projects / thirdparty / bash.git / blame
| Commit | Line | Data |
|---|---|---|
| 5e13499c | 1 | %!PS-Adobe-2.0 |
| 28157acd | 2 | %%Creator: dvips(k) 5.92b Copyright 2002 Radical Eye Software |
| 5e13499c | 3 | %%Title: bashref.dvi |
| 5cfe250d | 4 | %%Pages: 160 |
| 5e13499c CR |
5 | %%PageOrder: Ascend |
| 6 | %%BoundingBox: 0 0 612 792 | |
| 37c41ab1 CR |
7 | %%DocumentFonts: CMBX12 CMR10 CMTT10 CMSL10 CMSY10 CMBXTI10 CMTI10 |
| 8 | %%+ CMCSC10 CMSLTT10 CMTT12 CMSY9 CMR8 CMTT9 CMTI9 CMR9 | |
| 5e13499c CR |
9 | %%EndComments |
| 10 | %DVIPSWebPage: (www.radicaleye.com) | |
| 11 | %DVIPSCommandLine: dvips -D 600 -t letter -o bashref.ps bashref.dvi | |
| 28157acd CR |
12 | %DVIPSParameters: dpi=600, compressed |
| 13 | %DVIPSSource: TeX output 2006.01.26:1119 | |
| 14 | %%BeginProcSet: texc.pro | |
| 5e13499c CR |
15 | %! |
| 16 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
| 17 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
| 18 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
| 19 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
| 20 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
| 21 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
| 22 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
| 23 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
| 24 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
| 25 | N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin | |
| 26 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array | |
| 27 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 | |
| 28 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N | |
| 29 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
| 30 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
| 31 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
| 32 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
| 28157acd CR |
33 | 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 |
| 34 | 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx | |
| 35 | 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx | |
| 36 | sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ | |
| 37 | rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp | |
| 38 | gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B | |
| 39 | /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ | |
| 40 | /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ | |
| 41 | A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy | |
| 42 | get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} | |
| 43 | ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp | |
| 44 | fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 | |
| 45 | {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add | |
| 46 | chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ | |
| 47 | 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} | |
| 48 | forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
| 5e13499c CR |
49 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put |
| 50 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
| 51 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
| 52 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
| 53 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
| 54 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
| 55 | 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 | |
| 56 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N | |
| 57 | /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ | |
| 58 | /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) | |
| 59 | (LaserWriter 16/600)]{A length product length le{A length product exch 0 | |
| 60 | exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse | |
| 61 | end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask | |
| 62 | grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} | |
| 63 | imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round | |
| 64 | exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto | |
| 65 | fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p | |
| 66 | delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} | |
| 67 | B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ | |
| 68 | p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S | |
| 69 | rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
| 70 | ||
| 71 | %%EndProcSet | |
| 28157acd CR |
72 | %%BeginProcSet: f7b6d320.enc |
| 73 | % Thomas Esser, Dec 2002. public domain | |
| 74 | % | |
| 75 | % Encoding for: | |
| 76 | % cmb10 cmbx10 cmbx12 cmbx5 cmbx6 cmbx7 cmbx8 cmbx9 cmbxsl10 | |
| 77 | % cmdunh10 cmr10 cmr12 cmr17cmr6 cmr7 cmr8 cmr9 cmsl10 cmsl12 cmsl8 | |
| 78 | % cmsl9 cmss10cmss12 cmss17 cmss8 cmss9 cmssbx10 cmssdc10 cmssi10 | |
| 79 | % cmssi12 cmssi17 cmssi8cmssi9 cmssq8 cmssqi8 cmvtt10 | |
| 80 | % | |
| 81 | /TeXf7b6d320Encoding [ | |
| 82 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega | |
| 83 | /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute /caron /breve | |
| 84 | /macron /ring /cedilla /germandbls /ae /oe /oslash /AE /OE /Oslash | |
| 85 | /suppress /exclam /quotedblright /numbersign /dollar /percent /ampersand | |
| 86 | /quoteright /parenleft /parenright /asterisk /plus /comma /hyphen | |
| 87 | /period /slash /zero /one /two /three /four /five /six /seven /eight | |
| 88 | /nine /colon /semicolon /exclamdown /equal /questiondown /question /at | |
| 89 | /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X | |
| 90 | /Y /Z /bracketleft /quotedblleft /bracketright /circumflex /dotaccent | |
| 91 | /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u | |
| 92 | /v /w /x /y /z /endash /emdash /hungarumlaut /tilde /dieresis /suppress | |
| 93 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 94 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 95 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 96 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space | |
| 97 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef | |
| 98 | /.notdef /Omega /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute | |
| 99 | /caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE | |
| 100 | /OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef /.notdef | |
| 101 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 102 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 103 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 104 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 105 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 106 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 107 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 108 | ] def | |
| 109 | ||
| 110 | %%EndProcSet | |
| 111 | %%BeginProcSet: 09fbbfac.enc | |
| 112 | % Thomas Esser, Dec 2002. public domain | |
| 113 | % | |
| 114 | % Encoding for: | |
| 115 | % cmsltt10 cmtt10 cmtt12 cmtt8 cmtt9 | |
| 116 | /TeX09fbbfacEncoding [ | |
| 117 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi | |
| 118 | /Omega /arrowup /arrowdown /quotesingle /exclamdown /questiondown | |
| 119 | /dotlessi /dotlessj /grave /acute /caron /breve /macron /ring /cedilla | |
| 120 | /germandbls /ae /oe /oslash /AE /OE /Oslash /visiblespace /exclam | |
| 121 | /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft | |
| 122 | /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one | |
| 123 | /two /three /four /five /six /seven /eight /nine /colon /semicolon /less | |
| 124 | /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N | |
| 125 | /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright | |
| 126 | /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l | |
| 127 | /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright | |
| 128 | /asciitilde /dieresis /visiblespace /.notdef /.notdef /.notdef /.notdef | |
| 129 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 130 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 131 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 132 | /.notdef /.notdef /.notdef /space /Gamma /Delta /Theta /Lambda /Xi /Pi | |
| 133 | /Sigma /Upsilon /Phi /Psi /.notdef /.notdef /Omega /arrowup /arrowdown | |
| 134 | /quotesingle /exclamdown /questiondown /dotlessi /dotlessj /grave /acute | |
| 135 | /caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE | |
| 136 | /OE /Oslash /visiblespace /dieresis /.notdef /.notdef /.notdef /.notdef | |
| 137 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 138 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 139 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 140 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 141 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 142 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 143 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 144 | ] def | |
| 145 | ||
| 146 | %%EndProcSet | |
| 147 | %%BeginProcSet: bbad153f.enc | |
| 148 | % Thomas Esser, Dec 2002. public domain | |
| 149 | % | |
| 150 | % Encoding for: | |
| 151 | % cmsy10 cmsy5 cmsy6 cmsy7 cmsy8 cmsy9 | |
| 152 | % | |
| 153 | /TeXbbad153fEncoding [ | |
| 154 | /minus /periodcentered /multiply /asteriskmath /divide /diamondmath | |
| 155 | /plusminus /minusplus /circleplus /circleminus /circlemultiply | |
| 156 | /circledivide /circledot /circlecopyrt /openbullet /bullet | |
| 157 | /equivasymptotic /equivalence /reflexsubset /reflexsuperset /lessequal | |
| 158 | /greaterequal /precedesequal /followsequal /similar /approxequal | |
| 159 | /propersubset /propersuperset /lessmuch /greatermuch /precedes /follows | |
| 160 | /arrowleft /arrowright /arrowup /arrowdown /arrowboth /arrownortheast | |
| 161 | /arrowsoutheast /similarequal /arrowdblleft /arrowdblright /arrowdblup | |
| 162 | /arrowdbldown /arrowdblboth /arrownorthwest /arrowsouthwest /proportional | |
| 163 | /prime /infinity /element /owner /triangle /triangleinv /negationslash | |
| 164 | /mapsto /universal /existential /logicalnot /emptyset /Rfractur /Ifractur | |
| 165 | /latticetop /perpendicular /aleph /A /B /C /D /E /F /G /H /I /J /K | |
| 166 | /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /union /intersection | |
| 167 | /unionmulti /logicaland /logicalor /turnstileleft /turnstileright | |
| 168 | /floorleft /floorright /ceilingleft /ceilingright /braceleft /braceright | |
| 169 | /angbracketleft /angbracketright /bar /bardbl /arrowbothv /arrowdblbothv | |
| 170 | /backslash /wreathproduct /radical /coproduct /nabla /integral | |
| 171 | /unionsq /intersectionsq /subsetsqequal /supersetsqequal /section | |
| 172 | /dagger /daggerdbl /paragraph /club /diamond /heart /spade /arrowleft | |
| 173 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 174 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 175 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 176 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 177 | /minus /periodcentered /multiply /asteriskmath /divide /diamondmath | |
| 178 | /plusminus /minusplus /circleplus /circleminus /.notdef /.notdef | |
| 179 | /circlemultiply /circledivide /circledot /circlecopyrt /openbullet | |
| 180 | /bullet /equivasymptotic /equivalence /reflexsubset /reflexsuperset | |
| 181 | /lessequal /greaterequal /precedesequal /followsequal /similar | |
| 182 | /approxequal /propersubset /propersuperset /lessmuch /greatermuch | |
| 183 | /precedes /follows /arrowleft /spade /.notdef /.notdef /.notdef /.notdef | |
| 184 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 185 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 186 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 187 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 188 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 189 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 190 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 191 | ] def | |
| 192 | ||
| 193 | %%EndProcSet | |
| 194 | %%BeginProcSet: 74afc74c.enc | |
| 195 | % Thomas Esser, Dec 2002. public domain | |
| 196 | % | |
| 197 | % Encoding for: | |
| 198 | % cmbxti10 cmff10 cmfi10 cmfib8 cmti10 cmti12 cmti7 cmti8cmti9 cmu10 | |
| 199 | % | |
| 200 | /TeX74afc74cEncoding [ | |
| 201 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega | |
| 202 | /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute /caron /breve | |
| 203 | /macron /ring /cedilla /germandbls /ae /oe /oslash /AE /OE /Oslash | |
| 204 | /suppress /exclam /quotedblright /numbersign /sterling /percent | |
| 205 | /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma | |
| 206 | /hyphen /period /slash /zero /one /two /three /four /five /six /seven | |
| 207 | /eight /nine /colon /semicolon /exclamdown /equal /questiondown /question | |
| 208 | /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W | |
| 209 | /X /Y /Z /bracketleft /quotedblleft /bracketright /circumflex /dotaccent | |
| 210 | /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u | |
| 211 | /v /w /x /y /z /endash /emdash /hungarumlaut /tilde /dieresis /suppress | |
| 212 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 213 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 214 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 215 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space | |
| 216 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef | |
| 217 | /.notdef /Omega /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute | |
| 218 | /caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE | |
| 219 | /OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef /.notdef | |
| 220 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 221 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 222 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 223 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 224 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 225 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 226 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 227 | ] def | |
| 228 | ||
| 229 | %%EndProcSet | |
| 230 | %%BeginProcSet: 0ef0afca.enc | |
| 231 | % Thomas Esser, Dec 2002. public domain | |
| 232 | % | |
| 233 | % Encoding for: | |
| 234 | % cmr5 | |
| 235 | % | |
| 236 | /TeX0ef0afcaEncoding [ | |
| 237 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega | |
| 238 | /arrowup /arrowdown /quotesingle /exclamdown /questiondown /dotlessi | |
| 239 | /dotlessj /grave /acute /caron /breve /macron /ring /cedilla /germandbls | |
| 240 | /ae /oe /oslash /AE /OE /Oslash /suppress /exclam /quotedblright | |
| 241 | /numbersign /dollar /percent /ampersand /quoteright /parenleft | |
| 242 | /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one | |
| 243 | /two /three /four /five /six /seven /eight /nine /colon /semicolon | |
| 244 | /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K | |
| 245 | /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /quotedblleft | |
| 246 | /bracketright /circumflex /dotaccent /quoteleft /a /b /c /d /e /f /g /h | |
| 247 | /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /endash /emdash | |
| 248 | /hungarumlaut /tilde /dieresis /suppress /.notdef /.notdef /.notdef | |
| 249 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 250 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 251 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 252 | /.notdef /.notdef /.notdef /.notdef /space /Gamma /Delta /Theta /Lambda | |
| 253 | /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef /.notdef /Omega /arrowup | |
| 254 | /arrowdown /quotesingle /exclamdown /questiondown /dotlessi /dotlessj | |
| 255 | /grave /acute /caron /breve /macron /ring /cedilla /germandbls /ae /oe | |
| 256 | /oslash /AE /OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef | |
| 257 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 258 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 259 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 260 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 261 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 262 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 263 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
| 264 | ] def | |
| 265 | ||
| 266 | %%EndProcSet | |
| 267 | %%BeginProcSet: texps.pro | |
| 37c41ab1 CR |
268 | %! |
| 269 | TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 | |
| 270 | index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll | |
| 271 | exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]FontType 0 | |
| 272 | ne{/Metrics exch def dict begin Encoding{exch dup type/integertype ne{ | |
| 273 | pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get | |
| 274 | div def}ifelse}forall Metrics/Metrics currentdict end def}{{1 index type | |
| 275 | /nametype eq{exit}if exch pop}loop}ifelse[2 index currentdict end | |
| 276 | definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{dup | |
| 277 | sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll | |
| 278 | mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[ | |
| 279 | exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}if} | |
| 280 | forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}def | |
| 8a9c66f6 | 281 | end |
| 37c41ab1 CR |
282 | |
| 283 | %%EndProcSet | |
| 284 | %%BeginFont: CMTT12 | |
| 285 | %!PS-AdobeFont-1.1: CMTT12 1.0 | |
| 286 | %%CreationDate: 1991 Aug 20 16:45:46 | |
| 287 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 288 | 11 dict begin | |
| 289 | /FontInfo 7 dict dup begin | |
| 290 | /version (1.0) readonly def | |
| 291 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 292 | /FullName (CMTT12) readonly def | |
| 293 | /FamilyName (Computer Modern) readonly def | |
| 294 | /Weight (Medium) readonly def | |
| 295 | /ItalicAngle 0 def | |
| 296 | /isFixedPitch true def | |
| 297 | end readonly def | |
| 298 | /FontName /CMTT12 def | |
| 299 | /PaintType 0 def | |
| 300 | /FontType 1 def | |
| 301 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 302 | /Encoding 256 array | |
| 303 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 304 | dup 0 /.notdef put |
| 37c41ab1 CR |
305 | readonly def |
| 306 | /FontBBox{-1 -234 524 695}readonly def | |
| 28157acd | 307 | /UniqueID 5000833 def |
| 37c41ab1 CR |
308 | currentdict end |
| 309 | currentfile eexec | |
| 310 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 311 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 312 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 313 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 314 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 315 | 2BDBF16FBC7512FAA308A093FE5F0364CD5660FE13FF01BC20148F9C480BCD0E | |
| 316 | C81D5BFC66F04993DD73F0BE0AB13F53B1BA79FE5F618A4F672B16C06BE3251E | |
| 317 | 3BCB599BFA0E6041FBD558475370D693A959259A2699BA6E97CF40435B8E8A4B | |
| 318 | 426343E145DF14E59028D4E0941AB537E34024E6CDE0EA9AF8038A3260A0358D | |
| 319 | D5B1DB53582F0DAB7ADE29CF8DBA0992D5A94672DFF91573F38D9BFD1A57E161 | |
| 320 | E52DA1B41433C82261E47F79997DF603935D2A187A95F7A25D148FB3C2B6AA32 | |
| 321 | 6B982C32C6B25867871ED7B38E150031A3DE568C8D3731A779EAAF09AC5CE6C5 | |
| 322 | A129C4147E56882B8068DF37C97C761694F1316AF93E33FF7E0B2F1F252735CE | |
| 323 | 0D9F7BCE136B06EE967ABE0C8DF24DCBBF99874702ED252B677F407CB39678CC | |
| 324 | 85DDFC2F45C552BA967E4158165ED16FECC4E32AC4D3B3EB8046DCDD37C92FDF | |
| 325 | F1F3710BB8EF5CA358ABACA33C7E5ACAD6BF5DC58BDFC3CF09BA2A38291D45A4 | |
| 326 | C15FF1916FE2EC47FDC80911EB9C61F5D355BEDFC9DB17588547763AC5F0B1CC | |
| 327 | 12D2FFB32E0803D37E3281DA9CE36C5433655526ACFB3A301C56FAB09DF07B5D | |
| 328 | 048B47687348DEB96F3F9C53CE56DDD312B93D3918CD92AF53FB9461864D11B8 | |
| 329 | 0138918D0B1270C54873C4012CDE6F886DB11BCEA04B023EBB43E0D0A06BE725 | |
| 330 | 741D08B9DB688731A6C9886C15A83C28DADCC81385EA239E045E8F3670CE03DB | |
| 331 | 9EE77ED067036595C9F3B1854343BE3A12E486B6E5A2F8AC44FA5378D28DCCEE | |
| 332 | 306B0E283AA444423F9A4FF38E2B56DCF67A39CEB2C643DAE86865517D5D0371 | |
| 333 | CB8797208ADEC637330A3A57902C9A88EDB75A7C16FA9850075D9F19578EC666 | |
| 334 | 1353CC1FC512D59DFF847ACCD3D295C5D09DFE2A27B87A0F54938CC908FC87F8 | |
| 335 | A08FF8F94A3051855B401F349F5CBC1DAD02C3CBE583E69FBD18FC747D2730B9 | |
| 336 | A62F25952755ECC04C1852CB5CA505043B428E2BF1D407A26E0AC0C85E0DEB4C | |
| 337 | 425D14F1A1BA5972EC78AF68FFDB2425A9F5ED10220B1716A83D53D5958094ED | |
| 338 | 3D2CD66F2A070515F737516108CB2B0205255E9BA568C2A847679FCE1B1AAC31 | |
| 339 | 128359CED2C77D35333CE94AB2B05797C43EA28810F314D3283555D399E30FEC | |
| 340 | C1F113B94484B6CFCC0988EA652BD5E0F61983225CE3A1CC1FA80F13DD945516 | |
| 341 | C84962DC76A254C62CCBDB47B6CBE6DD237E38177D216AB3F9BBF876C4775680 | |
| 342 | A4F8CE4DB65064C59D540E36EDCF9C3AD79FFCFA244A6FB20D047BB4774E6316 | |
| 343 | 69F7D47D459A56A68B2F45417DA9C04CF6F370D13E2292908671929511BAC37F | |
| 344 | B8F709AC597A2B80340B60584817C685319CE7CD7FB243F5D9F9848D4B45CC4D | |
| 345 | 22CE6FEDDC2316EC3199EEEF12CA0263ED6122153C444612F0612C338981E889 | |
| 346 | ECB0006CFA33076F02EA838E03E551785BFD414BB360B19A0CFCEA852C12F6A7 | |
| 347 | C36E68E2121B416EB29CC55D87804D6E79B876C7A0BEA416FE1FCC727D00E341 | |
| 348 | 47F2B3A20534E6C16D81C0CAA970639C0D690DF2383FA7D6693E1863F2BFA94D | |
| 349 | D7A0B91D6E2A5770D6997971C227B38D3AB79D62CFA3BB7E18E5857FDE0271DC | |
| 350 | 8D0467EB8A60EF3A0EBD77730AD8F4D7AE248C103CCEFC17C717DDFCDE9ACE1C | |
| 351 | 1BBBF78434C9F66C455D1A02859960717C61B0FE911A0FEC12B0783F944F9B1C | |
| 352 | B7BE3D1B67108D79A2C5C578B97B870F5BB646CFCECB27885DDAF5342783ED3D | |
| 353 | 84463FF40B432FCDCEDAC7827FA0C1F6E26805C50EE6448BE598BA51324A6F5E | |
| 354 | 493F035C131B7D9DB57EF720FE2E5FE1C532C51A0905EAFFE463BF7E47202808 | |
| 355 | DFB0934AB9B27C12D8BB566BCF4D89709D282CDA9607E25DBC140F61671B1926 | |
| 356 | 0CBE74FBB99D87802E74A250E87029AA28E98B3FA3DFEFAD4723DE5961E9AF3C | |
| 357 | B5A35E3BED0B97894CF8E44176570DDCD6EDF06CB66F0CDCBE75F77E14C90F89 | |
| 358 | BA830760415ECCE0DD1A1B2191891182275904FA1B587DE149829C711CB58ACA | |
| 359 | 33843E14B42B9C120C917D57DD8EE4F0ECC257767B6AC6EB80E563F84101AE08 | |
| 360 | 829ABC0A055A4D33AB19281A0345AEE764A7D135BCAB8735A051D8A7892B4702 | |
| 361 | E9917E2CB149C24C721C1D12731A5F8412524CED7E850602D8BD05F7BEB64F46 | |
| 362 | 472A600F50E758FD22A8126A913C001473CBC84165A4B46B25E00FB2348F3896 | |
| 363 | 20C8886A5B08704C319924C1749F33A3096406A27FDADC6F17807103DA04D354 | |
| 364 | FEF400100881609A42E8572819B845B8A8B7FCF2CCCA75A1CB25BBBF3E2B1C45 | |
| 365 | FC4BDEC03311D6CCF78669C53432D786530039B36A8037A95A231F17E98359E6 | |
| 366 | F0E892CAEB646877F4C4FFBCCB5C5A8143FF00B90F01A62D0BE68D593E97A2CF | |
| 367 | 2EC3C1D389C2474878A7E7BAF4C97C2733F958D6CD02F9EF880158455958A15A | |
| 368 | C2A4ED22526838EC3530C7EC5654204444A28529BF68ADCF93E3DA72ABD50E46 | |
| 369 | 3499D9A9A061D59C0D35F1FA5C5EA5CB93500268FE96B416F66EF179E184D595 | |
| 370 | 14DED98C95A8EEF2D172F8F59AC529A392838572C0E48018F8C9D6E6644AEA2D | |
| 371 | 60C68F8B4BE2420B171750C96F8398C99DFB709379085C901EE6DA44DC4F671D | |
| 372 | 10172309F8E7E7E8D9F5D4A6EBCFE0C28BDD4D6DAA0C103AA0BB2F2D52217302 | |
| 373 | B580D26E9A89AB56927E729AFB576FDE9877B16A2483B67D3917729597707B08 | |
| 374 | C183A0DE48462D2E16BA17F8BACB18BB9B15434551FD9F0D9F6142F4A668F631 | |
| 375 | 8BE9288B53AAF5755A28DAA6D71D17062D29D19A9EB299814755C4C6E5D03B64 | |
| 376 | CE8ECD65C961AB35E468C36E087857A9315D362A1D3655A41D249C32C459760E | |
| 377 | A66FD627FCC6745F9575782B47F362A33C418F10C16E0DFB67A151E107B5109F | |
| 378 | 4F58565797D5BA3E4B0A45978FDFA804C452F708A81314B36D5F448A836C08EB | |
| 379 | A2FF2DE947BD3779658BEA382C00DE63BF2AC04DC2DED83B8DFC1263E7819446 | |
| 380 | 244FBF5CFD4581952D515909B617C205A54AB0B40CA7ADE8DF11B60C4F14802A | |
| 381 | 1398444E83A91834D2BF6E9525E6F9BBB4757EC393751695D626926D4240CA7D | |
| 382 | 501664845B89C7E6BE94E3BE8D67531C5528465CCF393A383238EE573E2A452A | |
| 383 | 97ECE639797A8B18FE620BE63784BAAD630E0F534E3715408A0AAABDB0767EE9 | |
| 384 | 92E8CC835ADACCE79B38AF6C21DA95F5B5EB17AD07892B6DE3598FE66FDB07F6 | |
| 385 | ||
| 386 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 387 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 388 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 389 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 390 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 391 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 392 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 393 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 394 | cleartomark | |
| 395 | %%EndFont | |
| 396 | %%BeginFont: CMR9 | |
| 397 | %!PS-AdobeFont-1.1: CMR9 1.0 | |
| 398 | %%CreationDate: 1991 Aug 20 16:39:59 | |
| 399 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 400 | 11 dict begin | |
| 401 | /FontInfo 7 dict dup begin | |
| 402 | /version (1.0) readonly def | |
| 403 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 404 | /FullName (CMR9) readonly def | |
| 405 | /FamilyName (Computer Modern) readonly def | |
| 406 | /Weight (Medium) readonly def | |
| 407 | /ItalicAngle 0 def | |
| 408 | /isFixedPitch false def | |
| 409 | end readonly def | |
| 410 | /FontName /CMR9 def | |
| 411 | /PaintType 0 def | |
| 412 | /FontType 1 def | |
| 413 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 414 | /Encoding 256 array | |
| 415 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 416 | dup 0 /.notdef put |
| 37c41ab1 CR |
417 | readonly def |
| 418 | /FontBBox{-39 -250 1036 750}readonly def | |
| 28157acd | 419 | /UniqueID 5000792 def |
| 37c41ab1 CR |
420 | currentdict end |
| 421 | currentfile eexec | |
| 422 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 423 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 424 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 425 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 426 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 427 | 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 | |
| 428 | 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F | |
| 429 | D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 | |
| 430 | 92A36FADB679CF58BAFDD3E51DFDD314B91A605515D729EE20C42505FD4E0835 | |
| 431 | 3C9D365B14C003BC6DD352F0228A8C161F172D2551CD1C67CD0B1B21DED53203 | |
| 432 | 046FAFF9B1129167921DD82C5964F9DDDFE0D2686875BD075FC81831A941F20E | |
| 433 | C5CD90040A092E559F6D1D3B0E9BB71733595AE0EA6093F986377A96060BF12A | |
| 434 | A1B525CD9FA741FE051DD54A32BECD55A868DD63119A4370F8322CCBEC889BC2 | |
| 435 | A723CB4015FC4AA90AE873EA14DE13382CA9CF0D8DFB65F0ABEDFD9A64BB3F4D | |
| 436 | 731E2E1C9A1789228FF44116230A70C339C9819676022AB31B5C9C589AE9094B | |
| 437 | 09882051AD4637C1710D93E8DD117B4E7B478493B91EA6306FDB3FA6D738AAB1 | |
| 438 | 49FBB21A00AC2A999C21445DE3177F21D8B6AAB33869C882613EA6B5EC56476B | |
| 439 | 5634181ECBF03BFEDB57F079EACE3B334F6F384BDF9D70AEBD592C8ECF21378B | |
| 440 | 54A8B5DBF7CB9282E16AA517E14843909339B5E7C55B038BF3BB493F3B884A1C | |
| 441 | C25F9E8FB912CBE23199AD9D2C3E573727701BA301526C66C3617B9514D6F11F | |
| 442 | 11930B1D97C17816C85B1BFD9B973A191B33CC3B391815AC46268691C741B2D4 | |
| 443 | 48A840F1128D9B2F9CF07D0709FE796B23A836417BF7B5B12D67F74453C82F5F | |
| 444 | 25F7B30701D6F6D4F4DC623C0C27D6A6FBECC7312A3CD10932FC7C10851C3C52 | |
| 445 | 24B75DEA8A648B7F34F5711DB0E843C914E25663C510185BC37BDB7593C1C259 | |
| 446 | 21D8DDAD33982C336BF272BAB2F48E68217403FE9F54877B243614A87E64784D | |
| 447 | 2796EE4179FBF96123D1BEE3EF89D682B427BA4F12A1318A57F18BE5DD903815 | |
| 448 | 26141589B9DB4C849B9628F781E6449B19640A9FFDA1F601120006E44A860188 | |
| 449 | B311425E422E51E61638D13C3E73A5735AE1A5302E290B24B4D0366C53E460A0 | |
| 450 | BA0B093E70BF9E5E438CCC0219974F12FCEBD742D9364CBA02229EF59D938ECA | |
| 451 | 18902C7CBE1265FA0597BA67B0B05E116AABCCA0FA6817F8A8803F61D6842718 | |
| 452 | B0EAB943575322BB38B86B51E9DA2F247A0FFECC8E3E327AFABBF5F6966E9FDC | |
| 453 | 5FFB9A3075CFAFA8A119019DD243BB1B0B8A0756A96C894D90000AEE0597A54E | |
| 454 | BBBD4A2077FD9F9A8A17FCB91AA6C68762AA23B99D5C87C62323DED943EB85E0 | |
| 455 | C597B8C67A6FFDC8E849A807F703C8A92809313CB8871143AA11815A1259CCEB | |
| 456 | C17B124C67F8678BBED3A00A9A7E9BB5699E81CEEA18B0BC1EF3B49E3DBA1CFB | |
| 457 | B0286E92685F5D9EC12419A6E8997F34E6E29B9E66119430D82509B8AE4BA7F9 | |
| 458 | B3137FA0E5D92948D0E0E8432A58A55D534CDD1339B20990B58DF13396FFFB01 | |
| 459 | 818DAEC0E7777059CE15D6BE8B313EAB3BC5CC04DA2F41775419FDE3BBDBF4D1 | |
| 460 | 4E6F1FEA0F3A746DD5A1DA447821E12597143EAF04D221FED9408A3DFB5F6D18 | |
| 461 | 4B9D8BCF5F947D893C988C13BBD1C45AD5F68E24C0D401E2FA8C0B911A179DB1 | |
| 462 | CE8E847144CF6363B241A3195414FFED9617F6ABAE1C9A7D1F5C385A9138DD0B | |
| 463 | EF2CF3A005050C9B0264DF4F824602CFA58FBF83F6B26A7972C2BE206C34F5AE | |
| 464 | 189FC968BEBA2E1B0EEBB86652A4AE7F86B93DA4F3CA93BD5C73E842EA96B3D5 | |
| 465 | A114D45D983BB890CC19F9944DF4741761C568141A87757C170595357A3A0546 | |
| 466 | B09CD7394A5F8A7E3E7661FBB04435ECDDB1BF4C5EC2A61A78F6E8F024D008BC | |
| 467 | 0A32FEEBC3DC0E9D3E572A2ADA2A0CA043C1C40B09C2954BFAC36030EE3CA9AA | |
| 468 | D49571EB8D392ED4ECB090477974F4E7D898438FB6312873D925686F05E5BDB6 | |
| 469 | D2274540F20C5B0409ABD35FC4C90071BBF121C656EE78D55B5F7D1606A958F7 | |
| 470 | CF1F81E631771333211F9286378ADD6525D5E4548A547DFDE2900D63EAB5DFAA | |
| 471 | 5ADCEB72A14EEFB53BF0B93C531211CCE2CB1B52FA387A716E79ED9ACBD9A3C2 | |
| 472 | DEBE7744DB6DA31D29E30998B42456D6FE15B3500ED0F003C985C5D4A38D55FD | |
| 473 | A70B015AEAEEBA889304E3DBAE87BF8BD28770B4014F4DBD5AE199D8B9536E70 | |
| 474 | FCD38C0B0E6C32C17218E0D86C0CCFB67CBF635D0A51BFA2CEE5A371D70DF4A0 | |
| 475 | 8359DC9C79122FB837299EA0C1EC7FBA0B3378CECCA1187804B48E4565AEE1AC | |
| 476 | E4162304465ED336C1A47C7A0ED44CD9F7F8EB851DE25A1EC6A536BC1D908279 | |
| 477 | 2637F66B9B11FBDE78D8FE275433106E69CE8693A395D59D20B0980E6D965B3B | |
| 478 | A29E9867D60010A45B94436D947C87385CB59113B1493550FD02FAE717AFBBE1 | |
| 479 | F630D61011E4D76DD3A9F57CBEC6DBF1896325FAE389CFF97B303CCA999E20E4 | |
| 480 | 57A7030758227017F51468FBF5AF4906D4403E23FFA829D3A9B11E58E1E2591B | |
| 481 | 24B467F1441B517ACD03F03D18E6A99CFECD54B9F91814337C3518D48B3BFE91 | |
| 482 | CF21D7D61B0EFFA25EA0B6B1E9F1A1518996178E619F9465E6E969F44ADB60BA | |
| 483 | 42565866C9AB7DD3F805A14900013294585A7C8B8B0DE2BE4A3634F61BA335E0 | |
| 484 | B82FB93C54D5FCEA68733C71D369D9FA4F3F7F1FB797441CCD5004FC4ACA1D5B | |
| 485 | C02E4F4123FFB4CC2D8951836A984875CE041FDC0ACD8B2A8E238C9738E39DCB | |
| 486 | 1D6015147E6EAD26DEA8163272090B5F9866F5BDB356CA1D62EA8A0B60493435 | |
| 487 | CAE557FBB2FAACC68D5F8A4FDCEAA0E2C82F167DC8B463E966467A741223D937 | |
| 488 | BF647469DEF8432DC5AA1E0D2D28CC0F1EB27501367FCB0DD9920F547A48E2E8 | |
| 489 | 773C1D6B13A50654D4B4E463375D58762FE46F7B4AA1395DBE36DB9A39A4CAEB | |
| 490 | B27071F27172D33B57A632634F738504312DD9D7470D4F6CCAAC1A0D3E04E8BF | |
| 491 | 6C951AEA1E54089A07423EC1090A1339A2AF21862A2AC993E599C39DEBD6CB3D | |
| 492 | FEA4787D129BA9F71899248B4CCB37B30EA6FF86F969A527F56C8A2BF2C72EDE | |
| 493 | C49A90723DEFCEA55047597AF887DDC49E2EF8CB794A1C1591C2E951063F5B0D | |
| 494 | E93CF4AD7D0769FADC79886CC7F25ECFF5B77C47E9204987D7AF6B13A8998BFA | |
| 495 | E5006923F3C61A3CCF6BFFB5DA63627F17BC2869DEFC98C67DF60424F8F8F585 | |
| 496 | 5DB4CCBBA16795C8D8DEF245BF954787F097B473AA571CD7A3607FB4DB277BCC | |
| 497 | DEDAEF8825A5E040E0EBC36179D3D673B9008BD0131C4529A93C2AF79BE99F70 | |
| 498 | E78D9D5FA0FFF06B013B8AF4BB5E328055AF9635F2AE7D6F741C043706EC7EE2 | |
| 499 | 4E3033ED8BF2A0E2849A1F594E114A00E04E36FF810E312C3414566C3479E748 | |
| 500 | 6E6DB35321874BEE56B562E1A82FE9A5EB9945A7D05170AB85D1FE58274C85B0 | |
| 501 | B9A50E491AB43863B115266242D2AF357BF1ABA348D83CF48C803601D413630A | |
| 502 | 94EA81BF6838D64D384590AD54926109651056AB83EE8BEAF15E010646EE31D0 | |
| 503 | DD32A0CD9435F33FE9C3C308E2412B65DD2B6EE05686EFE2D052A6AE449FB338 | |
| 504 | 6831AE4E0BEF3ACF3F3655DB8238EC9F0B1B543865D2581145CF98562E69C542 | |
| 505 | EF2857167B8F116EF2570487BA57AE6C05583763B24341BF2CDF983AD7CEAA4C | |
| 506 | 6837582B40A6508ED64BF5917AF1CB8E9F795B740386AECF52EA094D3BADA159 | |
| 507 | BACC1D8E3A6DB913E1203010BCE8F75F1EBB4F5A0CCF35E82497E109F115A864 | |
| 508 | 7DFF57DD7212BCB0BAE1787203E88C9EBD9208D905A4F7F56FFAB24DFDC6053B | |
| 509 | C460BEFF9FB9D0E145588FE8143BB3E6CD2072532BB03E8293C47EC2F740C602 | |
| 510 | AFBE8AA8C670A2835F55AB63D0E18C4C338767A86E9353CBBEECE199D664E84E | |
| 511 | 1EE4C5291D4B58C03463743EF5C59FA9F879423C4E1430E6FCCAADD89C05F8CE | |
| 512 | 8BD78AA57F70571E0B083CACB12C8E89728A542EB58E531E8DFF8164C86CCC57 | |
| 513 | 5ACDE9E9575B2028EE1F93C2B416123D2C2EFD2FA9DDF1857018C6A978CAD17D | |
| 514 | D95D92D1E564814F02729248EBCA0F69BBD35A6EEC46811BF5478796CF492A6A | |
| 515 | 796A013DE9844ACA7377AAC0F00331D9C7D8D4184E128D61CEA5E68388FC68A0 | |
| 516 | AED5DC264E973C0BA6EE0F6F7C540B563120D3DBDFE06866E9820C64E00A861E | |
| 517 | BB208B22A1DB195CC5B29D80DD65911233BF68899C8739FBC44AE8B8A4A7B08A | |
| 518 | 60621FBED6418BC7DECDFD9325D9ACD9CE9A787A467CF44D0EFFCD8E89E30EA5 | |
| 519 | 0ECFC159C2AA45841FD5170B9933A9CAA862B7A4A293FA59625DBA668EE1FD8A | |
| 520 | 17AC512DDC9D30B8A3215F2577E2063AE3F622801CA14FDDD0C2F0087E5DA873 | |
| 521 | F9EEB0D23DFBE8B0117C90EBB86983ACEE937810BF998B5B60AAF854DFFC3B38 | |
| 522 | 19B4C00F221BEB5CD126A01A20BFC333C3176176DBC3483F26297306BA56E155 | |
| 523 | 404DA68C2569732B15B74201CEEAA696E4C949A890B4C4AA3E931F8EE9A7FFB9 | |
| 524 | 44789CABC1DA86C54D43F1D2ADEBEDD4D9B764459352EAA4058A0DF5E925DE6B | |
| 525 | 5C4449E06686AE847A72B3DB0750C848C0F21A15E0C282DE6B989552A3755A97 | |
| 526 | E6D8BA6382D29CA47901A8F65867C4BCEEA35D75BB5CAD2930627A8462605DD2 | |
| 527 | 2825298D0AD47F81A7A12BD1A9DD293655FCA634D57F5259C98CE71005BCA2D7 | |
| 528 | C4B0CDFA9440EE4122A2CD6AA1F482838E0FB787EEBB5242AD1DA8C4C5E2829F | |
| 529 | 6567717A520AD64AC38AA586BB7432E9E567A9BB39E6018BA4ACBD172821E553 | |
| 530 | 9664C8BDDA39FDA69B47A17807293C4E1897ED1C608EE5C12DDE0B415BAC7FD6 | |
| 531 | 067BFE7C4BFC199A125FF68CC186372B9A212567DEB70985EE7667E0BB46E30E | |
| 532 | DA0D988D18A9E71133FB8130A5A11812A01C7D88C79A7AACF2D236EB9CFF413E | |
| 533 | F4F388671797C31599CE79169EDE7716C0B9DBF61892ED3A1CC9684FE3068F3E | |
| 534 | BE886A7B1A0D3E0C357858E209649561CD211B91264675E1978A7ACE2DCBDC29 | |
| 535 | 74118BE4F2B7C30558C0F3746F1C9E6A20931EF3C768009BB77B0CD9847A4281 | |
| 536 | EB754372DE304734457C102611ED20D4822F118D5BEA9661A8A4A8E0CC549489 | |
| 537 | 84D79E5C3AAF4FF29E81E2BCB8DC125109CE37BA6F7EA0D078B8AE8FF3695243 | |
| 538 | 1BB75054BF37D6209DC4E31D971E876B1799B3ADC4D2B636EF0C7FC11614231B | |
| 539 | 5BBD3A372EE95327AE7F423065E42C16D2B2EDF92A6118C40D4D2F2C5B683B25 | |
| 540 | 194F940AB871807A013B8F47700DC4DC2E935776CF4DD8B2C138432BF1331B1E | |
| 541 | 80B9D9ACC3897B41682315D62963AECAD855D3A4A7A2011BBA3DAAB75F4031DE | |
| 542 | F43A9628A073C49C0BF50340D5F239C3D1BC5276FD36C73A46B4A79C619F30E3 | |
| 543 | 73F3D58EBAC5FE2A4A22C362B8F9ADEEB3CCD0D31166178D241A24BCC61B2442 | |
| 544 | 23BFE2CA3E8FBA1B1FF660DE333184734E0D00BE164FBA03CFDDC13D65D29789 | |
| 545 | 27D3B2EAE0BB3DF0038C17A38FDF8CDE17E812DDBBA20F846767A178595DC63B | |
| 546 | 894C0A1FC610386087249495B08FA611EFD4E40AEDB0C8A92599993398EDA09A | |
| 547 | 62A56FD9FF0668FBE37294BEB2CF44785A8F1AA3FC65EF86E33D41619DBEA1C2 | |
| 548 | 25977D7C98974FA2CF8F552D55DA8EA87575774CC6CB3EDE9F6F0DAC189431B9 | |
| 549 | 58323A4CE3668D79D8B163BF08E4E85B9A4D93E534EBAD4039F0FBB3A43A17A1 | |
| 550 | C9898A1C75CC569784074F20ABE85231DFD859D712C181A106C86AF21ACDBB25 | |
| 551 | D4DE1A3982C7AEC8B93B596C49797D30FEE9A3A6195BCCEDB952DE695675FC30 | |
| 552 | 639FC6027BCA9A6A0EC6D01B0150BD0B57988DA1DE10AC902B1F29E7E29A6BBA | |
| 553 | 7B18C607819DDC53646FDCFDDE54A496775CC46DB45BED9FA297FF79B870F99E | |
| 554 | 0266FE50ADB32CC6D7E590D99C0DDFF0F1CC104A8BF44C47B31A56441C83F443 | |
| 555 | 9BC6200E5F0FBADD5846EC7C8F1DF1DEAFD7F4AADAC9C2540B4EEB98AAED1180 | |
| 556 | 0E632A23D9B53A6EAE41D5EA9C51EA04EE49458CBB0F496F84EB4CEBE0349FE0 | |
| 557 | 9CF81EF8CD856E92EAC893FEC03985B1082176581791FD5E89EFD6400729F36F | |
| 558 | 8A7D873C658FAAF4EEF2865133020E49244CF4FD8CAFBEC08794C0027DFCE196 | |
| 559 | E51C62BF45A599545814BC448A01C475A663A4497FC420232FEAFC83CA9A273B | |
| 560 | 99BD564032CFE2E4CDE6E5170D30D8CCC00EB65AAF766896E3C81157EA379722 | |
| 561 | 8953EE3B001DA3929AB84466079BD1647FF2C1FA077AB9EF5F50AC908CF56F1D | |
| 562 | EB6578F87451C63AF8FCFBABC67537ED44F2E84FF1C26B376441EB0330DD16DE | |
| 563 | A7B23A4BF434754044B8C067FA64274732235F6AE9D36019D21C3AE156026AB2 | |
| 564 | 34FCF01844E0125CE72F305ADACFFB9DAB8DB3EA160925A7883CFD31957ACB1F | |
| 565 | D9E925B6FE72AFEB962E671622195A84BAF7008884DC6D2F76726DDEE0A926A1 | |
| 566 | E03839C8FD709CD67EDE6D958A2625B53F1281D3246989BE1E91A63E481CE8B0 | |
| 567 | D4E017B8572DC6F4DEDB07AA1308CD43B21805B776274C1CDE2283704C999AE0 | |
| 568 | E992801118AE7FF2A9B38A0A56668651A008194011A06E83B215AEDFA044ECA8 | |
| 569 | 6E090F90FD605AA6FE7DA41B5A8F77EC688D3F427558ACDEF2775317C617DCBD | |
| 570 | A0382C9F8DE1D76A9E97273014FA37F4FBDB658528358C95E67245670B399EBD | |
| 571 | 14ED9348BBFE10232236D0DE2FFC241A0D5DD47E189586117A4931235EDE89F0 | |
| 572 | CE39F4311120E517EAC1791D19B53C60FAB31AE7DF52324E867EEA2FF7F57EA9 | |
| 573 | 52B9B3A92273B6C430DAF4EC4E66FDCA57AE283EE146CD7584EC6E3E15DBDC67 | |
| 574 | 3DF6FD613AFD83223B2C82B9550662C2717338DF7419C626532C2C727C7EC9C4 | |
| 575 | 67AC4899CD0B34869C951468CC73053EC8EAAEBC043D7344F7E1151FDA9CDB78 | |
| 576 | 26962B6F8EC149A06F4514233FCC29F59AE870CABE8EEC89BFB8A4FC4C048A15 | |
| 577 | 10E85357D4D77464BF998A5548D594DC1C0E170736E3FDB4837CAC26D3F57534 | |
| 578 | D7C7176BDF7DD76AC35CA91FE0B8C0FBA17C3FB4DFB9A0BC6BFAF0B6D2A9803C | |
| 579 | 43024BC30BE59525EFEE1D61FEE9F4939025FF68A6F213A7468503D91CA29DA1 | |
| 580 | DA7F23C07212E6C7E47AFF9003392054EF6ADFBD4D4B5230BAB2F8E365A13A8F | |
| 581 | 2812EEB21E62D7784338BB44CDF1160EA74CF9F226ED1837719F4669632BE163 | |
| 582 | 36365F8D5725D144CE335003A7E91F625FAAFC40C6191F683F33525F007CE77A | |
| 583 | 9ED0F975C38F42A59D53290BB8A9D065FF4FE8A37E87AE2F1A1C05CDD99378FD | |
| 584 | C3A3323AE26EC31EDF8F66DF7C3E22659437CBAC1BDC32363D9B0CF97C9856D2 | |
| 585 | C02A27518CD2156A5A86429BB103FFFA444BCB9F3D6AD1A67AD15CDD2653E787 | |
| 586 | ED1FDF94B3AA7B3B2C8E42E1D2F2D5DD5D5B8AA2B05407FF0462781DDB6C8B7D | |
| 587 | C29E8C07CAC763DA2681F19110166FC4A3F0F48F83FA1D8F903A7CD9E8942AE7 | |
| 588 | 44F608002B75C61C04D01897382C8C61985614170F4603F456FF710E81AB606D | |
| 589 | E1445B1F229788CDEC02FBA2ED5ED63EA09CA3CACD348123264D2E42570406CF | |
| 590 | 01B0D26B6C8E1F61E13D7AB33DACCD73243A64361ABD00EC00939D3E2024E524 | |
| 591 | ADC20AF175E99971601F65F0069E2F93EDE2A4B0FCA92FF2DDF5F62D8A366CAE | |
| 592 | 988421FD7C8CF5CDE44A8A64872B547ED08A5DC14B64612E2B531C5DC438AD42 | |
| 593 | B01DAAA15DD042A061BA0E0C2A15AF7B4F675C614BECA18A9DB7AF3885A2ECEE | |
| 594 | E73590646DCF1C0E637B8D41C677C0416C08837C256263D1E59D7F77959E8C4C | |
| 595 | 5E35D6825C95DCC0BC3873B62C2DB0C1132A2DA3BBFD0B79CA3F2165EC0753C5 | |
| 596 | 5C5D8B6F9E5D0D09EB8633CA00FCAFE780FE9FE75A3D43EB9346976473E884CD | |
| 597 | 6906C68AF30D9F7D3CFA4D02083B582460AC0D6065202ED76B2985CA2B3BE3F4 | |
| 598 | 7122B5E5964AA5203919E209644630FD4D0CEB6E609375D50D05C9233AB1A0D5 | |
| 599 | 7807B462671DFF0BB1087126F1964A519AB79C62AB8FB64A98688EC2B2202AB0 | |
| 600 | 448E7BCC1B797F431B49456B62D6DD7E013DB720DE07CAD495B7B5B4F97CB0CD | |
| 601 | CEDBBF1152A9DC207B25E5A3AFCC4C586CAB571F9B73A0E6A4D81EBEBC93CED5 | |
| 602 | 95EE5DD0F42EB0B536CEFFCA70C4A44BD512DAC07B37A88A54519884A3E0BC69 | |
| 603 | 0B460002AF91FE2F0D5272129E033824C228701F587B2AA2022F4F011D5F45F5 | |
| 604 | 75EFF578F1CC9EA572A5C894D4FDB7214D48DBF2FAEF95BD3B098CEE59F264ED | |
| 605 | AE5E3AF48E4E389F15E73614E959EE0E266A5C92C75011544F16A83A071FDE77 | |
| 606 | 153933C67D83A7EDE8AFC050FBA5D8FFDF7335EB3DA6DD40AFC6D8314EC3E8DD | |
| 607 | 5B2328E75DE1DB002FAD6AD832ADE67A95EFC21A9D191C8A3AE874E2741E6737 | |
| 608 | B1EA832C2DC88FEBF689B579DF104892907017C54BC7FF5133A101868D714DD0 | |
| 609 | B47FEA6399C608D6CFF631FBCCDC41840339B2E1248AA8A5C06A2068CDFFF253 | |
| 610 | 3014629558FF935F5409DFDA332004A9AE93E06F840C452DBA0CECD628E58267 | |
| 611 | F9167CE246A64FC554425FC08472D349CD92310CF2221162488712A1EC75EE3C | |
| 612 | BD19666DFC3BF19054D8EE6B81C994FA38DF0F13867D5CFD1819908B16F43738 | |
| 613 | 7293F7E6454499B0098DE9E3D6990F95537861C3765B36B570BBDC7F5E7D3C66 | |
| 614 | 7DC5D30748BBD089B1A9B234D62263F6C2C5B643A494B2274C95062F9505A680 | |
| 615 | 64E1FF9189F382EBFFCA2A29F746808CB1513A08B9EC1BBA3E895F569723BEEC | |
| 616 | 3AA02ED3EB290C185297507BC8A57B8FF2418532B23762C95B8A56373B1DF89B | |
| 617 | 590890ECEBF1B6FD24F037A80776835A576A0C9A90F1EFAD1350CF92C7DA91C3 | |
| 618 | FAA0077788E53FD9AE446BCC656F15BCBC0D956DA5F45BE7FD76CFE6FC542378 | |
| 619 | B4A439B042E74C8E15B051D4DDF09BD1E967AC20D855A3DCDFBE74D720573BF7 | |
| 620 | F9A9A98681B3AA5B0D9D17B2B9E43D6F09CA1B8510A3AAD2D66483FF0E863C2A | |
| 621 | ECA9EB7010CEA7A431CEBCA82A0FA12655A189D4CE5148D6D6E7102361365675 | |
| 622 | 5D24DA00F593DFD8F6C1CA0F19E675D71C75D3B48697DBE695EB99DCEA180530 | |
| 623 | 92C7ABF8BD4BA4E0A961C6C439F3FA2F7E722090F98CDBD45E61199A25A4778E | |
| 624 | C22B843A04CA84580DBDC711E334A00780F63549B32A467ECF4E23E87819F25E | |
| 625 | 8F5781DF6B383F5FBB93FCC882DA7AE7201811A40D958A405812274759EB579F | |
| 626 | E93A5D56AEE7E3D3361D3C95D3E8DEEEFC89FF0AF06BB2908E7B7E0085DD42FE | |
| 627 | 7581A65CB53A4F5AE7DFF2EBEC1F856963B4A4680D9E44270B6F65FC1D68349B | |
| 628 | 2514E355815C5E1AE4DB25C85949D14428F74D79C097BA31E65BB3EAD1C9C08A | |
| 629 | 0871B8B28DE6D7FCE097610C592952F2E80AA6B52811198E98EDFE8E044CD284 | |
| 630 | 1BEBF2F8C2C458D7F1B38BE0C884DECFCD8B02EFD7C83372BDDC3456F54379FE | |
| 631 | 73937349562D8778A291F8BFB45EB38F3E2A5595F7CAD8307B1200EEFD876DBD | |
| 632 | BCB48863ED0DCC32B0D84DF794810AE682FE485B9B9E51151DD2BD4458E5C16D | |
| 633 | C4ECD52B954F50B327611FB86F226B5C53C141108758B924BED4BA1934020BB6 | |
| 634 | FF33F71AB77797C7A7699A5B08BE46CE3EE3389E8EF235100F2135855A70D28B | |
| 635 | 0BA408A2C28C9D8ECED4548D9E43923E45C489A001BF71030D5F9BA0BDCD4D9D | |
| 636 | A090C8706CE43BCE05DF4CCD2B726042B65B52D0CB1A5FE71CDD8212FA710E59 | |
| 637 | A3E47FDF4B9CA1AD7302922F76C19C5AF4EFF3A6E4BD5E870FEDACE6B62FB2D5 | |
| 638 | 2EE76DF4F06A3120FE7023187A7B169F0A67E461917B69E2E13E8B76802A0E2A | |
| 639 | DD5FA5721A51720422D549F8F1ED065A412AF7333DBE243FED9EE7F028280DF0 | |
| 640 | 942C261D1DCE952000DA6F45A7DC9B28B357A06558D9F13848184E1C1C9D70B3 | |
| 641 | EA7C4929AEFA327ABEAA649176BB634F462D71A141AC05211F20D12A288CCA82 | |
| 642 | BBB8D3670FA38EBC170EE5BBE15C0EDA733B0741A590C7827A9E95EA725F3A18 | |
| 643 | 667CF5DDD40377D47CEEBF414DD01C84FB3D6218B7F09F63222EBB689CB16BEF | |
| 644 | 23691A379CC3DC5F25EBCAD812A784ADAE27C1B0996A921BBC35A267887AB668 | |
| 645 | 271C76B134225D66352754E6D1108A67DEF1F6E91C1C18A231EB2C571D091AC6 | |
| 646 | 7256FF70AFFEBB18F35C10ED7198E4E9FFE19669742BD040C85F5CF6A5A1792F | |
| 647 | E910B07549D60BF4C6BAFE994FEF823424B4D6A435230CFE62473AC4363D5135 | |
| 648 | 210232C0F65669CF3E175A3C15EC9C8B8D4CB096C7DB979ADC7B111CF9DC995D | |
| 649 | D7629CD94609CE60ACA31E679DA1CBE7F794FC8FB5BD1C0418717356080E3833 | |
| 650 | FD627F7F7BF89C64DCFD462E2B7ACB9A724F9D2AA2528B9F207A4CF74A05EEAE | |
| 651 | 595ECEE7965D42ABD654F115F78EF26F9ED9A94BB4B506B20A3435D20BB02B38 | |
| 652 | E4ABA7D9AADAB6C5519CA42483378FDEB0F7DC375D8CCB308AD7990C1A3A3AAB | |
| 653 | 6E6941516FCEA0F1350EB11E1DB0B51BB8F00B571FFADB726F21B67E7B29A7CB | |
| 654 | E6D38CB4C1CCFE95A06310405FAF798F92C82DEB739394731FAC8481D63EBBE3 | |
| 655 | 633CB294F60FA468A31D5BA0B9A8D0DC085DCB39E8CD72A9CA6161985CB4A019 | |
| 656 | D9A9E7A10328B028D852DBAE7F9B82EA7E5C98CD16E7C46C5F94959BCC80F8D6 | |
| 657 | 9889F36B502FEC34D118FD9AEA1B0BAAE0CA2F78F65C87B4776AA32D4294DFB0 | |
| 658 | CF82A8C6B55A74C53C6D34C37E64C10CB3222F6CD7C6A5C8FE5F30BCDAA0F9E6 | |
| 659 | 6FC2DDB07A63AE6F2CA4882D0D586FBA00CFA94696EE03DDAF6E77AEBB2025E0 | |
| 660 | 1914DDE86AE19E4519363397C67558C126AD2DFFD73DE2EC90AA37205DCE393B | |
| 661 | 78E59B2A027667EBCC3881716A3479F65AC9E989AF7142C8F1984C423A52BC7E | |
| 662 | BE657159C073A443F7BEEE4824DD61755FF91498B49F965021367A7D40D0B2CC | |
| 663 | D65A3274C0B27F507480A8FF3E2688F9265400F03314E85B12DF47C8D74EDB85 | |
| 664 | AA0EEAB58BCB40BC724630FD23F51FA37E74502E75D125C5E0CA1DC96A1C0ACA | |
| 665 | CB2BB037A59815B4F44DB0C11DE01C23A2670C4E2A3F7D485C407E4F3829C35F | |
| 666 | 14CDC22715001C4AC06F50B73AC5B1836B6D5C0BDE46E327A65D8F0F761F3771 | |
| 667 | F77096751B5F016AA26F866DE68A227E946E032AAE0EFB3DCF856D69ECD2DB30 | |
| 668 | 396110DD83C76821E2F0B824B3C9486373DAB394DC3E7030EA151CF3A3943DD4 | |
| 669 | 0C46FADDAC2B500B5E8305056FD9D21B65D0C550C21282B01E891CB9C2060EA8 | |
| 670 | 6A8C42DEC32AE007F9C1C4AF702BA660C3D4A4DC8471B981B262C4DAB4EFC2A8 | |
| 671 | 0B7BCD86B92C9EF56B4012DE355A67BF347DBBF5381D6D1921EE083A24FBFA58 | |
| 672 | EB1380FB34D6AB0B05F6607CF92F4517459F733A7AA088FD65F1DD661D779CB8 | |
| 673 | F7A2C8B58C8569330296D9F3A987CD2C383F261DAD558800AA0739AA0419BB0C | |
| 674 | 7CF3140D6EF1FE7F677E1FF938F82602C05197198DE46A9CE5B5F9817CB0010F | |
| 675 | 39ED8566A168265C15E9363E66DA34C803BC59107C7DDE6F8C8E8A1B39743B29 | |
| 676 | 1723A9A9F56C2346E856EE7E5605008975039A6111C1B4AF433413F8EED29C25 | |
| 677 | C17A951DA57772EDB0801D9C4123731C1E017D3F114EDBADB27E5FC82EA0982F | |
| 678 | 306FD46BC335CA016F5C5DF63C29DE01FD00089963F95864FEFA0713F86C1AD0 | |
| 679 | F3AF11ECF5D752D19877AF0A20BC3E58A0EF55EF881F1845237820716AADE38D | |
| 680 | BF358B31F2FBC6BFD60850913B650E8BC35174C7B5C68A205025C7DB1717AF82 | |
| 681 | 982D9DD01D396F2876C0B780FC7975589799AEF5D946F5002FE57DF9ED7D6EFC | |
| 682 | 368274302EE209EFBCDB1FD3DD46C47860B8F1A228C7BB90772D66135420E4E6 | |
| 683 | F9414E524B0DC392CE36413C3339C623C1692D7C0841F2492D9ADEB8AF6859D0 | |
| 684 | D8C72B7BDEDD007864B0718B187AA40643F53F054EAE49C577D0B2B644F78F65 | |
| 685 | 088D3CC6565A1C067E63609731364FA9067FFA01BA1F8B8D82A331D4087A93C5 | |
| 686 | B4CBBF75D523BB9D77655880F0ED09CBE20053DE63964E77A48F2C2535F63337 | |
| 687 | 16148FC945DD798FCC147F564364F3A4DF09E7EE7E0B0253286CA3C573FB9925 | |
| 688 | 1AA2EA9A8FCBA9E6587B160DC1CF7D7E67F47E15C0014A7AA30EA372D893AF2D | |
| 689 | BE297C9D2BEB977069E33DD533EBE99BCB520C748CE9C4A51D462AD740D1BE85 | |
| 690 | 6A2085D0DD1097F1ED235F00C1C7906587E9253D7AF66CA4CC22C0981720CBC8 | |
| 691 | 770E0BBAE73B7636A2DF642DFDA0DE233647B185A5BC4822582BCC8F2083ACC1 | |
| 692 | E9391646EE586C53DE007ACAEA74ECBE74CF7F062C73BB60F1B2651DC7B5B1B6 | |
| 693 | D53C4DEB4E78760FC7159C4DC73B0C1F6D0DB4D70F75D36763D4A49F5E42746A | |
| 694 | 794CC2C57E532336A6EBA76DC86618193088B93F7D6C40CD56FDFB2B5E0AD779 | |
| 695 | BC3867735CF71EAA51578956E1760F49C3F9DB1A58D3C811C74DB82848065DA5 | |
| 696 | 0FCA863047972AC37B148FB1F5BDC1CF3130E6FCB64AEB6D2923921D9DE69931 | |
| 697 | DADC9C1F8A9F974CA3A324AB4FED93D0695259A61375180378639E42DAA0D9E8 | |
| 698 | 2107B6D9328DDC89C4697F0C0FE07CA21970A53AF3D9BB8AC32902E51098B060 | |
| 699 | 67D5665C4A428EFA08C4F9A987A0BAA79175A1023D0F1EECDBD77EEE55CE1C84 | |
| 700 | 7435145DC7E81D8C0017C2839752F39C6DB97DB1AF28384DBE929A209F016F6C | |
| 701 | 197EE95E0F7440760E4CAF2C5BB40E7B26A7414158B385DB84ABD02FC7054B6C | |
| 702 | E5C9D9968E727688AC802B5750F7BE27D92D26C92421B058FA0EDA43CDD02F38 | |
| 703 | 78868B6A58E698CF14D982E3F134ACB20B824E1058593074CC3E49FB12D5CE9B | |
| 704 | 9D4BF81CD1CBDB8CDCBB1A6E2A8EB38CD5CE9A3332D4A399B0D58FC4709CFF46 | |
| 705 | EC32649DBE6F511B864890F00C1673A8F1B82AEE2ADF6125D87502DA2330B718 | |
| 706 | 09148FA7785A6BDE2E6690AD6A28CB389FAB8249C6E243569243829C8F9879BE | |
| 707 | FC29EE3808073C21923BE59BE768D15FE1F9D2CADA8EDAD89EEED23E9B2AC20A | |
| 708 | 4A0E044754A62EE21656219EA54E66D31BF4B9ACCCB9206CBB9BFC94B20D90F6 | |
| 709 | F7087788401D658BEF854D6E6CD3FADA78E7CF507413ADDEC56D00AE40518C39 | |
| 710 | 5036AEDC5A0098AE6667E82290B5E728565330ACCEC7F55630667335E9BA945B | |
| 711 | E961F4F3C7850DD2DEB8F5D7A080DD36838D3E4F1D5A0DB88CDB1819988DC67A | |
| 712 | 9C4943C34AD435B74BF783386EF2DFECED904B778CFBB4D98FAD7A91679EB575 | |
| 713 | 6E48B3F3BCE81F3CDD24CEFD1C76B109726809679D69220A426A87E49884950D | |
| 714 | 342CCCED279B166E41A709D243A42D2621529C6C33CC21333D376387585CA01F | |
| 715 | 2B36C4D2BF3AF077B5EDBD55BC06D6F973EF4FB8454F518C4F49DC36677990C3 | |
| 716 | F47F0C5CB73BDA7CC91A2086A3FC99C0C75554DA532148134028D7E47B59DFEF | |
| 717 | 69D31F6F67218E51CE01B6046D0B7128981E5D6F4FD5EA423D8F20C3859902AE | |
| 718 | C6CE0279870B7B9BBCAB0898528A0350FB728F082B941704829E34F6E231ECB0 | |
| 719 | A95AF2C4E2E3DE52339902D3CE019FE6CF9F25EF965EC4F6FE37C36089D05CC2 | |
| 720 | 33730B453D84EC0DFB7827BC643368AE4894A2B2E51BBAE60039B3F1BE1957DD | |
| 721 | A5BF893B29AC0DA7904359C97CBD075A5B510525D6825EAE1B9A4D844E56D3C2 | |
| 722 | DD3059CD01D67E69A229CBEC58356A0A83EC25646A23BE669876A7CBDCE9139A | |
| 723 | A4A80FBF1E760B8670BEED45C4F48C9CFE5E95F7CE875590F5F7FF39166BAD9B | |
| 724 | F896B3C99B3FD7F253E783B69169BA7D2A5E4AFF51C56AD761CAB4184B7C34FE | |
| 725 | 4C2E90CDE05506844A2E9044868CC8997E8650AFE300F06A09674EBBC1D71A87 | |
| 726 | 61A0DAF0CF08F431C26BF2CCB53571F8D30E98A7514E96F5AD7844ADCFDDC4CB | |
| 727 | ADD027C199C8AC1819234A8DD4E35E9BAC3C7BEA8A9D1FF485905434474FBDD4 | |
| 728 | 087560E03A3EF69ABE946842135C344DDCE0023E3B5CC5DE6C0939899DD6DFD4 | |
| 729 | FBD3BA17CCAE5D8EB42C25 | |
