--- /dev/null
+From cac5d4f9d76ae7e87db6bf9986af7cdc8982ae73 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 14:45:18 +0800
+Subject: ACPI: APEI: set memory failure flags as MF_ACTION_REQUIRED on
+ synchronous events
+
+From: Shuai Xue <xueshuai@linux.alibaba.com>
+
+[ Upstream commit a70297d2213253853e95f5b49651f924990c6d3b ]
+
+There are two major types of uncorrected recoverable (UCR) errors :
+
+ - Synchronous error: The error is detected and raised at the point of
+ the consumption in the execution flow, e.g. when a CPU tries to
+ access a poisoned cache line. The CPU will take a synchronous error
+ exception such as Synchronous External Abort (SEA) on Arm64 and
+ Machine Check Exception (MCE) on X86. OS requires to take action (for
+ example, offline failure page/kill failure thread) to recover this
+ uncorrectable error.
+
+ - Asynchronous error: The error is detected out of processor execution
+ context, e.g. when an error is detected by a background scrubber.
+ Some data in the memory are corrupted. But the data have not been
+ consumed. OS is optional to take action to recover this uncorrectable
+ error.
+
+When APEI firmware first is enabled, a platform may describe one error
+source for the handling of synchronous errors (e.g. MCE or SEA notification
+), or for handling asynchronous errors (e.g. SCI or External Interrupt
+notification). In other words, we can distinguish synchronous errors by
+APEI notification. For synchronous errors, kernel will kill the current
+process which accessing the poisoned page by sending SIGBUS with
+BUS_MCEERR_AR. In addition, for asynchronous errors, kernel will notify the
+process who owns the poisoned page by sending SIGBUS with BUS_MCEERR_AO in
+early kill mode. However, the GHES driver always sets mf_flags to 0 so that
+all synchronous errors are handled as asynchronous errors in memory failure.
+
+To this end, set memory failure flags as MF_ACTION_REQUIRED on synchronous
+events.
+
+Signed-off-by: Shuai Xue <xueshuai@linux.alibaba.com>
+Tested-by: Ma Wupeng <mawupeng1@huawei.com>
+Reviewed-by: Kefeng Wang <wangkefeng.wang@huawei.com>
+Reviewed-by: Xiaofei Tan <tanxiaofei@huawei.com>
+Reviewed-by: Baolin Wang <baolin.wang@linux.alibaba.com>
+Reviewed-by: James Morse <james.morse@arm.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/apei/ghes.c | 29 +++++++++++++++++++++++------
+ 1 file changed, 23 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/acpi/apei/ghes.c b/drivers/acpi/apei/ghes.c
+index 8678e162181f..160606af8b4f 100644
+--- a/drivers/acpi/apei/ghes.c
++++ b/drivers/acpi/apei/ghes.c
+@@ -99,6 +99,20 @@ static inline bool is_hest_type_generic_v2(struct ghes *ghes)
+ return ghes->generic->header.type == ACPI_HEST_TYPE_GENERIC_ERROR_V2;
+ }
+
++/*
++ * A platform may describe one error source for the handling of synchronous
++ * errors (e.g. MCE or SEA), or for handling asynchronous errors (e.g. SCI
++ * or External Interrupt). On x86, the HEST notifications are always
++ * asynchronous, so only SEA on ARM is delivered as a synchronous
++ * notification.
++ */
++static inline bool is_hest_sync_notify(struct ghes *ghes)
++{
++ u8 notify_type = ghes->generic->notify.type;
++
++ return notify_type == ACPI_HEST_NOTIFY_SEA;
++}
++
+ /*
+ * This driver isn't really modular, however for the time being,
+ * continuing to use module_param is the easiest way to remain
+@@ -461,7 +475,7 @@ static bool ghes_do_memory_failure(u64 physical_addr, int flags)
+ }
+
+ static bool ghes_handle_memory_failure(struct acpi_hest_generic_data *gdata,
+- int sev)
++ int sev, bool sync)
+ {
+ int flags = -1;
+ int sec_sev = ghes_severity(gdata->error_severity);
+@@ -475,7 +489,7 @@ static bool ghes_handle_memory_failure(struct acpi_hest_generic_data *gdata,
+ (gdata->flags & CPER_SEC_ERROR_THRESHOLD_EXCEEDED))
+ flags = MF_SOFT_OFFLINE;
+ if (sev == GHES_SEV_RECOVERABLE && sec_sev == GHES_SEV_RECOVERABLE)
+- flags = 0;
++ flags = sync ? MF_ACTION_REQUIRED : 0;
+
+ if (flags != -1)
+ return ghes_do_memory_failure(mem_err->physical_addr, flags);
+@@ -483,9 +497,11 @@ static bool ghes_handle_memory_failure(struct acpi_hest_generic_data *gdata,
+ return false;
+ }
+
+-static bool ghes_handle_arm_hw_error(struct acpi_hest_generic_data *gdata, int sev)
++static bool ghes_handle_arm_hw_error(struct acpi_hest_generic_data *gdata,
++ int sev, bool sync)
+ {
+ struct cper_sec_proc_arm *err = acpi_hest_get_payload(gdata);
++ int flags = sync ? MF_ACTION_REQUIRED : 0;
+ bool queued = false;
+ int sec_sev, i;
+ char *p;
+@@ -510,7 +526,7 @@ static bool ghes_handle_arm_hw_error(struct acpi_hest_generic_data *gdata, int s
+ * and don't filter out 'corrected' error here.
+ */
+ if (is_cache && has_pa) {
+- queued = ghes_do_memory_failure(err_info->physical_fault_addr, 0);
++ queued = ghes_do_memory_failure(err_info->physical_fault_addr, flags);
+ p += err_info->length;
+ continue;
+ }
+@@ -631,6 +647,7 @@ static bool ghes_do_proc(struct ghes *ghes,
+ const guid_t *fru_id = &guid_null;
+ char *fru_text = "";
+ bool queued = false;
++ bool sync = is_hest_sync_notify(ghes);
+
+ sev = ghes_severity(estatus->error_severity);
+ apei_estatus_for_each_section(estatus, gdata) {
+@@ -648,13 +665,13 @@ static bool ghes_do_proc(struct ghes *ghes,
+ ghes_edac_report_mem_error(sev, mem_err);
+
+ arch_apei_report_mem_error(sev, mem_err);
+- queued = ghes_handle_memory_failure(gdata, sev);
++ queued = ghes_handle_memory_failure(gdata, sev, sync);
+ }
+ else if (guid_equal(sec_type, &CPER_SEC_PCIE)) {
+ ghes_handle_aer(gdata);
+ }
+ else if (guid_equal(sec_type, &CPER_SEC_PROC_ARM)) {
+- queued = ghes_handle_arm_hw_error(gdata, sev);
++ queued = ghes_handle_arm_hw_error(gdata, sev, sync);
+ } else {
+ void *err = acpi_hest_get_payload(gdata);
+
+--
+2.43.0
+
--- /dev/null
+From 0adb883f933c9c8a1de2ed224a996c9a13af4de3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 13:00:37 -0500
+Subject: ACPI: extlog: fix NULL pointer dereference check
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Prarit Bhargava <prarit@redhat.com>
+
+[ Upstream commit 72d9b9747e78979510e9aafdd32eb99c7aa30dd1 ]
+
+The gcc plugin -fanalyzer [1] tries to detect various
+patterns of incorrect behaviour. The tool reports:
+
+drivers/acpi/acpi_extlog.c: In function ‘extlog_exit’:
+drivers/acpi/acpi_extlog.c:307:12: warning: check of ‘extlog_l1_addr’ for NULL after already dereferencing it [-Wanalyzer-deref-before-check]
+ |
+ | 306 | ((struct extlog_l1_head *)extlog_l1_addr)->flags &= ~FLAG_OS_OPTIN;
+ | | ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~^~~~~~~
+ | | |
+ | | (1) pointer ‘extlog_l1_addr’ is dereferenced here
+ | 307 | if (extlog_l1_addr)
+ | | ~
+ | | |
+ | | (2) pointer ‘extlog_l1_addr’ is checked for NULL here but it was already dereferenced at (1)
+ |
+
+Fix the NULL pointer dereference check in extlog_exit().
+
+Link: https://gcc.gnu.org/onlinedocs/gcc-10.1.0/gcc/Static-Analyzer-Options.html # [1]
+
+Signed-off-by: Prarit Bhargava <prarit@redhat.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/acpi_extlog.c | 5 +++--
+ 1 file changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/acpi/acpi_extlog.c b/drivers/acpi/acpi_extlog.c
+index 088db2356998..0a84d5afd37c 100644
+--- a/drivers/acpi/acpi_extlog.c
++++ b/drivers/acpi/acpi_extlog.c
+@@ -308,9 +308,10 @@ static int __init extlog_init(void)
+ static void __exit extlog_exit(void)
+ {
+ mce_unregister_decode_chain(&extlog_mce_dec);
+- ((struct extlog_l1_head *)extlog_l1_addr)->flags &= ~FLAG_OS_OPTIN;
+- if (extlog_l1_addr)
++ if (extlog_l1_addr) {
++ ((struct extlog_l1_head *)extlog_l1_addr)->flags &= ~FLAG_OS_OPTIN;
+ acpi_os_unmap_iomem(extlog_l1_addr, l1_size);
++ }
+ if (elog_addr)
+ acpi_os_unmap_iomem(elog_addr, elog_size);
+ release_mem_region(elog_base, elog_size);
+--
+2.43.0
+
--- /dev/null
+From 9af7f41afbc0b12d5ba0cc9f9c111c51d8a6aa11 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 26 Nov 2023 21:59:13 +0800
+Subject: ACPI: video: Add quirk for the Colorful X15 AT 23 Laptop
+
+From: Yuluo Qiu <qyl27@outlook.com>
+
+[ Upstream commit 143176a46bdd3bfbe9ba2462bf94458e80d65ebf ]
+
+The Colorful X15 AT 23 ACPI video-bus device report spurious
+ACPI_VIDEO_NOTIFY_CYCLE events resulting in spurious KEY_SWITCHVIDEOMODE
+events being reported to userspace (and causing trouble there) when
+an external screen plugged in.
+
+Add a quirk setting the report_key_events mask to
+REPORT_BRIGHTNESS_KEY_EVENTS so that the ACPI_VIDEO_NOTIFY_CYCLE
+events will be ignored, while still reporting brightness up/down
+hotkey-presses to userspace normally.
+
+Signed-off-by: Yuluo Qiu <qyl27@outlook.com>
+Co-developed-by: Celeste Liu <CoelacanthusHex@gmail.com>
+Signed-off-by: Celeste Liu <CoelacanthusHex@gmail.com>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/acpi/acpi_video.c | 9 +++++++++
+ 1 file changed, 9 insertions(+)
+
+diff --git a/drivers/acpi/acpi_video.c b/drivers/acpi/acpi_video.c
+index 9d384656323a..b2364ac455f3 100644
+--- a/drivers/acpi/acpi_video.c
++++ b/drivers/acpi/acpi_video.c
+@@ -568,6 +568,15 @@ static const struct dmi_system_id video_dmi_table[] = {
+ DMI_MATCH(DMI_PRODUCT_NAME, "Vostro 3350"),
+ },
+ },
++ {
++ .callback = video_set_report_key_events,
++ .driver_data = (void *)((uintptr_t)REPORT_BRIGHTNESS_KEY_EVENTS),
++ .ident = "COLORFUL X15 AT 23",
++ .matches = {
++ DMI_MATCH(DMI_SYS_VENDOR, "COLORFUL"),
++ DMI_MATCH(DMI_PRODUCT_NAME, "X15 AT 23"),
++ },
++ },
+ /*
+ * Some machines change the brightness themselves when a brightness
+ * hotkey gets pressed, despite us telling them not to. In this case
+--
+2.43.0
+
--- /dev/null
+From 7aa888276ec9fae49edd3ba038716d4fac48108b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 12:56:14 +0100
+Subject: afs: fix the usage of read_seqbegin_or_lock() in afs_find_server*()
+
+From: Oleg Nesterov <oleg@redhat.com>
+
+[ Upstream commit 1702e0654ca9a7bcd7c7619c8a5004db58945b71 ]
+
+David Howells says:
+
+ (5) afs_find_server().
+
+ There could be a lot of servers in the list and each server can have
+ multiple addresses, so I think this would be better with an exclusive
+ second pass.
+
+ The server list isn't likely to change all that often, but when it does
+ change, there's a good chance several servers are going to be
+ added/removed one after the other. Further, this is only going to be
+ used for incoming cache management/callback requests from the server,
+ which hopefully aren't going to happen too often - but it is remotely
+ drivable.
+
+ (6) afs_find_server_by_uuid().
+
+ Similarly to (5), there could be a lot of servers to search through, but
+ they are in a tree not a flat list, so it should be faster to process.
+ Again, it's not likely to change that often and, again, when it does
+ change it's likely to involve multiple changes. This can be driven
+ remotely by an incoming cache management request but is mostly going to
+ be driven by setting up or reconfiguring a volume's server list -
+ something that also isn't likely to happen often.
+
+Make the "seq" counter odd on the 2nd pass, otherwise read_seqbegin_or_lock()
+never takes the lock.
+
+Signed-off-by: Oleg Nesterov <oleg@redhat.com>
+Signed-off-by: David Howells <dhowells@redhat.com>
+cc: Marc Dionne <marc.dionne@auristor.com>
+cc: linux-afs@lists.infradead.org
+Link: https://lore.kernel.org/r/20231130115614.GA21581@redhat.com/
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/afs/server.c | 7 ++++---
+ 1 file changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/fs/afs/server.c b/fs/afs/server.c
+index 684a2b02b9ff..733e3c470f7e 100644
+--- a/fs/afs/server.c
++++ b/fs/afs/server.c
+@@ -27,7 +27,7 @@ struct afs_server *afs_find_server(struct afs_net *net,
+ const struct afs_addr_list *alist;
+ struct afs_server *server = NULL;
+ unsigned int i;
+- int seq = 0, diff;
++ int seq = 1, diff;
+
+ rcu_read_lock();
+
+@@ -35,6 +35,7 @@ struct afs_server *afs_find_server(struct afs_net *net,
+ if (server)
+ afs_unuse_server_notime(net, server, afs_server_trace_put_find_rsq);
+ server = NULL;
++ seq++; /* 2 on the 1st/lockless path, otherwise odd */
+ read_seqbegin_or_lock(&net->fs_addr_lock, &seq);
+
+ if (srx->transport.family == AF_INET6) {
+@@ -90,7 +91,7 @@ struct afs_server *afs_find_server_by_uuid(struct afs_net *net, const uuid_t *uu
+ {
+ struct afs_server *server = NULL;
+ struct rb_node *p;
+- int diff, seq = 0;
++ int diff, seq = 1;
+
+ _enter("%pU", uuid);
+
+@@ -102,7 +103,7 @@ struct afs_server *afs_find_server_by_uuid(struct afs_net *net, const uuid_t *uu
+ if (server)
+ afs_unuse_server(net, server, afs_server_trace_put_uuid_rsq);
+ server = NULL;
+-
++ seq++; /* 2 on the 1st/lockless path, otherwise odd */
+ read_seqbegin_or_lock(&net->fs_lock, &seq);
+
+ p = net->fs_servers.rb_node;
+--
+2.43.0
+
--- /dev/null
+From fc9d6bc94447ff10105f84dfc16fe24919f9da52 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 12:56:06 +0100
+Subject: afs: fix the usage of read_seqbegin_or_lock() in
+ afs_lookup_volume_rcu()
+
+From: Oleg Nesterov <oleg@redhat.com>
+
+[ Upstream commit 4121b4337146b64560d1e46ebec77196d9287802 ]
+
+David Howells says:
+
+ (2) afs_lookup_volume_rcu().
+
+ There can be a lot of volumes known by a system. A thousand would
+ require a 10-step walk and this is drivable by remote operation, so I
+ think this should probably take a lock on the second pass too.
+
+Make the "seq" counter odd on the 2nd pass, otherwise read_seqbegin_or_lock()
+never takes the lock.
+
+Signed-off-by: Oleg Nesterov <oleg@redhat.com>
+Signed-off-by: David Howells <dhowells@redhat.com>
+cc: Marc Dionne <marc.dionne@auristor.com>
+cc: linux-afs@lists.infradead.org
+Link: https://lore.kernel.org/r/20231130115606.GA21571@redhat.com/
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/afs/callback.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/fs/afs/callback.c b/fs/afs/callback.c
+index 7d9b23d981bf..229308c7f744 100644
+--- a/fs/afs/callback.c
++++ b/fs/afs/callback.c
+@@ -70,13 +70,14 @@ static struct afs_volume *afs_lookup_volume_rcu(struct afs_cell *cell,
+ {
+ struct afs_volume *volume = NULL;
+ struct rb_node *p;
+- int seq = 0;
++ int seq = 1;
+
+ do {
+ /* Unfortunately, rbtree walking doesn't give reliable results
+ * under just the RCU read lock, so we have to check for
+ * changes.
+ */
++ seq++; /* 2 on the 1st/lockless path, otherwise odd */
+ read_seqbegin_or_lock(&cell->volume_lock, &seq);
+
+ p = rcu_dereference_raw(cell->volumes.rb_node);
+--
+2.43.0
+
--- /dev/null
+From 08cd3a59c4e9c2b76aa21873bdc26efe0303a189 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 15:27:07 -0600
+Subject: ALSA: hda: Intel: add HDA_ARL PCI ID support
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+
+[ Upstream commit a31014ebad617868c246d3985ff80d891f03711e ]
+
+Yet another PCI ID.
+
+Signed-off-by: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+Reviewed-by: Péter Ujfalusi <peter.ujfalusi@linux.intel.com>
+Reviewed-by: Kai Vehmanen <kai.vehmanen@linux.intel.com>
+Acked-by: Mark Brown <broonie@kernel.org>
+Link: https://lore.kernel.org/r/20231204212710.185976-3-pierre-louis.bossart@linux.intel.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/pci/hda/hda_intel.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/sound/pci/hda/hda_intel.c b/sound/pci/hda/hda_intel.c
+index 12c6eb76fca3..a3c6a5eeba3a 100644
+--- a/sound/pci/hda/hda_intel.c
++++ b/sound/pci/hda/hda_intel.c
+@@ -2581,6 +2581,8 @@ static const struct pci_device_id azx_ids[] = {
+ .driver_data = AZX_DRIVER_SKL | AZX_DCAPS_INTEL_SKYLAKE},
+ { PCI_DEVICE(0x8086, 0x4b58),
+ .driver_data = AZX_DRIVER_SKL | AZX_DCAPS_INTEL_SKYLAKE},
++ /* Arrow Lake */
++ { PCI_DEVICE_DATA(INTEL, HDA_ARL, AZX_DRIVER_SKL | AZX_DCAPS_INTEL_SKYLAKE) },
+ /* Broxton-P(Apollolake) */
+ { PCI_DEVICE(0x8086, 0x5a98),
+ .driver_data = AZX_DRIVER_SKL | AZX_DCAPS_INTEL_BROXTON },
+--
+2.43.0
+
--- /dev/null
+From e449ce0f8c184374d076df9dc81effff0fc13664 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 15:27:08 -0600
+Subject: ALSA: hda: intel-dspcfg: add filters for ARL-S and ARL
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+
+[ Upstream commit 7a9d6bbe8a663c817080be55d9fecf19a4a8fd8f ]
+
+Same usual filters, SOF is required for DMIC and/or SoundWire support.
+
+Signed-off-by: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+Reviewed-by: Péter Ujfalusi <peter.ujfalusi@linux.intel.com>
+Reviewed-by: Kai Vehmanen <kai.vehmanen@linux.intel.com>
+Acked-by: Mark Brown <broonie@kernel.org>
+Link: https://lore.kernel.org/r/20231204212710.185976-4-pierre-louis.bossart@linux.intel.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/hda/intel-dsp-config.c | 10 ++++++++++
+ 1 file changed, 10 insertions(+)
+
+diff --git a/sound/hda/intel-dsp-config.c b/sound/hda/intel-dsp-config.c
+index 48c78388c1d2..ea0a2b1d23a3 100644
+--- a/sound/hda/intel-dsp-config.c
++++ b/sound/hda/intel-dsp-config.c
+@@ -372,6 +372,16 @@ static const struct config_entry config_table[] = {
+ .flags = FLAG_SOF | FLAG_SOF_ONLY_IF_DMIC_OR_SOUNDWIRE,
+ .device = 0x7e28,
+ },
++ /* ArrowLake-S */
++ {
++ .flags = FLAG_SOF | FLAG_SOF_ONLY_IF_DMIC_OR_SOUNDWIRE,
++ .device = PCI_DEVICE_ID_INTEL_HDA_ARL_S,
++ },
++ /* ArrowLake */
++ {
++ .flags = FLAG_SOF | FLAG_SOF_ONLY_IF_DMIC_OR_SOUNDWIRE,
++ .device = PCI_DEVICE_ID_INTEL_HDA_ARL,
++ },
+ #endif
+
+ /* Lunar Lake */
+--
+2.43.0
+
--- /dev/null
+From e98520902edb934e308a0dcd0abe8bd9020868c4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 16:41:25 +0100
+Subject: ALSA: hda: Refer to correct stream index at loops
+
+From: Takashi Iwai <tiwai@suse.de>
+
+[ Upstream commit 26257869672fd4a06a60c2da841e15fb2cb47bbe ]
+
+In a couple of loops over the all streams, we check the bitmap against
+the loop counter. A more correct reference would be, however, the
+index of each stream, instead.
+
+This patch corrects the check of bitmaps to the stream index.
+
+Note that this change doesn't fix anything for now; all existing
+drivers set up the stream indices properly, hence the loop count is
+always equal with the stream index. That said, this change is only
+for consistency.
+
+Link: https://lore.kernel.org/r/20231121154125.4888-1-tiwai@suse.de
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ sound/hda/hdac_stream.c | 9 +++------
+ 1 file changed, 3 insertions(+), 6 deletions(-)
+
+diff --git a/sound/hda/hdac_stream.c b/sound/hda/hdac_stream.c
+index 5570722458ca..e510bf09967d 100644
+--- a/sound/hda/hdac_stream.c
++++ b/sound/hda/hdac_stream.c
+@@ -605,17 +605,15 @@ void snd_hdac_stream_timecounter_init(struct hdac_stream *azx_dev,
+ struct hdac_stream *s;
+ bool inited = false;
+ u64 cycle_last = 0;
+- int i = 0;
+
+ list_for_each_entry(s, &bus->stream_list, list) {
+- if (streams & (1 << i)) {
++ if ((streams & (1 << s->index))) {
+ azx_timecounter_init(s, inited, cycle_last);
+ if (!inited) {
+ inited = true;
+ cycle_last = s->tc.cycle_last;
+ }
+ }
+- i++;
+ }
+
+ snd_pcm_gettime(runtime, &runtime->trigger_tstamp);
+@@ -660,14 +658,13 @@ void snd_hdac_stream_sync(struct hdac_stream *azx_dev, bool start,
+ unsigned int streams)
+ {
+ struct hdac_bus *bus = azx_dev->bus;
+- int i, nwait, timeout;
++ int nwait, timeout;
+ struct hdac_stream *s;
+
+ for (timeout = 5000; timeout; timeout--) {
+ nwait = 0;
+- i = 0;
+ list_for_each_entry(s, &bus->stream_list, list) {
+- if (!(streams & (1 << i++)))
++ if (!(streams & (1 << s->index)))
+ continue;
+
+ if (start) {
+--
+2.43.0
+
--- /dev/null
+From 4cfff7f5b72012c14cc18d77f9ac27739a5563bf Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:36:05 -0300
+Subject: ARM: dts: imx: Use flash@0,0 pattern
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 1e1d7cc478fb16816de09740e3c323c0c188d58f ]
+
+Per mtd-physmap.yaml, 'nor@0,0' is not a valid node pattern.
+
+Change it to 'flash@0,0' to fix the following dt-schema warning:
+
+imx1-ads.dtb: nor@0,0: $nodename:0: 'nor@0,0' does not match '^(flash|.*sram|nand)(@.*)?$'
+ from schema $id: http://devicetree.org/schemas/mtd/mtd-physmap.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx1-ads.dts | 2 +-
+ arch/arm/boot/dts/imx1-apf9328.dts | 2 +-
+ arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi | 2 +-
+ arch/arm/boot/dts/imx27-phytec-phycore-som.dtsi | 2 +-
+ 4 files changed, 4 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm/boot/dts/imx1-ads.dts b/arch/arm/boot/dts/imx1-ads.dts
+index 5833fb6f15d8..2c817c4a4c68 100644
+--- a/arch/arm/boot/dts/imx1-ads.dts
++++ b/arch/arm/boot/dts/imx1-ads.dts
+@@ -65,7 +65,7 @@
+ pinctrl-0 = <&pinctrl_weim>;
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ compatible = "cfi-flash";
+ reg = <0 0x00000000 0x02000000>;
+ bank-width = <4>;
+diff --git a/arch/arm/boot/dts/imx1-apf9328.dts b/arch/arm/boot/dts/imx1-apf9328.dts
+index 77b21aa7a146..27e72b07b517 100644
+--- a/arch/arm/boot/dts/imx1-apf9328.dts
++++ b/arch/arm/boot/dts/imx1-apf9328.dts
+@@ -45,7 +45,7 @@
+ pinctrl-0 = <&pinctrl_weim>;
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ compatible = "cfi-flash";
+ reg = <0 0x00000000 0x02000000>;
+ bank-width = <2>;
+diff --git a/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi b/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi
+index 4b83e2918b55..c7e923584878 100644
+--- a/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi
++++ b/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi
+@@ -90,7 +90,7 @@
+ &weim {
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ #address-cells = <1>;
+ #size-cells = <1>;
+ compatible = "cfi-flash";
+diff --git a/arch/arm/boot/dts/imx27-phytec-phycore-som.dtsi b/arch/arm/boot/dts/imx27-phytec-phycore-som.dtsi
+index 3d10273177e9..a5fdc2fd4ce5 100644
+--- a/arch/arm/boot/dts/imx27-phytec-phycore-som.dtsi
++++ b/arch/arm/boot/dts/imx27-phytec-phycore-som.dtsi
+@@ -322,7 +322,7 @@
+ &weim {
+ status = "okay";
+
+- nor: nor@0,0 {
++ nor: flash@0,0 {
+ compatible = "cfi-flash";
+ reg = <0 0x00000000 0x02000000>;
+ bank-width = <2>;
+--
+2.43.0
+
--- /dev/null
+From 838d9c9f24f540ffa670c7c053a22256b2ec2c4e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:39:21 -0300
+Subject: ARM: dts: imx1: Fix sram node
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit c248e535973088ba7071ff6f26ab7951143450af ]
+
+Per sram.yaml, address-cells, size-cells and ranges are mandatory.
+
+The node name should be sram.
+
+Change the node name and pass the required properties to fix the
+following dt-schema warnings:
+
+imx1-apf9328.dtb: esram@300000: $nodename:0: 'esram@300000' does not match '^sram(@.*)?'
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+imx1-apf9328.dtb: esram@300000: '#address-cells' is a required property
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+imx1-apf9328.dtb: esram@300000: '#size-cells' is a required property
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+imx1-apf9328.dtb: esram@300000: 'ranges' is a required property
+ from schema $id: http://devicetree.org/schemas/sram/sram.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx1.dtsi | 5 ++++-
+ 1 file changed, 4 insertions(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/imx1.dtsi b/arch/arm/boot/dts/imx1.dtsi
+index 9b940987864c..8d6e900a9081 100644
+--- a/arch/arm/boot/dts/imx1.dtsi
++++ b/arch/arm/boot/dts/imx1.dtsi
+@@ -268,9 +268,12 @@
+ status = "disabled";
+ };
+
+- esram: esram@300000 {
++ esram: sram@300000 {
+ compatible = "mmio-sram";
+ reg = <0x00300000 0x20000>;
++ ranges = <0 0x00300000 0x20000>;
++ #address-cells = <1>;
++ #size-cells = <1>;
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From bb321cd65794677fd61d0b09a0d69e6cb35881cc Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 07:26:31 -0300
+Subject: ARM: dts: imx23/28: Fix the DMA controller node name
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 858d83ca4b50bbc8693d95cc94310e6d791fb2e6 ]
+
+Per fsl,mxs-dma.yaml, the node name should be 'dma-controller'.
+
+Change it to fix the following dt-schema warning.
+
+imx28-apf28.dtb: dma-apbx@80024000: $nodename:0: 'dma-apbx@80024000' does not match '^dma-controller(@.*)?$'
+ from schema $id: http://devicetree.org/schemas/dma/fsl,mxs-dma.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx23.dtsi | 2 +-
+ arch/arm/boot/dts/imx28.dtsi | 2 +-
+ 2 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/arch/arm/boot/dts/imx23.dtsi b/arch/arm/boot/dts/imx23.dtsi
+index ce3d6360a7ef..b236d23f8071 100644
+--- a/arch/arm/boot/dts/imx23.dtsi
++++ b/arch/arm/boot/dts/imx23.dtsi
+@@ -414,7 +414,7 @@
+ status = "disabled";
+ };
+
+- dma_apbx: dma-apbx@80024000 {
++ dma_apbx: dma-controller@80024000 {
+ compatible = "fsl,imx23-dma-apbx";
+ reg = <0x80024000 0x2000>;
+ interrupts = <7 5 9 26
+diff --git a/arch/arm/boot/dts/imx28.dtsi b/arch/arm/boot/dts/imx28.dtsi
+index 6cab8b66db80..23ef4a322995 100644
+--- a/arch/arm/boot/dts/imx28.dtsi
++++ b/arch/arm/boot/dts/imx28.dtsi
+@@ -982,7 +982,7 @@
+ status = "disabled";
+ };
+
+- dma_apbx: dma-apbx@80024000 {
++ dma_apbx: dma-controller@80024000 {
+ compatible = "fsl,imx28-dma-apbx";
+ reg = <0x80024000 0x2000>;
+ interrupts = <78 79 66 0
+--
+2.43.0
+
--- /dev/null
+From 8e58e1cbcecbcee4c6ea51691bb79dc352261727 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 07:12:12 -0300
+Subject: ARM: dts: imx23-sansa: Use preferred i2c-gpios properties
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit e3aa1a82fb20ee97597022f6528823a8ab82bde6 ]
+
+The 'gpios' property to describe the SDA and SCL GPIOs is considered
+deprecated according to i2c-gpio.yaml.
+
+Switch to the preferred 'sda-gpios' and 'scl-gpios' properties.
+
+This fixes the following schema warnings:
+
+imx23-sansa.dtb: i2c-0: 'sda-gpios' is a required property
+ from schema $id: http://devicetree.org/schemas/i2c/i2c-gpio.yaml#
+imx23-sansa.dtb: i2c-0: 'scl-gpios' is a required property
+ from schema $id: http://devicetree.org/schemas/i2c/i2c-gpio.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx23-sansa.dts | 12 ++++--------
+ 1 file changed, 4 insertions(+), 8 deletions(-)
+
+diff --git a/arch/arm/boot/dts/imx23-sansa.dts b/arch/arm/boot/dts/imx23-sansa.dts
+index 46057d9bf555..c2efcc20ae80 100644
+--- a/arch/arm/boot/dts/imx23-sansa.dts
++++ b/arch/arm/boot/dts/imx23-sansa.dts
+@@ -175,10 +175,8 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+ compatible = "i2c-gpio";
+- gpios = <
+- &gpio1 24 0 /* SDA */
+- &gpio1 22 0 /* SCL */
+- >;
++ sda-gpios = <&gpio1 24 0>;
++ scl-gpios = <&gpio1 22 0>;
+ i2c-gpio,delay-us = <2>; /* ~100 kHz */
+ };
+
+@@ -186,10 +184,8 @@
+ #address-cells = <1>;
+ #size-cells = <0>;
+ compatible = "i2c-gpio";
+- gpios = <
+- &gpio0 31 0 /* SDA */
+- &gpio0 30 0 /* SCL */
+- >;
++ sda-gpios = <&gpio0 31 0>;
++ scl-gpios = <&gpio0 30 0>;
+ i2c-gpio,delay-us = <2>; /* ~100 kHz */
+
+ touch: touch@20 {
+--
+2.43.0
+
--- /dev/null
+From 2585f444dfb8feee6914069af3a1e7c7cafdb916 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 08:58:26 -0300
+Subject: ARM: dts: imx25/27-eukrea: Fix RTC node name
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 68c711b882c262e36895547cddea2c2d56ce611d ]
+
+Node names should be generic. Use 'rtc' as node name to fix
+the following dt-schema warning:
+
+imx25-eukrea-mbimxsd25-baseboard.dtb: pcf8563@51: $nodename:0: 'pcf8563@51' does not match '^rtc(@.*|-([0-9]|[1-9][0-9]+))?$'
+ from schema $id: http://devicetree.org/schemas/rtc/nxp,pcf8563.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx25-eukrea-cpuimx25.dtsi | 2 +-
+ arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi | 2 +-
+ 2 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/arch/arm/boot/dts/imx25-eukrea-cpuimx25.dtsi b/arch/arm/boot/dts/imx25-eukrea-cpuimx25.dtsi
+index 0703f62d10d1..93a6e4e680b4 100644
+--- a/arch/arm/boot/dts/imx25-eukrea-cpuimx25.dtsi
++++ b/arch/arm/boot/dts/imx25-eukrea-cpuimx25.dtsi
+@@ -27,7 +27,7 @@
+ pinctrl-0 = <&pinctrl_i2c1>;
+ status = "okay";
+
+- pcf8563@51 {
++ rtc@51 {
+ compatible = "nxp,pcf8563";
+ reg = <0x51>;
+ };
+diff --git a/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi b/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi
+index 74110bbcd9d4..4b83e2918b55 100644
+--- a/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi
++++ b/arch/arm/boot/dts/imx27-eukrea-cpuimx27.dtsi
+@@ -33,7 +33,7 @@
+ pinctrl-0 = <&pinctrl_i2c1>;
+ status = "okay";
+
+- pcf8563@51 {
++ rtc@51 {
+ compatible = "nxp,pcf8563";
+ reg = <0x51>;
+ };
+--
+2.43.0
+
--- /dev/null
+From 4e43727da99c3cf4a381fbf0ccfae3339d266c2f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:14:05 -0300
+Subject: ARM: dts: imx25/27: Pass timing0
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 11ab7ad6f795ae23c398a4a5c56505d3dab27c4c ]
+
+Per display-timings.yaml, the 'timing' pattern should be used to
+describe the display timings.
+
+Change it accordingly to fix the following dt-schema warning:
+
+imx27-apf27dev.dtb: display-timings: '800x480' does not match any of the regexes: '^timing', 'pinctrl-[0-9]+'
+ from schema $id: http://devicetree.org/schemas/display/panel/display-timings.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts | 2 +-
+ arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts | 2 +-
+ arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts | 2 +-
+ arch/arm/boot/dts/imx25-pdk.dts | 2 +-
+ arch/arm/boot/dts/imx27-apf27dev.dts | 2 +-
+ arch/arm/boot/dts/imx27-eukrea-mbimxsd27-baseboard.dts | 2 +-
+ arch/arm/boot/dts/imx27-phytec-phycard-s-rdk.dts | 2 +-
+ arch/arm/boot/dts/imx27-phytec-phycore-rdk.dts | 2 +-
+ 8 files changed, 8 insertions(+), 8 deletions(-)
+
+diff --git a/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts b/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts
+index 7d4301b22b90..1ed3fb7b9ce6 100644
+--- a/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts
++++ b/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-cmo-qvga.dts
+@@ -16,7 +16,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&qvga_timings>;
+- qvga_timings: 320x240 {
++ qvga_timings: timing0 {
+ clock-frequency = <6500000>;
+ hactive = <320>;
+ vactive = <240>;
+diff --git a/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts b/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts
+index 80a7f96de4c6..64b2ffac463b 100644
+--- a/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts
++++ b/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-svga.dts
+@@ -16,7 +16,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&dvi_svga_timings>;
+- dvi_svga_timings: 800x600 {
++ dvi_svga_timings: timing0 {
+ clock-frequency = <40000000>;
+ hactive = <800>;
+ vactive = <600>;
+diff --git a/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts b/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts
+index 24027a1fb46d..fb074bfdaa8d 100644
+--- a/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts
++++ b/arch/arm/boot/dts/imx25-eukrea-mbimxsd25-baseboard-dvi-vga.dts
+@@ -16,7 +16,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&dvi_vga_timings>;
+- dvi_vga_timings: 640x480 {
++ dvi_vga_timings: timing0 {
+ clock-frequency = <31250000>;
+ hactive = <640>;
+ vactive = <480>;
+diff --git a/arch/arm/boot/dts/imx25-pdk.dts b/arch/arm/boot/dts/imx25-pdk.dts
+index fb66884d8a2f..59b40d13a640 100644
+--- a/arch/arm/boot/dts/imx25-pdk.dts
++++ b/arch/arm/boot/dts/imx25-pdk.dts
+@@ -78,7 +78,7 @@
+ bus-width = <18>;
+ display-timings {
+ native-mode = <&wvga_timings>;
+- wvga_timings: 640x480 {
++ wvga_timings: timing0 {
+ hactive = <640>;
+ vactive = <480>;
+ hback-porch = <45>;
+diff --git a/arch/arm/boot/dts/imx27-apf27dev.dts b/arch/arm/boot/dts/imx27-apf27dev.dts
+index 6f1e8ce9e76e..68fcb5ce9a9e 100644
+--- a/arch/arm/boot/dts/imx27-apf27dev.dts
++++ b/arch/arm/boot/dts/imx27-apf27dev.dts
+@@ -16,7 +16,7 @@
+ fsl,pcr = <0xfae80083>; /* non-standard but required */
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 800x480 {
++ timing0: timing0 {
+ clock-frequency = <33000033>;
+ hactive = <800>;
+ vactive = <480>;
+diff --git a/arch/arm/boot/dts/imx27-eukrea-mbimxsd27-baseboard.dts b/arch/arm/boot/dts/imx27-eukrea-mbimxsd27-baseboard.dts
+index 9c3ec82ec7e5..50fa0bd4c8a1 100644
+--- a/arch/arm/boot/dts/imx27-eukrea-mbimxsd27-baseboard.dts
++++ b/arch/arm/boot/dts/imx27-eukrea-mbimxsd27-baseboard.dts
+@@ -16,7 +16,7 @@
+
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 320x240 {
++ timing0: timing0 {
+ clock-frequency = <6500000>;
+ hactive = <320>;
+ vactive = <240>;
+diff --git a/arch/arm/boot/dts/imx27-phytec-phycard-s-rdk.dts b/arch/arm/boot/dts/imx27-phytec-phycard-s-rdk.dts
+index 188639738dc3..7f36af150a25 100644
+--- a/arch/arm/boot/dts/imx27-phytec-phycard-s-rdk.dts
++++ b/arch/arm/boot/dts/imx27-phytec-phycard-s-rdk.dts
+@@ -19,7 +19,7 @@
+ fsl,pcr = <0xf0c88080>; /* non-standard but required */
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 640x480 {
++ timing0: timing0 {
+ hactive = <640>;
+ vactive = <480>;
+ hback-porch = <112>;
+diff --git a/arch/arm/boot/dts/imx27-phytec-phycore-rdk.dts b/arch/arm/boot/dts/imx27-phytec-phycore-rdk.dts
+index 344e77790152..d133b9f08b3a 100644
+--- a/arch/arm/boot/dts/imx27-phytec-phycore-rdk.dts
++++ b/arch/arm/boot/dts/imx27-phytec-phycore-rdk.dts
+@@ -19,7 +19,7 @@
+
+ display-timings {
+ native-mode = <&timing0>;
+- timing0: 240x320 {
++ timing0: timing0 {
+ clock-frequency = <5500000>;
+ hactive = <240>;
+ vactive = <320>;
+--
+2.43.0
+
--- /dev/null
+From 7c8ae83419696953f3823f23ef0a3f0e34b113a5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:00:33 -0300
+Subject: ARM: dts: imx25: Fix the iim compatible string
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit f0b929f58719fc57a4926ab4fc972f185453d6a5 ]
+
+Per imx-iim.yaml, the compatible string should only contain a single
+entry.
+
+Use it as "fsl,imx25-iim" to fix the following dt-schema warning:
+
+imx25-karo-tx25.dtb: efuse@53ff0000: compatible: ['fsl,imx25-iim', 'fsl,imx27-iim'] is too long
+ from schema $id: http://devicetree.org/schemas/nvmem/imx-iim.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx25.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/imx25.dtsi b/arch/arm/boot/dts/imx25.dtsi
+index d24b1da18766..99886ba36724 100644
+--- a/arch/arm/boot/dts/imx25.dtsi
++++ b/arch/arm/boot/dts/imx25.dtsi
+@@ -543,7 +543,7 @@
+ };
+
+ iim: efuse@53ff0000 {
+- compatible = "fsl,imx25-iim", "fsl,imx27-iim";
++ compatible = "fsl,imx25-iim";
+ reg = <0x53ff0000 0x4000>;
+ interrupts = <19>;
+ clocks = <&clks 99>;
+--
+2.43.0
+
--- /dev/null
+From 5fa03ca959fc3059857edbeb9d7a9d4a5eb80a67 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 17:19:05 -0300
+Subject: ARM: dts: imx27-apf27dev: Fix LED name
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit dc35e253d032b959d92e12f081db5b00db26ae64 ]
+
+Per leds-gpio.yaml, the led names should start with 'led'.
+
+Change it to fix the following dt-schema warning:
+
+imx27-apf27dev.dtb: leds: 'user' does not match any of the regexes: '(^led-[0-9a-f]$|led)', 'pinctrl-[0-9]+'
+ from schema $id: http://devicetree.org/schemas/leds/leds-gpio.yaml#
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx27-apf27dev.dts | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/imx27-apf27dev.dts b/arch/arm/boot/dts/imx27-apf27dev.dts
+index 68fcb5ce9a9e..3d9bb7fc3be2 100644
+--- a/arch/arm/boot/dts/imx27-apf27dev.dts
++++ b/arch/arm/boot/dts/imx27-apf27dev.dts
+@@ -47,7 +47,7 @@
+ pinctrl-names = "default";
+ pinctrl-0 = <&pinctrl_gpio_leds>;
+
+- user {
++ led-user {
+ label = "Heartbeat";
+ gpios = <&gpio6 14 GPIO_ACTIVE_HIGH>;
+ linux,default-trigger = "heartbeat";
+--
+2.43.0
+
--- /dev/null
+From 64bc6b30146abbbd8bf6939619e0fb36b9085601 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:39:20 -0300
+Subject: ARM: dts: imx27: Fix sram node
+
+From: Fabio Estevam <festevam@denx.de>
+
+[ Upstream commit 2fb7b2a2f06bb3f8321cf26c33e4e820c5b238b6 ]
+
+Per sram.yaml, address-cells, size-cells and ranges are mandatory.
+
+Pass them to fix the following dt-schema warnings:
+
+Signed-off-by: Fabio Estevam <festevam@denx.de>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx27.dtsi | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/arch/arm/boot/dts/imx27.dtsi b/arch/arm/boot/dts/imx27.dtsi
+index 7bc132737a37..8ae24c865521 100644
+--- a/arch/arm/boot/dts/imx27.dtsi
++++ b/arch/arm/boot/dts/imx27.dtsi
+@@ -588,6 +588,9 @@
+ iram: sram@ffff4c00 {
+ compatible = "mmio-sram";
+ reg = <0xffff4c00 0xb400>;
++ ranges = <0 0xffff4c00 0xb400>;
++ #address-cells = <1>;
++ #size-cells = <1>;
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From 01fc1cd926e1b08f6fccaae1f6692ec6935f950d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 10:15:53 +0200
+Subject: ARM: dts: imx7d: Fix coresight funnel ports
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 0d4ac04fa7c3f6dc263dba6f575a2ec7a2d4eca8 ]
+
+imx7d uses two ports for 'in-ports', so the syntax port@<num> has to
+be used. imx7d has both port and port@1 nodes present, raising these
+error:
+funnel@30041000: in-ports: More than one condition true in oneOf schema
+funnel@30041000: Unevaluated properties are not allowed
+('in-ports' was unexpected)
+
+Fix this by also using port@0 for imx7s as well.
+
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx7d.dtsi | 3 ---
+ arch/arm/boot/dts/imx7s.dtsi | 6 +++++-
+ 2 files changed, 5 insertions(+), 4 deletions(-)
+
+diff --git a/arch/arm/boot/dts/imx7d.dtsi b/arch/arm/boot/dts/imx7d.dtsi
+index b0bcfa9094a3..8ad3e60fd7d1 100644
+--- a/arch/arm/boot/dts/imx7d.dtsi
++++ b/arch/arm/boot/dts/imx7d.dtsi
+@@ -209,9 +209,6 @@
+ };
+
+ &ca_funnel_in_ports {
+- #address-cells = <1>;
+- #size-cells = <0>;
+-
+ port@1 {
+ reg = <1>;
+ ca_funnel_in_port1: endpoint {
+diff --git a/arch/arm/boot/dts/imx7s.dtsi b/arch/arm/boot/dts/imx7s.dtsi
+index 03bde2fb9bb1..622c60bd8b75 100644
+--- a/arch/arm/boot/dts/imx7s.dtsi
++++ b/arch/arm/boot/dts/imx7s.dtsi
+@@ -173,7 +173,11 @@
+ clock-names = "apb_pclk";
+
+ ca_funnel_in_ports: in-ports {
+- port {
++ #address-cells = <1>;
++ #size-cells = <0>;
++
++ port@0 {
++ reg = <0>;
+ ca_funnel_in_port0: endpoint {
+ remote-endpoint = <&etm0_out_port>;
+ };
+--
+2.43.0
+
--- /dev/null
+From 1963a207eb34fa066c22fe7ff61f25876aae2cfb Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 10:15:54 +0200
+Subject: ARM: dts: imx7s: Fix lcdif compatible
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 5f55da4cc37051cda600ea870ce8cf29f1297715 ]
+
+imx7d-lcdif is compatible to imx6sx-lcdif. MXSFB_V6 supports overlay
+by using LCDC_AS_CTRL register. This registers used by overlay plane:
+* LCDC_AS_CTRL
+* LCDC_AS_BUF
+* LCDC_AS_NEXT_BUF
+are listed in i.MX7D RM as well.
+
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx7s.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/imx7s.dtsi b/arch/arm/boot/dts/imx7s.dtsi
+index 622c60bd8b75..31ccf65d159b 100644
+--- a/arch/arm/boot/dts/imx7s.dtsi
++++ b/arch/arm/boot/dts/imx7s.dtsi
+@@ -773,7 +773,7 @@
+ };
+
+ lcdif: lcdif@30730000 {
+- compatible = "fsl,imx7d-lcdif", "fsl,imx28-lcdif";
++ compatible = "fsl,imx7d-lcdif", "fsl,imx6sx-lcdif";
+ reg = <0x30730000 0x10000>;
+ interrupts = <GIC_SPI 5 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clks IMX7D_LCDIF_PIXEL_ROOT_CLK>,
+--
+2.43.0
+
--- /dev/null
+From 216b1e65785cecabe2ba161399da536409fc6225 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 12 Oct 2023 10:15:55 +0200
+Subject: ARM: dts: imx7s: Fix nand-controller #size-cells
+
+From: Alexander Stein <alexander.stein@ew.tq-group.com>
+
+[ Upstream commit 4aadb841ed49bada1415c48c44d21f5b69e01299 ]
+
+nand-controller.yaml bindings says #size-cells shall be set to 0.
+Fixes the dtbs_check warning:
+arch/arm/boot/dts/nxp/imx/imx7s-mba7.dtb: nand-controller@33002000:
+ #size-cells:0:0: 0 was expected
+ from schema $id: http://devicetree.org/schemas/mtd/gpmi-nand.yaml#
+
+Signed-off-by: Alexander Stein <alexander.stein@ew.tq-group.com>
+Signed-off-by: Shawn Guo <shawnguo@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/imx7s.dtsi | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/arm/boot/dts/imx7s.dtsi b/arch/arm/boot/dts/imx7s.dtsi
+index 31ccf65d159b..b4cab6a21437 100644
+--- a/arch/arm/boot/dts/imx7s.dtsi
++++ b/arch/arm/boot/dts/imx7s.dtsi
+@@ -1235,7 +1235,7 @@
+ gpmi: nand-controller@33002000{
+ compatible = "fsl,imx7d-gpmi-nand";
+ #address-cells = <1>;
+- #size-cells = <1>;
++ #size-cells = <0>;
+ reg = <0x33002000 0x2000>, <0x33004000 0x4000>;
+ reg-names = "gpmi-nand", "bch";
+ interrupts = <GIC_SPI 14 IRQ_TYPE_LEVEL_HIGH>;
+--
+2.43.0
+
--- /dev/null
+From 7512b4e414a5b145b560f1435fc7464dcbc7c22c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 18:40:27 +0100
+Subject: ARM: dts: rockchip: fix rk3036 hdmi ports node
+
+From: Johan Jonker <jbx6244@gmail.com>
+
+[ Upstream commit 27ded76ef0fcfcf939914532aae575cf23c221b4 ]
+
+Fix hdmi ports node so that it matches the
+rockchip,inno-hdmi.yaml binding.
