminated
+in controller, residual BIGInfo reports might continue to come.
+This causes a new PA sync hcon to be added, and a new socket to be
+notified to user space.
+
+This commit fixs this by adding a flag on a Broadcast listening
+socket to mark when the PA sync child has been closed.
+
+This flag is checked when BIGInfo reports are indicated in
+iso_connect_ind, to avoid recreating a hcon and socket if
+residual reports arrive before PA sync is terminated.
+
+Signed-off-by: Iulia Tanasescu <iulia.tanasescu@nxp.com>
+Signed-off-by: Luiz Augusto von Dentz <luiz.von.dentz@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/bluetooth/iso.c | 51 ++++++++++++++++++++++++++++++++++++++++++---
+ 1 file changed, 48 insertions(+), 3 deletions(-)
+
+diff --git a/net/bluetooth/iso.c b/net/bluetooth/iso.c
+index 07b80e97aead..fd81289fd3e5 100644
+--- a/net/bluetooth/iso.c
++++ b/net/bluetooth/iso.c
+@@ -54,6 +54,7 @@ static void iso_sock_kill(struct sock *sk);
+ enum {
+ BT_SK_BIG_SYNC,
+ BT_SK_PA_SYNC,
++ BT_SK_PA_SYNC_TERM,
+ };
+
+ struct iso_pinfo {
+@@ -82,6 +83,11 @@ static bool iso_match_sid(struct sock *sk, void *data);
+ static bool iso_match_sync_handle(struct sock *sk, void *data);
+ static void iso_sock_disconn(struct sock *sk);
+
++typedef bool (*iso_sock_match_t)(struct sock *sk, void *data);
++
++static struct sock *iso_get_sock_listen(bdaddr_t *src, bdaddr_t *dst,
++ iso_sock_match_t match, void *data);
++
+ /* ---- ISO timers ---- */
+ #define ISO_CONN_TIMEOUT (HZ * 40)
+ #define ISO_DISCONN_TIMEOUT (HZ * 2)
+@@ -190,10 +196,21 @@ static void iso_chan_del(struct sock *sk, int err)
+ sock_set_flag(sk, SOCK_ZAPPED);
+ }
+
++static bool iso_match_conn_sync_handle(struct sock *sk, void *data)
++{
++ struct hci_conn *hcon = data;
++
++ if (test_bit(BT_SK_PA_SYNC, &iso_pi(sk)->flags))
++ return false;
++
++ return hcon->sync_handle == iso_pi(sk)->sync_handle;
++}
++
+ static void iso_conn_del(struct hci_conn *hcon, int err)
+ {
+ struct iso_conn *conn = hcon->iso_data;
+ struct sock *sk;
++ struct sock *parent;
+
+ if (!conn)
+ return;
+@@ -209,6 +226,25 @@ static void iso_conn_del(struct hci_conn *hcon, int err)
+
+ if (sk) {
+ lock_sock(sk);
++
++ /* While a PA sync hcon is in the process of closing,
++ * mark parent socket with a flag, so that any residual
++ * BIGInfo adv reports that arrive before PA sync is
++ * terminated are not processed anymore.
++ */
++ if (test_bit(BT_SK_PA_SYNC, &iso_pi(sk)->flags)) {
++ parent = iso_get_sock_listen(&hcon->src,
++ &hcon->dst,
++ iso_match_conn_sync_handle,
++ hcon);
++
++ if (parent) {
++ set_bit(BT_SK_PA_SYNC_TERM,
++ &iso_pi(parent)->flags);
++ sock_put(parent);
++ }
++ }
++
+ iso_sock_clear_timer(sk);
+ iso_chan_del(sk, err);
+ release_sock(sk);
+@@ -545,8 +581,6 @@ static struct sock *__iso_get_sock_listen_by_sid(bdaddr_t *ba, bdaddr_t *bc,
+ return NULL;
+ }
+
+-typedef bool (*iso_sock_match_t)(struct sock *sk, void *data);
+-
+ /* Find socket listening:
+ * source bdaddr (Unicast)
+ * destination bdaddr (Broadcast only)
+@@ -1759,9 +1793,20 @@ int iso_connect_ind(struct hci_dev *hdev, bdaddr_t *bdaddr, __u8 *flags)
+ /* Try to get PA sync listening socket, if it exists */
+ sk = iso_get_sock_listen(&hdev->bdaddr, bdaddr,
+ iso_match_pa_sync_flag, NULL);
+- if (!sk)
++
++ if (!sk) {
+ sk = iso_get_sock_listen(&hdev->bdaddr, bdaddr,
+ iso_match_sync_handle, ev2);
++
++ /* If PA Sync is in process of terminating,
++ * do not handle any more BIGInfo adv reports.
++ */
++
++ if (sk && test_bit(BT_SK_PA_SYNC_TERM,
++ &iso_pi(sk)->flags))
++ return lm;
++ }
++
+ if (sk) {
+ int err;
+
+--
+2.43.0
+
--- /dev/null
+From 9b01533f80d43bec411fe9010adf36675bc6c851 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 09:10:22 +0100
+Subject: Bluetooth: L2CAP: Fix possible multiple reject send
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Frédéric Danis <frederic.danis@collabora.com>
+
+[ Upstream commit 96a3398b467ab8aada3df2f3a79f4b7835d068b8 ]
+
+In case of an incomplete command or a command with a null identifier 2
+reject packets will be sent, one with the identifier and one with 0.
+Consuming the data of the command will prevent it.
+This allows to send a reject packet for each corrupted command in a
+multi-command packet.
+
+Signed-off-by: Frédéric Danis <frederic.danis@collabora.com>
+Signed-off-by: Luiz Augusto von Dentz <luiz.von.dentz@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/bluetooth/l2cap_core.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/net/bluetooth/l2cap_core.c b/net/bluetooth/l2cap_core.c
+index baeebee41cd9..60298975d5c4 100644
+--- a/net/bluetooth/l2cap_core.c
++++ b/net/bluetooth/l2cap_core.c
+@@ -6526,7 +6526,8 @@ static inline void l2cap_sig_channel(struct l2cap_conn *conn,
+ if (len > skb->len || !cmd->ident) {
+ BT_DBG("corrupted command");
+ l2cap_sig_send_rej(conn, cmd->ident);
+- break;
++ skb_pull(skb, len > skb->len ? skb->len : len);
++ continue;
+ }
+
+ err = l2cap_bredr_sig_cmd(conn, cmd, len, skb->data);
+--
+2.43.0
+
--- /dev/null
+From 6f6fe55c3cf9ec7ca16440d802ff53f7e967eaa3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 6 Nov 2023 14:02:46 +0800
+Subject: Bluetooth: qca: Set both WIDEBAND_SPEECH and LE_STATES quirks for
+ QCA2066
+
+From: Zijun Hu <quic_zijuhu@quicinc.com>
+
+[ Upstream commit 5d192b697c7417254cdd9edc3d5e9e0364eb9045 ]
+
+Set both WIDEBAND_SPEECH_SUPPORTED and VALID_LE_STATES quirks
+for QCA2066.
+
+Signed-off-by: Zijun Hu <quic_zijuhu@quicinc.com>
+Signed-off-by: Luiz Augusto von Dentz <luiz.von.dentz@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/bluetooth/hci_qca.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/bluetooth/hci_qca.c b/drivers/bluetooth/hci_qca.c
+index 067e248e3599..35f74f209d1f 100644
+--- a/drivers/bluetooth/hci_qca.c
++++ b/drivers/bluetooth/hci_qca.c
+@@ -2039,6 +2039,7 @@ static const struct qca_device_data qca_soc_data_wcn3998 __maybe_unused = {
+ static const struct qca_device_data qca_soc_data_qca2066 __maybe_unused = {
+ .soc_type = QCA_QCA2066,
+ .num_vregs = 0,
++ .capabilities = QCA_CAP_WIDEBAND_SPEECH | QCA_CAP_VALID_LE_STATES,
+ };
+
+ static const struct qca_device_data qca_soc_data_qca6390 __maybe_unused = {
+--
+2.43.0
+
--- /dev/null
+From 3222d33507b127b2e5aa39dff365089b315c03fc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 18 Nov 2023 16:16:53 +0800
+Subject: bonding: return -ENOMEM instead of BUG in alb_upper_dev_walk
+
+From: Zhengchao Shao <shaozhengchao@huawei.com>
+
+[ Upstream commit d6b83f1e3707c4d60acfa58afd3515e17e5d5384 ]
+
+If failed to allocate "tags" or could not find the final upper device from
+start_dev's upper list in bond_verify_device_path(), only the loopback
+detection of the current upper device should be affected, and the system is
+no need to be panic.
+So return -ENOMEM in alb_upper_dev_walk to stop walking, print some warn
+information when failed to allocate memory for vlan tags in
+bond_verify_device_path.
+
+I also think that the following function calls
+netdev_walk_all_upper_dev_rcu
+---->>>alb_upper_dev_walk
+---------->>>bond_verify_device_path
+From this way, "end device" can eventually be obtained from "start device"
+in bond_verify_device_path, IS_ERR(tags) could be instead of
+IS_ERR_OR_NULL(tags) in alb_upper_dev_walk.
+
+Signed-off-by: Zhengchao Shao <shaozhengchao@huawei.com>
+Acked-by: Jay Vosburgh <jay.vosburgh@canonical.com>
+Link: https://lore.kernel.org/r/20231118081653.1481260-1-shaozhengchao@huawei.com
+Signed-off-by: Paolo Abeni <pabeni@redhat.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/bonding/bond_alb.c | 3 ++-
+ drivers/net/bonding/bond_main.c | 5 ++++-
+ 2 files changed, 6 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/bonding/bond_alb.c b/drivers/net/bonding/bond_alb.c
+index dc2c7b979656..7edf0fd58c34 100644
+--- a/drivers/net/bonding/bond_alb.c
++++ b/drivers/net/bonding/bond_alb.c
+@@ -985,7 +985,8 @@ static int alb_upper_dev_walk(struct net_device *upper,
+ if (netif_is_macvlan(upper) && !strict_match) {
+ tags = bond_verify_device_path(bond->dev, upper, 0);
+ if (IS_ERR_OR_NULL(tags))
+- BUG();
++ return -ENOMEM;
++
+ alb_send_lp_vid(slave, upper->dev_addr,
+ tags[0].vlan_proto, tags[0].vlan_id);
+ kfree(tags);
+diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
+index 8e6cc0e133b7..9c1652886f4e 100644
+--- a/drivers/net/bonding/bond_main.c
++++ b/drivers/net/bonding/bond_main.c
+@@ -2973,8 +2973,11 @@ struct bond_vlan_tag *bond_verify_device_path(struct net_device *start_dev,
+
+ if (start_dev == end_dev) {
+ tags = kcalloc(level + 1, sizeof(*tags), GFP_ATOMIC);
+- if (!tags)
++ if (!tags) {
++ net_err_ratelimited("%s: %s: Failed to allocate tags\n",
++ __func__, start_dev->name);
+ return ERR_PTR(-ENOMEM);
++ }
+ tags[level].vlan_proto = BOND_VLAN_PROTO_NONE;
+ return tags;
+ }
+--
+2.43.0
+
--- /dev/null
+From b872b6737315b2d1ee37b8a8f2776b8c7a200782 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 22:04:19 +0800
+Subject: bpf: Check rcu_read_lock_trace_held() before calling bpf map helpers
+
+From: Hou Tao <houtao1@huawei.com>
+
+[ Upstream commit 169410eba271afc9f0fb476d996795aa26770c6d ]
+
+These three bpf_map_{lookup,update,delete}_elem() helpers are also
+available for sleepable bpf program, so add the corresponding lock
+assertion for sleepable bpf program, otherwise the following warning
+will be reported when a sleepable bpf program manipulates bpf map under
+interpreter mode (aka bpf_jit_enable=0):
+
+ WARNING: CPU: 3 PID: 4985 at kernel/bpf/helpers.c:40 ......
+ CPU: 3 PID: 4985 Comm: test_progs Not tainted 6.6.0+ #2
+ Hardware name: QEMU Standard PC (i440FX + PIIX, 1996) ......
+ RIP: 0010:bpf_map_lookup_elem+0x54/0x60
+ ......
+ Call Trace:
+ <TASK>
+ ? __warn+0xa5/0x240
+ ? bpf_map_lookup_elem+0x54/0x60
+ ? report_bug+0x1ba/0x1f0
+ ? handle_bug+0x40/0x80
+ ? exc_invalid_op+0x18/0x50
+ ? asm_exc_invalid_op+0x1b/0x20
+ ? __pfx_bpf_map_lookup_elem+0x10/0x10
+ ? rcu_lockdep_current_cpu_online+0x65/0xb0
+ ? rcu_is_watching+0x23/0x50
+ ? bpf_map_lookup_elem+0x54/0x60
+ ? __pfx_bpf_map_lookup_elem+0x10/0x10
+ ___bpf_prog_run+0x513/0x3b70
+ __bpf_prog_run32+0x9d/0xd0
+ ? __bpf_prog_enter_sleepable_recur+0xad/0x120
+ ? __bpf_prog_enter_sleepable_recur+0x3e/0x120
+ bpf_trampoline_6442580665+0x4d/0x1000
+ __x64_sys_getpgid+0x5/0x30
+ ? do_syscall_64+0x36/0xb0
+ entry_SYSCALL_64_after_hwframe+0x6e/0x76
+ </TASK>
+
+Signed-off-by: Hou Tao <houtao1@huawei.com>
+Link: https://lore.kernel.org/r/20231204140425.1480317-2-houtao@huaweicloud.com
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/bpf/helpers.c | 13 ++++++++-----
+ 1 file changed, 8 insertions(+), 5 deletions(-)
+
+diff --git a/kernel/bpf/helpers.c b/kernel/bpf/helpers.c
+index 6950f0461634..991186520af0 100644
+--- a/kernel/bpf/helpers.c
++++ b/kernel/bpf/helpers.c
+@@ -32,12 +32,13 @@
+ *
+ * Different map implementations will rely on rcu in map methods
+ * lookup/update/delete, therefore eBPF programs must run under rcu lock
+- * if program is allowed to access maps, so check rcu_read_lock_held in
+- * all three functions.
++ * if program is allowed to access maps, so check rcu_read_lock_held() or
++ * rcu_read_lock_trace_held() in all three functions.
+ */
+ BPF_CALL_2(bpf_map_lookup_elem, struct bpf_map *, map, void *, key)
+ {
+- WARN_ON_ONCE(!rcu_read_lock_held() && !rcu_read_lock_bh_held());
++ WARN_ON_ONCE(!rcu_read_lock_held() && !rcu_read_lock_trace_held() &&
++ !rcu_read_lock_bh_held());
+ return (unsigned long) map->ops->map_lookup_elem(map, key);
+ }
+
+@@ -53,7 +54,8 @@ const struct bpf_func_proto bpf_map_lookup_elem_proto = {
+ BPF_CALL_4(bpf_map_update_elem, struct bpf_map *, map, void *, key,
+ void *, value, u64, flags)
+ {
+- WARN_ON_ONCE(!rcu_read_lock_held() && !rcu_read_lock_bh_held());
++ WARN_ON_ONCE(!rcu_read_lock_held() && !rcu_read_lock_trace_held() &&
++ !rcu_read_lock_bh_held());
+ return map->ops->map_update_elem(map, key, value, flags);
+ }
+
+@@ -70,7 +72,8 @@ const struct bpf_func_proto bpf_map_update_elem_proto = {
+
+ BPF_CALL_2(bpf_map_delete_elem, struct bpf_map *, map, void *, key)
+ {
+- WARN_ON_ONCE(!rcu_read_lock_held() && !rcu_read_lock_bh_held());
++ WARN_ON_ONCE(!rcu_read_lock_held() && !rcu_read_lock_trace_held() &&
++ !rcu_read_lock_bh_held());
+ return map->ops->map_delete_elem(map, key);
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 5269f64c7edd9f004da4df2cea6bc4e2d0fabd7b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 26 Nov 2023 21:03:42 -0800
+Subject: bpf: Fix a few selftest failures due to llvm18 change
+
+From: Yonghong Song <yonghong.song@linux.dev>
+
+[ Upstream commit b16904fd9f01b580db357ef2b1cc9e86d89576c2 ]
+
+With latest upstream llvm18, the following test cases failed:
+
+ $ ./test_progs -j
+ #13/2 bpf_cookie/multi_kprobe_link_api:FAIL
+ #13/3 bpf_cookie/multi_kprobe_attach_api:FAIL
+ #13 bpf_cookie:FAIL
+ #77 fentry_fexit:FAIL
+ #78/1 fentry_test/fentry:FAIL
+ #78 fentry_test:FAIL
+ #82/1 fexit_test/fexit:FAIL
+ #82 fexit_test:FAIL
+ #112/1 kprobe_multi_test/skel_api:FAIL
+ #112/2 kprobe_multi_test/link_api_addrs:FAIL
+ [...]
+ #112 kprobe_multi_test:FAIL
+ #356/17 test_global_funcs/global_func17:FAIL
+ #356 test_global_funcs:FAIL
+
+Further analysis shows llvm upstream patch [1] is responsible for the above
+failures. For example, for function bpf_fentry_test7() in net/bpf/test_run.c,
+without [1], the asm code is:
+
+ 0000000000000400 <bpf_fentry_test7>:
+ 400: f3 0f 1e fa endbr64
+ 404: e8 00 00 00 00 callq 0x409 <bpf_fentry_test7+0x9>
+ 409: 48 89 f8 movq %rdi, %rax
+ 40c: c3 retq
+ 40d: 0f 1f 00 nopl (%rax)
+
+... and with [1], the asm code is:
+
+ 0000000000005d20 <bpf_fentry_test7.specialized.1>:
+ 5d20: e8 00 00 00 00 callq 0x5d25 <bpf_fentry_test7.specialized.1+0x5>
+ 5d25: c3 retq
+
+... and <bpf_fentry_test7.specialized.1> is called instead of <bpf_fentry_test7>
+and this caused test failures for #13/#77 etc. except #356.
+
+For test case #356/17, with [1] (progs/test_global_func17.c)), the main prog
+looks like:
+
+ 0000000000000000 <global_func17>:
+ 0: b4 00 00 00 2a 00 00 00 w0 = 0x2a
+ 1: 95 00 00 00 00 00 00 00 exit
+
+... which passed verification while the test itself expects a verification
+failure.
+
+Let us add 'barrier_var' style asm code in both places to prevent function
+specialization which caused selftests failure.
+
+ [1] https://github.com/llvm/llvm-project/pull/72903
+
+Signed-off-by: Yonghong Song <yonghong.song@linux.dev>
+Signed-off-by: Daniel Borkmann <daniel@iogearbox.net>
+Link: https://lore.kernel.org/bpf/20231127050342.1945270-1-yonghong.song@linux.dev
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/bpf/test_run.c | 2 +-
+ tools/testing/selftests/bpf/progs/test_global_func17.c | 1 +
+ 2 files changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/net/bpf/test_run.c b/net/bpf/test_run.c
+index c9fdcc5cdce1..711cf5d59816 100644
+--- a/net/bpf/test_run.c
++++ b/net/bpf/test_run.c
+@@ -542,7 +542,7 @@ struct bpf_fentry_test_t {
+
+ int noinline bpf_fentry_test7(struct bpf_fentry_test_t *arg)
+ {
+- asm volatile ("");
++ asm volatile ("": "+r"(arg));
+ return (long)arg;
+ }
+
+diff --git a/tools/testing/selftests/bpf/progs/test_global_func17.c b/tools/testing/selftests/bpf/progs/test_global_func17.c
+index a32e11c7d933..5de44b09e8ec 100644
+--- a/tools/testing/selftests/bpf/progs/test_global_func17.c
++++ b/tools/testing/selftests/bpf/progs/test_global_func17.c
+@@ -5,6 +5,7 @@
+
+ __noinline int foo(int *p)
+ {
++ barrier_var(p);
+ return p ? (*p = 42) : 0;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From ac2fb9d3ed7fe0ccc46e34c1ed8aa04650d10576 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 22:04:21 +0800
+Subject: bpf: Set need_defer as false when clearing fd array during map free
+
+From: Hou Tao <houtao1@huawei.com>
+
+[ Upstream commit 79d93b3c6ffd79abcd8e43345980aa1e904879c4 ]
+
+Both map deletion operation, map release and map free operation use
+fd_array_map_delete_elem() to remove the element from fd array and
+need_defer is always true in fd_array_map_delete_elem(). For the map
+deletion operation and map release operation, need_defer=true is
+necessary, because the bpf program, which accesses the element in fd
+array, may still alive. However for map free operation, it is certain
+that the bpf program which owns the fd array has already been exited, so
+setting need_defer as false is appropriate for map free operation.
+
+So fix it by adding need_defer parameter to bpf_fd_array_map_clear() and
+adding a new helper __fd_array_map_delete_elem() to handle the map
+deletion, map release and map free operations correspondingly.
+
+Signed-off-by: Hou Tao <houtao1@huawei.com>
+Link: https://lore.kernel.org/r/20231204140425.1480317-4-houtao@huaweicloud.com
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/bpf/arraymap.c | 23 ++++++++++++++---------
+ 1 file changed, 14 insertions(+), 9 deletions(-)
+
+diff --git a/kernel/bpf/arraymap.c b/kernel/bpf/arraymap.c
+index 9bfad7e96913..c9843dde6908 100644
+--- a/kernel/bpf/arraymap.c
++++ b/kernel/bpf/arraymap.c
+@@ -871,7 +871,7 @@ int bpf_fd_array_map_update_elem(struct bpf_map *map, struct file *map_file,
+ return 0;
+ }
+
+-static long fd_array_map_delete_elem(struct bpf_map *map, void *key)
++static long __fd_array_map_delete_elem(struct bpf_map *map, void *key, bool need_defer)
+ {
+ struct bpf_array *array = container_of(map, struct bpf_array, map);
+ void *old_ptr;
+@@ -890,13 +890,18 @@ static long fd_array_map_delete_elem(struct bpf_map *map, void *key)
+ }
+
+ if (old_ptr) {
+- map->ops->map_fd_put_ptr(map, old_ptr, true);
++ map->ops->map_fd_put_ptr(map, old_ptr, need_defer);
+ return 0;
+ } else {
+ return -ENOENT;
+ }
+ }
+
++static long fd_array_map_delete_elem(struct bpf_map *map, void *key)
++{
++ return __fd_array_map_delete_elem(map, key, true);
++}
++
+ static void *prog_fd_array_get_ptr(struct bpf_map *map,
+ struct file *map_file, int fd)
+ {
+@@ -925,13 +930,13 @@ static u32 prog_fd_array_sys_lookup_elem(void *ptr)
+ }
+
+ /* decrement refcnt of all bpf_progs that are stored in this map */
+-static void bpf_fd_array_map_clear(struct bpf_map *map)
++static void bpf_fd_array_map_clear(struct bpf_map *map, bool need_defer)
+ {
+ struct bpf_array *array = container_of(map, struct bpf_array, map);
+ int i;
+
+ for (i = 0; i < array->map.max_entries; i++)
+- fd_array_map_delete_elem(map, &i);
++ __fd_array_map_delete_elem(map, &i, need_defer);
+ }
+
+ static void prog_array_map_seq_show_elem(struct bpf_map *map, void *key,
+@@ -1072,7 +1077,7 @@ static void prog_array_map_clear_deferred(struct work_struct *work)
+ {
+ struct bpf_map *map = container_of(work, struct bpf_array_aux,
+ work)->map;
+- bpf_fd_array_map_clear(map);
++ bpf_fd_array_map_clear(map, true);
+ bpf_map_put(map);
+ }
+
+@@ -1222,7 +1227,7 @@ static void perf_event_fd_array_release(struct bpf_map *map,
+ for (i = 0; i < array->map.max_entries; i++) {
+ ee = READ_ONCE(array->ptrs[i]);
+ if (ee && ee->map_file == map_file)
+- fd_array_map_delete_elem(map, &i);
++ __fd_array_map_delete_elem(map, &i, true);
+ }
+ rcu_read_unlock();
+ }
+@@ -1230,7 +1235,7 @@ static void perf_event_fd_array_release(struct bpf_map *map,
+ static void perf_event_fd_array_map_free(struct bpf_map *map)
+ {
+ if (map->map_flags & BPF_F_PRESERVE_ELEMS)
+- bpf_fd_array_map_clear(map);
++ bpf_fd_array_map_clear(map, false);
+ fd_array_map_free(map);
+ }
+
+@@ -1266,7 +1271,7 @@ static void cgroup_fd_array_put_ptr(struct bpf_map *map, void *ptr, bool need_de
+
+ static void cgroup_fd_array_free(struct bpf_map *map)
+ {
+- bpf_fd_array_map_clear(map);
++ bpf_fd_array_map_clear(map, false);
+ fd_array_map_free(map);
+ }
+
+@@ -1311,7 +1316,7 @@ static void array_of_map_free(struct bpf_map *map)
+ * is protected by fdget/fdput.
+ */
+ bpf_map_meta_free(map->inner_map_meta);
+- bpf_fd_array_map_clear(map);
++ bpf_fd_array_map_clear(map, false);
+ fd_array_map_free(map);
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 32d54308057c51ff3c05803246d8ad5c62264211 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 18:23:53 +0800
+Subject: bpf: Set uattr->batch.count as zero before batched update or deletion
+
+From: Hou Tao <houtao1@huawei.com>
+
+[ Upstream commit 06e5c999f10269a532304e89a6adb2fbfeb0593c ]
+
+generic_map_{delete,update}_batch() doesn't set uattr->batch.count as
+zero before it tries to allocate memory for key. If the memory
+allocation fails, the value of uattr->batch.count will be incorrect.
+
+Fix it by setting uattr->batch.count as zero beore batched update or
+deletion.
+
+Signed-off-by: Hou Tao <houtao1@huawei.com>
+Link: https://lore.kernel.org/r/20231208102355.2628918-6-houtao@huaweicloud.com
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/bpf/syscall.c | 6 ++++++
+ 1 file changed, 6 insertions(+)
+
+diff --git a/kernel/bpf/syscall.c b/kernel/bpf/syscall.c
+index 58e34ff81197..349d735b4e1d 100644
+--- a/kernel/bpf/syscall.c
++++ b/kernel/bpf/syscall.c
+@@ -1702,6 +1702,9 @@ int generic_map_delete_batch(struct bpf_map *map,
+ if (!max_count)
+ return 0;
+
++ if (put_user(0, &uattr->batch.count))
++ return -EFAULT;
++
+ key = kvmalloc(map->key_size, GFP_USER | __GFP_NOWARN);
+ if (!key)
+ return -ENOMEM;
+@@ -1759,6 +1762,9 @@ int generic_map_update_batch(struct bpf_map *map, struct file *map_file,
+ if (!max_count)
+ return 0;
+
++ if (put_user(0, &uattr->batch.count))
++ return -EFAULT;
++
+ key = kvmalloc(map->key_size, GFP_USER | __GFP_NOWARN);
+ if (!key)
+ return -ENOMEM;
+--
+2.43.0
+
--- /dev/null
+From c0e1e51a4b60684c87431b1a38f5e88e0dcc063c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 00:34:51 +0800
+Subject: bridge: cfm: fix enum typo in br_cc_ccm_tx_parse
+
+From: Lin Ma <linma@zju.edu.cn>
+
+[ Upstream commit c2b2ee36250d967c21890cb801e24af4b6a9eaa5 ]
+
+It appears that there is a typo in the code where the nlattr array is
+being parsed with policy br_cfm_cc_ccm_tx_policy, but the instance is
+being accessed via IFLA_BRIDGE_CFM_CC_RDI_INSTANCE, which is associated
+with the policy br_cfm_cc_rdi_policy.
+
+This problem was introduced by commit 2be665c3940d ("bridge: cfm: Netlink
+SET configuration Interface.").
+
+Though it seems like a harmless typo since these two enum owns the exact
+same value (1 here), it is quite misleading hence fix it by using the
+correct enum IFLA_BRIDGE_CFM_CC_CCM_TX_INSTANCE here.
+
+Signed-off-by: Lin Ma <linma@zju.edu.cn>
+Reviewed-by: Simon Horman <horms@kernel.org>
+Acked-by: Nikolay Aleksandrov <razor@blackwall.org>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/bridge/br_cfm_netlink.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/net/bridge/br_cfm_netlink.c b/net/bridge/br_cfm_netlink.c
+index 5c4c369f8536..2faab44652e7 100644
+--- a/net/bridge/br_cfm_netlink.c
++++ b/net/bridge/br_cfm_netlink.c
+@@ -362,7 +362,7 @@ static int br_cc_ccm_tx_parse(struct net_bridge *br, struct nlattr *attr,
+
+ memset(&tx_info, 0, sizeof(tx_info));
+
+- instance = nla_get_u32(tb[IFLA_BRIDGE_CFM_CC_RDI_INSTANCE]);
++ instance = nla_get_u32(tb[IFLA_BRIDGE_CFM_CC_CCM_TX_INSTANCE]);
+ nla_memcpy(&tx_info.dmac.addr,
+ tb[IFLA_BRIDGE_CFM_CC_CCM_TX_DMAC],
+ sizeof(tx_info.dmac.addr));
+--
+2.43.0
+
--- /dev/null
+From 40ee700bda78be63c1c5159af7c088b3df1b0d1a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 17 Nov 2023 13:26:18 +0800
+Subject: ceph: fix deadlock or deadcode of misusing dget()
+
+From: Xiubo Li <xiubli@redhat.com>
+
+[ Upstream commit b493ad718b1f0357394d2cdecbf00a44a36fa085 ]
+
+The lock order is incorrect between denty and its parent, we should
+always make sure that the parent get the lock first.
+
+But since this deadcode is never used and the parent dir will always
+be set from the callers, let's just remove it.
+
+Link: https://lore.kernel.org/r/20231116081919.GZ1957730@ZenIV
+Reported-by: Al Viro <viro@zeniv.linux.org.uk>
+Signed-off-by: Xiubo Li <xiubli@redhat.com>
+Reviewed-by: Jeff Layton <jlayton@kernel.org>
+Signed-off-by: Ilya Dryomov <idryomov@gmail.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ceph/caps.c | 9 +++------
+ 1 file changed, 3 insertions(+), 6 deletions(-)
+
+diff --git a/fs/ceph/caps.c b/fs/ceph/caps.c
+index 2c0b8dc3dd0d..9c02f328c966 100644
+--- a/fs/ceph/caps.c
++++ b/fs/ceph/caps.c
+@@ -4887,13 +4887,15 @@ int ceph_encode_dentry_release(void **p, struct dentry *dentry,
+ struct inode *dir,
+ int mds, int drop, int unless)
+ {
+- struct dentry *parent = NULL;
+ struct ceph_mds_request_release *rel = *p;
+ struct ceph_dentry_info *di = ceph_dentry(dentry);
+ struct ceph_client *cl;
+ int force = 0;
+ int ret;
+
++ /* This shouldn't happen */
++ BUG_ON(!dir);
++
+ /*
+ * force an record for the directory caps if we have a dentry lease.
+ * this is racy (can't take i_ceph_lock and d_lock together), but it
+@@ -4903,14 +4905,9 @@ int ceph_encode_dentry_release(void **p, struct dentry *dentry,
+ spin_lock(&dentry->d_lock);
+ if (di->lease_session && di->lease_session->s_mds == mds)
+ force = 1;
+- if (!dir) {
+- parent = dget(dentry->d_parent);
+- dir = d_inode(parent);
+- }
+ spin_unlock(&dentry->d_lock);
+
+ ret = ceph_encode_inode_release(p, dir, mds, drop, unless, force);
+- dput(parent);
+
+ cl = ceph_inode_to_client(dir);
+ spin_lock(&dentry->d_lock);
+--
+2.43.0
+
--- /dev/null
+From 6988fdb1320bc638f148965854fdb3ef8095716a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 23 Nov 2023 09:53:40 +0800
+Subject: ceph: fix invalid pointer access if get_quota_realm return ERR_PTR
+
+From: Wenchao Hao <haowenchao2@huawei.com>
+
+[ Upstream commit 0f4cf64eabc6e16cfc2704f1960e82dc79d91c8d ]
+
+This issue is reported by smatch that get_quota_realm() might return
+ERR_PTR but we did not handle it. It's not a immediate bug, while we
+still should address it to avoid potential bugs if get_quota_realm()
+is changed to return other ERR_PTR in future.
+
+Set ceph_snap_realm's pointer in get_quota_realm()'s to address this
+issue, the pointer would be set to NULL if get_quota_realm() failed
+to get struct ceph_snap_realm, so no ERR_PTR would happen any more.
+
+[ xiubli: minor code style clean up ]
+
+Signed-off-by: Wenchao Hao <haowenchao2@huawei.com>
+Reviewed-by: Xiubo Li <xiubli@redhat.com>
+Signed-off-by: Ilya Dryomov <idryomov@gmail.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ceph/quota.c | 39 ++++++++++++++++++++++-----------------
+ 1 file changed, 22 insertions(+), 17 deletions(-)
+
+diff --git a/fs/ceph/quota.c b/fs/ceph/quota.c
+index 9d36c3532de1..06ee397e0c3a 100644
+--- a/fs/ceph/quota.c
++++ b/fs/ceph/quota.c
+@@ -197,10 +197,10 @@ void ceph_cleanup_quotarealms_inodes(struct ceph_mds_client *mdsc)
+ }
+
+ /*
+- * This function walks through the snaprealm for an inode and returns the
+- * ceph_snap_realm for the first snaprealm that has quotas set (max_files,
++ * This function walks through the snaprealm for an inode and set the
++ * realmp with the first snaprealm that has quotas set (max_files,
+ * max_bytes, or any, depending on the 'which_quota' argument). If the root is
+- * reached, return the root ceph_snap_realm instead.
++ * reached, set the realmp with the root ceph_snap_realm instead.
+ *
+ * Note that the caller is responsible for calling ceph_put_snap_realm() on the
+ * returned realm.
+@@ -211,10 +211,9 @@ void ceph_cleanup_quotarealms_inodes(struct ceph_mds_client *mdsc)
+ * this function will return -EAGAIN; otherwise, the snaprealms walk-through
+ * will be restarted.
+ */
+-static struct ceph_snap_realm *get_quota_realm(struct ceph_mds_client *mdsc,
+- struct inode *inode,
+- enum quota_get_realm which_quota,
+- bool retry)
++static int get_quota_realm(struct ceph_mds_client *mdsc, struct inode *inode,
++ enum quota_get_realm which_quota,
++ struct ceph_snap_realm **realmp, bool retry)
+ {
+ struct ceph_client *cl = mdsc->fsc->client;
+ struct ceph_inode_info *ci = NULL;
+@@ -222,8 +221,10 @@ static struct ceph_snap_realm *get_quota_realm(struct ceph_mds_client *mdsc,
+ struct inode *in;
+ bool has_quota;
+
++ if (realmp)
++ *realmp = NULL;
+ if (ceph_snap(inode) != CEPH_NOSNAP)
+- return NULL;
++ return 0;
+
+ restart:
+ realm = ceph_inode(inode)->i_snap_realm;
+@@ -250,7 +251,7 @@ static struct ceph_snap_realm *get_quota_realm(struct ceph_mds_client *mdsc,
+ break;
+ ceph_put_snap_realm(mdsc, realm);
+ if (!retry)
+- return ERR_PTR(-EAGAIN);
++ return -EAGAIN;
+ goto restart;
+ }
+
+@@ -259,8 +260,11 @@ static struct ceph_snap_realm *get_quota_realm(struct ceph_mds_client *mdsc,
+ iput(in);
+
+ next = realm->parent;
+- if (has_quota || !next)
+- return realm;
++ if (has_quota || !next) {
++ if (realmp)
++ *realmp = realm;
++ return 0;
++ }
+
+ ceph_get_snap_realm(mdsc, next);
+ ceph_put_snap_realm(mdsc, realm);
+@@ -269,7 +273,7 @@ static struct ceph_snap_realm *get_quota_realm(struct ceph_mds_client *mdsc,
+ if (realm)
+ ceph_put_snap_realm(mdsc, realm);
+
+- return NULL;
++ return 0;
+ }
+
+ bool ceph_quota_is_same_realm(struct inode *old, struct inode *new)
+@@ -277,6 +281,7 @@ bool ceph_quota_is_same_realm(struct inode *old, struct inode *new)
+ struct ceph_mds_client *mdsc = ceph_sb_to_mdsc(old->i_sb);
+ struct ceph_snap_realm *old_realm, *new_realm;
+ bool is_same;
++ int ret;
+
+ restart:
+ /*
+@@ -286,9 +291,9 @@ bool ceph_quota_is_same_realm(struct inode *old, struct inode *new)
+ * dropped and we can then restart the whole operation.
+ */
+ down_read(&mdsc->snap_rwsem);
+- old_realm = get_quota_realm(mdsc, old, QUOTA_GET_ANY, true);
+- new_realm = get_quota_realm(mdsc, new, QUOTA_GET_ANY, false);
+- if (PTR_ERR(new_realm) == -EAGAIN) {
++ get_quota_realm(mdsc, old, QUOTA_GET_ANY, &old_realm, true);
++ ret = get_quota_realm(mdsc, new, QUOTA_GET_ANY, &new_realm, false);
++ if (ret == -EAGAIN) {
+ up_read(&mdsc->snap_rwsem);
+ if (old_realm)
+ ceph_put_snap_realm(mdsc, old_realm);
+@@ -492,8 +497,8 @@ bool ceph_quota_update_statfs(struct ceph_fs_client *fsc, struct kstatfs *buf)
+ bool is_updated = false;
+
+ down_read(&mdsc->snap_rwsem);
+- realm = get_quota_realm(mdsc, d_inode(fsc->sb->s_root),
+- QUOTA_GET_MAX_BYTES, true);
++ get_quota_realm(mdsc, d_inode(fsc->sb->s_root), QUOTA_GET_MAX_BYTES,
++ &realm, true);
+ up_read(&mdsc->snap_rwsem);
+ if (!realm)
+ return false;
+--
+2.43.0
+
--- /dev/null
+From 2a782fb64ef5c708df3bba1ca1b3ff2d68c54139 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 6 Nov 2023 10:02:32 +0530
+Subject: ceph: reinitialize mds feature bit even when session in open
+
+From: Venky Shankar <vshankar@redhat.com>
+
+[ Upstream commit f48e0342a74d7770cdf1d11894bdc3b6d989b29e ]
+
+Following along the same lines as per the user-space fix. Right
+now this isn't really an issue with the ceph kernel driver because
+of the feature bit laginess, however, that can change over time
+(when the new snaprealm info type is ported to the kernel driver)
+and depending on the MDS version that's being upgraded can cause
+message decoding issues - so, fix that early on.
+
+Link: http://tracker.ceph.com/issues/63188
+Signed-off-by: Venky Shankar <vshankar@redhat.com>
+Reviewed-by: Xiubo Li <xiubli@redhat.com>
+Signed-off-by: Ilya Dryomov <idryomov@gmail.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ceph/mds_client.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/fs/ceph/mds_client.c b/fs/ceph/mds_client.c
+index d95eb525519a..558c3af44449 100644
+--- a/fs/ceph/mds_client.c
++++ b/fs/ceph/mds_client.c
+@@ -4128,12 +4128,12 @@ static void handle_session(struct ceph_mds_session *session,
+ pr_info_client(cl, "mds%d reconnect success\n",
+ session->s_mds);
+
++ session->s_features = features;
+ if (session->s_state == CEPH_MDS_SESSION_OPEN) {
+ pr_notice_client(cl, "mds%d is already opened\n",
+ session->s_mds);
+ } else {
+ session->s_state = CEPH_MDS_SESSION_OPEN;
+- session->s_features = features;
+ renewed_caps(mdsc, session, 0);
+ if (test_bit(CEPHFS_FEATURE_METRIC_COLLECT,
+ &session->s_features))
+--
+2.43.0
+
--- /dev/null
+From e4eb6eb5961854b97c91de0966a932468e82fdfc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 10:12:21 +0100
+Subject: cfi: Add CFI_NOSEAL()
+
+From: Peter Zijlstra <peterz@infradead.org>
+
+[ Upstream commit e9d13b9d2f99ccf7afeab490d97eaa5ac9846598 ]
+
+Add a CFI_NOSEAL() helper to mark functions that need to retain their
+CFI information, despite not otherwise leaking their address.
+
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Link: https://lore.kernel.org/r/20231215092707.669401084@infradead.org
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/x86/include/asm/cfi.h | 5 +++++
+ include/linux/cfi.h | 4 ++++
+ 2 files changed, 9 insertions(+)
+
+diff --git a/arch/x86/include/asm/cfi.h b/arch/x86/include/asm/cfi.h
+index 58dacd90daef..67b010c224e4 100644
+--- a/arch/x86/include/asm/cfi.h
++++ b/arch/x86/include/asm/cfi.h
+@@ -9,6 +9,7 @@
+ */
+
+ #include <linux/cfi.h>
++#include <asm/ibt.h>
+
+ #ifdef CONFIG_CFI_CLANG
+ enum bug_trap_type handle_cfi_failure(struct pt_regs *regs);
+@@ -19,4 +20,8 @@ static inline enum bug_trap_type handle_cfi_failure(struct pt_regs *regs)
+ }
+ #endif /* CONFIG_CFI_CLANG */
+
++#if HAS_KERNEL_IBT == 1
++#define CFI_NOSEAL(x) asm(IBT_NOSEAL(__stringify(x)))
++#endif
++
+ #endif /* _ASM_X86_CFI_H */
+diff --git a/include/linux/cfi.h b/include/linux/cfi.h
+index 3552ec82b725..bb084eb053e7 100644
+--- a/include/linux/cfi.h
++++ b/include/linux/cfi.h
+@@ -38,4 +38,8 @@ static inline void module_cfi_finalize(const Elf_Ehdr *hdr,
+ #endif /* CONFIG_ARCH_USES_CFI_TRAPS */
+ #endif /* CONFIG_MODULES */
+
++#ifndef CFI_NOSEAL
++#define CFI_NOSEAL(x)
++#endif
++
+ #endif /* _LINUX_CFI_H */
+--
+2.43.0
+
--- /dev/null
+From 45a7446a4ebbab2e964ae61751f3e1405d624692 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 29 Dec 2023 11:16:18 +0000
+Subject: cifs: fix in logging in cifs_chan_update_iface
+
+From: Shyam Prasad N <sprasad@microsoft.com>
+
+[ Upstream commit 516eea97f92f1e7271f20835cfe9e73774b0f8cc ]
+
+Recently, cifs_chan_update_iface was modified to not
+remove an iface if a suitable replacement was not found.
+With that, there were two conditionals that were exactly
+the same. This change removes that extra condition check.
+
+Also, fixed a logging in the same function to indicate
+the correct message.
+
+Signed-off-by: Shyam Prasad N <sprasad@microsoft.com>
+Signed-off-by: Steve French <stfrench@microsoft.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/smb/client/sess.c | 14 ++++++++------
+ 1 file changed, 8 insertions(+), 6 deletions(-)
+
+diff --git a/fs/smb/client/sess.c b/fs/smb/client/sess.c
+index 2d3b332a79a1..a16e175731eb 100644
+--- a/fs/smb/client/sess.c
++++ b/fs/smb/client/sess.c
+@@ -440,8 +440,14 @@ cifs_chan_update_iface(struct cifs_ses *ses, struct TCP_Server_Info *server)
+ }
+
+ if (!iface) {
+- cifs_dbg(FYI, "unable to get the interface matching: %pIS\n",
+- &ss);
++ if (!chan_index)
++ cifs_dbg(FYI, "unable to get the interface matching: %pIS\n",
++ &ss);
++ else {
++ cifs_dbg(FYI, "unable to find another interface to replace: %pIS\n",
++ &old_iface->sockaddr);
++ }
++
+ spin_unlock(&ses->iface_lock);
+ return 0;
+ }
+@@ -459,10 +465,6 @@ cifs_chan_update_iface(struct cifs_ses *ses, struct TCP_Server_Info *server)
+ iface->weight_fulfilled++;
+
+ kref_put(&old_iface->refcount, release_iface);
+- } else if (old_iface) {
+- /* if a new candidate is not found, keep things as is */
+- cifs_dbg(FYI, "could not replace iface: %pIS\n",
+- &old_iface->sockaddr);
+ } else if (!chan_index) {
+ /* special case: update interface for primary channel */
+ if (iface) {
+--
+2.43.0
+
--- /dev/null
+From 368f537d26f9317cfdf2b33780cc016aa40addc1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 00:50:40 +0800
+Subject: clk: hi3620: Fix memory leak in hi3620_mmc_clk_init()
+
+From: Kuan-Wei Chiu <visitorckw@gmail.com>
+
+[ Upstream commit bfbea9e5667cfa9552c3d88f023386f017f6c308 ]
+
+In cases where kcalloc() fails for the 'clk_data->clks' allocation, the
+code path does not handle the failure gracefully, potentially leading
+to a memory leak. This fix ensures proper cleanup by freeing the
+allocated memory for 'clk_data' before returning.
+
+Signed-off-by: Kuan-Wei Chiu <visitorckw@gmail.com>
+Link: https://lore.kernel.org/r/20231210165040.3407545-1-visitorckw@gmail.com
+Signed-off-by: Stephen Boyd <sboyd@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/clk/hisilicon/clk-hi3620.c | 4 +++-
+ 1 file changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/clk/hisilicon/clk-hi3620.c b/drivers/clk/hisilicon/clk-hi3620.c
+index 2d7186905abd..5d0226530fdb 100644
+--- a/drivers/clk/hisilicon/clk-hi3620.c
++++ b/drivers/clk/hisilicon/clk-hi3620.c
+@@ -466,8 +466,10 @@ static void __init hi3620_mmc_clk_init(struct device_node *node)
+ return;
+
+ clk_data->clks = kcalloc(num, sizeof(*clk_data->clks), GFP_KERNEL);
+- if (!clk_data->clks)
++ if (!clk_data->clks) {
++ kfree(clk_data);
+ return;
++ }
+
+ for (i = 0; i < num; i++) {
+ struct hisi_mmc_clock *mmc_clk = &hi3620_mmc_clks[i];
+--
+2.43.0
+
--- /dev/null
+From b5a1053ec1c2062f2e306572865968d56f365ad1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 13:24:07 +0100
+Subject: clk: imx: clk-imx8qxp: fix LVDS bypass, pixel and phy clocks
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 3f5f63adeea7e7aa715e101ffe4b4ac9705f9664 ]
+
+To be compatible with SCU firmware based on 1.15 a different clock
+routing for LVDS is needed.
+
+Signed-off-by: Oliver F. Brown <oliver.brown@oss.nxp.com>
+Signed-off-by: Ranjani Vaidyanathan <ranjani.vaidyanathan@nxp.com>
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Reviewed-by: Abel Vesa <abel.vesa@linaro.org>
+Link: https://lore.kernel.org/r/20231218122407.2757175-1-alexander.stein@ew.tq-group.com/
+Signed-off-by: Abel Vesa <abel.vesa@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/clk/imx/clk-imx8qxp.c | 24 ++++++++++++++++++++----
+ 1 file changed, 20 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/clk/imx/clk-imx8qxp.c b/drivers/clk/imx/clk-imx8qxp.c
+index 41f0a45aa162..7d8883916cac 100644
+--- a/drivers/clk/imx/clk-imx8qxp.c
++++ b/drivers/clk/imx/clk-imx8qxp.c
+@@ -66,6 +66,22 @@ static const char * const lcd_pxl_sels[] = {
+ "lcd_pxl_bypass_div_clk",
+ };
+
++static const char *const lvds0_sels[] = {
++ "clk_dummy",
++ "clk_dummy",
++ "clk_dummy",
++ "clk_dummy",
++ "mipi0_lvds_bypass_clk",
++};
++
++static const char *const lvds1_sels[] = {
++ "clk_dummy",
++ "clk_dummy",
++ "clk_dummy",
++ "clk_dummy",
++ "mipi1_lvds_bypass_clk",
++};
++
+ static const char * const mipi_sels[] = {
+ "clk_dummy",
+ "clk_dummy",
+@@ -207,9 +223,9 @@ static int imx8qxp_clk_probe(struct platform_device *pdev)
+ /* MIPI-LVDS SS */
+ imx_clk_scu("mipi0_bypass_clk", IMX_SC_R_MIPI_0, IMX_SC_PM_CLK_BYPASS);
+ imx_clk_scu("mipi0_pixel_clk", IMX_SC_R_MIPI_0, IMX_SC_PM_CLK_PER);
+- imx_clk_scu("mipi0_lvds_pixel_clk", IMX_SC_R_LVDS_0, IMX_SC_PM_CLK_MISC2);
+ imx_clk_scu("mipi0_lvds_bypass_clk", IMX_SC_R_LVDS_0, IMX_SC_PM_CLK_BYPASS);
+- imx_clk_scu("mipi0_lvds_phy_clk", IMX_SC_R_LVDS_0, IMX_SC_PM_CLK_MISC3);
++ imx_clk_scu2("mipi0_lvds_pixel_clk", lvds0_sels, ARRAY_SIZE(lvds0_sels), IMX_SC_R_LVDS_0, IMX_SC_PM_CLK_MISC2);
++ imx_clk_scu2("mipi0_lvds_phy_clk", lvds0_sels, ARRAY_SIZE(lvds0_sels), IMX_SC_R_LVDS_0, IMX_SC_PM_CLK_MISC3);
+ imx_clk_scu2("mipi0_dsi_tx_esc_clk", mipi_sels, ARRAY_SIZE(mipi_sels), IMX_SC_R_MIPI_0, IMX_SC_PM_CLK_MST_BUS);
+ imx_clk_scu2("mipi0_dsi_rx_esc_clk", mipi_sels, ARRAY_SIZE(mipi_sels), IMX_SC_R_MIPI_0, IMX_SC_PM_CLK_SLV_BUS);
+ imx_clk_scu2("mipi0_dsi_phy_clk", mipi_sels, ARRAY_SIZE(mipi_sels), IMX_SC_R_MIPI_0, IMX_SC_PM_CLK_PHY);
+@@ -219,9 +235,9 @@ static int imx8qxp_clk_probe(struct platform_device *pdev)
+
+ imx_clk_scu("mipi1_bypass_clk", IMX_SC_R_MIPI_1, IMX_SC_PM_CLK_BYPASS);
+ imx_clk_scu("mipi1_pixel_clk", IMX_SC_R_MIPI_1, IMX_SC_PM_CLK_PER);
+- imx_clk_scu("mipi1_lvds_pixel_clk", IMX_SC_R_LVDS_1, IMX_SC_PM_CLK_MISC2);
+ imx_clk_scu("mipi1_lvds_bypass_clk", IMX_SC_R_LVDS_1, IMX_SC_PM_CLK_BYPASS);
+- imx_clk_scu("mipi1_lvds_phy_clk", IMX_SC_R_LVDS_1, IMX_SC_PM_CLK_MISC3);
++ imx_clk_scu2("mipi1_lvds_pixel_clk", lvds1_sels, ARRAY_SIZE(lvds1_sels), IMX_SC_R_LVDS_1, IMX_SC_PM_CLK_MISC2);
++ imx_clk_scu2("mipi1_lvds_phy_clk", lvds1_sels, ARRAY_SIZE(lvds1_sels), IMX_SC_R_LVDS_1, IMX_SC_PM_CLK_MISC3);
+
+ imx_clk_scu2("mipi1_dsi_tx_esc_clk", mipi_sels, ARRAY_SIZE(mipi_sels), IMX_SC_R_MIPI_1, IMX_SC_PM_CLK_MST_BUS);
+ imx_clk_scu2("mipi1_dsi_rx_esc_clk", mipi_sels, ARRAY_SIZE(mipi_sels), IMX_SC_R_MIPI_1, IMX_SC_PM_CLK_SLV_BUS);
+--
+2.43.0
+
--- /dev/null
+From 6ee6cd62d9c54454e211998444a51e672b106cc5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 01:19:07 +0800
+Subject: clk: imx: scu: Fix memory leak in __imx_clk_gpr_scu()
+
+From: Kuan-Wei Chiu <visitorckw@gmail.com>
+
+[ Upstream commit 21c0efbcb45cf94724d17b040ebc03fcd4a81f22 ]
+
+In cases where imx_clk_is_resource_owned() returns false, the code path
+does not handle the failure gracefully, potentially leading to a memory
+leak. This fix ensures proper cleanup by freeing the allocated memory
+for 'clk_node' before returning.
+
+Signed-off-by: Kuan-Wei Chiu <visitorckw@gmail.com>
+Reviewed-by: Peng Fan <peng.fan@nxp.com>
+Link: https://lore.kernel.org/all/20231210171907.3410922-1-visitorckw@gmail.com/
+Signed-off-by: Abel Vesa <abel.vesa@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/clk/imx/clk-scu.c | 4 +++-
+ 1 file changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/clk/imx/clk-scu.c b/drivers/clk/imx/clk-scu.c
+index be89180dd19c..e48a904c0013 100644
+--- a/drivers/clk/imx/clk-scu.c
++++ b/drivers/clk/imx/clk-scu.c
+@@ -886,8 +886,10 @@ struct clk_hw *__imx_clk_gpr_scu(const char *name, const char * const *parent_na
+ return ERR_PTR(-EINVAL);
+ }
+
+- if (!imx_clk_is_resource_owned(rsrc_id))
++ if (!imx_clk_is_resource_owned(rsrc_id)) {
++ kfree(clk_node);
+ return NULL;
++ }
+
+ clk = kzalloc(sizeof(*clk), GFP_KERNEL);
+ if (!clk) {
+--
+2.43.0
+
--- /dev/null
+From 0e7c01f316c0b1f2e123742c69761e363fd38d0b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 01:52:32 +0800
+Subject: clk: mmp: pxa168: Fix memory leak in pxa168_clk_init()
+
+From: Kuan-Wei Chiu <visitorckw@gmail.com>
+
+[ Upstream commit 2fbabea626b6467eb4e6c4cb7a16523da12e43b4 ]
+
+In cases where mapping of mpmu/apmu/apbc registers fails, the code path
+does not handle the failure gracefully, potentially leading to a memory
+leak. This fix ensures proper cleanup by freeing the allocated memory
+for 'pxa_unit' before returning.
+
+Signed-off-by: Kuan-Wei Chiu <visitorckw@gmail.com>
+Link: https://lore.kernel.org/r/20231210175232.3414584-1-visitorckw@gmail.com
+Signed-off-by: Stephen Boyd <sboyd@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/clk/mmp/clk-of-pxa168.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/drivers/clk/mmp/clk-of-pxa168.c b/drivers/clk/mmp/clk-of-pxa168.c
+index fb0df64cf053..c5a7ba1deaa3 100644
+--- a/drivers/clk/mmp/clk-of-pxa168.c
++++ b/drivers/clk/mmp/clk-of-pxa168.c
+@@ -308,18 +308,21 @@ static void __init pxa168_clk_init(struct device_node *np)
+ pxa_unit->mpmu_base = of_iomap(np, 0);
+ if (!pxa_unit->mpmu_base) {
+ pr_err("failed to map mpmu registers\n");
++ kfree(pxa_unit);
+ return;
+ }
+
+ pxa_unit->apmu_base = of_iomap(np, 1);
+ if (!pxa_unit->apmu_base) {
+ pr_err("failed to map apmu registers\n");
++ kfree(pxa_unit);
+ return;
+ }
+
+ pxa_unit->apbc_base = of_iomap(np, 2);
+ if (!pxa_unit->apbc_base) {
+ pr_err("failed to map apbc registers\n");
++ kfree(pxa_unit);
+ return;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From d40f5e9b1ae695a3940b16ad9dfdb0c0ebc8ee1e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 11:48:51 +0100
+Subject: cpufreq/schedutil: Use a fixed reference frequency
+
+From: Vincent Guittot <vincent.guittot@linaro.org>
+
+[ Upstream commit b3edde44e5d4504c23a176819865cd603fd16d6c ]
+
+cpuinfo.max_freq can change at runtime because of boost as an example. This
+implies that the value could be different than the one that has been
+used when computing the capacity of a CPU.
+
+The new arch_scale_freq_ref() returns a fixed and coherent reference
+frequency that can be used when computing a frequency based on utilization.
+
+Use this arch_scale_freq_ref() when available and fallback to
+policy otherwise.
+
+Signed-off-by: Vincent Guittot <vincent.guittot@linaro.org>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Tested-by: Lukasz Luba <lukasz.luba@arm.com>
+Reviewed-by: Lukasz Luba <lukasz.luba@arm.com>
+Reviewed-by: Dietmar Eggemann <dietmar.eggemann@arm.com>
+Acked-by: Rafael J. Wysocki <rafael@kernel.org>
+Acked-by: Viresh Kumar <viresh.kumar@linaro.org>
+Link: https://lore.kernel.org/r/20231211104855.558096-4-vincent.guittot@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/sched/cpufreq_schedutil.c | 26 ++++++++++++++++++++++++--
+ 1 file changed, 24 insertions(+), 2 deletions(-)
+
+diff --git a/kernel/sched/cpufreq_schedutil.c b/kernel/sched/cpufreq_schedutil.c
+index 5888176354e2..11422c054c84 100644
+--- a/kernel/sched/cpufreq_schedutil.c
++++ b/kernel/sched/cpufreq_schedutil.c
+@@ -114,6 +114,28 @@ static void sugov_deferred_update(struct sugov_policy *sg_policy)
+ }
+ }
+
++/**
++ * get_capacity_ref_freq - get the reference frequency that has been used to
++ * correlate frequency and compute capacity for a given cpufreq policy. We use
++ * the CPU managing it for the arch_scale_freq_ref() call in the function.
++ * @policy: the cpufreq policy of the CPU in question.
++ *
++ * Return: the reference CPU frequency to compute a capacity.
++ */
++static __always_inline
++unsigned long get_capacity_ref_freq(struct cpufreq_policy *policy)
++{
++ unsigned int freq = arch_scale_freq_ref(policy->cpu);
++
++ if (freq)
++ return freq;
++
++ if (arch_scale_freq_invariant())
++ return policy->cpuinfo.max_freq;
++
++ return policy->cur;
++}
++
+ /**
+ * get_next_freq - Compute a new frequency for a given cpufreq policy.
+ * @sg_policy: schedutil policy object to compute the new frequency for.
+@@ -140,9 +162,9 @@ static unsigned int get_next_freq(struct sugov_policy *sg_policy,
+ unsigned long util, unsigned long max)
+ {
+ struct cpufreq_policy *policy = sg_policy->policy;
+- unsigned int freq = arch_scale_freq_invariant() ?
+- policy->cpuinfo.max_freq : policy->cur;
++ unsigned int freq;
+
++ freq = get_capacity_ref_freq(policy);
+ util = map_util_perf(util);
+ freq = map_util_freq(util, freq, max);
+
+--
+2.43.0
+
--- /dev/null
+From 36ad3cf98507b32a2ba905f81b087035ef495111 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 11:48:50 +0100
+Subject: cpufreq: Use the fixed and coherent frequency for scaling capacity
+
+From: Vincent Guittot <vincent.guittot@linaro.org>
+
+[ Upstream commit 599457ba15403037b489fe536266a3d5f9efaed7 ]
+
+cpuinfo.max_freq can change at runtime because of boost as an example. This
+implies that the value could be different from the frequency that has been
+used to compute the capacity of a CPU.
+
+The new arch_scale_freq_ref() returns a fixed and coherent frequency
+that can be used to compute the capacity for a given frequency.
+
+[ Also fix a arch_set_freq_scale() newline style wart in <linux/cpufreq.h>. ]
+
+Signed-off-by: Vincent Guittot <vincent.guittot@linaro.org>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Tested-by: Lukasz Luba <lukasz.luba@arm.com>
+Reviewed-by: Lukasz Luba <lukasz.luba@arm.com>
+Acked-by: Viresh Kumar <viresh.kumar@linaro.org>
+Acked-by: Rafael J. Wysocki <rafael@kernel.org>
+Link: https://lore.kernel.org/r/20231211104855.558096-3-vincent.guittot@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/cpufreq/cpufreq.c | 4 ++--
+ include/linux/cpufreq.h | 1 +
+ 2 files changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/cpufreq/cpufreq.c b/drivers/cpufreq/cpufreq.c
+index 934d35f570b7..44db4f59c4cc 100644
+--- a/drivers/cpufreq/cpufreq.c
++++ b/drivers/cpufreq/cpufreq.c
+@@ -454,7 +454,7 @@ void cpufreq_freq_transition_end(struct cpufreq_policy *policy,
+
+ arch_set_freq_scale(policy->related_cpus,
+ policy->cur,
+- policy->cpuinfo.max_freq);
++ arch_scale_freq_ref(policy->cpu));
+
+ spin_lock(&policy->transition_lock);
+ policy->transition_ongoing = false;
+@@ -2174,7 +2174,7 @@ unsigned int cpufreq_driver_fast_switch(struct cpufreq_policy *policy,
+
+ policy->cur = freq;
+ arch_set_freq_scale(policy->related_cpus, freq,
+- policy->cpuinfo.max_freq);
++ arch_scale_freq_ref(policy->cpu));
+ cpufreq_stats_record_transition(policy, freq);
+
+ if (trace_cpu_frequency_enabled()) {
+diff --git a/include/linux/cpufreq.h b/include/linux/cpufreq.h
+index 1c5ca92a0555..afda5f24d3dd 100644
+--- a/include/linux/cpufreq.h
++++ b/include/linux/cpufreq.h
+@@ -1203,6 +1203,7 @@ void arch_set_freq_scale(const struct cpumask *cpus,
+ {
+ }
+ #endif
++
+ /* the following are really really optional */
+ extern struct freq_attr cpufreq_freq_attr_scaling_available_freqs;
+ extern struct freq_attr cpufreq_freq_attr_scaling_boost_freqs;
+--
+2.43.0
+
--- /dev/null
+From ac31e282b900b6c54f96fc37b7b437b6c21d3e51 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 15:59:11 +0530
+Subject: crypto: octeontx2 - Fix cptvf driver cleanup
+
+From: Bharat Bhushan <bbhushan2@marvell.com>
+
+[ Upstream commit c480a421a4faf693c38e60b0fe6e554c9a3fee02 ]
+
+This patch fixes following cleanup issues:
+ - Missing instruction queue free on cleanup. This
+ will lead to memory leak.
+ - lfs->lfs_num is set to zero before cleanup, which
+ will lead to improper cleanup.
+
+Signed-off-by: Bharat Bhushan <bbhushan2@marvell.com>
+Signed-off-by: Herbert Xu <herbert@gondor.apana.org.au>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/crypto/marvell/octeontx2/otx2_cptlf.c | 6 ++++--
+ drivers/crypto/marvell/octeontx2/otx2_cptvf_main.c | 3 +++
+ 2 files changed, 7 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/crypto/marvell/octeontx2/otx2_cptlf.c b/drivers/crypto/marvell/octeontx2/otx2_cptlf.c
+index 6edd27ff8c4e..e4bd3f030cec 100644
+--- a/drivers/crypto/marvell/octeontx2/otx2_cptlf.c
++++ b/drivers/crypto/marvell/octeontx2/otx2_cptlf.c
+@@ -419,8 +419,8 @@ int otx2_cptlf_init(struct otx2_cptlfs_info *lfs, u8 eng_grp_mask, int pri,
+ return 0;
+
+ free_iq:
+- otx2_cpt_free_instruction_queues(lfs);
+ cptlf_hw_cleanup(lfs);
++ otx2_cpt_free_instruction_queues(lfs);
+ detach_rsrcs:
+ otx2_cpt_detach_rsrcs_msg(lfs);
+ clear_lfs_num:
+@@ -431,11 +431,13 @@ EXPORT_SYMBOL_NS_GPL(otx2_cptlf_init, CRYPTO_DEV_OCTEONTX2_CPT);
+
+ void otx2_cptlf_shutdown(struct otx2_cptlfs_info *lfs)
+ {
+- lfs->lfs_num = 0;
+ /* Cleanup LFs hardware side */
+ cptlf_hw_cleanup(lfs);
++ /* Free instruction queues */
++ otx2_cpt_free_instruction_queues(lfs);
+ /* Send request to detach LFs */
+ otx2_cpt_detach_rsrcs_msg(lfs);
++ lfs->lfs_num = 0;
+ }
+ EXPORT_SYMBOL_NS_GPL(otx2_cptlf_shutdown, CRYPTO_DEV_OCTEONTX2_CPT);
+
+diff --git a/drivers/crypto/marvell/octeontx2/otx2_cptvf_main.c b/drivers/crypto/marvell/octeontx2/otx2_cptvf_main.c
+index bac729c885f9..215a1b17b6ce 100644
+--- a/drivers/crypto/marvell/octeontx2/otx2_cptvf_main.c
++++ b/drivers/crypto/marvell/octeontx2/otx2_cptvf_main.c
+@@ -249,8 +249,11 @@ static void cptvf_lf_shutdown(struct otx2_cptlfs_info *lfs)
+ otx2_cptlf_unregister_interrupts(lfs);
+ /* Cleanup LFs software side */
+ lf_sw_cleanup(lfs);
++ /* Free instruction queues */
++ otx2_cpt_free_instruction_queues(lfs);
+ /* Send request to detach LFs */
+ otx2_cpt_detach_rsrcs_msg(lfs);
++ lfs->lfs_num = 0;
+ }
+
+ static int cptvf_lf_init(struct otx2_cptvf_dev *cptvf)
+--
+2.43.0
+
--- /dev/null
+From 7625745b593eb8bb2a5e157edf8abde6a402b923 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 12:52:44 -0600
+Subject: crypto: p10-aes-gcm - Avoid -Wstringop-overflow warnings
+
+From: Gustavo A. R. Silva <gustavoars@kernel.org>
+
+[ Upstream commit aaa03fdb56c781db4a4831dd5d6ec8817918c726 ]
+
+The compiler doesn't know that `32` is an offset into the Hash table:
+
+ 56 struct Hash_ctx {
+ 57 u8 H[16]; /* subkey */
+ 58 u8 Htable[256]; /* Xi, Hash table(offset 32) */
+ 59 };
+
+So, it legitimately complains about a potential out-of-bounds issue
+if `256 bytes` are accessed in `htable` (this implies going
+`32 bytes` beyond the boundaries of `Htable`):
+
+arch/powerpc/crypto/aes-gcm-p10-glue.c: In function 'gcmp10_init':
+arch/powerpc/crypto/aes-gcm-p10-glue.c:120:9: error: 'gcm_init_htable' accessing 256 bytes in a region of size 224 [-Werror=stringop-overflow=]
+ 120 | gcm_init_htable(hash->Htable+32, hash->H);
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+arch/powerpc/crypto/aes-gcm-p10-glue.c:120:9: note: referencing argument 1 of type 'unsigned char[256]'
+arch/powerpc/crypto/aes-gcm-p10-glue.c:120:9: note: referencing argument 2 of type 'unsigned char[16]'
+arch/powerpc/crypto/aes-gcm-p10-glue.c:40:17: note: in a call to function 'gcm_init_htable'
+ 40 | asmlinkage void gcm_init_htable(unsigned char htable[256], unsigned char Xi[16]);
+ | ^~~~~~~~~~~~~~~
+
+Address this by avoiding specifying the size of `htable` in the function
+prototype; and just for consistency, do the same for parameter `Xi`.
+
+Reported-by: Stephen Rothwell <sfr@canb.auug.org.au>
+Closes: https://lore.kernel.org/linux-next/20231121131903.68a37932@canb.auug.org.au/
+Signed-off-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Signed-off-by: Herbert Xu <herbert@gondor.apana.org.au>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/crypto/aes-gcm-p10-glue.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/powerpc/crypto/aes-gcm-p10-glue.c b/arch/powerpc/crypto/aes-gcm-p10-glue.c
+index 4b6e899895e7..f62ee54076c0 100644
+--- a/arch/powerpc/crypto/aes-gcm-p10-glue.c
++++ b/arch/powerpc/crypto/aes-gcm-p10-glue.c
+@@ -37,7 +37,7 @@ asmlinkage void aes_p10_gcm_encrypt(u8 *in, u8 *out, size_t len,
+ void *rkey, u8 *iv, void *Xi);
+ asmlinkage void aes_p10_gcm_decrypt(u8 *in, u8 *out, size_t len,
+ void *rkey, u8 *iv, void *Xi);
+-asmlinkage void gcm_init_htable(unsigned char htable[256], unsigned char Xi[16]);
++asmlinkage void gcm_init_htable(unsigned char htable[], unsigned char Xi[]);
+ asmlinkage void gcm_ghash_p10(unsigned char *Xi, unsigned char *Htable,
+ unsigned char *aad, unsigned int alen);
+
+--
+2.43.0
+
--- /dev/null
+From 8c9180d2db53fa9579307faaf15b28d924b32733 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 11:04:13 +0800
+Subject: crypto: starfive - Fix dev_err_probe return error
+
+From: Jia Jie Ho <jiajie.ho@starfivetech.com>
+
+[ Upstream commit 8517c34e87025b3f74f3c07813d493828f369598 ]
+
+Current dev_err_probe will return 0 instead of proper error code if
+driver failed to get irq number. Fix the return code.
+
+Signed-off-by: Jia Jie Ho <jiajie.ho@starfivetech.com>
+Signed-off-by: Herbert Xu <herbert@gondor.apana.org.au>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/crypto/starfive/jh7110-cryp.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/crypto/starfive/jh7110-cryp.c b/drivers/crypto/starfive/jh7110-cryp.c
+index 3a67ddc4d936..4f5b6818208d 100644
+--- a/drivers/crypto/starfive/jh7110-cryp.c
++++ b/drivers/crypto/starfive/jh7110-cryp.c
+@@ -168,7 +168,7 @@ static int starfive_cryp_probe(struct platform_device *pdev)
+ ret = devm_request_irq(&pdev->dev, irq, starfive_cryp_irq, 0, pdev->name,
+ (void *)cryp);
+ if (ret)
+- return dev_err_probe(&pdev->dev, irq,
++ return dev_err_probe(&pdev->dev, ret,
+ "Failed to register interrupt handler\n");
+
+ clk_prepare_enable(cryp->hclk);
+--
+2.43.0
+
--- /dev/null
+From 1dd8d5bfec44d627797e60dfe12a095cb9bd022a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 12:17:24 +0100
+Subject: crypto: stm32/crc32 - fix parsing list of devices
+
+From: Thomas Bourgoin <thomas.bourgoin@foss.st.com>
+
+[ Upstream commit 0eaef675b94c746900dcea7f6c41b9a103ed5d53 ]
+
+smatch warnings:
+drivers/crypto/stm32/stm32-crc32.c:108 stm32_crc_get_next_crc() warn:
+can 'crc' even be NULL?
+
+Use list_first_entry_or_null instead of list_first_entry to retrieve
+the first device registered.
+The function list_first_entry always return a non NULL pointer even if
+the list is empty. Hence checking if the pointer returned is NULL does
+not tell if the list is empty or not.
+
+Reported-by: kernel test robot <lkp@intel.com>
+Closes: https://lore.kernel.org/r/202311281111.ou2oUL2i-lkp@intel.com/
+Reported-by: Dan Carpenter <error27@gmail.com>
+Closes: https://lore.kernel.org/r/202311281111.ou2oUL2i-lkp@intel.com/
+Signed-off-by: Thomas Bourgoin <thomas.bourgoin@foss.st.com>
+Signed-off-by: Herbert Xu <herbert@gondor.apana.org.au>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/crypto/stm32/stm32-crc32.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/crypto/stm32/stm32-crc32.c b/drivers/crypto/stm32/stm32-crc32.c
+index b2d5c8921ab3..b0cf6d2fd352 100644
+--- a/drivers/crypto/stm32/stm32-crc32.c
++++ b/drivers/crypto/stm32/stm32-crc32.c
+@@ -104,7 +104,7 @@ static struct stm32_crc *stm32_crc_get_next_crc(void)
+ struct stm32_crc *crc;
+
+ spin_lock_bh(&crc_list.lock);
+- crc = list_first_entry(&crc_list.dev_list, struct stm32_crc, list);
++ crc = list_first_entry_or_null(&crc_list.dev_list, struct stm32_crc, list);
+ if (crc)
+ list_move_tail(&crc->list, &crc_list.dev_list);
+ spin_unlock_bh(&crc_list.lock);
+--
+2.43.0
+
--- /dev/null
+From fb469c7bea06b9dce28429c5788bed26a4c2c797 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 25 Oct 2023 23:39:07 +0200
+Subject: debugobjects: Stop accessing objects after releasing hash bucket lock
+
+From: Andrzej Hajda <andrzej.hajda@intel.com>
+
+[ Upstream commit 9bb6362652f3f4d74a87d572a91ee1b38e673ef6 ]
+
+After release of the hashbucket lock the tracking object can be modified or
+freed by a concurrent thread. Using it in such a case is error prone, even
+for printing the object state:
+
+ 1. T1 tries to deactivate destroyed object, debugobjects detects it,
+ hash bucket lock is released.
+
+ 2. T2 preempts T1 and frees the tracking object.
+
+ 3. The freed tracking object is allocated and initialized for a
+ different to be tracked kernel object.
+
+ 4. T1 resumes and reports error for wrong kernel object.
+
+Create a local copy of the tracking object before releasing the hash bucket
+lock and use the local copy for reporting and fixups to prevent this.
+
+Signed-off-by: Andrzej Hajda <andrzej.hajda@intel.com>
+Signed-off-by: Thomas Gleixner <tglx@linutronix.de>
+Link: https://lore.kernel.org/r/20231025-debugobjects_fix-v3-1-2bc3bf7084c2@intel.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ lib/debugobjects.c | 200 ++++++++++++++++++---------------------------
+ 1 file changed, 78 insertions(+), 122 deletions(-)
+
+diff --git a/lib/debugobjects.c b/lib/debugobjects.c
+index 2a8e9d63fbe3..fb12a9bacd2f 100644
+--- a/lib/debugobjects.c
++++ b/lib/debugobjects.c
+@@ -620,9 +620,8 @@ static void debug_objects_fill_pool(void)
+ static void
+ __debug_object_init(void *addr, const struct debug_obj_descr *descr, int onstack)
+ {
+- enum debug_obj_state state;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+- struct debug_obj *obj;
+ unsigned long flags;
+
+ debug_objects_fill_pool();
+@@ -643,24 +642,18 @@ __debug_object_init(void *addr, const struct debug_obj_descr *descr, int onstack
+ case ODEBUG_STATE_INIT:
+ case ODEBUG_STATE_INACTIVE:
+ obj->state = ODEBUG_STATE_INIT;
+- break;
+-
+- case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "init");
+- debug_object_fixup(descr->fixup_init, addr, state);
+- return;
+-
+- case ODEBUG_STATE_DESTROYED:
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "init");
+ return;
+ default:
+ break;
+ }
+
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_print_object(&o, "init");
++
++ if (o.state == ODEBUG_STATE_ACTIVE)
++ debug_object_fixup(descr->fixup_init, addr, o.state);
+ }
+
+ /**
+@@ -701,11 +694,9 @@ EXPORT_SYMBOL_GPL(debug_object_init_on_stack);
+ int debug_object_activate(void *addr, const struct debug_obj_descr *descr)
+ {
+ struct debug_obj o = { .object = addr, .state = ODEBUG_STATE_NOTAVAILABLE, .descr = descr };
+- enum debug_obj_state state;
+ struct debug_bucket *db;
+ struct debug_obj *obj;
+ unsigned long flags;
+- int ret;
+
+ if (!debug_objects_enabled)
+ return 0;
+@@ -717,49 +708,38 @@ int debug_object_activate(void *addr, const struct debug_obj_descr *descr)
+ raw_spin_lock_irqsave(&db->lock, flags);
+
+ obj = lookup_object_or_alloc(addr, db, descr, false, true);
+- if (likely(!IS_ERR_OR_NULL(obj))) {
+- bool print_object = false;
+-
++ if (unlikely(!obj)) {
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_objects_oom();
++ return 0;
++ } else if (likely(!IS_ERR(obj))) {
+ switch (obj->state) {
+- case ODEBUG_STATE_INIT:
+- case ODEBUG_STATE_INACTIVE:
+- obj->state = ODEBUG_STATE_ACTIVE;
+- ret = 0;
+- break;
+-
+ case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "activate");
+- ret = debug_object_fixup(descr->fixup_activate, addr, state);
+- return ret ? 0 : -EINVAL;
+-
+ case ODEBUG_STATE_DESTROYED:
+- print_object = true;
+- ret = -EINVAL;
++ o = *obj;
+ break;
++ case ODEBUG_STATE_INIT:
++ case ODEBUG_STATE_INACTIVE:
++ obj->state = ODEBUG_STATE_ACTIVE;
++ fallthrough;
+ default:
+- ret = 0;
+- break;
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return 0;
+ }
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (print_object)
+- debug_print_object(obj, "activate");
+- return ret;
+ }
+
+ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_print_object(&o, "activate");
+
+- /* If NULL the allocation has hit OOM */
+- if (!obj) {
+- debug_objects_oom();
+- return 0;
++ switch (o.state) {
++ case ODEBUG_STATE_ACTIVE:
++ case ODEBUG_STATE_NOTAVAILABLE:
++ if (debug_object_fixup(descr->fixup_activate, addr, o.state))
++ return 0;
++ fallthrough;
++ default:
++ return -EINVAL;
+ }
+-
+- /* Object is neither static nor tracked. It's not initialized */
+- debug_print_object(&o, "activate");
+- ret = debug_object_fixup(descr->fixup_activate, addr, ODEBUG_STATE_NOTAVAILABLE);
+- return ret ? 0 : -EINVAL;
+ }
+ EXPORT_SYMBOL_GPL(debug_object_activate);
+
+@@ -770,10 +750,10 @@ EXPORT_SYMBOL_GPL(debug_object_activate);
+ */
+ void debug_object_deactivate(void *addr, const struct debug_obj_descr *descr)
+ {
++ struct debug_obj o = { .object = addr, .state = ODEBUG_STATE_NOTAVAILABLE, .descr = descr };
+ struct debug_bucket *db;
+ struct debug_obj *obj;
+ unsigned long flags;
+- bool print_object = false;
+
+ if (!debug_objects_enabled)
+ return;
+@@ -785,33 +765,24 @@ void debug_object_deactivate(void *addr, const struct debug_obj_descr *descr)
+ obj = lookup_object(addr, db);
+ if (obj) {
+ switch (obj->state) {
++ case ODEBUG_STATE_DESTROYED:
++ break;
+ case ODEBUG_STATE_INIT:
+ case ODEBUG_STATE_INACTIVE:
+ case ODEBUG_STATE_ACTIVE:
+- if (!obj->astate)
+- obj->state = ODEBUG_STATE_INACTIVE;
+- else
+- print_object = true;
+- break;
+-
+- case ODEBUG_STATE_DESTROYED:
+- print_object = true;
+- break;
++ if (obj->astate)
++ break;
++ obj->state = ODEBUG_STATE_INACTIVE;
++ fallthrough;
+ default:
+- break;
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
+ }
++ o = *obj;
+ }
+
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (!obj) {
+- struct debug_obj o = { .object = addr,
+- .state = ODEBUG_STATE_NOTAVAILABLE,
+- .descr = descr };
+-
+- debug_print_object(&o, "deactivate");
+- } else if (print_object) {
+- debug_print_object(obj, "deactivate");
+- }
++ debug_print_object(&o, "deactivate");
+ }
+ EXPORT_SYMBOL_GPL(debug_object_deactivate);
+
+@@ -822,11 +793,9 @@ EXPORT_SYMBOL_GPL(debug_object_deactivate);
+ */
+ void debug_object_destroy(void *addr, const struct debug_obj_descr *descr)
+ {
+- enum debug_obj_state state;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+- struct debug_obj *obj;
+ unsigned long flags;
+- bool print_object = false;
+
+ if (!debug_objects_enabled)
+ return;
+@@ -836,32 +805,31 @@ void debug_object_destroy(void *addr, const struct debug_obj_descr *descr)
+ raw_spin_lock_irqsave(&db->lock, flags);
+
+ obj = lookup_object(addr, db);
+- if (!obj)
+- goto out_unlock;
++ if (!obj) {
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
++ }
+
+ switch (obj->state) {
++ case ODEBUG_STATE_ACTIVE:
++ case ODEBUG_STATE_DESTROYED:
++ break;
+ case ODEBUG_STATE_NONE:
+ case ODEBUG_STATE_INIT:
+ case ODEBUG_STATE_INACTIVE:
+ obj->state = ODEBUG_STATE_DESTROYED;
+- break;
+- case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
++ fallthrough;
++ default:
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "destroy");
+- debug_object_fixup(descr->fixup_destroy, addr, state);
+ return;
+-
+- case ODEBUG_STATE_DESTROYED:
+- print_object = true;
+- break;
+- default:
+- break;
+ }
+-out_unlock:
++
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (print_object)
+- debug_print_object(obj, "destroy");
++ debug_print_object(&o, "destroy");
++
++ if (o.state == ODEBUG_STATE_ACTIVE)
++ debug_object_fixup(descr->fixup_destroy, addr, o.state);
+ }
+ EXPORT_SYMBOL_GPL(debug_object_destroy);
+
+@@ -872,9 +840,8 @@ EXPORT_SYMBOL_GPL(debug_object_destroy);
+ */
+ void debug_object_free(void *addr, const struct debug_obj_descr *descr)
+ {
+- enum debug_obj_state state;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+- struct debug_obj *obj;
+ unsigned long flags;
+
+ if (!debug_objects_enabled)
+@@ -885,24 +852,26 @@ void debug_object_free(void *addr, const struct debug_obj_descr *descr)
+ raw_spin_lock_irqsave(&db->lock, flags);
+
+ obj = lookup_object(addr, db);
+- if (!obj)
+- goto out_unlock;
++ if (!obj) {
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
++ }
+
+ switch (obj->state) {
+ case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "free");
+- debug_object_fixup(descr->fixup_free, addr, state);
+- return;
++ break;
+ default:
+ hlist_del(&obj->node);
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+ free_object(obj);
+ return;
+ }
+-out_unlock:
++
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_print_object(&o, "free");
++
++ debug_object_fixup(descr->fixup_free, addr, o.state);
+ }
+ EXPORT_SYMBOL_GPL(debug_object_free);
+
+@@ -954,10 +923,10 @@ void
+ debug_object_active_state(void *addr, const struct debug_obj_descr *descr,
+ unsigned int expect, unsigned int next)
+ {
++ struct debug_obj o = { .object = addr, .state = ODEBUG_STATE_NOTAVAILABLE, .descr = descr };
+ struct debug_bucket *db;
+ struct debug_obj *obj;
+ unsigned long flags;
+- bool print_object = false;
+
+ if (!debug_objects_enabled)
+ return;
+@@ -970,28 +939,19 @@ debug_object_active_state(void *addr, const struct debug_obj_descr *descr,
+ if (obj) {
+ switch (obj->state) {
+ case ODEBUG_STATE_ACTIVE:
+- if (obj->astate == expect)
+- obj->astate = next;
+- else
+- print_object = true;
+- break;
+-
++ if (obj->astate != expect)
++ break;
++ obj->astate = next;
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
+ default:
+- print_object = true;
+ break;
+ }
++ o = *obj;
+ }
+
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (!obj) {
+- struct debug_obj o = { .object = addr,
+- .state = ODEBUG_STATE_NOTAVAILABLE,
+- .descr = descr };
+-
+- debug_print_object(&o, "active_state");
+- } else if (print_object) {
+- debug_print_object(obj, "active_state");
+- }
++ debug_print_object(&o, "active_state");
+ }
+ EXPORT_SYMBOL_GPL(debug_object_active_state);
+
+@@ -999,12 +959,10 @@ EXPORT_SYMBOL_GPL(debug_object_active_state);
+ static void __debug_check_no_obj_freed(const void *address, unsigned long size)
+ {
+ unsigned long flags, oaddr, saddr, eaddr, paddr, chunks;
+- const struct debug_obj_descr *descr;
+- enum debug_obj_state state;
++ int cnt, objs_checked = 0;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+ struct hlist_node *tmp;
+- struct debug_obj *obj;
+- int cnt, objs_checked = 0;
+
+ saddr = (unsigned long) address;
+ eaddr = saddr + size;
+@@ -1026,12 +984,10 @@ static void __debug_check_no_obj_freed(const void *address, unsigned long size)
+
+ switch (obj->state) {
+ case ODEBUG_STATE_ACTIVE:
+- descr = obj->descr;
+- state = obj->state;
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "free");
+- debug_object_fixup(descr->fixup_free,
+- (void *) oaddr, state);
++ debug_print_object(&o, "free");
++ debug_object_fixup(o.descr->fixup_free, (void *)oaddr, o.state);
+ goto repeat;
+ default:
+ hlist_del(&obj->node);
+--
+2.43.0
+
--- /dev/null
+From 420dddf5022217c7ec28ce9f3bbd374d933b78fa Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 11:58:47 +0000
+Subject: drivers/perf: pmuv3: don't expose SW_INCR event in sysfs
+
+From: Mark Rutland <mark.rutland@arm.com>
+
+[ Upstream commit ca6f537e459e2da4b331fe8928d1a0b0f9301f42 ]
+
+The SW_INCR event is somewhat unusual, and depends on the specific HW
+counter that it is programmed into. When programmed into PMEVCNTR<n>,
+SW_INCR will count any writes to PMSWINC_EL0 with bit n set, ignoring
+writes to SW_INCR with bit n clear.
+
+Event rotation means that there's no fixed relationship between
+perf_events and HW counters, so this isn't all that useful.
+
+Further, we program PMUSERENR.{SW,EN}=={0,0}, which causes EL0 writes to
+PMSWINC_EL0 to be trapped and handled as UNDEFINED, resulting in a
+SIGILL to userspace.
+
+Given that, it's not a good idea to expose SW_INCR in sysfs. Hide it as
+we did for CHAIN back in commit:
+
+ 4ba2578fa7b55701 ("arm64: perf: don't expose CHAIN event in sysfs")
+
+Signed-off-by: Mark Rutland <mark.rutland@arm.com>
+Cc: Will Deacon <will@kernel.org>
+Link: https://lore.kernel.org/r/20231204115847.2993026-1-mark.rutland@arm.com
+Signed-off-by: Will Deacon <will@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/perf/arm_pmuv3.c | 6 +++++-
+ 1 file changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/perf/arm_pmuv3.c b/drivers/perf/arm_pmuv3.c
+index 6ca7be05229c..0e80fdc9f9ca 100644
+--- a/drivers/perf/arm_pmuv3.c
++++ b/drivers/perf/arm_pmuv3.c
+@@ -169,7 +169,11 @@ armv8pmu_events_sysfs_show(struct device *dev,
+ PMU_EVENT_ATTR_ID(name, armv8pmu_events_sysfs_show, config)
+
+ static struct attribute *armv8_pmuv3_event_attrs[] = {
+- ARMV8_EVENT_ATTR(sw_incr, ARMV8_PMUV3_PERFCTR_SW_INCR),
++ /*
++ * Don't expose the sw_incr event in /sys. It's not usable as writes to
++ * PMSWINC_EL0 will trap as PMUSERENR.{SW,EN}=={0,0} and event rotation
++ * means we don't have a fixed event<->counter relationship regardless.
++ */
+ ARMV8_EVENT_ATTR(l1i_cache_refill, ARMV8_PMUV3_PERFCTR_L1I_CACHE_REFILL),
+ ARMV8_EVENT_ATTR(l1i_tlb_refill, ARMV8_PMUV3_PERFCTR_L1I_TLB_REFILL),
+ ARMV8_EVENT_ATTR(l1d_cache_refill, ARMV8_PMUV3_PERFCTR_L1D_CACHE_REFILL),
+--
+2.43.0
+
--- /dev/null
+From 00e1aa06dabbc04a5f510aaef1088645d892458e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 06:25:20 -0700
+Subject: drm/amd/display: add support for DTO genarated dscclk
+
+From: Wenjing Liu <wenjing.liu@amd.com>
+
+[ Upstream commit 08a32addf17317b9fac55be9b31275cbf6e41fb7 ]
+
+Current implementation will choose to use refclk as dscclk. This is not
+recommended by hardware team as refclk is a fixed value which could
+cause unnecessary power consumption or it could be not enough for large
+DSC timings. So we are adding new interfaces so we could switch to use
+dynamically generated DSCCLK by DTO. So DSCCLK is programmable based on
+current pixel clock and dispclk.
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: Chaitanya Dhere <chaitanya.dhere@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Wenjing Liu <wenjing.liu@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../amd/display/dc/hwss/dcn32/dcn32_hwseq.c | 25 +++++++++++++++++
+ drivers/gpu/drm/amd/display/dc/inc/hw/dccg.h | 4 +++
+ .../gpu/drm/amd/display/dc/link/link_dpms.c | 27 ++++++++++++++++++-
+ 3 files changed, 55 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dcn32/dcn32_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dcn32/dcn32_hwseq.c
+index 5bf9e7c1e052..cb9d8389329f 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dcn32/dcn32_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dcn32/dcn32_hwseq.c
+@@ -995,9 +995,22 @@ static int calc_mpc_flow_ctrl_cnt(const struct dc_stream_state *stream,
+ static void update_dsc_on_stream(struct pipe_ctx *pipe_ctx, bool enable)
+ {
+ struct display_stream_compressor *dsc = pipe_ctx->stream_res.dsc;
++ struct dc *dc = pipe_ctx->stream->ctx->dc;
+ struct dc_stream_state *stream = pipe_ctx->stream;
+ struct pipe_ctx *odm_pipe;
+ int opp_cnt = 1;
++ struct dccg *dccg = dc->res_pool->dccg;
++ /* It has been found that when DSCCLK is lower than 16Mhz, we will get DCN
++ * register access hung. When DSCCLk is based on refclk, DSCCLk is always a
++ * fixed value higher than 16Mhz so the issue doesn't occur. When DSCCLK is
++ * generated by DTO, DSCCLK would be based on 1/3 dispclk. For small timings
++ * with DSC such as 480p60Hz, the dispclk could be low enough to trigger
++ * this problem. We are implementing a workaround here to keep using dscclk
++ * based on fixed value refclk when timing is smaller than 3x16Mhz (i.e
++ * 48Mhz) pixel clock to avoid hitting this problem.
++ */
++ bool should_use_dto_dscclk = (dccg->funcs->set_dto_dscclk != NULL) &&
++ stream->timing.pix_clk_100hz > 480000;
+
+ ASSERT(dsc);
+ for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe)
+@@ -1020,12 +1033,16 @@ static void update_dsc_on_stream(struct pipe_ctx *pipe_ctx, bool enable)
+
+ dsc->funcs->dsc_set_config(dsc, &dsc_cfg, &dsc_optc_cfg);
+ dsc->funcs->dsc_enable(dsc, pipe_ctx->stream_res.opp->inst);
++ if (should_use_dto_dscclk)
++ dccg->funcs->set_dto_dscclk(dccg, dsc->inst);
+ for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe) {
+ struct display_stream_compressor *odm_dsc = odm_pipe->stream_res.dsc;
+
+ ASSERT(odm_dsc);
+ odm_dsc->funcs->dsc_set_config(odm_dsc, &dsc_cfg, &dsc_optc_cfg);
+ odm_dsc->funcs->dsc_enable(odm_dsc, odm_pipe->stream_res.opp->inst);
++ if (should_use_dto_dscclk)
++ dccg->funcs->set_dto_dscclk(dccg, odm_dsc->inst);
+ }
+ dsc_cfg.dc_dsc_cfg.num_slices_h *= opp_cnt;
+ dsc_cfg.pic_width *= opp_cnt;
+@@ -1045,9 +1062,13 @@ static void update_dsc_on_stream(struct pipe_ctx *pipe_ctx, bool enable)
+ OPTC_DSC_DISABLED, 0, 0);
+
+ /* disable DSC block */
++ if (dccg->funcs->set_ref_dscclk)
++ dccg->funcs->set_ref_dscclk(dccg, pipe_ctx->stream_res.dsc->inst);
+ dsc->funcs->dsc_disable(pipe_ctx->stream_res.dsc);
+ for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe) {
+ ASSERT(odm_pipe->stream_res.dsc);
++ if (dccg->funcs->set_ref_dscclk)
++ dccg->funcs->set_ref_dscclk(dccg, odm_pipe->stream_res.dsc->inst);
+ odm_pipe->stream_res.dsc->funcs->dsc_disable(odm_pipe->stream_res.dsc);
+ }
+ }
+@@ -1130,6 +1151,10 @@ void dcn32_update_odm(struct dc *dc, struct dc_state *context, struct pipe_ctx *
+ if (!pipe_ctx->next_odm_pipe && current_pipe_ctx->next_odm_pipe &&
+ current_pipe_ctx->next_odm_pipe->stream_res.dsc) {
+ struct display_stream_compressor *dsc = current_pipe_ctx->next_odm_pipe->stream_res.dsc;
++ struct dccg *dccg = dc->res_pool->dccg;
++
++ if (dccg->funcs->set_ref_dscclk)
++ dccg->funcs->set_ref_dscclk(dccg, dsc->inst);
+ /* disconnect DSC block from stream */
+ dsc->funcs->dsc_disconnect(dsc);
+ }
+diff --git a/drivers/gpu/drm/amd/display/dc/inc/hw/dccg.h b/drivers/gpu/drm/amd/display/dc/inc/hw/dccg.h
+index ce2f0c0e82bd..6b44557fcb1a 100644
+--- a/drivers/gpu/drm/amd/display/dc/inc/hw/dccg.h
++++ b/drivers/gpu/drm/amd/display/dc/inc/hw/dccg.h
+@@ -201,6 +201,10 @@ struct dccg_funcs {
+ struct dccg *dccg,
+ enum streamclk_source src,
+ uint32_t otg_inst);
++ void (*set_dto_dscclk)(
++ struct dccg *dccg,
++ uint32_t dsc_inst);
++ void (*set_ref_dscclk)(struct dccg *dccg, uint32_t dsc_inst);
+ };
+
+ #endif //__DAL_DCCG_H__
+diff --git a/drivers/gpu/drm/amd/display/dc/link/link_dpms.c b/drivers/gpu/drm/amd/display/dc/link/link_dpms.c
+index d28564b1b28a..a08ae59c1ea9 100644
+--- a/drivers/gpu/drm/amd/display/dc/link/link_dpms.c
++++ b/drivers/gpu/drm/amd/display/dc/link/link_dpms.c
+@@ -776,10 +776,26 @@ static bool dp_set_dsc_on_rx(struct pipe_ctx *pipe_ctx, bool enable)
+ */
+ void link_set_dsc_on_stream(struct pipe_ctx *pipe_ctx, bool enable)
+ {
++ /* TODO: Move this to HWSS as this is hardware programming sequence not a
++ * link layer sequence
++ */
+ struct display_stream_compressor *dsc = pipe_ctx->stream_res.dsc;
++ struct dc *dc = pipe_ctx->stream->ctx->dc;
+ struct dc_stream_state *stream = pipe_ctx->stream;
+ struct pipe_ctx *odm_pipe;
+ int opp_cnt = 1;
++ struct dccg *dccg = dc->res_pool->dccg;
++ /* It has been found that when DSCCLK is lower than 16Mhz, we will get DCN
++ * register access hung. When DSCCLk is based on refclk, DSCCLk is always a
++ * fixed value higher than 16Mhz so the issue doesn't occur. When DSCCLK is
++ * generated by DTO, DSCCLK would be based on 1/3 dispclk. For small timings
++ * with DSC such as 480p60Hz, the dispclk could be low enough to trigger
++ * this problem. We are implementing a workaround here to keep using dscclk
++ * based on fixed value refclk when timing is smaller than 3x16Mhz (i.e
++ * 48Mhz) pixel clock to avoid hitting this problem.
++ */
++ bool should_use_dto_dscclk = (dccg->funcs->set_dto_dscclk != NULL) &&
++ stream->timing.pix_clk_100hz > 480000;
+ DC_LOGGER_INIT(dsc->ctx->logger);
+
+ for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe)
+@@ -802,11 +818,15 @@ void link_set_dsc_on_stream(struct pipe_ctx *pipe_ctx, bool enable)
+
+ dsc->funcs->dsc_set_config(dsc, &dsc_cfg, &dsc_optc_cfg);
+ dsc->funcs->dsc_enable(dsc, pipe_ctx->stream_res.opp->inst);
++ if (should_use_dto_dscclk)
++ dccg->funcs->set_dto_dscclk(dccg, dsc->inst);
+ for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe) {
+ struct display_stream_compressor *odm_dsc = odm_pipe->stream_res.dsc;
+
+ odm_dsc->funcs->dsc_set_config(odm_dsc, &dsc_cfg, &dsc_optc_cfg);
+ odm_dsc->funcs->dsc_enable(odm_dsc, odm_pipe->stream_res.opp->inst);
++ if (should_use_dto_dscclk)
++ dccg->funcs->set_dto_dscclk(dccg, odm_dsc->inst);
+ }
+ dsc_cfg.dc_dsc_cfg.num_slices_h *= opp_cnt;
+ dsc_cfg.pic_width *= opp_cnt;
+@@ -856,9 +876,14 @@ void link_set_dsc_on_stream(struct pipe_ctx *pipe_ctx, bool enable)
+ }
+
+ /* disable DSC block */
++ if (dccg->funcs->set_ref_dscclk)
++ dccg->funcs->set_ref_dscclk(dccg, pipe_ctx->stream_res.dsc->inst);
+ pipe_ctx->stream_res.dsc->funcs->dsc_disable(pipe_ctx->stream_res.dsc);
+- for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe)
++ for (odm_pipe = pipe_ctx->next_odm_pipe; odm_pipe; odm_pipe = odm_pipe->next_odm_pipe) {
++ if (dccg->funcs->set_ref_dscclk)
++ dccg->funcs->set_ref_dscclk(dccg, odm_pipe->stream_res.dsc->inst);
+ odm_pipe->stream_res.dsc->funcs->dsc_disable(odm_pipe->stream_res.dsc);
++ }
+ }
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 8131e5eaf45f4307ad6afaaaf3b45fc0e6218719 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 06:25:15 -0700
+Subject: drm/amd/display: Fix disable_otg_wa logic
+
+From: Nicholas Susanto <nicholas.susanto@amd.com>
+
+[ Upstream commit 2ce156482a6fef349d2eba98e5070c412d3af662 ]
+
+[Why]
+When switching to another HDMI mode, we are unnecesarilly
+disabling/enabling FIFO causing both HPO and DIG registers to be set at
+the same time when only HPO is supposed to be set.
+
+This can lead to a system hang the next time we change refresh rates as
+there are cases when we don't disable OTG/FIFO but FIFO is enabled when
+it isn't supposed to be.
+
+[How]
+Removing the enable/disable FIFO entirely.
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: Nicholas Kazlauskas <nicholas.kazlauskas@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Nicholas Susanto <nicholas.susanto@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../gpu/drm/amd/display/dc/clk_mgr/dcn35/dcn35_clk_mgr.c | 8 --------
+ 1 file changed, 8 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn35/dcn35_clk_mgr.c b/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn35/dcn35_clk_mgr.c
+index 45ede6440a79..4ef90a3add1c 100644
+--- a/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn35/dcn35_clk_mgr.c
++++ b/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn35/dcn35_clk_mgr.c
+@@ -126,21 +126,13 @@ static void dcn35_disable_otg_wa(struct clk_mgr *clk_mgr_base, struct dc_state *
+ continue;
+ if (pipe->stream && (pipe->stream->dpms_off || dc_is_virtual_signal(pipe->stream->signal) ||
+ !pipe->stream->link_enc)) {
+- struct stream_encoder *stream_enc = pipe->stream_res.stream_enc;
+-
+ if (disable) {
+- if (stream_enc && stream_enc->funcs->disable_fifo)
+- pipe->stream_res.stream_enc->funcs->disable_fifo(stream_enc);
+-
+ if (pipe->stream_res.tg && pipe->stream_res.tg->funcs->immediate_disable_crtc)
+ pipe->stream_res.tg->funcs->immediate_disable_crtc(pipe->stream_res.tg);
+
+ reset_sync_context_for_pipe(dc, context, i);
+ } else {
+ pipe->stream_res.tg->funcs->enable_crtc(pipe->stream_res.tg);
+-
+- if (stream_enc && stream_enc->funcs->enable_fifo)
+- pipe->stream_res.stream_enc->funcs->enable_fifo(stream_enc);
+ }
+ }
+ }
+--
+2.43.0
+
--- /dev/null
+From 9b20c0009b5885b977813a0fd6806b15ae087ff8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 10:44:36 -0500
+Subject: drm/amd/display: Fix lightup regression with DP2 single display
+ configs
+
+From: Michael Strauss <michael.strauss@amd.com>
+
+[ Upstream commit 5a82b8d6c05f9b30828ede1b103b9ee5cb5c912e ]
+
+[WHY]
+Previous fix for multiple displays downstream of DP2 MST hub caused regression
+
+[HOW]
+Match sink IDs instead of sink struct addresses
+
+Reviewed-by: Nicholas Kazlauskas <nicholas.kazlauskas@amd.com>
+Reviewed-by: Charlene Liu <charlene.liu@amd.com>
+Acked-by: Wayne Lin <wayne.lin@amd.com>
+Signed-off-by: Michael Strauss <michael.strauss@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/dml2/dml2_utils.c | 8 ++++++++
+ 1 file changed, 8 insertions(+)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dml2/dml2_utils.c b/drivers/gpu/drm/amd/display/dc/dml2/dml2_utils.c
+index 2498b8341199..d6a68484153c 100644
+--- a/drivers/gpu/drm/amd/display/dc/dml2/dml2_utils.c
++++ b/drivers/gpu/drm/amd/display/dc/dml2/dml2_utils.c
+@@ -157,6 +157,14 @@ bool is_dp2p0_output_encoder(const struct pipe_ctx *pipe_ctx)
+ {
+ /* If this assert is hit then we have a link encoder dynamic management issue */
+ ASSERT(pipe_ctx->stream_res.hpo_dp_stream_enc ? pipe_ctx->link_res.hpo_dp_link_enc != NULL : true);
++ /* Count MST hubs once by treating only 1st remote sink in topology as an encoder */
++ if (pipe_ctx->stream->link && pipe_ctx->stream->link->remote_sinks[0]) {
++ return (pipe_ctx->stream_res.hpo_dp_stream_enc &&
++ pipe_ctx->link_res.hpo_dp_link_enc &&
++ dc_is_dp_signal(pipe_ctx->stream->signal) &&
++ (pipe_ctx->stream->link->remote_sinks[0]->sink_id == pipe_ctx->stream->sink->sink_id));
++ }
++
+ return (pipe_ctx->stream_res.hpo_dp_stream_enc &&
+ pipe_ctx->link_res.hpo_dp_link_enc &&
+ dc_is_dp_signal(pipe_ctx->stream->signal));
+--
+2.43.0
+
--- /dev/null
+From 14d9ee8037df239b692478663c2a23a02c7a1933 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 10:57:45 -0500
+Subject: drm/amd/display: Fix minor issues in BW Allocation Phase2
+
+From: Meenakshikumar Somasundaram <meenakshikumar.somasundaram@amd.com>
+
+[ Upstream commit aa5dc05340eb97486a631ce6bccb8d020bf6b56b ]
+
+[Why]
+Fix minor issues in BW Allocation Phase2.
+
+[How]
+- In set_usb4_req_bw_req(), link->dpia_bw_alloc_config.response_ready
+ flag should be reset before writing DPCD REQUEST_BW.
+- Fix the granularity for value of 2 in get_bw_granularity().
+- Removed bandwidth allocation support display fw boot option as
+ the fw would read feature enable status from bios.
+- Clean up DPIA_EST_BW_CHANGED and DPIA_BW_REQ_SUCCESS cases in
+ dpia_handle_bw_alloc_response().
+- Removed allocate_usb4_bw and deallocate_usb4_bw.
+- Optimized loop in get_lowest_dpia_index().
+- Updated link_dp_dpia_allocate_usb4_bandwidth_for_stream() and
+ set_usb4_req_bw_req() to always issue request bw.
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: PeiChen Huang <peichen.huang@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Meenakshikumar Somasundaram <meenakshikumar.somasundaram@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../dc/link/protocols/link_dp_dpia_bw.c | 221 ++++++++----------
+ .../dc/link/protocols/link_dp_dpia_bw.h | 4 +-
+ 2 files changed, 101 insertions(+), 124 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.c b/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.c
+index 7581023daa47..d6e1f969bfd5 100644
+--- a/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.c
++++ b/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.c
+@@ -50,6 +50,7 @@ static bool get_bw_alloc_proceed_flag(struct dc_link *tmp)
+ && tmp->hpd_status
+ && tmp->dpia_bw_alloc_config.bw_alloc_enabled);
+ }
++
+ static void reset_bw_alloc_struct(struct dc_link *link)
+ {
+ link->dpia_bw_alloc_config.bw_alloc_enabled = false;
+@@ -59,6 +60,11 @@ static void reset_bw_alloc_struct(struct dc_link *link)
+ link->dpia_bw_alloc_config.bw_granularity = 0;
+ link->dpia_bw_alloc_config.response_ready = false;
+ }
++
++#define BW_GRANULARITY_0 4 // 0.25 Gbps
++#define BW_GRANULARITY_1 2 // 0.5 Gbps
++#define BW_GRANULARITY_2 1 // 1 Gbps
++
+ static uint8_t get_bw_granularity(struct dc_link *link)
+ {
+ uint8_t bw_granularity = 0;
+@@ -71,16 +77,20 @@ static uint8_t get_bw_granularity(struct dc_link *link)
+
+ switch (bw_granularity & 0x3) {
+ case 0:
+- bw_granularity = 4;
++ bw_granularity = BW_GRANULARITY_0;
+ break;
+ case 1:
++ bw_granularity = BW_GRANULARITY_1;
++ break;
++ case 2:
+ default:
+- bw_granularity = 2;
++ bw_granularity = BW_GRANULARITY_2;
+ break;
+ }
+
+ return bw_granularity;
+ }
++
+ static int get_estimated_bw(struct dc_link *link)
+ {
+ uint8_t bw_estimated_bw = 0;
+@@ -93,31 +103,7 @@ static int get_estimated_bw(struct dc_link *link)
+
+ return bw_estimated_bw * (Kbps_TO_Gbps / link->dpia_bw_alloc_config.bw_granularity);
+ }
+-static bool allocate_usb4_bw(int *stream_allocated_bw, int bw_needed, struct dc_link *link)
+-{
+- if (bw_needed > 0)
+- *stream_allocated_bw += bw_needed;
+-
+- return true;
+-}
+-static bool deallocate_usb4_bw(int *stream_allocated_bw, int bw_to_dealloc, struct dc_link *link)
+-{
+- bool ret = false;
+-
+- if (*stream_allocated_bw > 0) {
+- *stream_allocated_bw -= bw_to_dealloc;
+- ret = true;
+- } else {
+- //Do nothing for now
+- ret = true;
+- }
+
+- // Unplug so reset values
+- if (!link->hpd_status)
+- reset_bw_alloc_struct(link);
+-
+- return ret;
+-}
+ /*
+ * Read all New BW alloc configuration ex: estimated_bw, allocated_bw,
+ * granuality, Driver_ID, CM_Group, & populate the BW allocation structs
+@@ -128,7 +114,12 @@ static void init_usb4_bw_struct(struct dc_link *link)
+ // Init the known values
+ link->dpia_bw_alloc_config.bw_granularity = get_bw_granularity(link);
+ link->dpia_bw_alloc_config.estimated_bw = get_estimated_bw(link);
++
++ DC_LOG_DEBUG("%s: bw_granularity(%d), estimated_bw(%d)\n",
++ __func__, link->dpia_bw_alloc_config.bw_granularity,
++ link->dpia_bw_alloc_config.estimated_bw);
+ }
++
+ static uint8_t get_lowest_dpia_index(struct dc_link *link)
+ {
+ const struct dc *dc_struct = link->dc;
+@@ -141,12 +132,15 @@ static uint8_t get_lowest_dpia_index(struct dc_link *link)
+ dc_struct->links[i]->ep_type != DISPLAY_ENDPOINT_USB4_DPIA)
+ continue;
+
+- if (idx > dc_struct->links[i]->link_index)
++ if (idx > dc_struct->links[i]->link_index) {
+ idx = dc_struct->links[i]->link_index;
++ break;
++ }
+ }
+
+ return idx;
+ }
++
+ /*
+ * Get the Max Available BW or Max Estimated BW for each Host Router
+ *
+@@ -186,6 +180,7 @@ static int get_host_router_total_bw(struct dc_link *link, uint8_t type)
+
+ return total_bw;
+ }
++
+ /*
+ * Cleanup function for when the dpia is unplugged to reset struct
+ * and perform any required clean up
+@@ -194,42 +189,50 @@ static int get_host_router_total_bw(struct dc_link *link, uint8_t type)
+ *
+ * return: none
+ */
+-static bool dpia_bw_alloc_unplug(struct dc_link *link)
++static void dpia_bw_alloc_unplug(struct dc_link *link)
+ {
+- if (!link)
+- return true;
+-
+- return deallocate_usb4_bw(&link->dpia_bw_alloc_config.sink_allocated_bw,
+- link->dpia_bw_alloc_config.sink_allocated_bw, link);
++ if (link) {
++ DC_LOG_DEBUG("%s: resetting bw alloc config for link(%d)\n",
++ __func__, link->link_index);
++ link->dpia_bw_alloc_config.sink_allocated_bw = 0;
++ reset_bw_alloc_struct(link);
++ }
+ }
++
+ static void set_usb4_req_bw_req(struct dc_link *link, int req_bw)
+ {
+ uint8_t requested_bw;
+ uint32_t temp;
+
+- // 1. Add check for this corner case #1
+- if (req_bw > link->dpia_bw_alloc_config.estimated_bw)
++ /* Error check whether request bw greater than allocated */
++ if (req_bw > link->dpia_bw_alloc_config.estimated_bw) {
++ DC_LOG_ERROR("%s: Request bw greater than estimated bw for link(%d)\n",
++ __func__, link->link_index);
+ req_bw = link->dpia_bw_alloc_config.estimated_bw;
++ }
+
+ temp = req_bw * link->dpia_bw_alloc_config.bw_granularity;
+ requested_bw = temp / Kbps_TO_Gbps;
+
+- // Always make sure to add more to account for floating points
++ /* Always make sure to add more to account for floating points */
+ if (temp % Kbps_TO_Gbps)
+ ++requested_bw;
+
+- // 2. Add check for this corner case #2
++ /* Error check whether requested and allocated are equal */
+ req_bw = requested_bw * (Kbps_TO_Gbps / link->dpia_bw_alloc_config.bw_granularity);
+- if (req_bw == link->dpia_bw_alloc_config.sink_allocated_bw)
+- return;
++ if (req_bw == link->dpia_bw_alloc_config.sink_allocated_bw) {
++ DC_LOG_ERROR("%s: Request bw equals to allocated bw for link(%d)\n",
++ __func__, link->link_index);
++ }
+
+- if (core_link_write_dpcd(
++ link->dpia_bw_alloc_config.response_ready = false; // Reset flag
++ core_link_write_dpcd(
+ link,
+ REQUESTED_BW,
+ &requested_bw,
+- sizeof(uint8_t)) == DC_OK)
+- link->dpia_bw_alloc_config.response_ready = false; // Reset flag
++ sizeof(uint8_t));
+ }
++
+ /*
+ * Return the response_ready flag from dc_link struct
+ *
+@@ -241,6 +244,7 @@ static bool get_cm_response_ready_flag(struct dc_link *link)
+ {
+ return link->dpia_bw_alloc_config.response_ready;
+ }
++
+ // ------------------------------------------------------------------
+ // PUBLIC FUNCTIONS
+ // ------------------------------------------------------------------
+@@ -277,27 +281,27 @@ bool link_dp_dpia_set_dptx_usb4_bw_alloc_support(struct dc_link *link)
+ DPTX_BW_ALLOCATION_MODE_CONTROL,
+ &response,
+ sizeof(uint8_t)) != DC_OK) {
+- DC_LOG_DEBUG("%s: **** FAILURE Enabling DPtx BW Allocation Mode Support ***\n",
+- __func__);
++ DC_LOG_DEBUG("%s: FAILURE Enabling DPtx BW Allocation Mode Support for link(%d)\n",
++ __func__, link->link_index);
+ } else {
+ // SUCCESS Enabled DPtx BW Allocation Mode Support
+- link->dpia_bw_alloc_config.bw_alloc_enabled = true;
+- DC_LOG_DEBUG("%s: **** SUCCESS Enabling DPtx BW Allocation Mode Support ***\n",
+- __func__);
++ DC_LOG_DEBUG("%s: SUCCESS Enabling DPtx BW Allocation Mode Support for link(%d)\n",
++ __func__, link->link_index);
+
+ ret = true;
+ init_usb4_bw_struct(link);
++ link->dpia_bw_alloc_config.bw_alloc_enabled = true;
+ }
+ }
+
+ out:
+ return ret;
+ }
++
+ void dpia_handle_bw_alloc_response(struct dc_link *link, uint8_t bw, uint8_t result)
+ {
+ int bw_needed = 0;
+ int estimated = 0;
+- int host_router_total_estimated_bw = 0;
+
+ if (!get_bw_alloc_proceed_flag((link)))
+ return;
+@@ -306,14 +310,22 @@ void dpia_handle_bw_alloc_response(struct dc_link *link, uint8_t bw, uint8_t res
+
+ case DPIA_BW_REQ_FAILED:
+
+- DC_LOG_DEBUG("%s: *** *** BW REQ FAILURE for DP-TX Request *** ***\n", __func__);
++ /*
++ * Ideally, we shouldn't run into this case as we always validate available
++ * bandwidth and request within that limit
++ */
++ estimated = bw * (Kbps_TO_Gbps / link->dpia_bw_alloc_config.bw_granularity);
+
+- // Update the new Estimated BW value updated by CM
+- link->dpia_bw_alloc_config.estimated_bw =
+- bw * (Kbps_TO_Gbps / link->dpia_bw_alloc_config.bw_granularity);
++ DC_LOG_ERROR("%s: BW REQ FAILURE for DP-TX Request for link(%d)\n",
++ __func__, link->link_index);
++ DC_LOG_ERROR("%s: current estimated_bw(%d), new estimated_bw(%d)\n",
++ __func__, link->dpia_bw_alloc_config.estimated_bw, estimated);
+
++ /* Update the new Estimated BW value updated by CM */
++ link->dpia_bw_alloc_config.estimated_bw = estimated;
++
++ /* Allocate the previously requested bandwidth */
+ set_usb4_req_bw_req(link, link->dpia_bw_alloc_config.estimated_bw);
+- link->dpia_bw_alloc_config.response_ready = false;
+
+ /*
+ * If FAIL then it is either:
+@@ -326,68 +338,34 @@ void dpia_handle_bw_alloc_response(struct dc_link *link, uint8_t bw, uint8_t res
+
+ case DPIA_BW_REQ_SUCCESS:
+
+- DC_LOG_DEBUG("%s: *** BW REQ SUCCESS for DP-TX Request ***\n", __func__);
+-
+- // 1. SUCCESS 1st time before any Pruning is done
+- // 2. SUCCESS after prev. FAIL before any Pruning is done
+- // 3. SUCCESS after Pruning is done but before enabling link
+-
+ bw_needed = bw * (Kbps_TO_Gbps / link->dpia_bw_alloc_config.bw_granularity);
+
+- // 1.
+- if (!link->dpia_bw_alloc_config.sink_allocated_bw) {
+-
+- allocate_usb4_bw(&link->dpia_bw_alloc_config.sink_allocated_bw, bw_needed, link);
+- link->dpia_bw_alloc_config.sink_verified_bw =
+- link->dpia_bw_alloc_config.sink_allocated_bw;
++ DC_LOG_DEBUG("%s: BW REQ SUCCESS for DP-TX Request for link(%d)\n",
++ __func__, link->link_index);
++ DC_LOG_DEBUG("%s: current allocated_bw(%d), new allocated_bw(%d)\n",
++ __func__, link->dpia_bw_alloc_config.sink_allocated_bw, bw_needed);
+
+- // SUCCESS from first attempt
+- if (link->dpia_bw_alloc_config.sink_allocated_bw >
+- link->dpia_bw_alloc_config.sink_max_bw)
+- link->dpia_bw_alloc_config.sink_verified_bw =
+- link->dpia_bw_alloc_config.sink_max_bw;
+- }
+- // 3.