| 730 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 731 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 732 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 733 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 734 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 735 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 736 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 737 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 738 | cleartomark | |
| 739 | %%EndFont | |
| 740 | %%BeginFont: CMTI9 | |
| 741 | %!PS-AdobeFont-1.1: CMTI9 1.0 | |
| 742 | %%CreationDate: 1991 Aug 18 21:08:07 | |
| 743 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 744 | 11 dict begin | |
| 745 | /FontInfo 7 dict dup begin | |
| 746 | /version (1.0) readonly def | |
| 747 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 748 | /FullName (CMTI9) readonly def | |
| 749 | /FamilyName (Computer Modern) readonly def | |
| 750 | /Weight (Medium) readonly def | |
| 751 | /ItalicAngle -14.04 def | |
| 752 | /isFixedPitch false def | |
| 753 | end readonly def | |
| 754 | /FontName /CMTI9 def | |
| 755 | /PaintType 0 def | |
| 756 | /FontType 1 def | |
| 757 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 758 | /Encoding 256 array | |
| 759 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 760 | dup 0 /.notdef put |
| 37c41ab1 CR |
761 | readonly def |
| 762 | /FontBBox{-35 -250 1148 750}readonly def | |
| 28157acd | 763 | /UniqueID 5000827 def |
| 37c41ab1 CR |
764 | currentdict end |
| 765 | currentfile eexec | |
| 766 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
| 767 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
| 768 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
| 769 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
| 770 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
| 771 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 | |
| 772 | 9E3948FFB3DF7BFF10C9BDA4EFE5F68A8CB1526990D1357AE6D2F7C2D2EF8496 | |
| 773 | 4E47B39E6712EB8908A3265E5FAB40567E866C244814449F1E993AAB422C3F1D | |
| 774 | DFA8C7118584F2E5197FD4BFA3A8AE9E953C6CD4672C0FF51E41C3A919749C1A | |
| 775 | F06650DF4C5E17492164BDBCDF22609A74BFA7F69960A64B9F949FFC2A807458 | |
| 776 | 8579366C4F41BDE1FDFBCC4845FA19BBB6963D65EE8532549274BAEBDFF24FA6 | |
| 777 | 03235D1BE37C06B1938AF369DA75BF38DDBC87A1FF445EAA16E1895ABE9506B9 | |
| 778 | 211955753E447865D33CEF007391D2666A046277A30A49804FFCED3FEA5EB2C3 | |
| 779 | E52EE14A9F75241EA10C91974CDA6236EB840FD44D6DDE4D9B3266C3B99BD38B | |
| 780 | D835BCA8CB819C073480FB972CC028D218F6A1D344CE1B63F4FBF2C826F412E1 | |
| 781 | 6E0B05A26125865A14FD7B7030B478BB8BC6BC395335C3BA940E1C348267F4F9 | |
| 782 | 0AF97BBEE253511940F1048E175D3569F7D05A28851B6F50765FEB6C9654FEDC | |
| 783 | 1BF52F535DB5BB90C1BD5D2EBF75E0AEBE82B20507F3C28A03746781018D4EB2 | |
| 784 | 298E4F2C27ACF73FA73EBE43F014BB575AAD516C0407B29E1653375135ECB74D | |
| 785 | C91372F06FA8EF37C31AF3FA48AE65318EAA6C34830A5377ABB2DFA5DA53A574 | |
| 786 | 433484BA1466709A4B186761655C8E482833B697673E847C691079E7F1DCB8D6 | |
| 787 | 1AD91101D757B83E2090337D525AEECB028FB3C9F6A6E6AD2F322CFDC5A833E6 | |
| 788 | 1CE4EDBF41FD34FD61630581D222F854A76C2EA9FD72796A7C9CC1F6C2FCCD16 | |
| 789 | E95CA05826A4ECFADA6A5FB83C41A7131E52BA6585DD6DD78515D8F7327DFC6F | |
| 790 | 9404F89293D6ACB433CD0802C43F0E74C6C4766A23A6AE3788FE6CAE82E1A104 | |
| 791 | BAEC8BEFDEFE4F292F625E60362F3886F602CE4121BF0AAD93526314BCBB5971 | |
| 792 | 40091A7BBF7EFB3BA355B88C897D9C70C841DE41309348751EDFFA8675215988 | |
| 793 | 49CB1599834A01EC6CD4FD813AFF97A614F56975775D5F48E9C1A9CE532FAEB1 | |
| 794 | 4EBE20C3FA87CFE03664C428BFC5C894668E507950005BD8C2BCA8998C1FB92C | |
| 795 | 4E6B791BA05B79F332EB8AF5B0F851B8B7EE372EC0861B09C007CDF43F82D0B7 | |
| 796 | 35446F682A0DA7F4112CDABE4F922EACFCB7B8C88BF550B60957E7 | |
| 797 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 798 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 799 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 800 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 801 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 802 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 803 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 804 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 805 | cleartomark | |
| 806 | %%EndFont | |
| 807 | %%BeginFont: CMSLTT10 | |
| 808 | %!PS-AdobeFont-1.1: CMSLTT10 1.0 | |
| 809 | %%CreationDate: 1991 Aug 20 16:41:43 | |
| 810 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 811 | 11 dict begin | |
| 812 | /FontInfo 7 dict dup begin | |
| 813 | /version (1.0) readonly def | |
| 814 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 815 | /FullName (CMSLTT10) readonly def | |
| 816 | /FamilyName (Computer Modern) readonly def | |
| 817 | /Weight (Medium) readonly def | |
| 818 | /ItalicAngle -9.46 def | |
| 819 | /isFixedPitch true def | |
| 820 | end readonly def | |
| 821 | /FontName /CMSLTT10 def | |
| 822 | /PaintType 0 def | |
| 823 | /FontType 1 def | |
| 824 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 825 | /Encoding 256 array | |
| 826 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 827 | dup 0 /.notdef put |
| 37c41ab1 CR |
828 | readonly def |
| 829 | /FontBBox{-20 -233 617 696}readonly def | |
| 28157acd | 830 | /UniqueID 5000800 def |
| 37c41ab1 CR |
831 | currentdict end |
| 832 | currentfile eexec | |
| 833 | D9D66F633B846A97B686A97E45A3D0AA0528A405DF15F03DB1C3DA8B850431F8 | |
| 834 | 0E5F73DAC973450D1ED0530313057E971FC7E7CA88E61DA6DB9A5CD61F0F76CB | |
| 835 | 4DE9105D0627B8DDF51A655098229920CF429CDAFC3F7788C95E7AB30E84F840 | |
| 836 | 8CED52E98DB4CFF161D2E62B0D28CB8B0AC82E7A8D2C007953BAFB3056D66079 | |
| 837 | 8064956E257D31C13509FB81A250D9E875C77A4E91CC49E9FB3C0718B2F691D4 | |
| 838 | B4A64F351F4DD68133DED7629B0D96E5124584A16FD2AC7A3EB244A934FF059F | |
| 839 | ED7297B0505F3C2994AD66A3CA5D2728B034DE94B64A8AFAF341601BD4DB5858 | |
| 840 | C9950A8BB9C598B8960609F48116ABA8C007190AF0ED335EB5BF61BA6871FA5F | |
| 841 | EAB5A26AEB5C7C352EB80799CEB983F19EEFA801093F62086AADD0B80BB6580F | |
| 842 | 2CF61B1390FA56DFA1A0B61C58DEF96BA767A8A37EA44730783C600706606C60 | |
| 843 | 4EE74EA99B7C0F8E2525C8847F3D31907C3C483EFA98F6C416B6B2C343DE6370 | |
| 844 | 52FAE423008D086A76A1FFB327CC7FD84B1C66B203A4F41582F4599A82F8362D | |
| 845 | 38108452EACCC937FFC4F3ABBFE3628DF51367DA6BA3F6826FC6522D6AC5E8EA | |
| 846 | 00BAD300FFB6DEDAB93237704202BACD030AA824B1E97C0AFE17FCE8C75F4FA0 | |
| 847 | B8A74329A6CF1788C7EB34DA7307411E9AD7ED8D6582884456E06E033B4FFE7D | |
| 848 | CD4DD8B06AD01340CCCFBC382C18CA451E4C886B01D082FF8CC5793F4727C3DF | |
| 849 | B52B4F1A242F31D1EB79D1E39A1D4FD13D6C5E2A42AD4B4D1CC4EE7BA0E5F80F | |
| 850 | 802E5AB57EA15F4DE44D82AC408AA86D4BF58EF967FBC6497BBC7F017C0598AE | |
| 851 | 32CF865DFFF0FC7FF9E6DCE9B5F2F4C7491AC674F46E8E7660452CE0A77C1EE8 | |
| 852 | 00DE382ABED85350033EC00053134DBABB69DD3098576DACC5D1E325C4B372B3 | |
| 853 | 943F8E90BE7B97B996D39337ED6D90F8041298B7A27B223358A5161FE98FA4E0 | |
| 854 | 6879524934E026863F790FE3B5A8A41AD2E91866F81B195E0A02D9BDF971633F | |
| 855 | 0FE9A9BEA04CBEA9E46AA44C31D694A0AF3D7CBC1FC4988F6A81130613047150 | |
| 856 | 12203A85849EF4D9238604ED8040DC85FB0CDE867F50EE685C8B2BB0574FE22E | |
| 857 | B02F2595A161E810E2C9FB46B3E15BF0B3E7591FE9CCF7689B1988B354D81E42 | |
| 858 | 145BDD9A5C21B3E52BA1F1CB76BCEAD38C97D40F1FB50C505B0FC423A1F495BF | |
| 859 | 62332481948BC331BE6395DB78C35E5DD1B55E92FD14F1943E73B157F5E5C24C | |
| 860 | AB2D70824FC69C818980EF3954F79FAA4E946064F55D8A62723694E4C489A1FB | |
| 861 | 6A082DE0BE740A145A71F1F9FD011E558E3F27DFCCDDD49DC348707DAB524EA6 | |
| 862 | 88370F288567B17F313D9EF6300E8D910F49A4E9E581BC95D89B84E2591EE3FA | |
| 863 | 41FFED57028D28600F1AEDFCB752BEE359856AB8F776A166C83929C17BA13600 | |
| 864 | 0A5D2447AD901988E5F5B6B9D710080392FEA79CD595FCAB7B9B52C94E0733A2 | |
| 865 | BC63FBE36CECAE723EBAC3BDF4AAD1494B9F3D146F7E3DE66F77F6C3636C6BF9 | |
| 866 | EE6C73AB8F1E98E043710DABDD1E9CE6E3F5FA8F44670AE15BF8FFEF72E849CC | |
| 867 | A9E20CBFB577BB42C9D842A3812FD73D0E26D592ECB2A920986F623184ACDCE0 | |
| 868 | 90610840699BF7302E534D6F9EC4B007E6CE4D8D07BF9D4F486C503A3EEF3999 | |
| 869 | 50E3A7402046E7C08AD26751A910154284312117F6C6AD506038B4A5A4E1097F | |
| 870 | 26241689BA60A4B2E58103089301AEE41DDEEC60CA3ED74B2E838AC0A86E355E | |
| 871 | EFB46562208EC834133CACC4A6516B4378B8C3F86083B18AD53C3C1E13200B8C | |
| 872 | 6F4ED7346CE480809EA316BC70C5AAD4FAFBAF995C7ED82624552BF2F0017E07 | |
| 873 | 51AEEB8E2529CE5E24087FF3F0921DD9963AF7BCA9582565573CB5A463C4A5DA | |
| 874 | 0F1C8A82D76213DF461AD578C25340C4178CA8A7E99D85CEAF6605FB5AC336AC | |
| 875 | 22CE77D930F859E0089A09D80C694C573BED5448F793FA7A3A977AC2EED1BD47 | |
| 876 | 7DDE4D72B9DB3828175AC20BBA66EB0C3D1CE9931AF3B5FDA9D9CF3C67E65CB7 | |
| 877 | 439F5FA380AFEC7DDB17FF8468D03ED4E99C507C3312E7926A5650346C44560B | |
| 878 | F729A594E0651F7BC3A0EAF5C66BBF27070CB1E691D584D48998189152D78F5A | |
| 879 | E2FFD2C517BA7127DF128CA5DEF2576FE2BF61733D5F3C0972BC423E34C102FC | |
| 880 | F84E33813FFB62ECDBDB494AD6A3AD2C9D1EF30D11031EE57D8F7775A6A0400F | |
| 881 | 3EEE57D877FB8E007E4B309412660197770EF9792605C08668F694608E37BD9F | |
| 882 | 264A298AB09C2A6E605C6A6BC523197E1F87DCA1150DE1A535C327CF09C86A3E | |
| 883 | 2FF9FFA2C5A12E2C4F1DFB00BE313BA13F80379EB70873D89667D0E274EB43EC | |
| 884 | 69E1D140DA4D02C8D2F8D088B2BF240EB96641836FA71EB749829ACFBAFB152A | |
| 885 | E67B9428C24006EC9AE92BBD00614E4FEF490944C906EC75508730FBD7F8E439 | |
| 886 | 1FC995C07CC43B83E2F4063A30BAA9E1E7398C250368C6E13BEDF0F14E6EF31B | |
| 887 | 823FAF0EEC9A2F745125AA099110843D606073A374E97AA91139C190B0992CC7 | |
| 888 | 07926D8F9F04132B6C629B6149B07229E3774AB12FD9CD2917E8162D6F4D26AE | |
| 889 | 99AB9F015A6C629B094E6C98767B8903678EFAEE09BF1C7B6F299A0821877171 | |
| 890 | FD01FC4AB79872088C954ED616FC17DA91B76F33BC8AF20EB81BDD3CC686C5D1 | |
| 891 | E28ADBE191E355419683D64E7A3C9F78C380052F9329EA6E7102ACD7D5588DDA | |
| 892 | B1EFEE6F0E6B4378D5E7DD88163141E47FF011C056319F8F8ACCFDCC2F352696 | |
| 893 | 3C04052BBEB16682801F73BE5B988BBED6D4C31B5D188E2C1D42C368BCF81B7F | |
| 894 | 363189B07A5056FEB84F7DFA5186E9DB319854FCCF6AB41FD87EA5C65C66201E | |
| 895 | 00D743116D2F0B799DCD60FF0F534FFA92A4B8073E12245F194D9DA9D76993F6 | |
| 896 | A17AEDEF24027EBB10EC75130081B6843C302BB5EB62CA40186F2E9E4ED17296 | |
| 897 | 632B085C31B432E748433B4FF2F1CD7BDD4E6B1E6C0C369DBCB7D5AB64D2D275 | |
| 898 | D93A35F54339DE4EB8DE77418B977E50D459732048AB32EA4CF69DD7DEF04CAA | |
| 899 | C22F16BCB3BE34512364791EE63E29B5733401C8F5A847764525E1B14CD6CCE1 | |
| 900 | 81A16F9FFC6D5B37B293938F0555AF9592537F4A9B2AEBE9EF766921DB1D2B43 | |
| 901 | 7AF063B20D66F4079ED13B0FA60EB782DBE17C5539A1A5CCD335F90B489E8C68 | |
| 902 | 95C28F9EE0E36BF385C0D554C681E5D927017B7DAC58A4C3442BD015892BB7CF | |
| 903 | 51CB250208CF5661918B5098017CEA30B5C0402C155D4A8D4935B92670B333E9 | |
| 904 | BE3154BAE9CF9BD47D79FA369216E2F3F0AA37DF598036400107B60E25FAA284 | |
| 905 | 87BDD4BA6459617AC77787137BA30F0CD07576E66527BF4D39E39E4AE54508DF | |
| 906 | 351035A3A1BFFDFE5BC76222C8797D78723A2F3A69042BD31ED69F88E8F6C68C | |
| 907 | F0D8EA3F36AFA8ED13EBB95ADD129E21932EFCE965F89A399970F30011AF367B | |
| 908 | 3AD8089D6B51E0DDC6B95F56435610DEE2AD9D8A2FCCD9699663523754C23A6F | |
| 909 | 774F44816FECAC1EF43BA3F9A1D69CC5457482E07B1976EFE7A7FAA60579B95F | |
| 910 | 8DDABBEAEE10353D72759E316932D064EF132FD0517BE7009431A5C185CF7A1B | |
| 911 | 13EA10A69449674E950ACFD367713348FDBAEBD12AECBFE70C4B7FEF702BAD2B | |
| 912 | 19DB97450F38E73B2784E98FBDAE84D2C3B1167E8B85A1ECAC09E62D187A3043 | |
| 913 | ACB93A5701AB9E66F25BC7D103DEB8161FF7DE5CC957218F0D279723DA4377CF | |
| 914 | A08BB2B08218D5F62D4FE80B8EBC3B8B2D0847C561A2A8A1F09EA64AEC9281D0 | |
| 915 | 7BEA4DF7C7ADA40809268E1DDA46FB41216DEBE3C971CE51C367773F7492208E | |
| 916 | E7EB797235FD349F6BAD6D6E4F99C29F5A6C3C87D6662210AEB92C0FD64B3CF6 | |
| 917 | AE2DF93D6A6EFA27B976E3A91BE80CCC2E7A1F2B90E1058F8AB9FAA0CF87C15D | |
| 918 | AF37C5EEF32ADACB6FDE08EB99F62F9194328C09BE10B390C349606AC58C167A | |
| 919 | 15728318A475D8F402E294B0E07FBE936574A0FA09EC4F829794285AE3150269 | |
| 920 | 91D07377024ED8EF474898744B82C693B8D9C91E1A9011D60B34391564A747E8 | |
| 921 | 57EFD30427B4001470009229591EA924C547FD154E16646DAE7BD115B0C8E3E8 | |
| 922 | BA8FDCDADFF9A09639A4B9FEB1B9F5C00CA5C87C7C04AC37BB7692689C832071 | |
| 923 | 5FC338C4E5B448BEB3B9F60394B6C8362D523E10B2DCDEEB70ECA04CC1C7CCDF | |
| 924 | 2827E3A40F34B70247CF6C5D3A638896366D4A28FAA2B1B98F865626C69039FF | |
| 925 | 3D54638C23EA32624CF10216A10D83BCB734A09575AF1B41A26B18FE5AC7C89F | |
| 926 | 64B70002CBD12AA01EB9BB97EA993BEA9FA225552AD79B23ADE62D47C48BE023 | |
| 927 | AB1ECD12E6D825A62962C41BC108E8E7FB37B976A4F826C12A59E7CE61C6CF71 | |
| 928 | 41F24BEF3E29709C371211809636651F02BC08EACA9B0AB2632DBD5D6E756953 | |
| 929 | 5C4145A7A3A81133D237335D202DF3673BDD07F679F650C67066ED300205584A | |
| 930 | 26E444A3731355C11FE972E181D9C93C6C29CB8CF542CAC213D9040EAA05889C | |
| 931 | 8C6EEF27DE0846314699DF54E99FAE310F11E3AB9005C432E5208D8BCE1A37AD | |
| 932 | F2D7F3289C7C564A24B951E0AA63BC60D75AF80428FA27EF965A1600D1A7D357 | |
| 933 | 935589477B0B5E12EA0512C7D219561F91A9BC95580D4CAEA7218F8B1045D6E3 | |
| 934 | FABEA4A25ED4453A7773D2C314B8F156249CA4AA102AD02343E5BFD0396C07B3 | |
| 935 | 14DF0108D25FFE8ECFA22D7C5DD91D422A399821E7D910FC87B00544E53AF711 | |
| 936 | E98F45C4329FBDACD3C332454809DEAB801F6DCB9511E92F235E1A17EF8DC8CA | |
| 937 | 1C1B6217082CB95C1A605D7835741D3DECDE9202DE38392B18AC147608CFEE8A | |
| 938 | BF21E6DE2429846EDE6CA2D573C1506039E9AECF0A52318E992EE6A2F23469AE | |
| 939 | C0CA4F3F90A79E610E4928D95D0210A30E9DBE65B841D16CEEDB1D98FC42CD3E | |
| 940 | 34426D5FEDC316E922F98EDE044DD192037787704B1206A21F759DE304972B60 | |
| 941 | 36115A6DA1512B38FECB759432F3A3BCF3DF0376B5F8D478DFF2BCEF69A3BF3C | |
| 942 | 7A65C734EB54BA16D2DF4B7D12F646DCE4FDEC0BBBCE02A623EEEEB4C6E81593 | |
| 943 | C0A3731B901C2D65F353937FB0CE821490398DD73B24EEF7943CDB0A1FA1EA6E | |
| 944 | 6CDB64DDE68377298A655116C02BC58E7A1401024394FCB4A4781BB0ECCA339E | |
| 945 | 7E8890D1C5E5B6549B5C7B42E3C1FE35703B21906A0B9AD51EE5117FAE9515E0 | |
| 946 | 3C1B82C57BDA12592692CB93370742E5AE20601AF5B4EF353CFA3EF5C92FEC69 | |
| 947 | 49EEBA22B9129068DEB74C4D04756695745C02DF963F12D7A256680DD052B070 | |
| 948 | CD7B9EBB05015170EFA40BE9E5C6A3B6CFC2C2F2A2CADA796B837E0E9E308551 | |
| 949 | E95A5D6598D332806D7E1423B0D572961949E322CA226726FB20DB1F25DB537D | |
| 950 | 3579D615A955EA323132CF0DCA83AEA15A738111BC420C200067379B0E90584B | |
| 951 | 7D142B52915DD2507477E6B6026CE3F55B42B6CD45263637D232FF9106934947 | |
| 952 | 0F31918EB3FE1AA0C56A67102D3341551365F0D02CFD324627C4C1BA77E9302F | |
| 953 | 673FE00CAECDD5CDBDC142E7074631C26258B1BC4DC5301FBD06C5CC46ECC9EE | |
| 954 | 8A3FC96AF26D9FAD776F4CB4BEA8A76362BA77AA07F4AF80BA17D6AFC668FAFD | |
| 955 | 4444E78E82FE7D70226125C15388F46D723804D215BF2A16F7C21AD0A632998D | |
| 956 | E9023CC75FC816112850565757C5E537BE8AF1EE069C3817CC8C4FD85BA8791F | |
| 957 | 6CFCD13667DC618DEF2B7F6CB788D8A039BEED888E4D0D8C41E36012774A92C1 | |
| 958 | 1B9D1A7343CC7513730619F110C055D61A4FEA3666097E27626F7AF00D63C49E | |
| 959 | C7B65540B1315CF48871455762EAA5EEB3714564E27C3C3F06AB0D5F08152B1C | |
| 960 | 3FE59C125EC1EC478957F9C41523DB63EA844B6BCC3F37A7AB39780DA0886F21 | |
| 961 | F3DF1BA3D37580DCE6D4E9A512669B1864EEAB35DEF3FD4A9279394E1E581020 | |
| 962 | 6FC27F2DB0AD5BCF04DD864B8070AF99E37440F80A80E13037CA7C146BE7943D | |
| 963 | B9BC86AD2B250657F97C7A96A551326980E14D16B5470CB75801581F8179BD05 | |
| 964 | 5A87E566BF2E2BD81C3CE1156E54636F0C0AE68AEF10BC74CD0A3B6DFAEC2970 | |
| 965 | 2C23166B8BC41F06EE48DE5D6B187F25C74A5A8C6A464CB9E3735320114E9A39 | |
| 966 | 00923504771DACDE90073F2DA7BA91E9D86B0660897BB72BE5D851F5AB62C6D4 | |
| 967 | 5709A2DBB85801A8D7FF60B14540305280E53C605121A863665E0A2D47D8A31D | |
| 968 | 173372FF7C179A1D1A8E4F6F9B34D274A94B25BBE087C657E09EFC6BA43445C1 | |
| 969 | 70FAB6A3EF0814094FBF5370382DBC64C4F03CD96364E047CFFFFA66C2D4F478 | |
| 970 | 9280BE9F6538BE45898F52E2F05D58DAD8DE61D096B08D5A80A65FC46F8FEBFF | |
| 971 | C7506D9EE411E3D68BA61C3B768D563FB9942E0DC5DF82A6AD090D514D682ECA | |
| 972 | C1F50E14EBF58D3E1513909F4C7CEBACFD88102670F5EB176D5F53C9C92C6BC4 | |
| 973 | B62C55E5555548B1D649D9A23EFAEAEF97EC0C3C627DFE4C8FD0E1065ADE5A74 | |
| 974 | 856863FEA0A73BBE28B5EC450596006508EF8FD468C1E2700D9B328684ECB780 | |
| 975 | 3167104317B143F059A53FBF64E4B7F7DC60B7701AA8CE4B5ED2A6AC991A1E99 | |
| 976 | BAFA89A16DE0E3A0AA33022B87D694B3CC40A9D0B346B1080C840182A0917431 | |
| 977 | CC2250854A407D83239A811130EF7EA6841A215B02248258FF3BA66DAEF6E137 | |
| 978 | 088980B04FC658DA0DF60DE24077F71318AE06B30627C3A638D6C0B2076D7A04 | |
| 979 | 5988936B9CC5ADAA2169F739B8F54AA91B85EB119E5E6894BF4A76E74F96F3FB | |
| 980 | CD6A3E96E85567581B91BE4A78FE90CBB1AD177F3A08B96BEABEEA5BA017B545 | |
| 981 | 69643B523626A76B823F8A010398229379FC051B846597EC174F3BDBE86AED57 | |
| 982 | D29BEF440D0A458A51658A8F11A84D553ED15BE9437F4F0C8D3EC3084F0868F1 | |
| 983 | C8E36F3E97E657F815560E470E8BAC98AE4E40DF2CEB35A76859083046CE172E | |
| 984 | C2F0DE76BDADE3E6C9FEC16F42605A41DFA748987D9196C3A8895535B756A37E | |
| 985 | D9E8056F6AE08DAB8BC625D127BD2B1633FEDB2DE282A2F22C0CC0CD45D7DF8F | |
| 986 | 6735C77DCFC66730A8D0D5C802E3D3E8A2F7C95BDBC769E9C8975116F3B97C59 | |
| 987 | 4F57E6CB135B014E34E1B2914AD2C4DB41E573730783F6531347F27077A1DBBA | |
| 988 | FE6DC259D3CD70C36CAD4529DFFD07305D786AEACC8BF3C4D3B7A1ECDCD3C4C4 | |
| 989 | 0607418948E6C8510C9CFD3E2B93675C81C33D1ADEE32892A47D92A29BB8F04C | |
| 990 | 278350E660667BE6139C0C8E1794FC9AD2099F3647BE96B1CBC8BA2F77A0AEFE | |
| 991 | 97EDE59D9F9550FD3952449BEFEC5CD25632998EA8E32DB16E6C93A83687C853 | |
| 992 | FEF32A49FF372CF8E580CFCDA6BD6E3BD60BE8E652FCE38D54FCB4F00055EC0D | |
| 993 | A41C9085CA039DC00843F9EFC88D12AF8C8826822464926023EB66AF8ECF3F86 | |
| 994 | 2F0488DAEA9F996FA25E8C8258FCE63B3A6C661BE677D165F65EA67B152ECA14 | |
| 995 | 0D2E61BEE481BEB1F45F2A83A96E95CFA2E2D076706320682B19F1547E68413C | |
| 996 | 581183B679DE75B7CFA694BB4E9D032D43AC0F08AE04416A60DD62682D30838C | |
| 997 | DD4E0897E2D8A178F4A829DE0783312970A8431705CD2FC6DBFBF57FEF332AB0 | |
| 998 | 5473B356B7E2AE91BF8D1CD9D780FAADF246AC930C0347713F96D82F1EE3BC2E | |
| 999 | F84A6CB140CF7AC313F34B3C1E073501607447C8B8324BA5728A28669B5D44B3 | |
| 1000 | 7F9B38562E61D74CACC250BF9EBC2097167A013338D44F51D036257398267560 | |
| 1001 | 5B4BDF8089C59CC50704DB35FB7EFE08E51F6A7CAD8EEA51C4909F8B22313881 | |
| 1002 | D90C6CA7CFF8A4135330BF780BE40249052A29934D57F83F6667EEC4A7733447 | |
| 1003 | B84CBB016D021625AB1B40F9AFC0405DBE0D7394D46595613CF234CD7BA6979E | |
| 1004 | 4AFFE8FFFB005B3D18A93A2DBC465E0ED90B113DE484084914B9DF7EBF44A678 | |
| 1005 | AD814A4EA2815C3BB1811109F500738F860EF4079AB3E826C2F92980CDC7F942 | |
| 1006 | 0679A6EE279291C5ED84D53EA15B59EE47646DD51155020EA7DA8D4A475F1266 | |
| 1007 | 18A8C879F4CF3D0562E61122B59A087BBE110188E634685D9E87DC0E5A8D06BE | |
| 1008 | 98AADB84E98A4428B25E66DD2AE23AB185D95D62ECE4085BE1D4967E9CADD5E5 | |
| 1009 | EC92BB488AAE7814EDBFCE5BB7F866668CBD8AF904FE4C7699DE9764C96CE74C | |
| 1010 | 17AA20AC60CD480F562778A95E025A3B98233F6F7EBF2F0359498A389D0F5B55 | |
| 1011 | 8CF1686AB3F1752B18B4A4B1D873DD8A35E73B3A7F08BD152DB528C52ABD9D29 | |
| 1012 | 9BD2DB7F07658D1F7E51D9038CFE60DC9D03FB2B6634074B6DEA51B63A358B58 | |
| 1013 | 1F7096676997D5B9DC7F1C68008B0BBBE13D2FE4CF2BEC425CFC8230D895E97A | |
| 1014 | C2C664A99AAAF37B627B33A57B4131959FF07E80E7D35DC9F6C0C216781F0F63 | |
| 1015 | AD3396D9D197EB54E70288A6EB1C63DC0CB185F08C1262EE0E63ECE4DDE17EFF | |
| 1016 | 4C074B28BE3419A6A6FB04E0ADE4E61F54FDDD69AC02DE30B9B419975870BA13 | |
| 1017 | 0ADF9F2658D799E9DA2E4AE93C75E0EEDBAC66D77F14097370BD22D009BCF6D0 | |
| 1018 | 838A4434CE9E65A045538BE825C804732D0C98615B724F8B1B6F052AA52851CF | |
| 1019 | 7ABC84AD999A9EA32304582C04B91B501B9B3CD2A685B9361F21BB52AFBE0496 | |
| 1020 | 2C9DD63C1664BF0693DFDFC3724DEAF49F6B9025672BFC12BA194CC5DF0EF962 | |
| 1021 | 18AC0130436D9D27F66B1089C0B59264FD1A388B545A469D57D20BC3864534AD | |
| 1022 | 73C748659935976CB0BA8AF81A159B4BF95EDA9C8130984631F1F4912412F02F | |
| 1023 | BABFE838EE13FE744CED03E6914BF43FA6DFF3F9314F42BEE02C6663037A3DDC | |
| 1024 | 6BBE88130E6525D2191EEB828FF6D7208FFECB77554DC41596FC1EE24FAA32A6 | |
| 1025 | 01D701BBC23147AC135A7AF22F8E82C5FFC20478C097EF9DAD8D0465D271DE62 | |
| 1026 | 012B1026F6970C05071ACC483D1B8A0E759152D94E9470EC560315AAD8666A16 | |
| 1027 | 7E422D75CA857276B0679AEC89E78EB6E5603B2C6588A27EC513F6BD48F839C1 | |
| 1028 | 3BD38C5B094110AE4DBFBE728CA8DD44249512B9AC86254D618F9CEBA7C6C544 | |
| 1029 | 967DA6AA44DC0654E581B4CB0F8F739AF8EF2A92B2A359FA4B3A0EA3FF4A8736 | |
| 1030 | 853D6CDA7034C13AD2DB0ED59AA9E6515227ED65E82B0A149F68AE248FE21B0D | |
| 1031 | 50CADB74A015BA18F6C1E534A626C4F50A379E53B18CB8BEC38298B6FCD95A69 | |
| 1032 | 601D2508FE90F45AF92D2AEFABBB0D0AE51BCBE5AAA96393328FEC03597B4415 | |
| 1033 | 941F0F2DAC79DAB1BBD04F1B9B8CA189F72D15D29C3F7C491FFBE9C991CAFB48 | |
| 1034 | 55E2F73EFB9C3CCFB791863AEC846799202754ABF7E01158F6DB791B8338264F | |
| 1035 | 0853D06D1230D8B025DAA6095C9DFFF2E08829C7BCA90F6D986ECFDDF424F532 | |
| 1036 | 29033647C954BA1F9C77E9955905867B31E45751F240261A3DF10F3F175DE485 | |
| 1037 | D08E903475856918194BD011FA5BCAB3C9923CC8D8F78B688E7892107A3A27AF | |
| 1038 | BDE5CBFDBB4E29B28208F66AB1456452EA0E36F75D6938312C7D160957E3D555 | |
| 1039 | E2DEC5B209D8FF62449CBF1DD1B5D7A799167AEE4DECD8E4FF761766AA094FB3 | |
| 1040 | 7FB7E86CFD76979667AE69886C797BFBC2E5AB647EFDE080AAB5B1AF6A20C0A9 | |
| 1041 | BD705D2B6AE86218C50829CA99D4EB234CBB0476F32A186B45EE45D41785AB77 | |
| 1042 | 434538B55F485CA58FFC35EF51C7C830EAC2EC176F816A2B3F271FCB610BBB24 | |
| 1043 | 76C36D8EA7D5F12845DCC200227D86A640CC0D70F59791F6408702AC7D1DF14B | |
| 1044 | F4CAAAB32F181BAC49255BB853F6B082EBFD1CA577F6B6253616DF067F003C65 | |
| 1045 | 88AF610C5F58E8D91660F51E586229ED325C5AE4C82E3187B70E0E59AD7B20E7 | |
| 1046 | 375327EACC433FE34B699AFC471832AECBF19488FE673BAFF48409D24B4AB58B | |
| 1047 | 1C8E8A561E3C8B28A078FC161655D90609B014012CFAB0F5EB875E9A83D2B88A | |
| 1048 | 87E11FB574749EC6763D722D8CBEB5F98143DF01AC4FAA1A3B70844E24C92A82 | |
| 1049 | C864731DDBB846D8BF01C0805A24EA471C6E18C34C756C0EAE281A9F00AC4948 | |
| 1050 | 3D2CC2F22C0637FC8DA5F4A9BBE085757EFB9CBD9E54F895D433E69E579D8ED5 | |
| 1051 | D8BA8C864142129E0AD170A7D4544ABD8A802191EAF6CF6F5E285404B7D19B38 | |
| 1052 | 093B52AB8112001A8546DE62C64F2605011DF6E02C967E02E340F1E9383043F5 | |
| 1053 | 4EF3E7E6DBAEE40AD431464011B25C8078DE28346216FFD394087F322007F911 | |
| 1054 | 1EE21C688102610F6394E3BEB9BDDBF8A36A1273D6316A53B9EBFA037D6AC637 | |
| 1055 | BA0B36AAD961061CBD3C31463380D6D13003C5FA5F68F276468AF2CED48A6CB9 | |
| 1056 | 387AE5741C7C79252928D88B51A853B00BE8C029E8B8C58F8C92ED4C74CC8943 | |
| 1057 | B4D89282E7160D532F9F22007312EA18C33A848E4248204F776F00D46D483259 | |
| 1058 | CA0104174D2F5DCDB64CCBFF60977D35A6CFC2CB3441EF966D15C7AA462B1737 | |
| 1059 | 0079B920361AE754EFF71DBEC68B21A885AB9A61C653841B9A9DAED199F33089 | |
| 1060 | C560C28FA29073899466B9BA55EA63439B4D675811D5CED006FB6FEA2674CBB8 | |
| 1061 | ED75493173B82B70ACA4C66AF3BABDEB0B43F1E43583D64EEB11CC16B1F481A5 | |
| 1062 | 68B11795DDB67CB33A03025AC2B215D5379835A32CE1D4E327EDE5B53FA360C0 | |
| 1063 | 399A30E2DE611B64862138476D68C9CCF899FD89B5EB8E155733364FCF981F0A | |
| 1064 | 4E14E79325210F6C3B9C594C1B8DD2725DD694F7AA30A48735D69434C650AA7F | |
| 1065 | 563DAB6D793E70767DDF0EB615F44E56002946E3506686BB09A365C31A2C38C1 | |
| 1066 | E95E601A0987902A54BB1743D9EC5A5C496FBC987D796B9C75DAF3513D0C2685 | |
| 1067 | F315A7E3C61D75C661CD4A5B49297B16C1FB62104F0AB175DA178EAF5B63C026 | |
| 1068 | E99E23AEFDC25D1C93BFB7C9182B58D4A599B484616286CFC0C93425DE11417F | |
| 1069 | 7F7BC7B05E6F8B2E3E37383BE6DEC107EB08971A6ACCC66AE172EFC6F529DCB2 | |
| 1070 | 4D478FA20742410A8804624DB03A90C6BDE00B38F92100E065BBB2755618A570 | |
| 1071 | BC84C28EB5DFEC2A4BA7EF6F4A6B6DBE18069229D912A310DF592878ADE6D3B8 | |
| 1072 | 4684C42D5DB517E86265F689D54E870E0EF9D64EEDD723BB9F99B820EC790FEA | |
| 1073 | 7BFD5EAA848D6EE17519EC82A9070B500BB5DB318509F72B316ACF162A1FAF75 | |
| 1074 | E5C7AD5A8F7A2CA610C1A78DAC995C378C38D73CADB167EFD61F1410BC166FAB | |
| 1075 | BFBF9C311FBA0040D77848DCB1B093D7AFA67C9CC400B1CC2790682D6077A400 | |
| 1076 | 091915F6F609C581705F095BA8CD132E31341168597CBFB9CEB29287176EB484 | |
| 1077 | 689573754C275F67B2802E9614B665C945B8A18B7E3355A922BB45011DA7251B | |
| 1078 | 90812D8C817AB81D65E3D69B00F9236D5CF95CEB734ABF83478BFEEDDA250CE5 | |
| 1079 | 859AFE01BD9375719F1DE48B9700AF63892C3D5CC9ACB84F07D77B68025D44EC | |
| 1080 | F6E08A113DFE85D935832BFF21A193F96A57594B79A69C3278794F3B96943F07 | |
| 1081 | 9A6C629AC9BD16924E2C18268F6482A73AA98B0FF28E9B8E1E2932683C155B14 | |
| 1082 | 491257A7FB094FEDD7501AB7C24CD11F3B45593702E4D462BB73AAC8C6D85A17 | |
| 1083 | 94AC384C6B1AED89EA4DA938A789C3E19C19447DB3219EDA58ECDC1602A8CD86 | |
| 1084 | 7416B777C32251EBC0B1135AF96111918ABDCDECADD7BA4FCFC07EBEC5F29863 | |
| 1085 | 458D30E5707343040174C85044FDE203878346FB14007EBFA2D7548E7ED1790F | |
| 1086 | E5CAB33BE24FEA0DC7B8091FA1DD58B303A449015E089FD7D0C3A102114FA2BB | |
| 1087 | 72213BA3EF3D1981F4DFCF0B7C3EAAB740AB77FC4401899DB5CF7D4AB0D50B3E | |
| 1088 | D1D050B48D4DD999594B576A72C6FADBBE7B08AEE834858101054CF8EF86ABA2 | |
| 1089 | F82F97CD18CA9E5D5BDD5C9FE6079531EA709F6E12E8633C8335E1A68C1E639A | |
| 1090 | 7D8F2916118506FB51D79B02614CFBA56C44F6CE83FDCE29A606FAB6E06D4AF3 | |
| 1091 | D9819629213892707B1B48CC0FBE495FE8AEE915CD7E4F3E107D8427C710E6EB | |
| 1092 | 5FD126FA9ED1C43F6EBEB2771D9179CFDAF9532176AD8BF820351A6B614D2B9B | |
| 1093 | DC0391C729A2F535326FFBBD9C5859B3D29F494FCE6D6C49E9D1AA97FAA8FC4A | |
| 1094 | 618E25F00BCBC742F3C9 | |
| 1095 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1096 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1097 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1098 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1099 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1100 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1101 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1102 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1103 | cleartomark | |
| 1104 | %%EndFont | |
| 1105 | %%BeginFont: CMTT9 | |
| 1106 | %!PS-AdobeFont-1.1: CMTT9 1.0 | |
| 1107 | %%CreationDate: 1991 Aug 20 16:46:24 | |
| 1108 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 1109 | 11 dict begin | |
| 1110 | /FontInfo 7 dict dup begin | |
| 1111 | /version (1.0) readonly def | |
| 1112 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 1113 | /FullName (CMTT9) readonly def | |
| 1114 | /FamilyName (Computer Modern) readonly def | |
| 1115 | /Weight (Medium) readonly def | |
| 1116 | /ItalicAngle 0 def | |
| 1117 | /isFixedPitch true def | |
| 1118 | end readonly def | |
| 1119 | /FontName /CMTT9 def | |
| 1120 | /PaintType 0 def | |
| 1121 | /FontType 1 def | |
| 1122 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 1123 | /Encoding 256 array | |
| 1124 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 1125 | dup 0 /.notdef put |
| 37c41ab1 CR |
1126 | readonly def |
| 1127 | /FontBBox{-6 -233 542 698}readonly def | |
| 28157acd | 1128 | /UniqueID 5000831 def |
| 37c41ab1 CR |
1129 | currentdict end |
| 1130 | currentfile eexec | |
| 1131 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 1132 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 1133 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 1134 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 1135 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 1136 | 2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D1E | |
| 1137 | 2931CE5F5D18C658602059F07BE66E6EFC9239D7AB2FB8A4CBD41675B8ECF279 | |
| 1138 | 650C29E53B14AC0E392A664848C1844B1CECBB2D5CFB72D0916B675C9A9A1E35 | |
| 1139 | F12696A6F628473C604A95376468E06E295AD6F76CEB939D94113532050B9D5A | |
| 1140 | D2F41A9EFB9424D986612313B89EFE9C8A71313340B248F6853B1EDBF02B7F9E | |
| 1141 | F447220FE131D7D54CFB8AA1281DBAEA73E665BACB1F164552CC0CEDB63BD4B1 | |
| 1142 | 4A9AE8AC6FA02242DBE8DA46B64B6BFC11762F0784F216FC8B9120D688D1705A | |
| 1143 | 438B14F5E5DEAF2A98408B3B64620DE3732A4DAE6D08D5D97E34C75DAE19EABD | |
| 1144 | BA0796165C1151BCBFB1DF8D29A63A8300DBDB9E3323CB82D0337598B83F4F2B | |
| 1145 | A97CF5196D4D1CEC1EDB8966E548C0D9C194C932319610FB43EA1B86322FE641 | |
| 1146 | AB48770FF13BD475A7267E142388563D1A400419C585B22A9886074687BEDF74 | |
| 1147 | D905BE8EE440BA2ABF28EAB673399B7F129B9729DD5564C681954621903B84BB | |
| 1148 | CAF89AC5ADB2932472DF29ADA2BDBDB4D05F65F28F5F4C529613D61858E0074A | |
| 1149 | 082A852710A62A147C966F2B85B51B0BE85F11D2057C66FDD61F6C5755367980 | |
| 1150 | 9F4DE680601D4DA41B46F8D2148450000413C27AA39B586B74B977B25F0FD3C0 | |
| 1151 | 4BA1EBFAFDBEC531EA1210365091671CE3C86A6D4BC591C37DCC02570042575A | |
| 1152 | 9D24252D6E01A8603753934D7EA5CAC1BE4E5AD2BA047DE8F3983B23A8A1511F | |
| 1153 | B08D373B69E5076CE4300137B8805EBCC0AAB89BBB312A77835795E3C069322D | |
| 1154 | 42C893A30AD739E2BDD299679B158F7493764F2321E3965141B5ED1C6F4765ED | |
| 1155 | F46D391A646B30C90002B1C461AEE79E5F094CACCA656CEA3DB921CC5205F328 | |
| 1156 | A2C69F817061D6C60B121EEE844CA5008F23DF072D4D1C9EE000CBF2FC3FF4E2 | |
| 1157 | 119740FB306D340D92D733000471A990E5227B06C53B3DA72141948D2FC17A77 | |
| 1158 | 0AD21196F678B0A93DC026C410A781255D359F043B777B70E1331E88E68032E1 | |
| 1159 | AFD0CB35E99550E1C0FD2852A7D190E079C1B8EA1F8B005D66F8406E14DCCD92 | |
| 1160 | 9B1F39E6A9CF2E33CBEEEAA09AE1930C846ACADD3B0F0F102B43AE6EEB3D9A24 | |
| 1161 | 50C521F1B4D0541CF7B325D14EF0575ED2A7A659C828570DE5A4A773DC6493AC | |
| 1162 | C95FDEE00FC1E9E332B536AE670CB145808E654923F757EDA89FF2BCA9E89FF1 | |
| 1163 | 6D0D03C51443C52FD718CAE35DCE7CB7BC738614074131479E3B05F534F67874 | |
| 1164 | E2118A332C880EA45B91253E8101C38FDF36BC7766CB320D14F34722E2F40F8E | |
| 1165 | A469DE22A904697BF8487AF1F26166730DEF2B9502847EA432FD862BA777B6E0 | |
| 1166 | C62A9622491A23CEF57E9713CD3D61A36E00C865E445BACF3536E9E33DF6DA81 | |
| 1167 | 995CDC130C5AF0CDB265692F769BC0200B42BC73A117C0617C412ACA508F970C | |
| 1168 | B20652DC14D4031E531BF59295938866FD3EC6F19B4DDA468C69B78E117DA535 | |
| 1169 | 438B129CE6DEC5FC2EA667058B36799189DD9CCFC0D60F96A055280C298663DF | |
| 1170 | B58FDA736DC747662D83914A9845669E87F78AD78F2E93466B14DE865CDABA3C | |
| 1171 | 444C8C17CF2C964CB42EEF8D7D72AA73B6E5A7DC48FDC0849A92A97253B05C76 | |
| 1172 | 5E4D2A947538E7DD046A0107C5B473C460F9C0367646875035C53D4435A5DF36 | |
| 1173 | 0D4C415B18D38411CCD3E29F3D63A14C9DE5B44CFA9DB7E3EDE6B5D881903618 | |
| 1174 | CFA9FC3BACEFE774B0052896286D9C8A5F302F1BAD47BC71064039020B164409 | |
| 1175 | 7261EBC080F141CAD093315E0687776D604C8D74C77CCCAD5FA2A808BF9ED3FF | |
| 1176 | FAADF730A8113AC0EEA8ECC761060D6A6D35DB4F902B6F63350EB5A819092DFD | |
| 1177 | 06559E737140E60F72543E3151039715DDE716517DA0A15BA43A7C0825997371 | |
| 1178 | B9B6CF9E3D3ACD82B053682EFA03ACC9055BB1C644F1BFEB1A543768237ADFF4 | |
| 1179 | 91123E508671FAAE22B1118471A081520C6E138CCC5543F163BB6D28D09F6371 | |
| 1180 | 78737184F1D3692BE655E3EEA04BB9B159B07EB70D22B4F27D218E8535282047 | |
| 1181 | 8AED37D8470659F013D648B1FD43CAA99437827E88BEFD7B7B51D38B68FD18E5 | |
| 1182 | 60B7C3BB9A1981D3CD0208FB94D29DC1BFD86AF42099D5AD7F0C49B05CB27291 | |
| 1183 | 7DC54D7CB4465E78864D78236419EDD8C52CC26D7041C16EBD06FA6F6FCE91E7 | |
| 1184 | A86B11C0D436E13958C81814F59007DD17FC68AC26029BCB74C4C01B7BEF049A | |
| 1185 | 81F2D35F0AD2313B95A09A65D8A915185EC6BB038F15B29ECD29E6110DD53E0C | |
| 1186 | B09883576A64A272D02A84AF63800E505D8B6B95CAC9E510EAED3888E193CD5E | |
| 1187 | 2348079F78FA6AEF1DB0A8A020A89315F26A4D3923DE9A6B6349AD75F1E08250 | |
| 1188 | 95996A8C71DC6901E90845D6ED174CCE6A2F2D7E1864469CA04567BB3A0B749D | |
| 1189 | D09F26846E95CD9B707331381AA1962CBE6092808DE03FD97022732E229F6107 | |
| 1190 | 6933E9BF8F63A0C0F73AA73EE8F64BD049F12FEF37957FFCF9EE4DCD373E6991 | |
| 1191 | BAF5FE4415CB2784AE7EEA194BCA730D552E6B23DCAD2ACE75C9239EFDEDD3A1 | |
| 1192 | 1A7E33C5D64F9664D26ED72EE280BB33C4DD08B76F787B2A8F5E484B6679B4C9 | |
| 1193 | 70A123B9DCAC536130E9095BA6688551392AFEADC8169F67ECF580B9A0F10BD7 | |
| 1194 | 4760E803C4B4624EF892A07F4A879436493D782F2BF34A0B560EEB21880246E9 | |
| 1195 | 4C2126D731636A317090E91CC4CA05D99E18764DCE7B1ED9A78ADC5C3F51EBC0 | |
| 1196 | 887F0E6409424D067AD199F238C059D05BEFA084ABD4A2CA7F5C16DBE97AE843 | |
| 1197 | B51BCB3B5CF71C9168040203083A3EE50E4D492BC21B7CA1648FB31645C74F32 | |
| 1198 | 801B3743CE95D230920B59DCE8D587EC6917D31CE10D60AB047040A4194E3DC5 | |
| 1199 | 347105F38770D26B9CFC472B3B88459DA521985B1F6005980A4D7C6A3B90901C | |
| 1200 | 0B79D23FD1BA58F75E0F9AAE0389FCA0D10C061A4469B4EF66523A2DA39B617D | |
| 1201 | 8E21BC50F7DE585F9DA3AF48A5E88237544D230562BC6E7B6B26CE43176EA3F9 | |
| 1202 | A8F1F13971F7C65C4C8FB391CFBE58CA3BAD327DAB59E6496869715FF5E8872A | |
| 1203 | 68409C73D11951511F5A8826BB47C051762D2E9E8495AFE328CCF14B4192724F | |
| 1204 | 4697500FA7007C9F662CCEE6EF492EC198515B9901E12D27991A029141D1826B | |
| 1205 | D722D41DC8FC2F7E197DE911445AF33E4F58E7E1A2067AAF19B5D46173039D43 | |
| 1206 | 4AAC3991E07AE3262F2AA3195F6F3B022FB40436111CC7BA6ECA51BE2C3867DE | |
| 1207 | 20D8AF638B6136320F9F214BE615954F01AE717CBBA102DC69B961ADCF6085D1 | |
| 1208 | EB59F2228F373E184EA3808359E2979DAD578C643F496645D97F41F46357FFC0 | |
| 1209 | 1219A3CE14E1BAB3D0CA3F79BC299CC0A810B44872C3BD0D12D06BA4945A9E71 | |
| 1210 | E792DCE14E8DF47DDB17D01DDFDF110D7F4D928E187E25DABC3F34F5428147B9 | |
| 1211 | 0F2F756B07763AD25685F99CAEAB3138A0809B272154A17EFE2E371CD9FBAA79 | |
| 1212 | B34F34A8466CA9B637C5FDE77A65A67FA68E4F1B6D1A2286A2F6F024A8ACD7A5 | |
| 1213 | 9F187818C7666E5BFAEACAF13B6489C88731287D58EB413006653574126EAF5F | |
| 1214 | 6E78B13514FE40761B70ECE6B6C1D2422F9FA86AC4DD12A807445A750E6774CA | |
| 1215 | 90DA9FC8211134451FFCC547ABCFAA8F63E934DFEC3B4443ACF203EBBFD7AB93 | |
| 1216 | 3EE98240E47B12A7423C2622E4D0DD6F5DF97421C29A644F2F37221C3F311FE1 | |
| 1217 | 418FFF1B36F1057CE5EFCB2801777DB7E746EB933D892FB57E94E8A0C617A6BE | |
| 1218 | 1711CAF45373D573A7D6018673AD72BBC10A418C756E7FC82F9A2824F3B080AA | |
| 1219 | 175631DFFD9D2C78A92FCCCE9E864173F774BE42D6A0B4F95DFC23E9FF4FB0DA | |
| 1220 | 4E69424B496A08308BDD03BA40E1E29004033959ECC88898D0057AA9E62974CA | |
| 1221 | 4BE6651B893AEEC10F325264D0C14A8142C30A58B87583A5A5938E43A4E39B60 | |
| 1222 | C47A1A227144050933BBA8095CFB4FF475EE9BD0FF44CE610E1E50390F641D2E | |
| 1223 | 1B0DD50C2BD7033C286A666C4B07CF27789D68F987AEBA241EF087D9215F89D6 | |
| 1224 | 0A89D4049EEACFF77A183ACFD83B60A492A0E847741E036353D0DEF1DBB01BC1 | |
| 1225 | 3354F15232992FC283EC2D95E93A8537AA790F21F23F9DE5C168C90933C6F9A6 | |
| 1226 | 3A4B773C1C1860A1E3B0C466B709D27C68FAB1B3617A73DF9E018C2E4B595330 | |
| 1227 | 8A0E8D1BDA0967B1DC3A5DA5B96627CA556E23BA89C12A512026CF6D43702E67 | |
| 1228 | 2EBA6786ABFEF3F10E204B9B5B72C738268BAB512ED9B8E1A5DBF95CB75738BE | |
| 1229 | ABDE1AD1208DD41BA7B9F7081B01AA22CA257C602E0CB9769973B4FB46C1A4D0 | |
| 1230 | 5EC5B567A9EC991DF2D7EFF791AB4A051220C2E3CB17D3A6FE6CE802A3BBE6E1 | |
| 1231 | 656BA3F612E6479BA94CE2020C55345ACCAA514A55C72C940419CBF128643946 | |
| 1232 | E0721F8945CFA9A7664D3E274AC498ACEDF9C8A9D09E931533CBFB712057B3AC | |
| 1233 | 44CA4BC95BB96F9B3FD438AF46D0FD5CB66EF308278ADEB0FE31CEB9E93E2373 | |
| 1234 | 0306CF0EDFAE6C73EFEB1540E342C89FC626966B7D01C2734795D3402A6BE710 | |
| 1235 | 660B2822088D5A9879DE4C6A74CB5719F766866D797FB846F4AE181ECE9E447A | |
| 1236 | 6FDC5365A937F5D5CDEE1F961210917191CCE511F442B34E2399C42C5CFC8F5A | |
| 1237 | 7B9EB407F508B1B998B295E39C04DDED5571492932537FF6AF76526E739C99E9 | |
| 1238 | 9B702414478863057F264B11BB195433D247AB684722B9EA66B02EE1BDC57422 | |
| 1239 | 6498382B2AA196C1EE9E8ACEBD946E16E415B148F3BEDB889B95645499E61EC5 | |
| 1240 | DFC8169ABC03A1AE3E51E85028338FD7FD471CED1708BBE55577560EEF0B4263 | |
| 1241 | 17C87251F434C0C40FDBA5E12F3720459421557A280233DCE87805BED9184318 | |
| 1242 | 9C4A55B99560459F0932A5656389255C259ABC6F115B900B8D6A82853FBCD7AE | |
| 1243 | 01BDE047AD558106FB9A5310C42E9CF17A1DA691234BF71E47EEAB720FF71B67 | |
| 1244 | 9723E6514600ED5733EC66969B367BD930D98B01F2DDB5B9A5C162EF2ED10E00 | |
| 1245 | 9A58B69492A07ACA258EA7E7BC0E6AA07C4389BF545F3C54FE5AACAAAC1F90A0 | |
| 1246 | F165EE30AB18495387C1CA716EBCCD08325EB578BC59C991EE784DE7040624A1 | |
| 1247 | 48183FC209D720FFF4CE907A4AE4D5057640F777A34B16B9E3096A83BB50D1F3 | |
| 1248 | 953E82F3F1A4828BC561DE99582E0AA54B2A963BE17EC5023FEEEA505DF9DF15 | |
| 1249 | BB5C2D3F4B75625C3FF06C0D843C3947D8EA58AB2A6267BE6E2506E0D58A2DD8 | |
| 1250 | E05B61C4D2F4231A3D4032175BA3C536A0A50DF906B2FA23A8F54848E81A9FF3 | |
| 1251 | 25354A7D5B17E9BC9CC2765865CE9F8BFF07BA9AD27E4ACB531D20A6EFF49B1A | |
| 1252 | D479A82CE51E83AC378677E19CB593735EC2E7BB14540B5E120DBCFC4CCD6319 | |
| 1253 | 16E6987A488031144E36DED23AB83ADE5DAD374A35620CE27AD89E54C176C0E5 | |
| 1254 | B0EE1A88D96A072A8950F425430624CDDB8ABD6F45D79004A72CAD5AA17F0714 | |
| 1255 | A3238C3E42814D7719A11017A656678DC89CD48D5B92FBDEC2A3506458B5050C | |
| 1256 | 87CD8B9CD0E7FC0CA26B822265E14E2B4812FF00C96FC342C4CE55B25E628CDE | |
| 1257 | 49099B12513DC1484CAE9462F09A946301E9597E11CDF3A31AC2420E4DFA47D4 | |
| 1258 | 259AF53C3AF330DFE4734B72684E50BD5895A8F64FC814B561342CFEE20A56A9 | |
| 1259 | CD60C3E9FD187D6033B322075E715BD230C4DB95EE677EC9147C78DF1BD284D8 | |
| 1260 | 8FF42450CDA9C4C556065898A93F2777B52203E2128713C1669484C10952C0A0 | |
| 1261 | C2306E036045E6370655A8D323BBFF8A6F2BE1F9B8446CB5955C9F3F1EF9F13F | |
| 1262 | CE8903EE90D0F7A2BDA34B279C4BB3D8BEE6A8C256DCA01D7149308A33926437 | |
| 1263 | 85E22529ECD1CC157AD27393B461A9F4685D0EEC63AC9EABA6309C0A36CE3198 | |
| 1264 | 2B6FDFDB499E29B46C692609400C55E13C491CEDD0BA275D2D876E06E4B9D255 | |
| 1265 | 5DBA5322454C6AF0602E0B01547145C502B0DFB31EFCD86743BDF087790B31A1 | |
| 1266 | 25F14F796BCB613625E1D915E6CB8598F17B463209CD72B4558D398B6D5A8BCA | |
| 1267 | 9FE5BE145AAD891E064E1E6E96D32B248E30C550A7EE4E533531007C29D83E23 | |
| 1268 | CB6075CDA42913296BE65F9CD48A7384CF56B86913D4BC5B11054431C32CB43E | |
| 1269 | 757B7D1A23100CADF5391C44CC9A614B180657C956BD408F7C7F81D31FB8EA8C | |
| 1270 | 8D038351A8F6CC8C8E25671AC4B77CB608B3882B2EA0A9B081C9B2F81EFC6DA5 | |
| 1271 | CC858FAEED1AE829E6488337429FCC62C2BA5C355154E05B9A3BD5944511CE0E | |
| 1272 | 8BF787EEFB3F136FCABE6CBA3C609C248AD6640530EEC6AD8247E77A6AC12E80 | |
| 1273 | C82732137D8CF638CD0EC7D4CDE42F80C8C7149244D6FBF1701E1E3C5666D02C | |
| 1274 | 2F68126B54B2333661C32F70051FBB82C750FD1C60FD9F667DFCF8657154F409 | |
| 1275 | 7E99629D2B7B926E8A1077CF78CA89AC5EDDBA3E04FB0A565AE2DF997E05AA09 | |
| 1276 | 73A00018671B2AB71652FF9A059F1C361659523606B78E9B4B10F6D72847FA39 | |
| 1277 | 953ECB88070296C1B09FE8D92A50EA8E98FD6FBACFD178EF5B2BF23150749F27 | |
| 1278 | 2CA4491C4C6AF4D6237EE0E912773A04CA55814FD6EFA493D01D1D911A29BFDD | |
| 1279 | D53F39E8CD7B7F964AA091DDE7CE9CD3EB8757DE545D074EAA584B8E24676364 | |
| 1280 | F666FE6F9B9EB570D154E7E2C05A8DB5A40AD741F0585641F4F32CA05A7F3016 | |
| 1281 | E116A22E4F85AD5E123F07FE0FE3AB55A7ECB31503202AEE7D66BB8E89421F08 | |
| 1282 | 1ED8C1734A93FF047AE8D0F87F83474EEC20D55E9763A4CACEF15F12AE7E3A20 | |
| 1283 | 667DC66A042FB67F3A140D1042E8175E47FD6140C05D89925DDF10BEA57A71CD | |
| 1284 | C778A57564AA74D7AF7B2074A4580331240782D35E80B528B8950FBCB1A8E593 | |
| 1285 | F96EFFE0F1DD23F6377363D661E1C4F98104C31D7C0E7F9C6F219AD81617A512 | |
| 1286 | 69B5322506690A672CB9E2877309F6DE2EAD18A4DC9102A1955E94E3081AB800 | |
| 1287 | 9202CFE99B057B1F41EEB87543BFBF5EE1FF1C93DADD0ACE6A7C7E779E011A6F | |
| 1288 | 39C0CA50F406A7F107418B4ACA6A69E0CB46C43676B0843463D5C53AB375B595 | |
| 1289 | 62E9F1FD5DF4E2D5BF34B7D111C8AD6CF2BFF59655C20D40B50EC525386887E1 | |
| 1290 | B6B11D62A02B7F81F65AB65472EDDB9A196D41D98FD5B1BC6D339964346CC55D | |
| 1291 | A55B98C5FB4A4BA1ACF255B2380447DE3732AB82E3BD0433D642ADB7D67C2217 | |
| 1292 | 884A6C99345D4638646CEF366A85F92860A0716F3DDE3E73CA907D4BE597AD07 | |
| 1293 | 053CD914362D5C6AFFAC009D29B7D288499522B923394AC2F02191EC869C5A6B | |
| 1294 | 1CBE5EB7B47A790040D3270E5AD0396C05FCF895E2E0AAC4A94C2EEF4B7C19D0 | |
| 1295 | F799E1507C81E2129F4E287B7318E62ED92300F121F282AB65872102B94314A8 | |
| 1296 | 1108E733828CF33ED983C7F72E3AB8CE5F6B61232965AD4D5259AFEA3FA8CC5C | |
| 1297 | AE4E0D1BB9F3180312DAE392E28B22EECFAD24965EF9756A29858A9901018FC6 | |
| 1298 | ED605A1F43886FE9E5307CA56DABBC9D42B0A606307E81705565D9CB81814DC5 | |
| 1299 | 78E5BB93DE5BEF316304E8D33D3AD847332A706853FADCDA40B7F04E11340EBD | |
| 1300 | BBAE024BBCA535597FF8D3215869F2CD3AA0A2BEC830F379FD005D12AF2CD298 | |
| 1301 | 53906D4DF912C3FF79C0A04020BDD46020CA80748920845D7C9AD60BFF780A45 | |
| 1302 | 99114B8E401BD5F3CC489432880EC68186FC7661F93F636A0CA790FBDBDEE105 | |
| 1303 | BC0C11C03C246365BD4090923BBDECF9F7501A65E9D6EF06B752B0B6C92B0469 | |
| 1304 | C1DF26D6384103B405D948CF0C4310CE34B0CCC47C98A38E7A237BB737C7B6E6 | |
| 1305 | 2298F143A5BB9769A5D7E4330F1C64C9EDA7EA34F85F31B19BD546516B3C97CE | |
| 1306 | 5B7906B0FA5D39FEA3C84C48C331A549DAD1A114A43AE7EE8ABFDE8FBC767F71 | |
| 1307 | E86450864BB71B9D11D9614EAFD6547E509081CC17C6261D3B81511EE43C33B2 | |
| 1308 | F63601B3519AB2F58A8A03A304DE0586517E0D9CD27E756AF6EC6FCEBD897FFC | |
| 1309 | 89CD5D760EEF2DC6C185126A7B85C0043B785A90901137FE197A57E9CC1116FB | |
| 1310 | 604E291B7846ACEB236E1C3BE9029B7B07D21900D8A2D6F19FDDC2EEAB076854 | |
| 1311 | 6443D8C28B4BC46D7CDE0D841E7B0C43F86A30DA56F6BE0F6023E2AA8064EA2E | |
| 1312 | DDC9D42906137635BC7D21312C23C19593756F4A344C72E7505C41A401B91887 | |
| 1313 | 9512A20F1E1F5A1E065FC6DDDA3412C255C89B9A77CF05A0FEB510146A0EED02 | |
| 1314 | 13633DE45D4626307B03A012A1C44AA0BC4039744D2EF60AA999C0D6F0C2A5EC | |
| 1315 | 065D730A2F43DA9396A58F41F57787BFE8FA71CCF395B9B68C221FA789279CCD | |
| 1316 | EF29B6635F6028A95C124C6A3025F2B16550E9206CC3245FBCA796E91098F4B5 | |
| 1317 | C61BBD21365F39045FB67086B11C32515AD245CD0F50687387DE65DB08CF6D4C | |
| 1318 | 9899DF674E334FC25A3B16FD97B19228951D43EA09EF4D0FBAE1D7589B312AE7 | |
| 1319 | FEC3EA4A20C9D63B7D9DC1A1C35EF58808A988C20ECCD08A407E8F1028B204B4 | |
| 1320 | 267453C5CDD206E47119ACAB15B690EF50B59224D863EE703C76F271E89A4827 | |
| 1321 | 14E154FD7DDA5BAFCD97DC9FECC47F0F136243DC58963D492C3CA6C91E54577D | |
| 1322 | 669228FA800E18F6F60F47675814A7BD746A79AA1F727539F1A7039B65049D41 | |
| 1323 | 2648B977A75178D2EA2806CCB41046C10BC62E2AF9F61A1EEBB7D762FC3F10C7 | |
| 1324 | 30457B1AA72511F10AA111D6DC77EB18F93A6DDFE8B98625FF037B088556DBB1 | |
| 1325 | 86FD399255368EA7161AD6E779502EEDA86F0D1EA4873C01E8A7BF9CE7CD3AB5 | |
| 1326 | 50DD7234BEAB66700D8F028B2468C367841DD2BF035A151FB15EE213C0A5943C | |
| 1327 | A0A5FD68B90C976EF9A008960CC12257203E95BBF7C82EFC853D41C9F983A6DF | |
| 1328 | ED243C9C67CA1889719EBE9D5F684210FABC485C3CA8675F2AAE6360312C191A | |
| 1329 | 8B1A0F18AA901257157CD7840324B2B0D78B1D50EDF9B3A812A9321F3091D203 | |
| 1330 | 2E113E616F09DFBC0FFCB15C54F8ABCADCED58DD3BB2526A81119F2B4FF93910 | |
| 1331 | 26A70BC4AB00D54047D1E997C375BA799635AE4AE0E7DF9A4FF97EAA560C269F | |
| 1332 | 4380E3252E6ADEECBA2BAFC7AE56729474E05DEC8A40ED3E0518732FCD253CEB | |
| 1333 | 71F1A8B18EA41AF08D54880924F5B02D7B181BC76B29A4DF769EC1723DDE2519 | |
| 1334 | 6B2170C3C5D4E70C50A21283ABEFE0064996392DFE93EEDBC854BDE2D4EA81BF | |
| 1335 | AD04AAC565C48737838933C5257D3AC9BE85E4C22AC3AB4FCF28B7580079D8E9 | |
| 1336 | 0F56C6ACABAB0D38C60FE08F5CEB05BA4DAD9B09B0F9E57C4AA524300E6B8AEF | |
| 1337 | 1250C6432E54D007AEA9B36E43890355C788E233454A7D59120E3277DA3EDB55 | |
| 1338 | 6BD9EE10B356C16E67F93F9891EDCD06B16279125C22F2B0EF90315F574BD651 | |
| 1339 | B46AD78D7723FA0CA2B0A0AE9C102C4CDA3155E33CCCBE026C5E8B603A3210E1 | |
| 1340 | FE538DD514A4D1FF897BE4655B5D8D752439F135E6EA7869F315F3E9699B7B77 | |
| 1341 | 810A6989623051130F6E4E1471656F6CCB10A13034FF085403221017732F2390 | |
| 1342 | 259FE3B29F6331804C300132B9586D3C6B08318A71AC700FAA6E83CB3A86B1FD | |
| 1343 | 61C6DC7BAFABD3B49F8DA9E3A98BC94926E07DE98945A45061CD0FD002B90CF2 | |
| 1344 | B8D294606DA133D4CB0874FA3ECD4843828F6F384A595EC123817EEB3BC6140E | |
| 1345 | 6419208362639835765C432D7BE88C8BB85DB91051F2BB3C247E729F25EE441E | |
| 1346 | BD3D4A44D90E9948BAD1D5C168D7FD14694599566116387F622B53F0E4096071 | |
| 1347 | 0DD97D7A6E64F3A2B11BFD075C6F7DD953F57C1B1C3FC952200E8142AC1D561D | |
| 1348 | 963C5F5C67A05D8E6872B97C6C54AFB455DAC53C80660E6E4CC554E3B5F5C268 | |
| 1349 | E0E027D321DA10B59BDAECB378E304D11A1CCF3D72A029FC4BBC2CAC76D1D5F2 | |
| 1350 | 84DF09B99A2249E6F1A0ABF58707BCC2C460DB4D4D9250B0FE4283BDE6CA55AE | |
| 1351 | BCB1C85A373E382ADDB1AA92B2FAA83858FC6444942CB783D5B639D69344B8BB | |
| 1352 | 4A8C7DCBBA3FDCD2B455ED377C3022E2BA3D7D717468B42B731CBBE3FA439E97 | |
| 1353 | EADECB5AD8DC8ABEF73F510FC6039D001EE8DE53E239594E64428F2A460FC809 | |
| 1354 | 3BB40C9C6A8358C7122B45483FAF3471F164D8BA84D4A844E09188B4C34FABEA | |
| 1355 | 79BEF8F884756AC909B70460BC22C6874F966699DFD1F3C54FA1D2AA72264E93 | |
| 1356 | 75596BA06673B01D2A763CE177E248960BA0F7E3BADD59265C8876EFDC6FCFD1 | |
| 1357 | 81469DBC59AFE8CD07EA8FC0BA3FEFE43DD7D527D84F685FD985B3A89BB5ACC1 | |
| 1358 | 31BEBCE59665D9CCA179B774390A1CA5573A2AFC8BDD6D6901FEBC9CAEBCC5AD | |
| 1359 | 9CF26EF10987154F9CA620F426E3EDE082A2551C5E949984C30CCD98E2B1D0FC | |
| 1360 | 3CCAF3EEADF436ED12108134359B711772E6D3C921B02677BB15EE87DFA5A2FF | |
| 1361 | A3F253528D2D0828BE0778AA599900DAF72AB2C17D1513BE9630761128C366EF | |
| 1362 | B3330BCBC83A5F745D0F163CFA100DD8177309A5ECAA912C8FE8546140587FC7 | |
| 1363 | 50B14AE5B8DAE05BD2399CD44B888A894F79550DAA5DBC84AAB94E62F0441A6D | |
| 1364 | 3E7D008F10EE46C58F1A92994269B52DA17A8266BEA8EB4BD99FD39D5361C028 | |
| 1365 | 81FBD28300E40BE415F7306C8D6D94713869722A6A179F5FA66A332CE60A0C39 | |
| 1366 | 97AAF72BED0B337795CEC21379D67FDF7D5011BFCC60CD433EDE8A3768455F68 | |
| 1367 | 62A9CBCC695F9F8B4A265026B1678DCD7ABD8FD566792218BFD7FE5A61FED3DA | |
| 1368 | 9307CF0FA486FB636D09E95D640A95483A929639D14141679BCE01337A309ABE | |
| 1369 | 6CC846D012CAE3E838FCC4FCE3372D020343A155EE284BD858C33A245EFE1B79 | |
| 1370 | A9FBEFFFA2B402ED5E17A9CBCB2AB9B2B131CCA1484291ADBEAC711503405F17 | |
| 1371 | 66570740C63CCA6E7AD5871AAB381ED4968806A911D6B6A2EF18CA9C6A4A800F | |
| 1372 | 95DB24AD68BDA434CA725D17F0AB0E99E339967FD4F0455D7301ADA41ACA31A9 | |
| 1373 | 6A03698C9A012E022234DC03E2F3276D2DA1FB03955C191D2E8B4DDDD668CF04 | |
| 1374 | 23F806E181DFB4CAC3E4B3C66E79AE87749C4083E84848BE641133EA61D06708 | |
| 1375 | B3F84508985C54352247D3B42857C49382FDC78F5F0D6101908673D90F4ED17E | |
| 1376 | 040F0B0F6EF8C1AE38B5BA866A45EB0DD3B3C9BB3F342B7F504A37605609E111 | |
| 1377 | 1CFDDFC92101E71E3F6DCA38F0A833D0CDC52CF1A03EC5F49506618277D382EA | |
| 1378 | 94DAC5B910F48275CCFC2AA7181DE0675079286DD6A06FC691989197A40305BD | |
| 1379 | 246A28B5F578E458B39EACEB1361AA5DA481563592DB0C9F03DFBF4D6D84D72D | |
| 1380 | C6FEBBB5DD1825735C97C51941B9CF05DB32D1C9A33A0676AF6A652077DA1FBC | |
| 1381 | 6E51CD90D46B767C729D54499D392EB6202DC498B57A50ED44FABCB78E8F7B23 | |
| 1382 | 5337EB2DF8395002AC4E2AC04974C9AC46E01BB7DA9C55074EA3BE0FE9F6846F | |
| 1383 | 9C573876BDD9A1086838430B9E5C42246117D7F5B2A8EE45DD30A6DA2504E2A3 | |
| 1384 | 2CAE453E9747615D9F0A0BA9F06B0026DF21FDEB50A4FFE7952FABFD6D17F098 | |
| 1385 | 79237B36805490D764D1843DF4A0190F094778D114489F6D2B5FE89B614BC0F6 | |
| 1386 | 23F5A366B2AC497155D729530FF1BF982C82D24204826C6AEDCB4F3B4AB88CE3 | |
| 1387 | FD55E650E8E67214253D189D67AC4CCD9090E0482CA19977166DE08230D434C6 | |
| 1388 | 41405B7E4AE2D63BF49E78819CB661237A9E27B2C2091E6EBAC4AAB0C5021B26 | |
| 1389 | 1D38AC2EE717F583B31AD83326080FE441FD2AF2637178F7C4EFDBED63A32C33 | |
| 1390 | 19C315F16BF7D12E78C11D9D769C7B52A453016538A2F72F4FCAB0DEFC246AF4 | |
| 1391 | FB40A1B5D3520839FAEB7B5E9BBCE4F0EA3874C2426085620B7E62C4FBB47CA0 | |
| 1392 | 7C32065EEE2B8A824999496999F06A6E34FF667808965E11605A19B744CB775D | |
| 1393 | D0598DFCCD73A530DF88D72D2D467D9631A8D7E665EAED42B3F74586795F7B43 | |
| 1394 | 51FBFA148672EEAA600B76FA43B0D14AFA5BC1BC57A8C13445FF035D5A754687 | |
| 1395 | 986A1774822DD5CA273D64E2D2CC94AC913859D435DE7C8DE64C5F2150BB395F | |
| 1396 | E55C60C898DA92625462846464F073F2699642F4D3CF0F849A7D9A2B2FDC80C1 | |
| 1397 | D26C06208191D63E97A2AAA73EC4B96373F23D4FC1FB91B93899E2A6DE369D90 | |
| 1398 | 830C451C3462DA0137C812BF06E8D219B90DC6A551FEBB2A52565030772C8657 | |
| 1399 | DDDC5D3ED99982F6A3F9FA842C550FE8A5A7A2BA36862EF2C3A413EF94F437CC | |
| 1400 | E3D51F5196918E4D9F1AF0CA1110AC00F963EE17AB1A2F1B7D6242C29D98747C | |
| 1401 | E91E8A6F924E89B4C6794677EF604FA3235E8F44578A5A87CE1114631260751A | |
| 1402 | 909C7274E941FA9596669D9FF82C29EC8280B1B326EDBC8812D2EE2DF812C02D | |
| 1403 | AAFFCEF6165985DDBA1D9537AA0948A4A797F01B316FFF6EEDBE874BD467A239 | |
| 1404 | E89435CB0AAD16CB06D3401F42EF7677C2D8EC60A395F716687958E5F9B6B887 | |
| 1405 | 5F9C29BB8320634C9892C9E72369A9CC1447B51489743E755363E4624CB88265 | |
| 1406 | 4315F7C6C62EFE3916F7580B3E226FE6C8B3429AF51F93DED861D22EFDB49B3C | |
| 1407 | 6C5FCB5893774E880566DBD66A408495FF65F8BB99D04E33F8830726B20C872C | |
| 1408 | 8F4A8537542E1956C1125311CBC0A014F0E8E90124AE145D2D8FB12D113D79B6 | |
| 1409 | 6D5828941563B1C3F2EC506BD4807A969279AEE347AA6B552E328C9D11AE52C7 | |
| 1410 | 61DAED073036C79B9DA40BACB90855AA3CA93020E2B553BD377C3504D7BE25CD | |
| 1411 | 5A43DD1C53FC73E3C2E1690FD80B93C4C6AA5C76324F32400C019D6360B2BCD0 | |
| 1412 | F33E15562763487060CD620C5F48C40000671A83C22E4F7E3F5F37C9F70BDD83 | |
| 1413 | 07085085B3F881555E1B8D0C45F13C95916907CC0A8E85EB1BE75A3382D16224 | |
| 1414 | 041858FB54EB7F0B8719AD892B123A2EA81EECF9CA572AF8509B94FF7DCD544A | |
| 1415 | 4CF9A7235FE70F97B9D817EB60E8A809BEB69DC4FFDA1653F588896C4C3E2378 | |