+
+Signed-off-by: Johan Jonker <jbx6244@gmail.com>
+Link: https://lore.kernel.org/r/9a2afac1-ed5c-382d-02b0-b2f5f1af3abb@gmail.com
+Signed-off-by: Heiko Stuebner <heiko@sntech.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm/boot/dts/rk3036.dtsi | 14 +++++++++++---
+ 1 file changed, 11 insertions(+), 3 deletions(-)
+
+diff --git a/arch/arm/boot/dts/rk3036.dtsi b/arch/arm/boot/dts/rk3036.dtsi
+index 093567022386..5f47b638f532 100644
+--- a/arch/arm/boot/dts/rk3036.dtsi
++++ b/arch/arm/boot/dts/rk3036.dtsi
+@@ -336,12 +336,20 @@
+ pinctrl-0 = <&hdmi_ctl>;
+ status = "disabled";
+
+- hdmi_in: port {
++ ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
+- hdmi_in_vop: endpoint@0 {
++
++ hdmi_in: port@0 {
+ reg = <0>;
+- remote-endpoint = <&vop_out_hdmi>;
++
++ hdmi_in_vop: endpoint {
++ remote-endpoint = <&vop_out_hdmi>;
++ };
++ };
++
++ hdmi_out: port@1 {
++ reg = <1>;
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From ea47e0d8170bfeb644cb9d21a4d99b297e047f7c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 9 Dec 2023 23:26:29 -0800
+Subject: arm64: dts: qcom: msm8996: Fix 'in-ports' is a required property
+
+From: Mao Jinlong <quic_jinlmao@quicinc.com>
+
+[ Upstream commit 9a6fc510a6a3ec150cb7450aec1e5f257e6fc77b ]
+
+Add the inport of funnel@3023000 to fix 'in-ports' is a required property
+warning.
+
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Mao Jinlong <quic_jinlmao@quicinc.com>
+Link: https://lore.kernel.org/r/20231210072633.4243-3-quic_jinlmao@quicinc.com
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/msm8996.dtsi | 21 +++++++++++++++++++++
+ 1 file changed, 21 insertions(+)
+
+diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
+index 0bc5fefb7a49..d766f3b5c03e 100644
+--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
++++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
+@@ -139,6 +139,19 @@
+ reg = <0 0 0 0>;
+ };
+
++ etm {
++ compatible = "qcom,coresight-remote-etm";
++
++ out-ports {
++ port {
++ modem_etm_out_funnel_in2: endpoint {
++ remote-endpoint =
++ <&funnel_in2_in_modem_etm>;
++ };
++ };
++ };
++ };
++
+ psci {
+ compatible = "arm,psci-1.0";
+ method = "smc";
+@@ -1374,6 +1387,14 @@
+ clocks = <&rpmcc RPM_QDSS_CLK>, <&rpmcc RPM_QDSS_A_CLK>;
+ clock-names = "apb_pclk", "atclk";
+
++ in-ports {
++ port {
++ funnel_in2_in_modem_etm: endpoint {
++ remote-endpoint =
++ <&modem_etm_out_funnel_in2>;
++ };
++ };
++ };
+
+ out-ports {
+ port {
+--
+2.43.0
+
--- /dev/null
+From 6d654be3732be4547cc2a4cf26d3e33c5c33b47a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 9 Dec 2023 23:26:30 -0800
+Subject: arm64: dts: qcom: msm8998: Fix 'out-ports' is a required property
+
+From: Mao Jinlong <quic_jinlmao@quicinc.com>
+
+[ Upstream commit ae5ee3562a2519214b12228545e88a203dd68bbd ]
+
+out-ports is a required property for coresight ETM. Add out-ports for
+ETM nodes to fix the warning.
+
+Reviewed-by: Krzysztof Kozlowski <krzysztof.kozlowski@linaro.org>
+Signed-off-by: Mao Jinlong <quic_jinlmao@quicinc.com>
+Link: https://lore.kernel.org/r/20231210072633.4243-4-quic_jinlmao@quicinc.com
+Signed-off-by: Bjorn Andersson <andersson@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/boot/dts/qcom/msm8998.dtsi | 32 +++++++++++++++++----------
+ 1 file changed, 20 insertions(+), 12 deletions(-)
+
+diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
+index 7c8d69ca91cf..ca8e7848769a 100644
+--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
++++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
+@@ -1577,9 +1577,11 @@
+
+ cpu = <&CPU4>;
+
+- port{
+- etm4_out: endpoint {
+- remote-endpoint = <&apss_funnel_in4>;
++ out-ports {
++ port{
++ etm4_out: endpoint {
++ remote-endpoint = <&apss_funnel_in4>;
++ };
+ };
+ };
+ };
+@@ -1594,9 +1596,11 @@
+
+ cpu = <&CPU5>;
+
+- port{
+- etm5_out: endpoint {
+- remote-endpoint = <&apss_funnel_in5>;
++ out-ports {
++ port{
++ etm5_out: endpoint {
++ remote-endpoint = <&apss_funnel_in5>;
++ };
+ };
+ };
+ };
+@@ -1611,9 +1615,11 @@
+
+ cpu = <&CPU6>;
+
+- port{
+- etm6_out: endpoint {
+- remote-endpoint = <&apss_funnel_in6>;
++ out-ports {
++ port{
++ etm6_out: endpoint {
++ remote-endpoint = <&apss_funnel_in6>;
++ };
+ };
+ };
+ };
+@@ -1628,9 +1634,11 @@
+
+ cpu = <&CPU7>;
+
+- port{
+- etm7_out: endpoint {
+- remote-endpoint = <&apss_funnel_in7>;
++ out-ports {
++ port{
++ etm7_out: endpoint {
++ remote-endpoint = <&apss_funnel_in7>;
++ };
+ };
+ };
+ };
+--
+2.43.0
+
--- /dev/null
+From 5b5e76abd023348c6a675feef1600aa893d104f3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 14:07:51 +0200
+Subject: ASoC: doc: Fix undefined SND_SOC_DAPM_NOPM argument
+
+From: Cristian Ciocaltea <cristian.ciocaltea@collabora.com>
+
+[ Upstream commit 67c7666fe808c3a7af3cc6f9d0a3dd3acfd26115 ]
+
+The virtual widget example makes use of an undefined SND_SOC_DAPM_NOPM
+argument passed to SND_SOC_DAPM_MIXER(). Replace with the correct
+SND_SOC_NOPM definition.
+
+Signed-off-by: Cristian Ciocaltea <cristian.ciocaltea@collabora.com>
+Link: https://lore.kernel.org/r/20231121120751.77355-1-cristian.ciocaltea@collabora.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ Documentation/sound/soc/dapm.rst | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/Documentation/sound/soc/dapm.rst b/Documentation/sound/soc/dapm.rst
+index 8e44107933ab..c3154ce6e1b2 100644
+--- a/Documentation/sound/soc/dapm.rst
++++ b/Documentation/sound/soc/dapm.rst
+@@ -234,7 +234,7 @@ corresponding soft power control. In this case it is necessary to create
+ a virtual widget - a widget with no control bits e.g.
+ ::
+
+- SND_SOC_DAPM_MIXER("AC97 Mixer", SND_SOC_DAPM_NOPM, 0, 0, NULL, 0),
++ SND_SOC_DAPM_MIXER("AC97 Mixer", SND_SOC_NOPM, 0, 0, NULL, 0),
+
+ This can be used to merge to signal paths together in software.
+
+--
+2.43.0
+
--- /dev/null
+From f33d952c4bf365694a0dd91ac910ae048e2c2839 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 18 Oct 2023 09:23:51 +0000
+Subject: audit: Send netlink ACK before setting connection in auditd_set
+
+From: Chris Riches <chris.riches@nutanix.com>
+
+[ Upstream commit 022732e3d846e197539712e51ecada90ded0572a ]
+
+When auditd_set sets the auditd_conn pointer, audit messages can
+immediately be put on the socket by other kernel threads. If the backlog
+is large or the rate is high, this can immediately fill the socket
+buffer. If the audit daemon requested an ACK for this operation, a full
+socket buffer causes the ACK to get dropped, also setting ENOBUFS on the
+socket.
+
+To avoid this race and ensure ACKs get through, fast-track the ACK in
+this specific case to ensure it is sent before auditd_conn is set.
+
+Signed-off-by: Chris Riches <chris.riches@nutanix.com>
+[PM: fix some tab vs space damage]
+Signed-off-by: Paul Moore <paul@paul-moore.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/audit.c | 31 ++++++++++++++++++++++++-------
+ 1 file changed, 24 insertions(+), 7 deletions(-)
+
+diff --git a/kernel/audit.c b/kernel/audit.c
+index aeec86ed4708..2ab04e0a7441 100644
+--- a/kernel/audit.c
++++ b/kernel/audit.c
+@@ -490,15 +490,19 @@ static void auditd_conn_free(struct rcu_head *rcu)
+ * @pid: auditd PID
+ * @portid: auditd netlink portid
+ * @net: auditd network namespace pointer
++ * @skb: the netlink command from the audit daemon
++ * @ack: netlink ack flag, cleared if ack'd here
+ *
+ * Description:
+ * This function will obtain and drop network namespace references as
+ * necessary. Returns zero on success, negative values on failure.
+ */
+-static int auditd_set(struct pid *pid, u32 portid, struct net *net)
++static int auditd_set(struct pid *pid, u32 portid, struct net *net,
++ struct sk_buff *skb, bool *ack)
+ {
+ unsigned long flags;
+ struct auditd_connection *ac_old, *ac_new;
++ struct nlmsghdr *nlh;
+
+ if (!pid || !net)
+ return -EINVAL;
+@@ -510,6 +514,13 @@ static int auditd_set(struct pid *pid, u32 portid, struct net *net)
+ ac_new->portid = portid;
+ ac_new->net = get_net(net);
+
++ /* send the ack now to avoid a race with the queue backlog */
++ if (*ack) {
++ nlh = nlmsg_hdr(skb);
++ netlink_ack(skb, nlh, 0, NULL);
++ *ack = false;
++ }
++
+ spin_lock_irqsave(&auditd_conn_lock, flags);
+ ac_old = rcu_dereference_protected(auditd_conn,
+ lockdep_is_held(&auditd_conn_lock));
+@@ -1203,7 +1214,8 @@ static int audit_replace(struct pid *pid)
+ return auditd_send_unicast_skb(skb);
+ }
+
+-static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh)
++static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh,
++ bool *ack)
+ {
+ u32 seq;
+ void *data;
+@@ -1296,7 +1308,8 @@ static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh)
+ /* register a new auditd connection */
+ err = auditd_set(req_pid,
+ NETLINK_CB(skb).portid,
+- sock_net(NETLINK_CB(skb).sk));
++ sock_net(NETLINK_CB(skb).sk),
++ skb, ack);
+ if (audit_enabled != AUDIT_OFF)
+ audit_log_config_change("audit_pid",
+ new_pid,
+@@ -1541,9 +1554,10 @@ static int audit_receive_msg(struct sk_buff *skb, struct nlmsghdr *nlh)
+ * Parse the provided skb and deal with any messages that may be present,
+ * malformed skbs are discarded.
+ */
+-static void audit_receive(struct sk_buff *skb)
++static void audit_receive(struct sk_buff *skb)
+ {
+ struct nlmsghdr *nlh;
++ bool ack;
+ /*
+ * len MUST be signed for nlmsg_next to be able to dec it below 0
+ * if the nlmsg_len was not aligned
+@@ -1556,9 +1570,12 @@ static void audit_receive(struct sk_buff *skb)
+
+ audit_ctl_lock();
+ while (nlmsg_ok(nlh, len)) {
+- err = audit_receive_msg(skb, nlh);
+- /* if err or if this message says it wants a response */
+- if (err || (nlh->nlmsg_flags & NLM_F_ACK))
++ ack = nlh->nlmsg_flags & NLM_F_ACK;
++ err = audit_receive_msg(skb, nlh, &ack);
++
++ /* send an ack if the user asked for one and audit_receive_msg
++ * didn't already do it, or if there was an error. */
++ if (ack || err)
+ netlink_ack(skb, nlh, err, NULL);
+
+ nlh = nlmsg_next(nlh, &len);
+--
+2.43.0
+
--- /dev/null
+From 0609bcb07548d483ca83f7357b1342791b9523db Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 12 Jan 2024 20:26:26 +0800
+Subject: blk-mq: fix IO hang from sbitmap wakeup race
+
+From: Ming Lei <ming.lei@redhat.com>
+
+[ Upstream commit 5266caaf5660529e3da53004b8b7174cab6374ed ]
+
+In blk_mq_mark_tag_wait(), __add_wait_queue() may be re-ordered
+with the following blk_mq_get_driver_tag() in case of getting driver
+tag failure.
+
+Then in __sbitmap_queue_wake_up(), waitqueue_active() may not observe
+the added waiter in blk_mq_mark_tag_wait() and wake up nothing, meantime
+blk_mq_mark_tag_wait() can't get driver tag successfully.
+
+This issue can be reproduced by running the following test in loop, and
+fio hang can be observed in < 30min when running it on my test VM
+in laptop.
+
+ modprobe -r scsi_debug
+ modprobe scsi_debug delay=0 dev_size_mb=4096 max_queue=1 host_max_queue=1 submit_queues=4
+ dev=`ls -d /sys/bus/pseudo/drivers/scsi_debug/adapter*/host*/target*/*/block/* | head -1 | xargs basename`
+ fio --filename=/dev/"$dev" --direct=1 --rw=randrw --bs=4k --iodepth=1 \
+ --runtime=100 --numjobs=40 --time_based --name=test \
+ --ioengine=libaio
+
+Fix the issue by adding one explicit barrier in blk_mq_mark_tag_wait(), which
+is just fine in case of running out of tag.
+
+Cc: Jan Kara <jack@suse.cz>
+Cc: Kemeng Shi <shikemeng@huaweicloud.com>
+Reported-by: Changhui Zhong <czhong@redhat.com>
+Signed-off-by: Ming Lei <ming.lei@redhat.com>
+Link: https://lore.kernel.org/r/20240112122626.4181044-1-ming.lei@redhat.com
+Signed-off-by: Jens Axboe <axboe@kernel.dk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ block/blk-mq.c | 16 ++++++++++++++++
+ 1 file changed, 16 insertions(+)
+
+diff --git a/block/blk-mq.c b/block/blk-mq.c
+index e153a36c9ba3..a7a31d7090ae 100644
+--- a/block/blk-mq.c
++++ b/block/blk-mq.c
+@@ -1188,6 +1188,22 @@ static bool blk_mq_mark_tag_wait(struct blk_mq_hw_ctx *hctx,
+ wait->flags &= ~WQ_FLAG_EXCLUSIVE;
+ __add_wait_queue(wq, wait);
+
++ /*
++ * Add one explicit barrier since blk_mq_get_driver_tag() may
++ * not imply barrier in case of failure.
++ *
++ * Order adding us to wait queue and allocating driver tag.
++ *
++ * The pair is the one implied in sbitmap_queue_wake_up() which
++ * orders clearing sbitmap tag bits and waitqueue_active() in
++ * __sbitmap_queue_wake_up(), since waitqueue_active() is lockless
++ *
++ * Otherwise, re-order of adding wait queue and getting driver tag
++ * may cause __sbitmap_queue_wake_up() to wake up nothing because
++ * the waitqueue_active() may not observe us in wait queue.
++ */
++ smp_mb();
++
+ /*
+ * It's possible that a tag was freed in the window between the
+ * allocation failure and adding the hardware queue to the wait
+--
+2.43.0
+
--- /dev/null
+From 0a3cd18f654595ffa337baa77e28d64d08ce05a6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 18:34:18 +0100
+Subject: block: prevent an integer overflow in bvec_try_merge_hw_page
+
+From: Christoph Hellwig <hch@lst.de>
+
+[ Upstream commit 3f034c374ad55773c12dd8f3c1607328e17c0072 ]
+
+Reordered a check to avoid a possible overflow when adding len to bv_len.
+
+Signed-off-by: Christoph Hellwig <hch@lst.de>
+Reviewed-by: Johannes Thumshirn <johannes.thumshirn@wdc.com>
+Link: https://lore.kernel.org/r/20231204173419.782378-2-hch@lst.de
+Signed-off-by: Jens Axboe <axboe@kernel.dk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ block/bio.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/block/bio.c b/block/bio.c
+index b729f0240082..6f7a1aa9ea22 100644
+--- a/block/bio.c
++++ b/block/bio.c
+@@ -770,7 +770,7 @@ static bool bio_try_merge_hw_seg(struct request_queue *q, struct bio *bio,
+
+ if ((addr1 | mask) != (addr2 | mask))
+ return false;
+- if (bv->bv_len + len > queue_max_segment_size(q))
++ if (len > queue_max_segment_size(q) - bv->bv_len)
+ return false;
+ return __bio_try_merge_page(bio, page, len, offset, same_page);
+ }
+--
+2.43.0
+
--- /dev/null
+From 7f34513978a4de631949341fb570ba078fe2d797 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 13:47:42 -0800
+Subject: block/rnbd-srv: Check for unlikely string overflow
+
+From: Kees Cook <keescook@chromium.org>
+
+[ Upstream commit 9e4bf6a08d1e127bcc4bd72557f2dfafc6bc7f41 ]
+
+Since "dev_search_path" can technically be as large as PATH_MAX,
+there was a risk of truncation when copying it and a second string
+into "full_path" since it was also PATH_MAX sized. The W=1 builds were
+reporting this warning:
+
+drivers/block/rnbd/rnbd-srv.c: In function 'process_msg_open.isra':
+drivers/block/rnbd/rnbd-srv.c:616:51: warning: '%s' directive output may be truncated writing up to 254 bytes into a region of size between 0 and 4095 [-Wformat-truncation=]
+ 616 | snprintf(full_path, PATH_MAX, "%s/%s",
+ | ^~
+In function 'rnbd_srv_get_full_path',
+ inlined from 'process_msg_open.isra' at drivers/block/rnbd/rnbd-srv.c:721:14: drivers/block/rnbd/rnbd-srv.c:616:17: note: 'snprintf' output between 2 and 4351 bytes into a destination of size 4096
+ 616 | snprintf(full_path, PATH_MAX, "%s/%s",
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+ 617 | dev_search_path, dev_name);
+ | ~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+To fix this, unconditionally check for truncation (as was already done
+for the case where "%SESSNAME%" was present).
+
+Reported-by: kernel test robot <lkp@intel.com>
+Closes: https://lore.kernel.org/oe-kbuild-all/202312100355.lHoJPgKy-lkp@intel.com/
+Cc: Md. Haris Iqbal <haris.iqbal@ionos.com>
+Cc: Jack Wang <jinpu.wang@ionos.com>
+Cc: Jens Axboe <axboe@kernel.dk>
+Cc: <linux-block@vger.kernel.org>
+Signed-off-by: Kees Cook <keescook@chromium.org>
+Acked-by: Guoqing Jiang <guoqing.jiang@linux.dev>
+Acked-by: Jack Wang <jinpu.wang@ionos.com>
+Link: https://lore.kernel.org/r/20231212214738.work.169-kees@kernel.org
+Signed-off-by: Jens Axboe <axboe@kernel.dk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/block/rnbd/rnbd-srv.c | 19 ++++++++++---------
+ 1 file changed, 10 insertions(+), 9 deletions(-)
+
+diff --git a/drivers/block/rnbd/rnbd-srv.c b/drivers/block/rnbd/rnbd-srv.c
+index e1bc8b4cd592..9c5d52335e17 100644
+--- a/drivers/block/rnbd/rnbd-srv.c
++++ b/drivers/block/rnbd/rnbd-srv.c
+@@ -591,6 +591,7 @@ static char *rnbd_srv_get_full_path(struct rnbd_srv_session *srv_sess,
+ {
+ char *full_path;
+ char *a, *b;
++ int len;
+
+ full_path = kmalloc(PATH_MAX, GFP_KERNEL);
+ if (!full_path)
+@@ -602,19 +603,19 @@ static char *rnbd_srv_get_full_path(struct rnbd_srv_session *srv_sess,
+ */
+ a = strnstr(dev_search_path, "%SESSNAME%", sizeof(dev_search_path));
+ if (a) {
+- int len = a - dev_search_path;
++ len = a - dev_search_path;
+
+ len = snprintf(full_path, PATH_MAX, "%.*s/%s/%s", len,
+ dev_search_path, srv_sess->sessname, dev_name);
+- if (len >= PATH_MAX) {
+- pr_err("Too long path: %s, %s, %s\n",
+- dev_search_path, srv_sess->sessname, dev_name);
+- kfree(full_path);
+- return ERR_PTR(-EINVAL);
+- }
+ } else {
+- snprintf(full_path, PATH_MAX, "%s/%s",
+- dev_search_path, dev_name);
++ len = snprintf(full_path, PATH_MAX, "%s/%s",
++ dev_search_path, dev_name);
++ }
++ if (len >= PATH_MAX) {
++ pr_err("Too long path: %s, %s, %s\n",
++ dev_search_path, srv_sess->sessname, dev_name);
++ kfree(full_path);
++ return ERR_PTR(-EINVAL);
+ }
+
+ /* eliminitate duplicated slashes */
+--
+2.43.0
+
--- /dev/null
+From 928f1846e0795dae64c1f47f57335d3457cbf703 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 09:10:22 +0100
+Subject: Bluetooth: L2CAP: Fix possible multiple reject send
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Frédéric Danis <frederic.danis@collabora.com>
+
+[ Upstream commit 96a3398b467ab8aada3df2f3a79f4b7835d068b8 ]
+
+In case of an incomplete command or a command with a null identifier 2
+reject packets will be sent, one with the identifier and one with 0.
+Consuming the data of the command will prevent it.
+This allows to send a reject packet for each corrupted command in a
+multi-command packet.
+
+Signed-off-by: Frédéric Danis <frederic.danis@collabora.com>
+Signed-off-by: Luiz Augusto von Dentz <luiz.von.dentz@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/bluetooth/l2cap_core.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/net/bluetooth/l2cap_core.c b/net/bluetooth/l2cap_core.c
+index cf78a48085ed..a752032e12fc 100644
+--- a/net/bluetooth/l2cap_core.c
++++ b/net/bluetooth/l2cap_core.c
+@@ -6522,7 +6522,8 @@ static inline void l2cap_sig_channel(struct l2cap_conn *conn,
+ if (len > skb->len || !cmd->ident) {
+ BT_DBG("corrupted command");
+ l2cap_sig_send_rej(conn, cmd->ident);
+- break;
++ skb_pull(skb, len > skb->len ? skb->len : len);
++ continue;
+ }
+
+ err = l2cap_bredr_sig_cmd(conn, cmd, len, skb->data);
+--
+2.43.0
+
--- /dev/null
+From 9b167afc50599c4ded51471d3e88762f39dc77ff Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 6 Nov 2023 14:02:46 +0800
+Subject: Bluetooth: qca: Set both WIDEBAND_SPEECH and LE_STATES quirks for
+ QCA2066
+
+From: Zijun Hu <quic_zijuhu@quicinc.com>
+
+[ Upstream commit 5d192b697c7417254cdd9edc3d5e9e0364eb9045 ]
+
+Set both WIDEBAND_SPEECH_SUPPORTED and VALID_LE_STATES quirks
+for QCA2066.
+
+Signed-off-by: Zijun Hu <quic_zijuhu@quicinc.com>
+Signed-off-by: Luiz Augusto von Dentz <luiz.von.dentz@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/bluetooth/hci_qca.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/bluetooth/hci_qca.c b/drivers/bluetooth/hci_qca.c
+index bc0850d3f7d2..6e0c0762fbab 100644
+--- a/drivers/bluetooth/hci_qca.c
++++ b/drivers/bluetooth/hci_qca.c
+@@ -1814,6 +1814,7 @@ static const struct qca_device_data qca_soc_data_wcn3998 = {
+ static const struct qca_device_data qca_soc_data_qca6390 = {
+ .soc_type = QCA_QCA6390,
+ .num_vregs = 0,
++ .capabilities = QCA_CAP_WIDEBAND_SPEECH | QCA_CAP_VALID_LE_STATES,
+ };
+
+ static void qca_power_shutdown(struct hci_uart *hu)
+--
+2.43.0
+
--- /dev/null
+From 8f33d29fe5baf7f6fcf7d8060b72afb6dd07d72c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 18 Nov 2023 16:16:53 +0800
+Subject: bonding: return -ENOMEM instead of BUG in alb_upper_dev_walk
+
+From: Zhengchao Shao <shaozhengchao@huawei.com>
+
+[ Upstream commit d6b83f1e3707c4d60acfa58afd3515e17e5d5384 ]
+
+If failed to allocate "tags" or could not find the final upper device from
+start_dev's upper list in bond_verify_device_path(), only the loopback
+detection of the current upper device should be affected, and the system is
+no need to be panic.
+So return -ENOMEM in alb_upper_dev_walk to stop walking, print some warn
+information when failed to allocate memory for vlan tags in
+bond_verify_device_path.
+
+I also think that the following function calls
+netdev_walk_all_upper_dev_rcu
+---->>>alb_upper_dev_walk
+---------->>>bond_verify_device_path
+From this way, "end device" can eventually be obtained from "start device"
+in bond_verify_device_path, IS_ERR(tags) could be instead of
+IS_ERR_OR_NULL(tags) in alb_upper_dev_walk.
+
+Signed-off-by: Zhengchao Shao <shaozhengchao@huawei.com>
+Acked-by: Jay Vosburgh <jay.vosburgh@canonical.com>
+Link: https://lore.kernel.org/r/20231118081653.1481260-1-shaozhengchao@huawei.com
+Signed-off-by: Paolo Abeni <pabeni@redhat.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/bonding/bond_alb.c | 3 ++-
+ drivers/net/bonding/bond_main.c | 5 ++++-
+ 2 files changed, 6 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/bonding/bond_alb.c b/drivers/net/bonding/bond_alb.c
+index 64ba465741a7..81a5e7622ea7 100644
+--- a/drivers/net/bonding/bond_alb.c
++++ b/drivers/net/bonding/bond_alb.c
+@@ -971,7 +971,8 @@ static int alb_upper_dev_walk(struct net_device *upper,
+ if (netif_is_macvlan(upper) && !strict_match) {
+ tags = bond_verify_device_path(bond->dev, upper, 0);
+ if (IS_ERR_OR_NULL(tags))
+- BUG();
++ return -ENOMEM;
++
+ alb_send_lp_vid(slave, upper->dev_addr,
+ tags[0].vlan_proto, tags[0].vlan_id);
+ kfree(tags);
+diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
+index 50fabba04248..506d6fdbfacc 100644
+--- a/drivers/net/bonding/bond_main.c
++++ b/drivers/net/bonding/bond_main.c
+@@ -2777,8 +2777,11 @@ struct bond_vlan_tag *bond_verify_device_path(struct net_device *start_dev,
+
+ if (start_dev == end_dev) {
+ tags = kcalloc(level + 1, sizeof(*tags), GFP_ATOMIC);
+- if (!tags)
++ if (!tags) {
++ net_err_ratelimited("%s: %s: Failed to allocate tags\n",
++ __func__, start_dev->name);
+ return ERR_PTR(-ENOMEM);
++ }
+ tags[level].vlan_proto = VLAN_N_VID;
+ return tags;
+ }
+--
+2.43.0
+
--- /dev/null
+From 168f32fcc3cdfb611c0575ee9ffc5f1dd796b7c9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 22:04:20 +0800
+Subject: bpf: Add map and need_defer parameters to .map_fd_put_ptr()
+
+From: Hou Tao <houtao1@huawei.com>
+
+[ Upstream commit 20c20bd11a0702ce4dc9300c3da58acf551d9725 ]
+
+map is the pointer of outer map, and need_defer needs some explanation.
+need_defer tells the implementation to defer the reference release of
+the passed element and ensure that the element is still alive before
+the bpf program, which may manipulate it, exits.
+
+The following three cases will invoke map_fd_put_ptr() and different
+need_defer values will be passed to these callers:
+
+1) release the reference of the old element in the map during map update
+ or map deletion. The release must be deferred, otherwise the bpf
+ program may incur use-after-free problem, so need_defer needs to be
+ true.
+2) release the reference of the to-be-added element in the error path of
+ map update. The to-be-added element is not visible to any bpf
+ program, so it is OK to pass false for need_defer parameter.
+3) release the references of all elements in the map during map release.
+ Any bpf program which has access to the map must have been exited and
+ released, so need_defer=false will be OK.
+
+These two parameters will be used by the following patches to fix the
+potential use-after-free problem for map-in-map.
+
+Signed-off-by: Hou Tao <houtao1@huawei.com>
+Link: https://lore.kernel.org/r/20231204140425.1480317-3-houtao@huaweicloud.com
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/linux/bpf.h | 6 +++++-
+ kernel/bpf/arraymap.c | 12 +++++++-----
+ kernel/bpf/hashtab.c | 6 +++---
+ kernel/bpf/map_in_map.c | 2 +-
+ kernel/bpf/map_in_map.h | 2 +-
+ 5 files changed, 17 insertions(+), 11 deletions(-)
+
+diff --git a/include/linux/bpf.h b/include/linux/bpf.h
+index 8f4379e93ad4..bfdf40be5360 100644
+--- a/include/linux/bpf.h
++++ b/include/linux/bpf.h
+@@ -82,7 +82,11 @@ struct bpf_map_ops {
+ /* funcs called by prog_array and perf_event_array map */
+ void *(*map_fd_get_ptr)(struct bpf_map *map, struct file *map_file,
+ int fd);
+- void (*map_fd_put_ptr)(void *ptr);
++ /* If need_defer is true, the implementation should guarantee that
++ * the to-be-put element is still alive before the bpf program, which
++ * may manipulate it, exists.
++ */
++ void (*map_fd_put_ptr)(struct bpf_map *map, void *ptr, bool need_defer);
+ int (*map_gen_lookup)(struct bpf_map *map, struct bpf_insn *insn_buf);
+ u32 (*map_fd_sys_lookup_elem)(void *ptr);
+ void (*map_seq_show_elem)(struct bpf_map *map, void *key,
+diff --git a/kernel/bpf/arraymap.c b/kernel/bpf/arraymap.c
+index f241bda2679d..5102338129d5 100644
+--- a/kernel/bpf/arraymap.c
++++ b/kernel/bpf/arraymap.c
+@@ -764,7 +764,7 @@ int bpf_fd_array_map_update_elem(struct bpf_map *map, struct file *map_file,
+ }
+
+ if (old_ptr)
+- map->ops->map_fd_put_ptr(old_ptr);
++ map->ops->map_fd_put_ptr(map, old_ptr, true);
+ return 0;
+ }
+
+@@ -787,7 +787,7 @@ static int fd_array_map_delete_elem(struct bpf_map *map, void *key)
+ }
+
+ if (old_ptr) {
+- map->ops->map_fd_put_ptr(old_ptr);
++ map->ops->map_fd_put_ptr(map, old_ptr, true);
+ return 0;
+ } else {
+ return -ENOENT;
+@@ -811,8 +811,9 @@ static void *prog_fd_array_get_ptr(struct bpf_map *map,
+ return prog;
+ }
+
+-static void prog_fd_array_put_ptr(void *ptr)
++static void prog_fd_array_put_ptr(struct bpf_map *map, void *ptr, bool need_defer)
+ {
++ /* bpf_prog is freed after one RCU or tasks trace grace period */
+ bpf_prog_put(ptr);
+ }
+
+@@ -1139,8 +1140,9 @@ static void *perf_event_fd_array_get_ptr(struct bpf_map *map,
+ return ee;
+ }
+
+-static void perf_event_fd_array_put_ptr(void *ptr)
++static void perf_event_fd_array_put_ptr(struct bpf_map *map, void *ptr, bool need_defer)
+ {
++ /* bpf_perf_event is freed after one RCU grace period */
+ bpf_event_entry_free_rcu(ptr);
+ }
+
+@@ -1195,7 +1197,7 @@ static void *cgroup_fd_array_get_ptr(struct bpf_map *map,
+ return cgroup_get_from_fd(fd);
+ }
+
+-static void cgroup_fd_array_put_ptr(void *ptr)
++static void cgroup_fd_array_put_ptr(struct bpf_map *map, void *ptr, bool need_defer)
+ {
+ /* cgroup_put free cgrp after a rcu grace period */
+ cgroup_put(ptr);
+diff --git a/kernel/bpf/hashtab.c b/kernel/bpf/hashtab.c
+index 0ce445aadfdf..ec8497314272 100644
+--- a/kernel/bpf/hashtab.c
++++ b/kernel/bpf/hashtab.c
+@@ -786,7 +786,7 @@ static void htab_put_fd_value(struct bpf_htab *htab, struct htab_elem *l)
+
+ if (map->ops->map_fd_put_ptr) {
+ ptr = fd_htab_map_get_ptr(map, l);
+- map->ops->map_fd_put_ptr(ptr);
++ map->ops->map_fd_put_ptr(map, ptr, true);
+ }
+ }
+
+@@ -2023,7 +2023,7 @@ static void fd_htab_map_free(struct bpf_map *map)
+ hlist_nulls_for_each_entry_safe(l, n, head, hash_node) {
+ void *ptr = fd_htab_map_get_ptr(map, l);
+
+- map->ops->map_fd_put_ptr(ptr);
++ map->ops->map_fd_put_ptr(map, ptr, false);
+ }
+ }
+
+@@ -2064,7 +2064,7 @@ int bpf_fd_htab_map_update_elem(struct bpf_map *map, struct file *map_file,
+
+ ret = htab_map_update_elem(map, key, &ptr, map_flags);
+ if (ret)
+- map->ops->map_fd_put_ptr(ptr);
++ map->ops->map_fd_put_ptr(map, ptr, false);
+
+ return ret;
+ }
+diff --git a/kernel/bpf/map_in_map.c b/kernel/bpf/map_in_map.c
+index 39ab0b68cade..0cf4cb685810 100644
+--- a/kernel/bpf/map_in_map.c
++++ b/kernel/bpf/map_in_map.c
+@@ -100,7 +100,7 @@ void *bpf_map_fd_get_ptr(struct bpf_map *map,
+ return inner_map;
+ }
+
+-void bpf_map_fd_put_ptr(void *ptr)
++void bpf_map_fd_put_ptr(struct bpf_map *map, void *ptr, bool need_defer)
+ {
+ /* ptr->ops->map_free() has to go through one
+ * rcu grace period by itself.
+diff --git a/kernel/bpf/map_in_map.h b/kernel/bpf/map_in_map.h
+index bcb7534afb3c..7d61602354de 100644
+--- a/kernel/bpf/map_in_map.h
++++ b/kernel/bpf/map_in_map.h
+@@ -13,7 +13,7 @@ struct bpf_map *bpf_map_meta_alloc(int inner_map_ufd);
+ void bpf_map_meta_free(struct bpf_map *map_meta);
+ void *bpf_map_fd_get_ptr(struct bpf_map *map, struct file *map_file,
+ int ufd);
+-void bpf_map_fd_put_ptr(void *ptr);
++void bpf_map_fd_put_ptr(struct bpf_map *map, void *ptr, bool need_defer);
+ u32 bpf_map_fd_sys_lookup_elem(void *ptr);
+
+ #endif
+--
+2.43.0
+
--- /dev/null
+From bc9603533b9ee0f7f52ed9b55010f40bc489bc02 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 18:23:53 +0800
+Subject: bpf: Set uattr->batch.count as zero before batched update or deletion
+
+From: Hou Tao <houtao1@huawei.com>
+
+[ Upstream commit 06e5c999f10269a532304e89a6adb2fbfeb0593c ]
+
+generic_map_{delete,update}_batch() doesn't set uattr->batch.count as
+zero before it tries to allocate memory for key. If the memory
+allocation fails, the value of uattr->batch.count will be incorrect.
+
+Fix it by setting uattr->batch.count as zero beore batched update or
+deletion.
+
+Signed-off-by: Hou Tao <houtao1@huawei.com>
+Link: https://lore.kernel.org/r/20231208102355.2628918-6-houtao@huaweicloud.com
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/bpf/syscall.c | 6 ++++++
+ 1 file changed, 6 insertions(+)
+
+diff --git a/kernel/bpf/syscall.c b/kernel/bpf/syscall.c
+index aaad2dce2be6..16affa09db5c 100644
+--- a/kernel/bpf/syscall.c
++++ b/kernel/bpf/syscall.c
+@@ -1285,6 +1285,9 @@ int generic_map_delete_batch(struct bpf_map *map,
+ if (!max_count)
+ return 0;
+
++ if (put_user(0, &uattr->batch.count))
++ return -EFAULT;
++
+ key = kmalloc(map->key_size, GFP_USER | __GFP_NOWARN);
+ if (!key)
+ return -ENOMEM;
+@@ -1343,6 +1346,9 @@ int generic_map_update_batch(struct bpf_map *map,
+ if (!max_count)
+ return 0;
+
++ if (put_user(0, &uattr->batch.count))
++ return -EFAULT;
++
+ key = kmalloc(map->key_size, GFP_USER | __GFP_NOWARN);
+ if (!key)
+ return -ENOMEM;
+--
+2.43.0
+
--- /dev/null
+From c16a88d8f5627e7b992acde8bc144d2943a60f46 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 17 Nov 2023 13:26:18 +0800
+Subject: ceph: fix deadlock or deadcode of misusing dget()
+
+From: Xiubo Li <xiubli@redhat.com>
+
+[ Upstream commit b493ad718b1f0357394d2cdecbf00a44a36fa085 ]
+
+The lock order is incorrect between denty and its parent, we should
+always make sure that the parent get the lock first.
+
+But since this deadcode is never used and the parent dir will always
+be set from the callers, let's just remove it.
+
+Link: https://lore.kernel.org/r/20231116081919.GZ1957730@ZenIV
+Reported-by: Al Viro <viro@zeniv.linux.org.uk>
+Signed-off-by: Xiubo Li <xiubli@redhat.com>
+Reviewed-by: Jeff Layton <jlayton@kernel.org>
+Signed-off-by: Ilya Dryomov <idryomov@gmail.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ceph/caps.c | 9 +++------
+ 1 file changed, 3 insertions(+), 6 deletions(-)
+
+diff --git a/fs/ceph/caps.c b/fs/ceph/caps.c
+index 432dc2a16e28..b0cf79b0dc49 100644
+--- a/fs/ceph/caps.c
++++ b/fs/ceph/caps.c
+@@ -4598,12 +4598,14 @@ int ceph_encode_dentry_release(void **p, struct dentry *dentry,
+ struct inode *dir,
+ int mds, int drop, int unless)
+ {
+- struct dentry *parent = NULL;
+ struct ceph_mds_request_release *rel = *p;
+ struct ceph_dentry_info *di = ceph_dentry(dentry);
+ int force = 0;
+ int ret;
+
++ /* This shouldn't happen */
++ BUG_ON(!dir);
++
+ /*
+ * force an record for the directory caps if we have a dentry lease.
+ * this is racy (can't take i_ceph_lock and d_lock together), but it
+@@ -4613,14 +4615,9 @@ int ceph_encode_dentry_release(void **p, struct dentry *dentry,
+ spin_lock(&dentry->d_lock);
+ if (di->lease_session && di->lease_session->s_mds == mds)
+ force = 1;
+- if (!dir) {
+- parent = dget(dentry->d_parent);
+- dir = d_inode(parent);
+- }
+ spin_unlock(&dentry->d_lock);
+
+ ret = ceph_encode_inode_release(p, dir, mds, drop, unless, force);
+- dput(parent);
+
+ spin_lock(&dentry->d_lock);
+ if (ret && di->lease_session && di->lease_session->s_mds == mds) {
+--
+2.43.0
+
--- /dev/null
+From 22d6c7608534bf4a2fc66a60b25c8ff77e9f7dad Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 00:50:40 +0800
+Subject: clk: hi3620: Fix memory leak in hi3620_mmc_clk_init()
+
+From: Kuan-Wei Chiu <visitorckw@gmail.com>
+
+[ Upstream commit bfbea9e5667cfa9552c3d88f023386f017f6c308 ]
+
+In cases where kcalloc() fails for the 'clk_data->clks' allocation, the
+code path does not handle the failure gracefully, potentially leading
+to a memory leak. This fix ensures proper cleanup by freeing the
+allocated memory for 'clk_data' before returning.
+
+Signed-off-by: Kuan-Wei Chiu <visitorckw@gmail.com>
+Link: https://lore.kernel.org/r/20231210165040.3407545-1-visitorckw@gmail.com
+Signed-off-by: Stephen Boyd <sboyd@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/clk/hisilicon/clk-hi3620.c | 4 +++-
+ 1 file changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/clk/hisilicon/clk-hi3620.c b/drivers/clk/hisilicon/clk-hi3620.c
+index a3d04c7c3da8..eb9c139babc3 100644
+--- a/drivers/clk/hisilicon/clk-hi3620.c
++++ b/drivers/clk/hisilicon/clk-hi3620.c
+@@ -467,8 +467,10 @@ static void __init hi3620_mmc_clk_init(struct device_node *node)
+ return;
+
+ clk_data->clks = kcalloc(num, sizeof(*clk_data->clks), GFP_KERNEL);
+- if (!clk_data->clks)
++ if (!clk_data->clks) {
++ kfree(clk_data);
+ return;
++ }
+
+ for (i = 0; i < num; i++) {
+ struct hisi_mmc_clock *mmc_clk = &hi3620_mmc_clks[i];
+--
+2.43.0
+
--- /dev/null
+From fae1d92f22deda98d5c89991027e4a0de729efc7 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 01:52:32 +0800
+Subject: clk: mmp: pxa168: Fix memory leak in pxa168_clk_init()
+
+From: Kuan-Wei Chiu <visitorckw@gmail.com>
+
+[ Upstream commit 2fbabea626b6467eb4e6c4cb7a16523da12e43b4 ]
+
+In cases where mapping of mpmu/apmu/apbc registers fails, the code path
+does not handle the failure gracefully, potentially leading to a memory
+leak. This fix ensures proper cleanup by freeing the allocated memory
+for 'pxa_unit' before returning.
+
+Signed-off-by: Kuan-Wei Chiu <visitorckw@gmail.com>
+Link: https://lore.kernel.org/r/20231210175232.3414584-1-visitorckw@gmail.com
+Signed-off-by: Stephen Boyd <sboyd@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/clk/mmp/clk-of-pxa168.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/drivers/clk/mmp/clk-of-pxa168.c b/drivers/clk/mmp/clk-of-pxa168.c
+index f110c02e83cb..9674c6c06dca 100644
+--- a/drivers/clk/mmp/clk-of-pxa168.c
++++ b/drivers/clk/mmp/clk-of-pxa168.c
+@@ -258,18 +258,21 @@ static void __init pxa168_clk_init(struct device_node *np)
+ pxa_unit->mpmu_base = of_iomap(np, 0);
+ if (!pxa_unit->mpmu_base) {
+ pr_err("failed to map mpmu registers\n");
++ kfree(pxa_unit);
+ return;
+ }
+
+ pxa_unit->apmu_base = of_iomap(np, 1);
+ if (!pxa_unit->apmu_base) {
+ pr_err("failed to map apmu registers\n");
++ kfree(pxa_unit);
+ return;
+ }
+
+ pxa_unit->apbc_base = of_iomap(np, 2);
+ if (!pxa_unit->apbc_base) {
+ pr_err("failed to map apbc registers\n");
++ kfree(pxa_unit);
+ return;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 577edf1b8c2885365510c2999cde3fe5dbfd0896 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 15 Dec 2023 12:17:24 +0100
+Subject: crypto: stm32/crc32 - fix parsing list of devices
+
+From: Thomas Bourgoin <thomas.bourgoin@foss.st.com>
+
+[ Upstream commit 0eaef675b94c746900dcea7f6c41b9a103ed5d53 ]
+
+smatch warnings:
+drivers/crypto/stm32/stm32-crc32.c:108 stm32_crc_get_next_crc() warn:
+can 'crc' even be NULL?
+
+Use list_first_entry_or_null instead of list_first_entry to retrieve
+the first device registered.
+The function list_first_entry always return a non NULL pointer even if
+the list is empty. Hence checking if the pointer returned is NULL does
+not tell if the list is empty or not.
+
+Reported-by: kernel test robot <lkp@intel.com>
+Closes: https://lore.kernel.org/r/202311281111.ou2oUL2i-lkp@intel.com/
+Reported-by: Dan Carpenter <error27@gmail.com>
+Closes: https://lore.kernel.org/r/202311281111.ou2oUL2i-lkp@intel.com/
+Signed-off-by: Thomas Bourgoin <thomas.bourgoin@foss.st.com>
+Signed-off-by: Herbert Xu <herbert@gondor.apana.org.au>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/crypto/stm32/stm32-crc32.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/crypto/stm32/stm32-crc32.c b/drivers/crypto/stm32/stm32-crc32.c
+index 90a920e7f664..c439be1650c8 100644
+--- a/drivers/crypto/stm32/stm32-crc32.c
++++ b/drivers/crypto/stm32/stm32-crc32.c
+@@ -104,7 +104,7 @@ static struct stm32_crc *stm32_crc_get_next_crc(void)
+ struct stm32_crc *crc;
+
+ spin_lock_bh(&crc_list.lock);
+- crc = list_first_entry(&crc_list.dev_list, struct stm32_crc, list);
++ crc = list_first_entry_or_null(&crc_list.dev_list, struct stm32_crc, list);
+ if (crc)
+ list_move_tail(&crc->list, &crc_list.dev_list);
+ spin_unlock_bh(&crc_list.lock);
+--
+2.43.0
+
--- /dev/null
+From 9c41c4d1e499304da25dad9ee9c5608b0504e9ac Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 25 Oct 2023 23:39:07 +0200
+Subject: debugobjects: Stop accessing objects after releasing hash bucket lock
+
+From: Andrzej Hajda <andrzej.hajda@intel.com>
+
+[ Upstream commit 9bb6362652f3f4d74a87d572a91ee1b38e673ef6 ]
+
+After release of the hashbucket lock the tracking object can be modified or
+freed by a concurrent thread. Using it in such a case is error prone, even
+for printing the object state:
+
+ 1. T1 tries to deactivate destroyed object, debugobjects detects it,
+ hash bucket lock is released.
+
+ 2. T2 preempts T1 and frees the tracking object.
+
+ 3. The freed tracking object is allocated and initialized for a
+ different to be tracked kernel object.
+
+ 4. T1 resumes and reports error for wrong kernel object.
+
+Create a local copy of the tracking object before releasing the hash bucket
+lock and use the local copy for reporting and fixups to prevent this.