+- else if (link->dpia_bw_alloc_config.sink_allocated_bw) {
+-
+- // Find out how much do we need to de-alloc
+- if (link->dpia_bw_alloc_config.sink_allocated_bw > bw_needed)
+- deallocate_usb4_bw(&link->dpia_bw_alloc_config.sink_allocated_bw,
+- link->dpia_bw_alloc_config.sink_allocated_bw - bw_needed, link);
+- else
+- allocate_usb4_bw(&link->dpia_bw_alloc_config.sink_allocated_bw,
+- bw_needed - link->dpia_bw_alloc_config.sink_allocated_bw, link);
+- }
+-
+- // 4. If this is the 2nd sink then any unused bw will be reallocated to master DPIA
+- // => check if estimated_bw changed
++ link->dpia_bw_alloc_config.sink_allocated_bw = bw_needed;
+
+ link->dpia_bw_alloc_config.response_ready = true;
+ break;
+
+ case DPIA_EST_BW_CHANGED:
+
+- DC_LOG_DEBUG("%s: *** ESTIMATED BW CHANGED for DP-TX Request ***\n", __func__);
+-
+ estimated = bw * (Kbps_TO_Gbps / link->dpia_bw_alloc_config.bw_granularity);
+- host_router_total_estimated_bw = get_host_router_total_bw(link, HOST_ROUTER_BW_ESTIMATED);
+
+- // 1. If due to unplug of other sink
+- if (estimated == host_router_total_estimated_bw) {
+- // First update the estimated & max_bw fields
+- if (link->dpia_bw_alloc_config.estimated_bw < estimated)
+- link->dpia_bw_alloc_config.estimated_bw = estimated;
+- }
+- // 2. If due to realloc bw btw 2 dpia due to plug OR realloc unused Bw
+- else {
+- // We lost estimated bw usually due to plug event of other dpia
+- link->dpia_bw_alloc_config.estimated_bw = estimated;
+- }
++ DC_LOG_DEBUG("%s: ESTIMATED BW CHANGED for link(%d)\n",
++ __func__, link->link_index);
++ DC_LOG_DEBUG("%s: current estimated_bw(%d), new estimated_bw(%d)\n",
++ __func__, link->dpia_bw_alloc_config.estimated_bw, estimated);
++
++ link->dpia_bw_alloc_config.estimated_bw = estimated;
+ break;
+
+ case DPIA_BW_ALLOC_CAPS_CHANGED:
+
+- DC_LOG_DEBUG("%s: *** BW ALLOC CAPABILITY CHANGED for DP-TX Request ***\n", __func__);
++ DC_LOG_ERROR("%s: BW ALLOC CAPABILITY CHANGED to Disabled for link(%d)\n",
++ __func__, link->link_index);
+ link->dpia_bw_alloc_config.bw_alloc_enabled = false;
+ break;
+ }
+@@ -409,11 +387,11 @@ int dpia_handle_usb4_bandwidth_allocation_for_link(struct dc_link *link, int pea
+ set_usb4_req_bw_req(link, link->dpia_bw_alloc_config.sink_max_bw);
+
+ do {
+- if (!(timeout > 0))
++ if (timeout > 0)
+ timeout--;
+ else
+ break;
+- fsleep(10 * 1000);
++ msleep(10);
+ } while (!get_cm_response_ready_flag(link));
+
+ if (!timeout)
+@@ -428,37 +406,36 @@ int dpia_handle_usb4_bandwidth_allocation_for_link(struct dc_link *link, int pea
+ out:
+ return ret;
+ }
+-int link_dp_dpia_allocate_usb4_bandwidth_for_stream(struct dc_link *link, int req_bw)
++
++bool link_dp_dpia_allocate_usb4_bandwidth_for_stream(struct dc_link *link, int req_bw)
+ {
+- int ret = 0;
++ bool ret = false;
+ uint8_t timeout = 10;
+
++ DC_LOG_DEBUG("%s: ENTER: link(%d), hpd_status(%d), current allocated_bw(%d), req_bw(%d)\n",
++ __func__, link->link_index, link->hpd_status,
++ link->dpia_bw_alloc_config.sink_allocated_bw, req_bw);
++
+ if (!get_bw_alloc_proceed_flag(link))
+ goto out;
+
+- /*
+- * Sometimes stream uses same timing parameters as the already
+- * allocated max sink bw so no need to re-alloc
+- */
+- if (req_bw != link->dpia_bw_alloc_config.sink_allocated_bw) {
+- set_usb4_req_bw_req(link, req_bw);
+- do {
+- if (!(timeout > 0))
+- timeout--;
+- else
+- break;
+- udelay(10 * 1000);
+- } while (!get_cm_response_ready_flag(link));
++ set_usb4_req_bw_req(link, req_bw);
++ do {
++ if (timeout > 0)
++ timeout--;
++ else
++ break;
++ msleep(10);
++ } while (!get_cm_response_ready_flag(link));
+
+- if (!timeout)
+- ret = 0;// ERROR TIMEOUT waiting for response for allocating bw
+- else if (link->dpia_bw_alloc_config.sink_allocated_bw > 0)
+- ret = get_host_router_total_bw(link, HOST_ROUTER_BW_ALLOCATED);
+- }
++ if (timeout)
++ ret = true;
+
+ out:
++ DC_LOG_DEBUG("%s: EXIT: timeout(%d), ret(%d)\n", __func__, timeout, ret);
+ return ret;
+ }
++
+ bool dpia_validate_usb4_bw(struct dc_link **link, int *bw_needed_per_dpia, const unsigned int num_dpias)
+ {
+ bool ret = true;
+diff --git a/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.h b/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.h
+index 7292690383ae..981bc4eb6120 100644
+--- a/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.h
++++ b/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_dpia_bw.h
+@@ -59,9 +59,9 @@ bool link_dp_dpia_set_dptx_usb4_bw_alloc_support(struct dc_link *link);
+ * @link: pointer to the dc_link struct instance
+ * @req_bw: Bw requested by the stream
+ *
+- * return: allocated bw else return 0
++ * return: true if allocated successfully
+ */
+-int link_dp_dpia_allocate_usb4_bandwidth_for_stream(struct dc_link *link, int req_bw);
++bool link_dp_dpia_allocate_usb4_bandwidth_for_stream(struct dc_link *link, int req_bw);
+
+ /*
+ * Handle the USB4 BW Allocation related functionality here:
+--
+2.43.0
+
--- /dev/null
+From 634d047a9a31973a0b785e56d31702dabba2d19f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 06:25:06 -0700
+Subject: drm/amd/display: Fix MST PBN/X.Y value calculations
+
+From: Ilya Bakoulin <ilya.bakoulin@amd.com>
+
+[ Upstream commit 94bbf802efd0a8f13147d6664af6e653637340a8 ]
+
+Changing PBN calculation to be more in line with spec. We don't need to
+inflate PBN_NATIVE value by the 1.006 margin, since that is already
+taken care of in the get_pbn_per_slot function.
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: Wenjing Liu <wenjing.liu@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Ilya Bakoulin <ilya.bakoulin@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/link/link_dpms.c | 13 ++++++++-----
+ 1 file changed, 8 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/link/link_dpms.c b/drivers/gpu/drm/amd/display/dc/link/link_dpms.c
+index 04d1ecd6e593..d28564b1b28a 100644
+--- a/drivers/gpu/drm/amd/display/dc/link/link_dpms.c
++++ b/drivers/gpu/drm/amd/display/dc/link/link_dpms.c
+@@ -1061,18 +1061,21 @@ static struct fixed31_32 get_pbn_from_bw_in_kbps(uint64_t kbps)
+ uint32_t denominator = 1;
+
+ /*
+- * margin 5300ppm + 300ppm ~ 0.6% as per spec, factor is 1.006
++ * The 1.006 factor (margin 5300ppm + 300ppm ~ 0.6% as per spec) is not
++ * required when determining PBN/time slot utilization on the link between
++ * us and the branch, since that overhead is already accounted for in
++ * the get_pbn_per_slot function.
++ *
+ * The unit of 54/64Mbytes/sec is an arbitrary unit chosen based on
+ * common multiplier to render an integer PBN for all link rate/lane
+ * counts combinations
+ * calculate
+- * peak_kbps *= (1006/1000)
+ * peak_kbps *= (64/54)
+- * peak_kbps *= 8 convert to bytes
++ * peak_kbps /= (8 * 1000) convert to bytes
+ */
+
+- numerator = 64 * PEAK_FACTOR_X1000;
+- denominator = 54 * 8 * 1000 * 1000;
++ numerator = 64;
++ denominator = 54 * 8 * 1000;
+ kbps *= numerator;
+ peak_kbps = dc_fixpt_from_fraction(kbps, denominator);
+
+--
+2.43.0
+
--- /dev/null
+From 4af7b61b57cb7276678677abd0dafec7709f4c0c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 06:25:19 -0700
+Subject: drm/amd/display: Fix Replay Desync Error IRQ handler
+
+From: Dennis Chan <dennis.chan@amd.com>
+
+[ Upstream commit dd5c6362ddcd8bdb07704faff8648593885ecfa1 ]
+
+In previous case, Replay didn't identify the IRQ type, This commit fixes
+the issues for the interrupt.
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: Robin Chen <robin.chen@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Dennis Chan <dennis.chan@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../display/dc/link/protocols/link_dp_irq_handler.c | 12 ++++++------
+ 1 file changed, 6 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_irq_handler.c b/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_irq_handler.c
+index 0c00e94e90b1..9eadc2c7f221 100644
+--- a/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_irq_handler.c
++++ b/drivers/gpu/drm/amd/display/dc/link/protocols/link_dp_irq_handler.c
+@@ -190,9 +190,6 @@ static void handle_hpd_irq_replay_sink(struct dc_link *link)
+ /*AMD Replay version reuse DP_PSR_ERROR_STATUS for REPLAY_ERROR status.*/
+ union psr_error_status replay_error_status;
+
+- if (link->replay_settings.config.force_disable_desync_error_check)
+- return;
+-
+ if (!link->replay_settings.replay_feature_enabled)
+ return;
+
+@@ -210,9 +207,6 @@ static void handle_hpd_irq_replay_sink(struct dc_link *link)
+ &replay_error_status.raw,
+ sizeof(replay_error_status.raw));
+
+- if (replay_configuration.bits.DESYNC_ERROR_STATUS)
+- link->replay_settings.config.received_desync_error_hpd = 1;
+-
+ link->replay_settings.config.replay_error_status.bits.LINK_CRC_ERROR =
+ replay_error_status.bits.LINK_CRC_ERROR;
+ link->replay_settings.config.replay_error_status.bits.DESYNC_ERROR =
+@@ -225,6 +219,12 @@ static void handle_hpd_irq_replay_sink(struct dc_link *link)
+ link->replay_settings.config.replay_error_status.bits.STATE_TRANSITION_ERROR) {
+ bool allow_active;
+
++ if (link->replay_settings.config.replay_error_status.bits.DESYNC_ERROR)
++ link->replay_settings.config.received_desync_error_hpd = 1;
++
++ if (link->replay_settings.config.force_disable_desync_error_check)
++ return;
++
+ /* Acknowledge and clear configuration bits */
+ dm_helpers_dp_write_dpcd(
+ link->ctx,
+--
+2.43.0
+
--- /dev/null
+From ba9b96c53ce5b104d5977b2e36a15c74ff9efc3d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 9 Nov 2023 00:04:36 -0500
+Subject: drm/amd/display: Fix tiled display misalignment
+
+From: Meenakshikumar Somasundaram <meenakshikumar.somasundaram@amd.com>
+
+[ Upstream commit c4b8394e76adba4f50a3c2696c75b214a291e24a ]
+
+[Why]
+When otg workaround is applied during clock update, otgs of
+tiled display went out of sync.
+
+[How]
+To call dc_trigger_sync() after clock update to sync otgs again.
+
+Reviewed-by: Nicholas Kazlauskas <nicholas.kazlauskas@amd.com>
+Acked-by: Hamza Mahfooz <hamza.mahfooz@amd.com>
+Signed-off-by: Meenakshikumar Somasundaram <meenakshikumar.somasundaram@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/core/dc.c | 4 ++++
+ 1 file changed, 4 insertions(+)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/core/dc.c b/drivers/gpu/drm/amd/display/dc/core/dc.c
+index bc098098345c..bbdeda489768 100644
+--- a/drivers/gpu/drm/amd/display/dc/core/dc.c
++++ b/drivers/gpu/drm/amd/display/dc/core/dc.c
+@@ -1964,6 +1964,10 @@ static enum dc_status dc_commit_state_no_check(struct dc *dc, struct dc_state *c
+ wait_for_no_pipes_pending(dc, context);
+ /* pplib is notified if disp_num changed */
+ dc->hwss.optimize_bandwidth(dc, context);
++ /* Need to do otg sync again as otg could be out of sync due to otg
++ * workaround applied during clock update
++ */
++ dc_trigger_sync(dc, context);
+ }
+
+ if (dc->hwss.update_dsc_pg)
+--
+2.43.0
+
--- /dev/null
+From 65bdc2e521527d0c6b2c4440607bece253585043 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 17:26:10 -0500
+Subject: drm/amd/display: fix usb-c connector_type
+
+From: Allen Pan <allen.pan@amd.com>
+
+[ Upstream commit 0d26644bc57d8737c8e2fb3145366f7d0b941935 ]
+
+[why]
+BIOS switches to use USB-C connector type 0x18, but VBIOS's
+objectInfo table not supported yet. driver needs to patch it
+based on enc_cap from system integration info table.
+
+Reviewed-by: Charlene Liu <charlene.liu@amd.com>
+Acked-by: Wayne Lin <wayne.lin@amd.com>
+Signed-off-by: Allen Pan <allen.pan@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../gpu/drm/amd/display/dc/dcn35/dcn35_dio_link_encoder.c | 5 +++++
+ 1 file changed, 5 insertions(+)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dcn35/dcn35_dio_link_encoder.c b/drivers/gpu/drm/amd/display/dc/dcn35/dcn35_dio_link_encoder.c
+index f91e08895275..da94e5309fba 100644
+--- a/drivers/gpu/drm/amd/display/dc/dcn35/dcn35_dio_link_encoder.c
++++ b/drivers/gpu/drm/amd/display/dc/dcn35/dcn35_dio_link_encoder.c
+@@ -256,6 +256,10 @@ void dcn35_link_encoder_construct(
+ enc10->base.features.flags.bits.IS_UHBR10_CAPABLE = bp_cap_info.DP_UHBR10_EN;
+ enc10->base.features.flags.bits.IS_UHBR13_5_CAPABLE = bp_cap_info.DP_UHBR13_5_EN;
+ enc10->base.features.flags.bits.IS_UHBR20_CAPABLE = bp_cap_info.DP_UHBR20_EN;
++ if (bp_cap_info.DP_IS_USB_C) {
++ /*BIOS not switch to use CONNECTOR_ID_USBC = 24 yet*/
++ enc10->base.features.flags.bits.DP_IS_USB_C = 1;
++ }
+
+ } else {
+ DC_LOG_WARNING("%s: Failed to get encoder_cap_info from VBIOS with error code %d!\n",
+@@ -264,4 +268,5 @@ void dcn35_link_encoder_construct(
+ }
+ if (enc10->base.ctx->dc->debug.hdmi20_disable)
+ enc10->base.features.flags.bits.HDMI_6GB_EN = 0;
++
+ }
+--
+2.43.0
+
--- /dev/null
+From b38e0d92857109b81cfeaf2b03a7a34eff172c75 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 18:15:16 -0500
+Subject: drm/amd/display: Fixing stream allocation regression
+
+From: Relja Vojvodic <relja.vojvodic@amd.com>
+
+[ Upstream commit 292c2116b2ae84c7e799ae340981e60551b18f5e ]
+
+For certain dual display configs that had one display using a 1080p
+mode, the DPM level used to drive the configs regressed from DPM 0 to
+DPM 3. This was caused by a missing check that should have only limited
+the pipe segments on non-phantom pipes. This caused issues with detile
+buffer allocation, which dissallow subvp from being used
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: Dillon Varone <dillon.varone@amd.com>
+Reviewed-by: Martin Leung <martin.leung@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Relja Vojvodic <relja.vojvodic@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/dcn32/dcn32_resource_helpers.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dcn32/dcn32_resource_helpers.c b/drivers/gpu/drm/amd/display/dc/dcn32/dcn32_resource_helpers.c
+index bc5f0db23d0c..a9c45174abed 100644
+--- a/drivers/gpu/drm/amd/display/dc/dcn32/dcn32_resource_helpers.c
++++ b/drivers/gpu/drm/amd/display/dc/dcn32/dcn32_resource_helpers.c
+@@ -290,7 +290,7 @@ static void override_det_for_subvp(struct dc *dc, struct dc_state *context, uint
+ for (i = 0; i < dc->res_pool->pipe_count; i++) {
+ struct pipe_ctx *pipe_ctx = &context->res_ctx.pipe_ctx[i];
+
+- if (pipe_ctx->stream && pipe_ctx->plane_state && pipe_ctx->stream->mall_stream_config.type != SUBVP_PHANTOM) {
++ if (pipe_ctx->stream && pipe_ctx->plane_state && pipe_ctx->stream->mall_stream_config.type != SUBVP_PHANTOM != SUBVP_PHANTOM) {
+ if (pipe_ctx->stream->timing.v_addressable == 1080 && pipe_ctx->stream->timing.h_addressable == 1920) {
+ if (pipe_segments[i] > 4)
+ pipe_segments[i] = 4;
+--
+2.43.0
+
--- /dev/null
+From bb77d57ab378f69b30a1b54dc1f9914346e61031 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 14:52:31 -0500
+Subject: drm/amd/display: For prefetch mode > 0, extend prefetch if possible
+
+From: Alvin Lee <alvin.lee2@amd.com>
+
+[ Upstream commit dd4e4bb28843393065eed279e869fac248d03f0f ]
+
+[Description]
+For mode programming we want to extend the prefetch as much as possible
+(up to oto, or as long as we can for equ) if we're not already applying
+the 60us prefetch requirement. This is to avoid intermittent underflow
+issues during prefetch.
+
+The prefetch extension is applied under the following scenarios:
+1. We're in prefetch mode 1 (i.e. we don't support MCLK switch in blank)
+2. We're using subvp or drr methods of p-state switch, in which case we
+ we don't care if prefetch takes up more of the blanking time
+
+Mode programming typically chooses the smallest prefetch time possible
+(i.e. highest bandwidth during prefetch) presumably to create margin between
+p-states / c-states that happen in vblank and prefetch. Therefore we only
+apply this prefetch extension when p-state in vblank is not required (UCLK
+p-states take up the most vblank time).
+
+Reviewed-by: Jun Lei <jun.lei@amd.com>
+Acked-by: Aurabindo Pillai <aurabindo.pillai@amd.com>
+Signed-off-by: Alvin Lee <alvin.lee2@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../dc/dml/dcn32/display_mode_vba_32.c | 3 ++
+ .../dc/dml/dcn32/display_mode_vba_util_32.c | 33 +++++++++++++++----
+ .../dc/dml/dcn32/display_mode_vba_util_32.h | 1 +
+ 3 files changed, 31 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_32.c b/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_32.c
+index cbdfb762c10c..6c84b0fa40f4 100644
+--- a/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_32.c
++++ b/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_32.c
+@@ -813,6 +813,8 @@ static void DISPCLKDPPCLKDCFCLKDeepSleepPrefetchParametersWatermarksAndPerforman
+ (v->DRAMSpeedPerState[mode_lib->vba.VoltageLevel] <= MEM_STROBE_FREQ_MHZ ||
+ v->DCFCLKPerState[mode_lib->vba.VoltageLevel] <= DCFCLK_FREQ_EXTRA_PREFETCH_REQ_MHZ) ?
+ mode_lib->vba.ip.min_prefetch_in_strobe_us : 0,
++ mode_lib->vba.PrefetchModePerState[mode_lib->vba.VoltageLevel][mode_lib->vba.maxMpcComb] > 0 || mode_lib->vba.DRAMClockChangeRequirementFinal == false,
++
+ /* Output */
+ &v->DSTXAfterScaler[k],
+ &v->DSTYAfterScaler[k],
+@@ -3317,6 +3319,7 @@ void dml32_ModeSupportAndSystemConfigurationFull(struct display_mode_lib *mode_l
+ v->SwathHeightCThisState[k], v->TWait,
+ (v->DRAMSpeedPerState[i] <= MEM_STROBE_FREQ_MHZ || v->DCFCLKState[i][j] <= DCFCLK_FREQ_EXTRA_PREFETCH_REQ_MHZ) ?
+ mode_lib->vba.ip.min_prefetch_in_strobe_us : 0,
++ mode_lib->vba.PrefetchModePerState[i][j] > 0 || mode_lib->vba.DRAMClockChangeRequirementFinal == false,
+
+ /* Output */
+ &v->dummy_vars.dml32_ModeSupportAndSystemConfigurationFull.DSTXAfterScaler[k],
+diff --git a/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.c b/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.c
+index d940dfa5ae43..80fccd4999a5 100644
+--- a/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.c
++++ b/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.c
+@@ -3423,6 +3423,7 @@ bool dml32_CalculatePrefetchSchedule(
+ unsigned int SwathHeightC,
+ double TWait,
+ double TPreReq,
++ bool ExtendPrefetchIfPossible,
+ /* Output */
+ double *DSTXAfterScaler,
+ double *DSTYAfterScaler,
+@@ -3892,12 +3893,32 @@ bool dml32_CalculatePrefetchSchedule(
+ /* Clamp to oto for bandwidth calculation */
+ LinesForPrefetchBandwidth = dst_y_prefetch_oto;
+ } else {
+- *DestinationLinesForPrefetch = dst_y_prefetch_equ;
+- TimeForFetchingMetaPTE = Tvm_equ;
+- TimeForFetchingRowInVBlank = Tr0_equ;
+- *PrefetchBandwidth = prefetch_bw_equ;
+- /* Clamp to equ for bandwidth calculation */
+- LinesForPrefetchBandwidth = dst_y_prefetch_equ;
++ /* For mode programming we want to extend the prefetch as much as possible
++ * (up to oto, or as long as we can for equ) if we're not already applying
++ * the 60us prefetch requirement. This is to avoid intermittent underflow
++ * issues during prefetch.
++ *
++ * The prefetch extension is applied under the following scenarios:
++ * 1. We're in prefetch mode > 0 (i.e. we don't support MCLK switch in blank)
++ * 2. We're using subvp or drr methods of p-state switch, in which case we
++ * we don't care if prefetch takes up more of the blanking time
++ *
++ * Mode programming typically chooses the smallest prefetch time possible
++ * (i.e. highest bandwidth during prefetch) presumably to create margin between
++ * p-states / c-states that happen in vblank and prefetch. Therefore we only
++ * apply this prefetch extension when p-state in vblank is not required (UCLK
++ * p-states take up the most vblank time).
++ */
++ if (ExtendPrefetchIfPossible && TPreReq == 0 && VStartup < MaxVStartup) {
++ MyError = true;
++ } else {
++ *DestinationLinesForPrefetch = dst_y_prefetch_equ;
++ TimeForFetchingMetaPTE = Tvm_equ;
++ TimeForFetchingRowInVBlank = Tr0_equ;
++ *PrefetchBandwidth = prefetch_bw_equ;
++ /* Clamp to equ for bandwidth calculation */
++ LinesForPrefetchBandwidth = dst_y_prefetch_equ;
++ }
+ }
+
+ *DestinationLinesToRequestVMInVBlank = dml_ceil(4.0 * TimeForFetchingMetaPTE / LineTime, 1.0) / 4.0;
+diff --git a/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.h b/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.h
+index 592d174df6c6..5d34735df83d 100644
+--- a/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.h
++++ b/drivers/gpu/drm/amd/display/dc/dml/dcn32/display_mode_vba_util_32.h
+@@ -747,6 +747,7 @@ bool dml32_CalculatePrefetchSchedule(
+ unsigned int SwathHeightC,
+ double TWait,
+ double TPreReq,
++ bool ExtendPrefetchIfPossible,
+ /* Output */
+ double *DSTXAfterScaler,
+ double *DSTYAfterScaler,
+--
+2.43.0
+
--- /dev/null
+From a1c51ac0383f2f3a03c33b1793d84ca23e4d75d3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 14:52:32 -0500
+Subject: drm/amd/display: Force p-state disallow if leaving no plane config
+
+From: Alvin Lee <alvin.lee2@amd.com>
+
+[ Upstream commit 9a902a9073c287353e25913c0761bfed49d75a88 ]
+
+[Description]
+- When we're in a no plane config, DCN is always asserting
+ P-State allow
+- This creates a scenario where the P-State blackout can start
+ just as VUPDATE takes place and transitions the DCN config to
+ a one where one or more HUBP's are active which can result in
+ underflow
+- To fix this issue, force p-state disallow and unforce after
+ the transition from no planes case -> one or more planes active
+
+Reviewed-by: Samson Tam <samson.tam@amd.com>
+Acked-by: Aurabindo Pillai <aurabindo.pillai@amd.com>
+Signed-off-by: Alvin Lee <alvin.lee2@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../amd/display/dc/hwss/dcn20/dcn20_hwseq.c | 20 +++++++++++++++++++
+ 1 file changed, 20 insertions(+)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c
+index 608221b0dd5d..c3c83178eb1e 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c
+@@ -1877,6 +1877,8 @@ void dcn20_program_front_end_for_ctx(
+ int i;
+ struct dce_hwseq *hws = dc->hwseq;
+ DC_LOGGER_INIT(dc->ctx->logger);
++ unsigned int prev_hubp_count = 0;
++ unsigned int hubp_count = 0;
+
+ if (resource_is_pipe_topology_changed(dc->current_state, context))
+ resource_log_pipe_topology_update(dc, context);
+@@ -1894,6 +1896,20 @@ void dcn20_program_front_end_for_ctx(
+ }
+ }
+
++ for (i = 0; i < dc->res_pool->pipe_count; i++) {
++ if (dc->current_state->res_ctx.pipe_ctx[i].plane_state)
++ prev_hubp_count++;
++ if (context->res_ctx.pipe_ctx[i].plane_state)
++ hubp_count++;
++ }
++
++ if (prev_hubp_count == 0 && hubp_count > 0) {
++ if (dc->res_pool->hubbub->funcs->force_pstate_change_control)
++ dc->res_pool->hubbub->funcs->force_pstate_change_control(
++ dc->res_pool->hubbub, true, false);
++ udelay(500);
++ }
++
+ /* Set pipe update flags and lock pipes */
+ for (i = 0; i < dc->res_pool->pipe_count; i++)
+ dcn20_detect_pipe_changes(&dc->current_state->res_ctx.pipe_ctx[i],
+@@ -2039,6 +2055,10 @@ void dcn20_post_unlock_program_front_end(
+ }
+ }
+
++ if (dc->res_pool->hubbub->funcs->force_pstate_change_control)
++ dc->res_pool->hubbub->funcs->force_pstate_change_control(
++ dc->res_pool->hubbub, false, false);
++
+ for (i = 0; i < dc->res_pool->pipe_count; i++) {
+ struct pipe_ctx *pipe = &context->res_ctx.pipe_ctx[i];
+
+--
+2.43.0
+
--- /dev/null
+From 4c34201fcd7023afc05dff0c5c3883271b13ec96 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 06:24:58 -0700
+Subject: drm/amd/display: initialize all the dpm level's stutter latency
+
+From: Charlene Liu <charlene.liu@amd.com>
+
+[ Upstream commit 885c71ad791c1709f668a37f701d33e6872a902f ]
+
+Fix issue when override level bigger than default. Levels 5, 6, and 7
+had zero stutter latency, this is because override level being
+initialized after stutter latency inits.
+
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Reviewed-by: Syed Hassan <syed.hassan@amd.com>
+Reviewed-by: Allen Pan <allen.pan@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Charlene Liu <charlene.liu@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/dml2/dml2_translation_helper.c | 4 +++-
+ 1 file changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dml2/dml2_translation_helper.c b/drivers/gpu/drm/amd/display/dc/dml2/dml2_translation_helper.c
+index bcc03b184e5e..9f84d17f4658 100644
+--- a/drivers/gpu/drm/amd/display/dc/dml2/dml2_translation_helper.c
++++ b/drivers/gpu/drm/amd/display/dc/dml2/dml2_translation_helper.c
+@@ -341,6 +341,9 @@ void dml2_init_soc_states(struct dml2_context *dml2, const struct dc *in_dc,
+ break;
+ }
+
++ if (dml2->config.bbox_overrides.clks_table.num_states)
++ p->in_states->num_states = dml2->config.bbox_overrides.clks_table.num_states;
++
+ /* Override from passed values, if available */
+ for (i = 0; i < p->in_states->num_states; i++) {
+ if (dml2->config.bbox_overrides.sr_exit_latency_us) {
+@@ -397,7 +400,6 @@ void dml2_init_soc_states(struct dml2_context *dml2, const struct dc *in_dc,
+ }
+ /* Copy clocks tables entries, if available */
+ if (dml2->config.bbox_overrides.clks_table.num_states) {
+- p->in_states->num_states = dml2->config.bbox_overrides.clks_table.num_states;
+
+ for (i = 0; i < dml2->config.bbox_overrides.clks_table.num_entries_per_clk.num_dcfclk_levels; i++) {
+ p->in_states->state_array[i].dcfclk_mhz = dml2->config.bbox_overrides.clks_table.clk_entries[i].dcfclk_mhz;
+--
+2.43.0
+
--- /dev/null
+From 6ba9e26c60b6d2308ea9f2805d3b46f9a05d7c02 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 12:01:05 -0500
+Subject: drm/amd/display: make flip_timestamp_in_us a 64-bit variable
+
+From: Josip Pavic <josip.pavic@amd.com>
+
+[ Upstream commit 6fb12518ca58412dc51054e2a7400afb41328d85 ]
+
+[Why]
+This variable currently overflows after about 71 minutes. This doesn't
+cause any known functional issues but it does make debugging more
+difficult.
+
+[How]
+Make it a 64-bit variable.
+
+Reviewed-by: Aric Cyr <aric.cyr@amd.com>
+Acked-by: Wayne Lin <wayne.lin@amd.com>
+Signed-off-by: Josip Pavic <josip.pavic@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/dc_hw_types.h | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dc_hw_types.h b/drivers/gpu/drm/amd/display/dc/dc_hw_types.h
+index e2a3aa8812df..811474f4419b 100644
+--- a/drivers/gpu/drm/amd/display/dc/dc_hw_types.h
++++ b/drivers/gpu/drm/amd/display/dc/dc_hw_types.h
+@@ -244,7 +244,7 @@ enum pixel_format {
+ #define DC_MAX_DIRTY_RECTS 3
+ struct dc_flip_addrs {
+ struct dc_plane_address address;
+- unsigned int flip_timestamp_in_us;
++ unsigned long long flip_timestamp_in_us;
+ bool flip_immediate;
+ /* TODO: add flip duration for FreeSync */
+ bool triplebuffer_flips;
+--
+2.43.0
+
--- /dev/null
+From acde85fb4ab6985528e9c199a63c991699b25902 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 11:56:56 -0500
+Subject: drm/amd/display: Only clear symclk otg flag for HDMI
+
+From: Alvin Lee <alvin.lee2@amd.com>
+
+[ Upstream commit dff45f03f508c92cd8eb2050e27b726726b8ae0b ]
+
+[Description]
+There is a corner case where the symclk otg flag is cleared
+when disabling the phantom pipe for subvp (because the phantom
+and main pipe share the same link). This is undesired because
+we need the maintain the correct symclk otg flag state for
+the main pipe.
+
+For now only clear the flag only for HDMI signal type, since
+it's only set for HDMI signal type (phantom is virtual). The
+ideal solution is to not clear it if the stream is phantom but
+currently there's a bug that doesn't allow us to do this. Once
+this issue is fixed the proper fix can be implemented.
+
+Reviewed-by: Samson Tam <samson.tam@amd.com>
+Acked-by: Wayne Lin <wayne.lin@amd.com>
+Signed-off-by: Alvin Lee <alvin.lee2@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c | 3 ++-
+ drivers/gpu/drm/amd/display/dc/hwss/dcn10/dcn10_hwseq.c | 3 ++-
+ drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c | 3 ++-
+ drivers/gpu/drm/amd/display/dc/hwss/dcn31/dcn31_hwseq.c | 3 ++-
+ 4 files changed, 8 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c
+index 9b8299d97e40..578e51a19fdd 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c
+@@ -2124,7 +2124,8 @@ static void dce110_reset_hw_ctx_wrap(
+ BREAK_TO_DEBUGGER();
+ }
+ pipe_ctx_old->stream_res.tg->funcs->disable_crtc(pipe_ctx_old->stream_res.tg);
+- pipe_ctx_old->stream->link->phy_state.symclk_ref_cnts.otg = 0;
++ if (dc_is_hdmi_tmds_signal(pipe_ctx_old->stream->signal))
++ pipe_ctx_old->stream->link->phy_state.symclk_ref_cnts.otg = 0;
+ pipe_ctx_old->plane_res.mi->funcs->free_mem_input(
+ pipe_ctx_old->plane_res.mi, dc->current_state->stream_count);
+
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dcn10/dcn10_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dcn10/dcn10_hwseq.c
+index cdb903116eb7..1fc8436c8130 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dcn10/dcn10_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dcn10/dcn10_hwseq.c
+@@ -1057,7 +1057,8 @@ static void dcn10_reset_back_end_for_pipe(
+ if (pipe_ctx->stream_res.tg->funcs->set_drr)
+ pipe_ctx->stream_res.tg->funcs->set_drr(
+ pipe_ctx->stream_res.tg, NULL);
+- pipe_ctx->stream->link->phy_state.symclk_ref_cnts.otg = 0;
++ if (dc_is_hdmi_tmds_signal(pipe_ctx->stream->signal))
++ pipe_ctx->stream->link->phy_state.symclk_ref_cnts.otg = 0;
+ }
+
+ for (i = 0; i < dc->res_pool->pipe_count; i++)
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c
+index c3c83178eb1e..da0181fef411 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dcn20/dcn20_hwseq.c
+@@ -2610,7 +2610,8 @@ static void dcn20_reset_back_end_for_pipe(
+ * the case where the same symclk is shared across multiple otg
+ * instances
+ */
+- link->phy_state.symclk_ref_cnts.otg = 0;
++ if (dc_is_hdmi_tmds_signal(pipe_ctx->stream->signal))
++ link->phy_state.symclk_ref_cnts.otg = 0;
+ if (link->phy_state.symclk_state == SYMCLK_ON_TX_OFF) {
+ link_hwss->disable_link_output(link,
+ &pipe_ctx->link_res, pipe_ctx->stream->signal);
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dcn31/dcn31_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dcn31/dcn31_hwseq.c
+index 52656691ae48..3a70a3cbc274 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dcn31/dcn31_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dcn31/dcn31_hwseq.c
+@@ -523,7 +523,8 @@ static void dcn31_reset_back_end_for_pipe(
+ if (pipe_ctx->stream_res.tg->funcs->set_odm_bypass)
+ pipe_ctx->stream_res.tg->funcs->set_odm_bypass(
+ pipe_ctx->stream_res.tg, &pipe_ctx->stream->timing);
+- pipe_ctx->stream->link->phy_state.symclk_ref_cnts.otg = 0;
++ if (dc_is_hdmi_tmds_signal(pipe_ctx->stream->signal))
++ pipe_ctx->stream->link->phy_state.symclk_ref_cnts.otg = 0;
+
+ if (pipe_ctx->stream_res.tg->funcs->set_drr)
+ pipe_ctx->stream_res.tg->funcs->set_drr(
+--
+2.43.0
+
--- /dev/null
+From 8aab9cd58129c01a85f1b387991d9f8b6369f4fa Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 16:36:44 +0800
+Subject: drm/amd/display: To adjust dprefclk by down spread percentage
+
+From: Martin Tsai <martin.tsai@amd.com>
+
+[ Upstream commit 17e74e11ac2b46e7514705ae7abfb93ac0e20bd6 ]
+
+[Why]
+Panels show corruption with high refresh rate timings when ssc is
+enabled.
+
+[How]
+Read down-spread percentage from lut to adjust dprefclk. Issues come
+from S0i3 with this commit has been fixed by SMU.
+
+Reviewed-by: Nicholas Kazlauskas <nicholas.kazlauskas@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Martin Tsai <martin.tsai@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../dc/clk_mgr/dcn314/dcn314_clk_mgr.c | 71 ++++++++++++++++++-
+ .../dc/clk_mgr/dcn314/dcn314_clk_mgr.h | 11 +++
+ .../gpu/drm/amd/display/dc/dce/dce_audio.c | 2 +-
+ .../drm/amd/display/dc/dce/dce_clock_source.c | 9 ++-
+ .../amd/display/dc/hwss/dce110/dce110_hwseq.c | 2 +-
+ .../gpu/drm/amd/display/dc/inc/hw/clk_mgr.h | 1 +
+ .../gpu/drm/amd/display/include/audio_types.h | 2 +-
+ 7 files changed, 93 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.c b/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.c
+index 59c2a3545db3..a84f1e376dee 100644
+--- a/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.c
++++ b/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.c
+@@ -87,6 +87,20 @@ static const struct IP_BASE CLK_BASE = { { { { 0x00016C00, 0x02401800, 0, 0, 0,
+ #define CLK1_CLK_PLL_REQ__PllSpineDiv_MASK 0x0000F000L
+ #define CLK1_CLK_PLL_REQ__FbMult_frac_MASK 0xFFFF0000L
+
++#define regCLK1_CLK2_BYPASS_CNTL 0x029c
++#define regCLK1_CLK2_BYPASS_CNTL_BASE_IDX 0
++
++#define CLK1_CLK2_BYPASS_CNTL__CLK2_BYPASS_SEL__SHIFT 0x0
++#define CLK1_CLK2_BYPASS_CNTL__CLK2_BYPASS_DIV__SHIFT 0x10
++#define CLK1_CLK2_BYPASS_CNTL__CLK2_BYPASS_SEL_MASK 0x00000007L
++#define CLK1_CLK2_BYPASS_CNTL__CLK2_BYPASS_DIV_MASK 0x000F0000L
++
++#define regCLK6_0_CLK6_spll_field_8 0x464b
++#define regCLK6_0_CLK6_spll_field_8_BASE_IDX 0
++
++#define CLK6_0_CLK6_spll_field_8__spll_ssc_en__SHIFT 0xd
++#define CLK6_0_CLK6_spll_field_8__spll_ssc_en_MASK 0x00002000L
++
+ #define REG(reg_name) \
+ (CLK_BASE.instance[0].segment[reg ## reg_name ## _BASE_IDX] + reg ## reg_name)
+
+@@ -157,6 +171,37 @@ static void dcn314_disable_otg_wa(struct clk_mgr *clk_mgr_base, struct dc_state
+ }
+ }
+
++bool dcn314_is_spll_ssc_enabled(struct clk_mgr *clk_mgr_base)
++{
++ struct clk_mgr_internal *clk_mgr = TO_CLK_MGR_INTERNAL(clk_mgr_base);
++ uint32_t ssc_enable;
++
++ REG_GET(CLK6_0_CLK6_spll_field_8, spll_ssc_en, &ssc_enable);
++
++ return ssc_enable == 1;
++}
++
++void dcn314_init_clocks(struct clk_mgr *clk_mgr)
++{
++ struct clk_mgr_internal *clk_mgr_int = TO_CLK_MGR_INTERNAL(clk_mgr);
++ uint32_t ref_dtbclk = clk_mgr->clks.ref_dtbclk_khz;
++
++ memset(&(clk_mgr->clks), 0, sizeof(struct dc_clocks));
++ // Assumption is that boot state always supports pstate
++ clk_mgr->clks.ref_dtbclk_khz = ref_dtbclk; // restore ref_dtbclk
++ clk_mgr->clks.p_state_change_support = true;
++ clk_mgr->clks.prev_p_state_change_support = true;
++ clk_mgr->clks.pwr_state = DCN_PWR_STATE_UNKNOWN;
++ clk_mgr->clks.zstate_support = DCN_ZSTATE_SUPPORT_UNKNOWN;
++
++ // to adjust dp_dto reference clock if ssc is enable otherwise to apply dprefclk
++ if (dcn314_is_spll_ssc_enabled(clk_mgr))
++ clk_mgr->dp_dto_source_clock_in_khz =
++ dce_adjust_dp_ref_freq_for_ss(clk_mgr_int, clk_mgr->dprefclk_khz);
++ else
++ clk_mgr->dp_dto_source_clock_in_khz = clk_mgr->dprefclk_khz;
++}
++
+ void dcn314_update_clocks(struct clk_mgr *clk_mgr_base,
+ struct dc_state *context,
+ bool safe_to_lower)
+@@ -433,6 +478,11 @@ static DpmClocks314_t dummy_clocks;
+
+ static struct dcn314_watermarks dummy_wms = { 0 };
+
++static struct dcn314_ss_info_table ss_info_table = {
++ .ss_divider = 1000,
++ .ss_percentage = {0, 0, 375, 375, 375}
++};
++
+ static void dcn314_build_watermark_ranges(struct clk_bw_params *bw_params, struct dcn314_watermarks *table)
+ {
+ int i, num_valid_sets;
+@@ -705,13 +755,31 @@ static struct clk_mgr_funcs dcn314_funcs = {
+ .get_dp_ref_clk_frequency = dce12_get_dp_ref_freq_khz,
+ .get_dtb_ref_clk_frequency = dcn31_get_dtb_ref_freq_khz,
+ .update_clocks = dcn314_update_clocks,
+- .init_clocks = dcn31_init_clocks,
++ .init_clocks = dcn314_init_clocks,
+ .enable_pme_wa = dcn314_enable_pme_wa,
+ .are_clock_states_equal = dcn314_are_clock_states_equal,
+ .notify_wm_ranges = dcn314_notify_wm_ranges
+ };
+ extern struct clk_mgr_funcs dcn3_fpga_funcs;
+
++static void dcn314_read_ss_info_from_lut(struct clk_mgr_internal *clk_mgr)
++{
++ uint32_t clock_source;
++ //uint32_t ssc_enable;
++
++ REG_GET(CLK1_CLK2_BYPASS_CNTL, CLK2_BYPASS_SEL, &clock_source);
++ //REG_GET(CLK6_0_CLK6_spll_field_8, spll_ssc_en, &ssc_enable);
++
++ if (dcn314_is_spll_ssc_enabled(&clk_mgr->base) && (clock_source < ARRAY_SIZE(ss_info_table.ss_percentage))) {
++ clk_mgr->dprefclk_ss_percentage = ss_info_table.ss_percentage[clock_source];
++
++ if (clk_mgr->dprefclk_ss_percentage != 0) {
++ clk_mgr->ss_on_dprefclk = true;
++ clk_mgr->dprefclk_ss_divider = ss_info_table.ss_divider;
++ }
++ }
++}
++
+ void dcn314_clk_mgr_construct(
+ struct dc_context *ctx,
+ struct clk_mgr_dcn314 *clk_mgr,
+@@ -779,6 +847,7 @@ void dcn314_clk_mgr_construct(
+ clk_mgr->base.base.dprefclk_khz = 600000;
+ clk_mgr->base.base.clks.ref_dtbclk_khz = 600000;
+ dce_clock_read_ss_info(&clk_mgr->base);
++ dcn314_read_ss_info_from_lut(&clk_mgr->base);
+ /*if bios enabled SS, driver needs to adjust dtb clock, only enable with correct bios*/
+
+ clk_mgr->base.base.bw_params = &dcn314_bw_params;
+diff --git a/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.h b/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.h
+index 171f84340eb2..002c28e80720 100644
+--- a/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.h
++++ b/drivers/gpu/drm/amd/display/dc/clk_mgr/dcn314/dcn314_clk_mgr.h
+@@ -28,6 +28,8 @@
+ #define __DCN314_CLK_MGR_H__
+ #include "clk_mgr_internal.h"
+
++#define DCN314_NUM_CLOCK_SOURCES 5
++
+ struct dcn314_watermarks;
+
+ struct dcn314_smu_watermark_set {
+@@ -40,9 +42,18 @@ struct clk_mgr_dcn314 {
+ struct dcn314_smu_watermark_set smu_wm_set;
+ };
+
++struct dcn314_ss_info_table {
++ uint32_t ss_divider;
++ uint32_t ss_percentage[DCN314_NUM_CLOCK_SOURCES];
++};
++
+ bool dcn314_are_clock_states_equal(struct dc_clocks *a,
+ struct dc_clocks *b);
+
++bool dcn314_is_spll_ssc_enabled(struct clk_mgr *clk_mgr_base);
++
++void dcn314_init_clocks(struct clk_mgr *clk_mgr);
++
+ void dcn314_update_clocks(struct clk_mgr *clk_mgr_base,
+ struct dc_state *context,
+ bool safe_to_lower);
+diff --git a/drivers/gpu/drm/amd/display/dc/dce/dce_audio.c b/drivers/gpu/drm/amd/display/dc/dce/dce_audio.c
+index 140598f18bbd..f0458b8f00af 100644
+--- a/drivers/gpu/drm/amd/display/dc/dce/dce_audio.c
++++ b/drivers/gpu/drm/amd/display/dc/dce/dce_audio.c
+@@ -782,7 +782,7 @@ static void get_azalia_clock_info_dp(
+ /*audio_dto_module = dpDtoSourceClockInkhz * 10,000;
+ * [khz] ->[100Hz] */
+ azalia_clock_info->audio_dto_module =
+- pll_info->dp_dto_source_clock_in_khz * 10;
++ pll_info->audio_dto_source_clock_in_khz * 10;
+ }
+
+ void dce_aud_wall_dto_setup(
+diff --git a/drivers/gpu/drm/amd/display/dc/dce/dce_clock_source.c b/drivers/gpu/drm/amd/display/dc/dce/dce_clock_source.c
+index 5d3f6fa1011e..970644b695cd 100644
+--- a/drivers/gpu/drm/amd/display/dc/dce/dce_clock_source.c
++++ b/drivers/gpu/drm/amd/display/dc/dce/dce_clock_source.c
+@@ -975,6 +975,9 @@ static bool dcn31_program_pix_clk(
+ look_up_in_video_optimized_rate_tlb(pix_clk_params->requested_pix_clk_100hz / 10);
+ struct bp_pixel_clock_parameters bp_pc_params = {0};
+ enum transmitter_color_depth bp_pc_colour_depth = TRANSMITTER_COLOR_DEPTH_24;
++
++ if (clock_source->ctx->dc->clk_mgr->dp_dto_source_clock_in_khz != 0)
++ dp_dto_ref_khz = clock_source->ctx->dc->clk_mgr->dp_dto_source_clock_in_khz;
+ // For these signal types Driver to program DP_DTO without calling VBIOS Command table
+ if (dc_is_dp_signal(pix_clk_params->signal_type) || dc_is_virtual_signal(pix_clk_params->signal_type)) {
+ if (e) {
+@@ -1088,6 +1091,10 @@ static bool get_pixel_clk_frequency_100hz(
+ struct dce110_clk_src *clk_src = TO_DCE110_CLK_SRC(clock_source);
+ unsigned int clock_hz = 0;
+ unsigned int modulo_hz = 0;
++ unsigned int dp_dto_ref_khz = clock_source->ctx->dc->clk_mgr->dprefclk_khz;
++
++ if (clock_source->ctx->dc->clk_mgr->dp_dto_source_clock_in_khz != 0)
++ dp_dto_ref_khz = clock_source->ctx->dc->clk_mgr->dp_dto_source_clock_in_khz;
+
+ if (clock_source->id == CLOCK_SOURCE_ID_DP_DTO) {
+ clock_hz = REG_READ(PHASE[inst]);
+@@ -1100,7 +1107,7 @@ static bool get_pixel_clk_frequency_100hz(
+ modulo_hz = REG_READ(MODULO[inst]);
+ if (modulo_hz)
+ *pixel_clk_khz = div_u64((uint64_t)clock_hz*
+- clock_source->ctx->dc->clk_mgr->dprefclk_khz*10,
++ dp_dto_ref_khz*10,
+ modulo_hz);
+ else
+ *pixel_clk_khz = 0;
+diff --git a/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c b/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c
+index 578e51a19fdd..9fedf9947569 100644
+--- a/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c
++++ b/drivers/gpu/drm/amd/display/dc/hwss/dce110/dce110_hwseq.c
+@@ -1353,7 +1353,7 @@ static void build_audio_output(
+ if (state->clk_mgr &&
+ (pipe_ctx->stream->signal == SIGNAL_TYPE_DISPLAY_PORT ||
+ pipe_ctx->stream->signal == SIGNAL_TYPE_DISPLAY_PORT_MST)) {
+- audio_output->pll_info.dp_dto_source_clock_in_khz =
++ audio_output->pll_info.audio_dto_source_clock_in_khz =
+ state->clk_mgr->funcs->get_dp_ref_clk_frequency(
+ state->clk_mgr);
+ }
+diff --git a/drivers/gpu/drm/amd/display/dc/inc/hw/clk_mgr.h b/drivers/gpu/drm/amd/display/dc/inc/hw/clk_mgr.h
+index fa9614bcb160..55ded5fb8a38 100644
+--- a/drivers/gpu/drm/amd/display/dc/inc/hw/clk_mgr.h
++++ b/drivers/gpu/drm/amd/display/dc/inc/hw/clk_mgr.h
+@@ -314,6 +314,7 @@ struct clk_mgr {
+ bool force_smu_not_present;
+ bool dc_mode_softmax_enabled;
+ int dprefclk_khz; // Used by program pixel clock in clock source funcs, need to figureout where this goes
++ int dp_dto_source_clock_in_khz; // Used to program DP DTO with ss adjustment on DCN314
+ int dentist_vco_freq_khz;
+ struct clk_state_registers_and_bypass boot_snapshot;
+ struct clk_bw_params *bw_params;
+diff --git a/drivers/gpu/drm/amd/display/include/audio_types.h b/drivers/gpu/drm/amd/display/include/audio_types.h
+index 66a54da0641c..915a031a43cb 100644
+--- a/drivers/gpu/drm/amd/display/include/audio_types.h
++++ b/drivers/gpu/drm/amd/display/include/audio_types.h
+@@ -64,7 +64,7 @@ enum audio_dto_source {
+ /* PLL information required for AZALIA DTO calculation */
+
+ struct audio_pll_info {
+- uint32_t dp_dto_source_clock_in_khz;
++ uint32_t audio_dto_source_clock_in_khz;
+ uint32_t feed_back_divider;
+ enum audio_dto_source dto_source;
+ bool ss_enabled;
+--
+2.43.0
+
--- /dev/null
+From da508d1ccbc751958c92a76036a6112e2e05c7b5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 5 Jan 2024 12:05:09 +0530
+Subject: drm/amd/powerplay: Fix kzalloc parameter 'ATOM_Tonga_PPM_Table' in
+ 'get_platform_power_management_table()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit 6616b5e1999146b1304abe78232af810080c67e3 ]
+
+In 'struct phm_ppm_table *ptr' allocation using kzalloc, an incorrect
+structure type is passed to sizeof() in kzalloc, larger structure types
+were used, thus using correct type 'struct phm_ppm_table' fixes the
+below:
+
+drivers/gpu/drm/amd/amdgpu/../pm/powerplay/hwmgr/process_pptables_v1_0.c:203 get_platform_power_management_table() warn: struct type mismatch 'phm_ppm_table vs _ATOM_Tonga_PPM_Table'
+
+Cc: Eric Huang <JinHuiEric.Huang@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Acked-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c
+index f2a55c1413f5..17882f8dfdd3 100644
+--- a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c
++++ b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c
+@@ -200,7 +200,7 @@ static int get_platform_power_management_table(
+ struct pp_hwmgr *hwmgr,
+ ATOM_Tonga_PPM_Table *atom_ppm_table)
+ {
+- struct phm_ppm_table *ptr = kzalloc(sizeof(ATOM_Tonga_PPM_Table), GFP_KERNEL);
++ struct phm_ppm_table *ptr = kzalloc(sizeof(*ptr), GFP_KERNEL);
+ struct phm_ppt_v1_information *pp_table_information =
+ (struct phm_ppt_v1_information *)(hwmgr->pptable);
+
+--
+2.43.0
+
--- /dev/null
+From a0049d8b250ed1990c914503f1bca07e1ec011c8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 3 Jan 2024 11:55:53 -0500
+Subject: drm/amdgpu: apply the RV2 system aperture fix to RN/CZN as well
+
+From: Alex Deucher <alexander.deucher@amd.com>
+
+[ Upstream commit 16783d8ef08448815e149e40c82fc1e1fc41ddbf ]
+
+These chips needs the same fix. This was previously not seen
+on then since the AGP aperture expanded the system aperture,
+but this showed up again when AGP was disabled.
+
+Reviewed-and-tested-by: Jiadong Zhu <Jiadong.Zhu@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/gfxhub_v1_0.c | 4 +++-
+ drivers/gpu/drm/amd/amdgpu/gfxhub_v1_2.c | 4 +++-
+ drivers/gpu/drm/amd/amdgpu/mmhub_v1_0.c | 4 +++-
+ drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c | 8 ++++++--
+ 4 files changed, 15 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_0.c b/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_0.c
+index 53a2ba5fcf4b..22175da0e16a 100644
+--- a/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_0.c
++++ b/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_0.c
+@@ -102,7 +102,9 @@ static void gfxhub_v1_0_init_system_aperture_regs(struct amdgpu_device *adev)
+ WREG32_SOC15_RLC(GC, 0, mmMC_VM_SYSTEM_APERTURE_LOW_ADDR,
+ min(adev->gmc.fb_start, adev->gmc.agp_start) >> 18);
+
+- if (adev->apu_flags & AMD_APU_IS_RAVEN2)
++ if (adev->apu_flags & (AMD_APU_IS_RAVEN2 |
++ AMD_APU_IS_RENOIR |
++ AMD_APU_IS_GREEN_SARDINE))
+ /*
+ * Raven2 has a HW issue that it is unable to use the
+ * vram which is out of MC_VM_SYSTEM_APERTURE_HIGH_ADDR.
+diff --git a/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_2.c b/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_2.c
+index 55423ff1bb49..95d06da544e2 100644
+--- a/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_2.c
++++ b/drivers/gpu/drm/amd/amdgpu/gfxhub_v1_2.c
+@@ -139,7 +139,9 @@ gfxhub_v1_2_xcc_init_system_aperture_regs(struct amdgpu_device *adev,
+ WREG32_SOC15_RLC(GC, GET_INST(GC, i), regMC_VM_SYSTEM_APERTURE_LOW_ADDR,
+ min(adev->gmc.fb_start, adev->gmc.agp_start) >> 18);
+
+- if (adev->apu_flags & AMD_APU_IS_RAVEN2)
++ if (adev->apu_flags & (AMD_APU_IS_RAVEN2 |
++ AMD_APU_IS_RENOIR |
++ AMD_APU_IS_GREEN_SARDINE))
+ /*
+ * Raven2 has a HW issue that it is unable to use the
+ * vram which is out of MC_VM_SYSTEM_APERTURE_HIGH_ADDR.
+diff --git a/drivers/gpu/drm/amd/amdgpu/mmhub_v1_0.c b/drivers/gpu/drm/amd/amdgpu/mmhub_v1_0.c
+index 843219a91736..e3ddd22aa172 100644
+--- a/drivers/gpu/drm/amd/amdgpu/mmhub_v1_0.c
++++ b/drivers/gpu/drm/amd/amdgpu/mmhub_v1_0.c
+@@ -96,7 +96,9 @@ static void mmhub_v1_0_init_system_aperture_regs(struct amdgpu_device *adev)
+ WREG32_SOC15(MMHUB, 0, mmMC_VM_SYSTEM_APERTURE_LOW_ADDR,
+ min(adev->gmc.fb_start, adev->gmc.agp_start) >> 18);
+
+- if (adev->apu_flags & AMD_APU_IS_RAVEN2)
++ if (adev->apu_flags & (AMD_APU_IS_RAVEN2 |
++ AMD_APU_IS_RENOIR |
++ AMD_APU_IS_GREEN_SARDINE))
+ /*
+ * Raven2 has a HW issue that it is unable to use the vram which
+ * is out of MC_VM_SYSTEM_APERTURE_HIGH_ADDR. So here is the
+diff --git a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c
+index 6f7d7f79ef89..affc628004ff 100644
+--- a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c
++++ b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c
+@@ -1257,7 +1257,9 @@ static void mmhub_read_system_context(struct amdgpu_device *adev, struct dc_phy_
+ /* AGP aperture is disabled */
+ if (agp_bot > agp_top) {
+ logical_addr_low = adev->gmc.fb_start >> 18;
+- if (adev->apu_flags & AMD_APU_IS_RAVEN2)
++ if (adev->apu_flags & (AMD_APU_IS_RAVEN2 |
++ AMD_APU_IS_RENOIR |
++ AMD_APU_IS_GREEN_SARDINE))
+ /*
+ * Raven2 has a HW issue that it is unable to use the vram which
+ * is out of MC_VM_SYSTEM_APERTURE_HIGH_ADDR. So here is the
+@@ -1269,7 +1271,9 @@ static void mmhub_read_system_context(struct amdgpu_device *adev, struct dc_phy_
+ logical_addr_high = adev->gmc.fb_end >> 18;
+ } else {
+ logical_addr_low = min(adev->gmc.fb_start, adev->gmc.agp_start) >> 18;
+- if (adev->apu_flags & AMD_APU_IS_RAVEN2)
++ if (adev->apu_flags & (AMD_APU_IS_RAVEN2 |
++ AMD_APU_IS_RENOIR |
++ AMD_APU_IS_GREEN_SARDINE))
+ /*
+ * Raven2 has a HW issue that it is unable to use the vram which
+ * is out of MC_VM_SYSTEM_APERTURE_HIGH_ADDR. So here is the
+--
+2.43.0
+
--- /dev/null
+From 11747702aace6f148d7f24337401f4bfcdeb9482 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 27 Dec 2023 12:54:44 +0530
+Subject: drm/amdgpu: Drop 'fence' check in 'to_amdgpu_amdkfd_fence()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit bf2ad4fb8adca89374b54b225d494e0b1956dbea ]
+
+Return value of container_of(...) can't be null, so null check is not
+required for 'fence'. Hence drop its NULL check.
+
+Fixes the below:
+drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c:93 to_amdgpu_amdkfd_fence() warn: can 'fence' even be NULL?
+
+Cc: Felix Kuehling <Felix.Kuehling@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Felix Kuehling <felix.kuehling@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c
+index 469785d33791..1ef758ac5076 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c
+@@ -90,7 +90,7 @@ struct amdgpu_amdkfd_fence *to_amdgpu_amdkfd_fence(struct dma_fence *f)
+ return NULL;
+
+ fence = container_of(f, struct amdgpu_amdkfd_fence, base);
+- if (fence && f->ops == &amdkfd_fence_ops)
++ if (f->ops == &amdkfd_fence_ops)
+ return fence;
+
+ return NULL;
+--
+2.43.0
+
--- /dev/null
+From 170b86ec8e779c0f38a6d66dc14e3a109188141a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 2 Oct 2023 14:27:13 -0400
+Subject: drm/amdgpu: fix avg vs input power reporting on smu7
+
+From: Alex Deucher <alexander.deucher@amd.com>
+
+[ Upstream commit 25852d4b97572ff62ffee574cb8bb4bc551af23a ]
+
+Hawaii, Bonaire, Fiji, and Tonga support average power, the others
+support current power.
+
+Reviewed-by: Yang Wang <kevinyang.wang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c | 17 ++++++++++++++++-
+ 1 file changed, 16 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c
+index b1a8799e2dee..aa91730e4eaf 100644
+--- a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c
++++ b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c
+@@ -3999,6 +3999,7 @@ static int smu7_read_sensor(struct pp_hwmgr *hwmgr, int idx,
+ uint32_t sclk, mclk, activity_percent;
+ uint32_t offset, val_vid;
+ struct smu7_hwmgr *data = (struct smu7_hwmgr *)(hwmgr->backend);
++ struct amdgpu_device *adev = hwmgr->adev;
+
+ /* size must be at least 4 bytes for all sensors */
+ if (*size < 4)
+@@ -4042,7 +4043,21 @@ static int smu7_read_sensor(struct pp_hwmgr *hwmgr, int idx,
+ *size = 4;
+ return 0;
+ case AMDGPU_PP_SENSOR_GPU_INPUT_POWER:
+- return smu7_get_gpu_power(hwmgr, (uint32_t *)value);
++ if ((adev->asic_type != CHIP_HAWAII) &&
++ (adev->asic_type != CHIP_BONAIRE) &&
++ (adev->asic_type != CHIP_FIJI) &&
++ (adev->asic_type != CHIP_TONGA))
++ return smu7_get_gpu_power(hwmgr, (uint32_t *)value);
++ else
++ return -EOPNOTSUPP;
++ case AMDGPU_PP_SENSOR_GPU_AVG_POWER:
++ if ((adev->asic_type != CHIP_HAWAII) &&
++ (adev->asic_type != CHIP_BONAIRE) &&
++ (adev->asic_type != CHIP_FIJI) &&
++ (adev->asic_type != CHIP_TONGA))
++ return -EOPNOTSUPP;
++ else
++ return smu7_get_gpu_power(hwmgr, (uint32_t *)value);
+ case AMDGPU_PP_SENSOR_VDDGFX:
+ if ((data->vr_config & VRCONF_VDDGFX_MASK) ==
+ (VR_SVI2_PLANE_2 << VRCONF_VDDGFX_SHIFT))
+--
+2.43.0
+
--- /dev/null
+From 404cd9d530e10c01c33c1a4b79fb1dc12a661af2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 16:13:23 +0800
+Subject: drm/amdgpu: Fix ecc irq enable/disable unpaired
+
+From: Stanley.Yang <Stanley.Yang@amd.com>
+
+[ Upstream commit a32c6f7f5737cc7e31cd7ad5133f0d96fca12ea6 ]
+
+The ecc_irq is disabled while GPU mode2 reset suspending process,
+but not be enabled during GPU mode2 reset resume process.
+
+Changed from V1:
+ only do sdma/gfx ras_late_init in aldebaran_mode2_restore_ip
+ delete amdgpu_ras_late_resume function
+
+Changed from V2:
+ check umc ras supported before put ecc_irq
+
+Signed-off-by: Stanley.Yang <Stanley.Yang@amd.com>
+Reviewed-by: Tao Zhou <tao.zhou1@amd.com>
+Reviewed-by: Hawking Zhang <Hawking.Zhang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/aldebaran.c | 26 +++++++++++++++++++++++++-
+ drivers/gpu/drm/amd/amdgpu/gmc_v10_0.c | 4 ++++
+ drivers/gpu/drm/amd/amdgpu/gmc_v11_0.c | 5 +++++
+ drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c | 4 ++++
+ 4 files changed, 38 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/aldebaran.c b/drivers/gpu/drm/amd/amdgpu/aldebaran.c
+index 02f4c6f9d4f6..576067d66bb9 100644
+--- a/drivers/gpu/drm/amd/amdgpu/aldebaran.c
++++ b/drivers/gpu/drm/amd/amdgpu/aldebaran.c
+@@ -330,6 +330,7 @@ aldebaran_mode2_restore_hwcontext(struct amdgpu_reset_control *reset_ctl,
+ {
+ struct list_head *reset_device_list = reset_context->reset_device_list;
+ struct amdgpu_device *tmp_adev = NULL;
++ struct amdgpu_ras *con;
+ int r;
+
+ if (reset_device_list == NULL)
+@@ -355,7 +356,30 @@ aldebaran_mode2_restore_hwcontext(struct amdgpu_reset_control *reset_ctl,
+ */
+ amdgpu_register_gpu_instance(tmp_adev);
+
+- /* Resume RAS */
++ /* Resume RAS, ecc_irq */
++ con = amdgpu_ras_get_context(tmp_adev);
++ if (!amdgpu_sriov_vf(tmp_adev) && con) {
++ if (tmp_adev->sdma.ras &&
++ tmp_adev->sdma.ras->ras_block.ras_late_init) {
++ r = tmp_adev->sdma.ras->ras_block.ras_late_init(tmp_adev,
++ &tmp_adev->sdma.ras->ras_block.ras_comm);
++ if (r) {
++ dev_err(tmp_adev->dev, "SDMA failed to execute ras_late_init! ret:%d\n", r);
++ goto end;
++ }
++ }
++
++ if (tmp_adev->gfx.ras &&
++ tmp_adev->gfx.ras->ras_block.ras_late_init) {
++ r = tmp_adev->gfx.ras->ras_block.ras_late_init(tmp_adev,
++ &tmp_adev->gfx.ras->ras_block.ras_comm);
++ if (r) {
++ dev_err(tmp_adev->dev, "GFX failed to execute ras_late_init! ret:%d\n", r);
++ goto end;
++ }
++ }
++ }
++
+ amdgpu_ras_resume(tmp_adev);
+
+ /* Update PSP FW topology after reset */
+diff --git a/drivers/gpu/drm/amd/amdgpu/gmc_v10_0.c b/drivers/gpu/drm/amd/amdgpu/gmc_v10_0.c
+index a5a05c16c10d..6c5185608854 100644
+--- a/drivers/gpu/drm/amd/amdgpu/gmc_v10_0.c
++++ b/drivers/gpu/drm/amd/amdgpu/gmc_v10_0.c
+@@ -1041,6 +1041,10 @@ static int gmc_v10_0_hw_fini(void *handle)
+
+ amdgpu_irq_put(adev, &adev->gmc.vm_fault, 0);
+
++ if (adev->gmc.ecc_irq.funcs &&
++ amdgpu_ras_is_supported(adev, AMDGPU_RAS_BLOCK__UMC))
++ amdgpu_irq_put(adev, &adev->gmc.ecc_irq, 0);
++
+ return 0;
+ }
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/gmc_v11_0.c b/drivers/gpu/drm/amd/amdgpu/gmc_v11_0.c
+index 23d7b548d13f..c9c653cfc765 100644
+--- a/drivers/gpu/drm/amd/amdgpu/gmc_v11_0.c
++++ b/drivers/gpu/drm/amd/amdgpu/gmc_v11_0.c
+@@ -941,6 +941,11 @@ static int gmc_v11_0_hw_fini(void *handle)
+ }
+
+ amdgpu_irq_put(adev, &adev->gmc.vm_fault, 0);
++
++ if (adev->gmc.ecc_irq.funcs &&
++ amdgpu_ras_is_supported(adev, AMDGPU_RAS_BLOCK__UMC))
++ amdgpu_irq_put(adev, &adev->gmc.ecc_irq, 0);
++
+ gmc_v11_0_gart_disable(adev);
+
+ return 0;
+diff --git a/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c b/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
+index 77e625f24cd0..776acdfc7209 100644
+--- a/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
++++ b/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
+@@ -2381,6 +2381,10 @@ static int gmc_v9_0_hw_fini(void *handle)
+
+ amdgpu_irq_put(adev, &adev->gmc.vm_fault, 0);
+
++ if (adev->gmc.ecc_irq.funcs &&
++ amdgpu_ras_is_supported(adev, AMDGPU_RAS_BLOCK__UMC))
++ amdgpu_irq_put(adev, &adev->gmc.ecc_irq, 0);
++
+ return 0;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 9ffba6b2b542d86cd9be13209953ddccb1330cab Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 21:03:04 +0800
+Subject: drm/amdgpu: fix ftrace event amdgpu_bo_move always move on same heap
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Wang, Beyond <Wang.Beyond@amd.com>
+
+[ Upstream commit 94aeb4117343d072e3a35b9595bcbfc0058ee724 ]
+
+Issue: during evict or validate happened on amdgpu_bo, the 'from' and
+'to' is always same in ftrace event of amdgpu_bo_move
+
+where calling the 'trace_amdgpu_bo_move', the comment says move_notify
+is called before move happens, but actually it is called after move
+happens, here the new_mem is same as bo->resource
+
+Fix: move trace_amdgpu_bo_move from move_notify to amdgpu_bo_move
+
+Signed-off-by: Wang, Beyond <Wang.Beyond@amd.com>
+Reviewed-by: Christian König <christian.koenig@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_object.c | 13 +------------
+ drivers/gpu/drm/amd/amdgpu/amdgpu_object.h | 4 +---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_ttm.c | 5 +++--
+ 3 files changed, 5 insertions(+), 17 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_object.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_object.c
+index 5ad03f2afdb4..425cebcc5cbf 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_object.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_object.c
+@@ -1245,19 +1245,15 @@ int amdgpu_bo_get_metadata(struct amdgpu_bo *bo, void *buffer,
+ * amdgpu_bo_move_notify - notification about a memory move
+ * @bo: pointer to a buffer object
+ * @evict: if this move is evicting the buffer from the graphics address space
+- * @new_mem: new information of the bufer object
+ *
+ * Marks the corresponding &amdgpu_bo buffer object as invalid, also performs
+ * bookkeeping.
+ * TTM driver callback which is called when ttm moves a buffer.
+ */
+-void amdgpu_bo_move_notify(struct ttm_buffer_object *bo,
+- bool evict,
+- struct ttm_resource *new_mem)
++void amdgpu_bo_move_notify(struct ttm_buffer_object *bo, bool evict)
+ {
+ struct amdgpu_device *adev = amdgpu_ttm_adev(bo->bdev);
+ struct amdgpu_bo *abo;
+- struct ttm_resource *old_mem = bo->resource;
+
+ if (!amdgpu_bo_is_amdgpu_bo(bo))
+ return;
+@@ -1274,13 +1270,6 @@ void amdgpu_bo_move_notify(struct ttm_buffer_object *bo,
+ /* remember the eviction */
+ if (evict)
+ atomic64_inc(&adev->num_evictions);
+-
+- /* update statistics */
+- if (!new_mem)
+- return;
+-
+- /* move_notify is called before move happens */
+- trace_amdgpu_bo_move(abo, new_mem->mem_type, old_mem->mem_type);
+ }
+
+ void amdgpu_bo_get_memory(struct amdgpu_bo *bo,
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_object.h b/drivers/gpu/drm/amd/amdgpu/amdgpu_object.h
+index d28e21baef16..a3ea8a82db23 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_object.h
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_object.h
+@@ -344,9 +344,7 @@ int amdgpu_bo_set_metadata (struct amdgpu_bo *bo, void *metadata,
+ int amdgpu_bo_get_metadata(struct amdgpu_bo *bo, void *buffer,
+ size_t buffer_size, uint32_t *metadata_size,
+ uint64_t *flags);
+-void amdgpu_bo_move_notify(struct ttm_buffer_object *bo,
+- bool evict,
+- struct ttm_resource *new_mem);
++void amdgpu_bo_move_notify(struct ttm_buffer_object *bo, bool evict);
+ void amdgpu_bo_release_notify(struct ttm_buffer_object *bo);
+ vm_fault_t amdgpu_bo_fault_reserve_notify(struct ttm_buffer_object *bo);
+ void amdgpu_bo_fence(struct amdgpu_bo *bo, struct dma_fence *fence,
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ttm.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ttm.c
+index ab4a762aed5b..75c9fd2c6c2a 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ttm.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ttm.c
+@@ -545,10 +545,11 @@ static int amdgpu_bo_move(struct ttm_buffer_object *bo, bool evict,
+ return r;
+ }
+
++ trace_amdgpu_bo_move(abo, new_mem->mem_type, old_mem->mem_type);
+ out:
+ /* update statistics */
+ atomic64_add(bo->base.size, &adev->num_bytes_moved);
+- amdgpu_bo_move_notify(bo, evict, new_mem);
++ amdgpu_bo_move_notify(bo, evict);
+ return 0;
+ }
+
+@@ -1553,7 +1554,7 @@ static int amdgpu_ttm_access_memory(struct ttm_buffer_object *bo,
+ static void
+ amdgpu_bo_delete_mem_notify(struct ttm_buffer_object *bo)
+ {
+- amdgpu_bo_move_notify(bo, false, NULL);
++ amdgpu_bo_move_notify(bo, false);
+ }
+
+ static struct ttm_device_funcs amdgpu_bo_driver = {
+--
+2.43.0
+
--- /dev/null
+From edad7b5bcfaa38b68399cf19fdd7fb8b58c0a649 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 3 Jan 2024 22:22:44 +0530
+Subject: drm/amdgpu: Fix '*fw' from request_firmware() not released in
+ 'amdgpu_ucode_request()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit 13a1851f923d9a7a78a477497295c2dfd16ad4a4 ]
+
+Fixes the below:
+drivers/gpu/drm/amd/amdgpu/amdgpu_ucode.c:1404 amdgpu_ucode_request() warn: '*fw' from request_firmware() not released on lines: 1404.
+
+Cc: Mario Limonciello <mario.limonciello@amd.com>
+Cc: Lijo Lazar <lijo.lazar@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Christian König <christian.koenig@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_ucode.c | 6 +++++-
+ 1 file changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ucode.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ucode.c
+index b14127429f30..0efb2568cb65 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ucode.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ucode.c
+@@ -1397,9 +1397,13 @@ int amdgpu_ucode_request(struct amdgpu_device *adev, const struct firmware **fw,
+
+ if (err)
+ return -ENODEV;
++
+ err = amdgpu_ucode_validate(*fw);
+- if (err)
++ if (err) {
+ dev_dbg(adev->dev, "\"%s\" failed to validate\n", fw_name);
++ release_firmware(*fw);
++ *fw = NULL;
++ }
+
+ return err;
+ }
+--
+2.43.0
+
--- /dev/null
+From 638ceac0c4124ff46a55e8e682c3a5941c15f124 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 26 Dec 2023 15:32:19 +0530
+Subject: drm/amdgpu: Fix possible NULL dereference in
+ amdgpu_ras_query_error_status_helper()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit b8d55a90fd55b767c25687747e2b24abd1ef8680 ]
+
+Return invalid error code -EINVAL for invalid block id.
+
+Fixes the below:
+
+drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c:1183 amdgpu_ras_query_error_status_helper() error: we previously assumed 'info' could be null (see line 1176)
+
+Suggested-by: Hawking Zhang <Hawking.Zhang@amd.com>
+Cc: Tao Zhou <tao.zhou1@amd.com>
+Cc: Hawking Zhang <Hawking.Zhang@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Hawking Zhang <Hawking.Zhang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c
+index 63fb4cd85e53..4a3726bb6da1 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c
+@@ -1174,6 +1174,9 @@ static int amdgpu_ras_query_error_status_helper(struct amdgpu_device *adev,
+ enum amdgpu_ras_block blk = info ? info->head.block : AMDGPU_RAS_BLOCK_COUNT;
+ struct amdgpu_ras_block_object *block_obj = NULL;
+
++ if (blk == AMDGPU_RAS_BLOCK_COUNT)
++ return -EINVAL;
++
+ if (error_query_mode == AMDGPU_RAS_INVALID_ERROR_QUERY)
+ return -EINVAL;
+
+--
+2.43.0
+
--- /dev/null
+From 5d7b8ca9c3c1cb2ab5919a0eace82382b3e77a1b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 3 Jan 2024 22:05:16 +0530
+Subject: drm/amdgpu: Fix variable 'mca_funcs' dereferenced before NULL check
+ in 'amdgpu_mca_smu_get_mca_entry()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit 4f32504a2f85a7b40fe149436881381f48e9c0c0 ]
+
+Fixes the below:
+
+drivers/gpu/drm/amd/amdgpu/amdgpu_mca.c:377 amdgpu_mca_smu_get_mca_entry() warn: variable dereferenced before check 'mca_funcs' (see line 368)
+
+357 int amdgpu_mca_smu_get_mca_entry(struct amdgpu_device *adev,
+ enum amdgpu_mca_error_type type,
+358 int idx, struct mca_bank_entry *entry)
+359 {
+360 const struct amdgpu_mca_smu_funcs *mca_funcs =
+ adev->mca.mca_funcs;
+361 int count;
+362
+363 switch (type) {
+364 case AMDGPU_MCA_ERROR_TYPE_UE:
+365 count = mca_funcs->max_ue_count;
+
+mca_funcs is dereferenced here.
+
+366 break;
+367 case AMDGPU_MCA_ERROR_TYPE_CE:
+368 count = mca_funcs->max_ce_count;
+
+mca_funcs is dereferenced here.
+
+369 break;
+370 default:
+371 return -EINVAL;
+372 }
+373
+374 if (idx >= count)
+375 return -EINVAL;
+376
+377 if (mca_funcs && mca_funcs->mca_get_mca_entry)
+ ^^^^^^^^^
+
+Checked too late!
+
+Cc: Yang Wang <kevinyang.wang@amd.com>
+Cc: Hawking Zhang <Hawking.Zhang@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Yang Wang <kevinyang.wang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_mca.c | 8 ++++----
+ 1 file changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_mca.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_mca.c
+index cf33eb219e25..061d88f4480d 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_mca.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_mca.c
+@@ -351,6 +351,9 @@ int amdgpu_mca_smu_get_mca_entry(struct amdgpu_device *adev, enum amdgpu_mca_err
+ const struct amdgpu_mca_smu_funcs *mca_funcs = adev->mca.mca_funcs;
+ int count;
+
++ if (!mca_funcs || !mca_funcs->mca_get_mca_entry)
++ return -EOPNOTSUPP;
++
+ switch (type) {
+ case AMDGPU_MCA_ERROR_TYPE_UE:
+ count = mca_funcs->max_ue_count;
+@@ -365,10 +368,7 @@ int amdgpu_mca_smu_get_mca_entry(struct amdgpu_device *adev, enum amdgpu_mca_err
+ if (idx >= count)
+ return -EINVAL;
+
+- if (mca_funcs && mca_funcs->mca_get_mca_entry)
+- return mca_funcs->mca_get_mca_entry(adev, type, idx, entry);
+-
+- return -EOPNOTSUPP;
++ return mca_funcs->mca_get_mca_entry(adev, type, idx, entry);
+ }
+
+ #if defined(CONFIG_DEBUG_FS)
+--
+2.43.0
+
--- /dev/null
+From ec870625e0a46813465d7aa028897df773ce4bf8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 4 Jan 2024 15:26:42 +0530
+Subject: drm/amdgpu: Fix with right return code '-EIO' in
+ 'amdgpu_gmc_vram_checking()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit fac4ebd79fed60e79cccafdad45a2bb8d3795044 ]
+
+The amdgpu_gmc_vram_checking() function in emulation checks whether
+all of the memory range of shared system memory could be accessed by
+GPU, from this aspect, -EIO is returned for error scenarios.
+
+Fixes the below:
+drivers/gpu/drm/amd/amdgpu/gmc_v6_0.c:919 gmc_v6_0_hw_init() warn: missing error code? 'r'
+drivers/gpu/drm/amd/amdgpu/gmc_v7_0.c:1103 gmc_v7_0_hw_init() warn: missing error code? 'r'
+drivers/gpu/drm/amd/amdgpu/gmc_v8_0.c:1223 gmc_v8_0_hw_init() warn: missing error code? 'r'
+drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c:2344 gmc_v9_0_hw_init() warn: missing error code? 'r'
+
+Cc: Xiaojian Du <Xiaojian.Du@amd.com>
+Cc: Lijo Lazar <lijo.lazar@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Suggested-by: Christian König <christian.koenig@amd.com>
+Reviewed-by: Christian König <christian.koenig@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c | 21 ++++++++++++++-------
+ 1 file changed, 14 insertions(+), 7 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+index d2f273d77e59..55784a9f26c4 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+@@ -1045,21 +1045,28 @@ int amdgpu_gmc_vram_checking(struct amdgpu_device *adev)
+ * seconds, so here, we just pick up three parts for emulation.
+ */
+ ret = memcmp(vram_ptr, cptr, 10);
+- if (ret)
+- return ret;
++ if (ret) {
++ ret = -EIO;
++ goto release_buffer;
++ }
+
+ ret = memcmp(vram_ptr + (size / 2), cptr, 10);
+- if (ret)
+- return ret;
++ if (ret) {
++ ret = -EIO;
++ goto release_buffer;
++ }
+
+ ret = memcmp(vram_ptr + size - 10, cptr, 10);
+- if (ret)
+- return ret;
++ if (ret) {
++ ret = -EIO;
++ goto release_buffer;
++ }
+
++release_buffer:
+ amdgpu_bo_free_kernel(&vram_bo, &vram_gpu,
+ &vram_ptr);
+
+- return 0;
++ return ret;
+ }
+
+ static ssize_t current_memory_partition_show(
+--
+2.43.0
+
--- /dev/null
+From 15d49b4e85c0698c4df5894a5bb669b4b1efe29a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 16:17:23 -0500
+Subject: drm/amdgpu: Let KFD sync with VM fences
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Felix Kuehling <Felix.Kuehling@amd.com>
+
+[ Upstream commit ec9ba4821fa52b5efdbc4cdf0a77497990655231 ]
+
+Change the rules for amdgpu_sync_resv to let KFD synchronize with VM
+fences on page table reservations. This fixes intermittent memory
+corruption after evictions when using amdgpu_vm_handle_moved to update
+page tables for VM mappings managed through render nodes.
+
+Signed-off-by: Felix Kuehling <Felix.Kuehling@amd.com>
+Reviewed-by: Christian König <christian.koenig@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c
+index dcd8c066bc1f..1b013a44ca99 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c
+@@ -191,7 +191,8 @@ static bool amdgpu_sync_test_fence(struct amdgpu_device *adev,
+
+ /* Never sync to VM updates either. */
+ if (fence_owner == AMDGPU_FENCE_OWNER_VM &&
+- owner != AMDGPU_FENCE_OWNER_UNDEFINED)
++ owner != AMDGPU_FENCE_OWNER_UNDEFINED &&
++ owner != AMDGPU_FENCE_OWNER_KFD)
+ return false;
+
+ /* Ignore fences depending on the sync mode */
+--
+2.43.0
+
--- /dev/null
+From eb76bb50a8bf96a2f025dd45863d1ce8d24d4151 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 18:13:11 +0530
+Subject: drm/amdgpu: Release 'adev->pm.fw' before return in
+ 'amdgpu_device_need_post()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit 8a44fdd3cf91debbd09b43bd2519ad2b2486ccf4 ]
+
+In function 'amdgpu_device_need_post(struct amdgpu_device *adev)' -
+'adev->pm.fw' may not be released before return.
+
+Using the function release_firmware() to release adev->pm.fw.
+
+Thus fixing the below:
+drivers/gpu/drm/amd/amdgpu/amdgpu_device.c:1571 amdgpu_device_need_post() warn: 'adev->pm.fw' from request_firmware() not released on lines: 1554.
+
+Cc: Monk Liu <Monk.Liu@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Suggested-by: Lijo Lazar <lijo.lazar@amd.com>
+Reviewed-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_device.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+index 3677d644183b..9257c9af3fee 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+@@ -1485,6 +1485,7 @@ bool amdgpu_device_need_post(struct amdgpu_device *adev)
+ return true;
+
+ fw_ver = *((uint32_t *)adev->pm.fw->data + 69);
++ release_firmware(adev->pm.fw);
+ if (fw_ver < 0x00160e00)
+ return true;
+ }
+--
+2.43.0
+
--- /dev/null
+From a72c1691940150bae950caf47ae1a9bd77a42c38 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 29 Dec 2023 15:07:09 +0530
+Subject: drm/amdkfd: Fix iterator used outside loop in 'kfd_add_peer_prop()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit b1a428b45dc7e47c7acc2ad0d08d8a6dda910c4c ]
+
+Fix the following about iterator use:
+drivers/gpu/drm/amd/amdgpu/../amdkfd/kfd_topology.c:1456 kfd_add_peer_prop() warn: iterator used outside loop: 'iolink3'
+
+Cc: Felix Kuehling <Felix.Kuehling@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Felix Kuehling <felix.kuehling@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdkfd/kfd_topology.c | 24 ++++++++++++-----------
+ 1 file changed, 13 insertions(+), 11 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_topology.c b/drivers/gpu/drm/amd/amdkfd/kfd_topology.c
+index 58d775a0668d..e5f7c92eebcb 100644
+--- a/drivers/gpu/drm/amd/amdkfd/kfd_topology.c
++++ b/drivers/gpu/drm/amd/amdkfd/kfd_topology.c
+@@ -1452,17 +1452,19 @@ static int kfd_add_peer_prop(struct kfd_topology_device *kdev,
+ /* CPU->CPU link*/
+ cpu_dev = kfd_topology_device_by_proximity_domain(iolink1->node_to);
+ if (cpu_dev) {
+- list_for_each_entry(iolink3, &cpu_dev->io_link_props, list)
+- if (iolink3->node_to == iolink2->node_to)
+- break;
+-
+- props->weight += iolink3->weight;
+- props->min_latency += iolink3->min_latency;
+- props->max_latency += iolink3->max_latency;
+- props->min_bandwidth = min(props->min_bandwidth,
+- iolink3->min_bandwidth);
+- props->max_bandwidth = min(props->max_bandwidth,
+- iolink3->max_bandwidth);
++ list_for_each_entry(iolink3, &cpu_dev->io_link_props, list) {
++ if (iolink3->node_to != iolink2->node_to)
++ continue;
++
++ props->weight += iolink3->weight;
++ props->min_latency += iolink3->min_latency;
++ props->max_latency += iolink3->max_latency;
++ props->min_bandwidth = min(props->min_bandwidth,
++ iolink3->min_bandwidth);
++ props->max_bandwidth = min(props->max_bandwidth,
++ iolink3->max_bandwidth);
++ break;
++ }
+ } else {
+ WARN(1, "CPU node not found");
+ }
+--
+2.43.0
+
--- /dev/null
+From d15f0aa38a08195834e552f3a61e10fbbcc8682b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 29 Dec 2023 15:19:25 -0500
+Subject: drm/amdkfd: Fix lock dependency warning with srcu
+
+From: Philip Yang <Philip.Yang@amd.com>
+
+[ Upstream commit 2a9de42e8d3c82c6990d226198602be44f43f340 ]
+
+======================================================
+WARNING: possible circular locking dependency detected
+6.5.0-kfd-yangp #2289 Not tainted
+------------------------------------------------------
+kworker/0:2/996 is trying to acquire lock:
+ (srcu){.+.+}-{0:0}, at: __synchronize_srcu+0x5/0x1a0
+
+but task is already holding lock:
+ ((work_completion)(&svms->deferred_list_work)){+.+.}-{0:0}, at:
+ process_one_work+0x211/0x560
+
+which lock already depends on the new lock.
+
+the existing dependency chain (in reverse order) is:
+
+-> #3 ((work_completion)(&svms->deferred_list_work)){+.+.}-{0:0}:
+ __flush_work+0x88/0x4f0
+ svm_range_list_lock_and_flush_work+0x3d/0x110 [amdgpu]
+ svm_range_set_attr+0xd6/0x14c0 [amdgpu]
+ kfd_ioctl+0x1d1/0x630 [amdgpu]
+ __x64_sys_ioctl+0x88/0xc0
+
+-> #2 (&info->lock#2){+.+.}-{3:3}:
+ __mutex_lock+0x99/0xc70
+ amdgpu_amdkfd_gpuvm_restore_process_bos+0x54/0x740 [amdgpu]
+ restore_process_helper+0x22/0x80 [amdgpu]
+ restore_process_worker+0x2d/0xa0 [amdgpu]
+ process_one_work+0x29b/0x560
+ worker_thread+0x3d/0x3d0
+
+-> #1 ((work_completion)(&(&process->restore_work)->work)){+.+.}-{0:0}:
+ __flush_work+0x88/0x4f0
+ __cancel_work_timer+0x12c/0x1c0
+ kfd_process_notifier_release_internal+0x37/0x1f0 [amdgpu]
+ __mmu_notifier_release+0xad/0x240
+ exit_mmap+0x6a/0x3a0
+ mmput+0x6a/0x120
+ do_exit+0x322/0xb90
+ do_group_exit+0x37/0xa0
+ __x64_sys_exit_group+0x18/0x20
+ do_syscall_64+0x38/0x80
+
+-> #0 (srcu){.+.+}-{0:0}:
+ __lock_acquire+0x1521/0x2510
+ lock_sync+0x5f/0x90
+ __synchronize_srcu+0x4f/0x1a0
+ __mmu_notifier_release+0x128/0x240
+ exit_mmap+0x6a/0x3a0
+ mmput+0x6a/0x120
+ svm_range_deferred_list_work+0x19f/0x350 [amdgpu]
+ process_one_work+0x29b/0x560
+ worker_thread+0x3d/0x3d0
+
+other info that might help us debug this:
+Chain exists of:
+ srcu --> &info->lock#2 --> (work_completion)(&svms->deferred_list_work)
+
+Possible unsafe locking scenario:
+
+ CPU0 CPU1
+ ---- ----
+ lock((work_completion)(&svms->deferred_list_work));
+ lock(&info->lock#2);
+ lock((work_completion)(&svms->deferred_list_work));
+ sync(srcu);
+
+Signed-off-by: Philip Yang <Philip.Yang@amd.com>
+Reviewed-by: Felix Kuehling <felix.kuehling@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdkfd/kfd_svm.c | 6 ++++--
+ 1 file changed, 4 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_svm.c b/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
+index 92d8b1513e57..f66f88d2b643 100644
+--- a/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
++++ b/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
+@@ -2366,8 +2366,10 @@ static void svm_range_deferred_list_work(struct work_struct *work)
+ mutex_unlock(&svms->lock);
+ mmap_write_unlock(mm);
+
+- /* Pairs with mmget in svm_range_add_list_work */
+- mmput(mm);
++ /* Pairs with mmget in svm_range_add_list_work. If dropping the
++ * last mm refcount, schedule release work to avoid circular locking
++ */
++ mmput_async(mm);
+
+ spin_lock(&svms->deferred_list_lock);
+ }
+--
+2.43.0
+
--- /dev/null
+From 0cbc013a914d14302a184b1f4f694a3e2567f1dd Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 2 Jan 2024 15:07:44 -0500
+Subject: drm/amdkfd: Fix lock dependency warning
+
+From: Felix Kuehling <felix.kuehling@amd.com>
+
+[ Upstream commit 47bf0f83fc86df1bf42b385a91aadb910137c5c9 ]
+
+======================================================
+WARNING: possible circular locking dependency detected
+6.5.0-kfd-fkuehlin #276 Not tainted
+------------------------------------------------------
+kworker/8:2/2676 is trying to acquire lock:
+ffff9435aae95c88 ((work_completion)(&svm_bo->eviction_work)){+.+.}-{0:0}, at: __flush_work+0x52/0x550
+
+but task is already holding lock:
+ffff9435cd8e1720 (&svms->lock){+.+.}-{3:3}, at: svm_range_deferred_list_work+0xe8/0x340 [amdgpu]
+
+which lock already depends on the new lock.
+
+the existing dependency chain (in reverse order) is:
+
+-> #2 (&svms->lock){+.+.}-{3:3}:
+ __mutex_lock+0x97/0xd30
+ kfd_ioctl_alloc_memory_of_gpu+0x6d/0x3c0 [amdgpu]
+ kfd_ioctl+0x1b2/0x5d0 [amdgpu]
+ __x64_sys_ioctl+0x86/0xc0
+ do_syscall_64+0x39/0x80
+ entry_SYSCALL_64_after_hwframe+0x63/0xcd
+
+-> #1 (&mm->mmap_lock){++++}-{3:3}:
+ down_read+0x42/0x160
+ svm_range_evict_svm_bo_worker+0x8b/0x340 [amdgpu]
+ process_one_work+0x27a/0x540
+ worker_thread+0x53/0x3e0
+ kthread+0xeb/0x120
+ ret_from_fork+0x31/0x50
+ ret_from_fork_asm+0x11/0x20
+
+-> #0 ((work_completion)(&svm_bo->eviction_work)){+.+.}-{0:0}:
+ __lock_acquire+0x1426/0x2200
+ lock_acquire+0xc1/0x2b0
+ __flush_work+0x80/0x550
+ __cancel_work_timer+0x109/0x190
+ svm_range_bo_release+0xdc/0x1c0 [amdgpu]
+ svm_range_free+0x175/0x180 [amdgpu]
+ svm_range_deferred_list_work+0x15d/0x340 [amdgpu]
+ process_one_work+0x27a/0x540
+ worker_thread+0x53/0x3e0
+ kthread+0xeb/0x120
+ ret_from_fork+0x31/0x50
+ ret_from_fork_asm+0x11/0x20
+
+other info that might help us debug this:
+
+Chain exists of:
+ (work_completion)(&svm_bo->eviction_work) --> &mm->mmap_lock --> &svms->lock
+
+ Possible unsafe locking scenario:
+
+ CPU0 CPU1
+ ---- ----
+ lock(&svms->lock);
+ lock(&mm->mmap_lock);
+ lock(&svms->lock);
+ lock((work_completion)(&svm_bo->eviction_work));
+
+I believe this cannot really lead to a deadlock in practice, because
+svm_range_evict_svm_bo_worker only takes the mmap_read_lock if the BO
+refcount is non-0. That means it's impossible that svm_range_bo_release
+is running concurrently. However, there is no good way to annotate this.
+
+To avoid the problem, take a BO reference in
+svm_range_schedule_evict_svm_bo instead of in the worker. That way it's
+impossible for a BO to get freed while eviction work is pending and the
+cancel_work_sync call in svm_range_bo_release can be eliminated.
+
+v2: Use svm_bo_ref_unless_zero and explained why that's safe. Also
+removed redundant checks that are already done in
+amdkfd_fence_enable_signaling.
+
+Signed-off-by: Felix Kuehling <felix.kuehling@amd.com>
+Reviewed-by: Philip Yang <philip.yang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdkfd/kfd_svm.c | 26 ++++++++++----------------
+ 1 file changed, 10 insertions(+), 16 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_svm.c b/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
+index a15bfb5223e8..92d8b1513e57 100644
+--- a/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
++++ b/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
+@@ -400,14 +400,9 @@ static void svm_range_bo_release(struct kref *kref)
+ spin_lock(&svm_bo->list_lock);
+ }
+ spin_unlock(&svm_bo->list_lock);
+- if (!dma_fence_is_signaled(&svm_bo->eviction_fence->base)) {
+- /* We're not in the eviction worker.
+- * Signal the fence and synchronize with any
+- * pending eviction work.
+- */
++ if (!dma_fence_is_signaled(&svm_bo->eviction_fence->base))
++ /* We're not in the eviction worker. Signal the fence. */
+ dma_fence_signal(&svm_bo->eviction_fence->base);
+- cancel_work_sync(&svm_bo->eviction_work);
+- }
+ dma_fence_put(&svm_bo->eviction_fence->base);
+ amdgpu_bo_unref(&svm_bo->bo);
+ kfree(svm_bo);
+@@ -3447,13 +3442,14 @@ svm_range_trigger_migration(struct mm_struct *mm, struct svm_range *prange,
+
+ int svm_range_schedule_evict_svm_bo(struct amdgpu_amdkfd_fence *fence)
+ {
+- if (!fence)
+- return -EINVAL;
+-
+- if (dma_fence_is_signaled(&fence->base))
+- return 0;
+-
+- if (fence->svm_bo) {
++ /* Dereferencing fence->svm_bo is safe here because the fence hasn't
++ * signaled yet and we're under the protection of the fence->lock.
++ * After the fence is signaled in svm_range_bo_release, we cannot get
++ * here any more.
++ *
++ * Reference is dropped in svm_range_evict_svm_bo_worker.
++ */
++ if (svm_bo_ref_unless_zero(fence->svm_bo)) {
+ WRITE_ONCE(fence->svm_bo->evicting, 1);
+ schedule_work(&fence->svm_bo->eviction_work);
+ }
+@@ -3468,8 +3464,6 @@ static void svm_range_evict_svm_bo_worker(struct work_struct *work)
+ int r = 0;
+
+ svm_bo = container_of(work, struct svm_range_bo, eviction_work);
+- if (!svm_bo_ref_unless_zero(svm_bo))
+- return; /* svm_bo was freed while eviction was pending */
+
+ if (mmget_not_zero(svm_bo->eviction_fence->mm)) {
+ mm = svm_bo->eviction_fence->mm;
+--
+2.43.0
+
--- /dev/null
+From 6dd6bded8285964d69e158a14e753f023773f666 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 12:22:07 -0500
+Subject: drm/amdkfd: fix mes set shader debugger process management
+
+From: Jonathan Kim <jonathan.kim@amd.com>
+
+[ Upstream commit bd33bb1409b494558a2935f7bbc7842def957fcd ]
+
+MES provides the driver a call to explicitly flush stale process memory
+within the MES to avoid a race condition that results in a fatal
+memory violation.
+
+When SET_SHADER_DEBUGGER is called, the driver passes a memory address
+that represents a process context address MES uses to keep track of
+future per-process calls.
+
+Normally, MES will purge its process context list when the last queue
+has been removed. The driver, however, can call SET_SHADER_DEBUGGER
+regardless of whether a queue has been added or not.
+
+If SET_SHADER_DEBUGGER has been called with no queues as the last call
+prior to process termination, the passed process context address will
+still reside within MES.
+
+On a new process call to SET_SHADER_DEBUGGER, the driver may end up
+passing an identical process context address value (based on per-process
+gpu memory address) to MES but is now pointing to a new allocated buffer
+object during KFD process creation. Since the MES is unaware of this,
+access of the passed address points to the stale object within MES and
+triggers a fatal memory violation.
+
+The solution is for KFD to explicitly flush the process context address
+from MES on process termination.
+
+Note that the flush call and the MES debugger calls use the same MES
+interface but are separated as KFD calls to avoid conflicting with each
+other.
+
+Signed-off-by: Jonathan Kim <jonathan.kim@amd.com>
+Tested-by: Alice Wong <shiwei.wong@amd.com>
+Reviewed-by: Eric Huang <jinhuieric.huang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_mes.c | 31 +++++++++++++++++++
+ drivers/gpu/drm/amd/amdgpu/amdgpu_mes.h | 10 +++---
+ .../amd/amdkfd/kfd_process_queue_manager.c | 1 +
+ drivers/gpu/drm/amd/include/mes_v11_api_def.h | 3 +-
+ 4 files changed, 40 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.c
+index 9ddbf1494326..30c010836658 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.c
+@@ -886,6 +886,11 @@ int amdgpu_mes_set_shader_debugger(struct amdgpu_device *adev,
+ op_input.op = MES_MISC_OP_SET_SHADER_DEBUGGER;
+ op_input.set_shader_debugger.process_context_addr = process_context_addr;
+ op_input.set_shader_debugger.flags.u32all = flags;
++
++ /* use amdgpu mes_flush_shader_debugger instead */
++ if (op_input.set_shader_debugger.flags.process_ctx_flush)
++ return -EINVAL;
++
+ op_input.set_shader_debugger.spi_gdbg_per_vmid_cntl = spi_gdbg_per_vmid_cntl;
+ memcpy(op_input.set_shader_debugger.tcp_watch_cntl, tcp_watch_cntl,
+ sizeof(op_input.set_shader_debugger.tcp_watch_cntl));
+@@ -905,6 +910,32 @@ int amdgpu_mes_set_shader_debugger(struct amdgpu_device *adev,
+ return r;
+ }
+
++int amdgpu_mes_flush_shader_debugger(struct amdgpu_device *adev,
++ uint64_t process_context_addr)
++{
++ struct mes_misc_op_input op_input = {0};
++ int r;
++
++ if (!adev->mes.funcs->misc_op) {
++ DRM_ERROR("mes flush shader debugger is not supported!\n");
++ return -EINVAL;
++ }
++
++ op_input.op = MES_MISC_OP_SET_SHADER_DEBUGGER;
++ op_input.set_shader_debugger.process_context_addr = process_context_addr;
++ op_input.set_shader_debugger.flags.process_ctx_flush = true;
++
++ amdgpu_mes_lock(&adev->mes);
++
++ r = adev->mes.funcs->misc_op(&adev->mes, &op_input);
++ if (r)
++ DRM_ERROR("failed to set_shader_debugger\n");
++
++ amdgpu_mes_unlock(&adev->mes);
++
++ return r;
++}
++
+ static void
+ amdgpu_mes_ring_to_queue_props(struct amdgpu_device *adev,
+ struct amdgpu_ring *ring,
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.h b/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.h
+index a27b424ffe00..c2c88b772361 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.h
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_mes.h
+@@ -291,9 +291,10 @@ struct mes_misc_op_input {
+ uint64_t process_context_addr;
+ union {
+ struct {
+- uint64_t single_memop : 1;
+- uint64_t single_alu_op : 1;
+- uint64_t reserved: 30;
++ uint32_t single_memop : 1;
++ uint32_t single_alu_op : 1;
++ uint32_t reserved: 29;
++ uint32_t process_ctx_flush: 1;
+ };
+ uint32_t u32all;
+ } flags;
+@@ -369,7 +370,8 @@ int amdgpu_mes_set_shader_debugger(struct amdgpu_device *adev,
+ const uint32_t *tcp_watch_cntl,
+ uint32_t flags,
+ bool trap_en);
+-
++int amdgpu_mes_flush_shader_debugger(struct amdgpu_device *adev,
++ uint64_t process_context_addr);
+ int amdgpu_mes_add_ring(struct amdgpu_device *adev, int gang_id,
+ int queue_type, int idx,
+ struct amdgpu_mes_ctx_data *ctx_data,
+diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c b/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c
+index 77f493262e05..8e55e78fce4e 100644
+--- a/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c
++++ b/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c
+@@ -87,6 +87,7 @@ void kfd_process_dequeue_from_device(struct kfd_process_device *pdd)
+ return;
+
+ dev->dqm->ops.process_termination(dev->dqm, &pdd->qpd);
++ amdgpu_mes_flush_shader_debugger(dev->adev, pdd->proc_ctx_gpu_addr);
+ pdd->already_dequeued = true;
+ }
+
+diff --git a/drivers/gpu/drm/amd/include/mes_v11_api_def.h b/drivers/gpu/drm/amd/include/mes_v11_api_def.h
+index b1db2b190187..e07e93167a82 100644
+--- a/drivers/gpu/drm/amd/include/mes_v11_api_def.h
++++ b/drivers/gpu/drm/amd/include/mes_v11_api_def.h
+@@ -571,7 +571,8 @@ struct SET_SHADER_DEBUGGER {
+ struct {
+ uint32_t single_memop : 1; /* SQ_DEBUG.single_memop */
+ uint32_t single_alu_op : 1; /* SQ_DEBUG.single_alu_op */
+- uint32_t reserved : 30;
++ uint32_t reserved : 29;
++ uint32_t process_ctx_flush : 1;
+ };
+ uint32_t u32all;
+ } flags;
+--
+2.43.0
+
--- /dev/null
+From 92301262b48d5f73aa91b433d99f16665bc5307c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 9 Jan 2024 16:57:26 +0530
+Subject: drm/amdkfd: Fix 'node' NULL check in
+ 'svm_range_get_range_boundaries()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit d7a254fad873775ce6c32b77796c81e81e6b7f2e ]
+
+Range interval [start, last] is ordered by rb_tree, rb_prev, rb_next
+return value still needs NULL check, thus modified from "node" to "rb_node".
+
+Fixes the below:
+drivers/gpu/drm/amd/amdgpu/../amdkfd/kfd_svm.c:2691 svm_range_get_range_boundaries() warn: can 'node' even be NULL?
+
+Suggested-by: Philip Yang <Philip.Yang@amd.com>
+Cc: Felix Kuehling <Felix.Kuehling@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Felix Kuehling <felix.kuehling@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdkfd/kfd_svm.c | 10 +++++-----
+ 1 file changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_svm.c b/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
+index f66f88d2b643..9af1d094385a 100644
+--- a/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
++++ b/drivers/gpu/drm/amd/amdkfd/kfd_svm.c
+@@ -2680,6 +2680,7 @@ svm_range_get_range_boundaries(struct kfd_process *p, int64_t addr,
+ {
+ struct vm_area_struct *vma;
+ struct interval_tree_node *node;
++ struct rb_node *rb_node;
+ unsigned long start_limit, end_limit;
+
+ vma = vma_lookup(p->mm, addr << PAGE_SHIFT);
+@@ -2699,16 +2700,15 @@ svm_range_get_range_boundaries(struct kfd_process *p, int64_t addr,
+ if (node) {
+ end_limit = min(end_limit, node->start);
+ /* Last range that ends before the fault address */
+- node = container_of(rb_prev(&node->rb),
+- struct interval_tree_node, rb);
++ rb_node = rb_prev(&node->rb);
+ } else {
+ /* Last range must end before addr because
+ * there was no range after addr
+ */
+- node = container_of(rb_last(&p->svms.objects.rb_root),
+- struct interval_tree_node, rb);
++ rb_node = rb_last(&p->svms.objects.rb_root);
+ }
+- if (node) {
++ if (rb_node) {
++ node = container_of(rb_node, struct interval_tree_node, rb);
+ if (node->last >= addr) {
+ WARN(1, "Overlap with prev node and page fault addr\n");
+ return -EFAULT;
+--
+2.43.0
+
--- /dev/null
+From f0b35d6049696a39bba7be257f9a68c031d3a175 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 13 Dec 2023 22:08:03 -0500
+Subject: drm/amdkfd: only flush mes process context if mes support is there
+
+From: Jonathan Kim <jonathan.kim@amd.com>
+
+[ Upstream commit 24149412dfc71f7f4a54868702e9145e396263d3 ]
+
+Fix up on mes process context flush to prevent non-mes devices from
+spamming error messages or running into undefined behaviour during
+process termination.
+
+Fixes: bd33bb1409b4 ("drm/amdkfd: fix mes set shader debugger process management")
+Signed-off-by: Jonathan Kim <jonathan.kim@amd.com>
+Reviewed-by: Eric Huang <jinhuieric.huang@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c b/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c
+index 8e55e78fce4e..43eff221eae5 100644
+--- a/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c
++++ b/drivers/gpu/drm/amd/amdkfd/kfd_process_queue_manager.c
+@@ -87,7 +87,8 @@ void kfd_process_dequeue_from_device(struct kfd_process_device *pdd)
+ return;
+
+ dev->dqm->ops.process_termination(dev->dqm, &pdd->qpd);
+- amdgpu_mes_flush_shader_debugger(dev->adev, pdd->proc_ctx_gpu_addr);
++ if (dev->kfd->shared_resources.enable_mes)
++ amdgpu_mes_flush_shader_debugger(dev->adev, pdd->proc_ctx_gpu_addr);
+ pdd->already_dequeued = true;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 8affc5cf75dbb61e690cf728c195f09dbaeebf38 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 20 Nov 2023 17:10:37 +0800
+Subject: drm/bridge: anx7625: Fix Set HPD irq detect window to 2ms
+
+From: Xin Ji <xji@analogixsemi.com>
+
+[ Upstream commit e3af7053de3f685c96158373bc234b2feca1f160 ]
+
+Polling firmware HPD GPIO status, set HPD irq detect window to 2ms
+after firmware HPD GPIO initial done
+
+Signed-off-by: Xin Ji <xji@analogixsemi.com>
+Reviewed-by: Robert Foss <rfoss@kernel.org>
+Signed-off-by: Robert Foss <rfoss@kernel.org>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231120091038.284825-2-xji@analogixsemi.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/bridge/analogix/anx7625.c | 51 ++++++++++++++++-------
+ drivers/gpu/drm/bridge/analogix/anx7625.h | 4 ++
+ 2 files changed, 40 insertions(+), 15 deletions(-)
+
+diff --git a/drivers/gpu/drm/bridge/analogix/anx7625.c b/drivers/gpu/drm/bridge/analogix/anx7625.c
+index 5168628f11cf..29d91493b101 100644
+--- a/drivers/gpu/drm/bridge/analogix/anx7625.c
++++ b/drivers/gpu/drm/bridge/analogix/anx7625.c
+@@ -1298,10 +1298,32 @@ static void anx7625_config(struct anx7625_data *ctx)
+ XTAL_FRQ_SEL, XTAL_FRQ_27M);
+ }
+
++static int anx7625_hpd_timer_config(struct anx7625_data *ctx)
++{
++ int ret;
++
++ /* Set irq detect window to 2ms */
++ ret = anx7625_reg_write(ctx, ctx->i2c.tx_p2_client,
++ HPD_DET_TIMER_BIT0_7, HPD_TIME & 0xFF);
++ ret |= anx7625_reg_write(ctx, ctx->i2c.tx_p2_client,
++ HPD_DET_TIMER_BIT8_15,
++ (HPD_TIME >> 8) & 0xFF);
++ ret |= anx7625_reg_write(ctx, ctx->i2c.tx_p2_client,
++ HPD_DET_TIMER_BIT16_23,
++ (HPD_TIME >> 16) & 0xFF);
++
++ return ret;
++}
++
++static int anx7625_read_hpd_gpio_config_status(struct anx7625_data *ctx)
++{
++ return anx7625_reg_read(ctx, ctx->i2c.rx_p0_client, GPIO_CTRL_2);
++}
++
+ static void anx7625_disable_pd_protocol(struct anx7625_data *ctx)
+ {
+ struct device *dev = ctx->dev;
+- int ret;
++ int ret, val;
+
+ /* Reset main ocm */
+ ret = anx7625_reg_write(ctx, ctx->i2c.rx_p0_client, 0x88, 0x40);
+@@ -1315,6 +1337,19 @@ static void anx7625_disable_pd_protocol(struct anx7625_data *ctx)
+ DRM_DEV_DEBUG_DRIVER(dev, "disable PD feature fail.\n");
+ else
+ DRM_DEV_DEBUG_DRIVER(dev, "disable PD feature succeeded.\n");
++
++ /*
++ * Make sure the HPD GPIO already be configured after OCM release before
++ * setting HPD detect window register. Here we poll the status register
++ * at maximum 40ms, then config HPD irq detect window register
++ */
++ readx_poll_timeout(anx7625_read_hpd_gpio_config_status,
++ ctx, val,
++ ((val & HPD_SOURCE) || (val < 0)),
++ 2000, 2000 * 20);
++
++ /* Set HPD irq detect window to 2ms */
++ anx7625_hpd_timer_config(ctx);
+ }
+
+ static int anx7625_ocm_loading_check(struct anx7625_data *ctx)
+@@ -1437,20 +1472,6 @@ static void anx7625_start_dp_work(struct anx7625_data *ctx)
+
+ static int anx7625_read_hpd_status_p0(struct anx7625_data *ctx)
+ {
+- int ret;
+-
+- /* Set irq detect window to 2ms */
+- ret = anx7625_reg_write(ctx, ctx->i2c.tx_p2_client,
+- HPD_DET_TIMER_BIT0_7, HPD_TIME & 0xFF);
+- ret |= anx7625_reg_write(ctx, ctx->i2c.tx_p2_client,
+- HPD_DET_TIMER_BIT8_15,
+- (HPD_TIME >> 8) & 0xFF);
+- ret |= anx7625_reg_write(ctx, ctx->i2c.tx_p2_client,
+- HPD_DET_TIMER_BIT16_23,
+- (HPD_TIME >> 16) & 0xFF);
+- if (ret < 0)
+- return ret;
+-
+ return anx7625_reg_read(ctx, ctx->i2c.rx_p0_client, SYSTEM_STSTUS);
+ }
+
+diff --git a/drivers/gpu/drm/bridge/analogix/anx7625.h b/drivers/gpu/drm/bridge/analogix/anx7625.h
+index 80d3fb4e985f..39ed35d33836 100644
+--- a/drivers/gpu/drm/bridge/analogix/anx7625.h
++++ b/drivers/gpu/drm/bridge/analogix/anx7625.h
+@@ -259,6 +259,10 @@
+ #define AP_MIPI_RX_EN BIT(5) /* 1: MIPI RX input in 0: no RX in */
+ #define AP_DISABLE_PD BIT(6)
+ #define AP_DISABLE_DISPLAY BIT(7)
++
++#define GPIO_CTRL_2 0x49
++#define HPD_SOURCE BIT(6)
++
+ /***************************************************************/
+ /* Register definition of device address 0x84 */
+ #define MIPI_PHY_CONTROL_3 0x03
+--
+2.43.0
+
--- /dev/null
+From 11f845759f8d62e7b0c0428265abfdf7afe4cf76 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 3 Nov 2023 15:14:03 +0200
+Subject: drm/drm_file: fix use of uninitialized variable
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 1d3062fad9c7313fff9970a88e0538a24480ffb8 ]
+
+smatch reports:
+
+drivers/gpu/drm/drm_file.c:967 drm_show_memory_stats() error: uninitialized symbol 'supported_status'.
+
+'supported_status' is only set in one code path. I'm not familiar with
+the code to say if that path will always be ran in real life, but
+whether that is the case or not, I think it is good to initialize
+'supported_status' to 0 to silence the warning (and possibly fix a bug).
+
+Reviewed-by: Laurent Pinchart <laurent.pinchart+renesas@ideasonboard.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231103-uninit-fixes-v2-1-c22b2444f5f5@ideasonboard.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/drm_file.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/drm_file.c b/drivers/gpu/drm/drm_file.c
+index 446458aca8e9..54a7103c1c0f 100644
+--- a/drivers/gpu/drm/drm_file.c
++++ b/drivers/gpu/drm/drm_file.c
+@@ -958,7 +958,7 @@ void drm_show_memory_stats(struct drm_printer *p, struct drm_file *file)
+ {
+ struct drm_gem_object *obj;
+ struct drm_memory_stats status = {};
+- enum drm_gem_object_status supported_status;
++ enum drm_gem_object_status supported_status = 0;
+ int id;
+
+ spin_lock(&file->table_lock);
+--
+2.43.0
+
--- /dev/null
+From 772ed45966c866dc14ee276a51d369e613a02099 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Sep 2023 12:26:52 -0700
+Subject: drm/exynos: Call drm_atomic_helper_shutdown() at shutdown/unbind time
+
+From: Douglas Anderson <dianders@chromium.org>
+
+[ Upstream commit 16ac5b21b31b439f03cdf44c153c5f5af94fb3eb ]
+
+Based on grepping through the source code this driver appears to be
+missing a call to drm_atomic_helper_shutdown() at system shutdown time
+and at driver unbind time. Among other things, this means that if a
+panel is in use that it won't be cleanly powered off at system
+shutdown time.
+
+The fact that we should call drm_atomic_helper_shutdown() in the case
+of OS shutdown/restart and at driver remove (or unbind) time comes
+straight out of the kernel doc "driver instance overview" in
+drm_drv.c.
+
+A few notes about this fix:
+- When adding drm_atomic_helper_shutdown() to the unbind path, I added
+ it after drm_kms_helper_poll_fini() since that's when other drivers
+ seemed to have it.
+- Technically with a previous patch, ("drm/atomic-helper:
+ drm_atomic_helper_shutdown(NULL) should be a noop"), we don't
+ actually need to check to see if our "drm" pointer is NULL before
+ calling drm_atomic_helper_shutdown(). We'll leave the "if" test in,
+ though, so that this patch can land without any dependencies. It
+ could potentially be removed later.
+- This patch also makes sure to set the drvdata to NULL in the case of
+ bind errors to make sure that shutdown can't access freed data.
+
+Suggested-by: Maxime Ripard <mripard@kernel.org>
+Reviewed-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Douglas Anderson <dianders@chromium.org>
+Tested-by: Marek Szyprowski <m.szyprowski@samsung.com>
+Reviewed-by: Marek Szyprowski <m.szyprowski@samsung.com>
+Signed-off-by: Inki Dae <inki.dae@samsung.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/exynos/exynos_drm_drv.c | 11 +++++++++++
+ 1 file changed, 11 insertions(+)
+
+diff --git a/drivers/gpu/drm/exynos/exynos_drm_drv.c b/drivers/gpu/drm/exynos/exynos_drm_drv.c
+index 8399256cb5c9..5380fb6c55ae 100644
+--- a/drivers/gpu/drm/exynos/exynos_drm_drv.c
++++ b/drivers/gpu/drm/exynos/exynos_drm_drv.c
+@@ -300,6 +300,7 @@ static int exynos_drm_bind(struct device *dev)
+ drm_mode_config_cleanup(drm);
+ exynos_drm_cleanup_dma(drm);
+ kfree(private);
++ dev_set_drvdata(dev, NULL);
+ err_free_drm:
+ drm_dev_put(drm);
+
+@@ -313,6 +314,7 @@ static void exynos_drm_unbind(struct device *dev)
+ drm_dev_unregister(drm);
+
+ drm_kms_helper_poll_fini(drm);
++ drm_atomic_helper_shutdown(drm);
+
+ component_unbind_all(drm->dev, drm);
+ drm_mode_config_cleanup(drm);
+@@ -350,9 +352,18 @@ static int exynos_drm_platform_remove(struct platform_device *pdev)
+ return 0;
+ }
+
++static void exynos_drm_platform_shutdown(struct platform_device *pdev)
++{
++ struct drm_device *drm = platform_get_drvdata(pdev);
++
++ if (drm)
++ drm_atomic_helper_shutdown(drm);
++}
++
+ static struct platform_driver exynos_drm_platform_driver = {
+ .probe = exynos_drm_platform_probe,
+ .remove = exynos_drm_platform_remove,
++ .shutdown = exynos_drm_platform_shutdown,
+ .driver = {
+ .name = "exynos-drm",
+ .pm = &exynos_drm_pm_ops,
+--
+2.43.0
+
--- /dev/null
+From 09bb383f88338316b11ca2270176a3439efef22f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 13 Oct 2023 16:13:59 +0300
+Subject: drm: Fix color LUT rounding
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Ville Syrjälä <ville.syrjala@linux.intel.com>
+
+[ Upstream commit c6fbb6bca10838485b820e8a26c23996f77ce580 ]
+
+The current implementation of drm_color_lut_extract()
+generates weird results. Eg. if we go through all the
+values for 16->8bpc conversion we see the following pattern:
+
+in out (count)
+ 0 - 7f -> 0 (128)
+ 80 - 17f -> 1 (256)
+ 180 - 27f -> 2 (256)
+ 280 - 37f -> 3 (256)
+...
+fb80 - fc7f -> fc (256)
+fc80 - fd7f -> fd (256)
+fd80 - fe7f -> fe (256)
+fe80 - ffff -> ff (384)
+
+So less values map to 0 and more values map 0xff, which
+doesn't seem particularly great.
+
+To get just the same number of input values to map to
+the same output values we'd just need to drop the rounding
+entrirely. But perhaps a better idea would be to follow the
+OpenGL int<->float conversion rules, in which case we get
+the following results:
+
+in out (count)
+ 0 - 80 -> 0 (129)
+ 81 - 181 -> 1 (257)
+ 182 - 282 -> 2 (257)
+ 283 - 383 -> 3 (257)
+...
+fc7c - fd7c -> fc (257)
+fd7d - fe7d -> fd (257)
+fe7e - ff7e -> fe (257)
+ff7f - ffff -> ff (129)
+
+Note that since the divisor is constant the compiler
+is able to optimize away the integer division in most
+cases. The only exception is the _ULL() case on 32bit
+architectures since that gets emitted as inline asm
+via do_div() and thus the compiler doesn't get to
+optimize it.
+
+Signed-off-by: Ville Syrjälä <ville.syrjala@linux.intel.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231013131402.24072-2-ville.syrjala@linux.intel.com
+Reviewed-by: Chaitanya Kumar Borah <chaitanya.kumar.borah@intel.com>
+Reviewed-by: Jani Nikula <jani.nikula@intel.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/drm/drm_color_mgmt.h | 19 ++++++++-----------
+ 1 file changed, 8 insertions(+), 11 deletions(-)
+
+diff --git a/include/drm/drm_color_mgmt.h b/include/drm/drm_color_mgmt.h
+index 81c298488b0c..54b2b2467bfd 100644
+--- a/include/drm/drm_color_mgmt.h
++++ b/include/drm/drm_color_mgmt.h
+@@ -36,20 +36,17 @@ struct drm_plane;
+ *
+ * Extract a degamma/gamma LUT value provided by user (in the form of
+ * &drm_color_lut entries) and round it to the precision supported by the
+- * hardware.
++ * hardware, following OpenGL int<->float conversion rules
++ * (see eg. OpenGL 4.6 specification - 2.3.5 Fixed-Point Data Conversions).
+ */
+ static inline u32 drm_color_lut_extract(u32 user_input, int bit_precision)
+ {
+- u32 val = user_input;
+- u32 max = 0xffff >> (16 - bit_precision);
+-
+- /* Round only if we're not using full precision. */
+- if (bit_precision < 16) {
+- val += 1UL << (16 - bit_precision - 1);
+- val >>= 16 - bit_precision;
+- }
+-
+- return clamp_val(val, 0, max);
++ if (bit_precision > 16)
++ return DIV_ROUND_CLOSEST_ULL(mul_u32_u32(user_input, (1 << bit_precision) - 1),
++ (1 << 16) - 1);
++ else
++ return DIV_ROUND_CLOSEST(user_input * ((1 << bit_precision) - 1),
++ (1 << 16) - 1);
+ }
+
+ u64 drm_color_ctm_s31_32_to_qm_n(u64 user_input, u32 m, u32 n);
+--
+2.43.0
+
--- /dev/null
+From 3621f73b4bb20bb3fd068cea7e8279e0b19e9bc8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 3 Nov 2023 15:14:04 +0200
+Subject: drm/framebuffer: Fix use of uninitialized variable
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit f9af8f0c1dc567a5a6a6318ff324c45d80d4a60f ]
+
+smatch reports:
+
+drivers/gpu/drm/drm_framebuffer.c:654 drm_mode_getfb2_ioctl() error: uninitialized symbol 'ret'.
+
+'ret' is possibly not set when there are no errors, causing the error
+above. I can't say if that ever happens in real-life, but in any case I
+think it is good to initialize 'ret' to 0.
+
+Reviewed-by: Laurent Pinchart <laurent.pinchart+renesas@ideasonboard.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231103-uninit-fixes-v2-2-c22b2444f5f5@ideasonboard.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/drm_framebuffer.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/drm_framebuffer.c b/drivers/gpu/drm/drm_framebuffer.c
+index d3ba0698b84b..36c5629af7d8 100644
+--- a/drivers/gpu/drm/drm_framebuffer.c
++++ b/drivers/gpu/drm/drm_framebuffer.c
+@@ -552,7 +552,7 @@ int drm_mode_getfb2_ioctl(struct drm_device *dev,
+ struct drm_mode_fb_cmd2 *r = data;
+ struct drm_framebuffer *fb;
+ unsigned int i;
+- int ret;
++ int ret = 0;
+
+ if (!drm_core_check_feature(dev, DRIVER_MODESET))
+ return -EINVAL;
+--
+2.43.0
+
--- /dev/null
+From f6e2a53880a718076495819210968cf459b18e9e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Sep 2023 13:50:32 +0300
+Subject: drm/mipi-dsi: Fix detach call without attach
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 90d50b8d85834e73536fdccd5aa913b30494fef0 ]
+
+It's been reported that DSI host driver's detach can be called without
+the attach ever happening:
+
+https://lore.kernel.org/all/20230412073954.20601-1-tony@atomide.com/
+
+After reading the code, I think this is what happens:
+
+We have a DSI host defined in the device tree and a DSI peripheral under
+that host (i.e. an i2c device using the DSI as data bus doesn't exhibit
+this behavior).