| 1416 | D1FE3F902ED27E3AD5BEEA4A54A88EFD453B380B06F222C088C5CA5536E1EC70 | |
| 1417 | 3CBB82839056CDCA0E770634B7E8320D856487E9C4B02CAA605B5510D563C3DE | |
| 1418 | A0709BEB02EDBB59432B65F5D27E38F5F91290B1C871E9FF9901BA8A3F938659 | |
| 1419 | C5A5D28E001A3F8DDEF24DFE7211081ED9749FF5A753F6FC8F3064ADA79EA8B5 | |
| 1420 | 201161CCC9385FBEF61739C6F103EF29135978DC77B9C374695CE7209F3C2B64 | |
| 1421 | 36CC939E58840C9FCF40888EA836B6EDD24B38A678EC8B988865D41E1389A32F | |
| 1422 | 4B6319BF59D48FF6349C98E611CFE1E7EB55EC557444F22EBF414E8EBE976472 | |
| 1423 | B2F7580731D42BEB735396F8F144587665BA950F43802B7FD8C4BBAA4D25345B | |
| 1424 | 736C90FE9838EFA1BB52B1973ED01D4DE7E7E1DBE08162C352B06918CF62523F | |
| 1425 | A135923EC6D932F5DB3469AC188E1409A83839C3F5B9A4967B1E77889C2DD5CA | |
| 1426 | 98D3038CACE8D9623BE6425378CF5262961462D7FF5F2761C1BBEF2A032FA6B2 | |
| 1427 | 7D67129F35D5FB609E5E60398CAEAD4079A9FB008F8EB9FFB26C04914ABAE0BD | |
| 1428 | AB4875F982AA68C8DEA77CF1F0F7BC8236DFBAC37302BB695E7102373A9DDF67 | |
| 1429 | 2163973FFD610BBB8E0D6E4DCBE688D092E6583EEC11CF6F42245871A3F86AA4 | |
| 1430 | 4D59A9BB6D53E586A4D187930AEAADFA4A072CFD97E3973475A8DDAFD6639535 | |
| 1431 | 44A41BBB8F81ADDBCE14CCBC9DB20268AFDD05E2B85779B0E0CC49E200CFCDE7 | |
| 1432 | B6B2B98034BB562A43B080360966D51E1DA0EEBA8803A9526F86A59B50861C2B | |
| 1433 | CE3D72A03EEDABD9ED8935A1C8BAD1D924EE7A118225A576830D30FFA3B2AF1A | |
| 1434 | 8D6B4AB990D3DA5428F6CAD5788553BCC2448DA0896C6A481FB803E28D7D335B | |
| 1435 | 2D569A4D801D66F27175EA483381F5B6ABE1DFA739AEB016C4B95CF230146B59 | |
| 1436 | 440F72EAF259ED4AA1798345DCC04786B8BDE68BE9D85F8AB4FCEF54D8E72DFF | |
| 1437 | 7D0BBBF7D4A79E71CE98EC0F130A2414B4F958DCF7E138C8A15984693FE1A092 | |
| 1438 | 5204582EC8F65BC1E4AA0654D4392B78C29649431886B236C95C11A3ACE49002 | |
| 1439 | 5D83E07965B396FDD136B49B203FC9E48A8BEA97CB77C6EE0F6A5AAFE249AB4A | |
| 1440 | 3194A802121CE314FB773F02A5A1D28C040CEDC32A1EE958018B48AB84E563B6 | |
| 1441 | DAE93C28036FACAFD6EC351D7960047B9AE8DE4845536EC7C02C4AADB202FAB8 | |
| 1442 | E32C9FB7056D17A5CF6817679E30A2E58BF2531F8F1521F5EB3F58EBE1EAD4C8 | |
| 1443 | 1BF11243FEA3332BFC647ADC8B7929A78D105423C6E34E5194BD8C18BE0512AF | |
| 1444 | 5A989420376FCB97176DF17EC9922C42E00D1987680C7CD96C3C81BA0C490A4F | |
| 1445 | A54F11154F3F105D05B465F6711DECDC06391325F04875805F0BE3294B4B412F | |
| 1446 | 425998A37BAB0DAFEBB09F5BB79C344E31FF93A81784CC3B334ADF4E515045A7 | |
| 1447 | 22B5F88737620B4098A7B38842A888AE61DF3E1A5A40E41315886A24C71E744D | |
| 1448 | 05FDE20901F03C5D5747789A686303DAC5690FDCFC5E09F3A031121509455FA7 | |
| 1449 | 8FE6B5C878495F39C40E6241E3A5AC629A1872E2332BEA5C0831D1106CA169A5 | |
| 1450 | 3F596660252B63AED600B8388E89202F81241BF0AD676D1632DDF73C379E05C4 | |
| 1451 | 315839EA8196F9FA4065294AA1770F75F6793D29E585737657A8FB0E3946A6D2 | |
| 1452 | 304F2241C79CDDCACA3162B28EE02C9BA50E511DB84463EB2EEA28CF96D3BDDF | |
| 1453 | 486E44FB8C4EAF0A6C44B459DBDF135863FB8B31958D49BD0C097A4D15C76D00 | |
| 1454 | EE844D99EF977BC0E89287B0C2C67C06D2256E846F85DBBF41A7059B2BC15D9C | |
| 1455 | 66D5D7693642901D17FA0C68FE80F3D3F7234B6E8D7067658E23FD09CFDEBAD8 | |
| 1456 | 6B35ED0A1EA4A69FD7E8E7EC16394C1E3CAAA9EFFAF95EF6C13230DEFF0302AA | |
| 1457 | 448B60136747CB51427943E0DB1C1DD087AD6B284DE4E354070CCABE9E1D5EEC | |
| 1458 | B6975793FB09A9655D36BE2D4A3026DC4689294DAF0D7B6320C34B5AC6C32FEA | |
| 1459 | 7E0675B45D3967D1B476FEB52744FFAB4BB49970F13642C89FFF63FED0D6B350 | |
| 1460 | 2B5C2972C747FA0B43C834363D848F99AF84FF0FE8A786D26C4D3167CC08CC67 | |
| 1461 | ED566087EDA4550120253ED1F19F1A4161E705A3D8DE6DF75C330D571FF2AB5F | |
| 1462 | E022B58D2EA582091CA3282EED6F075FB96000B36EFA323EC9B893A2CEC57865 | |
| 1463 | 09EEA572BB127A4DB00331BD574C258CBCABB02EC1E088F076EEE22362E93F49 | |
| 1464 | 7B4E08CB19E55431C59CBE634FD12B28D56320FA1A753B528FAD98DE5513CE90 | |
| 1465 | CC1B0D722A4437FA1508F6FAB9BB8F3BF38F7EDEB6947D2C46580A7602FA90AB | |
| 1466 | 0062ECD827C062737A163E1797576D1C83A31E0F4F892F7D7F83F1F4563EDFB3 | |
| 1467 | 219A03CF16638E6D5E7E961EF4341AB0D7AE9D80B38A0FA8AD4B7D24E4071F04 | |
| 1468 | 8A2B4FEC937C73FDC45CD570DA8C96D56FC104E39EDBB672478D9C34171D93A1 | |
| 1469 | 3A995D5F9306E3B39B35D04D76CAFCBFA1398465FCC9B544B2FCF97424120227 | |
| 1470 | A97CF3B254084F65516DF48F799D6D4F0E830314E1E7FDF23847B7B22CBB4739 | |
| 1471 | 708B3C0FB3043096AAFD133A43930819F5D16C57BC9A5913B8A552A9CDF5BE41 | |
| 1472 | 4B29F40F181A1089EAB1E1D4298EA03D94BB9D1365BCD0613CD5247A623E0603 | |
| 1473 | 23ED64BDCE80A76F28AD9DBD65495C2E32F8BEB374F2BAC04DEA83299A9FDD4D | |
| 1474 | 5D13287A44190D8CBC8F275AA695D58E7DD99A958FB645929E1134B5A796AF5D | |
| 1475 | B4DBF734E15633F17FBCEB18A41805E56D3B33C18E0D3DB638B5716FC11609BF | |
| 1476 | 42F01966B3D9E2D05DFC7E61326FF476C5973A6863E0318A95B0DA88F668A6CC | |
| 1477 | 6C657707388B0ECDAC67288015611D0AE7958F52D7F7C380FFD27AC1D3B83934 | |
| 1478 | C3F22276DC03EEB1DD096D86A24119D3FF9194ADF3FDBB09C42FFFA860550CFE | |
| 1479 | 290553C71DE6CFC37B9A11C22F859D956BC38CF9A4FCEF72B459F44ED1B31C66 | |
| 1480 | 79D80C7C88A7DD4833EE90FC64B7D8CDA2D0C98235665F71B07A3570189C6C88 | |
| 1481 | FC4AD8D1B0EE5A3BC948004F39963DAC6EBA7240DD832D60472C4F088274CCD7 | |
| 1482 | A97A05F6AB7BEB8292E20DE373513632C9AF5B1449D1D03BC4EBFE36DC25F58B | |
| 1483 | 75C2461DFB41E1AE20901F01A15362434460A638D80E2F569DD4948C1674B8AE | |
| 1484 | C5B1C3322B9DAD25A9A99D84932B2CEF8E074F2C031D9BE0CACD94CAC6ED149C | |
| 1485 | 86E787ACBD3CDDCB45057D149A2A155274C6FC165797F5A0973FE29FC9D3914D | |
| 1486 | 1F44B6CF95F23BB378C06447810BD91402DF356E30FB965A69676DD932659481 | |
| 1487 | A66CA8B8015B4112CC1EE2D90FF1BDDEDD4F80A232351389CABDD596766F19DE | |
| 1488 | 4D93DEF877106A54B0FECB005F41C9468CCF2C84DDB15732B015B2CD1A4155CE | |
| 1489 | 52D8AF86FBC1D97D8249A84C8CF54C271A206CBB0291C9A83F9D3F80A9A94052 | |
| 1490 | D090CDE951BCE2CC812F66A47202F44AC93FA73A7987D3286FE133103B364E5B | |
| 1491 | 04F3BF4907EFD49128AE6C07DDDA38A257ABD45F13872E0D70A19B82AEF69344 | |
| 1492 | 01F869C42AFE47B8CB550B6EF46B853952EDC511A909B4C8904B4BD121249977 | |
| 1493 | 5785489C28A02A3052D5A122132ED896BF20A5DD0ECFC08C933235FFABF515A5 | |
| 1494 | C7280AF5CFC4C13B6F153AA92EE18301448E410B882FC827343444B8AA88E281 | |
| 1495 | 73C15C38EFAFA3E640DB986A69B0D2D882DD31B2BAFCF09F8AE98F86761557E7 | |
| 1496 | BD3ADDBF480C7571770CB086139CB970FBBB4578923726F492DF82FDE83E4F94 | |
| 1497 | 171BFFB8B11C6B195CF22684A8D5F0D63C57E654F196DEFB51A5DC591FDBEB4E | |
| 1498 | 28310F8317514EB7770041BA2B6172B96E691D4F9F289B2E785058F99C288EA6 | |
| 1499 | 9FAC0E3D8D71EC5F16F1FC1F48962488CDE53B1BA5E57FAF21610326F3CEF7A4 | |
| 1500 | 24B314C4A55AD1C644604EA428830304AA36451AC1FD41F007E0AE84C4DF757A | |
| 1501 | B85F4F91BC123DD926A47161FF996C1EC4A722B912188E626AD7D928526BD12E | |
| 1502 | ED244BE4CFBBB20676C3BECDE1B734085F00B72C32267DCF002B47E6112BE3DB | |
| 1503 | 9A72953B4B34F98B4FC3E80ADD37A8E2D408007745F51F4BDDDA57038755F031 | |
| 1504 | D2B09BE5249A9A2C9BFF225C5C7AE43D97B761501B610891725CE320BF9C7C85 | |
| 1505 | 93C9E9AC2BA6947535BC406ECD989D01728EA41D963A8753DA2A0C9B4D9238EF | |
| 1506 | 826DA874319F994FDE1859E4CC3B17601D1495D1B3500AE1B861C55901D9610A | |
| 1507 | 25078C498AFC38B6C64118EE9837E5C61E03B2E7CDEBFD8B37646D649B1A8E21 | |
| 1508 | B6BA6A8552FFA55102A7F6BF6F8C0A15C66548AB867957728C673DF3221EDE4B | |
| 1509 | 022428A6E829E6CABC7CCA6C1A60700FE68D11C122930FF0D75DF89D89252CCA | |
| 1510 | 692CC02DC52F158E3874A9D030C8EF5B0DCB633B2025C203AE79636E1B2497C1 | |
| 1511 | 51208C4DDAF096885EEC50CDCA1133179227427AB85AF800122A7B7A506BACF1 | |
| 1512 | 6AD4B3954794B5D37F42AD94A93B90846C55E12B8943172C8C4715685D0EB537 | |
| 1513 | 75430F0A6EF94CCE0B6B9D71EA42571E9E26DA0840B0624E1F97FA1548F45FCB | |
| 1514 | FAA189A40844D88D87AE8EA4DE29CD9E7DF322016AAB4A472DA4DE10956E3DBD | |
| 1515 | 5B8E20B8AE941CD8541419FC0E90813FEC3DF42FE4F8A7C67C661F1AC766A278 | |
| 1516 | EABCCEE8F45150E4EF2D6F967E98CC3E1578FC5235C9111AE4ABB028A4E8E683 | |
| 1517 | E39056B5F1CB6E8F5EEBF12BB7DABBA1626D691C4AF07767537462AB6472B6CB | |
| 1518 | A9F4CC1DC29ABC46FBF92908E1C09D21DF40BA8E0D9376449FC64B1F91B13F10 | |
| 1519 | 9A1A484C7361EDC66F7603CB5C00D988E3A34057E2AB21071AA4554D1234D6B3 | |
| 1520 | BF04C440FEE0ECDC5378E34ECFE504D9B917543DEE8D86A1A1AAE111F7870C4E | |
| 1521 | D81D0B277CA333690FB282 | |
| 1522 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1523 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1524 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1525 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1526 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1527 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1528 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1529 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1530 | cleartomark | |
| 1531 | %%EndFont | |
| 1532 | %%BeginFont: CMR8 | |
| 1533 | %!PS-AdobeFont-1.1: CMR8 1.0 | |
| 1534 | %%CreationDate: 1991 Aug 20 16:39:40 | |
| 1535 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 1536 | 11 dict begin | |
| 1537 | /FontInfo 7 dict dup begin | |
| 1538 | /version (1.0) readonly def | |
| 1539 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 1540 | /FullName (CMR8) readonly def | |
| 1541 | /FamilyName (Computer Modern) readonly def | |
| 1542 | /Weight (Medium) readonly def | |
| 1543 | /ItalicAngle 0 def | |
| 1544 | /isFixedPitch false def | |
| 1545 | end readonly def | |
| 1546 | /FontName /CMR8 def | |
| 1547 | /PaintType 0 def | |
| 1548 | /FontType 1 def | |
| 1549 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 1550 | /Encoding 256 array | |
| 1551 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 1552 | dup 0 /.notdef put |
| 37c41ab1 CR |
1553 | readonly def |
| 1554 | /FontBBox{-36 -250 1070 750}readonly def | |
| 28157acd | 1555 | /UniqueID 5000791 def |
| 37c41ab1 CR |
1556 | currentdict end |
| 1557 | currentfile eexec | |
| 1558 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 1559 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 1560 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 1561 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 1562 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 1563 | 2BDBF16FBC7512FAA308A093FE5CF4E9D2405B169CD5365D6ECED5D768D66D6C | |
| 1564 | 68618B8C482B341F8CA38E9BB9BAFCFAAD9C2F3FD033B62690986ED43D9C9361 | |
| 1565 | 3645B82392D5CAE11A7CB49D7E2E82DCD485CBA1772CE422BB1D7283AD675B65 | |
| 1566 | 48A7EA0069A883EC1DAA3E1F9ECE7586D6CF0A128CD557C7E5D7AA3EA97EBAD3 | |
| 1567 | 9619D1BFCF4A6D64768741EDEA0A5B0EFBBF347CDCBE2E03D756967A16B613DB | |
| 1568 | 0FC45FA2A3312E0C46A5FD0466AB097C58FFEEC40601B8395E52775D0AFCD7DB | |
| 1569 | 8AB317333110531E5C44A4CB4B5ACD571A1A60960B15E450948A5EEA14DD330F | |
| 1570 | EA209265DB8E1A1FC80DCD3860323FD26C113B041A88C88A21655878680A4466 | |
| 1571 | FA10403D24BB97152A49B842C180E4D258C9D48F21D057782D90623116830BA3 | |
| 1572 | 9902B3C5F2F2DD01433B0D7099C07DBDE268D0FFED5169BCD03D48B2F058AD62 | |
| 1573 | D8678C626DC7A3F352152C99BA963EF95F8AD11DB8B0D351210A17E4C2C55AD8 | |
| 1574 | 9EB64172935D3C20A398F3EEEEC31551966A7438EF3FEE422C6D4E05337620D5 | |
| 1575 | ACC7B52BED984BFAAD36EF9D20748B05D07BE4414A63975125D272FAD83F76E6 | |
| 1576 | 10FFF8363014BE526D580873C5A42B70FA911EC7B86905F13AFE55EB0273F582 | |
| 1577 | 83158793B8CC296B8DE1DCCF1250FD57CB0E035C7EDA3B0092ED940D37A05493 | |
| 1578 | 2EC54E09B984FCA4AB7D2EA182BCF1263AA244B07EC0EA912A2BCC6CA6105B29 | |
| 1579 | 044005DDBEAF88E0F05541BBD233977A447B469F013D8535A9D7023CC0FB7B49 | |
| 1580 | A95CD2B6F18935C37F49E9A73E97A8602C5C26EE13D7A04A188336FCAB4CDEE0 | |
| 1581 | 23DE9D803FD6E8D846B3F729BD36137E834E016242CD2F7BF048959DD45AD413 | |
| 1582 | 19B985D05E5D422F3D0968375EA6A90FBEBF8B42B15F15280469D69629C08A42 | |
| 1583 | 1C298CC027CC288B9C984239ABB96B6A891C1360D08F9ECC22202861E4CE9B39 | |
| 1584 | 8BF6B05F0B97F8FDED86BDA32D9EE6204BEE321529D58F28F7A9B3D04A4469E2 | |
| 1585 | 775A8B43DF5350CA25E95F1794CEA94B99AA02F3498C608E6277595DFEC6CC7C | |
| 1586 | 965B69856CB2AFCAA52F66F5A019C999A1C79906EADED8AB0A185F84F5FC544F | |
| 1587 | B289E583A8AB4726F9538F4DDEA903CC1E623DC5EC25CD02353A4C9A63CCB7B3 | |
| 1588 | 483A481AD7220714EED8EA179FD74724C7D1F7032527E25A43FB59367B10F3F9 | |
| 1589 | 4BC23E2AD9F5744EB954C8A0086C0ED51450A8EE7DCA2BC27081C4F49FEFCFC0 | |
| 1590 | DE75DFA3E620747E85ED0F66EC590FE6CE40D08497B52B89FDD0EF6B1D4C0A8E | |
| 1591 | FB12E7A909CA56C9A44DAE837CFB4515412DA996C9E3A430D48B20671F04448C | |
| 1592 | 51A14CB5E9B2565D33A0C0992D9456F3272776BAB972E4AD37CD9538F78BE951 | |
| 1593 | 9A5898C0E3F68EBE589967254EC4E10B6010E386ECF44C742D37C64502DCB250 | |
| 1594 | E9CCD2AF341A18836489360B950DAB980CB0621155E647B6DE953A6DB1AF51B1 | |
| 1595 | 31375114FB8E6AC909DF17A7362DA2ADAB0DF9ABF040426957B6264BA0DF2B48 | |
| 1596 | 1AEAD8B9068A3E5A4D85166392CD12ED01738931E5683E83EE999C08C54AD19D | |
| 1597 | FAE794A00EDFFB4F430DFF757CC2163DE77D79C3F0ECDF5D42A1B079729E276B | |
| 1598 | DC2691D6B29EB3C37824D4A5C7A452C10C98E38FBD2437BB29CB8964ECB475F1 | |
| 1599 | 3DF9D1EC2F4723CFC914DF067470AB81C22F69FF0A615F693C0BF7084FF67DE4 | |
| 1600 | 741E765B47E222EFEF6DDCBCC5BB5EA3FE507959AA9CA4FF0CEB615938095738 | |
| 1601 | AE8107FB11FD1C35A85721CAF2FF491E90F4F15B4A8F8CBD72EAC28909FBD231 | |
| 1602 | B0A45D94469D2C03CC351E5C4127CD2334F94A1EE91FAF19DFAD50D49DDCA165 | |
| 1603 | 1CC936EAC431720FEEEC3184C1578EC4E9C6084EF6C6A30A327A455DE14E72F2 | |
| 1604 | 0ADF4A1DC4232577BA25B75DAFA460FC1E018DF361AA3A8874EB6B445F973459 | |
| 1605 | 83E3C1D441BCF8A100C22DD2B94DF2E3EB57C2C792A2C789137911DC67926D62 | |
| 1606 | 2848C29EC41A771243F46D48FC17133E004F9DA9202364E74773A22999E03437 | |
| 1607 | 1D34277B9724E78020DFE394298E990132C6647546B2F95CC2B336C40A335EAE | |
| 1608 | 85E5CE36670AA9E28C37E43AE4D5CDBE11352105A1A23B2B781A88EAE094B83F | |
| 1609 | D9FA26C3F500B5BA7E08758777F11A110679044B09CE57B64D1EA9BD4BCB4E71 | |
| 1610 | E15E27D15A83FC12ACE44971B199C9ECF06F20DBF062B6654DC6E15DAAED262B | |
| 1611 | D645A7B0B9F6A4159201A1650DDD4F74EC78F5EC876A1F58F351BD3AAD7C46B9 | |
| 1612 | 076F73EC8972CE1DA144C78E629FA13B34AF57913B2101A4A236DDF2FCFF1834 | |
| 1613 | 1C24D8360B9D8A24CE3AD889967CDE59D26511EE57B2C06F05AA04788E1231E2 | |
| 1614 | 854E0A2EE1A5CC34B44547D9EBF87FBC6D1B9E0E5C0323D1BC82EE7358F247FF | |
| 1615 | 6EC3C4F7817F405F91B5AA3FAD663BA2F7E28FC7B50427449B942D0A3820D2C1 | |
| 1616 | A10EBEBAB909EC5072E37106156859B98B0EAFAEFB8E13A4EB6A1E004B525C69 | |
| 1617 | DDE72B04661C425A7E03FE440008695D45934CB6192B6A30A5CA8A3FC61D1EA1 | |
| 1618 | CC2E1F17EA42F6A562E063C2E66B90189D123E6570A485D5019BEABD9C39F639 | |
| 1619 | 6601DA48143C88488B0484E823A382172B3133384336F5369928B5161B7AE927 | |
| 1620 | 710CB575FD233FC0908DC203D3B9A8ADAA0F454054BD29B037F3FBE0AB0F5A50 | |
| 1621 | A3B80660E06E62CB7306FE8612909E8DF7A1CB7B39B77524CC7472B3964C7C21 | |
| 1622 | 7F59E69BEB0EFB64AD1F79C38D246CB63F61BB31DAA2BCCEAFBC1F418F2B6DF0 | |
| 1623 | 292B5F8A4763BD8BBAD841D0A08D3145064510D427C5978470067ED239D81F6B | |
| 1624 | 0A10477AC233C934CEA58FA051E7F1D915CCA135A0658BA7736574DEE0887216 | |
| 1625 | CA99343D134715DBD2A5C46B3BD995A4B106DFE5A24347DFE38A14CBBAE8DBF4 | |
| 1626 | F8B7F782BA8FC181C3F8FB1DEC2C706D7DCCCD97EE254FAE1A9FC6B2466C04AF | |
| 1627 | 626E2A59C8B4E96FFF0DDA9872209084296276E54C5E8BB93E043BD9C9A36AED | |
| 1628 | 2C3E82BCBECEEB0C2DE7356F71235D9CF94EFDD4098B0DA80ADEC47ADA99A946 | |
| 1629 | B79DCE7274C6DC92757550B7FBF608886D3196206A3ACAAC643395C000541E5D | |
| 1630 | 19C9EBC62BE7AF3F3F81BBCB0476BE81B2083E8802DF643E0E4A8C873D17BDA3 | |
| 1631 | 76141A6F8C990869A3DCD7AB7F46C701DC92ABDF4AD9F38F01D2005415C1BADA | |
| 1632 | 9832C0888E5926C5344B85F4830C17FC928A585CC745DC25A7CEF3B4D41C6680 | |
| 1633 | 219EAF65CADA5524F5FB1F09343CC28AED8FB7A164C25F9CC5E8FC6180D08D88 | |
| 1634 | 509A93BF0AC28ABF2B9C27D5707C4F0188E843E3E8DC73A58D74B4D88525F699 | |
| 1635 | 5B98C71A6982D6DBB65B105B2D6E65E8171D915D8A1BBD89BB160C96F478D61C | |
| 1636 | EC0FBEEB9AF29705CCD13061097953825DA7354112DD72F1AAF30EBF508A5A02 | |
| 1637 | 6C7680AC7583974BF6A82F4AB9F35260EACEC1C9036C12C88B28B3C2467E4FDD | |
| 1638 | A22FF5FE59355DD4BFD849B5AC6C9F52DC51A3B8A4CD1AA7491E785B0DF81C1E | |
| 1639 | 33B610B2F1B3595C0D82B86789D548A92C20F5177B17C35A961F858D7DF0CE07 | |
| 1640 | CF9A957E2FE826F2C6ACE69A2082EEFD86D932C9C3574160AF7784CFA05C1EB1 | |
| 1641 | A881D7AFEB71668F1DEDA3F8055640E7CB2E7DD23139FDD37373FC6DFEA85C22 | |
| 1642 | B59330D72D6331B8A1D28A9B3D2172A177AE5CF0D22D28A1911F9F3FA700D355 | |
| 1643 | F84230610E2B79A735889C5CC591347AC17F9E65C03C0A1CDA2CEF75CF01D6C7 | |
| 1644 | C6D5F727258F499B09B0A042A97F7ACDDD7B188A5B917E3D7E7A411A0AC84F59 | |
| 1645 | B96A7DC581B81019168C31F7E5F6EB8211F1F44B785391D41E89565385D15D9F | |
| 1646 | 66FB6986A66B2460B4C8229E244A322ED81FEBCA8E2827E4A5E54236E33A788D | |
| 1647 | 0A06625F92AA6347A73A477A6A37292BDBF2DF42D5FDB1027DCBC8E481147AB3 | |
| 1648 | 7779E5EF008A67808490E7904DFC740E38BC185CF0C8F0C9002606D31764AE5D | |
| 1649 | FC5F6E9C330D43ECA95380B988084074E8C268FDFA357F7045B7603DFFC5B0BD | |
| 1650 | 01B257B0A754A14A565FA0D8C89CF7C4C9FB69445ACF7ABEDBEEC24C87E89889 | |
| 1651 | 61DAF3144291D4A8E7ABB3CA95F9E89AE84649419A20ACFE872E8BF81C523626 | |
| 1652 | 6CC14EDFE5565FA25E65290EC272E2DCE660A916D60C07C4C9CFBF539C7B5497 | |
| 1653 | C55F8FA22CC53374F6E07374A73B0F6F68FC0376703B6E73B319312448DD1CB1 | |
| 1654 | 962E16A84A3873A322E7B3C737B42E18D53B02BE9EDB07D21663D0ED6443538A | |
| 1655 | 276EC167D6DE7B94625C6254FB5555DA81B5D6CC92191D15C002F813A73E19A4 | |
| 1656 | A7C63106EB5C5EA7BD9E1FF3D4C3BFB6265C48AB48CC4A3FBA55B0D2D8795D55 | |
| 1657 | 484F3E387BB56602B8C2EC4D04A8E123AD02422D1FA04809A7F2884957E9DAD7 | |
| 1658 | EDE67F91D63FD0D73D89D9BB9126B5DF3C1C09CFC81A7C60CF6463ABA6197D2E | |
| 1659 | CC1E8339E2F5A26569838E66E7024DE8BF50BFFA3F1E6A923D363DAFE4751B48 | |
| 1660 | D5ED2CD68C5C8F248CA0C0A9B9CE506BE17B4044FE73003395274498928E081C | |
| 1661 | 450385B2F2D9FBF91871109F137E52CCA8035C9B30D3419901F342AAB26F874E | |
| 1662 | 449F214DD406C210DCC35EA89E6A0397E5AB4725586EA12B8C10F41D292F9140 | |
| 1663 | 115A57DFF19496AD04C0D9A640F7AA25E9E22A05B23C7A6FBCC115E3DAC7A34E | |
| 1664 | BCE9EC19AE54BCA3A7FEA7AA0C23B24870FBCD9BB15AB17F7002CC33ECD6F0EC | |
| 1665 | 4D43607C98126E7FF7A59EA187F3DEF3B6B1A174926B2D0CED8159B3741C0F67 | |
| 1666 | A16AACD009847CAFAD44B338D2A4F3148D6CA437A8F7709AB4D29EFC4A37C256 | |
| 1667 | 5A3A52282ED1B5114C14045D2A3806C8A7DB6854EF7E158DB4CD6C4F84A46047 | |
| 1668 | 098F6158763C0049A17CFADB12AA198B74E7AB62805556BD9DB8424A1037136B | |
| 1669 | 5AE30853446E67EE01770DC8153A906FC71DE0D8C85B86DDD62E6951B77E1709 | |
| 1670 | 900338A3CB40515E0636185392979B2BE52FEAC763930A99019C675FBFB94041 | |
| 1671 | DC09D119540CE689EF7C3ABA5D62573F6E4559B44F3F8AE1C3D04540525A10F6 | |
| 1672 | 501588CF0897D767C84E00896EE7CEF9FE832E772AFEAC08B1700F8F54056E19 | |
| 1673 | F05D44DA94063E497FA35C720A6EEBB2156BC1D91E68101C366AA5BC68CDC2BF | |
| 1674 | 90CB15EB12AE0F234B370EFC0B4A23C4E503EAF5529A032838C87F51FA806214 | |
| 1675 | 41BF8EDBF22C89F8905D4C8F7260B2269180C6E3127ED31ABD878D74EA7BDE87 | |
| 1676 | F597D440AE923A58AB02D27E349CA7CC043B946D89D81C8AE4264863989AB2AE | |
| 1677 | 5061880897F46E6CF9519548AC8A01431C746C482F4B4C6166788D372CE9C997 | |
| 1678 | E233DF9597857AF04E493EAFCE780FD229D04F4FA02CE51ACF4BD4CE1917F19D | |
| 1679 | 12C4B25B1A3575F0B41317EEA24DE1BEFDB1BC3AFD5F61E512238726E8E3A31A | |
| 1680 | 8B2F3BE79948C8B1B6CA815AEFE34B90DB93B7282C775D1FE88632A41B4FCBD2 | |
| 1681 | A05A9A04968293E79A8FE18892B806179790119BA3FE378B2AC882295A25C7FB | |
| 1682 | 59C0F458CB0FA4B103153A2AA534C24ED96976843EA8B30E30E6DB279426C24F | |
| 1683 | DB7D8ADC3FAEDDE6F204824C5ED8A31E10FA0B8DAD46E1BDC4E80436148D1134 | |
| 1684 | 09D08C56667DE58A1E78DA8103A4E9D6ED7DEACF7561BF0C85039468226296AC | |
| 1685 | 861156CB0F0FF2FEC76D2A32E7E49C48F06A95D61A2FE40F135634BCB99FE538 | |
| 1686 | 1F8492A5CEAC9CD4AC76533C237259E077AF4F1F26B3D1B0EC473CD56D3BAA8B | |
| 1687 | CDDAE26E7CEFBED818C1DD83AB0142EBB928E6FBC0697FD81B7A73B5CA05A16F | |
| 1688 | 11EC2428A8A77674D63707F0C91D78EC64F8D5F648199904AFCB27DFB49FC8B4 | |
| 1689 | CBFC4869BC0A2FCFC7AB259DDF59A941CF4A1D4AD4F451CD7FBDB168FF72038B | |
| 1690 | F1578D89C8F938FF72D408753AD113114460BEB902B7A0EC4F37A6FE3117E4CB | |
| 1691 | 625A664D7FC480E986681C7E3055036ADB8546EAC44B5F12CB4001039A9DE56F | |
| 1692 | A61D523DE1B0F83609E46E38CFE4146049420154A9C7C75622032404970B674D | |
| 1693 | 4F79BC99A5F3F720A45709338E8C6A529257281CC880C8C77CDD0F7E6B495D67 | |
| 1694 | AB139E3DA9CCC3C99306C3CE9B0E53D77B1A009A261B8A22B789BB67934EE7F3 | |
| 1695 | A1CA8C2170082F18903F335085FE5219EB3CD0ED4DC01C9A45426C26046219F5 | |
| 1696 | 3CA60CADB58F6ADE1FEAB848184067C6ABFC365553E20960EDF70DC319FF9574 | |
| 1697 | 654155F8AEFD9864A839EF5E0327291C8784AA2DADD37665FD8A2D70066411CA | |
| 1698 | C88205E79FF0E2C2FEED0661FFD3736A81A26AEF35599A7463B9F036D6B22AF5 | |
| 1699 | A6B0C9254F72BECE010800BB32100A745954D96F9A273D5BAC6658B5433BAA80 | |
| 1700 | 22B18397514F4C3DA8D0AFE9ECF437788CF11071BEDBFA9D5FCE42FB0896FFC9 | |
| 1701 | 629971DF9C78E9C40B065C909971202797E90387D12835DF3D305370094E9B37 | |
| 1702 | 4D294623FD09CFDEE5CA6F75827A69303D30026AB518BE812F021C7B25AAFE70 | |
| 1703 | 6485201252BE6AD4F19F33A18844904890003E57A763FCA21B0744BDEE1473E0 | |
| 1704 | CDD16D4A0A20DDC9B9CCD3E7146C95696FBAD1D1426C6EFF8733219106B56B58 | |
| 1705 | 42DFF423398F878930F85DA3245F6E248E98674144209F1DEFC9BB3D80F4425E | |
| 1706 | F6CF06E89522871DAC2865 | |
| 1707 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1708 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1709 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1710 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1711 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1712 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1713 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1714 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1715 | cleartomark | |
| 1716 | %%EndFont | |
| 1717 | %%BeginFont: CMSY9 | |
| 1718 | %!PS-AdobeFont-1.1: CMSY9 1.0 | |
| 1719 | %%CreationDate: 1991 Aug 15 07:22:27 | |
| 1720 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 1721 | 11 dict begin | |
| 1722 | /FontInfo 7 dict dup begin | |
| 1723 | /version (1.0) readonly def | |
| 1724 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 1725 | /FullName (CMSY9) readonly def | |
| 1726 | /FamilyName (Computer Modern) readonly def | |
| 1727 | /Weight (Medium) readonly def | |
| 1728 | /ItalicAngle -14.035 def | |
| 1729 | /isFixedPitch false def | |
| 1730 | end readonly def | |
| 1731 | /FontName /CMSY9 def | |
| 1732 | /PaintType 0 def | |
| 1733 | /FontType 1 def | |
| 1734 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 1735 | /Encoding 256 array | |
| 1736 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 1737 | dup 0 /.notdef put |
| 37c41ab1 CR |
1738 | readonly def |
| 1739 | /FontBBox{-30 -958 1146 777}readonly def | |
| 28157acd | 1740 | /UniqueID 5000819 def |
| 37c41ab1 CR |
1741 | currentdict end |
| 1742 | currentfile eexec | |
| 1743 | D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 | |
| 1744 | 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 | |
| 1745 | A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 | |
| 1746 | E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A | |
| 1747 | 221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A | |
| 1748 | 27D1663E0B62F461F6E40A5D6676D0037D33F24E2FAC2B0009AD3C8350CDF8CC | |
| 1749 | 65BCA87979C36D14CB552E9A985E48BE4E88ECA16DF418749AF04FDD2B0E1380 | |
| 1750 | D281BB2476BB45FF30946B247DFD7F57305FA87E50CA338121C71CDFDF927A9C | |
| 1751 | 77FF14CB4A1D6D80356FB1171ED38C37702350497B44E42CE31DB2F493807DAA | |
| 1752 | 15B887C671199A54C4C1294BC520F5538C15556BC43C9F62342B121C6DCD6C5F | |
| 1753 | 491DA47FF360201EE21C08A781ED0589A6DF91B99FE118B9B29E4F068672E52F | |
| 1754 | 1A06C514D91C4C937D4E642503392B1CD1BF5AF0BCA28EBD840AD76CC39AD7AA | |
| 1755 | CF2C05711374F7849708E1106F88737C9AA60612D384CA8C173FF1031EBF6EA4 | |
| 1756 | 176136DE1B9F29E40E82680A2CFFDC24DA05853307F1D1F6537D061EBCBCC5AE | |
| 1757 | E6316380ECD8E63ACBEA9FD1FC28949366850AAABCBC9552CAB2CA3BB934C8A2 | |
| 1758 | 14C9DFADE24D9214858B1D42B2171DB18A475AF78868C2549F19555AAB07F586 | |
| 1759 | 58B28541C74E14F28B68DA42A9D46C031CBD74FC09BFEAA3AC1DDC68B7B71B81 | |
| 1760 | 6003C9C6AC8EDDDC046D247A2B8AFA63A3B1BA1F12AE0B4DD07327F0138BF470 | |
| 1761 | 4630E4B5DA55C194F454EE2E872E0ABE6B879DF2E87CF81F75D79F458F7D3F81 | |
| 1762 | FDB76C15EEC4125D18685E1D8591C54C0B0D069E2ED73434617B9D30E64457E6 | |
| 1763 | 1542E4630E848948FF2747D5C31B9C314AE108931003DB9F76644DB43D245499 | |
| 1764 | 2D28E8452E50B1945E13A5DE2A8B93523D3671D1C7ED07EAB6FFB559E5A1F828 | |
| 1765 | B22D2FAF349B40C3B31FE806595F67C5E75260514F456FA0013668D948619514 | |
| 1766 | 0EFFC35C1AA131AF8578A254AE62CA75A6631489C78CCE633A3B302BFACB | |
| 1767 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1768 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1769 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1770 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1771 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1772 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1773 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1774 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1775 | cleartomark | |
| 1776 | %%EndFont | |
| 1777 | %%BeginFont: CMCSC10 | |
| 1778 | %!PS-AdobeFont-1.1: CMCSC10 1.0 | |
| 1779 | %%CreationDate: 1991 Aug 18 17:46:49 | |
| 1780 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 1781 | 11 dict begin | |
| 1782 | /FontInfo 7 dict dup begin | |
| 1783 | /version (1.0) readonly def | |
| 1784 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 1785 | /FullName (CMCSC10) readonly def | |
| 1786 | /FamilyName (Computer Modern) readonly def | |
| 1787 | /Weight (Medium) readonly def | |
| 1788 | /ItalicAngle 0 def | |
| 1789 | /isFixedPitch false def | |
| 1790 | end readonly def | |
| 1791 | /FontName /CMCSC10 def | |
| 1792 | /PaintType 0 def | |
| 1793 | /FontType 1 def | |
| 1794 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 1795 | /Encoding 256 array | |
| 1796 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 1797 | dup 0 /.notdef put |
| 37c41ab1 CR |
1798 | readonly def |
| 1799 | /FontBBox{14 -250 1077 750}readonly def | |
| 28157acd | 1800 | /UniqueID 5000772 def |
| 37c41ab1 CR |
1801 | currentdict end |
| 1802 | currentfile eexec | |
| 1803 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
| 1804 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
| 1805 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
| 1806 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
| 1807 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
| 1808 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A30EB76029337 | |
| 1809 | 900ECFB1390CA5C0C3A04528044F266BA17BE487C79B94FAC6D6484684C5BFEA | |
| 1810 | 87BCCC77D40AD11552035E95E3007126418ED49B68468B38A14E88E68A267B98 | |
| 1811 | 076F1C9769A5AFBC285E5B158EAC9F926F1D6C0B8F1D57D9C31D25AE27123518 | |
| 1812 | 9D2CD92E5689E0213089BD268DA5E47525CB8EABAA4B78A15AEA34705889AB3A | |
| 1813 | FFB8953B5B3482E52BFA0940630ADF8C0AC2177D907324299EE980E850F203CD | |
| 1814 | B627962F43D5A678C44243CDE97853BDC6AB45FD5C09AD274DAF89929F583CC9 | |
| 1815 | CCC24BDFC68B92111055ABA5F26D2DC67C70906F71C2957701D65AE746A60C30 | |
| 1816 | 40E6CB24B97FCDAD0487AE38A201FBF0E41BABD2181981A71940F1E707F91E5D | |
| 1817 | C8CA50CB16D8702D188E56D014D92F76CE0B52ABDB9110E32438D2BBF3E6A40B | |
| 1818 | 7B005F10BB437812CAC6ED2996F7606DC962C4FDE207FF322782C343DF44CEC5 | |
| 1819 | FF06A55C630C20E9AE1B0D1C5673753C43BA0767D65D1B451CC6380D8BB3C4DC | |
| 1820 | 81E8FD8AA79BE993218686F29D3CD925566DD587F541A0DA1B1CC3BCEA2E6C7D | |
| 1821 | 5E1016F6917A871F1BBAD96AF9E867735017119A381FCF33EB2D3E1E7093FD90 | |
| 1822 | CDB0CED4818CFD9E201A03430CEC713620BE0D3254158931FB657C6AD4B2482A | |
| 1823 | 0E7D070D7497892E9E942DF58E88CAF0C8221BF36BF7C435BF2C683A4A2EF4CB | |
| 1824 | E85820A8AD3486155A40143011BA9D76297F46DEF69ECA4596D6E4CAABF84091 | |
| 1825 | 22A96A4BC78A8DD072FEB759A68A44BE1164638B6D952147EE3C628F9A022060 | |
| 1826 | 1D1941E73310943FA782532ABB1116532AD67AEFE0758C051241E301C7E13A98 | |
| 1827 | 6447EB0180BF6799814BEA4DC0F727D0A40B7BC3B1269CDE174453D6A3C4479C | |
| 1828 | 146001CF717DE25AC1BE5AEA5F2F1C17719251C429D3AED19EFB5F708A36D89A | |
| 1829 | 354AAEB20A954E4FB9682D9D227FAEFB5CD1388867E0860EBB0E279ACE74934E | |
| 1830 | 3D12254656E004266D501B9DE05E7FAB380E4B69467E641D0857F13BABA4A940 | |
| 1831 | 02BD22D63B9600A7FC571C1A3AFF39B9DF9F0DD9F396497CFDD52BFACB8CCDF9 | |
| 1832 | FF9277FBE2D32303E4B3CAD99F79A7F45618B900CFD718F9AC9FCC77058D9486 | |
| 1833 | 97FC192847B08CAC407B89801CE23E7D54AF9DCCD0320CB64BA0B3E41079316F | |
| 1834 | 19B5A779D0BEC5FD5763BEF31035BD24BCCC838444B60BB1EFC43921BDC2DFDF | |
| 1835 | C3CECA21CC24C1C7C3CF17D2565DA4EBC9EE79001A286A1D0E0E8F48E4FA44DE | |
| 1836 | 5DAEC3E84B688D4235E35D78264A9CC83AED6DDD0E4591102EDCE85F2FBB474D | |
| 1837 | CB049179585556D6948D6F720F88853586A768547C085FD2DAFA1B4C986CB4C3 | |
| 1838 | A92B580C149EE31212E1A0EC36D1830FDDE4F19FB39C2F64586C292AF3BFBED3 | |
| 1839 | 6E3E8DD85124644B874A723D6E9544A3E56BACE9D8A0CDE0CFB0C334258D6A71 | |
| 1840 | F3A580D03195D0B2B72D92B4EFAB8F8151564C2E86CDDEA43546DCCF1DE7EDC6 | |
| 1841 | FD8123D17D3DC8A7805395A556CDB49FEFE2136DB8C62B163C37FF258FF675D6 | |
| 1842 | 2D9C7841F7F1FF81389F85DF6382DE676B524F3956216CFECC417767DA7F55E2 | |
| 1843 | 8470E949ADB93BE1E12B281532463BB4CE03C47EECE8D6C4AA13BFCD1C7313F7 | |
| 1844 | B626AB03395711F8EE5880A5C452E6A0DC1F25285E9C41044CE657AA0BFF7240 | |
| 1845 | BD162FBC9523073CAAA4790293305910CB07AC00893F35FDC0F0536C84A8D184 | |
| 1846 | E85542A95786168E1477DFF426E56E03028F3209A56995A842118ED577AA7A2C | |
| 1847 | 735B6808DFEECF65D37E6B7998909F23A9B39E575963B07CF93D47FFFDA47EB6 | |
| 1848 | 8F8EA091835E8293F2DE1C42668A16608AF3F3B2C53222A727A68327ABDC1270 | |
| 1849 | E98ABEAFC84434D8265697A16A55A735F77EEBF682F1C4A5DE01E042187E3845 | |
| 1850 | 987EB0027B14F7C0EF6C9C5A346ECD3417E381F3FF97AD21907D0DC835E6D976 | |
| 1851 | 990047FA51AD8DAEE9A86381D60B8A60244604701A782FA90D24C34502636353 | |
| 1852 | 2A2C507E189F1D1ED2B4E2EAA426A236C200208B43C765F680AA8F31CFC57992 | |
| 1853 | 4BA5003418EF6A81B2770DEC775C05F1CD948A39C3F5FA49D710151DA9AC22FE | |
| 1854 | 2E68640D5A47F5B4416F0F52279D1B87C563C95639B4AA9AD4D403FB48632824 | |
| 1855 | 4AFCAF43318E8E61D68B67F207DFB322ADBF72C805F09ED0505212F64A6185EF | |
| 1856 | 625F9BBA2126013E181577EB5B4C5A395B98871DAB1164572FDA647DB840ECBB | |
| 1857 | B119758B52CD0151D12D12EBB5E3AABD05AAA33CFB30BB47F7C4DA5963CE2718 | |
| 1858 | 4EF6272DC76784551C91B62BA293AD0FF335CB2BB8577A957CAFE7E3A91EEAD6 | |
| 1859 | E3EDD75B5A2BF62FA89A87814F1025344029BB7EF08D1227A6139EFFC9DFB5A9 | |
| 1860 | F17EB228E3A0CEB99FF9DFEDABEFE69BBEAF6C796F976595FCDA62CB0DF03A1D | |
| 1861 | 2F7D4A307DD6834159ED84EF35D9C2B8DB908469E146640B7499B7B17E3209DF | |
| 1862 | BFD574F6537287CAAF629AA021A784ECF4751940D231A6832C520318266248BA | |
| 1863 | 0D2EEBCA5CCC8AC81707E6F35424FF58D5B4828B71D5A59480A2502CD71D5620 | |
| 1864 | 05BBE8D046E1E00F6E726CDC38E0788584646D710EA033E917CC3686DD133B07 | |
| 1865 | 4FB8A343C20F11FBD21A93A3DB65383872BEAC848834D03F0217183DF50E3916 | |
| 1866 | AB7B68238C23848CFC7D345FC4C70AC15CCC3433592AE028C8424E539826AC0A | |
| 1867 | 83E3AA79AE231B447D6DCE32B074B5611EADE8C152F93B571154DB9213E6F6B6 | |
| 1868 | EAE38C9B2971C8313D15C953CBB7A37F5BA658306AACC6FD3AE4A3D0B1110507 | |
| 1869 | 0854DBB4FAD36BDEDF0ADA15108D9B6F7F61A10A9AD25E87F84A04989551B306 | |
| 1870 | 8C393AAE446F7CB06CB19B9D805DE0C52C70869CAB832F04F3E92E094031E553 | |
| 1871 | 5B8679720C774280F66B56DD63D9EE47371EA55817C4F66BA651C473C27A5F2E | |
| 1872 | 1675547F0B8861A42CD2ADBB8BC778156B5E139A611CE0A17140B72FFB99EF64 | |
| 1873 | D805E4C477C0EB42A59331D1E7020FCBEFB1B8753CC8DB27509E886EEBBB99C0 | |
| 1874 | 937E7CC06C3F42613612CF874263BE46DA67355ED0ACAC9A1DB02C5934562EEF | |
| 1875 | D6B30388D057D4488C4B77B3E04140C48966DCDD773BA08661710D19813A7887 | |
| 1876 | 6735A595B2D10D4CA14A807120A43B09DC8855B0EC0749F3532002801F45BE01 | |
| 1877 | 3ACA592F545511E6A889833BCB595D94CCC0905C4E298BF2D1BA59B1CF7BBCC9 | |
| 1878 | 832827A0FA9505B6D468F73DBFC63CF5188A5E2C1291C7666BF88A82FFF54275 | |
| 1879 | BA9AC8F7A3EE9469FB4D5271750D4AF3FC0BFF55A5F8DD60AD8745822B98495C | |
| 1880 | 2843A39D4FFF1760C2C7F066A760B2D44EA0D36BFC8171EB791126BC3E3575F1 | |
| 1881 | 7194B6A35677519DBEE369390AAFDBCF8C867BFEDE73AD82F90D2F641A9A4016 | |
| 1882 | C24294F7302D00AF096FD25D8ED6D779D3A1D65F7BA72D9F88BCAC873AA8F3C6 | |
| 1883 | BB9F693671D2C1E75F57C379604972E32DEE03D3709F7B1E2A71775EB003C9B8 | |
| 1884 | 7DD49825CC31AA66E5573863B2975826C19B8A6BF57B8D2E47F33FAC2E3C23E1 | |
| 1885 | 22946FC2FECF4B38E11F79B9C82EF395BE97E699470836C5FA2F4953C6BE47FD | |
| 1886 | E8062B48E429629C765EFCEE6CB7DD1D6F58D37E57A8FC521CABE705C7CA7417 | |
| 1887 | 41D0224C9C3D4210101B65ECF0EB4795B03C2ABC4504C09E9ECF74114B39D1BC | |
| 1888 | 8E83B1D818A5A89886071A14D57DAAEDD70540952F0C649452A42F6626C0C1DA | |
| 1889 | 165CE8233F8D318BE73E0F5E1CDBCD62C4BBFAF01A152372BBDF03D4F5950969 | |
| 1890 | BAE25148A8EF0BA62C20D9500F98697B6D3474B5E5F82AB1C260D52F78CBE06E | |
| 1891 | D487AC6E916929C5D35BFF07447608DF3C31296551245DE0A3F539C0BEBF5EFF | |
| 1892 | 3686859A904A688FCEE6E2770DB0209B52BC1260B4B0953665572E53FBA56545 | |
| 1893 | 263D697F6D0EE366972A66D481FDE9B5B760A749D9CEE1477A263BDE7163F785 | |
| 1894 | 12E5E52AEAAFB6A05AA3A9412E623AFF76DA062BC8768DCD745FD0B4BC618104 | |
| 1895 | C4FD4CE144C19D032CED19B8F0A0DA3CC45B2315EA918AC2580BFD08269F1A49 | |
| 1896 | 12DD707B3EBAC19D2593C43CBA8937708BE239D569415E55F885384032B30D95 | |
| 1897 | 1294463865AC6E40EF853BACA42E65F2E8718FC747FFE9633F614B9CE0A47CB7 | |
| 1898 | 8F22A5EC845BFBC50F822319D4CD604CC4A74A2649B2B3B67CB5D79F93C9DFBF | |
| 1899 | 457049066E8A4F3A7DC08593FA16FAF7AB4D8DEE6DAA41DE801BDE5A295CDBCE | |
| 1900 | 177EA270FC3C77914CD71BC4C508943B00CF8CCE983809DF50BECD29382C1BB4 | |
| 1901 | CAD8D737A88F25C0B9BACD9403A5699166DE2DF733BCA2B7A5C6220466B2649D | |
| 1902 | 46F72A5B9220DE95F19ADD3A5B4588AB50FD5BB335F89FFF1738C8A4E8592E9D | |
| 1903 | 5BD54974C2F5F5449C2100FC239466021C5AD8ACF6F07C9C6B01060CEC83FBE5 | |
| 1904 | 091CCD6B39BEB888015A349245FDE839454038D30A8F800588535A2FCEF762F1 | |
| 1905 | F90AB562F287030CD4B5D946AA3E78EBA4C852D5AE9205E67401B012F257A72C | |
| 1906 | 2296AB4606F43EF8B1ACB295BFC33F3ADEA31DDD57D6B4A0C133F0F200DEA2D3 | |
| 1907 | E4126CB9104194E6617A15E1796A14598F3A71EEFFF09EE3DE6EE31FCCAC8C73 | |
| 1908 | 5EE4782DA3CEDCC41EB50C9E12269BE8CD955C55261931E63F3E5B521EE9F6DB | |
| 1909 | 83B0F15E7DB784734E76B21424497B72646245B705BCE06988FD09A65FC7A09A | |
| 1910 | 27DDB98733BF0D7C56331EE45E9507923BC85F4B72053C2548604ADD163E28BD | |
| 1911 | 00EFB6D761342A3BE08CAFEF79F21E5E2949AB810133A394609923C920D44E10 | |
| 1912 | F605E5D90BF5183CB14536FEAFF86475E0605AC83CA928201ED1E5D8C5AF6AE8 | |
| 1913 | C7C3FC31C213633EFFFC133CBD012B6DC15A49D6D9FC0456BEB04FD8BB2CC10F | |
| 1914 | 29A93B34FEDAAF618DB52B2993E7EA0897B4A8E5729D0906FEA1F244100E53AC | |
| 1915 | 70EAFF565BA48199A29705D8D41DF7F1A7382D11616ECE63B1F1343209404B00 | |
| 1916 | 6705E0ACA23888F0E5A183AD39F812CA47B7C6EA888B302764D7817260744D5A | |
| 1917 | CBD64E7741D914DBCB538200B8F2DB8332C1CECC251C4A5A3F64D30569000DFE | |
| 1918 | A5870E1697576F04F2C887B3E406A99E525D50FA1EF50048FA427B62953ED05D | |
| 1919 | DF8CD3817D3DDA730622EB3E00A098B84F1E09734ED33DB4E2D0E1692DB61A2D | |
| 1920 | 3FAD2FDC0ADA0251D32517E08F0E74FBAAF407A35DB779995C8B5552696065AA | |
| 1921 | E4A0789023826E290408D0B871309C665C6CD1645E4039F7F63D1FE9FA5740B8 | |
| 1922 | D590F177E0381832A300C22CCD9E91E7A93F40B0F5953E40F0CF021FCD5DA3F1 | |
| 1923 | 444B6E8D2E0EC54C49E083806CD5743ED134E97F525BB9F77942688A7820FCC9 | |
| 1924 | 335AAD4E6C71F201B5CF7E1D7C8156F2D2C26D51675C7A164F8C5F8BC0BAD163 | |
| 1925 | 3009C8647860B4F760396872D61C8ACB542AD323EB06546B781D9D6681D0AB8F | |
| 1926 | 9D340526B5062A4CD4FC09425D4338DADF27DD627D25E300ED19D37B14BF4413 | |
| 1927 | 63E6E6F6DC32C593EA549B7A8877312E4498D93F13F1280071546DAA3264589F | |
| 1928 | A724E78CB69BC18A4C95D987E5264847D55F4BC4EA50220D73C1799D849FC874 | |
| 1929 | FBCA9C2FE0E4AC60AD37B569FFA06A12D4ABFAD51FC492E1353150BDA27BC49C | |
| 1930 | 791492C6D340C9BB73FCDC6A30655474D22E25845143E8DE4327765874FA7BBD | |
| 1931 | 7E09AC46D9EF1FCAEAB13FEC348EB2819DE9F7395B5B98EC1EE1EE1E14E0E28F | |
| 1932 | 9FB50D0908738B115941BF6A1550D64D7E88390C1E184089638BF40053685A1A | |
| 1933 | 19B7F1AE7AC99C4D58119B957F3E465674A5654AFA70EEBAB7B0B2D6D7DBD979 | |
| 1934 | 6EE804BC93B9465D453E97617A4166B14831FB9249395A9C1496D51E086B2943 | |
| 1935 | E32CF0283A4E99D0D2907545D17E7F023EC829527F389374FA1A28E068B4014D | |
| 1936 | D0353CC5EBA3603B41993B3ABF2A9EDA80E30CEB08EF43DB69B70D80E9175F1D | |
| 1937 | FA17A21172CA272B7E2FA169530C6F6D9E4B7DC99B0D60686C9905B627531100 | |
| 1938 | B2D49835AC49F002A9E481B62ABE97A4D9487A7F4DF4DC87FFED30809A855486 | |
| 1939 | 89E50FDD6D9AF814F74B5A2FA2940DBFE394C573B5150CC5B2BF3FBC787C7217 | |
| 1940 | 00C26BC6F88B5B4B2EC52BF5A6F3E24003A3A59B901FEBAB824BE07F958AB71C | |
| 1941 | E61D639EAB084E31FF721B4E17DEEB0E8A0E14E13ACA8BEFE2 | |
| 1942 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1943 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1944 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1945 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1946 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1947 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1948 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1949 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 1950 | cleartomark | |
| 1951 | %%EndFont | |
| 1952 | %%BeginFont: CMBX12 | |
| 1953 | %!PS-AdobeFont-1.1: CMBX12 1.0 | |
| 1954 | %%CreationDate: 1991 Aug 20 16:34:54 | |
| 1955 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 1956 | 11 dict begin | |
| 1957 | /FontInfo 7 dict dup begin | |
| 1958 | /version (1.0) readonly def | |
| 1959 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 1960 | /FullName (CMBX12) readonly def | |
| 1961 | /FamilyName (Computer Modern) readonly def | |
| 1962 | /Weight (Bold) readonly def | |
| 1963 | /ItalicAngle 0 def | |
| 1964 | /isFixedPitch false def | |
| 1965 | end readonly def | |
| 1966 | /FontName /CMBX12 def | |
| 1967 | /PaintType 0 def | |
| 1968 | /FontType 1 def | |
| 1969 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 1970 | /Encoding 256 array | |
| 1971 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 1972 | dup 0 /.notdef put |
| 37c41ab1 CR |
1973 | readonly def |
| 1974 | /FontBBox{-53 -251 1139 750}readonly def | |
| 28157acd | 1975 | /UniqueID 5000769 def |
| 37c41ab1 CR |
1976 | currentdict end |
| 1977 | currentfile eexec | |
| 1978 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 1979 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 1980 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 1981 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 1982 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 1983 | 2BDBF16FBC7512FAA308A093FE5F0364CD5660F74BEE96790DE35AFA90CCF712 | |
| 1984 | B1805DA88AE375A04D99598EADFC625BDC1F9C315B6CF28C9BD427F32C745C99 | |
| 1985 | AEBE70DAAED49EA45AF94F081934AA47894A370D698ABABDA4215500B190AF26 | |
| 1986 | 7FCFB7DDA2BC68605A4EF61ECCA3D61C684B47FFB5887A3BEDE0B4D30E8EBABF | |
| 1987 | 20980C23312618EB0EAF289B2924FF4A334B85D98FD68545FDADB47F991E7390 | |
| 1988 | B10EE86A46A5AF8866C010225024D5E5862D49DEB5D8ECCB95D94283C50A363D | |
| 1989 | 68A49071445610F03CE3600945118A6BC0B3AA4593104E727261C68C4A47F809 | |
| 1990 | D77E4CF27B3681F6B6F3AC498E45361BF9E01FAF5527F5E3CC790D3084674B3E | |
| 1991 | 26296F3E03321B5C555D2458578A89E72D3166A3C5D740B3ABB127CF420C316D | |
| 1992 | F957873DA04CF0DB25A73574A4DE2E4F2D5D4E8E0B430654CF7F341A1BDB3E26 | |
| 1993 | 77C194764EAD58C585F49EF10843FE020F9FDFD9008D660DE50B9BD7A2A87299 | |
| 1994 | BC319E66D781101BB956E30643A19B93C8967E1AE4719F300BFE5866F0D6DA5E | |
| 1995 | C55E171A24D3B707EFA325D47F473764E99BC8B1108D815CF2ACADFA6C4663E8 | |
| 1996 | 30855D673CE98AB78F5F829F7FA226AB57F07B3E7D4E7CE30ED3B7EB0D3035C5 | |
| 1997 | 148DA8D9FA34483414FDA8E3DC9E6C479E3EEE9A11A0547FC9085FA4631AD19C | |
| 1998 | E936E0598E3197207FA7BB6E55CFD5EF72AEC12D9A9675241C7A71316B2E148D | |
| 1999 | E2A1732B3627109EA446CB320EBBE2E78281CDF0890E2E72B6711335857F1E23 | |
| 2000 | 337C75E729701E93D5BEC0630CDC7F4E957233EC09F917E5CA703C7E93841598 | |
| 2001 | 0E73843FC6619DE017C8473A6D1B2BE5142DEBA285B98FA1CC5E64D2ADB981E6 | |
| 2002 | 472971848451A245DDF6AA3B8225E9AC8E4630B0FF32D679EC27ACAD85C6394E | |
| 2003 | A6F71023B660EE883D8B676837E9EBA4E42BA8F365433A900F1DC3A9F0E88A26 | |
| 2004 | 31B84248049A4C7D49ACFC81E3E4FEF5F69FA691073C34351C95E8BACB6C51F1 | |
| 2005 | F0A239823BF97F518E4B04A7F85F0AC7C6BE40E6FBCA328F96D0F9D9AC3C2A53 | |
| 2006 | F5781366C50469C5386935E833FC248D8260AD6F72D2F2D3688E9A94F87E5F62 | |
| 2007 | 5DD3358365F85FBE367FA2769C7EAD5EC9BEF5292B14ADDC9683E8CFD76FDECB | |
| 2008 | CB72CC020BF223B29FF3A9538B04C9B9403B01CE4DE99EF7B0CCDDCDAA7AC5AA | |
| 2009 | 8D7BFA69A836CFE988DDEF001303F7D58DD7E193171F7E9A23ADCB244AEDA2F9 | |
| 2010 | 642CBF8FDD62F6E91B80825292EDDDCD7496624B6C1D381A61E8C1AA0A00DC0F | |
| 2011 | 2280242088F24D4129B4CF1320A2989A08765AC390CA76720FA030743CAD6846 | |
| 2012 | F6E8789A5E3E96940C65CF0C9677DA1EA3162B71E99B770228070BB9A660909C | |
| 2013 | 47F380B10F7DD5AB2BC23044B4175164A88BA16451EF494E5A1902F43E9FAFFC | |
| 2014 | 3A60286E5561E16780F2115B85685E797E63731011E10EE1D64C148F65873F06 | |
| 2015 | 5DB9C32ADFCA9342F4A18E85BB905DD4AC45AA56B38EAFE3F1C9D17D689D8B0E | |
| 2016 | C6E91A7D42EE6BF82651E7BDB46BD65BFA57BE8E0A797E97BC1DECF2EA2DDAC3 | |
| 2017 | CA6164F5AE380D6B2A23B5DE1B97C91D29E535A2274BBFCACFC10C12E554D0C4 | |
| 2018 | EB97C43A3C752B5393154E9865685D33439FDDDC258860296047026EBF689762 | |
| 2019 | A1067296C711A03086D178FEC65A2FB0BE917ACA96321BBBFA8458EFA0E14A4C | |
| 2020 | 85AEB8EF6597D75D5BCCD1B0935DC1AFFB755BE6106162EFB60676735BE64564 | |
| 2021 | B5DDDAA7C26ECE1690A043F2754103FA3F81E29DA762BFB50D4A3F3C8BB419FF | |
| 2022 | E9317E01EF54AF28B4F875896C7B8196A95707DC79F1C3538D4F162260AFCD90 | |
| 2023 | 61A3967C99F6F780646B5B2A97DD6649CACB141F76E10EFD1A7A9DE0D76705A5 | |
| 2024 | AB7155D73ADEE46D19B6A7CFC58F614678D999A23C31E1C86CDBF7017DB90531 | |
| 2025 | C14ACA1F11A9FEDD6C0AE413C7DD478AD99E7CEFF7785DD631552FACE5B0B428 | |
| 2026 | 5781E221364CCDEAA1AB3486990515939A9EDB065282DA4C5A837C81CDE67A52 | |
| 2027 | 97FA3936E332AD57319A0DCF95DD083934855AB5CC535EA4E9D9DAE662F7BB0A | |
| 2028 | 6D45FBE3072DB42C1D27BC8DB5257FEB94D5CC9E7B944C1AE3F4B7322182690C | |
| 2029 | 9541CA08810032516B71FA614EC6823210DF837B551624862C9D4A1A863500A2 | |
| 2030 | A913E18C4298DB9EA02BDC2BACA79F0B57897AF2E486CDBEBE200FA42B0C2213 | |
| 2031 | E577843CC8090A89B416F8D09827C62EA1756C82BCFDB38A7888DD1866DF0EB8 | |
| 2032 | E45701027A28440A6DBADD0D1158BFB645F23DCF66205A14175E31281B1E5CE6 | |
| 2033 | 7BDAD0C786B0782E76044594F693B3546D0D807168833ACAFD06DC4B8CB05496 | |
| 2034 | D8041FD42795FE58DC25E5C14E78FFFEDE3B48BA53C008C1FC1723551B65BAC9 | |
| 2035 | 155B82AA53A9475D2B62954504DFEDB3DB0A8912313978CDAA587619F64BB9BE | |
| 2036 | C99872DA229A8D5A282A92148A68DBEA0DA4B2F0A08D2A00F6BC04F793968D0B | |
| 2037 | 7CB56E8AD3ABB9AB57A514A170F16EDA92F8176DE7CB42C4F23E504DFCAD2B20 | |
| 2038 | 2ED5863AAF337A28DAF9FFDAF578C029EE69B0A030CD6134DAEC4C0E71BB0851 | |
| 2039 | E7753AE655AEA168919C087038417510DAF6C48C31886A2674E2487C2E226B99 | |
| 2040 | 585FB5225A704EAF95B54E688080E863FB94407DDBBDF259620A9BD9073640C5 | |
| 2041 | ADBF23A33F705B852365912A262A40CB57FF109A87AF25466AE93C957DA63E5E | |
| 2042 | 6DC474A4DAABBD9337A852206C50B645D28AC81A9F1848425DFCF6A10702F23A | |
| 2043 | 1CDA1F43EFF11578D55C1380AA9DE2B0CB7BDCE13C78966FC614FBA1BF4F64F5 | |
| 2044 | 4B38ABC7919DA46D084DE5A435F006F127F3D1B232089ADA7B1705E03D727BA0 | |
| 2045 | 0F8BCB53E985AEF73B9D68B3DE0B1CD36E566072AF21BDE7D991E090D02E3239 | |
| 2046 | E1E389F9F799BD17C453F0885D74FB9CA04E6DB6BE1EC840F8C1E7C117199177 | |
| 2047 | A8BD4361E733E53210D3FD7B71825563EDA0D99153F1A81174D5850704559972 | |
| 2048 | 60D67F2A11FF9403C64D9F58F30C2A0E89C96281F8395E26B12C6EA61FEBFE63 | |
| 2049 | 737F0A33D7E37E3DCD245043BA1522729C6DBD5D78B2C8C58FA5BA77BFABCAE1 | |
| 2050 | AAE7C36E70FFA3E83A906E8E63CF6F331499964299443B9C5F0EFB91DC4E675C | |
| 2051 | 5784DBA5413F3DE861903D970018AC64CCB010133F2EFA4821ACD4474715F057 | |
| 2052 | 6FA8565AAD50B9F19F8DBB6E3AC72E1906423AB35A93D56E34CFD5F3B5863571 | |
| 2053 | F654EA6D67B299A48185EE5DA4F873932B39C23F57764ED19EBBA923A51A2C6C | |
| 2054 | 5CD7A59477341ABB5B5F21115D1774500B930AD6CD07638047F45A2AD8FFBA36 | |
| 2055 | 05C5CB6B7B97F88404462CC50EC5A75676E8F91E7D42C4DB59AA74E24848DFFE | |
| 2056 | B556A249D8E3D23137B60D9E8FE2A9641AF959A216C57A825B811C6E7522C443 | |
| 2057 | 69B8FA6395F7F3C628A3CA99FC5D8689C95E35EDD6B271F3FEED9D184F0B3AFA | |
| 2058 | 8A7B6100E336589BDD6FBD03B782E36D809A64E9A94F5E9B3C9E7822D24D46D8 | |
| 2059 | 515CBAFB830CE3F1923F6156E29AD479301470DB9A9180FA7381C4A09E9D1ADB | |
| 2060 | 51DA817559A37DE2615DF1AA2DD6B8C4BB1C9B27723DDE22C116B4E43ACE5463 | |
| 2061 | 71C4B79C1729EBF6F1ACABB12A3F596817827589E67879ED40DF7DDD403D45AA | |
| 2062 | 021B11B11859CD7ED42A6C6F15021E04508C2CBF94CDA637A75ACB47D3A249B3 | |
| 2063 | 31DC550B331B22CE2191850799B2E0AF443ABB788CC6297929AF3D3BC9405C8F | |
| 2064 | 2433C4BF18C250C2C15C442C10C119F543C101F60FEF1EE0F9558A8E2F6035B0 | |
| 2065 | C5789E9248D846D2ECD3EC4E790A79D2817F5E612833FCDC360C6902F176E130 | |
| 2066 | E70FC6E15E07ABF4FD6BE5F3EE3BD4A48DD38256706C25BF0E6D9A7C51DC80BA | |
| 2067 | 72BC5F5243C1B49E3D75455BEA13195C093C47AAC6ED3EABFFA674F9E66207EB | |
| 2068 | 98571BAA8C06389AD5402730DA846CDD6040CA84E0F27A65D1194D916A835275 | |
| 2069 | 4E99D6F6084F8EB0E34940F47C4D8700E1B46AAD46EE464D4E10C4E1259D2208 | |
| 2070 | 70D0EB1661EE28B7FBA067BAF8067480793B37D4C881678B2612531E87BC7243 | |
| 2071 | 0AC0B8A4B816F1670443C0A3E4FD631EB8B48DF3D4A03D9690408986E98F227E | |
| 2072 | 05253E9BCCB8C61AA0B4E352B6B76FD9D785AC8823A4FBCEBD4574182D86382F | |
| 2073 | 6CF90EE394506B1043FC4137E9FBE5D471F605E34B59AB3822ACF3B71730A79D | |
| 2074 | 802486209B66D4AF6BCB7821CE4BBC447F66B35ED8BC949A935C335B9F61646B | |
| 2075 | AED373E141AEFCC868D068C2D133AC284885829718513ED5328EDF5230C38399 | |
| 2076 | F97CE6F55004A89D21937914FC9CDEABC3837A63B658C1F96E1F6474420916CB | |
| 2077 | 3197C6F107159EC20D34E13A8698BB04E9E8BBB59993776DA701148447D07F19 | |
| 2078 | 2E8FFF1160E89A82D07D58C7DFC3B71EEBF7A9E958572BAAC093568F5BA7C0BD | |
| 2079 | B118994D1A3A9F60CC96A1A996D369E7FC684244C07C3461C932ABF4C266B7A3 | |
| 2080 | 239D80C79F603449A0145D88AB24A4DD8B2D82F315AF8F05904EF22F09331D9E | |
| 2081 | D6340306D266B4283E919117D283918BF0B4D944BD0B7990DEA8859A690F011C | |
| 2082 | 7C6843BFEFC9329CAE786F102EF0CF8A2D70050B264BF0D824E1647191D1AC13 | |
| 2083 | C23E7F53BA73E1B3636C50BC33E2F8D0631C3A76789304A52DC48AB4BD9D6C9C | |
| 2084 | 51D64DCF77AD95EFA09415A64B346B32D4189A9922B9514A26AD918667CE94DB | |
| 2085 | A631AAA4EABD64C71E9E954A40A16A66CC50F444350FBB77C1BF49868E2DF59F | |
| 2086 | 5EEBB30170DD95B0D8D7530E3B613B70337239A47C582AB7E3E0EA6C6C908B16 | |
| 2087 | 5E89F0969A57D2AB5429DE5CABF2158AD4DDEBA86000C37DA9D859BA60A6A4B0 | |
| 2088 | EC7C29E0B6E01D174EC741BD5989B5BE020C843A86ADCD2D6BA02CB524140D80 | |
| 2089 | 97FFC7AA43CD5ED3B6A4E7D4D90F3244A71598955428E310D2263394B807FF04 | |
| 2090 | E102DD0203FC79B002D2458B4E29AEEB42CB757197316ECA9A21D5E8D0F1CA74 | |
| 2091 | 1B52DFB5FDC9EE0764E5A2F2CA7307050D13DFAA548514374CE8BFFFE8109F57 | |
| 2092 | 638DD8BFCA8F51079D9ED3621A6AE9CAF4BC163F79E283BC7D52E215E73B896E | |
| 2093 | 7A208969AE5E6D2660B73891FE0C38D3F65A65117EFEA6C9008F006811ECABB3 | |
| 2094 | ACED727AB8D25D9D6F7B12A630090675131BD7657017E0D1BEBA6C721D97E496 | |
| 2095 | 3113B14D6D8C6ECCE0C82CD092480BE17F5031FE21FA67AEBAFE90E2DE02F273 | |
| 2096 | 8B82E66CA84CE6210D492175BD6A0EB412240AA3799637142CB8F8E07033FC81 | |
| 2097 | CAC9CC379FE10A0E444A373605647996A2AFF259B0A2332DC2C4C6AB519A102B | |
| 2098 | 5A0EF3331915EF092F5ACF3CAB65F21DBD04986BE3DF862411E7EDFF32867B63 | |
| 2099 | 9891E06A0BDCDABCD7EFB0F8080CA30C79FEA9ED999B9B2D94CB3CD3ABC6C94B | |
| 2100 | 1460CDB5C58247EE64C7B0A3896E86DFF036B3BACB489FCDE3C6B4926F7D6EF7 | |
| 2101 | 0166D4B404F3EEC540EB39B801F22B57F59F7E987F76E6BC8A61DC216557FF8F | |
| 2102 | 98901298DD5571653CC29C5B7F2DA9FBB4D93B62CE43C06AEC1B942BA6A3E86D | |
| 2103 | 7C1F83AC372F681EFCC95CC23149881FD1BF6951C669977722357026C481BD85 | |
| 2104 | C8B79C02D35D6EDF2DA523EF97B32CA023C21B7C0E746DC61A4E062AFA6033E2 | |
| 2105 | D1221BBB36256B230363B9B4E40E34272AB93C63D962D5BCFF652259E9EED617 | |
| 2106 | 38DB29D6521453834C876865FBA9AED8D6F740EFD3A0AC9DDDF999DEBFCE49B0 | |
| 2107 | 848E6B535C89DC288C1BC750B9FD923A74853E2EC884AF81499539BA9DA06041 | |
| 2108 | 89BFC782FB656E28F911EFFC5CD1AB78AD270D02AB7D129F1512EDAFF40E1895 | |
| 2109 | 4B9B7FD4D3F0669B1692B22690B08623D21318669D032E899617279149C08A48 | |
| 2110 | E71DB761E6E25DAFA8B51755120DAB6C7D9AA16EE353A5A619EB659C974FC026 | |
| 2111 | 9558753A717D6F3928835038F32C0FDD63D4664BC97FFC8FD5378CDDC66A3CFA | |
| 2112 | 093EE8063A0B09B9DF05F7564D65940FE9E6F1E9461355ACCA406A4B6E16FBCB | |
| 2113 | 5A2C9BA2EF4FFE362FA6CA020F5DB489755D27557242393E50377C6945B64996 | |
| 2114 | 868A29A500C5D5772BDBED54B25DCD6C229F6D43290FDD5D410576511D907D3A | |