+
+Signed-off-by: Andrzej Hajda <andrzej.hajda@intel.com>
+Signed-off-by: Thomas Gleixner <tglx@linutronix.de>
+Link: https://lore.kernel.org/r/20231025-debugobjects_fix-v3-1-2bc3bf7084c2@intel.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ lib/debugobjects.c | 200 ++++++++++++++++++---------------------------
+ 1 file changed, 78 insertions(+), 122 deletions(-)
+
+diff --git a/lib/debugobjects.c b/lib/debugobjects.c
+index 4dd9283f6fea..b055741a5a4d 100644
+--- a/lib/debugobjects.c
++++ b/lib/debugobjects.c
+@@ -612,9 +612,8 @@ static void debug_objects_fill_pool(void)
+ static void
+ __debug_object_init(void *addr, const struct debug_obj_descr *descr, int onstack)
+ {
+- enum debug_obj_state state;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+- struct debug_obj *obj;
+ unsigned long flags;
+
+ debug_objects_fill_pool();
+@@ -635,24 +634,18 @@ __debug_object_init(void *addr, const struct debug_obj_descr *descr, int onstack
+ case ODEBUG_STATE_INIT:
+ case ODEBUG_STATE_INACTIVE:
+ obj->state = ODEBUG_STATE_INIT;
+- break;
+-
+- case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "init");
+- debug_object_fixup(descr->fixup_init, addr, state);
+- return;
+-
+- case ODEBUG_STATE_DESTROYED:
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "init");
+ return;
+ default:
+ break;
+ }
+
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_print_object(&o, "init");
++
++ if (o.state == ODEBUG_STATE_ACTIVE)
++ debug_object_fixup(descr->fixup_init, addr, o.state);
+ }
+
+ /**
+@@ -693,11 +686,9 @@ EXPORT_SYMBOL_GPL(debug_object_init_on_stack);
+ int debug_object_activate(void *addr, const struct debug_obj_descr *descr)
+ {
+ struct debug_obj o = { .object = addr, .state = ODEBUG_STATE_NOTAVAILABLE, .descr = descr };
+- enum debug_obj_state state;
+ struct debug_bucket *db;
+ struct debug_obj *obj;
+ unsigned long flags;
+- int ret;
+
+ if (!debug_objects_enabled)
+ return 0;
+@@ -709,49 +700,38 @@ int debug_object_activate(void *addr, const struct debug_obj_descr *descr)
+ raw_spin_lock_irqsave(&db->lock, flags);
+
+ obj = lookup_object_or_alloc(addr, db, descr, false, true);
+- if (likely(!IS_ERR_OR_NULL(obj))) {
+- bool print_object = false;
+-
++ if (unlikely(!obj)) {
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_objects_oom();
++ return 0;
++ } else if (likely(!IS_ERR(obj))) {
+ switch (obj->state) {
+- case ODEBUG_STATE_INIT:
+- case ODEBUG_STATE_INACTIVE:
+- obj->state = ODEBUG_STATE_ACTIVE;
+- ret = 0;
+- break;
+-
+ case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "activate");
+- ret = debug_object_fixup(descr->fixup_activate, addr, state);
+- return ret ? 0 : -EINVAL;
+-
+ case ODEBUG_STATE_DESTROYED:
+- print_object = true;
+- ret = -EINVAL;
++ o = *obj;
+ break;
++ case ODEBUG_STATE_INIT:
++ case ODEBUG_STATE_INACTIVE:
++ obj->state = ODEBUG_STATE_ACTIVE;
++ fallthrough;
+ default:
+- ret = 0;
+- break;
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return 0;
+ }
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (print_object)
+- debug_print_object(obj, "activate");
+- return ret;
+ }
+
+ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_print_object(&o, "activate");
+
+- /* If NULL the allocation has hit OOM */
+- if (!obj) {
+- debug_objects_oom();
+- return 0;
++ switch (o.state) {
++ case ODEBUG_STATE_ACTIVE:
++ case ODEBUG_STATE_NOTAVAILABLE:
++ if (debug_object_fixup(descr->fixup_activate, addr, o.state))
++ return 0;
++ fallthrough;
++ default:
++ return -EINVAL;
+ }
+-
+- /* Object is neither static nor tracked. It's not initialized */
+- debug_print_object(&o, "activate");
+- ret = debug_object_fixup(descr->fixup_activate, addr, ODEBUG_STATE_NOTAVAILABLE);
+- return ret ? 0 : -EINVAL;
+ }
+ EXPORT_SYMBOL_GPL(debug_object_activate);
+
+@@ -762,10 +742,10 @@ EXPORT_SYMBOL_GPL(debug_object_activate);
+ */
+ void debug_object_deactivate(void *addr, const struct debug_obj_descr *descr)
+ {
++ struct debug_obj o = { .object = addr, .state = ODEBUG_STATE_NOTAVAILABLE, .descr = descr };
+ struct debug_bucket *db;
+ struct debug_obj *obj;
+ unsigned long flags;
+- bool print_object = false;
+
+ if (!debug_objects_enabled)
+ return;
+@@ -777,33 +757,24 @@ void debug_object_deactivate(void *addr, const struct debug_obj_descr *descr)
+ obj = lookup_object(addr, db);
+ if (obj) {
+ switch (obj->state) {
++ case ODEBUG_STATE_DESTROYED:
++ break;
+ case ODEBUG_STATE_INIT:
+ case ODEBUG_STATE_INACTIVE:
+ case ODEBUG_STATE_ACTIVE:
+- if (!obj->astate)
+- obj->state = ODEBUG_STATE_INACTIVE;
+- else
+- print_object = true;
+- break;
+-
+- case ODEBUG_STATE_DESTROYED:
+- print_object = true;
+- break;
++ if (obj->astate)
++ break;
++ obj->state = ODEBUG_STATE_INACTIVE;
++ fallthrough;
+ default:
+- break;
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
+ }
++ o = *obj;
+ }
+
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (!obj) {
+- struct debug_obj o = { .object = addr,
+- .state = ODEBUG_STATE_NOTAVAILABLE,
+- .descr = descr };
+-
+- debug_print_object(&o, "deactivate");
+- } else if (print_object) {
+- debug_print_object(obj, "deactivate");
+- }
++ debug_print_object(&o, "deactivate");
+ }
+ EXPORT_SYMBOL_GPL(debug_object_deactivate);
+
+@@ -814,11 +785,9 @@ EXPORT_SYMBOL_GPL(debug_object_deactivate);
+ */
+ void debug_object_destroy(void *addr, const struct debug_obj_descr *descr)
+ {
+- enum debug_obj_state state;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+- struct debug_obj *obj;
+ unsigned long flags;
+- bool print_object = false;
+
+ if (!debug_objects_enabled)
+ return;
+@@ -828,32 +797,31 @@ void debug_object_destroy(void *addr, const struct debug_obj_descr *descr)
+ raw_spin_lock_irqsave(&db->lock, flags);
+
+ obj = lookup_object(addr, db);
+- if (!obj)
+- goto out_unlock;
++ if (!obj) {
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
++ }
+
+ switch (obj->state) {
++ case ODEBUG_STATE_ACTIVE:
++ case ODEBUG_STATE_DESTROYED:
++ break;
+ case ODEBUG_STATE_NONE:
+ case ODEBUG_STATE_INIT:
+ case ODEBUG_STATE_INACTIVE:
+ obj->state = ODEBUG_STATE_DESTROYED;
+- break;
+- case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
++ fallthrough;
++ default:
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "destroy");
+- debug_object_fixup(descr->fixup_destroy, addr, state);
+ return;
+-
+- case ODEBUG_STATE_DESTROYED:
+- print_object = true;
+- break;
+- default:
+- break;
+ }
+-out_unlock:
++
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (print_object)
+- debug_print_object(obj, "destroy");
++ debug_print_object(&o, "destroy");
++
++ if (o.state == ODEBUG_STATE_ACTIVE)
++ debug_object_fixup(descr->fixup_destroy, addr, o.state);
+ }
+ EXPORT_SYMBOL_GPL(debug_object_destroy);
+
+@@ -864,9 +832,8 @@ EXPORT_SYMBOL_GPL(debug_object_destroy);
+ */
+ void debug_object_free(void *addr, const struct debug_obj_descr *descr)
+ {
+- enum debug_obj_state state;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+- struct debug_obj *obj;
+ unsigned long flags;
+
+ if (!debug_objects_enabled)
+@@ -877,24 +844,26 @@ void debug_object_free(void *addr, const struct debug_obj_descr *descr)
+ raw_spin_lock_irqsave(&db->lock, flags);
+
+ obj = lookup_object(addr, db);
+- if (!obj)
+- goto out_unlock;
++ if (!obj) {
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
++ }
+
+ switch (obj->state) {
+ case ODEBUG_STATE_ACTIVE:
+- state = obj->state;
+- raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "free");
+- debug_object_fixup(descr->fixup_free, addr, state);
+- return;
++ break;
+ default:
+ hlist_del(&obj->node);
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+ free_object(obj);
+ return;
+ }
+-out_unlock:
++
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
++ debug_print_object(&o, "free");
++
++ debug_object_fixup(descr->fixup_free, addr, o.state);
+ }
+ EXPORT_SYMBOL_GPL(debug_object_free);
+
+@@ -946,10 +915,10 @@ void
+ debug_object_active_state(void *addr, const struct debug_obj_descr *descr,
+ unsigned int expect, unsigned int next)
+ {
++ struct debug_obj o = { .object = addr, .state = ODEBUG_STATE_NOTAVAILABLE, .descr = descr };
+ struct debug_bucket *db;
+ struct debug_obj *obj;
+ unsigned long flags;
+- bool print_object = false;
+
+ if (!debug_objects_enabled)
+ return;
+@@ -962,28 +931,19 @@ debug_object_active_state(void *addr, const struct debug_obj_descr *descr,
+ if (obj) {
+ switch (obj->state) {
+ case ODEBUG_STATE_ACTIVE:
+- if (obj->astate == expect)
+- obj->astate = next;
+- else
+- print_object = true;
+- break;
+-
++ if (obj->astate != expect)
++ break;
++ obj->astate = next;
++ raw_spin_unlock_irqrestore(&db->lock, flags);
++ return;
+ default:
+- print_object = true;
+ break;
+ }
++ o = *obj;
+ }
+
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- if (!obj) {
+- struct debug_obj o = { .object = addr,
+- .state = ODEBUG_STATE_NOTAVAILABLE,
+- .descr = descr };
+-
+- debug_print_object(&o, "active_state");
+- } else if (print_object) {
+- debug_print_object(obj, "active_state");
+- }
++ debug_print_object(&o, "active_state");
+ }
+ EXPORT_SYMBOL_GPL(debug_object_active_state);
+
+@@ -991,12 +951,10 @@ EXPORT_SYMBOL_GPL(debug_object_active_state);
+ static void __debug_check_no_obj_freed(const void *address, unsigned long size)
+ {
+ unsigned long flags, oaddr, saddr, eaddr, paddr, chunks;
+- const struct debug_obj_descr *descr;
+- enum debug_obj_state state;
++ int cnt, objs_checked = 0;
++ struct debug_obj *obj, o;
+ struct debug_bucket *db;
+ struct hlist_node *tmp;
+- struct debug_obj *obj;
+- int cnt, objs_checked = 0;
+
+ saddr = (unsigned long) address;
+ eaddr = saddr + size;
+@@ -1018,12 +976,10 @@ static void __debug_check_no_obj_freed(const void *address, unsigned long size)
+
+ switch (obj->state) {
+ case ODEBUG_STATE_ACTIVE:
+- descr = obj->descr;
+- state = obj->state;
++ o = *obj;
+ raw_spin_unlock_irqrestore(&db->lock, flags);
+- debug_print_object(obj, "free");
+- debug_object_fixup(descr->fixup_free,
+- (void *) oaddr, state);
++ debug_print_object(&o, "free");
++ debug_object_fixup(o.descr->fixup_free, (void *)oaddr, o.state);
+ goto repeat;
+ default:
+ hlist_del(&obj->node);
+--
+2.43.0
+
--- /dev/null
+From 1a1ba8208b58f1cd6286626654fe609a30e6940e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 11:58:47 +0000
+Subject: drivers/perf: pmuv3: don't expose SW_INCR event in sysfs
+
+From: Mark Rutland <mark.rutland@arm.com>
+
+[ Upstream commit ca6f537e459e2da4b331fe8928d1a0b0f9301f42 ]
+
+The SW_INCR event is somewhat unusual, and depends on the specific HW
+counter that it is programmed into. When programmed into PMEVCNTR<n>,
+SW_INCR will count any writes to PMSWINC_EL0 with bit n set, ignoring
+writes to SW_INCR with bit n clear.
+
+Event rotation means that there's no fixed relationship between
+perf_events and HW counters, so this isn't all that useful.
+
+Further, we program PMUSERENR.{SW,EN}=={0,0}, which causes EL0 writes to
+PMSWINC_EL0 to be trapped and handled as UNDEFINED, resulting in a
+SIGILL to userspace.
+
+Given that, it's not a good idea to expose SW_INCR in sysfs. Hide it as
+we did for CHAIN back in commit:
+
+ 4ba2578fa7b55701 ("arm64: perf: don't expose CHAIN event in sysfs")
+
+Signed-off-by: Mark Rutland <mark.rutland@arm.com>
+Cc: Will Deacon <will@kernel.org>
+Link: https://lore.kernel.org/r/20231204115847.2993026-1-mark.rutland@arm.com
+Signed-off-by: Will Deacon <will@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/arm64/kernel/perf_event.c | 6 +++++-
+ 1 file changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/arch/arm64/kernel/perf_event.c b/arch/arm64/kernel/perf_event.c
+index cdb3d4549b3a..8e428f8dd108 100644
+--- a/arch/arm64/kernel/perf_event.c
++++ b/arch/arm64/kernel/perf_event.c
+@@ -171,7 +171,11 @@ armv8pmu_events_sysfs_show(struct device *dev,
+ }).attr.attr)
+
+ static struct attribute *armv8_pmuv3_event_attrs[] = {
+- ARMV8_EVENT_ATTR(sw_incr, ARMV8_PMUV3_PERFCTR_SW_INCR),
++ /*
++ * Don't expose the sw_incr event in /sys. It's not usable as writes to
++ * PMSWINC_EL0 will trap as PMUSERENR.{SW,EN}=={0,0} and event rotation
++ * means we don't have a fixed event<->counter relationship regardless.
++ */
+ ARMV8_EVENT_ATTR(l1i_cache_refill, ARMV8_PMUV3_PERFCTR_L1I_CACHE_REFILL),
+ ARMV8_EVENT_ATTR(l1i_tlb_refill, ARMV8_PMUV3_PERFCTR_L1I_TLB_REFILL),
+ ARMV8_EVENT_ATTR(l1d_cache_refill, ARMV8_PMUV3_PERFCTR_L1D_CACHE_REFILL),
+--
+2.43.0
+
--- /dev/null
+From 024723545e4ee7d8c74e2ce857cc3f789384f2c3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 9 Nov 2023 00:04:36 -0500
+Subject: drm/amd/display: Fix tiled display misalignment
+
+From: Meenakshikumar Somasundaram <meenakshikumar.somasundaram@amd.com>
+
+[ Upstream commit c4b8394e76adba4f50a3c2696c75b214a291e24a ]
+
+[Why]
+When otg workaround is applied during clock update, otgs of
+tiled display went out of sync.
+
+[How]
+To call dc_trigger_sync() after clock update to sync otgs again.
+
+Reviewed-by: Nicholas Kazlauskas <nicholas.kazlauskas@amd.com>
+Acked-by: Hamza Mahfooz <hamza.mahfooz@amd.com>
+Signed-off-by: Meenakshikumar Somasundaram <meenakshikumar.somasundaram@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/core/dc.c | 4 ++++
+ 1 file changed, 4 insertions(+)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/core/dc.c b/drivers/gpu/drm/amd/display/dc/core/dc.c
+index 36a9e9c84ed4..272252cd0500 100644
+--- a/drivers/gpu/drm/amd/display/dc/core/dc.c
++++ b/drivers/gpu/drm/amd/display/dc/core/dc.c
+@@ -1440,6 +1440,10 @@ static enum dc_status dc_commit_state_no_check(struct dc *dc, struct dc_state *c
+ wait_for_no_pipes_pending(dc, context);
+ /* pplib is notified if disp_num changed */
+ dc->hwss.optimize_bandwidth(dc, context);
++ /* Need to do otg sync again as otg could be out of sync due to otg
++ * workaround applied during clock update
++ */
++ dc_trigger_sync(dc, context);
+ }
+
+ context->stream_mask = get_stream_mask(dc, context);
+--
+2.43.0
+
--- /dev/null
+From 47d1ee1c6eba8de17ed4b1994f7f052339ea904f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 12:01:05 -0500
+Subject: drm/amd/display: make flip_timestamp_in_us a 64-bit variable
+
+From: Josip Pavic <josip.pavic@amd.com>
+
+[ Upstream commit 6fb12518ca58412dc51054e2a7400afb41328d85 ]
+
+[Why]
+This variable currently overflows after about 71 minutes. This doesn't
+cause any known functional issues but it does make debugging more
+difficult.
+
+[How]
+Make it a 64-bit variable.
+
+Reviewed-by: Aric Cyr <aric.cyr@amd.com>
+Acked-by: Wayne Lin <wayne.lin@amd.com>
+Signed-off-by: Josip Pavic <josip.pavic@amd.com>
+Tested-by: Daniel Wheeler <daniel.wheeler@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/display/dc/dc_hw_types.h | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/display/dc/dc_hw_types.h b/drivers/gpu/drm/amd/display/dc/dc_hw_types.h
+index 1a87bc3da826..b36d4c5d0eca 100644
+--- a/drivers/gpu/drm/amd/display/dc/dc_hw_types.h
++++ b/drivers/gpu/drm/amd/display/dc/dc_hw_types.h
+@@ -426,7 +426,7 @@ struct dc_cursor_position {
+ };
+
+ struct dc_cursor_mi_param {
+- unsigned int pixel_clk_khz;
++ unsigned long long pixel_clk_khz;
+ unsigned int ref_clk_khz;
+ struct rect viewport;
+ struct fixed31_32 h_scale_ratio;
+--
+2.43.0
+
--- /dev/null
+From 02b410bc61c3606cfd4301473eedf89a00df9c69 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 5 Jan 2024 12:05:09 +0530
+Subject: drm/amd/powerplay: Fix kzalloc parameter 'ATOM_Tonga_PPM_Table' in
+ 'get_platform_power_management_table()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit 6616b5e1999146b1304abe78232af810080c67e3 ]
+
+In 'struct phm_ppm_table *ptr' allocation using kzalloc, an incorrect
+structure type is passed to sizeof() in kzalloc, larger structure types
+were used, thus using correct type 'struct phm_ppm_table' fixes the
+below:
+
+drivers/gpu/drm/amd/amdgpu/../pm/powerplay/hwmgr/process_pptables_v1_0.c:203 get_platform_power_management_table() warn: struct type mismatch 'phm_ppm_table vs _ATOM_Tonga_PPM_Table'
+
+Cc: Eric Huang <JinHuiEric.Huang@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Acked-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c
+index b760f95e7fa7..5998c78ad536 100644
+--- a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c
++++ b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/process_pptables_v1_0.c
+@@ -204,7 +204,7 @@ static int get_platform_power_management_table(
+ struct pp_hwmgr *hwmgr,
+ ATOM_Tonga_PPM_Table *atom_ppm_table)
+ {
+- struct phm_ppm_table *ptr = kzalloc(sizeof(ATOM_Tonga_PPM_Table), GFP_KERNEL);
++ struct phm_ppm_table *ptr = kzalloc(sizeof(*ptr), GFP_KERNEL);
+ struct phm_ppt_v1_information *pp_table_information =
+ (struct phm_ppt_v1_information *)(hwmgr->pptable);
+
+--
+2.43.0
+
--- /dev/null
+From 6ddbfc3c03c0dc85d16a8444bd352735365ca371 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 27 Dec 2023 12:54:44 +0530
+Subject: drm/amdgpu: Drop 'fence' check in 'to_amdgpu_amdkfd_fence()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit bf2ad4fb8adca89374b54b225d494e0b1956dbea ]
+
+Return value of container_of(...) can't be null, so null check is not
+required for 'fence'. Hence drop its NULL check.
+
+Fixes the below:
+drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c:93 to_amdgpu_amdkfd_fence() warn: can 'fence' even be NULL?
+
+Cc: Felix Kuehling <Felix.Kuehling@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Reviewed-by: Felix Kuehling <felix.kuehling@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c
+index 3107b9575929..eef7517c9d24 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_amdkfd_fence.c
+@@ -88,7 +88,7 @@ struct amdgpu_amdkfd_fence *to_amdgpu_amdkfd_fence(struct dma_fence *f)
+ return NULL;
+
+ fence = container_of(f, struct amdgpu_amdkfd_fence, base);
+- if (fence && f->ops == &amdkfd_fence_ops)
++ if (f->ops == &amdkfd_fence_ops)
+ return fence;
+
+ return NULL;
+--
+2.43.0
+
--- /dev/null
+From 02560304d2493185cc0ae016411175cd195af5a5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 18 Dec 2023 16:17:23 -0500
+Subject: drm/amdgpu: Let KFD sync with VM fences
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Felix Kuehling <Felix.Kuehling@amd.com>
+
+[ Upstream commit ec9ba4821fa52b5efdbc4cdf0a77497990655231 ]
+
+Change the rules for amdgpu_sync_resv to let KFD synchronize with VM
+fences on page table reservations. This fixes intermittent memory
+corruption after evictions when using amdgpu_vm_handle_moved to update
+page tables for VM mappings managed through render nodes.
+
+Signed-off-by: Felix Kuehling <Felix.Kuehling@amd.com>
+Reviewed-by: Christian König <christian.koenig@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c
+index 8ea6c49529e7..6a22bc41c205 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_sync.c
+@@ -241,7 +241,8 @@ int amdgpu_sync_resv(struct amdgpu_device *adev, struct amdgpu_sync *sync,
+
+ /* Never sync to VM updates either. */
+ if (fence_owner == AMDGPU_FENCE_OWNER_VM &&
+- owner != AMDGPU_FENCE_OWNER_UNDEFINED)
++ owner != AMDGPU_FENCE_OWNER_UNDEFINED &&
++ owner != AMDGPU_FENCE_OWNER_KFD)
+ continue;
+
+ /* Ignore fences depending on the sync mode */
+--
+2.43.0
+
--- /dev/null
+From 616c32f3d09a37067aa68ab4208ccc1ddf84065b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 18:13:11 +0530
+Subject: drm/amdgpu: Release 'adev->pm.fw' before return in
+ 'amdgpu_device_need_post()'
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+
+[ Upstream commit 8a44fdd3cf91debbd09b43bd2519ad2b2486ccf4 ]
+
+In function 'amdgpu_device_need_post(struct amdgpu_device *adev)' -
+'adev->pm.fw' may not be released before return.
+
+Using the function release_firmware() to release adev->pm.fw.
+
+Thus fixing the below:
+drivers/gpu/drm/amd/amdgpu/amdgpu_device.c:1571 amdgpu_device_need_post() warn: 'adev->pm.fw' from request_firmware() not released on lines: 1554.
+
+Cc: Monk Liu <Monk.Liu@amd.com>
+Cc: Christian König <christian.koenig@amd.com>
+Cc: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Srinivasan Shanmugam <srinivasan.shanmugam@amd.com>
+Suggested-by: Lijo Lazar <lijo.lazar@amd.com>
+Reviewed-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Alex Deucher <alexander.deucher@amd.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/amd/amdgpu/amdgpu_device.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+index a093f1b27724..e833c02fabff 100644
+--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+@@ -1184,6 +1184,7 @@ bool amdgpu_device_need_post(struct amdgpu_device *adev)
+ return true;
+
+ fw_ver = *((uint32_t *)adev->pm.fw->data + 69);
++ release_firmware(adev->pm.fw);
+ if (fw_ver < 0x00160e00)
+ return true;
+ }
+--
+2.43.0
+
--- /dev/null
+From e620fe5c6350379b06b449239effa877ef698824 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 3 Nov 2023 15:14:03 +0200
+Subject: drm/drm_file: fix use of uninitialized variable
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 1d3062fad9c7313fff9970a88e0538a24480ffb8 ]
+
+smatch reports:
+
+drivers/gpu/drm/drm_file.c:967 drm_show_memory_stats() error: uninitialized symbol 'supported_status'.
+
+'supported_status' is only set in one code path. I'm not familiar with
+the code to say if that path will always be ran in real life, but
+whether that is the case or not, I think it is good to initialize
+'supported_status' to 0 to silence the warning (and possibly fix a bug).
+
+Reviewed-by: Laurent Pinchart <laurent.pinchart+renesas@ideasonboard.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231103-uninit-fixes-v2-1-c22b2444f5f5@ideasonboard.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/drm_file.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/drm_file.c b/drivers/gpu/drm/drm_file.c
+index 537e7de8e9c3..93da7b5d785b 100644
+--- a/drivers/gpu/drm/drm_file.c
++++ b/drivers/gpu/drm/drm_file.c
+@@ -411,7 +411,7 @@ int drm_open(struct inode *inode, struct file *filp)
+ {
+ struct drm_device *dev;
+ struct drm_minor *minor;
+- int retcode;
++ int retcode = 0;
+ int need_setup = 0;
+
+ minor = drm_minor_acquire(iminor(inode));
+--
+2.43.0
+
--- /dev/null
+From 40556a967543eb289857602119cf598b97b337db Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Sep 2023 12:26:52 -0700
+Subject: drm/exynos: Call drm_atomic_helper_shutdown() at shutdown/unbind time
+
+From: Douglas Anderson <dianders@chromium.org>
+
+[ Upstream commit 16ac5b21b31b439f03cdf44c153c5f5af94fb3eb ]
+
+Based on grepping through the source code this driver appears to be
+missing a call to drm_atomic_helper_shutdown() at system shutdown time
+and at driver unbind time. Among other things, this means that if a
+panel is in use that it won't be cleanly powered off at system
+shutdown time.
+
+The fact that we should call drm_atomic_helper_shutdown() in the case
+of OS shutdown/restart and at driver remove (or unbind) time comes
+straight out of the kernel doc "driver instance overview" in
+drm_drv.c.
+
+A few notes about this fix:
+- When adding drm_atomic_helper_shutdown() to the unbind path, I added
+ it after drm_kms_helper_poll_fini() since that's when other drivers
+ seemed to have it.
+- Technically with a previous patch, ("drm/atomic-helper:
+ drm_atomic_helper_shutdown(NULL) should be a noop"), we don't
+ actually need to check to see if our "drm" pointer is NULL before
+ calling drm_atomic_helper_shutdown(). We'll leave the "if" test in,
+ though, so that this patch can land without any dependencies. It
+ could potentially be removed later.
+- This patch also makes sure to set the drvdata to NULL in the case of
+ bind errors to make sure that shutdown can't access freed data.
+
+Suggested-by: Maxime Ripard <mripard@kernel.org>
+Reviewed-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Douglas Anderson <dianders@chromium.org>
+Tested-by: Marek Szyprowski <m.szyprowski@samsung.com>
+Reviewed-by: Marek Szyprowski <m.szyprowski@samsung.com>
+Signed-off-by: Inki Dae <inki.dae@samsung.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/exynos/exynos_drm_drv.c | 11 +++++++++++
+ 1 file changed, 11 insertions(+)
+
+diff --git a/drivers/gpu/drm/exynos/exynos_drm_drv.c b/drivers/gpu/drm/exynos/exynos_drm_drv.c
+index dbd80f1e4c78..7e13c1550083 100644
+--- a/drivers/gpu/drm/exynos/exynos_drm_drv.c
++++ b/drivers/gpu/drm/exynos/exynos_drm_drv.c
+@@ -344,6 +344,7 @@ static int exynos_drm_bind(struct device *dev)
+ drm_mode_config_cleanup(drm);
+ exynos_drm_cleanup_dma(drm);
+ kfree(private);
++ dev_set_drvdata(dev, NULL);
+ err_free_drm:
+ drm_dev_put(drm);
+
+@@ -358,6 +359,7 @@ static void exynos_drm_unbind(struct device *dev)
+
+ exynos_drm_fbdev_fini(drm);
+ drm_kms_helper_poll_fini(drm);
++ drm_atomic_helper_shutdown(drm);
+
+ component_unbind_all(drm->dev, drm);
+ drm_mode_config_cleanup(drm);
+@@ -395,9 +397,18 @@ static int exynos_drm_platform_remove(struct platform_device *pdev)
+ return 0;
+ }
+
++static void exynos_drm_platform_shutdown(struct platform_device *pdev)
++{
++ struct drm_device *drm = platform_get_drvdata(pdev);
++
++ if (drm)
++ drm_atomic_helper_shutdown(drm);
++}
++
+ static struct platform_driver exynos_drm_platform_driver = {
+ .probe = exynos_drm_platform_probe,
+ .remove = exynos_drm_platform_remove,
++ .shutdown = exynos_drm_platform_shutdown,
+ .driver = {
+ .name = "exynos-drm",
+ .pm = &exynos_drm_pm_ops,
+--
+2.43.0
+
--- /dev/null
+From a14d465b46cbe0834b8d90a959ad050f703f17b0 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 13 Oct 2023 16:13:59 +0300
+Subject: drm: Fix color LUT rounding
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Ville Syrjälä <ville.syrjala@linux.intel.com>
+
+[ Upstream commit c6fbb6bca10838485b820e8a26c23996f77ce580 ]
+
+The current implementation of drm_color_lut_extract()
+generates weird results. Eg. if we go through all the
+values for 16->8bpc conversion we see the following pattern:
+
+in out (count)
+ 0 - 7f -> 0 (128)
+ 80 - 17f -> 1 (256)
+ 180 - 27f -> 2 (256)
+ 280 - 37f -> 3 (256)
+...
+fb80 - fc7f -> fc (256)
+fc80 - fd7f -> fd (256)
+fd80 - fe7f -> fe (256)
+fe80 - ffff -> ff (384)
+
+So less values map to 0 and more values map 0xff, which
+doesn't seem particularly great.
+
+To get just the same number of input values to map to
+the same output values we'd just need to drop the rounding
+entrirely. But perhaps a better idea would be to follow the
+OpenGL int<->float conversion rules, in which case we get
+the following results:
+
+in out (count)
+ 0 - 80 -> 0 (129)
+ 81 - 181 -> 1 (257)
+ 182 - 282 -> 2 (257)
+ 283 - 383 -> 3 (257)
+...
+fc7c - fd7c -> fc (257)
+fd7d - fe7d -> fd (257)
+fe7e - ff7e -> fe (257)
+ff7f - ffff -> ff (129)
+
+Note that since the divisor is constant the compiler
+is able to optimize away the integer division in most
+cases. The only exception is the _ULL() case on 32bit
+architectures since that gets emitted as inline asm
+via do_div() and thus the compiler doesn't get to
+optimize it.
+
+Signed-off-by: Ville Syrjälä <ville.syrjala@linux.intel.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231013131402.24072-2-ville.syrjala@linux.intel.com
+Reviewed-by: Chaitanya Kumar Borah <chaitanya.kumar.borah@intel.com>
+Reviewed-by: Jani Nikula <jani.nikula@intel.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/drm/drm_color_mgmt.h | 19 ++++++++-----------
+ 1 file changed, 8 insertions(+), 11 deletions(-)
+
+diff --git a/include/drm/drm_color_mgmt.h b/include/drm/drm_color_mgmt.h
+index 81c298488b0c..54b2b2467bfd 100644
+--- a/include/drm/drm_color_mgmt.h
++++ b/include/drm/drm_color_mgmt.h
+@@ -36,20 +36,17 @@ struct drm_plane;
+ *
+ * Extract a degamma/gamma LUT value provided by user (in the form of
+ * &drm_color_lut entries) and round it to the precision supported by the
+- * hardware.
++ * hardware, following OpenGL int<->float conversion rules
++ * (see eg. OpenGL 4.6 specification - 2.3.5 Fixed-Point Data Conversions).
+ */
+ static inline u32 drm_color_lut_extract(u32 user_input, int bit_precision)
+ {
+- u32 val = user_input;
+- u32 max = 0xffff >> (16 - bit_precision);
+-
+- /* Round only if we're not using full precision. */
+- if (bit_precision < 16) {
+- val += 1UL << (16 - bit_precision - 1);
+- val >>= 16 - bit_precision;
+- }
+-
+- return clamp_val(val, 0, max);
++ if (bit_precision > 16)
++ return DIV_ROUND_CLOSEST_ULL(mul_u32_u32(user_input, (1 << bit_precision) - 1),
++ (1 << 16) - 1);
++ else
++ return DIV_ROUND_CLOSEST(user_input * ((1 << bit_precision) - 1),
++ (1 << 16) - 1);
+ }
+
+ u64 drm_color_ctm_s31_32_to_qm_n(u64 user_input, u32 m, u32 n);
+--
+2.43.0
+
--- /dev/null
+From a7d546bdbc9fe63627d97546f0487a7a649fdb4b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 3 Nov 2023 15:14:04 +0200
+Subject: drm/framebuffer: Fix use of uninitialized variable
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit f9af8f0c1dc567a5a6a6318ff324c45d80d4a60f ]
+
+smatch reports:
+
+drivers/gpu/drm/drm_framebuffer.c:654 drm_mode_getfb2_ioctl() error: uninitialized symbol 'ret'.
+
+'ret' is possibly not set when there are no errors, causing the error
+above. I can't say if that ever happens in real-life, but in any case I
+think it is good to initialize 'ret' to 0.
+
+Reviewed-by: Laurent Pinchart <laurent.pinchart+renesas@ideasonboard.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231103-uninit-fixes-v2-2-c22b2444f5f5@ideasonboard.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/drm_framebuffer.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/drm_framebuffer.c b/drivers/gpu/drm/drm_framebuffer.c
+index 2f5b0c2bb0fe..e490ef42441f 100644
+--- a/drivers/gpu/drm/drm_framebuffer.c
++++ b/drivers/gpu/drm/drm_framebuffer.c
+@@ -570,7 +570,7 @@ int drm_mode_getfb2_ioctl(struct drm_device *dev,
+ struct drm_mode_fb_cmd2 *r = data;
+ struct drm_framebuffer *fb;
+ unsigned int i;
+- int ret;
++ int ret = 0;
+
+ if (!drm_core_check_feature(dev, DRIVER_MODESET))
+ return -EINVAL;
+--
+2.43.0
+
--- /dev/null
+From 1d2899a8d21c3519c7baa07c8f6ff8af7c2de368 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Sep 2023 13:50:32 +0300
+Subject: drm/mipi-dsi: Fix detach call without attach
+
+From: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+
+[ Upstream commit 90d50b8d85834e73536fdccd5aa913b30494fef0 ]
+
+It's been reported that DSI host driver's detach can be called without
+the attach ever happening:
+
+https://lore.kernel.org/all/20230412073954.20601-1-tony@atomide.com/
+
+After reading the code, I think this is what happens:
+
+We have a DSI host defined in the device tree and a DSI peripheral under
+that host (i.e. an i2c device using the DSI as data bus doesn't exhibit
+this behavior).
+
+The host driver calls mipi_dsi_host_register(), which causes (via a few
+functions) mipi_dsi_device_add() to be called for the DSI peripheral. So
+now we have a DSI device under the host, but attach hasn't been called.
+
+Normally the probing of the devices continues, and eventually the DSI
+peripheral's driver will call mipi_dsi_attach(), attaching the
+peripheral.
+
+However, if the host driver's probe encounters an error after calling
+mipi_dsi_host_register(), and before the peripheral has called
+mipi_dsi_attach(), the host driver will do cleanups and return an error
+from its probe function. The cleanups include calling
+mipi_dsi_host_unregister().
+
+mipi_dsi_host_unregister() will call two functions for all its DSI
+peripheral devices: mipi_dsi_detach() and mipi_dsi_device_unregister().
+The latter makes sense, as the device exists, but the former may be
+wrong as attach has not necessarily been done.
+
+To fix this, track the attached state of the peripheral, and only detach
+from mipi_dsi_host_unregister() if the peripheral was attached.
+
+Note that I have only tested this with a board with an i2c DSI
+peripheral, not with a "pure" DSI peripheral.
+
+However, slightly related, the unregister machinery still seems broken.
+E.g. if the DSI host driver is unbound, it'll detach and unregister the
+DSI peripherals. After that, when the DSI peripheral driver unbound
+it'll call detach either directly or using the devm variant, leading to
+a crash. And probably the driver will crash if it happens, for some
+reason, to try to send a message via the DSI bus.
+
+But that's another topic.
+
+Tested-by: H. Nikolaus Schaller <hns@goldelico.com>
+Acked-by: Maxime Ripard <mripard@kernel.org>
+Reviewed-by: Sebastian Reichel <sebastian.reichel@collabora.com>
+Tested-by: Tony Lindgren <tony@atomide.com>
+Signed-off-by: Tomi Valkeinen <tomi.valkeinen@ideasonboard.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20230921-dsi-detach-fix-v1-1-d0de2d1621d9@ideasonboard.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/drm_mipi_dsi.c | 17 +++++++++++++++--
+ include/drm/drm_mipi_dsi.h | 2 ++
+ 2 files changed, 17 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/gpu/drm/drm_mipi_dsi.c b/drivers/gpu/drm/drm_mipi_dsi.c
+index 0c806e99e869..83918ac1f608 100644
+--- a/drivers/gpu/drm/drm_mipi_dsi.c
++++ b/drivers/gpu/drm/drm_mipi_dsi.c
+@@ -300,7 +300,8 @@ static int mipi_dsi_remove_device_fn(struct device *dev, void *priv)
+ {
+ struct mipi_dsi_device *dsi = to_mipi_dsi_device(dev);
+
+- mipi_dsi_detach(dsi);
++ if (dsi->attached)
++ mipi_dsi_detach(dsi);
+ mipi_dsi_device_unregister(dsi);
+
+ return 0;
+@@ -323,11 +324,18 @@ EXPORT_SYMBOL(mipi_dsi_host_unregister);
+ int mipi_dsi_attach(struct mipi_dsi_device *dsi)
+ {
+ const struct mipi_dsi_host_ops *ops = dsi->host->ops;
++ int ret;
+
+ if (!ops || !ops->attach)
+ return -ENOSYS;
+
+- return ops->attach(dsi->host, dsi);
++ ret = ops->attach(dsi->host, dsi);
++ if (ret)
++ return ret;
++
++ dsi->attached = true;
++
++ return 0;
+ }
+ EXPORT_SYMBOL(mipi_dsi_attach);
+
+@@ -339,9 +347,14 @@ int mipi_dsi_detach(struct mipi_dsi_device *dsi)
+ {
+ const struct mipi_dsi_host_ops *ops = dsi->host->ops;
+
++ if (WARN_ON(!dsi->attached))
++ return -EINVAL;
++
+ if (!ops || !ops->detach)
+ return -ENOSYS;
+
++ dsi->attached = false;
++
+ return ops->detach(dsi->host, dsi);
+ }
+ EXPORT_SYMBOL(mipi_dsi_detach);
+diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
+index 31ba85a4110a..3c0d1495c062 100644
+--- a/include/drm/drm_mipi_dsi.h
++++ b/include/drm/drm_mipi_dsi.h
+@@ -161,6 +161,7 @@ struct mipi_dsi_device_info {
+ * struct mipi_dsi_device - DSI peripheral device
+ * @host: DSI host for this peripheral
+ * @dev: driver model device node for this peripheral
++ * @attached: the DSI device has been successfully attached
+ * @name: DSI peripheral chip type
+ * @channel: virtual channel assigned to the peripheral
+ * @format: pixel format for video mode
+@@ -176,6 +177,7 @@ struct mipi_dsi_device_info {
+ struct mipi_dsi_device {
+ struct mipi_dsi_host *host;
+ struct device dev;
++ bool attached;
+
+ char name[DSI_DEV_NAME_SIZE];
+ unsigned int channel;
+--
+2.43.0
+
--- /dev/null
+From e1b78791073acd0b13da23f7079abe23aeb31d67 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 10:19:55 -0800
+Subject: drm/msm/dpu: Ratelimit framedone timeout msgs
+
+From: Rob Clark <robdclark@chromium.org>
+
+[ Upstream commit 2b72e50c62de60ad2d6bcd86aa38d4ccbdd633f2 ]
+
+When we start getting these, we get a *lot*. So ratelimit it to not
+flood dmesg.
+
+Signed-off-by: Rob Clark <robdclark@chromium.org>
+Reviewed-by: Abhinav Kumar <quic_abhinavk@quicinc.com>
+Reviewed-by: Marijn Suijten <marijn.suijten@somainline.org>
+Patchwork: https://patchwork.freedesktop.org/patch/571584/
+Link: https://lore.kernel.org/r/20231211182000.218088-1-robdclark@gmail.com
+Signed-off-by: Dmitry Baryshkov <dmitry.baryshkov@linaro.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c | 5 ++++-
+ drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h | 1 +
+ 2 files changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+index 408fc6c8a6df..44033a639419 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+@@ -45,6 +45,9 @@
+ (p) ? ((p)->hw_pp ? (p)->hw_pp->idx - PINGPONG_0 : -1) : -1, \
+ ##__VA_ARGS__)
+
++#define DPU_ERROR_ENC_RATELIMITED(e, fmt, ...) DPU_ERROR_RATELIMITED("enc%d " fmt,\
++ (e) ? (e)->base.base.id : -1, ##__VA_ARGS__)
++
+ /*
+ * Two to anticipate panels that can do cmd/vid dynamic switching
+ * plan is to create all possible physical encoder types, and switch between
+@@ -2135,7 +2138,7 @@ static void dpu_encoder_frame_done_timeout(struct timer_list *t)
+ return;
+ }
+
+- DPU_ERROR_ENC(dpu_enc, "frame done timeout\n");
++ DPU_ERROR_ENC_RATELIMITED(dpu_enc, "frame done timeout\n");
+
+ event = DPU_ENCODER_FRAME_EVENT_ERROR;
+ trace_dpu_enc_frame_done_timeout(DRMID(drm_enc), event);
+diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h
+index 1c0e4c0c9ffb..bb7c7e437242 100644
+--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h
++++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h
+@@ -52,6 +52,7 @@
+ } while (0)
+
+ #define DPU_ERROR(fmt, ...) pr_err("[dpu error]" fmt, ##__VA_ARGS__)
++#define DPU_ERROR_RATELIMITED(fmt, ...) pr_err_ratelimited("[dpu error]" fmt, ##__VA_ARGS__)
+
+ /**
+ * ktime_compare_safe - compare two ktime structures
+--
+2.43.0
+
--- /dev/null
+From 15aefc05571da4bf4c51fa2bbbd38f96295f9781 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 14:57:34 +1100
+Subject: drm: using mul_u32_u32() requires linux/math64.h
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Stephen Rothwell <sfr@canb.auug.org.au>
+
+[ Upstream commit 933a2a376fb3f22ba4774f74233571504ac56b02 ]
+
+Some pending include file cleanups produced this error:
+
+In file included from include/linux/kernel.h:27,
+ from drivers/gpu/ipu-v3/ipu-dp.c:7:
+include/drm/drm_color_mgmt.h: In function 'drm_color_lut_extract':
+include/drm/drm_color_mgmt.h:45:46: error: implicit declaration of function 'mul_u32_u32' [-Werror=implicit-function-declaration]
+ 45 | return DIV_ROUND_CLOSEST_ULL(mul_u32_u32(user_input, (1 << bit_precision) - 1),
+ | ^~~~~~~~~~~
+
+Fixes: c6fbb6bca108 ("drm: Fix color LUT rounding")
+Signed-off-by: Stephen Rothwell <sfr@canb.auug.org.au>
+Signed-off-by: Ville Syrjälä <ville.syrjala@linux.intel.com>
+Link: https://patchwork.freedesktop.org/patch/msgid/20231219145734.13e40e1e@canb.auug.org.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/drm/drm_color_mgmt.h | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/include/drm/drm_color_mgmt.h b/include/drm/drm_color_mgmt.h
+index 54b2b2467bfd..ed81741036d7 100644
+--- a/include/drm/drm_color_mgmt.h
++++ b/include/drm/drm_color_mgmt.h
+@@ -24,6 +24,7 @@
+ #define __DRM_COLOR_MGMT_H__
+
+ #include <linux/ctype.h>
++#include <linux/math64.h>
+ #include <drm/drm_property.h>
+
+ struct drm_crtc;
+--
+2.43.0
+
--- /dev/null
+From 33dbd685deb6a9736e092d5bb2a58aea0ccfd057 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 11 Aug 2023 14:38:12 -0400
+Subject: ecryptfs: Reject casefold directory inodes
+
+From: Gabriel Krisman Bertazi <krisman@suse.de>
+
+[ Upstream commit cd72c7ef5fed44272272a105b1da22810c91be69 ]
+
+Even though it seems to be able to resolve some names of
+case-insensitive directories, the lack of d_hash and d_compare means we
+end up with a broken state in the d_cache. Considering it was never a
+goal to support these two together, and we are preparing to use
+d_revalidate in case-insensitive filesystems, which would make the
+combination even more broken, reject any attempt to get a casefolded
+inode from ecryptfs.
+
+Signed-off-by: Gabriel Krisman Bertazi <krisman@suse.de>
+Reviewed-by: Eric Biggers <ebiggers@google.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ecryptfs/inode.c | 8 ++++++++
+ 1 file changed, 8 insertions(+)
+
+diff --git a/fs/ecryptfs/inode.c b/fs/ecryptfs/inode.c
+index e23752d9a79f..c867a0d62f36 100644
+--- a/fs/ecryptfs/inode.c
++++ b/fs/ecryptfs/inode.c
+@@ -76,6 +76,14 @@ static struct inode *__ecryptfs_get_inode(struct inode *lower_inode,
+
+ if (lower_inode->i_sb != ecryptfs_superblock_to_lower(sb))
+ return ERR_PTR(-EXDEV);
++
++ /* Reject dealing with casefold directories. */
++ if (IS_CASEFOLDED(lower_inode)) {
++ pr_err_ratelimited("%s: Can't handle casefolded directory.\n",
++ __func__);
++ return ERR_PTR(-EREMOTE);
++ }
++
+ if (!igrab(lower_inode))
+ return ERR_PTR(-ESTALE);
+ inode = iget5_locked(sb, (unsigned long)lower_inode,
+--
+2.43.0
+
--- /dev/null
+From a5cae33b1c1b65ad750fea08a6aa40605609f9cb Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 23 Oct 2023 09:30:56 +0800
+Subject: ext4: avoid online resizing failures due to oversized flex bg
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Baokun Li <libaokun1@huawei.com>
+
+[ Upstream commit 5d1935ac02ca5aee364a449a35e2977ea84509b0 ]
+
+When we online resize an ext4 filesystem with a oversized flexbg_size,
+
+ mkfs.ext4 -F -G 67108864 $dev -b 4096 100M
+ mount $dev $dir
+ resize2fs $dev 16G
+
+the following WARN_ON is triggered:
+==================================================================
+WARNING: CPU: 0 PID: 427 at mm/page_alloc.c:4402 __alloc_pages+0x411/0x550
+Modules linked in: sg(E)
+CPU: 0 PID: 427 Comm: resize2fs Tainted: G E 6.6.0-rc5+ #314
+RIP: 0010:__alloc_pages+0x411/0x550
+Call Trace:
+ <TASK>
+ __kmalloc_large_node+0xa2/0x200
+ __kmalloc+0x16e/0x290
+ ext4_resize_fs+0x481/0xd80
+ __ext4_ioctl+0x1616/0x1d90
+ ext4_ioctl+0x12/0x20
+ __x64_sys_ioctl+0xf0/0x150
+ do_syscall_64+0x3b/0x90
+==================================================================
+
+This is because flexbg_size is too large and the size of the new_group_data
+array to be allocated exceeds MAX_ORDER. Currently, the minimum value of
+MAX_ORDER is 8, the minimum value of PAGE_SIZE is 4096, the corresponding
+maximum number of groups that can be allocated is:
+
+ (PAGE_SIZE << MAX_ORDER) / sizeof(struct ext4_new_group_data) ≈ 21845
+
+And the value that is down-aligned to the power of 2 is 16384. Therefore,
+this value is defined as MAX_RESIZE_BG, and the number of groups added
+each time does not exceed this value during resizing, and is added multiple
+times to complete the online resizing. The difference is that the metadata
+in a flex_bg may be more dispersed.
+
+Signed-off-by: Baokun Li <libaokun1@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231023013057.2117948-4-libaokun1@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/resize.c | 25 +++++++++++++++++--------
+ 1 file changed, 17 insertions(+), 8 deletions(-)
+
+diff --git a/fs/ext4/resize.c b/fs/ext4/resize.c
+index 66ce3d118203..06e0eaf2ea4e 100644
+--- a/fs/ext4/resize.c
++++ b/fs/ext4/resize.c
+@@ -227,10 +227,17 @@ struct ext4_new_flex_group_data {
+ in the flex group */
+ __u16 *bg_flags; /* block group flags of groups
+ in @groups */
++ ext4_group_t resize_bg; /* number of allocated
++ new_group_data */
+ ext4_group_t count; /* number of groups in @groups
+ */
+ };
+
++/*
++ * Avoiding memory allocation failures due to too many groups added each time.
++ */
++#define MAX_RESIZE_BG 16384
++
+ /*
+ * alloc_flex_gd() allocates a ext4_new_flex_group_data with size of
+ * @flexbg_size.
+@@ -245,14 +252,18 @@ static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned int flexbg_size)
+ if (flex_gd == NULL)
+ goto out3;
+
+- flex_gd->count = flexbg_size;
+- flex_gd->groups = kmalloc_array(flexbg_size,
++ if (unlikely(flexbg_size > MAX_RESIZE_BG))
++ flex_gd->resize_bg = MAX_RESIZE_BG;
++ else
++ flex_gd->resize_bg = flexbg_size;
++
++ flex_gd->groups = kmalloc_array(flex_gd->resize_bg,
+ sizeof(struct ext4_new_group_data),
+ GFP_NOFS);
+ if (flex_gd->groups == NULL)
+ goto out2;
+
+- flex_gd->bg_flags = kmalloc_array(flexbg_size, sizeof(__u16),
++ flex_gd->bg_flags = kmalloc_array(flex_gd->resize_bg, sizeof(__u16),
+ GFP_NOFS);
+ if (flex_gd->bg_flags == NULL)
+ goto out1;
+@@ -1559,8 +1570,7 @@ static int ext4_flex_group_add(struct super_block *sb,
+
+ static int ext4_setup_next_flex_gd(struct super_block *sb,
+ struct ext4_new_flex_group_data *flex_gd,
+- ext4_fsblk_t n_blocks_count,
+- unsigned int flexbg_size)
++ ext4_fsblk_t n_blocks_count)
+ {
+ struct ext4_sb_info *sbi = EXT4_SB(sb);
+ struct ext4_super_block *es = sbi->s_es;
+@@ -1584,7 +1594,7 @@ static int ext4_setup_next_flex_gd(struct super_block *sb,
+ BUG_ON(last);
+ ext4_get_group_no_and_offset(sb, n_blocks_count - 1, &n_group, &last);
+
+- last_group = group | (flexbg_size - 1);
++ last_group = group | (flex_gd->resize_bg - 1);
+ if (last_group > n_group)
+ last_group = n_group;
+
+@@ -2081,8 +2091,7 @@ int ext4_resize_fs(struct super_block *sb, ext4_fsblk_t n_blocks_count)
+ /* Add flex groups. Note that a regular group is a
+ * flex group with 1 group.
+ */
+- while (ext4_setup_next_flex_gd(sb, flex_gd, n_blocks_count,
+- flexbg_size)) {
++ while (ext4_setup_next_flex_gd(sb, flex_gd, n_blocks_count)) {
+ if (jiffies - last_update_time > HZ * 10) {
+ if (last_update_time)
+ ext4_msg(sb, KERN_INFO,
+--
+2.43.0
+
--- /dev/null
+From e7a183fa1dd2314ab0e490849a15ac75935354ef Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 16 Dec 2023 09:09:19 +0800
+Subject: ext4: fix inconsistent between segment fstrim and full fstrim
+
+From: Ye Bin <yebin10@huawei.com>
+
+[ Upstream commit 68da4c44b994aea797eb9821acb3a4a36015293e ]
+
+Suppose we issue two FITRIM ioctls for ranges [0,15] and [16,31] with
+mininum length of trimmed range set to 8 blocks. If we have say a range of
+blocks 10-22 free, this range will not be trimmed because it straddles the
+boundary of the two FITRIM ranges and neither part is big enough. This is a
+bit surprising to some users that call FITRIM on smaller ranges of blocks
+to limit impact on the system. Also XFS trims all free space extents that
+overlap with the specified range so we are inconsistent among filesystems.
+Let's change ext4_try_to_trim_range() to consider for trimming the whole
+free space extent that straddles the end of specified range, not just the
+part of it within the range.