+
+The host driver calls mipi_dsi_host_register(), which causes (via a few
+functions) mipi_dsi_device_add() to be called for the DSI peripheral. So
+now we have a DSI device under the host, but attach hasn't been called.
+
+Normally the probing of the devices continues, and eventually the DSI
+peripheral's driver will call mipi_dsi_attach(), attaching the
+peripheral.
+
+However, if the host driver's probe encounters an error after calling
+mipi_dsi_host_register(), and before the peripheral has called
+mipi_dsi_attach(), the host driver will do cleanups and return an error
+from its probe function. The cleanups include calling
+mipi_dsi_host_unregister().
+
+mipi_dsi_host_unregister() will call two functions for all its DSI
+peripheral devices: mipi_dsi_detach() and mipi_dsi_device_unregister().
+The latter makes sense, as the device exists, but the former may be
+wrong as attach has not necessarily been done.
+
+To fix this, track the attached state of the peripheral, and only detach
+from mipi_dsi_host_unregister() if the peripheral was attached.
+
+Note that I have only tested this with a board with an i2c DSI
+peripheral, not with a "pure" DSI peripheral.
+
+However, slightly related, the unregister machinery still seems broken.
+E.g. if the DSI host driver is unbound, it'll detach and unregister the
+DSI peripherals. After that, when the DSI peripheral driver unbound
+it'll call detach either directly or using the devm variant, leading to
+a crash. And probably the driver will crash if it happens, for some
+reason, to try to send a message via the DSI bus.
+
+But that's another topic.
+
+Tested-by: H. Nikolaus Schaller <hns@goldelico.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Reviewed-by: Sebastian Reichel <sebastian.reichel@collabora.com>
+Tested-by: Tony Lindgren <tony@atomide.com>
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20230921-dsi-detach-fix-v1-1-d0de2d1621d9@ideasonboard.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/drm_mipi_dsi.c | 17 +++++++++++++++--
+ include/drm/drm_mipi_dsi.h | 2 ++
+ 2 files changed, 17 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/gpu/drm/drm_mipi_dsi.c b/drivers/gpu/drm/drm_mipi_dsi.c
+index 14201f73aab1..843a6dbda93a 100644
+--- a/drivers/gpu/drm/drm_mipi_dsi.c
++++ b/drivers/gpu/drm/drm_mipi_dsi.c
+@@ -347,7 +347,8 @@ static int mipi_dsi_remove_device_fn(struct device *dev, void *priv)
+ {
+ struct mipi_dsi_device *dsi = to_mipi_dsi_device(dev);
+
+- mipi_dsi_detach(dsi);
++ if (dsi->attached)
++ mipi_dsi_detach(dsi);
+ mipi_dsi_device_unregister(dsi);
+
+ return 0;
+@@ -370,11 +371,18 @@ EXPORT_SYMBOL(mipi_dsi_host_unregister);
+ int mipi_dsi_attach(struct mipi_dsi_device *dsi)
+ {
+ const struct mipi_dsi_host_ops *ops = dsi->host->ops;
++ int ret;
+
+ if (!ops || !ops->attach)
+ return -ENOSYS;
+
+- return ops->attach(dsi->host, dsi);
++ ret = ops->attach(dsi->host, dsi);
++ if (ret)
++ return ret;
++
++ dsi->attached = true;
++
++ return 0;
+ }
+ EXPORT_SYMBOL(mipi_dsi_attach);
+
+@@ -386,9 +394,14 @@ int mipi_dsi_detach(struct mipi_dsi_device *dsi)
+ {
+ const struct mipi_dsi_host_ops *ops = dsi->host->ops;
+
++ if (WARN_ON(!dsi->attached))
++ return -EINVAL;
++
+ if (!ops || !ops->detach)
+ return -ENOSYS;
+
++ dsi->attached = false;
++
+ return ops->detach(dsi->host, dsi);
+ }
+ EXPORT_SYMBOL(mipi_dsi_detach);
+diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
+index c9df0407980c..c0aec0d4d664 100644
+--- a/include/drm/drm_mipi_dsi.h
++++ b/include/drm/drm_mipi_dsi.h
+@@ -168,6 +168,7 @@ struct mipi_dsi_device_info {
+ * struct mipi_dsi_device - DSI peripheral device
+ * @host: DSI host for this peripheral
+ * @dev: driver model device node for this peripheral
++ * @attached: the DSI device has been successfully attached
+ * @name: DSI peripheral chip type
+ * @channel: virtual channel assigned to the peripheral
+ * @format: pixel format for video mode
+@@ -184,6 +185,7 @@ struct mipi_dsi_device_info {
+ struct mipi_dsi_device {
+ struct mipi_dsi_host *host;
+ struct device dev;
++ bool attached;
+
+ char name[DSI_DEV_NAME_SIZE];
+ unsigned int channel;
+--
+2.43.0
+
--- /dev/null
+From e1fe798a47c91e84e6b86fb391f0565951386318 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 11:11:51 -0800
+Subject: drm/msm/a690: Fix reg values for a690
+
+From: Danylo Piliaiev <dpiliaiev@igalia.com>
+
+[ Upstream commit 07e6de738aa6f0e873463e9ca88bdb7081c4bfd4 ]
+
+KGSL doesn't support a690 so all reg values were the same as
+on a660. Now we know the values and they are different from the
+windows driver.
+
+This fixes hangs on D3D12 games and some CTS tests.
+
+Signed-off-by: Danylo Piliaiev <dpiliaiev@igalia.com>
+Signed-off-by: Rob Clark <robdclark@chromium.org>
+Patchwork: https://patchwork.freedesktop.org/patch/568931/
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/adreno/a6xx_gpu.c | 23 +++++++++++++----------
+ 1 file changed, 13 insertions(+), 10 deletions(-)
+
+diff --git a/drivers/gpu/drm/msm/adreno/a6xx_gpu.c b/drivers/gpu/drm/msm/adreno/a6xx_gpu.c
+index 7a0220d29a23..500ed2d183fc 100644
+--- a/drivers/gpu/drm/msm/adreno/a6xx_gpu.c
++++ b/drivers/gpu/drm/msm/adreno/a6xx_gpu.c
+@@ -1312,6 +1312,7 @@ static void a6xx_set_ubwc_config(struct msm_gpu *gpu)
+
+ if (adreno_is_a650(adreno_gpu) ||
+ adreno_is_a660(adreno_gpu) ||
++ adreno_is_a690(adreno_gpu) ||
+ adreno_is_a730(adreno_gpu) ||
+ adreno_is_a740_family(adreno_gpu)) {
+ /* TODO: get ddr type from bootloader and use 2 for LPDDR4 */
+@@ -1321,13 +1322,6 @@ static void a6xx_set_ubwc_config(struct msm_gpu *gpu)
+ uavflagprd_inv = 2;
+ }
+
+- if (adreno_is_a690(adreno_gpu)) {
+- hbb_lo = 2;
+- amsbc = 1;
+- rgb565_predicator = 1;
+- uavflagprd_inv = 2;
+- }
+-
+ if (adreno_is_7c3(adreno_gpu)) {
+ hbb_lo = 1;
+ amsbc = 1;
+@@ -1741,7 +1735,9 @@ static int hw_init(struct msm_gpu *gpu)
+ /* Setting the primFifo thresholds default values,
+ * and vccCacheSkipDis=1 bit (0x200) for A640 and newer
+ */
+- if (adreno_is_a650(adreno_gpu) || adreno_is_a660(adreno_gpu) || adreno_is_a690(adreno_gpu))
++ if (adreno_is_a690(adreno_gpu))
++ gpu_write(gpu, REG_A6XX_PC_DBG_ECO_CNTL, 0x00800200);
++ else if (adreno_is_a650(adreno_gpu) || adreno_is_a660(adreno_gpu))
+ gpu_write(gpu, REG_A6XX_PC_DBG_ECO_CNTL, 0x00300200);
+ else if (adreno_is_a640_family(adreno_gpu) || adreno_is_7c3(adreno_gpu))
+ gpu_write(gpu, REG_A6XX_PC_DBG_ECO_CNTL, 0x00200200);
+@@ -1775,6 +1771,8 @@ static int hw_init(struct msm_gpu *gpu)
+ if (adreno_is_a730(adreno_gpu) ||
+ adreno_is_a740_family(adreno_gpu))
+ gpu_write(gpu, REG_A6XX_RBBM_INTERFACE_HANG_INT_CNTL, (1 << 30) | 0xcfffff);
++ else if (adreno_is_a690(adreno_gpu))
++ gpu_write(gpu, REG_A6XX_RBBM_INTERFACE_HANG_INT_CNTL, (1 << 30) | 0x4fffff);
+ else if (adreno_is_a619(adreno_gpu))
+ gpu_write(gpu, REG_A6XX_RBBM_INTERFACE_HANG_INT_CNTL, (1 << 30) | 0x3fffff);
+ else if (adreno_is_a610(adreno_gpu))
+@@ -1808,12 +1806,17 @@ static int hw_init(struct msm_gpu *gpu)
+ a6xx_set_cp_protect(gpu);
+
+ if (adreno_is_a660_family(adreno_gpu)) {
+- gpu_write(gpu, REG_A6XX_CP_CHICKEN_DBG, 0x1);
++ if (adreno_is_a690(adreno_gpu))
++ gpu_write(gpu, REG_A6XX_CP_CHICKEN_DBG, 0x00028801);
++ else
++ gpu_write(gpu, REG_A6XX_CP_CHICKEN_DBG, 0x1);
+ gpu_write(gpu, REG_A6XX_RBBM_GBIF_CLIENT_QOS_CNTL, 0x0);
+ }
+
++ if (adreno_is_a690(adreno_gpu))
++ gpu_write(gpu, REG_A6XX_UCHE_CMDQ_CONFIG, 0x90);
+ /* Set dualQ + disable afull for A660 GPU */
+- if (adreno_is_a660(adreno_gpu))
++ else if (adreno_is_a660(adreno_gpu))
+ gpu_write(gpu, REG_A6XX_UCHE_CMDQ_CONFIG, 0x66906);
+ else if (adreno_is_a7xx(adreno_gpu))
+ gpu_write(gpu, REG_A6XX_UCHE_CMDQ_CONFIG,
+--
+2.43.0
+
--- /dev/null
+From 382fcd66319e7334dec0bff3d0812053bcf5f0c8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 17:37:18 +0100
+Subject: drm/msm/dp: Add DisplayPort controller for SM8650
+
+From: Neil Armstrong <neil.armstrong@linaro.org>
+
+[ Upstream commit 1b2d98bdd7b7c64265732f5f0dace4c52c9ba8a8 ]
+
+The Qualcomm SM8650 platform comes with a DisplayPort controller
+with a different base offset than the previous SM8550 SoC,
+add support for this in the DisplayPort driver.
+
+Signed-off-by: Neil Armstrong <neil.armstrong@linaro.org>
+Reviewed-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Patchwork: https://patchwork.freedesktop.org/patch/571132/
+Link: https://lore.kernel.org/r/20231207-topic-sm8650-upstream-dp-v1-2-b762c06965bb@linaro.org
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/dp/dp_display.c | 6 ++++++
+ 1 file changed, 6 insertions(+)
+
+diff --git a/drivers/gpu/drm/msm/dp/dp_display.c b/drivers/gpu/drm/msm/dp/dp_display.c
+index 1b88fb52726f..4f89c9939501 100644
+--- a/drivers/gpu/drm/msm/dp/dp_display.c
++++ b/drivers/gpu/drm/msm/dp/dp_display.c
+@@ -170,6 +170,11 @@ static const struct msm_dp_desc sm8350_dp_descs[] = {
+ {}
+ };
+
++static const struct msm_dp_desc sm8650_dp_descs[] = {
++ { .io_start = 0x0af54000, .id = MSM_DP_CONTROLLER_0, .connector_type = DRM_MODE_CONNECTOR_DisplayPort },
++ {}
++};
++
+ static const struct of_device_id dp_dt_match[] = {
+ { .compatible = "qcom,sc7180-dp", .data = &sc7180_dp_descs },
+ { .compatible = "qcom,sc7280-dp", .data = &sc7280_dp_descs },
+@@ -180,6 +185,7 @@ static const struct of_device_id dp_dt_match[] = {
+ { .compatible = "qcom,sc8280xp-edp", .data = &sc8280xp_edp_descs },
+ { .compatible = "qcom,sdm845-dp", .data = &sc7180_dp_descs },
+ { .compatible = "qcom,sm8350-dp", .data = &sm8350_dp_descs },
++ { .compatible = "qcom,sm8650-dp", .data = &sm8650_dp_descs },
+ {}
+ };
+
+--
+2.43.0
+
--- /dev/null
+From 5daaf0f2d978d7cef713472b0284e6bd1be6ed72 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 15:10:58 -0800
+Subject: drm/msm/dpu: Add mutex lock in control vblank irq
+
+From: Paloma Arellano <quic_parellan@quicinc.com>
+
+[ Upstream commit 45284ff733e4caf6c118aae5131eb7e7cf3eea5a ]
+
+Add a mutex lock to control vblank irq to synchronize vblank
+enable/disable operations happening from different threads to prevent
+race conditions while registering/unregistering the vblank irq callback.
+
+v4: -Removed vblank_ctl_lock from dpu_encoder_virt, so it is only a
+ parameter of dpu_encoder_phys.
+ -Switch from atomic refcnt to a simple int counter as mutex has
+ now been added
+v3: Mistakenly did not change wording in last version. It is done now.
+v2: Slightly changed wording of commit message
+
+Signed-off-by: Paloma Arellano <quic_parellan@quicinc.com>
+Reviewed-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Patchwork: https://patchwork.freedesktop.org/patch/571854/
+Link: https://lore.kernel.org/r/20231212231101.9240-2-quic_parellan@quicinc.com
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c | 1 -
+ .../gpu/drm/msm/disp/dpu1/dpu_encoder_phys.h | 4 ++-
+ .../drm/msm/disp/dpu1/dpu_encoder_phys_cmd.c | 32 ++++++++++++------
+ .../drm/msm/disp/dpu1/dpu_encoder_phys_vid.c | 33 ++++++++++++-------
+ 4 files changed, 47 insertions(+), 23 deletions(-)
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+index 0dd95b7ff1f9..b9f0093389a8 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+@@ -2500,7 +2500,6 @@ void dpu_encoder_phys_init(struct dpu_encoder_phys *phys_enc,
+ phys_enc->enc_spinlock = p->enc_spinlock;
+ phys_enc->enable_state = DPU_ENC_DISABLED;
+
+- atomic_set(&phys_enc->vblank_refcount, 0);
+ atomic_set(&phys_enc->pending_kickoff_cnt, 0);
+ atomic_set(&phys_enc->pending_ctlstart_cnt, 0);
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys.h
+index 6f04c3d56e77..96bda57b6959 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys.h
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys.h
+@@ -155,6 +155,7 @@ enum dpu_intr_idx {
+ * @hw_wb: Hardware interface to the wb registers
+ * @dpu_kms: Pointer to the dpu_kms top level
+ * @cached_mode: DRM mode cached at mode_set time, acted on in enable
++ * @vblank_ctl_lock: Vblank ctl mutex lock to protect vblank_refcount
+ * @enabled: Whether the encoder has enabled and running a mode
+ * @split_role: Role to play in a split-panel configuration
+ * @intf_mode: Interface mode
+@@ -183,11 +184,12 @@ struct dpu_encoder_phys {
+ struct dpu_hw_wb *hw_wb;
+ struct dpu_kms *dpu_kms;
+ struct drm_display_mode cached_mode;
++ struct mutex vblank_ctl_lock;
+ enum dpu_enc_split_role split_role;
+ enum dpu_intf_mode intf_mode;
+ spinlock_t *enc_spinlock;
+ enum dpu_enc_enable_state enable_state;
+- atomic_t vblank_refcount;
++ int vblank_refcount;
+ atomic_t vsync_cnt;
+ atomic_t underrun_cnt;
+ atomic_t pending_ctlstart_cnt;
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_cmd.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_cmd.c
+index be185fe69793..2d788c5e26a8 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_cmd.c
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_cmd.c
+@@ -244,7 +244,8 @@ static int dpu_encoder_phys_cmd_control_vblank_irq(
+ return -EINVAL;
+ }
+
+- refcount = atomic_read(&phys_enc->vblank_refcount);
++ mutex_lock(&phys_enc->vblank_ctl_lock);
++ refcount = phys_enc->vblank_refcount;
+
+ /* Slave encoders don't report vblank */
+ if (!dpu_encoder_phys_cmd_is_master(phys_enc))
+@@ -260,16 +261,24 @@ static int dpu_encoder_phys_cmd_control_vblank_irq(
+ phys_enc->hw_pp->idx - PINGPONG_0,
+ enable ? "true" : "false", refcount);
+
+- if (enable && atomic_inc_return(&phys_enc->vblank_refcount) == 1)
+- ret = dpu_core_irq_register_callback(phys_enc->dpu_kms,
+- phys_enc->irq[INTR_IDX_RDPTR],
+- dpu_encoder_phys_cmd_te_rd_ptr_irq,
+- phys_enc);
+- else if (!enable && atomic_dec_return(&phys_enc->vblank_refcount) == 0)
+- ret = dpu_core_irq_unregister_callback(phys_enc->dpu_kms,
+- phys_enc->irq[INTR_IDX_RDPTR]);
++ if (enable) {
++ if (phys_enc->vblank_refcount == 0)
++ ret = dpu_core_irq_register_callback(phys_enc->dpu_kms,
++ phys_enc->irq[INTR_IDX_RDPTR],
++ dpu_encoder_phys_cmd_te_rd_ptr_irq,
++ phys_enc);
++ if (!ret)
++ phys_enc->vblank_refcount++;
++ } else if (!enable) {
++ if (phys_enc->vblank_refcount == 1)
++ ret = dpu_core_irq_unregister_callback(phys_enc->dpu_kms,
++ phys_enc->irq[INTR_IDX_RDPTR]);
++ if (!ret)
++ phys_enc->vblank_refcount--;
++ }
+
+ end:
++ mutex_unlock(&phys_enc->vblank_ctl_lock);
+ if (ret) {
+ DRM_ERROR("vblank irq err id:%u pp:%d ret:%d, enable %s/%d\n",
+ DRMID(phys_enc->parent),
+@@ -285,7 +294,7 @@ static void dpu_encoder_phys_cmd_irq_control(struct dpu_encoder_phys *phys_enc,
+ {
+ trace_dpu_enc_phys_cmd_irq_ctrl(DRMID(phys_enc->parent),
+ phys_enc->hw_pp->idx - PINGPONG_0,
+- enable, atomic_read(&phys_enc->vblank_refcount));
++ enable, phys_enc->vblank_refcount);
+
+ if (enable) {
+ dpu_core_irq_register_callback(phys_enc->dpu_kms,
+@@ -763,6 +772,9 @@ struct dpu_encoder_phys *dpu_encoder_phys_cmd_init(
+
+ dpu_encoder_phys_init(phys_enc, p);
+
++ mutex_init(&phys_enc->vblank_ctl_lock);
++ phys_enc->vblank_refcount = 0;
++
+ dpu_encoder_phys_cmd_init_ops(&phys_enc->ops);
+ phys_enc->intf_mode = INTF_MODE_CMD;
+ cmd_enc->stream_sel = 0;
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_vid.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_vid.c
+index a01fda711883..eeb0acf9665e 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_vid.c
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_vid.c
+@@ -364,7 +364,8 @@ static int dpu_encoder_phys_vid_control_vblank_irq(
+ int ret = 0;
+ int refcount;
+
+- refcount = atomic_read(&phys_enc->vblank_refcount);
++ mutex_lock(&phys_enc->vblank_ctl_lock);
++ refcount = phys_enc->vblank_refcount;
+
+ /* Slave encoders don't report vblank */
+ if (!dpu_encoder_phys_vid_is_master(phys_enc))
+@@ -377,18 +378,26 @@ static int dpu_encoder_phys_vid_control_vblank_irq(
+ }
+
+ DRM_DEBUG_VBL("id:%u enable=%d/%d\n", DRMID(phys_enc->parent), enable,
+- atomic_read(&phys_enc->vblank_refcount));
++ refcount);
+
+- if (enable && atomic_inc_return(&phys_enc->vblank_refcount) == 1)
+- ret = dpu_core_irq_register_callback(phys_enc->dpu_kms,
+- phys_enc->irq[INTR_IDX_VSYNC],
+- dpu_encoder_phys_vid_vblank_irq,
+- phys_enc);
+- else if (!enable && atomic_dec_return(&phys_enc->vblank_refcount) == 0)
+- ret = dpu_core_irq_unregister_callback(phys_enc->dpu_kms,
+- phys_enc->irq[INTR_IDX_VSYNC]);
++ if (enable) {
++ if (phys_enc->vblank_refcount == 0)
++ ret = dpu_core_irq_register_callback(phys_enc->dpu_kms,
++ phys_enc->irq[INTR_IDX_VSYNC],
++ dpu_encoder_phys_vid_vblank_irq,
++ phys_enc);
++ if (!ret)
++ phys_enc->vblank_refcount++;
++ } else if (!enable) {
++ if (phys_enc->vblank_refcount == 1)
++ ret = dpu_core_irq_unregister_callback(phys_enc->dpu_kms,
++ phys_enc->irq[INTR_IDX_VSYNC]);
++ if (!ret)
++ phys_enc->vblank_refcount--;
++ }
+
+ end:
++ mutex_unlock(&phys_enc->vblank_ctl_lock);
+ if (ret) {
+ DRM_ERROR("failed: id:%u intf:%d ret:%d enable:%d refcnt:%d\n",
+ DRMID(phys_enc->parent),
+@@ -618,7 +627,7 @@ static void dpu_encoder_phys_vid_irq_control(struct dpu_encoder_phys *phys_enc,
+ trace_dpu_enc_phys_vid_irq_ctrl(DRMID(phys_enc->parent),
+ phys_enc->hw_intf->idx - INTF_0,
+ enable,
+- atomic_read(&phys_enc->vblank_refcount));
++ phys_enc->vblank_refcount);
+
+ if (enable) {
+ ret = dpu_encoder_phys_vid_control_vblank_irq(phys_enc, true);
+@@ -713,6 +722,8 @@ struct dpu_encoder_phys *dpu_encoder_phys_vid_init(
+ DPU_DEBUG_VIDENC(phys_enc, "\n");
+
+ dpu_encoder_phys_init(phys_enc, p);
++ mutex_init(&phys_enc->vblank_ctl_lock);
++ phys_enc->vblank_refcount = 0;
+
+ dpu_encoder_phys_vid_init_ops(&phys_enc->ops);
+ phys_enc->intf_mode = INTF_MODE_VIDEO;
+--
+2.43.0
+
--- /dev/null
+From 8f6a45c5ba8c5250814e4ca257843e9db0222fae Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 11:21:18 -0800
+Subject: drm/msm/dpu: Correct UBWC settings for sc8280xp
+
+From: Rob Clark <robdclark@chromium.org>
+
+[ Upstream commit 0b414c731432917c83353c446e60ee838c9a9cfd ]
+
+The UBWC settings need to match between the display and GPU. When we
+updated the GPU settings, we forgot to make the corresponding update on
+the display side.
+
+Reported-by: Steev Klimaszewski <steev@kali.org>
+Fixes: 07e6de738aa6 ("drm/msm/a690: Fix reg values for a690")
+Signed-off-by: Rob Clark <robdclark@chromium.org>
+Tested-by: Steev Klimaszewski <steev@kali.org>
+Reviewed-by: Abhinav Kumar <quic_abhinavk@quicinc.com>
+Patchwork: https://patchwork.freedesktop.org/patch/569817/
+Link: https://lore.kernel.org/r/20231130192119.32538-1-robdclark@gmail.com
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/msm_mdss.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/msm/msm_mdss.c b/drivers/gpu/drm/msm/msm_mdss.c
+index 6865db1e3ce8..29bb38f0bb2c 100644
+--- a/drivers/gpu/drm/msm/msm_mdss.c
++++ b/drivers/gpu/drm/msm/msm_mdss.c
+@@ -545,7 +545,7 @@ static const struct msm_mdss_data sc8280xp_data = {
+ .ubwc_dec_version = UBWC_4_0,
+ .ubwc_swizzle = 6,
+ .ubwc_static = 1,
+- .highest_bank_bit = 2,
++ .highest_bank_bit = 3,
+ .macrotile_mode = 1,
+ };
+
+--
+2.43.0
+
--- /dev/null
+From 7c90c2aa4c204b95069cbec04774f6eb14fb9c37 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 3 Dec 2023 03:27:42 +0300
+Subject: drm/msm/dpu: enable writeback on SM8350
+
+From: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+
+[ Upstream commit c2949a49dfe960e952400029e14751dceff79d38 ]
+
+Enable WB2 hardware block, enabling writeback support on this platform.
+
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Reviewed-by: Abhinav Kumar <quic_abhinavk@quicinc.com>
+Patchwork: https://patchwork.freedesktop.org/patch/570188/
+Link: https://lore.kernel.org/r/20231203002743.1291956-3-dmitry.baryshkov@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../drm/msm/disp/dpu1/catalog/dpu_7_0_sm8350.h | 18 ++++++++++++++++++
+ 1 file changed, 18 insertions(+)
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_7_0_sm8350.h b/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_7_0_sm8350.h
+index 1709ba57f384..022b0408c24d 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_7_0_sm8350.h
++++ b/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_7_0_sm8350.h
+@@ -31,6 +31,7 @@ static const struct dpu_mdp_cfg sm8350_mdp = {
+ [DPU_CLK_CTRL_DMA1] = { .reg_off = 0x2b4, .bit_off = 8 },
+ [DPU_CLK_CTRL_DMA2] = { .reg_off = 0x2bc, .bit_off = 8 },
+ [DPU_CLK_CTRL_DMA3] = { .reg_off = 0x2c4, .bit_off = 8 },
++ [DPU_CLK_CTRL_WB2] = { .reg_off = 0x2bc, .bit_off = 16 },
+ [DPU_CLK_CTRL_REG_DMA] = { .reg_off = 0x2bc, .bit_off = 20 },
+ },
+ };
+@@ -298,6 +299,21 @@ static const struct dpu_dsc_cfg sm8350_dsc[] = {
+ },
+ };
+
++static const struct dpu_wb_cfg sm8350_wb[] = {
++ {
++ .name = "wb_2", .id = WB_2,
++ .base = 0x65000, .len = 0x2c8,
++ .features = WB_SM8250_MASK,
++ .format_list = wb2_formats,
++ .num_formats = ARRAY_SIZE(wb2_formats),
++ .clk_ctrl = DPU_CLK_CTRL_WB2,
++ .xin_id = 6,
++ .vbif_idx = VBIF_RT,
++ .maxlinewidth = 4096,
++ .intr_wb_done = DPU_IRQ_IDX(MDP_SSPP_TOP0_INTR, 4),
++ },
++};
++
+ static const struct dpu_intf_cfg sm8350_intf[] = {
+ {
+ .name = "intf_0", .id = INTF_0,
+@@ -393,6 +409,8 @@ const struct dpu_mdss_cfg dpu_sm8350_cfg = {
+ .dsc = sm8350_dsc,
+ .merge_3d_count = ARRAY_SIZE(sm8350_merge_3d),
+ .merge_3d = sm8350_merge_3d,
++ .wb_count = ARRAY_SIZE(sm8350_wb),
++ .wb = sm8350_wb,
+ .intf_count = ARRAY_SIZE(sm8350_intf),
+ .intf = sm8350_intf,
+ .vbif_count = ARRAY_SIZE(sdm845_vbif),
+--
+2.43.0
+
--- /dev/null
+From a1e9474bc7b16a83dbb4e189f3695ca166a47b8e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 3 Dec 2023 03:27:43 +0300
+Subject: drm/msm/dpu: enable writeback on SM8450
+
+From: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+
+[ Upstream commit eaa647cdbf2e357b4a14903f2f1e47ed9c4f8df3 ]
+
+Enable WB2 hardware block, enabling writeback support on this platform.
+
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Reviewed-by: Abhinav Kumar <quic_abhinavk@quicinc.com>
+Patchwork: https://patchwork.freedesktop.org/patch/570187/
+Link: https://lore.kernel.org/r/20231203002743.1291956-4-dmitry.baryshkov@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../drm/msm/disp/dpu1/catalog/dpu_8_1_sm8450.h | 18 ++++++++++++++++++
+ 1 file changed, 18 insertions(+)
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_8_1_sm8450.h b/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_8_1_sm8450.h
+index 72b0f547242f..7adc42257e1e 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_8_1_sm8450.h
++++ b/drivers/gpu/drm/msm/disp/dpu1/catalog/dpu_8_1_sm8450.h
+@@ -32,6 +32,7 @@ static const struct dpu_mdp_cfg sm8450_mdp = {
+ [DPU_CLK_CTRL_DMA1] = { .reg_off = 0x2b4, .bit_off = 8 },
+ [DPU_CLK_CTRL_DMA2] = { .reg_off = 0x2bc, .bit_off = 8 },
+ [DPU_CLK_CTRL_DMA3] = { .reg_off = 0x2c4, .bit_off = 8 },
++ [DPU_CLK_CTRL_WB2] = { .reg_off = 0x2bc, .bit_off = 16 },
+ [DPU_CLK_CTRL_REG_DMA] = { .reg_off = 0x2bc, .bit_off = 20 },
+ },
+ };
+@@ -316,6 +317,21 @@ static const struct dpu_dsc_cfg sm8450_dsc[] = {
+ },
+ };
+
++static const struct dpu_wb_cfg sm8450_wb[] = {
++ {
++ .name = "wb_2", .id = WB_2,
++ .base = 0x65000, .len = 0x2c8,
++ .features = WB_SM8250_MASK,
++ .format_list = wb2_formats,
++ .num_formats = ARRAY_SIZE(wb2_formats),
++ .clk_ctrl = DPU_CLK_CTRL_WB2,
++ .xin_id = 6,
++ .vbif_idx = VBIF_RT,
++ .maxlinewidth = 4096,
++ .intr_wb_done = DPU_IRQ_IDX(MDP_SSPP_TOP0_INTR, 4),
++ },
++};
++
+ static const struct dpu_intf_cfg sm8450_intf[] = {
+ {
+ .name = "intf_0", .id = INTF_0,
+@@ -411,6 +427,8 @@ const struct dpu_mdss_cfg dpu_sm8450_cfg = {
+ .dsc = sm8450_dsc,
+ .merge_3d_count = ARRAY_SIZE(sm8450_merge_3d),
+ .merge_3d = sm8450_merge_3d,
++ .wb_count = ARRAY_SIZE(sm8450_wb),
++ .wb = sm8450_wb,
+ .intf_count = ARRAY_SIZE(sm8450_intf),
+ .intf = sm8450_intf,
+ .vbif_count = ARRAY_SIZE(sdm845_vbif),
+--
+2.43.0
+
--- /dev/null
+From d6948a992fd29bf83c63531d6fd468619d3f8a27 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 12:52:41 -0800
+Subject: drm/msm/dpu: fix writeback programming for YUV cases
+
+From: Abhinav Kumar <quic_abhinavk@quicinc.com>
+
+[ Upstream commit 79caf2f2202b9eaad3a5a726e4b33807f67d0f1b ]
+
+For YUV cases, setting the required format bits was missed
+out in the register programming. Lets fix it now in preparation
+of adding YUV formats support for writeback.
+
+changes in v2:
+ - dropped the fixes tag as its not a fix but adding
+ new functionality
+
+Signed-off-by: Abhinav Kumar <quic_abhinavk@quicinc.com>
+Reviewed-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Patchwork: https://patchwork.freedesktop.org/patch/571814/
+Link: https://lore.kernel.org/r/20231212205254.12422-4-quic_abhinavk@quicinc.com
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/disp/dpu1/dpu_hw_wb.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_wb.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_wb.c
+index 9668fb97c047..d49b3ef7689e 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_wb.c
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_wb.c
+@@ -87,6 +87,9 @@ static void dpu_hw_wb_setup_format(struct dpu_hw_wb *ctx,
+ dst_format |= BIT(14); /* DST_ALPHA_X */
+ }
+
++ if (DPU_FORMAT_IS_YUV(fmt))
++ dst_format |= BIT(15);
++
+ pattern = (fmt->element[3] << 24) |
+ (fmt->element[2] << 16) |
+ (fmt->element[1] << 8) |
+--
+2.43.0
+
--- /dev/null
+From b86a7b1be7eec4967e89528404ca9f39187d90d3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 10:19:55 -0800
+Subject: drm/msm/dpu: Ratelimit framedone timeout msgs
+
+From: Rob Clark <robdclark@chromium.org>
+
+[ Upstream commit 2b72e50c62de60ad2d6bcd86aa38d4ccbdd633f2 ]
+
+When we start getting these, we get a *lot*. So ratelimit it to not
+flood dmesg.
+
+Signed-off-by: Rob Clark <robdclark@chromium.org>
+Reviewed-by: Abhinav Kumar <quic_abhinavk@quicinc.com>
+Reviewed-by: Marijn Suijten <marijn.suijten@somainline.org>
+Patchwork: https://patchwork.freedesktop.org/patch/571584/
+Link: https://lore.kernel.org/r/20231211182000.218088-1-robdclark@gmail.com
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c | 5 ++++-
+ drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h | 1 +
+ 2 files changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+index 5dbb5d27bbea..0dd95b7ff1f9 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+@@ -39,6 +39,9 @@
+ #define DPU_ERROR_ENC(e, fmt, ...) DPU_ERROR("enc%d " fmt,\
+ (e) ? (e)->base.base.id : -1, ##__VA_ARGS__)
+
++#define DPU_ERROR_ENC_RATELIMITED(e, fmt, ...) DPU_ERROR_RATELIMITED("enc%d " fmt,\
++ (e) ? (e)->base.base.id : -1, ##__VA_ARGS__)
++
+ /*
+ * Two to anticipate panels that can do cmd/vid dynamic switching
+ * plan is to create all possible physical encoder types, and switch between
+@@ -2339,7 +2342,7 @@ static void dpu_encoder_frame_done_timeout(struct timer_list *t)
+ return;
+ }
+
+- DPU_ERROR_ENC(dpu_enc, "frame done timeout\n");
++ DPU_ERROR_ENC_RATELIMITED(dpu_enc, "frame done timeout\n");
+
+ event = DPU_ENCODER_FRAME_EVENT_ERROR;
+ trace_dpu_enc_frame_done_timeout(DRMID(drm_enc), event);
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h
+index b6f53ca6e962..f5473d4dea92 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h
+@@ -51,6 +51,7 @@
+ } while (0)
+
+ #define DPU_ERROR(fmt, ...) pr_err("[dpu error]" fmt, ##__VA_ARGS__)
++#define DPU_ERROR_RATELIMITED(fmt, ...) pr_err_ratelimited("[dpu error]" fmt, ##__VA_ARGS__)
+
+ /**
+ * ktime_compare_safe - compare two ktime structures
+--
+2.43.0
+
--- /dev/null
+From a46b549a7f7b2a74938f06ee96a006f66c574e78 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 17 Nov 2023 13:46:32 -0800
+Subject: drm/panel-edp: Add override_edid_mode quirk for generic edp
+
+From: Hsin-Yi Wang <hsinyi@chromium.org>
+
+[ Upstream commit 9f7843b515811aea6c56527eb195b622e9c01f12 ]
+
+Generic edp gets mode from edid. However, some panels report incorrect
+mode in this way, resulting in glitches on panel. Introduce a new quirk
+additional_mode to the generic edid to pick a correct hardcoded mode.
+
+Signed-off-by: Hsin-Yi Wang <hsinyi@chromium.org>
+Reviewed-by: Douglas Anderson <dianders@chromium.org>
+Signed-off-by: Douglas Anderson <dianders@chromium.org>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231117215056.1883314-2-hsinyi@chromium.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/panel/panel-edp.c | 48 +++++++++++++++++++++++++++++--
+ 1 file changed, 45 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/gpu/drm/panel/panel-edp.c b/drivers/gpu/drm/panel/panel-edp.c
+index 7dc6fb7308ce..cba5a93e6082 100644
+--- a/drivers/gpu/drm/panel/panel-edp.c
++++ b/drivers/gpu/drm/panel/panel-edp.c
+@@ -203,6 +203,9 @@ struct edp_panel_entry {
+
+ /** @name: Name of this panel (for printing to logs). */
+ const char *name;
++
++ /** @override_edid_mode: Override the mode obtained by edid. */
++ const struct drm_display_mode *override_edid_mode;
+ };
+
+ struct panel_edp {
+@@ -301,6 +304,24 @@ static unsigned int panel_edp_get_display_modes(struct panel_edp *panel,
+ return num;
+ }
+
++static int panel_edp_override_edid_mode(struct panel_edp *panel,
++ struct drm_connector *connector,
++ const struct drm_display_mode *override_mode)
++{
++ struct drm_display_mode *mode;
++
++ mode = drm_mode_duplicate(connector->dev, override_mode);
++ if (!mode) {
++ dev_err(panel->base.dev, "failed to add additional mode\n");
++ return 0;
++ }
++
++ mode->type |= DRM_MODE_TYPE_DRIVER | DRM_MODE_TYPE_PREFERRED;
++ drm_mode_set_name(mode);
++ drm_mode_probed_add(connector, mode);
++ return 1;
++}
++
+ static int panel_edp_get_non_edid_modes(struct panel_edp *panel,
+ struct drm_connector *connector)
+ {
+@@ -568,6 +589,9 @@ static int panel_edp_get_modes(struct drm_panel *panel,
+ {
+ struct panel_edp *p = to_panel_edp(panel);
+ int num = 0;
++ bool has_override_edid_mode = p->detected_panel &&
++ p->detected_panel != ERR_PTR(-EINVAL) &&
++ p->detected_panel->override_edid_mode;
+
+ /* probe EDID if a DDC bus is available */
+ if (p->ddc) {
+@@ -575,9 +599,18 @@ static int panel_edp_get_modes(struct drm_panel *panel,
+
+ if (!p->edid)
+ p->edid = drm_get_edid(connector, p->ddc);
+-
+- if (p->edid)
+- num += drm_add_edid_modes(connector, p->edid);
++ if (p->edid) {
++ if (has_override_edid_mode) {
++ /*
++ * override_edid_mode is specified. Use
++ * override_edid_mode instead of from edid.
++ */
++ num += panel_edp_override_edid_mode(p, connector,
++ p->detected_panel->override_edid_mode);
++ } else {
++ num += drm_add_edid_modes(connector, p->edid);
++ }
++ }
+
+ pm_runtime_mark_last_busy(panel->dev);
+ pm_runtime_put_autosuspend(panel->dev);
+@@ -1830,6 +1863,15 @@ static const struct panel_delay delay_200_500_e200 = {
+ .delay = _delay \
+ }
+
++#define EDP_PANEL_ENTRY2(vend_chr_0, vend_chr_1, vend_chr_2, product_id, _delay, _name, _mode) \
++{ \
++ .name = _name, \
++ .panel_id = drm_edid_encode_panel_id(vend_chr_0, vend_chr_1, vend_chr_2, \
++ product_id), \
++ .delay = _delay, \
++ .override_edid_mode = _mode \
++}
++
+ /*
+ * This table is used to figure out power sequencing delays for panels that
+ * are detected by EDID. Entries here may point to entries in the
+--
+2.43.0
+
--- /dev/null
+From 41673d6ebfd3ff53e44f927c5db74edb5baeae2f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 14:57:34 +1100
+Subject: drm: using mul_u32_u32() requires linux/math64.h
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Stephen Rothwell <sfr@canb.auug.org.au>
+
+[ Upstream commit 933a2a376fb3f22ba4774f74233571504ac56b02 ]
+
+Some pending include file cleanups produced this error:
+
+In file included from include/linux/kernel.h:27,
+ from drivers/gpu/ipu-v3/ipu-dp.c:7:
+include/drm/drm_color_mgmt.h: In function 'drm_color_lut_extract':
+include/drm/drm_color_mgmt.h:45:46: error: implicit declaration of function 'mul_u32_u32' [-Werror=implicit-function-declaration]
+ 45 | return DIV_ROUND_CLOSEST_ULL(mul_u32_u32(user_input, (1 << bit_precision) - 1),
+ | ^~~~~~~~~~~
+
+Fixes: c6fbb6bca108 ("drm: Fix color LUT rounding")
+Signed-off-by: Stephen Rothwell <sfr@canb.auug.org.au>
+Signed-off-by: Ville Syrjälä <ville.syrjala@linux.intel.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231219145734.13e40e1e@canb.auug.org.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/drm/drm_color_mgmt.h | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/include/drm/drm_color_mgmt.h b/include/drm/drm_color_mgmt.h
+index 54b2b2467bfd..ed81741036d7 100644
+--- a/include/drm/drm_color_mgmt.h
++++ b/include/drm/drm_color_mgmt.h
+@@ -24,6 +24,7 @@
+ #define __DRM_COLOR_MGMT_H__
+
+ #include <linux/ctype.h>
++#include <linux/math64.h>
+ #include <drm/drm_property.h>
+
+ struct drm_crtc;
+--
+2.43.0
+
--- /dev/null
+From 2ea9b2618c2f3c46dcf9daabb474bab5ea178f6b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 11 Aug 2023 14:38:12 -0400
+Subject: ecryptfs: Reject casefold directory inodes
+
+From: Gabriel Krisman Bertazi <krisman@suse.de>
+
+[ Upstream commit cd72c7ef5fed44272272a105b1da22810c91be69 ]
+
+Even though it seems to be able to resolve some names of
+case-insensitive directories, the lack of d_hash and d_compare means we
+end up with a broken state in the d_cache. Considering it was never a
+goal to support these two together, and we are preparing to use
+d_revalidate in case-insensitive filesystems, which would make the
+combination even more broken, reject any attempt to get a casefolded
+inode from ecryptfs.
+
+Signed-off-by: Gabriel Krisman Bertazi <krisman@suse.de>
+Reviewed-by: Eric Biggers <ebiggers@google.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ecryptfs/inode.c | 8 ++++++++
+ 1 file changed, 8 insertions(+)
+
+diff --git a/fs/ecryptfs/inode.c b/fs/ecryptfs/inode.c
+index b0e8774c435a..d7193687b9b4 100644
+--- a/fs/ecryptfs/inode.c
++++ b/fs/ecryptfs/inode.c
+@@ -78,6 +78,14 @@ static struct inode *__ecryptfs_get_inode(struct inode *lower_inode,
+
+ if (lower_inode->i_sb != ecryptfs_superblock_to_lower(sb))
+ return ERR_PTR(-EXDEV);
++
++ /* Reject dealing with casefold directories. */
++ if (IS_CASEFOLDED(lower_inode)) {
++ pr_err_ratelimited("%s: Can't handle casefolded directory.\n",
++ __func__);
++ return ERR_PTR(-EREMOTE);
++ }
++
+ if (!igrab(lower_inode))
+ return ERR_PTR(-ESTALE);
+ inode = iget5_locked(sb, (unsigned long)lower_inode,
+--
+2.43.0
+
--- /dev/null
+From 8c89ad52802449d9abc85874c39b69e6a911504d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 11:48:52 +0100
+Subject: energy_model: Use a fixed reference frequency
+
+From: Vincent Guittot <vincent.guittot@linaro.org>
+
+[ Upstream commit 15cbbd1d317e07b4e5c6aca5d4c5579539a82784 ]
+
+The last item of a performance domain is not always the performance point
+that has been used to compute CPU's capacity. This can lead to different
+target frequency compared with other part of the system like schedutil and
+would result in wrong energy estimation.
+
+A new arch_scale_freq_ref() is available to return a fixed and coherent
+frequency reference that can be used when computing the CPU's frequency
+for an level of utilization. Use this function to get this reference
+frequency.
+
+Energy model is never used without defining arch_scale_freq_ref() but
+can be compiled. Define a default arch_scale_freq_ref() returning 0
+in such case.
+
+Signed-off-by: Vincent Guittot <vincent.guittot@linaro.org>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Tested-by: Lukasz Luba <lukasz.luba@arm.com>
+Reviewed-by: Lukasz Luba <lukasz.luba@arm.com>
+Link: https://lore.kernel.org/r/20231211104855.558096-5-vincent.guittot@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/linux/energy_model.h | 6 +++---
+ 1 file changed, 3 insertions(+), 3 deletions(-)
+
+diff --git a/include/linux/energy_model.h b/include/linux/energy_model.h
+index b9caa01dfac4..c19e7effe764 100644
+--- a/include/linux/energy_model.h
++++ b/include/linux/energy_model.h
+@@ -224,7 +224,7 @@ static inline unsigned long em_cpu_energy(struct em_perf_domain *pd,
+ unsigned long max_util, unsigned long sum_util,
+ unsigned long allowed_cpu_cap)
+ {
+- unsigned long freq, scale_cpu;
++ unsigned long freq, ref_freq, scale_cpu;
+ struct em_perf_state *ps;
+ int cpu;
+
+@@ -241,11 +241,11 @@ static inline unsigned long em_cpu_energy(struct em_perf_domain *pd,
+ */
+ cpu = cpumask_first(to_cpumask(pd->cpus));
+ scale_cpu = arch_scale_cpu_capacity(cpu);
+- ps = &pd->table[pd->nr_perf_states - 1];
++ ref_freq = arch_scale_freq_ref(cpu);
+
+ max_util = map_util_perf(max_util);
+ max_util = min(max_util, allowed_cpu_cap);
+- freq = map_util_freq(max_util, ps->frequency, scale_cpu);
++ freq = map_util_freq(max_util, ref_freq, scale_cpu);
+
+ /*
+ * Find the lowest performance state of the Energy Model above the
+--
+2.43.0
+
--- /dev/null
+From dc4d56966240a2683c75ff803eb940346271e05e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:10:55 +0800
+Subject: erofs: fix up compacted indexes for block size < 4096
+
+From: Gao Xiang <hsiangkao@linux.alibaba.com>
+
+[ Upstream commit 8d2517aaeea3ab8651bb517bca8f3c8664d318ea ]
+
+Previously, the block size always equaled to PAGE_SIZE, therefore
+`lclusterbits` couldn't be less than 12.
+
+Since sub-page compressed blocks are now considered, `lobits` for
+a lcluster in each pack cannot always be `lclusterbits` as before.
+Otherwise, there is no enough room for the special value
+`Z_EROFS_LI_D0_CBLKCNT`.
+
+To support smaller block sizes, `lobits` for each compacted lcluster is
+now calculated as:
+ lobits = max(lclusterbits, ilog2(Z_EROFS_LI_D0_CBLKCNT) + 1)
+
+Reviewed-by: Yue Hu <huyue2@coolpad.com>
+Reviewed-by: Chao Yu <chao@kernel.org>
+Signed-off-by: Gao Xiang <hsiangkao@linux.alibaba.com>
+Link: https://lore.kernel.org/r/20231206091057.87027-4-hsiangkao@linux.alibaba.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/erofs/zmap.c | 32 ++++++++++++++------------------
+ 1 file changed, 14 insertions(+), 18 deletions(-)
+
+diff --git a/fs/erofs/zmap.c b/fs/erofs/zmap.c
+index 7a1a24ae4a2d..e313c936351d 100644
+--- a/fs/erofs/zmap.c
++++ b/fs/erofs/zmap.c
+@@ -82,29 +82,26 @@ static int z_erofs_load_full_lcluster(struct z_erofs_maprecorder *m,
+ }
+
+ static unsigned int decode_compactedbits(unsigned int lobits,
+- unsigned int lomask,
+ u8 *in, unsigned int pos, u8 *type)
+ {
+ const unsigned int v = get_unaligned_le32(in + pos / 8) >> (pos & 7);
+- const unsigned int lo = v & lomask;
++ const unsigned int lo = v & ((1 << lobits) - 1);
+
+ *type = (v >> lobits) & 3;
+ return lo;
+ }
+
+-static int get_compacted_la_distance(unsigned int lclusterbits,
++static int get_compacted_la_distance(unsigned int lobits,
+ unsigned int encodebits,
+ unsigned int vcnt, u8 *in, int i)
+ {
+- const unsigned int lomask = (1 << lclusterbits) - 1;
+ unsigned int lo, d1 = 0;
+ u8 type;
+
+ DBG_BUGON(i >= vcnt);
+
+ do {
+- lo = decode_compactedbits(lclusterbits, lomask,
+- in, encodebits * i, &type);
++ lo = decode_compactedbits(lobits, in, encodebits * i, &type);
+
+ if (type != Z_EROFS_LCLUSTER_TYPE_NONHEAD)
+ return d1;
+@@ -123,15 +120,14 @@ static int unpack_compacted_index(struct z_erofs_maprecorder *m,
+ {
+ struct erofs_inode *const vi = EROFS_I(m->inode);
+ const unsigned int lclusterbits = vi->z_logical_clusterbits;
+- const unsigned int lomask = (1 << lclusterbits) - 1;
+- unsigned int vcnt, base, lo, encodebits, nblk, eofs;
++ unsigned int vcnt, base, lo, lobits, encodebits, nblk, eofs;
+ int i;
+ u8 *in, type;
+ bool big_pcluster;
+
+ if (1 << amortizedshift == 4 && lclusterbits <= 14)
+ vcnt = 2;
+- else if (1 << amortizedshift == 2 && lclusterbits == 12)
++ else if (1 << amortizedshift == 2 && lclusterbits <= 12)
+ vcnt = 16;
+ else
+ return -EOPNOTSUPP;
+@@ -140,6 +136,7 @@ static int unpack_compacted_index(struct z_erofs_maprecorder *m,
+ m->nextpackoff = round_down(pos, vcnt << amortizedshift) +
+ (vcnt << amortizedshift);
+ big_pcluster = vi->z_advise & Z_EROFS_ADVISE_BIG_PCLUSTER_1;
++ lobits = max(lclusterbits, ilog2(Z_EROFS_LI_D0_CBLKCNT) + 1U);
+ encodebits = ((vcnt << amortizedshift) - sizeof(__le32)) * 8 / vcnt;
+ eofs = erofs_blkoff(m->inode->i_sb, pos);
+ base = round_down(eofs, vcnt << amortizedshift);
+@@ -147,15 +144,14 @@ static int unpack_compacted_index(struct z_erofs_maprecorder *m,
+
+ i = (eofs - base) >> amortizedshift;
+
+- lo = decode_compactedbits(lclusterbits, lomask,
+- in, encodebits * i, &type);
++ lo = decode_compactedbits(lobits, in, encodebits * i, &type);
+ m->type = type;
+ if (type == Z_EROFS_LCLUSTER_TYPE_NONHEAD) {
+ m->clusterofs = 1 << lclusterbits;
+
+ /* figure out lookahead_distance: delta[1] if needed */
+ if (lookahead)
+- m->delta[1] = get_compacted_la_distance(lclusterbits,
++ m->delta[1] = get_compacted_la_distance(lobits,
+ encodebits, vcnt, in, i);
+ if (lo & Z_EROFS_LI_D0_CBLKCNT) {
+ if (!big_pcluster) {
+@@ -174,8 +170,8 @@ static int unpack_compacted_index(struct z_erofs_maprecorder *m,
+ * of which lo saves delta[1] rather than delta[0].
+ * Hence, get delta[0] by the previous lcluster indirectly.
+ */
+- lo = decode_compactedbits(lclusterbits, lomask,
+- in, encodebits * (i - 1), &type);
++ lo = decode_compactedbits(lobits, in,
++ encodebits * (i - 1), &type);
+ if (type != Z_EROFS_LCLUSTER_TYPE_NONHEAD)
+ lo = 0;
+ else if (lo & Z_EROFS_LI_D0_CBLKCNT)
+@@ -190,8 +186,8 @@ static int unpack_compacted_index(struct z_erofs_maprecorder *m,
+ nblk = 1;
+ while (i > 0) {
+ --i;
+- lo = decode_compactedbits(lclusterbits, lomask,
+- in, encodebits * i, &type);
++ lo = decode_compactedbits(lobits, in,
++ encodebits * i, &type);
+ if (type == Z_EROFS_LCLUSTER_TYPE_NONHEAD)
+ i -= lo;
+
+@@ -202,8 +198,8 @@ static int unpack_compacted_index(struct z_erofs_maprecorder *m,
+ nblk = 0;
+ while (i > 0) {
+ --i;
+- lo = decode_compactedbits(lclusterbits, lomask,
+- in, encodebits * i, &type);
++ lo = decode_compactedbits(lobits, in,
++ encodebits * i, &type);
+ if (type == Z_EROFS_LCLUSTER_TYPE_NONHEAD) {
+ if (lo & Z_EROFS_LI_D0_CBLKCNT) {
+ --i;
+--
+2.43.0
+
--- /dev/null
+From 5d9427b0b6754265419ea245fbc5cb44d0e5d640 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 00:13:37 +0800
+Subject: erofs: fix ztailpacking for subpage compressed blocks
+
+From: Gao Xiang <hsiangkao@linux.alibaba.com>
+
+[ Upstream commit e5aba911dee5e20fa82efbe13e0af8f38ea459e7 ]
+
+`pageofs_in` should be the compressed data offset of the page rather
+than of the block.
+
+Acked-by: Chao Yu <chao@kernel.org>
+Reviewed-by: Yue Hu <huyue2@coolpad.com>
+Signed-off-by: Gao Xiang <hsiangkao@linux.alibaba.com>
+Link: https://lore.kernel.org/r/20231214161337.753049-1-hsiangkao@linux.alibaba.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/erofs/zdata.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/fs/erofs/zdata.c b/fs/erofs/zdata.c
+index a33cd6757f98..1c0e6167d8e7 100644
+--- a/fs/erofs/zdata.c
++++ b/fs/erofs/zdata.c
+@@ -815,7 +815,6 @@ static int z_erofs_register_pcluster(struct z_erofs_decompress_frontend *fe)
+
+ if (ztailpacking) {
+ pcl->obj.index = 0; /* which indicates ztailpacking */
+- pcl->pageofs_in = erofs_blkoff(fe->inode->i_sb, map->m_pa);
+ pcl->tailpacking_size = map->m_plen;
+ } else {
+ pcl->obj.index = map->m_pa >> PAGE_SHIFT;
+@@ -893,6 +892,7 @@ static int z_erofs_pcluster_begin(struct z_erofs_decompress_frontend *fe)
+ }
+ get_page(map->buf.page);
+ WRITE_ONCE(fe->pcl->compressed_bvecs[0].page, map->buf.page);
++ fe->pcl->pageofs_in = map->m_pa & ~PAGE_MASK;
+ fe->mode = Z_EROFS_PCLUSTER_FOLLOWED_NOINPLACE;
+ }
+ /* file-backed inplace I/O pages are traversed in reverse order */
+--
+2.43.0
+
--- /dev/null
+From b6806533fc190afd4246f1968e10a454d286a16a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 23 Oct 2023 09:30:56 +0800
+Subject: ext4: avoid online resizing failures due to oversized flex bg
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Baokun Li <libaokun1@huawei.com>
+
+[ Upstream commit 5d1935ac02ca5aee364a449a35e2977ea84509b0 ]
+
+When we online resize an ext4 filesystem with a oversized flexbg_size,
+
+ mkfs.ext4 -F -G 67108864 $dev -b 4096 100M
+ mount $dev $dir
+ resize2fs $dev 16G
+
+the following WARN_ON is triggered:
+==================================================================
+WARNING: CPU: 0 PID: 427 at mm/page_alloc.c:4402 __alloc_pages+0x411/0x550
+Modules linked in: sg(E)
+CPU: 0 PID: 427 Comm: resize2fs Tainted: G E 6.6.0-rc5+ #314
+RIP: 0010:__alloc_pages+0x411/0x550
+Call Trace:
+ <TASK>
+ __kmalloc_large_node+0xa2/0x200
+ __kmalloc+0x16e/0x290
+ ext4_resize_fs+0x481/0xd80
+ __ext4_ioctl+0x1616/0x1d90
+ ext4_ioctl+0x12/0x20
+ __x64_sys_ioctl+0xf0/0x150
+ do_syscall_64+0x3b/0x90
+==================================================================
+
+This is because flexbg_size is too large and the size of the new_group_data
+array to be allocated exceeds MAX_ORDER. Currently, the minimum value of
+MAX_ORDER is 8, the minimum value of PAGE_SIZE is 4096, the corresponding
+maximum number of groups that can be allocated is:
+
+ (PAGE_SIZE << MAX_ORDER) / sizeof(struct ext4_new_group_data) ≈ 21845
+
+And the value that is down-aligned to the power of 2 is 16384. Therefore,
+this value is defined as MAX_RESIZE_BG, and the number of groups added
+each time does not exceed this value during resizing, and is added multiple
+times to complete the online resizing. The difference is that the metadata
+in a flex_bg may be more dispersed.
+
+Signed-off-by: Baokun Li <libaokun1@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231023013057.2117948-4-libaokun1@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/resize.c | 25 +++++++++++++++++--------
+ 1 file changed, 17 insertions(+), 8 deletions(-)
+
+diff --git a/fs/ext4/resize.c b/fs/ext4/resize.c
+index 0a57b199883c..e168a9f59600 100644
+--- a/fs/ext4/resize.c
++++ b/fs/ext4/resize.c
+@@ -218,10 +218,17 @@ struct ext4_new_flex_group_data {
+ in the flex group */
+ __u16 *bg_flags; /* block group flags of groups
+ in @groups */
++ ext4_group_t resize_bg; /* number of allocated
++ new_group_data */
+ ext4_group_t count; /* number of groups in @groups
+ */
+ };
+
++/*
++ * Avoiding memory allocation failures due to too many groups added each time.
++ */
++#define MAX_RESIZE_BG 16384
++
+ /*
+ * alloc_flex_gd() allocates a ext4_new_flex_group_data with size of
+ * @flexbg_size.
+@@ -236,14 +243,18 @@ static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned int flexbg_size)
+ if (flex_gd == NULL)
+ goto out3;
+
+- flex_gd->count = flexbg_size;
+- flex_gd->groups = kmalloc_array(flexbg_size,
++ if (unlikely(flexbg_size > MAX_RESIZE_BG))
++ flex_gd->resize_bg = MAX_RESIZE_BG;
++ else
++ flex_gd->resize_bg = flexbg_size;
++
++ flex_gd->groups = kmalloc_array(flex_gd->resize_bg,
+ sizeof(struct ext4_new_group_data),
+ GFP_NOFS);
+ if (flex_gd->groups == NULL)
+ goto out2;
+
+- flex_gd->bg_flags = kmalloc_array(flexbg_size, sizeof(__u16),
++ flex_gd->bg_flags = kmalloc_array(flex_gd->resize_bg, sizeof(__u16),
+ GFP_NOFS);
+ if (flex_gd->bg_flags == NULL)
+ goto out1;
+@@ -1602,8 +1613,7 @@ static int ext4_flex_group_add(struct super_block *sb,
+
+ static int ext4_setup_next_flex_gd(struct super_block *sb,
+ struct ext4_new_flex_group_data *flex_gd,
+- ext4_fsblk_t n_blocks_count,
+- unsigned int flexbg_size)
++ ext4_fsblk_t n_blocks_count)
+ {
+ struct ext4_sb_info *sbi = EXT4_SB(sb);
+ struct ext4_super_block *es = sbi->s_es;
+@@ -1627,7 +1637,7 @@ static int ext4_setup_next_flex_gd(struct super_block *sb,
+ BUG_ON(last);
+ ext4_get_group_no_and_offset(sb, n_blocks_count - 1, &n_group, &last);
+
+- last_group = group | (flexbg_size - 1);
++ last_group = group | (flex_gd->resize_bg - 1);
+ if (last_group > n_group)
+ last_group = n_group;
+
+@@ -2130,8 +2140,7 @@ int ext4_resize_fs(struct super_block *sb, ext4_fsblk_t n_blocks_count)
+ /* Add flex groups. Note that a regular group is a
+ * flex group with 1 group.
+ */
+- while (ext4_setup_next_flex_gd(sb, flex_gd, n_blocks_count,
+- flexbg_size)) {
++ while (ext4_setup_next_flex_gd(sb, flex_gd, n_blocks_count)) {
+ if (time_is_before_jiffies(last_update_time + HZ * 10)) {
+ if (last_update_time)
+ ext4_msg(sb, KERN_INFO,
+--
+2.43.0
+
--- /dev/null
+From a2576813333b3051698e9432dc85bb8747d0f1cc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 16 Dec 2023 09:09:19 +0800
+Subject: ext4: fix inconsistent between segment fstrim and full fstrim
+
+From: Ye Bin <yebin10@huawei.com>
+
+[ Upstream commit 68da4c44b994aea797eb9821acb3a4a36015293e ]
+
+Suppose we issue two FITRIM ioctls for ranges [0,15] and [16,31] with
+mininum length of trimmed range set to 8 blocks. If we have say a range of
+blocks 10-22 free, this range will not be trimmed because it straddles the
+boundary of the two FITRIM ranges and neither part is big enough. This is a
+bit surprising to some users that call FITRIM on smaller ranges of blocks
+to limit impact on the system. Also XFS trims all free space extents that
+overlap with the specified range so we are inconsistent among filesystems.
+Let's change ext4_try_to_trim_range() to consider for trimming the whole
+free space extent that straddles the end of specified range, not just the
+part of it within the range.
+
+Signed-off-by: Ye Bin <yebin10@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231216010919.1995851-1-yebin10@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/mballoc.c | 11 ++++++++---
+ 1 file changed, 8 insertions(+), 3 deletions(-)
+
+diff --git a/fs/ext4/mballoc.c b/fs/ext4/mballoc.c
+index ab023d709f72..8408318e1d32 100644
+--- a/fs/ext4/mballoc.c
++++ b/fs/ext4/mballoc.c
+@@ -6758,13 +6758,15 @@ static int ext4_try_to_trim_range(struct super_block *sb,
+ __acquires(ext4_group_lock_ptr(sb, e4b->bd_group))
+ __releases(ext4_group_lock_ptr(sb, e4b->bd_group))
+ {
+- ext4_grpblk_t next, count, free_count;
++ ext4_grpblk_t next, count, free_count, last, origin_start;
+ bool set_trimmed = false;
+ void *bitmap;
+
++ last = ext4_last_grp_cluster(sb, e4b->bd_group);
+ bitmap = e4b->bd_bitmap;
+- if (start == 0 && max >= ext4_last_grp_cluster(sb, e4b->bd_group))
++ if (start == 0 && max >= last)
+ set_trimmed = true;
++ origin_start = start;
+ start = max(e4b->bd_info->bb_first_free, start);
+ count = 0;
+ free_count = 0;
+@@ -6773,7 +6775,10 @@ __releases(ext4_group_lock_ptr(sb, e4b->bd_group))
+ start = mb_find_next_zero_bit(bitmap, max + 1, start);
+ if (start > max)
+ break;
+- next = mb_find_next_bit(bitmap, max + 1, start);
++
++ next = mb_find_next_bit(bitmap, last + 1, start);
++ if (origin_start == 0 && next >= last)
++ set_trimmed = true;
+
+ if ((next - start) >= minblocks) {
+ int ret = ext4_trim_extent(sb, start, next - start, e4b);
+--
+2.43.0
+
--- /dev/null
+From cb0346513a02360d30f132ccf5e87341f83fb4a7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 23 Oct 2023 09:30:55 +0800
+Subject: ext4: remove unnecessary check from alloc_flex_gd()
+
+From: Baokun Li <libaokun1@huawei.com>
+
+[ Upstream commit b099eb87de105cf07cad731ded6fb40b2675108b ]
+
+In commit 967ac8af4475 ("ext4: fix potential integer overflow in
+alloc_flex_gd()"), an overflow check is added to alloc_flex_gd() to
+prevent the allocated memory from being smaller than expected due to
+the overflow. However, after kmalloc() is replaced with kmalloc_array()
+in commit 6da2ec56059c ("treewide: kmalloc() -> kmalloc_array()"), the
+kmalloc_array() function has an overflow check, so the above problem
+will not occur. Therefore, the extra check is removed.
+
+Signed-off-by: Baokun Li <libaokun1@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231023013057.2117948-3-libaokun1@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Stable-dep-of: 5d1935ac02ca ("ext4: avoid online resizing failures due to oversized flex bg")
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/resize.c | 3 ---
+ 1 file changed, 3 deletions(-)
+
+diff --git a/fs/ext4/resize.c b/fs/ext4/resize.c
+index c6d4539d4c1f..0a57b199883c 100644
+--- a/fs/ext4/resize.c
++++ b/fs/ext4/resize.c
+@@ -236,10 +236,7 @@ static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned int flexbg_size)
+ if (flex_gd == NULL)
+ goto out3;
+
+- if (flexbg_size >= UINT_MAX / sizeof(struct ext4_new_group_data))
+- goto out2;
+ flex_gd->count = flexbg_size;
+-
+ flex_gd->groups = kmalloc_array(flexbg_size,
+ sizeof(struct ext4_new_group_data),
+ GFP_NOFS);
+--
+2.43.0
+
--- /dev/null
+From 577ab4785b9ccaefbf01826d0345f9fc299d4c23 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 1 Nov 2023 22:08:10 +0530
+Subject: ext4: treat end of range as exclusive in ext4_zero_range()
+
+From: Ojaswin Mujoo <ojaswin@linux.ibm.com>
+
+[ Upstream commit 92573369144f40397e8514440afdf59f24905b40 ]
+
+The call to filemap_write_and_wait_range() assumes the range passed to be
+inclusive, so fix the call to make sure we follow that.
+
+Signed-off-by: Ojaswin Mujoo <ojaswin@linux.ibm.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/e503107a7c73a2b68dec645c5ad798c437717c45.1698856309.git.ojaswin@linux.ibm.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/extents.c | 6 ++++--
+ 1 file changed, 4 insertions(+), 2 deletions(-)
+
+diff --git a/fs/ext4/extents.c b/fs/ext4/extents.c
+index d5efe076d3d3..01299b55a567 100644
+--- a/fs/ext4/extents.c
++++ b/fs/ext4/extents.c
+@@ -4523,7 +4523,8 @@ static long ext4_zero_range(struct file *file, loff_t offset,
+ * Round up offset. This is not fallocate, we need to zero out
+ * blocks, so convert interior block aligned part of the range to
+ * unwritten and possibly manually zero out unaligned parts of the
+- * range.
++ * range. Here, start and partial_begin are inclusive, end and
++ * partial_end are exclusive.
+ */
+ start = round_up(offset, 1 << blkbits);
+ end = round_down((offset + len), 1 << blkbits);
+@@ -4609,7 +4610,8 @@ static long ext4_zero_range(struct file *file, loff_t offset,
+ * disk in case of crash before zeroing trans is committed.
+ */
+ if (ext4_should_journal_data(inode)) {
+- ret = filemap_write_and_wait_range(mapping, start, end);
++ ret = filemap_write_and_wait_range(mapping, start,
++ end - 1);
+ if (ret) {
+ filemap_invalidate_unlock(mapping);
+ goto out_mutex;
+--
+2.43.0
+
--- /dev/null
+From 5e83d487b43144976bf127f21ec882ea1d92a29f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 23 Oct 2023 09:30:54 +0800
+Subject: ext4: unify the type of flexbg_size to unsigned int
+
+From: Baokun Li <libaokun1@huawei.com>
+
+[ Upstream commit 658a52344fb139f9531e7543a6e0015b630feb38 ]
+
+The maximum value of flexbg_size is 2^31, but the maximum value of int
+is (2^31 - 1), so overflow may occur when the type of flexbg_size is
+declared as int.
+
+For example, when uninit_mask is initialized in ext4_alloc_group_tables(),
+if flexbg_size == 2^31, the initialized uninit_mask is incorrect, and this
+may causes set_flexbg_block_bitmap() to trigger a BUG_ON().
+
+Therefore, the flexbg_size type is declared as unsigned int to avoid
+overflow and memory waste.
+
+Signed-off-by: Baokun Li <libaokun1@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231023013057.2117948-2-libaokun1@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Stable-dep-of: 5d1935ac02ca ("ext4: avoid online resizing failures due to oversized flex bg")
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/resize.c | 13 +++++++------
+ 1 file changed, 7 insertions(+), 6 deletions(-)
+
+diff --git a/fs/ext4/resize.c b/fs/ext4/resize.c
+index 4fe061edefdd..c6d4539d4c1f 100644
+--- a/fs/ext4/resize.c
++++ b/fs/ext4/resize.c
+@@ -228,7 +228,7 @@ struct ext4_new_flex_group_data {
+ *
+ * Returns NULL on failure otherwise address of the allocated structure.
+ */
+-static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned long flexbg_size)
++static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned int flexbg_size)
+ {
+ struct ext4_new_flex_group_data *flex_gd;
+
+@@ -283,7 +283,7 @@ static void free_flex_gd(struct ext4_new_flex_group_data *flex_gd)
+ */
+ static int ext4_alloc_group_tables(struct super_block *sb,
+ struct ext4_new_flex_group_data *flex_gd,
+- int flexbg_size)
++ unsigned int flexbg_size)
+ {
+ struct ext4_new_group_data *group_data = flex_gd->groups;
+ ext4_fsblk_t start_blk;
+@@ -384,12 +384,12 @@ static int ext4_alloc_group_tables(struct super_block *sb,
+ group = group_data[0].group;
+
+ printk(KERN_DEBUG "EXT4-fs: adding a flex group with "
+- "%d groups, flexbg size is %d:\n", flex_gd->count,
++ "%u groups, flexbg size is %u:\n", flex_gd->count,
+ flexbg_size);
+
+ for (i = 0; i < flex_gd->count; i++) {
+ ext4_debug(
+- "adding %s group %u: %u blocks (%d free, %d mdata blocks)\n",
++ "adding %s group %u: %u blocks (%u free, %u mdata blocks)\n",
+ ext4_bg_has_super(sb, group + i) ? "normal" :
+ "no-super", group + i,
+ group_data[i].blocks_count,
+@@ -1606,7 +1606,7 @@ static int ext4_flex_group_add(struct super_block *sb,
+ static int ext4_setup_next_flex_gd(struct super_block *sb,
+ struct ext4_new_flex_group_data *flex_gd,
+ ext4_fsblk_t n_blocks_count,
+- unsigned long flexbg_size)
++ unsigned int flexbg_size)
+ {
+ struct ext4_sb_info *sbi = EXT4_SB(sb);
+ struct ext4_super_block *es = sbi->s_es;
+@@ -1990,8 +1990,9 @@ int ext4_resize_fs(struct super_block *sb, ext4_fsblk_t n_blocks_count)
+ ext4_fsblk_t o_blocks_count;
+ ext4_fsblk_t n_blocks_count_retry = 0;
+ unsigned long last_update_time = 0;
+- int err = 0, flexbg_size = 1 << sbi->s_log_groups_per_flex;
++ int err = 0;
+ int meta_bg;
++ unsigned int flexbg_size = ext4_flex_bg_size(sbi);
+
+ /* See if the device is actually as big as what was requested */
+ bh = ext4_sb_bread(sb, n_blocks_count - 1, 0);
+--
+2.43.0
+
--- /dev/null
+From e3bdbafea3d54594c2b6b671e0e91e27c156c38c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 24 Nov 2023 09:49:13 +0800
+Subject: extcon: fix possible name leak in extcon_dev_register()
+
+From: Yaxiong Tian <tianyaxiong@kylinos.cn>
+
+[ Upstream commit e66523c72c9aae0ff0dae6859eb77b04de1e8e5f ]
+
+In the error path after calling dev_set_name(), the device
+name is leaked. To fix this, moving dev_set_name() after the
+error path and before device_register.
+
+Link: https://lore.kernel.org/lkml/TYZPR01MB4784ADCD3E951E0863F3DB72D5B8A@TYZPR01MB4784.apcprd01.prod.exchangelabs.com/
+Signed-off-by: Yaxiong Tian <tianyaxiong@kylinos.cn>
+Signed-off-by: Chanwoo Choi <cw00.choi@samsung.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/extcon/extcon.c | 3 +--
+ 1 file changed, 1 insertion(+), 2 deletions(-)
+
+diff --git a/drivers/extcon/extcon.c b/drivers/extcon/extcon.c
+index 6f7a60d2ed91..e7f55c021e56 100644
+--- a/drivers/extcon/extcon.c
++++ b/drivers/extcon/extcon.c
+@@ -1280,8 +1280,6 @@ int extcon_dev_register(struct extcon_dev *edev)
+
+ edev->id = ret;
+
+- dev_set_name(&edev->dev, "extcon%d", edev->id);
+-
+ ret = extcon_alloc_cables(edev);
+ if (ret < 0)
+ goto err_alloc_cables;
+@@ -1310,6 +1308,7 @@ int extcon_dev_register(struct extcon_dev *edev)
+ RAW_INIT_NOTIFIER_HEAD(&edev->nh_all);
+
+ dev_set_drvdata(&edev->dev, edev);
++ dev_set_name(&edev->dev, "extcon%d", edev->id);
+ edev->state = 0;
+
+ ret = device_register(&edev->dev);
+--
+2.43.0
+
--- /dev/null
+From 9d24f7e3eb363a856ae11ffc9e95c72df1e5cba4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 16 Nov 2023 14:25:56 +0800
+Subject: f2fs: fix to check return value of f2fs_reserve_new_block()
+
+From: Chao Yu <chao@kernel.org>
+
+[ Upstream commit 956fa1ddc132e028f3b7d4cf17e6bfc8cb36c7fd ]
+
+Let's check return value of f2fs_reserve_new_block() in do_recover_data()
+rather than letting it fails silently.
+
+Also refactoring check condition on return value of f2fs_reserve_new_block()
+as below:
+- trigger f2fs_bug_on() only for ENOSPC case;
+- use do-while statement to avoid redundant codes;
+
+Signed-off-by: Chao Yu <chao@kernel.org>
+Signed-off-by: Jaegeuk Kim <jaegeuk@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/f2fs/recovery.c | 23 +++++++++++++++++------
+ 1 file changed, 17 insertions(+), 6 deletions(-)
+
+diff --git a/fs/f2fs/recovery.c b/fs/f2fs/recovery.c
+index b56d0f1078a7..16415c770b45 100644
+--- a/fs/f2fs/recovery.c
++++ b/fs/f2fs/recovery.c
+@@ -712,7 +712,16 @@ static int do_recover_data(struct f2fs_sb_info *sbi, struct inode *inode,
+ */
+ if (dest == NEW_ADDR) {
+ f2fs_truncate_data_blocks_range(&dn, 1);
+- f2fs_reserve_new_block(&dn);
++ do {
++ err = f2fs_reserve_new_block(&dn);
++ if (err == -ENOSPC) {
++ f2fs_bug_on(sbi, 1);
++ break;
++ }
++ } while (err &&
++ IS_ENABLED(CONFIG_F2FS_FAULT_INJECTION));
++ if (err)
++ goto err;
+ continue;
+ }
+
+@@ -720,12 +729,14 @@ static int do_recover_data(struct f2fs_sb_info *sbi, struct inode *inode,
+ if (f2fs_is_valid_blkaddr(sbi, dest, META_POR)) {
+
+ if (src == NULL_ADDR) {
+- err = f2fs_reserve_new_block(&dn);
+- while (err &&
+- IS_ENABLED(CONFIG_F2FS_FAULT_INJECTION))
++ do {
+ err = f2fs_reserve_new_block(&dn);
+- /* We should not get -ENOSPC */
+- f2fs_bug_on(sbi, err);
++ if (err == -ENOSPC) {
++ f2fs_bug_on(sbi, 1);
++ break;
++ }
++ } while (err &&
++ IS_ENABLED(CONFIG_F2FS_FAULT_INJECTION));
+ if (err)
+ goto err;
+ }
+--
+2.43.0
+
--- /dev/null
+From ac44e9779931c2a131e865bf6fa243b98357f8ef Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 10 Dec 2023 19:35:42 +0800
+Subject: f2fs: fix to tag gcing flag on page during block migration
+
+From: Chao Yu <chao@kernel.org>
+
+[ Upstream commit 4961acdd65c956e97c1a000c82d91a8c1cdbe44b ]
+
+It needs to add missing gcing flag on page during block migration,
+in order to garantee migrated data be persisted during checkpoint,
+otherwise out-of-order persistency between data and node may cause
+data corruption after SPOR.
+
+Similar issue was fixed by commit 2d1fe8a86bf5 ("f2fs: fix to tag
+gcing flag on page during file defragment").
+
+Signed-off-by: Chao Yu <chao@kernel.org>
+Signed-off-by: Jaegeuk Kim <jaegeuk@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/f2fs/compress.c | 4 +++-
+ fs/f2fs/file.c | 2 ++
+ 2 files changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/fs/f2fs/compress.c b/fs/f2fs/compress.c
+index 36e5dab6baae..62119f3f7206 100644
+--- a/fs/f2fs/compress.c
++++ b/fs/f2fs/compress.c
+@@ -1036,8 +1036,10 @@ static void set_cluster_dirty(struct compress_ctx *cc)
+ int i;
+
+ for (i = 0; i < cc->cluster_size; i++)
+- if (cc->rpages[i])
++ if (cc->rpages[i]) {
+ set_page_dirty(cc->rpages[i]);
++ set_page_private_gcing(cc->rpages[i]);
++ }
+ }
+
+ static int prepare_compress_overwrite(struct compress_ctx *cc,
+diff --git a/fs/f2fs/file.c b/fs/f2fs/file.c
+index 8912511980ae..a05781e708d6 100644
+--- a/fs/f2fs/file.c
++++ b/fs/f2fs/file.c
+@@ -1317,6 +1317,7 @@ static int __clone_blkaddrs(struct inode *src_inode, struct inode *dst_inode,
+ }
+ memcpy_page(pdst, 0, psrc, 0, PAGE_SIZE);
+ set_page_dirty(pdst);
++ set_page_private_gcing(pdst);
+ f2fs_put_page(pdst, 1);
+ f2fs_put_page(psrc, 1);
+
+@@ -4059,6 +4060,7 @@ static int redirty_blocks(struct inode *inode, pgoff_t page_idx, int len)
+ f2fs_bug_on(F2FS_I_SB(inode), !page);
+
+ set_page_dirty(page);
++ set_page_private_gcing(page);
+ f2fs_put_page(page, 1);
+ f2fs_put_page(page, 0);
+ }
+--
+2.43.0
+
--- /dev/null
+From 8fccb2ada3a3d2067278d847e2d022b4faf5adc5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 2 Dec 2023 00:08:57 -0800
+Subject: f2fs: fix write pointers on zoned device after roll forward
+
+From: Jaegeuk Kim <jaegeuk@kernel.org>
+
+[ Upstream commit 9dad4d964291295ef48243d4e03972b85138bc9f ]
+
+1. do roll forward recovery
+2. update current segments pointers
+3. fix the entire zones' write pointers
+4. do checkpoint
+
+Reviewed-by: Daeho Jeong <daehojeong@google.com>
+Signed-off-by: Jaegeuk Kim <jaegeuk@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/f2fs/recovery.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/fs/f2fs/recovery.c b/fs/f2fs/recovery.c
+index 16415c770b45..d0f24ccbd1ac 100644
+--- a/fs/f2fs/recovery.c
++++ b/fs/f2fs/recovery.c
+@@ -917,6 +917,8 @@ int f2fs_recover_fsync_data(struct f2fs_sb_info *sbi, bool check_only)
+ if (!err && fix_curseg_write_pointer && !f2fs_readonly(sbi->sb) &&
+ f2fs_sb_has_blkzoned(sbi)) {
+ err = f2fs_fix_curseg_write_pointer(sbi);
++ if (!err)
++ err = f2fs_check_write_pointer(sbi);
+ ret = err;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From fda6886cec3478815c452e31b6a0e63ff386c669 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 1 Nov 2023 01:08:54 -0400
+Subject: fast_dput(): handle underflows gracefully
+
+From: Al Viro <viro@zeniv.linux.org.uk>
+
+[ Upstream commit 504e08cebe1d4e1efe25f915234f646e74a364a8 ]
+
+If refcount is less than 1, we should just warn, unlock dentry and
+return true, so that the caller doesn't try to do anything else.
+
+Taking care of that leaves the rest of "lockref_put_return() has
+failed" case equivalent to "decrement refcount and rejoin the
+normal slow path after the point where we grab ->d_lock".
+
+NOTE: lockref_put_return() is strictly a fastpath thing - unlike
+the rest of lockref primitives, it does not contain a fallback.
+Caller (and it looks like fast_dput() is the only legitimate one
+in the entire kernel) has to do that itself. Reasons for
+lockref_put_return() failures:
+ * ->d_lock held by somebody
+ * refcount <= 0
+ * ... or an architecture not supporting lockref use of
+cmpxchg - sparc, anything non-SMP, config with spinlock debugging...
+
+We could add a fallback, but it would be a clumsy API - we'd have
+to distinguish between:
+ (1) refcount > 1 - decremented, lock not held on return
+ (2) refcount < 1 - left alone, probably no sense to hold the lock
+ (3) refcount is 1, no cmphxcg - decremented, lock held on return
+ (4) refcount is 1, cmphxcg supported - decremented, lock *NOT* held
+ on return.
+We want to return with no lock held in case (4); that's the whole point of that
+thing. We very much do not want to have the fallback in case (3) return without
+a lock, since the caller might have to retake it in that case.
+So it wouldn't be more convenient than doing the fallback in the caller and
+it would be very easy to screw up, especially since the test coverage would
+suck - no way to test (3) and (4) on the same kernel build.
+
+Reviewed-by: Christian Brauner <brauner@kernel.org>
+Signed-off-by: Al Viro <viro@zeniv.linux.org.uk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/dcache.c | 7 ++++---
+ 1 file changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/fs/dcache.c b/fs/dcache.c
+index c82ae731df9a..d1ab857a69ca 100644
+--- a/fs/dcache.c
++++ b/fs/dcache.c
+@@ -787,12 +787,12 @@ static inline bool fast_dput(struct dentry *dentry)
+ */
+ if (unlikely(ret < 0)) {
+ spin_lock(&dentry->d_lock);
+- if (dentry->d_lockref.count > 1) {
+- dentry->d_lockref.count--;
++ if (WARN_ON_ONCE(dentry->d_lockref.count <= 0)) {
+ spin_unlock(&dentry->d_lock);
+ return true;
+ }
+- return false;
++ dentry->d_lockref.count--;
++ goto locked;
+ }
+
+ /*
+@@ -850,6 +850,7 @@ static inline bool fast_dput(struct dentry *dentry)
+ * else could have killed it and marked it dead. Either way, we
+ * don't need to do anything else.
+ */
++locked:
+ if (dentry->d_lockref.count) {
+ spin_unlock(&dentry->d_lock);
+ return true;
+--
+2.43.0
+
--- /dev/null
+From 5d36ef355bb8337ed511a316cf9298a829f439bd Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 11 Oct 2023 23:46:37 +0500
+Subject: FS:JFS:UBSAN:array-index-out-of-bounds in dbAdjTree
+
+From: Osama Muhammad <osmtendev@gmail.com>
+
+[ Upstream commit 9862ec7ac1cbc6eb5ee4a045b5d5b8edbb2f7e68 ]
+
+Syzkaller reported the following issue:
+
+UBSAN: array-index-out-of-bounds in fs/jfs/jfs_dmap.c:2867:6
+index 196694 is out of range for type 's8[1365]' (aka 'signed char[1365]')
+CPU: 1 PID: 109 Comm: jfsCommit Not tainted 6.6.0-rc3-syzkaller #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 08/04/2023
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1e7/0x2d0 lib/dump_stack.c:106
+ ubsan_epilogue lib/ubsan.c:217 [inline]
+ __ubsan_handle_out_of_bounds+0x11c/0x150 lib/ubsan.c:348
+ dbAdjTree+0x474/0x4f0 fs/jfs/jfs_dmap.c:2867
+ dbJoin+0x210/0x2d0 fs/jfs/jfs_dmap.c:2834
+ dbFreeBits+0x4eb/0xda0 fs/jfs/jfs_dmap.c:2331
+ dbFreeDmap fs/jfs/jfs_dmap.c:2080 [inline]
+ dbFree+0x343/0x650 fs/jfs/jfs_dmap.c:402
+ txFreeMap+0x798/0xd50 fs/jfs/jfs_txnmgr.c:2534
+ txUpdateMap+0x342/0x9e0
+ txLazyCommit fs/jfs/jfs_txnmgr.c:2664 [inline]
+ jfs_lazycommit+0x47a/0xb70 fs/jfs/jfs_txnmgr.c:2732
+ kthread+0x2d3/0x370 kernel/kthread.c:388
+ ret_from_fork+0x48/0x80 arch/x86/kernel/process.c:147
+ ret_from_fork_asm+0x11/0x20 arch/x86/entry/entry_64.S:304
+ </TASK>
+================================================================================
+Kernel panic - not syncing: UBSAN: panic_on_warn set ...
+CPU: 1 PID: 109 Comm: jfsCommit Not tainted 6.6.0-rc3-syzkaller #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 08/04/2023
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1e7/0x2d0 lib/dump_stack.c:106
+ panic+0x30f/0x770 kernel/panic.c:340
+ check_panic_on_warn+0x82/0xa0 kernel/panic.c:236
+ ubsan_epilogue lib/ubsan.c:223 [inline]
+ __ubsan_handle_out_of_bounds+0x13c/0x150 lib/ubsan.c:348
+ dbAdjTree+0x474/0x4f0 fs/jfs/jfs_dmap.c:2867
+ dbJoin+0x210/0x2d0 fs/jfs/jfs_dmap.c:2834
+ dbFreeBits+0x4eb/0xda0 fs/jfs/jfs_dmap.c:2331
+ dbFreeDmap fs/jfs/jfs_dmap.c:2080 [inline]
+ dbFree+0x343/0x650 fs/jfs/jfs_dmap.c:402
+ txFreeMap+0x798/0xd50 fs/jfs/jfs_txnmgr.c:2534
+ txUpdateMap+0x342/0x9e0
+ txLazyCommit fs/jfs/jfs_txnmgr.c:2664 [inline]
+ jfs_lazycommit+0x47a/0xb70 fs/jfs/jfs_txnmgr.c:2732
+ kthread+0x2d3/0x370 kernel/kthread.c:388
+ ret_from_fork+0x48/0x80 arch/x86/kernel/process.c:147
+ ret_from_fork_asm+0x11/0x20 arch/x86/entry/entry_64.S:304
+ </TASK>
+Kernel Offset: disabled
+Rebooting in 86400 seconds..
+
+The issue is caused when the value of lp becomes greater than
+CTLTREESIZE which is the max size of stree. Adding a simple check
+solves this issue.
+
+Dave:
+As the function returns a void, good error handling
+would require a more intrusive code reorganization, so I modified
+Osama's patch at use WARN_ON_ONCE for lack of a cleaner option.
+
+The patch is tested via syzbot.
+
+Reported-by: syzbot+39ba34a099ac2e9bd3cb@syzkaller.appspotmail.com
+Link: https://syzkaller.appspot.com/bug?extid=39ba34a099ac2e9bd3cb
+Signed-off-by: Osama Muhammad <osmtendev@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dmap.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/fs/jfs/jfs_dmap.c b/fs/jfs/jfs_dmap.c
+index 11c77757ead9..d55f0dd8d754 100644
+--- a/fs/jfs/jfs_dmap.c
++++ b/fs/jfs/jfs_dmap.c
+@@ -2871,6 +2871,9 @@ static void dbAdjTree(dmtree_t * tp, int leafno, int newval)
+ /* is the current value the same as the old value ? if so,
+ * there is nothing to do.
+ */
++ if (WARN_ON_ONCE(lp >= CTLTREESIZE))
++ return;
++
+ if (tp->dmt_stree[lp] == newval)
+ return;
+
+--
+2.43.0
+
--- /dev/null
+From 007e7ae0ae2160d480721f3f7e072c8134b006e8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 10:33:10 +0100
+Subject: fs/kernfs/dir: obey S_ISGID
+
+From: Max Kellermann <max.kellermann@ionos.com>
+
+[ Upstream commit 5133bee62f0ea5d4c316d503cc0040cac5637601 ]
+
+Handling of S_ISGID is usually done by inode_init_owner() in all other
+filesystems, but kernfs doesn't use that function. In kernfs, struct
+kernfs_node is the primary data structure, and struct inode is only
+created from it on demand. Therefore, inode_init_owner() can't be
+used and we need to imitate its behavior.
+
+S_ISGID support is useful for the cgroup filesystem; it allows
+subtrees managed by an unprivileged process to retain a certain owner
+gid, which then enables sharing access to the subtree with another
+unprivileged process.
+
+--
+v1 -> v2: minor coding style fix (comment)
+
+Signed-off-by: Max Kellermann <max.kellermann@ionos.com>
+Acked-by: Tejun Heo <tj@kernel.org>
+Link: https://lore.kernel.org/r/20231208093310.297233-2-max.kellermann@ionos.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/kernfs/dir.c | 12 ++++++++++++
+ 1 file changed, 12 insertions(+)
+
+diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
+index 8b2bd65d70e7..62d39ecf0a46 100644
+--- a/fs/kernfs/dir.c
++++ b/fs/kernfs/dir.c
+@@ -676,6 +676,18 @@ struct kernfs_node *kernfs_new_node(struct kernfs_node *parent,
+ {
+ struct kernfs_node *kn;
+
++ if (parent->mode & S_ISGID) {
++ /* this code block imitates inode_init_owner() for
++ * kernfs
++ */
++
++ if (parent->iattr)
++ gid = parent->iattr->ia_gid;
++
++ if (flags & KERNFS_DIR)
++ mode |= S_ISGID;
++ }
++
+ kn = __kernfs_new_node(kernfs_root(parent), parent,
+ name, mode, uid, gid, flags);
+ if (kn) {
+--
+2.43.0
+
--- /dev/null
+From deb098153a1c5b383d996b43a5ed9bf29f143a2d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 15 Nov 2023 14:28:15 +0100
+Subject: Hexagon: Make pfn accessors statics inlines
+
+From: Linus Walleij <linus.walleij@linaro.org>
+
+[ Upstream commit d6e81532b10d8deb2bc30f7b44f09534876893e3 ]
+
+Making virt_to_pfn() a static inline taking a strongly typed
+(const void *) makes the contract of a passing a pointer of that
+type to the function explicit and exposes any misuse of the
+macro virt_to_pfn() acting polymorphic and accepting many types
+such as (void *), (unitptr_t) or (unsigned long) as arguments
+without warnings.
+
+For symmetry do the same with pfn_to_virt().
+
+For compiletime resolution of __pa() we need PAGE_OFFSET which
+was not available to __pa() and resolved by the preprocessor
+wherever __pa() was used. Fix this by explicitly including
+<asm/mem-layout.h> where required, following the pattern of the
+architectures page.h file.
+
+Acked-by: Brian Cain <bcain@quicinc.com>
+Signed-off-by: Linus Walleij <linus.walleij@linaro.org>
+Signed-off-by: Arnd Bergmann <arnd@arndb.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/hexagon/include/asm/page.h | 15 +++++++++++++--
+ 1 file changed, 13 insertions(+), 2 deletions(-)
+
+diff --git a/arch/hexagon/include/asm/page.h b/arch/hexagon/include/asm/page.h
+index 9c03b9965f07..10f1bc07423c 100644
+--- a/arch/hexagon/include/asm/page.h
++++ b/arch/hexagon/include/asm/page.h
+@@ -78,6 +78,9 @@ typedef struct page *pgtable_t;
+ #define __pgd(x) ((pgd_t) { (x) })
+ #define __pgprot(x) ((pgprot_t) { (x) })
+
++/* Needed for PAGE_OFFSET used in the macro right below */
++#include <asm/mem-layout.h>
++
+ /*
+ * We need a __pa and a __va routine for kernel space.
+ * MIPS says they're only used during mem_init.
+@@ -125,8 +128,16 @@ static inline void clear_page(void *page)
+ */
+ #define page_to_phys(page) (page_to_pfn(page) << PAGE_SHIFT)
+
+-#define virt_to_pfn(kaddr) (__pa(kaddr) >> PAGE_SHIFT)
+-#define pfn_to_virt(pfn) __va((pfn) << PAGE_SHIFT)
++static inline unsigned long virt_to_pfn(const void *kaddr)
++{
++ return __pa(kaddr) >> PAGE_SHIFT;
++}
++
++static inline void *pfn_to_virt(unsigned long pfn)
++{
++ return (void *)((unsigned long)__va(pfn) << PAGE_SHIFT);
++}
++
+
+ #define page_to_virt(page) __va(page_to_phys(page))
+
+--
+2.43.0
+
--- /dev/null
+From fc00c747ca89e37bcf1f7f2aa314e6f181085830 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 21:49:19 -0800
+Subject: hwmon: (hp-wmi-sensors) Fix failure to load on EliteDesk 800 G6
+
+From: James Seo <james@equiv.tech>
+
+[ Upstream commit c9ba592580947b81f33f514320aeef02ddc001fd ]
+
+The EliteDesk 800 G6 stores a raw WMI string within the ACPI object in its
+BIOS corresponding to one instance of HPBIOS_PlatformEvents.Name. This is
+evidently a valid way of representing a WMI data item as far as the
+Microsoft ACPI-WMI mapper is concerned, but is preventing the driver from
+loading.
+
+This seems quite rare, but add support for such strings. Treating this as a
+quirk pretty much means adding that support anyway.
+
+Also clean up an oversight in update_numeric_sensor_from_wobj() in which
+the result of hp_wmi_strdup() was being used without error checking.
+
+Reported-by: Lukasz Stelmach <l.stelmach@samsung.com>
+Closes: https://lore.kernel.org/linux-hwmon/7850a0bd-60e7-88f8-1d6c-0bb0e3234fdc@roeck-us.net/
+Tested-by: Lukasz Stelmach <l.stelmach@samsung.com>
+Signed-off-by: James Seo <james@equiv.tech>
+Link: https://lore.kernel.org/r/20231123054918.157098-1-james@equiv.tech
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/hwmon/hp-wmi-sensors.c | 127 ++++++++++++++++++++++++++++-----
+ 1 file changed, 111 insertions(+), 16 deletions(-)
+
+diff --git a/drivers/hwmon/hp-wmi-sensors.c b/drivers/hwmon/hp-wmi-sensors.c
+index 17ae62f88bbf..b5325d0e72b9 100644
+--- a/drivers/hwmon/hp-wmi-sensors.c
++++ b/drivers/hwmon/hp-wmi-sensors.c
+@@ -17,6 +17,8 @@
+ * Available: https://github.com/linuxhw/ACPI
+ * [4] P. Rohár, "bmfdec - Decompile binary MOF file (BMF) from WMI buffer",
+ * 2017. [Online]. Available: https://github.com/pali/bmfdec
++ * [5] Microsoft Corporation, "Driver-Defined WMI Data Items", 2017. [Online].
++ * Available: https://learn.microsoft.com/en-us/windows-hardware/drivers/kernel/driver-defined-wmi-data-items
+ */
+
+ #include <linux/acpi.h>
+@@ -24,6 +26,7 @@
+ #include <linux/hwmon.h>
+ #include <linux/jiffies.h>
+ #include <linux/mutex.h>
++#include <linux/nls.h>
+ #include <linux/units.h>
+ #include <linux/wmi.h>
+
+@@ -395,6 +398,50 @@ struct hp_wmi_sensors {
+ struct mutex lock; /* Lock polling WMI and driver state changes. */
+ };
+
++static bool is_raw_wmi_string(const u8 *pointer, u32 length)
++{
++ const u16 *ptr;
++ u16 len;
++
++ /* WMI strings are length-prefixed UTF-16 [5]. */
++ if (length <= sizeof(*ptr))
++ return false;
++
++ length -= sizeof(*ptr);
++ ptr = (const u16 *)pointer;
++ len = *ptr;
++
++ return len <= length && !(len & 1);
++}
++
++static char *convert_raw_wmi_string(const u8 *buf)
++{
++ const wchar_t *src;
++ unsigned int cps;
++ unsigned int len;
++ char *dst;
++ int i;
++
++ src = (const wchar_t *)buf;
++
++ /* Count UTF-16 code points. Exclude trailing null padding. */
++ cps = *src / sizeof(*src);
++ while (cps && !src[cps])
++ cps--;
++
++ /* Each code point becomes up to 3 UTF-8 characters. */
++ len = min(cps * 3, HP_WMI_MAX_STR_SIZE - 1);
++
++ dst = kmalloc((len + 1) * sizeof(*dst), GFP_KERNEL);
++ if (!dst)
++ return NULL;
++
++ i = utf16s_to_utf8s(++src, cps, UTF16_LITTLE_ENDIAN, dst, len);
++ dst[i] = '\0';
++
++ return dst;
++}
++
+ /* hp_wmi_strdup - devm_kstrdup, but length-limited */
+ static char *hp_wmi_strdup(struct device *dev, const char *src)
+ {
+@@ -412,6 +459,23 @@ static char *hp_wmi_strdup(struct device *dev, const char *src)
+ return dst;
+ }
+
++/* hp_wmi_wstrdup - hp_wmi_strdup, but for a raw WMI string */
++static char *hp_wmi_wstrdup(struct device *dev, const u8 *buf)
++{
++ char *src;
++ char *dst;
++
++ src = convert_raw_wmi_string(buf);
++ if (!src)
++ return NULL;
++
++ dst = hp_wmi_strdup(dev, strim(src)); /* Note: Copy is trimmed. */
++
++ kfree(src);
++
++ return dst;
++}
++
+ /*
+ * hp_wmi_get_wobj - poll WMI for a WMI object instance
+ * @guid: WMI object GUID
+@@ -462,8 +526,14 @@ static int check_wobj(const union acpi_object *wobj,
+ for (prop = 0; prop <= last_prop; prop++) {
+ type = elements[prop].type;
+ valid_type = property_map[prop];
+- if (type != valid_type)
++ if (type != valid_type) {
++ if (type == ACPI_TYPE_BUFFER &&
++ valid_type == ACPI_TYPE_STRING &&
++ is_raw_wmi_string(elements[prop].buffer.pointer,
++ elements[prop].buffer.length))
++ continue;
+ return -EINVAL;
++ }
+ }
+
+ return 0;
+@@ -480,7 +550,9 @@ static int extract_acpi_value(struct device *dev,
+ break;
+
+ case ACPI_TYPE_STRING:
+- *out_string = hp_wmi_strdup(dev, strim(element->string.pointer));
++ *out_string = element->type == ACPI_TYPE_BUFFER ?
++ hp_wmi_wstrdup(dev, element->buffer.pointer) :
++ hp_wmi_strdup(dev, strim(element->string.pointer));
+ if (!*out_string)
+ return -ENOMEM;
+ break;
+@@ -861,7 +933,9 @@ update_numeric_sensor_from_wobj(struct device *dev,
+ {
+ const union acpi_object *elements;
+ const union acpi_object *element;
+- const char *string;
++ const char *new_string;
++ char *trimmed;
++ char *string;
+ bool is_new;
+ int offset;
+ u8 size;
+@@ -885,11 +959,21 @@ update_numeric_sensor_from_wobj(struct device *dev,
+ offset = is_new ? size - 1 : -2;
+
+ element = &elements[HP_WMI_PROPERTY_CURRENT_STATE + offset];
+- string = strim(element->string.pointer);
+-
+- if (strcmp(string, nsensor->current_state)) {
+- devm_kfree(dev, nsensor->current_state);
+- nsensor->current_state = hp_wmi_strdup(dev, string);
++ string = element->type == ACPI_TYPE_BUFFER ?
++ convert_raw_wmi_string(element->buffer.pointer) :
++ element->string.pointer;
++
++ if (string) {
++ trimmed = strim(string);
++ if (strcmp(trimmed, nsensor->current_state)) {
++ new_string = hp_wmi_strdup(dev, trimmed);
++ if (new_string) {
++ devm_kfree(dev, nsensor->current_state);
++ nsensor->current_state = new_string;
++ }
++ }
++ if (element->type == ACPI_TYPE_BUFFER)
++ kfree(string);
+ }
+
+ /* Old variant: -2 (not -1) because it lacks the Size property. */
+@@ -996,11 +1080,15 @@ static int check_event_wobj(const union acpi_object *wobj)
+ HP_WMI_EVENT_PROPERTY_STATUS);
+ }
+
+-static int populate_event_from_wobj(struct hp_wmi_event *event,
++static int populate_event_from_wobj(struct device *dev,
++ struct hp_wmi_event *event,
+ union acpi_object *wobj)
+ {
+ int prop = HP_WMI_EVENT_PROPERTY_NAME;
+ union acpi_object *element;
++ acpi_object_type type;
++ char *string;
++ u32 value;
+ int err;
+
+ err = check_event_wobj(wobj);
+@@ -1009,20 +1097,24 @@ static int populate_event_from_wobj(struct hp_wmi_event *event,
+
+ element = wobj->package.elements;
+
+- /* Extracted strings are NOT device-managed copies. */
+-
+ for (; prop <= HP_WMI_EVENT_PROPERTY_CATEGORY; prop++, element++) {
++ type = hp_wmi_event_property_map[prop];
++
++ err = extract_acpi_value(dev, element, type, &value, &string);
++ if (err)
++ return err;
++
+ switch (prop) {
+ case HP_WMI_EVENT_PROPERTY_NAME:
+- event->name = strim(element->string.pointer);
++ event->name = string;
+ break;
+
+ case HP_WMI_EVENT_PROPERTY_DESCRIPTION:
+- event->description = strim(element->string.pointer);
++ event->description = string;
+ break;
+
+ case HP_WMI_EVENT_PROPERTY_CATEGORY:
+- event->category = element->integer.value;
++ event->category = value;
+ break;
+
+ default:
+@@ -1511,8 +1603,8 @@ static void hp_wmi_notify(u32 value, void *context)
+ struct acpi_buffer out = { ACPI_ALLOCATE_BUFFER, NULL };
+ struct hp_wmi_sensors *state = context;
+ struct device *dev = &state->wdev->dev;
++ struct hp_wmi_event event = {};
+ struct hp_wmi_info *fan_info;
+- struct hp_wmi_event event;
+ union acpi_object *wobj;
+ acpi_status err;
+ int event_type;
+@@ -1546,7 +1638,7 @@ static void hp_wmi_notify(u32 value, void *context)
+
+ wobj = out.pointer;
+
+- err = populate_event_from_wobj(&event, wobj);
++ err = populate_event_from_wobj(dev, &event, wobj);
+ if (err) {
+ dev_warn(dev, "Bad event data (ACPI type %d)\n", wobj->type);
+ goto out_free_wobj;
+@@ -1577,6 +1669,9 @@ static void hp_wmi_notify(u32 value, void *context)
+ out_free_wobj:
+ kfree(wobj);
+
++ devm_kfree(dev, event.name);
++ devm_kfree(dev, event.description);
++
+ out_unlock:
+ mutex_unlock(&state->lock);
+ }
+--
+2.43.0
+
--- /dev/null
+From d84be4b6c6ceb45138999aa90a97cead2320930b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 16:16:04 +0800
+Subject: hwmon: (nct6775) Fix fan speed set failure in automatic mode
+
+From: Xing Tong Wu <xingtong.wu@siemens.com>
+
+[ Upstream commit 8b3800256abad20e91c2698607f9b28591407b19 ]
+
+Setting the fan speed is only valid in manual mode; it is not possible
+to set the fan's speed in automatic mode.
+Return error when attempting to set the fan speed in automatic mode.
+
+Signed-off-by: Xing Tong Wu <xingtong.wu@siemens.com>
+Link: https://lore.kernel.org/r/20231121081604.2499-3-xingtong_wu@163.com
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/hwmon/nct6775-core.c | 7 +++++++
+ 1 file changed, 7 insertions(+)
+
+diff --git a/drivers/hwmon/nct6775-core.c b/drivers/hwmon/nct6775-core.c
+index d928eb8ae5a3..92a49fafe2c0 100644
+--- a/drivers/hwmon/nct6775-core.c
++++ b/drivers/hwmon/nct6775-core.c
+@@ -2553,6 +2553,13 @@ store_pwm(struct device *dev, struct device_attribute *attr, const char *buf,
+ int err;
+ u16 reg;
+
++ /*
++ * The fan control mode should be set to manual if the user wants to adjust
++ * the fan speed. Otherwise, it will fail to set.
++ */
++ if (index == 0 && data->pwm_enable[nr] > manual)
++ return -EBUSY;
++
+ err = kstrtoul(buf, 10, &val);
+ if (err < 0)
+ return err;
+--
+2.43.0
+
--- /dev/null
+From a95f1e068507bc2f9c5e28e60883f3408f93eaa6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 12:02:07 -0800
+Subject: hwmon: (pc87360) Bounds check data->innr usage
+
+From: Kees Cook <keescook@chromium.org>
+
+[ Upstream commit 4265eb062a7303e537ab3792ade31f424c3c5189 ]
+
+Without visibility into the initializers for data->innr, GCC suspects
+using it as an index could walk off the end of the various 14-element
+arrays in data. Perform an explicit clamp to the array size. Silences
+the following warning with GCC 12+:
+
+../drivers/hwmon/pc87360.c: In function 'pc87360_update_device':
+../drivers/hwmon/pc87360.c:341:49: warning: writing 1 byte into a region of size 0 [-Wstringop-overflow=]
+ 341 | data->in_max[i] = pc87360_read_value(data,
+ | ~~~~~~~~~~~~~~~~^~~~~~~~~~~~~~~~~~~~~~~~~~
+ 342 | LD_IN, i,
+ | ~~~~~~~~~
+ 343 | PC87365_REG_IN_MAX);
+ | ~~~~~~~~~~~~~~~~~~~
+../drivers/hwmon/pc87360.c:209:12: note: at offset 255 into destination object 'in_max' of size 14
+ 209 | u8 in_max[14]; /* Register value */
+ | ^~~~~~
+
+Cc: Jim Cromie <jim.cromie@gmail.com>
+Cc: Jean Delvare <jdelvare@suse.com>
+Cc: Guenter Roeck <linux@roeck-us.net>
+Cc: linux-hwmon@vger.kernel.org
+Signed-off-by: Kees Cook <keescook@chromium.org>
+Reviewed-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Link: https://lore.kernel.org/r/20231130200207.work.679-kees@kernel.org
+[groeck: Added comment into code clarifying context]
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/hwmon/pc87360.c | 6 +++++-
+ 1 file changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/hwmon/pc87360.c b/drivers/hwmon/pc87360.c
+index 926ea1fe133c..9e9681b2e8c5 100644
+--- a/drivers/hwmon/pc87360.c
++++ b/drivers/hwmon/pc87360.c
+@@ -323,7 +323,11 @@ static struct pc87360_data *pc87360_update_device(struct device *dev)
+ }
+
+ /* Voltages */
+- for (i = 0; i < data->innr; i++) {
++ /*
++ * The min() below does not have any practical meaning and is
++ * only needed to silence a warning observed with gcc 12+.
++ */
++ for (i = 0; i < min(data->innr, ARRAY_SIZE(data->in)); i++) {
+ data->in_status[i] = pc87360_read_value(data, LD_IN, i,
+ PC87365_REG_IN_STATUS);
+ /* Clear bits */
+--
+2.43.0
+
--- /dev/null
+From 9e5760424afe6a87d68b06fcb35a80c0b79b1d88 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 20 Nov 2023 23:11:21 +0800
+Subject: hwrng: starfive - Fix dev_err_probe return error
+
+From: Jia Jie Ho <jiajie.ho@starfivetech.com>
+
+[ Upstream commit 2d37b3649c412b3bcecfea932cb677f7a5775b15 ]
+
+Current dev_err_probe will return 0 instead of proper error code if
+driver failed to get irq number. Fix the return err code.
+
+Signed-off-by: Jia Jie Ho <jiajie.ho@starfivetech.com>
+Reported-by: kernel test robot <lkp@intel.com>
+Reported-by: Dan Carpenter <error27@gmail.com>
+Closes: https://lore.kernel.org/r/202311160649.3GhKCfhd-lkp@intel.com/
+Signed-off-by: Herbert Xu <herbert@gondor.apana.org.au>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/char/hw_random/jh7110-trng.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/char/hw_random/jh7110-trng.c b/drivers/char/hw_random/jh7110-trng.c
+index 38474d48a25e..b1f94e3c0c6a 100644
+--- a/drivers/char/hw_random/jh7110-trng.c
++++ b/drivers/char/hw_random/jh7110-trng.c
+@@ -300,7 +300,7 @@ static int starfive_trng_probe(struct platform_device *pdev)
+ ret = devm_request_irq(&pdev->dev, irq, starfive_trng_irq, 0, pdev->name,
+ (void *)trng);
+ if (ret)
+- return dev_err_probe(&pdev->dev, irq,
++ return dev_err_probe(&pdev->dev, ret,
+ "Failed to register interrupt handler\n");
+
+ trng->hclk = devm_clk_get(&pdev->dev, "hclk");
+--
+2.43.0
+
--- /dev/null
+From aa126ea190ad2b594290d38e5656bf19085503d7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 3 Dec 2023 23:39:59 +1100
+Subject: i2c: rk3x: Adjust mask/value offset for i2c2 on rv1126
+
+From: Tim Lunn <tim@feathertop.org>
+
+[ Upstream commit 92a85b7c6262f19c65a1c115cf15f411ba65a57c ]
+
+Rockchip RV1126 is using old style i2c controller, the i2c2
+bus uses a non-sequential offset in the grf register for the
+mask/value bits for this bus.
+
+This patch fixes i2c2 bus on rv1126 SoCs.
+
+Signed-off-by: Tim Lunn <tim@feathertop.org>
+Acked-by: Heiko Stuebner <heiko@sntech.de>
+Reviewed-by: Andi Shyti <andi.shyti@kernel.org>
+Signed-off-by: Wolfram Sang <wsa@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/i2c/busses/i2c-rk3x.c | 8 ++++++--
+ 1 file changed, 6 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/i2c/busses/i2c-rk3x.c b/drivers/i2c/busses/i2c-rk3x.c
+index 4362db7c5789..086fdf262e7b 100644
+--- a/drivers/i2c/busses/i2c-rk3x.c
++++ b/drivers/i2c/busses/i2c-rk3x.c
+@@ -1295,8 +1295,12 @@ static int rk3x_i2c_probe(struct platform_device *pdev)
+ return -EINVAL;
+ }
+
+- /* 27+i: write mask, 11+i: value */
+- value = BIT(27 + bus_nr) | BIT(11 + bus_nr);
++ /* rv1126 i2c2 uses non-sequential write mask 20, value 4 */
++ if (i2c->soc_data == &rv1126_soc_data && bus_nr == 2)
++ value = BIT(20) | BIT(4);
++ else
++ /* 27+i: write mask, 11+i: value */
++ value = BIT(27 + bus_nr) | BIT(11 + bus_nr);
+
+ ret = regmap_write(grf, i2c->soc_data->grf_offset, value);
+ if (ret != 0) {
+--
+2.43.0
+
--- /dev/null
+From 8b800ac6a6e4ebbf4bea964f56e7b55eb5743047 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 30 Dec 2023 14:41:23 +0530
+Subject: i3c: master: cdns: Update maximum prescaler value for i2c clock
+
+From: Harshit Shah <harshitshah.opendev@gmail.com>
+
+[ Upstream commit 374c13f9080a1b9835a5ed3e7bea93cf8e2dc262 ]
+
+As per the Cadence IP document fixed the I2C clock divider value limit from
+16 bits instead of 10 bits. Without this change setting up the I2C clock to
+low frequencies will not work as the prescaler value might be greater than
+10 bit number.
+
+I3C clock divider value is 10 bits only. Updating the macro names for both.
+
+Signed-off-by: Harshit Shah <harshitshah.opendev@gmail.com>
+Link: https://lore.kernel.org/r/1703927483-28682-1-git-send-email-harshitshah.opendev@gmail.com
+Signed-off-by: Alexandre Belloni <alexandre.belloni@bootlin.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/i3c/master/i3c-master-cdns.c | 7 ++++---
+ 1 file changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/i3c/master/i3c-master-cdns.c b/drivers/i3c/master/i3c-master-cdns.c
+index bcbe8f914149..c1627f3552ce 100644
+--- a/drivers/i3c/master/i3c-master-cdns.c
++++ b/drivers/i3c/master/i3c-master-cdns.c
+@@ -76,7 +76,8 @@
+ #define PRESCL_CTRL0 0x14
+ #define PRESCL_CTRL0_I2C(x) ((x) << 16)
+ #define PRESCL_CTRL0_I3C(x) (x)
+-#define PRESCL_CTRL0_MAX GENMASK(9, 0)
++#define PRESCL_CTRL0_I3C_MAX GENMASK(9, 0)
++#define PRESCL_CTRL0_I2C_MAX GENMASK(15, 0)
+
+ #define PRESCL_CTRL1 0x18
+ #define PRESCL_CTRL1_PP_LOW_MASK GENMASK(15, 8)
+@@ -1233,7 +1234,7 @@ static int cdns_i3c_master_bus_init(struct i3c_master_controller *m)
+ return -EINVAL;
+
+ pres = DIV_ROUND_UP(sysclk_rate, (bus->scl_rate.i3c * 4)) - 1;
+- if (pres > PRESCL_CTRL0_MAX)
++ if (pres > PRESCL_CTRL0_I3C_MAX)
+ return -ERANGE;
+
+ bus->scl_rate.i3c = sysclk_rate / ((pres + 1) * 4);
+@@ -1246,7 +1247,7 @@ static int cdns_i3c_master_bus_init(struct i3c_master_controller *m)
+ max_i2cfreq = bus->scl_rate.i2c;
+
+ pres = (sysclk_rate / (max_i2cfreq * 5)) - 1;
+- if (pres > PRESCL_CTRL0_MAX)
++ if (pres > PRESCL_CTRL0_I2C_MAX)
+ return -ERANGE;
+
+ bus->scl_rate.i2c = sysclk_rate / ((pres + 1) * 5);
+--
+2.43.0
+
--- /dev/null
+From e658497dc0e5cd07066512128bb79e157cf818c4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 15:24:12 +0100
+Subject: i40e: Fix VF disable behavior to block all traffic
+
+From: Andrii Staikov <andrii.staikov@intel.com>
+
+[ Upstream commit 31deb12e85c35ddd2c037f0107d05d8674cab2c0 ]
+
+Currently, if a VF is disabled using the
+'ip link set dev $ETHX vf $VF_NUM state disable' command, the VF is still
+able to receive traffic.
+
+Fix the behavior of the 'ip link set dev $ETHX vf $VF_NUM state disable'
+to completely shutdown the VF's queues making it entirely disabled and
+not able to receive or send any traffic.
+
+Modify the behavior of the 'ip link set $ETHX vf $VF_NUM state enable'
+command to make a VF do reinitialization bringing the queues back up.
+
+Co-developed-by: Aleksandr Loktionov <aleksandr.loktionov@intel.com>
+Signed-off-by: Aleksandr Loktionov <aleksandr.loktionov@intel.com>
+Reviewed-by: Jan Sokolowski <jan.sokolowski@intel.com>
+Reviewed-by: Wojciech Drewek <wojciech.drewek@intel.com>
+Reviewed-by: Przemek Kitszel <przemyslaw.kitszel@intel.com>
+Signed-off-by: Andrii Staikov <andrii.staikov@intel.com>
+Tested-by: Rafal Romanowski <rafal.romanowski@intel.com>
+Signed-off-by: Tony Nguyen <anthony.l.nguyen@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../ethernet/intel/i40e/i40e_virtchnl_pf.c | 32 +++++++++++++++++++
+ .../ethernet/intel/i40e/i40e_virtchnl_pf.h | 1 +
+ 2 files changed, 33 insertions(+)
+
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c
+index de5ec4e6bedf..7db89b294510 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c
++++ b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c
+@@ -2607,6 +2607,14 @@ static int i40e_vc_enable_queues_msg(struct i40e_vf *vf, u8 *msg)
+ int aq_ret = 0;
+ int i;
+
++ if (vf->is_disabled_from_host) {
++ aq_ret = -EPERM;
++ dev_info(&pf->pdev->dev,
++ "Admin has disabled VF %d, will not enable queues\n",
++ vf->vf_id);
++ goto error_param;
++ }
++
+ if (!test_bit(I40E_VF_STATE_ACTIVE, &vf->vf_states)) {
+ aq_ret = -EINVAL;
+ goto error_param;
+@@ -4734,9 +4742,12 @@ int i40e_ndo_set_vf_link_state(struct net_device *netdev, int vf_id, int link)
+ struct i40e_link_status *ls = &pf->hw.phy.link_info;
+ struct virtchnl_pf_event pfe;
+ struct i40e_hw *hw = &pf->hw;
++ struct i40e_vsi *vsi;
++ unsigned long q_map;
+ struct i40e_vf *vf;
+ int abs_vf_id;
+ int ret = 0;
++ int tmp;
+
+ if (test_and_set_bit(__I40E_VIRTCHNL_OP_PENDING, pf->state)) {
+ dev_warn(&pf->pdev->dev, "Unable to configure VFs, other operation is pending.\n");
+@@ -4759,17 +4770,38 @@ int i40e_ndo_set_vf_link_state(struct net_device *netdev, int vf_id, int link)
+ switch (link) {
+ case IFLA_VF_LINK_STATE_AUTO:
+ vf->link_forced = false;
++ vf->is_disabled_from_host = false;
++ /* reset needed to reinit VF resources */
++ i40e_vc_reset_vf(vf, true);
+ i40e_set_vf_link_state(vf, &pfe, ls);
+ break;
+ case IFLA_VF_LINK_STATE_ENABLE:
+ vf->link_forced = true;
+ vf->link_up = true;
++ vf->is_disabled_from_host = false;
++ /* reset needed to reinit VF resources */
++ i40e_vc_reset_vf(vf, true);
+ i40e_set_vf_link_state(vf, &pfe, ls);
+ break;
+ case IFLA_VF_LINK_STATE_DISABLE:
+ vf->link_forced = true;
+ vf->link_up = false;
+ i40e_set_vf_link_state(vf, &pfe, ls);
++
++ vsi = pf->vsi[vf->lan_vsi_idx];
++ q_map = BIT(vsi->num_queue_pairs) - 1;
++
++ vf->is_disabled_from_host = true;
++
++ /* Try to stop both Tx&Rx rings even if one of the calls fails
++ * to ensure we stop the rings even in case of errors.
++ * If any of them returns with an error then the first
++ * error that occurred will be returned.
++ */
++ tmp = i40e_ctrl_vf_tx_rings(vsi, q_map, false);
++ ret = i40e_ctrl_vf_rx_rings(vsi, q_map, false);
++
++ ret = tmp ? tmp : ret;
+ break;
+ default:
+ ret = -EINVAL;
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h
+index 5fd607c0de0a..66f95e2f3146 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h
++++ b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h
+@@ -100,6 +100,7 @@ struct i40e_vf {
+ bool link_forced;
+ bool link_up; /* only valid if VF link is forced */
+ bool spoofchk;
++ bool is_disabled_from_host; /* PF ctrl of VF enable/disable */
+ u16 num_vlan;
+
+ /* ADq related variables */
+--
+2.43.0
+
--- /dev/null
+From 7af68c401b3bcbf1b50cf23741abb519a0653b6e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 09:07:45 +0100
+Subject: IB/ipoib: Fix mcast list locking
+
+From: Daniel Vacek <neelx@redhat.com>
+
+[ Upstream commit 4f973e211b3b1c6d36f7c6a19239d258856749f9 ]
+
+Releasing the `priv->lock` while iterating the `priv->multicast_list` in
+`ipoib_mcast_join_task()` opens a window for `ipoib_mcast_dev_flush()` to
+remove the items while in the middle of iteration. If the mcast is removed
+while the lock was dropped, the for loop spins forever resulting in a hard
+lockup (as was reported on RHEL 4.18.0-372.75.1.el8_6 kernel):
+
+ Task A (kworker/u72:2 below) | Task B (kworker/u72:0 below)
+ -----------------------------------+-----------------------------------
+ ipoib_mcast_join_task(work) | ipoib_ib_dev_flush_light(work)
+ spin_lock_irq(&priv->lock) | __ipoib_ib_dev_flush(priv, ...)