| 2115 | 5BAFC90F329A4C861883FE8185ED5ABA95A7DF29623704DD4EF379ECDE1CEC4F | |
| 2116 | AC06577755135A1B5427D5DAD85485AF0741FF7F16884AD6509854D7944CC513 | |
| 2117 | 6EF45A4A3E3F1F4C2DC86682B7A62811F784C3B7A735BE518196E8E2CAD81E6B | |
| 2118 | 2B8734FF26C91E988AA5B9E1E7FB42DE6B82FF6479AFBB7368A4260F67BDAB69 | |
| 2119 | 3E689082825E4FE7469CBA1B9B7177119C0825B100BE8E6F1A910DE8F92CB3A6 | |
| 2120 | 661B19BE5EC3B6DF6B04781432F40EDB678878FA51FB4F3DDE2076921CF3EEB8 | |
| 2121 | AB9885EDE74E091F0A6C1583515C7C46828AB1487B18B84F8B85A439A6C8EE1E | |
| 2122 | 3822776A0A1E25216B7BA38AE77EBC4FB706257290FCBDECBDC13BEB402F2C25 | |
| 2123 | 610AF618A12E7D229F6A83B8CA7D8A117E1EBAFE6C044F13D583223F4DC56E79 | |
| 2124 | 4C297063953E49AEC2428F1E96B1EAFAE79099FCA69EAC63E970F10512AE8B91 | |
| 2125 | 5BD5E11C20C0D65F637642E85058D8B2ECB4A5E6C6EBF6C7DEA6EADA0F978CB5 | |
| 2126 | EDFE9D9A7E608088F791EC9A12612DD9C997C71BD0465B2D06AEF2DA48BD4C2C | |
| 2127 | ABA638772D5E614C726AC75F61823707B4F72F2D42146089FEFC3998D9C15521 | |
| 2128 | 27863929D103F46673B563712BF63819930CD03242F480A026F77B3FB17C8819 | |
| 2129 | 4F9FC69F0EE56E975EF3C545AB514B0E6DCB8E575388E0961CCE8D200F445B2A | |
| 2130 | 4EC2A853EE7B2192526999A1C0AAE2A90A58DB58EC82A10661DC30134286FFEE | |
| 2131 | 3EA512A024143D07A6C671AFEC84858B4828B2B772AAE09E9CA9F7882A4220C8 | |
| 2132 | D618C9C5892FA5A36059B978EF8B26D6839EA8D9C679452810CC9E132C8E0274 | |
| 2133 | 117339DCEED2A92632DA2BA784AB19E90A938C9ABCEAE9296E0935F5F6309B16 | |
| 2134 | 1EC413004EC7E3CD2CEB4452AA657183E4733200C62A02914ECAC30FE556AF4A | |
| 2135 | 1AF2B26101CFDA61F122B1F4353F9551E38FEA412DE7D0A8445B9D039A417861 | |
| 2136 | 5C373641A4B6532370C2E8C5257583484A065421EDB4E50EE8AEEDE46F557A6C | |
| 2137 | 6CD994D162A969698AE100116344007A7B7F747391DA9796409D301E59C94148 | |
| 2138 | F285929AF6B8C6A31D65594F63BFA0D352BCEC60D50E9232C8F28E73B2DDE881 | |
| 2139 | DBC5F5DD8E88E8EF97828453D5095311B92409C532A1A549EFE3CAC1F3D91E5D | |
| 2140 | 2EEC82CA6129FE9DB8CC6FBD6F4BC204CA9454C475BD8877597D75ECBCEACC97 | |
| 2141 | 9DC698CC7A064227CBA45EAD0AD850C45D059E2A4ABB0C830EBF95E61F8AC3B3 | |
| 2142 | 8A9389EE9E05EA091E64DB71863480D9E4312772FD9B4D6757556CC7C43FB03E | |
| 2143 | 04EEA1C9A048ECEC4B7C465CDFCEAB707F67FFDC903F784CDB60CCA60CB3DA37 | |
| 2144 | 09CDEC7264AE28487F0042ED019070BA501C22685AD2EA7BB03EFD5D8728F672 | |
| 2145 | E8FAEC9A5885461CE9F2FE3BEB7F64DDBDE5B0F2A6CF1FF0CB2BA0DFA2CBFA20 | |
| 2146 | C539DBA84F0DDFD3E62AFA11CADD416CA921C2965093177B34DAC627D18442AD | |
| 2147 | 3167DFA2688C2364C0AB3F2DC94D0867CCF22998ECFC568EC07F28161F401789 | |
| 2148 | 4F3A13987DCA67E0012D41C712F4515135DAB1405B77BC1C2C3B7CFB52BDE5B1 | |
| 2149 | 7E2EFF5C3F19195B778B0016ADF3FF0B11DBF0D674A412AA946167CE88D6B10C | |
| 2150 | 3D77EC4BAE76A665329C977409D2AA8A8CB07325501FCCA2A295F83C21AD5582 | |
| 2151 | 09406FD233B02E25A465739986A6962ACC3FECCEA316A8C747B6CBA3B1C4C7F8 | |
| 2152 | 5A01B5BB008651EDAFC2A0AAB839EBDD14025BC19B9233D54CB5D400345106AB | |
| 2153 | E2D1617BC855A3AA6E2B60C50AFBC7FEA9DBA3D30EF2905D96A5F928011CAE86 | |
| 2154 | B1C6FB92AC8BA20D7B15B40113BDCFD9A05B0F9293477C4695E6FF84AA54E779 | |
| 2155 | AF7E19AFE02FE9A3DE310E6CDD4A2C612C227FBEA17CC5014AD9853A74BB6D05 | |
| 2156 | 5A64F1C4366DD4D807809FD02B29B8E455293104ED7187A3D4943C2643ADE321 | |
| 2157 | 3299D423DA71D017DEF79F33E499D5DEDC97120E91D0408ABA55CD77190E0964 | |
| 2158 | F7B7FCD76DC3213CC9D6F5EF9A7456A181433712F1ED8FCC46BA54793C33F10B | |
| 2159 | F8BF3C7E8B59C058AA0A9C18CFCF23CCE06D71A146A34B5362CA8EE5DBA42690 | |
| 2160 | 1EE541CD07C043C565F803F5EB1E459807DE1380398989EE397D73EA7D142AED | |
| 2161 | B255F05A5BBFF1F73C05FFDD277EF060CA9E3C7318A58AC3BA0A335442BAB763 | |
| 2162 | E725EDFAB0C984B14893F0050D0773F5037D763074D3CD9EDCFC92F17C3FB699 | |
| 2163 | F7AF92090BAB4B356C4837B9ECB1D71BCC98ACE7F88448A2E2FFE1B96767F9C9 | |
| 2164 | 45FE6C13E93E0638B370D660FE15D1AD1B6BEEC26C04EC188641560733EB5C39 | |
| 2165 | D19FE0D6CCADA8D7004F8132E7F535BCEC3C5D45321E59EEAB9576F7B4B39ADE | |
| 2166 | 59A85AA8EA28B2C737F4368720E2AF82A7BC1B364FCB39588256017A745059BD | |
| 2167 | 7C31D183495F63A7B4A76BC50C4A00EB2FE4EE0C512C3BD2573D2E6E415CC58D | |
| 2168 | E2933DB1BB194B005651138415593EB9EB4B9BD91D37A0CD576B218B6827EFC4 | |
| 2169 | 1D3F1D036C6DA66217EF92B6F349B918AA5E20B9D4BB950823BF7EB9FC07F78C | |
| 2170 | 8574224AA93ED2064D7A00C98C41F732215ECC9DE1017CFA379A5B8569C3A496 | |
| 2171 | C0CD61A6201D53177F2736DDF182379C671B38B16AF092D63450CA96C8E8084F | |
| 2172 | 2DB8C8EBA732B5A84F540CC34A4AD3E9908B3DD149A10767999850D353EB7149 | |
| 2173 | E2BD0102585AE07505B83FAE856F467310372205F79199BAE473893B723F7E21 | |
| 2174 | 88EE6659BE3088859D2FCEC1604FD568DDA45559DDF64EB10FDB19FE8C9D7C59 | |
| 2175 | F0E7B781DB5FD80A3C7A73420D470F1256D683F92EE6A7A9DD241B66CE4FC35E | |
| 2176 | C6D69D2B66834D848437D45374829F5F1624722806B9E126B43A51B4FB9C27E9 | |
| 2177 | D5EC07C90DFB7CDA30B53C0DDA3D1F93B7EE82DB6EBC14466F0FCA5149F13B4A | |
| 2178 | BD949717FB44FF8BFAFDAA7914240E43B0253E4F8ED5C481376C3B609A191670 | |
| 2179 | 1F2BDA2F6F6A466FD42FE9BE9EF7C3A5B20DCB2A7C18DACD0A75038DC30E3FD3 | |
| 2180 | 64F8389204FEEC67029A64FCC3E5FCF97AF24D98A455997D5667270A95BE2D13 | |
| 2181 | ED87F410B35B52A2D3D89BF180B3EF83CF39B634A0C1CAFB62D76F373D675E86 | |
| 2182 | 856E7D0ECFD67A5C48A7FF4653B7A607622DBDE7CB434E145F9A4B0501456B86 | |
| 2183 | 3E99DF2570B034243861E4BB80E0F9CE2649329960A792F30913C967F9538E76 | |
| 2184 | 75B1591E075C10BB59139E2D1933F6BED658D704F623F8507B0E2A03C582B75D | |
| 2185 | 657B577A72585B6926D51882ABE25C752824092C6A1F5A006512FFAB96700DCA | |
| 2186 | E2AD0C7D7A3AFFC4F823A02FAB788C32ABDFCDD56DDE65FBA63BF95E890573CB | |
| 2187 | EA28F7BB049BD3133DE22E8F4F05AD04133FE48785524A14041C73EAD6F60D7A | |
| 2188 | 2CF1F8F3C7258172EAC2A9820F4C04DC34DECF2912182EDC86D7412A25A6FB25 | |
| 2189 | F46341AC7889B645C36A85C8F10D22E41D4143D10EDFF014C00A7B1E4EFAAD1A | |
| 2190 | 7E42EBC657CBA442E9B2DA0BF049E86D680C5E1C4B2588E99F24844E8EA639D3 | |
| 2191 | A4CED6A0A7BE055856FD998BECB9DAADEFACA913A60AE501FDB6F035A2D300FB | |
| 2192 | FF13B510595A64A900DA5496B7CF1085676680008CE70D114082EBDB5B384058 | |
| 2193 | 06A99A26CBB247CFE8EDB6EA428D261602319D5EF03C9B6BB657E6D8A7632970 | |
| 2194 | 491BA80744BB5DF021382808F3F99ACDC4EBF26887523FA5EA81321D6EF2AA9A | |
| 2195 | 55939200A4D011602FFF717AD90EB5E47807CB58370C40461591217C2A714DCD | |
| 2196 | 2BE918A0177D068A21B5927C254643AE0B36EA772A3D2EFC25083B8291BF311D | |
| 2197 | 74B95C21696904773C60760CBEE6F94638855697A1948221438456099589576A | |
| 2198 | AE5438C70C082D177905FB82FFDBD4BD94ECAC1B6FAF0D4D7578A1B6576B4F13 | |
| 2199 | E3A6F814B4AB580ED09C916E20820DF0626FC1D9A925E8BB6A368E630AC6EBEB | |
| 2200 | 933991990F4E49075B318B62CA8296CA43B77FBB16578839419929DC8A2AD819 | |
| 2201 | F3C404FBAC9CE3CAE8AA904E39924C4B704272257DD3D0C8421A90D426376F9E | |
| 2202 | E2A4B6C868BA2884D7BAF0BADA6299E307ACA1A74B1D73D73F0150A6C560E65E | |
| 2203 | 6C0D247AD55969C1FC5DD81C764338799892D391A254B3613F89D1A348A9BDAF | |
| 2204 | CCA171CC6E51DEF7A91C7929D6FA2BBC243DA7B1BEF9652F1D8FBCEB2D367187 | |
| 2205 | 9FD4B2C681820B2189A213866CE3456E2007FB3DFE2E362149177CD104444D0B | |
| 2206 | C026EAD4390AF141B33868DC5A49E0E1108DF1A6DBC81E2015969F66773BFF69 | |
| 2207 | 707FCD43DD72B483EA751FB1C840C917EAAE7447AEC688EB9922FAAACE7BC094 | |
| 2208 | F617EFFA3199DD06552C72E53E67B0053A3BE5C5750EA0581B1A7692AEF0921A | |
| 2209 | 859C7F04DB8AAB312D2480ABE8AAFF257469A555B5F983D277ECE041588E8F94 | |
| 2210 | 07ACAC0E3DDFF44817A21B86939E7787FA7772113699B0A4D9E5462D3E59CEFC | |
| 2211 | 2798A0D70911F57BB068F9D11393D3F2A4161C26DC2F3C92A7D1F5FC32C6295D | |
| 2212 | 9C6DFD5E9561DD4443F5CB7A356A9BDCBB61706ACF0C51670668C67DC0FFF754 | |
| 2213 | 286CF2BEF36A02F637DA2DAB10F4897FAB65E78A408C405B52C4F88C4F70CE20 | |
| 2214 | 9A27803EAE707C5E9BBEAEF09A2ACEE9986A64BC671BA9D638375ADEC6E83038 | |
| 2215 | 303B41BD653612FBE967C4B5A121032C73C085A237A561B860660D52FC408F3F | |
| 2216 | CCC694CED076A3F42CA1CA6C12A222BEF6850199F45E2354CC7E308D277CE2FF | |
| 2217 | F85076C0FF875911B86306112881047E688C5EA9CB6497EF84A659A54ACE4AE9 | |
| 2218 | 774EB2A9ECD4ABA95831E2B6DCF60E8CCD197670E2CA7B79FBBF3C9D9990E737 | |
| 2219 | D8372E43DB9D4A1B488C630E86BB9B9E91012DAD1D7FD603D2DBBC732690B2A0 | |
| 2220 | 8295EB964EDC0197D6CE17CC3C71559962405AA1E21BB1A8C17EA1DB8911C970 | |
| 2221 | 4EFC85F0DB429C54FC4BDAE64F5BF4B5DD90236269894A180920BF30FED59182 | |
| 2222 | 6781F1602EFE3DFB2467EAB8B00CB5FC30B9669AADD4DAB5795E69F4B8703815 | |
| 2223 | 95F15C33DDF808D242BC2169FF88EB6D74E9E10B638658330EBC284C89442949 | |
| 2224 | 8F4658A6B3B0E70D1431E969676900E56D0773D36A7CD91CBA93C35EE3E07BB8 | |
| 2225 | 2124EA7CDAFD27C4EAB0C53754CD38D4A08C362E0479422E9042C8586BE74C21 | |
| 2226 | FE71358084B5395DED53C62FEE8ED78460D8A9E8C39E49355E9F712142D3CC38 | |
| 2227 | A62E9B7BA97061D2C70579E40A54C0962BFD0C5DC6B3338FE09770DE0910F9FC | |
| 2228 | 4B35C0A307412BF77CB83E62BE74B4EDD3A6BBF2E2294477209F823F57B87452 | |
| 2229 | 778759BA065047FA61F3CF1853F60BF4600245237CAA359DBD88619EE2E948A7 | |
| 2230 | FD380EE535751CEC58BEA1C0E48E098CAA97C0AB72A2BAD0B538D8D48A44CAC1 | |
| 2231 | AEA3848BE1B68AA401F37A1E2C4361FE68EF65617237AEC00A37FDA5E826ABD3 | |
| 2232 | 291EEA47E3D9800F98665C75184247D4CEE91401411E53B8B48FD8CFA7147E05 | |
| 2233 | 3603F82AA77C3FB65E787AF953D88B897ABF206480083C171AD32AF26F927E7F | |
| 2234 | 58F29406D9A4C64522378E3009AB2DDFA65F62ACBB25888F7244002324FCDD2C | |
| 2235 | D01D4E83F7D222DED9242922F1187FCFEDD0DC300E05C4508256AF9D8DF2141A | |
| 2236 | 84265C77AE2034B7848A2078933229C180BB2176481EA46056610BC76B21B33E | |
| 2237 | B5792BB9A3C4AFDA74A7316CFDBC0F9C63625CAC268AD7A3B82A9E693F4A2CC1 | |
| 2238 | 6CD9E3499B943C6B6522F4DFF471B012E8BBC82E941CB87F1672669A7297DA94 | |
| 2239 | 1D05CBE1D1BA7E3749E59275B55C1893F0EACF28EA06567D4702EFA6328B4E06 | |
| 2240 | A179896B168BEA4B248FF64884DA6B42EC4E49116F1BD06104C77E80DEE2B5B3 | |
| 2241 | 96476851455CBC7BA1F8D37E927F2B8AA5F6860070940F182B1643929C4A02C8 | |
| 2242 | 0D0CF40CBD295C8B5965CAF002D464D032209B83A69CDAC059D2C949A1CA48DC | |
| 2243 | 93C3F287AB2FAAA8010D2B982AD7663E331752B23C82FC07E7F3EB7D72FCE84F | |
| 2244 | 02EF6982C96FA3FCFCEA45BC433C3A1EAF91DA6BB03B8E6C22EB79958025C3D9 | |
| 2245 | 6BF93DD6421909607AC24B682E90C3E6F1559C58ADFC90350EB44CC159A69475 | |
| 2246 | BD46BB4123F4AA935D836E5BE5AD399F13D35136933D47F980D19CCA98DC441A | |
| 2247 | 351E2843395245E1A3412ABEAADCC1D314E61FD3F7C227804175717E50D4A553 | |
| 2248 | F329D7D5B1D3ECA7C063471ECB6F72B2FCF5B31C18FCB1C92B013C502C36E795 | |
| 2249 | 4BEBEA3247CCA9989B9AFB2E0144C8FDB21E6611242D26DDEF38024E971E3BB8 | |
| 2250 | 2ED74172E32515C57A002275759AE8C59CC17AA0EB4A849BB434F1CFE128CF02 | |
| 2251 | E5EF9D2A02279E03CFACBE546FEA176A9864EA3E2748CE7D6480C7BB1E8A469D | |
| 2252 | 85DF3BBB2D98337E82B68BE7A8C2DFE8D6D86FF6BD205D332030679599B70AFD | |
| 2253 | 8A002326707FB485B995826FC0D2F8C3588D1201446162A1F8FC7E75F9208B05 | |
| 2254 | EFF017F40F429CBF0CDE769D14016514543752438D907B32F0C40398C0E0B246 | |
| 2255 | B06E5C2740E7E5A6AF3182E0E0860A0B5158241D79F7F5FF174764D8351A89FD | |
| 2256 | 0A7D99E40F317AEFAE208F3C463DB86593B91892F11C9BFDCC8D741ACA2A0BEE | |
| 2257 | B2C1A836EC39A8894B9097B194F980E7501608B1403CAC065E92B41AE18664ED | |
| 2258 | 8D9A889C1653217FFDF6006CDAF20073DB4300CFA63025D381E4AE4FE969FBF4 | |
| 2259 | 1C66D6FBAA6C0BA67B91CE299044261708D93B15F30F685589FEF331733633D7 | |
| 2260 | F90D071B2CAF4106C22DC5C7361AE88FC817DB8BF37FCF2E409D882F1FEAEF11 | |
| 2261 | 41DC3702D9B44DAD630071210E34D2E644101C7CB2AAF0892C497BB391146614 | |
| 2262 | 50AD23021FE8FDFF23A505B207A89803DADB5E0E16886FC382809EB0854346C3 | |
| 2263 | 5D4D7084F688EBC02DF2673AFF763801F90DBCF5B43FB0E8D57B3079A2C6B07A | |
| 2264 | 69A462168B9FC750AD55E11A10724943B61F425344C8FAA924C87F31E07C3467 | |
| 2265 | 1002FDC8CCF3153405FD66EF0EB2FA0FF5E5E0A35FCF5052133B5550152BD88C | |
| 2266 | 2700F1A7D05EAF25B6857615918BA5654925448B950BEFB9EA36073AA00E7B40 | |
| 2267 | 0D7E839AC159B8856EDC45FEE444945EA9C4DE984C68C9C1EE918A8CD45BEB50 | |
| 2268 | 58C8DA3508F5353B1EB83FD38BAB985608E08A0412A5C83C2CBFE295057EC58C | |
| 2269 | 1C6B537EC6CBE44342700E114DF42ADD55E2FE7FDD9056908AF166ADDDDD93F7 | |
| 2270 | DD5865C03E8FAAADEA4173E3213392D37A545B409211E2D30F2118B5183DBEBD | |
| 2271 | E7CAB3C1E3C17CDDC47BA80B2EEC36E47E9CF81A30780B0B50B231A7A4C5E3D8 | |
| 2272 | 4151DE0CF686095E2706850C90761CCF524D1B61B3E76F6E8611F0E4D993D87C | |
| 2273 | 8A08A4809656DC07FDDFFCD8F5E60782F3160171BB025A6B736D4F4093BBB062 | |
| 2274 | B2F3704B7A438495FD39CE9270411A5111B499A5B97AE75D94A56EBCBD013406 | |
| 2275 | BD215B1A3526C8ECD4C745FA6384931D197EDF17C37BA19DCC3B0E0FB79C1946 | |
| 2276 | 53145487B08EF827AB1E4AE0BD7A0106CC4C1A61F2529CFEA254FA028D0D3DF8 | |
| 2277 | 48D762C42E711FDB0EDCC0D3D1DD6B4ABF4650856B8F275DF1C8179A8B4D3A28 | |
| 2278 | 94EC6376424A8F2462A99D1989AAAB1163A67D05D4EF46D07EADBF747BD56E9A | |
| 2279 | DC48E7E1B40A2FBDAF5D8CE2EB3AC9CDE96A6044160DA3D5B96B52ED82EE892D | |
| 2280 | CF600C28E53B9AAE89AA2FFD100EC94BEAE73FCFAB2F4FBC2CE26570C17AFC32 | |
| 2281 | 5B343E71769C190E8BB3CC4FAA48991930F7A5995F998D382A90C2A0C98AD6B1 | |
| 2282 | 57782EB0D16F191AAA1F04D2BAF1DB754D8543FBCD2B5D3E76591E5E6F1A2F80 | |
| 2283 | 6705E607D921873420D7A347215D7A522BAD6CAA9A2285D0353820C27D0834C2 | |
| 2284 | B3BF27AA4704E1E8ADF303E3855D4447BA084098B6E37F578DE9D6C739D44353 | |
| 2285 | 10957E129D642D099B137C406524161A5CBF6619FAB7BDB4A1FEB5F69EC2D8C0 | |
| 2286 | 803685291E483C2A9DDB83D8F7D751AE6C69DB8297702D20BDD7E293F7DACFA7 | |
| 2287 | E56F7B77F915221981C363DC170F6E04267CE593751908CAB3D95018E8CA038C | |
| 2288 | 8BA4EA16A91A227F04552857B947B693B0DAA420C7D99B5BFD058677FEB15E61 | |
| 2289 | EF1888A69C9E33CFB2E0010E1BA49CA8198242B9E025B988A9E6AB0A7D434C80 | |
| 2290 | 50CD2307B194DFB07FC8A827BF6239B3226935A32CCD429348E1789C8B3DFAF3 | |
| 2291 | 03B59B0905DF2EBE6C807F52A4811D10B8B10E967FED1853A6D4DB02A46DA4D5 | |
| 2292 | 05150D24118FFB7445C8CA17168BD332F32A78DD5211A37FCE92F8BC2142BAE5 | |
| 2293 | FED439839A5F7D1FA4364A2F5F8B1BB4F4BFD27F0078EF167F247DDE2210128F | |
| 2294 | B927D08CB682DE3C8F954E064349C585376E84DD8D0A15FACFFBC5F54CDB2EA7 | |
| 2295 | 34728FE9B4A4D2B07FBF7C6598EE6A5CE1CBB7C0A176D890AD82F3E2F19D686D | |
| 2296 | 75A6B5816D89FAEA212AA077AFEB0055AC44B4E9E639B7D7C8A2FD4C476F4A61 | |
| 2297 | AFE52462E4B8352D98B3412DD494642AD5BF0D59050DE29A72F90838941C4BB7 | |
| 2298 | 8A826E48A9AA4AFFC93DBB77A7C8BF4787C47E54F24BD702A3459CD060E70429 | |
| 2299 | 5EE5A72C97BCC54F001241C7E0B1D5E0DF76DA82FBDDD294ED30876554BE1E88 | |
| 2300 | DFAAD6D8DA75ECEC61588EDCB48E39A654CC3A8C5641A385B3E0590DE54E9EE2 | |
| 2301 | 65A85A1DAC0AAE90E1B131E7064006D5933D96A18235EA1CDE5662B14C393359 | |
| 2302 | 6F7995B833A671DC33B8ECCBEAE657004483AEDCB128D2D89DBBE7D87F56FBA8 | |
| 2303 | 091300D55B04A20C4ECED98B229A61D4A0ADFA6E7CB8EF07D92F69BA316F6690 | |
| 2304 | 02BAC63DF03E07BF5DDDF5C26EF67375032DD9E1CD0A4F9DEAE0AEB79D3BC2B2 | |
| 2305 | A084661D6DA1DBF6B5AB2047BDF4C1A52856524E17ABE66E38A37711FFE2C3AB | |
| 2306 | 0FAE88F096CECB55695970A1EB99491DADB601E0872543310D4335E11FC92DA0 | |
| 2307 | EC1E364D1A81CB3CDCDA4ACD219104C828108D8F75EA0990D6F39F879A58A757 | |
| 2308 | 56709186B52D8BDD9205E22DCE70F81FF0DB0F73D7BF22906A9DC9A95AF8452B | |
| 2309 | 40F60A11EDB522C9C8B1473C1B7409E95C520E660EF08F99BA405F44CBEF56B4 | |
| 2310 | 388ED1E816AAD6C5DFBA690C207D08DAE204826183FE0C18261EB2E51B594561 | |
| 2311 | D88BCFB02E70054F35E0DE0F31B15191867079301EAA85D5FE398D83F08F9FF9 | |
| 2312 | 054E00968650A1546AAF86268CD31B5769B6CAB63D5539D67B426847A822468E | |
| 2313 | 472A5BCFEA9DC15DDD0ECCBEFF03BEB6FA5ACBABEE7CF2A4CB7D85388BD84649 | |
| 2314 | 4ABAE15C9B52FED3B8C9AAAB550719309764625EBBD5434F4049309FCAF7571B | |
| 2315 | 377C4DFD355A890803929CBC4596FCDC5875E36668E891E1FFD980B8FA734931 | |
| 2316 | 632D59F23D6A80FFDAB866B595A86E6EF798FBDF73C1B0F7073F1C671D641F55 | |
| 2317 | 9757E3459CEFF505F1F35CA640B572F985717C6E5CA9E6C006DD797B3F47E0E4 | |
| 2318 | 03AA2294E550C63651FA76B2C32ADBB897A3F6099D211A31081AC349B67C89FA | |
| 2319 | 9D2BCDAE1BA92DF9F7B8AA9035783EAFA722A038AA94EBE8453B4A7C1C875090 | |
| 2320 | 3D13D7D2843E9E92FD2D55C5A31D7A0FB86A63E6F39D8A2E285AA7767EEBF42A | |
| 2321 | ADA62726BE511F7283FB148079086AE4A4148CD3B0BA71D2366D02DCEBC34EBB | |
| 2322 | 278D4869B09CC8E191C28D212615125A7BF3C7ABD0ED0173EB04751EB4AEC783 | |
| 2323 | 3E781DE01956244B1502D5CCB14EC3C1558F44BD8A7B4C5235EE01EB9787E3F4 | |
| 2324 | 7633CF9ACF9D1B95CCD78FCBE8B015FADFF6961D960DFF37AC63E5FCB3BDB0FA | |
| 2325 | 455935C1DD9D3D0D6B998E83E562A0CCECED8BCADB546D4298854C3E760A34E6 | |
| 2326 | 63AB4419351F5567DFA518340EA5E8DFF2C63E8A8862B992C3BF020A514EBA10 | |
| 2327 | 718183819DA30F6DCF7C47D94845835495E3B69FEF796728DDFE4C9E2E32D163 | |
| 2328 | E02393F60133F2316BB88A3FDF7BCE977CD1F23B4735DA3DC10631D5716CDD84 | |
| 2329 | A9E67B3A60493AB9589026321993D57CAA1E68A8E15BF7CAA67AC1C33A5458B5 | |
| 2330 | 4D6FDD851667B28F5E50EDFF7051F2A934BE94F86D5088412F5720D25A480D21 | |
| 2331 | CBD723974537BD0D8EC45B84FE50B15548CC910BD0E91BEEAA1966F3CD79EB7F | |
| 2332 | 5111A9E7597217524A812DD4C2FF71CD57EC7E368A13B56EF52BDE19E34561E6 | |
| 2333 | 58AC76FC258B6CAC1AB4A5564F90761D0A9EF18FFB33D27AFAA073B3228C22C9 | |
| 2334 | E2D0106451552CDB212B28F3597D8B652F03B94DF3A980C6888D69BD8597C73C | |
| 2335 | 5F9C6FD102453E2DE1DA43F0531BCD09873867BCCB7D2A78E8205BDDDF4F1602 | |
| 2336 | 6A9B9C370F9EB49AB46C6686BB5B74A65F0F7BC4A6028BCD93CA252785E8E27E | |
| 2337 | F0ED475B95D2819629AF5C08BCE99EE7F5AD89152FA4B6C5A06A15FF077911D0 | |
| 2338 | F3D99CCAB72B83A877508AD5AA2D8551623E22B1CB39753D61099184D035B063 | |
| 2339 | 69B7D8FDD9AF3515AB4EB6D423E302EE2D0D6E402632D9FD28BDC27B40157940 | |
| 2340 | 809A7F580610903D5BB8D3AA9B2D7F7B6512C106267D41B3644A21F2D8770E4E | |
| 2341 | 4A69BAC7DF73C94BDDCA5A54810FD0F4CB27E4583D1AF77A631DBD0F260296F4 | |
| 2342 | E61B4CBD7641D80CB0FCBBCBB03229D6386111E927B91B128E601ADF44B8F481 | |
| 2343 | 99E9941A3E9E5C4E791D822C4DA3B6DDF7D8E01FF3F4264C61E8A779BEC51DA8 | |
| 2344 | FAF47F90BFEF18B8A02E27C4F98A2413C659002232AD2FF6F556F90B634A4F3A | |
| 2345 | 220E89D77C19E9D9AADABF338EDB3C0A0FBF2995C8BD1FF35826988935FEA5EC | |
| 2346 | C36D3994011F3FDC88581F9431335719FBEA6CA09E232F3D3723937C4EF79E04 | |
| 2347 | C1026CF28D01A630044065B894C833F83254155E92B0B2EA97F1F262FAF419F6 | |
| 2348 | 7C665F1675CBE362A3848613677132FD9F8674B23937243BDA27D8C17521FE63 | |
| 2349 | 7950087A0D9E678AF1814B234127353D9C9BBDC7A156F8A67B45B3D7708B9AFD | |
| 2350 | 4647790FF9E9AC3CD84D67CE96E98FE1FC45526F0B1CED5A8E6E1117342DE6B5 | |
| 2351 | 966B2B006F3475210B2293769BD5119042D8D610BF2A98A8A749F99F54537A76 | |
| 2352 | BAE6FF65A536DF5C93F04CBBFE4736375CF9FE05CD4444D0DC75D5A19351AF7B | |
| 2353 | E3708E72FDB3246E2ED29E8E2D1DE84A547C72450185FA82E066369D37467725 | |
| 2354 | 6ECA1771A162DBE738F68EBE829C6F4297DCA6AC1C58072015551631C88DBFDF | |
| 2355 | 1887D5CE0726800230AE561F8B37880C536F39C70FE9A3FECDAFC92DBF5726EC | |
| 2356 | 8B4D486AFED75AB1FBE9468E449CAA33D450D68936A5DC20F9E179438318F5A8 | |
| 2357 | CE9D51AFB937162E7DDD1AA3292C17BA791657A7EE7DC44E80D363B0A0A26E03 | |
| 2358 | F6DD84E89D28D7C1C3ED347AF7FD4816B66FBF56A4A551776FD3DBBBAFBFAAA5 | |
| 2359 | A99CBA77634AC5FBA9A02B8289E14FD064591A9C1DAFBBA02F44125B931ACC5F | |
| 2360 | B94304B22DF6D09845415B0FBAD0F206E809EB721B7D57B4538A364EC470CFBC | |
| 2361 | 3D9D30311A4C98976498DE7B6FAF7EA6385B2F6BC3F913517083EA1A03BF3A37 | |
| 2362 | 28B17D9D90DDEEFFB6FED93911508F48424A2C7EF96FF5F7C2BE572C6BECEDAE | |
| 2363 | 9895E3364C10ECF70C24CF1F16C4265E4AE26E8118AD1CA54D17E0E5E1DC3E54 | |
| 2364 | 25A65F2180CADDBD660CC16034A000CB321E3F55C07039A5DAE31B9AFFB2A33F | |
| 2365 | E85C43EBFF2216229FAFF16DA8B2E91272C20A3D44BD9D1613347B80FC96D23A | |
| 2366 | E84FB08E2C4AF42E48C6DBE656C1593E1DEC2E3C5C5719AE12B5507840D27383 | |
| 2367 | 5D8B266561EEEC730072BB24DC7E734DDF6B8E725E9205AD2DA26A517478AA2A | |
| 2368 | 531AD334BC428F48586FC2DAEA9D262B673F5F3FCC1EE33C0FCA58955E739C58 | |
| 2369 | 75306B3CE28A091645670B38846F56D438561B84D7DDD7FCD31A7023916E0079 | |
| 2370 | FF95D359F472198BAE4628F8097C984B094C5601B8BF3AE95BD8F7ABE1BAA6A6 | |
| 2371 | A4E073756A2140A266B01B1D31253FA57BE714282F88960BAF37AA5DFE4FBBAE | |
| 2372 | 9DC32332D7C578C5 | |
| 2373 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2374 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2375 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2376 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2377 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2378 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2379 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2380 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2381 | cleartomark | |
| 2382 | %%EndFont | |
| 2383 | %%BeginFont: CMTI10 | |
| 2384 | %!PS-AdobeFont-1.1: CMTI10 1.00B | |
| 2385 | %%CreationDate: 1992 Feb 19 19:56:16 | |
| 2386 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 2387 | 11 dict begin | |
| 2388 | /FontInfo 7 dict dup begin | |
| 2389 | /version (1.00B) readonly def | |
| 2390 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 2391 | /FullName (CMTI10) readonly def | |
| 2392 | /FamilyName (Computer Modern) readonly def | |
| 2393 | /Weight (Medium) readonly def | |
| 2394 | /ItalicAngle -14.04 def | |
| 2395 | /isFixedPitch false def | |
| 2396 | end readonly def | |
| 2397 | /FontName /CMTI10 def | |
| 2398 | /PaintType 0 def | |
| 2399 | /FontType 1 def | |
| 2400 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 2401 | /Encoding 256 array | |
| 2402 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 2403 | dup 0 /.notdef put |
| 37c41ab1 CR |
2404 | readonly def |
| 2405 | /FontBBox{-163 -250 1146 969}readonly def | |
| 28157acd | 2406 | /UniqueID 5000828 def |
| 37c41ab1 CR |
2407 | currentdict end |
| 2408 | currentfile eexec | |
| 2409 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
| 2410 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
| 2411 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
| 2412 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
| 2413 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
| 2414 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 | |
| 2415 | 9E3948FFB0B4E70F212EC976D65099D84E0D37A7A771C3101D6AD26A0513378F | |
| 2416 | 21EC3643079EECE0C9AB54B4772E5DCA82D0D4ACC7F42FB493AA04A3BF4A1BD6 | |
| 2417 | 06ECE186315DBE9CFDCB1A0303E8D3E83027CD3AFA8F0BD466A8E8CA0E7164CF | |
| 2418 | 55B332FAD43482748DD4A1CB3F40CB1F5E67192B8216A0D8FE30F9F05BF016F5 | |
| 2419 | B5CC130A4B0796EE065495422FBA55BEE9BFD99D04464D987AC4D237C208FA86 | |
| 2420 | 0B112E55CE7B3782A34BC22E3DE31755D9AFF19E490C8E43B85E17ECE87FA8B9 | |
| 2421 | 1485831624D24F37C39BF9972D74E6EC4784727AC00B9C4A3AD3DA1C22BD6961 | |
| 2422 | 7E0ADAF55422F22ACA5E4DCD4DF9FCD187A566B7FB661D0530454D0DD6C6C50A | |
| 2423 | 7A3875C6CBF8EC7769F32A1F3F7FC1C072BADEC97794D4E90E0035282A170402 | |
| 2424 | 356E5A9CD9ABD80AC4342A5283E458A7269252F4541CBB6452B39ED54D336D0B | |
| 2425 | 19928E9CD1AB26AD83EB209E2EC75011A2643813053B5DBB0246097C4821B5F2 | |
| 2426 | C92554E9140BE35B2DBFCD98809A8EC9FC910FDE9E0D86457C70ACB056EBF90F | |
| 2427 | 244DC0A5BBD455E15D6E3180311D52CF50B0BF7D0A7F64F3A1821E0AEDBC2E7B | |
| 2428 | AEB549FE1D51088C153799C6E089B5D5D65E1C4E2D2B430CDF1FFA23CCB25D95 | |
| 2429 | 5C43C8942435D0AAA3D9055FF808F2C3C887A3C469BBD98F026D0A59E26BA9F9 | |
| 2430 | C2144CFE49A9AD892D4D31764F0AE3A10644AE3966B0A790684B14D11FA49785 | |
| 2431 | EC5565D2B2E584CBFD85125F3FAC133338DE35361943DCE9AF05FCF2840CE512 | |
| 2432 | 998D42CBEC52B57B79DD63F00985881E8463396ADA47189A94DDF951A78866F0 | |
| 2433 | B8A3D9197E39335277EF2294308DA70065D910943A34F7D5F2090FB4AA42ED70 | |
| 2434 | CBA469A9F64B95A6FBA4BC89DBC93765E3AE4723162DF3F9D6BDE77DD5870ADE | |
| 2435 | C8900D6346957B84C3CE88A8F9A12D46B8FCA50DF4433B0B8AED6A63B3DA102B | |
| 2436 | 6DF94E62408E24154BAAC66B2B249C695BC0FA37A28699D9C0F3EE94AA32E3C5 | |
| 2437 | 8F8D7F803B5D25014D43A353D719B14B247A87898A960DF68C0C0BAF70C83917 | |
| 2438 | 6E9F7B3ACC64DBAEF3FDCD3A80C0AB907EE342E543D607556CBE5A9089B86D1D | |
| 2439 | E768F27D74A613F3ABF883222A8596B542EBF54E9DCE327B5682AEE5F6BCC38A | |
| 2440 | 2A052EC4018AE3189DC1963BA39ACDED8F0C60C83F8873FBBF0302010956C520 | |
| 2441 | A7F3F8ECD0F177EDF5F4D5522C5984A3678FF32EEEB570B69C142AB89467641F | |
| 2442 | 917155D646DAF3352E27BF2AA0746E062E48532256AF364EFC0F0AAE3766F68E | |
| 2443 | 89DF9AEAE43DE6B2E2EBCB666FB344286445FFA4714A341419C7FE51D43CF1B8 | |
| 2444 | 01FC0B0071F73EA4FEB08FEAB64FC98F56EDA5E27B7A71F1F8E350BD94C093D5 | |
| 2445 | 9A86175C46B78C65BD85BA347656778AEEBC81467970F644D32D6F2BF2A3F14A | |
| 2446 | 6B05DAE8858A02D212177F15DABAFB2961F2746D4C3176FDDB5AB9821C57C417 | |
| 2447 | 0C8E0DC8B069090D8C95DCC3340643C68E5CFA60C3F41326579B869EA5D832D9 | |
| 2448 | 85119A957DE314546187E8C4AD9841F42DCAE231C5FDDB483481FF29FDE695C8 | |
| 2449 | 45FEC01A911F1390E3E3B80D59A30805601366FC0535E62E0CD9EAEBDE4DDEE0 | |
| 2450 | 260B40C3F20D80944ADEBD496A4C82985FA55362CEF5AA91377F3E5E2C3300AA | |
| 2451 | C24A28B5DE446EA56CE7173EA3A3983F8A39C1C04DC1117A9AD9EE90A6B0A6B8 | |
| 2452 | 340651456ECDE5360D8CFC8D88EF157B44EA6BD3CEEF3BB89425A716D03A671F | |
| 2453 | E2DAC845699F8213DF6BF7EAA0CCE93CFD7557629AFEF755FD9506F006789AD9 | |
| 2454 | 100BAEE1F8DAFB9C55DCD2CF75ABA02841B88EACAEBFBB6A3AE4F145204944B1 | |
| 2455 | 1B7EA32D8730B3E29C5D0CD64AFD23656C6E462ECB6CDF4757F8EFC0CB2DDA8A | |
| 2456 | 91B79D3F44A59B587DA59DDDFB2BE6AC75606C0A1F15CDCD27C6AD77C38CA62B | |
| 2457 | 692230D98A504D41F645E9379A8A8B3F95F33E4CC3605A9B44422EAFA939C4E0 | |
| 2458 | 19EB1E3A67FAC6E7E905F92B1E7F35F150F75364B22B71B8DAFA0E995CF30D8D | |
| 2459 | 119A9EEC79606E9B038E4B4D449653B0537907789B54D8E949BF20BC6AAD3C0E | |
| 2460 | 53075AFD1F67865A1D42AB0945534D9C59AA91C7C87275E2B3024CECBAE47E64 | |
| 2461 | 9E6190D0E790CE26F88CE6C0F7258FFDEC557C88F5560A756705B2D8B0B2F1FE | |
| 2462 | 279CF534C2604BB283024ECFB6AA6D1496021FCAEC3390B01DC093F7D04C9D67 | |
| 2463 | E2D77BB40E9035A1C41632037B5DB63C6302D464ABC9FEE829B742105984C3D3 | |
| 2464 | 3AA836FF446D394DDC7882C3A9FF355340EAA8461CB4AA082F03E11B6034DA2F | |
| 2465 | 37FB132E23E182E74333E46ADC2CA82A58AC483FBCA5FA6A0B7CC69FE75339E9 | |
| 2466 | 58350D7C0B336626ECF2BC024FB5712BA5B3F7936995FD937A4B1EA5FC4A6BFD | |
| 2467 | 050B25C5DDD3B64207A90097897FAC7F0D5F8C51ED0CD8F74D9C3C6006118B69 | |
| 2468 | 0A3C80BF08509EC03A7712076C9B789B9AFCBE0848FC16DFE18C9043D2C62CEE | |
| 2469 | 21422D965A6A398D7E3880C18461D16B0805FB95F5A7429D35F707C9543AF4C3 | |
| 2470 | 6568A1CD13E4D551C4D391390A9FD45D993B0A27A327B9E3E6511B3EF6C14BAA | |
| 2471 | F972D98A7596CD6A145603D942F59FD2081EEC6978C7AD5AA04683291CE5CF85 | |
| 2472 | 1CAD87DAAE0FFF00D14AFFEF3472F8413558DCE88E196647ABE2198E401ABE29 | |
| 2473 | 875BBF2E2AE0AFB0C9A262F60DD9CB19F43BD16CD90B199359A01490ACA053B3 | |
| 2474 | 77A76B7FB98A3E096A4C376A9DF69C8B91F76ADC634B4AFB58ED00C9655A0E7E | |
| 2475 | A0C55508304363A82C81254D827FA1911C16D49670A63E4402BD78A1F7F4C616 | |
| 2476 | 4910967EF94276B30AFDEB5724EA1F087D572BE403B0CFD786D5397453B44DA4 | |
| 2477 | A3F91FDF0789626FF3D8178331683B1CD16EBF7F97742AA3A966B8BC92E87D5B | |
| 2478 | B529CA5522D31A6EC30BBB4C80023BA8887D87DBB8FBEE8524409A554F5282A7 | |
| 2479 | F2D389139DBE74563663CE5C839DB39F9390CCFF9AA3AAF8C713A5F60D2FEA06 | |
| 2480 | E069A8AF06B118EE22926B6AA67AC8D9E8F7B8C95C6884A2816BB1BFA71D86A1 | |
| 2481 | 303B0448D870CB6D41006A017B26617782496EE396E68F8501F6B0ABC13EBB88 | |
| 2482 | C1AD1BD3C33DF6B013B8CD034F268645A2215713874D66C21EB75E65A2A88AAB | |
| 2483 | 6E83D74DD9D509F2B0D4355D528F9AD6A7EBF6ADFAF76A9220573F3E6219BD96 | |
| 2484 | 640F535F5F0B154FF77B5D6097C6D13F739E9AEBE8B2E745224EF1AE4570A437 | |
| 2485 | 0086BB3069D29059EEDD760AFF1D448F69669BDD37ED7FD90D5B18B055A9A1DD | |
| 2486 | D1237817EEFEB2C4DE9F27BDAEBDC0970587C9AFBCEF71F45CD7E6199EFDCBC0 | |
| 2487 | 0C7FBC2BC922289493C40FA7C624A1AEB18133FC0B5292EA905823937E82A2C2 | |
| 2488 | 00081E0DB58E59DE2D0962765CB54FCF8F9FAE24ED3FC649B1B4C2B1B7A85425 | |
| 2489 | B637B0431AA42CD8012D6FB016B984DAB93E0794C35EAD838B750DB8D3D5CA79 | |
| 2490 | E89C09DFFD4FF26D29BE719A1792A868DB70004051C3F801DF00CF356A5F2083 | |
| 2491 | CEA418DDD9C73F3DE15D1E0B1FB2D3A17CF92321E155AE4940DB50DCB15A333C | |
| 2492 | 622AB7D7A004348BADDD7ABF5B941463BEF9FBB812186CF17856FE4474DF7C4B | |
| 2493 | 6261E8D0FC262334A4605F4E6AFFD23F0B91A54C83638FC7A909694A3EFF251D | |
| 2494 | 16DD6B72F4E90C159EF9E0F2084795E93D4C38606AC68D72E28C5D9AF4FBCEA6 | |
| 2495 | 329E7617D13F8F81B0F91541A53B502EFE17D2776D7286BCA63A6AE78EADE167 | |
| 2496 | 32F3F3929D941516A9AAF2D3D26AA900491CE534BA3FFB14D60FDC6F51D36FD5 | |
| 2497 | 20D2B2C17A8751F02E90BF48B080DAC2BC7601604D97BDC0441D08D31E8DA70A | |
| 2498 | 528239646607E9AD6708A8E401229DB8DEB508BFE65582CF91506F3F627B24D3 | |
| 2499 | 4D7A8BF6C5CAE1A0BDE435ECC247551935EAB94BBA6BBA5BF1DFA673F4B5060A | |
| 2500 | 0AA6018F6D67B86E5437D3AF6E9A3A68AD7BF229919881FB6FC3B48FDFA51B1E | |
| 2501 | 9AABDBC1F9E8D97ED2B1FE2D465F6D7CE514FEF2B62276AA872546A0E27903E2 | |
| 2502 | F1D0460EE43C3806EBD9EA14C41088AB8AE0DAE60E5CE0FB63A226B232F78A7B | |
| 2503 | B6C96617C75BE615A510248A4FF3F09F7AD0EB0B104BB0EE5316496390A0DF28 | |
| 2504 | BED8A07237800A2FF3D37E3880D3602459C7BD5A92F393595D4FABE161052D34 | |
| 2505 | EEDF37EA8885564680BEBF27DD504EBDB28413CD242E181C07F2038EEA55D346 | |
| 2506 | B4431A12F580300AA1D2E12C9CEE10602D63852A26964E5523B1040A86A1B33D | |
| 2507 | FE271D325052B0A79F2A736DA669EC660AA60C844F2A08913E04CC92800A9358 | |
| 2508 | 5C0F1A4164140397FBF75672C7366128A2A3DE696901EA882DCA6EDC457D6145 | |
| 2509 | FC84214EAB132905FC7529E63022CD7E08D828E47B5C7D0BBCD171F0C0788A2D | |
| 2510 | BE4FE10CBF36FB8DFCEB0702365B4A58F8DA9F8C24061970B47C39E0153DC714 | |
| 2511 | 9EE93688EB1BB49F171364F1BCFD69B0B38BEEC512841B7B59F48E2BDF0C8232 | |
| 2512 | 3CBEE59A81530987299A450478201B8FB8E98B0F6369F5FE50106C3A0AF03D98 | |
| 2513 | 49B780C7FD6BFCB03677033FA56127E28871494281C0ADB19DB2D777D299FE76 | |
| 2514 | C262C2E999F56E64284C4533AF281C1936EA6174AC011C38680D10829226B268 | |
| 2515 | AFF13938517274BD415ABE48CF8928DAD48C10852C257858F2BC616499086BE6 | |
| 2516 | 9D3F0A2F6FEC61CA36A7271549AD623B6AC984DDB50A603D5682718730E7D200 | |
| 2517 | CBF0518D89F46E91B8580D8E9902018EBC8B1FD4D1A8648EE790A5067A2B2F0F | |
| 2518 | AD3A4AD02F0CFA43E612C2AE8E758AA1D80989FCD00E41487E3D2A563B2369F0 | |
| 2519 | E4DFF0582EAD6552253FDE8FCF3E1DDBA63185E512F41193533E21BC5EAEBD92 | |
| 2520 | A48DF5F64384719683608F1DE5767882784CC7B5E15B2E296B5303BBBED04074 | |
| 2521 | 9CECCFD4ADF441ABE8F689B4843E9A23D6F49F93A28E8AB4B16ECA7D3FE5F5D0 | |
| 2522 | 2D615E219C92538BFA1B4A69379A138E54E640119E9DB26441D797A337494517 | |
| 2523 | EFF7DF0429A7F508F8DBE974FCFBC97D9D1380BD012B2C20DC36D2337F259AAE | |
| 2524 | 691A0705BDB9394DC90A1DF5C180C033A0D139C1B12E62061E05F9A2551B7F9B | |
| 2525 | A7A90850ECB9878A9DD62FE08100A77CF9BC4BE11231F190B741741686F48FF5 | |
| 2526 | A19AE1DBB06323E9A1BB20D1F4EC8A845FD8C702C4E9090BAEAD6CA0E188F1E2 | |
| 2527 | D26280B587334AA83E36BBF96AC652AB10FDE648B364235582169B5CD5F6E65C | |
| 2528 | 91D1224171D25026FE6C030C29FEBCC84AC1D4FDB1E027952F00658B3EEDF9C0 | |
| 2529 | E498969539211F54CEF79EA07E8BE789CB88A7D0DC064C6B138B0A08E78FA517 | |
| 2530 | A466F534A15C839B94D7643CFB51C8B0D83522479542F044B14A751D5EE125EF | |
| 2531 | 08539F8A1FE1C0F083747BAB9CEEB7940BE0DED33165DB549D8E91EFD50CB8FE | |
| 2532 | C48BF3901D4515FFE1F82CF7155F7A441C00D380EDB2AC81A23114BF7E2CAB46 | |
| 2533 | 2517D67692C1FEBC62EEBA954BCF7407E096D839C9998AAF740B2F6503B4B40E | |
| 2534 | A85255E6AAC61D6E83E25D205DD4784EB270CA150F639078DA1AC9B2D2338488 | |
| 2535 | C0DA863DD9FED4A30C6803CB601883E95C1209D1E3572EDAFAFEB2D5B8F025F6 | |
| 2536 | 84765B31CAD2D66C3AFE6417E2156B039893183C7AC26EBEF0001CECCEFCE180 | |
| 2537 | 511CB2691E429155ACB128EA2E33E38434467F89F9A61CD996921C8B378B72C9 | |
| 2538 | EE97FF7AA8D2CD8797037892209C10F5947350E7DDC33DC6A01D23374CB1EAAD | |
| 2539 | 537DEBF3B575143F6BDEF20DE12B2DAC6B522F7048E23F9B22B2EC042DBCB851 | |
| 2540 | 5B392DCE99C783C870EEF9586D731732AF882401E812C2A553D6DBA2D78C324C | |
| 2541 | A653B748A155C1AAE475B5B7D416E8E4463AF3CA87146BADBA7DB13412C94949 | |
| 2542 | 317812DD7BD9F9945DCBEFFD7C05BA588714371AFCD0147B0F7A5DC66E0F0F7F | |
| 2543 | 4B597E49716029FFFAE90EF4A6D633407CD450BB2B831AC6289F449724DCF278 | |
| 2544 | AEFFDDB0D12BA46B7D39F11888A50BEDAEAC715E4B880E9FC41C635463BD99E1 | |
| 2545 | 4C401E5965405ECCE3AC654A2AFC59E95ED0416C797E5F145724DCD5A293A717 | |
| 2546 | 9A977A438CD5EDB02D1208F8A3CDF4E00E6D6A188DCFEC2CD5BF86CBF61D7C67 | |
| 2547 | A1A0A7946A35D7E7AC06F71DE671E33EC9A9ECA21E966AB453DEBF483D36F688 | |
| 2548 | 9D03C08AC0B39B8FA47C704E1B7522ACCA02C9DD0A21D47C0A4E007C9C2A6F61 | |
| 2549 | C0BD63CAAB8FB38E4D9775B42C49C33FC4A10AC96F71D2282E1A5C3CA63AC981 | |
| 2550 | 3F84C84EB68C4225FC169E8BC6F0CFDD7CBD8EB98A49C1F60705E8F3686EED4A | |
| 2551 | CF7E7FBB6630537CACB9C8A7F75DAA999BD91F88AA09F399AD41C19ABC746E83 | |
| 2552 | 93CEC3820496D0C0B4EB224AE6286A637DA5DE | |
| 2553 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2554 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2555 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2556 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2557 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2558 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2559 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2560 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2561 | cleartomark | |
| 2562 | %%EndFont | |
| 2563 | %%BeginFont: CMBXTI10 | |
| 2564 | %!PS-AdobeFont-1.1: CMBXTI10 1.0 | |
| 2565 | %%CreationDate: 1991 Aug 18 17:46:30 | |
| 2566 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 2567 | 11 dict begin | |
| 2568 | /FontInfo 7 dict dup begin | |
| 2569 | /version (1.0) readonly def | |
| 2570 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 2571 | /FullName (CMBXTI10) readonly def | |
| 2572 | /FamilyName (Computer Modern) readonly def | |
| 2573 | /Weight (Bold) readonly def | |
| 2574 | /ItalicAngle -14.04 def | |
| 2575 | /isFixedPitch false def | |
| 2576 | end readonly def | |
| 2577 | /FontName /CMBXTI10 def | |
| 2578 | /PaintType 0 def | |
| 2579 | /FontType 1 def | |
| 2580 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 2581 | /Encoding 256 array | |
| 2582 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 2583 | dup 0 /.notdef put |
| 37c41ab1 CR |
2584 | readonly def |
| 2585 | /FontBBox{-29 -250 1274 754}readonly def | |
| 28157acd | 2586 | /UniqueID 5000771 def |
| 37c41ab1 CR |
2587 | currentdict end |
| 2588 | currentfile eexec | |
| 2589 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
| 2590 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
| 2591 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
| 2592 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
| 2593 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
| 2594 | D919C2DDD26BDC0D99398B9F4D004B836D34E88C20EEB527CE1124209388A2DF | |
| 2595 | E27A8DF298A2693A9D529916AA0B2176E6ED237F69D84A8FEEB36861D1847207 | |
| 2596 | BE2BD61C6A412FFFEDFF13AFEC32AC7735BCCE5965F5966418A62ECB99112AB3 | |
| 2597 | 3BC938EC590FF6922659125EB67E260BF02885E49BA6019E696D33F0B53606A2 | |
| 2598 | F515E0C45F323311613A94B838491BAB9FE230C5CC79D22925E3D882799F2707 | |
| 2599 | C32975A494F0F9513E4D8332E7E54470D9721FBD345CDBB48286F2F19CC6D66E | |
| 2600 | BB631DD6476A509167A49CA525A72CA50E82C1D08C2B372DB54C5949C753B632 | |
| 2601 | 2009B761EB90492ACD3CBE6A35CE1B66F3BC4D8DC36827CE4261A703328451D1 | |
| 2602 | 879438479917C1647772999171DCCF1491A1C9086E0C6393506768F8757BD81D | |
| 2603 | 141C46EB9BF507EEC29962A0072B6C5D8C8588F3D68886CD2606DD3BD2FECCEF | |
| 2604 | 63245494E93EEA12AAFB06110E54ADC444C7E7619627A48A464394E5DE06EB46 | |
| 2605 | 4C76A2FF010318BBE48B3776C826A265C66515717F7F2E943C60EBAB23D96B5B | |
| 2606 | FD514A1C4E79BB3D3D2DEB936F90CD3FABF7B09FF7F564AB5CF4AF6A40E869FD | |
| 2607 | 395885A88F4A138B3CA6943A2D430BBE43D91F7F17621CAF52FB7161DA3B2003 | |
| 2608 | 82244FB6EE792DCA1722C03392C296C029A2DCC5BAAB3EA03F8DEB039DC83AE1 | |
| 2609 | 763AAB84776A2CCFFAE9EAF0BFDAE417E8BE682D237FFEDAF224AC09C9665019 | |
| 2610 | 165CE32F5349E857177D94AD6396570932E1657ADE4D3FF57A3419946CCD210E | |
| 2611 | 57E5A1D91CF708395942527D127606350924D71BC21C6F969288B1C8CA3404ED | |
| 2612 | E6219985F7301A20621368F74747EAD38990A4C9F2B62913B8FDB93657409FF5 | |
| 2613 | 178DAA7C97C35EAFA47778CE03E863303582D8A9900EF4F8DA879DED54BACD7A | |
| 2614 | 4A50C18AA2ED906FC4DC073B1E6CA1E3855AD5B7698EF4A96B77DBE19A12382A | |
| 2615 | CFA8717DE230CB6182F2250885B8E90AC42A66484A7B527061B223A6D1CC72D4 | |
| 2616 | 890359E7E04690BFFA99FAB5CC9999F0873A9DBE49E33F79E483FAD72313DF9A | |
| 2617 | 7B7D926461988C23CCE9F71AB7BB63BDB2B10B3F78176380AFFC154825C9BDCE | |
| 2618 | 82303FBFC3B59E070438984C28D12E8655BBBF049125BF56DD2B0DE8C0450E55 | |
| 2619 | 82832DA59EBEB001AAD86F2317460DD7ED264611B9043614221ECF | |
| 2620 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2621 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2622 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2623 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2624 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2625 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2626 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2627 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2628 | cleartomark | |
| 2629 | %%EndFont | |
| 2630 | %%BeginFont: CMSY10 | |
| 2631 | %!PS-AdobeFont-1.1: CMSY10 1.0 | |
| 2632 | %%CreationDate: 1991 Aug 15 07:20:57 | |
| 2633 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 2634 | 11 dict begin | |
| 2635 | /FontInfo 7 dict dup begin | |
| 2636 | /version (1.0) readonly def | |
| 2637 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 2638 | /FullName (CMSY10) readonly def | |
| 2639 | /FamilyName (Computer Modern) readonly def | |
| 2640 | /Weight (Medium) readonly def | |
| 2641 | /ItalicAngle -14.035 def | |
| 2642 | /isFixedPitch false def | |
| 2643 | end readonly def | |
| 2644 | /FontName /CMSY10 def | |
| 2645 | /PaintType 0 def | |
| 2646 | /FontType 1 def | |
| 2647 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 2648 | /Encoding 256 array | |
| 2649 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 2650 | dup 0 /.notdef put |
| 37c41ab1 CR |
2651 | readonly def |
| 2652 | /FontBBox{-29 -960 1116 775}readonly def | |
| 28157acd | 2653 | /UniqueID 5000820 def |
| 37c41ab1 CR |
2654 | currentdict end |
| 2655 | currentfile eexec | |
| 2656 | D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 | |
| 2657 | 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 | |
| 2658 | A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 | |
| 2659 | E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A | |
| 2660 | 221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A | |
| 2661 | 27D1663E0B62F461F6E40A5D6676D1D12B51E641C1D4E8E2771864FC104F8CBF | |
| 2662 | 5B78EC1D88228725F1C453A678F58A7E1B7BD7CA700717D288EB8DA1F57C4F09 | |
| 2663 | 0ABF1D42C5DDD0C384C7E22F8F8047BE1D4C1CC8E33368FB1AC82B4E96146730 | |
| 2664 | DE3302B2E6B819CB6AE455B1AF3187FFE8071AA57EF8A6616B9CB7941D44EC7A | |
| 2665 | 71A7BB3DF755178D7D2E4BB69859EFA4BBC30BD6BB1531133FD4D9438FF99F09 | |
| 2666 | 4ECC068A324D75B5F696B8688EEB2F17E5ED34CCD6D047A4E3806D000C199D7C | |
| 2667 | 515DB70A8D4F6146FE068DC1E5DE8BC57033D79919697C81395D5B94C3AAAB11 | |
| 2668 | 52D73937B8F82D3E2E764DA1B3BE273CBB84E4B1919CC1D5586C21F6FC23BF1D | |
| 2669 | 82DE5A8DFA3E8F5C25622AAB9F7A588532D13C663079C8FB84DA6BD4D2DEDB2F | |
| 2670 | 84CE30D0F188EEA26BAA650B1AA18C7D241CC179AE82933C45A82BD57808E2D8 | |
| 2671 | 032E1ABA37E4FD8E27AF35326011B8BD7FCA4EA71B5FDB60F7D63D0874B77656 | |
| 2672 | F289B324BE95E33A9B732669966C96E64C4840A8EDE39410E6F6F0F027063530 | |
| 2673 | B760AECC1594FED97FDAF84016D6D7CD8358E062040143593FD734B7EBEF810C | |
| 2674 | 6B1B941E0676910D0A04466C27EB62523967DA65748264D137D8ED841E3D36A8 | |
| 2675 | 06761884C9AC0DE7C88FBA06B933E311EC28B17428C69C796E3F14C6E7CF97E7 | |
| 2676 | 9FF2559E5D1F9EA00554A5995096075ED8901E2F45E76B2C5566E947E41294B5 | |
| 2677 | 9BC17D2F1AB2C577F2710540F7235BB4569D2FEE06C8E45C8A1C0BDCA78A43D5 | |
| 2678 | 7A687297D36E269B9EC59754EDB5DE481018BA228AEC200DD877D3E5DA7159C6 | |
| 2679 | 50F4D7348BA64508F84DAF7FCF01B8C5ABFBE5861D4B32F9E32C7C4B2B6EA064 | |
| 2680 | F179E8F62E3A59DC65FB475A3DB61C36E43AB3EEF286A50FD5F57277747CB7B7 | |
| 2681 | 78284143B3F0196437A1DEC9E61454F80C6720D8008EB945799236677E7FA331 | |
| 2682 | E091CD5D924C48EF02DEB2B54D8EE02897C481C815C24F15A7548E2ED908E3DE | |
| 2683 | 3763983CE2ED0A86B6BB97B4626F1AAFFAFF27CEF18947AF2EB40D7124A122C7 | |
| 2684 | 6A6ED9E0528A29F7A238DB73B95869018D40674CEDB9A993B6C117FADE48A8C5 | |
| 2685 | C6ADAE4960C0D56F3E30ACB38CA8AA8443166BCFF6A5FC2177C6836859CDE55B | |
| 2686 | E0F1E80605C8670AC34DC8E8586ACA6E1CECE99C53A42C5730 | |
| 2687 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2688 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2689 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2690 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2691 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2692 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2693 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2694 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 2695 | cleartomark | |
| 2696 | %%EndFont | |
| 2697 | %%BeginFont: CMSL10 | |
| 2698 | %!PS-AdobeFont-1.1: CMSL10 1.0 | |
| 2699 | %%CreationDate: 1991 Aug 20 16:40:20 | |
| 2700 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 2701 | 11 dict begin | |
| 2702 | /FontInfo 7 dict dup begin | |
| 2703 | /version (1.0) readonly def | |
| 2704 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 2705 | /FullName (CMSL10) readonly def | |
| 2706 | /FamilyName (Computer Modern) readonly def | |
| 2707 | /Weight (Medium) readonly def | |
| 2708 | /ItalicAngle -9.46 def | |
| 2709 | /isFixedPitch false def | |
| 2710 | end readonly def | |
| 2711 | /FontName /CMSL10 def | |
| 2712 | /PaintType 0 def | |
| 2713 | /FontType 1 def | |
| 2714 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 2715 | /Encoding 256 array | |
| 2716 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 2717 | dup 0 /.notdef put |
| 37c41ab1 CR |
2718 | readonly def |
| 2719 | /FontBBox{-62 -250 1123 750}readonly def | |
| 28157acd | 2720 | /UniqueID 5000798 def |
| 37c41ab1 CR |
2721 | currentdict end |
| 2722 | currentfile eexec | |
| 2723 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
| 2724 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
| 2725 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
| 2726 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
| 2727 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
| 2728 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 | |
| 2729 | 9429B9D40924DC059325D9D4CC0344F3F997A99E6CC0676735EBCD685AAC9142 | |
| 2730 | 08DAFEC78BB41AFC2F1C219910BDF41D6279284EF600B69776CA15BC8A34347C | |
| 2731 | 30783C52AFA60FBE3E353E2AE354CF87B558776A22C776C7A0B5AB5CE1F941EF | |
| 2732 | C2D9CAC37294BF407A671F10E4743BF842143F4F7DFEE643BA3BBD8BB9E3F24A | |
| 2733 | BCCF7F0ADF8BA500620C81033EAE8C4EF2C1DEF13AC575F1B3BBB66F093D3B78 | |
| 2734 | 5412B82B67FFA087AF57182B2230F9F2137180CA58A7D9B2C822FF04BE6CD01D | |
| 2735 | 43B2CA7058C7B953F6D9B5D6E91ECBAA5CDE1159B0E59C83DBAD96D6C8C8BAB1 | |
| 2736 | 374EF652D10C0F3EE7104472C98DD3572AAF2D45A70BF7061447E21EE3C3BF23 | |
| 2737 | DF39C2D1B35B42CD5297BEBE6BC94F7C9DC6E61EC67E4F677256FED9064BD3E4 | |
| 2738 | B51A71B1D27CA4E5AA9E1D8080E6DAB5310711EEF87C40859FA935B19524AE83 | |
| 2739 | 63B163FA8397BDFF443227FEDF7DB27DC35D89FB1C5E435DA0619A5C88AFC73B | |
| 2740 | 89A2DF5E767C5B536BC7167A840A0C32BD57A14DE69A7D0D819AC36FF32F908A | |
| 2741 | 5070F32983BB007437E3500799DF5E0AD3710A4C0000F0098D5BE99F2EB9C1C2 | |
| 2742 | C444FD9552D0DCA098A94B3BF176F511CEE13DB7EFFAED7C47B5ADCF8D4700F5 | |
| 2743 | 7A5FD1B49560969BF5C44F3749370663A04776F749DDD7B50674D93254426C4B | |
| 2744 | EFE264BEE7810EC93784B7C01A7F29EFD92547E13A2C7851A2E709FBD5B87850 | |
| 2745 | 4A44F08F56A542DBE072D2FBC58D9E6468E1AB858DC35240E30D31C7AC13D6C5 | |
| 2746 | 7D2BB634BEE96FA0E10F842B11A789F72A333DD6DDCB1BC23227EBC406E50B40 | |
| 2747 | 30AF0C48E6359AB0C46898CDAF1118E46BFF8B00F54EACBC2AC262AB898C42B9 | |
| 2748 | 2E080C10DE923C195ED0A46BD535972F0A59D3977A0C4E4C413050044C486CCE | |
| 2749 | 9413D853E3FDF83C84B0A7E5FC5AA859BD382DC2D94780F2B9FACCDD437183AF | |
| 2750 | E656EDA4147CB501BC39013529A953D6D78F640BD51EE6D1526D1D27F2538715 | |
| 2751 | 2BFA7F33FC8CE7A1B811D7E4251EE8C0640097D655F9EBB15102F85DAFFAB797 | |
| 2752 | 0E07D701E1BA93C6196EDE47DCF0491F102A3ADD983898E72900D1398033A2C1 | |
| 2753 | CB464B9EE9A47E7DE97F7D4ED4E99530C9A770F43EA6FFCBA27C41B4668C6047 | |
| 2754 | FD5DCECE8899E1603D3DEB282DFBEB30C8040E7EAAB83B8E78B2F7F61B7E8A77 | |
| 2755 | 4C544F5ED83E5056EED08C1A29221D05A4949A0AD635D9C930F7FE8601D74FA5 | |
| 2756 | 33B2F4FD4C29FAE4346FE914B123BA9CF5BA732FC430A128EDE270E3C60BD7AF | |
| 2757 | CF54674799A0DC1C214E10BA5511B29813AF2E3768AE494D240EC647D9851CB2 | |
| 2758 | EC38976C6D8763F8C413B8CBFCF8EDD0FAE02F72C6366F5CEC2715BB7C90440F | |
| 2759 | 2D7BB30CD1F107CB2340075D2A0D9D4114D644A09003403685A7D466CF47362A | |
| 2760 | B3187106FB1E2B32D7FE26F9231BE1AA87C8556A5421528BF5FC0478AC567DDF | |
| 2761 | EC95E6151FB92C7986631F641E23CA968DBDDC42A5880B89CCC00F09B82ABF41 | |
| 2762 | F72B2F9F28806308176EA7081DAC3DE89BC389FBC54E60D2C6B666F18562BA0E | |
| 2763 | 32B5906EF1C2B6A31FE0946E648C73142ADB3136E7D2BE4BCC42E08DE3A5F02C | |
| 2764 | 4B8575B1A296F04735C0F30C32D3DB7423FBFE682109815234C88BE292C8F313 | |
| 2765 | F667207D842DE2052A8D3701AE71C44F6C4788AA08A967D66270C5EA7DDB61C7 | |
| 2766 | 56D7BCBD106F1CF4EA7BC3A532CE23E29368899E7DE2175C4EB20802FAD3E840 | |
| 2767 | FD7B7B9956777195B646FCA2E5F4ABA05940E269858FDF5CBD236269C9FB0621 | |
| 2768 | C8224C63BC120EC8B8ECB643468C468CECAD06EA59C1CC6131F8091ECDD0D23A | |
| 2769 | 419DA3F684B229B64CADEF0AD3314C91186EC445B596FD398F41880FECC56453 | |
| 2770 | 6459474EAD902F020B750E99DE425498DB3ABFCEF48305FF9B0C412ACE5363C2 | |
| 2771 | 75EEA02FC8395179DF95E2A257E273F07CB0B899EC5E5AC093C9EEC345F6FA2E | |
| 2772 | AF7A6FF8AC2786F25DFA834FDF023B1DA2C4301D807999010C5EFF3DEE1EEBD9 | |
| 2773 | F4D888F285847810A3DA48BE7B63D23D432231E1C3FD7D7F249A68DB43C0B439 | |
| 2774 | 6EB0ACCE9083508830ED8BA1D9DC575938B07F07D9DAABA164281A09C7D00FDC | |
| 2775 | 78DB17CF89185DFF736892A6741CAF6B3864E92E7DE32A677E64B10C9765F925 | |
| 2776 | CFF01D76799957C8E2A4789CF754E9352C4957520A1D5303E4DFC850A5918A9D | |
| 2777 | B90735BED913175122AAA4426917ABE09DC19218EABDE6FEF861669F60819DBF | |
| 2778 | 6A76690FE9C9CD86851FE1D1AAD0219178779037A3C0C66589ACDDB712CD236F | |
| 2779 | DDC950DC13E099B747F7892B0B2DAB00161BA35240DD4CAE298B0EEAE5A4A2E5 | |
| 2780 | 4DB38F070F3985205B2391FEDC8AF24256323A68AF8FD7A62BBA1A2F702F5402 | |
| 2781 | 4EDC17889993E0D56817E6D2AE1469180286651F6C6643770D0251C8626A2A6E | |
| 2782 | 2CC25B87A3A520335B2AB1544807683BD52C3B8C3DAE7AD46077BC08E91D0701 | |
| 2783 | 387312C9481A4CE788A11DF9E94A5700EA62581EC3BC2D0DDC709ADF5ED14CD2 | |
| 2784 | 6B23D4480BFFD15828AA39A5E6A9BD9ED07C03F3B9528FEC1328AC1B35B5A1EA | |
| 2785 | C0BBAB5E5ACEDE99FF0099625897168374623C391A76441CCB7ADA5B458D0EFA | |
| 2786 | B829328D3A34C297BC605B3979C7110C90FA41295C25F84616A8F79A31B4E6D5 | |
| 2787 | B6F443022FB9F3AE6A0C23DC97F1811F50E38C254126EC2B9DD3992A6F61DED7 | |
| 2788 | 02C3535B414C33DA24D5F172A6B34AA29336AB5AD10EDE4DBCDF08574BAFCAB2 | |
| 2789 | 25D741156747BA56BF1069EDF0EF8AEF00C0B98860E8928DD5FA7600B2068188 | |
| 2790 | CF933C1C23DE74BDA86B3680D1E81401FE2FFF2905DDB015ED31F68F57BFF691 | |
| 2791 | DBBD798632E85A68477BAA42755C34A14D063059F88F411A0FDF0DFADFDC2F7F | |
| 2792 | B77353A472CFF8B6C420C535288CB18B0B0CEE480DAB9A767F2F6C7C427310A9 | |
| 2793 | BB1FCBC48C194E91855E54CA50C1EEF64B1BE0F7C8CEE9E1EB620902FA40DE3E | |
| 2794 | 96F962F6E38B2C64BB774F45BA51986434C8E25716EC38E320D0914F68645DCF | |
| 2795 | 67454133BBFDD4AFFF0A8ADB82E9730F94B17964A5E8A4FC1D630D4C7A9CE970 | |
| 2796 | 82C0B79D4E4B98CB3E173175CF1DDBD28A47FB67BAE582F9D072C1EA0B5A2B42 | |
| 2797 | 988B173EFC21F67BE388BD8C9D1D83D4752DD5A6CC8DA57A86BEC2FE2B1E269C | |
| 2798 | DBEAED127C4526C27FD349564F988DAF675C80E491162FDD7BCEBD7F3B13153C | |
| 2799 | 2AFD7F9D5CE941C6FCB0E585FF99D5706B3B90E630CF4985BD5CAE567CE919EB | |
| 2800 | 2DF4C66A7F366F68009E80373C0A9C386C1D30CE77A112C2BC3C59A2EBE50225 | |
| 2801 | 75B58ADCB776094FCCA56C3892D8FE0911361D3FB581A7F2B2DFCA79042BE3A5 | |
| 2802 | 80AFA160903B86CD46C65BC4BD9487928B06F6E387E8069AFFE9B2F784C0F722 | |
| 2803 | 53E3FAE45E96D993999645621D2633035DF829279F51E25161A7A48317C904EF | |
| 2804 | 264642205EF3D61840425EDDF9B5B80D5F66D642F7C393CACEBC8DF6838E074F | |
| 2805 | FB1FEDE41F42726CFBCC96B5BEF17EC26B27EF29087A163F40E3A1A777D4352E | |
| 2806 | 7E4E389F0685FDF4A6ACB6C88D997250104A35E879A0C0203BFC3BA7AE49AFCB | |
| 2807 | 3E8DFE3ACCC3F4A7364514AC94346332EFF06D7199CC29F017D9A21AB8731ECD | |
| 2808 | 1E01E0CC9B503C58A7093B2FE69282AAAF604849D7B916B477673CEB81C37AD7 | |
| 2809 | 65B3CE3EA27E158868CF723F803409E48EE3B5B68D5116ED1276C95FA12C46F1 | |
| 2810 | EF8633329220C07A6C5830EF35E5F510F50A762EC69C0C4464175A7F8556860A | |
| 2811 | 1D8C0CA834721A33CAF6CDAFD6658B8E0FFE72369B355AD2A854D6DF4D5E2922 | |
| 2812 | EDB5DDB055ED9E349AA71B211A6C07ABD6A9184CAD668AE16F0DE68D7ABDAC6E | |