+
+Signed-off-by: Ye Bin <yebin10@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231216010919.1995851-1-yebin10@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/mballoc.c | 11 ++++++++---
+ 1 file changed, 8 insertions(+), 3 deletions(-)
+
+diff --git a/fs/ext4/mballoc.c b/fs/ext4/mballoc.c
+index 39d03e0ef78b..9bec75847b85 100644
+--- a/fs/ext4/mballoc.c
++++ b/fs/ext4/mballoc.c
+@@ -5916,13 +5916,15 @@ static int ext4_try_to_trim_range(struct super_block *sb,
+ struct ext4_buddy *e4b, ext4_grpblk_t start,
+ ext4_grpblk_t max, ext4_grpblk_t minblocks)
+ {
+- ext4_grpblk_t next, count, free_count;
++ ext4_grpblk_t next, count, free_count, last, origin_start;
+ bool set_trimmed = false;
+ void *bitmap;
+
++ last = ext4_last_grp_cluster(sb, e4b->bd_group);
+ bitmap = e4b->bd_bitmap;
+- if (start == 0 && max >= ext4_last_grp_cluster(sb, e4b->bd_group))
++ if (start == 0 && max >= last)
+ set_trimmed = true;
++ origin_start = start;
+ start = max(e4b->bd_info->bb_first_free, start);
+ count = 0;
+ free_count = 0;
+@@ -5931,7 +5933,10 @@ static int ext4_try_to_trim_range(struct super_block *sb,
+ start = mb_find_next_zero_bit(bitmap, max + 1, start);
+ if (start > max)
+ break;
+- next = mb_find_next_bit(bitmap, max + 1, start);
++
++ next = mb_find_next_bit(bitmap, last + 1, start);
++ if (origin_start == 0 && next >= last)
++ set_trimmed = true;
+
+ if ((next - start) >= minblocks) {
+ int ret = ext4_trim_extent(sb, start, next - start, e4b);
+--
+2.43.0
+
--- /dev/null
+From 0c22ee8c6f15e4aa0052082e31262cf531ee0566 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 23 Oct 2023 09:30:55 +0800
+Subject: ext4: remove unnecessary check from alloc_flex_gd()
+
+From: Baokun Li <libaokun1@huawei.com>
+
+[ Upstream commit b099eb87de105cf07cad731ded6fb40b2675108b ]
+
+In commit 967ac8af4475 ("ext4: fix potential integer overflow in
+alloc_flex_gd()"), an overflow check is added to alloc_flex_gd() to
+prevent the allocated memory from being smaller than expected due to
+the overflow. However, after kmalloc() is replaced with kmalloc_array()
+in commit 6da2ec56059c ("treewide: kmalloc() -> kmalloc_array()"), the
+kmalloc_array() function has an overflow check, so the above problem
+will not occur. Therefore, the extra check is removed.
+
+Signed-off-by: Baokun Li <libaokun1@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231023013057.2117948-3-libaokun1@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/resize.c | 3 ---
+ 1 file changed, 3 deletions(-)
+
+diff --git a/fs/ext4/resize.c b/fs/ext4/resize.c
+index 96d278688fd7..66ce3d118203 100644
+--- a/fs/ext4/resize.c
++++ b/fs/ext4/resize.c
+@@ -245,10 +245,7 @@ static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned int flexbg_size)
+ if (flex_gd == NULL)
+ goto out3;
+
+- if (flexbg_size >= UINT_MAX / sizeof(struct ext4_new_group_data))
+- goto out2;
+ flex_gd->count = flexbg_size;
+-
+ flex_gd->groups = kmalloc_array(flexbg_size,
+ sizeof(struct ext4_new_group_data),
+ GFP_NOFS);
+--
+2.43.0
+
--- /dev/null
+From 6a32cc48394ced15827dc1b3c53890049ef17c1a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 23 Oct 2023 09:30:54 +0800
+Subject: ext4: unify the type of flexbg_size to unsigned int
+
+From: Baokun Li <libaokun1@huawei.com>
+
+[ Upstream commit 658a52344fb139f9531e7543a6e0015b630feb38 ]
+
+The maximum value of flexbg_size is 2^31, but the maximum value of int
+is (2^31 - 1), so overflow may occur when the type of flexbg_size is
+declared as int.
+
+For example, when uninit_mask is initialized in ext4_alloc_group_tables(),
+if flexbg_size == 2^31, the initialized uninit_mask is incorrect, and this
+may causes set_flexbg_block_bitmap() to trigger a BUG_ON().
+
+Therefore, the flexbg_size type is declared as unsigned int to avoid
+overflow and memory waste.
+
+Signed-off-by: Baokun Li <libaokun1@huawei.com>
+Reviewed-by: Jan Kara <jack@suse.cz>
+Link: https://lore.kernel.org/r/20231023013057.2117948-2-libaokun1@huawei.com
+Signed-off-by: Theodore Ts'o <tytso@mit.edu>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/ext4/resize.c | 13 +++++++------
+ 1 file changed, 7 insertions(+), 6 deletions(-)
+
+diff --git a/fs/ext4/resize.c b/fs/ext4/resize.c
+index 9b4199a1e039..96d278688fd7 100644
+--- a/fs/ext4/resize.c
++++ b/fs/ext4/resize.c
+@@ -237,7 +237,7 @@ struct ext4_new_flex_group_data {
+ *
+ * Returns NULL on failure otherwise address of the allocated structure.
+ */
+-static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned long flexbg_size)
++static struct ext4_new_flex_group_data *alloc_flex_gd(unsigned int flexbg_size)
+ {
+ struct ext4_new_flex_group_data *flex_gd;
+
+@@ -292,7 +292,7 @@ static void free_flex_gd(struct ext4_new_flex_group_data *flex_gd)
+ */
+ static int ext4_alloc_group_tables(struct super_block *sb,
+ struct ext4_new_flex_group_data *flex_gd,
+- int flexbg_size)
++ unsigned int flexbg_size)
+ {
+ struct ext4_new_group_data *group_data = flex_gd->groups;
+ ext4_fsblk_t start_blk;
+@@ -393,12 +393,12 @@ static int ext4_alloc_group_tables(struct super_block *sb,
+ group = group_data[0].group;
+
+ printk(KERN_DEBUG "EXT4-fs: adding a flex group with "
+- "%d groups, flexbg size is %d:\n", flex_gd->count,
++ "%u groups, flexbg size is %u:\n", flex_gd->count,
+ flexbg_size);
+
+ for (i = 0; i < flex_gd->count; i++) {
+ ext4_debug(
+- "adding %s group %u: %u blocks (%d free, %d mdata blocks)\n",
++ "adding %s group %u: %u blocks (%u free, %u mdata blocks)\n",
+ ext4_bg_has_super(sb, group + i) ? "normal" :
+ "no-super", group + i,
+ group_data[i].blocks_count,
+@@ -1563,7 +1563,7 @@ static int ext4_flex_group_add(struct super_block *sb,
+ static int ext4_setup_next_flex_gd(struct super_block *sb,
+ struct ext4_new_flex_group_data *flex_gd,
+ ext4_fsblk_t n_blocks_count,
+- unsigned long flexbg_size)
++ unsigned int flexbg_size)
+ {
+ struct ext4_sb_info *sbi = EXT4_SB(sb);
+ struct ext4_super_block *es = sbi->s_es;
+@@ -1941,8 +1941,9 @@ int ext4_resize_fs(struct super_block *sb, ext4_fsblk_t n_blocks_count)
+ ext4_fsblk_t o_blocks_count;
+ ext4_fsblk_t n_blocks_count_retry = 0;
+ unsigned long last_update_time = 0;
+- int err = 0, flexbg_size = 1 << sbi->s_log_groups_per_flex;
++ int err = 0;
+ int meta_bg;
++ unsigned int flexbg_size = ext4_flex_bg_size(sbi);
+
+ /* See if the device is actually as big as what was requested */
+ bh = ext4_sb_bread(sb, n_blocks_count - 1, 0);
+--
+2.43.0
+
--- /dev/null
+From 870dcbf40411c47ec8939f327cbf431b1296cb44 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 16 Nov 2023 14:25:56 +0800
+Subject: f2fs: fix to check return value of f2fs_reserve_new_block()
+
+From: Chao Yu <chao@kernel.org>
+
+[ Upstream commit 956fa1ddc132e028f3b7d4cf17e6bfc8cb36c7fd ]
+
+Let's check return value of f2fs_reserve_new_block() in do_recover_data()
+rather than letting it fails silently.
+
+Also refactoring check condition on return value of f2fs_reserve_new_block()
+as below:
+- trigger f2fs_bug_on() only for ENOSPC case;
+- use do-while statement to avoid redundant codes;
+
+Signed-off-by: Chao Yu <chao@kernel.org>
+Signed-off-by: Jaegeuk Kim <jaegeuk@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/f2fs/recovery.c | 23 +++++++++++++++++------
+ 1 file changed, 17 insertions(+), 6 deletions(-)
+
+diff --git a/fs/f2fs/recovery.c b/fs/f2fs/recovery.c
+index c3c527afdd07..2700e0fdd3e0 100644
+--- a/fs/f2fs/recovery.c
++++ b/fs/f2fs/recovery.c
+@@ -641,7 +641,16 @@ static int do_recover_data(struct f2fs_sb_info *sbi, struct inode *inode,
+ */
+ if (dest == NEW_ADDR) {
+ f2fs_truncate_data_blocks_range(&dn, 1);
+- f2fs_reserve_new_block(&dn);
++ do {
++ err = f2fs_reserve_new_block(&dn);
++ if (err == -ENOSPC) {
++ f2fs_bug_on(sbi, 1);
++ break;
++ }
++ } while (err &&
++ IS_ENABLED(CONFIG_F2FS_FAULT_INJECTION));
++ if (err)
++ goto err;
+ continue;
+ }
+
+@@ -649,12 +658,14 @@ static int do_recover_data(struct f2fs_sb_info *sbi, struct inode *inode,
+ if (f2fs_is_valid_blkaddr(sbi, dest, META_POR)) {
+
+ if (src == NULL_ADDR) {
+- err = f2fs_reserve_new_block(&dn);
+- while (err &&
+- IS_ENABLED(CONFIG_F2FS_FAULT_INJECTION))
++ do {
+ err = f2fs_reserve_new_block(&dn);
+- /* We should not get -ENOSPC */
+- f2fs_bug_on(sbi, err);
++ if (err == -ENOSPC) {
++ f2fs_bug_on(sbi, 1);
++ break;
++ }
++ } while (err &&
++ IS_ENABLED(CONFIG_F2FS_FAULT_INJECTION));
+ if (err)
+ goto err;
+ }
+--
+2.43.0
+
--- /dev/null
+From 58376bb6c5136defc9a202a0749f36936c874e3d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 2 Dec 2023 00:08:57 -0800
+Subject: f2fs: fix write pointers on zoned device after roll forward
+
+From: Jaegeuk Kim <jaegeuk@kernel.org>
+
+[ Upstream commit 9dad4d964291295ef48243d4e03972b85138bc9f ]
+
+1. do roll forward recovery
+2. update current segments pointers
+3. fix the entire zones' write pointers
+4. do checkpoint
+
+Reviewed-by: Daeho Jeong <daehojeong@google.com>
+Signed-off-by: Jaegeuk Kim <jaegeuk@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/f2fs/recovery.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/fs/f2fs/recovery.c b/fs/f2fs/recovery.c
+index 2700e0fdd3e0..cd56af93df42 100644
+--- a/fs/f2fs/recovery.c
++++ b/fs/f2fs/recovery.c
+@@ -855,6 +855,8 @@ int f2fs_recover_fsync_data(struct f2fs_sb_info *sbi, bool check_only)
+ if (!err && fix_curseg_write_pointer && !f2fs_readonly(sbi->sb) &&
+ f2fs_sb_has_blkzoned(sbi)) {
+ err = f2fs_fix_curseg_write_pointer(sbi);
++ if (!err)
++ err = f2fs_check_write_pointer(sbi);
+ ret = err;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From c870288e0b13b9c5f347dd833d3eab80f16acfe3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 1 Nov 2023 01:08:54 -0400
+Subject: fast_dput(): handle underflows gracefully
+
+From: Al Viro <viro@zeniv.linux.org.uk>
+
+[ Upstream commit 504e08cebe1d4e1efe25f915234f646e74a364a8 ]
+
+If refcount is less than 1, we should just warn, unlock dentry and
+return true, so that the caller doesn't try to do anything else.
+
+Taking care of that leaves the rest of "lockref_put_return() has
+failed" case equivalent to "decrement refcount and rejoin the
+normal slow path after the point where we grab ->d_lock".
+
+NOTE: lockref_put_return() is strictly a fastpath thing - unlike
+the rest of lockref primitives, it does not contain a fallback.
+Caller (and it looks like fast_dput() is the only legitimate one
+in the entire kernel) has to do that itself. Reasons for
+lockref_put_return() failures:
+ * ->d_lock held by somebody
+ * refcount <= 0
+ * ... or an architecture not supporting lockref use of
+cmpxchg - sparc, anything non-SMP, config with spinlock debugging...
+
+We could add a fallback, but it would be a clumsy API - we'd have
+to distinguish between:
+ (1) refcount > 1 - decremented, lock not held on return
+ (2) refcount < 1 - left alone, probably no sense to hold the lock
+ (3) refcount is 1, no cmphxcg - decremented, lock held on return
+ (4) refcount is 1, cmphxcg supported - decremented, lock *NOT* held
+ on return.
+We want to return with no lock held in case (4); that's the whole point of that
+thing. We very much do not want to have the fallback in case (3) return without
+a lock, since the caller might have to retake it in that case.
+So it wouldn't be more convenient than doing the fallback in the caller and
+it would be very easy to screw up, especially since the test coverage would
+suck - no way to test (3) and (4) on the same kernel build.
+
+Reviewed-by: Christian Brauner <brauner@kernel.org>
+Signed-off-by: Al Viro <viro@zeniv.linux.org.uk>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/dcache.c | 7 ++++---
+ 1 file changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/fs/dcache.c b/fs/dcache.c
+index ea0485861d93..976c7474d62a 100644
+--- a/fs/dcache.c
++++ b/fs/dcache.c
+@@ -759,12 +759,12 @@ static inline bool fast_dput(struct dentry *dentry)
+ */
+ if (unlikely(ret < 0)) {
+ spin_lock(&dentry->d_lock);
+- if (dentry->d_lockref.count > 1) {
+- dentry->d_lockref.count--;
++ if (WARN_ON_ONCE(dentry->d_lockref.count <= 0)) {
+ spin_unlock(&dentry->d_lock);
+ return true;
+ }
+- return false;
++ dentry->d_lockref.count--;
++ goto locked;
+ }
+
+ /*
+@@ -815,6 +815,7 @@ static inline bool fast_dput(struct dentry *dentry)
+ * else could have killed it and marked it dead. Either way, we
+ * don't need to do anything else.
+ */
++locked:
+ if (dentry->d_lockref.count) {
+ spin_unlock(&dentry->d_lock);
+ return true;
+--
+2.43.0
+
--- /dev/null
+From 3ffb2e81bce7b461801d9cd019dea3b00160e702 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 11 Oct 2023 23:46:37 +0500
+Subject: FS:JFS:UBSAN:array-index-out-of-bounds in dbAdjTree
+
+From: Osama Muhammad <osmtendev@gmail.com>
+
+[ Upstream commit 9862ec7ac1cbc6eb5ee4a045b5d5b8edbb2f7e68 ]
+
+Syzkaller reported the following issue:
+
+UBSAN: array-index-out-of-bounds in fs/jfs/jfs_dmap.c:2867:6
+index 196694 is out of range for type 's8[1365]' (aka 'signed char[1365]')
+CPU: 1 PID: 109 Comm: jfsCommit Not tainted 6.6.0-rc3-syzkaller #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 08/04/2023
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1e7/0x2d0 lib/dump_stack.c:106
+ ubsan_epilogue lib/ubsan.c:217 [inline]
+ __ubsan_handle_out_of_bounds+0x11c/0x150 lib/ubsan.c:348
+ dbAdjTree+0x474/0x4f0 fs/jfs/jfs_dmap.c:2867
+ dbJoin+0x210/0x2d0 fs/jfs/jfs_dmap.c:2834
+ dbFreeBits+0x4eb/0xda0 fs/jfs/jfs_dmap.c:2331
+ dbFreeDmap fs/jfs/jfs_dmap.c:2080 [inline]
+ dbFree+0x343/0x650 fs/jfs/jfs_dmap.c:402
+ txFreeMap+0x798/0xd50 fs/jfs/jfs_txnmgr.c:2534
+ txUpdateMap+0x342/0x9e0
+ txLazyCommit fs/jfs/jfs_txnmgr.c:2664 [inline]
+ jfs_lazycommit+0x47a/0xb70 fs/jfs/jfs_txnmgr.c:2732
+ kthread+0x2d3/0x370 kernel/kthread.c:388
+ ret_from_fork+0x48/0x80 arch/x86/kernel/process.c:147
+ ret_from_fork_asm+0x11/0x20 arch/x86/entry/entry_64.S:304
+ </TASK>
+================================================================================
+Kernel panic - not syncing: UBSAN: panic_on_warn set ...
+CPU: 1 PID: 109 Comm: jfsCommit Not tainted 6.6.0-rc3-syzkaller #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 08/04/2023
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1e7/0x2d0 lib/dump_stack.c:106
+ panic+0x30f/0x770 kernel/panic.c:340
+ check_panic_on_warn+0x82/0xa0 kernel/panic.c:236
+ ubsan_epilogue lib/ubsan.c:223 [inline]
+ __ubsan_handle_out_of_bounds+0x13c/0x150 lib/ubsan.c:348
+ dbAdjTree+0x474/0x4f0 fs/jfs/jfs_dmap.c:2867
+ dbJoin+0x210/0x2d0 fs/jfs/jfs_dmap.c:2834
+ dbFreeBits+0x4eb/0xda0 fs/jfs/jfs_dmap.c:2331
+ dbFreeDmap fs/jfs/jfs_dmap.c:2080 [inline]
+ dbFree+0x343/0x650 fs/jfs/jfs_dmap.c:402
+ txFreeMap+0x798/0xd50 fs/jfs/jfs_txnmgr.c:2534
+ txUpdateMap+0x342/0x9e0
+ txLazyCommit fs/jfs/jfs_txnmgr.c:2664 [inline]
+ jfs_lazycommit+0x47a/0xb70 fs/jfs/jfs_txnmgr.c:2732
+ kthread+0x2d3/0x370 kernel/kthread.c:388
+ ret_from_fork+0x48/0x80 arch/x86/kernel/process.c:147
+ ret_from_fork_asm+0x11/0x20 arch/x86/entry/entry_64.S:304
+ </TASK>
+Kernel Offset: disabled
+Rebooting in 86400 seconds..
+
+The issue is caused when the value of lp becomes greater than
+CTLTREESIZE which is the max size of stree. Adding a simple check
+solves this issue.
+
+Dave:
+As the function returns a void, good error handling
+would require a more intrusive code reorganization, so I modified
+Osama's patch at use WARN_ON_ONCE for lack of a cleaner option.
+
+The patch is tested via syzbot.
+
+Reported-by: syzbot+39ba34a099ac2e9bd3cb@syzkaller.appspotmail.com
+Link: https://syzkaller.appspot.com/bug?extid=39ba34a099ac2e9bd3cb
+Signed-off-by: Osama Muhammad <osmtendev@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dmap.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/fs/jfs/jfs_dmap.c b/fs/jfs/jfs_dmap.c
+index 72eb5ed54c2a..985beb1c654d 100644
+--- a/fs/jfs/jfs_dmap.c
++++ b/fs/jfs/jfs_dmap.c
+@@ -2935,6 +2935,9 @@ static void dbAdjTree(dmtree_t * tp, int leafno, int newval)
+ /* is the current value the same as the old value ? if so,
+ * there is nothing to do.
+ */
++ if (WARN_ON_ONCE(lp >= CTLTREESIZE))
++ return;
++
+ if (tp->dmt_stree[lp] == newval)
+ return;
+
+--
+2.43.0
+
--- /dev/null
+From 860ea09b901b3fb6d409b7b785912cac53804eb6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 10:33:10 +0100
+Subject: fs/kernfs/dir: obey S_ISGID
+
+From: Max Kellermann <max.kellermann@ionos.com>
+
+[ Upstream commit 5133bee62f0ea5d4c316d503cc0040cac5637601 ]
+
+Handling of S_ISGID is usually done by inode_init_owner() in all other
+filesystems, but kernfs doesn't use that function. In kernfs, struct
+kernfs_node is the primary data structure, and struct inode is only
+created from it on demand. Therefore, inode_init_owner() can't be
+used and we need to imitate its behavior.
+
+S_ISGID support is useful for the cgroup filesystem; it allows
+subtrees managed by an unprivileged process to retain a certain owner
+gid, which then enables sharing access to the subtree with another
+unprivileged process.
+
+--
+v1 -> v2: minor coding style fix (comment)
+
+Signed-off-by: Max Kellermann <max.kellermann@ionos.com>
+Acked-by: Tejun Heo <tj@kernel.org>
+Link: https://lore.kernel.org/r/20231208093310.297233-2-max.kellermann@ionos.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/kernfs/dir.c | 12 ++++++++++++
+ 1 file changed, 12 insertions(+)
+
+diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
+index c91ee05cce74..0ba056e06e48 100644
+--- a/fs/kernfs/dir.c
++++ b/fs/kernfs/dir.c
+@@ -696,6 +696,18 @@ struct kernfs_node *kernfs_new_node(struct kernfs_node *parent,
+ {
+ struct kernfs_node *kn;
+
++ if (parent->mode & S_ISGID) {
++ /* this code block imitates inode_init_owner() for
++ * kernfs
++ */
++
++ if (parent->iattr)
++ gid = parent->iattr->ia_gid;
++
++ if (flags & KERNFS_DIR)
++ mode |= S_ISGID;
++ }
++
+ kn = __kernfs_new_node(kernfs_root(parent), parent,
+ name, mode, uid, gid, flags);
+ if (kn) {
+--
+2.43.0
+
--- /dev/null
+From 239406643c60bd7c448c5b3a1ef1138ac2c4cb90 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 15 Nov 2023 14:28:15 +0100
+Subject: Hexagon: Make pfn accessors statics inlines
+
+From: Linus Walleij <linus.walleij@linaro.org>
+
+[ Upstream commit d6e81532b10d8deb2bc30f7b44f09534876893e3 ]
+
+Making virt_to_pfn() a static inline taking a strongly typed
+(const void *) makes the contract of a passing a pointer of that
+type to the function explicit and exposes any misuse of the
+macro virt_to_pfn() acting polymorphic and accepting many types
+such as (void *), (unitptr_t) or (unsigned long) as arguments
+without warnings.
+
+For symmetry do the same with pfn_to_virt().
+
+For compiletime resolution of __pa() we need PAGE_OFFSET which
+was not available to __pa() and resolved by the preprocessor
+wherever __pa() was used. Fix this by explicitly including
+<asm/mem-layout.h> where required, following the pattern of the
+architectures page.h file.
+
+Acked-by: Brian Cain <bcain@quicinc.com>
+Signed-off-by: Linus Walleij <linus.walleij@linaro.org>
+Signed-off-by: Arnd Bergmann <arnd@arndb.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/hexagon/include/asm/page.h | 15 +++++++++++++--
+ 1 file changed, 13 insertions(+), 2 deletions(-)
+
+diff --git a/arch/hexagon/include/asm/page.h b/arch/hexagon/include/asm/page.h
+index 7cbf719c578e..2d8c681c3469 100644
+--- a/arch/hexagon/include/asm/page.h
++++ b/arch/hexagon/include/asm/page.h
+@@ -78,6 +78,9 @@ typedef struct page *pgtable_t;
+ #define __pgd(x) ((pgd_t) { (x) })
+ #define __pgprot(x) ((pgprot_t) { (x) })
+
++/* Needed for PAGE_OFFSET used in the macro right below */
++#include <asm/mem-layout.h>
++
+ /*
+ * We need a __pa and a __va routine for kernel space.
+ * MIPS says they're only used during mem_init.
+@@ -126,8 +129,16 @@ static inline void clear_page(void *page)
+ */
+ #define page_to_phys(page) (page_to_pfn(page) << PAGE_SHIFT)
+
+-#define virt_to_pfn(kaddr) (__pa(kaddr) >> PAGE_SHIFT)
+-#define pfn_to_virt(pfn) __va((pfn) << PAGE_SHIFT)
++static inline unsigned long virt_to_pfn(const void *kaddr)
++{
++ return __pa(kaddr) >> PAGE_SHIFT;
++}
++
++static inline void *pfn_to_virt(unsigned long pfn)
++{
++ return (void *)((unsigned long)__va(pfn) << PAGE_SHIFT);
++}
++
+
+ #define page_to_virt(page) __va(page_to_phys(page))
+
+--
+2.43.0
+
--- /dev/null
+From 870b52ed1cd6d610437943c732fdf45c6396c6c6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 12:02:07 -0800
+Subject: hwmon: (pc87360) Bounds check data->innr usage
+
+From: Kees Cook <keescook@chromium.org>
+
+[ Upstream commit 4265eb062a7303e537ab3792ade31f424c3c5189 ]
+
+Without visibility into the initializers for data->innr, GCC suspects
+using it as an index could walk off the end of the various 14-element
+arrays in data. Perform an explicit clamp to the array size. Silences
+the following warning with GCC 12+:
+
+../drivers/hwmon/pc87360.c: In function 'pc87360_update_device':
+../drivers/hwmon/pc87360.c:341:49: warning: writing 1 byte into a region of size 0 [-Wstringop-overflow=]
+ 341 | data->in_max[i] = pc87360_read_value(data,
+ | ~~~~~~~~~~~~~~~~^~~~~~~~~~~~~~~~~~~~~~~~~~
+ 342 | LD_IN, i,
+ | ~~~~~~~~~
+ 343 | PC87365_REG_IN_MAX);
+ | ~~~~~~~~~~~~~~~~~~~
+../drivers/hwmon/pc87360.c:209:12: note: at offset 255 into destination object 'in_max' of size 14
+ 209 | u8 in_max[14]; /* Register value */
+ | ^~~~~~
+
+Cc: Jim Cromie <jim.cromie@gmail.com>
+Cc: Jean Delvare <jdelvare@suse.com>
+Cc: Guenter Roeck <linux@roeck-us.net>
+Cc: linux-hwmon@vger.kernel.org
+Signed-off-by: Kees Cook <keescook@chromium.org>
+Reviewed-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Link: https://lore.kernel.org/r/20231130200207.work.679-kees@kernel.org
+[groeck: Added comment into code clarifying context]
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/hwmon/pc87360.c | 6 +++++-
+ 1 file changed, 5 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/hwmon/pc87360.c b/drivers/hwmon/pc87360.c
+index 94f4b8b4a2ba..0cf603c8c9f9 100644
+--- a/drivers/hwmon/pc87360.c
++++ b/drivers/hwmon/pc87360.c
+@@ -1605,7 +1605,11 @@ static struct pc87360_data *pc87360_update_device(struct device *dev)
+ }
+
+ /* Voltages */
+- for (i = 0; i < data->innr; i++) {
++ /*
++ * The min() below does not have any practical meaning and is
++ * only needed to silence a warning observed with gcc 12+.
++ */
++ for (i = 0; i < min(data->innr, ARRAY_SIZE(data->in)); i++) {
+ data->in_status[i] = pc87360_read_value(data, LD_IN, i,
+ PC87365_REG_IN_STATUS);
+ /* Clear bits */
+--
+2.43.0
+
--- /dev/null
+From 30d15f2face6d238f84aa0d4e517943c8c8e4f53 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 30 Dec 2023 14:41:23 +0530
+Subject: i3c: master: cdns: Update maximum prescaler value for i2c clock
+
+From: Harshit Shah <harshitshah.opendev@gmail.com>
+
+[ Upstream commit 374c13f9080a1b9835a5ed3e7bea93cf8e2dc262 ]
+
+As per the Cadence IP document fixed the I2C clock divider value limit from
+16 bits instead of 10 bits. Without this change setting up the I2C clock to
+low frequencies will not work as the prescaler value might be greater than
+10 bit number.
+
+I3C clock divider value is 10 bits only. Updating the macro names for both.
+
+Signed-off-by: Harshit Shah <harshitshah.opendev@gmail.com>
+Link: https://lore.kernel.org/r/1703927483-28682-1-git-send-email-harshitshah.opendev@gmail.com
+Signed-off-by: Alexandre Belloni <alexandre.belloni@bootlin.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/i3c/master/i3c-master-cdns.c | 7 ++++---
+ 1 file changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/i3c/master/i3c-master-cdns.c b/drivers/i3c/master/i3c-master-cdns.c
+index 6b9df33ac561..6b126fce5a9e 100644
+--- a/drivers/i3c/master/i3c-master-cdns.c
++++ b/drivers/i3c/master/i3c-master-cdns.c
+@@ -77,7 +77,8 @@
+ #define PRESCL_CTRL0 0x14
+ #define PRESCL_CTRL0_I2C(x) ((x) << 16)
+ #define PRESCL_CTRL0_I3C(x) (x)
+-#define PRESCL_CTRL0_MAX GENMASK(9, 0)
++#define PRESCL_CTRL0_I3C_MAX GENMASK(9, 0)
++#define PRESCL_CTRL0_I2C_MAX GENMASK(15, 0)
+
+ #define PRESCL_CTRL1 0x18
+ #define PRESCL_CTRL1_PP_LOW_MASK GENMASK(15, 8)
+@@ -1234,7 +1235,7 @@ static int cdns_i3c_master_bus_init(struct i3c_master_controller *m)
+ return -EINVAL;
+
+ pres = DIV_ROUND_UP(sysclk_rate, (bus->scl_rate.i3c * 4)) - 1;
+- if (pres > PRESCL_CTRL0_MAX)
++ if (pres > PRESCL_CTRL0_I3C_MAX)
+ return -ERANGE;
+
+ bus->scl_rate.i3c = sysclk_rate / ((pres + 1) * 4);
+@@ -1247,7 +1248,7 @@ static int cdns_i3c_master_bus_init(struct i3c_master_controller *m)
+ max_i2cfreq = bus->scl_rate.i2c;
+
+ pres = (sysclk_rate / (max_i2cfreq * 5)) - 1;
+- if (pres > PRESCL_CTRL0_MAX)
++ if (pres > PRESCL_CTRL0_I2C_MAX)
+ return -ERANGE;
+
+ bus->scl_rate.i2c = sysclk_rate / ((pres + 1) * 5);
+--
+2.43.0
+
--- /dev/null
+From fef7bae14069a09fda40b481b7e9be207ec28355 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 15:24:12 +0100
+Subject: i40e: Fix VF disable behavior to block all traffic
+
+From: Andrii Staikov <andrii.staikov@intel.com>
+
+[ Upstream commit 31deb12e85c35ddd2c037f0107d05d8674cab2c0 ]
+
+Currently, if a VF is disabled using the
+'ip link set dev $ETHX vf $VF_NUM state disable' command, the VF is still
+able to receive traffic.
+
+Fix the behavior of the 'ip link set dev $ETHX vf $VF_NUM state disable'
+to completely shutdown the VF's queues making it entirely disabled and
+not able to receive or send any traffic.
+
+Modify the behavior of the 'ip link set $ETHX vf $VF_NUM state enable'
+command to make a VF do reinitialization bringing the queues back up.
+
+Co-developed-by: Aleksandr Loktionov <aleksandr.loktionov@intel.com>
+Signed-off-by: Aleksandr Loktionov <aleksandr.loktionov@intel.com>
+Reviewed-by: Jan Sokolowski <jan.sokolowski@intel.com>
+Reviewed-by: Wojciech Drewek <wojciech.drewek@intel.com>
+Reviewed-by: Przemek Kitszel <przemyslaw.kitszel@intel.com>
+Signed-off-by: Andrii Staikov <andrii.staikov@intel.com>
+Tested-by: Rafal Romanowski <rafal.romanowski@intel.com>
+Signed-off-by: Tony Nguyen <anthony.l.nguyen@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../ethernet/intel/i40e/i40e_virtchnl_pf.c | 32 +++++++++++++++++++
+ .../ethernet/intel/i40e/i40e_virtchnl_pf.h | 1 +
+ 2 files changed, 33 insertions(+)
+
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c
+index 7b0ed15f4df3..f79795cc9152 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c
++++ b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.c
+@@ -2545,6 +2545,14 @@ static int i40e_vc_enable_queues_msg(struct i40e_vf *vf, u8 *msg)
+ i40e_status aq_ret = 0;
+ int i;
+
++ if (vf->is_disabled_from_host) {
++ aq_ret = -EPERM;
++ dev_info(&pf->pdev->dev,
++ "Admin has disabled VF %d, will not enable queues\n",
++ vf->vf_id);
++ goto error_param;
++ }
++
+ if (!test_bit(I40E_VF_STATE_ACTIVE, &vf->vf_states)) {
+ aq_ret = I40E_ERR_PARAM;
+ goto error_param;
+@@ -4587,9 +4595,12 @@ int i40e_ndo_set_vf_link_state(struct net_device *netdev, int vf_id, int link)
+ struct i40e_pf *pf = np->vsi->back;
+ struct virtchnl_pf_event pfe;
+ struct i40e_hw *hw = &pf->hw;
++ struct i40e_vsi *vsi;
++ unsigned long q_map;
+ struct i40e_vf *vf;
+ int abs_vf_id;
+ int ret = 0;
++ int tmp;
+
+ if (test_and_set_bit(__I40E_VIRTCHNL_OP_PENDING, pf->state)) {
+ dev_warn(&pf->pdev->dev, "Unable to configure VFs, other operation is pending.\n");
+@@ -4612,6 +4623,9 @@ int i40e_ndo_set_vf_link_state(struct net_device *netdev, int vf_id, int link)
+ switch (link) {
+ case IFLA_VF_LINK_STATE_AUTO:
+ vf->link_forced = false;
++ vf->is_disabled_from_host = false;
++ /* reset needed to reinit VF resources */
++ i40e_vc_reset_vf(vf, true);
+ pfe.event_data.link_event.link_status =
+ pf->hw.phy.link_info.link_info & I40E_AQ_LINK_UP;
+ pfe.event_data.link_event.link_speed =
+@@ -4621,6 +4635,9 @@ int i40e_ndo_set_vf_link_state(struct net_device *netdev, int vf_id, int link)
+ case IFLA_VF_LINK_STATE_ENABLE:
+ vf->link_forced = true;
+ vf->link_up = true;
++ vf->is_disabled_from_host = false;
++ /* reset needed to reinit VF resources */
++ i40e_vc_reset_vf(vf, true);
+ pfe.event_data.link_event.link_status = true;
+ pfe.event_data.link_event.link_speed = VIRTCHNL_LINK_SPEED_40GB;
+ break;
+@@ -4629,6 +4646,21 @@ int i40e_ndo_set_vf_link_state(struct net_device *netdev, int vf_id, int link)
+ vf->link_up = false;
+ pfe.event_data.link_event.link_status = false;
+ pfe.event_data.link_event.link_speed = 0;
++
++ vsi = pf->vsi[vf->lan_vsi_idx];
++ q_map = BIT(vsi->num_queue_pairs) - 1;
++
++ vf->is_disabled_from_host = true;
++
++ /* Try to stop both Tx&Rx rings even if one of the calls fails
++ * to ensure we stop the rings even in case of errors.
++ * If any of them returns with an error then the first
++ * error that occurred will be returned.
++ */
++ tmp = i40e_ctrl_vf_tx_rings(vsi, q_map, false);
++ ret = i40e_ctrl_vf_rx_rings(vsi, q_map, false);
++
++ ret = tmp ? tmp : ret;
+ break;
+ default:
+ ret = -EINVAL;
+diff --git a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h
+index bd497cc5303a..97e9c34d7c6c 100644
+--- a/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h
++++ b/drivers/net/ethernet/intel/i40e/i40e_virtchnl_pf.h
+@@ -98,6 +98,7 @@ struct i40e_vf {
+ bool link_forced;
+ bool link_up; /* only valid if VF link is forced */
+ bool spoofchk;
++ bool is_disabled_from_host; /* PF ctrl of VF enable/disable */
+ u16 num_vlan;
+
+ /* ADq related variables */
+--
+2.43.0
+
--- /dev/null
+From 83b96c3e85f1212ff4075f246d6df943c4ca2836 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 09:07:45 +0100
+Subject: IB/ipoib: Fix mcast list locking
+
+From: Daniel Vacek <neelx@redhat.com>
+
+[ Upstream commit 4f973e211b3b1c6d36f7c6a19239d258856749f9 ]
+
+Releasing the `priv->lock` while iterating the `priv->multicast_list` in
+`ipoib_mcast_join_task()` opens a window for `ipoib_mcast_dev_flush()` to
+remove the items while in the middle of iteration. If the mcast is removed
+while the lock was dropped, the for loop spins forever resulting in a hard
+lockup (as was reported on RHEL 4.18.0-372.75.1.el8_6 kernel):
+
+ Task A (kworker/u72:2 below) | Task B (kworker/u72:0 below)
+ -----------------------------------+-----------------------------------
+ ipoib_mcast_join_task(work) | ipoib_ib_dev_flush_light(work)
+ spin_lock_irq(&priv->lock) | __ipoib_ib_dev_flush(priv, ...)
+ list_for_each_entry(mcast, | ipoib_mcast_dev_flush(dev = priv->dev)
+ &priv->multicast_list, list) |
+ ipoib_mcast_join(dev, mcast) |
+ spin_unlock_irq(&priv->lock) |
+ | spin_lock_irqsave(&priv->lock, flags)
+ | list_for_each_entry_safe(mcast, tmcast,
+ | &priv->multicast_list, list)
+ | list_del(&mcast->list);
+ | list_add_tail(&mcast->list, &remove_list)
+ | spin_unlock_irqrestore(&priv->lock, flags)
+ spin_lock_irq(&priv->lock) |
+ | ipoib_mcast_remove_list(&remove_list)
+ (Here, `mcast` is no longer on the | list_for_each_entry_safe(mcast, tmcast,
+ `priv->multicast_list` and we keep | remove_list, list)
+ spinning on the `remove_list` of | >>> wait_for_completion(&mcast->done)
+ the other thread which is blocked |
+ and the list is still valid on |
+ it's stack.)
+
+Fix this by keeping the lock held and changing to GFP_ATOMIC to prevent
+eventual sleeps.
+Unfortunately we could not reproduce the lockup and confirm this fix but
+based on the code review I think this fix should address such lockups.
+
+crash> bc 31
+PID: 747 TASK: ff1c6a1a007e8000 CPU: 31 COMMAND: "kworker/u72:2"
+--
+ [exception RIP: ipoib_mcast_join_task+0x1b1]
+ RIP: ffffffffc0944ac1 RSP: ff646f199a8c7e00 RFLAGS: 00000002
+ RAX: 0000000000000000 RBX: ff1c6a1a04dc82f8 RCX: 0000000000000000
+ work (&priv->mcast_task{,.work})
+ RDX: ff1c6a192d60ac68 RSI: 0000000000000286 RDI: ff1c6a1a04dc8000
+ &mcast->list
+ RBP: ff646f199a8c7e90 R8: ff1c699980019420 R9: ff1c6a1920c9a000
+ R10: ff646f199a8c7e00 R11: ff1c6a191a7d9800 R12: ff1c6a192d60ac00
+ mcast
+ R13: ff1c6a1d82200000 R14: ff1c6a1a04dc8000 R15: ff1c6a1a04dc82d8
+ dev priv (&priv->lock) &priv->multicast_list (aka head)
+ ORIG_RAX: ffffffffffffffff CS: 0010 SS: 0018
+
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/infiniband/ulp/ipoib/ipoib_multicast.c | 6 +-----
+ 1 file changed, 1 insertion(+), 5 deletions(-)
+
+diff --git a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+index 5633809dc61e..e009123c703b 100644
+--- a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
++++ b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+@@ -542,21 +542,17 @@ static int ipoib_mcast_join(struct net_device *dev, struct ipoib_mcast *mcast)
+ /* SM supports sendonly-fullmember, otherwise fallback to full-member */
+ rec.join_state = SENDONLY_FULLMEMBER_JOIN;
+ }
+- spin_unlock_irq(&priv->lock);
+
+ multicast = ib_sa_join_multicast(&ipoib_sa_client, priv->ca, priv->port,
+- &rec, comp_mask, GFP_KERNEL,
++ &rec, comp_mask, GFP_ATOMIC,
+ ipoib_mcast_join_complete, mcast);
+- spin_lock_irq(&priv->lock);
+ if (IS_ERR(multicast)) {
+ ret = PTR_ERR(multicast);
+ ipoib_warn(priv, "ib_sa_join_multicast failed, status %d\n", ret);
+ /* Requeue this join task with a backoff delay */
+ __ipoib_mcast_schedule_join_thread(priv, mcast, 1);
+ clear_bit(IPOIB_MCAST_FLAG_BUSY, &mcast->flags);
+- spin_unlock_irq(&priv->lock);
+ complete(&mcast->done);
+- spin_lock_irq(&priv->lock);
+ return ret;
+ }
+ return 0;
+--
+2.43.0
+
--- /dev/null
+From d6f816720b1484be9ee6dc1fa80217c0b0b1e0e2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 11 Dec 2023 10:57:57 -0800
+Subject: ionic: pass opcode to devcmd_wait
+
+From: Shannon Nelson <shannon.nelson@amd.com>
+
+[ Upstream commit 24f110240c03c6b5368f1203bac72883d511e606 ]
+
+Don't rely on the PCI memory for the devcmd opcode because we
+read a 0xff value if the PCI bus is broken, which can cause us
+to report a bogus dev_cmd opcode later.
+
+Signed-off-by: Shannon Nelson <shannon.nelson@amd.com>
+Reviewed-by: Brett Creeley <brett.creeley@amd.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/pensando/ionic/ionic_dev.c | 1 +
+ drivers/net/ethernet/pensando/ionic/ionic_dev.h | 1 +
+ drivers/net/ethernet/pensando/ionic/ionic_main.c | 2 +-
+ 3 files changed, 3 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_dev.c b/drivers/net/ethernet/pensando/ionic/ionic_dev.c
+index dc5fbc2704f3..b5f681918f6e 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_dev.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_dev.c
+@@ -200,6 +200,7 @@ void ionic_dev_cmd_comp(struct ionic_dev *idev, union ionic_dev_cmd_comp *comp)
+
+ void ionic_dev_cmd_go(struct ionic_dev *idev, union ionic_dev_cmd *cmd)
+ {
++ idev->opcode = cmd->cmd.opcode;
+ memcpy_toio(&idev->dev_cmd_regs->cmd, cmd, sizeof(*cmd));
+ iowrite32(0, &idev->dev_cmd_regs->done);
+ iowrite32(1, &idev->dev_cmd_regs->doorbell);
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_dev.h b/drivers/net/ethernet/pensando/ionic/ionic_dev.h
+index 64d27e8e0772..1ce0d307a9d0 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_dev.h
++++ b/drivers/net/ethernet/pensando/ionic/ionic_dev.h
+@@ -136,6 +136,7 @@ struct ionic_dev {
+ unsigned long last_hb_time;
+ u32 last_hb;
+ u8 last_fw_status;
++ u8 opcode;
+
+ u64 __iomem *db_pages;
+ dma_addr_t phy_db_pages;
+diff --git a/drivers/net/ethernet/pensando/ionic/ionic_main.c b/drivers/net/ethernet/pensando/ionic/ionic_main.c
+index 00b6985edea0..694e710244e6 100644
+--- a/drivers/net/ethernet/pensando/ionic/ionic_main.c
++++ b/drivers/net/ethernet/pensando/ionic/ionic_main.c
+@@ -333,7 +333,7 @@ int ionic_dev_cmd_wait(struct ionic *ionic, unsigned long max_seconds)
+ */
+ max_wait = jiffies + (max_seconds * HZ);
+ try_again:
+- opcode = readb(&idev->dev_cmd_regs->cmd.cmd.opcode);
++ opcode = idev->opcode;
+ start_time = jiffies;
+ do {
+ done = ionic_dev_cmd_done(idev);
+--
+2.43.0
+
--- /dev/null
+From 215f0cf378169883bb3433bd3f794c14f70380f6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 17 Oct 2023 17:33:56 +0530
+Subject: jfs: fix array-index-out-of-bounds in dbAdjTree
+
+From: Manas Ghandat <ghandatmanas@gmail.com>
+
+[ Upstream commit 74ecdda68242b174920fe7c6133a856fb7d8559b ]
+
+Currently there is a bound check missing in the dbAdjTree while
+accessing the dmt_stree. To add the required check added the bool is_ctl
+which is required to determine the size as suggest in the following
+commit.
+https://lore.kernel.org/linux-kernel-mentees/f9475918-2186-49b8-b801-6f0f9e75f4fa@oracle.com/
+
+Reported-by: syzbot+39ba34a099ac2e9bd3cb@syzkaller.appspotmail.com
+Closes: https://syzkaller.appspot.com/bug?extid=39ba34a099ac2e9bd3cb
+Signed-off-by: Manas Ghandat <ghandatmanas@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dmap.c | 60 ++++++++++++++++++++++++-----------------------
+ 1 file changed, 31 insertions(+), 29 deletions(-)
+
+diff --git a/fs/jfs/jfs_dmap.c b/fs/jfs/jfs_dmap.c
+index 985beb1c654d..9b6849b9bfdb 100644
+--- a/fs/jfs/jfs_dmap.c
++++ b/fs/jfs/jfs_dmap.c
+@@ -63,10 +63,10 @@
+ */
+ static void dbAllocBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ int nblocks);
+-static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval);
+-static int dbBackSplit(dmtree_t * tp, int leafno);
+-static int dbJoin(dmtree_t * tp, int leafno, int newval);
+-static void dbAdjTree(dmtree_t * tp, int leafno, int newval);
++static void dbSplit(dmtree_t *tp, int leafno, int splitsz, int newval, bool is_ctl);
++static int dbBackSplit(dmtree_t *tp, int leafno, bool is_ctl);
++static int dbJoin(dmtree_t *tp, int leafno, int newval, bool is_ctl);
++static void dbAdjTree(dmtree_t *tp, int leafno, int newval, bool is_ctl);
+ static int dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc,
+ int level);
+ static int dbAllocAny(struct bmap * bmp, s64 nblocks, int l2nb, s64 * results);
+@@ -2171,7 +2171,7 @@ static int dbFreeDmap(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ * system.
+ */
+ if (dp->tree.stree[word] == NOFREE)
+- dbBackSplit((dmtree_t *) & dp->tree, word);
++ dbBackSplit((dmtree_t *)&dp->tree, word, false);
+
+ dbAllocBits(bmp, dp, blkno, nblocks);
+ }
+@@ -2257,7 +2257,7 @@ static void dbAllocBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ * the binary system of the leaves if need be.
+ */
+ dbSplit(tp, word, BUDMIN,
+- dbMaxBud((u8 *) & dp->wmap[word]));
++ dbMaxBud((u8 *)&dp->wmap[word]), false);
+
+ word += 1;
+ } else {
+@@ -2297,7 +2297,7 @@ static void dbAllocBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ * system of the leaves to reflect the current
+ * allocation (size).
+ */
+- dbSplit(tp, word, size, NOFREE);
++ dbSplit(tp, word, size, NOFREE, false);
+
+ /* get the number of dmap words handled */
+ nw = BUDSIZE(size, BUDMIN);
+@@ -2404,7 +2404,7 @@ static int dbFreeBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+ /* update the leaf for this dmap word.
+ */
+ rc = dbJoin(tp, word,
+- dbMaxBud((u8 *) & dp->wmap[word]));
++ dbMaxBud((u8 *)&dp->wmap[word]), false);
+ if (rc)
+ return rc;
+
+@@ -2437,7 +2437,7 @@ static int dbFreeBits(struct bmap * bmp, struct dmap * dp, s64 blkno,
+
+ /* update the leaf.
+ */
+- rc = dbJoin(tp, word, size);
++ rc = dbJoin(tp, word, size, false);
+ if (rc)
+ return rc;
+
+@@ -2589,14 +2589,14 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ * that it is at the front of a binary buddy system.
+ */
+ if (oldval == NOFREE) {
+- rc = dbBackSplit((dmtree_t *) dcp, leafno);
++ rc = dbBackSplit((dmtree_t *)dcp, leafno, true);
+ if (rc)
+ return rc;
+ oldval = dcp->stree[ti];
+ }
+- dbSplit((dmtree_t *) dcp, leafno, dcp->budmin, newval);
++ dbSplit((dmtree_t *) dcp, leafno, dcp->budmin, newval, true);
+ } else {
+- rc = dbJoin((dmtree_t *) dcp, leafno, newval);
++ rc = dbJoin((dmtree_t *) dcp, leafno, newval, true);
+ if (rc)
+ return rc;
+ }
+@@ -2625,7 +2625,7 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ */
+ if (alloc) {
+ dbJoin((dmtree_t *) dcp, leafno,
+- oldval);
++ oldval, true);
+ } else {
+ /* the dbJoin() above might have
+ * caused a larger binary buddy system
+@@ -2635,9 +2635,9 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ */
+ if (dcp->stree[ti] == NOFREE)
+ dbBackSplit((dmtree_t *)
+- dcp, leafno);
++ dcp, leafno, true);
+ dbSplit((dmtree_t *) dcp, leafno,
+- dcp->budmin, oldval);
++ dcp->budmin, oldval, true);
+ }
+
+ /* release the buffer and return the error.