+ list_for_each_entry(mcast, | ipoib_mcast_dev_flush(dev = priv->dev)
+ &priv->multicast_list, list) |
+ ipoib_mcast_join(dev, mcast) |
+ spin_unlock_irq(&priv->lock) |
+ | spin_lock_irqsave(&priv->lock, flags)
+ | list_for_each_entry_safe(mcast, tmcast,
+ | &priv->multicast_list, list)
+ | list_del(&mcast->list);
+ | list_add_tail(&mcast->list, &remove_list)
+ | spin_unlock_irqrestore(&priv->lock, flags)
+ spin_lock_irq(&priv->lock) |
+ | ipoib_mcast_remove_list(&remove_list)
+ (Here, `mcast` is no longer on the | list_for_each_entry_safe(mcast, tmcast,
+ `priv->multicast_list` and we keep | remove_list, list)
+ spinning on the `remove_list` of | >>> wait_for_completion(&mcast->done)
+ the other thread which is blocked |
+ and the list is still valid on |
+ it's stack.)
+
+Fix this by keeping the lock held and changing to GFP_ATOMIC to prevent
+eventual sleeps.
+Unfortunately we could not reproduce the lockup and confirm this fix but
+based on the code review I think this fix should address such lockups.
+
+crash> bc 31
+PID: 747 TASK: ff1c6a1a007e8000 CPU: 31 COMMAND: "kworker/u72:2"
+--
+ [exception RIP: ipoib_mcast_join_task+0x1b1]
+ RIP: ffffffffc0944ac1 RSP: ff646f199a8c7e00 RFLAGS: 00000002
+ RAX: 0000000000000000 RBX: ff1c6a1a04dc82f8 RCX: 0000000000000000
+ work (&priv->mcast_task{,.work})
+ RDX: ff1c6a192d60ac68 RSI: 0000000000000286 RDI: ff1c6a1a04dc8000
+ &mcast->list
+ RBP: ff646f199a8c7e90 R8: ff1c699980019420 R9: ff1c6a1920c9a000
+ R10: ff646f199a8c7e00 R11: ff1c6a191a7d9800 R12: ff1c6a192d60ac00
+ mcast
+ R13: ff1c6a1d82200000 R14: ff1c6a1a04dc8000 R15: ff1c6a1a04dc82d8
+ dev priv (&priv->lock) &priv->multicast_list (aka head)
+ ORIG_RAX: ffffffffffffffff CS: 0010 SS: 0018
+
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/infiniband/ulp/ipoib/ipoib_multicast.c | 6 +-----
+ 1 file changed, 1 insertion(+), 5 deletions(-)
+
+diff --git a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+index 9e6967a40042..319d4288eddd 100644
+--- a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
++++ b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+@@ -531,21 +531,17 @@ static int ipoib_mcast_join(struct net_device *dev, struct ipoib_mcast *mcast)
+ if (test_bit(IPOIB_MCAST_FLAG_SENDONLY, &mcast->flags))
+ rec.join_state = SENDONLY_FULLMEMBER_JOIN;
+ }
+- spin_unlock_irq(&priv->lock);
+
+ multicast = ib_sa_join_multicast(&ipoib_sa_client, priv->ca, priv->port,
+- &rec, comp_mask, GFP_KERNEL,
++ &rec, comp_mask, GFP_ATOMIC,
+ ipoib_mcast_join_complete, mcast);
+- spin_lock_irq(&priv->lock);
+ if (IS_ERR(multicast)) {
+ ret = PTR_ERR(multicast);
+ ipoib_warn(priv, "ib_sa_join_multicast failed, status %d\n", ret);
+ /* Requeue this join task with a backoff delay */
+ __ipoib_mcast_schedule_join_thread(priv, mcast, 1);
+ clear_bit(IPOIB_MCAST_FLAG_BUSY, &mcast->flags);
+- spin_unlock_irq(&priv->lock);
+ complete(&mcast->done);
+- spin_lock_irq(&priv->lock);
+ return ret;
+ }
+ return 0;
+--
+2.43.0
+
--- /dev/null
+From 432363af96504ebc3961d2813fd38e50e35bbb62 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 17:33:17 -0700
+Subject: ice: fix ICE_AQ_VSI_Q_OPT_RSS_* register values
+
+From: Ahmed Zaki <ahmed.zaki@intel.com>
+
+[ Upstream commit 20f73b60bb5c276cee9b1a530f100c677bc74af8 ]
+
+Fix the values of the ICE_AQ_VSI_Q_OPT_RSS_* registers. Shifting is
+already done when the values are used, no need to double shift. Bug was
+not discovered earlier since only ICE_AQ_VSI_Q_OPT_RSS_TPLZ (Zero) is
+currently used.
+
+Also, rename ICE_AQ_VSI_Q_OPT_RSS_XXX to ICE_AQ_VSI_Q_OPT_RSS_HASH_XXX
+for consistency.
+
+Co-developed-by: Jesse Brandeburg <jesse.brandeburg@intel.com>
+Signed-off-by: Jesse Brandeburg <jesse.brandeburg@intel.com>
+Reviewed-by: Wojciech Drewek <wojciech.drewek@intel.com>
+Signed-off-by: Ahmed Zaki <ahmed.zaki@intel.com>
+Link: https://lore.kernel.org/r/20231213003321.605376-5-ahmed.zaki@intel.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/intel/ice/ice_adminq_cmd.h | 8 ++++----
+ drivers/net/ethernet/intel/ice/ice_lib.c | 4 ++--
+ drivers/net/ethernet/intel/ice/ice_virtchnl.c | 12 +++++-------
+ 3 files changed, 11 insertions(+), 13 deletions(-)
+
+diff --git a/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h b/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h
+index fbd5d92182d3..812a35d79b95 100644
+--- a/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h
++++ b/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h
+@@ -491,10 +491,10 @@ struct ice_aqc_vsi_props {
+ #define ICE_AQ_VSI_Q_OPT_RSS_GBL_LUT_M (0xF << ICE_AQ_VSI_Q_OPT_RSS_GBL_LUT_S)
+ #define ICE_AQ_VSI_Q_OPT_RSS_HASH_S 6
+ #define ICE_AQ_VSI_Q_OPT_RSS_HASH_M (0x3 << ICE_AQ_VSI_Q_OPT_RSS_HASH_S)
+-#define ICE_AQ_VSI_Q_OPT_RSS_TPLZ (0x0 << ICE_AQ_VSI_Q_OPT_RSS_HASH_S)
+-#define ICE_AQ_VSI_Q_OPT_RSS_SYM_TPLZ (0x1 << ICE_AQ_VSI_Q_OPT_RSS_HASH_S)
+-#define ICE_AQ_VSI_Q_OPT_RSS_XOR (0x2 << ICE_AQ_VSI_Q_OPT_RSS_HASH_S)
+-#define ICE_AQ_VSI_Q_OPT_RSS_JHASH (0x3 << ICE_AQ_VSI_Q_OPT_RSS_HASH_S)
++#define ICE_AQ_VSI_Q_OPT_RSS_HASH_TPLZ 0x0U
++#define ICE_AQ_VSI_Q_OPT_RSS_HASH_SYM_TPLZ 0x1U
++#define ICE_AQ_VSI_Q_OPT_RSS_HASH_XOR 0x2U
++#define ICE_AQ_VSI_Q_OPT_RSS_HASH_JHASH 0x3U
+ u8 q_opt_tc;
+ #define ICE_AQ_VSI_Q_OPT_TC_OVR_S 0
+ #define ICE_AQ_VSI_Q_OPT_TC_OVR_M (0x1F << ICE_AQ_VSI_Q_OPT_TC_OVR_S)
+diff --git a/drivers/net/ethernet/intel/ice/ice_lib.c b/drivers/net/ethernet/intel/ice/ice_lib.c
+index 1bad6e17f9be..24f95880a2ed 100644
+--- a/drivers/net/ethernet/intel/ice/ice_lib.c
++++ b/drivers/net/ethernet/intel/ice/ice_lib.c
+@@ -1186,12 +1186,12 @@ static void ice_set_rss_vsi_ctx(struct ice_vsi_ctx *ctxt, struct ice_vsi *vsi)
+ case ICE_VSI_PF:
+ /* PF VSI will inherit RSS instance of PF */
+ lut_type = ICE_AQ_VSI_Q_OPT_RSS_LUT_PF;
+- hash_type = ICE_AQ_VSI_Q_OPT_RSS_TPLZ;
++ hash_type = ICE_AQ_VSI_Q_OPT_RSS_HASH_TPLZ;
+ break;
+ case ICE_VSI_VF:
+ /* VF VSI will gets a small RSS table which is a VSI LUT type */
+ lut_type = ICE_AQ_VSI_Q_OPT_RSS_LUT_VSI;
+- hash_type = ICE_AQ_VSI_Q_OPT_RSS_TPLZ;
++ hash_type = ICE_AQ_VSI_Q_OPT_RSS_HASH_TPLZ;
+ break;
+ default:
+ dev_dbg(dev, "Unsupported VSI type %s\n",
+diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl.c b/drivers/net/ethernet/intel/ice/ice_virtchnl.c
+index 1c7b4ded948b..8872f7a4f432 100644
+--- a/drivers/net/ethernet/intel/ice/ice_virtchnl.c
++++ b/drivers/net/ethernet/intel/ice/ice_virtchnl.c
+@@ -823,8 +823,8 @@ static int ice_vc_handle_rss_cfg(struct ice_vf *vf, u8 *msg, bool add)
+ int status;
+
+ lut_type = ICE_AQ_VSI_Q_OPT_RSS_LUT_VSI;
+- hash_type = add ? ICE_AQ_VSI_Q_OPT_RSS_XOR :
+- ICE_AQ_VSI_Q_OPT_RSS_TPLZ;
++ hash_type = add ? ICE_AQ_VSI_Q_OPT_RSS_HASH_XOR :
++ ICE_AQ_VSI_Q_OPT_RSS_HASH_TPLZ;
+
+ ctx = kzalloc(sizeof(*ctx), GFP_KERNEL);
+ if (!ctx) {
+@@ -832,11 +832,9 @@ static int ice_vc_handle_rss_cfg(struct ice_vf *vf, u8 *msg, bool add)
+ goto error_param;
+ }
+
+- ctx->info.q_opt_rss = ((lut_type <<
+- ICE_AQ_VSI_Q_OPT_RSS_LUT_S) &
+- ICE_AQ_VSI_Q_OPT_RSS_LUT_M) |
+- (hash_type &
+- ICE_AQ_VSI_Q_OPT_RSS_HASH_M);
++ ctx->info.q_opt_rss =
++ FIELD_PREP(ICE_AQ_VSI_Q_OPT_RSS_LUT_M, lut_type) |
++ FIELD_PREP(ICE_AQ_VSI_Q_OPT_RSS_HASH_M, hash_type);
+
+ /* Preserve existing queueing option setting */
+ ctx->info.q_opt_rss |= (vsi->info.q_opt_rss &
+--
+2.43.0
+
--- /dev/null
+From ded1eee9fa2a3f5b52a86e2b7b4b33a0409a5cd6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 17:01:06 -0800
+Subject: ice: fix pre-shifted bit usage
+
+From: Jesse Brandeburg <jesse.brandeburg@intel.com>
+
+[ Upstream commit 7173be21ae29ef50ada42fd4464056a9d3f55bb3 ]
+
+While converting to FIELD_PREP() and FIELD_GET(), it was noticed that
+some of the RSS defines had *included* the shift in their definitions.
+This is completely outside of normal, such that a developer could easily
+make a mistake and shift at the usage site (like when using
+FIELD_PREP()).
+
+Rename the defines and set them to the "pre-shifted values" so they
+match the template the driver normally uses for masks and the member
+bits of the mask, which also allows the driver to use FIELD_PREP
+correctly with these values. Use GENMASK() for this changed MASK value.
+
+Do the same for the VLAN EMODE defines as well.
+
+Reviewed-by: Marcin Szycik <marcin.szycik@linux.intel.com>
+Reviewed-by: Simon Horman <horms@kernel.org>
+Signed-off-by: Jesse Brandeburg <jesse.brandeburg@intel.com>
+Tested-by: Pucha Himasekhar Reddy <himasekharx.reddy.pucha@intel.com> (A Contingent worker at Intel)
+Signed-off-by: Tony Nguyen <anthony.l.nguyen@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/intel/ice/ice_adminq_cmd.h | 10 +++++-----
+ drivers/net/ethernet/intel/ice/ice_lib.c | 3 ++-
+ .../net/ethernet/intel/ice/ice_vsi_vlan_lib.c | 16 +++++++++++-----
+ 3 files changed, 18 insertions(+), 11 deletions(-)
+
+diff --git a/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h b/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h
+index 812a35d79b95..b8437c36ff38 100644
+--- a/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h
++++ b/drivers/net/ethernet/intel/ice/ice_adminq_cmd.h
+@@ -421,10 +421,10 @@ struct ice_aqc_vsi_props {
+ #define ICE_AQ_VSI_INNER_VLAN_INSERT_PVID BIT(2)
+ #define ICE_AQ_VSI_INNER_VLAN_EMODE_S 3
+ #define ICE_AQ_VSI_INNER_VLAN_EMODE_M (0x3 << ICE_AQ_VSI_INNER_VLAN_EMODE_S)
+-#define ICE_AQ_VSI_INNER_VLAN_EMODE_STR_BOTH (0x0 << ICE_AQ_VSI_INNER_VLAN_EMODE_S)
+-#define ICE_AQ_VSI_INNER_VLAN_EMODE_STR_UP (0x1 << ICE_AQ_VSI_INNER_VLAN_EMODE_S)
+-#define ICE_AQ_VSI_INNER_VLAN_EMODE_STR (0x2 << ICE_AQ_VSI_INNER_VLAN_EMODE_S)
+-#define ICE_AQ_VSI_INNER_VLAN_EMODE_NOTHING (0x3 << ICE_AQ_VSI_INNER_VLAN_EMODE_S)
++#define ICE_AQ_VSI_INNER_VLAN_EMODE_STR_BOTH 0x0U
++#define ICE_AQ_VSI_INNER_VLAN_EMODE_STR_UP 0x1U
++#define ICE_AQ_VSI_INNER_VLAN_EMODE_STR 0x2U
++#define ICE_AQ_VSI_INNER_VLAN_EMODE_NOTHING 0x3U
+ u8 inner_vlan_reserved2[3];
+ /* ingress egress up sections */
+ __le32 ingress_table; /* bitmap, 3 bits per up */
+@@ -490,7 +490,7 @@ struct ice_aqc_vsi_props {
+ #define ICE_AQ_VSI_Q_OPT_RSS_GBL_LUT_S 2
+ #define ICE_AQ_VSI_Q_OPT_RSS_GBL_LUT_M (0xF << ICE_AQ_VSI_Q_OPT_RSS_GBL_LUT_S)
+ #define ICE_AQ_VSI_Q_OPT_RSS_HASH_S 6
+-#define ICE_AQ_VSI_Q_OPT_RSS_HASH_M (0x3 << ICE_AQ_VSI_Q_OPT_RSS_HASH_S)
++#define ICE_AQ_VSI_Q_OPT_RSS_HASH_M GENMASK(7, 6)
+ #define ICE_AQ_VSI_Q_OPT_RSS_HASH_TPLZ 0x0U
+ #define ICE_AQ_VSI_Q_OPT_RSS_HASH_SYM_TPLZ 0x1U
+ #define ICE_AQ_VSI_Q_OPT_RSS_HASH_XOR 0x2U
+diff --git a/drivers/net/ethernet/intel/ice/ice_lib.c b/drivers/net/ethernet/intel/ice/ice_lib.c
+index 24f95880a2ed..c01950de44ce 100644
+--- a/drivers/net/ethernet/intel/ice/ice_lib.c
++++ b/drivers/net/ethernet/intel/ice/ice_lib.c
+@@ -979,7 +979,8 @@ static void ice_set_dflt_vsi_ctx(struct ice_hw *hw, struct ice_vsi_ctx *ctxt)
+ */
+ if (ice_is_dvm_ena(hw)) {
+ ctxt->info.inner_vlan_flags |=
+- ICE_AQ_VSI_INNER_VLAN_EMODE_NOTHING;
++ FIELD_PREP(ICE_AQ_VSI_INNER_VLAN_EMODE_M,
++ ICE_AQ_VSI_INNER_VLAN_EMODE_NOTHING);
+ ctxt->info.outer_vlan_flags =
+ (ICE_AQ_VSI_OUTER_VLAN_TX_MODE_ALL <<
+ ICE_AQ_VSI_OUTER_VLAN_TX_MODE_S) &
+diff --git a/drivers/net/ethernet/intel/ice/ice_vsi_vlan_lib.c b/drivers/net/ethernet/intel/ice/ice_vsi_vlan_lib.c
+index 76266e709a39..8307902115ff 100644
+--- a/drivers/net/ethernet/intel/ice/ice_vsi_vlan_lib.c
++++ b/drivers/net/ethernet/intel/ice/ice_vsi_vlan_lib.c
+@@ -131,6 +131,7 @@ static int ice_vsi_manage_vlan_stripping(struct ice_vsi *vsi, bool ena)
+ {
+ struct ice_hw *hw = &vsi->back->hw;
+ struct ice_vsi_ctx *ctxt;
++ u8 *ivf;
+ int err;
+
+ /* do not allow modifying VLAN stripping when a port VLAN is configured
+@@ -143,19 +144,24 @@ static int ice_vsi_manage_vlan_stripping(struct ice_vsi *vsi, bool ena)
+ if (!ctxt)
+ return -ENOMEM;
+
++ ivf = &ctxt->info.inner_vlan_flags;
++
+ /* Here we are configuring what the VSI should do with the VLAN tag in
+ * the Rx packet. We can either leave the tag in the packet or put it in
+ * the Rx descriptor.
+ */
+- if (ena)
++ if (ena) {
+ /* Strip VLAN tag from Rx packet and put it in the desc */
+- ctxt->info.inner_vlan_flags = ICE_AQ_VSI_INNER_VLAN_EMODE_STR_BOTH;
+- else
++ *ivf = FIELD_PREP(ICE_AQ_VSI_INNER_VLAN_EMODE_M,
++ ICE_AQ_VSI_INNER_VLAN_EMODE_STR_BOTH);
++ } else {
+ /* Disable stripping. Leave tag in packet */
+- ctxt->info.inner_vlan_flags = ICE_AQ_VSI_INNER_VLAN_EMODE_NOTHING;
++ *ivf = FIELD_PREP(ICE_AQ_VSI_INNER_VLAN_EMODE_M,
++ ICE_AQ_VSI_INNER_VLAN_EMODE_NOTHING);
++ }
+
+ /* Allow all packets untagged/tagged */
+- ctxt->info.inner_vlan_flags |= ICE_AQ_VSI_INNER_VLAN_TX_MODE_ALL;
++ *ivf |= ICE_AQ_VSI_INNER_VLAN_TX_MODE_ALL;
+
+ ctxt->info.valid_sections = cpu_to_le16(ICE_AQ_VSI_PROP_VLAN_VALID);
+
+--
+2.43.0
+
--- /dev/null
+From 38a84c4106a80017219887d1676c1e4b026a706e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 17:01:01 -0800
+Subject: intel: add bit macro includes where needed
+
+From: Jesse Brandeburg <jesse.brandeburg@intel.com>
+
+[ Upstream commit 3314f2097dee43defc20554f961a8b17f4787e2d ]
+
+This series is introducing the use of FIELD_GET and FIELD_PREP which
+requires bitfield.h to be included. Fix all the includes in this one
+change, and rearrange includes into alphabetical order to ease
+readability and future maintenance.
+
+virtchnl.h and it's usage was modified to have it's own includes as it
+should. This required including bits.h for virtchnl.h.
+
+Reviewed-by: Marcin Szycik <marcin.szycik@linux.intel.com>
+Signed-off-by: Jesse Brandeburg <jesse.brandeburg@intel.com>
+Signed-off-by: Tony Nguyen <anthony.l.nguyen@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/intel/e1000/e1000_hw.c | 1 +
+ drivers/net/ethernet/intel/fm10k/fm10k_pf.c | 1 +
+ drivers/net/ethernet/intel/fm10k/fm10k_vf.c | 1 +
+ drivers/net/ethernet/intel/i40e/i40e_common.c | 1 +
+ drivers/net/ethernet/intel/i40e/i40e_dcb.c | 2 ++
+ drivers/net/ethernet/intel/i40e/i40e_nvm.c | 1 +
+ drivers/net/ethernet/intel/iavf/iavf_common.c | 3 +-
+ .../net/ethernet/intel/iavf/iavf_ethtool.c | 5 ++--
+ drivers/net/ethernet/intel/iavf/iavf_fdir.c | 1 +
+ drivers/net/ethernet/intel/iavf/iavf_txrx.c | 1 +
+ drivers/net/ethernet/intel/igb/e1000_i210.c | 4 +--
+ drivers/net/ethernet/intel/igb/e1000_nvm.c | 4 +--
+ drivers/net/ethernet/intel/igb/e1000_phy.c | 4 +--
+ drivers/net/ethernet/intel/igbvf/netdev.c | 28 +++++++++----------
+ drivers/net/ethernet/intel/igc/igc_i225.c | 1 +
+ drivers/net/ethernet/intel/igc/igc_phy.c | 1 +
+ include/linux/avf/virtchnl.h | 1 +
+ 17 files changed, 37 insertions(+), 23 deletions(-)
+
+diff --git a/drivers/net/ethernet/intel/e1000/e1000_hw.c b/drivers/net/ethernet/intel/e1000/e1000_hw.c
+index 4542e2bc28e8..4576511c99f5 100644
+--- a/drivers/net/ethernet/intel/e1000/e1000_hw.c
++++ b/drivers/net/ethernet/intel/e1000/e1000_hw.c
+@@ -5,6 +5,7 @@
+ * Shared functions for accessing and configuring the MAC
+ */
+
++#include <linux/bitfield.h>
+ #include "e1000.h"
+
+ static s32 e1000_check_downshift(struct e1000_hw *hw);
+diff --git a/drivers/net/ethernet/intel/fm10k/fm10k_pf.c b/drivers/net/ethernet/intel/fm10k/fm10k_pf.c
+index af1b0cde3670..ae700a1807c6 100644
+--- a/drivers/net/ethernet/intel/fm10k/fm10k_pf.c
++++ b/drivers/net/ethernet/intel/fm10k/fm10k_pf.c
+@@ -1,6 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2019 Intel Corporation. */
+
++#include <linux/bitfield.h>
+ #include "fm10k_pf.h"
+ #include "fm10k_vf.h"
+
+diff --git a/drivers/net/ethernet/intel/fm10k/fm10k_vf.c b/drivers/net/ethernet/intel/fm10k/fm10k_vf.c
+index dc8ccd378ec9..c50928ec14ff 100644
+--- a/drivers/net/ethernet/intel/fm10k/fm10k_vf.c
++++ b/drivers/net/ethernet/intel/fm10k/fm10k_vf.c
+@@ -1,6 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2019 Intel Corporation. */
+
++#include <linux/bitfield.h>
+ #include "fm10k_vf.h"
+
+ /**
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_common.c b/drivers/net/ethernet/intel/i40e/i40e_common.c
+index d7e24d661724..3eb6564c1cbc 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_common.c
++++ b/drivers/net/ethernet/intel/i40e/i40e_common.c
+@@ -2,6 +2,7 @@
+ /* Copyright(c) 2013 - 2021 Intel Corporation. */
+
+ #include <linux/avf/virtchnl.h>
++#include <linux/bitfield.h>
+ #include <linux/delay.h>
+ #include <linux/etherdevice.h>
+ #include <linux/pci.h>
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_dcb.c b/drivers/net/ethernet/intel/i40e/i40e_dcb.c
+index 68602fc375f6..d57dd30b024f 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_dcb.c
++++ b/drivers/net/ethernet/intel/i40e/i40e_dcb.c
+@@ -1,6 +1,8 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2021 Intel Corporation. */
+
++#include <linux/bitfield.h>
++#include "i40e_adminq.h"
+ #include "i40e_alloc.h"
+ #include "i40e_dcb.h"
+ #include "i40e_prototype.h"
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_nvm.c b/drivers/net/ethernet/intel/i40e/i40e_nvm.c
+index 77cdbfc19d47..e5aec09d58e2 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_nvm.c
++++ b/drivers/net/ethernet/intel/i40e/i40e_nvm.c
+@@ -1,6 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2018 Intel Corporation. */
+
++#include <linux/bitfield.h>
+ #include <linux/delay.h>
+ #include "i40e_alloc.h"
+ #include "i40e_prototype.h"
+diff --git a/drivers/net/ethernet/intel/iavf/iavf_common.c b/drivers/net/ethernet/intel/iavf/iavf_common.c
+index 8091e6feca01..6a10c0ecf2b5 100644
+--- a/drivers/net/ethernet/intel/iavf/iavf_common.c
++++ b/drivers/net/ethernet/intel/iavf/iavf_common.c
+@@ -1,10 +1,11 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2018 Intel Corporation. */
+
++#include <linux/avf/virtchnl.h>
++#include <linux/bitfield.h>
+ #include "iavf_type.h"
+ #include "iavf_adminq.h"
+ #include "iavf_prototype.h"
+-#include <linux/avf/virtchnl.h>
+
+ /**
+ * iavf_aq_str - convert AQ err code to a string
+diff --git a/drivers/net/ethernet/intel/iavf/iavf_ethtool.c b/drivers/net/ethernet/intel/iavf/iavf_ethtool.c
+index dc499fe7734e..25ba5653ac6b 100644
+--- a/drivers/net/ethernet/intel/iavf/iavf_ethtool.c
++++ b/drivers/net/ethernet/intel/iavf/iavf_ethtool.c
+@@ -1,11 +1,12 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2018 Intel Corporation. */
+
++#include <linux/bitfield.h>
++#include <linux/uaccess.h>
++
+ /* ethtool support for iavf */
+ #include "iavf.h"
+
+-#include <linux/uaccess.h>
+-
+ /* ethtool statistics helpers */
+
+ /**
+diff --git a/drivers/net/ethernet/intel/iavf/iavf_fdir.c b/drivers/net/ethernet/intel/iavf/iavf_fdir.c
+index 03e774bd2a5b..65ddcd81c993 100644
+--- a/drivers/net/ethernet/intel/iavf/iavf_fdir.c
++++ b/drivers/net/ethernet/intel/iavf/iavf_fdir.c
+@@ -3,6 +3,7 @@
+
+ /* flow director ethtool support for iavf */
+
++#include <linux/bitfield.h>
+ #include "iavf.h"
+
+ #define GTPU_PORT 2152
+diff --git a/drivers/net/ethernet/intel/iavf/iavf_txrx.c b/drivers/net/ethernet/intel/iavf/iavf_txrx.c
+index d64c4997136b..fb7edba9c2f8 100644
+--- a/drivers/net/ethernet/intel/iavf/iavf_txrx.c
++++ b/drivers/net/ethernet/intel/iavf/iavf_txrx.c
+@@ -1,6 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2013 - 2018 Intel Corporation. */
+
++#include <linux/bitfield.h>
+ #include <linux/prefetch.h>
+
+ #include "iavf.h"
+diff --git a/drivers/net/ethernet/intel/igb/e1000_i210.c b/drivers/net/ethernet/intel/igb/e1000_i210.c
+index b9b9d35494d2..53b396fd194a 100644
+--- a/drivers/net/ethernet/intel/igb/e1000_i210.c
++++ b/drivers/net/ethernet/intel/igb/e1000_i210.c
+@@ -5,9 +5,9 @@
+ * e1000_i211
+ */
+
+-#include <linux/types.h>
++#include <linux/bitfield.h>
+ #include <linux/if_ether.h>
+-
++#include <linux/types.h>
+ #include "e1000_hw.h"
+ #include "e1000_i210.h"
+
+diff --git a/drivers/net/ethernet/intel/igb/e1000_nvm.c b/drivers/net/ethernet/intel/igb/e1000_nvm.c
+index fa136e6e9328..0da57e89593a 100644
+--- a/drivers/net/ethernet/intel/igb/e1000_nvm.c
++++ b/drivers/net/ethernet/intel/igb/e1000_nvm.c
+@@ -1,9 +1,9 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2007 - 2018 Intel Corporation. */
+
+-#include <linux/if_ether.h>
++#include <linux/bitfield.h>
+ #include <linux/delay.h>
+-
++#include <linux/if_ether.h>
+ #include "e1000_mac.h"
+ #include "e1000_nvm.h"
+
+diff --git a/drivers/net/ethernet/intel/igb/e1000_phy.c b/drivers/net/ethernet/intel/igb/e1000_phy.c
+index a018000f7db9..3c1b562a3271 100644
+--- a/drivers/net/ethernet/intel/igb/e1000_phy.c
++++ b/drivers/net/ethernet/intel/igb/e1000_phy.c
+@@ -1,9 +1,9 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright(c) 2007 - 2018 Intel Corporation. */
+
+-#include <linux/if_ether.h>
++#include <linux/bitfield.h>
+ #include <linux/delay.h>
+-
++#include <linux/if_ether.h>
+ #include "e1000_mac.h"
+ #include "e1000_phy.h"
+
+diff --git a/drivers/net/ethernet/intel/igbvf/netdev.c b/drivers/net/ethernet/intel/igbvf/netdev.c
+index fd712585af27..e6c1fbee049e 100644
+--- a/drivers/net/ethernet/intel/igbvf/netdev.c
++++ b/drivers/net/ethernet/intel/igbvf/netdev.c
+@@ -3,25 +3,25 @@
+
+ #define pr_fmt(fmt) KBUILD_MODNAME ": " fmt
+
+-#include <linux/module.h>
+-#include <linux/types.h>
+-#include <linux/init.h>
+-#include <linux/pci.h>
+-#include <linux/vmalloc.h>
+-#include <linux/pagemap.h>
++#include <linux/bitfield.h>
+ #include <linux/delay.h>
+-#include <linux/netdevice.h>
+-#include <linux/tcp.h>
+-#include <linux/ipv6.h>
+-#include <linux/slab.h>
+-#include <net/checksum.h>
+-#include <net/ip6_checksum.h>
+-#include <linux/mii.h>
+ #include <linux/ethtool.h>
+ #include <linux/if_vlan.h>
++#include <linux/init.h>
++#include <linux/ipv6.h>
++#include <linux/mii.h>
++#include <linux/module.h>
++#include <linux/netdevice.h>
++#include <linux/pagemap.h>
++#include <linux/pci.h>
+ #include <linux/prefetch.h>
+ #include <linux/sctp.h>
+-
++#include <linux/slab.h>
++#include <linux/tcp.h>
++#include <linux/types.h>
++#include <linux/vmalloc.h>
++#include <net/checksum.h>
++#include <net/ip6_checksum.h>
+ #include "igbvf.h"
+
+ char igbvf_driver_name[] = "igbvf";
+diff --git a/drivers/net/ethernet/intel/igc/igc_i225.c b/drivers/net/ethernet/intel/igc/igc_i225.c
+index 17546a035ab1..d2562c8e8015 100644
+--- a/drivers/net/ethernet/intel/igc/igc_i225.c
++++ b/drivers/net/ethernet/intel/igc/igc_i225.c
+@@ -1,6 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright (c) 2018 Intel Corporation */
+
++#include <linux/bitfield.h>
+ #include <linux/delay.h>
+
+ #include "igc_hw.h"
+diff --git a/drivers/net/ethernet/intel/igc/igc_phy.c b/drivers/net/ethernet/intel/igc/igc_phy.c
+index 53b77c969c85..d0d9e7170154 100644
+--- a/drivers/net/ethernet/intel/igc/igc_phy.c
++++ b/drivers/net/ethernet/intel/igc/igc_phy.c
+@@ -1,6 +1,7 @@
+ // SPDX-License-Identifier: GPL-2.0
+ /* Copyright (c) 2018 Intel Corporation */
+
++#include <linux/bitfield.h>
+ #include "igc_phy.h"
+
+ /**
+diff --git a/include/linux/avf/virtchnl.h b/include/linux/avf/virtchnl.h
+index 6b3acf15be5c..99ae7960a8d1 100644
+--- a/include/linux/avf/virtchnl.h
++++ b/include/linux/avf/virtchnl.h
+@@ -5,6 +5,7 @@
+ #define _VIRTCHNL_H_
+
+ #include <linux/bitops.h>
++#include <linux/bits.h>
+ #include <linux/overflow.h>
+ #include <uapi/linux/if_ether.h>
+
+--
+2.43.0
+
--- /dev/null
+From 5e07be44282430af4c79482407f8154dbe2a8206 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 10:57:59 -0800
+Subject: ionic: bypass firmware cmds when stuck in reset
+
+From: Shannon Nelson <shannon.nelson@amd.com>
+
+[ Upstream commit ca5fdf9a7c5b65968c718f2be159cda4c13556a1 ]
+
+If the driver or firmware is stuck in reset state, don't bother
+trying to use adminq commands. This speeds up shutdown and
+prevents unnecessary timeouts and error messages.
+
+This includes a bit of rework on ionic_adminq_post_wait()
+and ionic_adminq_post_wait_nomsg() to both use
+__ionic_adminq_post_wait() which can do the checks needed in
+both cases.
+
+Signed-off-by: Shannon Nelson <shannon.nelson@amd.com>
+Reviewed-by: Brett Creeley <brett.creeley@amd.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../ethernet/pensando/ionic/ionic_bus_pci.c | 4 ++++
+ .../net/ethernet/pensando/ionic/ionic_lif.c | 3 +++
+ .../net/ethernet/pensando/ionic/ionic_main.c | 20 ++++++++++++-------
+ 3 files changed, 20 insertions(+), 7 deletions(-)
+
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_bus_pci.c b/drivers/net/ethernet/pensando/ionic/ionic_bus_pci.c
+index d6ce113a4210..fa4237c27e06 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_bus_pci.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_bus_pci.c
+@@ -392,6 +392,10 @@ static void ionic_remove(struct pci_dev *pdev)
+ del_timer_sync(&ionic->watchdog_timer);
+
+ if (ionic->lif) {
++ /* prevent adminq cmds if already known as down */
++ if (test_and_clear_bit(IONIC_LIF_F_FW_RESET, ionic->lif->state))
++ set_bit(IONIC_LIF_F_FW_STOPPING, ionic->lif->state);
++
+ ionic_lif_unregister(ionic->lif);
+ ionic_devlink_unregister(ionic);
+ ionic_lif_deinit(ionic->lif);
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_lif.c b/drivers/net/ethernet/pensando/ionic/ionic_lif.c
+index bad919343180..075e0e3fc2ea 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_lif.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_lif.c
+@@ -3238,6 +3238,9 @@ static void ionic_lif_reset(struct ionic_lif *lif)
+ {
+ struct ionic_dev *idev = &lif->ionic->idev;
+
++ if (!ionic_is_fw_running(idev))
++ return;
++
+ mutex_lock(&lif->ionic->dev_cmd_lock);
+ ionic_dev_cmd_lif_reset(idev, lif->index);
+ ionic_dev_cmd_wait(lif->ionic, DEVCMD_TIMEOUT);
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_main.c b/drivers/net/ethernet/pensando/ionic/ionic_main.c
+index 1b547acfd8e9..83c413a10f79 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_main.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_main.c
+@@ -410,22 +410,28 @@ int ionic_adminq_wait(struct ionic_lif *lif, struct ionic_admin_ctx *ctx,
+ do_msg);
+ }
+
+-int ionic_adminq_post_wait(struct ionic_lif *lif, struct ionic_admin_ctx *ctx)
++static int __ionic_adminq_post_wait(struct ionic_lif *lif,
++ struct ionic_admin_ctx *ctx,
++ const bool do_msg)
+ {
+ int err;
+
++ if (!ionic_is_fw_running(&lif->ionic->idev))
++ return 0;
++
+ err = ionic_adminq_post(lif, ctx);
+
+- return ionic_adminq_wait(lif, ctx, err, true);
++ return ionic_adminq_wait(lif, ctx, err, do_msg);
+ }
+
+-int ionic_adminq_post_wait_nomsg(struct ionic_lif *lif, struct ionic_admin_ctx *ctx)
++int ionic_adminq_post_wait(struct ionic_lif *lif, struct ionic_admin_ctx *ctx)
+ {
+- int err;
+-
+- err = ionic_adminq_post(lif, ctx);
++ return __ionic_adminq_post_wait(lif, ctx, true);
++}
+
+- return ionic_adminq_wait(lif, ctx, err, false);
++int ionic_adminq_post_wait_nomsg(struct ionic_lif *lif, struct ionic_admin_ctx *ctx)
++{
++ return __ionic_adminq_post_wait(lif, ctx, false);
+ }
+
+ static void ionic_dev_cmd_clean(struct ionic *ionic)
+--
+2.43.0
+
--- /dev/null
+From 156e5f68f75abb1dddbad798c1968bf54c8995f4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 10:57:57 -0800
+Subject: ionic: pass opcode to devcmd_wait
+
+From: Shannon Nelson <shannon.nelson@amd.com>
+
+[ Upstream commit 24f110240c03c6b5368f1203bac72883d511e606 ]
+
+Don't rely on the PCI memory for the devcmd opcode because we
+read a 0xff value if the PCI bus is broken, which can cause us
+to report a bogus dev_cmd opcode later.
+
+Signed-off-by: Shannon Nelson <shannon.nelson@amd.com>
+Reviewed-by: Brett Creeley <brett.creeley@amd.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/pensando/ionic/ionic_dev.c | 1 +
+ drivers/net/ethernet/pensando/ionic/ionic_dev.h | 1 +
+ drivers/net/ethernet/pensando/ionic/ionic_main.c | 2 +-
+ 3 files changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_dev.c b/drivers/net/ethernet/pensando/ionic/ionic_dev.c
+index c06576f43916..22ab0a44fa8c 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_dev.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_dev.c
+@@ -321,6 +321,7 @@ void ionic_dev_cmd_comp(struct ionic_dev *idev, union ionic_dev_cmd_comp *comp)
+
+ void ionic_dev_cmd_go(struct ionic_dev *idev, union ionic_dev_cmd *cmd)
+ {
++ idev->opcode = cmd->cmd.opcode;
+ memcpy_toio(&idev->dev_cmd_regs->cmd, cmd, sizeof(*cmd));
+ iowrite32(0, &idev->dev_cmd_regs->done);
+ iowrite32(1, &idev->dev_cmd_regs->doorbell);
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_dev.h b/drivers/net/ethernet/pensando/ionic/ionic_dev.h
+index 9b5463040075..fd112bee4dcf 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_dev.h
++++ b/drivers/net/ethernet/pensando/ionic/ionic_dev.h
+@@ -153,6 +153,7 @@ struct ionic_dev {
+ bool fw_hb_ready;
+ bool fw_status_ready;
+ u8 fw_generation;
++ u8 opcode;
+
+ u64 __iomem *db_pages;
+ dma_addr_t phy_db_pages;
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_main.c b/drivers/net/ethernet/pensando/ionic/ionic_main.c
+index 835577392178..1b547acfd8e9 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_main.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_main.c
+@@ -465,7 +465,7 @@ static int __ionic_dev_cmd_wait(struct ionic *ionic, unsigned long max_seconds,
+ */
+ max_wait = jiffies + (max_seconds * HZ);
+ try_again:
+- opcode = readb(&idev->dev_cmd_regs->cmd.cmd.opcode);
++ opcode = idev->opcode;
+ start_time = jiffies;
+ for (fw_up = ionic_is_fw_running(idev);
+ !done && fw_up && time_before(jiffies, max_wait);
+--
+2.43.0
+
--- /dev/null
+From 6ba476ad575656a68d36a438a0769cd80d13c69d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 17 Oct 2023 17:33:56 +0530
+Subject: jfs: fix array-index-out-of-bounds in dbAdjTree
+
+From: Manas Ghandat <ghandatmanas@gmail.com>
+
+[ Upstream commit 74ecdda68242b174920fe7c6133a856fb7d8559b ]
+
+Currently there is a bound check missing in the dbAdjTree while
+accessing the dmt_stree. To add the required check added the bool is_ctl
+which is required to determine the size as suggest in the following
+commit.
+https://lore.kernel.org/linux-kernel-mentees/f9475918-2186-49b8-b801-6f0f9e75f4fa@oracle.com/
+
+Reported-by: syzbot+39ba34a099ac2e9bd3cb@syzkaller.appspotmail.com
+Closes: https://syzkaller.appspot.com/bug?extid=39ba34a099ac2e9bd3cb
+Signed-off-by: Manas Ghandat <ghandatmanas@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dmap.c | 60 ++++++++++++++++++++++++-----------------------
+ 1 file changed, 31 insertions(+), 29 deletions(-)
+
+diff --git a/fs/jfs/jfs_dmap.c b/fs/jfs/jfs_dmap.c
+index d55f0dd8d754..cb3cda1390ad 100644
+--- a/fs/jfs/jfs_dmap.c
++++ b/fs/jfs/jfs_dmap.c
+@@ -63,10 +63,10 @@
+ */
+ static void dbAllocBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ int nblocks);
+-static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval);
+-static int dbBackSplit(dmtree_t * tp, int leafno);
+-static int dbJoin(dmtree_t * tp, int leafno, int newval);
+-static void dbAdjTree(dmtree_t * tp, int leafno, int newval);
++static void dbSplit(dmtree_t *tp, int leafno, int splitsz, int newval, bool is_ctl);
++static int dbBackSplit(dmtree_t *tp, int leafno, bool is_ctl);
++static int dbJoin(dmtree_t *tp, int leafno, int newval, bool is_ctl);
++static void dbAdjTree(dmtree_t *tp, int leafno, int newval, bool is_ctl);
+ static int dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc,
+ int level);
+ static int dbAllocAny(struct bmap * bmp, s64 nblocks, int l2nb, s64 * results);
+@@ -2103,7 +2103,7 @@ static int dbFreeDmap(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ * system.
+ */
+ if (dp->tree.stree[word] == NOFREE)
+- dbBackSplit((dmtree_t *) & dp->tree, word);
++ dbBackSplit((dmtree_t *)&dp->tree, word, false);
+
+ dbAllocBits(bmp, dp, blkno, nblocks);
+ }
+@@ -2189,7 +2189,7 @@ static void dbAllocBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ * the binary system of the leaves if need be.
+ */
+ dbSplit(tp, word, BUDMIN,
+- dbMaxBud((u8 *) & dp->wmap[word]));
++ dbMaxBud((u8 *)&dp->wmap[word]), false);
+
+ word += 1;
+ } else {
+@@ -2229,7 +2229,7 @@ static void dbAllocBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ * system of the leaves to reflect the current
+ * allocation (size).
+ */
+- dbSplit(tp, word, size, NOFREE);
++ dbSplit(tp, word, size, NOFREE, false);
+
+ /* get the number of dmap words handled */
+ nw = BUDSIZE(size, BUDMIN);
+@@ -2336,7 +2336,7 @@ static int dbFreeBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ /* update the leaf for this dmap word.
+ */
+ rc = dbJoin(tp, word,
+- dbMaxBud((u8 *) & dp->wmap[word]));
++ dbMaxBud((u8 *)&dp->wmap[word]), false);
+ if (rc)
+ return rc;
+
+@@ -2369,7 +2369,7 @@ static int dbFreeBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+
+ /* update the leaf.
+ */
+- rc = dbJoin(tp, word, size);
++ rc = dbJoin(tp, word, size, false);
+ if (rc)
+ return rc;
+
+@@ -2521,16 +2521,16 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ * that it is at the front of a binary buddy system.
+ */
+ if (oldval == NOFREE) {
+- rc = dbBackSplit((dmtree_t *) dcp, leafno);
++ rc = dbBackSplit((dmtree_t *)dcp, leafno, true);
+ if (rc) {
+ release_metapage(mp);
+ return rc;
+ }
+ oldval = dcp->stree[ti];
+ }
+- dbSplit((dmtree_t *) dcp, leafno, dcp->budmin, newval);
++ dbSplit((dmtree_t *) dcp, leafno, dcp->budmin, newval, true);
+ } else {
+- rc = dbJoin((dmtree_t *) dcp, leafno, newval);
++ rc = dbJoin((dmtree_t *) dcp, leafno, newval, true);
+ if (rc) {
+ release_metapage(mp);
+ return rc;
+@@ -2561,7 +2561,7 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ */
+ if (alloc) {
+ dbJoin((dmtree_t *) dcp, leafno,
+- oldval);
++ oldval, true);
+ } else {
+ /* the dbJoin() above might have
+ * caused a larger binary buddy system
+@@ -2571,9 +2571,9 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ */
+ if (dcp->stree[ti] == NOFREE)
+ dbBackSplit((dmtree_t *)
+- dcp, leafno);
++ dcp, leafno, true);
+ dbSplit((dmtree_t *) dcp, leafno,
+- dcp->budmin, oldval);
++ dcp->budmin, oldval, true);
+ }
+
+ /* release the buffer and return the error.
+@@ -2621,7 +2621,7 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ *
+ * serialization: IREAD_LOCK(ipbmap) or IWRITE_LOCK(ipbmap) held on entry/exit;
+ */
+-static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
++static void dbSplit(dmtree_t *tp, int leafno, int splitsz, int newval, bool is_ctl)
+ {
+ int budsz;
+ int cursz;
+@@ -2643,7 +2643,7 @@ static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
+ while (cursz >= splitsz) {
+ /* update the buddy's leaf with its new value.
+ */
+- dbAdjTree(tp, leafno ^ budsz, cursz);
++ dbAdjTree(tp, leafno ^ budsz, cursz, is_ctl);
+
+ /* on to the next size and buddy.
+ */
+@@ -2655,7 +2655,7 @@ static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
+ /* adjust the dmap tree to reflect the specified leaf's new
+ * value.
+ */
+- dbAdjTree(tp, leafno, newval);
++ dbAdjTree(tp, leafno, newval, is_ctl);
+ }
+
+
+@@ -2686,7 +2686,7 @@ static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
+ *
+ * serialization: IREAD_LOCK(ipbmap) or IWRITE_LOCK(ipbmap) held on entry/exit;
+ */
+-static int dbBackSplit(dmtree_t * tp, int leafno)
++static int dbBackSplit(dmtree_t *tp, int leafno, bool is_ctl)
+ {
+ int budsz, bud, w, bsz, size;
+ int cursz;
+@@ -2737,7 +2737,7 @@ static int dbBackSplit(dmtree_t * tp, int leafno)
+ * system in two.
+ */
+ cursz = leaf[bud] - 1;
+- dbSplit(tp, bud, cursz, cursz);
++ dbSplit(tp, bud, cursz, cursz, is_ctl);
+ break;
+ }
+ }
+@@ -2765,7 +2765,7 @@ static int dbBackSplit(dmtree_t * tp, int leafno)
+ *
+ * RETURN VALUES: none
+ */
+-static int dbJoin(dmtree_t * tp, int leafno, int newval)
++static int dbJoin(dmtree_t *tp, int leafno, int newval, bool is_ctl)
+ {
+ int budsz, buddy;
+ s8 *leaf;
+@@ -2820,12 +2820,12 @@ static int dbJoin(dmtree_t * tp, int leafno, int newval)
+ if (leafno < buddy) {
+ /* leafno is the left buddy.
+ */
+- dbAdjTree(tp, buddy, NOFREE);
++ dbAdjTree(tp, buddy, NOFREE, is_ctl);
+ } else {
+ /* buddy is the left buddy and becomes
+ * leafno.
+ */
+- dbAdjTree(tp, leafno, NOFREE);
++ dbAdjTree(tp, leafno, NOFREE, is_ctl);
+ leafno = buddy;
+ }
+
+@@ -2838,7 +2838,7 @@ static int dbJoin(dmtree_t * tp, int leafno, int newval)
+
+ /* update the leaf value.
+ */
+- dbAdjTree(tp, leafno, newval);
++ dbAdjTree(tp, leafno, newval, is_ctl);
+
+ return 0;
+ }
+@@ -2859,21 +2859,23 @@ static int dbJoin(dmtree_t * tp, int leafno, int newval)
+ *
+ * RETURN VALUES: none
+ */
+-static void dbAdjTree(dmtree_t * tp, int leafno, int newval)
++static void dbAdjTree(dmtree_t *tp, int leafno, int newval, bool is_ctl)
+ {
+ int lp, pp, k;
+- int max;
++ int max, size;
++
++ size = is_ctl ? CTLTREESIZE : TREESIZE;
+
+ /* pick up the index of the leaf for this leafno.
+ */
+ lp = leafno + le32_to_cpu(tp->dmt_leafidx);
+
++ if (WARN_ON_ONCE(lp >= size || lp < 0))
++ return;
++
+ /* is the current value the same as the old value ? if so,
+ * there is nothing to do.
+ */
+- if (WARN_ON_ONCE(lp >= CTLTREESIZE))
+- return;
+-
+ if (tp->dmt_stree[lp] == newval)
+ return;
+
+--
+2.43.0
+
--- /dev/null
+From 31d469ebfb376ed172f139910f3b0a5f7d600e66 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 09:36:22 +0800
+Subject: jfs: fix array-index-out-of-bounds in diNewExt
+
+From: Edward Adam Davis <eadavis@qq.com>
+
+[ Upstream commit 49f9637aafa6e63ba686c13cb8549bf5e6920402 ]
+
+[Syz report]
+UBSAN: array-index-out-of-bounds in fs/jfs/jfs_imap.c:2360:2
+index -878706688 is out of range for type 'struct iagctl[128]'
+CPU: 1 PID: 5065 Comm: syz-executor282 Not tainted 6.7.0-rc4-syzkaller-00009-gbee0e7762ad2 #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 11/10/2023
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1e7/0x2d0 lib/dump_stack.c:106
+ ubsan_epilogue lib/ubsan.c:217 [inline]
+ __ubsan_handle_out_of_bounds+0x11c/0x150 lib/ubsan.c:348
+ diNewExt+0x3cf3/0x4000 fs/jfs/jfs_imap.c:2360
+ diAllocExt fs/jfs/jfs_imap.c:1949 [inline]
+ diAllocAG+0xbe8/0x1e50 fs/jfs/jfs_imap.c:1666
+ diAlloc+0x1d3/0x1760 fs/jfs/jfs_imap.c:1587
+ ialloc+0x8f/0x900 fs/jfs/jfs_inode.c:56
+ jfs_mkdir+0x1c5/0xb90 fs/jfs/namei.c:225
+ vfs_mkdir+0x2f1/0x4b0 fs/namei.c:4106
+ do_mkdirat+0x264/0x3a0 fs/namei.c:4129
+ __do_sys_mkdir fs/namei.c:4149 [inline]
+ __se_sys_mkdir fs/namei.c:4147 [inline]
+ __x64_sys_mkdir+0x6e/0x80 fs/namei.c:4147
+ do_syscall_x64 arch/x86/entry/common.c:51 [inline]
+ do_syscall_64+0x45/0x110 arch/x86/entry/common.c:82
+ entry_SYSCALL_64_after_hwframe+0x63/0x6b
+RIP: 0033:0x7fcb7e6a0b57
+Code: ff ff 77 07 31 c0 c3 0f 1f 40 00 48 c7 c2 b8 ff ff ff f7 d8 64 89 02 b8 ff ff ff ff c3 66 0f 1f 44 00 00 b8 53 00 00 00 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b8 ff ff ff f7 d8 64 89 01 48
+RSP: 002b:00007ffd83023038 EFLAGS: 00000286 ORIG_RAX: 0000000000000053
+RAX: ffffffffffffffda RBX: 00000000ffffffff RCX: 00007fcb7e6a0b57
+RDX: 00000000000a1020 RSI: 00000000000001ff RDI: 0000000020000140
+RBP: 0000000020000140 R08: 0000000000000000 R09: 0000000000000000
+R10: 0000000000000000 R11: 0000000000000286 R12: 00007ffd830230d0
+R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000
+
+[Analysis]
+When the agstart is too large, it can cause agno overflow.
+
+[Fix]
+After obtaining agno, if the value is invalid, exit the subsequent process.
+
+Reported-and-tested-by: syzbot+553d90297e6d2f50dbc7@syzkaller.appspotmail.com
+Signed-off-by: Edward Adam Davis <eadavis@qq.com>
+
+Modified the test from agno > MAXAG to agno >= MAXAG based on linux-next
+report by kernel test robot (Dan Carpenter).
+
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_imap.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
+index a037ee59e398..2ec35889ad24 100644
+--- a/fs/jfs/jfs_imap.c
++++ b/fs/jfs/jfs_imap.c
+@@ -2179,6 +2179,9 @@ static int diNewExt(struct inomap * imap, struct iag * iagp, int extno)
+ /* get the ag and iag numbers for this iag.
+ */
+ agno = BLKTOAG(le64_to_cpu(iagp->agstart), sbi);
++ if (agno >= MAXAG || agno < 0)
++ return -EIO;
++
+ iagno = le32_to_cpu(iagp->iagnum);
+
+ /* check if this is the last free extent within the
+--
+2.43.0
+
--- /dev/null
+From 8db5723ca99ed87248cc9916b87fa1f627e7bf40 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 25 Oct 2023 11:39:07 +0530
+Subject: jfs: fix slab-out-of-bounds Read in dtSearch
+
+From: Manas Ghandat <ghandatmanas@gmail.com>
+
+[ Upstream commit fa5492ee89463a7590a1449358002ff7ef63529f ]
+
+Currently while searching for current page in the sorted entry table
+of the page there is a out of bound access. Added a bound check to fix
+the error.
+
+Dave:
+Set return code to -EIO
+
+Reported-by: kernel test robot <lkp@intel.com>
+Reported-by: Dan Carpenter <dan.carpenter@linaro.org>
+Closes: https://lore.kernel.org/r/202310241724.Ed02yUz9-lkp@intel.com/
+Signed-off-by: Manas Ghandat <ghandatmanas@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dtree.c | 5 +++++
+ 1 file changed, 5 insertions(+)
+
+diff --git a/fs/jfs/jfs_dtree.c b/fs/jfs/jfs_dtree.c
+index f3d3e8b3f50c..031d8f570f58 100644
+--- a/fs/jfs/jfs_dtree.c
++++ b/fs/jfs/jfs_dtree.c
+@@ -633,6 +633,11 @@ int dtSearch(struct inode *ip, struct component_name * key, ino_t * data,
+ for (base = 0, lim = p->header.nextindex; lim; lim >>= 1) {
+ index = base + (lim >> 1);
+
++ if (stbl[index] < 0) {
++ rc = -EIO;
++ goto out;
++ }
++
+ if (p->header.flag & BT_LEAF) {
+ /* uppercase leaf name to compare */
+ cmp =
+--
+2.43.0
+
--- /dev/null
+From 9ee0bb10912254002871b50c2ee2c7435ca66e78 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 31 Oct 2023 13:39:04 +0800
+Subject: jfs: fix uaf in jfs_evict_inode
+
+From: Edward Adam Davis <eadavis@qq.com>
+
+[ Upstream commit e0e1958f4c365e380b17ccb35617345b31ef7bf3 ]
+
+When the execution of diMount(ipimap) fails, the object ipimap that has been
+released may be accessed in diFreeSpecial(). Asynchronous ipimap release occurs
+when rcu_core() calls jfs_free_node().
+
+Therefore, when diMount(ipimap) fails, sbi->ipimap should not be initialized as
+ipimap.
+
+Reported-and-tested-by: syzbot+01cf2dbcbe2022454388@syzkaller.appspotmail.com
+Signed-off-by: Edward Adam Davis <eadavis@qq.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_mount.c | 6 +++---
+ 1 file changed, 3 insertions(+), 3 deletions(-)
+
+diff --git a/fs/jfs/jfs_mount.c b/fs/jfs/jfs_mount.c
+index 415eb65a36ff..9b5c6a20b30c 100644
+--- a/fs/jfs/jfs_mount.c
++++ b/fs/jfs/jfs_mount.c
+@@ -172,15 +172,15 @@ int jfs_mount(struct super_block *sb)
+ }
+ jfs_info("jfs_mount: ipimap:0x%p", ipimap);
+
+- /* map further access of per fileset inodes by the fileset inode */
+- sbi->ipimap = ipimap;
+-
+ /* initialize fileset inode allocation map */
+ if ((rc = diMount(ipimap))) {
+ jfs_err("jfs_mount: diMount failed w/rc = %d", rc);
+ goto err_ipimap;
+ }
+
++ /* map further access of per fileset inodes by the fileset inode */
++ sbi->ipimap = ipimap;
++
+ return rc;
+
+ /*
+--
+2.43.0
+
--- /dev/null
+From 0d4f466a6dae533c9c5aeffdf39b3d54662c1719 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 16:13:27 +0100
+Subject: kunit: Reset test->priv after each param iteration
+
+From: Michal Wajdeczko <michal.wajdeczko@intel.com>
+
+[ Upstream commit 342fb9789267ee3908959bfa136b82e88e2ce918 ]
+
+If we run parameterized test that uses test->priv to prepare some
+custom data, then value of test->priv will leak to the next param
+iteration and may be unexpected. This could be easily seen if
+we promote example_priv_test to parameterized test as then only
+first test iteration will be successful:
+
+$ ./tools/testing/kunit/kunit.py run \
+ --kunitconfig ./lib/kunit/.kunitconfig *.example_priv*
+
+[ ] Starting KUnit Kernel (1/1)...
+[ ] ============================================================
+[ ] =================== example (1 subtest) ====================
+[ ] ==================== example_priv_test ====================
+[ ] [PASSED] example value 3
+[ ] # example_priv_test: initializing
+[ ] # example_priv_test: ASSERTION FAILED at lib/kunit/kunit-example-test.c:230
+[ ] Expected test->priv == ((void *)0), but
+[ ] test->priv == 0000000060dfe290
+[ ] ((void *)0) == 0000000000000000
+[ ] # example_priv_test: cleaning up
+[ ] [FAILED] example value 2
+[ ] # example_priv_test: initializing
+[ ] # example_priv_test: ASSERTION FAILED at lib/kunit/kunit-example-test.c:230
+[ ] Expected test->priv == ((void *)0), but
+[ ] test->priv == 0000000060dfe290
+[ ] ((void *)0) == 0000000000000000
+[ ] # example_priv_test: cleaning up
+[ ] [FAILED] example value 1
+[ ] # example_priv_test: initializing
+[ ] # example_priv_test: ASSERTION FAILED at lib/kunit/kunit-example-test.c:230
+[ ] Expected test->priv == ((void *)0), but
+[ ] test->priv == 0000000060dfe290
+[ ] ((void *)0) == 0000000000000000
+[ ] # example_priv_test: cleaning up
+[ ] [FAILED] example value 0
+[ ] # example_priv_test: initializing
+[ ] # example_priv_test: cleaning up
+[ ] # example_priv_test: pass:1 fail:3 skip:0 total:4
+[ ] ================ [FAILED] example_priv_test ================
+[ ] # example: initializing suite
+[ ] # module: kunit_example_test
+[ ] # example: exiting suite
+[ ] # Totals: pass:1 fail:3 skip:0 total:4
+[ ] ===================== [FAILED] example =====================
+
+Fix that by resetting test->priv after each param iteration, in
+similar way what we did for the test->status.
+
+Signed-off-by: Michal Wajdeczko <michal.wajdeczko@intel.com>
+Cc: David Gow <davidgow@google.com>
+Cc: Rae Moar <rmoar@google.com>
+Reviewed-by: David Gow <davidgow@google.com>
+Signed-off-by: Shuah Khan <skhan@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ lib/kunit/test.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/lib/kunit/test.c b/lib/kunit/test.c
+index 7aceb07a1af9..1cdc405daa30 100644
+--- a/lib/kunit/test.c
++++ b/lib/kunit/test.c
+@@ -660,6 +660,7 @@ int kunit_run_tests(struct kunit_suite *suite)
+ test.param_index++;
+ test.status = KUNIT_SUCCESS;
+ test.status_comment[0] = '\0';
++ test.priv = NULL;
+ }
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 87acb27ca73eaf6475240cd3c916c691eb79835a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 21:34:09 +0000
+Subject: kunit: tool: fix parsing of test attributes
+
+From: Rae Moar <rmoar@google.com>
+
+[ Upstream commit 8ae27bc7fff4ef467a7964821a6cedb34a05d3b2 ]
+
+Add parsing of attributes as diagnostic data. Fixes issue with test plan
+being parsed incorrectly as diagnostic data when located after
+suite-level attributes.
+
+Note that if there does not exist a test plan line, the diagnostic lines
+between the suite header and the first result will be saved in the suite
+log rather than the first test case log.
+
+Signed-off-by: Rae Moar <rmoar@google.com>
+Reviewed-by: David Gow <davidgow@google.com>
+Signed-off-by: Shuah Khan <skhan@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/kunit/kunit_parser.py | 4 +++-
+ 1 file changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/tools/testing/kunit/kunit_parser.py b/tools/testing/kunit/kunit_parser.py
+index 79d8832c862a..ce34be15c929 100644
+--- a/tools/testing/kunit/kunit_parser.py
++++ b/tools/testing/kunit/kunit_parser.py
+@@ -450,7 +450,7 @@ def parse_diagnostic(lines: LineStream) -> List[str]:
+ Log of diagnostic lines
+ """
+ log = [] # type: List[str]
+- non_diagnostic_lines = [TEST_RESULT, TEST_HEADER, KTAP_START, TAP_START]
++ non_diagnostic_lines = [TEST_RESULT, TEST_HEADER, KTAP_START, TAP_START, TEST_PLAN]
+ while lines and not any(re.match(lines.peek())
+ for re in non_diagnostic_lines):
+ log.append(lines.pop())
+@@ -726,6 +726,7 @@ def parse_test(lines: LineStream, expected_num: int, log: List[str], is_subtest:
+ # test plan
+ test.name = "main"
+ ktap_line = parse_ktap_header(lines, test)
++ test.log.extend(parse_diagnostic(lines))
+ parse_test_plan(lines, test)
+ parent_test = True
+ else:
+@@ -737,6 +738,7 @@ def parse_test(lines: LineStream, expected_num: int, log: List[str], is_subtest:
+ if parent_test:
+ # If KTAP version line and/or subtest header is found, attempt
+ # to parse test plan and print test header
++ test.log.extend(parse_diagnostic(lines))
+ parse_test_plan(lines, test)
+ print_test_header(test)
+ expected_count = test.expected_count
+--
+2.43.0
+
--- /dev/null
+From a8f3aef248dd649e2c427ef975613d93ddce190a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 18:56:00 +0100
+Subject: KVM: s390: fix setting of fpc register
+
+From: Heiko Carstens <hca@linux.ibm.com>
+
+[ Upstream commit b988b1bb0053c0dcd26187d29ef07566a565cf55 ]
+
+kvm_arch_vcpu_ioctl_set_fpu() allows to set the floating point control
+(fpc) register of a guest cpu. The new value is tested for validity by
+temporarily loading it into the fpc register.
+
+This may lead to corruption of the fpc register of the host process:
+if an interrupt happens while the value is temporarily loaded into the fpc
+register, and within interrupt context floating point or vector registers
+are used, the current fp/vx registers are saved with save_fpu_regs()
+assuming they belong to user space and will be loaded into fp/vx registers
+when returning to user space.
+
+test_fp_ctl() restores the original user space / host process fpc register
+value, however it will be discarded, when returning to user space.
+
+In result the host process will incorrectly continue to run with the value
+that was supposed to be used for a guest cpu.
+
+Fix this by simply removing the test. There is another test right before
+the SIE context is entered which will handles invalid values.
+
+This results in a change of behaviour: invalid values will now be accepted
+instead of that the ioctl fails with -EINVAL. This seems to be acceptable,
+given that this interface is most likely not used anymore, and this is in
+addition the same behaviour implemented with the memory mapped interface
+(replace invalid values with zero) - see sync_regs() in kvm-s390.c.
+
+Reviewed-by: Christian Borntraeger <borntraeger@linux.ibm.com>
+Reviewed-by: Claudio Imbrenda <imbrenda@linux.ibm.com>
+Signed-off-by: Heiko Carstens <hca@linux.ibm.com>
+Signed-off-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/s390/kvm/kvm-s390.c | 5 -----
+ 1 file changed, 5 deletions(-)
+
+diff --git a/arch/s390/kvm/kvm-s390.c b/arch/s390/kvm/kvm-s390.c
+index 7aa0e668488f..16e32174807f 100644
+--- a/arch/s390/kvm/kvm-s390.c
++++ b/arch/s390/kvm/kvm-s390.c
+@@ -4316,10 +4316,6 @@ int kvm_arch_vcpu_ioctl_set_fpu(struct kvm_vcpu *vcpu, struct kvm_fpu *fpu)
+
+ vcpu_load(vcpu);
+
+- if (test_fp_ctl(fpu->fpc)) {
+- ret = -EINVAL;
+- goto out;
+- }
+ vcpu->run->s.regs.fpc = fpu->fpc;
+ if (MACHINE_HAS_VX)
+ convert_fp_to_vx((__vector128 *) vcpu->run->s.regs.vrs,
+@@ -4327,7 +4323,6 @@ int kvm_arch_vcpu_ioctl_set_fpu(struct kvm_vcpu *vcpu, struct kvm_fpu *fpu)
+ else
+ memcpy(vcpu->run->s.regs.fprs, &fpu->fprs, sizeof(fpu->fprs));
+
+-out:
+ vcpu_put(vcpu);
+ return ret;
+ }
+--
+2.43.0
+
--- /dev/null
+From fab298b690fbe7899718295169b9477f13d62069 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 16 Dec 2023 21:05:33 +0100
+Subject: leds: trigger: panic: Don't register panic notifier if creating the
+ trigger failed
+
+From: Heiner Kallweit <hkallweit1@gmail.com>
+
+[ Upstream commit afacb21834bb02785ddb0c3ec197208803b74faa ]
+
+It doesn't make sense to register the panic notifier if creating the
+panic trigger failed.
+
+Signed-off-by: Heiner Kallweit <hkallweit1@gmail.com>
+Link: https://lore.kernel.org/r/8a61e229-5388-46c7-919a-4d18cc7362b2@gmail.com
+Signed-off-by: Lee Jones <lee@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/leds/trigger/ledtrig-panic.c | 5 ++++-
+ 1 file changed, 4 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/leds/trigger/ledtrig-panic.c b/drivers/leds/trigger/ledtrig-panic.c
+index 64abf2e91608..5a6b21bfeb9a 100644
+--- a/drivers/leds/trigger/ledtrig-panic.c
++++ b/drivers/leds/trigger/ledtrig-panic.c
+@@ -64,10 +64,13 @@ static long led_panic_blink(int state)
+
+ static int __init ledtrig_panic_init(void)
+ {
++ led_trigger_register_simple("panic", &trigger);
++ if (!trigger)
++ return -ENOMEM;
++
+ atomic_notifier_chain_register(&panic_notifier_list,
+ &led_trigger_panic_nb);
+
+- led_trigger_register_simple("panic", &trigger);
+ panic_blink = led_panic_blink;
+ return 0;
+ }
+--
+2.43.0
+
--- /dev/null
+From 87de1fa86689b3f82cb7fcc803927baeff1ed32e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 11:39:47 +0800
+Subject: libbpf: Fix NULL pointer dereference in
+ bpf_object__collect_prog_relos
+
+From: Mingyi Zhang <zhangmingyi5@huawei.com>
+
+[ Upstream commit fc3a5534e2a8855427403113cbeb54af5837bbe0 ]
+
+An issue occurred while reading an ELF file in libbpf.c during fuzzing:
+
+ Program received signal SIGSEGV, Segmentation fault.
+ 0x0000000000958e97 in bpf_object.collect_prog_relos () at libbpf.c:4206
+ 4206 in libbpf.c
+ (gdb) bt
+ #0 0x0000000000958e97 in bpf_object.collect_prog_relos () at libbpf.c:4206
+ #1 0x000000000094f9d6 in bpf_object.collect_relos () at libbpf.c:6706
+ #2 0x000000000092bef3 in bpf_object_open () at libbpf.c:7437
+ #3 0x000000000092c046 in bpf_object.open_mem () at libbpf.c:7497
+ #4 0x0000000000924afa in LLVMFuzzerTestOneInput () at fuzz/bpf-object-fuzzer.c:16
+ #5 0x000000000060be11 in testblitz_engine::fuzzer::Fuzzer::run_one ()
+ #6 0x000000000087ad92 in tracing::span::Span::in_scope ()
+ #7 0x00000000006078aa in testblitz_engine::fuzzer::util::walkdir ()
+ #8 0x00000000005f3217 in testblitz_engine::entrypoint::main::{{closure}} ()
+ #9 0x00000000005f2601 in main ()
+ (gdb)
+
+scn_data was null at this code(tools/lib/bpf/src/libbpf.c):
+
+ if (rel->r_offset % BPF_INSN_SZ || rel->r_offset >= scn_data->d_size) {
+
+The scn_data is derived from the code above:
+
+ scn = elf_sec_by_idx(obj, sec_idx);
+ scn_data = elf_sec_data(obj, scn);
+
+ relo_sec_name = elf_sec_str(obj, shdr->sh_name);
+ sec_name = elf_sec_name(obj, scn);
+ if (!relo_sec_name || !sec_name)// don't check whether scn_data is NULL
+ return -EINVAL;
+
+In certain special scenarios, such as reading a malformed ELF file,
+it is possible that scn_data may be a null pointer
+
+Signed-off-by: Mingyi Zhang <zhangmingyi5@huawei.com>
+Signed-off-by: Xin Liu <liuxin350@huawei.com>
+Signed-off-by: Changye Wu <wuchangye@huawei.com>
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Signed-off-by: Daniel Borkmann <daniel@iogearbox.net>
+Acked-by: Daniel Borkmann <daniel@iogearbox.net>
+Link: https://lore.kernel.org/bpf/20231221033947.154564-1-liuxin350@huawei.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/lib/bpf/libbpf.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/tools/lib/bpf/libbpf.c b/tools/lib/bpf/libbpf.c
+index e067be95da3c..df1b550f7460 100644
+--- a/tools/lib/bpf/libbpf.c
++++ b/tools/lib/bpf/libbpf.c
+@@ -4344,6 +4344,8 @@ bpf_object__collect_prog_relos(struct bpf_object *obj, Elf64_Shdr *shdr, Elf_Dat
+
+ scn = elf_sec_by_idx(obj, sec_idx);
+ scn_data = elf_sec_data(obj, scn);
++ if (!scn_data)
++ return -LIBBPF_ERRNO__FORMAT;
+
+ relo_sec_name = elf_sec_str(obj, shdr->sh_name);
+ sec_name = elf_sec_name(obj, scn);
+--
+2.43.0
+
--- /dev/null
+From 36d77a3ffe78f2c56ef7a3157f02e78e824dc730 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 7 Nov 2023 12:15:11 -0800
+Subject: libbpf: Fix potential uninitialized tail padding with
+ LIBBPF_OPTS_RESET
+
+From: Yonghong Song <yonghong.song@linux.dev>
+
+[ Upstream commit 7f7c43693c1b46652cfafb7af67ba31726d6ec4e ]
+
+Martin reported that there is a libbpf complaining of non-zero-value tail
+padding with LIBBPF_OPTS_RESET macro if struct bpf_netkit_opts is modified
+to have a 4-byte tail padding. This only happens to clang compiler.
+The commend line is: ./test_progs -t tc_netkit_multi_links
+Martin and I did some investigation and found this indeed the case and
+the following are the investigation details.
+
+Clang:
+ clang version 18.0.0
+ <I tried clang15/16/17 and they all have similar results>
+
+tools/lib/bpf/libbpf_common.h:
+ #define LIBBPF_OPTS_RESET(NAME, ...) \
+ do { \
+ memset(&NAME, 0, sizeof(NAME)); \
+ NAME = (typeof(NAME)) { \
+ .sz = sizeof(NAME), \
+ __VA_ARGS__ \
+ }; \
+ } while (0)
+
+ #endif
+
+tools/lib/bpf/libbpf.h:
+ struct bpf_netkit_opts {
+ /* size of this struct, for forward/backward compatibility */
+ size_t sz;
+ __u32 flags;
+ __u32 relative_fd;
+ __u32 relative_id;
+ __u64 expected_revision;
+ size_t :0;
+ };
+ #define bpf_netkit_opts__last_field expected_revision
+In the above struct bpf_netkit_opts, there is no tail padding.
+
+prog_tests/tc_netkit.c:
+ static void serial_test_tc_netkit_multi_links_target(int mode, int target)
+ {
+ ...
+ LIBBPF_OPTS(bpf_netkit_opts, optl);
+ ...
+ LIBBPF_OPTS_RESET(optl,
+ .flags = BPF_F_BEFORE,
+ .relative_fd = bpf_program__fd(skel->progs.tc1),
+ );
+ ...
+ }
+
+Let us make the following source change, note that we have a 4-byte
+tailing padding now.
+ diff --git a/tools/lib/bpf/libbpf.h b/tools/lib/bpf/libbpf.h
+ index 6cd9c501624f..0dd83910ae9a 100644
+ --- a/tools/lib/bpf/libbpf.h
+ +++ b/tools/lib/bpf/libbpf.h
+ @@ -803,13 +803,13 @@ bpf_program__attach_tcx(const struct bpf_program *prog, int ifindex,
+ struct bpf_netkit_opts {
+ /* size of this struct, for forward/backward compatibility */
+ size_t sz;
+ - __u32 flags;
+ __u32 relative_fd;
+ __u32 relative_id;
+ __u64 expected_revision;
+ + __u32 flags;
+ size_t :0;
+ };
+ -#define bpf_netkit_opts__last_field expected_revision
+ +#define bpf_netkit_opts__last_field flags
+
+The clang 18 generated asm code looks like below:
+ ; LIBBPF_OPTS_RESET(optl,
+ 55e3: 48 8d 7d 98 leaq -0x68(%rbp), %rdi
+ 55e7: 31 f6 xorl %esi, %esi
+ 55e9: ba 20 00 00 00 movl $0x20, %edx
+ 55ee: e8 00 00 00 00 callq 0x55f3 <serial_test_tc_netkit_multi_links_target+0x18d3>
+ 55f3: 48 c7 85 10 fd ff ff 20 00 00 00 movq $0x20, -0x2f0(%rbp)
+ 55fe: 48 8b 85 68 ff ff ff movq -0x98(%rbp), %rax
+ 5605: 48 8b 78 18 movq 0x18(%rax), %rdi
+ 5609: e8 00 00 00 00 callq 0x560e <serial_test_tc_netkit_multi_links_target+0x18ee>
+ 560e: 89 85 18 fd ff ff movl %eax, -0x2e8(%rbp)
+ 5614: c7 85 1c fd ff ff 00 00 00 00 movl $0x0, -0x2e4(%rbp)
+ 561e: 48 c7 85 20 fd ff ff 00 00 00 00 movq $0x0, -0x2e0(%rbp)
+ 5629: c7 85 28 fd ff ff 08 00 00 00 movl $0x8, -0x2d8(%rbp)
+ 5633: 48 8b 85 10 fd ff ff movq -0x2f0(%rbp), %rax
+ 563a: 48 89 45 98 movq %rax, -0x68(%rbp)
+ 563e: 48 8b 85 18 fd ff ff movq -0x2e8(%rbp), %rax
+ 5645: 48 89 45 a0 movq %rax, -0x60(%rbp)
+ 5649: 48 8b 85 20 fd ff ff movq -0x2e0(%rbp), %rax
+ 5650: 48 89 45 a8 movq %rax, -0x58(%rbp)
+ 5654: 48 8b 85 28 fd ff ff movq -0x2d8(%rbp), %rax
+ 565b: 48 89 45 b0 movq %rax, -0x50(%rbp)
+ ; link = bpf_program__attach_netkit(skel->progs.tc2, ifindex, &optl);
+
+At -O0 level, the clang compiler creates an intermediate copy.
+We have below to store 'flags' with 4-byte store and leave another 4 byte
+in the same 8-byte-aligned storage undefined,
+ 5629: c7 85 28 fd ff ff 08 00 00 00 movl $0x8, -0x2d8(%rbp)
+and later we store 8-byte to the original zero'ed buffer
+ 5654: 48 8b 85 28 fd ff ff movq -0x2d8(%rbp), %rax
+ 565b: 48 89 45 b0 movq %rax, -0x50(%rbp)
+
+This caused a problem as the 4-byte value at [%rbp-0x2dc, %rbp-0x2e0)
+may be garbage.
+
+gcc (gcc 11.4) does not have this issue as it does zeroing struct first before
+doing assignments:
+ ; LIBBPF_OPTS_RESET(optl,
+ 50fd: 48 8d 85 40 fc ff ff leaq -0x3c0(%rbp), %rax
+ 5104: ba 20 00 00 00 movl $0x20, %edx
+ 5109: be 00 00 00 00 movl $0x0, %esi
+ 510e: 48 89 c7 movq %rax, %rdi
+ 5111: e8 00 00 00 00 callq 0x5116 <serial_test_tc_netkit_multi_links_target+0x1522>
+ 5116: 48 8b 45 f0 movq -0x10(%rbp), %rax
+ 511a: 48 8b 40 18 movq 0x18(%rax), %rax
+ 511e: 48 89 c7 movq %rax, %rdi
+ 5121: e8 00 00 00 00 callq 0x5126 <serial_test_tc_netkit_multi_links_target+0x1532>
+ 5126: 48 c7 85 40 fc ff ff 00 00 00 00 movq $0x0, -0x3c0(%rbp)
+ 5131: 48 c7 85 48 fc ff ff 00 00 00 00 movq $0x0, -0x3b8(%rbp)
+ 513c: 48 c7 85 50 fc ff ff 00 00 00 00 movq $0x0, -0x3b0(%rbp)
+ 5147: 48 c7 85 58 fc ff ff 00 00 00 00 movq $0x0, -0x3a8(%rbp)
+ 5152: 48 c7 85 40 fc ff ff 20 00 00 00 movq $0x20, -0x3c0(%rbp)
+ 515d: 89 85 48 fc ff ff movl %eax, -0x3b8(%rbp)
+ 5163: c7 85 58 fc ff ff 08 00 00 00 movl $0x8, -0x3a8(%rbp)
+ ; link = bpf_program__attach_netkit(skel->progs.tc2, ifindex, &optl);
+
+It is not clear how to resolve the compiler code generation as the compiler
+generates correct code w.r.t. how to handle unnamed padding in C standard.
+So this patch changed LIBBPF_OPTS_RESET macro to avoid uninitialized tail
+padding. We already knows LIBBPF_OPTS macro works on both gcc and clang,
+even with tail padding. So LIBBPF_OPTS_RESET is changed to be a
+LIBBPF_OPTS followed by a memcpy(), thus avoiding uninitialized tail padding.
+
+The below is asm code generated with this patch and with clang compiler:
+ ; LIBBPF_OPTS_RESET(optl,
+ 55e3: 48 8d bd 10 fd ff ff leaq -0x2f0(%rbp), %rdi
+ 55ea: 31 f6 xorl %esi, %esi
+ 55ec: ba 20 00 00 00 movl $0x20, %edx
+ 55f1: e8 00 00 00 00 callq 0x55f6 <serial_test_tc_netkit_multi_links_target+0x18d6>
+ 55f6: 48 c7 85 10 fd ff ff 20 00 00 00 movq $0x20, -0x2f0(%rbp)
+ 5601: 48 8b 85 68 ff ff ff movq -0x98(%rbp), %rax
+ 5608: 48 8b 78 18 movq 0x18(%rax), %rdi
+ 560c: e8 00 00 00 00 callq 0x5611 <serial_test_tc_netkit_multi_links_target+0x18f1>
+ 5611: 89 85 18 fd ff ff movl %eax, -0x2e8(%rbp)
+ 5617: c7 85 1c fd ff ff 00 00 00 00 movl $0x0, -0x2e4(%rbp)
+ 5621: 48 c7 85 20 fd ff ff 00 00 00 00 movq $0x0, -0x2e0(%rbp)
+ 562c: c7 85 28 fd ff ff 08 00 00 00 movl $0x8, -0x2d8(%rbp)
+ 5636: 48 8b 85 10 fd ff ff movq -0x2f0(%rbp), %rax
+ 563d: 48 89 45 98 movq %rax, -0x68(%rbp)
+ 5641: 48 8b 85 18 fd ff ff movq -0x2e8(%rbp), %rax
+ 5648: 48 89 45 a0 movq %rax, -0x60(%rbp)
+ 564c: 48 8b 85 20 fd ff ff movq -0x2e0(%rbp), %rax
+ 5653: 48 89 45 a8 movq %rax, -0x58(%rbp)
+ 5657: 48 8b 85 28 fd ff ff movq -0x2d8(%rbp), %rax
+ 565e: 48 89 45 b0 movq %rax, -0x50(%rbp)
+ ; link = bpf_program__attach_netkit(skel->progs.tc2, ifindex, &optl);
+
+In the above code, a temporary buffer is zeroed and then has proper value assigned.
+Finally, values in temporary buffer are copied to the original variable buffer,
+hence tail padding is guaranteed to be 0.
+
+Signed-off-by: Yonghong Song <yonghong.song@linux.dev>
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Tested-by: Martin KaFai Lau <martin.lau@kernel.org>
+Link: https://lore.kernel.org/bpf/20231107201511.2548645-1-yonghong.song@linux.dev
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/lib/bpf/libbpf_common.h | 13 ++++++++-----
+ 1 file changed, 8 insertions(+), 5 deletions(-)
+
+diff --git a/tools/lib/bpf/libbpf_common.h b/tools/lib/bpf/libbpf_common.h
+index b7060f254486..8fe248e14eb6 100644
+--- a/tools/lib/bpf/libbpf_common.h
++++ b/tools/lib/bpf/libbpf_common.h
+@@ -79,11 +79,14 @@
+ */
+ #define LIBBPF_OPTS_RESET(NAME, ...) \
+ do { \
+- memset(&NAME, 0, sizeof(NAME)); \
+- NAME = (typeof(NAME)) { \
+- .sz = sizeof(NAME), \
+- __VA_ARGS__ \
+- }; \
++ typeof(NAME) ___##NAME = ({ \
++ memset(&___##NAME, 0, sizeof(NAME)); \
++ (typeof(NAME)) { \
++ .sz = sizeof(NAME), \
++ __VA_ARGS__ \
++ }; \
++ }); \
++ memcpy(&NAME, &___##NAME, sizeof(NAME)); \
+ } while (0)
+
+ #endif /* __LIBBPF_LIBBPF_COMMON_H */
+--
+2.43.0
+
--- /dev/null
+From 757b4f7bfd535c714afe36c9712af5ea27e2d6cc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 16:05:13 -0800
+Subject: libsubcmd: Fix memory leak in uniq()
+
+From: Ian Rogers <irogers@google.com>
+
+[ Upstream commit ad30469a841b50dbb541df4d6971d891f703c297 ]
+
+uniq() will write one command name over another causing the overwritten
+string to be leaked. Fix by doing a pass that removes duplicates and a
+second that removes the holes.
+
+Signed-off-by: Ian Rogers <irogers@google.com>
+Cc: Adrian Hunter <adrian.hunter@intel.com>
+Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
+Cc: Chenyuan Mi <cymi20@fudan.edu.cn>
+Cc: Ingo Molnar <mingo@redhat.com>
+Cc: Jiri Olsa <jolsa@kernel.org>
+Cc: Mark Rutland <mark.rutland@arm.com>
+Cc: Namhyung Kim <namhyung@kernel.org>
+Cc: Peter Zijlstra <peterz@infradead.org>
+Link: https://lore.kernel.org/r/20231208000515.1693746-1-irogers@google.com
+Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/lib/subcmd/help.c | 18 ++++++++++++++----
+ 1 file changed, 14 insertions(+), 4 deletions(-)
+
+diff --git a/tools/lib/subcmd/help.c b/tools/lib/subcmd/help.c
+index adfbae27dc36..8561b0f01a24 100644
+--- a/tools/lib/subcmd/help.c
++++ b/tools/lib/subcmd/help.c
+@@ -52,11 +52,21 @@ void uniq(struct cmdnames *cmds)
+ if (!cmds->cnt)
+ return;
+
+- for (i = j = 1; i < cmds->cnt; i++)
+- if (strcmp(cmds->names[i]->name, cmds->names[i-1]->name))
+- cmds->names[j++] = cmds->names[i];
+-
++ for (i = 1; i < cmds->cnt; i++) {
++ if (!strcmp(cmds->names[i]->name, cmds->names[i-1]->name))
++ zfree(&cmds->names[i - 1]);
++ }
++ for (i = 0, j = 0; i < cmds->cnt; i++) {
++ if (cmds->names[i]) {
++ if (i == j)
++ j++;
++ else
++ cmds->names[j++] = cmds->names[i];
++ }
++ }
+ cmds->cnt = j;
++ while (j < i)
++ cmds->names[j++] = NULL;
+ }
+
+ void exclude_cmds(struct cmdnames *cmds, struct cmdnames *excludes)
+--
+2.43.0
+
--- /dev/null
+From f70cf400f0157dfb7c70e8f34648ca58077e218d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 19:37:22 +0800
+Subject: mailbox: arm_mhuv2: Fix a bug for mhuv2_sender_interrupt
+
+From: Xiaowu.ding <xiaowu.ding@jaguarmicro.com>
+
+[ Upstream commit ee01c0b4384d19ecc5dfa7db3fd4303f965c3eba ]
+
+Message Handling Unit version is v2.1.
+
+When arm_mhuv2 working with the data protocol transfer mode.
+We have split one mhu into two channels, and every channel
+include four channel windows, the two channels share
+one gic spi interrupt.
+
+There is a problem with the sending scenario.
+
+The first channel will take up 0-3 channel windows, and the second
+channel take up 4-7 channel windows. When the first channel send the
+data, and the receiver will clear all the four channels status.
+Although we only enabled the interrupt on the last channel window with
+register CH_INT_EN,the register CHCOMB_INT_ST0 will be 0xf, not be 0x8.
+Currently we just clear the last channel windows int status with the
+data proctol mode.So after that,the CHCOMB_INT_ST0 status will be 0x7,
+not be the 0x0.
+
+Then the second channel send the data, the receiver read the
+data, clear all the four channel windows status, trigger the sender
+interrupt. But currently the CHCOMB_INT_ST0 register will be 0xf7,
+get_irq_chan_comb function will always return the first channel.
+
+So this patch clear all channel windows int status to avoid this interrupt
+confusion.
+
+Signed-off-by: Xiaowu.ding <xiaowu.ding@jaguarmicro.com>
+Acked-by: Viresh Kumar <viresh.kumar@linaro.org>
+Signed-off-by: Jassi Brar <jaswinder.singh@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/mailbox/arm_mhuv2.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/mailbox/arm_mhuv2.c b/drivers/mailbox/arm_mhuv2.c
+index c6d4957c4da8..0ec21dcdbde7 100644
+--- a/drivers/mailbox/arm_mhuv2.c
++++ b/drivers/mailbox/arm_mhuv2.c
+@@ -553,7 +553,8 @@ static irqreturn_t mhuv2_sender_interrupt(int irq, void *data)
+ priv = chan->con_priv;
+
+ if (!IS_PROTOCOL_DOORBELL(priv)) {
+- writel_relaxed(1, &mhu->send->ch_wn[priv->ch_wn_idx + priv->windows - 1].int_clr);
++ for (i = 0; i < priv->windows; i++)
++ writel_relaxed(1, &mhu->send->ch_wn[priv->ch_wn_idx + i].int_clr);
+
+ if (chan->cl) {
+ mbox_chan_txdone(chan, 0);
+--
+2.43.0
+
--- /dev/null
+From 1cb5b29574fca4a85f289be06aed479afb210c56 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 13 Dec 2023 14:24:31 +0200
+Subject: md: Whenassemble the array, consult the superblock of the freshest
+ device
+
+From: Alex Lyakas <alex.lyakas@zadara.com>
+
+[ Upstream commit dc1cc22ed58f11d58d8553c5ec5f11cbfc3e3039 ]
+
+Upon assembling the array, both kernel and mdadm allow the devices to have event
+counter difference of 1, and still consider them as up-to-date.
+However, a device whose event count is behind by 1, may in fact not be up-to-date,
+and array resync with such a device may cause data corruption.
+To avoid this, consult the superblock of the freshest device about the status
+of a device, whose event counter is behind by 1.
+
+Signed-off-by: Alex Lyakas <alex.lyakas@zadara.com>
+Signed-off-by: Song Liu <song@kernel.org>
+Link: https://lore.kernel.org/r/1702470271-16073-1-git-send-email-alex.lyakas@zadara.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/md/md.c | 54 ++++++++++++++++++++++++++++++++++++++++---------
+ 1 file changed, 44 insertions(+), 10 deletions(-)
+
+diff --git a/drivers/md/md.c b/drivers/md/md.c
+index 22b54788bcea..21b04607d53a 100644
+--- a/drivers/md/md.c
++++ b/drivers/md/md.c
+@@ -1219,6 +1219,7 @@ struct super_type {
+ struct md_rdev *refdev,
+ int minor_version);
+ int (*validate_super)(struct mddev *mddev,
++ struct md_rdev *freshest,
+ struct md_rdev *rdev);
+ void (*sync_super)(struct mddev *mddev,
+ struct md_rdev *rdev);
+@@ -1356,8 +1357,9 @@ static int super_90_load(struct md_rdev *rdev, struct md_rdev *refdev, int minor
+
+ /*
+ * validate_super for 0.90.0
++ * note: we are not using "freshest" for 0.9 superblock
+ */
+-static int super_90_validate(struct mddev *mddev, struct md_rdev *rdev)
++static int super_90_validate(struct mddev *mddev, struct md_rdev *freshest, struct md_rdev *rdev)
+ {
+ mdp_disk_t *desc;
+ mdp_super_t *sb = page_address(rdev->sb_page);
+@@ -1869,7 +1871,7 @@ static int super_1_load(struct md_rdev *rdev, struct md_rdev *refdev, int minor_
+ return ret;
+ }
+
+-static int super_1_validate(struct mddev *mddev, struct md_rdev *rdev)
++static int super_1_validate(struct mddev *mddev, struct md_rdev *freshest, struct md_rdev *rdev)
+ {
+ struct mdp_superblock_1 *sb = page_address(rdev->sb_page);
+ __u64 ev1 = le64_to_cpu(sb->events);
+@@ -1965,13 +1967,15 @@ static int super_1_validate(struct mddev *mddev, struct md_rdev *rdev)
+ }
+ } else if (mddev->pers == NULL) {
+ /* Insist of good event counter while assembling, except for
+- * spares (which don't need an event count) */
+- ++ev1;
++ * spares (which don't need an event count).
++ * Similar to mdadm, we allow event counter difference of 1
++ * from the freshest device.
++ */
+ if (rdev->desc_nr >= 0 &&
+ rdev->desc_nr < le32_to_cpu(sb->max_dev) &&
+ (le16_to_cpu(sb->dev_roles[rdev->desc_nr]) < MD_DISK_ROLE_MAX ||
+ le16_to_cpu(sb->dev_roles[rdev->desc_nr]) == MD_DISK_ROLE_JOURNAL))
+- if (ev1 < mddev->events)
++ if (ev1 + 1 < mddev->events)
+ return -EINVAL;
+ } else if (mddev->bitmap) {
+ /* If adding to array with a bitmap, then we can accept an
+@@ -1992,8 +1996,38 @@ static int super_1_validate(struct mddev *mddev, struct md_rdev *rdev)
+ rdev->desc_nr >= le32_to_cpu(sb->max_dev)) {
+ role = MD_DISK_ROLE_SPARE;
+ rdev->desc_nr = -1;
+- } else
++ } else if (mddev->pers == NULL && freshest && ev1 < mddev->events) {
++ /*
++ * If we are assembling, and our event counter is smaller than the
++ * highest event counter, we cannot trust our superblock about the role.
++ * It could happen that our rdev was marked as Faulty, and all other
++ * superblocks were updated with +1 event counter.
++ * Then, before the next superblock update, which typically happens when
++ * remove_and_add_spares() removes the device from the array, there was
++ * a crash or reboot.
++ * If we allow current rdev without consulting the freshest superblock,
++ * we could cause data corruption.
++ * Note that in this case our event counter is smaller by 1 than the
++ * highest, otherwise, this rdev would not be allowed into array;
++ * both kernel and mdadm allow event counter difference of 1.
++ */
++ struct mdp_superblock_1 *freshest_sb = page_address(freshest->sb_page);
++ u32 freshest_max_dev = le32_to_cpu(freshest_sb->max_dev);
++
++ if (rdev->desc_nr >= freshest_max_dev) {
++ /* this is unexpected, better not proceed */
++ pr_warn("md: %s: rdev[%pg]: desc_nr(%d) >= freshest(%pg)->sb->max_dev(%u)\n",
++ mdname(mddev), rdev->bdev, rdev->desc_nr,
++ freshest->bdev, freshest_max_dev);
++ return -EUCLEAN;
++ }
++
++ role = le16_to_cpu(freshest_sb->dev_roles[rdev->desc_nr]);
++ pr_debug("md: %s: rdev[%pg]: role=%d(0x%x) according to freshest %pg\n",
++ mdname(mddev), rdev->bdev, role, role, freshest->bdev);
++ } else {
+ role = le16_to_cpu(sb->dev_roles[rdev->desc_nr]);
++ }
+ switch(role) {
+ case MD_DISK_ROLE_SPARE: /* spare */
+ break;
+@@ -2900,7 +2934,7 @@ static int add_bound_rdev(struct md_rdev *rdev)
+ * and should be added immediately.
+ */
+ super_types[mddev->major_version].
+- validate_super(mddev, rdev);
++ validate_super(mddev, NULL/*freshest*/, rdev);
+ err = mddev->pers->hot_add_disk(mddev, rdev);
+ if (err) {
+ md_kick_rdev_from_array(rdev);
+@@ -3837,7 +3871,7 @@ static int analyze_sbs(struct mddev *mddev)
+ }
+
+ super_types[mddev->major_version].
+- validate_super(mddev, freshest);
++ validate_super(mddev, NULL/*freshest*/, freshest);
+
+ i = 0;
+ rdev_for_each_safe(rdev, tmp, mddev) {
+@@ -3852,7 +3886,7 @@ static int analyze_sbs(struct mddev *mddev)
+ }
+ if (rdev != freshest) {
+ if (super_types[mddev->major_version].
+- validate_super(mddev, rdev)) {
++ validate_super(mddev, freshest, rdev)) {
+ pr_warn("md: kicking non-fresh %pg from array!\n",
+ rdev->bdev);
+ md_kick_rdev_from_array(rdev);
+@@ -6843,7 +6877,7 @@ int md_add_new_disk(struct mddev *mddev, struct mdu_disk_info_s *info)
+ rdev->saved_raid_disk = rdev->raid_disk;
+ } else
+ super_types[mddev->major_version].
+- validate_super(mddev, rdev);
++ validate_super(mddev, NULL/*freshest*/, rdev);
+ if ((info->state & (1<<MD_DISK_SYNC)) &&
+ rdev->raid_disk != info->raid_disk) {
+ /* This was a hot-add request, but events doesn't
+--
+2.43.0
+
--- /dev/null
+From a128eb81bc74d6158e3535e50b16dc43d1638b2d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 15:33:42 +0800
+Subject: media: amphion: remove mutext lock in condition of wait_event
+
+From: Ming Qian <ming.qian@nxp.com>
+
+[ Upstream commit f9c8ddce2fe3b767582f299d03fc8fb85943568c ]
+
+mutext_lock should not be called in condition of wait_event, otherwise,
+when CONFIG_DEBUG_ATOMIC_SLEEP is enabled, we may meet the following
+warning:
+do not call blocking ops when !TASK_RUNNING; state=2
+WARNING: CPU: 5 PID: 741 at kernel/sched/core.c:9859
+__might_sleep+0x80/0xa4
+Hardware name: Freescale i.MX8QM MEK (DT)
+pstate: 60000005 (nZCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc :
+__might_sleep+0x80/0xa4 lr : __might_sleep+0x80/0xa4 sp : ffffffc0123738a0
+x29: ffffffc0123738a0 x28: ffffffc009194c48 x27: ffffffc00bbc1050
+x26: ffffff8814b282f0 x25: ffffff8814b280d0 x24: ffffff8814b28080
+x23: 0000000000000001 x22: 0000000000000032 x21: ffffffc00bbc1000
+x20: 000000000000011b x19: ffffffc009324670 x18: 00000000fffffffd
+x17: 30303c5b20746120 x16: 74657320323d6574 x15: 617473203b474e49
+x14: 00058b5b8b9aa1f1 x13: ffffffc00903cda0 x12: 00000000d744fcc9
+x11: 000000000000001c x10: 00000000000009a0 x9 : ffffffc0090201f4
+x8 : ffffff8828245000 x7 : 0000000000000001 x6 : 0000000000000001
+x5 : 00000000410fd080 x4 : 0000000000000002 x3 : ffffff8815aab4c8
+x2 : 0000000000000000 x1 : 0000000000000000 x0 : ffffff8828244600
+Call trace:
+ __might_sleep+0x80/0xa4
+ mutex_lock+0x2c/0x80
+ sync_session_response+0x110/0x310
+ vpu_session_send_cmd+0x18c/0x244
+ vpu_session_start+0x38/0x70
+ vdec_start_session+0x1b4/0x3e0
+ vpu_vb2_start_streaming+0xa0/0x1c4
+ vb2_start_streaming+0x74/0x160
+ vb2_core_qbuf+0x488/0x650
+ vb2_qbuf+0x9c/0x100
+ v4l2_m2m_qbuf+0x7c/0x224
+ v4l2_m2m_ioctl_qbuf+0x20/0x2c
+ v4l_qbuf+0x50/0x6c
+ __video_do_ioctl+0x174/0x3f0
+ video_usercopy+0x210/0x7cc
+ video_ioctl2+0x20/0x30
+ v4l2_ioctl+0x48/0x6c
+
+we need to refine check_is_responsed() to remove the mutext_lock, each
+cmd has a monotonically increasing id, and cmds are executed
+sequentially, so we can check the id of the last reponsed cmd, then
+determine whether a command has been responded or not.
+
+Signed-off-by: Ming Qian <ming.qian@nxp.com>
+CC: Xiaolei Wang <xiaolei.wang@windriver.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/platform/amphion/vpu.h | 3 ++-
+ drivers/media/platform/amphion/vpu_cmds.c | 28 ++++++++---------------
+ drivers/media/platform/amphion/vpu_v4l2.c | 1 +
+ 3 files changed, 12 insertions(+), 20 deletions(-)
+
+diff --git a/drivers/media/platform/amphion/vpu.h b/drivers/media/platform/amphion/vpu.h
+index 5a701f64289e..0246cf0ac3a8 100644
+--- a/drivers/media/platform/amphion/vpu.h
++++ b/drivers/media/platform/amphion/vpu.h
+@@ -154,7 +154,6 @@ struct vpu_core {
+ struct vpu_mbox tx_type;
+ struct vpu_mbox tx_data;
+ struct vpu_mbox rx;
+- unsigned long cmd_seq;
+
+ wait_queue_head_t ack_wq;
+ struct completion cmp;
+@@ -253,6 +252,8 @@ struct vpu_inst {
+
+ struct list_head cmd_q;
+ void *pending;
++ unsigned long cmd_seq;
++ atomic_long_t last_response_cmd;
+
+ struct vpu_inst_ops *ops;
+ const struct vpu_format *formats;
+diff --git a/drivers/media/platform/amphion/vpu_cmds.c b/drivers/media/platform/amphion/vpu_cmds.c
+index c2337812573e..5695f5c1cb3e 100644
+--- a/drivers/media/platform/amphion/vpu_cmds.c
++++ b/drivers/media/platform/amphion/vpu_cmds.c
+@@ -32,6 +32,7 @@ struct vpu_cmd_t {
+ struct vpu_cmd_request *request;
+ struct vpu_rpc_event *pkt;
+ unsigned long key;
++ atomic_long_t *last_response_cmd;
+ };
+
+ static struct vpu_cmd_request vpu_cmd_requests[] = {
+@@ -115,6 +116,8 @@ static void vpu_free_cmd(struct vpu_cmd_t *cmd)
+ {
+ if (!cmd)
+ return;
++ if (cmd->last_response_cmd)
++ atomic_long_set(cmd->last_response_cmd, cmd->key);
+ vfree(cmd->pkt);
+ vfree(cmd);
+ }
+@@ -172,7 +175,8 @@ static int vpu_request_cmd(struct vpu_inst *inst, u32 id, void *data,
+ return -ENOMEM;
+
+ mutex_lock(&core->cmd_lock);
+- cmd->key = core->cmd_seq++;
++ cmd->key = ++inst->cmd_seq;
++ cmd->last_response_cmd = &inst->last_response_cmd;
+ if (key)
+ *key = cmd->key;
+ if (sync)
+@@ -246,26 +250,12 @@ void vpu_clear_request(struct vpu_inst *inst)
+
+ static bool check_is_responsed(struct vpu_inst *inst, unsigned long key)
+ {
+- struct vpu_core *core = inst->core;
+- struct vpu_cmd_t *cmd;
+- bool flag = true;
++ unsigned long last_response = atomic_long_read(&inst->last_response_cmd);
+
+- mutex_lock(&core->cmd_lock);
+- cmd = inst->pending;
+- if (cmd && key == cmd->key) {
+- flag = false;
+- goto exit;
+- }
+- list_for_each_entry(cmd, &inst->cmd_q, list) {
+- if (key == cmd->key) {
+- flag = false;
+- break;
+- }
+- }
+-exit:
+- mutex_unlock(&core->cmd_lock);
++ if (key <= last_response && (last_response - key) < (ULONG_MAX >> 1))
++ return true;
+
+- return flag;
++ return false;
+ }
+
+ static int sync_session_response(struct vpu_inst *inst, unsigned long key, long timeout, int try)
+diff --git a/drivers/media/platform/amphion/vpu_v4l2.c b/drivers/media/platform/amphion/vpu_v4l2.c
+index 0f6e4c666440..d7e0de49b3dc 100644
+--- a/drivers/media/platform/amphion/vpu_v4l2.c
++++ b/drivers/media/platform/amphion/vpu_v4l2.c
+@@ -716,6 +716,7 @@ int vpu_v4l2_open(struct file *file, struct vpu_inst *inst)
+ func = &vpu->decoder;
+
+ atomic_set(&inst->ref_count, 0);
++ atomic_long_set(&inst->last_response_cmd, 0);
+ vpu_inst_get(inst);
+ inst->vpu = vpu;
+ inst->core = vpu_request_core(vpu, inst->type);
+--
+2.43.0
+
--- /dev/null
+From fb8f0f05b2036d4028bd5560a94d1255c0c594c9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 20 Oct 2023 17:17:23 +0800
+Subject: media: ddbridge: fix an error code problem in ddb_probe
+
+From: Su Hui <suhui@nfschina.com>
+
+[ Upstream commit 09b4195021be69af1e1936cca995712a6d0f2562 ]
+
+Error code is assigned to 'stat', return 'stat' rather than '-1'.
+
+Signed-off-by: Su Hui <suhui@nfschina.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/pci/ddbridge/ddbridge-main.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/media/pci/ddbridge/ddbridge-main.c b/drivers/media/pci/ddbridge/ddbridge-main.c
+index 91733ab9f58c..363badab7cf0 100644
+--- a/drivers/media/pci/ddbridge/ddbridge-main.c
++++ b/drivers/media/pci/ddbridge/ddbridge-main.c
+@@ -238,7 +238,7 @@ static int ddb_probe(struct pci_dev *pdev,
+ ddb_unmap(dev);
+ pci_set_drvdata(pdev, NULL);
+ pci_disable_device(pdev);
+- return -1;
++ return stat;
+ }
+
+ /****************************************************************************/
+--
+2.43.0
+
--- /dev/null
+From d0e577d735a6134204924c6b4ba65bae8773e87d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 18:29:48 +0530
+Subject: media: i2c: imx335: Fix hblank min/max values
+
+From: Kieran Bingham <kieran.bingham@ideasonboard.com>
+
+[ Upstream commit d7b95ad7a8d56248dfc34f861e445fad7a4004f4 ]
+
+The V4L2_CID_HBLANK control is marked as readonly and can only be a
+single value.
+
+Set the minimum and maximum value to match the mode value.
+
+Reviewed-by: Umang Jain <umang.jain@ideasonboard.com>
+Signed-off-by: Kieran Bingham <kieran.bingham@ideasonboard.com>
+Signed-off-by: Sakari Ailus <sakari.ailus@linux.intel.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/i2c/imx335.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/media/i2c/imx335.c b/drivers/media/i2c/imx335.c
+index ec729126274b..964a81bec5a4 100644
+--- a/drivers/media/i2c/imx335.c
++++ b/drivers/media/i2c/imx335.c
+@@ -962,8 +962,8 @@ static int imx335_init_controls(struct imx335 *imx335)
+ imx335->hblank_ctrl = v4l2_ctrl_new_std(ctrl_hdlr,
+ &imx335_ctrl_ops,
+ V4L2_CID_HBLANK,
+- IMX335_REG_MIN,
+- IMX335_REG_MAX,
++ mode->hblank,
++ mode->hblank,
+ 1, mode->hblank);
+ if (imx335->hblank_ctrl)
+ imx335->hblank_ctrl->flags |= V4L2_CTRL_FLAG_READ_ONLY;
+--
+2.43.0
+
--- /dev/null
+From e46a581723fd34d4854fe51057748b6d737ee941 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 13:39:42 +0100
+Subject: media: ov2740: Fix hts value
+
+From: Hans de Goede <hdegoede@redhat.com>
+
+[ Upstream commit 3735228bbe3511f844e03dfcc4003fadb59dde23 ]
+
+HTS must be more then width, so the 1080 value clearly is wrong,
+this is then corrected with some weird math dividing clocks in
+to_pixels_per_line() which results in the hts getting multiplied by 2,
+resulting in 2160.
+
+Instead just directly set hts to the correct value of 2160 and
+drop to_pixels_per_line().
+
+Signed-off-by: Hans de Goede <hdegoede@redhat.com>
+Signed-off-by: Sakari Ailus <sakari.ailus@linux.intel.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/i2c/ov2740.c | 17 +++--------------
+ 1 file changed, 3 insertions(+), 14 deletions(-)
+
+diff --git a/drivers/media/i2c/ov2740.c b/drivers/media/i2c/ov2740.c
+index 24e468485fbf..6be22586c3d2 100644
+--- a/drivers/media/i2c/ov2740.c
++++ b/drivers/media/i2c/ov2740.c
+@@ -310,7 +310,7 @@ static const struct ov2740_mode supported_modes[] = {
+ {
+ .width = 1932,
+ .height = 1092,
+- .hts = 1080,
++ .hts = 2160,
+ .vts_def = OV2740_VTS_DEF,
+ .vts_min = OV2740_VTS_MIN,
+ .reg_list = {
+@@ -357,15 +357,6 @@ static u64 to_pixel_rate(u32 f_index)
+ return pixel_rate;
+ }
+
+-static u64 to_pixels_per_line(u32 hts, u32 f_index)
+-{
+- u64 ppl = hts * to_pixel_rate(f_index);
+-
+- do_div(ppl, OV2740_SCLK);
+-
+- return ppl;
+-}
+-
+ static int ov2740_read_reg(struct ov2740 *ov2740, u16 reg, u16 len, u32 *val)
+ {
+ struct i2c_client *client = v4l2_get_subdevdata(&ov2740->sd);
+@@ -598,8 +589,7 @@ static int ov2740_init_controls(struct ov2740 *ov2740)
+ V4L2_CID_VBLANK, vblank_min,
+ vblank_max, 1, vblank_default);
+
+- h_blank = to_pixels_per_line(cur_mode->hts, cur_mode->link_freq_index);
+- h_blank -= cur_mode->width;
++ h_blank = cur_mode->hts - cur_mode->width;
+ ov2740->hblank = v4l2_ctrl_new_std(ctrl_hdlr, &ov2740_ctrl_ops,
+ V4L2_CID_HBLANK, h_blank, h_blank, 1,
+ h_blank);
+@@ -842,8 +832,7 @@ static int ov2740_set_format(struct v4l2_subdev *sd,
+ mode->vts_min - mode->height,
+ OV2740_VTS_MAX - mode->height, 1, vblank_def);
+ __v4l2_ctrl_s_ctrl(ov2740->vblank, vblank_def);
+- h_blank = to_pixels_per_line(mode->hts, mode->link_freq_index) -
+- mode->width;
++ h_blank = mode->hts - mode->width;
+ __v4l2_ctrl_modify_range(ov2740->hblank, h_blank, h_blank, 1, h_blank);
+
+ return 0;
+--
+2.43.0
+
--- /dev/null
+From 9792540120e2ea143bbd90a01c4939511d30d38f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 26 Nov 2023 03:37:15 +0200
+Subject: media: renesas: vsp1: Fix references to pad config
+
+From: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+
+[ Upstream commit 30d187cd74874aaf24e1b4a2dd2a64dc850c6b14 ]
+
+V4L2 subdev operations have moved from operating on a
+v4l2_subdev_pad_config to a v4l2_subdev_state a long time ago. Fix
+remaining incorrect references to pad config in function and variable
+names.
+
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Reviewed-by: Jacopo Mondi <jacopo.mondi@ideasonboard.com>
+Signed-off-by: Sakari Ailus <sakari.ailus@linux.intel.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../media/platform/renesas/vsp1/vsp1_brx.c | 40 +++++----
+ .../media/platform/renesas/vsp1/vsp1_clu.c | 3 +-
+ .../media/platform/renesas/vsp1/vsp1_entity.c | 85 +++++++++----------
+ .../media/platform/renesas/vsp1/vsp1_entity.h | 10 +--
+ .../media/platform/renesas/vsp1/vsp1_hgo.c | 4 +-
+ .../media/platform/renesas/vsp1/vsp1_hgt.c | 4 +-
+ .../media/platform/renesas/vsp1/vsp1_histo.c | 24 +++---
+ .../media/platform/renesas/vsp1/vsp1_hsit.c | 11 ++-
+ .../media/platform/renesas/vsp1/vsp1_lif.c | 2 +-
+ .../media/platform/renesas/vsp1/vsp1_rpf.c | 8 +-
+ .../media/platform/renesas/vsp1/vsp1_rwpf.c | 37 ++++----
+ .../media/platform/renesas/vsp1/vsp1_sru.c | 36 ++++----
+ .../media/platform/renesas/vsp1/vsp1_uds.c | 39 ++++-----
+ .../media/platform/renesas/vsp1/vsp1_uif.c | 24 +++---
+ .../media/platform/renesas/vsp1/vsp1_video.c | 4 +-
+ .../media/platform/renesas/vsp1/vsp1_wpf.c | 10 +--
+ 16 files changed, 162 insertions(+), 179 deletions(-)
+
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_brx.c b/drivers/media/platform/renesas/vsp1/vsp1_brx.c
+index 89385b4cabe5..23e815cea825 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_brx.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_brx.c
+@@ -136,29 +136,28 @@ static int brx_set_format(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_format *fmt)
+ {
+ struct vsp1_brx *brx = to_brx(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+ mutex_lock(&brx->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&brx->entity, sd_state,
+- fmt->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&brx->entity, sd_state, fmt->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+- brx_try_format(brx, config, fmt->pad, &fmt->format);
++ brx_try_format(brx, state, fmt->pad, &fmt->format);
+
+- format = vsp1_entity_get_pad_format(&brx->entity, config, fmt->pad);
++ format = vsp1_entity_get_pad_format(&brx->entity, state, fmt->pad);
+ *format = fmt->format;
+
+ /* Reset the compose rectangle. */
+ if (fmt->pad != brx->entity.source_pad) {
+ struct v4l2_rect *compose;
+
+- compose = brx_get_compose(brx, config, fmt->pad);
++ compose = brx_get_compose(brx, state, fmt->pad);
+ compose->left = 0;
+ compose->top = 0;
+ compose->width = format->width;
+@@ -171,7 +170,7 @@ static int brx_set_format(struct v4l2_subdev *subdev,
+
+ for (i = 0; i <= brx->entity.source_pad; ++i) {
+ format = vsp1_entity_get_pad_format(&brx->entity,
+- config, i);
++ state, i);
+ format->code = fmt->format.code;
+ }
+ }
+@@ -186,7 +185,7 @@ static int brx_get_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_brx *brx = to_brx(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+
+ if (sel->pad == brx->entity.source_pad)
+ return -EINVAL;
+@@ -200,13 +199,13 @@ static int brx_get_selection(struct v4l2_subdev *subdev,
+ return 0;
+
+ case V4L2_SEL_TGT_COMPOSE:
+- config = vsp1_entity_get_pad_config(&brx->entity, sd_state,
+- sel->which);
+- if (!config)
++ state = vsp1_entity_get_state(&brx->entity, sd_state,
++ sel->which);
++ if (!state)
+ return -EINVAL;
+
+ mutex_lock(&brx->entity.lock);
+- sel->r = *brx_get_compose(brx, config, sel->pad);
++ sel->r = *brx_get_compose(brx, state, sel->pad);
+ mutex_unlock(&brx->entity.lock);
+ return 0;
+
+@@ -220,7 +219,7 @@ static int brx_set_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_brx *brx = to_brx(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ struct v4l2_rect *compose;
+ int ret = 0;
+@@ -233,9 +232,8 @@ static int brx_set_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&brx->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&brx->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&brx->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+@@ -244,7 +242,7 @@ static int brx_set_selection(struct v4l2_subdev *subdev,
+ * The compose rectangle top left corner must be inside the output
+ * frame.
+ */
+- format = vsp1_entity_get_pad_format(&brx->entity, config,
++ format = vsp1_entity_get_pad_format(&brx->entity, state,
+ brx->entity.source_pad);
+ sel->r.left = clamp_t(unsigned int, sel->r.left, 0, format->width - 1);
+ sel->r.top = clamp_t(unsigned int, sel->r.top, 0, format->height - 1);
+@@ -253,11 +251,11 @@ static int brx_set_selection(struct v4l2_subdev *subdev,
+ * Scaling isn't supported, the compose rectangle size must be identical
+ * to the sink format size.
+ */
+- format = vsp1_entity_get_pad_format(&brx->entity, config, sel->pad);
++ format = vsp1_entity_get_pad_format(&brx->entity, state, sel->pad);
+ sel->r.width = format->width;
+ sel->r.height = format->height;
+
+- compose = brx_get_compose(brx, config, sel->pad);
++ compose = brx_get_compose(brx, state, sel->pad);
+ *compose = sel->r;
+
+ done:
+@@ -293,7 +291,7 @@ static void brx_configure_stream(struct vsp1_entity *entity,
+ unsigned int flags;
+ unsigned int i;
+
+- format = vsp1_entity_get_pad_format(&brx->entity, brx->entity.config,
++ format = vsp1_entity_get_pad_format(&brx->entity, brx->entity.state,
+ brx->entity.source_pad);
+
+ /*
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_clu.c b/drivers/media/platform/renesas/vsp1/vsp1_clu.c
+index c5217fee24f1..50a5c0dc0e86 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_clu.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_clu.c
+@@ -182,8 +182,7 @@ static void clu_configure_stream(struct vsp1_entity *entity,
+ * The yuv_mode can't be changed during streaming. Cache it internally
+ * for future runtime configuration calls.
+ */
+- format = vsp1_entity_get_pad_format(&clu->entity,
+- clu->entity.config,
++ format = vsp1_entity_get_pad_format(&clu->entity, clu->entity.state,
+ CLU_PAD_SINK);
+ clu->yuv_mode = format->code == MEDIA_BUS_FMT_AYUV8_1X32;
+ }
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_entity.c b/drivers/media/platform/renesas/vsp1/vsp1_entity.c
+index c31f05a80bb5..47413f5c4824 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_entity.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_entity.c
+@@ -101,27 +101,26 @@ void vsp1_entity_configure_partition(struct vsp1_entity *entity,
+ */
+
+ /**
+- * vsp1_entity_get_pad_config - Get the pad configuration for an entity
++ * vsp1_entity_get_state - Get the subdev state for an entity
+ * @entity: the entity
+ * @sd_state: the TRY state
+- * @which: configuration selector (ACTIVE or TRY)
++ * @which: state selector (ACTIVE or TRY)
+ *
+ * When called with which set to V4L2_SUBDEV_FORMAT_ACTIVE the caller must hold
+ * the entity lock to access the returned configuration.
+ *
+- * Return the pad configuration requested by the which argument. The TRY
+- * configuration is passed explicitly to the function through the cfg argument
+- * and simply returned when requested. The ACTIVE configuration comes from the
+- * entity structure.
++ * Return the subdev state requested by the which argument. The TRY state is
++ * passed explicitly to the function through the sd_state argument and simply
++ * returned when requested. The ACTIVE state comes from the entity structure.
+ */
+ struct v4l2_subdev_state *
+-vsp1_entity_get_pad_config(struct vsp1_entity *entity,
+- struct v4l2_subdev_state *sd_state,
+- enum v4l2_subdev_format_whence which)
++vsp1_entity_get_state(struct vsp1_entity *entity,
++ struct v4l2_subdev_state *sd_state,
++ enum v4l2_subdev_format_whence which)
+ {
+ switch (which) {
+ case V4L2_SUBDEV_FORMAT_ACTIVE:
+- return entity->config;
++ return entity->state;
+ case V4L2_SUBDEV_FORMAT_TRY:
+ default:
+ return sd_state;
+@@ -176,10 +175,11 @@ vsp1_entity_get_pad_selection(struct vsp1_entity *entity,
+ /*
+ * vsp1_entity_init_cfg - Initialize formats on all pads
+ * @subdev: V4L2 subdevice
+- * @cfg: V4L2 subdev pad configuration
++ * @sd_state: V4L2 subdev state
+ *
+- * Initialize all pad formats with default values in the given pad config. This
+- * function can be used as a handler for the subdev pad::init_cfg operation.
++ * Initialize all pad formats with default values in the given subdev state.
++ * This function can be used as a handler for the subdev pad::init_cfg
++ * operation.
