Prevent some type incompatibility warnings.

Add declaration for agent option global (used by option parser).

If interfaces are specified, don't configure any that weren't.   In INIT-REBOOT state, initialize the xid before calling make_request().   Check chaddr as well as xid to validate return from server.   Make write_client_lease rewrite the client lease file after 20 leases have been written.   Fix an xid bug in DHCPRELEASE code.   Document Y2K non-bug.

Use DLPI, not sockets.   Also, since we're using rand instead of random, use srand instead of srandom.

More DLPI stuff

More prototypes.   Agent Option support.

Add defines for relay agent options.

DLPI support, contributed by Eric James Negaard.

Don't mention compiling with BPF if user has multiple interfaces - if it's not happening now, it probably doesn't work.   Also, correct = vs == confusion that was causing packets to go out with bogus destination addresses.

Add a comment to document the non-presence of a Y2K bug, since people are getting paranoid about that.

Reword dns query code

Document that NBNS and WINS are the same thing

Don't invalidate a lease if we receive an ICMP echo reply for it when it has a valid lease.   This can happen if some other user on the host pings the client after we've assigned it an address.

Add a comment to document the non-presence of a Y2K bug, since people are getting paranoid about that.

Parse agent options specially.   Pack agent options into outgoing messages if supplied.   Allow caller to pass dhcp_max_message_size into cons_options if the original packet is no longer available.

Add dhcp_max_agent_option_packet_length.

Adjust cons_options calls.   Copy the entire chaddr field even if hlen indicates it's shorter.   Keep track of Relay Agent Information options.

Copy the entire chaddr field, even if the length is shorter than the total.   This works around a bug in certain Microsoft clients.   If the options aren't valid, just copy the option buffer from the incoming packet into the outgoing packet.   This lets NeXT boxes boot.   Adjust calling conventions for cons_options.

Change cons_option calling convention.   Declare dhcp_max_agent_option_packet_length.

Correct freudian slip.

Finish documenting dhcpd.leases format.

Document token ring hardware type.

Add DLPI support

Define Async DNS structures.   Add new dns functions.   Add DLPI functions.

Adjust provided functionality to be compatible with asynchronous resolver.

Handle ICMP packets with IP header options correctly.

Preliminary rewrite of asynchronous DNS code (needs work)

Add dlpi.c

Use new_network_number, not new_network_address.   Use search, not domain in /etc/resolv.conf.

Add missing fi

Fix up option declaration modifier documentation.

Define ssize_t and NEED_INET_ATON.

Document changes in Beta 1 (oops)

Document broadcast addr hack for HP-UX 9.x

Check mktemp() return and die with error message if it's NULL

Use yiaddr to transmit response to client

BOOTP Protocol specification

Current DHCP Options specification

Current DHCP protocol specification

file rfc2131.txt was initially added on branch RELEASE_1.

Update for 2.0 Beta 1

NAK if a client requests an address that we own but can't give to it.

Ignore lines in resolv.conf whose first token isn't recognized.

Handle token ring...

Cast pid_t up to long so that printf will work on systems where it's long and not int.

Document Linux 2.1 version that supports SO_BINDTODEVICE

Document changes in current snapshot since June.

If we're responding to a BOOTP request, hunt for a lease that's applicable - there might be more than one lease matching the network and the hardware address.

Copy the hardware address into the static lease structure so that it can be used later.

Create database with mode 0664 & ~umask, not 0666 & ~umask.

If we find more than one lease for the same client on the same network, give it the one it asked for.

Document Linux 2.1.x bootp agent screw

Fix DHCPRELEASE handling to conform to spec

Always print two digits for day and month in leases.

If AF_LINK is defined, need to include if_dl.h

Don't use sun_len on systems that don't support it

%02x, not %2.2x

Test return value of socket for <0, not ==0 to indicate failure.

Use ifp -> ifr_name, not ifr.ifr_name, which isn't yet initialized.   errno, not ERRNO.

Update README

Add a caveat that this doesn't include everything

Update release notes (lose obsolete cruft about old lease database formats)

new catted man page

Document -q.  Fix typos/pastos.   Reword some bad stuff.   Fix SEE ALSO

Daemonize by default.   Fix a couple of uninitialized automatic variables.   Add -q flag which shuts up interface status printout.   Write a pid file.

Name server definitions

Override default value for _PATH_DHCRELAY_PID

Set a default value for _PATH_DHCRELAY_PID

Fix typo in comment.

new catted man page

new catted man pages

Add dhcpd.leases man page.   Globalize sed scripts on man pages.

new catted man pages

Fix errors mentioned by cgd.   s/dhcp(5)/dhcp-options(5)/   Fix SEE ALSO.

Move BUGS up.   Add FILES section documenting location of script files in distribution

globalize sed commands on man pages

catted man page for nroff-less systems

catted man pages, for machines that don't have troff/nroff

DHCP lease database description

Build and install dhclient.leases man page

DHCP Client lease database description

Don't echo ifconfig parameters - that was for debugging.

DHCP client configuration script

Write an actual manual page

Add prototype for broadcast_addr()

Add broadcast_addr function which produces the broadcast address of a subnet given the subnet number and subnet mask.

Move dhcp option documentation to dhcp-options(5)

Build and install dhcp-options.5

Documentation for DHCP option declaration syntax

bsd/os client script (pretty much identical to NetBSD)

Check if variables have value before doing set $variable

Don't need to compute network number or broadcast address anymore

Compute network number and (if not offered by server) broadcast address for linux client script

Fix up references

fix up name

Support hostname keyword

Fix up handling of hostname

Fix up handling of hostname

Fix spelling

Don't ping static leases - there's no persistent structure for them!