+@@ -2685,7 +2685,7 @@ dbAdjCtl(struct bmap * bmp, s64 blkno, int newval, int alloc, int level)
+ *
+ * serialization: IREAD_LOCK(ipbmap) or IWRITE_LOCK(ipbmap) held on entry/exit;
+ */
+-static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
++static void dbSplit(dmtree_t *tp, int leafno, int splitsz, int newval, bool is_ctl)
+ {
+ int budsz;
+ int cursz;
+@@ -2707,7 +2707,7 @@ static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
+ while (cursz >= splitsz) {
+ /* update the buddy's leaf with its new value.
+ */
+- dbAdjTree(tp, leafno ^ budsz, cursz);
++ dbAdjTree(tp, leafno ^ budsz, cursz, is_ctl);
+
+ /* on to the next size and buddy.
+ */
+@@ -2719,7 +2719,7 @@ static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
+ /* adjust the dmap tree to reflect the specified leaf's new
+ * value.
+ */
+- dbAdjTree(tp, leafno, newval);
++ dbAdjTree(tp, leafno, newval, is_ctl);
+ }
+
+
+@@ -2750,7 +2750,7 @@ static void dbSplit(dmtree_t * tp, int leafno, int splitsz, int newval)
+ *
+ * serialization: IREAD_LOCK(ipbmap) or IWRITE_LOCK(ipbmap) held on entry/exit;
+ */
+-static int dbBackSplit(dmtree_t * tp, int leafno)
++static int dbBackSplit(dmtree_t *tp, int leafno, bool is_ctl)
+ {
+ int budsz, bud, w, bsz, size;
+ int cursz;
+@@ -2801,7 +2801,7 @@ static int dbBackSplit(dmtree_t * tp, int leafno)
+ * system in two.
+ */
+ cursz = leaf[bud] - 1;
+- dbSplit(tp, bud, cursz, cursz);
++ dbSplit(tp, bud, cursz, cursz, is_ctl);
+ break;
+ }
+ }
+@@ -2829,7 +2829,7 @@ static int dbBackSplit(dmtree_t * tp, int leafno)
+ *
+ * RETURN VALUES: none
+ */
+-static int dbJoin(dmtree_t * tp, int leafno, int newval)
++static int dbJoin(dmtree_t *tp, int leafno, int newval, bool is_ctl)
+ {
+ int budsz, buddy;
+ s8 *leaf;
+@@ -2884,12 +2884,12 @@ static int dbJoin(dmtree_t * tp, int leafno, int newval)
+ if (leafno < buddy) {
+ /* leafno is the left buddy.
+ */
+- dbAdjTree(tp, buddy, NOFREE);
++ dbAdjTree(tp, buddy, NOFREE, is_ctl);
+ } else {
+ /* buddy is the left buddy and becomes
+ * leafno.
+ */
+- dbAdjTree(tp, leafno, NOFREE);
++ dbAdjTree(tp, leafno, NOFREE, is_ctl);
+ leafno = buddy;
+ }
+
+@@ -2902,7 +2902,7 @@ static int dbJoin(dmtree_t * tp, int leafno, int newval)
+
+ /* update the leaf value.
+ */
+- dbAdjTree(tp, leafno, newval);
++ dbAdjTree(tp, leafno, newval, is_ctl);
+
+ return 0;
+ }
+@@ -2923,21 +2923,23 @@ static int dbJoin(dmtree_t * tp, int leafno, int newval)
+ *
+ * RETURN VALUES: none
+ */
+-static void dbAdjTree(dmtree_t * tp, int leafno, int newval)
++static void dbAdjTree(dmtree_t *tp, int leafno, int newval, bool is_ctl)
+ {
+ int lp, pp, k;
+- int max;
++ int max, size;
++
++ size = is_ctl ? CTLTREESIZE : TREESIZE;
+
+ /* pick up the index of the leaf for this leafno.
+ */
+ lp = leafno + le32_to_cpu(tp->dmt_leafidx);
+
++ if (WARN_ON_ONCE(lp >= size || lp < 0))
++ return;
++
+ /* is the current value the same as the old value ? if so,
+ * there is nothing to do.
+ */
+- if (WARN_ON_ONCE(lp >= CTLTREESIZE))
+- return;
+-
+ if (tp->dmt_stree[lp] == newval)
+ return;
+
+--
+2.43.0
+
--- /dev/null
+From 316f0a238d13fdb3eefb70d2120f61e6f75cfa6d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 12 Dec 2023 09:36:22 +0800
+Subject: jfs: fix array-index-out-of-bounds in diNewExt
+
+From: Edward Adam Davis <eadavis@qq.com>
+
+[ Upstream commit 49f9637aafa6e63ba686c13cb8549bf5e6920402 ]
+
+[Syz report]
+UBSAN: array-index-out-of-bounds in fs/jfs/jfs_imap.c:2360:2
+index -878706688 is out of range for type 'struct iagctl[128]'
+CPU: 1 PID: 5065 Comm: syz-executor282 Not tainted 6.7.0-rc4-syzkaller-00009-gbee0e7762ad2 #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 11/10/2023
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1e7/0x2d0 lib/dump_stack.c:106
+ ubsan_epilogue lib/ubsan.c:217 [inline]
+ __ubsan_handle_out_of_bounds+0x11c/0x150 lib/ubsan.c:348
+ diNewExt+0x3cf3/0x4000 fs/jfs/jfs_imap.c:2360
+ diAllocExt fs/jfs/jfs_imap.c:1949 [inline]
+ diAllocAG+0xbe8/0x1e50 fs/jfs/jfs_imap.c:1666
+ diAlloc+0x1d3/0x1760 fs/jfs/jfs_imap.c:1587
+ ialloc+0x8f/0x900 fs/jfs/jfs_inode.c:56
+ jfs_mkdir+0x1c5/0xb90 fs/jfs/namei.c:225
+ vfs_mkdir+0x2f1/0x4b0 fs/namei.c:4106
+ do_mkdirat+0x264/0x3a0 fs/namei.c:4129
+ __do_sys_mkdir fs/namei.c:4149 [inline]
+ __se_sys_mkdir fs/namei.c:4147 [inline]
+ __x64_sys_mkdir+0x6e/0x80 fs/namei.c:4147
+ do_syscall_x64 arch/x86/entry/common.c:51 [inline]
+ do_syscall_64+0x45/0x110 arch/x86/entry/common.c:82
+ entry_SYSCALL_64_after_hwframe+0x63/0x6b
+RIP: 0033:0x7fcb7e6a0b57
+Code: ff ff 77 07 31 c0 c3 0f 1f 40 00 48 c7 c2 b8 ff ff ff f7 d8 64 89 02 b8 ff ff ff ff c3 66 0f 1f 44 00 00 b8 53 00 00 00 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b8 ff ff ff f7 d8 64 89 01 48
+RSP: 002b:00007ffd83023038 EFLAGS: 00000286 ORIG_RAX: 0000000000000053
+RAX: ffffffffffffffda RBX: 00000000ffffffff RCX: 00007fcb7e6a0b57
+RDX: 00000000000a1020 RSI: 00000000000001ff RDI: 0000000020000140
+RBP: 0000000020000140 R08: 0000000000000000 R09: 0000000000000000
+R10: 0000000000000000 R11: 0000000000000286 R12: 00007ffd830230d0
+R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000
+
+[Analysis]
+When the agstart is too large, it can cause agno overflow.
+
+[Fix]
+After obtaining agno, if the value is invalid, exit the subsequent process.
+
+Reported-and-tested-by: syzbot+553d90297e6d2f50dbc7@syzkaller.appspotmail.com
+Signed-off-by: Edward Adam Davis <eadavis@qq.com>
+
+Modified the test from agno > MAXAG to agno >= MAXAG based on linux-next
+report by kernel test robot (Dan Carpenter).
+
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_imap.c | 3 +++
+ 1 file changed, 3 insertions(+)
+
+diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
+index 14f918a4831d..b0965f3ef186 100644
+--- a/fs/jfs/jfs_imap.c
++++ b/fs/jfs/jfs_imap.c
+@@ -2181,6 +2181,9 @@ static int diNewExt(struct inomap * imap, struct iag * iagp, int extno)
+ /* get the ag and iag numbers for this iag.
+ */
+ agno = BLKTOAG(le64_to_cpu(iagp->agstart), sbi);
++ if (agno >= MAXAG || agno < 0)
++ return -EIO;
++
+ iagno = le32_to_cpu(iagp->iagnum);
+
+ /* check if this is the last free extent within the
+--
+2.43.0
+
--- /dev/null
+From 371e45c09fa6482fe421cf54441993181c197ba6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 25 Oct 2023 11:39:07 +0530
+Subject: jfs: fix slab-out-of-bounds Read in dtSearch
+
+From: Manas Ghandat <ghandatmanas@gmail.com>
+
+[ Upstream commit fa5492ee89463a7590a1449358002ff7ef63529f ]
+
+Currently while searching for current page in the sorted entry table
+of the page there is a out of bound access. Added a bound check to fix
+the error.
+
+Dave:
+Set return code to -EIO
+
+Reported-by: kernel test robot <lkp@intel.com>
+Reported-by: Dan Carpenter <dan.carpenter@linaro.org>
+Closes: https://lore.kernel.org/r/202310241724.Ed02yUz9-lkp@intel.com/
+Signed-off-by: Manas Ghandat <ghandatmanas@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dtree.c | 5 +++++
+ 1 file changed, 5 insertions(+)
+
+diff --git a/fs/jfs/jfs_dtree.c b/fs/jfs/jfs_dtree.c
+index fafcb90219cf..a222a9d71887 100644
+--- a/fs/jfs/jfs_dtree.c
++++ b/fs/jfs/jfs_dtree.c
+@@ -633,6 +633,11 @@ int dtSearch(struct inode *ip, struct component_name * key, ino_t * data,
+ for (base = 0, lim = p->header.nextindex; lim; lim >>= 1) {
+ index = base + (lim >> 1);
+
++ if (stbl[index] < 0) {
++ rc = -EIO;
++ goto out;
++ }
++
+ if (p->header.flag & BT_LEAF) {
+ /* uppercase leaf name to compare */
+ cmp =
+--
+2.43.0
+
--- /dev/null
+From e0b4add42d09720d1c544045e038565d6722ab2c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 31 Oct 2023 13:39:04 +0800
+Subject: jfs: fix uaf in jfs_evict_inode
+
+From: Edward Adam Davis <eadavis@qq.com>
+
+[ Upstream commit e0e1958f4c365e380b17ccb35617345b31ef7bf3 ]
+
+When the execution of diMount(ipimap) fails, the object ipimap that has been
+released may be accessed in diFreeSpecial(). Asynchronous ipimap release occurs
+when rcu_core() calls jfs_free_node().
+
+Therefore, when diMount(ipimap) fails, sbi->ipimap should not be initialized as
+ipimap.
+
+Reported-and-tested-by: syzbot+01cf2dbcbe2022454388@syzkaller.appspotmail.com
+Signed-off-by: Edward Adam Davis <eadavis@qq.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_mount.c | 6 +++---
+ 1 file changed, 3 insertions(+), 3 deletions(-)
+
+diff --git a/fs/jfs/jfs_mount.c b/fs/jfs/jfs_mount.c
+index aa4ff7bcaff2..55702b31ab3c 100644
+--- a/fs/jfs/jfs_mount.c
++++ b/fs/jfs/jfs_mount.c
+@@ -172,15 +172,15 @@ int jfs_mount(struct super_block *sb)
+ }
+ jfs_info("jfs_mount: ipimap:0x%p", ipimap);
+
+- /* map further access of per fileset inodes by the fileset inode */
+- sbi->ipimap = ipimap;
+-
+ /* initialize fileset inode allocation map */
+ if ((rc = diMount(ipimap))) {
+ jfs_err("jfs_mount: diMount failed w/rc = %d", rc);
+ goto err_ipimap;
+ }
+
++ /* map further access of per fileset inodes by the fileset inode */
++ sbi->ipimap = ipimap;
++
+ return rc;
+
+ /*
+--
+2.43.0
+
--- /dev/null
+From c28022224ade93104480c1946cbae4823fb39d93 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 18:56:00 +0100
+Subject: KVM: s390: fix setting of fpc register
+
+From: Heiko Carstens <hca@linux.ibm.com>
+
+[ Upstream commit b988b1bb0053c0dcd26187d29ef07566a565cf55 ]
+
+kvm_arch_vcpu_ioctl_set_fpu() allows to set the floating point control
+(fpc) register of a guest cpu. The new value is tested for validity by
+temporarily loading it into the fpc register.
+
+This may lead to corruption of the fpc register of the host process:
+if an interrupt happens while the value is temporarily loaded into the fpc
+register, and within interrupt context floating point or vector registers
+are used, the current fp/vx registers are saved with save_fpu_regs()
+assuming they belong to user space and will be loaded into fp/vx registers
+when returning to user space.
+
+test_fp_ctl() restores the original user space / host process fpc register
+value, however it will be discarded, when returning to user space.
+
+In result the host process will incorrectly continue to run with the value
+that was supposed to be used for a guest cpu.
+
+Fix this by simply removing the test. There is another test right before
+the SIE context is entered which will handles invalid values.
+
+This results in a change of behaviour: invalid values will now be accepted
+instead of that the ioctl fails with -EINVAL. This seems to be acceptable,
+given that this interface is most likely not used anymore, and this is in
+addition the same behaviour implemented with the memory mapped interface
+(replace invalid values with zero) - see sync_regs() in kvm-s390.c.
+
+Reviewed-by: Christian Borntraeger <borntraeger@linux.ibm.com>
+Reviewed-by: Claudio Imbrenda <imbrenda@linux.ibm.com>
+Signed-off-by: Heiko Carstens <hca@linux.ibm.com>
+Signed-off-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/s390/kvm/kvm-s390.c | 5 -----
+ 1 file changed, 5 deletions(-)
+
+diff --git a/arch/s390/kvm/kvm-s390.c b/arch/s390/kvm/kvm-s390.c
+index 7a326d03087a..f6c27b44766f 100644
+--- a/arch/s390/kvm/kvm-s390.c
++++ b/arch/s390/kvm/kvm-s390.c
+@@ -3649,10 +3649,6 @@ int kvm_arch_vcpu_ioctl_set_fpu(struct kvm_vcpu *vcpu, struct kvm_fpu *fpu)
+
+ vcpu_load(vcpu);
+
+- if (test_fp_ctl(fpu->fpc)) {
+- ret = -EINVAL;
+- goto out;
+- }
+ vcpu->run->s.regs.fpc = fpu->fpc;
+ if (MACHINE_HAS_VX)
+ convert_fp_to_vx((__vector128 *) vcpu->run->s.regs.vrs,
+@@ -3660,7 +3656,6 @@ int kvm_arch_vcpu_ioctl_set_fpu(struct kvm_vcpu *vcpu, struct kvm_fpu *fpu)
+ else
+ memcpy(vcpu->run->s.regs.fprs, &fpu->fprs, sizeof(fpu->fprs));
+
+-out:
+ vcpu_put(vcpu);
+ return ret;
+ }
+--
+2.43.0
+
--- /dev/null
+From b2eefa29bc93129e471a7e0069cce49711394a3e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 16 Dec 2023 21:05:33 +0100
+Subject: leds: trigger: panic: Don't register panic notifier if creating the
+ trigger failed
+
+From: Heiner Kallweit <hkallweit1@gmail.com>
+
+[ Upstream commit afacb21834bb02785ddb0c3ec197208803b74faa ]
+
+It doesn't make sense to register the panic notifier if creating the
+panic trigger failed.
+
+Signed-off-by: Heiner Kallweit <hkallweit1@gmail.com>
+Link: https://lore.kernel.org/r/8a61e229-5388-46c7-919a-4d18cc7362b2@gmail.com
+Signed-off-by: Lee Jones <lee@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/leds/trigger/ledtrig-panic.c | 5 ++++-
+ 1 file changed, 4 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/leds/trigger/ledtrig-panic.c b/drivers/leds/trigger/ledtrig-panic.c
+index 5751cd032f9d..4bf232465dfd 100644
+--- a/drivers/leds/trigger/ledtrig-panic.c
++++ b/drivers/leds/trigger/ledtrig-panic.c
+@@ -63,10 +63,13 @@ static long led_panic_blink(int state)
+
+ static int __init ledtrig_panic_init(void)
+ {
++ led_trigger_register_simple("panic", &trigger);
++ if (!trigger)
++ return -ENOMEM;
++
+ atomic_notifier_chain_register(&panic_notifier_list,
+ &led_trigger_panic_nb);
+
+- led_trigger_register_simple("panic", &trigger);
+ panic_blink = led_panic_blink;
+ return 0;
+ }
+--
+2.43.0
+
--- /dev/null
+From 8cced0065821117fbd6f203f7f0c47d8add550df Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Dec 2023 11:39:47 +0800
+Subject: libbpf: Fix NULL pointer dereference in
+ bpf_object__collect_prog_relos
+
+From: Mingyi Zhang <zhangmingyi5@huawei.com>
+
+[ Upstream commit fc3a5534e2a8855427403113cbeb54af5837bbe0 ]
+
+An issue occurred while reading an ELF file in libbpf.c during fuzzing:
+
+ Program received signal SIGSEGV, Segmentation fault.
+ 0x0000000000958e97 in bpf_object.collect_prog_relos () at libbpf.c:4206
+ 4206 in libbpf.c
+ (gdb) bt
+ #0 0x0000000000958e97 in bpf_object.collect_prog_relos () at libbpf.c:4206
+ #1 0x000000000094f9d6 in bpf_object.collect_relos () at libbpf.c:6706
+ #2 0x000000000092bef3 in bpf_object_open () at libbpf.c:7437
+ #3 0x000000000092c046 in bpf_object.open_mem () at libbpf.c:7497
+ #4 0x0000000000924afa in LLVMFuzzerTestOneInput () at fuzz/bpf-object-fuzzer.c:16
+ #5 0x000000000060be11 in testblitz_engine::fuzzer::Fuzzer::run_one ()
+ #6 0x000000000087ad92 in tracing::span::Span::in_scope ()
+ #7 0x00000000006078aa in testblitz_engine::fuzzer::util::walkdir ()
+ #8 0x00000000005f3217 in testblitz_engine::entrypoint::main::{{closure}} ()
+ #9 0x00000000005f2601 in main ()
+ (gdb)
+
+scn_data was null at this code(tools/lib/bpf/src/libbpf.c):
+
+ if (rel->r_offset % BPF_INSN_SZ || rel->r_offset >= scn_data->d_size) {
+
+The scn_data is derived from the code above:
+
+ scn = elf_sec_by_idx(obj, sec_idx);
+ scn_data = elf_sec_data(obj, scn);
+
+ relo_sec_name = elf_sec_str(obj, shdr->sh_name);
+ sec_name = elf_sec_name(obj, scn);
+ if (!relo_sec_name || !sec_name)// don't check whether scn_data is NULL
+ return -EINVAL;
+
+In certain special scenarios, such as reading a malformed ELF file,
+it is possible that scn_data may be a null pointer
+
+Signed-off-by: Mingyi Zhang <zhangmingyi5@huawei.com>
+Signed-off-by: Xin Liu <liuxin350@huawei.com>
+Signed-off-by: Changye Wu <wuchangye@huawei.com>
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Signed-off-by: Daniel Borkmann <daniel@iogearbox.net>
+Acked-by: Daniel Borkmann <daniel@iogearbox.net>
+Link: https://lore.kernel.org/bpf/20231221033947.154564-1-liuxin350@huawei.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/lib/bpf/libbpf.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/tools/lib/bpf/libbpf.c b/tools/lib/bpf/libbpf.c
+index 015ed8253f73..0cbb1b43065f 100644
+--- a/tools/lib/bpf/libbpf.c
++++ b/tools/lib/bpf/libbpf.c
+@@ -3514,6 +3514,8 @@ bpf_object__collect_prog_relos(struct bpf_object *obj, GElf_Shdr *shdr, Elf_Data
+ __u32 insn_idx;
+ GElf_Sym sym;
+ GElf_Rel rel;
++ if (!scn_data)
++ return -LIBBPF_ERRNO__FORMAT;
+
+ relo_sec_name = elf_sec_str(obj, shdr->sh_name);
+ sec_name = elf_sec_name(obj, elf_sec_by_idx(obj, sec_idx));
+--
+2.43.0
+
--- /dev/null
+From c99e765e6df250a1c27d2a6631c3547422883539 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 7 Dec 2023 16:05:13 -0800
+Subject: libsubcmd: Fix memory leak in uniq()
+
+From: Ian Rogers <irogers@google.com>
+
+[ Upstream commit ad30469a841b50dbb541df4d6971d891f703c297 ]
+
+uniq() will write one command name over another causing the overwritten
+string to be leaked. Fix by doing a pass that removes duplicates and a
+second that removes the holes.
+
+Signed-off-by: Ian Rogers <irogers@google.com>
+Cc: Adrian Hunter <adrian.hunter@intel.com>
+Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
+Cc: Chenyuan Mi <cymi20@fudan.edu.cn>
+Cc: Ingo Molnar <mingo@redhat.com>
+Cc: Jiri Olsa <jolsa@kernel.org>
+Cc: Mark Rutland <mark.rutland@arm.com>
+Cc: Namhyung Kim <namhyung@kernel.org>
+Cc: Peter Zijlstra <peterz@infradead.org>
+Link: https://lore.kernel.org/r/20231208000515.1693746-1-irogers@google.com
+Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/lib/subcmd/help.c | 18 ++++++++++++++----
+ 1 file changed, 14 insertions(+), 4 deletions(-)
+
+diff --git a/tools/lib/subcmd/help.c b/tools/lib/subcmd/help.c
+index bf02d62a3b2b..42f57b640f11 100644
+--- a/tools/lib/subcmd/help.c
++++ b/tools/lib/subcmd/help.c
+@@ -50,11 +50,21 @@ void uniq(struct cmdnames *cmds)
+ if (!cmds->cnt)
+ return;
+
+- for (i = j = 1; i < cmds->cnt; i++)
+- if (strcmp(cmds->names[i]->name, cmds->names[i-1]->name))
+- cmds->names[j++] = cmds->names[i];
+-
++ for (i = 1; i < cmds->cnt; i++) {
++ if (!strcmp(cmds->names[i]->name, cmds->names[i-1]->name))
++ zfree(&cmds->names[i - 1]);
++ }
++ for (i = 0, j = 0; i < cmds->cnt; i++) {
++ if (cmds->names[i]) {
++ if (i == j)
++ j++;
++ else
++ cmds->names[j++] = cmds->names[i];
++ }
++ }
+ cmds->cnt = j;
++ while (j < i)
++ cmds->names[j++] = NULL;
+ }
+
+ void exclude_cmds(struct cmdnames *cmds, struct cmdnames *excludes)
+--
+2.43.0
+
--- /dev/null
+From 3369f553ae8bf6ac8e79542124e1ecd3dc25099b Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 13 Dec 2023 14:24:31 +0200
+Subject: md: Whenassemble the array, consult the superblock of the freshest
+ device
+
+From: Alex Lyakas <alex.lyakas@zadara.com>
+
+[ Upstream commit dc1cc22ed58f11d58d8553c5ec5f11cbfc3e3039 ]
+
+Upon assembling the array, both kernel and mdadm allow the devices to have event
+counter difference of 1, and still consider them as up-to-date.
+However, a device whose event count is behind by 1, may in fact not be up-to-date,
+and array resync with such a device may cause data corruption.
+To avoid this, consult the superblock of the freshest device about the status
+of a device, whose event counter is behind by 1.
+
+Signed-off-by: Alex Lyakas <alex.lyakas@zadara.com>
+Signed-off-by: Song Liu <song@kernel.org>
+Link: https://lore.kernel.org/r/1702470271-16073-1-git-send-email-alex.lyakas@zadara.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/md/md.c | 54 ++++++++++++++++++++++++++++++++++++++++---------
+ 1 file changed, 44 insertions(+), 10 deletions(-)
+
+diff --git a/drivers/md/md.c b/drivers/md/md.c
+index 6efe49f7bdf5..03d2e31dda2f 100644
+--- a/drivers/md/md.c
++++ b/drivers/md/md.c
+@@ -1179,6 +1179,7 @@ struct super_type {
+ struct md_rdev *refdev,
+ int minor_version);
+ int (*validate_super)(struct mddev *mddev,
++ struct md_rdev *freshest,
+ struct md_rdev *rdev);
+ void (*sync_super)(struct mddev *mddev,
+ struct md_rdev *rdev);
+@@ -1317,8 +1318,9 @@ static int super_90_load(struct md_rdev *rdev, struct md_rdev *refdev, int minor
+
+ /*
+ * validate_super for 0.90.0
++ * note: we are not using "freshest" for 0.9 superblock
+ */
+-static int super_90_validate(struct mddev *mddev, struct md_rdev *rdev)
++static int super_90_validate(struct mddev *mddev, struct md_rdev *freshest, struct md_rdev *rdev)
+ {
+ mdp_disk_t *desc;
+ mdp_super_t *sb = page_address(rdev->sb_page);
+@@ -1833,7 +1835,7 @@ static int super_1_load(struct md_rdev *rdev, struct md_rdev *refdev, int minor_
+ return ret;
+ }
+
+-static int super_1_validate(struct mddev *mddev, struct md_rdev *rdev)
++static int super_1_validate(struct mddev *mddev, struct md_rdev *freshest, struct md_rdev *rdev)
+ {
+ struct mdp_superblock_1 *sb = page_address(rdev->sb_page);
+ __u64 ev1 = le64_to_cpu(sb->events);
+@@ -1929,13 +1931,15 @@ static int super_1_validate(struct mddev *mddev, struct md_rdev *rdev)
+ }
+ } else if (mddev->pers == NULL) {
+ /* Insist of good event counter while assembling, except for
+- * spares (which don't need an event count) */
+- ++ev1;
++ * spares (which don't need an event count).
++ * Similar to mdadm, we allow event counter difference of 1
++ * from the freshest device.
++ */
+ if (rdev->desc_nr >= 0 &&
+ rdev->desc_nr < le32_to_cpu(sb->max_dev) &&
+ (le16_to_cpu(sb->dev_roles[rdev->desc_nr]) < MD_DISK_ROLE_MAX ||
+ le16_to_cpu(sb->dev_roles[rdev->desc_nr]) == MD_DISK_ROLE_JOURNAL))
+- if (ev1 < mddev->events)
++ if (ev1 + 1 < mddev->events)
+ return -EINVAL;
+ } else if (mddev->bitmap) {
+ /* If adding to array with a bitmap, then we can accept an
+@@ -1956,8 +1960,38 @@ static int super_1_validate(struct mddev *mddev, struct md_rdev *rdev)
+ rdev->desc_nr >= le32_to_cpu(sb->max_dev)) {
+ role = MD_DISK_ROLE_SPARE;
+ rdev->desc_nr = -1;
+- } else
++ } else if (mddev->pers == NULL && freshest && ev1 < mddev->events) {
++ /*
++ * If we are assembling, and our event counter is smaller than the
++ * highest event counter, we cannot trust our superblock about the role.
++ * It could happen that our rdev was marked as Faulty, and all other
++ * superblocks were updated with +1 event counter.
++ * Then, before the next superblock update, which typically happens when
++ * remove_and_add_spares() removes the device from the array, there was
++ * a crash or reboot.
++ * If we allow current rdev without consulting the freshest superblock,
++ * we could cause data corruption.
++ * Note that in this case our event counter is smaller by 1 than the
++ * highest, otherwise, this rdev would not be allowed into array;
++ * both kernel and mdadm allow event counter difference of 1.
++ */
++ struct mdp_superblock_1 *freshest_sb = page_address(freshest->sb_page);
++ u32 freshest_max_dev = le32_to_cpu(freshest_sb->max_dev);
++
++ if (rdev->desc_nr >= freshest_max_dev) {
++ /* this is unexpected, better not proceed */
++ pr_warn("md: %s: rdev[%pg]: desc_nr(%d) >= freshest(%pg)->sb->max_dev(%u)\n",
++ mdname(mddev), rdev->bdev, rdev->desc_nr,
++ freshest->bdev, freshest_max_dev);
++ return -EUCLEAN;
++ }
++
++ role = le16_to_cpu(freshest_sb->dev_roles[rdev->desc_nr]);
++ pr_debug("md: %s: rdev[%pg]: role=%d(0x%x) according to freshest %pg\n",
++ mdname(mddev), rdev->bdev, role, role, freshest->bdev);
++ } else {
+ role = le16_to_cpu(sb->dev_roles[rdev->desc_nr]);
++ }
+ switch(role) {
+ case MD_DISK_ROLE_SPARE: /* spare */
+ break;
+@@ -2896,7 +2930,7 @@ static int add_bound_rdev(struct md_rdev *rdev)
+ * and should be added immediately.
+ */
+ super_types[mddev->major_version].
+- validate_super(mddev, rdev);
++ validate_super(mddev, NULL/*freshest*/, rdev);
+ if (add_journal)
+ mddev_suspend(mddev);
+ err = mddev->pers->hot_add_disk(mddev, rdev);
+@@ -3814,7 +3848,7 @@ static int analyze_sbs(struct mddev *mddev)
+ }
+
+ super_types[mddev->major_version].
+- validate_super(mddev, freshest);
++ validate_super(mddev, NULL/*freshest*/, freshest);
+
+ i = 0;
+ rdev_for_each_safe(rdev, tmp, mddev) {
+@@ -3829,7 +3863,7 @@ static int analyze_sbs(struct mddev *mddev)
+ }
+ if (rdev != freshest) {
+ if (super_types[mddev->major_version].
+- validate_super(mddev, rdev)) {
++ validate_super(mddev, freshest, rdev)) {
+ pr_warn("md: kicking non-fresh %s from array!\n",
+ bdevname(rdev->bdev,b));
+ md_kick_rdev_from_array(rdev);
+@@ -6817,7 +6851,7 @@ int md_add_new_disk(struct mddev *mddev, struct mdu_disk_info_s *info)
+ rdev->saved_raid_disk = rdev->raid_disk;
+ } else
+ super_types[mddev->major_version].
+- validate_super(mddev, rdev);
++ validate_super(mddev, NULL/*freshest*/, rdev);
+ if ((info->state & (1<<MD_DISK_SYNC)) &&
+ rdev->raid_disk != info->raid_disk) {
+ /* This was a hot-add request, but events doesn't
+--
+2.43.0
+
--- /dev/null
+From 282c8bb85021b4f7424cd16d2bd3938876356cf1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 20 Oct 2023 17:17:23 +0800
+Subject: media: ddbridge: fix an error code problem in ddb_probe
+
+From: Su Hui <suhui@nfschina.com>
+
+[ Upstream commit 09b4195021be69af1e1936cca995712a6d0f2562 ]
+
+Error code is assigned to 'stat', return 'stat' rather than '-1'.
+
+Signed-off-by: Su Hui <suhui@nfschina.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/pci/ddbridge/ddbridge-main.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/media/pci/ddbridge/ddbridge-main.c b/drivers/media/pci/ddbridge/ddbridge-main.c
+index 03dc9924fa2c..bb7fb6402d6e 100644
+--- a/drivers/media/pci/ddbridge/ddbridge-main.c
++++ b/drivers/media/pci/ddbridge/ddbridge-main.c
+@@ -247,7 +247,7 @@ static int ddb_probe(struct pci_dev *pdev,
+ ddb_unmap(dev);
+ pci_set_drvdata(pdev, NULL);
+ pci_disable_device(pdev);
+- return -1;
++ return stat;
+ }
+
+ /****************************************************************************/
+--
+2.43.0
+
--- /dev/null
+From 77b48efe551f1385bb9522ed8a07925b121d82f5 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 13 Oct 2023 13:00:22 +0200
+Subject: media: rockchip: rga: fix swizzling for RGB formats
+
+From: Michael Tretter <m.tretter@pengutronix.de>
+
+[ Upstream commit 9e7dc39260edac180c206bb6149595a40eabae3e ]
+
+When using 32 bit RGB formats, the RGA on the rk3568 produces wrong
+colors as the wrong color channels are read or written. The reason is
+that the format description for the channel swizzeling is wrong and the
+wrong bits are configured. For example, when converting ARGB32 to NV12,
+the alpha channel is used as blue channel.. This doesn't happen if the
+color format is the same on both sides.
+
+Fix the color_swap settings of the formats to correctly handle 32 bit
+RGB formats.
+
+For RGA_COLOR_FMT_XBGR8888, the RGA_COLOR_ALPHA_SWAP bit doesn't have an
+effect. Thus, it isn't possible to handle the V4L2_PIX_FMT_XRGB32. Thus,
+it is removed from the list of supported formats.
+
+Signed-off-by: Michael Tretter <m.tretter@pengutronix.de>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/platform/rockchip/rga/rga.c | 15 +++------------
+ 1 file changed, 3 insertions(+), 12 deletions(-)
+
+diff --git a/drivers/media/platform/rockchip/rga/rga.c b/drivers/media/platform/rockchip/rga/rga.c
+index e3246344fb72..bcbbd1408b36 100644
+--- a/drivers/media/platform/rockchip/rga/rga.c
++++ b/drivers/media/platform/rockchip/rga/rga.c
+@@ -187,25 +187,16 @@ static int rga_setup_ctrls(struct rga_ctx *ctx)
+ static struct rga_fmt formats[] = {
+ {
+ .fourcc = V4L2_PIX_FMT_ARGB32,
+- .color_swap = RGA_COLOR_RB_SWAP,
++ .color_swap = RGA_COLOR_ALPHA_SWAP,
+ .hw_format = RGA_COLOR_FMT_ABGR8888,
+ .depth = 32,
+ .uv_factor = 1,
+ .y_div = 1,
+ .x_div = 1,
+ },
+- {
+- .fourcc = V4L2_PIX_FMT_XRGB32,
+- .color_swap = RGA_COLOR_RB_SWAP,
+- .hw_format = RGA_COLOR_FMT_XBGR8888,
+- .depth = 32,
+- .uv_factor = 1,
+- .y_div = 1,
+- .x_div = 1,
+- },
+ {
+ .fourcc = V4L2_PIX_FMT_ABGR32,
+- .color_swap = RGA_COLOR_ALPHA_SWAP,
++ .color_swap = RGA_COLOR_RB_SWAP,
+ .hw_format = RGA_COLOR_FMT_ABGR8888,
+ .depth = 32,
+ .uv_factor = 1,
+@@ -214,7 +205,7 @@ static struct rga_fmt formats[] = {
+ },
+ {
+ .fourcc = V4L2_PIX_FMT_XBGR32,
+- .color_swap = RGA_COLOR_ALPHA_SWAP,
++ .color_swap = RGA_COLOR_RB_SWAP,
+ .hw_format = RGA_COLOR_FMT_XBGR8888,
+ .depth = 32,
+ .uv_factor = 1,
+--
+2.43.0
+
--- /dev/null
+From 3538a2728d09316690bea3bb646e8c209648acf2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 14:32:36 +0530
+Subject: media: stk1160: Fixed high volume of stk1160_dbg messages
+
+From: Ghanshyam Agrawal <ghanshyam1898@gmail.com>
+
+[ Upstream commit b3695e86d25aafbe175dd51f6aaf6f68d341d590 ]
+
+The function stk1160_dbg gets called too many times, which causes
+the output to get flooded with messages. Since stk1160_dbg uses
+printk, it is now replaced with printk_ratelimited.
+
+Suggested-by: Phillip Potter <phil@philpotter.co.uk>
+Signed-off-by: Ghanshyam Agrawal <ghanshyam1898@gmail.com>
+Signed-off-by: Hans Verkuil <hverkuil-cisco@xs4all.nl>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/media/usb/stk1160/stk1160-video.c | 5 ++---
+ 1 file changed, 2 insertions(+), 3 deletions(-)
+
+diff --git a/drivers/media/usb/stk1160/stk1160-video.c b/drivers/media/usb/stk1160/stk1160-video.c
+index 202b084f65a2..4cf540d1b250 100644
+--- a/drivers/media/usb/stk1160/stk1160-video.c
++++ b/drivers/media/usb/stk1160/stk1160-video.c
+@@ -107,8 +107,7 @@ void stk1160_copy_video(struct stk1160 *dev, u8 *src, int len)
+
+ /*
+ * TODO: These stk1160_dbg are very spammy!
+- * We should 1) check why we are getting them
+- * and 2) add ratelimit.
++ * We should check why we are getting them.
+ *
+ * UPDATE: One of the reasons (the only one?) for getting these
+ * is incorrect standard (mismatch between expected and configured).
+@@ -151,7 +150,7 @@ void stk1160_copy_video(struct stk1160 *dev, u8 *src, int len)
+
+ /* Let the bug hunt begin! sanity checks! */
+ if (lencopy < 0) {
+- stk1160_dbg("copy skipped: negative lencopy\n");
++ printk_ratelimited(KERN_DEBUG "copy skipped: negative lencopy\n");
+ return;
+ }
+
+--
+2.43.0
+
--- /dev/null
+From a7a7a96bbbabb422c8fee34d1f700f72d3240007 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 20 Dec 2023 15:56:39 +0000
+Subject: mfd: ti_am335x_tscadc: Fix TI SoC dependencies
+
+From: Peter Robinson <pbrobinson@gmail.com>
+
+[ Upstream commit 284d16c456e5d4b143f375b8ccc4038ab3f4ee0f ]
+
+The ti_am335x_tscadc is specific to some TI SoCs, update
+the dependencies for those SoCs and compile testing.
+
+Signed-off-by: Peter Robinson <pbrobinson@gmail.com>
+Link: https://lore.kernel.org/r/20231220155643.445849-1-pbrobinson@gmail.com
+Signed-off-by: Lee Jones <lee@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/mfd/Kconfig | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/mfd/Kconfig b/drivers/mfd/Kconfig
+index b8847ae04d93..c5c6608ccc84 100644
+--- a/drivers/mfd/Kconfig
++++ b/drivers/mfd/Kconfig
+@@ -1382,6 +1382,7 @@ config MFD_DAVINCI_VOICECODEC
+
+ config MFD_TI_AM335X_TSCADC
+ tristate "TI ADC / Touch Screen chip support"
++ depends on ARCH_OMAP2PLUS || ARCH_K3 || COMPILE_TEST
+ select MFD_CORE
+ select REGMAP
+ select REGMAP_MMIO
+--
+2.43.0
+
--- /dev/null
+From 1726aaef9a92ea90ffdf3087d9b6682eed7ab44c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 24 Dec 2023 19:34:02 +0100
+Subject: misc: lis3lv02d_i2c: Add missing setting of the reg_ctrl callback
+
+From: Hans de Goede <hdegoede@redhat.com>
+
+[ Upstream commit b1b9f7a494400c0c39f8cd83de3aaa6111c55087 ]
+
+The lis3lv02d_i2c driver was missing a line to set the lis3_dev's
+reg_ctrl callback.
+
+lis3_reg_ctrl(on) is called from the init callback, but due to
+the missing reg_ctrl callback the regulators where never turned off
+again leading to the following oops/backtrace when detaching the driver:
+
+[ 82.313527] ------------[ cut here ]------------
+[ 82.313546] WARNING: CPU: 1 PID: 1724 at drivers/regulator/core.c:2396 _regulator_put+0x219/0x230
+...
+[ 82.313695] RIP: 0010:_regulator_put+0x219/0x230
+...
+[ 82.314767] Call Trace:
+[ 82.314770] <TASK>
+[ 82.314772] ? _regulator_put+0x219/0x230
+[ 82.314777] ? __warn+0x81/0x170
+[ 82.314784] ? _regulator_put+0x219/0x230
+[ 82.314791] ? report_bug+0x18d/0x1c0
+[ 82.314801] ? handle_bug+0x3c/0x80
+[ 82.314806] ? exc_invalid_op+0x13/0x60
+[ 82.314812] ? asm_exc_invalid_op+0x16/0x20
+[ 82.314845] ? _regulator_put+0x219/0x230
+[ 82.314857] regulator_bulk_free+0x39/0x60
+[ 82.314865] i2c_device_remove+0x22/0xb0
+
+Add the missing setting of the callback so that the regulators
+properly get turned off again when not used.
+
+Signed-off-by: Hans de Goede <hdegoede@redhat.com>
+Link: https://lore.kernel.org/r/20231224183402.95640-1-hdegoede@redhat.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/misc/lis3lv02d/lis3lv02d_i2c.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/misc/lis3lv02d/lis3lv02d_i2c.c b/drivers/misc/lis3lv02d/lis3lv02d_i2c.c
+index 52555d2e824b..ab1db760ba4e 100644
+--- a/drivers/misc/lis3lv02d/lis3lv02d_i2c.c
++++ b/drivers/misc/lis3lv02d/lis3lv02d_i2c.c
+@@ -151,6 +151,7 @@ static int lis3lv02d_i2c_probe(struct i2c_client *client,
+ lis3_dev.init = lis3_i2c_init;
+ lis3_dev.read = lis3_i2c_read;
+ lis3_dev.write = lis3_i2c_write;
++ lis3_dev.reg_ctrl = lis3_reg_ctrl;
+ lis3_dev.irq = client->irq;
+ lis3_dev.ac = lis3lv02d_axis_map;
+ lis3_dev.pm_dev = &client->dev;
+--
+2.43.0
+
--- /dev/null
+From 37066a683da0acc1867f90f57a588e3b03996b05 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 14 Dec 2023 14:50:24 +0100
+Subject: net: dsa: mv88e6xxx: Fix mv88e6352_serdes_get_stats error path
+
+From: Tobias Waldekranz <tobias@waldekranz.com>
+
+[ Upstream commit fc82a08ae795ee6b73fb6b50785f7be248bec7b5 ]
+
+mv88e6xxx_get_stats, which collects stats from various sources,
+expects all callees to return the number of stats read. If an error
+occurs, 0 should be returned.
+
+Prevent future mishaps of this kind by updating the return type to
+reflect this contract.
+
+Reviewed-by: Vladimir Oltean <vladimir.oltean@nxp.com>
+Reviewed-by: Florian Fainelli <florian.fainelli@broadcom.com>
+Signed-off-by: Tobias Waldekranz <tobias@waldekranz.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/dsa/mv88e6xxx/chip.h | 4 ++--
+ drivers/net/dsa/mv88e6xxx/serdes.c | 8 ++++----
+ drivers/net/dsa/mv88e6xxx/serdes.h | 8 ++++----
+ 3 files changed, 10 insertions(+), 10 deletions(-)
+
+diff --git a/drivers/net/dsa/mv88e6xxx/chip.h b/drivers/net/dsa/mv88e6xxx/chip.h
+index 51a7ff44478e..67e52c481504 100644
+--- a/drivers/net/dsa/mv88e6xxx/chip.h
++++ b/drivers/net/dsa/mv88e6xxx/chip.h
+@@ -536,8 +536,8 @@ struct mv88e6xxx_ops {
+ int (*serdes_get_sset_count)(struct mv88e6xxx_chip *chip, int port);
+ int (*serdes_get_strings)(struct mv88e6xxx_chip *chip, int port,
+ uint8_t *data);
+- int (*serdes_get_stats)(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data);
++ size_t (*serdes_get_stats)(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data);
+
+ /* SERDES registers for ethtool */
+ int (*serdes_get_regs_len)(struct mv88e6xxx_chip *chip, int port);
+diff --git a/drivers/net/dsa/mv88e6xxx/serdes.c b/drivers/net/dsa/mv88e6xxx/serdes.c
+index 6920e62c864d..9494d75eec62 100644
+--- a/drivers/net/dsa/mv88e6xxx/serdes.c
++++ b/drivers/net/dsa/mv88e6xxx/serdes.c
+@@ -314,8 +314,8 @@ static uint64_t mv88e6352_serdes_get_stat(struct mv88e6xxx_chip *chip,
+ return val;
+ }
+
+-int mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data)
++size_t mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data)
+ {
+ struct mv88e6xxx_port *mv88e6xxx_port = &chip->ports[port];
+ struct mv88e6352_serdes_hw_stat *stat;
+@@ -631,8 +631,8 @@ static uint64_t mv88e6390_serdes_get_stat(struct mv88e6xxx_chip *chip, int lane,
+ return reg[0] | ((u64)reg[1] << 16) | ((u64)reg[2] << 32);
+ }
+
+-int mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data)
++size_t mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data)
+ {
+ struct mv88e6390_serdes_hw_stat *stat;
+ int lane;
+diff --git a/drivers/net/dsa/mv88e6xxx/serdes.h b/drivers/net/dsa/mv88e6xxx/serdes.h
+index 14315f26228a..035688659b50 100644
+--- a/drivers/net/dsa/mv88e6xxx/serdes.h
++++ b/drivers/net/dsa/mv88e6xxx/serdes.h
+@@ -116,13 +116,13 @@ irqreturn_t mv88e6390_serdes_irq_status(struct mv88e6xxx_chip *chip, int port,
+ int mv88e6352_serdes_get_sset_count(struct mv88e6xxx_chip *chip, int port);
+ int mv88e6352_serdes_get_strings(struct mv88e6xxx_chip *chip,
+ int port, uint8_t *data);
+-int mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data);
++size_t mv88e6352_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data);
+ int mv88e6390_serdes_get_sset_count(struct mv88e6xxx_chip *chip, int port);
+ int mv88e6390_serdes_get_strings(struct mv88e6xxx_chip *chip,
+ int port, uint8_t *data);
+-int mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
+- uint64_t *data);
++size_t mv88e6390_serdes_get_stats(struct mv88e6xxx_chip *chip, int port,
++ uint64_t *data);
+
+ int mv88e6352_serdes_get_regs_len(struct mv88e6xxx_chip *chip, int port);
+ void mv88e6352_serdes_get_regs(struct mv88e6xxx_chip *chip, int port, void *_p);
+--
+2.43.0
+
--- /dev/null
+From 6c1cb4db1450d5c1be6016b7940624d0b52618a4 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 11:08:10 +0100
+Subject: net: mvmdio: Avoid excessive sleeps in polled mode
+
+From: Tobias Waldekranz <tobias@waldekranz.com>
+
+[ Upstream commit 7dd12fe34686d89c332b1a05104d18d728591f0a ]
+
+Before this change, when operating in polled mode, i.e. no IRQ is
+available, every individual C45 access would be hit with a 150us sleep
+after the bus access.
+
+For example, on a board with a CN9130 SoC connected to an MV88X3310
+PHY, a single C45 read would take around 165us:
+
+ root@infix:~$ mdio f212a600.mdio-mii mmd 4:1 bench 0xc003
+ Performed 1000 reads in 165ms
+
+By replacing the long sleep with a tighter poll loop, we observe a 10x
+increase in bus throughput:
+
+ root@infix:~$ mdio f212a600.mdio-mii mmd 4:1 bench 0xc003
+ Performed 1000 reads in 15ms
+
+Signed-off-by: Tobias Waldekranz <tobias@waldekranz.com>
+Reviewed-by: Andrew Lunn <andrew@lunn.ch>
+Tested-by: Andrew Lunn <andrew@lunn.ch>
+Link: https://lore.kernel.org/r/20231204100811.2708884-3-tobias@waldekranz.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/ethernet/marvell/mvmdio.c | 53 ++++++++-------------------
+ 1 file changed, 16 insertions(+), 37 deletions(-)
+
+diff --git a/drivers/net/ethernet/marvell/mvmdio.c b/drivers/net/ethernet/marvell/mvmdio.c
+index d14762d93640..28967a7b8df2 100644
+--- a/drivers/net/ethernet/marvell/mvmdio.c
++++ b/drivers/net/ethernet/marvell/mvmdio.c
+@@ -21,6 +21,7 @@
+ #include <linux/delay.h>
+ #include <linux/interrupt.h>
+ #include <linux/io.h>
++#include <linux/iopoll.h>
+ #include <linux/kernel.h>
+ #include <linux/module.h>
+ #include <linux/of_device.h>
+@@ -56,11 +57,6 @@
+ * - Armada 370 (Globalscale Mirabox): 41us to 43us (Polled)
+ */
+ #define MVMDIO_SMI_TIMEOUT 1000 /* 1000us = 1ms */
+-#define MVMDIO_SMI_POLL_INTERVAL_MIN 45
+-#define MVMDIO_SMI_POLL_INTERVAL_MAX 55
+-
+-#define MVMDIO_XSMI_POLL_INTERVAL_MIN 150
+-#define MVMDIO_XSMI_POLL_INTERVAL_MAX 160
+
+ struct orion_mdio_dev {
+ void __iomem *regs;
+@@ -82,8 +78,6 @@ enum orion_mdio_bus_type {
+
+ struct orion_mdio_ops {
+ int (*is_done)(struct orion_mdio_dev *);
+- unsigned int poll_interval_min;
+- unsigned int poll_interval_max;
+ };
+
+ /* Wait for the SMI unit to be ready for another operation
+@@ -92,34 +86,23 @@ static int orion_mdio_wait_ready(const struct orion_mdio_ops *ops,
+ struct mii_bus *bus)
+ {
+ struct orion_mdio_dev *dev = bus->priv;
+- unsigned long timeout = usecs_to_jiffies(MVMDIO_SMI_TIMEOUT);
+- unsigned long end = jiffies + timeout;
+- int timedout = 0;
++ unsigned long timeout;
++ int done;
+
+- while (1) {
+- if (ops->is_done(dev))
++ if (dev->err_interrupt <= 0) {
++ if (!read_poll_timeout_atomic(ops->is_done, done, done, 2,
++ MVMDIO_SMI_TIMEOUT, false, dev))
++ return 0;
++ } else {
++ /* wait_event_timeout does not guarantee a delay of at
++ * least one whole jiffie, so timeout must be no less
++ * than two.