+ */
+ int vsp1_entity_init_cfg(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_state *sd_state)
+@@ -202,7 +202,7 @@ int vsp1_entity_init_cfg(struct v4l2_subdev *subdev,
+ /*
+ * vsp1_subdev_get_pad_format - Subdev pad get_fmt handler
+ * @subdev: V4L2 subdevice
+- * @cfg: V4L2 subdev pad configuration
++ * @sd_state: V4L2 subdev state
+ * @fmt: V4L2 subdev format
+ *
+ * This function implements the subdev get_fmt pad operation. It can be used as
+@@ -213,14 +213,14 @@ int vsp1_subdev_get_pad_format(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_format *fmt)
+ {
+ struct vsp1_entity *entity = to_vsp1_entity(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+
+- config = vsp1_entity_get_pad_config(entity, sd_state, fmt->which);
+- if (!config)
++ state = vsp1_entity_get_state(entity, sd_state, fmt->which);
++ if (!state)
+ return -EINVAL;
+
+ mutex_lock(&entity->lock);
+- fmt->format = *vsp1_entity_get_pad_format(entity, config, fmt->pad);
++ fmt->format = *vsp1_entity_get_pad_format(entity, state, fmt->pad);
+ mutex_unlock(&entity->lock);
+
+ return 0;
+@@ -229,7 +229,7 @@ int vsp1_subdev_get_pad_format(struct v4l2_subdev *subdev,
+ /*
+ * vsp1_subdev_enum_mbus_code - Subdev pad enum_mbus_code handler
+ * @subdev: V4L2 subdevice
+- * @cfg: V4L2 subdev pad configuration
++ * @sd_state: V4L2 subdev state
+ * @code: Media bus code enumeration
+ * @codes: Array of supported media bus codes
+ * @ncodes: Number of supported media bus codes
+@@ -252,7 +252,7 @@ int vsp1_subdev_enum_mbus_code(struct v4l2_subdev *subdev,
+
+ code->code = codes[code->index];
+ } else {
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+
+ /*
+@@ -262,13 +262,12 @@ int vsp1_subdev_enum_mbus_code(struct v4l2_subdev *subdev,
+ if (code->index)
+ return -EINVAL;
+
+- config = vsp1_entity_get_pad_config(entity, sd_state,
+- code->which);
+- if (!config)
++ state = vsp1_entity_get_state(entity, sd_state, code->which);
++ if (!state)
+ return -EINVAL;
+
+ mutex_lock(&entity->lock);
+- format = vsp1_entity_get_pad_format(entity, config, 0);
++ format = vsp1_entity_get_pad_format(entity, state, 0);
+ code->code = format->code;
+ mutex_unlock(&entity->lock);
+ }
+@@ -279,7 +278,7 @@ int vsp1_subdev_enum_mbus_code(struct v4l2_subdev *subdev,
+ /*
+ * vsp1_subdev_enum_frame_size - Subdev pad enum_frame_size handler
+ * @subdev: V4L2 subdevice
+- * @cfg: V4L2 subdev pad configuration
++ * @sd_state: V4L2 subdev state
+ * @fse: Frame size enumeration
+ * @min_width: Minimum image width
+ * @min_height: Minimum image height
+@@ -298,15 +297,15 @@ int vsp1_subdev_enum_frame_size(struct v4l2_subdev *subdev,
+ unsigned int max_width, unsigned int max_height)
+ {
+ struct vsp1_entity *entity = to_vsp1_entity(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+- config = vsp1_entity_get_pad_config(entity, sd_state, fse->which);
+- if (!config)
++ state = vsp1_entity_get_state(entity, sd_state, fse->which);
++ if (!state)
+ return -EINVAL;
+
+- format = vsp1_entity_get_pad_format(entity, config, fse->pad);
++ format = vsp1_entity_get_pad_format(entity, state, fse->pad);
+
+ mutex_lock(&entity->lock);
+
+@@ -339,7 +338,7 @@ int vsp1_subdev_enum_frame_size(struct v4l2_subdev *subdev,
+ /*
+ * vsp1_subdev_set_pad_format - Subdev pad set_fmt handler
+ * @subdev: V4L2 subdevice
+- * @cfg: V4L2 subdev pad configuration
++ * @sd_state: V4L2 subdev state
+ * @fmt: V4L2 subdev format
+ * @codes: Array of supported media bus codes
+ * @ncodes: Number of supported media bus codes
+@@ -362,7 +361,7 @@ int vsp1_subdev_set_pad_format(struct v4l2_subdev *subdev,
+ unsigned int max_width, unsigned int max_height)
+ {
+ struct vsp1_entity *entity = to_vsp1_entity(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ struct v4l2_rect *selection;
+ unsigned int i;
+@@ -370,13 +369,13 @@ int vsp1_subdev_set_pad_format(struct v4l2_subdev *subdev,
+
+ mutex_lock(&entity->lock);
+
+- config = vsp1_entity_get_pad_config(entity, sd_state, fmt->which);
+- if (!config) {
++ state = vsp1_entity_get_state(entity, sd_state, fmt->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+- format = vsp1_entity_get_pad_format(entity, config, fmt->pad);
++ format = vsp1_entity_get_pad_format(entity, state, fmt->pad);
+
+ if (fmt->pad == entity->source_pad) {
+ /* The output format can't be modified. */
+@@ -404,18 +403,18 @@ int vsp1_subdev_set_pad_format(struct v4l2_subdev *subdev,
+ fmt->format = *format;
+
+ /* Propagate the format to the source pad. */
+- format = vsp1_entity_get_pad_format(entity, config, entity->source_pad);
++ format = vsp1_entity_get_pad_format(entity, state, entity->source_pad);
+ *format = fmt->format;
+
+ /* Reset the crop and compose rectangles. */
+- selection = vsp1_entity_get_pad_selection(entity, config, fmt->pad,
++ selection = vsp1_entity_get_pad_selection(entity, state, fmt->pad,
+ V4L2_SEL_TGT_CROP);
+ selection->left = 0;
+ selection->top = 0;
+ selection->width = format->width;
+ selection->height = format->height;
+
+- selection = vsp1_entity_get_pad_selection(entity, config, fmt->pad,
++ selection = vsp1_entity_get_pad_selection(entity, state, fmt->pad,
+ V4L2_SEL_TGT_COMPOSE);
+ selection->left = 0;
+ selection->top = 0;
+@@ -672,18 +671,18 @@ int vsp1_entity_init(struct vsp1_device *vsp1, struct vsp1_entity *entity,
+ vsp1_entity_init_cfg(subdev, NULL);
+
+ /*
+- * Allocate the pad configuration to store formats and selection
++ * Allocate the subdev state to store formats and selection
+ * rectangles.
+ */
+ /*
+ * FIXME: Drop this call, drivers are not supposed to use
+ * __v4l2_subdev_state_alloc().
+ */
+- entity->config = __v4l2_subdev_state_alloc(&entity->subdev,
+- "vsp1:config->lock", &key);
+- if (IS_ERR(entity->config)) {
++ entity->state = __v4l2_subdev_state_alloc(&entity->subdev,
++ "vsp1:state->lock", &key);
++ if (IS_ERR(entity->state)) {
+ media_entity_cleanup(&entity->subdev.entity);
+- return PTR_ERR(entity->config);
++ return PTR_ERR(entity->state);
+ }
+
+ return 0;
+@@ -695,6 +694,6 @@ void vsp1_entity_destroy(struct vsp1_entity *entity)
+ entity->ops->destroy(entity);
+ if (entity->subdev.ctrl_handler)
+ v4l2_ctrl_handler_free(entity->subdev.ctrl_handler);
+- __v4l2_subdev_state_free(entity->config);
++ __v4l2_subdev_state_free(entity->state);
+ media_entity_cleanup(&entity->subdev.entity);
+ }
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_entity.h b/drivers/media/platform/renesas/vsp1/vsp1_entity.h
+index 17f98a6a972e..8c737cadee81 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_entity.h
++++ b/drivers/media/platform/renesas/vsp1/vsp1_entity.h
+@@ -115,9 +115,9 @@ struct vsp1_entity {
+ unsigned int sink_pad;
+
+ struct v4l2_subdev subdev;
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+
+- struct mutex lock; /* Protects the pad config */
++ struct mutex lock; /* Protects the state */
+ };
+
+ static inline struct vsp1_entity *to_vsp1_entity(struct v4l2_subdev *subdev)
+@@ -135,9 +135,9 @@ int vsp1_entity_link_setup(struct media_entity *entity,
+ const struct media_pad *remote, u32 flags);
+
+ struct v4l2_subdev_state *
+-vsp1_entity_get_pad_config(struct vsp1_entity *entity,
+- struct v4l2_subdev_state *sd_state,
+- enum v4l2_subdev_format_whence which);
++vsp1_entity_get_state(struct vsp1_entity *entity,
++ struct v4l2_subdev_state *sd_state,
++ enum v4l2_subdev_format_whence which);
+ struct v4l2_mbus_framefmt *
+ vsp1_entity_get_pad_format(struct vsp1_entity *entity,
+ struct v4l2_subdev_state *sd_state,
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_hgo.c b/drivers/media/platform/renesas/vsp1/vsp1_hgo.c
+index e6492deb0a64..40c571a987ef 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_hgo.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_hgo.c
+@@ -140,9 +140,9 @@ static void hgo_configure_stream(struct vsp1_entity *entity,
+ unsigned int hratio;
+ unsigned int vratio;
+
+- crop = vsp1_entity_get_pad_selection(entity, entity->config,
++ crop = vsp1_entity_get_pad_selection(entity, entity->state,
+ HISTO_PAD_SINK, V4L2_SEL_TGT_CROP);
+- compose = vsp1_entity_get_pad_selection(entity, entity->config,
++ compose = vsp1_entity_get_pad_selection(entity, entity->state,
+ HISTO_PAD_SINK,
+ V4L2_SEL_TGT_COMPOSE);
+
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_hgt.c b/drivers/media/platform/renesas/vsp1/vsp1_hgt.c
+index aa1c718e0453..8281b86874ab 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_hgt.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_hgt.c
+@@ -139,9 +139,9 @@ static void hgt_configure_stream(struct vsp1_entity *entity,
+ u8 upper;
+ unsigned int i;
+
+- crop = vsp1_entity_get_pad_selection(entity, entity->config,
++ crop = vsp1_entity_get_pad_selection(entity, entity->state,
+ HISTO_PAD_SINK, V4L2_SEL_TGT_CROP);
+- compose = vsp1_entity_get_pad_selection(entity, entity->config,
++ compose = vsp1_entity_get_pad_selection(entity, entity->state,
+ HISTO_PAD_SINK,
+ V4L2_SEL_TGT_COMPOSE);
+
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_histo.c b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+index f22449dd654c..71155282ca11 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_histo.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+@@ -203,7 +203,7 @@ static int histo_get_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_histogram *histo = subdev_to_histo(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ struct v4l2_rect *crop;
+ int ret = 0;
+@@ -213,9 +213,8 @@ static int histo_get_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&histo->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&histo->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&histo->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+@@ -223,7 +222,7 @@ static int histo_get_selection(struct v4l2_subdev *subdev,
+ switch (sel->target) {
+ case V4L2_SEL_TGT_COMPOSE_BOUNDS:
+ case V4L2_SEL_TGT_COMPOSE_DEFAULT:
+- crop = vsp1_entity_get_pad_selection(&histo->entity, config,
++ crop = vsp1_entity_get_pad_selection(&histo->entity, state,
+ HISTO_PAD_SINK,
+ V4L2_SEL_TGT_CROP);
+ sel->r.left = 0;
+@@ -234,7 +233,7 @@ static int histo_get_selection(struct v4l2_subdev *subdev,
+
+ case V4L2_SEL_TGT_CROP_BOUNDS:
+ case V4L2_SEL_TGT_CROP_DEFAULT:
+- format = vsp1_entity_get_pad_format(&histo->entity, config,
++ format = vsp1_entity_get_pad_format(&histo->entity, state,
+ HISTO_PAD_SINK);
+ sel->r.left = 0;
+ sel->r.top = 0;
+@@ -244,7 +243,7 @@ static int histo_get_selection(struct v4l2_subdev *subdev,
+
+ case V4L2_SEL_TGT_COMPOSE:
+ case V4L2_SEL_TGT_CROP:
+- sel->r = *vsp1_entity_get_pad_selection(&histo->entity, config,
++ sel->r = *vsp1_entity_get_pad_selection(&histo->entity, state,
+ sel->pad, sel->target);
+ break;
+
+@@ -346,7 +345,7 @@ static int histo_set_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_histogram *histo = subdev_to_histo(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ int ret;
+
+ if (sel->pad != HISTO_PAD_SINK)
+@@ -354,17 +353,16 @@ static int histo_set_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&histo->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&histo->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&histo->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+ if (sel->target == V4L2_SEL_TGT_CROP)
+- ret = histo_set_crop(subdev, config, sel);
++ ret = histo_set_crop(subdev, state, sel);
+ else if (sel->target == V4L2_SEL_TGT_COMPOSE)
+- ret = histo_set_compose(subdev, config, sel);
++ ret = histo_set_compose(subdev, state, sel);
+ else
+ ret = -EINVAL;
+
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_hsit.c b/drivers/media/platform/renesas/vsp1/vsp1_hsit.c
+index 361a870380c2..6342ac7bdf54 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_hsit.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_hsit.c
+@@ -66,20 +66,19 @@ static int hsit_set_format(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_format *fmt)
+ {
+ struct vsp1_hsit *hsit = to_hsit(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+ mutex_lock(&hsit->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&hsit->entity, sd_state,
+- fmt->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&hsit->entity, sd_state, fmt->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+- format = vsp1_entity_get_pad_format(&hsit->entity, config, fmt->pad);
++ format = vsp1_entity_get_pad_format(&hsit->entity, state, fmt->pad);
+
+ if (fmt->pad == HSIT_PAD_SOURCE) {
+ /*
+@@ -102,7 +101,7 @@ static int hsit_set_format(struct v4l2_subdev *subdev,
+ fmt->format = *format;
+
+ /* Propagate the format to the source pad. */
+- format = vsp1_entity_get_pad_format(&hsit->entity, config,
++ format = vsp1_entity_get_pad_format(&hsit->entity, state,
+ HSIT_PAD_SOURCE);
+ *format = fmt->format;
+ format->code = hsit->inverse ? MEDIA_BUS_FMT_ARGB8888_1X32
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_lif.c b/drivers/media/platform/renesas/vsp1/vsp1_lif.c
+index 0ab2e0c70474..75c24df41a7a 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_lif.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_lif.c
+@@ -94,7 +94,7 @@ static void lif_configure_stream(struct vsp1_entity *entity,
+ unsigned int obth;
+ unsigned int lbth;
+
+- format = vsp1_entity_get_pad_format(&lif->entity, lif->entity.config,
++ format = vsp1_entity_get_pad_format(&lif->entity, lif->entity.state,
+ LIF_PAD_SOURCE);
+
+ switch (entity->vsp1->version & VI6_IP_VERSION_MODEL_MASK) {
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+index ea12c3f12c92..c47579efc65f 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+@@ -81,10 +81,10 @@ static void rpf_configure_stream(struct vsp1_entity *entity,
+
+ /* Format */
+ sink_format = vsp1_entity_get_pad_format(&rpf->entity,
+- rpf->entity.config,
++ rpf->entity.state,
+ RWPF_PAD_SINK);
+ source_format = vsp1_entity_get_pad_format(&rpf->entity,
+- rpf->entity.config,
++ rpf->entity.state,
+ RWPF_PAD_SOURCE);
+
+ infmt = VI6_RPF_INFMT_CIPM
+@@ -158,7 +158,7 @@ static void rpf_configure_stream(struct vsp1_entity *entity,
+ const struct v4l2_rect *compose;
+
+ compose = vsp1_entity_get_pad_selection(pipe->brx,
+- pipe->brx->config,
++ pipe->brx->state,
+ rpf->brx_input,
+ V4L2_SEL_TGT_COMPOSE);
+ left = compose->left;
+@@ -302,7 +302,7 @@ static void rpf_configure_partition(struct vsp1_entity *entity,
+ * offsets are needed, as planes 2 and 3 always have identical
+ * strides.
+ */
+- crop = *vsp1_rwpf_get_crop(rpf, rpf->entity.config);
++ crop = *vsp1_rwpf_get_crop(rpf, rpf->entity.state);
+
+ /*
+ * Partition Algorithm Control
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rwpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rwpf.c
+index e0f87c8103ca..1ec921fa5bdd 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_rwpf.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_rwpf.c
+@@ -62,15 +62,14 @@ static int vsp1_rwpf_set_format(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_format *fmt)
+ {
+ struct vsp1_rwpf *rwpf = to_rwpf(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+ mutex_lock(&rwpf->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&rwpf->entity, sd_state,
+- fmt->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&rwpf->entity, sd_state, fmt->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+@@ -81,7 +80,7 @@ static int vsp1_rwpf_set_format(struct v4l2_subdev *subdev,
+ fmt->format.code != MEDIA_BUS_FMT_AYUV8_1X32)
+ fmt->format.code = MEDIA_BUS_FMT_AYUV8_1X32;
+
+- format = vsp1_entity_get_pad_format(&rwpf->entity, config, fmt->pad);
++ format = vsp1_entity_get_pad_format(&rwpf->entity, state, fmt->pad);
+
+ if (fmt->pad == RWPF_PAD_SOURCE) {
+ /*
+@@ -107,7 +106,7 @@ static int vsp1_rwpf_set_format(struct v4l2_subdev *subdev,
+ struct v4l2_rect *crop;
+
+ /* Update the sink crop rectangle. */
+- crop = vsp1_rwpf_get_crop(rwpf, config);
++ crop = vsp1_rwpf_get_crop(rwpf, state);
+ crop->left = 0;
+ crop->top = 0;
+ crop->width = fmt->format.width;
+@@ -115,7 +114,7 @@ static int vsp1_rwpf_set_format(struct v4l2_subdev *subdev,
+ }
+
+ /* Propagate the format to the source pad. */
+- format = vsp1_entity_get_pad_format(&rwpf->entity, config,
++ format = vsp1_entity_get_pad_format(&rwpf->entity, state,
+ RWPF_PAD_SOURCE);
+ *format = fmt->format;
+
+@@ -134,7 +133,7 @@ static int vsp1_rwpf_get_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_rwpf *rwpf = to_rwpf(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+@@ -147,20 +146,19 @@ static int vsp1_rwpf_get_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&rwpf->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&rwpf->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&rwpf->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+ switch (sel->target) {
+ case V4L2_SEL_TGT_CROP:
+- sel->r = *vsp1_rwpf_get_crop(rwpf, config);
++ sel->r = *vsp1_rwpf_get_crop(rwpf, state);
+ break;
+
+ case V4L2_SEL_TGT_CROP_BOUNDS:
+- format = vsp1_entity_get_pad_format(&rwpf->entity, config,
++ format = vsp1_entity_get_pad_format(&rwpf->entity, state,
+ RWPF_PAD_SINK);
+ sel->r.left = 0;
+ sel->r.top = 0;
+@@ -183,7 +181,7 @@ static int vsp1_rwpf_set_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_rwpf *rwpf = to_rwpf(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ struct v4l2_rect *crop;
+ int ret = 0;
+@@ -200,15 +198,14 @@ static int vsp1_rwpf_set_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&rwpf->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&rwpf->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&rwpf->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+ /* Make sure the crop rectangle is entirely contained in the image. */
+- format = vsp1_entity_get_pad_format(&rwpf->entity, config,
++ format = vsp1_entity_get_pad_format(&rwpf->entity, state,
+ RWPF_PAD_SINK);
+
+ /*
+@@ -229,11 +226,11 @@ static int vsp1_rwpf_set_selection(struct v4l2_subdev *subdev,
+ sel->r.height = min_t(unsigned int, sel->r.height,
+ format->height - sel->r.top);
+
+- crop = vsp1_rwpf_get_crop(rwpf, config);
++ crop = vsp1_rwpf_get_crop(rwpf, state);
+ *crop = sel->r;
+
+ /* Propagate the format to the source pad. */
+- format = vsp1_entity_get_pad_format(&rwpf->entity, config,
++ format = vsp1_entity_get_pad_format(&rwpf->entity, state,
+ RWPF_PAD_SOURCE);
+ format->width = crop->width;
+ format->height = crop->height;
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_sru.c b/drivers/media/platform/renesas/vsp1/vsp1_sru.c
+index b614a2aea461..2dd6f8575614 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_sru.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_sru.c
+@@ -123,16 +123,15 @@ static int sru_enum_frame_size(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_frame_size_enum *fse)
+ {
+ struct vsp1_sru *sru = to_sru(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+- config = vsp1_entity_get_pad_config(&sru->entity, sd_state,
+- fse->which);
+- if (!config)
++ state = vsp1_entity_get_state(&sru->entity, sd_state, fse->which);
++ if (!state)
+ return -EINVAL;
+
+- format = vsp1_entity_get_pad_format(&sru->entity, config, SRU_PAD_SINK);
++ format = vsp1_entity_get_pad_format(&sru->entity, state, SRU_PAD_SINK);
+
+ mutex_lock(&sru->entity.lock);
+
+@@ -221,31 +220,30 @@ static int sru_set_format(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_format *fmt)
+ {
+ struct vsp1_sru *sru = to_sru(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+ mutex_lock(&sru->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&sru->entity, sd_state,
+- fmt->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&sru->entity, sd_state, fmt->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+- sru_try_format(sru, config, fmt->pad, &fmt->format);
++ sru_try_format(sru, state, fmt->pad, &fmt->format);
+
+- format = vsp1_entity_get_pad_format(&sru->entity, config, fmt->pad);
++ format = vsp1_entity_get_pad_format(&sru->entity, state, fmt->pad);
+ *format = fmt->format;
+
+ if (fmt->pad == SRU_PAD_SINK) {
+ /* Propagate the format to the source pad. */
+- format = vsp1_entity_get_pad_format(&sru->entity, config,
++ format = vsp1_entity_get_pad_format(&sru->entity, state,
+ SRU_PAD_SOURCE);
+ *format = fmt->format;
+
+- sru_try_format(sru, config, SRU_PAD_SOURCE, format);
++ sru_try_format(sru, state, SRU_PAD_SOURCE, format);
+ }
+
+ done:
+@@ -280,9 +278,9 @@ static void sru_configure_stream(struct vsp1_entity *entity,
+ struct v4l2_mbus_framefmt *output;
+ u32 ctrl0;
+
+- input = vsp1_entity_get_pad_format(&sru->entity, sru->entity.config,
++ input = vsp1_entity_get_pad_format(&sru->entity, sru->entity.state,
+ SRU_PAD_SINK);
+- output = vsp1_entity_get_pad_format(&sru->entity, sru->entity.config,
++ output = vsp1_entity_get_pad_format(&sru->entity, sru->entity.state,
+ SRU_PAD_SOURCE);
+
+ if (input->code == MEDIA_BUS_FMT_ARGB8888_1X32)
+@@ -310,9 +308,9 @@ static unsigned int sru_max_width(struct vsp1_entity *entity,
+ struct v4l2_mbus_framefmt *input;
+ struct v4l2_mbus_framefmt *output;
+
+- input = vsp1_entity_get_pad_format(&sru->entity, sru->entity.config,
++ input = vsp1_entity_get_pad_format(&sru->entity, sru->entity.state,
+ SRU_PAD_SINK);
+- output = vsp1_entity_get_pad_format(&sru->entity, sru->entity.config,
++ output = vsp1_entity_get_pad_format(&sru->entity, sru->entity.state,
+ SRU_PAD_SOURCE);
+
+ /*
+@@ -336,9 +334,9 @@ static void sru_partition(struct vsp1_entity *entity,
+ struct v4l2_mbus_framefmt *input;
+ struct v4l2_mbus_framefmt *output;
+
+- input = vsp1_entity_get_pad_format(&sru->entity, sru->entity.config,
++ input = vsp1_entity_get_pad_format(&sru->entity, sru->entity.state,
+ SRU_PAD_SINK);
+- output = vsp1_entity_get_pad_format(&sru->entity, sru->entity.config,
++ output = vsp1_entity_get_pad_format(&sru->entity, sru->entity.state,
+ SRU_PAD_SOURCE);
+
+ /* Adapt if SRUx2 is enabled. */
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_uds.c b/drivers/media/platform/renesas/vsp1/vsp1_uds.c
+index 1c290cda005a..59ff4ae46cea 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_uds.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_uds.c
+@@ -128,17 +128,15 @@ static int uds_enum_frame_size(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_frame_size_enum *fse)
+ {
+ struct vsp1_uds *uds = to_uds(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+- config = vsp1_entity_get_pad_config(&uds->entity, sd_state,
+- fse->which);
+- if (!config)
++ state = vsp1_entity_get_state(&uds->entity, sd_state, fse->which);
++ if (!state)
+ return -EINVAL;
+
+- format = vsp1_entity_get_pad_format(&uds->entity, config,
+- UDS_PAD_SINK);
++ format = vsp1_entity_get_pad_format(&uds->entity, state, UDS_PAD_SINK);
+
+ mutex_lock(&uds->entity.lock);
+
+@@ -205,31 +203,30 @@ static int uds_set_format(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_format *fmt)
+ {
+ struct vsp1_uds *uds = to_uds(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+ mutex_lock(&uds->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&uds->entity, sd_state,
+- fmt->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&uds->entity, sd_state, fmt->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+- uds_try_format(uds, config, fmt->pad, &fmt->format);
++ uds_try_format(uds, state, fmt->pad, &fmt->format);
+
+- format = vsp1_entity_get_pad_format(&uds->entity, config, fmt->pad);
++ format = vsp1_entity_get_pad_format(&uds->entity, state, fmt->pad);
+ *format = fmt->format;
+
+ if (fmt->pad == UDS_PAD_SINK) {
+ /* Propagate the format to the source pad. */
+- format = vsp1_entity_get_pad_format(&uds->entity, config,
++ format = vsp1_entity_get_pad_format(&uds->entity, state,
+ UDS_PAD_SOURCE);
+ *format = fmt->format;
+
+- uds_try_format(uds, config, UDS_PAD_SOURCE, format);
++ uds_try_format(uds, state, UDS_PAD_SOURCE, format);
+ }
+
+ done:
+@@ -269,9 +266,9 @@ static void uds_configure_stream(struct vsp1_entity *entity,
+ unsigned int vscale;
+ bool multitap;
+
+- input = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ input = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SINK);
+- output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SOURCE);
+
+ hscale = uds_compute_ratio(input->width, output->width);
+@@ -314,7 +311,7 @@ static void uds_configure_partition(struct vsp1_entity *entity,
+ struct vsp1_partition *partition = pipe->partition;
+ const struct v4l2_mbus_framefmt *output;
+
+- output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SOURCE);
+
+ /* Input size clipping. */
+@@ -339,9 +336,9 @@ static unsigned int uds_max_width(struct vsp1_entity *entity,
+ const struct v4l2_mbus_framefmt *input;
+ unsigned int hscale;
+
+- input = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ input = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SINK);
+- output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SOURCE);
+ hscale = output->width / input->width;
+
+@@ -381,9 +378,9 @@ static void uds_partition(struct vsp1_entity *entity,
+ partition->uds_sink = *window;
+ partition->uds_source = *window;
+
+- input = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ input = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SINK);
+- output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.config,
++ output = vsp1_entity_get_pad_format(&uds->entity, uds->entity.state,
+ UDS_PAD_SOURCE);
+
+ partition->uds_sink.width = window->width * input->width
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_uif.c b/drivers/media/platform/renesas/vsp1/vsp1_uif.c
+index 83d7f17df80e..d84d10f35090 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_uif.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_uif.c
+@@ -86,7 +86,7 @@ static int uif_get_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_uif *uif = to_uif(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ int ret = 0;
+
+@@ -95,9 +95,8 @@ static int uif_get_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&uif->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&uif->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&uif->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+@@ -105,7 +104,7 @@ static int uif_get_selection(struct v4l2_subdev *subdev,
+ switch (sel->target) {
+ case V4L2_SEL_TGT_CROP_BOUNDS:
+ case V4L2_SEL_TGT_CROP_DEFAULT:
+- format = vsp1_entity_get_pad_format(&uif->entity, config,
++ format = vsp1_entity_get_pad_format(&uif->entity, state,
+ UIF_PAD_SINK);
+ sel->r.left = 0;
+ sel->r.top = 0;
+@@ -114,7 +113,7 @@ static int uif_get_selection(struct v4l2_subdev *subdev,
+ break;
+
+ case V4L2_SEL_TGT_CROP:
+- sel->r = *vsp1_entity_get_pad_selection(&uif->entity, config,
++ sel->r = *vsp1_entity_get_pad_selection(&uif->entity, state,
+ sel->pad, sel->target);
+ break;
+
+@@ -133,7 +132,7 @@ static int uif_set_selection(struct v4l2_subdev *subdev,
+ struct v4l2_subdev_selection *sel)
+ {
+ struct vsp1_uif *uif = to_uif(subdev);
+- struct v4l2_subdev_state *config;
++ struct v4l2_subdev_state *state;
+ struct v4l2_mbus_framefmt *format;
+ struct v4l2_rect *selection;
+ int ret = 0;
+@@ -144,15 +143,14 @@ static int uif_set_selection(struct v4l2_subdev *subdev,
+
+ mutex_lock(&uif->entity.lock);
+
+- config = vsp1_entity_get_pad_config(&uif->entity, sd_state,
+- sel->which);
+- if (!config) {
++ state = vsp1_entity_get_state(&uif->entity, sd_state, sel->which);
++ if (!state) {
+ ret = -EINVAL;
+ goto done;
+ }
+
+ /* The crop rectangle must be inside the input frame. */
+- format = vsp1_entity_get_pad_format(&uif->entity, config, UIF_PAD_SINK);
++ format = vsp1_entity_get_pad_format(&uif->entity, state, UIF_PAD_SINK);
+
+ sel->r.left = clamp_t(unsigned int, sel->r.left, 0, format->width - 1);
+ sel->r.top = clamp_t(unsigned int, sel->r.top, 0, format->height - 1);
+@@ -162,7 +160,7 @@ static int uif_set_selection(struct v4l2_subdev *subdev,
+ format->height - sel->r.top);
+
+ /* Store the crop rectangle. */
+- selection = vsp1_entity_get_pad_selection(&uif->entity, config,
++ selection = vsp1_entity_get_pad_selection(&uif->entity, state,
+ sel->pad, V4L2_SEL_TGT_CROP);
+ *selection = sel->r;
+
+@@ -206,7 +204,7 @@ static void uif_configure_stream(struct vsp1_entity *entity,
+ vsp1_uif_write(uif, dlb, VI6_UIF_DISCOM_DOCMPMR,
+ VI6_UIF_DISCOM_DOCMPMR_SEL(9));
+
+- crop = vsp1_entity_get_pad_selection(entity, entity->config,
++ crop = vsp1_entity_get_pad_selection(entity, entity->state,
+ UIF_PAD_SINK, V4L2_SEL_TGT_CROP);
+
+ left = crop->left;
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_video.c b/drivers/media/platform/renesas/vsp1/vsp1_video.c
+index e9d5027761bb..5a9cb0e5640e 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_video.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_video.c
+@@ -198,7 +198,7 @@ static void vsp1_video_calculate_partition(struct vsp1_pipeline *pipe,
+ * at the WPF sink.
+ */
+ format = vsp1_entity_get_pad_format(&pipe->output->entity,
+- pipe->output->entity.config,
++ pipe->output->entity.state,
+ RWPF_PAD_SINK);
+
+ /* A single partition simply processes the output size in full. */
+@@ -263,7 +263,7 @@ static int vsp1_video_pipeline_setup_partitions(struct vsp1_pipeline *pipe)
+ * at the WPF sink.
+ */
+ format = vsp1_entity_get_pad_format(&pipe->output->entity,
+- pipe->output->entity.config,
++ pipe->output->entity.state,
+ RWPF_PAD_SINK);
+ div_size = format->width;
+
+diff --git a/drivers/media/platform/renesas/vsp1/vsp1_wpf.c b/drivers/media/platform/renesas/vsp1/vsp1_wpf.c
+index cab4445eca69..9693aeab1cac 100644
+--- a/drivers/media/platform/renesas/vsp1/vsp1_wpf.c
++++ b/drivers/media/platform/renesas/vsp1/vsp1_wpf.c
+@@ -66,10 +66,10 @@ static int vsp1_wpf_set_rotation(struct vsp1_rwpf *wpf, unsigned int rotation)
+ }
+
+ sink_format = vsp1_entity_get_pad_format(&wpf->entity,
+- wpf->entity.config,
++ wpf->entity.state,
+ RWPF_PAD_SINK);
+ source_format = vsp1_entity_get_pad_format(&wpf->entity,
+- wpf->entity.config,
++ wpf->entity.state,
+ RWPF_PAD_SOURCE);
+
+ mutex_lock(&wpf->entity.lock);
+@@ -246,10 +246,10 @@ static void wpf_configure_stream(struct vsp1_entity *entity,
+ int ret;
+
+ sink_format = vsp1_entity_get_pad_format(&wpf->entity,
+- wpf->entity.config,
++ wpf->entity.state,
+ RWPF_PAD_SINK);
+ source_format = vsp1_entity_get_pad_format(&wpf->entity,
+- wpf->entity.config,
++ wpf->entity.state,
+ RWPF_PAD_SOURCE);
+
+ /* Format */
+@@ -384,7 +384,7 @@ static void wpf_configure_partition(struct vsp1_entity *entity,
+ unsigned int i;
+
+ sink_format = vsp1_entity_get_pad_format(&wpf->entity,
+- wpf->entity.config,
++ wpf->entity.state,
+ RWPF_PAD_SINK);
+ width = sink_format->width;
+ height = sink_format->height;
+--
+2.43.0
+
--- /dev/null
+From 1f45b1baac2feb026a58aa51766f6309500edc87 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 08:57:45 +0100
+Subject: media: rkisp1: Drop IRQF_SHARED
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 85d2a31fe4d9be1555f621ead7a520d8791e0f74 ]
+
+In all known platforms the ISP has dedicated IRQ lines, but for some
+reason the driver uses IRQF_SHARED.
+
+Supporting IRQF_SHARED properly requires handling interrupts even when
+our device is disabled, and the driver does not handle this. To avoid
+adding such code, and to be sure the driver won't accidentally be used
+in a platform with shared interrupts, let's drop the IRQF_SHARED flag.
+
+Link: https://lore.kernel.org/r/20231207-rkisp-irq-fix-v3-1-358a2c871a3c@ideasonboard.com
+
+Tested-by: Adam Ford <aford173@gmail.com> #imx8mp-beacon
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c b/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
+index 894d5afaff4e..b676db9bff62 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
+@@ -542,7 +542,7 @@ static int rkisp1_probe(struct platform_device *pdev)
+ if (irq < 0)
+ return irq;
+
+- ret = devm_request_irq(dev, irq, info->isrs[i].isr, IRQF_SHARED,
++ ret = devm_request_irq(dev, irq, info->isrs[i].isr, 0,
+ dev_driver_string(dev), dev);
+ if (ret) {
+ dev_err(dev, "request irq failed: %d\n", ret);
+--
+2.43.0
+
--- /dev/null
+From d8bfc0f44554d2e9613a167abb44eef5ca403c63 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 08:57:48 +0100
+Subject: media: rkisp1: Fix IRQ disable race issue
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 870565f063a58576e8a4529f122cac4325c6b395 ]
+
+In rkisp1_isp_stop() and rkisp1_csi_disable() the driver masks the
+interrupts and then apparently assumes that the interrupt handler won't
+be running, and proceeds in the stop procedure. This is not the case, as
+the interrupt handler can already be running, which would lead to the
+ISP being disabled while the interrupt handler handling a captured
+frame.
+
+This brings up two issues: 1) the ISP could be powered off while the
+interrupt handler is still running and accessing registers, leading to
+board lockup, and 2) the interrupt handler code and the code that
+disables the streaming might do things that conflict.
+
+It is not clear to me if 2) causes a real issue, but 1) can be seen with
+a suitable delay (or printk in my case) in the interrupt handler,
+leading to board lockup.
+
+Link: https://lore.kernel.org/r/20231207-rkisp-irq-fix-v3-4-358a2c871a3c@ideasonboard.com
+
+Tested-by: Adam Ford <aford173@gmail.com> #imx8mp-beacon
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../platform/rockchip/rkisp1/rkisp1-csi.c | 14 ++++++++++++-
+ .../platform/rockchip/rkisp1/rkisp1-isp.c | 20 ++++++++++++++++---
+ 2 files changed, 30 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-csi.c b/drivers/media/platform/rockchip/rkisp1/rkisp1-csi.c
+index 6e17b2817e61..702adee83322 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-csi.c
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-csi.c
+@@ -125,8 +125,20 @@ static void rkisp1_csi_disable(struct rkisp1_csi *csi)
+ struct rkisp1_device *rkisp1 = csi->rkisp1;
+ u32 val;
+
+- /* Mask and clear interrupts. */
++ /* Mask MIPI interrupts. */
+ rkisp1_write(rkisp1, RKISP1_CIF_MIPI_IMSC, 0);
++
++ /* Flush posted writes */
++ rkisp1_read(rkisp1, RKISP1_CIF_MIPI_IMSC);
++
++ /*
++ * Wait until the IRQ handler has ended. The IRQ handler may get called
++ * even after this, but it will return immediately as the MIPI
++ * interrupts have been masked.
++ */
++ synchronize_irq(rkisp1->irqs[RKISP1_IRQ_MIPI]);
++
++ /* Clear MIPI interrupt status */
+ rkisp1_write(rkisp1, RKISP1_CIF_MIPI_ICR, ~0);
+
+ val = rkisp1_read(rkisp1, RKISP1_CIF_MIPI_CTRL);
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-isp.c b/drivers/media/platform/rockchip/rkisp1/rkisp1-isp.c
+index 45d1ab96fc6e..5fbc47bda683 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-isp.c
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-isp.c
+@@ -254,11 +254,25 @@ static void rkisp1_isp_stop(struct rkisp1_isp *isp)
+ * ISP(mi) stop in mi frame end -> Stop ISP(mipi) ->
+ * Stop ISP(isp) ->wait for ISP isp off
+ */
+- /* stop and clear MI and ISP interrupts */
+- rkisp1_write(rkisp1, RKISP1_CIF_ISP_IMSC, 0);
+- rkisp1_write(rkisp1, RKISP1_CIF_ISP_ICR, ~0);
+
++ /* Mask MI and ISP interrupts */
++ rkisp1_write(rkisp1, RKISP1_CIF_ISP_IMSC, 0);
+ rkisp1_write(rkisp1, RKISP1_CIF_MI_IMSC, 0);
++
++ /* Flush posted writes */
++ rkisp1_read(rkisp1, RKISP1_CIF_MI_IMSC);
++
++ /*
++ * Wait until the IRQ handler has ended. The IRQ handler may get called
++ * even after this, but it will return immediately as the MI and ISP
++ * interrupts have been masked.
++ */
++ synchronize_irq(rkisp1->irqs[RKISP1_IRQ_ISP]);
++ if (rkisp1->irqs[RKISP1_IRQ_ISP] != rkisp1->irqs[RKISP1_IRQ_MI])
++ synchronize_irq(rkisp1->irqs[RKISP1_IRQ_MI]);
++
++ /* Clear MI and ISP interrupt status */
++ rkisp1_write(rkisp1, RKISP1_CIF_ISP_ICR, ~0);
+ rkisp1_write(rkisp1, RKISP1_CIF_MI_ICR, ~0);
+
+ /* stop ISP */
+--
+2.43.0
+
--- /dev/null
+From 539123486952b01046fc0e3caa4fce380cfc39d3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 08:57:46 +0100
+Subject: media: rkisp1: Fix IRQ handler return values
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 3eb7910e1b16a2c136be26a8380f21469225b2f6 ]
+
+The IRQ handler rkisp1_isr() calls sub-handlers, all of which returns an
+irqreturn_t value, but rkisp1_isr() ignores those values and always
+returns IRQ_HANDLED.
+
+Fix this by collecting the return values, and returning IRQ_HANDLED or
+IRQ_NONE as appropriate.
+
+Link: https://lore.kernel.org/r/20231207-rkisp-irq-fix-v3-2-358a2c871a3c@ideasonboard.com
+
+Tested-by: Adam Ford <aford173@gmail.com> #imx8mp-beacon
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../media/platform/rockchip/rkisp1/rkisp1-dev.c | 16 ++++++++++++----
+ 1 file changed, 12 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c b/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
+index b676db9bff62..7b8a361d4c4a 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
+@@ -442,17 +442,25 @@ static int rkisp1_entities_register(struct rkisp1_device *rkisp1)
+
+ static irqreturn_t rkisp1_isr(int irq, void *ctx)
+ {
++ irqreturn_t ret = IRQ_NONE;
++
+ /*
+ * Call rkisp1_capture_isr() first to handle the frame that
+ * potentially completed using the current frame_sequence number before
+ * it is potentially incremented by rkisp1_isp_isr() in the vertical
+ * sync.
+ */
+- rkisp1_capture_isr(irq, ctx);
+- rkisp1_isp_isr(irq, ctx);
+- rkisp1_csi_isr(irq, ctx);
+
+- return IRQ_HANDLED;
++ if (rkisp1_capture_isr(irq, ctx) == IRQ_HANDLED)
++ ret = IRQ_HANDLED;
++
++ if (rkisp1_isp_isr(irq, ctx) == IRQ_HANDLED)
++ ret = IRQ_HANDLED;
++
++ if (rkisp1_csi_isr(irq, ctx) == IRQ_HANDLED)
++ ret = IRQ_HANDLED;
++
++ return ret;
+ }
+
+ static const char * const px30_isp_clks[] = {
+--
+2.43.0
+
--- /dev/null
+From 6feb0bb7af09c47913ac5769e02589d999c12a98 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 26 Nov 2023 03:09:48 +0100
+Subject: media: rkisp1: resizer: Stop manual allocation of v4l2_subdev_state
+
+From: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+
+[ Upstream commit efa28efd9cba015f8c3d88123527c3c3cfcd13d0 ]
+
+Supported media bus codes on the resizer sink pad are identical to the
+ISP source pad. The .enum_mbus_code() handler thus delegates the
+enumeration to the ISP's operation. This is problematic for two
+reasons:
+
+- Format enumeration on the ISP source pad is dependent on the format
+ configured on the ISP sink pad for the same subdev state (TRY or
+ ACTIVE), while format enumeration on the resizer sink pad should
+ return all formats supported by the resizer subdev, regardless of the
+ ISP configuration.
+
+- Delegating the operation involves creating a fake v4l2_subdev_state on
+ the stack to pass to the ISP .enum_mbus_code() handler. This gets in
+ the way of evolution of both the ISP enumeration handler and, more
+ generally, the V4L2 subdev state infrastructure.
+
+Fix those two issues by implementing format enumeration manually for the
+resizer.
+
+Link: https://lore.kernel.org/r/20231126020948.2700-1-laurent.pinchart@ideasonboard.com
+
+Reviewed-by: Paul Elder <paul.elder@ideasonboard.com>
+Reviewed-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../platform/rockchip/rkisp1/rkisp1-resizer.c | 38 ++++++++++++-------
+ 1 file changed, 24 insertions(+), 14 deletions(-)
+
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-resizer.c b/drivers/media/platform/rockchip/rkisp1/rkisp1-resizer.c
+index 28ecc7347d54..6297870ee9e9 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-resizer.c
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-resizer.c
+@@ -335,12 +335,8 @@ static int rkisp1_rsz_enum_mbus_code(struct v4l2_subdev *sd,
+ {
+ struct rkisp1_resizer *rsz =
+ container_of(sd, struct rkisp1_resizer, sd);
+- struct v4l2_subdev_pad_config dummy_cfg;
+- struct v4l2_subdev_state pad_state = {
+- .pads = &dummy_cfg
+- };
+- u32 pad = code->pad;
+- int ret;
++ unsigned int index = code->index;
++ unsigned int i;
+
+ if (code->pad == RKISP1_RSZ_PAD_SRC) {
+ /* supported mbus codes on the src are the same as in the capture */
+@@ -360,15 +356,29 @@ static int rkisp1_rsz_enum_mbus_code(struct v4l2_subdev *sd,
+ return 0;
+ }
+
+- /* supported mbus codes on the sink pad are the same as isp src pad */
+- code->pad = RKISP1_ISP_PAD_SOURCE_VIDEO;
+- ret = v4l2_subdev_call(&rsz->rkisp1->isp.sd, pad, enum_mbus_code,
+- &pad_state, code);
++ /*
++ * Supported mbus codes on the sink pad are the same as on the ISP
++ * source pad.
++ */
++ for (i = 0; ; i++) {
++ const struct rkisp1_mbus_info *fmt =
++ rkisp1_mbus_info_get_by_index(i);
+
+- /* restore pad */
+- code->pad = pad;
+- code->flags = 0;
+- return ret;
++ if (!fmt)
++ break;
++
++ if (!(fmt->direction & RKISP1_ISP_SD_SRC))
++ continue;
++
++ if (!index) {
++ code->code = fmt->mbus_code;
++ return 0;
++ }
++
++ index--;
++ }
++
++ return -EINVAL;
+ }
+
+ static int rkisp1_rsz_init_config(struct v4l2_subdev *sd,
+--
+2.43.0
+
--- /dev/null
+From 5e287fd84bdce35e1c1e70f9e399445f17575bd6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 08:57:47 +0100
+Subject: media: rkisp1: Store IRQ lines
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 0753874617de883c6d4da903142f334f76a75d70 ]
+
+Store the IRQ lines used by the driver for easy access. These are needed
+in future patches which fix IRQ race issues.
+
+Link: https://lore.kernel.org/r/20231207-rkisp-irq-fix-v3-3-358a2c871a3c@ideasonboard.com
+
+Tested-by: Adam Ford <aford173@gmail.com> #imx8mp-beacon
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../platform/rockchip/rkisp1/rkisp1-common.h | 11 ++++++++++-
+ .../media/platform/rockchip/rkisp1/rkisp1-dev.c | 17 +++++++++++++----
+ 2 files changed, 23 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-common.h b/drivers/media/platform/rockchip/rkisp1/rkisp1-common.h
+index 1e7cea1bea5e..2d7f06281c39 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-common.h
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-common.h
+@@ -61,6 +61,14 @@ struct dentry;
+ RKISP1_CIF_ISP_EXP_END | \
+ RKISP1_CIF_ISP_HIST_MEASURE_RDY)
+
++/* IRQ lines */
++enum rkisp1_irq_line {
++ RKISP1_IRQ_ISP = 0,
++ RKISP1_IRQ_MI,
++ RKISP1_IRQ_MIPI,
++ RKISP1_NUM_IRQS,
++};
++
+ /* enum for the resizer pads */
+ enum rkisp1_rsz_pad {
+ RKISP1_RSZ_PAD_SINK,
+@@ -423,7 +431,6 @@ struct rkisp1_debug {
+ * struct rkisp1_device - ISP platform device
+ *
+ * @base_addr: base register address
+- * @irq: the irq number
+ * @dev: a pointer to the struct device
+ * @clk_size: number of clocks
+ * @clks: array of clocks
+@@ -441,6 +448,7 @@ struct rkisp1_debug {
+ * @stream_lock: serializes {start/stop}_streaming callbacks between the capture devices.
+ * @debug: debug params to be exposed on debugfs
+ * @info: version-specific ISP information
++ * @irqs: IRQ line numbers
+ */
+ struct rkisp1_device {
+ void __iomem *base_addr;
+@@ -461,6 +469,7 @@ struct rkisp1_device {
+ struct mutex stream_lock; /* serialize {start/stop}_streaming cb between capture devices */
+ struct rkisp1_debug debug;
+ const struct rkisp1_info *info;
++ int irqs[RKISP1_NUM_IRQS];
+ };
+
+ /*
+diff --git a/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c b/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
+index 7b8a361d4c4a..f96f821a7b50 100644
+--- a/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
++++ b/drivers/media/platform/rockchip/rkisp1/rkisp1-dev.c
+@@ -114,6 +114,7 @@
+ struct rkisp1_isr_data {
+ const char *name;
+ irqreturn_t (*isr)(int irq, void *ctx);
++ u32 line_mask;
+ };
+
+ /* ----------------------------------------------------------------------------
+@@ -471,9 +472,9 @@ static const char * const px30_isp_clks[] = {
+ };
+
+ static const struct rkisp1_isr_data px30_isp_isrs[] = {
+- { "isp", rkisp1_isp_isr },
+- { "mi", rkisp1_capture_isr },
+- { "mipi", rkisp1_csi_isr },
++ { "isp", rkisp1_isp_isr, BIT(RKISP1_IRQ_ISP) },
++ { "mi", rkisp1_capture_isr, BIT(RKISP1_IRQ_MI) },
++ { "mipi", rkisp1_csi_isr, BIT(RKISP1_IRQ_MIPI) },
+ };
+
+ static const struct rkisp1_info px30_isp_info = {
+@@ -492,7 +493,7 @@ static const char * const rk3399_isp_clks[] = {
+ };
+
+ static const struct rkisp1_isr_data rk3399_isp_isrs[] = {
+- { NULL, rkisp1_isr },
++ { NULL, rkisp1_isr, BIT(RKISP1_IRQ_ISP) | BIT(RKISP1_IRQ_MI) | BIT(RKISP1_IRQ_MIPI) },
+ };
+
+ static const struct rkisp1_info rk3399_isp_info = {
+@@ -543,6 +544,9 @@ static int rkisp1_probe(struct platform_device *pdev)
+ if (IS_ERR(rkisp1->base_addr))
+ return PTR_ERR(rkisp1->base_addr);
+
++ for (unsigned int il = 0; il < ARRAY_SIZE(rkisp1->irqs); ++il)
++ rkisp1->irqs[il] = -1;
++
+ for (i = 0; i < info->isr_size; i++) {
+ irq = info->isrs[i].name
+ ? platform_get_irq_byname(pdev, info->isrs[i].name)
+@@ -550,6 +554,11 @@ static int rkisp1_probe(struct platform_device *pdev)
+ if (irq < 0)
+ return irq;
+
++ for (unsigned int il = 0; il < ARRAY_SIZE(rkisp1->irqs); ++il) {
++ if (info->isrs[i].line_mask & BIT(il))
++ rkisp1->irqs[il] = irq;
++ }
++
+ ret = devm_request_irq(dev, irq, info->isrs[i].isr, 0,
+ dev_driver_string(dev), dev);
+ if (ret) {
+--
+2.43.0
+
--- /dev/null
+From ffb4f6fe7746dfbdad3fec7959bf5ab40175cbf7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 13 Oct 2023 13:00:22 +0200
+Subject: media: rockchip: rga: fix swizzling for RGB formats
+
+From: Michael Tretter <m.tretter@pengutronix.de>
+
+[ Upstream commit 9e7dc39260edac180c206bb6149595a40eabae3e ]
+
+When using 32 bit RGB formats, the RGA on the rk3568 produces wrong
+colors as the wrong color channels are read or written. The reason is
+that the format description for the channel swizzeling is wrong and the
+wrong bits are configured. For example, when converting ARGB32 to NV12,
+the alpha channel is used as blue channel.. This doesn't happen if the
+color format is the same on both sides.
+
+Fix the color_swap settings of the formats to correctly handle 32 bit
+RGB formats.
+
+For RGA_COLOR_FMT_XBGR8888, the RGA_COLOR_ALPHA_SWAP bit doesn't have an
+effect. Thus, it isn't possible to handle the V4L2_PIX_FMT_XRGB32. Thus,
+it is removed from the list of supported formats.
+
+Signed-off-by: Michael Tretter <m.tretter@pengutronix.de>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/platform/rockchip/rga/rga.c | 15 +++------------
+ 1 file changed, 3 insertions(+), 12 deletions(-)
+
+diff --git a/drivers/media/platform/rockchip/rga/rga.c b/drivers/media/platform/rockchip/rga/rga.c
+index f1c532a5802a..25f5b5eebf13 100644
+--- a/drivers/media/platform/rockchip/rga/rga.c
++++ b/drivers/media/platform/rockchip/rga/rga.c
+@@ -184,25 +184,16 @@ static int rga_setup_ctrls(struct rga_ctx *ctx)
+ static struct rga_fmt formats[] = {
+ {
+ .fourcc = V4L2_PIX_FMT_ARGB32,
+- .color_swap = RGA_COLOR_RB_SWAP,
++ .color_swap = RGA_COLOR_ALPHA_SWAP,
+ .hw_format = RGA_COLOR_FMT_ABGR8888,
+ .depth = 32,
+ .uv_factor = 1,
+ .y_div = 1,
+ .x_div = 1,
+ },
+- {
+- .fourcc = V4L2_PIX_FMT_XRGB32,
+- .color_swap = RGA_COLOR_RB_SWAP,
+- .hw_format = RGA_COLOR_FMT_XBGR8888,
+- .depth = 32,
+- .uv_factor = 1,
+- .y_div = 1,
+- .x_div = 1,
+- },
+ {
+ .fourcc = V4L2_PIX_FMT_ABGR32,
+- .color_swap = RGA_COLOR_ALPHA_SWAP,
++ .color_swap = RGA_COLOR_RB_SWAP,
+ .hw_format = RGA_COLOR_FMT_ABGR8888,
+ .depth = 32,
+ .uv_factor = 1,
+@@ -211,7 +202,7 @@ static struct rga_fmt formats[] = {
+ },
+ {
+ .fourcc = V4L2_PIX_FMT_XBGR32,
+- .color_swap = RGA_COLOR_ALPHA_SWAP,
++ .color_swap = RGA_COLOR_RB_SWAP,
+ .hw_format = RGA_COLOR_FMT_XBGR8888,
+ .depth = 32,
+ .uv_factor = 1,
+--
+2.43.0
+
--- /dev/null
+From 9c7a60e106cd25c7baa268cb76cf619315e5144c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 14:32:36 +0530
+Subject: media: stk1160: Fixed high volume of stk1160_dbg messages
+
+From: Ghanshyam Agrawal <ghanshyam1898@gmail.com>
+
+[ Upstream commit b3695e86d25aafbe175dd51f6aaf6f68d341d590 ]
+
+The function stk1160_dbg gets called too many times, which causes
+the output to get flooded with messages. Since stk1160_dbg uses
+printk, it is now replaced with printk_ratelimited.
+
+Suggested-by: Phillip Potter <phil@philpotter.co.uk>
+Signed-off-by: Ghanshyam Agrawal <ghanshyam1898@gmail.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/usb/stk1160/stk1160-video.c | 5 ++---
+ 1 file changed, 2 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/media/usb/stk1160/stk1160-video.c b/drivers/media/usb/stk1160/stk1160-video.c
+index 4e966f6bf608..366f0e4a5dc0 100644
+--- a/drivers/media/usb/stk1160/stk1160-video.c
++++ b/drivers/media/usb/stk1160/stk1160-video.c
+@@ -107,8 +107,7 @@ void stk1160_copy_video(struct stk1160 *dev, u8 *src, int len)
+
+ /*
+ * TODO: These stk1160_dbg are very spammy!
+- * We should 1) check why we are getting them
+- * and 2) add ratelimit.
++ * We should check why we are getting them.
+ *
+ * UPDATE: One of the reasons (the only one?) for getting these
+ * is incorrect standard (mismatch between expected and configured).
+@@ -151,7 +150,7 @@ void stk1160_copy_video(struct stk1160 *dev, u8 *src, int len)
+
+ /* Let the bug hunt begin! sanity checks! */
+ if (lencopy < 0) {
+- stk1160_dbg("copy skipped: negative lencopy\n");
++ printk_ratelimited(KERN_DEBUG "copy skipped: negative lencopy\n");
+ return;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 334f8feaacffb98099bc11ba9439b34384e97e17 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Sep 2023 17:29:52 +0200
+Subject: media: uvcvideo: Fix power line control for a Chicony camera
+
+From: Ricardo Ribalda <ribalda@chromium.org>
+
+[ Upstream commit dba3e701917a4cce92920f8ccb9fa4d4ee5ac07e ]
+
+The device does not implement the control properly.
+
+Fixes v4l2-compliance error:
+
+info: checking control 'Power Line Frequency' (0x00980918)
+fail: v4l2-test-controls.cpp(552): could not set valid menu item 3
+
+Signed-off-by: Ricardo Ribalda <ribalda@chromium.org>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/usb/uvc/uvc_driver.c | 9 +++++++++
+ 1 file changed, 9 insertions(+)
+
+diff --git a/drivers/media/usb/uvc/uvc_driver.c b/drivers/media/usb/uvc/uvc_driver.c
+index 08fcd2ffa727..4b5ea3501753 100644
+--- a/drivers/media/usb/uvc/uvc_driver.c
++++ b/drivers/media/usb/uvc/uvc_driver.c
+@@ -2592,6 +2592,15 @@ static const struct usb_device_id uvc_ids[] = {
+ .bInterfaceSubClass = 1,
+ .bInterfaceProtocol = 0,
+ .driver_info = (kernel_ulong_t)&uvc_ctrl_power_line_limited },
++ /* Chicony Electronics Co., Ltd Integrated Camera */
++ { .match_flags = USB_DEVICE_ID_MATCH_DEVICE
++ | USB_DEVICE_ID_MATCH_INT_INFO,
++ .idVendor = 0x04f2,
++ .idProduct = 0xb67c,
++ .bInterfaceClass = USB_CLASS_VIDEO,
++ .bInterfaceSubClass = 1,
++ .bInterfaceProtocol = UVC_PC_PROTOCOL_15,
++ .driver_info = (kernel_ulong_t)&uvc_ctrl_power_line_uvc11 },
+ /* Chicony EasyCamera */
+ { .match_flags = USB_DEVICE_ID_MATCH_DEVICE
+ | USB_DEVICE_ID_MATCH_INT_INFO,
+--
+2.43.0
+
--- /dev/null
+From 8f7579a67117628480a54449b34a31b3acf58afd Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 28 Oct 2023 09:55:04 +0200
+Subject: media: uvcvideo: Fix power line control for SunplusIT camera
+
+From: Ricardo Ribalda <ribalda@chromium.org>
+
+[ Upstream commit 6180056b0e0c097dad5d1569dcd661eaf509ea43 ]
+
+The device does not implement the power line frequency control
+correctly. It is a UVC 1.5 device, but implements the control as a UVC
+1.1 device.
+
+Add the corresponding control mapping override.
+
+Bus 003 Device 002: ID 2b7e:b752 SunplusIT Inc HD Camera
+Device Descriptor:
+ bLength 18
+ bDescriptorType 1
+ bcdUSB 2.01
+ bDeviceClass 239 Miscellaneous Device
+ bDeviceSubClass 2
+ bDeviceProtocol 1 Interface Association
+ bMaxPacketSize0 64
+ idVendor 0x2b7e
+ idProduct 0xb752
+ bcdDevice 0.04
+ iManufacturer 1 SunplusIT Inc
+ iProduct 2 HD Camera
+ iSerial 3 01.00.00
+ bNumConfigurations 1
+
+Cc: Yunke Cao <yunkec@chromium.org>
+Signed-off-by: Ricardo Ribalda <ribalda@chromium.org>
+Signed-off-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
+Signed-off-by: Mauro Carvalho Chehab <mchehab@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/usb/uvc/uvc_driver.c | 9 +++++++++
+ 1 file changed, 9 insertions(+)
+
+diff --git a/drivers/media/usb/uvc/uvc_driver.c b/drivers/media/usb/uvc/uvc_driver.c
+index 4b5ea3501753..bbd90123a4e7 100644
+--- a/drivers/media/usb/uvc/uvc_driver.c
++++ b/drivers/media/usb/uvc/uvc_driver.c
+@@ -3003,6 +3003,15 @@ static const struct usb_device_id uvc_ids[] = {
+ .bInterfaceSubClass = 1,
+ .bInterfaceProtocol = 0,
+ .driver_info = UVC_INFO_QUIRK(UVC_QUIRK_FORCE_BPP) },
++ /* SunplusIT Inc HD Camera */
++ { .match_flags = USB_DEVICE_ID_MATCH_DEVICE
++ | USB_DEVICE_ID_MATCH_INT_INFO,
++ .idVendor = 0x2b7e,
++ .idProduct = 0xb752,
++ .bInterfaceClass = USB_CLASS_VIDEO,
++ .bInterfaceSubClass = 1,
++ .bInterfaceProtocol = UVC_PC_PROTOCOL_15,
++ .driver_info = (kernel_ulong_t)&uvc_ctrl_power_line_uvc11 },
+ /* Lenovo Integrated Camera */
+ { .match_flags = USB_DEVICE_ID_MATCH_DEVICE
+ | USB_DEVICE_ID_MATCH_INT_INFO,
+--
+2.43.0
+
--- /dev/null
+From d8e442023ff1751e76ecf0b5ad3077725d96f41b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 20 Dec 2023 15:56:39 +0000
+Subject: mfd: ti_am335x_tscadc: Fix TI SoC dependencies
+
+From: Peter Robinson <pbrobinson@gmail.com>
+
+[ Upstream commit 284d16c456e5d4b143f375b8ccc4038ab3f4ee0f ]
+
+The ti_am335x_tscadc is specific to some TI SoCs, update
+the dependencies for those SoCs and compile testing.
+
+Signed-off-by: Peter Robinson <pbrobinson@gmail.com>
+Link: https://lore.kernel.org/r/20231220155643.445849-1-pbrobinson@gmail.com
+Signed-off-by: Lee Jones <lee@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/mfd/Kconfig | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/mfd/Kconfig b/drivers/mfd/Kconfig
+index 90ce58fd629e..68d71b4b55bd 100644
+--- a/drivers/mfd/Kconfig
++++ b/drivers/mfd/Kconfig
+@@ -1483,6 +1483,7 @@ config MFD_SYSCON
+
+ config MFD_TI_AM335X_TSCADC
+ tristate "TI ADC / Touch Screen chip support"
++ depends on ARCH_OMAP2PLUS || ARCH_K3 || COMPILE_TEST
+ select MFD_CORE
+ select REGMAP
+ select REGMAP_MMIO
+--
+2.43.0
+
--- /dev/null
+From c0ff6a8450865184f7a6eedcac9af0024483c316 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 24 Dec 2023 19:34:02 +0100
+Subject: misc: lis3lv02d_i2c: Add missing setting of the reg_ctrl callback
+
+From: Hans de Goede <hdegoede@redhat.com>
+
+[ Upstream commit b1b9f7a494400c0c39f8cd83de3aaa6111c55087 ]
+
+The lis3lv02d_i2c driver was missing a line to set the lis3_dev's
+reg_ctrl callback.
+
+lis3_reg_ctrl(on) is called from the init callback, but due to
+the missing reg_ctrl callback the regulators where never turned off
+again leading to the following oops/backtrace when detaching the driver:
+
+[ 82.313527] ------------[ cut here ]------------
+[ 82.313546] WARNING: CPU: 1 PID: 1724 at drivers/regulator/core.c:2396 _regulator_put+0x219/0x230
+...
+[ 82.313695] RIP: 0010:_regulator_put+0x219/0x230
+...
+[ 82.314767] Call Trace:
+[ 82.314770] <TASK>
+[ 82.314772] ? _regulator_put+0x219/0x230
+[ 82.314777] ? __warn+0x81/0x170
+[ 82.314784] ? _regulator_put+0x219/0x230
+[ 82.314791] ? report_bug+0x18d/0x1c0
+[ 82.314801] ? handle_bug+0x3c/0x80
+[ 82.314806] ? exc_invalid_op+0x13/0x60
+[ 82.314812] ? asm_exc_invalid_op+0x16/0x20
+[ 82.314845] ? _regulator_put+0x219/0x230
+[ 82.314857] regulator_bulk_free+0x39/0x60
+[ 82.314865] i2c_device_remove+0x22/0xb0
+
+Add the missing setting of the callback so that the regulators
+properly get turned off again when not used.
+
+Signed-off-by: Hans de Goede <hdegoede@redhat.com>
+Link: https://lore.kernel.org/r/20231224183402.95640-1-hdegoede@redhat.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/misc/lis3lv02d/lis3lv02d_i2c.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/misc/lis3lv02d/lis3lv02d_i2c.c b/drivers/misc/lis3lv02d/lis3lv02d_i2c.c
+index 3882e97e96a7..c6eb27d46cb0 100644
+--- a/drivers/misc/lis3lv02d/lis3lv02d_i2c.c
++++ b/drivers/misc/lis3lv02d/lis3lv02d_i2c.c
+@@ -150,6 +150,7 @@ static int lis3lv02d_i2c_probe(struct i2c_client *client)
+ lis3_dev.init = lis3_i2c_init;
+ lis3_dev.read = lis3_i2c_read;
+ lis3_dev.write = lis3_i2c_write;
++ lis3_dev.reg_ctrl = lis3_reg_ctrl;
+ lis3_dev.irq = client->irq;
+ lis3_dev.ac = lis3lv02d_axis_map;
+ lis3_dev.pm_dev = &client->dev;
+--
+2.43.0
+
--- /dev/null
+From d3bbcfb27299e0de1c8eeccca8b6dde9a5c8a16c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 13 Dec 2023 10:50:44 +0100
+Subject: net: atlantic: eliminate double free in error handling logic
+
+From: Igor Russkikh <irusskikh@marvell.com>
+
+[ Upstream commit b3cb7a830a24527877b0bc900b9bd74a96aea928 ]
+
+Driver has a logic leak in ring data allocation/free,
+where aq_ring_free could be called multiple times on same ring,
+if system is under stress and got memory allocation error.
+
+Ring pointer was used as an indicator of failure, but this is
+not correct since only ring data is allocated/deallocated.
+Ring itself is an array member.
+
+Changing ring allocation functions to return error code directly.
+This simplifies error handling and eliminates aq_ring_free
+on higher layer.
+
+Signed-off-by: Igor Russkikh <irusskikh@marvell.com>
+Link: https://lore.kernel.org/r/20231213095044.23146-1-irusskikh@marvell.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../net/ethernet/aquantia/atlantic/aq_ptp.c | 28 +++------
+ .../net/ethernet/aquantia/atlantic/aq_ring.c | 61 +++++--------------
+ .../net/ethernet/aquantia/atlantic/aq_ring.h | 22 +++----
+ .../net/ethernet/aquantia/atlantic/aq_vec.c | 23 +++----
+ 4 files changed, 47 insertions(+), 87 deletions(-)
+
+diff --git a/drivers/net/ethernet/aquantia/atlantic/aq_ptp.c b/drivers/net/ethernet/aquantia/atlantic/aq_ptp.c
+index 28c9b6f1a54f..abd4832e4ed2 100644
+--- a/drivers/net/ethernet/aquantia/atlantic/aq_ptp.c
++++ b/drivers/net/ethernet/aquantia/atlantic/aq_ptp.c
+@@ -953,8 +953,6 @@ int aq_ptp_ring_alloc(struct aq_nic_s *aq_nic)
+ {
+ struct aq_ptp_s *aq_ptp = aq_nic->aq_ptp;
+ unsigned int tx_ring_idx, rx_ring_idx;
+- struct aq_ring_s *hwts;
+- struct aq_ring_s *ring;
+ int err;
+
+ if (!aq_ptp)
+@@ -962,29 +960,23 @@ int aq_ptp_ring_alloc(struct aq_nic_s *aq_nic)
+
+ tx_ring_idx = aq_ptp_ring_idx(aq_nic->aq_nic_cfg.tc_mode);
+
+- ring = aq_ring_tx_alloc(&aq_ptp->ptp_tx, aq_nic,
+- tx_ring_idx, &aq_nic->aq_nic_cfg);
+- if (!ring) {
+- err = -ENOMEM;
++ err = aq_ring_tx_alloc(&aq_ptp->ptp_tx, aq_nic,
++ tx_ring_idx, &aq_nic->aq_nic_cfg);
++ if (err)
+ goto err_exit;
+- }
+
+ rx_ring_idx = aq_ptp_ring_idx(aq_nic->aq_nic_cfg.tc_mode);
+
+- ring = aq_ring_rx_alloc(&aq_ptp->ptp_rx, aq_nic,
+- rx_ring_idx, &aq_nic->aq_nic_cfg);
+- if (!ring) {
+- err = -ENOMEM;
++ err = aq_ring_rx_alloc(&aq_ptp->ptp_rx, aq_nic,
++ rx_ring_idx, &aq_nic->aq_nic_cfg);
++ if (err)
+ goto err_exit_ptp_tx;
+- }
+
+- hwts = aq_ring_hwts_rx_alloc(&aq_ptp->hwts_rx, aq_nic, PTP_HWST_RING_IDX,
+- aq_nic->aq_nic_cfg.rxds,
+- aq_nic->aq_nic_cfg.aq_hw_caps->rxd_size);
+- if (!hwts) {
+- err = -ENOMEM;
++ err = aq_ring_hwts_rx_alloc(&aq_ptp->hwts_rx, aq_nic, PTP_HWST_RING_IDX,
++ aq_nic->aq_nic_cfg.rxds,
++ aq_nic->aq_nic_cfg.aq_hw_caps->rxd_size);
++ if (err)
+ goto err_exit_ptp_rx;
+- }
+
+ err = aq_ptp_skb_ring_init(&aq_ptp->skb_ring, aq_nic->aq_nic_cfg.rxds);
+ if (err != 0) {
+diff --git a/drivers/net/ethernet/aquantia/atlantic/aq_ring.c b/drivers/net/ethernet/aquantia/atlantic/aq_ring.c
+index e1885c1eb100..cda8597b4e14 100644
+--- a/drivers/net/ethernet/aquantia/atlantic/aq_ring.c
++++ b/drivers/net/ethernet/aquantia/atlantic/aq_ring.c
+@@ -132,8 +132,8 @@ static int aq_get_rxpages(struct aq_ring_s *self, struct aq_ring_buff_s *rxbuf)
+ return 0;
+ }
+
+-static struct aq_ring_s *aq_ring_alloc(struct aq_ring_s *self,
+- struct aq_nic_s *aq_nic)
++static int aq_ring_alloc(struct aq_ring_s *self,
++ struct aq_nic_s *aq_nic)
+ {
+ int err = 0;
+
+@@ -156,46 +156,29 @@ static struct aq_ring_s *aq_ring_alloc(struct aq_ring_s *self,
+ err_exit:
+ if (err < 0) {
+ aq_ring_free(self);
+- self = NULL;
+ }
+
+- return self;
++ return err;
+ }
+
+-struct aq_ring_s *aq_ring_tx_alloc(struct aq_ring_s *self,
+- struct aq_nic_s *aq_nic,
+- unsigned int idx,
+- struct aq_nic_cfg_s *aq_nic_cfg)
++int aq_ring_tx_alloc(struct aq_ring_s *self,
++ struct aq_nic_s *aq_nic,
++ unsigned int idx,
++ struct aq_nic_cfg_s *aq_nic_cfg)
+ {
+- int err = 0;
+-
+ self->aq_nic = aq_nic;
+ self->idx = idx;
+ self->size = aq_nic_cfg->txds;
+ self->dx_size = aq_nic_cfg->aq_hw_caps->txd_size;
+
+- self = aq_ring_alloc(self, aq_nic);
+- if (!self) {
+- err = -ENOMEM;
+- goto err_exit;
+- }
+-
+-err_exit:
+- if (err < 0) {
+- aq_ring_free(self);
+- self = NULL;
+- }
+-
+- return self;
++ return aq_ring_alloc(self, aq_nic);
+ }
+
+-struct aq_ring_s *aq_ring_rx_alloc(struct aq_ring_s *self,
+- struct aq_nic_s *aq_nic,
+- unsigned int idx,
+- struct aq_nic_cfg_s *aq_nic_cfg)
++int aq_ring_rx_alloc(struct aq_ring_s *self,
++ struct aq_nic_s *aq_nic,
++ unsigned int idx,
++ struct aq_nic_cfg_s *aq_nic_cfg)
+ {
+- int err = 0;
+-
+ self->aq_nic = aq_nic;
+ self->idx = idx;
+ self->size = aq_nic_cfg->rxds;
+@@ -217,22 +200,10 @@ struct aq_ring_s *aq_ring_rx_alloc(struct aq_ring_s *self,
+ self->tail_size = 0;
+ }
+
+- self = aq_ring_alloc(self, aq_nic);
+- if (!self) {
+- err = -ENOMEM;
+- goto err_exit;
+- }
+-
+-err_exit:
+- if (err < 0) {
+- aq_ring_free(self);
+- self = NULL;
+- }
+-
+- return self;
++ return aq_ring_alloc(self, aq_nic);
+ }
+
+-struct aq_ring_s *
++int
+ aq_ring_hwts_rx_alloc(struct aq_ring_s *self, struct aq_nic_s *aq_nic,
+ unsigned int idx, unsigned int size, unsigned int dx_size)
+ {
+@@ -250,10 +221,10 @@ aq_ring_hwts_rx_alloc(struct aq_ring_s *self, struct aq_nic_s *aq_nic,
+ GFP_KERNEL);
+ if (!self->dx_ring) {
+ aq_ring_free(self);
+- return NULL;
++ return -ENOMEM;
+ }
+
+- return self;
++ return 0;
+ }
+
+ int aq_ring_init(struct aq_ring_s *self, const enum atl_ring_type ring_type)
+diff --git a/drivers/net/ethernet/aquantia/atlantic/aq_ring.h b/drivers/net/ethernet/aquantia/atlantic/aq_ring.h
+index 0a6c34438c1d..52847310740a 100644
+--- a/drivers/net/ethernet/aquantia/atlantic/aq_ring.h
++++ b/drivers/net/ethernet/aquantia/atlantic/aq_ring.h
+@@ -183,14 +183,14 @@ static inline unsigned int aq_ring_avail_dx(struct aq_ring_s *self)
+ self->sw_head - self->sw_tail - 1);
+ }
+
+-struct aq_ring_s *aq_ring_tx_alloc(struct aq_ring_s *self,
+- struct aq_nic_s *aq_nic,
+- unsigned int idx,
+- struct aq_nic_cfg_s *aq_nic_cfg);
+-struct aq_ring_s *aq_ring_rx_alloc(struct aq_ring_s *self,
+- struct aq_nic_s *aq_nic,
+- unsigned int idx,
+- struct aq_nic_cfg_s *aq_nic_cfg);
++int aq_ring_tx_alloc(struct aq_ring_s *self,
++ struct aq_nic_s *aq_nic,
++ unsigned int idx,
++ struct aq_nic_cfg_s *aq_nic_cfg);
++int aq_ring_rx_alloc(struct aq_ring_s *self,
++ struct aq_nic_s *aq_nic,
++ unsigned int idx,
++ struct aq_nic_cfg_s *aq_nic_cfg);
+
+ int aq_ring_init(struct aq_ring_s *self, const enum atl_ring_type ring_type);
+ void aq_ring_rx_deinit(struct aq_ring_s *self);
+@@ -207,9 +207,9 @@ int aq_ring_rx_clean(struct aq_ring_s *self,
+ int budget);
+ int aq_ring_rx_fill(struct aq_ring_s *self);
+
+-struct aq_ring_s *aq_ring_hwts_rx_alloc(struct aq_ring_s *self,
+- struct aq_nic_s *aq_nic, unsigned int idx,
+- unsigned int size, unsigned int dx_size);
++int aq_ring_hwts_rx_alloc(struct aq_ring_s *self,
++ struct aq_nic_s *aq_nic, unsigned int idx,
++ unsigned int size, unsigned int dx_size);
+ void aq_ring_hwts_rx_clean(struct aq_ring_s *self, struct aq_nic_s *aq_nic);
+
+ unsigned int aq_ring_fill_stats_data(struct aq_ring_s *self, u64 *data);
+diff --git a/drivers/net/ethernet/aquantia/atlantic/aq_vec.c b/drivers/net/ethernet/aquantia/atlantic/aq_vec.c
+index f5db1c44e9b9..9769ab4f9bef 100644
+--- a/drivers/net/ethernet/aquantia/atlantic/aq_vec.c
++++ b/drivers/net/ethernet/aquantia/atlantic/aq_vec.c
+@@ -136,35 +136,32 @@ int aq_vec_ring_alloc(struct aq_vec_s *self, struct aq_nic_s *aq_nic,
+ const unsigned int idx_ring = AQ_NIC_CFG_TCVEC2RING(aq_nic_cfg,
+ i, idx);
+
+- ring = aq_ring_tx_alloc(&self->ring[i][AQ_VEC_TX_ID], aq_nic,
+- idx_ring, aq_nic_cfg);
+- if (!ring) {
+- err = -ENOMEM;
++ ring = &self->ring[i][AQ_VEC_TX_ID];
++ err = aq_ring_tx_alloc(ring, aq_nic, idx_ring, aq_nic_cfg);
++ if (err)
+ goto err_exit;
+- }
+
+ ++self->tx_rings;
+
+ aq_nic_set_tx_ring(aq_nic, idx_ring, ring);
+
+- if (xdp_rxq_info_reg(&self->ring[i][AQ_VEC_RX_ID].xdp_rxq,
++ ring = &self->ring[i][AQ_VEC_RX_ID];
++ if (xdp_rxq_info_reg(&ring->xdp_rxq,
+ aq_nic->ndev, idx,
+ self->napi.napi_id) < 0) {
+ err = -ENOMEM;
+ goto err_exit;
+ }
+- if (xdp_rxq_info_reg_mem_model(&self->ring[i][AQ_VEC_RX_ID].xdp_rxq,
++ if (xdp_rxq_info_reg_mem_model(&ring->xdp_rxq,
+ MEM_TYPE_PAGE_SHARED, NULL) < 0) {
+- xdp_rxq_info_unreg(&self->ring[i][AQ_VEC_RX_ID].xdp_rxq);
++ xdp_rxq_info_unreg(&ring->xdp_rxq);
+ err = -ENOMEM;
+ goto err_exit;
+ }
+
+- ring = aq_ring_rx_alloc(&self->ring[i][AQ_VEC_RX_ID], aq_nic,
+- idx_ring, aq_nic_cfg);
+- if (!ring) {
+- xdp_rxq_info_unreg(&self->ring[i][AQ_VEC_RX_ID].xdp_rxq);
+- err = -ENOMEM;
++ err = aq_ring_rx_alloc(ring, aq_nic, idx_ring, aq_nic_cfg);
++ if (err) {
++ xdp_rxq_info_unreg(&ring->xdp_rxq);
+ goto err_exit;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From c2dcc30911de78d26d6b87fcdacf73a8a2b1741f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 14 Dec 2023 14:50:24 +0100
+Subject: net: dsa: mv88e6xxx: Fix mv88e6352_serdes_get_stats error path
+
+From: Tobias Waldekranz <tobias@waldekranz.com>
+
+[ Upstream commit fc82a08ae795ee6b73fb6b50785f7be248bec7b5 ]
+
+mv88e6xxx_get_stats, which collects stats from various sources,
+expects all callees to return the number of stats read. If an error
+occurs, 0 should be returned.
+
+Prevent future mishaps of this kind by updating the return type to
+reflect this contract.
+
+Reviewed-by: Vladimir Oltean <vladimir.oltean@nxp.com>
+Reviewed-by: Florian Fainelli <florian.fainelli@broadcom.com>
+Signed-off-by: Tobias Waldekranz <tobias@waldekranz.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/dsa/mv88e6xxx/chip.h | 4 ++--
+ drivers/net/dsa/mv88e6xxx/serdes.c | 10 +++++-----
+ drivers/net/dsa/mv88e6xxx/serdes.h | 8 ++++----
+ 3 files changed, 11 insertions(+), 11 deletions(-)
+
+diff --git a/drivers/net/dsa/mv88e6xxx/chip.h b/drivers/net/dsa/mv88e6xxx/chip.h
+index 44383a03ef2f..c54d305a1d83 100644
+--- a/drivers/net/dsa/mv88e6xxx/chip.h
++++ b/drivers/net/dsa/mv88e6xxx/chip.h
+@@ -601,8 +601,8 @@ struct mv88e6xxx_ops {
+ int (*serdes_get_sset_count)(struct mv88e6xxx_chip *chip, int port);
+ int (*serdes_get_strings)(struct mv88e6xxx_chip *chip, int port,
+ uint8_t *data);
+- int (*serdes_get_stats)(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data);
++ size_t (*serdes_get_stats)(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data);
+
+ /* SERDES registers for ethtool */
+ int (*serdes_get_regs_len)(struct mv88e6xxx_chip *chip, int port);
+diff --git a/drivers/net/dsa/mv88e6xxx/serdes.c b/drivers/net/dsa/mv88e6xxx/serdes.c
+index 3b4b42651fa3..01ea53940786 100644
+--- a/drivers/net/dsa/mv88e6xxx/serdes.c
++++ b/drivers/net/dsa/mv88e6xxx/serdes.c
+@@ -177,8 +177,8 @@ static uint64_t mv88e6352_serdes_get_stat(struct mv88e6xxx_chip *chip,
+ return val;
+ }
+
+-int mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data)
++size_t mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data)
+ {
+ struct mv88e6xxx_port *mv88e6xxx_port = &chip->ports[port];
+ struct mv88e6352_serdes_hw_stat *stat;
+@@ -187,7 +187,7 @@ int mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+
+ err = mv88e6352_g2_scratch_port_has_serdes(chip, port);
+ if (err <= 0)
+- return err;
++ return 0;
+
+ BUILD_BUG_ON(ARRAY_SIZE(mv88e6352_serdes_hw_stats) >
+ ARRAY_SIZE(mv88e6xxx_port->serdes_stats));
+@@ -429,8 +429,8 @@ static uint64_t mv88e6390_serdes_get_stat(struct mv88e6xxx_chip *chip, int lane,
+ return reg[0] | ((u64)reg[1] << 16) | ((u64)reg[2] << 32);
+ }
+
+-int mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data)
++size_t mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data)
+ {
+ struct mv88e6390_serdes_hw_stat *stat;
+ int lane;
+diff --git a/drivers/net/dsa/mv88e6xxx/serdes.h b/drivers/net/dsa/mv88e6xxx/serdes.h
+index aac95cab46e3..ff5c3ab31e15 100644
+--- a/drivers/net/dsa/mv88e6xxx/serdes.h
++++ b/drivers/net/dsa/mv88e6xxx/serdes.h
+@@ -127,13 +127,13 @@ unsigned int mv88e6390_serdes_irq_mapping(struct mv88e6xxx_chip *chip,
+ int mv88e6352_serdes_get_sset_count(struct mv88e6xxx_chip *chip, int port);
+ int mv88e6352_serdes_get_strings(struct mv88e6xxx_chip *chip,
+ int port, uint8_t *data);
+-int mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data);
++size_t mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data);
+ int mv88e6390_serdes_get_sset_count(struct mv88e6xxx_chip *chip, int port);
+ int mv88e6390_serdes_get_strings(struct mv88e6xxx_chip *chip,
+ int port, uint8_t *data);
+-int mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data);
++size_t mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data);
+
+ int mv88e6352_serdes_get_regs_len(struct mv88e6xxx_chip *chip, int port);
+ void mv88e6352_serdes_get_regs(struct mv88e6xxx_chip *chip, int port, void *_p);
+--
+2.43.0
+
--- /dev/null
+From 41e87206753bcc8bfadbc77ef45ce0c2da4abdf6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 4 Jan 2024 16:00:31 +0200
+Subject: net: dsa: qca8k: put MDIO bus OF node on qca8k_mdio_register()
+ failure
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Vladimir Oltean <vladimir.oltean@nxp.com>
+
+[ Upstream commit 68e1010cda7967cfca9c8650ee1f4efcae54ab90 ]
+
+of_get_child_by_name() gives us an OF node with an elevated refcount,
+which should be dropped when we're done with it. This is so that,
+if (of_node_check_flag(node, OF_DYNAMIC)) is true, the node's memory can
+eventually be freed.
+
+There are 2 distinct paths to be considered in qca8k_mdio_register():
+
+- devm_of_mdiobus_register() succeeds: since commit 3b73a7b8ec38 ("net:
+ mdio_bus: add refcounting for fwnodes to mdiobus"), the MDIO core
+ treats this well.
+
+- devm_of_mdiobus_register() or anything up to that point fails: it is
+ the duty of the qca8k driver to release the OF node.
+
+This change addresses the second case by making sure that the OF node
+reference is not leaked.
+
+The "mdio" node may be NULL, but of_node_put(NULL) is safe.
+
+Signed-off-by: Vladimir Oltean <vladimir.oltean@nxp.com>
+Reviewed-by: Alvin Šipraga <alsi@bang-olufsen.dk>
+Reviewed-by: Florian Fainelli <florian.fainelli@broadcom.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/dsa/qca/qca8k-8xxx.c | 21 ++++++++++++++++-----
+ 1 file changed, 16 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/net/dsa/qca/qca8k-8xxx.c b/drivers/net/dsa/qca/qca8k-8xxx.c
+index ec57d9d52072..5f47a290bd6e 100644
+--- a/drivers/net/dsa/qca/qca8k-8xxx.c
++++ b/drivers/net/dsa/qca/qca8k-8xxx.c
+@@ -949,10 +949,15 @@ qca8k_mdio_register(struct qca8k_priv *priv)
+ struct dsa_switch *ds = priv->ds;
+ struct device_node *mdio;
+ struct mii_bus *bus;
++ int err;
++
++ mdio = of_get_child_by_name(priv->dev->of_node, "mdio");
+
+ bus = devm_mdiobus_alloc(ds->dev);
+- if (!bus)
+- return -ENOMEM;
++ if (!bus) {
++ err = -ENOMEM;
++ goto out_put_node;
++ }
+
+ bus->priv = (void *)priv;
+ snprintf(bus->id, MII_BUS_ID_SIZE, "qca8k-%d.%d",
+@@ -962,12 +967,12 @@ qca8k_mdio_register(struct qca8k_priv *priv)
+ ds->user_mii_bus = bus;
+
+ /* Check if the devicetree declare the port:phy mapping */
+- mdio = of_get_child_by_name(priv->dev->of_node, "mdio");
+ if (of_device_is_available(mdio)) {
+ bus->name = "qca8k user mii";
+ bus->read = qca8k_internal_mdio_read;
+ bus->write = qca8k_internal_mdio_write;
+- return devm_of_mdiobus_register(priv->dev, bus, mdio);
++ err = devm_of_mdiobus_register(priv->dev, bus, mdio);
++ goto out_put_node;
+ }
+
+ /* If a mapping can't be found the legacy mapping is used,
+@@ -976,7 +981,13 @@ qca8k_mdio_register(struct qca8k_priv *priv)
+ bus->name = "qca8k-legacy user mii";
+ bus->read = qca8k_legacy_mdio_read;
+ bus->write = qca8k_legacy_mdio_write;
+- return devm_mdiobus_register(priv->dev, bus);
++
++ err = devm_mdiobus_register(priv->dev, bus);
++
++out_put_node:
++ of_node_put(mdio);
++
++ return err;
+ }
+
+ static int
+--
+2.43.0
+
--- /dev/null
+From f252439c286e8d07735300dcb9bf69fd24619090 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 2 Jan 2024 12:59:58 -0800
+Subject: net: kcm: fix direct access to bv_len
+
+From: Mina Almasry <almasrymina@google.com>
+
+[ Upstream commit b15a4cfe100b9acd097d3ae7052448bd1cdc2a3b ]
+
+Minor fix for kcm: code wanting to access the fields inside an skb
+frag should use the skb_frag_*() helpers, instead of accessing the
+fields directly.
+
+Signed-off-by: Mina Almasry <almasrymina@google.com>
+Link: https://lore.kernel.org/r/20240102205959.794513-1-almasrymina@google.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/kcm/kcmsock.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/net/kcm/kcmsock.c b/net/kcm/kcmsock.c
+index 65d1f6755f98..1184d40167b8 100644
+--- a/net/kcm/kcmsock.c
++++ b/net/kcm/kcmsock.c
+@@ -634,7 +634,7 @@ static int kcm_write_msgs(struct kcm_sock *kcm)
+
+ msize = 0;
+ for (i = 0; i < skb_shinfo(skb)->nr_frags; i++)
+- msize += skb_shinfo(skb)->frags[i].bv_len;
++ msize += skb_frag_size(&skb_shinfo(skb)->frags[i]);
+
+ iov_iter_bvec(&msg.msg_iter, ITER_SOURCE,
+ skb_shinfo(skb)->frags, skb_shinfo(skb)->nr_frags,
+--
+2.43.0
+
--- /dev/null
+From efb3503566a43c9e585338f3c3883ce0ea04da8f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 11:08:10 +0100
+Subject: net: mvmdio: Avoid excessive sleeps in polled mode
+
+From: Tobias Waldekranz <tobias@waldekranz.com>
+
+[ Upstream commit 7dd12fe34686d89c332b1a05104d18d728591f0a ]
+
+Before this change, when operating in polled mode, i.e. no IRQ is
+available, every individual C45 access would be hit with a 150us sleep
+after the bus access.
+
+For example, on a board with a CN9130 SoC connected to an MV88X3310
+PHY, a single C45 read would take around 165us:
+
+ root@infix:~$ mdio f212a600.mdio-mii mmd 4:1 bench 0xc003
+ Performed 1000 reads in 165ms
+
+By replacing the long sleep with a tighter poll loop, we observe a 10x
+increase in bus throughput:
+
+ root@infix:~$ mdio f212a600.mdio-mii mmd 4:1 bench 0xc003
+ Performed 1000 reads in 15ms
+
+Signed-off-by: Tobias Waldekranz <tobias@waldekranz.com>
+Reviewed-by: Andrew Lunn <andrew@lunn.ch>
+Tested-by: Andrew Lunn <andrew@lunn.ch>
+Link: https://lore.kernel.org/r/20231204100811.2708884-3-tobias@waldekranz.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/marvell/mvmdio.c | 53 ++++++++-------------------
+ 1 file changed, 16 insertions(+), 37 deletions(-)
+
+diff --git a/drivers/net/ethernet/marvell/mvmdio.c b/drivers/net/ethernet/marvell/mvmdio.c
+index 89f26402f8fb..5f66f779e56f 100644
+--- a/drivers/net/ethernet/marvell/mvmdio.c
++++ b/drivers/net/ethernet/marvell/mvmdio.c
+@@ -23,6 +23,7 @@
+ #include <linux/delay.h>
+ #include <linux/interrupt.h>
+ #include <linux/io.h>
++#include <linux/iopoll.h>
+ #include <linux/kernel.h>
+ #include <linux/mod_devicetable.h>
+ #include <linux/module.h>
+@@ -58,11 +59,6 @@
+ * - Armada 370 (Globalscale Mirabox): 41us to 43us (Polled)
+ */
+ #define MVMDIO_SMI_TIMEOUT 1000 /* 1000us = 1ms */
+-#define MVMDIO_SMI_POLL_INTERVAL_MIN 45
+-#define MVMDIO_SMI_POLL_INTERVAL_MAX 55
+-
+-#define MVMDIO_XSMI_POLL_INTERVAL_MIN 150
+-#define MVMDIO_XSMI_POLL_INTERVAL_MAX 160
+
+ struct orion_mdio_dev {
+ void __iomem *regs;
+@@ -84,8 +80,6 @@ enum orion_mdio_bus_type {
+
+ struct orion_mdio_ops {
+ int (*is_done)(struct orion_mdio_dev *);
+- unsigned int poll_interval_min;
+- unsigned int poll_interval_max;
+ };
+
+ /* Wait for the SMI unit to be ready for another operation
+@@ -94,34 +88,23 @@ static int orion_mdio_wait_ready(const struct orion_mdio_ops *ops,
+ struct mii_bus *bus)
+ {
+ struct orion_mdio_dev *dev = bus->priv;
+- unsigned long timeout = usecs_to_jiffies(MVMDIO_SMI_TIMEOUT);
+- unsigned long end = jiffies + timeout;
+- int timedout = 0;
++ unsigned long timeout;
++ int done;
+
+- while (1) {
+- if (ops->is_done(dev))
++ if (dev->err_interrupt <= 0) {
++ if (!read_poll_timeout_atomic(ops->is_done, done, done, 2,
++ MVMDIO_SMI_TIMEOUT, false, dev))
++ return 0;
++ } else {
++ /* wait_event_timeout does not guarantee a delay of at
++ * least one whole jiffie, so timeout must be no less
++ * than two.
++ */
++ timeout = max(usecs_to_jiffies(MVMDIO_SMI_TIMEOUT), 2);
++
++ if (wait_event_timeout(dev->smi_busy_wait,
++ ops->is_done(dev), timeout))
+ return 0;
+- else if (timedout)
+- break;
+-
+- if (dev->err_interrupt <= 0) {
+- usleep_range(ops->poll_interval_min,
+- ops->poll_interval_max);
+-
+- if (time_is_before_jiffies(end))
+- ++timedout;
+- } else {
+- /* wait_event_timeout does not guarantee a delay of at
+- * least one whole jiffie, so timeout must be no less
+- * than two.
+- */
+- if (timeout < 2)
+- timeout = 2;
+- wait_event_timeout(dev->smi_busy_wait,
+- ops->is_done(dev), timeout);
+-
+- ++timedout;
+- }
+ }
+
+ dev_err(bus->parent, "Timeout: SMI busy for too long\n");
+@@ -135,8 +118,6 @@ static int orion_mdio_smi_is_done(struct orion_mdio_dev *dev)
+
+ static const struct orion_mdio_ops orion_mdio_smi_ops = {
+ .is_done = orion_mdio_smi_is_done,
+- .poll_interval_min = MVMDIO_SMI_POLL_INTERVAL_MIN,
+- .poll_interval_max = MVMDIO_SMI_POLL_INTERVAL_MAX,
+ };
+
+ static int orion_mdio_smi_read(struct mii_bus *bus, int mii_id,
+@@ -194,8 +175,6 @@ static int orion_mdio_xsmi_is_done(struct orion_mdio_dev *dev)
+
+ static const struct orion_mdio_ops orion_mdio_xsmi_ops = {
+ .is_done = orion_mdio_xsmi_is_done,
+- .poll_interval_min = MVMDIO_XSMI_POLL_INTERVAL_MIN,
+- .poll_interval_max = MVMDIO_XSMI_POLL_INTERVAL_MAX,
+ };
+
+ static int orion_mdio_xsmi_read_c45(struct mii_bus *bus, int mii_id,
+--
+2.43.0
+
--- /dev/null
+From 4ec813b1bb235ff953aef735a6ecff12ec2747c8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 15:51:48 +0100
+Subject: net: phy: at803x: fix passing the wrong reference for config_intr
+
+From: Christian Marangi <ansuelsmth@gmail.com>
+
+[ Upstream commit f8fdbf3389f44c7026f16e36cb1f2ff017f7f5b2 ]
+
+Fix passing the wrong reference for config_initr on passing the function
+pointer, drop the wrong & from at803x_config_intr in the PHY struct.
+
+Signed-off-by: Christian Marangi <ansuelsmth@gmail.com>
+Reviewed-by: Andrew Lunn <andrew@lunn.ch>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/phy/at803x.c | 6 +++---
+ 1 file changed, 3 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/net/phy/at803x.c b/drivers/net/phy/at803x.c
+index 37fb033e1c29..ef203b0807e5 100644
+--- a/drivers/net/phy/at803x.c
++++ b/drivers/net/phy/at803x.c
+@@ -2104,7 +2104,7 @@ static struct phy_driver at803x_driver[] = {
+ .write_page = at803x_write_page,
+ .get_features = at803x_get_features,
+ .read_status = at803x_read_status,
+- .config_intr = &at803x_config_intr,
++ .config_intr = at803x_config_intr,
+ .handle_interrupt = at803x_handle_interrupt,
+ .get_tunable = at803x_get_tunable,
+ .set_tunable = at803x_set_tunable,
+@@ -2134,7 +2134,7 @@ static struct phy_driver at803x_driver[] = {
+ .resume = at803x_resume,
+ .flags = PHY_POLL_CABLE_TEST,
+ /* PHY_BASIC_FEATURES */
+- .config_intr = &at803x_config_intr,
++ .config_intr = at803x_config_intr,
+ .handle_interrupt = at803x_handle_interrupt,
+ .cable_test_start = at803x_cable_test_start,
+ .cable_test_get_status = at803x_cable_test_get_status,
+@@ -2150,7 +2150,7 @@ static struct phy_driver at803x_driver[] = {
+ .resume = at803x_resume,
+ .flags = PHY_POLL_CABLE_TEST,
+ /* PHY_BASIC_FEATURES */
+- .config_intr = &at803x_config_intr,
++ .config_intr = at803x_config_intr,
+ .handle_interrupt = at803x_handle_interrupt,
+ .cable_test_start = at803x_cable_test_start,
+ .cable_test_get_status = at803x_cable_test_get_status,
+--
+2.43.0
+
--- /dev/null
+From 2b448c6317a380e1881de4a18ced44200a3615e2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 14 Nov 2023 12:28:34 +0100
+Subject: net: phy: micrel: fix ts_info value in case of no phc
+
+From: Kory Maincent <kory.maincent@bootlin.com>
+
+[ Upstream commit 915d25a9d69be969c1cc6c1dd0c3861f6da7b55e ]
+
+In case of no phc we should not return SOFTWARE TIMESTAMPING flags as we do
+not know whether the netdev supports of timestamping.
+Remove it from the lan8841_ts_info and simply return 0.
+
+Signed-off-by: Kory Maincent <kory.maincent@bootlin.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/phy/micrel.c | 6 +-----
+ 1 file changed, 1 insertion(+), 5 deletions(-)
+
+diff --git a/drivers/net/phy/micrel.c b/drivers/net/phy/micrel.c
+index 858175ca58cd..ca2db4adcb35 100644
+--- a/drivers/net/phy/micrel.c
++++ b/drivers/net/phy/micrel.c
+@@ -3650,12 +3650,8 @@ static int lan8841_ts_info(struct mii_timestamper *mii_ts,
+
+ info->phc_index = ptp_priv->ptp_clock ?
+ ptp_clock_index(ptp_priv->ptp_clock) : -1;
+- if (info->phc_index == -1) {
+- info->so_timestamping |= SOF_TIMESTAMPING_TX_SOFTWARE |
+- SOF_TIMESTAMPING_RX_SOFTWARE |
+- SOF_TIMESTAMPING_SOFTWARE;
++ if (info->phc_index == -1)
+ return 0;
+- }
+
+ info->so_timestamping = SOF_TIMESTAMPING_TX_HARDWARE |
+ SOF_TIMESTAMPING_RX_HARDWARE |
+--
+2.43.0
+
--- /dev/null
+From 0b1dc89f74a514eafd8145365e42c283db6e22de Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 22:26:15 +0800
+Subject: net/smc: disable SEID on non-s390 archs where virtual ISM may be used
+
+From: Wen Gu <guwen@linux.alibaba.com>
+
+[ Upstream commit c6b8b8eb49904018e22e4e4b1fa502e57dc747d9 ]
+
+The system EID (SEID) is an internal EID used by SMC-D to represent the
+s390 physical machine that OS is executing on. On s390 architecture, it
+predefined by fixed string and part of cpuid and is enabled regardless
+of whether underlay device is virtual ISM or platform firmware ISM.
+
+However on non-s390 architectures where SMC-D can be used with virtual
+ISM devices, there is no similar information to identify physical
+machines, especially in virtualization scenarios. So in such cases, SEID
+is forcibly disabled and the user-defined UEID will be used to represent
+the communicable space.
+
+Signed-off-by: Wen Gu <guwen@linux.alibaba.com>
+Reviewed-and-tested-by: Wenjia Zhang <wenjia@linux.ibm.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/smc/smc_clc.c | 14 ++++++++++++++
+ 1 file changed, 14 insertions(+)
+
+diff --git a/net/smc/smc_clc.c b/net/smc/smc_clc.c
+index 72f4d81a3f41..1489a8421d78 100644
+--- a/net/smc/smc_clc.c
++++ b/net/smc/smc_clc.c
+@@ -155,10 +155,12 @@ static int smc_clc_ueid_remove(char *ueid)
+ rc = 0;
+ }
+ }
++#if IS_ENABLED(CONFIG_S390)
+ if (!rc && !smc_clc_eid_table.ueid_cnt) {
+ smc_clc_eid_table.seid_enabled = 1;
+ rc = -EAGAIN; /* indicate success and enabling of seid */
+ }
++#endif
+ write_unlock(&smc_clc_eid_table.lock);
+ return rc;
+ }
+@@ -273,22 +275,30 @@ int smc_nl_dump_seid(struct sk_buff *skb, struct netlink_callback *cb)
+
+ int smc_nl_enable_seid(struct sk_buff *skb, struct genl_info *info)
+ {
++#if IS_ENABLED(CONFIG_S390)
+ write_lock(&smc_clc_eid_table.lock);
+ smc_clc_eid_table.seid_enabled = 1;
+ write_unlock(&smc_clc_eid_table.lock);
+ return 0;
++#else
++ return -EOPNOTSUPP;
++#endif
+ }
+
+ int smc_nl_disable_seid(struct sk_buff *skb, struct genl_info *info)
+ {
+ int rc = 0;
+
++#if IS_ENABLED(CONFIG_S390)
+ write_lock(&smc_clc_eid_table.lock);
+ if (!smc_clc_eid_table.ueid_cnt)
+ rc = -ENOENT;
+ else
+ smc_clc_eid_table.seid_enabled = 0;
+ write_unlock(&smc_clc_eid_table.lock);
++#else
++ rc = -EOPNOTSUPP;
++#endif
+ return rc;
+ }
+
+@@ -1269,7 +1279,11 @@ void __init smc_clc_init(void)
+ INIT_LIST_HEAD(&smc_clc_eid_table.list);
+ rwlock_init(&smc_clc_eid_table.lock);
+ smc_clc_eid_table.ueid_cnt = 0;
++#if IS_ENABLED(CONFIG_S390)
+ smc_clc_eid_table.seid_enabled = 1;
++#else
++ smc_clc_eid_table.seid_enabled = 0;
++#endif
+ }
+
+ void smc_clc_exit(void)
+--
+2.43.0
+
--- /dev/null
+From 712ae121d8a8e21d8f3b2171b04378e4972e32e9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 20 Nov 2023 13:11:41 +0100
+Subject: net: usb: ax88179_178a: avoid two consecutive device resets
+
+From: Jose Ignacio Tornos Martinez <jtornosm@redhat.com>
+
+[ Upstream commit d2689b6a86b9d23574bd4b654bf770b6034e2c7e ]
+
+The device is always reset two consecutive times (ax88179_reset is called
+twice), one from usbnet_probe during the device binding and the other from
+usbnet_open.
+
+Remove the non-necessary reset during the device binding and let the reset
+operation from open to keep the normal behavior (tested with generic ASIX
+Electronics Corp. AX88179 Gigabit Ethernet device).
+
+Reported-by: Herb Wei <weihao.bj@ieisystem.com>
+Tested-by: Herb Wei <weihao.bj@ieisystem.com>
+Signed-off-by: Jose Ignacio Tornos Martinez <jtornosm@redhat.com>
+Link: https://lore.kernel.org/r/20231120121239.54504-1-jtornosm@redhat.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/usb/ax88179_178a.c | 2 --
+ 1 file changed, 2 deletions(-)
+
+diff --git a/drivers/net/usb/ax88179_178a.c b/drivers/net/usb/ax88179_178a.c
+index 5a1bf42ce156..d837c1887416 100644
+--- a/drivers/net/usb/ax88179_178a.c
++++ b/drivers/net/usb/ax88179_178a.c
+@@ -1315,8 +1315,6 @@ static int ax88179_bind(struct usbnet *dev, struct usb_interface *intf)
+
+ netif_set_tso_max_size(dev->net, 16384);
+
+- ax88179_reset(dev);
+-
+ return 0;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From e7ccb8bc3ea2db1bf0f9e049ee95be2ee837d655 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 23:14:21 +0200
+Subject: ocfs2: Avoid touching renamed directory if parent does not change
+
+From: Jan Kara <jack@suse.cz>
+
+[ Upstream commit 9d618d19b29c2943527e3a43da0a35aea91062fc ]
+
+The VFS will not be locking moved directory if its parent does not
+change. Change ocfs2 rename code to avoid touching renamed directory if
+its parent does not change as without locking that can corrupt the
+filesystem.
+
+Signed-off-by: Jan Kara <jack@suse.cz>
+Signed-off-by: Al Viro <viro@zeniv.linux.org.uk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ocfs2/namei.c | 8 +++++---
+ 1 file changed, 5 insertions(+), 3 deletions(-)
+
+diff --git a/fs/ocfs2/namei.c b/fs/ocfs2/namei.c
+index 814733ba2f4b..9221a33f917b 100644
+--- a/fs/ocfs2/namei.c
++++ b/fs/ocfs2/namei.c
+@@ -1336,7 +1336,7 @@ static int ocfs2_rename(struct mnt_idmap *idmap,
+ goto bail;
+ }
+
+- if (S_ISDIR(old_inode->i_mode)) {
++ if (S_ISDIR(old_inode->i_mode) && new_dir != old_dir) {
+ u64 old_inode_parent;
+
+ update_dot_dot = 1;
+@@ -1353,8 +1353,7 @@ static int ocfs2_rename(struct mnt_idmap *idmap,
+ goto bail;
+ }
+
+- if (!new_inode && new_dir != old_dir &&
+- new_dir->i_nlink >= ocfs2_link_max(osb)) {
++ if (!new_inode && new_dir->i_nlink >= ocfs2_link_max(osb)) {
+ status = -EMLINK;
+ goto bail;
+ }
+@@ -1601,6 +1600,9 @@ static int ocfs2_rename(struct mnt_idmap *idmap,
+ mlog_errno(status);
+ goto bail;
+ }
++ }
++
++ if (S_ISDIR(old_inode->i_mode)) {
+ drop_nlink(old_dir);
+ if (new_inode) {
+ drop_nlink(new_inode);
+--
+2.43.0
+
--- /dev/null
+From a137db635e1d407c05c265dc46aaf98f99256edd Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 1 Jan 2024 20:20:42 +0530
+Subject: octeontx2-af: Fix max NPC MCAM entry check while validating ref_entry
+
+From: Suman Ghosh <sumang@marvell.com>
+
+[ Upstream commit 4ebb1f95e0c3c3e0eec5bb21aa43097580c4b6e4 ]
+
+As of today, the last MCAM entry was not getting allocated because of
+a <= check with the max_bmap count. This patch modifies that and if the
+requested entry is greater than the available entries then set it to the
+max value.
+
+Signed-off-by: Suman Ghosh <sumang@marvell.com>
+Link: https://lore.kernel.org/r/20240101145042.419697-1-sumang@marvell.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/marvell/octeontx2/af/rvu_npc.c | 13 ++++++-------
+ 1 file changed, 6 insertions(+), 7 deletions(-)
+
+diff --git a/drivers/net/ethernet/marvell/octeontx2/af/rvu_npc.c b/drivers/net/ethernet/marvell/octeontx2/af/rvu_npc.c
+index 0bcf3e559280..3784347b6fd8 100644
+--- a/drivers/net/ethernet/marvell/octeontx2/af/rvu_npc.c
++++ b/drivers/net/ethernet/marvell/octeontx2/af/rvu_npc.c
+@@ -2678,18 +2678,17 @@ int rvu_mbox_handler_npc_mcam_alloc_entry(struct rvu *rvu,
+ rsp->entry = NPC_MCAM_ENTRY_INVALID;
+ rsp->free_count = 0;
+
+- /* Check if ref_entry is within range */
+- if (req->priority && req->ref_entry >= mcam->bmap_entries) {
+- dev_err(rvu->dev, "%s: reference entry %d is out of range\n",
+- __func__, req->ref_entry);
+- return NPC_MCAM_INVALID_REQ;
+- }
++ /* Check if ref_entry is greater that the range
++ * then set it to max value.
++ */
++ if (req->ref_entry > mcam->bmap_entries)
++ req->ref_entry = mcam->bmap_entries;
+
+ /* ref_entry can't be '0' if requested priority is high.
+ * Can't be last entry if requested priority is low.
+ */
+ if ((!req->ref_entry && req->priority == NPC_MCAM_HIGHER_PRIO) ||
+- ((req->ref_entry == (mcam->bmap_entries - 1)) &&
++ ((req->ref_entry == mcam->bmap_entries) &&
+ req->priority == NPC_MCAM_LOWER_PRIO))
+ return NPC_MCAM_INVALID_REQ;
+
+--
+2.43.0
+
--- /dev/null
+From 30905b25847211ef30559939b72bc14af96adfbf Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 11:32:39 +0530
+Subject: OPP: The level field is always of unsigned int type
+
+From: Viresh Kumar <viresh.kumar@linaro.org>
+
+[ Upstream commit ba367479c7ad0b870461024cd5ae7a1ea6e1e3db ]
+
+By mistake, dev_pm_opp_find_level_floor() used the level parameter as
+unsigned long instead of unsigned int. Fix it.
+
+Signed-off-by: Viresh Kumar <viresh.kumar@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/opp/core.c | 9 +++++++--
+ include/linux/pm_opp.h | 4 ++--
+ 2 files changed, 9 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/opp/core.c b/drivers/opp/core.c
+index b2971dd95335..f1e54a3a15c7 100644
+--- a/drivers/opp/core.c
++++ b/drivers/opp/core.c
+@@ -832,9 +832,14 @@ EXPORT_SYMBOL_GPL(dev_pm_opp_find_level_ceil);
+ * use.
+ */
+ struct dev_pm_opp *dev_pm_opp_find_level_floor(struct device *dev,
+- unsigned long *level)
++ unsigned int *level)
+ {
+- return _find_key_floor(dev, level, 0, true, _read_level, NULL);
++ unsigned long temp = *level;
++ struct dev_pm_opp *opp;
++
++ opp = _find_key_floor(dev, &temp, 0, true, _read_level, NULL);
++ *level = temp;
++ return opp;
+ }
+ EXPORT_SYMBOL_GPL(dev_pm_opp_find_level_floor);
+
+diff --git a/include/linux/pm_opp.h b/include/linux/pm_opp.h
+index ccd97bcef269..18a102174c4f 100644
+--- a/include/linux/pm_opp.h
++++ b/include/linux/pm_opp.h
+@@ -157,7 +157,7 @@ struct dev_pm_opp *dev_pm_opp_find_level_ceil(struct device *dev,
+ unsigned int *level);
+
+ struct dev_pm_opp *dev_pm_opp_find_level_floor(struct device *dev,
+- unsigned long *level);
++ unsigned int *level);
+
+ struct dev_pm_opp *dev_pm_opp_find_bw_ceil(struct device *dev,
+ unsigned int *bw, int index);
+@@ -324,7 +324,7 @@ static inline struct dev_pm_opp *dev_pm_opp_find_level_ceil(struct device *dev,
+ }
+
+ static inline struct dev_pm_opp *dev_pm_opp_find_level_floor(struct device *dev,
+- unsigned long *level)
++ unsigned int *level)
+ {
+ return ERR_PTR(-EOPNOTSUPP);
+ }
+--
+2.43.0
+
--- /dev/null
+From 93b0232c1a118064ab20b0538bd8cde885427877 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 15:27:06 -0600
+Subject: PCI: add INTEL_HDA_ARL to pci_ids.h
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+
+[ Upstream commit 5ec42bf04d72fd6d0a6855810cc779e0ee31dfd7 ]
+
+The PCI ID insertion follows the increasing order in the table, but
+this hardware follows MTL (MeteorLake).
+
+Signed-off-by: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+Reviewed-by: Péter Ujfalusi <peter.ujfalusi@linux.intel.com>
+Reviewed-by: Kai Vehmanen <kai.vehmanen@linux.intel.com>
+Acked-by: Mark Brown <broonie@kernel.org>
+Link: https://lore.kernel.org/r/20231204212710.185976-2-pierre-louis.bossart@linux.intel.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/linux/pci_ids.h | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/include/linux/pci_ids.h b/include/linux/pci_ids.h
+index 275799b5f535..97cc0baad0f4 100644
+--- a/include/linux/pci_ids.h
++++ b/include/linux/pci_ids.h
+@@ -3065,6 +3065,7 @@
+ #define PCI_DEVICE_ID_INTEL_82443GX_0 0x71a0
+ #define PCI_DEVICE_ID_INTEL_82443GX_2 0x71a2
+ #define PCI_DEVICE_ID_INTEL_82372FB_1 0x7601
++#define PCI_DEVICE_ID_INTEL_HDA_ARL 0x7728
+ #define PCI_DEVICE_ID_INTEL_HDA_RPL_S 0x7a50
+ #define PCI_DEVICE_ID_INTEL_HDA_ADL_S 0x7ad0
+ #define PCI_DEVICE_ID_INTEL_HDA_MTL 0x7e28
+--
+2.43.0
+
--- /dev/null
+From a9937c8f54167f611728a084a8d8a812540e16e3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 15 Nov 2023 13:17:16 +0100
+Subject: PCI: Add no PM reset quirk for NVIDIA Spectrum devices
+
+From: Ido Schimmel <idosch@nvidia.com>
+
+[ Upstream commit 3ed48c80b28d8dcd584d6ddaf00c75b7673e1a05 ]
+
+Spectrum-{1,2,3,4} devices report that a D3hot->D0 transition causes a
+reset (i.e., they advertise NoSoftRst-). However, this transition does
+not have any effect on the device: It continues to be operational and
+network ports remain up. Advertising this support makes it seem as if a
+PM reset is viable for these devices. Mark it as unavailable to skip it
+when testing reset methods.
+
+Before:
+
+ # cat /sys/bus/pci/devices/0000\:03\:00.0/reset_method
+ pm bus
+
+After:
+
+ # cat /sys/bus/pci/devices/0000\:03\:00.0/reset_method
+ bus
+
+Signed-off-by: Ido Schimmel <idosch@nvidia.com>
+Acked-by: Bjorn Helgaas <bhelgaas@google.com>
+Signed-off-by: Petr Machata <petrm@nvidia.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/quirks.c | 13 +++++++++++++
+ 1 file changed, 13 insertions(+)
+
+diff --git a/drivers/pci/quirks.c b/drivers/pci/quirks.c
+index d55a3ffae4b8..a991710efa40 100644
+--- a/drivers/pci/quirks.c
++++ b/drivers/pci/quirks.c
+@@ -3786,6 +3786,19 @@ static void quirk_no_pm_reset(struct pci_dev *dev)
+ DECLARE_PCI_FIXUP_CLASS_HEADER(PCI_VENDOR_ID_ATI, PCI_ANY_ID,
+ PCI_CLASS_DISPLAY_VGA, 8, quirk_no_pm_reset);
+
++/*
++ * Spectrum-{1,2,3,4} devices report that a D3hot->D0 transition causes a reset
++ * (i.e., they advertise NoSoftRst-). However, this transition does not have
++ * any effect on the device: It continues to be operational and network ports
++ * remain up. Advertising this support makes it seem as if a PM reset is viable
++ * for these devices. Mark it as unavailable to skip it when testing reset
++ * methods.
++ */
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcb84, quirk_no_pm_reset);
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcf6c, quirk_no_pm_reset);
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcf70, quirk_no_pm_reset);
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcf80, quirk_no_pm_reset);
++
+ /*
+ * Thunderbolt controllers with broken MSI hotplug signaling:
+ * Entire 1st generation (Light Ridge, Eagle Ridge, Light Peak) and part
+--
+2.43.0
+
--- /dev/null
+From 5b7813420afbf8c785aaa92ce4ad3c2c9872c17a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 16:42:30 -0600
+Subject: PCI/AER: Decode Requester ID when no error info found
+
+From: Bjorn Helgaas <bhelgaas@google.com>
+
+[ Upstream commit 1291b716bbf969e101d517bfb8ba18d958f758b8 ]
+
+When a device with AER detects an error, it logs error information in its
+own AER Error Status registers. It may send an Error Message to the Root
+Port (RCEC in the case of an RCiEP), which logs the fact that an Error
+Message was received (Root Error Status) and the Requester ID of the
+message source (Error Source Identification).
+
+aer_print_port_info() prints the Requester ID from the Root Port Error
+Source in the usual Linux "bb:dd.f" format, but when find_source_device()
+finds no error details in the hierarchy below the Root Port, it printed the
+raw Requester ID without decoding it.
+
+Decode the Requester ID in the usual Linux format so it matches other
+messages.
+
+Sample message changes:
+
+ - pcieport 0000:00:1c.5: AER: Correctable error received: 0000:00:1c.5
+ - pcieport 0000:00:1c.5: AER: can't find device of ID00e5
+ + pcieport 0000:00:1c.5: AER: Correctable error message received from 0000:00:1c.5
+ + pcieport 0000:00:1c.5: AER: found no error details for 0000:00:1c.5
+
+Link: https://lore.kernel.org/r/20231206224231.732765-3-helgaas@kernel.org
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Reviewed-by: Jonathan Cameron <Jonathan.Cameron@huawei.com>
+Reviewed-by: Kuppuswamy Sathyanarayanan <sathyanarayanan.kuppuswamy@linux.intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/pcie/aer.c | 9 +++++++--
+ 1 file changed, 7 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/pci/pcie/aer.c b/drivers/pci/pcie/aer.c
+index 42a3bd35a3e1..38e3346772cc 100644
+--- a/drivers/pci/pcie/aer.c
++++ b/drivers/pci/pcie/aer.c
+@@ -740,7 +740,7 @@ static void aer_print_port_info(struct pci_dev *dev, struct aer_err_info *info)
+ u8 bus = info->id >> 8;
+ u8 devfn = info->id & 0xff;
+
+- pci_info(dev, "%s%s error received: %04x:%02x:%02x.%d\n",
++ pci_info(dev, "%s%s error message received from %04x:%02x:%02x.%d\n",
+ info->multi_error_valid ? "Multiple " : "",
+ aer_error_severity_string[info->severity],
+ pci_domain_nr(dev->bus), bus, PCI_SLOT(devfn),
+@@ -929,7 +929,12 @@ static bool find_source_device(struct pci_dev *parent,
+ pci_walk_bus(parent->subordinate, find_device_iter, e_info);
+
+ if (!e_info->error_dev_num) {
+- pci_info(parent, "can't find device of ID%04x\n", e_info->id);
++ u8 bus = e_info->id >> 8;
++ u8 devfn = e_info->id & 0xff;
++
++ pci_info(parent, "found no error details for %04x:%02x:%02x.%d\n",
++ pci_domain_nr(parent->bus), bus, PCI_SLOT(devfn),
++ PCI_FUNC(devfn));
+ return false;
+ }
+ return true;
+--
+2.43.0
+
--- /dev/null
+From 8459e1673968c5ffd310b3bd1274fd08da8821d9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 2 Jan 2024 19:27:00 +0200
+Subject: PCI: Fix 64GT/s effective data rate calculation
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Ilpo Järvinen <ilpo.jarvinen@linux.intel.com>
+
+[ Upstream commit ac4f1897fa5433a1b07a625503a91b6aa9d7e643 ]
+
+Unlike the lower rates, the PCIe 64GT/s Data Rate uses 1b/1b encoding, not
+128b/130b (PCIe r6.1 sec 1.2, Table 1-1). Correct the PCIE_SPEED2MBS_ENC()
+calculation to reflect that.
+
+Link: https://lore.kernel.org/r/20240102172701.65501-1-ilpo.jarvinen@linux.intel.com
+Signed-off-by: Ilpo Järvinen <ilpo.jarvinen@linux.intel.com>
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/pci.h | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/pci/pci.h b/drivers/pci/pci.h
+index f43873049d52..c6283ba78197 100644
+--- a/drivers/pci/pci.h
++++ b/drivers/pci/pci.h
+@@ -272,7 +272,7 @@ void pci_bus_put(struct pci_bus *bus);
+
+ /* PCIe speed to Mb/s reduced by encoding overhead */
+ #define PCIE_SPEED2MBS_ENC(speed) \
+- ((speed) == PCIE_SPEED_64_0GT ? 64000*128/130 : \
++ ((speed) == PCIE_SPEED_64_0GT ? 64000*1/1 : \
+ (speed) == PCIE_SPEED_32_0GT ? 32000*128/130 : \
+ (speed) == PCIE_SPEED_16_0GT ? 16000*128/130 : \
+ (speed) == PCIE_SPEED_8_0GT ? 8000*128/130 : \
+--
+2.43.0
+
--- /dev/null
+From 602d69607d9cb032c6c72583480ee5641a9afd11 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 20 Nov 2023 13:04:36 -0300
+Subject: PCI: Only override AMD USB controller if required
+
+From: Guilherme G. Piccoli <gpiccoli@igalia.com>
+
+[ Upstream commit e585a37e5061f6d5060517aed1ca4ccb2e56a34c ]
+
+By running a Van Gogh device (Steam Deck), the following message
+was noticed in the kernel log:
+
+ pci 0000:04:00.3: PCI class overridden (0x0c03fe -> 0x0c03fe) so dwc3 driver can claim this instead of xhci
+
+Effectively this means the quirk executed but changed nothing, since the
+class of this device was already the proper one (likely adjusted by newer
+firmware versions).
+
+Check and perform the override only if necessary.