| 2813 | 1AD0A61EE9864500045F0F033303BBA2879BE36D4A52AEAF51CC1377A85D326D | |
| 2814 | 424E03664C527F74CD4466987C232AAA468048E5B517B79E4276EFE4B9B881AC | |
| 2815 | E9BEC15016A207F3B270507EA8477A8F97E8E8B108733B4DC48505F14E93B75D | |
| 2816 | 1AEB210FA5E55F8C6EA04AA441A385E336B9FCB337C53261659A7AE9F69489B0 | |
| 2817 | E4B38ADE248B90043A6EB0DFA3795DD111931CE6462CACAD0B69B185E627B156 | |
| 2818 | 960F46F9031790770D6A8BD3FC3F535CE85FDA7E27629AA14B3D97DE676EB440 | |
| 2819 | DE7ABD25EE41CC51BEC18F707D35DAD24662EA4EEAC59FA0A8F8AE09CED2653B | |
| 2820 | 013226BFFB578ABD5E2341759B229CA9D1882465784D5BCD351E3884620D0A9F | |
| 2821 | 075F1EA689A99C7F24878E8F79ED2AE6A8536F9D1BA1C07A2DC05807C438CA44 | |
| 2822 | F3E9708C877AB2BDD3F6467C39419606083598F1BD22DEDE6CDECEA07A838249 | |
| 2823 | 1D289F98A1108574C5F13B25E2545B7146CD9AF5D11BA3DB3140EFCC7365C143 | |
| 2824 | DE5C87525122EC71BD00E3ABF2939DA6BCE4EE64C4B56271B393F3CB00413620 | |
| 2825 | B4AB8AA010B38FF264E76A5E74F1EBAD812BF9E7E0188F3308D85434360F124F | |
| 2826 | 8E9B24133BB853F4E64D973254E304BE6EAD60E2343DD994E61C26C496B4517E | |
| 2827 | 69F577D13817EB375933FD3FA53C9A1BF02A89CDFC00296E2A2D2689CC850088 | |
| 2828 | 73E181933D90A88078AB76EF5C50598AFC12CEEF15A2BFE3C87B773B7FF1B8DC | |
| 2829 | 3F9A8D68908615F621BB695C57215308F69C069C24433349DFF17E8CA7273691 | |
| 2830 | 845DE5B2B736CECA05A5BA8B3B61C04305C5CFB5E089FD4A8B9E6BAE31C4C5FF | |
| 2831 | A84FBCB040C72A8D453BE0B263B223A8A9D1B74AA175F9AE02F2F4C34BA87263 | |
| 2832 | 830A03CF5D34E060ED148221E3C617D1D4C70003EA05623C4C1F2082DC633E79 | |
| 2833 | A1E9D57A4AC834BFED02856B32DC13A39F39139D59F9637B8470C944D03A8D97 | |
| 2834 | DF61859A53954B7DED4738BFB91165EC60A44BB69D607AC6B70F592224121960 | |
| 2835 | E56BE9A190DFEC3F07EE60AC62AB28678F8DCB6A77CCF44B153789AFDB28CBBE | |
| 2836 | BB99798FA478CEBF9C1BEDE10DCC704FC3FA0280EEABB6E909056242B7A2E193 | |
| 2837 | DCE348EC8587CF15D40C219251DAEA07854234A9EC835190EFD1CC69B3C7EC82 | |
| 2838 | AE57FEE324AA2F1A45EA3BDE5F60E1A232270C2105D57D3845A48837DFD389E1 | |
| 2839 | 02293DC23B6E76AD95282017E91E7042D9734D82D46E3DBEE0CC790F4052E008 | |
| 2840 | B3792AD9822B94CC445AA1C9185466DD7D28A0F7D6A33D727A485F24E709DB18 | |
| 2841 | 86AA1A798CC7758BE528C4300BA560FB89AD49AD57961E96799A1B31DEA2C715 | |
| 2842 | 4E804BE9396A1AE54C7549E73B2ED2F548B042D8DED2B7C7BAA049C7D120149A | |
| 2843 | A90B7D458D15B8DA6F533CCDF7E82D64A7E0CDEDC2D281D6B7E470D93849CF17 | |
| 2844 | 2A579C3403F6FD16EF49C6F136449EED08BAFC1E0D03CBA37B4765BCA1F26699 | |
| 2845 | 17E542001E2614D83877E37EBAD25029B97B94AC1586BC42A0A0C49066708051 | |
| 2846 | 0DBD7B46D45A02E2FDD9F2FEFC8B1217811A3BE709F392AAA03D2F7EAEC828C3 | |
| 2847 | 3C5EE95A5E273702A176ABB4B2C4BA48EE7F16348F650D426BC71C3EB740323A | |
| 2848 | A8BEF22F6EBAADB73AD4C9883557AB33451A89DFBE25CA6C184A3C37F058C3A5 | |
| 2849 | 4C6EFDA4E2B0354845CC6A38293891891FEF286712171E56FBD8B7A9EBFFF47E | |
| 2850 | FBD889E1EA7D08F7A06BAF9CD988773FCD4DAE43FC6A9F80F1D6A56E550CF799 | |
| 2851 | 3BBAEE0303933E02D1427A5842C9272D3D0A0ED94ECEAA9B82E81EDC54560F8F | |
| 2852 | 2A4C0D28B3264EA640491E24D3F7165A17725C28A6F153C742D01C7E95C79C1E | |
| 2853 | 8229B8183B8C10F00DF68899914534C58E2DFBF7087D7B6A3A4BF875F5A754C3 | |
| 2854 | B4B8713DC4EB1682B84151887B8461EE05A0C9FFD6F619B83444BA9ECE1D0C7B | |
| 2855 | D17E96315220F7C341194994375CEA1AC7C061D9E7700B6B30B5F15A6A2A61E4 | |
| 2856 | 25E6C3D0B1E13BCBE7FB89C24327AF46AC62B2EE332348B55D9E6D599D9FBD79 | |
| 2857 | E64E8BA6C960A598600EAEB080E08A0D9AF13FBC60218A9FB400D5CF3507DD38 | |
| 2858 | FE41BFBB0594F43F10EAE9CF159097226DE7706F34871A76661B6CB9EC1127DC | |
| 2859 | 09651E98E34D3ECA5BA7D695B27645AC8C16364CA380D45524D700A460051B62 | |
| 2860 | A69ED221BDA45051C1723796A305A3A7C85A62F5DFF7F7ED690DEE4C0BE2571A | |
| 2861 | 155ADB8BF7DD4E6B31AAD3D884337C1A2F99FAA44BFDA357966C77C35A435411 | |
| 2862 | 2AF36766DC0BBEF0B50B742A9C9E8541C58AD964B26C47BED17B5BDD9C5520F5 | |
| 2863 | 947E4B8017AFFF9FDD3BF15B2DDA6CD750E09222A3DF1D9ECE2AA6E22CC5FCD4 | |
| 2864 | C6746E58BD628558A7157B72F6370507AB0596FD4F4821A800A358BE7B62C7FD | |
| 2865 | 92131D308957E99FE4408ECDC0F48F5C747680992721F9D96B41B956C14F8E13 | |
| 2866 | FB260376C508F88D30355C94D0208D419F81019EE01A114E20EC2438C3894C79 | |
| 2867 | 62096B4A5F6288116308FB98EB0DDADDB259205A11C56C6AC6C5E1C8FF45A25A | |
| 2868 | F16596B76397BF54C3DBD0ACA1599AC886415E46EF99FD15C9218125CF0426CC | |
| 2869 | B6B5BC60C0A14CFD116DCDCC3CE7DA6962B972AE23BCBDC5F283A807A63C1C8C | |
| 2870 | 9EDC5D95CBED7A9E1D63876A55C7A8878DBE0C66FAF5E7A680416840156FC63D | |
| 2871 | FD8FD7FD12F32245B3084FC3532F3883DEEEFD52325439EDADE56EC1B4845CCB | |
| 2872 | 282FA0EDBC405ED2FC3B01FC93D1ABF06B64B2EF4D6FE40B6BC91D7540BDC5EB | |
| 2873 | F3681BA084FE84FA153E8E11442A7840C6F7FEF98E346601A67885B3B0AE2EF2 | |
| 2874 | E3703ED14AB786488C48CD937E9DE8B666CD25DFC9AA9351338605D653BA6EC8 | |
| 2875 | 16A18D7181B2DB084BB1D3E75C84D8CD3533EB35F150F006C6047BFCABDE14EA | |
| 2876 | 32FE9A0C1BACCBBAB3F6595E1D11D279A34CE66D0BDC09764436A23BAFC467E7 | |
| 2877 | A986D6947DE65B77BC8480B94E6F66F8B4D93FDB517FE1A6C2AE5FF3BDA37919 | |
| 2878 | 6F34C72EDBD09CDA95D751CB5ADD93B422E98560EA03AFE810E1435490C19405 | |
| 2879 | C534026D001C4E2A86EFA7F342E3967059BE771E728361AA77E8C2F497442E24 | |
| 2880 | AB938CBA02C5FD0561A601BBA8AE96E8232212DB222C202C1AB4B4EDB4494CA2 | |
| 2881 | 77221C9EE7810640B730DD31FFF60F2A05DB7FB80577A48513BB9A76B262EC6B | |
| 2882 | 751157FA65B47B7CE97D61DC0161877F89210EF3C9A8CEC5DBC5EDA5B9A8770D | |
| 2883 | 7643300C9C3A5D00F0FA18BCBED0295833612A57246D8184975ADF14D84C32F4 | |
| 2884 | BBF15E6BEBDA45A2E8BBA461D53C090C25BF7FD351CBF69CC904EEEF8D7802D5 | |
| 2885 | D14A4EBE6804075D2F742384749150174603F14519BAC00B220E83F7309D15BF | |
| 2886 | 12A0DC08230DBE23EF40048A77ED17D9F931C817F780C67E59ECFEA62FD4D8E9 | |
| 2887 | DEB4D1A8D28643C4E476AFB2F86FE8E5C353F08B9D0F0C10035B1737A7D51F4A | |
| 2888 | 6141D0000F04113A7FD710DFEAA16CED294E5AFC3856BB243E2A676794DE99EF | |
| 2889 | 660C4B522E5A4EDAD43C3A0A359B4B34AA9A59A6E2D4E5217553B790ADF45A9A | |
| 2890 | 7636529EF840879F18A34C3C2D5207B4D14C59E264A6415F142A7C0294597D64 | |
| 2891 | D02A28F126E774A31604FCC671E1BC0FF681082B2818792A60DAE56FFEDEE3B7 | |
| 2892 | 6EA7A834D088E6D10B1673F3250D229F1BF59CE4D0AE3376E6FD99D883B2ED03 | |
| 2893 | 71B72A3F679A5DBD76BD2FF6C04435D14364C4A61AFBC0D5B31E48BC631C0545 | |
| 2894 | DD3C1C0FBF3123EC3944C404D37398D05BE3756848E59FA54EE7C34D0D5382D8 | |
| 2895 | 74DB6A6E70C7A5AAEC7B941B4F5D800B226D8976473FDABB34FDBFF2C6016FBC | |
| 2896 | 5E34BAA392A29B7CA9F667D609EA7A391C6067566631FA910BF17DDC0CE56F37 | |
| 2897 | A2E6A22228A4A0AE138924F09275921C8DA60D818AAB8C2B06108DCB9A85D6B9 | |
| 2898 | DF6BF40ED6E86DEC75A2DB917E605C1735D5896F29D762C77AC212994AA2F9D3 | |
| 2899 | 96857C5A2F3E86FBE7E34F34D8E0CAB1024AAF59699844CECB49D7A429F4BD02 | |
| 2900 | 5567416D4D0152C3D0B6B77D7104B20EE19EDB264DF437E51F4BD92D21873FBF | |
| 2901 | 3D35B2EFCDC5F146491099BCBD3B381AEE555FC25A7B0713FFB082389975552A | |
| 2902 | 825B8762D630B204B99D97E0F0062B358E1E443D65CD8DF3CF8284CF38066DEF | |
| 2903 | 3F130A06CCEA592955EA05F416E0F67AEEB690D626728426BA54BC4C4083CBD0 | |
| 2904 | F3F9A0E7EBF3B1489C019F7A29FA78F77D8A96251B66D73C7C858E2B7AA768C0 | |
| 2905 | 31CCD34792D6D093643502BCB4453C3D5DEA5B577EF92D3EDAA22E90827F3573 | |
| 2906 | A811FF5C5F6697AB88C42291498BC348F4102BFBE007D68092C0057DD8576A9B | |
| 2907 | 5BD032CF7196103028156CDFEA122F9A7101F0DFB1C73D3B5605A73C1B335EC8 | |
| 2908 | 7DA6B4CD39E976F7DB91CDA187B1CB4E4338F7C72873F24D5C02934BDFDA019A | |
| 2909 | 69FAD10C96BD82D12D07A2EF76D86C3082E1D68B0A4462D0635A8F15245EBDA4 | |
| 2910 | 4EDBC69D510B12637F02ACEB3A1DF278C4055B98D77ECFF82BDDBEF4C5AFE2B0 | |
| 2911 | B88A9EB5333AE842093A80E2064BD36D5D81AAB9D80CAA04B55943FF5A1DDE94 | |
| 2912 | CF3CA32648BDCFAAC88E72CD3ACE65C880FD8BB75B11A8A6ED351524E1DA35F3 | |
| 2913 | 13466B349A3E4CEEF0C1160B1F95643B500A171B33ADE7D55F4EEE1934952333 | |
| 2914 | 2CBD044D07A12985D93FE51C93EC8F629DC423458C1B631A7364E17B07E89C40 | |
| 2915 | 256DEF8A88897ACA388014A2C6969ACB9B3AE6925B4B4543BC924061EDCF86E7 | |
| 2916 | F51F447A7FB62E03A05EA6FA2DA1CD76615680FE009621148647C7C74E4BC6E0 | |
| 2917 | B34B356A3CB8947E0F775AE6079FC4594F39A4B8218E5D27DDA4583D9D5BAF07 | |
| 2918 | 009CA08E3E08E407D0AA9EE80E3B0B049F37DC38FE8F7FD055CE316D72A6993D | |
| 2919 | 60CAAB09DB8A899E5EBD8AF11BBB8B2EA8E644D2B6CB4D9EED9266EDDC3A7ECC | |
| 2920 | FBEBADD9506987DE2945A65D027DE828D5A12FB0D6AEF5D6A2035421DB46313A | |
| 2921 | 9CB95EEABB6F5A87013C3F3130DB32B3D955D22C9F3095A19715D341FD118259 | |
| 2922 | C661FC30E9D781B32396A8A2EA06122045D98EC5FCC6CFE11AF9B2A2FBBC99CE | |
| 2923 | 45925EDE91D6A964B68EE20032B96A71B48DACDBFC145B6F6DEA7F011DD7B246 | |
| 2924 | D9DBC3CC6B1EB35F471FFC463E8444F1E1CE43D3D41A113D9601C12FDD755E34 | |
| 2925 | 86B8202134691C4DA22717CD3F9F958CC6E7BE20CFAE9F10EB67C0BB58E40F17 | |
| 2926 | 5E3A142AE71E3619B1B61F706F611496EF29DC07111BEAFCF4D2979D39660C0D | |
| 2927 | 05A8A2BA5D2E0BBE2F522B6BA0A39B27AFB2FD2DD4666A0F895F49F7833C2661 | |
| 2928 | 88D28BFD7522A9CE8EA109E1B8273A1295F4982907109518E82A156A9C4D7F27 | |
| 2929 | 9B7EA2CAD89D22A3D56637D5427AEDEDA98A6D9257B419D761C8AC925B61C93D | |
| 2930 | 5E4C47DA6EFCC66A6A4D3B7FC1DF27C6F5C7919E34E9E7CA982C0D40C5D53F0D | |
| 2931 | 0A09C57FF29657A7FA230102C9487A8D68F93F278BFF94E6CFE8E5E3BA38A082 | |
| 2932 | 744F9D018A6D7452D2BF0D06BB61D72F7767A4E9936DDB660C8CA18468262471 | |
| 2933 | 3C81A68BCC375326C935B90D02F80B704F479DD7F030B089685F091B3144E794 | |
| 2934 | 11D284BF2B8502964E4F6C7B79FC2C37197D52166E377D66AD0E7D0325909D46 | |
| 2935 | E0F8A35807DFB8C8208BA672EC21188149F3155027F16A23AAEFDD2F3AD642F9 | |
| 2936 | 310D631E07655AB6885C6C3882CCC8690D05D96779CC83A117D946E2F9F6521F | |
| 2937 | B8F4458B8E01FC30CF59ACDB52DAEAD21F7B7F490D74898F2570C6FA5B4DB522 | |
| 2938 | C077FF694CBEF398F0207C708D7C3E4F8EF42FAB91ADB4CEACB592E56035DA1D | |
| 2939 | E8C44FE37116712D588C873D8C2C51B960E97D07651D611AB133D950258F0A2A | |
| 2940 | D8C4557DE5EC6D98E1298B71FF08B5F59C6619AEA88CEA839A16B9C810438B78 | |
| 2941 | 060594A85095D525246CA31DB045C2BEEBC0B1F8262C59F9A687951AD2A1A5E1 | |
| 2942 | 3049E4BC2CF76E90956DC45670A6A7A6A4A07983758BA4887552CB30DDCFDB02 | |
| 2943 | 090E12B56D356EBA8E7AEED14E4EA4C36A528A7F5105A545BD9EA5BDFD1F04E6 | |
| 2944 | C65428A54A41C5977142EBEB7F49D65F1FAB9FBBC2C283EC7AAB8562047E013D | |
| 2945 | 369A009127BAE150E7822A278BB3638BDEDE5A1985DD3081F08EDE5E0EC8C4EE | |
| 2946 | 56AAA592D3EB3BAA1CFFCE3AC23854790D0B648E83E2FE3C2CF7A14ED0601761 | |
| 2947 | E5A377DD4CFAAAA59D375499CF40DFC355D344AE50DFC65E4E5AEDC0ABB48A2D | |
| 2948 | 12DCA4C33F9671CBE7CBFF6D302805F433F581B4A6B1E4537EFE9C11F8C808F1 | |
| 2949 | F9C56321C402BA29DA2BDA3D2468CF3A26276929980D53E3BED09C5D9C2FAED6 | |
| 2950 | DBF053142E82A04F618CED7F51D09C28A1885DA028F275B85D3BF5DB6D20FCAC | |
| 2951 | 6202ED88D2DFC36D642FCB236F51B4016D7380CB85FC2306D986345F8A127EB8 | |
| 2952 | E32C7118C0F77B1B668D54FC2E8A4C70A681535A5117DB2E3D9ECD1B59A476CC | |
| 2953 | 8BE712591E1135B8E05652849F3A0737EDAA98E160D39A1C83AB9E586DE2524F | |
| 2954 | C22C5BAB3075D6198C15F9E6EC9C066B085B532B8B1ACD16EDBA42DDA0C6E2C7 | |
| 2955 | DA50A742E55A1C4B86332FC7406BEE517373BD0E5A252763DF5886F433E60A64 | |
| 2956 | 7BC6B0E70FB998C448F7C2D431249B581BF20680572405853CFB5CCAA1DE68B9 | |
| 2957 | D6AB0E0FE7E0C4D9DF2444267C6428C6D5CFAE69D651651FBF84C606282B4F95 | |
| 2958 | 0C81904C77350ECA5B82128A4BD281C9889912ECB461D651652986EFA8B701F1 | |
| 2959 | 4B721AFE6AD536CB1968FE14D0BADCBBDF798D11F4DC6A3EF533B3BB8A236595 | |
| 2960 | B70C4A03E6E33A6D44F93FB54A63063328305D2193E012D24E4D31E62CAE4DE2 | |
| 2961 | 87D59D842475522204CEBB88D08AB0DD5DF57B6F165C693DD0AD34B87F89AAA4 | |
| 2962 | 9F7B7A880BC3A5DBDFD9FD9C3D3B9DA30B132CA968A216BB52434FD3FE77BA51 | |
| 2963 | A70210B1ACFD28B81BDB75F97712DF6F7297F34A59A393006A881E2B3CCC3F7B | |
| 2964 | B39C8D6E99AAAC39B071B7F383F9E8EC407118C5DC17BEB0D737059ED7DCE758 | |
| 2965 | 83EE43E0514015D490C2271FA5463B93EAEF9B3BD3C88CD74A19D9DC95660C96 | |
| 2966 | 0A38B26D3B023FFDD27FF6E9D98ADDADB54825D2B555206F0E7C889DB55347DA | |
| 2967 | 9A4C9519C0C8A8D3ACDC06AB3069268BA83984376BFED1CFE3B1417845911CAC | |
| 2968 | 5428A0800146CF549EE78C263F36DDD8A04A75BFBA4534A78412B7C2B6EC47DC | |
| 2969 | 49223DB72FCDC5E88839709D704C196133A3032149AD0AE29950C8D6509F877E | |
| 2970 | 04B849B5AC09421BB33B658D30CE6E04DA1A35862043BDEAB7BC684E1A6DE8E5 | |
| 2971 | CAF33EFC866D6D075C269693690750D526B801DBAF5099A04BD3E911135B118D | |
| 2972 | EF01207599588E25EDE475FA428E67AD93FFF63682A9B1F9ED495C7AD50EB96E | |
| 2973 | 836A965C2B27CAC71CE79170C4F56E0497F0F6CA9041E92E1D01078FC922DDD7 | |
| 2974 | 3F79147EA667173AB4E64AB4E3664054547AFC2E2E1382FE059C37B352120D69 | |
| 2975 | 6A15BBA8670CAE7E310B03C2A4B12FB33617C17CB9D992AFE2DB2A1BC1DA806B | |
| 2976 | 1B82DACB2C1157A8D3F5D86353C12F474078418FAE22EB4213FBDFED904F0156 | |
| 2977 | C17A9C5205DE359694C899E992E40C2B54A565F4777C0147E864F25FD4C487ED | |
| 2978 | 6CB1C1BDD93702AEBC7278FD7E62A79A28F7E3A16E763F154471E001D21D4FE3 | |
| 2979 | 2FD8ACBBCF301995528042E861A9830ACACB99669EABA851FF2A8609D30B9775 | |
| 2980 | A048BEA2E1B538D9865A8A646E907407EEBFAB32F76BDF132E905764EAF10891 | |
| 2981 | 907EC36BDB2D8F89CDCF5365D2FDEF131B23A8308E05A696E5FF6EC44066FA26 | |
| 2982 | 9348C4249B64F87D71C552F9CEE2AD126AB9A9B6FBFCC58438C6248A7C0962C5 | |
| 2983 | 6D7622CF440288F906566E4947699270D4E5BB1E9D80E10C17A7147852495892 | |
| 2984 | 707F47DD09B09802B37B1D40F848BB9C732941996EBF595184E4F484BE6561EE | |
| 2985 | 9BA94C00F1AA76BCBF817C814CDD4ED94F025A31765A118C75E6F3B2C6C2767A | |
| 2986 | 090D5389DCCB5A0ACCC67CB1B1DA2EB5B4B3EEAF5A4D7F390BC83A0C1B2B0910 | |
| 2987 | C180698E9E7F9D288C3BDEBD37D74CB5710AAACD2FAA4686A9A750064F6B306B | |
| 2988 | F86C9F4BB77ED693419232AF4C1D897A6A5B737B41647A7E37350BC7853FBA31 | |
| 2989 | C5CA92ED67367D9858919229645A81EC6E30BE97FFF25AE6FE8CB16709D4550C | |
| 2990 | DD5B4098ADD0D4D60ECE796384C007203A2B00595CB4608AB8C265C4E67FEAAD | |
| 2991 | 7B5AEDADDE94CCB6FFC545A9E3C47B8B911110EDCAF2160135492B722879C62A | |
| 2992 | 6A8FBB02BE4AC067194682264771595601859CDF549C3BD7A3DBF7F681D01F2A | |
| 2993 | 1FF5329CE52A00E9FB7F76E7F50A2B37AD1DF467A7B63EE8555FCFEC2A8C42CF | |
| 2994 | C2297EF18EE8D49B0FAE5FE08857F0E0424FFCC5804D3063715F039C7F87396D | |
| 2995 | 579C57944840382C2A9524DDA1BB3C87866EF386581F2B1ABC18BD49490EC9DE | |
| 2996 | 5D184B752A976528892A0401AB4F165BEDA7597236C6A5433D7B8486FB007DF5 | |
| 2997 | A0A8503322639EA7916CE8D727284E90CD3F657E07C10370B3D8708B26AB933E | |
| 2998 | DAF9BC060C2DE8345802CB0A3FF962FCA229295E15A02FB35D15476EFD85EB05 | |
| 2999 | AB102C504AC86BDFC3613EC7E947D5411CBE0A66AFC012115334ECA15BB0A353 | |
| 3000 | EAD3C33090046DD5FE981BE10A7EE6FEB747178AB6357EE22F6BE81D0FD617D7 | |
| 3001 | ABBA0F7ED0CB5E14F213A96854FE0FB0FAD0C3469A9590BCF9E7076BDC8BDF20 | |
| 3002 | 933DE9DD6E99EA0C7DF1D28114B7EAD10367BD28A82314829E4FAB344F3A8882 | |
| 3003 | 080BD2A920FBBD2227D2DA1FD6AF21E538DC10E50648535187EFAE304D0F72E5 | |
| 3004 | 0746BE1853D59A1FC89BC3847BB8A0EB5A1BFD83B6E465D79012A80E27AE7BDA | |
| 3005 | 590BCDFDAA602DDD8D596F3B57490A564120EAEBCDCE0EA0000C572266CAA363 | |
| 3006 | 536E654DEB595B137CB03701ABF08EC994B2D48622DCF99E137BB27DF2FC85B3 | |
| 3007 | FFFB9D781ED87B39054756B9B9AE7A13978E8EABD8F30804031CF77E698F8852 | |
| 3008 | F26626A3D817D3A3234475A80C1768CABAE431CC6E552596818F9B47161B8C67 | |
| 3009 | CFB0618039025E0B76E95B770BD302F3EE622C5E0898B34027932498345DF0D8 | |
| 3010 | 32C65257F9DB75D158EF0081911CFBFD8E73BCC7F254C17C0B72AB39CE7EEDC8 | |
| 3011 | 8ADD52AEB813C016D982BA5F10268E28466947C765F65C80E2595B2F732D4E68 | |
| 3012 | D69A757D8230F6ADEB79D31EEAEE284EBEE7E40A99C422050B338A07564BF7CB | |
| 3013 | EBDB383FB6E5F632A972450E4F88241F4C7CA492A860822054E41BEEB3A59E7B | |
| 3014 | 6D6E769894FD8FE20B47D25F43809077696F516DE603D4EF1D683FC9895B9C4F | |
| 3015 | 00D38E738BC1899C9403F9BD7D861B0FB18AE11BBAF4438303AF6D1942A41DA0 | |
| 3016 | 29FB10183B46BAC9AB9E858D95CD54DE11D3167B94F0642E89BB08082A3E589B | |
| 3017 | 33797A5B481669A45C76463B69BB4EF884CE76812BA488BD8A32DEE0AD6E9762 | |
| 3018 | 10DE07FF0216F6B88AECD07E5A1DFE60801607FDC4F03D9A5B074E59A2EB23B8 | |
| 3019 | D85503FA1D12A6717FDC69220E31B04911E249446AF19FF550B09DBE833AE75D | |
| 3020 | 6BE48EB06866CDFB7999E9FCD923E5CAC8286D638C643AC161A80B1FF87A44AB | |
| 3021 | 6181929F69A6795591D319879BE5999F200F0556650475472F9863BE3525F6B3 | |
| 3022 | 9DE2D2CD94229A257602F4956A0018A4211324E3ECEABE650EEA36D34A77E5D3 | |
| 3023 | DCA8AC728A71377A9E7A9B12E58492196C852303B9DD4EAE6983066C6ABD4D9C | |
| 3024 | 7787C837EFAA2F9D3FDE032665323585D4450A9D3E8C7E8FB2FBC87234CAF228 | |
| 3025 | B5C1654EB2B36AA06224C22A33C7E0300ABA12825C47D2F20BD71C03D546E4FB | |
| 3026 | 2FDD37D7069C6A8EE431A45D810E52CF05A478945988DF389AC0DC8C807CD51F | |
| 3027 | EB049AC262A09D5355907421A5D3A5903A67C79F2F82BC62EAA06EFF45872229 | |
| 3028 | 1E9AE5A761FBE2BAE8276314A1ABB109FCD681A0E339182720A41099D77C47EE | |
| 3029 | 7B6586829BC6728C44BA90D2A259130B78EA3648EAADF62B501D8482D7A0955C | |
| 3030 | C7972E5C22435AE131CC837EA6481371E79535B455861023D881FFE838FEAAEB | |
| 3031 | CA47DDB85DAF8FEBE91A5897CBCFC4E2E49213855ABFE6FBB558A9E27AA46244 | |
| 3032 | 49FD8FABD897417E0008B57675283EFA92780046E5A1D41B3FFB3399518EB86F | |
| 3033 | 4D110EAA5C0AF45563103B89A9388929E719EF8FE2794B8BD18388DD66F2EF1E | |
| 3034 | 8C4206510EB7BE863F23D255C45B40CCCFCA951EF67582C00AFFF61C2199B046 | |
| 3035 | 5D7C463F3AD70446A29F899E95EB6898721C737850E4350FD3660BE1FF7B317F | |
| 3036 | E2F170120F972AE9923F79D453B5E51845E6264A41E1CD7545C35BC1AAAAA545 | |
| 3037 | BDF3D419D9D2E6B1F8DC295004689506BDBF6BF47BAC17CFEBB565C41700E784 | |
| 3038 | 70BA1163B66A4FA197EF0D2868B1FC46E0E8695F8C92BBECE917C792442AE284 | |
| 3039 | A2F859DE93424F51D52D5D1C00DEF99BD1F1160EC2F94F84C3BB59C1EE56CA69 | |
| 3040 | A6616AD396B9469FBECB6B4986EAF6E439441CCDED87607BDDA10757BD4B439D | |
| 3041 | 28ABDB82D4CC8D4095831509F1087252BBB1DF0557B2F6275F7CC610E8742C01 | |
| 3042 | ACD9F985641A3C16A8BE1B172BFDFD36115855AC40A04C6C26060D6D95A10707 | |
| 3043 | B1F56D0DEDA7A48E25D9281790D3A2FFDDD479F24A3A0E68FD097448CF500597 | |
| 3044 | B662EF8DD419AE338D4C81859547CB86FABDD162907034D2ED814895115E76F5 | |
| 3045 | B8BA5DF352CBC93260002C3D72015180067F1A74ACB5A6BC48225E116395EA43 | |
| 3046 | 65C12774423923E4859AF3374456F204E0FDC9460E8EE2E87098B9E7A3977992 | |
| 3047 | F106D0A8C542DED8B2E4C67527810CD19E03275998684483F33E9A6242ED0330 | |
| 3048 | EC553A673B1B34C89057D5972BE82AED5E88B5619C748DEBF6EE02489C51D3C5 | |
| 3049 | 6DA3478C65521B8FFCADFA3E569963649019CF46AEA9357B5EDBA74A43A4A199 | |
| 3050 | A132885B74D5879BD2DDD2E444187737BE8CDEC939500F1CFF538BC8373266F9 | |
| 3051 | 2E91BFCEDF58A2CC1F197EA1A941E85E021AAD4F94AB54986AA42E138BF54E26 | |
| 3052 | 78BC33104EDD4E86565FF8456CD151FA2ECCEFC15943B7F0F23C359608D48D79 | |
| 3053 | B1BDE2A0308CD359089009E0B39CBC21FA4B337E7F502595D6B22CB92C096709 | |
| 3054 | EEB2B4D1D8F697EDA69C13EABAC0FAC550C5A15D1018B6DD4D740EDB2F9C700E | |
| 3055 | 9383D7307D0F6CB98006B0453EEFF884949DE1CDB38A681B412E2A98312C3A8E | |
| 3056 | FCDB7080BBCAD61746027D3261389CCC55A6159B18B3B29B36C5071846117431 | |
| 3057 | C67079CDF2E5DC78EE02F82716E31D6B63AE901E7BFA1EE86F3858FBA107B735 | |
| 3058 | D42155673489A7714B683D2BC5D630D492F1537823001E70EF18242F06F52F38 | |
| 3059 | 80901A5EF067BE5F2473DBE171E8D85A89796C98074424D384F01DE987F5544F | |
| 3060 | 118527F4C19427E8338B8CC7050DC48AC4BDB23C160EC2918EDD2AFD17B4DB92 | |
| 3061 | 7B9736676D6AC40AF23A6541AA47141C047D0BFECF7DE8BC917FD34A13F2EB7A | |
| 3062 | 28A0EA62137A8A1CE7BC5F1439242084A4DF8DFEEF495D308830F04DD7D2286A | |
| 3063 | 499E3802995BEE8D3236511C1C2F6B5CF4668857386AA2AA42872E5769B49F66 | |
| 3064 | 61F058103691825DCDEF5AA4554F4DA460FACBF69DD8956FE3F1766A72143EEB | |
| 3065 | 80D4F8D3A109C2277C620322B6B33C62382F4AC88E8A49451914A5FDC69E33FF | |
| 3066 | 3C65D1FF4A193AEDCA633FC5BAE6D10D63A98E0A2596B6E65456327E59EFBD37 | |
| 3067 | B5C45EDC86A4BBD9072061856C4FA228250640406F9976645171978F6DFF12B2 | |
| 3068 | C7946FF5FB10F4532F4A780BA48F5B203B223AF1043646A484CF7B4DB3628B9C | |
| 3069 | B06DC7D8847A42F21328BC90A7BD8131B330D9EA2F513C564EB8B4B0EB3E404C | |
| 3070 | 13069D6ED4599EE4DCCD36A4178007D1AE551FC0863FBDE1CD639F05484598BD | |
| 3071 | 33325BBE61C5B10EF6A89886D854D6AD643005210262770A6F4D92E7328BB00C | |
| 3072 | 9E2D4DF7F41D941952F9A08D318EC90A5A6E0EA95DA7F21BBE72DBEA4BBD0002 | |
| 3073 | C7677F14F2DEFA91794674B4C06696C5D11C1350CFBD4F56FEDB1EFBAF120B6D | |
| 3074 | D6CEF9ED27A6BDB215C4D25A0973CDFFDDEE574D4BEFA05AD9EF3BC70129B888 | |
| 3075 | 84B6160AA09A3C2DDF44283511B376658B9985732F27A8B60CB60B87D8BE7383 | |
| 3076 | 6A2EE83043FB5390E0CE89D7CE02E9C0B90183E959CB233AF3754C137962563D | |
| 3077 | 253B70B07A45DE56E476437DE41DBF7D178A902E899021E822C511CCD4EAA212 | |
| 3078 | 4687E475F6817C093719800AC5E9B6F6F80C7A275DED35E7E8F35D365C070654 | |
| 3079 | DC5ABEC55536DC085808CE8B657711B9CE5F2347A5F99808EDFC577E587A6878 | |
| 3080 | DEC190AFFBB5E443EF719E72A8B5541EEE670E90B36042712FBB0AEED585B70F | |
| 3081 | 4260EC637590AECC2407A7DAB5D789AACC819C3460881FCBD0BDE3DA20E5A62B | |
| 3082 | 3B021CAC46DC9557559B483AB41ABD4B0EA498F483730454826891EB93523F32 | |
| 3083 | C07794BE2DEC3A86F0ADE128E9FAAE879A961B04C12F1F0E65CB869DF7C6A79F | |
| 3084 | C7CE635163CBE878B3E8723706AB83A9334F4C67F72D28BD1D02F9600BEED3D0 | |
| 3085 | B4DBC423710CDE7FFD92C96E5B80D79E2142EBF216F4F10A857A744DC7BCFD44 | |
| 3086 | CA57CC9ACC7726B1A8F09039F77F0B1CD29FD64DFCD6A179961CA869E3AF0A63 | |
| 3087 | C1D1 | |
| 3088 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3089 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3090 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3091 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3092 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3093 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3094 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3095 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3096 | cleartomark | |
| 3097 | %%EndFont | |
| 3098 | %%BeginFont: CMTT10 | |
| 3099 | %!PS-AdobeFont-1.1: CMTT10 1.00B | |
| 3100 | %%CreationDate: 1992 Apr 26 10:42:42 | |
| 3101 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 3102 | 11 dict begin | |
| 3103 | /FontInfo 7 dict dup begin | |
| 3104 | /version (1.00B) readonly def | |
| 3105 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 3106 | /FullName (CMTT10) readonly def | |
| 3107 | /FamilyName (Computer Modern) readonly def | |
| 3108 | /Weight (Medium) readonly def | |
| 3109 | /ItalicAngle 0 def | |
| 3110 | /isFixedPitch true def | |
| 3111 | end readonly def | |
| 3112 | /FontName /CMTT10 def | |
| 3113 | /PaintType 0 def | |
| 3114 | /FontType 1 def | |
| 3115 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 3116 | /Encoding 256 array | |
| 3117 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 3118 | dup 0 /.notdef put |
| 37c41ab1 CR |
3119 | readonly def |
| 3120 | /FontBBox{-4 -235 731 800}readonly def | |
| 28157acd | 3121 | /UniqueID 5000832 def |
| 37c41ab1 CR |
3122 | currentdict end |
| 3123 | currentfile eexec | |
| 3124 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 3125 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 3126 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 3127 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 3128 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 3129 | 2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D19 | |
| 3130 | 38DD5C4467F9DD8C5D1A2000B3A6BF2F25629BAEC199AE8BD4BA6ED9BBF7DABF | |
| 3131 | D0E153BAB1C17900D4FCE209622ACD19E7C74C2807D0397357ED07AB460D5204 | |
| 3132 | EB3A45B7AC4D106B7303AD8348853032A745F417943F9B4FED652B835AA49727 | |
| 3133 | A8B4117AFF1D4BCE831EB510B6851796D0BE6982B76620CB3CE0C22CACDD4593 | |
| 3134 | F244C14EEC0E5A7C4AC42392F81C01BC4257FE12AF33F4BFEA9108FF11CF9714 | |
| 3135 | 4DD6EC70A2C4C1E4F328A1EB25E43525FB1E16C07E28CC359DF61F426B7D41EA | |
| 3136 | 6A0C84DD63275395A503AAE908E1C82D389FD12A21E86999799E7F24A994472E | |
| 3137 | A10EAE77096709BE0D11AAD24A30D96E15A51D720AFB3B10D2E0AC8DC1A1204B | |
| 3138 | E8725E00D7E3A96F9978BC19377034D93D080C4391E579C34FF9FC2379CB119F | |
| 3139 | 1E5BBEA91AE20F343C6420BE1E2BD0636B04FCCC0BEE0DC2D56D66F06DB22438 | |
| 3140 | 452822CBEAF03EE9EAA8398F276EC0D92A7FB978C17805DB2F4A7DFBA56FD6AF | |
| 3141 | 8670EB364F01DE8FCAFBAF657D68C3A03112915736CEABAA8BA5C0AC25288369 | |
| 3142 | 5D49BD891FABEFE8699A0AE3ED85B48ACB22229E15623399C93DE7D935734ADA | |
| 3143 | DA7A1462C111D44AD53EA35B57E5D0B5FC0B481820E43222DB8EFCD5D30E15F9 | |
| 3144 | BA304FA879392EE0BCC0E1A61E74B3A1FC3A3D170218D7244580C7AA0DC65D19 | |
| 3145 | 741FA5FE6F8CBF60250ACC27454BBF0897CA4B909C83A56672958752ED4B5E79 | |
| 3146 | E18660764F155E86F09EFA9F7685F2F5027EC85A775287B30E2069DE4E4D5712 | |
| 3147 | E7D033481A53A2702BA7542C71062173039030CF28D8B9C63B5596A9B42B33E7 | |
| 3148 | D922944A38713383D3648A4AF160A3B0C8F3379BA4372BE2E7EA49AABA75AEEE | |
| 3149 | C5DDE1D8BF68483C3D21271280ABB91D54CC819680322EAB72E1250A760BC8DA | |
| 3150 | 726405EFE420635B5B7F0B48752C06083E92BDE06401C42A2C528C8A60381227 | |
| 3151 | CEBEF0C9440DC034DAD9C19FB27DB399BDAEE22053591D6538587C768C1B7B0B | |
| 3152 | 7D1E222D2D8AF3A6473CC4C0D6C3E0DB49068CEB8C9BD1C5CD486A50DAA10BC7 | |
| 3153 | 7D6286142355E3F21DD254E27C00C442728A0BAEC9D3F17AE9CE320D365152E9 | |
| 3154 | EB0D5E3874F2BCEDA98521D23FCFC30B4B69DAD2ADBE80E5964ED0ABEF6C73B6 | |
| 3155 | DAD30E2C5061E3747FE536E1A5D190D028F2130AF608F5DDF9DDDF1E77DC8437 | |
| 3156 | ECB3EC93B33505DF47884DDBD1DC6BBE4098DF04A29AF6FA3AE344600D0AAB53 | |
| 3157 | B3820DD7ECB600A3B8001C51AF2CA7A39AE1485A087FD1752DF68F55B52B4DA7 | |
| 3158 | 48030F2AA7E570B3D56C4EAD367B9B73FBC0A7356253233006178B9A6BC19081 | |
| 3159 | B815B5988AE76FE6FAFD7AC239072B1106A3F509381AAEE79B2F2154CAC4727B | |
| 3160 | D199CDC8B4D05DF4BA006982512ABD7539E28D937B0F87FF79A3F84C29ECF943 | |
| 3161 | A8DCB8BDF8EA9E7A0E7CD60BC2308C96B3E889C797D0FF28FF4847016B3DA141 | |
| 3162 | E76FC6BE78A6EE9CE07E651FF86E720A1A1F075972D36E5C55162E3FE26BCE3A | |
| 3163 | 814BFEB12D4C5FD24340CFFED499C7CA183E57EC4F12CFFBE3291D43F7270575 | |
| 3164 | C6C3306F832EF182ADD0AA14C4D8669A17C09F632406AFA195F90C4DDC39779E | |
| 3165 | EC0A77E590211592D6EE19563963225C06C2F13265EBB5A6CFB7C17D9E77650D | |
| 3166 | 11958305727AF662AE73AD0E3ED5F7E7086C5A0C3548A8129575980B06C715AF | |
| 3167 | DD55C8DF869BED0A7883491030B1A7E82C5EB04E5A7D952E716DD8F2EF6275EE | |
| 3168 | 087614CFAB55FCE2BBECD7E8D9C90FD8359E929D5E0A416A23BD58158318B4FF | |
| 3169 | 87B095EB63F7F052B3A77F136FD66EB2C52BD46CD7DB3091A4B78A607112B12C | |
| 3170 | 4D171B2A00B78B0E1C44B0D90C20D9244281F5123DC1F6063F91E9E3E48DE78B | |
| 3171 | C862D848BAD073A4FCB5EEC9FF54B5AB8E234CCC3C7439C62ABC4A13EF1B8897 | |
| 3172 | ABBF21F900C564C9A305FC36FC7224932F766E6E72C2EBB55953DFE2AFC2E3FD | |
| 3173 | 33A0C6F0FDFF086E9FD796E7242596AE85B877223532667625E371D2156E4C04 | |
| 3174 | 0D7FFCD3337B93DF066CB6FE1E13960719EB7CB409EE805C08ACD2C06303ED9C | |
| 3175 | E34C898787A43C1B428B896551C6FEB50A831C6F8CE2073EFC662EC286CB7555 | |
| 3176 | A3B42E58772E82FEE206948B8C439FEC5E4ECB9E11DC3A4CBC7611E30890E408 | |
| 3177 | 637A01A2118441B4F9467A98BB2A1B03BB2F5D8E3DB7D1D15C188D9E856088EC | |
| 3178 | B762F07B1C06024F7EF53A2FBD60C0A1F4C0275D07164545250ECEEF8CB15B04 | |
| 3179 | A2D8AC44DDE818C4E3CBD2A5FA0FE49750886CD7CFAAF8B780255F89DF7F4F5C | |
| 3180 | BB594FE7C1597DA71813C2952AD3E811524459EB71D29696B450C924B6A5C843 | |
| 3181 | 8F36A0F1D7DFE796FB9564333666D74AE614D0D698FAFF20F83C86524C894BB0 | |
| 3182 | 272221C060544F3B653CB0E4E4F82B20D7530B3806E6A5830852C58070177815 | |
| 3183 | E287C847F19F64E854F1463C23DDD80093D6FEB8BAA22C5F05C21F99FBA7193A | |
| 3184 | EB7CD49CFDF4308C6C68CC955A45FCFB54FCADA9A3BFBDE086B057DE88BE335D | |
| 3185 | 280F5338D7E66AD39FD08F9B55884F1F377FB6869FBABE3EAA4B7ACCD85BE672 | |
| 3186 | 724B4B8F236B0889B6E7049CBA558A89F17863E82DF145DB8C7ED1F36332DE23 | |
| 3187 | 3C0053B74E850FA14F9EC9EFC23AF18E153CC96FB0FFD910347370E57F0D81E9 | |
| 3188 | 4A83E2D189EE5635E85A2BEAB5B1CB974546BFB2FC2ABA1E15DC0EC1BB3AF1DB | |
| 3189 | B2F93538B92F504CBD7AAFE36F5F3AD45EB16378F169B17869FE81464CB826CB | |
| 3190 | 400D2F5441A496B6C60A4F15FD20ECCAC1F8F91015E7E1C1A10B7992A1554E52 | |
| 3191 | 9FBEE905A3005336E49CB04BA7223F1674C0BBDFA06ACA34F7BFDA56906E04A7 | |
| 3192 | 4DD79EC7E79B021A5008F3B1E04712D689366F520B0FA66A558F957011992728 | |
| 3193 | 561BF4B75C2BE07C4024C172085E51CCC5CFA439F570297154CDDBB3AA25CD6A | |
| 3194 | 3004B936488851BA1E814260C06CD5479DCAB1A6AE21A5F4563024F973D738B4 | |
| 3195 | 0DDB6C6DD2E3AC21B4F6D95CF9AACA782919F5D3E613D61F3224A982AF485C8D | |
| 3196 | EA0037410EB70AB7D3EC174C6D5DE5C9C5A1220EF7C2B74499ADCEEFF077D1D3 | |
| 3197 | 50C1124535F88C3C3F66477E42F1932665AD323E06B398D2805B9CEA632F5B1E | |
| 3198 | 50FA587B102A35E2F15EC22DD66E4DF06A3F4BB717A3ED7FBBE2458EB4D896DD | |
| 3199 | AF00D1BC71FE1CCA27890ECBF9F0AF01D3E65CAA29427FAF06B3BE1E640522E0 | |
| 3200 | 73B213D04491B93DB29113EF72211E31F4C5A7FD58451946CFC15FD805112FE2 | |
| 3201 | 547D1131A46710DFB75659A33695FFAF3CDD40AE5260AD6766DA81DAB0A6E96B | |
| 3202 | E89D57AAEF32B5EDBBE9F7CC033BB2595CA3FEDA2ABAC8E5395EBC35BC112FE9 | |
| 3203 | 67EAF1F123228538091483050847F8FB5194203609502D3A09CDE811EADC18B9 | |
| 3204 | F039593782C27EFA7697182D6367E88E326AD5622C5A457FE2644FEADA88615D | |
| 3205 | 9DE3E483BFD9329667953CDB86F9D2F0D4F02DAB8A98FDEB1D17CAAED9B6E2E6 | |
| 3206 | 0C55C1FEE25AB98FF59FC235876029CE03E4A713B75B3163BE3B2DC0D4472DBC | |
| 3207 | 473E10400C0F57E627AE97FD0C1CB0F78FD8E2FA831A3D2B1C2BB3F2D4E812A4 | |
| 3208 | 194C8732B0C525361DC8480CB27C30CD4DCFF01318D2EB4F5234B4A42EA8C23E | |
| 3209 | 7B3EECA41B8E4F54D5458B37EF0FB2F49EB19F4EA8AD2B53820FA36E93DD309E | |
| 3210 | 48847F5C01B1118ECE7D0186E6B8953344EB775D655AAAD7BCDA642EA2E39A15 | |
| 3211 | 855C027CBC0E3FA752900EEB464E2D39404D1B85072B40834748C6F9C74C5B6C | |
| 3212 | 3CEDE988343FD984CFE4B856A481E60E2E65D3BB41BAF2FA80AC0BFE381071C4 | |
| 3213 | 573C6ED65C524FF777F34D82E9661E4A75E3878CC77BC59218244612219C5A92 | |
| 3214 | E95B90EC2C38614665550026F1730D11162F19D841681C04C401E102C047541B | |
| 3215 | 97B9264D86F47E25A347696AE5EF0FF3ECD9BA32C92901DEDD816F7D73ED1216 | |
| 3216 | 0A98771892472CD625A8F7F19DEFCF5CA2AE57F8AD3898F2C1005B187DEC6F2A | |
| 3217 | A31C32720EBC934178E0E9979013B3C9AEDA4051DF63D8C903A399DC88F83DCB | |
| 3218 | A73F1B2083819D1BBEA5235F8FE1D098F32A2BA6274424A99A4975FE4BFD59AD | |
| 3219 | 79B40A8003CC0AA728EA79D6BDCBBD73DF45B7918BC099C5BE4A068BF64A30B1 | |
| 3220 | C39442CED98AAE1BD495F6CA32D564A72E3BF753B49E4178927E4BBC0F06048F | |
| 3221 | 96DE7C30AF580B0BFFDB330B3B87D7F6532A24F403680BD9F15E758CDF04EB94 | |
| 3222 | E83C7E644FDE5BEE7CE73EFAC75669E41BDFB20A5B8ADE1137378DD8102A0DBE | |
| 3223 | 19499A623770417CBF5211395A6BA9F4490F4707A46F1F9B3FBE642DEA0CA053 | |
| 3224 | 9ABC307B1E71DC2B069DDDBB4EAE378BCC75AD61DA900AF8BA6DF0E27A8D2258 | |
| 3225 | DC80205305AB6ABFE3726703E60869BFAFF1874F3C0E05FAD9C05D7D89ECECA9 | |
| 3226 | DD2AF5F777D7514208697E712B52448B364D3ECEFD8127043DDC9D0757B7CC37 | |
| 3227 | 5CDE8001D007A6E961EA24D7FFC92410F3B13A32946F12A50DFFA256249BC8D7 | |
| 3228 | C1842FB84AD51B41008EC4604F6B70990510EE13E6DA34F864A572D99A13FFC7 | |
| 3229 | 3609EF2BB1FCDEDF37A6018248C545E086EAD1BA1143E74AC60B684E755E59E7 | |
| 3230 | 36557B915F92EF78FC177621D49F777A2AF39F3C2AA6EC74750AAAE08BCC21CA | |
| 3231 | A71CCDC91DD45E6050D83ABA49ECE425B55EEE137C55619037F1C30530BD0A6E | |
| 3232 | CD2004B6A040405064D7E87C55536680364E09248BFAA3FDF95CDA0708E55F4C | |
| 3233 | F7D0A92A93DEE0C7B69638F171B28B7F854CCC6EBC6AEE14864BF5144EA36D46 | |
| 3234 | A9C297225AB0325E28EF6BD06D7E40E3A724EA1E50C4C6163B195CFFD5DD291D | |
| 3235 | D7BBE9AF4324A69394117EFD62F08D6BA6A8F0AC3E2353492999AF28FBA758C3 | |
| 3236 | A50B6840CC72054355E6CBDBD86F683537A4115049BC1616BA35C2B0B6F5CC32 | |
| 3237 | 3F6831DE4E6029310738DE23D36D2C6E82F04EB675FB89789F74AFE3B8854250 | |
| 3238 | 51812FBEFBCF162947554324FADAB765C74B6DA89F60A734076D44BBE45263B1 | |
| 3239 | 3FEFEEA90EC7948F23F34D4049087AF6563692417DDBCDD5A9552A373C2528F8 | |
| 3240 | 0318D3C0669279F292127CBA40B0ABE08A1476BC9EBFA8BD5D622BC5CE7DBA20 | |
| 3241 | C689BDAF50D5B1EAA89E296787CC53845DB2BA54FDE363DCC98A7BA256663869 | |
| 3242 | E9E02E09077884DF1A2A41AA698B7EDE8DAFA621B552DDA91AD1E671D636FB36 | |
| 3243 | 91C62B4D2D4112F2C169E0023EB7521F570CECC54ECA5EBA462049AABBE2ADEF | |
| 3244 | E3234BFD71B26DFDD9D34DFA69E5E80FD90406E6505A6798F030A4B5172A7BC2 | |
| 3245 | C9B765A86ED55C0590E0432719BCD7BDE7CCC7F6B33BD467063D886276C8879D | |
| 3246 | E04897A4623111C14A1EDBBF69E2FEDDFEAEB2A785C6D2F0711DF4B93AAA291E | |
| 3247 | 7F4E0CF9CC3FF0D31953C594DAD014097DA02CBD5AE8828C7E7B5BDA09188B05 | |
| 3248 | 0D7263F164E1E78CC430ACAD1E8FA71001E9BCEFAE47C79846916A5F819CA366 | |
| 3249 | 5734089BCDD458CA1A9E8E17BFF357A91F9A7A8A6E1DEFB121353AA80F1906A5 | |
| 3250 | AF7CD2E59EE6776FC0DA6574DA0DE522918CAC4E566F13FB9B64EFE79F3A3BC0 | |
| 3251 | 689E3B0676741C90FF3BF85C7A0FA9716F4ED0E329512B66BFB8AEB56C3DD6B2 | |
| 3252 | 24F8D6E23751A8485F7EB46719E9D22618FEE86D5E01ECCF4C6E74368A8E9B49 | |
| 3253 | 245D80E7484DFBC916FB2447852B36EF3F99A82B6C106F786707D7689DCD7AEC | |
| 3254 | A0C51AC1A3F67034C16B74994403FAE7743BF02149BEBEF554814BEF31B79184 | |
| 3255 | 3FAB4D2C887E1BEE81B465D12DCDDAD03DE5ABE9E763C440B2CFD42FD16D96EB | |
| 3256 | C21FE788C8C2688F79F148AA7090BE64B0EA710D376222FD1590301BA9A2E715 | |
| 3257 | D33B8C1D95F2589AB0EE476F7046537E27DBBCDADEA1E7357C9D7FA92C2F93A6 | |
| 3258 | 7BDDF58A44966590821023380C97CDE37EF6D449E35EF32BCA6E69DC8458511E | |
| 3259 | 8DC8AB63171A6018AC9A334829E5978484C4C6E917A5F1C254E6669F4037C691 | |
| 3260 | 36980250A80673E0F18C9E0FBA1E5CCA3BE30B8E7B7188062B25F8E1E16528A2 | |
| 3261 | F217C18D6A1955482E5463FBF097ABAF7314E449C6FEE56E2695407A8AA9648C | |
| 3262 | 61AC2BF3B2D9CB6317A9B16CE931D318C8BC9676CD908505568C197D90C2BB46 | |
| 3263 | 06431C999EB68C8216409E4CABACB2BB34A05B697B9DD1E91471A404B4969519 | |
| 3264 | E25209EF4EDD420944BED17B18DB3566FCB8059699FE416789191EC2B35086AA | |
| 3265 | 2E10C139E3C9FA0A535DEE9255A867A26656213E85851DE5F51F9780D3A6E572 | |
| 3266 | F1F5CE64DA176CA810799DC1C60A8FD2A5ED42E613021A19928EC4572059B2C1 | |
| 3267 | EE441E79CDF7DD4AF7B6E3D3230419ACAED329388044B107DCB4DE91B71EB838 | |
| 3268 | 904B1F969738BBDA064FFE75C6623639BE9924602DDF0C166B433B9D54ACDA5E | |
| 3269 | 018680477FB8F10621FF32319E58DB672D744959A33E7314A1B3CDE0C038F7D6 | |
| 3270 | 0C8A195AF191E36B0325334A711CD8E25D9C1D257E46A734779E486567481108 | |
| 3271 | E0281DE96907D460546578DE83A0A01A9ABF64402B48DEF739F4308E14145753 | |
| 3272 | 719CEF720FE5CF8DAD7845E74D502B69DC18D172C3A27411259B8042F3FF82C3 | |
| 3273 | B157BE242C351830255CF0EDA96577375A70657BD9A2E9FFC54AF0AE563D73F2 | |
| 3274 | E510279FEF48D79F5F7745DBB492F1D74DA738E6A4FE4364799B5BEC93B4CAF6 | |
| 3275 | B06B9B8C8D164F8FA1FBBA693204064F2C1806C39910910E02ECA8D092558CB8 | |
| 3276 | 33338B359D56483B7B99A1D8137204EC1AE70ED3D75881FC3B00BB9349AD934C | |
| 3277 | 81A9F285312FDDC77FA923B18B1873D288C2AAF2E6D0AF90BF25A982B843789D | |
| 3278 | 5662D6A2DD58E065026885601ABED4B09CAAA3116DEE6B430B15BE0A121FC1BB | |
| 3279 | FDEA5A501F0798CFFFFEAB5101E707F1A00C8E014A3561FD39972EA9AB108EBB | |
| 3280 | 960AEA7FF60C301AD6CBFCAA7D35CBF6F8462A4D76C4FBA6F3DF6BB762DF7900 | |
| 3281 | 9F69529AB4EAF96C2866444B257160E8822533A7A1240C83EC18C364F577407B | |
| 3282 | 4CB314678D2511735308A1660AD94B8B818CEA4A3DC00C5A1C978F8BB4E0491C | |
| 3283 | 49328F6CDF95BF620AE53056364423841D84418B23C2A447B0CCF8D8633FE2E8 | |
| 3284 | 4A4AC1C6C74627EECDC994059F1BAE9E6B10FA80D767B3FE97BFFAD413DCB0A8 | |
| 3285 | 495039744B48266278194D60422D6E7C74D0DB45ACF217797D0C0678EEB60759 | |
| 3286 | 6231438CFEFB346553A7A447B50807EBB6E885B5A49CA9A350EC4A8C76EDFBB3 | |
| 3287 | A4DA1C9E3EFA193CDF08553302998F20055C84420A4C5252F764CC4B7A4BEF6A | |
| 3288 | A09170EC417B296DD9E2301CD8EABE4A087E648E0525A9FFAF26374C47FDC123 | |
| 3289 | 82F18C9884843864F418ACB08041E7896FDD395225532460A8194A8DB4DBD824 | |
| 3290 | 1C68C6665F85059E365EC0972EC6465E2D8867449907DA6692A021F026F437BD | |
| 3291 | D02654BC11381BB6557663E0B0B8C4F2FF69E4776F4EABA69311BC1AF8155F7D | |
| 3292 | 6D3A418BDC912CC7CF1A4BBC8A1376D8B4DEEB6585416959BCA4AA08D4520C33 | |
| 3293 | EB054DE53140992D0707210593BE62B3659E3E493C4562C2E99CECA143791DAC | |
| 3294 | 679896BCDA0699E405957E17DDBD243E65CDD7C9C8629F29A2078658746A7779 | |
| 3295 | 0F75BE24E2DDBB672B95F26366BAF036B3C23BE4132D7362E76D4183A469E0F7 | |
| 3296 | 29174711ECAF4FD9A923E72FE58DF2854C5537E3626317D471D1E8A922C9BBA4 | |
| 3297 | CE9163A4086AC4A231C2BF35FBC39A5BBCFE41843CAC7D81A054509D31572BE1 | |
| 3298 | 596E0B0B563DF2BF0E57DB4943DAEE35CA26C8433FEE4FC61145C77F65DADE75 | |
| 3299 | 62DA18DFABC7F4194906F53884E62E77D8AB3E099776AB93B2B4D0C98FA44C71 | |
| 3300 | 597202A2643942795EE8CE098FE26F1AF8134F1E75FAE18D563B1FF43A511C9E | |
| 3301 | EAFB9EFCF61490A1A4FD2CF354927B72C5EDD5D62B2F3F5006D6130562A13BCB | |
| 3302 | 1B988A994A8D68B051A5A821CCD5D0F8D9D49FE7CD04EECCFD7A554CCDFFD77E | |
| 3303 | 27AC4AB5BF9FE40F90EBD066C483796CE1A364E95C5E0CF2154834760522F128 | |
| 3304 | B2DBD1F4F73347D42635B2875A23597C35A0823CC6F71E49598125411BC9B2C2 | |
| 3305 | 72470D36DD967C947AFB031BFCF770FE50551A134DF8C5D1AB1F09819569A57E | |
| 3306 | E23D4E87C0B52CD02B0A2E3FAA7D27A94359E82AF047756BB769BC5950A75207 | |
| 3307 | 78ABD49D174F2F69810AFFA9336A52D6B93B004DCA5CDE58475C0210E0BA1D20 | |
| 3308 | FD4FFD6838EC56A0922472D4C4EE0CC481574BC30618179E733EA40A48847E14 | |
| 3309 | A75BE7717CC5DDCB5B0718074EAB6FF07CFFE794D335B3A13EB968EA8FC5B08A | |
| 3310 | 13B38AD1C2C964E4B07E90B9732C458216B028E07DD593A5B767A2B415EFE7DA | |
| 3311 | 951FC07800F11C7E2EF9BDD152BC6815B7F32117F49FE08BD79BEB949003512A | |
| 3312 | 327F3F8FAE1767E7842348BA4373649F1A21DB2C56C081BCF9FA4EA86C8DFF00 | |
| 3313 | FF45C4F1386CF8C2C4120F3F6019CEBB639F2D272D08C1763A470D4BF6330DC8 | |
| 3314 | 43C069A6333113C3A0C93471486EFE9BFC02B760C7CBB2E9156087D09EE8A178 | |
| 3315 | 5EF50B34994094C3F0015EA2ADB6C920F4302FDEF128711994875551C4E883E2 | |
| 3316 | DDEFFAAE11F2234AFDD96400BB69C1B4E6EFD75734C586A10A54A98E7D790F28 | |
| 3317 | DEF7C7DF61FB23BF91AA700AE585EBDE74E215DA49F4ED466F46129022722086 | |
| 3318 | 8884D8E026F35C4BEE7E866DF8E0846D5EC3534069B713FAB02D4B4EE3B44E1B | |
| 3319 | 656F30D629D40AA1337786C1FDA08EA1217AFA4A6E2498B334DAB5461A70DFBB | |
| 3320 | 5AA5686C89FFA4EE82D81CE2B28334DC5C032487CCE998616F48150BA1281911 | |
| 3321 | 076E626E5BFCC56A0A4CDC559F878F14C2BD7A5148C1D8CC303FF9EC473354D2 | |
| 3322 | D4FB0F0F2AD0CF182A28074ED6552E179222570DE0E0D44E8FF4DB36C3AD6487 | |
| 3323 | C4BA53C8548714A69FCF8E3E5202F09469D7447C6519AE902C1D611A720BAFB5 | |
| 3324 | 59E27A6DBA73624F44B4ABE0988BA3450F82E03521CCE8EDE8BE7EE1223B575A | |
| 3325 | DF9A52650E85545525E6F121FF2D1531F156EA9D5594239AEA2CD09EE28ACB15 | |
| 3326 | A445E11FD1C031188DB61881F474D49425C084489A88A47D681EA68E7FC4B1F9 | |
| 3327 | DBB552063A02A0EB51125E9B2CC646B940D46FF457415F9565892DEAC030F08B | |
| 3328 | E4C10DC38D825C7597394C844CB863CE6C843F67F2E1C42C4EF86AC7FB727BF0 | |
| 3329 | 224B5E91BAD99CC6638AB2C64469A81D8B1789981872ED037B3A34BDF3130137 | |
| 3330 | 80FE80FDA65EFBC11A08B98A1AE595F980B577E22D3CB7FED1D4016F5290ADF5 | |
| 3331 | 47D7D9BAFE39F294582F2C084003E9C83FDB9EBC87C8B477CB8BB359EDD9BBC9 | |
| 3332 | 9368D6605E1468A20909831BF602EFCEC0D5EBA99A2223E5A269275C8B221B3A | |
| 3333 | F9226654185929F794E1979ED18B4CD36152F973433AC67BE24B9D953254FBBD | |
| 3334 | B644CDF3BF0E29A2C72113DC486E46DED2CE8F8DFA8B0F8478D1F18C9AA8E054 | |
| 3335 | A31C3DBE84ECEDD85DF6AF9467AC2990ECAA3384FBCA1BBE598AA0D6813C859E | |
| 3336 | 1520B88BF30ADA910A6AC3068A5B8CFD76B7F0F6F4AF4C32450D628B5320C384 | |
| 3337 | F23A2B5E8756895584155226A30F8B0437E028978491DCD00E79C0ED58DF261E | |
| 3338 | 79B9DA17E57AEE03EE92102EAB2D63E69A88EE0B1E2087ED0C0CF6475EBDC3BE | |
| 3339 | 0324D1FC8F7B90D8D807533E5436F2C2583B9629EC390403437FDAC908557894 | |
| 3340 | 03054A6DD6A3586043A9C8BFD0C7EDE1229DBB9F69F7A5D20F55664D061F6517 | |
| 3341 | 0051C6B3CD7338241FB403F2AF77DAB1A8EBE1650156D40863EC1957372BFDEA | |
| 3342 | BA8D0BB1193CC5BEB5A68C8274802E14FFA3ADCEBE19070325B1BDB960CF2988 | |
| 3343 | C0F5A9BFD843C515ADEC8B8AB02B2891EDD7502D9F28F4E58D8F67D1ACAFD0C3 | |
| 3344 | 3531E0C7D1554344CCF90AC8696E83A3F968252981CAC09653956F4343B99D3D | |
| 3345 | 4F17CB8BBE4506B354439B70F2024871D16668F9DECD8EDB872BE5E6ACC406F1 | |
| 3346 | 1DF4E3ADF60EFED57D1C426292970199BB663405236C6A907B6891C6190E87F2 | |
| 3347 | 78D9142220FF295C7BF44AF61470798FB8CFBEE6973C69DA1CC24ECB058AA753 | |
| 3348 | DDBFD92FBB15560EA19D5D92F0005B74F06F0EA5901D231996E0866389DCA433 | |
| 3349 | E62BE48479687084C1D67BC592E592939F806FA8BF5F0D3F644B1FA6F056DE0D | |
| 3350 | 51D3F212C6818CB6166317058C2A0C07AE2E324CD90D4EC83CF4819B10CC348C | |
| 3351 | 6DBABA024A5FCDAE6E288F82DA060BCD16437F07DCA43BF1E5A1B402F16C78FC | |
| 3352 | 075BEE900B4021A1019C4A5ADC33230047FF11FDE8FB775DDA267040A22B4E5D | |
| 3353 | 6012F7E72B8BC8DD3A81369A08FB81C6C4873C2147D03D4181D6D8032DD2B610 | |
| 3354 | 9C44CAB50C5BD8F489EBF01C72D4198B66EEA4E976462F8874143640B82AE57C | |
| 3355 | A51EDEDE75A9A55D31587C14F8DEFFE69F75EA7B95BF725CE9991FB2F07AF568 | |
| 3356 | 5AFEB39447B728B99BE0502BF28DE1D92B15926BE4E3DA2E7BB44A24836A97C6 | |
| 3357 | EE3A2080E01DC6514180DAF9C055F4C94929D34F193920020505E62804461630 | |
| 3358 | 9F42C652F9D5681C91BE23DCB0C634247E739135F925EF3D5424767D5F5C5879 | |
| 3359 | C46F2E3395E2B49D282622FA4C18475FC52BA7AC4DB7C1AAD65352E66DB9D962 | |
| 3360 | AB975C01CC6490490F35CB358D77DF26703B356F5C5D80E25091CDE93B39BC22 | |
| 3361 | AC7F7CC6FBCBD39C39F7F8B41B3286CD39D6DE2E6B2A9AC1D2EE8AD1FF53AA85 | |
| 3362 | C34B2BB3A2E385B980FB5F35A1BECB5596FC2FB2209828F3C54D01B3D867B391 | |
| 3363 | 033A752F4AA80C91775F9CB9BE939C850B2B322FA948907302D670F2302DAE93 | |
| 3364 | B5F8D2B835DDE001ECEA3B67BD3D620BC6D1E325C4B355985A129CBD6AFFD2D3 | |
| 3365 | 5147E4CEC0209A8DF23ED77AE818B88A3696257268536CEF2DA90202ADF21C34 | |
| 3366 | 07A0383E17206532F5F71061E625F3199D72E461D04F4AF18AD91B8A09E37E5A | |
| 3367 | 46D2E5D3634C508197C6CBD81F3E2BB8C759E331AD1CD54FCA815B92207579D5 | |
| 3368 | B248F2A1BD2B725117C76FE754F5D3CAA9F642D29AFE61DD78ACEB9F1DD67764 | |
| 3369 | 0AE3E795C8016E150C92CC4D2EA682D6808DCCB4F24724541F856C29B3ED24D6 | |
| 3370 | 64F1BFA439DD155E53F06FEBD8DD73C7C2D933CF70D9001707870C2D06EAB2F1 | |
| 3371 | 649B32FFF09C7A1FA4C2E7EC2B3CEAEF12515CD401C582A315906EAE1A0D51B8 | |
| 3372 | 1BF625E07761AC2BF59A28B7840E8833410C7A3CCFA16E32A0E90E0FDFDC46B6 | |
| 3373 | 7E073A5957E59E58B33CDC146394FB7C860EF5CB1CC9871D3783D189B1A5EDB4 | |
| 3374 | 1BD462A5AF1CE8BA67D096CCBA709C49A6EA7C1233C125155D8FC7E9482C8EED | |
| 3375 | E15A207196E74C9D2C19CA96CB1B4852C3DB5ACFE88246F0325169DCCC88F4B8 | |
| 3376 | 8BC213413EC95D2E3F39329B2165A0D1E3B4643C8AC58C126AD9E71B02B8A04E | |
| 3377 | D5ED3F93B60A7D1D142A4CAEFDE0FD1C0778B3F9E2CEB4E0058D714FED13EFC0 | |
| 3378 | F4BC2FA09A125652BD936BDFB3B9C83C182DF3C329E060E983D054410928E4E2 | |
| 3379 | DA66453101A4D23BB5FDF7D67051BC92152A687620C9B653CBE6160929FBC393 | |
| 3380 | BCDD07F0010CB35BD030CB5E13A4AFEB7DC0DD5D89F9A638509AA2A4DCB83CF5 | |
| 3381 | DFC0873FCAA432F351D88B35DBC6129A44A35CB2CE4308979F474921590FE9B5 | |
| 3382 | 45A4F50C799BFB555A1674D1E49CD81DD2EFF2A409626569C64B9C80B5341EAE | |
| 3383 | 50A011D7BC615F2BD6270981E2D66BEBB017EA4B5E9DC2EF8A7D059C94CDD2D1 | |
| 3384 | 2C2C80FE9E086DFF9682C1BBD31EFC52E60625FD854280CB6717225D2FF35582 | |
| 3385 | CC3B9924635593248420EE48AC47332745597A5E542C2C375E947BB80F463C8D | |
| 3386 | 54FADB19A7B5993F39D9E07875785DF6342617F718A660F6A27C9642717CEC01 | |
| 3387 | D9DECD957E3C8CE1C0CFA3F2F02796EDC1CBE35E7F12C3CAF968D8EFB5F09588 | |
| 3388 | 4277CDD2FB8DB2CF43C82980C9CD75599416218D7F88077B6B7CB579B7331D1E | |
| 3389 | 2ADCFF01EBB0A43FF5C78B5F4CE0F183FA66DD45BD9E950738FC3E78AB286B70 | |
| 3390 | FC45C628DD2DD70F8C33E99AD2F3A82389FAE546138FD8609EE51BF337C50EDF | |
| 3391 | A4666AE87E764F38A99EA91F0CE63D72CBCB7B8EDDFB72AB57270F33599BE69B | |
| 3392 | 8C7A9F15B6704240A719A1B2B8E662B5F479ED331FDCD7EA86179971E0F193DA | |
| 3393 | 27DB7DDD61EEB68D5F5ADDF0827E7A961D0F35D943C89E46909EC09B3D02FA88 | |
| 3394 | 10E8D8B85474248CBEE142D33C5CC24CA4923CDED8A4A5028D585392DD1BC8AD | |
| 3395 | 61CCE83D7D2371A5AA76F87642C10253D00EF336FF8C5B14BCBEA473577333D5 | |
| 3396 | 5A858CCDC4D51A715859FE3DC0B79BEDD3187ED7C579615394354C46AB860C4E | |
| 3397 | 13D26ADD1D09B3B86FDDEF1D5232B618B6A8636BDBE04E7187F4CC624CF2BC9E | |
| 3398 | 38D39A393A0A6E42654329BB2F5735AEA951A1642CF093B06BB7656A23B9A9C5 | |
| 3399 | 487947A4419B1AC4EDD7FDAF7FD0DB8FBA10E65AAFCECEEDA53D3CA4C5F381CF | |
| 3400 | 8A15DE4D52EA901171C5AC8D8D402F6EC75E898E0756BAD7F206311E74101055 | |
| 3401 | 730DA667F74E9AD40BBDA833EA7439EC939381EFE8DE64917CBFC4E4C0A96A2A | |
| 3402 | 069053049D14A8CA33ACC6900C37CE589DEEC5CDCBC4153C0DEDE51266091DE5 | |
| 3403 | E417ACF812AC380EFB7523EAECEDC133D2368C3916A92B85EAAE86CE9CE912AC | |
| 3404 | 94749AF7E040CDFFA2EA2B78875EC3BF0E72C228B2C68ABA783E9EA17663CD76 | |
| 3405 | 70CAD683E416E6863D21FC2A42F1BD447CAA62A66CAB6DE56B193B3D83FB521A | |
| 3406 | 82A7C3F08190BC10217F7EAB6876354320F1A63885479B1EC91750A247CB51B9 | |
| 3407 | 1D22EF0D19D48C9893E0716A64ABF1A54700DD9BF0BB498EC874B2266B6E86C3 | |
| 3408 | 2D273A2969F184B9023E83CB245FF9F484C9C37E70BFF61AD20EDB3C2DCCBD3C | |
| 3409 | 38716C5AEA8465E87C3E9F4B9884AC9E213817E102B30691D25D808388A3C4DC | |
| 3410 | 8894BA463F8E0F5E3406BAEA54BECA95E934C8E019AB014B13A618D68A89CBC8 | |
| 3411 | 3F76AD4C46060C0FF3D0BEE87082294BCEC05BED477BF02BD9F8D62ACF3AB816 | |
| 3412 | 30A0846A3FDCD885E4F310D56C332CED12A279154275A682438ADA6970E18CFF | |
| 3413 | F66012252726FC421A3D772DDF7867ACA38E70DDC25255283E72918772DED8AB | |
| 3414 | AB05ACA6477F6FB6D2C2A4C35D7CB877C2F07B6A3E113468B53356947B0EC500 | |
| 3415 | FF3ABA15ADC0466BB9333C6A1E73EBDDE53986FFC8F44ED9A1136BF27A599F28 | |
| 3416 | 414C8A71B2893F248284DD7E0D887A1102357CD8EC4E034C7736469DAD3BBBF3 | |
| 3417 | 45F0231D7C29DC8D0A62CF4ABA718BBD7D985513986B93B599C912408BBB2BA7 | |
| 3418 | DB96EEAFE84D1C6AD71FC59216FCE27E179BE74FD7007FBAB1AE2A9ECD11F1FF | |
| 3419 | 4396A13B7EE4FE5727E2142AEEE4E39941F02E54BA6730086B9FCFA6A6D00B7D | |
| 3420 | BC6AA1432E129289B05C34A0B68494019D387AC6161B6585B2266DCF37DC63AE | |
| 3421 | 1CAFE2F3EC9E584981468CB2B1FF77C7FAF3342B72E260E15B558974BCCA35E1 | |
| 3422 | 4D9040394866724F140857AAAB68BB9EE785787A857D17CBDB0F4CB00844FFB4 | |
| 3423 | 2244AAD459ECCA522F5C590976EDDA6900919CDA0FE66DC39DBCF1434FD7EFF9 | |
| 3424 | 194BEDAB53F7580D169909C31D6FD38EB7A79DD4426186235098A9F574E08DF1 | |
| 3425 | A03F709A1FA398A545331FF9454622B4CF225E95753037BF7620FAB86E06A1CB | |
| 3426 | 0B5FD5C82C3C2A9E2BDD2AEE6F3547033D5512045506D6DC0946AF56E87DD984 | |
| 3427 | 2BC92D8C6F1494E6A19CEC6E3CC20CC46465AA61DF9A9CB7D9B4ED157E3DC4BF | |
| 3428 | FF6B752AFD16943A4CA7B6954AD3C8E115055F0FCCED4A7A9AC3DF6888724A0C | |
| 3429 | 1AC640EF479E7D502B2F030F2B43D51996429B40841CA139E8EAA87B6AE277AE | |
| 3430 | F8A4C55D4555BDBEE4232DFD1A468548DD2BE1193B3E0C7DE64A944973BA61A7 | |
| 3431 | 4EB28DB3AA37C5FA901A9E7DB175DAED17DB95E22EFAC77CF7D4B0885824825C | |
| 3432 | 9B6C7B83BD0ECEB934797B49BC0F530F7E114C2B46D63DD7C56B89FE4A67EB3B | |
| 3433 | 6730F3281453F8B12A13967F1FC1428ED836B7B74C88C893407F13CD9FEB37A2 | |
| 3434 | E63D62D24F0097F41F756E706C376E1F85EA99FD6FA72611A9A92D3E49711516 | |
| 3435 | 42FCDD0AB37B61DC086B7CE1D4FC559E2436D1334B3FC6A45F2FBFAEA7274455 | |
| 3436 | AC6715983EF884243D21C1FB3B433634A1B100DE7EFEDC96A2375C370F5F6AF7 | |
| 3437 | 88FF97C7F49A8716AC5BE715578FA60394A5AA3ABD91750D3D92EB2C20697852 | |
| 3438 | A7701DE59D37A8FBE71FB85C8BB31BE3FB05443E7ACBED3CEB33379E088BA46C | |
| 3439 | 9F00659840057537B0CBBB92106343FE7B22E1EBDF988D2EDDE8454DE5042227 | |
| 3440 | B71CD978B414CEFD6CD9C3F17F11D325DFB90DACC1EA8D539B258B36A67AC1F4 | |
| 3441 | A3151BF7CC34F987932C469ADDE1FF880C6AA1638D11D339181C3AB485D9531C | |
| 3442 | ECB30F18504BCBD1432123AAF1A20B45DD783C4BDE3D9222B7090F20D3DD0CC4 | |
| 3443 | 46EDBECB37892190C4E3099B2A5599C2969A2772D7BCEAEF5E68C7BF2FA00DE2 | |
| 3444 | B955FB052E6C030D9077456494ED80A3E06937E0C47B28B92E3EE4E4D287C687 | |
| 3445 | E65221A1F3D8D61780C7A9199B373087770136C43A8B2A15A288CC4E89B3D298 | |
| 3446 | 6F368BCC97D573BC587A0638FBD3618AB7AE3385BB12277EF891C06F6F618BC1 | |
| 3447 | 5376A53CDDAC8067BE854DE1C5E554DAD1D067B6236E24C71E05DD580AF904BA | |
| 3448 | B6085CC5FD0EF91C7A9D99E765C1A0C042508EE88E882121735E5A8FD6AB154F | |
| 3449 | 9993E0FB801632B535E6855A2E957D1DC342AECCF2E3BB566CD687271DC01C73 | |
| 3450 | C04F207F8C6294E0EC5C4644C8FC359A7DE5656D49965F7A4AF7D4AAB46BDE80 | |
| 3451 | 7AAE6A0B0A1F737E075FD15984BDE06E06670A676EDDB0FD7BEFACBDD16EFB6D | |
| 3452 | 78AC731178AF94A77470EFD8F327A15F1A03300CFC19C9A9C90EF1388E9FF702 | |
| 3453 | 5526B6990D2F8AA2DB72A1B19043045121F02D0212F3E892D1B13601E8324493 | |
| 3454 | BC4FB860EABE27DB73E5828FDE47C2D83E5505DB2C8491612605DC988F84574A | |
| 3455 | 5152E8F40CF20B26BE241B1036C9BF67942A8664398F43C4A5F1ADE0EB752D34 | |
| 3456 | 1201D0DEC34EA95609A2DD65A7F761A0BE2FAB352F7AB8BFA31D559D39BC356B | |
| 3457 | E796188AC31E0C512B37AA9637604C6656B10F0BF5C8F083496E3FBA6F449420 | |
| 3458 | C05C5371B16BA0B047F450104834C2FF96ED9E66F146D19E807B4C1C78746CF2 | |
| 3459 | C918DEBFA52C49A4645CCB2F3C5FF2E4588DDD1CC6832A7991CBCF3D3387992E | |
| 3460 | 4DBE05C65455EFC9D3F88248B27C5B83DBCFB13E72B24B9A13DF66E68CBACA95 | |