++ */
++ timeout = max(usecs_to_jiffies(MVMDIO_SMI_TIMEOUT), 2);
++
++ if (wait_event_timeout(dev->smi_busy_wait,
++ ops->is_done(dev), timeout))
+ return 0;
+- else if (timedout)
+- break;
+-
+- if (dev->err_interrupt <= 0) {
+- usleep_range(ops->poll_interval_min,
+- ops->poll_interval_max);
+-
+- if (time_is_before_jiffies(end))
+- ++timedout;
+- } else {
+- /* wait_event_timeout does not guarantee a delay of at
+- * least one whole jiffie, so timeout must be no less
+- * than two.
+- */
+- if (timeout < 2)
+- timeout = 2;
+- wait_event_timeout(dev->smi_busy_wait,
+- ops->is_done(dev), timeout);
+-
+- ++timedout;
+- }
+ }
+
+ dev_err(bus->parent, "Timeout: SMI busy for too long\n");
+@@ -133,8 +116,6 @@ static int orion_mdio_smi_is_done(struct orion_mdio_dev *dev)
+
+ static const struct orion_mdio_ops orion_mdio_smi_ops = {
+ .is_done = orion_mdio_smi_is_done,
+- .poll_interval_min = MVMDIO_SMI_POLL_INTERVAL_MIN,
+- .poll_interval_max = MVMDIO_SMI_POLL_INTERVAL_MAX,
+ };
+
+ static int orion_mdio_smi_read(struct mii_bus *bus, int mii_id,
+@@ -198,8 +179,6 @@ static int orion_mdio_xsmi_is_done(struct orion_mdio_dev *dev)
+
+ static const struct orion_mdio_ops orion_mdio_xsmi_ops = {
+ .is_done = orion_mdio_xsmi_is_done,
+- .poll_interval_min = MVMDIO_XSMI_POLL_INTERVAL_MIN,
+- .poll_interval_max = MVMDIO_XSMI_POLL_INTERVAL_MAX,
+ };
+
+ static int orion_mdio_xsmi_read(struct mii_bus *bus, int mii_id,
+--
+2.43.0
+
--- /dev/null
+From 556231b29b53a673fc708728c1af15e35281e573 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 15:27:06 -0600
+Subject: PCI: add INTEL_HDA_ARL to pci_ids.h
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+
+[ Upstream commit 5ec42bf04d72fd6d0a6855810cc779e0ee31dfd7 ]
+
+The PCI ID insertion follows the increasing order in the table, but
+this hardware follows MTL (MeteorLake).
+
+Signed-off-by: Pierre-Louis Bossart <pierre-louis.bossart@linux.intel.com>
+Reviewed-by: Péter Ujfalusi <peter.ujfalusi@linux.intel.com>
+Reviewed-by: Kai Vehmanen <kai.vehmanen@linux.intel.com>
+Acked-by: Mark Brown <broonie@kernel.org>
+Link: https://lore.kernel.org/r/20231204212710.185976-2-pierre-louis.bossart@linux.intel.com
+Signed-off-by: Takashi Iwai <tiwai@suse.de>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ include/linux/pci_ids.h | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/include/linux/pci_ids.h b/include/linux/pci_ids.h
+index 1a41147b22e8..80744a7b5e33 100644
+--- a/include/linux/pci_ids.h
++++ b/include/linux/pci_ids.h
+@@ -3020,6 +3020,7 @@
+ #define PCI_DEVICE_ID_INTEL_82443GX_0 0x71a0
+ #define PCI_DEVICE_ID_INTEL_82443GX_2 0x71a2
+ #define PCI_DEVICE_ID_INTEL_82372FB_1 0x7601
++#define PCI_DEVICE_ID_INTEL_HDA_ARL 0x7728
+ #define PCI_DEVICE_ID_INTEL_SCH_LPC 0x8119
+ #define PCI_DEVICE_ID_INTEL_SCH_IDE 0x811a
+ #define PCI_DEVICE_ID_INTEL_E6XX_CU 0x8183
+--
+2.43.0
+
--- /dev/null
+From b2f4b1a01c811f4faa815d891d7b631043f95215 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 15 Nov 2023 13:17:16 +0100
+Subject: PCI: Add no PM reset quirk for NVIDIA Spectrum devices
+
+From: Ido Schimmel <idosch@nvidia.com>
+
+[ Upstream commit 3ed48c80b28d8dcd584d6ddaf00c75b7673e1a05 ]
+
+Spectrum-{1,2,3,4} devices report that a D3hot->D0 transition causes a
+reset (i.e., they advertise NoSoftRst-). However, this transition does
+not have any effect on the device: It continues to be operational and
+network ports remain up. Advertising this support makes it seem as if a
+PM reset is viable for these devices. Mark it as unavailable to skip it
+when testing reset methods.
+
+Before:
+
+ # cat /sys/bus/pci/devices/0000\:03\:00.0/reset_method
+ pm bus
+
+After:
+
+ # cat /sys/bus/pci/devices/0000\:03\:00.0/reset_method
+ bus
+
+Signed-off-by: Ido Schimmel <idosch@nvidia.com>
+Acked-by: Bjorn Helgaas <bhelgaas@google.com>
+Signed-off-by: Petr Machata <petrm@nvidia.com>
+Signed-off-by: David S. Miller <davem@davemloft.net>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/quirks.c | 13 +++++++++++++
+ 1 file changed, 13 insertions(+)
+
+diff --git a/drivers/pci/quirks.c b/drivers/pci/quirks.c
+index 21661feeeeb6..03a30734cdc6 100644
+--- a/drivers/pci/quirks.c
++++ b/drivers/pci/quirks.c
+@@ -3638,6 +3638,19 @@ static void quirk_no_pm_reset(struct pci_dev *dev)
+ DECLARE_PCI_FIXUP_CLASS_HEADER(PCI_VENDOR_ID_ATI, PCI_ANY_ID,
+ PCI_CLASS_DISPLAY_VGA, 8, quirk_no_pm_reset);
+
++/*
++ * Spectrum-{1,2,3,4} devices report that a D3hot->D0 transition causes a reset
++ * (i.e., they advertise NoSoftRst-). However, this transition does not have
++ * any effect on the device: It continues to be operational and network ports
++ * remain up. Advertising this support makes it seem as if a PM reset is viable
++ * for these devices. Mark it as unavailable to skip it when testing reset
++ * methods.
++ */
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcb84, quirk_no_pm_reset);
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcf6c, quirk_no_pm_reset);
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcf70, quirk_no_pm_reset);
++DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_MELLANOX, 0xcf80, quirk_no_pm_reset);
++
+ /*
+ * Thunderbolt controllers with broken MSI hotplug signaling:
+ * Entire 1st generation (Light Ridge, Eagle Ridge, Light Peak) and part
+--
+2.43.0
+
--- /dev/null
+From 0b5fb7c67131738c725c82e511f27747481a14e8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 16:42:30 -0600
+Subject: PCI/AER: Decode Requester ID when no error info found
+
+From: Bjorn Helgaas <bhelgaas@google.com>
+
+[ Upstream commit 1291b716bbf969e101d517bfb8ba18d958f758b8 ]
+
+When a device with AER detects an error, it logs error information in its
+own AER Error Status registers. It may send an Error Message to the Root
+Port (RCEC in the case of an RCiEP), which logs the fact that an Error
+Message was received (Root Error Status) and the Requester ID of the
+message source (Error Source Identification).
+
+aer_print_port_info() prints the Requester ID from the Root Port Error
+Source in the usual Linux "bb:dd.f" format, but when find_source_device()
+finds no error details in the hierarchy below the Root Port, it printed the
+raw Requester ID without decoding it.
+
+Decode the Requester ID in the usual Linux format so it matches other
+messages.
+
+Sample message changes:
+
+ - pcieport 0000:00:1c.5: AER: Correctable error received: 0000:00:1c.5
+ - pcieport 0000:00:1c.5: AER: can't find device of ID00e5
+ + pcieport 0000:00:1c.5: AER: Correctable error message received from 0000:00:1c.5
+ + pcieport 0000:00:1c.5: AER: found no error details for 0000:00:1c.5
+
+Link: https://lore.kernel.org/r/20231206224231.732765-3-helgaas@kernel.org
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Reviewed-by: Jonathan Cameron <Jonathan.Cameron@huawei.com>
+Reviewed-by: Kuppuswamy Sathyanarayanan <sathyanarayanan.kuppuswamy@linux.intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/pcie/aer.c | 9 +++++++--
+ 1 file changed, 7 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/pci/pcie/aer.c b/drivers/pci/pcie/aer.c
+index 9564b74003f0..d58b02237075 100644
+--- a/drivers/pci/pcie/aer.c
++++ b/drivers/pci/pcie/aer.c
+@@ -741,7 +741,7 @@ static void aer_print_port_info(struct pci_dev *dev, struct aer_err_info *info)
+ u8 bus = info->id >> 8;
+ u8 devfn = info->id & 0xff;
+
+- pci_info(dev, "%s%s error received: %04x:%02x:%02x.%d\n",
++ pci_info(dev, "%s%s error message received from %04x:%02x:%02x.%d\n",
+ info->multi_error_valid ? "Multiple " : "",
+ aer_error_severity_string[info->severity],
+ pci_domain_nr(dev->bus), bus, PCI_SLOT(devfn),
+@@ -926,7 +926,12 @@ static bool find_source_device(struct pci_dev *parent,
+ pci_walk_bus(parent->subordinate, find_device_iter, e_info);
+
+ if (!e_info->error_dev_num) {
+- pci_info(parent, "can't find device of ID%04x\n", e_info->id);
++ u8 bus = e_info->id >> 8;
++ u8 devfn = e_info->id & 0xff;
++
++ pci_info(parent, "found no error details for %04x:%02x:%02x.%d\n",
++ pci_domain_nr(parent->bus), bus, PCI_SLOT(devfn),
++ PCI_FUNC(devfn));
+ return false;
+ }
+ return true;
+--
+2.43.0
+
--- /dev/null
+From ed1b6c5d59c469c1001eb78e71b86cff85dd3e40 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 20 Nov 2023 13:04:36 -0300
+Subject: PCI: Only override AMD USB controller if required
+
+From: Guilherme G. Piccoli <gpiccoli@igalia.com>
+
+[ Upstream commit e585a37e5061f6d5060517aed1ca4ccb2e56a34c ]
+
+By running a Van Gogh device (Steam Deck), the following message
+was noticed in the kernel log:
+
+ pci 0000:04:00.3: PCI class overridden (0x0c03fe -> 0x0c03fe) so dwc3 driver can claim this instead of xhci
+
+Effectively this means the quirk executed but changed nothing, since the
+class of this device was already the proper one (likely adjusted by newer
+firmware versions).
+
+Check and perform the override only if necessary.
+
+Link: https://lore.kernel.org/r/20231120160531.361552-1-gpiccoli@igalia.com
+Signed-off-by: Guilherme G. Piccoli <gpiccoli@igalia.com>
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Cc: Huang Rui <ray.huang@amd.com>
+Cc: Vicki Pfau <vi@endrift.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/quirks.c | 11 +++++++----
+ 1 file changed, 7 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/pci/quirks.c b/drivers/pci/quirks.c
+index 03a30734cdc6..b67aea8d8f19 100644
+--- a/drivers/pci/quirks.c
++++ b/drivers/pci/quirks.c
+@@ -609,10 +609,13 @@ static void quirk_amd_dwc_class(struct pci_dev *pdev)
+ {
+ u32 class = pdev->class;
+
+- /* Use "USB Device (not host controller)" class */
+- pdev->class = PCI_CLASS_SERIAL_USB_DEVICE;
+- pci_info(pdev, "PCI class overridden (%#08x -> %#08x) so dwc3 driver can claim this instead of xhci\n",
+- class, pdev->class);
++ if (class != PCI_CLASS_SERIAL_USB_DEVICE) {
++ /* Use "USB Device (not host controller)" class */
++ pdev->class = PCI_CLASS_SERIAL_USB_DEVICE;
++ pci_info(pdev,
++ "PCI class overridden (%#08x -> %#08x) so dwc3 driver can claim this instead of xhci\n",
++ class, pdev->class);
++ }
+ }
+ DECLARE_PCI_FIXUP_HEADER(PCI_VENDOR_ID_AMD, PCI_DEVICE_ID_AMD_NL_USB,
+ quirk_amd_dwc_class);
+--
+2.43.0
+
--- /dev/null
+From d286bfc181bd218530ad6e397ba74421af74a822 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 20:23:16 -0800
+Subject: PCI: switchtec: Fix stdev_release() crash after surprise hot remove
+
+From: Daniel Stodden <dns@arista.com>
+
+[ Upstream commit df25461119d987b8c81d232cfe4411e91dcabe66 ]
+
+A PCI device hot removal may occur while stdev->cdev is held open. The call
+to stdev_release() then happens during close or exit, at a point way past
+switchtec_pci_remove(). Otherwise the last ref would vanish with the
+trailing put_device(), just before return.
+
+At that later point in time, the devm cleanup has already removed the
+stdev->mmio_mrpc mapping. Also, the stdev->pdev reference was not a counted
+one. Therefore, in DMA mode, the iowrite32() in stdev_release() will cause
+a fatal page fault, and the subsequent dma_free_coherent(), if reached,
+would pass a stale &stdev->pdev->dev pointer.
+
+Fix by moving MRPC DMA shutdown into switchtec_pci_remove(), after
+stdev_kill(). Counting the stdev->pdev ref is now optional, but may prevent
+future accidents.
+
+Reproducible via the script at
+https://lore.kernel.org/r/20231113212150.96410-1-dns@arista.com
+
+Link: https://lore.kernel.org/r/20231122042316.91208-2-dns@arista.com
+Signed-off-by: Daniel Stodden <dns@arista.com>
+Signed-off-by: Bjorn Helgaas <bhelgaas@google.com>
+Reviewed-by: Logan Gunthorpe <logang@deltatee.com>
+Reviewed-by: Dmitry Safonov <dima@arista.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pci/switch/switchtec.c | 25 +++++++++++++++++--------
+ 1 file changed, 17 insertions(+), 8 deletions(-)
+
+diff --git a/drivers/pci/switch/switchtec.c b/drivers/pci/switch/switchtec.c
+index ba52459928f7..5cea3ad290c5 100644
+--- a/drivers/pci/switch/switchtec.c
++++ b/drivers/pci/switch/switchtec.c
+@@ -1251,13 +1251,6 @@ static void stdev_release(struct device *dev)
+ {
+ struct switchtec_dev *stdev = to_stdev(dev);
+
+- if (stdev->dma_mrpc) {
+- iowrite32(0, &stdev->mmio_mrpc->dma_en);
+- flush_wc_buf(stdev);
+- writeq(0, &stdev->mmio_mrpc->dma_addr);
+- dma_free_coherent(&stdev->pdev->dev, sizeof(*stdev->dma_mrpc),
+- stdev->dma_mrpc, stdev->dma_mrpc_dma_addr);
+- }
+ kfree(stdev);
+ }
+
+@@ -1301,7 +1294,7 @@ static struct switchtec_dev *stdev_create(struct pci_dev *pdev)
+ return ERR_PTR(-ENOMEM);
+
+ stdev->alive = true;
+- stdev->pdev = pdev;
++ stdev->pdev = pci_dev_get(pdev);
+ INIT_LIST_HEAD(&stdev->mrpc_queue);
+ mutex_init(&stdev->mrpc_mutex);
+ stdev->mrpc_busy = 0;
+@@ -1335,6 +1328,7 @@ static struct switchtec_dev *stdev_create(struct pci_dev *pdev)
+ return stdev;
+
+ err_put:
++ pci_dev_put(stdev->pdev);
+ put_device(&stdev->dev);
+ return ERR_PTR(rc);
+ }
+@@ -1587,6 +1581,18 @@ static int switchtec_init_pci(struct switchtec_dev *stdev,
+ return 0;
+ }
+
++static void switchtec_exit_pci(struct switchtec_dev *stdev)
++{
++ if (stdev->dma_mrpc) {
++ iowrite32(0, &stdev->mmio_mrpc->dma_en);
++ flush_wc_buf(stdev);
++ writeq(0, &stdev->mmio_mrpc->dma_addr);
++ dma_free_coherent(&stdev->pdev->dev, sizeof(*stdev->dma_mrpc),
++ stdev->dma_mrpc, stdev->dma_mrpc_dma_addr);
++ stdev->dma_mrpc = NULL;
++ }
++}
++
+ static int switchtec_pci_probe(struct pci_dev *pdev,
+ const struct pci_device_id *id)
+ {
+@@ -1646,6 +1652,9 @@ static void switchtec_pci_remove(struct pci_dev *pdev)
+ ida_simple_remove(&switchtec_minor_ida, MINOR(stdev->dev.devt));
+ dev_info(&stdev->dev, "unregistered.\n");
+ stdev_kill(stdev);
++ switchtec_exit_pci(stdev);
++ pci_dev_put(stdev->pdev);
++ stdev->pdev = NULL;
+ put_device(&stdev->dev);
+ }
+
+--
+2.43.0
+
--- /dev/null
+From cccdb7d5e7f195df6c3b5484cff22077268da0e9 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 12 Jun 2023 15:09:09 +0200
+Subject: perf/core: Fix narrow startup race when creating the perf
+ nr_addr_filters sysfs file
+
+From: Greg KH <gregkh@linuxfoundation.org>
+
+[ Upstream commit 652ffc2104ec1f69dd4a46313888c33527145ccf ]
+
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Link: https://lkml.kernel.org/r/2023061204-decal-flyable-6090@gregkh
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/events/core.c | 40 ++++++++++++++++++++++++++++------------
+ 1 file changed, 28 insertions(+), 12 deletions(-)
+
+diff --git a/kernel/events/core.c b/kernel/events/core.c
+index afedd008e0af..ab5b75f3b886 100644
+--- a/kernel/events/core.c
++++ b/kernel/events/core.c
+@@ -10855,9 +10855,32 @@ static DEVICE_ATTR_RW(perf_event_mux_interval_ms);
+ static struct attribute *pmu_dev_attrs[] = {
+ &dev_attr_type.attr,
+ &dev_attr_perf_event_mux_interval_ms.attr,
++ &dev_attr_nr_addr_filters.attr,
++ NULL,
++};
++
++static umode_t pmu_dev_is_visible(struct kobject *kobj, struct attribute *a, int n)
++{
++ struct device *dev = kobj_to_dev(kobj);
++ struct pmu *pmu = dev_get_drvdata(dev);
++
++ if (!pmu->nr_addr_filters)
++ return 0;
++
++ return a->mode;
++
++ return 0;
++}
++
++static struct attribute_group pmu_dev_attr_group = {
++ .is_visible = pmu_dev_is_visible,
++ .attrs = pmu_dev_attrs,
++};
++
++static const struct attribute_group *pmu_dev_groups[] = {
++ &pmu_dev_attr_group,
+ NULL,
+ };
+-ATTRIBUTE_GROUPS(pmu_dev);
+
+ static int pmu_bus_running;
+ static struct bus_type pmu_bus = {
+@@ -10893,18 +10916,11 @@ static int pmu_dev_alloc(struct pmu *pmu)
+ if (ret)
+ goto free_dev;
+
+- /* For PMUs with address filters, throw in an extra attribute: */
+- if (pmu->nr_addr_filters)
+- ret = device_create_file(pmu->dev, &dev_attr_nr_addr_filters);
+-
+- if (ret)
+- goto del_dev;
+-
+- if (pmu->attr_update)
++ if (pmu->attr_update) {
+ ret = sysfs_update_groups(&pmu->dev->kobj, pmu->attr_update);
+-
+- if (ret)
+- goto del_dev;
++ if (ret)
++ goto del_dev;
++ }
+
+ out:
+ return ret;
+--
+2.43.0
+
--- /dev/null
+From a70fc098380663e9c8827b1ed94fc284c5f73e95 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 11:07:56 +0100
+Subject: perf: Fix the nr_addr_filters fix
+
+From: Peter Zijlstra <peterz@infradead.org>
+
+[ Upstream commit 388a1fb7da6aaa1970c7e2a7d7fcd983a87a8484 ]
+
+Thomas reported that commit 652ffc2104ec ("perf/core: Fix narrow
+startup race when creating the perf nr_addr_filters sysfs file") made
+the entire attribute group vanish, instead of only the nr_addr_filters
+attribute.
+
+Additionally a stray return.
+
+Insufficient coffee was involved with both writing and merging the
+patch.
+
+Fixes: 652ffc2104ec ("perf/core: Fix narrow startup race when creating the perf nr_addr_filters sysfs file")
+Reported-by: Thomas Richter <tmricht@linux.ibm.com>
+Signed-off-by: Peter Zijlstra (Intel) <peterz@infradead.org>
+Tested-by: Thomas Richter <tmricht@linux.ibm.com>
+Link: https://lkml.kernel.org/r/20231122100756.GP8262@noisy.programming.kicks-ass.net
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ kernel/events/core.c | 4 +---
+ 1 file changed, 1 insertion(+), 3 deletions(-)
+
+diff --git a/kernel/events/core.c b/kernel/events/core.c
+index ab5b75f3b886..bd569cf23569 100644
+--- a/kernel/events/core.c
++++ b/kernel/events/core.c
+@@ -10864,12 +10864,10 @@ static umode_t pmu_dev_is_visible(struct kobject *kobj, struct attribute *a, int
+ struct device *dev = kobj_to_dev(kobj);
+ struct pmu *pmu = dev_get_drvdata(dev);
+
+- if (!pmu->nr_addr_filters)
++ if (n == 2 && !pmu->nr_addr_filters)
+ return 0;
+
+ return a->mode;
+-
+- return 0;
+ }
+
+ static struct attribute_group pmu_dev_attr_group = {
+--
+2.43.0
+
--- /dev/null
+From e4e3e646475b3bbaff021251a795c5c526883510 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 25 Nov 2023 02:41:58 +0530
+Subject: PM / devfreq: Synchronize devfreq_monitor_[start/stop]
+
+From: Mukesh Ojha <quic_mojha@quicinc.com>
+
+[ Upstream commit aed5ed595960c6d301dcd4ed31aeaa7a8054c0c6 ]
+
+There is a chance if a frequent switch of the governor
+done in a loop result in timer list corruption where
+timer cancel being done from two place one from
+cancel_delayed_work_sync() and followed by expire_timers()
+can be seen from the traces[1].
+
+while true
+do
+ echo "simple_ondemand" > /sys/class/devfreq/1d84000.ufshc/governor
+ echo "performance" > /sys/class/devfreq/1d84000.ufshc/governor
+done
+
+It looks to be issue with devfreq driver where
+device_monitor_[start/stop] need to synchronized so that
+delayed work should get corrupted while it is either
+being queued or running or being cancelled.
+
+Let's use polling flag and devfreq lock to synchronize the
+queueing the timer instance twice and work data being
+corrupted.
+
+[1]
+...
+..
+<idle>-0 [003] 9436.209662: timer_cancel timer=0xffffff80444f0428
+<idle>-0 [003] 9436.209664: timer_expire_entry timer=0xffffff80444f0428 now=0x10022da1c function=__typeid__ZTSFvP10timer_listE_global_addr baseclk=0x10022da1c
+<idle>-0 [003] 9436.209718: timer_expire_exit timer=0xffffff80444f0428
+kworker/u16:6-14217 [003] 9436.209863: timer_start timer=0xffffff80444f0428 function=__typeid__ZTSFvP10timer_listE_global_addr expires=0x10022da2b now=0x10022da1c flags=182452227
+vendor.xxxyyy.ha-1593 [004] 9436.209888: timer_cancel timer=0xffffff80444f0428
+vendor.xxxyyy.ha-1593 [004] 9436.216390: timer_init timer=0xffffff80444f0428
+vendor.xxxyyy.ha-1593 [004] 9436.216392: timer_start timer=0xffffff80444f0428 function=__typeid__ZTSFvP10timer_listE_global_addr expires=0x10022da2c now=0x10022da1d flags=186646532
+vendor.xxxyyy.ha-1593 [005] 9436.220992: timer_cancel timer=0xffffff80444f0428
+xxxyyyTraceManag-7795 [004] 9436.261641: timer_cancel timer=0xffffff80444f0428
+
+[2]
+
+ 9436.261653][ C4] Unable to handle kernel paging request at virtual address dead00000000012a
+[ 9436.261664][ C4] Mem abort info:
+[ 9436.261666][ C4] ESR = 0x96000044
+[ 9436.261669][ C4] EC = 0x25: DABT (current EL), IL = 32 bits
+[ 9436.261671][ C4] SET = 0, FnV = 0
+[ 9436.261673][ C4] EA = 0, S1PTW = 0
+[ 9436.261675][ C4] Data abort info:
+[ 9436.261677][ C4] ISV = 0, ISS = 0x00000044
+[ 9436.261680][ C4] CM = 0, WnR = 1
+[ 9436.261682][ C4] [dead00000000012a] address between user and kernel address ranges
+[ 9436.261685][ C4] Internal error: Oops: 96000044 [#1] PREEMPT SMP
+[ 9436.261701][ C4] Skip md ftrace buffer dump for: 0x3a982d0
+...
+
+[ 9436.262138][ C4] CPU: 4 PID: 7795 Comm: TraceManag Tainted: G S W O 5.10.149-android12-9-o-g17f915d29d0c #1
+[ 9436.262141][ C4] Hardware name: Qualcomm Technologies, Inc. (DT)
+[ 9436.262144][ C4] pstate: 22400085 (nzCv daIf +PAN -UAO +TCO BTYPE=--)
+[ 9436.262161][ C4] pc : expire_timers+0x9c/0x438
+[ 9436.262164][ C4] lr : expire_timers+0x2a4/0x438
+[ 9436.262168][ C4] sp : ffffffc010023dd0
+[ 9436.262171][ C4] x29: ffffffc010023df0 x28: ffffffd0636fdc18
+[ 9436.262178][ C4] x27: ffffffd063569dd0 x26: ffffffd063536008
+[ 9436.262182][ C4] x25: 0000000000000001 x24: ffffff88f7c69280
+[ 9436.262185][ C4] x23: 00000000000000e0 x22: dead000000000122
+[ 9436.262188][ C4] x21: 000000010022da29 x20: ffffff8af72b4e80
+[ 9436.262191][ C4] x19: ffffffc010023e50 x18: ffffffc010025038
+[ 9436.262195][ C4] x17: 0000000000000240 x16: 0000000000000201
+[ 9436.262199][ C4] x15: ffffffffffffffff x14: ffffff889f3c3100
+[ 9436.262203][ C4] x13: ffffff889f3c3100 x12: 00000000049f56b8
+[ 9436.262207][ C4] x11: 00000000049f56b8 x10: 00000000ffffffff
+[ 9436.262212][ C4] x9 : ffffffc010023e50 x8 : dead000000000122
+[ 9436.262216][ C4] x7 : ffffffffffffffff x6 : ffffffc0100239d8
+[ 9436.262220][ C4] x5 : 0000000000000000 x4 : 0000000000000101
+[ 9436.262223][ C4] x3 : 0000000000000080 x2 : ffffff889edc155c
+[ 9436.262227][ C4] x1 : ffffff8001005200 x0 : ffffff80444f0428
+[ 9436.262232][ C4] Call trace:
+[ 9436.262236][ C4] expire_timers+0x9c/0x438
+[ 9436.262240][ C4] __run_timers+0x1f0/0x330
+[ 9436.262245][ C4] run_timer_softirq+0x28/0x58
+[ 9436.262255][ C4] efi_header_end+0x168/0x5ec
+[ 9436.262265][ C4] __irq_exit_rcu+0x108/0x124
+[ 9436.262274][ C4] __handle_domain_irq+0x118/0x1e4
+[ 9436.262282][ C4] gic_handle_irq.30369+0x6c/0x2bc
+[ 9436.262286][ C4] el0_irq_naked+0x60/0x6c
+
+Link: https://lore.kernel.org/all/1700860318-4025-1-git-send-email-quic_mojha@quicinc.com/
+Reported-by: Joyyoung Huang <huangzaiyang@oppo.com>
+Acked-by: MyungJoo Ham <myungjoo.ham@samsung.com>
+Signed-off-by: Mukesh Ojha <quic_mojha@quicinc.com>
+Signed-off-by: Chanwoo Choi <cw00.choi@samsung.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/devfreq/devfreq.c | 24 ++++++++++++++++++++++--
+ 1 file changed, 22 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/devfreq/devfreq.c b/drivers/devfreq/devfreq.c
+index 42c1eed44529..216594b86119 100644
+--- a/drivers/devfreq/devfreq.c
++++ b/drivers/devfreq/devfreq.c
+@@ -438,10 +438,14 @@ static void devfreq_monitor(struct work_struct *work)
+ if (err)
+ dev_err(&devfreq->dev, "dvfs failed with (%d) error\n", err);
+
++ if (devfreq->stop_polling)
++ goto out;
++
+ queue_delayed_work(devfreq_wq, &devfreq->work,
+ msecs_to_jiffies(devfreq->profile->polling_ms));
+- mutex_unlock(&devfreq->lock);
+
++out:
++ mutex_unlock(&devfreq->lock);
+ trace_devfreq_monitor(devfreq);
+ }
+
+@@ -459,6 +463,10 @@ void devfreq_monitor_start(struct devfreq *devfreq)
+ if (devfreq->governor->interrupt_driven)
+ return;
+
++ mutex_lock(&devfreq->lock);
++ if (delayed_work_pending(&devfreq->work))
++ goto out;
++
+ switch (devfreq->profile->timer) {
+ case DEVFREQ_TIMER_DEFERRABLE:
+ INIT_DEFERRABLE_WORK(&devfreq->work, devfreq_monitor);
+@@ -467,12 +475,16 @@ void devfreq_monitor_start(struct devfreq *devfreq)
+ INIT_DELAYED_WORK(&devfreq->work, devfreq_monitor);
+ break;
+ default:
+- return;
++ goto out;
+ }
+
+ if (devfreq->profile->polling_ms)
+ queue_delayed_work(devfreq_wq, &devfreq->work,
+ msecs_to_jiffies(devfreq->profile->polling_ms));
++
++out:
++ devfreq->stop_polling = false;
++ mutex_unlock(&devfreq->lock);
+ }
+ EXPORT_SYMBOL(devfreq_monitor_start);
+
+@@ -489,6 +501,14 @@ void devfreq_monitor_stop(struct devfreq *devfreq)
+ if (devfreq->governor->interrupt_driven)
+ return;
+
++ mutex_lock(&devfreq->lock);
++ if (devfreq->stop_polling) {
++ mutex_unlock(&devfreq->lock);
++ return;
++ }
++
++ devfreq->stop_polling = true;
++ mutex_unlock(&devfreq->lock);
+ cancel_delayed_work_sync(&devfreq->work);
+ }
+ EXPORT_SYMBOL(devfreq_monitor_stop);
+--
+2.43.0
+
--- /dev/null
+From d64b99aac72174c053261c93524fb01ad95190cb Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 28 Nov 2023 05:52:10 +0300
+Subject: PNP: ACPI: fix fortify warning
+
+From: Dmitry Antipov <dmantipov@yandex.ru>
+
+[ Upstream commit ba3f5058db437d919f8468db50483dd9028ff688 ]
+
+When compiling with gcc version 14.0.0 20231126 (experimental)
+and CONFIG_FORTIFY_SOURCE=y, I've noticed the following:
+
+In file included from ./include/linux/string.h:295,
+ from ./include/linux/bitmap.h:12,
+ from ./include/linux/cpumask.h:12,
+ from ./arch/x86/include/asm/paravirt.h:17,
+ from ./arch/x86/include/asm/cpuid.h:62,
+ from ./arch/x86/include/asm/processor.h:19,
+ from ./arch/x86/include/asm/cpufeature.h:5,
+ from ./arch/x86/include/asm/thread_info.h:53,
+ from ./include/linux/thread_info.h:60,
+ from ./arch/x86/include/asm/preempt.h:9,
+ from ./include/linux/preempt.h:79,
+ from ./include/linux/spinlock.h:56,
+ from ./include/linux/mmzone.h:8,
+ from ./include/linux/gfp.h:7,
+ from ./include/linux/slab.h:16,
+ from ./include/linux/resource_ext.h:11,
+ from ./include/linux/acpi.h:13,
+ from drivers/pnp/pnpacpi/rsparser.c:11:
+In function 'fortify_memcpy_chk',
+ inlined from 'pnpacpi_parse_allocated_vendor' at drivers/pnp/pnpacpi/rsparser.c:158:3,
+ inlined from 'pnpacpi_allocated_resource' at drivers/pnp/pnpacpi/rsparser.c:249:3:
+./include/linux/fortify-string.h:588:25: warning: call to '__read_overflow2_field'
+declared with attribute warning: detected read beyond size of field (2nd parameter);
+maybe use struct_group()? [-Wattribute-warning]
+ 588 | __read_overflow2_field(q_size_field, size);
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+According to the comments in include/linux/fortify-string.h, 'memcpy()',
+'memmove()' and 'memset()' must not be used beyond individual struct
+members to ensure that the compiler can enforce protection against
+buffer overflows, and, IIUC, this also applies to partial copies from
+the particular member ('vendor->byte_data' in this case). So it should
+be better (and safer) to do both copies at once (and 'byte_data' of
+'struct acpi_resource_vendor_typed' seems to be a good candidate for
+'__counted_by(byte_length)' as well).
+
+Signed-off-by: Dmitry Antipov <dmantipov@yandex.ru>
+Reviewed-by: Kees Cook <keescook@chromium.org>
+Signed-off-by: Rafael J. Wysocki <rafael.j.wysocki@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/pnp/pnpacpi/rsparser.c | 12 ++++++------
+ 1 file changed, 6 insertions(+), 6 deletions(-)
+
+diff --git a/drivers/pnp/pnpacpi/rsparser.c b/drivers/pnp/pnpacpi/rsparser.c
+index da78dc77aed3..9879deb4dc0b 100644
+--- a/drivers/pnp/pnpacpi/rsparser.c
++++ b/drivers/pnp/pnpacpi/rsparser.c
+@@ -151,13 +151,13 @@ static int vendor_resource_matches(struct pnp_dev *dev,
+ static void pnpacpi_parse_allocated_vendor(struct pnp_dev *dev,
+ struct acpi_resource_vendor_typed *vendor)
+ {
+- if (vendor_resource_matches(dev, vendor, &hp_ccsr_uuid, 16)) {
+- u64 start, length;
++ struct { u64 start, length; } range;
+
+- memcpy(&start, vendor->byte_data, sizeof(start));
+- memcpy(&length, vendor->byte_data + 8, sizeof(length));
+-
+- pnp_add_mem_resource(dev, start, start + length - 1, 0);
++ if (vendor_resource_matches(dev, vendor, &hp_ccsr_uuid,
++ sizeof(range))) {
++ memcpy(&range, vendor->byte_data, sizeof(range));
++ pnp_add_mem_resource(dev, range.start, range.start +
++ range.length - 1, 0);
+ }
+ }
+
+--
+2.43.0
+
--- /dev/null
+From 4336baef047e3a64bdcb2cda851a37a3532c1ec8 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 22:44:33 +1100
+Subject: powerpc: Fix build error due to is_valid_bugaddr()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Michael Ellerman <mpe@ellerman.id.au>
+
+[ Upstream commit f8d3555355653848082c351fa90775214fb8a4fa ]
+
+With CONFIG_GENERIC_BUG=n the build fails with:
+
+ arch/powerpc/kernel/traps.c:1442:5: error: no previous prototype for ‘is_valid_bugaddr’ [-Werror=missing-prototypes]
+ 1442 | int is_valid_bugaddr(unsigned long addr)
+ | ^~~~~~~~~~~~~~~~
+
+The prototype is only defined, and the function is only needed, when
+CONFIG_GENERIC_BUG=y, so move the implementation under that.
+
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231130114433.3053544-2-mpe@ellerman.id.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/kernel/traps.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/arch/powerpc/kernel/traps.c b/arch/powerpc/kernel/traps.c
+index 5e5a2448ae79..b0e87dce2b9a 100644
+--- a/arch/powerpc/kernel/traps.c
++++ b/arch/powerpc/kernel/traps.c
+@@ -1432,10 +1432,12 @@ static int emulate_instruction(struct pt_regs *regs)
+ return -EINVAL;
+ }
+
++#ifdef CONFIG_GENERIC_BUG
+ int is_valid_bugaddr(unsigned long addr)
+ {
+ return is_kernel_addr(addr);
+ }
++#endif
+
+ #ifdef CONFIG_MATH_EMULATION
+ static int emulate_math(struct pt_regs *regs)
+--
+2.43.0
+
--- /dev/null
+From d41bbbca1f759ec9770a711ce27b2ed4fb43814d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 23 Nov 2023 12:47:05 +0530
+Subject: powerpc/lib: Validate size for vector operations
+
+From: Naveen N Rao <naveen@kernel.org>
+
+[ Upstream commit 8f9abaa6d7de0a70fc68acaedce290c1f96e2e59 ]
+
+Some of the fp/vmx code in sstep.c assume a certain maximum size for the
+instructions being emulated. The size of those operations however is
+determined separately in analyse_instr().
+
+Add a check to validate the assumption on the maximum size of the
+operations, so as to prevent any unintended kernel stack corruption.
+
+Signed-off-by: Naveen N Rao <naveen@kernel.org>
+Reviewed-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Build-tested-by: Gustavo A. R. Silva <gustavoars@kernel.org>
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231123071705.397625-1-naveen@kernel.org
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/lib/sstep.c | 10 ++++++++++
+ 1 file changed, 10 insertions(+)
+
+diff --git a/arch/powerpc/lib/sstep.c b/arch/powerpc/lib/sstep.c
+index 2d19655328f1..ca4733fbd02d 100644
+--- a/arch/powerpc/lib/sstep.c
++++ b/arch/powerpc/lib/sstep.c
+@@ -512,6 +512,8 @@ static int do_fp_load(struct instruction_op *op, unsigned long ea,
+ } u;
+
+ nb = GETSIZE(op->type);
++ if (nb > sizeof(u))
++ return -EINVAL;
+ if (!address_ok(regs, ea, nb))
+ return -EFAULT;
+ rn = op->reg;
+@@ -562,6 +564,8 @@ static int do_fp_store(struct instruction_op *op, unsigned long ea,
+ } u;
+
+ nb = GETSIZE(op->type);
++ if (nb > sizeof(u))
++ return -EINVAL;
+ if (!address_ok(regs, ea, nb))
+ return -EFAULT;
+ rn = op->reg;
+@@ -606,6 +610,9 @@ static nokprobe_inline int do_vec_load(int rn, unsigned long ea,
+ u8 b[sizeof(__vector128)];
+ } u = {};
+
++ if (size > sizeof(u))
++ return -EINVAL;
++
+ if (!address_ok(regs, ea & ~0xfUL, 16))
+ return -EFAULT;
+ /* align to multiple of size */
+@@ -633,6 +640,9 @@ static nokprobe_inline int do_vec_store(int rn, unsigned long ea,
+ u8 b[sizeof(__vector128)];
+ } u;
+
++ if (size > sizeof(u))
++ return -EINVAL;
++
+ if (!address_ok(regs, ea & ~0xfUL, 16))
+ return -EFAULT;
+ /* align to multiple of size */
+--
+2.43.0
+
--- /dev/null
+From 1904620705c5d0f668e68136be3e891e005e42f2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 22:44:32 +1100
+Subject: powerpc/mm: Fix build failures due to arch_reserved_kernel_pages()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Michael Ellerman <mpe@ellerman.id.au>
+
+[ Upstream commit d8c3f243d4db24675b653f0568bb65dae34e6455 ]
+
+With NUMA=n and FA_DUMP=y or PRESERVE_FA_DUMP=y the build fails with:
+
+ arch/powerpc/kernel/fadump.c:1739:22: error: no previous prototype for ‘arch_reserved_kernel_pages’ [-Werror=missing-prototypes]
+ 1739 | unsigned long __init arch_reserved_kernel_pages(void)
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~
+
+The prototype for arch_reserved_kernel_pages() is in include/linux/mm.h,
+but it's guarded by __HAVE_ARCH_RESERVED_KERNEL_PAGES. The powerpc
+headers define __HAVE_ARCH_RESERVED_KERNEL_PAGES in asm/mmzone.h, which
+is not included into the generic headers when NUMA=n.
+
+Move the definition of __HAVE_ARCH_RESERVED_KERNEL_PAGES into asm/mmu.h
+which is included regardless of NUMA=n.
+
+Additionally the ifdef around __HAVE_ARCH_RESERVED_KERNEL_PAGES needs to
+also check for CONFIG_PRESERVE_FA_DUMP.
+
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231130114433.3053544-1-mpe@ellerman.id.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/include/asm/mmu.h | 4 ++++
+ arch/powerpc/include/asm/mmzone.h | 3 ---
+ 2 files changed, 4 insertions(+), 3 deletions(-)
+
+diff --git a/arch/powerpc/include/asm/mmu.h b/arch/powerpc/include/asm/mmu.h
+index 255a1837e9f7..3a5a27318a0e 100644
+--- a/arch/powerpc/include/asm/mmu.h
++++ b/arch/powerpc/include/asm/mmu.h
+@@ -390,5 +390,9 @@ extern void *abatron_pteptrs[2];
+ #include <asm/nohash/mmu.h>
+ #endif
+
++#if defined(CONFIG_FA_DUMP) || defined(CONFIG_PRESERVE_FA_DUMP)
++#define __HAVE_ARCH_RESERVED_KERNEL_PAGES
++#endif
++
+ #endif /* __KERNEL__ */
+ #endif /* _ASM_POWERPC_MMU_H_ */
+diff --git a/arch/powerpc/include/asm/mmzone.h b/arch/powerpc/include/asm/mmzone.h
+index 6cda76b57c5d..bd1a8d7256ff 100644
+--- a/arch/powerpc/include/asm/mmzone.h
++++ b/arch/powerpc/include/asm/mmzone.h
+@@ -42,9 +42,6 @@ u64 memory_hotplug_max(void);
+ #else
+ #define memory_hotplug_max() memblock_end_of_DRAM()
+ #endif /* CONFIG_NEED_MULTIPLE_NODES */
+-#ifdef CONFIG_FA_DUMP
+-#define __HAVE_ARCH_RESERVED_KERNEL_PAGES
+-#endif
+
+ #ifdef CONFIG_MEMORY_HOTPLUG
+ extern int create_section_mapping(unsigned long start, unsigned long end,
+--
+2.43.0
+
--- /dev/null
+From 2c06f221333e5e11c0b05ec8bb773d710fecb6e1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 4 Dec 2023 10:32:23 +0800
+Subject: powerpc/mm: Fix null-pointer dereference in pgtable_cache_add
+
+From: Kunwu Chan <chentao@kylinos.cn>
+
+[ Upstream commit f46c8a75263f97bda13c739ba1c90aced0d3b071 ]
+
+kasprintf() returns a pointer to dynamically allocated memory
+which can be NULL upon failure. Ensure the allocation was successful
+by checking the pointer validity.
+
+Suggested-by: Christophe Leroy <christophe.leroy@csgroup.eu>
+Suggested-by: Michael Ellerman <mpe@ellerman.id.au>
+Signed-off-by: Kunwu Chan <chentao@kylinos.cn>
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231204023223.2447523-1-chentao@kylinos.cn
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/mm/init-common.c | 5 +++--
+ 1 file changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/arch/powerpc/mm/init-common.c b/arch/powerpc/mm/init-common.c
+index 8e0d792ac296..52a20c97e46e 100644
+--- a/arch/powerpc/mm/init-common.c
++++ b/arch/powerpc/mm/init-common.c
+@@ -111,7 +111,7 @@ void pgtable_cache_add(unsigned int shift)
+ * as to leave enough 0 bits in the address to contain it. */
+ unsigned long minalign = max(MAX_PGTABLE_INDEX_SIZE + 1,
+ HUGEPD_SHIFT_MASK + 1);
+- struct kmem_cache *new;
++ struct kmem_cache *new = NULL;
+
+ /* It would be nice if this was a BUILD_BUG_ON(), but at the
+ * moment, gcc doesn't seem to recognize is_power_of_2 as a
+@@ -124,7 +124,8 @@ void pgtable_cache_add(unsigned int shift)
+
+ align = max_t(unsigned long, align, minalign);
+ name = kasprintf(GFP_KERNEL, "pgtable-2^%d", shift);
+- new = kmem_cache_create(name, table_size, align, 0, ctor(shift));
++ if (name)
++ new = kmem_cache_create(name, table_size, align, 0, ctor(shift));
+ if (!new)
+ panic("Could not allocate pgtable cache for order %d", shift);
+
+--
+2.43.0
+
--- /dev/null
+From c0034269570f8c63bf260dadcfe32aadbf6a57d3 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 27 Nov 2023 13:28:09 +1100
+Subject: powerpc: pmd_move_must_withdraw() is only needed for
+ CONFIG_TRANSPARENT_HUGEPAGE
+
+From: Stephen Rothwell <sfr@canb.auug.org.au>
+
+[ Upstream commit 0d555b57ee660d8a871781c0eebf006e855e918d ]
+
+The linux-next build of powerpc64 allnoconfig fails with:
+
+ arch/powerpc/mm/book3s64/pgtable.c:557:5: error: no previous prototype for 'pmd_move_must_withdraw'
+ 557 | int pmd_move_must_withdraw(struct spinlock *new_pmd_ptl,
+ | ^~~~~~~~~~~~~~~~~~~~~~
+
+Caused by commit:
+
+ c6345dfa6e3e ("Makefile.extrawarn: turn on missing-prototypes globally")
+
+Fix it by moving the function definition under
+CONFIG_TRANSPARENT_HUGEPAGE like the prototype. The function is only
+called when CONFIG_TRANSPARENT_HUGEPAGE=y.
+
+Signed-off-by: Stephen Rothwell <sfr@canb.auug.org.au>
+[mpe: Flesh out change log from linux-next patch]
+Signed-off-by: Michael Ellerman <mpe@ellerman.id.au>
+Link: https://msgid.link/20231127132809.45c2b398@canb.auug.org.au
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/powerpc/mm/book3s64/pgtable.c | 2 ++
+ 1 file changed, 2 insertions(+)
+
+diff --git a/arch/powerpc/mm/book3s64/pgtable.c b/arch/powerpc/mm/book3s64/pgtable.c
+index e18ae50a275c..a86d932a7c30 100644
+--- a/arch/powerpc/mm/book3s64/pgtable.c
++++ b/arch/powerpc/mm/book3s64/pgtable.c
+@@ -446,6 +446,7 @@ void ptep_modify_prot_commit(struct vm_area_struct *vma, unsigned long addr,
+ set_pte_at(vma->vm_mm, addr, ptep, pte);
+ }
+
++#ifdef CONFIG_TRANSPARENT_HUGEPAGE
+ /*
+ * For hash translation mode, we use the deposited table to store hash slot
+ * information and they are stored at PTRS_PER_PMD offset from related pmd
+@@ -467,6 +468,7 @@ int pmd_move_must_withdraw(struct spinlock *new_pmd_ptl,
+
+ return true;
+ }
++#endif
+
+ /*
+ * Does the CPU support tlbie?
+--
+2.43.0
+
--- /dev/null
+From e9fd4e683ba9fa0fec2417df5ad107ed2605965a Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 24 Feb 2023 10:36:32 +0800
+Subject: pstore/ram: Fix crash when setting number of cpus to an odd number
+
+From: Weichen Chen <weichen.chen@mediatek.com>
+
+[ Upstream commit d49270a04623ce3c0afddbf3e984cb245aa48e9c ]
+
+When the number of cpu cores is adjusted to 7 or other odd numbers,
+the zone size will become an odd number.
+The address of the zone will become:
+ addr of zone0 = BASE
+ addr of zone1 = BASE + zone_size
+ addr of zone2 = BASE + zone_size*2
+ ...
+The address of zone1/3/5/7 will be mapped to non-alignment va.
+Eventually crashes will occur when accessing these va.
+
+So, use ALIGN_DOWN() to make sure the zone size is even
+to avoid this bug.
+
+Signed-off-by: Weichen Chen <weichen.chen@mediatek.com>
+Reviewed-by: Matthias Brugger <matthias.bgg@gmail.com>
+Tested-by: "Guilherme G. Piccoli" <gpiccoli@igalia.com>
+Link: https://lore.kernel.org/r/20230224023632.6840-1-weichen.chen@mediatek.com
+Signed-off-by: Kees Cook <keescook@chromium.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/pstore/ram.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/fs/pstore/ram.c b/fs/pstore/ram.c
+index 98e579ce0d63..44fc3b396288 100644
+--- a/fs/pstore/ram.c
++++ b/fs/pstore/ram.c
+@@ -519,6 +519,7 @@ static int ramoops_init_przs(const char *name,
+ }
+
+ zone_sz = mem_sz / *cnt;
++ zone_sz = ALIGN_DOWN(zone_sz, 2);
+ if (!zone_sz) {
+ dev_err(dev, "%s zone size == 0\n", name);
+ goto fail;
+--
+2.43.0
+
--- /dev/null
+From cc1955a73d23a7a05eb5d0a714a07e4573d77f6d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 21 Nov 2023 14:03:15 +0100
+Subject: RDMA/IPoIB: Fix error code return in ipoib_mcast_join
+
+From: Jack Wang <jinpu.wang@ionos.com>
+
+[ Upstream commit 753fff78f430704548f45eda52d6d55371a52c0f ]
+
+Return the error code in case of ib_sa_join_multicast fail.