+
+Link: https://lore.kernel.org/r/20231120160531.361552-1-gpiccoli@igalia.com
+Signed-off-by: Guilherme G. Piccoli <gpiccoli@igalia.com>
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Cc: Huang Rui <ray.huang@amd.com>
+Cc: Vicki Pfau <vi@endrift.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/quirks.c | 11 +++++++----
+ 1 file changed, 7 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/pci/quirks.c b/drivers/pci/quirks.c
+index a991710efa40..a2bf6de11462 100644
+--- a/drivers/pci/quirks.c
++++ b/drivers/pci/quirks.c
+@@ -702,10 +702,13 @@ static void quirk_amd_dwc_class(struct pci_dev *pdev)
+ {
+ u32 class = pdev->class;
+
+- /* Use "USB Device (not host controller)" class */
+- pdev->class = PCI_CLASS_SERIAL_USB_DEVICE;
+- pci_info(pdev, "PCI class overridden (%#08x -> %#08x) so dwc3 driver can claim this instead of xhci\n",
+- class, pdev->class);
++ if (class != PCI_CLASS_SERIAL_USB_DEVICE) {
++ /* Use "USB Device (not host controller)" class */
++ pdev->class = PCI_CLASS_SERIAL_USB_DEVICE;
++ pci_info(pdev,
++ "PCI class overridden (%#08x -> %#08x) so dwc3 driver can claim this instead of xhci\n",
++ class, pdev->class);
++ }
+ }
+ DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_AMD, PCI_DEVICE_ID_AMD_NL_USB,
+ quirk_amd_dwc_class);
+--
+2.43.0
+
--- /dev/null
+From 2f28914f4babfaea5de1301b74c0f24d5cc937a2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 20:23:16 -0800
+Subject: PCI: switchtec: Fix stdev_release() crash after surprise hot remove
+
+From: Daniel Stodden <dns@arista.com>
+
+[ Upstream commit df25461119d987b8c81d232cfe4411e91dcabe66 ]
+
+A PCI device hot removal may occur while stdev->cdev is held open. The call
+to stdev_release() then happens during close or exit, at a point way past
+switchtec_pci_remove(). Otherwise the last ref would vanish with the
+trailing put_device(), just before return.
+
+At that later point in time, the devm cleanup has already removed the
+stdev->mmio_mrpc mapping. Also, the stdev->pdev reference was not a counted
+one. Therefore, in DMA mode, the iowrite32() in stdev_release() will cause
+a fatal page fault, and the subsequent dma_free_coherent(), if reached,
+would pass a stale &stdev->pdev->dev pointer.
+
+Fix by moving MRPC DMA shutdown into switchtec_pci_remove(), after
+stdev_kill(). Counting the stdev->pdev ref is now optional, but may prevent
+future accidents.
+
+Reproducible via the script at
+https://lore.kernel.org/r/20231113212150.96410-1-dns@arista.com
+
+Link: https://lore.kernel.org/r/20231122042316.91208-2-dns@arista.com
+Signed-off-by: Daniel Stodden <dns@arista.com>
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Reviewed-by: Logan Gunthorpe <logang@deltatee.com>
+Reviewed-by: Dmitry Safonov <dima@arista.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/switch/switchtec.c | 25 +++++++++++++++++--------
+ 1 file changed, 17 insertions(+), 8 deletions(-)
+
+diff --git a/drivers/pci/switch/switchtec.c b/drivers/pci/switch/switchtec.c
+index 5b921387eca6..1804794d0e68 100644
+--- a/drivers/pci/switch/switchtec.c
++++ b/drivers/pci/switch/switchtec.c
+@@ -1308,13 +1308,6 @@ static void stdev_release(struct device *dev)
+ {
+ struct switchtec_dev *stdev = to_stdev(dev);
+
+- if (stdev->dma_mrpc) {
+- iowrite32(0, &stdev->mmio_mrpc->dma_en);
+- flush_wc_buf(stdev);
+- writeq(0, &stdev->mmio_mrpc->dma_addr);
+- dma_free_coherent(&stdev->pdev->dev, sizeof(*stdev->dma_mrpc),
+- stdev->dma_mrpc, stdev->dma_mrpc_dma_addr);
+- }
+ kfree(stdev);
+ }
+
+@@ -1358,7 +1351,7 @@ static struct switchtec_dev *stdev_create(struct pci_dev *pdev)
+ return ERR_PTR(-ENOMEM);
+
+ stdev->alive = true;
+- stdev->pdev = pdev;
++ stdev->pdev = pci_dev_get(pdev);
+ INIT_LIST_HEAD(&stdev->mrpc_queue);
+ mutex_init(&stdev->mrpc_mutex);
+ stdev->mrpc_busy = 0;
+@@ -1391,6 +1384,7 @@ static struct switchtec_dev *stdev_create(struct pci_dev *pdev)
+ return stdev;
+
+ err_put:
++ pci_dev_put(stdev->pdev);
+ put_device(&stdev->dev);
+ return ERR_PTR(rc);
+ }
+@@ -1644,6 +1638,18 @@ static int switchtec_init_pci(struct switchtec_dev *stdev,
+ return 0;
+ }
+
++static void switchtec_exit_pci(struct switchtec_dev *stdev)
++{
++ if (stdev->dma_mrpc) {
++ iowrite32(0, &stdev->mmio_mrpc->dma_en);
++ flush_wc_buf(stdev);
++ writeq(0, &stdev->mmio_mrpc->dma_addr);
++ dma_free_coherent(&stdev->pdev->dev, sizeof(*stdev->dma_mrpc),
++ stdev->dma_mrpc, stdev->dma_mrpc_dma_addr);
++ stdev->dma_mrpc = NULL;
++ }
++}
++
+ static int switchtec_pci_probe(struct pci_dev *pdev,
+ const struct pci_device_id *id)
+ {
+@@ -1703,6 +1709,9 @@ static void switchtec_pci_remove(struct pci_dev *pdev)
+ ida_free(&switchtec_minor_ida, MINOR(stdev->dev.devt));
+ dev_info(&stdev->dev, "unregistered.\n");
+ stdev_kill(stdev);
++ switchtec_exit_pci(stdev);
++ pci_dev_put(stdev->pdev);
++ stdev->pdev = NULL;
+ put_device(&stdev->dev);
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 22e6fd00db9115ded801c3e6fe54a943040b54c2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 12 Jun 2023 15:09:09 +0200
+Subject: perf/core: Fix narrow startup race when creating the perf
+ nr_addr_filters sysfs file
+
+From: Greg KH <gregkh@linuxfoundation.org>
+
+[ Upstream commit 652ffc2104ec1f69dd4a46313888c33527145ccf ]
+
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Link: https://lkml.kernel.org/r/2023061204-decal-flyable-6090@gregkh
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/events/core.c | 40 ++++++++++++++++++++++++++++------------
+ 1 file changed, 28 insertions(+), 12 deletions(-)
+
+diff --git a/kernel/events/core.c b/kernel/events/core.c
+index 9efd0d7775e7..fbecba5b00b1 100644
+--- a/kernel/events/core.c
++++ b/kernel/events/core.c
+@@ -11425,9 +11425,32 @@ static DEVICE_ATTR_RW(perf_event_mux_interval_ms);
+ static struct attribute *pmu_dev_attrs[] = {
+ &dev_attr_type.attr,
+ &dev_attr_perf_event_mux_interval_ms.attr,
++ &dev_attr_nr_addr_filters.attr,
++ NULL,
++};
++
++static umode_t pmu_dev_is_visible(struct kobject *kobj, struct attribute *a, int n)
++{
++ struct device *dev = kobj_to_dev(kobj);
++ struct pmu *pmu = dev_get_drvdata(dev);
++
++ if (!pmu->nr_addr_filters)
++ return 0;
++
++ return a->mode;
++
++ return 0;
++}
++
++static struct attribute_group pmu_dev_attr_group = {
++ .is_visible = pmu_dev_is_visible,
++ .attrs = pmu_dev_attrs,
++};
++
++static const struct attribute_group *pmu_dev_groups[] = {
++ &pmu_dev_attr_group,
+ NULL,
+ };
+-ATTRIBUTE_GROUPS(pmu_dev);
+
+ static int pmu_bus_running;
+ static struct bus_type pmu_bus = {
+@@ -11464,18 +11487,11 @@ static int pmu_dev_alloc(struct pmu *pmu)
+ if (ret)
+ goto free_dev;
+
+- /* For PMUs with address filters, throw in an extra attribute: */
+- if (pmu->nr_addr_filters)
+- ret = device_create_file(pmu->dev, &dev_attr_nr_addr_filters);
+-
+- if (ret)
+- goto del_dev;
+-
+- if (pmu->attr_update)
++ if (pmu->attr_update) {
+ ret = sysfs_update_groups(&pmu->dev->kobj, pmu->attr_update);
+-
+- if (ret)
+- goto del_dev;
++ if (ret)
++ goto del_dev;
++ }
+
+ out:
+ return ret;
+--
+2.43.0
+
--- /dev/null
+From 6205760dcb7c134606d2bc1b5c7a53e4c46b4db6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Sep 2023 14:37:15 +0100
+Subject: perf cs-etm: Bump minimum OpenCSD version to ensure a bugfix is
+ present
+
+From: James Clark <james.clark@arm.com>
+
+[ Upstream commit 2dbba30fd69b604802a9535b74bddb5bcca23793 ]
+
+Since commit d927ef5004ef ("perf cs-etm: Add exception level consistency
+check"), the exception that was added to Perf will be triggered unless
+the following bugfix from OpenCSD is present:
+
+ - _Version 1.2.1_:
+ - __Bugfix__:
+ ETM4x / ETE - output of context elements to client can in some
+ circumstances be delayed until after subsequent atoms have been
+ processed leading to incorrect memory decode access via the client
+ callbacks. Fixed to flush context elements immediately they are
+ committed.
+
+Rather than remove the assert and silently fail, just increase the
+minimum version requirement to avoid hard to debug issues and
+regressions.
+
+Reviewed-by: Ian Rogers <irogers@google.com>
+Signed-off-by: James Clark <james.clark@arm.com>
+Tested-by: Leo Yan <leo.yan@linaro.org>
+Cc: John Garry <john.g.garry@oracle.com>
+Cc: Mike Leach <mike.leach@linaro.org>
+Cc: Will Deacon <will@kernel.org>
+Cc: linux-arm-kernel@lists.infradead.org
+Link: https://lore.kernel.org/r/20230901133716.677499-1-james.clark@arm.com
+Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/build/feature/test-libopencsd.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/tools/build/feature/test-libopencsd.c b/tools/build/feature/test-libopencsd.c
+index eb6303ff446e..4cfcef9da3e4 100644
+--- a/tools/build/feature/test-libopencsd.c
++++ b/tools/build/feature/test-libopencsd.c
+@@ -4,9 +4,9 @@
+ /*
+ * Check OpenCSD library version is sufficient to provide required features
+ */
+-#define OCSD_MIN_VER ((1 << 16) | (1 << 8) | (1))
++#define OCSD_MIN_VER ((1 << 16) | (2 << 8) | (1))
+ #if !defined(OCSD_VER_NUM) || (OCSD_VER_NUM < OCSD_MIN_VER)
+-#error "OpenCSD >= 1.1.1 is required"
++#error "OpenCSD >= 1.2.1 is required"
+ #endif
+
+ int main(void)
+--
+2.43.0
+
--- /dev/null
+From f63748b46bf85c520a8570b68c9497a08a7c373e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 11:07:56 +0100
+Subject: perf: Fix the nr_addr_filters fix
+
+From: Peter Zijlstra <peterz@infradead.org>
+
+[ Upstream commit 388a1fb7da6aaa1970c7e2a7d7fcd983a87a8484 ]
+
+Thomas reported that commit 652ffc2104ec ("perf/core: Fix narrow
+startup race when creating the perf nr_addr_filters sysfs file") made
+the entire attribute group vanish, instead of only the nr_addr_filters
+attribute.
+
+Additionally a stray return.
+
+Insufficient coffee was involved with both writing and merging the
+patch.
+
+Fixes: 652ffc2104ec ("perf/core: Fix narrow startup race when creating the perf nr_addr_filters sysfs file")
+Reported-by: Thomas Richter <tmricht@linux.ibm.com>
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Tested-by: Thomas Richter <tmricht@linux.ibm.com>
+Link: https://lkml.kernel.org/r/20231122100756.GP8262@noisy.programming.kicks-ass.net
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/events/core.c | 4 +---
+ 1 file changed, 1 insertion(+), 3 deletions(-)
+
+diff --git a/kernel/events/core.c b/kernel/events/core.c
+index fbecba5b00b1..7c0330579718 100644
+--- a/kernel/events/core.c
++++ b/kernel/events/core.c
+@@ -11434,12 +11434,10 @@ static umode_t pmu_dev_is_visible(struct kobject *kobj, struct attribute *a, int
+ struct device *dev = kobj_to_dev(kobj);
+ struct pmu *pmu = dev_get_drvdata(dev);
+
+- if (!pmu->nr_addr_filters)
++ if (n == 2 && !pmu->nr_addr_filters)
+ return 0;
+
+ return a->mode;
+-
+- return 0;
+ }
+
+ static struct attribute_group pmu_dev_attr_group = {
+--
+2.43.0
+
--- /dev/null
+From 20c95a854a519c3e90d1ec6dfd758e792e72fa1e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 19:50:36 +0200
+Subject: pinctrl: baytrail: Fix types of config value in byt_pin_config_set()
+
+From: Andy Shevchenko <andriy.shevchenko@linux.intel.com>
+
+[ Upstream commit 1a856a22e6036c5f0d6da7568b4550270f989038 ]
+
+When unpacked, the config value is split to two of different types.
+Fix the types accordingly.
+
+Acked-by: Mika Westerberg <mika.westerberg@linux.intel.com>
+Signed-off-by: Andy Shevchenko <andriy.shevchenko@linux.intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pinctrl/intel/pinctrl-baytrail.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/pinctrl/intel/pinctrl-baytrail.c b/drivers/pinctrl/intel/pinctrl-baytrail.c
+index 3cd0798ee631..f1af21dbd5fb 100644
+--- a/drivers/pinctrl/intel/pinctrl-baytrail.c
++++ b/drivers/pinctrl/intel/pinctrl-baytrail.c
+@@ -918,13 +918,14 @@ static int byt_pin_config_set(struct pinctrl_dev *pctl_dev,
+ unsigned int num_configs)
+ {
+ struct intel_pinctrl *vg = pinctrl_dev_get_drvdata(pctl_dev);
+- unsigned int param, arg;
+ void __iomem *conf_reg = byt_gpio_reg(vg, offset, BYT_CONF0_REG);
+ void __iomem *val_reg = byt_gpio_reg(vg, offset, BYT_VAL_REG);
+ void __iomem *db_reg = byt_gpio_reg(vg, offset, BYT_DEBOUNCE_REG);
+ u32 conf, val, db_pulse, debounce;
++ enum pin_config_param param;
+ unsigned long flags;
+ int i, ret = 0;
++ u32 arg;
+
+ raw_spin_lock_irqsave(&byt_lock, flags);
+
+--
+2.43.0
+
--- /dev/null
+From 9b687444c8e73f8dad1ecffeda81b37418f2fc11 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 02:41:58 +0530
+Subject: PM / devfreq: Synchronize devfreq_monitor_[start/stop]
+
+From: Mukesh Ojha <quic_mojha@quicinc.com>
+
+[ Upstream commit aed5ed595960c6d301dcd4ed31aeaa7a8054c0c6 ]
+
+There is a chance if a frequent switch of the governor
+done in a loop result in timer list corruption where
+timer cancel being done from two place one from
+cancel_delayed_work_sync() and followed by expire_timers()
+can be seen from the traces[1].
+
+while true
+do
+ echo "simple_ondemand" > /sys/class/devfreq/1d84000.ufshc/governor
+ echo "performance" > /sys/class/devfreq/1d84000.ufshc/governor
+done
+
+It looks to be issue with devfreq driver where
+device_monitor_[start/stop] need to synchronized so that
+delayed work should get corrupted while it is either
+being queued or running or being cancelled.
+
+Let's use polling flag and devfreq lock to synchronize the
+queueing the timer instance twice and work data being
+corrupted.
+
+[1]
+...
+..
+<idle>-0 [003] 9436.209662: timer_cancel timer=0xffffff80444f0428
+<idle>-0 [003] 9436.209664: timer_expire_entry timer=0xffffff80444f0428 now=0x10022da1c function=__typeid__ZTSFvP10timer_listE_global_addr baseclk=0x10022da1c
+<idle>-0 [003] 9436.209718: timer_expire_exit timer=0xffffff80444f0428
+kworker/u16:6-14217 [003] 9436.209863: timer_start timer=0xffffff80444f0428 function=__typeid__ZTSFvP10timer_listE_global_addr expires=0x10022da2b now=0x10022da1c flags=182452227
+vendor.xxxyyy.ha-1593 [004] 9436.209888: timer_cancel timer=0xffffff80444f0428
+vendor.xxxyyy.ha-1593 [004] 9436.216390: timer_init timer=0xffffff80444f0428
+vendor.xxxyyy.ha-1593 [004] 9436.216392: timer_start timer=0xffffff80444f0428 function=__typeid__ZTSFvP10timer_listE_global_addr expires=0x10022da2c now=0x10022da1d flags=186646532
+vendor.xxxyyy.ha-1593 [005] 9436.220992: timer_cancel timer=0xffffff80444f0428
+xxxyyyTraceManag-7795 [004] 9436.261641: timer_cancel timer=0xffffff80444f0428
+
+[2]
+
+ 9436.261653][ C4] Unable to handle kernel paging request at virtual address dead00000000012a
+[ 9436.261664][ C4] Mem abort info:
+[ 9436.261666][ C4] ESR = 0x96000044
+[ 9436.261669][ C4] EC = 0x25: DABT (current EL), IL = 32 bits
+[ 9436.261671][ C4] SET = 0, FnV = 0
+[ 9436.261673][ C4] EA = 0, S1PTW = 0
+[ 9436.261675][ C4] Data abort info:
+[ 9436.261677][ C4] ISV = 0, ISS = 0x00000044
+[ 9436.261680][ C4] CM = 0, WnR = 1
+[ 9436.261682][ C4] [dead00000000012a] address between user and kernel address ranges
+[ 9436.261685][ C4] Internal error: Oops: 96000044 [#1] PREEMPT SMP
+[ 9436.261701][ C4] Skip md ftrace buffer dump for: 0x3a982d0
+...
+
+[ 9436.262138][ C4] CPU: 4 PID: 7795 Comm: TraceManag Tainted: G S W O 5.10.149-android12-9-o-g17f915d29d0c #1
+[ 9436.262141][ C4] Hardware name: Qualcomm Technologies, Inc. (DT)
+[ 9436.262144][ C4] pstate: 22400085 (nzCv daIf +PAN -UAO +TCO BTYPE=--)
+[ 9436.262161][ C4] pc : expire_timers+0x9c/0x438
+[ 9436.262164][ C4] lr : expire_timers+0x2a4/0x438
+[ 9436.262168][ C4] sp : ffffffc010023dd0
+[ 9436.262171][ C4] x29: ffffffc010023df0 x28: ffffffd0636fdc18
+[ 9436.262178][ C4] x27: ffffffd063569dd0 x26: ffffffd063536008
+[ 9436.262182][ C4] x25: 0000000000000001 x24: ffffff88f7c69280
+[ 9436.262185][ C4] x23: 00000000000000e0 x22: dead000000000122
+[ 9436.262188][ C4] x21: 000000010022da29 x20: ffffff8af72b4e80
+[ 9436.262191][ C4] x19: ffffffc010023e50 x18: ffffffc010025038
+[ 9436.262195][ C4] x17: 0000000000000240 x16: 0000000000000201
+[ 9436.262199][ C4] x15: ffffffffffffffff x14: ffffff889f3c3100
+[ 9436.262203][ C4] x13: ffffff889f3c3100 x12: 00000000049f56b8
+[ 9436.262207][ C4] x11: 00000000049f56b8 x10: 00000000ffffffff
+[ 9436.262212][ C4] x9 : ffffffc010023e50 x8 : dead000000000122
+[ 9436.262216][ C4] x7 : ffffffffffffffff x6 : ffffffc0100239d8
+[ 9436.262220][ C4] x5 : 0000000000000000 x4 : 0000000000000101
+[ 9436.262223][ C4] x3 : 0000000000000080 x2 : ffffff889edc155c
+[ 9436.262227][ C4] x1 : ffffff8001005200 x0 : ffffff80444f0428
+[ 9436.262232][ C4] Call trace:
+[ 9436.262236][ C4] expire_timers+0x9c/0x438
+[ 9436.262240][ C4] __run_timers+0x1f0/0x330
+[ 9436.262245][ C4] run_timer_softirq+0x28/0x58
+[ 9436.262255][ C4] efi_header_end+0x168/0x5ec
+[ 9436.262265][ C4] __irq_exit_rcu+0x108/0x124
+[ 9436.262274][ C4] __handle_domain_irq+0x118/0x1e4
+[ 9436.262282][ C4] gic_handle_irq.30369+0x6c/0x2bc
+[ 9436.262286][ C4] el0_irq_naked+0x60/0x6c
+
+Link: https://lore.kernel.org/all/1700860318-4025-1-git-send-email-quic_mojha@quicinc.com/
+Reported-by: Joyyoung Huang <huangzaiyang@oppo.com>
+Acked-by: MyungJoo Ham <myungjoo.ham@samsung.com>
+Signed-off-by: Mukesh Ojha <quic_mojha@quicinc.com>
+Signed-off-by: Chanwoo Choi <cw00.choi@samsung.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/devfreq/devfreq.c | 24 ++++++++++++++++++++++--
+ 1 file changed, 22 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/devfreq/devfreq.c b/drivers/devfreq/devfreq.c
+index 907f50ab70ed..7162d2bad446 100644
+--- a/drivers/devfreq/devfreq.c
++++ b/drivers/devfreq/devfreq.c
+@@ -461,10 +461,14 @@ static void devfreq_monitor(struct work_struct *work)
+ if (err)
+ dev_err(&devfreq->dev, "dvfs failed with (%d) error\n", err);
+
++ if (devfreq->stop_polling)
++ goto out;
++
+ queue_delayed_work(devfreq_wq, &devfreq->work,
+ msecs_to_jiffies(devfreq->profile->polling_ms));
+- mutex_unlock(&devfreq->lock);
+
++out:
++ mutex_unlock(&devfreq->lock);
+ trace_devfreq_monitor(devfreq);
+ }
+
+@@ -483,6 +487,10 @@ void devfreq_monitor_start(struct devfreq *devfreq)
+ if (IS_SUPPORTED_FLAG(devfreq->governor->flags, IRQ_DRIVEN))
+ return;
+
++ mutex_lock(&devfreq->lock);
++ if (delayed_work_pending(&devfreq->work))
++ goto out;
++
+ switch (devfreq->profile->timer) {
+ case DEVFREQ_TIMER_DEFERRABLE:
+ INIT_DEFERRABLE_WORK(&devfreq->work, devfreq_monitor);
+@@ -491,12 +499,16 @@ void devfreq_monitor_start(struct devfreq *devfreq)
+ INIT_DELAYED_WORK(&devfreq->work, devfreq_monitor);
+ break;
+ default:
+- return;
++ goto out;
+ }
+
+ if (devfreq->profile->polling_ms)
+ queue_delayed_work(devfreq_wq, &devfreq->work,
+ msecs_to_jiffies(devfreq->profile->polling_ms));
++
++out:
++ devfreq->stop_polling = false;
++ mutex_unlock(&devfreq->lock);
+ }
+ EXPORT_SYMBOL(devfreq_monitor_start);
+
+@@ -513,6 +525,14 @@ void devfreq_monitor_stop(struct devfreq *devfreq)
+ if (IS_SUPPORTED_FLAG(devfreq->governor->flags, IRQ_DRIVEN))
+ return;
+
++ mutex_lock(&devfreq->lock);
++ if (devfreq->stop_polling) {
++ mutex_unlock(&devfreq->lock);
++ return;
++ }
++
++ devfreq->stop_polling = true;
++ mutex_unlock(&devfreq->lock);
+ cancel_delayed_work_sync(&devfreq->work);
+ }
+ EXPORT_SYMBOL(devfreq_monitor_stop);
+--
+2.43.0
+
--- /dev/null
+From 101df7d9a95ee81b652b8670f737cc30f9fa54d7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 28 Nov 2023 05:52:10 +0300
+Subject: PNP: ACPI: fix fortify warning
+
+From: Dmitry Antipov <dmantipov@yandex.ru>
+
+[ Upstream commit ba3f5058db437d919f8468db50483dd9028ff688 ]
+
+When compiling with gcc version 14.0.0 20231126 (experimental)
+and CONFIG_FORTIFY_SOURCE=y, I've noticed the following:
+
+In file included from ./include/linux/string.h:295,
+ from ./include/linux/bitmap.h:12,
+ from ./include/linux/cpumask.h:12,
+ from ./arch/x86/include/asm/paravirt.h:17,
+ from ./arch/x86/include/asm/cpuid.h:62,
+ from ./arch/x86/include/asm/processor.h:19,
+ from ./arch/x86/include/asm/cpufeature.h:5,
+ from ./arch/x86/include/asm/thread_info.h:53,
+ from ./include/linux/thread_info.h:60,
+ from ./arch/x86/include/asm/preempt.h:9,
+ from ./include/linux/preempt.h:79,
+ from ./include/linux/spinlock.h:56,
+ from ./include/linux/mmzone.h:8,
+ from ./include/linux/gfp.h:7,
+ from ./include/linux/slab.h:16,
+ from ./include/linux/resource_ext.h:11,
+ from ./include/linux/acpi.h:13,
+ from drivers/pnp/pnpacpi/rsparser.c:11:
+In function 'fortify_memcpy_chk',
+ inlined from 'pnpacpi_parse_allocated_vendor' at drivers/pnp/pnpacpi/rsparser.c:158:3,
+ inlined from 'pnpacpi_allocated_resource' at drivers/pnp/pnpacpi/rsparser.c:249:3:
+./include/linux/fortify-string.h:588:25: warning: call to '__read_overflow2_field'
+declared with attribute warning: detected read beyond size of field (2nd parameter);
+maybe use struct_group()? [-Wattribute-warning]
+ 588 | __read_overflow2_field(q_size_field, size);
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+According to the comments in include/linux/fortify-string.h, 'memcpy()',
+'memmove()' and 'memset()' must not be used beyond individual struct
+members to ensure that the compiler can enforce protection against
+buffer overflows, and, IIUC, this also applies to partial copies from
+the particular member ('vendor->byte_data' in this case). So it should
+be better (and safer) to do both copies at once (and 'byte_data' of
+'struct acpi_resource_vendor_typed' seems to be a good candidate for
+'__counted_by(byte_length)' as well).
+
+Signed-off-by: Dmitry Antipov <dmantipov@yandex.ru>
+Reviewed-by: Kees Cook <keescook@chromium.org>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pnp/pnpacpi/rsparser.c | 12 ++++++------
+ 1 file changed, 6 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/pnp/pnpacpi/rsparser.c b/drivers/pnp/pnpacpi/rsparser.c
+index 4f05f610391b..c02ce0834c2c 100644
+--- a/drivers/pnp/pnpacpi/rsparser.c
++++ b/drivers/pnp/pnpacpi/rsparser.c
+@@ -151,13 +151,13 @@ static int vendor_resource_matches(struct pnp_dev *dev,
+ static void pnpacpi_parse_allocated_vendor(struct pnp_dev *dev,
+ struct acpi_resource_vendor_typed *vendor)
+ {
+- if (vendor_resource_matches(dev, vendor, &hp_ccsr_uuid, 16)) {
+- u64 start, length;
++ struct { u64 start, length; } range;
+
+- memcpy(&start, vendor->byte_data, sizeof(start));
+- memcpy(&length, vendor->byte_data + 8, sizeof(length));
+-
+- pnp_add_mem_resource(dev, start, start + length - 1, 0);
++ if (vendor_resource_matches(dev, vendor, &hp_ccsr_uuid,
++ sizeof(range))) {
++ memcpy(&range, vendor->byte_data, sizeof(range));
++ pnp_add_mem_resource(dev, range.start, range.start +
++ range.length - 1, 0);
+ }
+ }
+
+--
+2.43.0
+
--- /dev/null
+From ef2af6e008dec0a93912f4cefa04b3d5e6be3112 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 00:19:19 +1100
+Subject: powerpc/64s: Fix CONFIG_NUMA=n build due to create_section_mapping()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Michael Ellerman <mpe@ellerman.id.au>
+
+[ Upstream commit ede66cd22441820cbd399936bf84fdc4294bc7fa ]
+
+With CONFIG_NUMA=n the build fails with:
+
+ arch/powerpc/mm/book3s64/pgtable.c:275:15: error: no previous prototype for ‘create_section_mapping’ [-Werror=missing-prototypes]
+ 275 | int __meminit create_section_mapping(unsigned long start, unsigned long end,
+ | ^~~~~~~~~~~~~~~~~~~~~~
+
+That happens because the prototype for create_section_mapping() is in
+asm/mmzone.h, but asm/mmzone.h is only included by linux/mmzone.h
+when CONFIG_NUMA=y.
+
+In fact the prototype is only needed by arch/powerpc/mm code, so move
+the prototype into arch/powerpc/mm/mmu_decl.h, which also fixes the
+build error.
+
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231129131919.2528517-5-mpe@ellerman.id.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/include/asm/mmzone.h | 5 -----
+ arch/powerpc/mm/mmu_decl.h | 5 +++++
+ 2 files changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/arch/powerpc/include/asm/mmzone.h b/arch/powerpc/include/asm/mmzone.h
+index 3764d3585d30..da827d2d0866 100644
+--- a/arch/powerpc/include/asm/mmzone.h
++++ b/arch/powerpc/include/asm/mmzone.h
+@@ -43,10 +43,5 @@ u64 memory_hotplug_max(void);
+ #define memory_hotplug_max() memblock_end_of_DRAM()
+ #endif /* CONFIG_NUMA */
+
+-#ifdef CONFIG_MEMORY_HOTPLUG
+-extern int create_section_mapping(unsigned long start, unsigned long end,
+- int nid, pgprot_t prot);
+-#endif
+-
+ #endif /* __KERNEL__ */
+ #endif /* _ASM_MMZONE_H_ */
+diff --git a/arch/powerpc/mm/mmu_decl.h b/arch/powerpc/mm/mmu_decl.h
+index 7f9ff0640124..72341b9fb552 100644
+--- a/arch/powerpc/mm/mmu_decl.h
++++ b/arch/powerpc/mm/mmu_decl.h
+@@ -181,3 +181,8 @@ static inline bool debug_pagealloc_enabled_or_kfence(void)
+ {
+ return IS_ENABLED(CONFIG_KFENCE) || debug_pagealloc_enabled();
+ }
++
++#ifdef CONFIG_MEMORY_HOTPLUG
++int create_section_mapping(unsigned long start, unsigned long end,
++ int nid, pgprot_t prot);
++#endif
+--
+2.43.0
+
--- /dev/null
+From d74b2d840615e67363b490c412bb911ef4c383f1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 22:44:33 +1100
+Subject: powerpc: Fix build error due to is_valid_bugaddr()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Michael Ellerman <mpe@ellerman.id.au>
+
+[ Upstream commit f8d3555355653848082c351fa90775214fb8a4fa ]
+
+With CONFIG_GENERIC_BUG=n the build fails with:
+
+ arch/powerpc/kernel/traps.c:1442:5: error: no previous prototype for ‘is_valid_bugaddr’ [-Werror=missing-prototypes]
+ 1442 | int is_valid_bugaddr(unsigned long addr)
+ | ^~~~~~~~~~~~~~~~
+
+The prototype is only defined, and the function is only needed, when
+CONFIG_GENERIC_BUG=y, so move the implementation under that.
+
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231130114433.3053544-2-mpe@ellerman.id.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/kernel/traps.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/arch/powerpc/kernel/traps.c b/arch/powerpc/kernel/traps.c
+index 5ea2014aff90..11e062b47d3f 100644
+--- a/arch/powerpc/kernel/traps.c
++++ b/arch/powerpc/kernel/traps.c
+@@ -1439,10 +1439,12 @@ static int emulate_instruction(struct pt_regs *regs)
+ return -EINVAL;
+ }
+
++#ifdef CONFIG_GENERIC_BUG
+ int is_valid_bugaddr(unsigned long addr)
+ {
+ return is_kernel_addr(addr);
+ }
++#endif
+
+ #ifdef CONFIG_MATH_EMULATION
+ static int emulate_math(struct pt_regs *regs)
+--
+2.43.0
+
--- /dev/null
+From f026cd5f34468fdb9845e560f572232e0fdf8717 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 23 Nov 2023 12:47:05 +0530
+Subject: powerpc/lib: Validate size for vector operations
+
+From: Naveen N Rao <naveen@kernel.org>
+
+[ Upstream commit 8f9abaa6d7de0a70fc68acaedce290c1f96e2e59 ]
+
+Some of the fp/vmx code in sstep.c assume a certain maximum size for the
+instructions being emulated. The size of those operations however is
+determined separately in analyse_instr().
+
+Add a check to validate the assumption on the maximum size of the
+operations, so as to prevent any unintended kernel stack corruption.
+
+Signed-off-by: Naveen N Rao <naveen@kernel.org>
+Reviewed-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Build-tested-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231123071705.397625-1-naveen@kernel.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/lib/sstep.c | 10 ++++++++++
+ 1 file changed, 10 insertions(+)
+
+diff --git a/arch/powerpc/lib/sstep.c b/arch/powerpc/lib/sstep.c
+index a4ab8625061a..6af97dc0f6d5 100644
+--- a/arch/powerpc/lib/sstep.c
++++ b/arch/powerpc/lib/sstep.c
+@@ -586,6 +586,8 @@ static int do_fp_load(struct instruction_op *op, unsigned long ea,
+ } u;
+
+ nb = GETSIZE(op->type);
++ if (nb > sizeof(u))
++ return -EINVAL;
+ if (!address_ok(regs, ea, nb))
+ return -EFAULT;
+ rn = op->reg;
+@@ -636,6 +638,8 @@ static int do_fp_store(struct instruction_op *op, unsigned long ea,
+ } u;
+
+ nb = GETSIZE(op->type);
++ if (nb > sizeof(u))
++ return -EINVAL;
+ if (!address_ok(regs, ea, nb))
+ return -EFAULT;
+ rn = op->reg;
+@@ -680,6 +684,9 @@ static nokprobe_inline int do_vec_load(int rn, unsigned long ea,
+ u8 b[sizeof(__vector128)];
+ } u = {};
+
++ if (size > sizeof(u))
++ return -EINVAL;
++
+ if (!address_ok(regs, ea & ~0xfUL, 16))
+ return -EFAULT;
+ /* align to multiple of size */
+@@ -707,6 +714,9 @@ static nokprobe_inline int do_vec_store(int rn, unsigned long ea,
+ u8 b[sizeof(__vector128)];
+ } u;
+
++ if (size > sizeof(u))
++ return -EINVAL;
++
+ if (!address_ok(regs, ea & ~0xfUL, 16))
+ return -EFAULT;
+ /* align to multiple of size */
+--
+2.43.0
+
--- /dev/null
+From 01e8ddd9ca54f2863d721be68f73b8db815d2d02 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 22:44:32 +1100
+Subject: powerpc/mm: Fix build failures due to arch_reserved_kernel_pages()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Michael Ellerman <mpe@ellerman.id.au>
+
+[ Upstream commit d8c3f243d4db24675b653f0568bb65dae34e6455 ]
+
+With NUMA=n and FA_DUMP=y or PRESERVE_FA_DUMP=y the build fails with:
+
+ arch/powerpc/kernel/fadump.c:1739:22: error: no previous prototype for ‘arch_reserved_kernel_pages’ [-Werror=missing-prototypes]
+ 1739 | unsigned long __init arch_reserved_kernel_pages(void)
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~
+
+The prototype for arch_reserved_kernel_pages() is in include/linux/mm.h,
+but it's guarded by __HAVE_ARCH_RESERVED_KERNEL_PAGES. The powerpc
+headers define __HAVE_ARCH_RESERVED_KERNEL_PAGES in asm/mmzone.h, which
+is not included into the generic headers when NUMA=n.
+
+Move the definition of __HAVE_ARCH_RESERVED_KERNEL_PAGES into asm/mmu.h
+which is included regardless of NUMA=n.
+
+Additionally the ifdef around __HAVE_ARCH_RESERVED_KERNEL_PAGES needs to
+also check for CONFIG_PRESERVE_FA_DUMP.
+
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231130114433.3053544-1-mpe@ellerman.id.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/include/asm/mmu.h | 4 ++++
+ arch/powerpc/include/asm/mmzone.h | 3 ---
+ 2 files changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/arch/powerpc/include/asm/mmu.h b/arch/powerpc/include/asm/mmu.h
+index 52cc25864a1b..d8b7e246a32f 100644
+--- a/arch/powerpc/include/asm/mmu.h
++++ b/arch/powerpc/include/asm/mmu.h
+@@ -412,5 +412,9 @@ extern void *abatron_pteptrs[2];
+ #include <asm/nohash/mmu.h>
+ #endif
+
++#if defined(CONFIG_FA_DUMP) || defined(CONFIG_PRESERVE_FA_DUMP)
++#define __HAVE_ARCH_RESERVED_KERNEL_PAGES
++#endif
++
+ #endif /* __KERNEL__ */
+ #endif /* _ASM_POWERPC_MMU_H_ */
+diff --git a/arch/powerpc/include/asm/mmzone.h b/arch/powerpc/include/asm/mmzone.h
+index 4c6c6dbd182f..3764d3585d30 100644
+--- a/arch/powerpc/include/asm/mmzone.h
++++ b/arch/powerpc/include/asm/mmzone.h
+@@ -42,9 +42,6 @@ u64 memory_hotplug_max(void);
+ #else
+ #define memory_hotplug_max() memblock_end_of_DRAM()
+ #endif /* CONFIG_NUMA */
+-#ifdef CONFIG_FA_DUMP
+-#define __HAVE_ARCH_RESERVED_KERNEL_PAGES
+-#endif
+
+ #ifdef CONFIG_MEMORY_HOTPLUG
+ extern int create_section_mapping(unsigned long start, unsigned long end,
+--
+2.43.0
+
--- /dev/null
+From 30b81ff47982a2ed0b13d156dc983362b0c762e5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 10:32:23 +0800
+Subject: powerpc/mm: Fix null-pointer dereference in pgtable_cache_add
+
+From: Kunwu Chan <chentao@kylinos.cn>
+
+[ Upstream commit f46c8a75263f97bda13c739ba1c90aced0d3b071 ]
+
+kasprintf() returns a pointer to dynamically allocated memory
+which can be NULL upon failure. Ensure the allocation was successful
+by checking the pointer validity.
+
+Suggested-by: Christophe Leroy <christophe.leroy@csgroup.eu>
+Suggested-by: Michael Ellerman <mpe@ellerman.id.au>
+Signed-off-by: Kunwu Chan <chentao@kylinos.cn>
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231204023223.2447523-1-chentao@kylinos.cn
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/mm/init-common.c | 5 +++--
+ 1 file changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/arch/powerpc/mm/init-common.c b/arch/powerpc/mm/init-common.c
+index 119ef491f797..d3a7726ecf51 100644
+--- a/arch/powerpc/mm/init-common.c
++++ b/arch/powerpc/mm/init-common.c
+@@ -126,7 +126,7 @@ void pgtable_cache_add(unsigned int shift)
+ * as to leave enough 0 bits in the address to contain it. */
+ unsigned long minalign = max(MAX_PGTABLE_INDEX_SIZE + 1,
+ HUGEPD_SHIFT_MASK + 1);
+- struct kmem_cache *new;
++ struct kmem_cache *new = NULL;
+
+ /* It would be nice if this was a BUILD_BUG_ON(), but at the
+ * moment, gcc doesn't seem to recognize is_power_of_2 as a
+@@ -139,7 +139,8 @@ void pgtable_cache_add(unsigned int shift)
+
+ align = max_t(unsigned long, align, minalign);
+ name = kasprintf(GFP_KERNEL, "pgtable-2^%d", shift);
+- new = kmem_cache_create(name, table_size, align, 0, ctor(shift));
++ if (name)
++ new = kmem_cache_create(name, table_size, align, 0, ctor(shift));
+ if (!new)
+ panic("Could not allocate pgtable cache for order %d", shift);
+
+--
+2.43.0
+
--- /dev/null
+From 73b6eee5301ea47491a3ddf98e93fe52234c9bd9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 27 Nov 2023 13:28:09 +1100
+Subject: powerpc: pmd_move_must_withdraw() is only needed for
+ CONFIG_TRANSPARENT_HUGEPAGE
+
+From: Stephen Rothwell <sfr@canb.auug.org.au>
+
+[ Upstream commit 0d555b57ee660d8a871781c0eebf006e855e918d ]
+
+The linux-next build of powerpc64 allnoconfig fails with:
+
+ arch/powerpc/mm/book3s64/pgtable.c:557:5: error: no previous prototype for 'pmd_move_must_withdraw'
+ 557 | int pmd_move_must_withdraw(struct spinlock *new_pmd_ptl,
+ | ^~~~~~~~~~~~~~~~~~~~~~
+
+Caused by commit:
+
+ c6345dfa6e3e ("Makefile.extrawarn: turn on missing-prototypes globally")
+
+Fix it by moving the function definition under
+CONFIG_TRANSPARENT_HUGEPAGE like the prototype. The function is only
+called when CONFIG_TRANSPARENT_HUGEPAGE=y.
+
+Signed-off-by: Stephen Rothwell <sfr@canb.auug.org.au>
+[mpe: Flesh out change log from linux-next patch]
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231127132809.45c2b398@canb.auug.org.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/mm/book3s64/pgtable.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/arch/powerpc/mm/book3s64/pgtable.c b/arch/powerpc/mm/book3s64/pgtable.c
+index be229290a6a7..3438ab72c346 100644
+--- a/arch/powerpc/mm/book3s64/pgtable.c
++++ b/arch/powerpc/mm/book3s64/pgtable.c
+@@ -542,6 +542,7 @@ void ptep_modify_prot_commit(struct vm_area_struct *vma, unsigned long addr,
+ set_pte_at(vma->vm_mm, addr, ptep, pte);
+ }
+
++#ifdef CONFIG_TRANSPARENT_HUGEPAGE
+ /*
+ * For hash translation mode, we use the deposited table to store hash slot
+ * information and they are stored at PTRS_PER_PMD offset from related pmd
+@@ -563,6 +564,7 @@ int pmd_move_must_withdraw(struct spinlock *new_pmd_ptl,
+
+ return true;
+ }
++#endif
+
+ /*
+ * Does the CPU support tlbie?
+--
+2.43.0
+
--- /dev/null
+From 5b3f2a5a31c60ab5acb37d3773b9562c5fbf4d81 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 24 Feb 2023 10:36:32 +0800
+Subject: pstore/ram: Fix crash when setting number of cpus to an odd number
+
+From: Weichen Chen <weichen.chen@mediatek.com>
+
+[ Upstream commit d49270a04623ce3c0afddbf3e984cb245aa48e9c ]
+
+When the number of cpu cores is adjusted to 7 or other odd numbers,
+the zone size will become an odd number.
+The address of the zone will become:
+ addr of zone0 = BASE
+ addr of zone1 = BASE + zone_size
+ addr of zone2 = BASE + zone_size*2
+ ...
+The address of zone1/3/5/7 will be mapped to non-alignment va.
+Eventually crashes will occur when accessing these va.
+
+So, use ALIGN_DOWN() to make sure the zone size is even
+to avoid this bug.
+
+Signed-off-by: Weichen Chen <weichen.chen@mediatek.com>
+Reviewed-by: Matthias Brugger <matthias.bgg@gmail.com>
+Tested-by: "Guilherme G. Piccoli" <gpiccoli@igalia.com>
+Link: https://lore.kernel.org/r/20230224023632.6840-1-weichen.chen@mediatek.com
+Signed-off-by: Kees Cook <keescook@chromium.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/pstore/ram.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/fs/pstore/ram.c b/fs/pstore/ram.c
+index d36702c7ab3c..88b34fdbf759 100644
+--- a/fs/pstore/ram.c
++++ b/fs/pstore/ram.c
+@@ -529,6 +529,7 @@ static int ramoops_init_przs(const char *name,
+ }
+
+ zone_sz = mem_sz / *cnt;
++ zone_sz = ALIGN_DOWN(zone_sz, 2);
+ if (!zone_sz) {
+ dev_err(dev, "%s zone size == 0\n", name);
+ goto fail;
+--
+2.43.0
+
--- /dev/null
+From f4fb858bd9a49df08b488fb2c8f2328393b9e9a4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 14:03:15 +0100
+Subject: RDMA/IPoIB: Fix error code return in ipoib_mcast_join
+
+From: Jack Wang <jinpu.wang@ionos.com>
+
+[ Upstream commit 753fff78f430704548f45eda52d6d55371a52c0f ]
+
+Return the error code in case of ib_sa_join_multicast fail.
+
+Signed-off-by: Jack Wang <jinpu.wang@ionos.com>
+Link: https://lore.kernel.org/r/20231121130316.126364-2-jinpu.wang@ionos.com
+Signed-off-by: Leon Romanovsky <leon@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/infiniband/ulp/ipoib/ipoib_multicast.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+index 5b3154503bf4..9e6967a40042 100644
+--- a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
++++ b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+@@ -546,6 +546,7 @@ static int ipoib_mcast_join(struct net_device *dev, struct ipoib_mcast *mcast)
+ spin_unlock_irq(&priv->lock);
+ complete(&mcast->done);
+ spin_lock_irq(&priv->lock);
++ return ret;
+ }
+ return 0;
+ }
+--
+2.43.0
+
--- /dev/null
+From c205dc34d6eeefaabd7d0d2c85dc2b4c56269d9f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 2 Oct 2023 13:47:54 -0400
+Subject: Re-revert "drm/amd/display: Enable Replay for static screen use
+ cases"
+
+From: Ivan Lipski <ivlipski@amd.com>
+
+[ Upstream commit d6398866a6b47e92319ef6efdb0126a4fbb7796a ]
+
+This reverts commit 44e60b14d5a72f91fd0bdeae8da59ae37a3ca8e5.
+
+Since, it causes a regression in which eDP displays with PSR support,
+but no Replay support (Sink support <= 0x03), fail to enable PSR and
+consequently all IGT amd_psr tests fail. So, revert this until a more
+suitable fix can be found.
+
+This got brought back accidently with the backmerge.
+
+Acked-by: Leo Li <sunpeng.li@amd.com>
+Signed-off-by: Ivan Lipski <ivlipski@amd.com>
+Signed-off-by: Hamza Mahfooz <hamza.mahfooz@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c | 22 -------------------
+ .../amd/display/amdgpu_dm/amdgpu_dm_crtc.c | 9 +-------
+ drivers/gpu/drm/amd/include/amd_shared.h | 2 --
+ 3 files changed, 1 insertion(+), 32 deletions(-)
+
+diff --git a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c
+index 9dbbaeb8c6cf..6f7d7f79ef89 100644
+--- a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c
++++ b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c
+@@ -65,7 +65,6 @@
+ #include "amdgpu_dm_debugfs.h"
+ #endif
+ #include "amdgpu_dm_psr.h"
+-#include "amdgpu_dm_replay.h"
+
+ #include "ivsrcid/ivsrcid_vislands30.h"
+
+@@ -4348,7 +4347,6 @@ static int amdgpu_dm_initialize_drm_device(struct amdgpu_device *adev)
+ enum dc_connection_type new_connection_type = dc_connection_none;
+ const struct dc_plane_cap *plane;
+ bool psr_feature_enabled = false;
+- bool replay_feature_enabled = false;
+ int max_overlay = dm->dc->caps.max_slave_planes;
+
+ dm->display_indexes_num = dm->dc->caps.max_streams;
+@@ -4460,20 +4458,6 @@ static int amdgpu_dm_initialize_drm_device(struct amdgpu_device *adev)
+ }
+ }
+
+- if (!(amdgpu_dc_debug_mask & DC_DISABLE_REPLAY)) {
+- switch (adev->ip_versions[DCE_HWIP][0]) {
+- case IP_VERSION(3, 1, 4):
+- case IP_VERSION(3, 1, 5):
+- case IP_VERSION(3, 1, 6):
+- case IP_VERSION(3, 2, 0):
+- case IP_VERSION(3, 2, 1):
+- replay_feature_enabled = true;
+- break;
+- default:
+- replay_feature_enabled = amdgpu_dc_feature_mask & DC_REPLAY_MASK;
+- break;
+- }
+- }
+ /* loops over all connectors on the board */
+ for (i = 0; i < link_cnt; i++) {
+ struct dc_link *link = NULL;
+@@ -4522,12 +4506,6 @@ static int amdgpu_dm_initialize_drm_device(struct amdgpu_device *adev)
+ amdgpu_dm_update_connector_after_detect(aconnector);
+ setup_backlight_device(dm, aconnector);
+
+- /*
+- * Disable psr if replay can be enabled
+- */
+- if (replay_feature_enabled && amdgpu_dm_setup_replay(link, aconnector))
+- psr_feature_enabled = false;
+-
+ if (psr_feature_enabled)
+ amdgpu_dm_set_psr_caps(link);
+
+diff --git a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm_crtc.c b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm_crtc.c
+index cb0b48bb2a7d..d2834ad85a54 100644
+--- a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm_crtc.c
++++ b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm_crtc.c
+@@ -29,7 +29,6 @@
+ #include "dc.h"
+ #include "amdgpu.h"
+ #include "amdgpu_dm_psr.h"
+-#include "amdgpu_dm_replay.h"
+ #include "amdgpu_dm_crtc.h"
+ #include "amdgpu_dm_plane.h"
+ #include "amdgpu_dm_trace.h"
+@@ -124,12 +123,7 @@ static void amdgpu_dm_crtc_vblank_control_worker(struct work_struct *work)
+ * fill_dc_dirty_rects().
+ */
+ if (vblank_work->stream && vblank_work->stream->link) {
+- /*
+- * Prioritize replay, instead of psr
+- */
+- if (vblank_work->stream->link->replay_settings.replay_feature_enabled)
+- amdgpu_dm_replay_enable(vblank_work->stream, false);
+- else if (vblank_work->enable) {
++ if (vblank_work->enable) {
+ if (vblank_work->stream->link->psr_settings.psr_version < DC_PSR_VERSION_SU_1 &&
+ vblank_work->stream->link->psr_settings.psr_allow_active)
+ amdgpu_dm_psr_disable(vblank_work->stream);
+@@ -138,7 +132,6 @@ static void amdgpu_dm_crtc_vblank_control_worker(struct work_struct *work)
+ #ifdef CONFIG_DRM_AMD_SECURE_DISPLAY
+ !amdgpu_dm_crc_window_is_activated(&vblank_work->acrtc->base) &&
+ #endif
+- vblank_work->stream->link->panel_config.psr.disallow_replay &&
+ vblank_work->acrtc->dm_irq_params.allow_psr_entry) {
+ amdgpu_dm_psr_enable(vblank_work->stream);
+ }
+diff --git a/drivers/gpu/drm/amd/include/amd_shared.h b/drivers/gpu/drm/amd/include/amd_shared.h
+index 7f98394338c2..579977f6ad52 100644
+--- a/drivers/gpu/drm/amd/include/amd_shared.h
++++ b/drivers/gpu/drm/amd/include/amd_shared.h
+@@ -244,7 +244,6 @@ enum DC_FEATURE_MASK {
+ DC_DISABLE_LTTPR_DP2_0 = (1 << 6), //0x40, disabled by default
+ DC_PSR_ALLOW_SMU_OPT = (1 << 7), //0x80, disabled by default
+ DC_PSR_ALLOW_MULTI_DISP_OPT = (1 << 8), //0x100, disabled by default
+- DC_REPLAY_MASK = (1 << 9), //0x200, disabled by default for dcn < 3.1.4
+ };
+
+ enum DC_DEBUG_MASK {
+@@ -255,7 +254,6 @@ enum DC_DEBUG_MASK {
+ DC_DISABLE_PSR = 0x10,
+ DC_FORCE_SUBVP_MCLK_SWITCH = 0x20,
+ DC_DISABLE_MPO = 0x40,
+- DC_DISABLE_REPLAY = 0x50,
+ DC_ENABLE_DPIA_TRACE = 0x80,
+ };
+
+--
+2.43.0
+
--- /dev/null
+From 07a85b6e8a435b766189e2e1cdbf0c3186b2a77a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 3 Nov 2023 15:42:31 +0800
+Subject: regulator: core: Only increment use_count when enable_count changes
+
+From: Rui Zhang <zr.zhang@vivo.com>
+
+[ Upstream commit 7993d3a9c34f609c02171e115fd12c10e2105ff4 ]
+
+The use_count of a regulator should only be incremented when the
+enable_count changes from 0 to 1. Similarly, the use_count should
+only be decremented when the enable_count changes from 1 to 0.
+
+In the previous implementation, use_count was sometimes decremented
+to 0 when some consumer called unbalanced disable,
+leading to unexpected disable even the regulator is enabled by
+other consumers. With this change, the use_count accurately reflects
+the number of users which the regulator is enabled.
+
+This should make things more robust in the case where a consumer does
+leak references.
+
+Signed-off-by: Rui Zhang <zr.zhang@vivo.com>
+Link: https://lore.kernel.org/r/20231103074231.8031-1-zr.zhang@vivo.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/regulator/core.c | 56 +++++++++++++++++++++-------------------
+ 1 file changed, 30 insertions(+), 26 deletions(-)
+
+diff --git a/drivers/regulator/core.c b/drivers/regulator/core.c
+index 3137e40fcd3e..a7b3e548ea5a 100644
+--- a/drivers/regulator/core.c
++++ b/drivers/regulator/core.c
+@@ -2918,7 +2918,8 @@ static int _regulator_enable(struct regulator *regulator)
+ /* Fallthrough on positive return values - already enabled */
+ }
+
+- rdev->use_count++;
++ if (regulator->enable_count == 1)
++ rdev->use_count++;
+
+ return 0;
+
+@@ -2993,37 +2994,40 @@ static int _regulator_disable(struct regulator *regulator)
+
+ lockdep_assert_held_once(&rdev->mutex.base);
+
+- if (WARN(rdev->use_count <= 0,
++ if (WARN(regulator->enable_count == 0,
+ "unbalanced disables for %s\n", rdev_get_name(rdev)))
+ return -EIO;
+
+- /* are we the last user and permitted to disable ? */
+- if (rdev->use_count == 1 &&
+- (rdev->constraints && !rdev->constraints->always_on)) {
+-
+- /* we are last user */
+- if (regulator_ops_is_valid(rdev, REGULATOR_CHANGE_STATUS)) {
+- ret = _notifier_call_chain(rdev,
+- REGULATOR_EVENT_PRE_DISABLE,
+- NULL);
+- if (ret & NOTIFY_STOP_MASK)
+- return -EINVAL;
+-
+- ret = _regulator_do_disable(rdev);
+- if (ret < 0) {
+- rdev_err(rdev, "failed to disable: %pe\n", ERR_PTR(ret));
+- _notifier_call_chain(rdev,
+- REGULATOR_EVENT_ABORT_DISABLE,
++ if (regulator->enable_count == 1) {
++ /* disabling last enable_count from this regulator */
++ /* are we the last user and permitted to disable ? */
++ if (rdev->use_count == 1 &&
++ (rdev->constraints && !rdev->constraints->always_on)) {
++
++ /* we are last user */
++ if (regulator_ops_is_valid(rdev, REGULATOR_CHANGE_STATUS)) {
++ ret = _notifier_call_chain(rdev,
++ REGULATOR_EVENT_PRE_DISABLE,
++ NULL);
++ if (ret & NOTIFY_STOP_MASK)
++ return -EINVAL;
++
++ ret = _regulator_do_disable(rdev);
++ if (ret < 0) {
++ rdev_err(rdev, "failed to disable: %pe\n", ERR_PTR(ret));
++ _notifier_call_chain(rdev,
++ REGULATOR_EVENT_ABORT_DISABLE,
++ NULL);
++ return ret;
++ }
++ _notifier_call_chain(rdev, REGULATOR_EVENT_DISABLE,
+ NULL);
+- return ret;
+ }
+- _notifier_call_chain(rdev, REGULATOR_EVENT_DISABLE,
+- NULL);
+- }
+
+- rdev->use_count = 0;
+- } else if (rdev->use_count > 1) {
+- rdev->use_count--;
++ rdev->use_count = 0;
++ } else if (rdev->use_count > 1) {
++ rdev->use_count--;
++ }
+ }
+
+ if (ret == 0)
+--
+2.43.0
+
--- /dev/null
+From c54ae0eab32b08e9861b2870d1d07264388b199a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 23:14:20 +0200
+Subject: reiserfs: Avoid touching renamed directory if parent does not change
+
+From: Jan Kara <jack@suse.cz>
+
+[ Upstream commit 49db9b1b86a82448dfaf3fcfefcf678dee56c8ed ]
+
+The VFS will not be locking moved directory if its parent does not
+change. Change reiserfs rename code to avoid touching renamed directory
+if its parent does not change as without locking that can corrupt the
+filesystem.
+
+Signed-off-by: Jan Kara <jack@suse.cz>
+Signed-off-by: Al Viro <viro@zeniv.linux.org.uk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/reiserfs/namei.c | 54 ++++++++++++++++++++++++---------------------
+ 1 file changed, 29 insertions(+), 25 deletions(-)
+
+diff --git a/fs/reiserfs/namei.c b/fs/reiserfs/namei.c
+index 994d6e6995ab..5996197ba40c 100644
+--- a/fs/reiserfs/namei.c
++++ b/fs/reiserfs/namei.c
+@@ -1324,8 +1324,8 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+ struct inode *old_inode, *new_dentry_inode;
+ struct reiserfs_transaction_handle th;
+ int jbegin_count;
+- umode_t old_inode_mode;
+ unsigned long savelink = 1;
++ bool update_dir_parent = false;
+
+ if (flags & ~RENAME_NOREPLACE)
+ return -EINVAL;
+@@ -1375,8 +1375,7 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+ return -ENOENT;
+ }
+
+- old_inode_mode = old_inode->i_mode;
+- if (S_ISDIR(old_inode_mode)) {
++ if (S_ISDIR(old_inode->i_mode)) {
+ /*
+ * make sure that directory being renamed has correct ".."
+ * and that its new parent directory has not too many links
+@@ -1389,24 +1388,28 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+ }
+ }
+
+- /*
+- * directory is renamed, its parent directory will be changed,
+- * so find ".." entry
+- */
+- dot_dot_de.de_gen_number_bit_string = NULL;
+- retval =
+- reiserfs_find_entry(old_inode, "..", 2, &dot_dot_entry_path,
++ if (old_dir != new_dir) {
++ /*
++ * directory is renamed, its parent directory will be
++ * changed, so find ".." entry
++ */
++ dot_dot_de.de_gen_number_bit_string = NULL;
++ retval =
++ reiserfs_find_entry(old_inode, "..", 2,
++ &dot_dot_entry_path,
+ &dot_dot_de);
+- pathrelse(&dot_dot_entry_path);
+- if (retval != NAME_FOUND) {
+- reiserfs_write_unlock(old_dir->i_sb);
+- return -EIO;
+- }
++ pathrelse(&dot_dot_entry_path);
++ if (retval != NAME_FOUND) {
++ reiserfs_write_unlock(old_dir->i_sb);
++ return -EIO;
++ }
+
+- /* inode number of .. must equal old_dir->i_ino */
+- if (dot_dot_de.de_objectid != old_dir->i_ino) {
+- reiserfs_write_unlock(old_dir->i_sb);
+- return -EIO;
++ /* inode number of .. must equal old_dir->i_ino */
++ if (dot_dot_de.de_objectid != old_dir->i_ino) {
++ reiserfs_write_unlock(old_dir->i_sb);
++ return -EIO;
++ }
++ update_dir_parent = true;
+ }
+ }
+
+@@ -1486,7 +1489,7 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+
+ reiserfs_prepare_for_journal(old_inode->i_sb, new_de.de_bh, 1);
+
+- if (S_ISDIR(old_inode->i_mode)) {
++ if (update_dir_parent) {
+ if ((retval =
+ search_by_entry_key(new_dir->i_sb,
+ &dot_dot_de.de_entry_key,
+@@ -1534,14 +1537,14 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+ new_de.de_bh);
+ reiserfs_restore_prepared_buffer(old_inode->i_sb,
+ old_de.de_bh);
+- if (S_ISDIR(old_inode_mode))
++ if (update_dir_parent)
+ reiserfs_restore_prepared_buffer(old_inode->
+ i_sb,
+ dot_dot_de.
+ de_bh);
+ continue;
+ }
+- if (S_ISDIR(old_inode_mode)) {
++ if (update_dir_parent) {
+ if (item_moved(&dot_dot_ih, &dot_dot_entry_path) ||
+ !entry_points_to_object("..", 2, &dot_dot_de,
+ old_dir)) {
+@@ -1559,7 +1562,7 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+ }
+ }
+
+- RFALSE(S_ISDIR(old_inode_mode) &&
++ RFALSE(update_dir_parent &&
+ !buffer_journal_prepared(dot_dot_de.de_bh), "");
+
+ break;
+@@ -1592,11 +1595,12 @@ static int reiserfs_rename(struct mnt_idmap *idmap,
+ savelink = new_dentry_inode->i_nlink;
+ }
+
+- if (S_ISDIR(old_inode_mode)) {
++ if (update_dir_parent) {
+ /* adjust ".." of renamed directory */
+ set_ino_in_dir_entry(&dot_dot_de, INODE_PKEY(new_dir));
+ journal_mark_dirty(&th, dot_dot_de.de_bh);
+-
++ }
++ if (S_ISDIR(old_inode->i_mode)) {
+ /*
+ * there (in new_dir) was no directory, so it got new link
+ * (".." of renamed directory)
+--
+2.43.0
+
--- /dev/null
+From 4dafce7529750caa3500522e77f1a7990756d976 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 20 Dec 2023 10:34:32 -0500
+Subject: Revert "drm/amd/display: Fix conversions between bytes and KB"
+
+From: Daniel Miess <daniel.miess@amd.com>
+
+[ Upstream commit bf282eb92b84709d99186ad5940b9997eb3c1ff2 ]
+
+This reverts commit d0f639c5869399bf6dde4d694d5f8c0ab8c0ec46.
+
+The previous commit causes failure to light up for 1080p
+eDP + 8k HDMI panel combo.
+
+Reviewed-by: Charlene Liu <charlene.liu@amd.com>
+Acked-by: Rodrigo Siqueira <rodrigo.siqueira@amd.com>
+Signed-off-by: Daniel Miess <daniel.miess@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/dml2/display_mode_core.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dml2/display_mode_core.c b/drivers/gpu/drm/amd/display/dc/dml2/display_mode_core.c
+index 62ce95bac8f2..9be5ebf3a8c0 100644
+--- a/drivers/gpu/drm/amd/display/dc/dml2/display_mode_core.c
++++ b/drivers/gpu/drm/amd/display/dc/dml2/display_mode_core.c
+@@ -6229,7 +6229,7 @@ static void set_calculate_prefetch_schedule_params(struct display_mode_lib_st *m
+ CalculatePrefetchSchedule_params->GPUVMEnable = mode_lib->ms.cache_display_cfg.plane.GPUVMEnable;
+ CalculatePrefetchSchedule_params->HostVMEnable = mode_lib->ms.cache_display_cfg.plane.HostVMEnable;
+ CalculatePrefetchSchedule_params->HostVMMaxNonCachedPageTableLevels = mode_lib->ms.cache_display_cfg.plane.HostVMMaxPageTableLevels;
+- CalculatePrefetchSchedule_params->HostVMMinPageSize = mode_lib->ms.soc.hostvm_min_page_size_kbytes;
++ CalculatePrefetchSchedule_params->HostVMMinPageSize = mode_lib->ms.soc.hostvm_min_page_size_kbytes * 1024;
+ CalculatePrefetchSchedule_params->DynamicMetadataEnable = mode_lib->ms.cache_display_cfg.plane.DynamicMetadataEnable[k];
+ CalculatePrefetchSchedule_params->DynamicMetadataVMEnabled = mode_lib->ms.ip.dynamic_metadata_vm_enabled;
+ CalculatePrefetchSchedule_params->DynamicMetadataLinesBeforeActiveRequired = mode_lib->ms.cache_display_cfg.plane.DynamicMetadataLinesBeforeActiveRequired[k];
+--
+2.43.0
+
--- /dev/null
+From 4e8b7173d9402cc94d678ff79d14a5ee040ddd3c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 18 Jan 2024 22:21:20 +0100
+Subject: riscv: Fix build error on rv32 + XIP
+
+From: Alexandre Ghiti <alexghiti@rivosinc.com>
+
+[ Upstream commit 66f962d8939fd2ac74de901d30d30310c8ddca79 ]
+
+commit 66f1e6809397 ("riscv: Make XIP bootable again") restricted page
+offset to the sv39 page offset instead of the default sv57, which makes
+sense since probably the platforms that target XIP kernels do not
+support anything else than sv39 and we do not try to find out the
+largest address space supported on XIP kernels (ie set_satp_mode()).
+
+But PAGE_OFFSET_L3 is not defined for rv32, so fix the build error by
+restoring the previous behaviour which picks CONFIG_PAGE_OFFSET for rv32.
+
+Fixes: 66f1e6809397 ("riscv: Make XIP bootable again")
+Reported-by: Randy Dunlap <rdunlap@infradead.org>
+Closes: https://lore.kernel.org/linux-riscv/344dca85-5c48-44e1-bc64-4fa7973edd12@infradead.org/T/#u
+Signed-off-by: Alexandre Ghiti <alexghiti@rivosinc.com>
+Acked-by: Randy Dunlap <rdunlap@infradead.org>
+Tested-by: Randy Dunlap <rdunlap@infradead.org> # build-tested
+Link: https://lore.kernel.org/r/20240118212120.2087803-1-alexghiti@rivosinc.com
+Signed-off-by: Palmer Dabbelt <palmer@rivosinc.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/riscv/mm/init.c | 4 ++++
+ 1 file changed, 4 insertions(+)
+
+diff --git a/arch/riscv/mm/init.c b/arch/riscv/mm/init.c
+index a65937336cdc..ad77ed410d4d 100644
+--- a/arch/riscv/mm/init.c
++++ b/arch/riscv/mm/init.c
+@@ -1060,7 +1060,11 @@ asmlinkage void __init setup_vm(uintptr_t dtb_pa)
+ kernel_map.virt_addr = KERNEL_LINK_ADDR + kernel_map.virt_offset;
+
+ #ifdef CONFIG_XIP_KERNEL
++#ifdef CONFIG_64BIT
+ kernel_map.page_offset = PAGE_OFFSET_L3;
++#else
++ kernel_map.page_offset = _AC(CONFIG_PAGE_OFFSET, UL);
++#endif
+ kernel_map.xiprom = (uintptr_t)CONFIG_XIP_PHYS_ADDR;
+ kernel_map.xiprom_sz = (uintptr_t)(&_exiprom) - (uintptr_t)(&_xiprom);
+
+--
+2.43.0
+
--- /dev/null
+From cd917d52a96af635ad5d39bb257edc059be58467 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 14:01:12 +0100
+Subject: riscv: Make XIP bootable again
+
+From: Frederik Haxel <haxel@fzi.de>
+
+[ Upstream commit 66f1e68093979816a23412a3fad066f5bcbc0360 ]
+
+Currently, the XIP kernel seems to fail to boot due to missing
+XIP_FIXUP and a wrong page_offset value. A superfluous XIP_FIXUP
+has also been removed.
+
+Signed-off-by: Frederik Haxel <haxel@fzi.de>
+Link: https://lore.kernel.org/r/20231212130116.848530-2-haxel@fzi.de
+Signed-off-by: Palmer Dabbelt <palmer@rivosinc.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/riscv/kernel/head.S | 1 +
+ arch/riscv/mm/init.c | 8 ++++++--
+ 2 files changed, 7 insertions(+), 2 deletions(-)
+
+diff --git a/arch/riscv/kernel/head.S b/arch/riscv/kernel/head.S
+index 76ace1e0b46f..663881785b2b 100644
+--- a/arch/riscv/kernel/head.S
++++ b/arch/riscv/kernel/head.S
+@@ -89,6 +89,7 @@ relocate_enable_mmu:
+ /* Compute satp for kernel page tables, but don't load it yet */
+ srl a2, a0, PAGE_SHIFT
+ la a1, satp_mode
++ XIP_FIXUP_OFFSET a1
+ REG_L a1, 0(a1)
+ or a2, a2, a1
+
+diff --git a/arch/riscv/mm/init.c b/arch/riscv/mm/init.c
+index 2e011cbddf3a..a65937336cdc 100644
+--- a/arch/riscv/mm/init.c
++++ b/arch/riscv/mm/init.c
+@@ -174,6 +174,9 @@ void __init mem_init(void)
+
+ /* Limit the memory size via mem. */
+ static phys_addr_t memory_limit;
++#ifdef CONFIG_XIP_KERNEL
++#define memory_limit (*(phys_addr_t *)XIP_FIXUP(&memory_limit))
++#endif /* CONFIG_XIP_KERNEL */
+
+ static int __init early_mem(char *p)
+ {
+@@ -952,7 +955,7 @@ static void __init create_fdt_early_page_table(uintptr_t fix_fdt_va,
+ * setup_vm_final installs the linear mapping. For 32-bit kernel, as the
+ * kernel is mapped in the linear mapping, that makes no difference.
+ */
+- dtb_early_va = kernel_mapping_pa_to_va(XIP_FIXUP(dtb_pa));
++ dtb_early_va = kernel_mapping_pa_to_va(dtb_pa);
+ #endif
+
+ dtb_early_pa = dtb_pa;
+@@ -1055,9 +1058,9 @@ asmlinkage void __init setup_vm(uintptr_t dtb_pa)
+ #endif
+
+ kernel_map.virt_addr = KERNEL_LINK_ADDR + kernel_map.virt_offset;
+- kernel_map.page_offset = _AC(CONFIG_PAGE_OFFSET, UL);
+
+ #ifdef CONFIG_XIP_KERNEL
++ kernel_map.page_offset = PAGE_OFFSET_L3;
+ kernel_map.xiprom = (uintptr_t)CONFIG_XIP_PHYS_ADDR;
+ kernel_map.xiprom_sz = (uintptr_t)(&_exiprom) - (uintptr_t)(&_xiprom);
+
+@@ -1067,6 +1070,7 @@ asmlinkage void __init setup_vm(uintptr_t dtb_pa)
+
+ kernel_map.va_kernel_xip_pa_offset = kernel_map.virt_addr - kernel_map.xiprom;
+ #else
++ kernel_map.page_offset = _AC(CONFIG_PAGE_OFFSET, UL);
+ kernel_map.phys_addr = (uintptr_t)(&_start);
+ kernel_map.size = (uintptr_t)(&_end) - kernel_map.phys_addr;
+ #endif
+--
+2.43.0
+
--- /dev/null
+From 4b2b8b19cfea4af1f7104c449e2e8cd1757c2d22 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 17 Nov 2023 17:48:46 +0100
+Subject: rxrpc_find_service_conn_rcu: fix the usage of read_seqbegin_or_lock()
+
+From: Oleg Nesterov <oleg@redhat.com>
+
+[ Upstream commit bad1a11c0f061aa073bab785389fe04f19ba02e1 ]
+
+rxrpc_find_service_conn_rcu() should make the "seq" counter odd on the
+second pass, otherwise read_seqbegin_or_lock() never takes the lock.
+
+Signed-off-by: Oleg Nesterov <oleg@redhat.com>
+Signed-off-by: David Howells <dhowells@redhat.com>
+cc: Marc Dionne <marc.dionne@auristor.com>
+cc: linux-afs@lists.infradead.org
+Link: https://lore.kernel.org/r/20231117164846.GA10410@redhat.com/
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/rxrpc/conn_service.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/net/rxrpc/conn_service.c b/net/rxrpc/conn_service.c
+index 89ac05a711a4..39c908a3ca6e 100644
+--- a/net/rxrpc/conn_service.c
++++ b/net/rxrpc/conn_service.c
+@@ -25,7 +25,7 @@ struct rxrpc_connection *rxrpc_find_service_conn_rcu(struct rxrpc_peer *peer,
+ struct rxrpc_conn_proto k;
+ struct rxrpc_skb_priv *sp = rxrpc_skb(skb);
+ struct rb_node *p;
+- unsigned int seq = 0;
++ unsigned int seq = 1;
+
+ k.epoch = sp->hdr.epoch;
+ k.cid = sp->hdr.cid & RXRPC_CIDMASK;
+@@ -35,6 +35,7 @@ struct rxrpc_connection *rxrpc_find_service_conn_rcu(struct rxrpc_peer *peer,
+ * under just the RCU read lock, so we have to check for
+ * changes.
+ */
++ seq++; /* 2 on the 1st/lockless path, otherwise odd */
+ read_seqbegin_or_lock(&peer->service_conn_lock, &seq);
+
+ p = rcu_dereference_raw(peer->service_conns.rb_node);
+--
+2.43.0
+
--- /dev/null
+From b218beba026ee9ac43e5ba095a053a51a5c0b43d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 16 Jul 2023 10:56:00 +0200
+Subject: s390/boot: always align vmalloc area on segment boundary
+
+From: Alexander Gordeev <agordeev@linux.ibm.com>
+
+[ Upstream commit 65f8780e2d70257200547b5a7654974aa7c37ce1 ]
+
+The size of vmalloc area depends from various factors
+on boot and could be set to:
+
+1. Default size as determined by VMALLOC_DEFAULT_SIZE macro;
+2. One half of the virtual address space not occupied by
+ modules and fixed mappings;
+3. The size provided by user with vmalloc= kernel command
+ line parameter;
+
+In cases [1] and [2] the vmalloc area base address is aligned
+on Region3 table type boundary, while in case [3] in might get
+aligned on page boundary.
+
+Limit the waste of page tables and always align vmalloc area
+size and base address on segment boundary.
+
+Acked-by: Heiko Carstens <hca@linux.ibm.com>
+Signed-off-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/s390/boot/ipl_parm.c | 2 +-
+ arch/s390/boot/startup.c | 3 ++-
+ 2 files changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/arch/s390/boot/ipl_parm.c b/arch/s390/boot/ipl_parm.c
+index 2ab4872fbee1..b24de9aabf7d 100644
+--- a/arch/s390/boot/ipl_parm.c
++++ b/arch/s390/boot/ipl_parm.c
+@@ -274,7 +274,7 @@ void parse_boot_command_line(void)
+ memory_limit = round_down(memparse(val, NULL), PAGE_SIZE);
+
+ if (!strcmp(param, "vmalloc") && val) {
+- vmalloc_size = round_up(memparse(val, NULL), PAGE_SIZE);
++ vmalloc_size = round_up(memparse(val, NULL), _SEGMENT_SIZE);
+ vmalloc_size_set = 1;
+ }
+
+diff --git a/arch/s390/boot/startup.c b/arch/s390/boot/startup.c
+index 8104e0e3d188..9cc76e631759 100644
+--- a/arch/s390/boot/startup.c
++++ b/arch/s390/boot/startup.c
+@@ -255,7 +255,8 @@ static unsigned long setup_kernel_memory_layout(void)
+ VMALLOC_END = MODULES_VADDR;
+
+ /* allow vmalloc area to occupy up to about 1/2 of the rest virtual space left */
+- vmalloc_size = min(vmalloc_size, round_down(VMALLOC_END / 2, _REGION3_SIZE));
++ vsize = round_down(VMALLOC_END / 2, _SEGMENT_SIZE);
++ vmalloc_size = min(vmalloc_size, vsize);
+ VMALLOC_START = VMALLOC_END - vmalloc_size;
+
+ /* split remaining virtual space between 1:1 mapping & vmemmap array */
+--
+2.43.0
+
--- /dev/null
+From d857fbf1e3b0c3fddd23d01b1ad27793415edbae Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 18:55:59 +0100
+Subject: s390/ptrace: handle setting of fpc register correctly
+
+From: Heiko Carstens <hca@linux.ibm.com>
+
+[ Upstream commit 8b13601d19c541158a6e18b278c00ba69ae37829 ]
+
+If the content of the floating point control (fpc) register of a traced
+process is modified with the ptrace interface the new value is tested for
+validity by temporarily loading it into the fpc register.
+
+This may lead to corruption of the fpc register of the tracing process:
+if an interrupt happens while the value is temporarily loaded into the
+fpc register, and within interrupt context floating point or vector
+registers are used, the current fp/vx registers are saved with
+save_fpu_regs() assuming they belong to user space and will be loaded into
+fp/vx registers when returning to user space.
+
+test_fp_ctl() restores the original user space fpc register value, however
+it will be discarded, when returning to user space.
+
+In result the tracer will incorrectly continue to run with the value that
+was supposed to be used for the traced process.
+
+Fix this by saving fpu register contents with save_fpu_regs() before using
+test_fp_ctl().
+
+Reviewed-by: Claudio Imbrenda <imbrenda@linux.ibm.com>
+Signed-off-by: Heiko Carstens <hca@linux.ibm.com>
+Signed-off-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/s390/kernel/ptrace.c | 6 +++---
+ 1 file changed, 3 insertions(+), 3 deletions(-)
+
+diff --git a/arch/s390/kernel/ptrace.c b/arch/s390/kernel/ptrace.c
+index 046403471c5d..c7ed302a6b59 100644
+--- a/arch/s390/kernel/ptrace.c
++++ b/arch/s390/kernel/ptrace.c
+@@ -392,6 +392,7 @@ static int __poke_user(struct task_struct *child, addr_t addr, addr_t data)
+ /*
+ * floating point control reg. is in the thread structure
+ */
++ save_fpu_regs();
+ if ((unsigned int) data != 0 ||
+ test_fp_ctl(data >> (BITS_PER_LONG - 32)))
+ return -EINVAL;
+@@ -748,6 +749,7 @@ static int __poke_user_compat(struct task_struct *child,
+ /*
+ * floating point control reg. is in the thread structure
+ */
++ save_fpu_regs();
+ if (test_fp_ctl(tmp))
+ return -EINVAL;
+ child->thread.fpu.fpc = data;
+@@ -911,9 +913,7 @@ static int s390_fpregs_set(struct task_struct *target,
+ int rc = 0;
+ freg_t fprs[__NUM_FPRS];
+
+- if (target == current)
+- save_fpu_regs();
+-
++ save_fpu_regs();
+ if (MACHINE_HAS_VX)
+ convert_vx_to_fp(fprs, target->thread.fpu.vxrs);
+ else
+--
+2.43.0
+
--- /dev/null
+From 795c0ffd40030802cb87f7bf5cbb4a4d5cd120da Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 8 Nov 2023 15:11:30 -0500
+Subject: s390/vfio-ap: fix sysfs status attribute for AP queue devices
+
+From: Tony Krowiak <akrowiak@linux.ibm.com>
+
+[ Upstream commit a0d8f4eeb7c4ffaee21702bcc91a09b3988c5b7a ]
+
+The 'status' attribute for AP queue devices bound to the vfio_ap device
+driver displays incorrect status when the mediated device is attached to a
+guest, but the queue device is not passed through. In the current
+implementation, the status displayed is 'in_use' which is not correct; it
+should be 'assigned'. This can happen if one of the queue devices
+associated with a given adapter is not bound to the vfio_ap device driver.
+For example:
+
+Queues listed in /sys/bus/ap/drivers/vfio_ap:
+14.0005
+14.0006
+14.000d
+16.0006
+16.000d
+
+Queues listed in /sys/devices/vfio_ap/matrix/$UUID/matrix
+14.0005
+14.0006
+14.000d
+16.0005
+16.0006
+16.000d
+
+Queues listed in /sys/devices/vfio_ap/matrix/$UUID/guest_matrix
+14.0005
+14.0006
+14.000d
+
+The reason no queues for adapter 0x16 are listed in the guest_matrix is
+because queue 16.0005 is not bound to the vfio_ap device driver, so no
+queue associated with the adapter is passed through to the guest;
+therefore, each queue device for adapter 0x16 should display 'assigned'
+instead of 'in_use', because those queues are not in use by a guest, but
+only assigned to the mediated device.
+
+Let's check the AP configuration for the guest to determine whether a
+queue device is passed through before displaying a status of 'in_use'.
+
+Signed-off-by: Tony Krowiak <akrowiak@linux.ibm.com>
+Acked-by: Halil Pasic <pasic@linux.ibm.com>
+Acked-by: Harald Freudenberger <freude@linux.ibm.com>
+Link: https://lore.kernel.org/r/20231108201135.351419-1-akrowiak@linux.ibm.com
+Signed-off-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/s390/crypto/vfio_ap_ops.c | 16 +++++++++++++++-
+ 1 file changed, 15 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/s390/crypto/vfio_ap_ops.c b/drivers/s390/crypto/vfio_ap_ops.c
+index 88f41f95cc94..d6ea2fd4c2a0 100644
+--- a/drivers/s390/crypto/vfio_ap_ops.c
++++ b/drivers/s390/crypto/vfio_ap_ops.c
+@@ -2044,6 +2044,7 @@ static ssize_t status_show(struct device *dev,
+ {
+ ssize_t nchars = 0;
+ struct vfio_ap_queue *q;
++ unsigned long apid, apqi;
+ struct ap_matrix_mdev *matrix_mdev;
+ struct ap_device *apdev = to_ap_dev(dev);
+
+@@ -2051,8 +2052,21 @@ static ssize_t status_show(struct device *dev,
+ q = dev_get_drvdata(&apdev->device);
+ matrix_mdev = vfio_ap_mdev_for_queue(q);
+
++ /* If the queue is assigned to the matrix mediated device, then
++ * determine whether it is passed through to a guest; otherwise,
++ * indicate that it is unassigned.
++ */
+ if (matrix_mdev) {
+- if (matrix_mdev->kvm)
++ apid = AP_QID_CARD(q->apqn);
++ apqi = AP_QID_QUEUE(q->apqn);
++ /*
++ * If the queue is passed through to the guest, then indicate
++ * that it is in use; otherwise, indicate that it is
++ * merely assigned to a matrix mediated device.
++ */
++ if (matrix_mdev->kvm &&
++ test_bit_inv(apid, matrix_mdev->shadow_apcb.apm) &&
++ test_bit_inv(apqi, matrix_mdev->shadow_apcb.aqm))
+ nchars = scnprintf(buf, PAGE_SIZE, "%s\n",
+ AP_QUEUE_IN_USE);
+ else
+--
+2.43.0
+
--- /dev/null
+From d0dae323e9150c8f2d65d0c30a9cc8d5e98a7feb Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 17:40:14 +0100
+Subject: sched/fair: Fix tg->load when offlining a CPU
+
+From: Vincent Guittot <vincent.guittot@linaro.org>
+
+[ Upstream commit f60a631ab9ed5df15e446269ea515f2b8948ba0c ]
+
+When a CPU is taken offline, the contribution of its cfs_rqs to task_groups'
+load may remain and will negatively impact the calculation of the share of
+the online CPUs.
+
+To fix this bug, clear the contribution of an offlining CPU to task groups'
+load and skip its contribution while it is inactive.
+
+Here's the reproducer of the anomaly, by Imran Khan:
+
+ "So far I have encountered only one rather lengthy way of reproducing this issue,
+ which is as follows:
+
+ 1. Take a KVM guest (booted with 4 CPUs and can be scaled up to 124 CPUs) and
+ create 2 custom cgroups: /sys/fs/cgroup/cpu/test_group_1 and /sys/fs/cgroup/
+ cpu/test_group_2
+
+ 2. Assign a CPU intensive workload to each of these cgroups and start the
+ workload.
+
+ For my tests I am using following app:
+
+ int main(int argc, char *argv[])
+ {
+ unsigned long count, i, val;
+ if (argc != 2) {
+ printf("usage: ./a.out <number of random nums to generate> \n");
+ return 0;
+ }
+
+ count = strtoul(argv[1], NULL, 10);
+
+ printf("Generating %lu random numbers \n", count);
+ for (i = 0; i < count; i++) {
+ val = rand();
+ val = val % 2;
+ //usleep(1);
+ }
+ printf("Generated %lu random numbers \n", count);
+ return 0;
+ }
+
+ Also since the system is booted with 4 CPUs, in order to completely load the
+ system I am also launching 4 instances of same test app under:
+
+ /sys/fs/cgroup/cpu/
+
+ 3. We can see that both of the cgroups get similar CPU time:
+
+ # systemd-cgtop --depth 1
+ Path Tasks %CPU Memory Input/s Output/s
+ / 659 - 5.5G - -
+ /system.slice - - 5.7G - -
+ /test_group_1 4 - - - -
+ /test_group_2 3 - - - -
+ /user.slice 31 - 56.5M - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 659 394.6 5.5G - -
+ /test_group_2 3 65.7 - - -
+ /user.slice 29 55.1 48.0M - -
+ /test_group_1 4 47.3 - - -
+ /system.slice - 2.2 5.7G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 659 394.8 5.5G - -
+ /test_group_1 4 62.9 - - -
+ /user.slice 28 44.9 54.2M - -
+ /test_group_2 3 44.7 - - -
+ /system.slice - 0.9 5.7G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 659 394.4 5.5G - -
+ /test_group_2 3 58.8 - - -
+ /test_group_1 4 51.9 - - -
+ /user.slice 30 39.3 59.6M - -
+ /system.slice - 1.9 5.7G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 659 394.7 5.5G - -
+ /test_group_1 4 60.9 - - -
+ /test_group_2 3 57.9 - - -
+ /user.slice 28 43.5 36.9M - -
+ /system.slice - 3.0 5.7G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 659 395.0 5.5G - -
+ /test_group_1 4 66.8 - - -
+ /test_group_2 3 56.3 - - -
+ /user.slice 29 43.1 51.8M - -
+ /system.slice - 0.7 5.7G - -
+
+ 4. Now move systemd-udevd to one of these test groups, say test_group_1, and
+ perform scale up to 124 CPUs followed by scale down back to 4 CPUs from the
+ host side.
+
+ 5. Run the same workload i.e 4 instances of CPU hogger under /sys/fs/cgroup/cpu
+ and one instance of CPU hogger each in /sys/fs/cgroup/cpu/test_group_1 and
+ /sys/fs/cgroup/test_group_2.
+
+ It can be seen that test_group_1 (the one where systemd-udevd was moved) is getting
+ much less CPU time than the test_group_2, even though at this point of time both of
+ these groups have only CPU hogger running:
+
+ # systemd-cgtop --depth 1
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1219 - 5.4G - -
+ /system.slice - - 5.6G - -
+ /test_group_1 4 - - - -
+ /test_group_2 3 - - - -
+ /user.slice 26 - 91.3M - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 394.3 5.4G - -
+ /test_group_2 3 82.7 - - -
+ /test_group_1 4 14.3 - - -
+ /system.slice - 0.8 5.6G - -
+ /user.slice 26 0.4 91.2M - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 394.6 5.4G - -
+ /test_group_2 3 67.4 - - -
+ /system.slice - 24.6 5.6G - -
+ /test_group_1 4 12.5 - - -
+ /user.slice 26 0.4 91.2M - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 395.2 5.4G - -
+ /test_group_2 3 60.9 - - -
+ /system.slice - 27.9 5.6G - -
+ /test_group_1 4 12.2 - - -
+ /user.slice 26 0.4 91.2M - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 395.2 5.4G - -
+ /test_group_2 3 69.4 - - -
+ /test_group_1 4 13.9 - - -
+ /user.slice 28 1.6 92.0M - -
+ /system.slice - 1.0 5.6G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 395.6 5.4G - -
+ /test_group_2 3 59.3 - - -
+ /test_group_1 4 14.1 - - -
+ /user.slice 28 1.3 92.2M - -
+ /system.slice - 0.7 5.6G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 395.5 5.4G - -
+ /test_group_2 3 67.2 - - -
+ /test_group_1 4 11.5 - - -
+ /user.slice 28 1.3 92.5M - -
+ /system.slice - 0.6 5.6G - -
+
+ Path Tasks %CPU Memory Input/s Output/s
+ / 1221 395.1 5.4G - -
+ /test_group_2 3 76.8 - - -
+ /test_group_1 4 12.9 - - -
+ /user.slice 28 1.3 92.8M - -
+ /system.slice - 1.2 5.6G - -
+
+ From sched_debug data it can be seen that in bad case the load.weight of per-CPU
+ sched entities corresponding to test_group_1 has reduced significantly and
+ also load_avg of test_group_1 remains much higher than that of test_group_2,
+ even though systemd-udevd stopped running long time back and at this point of
+ time both cgroups just have the CPU hogger app as running entity."
+
+[ mingo: Added details from the original discussion, plus minor edits to the patch. ]
+
+Reported-by: Imran Khan <imran.f.khan@oracle.com>
+Tested-by: Imran Khan <imran.f.khan@oracle.com>
+Tested-by: Aaron Lu <aaron.lu@intel.com>
+Signed-off-by: Vincent Guittot <vincent.guittot@linaro.org>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Reviewed-by: Imran Khan <imran.f.khan@oracle.com>
+Cc: Peter Zijlstra <peterz@infradead.org>
+Cc: Borislav Petkov <bp@alien8.de>
+Link: https://lore.kernel.org/r/20231223111545.62135-1-vincent.guittot@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/sched/fair.c | 52 +++++++++++++++++++++++++++++++++++++++++++++
+ 1 file changed, 52 insertions(+)
+
+diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
+index 3070c6f7168e..7ac9f4b1d955 100644
+--- a/kernel/sched/fair.c
++++ b/kernel/sched/fair.c
+@@ -4098,6 +4098,10 @@ static inline void update_tg_load_avg(struct cfs_rq *cfs_rq)
+ if (cfs_rq->tg == &root_task_group)
+ return;
+
++ /* rq has been offline and doesn't contribute to the share anymore: */
++ if (!cpu_active(cpu_of(rq_of(cfs_rq))))
++ return;
++
+ /*
+ * For migration heavy workloads, access to tg->load_avg can be
+ * unbound. Limit the update rate to at most once per ms.
+@@ -4114,6 +4118,49 @@ static inline void update_tg_load_avg(struct cfs_rq *cfs_rq)
+ }
+ }
+
++static inline void clear_tg_load_avg(struct cfs_rq *cfs_rq)
++{
++ long delta;
++ u64 now;
++
++ /*
++ * No need to update load_avg for root_task_group, as it is not used.
++ */
++ if (cfs_rq->tg == &root_task_group)
++ return;
++
++ now = sched_clock_cpu(cpu_of(rq_of(cfs_rq)));
++ delta = 0 - cfs_rq->tg_load_avg_contrib;
++ atomic_long_add(delta, &cfs_rq->tg->load_avg);
++ cfs_rq->tg_load_avg_contrib = 0;
++ cfs_rq->last_update_tg_load_avg = now;
++}
++
++/* CPU offline callback: */
++static void __maybe_unused clear_tg_offline_cfs_rqs(struct rq *rq)
++{
++ struct task_group *tg;
++
++ lockdep_assert_rq_held(rq);
++
++ /*
++ * The rq clock has already been updated in
++ * set_rq_offline(), so we should skip updating
++ * the rq clock again in unthrottle_cfs_rq().
++ */
++ rq_clock_start_loop_update(rq);
++
++ rcu_read_lock();
++ list_for_each_entry_rcu(tg, &task_groups, list) {
++ struct cfs_rq *cfs_rq = tg->cfs_rq[cpu_of(rq)];
++
++ clear_tg_load_avg(cfs_rq);
++ }
++ rcu_read_unlock();
++
++ rq_clock_stop_loop_update(rq);
++}
++
+ /*
+ * Called within set_task_rq() right before setting a task's CPU. The
+ * caller only guarantees p->pi_lock is held; no other assumptions,
+@@ -4410,6 +4457,8 @@ static inline bool skip_blocked_update(struct sched_entity *se)
+
+ static inline void update_tg_load_avg(struct cfs_rq *cfs_rq) {}
+
++static inline void clear_tg_offline_cfs_rqs(struct rq *rq) {}
++
+ static inline int propagate_entity_load_avg(struct sched_entity *se)
+ {
+ return 0;
+@@ -12415,6 +12464,9 @@ static void rq_offline_fair(struct rq *rq)
+
+ /* Ensure any throttled groups are reachable by pick_next_task */
+ unthrottle_offline_cfs_rqs(rq);
++
++ /* Ensure that we remove rq contribution to group share: */
++ clear_tg_offline_cfs_rqs(rq);
+ }
+
+ #endif /* CONFIG_SMP */
+--
+2.43.0
+
--- /dev/null
+From 14789201635329de7e11f84218ffbf2d48579c99 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 20 Oct 2023 21:27:46 +0530
+Subject: sched/numa: Fix mm numa_scan_seq based unconditional scan
+
+From: Raghavendra K T <raghavendra.kt@amd.com>
+
+[ Upstream commit 84db47ca7146d7bd00eb5cf2b93989a971c84650 ]
+
+Since commit fc137c0ddab2 ("sched/numa: enhance vma scanning logic")
+
+NUMA Balancing allows updating PTEs to trap NUMA hinting faults if the
+task had previously accessed VMA. However unconditional scan of VMAs are
+allowed during initial phase of VMA creation until process's
+mm numa_scan_seq reaches 2 even though current task had not accessed VMA.
+
+Rationale:
+ - Without initial scan subsequent PTE update may never happen.
+ - Give fair opportunity to all the VMAs to be scanned and subsequently
+understand the access pattern of all the VMAs.
+
+But it has a corner case where, if a VMA is created after some time,
+process's mm numa_scan_seq could be already greater than 2.
+
+For e.g., values of mm numa_scan_seq when VMAs are created by running
+mmtest autonuma benchmark briefly looks like:
+start_seq=0 : 459
+start_seq=2 : 138
+start_seq=3 : 144
+start_seq=4 : 8
+start_seq=8 : 1
+start_seq=9 : 1
+This results in no unconditional PTE updates for those VMAs created after
+some time.
+
+Fix:
+ - Note down the initial value of mm numa_scan_seq in per VMA start_seq.
+ - Allow unconditional scan till start_seq + 2.
+
+Result:
+SUT: AMD EPYC Milan with 2 NUMA nodes 256 cpus.
+base kernel: upstream 6.6-rc6 with Mels patches [1] applied.
+
+kernbench
+========== base patched %gain
+Amean elsp-128 165.09 ( 0.00%) 164.78 * 0.19%*
+
+Duration User 41404.28 41375.08
+Duration System 9862.22 9768.48
+Duration Elapsed 519.87 518.72
+
+Ops NUMA PTE updates 1041416.00 831536.00
+Ops NUMA hint faults 263296.00 220966.00
+Ops NUMA pages migrated 258021.00 212769.00
+Ops AutoNUMA cost 1328.67 1114.69
+
+autonumabench
+
+NUMA01_THREADLOCAL
+==================
+Amean elsp-NUMA01_THREADLOCAL 81.79 (0.00%) 67.74 * 17.18%*
+
+Duration User 54832.73 47379.67
+Duration System 75.00 185.75
+Duration Elapsed 576.72 476.09
+
+Ops NUMA PTE updates 394429.00 11121044.00
+Ops NUMA hint faults 1001.00 8906404.00
+Ops NUMA pages migrated 288.00 2998694.00
+Ops AutoNUMA cost 7.77 44666.84
+
+Signed-off-by: Raghavendra K T <raghavendra.kt@amd.com>
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Acked-by: Mel Gorman <mgorman@suse.de>
+Link: https://lore.kernel.org/r/2ea7cbce80ac7c62e90cbfb9653a7972f902439f.1697816692.git.raghavendra.kt@amd.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/linux/mm_types.h | 3 +++
+ kernel/sched/fair.c | 4 +++-
+ 2 files changed, 6 insertions(+), 1 deletion(-)
+
+diff --git a/include/linux/mm_types.h b/include/linux/mm_types.h
+index 957ce38768b2..950df415d7de 100644
+--- a/include/linux/mm_types.h
++++ b/include/linux/mm_types.h
+@@ -600,6 +600,9 @@ struct vma_numab_state {
+ */
+ unsigned long pids_active[2];
+
++ /* MM scan sequence ID when scan first started after VMA creation */
++ int start_scan_seq;
++
+ /*
+ * MM scan sequence ID when the VMA was last completely scanned.
+ * A VMA is not eligible for scanning if prev_scan_seq == numa_scan_seq
+diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
+index 4182fb118ce9..3070c6f7168e 100644
+--- a/kernel/sched/fair.c
++++ b/kernel/sched/fair.c
+@@ -3164,7 +3164,7 @@ static bool vma_is_accessed(struct mm_struct *mm, struct vm_area_struct *vma)
+ * This is also done to avoid any side effect of task scanning
+ * amplifying the unfairness of disjoint set of VMAs' access.
+ */
+- if (READ_ONCE(current->mm->numa_scan_seq) < 2)
++ if ((READ_ONCE(current->mm->numa_scan_seq) - vma->numab_state->start_scan_seq) < 2)
+ return true;
+
+ pids = vma->numab_state->pids_active[0] | vma->numab_state->pids_active[1];
+@@ -3307,6 +3307,8 @@ static void task_numa_work(struct callback_head *work)
+ if (!vma->numab_state)
+ continue;
+
++ vma->numab_state->start_scan_seq = mm->numa_scan_seq;
++
+ vma->numab_state->next_scan = now +
+ msecs_to_jiffies(sysctl_numa_balancing_scan_delay);
+
+--
+2.43.0
+
--- /dev/null
+From fc69814198f7433f4dadf0ad7d29847df19a1fe7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 11:48:49 +0100
+Subject: sched/topology: Add a new arch_scale_freq_ref() method
+
+From: Vincent Guittot <vincent.guittot@linaro.org>
+
+[ Upstream commit 9942cb22ea458c34fa17b73d143ea32d4df1caca ]
+
+Create a new method to get a unique and fixed max frequency. Currently
+cpuinfo.max_freq or the highest (or last) state of performance domain are
+used as the max frequency when computing the frequency for a level of
+utilization, but:
+
+ - cpuinfo_max_freq can change at runtime. boost is one example of
+ such change.
+
+ - cpuinfo.max_freq and last item of the PD can be different leading to
+ different results between cpufreq and energy model.
+
+We need to save the reference frequency that has been used when computing
+the CPUs capacity and use this fixed and coherent value to convert between
+frequency and CPU's capacity.
+
+In fact, we already save the frequency that has been used when computing
+the capacity of each CPU. We extend the precision to save kHz instead of
+MHz currently and we modify the type to be aligned with other variables
+used when converting frequency to capacity and the other way.
+
+[ mingo: Minor edits. ]
+
+Signed-off-by: Vincent Guittot <vincent.guittot@linaro.org>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Tested-by: Lukasz Luba <lukasz.luba@arm.com>
+Reviewed-by: Lukasz Luba <lukasz.luba@arm.com>
+Acked-by: Sudeep Holla <sudeep.holla@arm.com>
+Link: https://lore.kernel.org/r/20231211104855.558096-2-vincent.guittot@linaro.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/include/asm/topology.h | 1 +
+ arch/arm64/include/asm/topology.h | 1 +
+ arch/riscv/include/asm/topology.h | 1 +
+ drivers/base/arch_topology.c | 29 ++++++++++++++---------------
+ include/linux/arch_topology.h | 7 +++++++
+ include/linux/sched/topology.h | 8 ++++++++
+ 6 files changed, 32 insertions(+), 15 deletions(-)
+
+diff --git a/arch/arm/include/asm/topology.h b/arch/arm/include/asm/topology.h
+index c7d2510e5a78..853c4f81ba4a 100644
+--- a/arch/arm/include/asm/topology.h
++++ b/arch/arm/include/asm/topology.h
+@@ -13,6 +13,7 @@
+ #define arch_set_freq_scale topology_set_freq_scale
+ #define arch_scale_freq_capacity topology_get_freq_scale
+ #define arch_scale_freq_invariant topology_scale_freq_invariant
++#define arch_scale_freq_ref topology_get_freq_ref
+ #endif
+
+ /* Replace task scheduler's default cpu-invariant accounting */
+diff --git a/arch/arm64/include/asm/topology.h b/arch/arm64/include/asm/topology.h
+index 9fab663dd2de..a323b109b9c4 100644
+--- a/arch/arm64/include/asm/topology.h
++++ b/arch/arm64/include/asm/topology.h
+@@ -23,6 +23,7 @@ void update_freq_counters_refs(void);
+ #define arch_set_freq_scale topology_set_freq_scale
+ #define arch_scale_freq_capacity topology_get_freq_scale
+ #define arch_scale_freq_invariant topology_scale_freq_invariant
++#define arch_scale_freq_ref topology_get_freq_ref
+
+ #ifdef CONFIG_ACPI_CPPC_LIB
+ #define arch_init_invariance_cppc topology_init_cpu_capacity_cppc
+diff --git a/arch/riscv/include/asm/topology.h b/arch/riscv/include/asm/topology.h
+index e316ab3b77f3..61183688bdd5 100644
+--- a/arch/riscv/include/asm/topology.h
++++ b/arch/riscv/include/asm/topology.h
+@@ -9,6 +9,7 @@
+ #define arch_set_freq_scale topology_set_freq_scale
+ #define arch_scale_freq_capacity topology_get_freq_scale
+ #define arch_scale_freq_invariant topology_scale_freq_invariant
++#define arch_scale_freq_ref topology_get_freq_ref
+
+ /* Replace task scheduler's default cpu-invariant accounting */
+ #define arch_scale_cpu_capacity topology_get_cpu_scale
+diff --git a/drivers/base/arch_topology.c b/drivers/base/arch_topology.c
+index b741b5ba82bd..0c9ae5b157b1 100644
+--- a/drivers/base/arch_topology.c
++++ b/drivers/base/arch_topology.c
+@@ -19,6 +19,7 @@
+ #include <linux/init.h>
+ #include <linux/rcupdate.h>
+ #include <linux/sched.h>
++#include <linux/units.h>
+
+ #define CREATE_TRACE_POINTS
+ #include <trace/events/thermal_pressure.h>
+@@ -26,7 +27,8 @@
+ static DEFINE_PER_CPU(struct scale_freq_data __rcu *, sft_data);
+ static struct cpumask scale_freq_counters_mask;
+ static bool scale_freq_invariant;
+-static DEFINE_PER_CPU(u32, freq_factor) = 1;
++DEFINE_PER_CPU(unsigned long, capacity_freq_ref) = 1;
++EXPORT_PER_CPU_SYMBOL_GPL(capacity_freq_ref);
+
+ static bool supports_scale_freq_counters(const struct cpumask *cpus)
+ {
+@@ -170,9 +172,9 @@ DEFINE_PER_CPU(unsigned long, thermal_pressure);
+ * operating on stale data when hot-plug is used for some CPUs. The
+ * @capped_freq reflects the currently allowed max CPUs frequency due to
+ * thermal capping. It might be also a boost frequency value, which is bigger
+- * than the internal 'freq_factor' max frequency. In such case the pressure
+- * value should simply be removed, since this is an indication that there is
+- * no thermal throttling. The @capped_freq must be provided in kHz.
++ * than the internal 'capacity_freq_ref' max frequency. In such case the
++ * pressure value should simply be removed, since this is an indication that
++ * there is no thermal throttling. The @capped_freq must be provided in kHz.
+ */
+ void topology_update_thermal_pressure(const struct cpumask *cpus,
+ unsigned long capped_freq)
+@@ -183,10 +185,7 @@ void topology_update_thermal_pressure(const struct cpumask *cpus,
+
+ cpu = cpumask_first(cpus);
+ max_capacity = arch_scale_cpu_capacity(cpu);
+- max_freq = per_cpu(freq_factor, cpu);
+-
+- /* Convert to MHz scale which is used in 'freq_factor' */
+- capped_freq /= 1000;
++ max_freq = arch_scale_freq_ref(cpu);
+
+ /*
+ * Handle properly the boost frequencies, which should simply clean
+@@ -279,13 +278,13 @@ void topology_normalize_cpu_scale(void)
+
+ capacity_scale = 1;
+ for_each_possible_cpu(cpu) {
+- capacity = raw_capacity[cpu] * per_cpu(freq_factor, cpu);
++ capacity = raw_capacity[cpu] * per_cpu(capacity_freq_ref, cpu);
+ capacity_scale = max(capacity, capacity_scale);
+ }
+
+ pr_debug("cpu_capacity: capacity_scale=%llu\n", capacity_scale);
+ for_each_possible_cpu(cpu) {
+- capacity = raw_capacity[cpu] * per_cpu(freq_factor, cpu);
++ capacity = raw_capacity[cpu] * per_cpu(capacity_freq_ref, cpu);
+ capacity = div64_u64(capacity << SCHED_CAPACITY_SHIFT,
+ capacity_scale);
+ topology_set_cpu_scale(cpu, capacity);
+@@ -321,15 +320,15 @@ bool __init topology_parse_cpu_capacity(struct device_node *cpu_node, int cpu)
+ cpu_node, raw_capacity[cpu]);
+
+ /*
+- * Update freq_factor for calculating early boot cpu capacities.
++ * Update capacity_freq_ref for calculating early boot CPU capacities.
+ * For non-clk CPU DVFS mechanism, there's no way to get the
+ * frequency value now, assuming they are running at the same
+- * frequency (by keeping the initial freq_factor value).
++ * frequency (by keeping the initial capacity_freq_ref value).
+ */
+ cpu_clk = of_clk_get(cpu_node, 0);
+ if (!PTR_ERR_OR_ZERO(cpu_clk)) {
+- per_cpu(freq_factor, cpu) =
+- clk_get_rate(cpu_clk) / 1000;
++ per_cpu(capacity_freq_ref, cpu) =
++ clk_get_rate(cpu_clk) / HZ_PER_KHZ;
+ clk_put(cpu_clk);
+ }
+ } else {
+@@ -411,7 +410,7 @@ init_cpu_capacity_callback(struct notifier_block *nb,
+ cpumask_andnot(cpus_to_visit, cpus_to_visit, policy->related_cpus);
+
+ for_each_cpu(cpu, policy->related_cpus)
+- per_cpu(freq_factor, cpu) = policy->cpuinfo.max_freq / 1000;
++ per_cpu(capacity_freq_ref, cpu) = policy->cpuinfo.max_freq;
+
+ if (cpumask_empty(cpus_to_visit)) {
+ topology_normalize_cpu_scale();
+diff --git a/include/linux/arch_topology.h b/include/linux/arch_topology.h
+index a07b510e7dc5..32c24ff4f2a8 100644
+--- a/include/linux/arch_topology.h
++++ b/include/linux/arch_topology.h
+@@ -27,6 +27,13 @@ static inline unsigned long topology_get_cpu_scale(int cpu)
+
+ void topology_set_cpu_scale(unsigned int cpu, unsigned long capacity);
+
++DECLARE_PER_CPU(unsigned long, capacity_freq_ref);
++
++static inline unsigned long topology_get_freq_ref(int cpu)
++{
++ return per_cpu(capacity_freq_ref, cpu);
++}
++
+ DECLARE_PER_CPU(unsigned long, arch_freq_scale);
+
+ static inline unsigned long topology_get_freq_scale(int cpu)
+diff --git a/include/linux/sched/topology.h b/include/linux/sched/topology.h
+index de545ba85218..a6e04b4a21d7 100644
+--- a/include/linux/sched/topology.h
++++ b/include/linux/sched/topology.h
+@@ -279,6 +279,14 @@ void arch_update_thermal_pressure(const struct cpumask *cpus,
+ { }
+ #endif
+
++#ifndef arch_scale_freq_ref
++static __always_inline
++unsigned int arch_scale_freq_ref(int cpu)
++{
++ return 0;
++}
++#endif
++
+ static inline int task_node(const struct task_struct *p)
+ {
+ return cpu_to_node(task_cpu(p));
+--
+2.43.0
+
--- /dev/null
+From 5cc8d3ba8497bd2afb544dd39afb9c2983932a00 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 2 Oct 2023 17:50:27 +0800
+Subject: scsi: arcmsr: Support new PCI device IDs 1883 and 1886
+
+From: ching Huang <ching2048@areca.com.tw>
+
+[ Upstream commit 41c8a1a1e90fa4721f856bf3cf71211fd16d6434 ]
+
+Add support for Areca RAID controllers with PCI device IDs 1883 and 1886.
+
+Signed-off-by: ching Huang <ching2048@areca.com.tw>
+Link: https://lore.kernel.org/r/7732e743eaad57681b1552eec9c6a86c76dbe459.camel@areca.com.tw
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/arcmsr/arcmsr.h | 4 ++++
+ drivers/scsi/arcmsr/arcmsr_hba.c | 6 ++++++
+ 2 files changed, 10 insertions(+)
+
+diff --git a/drivers/scsi/arcmsr/arcmsr.h b/drivers/scsi/arcmsr/arcmsr.h
+index ed8d9319862a..3819d559ebbb 100644
+--- a/drivers/scsi/arcmsr/arcmsr.h
++++ b/drivers/scsi/arcmsr/arcmsr.h
+@@ -78,9 +78,13 @@ struct device_attribute;
+ #ifndef PCI_DEVICE_ID_ARECA_1203
+ #define PCI_DEVICE_ID_ARECA_1203 0x1203
+ #endif
++#ifndef PCI_DEVICE_ID_ARECA_1883
++#define PCI_DEVICE_ID_ARECA_1883 0x1883
++#endif
+ #ifndef PCI_DEVICE_ID_ARECA_1884
+ #define PCI_DEVICE_ID_ARECA_1884 0x1884
+ #endif
++#define PCI_DEVICE_ID_ARECA_1886_0 0x1886
+ #define PCI_DEVICE_ID_ARECA_1886 0x188A
+ #define ARCMSR_HOURS (1000 * 60 * 60 * 4)
+ #define ARCMSR_MINUTES (1000 * 60 * 60)
+diff --git a/drivers/scsi/arcmsr/arcmsr_hba.c b/drivers/scsi/arcmsr/arcmsr_hba.c
+index a66221c3b72f..01fb1396e1a9 100644
+--- a/drivers/scsi/arcmsr/arcmsr_hba.c
++++ b/drivers/scsi/arcmsr/arcmsr_hba.c
+@@ -214,8 +214,12 @@ static struct pci_device_id arcmsr_device_id_table[] = {
+ .driver_data = ACB_ADAPTER_TYPE_A},
+ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1880),
+ .driver_data = ACB_ADAPTER_TYPE_C},
++ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1883),
++ .driver_data = ACB_ADAPTER_TYPE_C},
+ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1884),
+ .driver_data = ACB_ADAPTER_TYPE_E},
++ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1886_0),
++ .driver_data = ACB_ADAPTER_TYPE_F},
+ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1886),
+ .driver_data = ACB_ADAPTER_TYPE_F},
+ {0, 0}, /* Terminating entry */
+@@ -4706,9 +4710,11 @@ static const char *arcmsr_info(struct Scsi_Host *host)
+ case PCI_DEVICE_ID_ARECA_1680:
+ case PCI_DEVICE_ID_ARECA_1681:
+ case PCI_DEVICE_ID_ARECA_1880:
++ case PCI_DEVICE_ID_ARECA_1883:
+ case PCI_DEVICE_ID_ARECA_1884:
+ type = "SAS/SATA";
+ break;
++ case PCI_DEVICE_ID_ARECA_1886_0:
+ case PCI_DEVICE_ID_ARECA_1886:
+ type = "NVMe/SAS/SATA";
+ break;
+--
+2.43.0
+
--- /dev/null
+From 9d127b60acfdc83233d1b4dbe8889ec19841e45c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 14 Dec 2023 11:45:12 +0800
+Subject: scsi: hisi_sas: Set .phy_attached before notifing phyup event
+ HISI_PHYE_PHY_UP_PM
+
+From: Yihang Li <liyihang9@huawei.com>
+
+[ Upstream commit ce26497c745d0541aec930d5211b431a1c26af97 ]
+
+Currently in directly attached scenario, the phyup event
+HISI_PHYE_PHY_UP_PM is notified before .phy_attached is set - this may
+cause the phyup work hisi_sas_bytes_dmaed() execution failed and the
+attached device will not be found.
+
+To fix it, set .phy_attached before notifing phyup event.
+
+Signed-off-by: Yihang Li <liyihang9@huawei.com>
+Signed-off-by: Xiang Chen <chenxiang66@hisilicon.com>
+Link: https://lore.kernel.org/r/1702525516-51258-2-git-send-email-chenxiang66@hisilicon.com
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/hisi_sas/hisi_sas_v3_hw.c | 10 +++++-----
+ 1 file changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/scsi/hisi_sas/hisi_sas_v3_hw.c b/drivers/scsi/hisi_sas/hisi_sas_v3_hw.c
+index 6d8577423d32..b56fbc61a15a 100644
+--- a/drivers/scsi/hisi_sas/hisi_sas_v3_hw.c
++++ b/drivers/scsi/hisi_sas/hisi_sas_v3_hw.c
+@@ -1605,6 +1605,11 @@ static irqreturn_t phy_up_v3_hw(int phy_no, struct hisi_hba *hisi_hba)
+ }
+
+ phy->port_id = port_id;
++ spin_lock(&phy->lock);
++ /* Delete timer and set phy_attached atomically */
++ del_timer(&phy->timer);
++ phy->phy_attached = 1;
++ spin_unlock(&phy->lock);
+
+ /*
+ * Call pm_runtime_get_noresume() which pairs with
+@@ -1618,11 +1623,6 @@ static irqreturn_t phy_up_v3_hw(int phy_no, struct hisi_hba *hisi_hba)
+
+ res = IRQ_HANDLED;
+
+- spin_lock(&phy->lock);
+- /* Delete timer and set phy_attached atomically */
+- del_timer(&phy->timer);
+- phy->phy_attached = 1;
+- spin_unlock(&phy->lock);
+ end:
+ if (phy->reset_completion)
+ complete(phy->reset_completion);
+--
+2.43.0
+
--- /dev/null
+From 354f2ee46f74f48a1dbdd074b55172a869c85f5b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 17:58:30 +0100
+Subject: scsi: libfc: Don't schedule abort twice
+
+From: Hannes Reinecke <hare@suse.de>
+
+[ Upstream commit b57c4db5d23b9df0118a25e2441c9288edd73710 ]
+
+The current FC error recovery is sending up to three REC (recovery) frames
+in 10 second intervals, and as a final step sending an ABTS after 30
+seconds for the command itself. Unfortunately sending an ABTS is also the
+action for the SCSI abort handler, and the default timeout for SCSI
+commands is also 30 seconds. This causes two ABTS to be scheduled, with the
+libfc one slightly earlier. The ABTS scheduled by SCSI EH then sees the
+command to be already aborted, and will always return with a 'GOOD' status
+irrespective on the actual result from the first ABTS. This causes the
+SCSI EH abort handler to always succeed, and SCSI EH never to be engaged.
+Fix this by not issuing an ABTS when a SCSI command is present for the
+exchange, but rather wait for the abort scheduled from SCSI EH. And warn
+if an abort is already scheduled to avoid similar errors in the future.
+
+Signed-off-by: Hannes Reinecke <hare@suse.de>
+Link: https://lore.kernel.org/r/20231129165832.224100-2-hare@kernel.org
+Reviewed-by: Christoph Hellwig <hch@lst.de>
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/libfc/fc_fcp.c | 16 +++++++++++-----
+ 1 file changed, 11 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/scsi/libfc/fc_fcp.c b/drivers/scsi/libfc/fc_fcp.c
+index 945adca5e72f..3f189cedf6db 100644
+--- a/drivers/scsi/libfc/fc_fcp.c
++++ b/drivers/scsi/libfc/fc_fcp.c
+@@ -265,6 +265,11 @@ static int fc_fcp_send_abort(struct fc_fcp_pkt *fsp)
+ if (!fsp->seq_ptr)
+ return -EINVAL;
+
++ if (fsp->state & FC_SRB_ABORT_PENDING) {
++ FC_FCP_DBG(fsp, "abort already pending\n");
++ return -EBUSY;
++ }
++
+ this_cpu_inc(fsp->lp->stats->FcpPktAborts);
+
+ fsp->state |= FC_SRB_ABORT_PENDING;
+@@ -1690,11 +1695,12 @@ static void fc_fcp_recovery(struct fc_fcp_pkt *fsp, u8 code)
+ fsp->status_code = code;
+ fsp->cdb_status = 0;
+ fsp->io_status = 0;
+- /*
+- * if this fails then we let the scsi command timer fire and
+- * scsi-ml escalate.
+- */
+- fc_fcp_send_abort(fsp);
++ if (!fsp->cmd)
++ /*
++ * Only abort non-scsi commands; otherwise let the
++ * scsi command timer fire and scsi-ml escalate.
++ */
++ fc_fcp_send_abort(fsp);
+ }
+
+ /**
+--
+2.43.0
+
--- /dev/null
+From 2ce1a123b3c1f7d7885fcb3f1448e61a8e63b55c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 17:58:31 +0100
+Subject: scsi: libfc: Fix up timeout error in fc_fcp_rec_error()
+
+From: Hannes Reinecke <hare@suse.de>
+
+[ Upstream commit 53122a49f49796beb2c4a1bb702303b66347e29f ]
+
+We should set the status to FC_TIMED_OUT when a timeout error is passed to
+fc_fcp_rec_error().
+
+Signed-off-by: Hannes Reinecke <hare@suse.de>
+Link: https://lore.kernel.org/r/20231129165832.224100-3-hare@kernel.org
+Reviewed-by: Christoph Hellwig <hch@lst.de>
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/libfc/fc_fcp.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/scsi/libfc/fc_fcp.c b/drivers/scsi/libfc/fc_fcp.c
+index 3f189cedf6db..05be0810b5e3 100644
+--- a/drivers/scsi/libfc/fc_fcp.c
++++ b/drivers/scsi/libfc/fc_fcp.c
+@@ -1676,7 +1676,7 @@ static void fc_fcp_rec_error(struct fc_fcp_pkt *fsp, struct fc_frame *fp)
+ if (fsp->recov_retry++ < FC_MAX_RECOV_RETRY)
+ fc_fcp_rec(fsp);
+ else
+- fc_fcp_recovery(fsp, FC_ERROR);
++ fc_fcp_recovery(fsp, FC_TIMED_OUT);
+ break;
+ }
+ fc_fcp_unlock_pkt(fsp);
+--
+2.43.0
+
--- /dev/null
+From 67e57c8178e254f0bf9befea64550393368a75a7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 31 Oct 2023 12:12:17 -0700
+Subject: scsi: lpfc: Fix possible file string name overflow when updating
+ firmware
+
+From: Justin Tee <justin.tee@broadcom.com>
+
+[ Upstream commit f5779b529240b715f0e358489ad0ed933bf77c97 ]
+
+Because file_name and phba->ModelName are both declared a size 80 bytes,
+the extra ".grp" file extension could cause an overflow into file_name.
+
+Define a ELX_FW_NAME_SIZE macro with value 84. 84 incorporates the 4 extra
+characters from ".grp". file_name is changed to be declared as a char and
+initialized to zeros i.e. null chars.