| 3461 | BEC7C0A6E2CBEE404259455688DA4F512A2AEACA619C2CB1FF20546200F164C9 | |
| 3462 | DAAD09F2CAAD9A9B05FD59790FB8B892B9A72B3A04F9443EB216E762AD9C0695 | |
| 3463 | B966BC2510652F31A1DD10AECE493329982E3583A7C106E8E4EDF7186574ADC4 | |
| 3464 | CF2227B520ED9DCEA96D8FDBA7E227219DC13DEEEF8958EA602FCB52DEF6F9A1 | |
| 3465 | 589C659AAA7A4CA5D78176CD27F7328BB71FADE61224866B756C78329BB6557A | |
| 3466 | 3B003E15B66A6C307023282FFC3EA63467683B1428DCE51B2D5BA418661A4DA4 | |
| 3467 | BE4E35945C93F22D9B4467B2A20D1B282724A02D9032F48F2829868163989995 | |
| 3468 | 1B866536E43B6AFD8090ECD4AE576A28CE2DC7BAF04111701A71EF4C3B8E8BA8 | |
| 3469 | 8AFF6E096BCFEF20DF3BF29ABFDC2507896D53E3AA48DDCC77BB58D85A3515FF | |
| 3470 | BA5BBB0A44D4FE8580838AB91BA337CE461B537EFCB0D4BD968D0CA8F4B808FC | |
| 3471 | 3ACB08AF1C580C634AE27123E50E7E42A8C861667238A52856A66E9BBBECB160 | |
| 3472 | DBDB1DD426A2F76CB8C7890320F7DF50C9FE89ED1405A59721D11FDF2FA2B048 | |
| 3473 | 83B77C164248F7BF436E2007AC9BB4F27BD8FF62C4ED9D377F2044D2F5F63420 | |
| 3474 | 1D9935BEC227187942805B7A66342044F54692D71C820729691709CFE6720A1C | |
| 3475 | 6DCE3E05095351635827C6C03B1E67C9CE546E5D464B6E2F608CFBDF7EBD0280 | |
| 3476 | 04D2C1DD0AB53E75E0C4D2864D793E617477F3A308E95D68E717790B3BA4B4B6 | |
| 3477 | 9CDC5B978CCA0A52FBF14D7FDB5AAEA8AF591CCEF944D9757163370A95394324 | |
| 3478 | 8AE2885C1F9FDC8D5365811D20355BAFCCDA0722057A229D9609D5DBCAB0C3B7 | |
| 3479 | 354B8A0432FF196F4B5DE84BF7B7C799C5772D9B1FE97ABBA646916F7081B98C | |
| 3480 | 5EE2019F992CD1611956B9C500F89DD6610224371833D0B85319EA50CA5B6797 | |
| 3481 | DFF2EAAD1A190F32CCC801C06D40DB4978646590FF40A943C419BEF1C1E7C642 | |
| 3482 | 1CC1F33899247BF8B830FE58A2F0B93E5F011BF23A54782CA0EA09A0BDCC10DF | |
| 3483 | 7B688287D2D0DA736A9194F070DDA4D39248DEC41CB441A4225602C87AC3F7CC | |
| 3484 | 780120F4F92E65ADD62FEBA9F5D8AD1029AFC86EB4D8AB729B17E1AB21E5A07A | |
| 3485 | DA4AF13BB3C02B9CDD7C063741D0E79310D48D7A435D8904F87BAD143BE8E521 | |
| 3486 | A51D6E7F3D348A3512C2D315BDF1A68D87FE3DE03F5D95E440B691AEE8C7DED7 | |
| 3487 | 92189FC58C20E36FD72932BF07A921DFCB5C444F180D78F7CC5B83848DE155A2 | |
| 3488 | F3E47F45F576CF59C5D46ADD277B0DE74778F11F999F3C2B6436CDA253033328 | |
| 3489 | 65D0BDBE877B644A4A6685C239921821357CFD228E9BE92C21B3428D693F48EC | |
| 3490 | 058CD8C02C5EEBE3957A671555703F01E430A5CDAFA3A95155E6750A4CE39D1E | |
| 3491 | A89F19195788625B26FE693F312CBA53F08DE5E3A2A8C29FD7312A92DBF79C73 | |
| 3492 | 0BC7A31C9D1945CF8578672F586493132463032964C629E0CCE49647DB95EF33 | |
| 3493 | CB434C8816E0E3427A0114F795F8A0C51CB2AEAEAA62C98CED7B87024BC16B30 | |
| 3494 | 40D997940650EAE72BE6323F1697205F608091BE8AF08A9C91089C120420B3A6 | |
| 3495 | 68FD09615D986FFD06EEDD39BBAC9C4C166FCB9E3657D88FADEFB2EAD4941591 | |
| 3496 | 4420282BE836A4CCB74476114E2979CA9CDA9845668DC89B04BA0AD91CA46BF5 | |
| 3497 | F91F8E677815B3D2CACA13A3C7E62BA3FF44B35E957A0BE4A1EDB4DE5EC2B42B | |
| 3498 | CC427D4E8B8907C7F0E3B82E960663456C1AEC4C2B275A1EAE6126BB5A802238 | |
| 3499 | 1830D00CCF43963C8CA537D24D7B8A8A767E978DA955613A819AE1F5A0D12BFD | |
| 3500 | 378B8118EA7ED73D6914DA71C0FD41620151A7CAE1AA36625E98A25F72D0CEAD | |
| 3501 | F48F4A822862095EEFA5FEA97A7A72047985E455F326F94F65F9B8ECAC0B2A42 | |
| 3502 | 58396F7F3C4211EE320CBBE9280B08ED54171E44D8973256A286AF41730A9A7E | |
| 3503 | A88FC1F92509135434BABCA88CEAAA2ED499E2F3C316529DEE9D024FC1F92FFA | |
| 3504 | 69D8BF95AE1A5ABAD706442CCA15D352D10A03384B06DB6C31AAE831013B32F7 | |
| 3505 | 53C0D21ECB615D0F08BE01C0E7FB1F23715A10CE32F1E33CB40292CEDF59A4A3 | |
| 3506 | 4BF715EDABE23B4D1FCFF71C40550249A03235D307F948D462944BF685530035 | |
| 3507 | 1269AA516F99D95618B24B07A8D2E56F1DE82C5A2336263C46F329A5AFF5AB23 | |
| 3508 | FED8E1B05B07935581816B5A3F3412C403DCD207A1F332C79F17B711442DF1CD | |
| 3509 | 7A54B90653F78C0180FAF33C82BF371D56CCB71CC73B9EB2BB10E3617FB7E0D8 | |
| 3510 | C8AD510865216E44B6D2D3B2A02178A42766BBE1F738402C6DCE694307C8EA63 | |
| 3511 | 25CCB6D7298A2200C63CEE67739D14270D1898C495361504B38A15F81057B129 | |
| 3512 | 89835CA35A523E2B848DE47F50EEE2062050522B8C6E4EE0C3CDF8EA7E878C1C | |
| 3513 | 387B5BA7EAED5E890CA1508413CEAE9370286690BDE5A96E89E916A8A81A90CF | |
| 3514 | 223797B54F0C408044F035D1BCADFE1850DA6EEC5D61211A543741C36CA5A14B | |
| 3515 | D5402FE65382DF64CE4072E5A532F009D156287866C0035953B5AC4CBFD33EB6 | |
| 3516 | AC1123A0D0B8AED978F2D9B7EA1923C104237A97AEE2263163727E98D22CC5FF | |
| 3517 | BDC0352C9BC16ADFD1D4DC968882D53DCC5E7ADA2CA2FD67DA972CFF17735833 | |
| 3518 | D4E0DF395B0F5F8038E4B70D6CBB8DA85AAC12D8C9B63EDA42066977FAA79121 | |
| 3519 | 43AE6F4692A9F7F88DC200D049FBAF35D776BDBB0B89811F2FADB8224690902B | |
| 3520 | 2A6E146A133A517CA12386AC920A4543A0F6CF05A9071074CD157C133EA7A7BC | |
| 3521 | 4E6A2874A6699DD65DC25C5859580308316E743B8938ED9DFAEA61E1F836D2D5 | |
| 3522 | F13DF35A82339269D80A1041651CB4A28B4608D0E2C326F01B698816DD20541A | |
| 3523 | 5D01822C865109022872230FC18DA7A7B3BD858712AF458F4D17F3286303F837 | |
| 3524 | 954F784FF3CAC74E28C5C633A4581AB32C11B9974BDC0FC47F546A9F81FDC281 | |
| 3525 | 6495A1229CA0B91B63E491842BCBFF262DE9556EFCBAE22881466AA874904438 | |
| 3526 | A57EE59D023A2D3C6EF7D5478323812CD8719A14AC99D480ACFD5CC9DC5C13B4 | |
| 3527 | 28E43CC9784386169BA06D306E25C8D1BB6C0C325885423DAE98B7B74F477768 | |
| 3528 | 6AC27A297360C8530142BC1E7DEFA726C2A6B191442BD7CA8936EF73087D8ADF | |
| 3529 | 6C9A1557BCA49C69E33081FD3F4766092F00DB3C7DC71CC151DEF1EBA8D9001C | |
| 3530 | 4F11AB87091DB2646CCF6D480B6E71E7106581A0509FA55E8326A428F3A2865C | |
| 3531 | 94B3A88660C35B24559ACC697DE7DB5729F33D1E72719D38CA6BBE24D3E6A0CC | |
| 3532 | D291719268709C7AA1B4F00D42A973164E573827773F5D476D5FC2C915937065 | |
| 3533 | 66C6F51D1E9293BE96E0E16AF71E5A26A64FB07D29D5548FEE89DC3A6CB98388 | |
| 3534 | 5505C882BBFE323D4E7483BB1F5F75D9332C8FA1C75628FACC6F6C9CA2065DA3 | |
| 3535 | A69E213ECFE3B1EC646DAF1422AA8E8734B028314EC6318ADB331E25223E4C1A | |
| 3536 | 1312A03BC70E0A390F9F07A15E46AF1F39F561BF65790669866A9444D72C4D57 | |
| 3537 | 181AD91B1350573D35122EDC10EF57CB6505EE89148D8750704A036F9B80078A | |
| 3538 | D6DE659C19193236E531DEF598D972D826379B9C675A8CF10B3977E7088C717D | |
| 3539 | A211BFCADDE1B91C9F79B3DB488C5EEF262F0524E6F82BE7E5D94B58953E72C9 | |
| 3540 | 63F6778919F1F2126404A2E1EF9397773BB32C0C4EAA1B8E02BBE3E9FC75546A | |
| 3541 | 072611BF1D5DA8360AE0E2B199288F690859D9BA2720878301E6A358D26F04F0 | |
| 3542 | D93B36441077B89CD9ECC805B87BDD1FF13E6E4426C1CCA3E9F4141B4D268A07 | |
| 3543 | 02ED31E3EE96C6E62DA983E9DDC28796995F452F5F1B9635DF1914140006FA69 | |
| 3544 | AE2D0C04D504E4B735B8BF7A5CA4ED496D56EF87389EDCD78B6870951F963F17 | |
| 3545 | A4A9E2378830CFD1B0AFAC64C93203C083D580D0DC575A69E5F2A318C35C4052 | |
| 3546 | FFFC7F4EC5DD7556DF2CE165A362FD3BD3BEB568C247569F18FD85B5CEBAB263 | |
| 3547 | 9B7F1E9B5886F07E9E3BF192E462659944241030D9375DCC40E1D744CCCD18CB | |
| 3548 | 5A6595A1976E3767C0F1829F76F220A335A5EC49A6E099F7288FB1A415DE05CE | |
| 3549 | F41FE8AF2DB82BE6B53EC82A0AB3FF14ADD98F5AFD9B68B76F5199BABA5436DC | |
| 3550 | 921C36A6AC8B245BE2702A7C036216C82E81A775D1AD068FF106789CED865D64 | |
| 3551 | A4FAA7861BF49C52065A1C9E52AFE9A0CC9BBC8863B902FA5DC046A645C3D72E | |
| 3552 | E28FA624B18103C9782123D6AEB075E22B0707348C15159D1A3002B2822F3269 | |
| 3553 | 129457B3FBDE1DD4E148B77D75A50A0A063D541DC4D00E1500E5A19BEF09BFCD | |
| 3554 | C36D7E0B60BC2A745B50BD7B650536C563AC305C0AB63389BA4E9AB11A171D6E | |
| 3555 | 36EBB5CCA1A06960173A865B7BE57336C18BA87710092A12C88A4BB739A070B1 | |
| 3556 | 92D1D52A22EA87E84B9D70A0C8764F48076F7C381E2FEA4DD8F9A86FAB2FF56A | |
| 3557 | 9FCE5A47BCFEBB78F4248513E9F117A50DF41F14379F9D61EE774F109162B87E | |
| 3558 | A3F45F36EEAFFBC1EB63D796FE6D4FAF2D16B3807E4BE4E54F9779FA01EB853C | |
| 3559 | B6DDCD9773EEDAD35F4795D90D17BE66400B31A2E4C3ECA5B5282E22CD2846AD | |
| 3560 | C1D46908A493998F17D13A2416D4671F956398EBFD075FFC676F4BA9B8CD5BCE | |
| 3561 | 391B45AD842C43F98FF8FA42F6ADAF4C429DAF025AA7383F4CB0195CC514E804 | |
| 3562 | C47FC3217159F58E174481B4037112F219F4E7CD8816DD332F2596109AC3E46D | |
| 3563 | C38E214ACBA5A55ABF5177D53782E2CE38763618ACA0E461B0B735AB5A9DC1AB | |
| 3564 | B92F8588E3362F24202F163DB7CBB3D24A06620F0D75F621869A97DFB8678ABC | |
| 3565 | EB57767E94672F51154F22FFF68EDC69279603BF5499F58B3BCF5ED32848F42A | |
| 3566 | 78A029DD1F5950DA3C6C4E7CB911C69A88075E14970EF23ACAB307D52A627EC4 | |
| 3567 | 4359B28C00D05ADB4EB726FC31B0335E7C2942A851870D3520C5C96A4F1F834D | |
| 3568 | 584D92A454BAE25D79F2984A708C864B853B24A303F4EB132BD9DEAB438BCA65 | |
| 3569 | 78864ECC83C746D63B7CF7B5CF1B9734E102007F9A0954EFB8550C43A9410168 | |
| 3570 | 2D21E28DE211D231EE4A165EE129F47D07186048A152496E4FC9CE844FE45903 | |
| 3571 | 076F6D4FEF780A52BCC56D8435A3949DB75C12F1F62CDFDC521CBCEC2554C460 | |
| 3572 | F700716A202A10153C800797C00F0162A14B8CB0E9B355938039773407738B57 | |
| 3573 | 6380CAEAC0AA2AD724739796A9485D12ECCC0F3546F46D6040372B6E811212D0 | |
| 3574 | 88758DF06DE11650C52F3C178CBE912B749351F065468DFFDCA9A01E14348D98 | |
| 3575 | EBBB9A7A168D1C4EEF97AA0C20FE37C3B3CE1CFD53AB00F5C7FA394F2123CFEB | |
| 3576 | 7A1DC68E7BA6467B2578EA2B00847F6BE6E11F77AD6EDAB10AF837551B81D429 | |
| 3577 | AB185372A6E567B73C56378A023AC24D83BDEC508CEA954A2609F0BF06389A22 | |
| 3578 | 8F8D4ED71E2C0B202B68C0597DCB2421AA163E77CEEEA6908CD7F08B5DBFDD28 | |
| 3579 | DA55017714ABD1C98B5D5C8E01EAC1FFB4D4D00D7879B6EA44DFCF7C73EB1AD7 | |
| 3580 | 0F8ACCC9A404496F769F5DC79FA1C28FB86F3C863D3B5961406B630D87270C63 | |
| 3581 | 84FB51C5A8060B7E59211E3953A3FA571008D3677E8CED908A8BA2C7A0FBE6FF | |
| 3582 | ADAC7053ECF03073C33A681065B5013F1F39E4D63CB657FC9DF6763440272B45 | |
| 3583 | 0E908CBA727375DCE5D479B7604510D081F452E30AEE9335635BAC3FC4B4516F | |
| 3584 | 714A5D709BDB673A0E4C4A7CF7833F8011B1632F03B3C5815E4C2BC44502ECFE | |
| 3585 | 5791A5A92A8EA997530DB13A5BB2C9B8DC2E60D18FF029A88F63103AB54E9B52 | |
| 3586 | D08F82AFA775AEA9E0354C77F3442019698A08D366E88435A5FE1C388CCBDE65 | |
| 3587 | 94A41A384AA4B4E47CA54D2F37B8B80FC3485EA95B33DF87A4A5CF313325C08A | |
| 3588 | 76C669C86AE536AE345D7E5A3052BAA92DBB827FB877A1EE8AB6914F672C37A2 | |
| 3589 | 9469AFD84800A913AB4A1F681E7DF81E93B9C34076B32D03BDD8FFB2036A6035 | |
| 3590 | 86E4CBDC20263AC0A990AFAC2EBD451CAB04EB66542AE984D0E610CA79FC3268 | |
| 3591 | CABBD8F91E8DB1AD7E81C13B5E9C682C679D48E9DC94DEDDC52A68F76DB57242 | |
| 3592 | 1628F8941AF3B433B8A780C209DFA18AF329E93769DDDAABB87EB1FF71CF2401 | |
| 3593 | F3162EAB20883AE2423E84E05BD0A4D3A4BD1A3627FEBACF14E1245ABC8B378F | |
| 3594 | 406C6FD1C60F2B02B72DB5449582C0348B4DB66CD1B1800A27FC41DCC0F1B9C4 | |
| 3595 | E6ED1E83A78C452A4B55AA0A93EBEA6CC4618FEEA937695E6513B7875E4EFCDC | |
| 3596 | 643A87DE5F11B40ADA5D5A3D0F4245D5F8C8CB8D6E22 | |
| 3597 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3598 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3599 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3600 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3601 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3602 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3603 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3604 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 3605 | cleartomark | |
| 3606 | %%EndFont | |
| 3607 | %%BeginFont: CMR10 | |
| 3608 | %!PS-AdobeFont-1.1: CMR10 1.00B | |
| 3609 | %%CreationDate: 1992 Feb 19 19:54:52 | |
| 3610 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
| 3611 | 11 dict begin | |
| 3612 | /FontInfo 7 dict dup begin | |
| 3613 | /version (1.00B) readonly def | |
| 3614 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
| 3615 | /FullName (CMR10) readonly def | |
| 3616 | /FamilyName (Computer Modern) readonly def | |
| 3617 | /Weight (Medium) readonly def | |
| 3618 | /ItalicAngle 0 def | |
| 3619 | /isFixedPitch false def | |
| 3620 | end readonly def | |
| 3621 | /FontName /CMR10 def | |
| 3622 | /PaintType 0 def | |
| 3623 | /FontType 1 def | |
| 3624 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
| 3625 | /Encoding 256 array | |
| 3626 | 0 1 255 {1 index exch /.notdef put} for | |
| 28157acd | 3627 | dup 0 /.notdef put |
| 37c41ab1 CR |
3628 | readonly def |
| 3629 | /FontBBox{-251 -250 1009 969}readonly def | |
| 28157acd | 3630 | /UniqueID 5000793 def |
| 37c41ab1 CR |
3631 | currentdict end |
| 3632 | currentfile eexec | |
| 3633 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
| 3634 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
| 3635 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
| 3636 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
| 3637 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
| 3638 | 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 | |
| 3639 | 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F | |
| 3640 | D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 | |
| 3641 | 92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C | |
| 3642 | 295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75 | |
| 3643 | 409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C | |
| 3644 | 4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF | |
| 3645 | 2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E | |
| 3646 | 0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E | |
| 3647 | B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008 | |
| 3648 | 24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B | |
| 3649 | 43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF | |
| 3650 | D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575 | |
| 3651 | 5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC | |
| 3652 | 96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3 | |
| 3653 | 7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEFD8D9C400015B65 | |
| 3654 | 0F2F536D035626B1FF0A69D732C7A1836D635C30C06BED4327737029E5BA5830 | |
| 3655 | B9E88A4024C3326AD2F34F47B54739B48825AD6699F7D117EA4C4AEC4440BF6D | |
| 3656 | AA0099DEFD326235965C63647921828BF269ECC87A2B1C8CAD6C78B6E561B007 | |
| 3657 | 97BE2BC7CA32B4534075F6491BE959D1F635463E71679E527F4F456F774B2AF8 | |
| 3658 | FEF3D8C63B2F8B99FE0F73BA44B3CF15A613471EA3C7A1CD783D3EB41F4ACEE5 | |
| 3659 | 20759B6A4C4466E2D80EF7C7866BAD06E5DF0434D2C607FC82C9EBD4D8902EE4 | |
| 3660 | 0A7617C3AEACCB7CCE00319D0677AA6DB7E0250B51908F966977BD8C8D07FDBD | |
| 3661 | F4D058444E7D7D91788DEA997CBE0545902E67194B7BA3CD0BF454FCA60B9A20 | |
| 3662 | 3E6BB526D2D5B5321EE18DD2A0B15E53BCB8E3E01067B30ED2DD2CB9B06D3122 | |
| 3663 | A737435305D42DE9C6B614926BFD44DF10D14402EBEDFF0B144B1C9BD22D7379 | |
| 3664 | 5262FEEAFE31C8A721C2D46AA00C10681BA9970D09F1EA4FA77428025D4059BA | |
| 3665 | 2988AC2E3D7246BAAAFB89745F0E38580546045527C8779A254DB08DCC6FB9B9 | |
| 3666 | 0E172209FBE3857AF495A7F2B34BC895A39A30F903DC6E3202D29AC110D868F4 | |
| 3667 | 7184CB78407B8B9D42F6375F67FD4B828592E4A977B9E71854D143CD1A9EDCD1 | |
| 3668 | 767CC2929E071FBA4C3D17500E28A23F697B5D5CC68D5F56EAD14BD504E07182 | |
| 3669 | 3FDC12F5404E74EC1C02AF00C1A6A17F958770ED4A024F5B3644DEFB61F2578E | |
| 3670 | 56013D0B4E7CA3AD255E23DD63369A921D427EEE0E098E8148B16E8A5613A8F8 | |
| 3671 | A5F1099E15AD16EC554B644DF306F0CF3571055A81F1B464529DB49E919F88E7 | |
| 3672 | 581066BEC4765E31BBE28C245BBF0B74610DBA30C63A71A4F3B60593A6B41C6C | |
| 3673 | 636C980828CFE9A3362FBC02F1967F0F770A4790F90DEF9D56E0A76B0703FC58 | |
| 3674 | 2841E6E8D984FB476D4FEB960FFB6B386EC6CBB9EB83704B0AF63F38C77090A8 | |
| 3675 | DAA165E6C6BC86601B14F8E9F504A9D578AF05128D8C1BCEA9D21057958D5DCF | |
| 3676 | 63459352EAD6B4A2A666CC5D85855641CB31507F9E30405977B74356FE985A6D | |
| 3677 | 541884CB65A4F5A8D4C82CB9D82846CC510CBD243E98A0011AD37A81047021DF | |
| 3678 | 46F69D7C3DFAF2F10F1F0CCEFBE12EB70420BE90C450975434E223C67D24226E | |
| 3679 | 8B62BCA6BF93B0B1373AF55E4ADD92775B2DF199B6599CB02DB64B2D6160BEBE | |
| 3680 | 449C057B5B2D226E0F5D7CFB5C9A4A7184FB29A595E91252AE787861A6331FC2 | |
| 3681 | 6605C995D55120121CB463473A7CBD22F270D56CA8E0DA99832A468D399CB9F5 | |
| 3682 | A1CBCF0031D99F3C4F4B78A0944BED5A7B1AE23E3A66EED453917F9296077306 | |
| 3683 | 06CFA772BE60854A30885DC5FB8417E0D3F7AB45ABFE186D877A377F5D17DD35 | |
| 3684 | 0FAB81745294E35A5DCAB20321C6ECAE276B63BB17366867F346CAD53E06AD96 | |
| 3685 | 091CAC75465BCDDFDE9C4364B2A8EF496C4CDF76B058E4BC1F616F6CF62FB60A | |
| 3686 | 64F81BABA7A729B8CF679CEE01B1C985558E8D1493C03B834F3696E5511A1917 | |
| 3687 | 2AE7E16AA8FC516CD2CEDE020BC5777598165B6EF2310F4DBD54FE14071101EB | |
| 3688 | 47F4B2B59778B1EA7DE13ADF46393E07DBE2082C2487944A71CEDD4ED7D3D877 | |
| 3689 | 749D2500636C3996A34EE0CBA770F6B6A655DCB9840AA8236EF3F6182E1C8997 | |
| 3690 | 395077D9DB15B9D0A2DF9A3F6042C94E6E492C965E4E8542AC4AF5B21906B6E8 | |
| 3691 | 4AE2B01C0810E38BFAE99DD83EBFF8E145D09F763B6B134A25A1CC067C6DC1D0 | |
| 3692 | 7286045CE90BA968598D83E5602ED96C72A424848E211C028CB344D95DA04ADE | |
| 3693 | 4C5DADCE9009A72B6EC01E7B5CF8C52BDFD2B416F5E1833F514659D94BB2F452 | |
| 3694 | EC4F2E65CE71AAF79106A0468D76D283ADD44D7DB5760AA429D61C1DC2E912C7 | |
| 3695 | 9446C19557A1D12E7116B765BE522EA166E8F0B604807215323DC5C2DB1F2E05 | |
| 3696 | 246873CE189E03FA291A961E4AD90563A8F7B0E08A67DE4CB3607C6ECA114DD0 | |
| 3697 | DCE97976E208615F3CA13FC44041360086A4A173D5441D9C33A38013099F73E9 | |
| 3698 | 0FBC96808F7442FD4D56DF7C4F2D4C9B2301F7CE626B4C6C1617B8F1584DF195 | |
| 28157acd CR |
3699 | F92FC6385070EB02BF2541307E4EA34C131815FB9028C118F4B792C5E74EAF2B |
| 3700 | 2FEAAA4F5CE91829ABEEAD9B4DC623A08AE0D8049DC1FB98349FFBABD1D2B5F7 | |
| 3701 | B2D58CF489C1116C69B0E39BA3E669B3858004BCD4518C3E0718DC4A64B2EB60 | |
| 3702 | 6502E783FA4B6EBD1A7D112670467B74F8A04DA69311381DC4C26044B4696BEF | |
| 3703 | EFB07B0BFEB7E3F7713B61706F348EF1AC277E6C43A8DAD97241D9A7C0B97D44 | |
| 3704 | 1032D8AE53999D179CF8D749E383D14DFBD6AD57C6808ECD8BC8A3A14ADD112D | |
| 3705 | 77874CA9C03F752F15DC94D2839AA4638F0F842CA5D8D1617BBDD108CA950AF1 | |
| 3706 | 23A235EC6CF12B1D3F4741AC28C4B2906383A1A5492AC1BAB91FC6C7182DA522 | |
| 3707 | 7098CCF89A5D5093AC0BB825E1D135847F5A710DC831D4FC712C41ED765502D1 | |
| 3708 | BC4B74CA6F65B776BF110862316382644EA5C79A6E0C49BCB44DD88A536E25B4 | |
| 3709 | BEBB9CB3A583E579E775BC22B1FB3C1848A7E3B6665942E9AAB756B0522005F1 | |
| 3710 | BCD665F977B85C37FA97B5FF19D2558A874611364B4318FD659D018498E2C994 | |
| 3711 | ACB091EFDAA211F3AD8F720489753816FCD5097334D12B02F6C5CD060AB925F8 | |
| 3712 | E61FA171FC57353144D2946B33E8001D3AB8CEE91F02945934BAD0C06B4757B7 | |
| 3713 | 7CDC8EC97B4FF04B3470D1D4AF486589BA1B55ED9DB471877784FC57398AA686 | |
| 3714 | E7E220D04C06AAB74E7EBF3103ED1248CB7C9F49643CC27E21F3270E096FA915 | |
| 3715 | 486BD1D3B7CE89DBB225AA0F9D75B951817D41472C7B791CACAC2B36BE2005F2 | |
| 3716 | 04AD42AF90A2EC433F70C085DF6589C50744017EB9BEAD58FC26B1B56C285910 | |
| 3717 | 2B2DBA4870802BA859F275815A7AC1032B05028D3044CE118DE5DCF048713250 | |
| 3718 | BDFEF7B95E8CE4DD75EC4B97CFA5C5ED5B8F9191E7D2D2313357230E0629C41F | |
| 3719 | 474B1B9F5F6FC94266621F0D2A50CAEBC60AAF6F24D7062FF4FA0948E12A74F7 | |
| 3720 | 238663776C8A8031577FC30FE095DA64C90E29F51807DCA8F4F83780624DDB14 | |
| 3721 | 556472128263E12E16736088DBFEC7085D3628FFB8A35DF8DF5E400E5C18086B | |
| 3722 | 352680C7575B4DD9063CD9BD7372DF56D39061F6A5A5B1FC98FF6DF7E00978C7 | |
| 3723 | 26220733B9D40E4A97EE56A8FF28BA37EF3ADA813230C43F33A7A84041757A27 | |
| 3724 | 2156176B2F668CC4D76516E4E3C356A9EF414D51FD0549A70647AC86B6456A43 | |
| 3725 | 84056088E5119AA4594F6487B75946BE84C510200BBD779D70E8B61C700A939E | |
| 3726 | 3217C49E69985AD039CC7BE4C730732FE2FE01CBE34CB774B16CEE0358BBB56F | |
| 3727 | C8115E3555D2AA629AA2EEFFD19D729A18ADE2F91B3364818670905186B9B029 | |
| 3728 | D25C642313375FDFA4D6A3BCF349865E7EDDEE435C61FB30B04B8FBB1378D0D2 | |
| 3729 | 694162AD5E4B4A79C234F469DABA61EB15EF3C3D20D8AB5C01BBB4E724FAE144 | |
| 3730 | E9A8470BB2699F3ED8E6F7DD946A0879123459B44E642452C64620F18C7B04D0 | |
| 3731 | AC4296DC67D8FB0B13F180FE00E82FEBEDD7319FC6CBA642489FF2ACF91793F6 | |
| 3732 | 6AB7C3ADC0D0F09A02F42099CEB111C097D73FCFC007422F4EAEBEC99EF05732 | |
| 3733 | 09AAF021324F0B190D026CB0A21838C494A00E4DB00E362A29AA54E05F987D51 | |
| 3734 | F50E98795962DA5A3D7DE59C89E60554AC31E04AC7DE6FB46C5264FF771987AE | |
| 3735 | 12F9E5DCDB3365BB2AE18CEAA43246845CEB68E938AD726BBDDEDB561CF1D260 | |
| 3736 | AF3B9787B7B491F1169E118850886319D2F8A5600AF06675862367BCD68C6D2D | |
| 3737 | 27C5DCE0D733566DDD430FB83A4900B131475116B6D123374463B22148CBD831 | |
| 3738 | 4C524195BADDEB0105C6911770FB4875E94ABDDA49E4AC41D8BA10FC28CC2807 | |
| 3739 | 706AEFFE3B12D4FDAEBA50B255FE2213FB623ECBE1A2BF57355768F12B022AE7 | |
| 3740 | 3F18DBBFCE10279DE13A0633737C7794073255DE5E424DF633C700324C8C795B | |
| 3741 | 0037E819A252770267E46B2307CF4791CF6CBC4D857A18B9DC2B5C493F389AB7 | |
| 3742 | 5A859765342A8F71088A9BF7C94A26FF5EA240B798AA3888FD0D3AB7E696D693 | |
| 3743 | 551D3E2678A451027C4BC4A2A774A3335CA803D85A1D205225E9DD2E219B0849 | |
| 3744 | AAD18F56F7FF65DA30B21DEC14047039178652040A5B3BB9514FE1EDF202660A | |
| 3745 | 24546B62117862181469C192D74F2D5E24483BFDB8173EFA1B62CC8E96553B74 | |
| 3746 | 7BA2A2C763A7DC9E78818FDD67B5C4B13E893A99068383D6A5644DAE0177CA5F | |
| 3747 | BD2B00031ED86DD51E7DF343539233BC6A8B7D75D8A47CB16E1819E8C749EE07 | |
| 3748 | 4053F56BE02CC04A67B73D25365C1BF41AD384749BA989866D54B8A4F69AA1F9 | |
| 3749 | C9752774E8C0C917318567EC7AF0B847EAADB75FDC46BC48FCC80D9F5AB0D56F | |
| 3750 | 762404B5190A07AA02C3F8278BC3058CB57A51D338754BD152E956D42158208C | |
| 3751 | AC56715B72570E91D0F0CE72EAD1E3A9C5895513DA0599AE2B6F2DB678E732A3 | |
| 3752 | 4CC0918D27A93EE94CEBD3A2A2D350A6C116DDF6BF5CBADCBBD83FE3A2CE888E | |
| 3753 | 58F1B8EE470EE81F8EB0E87F30E228616190F4847AA95A77E4D1D85CB463D7EF | |
| 3754 | A33F63AEAAD1822B739AFA770AFBD394B5745ED510C84A9F2B226AC67A9BC0BA | |
| 3755 | 254B6A69F1A3CDD616DD72DEB93677AC1E2FA973B53DA945BAE7FF61B8677A34 | |
| 3756 | 9B53BCD8D20DB78159BF76ABF5708DD847F97A875F1184EDDB3CB7B8086D8568 | |
| 3757 | 36A6557D675CBD5EA77137336E805BC7886CF89651EE2DA8B7FD3D7FD5944361 | |
| 3758 | 42272408AD91353519F895A302A419DB8533730A51BB40BAEB512029B8817E69 | |
| 3759 | 0B8B130DD9E3EF42C32AC8FDB022D55576EA671EE98D484C268953B3D95E8EAF | |
| 3760 | 3524231212ED7116534D26BFC2D69E621FC08EA38C00BA7EEEA53BD71792276D | |
| 3761 | 20630F4F2CE9C444FDB3F0F03C32F419FAD16C05B80CC74FB0187472A78A019F | |
| 3762 | 2E38BBE6E0D62655A4E09F40980217EB56DDF74F42A52459D261B91A240581EC | |
| 3763 | EBFD52810A1FA41EF65D2785484B80F1D728597D8669C0D5C09D2816AF24F752 | |
| 3764 | EA846D2B028077EC6D9830B8CA4ECA7DB77AE637750528395754CC531C905FFF | |
| 3765 | 182B160C780C6EA7AE8F8F42FC07E8B0CB5F9B6AF842C728FAF7F7FC8CB5EFCA | |
| 3766 | 2161C8E0BCDA9B3F100F2FEE71F9BA941DFC5C1A4ACBB3177D2D0A60C7BB23B5 | |
| 3767 | C8304153EC1DC5A4EDE951FBA3CE223B57CAB15E7AEA03104975990DBA44B971 | |
| 3768 | F7D52112B6309798DB7ABF51383CB091225A7BB1721ED1A03DB2684F3754A706 | |
| 3769 | 750B6BF629136CE3353DB97BAF71D6CCC5E857A2ABFE104A6445E3392045DD66 | |
| 3770 | ECD4A5479C18038B5375A0DF3586187ADD6A8F61A51EA1E41FB67FD9D728F3F9 | |
| 3771 | DB8B04772112E69382A34FB7B2DAAF5E7E653B6BB300D8EE284FB49FFEE69A5D | |
| 3772 | 8ADC239268E0612EED7F08E8A9E2995F10856866A7E739FCF376664B92EFDB91 | |
| 3773 | F2633033398A215918D9DA74A4F0F09692FDEFD1BC7FC1899580E6C08D8AF26D | |
| 3774 | 6F720E25241E76A87205A65DC8871D32F92056B5BE9438F3D1225FBAE577ABD7 | |
| 3775 | 952C75DDF86C433F1AADD9798344C62BD300663662E35DF041F143DCD6A4248D | |
| 3776 | 094D9727DB6389CB05BAAA752323280E10C99A8A1717D811C8030DD97DF3D98B | |
| 3777 | 9759CB26CC003F574BDDDB8FE1FC1C8197F8B071FD1E7F4BC3E2212471AC384C | |
| 3778 | 8770AFF104742B88F8158EBBB3467B4ACF504F4A3C4EED87245F0811D936B2F4 | |
| 3779 | 5904EBCA5C1224736F5DFA8934DFF8F6AE0DA84DF6B43CDB6A491F36525CA7AA | |
| 3780 | 221CE05922DC7C0ADEDA5D7A992EDD52CBC4CF82580CE15D953A9658B2EC71D9 | |
| 3781 | E8DC5B3FA8C9534451D457F745DD18C44438A70C7FE457745CDED39FB6F7223D | |
| 3782 | CC4D063B2940B6FA6645E1D68BBB62A440BAF0341B883B1DA34F340B21703E3F | |
| 3783 | D9DE3965E40EB9E61ED42EA03455F25BC25112B11E81A917F02866013E77E47E | |
| 3784 | 3F6F92BB76F2EFA8F7B4BCC20772A78345BA34A074CB4B7AE7988563E402872F | |
| 3785 | B1310D0CB7EBFDF05EAD32944BDC70953DACBAD16E6C72590E403FEDE9A8AEC6 | |
| 3786 | 4520334FB4C53202EA19C5825CE0E8784696AC16C23FCB2A7E8C88417A898594 | |
| 3787 | 7B0A4BAC3B46F6174C9821B3B169E49FB340AB07BB3383868CF6C542A384D610 | |
| 3788 | 6DC6E0C10C26F6FFF27BE7D82936A15A3555AD6B19E84D548D9D58D54998E459 | |
| 3789 | 12CC0C89325E7373588449DAB292DBFECF9872F2C4601B731334B86CAC488F2B | |
| 3790 | D399EBCE0A084B90FF3F41169E124E6777A0DDD635FB31A2572A19C516451978 | |
| 3791 | 717368FD0E14D446AF7382D424F6750E0D61536D574373B42838E4BDAA34FE52 | |
| 3792 | 625EDFDDCAA6E32952115D7FC1B22229AB7BFA0D31E3F19604A79F0EE9529287 | |
| 3793 | 2498C49610A099F76B0A736AA0B887CB0344CB3F32D9654C3607B6373F053233 | |
| 3794 | 02D960850D39EE00007F83ACA09FDBF3E70EE39A24FC57FD0A3AE046DF02A8C4 | |
| 3795 | 8F2432E78BD517E179DFB16AE0FCA608606C8E4F6BD81FE20C168FB3C3625C42 | |
| 3796 | 64CF2BA9CA83298AECD584157576ADF528832AF12415129BF324A3813C324D89 | |
| 3797 | D13EB101F6ECCCDA77AFB15AF36F7B48B34D57D7DE23328D8A97CAD0C5A2461D | |
| 3798 | 6535407EF0F907BA3274B4A87D8BCDC9838398EC738949532BC511FEDCA9772E | |
| 3799 | E7423BEAEECB19FFFDBE73F89138157C87D7726EDCAFAFFE237E3CD466CB668F | |
| 3800 | D2329976D5BA24E298ED057940C2E87A48D65DE79B4F986A4105289776A137F6 | |
| 3801 | FEE20222F3F5F049C7F14B330D4627B15BD48EBC734C8F568755515127A7A8F1 | |
| 3802 | 471CF2ACFA2DBA613834DD7E0B2DDD59ABB2382C2B3D1905C39719EAF1EC04F2 | |
| 3803 | 7F731D084DF76B6948D8F2A0571D66E84DD9626785929DEF390982B9A324BC3E | |
| 3804 | D6D1C5D5FB41F147ADA0BD282387B9DBBD1576E6E128405A4AC575F2F2B83954 | |
| 3805 | B42E52781AE341371167763940506B4EA4A8B243FA32403020498A12D350CDD4 | |
| 3806 | E05A59605665A337B38D8F3F34FFCEA5C16CEAEB4C34E670852C80FFF4E3C624 | |
| 3807 | 6220F65BEE999AA487A2D24C58C4CE684B74A3C5E49C01C4CE274B9C4A442CA8 | |
| 3808 | 50973A35ECD40B85E048B1C0FACF78964D60C026C2E2DFB8941A36E0B7B28CE0 | |
| 3809 | DB5F5A58260716DAB92E187A4E518CD9A93AB5F97CE6ECB8E7523D7B932C99E0 | |
| 3810 | 7A40A73ACCF22F0139925B76E388789F252CCA699209D23B8D341C9C5FF81F0F | |
| 3811 | A2A10C7F159C45896A244B7EFED4CAFE35FDA8C3D4DDD28F336B09DC2CB8F56B | |
| 3812 | A7378D2F3D13CCBCE823A81FB84D051734AAE8395EEA9F9CC35E10B3770BF2B7 | |
| 3813 | 827CEC011B2B125A21B9D923152983DF7196F6B54588C258372D5EF51827B2A6 | |
| 3814 | 23934358274D7ED265EC913C596E9545B357606A2CE0F644A38052B6B9BFE3F0 | |
| 3815 | C973035A7F11BFDF17CB5B3547485C8088551F0A8B739C9E798C15853317FF98 | |
| 3816 | 599A65934B447EB6844727F740985FBB16BC77FBB89622F950B9ECA9F4CF215F | |
| 3817 | 4584CB8C3FABD1F45CE7CFA3123BCFEF5D427E37290DD7E8F5FABF2C1FE63BD3 | |
| 3818 | 8FDE1816F9DCAF432789679CCAA4AC856F8E06A63040CA81FB90E37F3804C7DA | |
| 3819 | C82A0B8C4B9AB803FF5B5494586955608D9B6472583B38203B18BE0943CF6B67 | |
| 3820 | 3EB41329EE7EB0E7B5ABF722F9E855821BB63EA32FA5D4284D3D0F365B2030C4 | |
| 3821 | 5E855F51A64EFD5827BA4AA5865731C1FBFED2F75BDC40D5448A66F1B0EA7CFB | |
| 3822 | F893034C42386B15E22A255A218926E1C4001F499C7127FB7DE4AD11B6FF8E53 | |
| 3823 | BDECEDD7E59F13F614C849FE407F653FF6A4D7F3DC6C260D728B36A7EAD4453C | |
| 3824 | 934B3A6CE00C42F3B5093B9A6783C36F989278C3B2BE8A5909589F0F95937F2D | |
| 3825 | D2AD01B3C289E9BCBC07CFEB2B0668678CCBEF25C2F939CBE4E332870E705946 | |
| 3826 | 35FDFE97E45D356B6C0AA8164A05D6FFBFEAC2990937E9024861DF345B485B83 | |
| 3827 | 21A1B21A779EED3EE73A7ECDC0C464D1653D76B611A8C76CBC9D2C280EE59347 | |
| 3828 | 71331132D76F5E0D2B3277958B49C7E36E9ADE80E7C9654A68413519E4FF29C8 | |
| 3829 | A05534C8C1E12A228F022C7AB1B5523FFED08986443074CB7C029D2F535A972F | |
| 3830 | 6E9414811636A915F95B7264505C2DC4531C9C6D8B8399FF96D46A358796EF7C | |
| 3831 | AB643E601824CFC87692AFF952DA1103AC8C396579F6C3D345263B9C09560DA4 | |
| 3832 | 8369CFD7DD502C3116B270BD74219B39B368EDCE1BA32DF8976850ED46480612 | |
| 3833 | D069C3731337BB9232F2D641A5ED8611C97716597D6C7FFCF6A42D00432935B0 | |
| 3834 | 95A56030C4CDF19EFB5FDBEE9806744332A18873711076E6EC4FABE9588D1D4C | |
| 3835 | 1771FFCF701E6FDC9CB9BE14C7E91D8FFC898C9A4483FB67176B65E4B517131A | |
| 3836 | 6420B2C2B92C6AF4E3DF7C16F1FCD5041FDA0DB071C902204A219064E00D3829 | |
| 3837 | 94BB53E1468F984777F412A8205DD06F7B9F7CCB61963411B69E39A6B0969684 | |
| 3838 | 0F04A5D4CFE09D9448B91033E8E0DF40BFC7A2C26B391982328FE357D811A7F7 | |
| 3839 | 31DCE0991BC63F286C63072503E3BE5A4FA023FD0C90B60AD076D879D5142C60 | |
| 3840 | 33E9A2F6BECA8FA37EAB6F6AD1C007AD8458CFF7062C0D59FBE2F464CC5F819C | |
| 3841 | 0100DC5B1F492C994C21DB335E31F9028A8405BD2C7C9E6B4E6B1664DB0924C6 | |
| 3842 | C4C3421D5DBD24AB2364A4FF49301E18CEAAE951D58874020EC0FA0CCC8F38CD | |
| 3843 | 28718F2B31F98160BD68187256DA6E01B5D3CD36BE526EB02090DFC6AFD89C4A | |
| 3844 | D03F115EDC247B41211A4E289CDE67B424CD665B4D2DD457874D160400F0255B | |
| 3845 | ADF7EF681C6C52DD9FD13D2780CD10D11D1136A72CA8072CF43CCCCFD4E54FFB | |
| 3846 | B36EBE90605C4E273D7BD418958EB0B170312CC10B1BF7BC0D8F94BC4FD984DB | |
| 3847 | 937891E06C7F3AC2FBD3C4F916A7D7CCF96C38168A9662326C4AC8860F1CC17D | |
| 3848 | 0A02AA42C73D0D974B3B61A0D81B93DE2641D71272B9F2BCA4B5A1F2AF440BD1 | |
| 3849 | 9DC246A79AEEC9CF26DC34572C5F0FD0433E6684859C9D43F06DC15594298A9C | |
| 3850 | 47D3DD335FE4D21B2B26BA0ABBA0A8DAAFC4FBED4E107C2E680DCDCFA0659E53 | |
| 3851 | 66319DF3D69924E79D9B3123A085245208E712A4F86D023CE0A3BFD16C4F5890 | |
| 3852 | 69DFB64E9E48E4F0AA062AA392F0224511DABF7FEC63B94FA3E5B1D74816257A | |
| 3853 | 3A4DA3AA4A8575DEDEE71B854E004FC2784D7BAB4C84A7DEF212AFE275C29A85 | |
| 3854 | 00BD8F311E3687EB95C20E3FD328A904117E71CFEDD68780A1F595B1BF5755D0 | |
| 3855 | 6CC3C174A3D4D9C4BD0ADB763898043607ADFE2F62DCD913433E02C1C1D1363C | |
| 3856 | CE328B6C1466839E3C22F30D9353EA0611D68EF070235F731EEE2950C6CFE0C1 | |
| 3857 | 09563F9B9C39EA4526E8CE38FFCB9FDCC762B25AD3189ED8FFA914E59D8DF563 | |
| 3858 | 441C51C304D6587D5B543C25AF3673E532AEFE0C1D2BFFA04C9450E55B223CD7 | |
| 3859 | 446F777B5E52154E6F980E1E7380E5DCB12AA7B1905ECB92E3E7DD250D64C7EC | |
| 3860 | E2A1FE667B328277A33177655C3E453E10CBB5DE3630E633887E39BC92B29B82 | |
| 3861 | 14ADDC605199C950BCD18C28F2CD834BBCC37ADEAA6139C6765ED40C08FCB1D9 | |
| 3862 | 24CB537F0F0F14F9C89FA111CD84E5A417BF282A65C22F1AF43F7A00CFF754D0 | |
| 3863 | 4CD244FEB1B7299FD69BEE63C0E4899EFA527367CFC4C920C20085483EECC059 | |
| 3864 | 2F66C368808DA656B1C092CB53A9B3E5A5250889BAD55E241EAB6004ACE3431E | |
| 3865 | BEFCB9BE94C25E1CEF0B3632D3D72279CE5E2F05F75A343CB7658BDC2C120C26 | |
| 3866 | 685800504B05A938C56FC91627652B0D8FAB94F4F57DF2702C85AB021E640DC9 | |
| 3867 | 013F7EC636AD0770A6D90F7289946CF03951E6D92F8066F68F23842E70C0008E | |
| 3868 | BA986F9DF7A78C0EB30350DD52EAF82D32053C3C8182C51BE3171F9094952C13 | |
| 3869 | 628403CABE67EF308B2492419D94F93E7C0453873A7C6141D12ED6B482A70AD0 | |
| 3870 | 33C572EFC7431EC51A388D0A7FFB1122F6DE4DE70BDC8597B7F7FF220275A8C6 | |
| 3871 | AA05147874727458E624A5338EBE95A99D1529E7FAF981F4E5B7158D2F6DB7D7 | |
| 3872 | 057756D3E0146EEA649108E6EB17B186FD2314ABB0DEF5A02C75542C3EDF11DC | |
| 3873 | E5660CAEE7A102627B110ECABEF1F0457E619F429EED4B4D4F2ED19D276B50ED | |
| 3874 | C53A515750A44A139CE3AF0F54EC7E4D2E9A95E7C5560C37AE2CE8C2069C69B9 | |
| 3875 | 49D82C48629D21CB7976CAF638EDEBB48BCF928211909F9FC6F1EC53557C3CDE | |
| 3876 | B536D5C2397681C2EEC7B1B45AA6330336C5A1A603B117B328FBF1DCE5DD4984 | |
| 3877 | CF2EA6BE5AE975AC530AD0AEAA68C6854452A8E152B01CE21A3EF3FBBF814808 | |
| 3878 | 041F415F88F4C0D1B138C6794396D6384BB3B1940D8541072D0E0EF3B072C84F | |
| 3879 | 175E90E9BE167D3623BAA68BAE16EB8D3A37B01EFA248C99BC387EC50FC1FCAE | |
| 3880 | 81F2059B29868ED55DFB5EA982942766466C2912A51B9B245E26704767B05377 | |
| 3881 | EE575D2723260CF9443EE83D48AF5311D19F3AB2E0B9EA99EE33A9DAA08E6884 | |
| 3882 | 4885BA35B092C033C52547F35CC840FBD7ADE26AB8E5791930A80ED7EBC17F96 | |
| 3883 | 40C4E1F142253C8BEAEB88061D486C8BA3776DF2598C6EE4D22A371B02D2FD20 | |
| 3884 | 402A7F2278DC774236E57CC2E43BAD027D695D04AF02A9668E7092E21FB3F268 | |
| 3885 | 1453AD9C2158B231E5CDCDA5A37A4EA0B408C61EBD2AC7A669270999BB7C3D4A | |
| 3886 | 9590E4DDAC50350CC929557EE6B694EE13BCBF3A8889ED59AB36505F238106E4 | |
| 3887 | 908C678110AFF73227B0C1F6C1B622C76C242DFA0213AA7ADD5C98F344AE0530 | |
| 3888 | C97EB6B4FD044C1752977AE8577E22DBC0B183711E47A410D9DA539121932A36 | |
| 3889 | 313F9B79F48DBFCA5F6700D89DC9469DEF3C5D0E8A36FCD60A3C2B00748F53A2 | |
| 3890 | C928B80420610C7FFE1C141C226BAD4468C9439954692DC5BCC7F01562C902C8 | |
| 3891 | 6BA19D25BF6993DADDDE6EFCA7564DBBD28B37D8A3262A08EAF397A48BDF547D | |
| 3892 | E2B3B20B3AA1F105F092A2189AECE726EF0F7F25D497CEEE57CAE48576453CA3 | |
| 3893 | 369222BF23760E85A714E33821B4B08B3C1159B766BBFC8B87BDC64A3FB8096A | |
| 3894 | 695FB27F7625D20A822A731887F119E45255348442BC5F8C08BEE83B37951225 | |
| 3895 | 70C65307C98895BA0FCFA9DAFC464BAD78A182BEA1DE19B34CE77CC4A14B78F6 | |
| 3896 | E11C085DE14039B61084E9E83E074722DA3D4772C239E51606648B866874D40D | |
| 3897 | 9B445DB50B497725E2373C268ABE838CFA5FF2DFACD643539A6A9F86C25F0CEB | |
| 3898 | 51429E91FE1AC28B04D9E8FD5E440F59B0FF11BCFC1CC834E42E19C202986947 | |
| 3899 | 08A7FE14B616C5C105C400B88151231E0303D22E1426DF7D586598D1378AF870 | |
| 3900 | 6F590BDB68110428D0561C5E1AE7400BEC60AA1FDB9A189A0BFFEB2312414C95 | |
| 3901 | 187F70F0B327F09B83FCBDCBA8CCCC0E41ECB9AEC489ECAB26666BE8A8AB10FE | |
| 3902 | 5A95F2A0EE3EAAF21D40D5CB3B155A2B9CEC7615D6F267121CBEB3D85C283E9B | |
| 3903 | 36D9B0940DE48B5687FF8E5364C8D7B851AF3F8502B288AF7570965E62029803 | |
| 3904 | 153080441CA754CFF0951056ECAC2C1C58D0EA87B93D3B09A0423E3FDFE1E44B | |
| 3905 | 97550E8AF88B65E672E8B309F526590A438E38E48A14E01530BAAB755721AED7 | |
| 3906 | 00BE9A1AD476F61170D4A1FEBC0FCB1486F75F68F5E8809F735F7C7EE0398BAD | |
| 3907 | 6670E1A678A99F2AE33D639FDB6E504AA9F02B3D875DADCDC965993A86112BB1 | |
| 3908 | 4E06541C8D658E64B26A7B4F38C0BD161D25AD0B0E815C4CAA65D85C998D7DFE | |
| 3909 | DFE69331D0447ADEAE5E24A9896BFEF8493CEA0FDFB81209DD068EBF24D3E9DB | |
| 3910 | A91FFAB381BA9B169595C1171F986820E9BB9AF52726340C8A256411D89A777B | |
| 3911 | 2B804FE94DA7D9E9FD0832F22BC354D4D31198712BD3D2A3FA433B0C2C8EC0D9 | |
| 3912 | B8A0A852C2106A040658AFDA6ACF672F02D432FA4CEF0ED148A6F08645D0C73B | |
| 3913 | 268AD4AAC25EF9DACCD53E4FCF07E2DCD9A32210340D7F4295A187365A4A904D | |
| 3914 | 68960C4E644A40B9F4E3C6EB2154B8456A7F8200CAC41F87A5936D1B230E0431 | |
| 3915 | F4D65028EAD48BA22CF41815D8CFFAEF0BC411E100A401CCF25AA630782D9C0C | |
| 3916 | 4DCC6834877FF4A0330C2C7EE37C58AEE4A53AC28F0AE02ABF2ED7E65D80061F | |
| 3917 | 905E38EACCB58390375DADD554C98CA2B005579F8E724C97B88F6AE8289EF21C | |
| 3918 | F351267D586922AFDD20892BF3263F5FBAA4A3E7C16024187FBBED81B557196B | |
| 3919 | D2EACC985930C0E97539EFA52BE652EC950212E156F8DF4B88D1AF2992B79C5F | |
| 3920 | D25DCD8099CD2AF75FCDEC084AC81B94D4B09488B6A8DB446741774E11AF113D | |
| 3921 | DE79BCDE46F1D30EAFADA8401EB76FFF0613F54C508076AC8CE62773DC44DC65 | |
| 3922 | 194083F0305D174A25E9CAB354019D1DD787DCBFC00079AF126E5C75CB4CB10B | |
| 3923 | CCE3BCBFCFF8470658E234CE47CE610A064C90CEEE64BF4E94CBFF0769EDA6CB | |
| 3924 | 3F60B4F4A12236BD273ADC174DA360C7A302B7154D610C2EBD0439EC2A0AC1BF | |
| 3925 | 708F327C709AC551F72F93318C61E227B2C04BA2F5BEC6913A7D14E684831B80 | |
| 3926 | F625FD2526552FC2A952112EA17BD97C28C4D5C4A985703206EA7599C7CE5543 | |
| 3927 | 9F06D89FAE65483C61CC99C1B479062F514156462B010FB0C130FC44BCC8B1F3 | |
| 3928 | 6437FEFC5682B9619235BDE023C7FCD389848BB255BA164FCC11B298E6FF81F0 | |
| 3929 | 198FBAE98AAE5094380AEF9C9EBDF7D9DC8E063E01D20CFF3318C0BE4539B03D | |
| 3930 | 454FEE6C426FB9B50EFC5A5D90993C2ABE542ABB07540EFD18DEF8BA9C649452 | |
| 3931 | 0BAAAEE1BA0AA0174616980A1FAA41DBF6045F6D71911826BCBBB85A29C50DFE | |
| 3932 | 81D474562C33133AFA8BCE730A347B7225928AC3393FF04080DD74B685D83C71 | |
| 3933 | C79974FF1BD93EB1483B4115633F8D22F5740EDDF7C0AB00EA0E5C0E33BB9AB2 | |
| 3934 | 6B25E4783B47E129BBF5315249BAADD06EE754442F58F803F50FDFC3B90E33A1 | |
| 3935 | F15D292ADA6C5A562474E339A0EDE2AE8C5225E182C0AA5986E34AF85CA30185 | |
| 3936 | 73FDA3B97EA7AC64E1834E4B7BAC07C4404B41D7D327E4A6D11E672AF6B0FD5B | |
| 3937 | B16BC5C05C3A6021030129C7970EA1B6255E57AEB5DFAE77951667C85E9C7912 | |
| 3938 | D626DD5EBE8080FAF71916E21E3908CF1187C239AE7F99BAFA6AF6FA9BB8F6FA | |
| 3939 | 10548EDF22519AA6C065B6F36B362FF63AB22C28EB9A2C096AB5C3B3ABF9F0E4 | |
| 3940 | 230B111051268A91099FD425298224BBBF3D82773E80661F46A2108E434E950E | |
| 3941 | 0667FFC199BBDF202A02760561FA2C938D633141C2567A71769553DDBB977E62 | |
| 3942 | 487AE5F58F405E2DF065A1082C64230EF6988F371875E7455AE359D413FC19E1 | |
| 3943 | 618E13423380CF7101C1E5786E437697BCD3AFFDFAD0E2F4988B59AFD74CCA7F | |
| 3944 | C0849B717EC76D1CDADAE754FF3E2888100F6F8AA5A407565CBAE2519FCAC7A3 | |
| 3945 | 6BA7D2804B55277A96785BAA7007840ABA7097BF029A42F09BBABDA7F618B009 | |
| 3946 | 02B20D0C5166170E49F927ECEA486DBF60D4545C406288BEA9185D29419AF9B1 | |
| 3947 | DC5B2426047444D704D1C8284DB6C8916028CB559A1A1D993C372432A8FEF201 | |
| 3948 | 8B15EBDF1839FBCC99AF4B2CC70184227739FEEA44F71B17C066BC6E8281BE57 | |
| 3949 | FA43B781CD0B22DCBB4D45FE5D043F7F77FEBBBD6E901021405E21F369075CC1 | |
| 3950 | A5EFAE8B1223DA341CDBA4422051DAD575D85B8F21D3D0A23AEF706E6C7889E8 | |
| 3951 | 90BD5507B77214FEC20248907D9CC76F06261EDB9C1872B58D5B24EC75A12637 | |
| 3952 | 46B326DA1CB035F5101A0D61423E929D1492857D8D3472CA79CF864B75E8C884 | |
| 3953 | CBC59B3F398D2AC1E72EDD7712EB9C771E151DA8F345F49CA9184D793531AC0E | |
| 3954 | 6C61BBF5374CC131D7D132CD9DE327A6466ADBA8ED66CAF4C3619CCCF439036A | |
| 3955 | C79828F7F6CA8FA0E6BF1156589D5FCA0180A8E40B9BD937C20A3759C4A5D2CD | |
| 3956 | AF6065B9B04660DA644AC7812348F005614E3E68F34FFD9CE2A8D4BD457EF076 | |
| 3957 | B53F1AD0855916BB95532FA2191B5AFF57E34028A2438363A281D4A8A17C7271 | |
| 3958 | 73C772DC4E1E13214B8C8FDEE2535C68728AB24D9D1A966B745FF6DB0347B907 | |
| 3959 | 92EAFEF9B76EEDF4A9D21D77E48DA53AE70D4B82C2F170D746667AA7560481D9 | |
| 3960 | 953DC48BD52240ABC2CCA770150E0766F6D2CD68D3C6C98A216CFDAC5F7AA074 | |
| 3961 | 439A23338CCBE958C09B80A1114492669E06A8B59F11E09A06D5CA95F5079CE7 | |
| 3962 | 1F05A6C757F2E7E77063BE425D4F9C231774326C5F474662DA165929D06DC06E | |
| 3963 | 5EB521CCD55445C0D8D309CD4E86DCC01BCBED2461536DD64C8EFABAE3113080 | |
| 3964 | 33756075E86C360F5172C2AE9751E166E095C2768C6F78D2F034D7B8AAEB4AF1 | |
| 3965 | 5AF5455B393ABDA883E40430EADF998233BCFF3FEB60BE426FA32BBF703087D5 | |
| 3966 | 162A205F35C5EE5B495C818576E0A0D0185C46B2261D0A3AE5581AFC867F0421 | |
| 3967 | 33EFA2AAD59FF5F4B28B4237BE6EA30F411C480A5419E88FFFF6F71CFBF524B7 | |
| 3968 | 3373C8779F3D38348202046FF56A9AA81DE74452FB2B4D74FF664484128E9773 | |
| 3969 | 3828C9CBC64ED407B4D249DFD88E4C6059E3A0EF0F78C477D9173A8AAAF3C2C0 | |
| 3970 | 4442D24EE56A41796E1F022625F147350D01A2941005D7D76466C09F72B4C6EC | |
| 3971 | 2ABEC87DCB93686A9490D123996F2E0233A4D5789606C1DF88FA1E2346334FBE | |
| 3972 | 8C2F1D0604EFB1480D7D92C60EF352B98D40E529D1FA9BFC08E65ABE99E9A3A7 | |
| 3973 | ECBD6640D103D25F7CA7C3746DDE20F8872E34CE5CE1A5D705F26505607B534B | |
| 3974 | D1E2EFF16A88B21785BCF5C0C7C94EF71D7F5B70C1CD648F79A0D62E8DD798AF | |
| 3975 | 78A6BE13AF22426C6A3F84E74AEDF294FBC6CECC7DA03263BA8D3BECEB51E07E | |
| 3976 | 5183C9714D421273EEA1786FCF2136FB35200F39403247204A93D8DD0E061A70 | |
| 3977 | FD3FAC8DE2941B0790D1286E70BB164B608F663157B36B92D9FBF4806AC5C85C | |
| 3978 | 83D3AADDA9B5ADC8801F54DFACBD443D0671EFCC98638D5AA83640991C468B02 | |
| 3979 | 050576A22700A7D253C080847012A5D12AFE1F64E9CEB0A8BD9D9835BE9DFD73 | |
| 3980 | C08F415F9FAC16E7335CFAAD30916DA2208A1A1D92D94CC43FFE83536320607A | |
| 3981 | AE216F2423F1C44F3EEAE597C614DE23A4F5AD0E0EEC702DDB0B681518AC2661 | |
| 3982 | 83D85D58BA9351FDFAEDCEE6A657F3013D10FB108BEC655DDDD2B292A0DBA305 | |
| 3983 | 76E08D8776153981BD805B191643C49FE7F112ECCF33887E05208CFDA3035E7C | |
| 3984 | 53DE8F2DC368F3EFD64A5FF94EB46372FFC5C3600A5EB79F6D55F0F5EE536255 | |
| 3985 | 564E3D4605CD5513812E00C02E68AE770FC74B5D2B474EB11257CE60B2EE5385 | |
| 3986 | 8D79B59B8E57FEA51662D012044EB1E759424B00D6E3C9B60F760629AA6B3C71 | |
| 3987 | AE02C0D5E8EEF62B316E200F2A65DFEA797673AB9DBDB269675F4EBE0AEE8A56 | |
| 3988 | 938B7ECFB5D0818831CD99DA461145B2A7733400650880C582B5FE0A7F65373B | |
| 3989 | 9F06931E17B0E338C9749913C4416B1A2948672B5920AC7394BD49B512A96788 | |
| 3990 | EA25AEB8111D7B1010F78A6F0568BCC2A92E3E13569EDEAE5E6AA4BD2DB61687 | |
| 3991 | C271F6FA05A7374E156C580483B5AB1C352BB2FF2FA68BFA681E8C4FDEE4D8D2 | |
| 3992 | A794254B3340FA82B3A4D373D2780C7404F3E1C58EBF35C235D47A67094E2982 | |
| 3993 | 2D2CEFC9D4546127FE445ADDBA25BCEE039D86874BE5D3A8B35C8E6DE6D7C751 | |
| 3994 | F91DD71BA744782C422C2A4410CCDE106C17BE390D58480565FB9C382AD36D2B | |
| 3995 | 674DC1AD7A72D3E61AC694509ACE0D0CD0BD0DDB3E4C54B026A803A82973D875 | |
| 3996 | 13DCD6A5D33A89893C0E1B03EF1BA703753969925B835D1EA598ED1C464CBBDC | |
| 3997 | DE0048DF3B5597B9A8B69620721016D72F217EFE031C690E78F55AB9F25D50FF | |
| 3998 | 0A9313DBF049CC299B66741668FB6602A8FDA41791BD90D61C039D8181CF9CDF | |
| 3999 | E0E400EA339267C6DE2B6787385714C53DBFD8A3B11FA8ACDFD1D9E1DCFB9F00 | |
| 4000 | 823AA131B63CBC3CA7838A410BB79A777E7AFF2E94539E6CC4F644558FAF742A | |
| 4001 | 7D96591496EF10E5B4D9197B6B8A1DF530DE579F6198EAAC693E8E4342283898 | |
| 4002 | D809C1EEC0EAA25D8F9D2483255F3EABC9FB4E9EE501077C2611A4A9C37304D5 | |
| 4003 | 9DA262A5A272E1FAA9A4691C5A2D095042C4A0E81003B4A3D9C3D53A88DEA774 | |
| 4004 | 1880BEE754D33DFAF8058A7919DB3F3EDC3B565F8E86E231557A4D48FF9722B9 | |
| 4005 | 905631EEE5331EB628B68553279CF12D3B124FDA6C82CC741E45456A5152685D | |
| 4006 | 7656D0373F3BE63445DAE733E6271FF786DC1CEB0F76286F8B1BB3E4EF745C7D | |
| 4007 | D64916DFD010A1754C6BF0F1545E865924F6FC60B8B36901C9984A2123144EF5 | |
| 4008 | DF3ED789DFE1C2A9C8C4165771BE0475238D78BC3C4B89E1281B842C9484BCED | |
| 4009 | 9C04781D867F142E4CD8870ABED25BD99CACC7E16762CB89D83C32DAE0BB4A43 | |
| 4010 | BA2CD338F47DAA89524529F276664C563C23EBED3A46A3A1837BE45FA0D92C74 | |
| 4011 | 7D2F624AC5379325AAD79C73AD35C55952BEB47D938E1E069530AD71A19CC017 | |
| 4012 | 6F215945A8299281E8D603884F30D948F583BDF3D0634511D24EF5F81CB639DB | |
| 4013 | EF876929DBD5882BE184D9FD1DAEDE8CE9BBBF0650B820B94F8FB1DE9C72317D | |
| 4014 | A3CB6D4018B5DD3F15658121816266243E5576A9593F6CEB97A3DA96EE7A0913 | |
| 4015 | C67E9C7E67EA60618250E53A4922B087DCEB67A6FD88A38B95F2905878074EC7 | |
| 4016 | 2EEE2E47986F5B4DE3E734CB12C635435D1F3CB9FB73AB976B4B62B50029D650 | |
| 4017 | BCCB5CB2C16912C7798DBA5A10E05BE321E0D8141760CD4A71A58615503624CA | |
| 4018 | D18653A8051F18BDA8530020883188513B44ACB06C51761A69A9454264B4353E | |
| 4019 | 3C691FD15BC6490AACD307018B211C444A3BA2DFBE64B4554589C3EE03985ED6 | |
| 4020 | 19964D980CBF18EF329C905B1562D07A476592161431BB9C13DD616C324856B1 | |
| 4021 | D99367903981A959D6544C668FF56A11A4E6A8F137CCF811C08760C335EACD7A | |
| 4022 | 896DEB339070364757DA87D674AEC3CF2B73A907972111AD235E3E687BEBEFC4 | |
| 4023 | 1B9E0244FE67A10C1F1F483C25A077440357190D8C23086A468DF5F204C4E77D | |
| 4024 | A99E44D25F84F187759F801DB1E823042391062DC6CDB515AD7468A21E67BD8D | |
| 4025 | 531DDA55A4484C5737393AC599F7142DCF408D39E6F21FEEA1E255ECAB4880CB | |
| 4026 | BD30235F6A06D8B85BB96C496BB4945B5D869D03AE23CD53592B1CC9E603D198 | |
| 4027 | 9636D1EEF8CC323D05A4D115DF2050D0336EB847FD254C6DD87DB1C16F957637 | |
| 4028 | 1328D89FD3E824277B47F4D184292023F7164FC817402915AD18EA5FDDC0E568 | |
| 4029 | 484B69C1BD707EE0F17E99F841A003ADA952DA003D7E3015F7CD6671C99866C0 | |
| 4030 | 38AA0004C4EC22083FC499B2D54426D73F355FC40CE9FF0F4FF898D3ACF54CE9 | |
| 4031 | F5C35329EA8C3D8342C375E94D76746321EC3C2C41CBC5C99111D35BDA763A95 | |
| 4032 | F3E087E544B8FF99442822D00C64519AFF28A4567239251D7F857CB66C411A92 | |
| 4033 | 3EB1A627B5DF96AE5186F2A2C6DC3599EAE470E9D5E4DD51AA51DB6CE0DF132C | |
| 4034 | C49E2267E3AE73A37974CAF206FAA471502CA50DD99A02D23E0BD2ADA02DB11A | |
| 4035 | FAA4F1CC935ED0CC09366A347B5C102485247803980B88F87068DADC477EA546 | |
| 4036 | BED59BAB0DD6C146EE76891DC7AF56D87C5128C6B026ACFDDD40F9311848F1B0 | |
| 4037 | 3745D94A521C53F96169EB060AA88AC19762B7BA18298A7E6783CFCE246A8162 | |
| 4038 | EFF4A3FF1D589C7B4F24C60E04F073882A3B7AEE9517DB1673E86353F8C7A2DC | |
| 4039 | C7450175350658583C38546D7171A7D9A2F95961622E5DE16BE57FDC37FCBEF3 | |
| 4040 | 17D5EFFB641A127B76B0E210782DCB7A6D9C8FF97727B7CB885E77DE90BB77B7 | |
| 4041 | 93E59B9B05EFAD7EA49396A590F926F0E3EED3C3D00B3469C45234E48E5A3C70 | |
| 4042 | 95F6B06783446665A1FF599209988DF2E14C8A4EB6B4DDA0C919A73FBC5DD48F | |
| 4043 | 278AADF0F2DC3B1AD4D5177A751B206455B2B8180A7D0A6CA16A2CFD6F042800 | |
| 4044 | 0A51B62EDF48A50FC30534DE393F56298C446FDA0E2688619D25DDA39512E5C3 | |
| 4045 | 07DBD0AFA890DEF8377901E3D083FD5E041DE516800D366760CF2F60EA788F38 | |
| 4046 | E31229C576DC3C2ACE277621BF3E1945A8AEE7F64F590C6E9BD7B8182F0E7052 | |
| 4047 | 0B04E382A9D021E2959A4A7B7F0B8153D1815FE44491EFEB187C484CFF9470AB | |
| 4048 | 9760044720C74C13499D52860603439FE20AAFBC968A7085BF7903715A103390 | |
| 4049 | 408DF7BF7F5AABD26E640BC4ACC9AD5A5420EAAE93C01C54D4774ECE5AD5DAC0 | |
| 4050 | A375696AE02782C54006A6C5E7AB2376DD3CF580DC319BD8AF07556B3198F678 | |
| 4051 | 4690576921D1DA4E8CA6E8D2AB24144BE55C0CAAA29FE540DBEDE0FA19CE4915 | |
| 4052 | F7FDC6F3D415C163159AA840EDDBF61A32DA2282BB6F7BE3C0B25B97D6F33B9D | |
| 4053 | ADB359E7FE393FD07F66A90F24CBDF65ACA58991D236BF55E70F0F83EEEFFA7B | |
| 4054 | BD9280C77836ACA05F62087D87FC851BA3FAA9B4828C1C04DF4874B08134AAC0 | |
| 4055 | D7375DFE924480A118551247A787F46701484F13B78CBF53C4E2505E9BDB4A6D | |
| 4056 | 46EB367B6C592BEF0C4F0435F6AA1AB16EFE3CFFF2E0EF873878EAEFD8F7BC46 | |
| 4057 | 91442950C720410F21132F1CC1072DD9AA0732E7A808A4B4DB0EF4C0FC4075B5 | |
| 4058 | 3E05559438311C575D06FFE434832932457F14A3B344822DB9251781B4AE7130 | |
| 4059 | C6BD78F20AE92800782012B65AA2F50E5F586481E2B2555F9E220636BD042219 | |
| 4060 | 6D0ED63BC5A1C9745AEAA322848605D0A21BFF7063668D4424603C3B7BBA7E77 | |
| 4061 | 1A487FDBA58C679B6EC246740FDC50E965504B13EE43757B8D7021C6DEFD5D89 | |
| 4062 | A6F0CCA97767C20D1B8A3AE2603A32DCAB67CDB24563811976850786CE6555A3 | |
| 4063 | C4E05C5144F6BB540C67C6AAAB1549C698E67953F6C723072D000128F5972331 | |
| 4064 | FAF75692D9C468365C2D314617C1A9ED01621C246202A838A5C090722A93C946 | |
| 4065 | 39FE88C132E81ADB3057B068E5AAB73388F11281B4464C70FA539E5DB5600431 | |
| 4066 | 46F3B5F9708F0A702C59D022A3E490BD13F1163841408D5FE0296E3787DC7824 | |
| 4067 | D7DF4D1F51DD1D691B9116EBD597A15E991686B587C34B99D48DE220E4DE678F | |
| 4068 | 70C18D63A8A928EAF6D4020BB86ED766CED705064CA178108F824E69D23948B3 | |
| 4069 | 918D8990A9DA0D5BC6BB6BFAB120C4116C4E3748BAFC59774D2E2B1E54E28356 | |
| 4070 | 1223B92E55DD1C38C7992EAE97499342C34205EA9D78962228312BC8544C4C35 | |
| 4071 | 64A7B9F0995EF130FCDF4A6AC271B238CCF2F14ACFAF2C52CF5E88D94427B59D | |
| 4072 | 3CA2192E072E60AE68635AA43B4CCD84818F8BA3BE6E7C3A12141B051EC066CE | |
| 4073 | F22B72F32F7DB4C2DE9641473F2E7DD67B3016360293C495AACB39D0D09EE8A5 | |
| 4074 | 829EA662A480655AF4372BC006D9000553BF51BCD2820759776AF30A58A4CD01 | |
| 4075 | F909C84B66320F657E59932B16CBB4660F30003F8D537358C07F0534C0EA2E9A | |
| 4076 | 93632315A142C322159D6E8C243767FCD9A6AE5E44608F1C546D6F14988C289E | |
| 4077 | F724AD9706E1AC8B8B69525F1D9A1EF2123C1E226F34D8CD54B0A5831EFFAC4E | |
| 4078 | 824F342E25FDD64C8095CB7E0B077CAB654DD5CD8410B2B776C750F4A03198C3 | |
| 4079 | 60D50F2091D26CA50C3D1EADD19A4474152013C0A7C4395C43A67DE232D21B96 | |
| 4080 | 44F30F6A33B7A6E515705F50730FAE828CB828A83C6245F29BA4BDB0F2DED3D9 | |
| 4081 | 4D1247CC5844DB55A42D11BD6D5D2A36FE316C0287789955B81B32B2C7BC490F | |
| 4082 | 78021F2667D4F0C866F5FE119A416CC10AD5E0E66BA57EDA546299E6FEC3D74B | |
| 4083 | C1A0144D3759CE48361B442546425E1A5BADCB653F888EA9005B1BCBBE61F117 | |
| 4084 | F7DB7003CEB38EC717D97CB107E8C36D5C9CBDA7A64CBA9DCA6F4D37C72A754C | |
| 4085 | 54D7E98B45EAEBF36FEA9617EE21BE9302AE83F8D63ACCC2ED2A930A9A506823 | |
| 4086 | 8D402F62664DCFF4A30AD57E7CCD617EE8D65EA164C3A6258937E76BF1CF6F9E | |
| 4087 | DE29CC5CC415DA1CAC77E47EA11F0581403207A4BA16C060AF0B7EBBAB4CB949 | |
| 4088 | EB01F91C29151CDC84940BFF14BB524DEB28A0BC04D3435B9BC2ADCB20FDB237 | |
| 4089 | 4719C73156BFD458ED3203A03C7E2672D96D77D3392455E51664AC15EBCA25A0 | |
| 4090 | 700BB1D41AB6787C8B5B8247445B02394EFADBEEAC50950266C8B5D412590C1F | |
| 4091 | CE473FBC668B9E34BFB993AEC72FFA4C0404D845AB9A7015617E314CF30EA7FE | |
| 4092 | D55ABB0566CF07BF9EE798FAA2DAC7DB46AF29BAF4336BA55380CA606784ADBC | |
| 4093 | 1557AA647220FF1545D4932A5F1DC343AA1CEBE547EAF0CBFB3073614D0D9529 | |
| 4094 | 499884742FC1564657BF85E7CDF0B4A808CF72E7795628DC27FB352A88E9EEF9 | |
| 4095 | A1F87518E565B56ACE1B38268E1A145B3D337DC708E43C5531E392BEE0C88675 | |
| 4096 | 29A7A7F0AF6C8463036B9F0BB3F13EE9D80E7FEEC301136C6B9B8127B0796A56 | |
| 4097 | 7A649DF11FA433BACC73C9119055962D0B4B9D8357E7D85F0AD462E498F492B0 | |
| 4098 | 56A39629217CCFBA0A2D64E614E49CF82D2A07264069FC97A9D3CB23AEA7AF41 | |
| 4099 | 276B91EFBC9D29996E78C35F5C5E2D55F8EF74743CBF70B30F99152C4CCF3B89 | |
| 4100 | 7E63CF273D8A7A144DD378E349057DAC564A504C779F2302CAD97D3DDE96F547 | |
| 4101 | 3C825E38DF9D5B8B7AA92992EC0DA0435C45F5B11A25E8AB8EF8686644046B5D | |
| 4102 | 5EE08DCCB9F0C63C2BBD9F86F9EA6A1A75F430393DBD276D89A46632B5F4806F | |
| 4103 | E2AC2AF6FA72EB3B63CD97E10A41D74C861DF50B269E9ACFF80AB7103E6FDA0D | |
| 4104 | 221D90E26BE737901DD5360000F4C66930DCAA8F564DEEB7D9B33DEB663A3F0D | |
| 4105 | B19EEB5F2F137DA03DAA25547C56CAF187C3877C1E272D126D7AF5185C7E4590 | |
| 4106 | 108BD19DB3BA70888E7E24DD0AF9723598E5722716BAAAC7CEC44B42FA3EACD6 | |
| 4107 | 7AC8F81A9EE1551AC9D67A8BC2FC07B40B61CFB0375DF2554B69AF994DC56255 | |
| 4108 | E7288CC7264487DF62510042005EA32B0152DE4B6DDB72C4C5C5FB8D4C6E0B99 | |
| 4109 | 9583A88B94EBE302AC43874B57D903535068B731E18FD1097B43A18097D19373 | |