+
+Signed-off-by: Jack Wang <jinpu.wang@ionos.com>
+Link: https://lore.kernel.org/r/20231121130316.126364-2-jinpu.wang@ionos.com
+Signed-off-by: Leon Romanovsky <leon@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/infiniband/ulp/ipoib/ipoib_multicast.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+index 86e4ed64e4e2..5633809dc61e 100644
+--- a/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
++++ b/drivers/infiniband/ulp/ipoib/ipoib_multicast.c
+@@ -557,6 +557,7 @@ static int ipoib_mcast_join(struct net_device *dev, struct ipoib_mcast *mcast)
+ spin_unlock_irq(&priv->lock);
+ complete(&mcast->done);
+ spin_lock_irq(&priv->lock);
++ return ret;
+ }
+ return 0;
+ }
+--
+2.43.0
+
--- /dev/null
+From 83ce26d5a5c9183b37f5f25d38f9295094992059 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 3 Nov 2023 15:42:31 +0800
+Subject: regulator: core: Only increment use_count when enable_count changes
+
+From: Rui Zhang <zr.zhang@vivo.com>
+
+[ Upstream commit 7993d3a9c34f609c02171e115fd12c10e2105ff4 ]
+
+The use_count of a regulator should only be incremented when the
+enable_count changes from 0 to 1. Similarly, the use_count should
+only be decremented when the enable_count changes from 1 to 0.
+
+In the previous implementation, use_count was sometimes decremented
+to 0 when some consumer called unbalanced disable,
+leading to unexpected disable even the regulator is enabled by
+other consumers. With this change, the use_count accurately reflects
+the number of users which the regulator is enabled.
+
+This should make things more robust in the case where a consumer does
+leak references.
+
+Signed-off-by: Rui Zhang <zr.zhang@vivo.com>
+Link: https://lore.kernel.org/r/20231103074231.8031-1-zr.zhang@vivo.com
+Signed-off-by: Mark Brown <broonie@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/regulator/core.c | 56 +++++++++++++++++++++-------------------
+ 1 file changed, 30 insertions(+), 26 deletions(-)
+
+diff --git a/drivers/regulator/core.c b/drivers/regulator/core.c
+index 51c4f604d3b2..54330eb0d03b 100644
+--- a/drivers/regulator/core.c
++++ b/drivers/regulator/core.c
+@@ -2768,7 +2768,8 @@ static int _regulator_enable(struct regulator *regulator)
+ /* Fallthrough on positive return values - already enabled */
+ }
+
+- rdev->use_count++;
++ if (regulator->enable_count == 1)
++ rdev->use_count++;
+
+ return 0;
+
+@@ -2846,37 +2847,40 @@ static int _regulator_disable(struct regulator *regulator)
+
+ lockdep_assert_held_once(&rdev->mutex.base);
+
+- if (WARN(rdev->use_count <= 0,
++ if (WARN(regulator->enable_count == 0,
+ "unbalanced disables for %s\n", rdev_get_name(rdev)))
+ return -EIO;
+
+- /* are we the last user and permitted to disable ? */
+- if (rdev->use_count == 1 &&
+- (rdev->constraints && !rdev->constraints->always_on)) {
+-
+- /* we are last user */
+- if (regulator_ops_is_valid(rdev, REGULATOR_CHANGE_STATUS)) {
+- ret = _notifier_call_chain(rdev,
+- REGULATOR_EVENT_PRE_DISABLE,
+- NULL);
+- if (ret & NOTIFY_STOP_MASK)
+- return -EINVAL;
+-
+- ret = _regulator_do_disable(rdev);
+- if (ret < 0) {
+- rdev_err(rdev, "failed to disable: %pe\n", ERR_PTR(ret));
+- _notifier_call_chain(rdev,
+- REGULATOR_EVENT_ABORT_DISABLE,
++ if (regulator->enable_count == 1) {
++ /* disabling last enable_count from this regulator */
++ /* are we the last user and permitted to disable ? */
++ if (rdev->use_count == 1 &&
++ (rdev->constraints && !rdev->constraints->always_on)) {
++
++ /* we are last user */
++ if (regulator_ops_is_valid(rdev, REGULATOR_CHANGE_STATUS)) {
++ ret = _notifier_call_chain(rdev,
++ REGULATOR_EVENT_PRE_DISABLE,
++ NULL);
++ if (ret & NOTIFY_STOP_MASK)
++ return -EINVAL;
++
++ ret = _regulator_do_disable(rdev);
++ if (ret < 0) {
++ rdev_err(rdev, "failed to disable: %pe\n", ERR_PTR(ret));
++ _notifier_call_chain(rdev,
++ REGULATOR_EVENT_ABORT_DISABLE,
++ NULL);
++ return ret;
++ }
++ _notifier_call_chain(rdev, REGULATOR_EVENT_DISABLE,
+ NULL);
+- return ret;
+ }
+- _notifier_call_chain(rdev, REGULATOR_EVENT_DISABLE,
+- NULL);
+- }
+
+- rdev->use_count = 0;
+- } else if (rdev->use_count > 1) {
+- rdev->use_count--;
++ rdev->use_count = 0;
++ } else if (rdev->use_count > 1) {
++ rdev->use_count--;
++ }
+ }
+
+ if (ret == 0)
+--
+2.43.0
+
--- /dev/null
+From 1551751b3929c7a734abb2e0ef3736c6cddb1000 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 17 Nov 2023 17:48:46 +0100
+Subject: rxrpc_find_service_conn_rcu: fix the usage of read_seqbegin_or_lock()
+
+From: Oleg Nesterov <oleg@redhat.com>
+
+[ Upstream commit bad1a11c0f061aa073bab785389fe04f19ba02e1 ]
+
+rxrpc_find_service_conn_rcu() should make the "seq" counter odd on the
+second pass, otherwise read_seqbegin_or_lock() never takes the lock.
+
+Signed-off-by: Oleg Nesterov <oleg@redhat.com>
+Signed-off-by: David Howells <dhowells@redhat.com>
+cc: Marc Dionne <marc.dionne@auristor.com>
+cc: linux-afs@lists.infradead.org
+Link: https://lore.kernel.org/r/20231117164846.GA10410@redhat.com/
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/rxrpc/conn_service.c | 3 ++-
+ 1 file changed, 2 insertions(+), 1 deletion(-)
+
+diff --git a/net/rxrpc/conn_service.c b/net/rxrpc/conn_service.c
+index 68508166bbc0..af0e95ef992d 100644
+--- a/net/rxrpc/conn_service.c
++++ b/net/rxrpc/conn_service.c
+@@ -31,7 +31,7 @@ struct rxrpc_connection *rxrpc_find_service_conn_rcu(struct rxrpc_peer *peer,
+ struct rxrpc_conn_proto k;
+ struct rxrpc_skb_priv *sp = rxrpc_skb(skb);
+ struct rb_node *p;
+- unsigned int seq = 0;
++ unsigned int seq = 1;
+
+ k.epoch = sp->hdr.epoch;
+ k.cid = sp->hdr.cid & RXRPC_CIDMASK;
+@@ -41,6 +41,7 @@ struct rxrpc_connection *rxrpc_find_service_conn_rcu(struct rxrpc_peer *peer,
+ * under just the RCU read lock, so we have to check for
+ * changes.
+ */
++ seq++; /* 2 on the 1st/lockless path, otherwise odd */
+ read_seqbegin_or_lock(&peer->service_conn_lock, &seq);
+
+ p = rcu_dereference_raw(peer->service_conns.rb_node);
+--
+2.43.0
+
--- /dev/null
+From 23b244393a59ce6a81f97f75fda694b3e190f50f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 30 Nov 2023 18:55:59 +0100
+Subject: s390/ptrace: handle setting of fpc register correctly
+
+From: Heiko Carstens <hca@linux.ibm.com>
+
+[ Upstream commit 8b13601d19c541158a6e18b278c00ba69ae37829 ]
+
+If the content of the floating point control (fpc) register of a traced
+process is modified with the ptrace interface the new value is tested for
+validity by temporarily loading it into the fpc register.
+
+This may lead to corruption of the fpc register of the tracing process:
+if an interrupt happens while the value is temporarily loaded into the
+fpc register, and within interrupt context floating point or vector
+registers are used, the current fp/vx registers are saved with
+save_fpu_regs() assuming they belong to user space and will be loaded into
+fp/vx registers when returning to user space.
+
+test_fp_ctl() restores the original user space fpc register value, however
+it will be discarded, when returning to user space.
+
+In result the tracer will incorrectly continue to run with the value that
+was supposed to be used for the traced process.
+
+Fix this by saving fpu register contents with save_fpu_regs() before using
+test_fp_ctl().
+
+Reviewed-by: Claudio Imbrenda <imbrenda@linux.ibm.com>
+Signed-off-by: Heiko Carstens <hca@linux.ibm.com>
+Signed-off-by: Alexander Gordeev <agordeev@linux.ibm.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/s390/kernel/ptrace.c | 6 +++---
+ 1 file changed, 3 insertions(+), 3 deletions(-)
+
+diff --git a/arch/s390/kernel/ptrace.c b/arch/s390/kernel/ptrace.c
+index 3009bb527252..f381caddd905 100644
+--- a/arch/s390/kernel/ptrace.c
++++ b/arch/s390/kernel/ptrace.c
+@@ -411,6 +411,7 @@ static int __poke_user(struct task_struct *child, addr_t addr, addr_t data)
+ /*
+ * floating point control reg. is in the thread structure
+ */
++ save_fpu_regs();
+ if ((unsigned int) data != 0 ||
+ test_fp_ctl(data >> (BITS_PER_LONG - 32)))
+ return -EINVAL;
+@@ -771,6 +772,7 @@ static int __poke_user_compat(struct task_struct *child,
+ /*
+ * floating point control reg. is in the thread structure
+ */
++ save_fpu_regs();
+ if (test_fp_ctl(tmp))
+ return -EINVAL;
+ child->thread.fpu.fpc = data;
+@@ -1010,9 +1012,7 @@ static int s390_fpregs_set(struct task_struct *target,
+ int rc = 0;
+ freg_t fprs[__NUM_FPRS];
+
+- if (target == current)
+- save_fpu_regs();
+-
++ save_fpu_regs();
+ if (MACHINE_HAS_VX)
+ convert_vx_to_fp(fprs, target->thread.fpu.vxrs);
+ else
+--
+2.43.0
+
--- /dev/null
+From 394d8291a332facf917dd3f0f31d8450d258ee25 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 2 Oct 2023 17:50:27 +0800
+Subject: scsi: arcmsr: Support new PCI device IDs 1883 and 1886
+
+From: ching Huang <ching2048@areca.com.tw>
+
+[ Upstream commit 41c8a1a1e90fa4721f856bf3cf71211fd16d6434 ]
+
+Add support for Areca RAID controllers with PCI device IDs 1883 and 1886.
+
+Signed-off-by: ching Huang <ching2048@areca.com.tw>
+Link: https://lore.kernel.org/r/7732e743eaad57681b1552eec9c6a86c76dbe459.camel@areca.com.tw
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/arcmsr/arcmsr.h | 4 ++++
+ drivers/scsi/arcmsr/arcmsr_hba.c | 6 ++++++
+ 2 files changed, 10 insertions(+)
+
+diff --git a/drivers/scsi/arcmsr/arcmsr.h b/drivers/scsi/arcmsr/arcmsr.h
+index 5d054d5c70a5..f2e587e66e19 100644
+--- a/drivers/scsi/arcmsr/arcmsr.h
++++ b/drivers/scsi/arcmsr/arcmsr.h
+@@ -77,9 +77,13 @@ struct device_attribute;
+ #ifndef PCI_DEVICE_ID_ARECA_1203
+ #define PCI_DEVICE_ID_ARECA_1203 0x1203
+ #endif
++#ifndef PCI_DEVICE_ID_ARECA_1883
++#define PCI_DEVICE_ID_ARECA_1883 0x1883
++#endif
+ #ifndef PCI_DEVICE_ID_ARECA_1884
+ #define PCI_DEVICE_ID_ARECA_1884 0x1884
+ #endif
++#define PCI_DEVICE_ID_ARECA_1886_0 0x1886
+ #define PCI_DEVICE_ID_ARECA_1886 0x188A
+ #define ARCMSR_HOURS (1000 * 60 * 60 * 4)
+ #define ARCMSR_MINUTES (1000 * 60 * 60)
+diff --git a/drivers/scsi/arcmsr/arcmsr_hba.c b/drivers/scsi/arcmsr/arcmsr_hba.c
+index 9294a2c677b3..199b102f31a2 100644
+--- a/drivers/scsi/arcmsr/arcmsr_hba.c
++++ b/drivers/scsi/arcmsr/arcmsr_hba.c
+@@ -208,8 +208,12 @@ static struct pci_device_id arcmsr_device_id_table[] = {
+ .driver_data = ACB_ADAPTER_TYPE_A},
+ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1880),
+ .driver_data = ACB_ADAPTER_TYPE_C},
++ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1883),
++ .driver_data = ACB_ADAPTER_TYPE_C},
+ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1884),
+ .driver_data = ACB_ADAPTER_TYPE_E},
++ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1886_0),
++ .driver_data = ACB_ADAPTER_TYPE_F},
+ {PCI_DEVICE(PCI_VENDOR_ID_ARECA, PCI_DEVICE_ID_ARECA_1886),
+ .driver_data = ACB_ADAPTER_TYPE_F},
+ {0, 0}, /* Terminating entry */
+@@ -4701,9 +4705,11 @@ static const char *arcmsr_info(struct Scsi_Host *host)
+ case PCI_DEVICE_ID_ARECA_1680:
+ case PCI_DEVICE_ID_ARECA_1681:
+ case PCI_DEVICE_ID_ARECA_1880:
++ case PCI_DEVICE_ID_ARECA_1883:
+ case PCI_DEVICE_ID_ARECA_1884:
+ type = "SAS/SATA";
+ break;
++ case PCI_DEVICE_ID_ARECA_1886_0:
+ case PCI_DEVICE_ID_ARECA_1886:
+ type = "NVMe/SAS/SATA";
+ break;
+--
+2.43.0
+
--- /dev/null
+From f99105d036ec38c0c34650ccab130fbe416d790d Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 17:58:30 +0100
+Subject: scsi: libfc: Don't schedule abort twice
+
+From: Hannes Reinecke <hare@suse.de>
+
+[ Upstream commit b57c4db5d23b9df0118a25e2441c9288edd73710 ]
+
+The current FC error recovery is sending up to three REC (recovery) frames
+in 10 second intervals, and as a final step sending an ABTS after 30
+seconds for the command itself. Unfortunately sending an ABTS is also the
+action for the SCSI abort handler, and the default timeout for SCSI
+commands is also 30 seconds. This causes two ABTS to be scheduled, with the
+libfc one slightly earlier. The ABTS scheduled by SCSI EH then sees the
+command to be already aborted, and will always return with a 'GOOD' status
+irrespective on the actual result from the first ABTS. This causes the
+SCSI EH abort handler to always succeed, and SCSI EH never to be engaged.
+Fix this by not issuing an ABTS when a SCSI command is present for the
+exchange, but rather wait for the abort scheduled from SCSI EH. And warn
+if an abort is already scheduled to avoid similar errors in the future.
+
+Signed-off-by: Hannes Reinecke <hare@suse.de>
+Link: https://lore.kernel.org/r/20231129165832.224100-2-hare@kernel.org
+Reviewed-by: Christoph Hellwig <hch@lst.de>
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/libfc/fc_fcp.c | 16 +++++++++++-----
+ 1 file changed, 11 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/scsi/libfc/fc_fcp.c b/drivers/scsi/libfc/fc_fcp.c
+index 7cfeb6886237..6f005ada489b 100644
+--- a/drivers/scsi/libfc/fc_fcp.c
++++ b/drivers/scsi/libfc/fc_fcp.c
+@@ -270,6 +270,11 @@ static int fc_fcp_send_abort(struct fc_fcp_pkt *fsp)
+ if (!fsp->seq_ptr)
+ return -EINVAL;
+
++ if (fsp->state & FC_SRB_ABORT_PENDING) {
++ FC_FCP_DBG(fsp, "abort already pending\n");
++ return -EBUSY;
++ }
++
+ per_cpu_ptr(fsp->lp->stats, get_cpu())->FcpPktAborts++;
+ put_cpu();
+
+@@ -1700,11 +1705,12 @@ static void fc_fcp_recovery(struct fc_fcp_pkt *fsp, u8 code)
+ fsp->status_code = code;
+ fsp->cdb_status = 0;
+ fsp->io_status = 0;
+- /*
+- * if this fails then we let the scsi command timer fire and
+- * scsi-ml escalate.
+- */
+- fc_fcp_send_abort(fsp);
++ if (!fsp->cmd)
++ /*
++ * Only abort non-scsi commands; otherwise let the
++ * scsi command timer fire and scsi-ml escalate.
++ */
++ fc_fcp_send_abort(fsp);
+ }
+
+ /**
+--
+2.43.0
+
--- /dev/null
+From 6180b984fbd1c99e0217665aa47fa86d8a9db2f2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 17:58:31 +0100
+Subject: scsi: libfc: Fix up timeout error in fc_fcp_rec_error()
+
+From: Hannes Reinecke <hare@suse.de>
+
+[ Upstream commit 53122a49f49796beb2c4a1bb702303b66347e29f ]
+
+We should set the status to FC_TIMED_OUT when a timeout error is passed to
+fc_fcp_rec_error().
+
+Signed-off-by: Hannes Reinecke <hare@suse.de>
+Link: https://lore.kernel.org/r/20231129165832.224100-3-hare@kernel.org
+Reviewed-by: Christoph Hellwig <hch@lst.de>
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/libfc/fc_fcp.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/drivers/scsi/libfc/fc_fcp.c b/drivers/scsi/libfc/fc_fcp.c
+index 6f005ada489b..61c12dde967e 100644
+--- a/drivers/scsi/libfc/fc_fcp.c
++++ b/drivers/scsi/libfc/fc_fcp.c
+@@ -1686,7 +1686,7 @@ static void fc_fcp_rec_error(struct fc_fcp_pkt *fsp, struct fc_frame *fp)
+ if (fsp->recov_retry++ < FC_MAX_RECOV_RETRY)
+ fc_fcp_rec(fsp);
+ else
+- fc_fcp_recovery(fsp, FC_ERROR);
++ fc_fcp_recovery(fsp, FC_TIMED_OUT);
+ break;
+ }
+ fc_fcp_unlock_pkt(fsp);
+--
+2.43.0
+
--- /dev/null
+From 55d94d69c07074bccc7d2cd55a57446fbd57c149 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 31 Oct 2023 12:12:17 -0700
+Subject: scsi: lpfc: Fix possible file string name overflow when updating
+ firmware
+
+From: Justin Tee <justin.tee@broadcom.com>
+
+[ Upstream commit f5779b529240b715f0e358489ad0ed933bf77c97 ]
+
+Because file_name and phba->ModelName are both declared a size 80 bytes,
+the extra ".grp" file extension could cause an overflow into file_name.
+
+Define a ELX_FW_NAME_SIZE macro with value 84. 84 incorporates the 4 extra
+characters from ".grp". file_name is changed to be declared as a char and
+initialized to zeros i.e. null chars.
+
+Signed-off-by: Justin Tee <justin.tee@broadcom.com>
+Link: https://lore.kernel.org/r/20231031191224.150862-3-justintee8345@gmail.com
+Reviewed-by: Himanshu Madhani <himanshu.madhani@oracle.com>
+Signed-off-by: Martin K. Petersen <martin.petersen@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/scsi/lpfc/lpfc.h | 1 +
+ drivers/scsi/lpfc/lpfc_init.c | 4 ++--
+ 2 files changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/scsi/lpfc/lpfc.h b/drivers/scsi/lpfc/lpfc.h
+index 03bc472f302a..cf69f831a725 100644
+--- a/drivers/scsi/lpfc/lpfc.h
++++ b/drivers/scsi/lpfc/lpfc.h
+@@ -32,6 +32,7 @@
+ struct lpfc_sli2_slim;
+
+ #define ELX_MODEL_NAME_SIZE 80
++#define ELX_FW_NAME_SIZE 84
+
+ #define LPFC_PCI_DEV_LP 0x1
+ #define LPFC_PCI_DEV_OC 0x2
+diff --git a/drivers/scsi/lpfc/lpfc_init.c b/drivers/scsi/lpfc/lpfc_init.c
+index 1bb3c96a04bd..5f2009327a59 100644
+--- a/drivers/scsi/lpfc/lpfc_init.c
++++ b/drivers/scsi/lpfc/lpfc_init.c
+@@ -13026,7 +13026,7 @@ lpfc_write_firmware(const struct firmware *fw, void *context)
+ int
+ lpfc_sli4_request_firmware_update(struct lpfc_hba *phba, uint8_t fw_upgrade)
+ {
+- uint8_t file_name[ELX_MODEL_NAME_SIZE];
++ char file_name[ELX_FW_NAME_SIZE] = {0};
+ int ret;
+ const struct firmware *fw;
+
+@@ -13035,7 +13035,7 @@ lpfc_sli4_request_firmware_update(struct lpfc_hba *phba, uint8_t fw_upgrade)
+ LPFC_SLI_INTF_IF_TYPE_2)
+ return -EPERM;
+
+- snprintf(file_name, ELX_MODEL_NAME_SIZE, "%s.grp", phba->ModelName);
++ scnprintf(file_name, sizeof(file_name), "%s.grp", phba->ModelName);
+
+ if (fw_upgrade == INT_FW_UPGRADE) {
+ ret = request_firmware_nowait(THIS_MODULE, FW_ACTION_HOTPLUG,
+--
+2.43.0
+
--- /dev/null
+From acbab276dd3fb14978740cdcf3f7adbbda3bb84e Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 10 Nov 2023 11:36:44 -0800
+Subject: selftests/bpf: Fix pyperf180 compilation failure with clang18
+
+From: Yonghong Song <yonghong.song@linux.dev>
+
+[ Upstream commit 100888fb6d8a185866b1520031ee7e3182b173de ]
+
+With latest clang18 (main branch of llvm-project repo), when building bpf selftests,
+ [~/work/bpf-next (master)]$ make -C tools/testing/selftests/bpf LLVM=1 -j
+
+The following compilation error happens:
+ fatal error: error in backend: Branch target out of insn range
+ ...
+ Stack dump:
+ 0. Program arguments: clang -g -Wall -Werror -D__TARGET_ARCH_x86 -mlittle-endian
+ -I/home/yhs/work/bpf-next/tools/testing/selftests/bpf/tools/include
+ -I/home/yhs/work/bpf-next/tools/testing/selftests/bpf -I/home/yhs/work/bpf-next/tools/include/uapi
+ -I/home/yhs/work/bpf-next/tools/testing/selftests/usr/include -idirafter
+ /home/yhs/work/llvm-project/llvm/build.18/install/lib/clang/18/include -idirafter /usr/local/include
+ -idirafter /usr/include -Wno-compare-distinct-pointer-types -DENABLE_ATOMICS_TESTS -O2 --target=bpf
+ -c progs/pyperf180.c -mcpu=v3 -o /home/yhs/work/bpf-next/tools/testing/selftests/bpf/pyperf180.bpf.o
+ 1. <eof> parser at end of file
+ 2. Code generation
+ ...
+
+The compilation failure only happens to cpu=v2 and cpu=v3. cpu=v4 is okay
+since cpu=v4 supports 32-bit branch target offset.
+
+The above failure is due to upstream llvm patch [1] where some inlining behavior
+are changed in clang18.
+
+To workaround the issue, previously all 180 loop iterations are fully unrolled.
+The bpf macro __BPF_CPU_VERSION__ (implemented in clang18 recently) is used to avoid
+unrolling changes if cpu=v4. If __BPF_CPU_VERSION__ is not available and the
+compiler is clang18, the unrollng amount is unconditionally reduced.
+
+ [1] https://github.com/llvm/llvm-project/commit/1a2e77cf9e11dbf56b5720c607313a566eebb16e
+
+Signed-off-by: Yonghong Song <yonghong.song@linux.dev>
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Tested-by: Alan Maguire <alan.maguire@oracle.com>
+Link: https://lore.kernel.org/bpf/20231110193644.3130906-1-yonghong.song@linux.dev
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/progs/pyperf180.c | 22 +++++++++++++++++++
+ 1 file changed, 22 insertions(+)
+
+diff --git a/tools/testing/selftests/bpf/progs/pyperf180.c b/tools/testing/selftests/bpf/progs/pyperf180.c
+index c39f559d3100..42c4a8b62e36 100644
+--- a/tools/testing/selftests/bpf/progs/pyperf180.c
++++ b/tools/testing/selftests/bpf/progs/pyperf180.c
+@@ -1,4 +1,26 @@
+ // SPDX-License-Identifier: GPL-2.0
+ // Copyright (c) 2019 Facebook
+ #define STACK_MAX_LEN 180
++
++/* llvm upstream commit at clang18
++ * https://github.com/llvm/llvm-project/commit/1a2e77cf9e11dbf56b5720c607313a566eebb16e
++ * changed inlining behavior and caused compilation failure as some branch
++ * target distance exceeded 16bit representation which is the maximum for
++ * cpu v1/v2/v3. Macro __BPF_CPU_VERSION__ is later implemented in clang18
++ * to specify which cpu version is used for compilation. So a smaller
++ * unroll_count can be set if __BPF_CPU_VERSION__ is less than 4, which
++ * reduced some branch target distances and resolved the compilation failure.
++ *
++ * To capture the case where a developer/ci uses clang18 but the corresponding
++ * repo checkpoint does not have __BPF_CPU_VERSION__, a smaller unroll_count
++ * will be set as well to prevent potential compilation failures.
++ */
++#ifdef __BPF_CPU_VERSION__
++#if __BPF_CPU_VERSION__ < 4
++#define UNROLL_COUNT 90
++#endif
++#elif __clang_major__ == 18
++#define UNROLL_COUNT 90
++#endif
++
+ #include "pyperf.h"
+--
+2.43.0
+
--- /dev/null
+From e8940a7ee48cba9a2aa5844b1e6a29a9f4943163 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 1 Nov 2023 20:37:44 -0700
+Subject: selftests/bpf: satisfy compiler by having explicit return in btf test
+
+From: Andrii Nakryiko <andrii@kernel.org>
+
+[ Upstream commit f4c7e887324f5776eef6e6e47a90e0ac8058a7a8 ]
+
+Some compilers complain about get_pprint_mapv_size() not returning value
+in some code paths. Fix with explicit return.
+
+Signed-off-by: Andrii Nakryiko <andrii@kernel.org>
+Link: https://lore.kernel.org/r/20231102033759.2541186-3-andrii@kernel.org
+Signed-off-by: Alexei Starovoitov <ast@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ tools/testing/selftests/bpf/prog_tests/btf.c | 1 +
+ 1 file changed, 1 insertion(+)
+
+diff --git a/tools/testing/selftests/bpf/prog_tests/btf.c b/tools/testing/selftests/bpf/prog_tests/btf.c
+index 28d22265b825..cbdc2839904e 100644
+--- a/tools/testing/selftests/bpf/prog_tests/btf.c
++++ b/tools/testing/selftests/bpf/prog_tests/btf.c
+@@ -4611,6 +4611,7 @@ static size_t get_pprint_mapv_size(enum pprint_mapv_kind_t mapv_kind)
+ #endif
+
+ assert(0);
++ return 0;
+ }
+
+ static void set_pprint_mapv(enum pprint_mapv_kind_t mapv_kind,
+--
+2.43.0
+
tick-sched-preserve-number-of-idle-sleeps-across-cpu-hotplug-events.patch
x86-entry-ia32-ensure-s32-is-sign-extended-to-s64.patch
cifs-fix-off-by-one-in-smb2_query_info_init.patch
+powerpc-mm-fix-null-pointer-dereference-in-pgtable_c.patch
+drivers-perf-pmuv3-don-t-expose-sw_incr-event-in-sys.patch
+powerpc-fix-build-error-due-to-is_valid_bugaddr.patch
+powerpc-mm-fix-build-failures-due-to-arch_reserved_k.patch
+x86-boot-ignore-nmis-during-very-early-boot.patch
+powerpc-pmd_move_must_withdraw-is-only-needed-for-co.patch
+powerpc-lib-validate-size-for-vector-operations.patch
+x86-mce-mark-fatal-mce-s-page-as-poison-to-avoid-pan.patch
+perf-core-fix-narrow-startup-race-when-creating-the-.patch
+debugobjects-stop-accessing-objects-after-releasing-.patch
+regulator-core-only-increment-use_count-when-enable_.patch
+audit-send-netlink-ack-before-setting-connection-in-.patch
+acpi-video-add-quirk-for-the-colorful-x15-at-23-lapt.patch
+pnp-acpi-fix-fortify-warning.patch
+acpi-extlog-fix-null-pointer-dereference-check.patch
+pm-devfreq-synchronize-devfreq_monitor_-start-stop.patch
+acpi-apei-set-memory-failure-flags-as-mf_action_requ.patch
+fs-jfs-ubsan-array-index-out-of-bounds-in-dbadjtree.patch
+ubsan-array-index-out-of-bounds-in-dtsplitroot.patch
+jfs-fix-slab-out-of-bounds-read-in-dtsearch.patch
+jfs-fix-array-index-out-of-bounds-in-dbadjtree.patch
+jfs-fix-uaf-in-jfs_evict_inode.patch
+pstore-ram-fix-crash-when-setting-number-of-cpus-to-.patch
+crypto-stm32-crc32-fix-parsing-list-of-devices.patch
+afs-fix-the-usage-of-read_seqbegin_or_lock-in-afs_lo.patch
+afs-fix-the-usage-of-read_seqbegin_or_lock-in-afs_fi.patch
+rxrpc_find_service_conn_rcu-fix-the-usage-of-read_se.patch
+jfs-fix-array-index-out-of-bounds-in-dinewext.patch
+hexagon-make-pfn-accessors-statics-inlines.patch
+s390-ptrace-handle-setting-of-fpc-register-correctly.patch
+kvm-s390-fix-setting-of-fpc-register.patch
+sunrpc-fix-a-suspicious-rcu-usage-warning.patch
+ecryptfs-reject-casefold-directory-inodes.patch
+ext4-fix-inconsistent-between-segment-fstrim-and-ful.patch
+ext4-unify-the-type-of-flexbg_size-to-unsigned-int.patch
+ext4-remove-unnecessary-check-from-alloc_flex_gd.patch
+ext4-avoid-online-resizing-failures-due-to-oversized.patch
+wifi-rt2x00-restart-beacon-queue-when-hardware-reset.patch
+selftests-bpf-satisfy-compiler-by-having-explicit-re.patch
+selftests-bpf-fix-pyperf180-compilation-failure-with.patch
+scsi-lpfc-fix-possible-file-string-name-overflow-whe.patch
+pci-add-no-pm-reset-quirk-for-nvidia-spectrum-device.patch
+bonding-return-enomem-instead-of-bug-in-alb_upper_de.patch
+scsi-arcmsr-support-new-pci-device-ids-1883-and-1886.patch
+arm-dts-imx7d-fix-coresight-funnel-ports.patch
+arm-dts-imx7s-fix-lcdif-compatible.patch
+arm-dts-imx7s-fix-nand-controller-size-cells.patch
+wifi-ath9k-fix-potential-array-index-out-of-bounds-r.patch
+bpf-add-map-and-need_defer-parameters-to-.map_fd_put.patch
+scsi-libfc-don-t-schedule-abort-twice.patch
+scsi-libfc-fix-up-timeout-error-in-fc_fcp_rec_error.patch
+net-mvmdio-avoid-excessive-sleeps-in-polled-mode.patch
+bpf-set-uattr-batch.count-as-zero-before-batched-upd.patch
+arm-dts-rockchip-fix-rk3036-hdmi-ports-node.patch
+arm-dts-imx25-27-eukrea-fix-rtc-node-name.patch
+arm-dts-imx-use-flash-0-0-pattern.patch
+arm-dts-imx27-fix-sram-node.patch
+arm-dts-imx1-fix-sram-node.patch
+ionic-pass-opcode-to-devcmd_wait.patch
+block-rnbd-srv-check-for-unlikely-string-overflow.patch
+arm-dts-imx25-fix-the-iim-compatible-string.patch
+arm-dts-imx25-27-pass-timing0.patch
+arm-dts-imx27-apf27dev-fix-led-name.patch
+arm-dts-imx23-sansa-use-preferred-i2c-gpios-properti.patch
+arm-dts-imx23-28-fix-the-dma-controller-node-name.patch
+net-dsa-mv88e6xxx-fix-mv88e6352_serdes_get_stats-err.patch
+block-prevent-an-integer-overflow-in-bvec_try_merge_.patch
+md-whenassemble-the-array-consult-the-superblock-of-.patch
+arm64-dts-qcom-msm8996-fix-in-ports-is-a-required-pr.patch
+arm64-dts-qcom-msm8998-fix-out-ports-is-a-required-p.patch
+wifi-rtl8xxxu-add-additional-usb-ids-for-rtl8192eu-d.patch
+libbpf-fix-null-pointer-dereference-in-bpf_object__c.patch
+wifi-rtlwifi-rtl8723-be-ae-using-calculate_bit_shift.patch
+wifi-cfg80211-free-beacon_ies-when-overridden-from-h.patch
+bluetooth-qca-set-both-wideband_speech-and-le_states.patch
+bluetooth-l2cap-fix-possible-multiple-reject-send.patch
+i40e-fix-vf-disable-behavior-to-block-all-traffic.patch
+f2fs-fix-to-check-return-value-of-f2fs_reserve_new_b.patch
+alsa-hda-refer-to-correct-stream-index-at-loops.patch
+asoc-doc-fix-undefined-snd_soc_dapm_nopm-argument.patch
+drm-fix-color-lut-rounding.patch
+fast_dput-handle-underflows-gracefully.patch
+rdma-ipoib-fix-error-code-return-in-ipoib_mcast_join.patch
+drm-amd-display-fix-tiled-display-misalignment.patch
+f2fs-fix-write-pointers-on-zoned-device-after-roll-f.patch
+drm-drm_file-fix-use-of-uninitialized-variable.patch
+drm-framebuffer-fix-use-of-uninitialized-variable.patch
+drm-mipi-dsi-fix-detach-call-without-attach.patch
+media-stk1160-fixed-high-volume-of-stk1160_dbg-messa.patch
+media-rockchip-rga-fix-swizzling-for-rgb-formats.patch
+pci-add-intel_hda_arl-to-pci_ids.h.patch
+alsa-hda-intel-add-hda_arl-pci-id-support.patch
+alsa-hda-intel-dspcfg-add-filters-for-arl-s-and-arl.patch
+hwmon-pc87360-bounds-check-data-innr-usage.patch
+drm-exynos-call-drm_atomic_helper_shutdown-at-shutdo.patch
+ib-ipoib-fix-mcast-list-locking.patch
+media-ddbridge-fix-an-error-code-problem-in-ddb_prob.patch
+drm-msm-dpu-ratelimit-framedone-timeout-msgs.patch
+clk-hi3620-fix-memory-leak-in-hi3620_mmc_clk_init.patch
+clk-mmp-pxa168-fix-memory-leak-in-pxa168_clk_init.patch
+watchdog-it87_wdt-keep-wdtctrl-bit-3-unmodified-for-.patch
+drm-amd-display-make-flip_timestamp_in_us-a-64-bit-v.patch
+drm-amdgpu-let-kfd-sync-with-vm-fences.patch
+drm-amdgpu-drop-fence-check-in-to_amdgpu_amdkfd_fenc.patch
+leds-trigger-panic-don-t-register-panic-notifier-if-.patch
+um-fix-naming-clash-between-uml-and-scheduler.patch
+um-don-t-use-vfprintf-for-os_info.patch
+um-net-fix-return-type-of-uml_net_start_xmit.patch
+i3c-master-cdns-update-maximum-prescaler-value-for-i.patch
+xen-gntdev-fix-the-abuse-of-underlying-struct-page-i.patch
+mfd-ti_am335x_tscadc-fix-ti-soc-dependencies.patch
+pci-only-override-amd-usb-controller-if-required.patch
+pci-switchtec-fix-stdev_release-crash-after-surprise.patch
+usb-hub-replace-hardcoded-quirk-value-with-bit-macro.patch
+tty-allow-tiocslcktrmios-with-cap_checkpoint_restore.patch
+fs-kernfs-dir-obey-s_isgid.patch
+pci-aer-decode-requester-id-when-no-error-info-found.patch
+misc-lis3lv02d_i2c-add-missing-setting-of-the-reg_ct.patch
+libsubcmd-fix-memory-leak-in-uniq.patch
+virtio_net-fix-d-directive-writing-between-1-and-11-.patch
+blk-mq-fix-io-hang-from-sbitmap-wakeup-race.patch
+ceph-fix-deadlock-or-deadcode-of-misusing-dget.patch
+drm-amd-powerplay-fix-kzalloc-parameter-atom_tonga_p.patch
+drm-amdgpu-release-adev-pm.fw-before-return-in-amdgp.patch
+perf-fix-the-nr_addr_filters-fix.patch
+wifi-cfg80211-fix-rcu-dereference-in-__cfg80211_bss_.patch
+drm-using-mul_u32_u32-requires-linux-math64.h.patch
--- /dev/null
+From aeec7d244bf68a6014c733ca03ca27fe4478b814 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Mon, 27 Nov 2023 17:06:18 -0500
+Subject: SUNRPC: Fix a suspicious RCU usage warning
+
+From: Anna Schumaker <Anna.Schumaker@Netapp.com>
+
+[ Upstream commit 31b62908693c90d4d07db597e685d9f25a120073 ]
+
+I received the following warning while running cthon against an ontap
+server running pNFS:
+
+[ 57.202521] =============================
+[ 57.202522] WARNING: suspicious RCU usage
+[ 57.202523] 6.7.0-rc3-g2cc14f52aeb7 #41492 Not tainted
+[ 57.202525] -----------------------------
+[ 57.202525] net/sunrpc/xprtmultipath.c:349 RCU-list traversed in non-reader section!!
+[ 57.202527]
+ other info that might help us debug this:
+
+[ 57.202528]
+ rcu_scheduler_active = 2, debug_locks = 1
+[ 57.202529] no locks held by test5/3567.
+[ 57.202530]
+ stack backtrace:
+[ 57.202532] CPU: 0 PID: 3567 Comm: test5 Not tainted 6.7.0-rc3-g2cc14f52aeb7 #41492 5b09971b4965c0aceba19f3eea324a4a806e227e
+[ 57.202534] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS unknown 2/2/2022
+[ 57.202536] Call Trace:
+[ 57.202537] <TASK>
+[ 57.202540] dump_stack_lvl+0x77/0xb0
+[ 57.202551] lockdep_rcu_suspicious+0x154/0x1a0
+[ 57.202556] rpc_xprt_switch_has_addr+0x17c/0x190 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202596] rpc_clnt_setup_test_and_add_xprt+0x50/0x180 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202621] ? rpc_clnt_add_xprt+0x254/0x300 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202646] rpc_clnt_add_xprt+0x27a/0x300 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202671] ? __pfx_rpc_clnt_setup_test_and_add_xprt+0x10/0x10 [sunrpc ebe02571b9a8ceebf7d98e71675af20c19bdb1f6]
+[ 57.202696] nfs4_pnfs_ds_connect+0x345/0x760 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202728] ? __pfx_nfs4_test_session_trunk+0x10/0x10 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202754] nfs4_fl_prepare_ds+0x75/0xc0 [nfs_layout_nfsv41_files e3a4187f18ae8a27b630f9feae6831b584a9360a]
+[ 57.202760] filelayout_write_pagelist+0x4a/0x200 [nfs_layout_nfsv41_files e3a4187f18ae8a27b630f9feae6831b584a9360a]
+[ 57.202765] pnfs_generic_pg_writepages+0xbe/0x230 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202788] __nfs_pageio_add_request+0x3fd/0x520 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202813] nfs_pageio_add_request+0x18b/0x390 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202831] nfs_do_writepage+0x116/0x1e0 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202849] nfs_writepages_callback+0x13/0x30 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202866] write_cache_pages+0x265/0x450
+[ 57.202870] ? __pfx_nfs_writepages_callback+0x10/0x10 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202891] nfs_writepages+0x141/0x230 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202913] do_writepages+0xd2/0x230
+[ 57.202917] ? filemap_fdatawrite_wbc+0x5c/0x80
+[ 57.202921] filemap_fdatawrite_wbc+0x67/0x80
+[ 57.202924] filemap_write_and_wait_range+0xd9/0x170
+[ 57.202930] nfs_wb_all+0x49/0x180 [nfs 6c976fa593a7c2976f5a0aeb4965514a828e6902]
+[ 57.202947] nfs4_file_flush+0x72/0xb0 [nfsv4 c716d88496ded0ea6d289bbea684fa996f9b57a9]
+[ 57.202969] __se_sys_close+0x46/0xd0
+[ 57.202972] do_syscall_64+0x68/0x100
+[ 57.202975] ? do_syscall_64+0x77/0x100
+[ 57.202976] ? do_syscall_64+0x77/0x100
+[ 57.202979] entry_SYSCALL_64_after_hwframe+0x6e/0x76
+[ 57.202982] RIP: 0033:0x7fe2b12e4a94
+[ 57.202985] Code: 00 f7 d8 64 89 01 48 83 c8 ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa 80 3d d5 18 0e 00 00 74 13 b8 03 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 44 c3 0f 1f 00 48 83 ec 18 89 7c 24 0c e8 c3
+[ 57.202987] RSP: 002b:00007ffe857ddb38 EFLAGS: 00000202 ORIG_RAX: 0000000000000003
+[ 57.202989] RAX: ffffffffffffffda RBX: 00007ffe857dfd68 RCX: 00007fe2b12e4a94
+[ 57.202991] RDX: 0000000000002000 RSI: 00007ffe857ddc40 RDI: 0000000000000003
+[ 57.202992] RBP: 00007ffe857dfc50 R08: 7fffffffffffffff R09: 0000000065650f49
+[ 57.202993] R10: 00007fe2b11f8300 R11: 0000000000000202 R12: 0000000000000000
+[ 57.202994] R13: 00007ffe857dfd80 R14: 00007fe2b1445000 R15: 0000000000000000
+[ 57.202999] </TASK>
+
+The problem seems to be that two out of three callers aren't taking the
+rcu_read_lock() before calling the list_for_each_entry_rcu() function in
+rpc_xprt_switch_has_addr(). I fix this by having
+rpc_xprt_switch_has_addr() unconditionaly take the rcu_read_lock(),
+which is okay to do recursively in the case that the lock has already
+been taken by a caller.
+
+Reviewed-by: Jeff Layton <jlayton@kernel.org>
+Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/sunrpc/xprtmultipath.c | 17 +++++++++++++++--
+ 1 file changed, 15 insertions(+), 2 deletions(-)
+
+diff --git a/net/sunrpc/xprtmultipath.c b/net/sunrpc/xprtmultipath.c
+index 78c075a68c04..a11e80d17830 100644
+--- a/net/sunrpc/xprtmultipath.c
++++ b/net/sunrpc/xprtmultipath.c
+@@ -253,8 +253,9 @@ struct rpc_xprt *xprt_iter_current_entry(struct rpc_xprt_iter *xpi)
+ return xprt_switch_find_current_entry(head, xpi->xpi_cursor);
+ }
+
+-bool rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
+- const struct sockaddr *sap)
++static
++bool __rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
++ const struct sockaddr *sap)
+ {
+ struct list_head *head;
+ struct rpc_xprt *pos;
+@@ -273,6 +274,18 @@ bool rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
+ return false;
+ }
+
++bool rpc_xprt_switch_has_addr(struct rpc_xprt_switch *xps,
++ const struct sockaddr *sap)
++{
++ bool res;
++
++ rcu_read_lock();
++ res = __rpc_xprt_switch_has_addr(xps, sap);
++ rcu_read_unlock();
++
++ return res;
++}
++
+ static
+ struct rpc_xprt *xprt_switch_find_next_entry(struct list_head *head,
+ const struct rpc_xprt *cur)
+--
+2.43.0
+
--- /dev/null
+From f34988d5f48064fd0e192bb31a752a2aedd9b767 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 8 Dec 2023 15:36:56 +0100
+Subject: tty: allow TIOCSLCKTRMIOS with CAP_CHECKPOINT_RESTORE
+
+From: Adrian Reber <areber@redhat.com>
+
+[ Upstream commit e0f25b8992345aa5f113da2815f5add98738c611 ]
+
+The capability CAP_CHECKPOINT_RESTORE was introduced to allow non-root
+users to checkpoint and restore processes as non-root with CRIU.
+
+This change extends CAP_CHECKPOINT_RESTORE to enable the CRIU option
+'--shell-job' as non-root. CRIU's man-page describes the '--shell-job'
+option like this:
+
+ Allow one to dump shell jobs. This implies the restored task will
+ inherit session and process group ID from the criu itself. This option
+ also allows to migrate a single external tty connection, to migrate
+ applications like top.
+
+TIOCSLCKTRMIOS can only be done if the process has CAP_SYS_ADMIN and
+this change extends it to CAP_SYS_ADMIN or CAP_CHECKPOINT_RESTORE.
+
+With this change it is possible to checkpoint and restore processes
+which have a tty connection as non-root if CAP_CHECKPOINT_RESTORE is
+set.
+
+Acked-by: Christian Brauner <brauner@kernel.org>
+Signed-off-by: Adrian Reber <areber@redhat.com>
+Acked-by: Andrei Vagin <avagin@gmail.com>
+Link: https://lore.kernel.org/r/20231208143656.1019-1-areber@redhat.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/tty/tty_ioctl.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/tty/tty_ioctl.c b/drivers/tty/tty_ioctl.c
+index 12a30329abdb..7ae2630cb750 100644
+--- a/drivers/tty/tty_ioctl.c
++++ b/drivers/tty/tty_ioctl.c
+@@ -763,7 +763,7 @@ int tty_mode_ioctl(struct tty_struct *tty, struct file *file,
+ ret = -EFAULT;
+ return ret;
+ case TIOCSLCKTRMIOS:
+- if (!capable(CAP_SYS_ADMIN))
++ if (!checkpoint_restore_ns_capable(&init_user_ns))
+ return -EPERM;
+ copy_termios_locked(real_tty, &kterm);
+ if (user_termios_to_kernel_termios(&kterm,
+@@ -780,7 +780,7 @@ int tty_mode_ioctl(struct tty_struct *tty, struct file *file,
+ ret = -EFAULT;
+ return ret;
+ case TIOCSLCKTRMIOS:
+- if (!capable(CAP_SYS_ADMIN))
++ if (!checkpoint_restore_ns_capable(&init_user_ns))
+ return -EPERM;
+ copy_termios_locked(real_tty, &kterm);
+ if (user_termios_to_kernel_termios_1(&kterm,
+--
+2.43.0
+
--- /dev/null
+From 2affcca4705e4a51a4305f43b3aa2841cda7a52f Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 14 Oct 2023 00:10:28 +0500
+Subject: UBSAN: array-index-out-of-bounds in dtSplitRoot
+
+From: Osama Muhammad <osmtendev@gmail.com>
+
+[ Upstream commit 27e56f59bab5ddafbcfe69ad7a4a6ea1279c1b16 ]
+
+Syzkaller reported the following issue:
+
+oop0: detected capacity change from 0 to 32768
+
+UBSAN: array-index-out-of-bounds in fs/jfs/jfs_dtree.c:1971:9
+index -2 is out of range for type 'struct dtslot [128]'
+CPU: 0 PID: 3613 Comm: syz-executor270 Not tainted 6.0.0-syzkaller-09423-g493ffd6605b2 #0
+Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 09/22/2022
+Call Trace:
+ <TASK>
+ __dump_stack lib/dump_stack.c:88 [inline]
+ dump_stack_lvl+0x1b1/0x28e lib/dump_stack.c:106
+ ubsan_epilogue lib/ubsan.c:151 [inline]
+ __ubsan_handle_out_of_bounds+0xdb/0x130 lib/ubsan.c:283
+ dtSplitRoot+0x8d8/0x1900 fs/jfs/jfs_dtree.c:1971
+ dtSplitUp fs/jfs/jfs_dtree.c:985 [inline]
+ dtInsert+0x1189/0x6b80 fs/jfs/jfs_dtree.c:863
+ jfs_mkdir+0x757/0xb00 fs/jfs/namei.c:270
+ vfs_mkdir+0x3b3/0x590 fs/namei.c:4013
+ do_mkdirat+0x279/0x550 fs/namei.c:4038
+ __do_sys_mkdirat fs/namei.c:4053 [inline]
+ __se_sys_mkdirat fs/namei.c:4051 [inline]
+ __x64_sys_mkdirat+0x85/0x90 fs/namei.c:4051
+ do_syscall_x64 arch/x86/entry/common.c:50 [inline]
+ do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80
+ entry_SYSCALL_64_after_hwframe+0x63/0xcd
+RIP: 0033:0x7fcdc0113fd9
+Code: ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 0f 1f 40 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 c0 ff ff ff f7 d8 64 89 01 48
+RSP: 002b:00007ffeb8bc67d8 EFLAGS: 00000246 ORIG_RAX: 0000000000000102
+RAX: ffffffffffffffda RBX: 0000000000000000 RCX: 00007fcdc0113fd9
+RDX: 0000000000000000 RSI: 0000000020000340 RDI: 0000000000000003
+RBP: 00007fcdc00d37a0 R08: 0000000000000000 R09: 00007fcdc00d37a0
+R10: 00005555559a72c0 R11: 0000000000000246 R12: 00000000f8008000
+R13: 0000000000000000 R14: 00083878000000f8 R15: 0000000000000000
+ </TASK>
+
+The issue is caused when the value of fsi becomes less than -1.