+
+Signed-off-by: Justin Tee <justin.tee@broadcom.com>
+Link: https://lore.kernel.org/r/20231031191224.150862-3-justintee8345@gmail.com
+Reviewed-by: Himanshu Madhani <himanshu.madhani@oracle.com>
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/lpfc/lpfc.h | 1 +
+ drivers/scsi/lpfc/lpfc_init.c | 4 ++--
+ 2 files changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/scsi/lpfc/lpfc.h b/drivers/scsi/lpfc/lpfc.h
+index af15f7a22d25..04d608ea9106 100644
+--- a/drivers/scsi/lpfc/lpfc.h
++++ b/drivers/scsi/lpfc/lpfc.h
+@@ -33,6 +33,7 @@
+ struct lpfc_sli2_slim;
+
+ #define ELX_MODEL_NAME_SIZE 80
++#define ELX_FW_NAME_SIZE 84
+
+ #define LPFC_PCI_DEV_LP 0x1
+ #define LPFC_PCI_DEV_OC 0x2
+diff --git a/drivers/scsi/lpfc/lpfc_init.c b/drivers/scsi/lpfc/lpfc_init.c
+index e7c47ee185a4..70bcee64bc8c 100644
+--- a/drivers/scsi/lpfc/lpfc_init.c
++++ b/drivers/scsi/lpfc/lpfc_init.c
+@@ -14721,7 +14721,7 @@ lpfc_write_firmware(const struct firmware *fw, void *context)
+ int
+ lpfc_sli4_request_firmware_update(struct lpfc_hba *phba, uint8_t fw_upgrade)
+ {
+- uint8_t file_name[ELX_MODEL_NAME_SIZE];
++ char file_name[ELX_FW_NAME_SIZE] = {0};
+ int ret;
+ const struct firmware *fw;
+
+@@ -14730,7 +14730,7 @@ lpfc_sli4_request_firmware_update(struct lpfc_hba *phba, uint8_t fw_upgrade)
+ LPFC_SLI_INTF_IF_TYPE_2)
+ return -EPERM;
+
+- snprintf(file_name, ELX_MODEL_NAME_SIZE, "%s.grp", phba->ModelName);
++ scnprintf(file_name, sizeof(file_name), "%s.grp", phba->ModelName);
+
+ if (fw_upgrade == INT_FW_UPGRADE) {
+ ret = request_firmware_nowait(THIS_MODULE, FW_ACTION_UEVENT,
+--
+2.43.0
+
--- /dev/null
+From 16575564b1349804c65cc3a643a9abfca0139f4c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 14:40:38 -0800
+Subject: scsi: lpfc: Move determination of vmid_flag after VMID
+ reinitialization completes
+
+From: Justin Tee <justin.tee@broadcom.com>
+
+[ Upstream commit aba0fb0ef607a71511d23a07406f11130c1a54c5 ]
+
+If priority tagging is set in the service parameters of a FLOGI cmpl, then
+we update the vmid_flag. In the current logic, if a follow up FLOGI cmpl
+updates its service parameters such that priority tagging is no longer set,
+then the vmid_flag ends up keeping stale data.
+
+Fix by ensuring we clear the vmid_flag member during lpfc_reinit_vmid, and
+check the priority tagging service parameter after reinitialization of the
+vmid data structures.
+
+Signed-off-by: Justin Tee <justin.tee@broadcom.com>
+Link: https://lore.kernel.org/r/20231207224039.35466-4-justintee8345@gmail.com
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/lpfc/lpfc_els.c | 6 +++---
+ drivers/scsi/lpfc/lpfc_vmid.c | 1 +
+ 2 files changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/scsi/lpfc/lpfc_els.c b/drivers/scsi/lpfc/lpfc_els.c
+index 7e9b93460e64..385e1636f139 100644
+--- a/drivers/scsi/lpfc/lpfc_els.c
++++ b/drivers/scsi/lpfc/lpfc_els.c
+@@ -1130,12 +1130,12 @@ lpfc_cmpl_els_flogi(struct lpfc_hba *phba, struct lpfc_iocbq *cmdiocb,
+ vport->port_state, vport->fc_flag,
+ sp->cmn.priority_tagging, kref_read(&ndlp->kref));
+
+- if (sp->cmn.priority_tagging)
+- vport->phba->pport->vmid_flag |= (LPFC_VMID_ISSUE_QFPA |
+- LPFC_VMID_TYPE_PRIO);
+ /* reinitialize the VMID datastructure before returning */
+ if (lpfc_is_vmid_enabled(phba))
+ lpfc_reinit_vmid(vport);
++ if (sp->cmn.priority_tagging)
++ vport->phba->pport->vmid_flag |= (LPFC_VMID_ISSUE_QFPA |
++ LPFC_VMID_TYPE_PRIO);
+
+ /*
+ * Address a timing race with dev_loss. If dev_loss is active on
+diff --git a/drivers/scsi/lpfc/lpfc_vmid.c b/drivers/scsi/lpfc/lpfc_vmid.c
+index cf8ba840d0ea..773e02ae20c3 100644
+--- a/drivers/scsi/lpfc/lpfc_vmid.c
++++ b/drivers/scsi/lpfc/lpfc_vmid.c
+@@ -321,5 +321,6 @@ lpfc_reinit_vmid(struct lpfc_vport *vport)
+ if (!hash_empty(vport->hash_table))
+ hash_for_each_safe(vport->hash_table, bucket, tmp, cur, hnode)
+ hash_del(&cur->hnode);
++ vport->vmid_flag = 0;
+ write_unlock(&vport->vmid_lock);
+ }
+--
+2.43.0
+
--- /dev/null
+From 9e2c5c7af52bfbe9f9dcee0ba617d4ae792c4a94 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 14:40:37 -0800
+Subject: scsi: lpfc: Reinitialize an NPIV's VMID data structures after FDISC
+
+From: Justin Tee <justin.tee@broadcom.com>
+
+[ Upstream commit 8dc8eb89f4df74593ba4bf30c3d31a0fc6d3ea47 ]
+
+After a follow up FDISC cmpl, an NPIV's VMID data structures are not
+updated.
+
+Fix by calling lpfc_reinit_vmid and copying the physical port's vmid_flag
+to the NPIV's vmid_flag in the NPIV registration cmpl code path.
+
+Signed-off-by: Justin Tee <justin.tee@broadcom.com>
+Link: https://lore.kernel.org/r/20231207224039.35466-3-justintee8345@gmail.com
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/lpfc/lpfc_els.c | 8 ++++++++
+ 1 file changed, 8 insertions(+)
+
+diff --git a/drivers/scsi/lpfc/lpfc_els.c b/drivers/scsi/lpfc/lpfc_els.c
+index 0829fe6ddff8..7e9b93460e64 100644
+--- a/drivers/scsi/lpfc/lpfc_els.c
++++ b/drivers/scsi/lpfc/lpfc_els.c
+@@ -11130,6 +11130,14 @@ lpfc_cmpl_reg_new_vport(struct lpfc_hba *phba, LPFC_MBOXQ_t *pmb)
+ lpfc_nlp_put(ndlp);
+
+ mempool_free(pmb, phba->mbox_mem_pool);
++
++ /* reinitialize the VMID datastructure before returning.
++ * this is specifically for vport
++ */
++ if (lpfc_is_vmid_enabled(phba))
++ lpfc_reinit_vmid(vport);
++ vport->vmid_flag = vport->phba->pport->vmid_flag;
++
+ return;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 872d974dd53b4de93cef017fa777072997528957 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 23 Nov 2023 21:31:29 +0530
+Subject: scsi: mpi3mr: Add PCI checks where SAS5116 diverges from SAS4116
+
+From: Sumit Saxena <sumit.saxena@broadcom.com>
+
+[ Upstream commit c9260ff28ee561fca5f96425c9328a9698e8427b ]
+
+Add PCI IDs checks for the cases where SAS5116 diverges from SAS4116 in
+behavior.
+
+Signed-off-by: Sumit Saxena <sumit.saxena@broadcom.com>
+Link: https://lore.kernel.org/r/20231123160132.4155-3-sumit.saxena@broadcom.com
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/mpi3mr/mpi3mr_fw.c | 3 ++-
+ drivers/scsi/mpi3mr/mpi3mr_os.c | 5 ++++-
+ 2 files changed, 6 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/scsi/mpi3mr/mpi3mr_fw.c b/drivers/scsi/mpi3mr/mpi3mr_fw.c
+index f039f1d98647..0d148c39ebcc 100644
+--- a/drivers/scsi/mpi3mr/mpi3mr_fw.c
++++ b/drivers/scsi/mpi3mr/mpi3mr_fw.c
+@@ -1892,7 +1892,8 @@ static int mpi3mr_create_op_reply_q(struct mpi3mr_ioc *mrioc, u16 qidx)
+
+ reply_qid = qidx + 1;
+ op_reply_q->num_replies = MPI3MR_OP_REP_Q_QD;
+- if (!mrioc->pdev->revision)
++ if ((mrioc->pdev->device == MPI3_MFGPAGE_DEVID_SAS4116) &&
++ !mrioc->pdev->revision)
+ op_reply_q->num_replies = MPI3MR_OP_REP_Q_QD4K;
+ op_reply_q->ci = 0;
+ op_reply_q->ephase = 1;
+diff --git a/drivers/scsi/mpi3mr/mpi3mr_os.c b/drivers/scsi/mpi3mr/mpi3mr_os.c
+index 94adb0b1afc9..872d4b809d08 100644
+--- a/drivers/scsi/mpi3mr/mpi3mr_os.c
++++ b/drivers/scsi/mpi3mr/mpi3mr_os.c
+@@ -5112,7 +5112,10 @@ mpi3mr_probe(struct pci_dev *pdev, const struct pci_device_id *id)
+ mpi3mr_init_drv_cmd(&mrioc->evtack_cmds[i],
+ MPI3MR_HOSTTAG_EVTACKCMD_MIN + i);
+
+- if (pdev->revision)
++ if ((pdev->device == MPI3_MFGPAGE_DEVID_SAS4116) &&
++ !pdev->revision)
++ mrioc->enable_segqueue = false;
++ else
+ mrioc->enable_segqueue = true;
+
+ init_waitqueue_head(&mrioc->reset_waitq);
+--
+2.43.0
+
--- /dev/null
+From a8f39c9bd34d080ba886b10a66602f73d64d2ec0 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 23 Nov 2023 21:31:28 +0530
+Subject: scsi: mpi3mr: Add support for SAS5116 PCI IDs
+
+From: Sumit Saxena <sumit.saxena@broadcom.com>
+
+[ Upstream commit 6fa21eab82be57a3ad2470fac27b982793805336 ]
+
+Add support for Broadcom's SAS5116 IO/RAID controllers PCI IDs.
+
+Signed-off-by: Sumit Saxena <sumit.saxena@broadcom.com>
+Link: https://lore.kernel.org/r/20231123160132.4155-2-sumit.saxena@broadcom.com
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/mpi3mr/mpi3mr_os.c | 8 ++++++++
+ 1 file changed, 8 insertions(+)
+
+diff --git a/drivers/scsi/mpi3mr/mpi3mr_os.c b/drivers/scsi/mpi3mr/mpi3mr_os.c
+index e2f2c205df71..94adb0b1afc9 100644
+--- a/drivers/scsi/mpi3mr/mpi3mr_os.c
++++ b/drivers/scsi/mpi3mr/mpi3mr_os.c
+@@ -5441,6 +5441,14 @@ static const struct pci_device_id mpi3mr_pci_id_table[] = {
+ PCI_DEVICE_SUB(MPI3_MFGPAGE_VENDORID_BROADCOM,
+ MPI3_MFGPAGE_DEVID_SAS4116, PCI_ANY_ID, PCI_ANY_ID)
+ },
++ {
++ PCI_DEVICE_SUB(MPI3_MFGPAGE_VENDORID_BROADCOM,
++ MPI3_MFGPAGE_DEVID_SAS5116_MPI, PCI_ANY_ID, PCI_ANY_ID)
++ },
++ {
++ PCI_DEVICE_SUB(MPI3_MFGPAGE_VENDORID_BROADCOM,
++ MPI3_MFGPAGE_DEVID_SAS5116_MPI_MGMT, PCI_ANY_ID, PCI_ANY_ID)
++ },
+ { 0 }
+ };
+ MODULE_DEVICE_TABLE(pci, mpi3mr_pci_id_table);
+--
+2.43.0
+
--- /dev/null
+From e5d23d028bee0819d71b16ce8432edba604c3380 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 14:53:43 -0800
+Subject: selftests/bpf: fix compiler warnings in RELEASE=1 mode
+
+From: Andrii Nakryiko <andrii@kernel.org>
+
+[ Upstream commit 62d9a969f4a95219c757831e9ad66cd4dd9edee5 ]
+
+When compiling BPF selftests with RELEASE=1, we get two new
+warnings, which are treated as errors. Fix them.
+
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Acked-by: Yonghong Song <yonghong.song@linux.dev>
+Acked-by: John Fastabend <john.fastabend@gmail.com>
+Link: https://lore.kernel.org/r/20231212225343.1723081-1-andrii@kernel.org
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/veristat.c | 2 +-
+ tools/testing/selftests/bpf/xdp_hw_metadata.c | 2 +-
+ 2 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/tools/testing/selftests/bpf/veristat.c b/tools/testing/selftests/bpf/veristat.c
+index 655095810d4a..0ad98b6a8e6e 100644
+--- a/tools/testing/selftests/bpf/veristat.c
++++ b/tools/testing/selftests/bpf/veristat.c
+@@ -1214,7 +1214,7 @@ static int cmp_join_stat(const struct verif_stats_join *s1,
+ enum stat_id id, enum stat_variant var, bool asc)
+ {
+ const char *str1 = NULL, *str2 = NULL;
+- double v1, v2;
++ double v1 = 0.0, v2 = 0.0;
+ int cmp = 0;
+
+ fetch_join_stat_value(s1, id, var, &str1, &v1);
+diff --git a/tools/testing/selftests/bpf/xdp_hw_metadata.c b/tools/testing/selftests/bpf/xdp_hw_metadata.c
+index c3ba40d0b9de..c5e7937d7f63 100644
+--- a/tools/testing/selftests/bpf/xdp_hw_metadata.c
++++ b/tools/testing/selftests/bpf/xdp_hw_metadata.c
+@@ -70,7 +70,7 @@ static int open_xsk(int ifindex, struct xsk *xsk, __u32 queue_id)
+ .frame_size = XSK_UMEM__DEFAULT_FRAME_SIZE,
+ .flags = XDP_UMEM_UNALIGNED_CHUNK_FLAG,
+ };
+- __u32 idx;
++ __u32 idx = 0;
+ u64 addr;
+ int ret;
+ int i;
+--
+2.43.0
+
--- /dev/null
+From 508dc96f0897688e5b3f24ed3fea6750aaffef41 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 11 Nov 2023 09:00:30 +0000
+Subject: selftests/bpf: Fix issues in setup_classid_environment()
+
+From: Yafang Shao <laoar.shao@gmail.com>
+
+[ Upstream commit 4849775587844e44d215289c425bcd70f315efe7 ]
+
+If the net_cls subsystem is already mounted, attempting to mount it again
+in setup_classid_environment() will result in a failure with the error code
+EBUSY. Despite this, tmpfs will have been successfully mounted at
+/sys/fs/cgroup/net_cls. Consequently, the /sys/fs/cgroup/net_cls directory
+will be empty, causing subsequent setup operations to fail.
+
+Here's an error log excerpt illustrating the issue when net_cls has already
+been mounted at /sys/fs/cgroup/net_cls prior to running
+setup_classid_environment():
+
+- Before that change
+
+ $ tools/testing/selftests/bpf/test_progs --name=cgroup_v1v2
+ test_cgroup_v1v2:PASS:server_fd 0 nsec
+ test_cgroup_v1v2:PASS:client_fd 0 nsec
+ test_cgroup_v1v2:PASS:cgroup_fd 0 nsec
+ test_cgroup_v1v2:PASS:server_fd 0 nsec
+ run_test:PASS:skel_open 0 nsec
+ run_test:PASS:prog_attach 0 nsec
+ test_cgroup_v1v2:PASS:cgroup-v2-only 0 nsec
+ (cgroup_helpers.c:248: errno: No such file or directory) Opening Cgroup Procs: /sys/fs/cgroup/net_cls/cgroup.procs
+ (cgroup_helpers.c:540: errno: No such file or directory) Opening cgroup classid: /sys/fs/cgroup/net_cls/cgroup-test-work-dir/net_cls.classid
+ run_test:PASS:skel_open 0 nsec
+ run_test:PASS:prog_attach 0 nsec
+ (cgroup_helpers.c:248: errno: No such file or directory) Opening Cgroup Procs: /sys/fs/cgroup/net_cls/cgroup-test-work-dir/cgroup.procs
+ run_test:FAIL:join_classid unexpected error: 1 (errno 2)
+ test_cgroup_v1v2:FAIL:cgroup-v1v2 unexpected error: -1 (errno 2)
+ (cgroup_helpers.c:248: errno: No such file or directory) Opening Cgroup Procs: /sys/fs/cgroup/net_cls/cgroup.procs
+ #44 cgroup_v1v2:FAIL
+ Summary: 0/0 PASSED, 0 SKIPPED, 1 FAILED
+
+- After that change
+ $ tools/testing/selftests/bpf/test_progs --name=cgroup_v1v2
+ #44 cgroup_v1v2:OK
+ Summary: 1/0 PASSED, 0 SKIPPED, 0 FAILED
+
+Signed-off-by: Yafang Shao <laoar.shao@gmail.com>
+Link: https://lore.kernel.org/r/20231111090034.4248-3-laoar.shao@gmail.com
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/cgroup_helpers.c | 18 ++++++++++++++----
+ 1 file changed, 14 insertions(+), 4 deletions(-)
+
+diff --git a/tools/testing/selftests/bpf/cgroup_helpers.c b/tools/testing/selftests/bpf/cgroup_helpers.c
+index 5b1da2a32ea7..10b5f42e65e7 100644
+--- a/tools/testing/selftests/bpf/cgroup_helpers.c
++++ b/tools/testing/selftests/bpf/cgroup_helpers.c
+@@ -523,10 +523,20 @@ int setup_classid_environment(void)
+ return 1;
+ }
+
+- if (mount("net_cls", NETCLS_MOUNT_PATH, "cgroup", 0, "net_cls") &&
+- errno != EBUSY) {
+- log_err("mount cgroup net_cls");
+- return 1;
++ if (mount("net_cls", NETCLS_MOUNT_PATH, "cgroup", 0, "net_cls")) {
++ if (errno != EBUSY) {
++ log_err("mount cgroup net_cls");
++ return 1;
++ }
++
++ if (rmdir(NETCLS_MOUNT_PATH)) {
++ log_err("rmdir cgroup net_cls");
++ return 1;
++ }
++ if (umount(CGROUP_MOUNT_DFLT)) {
++ log_err("umount cgroup base");
++ return 1;
++ }
+ }
+
+ cleanup_classid_environment();
+--
+2.43.0
+
--- /dev/null
+From 160050e73f450ef98482637439a6ccf7508ec55d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 10 Nov 2023 11:36:44 -0800
+Subject: selftests/bpf: Fix pyperf180 compilation failure with clang18
+
+From: Yonghong Song <yonghong.song@linux.dev>
+
+[ Upstream commit 100888fb6d8a185866b1520031ee7e3182b173de ]
+
+With latest clang18 (main branch of llvm-project repo), when building bpf selftests,
+ [~/work/bpf-next (master)]$ make -C tools/testing/selftests/bpf LLVM=1 -j
+
+The following compilation error happens:
+ fatal error: error in backend: Branch target out of insn range
+ ...
+ Stack dump:
+ 0. Program arguments: clang -g -Wall -Werror -D__TARGET_ARCH_x86 -mlittle-endian
+ -I/home/yhs/work/bpf-next/tools/testing/selftests/bpf/tools/include
+ -I/home/yhs/work/bpf-next/tools/testing/selftests/bpf -I/home/yhs/work/bpf-next/tools/include/uapi
+ -I/home/yhs/work/bpf-next/tools/testing/selftests/usr/include -idirafter
+ /home/yhs/work/llvm-project/llvm/build.18/install/lib/clang/18/include -idirafter /usr/local/include
+ -idirafter /usr/include -Wno-compare-distinct-pointer-types -DENABLE_ATOMICS_TESTS -O2 --target=bpf
+ -c progs/pyperf180.c -mcpu=v3 -o /home/yhs/work/bpf-next/tools/testing/selftests/bpf/pyperf180.bpf.o
+ 1. <eof> parser at end of file
+ 2. Code generation
+ ...
+
+The compilation failure only happens to cpu=v2 and cpu=v3. cpu=v4 is okay
+since cpu=v4 supports 32-bit branch target offset.
+
+The above failure is due to upstream llvm patch [1] where some inlining behavior
+are changed in clang18.
+
+To workaround the issue, previously all 180 loop iterations are fully unrolled.
+The bpf macro __BPF_CPU_VERSION__ (implemented in clang18 recently) is used to avoid
+unrolling changes if cpu=v4. If __BPF_CPU_VERSION__ is not available and the
+compiler is clang18, the unrollng amount is unconditionally reduced.
+
+ [1] https://github.com/llvm/llvm-project/commit/1a2e77cf9e11dbf56b5720c607313a566eebb16e
+
+Signed-off-by: Yonghong Song <yonghong.song@linux.dev>
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Tested-by: Alan Maguire <alan.maguire@oracle.com>
+Link: https://lore.kernel.org/bpf/20231110193644.3130906-1-yonghong.song@linux.dev
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/progs/pyperf180.c | 22 +++++++++++++++++++
+ 1 file changed, 22 insertions(+)
+
+diff --git a/tools/testing/selftests/bpf/progs/pyperf180.c b/tools/testing/selftests/bpf/progs/pyperf180.c
+index c39f559d3100..42c4a8b62e36 100644
+--- a/tools/testing/selftests/bpf/progs/pyperf180.c
++++ b/tools/testing/selftests/bpf/progs/pyperf180.c
+@@ -1,4 +1,26 @@
+ // SPDX-License-Identifier: GPL-2.0
+ // Copyright (c) 2019 Facebook
+ #define STACK_MAX_LEN 180
++
++/* llvm upstream commit at clang18
++ * https://github.com/llvm/llvm-project/commit/1a2e77cf9e11dbf56b5720c607313a566eebb16e
++ * changed inlining behavior and caused compilation failure as some branch
++ * target distance exceeded 16bit representation which is the maximum for
++ * cpu v1/v2/v3. Macro __BPF_CPU_VERSION__ is later implemented in clang18
++ * to specify which cpu version is used for compilation. So a smaller
++ * unroll_count can be set if __BPF_CPU_VERSION__ is less than 4, which
++ * reduced some branch target distances and resolved the compilation failure.
++ *
++ * To capture the case where a developer/ci uses clang18 but the corresponding
++ * repo checkpoint does not have __BPF_CPU_VERSION__, a smaller unroll_count
++ * will be set as well to prevent potential compilation failures.
++ */
++#ifdef __BPF_CPU_VERSION__
++#if __BPF_CPU_VERSION__ < 4
++#define UNROLL_COUNT 90
++#endif
++#elif __clang_major__ == 18
++#define UNROLL_COUNT 90
++#endif
++
+ #include "pyperf.h"
+--
+2.43.0
+
--- /dev/null
+From d66a88b09d12c98cdfb168f8948582f1fc93df35 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 1 Nov 2023 20:37:43 -0700
+Subject: selftests/bpf: fix RELEASE=1 build for tc_opts
+
+From: Andrii Nakryiko <andrii@kernel.org>
+
+[ Upstream commit 2b62aa59d02ed281fa4fc218df3ca91b773e1e62 ]
+
+Compiler complains about malloc(). We also don't need to dynamically
+allocate anything, so make the life easier by using statically sized
+buffer.
+
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Link: https://lore.kernel.org/r/20231102033759.2541186-2-andrii@kernel.org
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/prog_tests/tc_opts.c | 6 +-----
+ 1 file changed, 1 insertion(+), 5 deletions(-)
+
+diff --git a/tools/testing/selftests/bpf/prog_tests/tc_opts.c b/tools/testing/selftests/bpf/prog_tests/tc_opts.c
+index 51883ccb8020..196abf223465 100644
+--- a/tools/testing/selftests/bpf/prog_tests/tc_opts.c
++++ b/tools/testing/selftests/bpf/prog_tests/tc_opts.c
+@@ -2387,12 +2387,9 @@ static int generate_dummy_prog(void)
+ const size_t prog_insn_cnt = sizeof(prog_insns) / sizeof(struct bpf_insn);
+ LIBBPF_OPTS(bpf_prog_load_opts, opts);
+ const size_t log_buf_sz = 256;
+- char *log_buf;
++ char log_buf[log_buf_sz];
+ int fd = -1;
+
+- log_buf = malloc(log_buf_sz);
+- if (!ASSERT_OK_PTR(log_buf, "log_buf_alloc"))
+- return fd;
+ opts.log_buf = log_buf;
+ opts.log_size = log_buf_sz;
+
+@@ -2402,7 +2399,6 @@ static int generate_dummy_prog(void)
+ prog_insns, prog_insn_cnt, &opts);
+ ASSERT_STREQ(log_buf, "", "log_0");
+ ASSERT_GE(fd, 0, "prog_fd");
+- free(log_buf);
+ return fd;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 774db9495ecc62bf5946e81abc86e1669337cbbd Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 1 Nov 2023 20:37:44 -0700
+Subject: selftests/bpf: satisfy compiler by having explicit return in btf test
+
+From: Andrii Nakryiko <andrii@kernel.org>
+
+[ Upstream commit f4c7e887324f5776eef6e6e47a90e0ac8058a7a8 ]
+
+Some compilers complain about get_pprint_mapv_size() not returning value
+in some code paths. Fix with explicit return.
+
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Link: https://lore.kernel.org/r/20231102033759.2541186-3-andrii@kernel.org
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/prog_tests/btf.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/tools/testing/selftests/bpf/prog_tests/btf.c b/tools/testing/selftests/bpf/prog_tests/btf.c
+index 92d51f377fe5..8fb4a04fbbc0 100644
+--- a/tools/testing/selftests/bpf/prog_tests/btf.c
++++ b/tools/testing/selftests/bpf/prog_tests/btf.c
+@@ -5265,6 +5265,7 @@ static size_t get_pprint_mapv_size(enum pprint_mapv_kind_t mapv_kind)
+ #endif
+
+ assert(0);
++ return 0;
+ }
+
+ static void set_pprint_mapv(enum pprint_mapv_kind_t mapv_kind,
+--
+2.43.0
+
--- /dev/null
+From a3381d3c307ee66014065c25c945f2b03fba128d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 5 Nov 2023 15:16:38 +0100
+Subject: selftests/nolibc: fix testcase status alignment
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Thomas Weißschuh <linux@weissschuh.net>
+
+[ Upstream commit 07f679b50252dc9e3d0c19aca5801f82c230c527 ]
+
+Center-align all possible status reports.
+Before OK and FAIL were center-aligned in relation to each other but
+SKIPPED and FAILED would be left-aligned.
+
+Before:
+
+7 environ_addr = <0x7fffef3e7c50> [OK]
+8 environ_envp = <0x7fffef3e7c58> [FAIL]
+9 environ_auxv [SKIPPED]
+10 environ_total [SKIPPED]
+11 environ_HOME = <0x7fffef3e99bd> [OK]
+12 auxv_addr [SKIPPED]
+13 auxv_AT_UID = 1000 [OK]
+
+After:
+
+7 environ_addr = <0x7ffff13b00a0> [OK]
+8 environ_envp = <0x7ffff13b00a8> [FAIL]
+9 environ_auxv [SKIPPED]
+10 environ_total [SKIPPED]
+11 environ_HOME = <0x7ffff13b19bd> [OK]
+12 auxv_addr [SKIPPED]
+13 auxv_AT_UID = 1000 [OK]
+
+Signed-off-by: Thomas Weißschuh <linux@weissschuh.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/nolibc/nolibc-test.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/tools/testing/selftests/nolibc/nolibc-test.c b/tools/testing/selftests/nolibc/nolibc-test.c
+index 2f10541e6f38..e173014f6b66 100644
+--- a/tools/testing/selftests/nolibc/nolibc-test.c
++++ b/tools/testing/selftests/nolibc/nolibc-test.c
+@@ -150,11 +150,11 @@ static void result(int llen, enum RESULT r)
+ const char *msg;
+
+ if (r == OK)
+- msg = " [OK]";
++ msg = " [OK]";
+ else if (r == SKIPPED)
+ msg = "[SKIPPED]";
+ else
+- msg = "[FAIL]";
++ msg = " [FAIL]";
+
+ if (llen < 64)
+ putcharn(' ', 64 - llen);
+--
+2.43.0
+
--- /dev/null
+From dd931b72d09fe96af42cfac1bf0183024492baa9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 5 Oct 2023 17:38:50 +0200
+Subject: selftests/sgx: Fix linker script asserts
+
+From: Jo Van Bulck <jo.vanbulck@cs.kuleuven.be>
+
+[ Upstream commit 9fd552ee32c6c1e27c125016b87d295bea6faea7 ]
+
+DEFINED only considers symbols, not section names. Hence, replace the
+check for .got.plt with the _GLOBAL_OFFSET_TABLE_ symbol and remove other
+(non-essential) asserts.
+
+Signed-off-by: Jo Van Bulck <jo.vanbulck@cs.kuleuven.be>
+Signed-off-by: Dave Hansen <dave.hansen@linux.intel.com>
+Reviewed-by: Jarkko Sakkinen <jarkko@kernel.org>
+Link: https://lore.kernel.org/all/20231005153854.25566-10-jo.vanbulck%40cs.kuleuven.be
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/sgx/test_encl.lds | 6 +-----
+ 1 file changed, 1 insertion(+), 5 deletions(-)
+
+diff --git a/tools/testing/selftests/sgx/test_encl.lds b/tools/testing/selftests/sgx/test_encl.lds
+index a1ec64f7d91f..108bc11d1d8c 100644
+--- a/tools/testing/selftests/sgx/test_encl.lds
++++ b/tools/testing/selftests/sgx/test_encl.lds
+@@ -34,8 +34,4 @@ SECTIONS
+ }
+ }
+
+-ASSERT(!DEFINED(.altinstructions), "ALTERNATIVES are not supported in enclaves")
+-ASSERT(!DEFINED(.altinstr_replacement), "ALTERNATIVES are not supported in enclaves")
+-ASSERT(!DEFINED(.discard.retpoline_safe), "RETPOLINE ALTERNATIVES are not supported in enclaves")
+-ASSERT(!DEFINED(.discard.nospec), "RETPOLINE ALTERNATIVES are not supported in enclaves")
+-ASSERT(!DEFINED(.got.plt), "Libcalls are not supported in enclaves")
++ASSERT(!DEFINED(_GLOBAL_OFFSET_TABLE_), "Libcalls through GOT are not supported in enclaves")
+--
+2.43.0
+
--- /dev/null
+asm-generic-make-sparse-happy-with-odd-sized-put_una.patch
+powerpc-mm-fix-null-pointer-dereference-in-pgtable_c.patch
+arm64-irq-set-the-correct-node-for-vmap-stack.patch
+drivers-perf-pmuv3-don-t-expose-sw_incr-event-in-sys.patch
+powerpc-fix-build-error-due-to-is_valid_bugaddr.patch
+powerpc-mm-fix-build-failures-due-to-arch_reserved_k.patch
+powerpc-64s-fix-config_numa-n-build-due-to-create_se.patch
+x86-boot-ignore-nmis-during-very-early-boot.patch
+powerpc-pmd_move_must_withdraw-is-only-needed-for-co.patch
+powerpc-lib-validate-size-for-vector-operations.patch
+x86-mce-mark-fatal-mce-s-page-as-poison-to-avoid-pan.patch
+sched-numa-fix-mm-numa_scan_seq-based-unconditional-.patch
+perf-core-fix-narrow-startup-race-when-creating-the-.patch
+debugobjects-stop-accessing-objects-after-releasing-.patch
+sched-topology-add-a-new-arch_scale_freq_ref-method.patch
+cpufreq-use-the-fixed-and-coherent-frequency-for-sca.patch
+cpufreq-schedutil-use-a-fixed-reference-frequency.patch
+energy_model-use-a-fixed-reference-frequency.patch
+sched-fair-fix-tg-load-when-offlining-a-cpu.patch
+regulator-core-only-increment-use_count-when-enable_.patch
+audit-send-netlink-ack-before-setting-connection-in-.patch
+acpi-tables-correct-and-clean-up-the-logic-of-acpi_p.patch
+acpi-video-add-quirk-for-the-colorful-x15-at-23-lapt.patch
+pnp-acpi-fix-fortify-warning.patch
+acpi-extlog-fix-null-pointer-dereference-check.patch
+selftests-nolibc-fix-testcase-status-alignment.patch
+acpi-numa-fix-the-logic-of-getting-the-fake_pxm-valu.patch
+kunit-tool-fix-parsing-of-test-attributes.patch
+kunit-reset-test-priv-after-each-param-iteration.patch
+pm-devfreq-synchronize-devfreq_monitor_-start-stop.patch
+acpi-apei-set-memory-failure-flags-as-mf_action_requ.patch
+opp-the-level-field-is-always-of-unsigned-int-type.patch
+thermal-core-fix-thermal-zone-suspend-resume-synchro.patch
+fs-jfs-ubsan-array-index-out-of-bounds-in-dbadjtree.patch
+ubsan-array-index-out-of-bounds-in-dtsplitroot.patch
+jfs-fix-slab-out-of-bounds-read-in-dtsearch.patch
+jfs-fix-array-index-out-of-bounds-in-dbadjtree.patch
+jfs-fix-uaf-in-jfs_evict_inode.patch
+hwrng-starfive-fix-dev_err_probe-return-error.patch
+crypto-p10-aes-gcm-avoid-wstringop-overflow-warnings.patch
+pstore-ram-fix-crash-when-setting-number-of-cpus-to-.patch
+erofs-fix-up-compacted-indexes-for-block-size-4096.patch
+crypto-starfive-fix-dev_err_probe-return-error.patch
+crypto-octeontx2-fix-cptvf-driver-cleanup.patch
+erofs-fix-ztailpacking-for-subpage-compressed-blocks.patch
+crypto-stm32-crc32-fix-parsing-list-of-devices.patch
+afs-fix-the-usage-of-read_seqbegin_or_lock-in-afs_lo.patch
+rxrpc_find_service_conn_rcu-fix-the-usage-of-read_se.patch
+jfs-fix-array-index-out-of-bounds-in-dinewext.patch
+s390-boot-always-align-vmalloc-area-on-segment-bound.patch
+arch-consolidate-arch_irq_work_raise-prototypes.patch
+arch-fix-asm-offsets.c-building-with-wmissing-protot.patch
+s390-vfio-ap-fix-sysfs-status-attribute-for-ap-queue.patch
+hexagon-make-pfn-accessors-statics-inlines.patch
+s390-ptrace-handle-setting-of-fpc-register-correctly.patch
+kvm-s390-fix-setting-of-fpc-register.patch
+sysctl-fix-out-of-bounds-access-for-empty-sysctl-reg.patch
+sunrpc-fix-a-suspicious-rcu-usage-warning.patch
+ext4-treat-end-of-range-as-exclusive-in-ext4_zero_ra.patch
+smb-client-fix-renaming-of-reparse-points.patch
+smb-client-fix-hardlinking-of-reparse-points.patch
+cifs-fix-in-logging-in-cifs_chan_update_iface.patch
+ecryptfs-reject-casefold-directory-inodes.patch
+ext4-fix-inconsistent-between-segment-fstrim-and-ful.patch
+ext4-unify-the-type-of-flexbg_size-to-unsigned-int.patch
+ext4-remove-unnecessary-check-from-alloc_flex_gd.patch
+ext4-avoid-online-resizing-failures-due-to-oversized.patch
+wifi-rtw89-fix-timeout-calculation-in-rtw89_roc_end.patch
+wifi-rt2x00-restart-beacon-queue-when-hardware-reset.patch
+selftests-bpf-fix-release-1-build-for-tc_opts.patch
+selftests-bpf-satisfy-compiler-by-having-explicit-re.patch
+libbpf-fix-potential-uninitialized-tail-padding-with.patch
+selftests-bpf-fix-pyperf180-compilation-failure-with.patch
+wifi-rt2x00-correct-wrong-bbp-register-in-rxdcoc-cal.patch
+selftests-bpf-fix-issues-in-setup_classid_environmen.patch
+arm-dts-qcom-strip-prefix-from-pmic-files.patch
+arm-dts-qcom-mdm9615-fix-pmic-node-labels.patch
+arm-dts-qcom-msm8660-fix-pmic-node-labels.patch
+arm-dts-qcom-msm8960-fix-pmic-node-labels.patch
+soc-xilinx-fix-for-call-trace-due-to-the-usage-of-sm.patch
+soc-xilinx-fix-unhandled-sgi-warning-message.patch
+scsi-lpfc-fix-possible-file-string-name-overflow-whe.patch
+arm-dts-samsung-exynos4-fix-camera-unit-addresses-ra.patch
+arm-dts-samsung-s5pv210-fix-camera-unit-addresses-ra.patch
+net-phy-micrel-fix-ts_info-value-in-case-of-no-phc.patch
+pci-add-no-pm-reset-quirk-for-nvidia-spectrum-device.patch
+bonding-return-enomem-instead-of-bug-in-alb_upper_de.patch
+net-usb-ax88179_178a-avoid-two-consecutive-device-re.patch
+scsi-mpi3mr-add-support-for-sas5116-pci-ids.patch
+scsi-mpi3mr-add-pci-checks-where-sas5116-diverges-fr.patch
+scsi-arcmsr-support-new-pci-device-ids-1883-and-1886.patch
+arm-dts-imx7d-fix-coresight-funnel-ports.patch
+arm-dts-imx7s-fix-lcdif-compatible.patch
+arm-dts-imx7s-fix-nand-controller-size-cells.patch
+bpf-fix-a-few-selftest-failures-due-to-llvm18-change.patch
+wifi-ath9k-fix-potential-array-index-out-of-bounds-r.patch
+wifi-ath11k-fix-race-due-to-setting-ath11k_flag_ext_.patch
+wifi-rtw89-fix-not-entering-ps-mode-after-ap-stops.patch
+wifi-rtw89-fix-misbehavior-of-tx-beacon-in-concurren.patch
+bpf-check-rcu_read_lock_trace_held-before-calling-bp.patch
+bpf-set-need_defer-as-false-when-clearing-fd-array-d.patch
+wifi-ath12k-fix-and-enable-ap-mode-for-wcn7850.patch
+scsi-libfc-don-t-schedule-abort-twice.patch
+scsi-libfc-fix-up-timeout-error-in-fc_fcp_rec_error.patch
+net-mvmdio-avoid-excessive-sleeps-in-polled-mode.patch
+arm64-dts-qcom-sm8550-fix-soundwire-controllers-node.patch
+arm64-dts-qcom-sm8450-fix-soundwire-controllers-node.patch
+arm64-dts-qcom-sm8350-fix-remoteproc-interrupt-type.patch
+wifi-mt76-connac-fix-eht-phy-mode-check.patch
+wifi-mt76-mt7996-add-pci-ids-for-mt7992.patch
+bpf-set-uattr-batch.count-as-zero-before-batched-upd.patch
+wifi-wfx-fix-possible-null-pointer-dereference-in-wf.patch
+wifi-ath12k-fix-the-issue-that-the-multicast-broadca.patch
+arm-dts-rockchip-fix-rk3036-hdmi-ports-node.patch
+arm-dts-imx25-27-eukrea-fix-rtc-node-name.patch
+arm-dts-imx-use-flash-0-0-pattern.patch
+arm-dts-imx27-fix-sram-node.patch
+arm-dts-imx1-fix-sram-node.patch
+net-phy-at803x-fix-passing-the-wrong-reference-for-c.patch
+ionic-pass-opcode-to-devcmd_wait.patch
+ionic-bypass-firmware-cmds-when-stuck-in-reset.patch
+block-rnbd-srv-check-for-unlikely-string-overflow.patch
+arm64-zynqmp-move-fixed-clock-to-for-kv260.patch
+arm64-zynqmp-fix-clock-node-name-in-kv260-cards.patch
+selftests-bpf-fix-compiler-warnings-in-release-1-mod.patch
+arm-dts-imx25-fix-the-iim-compatible-string.patch
+arm-dts-imx25-27-pass-timing0.patch
+arm-dts-imx27-apf27dev-fix-led-name.patch
+arm-dts-imx23-sansa-use-preferred-i2c-gpios-properti.patch
+arm-dts-imx23-28-fix-the-dma-controller-node-name.patch
+scsi-lpfc-reinitialize-an-npiv-s-vmid-data-structure.patch
+scsi-lpfc-move-determination-of-vmid_flag-after-vmid.patch
+scsi-hisi_sas-set-.phy_attached-before-notifing-phyu.patch
+ice-fix-ice_aq_vsi_q_opt_rss_-register-values.patch
+net-atlantic-eliminate-double-free-in-error-handling.patch
+net-dsa-mv88e6xxx-fix-mv88e6352_serdes_get_stats-err.patch
+arm-dts-marvell-fix-some-common-switch-mistakes.patch
+arm64-dts-marvell-fix-some-common-switch-mistakes.patch
+block-prevent-an-integer-overflow-in-bvec_try_merge_.patch
+md-whenassemble-the-array-consult-the-superblock-of-.patch
+cfi-add-cfi_noseal.patch
+x86-cfi-bpf-fix-bpf_exception_cb-signature.patch
+arm64-dts-qcom-msm8996-fix-in-ports-is-a-required-pr.patch
+arm64-dts-qcom-msm8998-fix-out-ports-is-a-required-p.patch
+arm64-dts-qcom-fix-coresight-warnings-in-in-ports-an.patch
+intel-add-bit-macro-includes-where-needed.patch
+ice-fix-pre-shifted-bit-usage.patch
+arm64-dts-amlogic-fix-format-for-s4-uart-node.patch
+wifi-rtl8xxxu-add-additional-usb-ids-for-rtl8192eu-d.patch
+wifi-rtw89-coex-fix-wrong-wi-fi-role-info-and-fddt-p.patch
+libbpf-fix-null-pointer-dereference-in-bpf_object__c.patch
+wifi-rtlwifi-rtl8723-be-ae-using-calculate_bit_shift.patch
+wifi-cfg80211-free-beacon_ies-when-overridden-from-h.patch
+bluetooth-qca-set-both-wideband_speech-and-le_states.patch
+bluetooth-iso-avoid-creating-child-socket-if-pa-sync.patch
+bluetooth-hci_sync-fix-br-edr-wakeup-bug.patch
+bluetooth-l2cap-fix-possible-multiple-reject-send.patch
+net-smc-disable-seid-on-non-s390-archs-where-virtual.patch
+bridge-cfm-fix-enum-typo-in-br_cc_ccm_tx_parse.patch
+arm64-dts-sprd-add-clock-reference-for-pll2-on-ums51.patch
+arm64-dts-sprd-change-ums512-idle-state-nodename-to-.patch
+i40e-fix-vf-disable-behavior-to-block-all-traffic.patch
+octeontx2-af-fix-max-npc-mcam-entry-check-while-vali.patch
+net-kcm-fix-direct-access-to-bv_len.patch
+net-dsa-qca8k-put-mdio-bus-of-node-on-qca8k_mdio_reg.patch
+arm-dts-usr8200-fix-phy-registers.patch
+f2fs-fix-to-check-return-value-of-f2fs_reserve_new_b.patch
+alsa-hda-refer-to-correct-stream-index-at-loops.patch
+asoc-doc-fix-undefined-snd_soc_dapm_nopm-argument.patch
+drm-fix-color-lut-rounding.patch
+fast_dput-handle-underflows-gracefully.patch
+reiserfs-avoid-touching-renamed-directory-if-parent-.patch
+ocfs2-avoid-touching-renamed-directory-if-parent-doe.patch
+drm-msm-a690-fix-reg-values-for-a690.patch
+rdma-ipoib-fix-error-code-return-in-ipoib_mcast_join.patch
+drm-panel-edp-add-override_edid_mode-quirk-for-gener.patch
+drm-bridge-anx7625-fix-set-hpd-irq-detect-window-to-.patch
+drm-amd-display-fix-tiled-display-misalignment.patch
+media-renesas-vsp1-fix-references-to-pad-config.patch
+f2fs-fix-write-pointers-on-zoned-device-after-roll-f.patch
+asoc-amd-add-new-dmi-entries-for-acp5x-platform.patch
+drm-amd-display-initialize-all-the-dpm-level-s-stutt.patch
+drm-amd-display-fix-mst-pbn-x.y-value-calculations.patch
+drm-amd-display-fix-disable_otg_wa-logic.patch
+drm-amd-display-fix-replay-desync-error-irq-handler.patch
+drm-amd-display-add-support-for-dto-genarated-dscclk.patch
+drm-drm_file-fix-use-of-uninitialized-variable.patch
+drm-framebuffer-fix-use-of-uninitialized-variable.patch
+drm-mipi-dsi-fix-detach-call-without-attach.patch
+media-stk1160-fixed-high-volume-of-stk1160_dbg-messa.patch
+media-rockchip-rga-fix-swizzling-for-rgb-formats.patch
+pci-add-intel_hda_arl-to-pci_ids.h.patch
+alsa-hda-intel-add-hda_arl-pci-id-support.patch
+alsa-hda-intel-dspcfg-add-filters-for-arl-s-and-arl.patch
+drm-msm-dp-add-displayport-controller-for-sm8650.patch
+media-uvcvideo-fix-power-line-control-for-a-chicony-.patch
+media-uvcvideo-fix-power-line-control-for-sunplusit-.patch
+media-rkisp1-drop-irqf_shared.patch
+media-rkisp1-fix-irq-handler-return-values.patch
+media-rkisp1-store-irq-lines.patch
+media-rkisp1-fix-irq-disable-race-issue.patch
+media-rkisp1-resizer-stop-manual-allocation-of-v4l2_.patch
+hwmon-nct6775-fix-fan-speed-set-failure-in-automatic.patch
+hwmon-pc87360-bounds-check-data-innr-usage.patch
+hwmon-hp-wmi-sensors-fix-failure-to-load-on-elitedes.patch
+f2fs-fix-to-tag-gcing-flag-on-page-during-block-migr.patch
+drm-exynos-call-drm_atomic_helper_shutdown-at-shutdo.patch
+ib-ipoib-fix-mcast-list-locking.patch
+media-amphion-remove-mutext-lock-in-condition-of-wai.patch
+media-ddbridge-fix-an-error-code-problem-in-ddb_prob.patch
+media-ov2740-fix-hts-value.patch
+media-i2c-imx335-fix-hblank-min-max-values.patch
+drm-amd-display-for-prefetch-mode-0-extend-prefetch-.patch
+drm-amd-display-force-p-state-disallow-if-leaving-no.patch
+drm-amdkfd-fix-mes-set-shader-debugger-process-manag.patch
+drm-msm-dpu-enable-writeback-on-sm8350.patch
+drm-msm-dpu-enable-writeback-on-sm8450.patch
+drm-msm-dpu-ratelimit-framedone-timeout-msgs.patch
+drm-msm-dpu-fix-writeback-programming-for-yuv-cases.patch
+drm-msm-dpu-add-mutex-lock-in-control-vblank-irq.patch
+drm-amdgpu-fix-ftrace-event-amdgpu_bo_move-always-mo.patch
+clk-hi3620-fix-memory-leak-in-hi3620_mmc_clk_init.patch
+clk-mmp-pxa168-fix-memory-leak-in-pxa168_clk_init.patch
+watchdog-starfive-add-lock-annotations-to-fix-contex.patch
+watchdog-it87_wdt-keep-wdtctrl-bit-3-unmodified-for-.patch
+accel-habanalabs-add-support-for-gaudi2c-device.patch
+accel-habanalabs-fix-eq-heartbeat-mechanism.patch
+accel-habanalabs-gaudi2-fix-undef-opcode-reporting.patch
+drm-amd-display-make-flip_timestamp_in_us-a-64-bit-v.patch
+drm-amd-display-fix-usb-c-connector_type.patch
+drm-amd-display-fix-lightup-regression-with-dp2-sing.patch
+drm-amd-display-only-clear-symclk-otg-flag-for-hdmi.patch
+clk-imx-scu-fix-memory-leak-in-__imx_clk_gpr_scu.patch
+clk-imx-clk-imx8qxp-fix-lvds-bypass-pixel-and-phy-cl.patch
+drm-amdgpu-fix-ecc-irq-enable-disable-unpaired.patch
+drm-amd-display-fix-minor-issues-in-bw-allocation-ph.patch
+drm-amdgpu-let-kfd-sync-with-vm-fences.patch
+drm-amd-display-fixing-stream-allocation-regression.patch
+re-revert-drm-amd-display-enable-replay-for-static-s.patch
+drm-amdgpu-fix-possible-null-dereference-in-amdgpu_r.patch
+drm-amdgpu-fix-variable-mca_funcs-dereferenced-befor.patch
+drm-amdgpu-fix-fw-from-request_firmware-not-released.patch
+drm-amdgpu-drop-fence-check-in-to_amdgpu_amdkfd_fenc.patch
+drm-amdkfd-fix-iterator-used-outside-loop-in-kfd_add.patch
+drm-amdgpu-apply-the-rv2-system-aperture-fix-to-rn-c.patch
+alsa-hda-conexant-fix-headset-auto-detect-fail-in-cx.patch
+pinctrl-baytrail-fix-types-of-config-value-in-byt_pi.patch
+leds-trigger-panic-don-t-register-panic-notifier-if-.patch
+um-fix-naming-clash-between-uml-and-scheduler.patch
+um-don-t-use-vfprintf-for-os_info.patch
+um-net-fix-return-type-of-uml_net_start_xmit.patch
+um-time-travel-fix-time-corruption.patch
+i3c-master-cdns-update-maximum-prescaler-value-for-i.patch
+acpi-resource-add-dmi-quirks-for-asus-vivobook-e1504.patch
+acpi-resource-skip-irq-override-on-asus-expertbook-b.patch
+riscv-make-xip-bootable-again.patch
+xen-gntdev-fix-the-abuse-of-underlying-struct-page-i.patch
+mfd-ti_am335x_tscadc-fix-ti-soc-dependencies.patch
+mailbox-arm_mhuv2-fix-a-bug-for-mhuv2_sender_interru.patch
+pci-only-override-amd-usb-controller-if-required.patch
+pci-switchtec-fix-stdev_release-crash-after-surprise.patch
+perf-cs-etm-bump-minimum-opencsd-version-to-ensure-a.patch
+xhci-fix-possible-null-pointer-deref-during-xhci-urb.patch
+extcon-fix-possible-name-leak-in-extcon_dev_register.patch
+usb-hub-replace-hardcoded-quirk-value-with-bit-macro.patch
+usb-hub-add-quirk-to-decrease-in-ep-poll-interval-fo.patch
+selftests-sgx-fix-linker-script-asserts.patch
+tty-allow-tiocslcktrmios-with-cap_checkpoint_restore.patch
+tty-serial-8250-set-rs422-interface-by-default-to-fi.patch
+fs-kernfs-dir-obey-s_isgid.patch
+spmi-mediatek-fix-uaf-on-device-remove.patch
+staging-vme_user-fix-the-issue-of-return-the-wrong-e.patch
+pci-fix-64gt-s-effective-data-rate-calculation.patch
+pci-aer-decode-requester-id-when-no-error-info-found.patch
+9p-fix-initialisation-of-netfs_inode-for-9p.patch
+tracefs-eventfs-use-root-and-instance-inodes-as-defa.patch
+usb-xhci-plat-fix-usb-disconnect-issue-after-s4.patch
+misc-lis3lv02d_i2c-add-missing-setting-of-the-reg_ct.patch
+libsubcmd-fix-memory-leak-in-uniq.patch
+asoc-codecs-rtq9128-fix-pm_runtime-usage.patch
+asoc-codecs-rtq9128-fix-tdm-enable-and-dai-format-co.patch
+drm-amdkfd-fix-lock-dependency-warning.patch
+drm-amd-display-to-adjust-dprefclk-by-down-spread-pe.patch
+revert-drm-amd-display-fix-conversions-between-bytes.patch
+drm-amdkfd-fix-lock-dependency-warning-with-srcu.patch
+virtio_net-fix-d-directive-writing-between-1-and-11-.patch
+blk-mq-fix-io-hang-from-sbitmap-wakeup-race.patch
+ceph-reinitialize-mds-feature-bit-even-when-session-.patch
+ceph-fix-deadlock-or-deadcode-of-misusing-dget.patch
+ceph-fix-invalid-pointer-access-if-get_quota_realm-r.patch
+drm-amdgpu-fix-avg-vs-input-power-reporting-on-smu7.patch
+drm-amd-powerplay-fix-kzalloc-parameter-atom_tonga_p.patch
+drm-amdgpu-fix-with-right-return-code-eio-in-amdgpu_.patch
+drm-amdgpu-release-adev-pm.fw-before-return-in-amdgp.patch
+drm-amdkfd-fix-node-null-check-in-svm_range_get_rang.patch
+i2c-rk3x-adjust-mask-value-offset-for-i2c2-on-rv1126.patch
+perf-fix-the-nr_addr_filters-fix.patch
+wifi-cfg80211-fix-rcu-dereference-in-__cfg80211_bss_.patch
+drm-using-mul_u32_u32-requires-linux-math64.h.patch
+drm-msm-dpu-correct-ubwc-settings-for-sc8280xp.patch
+drm-amdkfd-only-flush-mes-process-context-if-mes-sup.patch
+riscv-fix-build-error-on-rv32-xip.patch
--- /dev/null
+From f9545c7cbf878fdbc44ce9fa7772ce76f433c84b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 23:55:07 -0300
+Subject: smb: client: fix hardlinking of reparse points
+
+From: Paulo Alcantara <pc@manguebit.com>
+
+[ Upstream commit 5408990aa662bcfd6ba894734023a023a16e8729 ]
+
+The client was sending an SMB2_CREATE request without setting
+OPEN_REPARSE_POINT flag thus failing the entire hardlink operation.
+
+Fix this by setting OPEN_REPARSE_POINT in create options for
+SMB2_CREATE request when the source inode is a repase point.
+
+Signed-off-by: Paulo Alcantara (SUSE) <pc@manguebit.com>
+Signed-off-by: Steve French <stfrench@microsoft.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/smb/client/cifsglob.h | 8 +++++---
+ fs/smb/client/cifsproto.h | 8 +++++---
+ fs/smb/client/cifssmb.c | 9 +++++----
+ fs/smb/client/link.c | 4 ++--
+ fs/smb/client/smb2inode.c | 33 +++++++++++++++++++++------------
+ fs/smb/client/smb2proto.h | 8 +++++---
+ 6 files changed, 43 insertions(+), 27 deletions(-)
+
+diff --git a/fs/smb/client/cifsglob.h b/fs/smb/client/cifsglob.h
+index 4d07b96038d8..942e6ece56b1 100644
+--- a/fs/smb/client/cifsglob.h
++++ b/fs/smb/client/cifsglob.h
+@@ -405,9 +405,11 @@ struct smb_version_operations {
+ const char *from_name, const char *to_name,
+ struct cifs_sb_info *cifs_sb);
+ /* send create hardlink request */
+- int (*create_hardlink)(const unsigned int, struct cifs_tcon *,
+- const char *, const char *,
+- struct cifs_sb_info *);
++ int (*create_hardlink)(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb);
+ /* query symlink target */
+ int (*query_symlink)(const unsigned int xid,
+ struct cifs_tcon *tcon,
+diff --git a/fs/smb/client/cifsproto.h b/fs/smb/client/cifsproto.h
+index 5af921b400d7..9516f5732324 100644
+--- a/fs/smb/client/cifsproto.h
++++ b/fs/smb/client/cifsproto.h
+@@ -443,9 +443,11 @@ extern int CIFSSMBRenameOpenFile(const unsigned int xid, struct cifs_tcon *tcon,
+ int netfid, const char *target_name,
+ const struct nls_table *nls_codepage,
+ int remap_special_chars);
+-extern int CIFSCreateHardLink(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb);
++int CIFSCreateHardLink(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb);
+ extern int CIFSUnixCreateHardLink(const unsigned int xid,
+ struct cifs_tcon *tcon,
+ const char *fromName, const char *toName,
+diff --git a/fs/smb/client/cifssmb.c b/fs/smb/client/cifssmb.c
+index 5bdea01919e8..e9e33b0b3ac4 100644
+--- a/fs/smb/client/cifssmb.c
++++ b/fs/smb/client/cifssmb.c
+@@ -2530,10 +2530,11 @@ CIFSUnixCreateHardLink(const unsigned int xid, struct cifs_tcon *tcon,
+ return rc;
+ }
+
+-int
+-CIFSCreateHardLink(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb)
++int CIFSCreateHardLink(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb)
+ {
+ int rc = 0;
+ NT_RENAME_REQ *pSMB = NULL;
+diff --git a/fs/smb/client/link.c b/fs/smb/client/link.c
+index a1da50e66fbb..3ef34218a790 100644
+--- a/fs/smb/client/link.c
++++ b/fs/smb/client/link.c
+@@ -510,8 +510,8 @@ cifs_hardlink(struct dentry *old_file, struct inode *inode,
+ rc = -ENOSYS;
+ goto cifs_hl_exit;
+ }
+- rc = server->ops->create_hardlink(xid, tcon, from_name, to_name,
+- cifs_sb);
++ rc = server->ops->create_hardlink(xid, tcon, old_file,
++ from_name, to_name, cifs_sb);
+ if ((rc == -EIO) || (rc == -EINVAL))
+ rc = -EOPNOTSUPP;
+ }
+diff --git a/fs/smb/client/smb2inode.c b/fs/smb/client/smb2inode.c
+index c3e28673e0cd..6cac0b107a2d 100644
+--- a/fs/smb/client/smb2inode.c
++++ b/fs/smb/client/smb2inode.c
+@@ -35,6 +35,18 @@ free_set_inf_compound(struct smb_rqst *rqst)
+ SMB2_close_free(&rqst[2]);
+ }
+
++static inline __u32 file_create_options(struct dentry *dentry)
++{
++ struct cifsInodeInfo *ci;
++
++ if (dentry) {
++ ci = CIFS_I(d_inode(dentry));
++ if (ci->cifsAttrs & ATTR_REPARSE)
++ return OPEN_REPARSE_POINT;
++ }
++ return 0;
++}
++
+ /*
+ * note: If cfile is passed, the reference to it is dropped here.
+ * So make sure that you do not reuse cfile after return from this func.
+@@ -809,15 +821,9 @@ int smb2_rename_path(const unsigned int xid,
+ const char *from_name, const char *to_name,
+ struct cifs_sb_info *cifs_sb)
+ {
+- struct cifsInodeInfo *ci;
+ struct cifsFileInfo *cfile;
+- __u32 co = 0;
++ __u32 co = file_create_options(source_dentry);
+
+- if (source_dentry) {
+- ci = CIFS_I(d_inode(source_dentry));
+- if (ci->cifsAttrs & ATTR_REPARSE)
+- co |= OPEN_REPARSE_POINT;
+- }
+ drop_cached_dir_by_name(xid, tcon, from_name, cifs_sb);
+ cifs_get_writable_path(tcon, from_name, FIND_WR_WITH_DELETE, &cfile);
+
+@@ -825,13 +831,16 @@ int smb2_rename_path(const unsigned int xid,
+ co, DELETE, SMB2_OP_RENAME, cfile);
+ }
+
+-int
+-smb2_create_hardlink(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb)
++int smb2_create_hardlink(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb)
+ {
++ __u32 co = file_create_options(source_dentry);
++
+ return smb2_set_path_attr(xid, tcon, from_name, to_name,
+- cifs_sb, 0, FILE_READ_ATTRIBUTES,
++ cifs_sb, co, FILE_READ_ATTRIBUTES,
+ SMB2_OP_HARDLINK, NULL);
+ }
+
+diff --git a/fs/smb/client/smb2proto.h b/fs/smb/client/smb2proto.h
+index 7cbf1a76b42d..a8084ce7fcbd 100644
+--- a/fs/smb/client/smb2proto.h
++++ b/fs/smb/client/smb2proto.h
+@@ -85,9 +85,11 @@ int smb2_rename_path(const unsigned int xid,
+ struct dentry *source_dentry,
+ const char *from_name, const char *to_name,
+ struct cifs_sb_info *cifs_sb);
+-extern int smb2_create_hardlink(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb);
++int smb2_create_hardlink(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb);
+ extern int smb3_create_mf_symlink(unsigned int xid, struct cifs_tcon *tcon,
+ struct cifs_sb_info *cifs_sb, const unsigned char *path,
+ char *pbuf, unsigned int *pbytes_written);
+--
+2.43.0
+
--- /dev/null
+From 79ae51caf2e1585067a54c8b23fad83c81709644 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 23:55:06 -0300
+Subject: smb: client: fix renaming of reparse points
+
+From: Paulo Alcantara <pc@manguebit.com>
+
+[ Upstream commit 7435d51b7ea2ab7801279c43ecd72063e9d5c92f ]
+
+The client was sending an SMB2_CREATE request without setting
+OPEN_REPARSE_POINT flag thus failing the entire rename operation.
+
+Fix this by setting OPEN_REPARSE_POINT in create options for
+SMB2_CREATE request when the source inode is a repase point.
+
+Signed-off-by: Paulo Alcantara (SUSE) <pc@manguebit.com>
+Signed-off-by: Steve French <stfrench@microsoft.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/smb/client/cifsglob.h | 22 +++++++++++++++++-----
+ fs/smb/client/cifsproto.h | 7 ++++---
+ fs/smb/client/cifssmb.c | 8 ++++----
+ fs/smb/client/inode.c | 3 ++-
+ fs/smb/client/smb2inode.c | 38 +++++++++++++++++++++++---------------
+ fs/smb/client/smb2proto.h | 8 +++++---
+ 6 files changed, 55 insertions(+), 31 deletions(-)
+
+diff --git a/fs/smb/client/cifsglob.h b/fs/smb/client/cifsglob.h
+index 5e32c79f03a7..4d07b96038d8 100644
+--- a/fs/smb/client/cifsglob.h
++++ b/fs/smb/client/cifsglob.h
+@@ -205,9 +205,18 @@ struct cifs_open_info_data {
+ };
+ };
+
+-#define cifs_open_data_reparse(d) \
+- ((d)->reparse_point || \
+- (le32_to_cpu((d)->fi.Attributes) & ATTR_REPARSE))
++static inline bool cifs_open_data_reparse(struct cifs_open_info_data *data)
++{
++ struct smb2_file_all_info *fi = &data->fi;
++ u32 attrs = le32_to_cpu(fi->Attributes);
++ bool ret;
++
++ ret = data->reparse_point || (attrs & ATTR_REPARSE);
++ if (ret)
++ attrs |= ATTR_REPARSE;
++ fi->Attributes = cpu_to_le32(attrs);
++ return ret;
++}
+
+ static inline void cifs_free_open_info(struct cifs_open_info_data *data)
+ {
+@@ -390,8 +399,11 @@ struct smb_version_operations {
+ int (*rename_pending_delete)(const char *, struct dentry *,
+ const unsigned int);
+ /* send rename request */
+- int (*rename)(const unsigned int, struct cifs_tcon *, const char *,
+- const char *, struct cifs_sb_info *);
++ int (*rename)(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb);
+ /* send create hardlink request */
+ int (*create_hardlink)(const unsigned int, struct cifs_tcon *,
+ const char *, const char *,
+diff --git a/fs/smb/client/cifsproto.h b/fs/smb/client/cifsproto.h
+index 46feaa0880bd..5af921b400d7 100644
+--- a/fs/smb/client/cifsproto.h
++++ b/fs/smb/client/cifsproto.h
+@@ -435,9 +435,10 @@ extern int CIFSPOSIXDelFile(const unsigned int xid, struct cifs_tcon *tcon,
+ int remap_special_chars);
+ extern int CIFSSMBDelFile(const unsigned int xid, struct cifs_tcon *tcon,
+ const char *name, struct cifs_sb_info *cifs_sb);
+-extern int CIFSSMBRename(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb);
++int CIFSSMBRename(const unsigned int xid, struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb);
+ extern int CIFSSMBRenameOpenFile(const unsigned int xid, struct cifs_tcon *tcon,
+ int netfid, const char *target_name,
+ const struct nls_table *nls_codepage,
+diff --git a/fs/smb/client/cifssmb.c b/fs/smb/client/cifssmb.c
+index 9ee348e6d106..5bdea01919e8 100644
+--- a/fs/smb/client/cifssmb.c
++++ b/fs/smb/client/cifssmb.c
+@@ -2149,10 +2149,10 @@ CIFSSMBFlush(const unsigned int xid, struct cifs_tcon *tcon, int smb_file_id)
+ return rc;
+ }
+
+-int
+-CIFSSMBRename(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb)
++int CIFSSMBRename(const unsigned int xid, struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb)
+ {
+ int rc = 0;
+ RENAME_REQ *pSMB = NULL;
+diff --git a/fs/smb/client/inode.c b/fs/smb/client/inode.c
+index 09c5c0f5c96e..eb54e4893777 100644
+--- a/fs/smb/client/inode.c
++++ b/fs/smb/client/inode.c
+@@ -2219,7 +2219,8 @@ cifs_do_rename(const unsigned int xid, struct dentry *from_dentry,
+ return -ENOSYS;
+
+ /* try path-based rename first */
+- rc = server->ops->rename(xid, tcon, from_path, to_path, cifs_sb);
++ rc = server->ops->rename(xid, tcon, from_dentry,
++ from_path, to_path, cifs_sb);
+
+ /*
+ * Don't bother with rename by filehandle unless file is busy and
+diff --git a/fs/smb/client/smb2inode.c b/fs/smb/client/smb2inode.c
+index c94940af5d4b..c3e28673e0cd 100644
+--- a/fs/smb/client/smb2inode.c
++++ b/fs/smb/client/smb2inode.c
+@@ -781,11 +781,11 @@ smb2_unlink(const unsigned int xid, struct cifs_tcon *tcon, const char *name,
+ ACL_NO_MODE, NULL, SMB2_OP_DELETE, NULL, NULL, NULL, NULL, NULL);
+ }
+
+-static int
+-smb2_set_path_attr(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb, __u32 access, int command,
+- struct cifsFileInfo *cfile)
++static int smb2_set_path_attr(const unsigned int xid, struct cifs_tcon *tcon,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb,
++ __u32 create_options, __u32 access,
++ int command, struct cifsFileInfo *cfile)
+ {
+ __le16 *smb2_to_name = NULL;
+ int rc;
+@@ -796,25 +796,33 @@ smb2_set_path_attr(const unsigned int xid, struct cifs_tcon *tcon,
+ goto smb2_rename_path;
+ }
+ rc = smb2_compound_op(xid, tcon, cifs_sb, from_name, access,
+- FILE_OPEN, 0, ACL_NO_MODE, smb2_to_name,
++ FILE_OPEN, create_options, ACL_NO_MODE, smb2_to_name,
+ command, cfile, NULL, NULL, NULL, NULL);
+ smb2_rename_path:
+ kfree(smb2_to_name);
+ return rc;
+ }
+
+-int
+-smb2_rename_path(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb)
++int smb2_rename_path(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb)
+ {
++ struct cifsInodeInfo *ci;
+ struct cifsFileInfo *cfile;
++ __u32 co = 0;
+
++ if (source_dentry) {
++ ci = CIFS_I(d_inode(source_dentry));
++ if (ci->cifsAttrs & ATTR_REPARSE)
++ co |= OPEN_REPARSE_POINT;
++ }
+ drop_cached_dir_by_name(xid, tcon, from_name, cifs_sb);
+ cifs_get_writable_path(tcon, from_name, FIND_WR_WITH_DELETE, &cfile);
+
+- return smb2_set_path_attr(xid, tcon, from_name, to_name,
+- cifs_sb, DELETE, SMB2_OP_RENAME, cfile);
++ return smb2_set_path_attr(xid, tcon, from_name, to_name, cifs_sb,
++ co, DELETE, SMB2_OP_RENAME, cfile);
+ }
+
+ int
+@@ -822,9 +830,9 @@ smb2_create_hardlink(const unsigned int xid, struct cifs_tcon *tcon,
+ const char *from_name, const char *to_name,
+ struct cifs_sb_info *cifs_sb)
+ {
+- return smb2_set_path_attr(xid, tcon, from_name, to_name, cifs_sb,
+- FILE_READ_ATTRIBUTES, SMB2_OP_HARDLINK,
+- NULL);
++ return smb2_set_path_attr(xid, tcon, from_name, to_name,
++ cifs_sb, 0, FILE_READ_ATTRIBUTES,
++ SMB2_OP_HARDLINK, NULL);
+ }
+
+ int
+diff --git a/fs/smb/client/smb2proto.h b/fs/smb/client/smb2proto.h
+index 0e371f7e2854..7cbf1a76b42d 100644
+--- a/fs/smb/client/smb2proto.h
++++ b/fs/smb/client/smb2proto.h
+@@ -80,9 +80,11 @@ extern int smb2_rmdir(const unsigned int xid, struct cifs_tcon *tcon,
+ const char *name, struct cifs_sb_info *cifs_sb);
+ extern int smb2_unlink(const unsigned int xid, struct cifs_tcon *tcon,
+ const char *name, struct cifs_sb_info *cifs_sb);
+-extern int smb2_rename_path(const unsigned int xid, struct cifs_tcon *tcon,
+- const char *from_name, const char *to_name,
+- struct cifs_sb_info *cifs_sb);
++int smb2_rename_path(const unsigned int xid,
++ struct cifs_tcon *tcon,
++ struct dentry *source_dentry,
++ const char *from_name, const char *to_name,
++ struct cifs_sb_info *cifs_sb);
+ extern int smb2_create_hardlink(const unsigned int xid, struct cifs_tcon *tcon,
+ const char *from_name, const char *to_name,
+ struct cifs_sb_info *cifs_sb);
+--
+2.43.0
+
--- /dev/null
+From 61dc696e7d67f56dc163587fd977136ae0235f48 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 26 Oct 2023 22:56:22 -0700
+Subject: soc: xilinx: Fix for call trace due to the usage of
+ smp_processor_id()
+
+From: HariBabu Gattem <haribabu.gattem@xilinx.com>
+
+[ Upstream commit daed80ed07580e5adc0e6d8bc79933a35154135a ]
+
+When preemption is enabled in kernel and if any task which can be
+preempted should not use smp_processor_id() directly, since CPU
+switch can happen at any time, the previous value of cpu_id
+differs with current cpu_id. As a result we see the below call trace
+during xlnx_event_manager_probe.
+
+[ 6.140197] dump_backtrace+0x0/0x190
+[ 6.143884] show_stack+0x18/0x40
+[ 6.147220] dump_stack_lvl+0x7c/0xa0
+[ 6.150907] dump_stack+0x18/0x34
+[ 6.154241] check_preemption_disabled+0x124/0x134
+[ 6.159068] debug_smp_processor_id+0x20/0x2c
+[ 6.163453] xlnx_event_manager_probe+0x48/0x250
+
+To protect cpu_id, It is recommended to use get_cpu()/put_cpu()
+to disable preemption, get the cpu_id and enable preemption respectively.
+(For Reference, Documentation/locking/preempt-locking.rst and
+Documentation/kernel-hacking/hacking.rst)
+
+Use preempt_disable()/smp_processor_id()/preempt_enable()
+API's to achieve the same.
+
+Signed-off-by: HariBabu Gattem <haribabu.gattem@xilinx.com>
+Signed-off-by: Jay Buddhabhatti <jay.buddhabhatti@amd.com>
+Link: https://lore.kernel.org/r/20231027055622.21544-1-jay.buddhabhatti@amd.com
+Signed-off-by: Michal Simek <michal.simek@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/soc/xilinx/xlnx_event_manager.c | 5 ++++-
+ 1 file changed, 4 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
+index 86a048a10a13..edfb1d5c10c6 100644
+--- a/drivers/soc/xilinx/xlnx_event_manager.c
++++ b/drivers/soc/xilinx/xlnx_event_manager.c
+@@ -555,7 +555,7 @@ static void xlnx_disable_percpu_irq(void *data)
+ static int xlnx_event_init_sgi(struct platform_device *pdev)
+ {
+ int ret = 0;
+- int cpu = smp_processor_id();
++ int cpu;
+ /*
+ * IRQ related structures are used for the following:
+ * for each SGI interrupt ensure its mapped by GIC IRQ domain
+@@ -592,9 +592,12 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
+ sgi_fwspec.param[0] = sgi_num;
+ virq_sgi = irq_create_fwspec_mapping(&sgi_fwspec);
+
++ cpu = get_cpu();
+ per_cpu(cpu_number1, cpu) = cpu;
+ ret = request_percpu_irq(virq_sgi, xlnx_event_handler, "xlnx_event_mgmt",
+ &cpu_number1);
++ put_cpu();
++
+ WARN_ON(ret);
+ if (ret) {
+ irq_dispose_mapping(virq_sgi);
+--
+2.43.0
+
--- /dev/null
+From e71a285c0179e9e2eaa1c09b8f6c1cf1ee023cfe Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 27 Oct 2023 23:53:59 +0530
+Subject: soc: xilinx: fix unhandled SGI warning message
+
+From: Tanmay Shah <tanmay.shah@xilinx.com>
+
+[ Upstream commit 9c6724abf969251af53cdae525ad8100ec78d3c2 ]
+
+Xen broadcasts SGI to each VM when multiple VMs run on Xen hypervisor. In
+such case spurious SGI is expected if one event is registered by one VM and
+not registered by another VM. We let users know that Unhandled SGI is not
+error and expected if kernel is running on Xen hypervisor.
+
+Signed-off-by: Tanmay Shah <tanmay.shah@xilinx.com>
+Signed-off-by: Radhey Shyam Pandey <radhey.shyam.pandey@amd.com>
+Link: https://lore.kernel.org/r/1698431039-2734260-1-git-send-email-radhey.shyam.pandey@amd.com
+Signed-off-by: Michal Simek <michal.simek@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/soc/xilinx/xlnx_event_manager.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
+index edfb1d5c10c6..042553abe1bf 100644
+--- a/drivers/soc/xilinx/xlnx_event_manager.c
++++ b/drivers/soc/xilinx/xlnx_event_manager.c
+@@ -477,7 +477,7 @@ static void xlnx_call_notify_cb_handler(const u32 *payload)
+ }
+ }
+ if (!is_callback_found)
+- pr_warn("Didn't find any registered callback for 0x%x 0x%x\n",
++ pr_warn("Unhandled SGI node 0x%x event 0x%x. Expected with Xen hypervisor\n",
+ payload[1], payload[2]);
+ }
+
+--
+2.43.0
+
--- /dev/null
+From f862ef3b06a49aba2a05a3b7889755422fa6e5e2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 15:17:25 -0800
+Subject: spmi: mediatek: Fix UAF on device remove
+
+From: Yu-Che Cheng <giver@chromium.org>
+
+[ Upstream commit e821d50ab5b956ed0effa49faaf29912fd4106d9 ]
+
+The pmif driver data that contains the clocks is allocated along with
+spmi_controller.
+On device remove, spmi_controller will be freed first, and then devres
+, including the clocks, will be cleanup.
+This leads to UAF because putting the clocks will access the clocks in
+the pmif driver data, which is already freed along with spmi_controller.
+
+This can be reproduced by enabling DEBUG_TEST_DRIVER_REMOVE and
+building the kernel with KASAN.
+
+Fix the UAF issue by using unmanaged clk_bulk_get() and putting the
+clocks before freeing spmi_controller.
+
+Reported-by: Fei Shao <fshao@chromium.org>
+Signed-off-by: Yu-Che Cheng <giver@chromium.org>
+Link: https://lore.kernel.org/r/20230717173934.1.If004a6e055a189c7f2d0724fa814422c26789839@changeid
+Tested-by: Fei Shao <fshao@chromium.org>
+Reviewed-by: Fei Shao <fshao@chromium.org>
+Reviewed-by: Chen-Yu Tsai <wenst@chromium.org>
+Signed-off-by: Stephen Boyd <sboyd@kernel.org>
+Link: https://lore.kernel.org/r/20231206231733.4031901-3-sboyd@kernel.org
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/spmi/spmi-mtk-pmif.c | 7 +++++--
+ 1 file changed, 5 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/spmi/spmi-mtk-pmif.c b/drivers/spmi/spmi-mtk-pmif.c
+index 54c35f5535cb..1261f381cae6 100644
+--- a/drivers/spmi/spmi-mtk-pmif.c
++++ b/drivers/spmi/spmi-mtk-pmif.c
+@@ -475,7 +475,7 @@ static int mtk_spmi_probe(struct platform_device *pdev)
+ for (i = 0; i < arb->nclks; i++)
+ arb->clks[i].id = pmif_clock_names[i];
+
+- err = devm_clk_bulk_get(&pdev->dev, arb->nclks, arb->clks);
++ err = clk_bulk_get(&pdev->dev, arb->nclks, arb->clks);
+ if (err) {
+ dev_err(&pdev->dev, "Failed to get clocks: %d\n", err);
+ goto err_put_ctrl;
+@@ -484,7 +484,7 @@ static int mtk_spmi_probe(struct platform_device *pdev)
+ err = clk_bulk_prepare_enable(arb->nclks, arb->clks);
+ if (err) {
+ dev_err(&pdev->dev, "Failed to enable clocks: %d\n", err);
+- goto err_put_ctrl;
++ goto err_put_clks;
+ }
+
+ ctrl->cmd = pmif_arb_cmd;
+@@ -510,6 +510,8 @@ static int mtk_spmi_probe(struct platform_device *pdev)
+
+ err_domain_remove:
+ clk_bulk_disable_unprepare(arb->nclks, arb->clks);
++err_put_clks:
++ clk_bulk_put(arb->nclks, arb->clks);
+ err_put_ctrl:
+ spmi_controller_put(ctrl);
+ return err;
+@@ -521,6 +523,7 @@ static void mtk_spmi_remove(struct platform_device *pdev)
+ struct pmif *arb = spmi_controller_get_drvdata(ctrl);
+
+ clk_bulk_disable_unprepare(arb->nclks, arb->clks);
++ clk_bulk_put(arb->nclks, arb->clks);
+ spmi_controller_remove(ctrl);
+ spmi_controller_put(ctrl);
+ }
+--
+2.43.0
+
--- /dev/null
+From 6be17eb51bd320c5d1b2020ca5b0816252936d30 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 20 Dec 2023 01:04:47 +0800
+Subject: staging: vme_user: Fix the issue of return the wrong error code
+
+From: Piro Yang <piroyangg@gmail.com>
+
+[ Upstream commit 5090a4bc2a2f04b7693b49500ad1287e8d0fb6c3 ]
+
+Fix the issue of returning the -ENOSYS error code when an error occurs.
+
+The error code of -ENOSYS indicates Invalid system call number, but
+there is not system call error. So replace -ENOSYS error code by the
+return -EINVAL error code.
+
+Signed-off-by: Piro Yang <piroyangg@gmail.com>
+Link: https://lore.kernel.org/r/20231219170447.51237-1-piroyangg@gmail.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/staging/vme_user/vme.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/staging/vme_user/vme.c b/drivers/staging/vme_user/vme.c
+index 5c416c31ec57..9bc2d35405af 100644
+--- a/drivers/staging/vme_user/vme.c
++++ b/drivers/staging/vme_user/vme.c
+@@ -341,7 +341,7 @@ int vme_slave_set(struct vme_resource *resource, int enabled,
+
+ if (!bridge->slave_set) {
+ dev_err(bridge->parent, "Function not supported\n");
+- return -ENOSYS;
++ return -EINVAL;
+ }
+
+ if (!(((image->address_attr & aspace) == aspace) &&
+--
+2.43.0
+
--- /dev/null
+From 3a2942a6520da5274fa3240b533e71575887cd81 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 27 Nov 2023 17:06:18 -0500
+Subject: SUNRPC: Fix a suspicious RCU usage warning
+
+From: Anna Schumaker <Anna.Schumaker@Netapp.com>
+
+[ Upstream commit 31b62908693c90d4d07db597e685d9f25a120073 ]
+
+I received the following warning while running cthon against an ontap
+server running pNFS:
+
+[ 57.202521] =============================
+[ 57.202522] WARNING: suspicious RCU usage
+[ 57.202523] 6.7.0-rc3-g2cc14f52aeb7 #41492 Not tainted
+[ 57.202525] -----------------------------
+[ 57.202525] net/sunrpc/xprtmultipath.c:349 RCU-list traversed in non-reader section!!
+[ 57.202527]
+ other info that might help us debug this:
+
+[ 57.202528]
+ rcu_scheduler_active = 2, debug_locks = 1
+[ 57.202529] no locks held by test5/3567.
+[ 57.202530]
+ stack backtrace:
+[ 57.202532] CPU: 0 PID: 3567 Comm: test5 Not tainted 6.7.0-rc3-g2cc14f52aeb7 #41492 5b09971b4965c0aceba19f3eea324a4a806e227e
+[ 57.202534] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS unknown 2/2/2022
+[ 57.202536] Call Trace:
+[ 57.202537] <TASK>
+[ 57.202540] dump_stack_lvl+0x77/0xb0
+[ 57.202551] lockdep_rcu_suspicious+0x154/0x1a0
+[ 57.202556] rpc_xprt_switch_has_addr+0x17c/0x190 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202596] rpc_clnt_setup_test_and_add_xprt+0x50/0x180 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202621] ? rpc_clnt_add_xprt+0x254/0x300 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202646] rpc_clnt_add_xprt+0x27a/0x300 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202671] ? __pfx_rpc_clnt_setup_test_and_add_xprt+0x10/0x10 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202696] nfs4_pnfs_ds_connect+0x345/0x760 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202728] ? __pfx_nfs4_test_session_trunk+0x10/0x10 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202754] nfs4_fl_prepare_ds+0x75/0xc0 [nfs_layout_nfsv41_files e3a4187f18ae8a27b630f9feae6831b584a9360a]
+[ 57.202760] filelayout_write_pagelist+0x4a/0x200 [nfs_layout_nfsv41_files e3a4187f18ae8a27b630f9feae6831b584a9360a]
+[ 57.202765] pnfs_generic_pg_writepages+0xbe/0x230 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202788] __nfs_pageio_add_request+0x3fd/0x520 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202813] nfs_pageio_add_request+0x18b/0x390 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202831] nfs_do_writepage+0x116/0x1e0 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202849] nfs_writepages_callback+0x13/0x30 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202866] write_cache_pages+0x265/0x450
+[ 57.202870] ? __pfx_nfs_writepages_callback+0x10/0x10 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202891] nfs_writepages+0x141/0x230 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202913] do_writepages+0xd2/0x230
+[ 57.202917] ? filemap_fdatawrite_wbc+0x5c/0x80
+[ 57.202921] filemap_fdatawrite_wbc+0x67/0x80
+[ 57.202924] filemap_write_and_wait_range+0xd9/0x170
+[ 57.202930] nfs_wb_all+0x49/0x180 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202947] nfs4_file_flush+0x72/0xb0 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202969] __se_sys_close+0x46/0xd0
+[ 57.202972] do_syscall_64+0x68/0x100
+[ 57.202975] ? do_syscall_64+0x77/0x100
+[ 57.202976] ? do_syscall_64+0x77/0x100
+[ 57.202979] entry_SYSCALL_64_after_hwframe+0x6e/0x76
+[ 57.202982] RIP: 0033:0x7fe2b12e4a94
+[ 57.202985] Code: 00 f7 d8 64 89 01 48 83 c8 ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa 80 3d d5 18 0e 00 00 74 13 b8 03 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 44 c3 0f 1f 00 48 83 ec 18 89 7c 24 0c e8 c3
+[ 57.202987] RSP: 002b:00007ffe857ddb38 EFLAGS: 00000202 ORIG_RAX: 0000000000000003
+[ 57.202989] RAX: ffffffffffffffda RBX: 00007ffe857dfd68 RCX: 00007fe2b12e4a94
+[ 57.202991] RDX: 0000000000002000 RSI: 00007ffe857ddc40 RDI: 0000000000000003
+[ 57.202992] RBP: 00007ffe857dfc50 R08: 7fffffffffffffff R09: 0000000065650f49
+[ 57.202993] R10: 00007fe2b11f8300 R11: 0000000000000202 R12: 0000000000000000
+[ 57.202994] R13: 00007ffe857dfd80 R14: 00007fe2b1445000 R15: 0000000000000000
+[ 57.202999] </TASK>
+
+The problem seems to be that two out of three callers aren't taking the
+rcu_read_lock() before calling the list_for_each_entry_rcu() function in
+rpc_xprt_switch_has_addr(). I fix this by having
+rpc_xprt_switch_has_addr() unconditionaly take the rcu_read_lock(),
+which is okay to do recursively in the case that the lock has already
+been taken by a caller.
+
+Reviewed-by: Jeff Layton <jlayton@kernel.org>
+Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/sunrpc/xprtmultipath.c | 17 +++++++++++++++--
+ 1 file changed, 15 insertions(+), 2 deletions(-)
+
+diff --git a/net/sunrpc/xprtmultipath.c b/net/sunrpc/xprtmultipath.c
+index 74ee2271251e..720d3ba742ec 100644
+--- a/net/sunrpc/xprtmultipath.c
++++ b/net/sunrpc/xprtmultipath.c
+@@ -336,8 +336,9 @@ struct rpc_xprt *xprt_iter_current_entry_offline(struct rpc_xprt_iter *xpi)
+ xprt_switch_find_current_entry_offline);
+ }
+
+-bool rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
+- const struct sockaddr *sap)
++static
++bool __rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
++ const struct sockaddr *sap)
+ {
+ struct list_head *head;
+ struct rpc_xprt *pos;
+@@ -356,6 +357,18 @@ bool rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
+ return false;
+ }
+
++bool rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
++ const struct sockaddr *sap)
++{
++ bool res;
++
++ rcu_read_lock();
++ res = __rpc_xprt_switch_has_addr(xps, sap);
++ rcu_read_unlock();
++
++ return res;
++}
++
+ static
+ struct rpc_xprt *xprt_switch_find_next_entry(struct list_head *head,
+ const struct rpc_xprt *cur, bool check_active)
+--
+2.43.0
+
--- /dev/null
+From 97ad3107e52bec0b0471fff94daf0b049f9453d8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 12:02:18 +0100
+Subject: sysctl: Fix out of bounds access for empty sysctl registers
+
+From: Joel Granados <j.granados@samsung.com>
+
+[ Upstream commit 315552310c7de92baea4e570967066569937a843 ]
+
+When registering tables to the sysctl subsystem there is a check to see
+if header is a permanently empty directory (used for mounts). This check
+evaluates the first element of the ctl_table. This results in an out of
+bounds evaluation when registering empty directories.
+
+The function register_sysctl_mount_point now passes a ctl_table of size
+1 instead of size 0. It now relies solely on the type to identify
+a permanently empty register.
+
+Make sure that the ctl_table has at least one element before testing for
+permanent emptiness.
+
+Signed-off-by: Joel Granados <j.granados@samsung.com>
+Reported-by: kernel test robot <oliver.sang@intel.com>
+Closes: https://lore.kernel.org/oe-lkp/202311201431.57aae8f3-oliver.sang@intel.com
+Signed-off-by: Luis Chamberlain <mcgrof@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/proc/proc_sysctl.c | 9 +++++++--
+ 1 file changed, 7 insertions(+), 2 deletions(-)
+
+diff --git a/fs/proc/proc_sysctl.c b/fs/proc/proc_sysctl.c
+index 8064ea76f80b..84abf98340a0 100644
+--- a/fs/proc/proc_sysctl.c
++++ b/fs/proc/proc_sysctl.c
+@@ -44,7 +44,7 @@ static struct ctl_table sysctl_mount_point[] = {
+ */
+ struct ctl_table_header *register_sysctl_mount_point(const char *path)
+ {
+- return register_sysctl_sz(path, sysctl_mount_point, 0);
++ return register_sysctl(path, sysctl_mount_point);
+ }
+ EXPORT_SYMBOL(register_sysctl_mount_point);
+
+@@ -233,7 +233,8 @@ static int insert_header(struct ctl_dir *dir, struct ctl_table_header *header)
+ return -EROFS;
+
+ /* Am I creating a permanently empty directory? */
+- if (sysctl_is_perm_empty_ctl_table(header->ctl_table)) {
++ if (header->ctl_table_size > 0 &&
++ sysctl_is_perm_empty_ctl_table(header->ctl_table)) {
+ if (!RB_EMPTY_ROOT(&dir->root))
+ return -EINVAL;
+ sysctl_set_perm_empty_ctl_header(dir_h);
+@@ -1213,6 +1214,10 @@ static bool get_links(struct ctl_dir *dir,
+ struct ctl_table_header *tmp_head;
+ struct ctl_table *entry, *link;
+
++ if (header->ctl_table_size == 0 ||
++ sysctl_is_perm_empty_ctl_table(header->ctl_table))
++ return true;
++
+ /* Are there links available for every entry in table? */
+ list_for_each_table_entry(entry, header) {
+ const char *procname = entry->procname;
+--
+2.43.0
+
--- /dev/null
+From f393c7fedb9bb059ec2aede1a55e490baf3db6c1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 20:25:02 +0100
+Subject: thermal: core: Fix thermal zone suspend-resume synchronization
+
+From: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+
+[ Upstream commit 4e814173a8c4f432fd068b1c796f0416328c9d99 ]
+
+There are 3 synchronization issues with thermal zone suspend-resume
+during system-wide transitions:
+
+ 1. The resume code runs in a PM notifier which is invoked after user
+ space has been thawed, so it can run concurrently with user space
+ which can trigger a thermal zone device removal. If that happens,
+ the thermal zone resume code may use a stale pointer to the next
+ list element and crash, because it does not hold thermal_list_lock
+ while walking thermal_tz_list.
+
+ 2. The thermal zone resume code calls thermal_zone_device_init()
+ outside the zone lock, so user space or an update triggered by
+ the platform firmware may see an inconsistent state of a
+ thermal zone leading to unexpected behavior.
+
+ 3. Clearing the in_suspend global variable in thermal_pm_notify()
+ allows __thermal_zone_device_update() to continue for all thermal
+ zones and it may as well run before the thermal_tz_list walk (or
+ at any point during the list walk for that matter) and attempt to
+ operate on a thermal zone that has not been resumed yet. It may
+ also race destructively with thermal_zone_device_init().
+
+To address these issues, add thermal_list_lock locking to
+thermal_pm_notify(), especially arount the thermal_tz_list,
+make it call thermal_zone_device_init() back-to-back with
+__thermal_zone_device_update() under the zone lock and replace
+in_suspend with per-zone bool "suspend" indicators set and unset
+under the given zone's lock.
+
+Link: https://lore.kernel.org/linux-pm/20231218162348.69101-1-bo.ye@mediatek.com/
+Reported-by: Bo Ye <bo.ye@mediatek.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/thermal/thermal_core.c | 30 +++++++++++++++++++++++-------
+ include/linux/thermal.h | 2 ++
+ 2 files changed, 25 insertions(+), 7 deletions(-)
+
+diff --git a/drivers/thermal/thermal_core.c b/drivers/thermal/thermal_core.c
+index 1bc7ba459406..45f51727410c 100644
+--- a/drivers/thermal/thermal_core.c
++++ b/drivers/thermal/thermal_core.c
+@@ -37,8 +37,6 @@ static LIST_HEAD(thermal_governor_list);
+ static DEFINE_MUTEX(thermal_list_lock);
+ static DEFINE_MUTEX(thermal_governor_lock);
+
+-static atomic_t in_suspend;
+-
+ static struct thermal_governor *def_governor;
+
+ /*
+@@ -405,7 +403,7 @@ void __thermal_zone_device_update(struct thermal_zone_device *tz,
+ {
+ const struct thermal_trip *trip;
+
+- if (atomic_read(&in_suspend))
++ if (tz->suspended)
+ return;
+
+ if (WARN_ONCE(!tz->ops->get_temp,
+@@ -1514,17 +1512,35 @@ static int thermal_pm_notify(struct notifier_block *nb,
+ case PM_HIBERNATION_PREPARE:
+ case PM_RESTORE_PREPARE:
+ case PM_SUSPEND_PREPARE:
+- atomic_set(&in_suspend, 1);
++ mutex_lock(&thermal_list_lock);
++
++ list_for_each_entry(tz, &thermal_tz_list, node) {
++ mutex_lock(&tz->lock);
++
++ tz->suspended = true;
++
++ mutex_unlock(&tz->lock);
++ }
++
++ mutex_unlock(&thermal_list_lock);
+ break;
+ case PM_POST_HIBERNATION:
+ case PM_POST_RESTORE:
+ case PM_POST_SUSPEND:
+- atomic_set(&in_suspend, 0);
++ mutex_lock(&thermal_list_lock);
++
+ list_for_each_entry(tz, &thermal_tz_list, node) {
++ mutex_lock(&tz->lock);
++
++ tz->suspended = false;
++
+ thermal_zone_device_init(tz);
+- thermal_zone_device_update(tz,
+- THERMAL_EVENT_UNSPECIFIED);
++ __thermal_zone_device_update(tz, THERMAL_EVENT_UNSPECIFIED);
++
++ mutex_unlock(&tz->lock);
+ }
++
++ mutex_unlock(&thermal_list_lock);
+ break;
+ default:
+ break;
+diff --git a/include/linux/thermal.h b/include/linux/thermal.h
+index cee814d5d1ac..1da1739d75d9 100644
+--- a/include/linux/thermal.h
++++ b/include/linux/thermal.h
+@@ -149,6 +149,7 @@ struct thermal_cooling_device {
+ * @node: node in thermal_tz_list (in thermal_core.c)
+ * @poll_queue: delayed work for polling
+ * @notify_event: Last notification event
++ * @suspended: thermal zone suspend indicator
+ */
+ struct thermal_zone_device {
+ int id;
+@@ -181,6 +182,7 @@ struct thermal_zone_device {
+ struct list_head node;
+ struct delayed_work poll_queue;
+ enum thermal_notify_event notify_event;
++ bool suspended;
+ };
+
+ /**
+--
+2.43.0
+
--- /dev/null
+From 3a19aa6db53994290f2d5ea89ac924d085937f2b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 3 Jan 2024 21:50:16 -0500
+Subject: tracefs/eventfs: Use root and instance inodes as default ownership
+
+From: Steven Rostedt (Google) <rostedt@goodmis.org>
+
+[ Upstream commit 8186fff7ab649085e2c60d032d9a20a85af1d87c ]
+
+Instead of walking the dentries on mount/remount to update the gid values of
+all the dentries if a gid option is specified on mount, just update the root
+inode. Add .getattr, .setattr, and .permissions on the tracefs inode
+operations to update the permissions of the files and directories.
+
+For all files and directories in the top level instance:
+
+ /sys/kernel/tracing/*
+
+It will use the root inode as the default permissions. The inode that
+represents: /sys/kernel/tracing (or wherever it is mounted).
+
+When an instance is created:
+
+ mkdir /sys/kernel/tracing/instance/foo
+
+The directory "foo" and all its files and directories underneath will use
+the default of what foo is when it was created. A remount of tracefs will
+not affect it.
+
+If a user were to modify the permissions of any file or directory in
+tracefs, it will also no longer be modified by a change in ownership of a
+remount.
+
+The events directory, if it is in the top level instance, will use the
+tracefs root inode as the default ownership for itself and all the files and
+directories below it.
+
+For the events directory in an instance ("foo"), it will keep the ownership
+of what it was when it was created, and that will be used as the default
+ownership for the files and directories beneath it.
+
+Link: https://lore.kernel.org/linux-trace-kernel/CAHk-=wjVdGkjDXBbvLn2wbZnqP4UsH46E3gqJ9m7UG6DpX2+WA@mail.gmail.com/
+Link: https://lore.kernel.org/linux-trace-kernel/20240103215016.1e0c9811@gandalf.local.home
+
+Cc: Masami Hiramatsu <mhiramat@kernel.org>
+Cc: Mathieu Desnoyers <mathieu.desnoyers@efficios.com>
+Cc: Linus Torvalds <torvalds@linux-foundation.org>
+Cc: Al Viro <viro@ZenIV.linux.org.uk>
+Cc: Christian Brauner <brauner@kernel.org>
+Cc: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Steven Rostedt (Google) <rostedt@goodmis.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/tracefs/event_inode.c | 79 +++++++++++++++-
+ fs/tracefs/inode.c | 198 ++++++++++++++++++++++-----------------
+ fs/tracefs/internal.h | 3 +
+ 3 files changed, 190 insertions(+), 90 deletions(-)
+
+diff --git a/fs/tracefs/event_inode.c b/fs/tracefs/event_inode.c
+index f0677ea0ec24..517f1ae1a058 100644
+--- a/fs/tracefs/event_inode.c
++++ b/fs/tracefs/event_inode.c
+@@ -45,6 +45,7 @@ enum {
+ EVENTFS_SAVE_MODE = BIT(16),
+ EVENTFS_SAVE_UID = BIT(17),
+ EVENTFS_SAVE_GID = BIT(18),
++ EVENTFS_TOPLEVEL = BIT(19),
+ };
+
+ #define EVENTFS_MODE_MASK (EVENTFS_SAVE_MODE - 1)
+@@ -117,10 +118,17 @@ static int eventfs_set_attr(struct mnt_idmap *idmap, struct dentry *dentry,
+ * The events directory dentry is never freed, unless its
+ * part of an instance that is deleted. It's attr is the
+ * default for its child files and directories.
+- * Do not update it. It's not used for its own mode or ownership
++ * Do not update it. It's not used for its own mode or ownership.
+ */
+- if (!ei->is_events)
++ if (ei->is_events) {
++ /* But it still needs to know if it was modified */
++ if (iattr->ia_valid & ATTR_UID)
++ ei->attr.mode |= EVENTFS_SAVE_UID;
++ if (iattr->ia_valid & ATTR_GID)
++ ei->attr.mode |= EVENTFS_SAVE_GID;
++ } else {
+ update_attr(&ei->attr, iattr);
++ }
+
+ } else {
+ name = dentry->d_name.name;
+@@ -138,9 +146,66 @@ static int eventfs_set_attr(struct mnt_idmap *idmap, struct dentry *dentry,
+ return ret;
+ }
+
++static void update_top_events_attr(struct eventfs_inode *ei, struct dentry *dentry)
++{
++ struct inode *inode;
++
++ /* Only update if the "events" was on the top level */
++ if (!ei || !(ei->attr.mode & EVENTFS_TOPLEVEL))
++ return;
++
++ /* Get the tracefs root inode. */
++ inode = d_inode(dentry->d_sb->s_root);
++ ei->attr.uid = inode->i_uid;
++ ei->attr.gid = inode->i_gid;
++}
++
++static void set_top_events_ownership(struct inode *inode)
++{
++ struct tracefs_inode *ti = get_tracefs(inode);
++ struct eventfs_inode *ei = ti->private;
++ struct dentry *dentry;
++
++ /* The top events directory doesn't get automatically updated */
++ if (!ei || !ei->is_events || !(ei->attr.mode & EVENTFS_TOPLEVEL))
++ return;
++
++ dentry = ei->dentry;
++
++ update_top_events_attr(ei, dentry);
++
++ if (!(ei->attr.mode & EVENTFS_SAVE_UID))
++ inode->i_uid = ei->attr.uid;
++
++ if (!(ei->attr.mode & EVENTFS_SAVE_GID))
++ inode->i_gid = ei->attr.gid;
++}
++
++static int eventfs_get_attr(struct mnt_idmap *idmap,
++ const struct path *path, struct kstat *stat,
++ u32 request_mask, unsigned int flags)
++{
++ struct dentry *dentry = path->dentry;
++ struct inode *inode = d_backing_inode(dentry);
++
++ set_top_events_ownership(inode);
++
++ generic_fillattr(idmap, request_mask, inode, stat);
++ return 0;
++}
++
++static int eventfs_permission(struct mnt_idmap *idmap,
++ struct inode *inode, int mask)
++{
++ set_top_events_ownership(inode);
++ return generic_permission(idmap, inode, mask);
++}
++
+ static const struct inode_operations eventfs_root_dir_inode_operations = {
+ .lookup = eventfs_root_lookup,
+ .setattr = eventfs_set_attr,
++ .getattr = eventfs_get_attr,
++ .permission = eventfs_permission,
+ };
+
+ static const struct inode_operations eventfs_file_inode_operations = {
+@@ -178,6 +243,8 @@ static struct eventfs_inode *eventfs_find_events(struct dentry *dentry)
+ } while (!ei->is_events);
+ mutex_unlock(&eventfs_mutex);
+
++ update_top_events_attr(ei, dentry);
++
+ return ei;
+ }
+
+@@ -968,6 +1035,14 @@ struct eventfs_inode *eventfs_create_events_dir(const char *name, struct dentry
+ uid = d_inode(dentry->d_parent)->i_uid;
+ gid = d_inode(dentry->d_parent)->i_gid;
+
++ /*
++ * If the events directory is of the top instance, then parent
++ * is NULL. Set the attr.mode to reflect this and its permissions will
++ * default to the tracefs root dentry.
++ */
++ if (!parent)
++ ei->attr.mode = EVENTFS_TOPLEVEL;
++
+ /* This is used as the default ownership of the files and directories */
+ ei->attr.uid = uid;
+ ei->attr.gid = gid;
+diff --git a/fs/tracefs/inode.c b/fs/tracefs/inode.c
+index bc86ffdb103b..e1b172c0e091 100644
+--- a/fs/tracefs/inode.c
++++ b/fs/tracefs/inode.c
+@@ -91,6 +91,7 @@ static int tracefs_syscall_mkdir(struct mnt_idmap *idmap,
+ struct inode *inode, struct dentry *dentry,
+ umode_t mode)
+ {
++ struct tracefs_inode *ti;
+ char *name;
+ int ret;
+
+@@ -98,6 +99,15 @@ static int tracefs_syscall_mkdir(struct mnt_idmap *idmap,
+ if (!name)
+ return -ENOMEM;
+
++ /*
++ * This is a new directory that does not take the default of
++ * the rootfs. It becomes the default permissions for all the
++ * files and directories underneath it.
++ */
++ ti = get_tracefs(inode);
++ ti->flags |= TRACEFS_INSTANCE_INODE;
++ ti->private = inode;
++
+ /*
+ * The mkdir call can call the generic functions that create
+ * the files within the tracefs system. It is up to the individual
+@@ -141,10 +151,76 @@ static int tracefs_syscall_rmdir(struct inode *inode, struct dentry *dentry)
+ return ret;
+ }
+
+-static const struct inode_operations tracefs_dir_inode_operations = {
++static void set_tracefs_inode_owner(struct inode *inode)
++{
++ struct tracefs_inode *ti = get_tracefs(inode);
++ struct inode *root_inode = ti->private;
++
++ /*
++ * If this inode has never been referenced, then update
++ * the permissions to the superblock.
++ */
++ if (!(ti->flags & TRACEFS_UID_PERM_SET))
++ inode->i_uid = root_inode->i_uid;
++
++ if (!(ti->flags & TRACEFS_GID_PERM_SET))
++ inode->i_gid = root_inode->i_gid;
++}
++
++static int tracefs_permission(struct mnt_idmap *idmap,
++ struct inode *inode, int mask)
++{
++ set_tracefs_inode_owner(inode);
++ return generic_permission(idmap, inode, mask);
++}
++
++static int tracefs_getattr(struct mnt_idmap *idmap,
++ const struct path *path, struct kstat *stat,
++ u32 request_mask, unsigned int flags)
++{
++ struct inode *inode = d_backing_inode(path->dentry);
++
++ set_tracefs_inode_owner(inode);
++ generic_fillattr(idmap, request_mask, inode, stat);
++ return 0;
++}
++
++static int tracefs_setattr(struct mnt_idmap *idmap, struct dentry *dentry,
++ struct iattr *attr)
++{
++ unsigned int ia_valid = attr->ia_valid;
++ struct inode *inode = d_inode(dentry);
++ struct tracefs_inode *ti = get_tracefs(inode);
++
++ if (ia_valid & ATTR_UID)
++ ti->flags |= TRACEFS_UID_PERM_SET;
++
++ if (ia_valid & ATTR_GID)
++ ti->flags |= TRACEFS_GID_PERM_SET;
++
++ return simple_setattr(idmap, dentry, attr);
++}
++
++static const struct inode_operations tracefs_instance_dir_inode_operations = {
+ .lookup = simple_lookup,
+ .mkdir = tracefs_syscall_mkdir,
+ .rmdir = tracefs_syscall_rmdir,
++ .permission = tracefs_permission,
++ .getattr = tracefs_getattr,
++ .setattr = tracefs_setattr,
++};
++
++static const struct inode_operations tracefs_dir_inode_operations = {
++ .lookup = simple_lookup,
++ .permission = tracefs_permission,
++ .getattr = tracefs_getattr,
++ .setattr = tracefs_setattr,
++};
++
++static const struct inode_operations tracefs_file_inode_operations = {
++ .permission = tracefs_permission,
++ .getattr = tracefs_getattr,
++ .setattr = tracefs_setattr,
+ };
+
+ struct inode *tracefs_get_inode(struct super_block *sb)
+@@ -183,87 +259,6 @@ struct tracefs_fs_info {
+ struct tracefs_mount_opts mount_opts;
+ };
+
+-static void change_gid(struct dentry *dentry, kgid_t gid)
+-{
+- if (!dentry->d_inode)
+- return;
+- dentry->d_inode->i_gid = gid;
+-}
+-
+-/*
+- * Taken from d_walk, but without he need for handling renames.
+- * Nothing can be renamed while walking the list, as tracefs
+- * does not support renames. This is only called when mounting
+- * or remounting the file system, to set all the files to
+- * the given gid.
+- */
+-static void set_gid(struct dentry *parent, kgid_t gid)
+-{
+- struct dentry *this_parent;
+- struct list_head *next;
+-
+- this_parent = parent;
+- spin_lock(&this_parent->d_lock);
+-
+- change_gid(this_parent, gid);
+-repeat:
+- next = this_parent->d_subdirs.next;
+-resume:
+- while (next != &this_parent->d_subdirs) {
+- struct tracefs_inode *ti;
+- struct list_head *tmp = next;
+- struct dentry *dentry = list_entry(tmp, struct dentry, d_child);
+- next = tmp->next;
+-
+- /* Note, getdents() can add a cursor dentry with no inode */
+- if (!dentry->d_inode)
+- continue;
+-
+- spin_lock_nested(&dentry->d_lock, DENTRY_D_LOCK_NESTED);
+-
+- change_gid(dentry, gid);
+-
+- /* If this is the events directory, update that too */
+- ti = get_tracefs(dentry->d_inode);
+- if (ti && (ti->flags & TRACEFS_EVENT_INODE))
+- eventfs_update_gid(dentry, gid);
+-
+- if (!list_empty(&dentry->d_subdirs)) {
+- spin_unlock(&this_parent->d_lock);
+- spin_release(&dentry->d_lock.dep_map, _RET_IP_);
+- this_parent = dentry;
+- spin_acquire(&this_parent->d_lock.dep_map, 0, 1, _RET_IP_);
+- goto repeat;
+- }
+- spin_unlock(&dentry->d_lock);
+- }
+- /*
+- * All done at this level ... ascend and resume the search.
+- */
+- rcu_read_lock();
+-ascend:
+- if (this_parent != parent) {
+- struct dentry *child = this_parent;
+- this_parent = child->d_parent;
+-
+- spin_unlock(&child->d_lock);
+- spin_lock(&this_parent->d_lock);
+-
+- /* go into the first sibling still alive */
+- do {
+- next = child->d_child.next;
+- if (next == &this_parent->d_subdirs)
+- goto ascend;
+- child = list_entry(next, struct dentry, d_child);
+- } while (unlikely(child->d_flags & DCACHE_DENTRY_KILLED));
+- rcu_read_unlock();
+- goto resume;
+- }
+- rcu_read_unlock();
+- spin_unlock(&this_parent->d_lock);
+- return;
+-}
+-
+ static int tracefs_parse_options(char *data, struct tracefs_mount_opts *opts)
+ {
+ substring_t args[MAX_OPT_ARGS];
+@@ -336,10 +331,8 @@ static int tracefs_apply_options(struct super_block *sb, bool remount)
+ if (!remount || opts->opts & BIT(Opt_uid))
+ inode->i_uid = opts->uid;
+
+- if (!remount || opts->opts & BIT(Opt_gid)) {
+- /* Set all the group ids to the mount option */
+- set_gid(sb->s_root, opts->gid);
+- }
++ if (!remount || opts->opts & BIT(Opt_gid))
++ inode->i_gid = opts->gid;
+
+ return 0;
+ }
+@@ -573,6 +566,26 @@ struct dentry *eventfs_end_creating(struct dentry *dentry)
+ return dentry;
+ }
+
++/* Find the inode that this will use for default */
++static struct inode *instance_inode(struct dentry *parent, struct inode *inode)
++{
++ struct tracefs_inode *ti;
++
++ /* If parent is NULL then use root inode */
++ if (!parent)
++ return d_inode(inode->i_sb->s_root);
++
++ /* Find the inode that is flagged as an instance or the root inode */
++ while (!IS_ROOT(parent)) {
++ ti = get_tracefs(d_inode(parent));
++ if (ti->flags & TRACEFS_INSTANCE_INODE)
++ break;
++ parent = parent->d_parent;
++ }
++
++ return d_inode(parent);
++}
++
+ /**
+ * tracefs_create_file - create a file in the tracefs filesystem
+ * @name: a pointer to a string containing the name of the file to create.
+@@ -603,6 +616,7 @@ struct dentry *tracefs_create_file(const char *name, umode_t mode,
+ struct dentry *parent, void *data,
+ const struct file_operations *fops)
+ {
++ struct tracefs_inode *ti;
+ struct dentry *dentry;
+ struct inode *inode;
+
+@@ -621,7 +635,11 @@ struct dentry *tracefs_create_file(const char *name, umode_t mode,
+ if (unlikely(!inode))
+ return tracefs_failed_creating(dentry);
+
++ ti = get_tracefs(inode);
++ ti->private = instance_inode(parent, inode);
++
+ inode->i_mode = mode;
++ inode->i_op = &tracefs_file_inode_operations;
+ inode->i_fop = fops ? fops : &tracefs_file_operations;
+ inode->i_private = data;
+ inode->i_uid = d_inode(dentry->d_parent)->i_uid;
+@@ -634,6 +652,7 @@ struct dentry *tracefs_create_file(const char *name, umode_t mode,
+ static struct dentry *__create_dir(const char *name, struct dentry *parent,
+ const struct inode_operations *ops)
+ {
++ struct tracefs_inode *ti;
+ struct dentry *dentry = tracefs_start_creating(name, parent);
+ struct inode *inode;
+
+@@ -651,6 +670,9 @@ static struct dentry *__create_dir(const char *name, struct dentry *parent,
+ inode->i_uid = d_inode(dentry->d_parent)->i_uid;
+ inode->i_gid = d_inode(dentry->d_parent)->i_gid;
+
++ ti = get_tracefs(inode);
++ ti->private = instance_inode(parent, inode);
++
+ /* directory inodes start off with i_nlink == 2 (for "." entry) */
+ inc_nlink(inode);
+ d_instantiate(dentry, inode);
+@@ -681,7 +703,7 @@ struct dentry *tracefs_create_dir(const char *name, struct dentry *parent)
+ if (security_locked_down(LOCKDOWN_TRACEFS))
+ return NULL;
+
+- return __create_dir(name, parent, &simple_dir_inode_operations);
++ return __create_dir(name, parent, &tracefs_dir_inode_operations);
+ }
+
+ /**
+@@ -712,7 +734,7 @@ __init struct dentry *tracefs_create_instance_dir(const char *name,
+ if (WARN_ON(tracefs_ops.mkdir || tracefs_ops.rmdir))
+ return NULL;
+
+- dentry = __create_dir(name, parent, &tracefs_dir_inode_operations);
++ dentry = __create_dir(name, parent, &tracefs_instance_dir_inode_operations);
+ if (!dentry)
+ return NULL;
+
+diff --git a/fs/tracefs/internal.h b/fs/tracefs/internal.h
+index 42bdeb471a07..12b7d0150ae9 100644
+--- a/fs/tracefs/internal.h
++++ b/fs/tracefs/internal.h
+@@ -5,6 +5,9 @@
+ enum {
+ TRACEFS_EVENT_INODE = BIT(1),
+ TRACEFS_EVENT_TOP_INODE = BIT(2),
++ TRACEFS_GID_PERM_SET = BIT(3),
++ TRACEFS_UID_PERM_SET = BIT(4),
++ TRACEFS_INSTANCE_INODE = BIT(5),
+ };
+
+ struct tracefs_inode {
+--
+2.43.0
+
--- /dev/null
+From 85655386eaef056ee0c06ea7a0117c3ece7e50f0 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 15:36:56 +0100
+Subject: tty: allow TIOCSLCKTRMIOS with CAP_CHECKPOINT_RESTORE
+
+From: Adrian Reber <areber@redhat.com>
+
+[ Upstream commit e0f25b8992345aa5f113da2815f5add98738c611 ]
+
+The capability CAP_CHECKPOINT_RESTORE was introduced to allow non-root
+users to checkpoint and restore processes as non-root with CRIU.
+
+This change extends CAP_CHECKPOINT_RESTORE to enable the CRIU option
+'--shell-job' as non-root. CRIU's man-page describes the '--shell-job'
+option like this:
+
+ Allow one to dump shell jobs. This implies the restored task will
+ inherit session and process group ID from the criu itself. This option
+ also allows to migrate a single external tty connection, to migrate
+ applications like top.
+
+TIOCSLCKTRMIOS can only be done if the process has CAP_SYS_ADMIN and
+this change extends it to CAP_SYS_ADMIN or CAP_CHECKPOINT_RESTORE.
+
+With this change it is possible to checkpoint and restore processes
+which have a tty connection as non-root if CAP_CHECKPOINT_RESTORE is
+set.
+
+Acked-by: Christian Brauner <brauner@kernel.org>
+Signed-off-by: Adrian Reber <areber@redhat.com>
+Acked-by: Andrei Vagin <avagin@gmail.com>
+Link: https://lore.kernel.org/r/20231208143656.1019-1-areber@redhat.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/tty/tty_ioctl.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/tty/tty_ioctl.c b/drivers/tty/tty_ioctl.c
+index 4b499301a3db..85de90eebc7b 100644
+--- a/drivers/tty/tty_ioctl.c
++++ b/drivers/tty/tty_ioctl.c
+@@ -844,7 +844,7 @@ int tty_mode_ioctl(struct tty_struct *tty, unsigned int cmd, unsigned long arg)
+ ret = -EFAULT;
+ return ret;
+ case TIOCSLCKTRMIOS:
+- if (!capable(CAP_SYS_ADMIN))
++ if (!checkpoint_restore_ns_capable(&init_user_ns))
+ return -EPERM;
+ copy_termios_locked(real_tty, &kterm);
+ if (user_termios_to_kernel_termios(&kterm,
+@@ -861,7 +861,7 @@ int tty_mode_ioctl(struct tty_struct *tty, unsigned int cmd, unsigned long arg)
+ ret = -EFAULT;
+ return ret;
+ case TIOCSLCKTRMIOS:
+- if (!capable(CAP_SYS_ADMIN))
++ if (!checkpoint_restore_ns_capable(&init_user_ns))
+ return -EPERM;
+ copy_termios_locked(real_tty, &kterm);
+ if (user_termios_to_kernel_termios_1(&kterm,
+--
+2.43.0
+
--- /dev/null
+From e2e789446b9f5accd176779dbfb5353c924a992a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 14 Dec 2023 14:02:34 +0800
+Subject: tty: serial: 8250: Set RS422 interface by default to fix Moxa
+ RS422/RS485 PCIe boards
+
+From: Crescent CY Hsieh <crescentcy.hsieh@moxa.com>
+
+[ Upstream commit 43f012df3c1e979966524f79b5371fde6545488a ]
+
+MOXA PCIe RS422/RS485 boards will not function by default because of the
+initial default serial interface of all MOXA PCIe boards is set to
+RS232.
+
+This patch fixes the problem above by setting the initial default serial
+interface to RS422 for those MOXA RS422/RS485 PCIe boards.
+
+Signed-off-by: Crescent CY Hsieh <crescentcy.hsieh@moxa.com>
+Reviewed-by: Jiri Slaby <jirislaby@kernel.org>
+Link: https://lore.kernel.org/r/20231214060234.6147-1-crescentcy.hsieh@moxa.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/tty/serial/8250/8250_pci.c | 58 +++++++++++++++++++++++++++++-
+ 1 file changed, 57 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/tty/serial/8250/8250_pci.c b/drivers/tty/serial/8250/8250_pci.c
+index 614be0f13a31..8ccf691935b7 100644
+--- a/drivers/tty/serial/8250/8250_pci.c
++++ b/drivers/tty/serial/8250/8250_pci.c
+@@ -19,6 +19,7 @@
+ #include <linux/serial_core.h>
+ #include <linux/8250_pci.h>
+ #include <linux/bitops.h>
++#include <linux/bitfield.h>
+
+ #include <asm/byteorder.h>
+ #include <asm/io.h>
+@@ -1970,6 +1971,20 @@ pci_sunix_setup(struct serial_private *priv,
+
+ #define MOXA_GPIO_PIN2 BIT(2)
+
++#define MOXA_RS232 0x00
++#define MOXA_RS422 0x01
++#define MOXA_RS485_4W 0x0B
++#define MOXA_RS485_2W 0x0F
++#define MOXA_UIR_OFFSET 0x04
++#define MOXA_EVEN_RS_MASK GENMASK(3, 0)
++#define MOXA_ODD_RS_MASK GENMASK(7, 4)
++
++enum {
++ MOXA_SUPP_RS232 = BIT(0),
++ MOXA_SUPP_RS422 = BIT(1),
++ MOXA_SUPP_RS485 = BIT(2),
++};
++
+ static bool pci_moxa_is_mini_pcie(unsigned short device)
+ {
+ if (device == PCI_DEVICE_ID_MOXA_CP102N ||
+@@ -1983,13 +1998,54 @@ static bool pci_moxa_is_mini_pcie(unsigned short device)
+ return false;
+ }
+
++static unsigned int pci_moxa_supported_rs(struct pci_dev *dev)
++{
++ switch (dev->device & 0x0F00) {
++ case 0x0000:
++ case 0x0600:
++ return MOXA_SUPP_RS232;
++ case 0x0100:
++ return MOXA_SUPP_RS232 | MOXA_SUPP_RS422 | MOXA_SUPP_RS485;
++ case 0x0300:
++ return MOXA_SUPP_RS422 | MOXA_SUPP_RS485;
++ }
++ return 0;
++}
++
++static int pci_moxa_set_interface(const struct pci_dev *dev,
++ unsigned int port_idx,
++ u8 mode)
++{
++ resource_size_t iobar_addr = pci_resource_start(dev, 2);
++ resource_size_t UIR_addr = iobar_addr + MOXA_UIR_OFFSET + port_idx / 2;
++ u8 val;
++
++ val = inb(UIR_addr);
++
++ if (port_idx % 2) {
++ val &= ~MOXA_ODD_RS_MASK;
++ val |= FIELD_PREP(MOXA_ODD_RS_MASK, mode);
++ } else {
++ val &= ~MOXA_EVEN_RS_MASK;
++ val |= FIELD_PREP(MOXA_EVEN_RS_MASK, mode);
++ }
++ outb(val, UIR_addr);
++
++ return 0;
++}
++
+ static int pci_moxa_init(struct pci_dev *dev)
+ {
+ unsigned short device = dev->device;
+ resource_size_t iobar_addr = pci_resource_start(dev, 2);
+- unsigned int num_ports = (device & 0x00F0) >> 4;
++ unsigned int num_ports = (device & 0x00F0) >> 4, i;
+ u8 val;
+
++ if (!(pci_moxa_supported_rs(dev) & MOXA_SUPP_RS232)) {
++ for (i = 0; i < num_ports; ++i)
++ pci_moxa_set_interface(dev, i, MOXA_RS422);
++ }
++
+ /*
+ * Enable hardware buffer to prevent break signal output when system boots up.