| 4110 | C7BEDCC310BBF683C7A7ED3DF6248219AD63E6A064FF9300CDDC6689213415E8 | |
| 4111 | 2B65787B1D62B3194A64F2B9F4BC98C6F1D0090647288965E5A3AD841A88ED68 | |
| 4112 | 1A0A7C27E6A17FF9AF31881F9A6EAD18688A473D74D9382688938BC9806DCB42 | |
| 4113 | 2537E5897E6E3AC020325942FA482C9EFB6C1BA346C8B0FC3A5E8B8A5B66C8BC | |
| 4114 | 4589DA12816201A2BD7FADC77B30B992CFCA4FEBD70834E20A00F557C2EEDC1F | |
| 4115 | 3A66D6B459C763B39E2C6E5858E4DAC6CFF97C5775B5590C621755ABE64EFCC8 | |
| 4116 | A3C6B093EEA54ADE8943D533000DA3AA06A0CE15AC5EF05E1892E7AE5A0819FF | |
| 4117 | C01D58C56F99B67588BC1D35181998C99F13D0B931B3A059D42F6501DF04888E | |
| 4118 | 00BDCC4515D4C10986ABF47697808223FD2D5653BCDEEF74179237BE8E90E832 | |
| 4119 | F98302AE9F1926A90BD6A7BF826FEBFF898CFDDDDDDDCDBEB8366B95780DF205 | |
| 4120 | 42766E31290F09775D684B4F3102C6F17B8798DD03A07893720F8DAC799001BB | |
| 4121 | E53E6E249420D739B686CC979EADFE335A71517B505E4088640FB2365FEC3A3A | |
| 4122 | 536EBD10C64F6472F46E6789A9022F61FD39E99A34FEF7F8A77AD8B4277C20E9 | |
| 4123 | 21F6ECF7C0272DF3E8EB1282D80CDA9A7ABBF4553787EDA5D87772DF5F17ABAE | |
| 4124 | BE0F4485121EF3CA4C2E484F56EBDEC8445FB13BEBC70E427428C746E979C8BE | |
| 4125 | BA1409FD47C8A8CCAECBD762A2A9EC4DBED06320782CE1D516ECF8A4B4C0F515 | |
| 4126 | 68257E14FDA7CFFC8B2EEE670C3F0867A9D0F2AE01DF1B2E99FAFB707D0C7752 | |
| 4127 | 96E05956C8D4E1FB350EEEF51D557ECF9406DF03DAC8F475389B447BAC94AB39 | |
| 4128 | 1AF3F3EC487506CFCEC37945FBC56226E98BF406AFDD02A0713F7B089D3E7EBC | |
| 4129 | F11E5ADF5C2953873F8DFAA42AF78360B3D9D03238291736006506D31C121145 | |
| 4130 | DA6CB0AC8C11B02CD04E1A4C01E4C1B5EF7467BD42160DF83515640D6B0D9BA3 | |
| 4131 | E8C9F9D3A1010C2AC7F50BD2329AD2BE095525964B1FD4B317A747C91674990C | |
| 4132 | A0FE282E204A58A3C08AE386CAA8 | |
| 37c41ab1 CR |
4133 | 0000000000000000000000000000000000000000000000000000000000000000 |
| 4134 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4135 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4136 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4137 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4138 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4139 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4140 | 0000000000000000000000000000000000000000000000000000000000000000 | |
| 4141 | cleartomark | |
| 4142 | %%EndFont | |
| 4143 | TeXDict begin 40258431 52099146 1000 600 600 (bashref.dvi) | |
| 28157acd CR |
4144 | @start /Fa 130[62 1[62 123[{ TeX09fbbfacEncoding ReEncodeFont }2 |
| 4145 | 119.552 /CMTT12 rf /Fb 133[34 41 41 55 41 43 30 30 30 | |
| 4146 | 41 43 38 43 64 21 41 23 21 43 38 23 34 43 34 43 38 8[58 | |
| 4147 | 2[58 1[43 57 1[52 60 58 70 48 2[28 58 60 50 1[59 1[54 | |
| 4148 | 58 7[38 38 38 38 38 38 38 38 38 38 3[21 31[43 12[{ | |
| 4149 | TeXf7b6d320Encoding ReEncodeFont }54 74.7198 /CMR9 rf | |
| 4150 | /Fc 209[24 46[{ TeX74afc74cEncoding ReEncodeFont }1 74.7198 | |
| 4151 | /CMTI9 rf /Fd 134[39 39 2[39 39 39 39 2[39 39 39 39 2[39 | |
| 4152 | 39 2[39 3[39 19[39 27[39 39 2[39 45[{ TeX09fbbfacEncoding ReEncodeFont } | |
| 4153 | 18 74.7198 /CMSLTT10 rf /Fe 129[39 39 1[39 39 39 39 39 | |
| 37c41ab1 | 4154 | 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 |
| 28157acd CR |
4155 | 39 39 39 39 39 39 39 39 1[39 39 39 39 39 39 39 39 39 |
| 4156 | 39 1[39 39 39 39 39 39 1[39 39 39 39 39 39 39 39 39 39 | |
| 4157 | 39 39 1[39 39 39 5[39 39 39 39 39 39 39 39 39 1[39 39 | |
| 4158 | 39 39 39 1[39 39 1[39 33[{ TeX09fbbfacEncoding ReEncodeFont }81 | |
| 4159 | 74.7198 /CMTT9 rf /Ff 138[39 27 28 28 1[39 1[39 2[37 | |
| 4160 | 22 4[31 1[31 1[35 5[20 6[51 39 52 1[48 3[44 5[46 48 54 | |
| 4161 | 51 50 53 15[35 3[24 5[20 39[{ TeXf7b6d320Encoding ReEncodeFont }26 | |
| 4162 | 66.4176 /CMR8 rf /Fg 150[30 30 104[{ TeXbbad153fEncoding ReEncodeFont } | |
| 4163 | 2 74.7198 /CMSY9 rf /Fh 135[61 2[61 1[46 2[56 63 5[30 | |
| 4164 | 1[64 2[62 52[55 47[{ TeX0ef0afcaEncoding ReEncodeFont }9 | |
| 4165 | 99.6264 /CMCSC10 rf /Fi 140[56 3[56 56 1[56 2[56 56 56 | |
| 4166 | 57[56 45[{ TeX09fbbfacEncoding ReEncodeFont }8 109.091 | |
| 4167 | /CMTT12 rf /Fj 134[48 48 48 48 48 48 48 48 48 48 48 48 | |
| 4168 | 48 48 48 48 48 48 48 48 48 48 48 48 48 1[48 2[48 3[48 | |
| 4169 | 3[48 1[48 1[48 1[48 48 48 1[48 48 48 1[48 48 48 48 1[48 | |
| 4170 | 6[48 6[48 48 48 48 2[48 2[48 2[48 39[{ | |
| 4171 | TeX09fbbfacEncoding ReEncodeFont }50 90.9091 /CMSLTT10 | |
| 4172 | rf /Fk 134[65 65 89 65 68 48 48 50 65 68 61 68 102 34 | |
| 4173 | 65 1[34 68 61 37 56 68 55 68 60 34 6[93 1[127 1[94 85 | |
| 4174 | 68 92 92 84 92 96 116 74 96 1[46 96 96 77 81 94 89 87 | |
| 4175 | 93 1[58 4[34 61 61 61 61 61 61 61 61 61 2[34 41 34 4[34 | |
| 4176 | 26[68 72 11[{ TeXf7b6d320Encoding ReEncodeFont }64 109.091 | |
| 4177 | /CMBX12 rf /Fl 135[56 2[56 54 42 55 1[51 58 56 68 47 | |
| 4178 | 1[39 27 56 58 49 51 57 54 53 56 46[50 2[50 1[34 45[{ | |
| 4179 | TeX0ef0afcaEncoding ReEncodeFont }23 90.9091 /CMCSC10 | |
| 4180 | rf /Fm 135[42 1[42 1[30 37 38 1[46 46 51 74 23 2[28 1[42 | |
| 4181 | 1[42 46 42 1[46 50[28 33[51 12[{ TeX74afc74cEncoding ReEncodeFont }18 | |
| 4182 | 90.9091 /CMTI10 rf /Fn 209[43 46[{ TeX74afc74cEncoding ReEncodeFont }1 | |
| 4183 | 119.552 /CMBXTI10 rf /Fo 134[85 85 1[85 90 63 64 66 1[90 | |
| 4184 | 81 90 134 45 1[49 45 90 81 49 74 90 72 90 78 9[167 122 | |
| 4185 | 124 112 90 120 1[110 2[153 97 1[83 60 126 1[101 106 124 | |
| 4186 | 117 115 122 7[81 81 81 81 81 81 81 81 81 81 35[90 94 | |
| 4187 | 11[{ TeXf7b6d320Encoding ReEncodeFont }52 143.462 /CMBX12 | |
| 4188 | rf /Fp 200[0 21[91 17[45 1[91 12[71{ TeXbbad153fEncoding ReEncodeFont } | |
| 4189 | 5 90.9091 /CMSY10 rf /Fq 134[48 48 66 48 51 35 36 36 | |
| 4190 | 48 51 45 51 76 25 48 28 25 51 45 28 40 51 40 51 45 8[68 | |
| 4191 | 93 1[68 66 51 67 1[62 71 68 83 57 71 1[33 68 71 59 62 | |
| 4192 | 69 66 64 68 13[45 45 45 3[30 2[45 27[76 1[51 53 11[{ | |
| 4193 | TeXf7b6d320Encoding ReEncodeFont }54 90.9091 /CMSL10 | |
| 5cfe250d CR |
4194 | rf /Fr 134[71 71 97 71 75 52 53 55 1[75 67 75 112 37 |
| 4195 | 71 41 37 75 67 41 61 75 60 75 65 3[37 1[37 1[102 102 | |
| 4196 | 139 102 103 94 75 100 101 92 101 105 128 81 105 69 50 | |
| 4197 | 105 106 85 88 103 97 96 102 105 64 4[37 67 67 67 67 67 | |
| 4198 | 67 67 67 67 67 1[37 45 37 1[67 5[67 112 1[41 20[75 78 | |
| 28157acd CR |
4199 | 11[{ TeXf7b6d320Encoding ReEncodeFont }73 119.552 /CMBX12 |
| 4200 | rf /Fs 129[48 48 48 48 48 48 48 48 48 48 48 48 48 48 | |
| 258e3d46 | 4201 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
| 37c41ab1 | 4202 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
| 28157acd | 4203 | 48 48 1[48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
| 37c41ab1 | 4204 | 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 48 |
| 28157acd CR |
4205 | 48 48 48 48 48 48 48 48 33[{ TeX09fbbfacEncoding ReEncodeFont }93 |
| 4206 | 90.9091 /CMTT10 rf /Ft 131[91 1[40 48 48 66 48 51 35 | |
| 5cfe250d CR |
4207 | 36 36 48 51 45 51 76 25 48 28 25 51 45 28 40 51 40 51 |
| 4208 | 45 25 2[25 45 25 56 68 68 93 68 68 66 51 67 71 62 71 | |
| 4209 | 68 83 57 71 47 33 68 71 59 62 69 66 64 68 1[43 1[71 1[25 | |
| 4210 | 25 45 45 45 45 45 45 45 45 45 45 45 25 30 25 2[35 35 | |
| 28157acd CR |
4211 | 25 1[76 45 1[45 25 18[76 51 51 53 11[{ |
| 4212 | TeXf7b6d320Encoding ReEncodeFont }86 90.9091 /CMR10 | |
| 5cfe250d | 4213 | rf /Fu 138[108 1[76 79 3[108 1[54 3[108 1[59 88 1[86 |
| 28157acd CR |
4214 | 1[94 14[144 4[184 10[138 66[{ TeXf7b6d320Encoding ReEncodeFont }13 |
| 4215 | 172.154 /CMBX12 rf end | |
| 5e13499c CR |
4216 | %%EndProlog |
| 4217 | %%BeginSetup | |
| 4218 | %%Feature: *Resolution 600dpi | |
| 4219 | TeXDict begin | |
| 4220 | %%BeginPaperSize: Letter | |
| 4221 | letter | |
| 4222 | %%EndPaperSize | |
| 37c41ab1 | 4223 | end |
| 5e13499c CR |
4224 | %%EndSetup |
| 4225 | %%Page: 1 1 | |
| 37c41ab1 CR |
4226 | TeXDict begin 1 0 bop 150 1318 a Fu(Bash)64 b(Reference)j(Man)-5 |
| 4227 | b(ual)p 150 1385 3600 34 v 2361 1481 a Ft(Reference)31 | |
| ac18b312 | 4228 | b(Do)s(cumen)m(tation)i(for)d(Bash)2428 1589 y(Edition)h(3.2,)g(for)f |
| 28157acd | 4229 | Fs(Bash)g Ft(V)-8 b(ersion)31 b(3.2.)3218 1697 y(Jan)m(uary)f(2006)150 |
| 5cfe250d CR |
4230 | 4935 y Fr(Chet)45 b(Ramey)-11 b(,)46 b(Case)g(W)-11 b(estern)46 |
| 4231 | b(Reserv)l(e)g(Univ)l(ersit)l(y)150 5068 y(Brian)f(F)-11 | |
| 4232 | b(o)l(x,)45 b(F)-11 b(ree)45 b(Soft)l(w)l(are)h(F)-11 | |
| ac18b312 | 4233 | b(oundation)p 150 5141 3600 17 v eop end |
| 5e13499c | 4234 | %%Page: 2 2 |
| 37c41ab1 CR |
4235 | TeXDict begin 2 1 bop 150 2889 a Ft(This)35 b(text)h(is)g(a)g(brief)f |
| 4236 | (description)h(of)f(the)h(features)g(that)g(are)g(presen)m(t)g(in)f | |
| 28157acd CR |
4237 | (the)h(Bash)f(shell)h(\(v)m(ersion)150 2999 y(3.2,)c(26)f(Jan)m(uary)f |
| 4238 | (2006\).)150 3133 y(This)j(is)g(Edition)g(3.2,)j(last)e(up)s(dated)e | |
| 4239 | (26)i(Jan)m(uary)f(2006,)j(of)d Fq(The)g(GNU)h(Bash)g(Reference)g(Man)m | |
| 5cfe250d CR |
4240 | (ual)p Ft(,)150 3243 y(for)c Fs(Bash)p Ft(,)g(V)-8 b(ersion)31 |
| 4241 | b(3.2.)150 3377 y(Cop)m(yrigh)m(t)602 3374 y(c)577 3377 | |
| 4242 | y Fp(\015)f Ft(1988-2005)k(F)-8 b(ree)32 b(Soft)m(w)m(are)f(F)-8 | |
| 4243 | b(oundation,)32 b(Inc.)150 3512 y(P)m(ermission)g(is)h(gran)m(ted)g(to) | |
| 4244 | f(mak)m(e)i(and)d(distribute)h(v)m(erbatim)h(copies)g(of)f(this)g(man)m | |
| 4245 | (ual)h(pro)m(vided)f(the)150 3621 y(cop)m(yrigh)m(t)g(notice)f(and)f | |
| 4246 | (this)g(p)s(ermission)g(notice)h(are)g(preserv)m(ed)f(on)h(all)g | |
| 4247 | (copies.)390 3756 y(P)m(ermission)k(is)h(gran)m(ted)f(to)h(cop)m(y)-8 | |
| 4248 | b(,)38 b(distribute)d(and/or)g(mo)s(dify)f(this)h(do)s(cumen)m(t)g | |
| 4249 | (under)390 3866 y(the)j(terms)g(of)g(the)g(GNU)h(F)-8 | |
| 4250 | b(ree)39 b(Do)s(cumen)m(tation)h(License,)g(V)-8 b(ersion)39 | |
| 28157acd | 4251 | b(1.1)g(or)f(an)m(y)g(later)390 3975 y(v)m(ersion)28 |
| 37c41ab1 CR |
4252 | b(published)d(b)m(y)j(the)f(F)-8 b(ree)29 b(Soft)m(w)m(are)f(F)-8 |
| 4253 | b(oundation;)30 b(with)d(no)g(In)m(v)-5 b(arian)m(t)28 | |
| 4254 | b(Sections,)390 4085 y(with)i(the)h(F)-8 b(ron)m(t-Co)m(v)m(er)33 | |
| 4255 | b(texts)e(b)s(eing)g(\\A)g(GNU)g(Man)m(ual,")h(and)e(with)g(the)h(Bac)m | |
| 4256 | (k-Co)m(v)m(er)390 4194 y(T)-8 b(exts)33 b(as)g(in)f(\(a\))h(b)s(elo)m | |
| 4257 | (w.)47 b(A)33 b(cop)m(y)g(of)f(the)h(license)g(is)g(included)e(in)h | |
| 4258 | (the)h(section)g(en)m(titled)390 4304 y(\\GNU)e(F)-8 | |
| 4259 | b(ree)32 b(Do)s(cumen)m(tation)g(License.")390 4438 y(\(a\))39 | |
| 4260 | b(The)f(FSF's)g(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext)39 b(is:)56 | |
| 113d85a4 | 4261 | b(\\Y)-8 b(ou)39 b(ha)m(v)m(e)g(freedom)f(to)h(cop)m(y)f(and)g(mo)s |
| 37c41ab1 CR |
4262 | (dify)390 4548 y(this)32 b(GNU)i(Man)m(ual,)g(lik)m(e)g(GNU)f(soft)m(w) |
| 4263 | m(are.)49 b(Copies)32 b(published)f(b)m(y)h(the)h(F)-8 | |
| 4264 | b(ree)34 b(Soft)m(w)m(are)390 4658 y(F)-8 b(oundation)31 | |
| 4265 | b(raise)g(funds)d(for)j(GNU)g(dev)m(elopmen)m(t.")150 | |
| 4266 | 4902 y(Published)e(b)m(y)h(the)h(F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 | |
| 4267 | b(oundation)150 5011 y(59)31 b(T)-8 b(emple)31 b(Place,)h(Suite)e(330,) | |
| 4268 | 150 5121 y(Boston,)i(MA)e(02111-1307)150 5230 y(USA)p | |
| 4269 | eop end | |
| 5e13499c | 4270 | %%Page: -1 3 |
| 37c41ab1 CR |
4271 | TeXDict begin -1 2 bop 3725 -116 a Ft(i)150 299 y Fo(T)-13 |
| 4272 | b(able)53 b(of)h(Con)l(ten)l(ts)150 641 y Fr(1)135 b(In)l(tro)t | |
| 4273 | (duction)15 b Fn(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h | |
| 4274 | (.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.) | |
| 4275 | 60 b Fr(1)449 778 y Ft(1.1)92 b(What)31 b(is)f(Bash?)21 | |
| 5e13499c CR |
4276 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4277 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4278 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 b Ft(1)449 888 y(1.2)92 | |
| 37c41ab1 | 4279 | b(What)31 b(is)f(a)h(shell?)14 b Fm(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c CR |
4280 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4281 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 | |
| 4282 | b Ft(1)150 1130 y Fr(2)135 b(De\014nitions)37 b Fn(.)19 | |
| 4283 | b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h | |
| 4284 | (.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)81 | |
| 4285 | b Fr(3)150 1400 y(3)135 b(Basic)45 b(Shell)g(F)-11 b(eatures)12 | |
| 4286 | b Fn(.)20 b(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f | |
| 4287 | (.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)57 b Fr(5)449 1537 y Ft(3.1)92 | |
| 37c41ab1 | 4288 | b(Shell)30 b(Syn)m(tax)22 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c CR |
4289 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4290 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 | |
| 37c41ab1 CR |
4291 | b Ft(5)748 1646 y(3.1.1)93 b(Shell)30 b(Op)s(eration)10 |
| 4292 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4293 | (.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 | |
| 4294 | b Ft(5)748 1756 y(3.1.2)93 b(Quoting)10 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g | |
| 4295 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.) | |
| 4296 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 | |
| 5e13499c CR |
4297 | b Ft(5)1047 1866 y(3.1.2.1)93 b(Escap)s(e)30 b(Character)24 |
| 4298 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4299 | (.)g(.)g(.)g(.)g(.)g(.)53 b Ft(6)1047 1975 y(3.1.2.2)93 | |
| 37c41ab1 | 4300 | b(Single)31 b(Quotes)15 b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.) |
| 5e13499c | 4301 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 |
| 37c41ab1 | 4302 | b Ft(6)1047 2085 y(3.1.2.3)93 b(Double)31 b(Quotes)15 |
| 5e13499c CR |
4303 | b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4304 | g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)44 b Ft(6)1047 2194 y(3.1.2.4)93 | |
| 37c41ab1 | 4305 | b(ANSI-C)30 b(Quoting)18 b Fm(.)d(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4306 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 |
| 37c41ab1 CR |
4307 | b Ft(6)1047 2304 y(3.1.2.5)93 b(Lo)s(cale-Sp)s(eci\014c)32 |
| 4308 | b(T)-8 b(ranslation)11 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4309 | (.)g(.)g(.)g(.)41 b Ft(7)748 2413 y(3.1.3)93 b(Commen)m(ts)25 | |
| 5e13499c CR |
4310 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4311 | (.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 37c41ab1 | 4312 | g(.)g(.)g(.)55 b Ft(7)449 2523 y(3.2)92 b(Shell)30 b(Commands)23 |
| 5e13499c CR |
4313 | b Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g |
| 4314 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4315 | g(.)g(.)g(.)g(.)g(.)g(.)53 b Ft(7)748 2633 y(3.2.1)93 | |
| 37c41ab1 | 4316 | b(Simple)30 b(Commands)15 b Fm(.)f(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c CR |
4317 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4318 | g(.)g(.)45 b Ft(8)748 2742 y(3.2.2)93 b(Pip)s(elines)14 | |
| 37c41ab1 | 4319 | b Fm(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 5e13499c | 4320 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g |
| 37c41ab1 CR |
4321 | (.)g(.)g(.)g(.)g(.)44 b Ft(8)748 2852 y(3.2.3)93 b(Lists)30 |
| 4322 | b(of)h(Commands)23 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 5e13499c CR |
4323 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4324 | 54 b Ft(8)748 2961 y(3.2.4)93 b(Comp)s(ound)28 b(Commands)17 | |
| 4325 | b Fm(.)d(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4326 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 b Ft(9)1047 3071 | |
| 37c41ab1 | 4327 | y(3.2.4.1)93 b(Lo)s(oping)30 b(Constructs)c Fm(.)15 b(.)g(.)g(.)g(.)g |
| 5e13499c | 4328 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 |
| 37c41ab1 | 4329 | b Ft(9)1047 3181 y(3.2.4.2)93 b(Conditional)31 b(Constructs)18 |
| 5e13499c | 4330 | b Fm(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 |
| 37c41ab1 | 4331 | b Ft(10)1047 3290 y(3.2.4.3)93 b(Grouping)30 b(Commands)13 |
| 5e13499c | 4332 | b Fm(.)h(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 37c41ab1 CR |
4333 | g(.)42 b Ft(13)449 3400 y(3.3)92 b(Shell)30 b(F)-8 b(unctions)8 |
| 4334 | b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g | |
| 5e13499c CR |
4335 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4336 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 b Ft(13)449 3509 y(3.4)92 | |
| 37c41ab1 | 4337 | b(Shell)30 b(P)m(arameters)20 b Fm(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c CR |
4338 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4339 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 b | |
| 9d2b70f0 | 4340 | Ft(15)748 3619 y(3.4.1)93 b(P)m(ositional)32 b(P)m(arameters)14 |
| 5e13499c CR |
4341 | b Fm(.)i(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.) |
| 4342 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)43 b Ft(15)748 3729 | |
| 37c41ab1 | 4343 | y(3.4.2)93 b(Sp)s(ecial)30 b(P)m(arameters)f Fm(.)15 |
| 5e13499c | 4344 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 9d2b70f0 | 4345 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)57 b Ft(16)449 |
| 37c41ab1 | 4346 | 3838 y(3.5)92 b(Shell)30 b(Expansions)20 b Fm(.)14 b(.)h(.)g(.)g(.)g(.) |
| 5e13499c CR |
4347 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g |
| 4348 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 | |
| 9d2b70f0 | 4349 | b Ft(17)748 3948 y(3.5.1)93 b(Brace)31 b(Expansion)e |
| 5e13499c CR |
4350 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4351 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)58 | |
| 37c41ab1 CR |
4352 | b Ft(17)748 4057 y(3.5.2)93 b(Tilde)30 b(Expansion)17 |
| 4353 | b Fm(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 5e13499c | 4354 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 |
| eb2bb562 | 4355 | b Ft(18)748 4167 y(3.5.3)93 b(Shell)30 b(P)m(arameter)h(Expansion)18 |
| 37c41ab1 | 4356 | b Fm(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 9d2b70f0 | 4357 | h(.)f(.)g(.)g(.)47 b Ft(19)748 4276 y(3.5.4)93 b(Command)29 |
| 37c41ab1 | 4358 | b(Substitution)f Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4359 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(21)748 |
| 37c41ab1 | 4360 | 4386 y(3.5.5)93 b(Arithmetic)31 b(Expansion)12 b Fm(.)j(.)g(.)g(.)g(.)g |
| 5e13499c | 4361 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 9d2b70f0 | 4362 | g(.)g(.)g(.)42 b Ft(22)748 4496 y(3.5.6)93 b(Pro)s(cess)30 |
| 37c41ab1 CR |
4363 | b(Substitution)19 b Fm(.)c(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4364 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 | |
| eb2bb562 | 4365 | b Ft(22)748 4605 y(3.5.7)93 b(W)-8 b(ord)30 b(Splitting)c |
| 37c41ab1 | 4366 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4367 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 |
| 37c41ab1 | 4368 | b Ft(22)748 4715 y(3.5.8)93 b(Filename)31 b(Expansion)25 |
| 5e13499c | 4369 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 9d2b70f0 | 4370 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Ft(23)1047 |
| 5e13499c | 4371 | 4824 y(3.5.8.1)93 b(P)m(attern)31 b(Matc)m(hing)20 b |
| 37c41ab1 | 4372 | Fm(.)d(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4373 | (.)g(.)g(.)g(.)49 b Ft(23)748 4934 y(3.5.9)93 b(Quote)30 |
| 37c41ab1 | 4374 | b(Remo)m(v)-5 b(al)15 b Fm(.)i(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4375 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4376 | g(.)g(.)g(.)44 b Ft(24)449 5044 y(3.6)92 b(Redirections)24 |
| 5e13499c CR |
4377 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g |
| 4378 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| ac18b312 | 4379 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Ft(25)748 5153 |
| 37c41ab1 | 4380 | y(3.6.1)93 b(Redirecting)31 b(Input)11 b Fm(.)j(.)h(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4381 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| ac18b312 | 4382 | g(.)h(.)f(.)g(.)g(.)40 b Ft(26)748 5263 y(3.6.2)93 b(Redirecting)31 |
| 5e13499c CR |
4383 | b(Output)18 b Fm(.)13 b(.)i(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4384 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 | |
| eb2bb562 | 4385 | b Ft(26)p eop end |
| 5e13499c | 4386 | %%Page: -2 4 |
| 37c41ab1 CR |
4387 | TeXDict begin -2 3 bop 150 -116 a Ft(ii)2612 b(Bash)31 |
| 4388 | b(Reference)g(Man)m(ual)748 83 y(3.6.3)93 b(App)s(ending)28 | |
| 4389 | b(Redirected)j(Output)16 b Fm(.)e(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4390 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b Ft(26)748 193 y(3.6.4)93 | |
| 4391 | b(Redirecting)31 b(Standard)e(Output)g(and)h(Standard)f(Error)954 | |
| 4392 | 302 y Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 5e13499c | 4393 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 37c41ab1 CR |
4394 | g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 |
| 4395 | b Ft(26)748 412 y(3.6.5)93 b(Here)30 b(Do)s(cumen)m(ts)13 | |
| 4396 | b Fm(.)k(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4397 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)43 | |
| ac18b312 | 4398 | b Ft(27)748 521 y(3.6.6)93 b(Here)30 b(Strings)10 b Fm(.)15 |
| 37c41ab1 CR |
4399 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4400 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)39 | |
| eb2bb562 | 4401 | b Ft(27)748 631 y(3.6.7)93 b(Duplicating)31 b(File)h(Descriptors)17 |
| 37c41ab1 CR |
4402 | b Fm(.)f(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4403 | g(.)g(.)g(.)47 b Ft(27)748 741 y(3.6.8)93 b(Mo)m(ving)31 | |
| 4404 | b(File)h(Descriptors)15 b Fm(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 5e13499c | 4405 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)44 |
| ac18b312 | 4406 | b Ft(28)748 850 y(3.6.9)93 b(Op)s(ening)29 b(File)i(Descriptors)g(for)f |
| 37c41ab1 | 4407 | (Reading)h(and)f(W)-8 b(riting)954 960 y Fm(.)16 b(.)f(.)g(.)g(.)g(.)g |
| 5e13499c CR |
4408 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4409 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
| eb2bb562 | 4410 | (.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Ft(28)449 1069 y(3.7)92 |
| 37c41ab1 | 4411 | b(Executing)31 b(Commands)25 b Fm(.)15 b(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.) |
| 5e13499c | 4412 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| eb2bb562 | 4413 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 b Ft(28)748 1179 y(3.7.1)93 |
| 37c41ab1 | 4414 | b(Simple)30 b(Command)f(Expansion)c Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g |
| eb2bb562 | 4415 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Ft(28)748 |
| 37c41ab1 CR |
4416 | 1289 y(3.7.2)93 b(Command)29 b(Searc)m(h)i(and)e(Execution)13 |
| 4417 | b Fm(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)42 | |
| 9d2b70f0 | 4418 | b Ft(29)748 1398 y(3.7.3)93 b(Command)29 b(Execution)i(En)m(vironmen)m |
| 37c41ab1 | 4419 | (t)18 b Fm(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 |
| 5e13499c | 4420 | b Ft(29)748 1508 y(3.7.4)93 b(En)m(vironmen)m(t)21 b |
| 37c41ab1 | 4421 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4422 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 37c41ab1 | 4423 | 50 b Ft(30)748 1617 y(3.7.5)93 b(Exit)30 b(Status)8 b |
| 5e13499c CR |
4424 | Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4425 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
| eb2bb562 | 4426 | f(.)g(.)37 b Ft(31)748 1727 y(3.7.6)93 b(Signals)10 b |
| 37c41ab1 CR |
4427 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4428 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
| 4429 | g(.)g(.)g(.)g(.)g(.)g(.)39 b Ft(31)449 1836 y(3.8)92 | |
| 4430 | b(Shell)30 b(Scripts)21 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4431 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4432 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 | |
| eb2bb562 | 4433 | b Ft(32)150 2079 y Fr(4)135 b(Shell)45 b(Builtin)g(Commands)38 |
| 5e13499c | 4434 | b Fn(.)19 b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h |
| ac18b312 | 4435 | (.)f(.)82 b Fr(35)449 2216 y Ft(4.1)92 b(Bourne)30 b(Shell)g(Builtins) |
| 37c41ab1 | 4436 | 16 b Fm(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4437 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| ac18b312 | 4438 | g(.)45 b Ft(35)449 2325 y(4.2)92 b(Bash)30 b(Builtin)h(Commands)17 |
| 5e13499c CR |
4439 | b Fm(.)d(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) |
| 4440 | f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)46 | |
| 28157acd CR |
4441 | b Ft(41)449 2435 y(4.3)92 b(The)30 b(Set)g(Builtin)25 |
| 4442 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4443 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4444 | g(.)g(.)g(.)g(.)g(.)g(.)53 b Ft(53)449 2545 y(4.4)92 | |
| 4445 | b(Sp)s(ecial)31 b(Builtins)22 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h | |
| 9d6e5e30 | 4446 | (.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd CR |
4447 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 |
| 4448 | b Ft(56)150 2787 y Fr(5)135 b(Shell)45 b(V)-11 b(ariables)10 | |
| 4449 | b Fn(.)21 b(.)e(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f | |
| 4450 | (.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)55 b Fr(57)449 | |
| 4451 | 2924 y Ft(5.1)92 b(Bourne)30 b(Shell)g(V)-8 b(ariables)11 | |
| 4452 | b Fm(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4453 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4454 | 40 b Ft(57)449 3034 y(5.2)92 b(Bash)30 b(V)-8 b(ariables)17 | |
| 4455 | b Fm(.)g(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4456 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4457 | (.)g(.)g(.)g(.)g(.)g(.)g(.)46 b Ft(57)150 3276 y Fr(6)135 | |
| 4458 | b(Bash)44 b(F)-11 b(eatures)31 b Fn(.)20 b(.)f(.)g(.)h(.)f(.)h(.)f(.)h | |
| 4459 | (.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.) | |
| 4460 | g(.)h(.)75 b Fr(67)449 3413 y Ft(6.1)92 b(In)m(v)m(oking)31 | |
| 4461 | b(Bash)e Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4462 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4463 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(67)449 3523 | |
| 4464 | y(6.2)92 b(Bash)30 b(Startup)g(Files)c Fm(.)15 b(.)g(.)h(.)f(.)g(.)g(.) | |
| 4465 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4466 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 | |
| 4467 | b Ft(69)449 3632 y(6.3)92 b(In)m(teractiv)m(e)33 b(Shells)14 | |
| 4468 | b Fm(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4469 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g | |
| 4470 | (.)g(.)g(.)g(.)g(.)43 b Ft(71)748 3742 y(6.3.1)93 b(What)31 | |
| 4471 | b(is)f(an)g(In)m(teractiv)m(e)j(Shell?)20 b Fm(.)15 b(.)g(.)g(.)g(.)g | |
| 4472 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 | |
| 4473 | b Ft(71)748 3851 y(6.3.2)93 b(Is)30 b(this)g(Shell)g(In)m(teractiv)m | |
| 4474 | (e?)10 b Fm(.)18 b(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4475 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Ft(71)748 | |
| 4476 | 3961 y(6.3.3)93 b(In)m(teractiv)m(e)32 b(Shell)f(Beha)m(vior)22 | |
| 4477 | b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4478 | (.)g(.)g(.)g(.)g(.)g(.)51 b Ft(71)449 4071 y(6.4)92 b(Bash)30 | |
| 37c41ab1 | 4479 | b(Conditional)h(Expressions)20 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4480 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) |
| 28157acd | 4481 | f(.)49 b Ft(72)449 4180 y(6.5)92 b(Shell)30 b(Arithmetic)f |
| 5e13499c CR |
4482 | Fm(.)15 b(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4483 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4484 | g(.)g(.)h(.)f(.)g(.)57 b Ft(74)449 4290 y(6.6)92 b(Aliases)25 |
| 5e13499c CR |
4485 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4486 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4487 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 | |
| 28157acd | 4488 | b Ft(75)449 4399 y(6.7)92 b(Arra)m(ys)29 b Fm(.)15 b(.)g(.)g(.)g(.)g(.) |
| 5e13499c CR |
4489 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4490 | (.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4491 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(76)449 4509 y(6.8)92 |
| 37c41ab1 | 4492 | b(The)30 b(Directory)i(Stac)m(k)15 b Fm(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4493 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) |
| 28157acd CR |
4494 | f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 b Ft(77)748 |
| 4495 | 4619 y(6.8.1)93 b(Directory)31 b(Stac)m(k)h(Builtins)10 | |
| 37c41ab1 | 4496 | b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4497 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Ft(77)449 4728 y(6.9)92 |
| 37c41ab1 | 4498 | b(Con)m(trolling)31 b(the)g(Prompt)15 b Fm(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4499 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4500 | g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)44 b Ft(78)449 4838 y(6.10)92 |
| 37c41ab1 | 4501 | b(The)30 b(Restricted)i(Shell)11 b Fm(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4502 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4503 | g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)40 b Ft(80)449 4947 |
| 5e13499c CR |
4504 | y(6.11)92 b(Bash)31 b(POSIX)e(Mo)s(de)16 b Fm(.)f(.)g(.)g(.)g(.)g(.)g |
| 4505 | (.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 4506 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b | |
| 28157acd | 4507 | Ft(80)p eop end |
| 5e13499c | 4508 | %%Page: -3 5 |
| 37c41ab1 CR |
4509 | TeXDict begin -3 4 bop 3674 -116 a Ft(iii)150 83 y Fr(7)135 |
| 4510 | b(Job)45 b(Con)l(trol)32 b Fn(.)20 b(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.) | |
| 4511 | h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f | |
| 28157acd | 4512 | (.)h(.)f(.)76 b Fr(85)449 220 y Ft(7.1)92 b(Job)30 b(Con)m(trol)h |
| 37c41ab1 CR |
4513 | (Basics)23 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4514 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4515 | g(.)g(.)g(.)g(.)g(.)g(.)52 b Ft(85)449 330 y(7.2)92 b(Job)30 |
| 37c41ab1 CR |
4516 | b(Con)m(trol)h(Builtins)12 b Fm(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4517 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4518 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)41 b Ft(86)449 439 y(7.3)92 |
| 37c41ab1 CR |
4519 | b(Job)30 b(Con)m(trol)h(V)-8 b(ariables)30 b Fm(.)15 |
| 4520 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g | |
| 4521 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 | |
| 28157acd | 4522 | b Ft(87)150 682 y Fr(8)135 b(Command)45 b(Line)g(Editing)38 |
| 37c41ab1 | 4523 | b Fn(.)19 b(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h |
| 28157acd | 4524 | (.)f(.)h(.)81 b Fr(89)449 819 y Ft(8.1)92 b(In)m(tro)s(duction)30 |
| 37c41ab1 | 4525 | b(to)h(Line)f(Editing)24 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) |
| 5e13499c | 4526 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4527 | (.)53 b Ft(89)449 928 y(8.2)92 b(Readline)31 b(In)m(teraction)15 |
| 37c41ab1 | 4528 | b Fm(.)i(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 5e13499c | 4529 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g |
| 28157acd | 4530 | (.)g(.)44 b Ft(89)748 1038 y(8.2.1)93 b(Readline)31 b(Bare)g(Essen)m |
| 37c41ab1 | 4531 | (tials)25 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4532 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Ft(89)748 |
| 37c41ab1 | 4533 | 1147 y(8.2.2)93 b(Readline)31 b(Mo)m(v)m(emen)m(t)h(Commands)13 |
| 5e13499c | 4534 | b Fm(.)h(.)h(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4535 | 42 b Ft(90)748 1257 y(8.2.3)93 b(Readline)31 b(Killing)g(Commands)20 |
| 5e13499c | 4536 | b Fm(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4537 | (.)g(.)g(.)g(.)50 b Ft(90)748 1367 y(8.2.4)93 b(Readline)31 |
| 5e13499c CR |
4538 | b(Argumen)m(ts)23 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g |
| 4539 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 | |
| 28157acd | 4540 | b Ft(91)748 1476 y(8.2.5)93 b(Searc)m(hing)30 b(for)h(Commands)e(in)h |
| 37c41ab1 | 4541 | (the)g(History)c Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 |
| 28157acd | 4542 | b Ft(91)449 1586 y(8.3)92 b(Readline)31 b(Init)f(File)f |
| 5e13499c CR |
4543 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4544 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
| 28157acd | 4545 | g(.)g(.)g(.)g(.)56 b Ft(92)748 1695 y(8.3.1)93 b(Readline)31 |
| 37c41ab1 | 4546 | b(Init)f(File)h(Syn)m(tax)12 b Fm(.)k(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4547 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)41 |
| 28157acd | 4548 | b Ft(92)748 1805 y(8.3.2)93 b(Conditional)30 b(Init)h(Constructs)e |
| 5e13499c | 4549 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd CR |
4550 | (.)g(.)g(.)g(.)59 b Ft(97)748 1914 y(8.3.3)93 b(Sample)30 |
| 4551 | b(Init)g(File)21 b Fm(.)c(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 37c41ab1 | 4552 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4553 | g(.)51 b Ft(98)449 2024 y(8.4)92 b(Bindable)31 b(Readline)g(Commands)11 |
| ac18b312 | 4554 | b Fm(.)j(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4555 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)41 b Ft(101)748 2134 |
| ac18b312 | 4556 | y(8.4.1)93 b(Commands)29 b(F)-8 b(or)31 b(Mo)m(ving)c |
| 37c41ab1 | 4557 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4558 | (.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Ft(101)748 2243 y(8.4.2)93 |
| ac18b312 | 4559 | b(Commands)29 b(F)-8 b(or)31 b(Manipulating)g(The)f(History)17 |
| 28157acd | 4560 | b Fm(.)e(.)g(.)g(.)h(.)f(.)46 b Ft(101)748 2353 y(8.4.3)93 |
| 9d2b70f0 CR |
4561 | b(Commands)29 b(F)-8 b(or)31 b(Changing)f(T)-8 b(ext)29 |
| 4562 | b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4563 | 58 b Ft(103)748 2462 y(8.4.4)93 b(Killing)31 b(And)e(Y)-8 |
| 37c41ab1 CR |
4564 | b(anking)16 b Fm(.)g(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4565 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)46 b | |
| 28157acd | 4566 | Ft(104)748 2572 y(8.4.5)93 b(Sp)s(ecifying)29 b(Numeric)i(Argumen)m(ts) |
| 37c41ab1 | 4567 | 23 b Fm(.)15 b(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4568 | (.)53 b Ft(105)748 2682 y(8.4.6)93 b(Letting)31 b(Readline)g(T)m(yp)s |
| 37c41ab1 | 4569 | (e)f(F)-8 b(or)31 b(Y)-8 b(ou)18 b Fm(.)e(.)f(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4570 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Ft(105)748 2791 y(8.4.7)93 |
| 37c41ab1 CR |
4571 | b(Keyb)s(oard)29 b(Macros)10 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)h(.) |
| 4572 | f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 28157acd | 4573 | (.)g(.)g(.)40 b Ft(106)748 2901 y(8.4.8)93 b(Some)30 |
| 37c41ab1 | 4574 | b(Miscellaneous)i(Commands)12 b Fm(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4575 | (.)g(.)g(.)g(.)g(.)g(.)g(.)42 b Ft(107)449 3010 y(8.5)92 |
| 37c41ab1 | 4576 | b(Readline)31 b(vi)f(Mo)s(de)c Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 8a9c66f6 | 4577 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4578 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Ft(109)449 |
| 37c41ab1 | 4579 | 3120 y(8.6)92 b(Programmable)31 b(Completion)12 b Fm(.)j(.)g(.)g(.)g(.) |
| 8a9c66f6 | 4580 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g |
| 28157acd | 4581 | (.)g(.)g(.)g(.)g(.)g(.)g(.)41 b Ft(109)449 3230 y(8.7)92 |
| 37c41ab1 | 4582 | b(Programmable)31 b(Completion)g(Builtins)12 b Fm(.)j(.)g(.)g(.)h(.)f |
| 8a9c66f6 | 4583 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)42 |
| 28157acd | 4584 | b Ft(111)150 3472 y Fr(9)135 b(Using)45 b(History)h(In)l(teractiv)l |
| 8a9c66f6 | 4585 | (ely)14 b Fn(.)22 b(.)d(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 4586 | (.)58 b Fr(115)449 3609 y Ft(9.1)92 b(Bash)30 b(History)h(F)-8 |
| 37c41ab1 CR |
4587 | b(acilities)11 b Fm(.)19 b(.)c(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4588 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4589 | g(.)g(.)g(.)41 b Ft(115)449 3719 y(9.2)92 b(Bash)30 b(History)h |
| 37c41ab1 CR |
4590 | (Builtins)9 b Fm(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4591 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4592 | g(.)h(.)f(.)38 b Ft(115)449 3828 y(9.3)92 b(History)31 |
| 37c41ab1 CR |
4593 | b(Expansion)d Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4594 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4595 | g(.)g(.)g(.)g(.)g(.)58 b Ft(117)748 3938 y(9.3.1)93 b(Ev)m(en)m(t)31 |
| 37c41ab1 CR |
4596 | b(Designators)21 b Fm(.)c(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4597 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 | |
| 28157acd | 4598 | b Ft(117)748 4047 y(9.3.2)93 b(W)-8 b(ord)30 b(Designators)g |
| 5e13499c | 4599 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4600 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Ft(118)748 |
| 37c41ab1 | 4601 | 4157 y(9.3.3)93 b(Mo)s(di\014ers)27 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g |
| 5e13499c | 4602 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 28157acd | 4603 | g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)57 b Ft(119)150 |
| 5e13499c CR |
4604 | 4399 y Fr(10)135 b(Installing)46 b(Bash)30 b Fn(.)20 |
| 4605 | b(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f | |
| 28157acd | 4606 | (.)h(.)f(.)g(.)h(.)f(.)h(.)74 b Fr(121)449 4536 y Ft(10.1)92 |
| 37c41ab1 CR |
4607 | b(Basic)32 b(Installation)d Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4608 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4609 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)57 b Ft(121)449 4646 |
| 37c41ab1 CR |
4610 | y(10.2)92 b(Compilers)30 b(and)g(Options)22 b Fm(.)15 |
| 4611 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 5e13499c | 4612 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)51 |
| 28157acd | 4613 | b Ft(121)449 4755 y(10.3)92 b(Compiling)31 b(F)-8 b(or)31 |
| 37c41ab1 | 4614 | b(Multiple)g(Arc)m(hitectures)12 b Fm(.)k(.)f(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4615 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)41 b Ft(122)449 |
| 37c41ab1 | 4616 | 4865 y(10.4)92 b(Installation)32 b(Names)22 b Fm(.)16 |
| 5e13499c CR |
4617 | b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4618 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)51 | |
| 28157acd | 4619 | b Ft(122)449 4975 y(10.5)92 b(Sp)s(ecifying)30 b(the)h(System)f(T)m(yp) |
| 5e13499c | 4620 | s(e)11 b Fm(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4621 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)41 b Ft(122)449 |
| 37c41ab1 | 4622 | 5084 y(10.6)92 b(Sharing)30 b(Defaults)21 b Fm(.)16 b(.)f(.)g(.)g(.)g |
| 5e13499c CR |
4623 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 4624 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 | |
| 28157acd | 4625 | b Ft(123)449 5194 y(10.7)92 b(Op)s(eration)30 b(Con)m(trols)12 |
| 37c41ab1 | 4626 | b Fm(.)k(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
| 5e13499c | 4627 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g |
| 28157acd | 4628 | (.)41 b Ft(123)449 5303 y(10.8)92 b(Optional)31 b(F)-8 |
| 5e13499c CR |
4629 | b(eatures)17 b Fm(.)g(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
| 4630 | (.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd | 4631 | g(.)g(.)g(.)g(.)g(.)47 b Ft(123)p eop end |
| 5e13499c | 4632 | %%Page: -4 6 |
| 37c41ab1 CR |
4633 | TeXDict begin -4 5 bop 150 -116 a Ft(iv)2589 b(Bash)31 |
| 4634 | b(Reference)g(Man)m(ual)150 83 y Fr(App)t(endix)44 b(A)99 | |
| 4635 | b(Rep)t(orting)46 b(Bugs)12 b Fn(.)20 b(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f | |
| 28157acd | 4636 | (.)h(.)f(.)g(.)h(.)f(.)h(.)56 b Fr(129)150 353 y(App)t(endix)44 |
| 37c41ab1 CR |
4637 | b(B)105 b(Ma)7 b(jor)46 b(Di\013erences)g(F)-11 b(rom)45 |
| 4638 | b(The)f(Bourne)419 486 y(Shell)17 b Fn(.)j(.)f(.)h(.)f(.)h(.)f(.)g(.)h | |
| 4639 | (.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.) | |
| 28157acd | 4640 | h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)61 b Fr(131)449 623 |
| 37c41ab1 CR |
4641 | y Ft(B.1)92 b(Implemen)m(tation)31 b(Di\013erences)h(F)-8 |
| 4642 | b(rom)31 b(The)f(SVR4.2)h(Shell)21 b Fm(.)15 b(.)g(.)g(.)g(.)50 | |
| 28157acd | 4643 | b Ft(135)150 865 y Fr(App)t(endix)44 b(C)104 b(Cop)l(ying)46 |
| 37c41ab1 | 4644 | b(This)e(Man)l(ual)27 b Fn(.)20 b(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)71 |
| 28157acd | 4645 | b Fr(137)449 1002 y Ft(C.1)91 b(GNU)31 b(F)-8 b(ree)32 |
| 37c41ab1 CR |
4646 | b(Do)s(cumen)m(tation)g(License)27 b Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g |
| 4647 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)56 | |
| 28157acd | 4648 | b Ft(137)748 1112 y(C.1.1)92 b(ADDENDUM:)32 b(Ho)m(w)f(to)h(use)e(this) |
| 37c41ab1 CR |
4649 | g(License)h(for)f(y)m(our)930 1221 y(do)s(cumen)m(ts)c |
| 4650 | Fm(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
| 4651 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
| 28157acd CR |
4652 | g(.)g(.)g(.)56 b Ft(143)150 1464 y Fr(Index)45 b(of)g(Shell)g(Builtin)h |
| 4653 | (Commands)27 b Fn(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)71 | |
| 4654 | b Fr(145)150 1733 y(Index)45 b(of)g(Shell)g(Reserv)l(ed)h(W)-11 | |
| 4655 | b(ords)41 b Fn(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h | |
| 4656 | (.)85 b Fr(147)150 2003 y(P)l(arameter)47 b(and)d(V)-11 | |
| 4657 | b(ariable)46 b(Index)27 b Fn(.)19 b(.)g(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h | |
| 4658 | (.)f(.)h(.)f(.)g(.)71 b Fr(149)150 2273 y(F)-11 b(unction)44 | |
| 4659 | b(Index)36 b Fn(.)19 b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h | |
| 4660 | (.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)80 | |
| 4661 | b Fr(151)150 2543 y(Concept)45 b(Index)18 b Fn(.)i(.)f(.)h(.)f(.)g(.)h | |
| 4662 | (.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.) | |
| 4663 | h(.)f(.)g(.)h(.)f(.)h(.)62 b Fr(153)p eop end | |
| 5e13499c | 4664 | %%Page: 1 7 |
| 37c41ab1 CR |
4665 | TeXDict begin 1 6 bop 150 -116 a Ft(Chapter)30 b(1:)41 |
| 4666 | b(In)m(tro)s(duction)2592 b(1)150 299 y Fo(1)80 b(In)l(tro)t(duction) | |
| 4667 | 150 675 y Fr(1.1)68 b(What)45 b(is)g(Bash?)275 923 y | |
| 4668 | Ft(Bash)29 b(is)h(the)f(shell,)i(or)e(command)g(language)i(in)m | |
| 4669 | (terpreter,)g(for)e(the)h Fl(gnu)f Ft(op)s(erating)h(system.)40 | |
| 4670 | b(The)150 1033 y(name)33 b(is)g(an)g(acron)m(ym)g(for)g(the)g(`)p | |
| 5e13499c | 4671 | Fs(Bourne-Again)27 b(SHell)p Ft(',)32 b(a)i(pun)d(on)i(Stephen)f |
| 37c41ab1 CR |
4672 | (Bourne,)h(the)g(author)150 1142 y(of)f(the)f(direct)h(ancestor)h(of)e |
| 4673 | (the)h(curren)m(t)f(Unix)g(shell)h Fs(sh)p Ft(,)f(whic)m(h)g(app)s | |
| 4674 | (eared)g(in)g(the)h(Sev)m(en)m(th)g(Edition)150 1252 | |
| 4675 | y(Bell)g(Labs)e(Researc)m(h)h(v)m(ersion)g(of)f(Unix.)275 | |
| 4676 | 1391 y(Bash)f(is)g(largely)i(compatible)f(with)f Fs(sh)g | |
| 4677 | Ft(and)g(incorp)s(orates)g(useful)g(features)g(from)g(the)g(Korn)g | |
| 4678 | (shell)150 1500 y Fs(ksh)37 b Ft(and)h(the)g(C)g(shell)g | |
| 4679 | Fs(csh)p Ft(.)64 b(It)38 b(is)g(in)m(tended)g(to)h(b)s(e)f(a)g | |
| 4680 | (conforman)m(t)h(implemen)m(tation)h(of)e(the)g Fl(ieee)150 | |
| ac18b312 CR |
4681 | 1610 y(posix)c Ft(Shell)g(and)g(T)-8 b(o)s(ols)35 b(p)s(ortion)f(of)g |
| 4682 | (the)h Fl(ieee)f(posix)f Ft(sp)s(eci\014cation)j(\()p | |
| 4683 | Fl(ieee)e Ft(Standard)f(1003.1\).)56 b(It)150 1719 y(o\013ers)31 | |
| 4684 | b(functional)f(impro)m(v)m(emen)m(ts)i(o)m(v)m(er)g Fs(sh)d | |
| 4685 | Ft(for)i(b)s(oth)e(in)m(teractiv)m(e)k(and)d(programming)g(use.)275 | |
| 37c41ab1 CR |
4686 | 1858 y(While)h(the)g Fl(gnu)f Ft(op)s(erating)h(system)g(pro)m(vides)f |
| 4687 | (other)h(shells,)g(including)f(a)h(v)m(ersion)g(of)g | |
| 4688 | Fs(csh)p Ft(,)f(Bash)150 1968 y(is)j(the)h(default)f(shell.)49 | |
| 4689 | b(Lik)m(e)34 b(other)g Fl(gnu)f Ft(soft)m(w)m(are,)i(Bash)f(is)f(quite) | |
| 4690 | h(p)s(ortable.)49 b(It)33 b(curren)m(tly)g(runs)f(on)150 | |
| 4691 | 2077 y(nearly)c(ev)m(ery)g(v)m(ersion)g(of)f(Unix)h(and)e(a)i(few)f | |
| 4692 | (other)h(op)s(erating)g(systems)f Fp(\000)g Ft(indep)s(enden)m | |
| 4693 | (tly-supp)s(orted)150 2187 y(p)s(orts)j(exist)h(for)f | |
| 4694 | Fl(ms-dos)p Ft(,)f Fl(os/2)p Ft(,)i(and)f(Windo)m(ws)g(platforms.)150 | |
| 5e13499c | 4695 | 2455 y Fr(1.2)68 b(What)45 b(is)g(a)h(shell?)275 2703 |
| 37c41ab1 | 4696 | y Ft(A)m(t)41 b(its)f(base,)j(a)e(shell)f(is)g(simply)g(a)h(macro)f |
| 5e13499c | 4697 | (pro)s(cessor)g(that)h(executes)g(commands.)70 b(The)40 |
| 37c41ab1 CR |
4698 | b(term)150 2813 y(macro)29 b(pro)s(cessor)f(means)g(functionalit)m(y)i |
| 4699 | (where)e(text)i(and)e(sym)m(b)s(ols)g(are)g(expanded)g(to)h(create)h | |
| 4700 | (larger)150 2922 y(expressions.)275 3061 y(A)k(Unix)h(shell)g(is)f(b)s | |
| 4701 | (oth)g(a)h(command)g(in)m(terpreter)g(and)f(a)h(programming)f | |
| 4702 | (language.)55 b(As)35 b(a)g(com-)150 3170 y(mand)30 b(in)m(terpreter,)i | |
| 4703 | (the)g(shell)f(pro)m(vides)g(the)h(user)e(in)m(terface)j(to)f(the)f | |
| 4704 | (ric)m(h)h(set)g(of)f Fl(gnu)g Ft(utilities.)44 b(The)150 | |
| 28157acd CR |
4705 | 3280 y(programming)26 b(language)i(features)f(allo)m(w)h(these)f |
| 4706 | (utilitites)h(to)f(b)s(e)f(com)m(bined.)40 b(Files)27 | |
| 4707 | b(con)m(taining)h(com-)150 3390 y(mands)h(can)i(b)s(e)e(created,)j(and) | |
| 37c41ab1 | 4708 | d(b)s(ecome)i(commands)f(themselv)m(es.)42 b(These)30 |
| 5e13499c | 4709 | b(new)f(commands)h(ha)m(v)m(e)i(the)150 3499 y(same)f(status)h(as)f |
| 37c41ab1 CR |
4710 | (system)g(commands)g(in)g(directories)h(suc)m(h)f(as)g(`)p |
| 4711 | Fs(/bin)p Ft(',)g(allo)m(wing)i(users)d(or)h(groups)f(to)150 | |
| 4712 | 3609 y(establish)h(custom)f(en)m(vironmen)m(ts)h(to)g(automate)h(their) | |
| 4713 | f(common)f(tasks.)275 3748 y(Shells)j(ma)m(y)h(b)s(e)f(used)g(in)m | |
| 4714 | (teractiv)m(ely)k(or)d(non-in)m(teractiv)m(ely)-8 b(.)54 | |
| 4715 | b(In)33 b(in)m(teractiv)m(e)j(mo)s(de,)f(they)e(accept)150 | |
| 4716 | 3857 y(input)21 b(t)m(yp)s(ed)h(from)g(the)h(k)m(eyb)s(oard.)37 | |
| 4717 | b(When)22 b(executing)i(non-in)m(teractiv)m(ely)-8 b(,)27 | |
| 4718 | b(shells)c(execute)g(commands)150 3967 y(read)30 b(from)g(a)h(\014le.) | |
| 4719 | 275 4105 y(A)41 b(shell)g(allo)m(ws)h(execution)h(of)e | |
| 4720 | Fl(gnu)g Ft(commands,)i(b)s(oth)e(sync)m(hronously)f(and)h(async)m | |
| 4721 | (hronously)-8 b(.)150 4215 y(The)29 b(shell)g(w)m(aits)i(for)e(sync)m | |
| 28157acd CR |
4722 | (hronous)f(commands)h(to)h(complete)h(b)s(efore)e(accepting)h(more)g |
| 4723 | (input;)f(asyn-)150 4325 y(c)m(hronous)22 b(commands)h(con)m(tin)m(ue)h | |
| 37c41ab1 CR |
4724 | (to)f(execute)h(in)e(parallel)i(with)f(the)f(shell)h(while)g(it)g |
| 4725 | (reads)g(and)f(executes)150 4434 y(additional)35 b(commands.)50 | |
| 4726 | b(The)33 b Fq(redirection)h Ft(constructs)g(p)s(ermit)f(\014ne-grained) | |
| 4727 | g(con)m(trol)i(of)f(the)g(input)150 4544 y(and)40 b(output)f(of)i | |
| 4728 | (those)f(commands.)70 b(Moreo)m(v)m(er,)45 b(the)c(shell)f(allo)m(ws)h | |
| 4729 | (con)m(trol)h(o)m(v)m(er)g(the)e(con)m(ten)m(ts)i(of)150 | |
| 4730 | 4653 y(commands')30 b(en)m(vironmen)m(ts.)275 4792 y(Shells)k(also)i | |
| 4731 | (pro)m(vide)g(a)f(small)h(set)f(of)g(built-in)g(commands)g(\()p | |
| 4732 | Fq(builtins)t Ft(\))g(implemen)m(ting)h(function-)150 | |
| 4733 | 4902 y(alit)m(y)i(imp)s(ossible)e(or)g(incon)m(v)m(enien)m(t)j(to)e | |
| 4734 | (obtain)g(via)g(separate)g(utilities.)61 b(F)-8 b(or)37 | |
| 4735 | b(example,)i Fs(cd)p Ft(,)e Fs(break)p Ft(,)150 5011 | |
| 5e13499c | 4736 | y Fs(continue)p Ft(,)43 b(and)f Fs(exec)p Ft(\))g(cannot)h(b)s(e)e |
| 37c41ab1 CR |
4737 | (implemen)m(ted)i(outside)g(of)f(the)h(shell)f(b)s(ecause)h(they)f |
| 4738 | (directly)150 5121 y(manipulate)37 b(the)g(shell)f(itself.)61 | |
| 5e13499c | 4739 | b(The)36 b Fs(history)p Ft(,)g Fs(getopts)p Ft(,)g Fs(kill)p |
| 37c41ab1 CR |
4740 | Ft(,)h(or)g Fs(pwd)f Ft(builtins,)h(among)h(others,)150 |
| 4741 | 5230 y(could)33 b(b)s(e)f(implemen)m(ted)h(in)g(separate)g(utilities,)i | |
| 4742 | (but)d(they)h(are)h(more)f(con)m(v)m(enien)m(t)h(to)g(use)e(as)h | |
| 4743 | (builtin)150 5340 y(commands.)40 b(All)31 b(of)g(the)f(shell)h | |
| 4744 | (builtins)f(are)h(describ)s(ed)e(in)h(subsequen)m(t)g(sections.)p | |
| 4745 | eop end | |
| 5e13499c | 4746 | %%Page: 2 8 |
| 37c41ab1 CR |
4747 | TeXDict begin 2 7 bop 150 -116 a Ft(2)2617 b(Bash)31 |
| 4748 | b(Reference)g(Man)m(ual)275 299 y(While)39 b(executing)h(commands)e(is) | |
| 4749 | g(essen)m(tial,)43 b(most)c(of)g(the)g(p)s(o)m(w)m(er)f(\(and)g | |
| 4750 | (complexit)m(y\))j(of)e(shells)150 408 y(is)34 b(due)f(to)i(their)f(em) | |
| 4751 | m(b)s(edded)f(programming)h(languages.)52 b(Lik)m(e)35 | |
| 4752 | b(an)m(y)f(high-lev)m(el)i(language,)h(the)d(shell)150 | |
| 4753 | 518 y(pro)m(vides)c(v)-5 b(ariables,)32 b(\015o)m(w)e(con)m(trol)i | |
| 4754 | (constructs,)f(quoting,)g(and)f(functions.)275 653 y(Shells)21 | |
| 4755 | b(o\013er)i(features)f(geared)h(sp)s(eci\014cally)g(for)f(in)m | |
| 4756 | (teractiv)m(e)j(use)d(rather)g(than)g(to)h(augmen)m(t)g(the)f(pro-)150 | |