+The check to break the loop when fsi value becomes -1 is present
+but syzbot was able to produce value less than -1 which cause the error.
+This patch simply add the change for the values less than 0.
+
+The patch is tested via syzbot.
+
+Reported-and-tested-by: syzbot+d4b1df2e9d4ded6488ec@syzkaller.appspotmail.com
+Link: https://syzkaller.appspot.com/bug?extid=d4b1df2e9d4ded6488ec
+Signed-off-by: Osama Muhammad <osmtendev@gmail.com>
+Signed-off-by: Dave Kleikamp <dave.kleikamp@oracle.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ fs/jfs/jfs_dtree.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/fs/jfs/jfs_dtree.c b/fs/jfs/jfs_dtree.c
+index 837d42f61464..fafcb90219cf 100644
+--- a/fs/jfs/jfs_dtree.c
++++ b/fs/jfs/jfs_dtree.c
+@@ -1970,7 +1970,7 @@ static int dtSplitRoot(tid_t tid,
+ do {
+ f = &rp->slot[fsi];
+ fsi = f->next;
+- } while (fsi != -1);
++ } while (fsi >= 0);
+
+ f->next = n;
+ }
+--
+2.43.0
+
--- /dev/null
+From ffaafa3ae5475f001cc07801b7f57491d8673e03 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Fri, 10 Nov 2023 12:03:41 +0100
+Subject: um: Don't use vfprintf() for os_info()
+
+From: Benjamin Berg <benjamin@sipsolutions.net>
+
+[ Upstream commit 236f9fe39b02c15fa5530b53e9cca48354394389 ]
+
+The threads allocated inside the kernel have only a single page of
+stack. Unfortunately, the vfprintf function in standard glibc may use
+too much stack-space, overflowing it.
+
+To make os_info safe to be used by helper threads, use the kernel
+vscnprintf function into a smallish buffer and write out the information
+to stderr.
+
+Signed-off-by: Benjamin Berg <benjamin@sipsolutions.net>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/os-Linux/util.c | 19 +++++++++++++++++--
+ 1 file changed, 17 insertions(+), 2 deletions(-)
+
+diff --git a/arch/um/os-Linux/util.c b/arch/um/os-Linux/util.c
+index 07327425d06e..56d9589e1cd1 100644
+--- a/arch/um/os-Linux/util.c
++++ b/arch/um/os-Linux/util.c
+@@ -166,23 +166,38 @@ __uml_setup("quiet", quiet_cmd_param,
+ "quiet\n"
+ " Turns off information messages during boot.\n\n");
+
++/*
++ * The os_info/os_warn functions will be called by helper threads. These
++ * have a very limited stack size and using the libc formatting functions
++ * may overflow the stack.
++ * So pull in the kernel vscnprintf and use that instead with a fixed
++ * on-stack buffer.
++ */
++int vscnprintf(char *buf, size_t size, const char *fmt, va_list args);
++
+ void os_info(const char *fmt, ...)
+ {
++ char buf[256];
+ va_list list;
++ int len;
+
+ if (quiet_info)
+ return;
+
+ va_start(list, fmt);
+- vfprintf(stderr, fmt, list);
++ len = vscnprintf(buf, sizeof(buf), fmt, list);
++ fwrite(buf, len, 1, stderr);
+ va_end(list);
+ }
+
+ void os_warn(const char *fmt, ...)
+ {
++ char buf[256];
+ va_list list;
++ int len;
+
+ va_start(list, fmt);
+- vfprintf(stderr, fmt, list);
++ len = vscnprintf(buf, sizeof(buf), fmt, list);
++ fwrite(buf, len, 1, stderr);
+ va_end(list);
+ }
+--
+2.43.0
+
--- /dev/null
+From f73bfff3aaaec40caaa2c961f09c83541049ec69 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 21 Sep 2023 15:34:44 +0100
+Subject: um: Fix naming clash between UML and scheduler
+
+From: Anton Ivanov <anton.ivanov@cambridgegreys.com>
+
+[ Upstream commit 541d4e4d435c8b9bfd29f70a1da4a2db97794e0a ]
+
+__cant_sleep was already used and exported by the scheduler.
+The name had to be changed to a UML specific one.
+
+Signed-off-by: Anton Ivanov <anton.ivanov@cambridgegreys.com>
+Reviewed-by: Peter Lafreniere <peter@n8pjl.ca>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/include/shared/kern_util.h | 2 +-
+ arch/um/kernel/process.c | 2 +-
+ arch/um/os-Linux/helper.c | 6 +++---
+ 3 files changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/arch/um/include/shared/kern_util.h b/arch/um/include/shared/kern_util.h
+index 9c08e728a675..83171f9e0912 100644
+--- a/arch/um/include/shared/kern_util.h
++++ b/arch/um/include/shared/kern_util.h
+@@ -51,7 +51,7 @@ extern void do_uml_exitcalls(void);
+ * Are we disallowed to sleep? Used to choose between GFP_KERNEL and
+ * GFP_ATOMIC.
+ */
+-extern int __cant_sleep(void);
++extern int __uml_cant_sleep(void);
+ extern int get_current_pid(void);
+ extern int copy_from_user_proc(void *to, void *from, int size);
+ extern int cpu(void);
+diff --git a/arch/um/kernel/process.c b/arch/um/kernel/process.c
+index e6c9b11b2033..76faaf1082ce 100644
+--- a/arch/um/kernel/process.c
++++ b/arch/um/kernel/process.c
+@@ -221,7 +221,7 @@ void arch_cpu_idle(void)
+ raw_local_irq_enable();
+ }
+
+-int __cant_sleep(void) {
++int __uml_cant_sleep(void) {
+ return in_atomic() || irqs_disabled() || in_interrupt();
+ /* Is in_interrupt() really needed? */
+ }
+diff --git a/arch/um/os-Linux/helper.c b/arch/um/os-Linux/helper.c
+index 9fa6e4187d4f..57a27555092f 100644
+--- a/arch/um/os-Linux/helper.c
++++ b/arch/um/os-Linux/helper.c
+@@ -45,7 +45,7 @@ int run_helper(void (*pre_exec)(void *), void *pre_data, char **argv)
+ unsigned long stack, sp;
+ int pid, fds[2], ret, n;
+
+- stack = alloc_stack(0, __cant_sleep());
++ stack = alloc_stack(0, __uml_cant_sleep());
+ if (stack == 0)
+ return -ENOMEM;
+
+@@ -69,7 +69,7 @@ int run_helper(void (*pre_exec)(void *), void *pre_data, char **argv)
+ data.pre_data = pre_data;
+ data.argv = argv;
+ data.fd = fds[1];
+- data.buf = __cant_sleep() ? uml_kmalloc(PATH_MAX, UM_GFP_ATOMIC) :
++ data.buf = __uml_cant_sleep() ? uml_kmalloc(PATH_MAX, UM_GFP_ATOMIC) :
+ uml_kmalloc(PATH_MAX, UM_GFP_KERNEL);
+ pid = clone(helper_child, (void *) sp, CLONE_VM, &data);
+ if (pid < 0) {
+@@ -116,7 +116,7 @@ int run_helper_thread(int (*proc)(void *), void *arg, unsigned int flags,
+ unsigned long stack, sp;
+ int pid, status, err;
+
+- stack = alloc_stack(0, __cant_sleep());
++ stack = alloc_stack(0, __uml_cant_sleep());
+ if (stack == 0)
+ return -ENOMEM;
+
+--
+2.43.0
+
--- /dev/null
+From 0fc09f04a979a752ee13a527ff19c32a1e6e53f2 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 6 Dec 2023 09:49:46 -0700
+Subject: um: net: Fix return type of uml_net_start_xmit()
+
+From: Nathan Chancellor <nathan@kernel.org>
+
+[ Upstream commit 7d748f60a4b82b50bf25fad1bd42d33f049f76aa ]
+
+With clang's kernel control flow integrity (kCFI, CONFIG_CFI_CLANG),
+indirect call targets are validated against the expected function
+pointer prototype to make sure the call target is valid to help mitigate
+ROP attacks. If they are not identical, there is a failure at run time,
+which manifests as either a kernel panic or thread getting killed. A
+warning in clang aims to catch these at compile time, which reveals:
+
+ arch/um/drivers/net_kern.c:353:21: warning: incompatible function pointer types initializing 'netdev_tx_t (*)(struct sk_buff *, struct net_device *)' (aka 'enum netdev_tx (*)(struct sk_buff *, struct net_device *)') with an expression of type 'int (struct sk_buff *, struct net_device *)' [-Wincompatible-function-pointer-types-strict]
+ 353 | .ndo_start_xmit = uml_net_start_xmit,
+ | ^~~~~~~~~~~~~~~~~~
+ 1 warning generated.
+
+->ndo_start_xmit() in 'struct net_device_ops' expects a return type of
+'netdev_tx_t', not 'int'. Adjust the return type of uml_net_start_xmit()
+to match the prototype's to resolve the warning. While UML does not
+currently implement support for kCFI, it could in the future, which
+means this warning becomes a fatal CFI failure at run time.
+
+Reported-by: kernel test robot <lkp@intel.com>
+Closes: https://lore.kernel.org/oe-kbuild-all/202310031340.v1vPh207-lkp@intel.com/
+Acked-by: Anton Ivanov <anton.ivanov@cambridgegreys.com>
+Signed-off-by: Nathan Chancellor <nathan@kernel.org>
+Signed-off-by: Richard Weinberger <richard@nod.at>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/um/drivers/net_kern.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/arch/um/drivers/net_kern.c b/arch/um/drivers/net_kern.c
+index 1802cf4ef5a5..ee55333255d0 100644
+--- a/arch/um/drivers/net_kern.c
++++ b/arch/um/drivers/net_kern.c
+@@ -204,7 +204,7 @@ static int uml_net_close(struct net_device *dev)
+ return 0;
+ }
+
+-static int uml_net_start_xmit(struct sk_buff *skb, struct net_device *dev)
++static netdev_tx_t uml_net_start_xmit(struct sk_buff *skb, struct net_device *dev)
+ {
+ struct uml_net_private *lp = netdev_priv(dev);
+ unsigned long flags;
+--
+2.43.0
+
--- /dev/null
+From 024855d26852d63554603cceda7af8b3e1295266 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 5 Dec 2023 19:18:28 +0100
+Subject: usb: hub: Replace hardcoded quirk value with BIT() macro
+
+From: Hardik Gajjar <hgajjar@de.adit-jv.com>
+
+[ Upstream commit 6666ea93d2c422ebeb8039d11e642552da682070 ]
+
+This patch replaces the hardcoded quirk value in the macro with
+BIT().
+
+Signed-off-by: Hardik Gajjar <hgajjar@de.adit-jv.com>
+Reviewed-by: Alan Stern <stern@rowland.harvard.edu>
+Link: https://lore.kernel.org/r/20231205181829.127353-1-hgajjar@de.adit-jv.com
+Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/usb/core/hub.c | 4 ++--
+ 1 file changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/usb/core/hub.c b/drivers/usb/core/hub.c
+index 331f41c6cc75..a3a7dd7d3326 100644
+--- a/drivers/usb/core/hub.c
++++ b/drivers/usb/core/hub.c
+@@ -46,8 +46,8 @@
+ #define USB_VENDOR_TEXAS_INSTRUMENTS 0x0451
+ #define USB_PRODUCT_TUSB8041_USB3 0x8140
+ #define USB_PRODUCT_TUSB8041_USB2 0x8142
+-#define HUB_QUIRK_CHECK_PORT_AUTOSUSPEND 0x01
+-#define HUB_QUIRK_DISABLE_AUTOSUSPEND 0x02
++#define HUB_QUIRK_CHECK_PORT_AUTOSUSPEND BIT(0)
++#define HUB_QUIRK_DISABLE_AUTOSUSPEND BIT(1)
+
+ #define USB_TP_TRANSMISSION_DELAY 40 /* ns */
+ #define USB_TP_TRANSMISSION_DELAY_MAX 65535 /* ns */
+--
+2.43.0
+
--- /dev/null
+From 6e82ab74595ca520e884a7f946e1db3c7c9658ee Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 4 Jan 2024 10:09:02 +0800
+Subject: =?UTF-8?q?virtio=5Fnet:=20Fix=20"=E2=80=98%d=E2=80=99=20directive?=
+ =?UTF-8?q?=20writing=20between=201=20and=2011=20bytes=20into=20a=20region?=
+ =?UTF-8?q?=20of=20size=2010"=20warnings?=
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Zhu Yanjun <yanjun.zhu@linux.dev>
+
+[ Upstream commit e3fe8d28c67bf6c291e920c6d04fa22afa14e6e4 ]
+
+Fix the warnings when building virtio_net driver.
+
+"
+drivers/net/virtio_net.c: In function ‘init_vqs’:
+drivers/net/virtio_net.c:4551:48: warning: ‘%d’ directive writing between 1 and 11 bytes into a region of size 10 [-Wformat-overflow=]
+ 4551 | sprintf(vi->rq[i].name, "input.%d", i);
+ | ^~
+In function ‘virtnet_find_vqs’,
+ inlined from ‘init_vqs’ at drivers/net/virtio_net.c:4645:8:
+drivers/net/virtio_net.c:4551:41: note: directive argument in the range [-2147483643, 65534]
+ 4551 | sprintf(vi->rq[i].name, "input.%d", i);
+ | ^~~~~~~~~~
+drivers/net/virtio_net.c:4551:17: note: ‘sprintf’ output between 8 and 18 bytes into a destination of size 16
+ 4551 | sprintf(vi->rq[i].name, "input.%d", i);
+ | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+drivers/net/virtio_net.c: In function ‘init_vqs’:
+drivers/net/virtio_net.c:4552:49: warning: ‘%d’ directive writing between 1 and 11 bytes into a region of size 9 [-Wformat-overflow=]
+ 4552 | sprintf(vi->sq[i].name, "output.%d", i);
+ | ^~
+In function ‘virtnet_find_vqs’,
+ inlined from ‘init_vqs’ at drivers/net/virtio_net.c:4645:8:
+drivers/net/virtio_net.c:4552:41: note: directive argument in the range [-2147483643, 65534]
+ 4552 | sprintf(vi->sq[i].name, "output.%d", i);
+ | ^~~~~~~~~~~
+drivers/net/virtio_net.c:4552:17: note: ‘sprintf’ output between 9 and 19 bytes into a destination of size 16
+ 4552 | sprintf(vi->sq[i].name, "output.%d", i);
+
+"
+
+Reviewed-by: Xuan Zhuo <xuanzhuo@linux.alibaba.com>
+Signed-off-by: Zhu Yanjun <yanjun.zhu@linux.dev>
+Link: https://lore.kernel.org/r/20240104020902.2753599-1-yanjun.zhu@intel.com
+Signed-off-by: Jakub Kicinski <kuba@kernel.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/virtio_net.c | 9 +++++----
+ 1 file changed, 5 insertions(+), 4 deletions(-)
+
+diff --git a/drivers/net/virtio_net.c b/drivers/net/virtio_net.c
+index 2fd5d2b7a209..4029c56dfcf0 100644
+--- a/drivers/net/virtio_net.c
++++ b/drivers/net/virtio_net.c
+@@ -2819,10 +2819,11 @@ static int virtnet_find_vqs(struct virtnet_info *vi)
+ {
+ vq_callback_t **callbacks;
+ struct virtqueue **vqs;
+- int ret = -ENOMEM;
+- int i, total_vqs;
+ const char **names;
++ int ret = -ENOMEM;
++ int total_vqs;
+ bool *ctx;
++ u16 i;
+
+ /* We expect 1 RX virtqueue followed by 1 TX virtqueue, followed by
+ * possible N-1 RX/TX queue pairs used in multiqueue mode, followed by
+@@ -2859,8 +2860,8 @@ static int virtnet_find_vqs(struct virtnet_info *vi)
+ for (i = 0; i < vi->max_queue_pairs; i++) {
+ callbacks[rxq2vq(i)] = skb_recv_done;
+ callbacks[txq2vq(i)] = skb_xmit_done;
+- sprintf(vi->rq[i].name, "input.%d", i);
+- sprintf(vi->sq[i].name, "output.%d", i);
++ sprintf(vi->rq[i].name, "input.%u", i);
++ sprintf(vi->sq[i].name, "output.%u", i);
+ names[rxq2vq(i)] = vi->rq[i].name;
+ names[txq2vq(i)] = vi->sq[i].name;
+ if (ctx)
+--
+2.43.0
+
--- /dev/null
+From c3fc8645139b6ca937828cb6f2360f1c4d6a2066 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 13 Dec 2023 10:45:25 +0100
+Subject: watchdog: it87_wdt: Keep WDTCTRL bit 3 unmodified for IT8784/IT8786
+
+From: Werner Fischer <devlists@wefi.net>
+
+[ Upstream commit d12971849d71781c1e4ffd1117d4878ce233d319 ]
+
+WDTCTRL bit 3 sets the mode choice for the clock input of IT8784/IT8786.
+Some motherboards require this bit to be set to 1 (= PCICLK mode),
+otherwise the watchdog functionality gets broken. The BIOS of those
+motherboards sets WDTCTRL bit 3 already to 1.
+
+Instead of setting all bits of WDTCTRL to 0 by writing 0x00 to it, keep
+bit 3 of it unchanged for IT8784/IT8786 chips. In this way, bit 3 keeps
+the status as set by the BIOS of the motherboard.
+
+Watchdog tests have been successful with this patch with the following
+systems:
+ IT8784: Thomas-Krenn LES plus v2 (YANLING YL-KBRL2 V2)
+ IT8786: Thomas-Krenn LES plus v3 (YANLING YL-CLU L2)
+ IT8786: Thomas-Krenn LES network 6L v2 (YANLING YL-CLU6L)
+
+Link: https://lore.kernel.org/all/140b264d-341f-465b-8715-dacfe84b3f71@roeck-us.net/
+
+Signed-off-by: Werner Fischer <devlists@wefi.net>
+Reviewed-by: Guenter Roeck <linux@roeck-us.net>
+Link: https://lore.kernel.org/r/20231213094525.11849-4-devlists@wefi.net
+Signed-off-by: Guenter Roeck <linux@roeck-us.net>
+Signed-off-by: Wim Van Sebroeck <wim@linux-watchdog.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/watchdog/it87_wdt.c | 14 +++++++++++++-
+ 1 file changed, 13 insertions(+), 1 deletion(-)
+
+diff --git a/drivers/watchdog/it87_wdt.c b/drivers/watchdog/it87_wdt.c
+index 2b4831842162..6340ca058f89 100644
+--- a/drivers/watchdog/it87_wdt.c
++++ b/drivers/watchdog/it87_wdt.c
+@@ -263,6 +263,7 @@ static struct watchdog_device wdt_dev = {
+ static int __init it87_wdt_init(void)
+ {
+ u8 chip_rev;
++ u8 ctrl;
+ int rc;
+
+ rc = superio_enter();
+@@ -321,7 +322,18 @@ static int __init it87_wdt_init(void)
+
+ superio_select(GPIO);
+ superio_outb(WDT_TOV1, WDTCFG);
+- superio_outb(0x00, WDTCTRL);
++
++ switch (chip_type) {
++ case IT8784_ID:
++ case IT8786_ID:
++ ctrl = superio_inb(WDTCTRL);
++ ctrl &= 0x08;
++ superio_outb(ctrl, WDTCTRL);
++ break;
++ default:
++ superio_outb(0x00, WDTCTRL);
++ }
++
+ superio_exit();
+
+ if (timeout < 1 || timeout > max_units * 60) {
+--
+2.43.0
+
--- /dev/null
+From 05eb444d63666550b8b9e3cb7ffd8615c1f895ed Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 22 Nov 2023 20:31:04 +0200
+Subject: wifi: ath9k: Fix potential array-index-out-of-bounds read in
+ ath9k_htc_txstatus()
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Minsuk Kang <linuxlovemin@yonsei.ac.kr>
+
+[ Upstream commit 2adc886244dff60f948497b59affb6c6ebb3c348 ]
+
+Fix an array-index-out-of-bounds read in ath9k_htc_txstatus(). The bug
+occurs when txs->cnt, data from a URB provided by a USB device, is
+bigger than the size of the array txs->txstatus, which is
+HTC_MAX_TX_STATUS. WARN_ON() already checks it, but there is no bug
+handling code after the check. Make the function return if that is the
+case.
+
+Found by a modified version of syzkaller.
+
+UBSAN: array-index-out-of-bounds in htc_drv_txrx.c
+index 13 is out of range for type '__wmi_event_txstatus [12]'
+Call Trace:
+ ath9k_htc_txstatus
+ ath9k_wmi_event_tasklet
+ tasklet_action_common
+ __do_softirq
+ irq_exit_rxu
+ sysvec_apic_timer_interrupt
+
+Signed-off-by: Minsuk Kang <linuxlovemin@yonsei.ac.kr>
+Acked-by: Toke Høiland-Jørgensen <toke@toke.dk>
+Signed-off-by: Kalle Valo <quic_kvalo@quicinc.com>
+Link: https://lore.kernel.org/r/20231113065756.1491991-1-linuxlovemin@yonsei.ac.kr
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ath/ath9k/htc_drv_txrx.c | 5 +++--
+ 1 file changed, 3 insertions(+), 2 deletions(-)
+
+diff --git a/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c b/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c
+index 622fc7f17040..5037142c5a82 100644
+--- a/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c
++++ b/drivers/net/wireless/ath/ath9k/htc_drv_txrx.c
+@@ -647,9 +647,10 @@ void ath9k_htc_txstatus(struct ath9k_htc_priv *priv, void *wmi_event)
+ struct ath9k_htc_tx_event *tx_pend;
+ int i;
+
+- for (i = 0; i < txs->cnt; i++) {
+- WARN_ON(txs->cnt > HTC_MAX_TX_STATUS);
++ if (WARN_ON_ONCE(txs->cnt > HTC_MAX_TX_STATUS))
++ return;
+
++ for (i = 0; i < txs->cnt; i++) {
+ __txs = &txs->txstatus[i];
+
+ skb = ath9k_htc_tx_get_packet(priv, __txs);
+--
+2.43.0
+
--- /dev/null
+From 1ff8a08a9ac54067bb447b9cc662175efbbc2de1 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 3 Jan 2024 20:13:51 +0800
+Subject: wifi: cfg80211: fix RCU dereference in __cfg80211_bss_update
+
+From: Edward Adam Davis <eadavis@qq.com>
+
+[ Upstream commit 1184950e341c11b6f82bc5b59564411d9537ab27 ]
+
+Replace rcu_dereference() with rcu_access_pointer() since we hold
+the lock here (and aren't in an RCU critical section).
+
+Fixes: 32af9a9e1069 ("wifi: cfg80211: free beacon_ies when overridden from hidden BSS")
+Reported-and-tested-by: syzbot+864a269c27ee06b58374@syzkaller.appspotmail.com
+Signed-off-by: Edward Adam Davis <eadavis@qq.com>
+Link: https://msgid.link/tencent_BF8F0DF0258C8DBF124CDDE4DD8D992DCF07@qq.com
+Signed-off-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/wireless/scan.c | 2 +-
+ 1 file changed, 1 insertion(+), 1 deletion(-)
+
+diff --git a/net/wireless/scan.c b/net/wireless/scan.c
+index 6f0a01038db1..a6c289a61d30 100644
+--- a/net/wireless/scan.c
++++ b/net/wireless/scan.c
+@@ -1802,7 +1802,7 @@ cfg80211_bss_update(struct cfg80211_registered_device *rdev,
+ &hidden->hidden_list);
+ hidden->refcount++;
+
+- ies = (void *)rcu_dereference(new->pub.beacon_ies);
++ ies = (void *)rcu_access_pointer(new->pub.beacon_ies);
+ rcu_assign_pointer(new->pub.beacon_ies,
+ hidden->pub.beacon_ies);
+ if (ies)
+--
+2.43.0
+
--- /dev/null
+From 510b69f014fec3b7afe5503250704fe6c4536933 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 20 Dec 2023 13:41:41 +0200
+Subject: wifi: cfg80211: free beacon_ies when overridden from hidden BSS
+
+From: Benjamin Berg <benjamin.berg@intel.com>
+
+[ Upstream commit 32af9a9e1069e55bc02741fb00ac9d0ca1a2eaef ]
+
+This is a more of a cosmetic fix. The branch will only be taken if
+proberesp_ies is set, which implies that beacon_ies is not set unless we
+are connected to an AP that just did a channel switch. And, in that case
+we should have found the BSS in the internal storage to begin with.
+
+Signed-off-by: Benjamin Berg <benjamin.berg@intel.com>
+Reviewed-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Miri Korenblit <miriam.rachel.korenblit@intel.com>
+Link: https://msgid.link/20231220133549.b898e22dadff.Id8c4c10aedd176ef2e18a4cad747b299f150f9df@changeid
+Signed-off-by: Johannes Berg <johannes.berg@intel.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ net/wireless/scan.c | 4 ++++
+ 1 file changed, 4 insertions(+)
+
+diff --git a/net/wireless/scan.c b/net/wireless/scan.c
+index 1e6dfe204ff3..6f0a01038db1 100644
+--- a/net/wireless/scan.c
++++ b/net/wireless/scan.c
+@@ -1801,8 +1801,12 @@ cfg80211_bss_update(struct cfg80211_registered_device *rdev,
+ list_add(&new->hidden_list,
+ &hidden->hidden_list);
+ hidden->refcount++;
++
++ ies = (void *)rcu_dereference(new->pub.beacon_ies);
+ rcu_assign_pointer(new->pub.beacon_ies,
+ hidden->pub.beacon_ies);
++ if (ies)
++ kfree_rcu(ies, rcu_head);
+ }
+ } else {
+ /*
+--
+2.43.0
+
--- /dev/null
+From b1d44bb3df2eb8abce4ba8cab9e257fe471f9399 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sat, 4 Nov 2023 16:58:00 +0800
+Subject: wifi: rt2x00: restart beacon queue when hardware reset
+
+From: Shiji Yang <yangshiji66@outlook.com>
+
+[ Upstream commit a11d965a218f0cd95b13fe44d0bcd8a20ce134a8 ]
+
+When a hardware reset is triggered, all registers are reset, so all
+queues are forced to stop in hardware interface. However, mac80211
+will not automatically stop the queue. If we don't manually stop the
+beacon queue, the queue will be deadlocked and unable to start again.
+This patch fixes the issue where Apple devices cannot connect to the
+AP after calling ieee80211_restart_hw().
+
+Signed-off-by: Shiji Yang <yangshiji66@outlook.com>
+Acked-by: Stanislaw Gruszka <stf_xl@wp.pl>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://lore.kernel.org/r/TYAP286MB031530EB6D98DCE4DF20766CBCA4A@TYAP286MB0315.JPNP286.PROD.OUTLOOK.COM
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/ralink/rt2x00/rt2x00dev.c | 3 +++
+ drivers/net/wireless/ralink/rt2x00/rt2x00mac.c | 11 +++++++++++
+ 2 files changed, 14 insertions(+)
+
+diff --git a/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c b/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c
+index b04f76551ca4..be3c153ab3b0 100644
+--- a/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c
++++ b/drivers/net/wireless/ralink/rt2x00/rt2x00dev.c
+@@ -101,6 +101,7 @@ void rt2x00lib_disable_radio(struct rt2x00_dev *rt2x00dev)
+ rt2x00link_stop_tuner(rt2x00dev);
+ rt2x00queue_stop_queues(rt2x00dev);
+ rt2x00queue_flush_queues(rt2x00dev, true);
++ rt2x00queue_stop_queue(rt2x00dev->bcn);
+
+ /*
+ * Disable radio.
+@@ -1272,6 +1273,7 @@ int rt2x00lib_start(struct rt2x00_dev *rt2x00dev)
+ rt2x00dev->intf_ap_count = 0;
+ rt2x00dev->intf_sta_count = 0;
+ rt2x00dev->intf_associated = 0;
++ rt2x00dev->intf_beaconing = 0;
+
+ /* Enable the radio */
+ retval = rt2x00lib_enable_radio(rt2x00dev);
+@@ -1298,6 +1300,7 @@ void rt2x00lib_stop(struct rt2x00_dev *rt2x00dev)
+ rt2x00dev->intf_ap_count = 0;
+ rt2x00dev->intf_sta_count = 0;
+ rt2x00dev->intf_associated = 0;
++ rt2x00dev->intf_beaconing = 0;
+ }
+
+ static inline void rt2x00lib_set_if_combinations(struct rt2x00_dev *rt2x00dev)
+diff --git a/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c b/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c
+index 2f68a31072ae..795bd3b0ebd8 100644
+--- a/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c
++++ b/drivers/net/wireless/ralink/rt2x00/rt2x00mac.c
+@@ -599,6 +599,17 @@ void rt2x00mac_bss_info_changed(struct ieee80211_hw *hw,
+ */
+ if (changes & BSS_CHANGED_BEACON_ENABLED) {
+ mutex_lock(&intf->beacon_skb_mutex);
++
++ /*
++ * Clear the 'enable_beacon' flag and clear beacon because
++ * the beacon queue has been stopped after hardware reset.
++ */
++ if (test_bit(DEVICE_STATE_RESET, &rt2x00dev->flags) &&
++ intf->enable_beacon) {
++ intf->enable_beacon = false;
++ rt2x00queue_clear_beacon(rt2x00dev, vif);
++ }
++
+ if (!bss_conf->enable_beacon && intf->enable_beacon) {
+ rt2x00dev->intf_beaconing--;
+ intf->enable_beacon = false;
+--
+2.43.0
+
--- /dev/null
+From 7a10c33cf053066409add7fa01a523d91d64579c Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 17 Dec 2023 20:30:17 +0800
+Subject: wifi: rtl8xxxu: Add additional USB IDs for RTL8192EU devices
+
+From: Zenm Chen <zenmchen@gmail.com>
+
+[ Upstream commit 4e87ca403e2008b9e182239e1abbf6876a55eb33 ]
+
+Add additional USB IDs found in the vendor driver from
+https://github.com/Mange/rtl8192eu-linux-driver to support more
+RTL8192EU devices.
+
+Signed-off-by: Zenm Chen <zenmchen@gmail.com>
+Reviewed-by: Ping-Ke Shih <pkshih@realtek.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://msgid.link/20231217123017.1982-1-zenmchen@gmail.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ .../net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c | 12 ++++++++++++
+ 1 file changed, 12 insertions(+)
+
+diff --git a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c
+index 004778faf3d0..3051fb358fdd 100644
+--- a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c
++++ b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_core.c
+@@ -6973,6 +6973,18 @@ static const struct usb_device_id dev_table[] = {
+ .driver_info = (unsigned long)&rtl8192eu_fops},
+ {USB_DEVICE_AND_INTERFACE_INFO(USB_VENDOR_ID_REALTEK, 0x818c, 0xff, 0xff, 0xff),
+ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* D-Link DWA-131 rev C1 */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2001, 0x3312, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* TP-Link TL-WN8200ND V2 */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2357, 0x0126, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* Mercusys MW300UM */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2c4e, 0x0100, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
++/* Mercusys MW300UH */
++{USB_DEVICE_AND_INTERFACE_INFO(0x2c4e, 0x0104, 0xff, 0xff, 0xff),
++ .driver_info = (unsigned long)&rtl8192eu_fops},
+ #endif
+ { }
+ };
+--
+2.43.0
+
--- /dev/null
+From 8482971dd22e2e5a6d99414eb310ae36d2eea771 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Tue, 19 Dec 2023 14:57:39 +0800
+Subject: wifi: rtlwifi: rtl8723{be,ae}: using calculate_bit_shift()
+
+From: Su Hui <suhui@nfschina.com>
+
+[ Upstream commit 5c16618bc06a41ad68fd8499a21d35ef57ca06c2 ]
+
+Using calculate_bit_shift() to replace rtl8723_phy_calculate_bit_shift().
+And fix an undefined bitwise shift behavior problem.
+
+Signed-off-by: Su Hui <suhui@nfschina.com>
+Signed-off-by: Kalle Valo <kvalo@kernel.org>
+Link: https://msgid.link/20231219065739.1895666-12-suhui@nfschina.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c | 6 +++---
+ drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c | 4 ++--
+ 2 files changed, 5 insertions(+), 5 deletions(-)
+
+diff --git a/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c b/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c
+index fa0eed434d4f..d26dda8e46fd 100644
+--- a/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c
++++ b/drivers/net/wireless/realtek/rtlwifi/rtl8723ae/phy.c
+@@ -49,7 +49,7 @@ u32 rtl8723e_phy_query_rf_reg(struct ieee80211_hw *hw,
+ rfpath, regaddr);
+ }
+
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ readback_value = (original_value & bitmask) >> bitshift;
+
+ spin_unlock(&rtlpriv->locks.rf_lock);
+@@ -80,7 +80,7 @@ void rtl8723e_phy_set_rf_reg(struct ieee80211_hw *hw,
+ original_value = rtl8723_phy_rf_serial_read(hw,
+ rfpath,
+ regaddr);
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ data =
+ ((original_value & (~bitmask)) |
+ (data << bitshift));
+@@ -89,7 +89,7 @@ void rtl8723e_phy_set_rf_reg(struct ieee80211_hw *hw,
+ rtl8723_phy_rf_serial_write(hw, rfpath, regaddr, data);
+ } else {
+ if (bitmask != RFREG_OFFSET_MASK) {
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ data =
+ ((original_value & (~bitmask)) |
+ (data << bitshift));
+diff --git a/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c b/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c
+index f09f55b0468a..35dfea54ae9c 100644
+--- a/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c
++++ b/drivers/net/wireless/realtek/rtlwifi/rtl8723be/phy.c
+@@ -41,7 +41,7 @@ u32 rtl8723be_phy_query_rf_reg(struct ieee80211_hw *hw, enum radio_path rfpath,
+ spin_lock(&rtlpriv->locks.rf_lock);
+
+ original_value = rtl8723_phy_rf_serial_read(hw, rfpath, regaddr);
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ readback_value = (original_value & bitmask) >> bitshift;
+
+ spin_unlock(&rtlpriv->locks.rf_lock);
+@@ -68,7 +68,7 @@ void rtl8723be_phy_set_rf_reg(struct ieee80211_hw *hw, enum radio_path path,
+ if (bitmask != RFREG_OFFSET_MASK) {
+ original_value = rtl8723_phy_rf_serial_read(hw, path,
+ regaddr);
+- bitshift = rtl8723_phy_calculate_bit_shift(bitmask);
++ bitshift = calculate_bit_shift(bitmask);
+ data = ((original_value & (~bitmask)) |
+ (data << bitshift));
+ }
+--
+2.43.0
+
--- /dev/null
+From 955042e02ba8f297e9dbcf8cc6d1ce7e613b5e10 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Wed, 29 Nov 2023 15:44:49 -0500
+Subject: x86/boot: Ignore NMIs during very early boot
+
+From: Jun'ichi Nomura <junichi.nomura@nec.com>
+
+[ Upstream commit 78a509fba9c9b1fcb77f95b7c6be30da3d24823a ]
+
+When there are two racing NMIs on x86, the first NMI invokes NMI handler and
+the 2nd NMI is latched until IRET is executed.
+
+If panic on NMI and panic kexec are enabled, the first NMI triggers
+panic and starts booting the next kernel via kexec. Note that the 2nd
+NMI is still latched. During the early boot of the next kernel, once
+an IRET is executed as a result of a page fault, then the 2nd NMI is
+unlatched and invokes the NMI handler.
+
+However, NMI handler is not set up at the early stage of boot, which
+results in a boot failure.
+
+Avoid such problems by setting up a NOP handler for early NMIs.
+
+[ mingo: Refined the changelog. ]
+
+Signed-off-by: Jun'ichi Nomura <junichi.nomura@nec.com>
+Signed-off-by: Derek Barbosa <debarbos@redhat.com>
+Signed-off-by: Ingo Molnar <mingo@kernel.org>
+Cc: Kees Cook <keescook@chromium.org>
+Cc: Linus Torvalds <torvalds@linux-foundation.org>
+Cc: Paul E. McKenney <paulmck@kernel.org>
+Cc: Andy Lutomirski <luto@kernel.org>
+Cc: "H. Peter Anvin" <hpa@zytor.com>
+Cc: Peter Zijlstra <peterz@infradead.org>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/x86/boot/compressed/ident_map_64.c | 5 +++++
+ arch/x86/boot/compressed/idt_64.c | 1 +
+ arch/x86/boot/compressed/idt_handlers_64.S | 1 +
+ arch/x86/boot/compressed/misc.h | 1 +
+ 4 files changed, 8 insertions(+)
+
+diff --git a/arch/x86/boot/compressed/ident_map_64.c b/arch/x86/boot/compressed/ident_map_64.c
+index f4a2e6d373b2..1e4eb3894ec4 100644
+--- a/arch/x86/boot/compressed/ident_map_64.c
++++ b/arch/x86/boot/compressed/ident_map_64.c
+@@ -367,3 +367,8 @@ void do_boot_page_fault(struct pt_regs *regs, unsigned long error_code)
+ */
+ add_identity_map(address, end);
+ }
++
++void do_boot_nmi_trap(struct pt_regs *regs, unsigned long error_code)
++{
++ /* Empty handler to ignore NMI during early boot */
++}
+diff --git a/arch/x86/boot/compressed/idt_64.c b/arch/x86/boot/compressed/idt_64.c
+index 804a502ee0d2..eb30bb20c33b 100644
+--- a/arch/x86/boot/compressed/idt_64.c
++++ b/arch/x86/boot/compressed/idt_64.c
+@@ -45,6 +45,7 @@ void load_stage2_idt(void)
+ boot_idt_desc.address = (unsigned long)boot_idt;
+
+ set_idt_entry(X86_TRAP_PF, boot_page_fault);
++ set_idt_entry(X86_TRAP_NMI, boot_nmi_trap);
+
+ #ifdef CONFIG_AMD_MEM_ENCRYPT
+ set_idt_entry(X86_TRAP_VC, boot_stage2_vc);
+diff --git a/arch/x86/boot/compressed/idt_handlers_64.S b/arch/x86/boot/compressed/idt_handlers_64.S
+index 22890e199f5b..4d03c8562f63 100644
+--- a/arch/x86/boot/compressed/idt_handlers_64.S
++++ b/arch/x86/boot/compressed/idt_handlers_64.S
+@@ -70,6 +70,7 @@ SYM_FUNC_END(\name)
+ .code64
+
+ EXCEPTION_HANDLER boot_page_fault do_boot_page_fault error_code=1
++EXCEPTION_HANDLER boot_nmi_trap do_boot_nmi_trap error_code=0
+
+ #ifdef CONFIG_AMD_MEM_ENCRYPT
+ EXCEPTION_HANDLER boot_stage1_vc do_vc_no_ghcb error_code=1
+diff --git a/arch/x86/boot/compressed/misc.h b/arch/x86/boot/compressed/misc.h
+index d9a631c5973c..0ccc32718483 100644
+--- a/arch/x86/boot/compressed/misc.h
++++ b/arch/x86/boot/compressed/misc.h
+@@ -156,6 +156,7 @@ extern struct desc_ptr boot_idt_desc;
+
+ /* IDT Entry Points */
+ void boot_page_fault(void);
++void boot_nmi_trap(void);
+ void boot_stage1_vc(void);
+ void boot_stage2_vc(void);
+
+--
+2.43.0
+
--- /dev/null
+From 9e0a601c7d474cce01bdacc72d43fe85ab2324d6 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Thu, 26 Oct 2023 08:39:03 +0800
+Subject: x86/mce: Mark fatal MCE's page as poison to avoid panic in the kdump
+ kernel
+
+From: Zhiquan Li <zhiquan1.li@intel.com>
+
+[ Upstream commit 9f3b130048bfa2e44a8cfb1b616f826d9d5d8188 ]
+
+Memory errors don't happen very often, especially fatal ones. However,
+in large-scale scenarios such as data centers, that probability
+increases with the amount of machines present.
+
+When a fatal machine check happens, mce_panic() is called based on the
+severity grading of that error. The page containing the error is not
+marked as poison.
+
+However, when kexec is enabled, tools like makedumpfile understand when
+pages are marked as poison and do not touch them so as not to cause
+a fatal machine check exception again while dumping the previous
+kernel's memory.
+
+Therefore, mark the page containing the error as poisoned so that the
+kexec'ed kernel can avoid accessing the page.
+
+ [ bp: Rewrite commit message and comment. ]
+
+Co-developed-by: Youquan Song <youquan.song@intel.com>
+Signed-off-by: Youquan Song <youquan.song@intel.com>
+Signed-off-by: Zhiquan Li <zhiquan1.li@intel.com>
+Signed-off-by: Borislav Petkov (AMD) <bp@alien8.de>
+Reviewed-by: Naoya Horiguchi <naoya.horiguchi@nec.com>
+Link: https://lore.kernel.org/r/20231014051754.3759099-1-zhiquan1.li@intel.com
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ arch/x86/kernel/cpu/mce/core.c | 16 ++++++++++++++++
+ 1 file changed, 16 insertions(+)
+
+diff --git a/arch/x86/kernel/cpu/mce/core.c b/arch/x86/kernel/cpu/mce/core.c
+index 0b7c81389c50..18a6ed2afca0 100644
+--- a/arch/x86/kernel/cpu/mce/core.c
++++ b/arch/x86/kernel/cpu/mce/core.c
+@@ -44,6 +44,7 @@
+ #include <linux/sync_core.h>
+ #include <linux/task_work.h>
+ #include <linux/hardirq.h>
++#include <linux/kexec.h>
+
+ #include <asm/intel-family.h>
+ #include <asm/processor.h>
+@@ -274,6 +275,7 @@ static noinstr void mce_panic(const char *msg, struct mce *final, char *exp)
+ struct llist_node *pending;
+ struct mce_evt_llist *l;
+ int apei_err = 0;
++ struct page *p;
+
+ /*
+ * Allow instrumentation around external facilities usage. Not that it
+@@ -329,6 +331,20 @@ static noinstr void mce_panic(const char *msg, struct mce *final, char *exp)
+ if (!fake_panic) {
+ if (panic_timeout == 0)
+ panic_timeout = mca_cfg.panic_timeout;
++
++ /*
++ * Kdump skips the poisoned page in order to avoid
++ * touching the error bits again. Poison the page even
++ * if the error is fatal and the machine is about to
++ * panic.
++ */
++ if (kexec_crash_loaded()) {
++ if (final && (final->status & MCI_STATUS_ADDRV)) {
++ p = pfn_to_online_page(final->addr >> PAGE_SHIFT);
++ if (p)
++ SetPageHWPoison(p);
++ }
++ }
+ panic(msg);
+ } else
+ pr_emerg(HW_ERR "Fake kernel panic: %s\n", msg);
+--
+2.43.0
+
--- /dev/null
+From 70413aeb0018e4eb131e9fec45a40527955d5588 Mon Sep 17 00:00:00 2001
+From: Sasha Levin <sashal@kernel.org>
+Date: Sun, 7 Jan 2024 12:34:26 +0200
+Subject: xen/gntdev: Fix the abuse of underlying struct page in DMA-buf import
+MIME-Version: 1.0
+Content-Type: text/plain; charset=UTF-8
+Content-Transfer-Encoding: 8bit
+
+From: Oleksandr Tyshchenko <oleksandr_tyshchenko@epam.com>
+
+[ Upstream commit 2d2db7d40254d5fb53b11ebd703cd1ed0c5de7a1 ]
+
+DO NOT access the underlying struct page of an sg table exported
+by DMA-buf in dmabuf_imp_to_refs(), this is not allowed.
+Please see drivers/dma-buf/dma-buf.c:mangle_sg_table() for details.
+
+Fortunately, here (for special Xen device) we can avoid using
+pages and calculate gfns directly from dma addresses provided by
+the sg table.
+
+Suggested-by: Daniel Vetter <daniel@ffwll.ch>
+Signed-off-by: Oleksandr Tyshchenko <oleksandr_tyshchenko@epam.com>
+Acked-by: Christian König <christian.koenig@amd.com>
+Reviewed-by: Stefano Stabellini <sstabellini@kernel.org>
+Acked-by: Daniel Vetter <daniel@ffwll.ch>
+Link: https://lore.kernel.org/r/20240107103426.2038075-1-olekstysh@gmail.com
+Signed-off-by: Juergen Gross <jgross@suse.com>
+Signed-off-by: Sasha Levin <sashal@kernel.org>
+---
+ drivers/xen/gntdev-dmabuf.c | 50 ++++++++++++++++++-------------------
+ 1 file changed, 25 insertions(+), 25 deletions(-)
+
+diff --git a/drivers/xen/gntdev-dmabuf.c b/drivers/xen/gntdev-dmabuf.c
+index 4c13cbc99896..398ea69c176c 100644
+--- a/drivers/xen/gntdev-dmabuf.c
++++ b/drivers/xen/gntdev-dmabuf.c
+@@ -11,6 +11,7 @@
+ #include <linux/kernel.h>
+ #include <linux/errno.h>
+ #include <linux/dma-buf.h>
++#include <linux/dma-direct.h>
+ #include <linux/slab.h>
+ #include <linux/types.h>
+ #include <linux/uaccess.h>
+@@ -56,7 +57,7 @@ struct gntdev_dmabuf {
+
+ /* Number of pages this buffer has. */
+ int nr_pages;
+- /* Pages of this buffer. */
++ /* Pages of this buffer (only for dma-buf export). */
+ struct page **pages;
+ };
+
+@@ -490,7 +491,7 @@ static int dmabuf_exp_from_refs(struct gntdev_priv *priv, int flags,
+ /* DMA buffer import support. */
+
+ static int
+-dmabuf_imp_grant_foreign_access(struct page **pages, u32 *refs,
++dmabuf_imp_grant_foreign_access(unsigned long *gfns, u32 *refs,
+ int count, int domid)
+ {
+ grant_ref_t priv_gref_head;
+@@ -513,7 +514,7 @@ dmabuf_imp_grant_foreign_access(struct page **pages, u32 *refs,
+ }
+
+ gnttab_grant_foreign_access_ref(cur_ref, domid,
+- xen_page_to_gfn(pages[i]), 0);
++ gfns[i], 0);
+ refs[i] = cur_ref;
+ }
+
+@@ -535,7 +536,6 @@ static void dmabuf_imp_end_foreign_access(u32 *refs, int count)
+
+ static void dmabuf_imp_free_storage(struct gntdev_dmabuf *gntdev_dmabuf)
+ {
+- kfree(gntdev_dmabuf->pages);
+ kfree(gntdev_dmabuf->u.imp.refs);
+ kfree(gntdev_dmabuf);
+ }
+@@ -555,12 +555,6 @@ static struct gntdev_dmabuf *dmabuf_imp_alloc_storage(int count)
+ if (!gntdev_dmabuf->u.imp.refs)
+ goto fail;
+
+- gntdev_dmabuf->pages = kcalloc(count,
+- sizeof(gntdev_dmabuf->pages[0]),
+- GFP_KERNEL);
+- if (!gntdev_dmabuf->pages)
+- goto fail;
+-
+ gntdev_dmabuf->nr_pages = count;
+
+ for (i = 0; i < count; i++)
+@@ -582,7 +576,8 @@ dmabuf_imp_to_refs(struct gntdev_dmabuf_priv *priv, struct device *dev,
+ struct dma_buf *dma_buf;
+ struct dma_buf_attachment *attach;
+ struct sg_table *sgt;
+- struct sg_page_iter sg_iter;
++ struct sg_dma_page_iter sg_iter;
++ unsigned long *gfns;
+ int i;
+
+ dma_buf = dma_buf_get(fd);
+@@ -630,26 +625,31 @@ dmabuf_imp_to_refs(struct gntdev_dmabuf_priv *priv, struct device *dev,
+
+ gntdev_dmabuf->u.imp.sgt = sgt;
+
+- /* Now convert sgt to array of pages and check for page validity. */
++ gfns = kcalloc(count, sizeof(*gfns), GFP_KERNEL);
++ if (!gfns) {
++ ret = ERR_PTR(-ENOMEM);
++ goto fail_unmap;
++ }
++
++ /*
++ * Now convert sgt to array of gfns without accessing underlying pages.
++ * It is not allowed to access the underlying struct page of an sg table
++ * exported by DMA-buf, but since we deal with special Xen dma device here
++ * (not a normal physical one) look at the dma addresses in the sg table
++ * and then calculate gfns directly from them.
++ */
+ i = 0;
+- for_each_sgtable_page(sgt, &sg_iter, 0) {
+- struct page *page = sg_page_iter_page(&sg_iter);
+- /*
+- * Check if page is valid: this can happen if we are given
+- * a page from VRAM or other resources which are not backed
+- * by a struct page.
+- */
+- if (!pfn_valid(page_to_pfn(page))) {
+- ret = ERR_PTR(-EINVAL);
+- goto fail_unmap;
+- }
++ for_each_sgtable_dma_page(sgt, &sg_iter, 0) {
++ dma_addr_t addr = sg_page_iter_dma_address(&sg_iter);
++ unsigned long pfn = bfn_to_pfn(XEN_PFN_DOWN(dma_to_phys(dev, addr)));
+
+- gntdev_dmabuf->pages[i++] = page;
++ gfns[i++] = pfn_to_gfn(pfn);
+ }
+
+- ret = ERR_PTR(dmabuf_imp_grant_foreign_access(gntdev_dmabuf->pages,
++ ret = ERR_PTR(dmabuf_imp_grant_foreign_access(gfns,
+ gntdev_dmabuf->u.imp.refs,
+ count, domid));
++ kfree(gfns);
+ if (IS_ERR(ret))
+ goto fail_end_access;
+
+--
+2.43.0
+