+ * This hardware buffer is only supported on Mini PCIe series.
+--
+2.43.0
+
--- /dev/null
+From 1a92a0128b3a6dff69725dd5d26e98e6ee47255a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 14 Oct 2023 00:10:28 +0500
+Subject: UBSAN: array-index-out-of-bounds in dtSplitRoot
+
+From: Osama Muhammad <osmtendev@gmail.com>
+
+[ Upstream commit 27e56f59bab5ddafbcfe69ad7a4a6ea1279c1b16 ]
+
+Syzkaller reported the following issue:
+
+oop0: detected capacity change from 0 to 32768
+
+UBSAN: array-index-out-of-bounds in fs/jfs/jfs_dtree.c:1971:9
+index -2 is out of range for type 'struct dtslot [128]'
+CPU: 0 PID: 3613 Comm: syz-executor270 Not tainted 6.0.0-syzkaller-09423-g493ffd6605b2 #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 09/22/2022
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1b1/0x28e lib/dump_stack.c:106
+ ubsan_epilogue lib/ubsan.c:151 [inline]
+ __ubsan_handle_out_of_bounds+0xdb/0x130 lib/ubsan.c:283
+ dtSplitRoot+0x8d8/0x1900 fs/jfs/jfs_dtree.c:1971
+ dtSplitUp fs/jfs/jfs_dtree.c:985 [inline]
+ dtInsert+0x1189/0x6b80 fs/jfs/jfs_dtree.c:863
+ jfs_mkdir+0x757/0xb00 fs/jfs/namei.c:270
+ vfs_mkdir+0x3b3/0x590 fs/namei.c:4013
+ do_mkdirat+0x279/0x550 fs/namei.c:4038
+ __do_sys_mkdirat fs/namei.c:4053 [inline]
+ __se_sys_mkdirat fs/namei.c:4051 [inline]
+ __x64_sys_mkdirat+0x85/0x90 fs/namei.c:4051
+ do_syscall_x64 arch/x86/entry/common.c:50 [inline]
+ do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80
+ entry_SYSCALL_64_after_hwframe+0x63/0xcd
+RIP: 0033:0x7fcdc0113fd9
+Code: ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 0f 1f 40 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 c0 ff ff ff f7 d8 64 89 01 48
+RSP: 002b:00007ffeb8bc67d8 EFLAGS: 00000246 ORIG_RAX: 0000000000000102
+RAX: ffffffffffffffda RBX: 0000000000000000 RCX: 00007fcdc0113fd9
+RDX: 0000000000000000 RSI: 0000000020000340 RDI: 0000000000000003
+RBP: 00007fcdc00d37a0 R08: 0000000000000000 R09: 00007fcdc00d37a0
+R10: 00005555559a72c0 R11: 0000000000000246 R12: 00000000f8008000
+R13: 0000000000000000 R14: 00083878000000f8 R15: 0000000000000000
+ </TASK>
+
+The issue is caused when the value of fsi becomes less than -1.
+The check to break the loop when fsi value becomes -1 is present
+but syzbot was able to produce value less than -1 which cause the error.
+This patch simply add the change for the values less than 0.
+
+The patch is tested via syzbot.
+
+Reported-and-tested-by: syzbot+d4b1df2e9d4ded6488ec@syzkaller.appspotmail.com
+Link: https://syzkaller.appspot.com/bug?extid=d4b1df2e9d4ded6488ec
+Signed-off-by: Osama Muhammad <osmtendev@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dtree.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/fs/jfs/jfs_dtree.c b/fs/jfs/jfs_dtree.c
+index 92b7c533407c..f3d3e8b3f50c 100644
+--- a/fs/jfs/jfs_dtree.c
++++ b/fs/jfs/jfs_dtree.c
+@@ -1970,7 +1970,7 @@ static int dtSplitRoot(tid_t tid,
+ do {
+ f = &rp->slot[fsi];
+ fsi = f->next;
+- } while (fsi != -1);
++ } while (fsi >= 0);
+
+ f->next = n;
+ }
+--
+2.43.0
+
--- /dev/null
+From 9ab7b885bed73d0e20df1251914123f06d3ef3f4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 10 Nov 2023 12:03:41 +0100
+Subject: um: Don't use vfprintf() for os_info()
+
+From: Benjamin Berg <benjamin@sipsolutions.net>
+
+[ Upstream commit 236f9fe39b02c15fa5530b53e9cca48354394389 ]
+
+The threads allocated inside the kernel have only a single page of
+stack. Unfortunately, the vfprintf function in standard glibc may use
+too much stack-space, overflowing it.
+
+To make os_info safe to be used by helper threads, use the kernel
+vscnprintf function into a smallish buffer and write out the information
+to stderr.
+
+Signed-off-by: Benjamin Berg <benjamin@sipsolutions.net>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/os-Linux/util.c | 19 +++++++++++++++++--
+ 1 file changed, 17 insertions(+), 2 deletions(-)
+
+diff --git a/arch/um/os-Linux/util.c b/arch/um/os-Linux/util.c
+index fc0f2a9dee5a..1dca4ffbd572 100644
+--- a/arch/um/os-Linux/util.c
++++ b/arch/um/os-Linux/util.c
+@@ -173,23 +173,38 @@ __uml_setup("quiet", quiet_cmd_param,
+ "quiet\n"
+ " Turns off information messages during boot.\n\n");
+
++/*
++ * The os_info/os_warn functions will be called by helper threads. These
++ * have a very limited stack size and using the libc formatting functions
++ * may overflow the stack.
++ * So pull in the kernel vscnprintf and use that instead with a fixed
++ * on-stack buffer.
++ */
++int vscnprintf(char *buf, size_t size, const char *fmt, va_list args);
++
+ void os_info(const char *fmt, ...)
+ {
++ char buf[256];
+ va_list list;
++ int len;
+
+ if (quiet_info)
+ return;
+
+ va_start(list, fmt);
+- vfprintf(stderr, fmt, list);
++ len = vscnprintf(buf, sizeof(buf), fmt, list);
++ fwrite(buf, len, 1, stderr);
+ va_end(list);
+ }
+
+ void os_warn(const char *fmt, ...)
+ {
++ char buf[256];
+ va_list list;
++ int len;
+
+ va_start(list, fmt);
+- vfprintf(stderr, fmt, list);
++ len = vscnprintf(buf, sizeof(buf), fmt, list);
++ fwrite(buf, len, 1, stderr);
+ va_end(list);
+ }
+--
+2.43.0
+
--- /dev/null
+From 8caad6c7ec1422fceb2c9476a517f6871fa5e10f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Sep 2023 15:34:44 +0100
+Subject: um: Fix naming clash between UML and scheduler
+
+From: Anton Ivanov <anton.ivanov@cambridgegreys.com>
+
+[ Upstream commit 541d4e4d435c8b9bfd29f70a1da4a2db97794e0a ]
+
+__cant_sleep was already used and exported by the scheduler.
+The name had to be changed to a UML specific one.
+
+Signed-off-by: Anton Ivanov <anton.ivanov@cambridgegreys.com>
+Reviewed-by: Peter Lafreniere <peter@n8pjl.ca>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/include/shared/kern_util.h | 2 +-
+ arch/um/kernel/process.c | 2 +-
+ arch/um/os-Linux/helper.c | 6 +++---
+ 3 files changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/arch/um/include/shared/kern_util.h b/arch/um/include/shared/kern_util.h
+index d8b8b4f07e42..444bae755b16 100644
+--- a/arch/um/include/shared/kern_util.h
++++ b/arch/um/include/shared/kern_util.h
+@@ -50,7 +50,7 @@ extern void do_uml_exitcalls(void);
+ * Are we disallowed to sleep? Used to choose between GFP_KERNEL and
+ * GFP_ATOMIC.
+ */
+-extern int __cant_sleep(void);
++extern int __uml_cant_sleep(void);
+ extern int get_current_pid(void);
+ extern int copy_from_user_proc(void *to, void *from, int size);
+ extern char *uml_strdup(const char *string);
+diff --git a/arch/um/kernel/process.c b/arch/um/kernel/process.c
+index 106b7da2f8d6..6daffb9d8a8d 100644
+--- a/arch/um/kernel/process.c
++++ b/arch/um/kernel/process.c
+@@ -220,7 +220,7 @@ void arch_cpu_idle(void)
+ um_idle_sleep();
+ }
+
+-int __cant_sleep(void) {
++int __uml_cant_sleep(void) {
+ return in_atomic() || irqs_disabled() || in_interrupt();
+ /* Is in_interrupt() really needed? */
+ }
+diff --git a/arch/um/os-Linux/helper.c b/arch/um/os-Linux/helper.c
+index b459745f52e2..3cb8ac63be6e 100644
+--- a/arch/um/os-Linux/helper.c
++++ b/arch/um/os-Linux/helper.c
+@@ -46,7 +46,7 @@ int run_helper(void (*pre_exec)(void *), void *pre_data, char **argv)
+ unsigned long stack, sp;
+ int pid, fds[2], ret, n;
+
+- stack = alloc_stack(0, __cant_sleep());
++ stack = alloc_stack(0, __uml_cant_sleep());
+ if (stack == 0)
+ return -ENOMEM;
+
+@@ -70,7 +70,7 @@ int run_helper(void (*pre_exec)(void *), void *pre_data, char **argv)
+ data.pre_data = pre_data;
+ data.argv = argv;
+ data.fd = fds[1];
+- data.buf = __cant_sleep() ? uml_kmalloc(PATH_MAX, UM_GFP_ATOMIC) :
++ data.buf = __uml_cant_sleep() ? uml_kmalloc(PATH_MAX, UM_GFP_ATOMIC) :
+ uml_kmalloc(PATH_MAX, UM_GFP_KERNEL);
+ pid = clone(helper_child, (void *) sp, CLONE_VM, &data);
+ if (pid < 0) {
+@@ -121,7 +121,7 @@ int run_helper_thread(int (*proc)(void *), void *arg, unsigned int flags,
+ unsigned long stack, sp;
+ int pid, status, err;
+
+- stack = alloc_stack(0, __cant_sleep());
++ stack = alloc_stack(0, __uml_cant_sleep());
+ if (stack == 0)
+ return -ENOMEM;
+
+--
+2.43.0
+
--- /dev/null
+From 965a1a4b296c507396aaa580d1bc18511b8fecfe Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:49:46 -0700
+Subject: um: net: Fix return type of uml_net_start_xmit()
+
+From: Nathan Chancellor <nathan@kernel.org>
+
+[ Upstream commit 7d748f60a4b82b50bf25fad1bd42d33f049f76aa ]
+
+With clang's kernel control flow integrity (kCFI, CONFIG_CFI_CLANG),
+indirect call targets are validated against the expected function
+pointer prototype to make sure the call target is valid to help mitigate
+ROP attacks. If they are not identical, there is a failure at run time,
+which manifests as either a kernel panic or thread getting killed. A
+warning in clang aims to catch these at compile time, which reveals:
+
+ arch/um/drivers/net_kern.c:353:21: warning: incompatible function pointer types initializing 'netdev_tx_t (*)(struct sk_buff *, struct net_device *)' (aka 'enum netdev_tx (*)(struct sk_buff *, struct net_device *)') with an expression of type 'int (struct sk_buff *, struct net_device *)' [-Wincompatible-function-pointer-types-strict]
+ 353 | .ndo_start_xmit = uml_net_start_xmit,
+ | ^~~~~~~~~~~~~~~~~~
+ 1 warning generated.
+
+->ndo_start_xmit() in 'struct net_device_ops' expects a return type of
+'netdev_tx_t', not 'int'. Adjust the return type of uml_net_start_xmit()
+to match the prototype's to resolve the warning. While UML does not
+currently implement support for kCFI, it could in the future, which
+means this warning becomes a fatal CFI failure at run time.
+
+Reported-by: kernel test robot <lkp@intel.com>
+Closes: https://lore.kernel.org/oe-kbuild-all/202310031340.v1vPh207-lkp@intel.com/
+Acked-by: Anton Ivanov <anton.ivanov@cambridgegreys.com>
+Signed-off-by: Nathan Chancellor <nathan@kernel.org>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/drivers/net_kern.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/um/drivers/net_kern.c b/arch/um/drivers/net_kern.c
+index 3d7836c46507..cabcc501b448 100644
+--- a/arch/um/drivers/net_kern.c
++++ b/arch/um/drivers/net_kern.c
+@@ -204,7 +204,7 @@ static int uml_net_close(struct net_device *dev)
+ return 0;
+ }
+
+-static int uml_net_start_xmit(struct sk_buff *skb, struct net_device *dev)
++static netdev_tx_t uml_net_start_xmit(struct sk_buff *skb, struct net_device *dev)
+ {
+ struct uml_net_private *lp = netdev_priv(dev);
+ unsigned long flags;
+--
+2.43.0
+
--- /dev/null
+From 9ba41f8eca74e3f0052745ae218810b6a4e4a6cc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 25 Oct 2023 22:45:05 +0200
+Subject: um: time-travel: fix time corruption
+
+From: Johannes Berg <johannes.berg@intel.com>
+
+[ Upstream commit abe4eaa8618bb36c2b33e9cdde0499296a23448c ]
+
+In 'basic' time-travel mode (without =inf-cpu or =ext), we
+still get timer interrupts. These can happen at arbitrary
+points in time, i.e. while in timer_read(), which pushes
+time forward just a little bit. Then, if we happen to get
+the interrupt after calculating the new time to push to,
+but before actually finishing that, the interrupt will set
+the time to a value that's incompatible with the forward,
+and we'll crash because time goes backwards when we do the
+forwarding.
+
+Fix this by reading the time_travel_time, calculating the
+adjustment, and doing the adjustment all with interrupts
+disabled.
+
+Reported-by: Vincent Whitchurch <Vincent.Whitchurch@axis.com>
+Signed-off-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/kernel/time.c | 32 +++++++++++++++++++++++++++-----
+ 1 file changed, 27 insertions(+), 5 deletions(-)
+
+diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c
+index fddd1dec27e6..3e270da6b6f6 100644
+--- a/arch/um/kernel/time.c
++++ b/arch/um/kernel/time.c
+@@ -432,9 +432,29 @@ static void time_travel_update_time(unsigned long long next, bool idle)
+ time_travel_del_event(&ne);
+ }
+
++static void time_travel_update_time_rel(unsigned long long offs)
++{
++ unsigned long flags;
++
++ /*
++ * Disable interrupts before calculating the new time so
++ * that a real timer interrupt (signal) can't happen at
++ * a bad time e.g. after we read time_travel_time but
++ * before we've completed updating the time.
++ */
++ local_irq_save(flags);
++ time_travel_update_time(time_travel_time + offs, false);
++ local_irq_restore(flags);
++}
++
+ void time_travel_ndelay(unsigned long nsec)
+ {
+- time_travel_update_time(time_travel_time + nsec, false);
++ /*
++ * Not strictly needed to use _rel() version since this is
++ * only used in INFCPU/EXT modes, but it doesn't hurt and
++ * is more readable too.
++ */
++ time_travel_update_time_rel(nsec);
+ }
+ EXPORT_SYMBOL(time_travel_ndelay);
+
+@@ -568,7 +588,11 @@ static void time_travel_set_start(void)
+ #define time_travel_time 0
+ #define time_travel_ext_waiting 0
+
+-static inline void time_travel_update_time(unsigned long long ns, bool retearly)
++static inline void time_travel_update_time(unsigned long long ns, bool idle)
++{
++}
++
++static inline void time_travel_update_time_rel(unsigned long long offs)
+ {
+ }
+
+@@ -720,9 +744,7 @@ static u64 timer_read(struct clocksource *cs)
+ */
+ if (!irqs_disabled() && !in_interrupt() && !in_softirq() &&
+ !time_travel_ext_waiting)
+- time_travel_update_time(time_travel_time +
+- TIMER_MULTIPLIER,
+- false);
++ time_travel_update_time_rel(TIMER_MULTIPLIER);
+ return time_travel_time / TIMER_MULTIPLIER;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From fbb58c1cfcc0eee55bdf3ef831461a22dbd52812 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 19:18:29 +0100
+Subject: usb: hub: Add quirk to decrease IN-ep poll interval for Microchip
+ USB491x hub
+
+From: Hardik Gajjar <hgajjar@de.adit-jv.com>
+
+[ Upstream commit 855d75cf8311fee156fabb5639bb53757ca83dd4 ]
+
+There is a potential delay in notifying Linux USB drivers of downstream
+USB bus activity when connecting a high-speed or superSpeed device via the
+Microchip USB491x hub. This delay is due to the fixed bInterval value of
+12 in the silicon of the Microchip USB491x hub.
+
+Microchip requested to ignore the device descriptor and decrease that
+value to 9 as it was too late to modify that in silicon.
+
+This patch speeds up the USB enummeration process that helps to pass
+Apple Carplay certifications and improve the User experience when utilizing
+the USB device via Microchip Multihost USB491x Hub.
+
+A new hub quirk HUB_QUIRK_REDUCE_FRAME_INTR_BINTERVAL speeds up
+the notification process for Microchip USB491x hub by limiting
+the maximum bInterval value to 9.
+
+Signed-off-by: Hardik Gajjar <hgajjar@de.adit-jv.com>
+Reviewed-by: Alan Stern <stern@rowland.harvard.edu>
+Link: https://lore.kernel.org/r/20231205181829.127353-2-hgajjar@de.adit-jv.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/usb/core/hub.c | 29 +++++++++++++++++++++++++++++
+ 1 file changed, 29 insertions(+)
+
+diff --git a/drivers/usb/core/hub.c b/drivers/usb/core/hub.c
+index 7deeba174858..ef8d9bda94ac 100644
+--- a/drivers/usb/core/hub.c
++++ b/drivers/usb/core/hub.c
+@@ -47,12 +47,18 @@
+ #define USB_VENDOR_TEXAS_INSTRUMENTS 0x0451
+ #define USB_PRODUCT_TUSB8041_USB3 0x8140
+ #define USB_PRODUCT_TUSB8041_USB2 0x8142
++#define USB_VENDOR_MICROCHIP 0x0424
++#define USB_PRODUCT_USB4913 0x4913
++#define USB_PRODUCT_USB4914 0x4914
++#define USB_PRODUCT_USB4915 0x4915
+ #define HUB_QUIRK_CHECK_PORT_AUTOSUSPEND BIT(0)
+ #define HUB_QUIRK_DISABLE_AUTOSUSPEND BIT(1)
++#define HUB_QUIRK_REDUCE_FRAME_INTR_BINTERVAL BIT(2)
+
+ #define USB_TP_TRANSMISSION_DELAY 40 /* ns */
+ #define USB_TP_TRANSMISSION_DELAY_MAX 65535 /* ns */
+ #define USB_PING_RESPONSE_TIME 400 /* ns */
++#define USB_REDUCE_FRAME_INTR_BINTERVAL 9
+
+ /* Protect struct usb_device->state and ->children members
+ * Note: Both are also protected by ->dev.sem, except that ->state can
+@@ -1904,6 +1910,14 @@ static int hub_probe(struct usb_interface *intf, const struct usb_device_id *id)
+ usb_autopm_get_interface_no_resume(intf);
+ }
+
++ if ((id->driver_info & HUB_QUIRK_REDUCE_FRAME_INTR_BINTERVAL) &&
++ desc->endpoint[0].desc.bInterval > USB_REDUCE_FRAME_INTR_BINTERVAL) {
++ desc->endpoint[0].desc.bInterval =
++ USB_REDUCE_FRAME_INTR_BINTERVAL;
++ /* Tell the HCD about the interrupt ep's new bInterval */
++ usb_set_interface(hdev, 0, 0);
++ }
++
+ if (hub_configure(hub, &desc->endpoint[0].desc) >= 0) {
+ onboard_hub_create_pdevs(hdev, &hub->onboard_hub_devs);
+
+@@ -5895,6 +5909,21 @@ static const struct usb_device_id hub_id_table[] = {
+ .idVendor = USB_VENDOR_TEXAS_INSTRUMENTS,
+ .idProduct = USB_PRODUCT_TUSB8041_USB3,
+ .driver_info = HUB_QUIRK_DISABLE_AUTOSUSPEND},
++ { .match_flags = USB_DEVICE_ID_MATCH_VENDOR
++ | USB_DEVICE_ID_MATCH_PRODUCT,
++ .idVendor = USB_VENDOR_MICROCHIP,
++ .idProduct = USB_PRODUCT_USB4913,
++ .driver_info = HUB_QUIRK_REDUCE_FRAME_INTR_BINTERVAL},
++ { .match_flags = USB_DEVICE_ID_MATCH_VENDOR
++ | USB_DEVICE_ID_MATCH_PRODUCT,
++ .idVendor = USB_VENDOR_MICROCHIP,
++ .idProduct = USB_PRODUCT_USB4914,
++ .driver_info = HUB_QUIRK_REDUCE_FRAME_INTR_BINTERVAL},
++ { .match_flags = USB_DEVICE_ID_MATCH_VENDOR
++ | USB_DEVICE_ID_MATCH_PRODUCT,
++ .idVendor = USB_VENDOR_MICROCHIP,
++ .idProduct = USB_PRODUCT_USB4915,
++ .driver_info = HUB_QUIRK_REDUCE_FRAME_INTR_BINTERVAL},
+ { .match_flags = USB_DEVICE_ID_MATCH_DEV_CLASS,
+ .bDeviceClass = USB_CLASS_HUB},
+ { .match_flags = USB_DEVICE_ID_MATCH_INT_CLASS,
+--
+2.43.0
+
--- /dev/null
+From c64aab842366375c2e88b0c3200d352354cea695 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 19:18:28 +0100
+Subject: usb: hub: Replace hardcoded quirk value with BIT() macro
+
+From: Hardik Gajjar <hgajjar@de.adit-jv.com>
+
+[ Upstream commit 6666ea93d2c422ebeb8039d11e642552da682070 ]
+
+This patch replaces the hardcoded quirk value in the macro with
+BIT().
+
+Signed-off-by: Hardik Gajjar <hgajjar@de.adit-jv.com>
+Reviewed-by: Alan Stern <stern@rowland.harvard.edu>
+Link: https://lore.kernel.org/r/20231205181829.127353-1-hgajjar@de.adit-jv.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/usb/core/hub.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/usb/core/hub.c b/drivers/usb/core/hub.c
+index 87480a6e6d93..7deeba174858 100644
+--- a/drivers/usb/core/hub.c
++++ b/drivers/usb/core/hub.c
+@@ -47,8 +47,8 @@
+ #define USB_VENDOR_TEXAS_INSTRUMENTS 0x0451
+ #define USB_PRODUCT_TUSB8041_USB3 0x8140
+ #define USB_PRODUCT_TUSB8041_USB2 0x8142
+-#define HUB_QUIRK_CHECK_PORT_AUTOSUSPEND 0x01
+-#define HUB_QUIRK_DISABLE_AUTOSUSPEND 0x02
++#define HUB_QUIRK_CHECK_PORT_AUTOSUSPEND BIT(0)
++#define HUB_QUIRK_DISABLE_AUTOSUSPEND BIT(1)
+
+ #define USB_TP_TRANSMISSION_DELAY 40 /* ns */
+ #define USB_TP_TRANSMISSION_DELAY_MAX 65535 /* ns */
+--
+2.43.0
+
--- /dev/null
+From 754b0d4258d8818c1bdc5ad7ef8c148ca58ab7e7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 28 Dec 2023 15:11:13 +0800
+Subject: usb: xhci-plat: fix usb disconnect issue after s4
+
+From: Yinbo Zhu <zhuyinbo@loongson.cn>
+
+[ Upstream commit 6d6887c42e946f43bed2e64571a40c8476a1e4a9 ]
+
+The xhci retaining bogus hardware states cause usb disconnect devices
+connected before hibernation(s4) and refer to the commit 'f3d478858be
+("usb: ohci-platform: fix usb disconnect issue after s4")' which set
+flag "hibernated" as true when resume-from-hibernation and that the
+drivers will reset the hardware to get rid of any existing state and
+make sure resume from hibernation re-enumerates everything for xhci.
+
+Signed-off-by: Yinbo Zhu <zhuyinbo@loongson.cn>
+Link: https://lore.kernel.org/r/20231228071113.1719-1-zhuyinbo@loongson.cn
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/usb/host/xhci-plat.c | 23 +++++++++++++++++++----
+ 1 file changed, 19 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/usb/host/xhci-plat.c b/drivers/usb/host/xhci-plat.c
+index 732cdeb73920..f0853c4478f5 100644
+--- a/drivers/usb/host/xhci-plat.c
++++ b/drivers/usb/host/xhci-plat.c
+@@ -433,7 +433,7 @@ void xhci_plat_remove(struct platform_device *dev)
+ }
+ EXPORT_SYMBOL_GPL(xhci_plat_remove);
+
+-static int __maybe_unused xhci_plat_suspend(struct device *dev)
++static int xhci_plat_suspend(struct device *dev)
+ {
+ struct usb_hcd *hcd = dev_get_drvdata(dev);
+ struct xhci_hcd *xhci = hcd_to_xhci(hcd);
+@@ -461,7 +461,7 @@ static int __maybe_unused xhci_plat_suspend(struct device *dev)
+ return 0;
+ }
+
+-static int __maybe_unused xhci_plat_resume(struct device *dev)
++static int xhci_plat_resume_common(struct device *dev, struct pm_message pmsg)
+ {
+ struct usb_hcd *hcd = dev_get_drvdata(dev);
+ struct xhci_hcd *xhci = hcd_to_xhci(hcd);
+@@ -483,7 +483,7 @@ static int __maybe_unused xhci_plat_resume(struct device *dev)
+ if (ret)
+ goto disable_clks;
+
+- ret = xhci_resume(xhci, PMSG_RESUME);
++ ret = xhci_resume(xhci, pmsg);
+ if (ret)
+ goto disable_clks;
+
+@@ -502,6 +502,16 @@ static int __maybe_unused xhci_plat_resume(struct device *dev)
+ return ret;
+ }
+
++static int xhci_plat_resume(struct device *dev)
++{
++ return xhci_plat_resume_common(dev, PMSG_RESUME);
++}
++
++static int xhci_plat_restore(struct device *dev)
++{
++ return xhci_plat_resume_common(dev, PMSG_RESTORE);
++}
++
+ static int __maybe_unused xhci_plat_runtime_suspend(struct device *dev)
+ {
+ struct usb_hcd *hcd = dev_get_drvdata(dev);
+@@ -524,7 +534,12 @@ static int __maybe_unused xhci_plat_runtime_resume(struct device *dev)
+ }
+
+ const struct dev_pm_ops xhci_plat_pm_ops = {
+- SET_SYSTEM_SLEEP_PM_OPS(xhci_plat_suspend, xhci_plat_resume)
++ .suspend = pm_sleep_ptr(xhci_plat_suspend),
++ .resume = pm_sleep_ptr(xhci_plat_resume),
++ .freeze = pm_sleep_ptr(xhci_plat_suspend),
++ .thaw = pm_sleep_ptr(xhci_plat_resume),
++ .poweroff = pm_sleep_ptr(xhci_plat_suspend),
++ .restore = pm_sleep_ptr(xhci_plat_restore),
+
+ SET_RUNTIME_PM_OPS(xhci_plat_runtime_suspend,
+ xhci_plat_runtime_resume,
+--
+2.43.0
+
--- /dev/null
+From 6d8d756e5a5c7cd6136c13733bca7cc3f4d5383d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 4 Jan 2024 10:09:02 +0800
+Subject: =?UTF-8?q?virtio=5Fnet:=20Fix=20"=E2=80=98%d=E2=80=99=20directive?=
+ =?UTF-8?q?=20writing=20between=201=20and=2011=20bytes=20into=20a=20region?=
+ =?UTF-8?q?=20of=20size=2010"=20warnings?=
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Zhu Yanjun <yanjun.zhu@linux.dev>
+
+[ Upstream commit e3fe8d28c67bf6c291e920c6d04fa22afa14e6e4 ]
+
+Fix the warnings when building virtio_net driver.
+
+"
+drivers/net/virtio_net.c: In function ‘init_vqs’:
+drivers/net/virtio_net.c:4551:48: warning: ‘%d’ directive writing between 1 and 11 bytes into a region of size 10 [-Wformat-overflow=]
+ 4551 | sprintf(vi->rq[i].name, "input.%d", i);
+ | ^~
+In function ‘virtnet_find_vqs’,
+ inlined from ‘init_vqs’ at drivers/net/virtio_net.c:4645:8:
+drivers/net/virtio_net.c:4551:41: note: directive argument in the range [-2147483643, 65534]
+ 4551 | sprintf(vi->rq[i].name, "input.%d", i);
+ | ^~~~~~~~~~
+drivers/net/virtio_net.c:4551:17: note: ‘sprintf’ output between 8 and 18 bytes into a destination of size 16
+ 4551 | sprintf(vi->rq[i].name, "input.%d", i);
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+drivers/net/virtio_net.c: In function ‘init_vqs’:
+drivers/net/virtio_net.c:4552:49: warning: ‘%d’ directive writing between 1 and 11 bytes into a region of size 9 [-Wformat-overflow=]
+ 4552 | sprintf(vi->sq[i].name, "output.%d", i);
+ | ^~
+In function ‘virtnet_find_vqs’,
+ inlined from ‘init_vqs’ at drivers/net/virtio_net.c:4645:8:
+drivers/net/virtio_net.c:4552:41: note: directive argument in the range [-2147483643, 65534]
+ 4552 | sprintf(vi->sq[i].name, "output.%d", i);
+ | ^~~~~~~~~~~
+drivers/net/virtio_net.c:4552:17: note: ‘sprintf’ output between 9 and 19 bytes into a destination of size 16
+ 4552 | sprintf(vi->sq[i].name, "output.%d", i);
+
+"
+
+Reviewed-by: Xuan Zhuo <xuanzhuo@linux.alibaba.com>
+Signed-off-by: Zhu Yanjun <yanjun.zhu@linux.dev>
+Link: https://lore.kernel.org/r/20240104020902.2753599-1-yanjun.zhu@intel.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/virtio_net.c | 9 +++++----
+ 1 file changed, 5 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/net/virtio_net.c b/drivers/net/virtio_net.c
+index 51b1868d2f22..1caf21fd5032 100644
+--- a/drivers/net/virtio_net.c
++++ b/drivers/net/virtio_net.c
+@@ -4096,10 +4096,11 @@ static int virtnet_find_vqs(struct virtnet_info *vi)
+ {
+ vq_callback_t **callbacks;
+ struct virtqueue **vqs;
+- int ret = -ENOMEM;
+- int i, total_vqs;
+ const char **names;
++ int ret = -ENOMEM;
++ int total_vqs;
+ bool *ctx;
++ u16 i;
+
+ /* We expect 1 RX virtqueue followed by 1 TX virtqueue, followed by
+ * possible N-1 RX/TX queue pairs used in multiqueue mode, followed by
+@@ -4136,8 +4137,8 @@ static int virtnet_find_vqs(struct virtnet_info *vi)
+ for (i = 0; i < vi->max_queue_pairs; i++) {
+ callbacks[rxq2vq(i)] = skb_recv_done;
+ callbacks[txq2vq(i)] = skb_xmit_done;
+- sprintf(vi->rq[i].name, "input.%d", i);
+- sprintf(vi->sq[i].name, "output.%d", i);
++ sprintf(vi->rq[i].name, "input.%u", i);
++ sprintf(vi->sq[i].name, "output.%u", i);
+ names[rxq2vq(i)] = vi->rq[i].name;
+ names[txq2vq(i)] = vi->sq[i].name;
+ if (ctx)
+--
+2.43.0
+
--- /dev/null
+From 8d80414d07ed2816da2470dbc2f8e441c7e94994 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 13 Dec 2023 10:45:25 +0100
+Subject: watchdog: it87_wdt: Keep WDTCTRL bit 3 unmodified for IT8784/IT8786
+
+From: Werner Fischer <devlists@wefi.net>
+
+[ Upstream commit d12971849d71781c1e4ffd1117d4878ce233d319 ]
+
+WDTCTRL bit 3 sets the mode choice for the clock input of IT8784/IT8786.
+Some motherboards require this bit to be set to 1 (= PCICLK mode),
+otherwise the watchdog functionality gets broken. The BIOS of those
+motherboards sets WDTCTRL bit 3 already to 1.
+
+Instead of setting all bits of WDTCTRL to 0 by writing 0x00 to it, keep
+bit 3 of it unchanged for IT8784/IT8786 chips. In this way, bit 3 keeps
+the status as set by the BIOS of the motherboard.
+
+Watchdog tests have been successful with this patch with the following
+systems:
+ IT8784: Thomas-Krenn LES plus v2 (YANLING YL-KBRL2 V2)
+ IT8786: Thomas-Krenn LES plus v3 (YANLING YL-CLU L2)
+ IT8786: Thomas-Krenn LES network 6L v2 (YANLING YL-CLU6L)
+
+Link: https://lore.kernel.org/all/140b264d-341f-465b-8715-dacfe84b3f71@roeck-us.net/
+
+Signed-off-by: Werner Fischer <devlists@wefi.net>
+Reviewed-by: Guenter Roeck <linux@roeck-us.net>
+Link: https://lore.kernel.org/r/20231213094525.11849-4-devlists@wefi.net
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Wim Van Sebroeck <wim@linux-watchdog.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/watchdog/it87_wdt.c | 14 +++++++++++++-
+ 1 file changed, 13 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/watchdog/it87_wdt.c b/drivers/watchdog/it87_wdt.c
+index e888b1bdd1f2..8c1ee072f48b 100644
+--- a/drivers/watchdog/it87_wdt.c
++++ b/drivers/watchdog/it87_wdt.c
+@@ -256,6 +256,7 @@ static struct watchdog_device wdt_dev = {
+ static int __init it87_wdt_init(void)
+ {
+ u8 chip_rev;
++ u8 ctrl;
+ int rc;
+
+ rc = superio_enter();
+@@ -315,7 +316,18 @@ static int __init it87_wdt_init(void)
+
+ superio_select(GPIO);
+ superio_outb(WDT_TOV1, WDTCFG);
+- superio_outb(0x00, WDTCTRL);
++
++ switch (chip_type) {
++ case IT8784_ID:
++ case IT8786_ID:
++ ctrl = superio_inb(WDTCTRL);
++ ctrl &= 0x08;
++ superio_outb(ctrl, WDTCTRL);
++ break;
++ default:
++ superio_outb(0x00, WDTCTRL);
++ }
++
+ superio_exit();
+
+ if (timeout < 1 || timeout > max_units * 60) {
+--
+2.43.0
+
--- /dev/null
+From 0d2bb2e94397bbb0bc650d8235823377f4525570 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 08:51:18 +0000
+Subject: watchdog: starfive: add lock annotations to fix context imbalances
+
+From: Ben Dooks <ben.dooks@codethink.co.uk>
+
+[ Upstream commit f77999887235f8c378af343df11a6bcedda5b284 ]
+
+Add the necessary __acquires() and __releases() to the functions
+that take and release the wdt lock to avoid the following sparse
+warnings:
+
+drivers/watchdog/starfive-wdt.c:204:13: warning: context imbalance in 'starfive_wdt_unlock' - wrong count at exit
+drivers/watchdog/starfive-wdt.c:212:9: warning: context imbalance in 'starfive_wdt_lock' - unexpected unlock
+
+Signed-off-by: Ben Dooks <ben.dooks@codethink.co.uk>
+Reviewed-by: Guenter Roeck <linux@roeck-us.net>
+Link: https://lore.kernel.org/r/20231122085118.177589-1-ben.dooks@codethink.co.uk
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Wim Van Sebroeck <wim@linux-watchdog.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/watchdog/starfive-wdt.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/drivers/watchdog/starfive-wdt.c b/drivers/watchdog/starfive-wdt.c
+index 5f501b41faf9..49b38ecc092d 100644
+--- a/drivers/watchdog/starfive-wdt.c
++++ b/drivers/watchdog/starfive-wdt.c
+@@ -202,12 +202,14 @@ static u32 starfive_wdt_ticks_to_sec(struct starfive_wdt *wdt, u32 ticks)
+
+ /* Write unlock-key to unlock. Write other value to lock. */
+ static void starfive_wdt_unlock(struct starfive_wdt *wdt)
++ __acquires(&wdt->lock)
+ {
+ spin_lock(&wdt->lock);
+ writel(wdt->variant->unlock_key, wdt->base + wdt->variant->unlock);
+ }
+
+ static void starfive_wdt_lock(struct starfive_wdt *wdt)
++ __releases(&wdt->lock)
+ {
+ writel(~wdt->variant->unlock_key, wdt->base + wdt->variant->unlock);
+ spin_unlock(&wdt->lock);
+--
+2.43.0
+
--- /dev/null
+From 0bfd3731e85fa69c7759233d17b9643a7b817984 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 17 Nov 2023 08:39:19 +0800
+Subject: wifi: ath11k: fix race due to setting ATH11K_FLAG_EXT_IRQ_ENABLED too
+ early
+
+From: Baochen Qiang <quic_bqiang@quicinc.com>
+
+[ Upstream commit 5082b3e3027eae393a4e86874bffb4ce3f83c26e ]
+
+We are seeing below error randomly in the case where only
+one MSI vector is configured:
+
+kernel: ath11k_pci 0000:03:00.0: wmi command 16387 timeout
+
+The reason is, currently, in ath11k_pcic_ext_irq_enable(),
+ATH11K_FLAG_EXT_IRQ_ENABLED is set before NAPI is enabled.
+This results in a race condition: after
+ATH11K_FLAG_EXT_IRQ_ENABLED is set but before NAPI enabled,
+CE interrupt breaks in. Since IRQ is shared by CE and data
+path, ath11k_pcic_ext_interrupt_handler() is also called
+where we call disable_irq_nosync() to disable IRQ. Then
+napi_schedule() is called but it does nothing because NAPI
+is not enabled at that time, meaning
+ath11k_pcic_ext_grp_napi_poll() will never run, so we have
+no chance to call enable_irq() to enable IRQ back. Finally
+we get above error.
+
+Fix it by setting ATH11K_FLAG_EXT_IRQ_ENABLED after all
+NAPI and IRQ work are done. With the fix, we are sure that
+by the time ATH11K_FLAG_EXT_IRQ_ENABLED is set, NAPI is
+enabled.
+
+Note that the fix above also introduce some side effects:
+if ath11k_pcic_ext_interrupt_handler() breaks in after NAPI
+enabled but before ATH11K_FLAG_EXT_IRQ_ENABLED set, nothing
+will be done by the handler this time, the work will be
+postponed till the next time the IRQ fires.
+
+Tested-on: WCN6855 hw2.1 PCI WLAN.HSP.1.1-03125-QCAHSPSWPL_V1_V2_SILICONZ_LITE-3.6510.23
+
+Signed-off-by: Baochen Qiang <quic_bqiang@quicinc.com>
+Acked-by: Jeff Johnson <quic_jjohnson@quicinc.com>
+Signed-off-by: Kalle Valo <quic_kvalo@quicinc.com>
+Link: https://lore.kernel.org/r/20231117003919.26218-1-quic_bqiang@quicinc.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ath/ath11k/pcic.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/wireless/ath/ath11k/pcic.c b/drivers/net/wireless/ath/ath11k/pcic.c
+index 16d1e332193f..e602d4130105 100644
+--- a/drivers/net/wireless/ath/ath11k/pcic.c
++++ b/drivers/net/wireless/ath/ath11k/pcic.c
+@@ -460,8 +460,6 @@ void ath11k_pcic_ext_irq_enable(struct ath11k_base *ab)
+ {
+ int i;
+
+- set_bit(ATH11K_FLAG_EXT_IRQ_ENABLED, &ab->dev_flags);
+-
+ for (i = 0; i < ATH11K_EXT_IRQ_GRP_NUM_MAX; i++) {
+ struct ath11k_ext_irq_grp *irq_grp = &ab->ext_irq_grp[i];
+
+@@ -471,6 +469,8 @@ void ath11k_pcic_ext_irq_enable(struct ath11k_base *ab)
+ }
+ ath11k_pcic_ext_grp_enable(irq_grp);
+ }
++
++ set_bit(ATH11K_FLAG_EXT_IRQ_ENABLED, &ab->dev_flags);
+ }
+ EXPORT_SYMBOL(ath11k_pcic_ext_irq_enable);
+
+--
+2.43.0
+
--- /dev/null
+From a588cc32cbfbd161732afe89f2e5b4d901e172b9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 18:09:48 +0200
+Subject: wifi: ath12k: fix and enable AP mode for WCN7850
+
+From: Kang Yang <quic_kangyang@quicinc.com>
+
+[ Upstream commit ed7e818a7b501012038d6bc6fedadaf7375a380a ]
+
+For AP mode, the peer is created earlier in ath12k_mac_op_add_interface() but
+ath12k_mac_op_assign_vif_chanctx() will try to create peer again. Then an
+error will return which makes AP mode startup fail.
+
+Kernel log:
+
+[ 5017.665006] ath12k_pci 0000:04:00.0: failed to create peer after vdev start delay: -22
+
+wpa_supplicant log:
+
+Failed to set beacon parameters
+Interface initialization failed
+wls1: interface state UNINITIALIZED->DISABLED
+wls1: AP-DISABLED
+wls1: Unable to setup interface.
+Failed to initialize AP interface
+wls1: interface state DISABLED->DISABLED
+wls1: AP-DISABLED
+
+So fix this check and enable AP mode for WCN7850, as now AP mode works normally.
+
+Tested-on: WCN7850 hw2.0 PCI WLAN.HMT.1.0-03427-QCAHMTSWPL_V1.0_V2.0_SILICONZ-1.15378.4
+
+Signed-off-by: Kang Yang <quic_kangyang@quicinc.com>
+Acked-by: Jeff Johnson <quic_jjohnson@quicinc.com>
+Signed-off-by: Kalle Valo <quic_kvalo@quicinc.com>
+Link: https://lore.kernel.org/r/20231121022459.17209-1-quic_kangyang@quicinc.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ath/ath12k/hw.c | 3 ++-
+ drivers/net/wireless/ath/ath12k/mac.c | 4 ++--
+ 2 files changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/net/wireless/ath/ath12k/hw.c b/drivers/net/wireless/ath/ath12k/hw.c
+index 2245fb510ba2..b55cf33e37bd 100644
+--- a/drivers/net/wireless/ath/ath12k/hw.c
++++ b/drivers/net/wireless/ath/ath12k/hw.c
+@@ -949,7 +949,8 @@ static const struct ath12k_hw_params ath12k_hw_params[] = {
+ .rx_mac_buf_ring = true,
+ .vdev_start_delay = true,
+
+- .interface_modes = BIT(NL80211_IFTYPE_STATION),
++ .interface_modes = BIT(NL80211_IFTYPE_STATION) |
++ BIT(NL80211_IFTYPE_AP),
+ .supports_monitor = false,
+
+ .idle_ps = true,
+diff --git a/drivers/net/wireless/ath/ath12k/mac.c b/drivers/net/wireless/ath/ath12k/mac.c
+index fc0d14ea328e..b698e55a5b7b 100644
+--- a/drivers/net/wireless/ath/ath12k/mac.c
++++ b/drivers/net/wireless/ath/ath12k/mac.c
+@@ -6380,8 +6380,8 @@ ath12k_mac_op_assign_vif_chanctx(struct ieee80211_hw *hw,
+ }
+
+ if (ab->hw_params->vdev_start_delay &&
+- (arvif->vdev_type == WMI_VDEV_TYPE_AP ||
+- arvif->vdev_type == WMI_VDEV_TYPE_MONITOR)) {
++ arvif->vdev_type != WMI_VDEV_TYPE_AP &&
++ arvif->vdev_type != WMI_VDEV_TYPE_MONITOR) {
+ param.vdev_id = arvif->vdev_id;
+ param.peer_type = WMI_PEER_TYPE_DEFAULT;
+ param.peer_addr = ar->mac_addr;
+--
+2.43.0
+
--- /dev/null
+From 0801ffdd94ac4b95714ae913bfbbacb0c4a60999 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 22:17:59 +0800
+Subject: wifi: ath12k: fix the issue that the multicast/broadcast indicator is
+ not read correctly for WCN7850
+
+From: Lingbo Kong <quic_lingbok@quicinc.com>
+
+[ Upstream commit 7133b072dfbfac8763ffb017642c9c894894c50d ]
+
+We observe some packets are discarded in ieee80211_rx_handlers_result
+function for WCN7850. This is because the way to get multicast/broadcast
+indicator with RX_MSDU_END_INFO5_DA_IS_MCBC & info5 is incorrect. It should
+use RX_MSDU_END_INFO13_MCAST_BCAST & info13 to get multicast/broadcast
+indicator.
+
+Tested-on: WCN7850 hw2.0 PCI WLAN.HMT.1.0-03427-QCAHMTSWPL_V1.0_V2.0_SILICONZ-1.15378.4
+
+Signed-off-by: Lingbo Kong <quic_lingbok@quicinc.com>
+Signed-off-by: Kalle Valo <quic_kvalo@quicinc.com>
+Link: https://lore.kernel.org/r/20231206141759.5430-1-quic_lingbok@quicinc.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ath/ath12k/hal.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/wireless/ath/ath12k/hal.c b/drivers/net/wireless/ath/ath12k/hal.c
+index eca86fc25a60..b896dfe66dad 100644
+--- a/drivers/net/wireless/ath/ath12k/hal.c
++++ b/drivers/net/wireless/ath/ath12k/hal.c
+@@ -889,8 +889,8 @@ static u8 *ath12k_hw_wcn7850_rx_desc_mpdu_start_addr2(struct hal_rx_desc *desc)
+
+ static bool ath12k_hw_wcn7850_rx_desc_is_da_mcbc(struct hal_rx_desc *desc)
+ {
+- return __le16_to_cpu(desc->u.wcn7850.msdu_end.info5) &
+- RX_MSDU_END_INFO5_DA_IS_MCBC;
++ return __le32_to_cpu(desc->u.wcn7850.msdu_end.info13) &
++ RX_MSDU_END_INFO13_MCAST_BCAST;
+ }
+
+ static void ath12k_hw_wcn7850_rx_desc_get_dot11_hdr(struct hal_rx_desc *desc,
+--
+2.43.0
+
--- /dev/null
+From 4bdcc8509ad8c145c2bc9405e2f065cb269e80ff Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 20:31:04 +0200
+Subject: wifi: ath9k: Fix potential array-index-out-of-bounds read in
+ ath9k_htc_txstatus()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Minsuk Kang <linuxlovemin@yonsei.ac.kr>
+
+[ Upstream commit 2adc886244dff60f948497b59affb6c6ebb3c348 ]
+
+Fix an array-index-out-of-bounds read in ath9k_htc_txstatus(). The bug
+occurs when txs->cnt, data from a URB provided by a USB device, is
+bigger than the size of the array txs->txstatus, which is
+HTC_MAX_TX_STATUS. WARN_ON() already checks it, but there is no bug
+handling code after the check. Make the function return if that is the
+case.
+
+Found by a modified version of syzkaller.
+
+UBSAN: array-index-out-of-bounds in htc_drv_txrx.c
+index 13 is out of range for type '__wmi_event_txstatus [12]'
+Call Trace:
+ ath9k_htc_txstatus
+ ath9k_wmi_event_tasklet
+ tasklet_action_common
+ __do_softirq
+ irq_exit_rxu
+ sysvec_apic_timer_interrupt
+
+Signed-off-by: Minsuk Kang <linuxlovemin@yonsei.ac.kr>
+Acked-by: Toke Høiland-Jørgensen <toke@toke.dk>
+Signed-off-by: Kalle Valo <quic_kvalo@quicinc.com>
+Link: https://lore.kernel.org/r/20231113065756.1491991-1-linuxlovemin@yonsei.ac.kr
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ath/ath9k/htc_drv_txrx.c | 5 +++--
+ 1 file changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c b/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c
+index 800177021baf..efcaeccb055a 100644
+--- a/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c
++++ b/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c
+@@ -652,9 +652,10 @@ void ath9k_htc_txstatus(struct ath9k_htc_priv *priv, void *wmi_event)
+ struct ath9k_htc_tx_event *tx_pend;
+ int i;
+
+- for (i = 0; i < txs->cnt; i++) {
+- WARN_ON(txs->cnt > HTC_MAX_TX_STATUS);
++ if (WARN_ON_ONCE(txs->cnt > HTC_MAX_TX_STATUS))
++ return;
+
++ for (i = 0; i < txs->cnt; i++) {
+ __txs = &txs->txstatus[i];
+
+ skb = ath9k_htc_tx_get_packet(priv, __txs);
+--
+2.43.0
+
--- /dev/null
+From 3faa0968da60a25d73002adf23a00f05f01fdc2e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 3 Jan 2024 20:13:51 +0800
+Subject: wifi: cfg80211: fix RCU dereference in __cfg80211_bss_update
+
+From: Edward Adam Davis <eadavis@qq.com>
+
+[ Upstream commit 1184950e341c11b6f82bc5b59564411d9537ab27 ]
+
+Replace rcu_dereference() with rcu_access_pointer() since we hold
+the lock here (and aren't in an RCU critical section).
+
+Fixes: 32af9a9e1069 ("wifi: cfg80211: free beacon_ies when overridden from hidden BSS")
+Reported-and-tested-by: syzbot+864a269c27ee06b58374@syzkaller.appspotmail.com
+Signed-off-by: Edward Adam Davis <eadavis@qq.com>
+Link: https://msgid.link/tencent_BF8F0DF0258C8DBF124CDDE4DD8D992DCF07@qq.com
+Signed-off-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/wireless/scan.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/net/wireless/scan.c b/net/wireless/scan.c
+index 082f0bd4ebdd..b9da6f5152cb 100644
+--- a/net/wireless/scan.c
++++ b/net/wireless/scan.c
+@@ -1865,7 +1865,7 @@ __cfg80211_bss_update(struct cfg80211_registered_device *rdev,
+ &hidden->hidden_list);
+ hidden->refcount++;
+
+- ies = (void *)rcu_dereference(new->pub.beacon_ies);
++ ies = (void *)rcu_access_pointer(new->pub.beacon_ies);
+ rcu_assign_pointer(new->pub.beacon_ies,
+ hidden->pub.beacon_ies);
+ if (ies)
+--
+2.43.0
+
--- /dev/null
+From 8b6f86e70fee0a5937c52cf6fad9c1440fd661d6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 20 Dec 2023 13:41:41 +0200
+Subject: wifi: cfg80211: free beacon_ies when overridden from hidden BSS
+
+From: Benjamin Berg <benjamin.berg@intel.com>
+
+[ Upstream commit 32af9a9e1069e55bc02741fb00ac9d0ca1a2eaef ]
+
+This is a more of a cosmetic fix. The branch will only be taken if
+proberesp_ies is set, which implies that beacon_ies is not set unless we
+are connected to an AP that just did a channel switch. And, in that case
+we should have found the BSS in the internal storage to begin with.
+
+Signed-off-by: Benjamin Berg <benjamin.berg@intel.com>
+Reviewed-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Miri Korenblit <miriam.rachel.korenblit@intel.com>
+Link: https://msgid.link/20231220133549.b898e22dadff.Id8c4c10aedd176ef2e18a4cad747b299f150f9df@changeid
+Signed-off-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/wireless/scan.c | 4 ++++
+ 1 file changed, 4 insertions(+)
+
+diff --git a/net/wireless/scan.c b/net/wireless/scan.c
+index 0d6c3fc1238a..082f0bd4ebdd 100644
+--- a/net/wireless/scan.c
++++ b/net/wireless/scan.c
+@@ -1864,8 +1864,12 @@ __cfg80211_bss_update(struct cfg80211_registered_device *rdev,
+ list_add(&new->hidden_list,
+ &hidden->hidden_list);
+ hidden->refcount++;
++
++ ies = (void *)rcu_dereference(new->pub.beacon_ies);
+ rcu_assign_pointer(new->pub.beacon_ies,
+ hidden->pub.beacon_ies);
++ if (ies)
++ kfree_rcu(ies, rcu_head);
+ }
+ } else {
+ /*
+--
+2.43.0
+
--- /dev/null
+From 763473db48ae31424a222085805b76ae3b49fece Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 2 Nov 2023 18:03:02 +0800
+Subject: wifi: mt76: connac: fix EHT phy mode check
+
+From: MeiChia Chiu <meichia.chiu@mediatek.com>
+
+[ Upstream commit 2c2f50bf6407e1fd43a1a257916aeaa5ffdacd6c ]
+
+Add a BSS eht_support check before returning EHT phy mode. Without this
+patch, there might be an inconsistency where the softmac layer thinks
+the BSS is in HE mode, while the FW thinks it is in EHT mode.
+
+Signed-off-by: MeiChia Chiu <meichia.chiu@mediatek.com>
+Signed-off-by: Shayne Chen <shayne.chen@mediatek.com>
+Signed-off-by: Felix Fietkau <nbd@nbd.name>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/mediatek/mt76/mt76_connac_mcu.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/net/wireless/mediatek/mt76/mt76_connac_mcu.c b/drivers/net/wireless/mediatek/mt76/mt76_connac_mcu.c
+index ae6bf3c968df..b475555097ff 100644
+--- a/drivers/net/wireless/mediatek/mt76/mt76_connac_mcu.c
++++ b/drivers/net/wireless/mediatek/mt76/mt76_connac_mcu.c
+@@ -1359,7 +1359,7 @@ u8 mt76_connac_get_phy_mode_ext(struct mt76_phy *phy, struct ieee80211_vif *vif,
+ sband = phy->hw->wiphy->bands[band];
+ eht_cap = ieee80211_get_eht_iftype_cap(sband, vif->type);
+
+- if (!eht_cap || !eht_cap->has_eht)
++ if (!eht_cap || !eht_cap->has_eht || !vif->bss_conf.eht_support)
+ return mode;
+
+ switch (band) {
+--
+2.43.0
+
--- /dev/null
+From cef69f4f272d2132fae2f96ef866d1e54abf2dde Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 13 Nov 2023 15:06:19 +0800
+Subject: wifi: mt76: mt7996: add PCI IDs for mt7992
+
+From: StanleyYP Wang <StanleyYP.Wang@mediatek.com>
+
+[ Upstream commit 3d3f117a259a65353bf2714a18e25731b3ca5770 ]
+
+Add PCI device IDs to enable mt7992 chipsets support.
+
+Signed-off-by: StanleyYP Wang <StanleyYP.Wang@mediatek.com>
+Signed-off-by: Shayne Chen <shayne.chen@mediatek.com>
+Signed-off-by: Felix Fietkau <nbd@nbd.name>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/mediatek/mt76/mt7996/pci.c | 8 ++++++--
+ 1 file changed, 6 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/wireless/mediatek/mt76/mt7996/pci.c b/drivers/net/wireless/mediatek/mt76/mt7996/pci.c
+index c5301050ff8b..67c015896243 100644
+--- a/drivers/net/wireless/mediatek/mt76/mt7996/pci.c
++++ b/drivers/net/wireless/mediatek/mt76/mt7996/pci.c
+@@ -17,11 +17,13 @@ static u32 hif_idx;
+
+ static const struct pci_device_id mt7996_pci_device_table[] = {
+ { PCI_DEVICE(PCI_VENDOR_ID_MEDIATEK, 0x7990) },
++ { PCI_DEVICE(PCI_VENDOR_ID_MEDIATEK, 0x7992) },
+ { },
+ };
+
+ static const struct pci_device_id mt7996_hif_device_table[] = {
+ { PCI_DEVICE(PCI_VENDOR_ID_MEDIATEK, 0x7991) },
++ { PCI_DEVICE(PCI_VENDOR_ID_MEDIATEK, 0x799a) },
+ { },
+ };
+
+@@ -60,7 +62,9 @@ static void mt7996_put_hif2(struct mt7996_hif *hif)
+ static struct mt7996_hif *mt7996_pci_init_hif2(struct pci_dev *pdev)
+ {
+ hif_idx++;
+- if (!pci_get_device(PCI_VENDOR_ID_MEDIATEK, 0x7991, NULL))
++
++ if (!pci_get_device(PCI_VENDOR_ID_MEDIATEK, 0x7991, NULL) &&
++ !pci_get_device(PCI_VENDOR_ID_MEDIATEK, 0x799a, NULL))
+ return NULL;
+
+ writel(hif_idx | MT_PCIE_RECOG_ID_SEM,
+@@ -113,7 +117,7 @@ static int mt7996_pci_probe(struct pci_dev *pdev,
+
+ mt76_pci_disable_aspm(pdev);
+
+- if (id->device == 0x7991)
++ if (id->device == 0x7991 || id->device == 0x799a)
+ return mt7996_pci_hif2_probe(pdev);
+
+ dev = mt7996_mmio_probe(&pdev->dev, pcim_iomap_table(pdev)[0],
+--
+2.43.0
+
--- /dev/null
+From 109a6888cc558d9b2ccf4a899101391b9a7624dc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 9 Nov 2023 12:38:51 +0800
+Subject: wifi: rt2x00: correct wrong BBP register in RxDCOC calibration
+
+From: Shiji Yang <yangshiji66@outlook.com>
+
+[ Upstream commit 50da74e1e8b682853d1e07fc8bbe3a0774ae5e09 ]
+
+Refer to Mediatek vendor driver RxDCOC_Calibration() function, when
+performing gainfreeze calibration, we should write register 140
+instead of 141. This fix can reduce the total calibration time from
+6 seconds to 1 second.
+
+Signed-off-by: Shiji Yang <yangshiji66@outlook.com>
+Acked-by: Stanislaw Gruszka <stf_xl@wp.pl>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/TYAP286MB0315B13B89DF57B6B27BB854BCAFA@TYAP286MB0315.JPNP286.PROD.OUTLOOK.COM
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ralink/rt2x00/rt2800lib.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/net/wireless/ralink/rt2x00/rt2800lib.c b/drivers/net/wireless/ralink/rt2x00/rt2800lib.c
+index ee880f749b3c..1926ffdffb4f 100644
+--- a/drivers/net/wireless/ralink/rt2x00/rt2800lib.c
++++ b/drivers/net/wireless/ralink/rt2x00/rt2800lib.c
+@@ -8659,7 +8659,7 @@ static void rt2800_rxdcoc_calibration(struct rt2x00_dev *rt2x00dev)
+ rt2800_rfcsr_write_bank(rt2x00dev, 5, 4, saverfb5r4);
+ rt2800_rfcsr_write_bank(rt2x00dev, 7, 4, saverfb7r4);
+
+- rt2800_bbp_write(rt2x00dev, 158, 141);
++ rt2800_bbp_write(rt2x00dev, 158, 140);
+ bbpreg = rt2800_bbp_read(rt2x00dev, 159);
+ bbpreg = bbpreg & (~0x40);
+ rt2800_bbp_write(rt2x00dev, 159, bbpreg);
+--
+2.43.0
+
--- /dev/null
+From b208c463a2b7bc91939d795536667da98afaac75 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 4 Nov 2023 16:58:00 +0800
+Subject: wifi: rt2x00: restart beacon queue when hardware reset
+
+From: Shiji Yang <yangshiji66@outlook.com>
+
+[ Upstream commit a11d965a218f0cd95b13fe44d0bcd8a20ce134a8 ]
+
+When a hardware reset is triggered, all registers are reset, so all
+queues are forced to stop in hardware interface. However, mac80211
+will not automatically stop the queue. If we don't manually stop the
+beacon queue, the queue will be deadlocked and unable to start again.
+This patch fixes the issue where Apple devices cannot connect to the
+AP after calling ieee80211_restart_hw().
+
+Signed-off-by: Shiji Yang <yangshiji66@outlook.com>
+Acked-by: Stanislaw Gruszka <stf_xl@wp.pl>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/TYAP286MB031530EB6D98DCE4DF20766CBCA4A@TYAP286MB0315.JPNP286.PROD.OUTLOOK.COM
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ralink/rt2x00/rt2x00dev.c | 3 +++
+ drivers/net/wireless/ralink/rt2x00/rt2x00mac.c | 11 +++++++++++
+ 2 files changed, 14 insertions(+)
+
+diff --git a/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c b/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c
+index c88ce446e117..9e7d9dbe954c 100644
+--- a/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c
++++ b/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c
+@@ -101,6 +101,7 @@ void rt2x00lib_disable_radio(struct rt2x00_dev *rt2x00dev)
+ rt2x00link_stop_tuner(rt2x00dev);
+ rt2x00queue_stop_queues(rt2x00dev);
+ rt2x00queue_flush_queues(rt2x00dev, true);
++ rt2x00queue_stop_queue(rt2x00dev->bcn);
+
+ /*
+ * Disable radio.
+@@ -1286,6 +1287,7 @@ int rt2x00lib_start(struct rt2x00_dev *rt2x00dev)
+ rt2x00dev->intf_ap_count = 0;
+ rt2x00dev->intf_sta_count = 0;
+ rt2x00dev->intf_associated = 0;
++ rt2x00dev->intf_beaconing = 0;
+
+ /* Enable the radio */
+ retval = rt2x00lib_enable_radio(rt2x00dev);
+@@ -1312,6 +1314,7 @@ void rt2x00lib_stop(struct rt2x00_dev *rt2x00dev)
+ rt2x00dev->intf_ap_count = 0;
+ rt2x00dev->intf_sta_count = 0;
+ rt2x00dev->intf_associated = 0;
++ rt2x00dev->intf_beaconing = 0;
+ }
+
+ static inline void rt2x00lib_set_if_combinations(struct rt2x00_dev *rt2x00dev)
+diff --git a/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c b/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c
+index 4202c6517783..75fda72c14ca 100644
+--- a/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c
++++ b/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c
+@@ -598,6 +598,17 @@ void rt2x00mac_bss_info_changed(struct ieee80211_hw *hw,
+ */
+ if (changes & BSS_CHANGED_BEACON_ENABLED) {
+ mutex_lock(&intf->beacon_skb_mutex);
++
++ /*
++ * Clear the 'enable_beacon' flag and clear beacon because
++ * the beacon queue has been stopped after hardware reset.
++ */
++ if (test_bit(DEVICE_STATE_RESET, &rt2x00dev->flags) &&
++ intf->enable_beacon) {
++ intf->enable_beacon = false;
++ rt2x00queue_clear_beacon(rt2x00dev, vif);
++ }
++
+ if (!bss_conf->enable_beacon && intf->enable_beacon) {
+ rt2x00dev->intf_beaconing--;
+ intf->enable_beacon = false;
+--
+2.43.0
+
--- /dev/null
+From 0357b94e1814aacbe6691696794ccbe9d0634b50 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 17 Dec 2023 20:30:17 +0800
+Subject: wifi: rtl8xxxu: Add additional USB IDs for RTL8192EU devices
+
+From: Zenm Chen <zenmchen@gmail.com>
+
+[ Upstream commit 4e87ca403e2008b9e182239e1abbf6876a55eb33 ]
+
+Add additional USB IDs found in the vendor driver from
+https://github.com/Mange/rtl8192eu-linux-driver to support more
+RTL8192EU devices.
+
+Signed-off-by: Zenm Chen <zenmchen@gmail.com>
+Reviewed-by: Ping-Ke Shih <pkshih@realtek.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://msgid.link/20231217123017.1982-1-zenmchen@gmail.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c | 12 ++++++++++++
+ 1 file changed, 12 insertions(+)
+
+diff --git a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c
+index 43ee7592bc6e..180907319e8c 100644
+--- a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c
++++ b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c
+@@ -7961,6 +7961,18 @@ static const struct usb_device_id dev_table[] = {
+ .driver_info = (unsigned long)&rtl8192eu_fops},
+ {USB_DEVICE_AND_INTERFACE_INFO(USB_VENDOR_ID_REALTEK, 0x818c, 0xff, 0xff, 0xff),
+ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* D-Link DWA-131 rev C1 */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2001, 0x3312, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* TP-Link TL-WN8200ND V2 */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2357, 0x0126, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* Mercusys MW300UM */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2c4e, 0x0100, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* Mercusys MW300UH */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2c4e, 0x0104, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
+ #endif
+ { }
+ };
+--
+2.43.0
+
--- /dev/null
+From c12c939e972f1e3d6d7622cf6e1f49fb7f1fa109 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 14:57:39 +0800
+Subject: wifi: rtlwifi: rtl8723{be,ae}: using calculate_bit_shift()
+
+From: Su Hui <suhui@nfschina.com>
+
+[ Upstream commit 5c16618bc06a41ad68fd8499a21d35ef57ca06c2 ]
+
+Using calculate_bit_shift() to replace rtl8723_phy_calculate_bit_shift().
+And fix an undefined bitwise shift behavior problem.
+
+Signed-off-by: Su Hui <suhui@nfschina.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://msgid.link/20231219065739.1895666-12-suhui@nfschina.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c | 6 +++---
+ drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c | 4 ++--
+ 2 files changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c b/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c
+index fe9b407dc2af..71e29b103da5 100644
+--- a/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c
++++ b/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c
+@@ -49,7 +49,7 @@ u32 rtl8723e_phy_query_rf_reg(struct ieee80211_hw *hw,
+ rfpath, regaddr);
+ }
+
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ readback_value = (original_value & bitmask) >> bitshift;
+
+ spin_unlock(&rtlpriv->locks.rf_lock);
+@@ -80,7 +80,7 @@ void rtl8723e_phy_set_rf_reg(struct ieee80211_hw *hw,
+ original_value = rtl8723_phy_rf_serial_read(hw,
+ rfpath,
+ regaddr);
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ data =
+ ((original_value & (~bitmask)) |
+ (data << bitshift));
+@@ -89,7 +89,7 @@ void rtl8723e_phy_set_rf_reg(struct ieee80211_hw *hw,
+ rtl8723_phy_rf_serial_write(hw, rfpath, regaddr, data);
+ } else {
+ if (bitmask != RFREG_OFFSET_MASK) {
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ data =
+ ((original_value & (~bitmask)) |
+ (data << bitshift));
+diff --git a/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c b/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c
+index 2b9313cb93db..094cb36153f5 100644
+--- a/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c
++++ b/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c
+@@ -41,7 +41,7 @@ u32 rtl8723be_phy_query_rf_reg(struct ieee80211_hw *hw, enum radio_path rfpath,
+ spin_lock(&rtlpriv->locks.rf_lock);
+
+ original_value = rtl8723_phy_rf_serial_read(hw, rfpath, regaddr);
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ readback_value = (original_value & bitmask) >> bitshift;
+
+ spin_unlock(&rtlpriv->locks.rf_lock);
+@@ -68,7 +68,7 @@ void rtl8723be_phy_set_rf_reg(struct ieee80211_hw *hw, enum radio_path path,
+ if (bitmask != RFREG_OFFSET_MASK) {
+ original_value = rtl8723_phy_rf_serial_read(hw, path,
+ regaddr);
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ data = ((original_value & (~bitmask)) |
+ (data << bitshift));
+ }
+--
+2.43.0
+
--- /dev/null
+From 43109ffa2981f42946953adb5de356471dd04c7f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 14:13:31 +0800
+Subject: wifi: rtw89: coex: Fix wrong Wi-Fi role info and FDDT parameter
+ members
+
+From: Ching-Te Ku <ku920601@realtek.com>
+
+[ Upstream commit acc55d7dd4de525ac07e43e90ea3cc630677ec8a ]
+
+The Wi-Fi firmware 29.29.X should use version 2 role info format. FDDT
+mechanism version 5 use the same cell members to judge traffic situation,
+don't need to add another new format.
+
+Signed-off-by: Ching-Te Ku <ku920601@realtek.com>
+Signed-off-by: Ping-Ke Shih <pkshih@realtek.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://msgid.link/20231218061341.51255-2-pkshih@realtek.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/realtek/rtw89/coex.c | 4 ++--
+ drivers/net/wireless/realtek/rtw89/core.h | 12 +++---------
+ 2 files changed, 5 insertions(+), 11 deletions(-)
+
+diff --git a/drivers/net/wireless/realtek/rtw89/coex.c b/drivers/net/wireless/realtek/rtw89/coex.c
+index bdcc172639e4..ace7bbf2cf94 100644
+--- a/drivers/net/wireless/realtek/rtw89/coex.c
++++ b/drivers/net/wireless/realtek/rtw89/coex.c
+@@ -131,7 +131,7 @@ static const struct rtw89_btc_ver rtw89_btc_ver_defs[] = {
+ .fcxbtcrpt = 105, .fcxtdma = 3, .fcxslots = 1, .fcxcysta = 5,
+ .fcxstep = 3, .fcxnullsta = 2, .fcxmreg = 2, .fcxgpiodbg = 1,
+ .fcxbtver = 1, .fcxbtscan = 2, .fcxbtafh = 2, .fcxbtdevinfo = 1,
+- .fwlrole = 1, .frptmap = 3, .fcxctrl = 1,
++ .fwlrole = 2, .frptmap = 3, .fcxctrl = 1,
+ .info_buf = 1800, .max_role_num = 6,
+ },
+ {RTL8852C, RTW89_FW_VER_CODE(0, 27, 57, 0),
+@@ -159,7 +159,7 @@ static const struct rtw89_btc_ver rtw89_btc_ver_defs[] = {
+ .fcxbtcrpt = 105, .fcxtdma = 3, .fcxslots = 1, .fcxcysta = 5,
+ .fcxstep = 3, .fcxnullsta = 2, .fcxmreg = 2, .fcxgpiodbg = 1,
+ .fcxbtver = 1, .fcxbtscan = 2, .fcxbtafh = 2, .fcxbtdevinfo = 1,
+- .fwlrole = 1, .frptmap = 3, .fcxctrl = 1,
++ .fwlrole = 2, .frptmap = 3, .fcxctrl = 1,
+ .info_buf = 1800, .max_role_num = 6,
+ },
+ {RTL8852B, RTW89_FW_VER_CODE(0, 29, 14, 0),
+diff --git a/drivers/net/wireless/realtek/rtw89/core.h b/drivers/net/wireless/realtek/rtw89/core.h
+index 91e4d4e79eea..8f59461e58f2 100644
+--- a/drivers/net/wireless/realtek/rtw89/core.h
++++ b/drivers/net/wireless/realtek/rtw89/core.h
+@@ -2294,12 +2294,6 @@ struct rtw89_btc_fbtc_fddt_cell_status {
+ u8 state_phase; /* [0:3] train state, [4:7] train phase */
+ } __packed;
+
+-struct rtw89_btc_fbtc_fddt_cell_status_v5 {
+- s8 wl_tx_pwr;
+- s8 bt_tx_pwr;
+- s8 bt_rx_gain;
+-} __packed;
+-
+ struct rtw89_btc_fbtc_cysta_v3 { /* statistics for cycles */
+ u8 fver;
+ u8 rsvd;
+@@ -2363,9 +2357,9 @@ struct rtw89_btc_fbtc_cysta_v5 { /* statistics for cycles */
+ struct rtw89_btc_fbtc_cycle_a2dp_empty_info a2dp_ept;
+ struct rtw89_btc_fbtc_a2dp_trx_stat_v4 a2dp_trx[BTC_CYCLE_SLOT_MAX];
+ struct rtw89_btc_fbtc_cycle_fddt_info_v5 fddt_trx[BTC_CYCLE_SLOT_MAX];
+- struct rtw89_btc_fbtc_fddt_cell_status_v5 fddt_cells[FDD_TRAIN_WL_DIRECTION]
+- [FDD_TRAIN_WL_RSSI_LEVEL]
+- [FDD_TRAIN_BT_RSSI_LEVEL];
++ struct rtw89_btc_fbtc_fddt_cell_status fddt_cells[FDD_TRAIN_WL_DIRECTION]
++ [FDD_TRAIN_WL_RSSI_LEVEL]
++ [FDD_TRAIN_BT_RSSI_LEVEL];
+ __le32 except_map;
+ } __packed;
+
+--
+2.43.0
+
--- /dev/null
+From 26554af71cd487cfc3045280b74a3abb446e5e2d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 15:00:46 +0800
+Subject: wifi: rtw89: fix misbehavior of TX beacon in concurrent mode
+
+From: Chih-Kang Chang <gary.chang@realtek.com>
+
+[ Upstream commit 756b31203d482d2dd1aa6c208978b0410dc7530f ]
+
+In concurrent mode, when STA interface is scanning, it causes
+AP interface TX beacon on wrong channel. We modified it to scan
+with the operating channel when one of the interfaces is already
+connected. Additionally, STA interface need to stop scan when AP
+interface is starting to avoid TX beacon on wrong channel. Finally,
+AP interface need to stop TX beacon when STA interface is scanning
+and switching to non-OP channel,This prevent other device to get
+beacons on wrong channel.
+
+Signed-off-by: Chih-Kang Chang <gary.chang@realtek.com>
+Signed-off-by: Ping-Ke Shih <pkshih@realtek.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/20231129070046.18443-5-pkshih@realtek.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/realtek/rtw89/fw.c | 17 +++++++++--
+ drivers/net/wireless/realtek/rtw89/mac.c | 29 +++++++++++++++----
+ drivers/net/wireless/realtek/rtw89/mac.h | 1 +
+ drivers/net/wireless/realtek/rtw89/mac80211.c | 3 ++
+ 4 files changed, 43 insertions(+), 7 deletions(-)
+
+diff --git a/drivers/net/wireless/realtek/rtw89/fw.c b/drivers/net/wireless/realtek/rtw89/fw.c
+index a732c22a2d54..313ed4c45464 100644
+--- a/drivers/net/wireless/realtek/rtw89/fw.c
++++ b/drivers/net/wireless/realtek/rtw89/fw.c
+@@ -4043,6 +4043,7 @@ void rtw89_hw_scan_complete(struct rtw89_dev *rtwdev, struct ieee80211_vif *vif,
+ rtw89_core_scan_complete(rtwdev, vif, true);
+ ieee80211_scan_completed(rtwdev->hw, &info);
+ ieee80211_wake_queues(rtwdev->hw);
++ rtw89_mac_enable_beacon_for_ap_vifs(rtwdev, true);
+
+ rtw89_release_pkt_list(rtwdev);
+ rtwvif = (struct rtw89_vif *)vif->drv_priv;
+@@ -4060,6 +4061,19 @@ void rtw89_hw_scan_abort(struct rtw89_dev *rtwdev, struct ieee80211_vif *vif)
+ rtw89_hw_scan_complete(rtwdev, vif, true);
+ }
+
++static bool rtw89_is_any_vif_connected_or_connecting(struct rtw89_dev *rtwdev)
++{
++ struct rtw89_vif *rtwvif;
++
++ rtw89_for_each_rtwvif(rtwdev, rtwvif) {
++ /* This variable implies connected or during attempt to connect */
++ if (!is_zero_ether_addr(rtwvif->bssid))
++ return true;
++ }
++
++ return false;
++}
++
+ int rtw89_hw_scan_offload(struct rtw89_dev *rtwdev, struct ieee80211_vif *vif,
+ bool enable)
+ {
+@@ -4072,8 +4086,7 @@ int rtw89_hw_scan_offload(struct rtw89_dev *rtwdev, struct ieee80211_vif *vif,
+ if (!rtwvif)
+ return -EINVAL;
+
+- /* This variable implies connected or during attempt to connect */
+- connected = !is_zero_ether_addr(rtwvif->bssid);
++ connected = rtw89_is_any_vif_connected_or_connecting(rtwdev);
+ opt.enable = enable;
+ opt.target_ch_mode = connected;
+ if (enable) {
+diff --git a/drivers/net/wireless/realtek/rtw89/mac.c b/drivers/net/wireless/realtek/rtw89/mac.c
+index add8a7ff01a5..d0c7de4e80dc 100644
+--- a/drivers/net/wireless/realtek/rtw89/mac.c
++++ b/drivers/net/wireless/realtek/rtw89/mac.c
+@@ -3916,12 +3916,10 @@ static void rtw89_mac_port_cfg_rx_sync(struct rtw89_dev *rtwdev,
+ }
+
+ static void rtw89_mac_port_cfg_tx_sw(struct rtw89_dev *rtwdev,
+- struct rtw89_vif *rtwvif)
++ struct rtw89_vif *rtwvif, bool en)
+ {
+ const struct rtw89_mac_gen_def *mac = rtwdev->chip->mac_def;
+ const struct rtw89_port_reg *p = mac->port_base;
+- bool en = rtwvif->net_type == RTW89_NET_TYPE_AP_MODE ||
+- rtwvif->net_type == RTW89_NET_TYPE_AD_HOC;
+
+ if (en)
+ rtw89_write32_port_set(rtwdev, rtwvif, p->port_cfg, B_AX_BCNTX_EN);
+@@ -3929,6 +3927,24 @@ static void rtw89_mac_port_cfg_tx_sw(struct rtw89_dev *rtwdev,
+ rtw89_write32_port_clr(rtwdev, rtwvif, p->port_cfg, B_AX_BCNTX_EN);
+ }
+
++static void rtw89_mac_port_cfg_tx_sw_by_nettype(struct rtw89_dev *rtwdev,
++ struct rtw89_vif *rtwvif)
++{
++ bool en = rtwvif->net_type == RTW89_NET_TYPE_AP_MODE ||
++ rtwvif->net_type == RTW89_NET_TYPE_AD_HOC;
++
++ rtw89_mac_port_cfg_tx_sw(rtwdev, rtwvif, en);
++}
++
++void rtw89_mac_enable_beacon_for_ap_vifs(struct rtw89_dev *rtwdev, bool en)
++{
++ struct rtw89_vif *rtwvif;
++
++ rtw89_for_each_rtwvif(rtwdev, rtwvif)
++ if (rtwvif->net_type == RTW89_NET_TYPE_AP_MODE)
++ rtw89_mac_port_cfg_tx_sw(rtwdev, rtwvif, en);
++}
++
+ static void rtw89_mac_port_cfg_bcn_intv(struct rtw89_dev *rtwdev,
+ struct rtw89_vif *rtwvif)
+ {
+@@ -4235,7 +4251,7 @@ int rtw89_mac_port_update(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif)
+ rtw89_mac_port_cfg_bcn_prct(rtwdev, rtwvif);
+ rtw89_mac_port_cfg_rx_sw(rtwdev, rtwvif);
+ rtw89_mac_port_cfg_rx_sync(rtwdev, rtwvif);
+- rtw89_mac_port_cfg_tx_sw(rtwdev, rtwvif);
++ rtw89_mac_port_cfg_tx_sw_by_nettype(rtwdev, rtwvif);
+ rtw89_mac_port_cfg_bcn_intv(rtwdev, rtwvif);
+ rtw89_mac_port_cfg_hiq_win(rtwdev, rtwvif);
+ rtw89_mac_port_cfg_hiq_dtim(rtwdev, rtwvif);
+@@ -4397,8 +4413,10 @@ rtw89_mac_c2h_scanofld_rsp(struct rtw89_dev *rtwdev, struct sk_buff *c2h,
+
+ switch (reason) {
+ case RTW89_SCAN_LEAVE_CH_NOTIFY:
+- if (rtw89_is_op_chan(rtwdev, band, chan))
++ if (rtw89_is_op_chan(rtwdev, band, chan)) {
++ rtw89_mac_enable_beacon_for_ap_vifs(rtwdev, false);
+ ieee80211_stop_queues(rtwdev->hw);
++ }
+ return;
+ case RTW89_SCAN_END_SCAN_NOTIFY:
+ if (rtwvif && rtwvif->scan_req &&
+@@ -4416,6 +4434,7 @@ rtw89_mac_c2h_scanofld_rsp(struct rtw89_dev *rtwdev, struct sk_buff *c2h,
+ if (rtw89_is_op_chan(rtwdev, band, chan)) {
+ rtw89_assign_entity_chan(rtwdev, rtwvif->sub_entity_idx,
+ &rtwdev->scan_info.op_chan);
++ rtw89_mac_enable_beacon_for_ap_vifs(rtwdev, true);
+ ieee80211_wake_queues(rtwdev->hw);
+ } else {
+ rtw89_chan_create(&new, chan, chan, band,
+diff --git a/drivers/net/wireless/realtek/rtw89/mac.h b/drivers/net/wireless/realtek/rtw89/mac.h
+index c11c904f87fe..f9fef678f314 100644
+--- a/drivers/net/wireless/realtek/rtw89/mac.h
++++ b/drivers/net/wireless/realtek/rtw89/mac.h
+@@ -992,6 +992,7 @@ int rtw89_mac_port_get_tsf(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif,
+ void rtw89_mac_set_he_obss_narrow_bw_ru(struct rtw89_dev *rtwdev,
+ struct ieee80211_vif *vif);
+ void rtw89_mac_stop_ap(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif);
++void rtw89_mac_enable_beacon_for_ap_vifs(struct rtw89_dev *rtwdev, bool en);
+ int rtw89_mac_remove_vif(struct rtw89_dev *rtwdev, struct rtw89_vif *vif);
+ int rtw89_mac_enable_bb_rf(struct rtw89_dev *rtwdev);
+ int rtw89_mac_disable_bb_rf(struct rtw89_dev *rtwdev);
+diff --git a/drivers/net/wireless/realtek/rtw89/mac80211.c b/drivers/net/wireless/realtek/rtw89/mac80211.c
+index 31d1f7891675..b7ceaf5595eb 100644
+--- a/drivers/net/wireless/realtek/rtw89/mac80211.c
++++ b/drivers/net/wireless/realtek/rtw89/mac80211.c
+@@ -477,6 +477,9 @@ static int rtw89_ops_start_ap(struct ieee80211_hw *hw,
+ return -EOPNOTSUPP;
+ }
+
++ if (rtwdev->scanning)
++ rtw89_hw_scan_abort(rtwdev, rtwdev->scan_info.scanning_vif);
++
+ ether_addr_copy(rtwvif->bssid, vif->bss_conf.bssid);
+ rtw89_cam_bssid_changed(rtwdev, rtwvif);
+ rtw89_mac_port_update(rtwdev, rtwvif);
+--
+2.43.0
+
--- /dev/null
+From 9cfa03e4dad450d5abb1ee73a0ee2436c91c4b91 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 15:00:43 +0800
+Subject: wifi: rtw89: fix not entering PS mode after AP stops
+
+From: Po-Hao Huang <phhuang@realtek.com>
+
+[ Upstream commit 0052b3c401cdf39d3c3d12a0c3852175bc9a39c7 ]
+
+The attempt to enter power save mode might fail if there are still
+beacons pending in the queue. This sometimes happens after stopping
+P2P GO or AP mode. Extend stop AP function and flush all beacons to
+resolve this.
+
+Signed-off-by: Po-Hao Huang <phhuang@realtek.com>
+Signed-off-by: Ping-Ke Shih <pkshih@realtek.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/20231129070046.18443-2-pkshih@realtek.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/realtek/rtw89/mac.c | 71 ++++++++++++++++++++++--
+ drivers/net/wireless/realtek/rtw89/reg.h | 17 ++++++
+ 2 files changed, 82 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/net/wireless/realtek/rtw89/mac.c b/drivers/net/wireless/realtek/rtw89/mac.c
+index 0c5768f41d55..add8a7ff01a5 100644
+--- a/drivers/net/wireless/realtek/rtw89/mac.c
++++ b/drivers/net/wireless/realtek/rtw89/mac.c
+@@ -3747,6 +3747,50 @@ static const struct rtw89_port_reg rtw89_port_base_ax = {
+ R_AX_PORT_HGQ_WINDOW_CFG + 3},
+ };
+
++static void rtw89_mac_check_packet_ctrl(struct rtw89_dev *rtwdev,
++ struct rtw89_vif *rtwvif, u8 type)
++{
++ u8 mask = B_AX_PTCL_DBG_INFO_MASK_BY_PORT(rtwvif->port);
++ u32 reg_info, reg_ctrl;
++ u32 val;
++ int ret;
++
++ reg_info = rtw89_mac_reg_by_idx(rtwdev, R_AX_PTCL_DBG_INFO, rtwvif->mac_idx);
++ reg_ctrl = rtw89_mac_reg_by_idx(rtwdev, R_AX_PTCL_DBG, rtwvif->mac_idx);
++
++ rtw89_write32_mask(rtwdev, reg_ctrl, B_AX_PTCL_DBG_SEL_MASK, type);
++ rtw89_write32_set(rtwdev, reg_ctrl, B_AX_PTCL_DBG_EN);
++ fsleep(100);
++
++ ret = read_poll_timeout(rtw89_read32_mask, val, val == 0, 1000, 100000,
++ true, rtwdev, reg_info, mask);
++ if (ret)
++ rtw89_warn(rtwdev, "Polling beacon packet empty fail\n");
++}
++
++static void rtw89_mac_bcn_drop(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif)
++{
++ const struct rtw89_mac_gen_def *mac = rtwdev->chip->mac_def;
++ const struct rtw89_port_reg *p = mac->port_base;
++
++ rtw89_write32_set(rtwdev, R_AX_BCN_DROP_ALL0, BIT(rtwvif->port));
++ rtw89_write32_port_mask(rtwdev, rtwvif, p->tbtt_prohib, B_AX_TBTT_SETUP_MASK, 1);
++ rtw89_write32_port_mask(rtwdev, rtwvif, p->bcn_area, B_AX_BCN_MSK_AREA_MASK, 0);
++ rtw89_write32_port_mask(rtwdev, rtwvif, p->tbtt_prohib, B_AX_TBTT_HOLD_MASK, 0);
++ rtw89_write32_port_mask(rtwdev, rtwvif, p->bcn_early, B_AX_BCNERLY_MASK, 2);
++ rtw89_write16_port_mask(rtwdev, rtwvif, p->tbtt_early, B_AX_TBTTERLY_MASK, 1);
++ rtw89_write32_port_mask(rtwdev, rtwvif, p->bcn_space, B_AX_BCN_SPACE_MASK, 1);
++ rtw89_write32_port_set(rtwdev, rtwvif, p->port_cfg, B_AX_BCNTX_EN);
++
++ rtw89_mac_check_packet_ctrl(rtwdev, rtwvif, AX_PTCL_DBG_BCNQ_NUM0);
++ if (rtwvif->port == RTW89_PORT_0)
++ rtw89_mac_check_packet_ctrl(rtwdev, rtwvif, AX_PTCL_DBG_BCNQ_NUM1);
++
++ rtw89_write32_clr(rtwdev, R_AX_BCN_DROP_ALL0, BIT(rtwvif->port));
++ rtw89_write32_port_clr(rtwdev, rtwvif, p->port_cfg, B_AX_TBTT_PROHIB_EN);
++ fsleep(2);
++}
++
+ #define BCN_INTERVAL 100
+ #define BCN_ERLY_DEF 160
+ #define BCN_SETUP_DEF 2
+@@ -3762,21 +3806,36 @@ static void rtw89_mac_port_cfg_func_sw(struct rtw89_dev *rtwdev,
+ const struct rtw89_mac_gen_def *mac = rtwdev->chip->mac_def;
+ const struct rtw89_port_reg *p = mac->port_base;
+ struct ieee80211_vif *vif = rtwvif_to_vif(rtwvif);
++ const struct rtw89_chip_info *chip = rtwdev->chip;
++ bool need_backup = false;
++ u32 backup_val;
+
+ if (!rtw89_read32_port_mask(rtwdev, rtwvif, p->port_cfg, B_AX_PORT_FUNC_EN))
+ return;
+
+- rtw89_write32_port_clr(rtwdev, rtwvif, p->tbtt_prohib, B_AX_TBTT_SETUP_MASK);
+- rtw89_write32_port_mask(rtwdev, rtwvif, p->tbtt_prohib, B_AX_TBTT_HOLD_MASK, 1);
+- rtw89_write16_port_clr(rtwdev, rtwvif, p->tbtt_early, B_AX_TBTTERLY_MASK);
+- rtw89_write16_port_clr(rtwdev, rtwvif, p->bcn_early, B_AX_BCNERLY_MASK);
++ if (chip->chip_id == RTL8852A && rtwvif->port != RTW89_PORT_0) {
++ need_backup = true;
++ backup_val = rtw89_read32_port(rtwdev, rtwvif, p->tbtt_prohib);
++ }
+
+- msleep(vif->bss_conf.beacon_int + 1);
++ if (rtwvif->net_type == RTW89_NET_TYPE_AP_MODE)
++ rtw89_mac_bcn_drop(rtwdev, rtwvif);
++
++ if (chip->chip_id == RTL8852A) {
++ rtw89_write32_port_clr(rtwdev, rtwvif, p->tbtt_prohib, B_AX_TBTT_SETUP_MASK);
++ rtw89_write32_port_mask(rtwdev, rtwvif, p->tbtt_prohib, B_AX_TBTT_HOLD_MASK, 1);
++ rtw89_write16_port_clr(rtwdev, rtwvif, p->tbtt_early, B_AX_TBTTERLY_MASK);
++ rtw89_write16_port_clr(rtwdev, rtwvif, p->bcn_early, B_AX_BCNERLY_MASK);
++ }
+
++ msleep(vif->bss_conf.beacon_int + 1);
+ rtw89_write32_port_clr(rtwdev, rtwvif, p->port_cfg, B_AX_PORT_FUNC_EN |
+ B_AX_BRK_SETUP);
+ rtw89_write32_port_set(rtwdev, rtwvif, p->port_cfg, B_AX_TSFTR_RST);
+ rtw89_write32_port(rtwdev, rtwvif, p->bcn_cnt_tmr, 0);
++
++ if (need_backup)
++ rtw89_write32_port(rtwdev, rtwvif, p->tbtt_prohib, backup_val);
+ }
+
+ static void rtw89_mac_port_cfg_tx_rpt(struct rtw89_dev *rtwdev,
+@@ -4261,7 +4320,7 @@ void rtw89_mac_set_he_obss_narrow_bw_ru(struct rtw89_dev *rtwdev,
+
+ void rtw89_mac_stop_ap(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif)
+ {
+- rtw89_mac_port_cfg_func_en(rtwdev, rtwvif, false);
++ rtw89_mac_port_cfg_func_sw(rtwdev, rtwvif);
+ }
+
+ int rtw89_mac_add_vif(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif)
+diff --git a/drivers/net/wireless/realtek/rtw89/reg.h b/drivers/net/wireless/realtek/rtw89/reg.h
+index ccd5481e8a3d..672010b9e026 100644
+--- a/drivers/net/wireless/realtek/rtw89/reg.h
++++ b/drivers/net/wireless/realtek/rtw89/reg.h
+@@ -2375,6 +2375,14 @@
+ #define R_AX_TSFTR_HIGH_P4 0xC53C
+ #define B_AX_TSFTR_HIGH_MASK GENMASK(31, 0)
+
++#define R_AX_BCN_DROP_ALL0 0xC560
++#define R_AX_BCN_DROP_ALL0_C1 0xE560
++#define B_AX_BCN_DROP_ALL_P4 BIT(4)
++#define B_AX_BCN_DROP_ALL_P3 BIT(3)
++#define B_AX_BCN_DROP_ALL_P2 BIT(2)
++#define B_AX_BCN_DROP_ALL_P1 BIT(1)
++#define B_AX_BCN_DROP_ALL_P0 BIT(0)
++
+ #define R_AX_MBSSID_CTRL 0xC568
+ #define R_AX_MBSSID_CTRL_C1 0xE568
+ #define B_AX_P0MB_ALL_MASK GENMASK(23, 1)
+@@ -2554,11 +2562,20 @@
+
+ #define R_AX_PTCL_DBG_INFO 0xC6F0
+ #define R_AX_PTCL_DBG_INFO_C1 0xE6F0
++#define B_AX_PTCL_DBG_INFO_MASK_BY_PORT(port) \
++({\
++ typeof(port) _port = (port); \
++ GENMASK((_port) * 2 + 1, (_port) * 2); \
++})
++
+ #define B_AX_PTCL_DBG_INFO_MASK GENMASK(31, 0)
+ #define R_AX_PTCL_DBG 0xC6F4
+ #define R_AX_PTCL_DBG_C1 0xE6F4
+ #define B_AX_PTCL_DBG_EN BIT(8)
+ #define B_AX_PTCL_DBG_SEL_MASK GENMASK(7, 0)
++#define AX_PTCL_DBG_BCNQ_NUM0 8
++#define AX_PTCL_DBG_BCNQ_NUM1 9
++
+
+ #define R_AX_DLE_CTRL 0xC800
+ #define R_AX_DLE_CTRL_C1 0xE800
+--
+2.43.0
+
--- /dev/null
+From bf711dc20d4fda9376fc26836456c3b01ed69152 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 24 Oct 2023 17:31:33 +0300
+Subject: wifi: rtw89: fix timeout calculation in rtw89_roc_end()
+
+From: Dmitry Antipov <dmantipov@yandex.ru>
+
+[ Upstream commit e416514e309f7e25e577fee45a65f246f67b2261 ]
+
+Since 'rtw89_core_tx_kick_off_and_wait()' assumes timeout
+(actually RTW89_ROC_TX_TIMEOUT) in milliseconds, I suppose
+that RTW89_ROC_IDLE_TIMEOUT is in milliseconds as well. If
+so, 'msecs_to_jiffies()' should be used in a call to
+'ieee80211_queue_delayed_work()' from 'rtw89_roc_end()'.
+Compile tested only.
+
+Signed-off-by: Dmitry Antipov <dmantipov@yandex.ru>
+Acked-by: Ping-Ke Shih <pkshih@realtek.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/20231024143137.30393-1-dmantipov@yandex.ru
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/realtek/rtw89/core.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/net/wireless/realtek/rtw89/core.c b/drivers/net/wireless/realtek/rtw89/core.c
+index 3d75165e48be..a3624ebf01b7 100644
+--- a/drivers/net/wireless/realtek/rtw89/core.c
++++ b/drivers/net/wireless/realtek/rtw89/core.c
+@@ -2886,7 +2886,7 @@ void rtw89_roc_end(struct rtw89_dev *rtwdev, struct rtw89_vif *rtwvif)
+
+ if (hw->conf.flags & IEEE80211_CONF_IDLE)
+ ieee80211_queue_delayed_work(hw, &roc->roc_work,
+- RTW89_ROC_IDLE_TIMEOUT);
++ msecs_to_jiffies(RTW89_ROC_IDLE_TIMEOUT));
+ }
+
+ void rtw89_roc_work(struct work_struct *work)
+--
+2.43.0
+
--- /dev/null
+From fac3bb9de6fd385bc3fe3f015bee4c381d5e6d83 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 20:11:28 +0300
+Subject: wifi: wfx: fix possible NULL pointer dereference in wfx_set_mfp_ap()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Dmitry Antipov <dmantipov@yandex.ru>
+
+[ Upstream commit fe0a7776d4d19e613bb8dd80fe2d78ae49e8b49d ]
+
+Since 'ieee80211_beacon_get()' can return NULL, 'wfx_set_mfp_ap()'
+should check the return value before examining skb data. So convert
+the latter to return an appropriate error code and propagate it to
+return from 'wfx_start_ap()' as well. Compile tested only.
+
+Signed-off-by: Dmitry Antipov <dmantipov@yandex.ru>
+Tested-by: Jérôme Pouiller <jerome.pouiller@silabs.com>
+Acked-by: Jérôme Pouiller <jerome.pouiller@silabs.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/20231204171130.141394-1-dmantipov@yandex.ru
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/silabs/wfx/sta.c | 42 ++++++++++++++++-----------
+ 1 file changed, 25 insertions(+), 17 deletions(-)
+
+diff --git a/drivers/net/wireless/silabs/wfx/sta.c b/drivers/net/wireless/silabs/wfx/sta.c
+index 1b6c158457b4..537caf9d914a 100644
+--- a/drivers/net/wireless/silabs/wfx/sta.c
++++ b/drivers/net/wireless/silabs/wfx/sta.c
+@@ -336,29 +336,38 @@ static int wfx_upload_ap_templates(struct wfx_vif *wvif)
+ return 0;
+ }
+
+-static void wfx_set_mfp_ap(struct wfx_vif *wvif)
++static int wfx_set_mfp_ap(struct wfx_vif *wvif)
+ {
+ struct ieee80211_vif *vif = wvif_to_vif(wvif);
+ struct sk_buff *skb = ieee80211_beacon_get(wvif->wdev->hw, vif, 0);
+ const int ieoffset = offsetof(struct ieee80211_mgmt, u.beacon.variable);
+- const u16 *ptr = (u16 *)cfg80211_find_ie(WLAN_EID_RSN, skb->data + ieoffset,
+- skb->len - ieoffset);
+ const int pairwise_cipher_suite_count_offset = 8 / sizeof(u16);
+ const int pairwise_cipher_suite_size = 4 / sizeof(u16);
+ const int akm_suite_size = 4 / sizeof(u16);
++ const u16 *ptr;
+
+- if (ptr) {
+- ptr += pairwise_cipher_suite_count_offset;
+- if (WARN_ON(ptr > (u16 *)skb_tail_pointer(skb)))
+- return;
+- ptr += 1 + pairwise_cipher_suite_size * *ptr;
+- if (WARN_ON(ptr > (u16 *)skb_tail_pointer(skb)))
+- return;
+- ptr += 1 + akm_suite_size * *ptr;
+- if (WARN_ON(ptr > (u16 *)skb_tail_pointer(skb)))
+- return;
+- wfx_hif_set_mfp(wvif, *ptr & BIT(7), *ptr & BIT(6));
+- }
++ if (unlikely(!skb))
++ return -ENOMEM;
++
++ ptr = (u16 *)cfg80211_find_ie(WLAN_EID_RSN, skb->data + ieoffset,
++ skb->len - ieoffset);
++ if (unlikely(!ptr))
++ return -EINVAL;
++
++ ptr += pairwise_cipher_suite_count_offset;
++ if (WARN_ON(ptr > (u16 *)skb_tail_pointer(skb)))
++ return -EINVAL;
++
++ ptr += 1 + pairwise_cipher_suite_size * *ptr;
++ if (WARN_ON(ptr > (u16 *)skb_tail_pointer(skb)))
++ return -EINVAL;
++
++ ptr += 1 + akm_suite_size * *ptr;
++ if (WARN_ON(ptr > (u16 *)skb_tail_pointer(skb)))
++ return -EINVAL;
++
++ wfx_hif_set_mfp(wvif, *ptr & BIT(7), *ptr & BIT(6));
++ return 0;
+ }
+
+ int wfx_start_ap(struct ieee80211_hw *hw, struct ieee80211_vif *vif,
+@@ -376,8 +385,7 @@ int wfx_start_ap(struct ieee80211_hw *hw, struct ieee80211_vif *vif,
+ ret = wfx_hif_start(wvif, &vif->bss_conf, wvif->channel);
+ if (ret > 0)
+ return -EIO;
+- wfx_set_mfp_ap(wvif);
+- return ret;
++ return wfx_set_mfp_ap(wvif);
+ }
+
+ void wfx_stop_ap(struct ieee80211_hw *hw, struct ieee80211_vif *vif,
+--
+2.43.0
+
--- /dev/null
+From ab3d91902192ec7e804c6f9603e36f9910ccced0 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 15:44:49 -0500
+Subject: x86/boot: Ignore NMIs during very early boot
+
+From: Jun'ichi Nomura <junichi.nomura@nec.com>
+
+[ Upstream commit 78a509fba9c9b1fcb77f95b7c6be30da3d24823a ]
+
+When there are two racing NMIs on x86, the first NMI invokes NMI handler and
+the 2nd NMI is latched until IRET is executed.
+
+If panic on NMI and panic kexec are enabled, the first NMI triggers
+panic and starts booting the next kernel via kexec. Note that the 2nd
+NMI is still latched. During the early boot of the next kernel, once
+an IRET is executed as a result of a page fault, then the 2nd NMI is
+unlatched and invokes the NMI handler.
+
+However, NMI handler is not set up at the early stage of boot, which
+results in a boot failure.
+
+Avoid such problems by setting up a NOP handler for early NMIs.
+
+[ mingo: Refined the changelog. ]
+
+Signed-off-by: Jun'ichi Nomura <junichi.nomura@nec.com>
+Signed-off-by: Derek Barbosa <debarbos@redhat.com>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Cc: Kees Cook <keescook@chromium.org>
+Cc: Linus Torvalds <torvalds@linux-foundation.org>
+Cc: Paul E. McKenney <paulmck@kernel.org>
+Cc: Andy Lutomirski <luto@kernel.org>
+Cc: "H. Peter Anvin" <hpa@zytor.com>
+Cc: Peter Zijlstra <peterz@infradead.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/x86/boot/compressed/ident_map_64.c | 5 +++++
+ arch/x86/boot/compressed/idt_64.c | 1 +
+ arch/x86/boot/compressed/idt_handlers_64.S | 1 +
+ arch/x86/boot/compressed/misc.h | 1 +
+ 4 files changed, 8 insertions(+)
+
+diff --git a/arch/x86/boot/compressed/ident_map_64.c b/arch/x86/boot/compressed/ident_map_64.c
+index 473ba59b82a8..d040080d7edb 100644
+--- a/arch/x86/boot/compressed/ident_map_64.c
++++ b/arch/x86/boot/compressed/ident_map_64.c
+@@ -386,3 +386,8 @@ void do_boot_page_fault(struct pt_regs *regs, unsigned long error_code)
+ */
+ kernel_add_identity_map(address, end);
+ }
++
++void do_boot_nmi_trap(struct pt_regs *regs, unsigned long error_code)
++{
++ /* Empty handler to ignore NMI during early boot */
++}
+diff --git a/arch/x86/boot/compressed/idt_64.c b/arch/x86/boot/compressed/idt_64.c
+index 3cdf94b41456..d100284bbef4 100644
+--- a/arch/x86/boot/compressed/idt_64.c
++++ b/arch/x86/boot/compressed/idt_64.c
+@@ -61,6 +61,7 @@ void load_stage2_idt(void)
+ boot_idt_desc.address = (unsigned long)boot_idt;
+
+ set_idt_entry(X86_TRAP_PF, boot_page_fault);
++ set_idt_entry(X86_TRAP_NMI, boot_nmi_trap);
+
+ #ifdef CONFIG_AMD_MEM_ENCRYPT
+ /*
+diff --git a/arch/x86/boot/compressed/idt_handlers_64.S b/arch/x86/boot/compressed/idt_handlers_64.S
+index 22890e199f5b..4d03c8562f63 100644
+--- a/arch/x86/boot/compressed/idt_handlers_64.S
++++ b/arch/x86/boot/compressed/idt_handlers_64.S
+@@ -70,6 +70,7 @@ SYM_FUNC_END(\name)
+ .code64
+
+ EXCEPTION_HANDLER boot_page_fault do_boot_page_fault error_code=1
++EXCEPTION_HANDLER boot_nmi_trap do_boot_nmi_trap error_code=0
+
+ #ifdef CONFIG_AMD_MEM_ENCRYPT
+ EXCEPTION_HANDLER boot_stage1_vc do_vc_no_ghcb error_code=1
+diff --git a/arch/x86/boot/compressed/misc.h b/arch/x86/boot/compressed/misc.h
+index c0d502bd8716..bc2f0f17fb90 100644
+--- a/arch/x86/boot/compressed/misc.h
++++ b/arch/x86/boot/compressed/misc.h
+@@ -196,6 +196,7 @@ static inline void cleanup_exception_handling(void) { }
+
+ /* IDT Entry Points */
+ void boot_page_fault(void);
++void boot_nmi_trap(void);
+ void boot_stage1_vc(void);
+ void boot_stage2_vc(void);
+
+--
+2.43.0
+
--- /dev/null
+From 0b77069fa618bd8243864fdc2413dac59b9f39df Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 10:12:23 +0100
+Subject: x86/cfi,bpf: Fix bpf_exception_cb() signature
+
+From: Alexei Starovoitov <alexei.starovoitov@gmail.com>
+
+[ Upstream commit 852486b35f344887786d63250946dd921a05d7e8 ]
+
+As per the earlier patches, BPF sub-programs have bpf_callback_t
+signature and CFI expects callers to have matching signature. This is
+violated by bpf_prog_aux::bpf_exception_cb().
+
+[peterz: Changelog]
+Reported-by: Peter Zijlstra <peterz@infradead.org>
+Signed-off-by: Alexei Starovoitov <alexei.starovoitov@gmail.com>
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Link: https://lkml.kernel.org/r/CAADnVQ+Z7UcXXBBhMubhcMM=R-dExk-uHtfOLtoLxQ1XxEpqEA@mail.gmail.com
+Link: https://lore.kernel.org/r/20231215092707.910319166@infradead.org
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/linux/bpf.h | 2 +-
+ kernel/bpf/helpers.c | 2 +-
+ 2 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/include/linux/bpf.h b/include/linux/bpf.h
+index 7a7859a5cce4..cfc6d2f98058 100644
+--- a/include/linux/bpf.h
++++ b/include/linux/bpf.h
+@@ -1447,7 +1447,7 @@ struct bpf_prog_aux {
+ int cgroup_atype; /* enum cgroup_bpf_attach_type */
+ struct bpf_map *cgroup_storage[MAX_BPF_CGROUP_STORAGE_TYPE];
+ char name[BPF_OBJ_NAME_LEN];
+- unsigned int (*bpf_exception_cb)(u64 cookie, u64 sp, u64 bp);
++ u64 (*bpf_exception_cb)(u64 cookie, u64 sp, u64 bp, u64, u64);
+ #ifdef CONFIG_SECURITY
+ void *security;
+ #endif
+diff --git a/kernel/bpf/helpers.c b/kernel/bpf/helpers.c
+index 991186520af0..b3053af6427d 100644
+--- a/kernel/bpf/helpers.c
++++ b/kernel/bpf/helpers.c
+@@ -2509,7 +2509,7 @@ __bpf_kfunc void bpf_throw(u64 cookie)
+ * which skips compiler generated instrumentation to do the same.
+ */
+ kasan_unpoison_task_stack_below((void *)(long)ctx.sp);
+- ctx.aux->bpf_exception_cb(cookie, ctx.sp, ctx.bp);
++ ctx.aux->bpf_exception_cb(cookie, ctx.sp, ctx.bp, 0, 0);
+ WARN(1, "A call to BPF exception callback should never return\n");
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 7e14b1fb55687f201a1b880b6f413bafe8e9edc4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 26 Oct 2023 08:39:03 +0800
+Subject: x86/mce: Mark fatal MCE's page as poison to avoid panic in the kdump
+ kernel
+
+From: Zhiquan Li <zhiquan1.li@intel.com>
+
+[ Upstream commit 9f3b130048bfa2e44a8cfb1b616f826d9d5d8188 ]
+
+Memory errors don't happen very often, especially fatal ones. However,
+in large-scale scenarios such as data centers, that probability
+increases with the amount of machines present.
+
+When a fatal machine check happens, mce_panic() is called based on the
+severity grading of that error. The page containing the error is not
+marked as poison.
+
+However, when kexec is enabled, tools like makedumpfile understand when
+pages are marked as poison and do not touch them so as not to cause
+a fatal machine check exception again while dumping the previous
+kernel's memory.
+
+Therefore, mark the page containing the error as poisoned so that the
+kexec'ed kernel can avoid accessing the page.
+
+ [ bp: Rewrite commit message and comment. ]
+
+Co-developed-by: Youquan Song <youquan.song@intel.com>
+Signed-off-by: Youquan Song <youquan.song@intel.com>
+Signed-off-by: Zhiquan Li <zhiquan1.li@intel.com>
+Signed-off-by: Borislav Petkov (AMD) <bp@alien8.de>
+Reviewed-by: Naoya Horiguchi <naoya.horiguchi@nec.com>
+Link: https://lore.kernel.org/r/20231014051754.3759099-1-zhiquan1.li@intel.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/x86/kernel/cpu/mce/core.c | 16 ++++++++++++++++
+ 1 file changed, 16 insertions(+)
+
+diff --git a/arch/x86/kernel/cpu/mce/core.c b/arch/x86/kernel/cpu/mce/core.c
+index 7b397370b4d6..df8d25e744d1 100644
+--- a/arch/x86/kernel/cpu/mce/core.c
++++ b/arch/x86/kernel/cpu/mce/core.c
+@@ -44,6 +44,7 @@
+ #include <linux/sync_core.h>
+ #include <linux/task_work.h>
+ #include <linux/hardirq.h>
++#include <linux/kexec.h>
+
+ #include <asm/intel-family.h>
+ #include <asm/processor.h>
+@@ -233,6 +234,7 @@ static noinstr void mce_panic(const char *msg, struct mce *final, char *exp)
+ struct llist_node *pending;
+ struct mce_evt_llist *l;
+ int apei_err = 0;
++ struct page *p;
+
+ /*
+ * Allow instrumentation around external facilities usage. Not that it
+@@ -286,6 +288,20 @@ static noinstr void mce_panic(const char *msg, struct mce *final, char *exp)
+ if (!fake_panic) {
+ if (panic_timeout == 0)
+ panic_timeout = mca_cfg.panic_timeout;
++
++ /*
++ * Kdump skips the poisoned page in order to avoid
++ * touching the error bits again. Poison the page even
++ * if the error is fatal and the machine is about to
++ * panic.
++ */
++ if (kexec_crash_loaded()) {
++ if (final && (final->status & MCI_STATUS_ADDRV)) {
++ p = pfn_to_online_page(final->addr >> PAGE_SHIFT);
++ if (p)
++ SetPageHWPoison(p);
++ }
++ }
+ panic(msg);
+ } else
+ pr_emerg(HW_ERR "Fake kernel panic: %s\n", msg);
+--
+2.43.0
+
--- /dev/null
+From 2e6598626003a07a83d13bc65fd248e101df3c98 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 7 Jan 2024 12:34:26 +0200
+Subject: xen/gntdev: Fix the abuse of underlying struct page in DMA-buf import
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Oleksandr Tyshchenko <oleksandr_tyshchenko@epam.com>
+
+[ Upstream commit 2d2db7d40254d5fb53b11ebd703cd1ed0c5de7a1 ]
+
+DO NOT access the underlying struct page of an sg table exported
+by DMA-buf in dmabuf_imp_to_refs(), this is not allowed.
+Please see drivers/dma-buf/dma-buf.c:mangle_sg_table() for details.
+
+Fortunately, here (for special Xen device) we can avoid using
+pages and calculate gfns directly from dma addresses provided by
+the sg table.
+
+Suggested-by: Daniel Vetter <daniel@ffwll.ch>
+Signed-off-by: Oleksandr Tyshchenko <oleksandr_tyshchenko@epam.com>
+Acked-by: Christian König <christian.koenig@amd.com>
+Reviewed-by: Stefano Stabellini <sstabellini@kernel.org>
+Acked-by: Daniel Vetter <daniel@ffwll.ch>
+Link: https://lore.kernel.org/r/20240107103426.2038075-1-olekstysh@gmail.com
+Signed-off-by: Juergen Gross <jgross@suse.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/xen/gntdev-dmabuf.c | 50 ++++++++++++++++++-------------------
+ 1 file changed, 25 insertions(+), 25 deletions(-)
+
+diff --git a/drivers/xen/gntdev-dmabuf.c b/drivers/xen/gntdev-dmabuf.c
+index 4440e626b797..42adc2c1e06b 100644
+--- a/drivers/xen/gntdev-dmabuf.c
++++ b/drivers/xen/gntdev-dmabuf.c
+@@ -11,6 +11,7 @@
+ #include <linux/kernel.h>
+ #include <linux/errno.h>
+ #include <linux/dma-buf.h>
++#include <linux/dma-direct.h>
+ #include <linux/slab.h>
+ #include <linux/types.h>
+ #include <linux/uaccess.h>
+@@ -50,7 +51,7 @@ struct gntdev_dmabuf {
+
+ /* Number of pages this buffer has. */
+ int nr_pages;
+- /* Pages of this buffer. */
++ /* Pages of this buffer (only for dma-buf export). */
+ struct page **pages;
+ };
+
+@@ -484,7 +485,7 @@ static int dmabuf_exp_from_refs(struct gntdev_priv *priv, int flags,
+ /* DMA buffer import support. */
+
+ static int
+-dmabuf_imp_grant_foreign_access(struct page **pages, u32 *refs,
++dmabuf_imp_grant_foreign_access(unsigned long *gfns, u32 *refs,
+ int count, int domid)
+ {
+ grant_ref_t priv_gref_head;
+@@ -507,7 +508,7 @@ dmabuf_imp_grant_foreign_access(struct page **pages, u32 *refs,
+ }
+
+ gnttab_grant_foreign_access_ref(cur_ref, domid,
+- xen_page_to_gfn(pages[i]), 0);
++ gfns[i], 0);
+ refs[i] = cur_ref;
+ }
+
+@@ -529,7 +530,6 @@ static void dmabuf_imp_end_foreign_access(u32 *refs, int count)
+
+ static void dmabuf_imp_free_storage(struct gntdev_dmabuf *gntdev_dmabuf)
+ {
+- kfree(gntdev_dmabuf->pages);
+ kfree(gntdev_dmabuf->u.imp.refs);
+ kfree(gntdev_dmabuf);
+ }
+@@ -549,12 +549,6 @@ static struct gntdev_dmabuf *dmabuf_imp_alloc_storage(int count)
+ if (!gntdev_dmabuf->u.imp.refs)
+ goto fail;
+
+- gntdev_dmabuf->pages = kcalloc(count,
+- sizeof(gntdev_dmabuf->pages[0]),
+- GFP_KERNEL);
+- if (!gntdev_dmabuf->pages)
+- goto fail;
+-
+ gntdev_dmabuf->nr_pages = count;
+
+ for (i = 0; i < count; i++)
+@@ -576,7 +570,8 @@ dmabuf_imp_to_refs(struct gntdev_dmabuf_priv *priv, struct device *dev,
+ struct dma_buf *dma_buf;
+ struct dma_buf_attachment *attach;
+ struct sg_table *sgt;
+- struct sg_page_iter sg_iter;
++ struct sg_dma_page_iter sg_iter;
++ unsigned long *gfns;
+ int i;
+
+ dma_buf = dma_buf_get(fd);
+@@ -624,26 +619,31 @@ dmabuf_imp_to_refs(struct gntdev_dmabuf_priv *priv, struct device *dev,
+
+ gntdev_dmabuf->u.imp.sgt = sgt;
+
+- /* Now convert sgt to array of pages and check for page validity. */
++ gfns = kcalloc(count, sizeof(*gfns), GFP_KERNEL);
++ if (!gfns) {
++ ret = ERR_PTR(-ENOMEM);
++ goto fail_unmap;
++ }
++
++ /*
++ * Now convert sgt to array of gfns without accessing underlying pages.
++ * It is not allowed to access the underlying struct page of an sg table
++ * exported by DMA-buf, but since we deal with special Xen dma device here
++ * (not a normal physical one) look at the dma addresses in the sg table
++ * and then calculate gfns directly from them.
++ */
+ i = 0;
+- for_each_sgtable_page(sgt, &sg_iter, 0) {
+- struct page *page = sg_page_iter_page(&sg_iter);
+- /*
+- * Check if page is valid: this can happen if we are given
+- * a page from VRAM or other resources which are not backed
+- * by a struct page.
+- */
+- if (!pfn_valid(page_to_pfn(page))) {
+- ret = ERR_PTR(-EINVAL);
+- goto fail_unmap;
+- }
++ for_each_sgtable_dma_page(sgt, &sg_iter, 0) {
++ dma_addr_t addr = sg_page_iter_dma_address(&sg_iter);
++ unsigned long pfn = bfn_to_pfn(XEN_PFN_DOWN(dma_to_phys(dev, addr)));
+
+- gntdev_dmabuf->pages[i++] = page;
++ gfns[i++] = pfn_to_gfn(pfn);
+ }
+
+- ret = ERR_PTR(dmabuf_imp_grant_foreign_access(gntdev_dmabuf->pages,
++ ret = ERR_PTR(dmabuf_imp_grant_foreign_access(gfns,
+ gntdev_dmabuf->u.imp.refs,
+ count, domid));
++ kfree(gfns);
+ if (IS_ERR(ret))
+ goto fail_end_access;
+
+--
+2.43.0
+
--- /dev/null
+From e4de6fe8519e6ef1a17bd225b132081fbbfe5608 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 1 Dec 2023 17:06:47 +0200
+Subject: xhci: fix possible null pointer deref during xhci urb enqueue
+
+From: Mathias Nyman <mathias.nyman@linux.intel.com>
+
+[ Upstream commit e2e2aacf042f52854c92775b7800ba668e0bdfe4 ]
+
+There is a short gap between urb being submitted and actually added to the
+endpoint queue (linked). If the device is disconnected during this time
+then usb core is not yet aware of the pending urb, and device may be freed
+just before xhci_urq_enqueue() continues, dereferencing the freed device.
+
+Freeing the device is protected by the xhci spinlock, so make sure we take
+and keep the lock while checking that device exists, dereference it, and
+add the urb to the queue.
+
+Remove the unnecessary URB check, usb core checks it before calling
+xhci_urb_enqueue()
+
+Suggested-by: Kuen-Han Tsai <khtsai@google.com>
+Signed-off-by: Mathias Nyman <mathias.nyman@linux.intel.com>
+Link: https://lore.kernel.org/r/20231201150647.1307406-20-mathias.nyman@linux.intel.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/usb/host/xhci.c | 40 +++++++++++++++++++++++-----------------
+ 1 file changed, 23 insertions(+), 17 deletions(-)
+
+diff --git a/drivers/usb/host/xhci.c b/drivers/usb/host/xhci.c
+index 884b0898d9c9..ddb686301af5 100644
+--- a/drivers/usb/host/xhci.c
++++ b/drivers/usb/host/xhci.c
+@@ -1522,24 +1522,7 @@ static int xhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag
+ struct urb_priv *urb_priv;
+ int num_tds;
+
+- if (!urb)
+- return -EINVAL;
+- ret = xhci_check_args(hcd, urb->dev, urb->ep,
+- true, true, __func__);
+- if (ret <= 0)
+- return ret ? ret : -EINVAL;
+-
+- slot_id = urb->dev->slot_id;
+ ep_index = xhci_get_endpoint_index(&urb->ep->desc);
+- ep_state = &xhci->devs[slot_id]->eps[ep_index].ep_state;
+-
+- if (!HCD_HW_ACCESSIBLE(hcd))
+- return -ESHUTDOWN;
+-
+- if (xhci->devs[slot_id]->flags & VDEV_PORT_ERROR) {
+- xhci_dbg(xhci, "Can't queue urb, port error, link inactive\n");
+- return -ENODEV;
+- }
+
+ if (usb_endpoint_xfer_isoc(&urb->ep->desc))
+ num_tds = urb->number_of_packets;
+@@ -1578,12 +1561,35 @@ static int xhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag
+
+ spin_lock_irqsave(&xhci->lock, flags);
+
++ ret = xhci_check_args(hcd, urb->dev, urb->ep,
++ true, true, __func__);
++ if (ret <= 0) {
++ ret = ret ? ret : -EINVAL;
++ goto free_priv;
++ }
++
++ slot_id = urb->dev->slot_id;
++
++ if (!HCD_HW_ACCESSIBLE(hcd)) {
++ ret = -ESHUTDOWN;
++ goto free_priv;
++ }
++
++ if (xhci->devs[slot_id]->flags & VDEV_PORT_ERROR) {
++ xhci_dbg(xhci, "Can't queue urb, port error, link inactive\n");
++ ret = -ENODEV;
++ goto free_priv;
++ }
++
+ if (xhci->xhc_state & XHCI_STATE_DYING) {
+ xhci_dbg(xhci, "Ep 0x%x: URB %p submitted for non-responsive xHCI host.\n",
+ urb->ep->desc.bEndpointAddress, urb);
+ ret = -ESHUTDOWN;
+ goto free_priv;
+ }
++
++ ep_state = &xhci->devs[slot_id]->eps[ep_index].ep_state;
++
+ if (*ep_state & (EP_GETTING_STREAMS | EP_GETTING_NO_STREAMS)) {
+ xhci_warn(xhci, "WARN: Can't enqueue URB, ep in streams transition state %x\n",
+ *ep_state);
+--
+2.43.0
+