| 4757 | 762 y(gramming)32 b(language.)48 b(These)32 b(in)m(teractiv)m(e)j | |
| 4758 | (features)d(include)g(job)g(con)m(trol,)j(command)c(line)i(editing,)150 | |
| 4759 | 872 y(command)d(history)g(and)g(aliases.)42 b(Eac)m(h)31 | |
| 4760 | b(of)g(these)g(features)f(is)h(describ)s(ed)e(in)h(this)g(man)m(ual.)p | |
| 4761 | eop end | |
| 5e13499c | 4762 | %%Page: 3 9 |
| 37c41ab1 CR |
4763 | TeXDict begin 3 8 bop 150 -116 a Ft(Chapter)30 b(2:)41 |
| 4764 | b(De\014nitions)2662 b(3)150 299 y Fo(2)80 b(De\014nitions)275 | |
| 4765 | 527 y Ft(These)30 b(de\014nitions)g(are)g(used)g(throughout)g(the)g | |
| 4766 | (remainder)g(of)h(this)f(man)m(ual.)150 684 y Fs(POSIX)240 | |
| ac18b312 CR |
4767 | b Ft(A)27 b(family)g(of)g(op)s(en)f(system)g(standards)g(based)g(on)h |
| 4768 | (Unix.)39 b(Bash)27 b(is)g(primarily)f(concerned)630 | |
| 4769 | 794 y(with)k(the)h(Shell)f(and)g(Utilities)i(p)s(ortion)e(of)h(the)f | |
| 4770 | Fl(posix)g Ft(1003.1)j(standard.)150 950 y Fs(blank)240 | |
| 4771 | b Ft(A)30 b(space)h(or)g(tab)f(c)m(haracter.)150 1107 | |
| 4772 | y Fs(builtin)144 b Ft(A)35 b(command)g(that)g(is)g(implemen)m(ted)g(in) | |
| 4773 | m(ternally)h(b)m(y)f(the)g(shell)g(itself,)i(rather)d(than)h(b)m(y)630 | |
| 4774 | 1217 y(an)30 b(executable)i(program)e(somewhere)h(in)f(the)g(\014le)h | |
| 4775 | (system.)150 1374 y Fs(control)d(operator)630 1484 y | |
| 4776 | Ft(A)c Fs(word)e Ft(that)i(p)s(erforms)f(a)h(con)m(trol)h(function.)38 | |
| 4777 | b(It)24 b(is)f(a)h Fs(newline)e Ft(or)i(one)g(of)f(the)h(follo)m(wing:) | |
| 4778 | 630 1593 y(`)p Fs(||)p Ft(',)31 b(`)p Fs(&&)p Ft(',)f(`)p | |
| 4779 | Fs(&)p Ft(',)h(`)p Fs(;)p Ft(',)g(`)p Fs(;;)p Ft(',)f(`)p | |
| 4780 | Fs(|)p Ft(',)h(`)p Fs(\()p Ft(',)g(or)f(`)p Fs(\))p Ft('.)150 | |
| 4781 | 1750 y Fs(exit)f(status)630 1860 y Ft(The)f(v)-5 b(alue)29 | |
| 4782 | b(returned)e(b)m(y)h(a)h(command)f(to)h(its)g(caller.)41 | |
| 4783 | b(The)28 b(v)-5 b(alue)29 b(is)f(restricted)h(to)h(eigh)m(t)630 | |
| 4784 | 1969 y(bits,)h(so)f(the)h(maxim)m(um)f(v)-5 b(alue)31 | |
| 4785 | b(is)f(255.)150 2126 y Fs(field)240 b Ft(A)27 b(unit)g(of)g(text)h | |
| 4786 | (that)g(is)f(the)g(result)g(of)g(one)h(of)f(the)g(shell)g(expansions.) | |
| 4787 | 40 b(After)27 b(expansion,)630 2236 y(when)e(executing)h(a)g(command,)h | |
| 4788 | (the)f(resulting)f(\014elds)g(are)h(used)f(as)h(the)g(command)f(name) | |
| 4789 | 630 2346 y(and)30 b(argumen)m(ts.)150 2503 y Fs(filename)96 | |
| 4790 | b Ft(A)30 b(string)h(of)f(c)m(haracters)i(used)e(to)h(iden)m(tify)g(a)f | |
| 4791 | (\014le.)150 2659 y Fs(job)336 b Ft(A)31 b(set)h(of)f(pro)s(cesses)g | |
| 4792 | (comprising)g(a)g(pip)s(eline,)g(and)g(an)m(y)g(pro)s(cesses)g | |
| 4793 | (descended)g(from)f(it,)630 2769 y(that)h(are)g(all)g(in)f(the)h(same)f | |
| 4794 | (pro)s(cess)g(group.)150 2926 y Fs(job)f(control)630 | |
| 4795 | 3036 y Ft(A)22 b(mec)m(hanism)g(b)m(y)f(whic)m(h)h(users)f(can)h | |
| 4796 | (selectiv)m(ely)i(stop)e(\(susp)s(end\))e(and)h(restart)i(\(resume\)) | |
| 4797 | 630 3145 y(execution)32 b(of)e(pro)s(cesses.)150 3302 | |
| 4798 | y Fs(metacharacter)630 3412 y Ft(A)25 b(c)m(haracter)i(that,)g(when)d | |
| 4799 | (unquoted,)i(separates)g(w)m(ords.)38 b(A)26 b(metac)m(haracter)i(is)d | |
| 4800 | (a)g Fs(blank)630 3521 y Ft(or)30 b(one)h(of)g(the)f(follo)m(wing)i(c)m | |
| 4801 | (haracters:)42 b(`)p Fs(|)p Ft(',)31 b(`)p Fs(&)p Ft(',)g(`)p | |
| 4802 | Fs(;)p Ft(',)g(`)p Fs(\()p Ft(',)f(`)p Fs(\))p Ft(',)h(`)p | |
| 4803 | Fs(<)p Ft(',)g(or)f(`)p Fs(>)p Ft('.)150 3678 y Fs(name)288 | |
| 4804 | b Ft(A)37 b Fs(word)f Ft(consisting)i(solely)h(of)e(letters,)j(n)m(um)m | |
| 4805 | (b)s(ers,)e(and)f(underscores,)h(and)f(b)s(eginning)630 | |
| 4806 | 3788 y(with)23 b(a)g(letter)h(or)f(underscore.)38 b Fs(Name)p | |
| 4807 | Ft(s)22 b(are)h(used)f(as)i(shell)f(v)-5 b(ariable)24 | |
| 4808 | b(and)e(function)h(names.)630 3898 y(Also)31 b(referred)f(to)h(as)f(an) | |
| 4809 | h Fs(identifier)p Ft(.)150 4055 y Fs(operator)96 b Ft(A)38 | |
| 4810 | b Fs(control)28 b(operator)36 b Ft(or)h(a)i Fs(redirection)27 | |
| 4811 | b(operator)p Ft(.)61 b(See)38 b(Section)g(3.6)h([Redirec-)630 | |
| 4812 | 4164 y(tions],)31 b(page)g(25,)h(for)e(a)h(list)g(of)f(redirection)h | |
| 4813 | (op)s(erators.)150 4321 y Fs(process)d(group)630 4431 | |
| 4814 | y Ft(A)i(collection)k(of)c(related)h(pro)s(cesses)g(eac)m(h)g(ha)m | |
| 4815 | (ving)g(the)g(same)f(pro)s(cess)g(group)g Fl(id)p Ft(.)150 | |
| 28157acd CR |
4816 | 4588 y Fs(process)e(group)h(ID)630 4697 y Ft(A)h(unique)g(iden)m(tifer) |
| 4817 | h(that)g(represen)m(ts)f(a)h Fs(process)d(group)h Ft(during)g(its)i | |
| 4818 | (lifetime.)150 4854 y Fs(reserved)d(word)630 4964 y Ft(A)h | |
| 4819 | Fs(word)e Ft(that)i(has)f(a)h(sp)s(ecial)g(meaning)f(to)h(the)g(shell.) | |
| 4820 | 40 b(Most)30 b(reserv)m(ed)e(w)m(ords)g(in)m(tro)s(duce)630 | |
| 4821 | 5073 y(shell)j(\015o)m(w)f(con)m(trol)i(constructs,)f(suc)m(h)f(as)g | |
| 4822 | Fs(for)g Ft(and)g Fs(while)p Ft(.)150 5230 y Fs(return)f(status)630 | |
| 5e13499c | 4823 | 5340 y Ft(A)h(synon)m(ym)g(for)g Fs(exit)g(status)p Ft(.)p |
| 37c41ab1 | 4824 | eop end |
| 5e13499c | 4825 | %%Page: 4 10 |
| 37c41ab1 CR |
4826 | TeXDict begin 4 9 bop 150 -116 a Ft(4)2617 b(Bash)31 |
| 4827 | b(Reference)g(Man)m(ual)150 299 y Fs(signal)192 b Ft(A)40 | |
| 4828 | b(mec)m(hanism)h(b)m(y)e(whic)m(h)h(a)h(pro)s(cess)e(ma)m(y)i(b)s(e)e | |
| 4829 | (noti\014ed)h(b)m(y)g(the)h(k)m(ernel)f(of)g(an)g(ev)m(en)m(t)630 | |
| 4830 | 408 y(o)s(ccurring)30 b(in)g(the)h(system.)150 568 y | |
| ac18b312 CR |
4831 | Fs(special)d(builtin)630 677 y Ft(A)j(shell)f(builtin)g(command)h(that) |
| 4832 | g(has)f(b)s(een)g(classi\014ed)h(as)g(sp)s(ecial)g(b)m(y)f(the)h | |
| 4833 | Fl(posix)f Ft(stan-)630 787 y(dard.)150 946 y Fs(token)240 | |
| 37c41ab1 CR |
4834 | b Ft(A)38 b(sequence)h(of)f(c)m(haracters)h(considered)f(a)h(single)g |
| 4835 | (unit)e(b)m(y)h(the)h(shell.)64 b(It)38 b(is)g(either)h(a)630 | |
| 4836 | 1056 y Fs(word)29 b Ft(or)i(an)f Fs(operator)p Ft(.)150 | |
| 4837 | 1215 y Fs(word)288 b Ft(A)30 b Fs(token)f Ft(that)i(is)g(not)f(an)h | |
| 4838 | Fs(operator)p Ft(.)p eop end | |
| 5e13499c | 4839 | %%Page: 5 11 |
| 37c41ab1 CR |
4840 | TeXDict begin 5 10 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 4841 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(5)150 299 | |
| 4842 | y Fo(3)80 b(Basic)54 b(Shell)e(F)-13 b(eatures)275 544 | |
| 4843 | y Ft(Bash)27 b(is)g(an)g(acron)m(ym)h(for)f(`)p Fs(Bourne-Again)g | |
| 4844 | (SHell)p Ft('.)39 b(The)26 b(Bourne)h(shell)h(is)f(the)g(traditional)i | |
| 4845 | (Unix)150 653 y(shell)34 b(originally)h(written)e(b)m(y)g(Stephen)g | |
| 4846 | (Bourne.)50 b(All)34 b(of)g(the)f(Bourne)h(shell)f(builtin)g(commands)h | |
| 4847 | (are)150 763 y(a)m(v)-5 b(ailable)32 b(in)c(Bash,)i(The)f(rules)g(for)g | |
| 4848 | (ev)-5 b(aluation)31 b(and)d(quoting)i(are)f(tak)m(en)i(from)d(the)i | |
| 4849 | Fl(posix)e Ft(sp)s(eci\014ca-)150 872 y(tion)j(for)f(the)h(`standard')f | |
| 4850 | (Unix)g(shell.)275 1010 y(This)h(c)m(hapter)i(brie\015y)e(summarizes)h | |
| 4851 | (the)h(shell's)f(`building)g(blo)s(c)m(ks':)45 b(commands,)32 | |
| 4852 | b(con)m(trol)i(struc-)150 1120 y(tures,)k(shell)e(functions,)h(shell)g | |
| 4853 | Fm(p)-5 b(ar)g(ameters)p Ft(,)41 b(shell)36 b(expansions,)i | |
| 4854 | Fm(r)-5 b(e)g(dir)g(e)g(ctions)p Ft(,)40 b(whic)m(h)c(are)h(a)f(w)m(a)m | |
| 4855 | (y)h(to)150 1230 y(direct)31 b(input)e(and)h(output)g(from)g(and)g(to)h | |
| 4856 | (named)f(\014les,)g(and)g(ho)m(w)g(the)h(shell)g(executes)g(commands.) | |
| 4857 | 150 1496 y Fr(3.1)68 b(Shell)45 b(Syn)l(tax)275 1744 | |
| 4858 | y Ft(When)32 b(the)h(shell)g(reads)g(input,)g(it)g(pro)s(ceeds)f | |
| 4859 | (through)h(a)g(sequence)g(of)g(op)s(erations.)48 b(If)33 | |
| 4860 | b(the)g(input)150 1853 y(indicates)e(the)f(b)s(eginning)f(of)h(a)g | |
| 4861 | (commen)m(t,)h(the)f(shell)g(ignores)g(the)g(commen)m(t)h(sym)m(b)s(ol) | |
| 4862 | f(\(`)p Fs(#)p Ft('\),)h(and)e(the)150 1963 y(rest)i(of)f(that)h(line.) | |
| 4863 | 275 2101 y(Otherwise,)h(roughly)f(sp)s(eaking,)i(the)f(shell)g(reads)g | |
| 4864 | (its)g(input)f(and)h(divides)f(the)i(input)e(in)m(to)h(w)m(ords)150 | |
| 4865 | 2210 y(and)23 b(op)s(erators,)j(emplo)m(ying)e(the)g(quoting)h(rules)e | |
| 4866 | (to)h(select)i(whic)m(h)d(meanings)h(to)h(assign)f(v)-5 | |
| 4867 | b(arious)23 b(w)m(ords)150 2320 y(and)30 b(c)m(haracters.)275 | |
| 4868 | 2458 y(The)38 b(shell)h(then)f(parses)g(these)h(tok)m(ens)h(in)m(to)f | |
| 4869 | (commands)g(and)f(other)h(constructs,)i(remo)m(v)m(es)f(the)150 | |
| 4870 | 2568 y(sp)s(ecial)31 b(meaning)f(of)g(certain)h(w)m(ords)f(or)g(c)m | |
| 4871 | (haracters,)i(expands)d(others,)h(redirects)h(input)e(and)g(output)150 | |
| 4872 | 2677 y(as)d(needed,)g(executes)g(the)g(sp)s(eci\014ed)e(command,)j(w)m | |
| 4873 | (aits)f(for)f(the)g(command's)g(exit)i(status,)f(and)f(mak)m(es)150 | |
| 4874 | 2787 y(that)31 b(exit)g(status)g(a)m(v)-5 b(ailable)33 | |
| 4875 | b(for)d(further)f(insp)s(ection)h(or)h(pro)s(cessing.)150 | |
| 5e13499c | 4876 | 3018 y Fk(3.1.1)63 b(Shell)41 b(Op)s(eration)275 3266 |
| 37c41ab1 CR |
4877 | y Ft(The)28 b(follo)m(wing)i(is)f(a)g(brief)f(description)h(of)g(the)g |
| 4878 | (shell's)g(op)s(eration)h(when)d(it)j(reads)e(and)g(executes)j(a)150 | |
| 4879 | 3375 y(command.)40 b(Basically)-8 b(,)34 b(the)c(shell)h(do)s(es)f(the) | |
| 4880 | h(follo)m(wing:)199 3513 y(1.)61 b(Reads)42 b(its)h(input)e(from)h(a)g | |
| eb2bb562 | 4881 | (\014le)h(\(see)g(Section)g(3.8)g([Shell)f(Scripts],)j(page)e(32\),)k |
| 37c41ab1 CR |
4882 | (from)41 b(a)i(string)330 3623 y(supplied)26 b(as)i(an)f(argumen)m(t)g |
| 4883 | (to)h(the)g(`)p Fs(-c)p Ft(')f(in)m(v)m(o)s(cation)i(option)f(\(see)g | |
| 28157acd | 4884 | (Section)h(6.1)f([In)m(v)m(oking)g(Bash],)330 3732 y(page)j(67\),)h(or) |
| 5e13499c | 4885 | e(from)g(the)h(user's)f(terminal.)199 3869 y(2.)61 b(Breaks)43 |
| 37c41ab1 CR |
4886 | b(the)g(input)f(in)m(to)h(w)m(ords)f(and)g(op)s(erators,)k(ob)s(eying)d |
| 4887 | (the)g(quoting)g(rules)f(describ)s(ed)f(in)330 3978 y(Section)27 | |
| 4888 | b(3.1.2)i([Quoting],)f(page)f(6.)40 b(These)26 b(tok)m(ens)i(are)f | |
| 5e13499c | 4889 | (separated)g(b)m(y)f Fs(metacharacters)p Ft(.)36 b(Alias)330 |
| 37c41ab1 | 4890 | 4088 y(expansion)30 b(is)h(p)s(erformed)d(b)m(y)j(this)f(step)g(\(see)i |
| 28157acd | 4891 | (Section)f(6.6)g([Aliases],)i(page)e(75\).)199 4224 y(3.)61 |
| 37c41ab1 CR |
4892 | b(P)m(arses)35 b(the)g(tok)m(ens)g(in)m(to)h(simple)e(and)g(comp)s |
| 4893 | (ound)f(commands)h(\(see)h(Section)h(3.2)f([Shell)g(Com-)330 | |
| 4894 | 4334 y(mands],)30 b(page)h(8\).)199 4470 y(4.)61 b(P)m(erforms)40 | |
| 4895 | b(the)h(v)-5 b(arious)40 b(shell)h(expansions)f(\(see)h(Section)g(3.5)g | |
| 9d2b70f0 | 4896 | ([Shell)g(Expansions],)h(page)f(17\),)330 4580 y(breaking)35 |
| 37c41ab1 CR |
4897 | b(the)g(expanded)g(tok)m(ens)h(in)m(to)g(lists)f(of)g(\014lenames)h |
| 4898 | (\(see)g(Section)f(3.5.8)i([Filename)g(Ex-)330 4689 y(pansion],)30 | |
| eb2bb562 | 4899 | b(page)h(23\))h(and)e(commands)g(and)g(argumen)m(ts.)199 |
| 37c41ab1 | 4900 | 4826 y(5.)61 b(P)m(erforms)36 b(an)m(y)i(necessary)f(redirections)g |
| 9d2b70f0 | 4901 | (\(see)h(Section)f(3.6)h([Redirections],)i(page)e(25\))g(and)e(re-)330 |
| 37c41ab1 CR |
4902 | 4935 y(mo)m(v)m(es)c(the)e(redirection)h(op)s(erators)g(and)f(their)g |
| 4903 | (op)s(erands)f(from)h(the)h(argumen)m(t)f(list.)199 5071 | |
| 4904 | y(6.)61 b(Executes)31 b(the)g(command)f(\(see)h(Section)g(3.7)h | |
| 4905 | ([Executing)f(Commands],)f(page)h(28\).)199 5208 y(7.)61 | |
| 4906 | b(Optionally)40 b(w)m(aits)g(for)f(the)g(command)g(to)h(complete)g(and) | |
| 4907 | f(collects)i(its)f(exit)g(status)f(\(see)h(Sec-)330 5317 | |
| eb2bb562 | 4908 | y(tion)31 b(3.7.5)h([Exit)f(Status],)g(page)g(31\).)p |
| 37c41ab1 | 4909 | eop end |
| 5e13499c | 4910 | %%Page: 6 12 |
| 37c41ab1 CR |
4911 | TeXDict begin 6 11 bop 150 -116 a Ft(6)2617 b(Bash)31 |
| 4912 | b(Reference)g(Man)m(ual)150 299 y Fk(3.1.2)63 b(Quoting)275 | |
| 01ed5ba4 | 4913 | 537 y Ft(Quoting)24 b(is)g(used)f(to)h(remo)m(v)m(e)i(the)e(sp)s(ecial) |
| 37c41ab1 | 4914 | g(meaning)g(of)g(certain)h(c)m(haracters)h(or)d(w)m(ords)h(to)g(the)g |
| 01ed5ba4 | 4915 | (shell.)150 647 y(Quoting)k(can)f(b)s(e)g(used)f(to)j(disable)e(sp)s |
| 37c41ab1 | 4916 | (ecial)h(treatmen)m(t)h(for)e(sp)s(ecial)h(c)m(haracters,)i(to)e(prev)m |
| 01ed5ba4 | 4917 | (en)m(t)g(reserv)m(ed)150 757 y(w)m(ords)i(from)g(b)s(eing)g |
| 37c41ab1 | 4918 | (recognized)h(as)g(suc)m(h,)f(and)g(to)h(prev)m(en)m(t)g(parameter)g |
| 01ed5ba4 | 4919 | (expansion.)275 886 y(Eac)m(h)22 b(of)g(the)g(shell)g(metac)m |
| 37c41ab1 | 4920 | (haracters)i(\(see)f(Chapter)e(2)i([De\014nitions],)h(page)f(3\))g(has) |
| 01ed5ba4 | 4921 | e(sp)s(ecial)i(meaning)150 995 y(to)40 b(the)g(shell)f(and)g(m)m(ust)g |
| 37c41ab1 | 4922 | (b)s(e)g(quoted)g(if)h(it)g(is)f(to)h(represen)m(t)g(itself.)68 |
| 01ed5ba4 CR |
4923 | b(When)39 b(the)h(command)f(history)150 1105 y(expansion)i(facilities)j |
| 4924 | (are)e(b)s(eing)f(used)g(\(see)h(Section)h(9.3)f([History)h(In)m | |
| 28157acd | 4925 | (teraction],)j(page)c(117\),)47 b(the)150 1214 y Fq(history)30 |
| 01ed5ba4 CR |
4926 | b(expansion)h Ft(c)m(haracter,)h(usually)f(`)p Fs(!)p |
| 4927 | Ft(',)g(m)m(ust)f(b)s(e)g(quoted)h(to)g(prev)m(en)m(t)g(history)g | |
| 4928 | (expansion.)41 b(See)150 1324 y(Section)22 b(9.1)g([Bash)f(History)h(F) | |
| 28157acd | 4929 | -8 b(acilities],)26 b(page)c(115,)j(for)20 b(more)h(details)h |
| 01ed5ba4 CR |
4930 | (concerning)g(history)f(expansion.)275 1453 y(There)37 |
| 4931 | b(are)h(three)f(quoting)h(mec)m(hanisms:)56 b(the)38 | |
| 4932 | b Fq(escap)s(e)g(c)m(haracter)p Ft(,)j(single)d(quotes,)i(and)d(double) | |
| 4933 | 150 1563 y(quotes.)150 1770 y Fk(3.1.2.1)63 b(Escap)s(e)41 | |
| 4934 | b(Character)275 2009 y Ft(A)27 b(non-quoted)g(bac)m(kslash)h(`)p | |
| 4935 | Fs(\\)p Ft(')f(is)g(the)h(Bash)f(escap)s(e)g(c)m(haracter.)42 | |
| 4936 | b(It)27 b(preserv)m(es)g(the)g(literal)i(v)-5 b(alue)28 | |
| 4937 | b(of)150 2119 y(the)f(next)g(c)m(haracter)h(that)f(follo)m(ws,)i(with)d | |
| 4938 | (the)h(exception)g(of)g Fs(newline)p Ft(.)38 b(If)26 | |
| 4939 | b(a)h Fs(\\newline)d Ft(pair)i(app)s(ears,)150 2228 y(and)k(the)h(bac)m | |
| 4940 | (kslash)g(itself)g(is)g(not)g(quoted,)g(the)f Fs(\\newline)f | |
| 4941 | Ft(is)h(treated)i(as)f(a)g(line)g(con)m(tin)m(uation)h(\(that)150 | |
| 4942 | 2338 y(is,)f(it)g(is)f(remo)m(v)m(ed)h(from)f(the)h(input)e(stream)i | |
| 4943 | (and)f(e\013ectiv)m(ely)j(ignored\).)150 2545 y Fk(3.1.2.2)63 | |
| 4944 | b(Single)42 b(Quotes)275 2784 y Ft(Enclosing)36 b(c)m(haracters)i(in)d | |
| 4945 | (single)i(quotes)g(\(`)p Fs(')p Ft('\))f(preserv)m(es)h(the)f(literal)h | |
| 4946 | (v)-5 b(alue)37 b(of)f(eac)m(h)h(c)m(haracter)150 2894 | |
| 4947 | y(within)24 b(the)h(quotes.)39 b(A)25 b(single)h(quote)f(ma)m(y)g(not)g | |
| 4948 | (o)s(ccur)g(b)s(et)m(w)m(een)g(single)h(quotes,)g(ev)m(en)g(when)d | |
| 4949 | (preceded)150 3003 y(b)m(y)30 b(a)h(bac)m(kslash.)150 | |
| 4950 | 3211 y Fk(3.1.2.3)63 b(Double)42 b(Quotes)275 3450 y | |
| 4951 | Ft(Enclosing)36 b(c)m(haracters)i(in)e(double)g(quotes)h(\(`)p | |
| 4952 | Fs(")p Ft('\))g(preserv)m(es)f(the)g(literal)i(v)-5 b(alue)37 | |
| 4953 | b(of)f(all)h(c)m(haracters)150 3559 y(within)25 b(the)g(quotes,)i(with) | |
| 4954 | e(the)g(exception)h(of)g(`)p Fs($)p Ft(',)g(`)p Fs(`)p | |
| 4955 | Ft(',)h(`)p Fs(\\)p Ft(',)f(and,)g(when)e(history)i(expansion)f(is)g | |
| 4956 | (enabled,)150 3669 y(`)p Fs(!)p Ft('.)48 b(The)32 b(c)m(haracters)i(`)p | |
| 4957 | Fs($)p Ft(')f(and)f(`)p Fs(`)p Ft(')h(retain)g(their)g(sp)s(ecial)g | |
| 4958 | (meaning)g(within)f(double)h(quotes)g(\(see)g(Sec-)150 | |
| 9d2b70f0 | 4959 | 3778 y(tion)e(3.5)h([Shell)e(Expansions],)g(page)i(17\).)42 |
| 01ed5ba4 CR |
4960 | b(The)30 b(bac)m(kslash)h(retains)g(its)g(sp)s(ecial)g(meaning)f(only)h |
| 4961 | (when)150 3888 y(follo)m(w)m(ed)40 b(b)m(y)e(one)h(of)g(the)f(follo)m | |
| 4962 | (wing)i(c)m(haracters:)58 b(`)p Fs($)p Ft(',)41 b(`)p | |
| 4963 | Fs(`)p Ft(',)g(`)p Fs(")p Ft(',)g(`)p Fs(\\)p Ft(',)g(or)d | |
| 4964 | Fs(newline)p Ft(.)63 b(Within)38 b(double)150 3998 y(quotes,)c(bac)m | |
| 4965 | (kslashes)g(that)f(are)g(follo)m(w)m(ed)h(b)m(y)f(one)g(of)f(these)h(c) | |
| 4966 | m(haracters)i(are)e(remo)m(v)m(ed.)48 b(Bac)m(kslashes)150 | |
| 4967 | 4107 y(preceding)25 b(c)m(haracters)h(without)f(a)h(sp)s(ecial)f | |
| 4968 | (meaning)h(are)f(left)h(unmo)s(di\014ed.)37 b(A)25 b(double)f(quote)i | |
| 4969 | (ma)m(y)g(b)s(e)150 4217 y(quoted)g(within)f(double)g(quotes)g(b)m(y)h | |
| 4970 | (preceding)f(it)h(with)f(a)h(bac)m(kslash.)40 b(If)25 | |
| 4971 | b(enabled,)i(history)e(expansion)150 4326 y(will)38 b(b)s(e)e(p)s | |
| 4972 | (erformed)g(unless)h(an)g(`)p Fs(!)p Ft(')h(app)s(earing)f(in)g(double) | |
| 4973 | g(quotes)h(is)f(escap)s(ed)g(using)g(a)h(bac)m(kslash.)150 | |
| 4974 | 4436 y(The)30 b(bac)m(kslash)h(preceding)f(the)h(`)p | |
| 4975 | Fs(!)p Ft(')f(is)h(not)f(remo)m(v)m(ed.)275 4565 y(The)41 | |
| 4976 | b(sp)s(ecial)h(parameters)f(`)p Fs(*)p Ft(')h(and)f(`)p | |
| 4977 | Fs(@)p Ft(')h(ha)m(v)m(e)g(sp)s(ecial)g(meaning)g(when)f(in)g(double)g | |
| 4978 | (quotes)h(\(see)150 4674 y(Section)31 b(3.5.3)h([Shell)f(P)m(arameter)h | |
| 4979 | (Expansion],)e(page)h(19\).)150 4882 y Fk(3.1.2.4)63 | |
| 4980 | b(ANSI-C)40 b(Quoting)275 5121 y Ft(W)-8 b(ords)33 b(of)h(the)g(form)f | |
| 4981 | Fs($')p Fj(string)11 b Fs(')31 b Ft(are)j(treated)g(sp)s(ecially)-8 | |
| 37c41ab1 CR |
4982 | b(.)52 b(The)33 b(w)m(ord)g(expands)g(to)i Fq(string)p |
| 4983 | Ft(,)f(with)150 5230 y(bac)m(kslash-escap)s(ed)44 b(c)m(haracters)h | |
| 4984 | (replaced)f(as)g(sp)s(eci\014ed)f(b)m(y)g(the)g(ANSI)g(C)g(standard.)79 | |
| 4985 | b(Bac)m(kslash)150 5340 y(escap)s(e)31 b(sequences,)g(if)f(presen)m(t,) | |
| 4986 | h(are)g(deco)s(ded)f(as)g(follo)m(ws:)p eop end | |
| 5e13499c | 4987 | %%Page: 7 13 |
| 37c41ab1 CR |
4988 | TeXDict begin 7 12 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 4989 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(7)150 299 | |
| 28157acd CR |
4990 | y Fs(\\a)384 b Ft(alert)31 b(\(b)s(ell\))150 487 y Fs(\\b)384 |
| 4991 | b Ft(bac)m(kspace)150 675 y Fs(\\e)g Ft(an)30 b(escap)s(e)h(c)m | |
| 4992 | (haracter)h(\(not)f(ANSI)f(C\))150 862 y Fs(\\f)384 b | |
| 4993 | Ft(form)30 b(feed)150 1050 y Fs(\\n)384 b Ft(newline)150 | |
| 4994 | 1238 y Fs(\\r)g Ft(carriage)32 b(return)150 1426 y Fs(\\t)384 | |
| 4995 | b Ft(horizon)m(tal)32 b(tab)150 1614 y Fs(\\v)384 b Ft(v)m(ertical)32 | |
| 4996 | b(tab)150 1802 y Fs(\\\\)384 b Ft(bac)m(kslash)150 1989 | |
| 4997 | y Fs(\\')g Ft(single)31 b(quote)150 2177 y Fs(\\)p Fj(nnn)288 | |
| 37c41ab1 CR |
4998 | b Ft(the)31 b(eigh)m(t-bit)h(c)m(haracter)g(whose)e(v)-5 |
| 4999 | b(alue)31 b(is)f(the)h(o)s(ctal)g(v)-5 b(alue)31 b Fq(nnn)e | |
| 28157acd | 5000 | Ft(\(one)i(to)g(three)g(digits\))150 2365 y Fs(\\x)p |
| 37c41ab1 CR |
5001 | Fj(HH)288 b Ft(the)36 b(eigh)m(t-bit)i(c)m(haracter)f(whose)f(v)-5 |
| 5002 | b(alue)36 b(is)g(the)g(hexadecimal)h(v)-5 b(alue)36 b | |
| 28157acd CR |
5003 | Fq(HH)46 b Ft(\(one)37 b(or)f(t)m(w)m(o)630 2475 y(hex)30 |
| 5004 | b(digits\))150 2662 y Fs(\\c)p Fj(x)336 b Ft(a)31 b(con)m(trol-)p | |
| 5005 | Fq(x)38 b Ft(c)m(haracter)150 2865 y(The)30 b(expanded)f(result)i(is)f | |
| 37c41ab1 | 5006 | (single-quoted,)i(as)f(if)f(the)g(dollar)h(sign)g(had)e(not)i(b)s(een)f |
| 28157acd CR |
5007 | (presen)m(t.)150 3146 y Fk(3.1.2.5)63 b(Lo)s(cale-Sp)s(eci\014c)41 |
| 5008 | b(T)-10 b(ranslation)275 3418 y Ft(A)30 b(double-quoted)h(string)f | |
| 37c41ab1 CR |
5009 | (preceded)g(b)m(y)h(a)g(dollar)g(sign)f(\(`)p Fs($)p |
| 5010 | Ft('\))i(will)e(cause)i(the)e(string)h(to)g(b)s(e)f(trans-)150 | |
| 28157acd | 5011 | 3528 y(lated)j(according)g(to)g(the)f(curren)m(t)g(lo)s(cale.)47 |
| 37c41ab1 CR |
5012 | b(If)32 b(the)g(curren)m(t)g(lo)s(cale)i(is)e Fs(C)g |
| 5013 | Ft(or)g Fs(POSIX)p Ft(,)f(the)h(dollar)h(sign)f(is)150 | |
| 28157acd | 5014 | 3637 y(ignored.)41 b(If)30 b(the)g(string)h(is)f(translated)h(and)f |
| 37c41ab1 | 5015 | (replaced,)h(the)g(replacemen)m(t)g(is)g(double-quoted.)275 |
| 28157acd | 5016 | 3800 y(Some)20 b(systems)h(use)f(the)h(message)h(catalog)h(selected)f |
| 37c41ab1 | 5017 | (b)m(y)f(the)g Fs(LC_MESSAGES)c Ft(shell)k(v)-5 b(ariable.)39 |
| 28157acd | 5018 | b(Others)150 3910 y(create)g(the)e(name)g(of)g(the)g(message)h(catalog) |
| 37c41ab1 | 5019 | i(from)d(the)g(v)-5 b(alue)37 b(of)g(the)h Fs(TEXTDOMAIN)c |
| 28157acd | 5020 | Ft(shell)j(v)-5 b(ariable,)150 4019 y(p)s(ossibly)31 |
| 37c41ab1 CR |
5021 | b(adding)g(a)g(su\016x)g(of)h(`)p Fs(.mo)p Ft('.)43 b(If)31 |
| 5022 | b(y)m(ou)h(use)f(the)h Fs(TEXTDOMAIN)c Ft(v)-5 b(ariable,)33 | |
| 28157acd | 5023 | b(y)m(ou)f(ma)m(y)g(need)f(to)h(set)150 4129 y(the)22 |
| 37c41ab1 CR |
5024 | b Fs(TEXTDOMAINDIR)d Ft(v)-5 b(ariable)23 b(to)g(the)f(lo)s(cation)i |
| 5025 | (of)e(the)h(message)g(catalog)i(\014les.)38 b(Still)23 | |
| 28157acd | 5026 | b(others)f(use)g(b)s(oth)150 4238 y(v)-5 b(ariables)31 |
| 37c41ab1 | 5027 | b(in)f(this)g(fashion:)41 b Fs(TEXTDOMAINDIR)p Ft(/)p |
| 28157acd CR |
5028 | Fs(LC_MESSAGES)p Ft(/LC)p 2528 4238 28 4 v 34 w(MESSA)m(GES/)p |
| 5029 | Fs(TEXTDOMAIN)p Ft(.mo.)150 4520 y Fk(3.1.3)63 b(Commen)m(ts)275 | |
| 5030 | 4792 y Ft(In)34 b(a)j(non-in)m(teractiv)m(e)h(shell,)f(or)f(an)f(in)m | |
| 37c41ab1 | 5031 | (teractiv)m(e)k(shell)d(in)f(whic)m(h)h(the)f Fs(interactive_comments) |
| 28157acd CR |
5032 | 150 4902 y Ft(option)j(to)g(the)f Fs(shopt)f Ft(builtin)h(is)g(enabled) |
| 5033 | g(\(see)h(Section)h(4.2)f([Bash)f(Builtins],)j(page)e(41\),)j(a)c(w)m | |
| 5034 | (ord)150 5011 y(b)s(eginning)26 b(with)g(`)p Fs(#)p Ft(')g(causes)h | |
| 5035 | (that)f(w)m(ord)g(and)g(all)h(remaining)g(c)m(haracters)g(on)f(that)h | |
| 5036 | (line)g(to)g(b)s(e)f(ignored.)150 5121 y(An)43 b(in)m(teractiv)m(e)j | |
| 5037 | (shell)e(without)f(the)g Fs(interactive_comments)38 b | |
| 5038 | Ft(option)44 b(enabled)f(do)s(es)g(not)g(allo)m(w)150 | |
| 5039 | 5230 y(commen)m(ts.)56 b(The)34 b Fs(interactive_comments)c | |
| 5040 | Ft(option)35 b(is)g(on)g(b)m(y)g(default)g(in)g(in)m(teractiv)m(e)j | |
| 5041 | (shells.)55 b(See)150 5340 y(Section)30 b(6.3)f([In)m(teractiv)m(e)j | |
| 5042 | (Shells],)d(page)h(71,)g(for)e(a)i(description)e(of)h(what)g(mak)m(es)h | |
| 5043 | (a)f(shell)g(in)m(teractiv)m(e.)p eop end | |
| 5e13499c | 5044 | %%Page: 8 14 |
| 37c41ab1 CR |
5045 | TeXDict begin 8 13 bop 150 -116 a Ft(8)2617 b(Bash)31 |
| 5046 | b(Reference)g(Man)m(ual)150 299 y Fr(3.2)68 b(Shell)45 | |
| 5047 | b(Commands)275 553 y Ft(A)32 b(simple)g(shell)g(command)g(suc)m(h)g(as) | |
| 5048 | h Fs(echo)c(a)h(b)g(c)i Ft(consists)g(of)h(the)f(command)g(itself)h | |
| 5049 | (follo)m(w)m(ed)h(b)m(y)150 663 y(argumen)m(ts,)d(separated)g(b)m(y)f | |
| 5050 | (spaces.)275 808 y(More)h(complex)h(shell)f(commands)g(are)g(comp)s | |
| 5051 | (osed)g(of)g(simple)g(commands)g(arranged)g(together)h(in)150 | |
| 5052 | 917 y(a)f(v)-5 b(ariet)m(y)32 b(of)f(w)m(a)m(ys:)41 b(in)31 | |
| 5053 | b(a)g(pip)s(eline)f(in)g(whic)m(h)g(the)h(output)f(of)h(one)f(command)h | |
| 5054 | (b)s(ecomes)f(the)h(input)f(of)150 1027 y(a)h(second,)f(in)h(a)f(lo)s | |
| 5055 | (op)h(or)f(conditional)i(construct,)f(or)f(in)g(some)h(other)g | |
| 5056 | (grouping.)150 1272 y Fk(3.2.1)63 b(Simple)41 b(Commands)275 | |
| 5057 | 1526 y Ft(A)26 b(simple)h(command)g(is)f(the)h(kind)f(of)h(command)g | |
| 5e13499c CR |
5058 | (encoun)m(tered)g(most)g(often.)40 b(It's)27 b(just)f(a)i(sequence)150 |
| 5059 | 1636 y(of)f(w)m(ords)f(separated)h(b)m(y)g Fs(blank)p | |
| 37c41ab1 CR |
5060 | Ft(s,)f(terminated)h(b)m(y)g(one)g(of)g(the)g(shell's)g(con)m(trol)h |
| 5061 | (op)s(erators)f(\(see)h(Chap-)150 1745 y(ter)34 b(2)g([De\014nitions],) | |
| 5062 | i(page)f(3\).)51 b(The)34 b(\014rst)f(w)m(ord)g(generally)i(sp)s | |
| 5063 | (eci\014es)e(a)i(command)e(to)i(b)s(e)e(executed,)150 | |
| 5064 | 1855 y(with)d(the)h(rest)f(of)h(the)f(w)m(ords)g(b)s(eing)g(that)h | |
| 5e13499c | 5065 | (command's)f(argumen)m(ts.)275 2000 y(The)h(return)h(status)g(\(see)i |
| eb2bb562 | 5066 | (Section)f(3.7.5)h([Exit)f(Status],)h(page)f(31\))g(of)g(a)g(simple)f |
| 37c41ab1 CR |
5067 | (command)g(is)h(its)150 2109 y(exit)38 b(status)f(as)g(pro)m(vided)f(b) |
| 5068 | m(y)h(the)g Fl(posix)f Ft(1003.1)j Fs(waitpid)c Ft(function,)j(or)f | |
| 5069 | (128)p Fs(+)p Fq(n)g Ft(if)g(the)g(command)150 2219 y(w)m(as)31 | |
| 5070 | b(terminated)g(b)m(y)f(signal)h Fq(n)p Ft(.)150 2463 | |
| 5e13499c | 5071 | y Fk(3.2.2)63 b(Pip)s(elines)275 2718 y Ft(A)30 b Fs(pipeline)e |
| 37c41ab1 CR |
5072 | Ft(is)j(a)f(sequence)h(of)g(simple)f(commands)g(separated)h(b)m(y)f(`)p |
| 5073 | Fs(|)p Ft('.)275 2863 y(The)f(format)i(for)f(a)h(pip)s(eline)f(is)390 | |
| 5e13499c CR |
5074 | 3007 y Fs([time)46 b([-p]])h([!])g Fj(command1)56 b Fs([|)47 |
| 5075 | b Fj(command2)56 b Fs(...)o(])150 3152 y Ft(The)36 b(output)h(of)g(eac) | |
| 37c41ab1 CR |
5076 | m(h)h(command)e(in)h(the)g(pip)s(eline)f(is)h(connected)h(via)f(a)g |
| 5077 | (pip)s(e)f(to)i(the)f(input)f(of)h(the)150 3262 y(next)31 | |
| 5078 | b(command.)40 b(That)30 b(is,)h(eac)m(h)h(command)e(reads)g(the)g | |
| 5079 | (previous)g(command's)g(output.)275 3407 y(The)36 b(reserv)m(ed)g(w)m | |
| 5080 | (ord)g Fs(time)g Ft(causes)h(timing)g(statistics)h(to)f(b)s(e)f(prin)m | |
| 5081 | (ted)g(for)g(the)h(pip)s(eline)f(once)h(it)150 3516 y(\014nishes.)51 | |
| 5082 | b(The)34 b(statistics)i(curren)m(tly)e(consist)h(of)f(elapsed)h(\(w)m | |
| 5083 | (all-clo)s(c)m(k\))i(time)e(and)f(user)f(and)h(system)150 | |
| 5084 | 3626 y(time)i(consumed)f(b)m(y)g(the)h(command's)f(execution.)57 | |
| 5085 | b(The)35 b(`)p Fs(-p)p Ft(')h(option)f(c)m(hanges)i(the)f(output)f | |
| 5086 | (format)150 3735 y(to)i(that)f(sp)s(eci\014ed)f(b)m(y)h | |
| 5e13499c | 5087 | Fl(posix)p Ft(.)57 b(The)35 b Fs(TIMEFORMAT)e Ft(v)-5 |
| 37c41ab1 CR |
5088 | b(ariable)37 b(ma)m(y)g(b)s(e)e(set)h(to)h(a)f(format)g(string)g(that) |
| 5089 | 150 3845 y(sp)s(eci\014es)29 b(ho)m(w)g(the)g(timing)g(information)h | |
| 5090 | (should)d(b)s(e)i(displa)m(y)m(ed.)41 b(See)29 b(Section)h(5.2)g([Bash) | |
| 28157acd | 5091 | f(V)-8 b(ariables],)150 3955 y(page)29 b(57,)h(for)e(a)g(description)h |
| 37c41ab1 | 5092 | (of)f(the)g(a)m(v)-5 b(ailable)31 b(formats.)40 b(The)28 |
| 5e13499c | 5093 | b(use)g(of)g Fs(time)f Ft(as)i(a)f(reserv)m(ed)h(w)m(ord)f(p)s(er-)150 |
| 37c41ab1 CR |
5094 | 4064 y(mits)g(the)g(timing)g(of)g(shell)g(builtins,)g(shell)g |
| 5095 | (functions,)g(and)f(pip)s(elines.)40 b(An)27 b(external)i | |
| 5096 | Fs(time)d Ft(command)150 4174 y(cannot)31 b(time)g(these)g(easily)-8 | |
| 5097 | b(.)275 4318 y(If)24 b(the)h(pip)s(eline)g(is)g(not)g(executed)h(async) | |
| 5098 | m(hronously)f(\(see)h(Section)g(3.2.3)h([Lists],)g(page)e(9\),)i(the)f | |
| 5099 | (shell)150 4428 y(w)m(aits)31 b(for)f(all)i(commands)e(in)g(the)g(pip)s | |
| 5100 | (eline)g(to)h(complete.)275 4573 y(Eac)m(h)25 b(command)g(in)g(a)g(pip) | |
| 5101 | s(eline)g(is)g(executed)h(in)f(its)g(o)m(wn)h(subshell)e(\(see)i | |
| 5102 | (Section)g(3.7.3)h([Command)150 4682 y(Execution)36 b(En)m(vironmen)m | |
| 28157acd CR |
5103 | (t],)i(page)e(29\).)58 b(The)36 b(exit)g(status)g(of)g(a)g(pip)s(eline) |
| 5104 | g(is)f(the)h(exit)h(status)f(of)g(the)150 4792 y(last)c(command)f(in)g | |
| 5105 | (the)g(pip)s(eline,)g(unless)g(the)g Fs(pipefail)e Ft(option)j(is)f | |
| 5106 | (enabled)g(\(see)h(Section)g(4.3)g([The)150 4902 y(Set)i(Builtin],)j | |
| 5107 | (page)e(53\).)53 b(If)34 b Fs(pipefail)e Ft(is)i(enabled,)h(the)g(pip)s | |
| 5108 | (eline's)f(return)f(status)h(is)h(the)f(v)-5 b(alue)35 | |
| 5109 | b(of)150 5011 y(the)d(last)h(\(righ)m(tmost\))h(command)e(to)h(exit)g | |
| 5110 | (with)e(a)i(non-zero)f(status,)h(or)f(zero)h(if)f(all)h(commands)f | |
| 5111 | (exit)150 5121 y(successfully)-8 b(.)67 b(If)38 b(the)h(reserv)m(ed)g | |
| 5112 | (w)m(ord)g(`)p Fs(!)p Ft(')g(precedes)g(the)g(pip)s(eline,)h(the)g | |
| 5113 | (exit)f(status)g(is)g(the)g(logical)150 5230 y(negation)h(of)f(the)f | |
| 5114 | (exit)i(status)f(as)f(describ)s(ed)g(ab)s(o)m(v)m(e.)66 | |
| 5115 | b(The)38 b(shell)h(w)m(aits)h(for)e(all)h(commands)g(in)f(the)150 | |
| 5116 | 5340 y(pip)s(eline)30 b(to)h(terminate)g(b)s(efore)f(returning)g(a)h(v) | |
| 5117 | -5 b(alue.)p eop end | |
| 5e13499c | 5118 | %%Page: 9 15 |
| 37c41ab1 CR |
5119 | TeXDict begin 9 14 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 5120 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2292 b(9)150 299 | |
| 5121 | y Fk(3.2.3)63 b(Lists)41 b(of)h(Commands)275 547 y Ft(A)29 | |
| 5122 | b Fs(list)f Ft(is)i(a)f(sequence)h(of)g(one)f(or)h(more)f(pip)s(elines) | |
| 5123 | g(separated)h(b)m(y)f(one)h(of)f(the)h(op)s(erators)g(`)p | |
| 5124 | Fs(;)p Ft(',)g(`)p Fs(&)p Ft(',)150 657 y(`)p Fs(&&)p | |
| 5125 | Ft(',)h(or)f(`)p Fs(||)p Ft(',)g(and)g(optionally)i(terminated)f(b)m(y) | |
| 5126 | f(one)h(of)f(`)p Fs(;)p Ft(',)h(`)p Fs(&)p Ft(',)g(or)f(a)h | |
| 5127 | Fs(newline)p Ft(.)275 795 y(Of)23 b(these)h(list)g(op)s(erators,)i(`)p | |
| 5128 | Fs(&&)p Ft(')d(and)g(`)p Fs(||)p Ft(')h(ha)m(v)m(e)h(equal)f | |
| 5129 | (precedence,)i(follo)m(w)m(ed)f(b)m(y)f(`)p Fs(;)p Ft(')g(and)f(`)p | |
| 5130 | Fs(&)p Ft(',)i(whic)m(h)150 905 y(ha)m(v)m(e)32 b(equal)e(precedence.) | |
| 5131 | 275 1044 y(A)f(sequence)h(of)g(one)g(or)g(more)g(newlines)f(ma)m(y)h | |
| 5132 | (app)s(ear)f(in)h(a)g Fs(list)e Ft(to)j(delimit)f(commands,)g(equiv-) | |
| 5133 | 150 1153 y(alen)m(t)i(to)f(a)g(semicolon.)275 1292 y(If)c(a)h(command)f | |
| 5134 | (is)h(terminated)g(b)m(y)g(the)g(con)m(trol)h(op)s(erator)f(`)p | |
| 5135 | Fs(&)p Ft(',)h(the)e(shell)h(executes)h(the)f(command)150 | |
| 5136 | 1401 y(async)m(hronously)g(in)h(a)g(subshell.)39 b(This)28 | |
| 5137 | b(is)h(kno)m(wn)f(as)h(executing)h(the)f(command)g(in)f(the)h | |
| 5138 | Fq(bac)m(kground)p Ft(.)150 1511 y(The)f(shell)h(do)s(es)f(not)h(w)m | |
| 5139 | (ait)g(for)f(the)h(command)f(to)i(\014nish,)d(and)h(the)h(return)e | |
| 5140 | (status)i(is)g(0)g(\(true\).)40 b(When)150 1621 y(job)g(con)m(trol)h | |
| 5141 | (is)g(not)f(activ)m(e)i(\(see)f(Chapter)f(7)h([Job)f(Con)m(trol],)j | |
| 28157acd | 5142 | (page)e(85\),)j(the)d(standard)e(input)g(for)150 1730 |
| 37c41ab1 CR |
5143 | y(async)m(hronous)k(commands,)k(in)d(the)f(absence)i(of)f(an)m(y)g |
| 5144 | (explicit)h(redirections,)j(is)43 b(redirected)h(from)150 | |
| 5e13499c | 5145 | 1840 y Fs(/dev/null)p Ft(.)275 1979 y(Commands)19 b(separated)j(b)m(y)f |
| 37c41ab1 CR |
5146 | (a)g(`)p Fs(;)p Ft(')g(are)h(executed)g(sequen)m(tially;)k(the)21 |
| 5147 | b(shell)g(w)m(aits)h(for)f(eac)m(h)h(command)150 2088 | |
| 5148 | y(to)31 b(terminate)h(in)e(turn.)39 b(The)30 b(return)f(status)i(is)f | |
| 5149 | (the)h(exit)g(status)g(of)g(the)f(last)h(command)f(executed.)275 | |
| 5150 | 2227 y(The)f(con)m(trol)j(op)s(erators)e(`)p Fs(&&)p | |
| 5151 | Ft(')g(and)g(`)p Fs(||)p Ft(')g(denote)h Fl(and)e Ft(lists)i(and)f | |
| 5152 | Fl(or)f Ft(lists,)i(resp)s(ectiv)m(ely)-8 b(.)43 b(An)30 | |
| 5153 | b Fl(and)150 2336 y Ft(list)h(has)f(the)h(form)390 2475 | |
| 5e13499c | 5154 | y Fj(command1)56 b Fs(&&)47 b Fj(command2)150 2614 y |
| 37c41ab1 CR |
5155 | Fq(command2)38 b Ft(is)30 b(executed)i(if,)e(and)g(only)g(if,)h |
| 5156 | Fq(command1)38 b Ft(returns)29 b(an)h(exit)h(status)g(of)g(zero.)275 | |
| 5157 | 2752 y(An)f Fl(or)f Ft(list)i(has)f(the)h(form)390 2891 | |
| 5e13499c | 5158 | y Fj(command1)56 b Fs(||)47 b Fj(command2)150 3030 y |
| 37c41ab1 CR |
5159 | Fq(command2)38 b Ft(is)30 b(executed)i(if,)e(and)g(only)g(if,)h |
| 5160 | Fq(command1)38 b Ft(returns)29 b(a)i(non-zero)g(exit)g(status.)275 | |
| 5161 | 3168 y(The)h(return)g(status)i(of)f Fl(and)f Ft(and)h | |
| 5162 | Fl(or)f Ft(lists)i(is)f(the)g(exit)h(status)g(of)f(the)g(last)h | |
| 5163 | (command)f(executed)150 3278 y(in)d(the)h(list.)150 3510 | |
| 5164 | y Fk(3.2.4)63 b(Comp)s(ound)42 b(Commands)275 3759 y | |
| 5165 | Ft(Comp)s(ound)e(commands)i(are)h(the)g(shell)g(programming)f | |
| 5e13499c | 5166 | (constructs.)77 b(Eac)m(h)44 b(construct)e(b)s(egins)150 |
| 37c41ab1 CR |
5167 | 3868 y(with)d(a)g(reserv)m(ed)g(w)m(ord)f(or)h(con)m(trol)h(op)s |
| 5168 | (erator)f(and)g(is)g(terminated)g(b)m(y)g(a)g(corresp)s(onding)f | |
| 5169 | (reserv)m(ed)150 3978 y(w)m(ord)k(or)h(op)s(erator.)77 | |
| 5170 | b(An)m(y)42 b(redirections)h(\(see)h(Section)f(3.6)h([Redirections],)j | |
| 9d2b70f0 | 5171 | (page)c(25\))g(asso)s(ciated)150 4087 y(with)26 b(a)g(comp)s(ound)f |
| 37c41ab1 CR |
5172 | (command)h(apply)g(to)h(all)g(commands)f(within)f(that)i(comp)s(ound)e |
| 5173 | (command)h(unless)150 4197 y(explicitly)32 b(o)m(v)m(erridden.)275 | |
| 5174 | 4336 y(Bash)45 b(pro)m(vides)h(lo)s(oping)g(constructs,)j(conditional)e | |
| 5175 | (commands,)j(and)44 b(mec)m(hanisms)i(to)g(group)150 | |
| 5176 | 4445 y(commands)30 b(and)g(execute)i(them)e(as)g(a)h(unit.)150 | |
| 5e13499c | 5177 | 4678 y Fk(3.2.4.1)63 b(Lo)s(oping)43 b(Constructs)275 |
| 37c41ab1 CR |
5178 | 4926 y Ft(Bash)30 b(supp)s(orts)f(the)h(follo)m(wing)i(lo)s(oping)f |
| 5179 | (constructs.)275 5065 y(Note)k(that)f(wherev)m(er)g(a)g(`)p | |
| 5180 | Fs(;)p Ft(')g(app)s(ears)f(in)h(the)g(description)g(of)g(a)g(command's) | |
| 5181 | g(syn)m(tax,)i(it)e(ma)m(y)h(b)s(e)150 5174 y(replaced)c(with)f(one)h | |
| 5182 | (or)f(more)g(newlines.)150 5340 y Fs(until)240 b Ft(The)30 | |
| 5183 | b(syn)m(tax)h(of)f(the)h Fs(until)e Ft(command)h(is:)p | |
| 5184 | eop end | |
| 5e13499c | 5185 | %%Page: 10 16 |
| 37c41ab1 CR |
5186 | TeXDict begin 10 15 bop 150 -116 a Ft(10)2572 b(Bash)31 |
| 5187 | b(Reference)g(Man)m(ual)870 299 y Fs(until)46 b Fj(test-commands)11 | |
| 5188 | b Fs(;)44 b(do)j Fj(consequent-commands)11 b Fs(;)42 | |
| 5189 | b(done)630 434 y Ft(Execute)g Fq(consequen)m(t-commands)k | |
| 5190 | Ft(as)41 b(long)h(as)f Fq(test-commands)46 b Ft(has)41 | |
| 5191 | b(an)g(exit)h(status)630 543 y(whic)m(h)c(is)h(not)g(zero.)67 | |
| 28157acd | 5192 | b(The)38 b(return)f(status)j(is)e(the)h(exit)h(status)f(of)g(the)g |
| 37c41ab1 CR |
5193 | (last)g(command)630 653 y(executed)31 b(in)f Fq(consequen)m(t-commands) |
| 5194 | p Ft(,)i(or)e(zero)h(if)g(none)f(w)m(as)h(executed.)150 | |
| 5e13499c CR |
5195 | 813 y Fs(while)240 b Ft(The)30 b(syn)m(tax)h(of)f(the)h |
| 5196 | Fs(while)e Ft(command)h(is:)870 948 y Fs(while)46 b Fj(test-commands)11 | |
| 5197 | b Fs(;)44 b(do)j Fj(consequent-commands)11 b Fs(;)42 | |
| 5198 | b(done)630 1083 y Ft(Execute)g Fq(consequen)m(t-commands)k | |
| 37c41ab1 CR |
5199 | Ft(as)41 b(long)h(as)f Fq(test-commands)46 b Ft(has)41 |
| 5200 | b(an)g(exit)h(status)630 1193 y(of)34 b(zero.)53 b(The)34 | |
| 5201 | b(return)f(status)h(is)h(the)f(exit)h(status)g(of)f(the)g(last)h | |
| 5202 | (command)f(executed)h(in)630 1302 y Fq(consequen)m(t-commands)p | |
| 5203 | Ft(,)c(or)g(zero)g(if)f(none)g(w)m(as)h(executed.)150 | |
| 5e13499c CR |
5204 | 1463 y Fs(for)336 b Ft(The)30 b(syn)m(tax)h(of)f(the)h |
| 5205 | Fs(for)e Ft(command)i(is:)870 1598 y Fs(for)47 b Fj(name)57 | |
| 5206 | b Fs([in)47 b Fj(words)57 b Fs(...)o(];)47 b(do)g Fj(commands)11 | |
| 5207 | b Fs(;)45 b(done)630 1733 y Ft(Expand)31 b Fq(w)m(ords)p | |
| 5208 | Ft(,)j(and)e(execute)i Fq(commands)i Ft(once)d(for)g(eac)m(h)h(mem)m(b) | |
| 37c41ab1 | 5209 | s(er)e(in)g(the)h(resultan)m(t)630 1842 y(list,)c(with)f |
| 5e13499c | 5210 | Fq(name)33 b Ft(b)s(ound)26 b(to)j(the)f(curren)m(t)g(mem)m(b)s(er.)40 |
| 37c41ab1 | 5211 | b(If)27 b(`)p Fs(in)j Fj(words)11 b Ft(')27 b(is)h(not)g(presen)m(t,)h |
| 5e13499c | 5212 | (the)630 1952 y Fs(for)g Ft(command)g(executes)i(the)e |
| 37c41ab1 CR |
5213 | Fq(commands)k Ft(once)d(for)f(eac)m(h)i(p)s(ositional)f(parameter)g |
| 5214 | (that)630 2061 y(is)d(set,)h(as)f(if)g(`)p Fs(in)j("$@")p | |
| 5215 | Ft(')c(had)g(b)s(een)g(sp)s(eci\014ed)g(\(see)i(Section)f(3.4.2)i([Sp)s | |
| 9d2b70f0 | 5216 | (ecial)e(P)m(arameters],)630 2171 y(page)c(16\).)39 b(The)21 |
| 37c41ab1 CR |
5217 | b(return)g(status)h(is)g(the)g(exit)h(status)f(of)g(the)g(last)g |
| 5218 | (command)g(that)g(executes.)630 2281 y(If)i(there)h(are)h(no)e(items)i | |
| 5219 | (in)e(the)h(expansion)g(of)g Fq(w)m(ords)p Ft(,)h(no)f(commands)f(are)h | |
| 5220 | (executed,)j(and)630 2390 y(the)j(return)e(status)i(is)f(zero.)630 | |
| 5221 | 2525 y(An)g(alternate)i(form)e(of)h(the)f Fs(for)g Ft(command)g(is)g | |
| 5e13499c CR |
5222 | (also)h(supp)s(orted:)870 2660 y Fs(for)47 b(\(\()g Fj(expr1)57 |
| 5223 | b Fs(;)47 b Fj(expr2)57 b Fs(;)48 b Fj(expr3)57 b Fs(\)\))47 | |
| 5224 | b(;)g(do)g Fj(commands)57 b Fs(;)47 b(done)630 2795 y | |
| 37c41ab1 CR |
5225 | Ft(First,)38 b(the)f(arithmetic)h(expression)e Fq(expr1)43 |
| 5226 | b Ft(is)36 b(ev)-5 b(aluated)38 b(according)f(to)g(the)g(rules)f(de-) | |
| 5227 | 630 2905 y(scrib)s(ed)41 b(b)s(elo)m(w)h(\(see)h(Section)g(6.5)g | |
| 28157acd | 5228 | ([Shell)g(Arithmetic],)j(page)d(74\).)77 b(The)42 b(arithmetic)630 |
| 37c41ab1 CR |
5229 | 3014 y(expression)33 b Fq(expr2)41 b Ft(is)34 b(then)f(ev)-5 |
| 5230 | b(aluated)35 b(rep)s(eatedly)f(un)m(til)g(it)g(ev)-5 | |
| 5231 | b(aluates)35 b(to)g(zero.)51 b(Eac)m(h)630 3124 y(time)23 | |
| 5232 | b Fq(expr2)30 b Ft(ev)-5 b(aluates)25 b(to)e(a)g(non-zero)h(v)-5 | |
| 5233 | b(alue,)25 b Fq(commands)h Ft(are)d(executed)g(and)g(the)g(arith-)630 | |
| 5234 | 3233 y(metic)29 b(expression)f Fq(expr3)36 b Ft(is)28 | |
| 5235 | b(ev)-5 b(aluated.)41 b(If)28 b(an)m(y)h(expression)f(is)g(omitted,)i | |
| 5236 | (it)f(b)s(eha)m(v)m(es)g(as)630 3343 y(if)i(it)h(ev)-5 | |
| 5237 | b(aluates)32 b(to)g(1.)44 b(The)30 b(return)g(v)-5 b(alue)32 | |
| 5238 | b(is)f(the)g(exit)h(status)g(of)f(the)g(last)h(command)f(in)630 | |
| 5239 | 3453 y Fq(list)i Ft(that)e(is)f(executed,)i(or)e(false)h(if)g(an)m(y)f | |
| 5240 | (of)h(the)f(expressions)g(is)h(in)m(v)-5 b(alid.)275 | |
| 5241 | 3613 y(The)26 b Fs(break)g Ft(and)h Fs(continue)e Ft(builtins)i(\(see)h | |
| ac18b312 | 5242 | (Section)h(4.1)f([Bourne)g(Shell)f(Builtins],)i(page)f(35\))g(ma)m(y) |
| 37c41ab1 | 5243 | 150 3723 y(b)s(e)i(used)f(to)i(con)m(trol)h(lo)s(op)f(execution.)150 |
| 5e13499c CR |
5244 | 3949 y Fk(3.2.4.2)63 b(Conditional)42 b(Constructs)150 |
| 5245 | 4193 y Fs(if)384 b Ft(The)30 b(syn)m(tax)h(of)f(the)h | |
| 5246 | Fs(if)f Ft(command)g(is:)870 4328 y Fs(if)47 b Fj(test-commands)11 | |
| 5247 | b Fs(;)44 b(then)965 4438 y Fj(consequent-commands)11 | |
| 5248 | b Fs(;)870 4547 y([elif)46 b Fj(more-test-commands)11 | |
| 5249 | b Fs(;)42 b(then)965 4657 y Fj(more-consequents)11 b | |
| 5250 | Fs(;])870 4767 y([else)46 b Fj(alternate-consequents)11 | |
| 5251 | b Fs(;])870 4876 y(fi)630 5011 y Ft(The)53 b Fq(test-commands)58 | |
| 37c41ab1 CR |
5252 | b Ft(list)c(is)g(executed,)60 b(and)53 b(if)g(its)h(return)e(status)i |
| 5253 | (is)f(zero,)61 b(the)630 5121 y Fq(consequen)m(t-commands)44 | |
| 5254 | b Ft(list)d(is)f(executed.)70 b(If)40 b Fq(test-commands)k | |
| 5e13499c | 5255 | Ft(returns)39 b(a)h(non-zero)630 5230 y(status,)45 b(eac)m(h)e |
| 37c41ab1 CR |
5256 | Fs(elif)d Ft(list)i(is)g(executed)h(in)e(turn,)j(and)d(if)g(its)h(exit) |
| 5257 | h(status)f(is)f(zero,)46 b(the)630 5340 y(corresp)s(onding)37 | |
| 5258 | b Fq(more-consequen)m(ts)42 b Ft(is)c(executed)g(and)f(the)h(command)g | |
| 5259 | (completes.)63 b(If)p eop end | |
| 5e13499c | 5260 | %%Page: 11 17 |
| 37c41ab1 CR |
5261 | TeXDict begin 11 16 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 5262 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(11)630 299 | |
| 5263 | y(`)p Fs(else)29 b Fj(alternate-consequents)11 b Ft(')23 | |
| 5264 | b(is)30 b(presen)m(t,)f(and)g(the)g(\014nal)g(command)f(in)h(the)g | |
| 5265 | (\014nal)630 408 y Fs(if)44 b Ft(or)g Fs(elif)f Ft(clause)i(has)f(a)h | |
| 5266 | (non-zero)g(exit)g(status,)j(then)c Fq(alternate-consequen)m(ts)51 | |
| 5267 | b Ft(is)630 518 y(executed.)k(The)34 b(return)g(status)h(is)f(the)h | |
| 5268 | (exit)h(status)f(of)g(the)g(last)g(command)g(executed,)630 | |
| 5269 | 628 y(or)30 b(zero)i(if)e(no)g(condition)h(tested)g(true.)150 | |
| 9d2b70f0 CR |
5270 | 788 y Fs(case)288 b Ft(The)30 b(syn)m(tax)h(of)f(the)h |
| 5271 | Fs(case)e Ft(command)h(is:)870 923 y Fs(case)47 b Fj(word)57 | |
| 5e13499c CR |
5272 | b Fs(in)47 b([)g([\(])g Fj(pattern)57 b Fs([|)47 b Fj(pattern)11 |
| 5273 | b Fs(]...)l(\))48 b Fj(command-list)55 b Fs(;;]...)46 | |
| 28157acd CR |
5274 | b(esac)630 1058 y(case)34 b Ft(will)h(selectiv)m(ely)i(execute)f(the)f |
| 5275 | Fq(command-list)j Ft(corresp)s(onding)33 b(to)j(the)e(\014rst)g | |
| 5276 | Fq(pat-)630 1167 y(tern)g Ft(that)h(matc)m(hes)h Fq(w)m(ord)p | |
| 5277 | Ft(.)52 b(If)34 b(the)g(shell)h(option)g Fs(nocasematch)c | |
| 5278 | Ft(\(see)k(the)g(description)630 1277 y(of)e Fs(shopt)e | |
| 5279 | Ft(in)h(Section)h(4.2)h([Bash)f(Builtins],)g(page)h(41\))f(is)g | |
| 5280 | (enabled,)g(the)g(matc)m(h)g(is)g(p)s(er-)630 1386 y(formed)e(without)h | |
| 5281 | (regard)g(to)h(the)f(case)h(of)f(alphab)s(etic)h(c)m(haracters.)47 | |
| 5282 | b(The)31 b(`)p Fs(|)p Ft(')h(is)g(used)f(to)630 1496 | |
| 5283 | y(separate)25 b(m)m(ultiple)h(patterns,)g(and)d(the)i(`)p | |
| 5284 | Fs(\))p Ft(')g(op)s(erator)f(terminates)i(a)f(pattern)f(list.)40 | |
| 5285 | b(A)24 b(list)630 1606 y(of)32 b(patterns)g(and)f(an)h(asso)s(ciated)h | |
| 5286 | (command-list)g(is)f(kno)m(wn)f(as)h(a)h Fq(clause)p | |
| 5287 | Ft(.)46 b(Eac)m(h)32 b(clause)630 1715 y(m)m(ust)d(b)s(e)f(terminated)h | |
| 5288 | (with)g(`)p Fs(;;)p Ft('.)40 b(The)28 b Fq(w)m(ord)k | |
| 5289 | Ft(undergo)s(es)c(tilde)h(expansion,)g(parameter)630 | |
| 5290 | 1825 y(expansion,)c(command)f(substitution,)h(arithmetic)g(expansion,)g | |
| 5291 | (and)e(quote)h(remo)m(v)-5 b(al)25 b(b)s(e-)630 1934 | |
| 5292 | y(fore)e(matc)m(hing)i(is)e(attempted.)39 b(Eac)m(h)24 | |
| 5293 | b Fq(pattern)f Ft(undergo)s(es)g(tilde)h(expansion,)g(parameter)630 | |
| 5294 | 2044 y(expansion,)30 b(command)h(substitution,)f(and)g(arithmetic)h | |
| 5295 | (expansion.)630 2179 y(There)f(ma)m(y)g(b)s(e)f(an)h(arbitrary)g(n)m | |
| 5296 | (um)m(b)s(er)f(of)h Fs(case)f Ft(clauses,)i(eac)m(h)g(terminated)g(b)m | |
| 5297 | (y)e(a)i(`)p Fs(;;)p Ft('.)630 2288 y(The)f(\014rst)f(pattern)i(that)g | |
| 5298 | (matc)m(hes)g(determines)g(the)f(command-list)i(that)f(is)f(executed.) | |
| 5299 | 630 2423 y(Here)35 b(is)g(an)g(example)h(using)e Fs(case)g | |
| 9d2b70f0 CR |
5300 | Ft(in)g(a)h(script)g(that)h(could)f(b)s(e)f(used)g(to)h(describ)s(e)g |
| 5301 | (one)630 2533 y(in)m(teresting)d(feature)f(of)f(an)g(animal:)870 | |
| 5302 | 2668 y Fs(echo)47 b(-n)g("Enter)f(the)h(name)f(of)i(an)f(animal:)f(") | |
| 5303 | 870 2777 y(read)h(ANIMAL)870 2887 y(echo)g(-n)g("The)f($ANIMAL)g(has)h | |
| 5304 | (")870 2996 y(case)g($ANIMAL)e(in)965 3106 y(horse)i(|)g(dog)g(|)h | |
| 5305 | (cat\))e(echo)h(-n)g("four";;)965 3216 y(man)g(|)h(kangaroo)d(\))j | |
| 5306 | (echo)e(-n)i("two";;)965 3325 y(*\))g(echo)e(-n)h("an)g(unknown)f | |
| 5307 | (number)g(of";;)870 3435 y(esac)870 3544 y(echo)h(")g(legs.")630 | |
| 5308 | 3679 y Ft(The)26 b(return)f(status)h(is)g(zero)h(if)f(no)g | |
| 37c41ab1 | 5309 | Fq(pattern)g Ft(is)g(matc)m(hed.)40 b(Otherwise,)27 b(the)g(return)e |
| 9d2b70f0 CR |
5310 | (status)630 3789 y(is)30 b(the)h(exit)g(status)g(of)f(the)h |
| 5311 | Fq(command-list)i Ft(executed.)150 3949 y Fs(select)630 | |
| 5312 | 4084 y Ft(The)g Fs(select)f Ft(construct)i(allo)m(ws)h(the)f(easy)g | |
| 37c41ab1 | 5313 | (generation)h(of)e(men)m(us.)50 b(It)34 b(has)f(almost)i(the)630 |
| 9d2b70f0 CR |
5314 | 4194 y(same)c(syn)m(tax)g(as)f(the)h Fs(for)e Ft(command:)870 |
| 5315 | 4328 y Fs(select)46 b Fj(name)57 b Fs([in)47 b Fj(words)57 | |
| 5e13499c | 5316 | b Fs(...)o(];)47 b(do)h Fj(commands)11 b Fs(;)44 b(done)630 |
| 9d2b70f0 | 5317 | 4463 y Ft(The)d(list)i(of)e(w)m(ords)h(follo)m(wing)h |
| 37c41ab1 | 5318 | Fs(in)e Ft(is)h(expanded,)i(generating)f(a)f(list)g(of)g(items.)75 |
| 9d2b70f0 | 5319 | b(The)630 4573 y(set)41 b(of)f(expanded)f(w)m(ords)g(is)i(prin)m(ted)e |
| 37c41ab1 | 5320 | (on)h(the)g(standard)f(error)h(output)g(stream,)j(eac)m(h)630 |
| 9d2b70f0 | 5321 | 4682 y(preceded)30 b(b)m(y)g(a)h(n)m(um)m(b)s(er.)40 |
| 37c41ab1 | 5322 | b(If)29 b(the)i(`)p Fs(in)f Fj(words)11 b Ft(')29 b(is)h(omitted,)i |
| 28157acd CR |
5323 | (the)e(p)s(ositional)i(parameters)630 4792 y(are)24 b(prin)m(ted,)g(as) |
| 5324 | g(if)f(`)p Fs(in)30 b("$@")p Ft(')23 b(had)f(b)s(een)h(sp)s(ecifed.)38 | |
| 5325 | b(The)23 b Fs(PS3)f Ft(prompt)h(is)g(then)g(displa)m(y)m(ed)630 | |
| 9d2b70f0 | 5326 | 4902 y(and)38 b(a)h(line)g(is)f(read)h(from)f(the)h(standard)e(input.) |
| 37c41ab1 | 5327 | 65 b(If)38 b(the)h(line)g(consists)g(of)f(a)h(n)m(um)m(b)s(er)630 |
| 9d2b70f0 | 5328 | 5011 y(corresp)s(onding)33 b(to)i(one)f(of)g(the)g(displa)m(y)m(ed)h(w) |
| 37c41ab1 | 5329 | m(ords,)f(then)g(the)g(v)-5 b(alue)34 b(of)h Fq(name)k |
| 9d2b70f0 | 5330 | Ft(is)34 b(set)g(to)630 5121 y(that)g(w)m(ord.)49 b(If)32 |
| 37c41ab1 | 5331 | b(the)i(line)f(is)h(empt)m(y)-8 b(,)35 b(the)e(w)m(ords)g(and)f(prompt) |
| 9d2b70f0 | 5332 | h(are)g(displa)m(y)m(ed)h(again.)50 b(If)630 5230 y Fs(EOF)23 |
| 37c41ab1 CR |
5333 | b Ft(is)g(read,)j(the)d Fs(select)f Ft(command)i(completes.)40 |
| 5334 | b(An)m(y)23 b(other)h(v)-5 b(alue)24 b(read)g(causes)g | |
| 9d2b70f0 | 5335 | Fq(name)630 5340 y Ft(to)31 b(b)s(e)f(set)h(to)g(n)m(ull.)41 |
| 37c41ab1 | 5336 | b(The)29 b(line)i(read)f(is)h(sa)m(v)m(ed)g(in)f(the)h(v)-5 |
| 9d2b70f0 | 5337 | b(ariable)31 b Fs(REPLY)p Ft(.)p eop end |
| 5e13499c | 5338 | %%Page: 12 18 |
| 37c41ab1 | 5339 | TeXDict begin 12 17 bop 150 -116 a Ft(12)2572 b(Bash)31 |
| 9d2b70f0 CR |
5340 | b(Reference)g(Man)m(ual)630 299 y(The)42 b Fq(commands)j |
| 5341 | Ft(are)d(executed)h(after)g(eac)m(h)g(selection)h(un)m(til)e(a)h | |
| 5342 | Fs(break)d Ft(command)i(is)630 408 y(executed,)32 b(at)f(whic)m(h)f(p)s | |
| 5343 | (oin)m(t)g(the)h Fs(select)d Ft(command)i(completes.)630 | |
| 5344 | 542 y(Here)39 b(is)g(an)g(example)h(that)f(allo)m(ws)i(the)e(user)f(to) | |
| 5345 | i(pic)m(k)f(a)g(\014lename)h(from)e(the)h(curren)m(t)630 | |
| 5346 | 651 y(directory)-8 b(,)32 b(and)d(displa)m(ys)i(the)f(name)h(and)f | |
| 5347 | (index)f(of)i(the)g(\014le)f(selected.)870 784 y Fs(select)46 | |
| 5348 | b(fname)g(in)i(*;)870 894 y(do)870 1003 y(echo)f(you)g(picked)f($fname) | |
| 5349 | g(\\\($REPLY\\\))870 1113 y(break;)870 1223 y(done)150 | |
| 5350 | 1379 y(\(\(...)o(\)\))870 1512 y(\(\()h Fj(expression)56 | |
| 5351 | b Fs(\)\))630 1645 y Ft(The)33 b(arithmetic)i Fq(expression)f | |
| 5352 | Ft(is)f(ev)-5 b(aluated)35 b(according)g(to)f(the)g(rules)f(describ)s | |
| 5353 | (ed)g(b)s(elo)m(w)630 1755 y(\(see)j(Section)f(6.5)h([Shell)f | |
| 28157acd | 5354 | (Arithmetic],)i(page)f(74\).)55 b(If)34 b(the)h(v)-5 |
| 9d2b70f0 CR |
5355 | b(alue)35 b(of)g(the)g(expression)g(is)630 1864 y(non-zero,)27 |
| 5356 | b(the)f(return)e(status)i(is)g(0;)h(otherwise)f(the)g(return)e(status)i | |
| 5357 | (is)g(1.)39 b(This)25 b(is)g(exactly)630 1974 y(equiv)-5 | |
| 5358 | b(alen)m(t)32 b(to)870 2107 y Fs(let)47 b(")p Fj(expression)11 | |
| 5359 | b Fs(")630 2240 y Ft(See)25 b(Section)h(4.2)h([Bash)e(Builtins],)i | |
| ac18b312 | 5360 | (page)f(41,)i(for)c(a)i(full)f(description)g(of)g(the)h |
| 9d2b70f0 CR |
5361 | Fs(let)e Ft(builtin.)150 2397 y Fs([[...)o(]])870 2530 |
| 5362 | y([[)47 b Fj(expression)56 b Fs(]])630 2663 y Ft(Return)25 | |
| 37c41ab1 CR |
5363 | b(a)h(status)f(of)h(0)g(or)g(1)g(dep)s(ending)e(on)h(the)h(ev)-5 |
| 5364 | b(aluation)27 b(of)e(the)h(conditional)h(expres-)630 | |
| 9d2b70f0 | 5365 | 2772 y(sion)j Fq(expression)p Ft(.)41 b(Expressions)29 |
| 37c41ab1 | 5366 | b(are)i(comp)s(osed)f(of)g(the)h(primaries)f(describ)s(ed)f(b)s(elo)m |
| 9d2b70f0 | 5367 | (w)h(in)630 2882 y(Section)36 b(6.4)h([Bash)f(Conditional)g |
| 28157acd | 5368 | (Expressions],)h(page)f(73.)57 b(W)-8 b(ord)36 b(splitting)h(and)e |
| 9d2b70f0 | 5369 | (\014le-)630 2992 y(name)24 b(expansion)h(are)g(not)f(p)s(erformed)f |
| 5e13499c | 5370 | (on)h(the)h(w)m(ords)f(b)s(et)m(w)m(een)h(the)g(`)p Fs([[)p |
| 9d2b70f0 | 5371 | Ft(')f(and)g(`)p Fs(]])p Ft(';)i(tilde)630 3101 y(expansion,)31 |
| 37c41ab1 | 5372 | b(parameter)g(and)f(v)-5 b(ariable)31 b(expansion,)g(arithmetic)g |
| 9d2b70f0 | 5373 | (expansion,)g(command)630 3211 y(substitution,)40 b(pro)s(cess)f |
| 37c41ab1 | 5374 | (substitution,)h(and)e(quote)h(remo)m(v)-5 b(al)40 b(are)f(p)s |
| 9d2b70f0 | 5375 | (erformed.)63 b(Condi-)630 3320 y(tional)32 b(op)s(erators)e(suc)m(h)g |
| 5e13499c | 5376 | (as)h(`)p Fs(-f)p Ft(')f(m)m(ust)g(b)s(e)g(unquoted)g(to)h(b)s(e)e |
| 9d2b70f0 | 5377 | (recognized)j(as)f(primaries.)630 3453 y(When)22 b(the)h(`)p |
| 5e13499c | 5378 | Fs(==)p Ft(')f(and)g(`)p Fs(!=)p Ft(')g(op)s(erators)h(are)g(used,)g |
| 37c41ab1 | 5379 | (the)g(string)f(to)i(the)e(righ)m(t)h(of)g(the)g(op)s(erator)630 |
| 9d2b70f0 | 5380 | 3563 y(is)31 b(considered)g(a)h(pattern)f(and)g(matc)m(hed)h(according) |
| 37c41ab1 | 5381 | g(to)g(the)g(rules)f(describ)s(ed)f(b)s(elo)m(w)h(in)630 |
| 28157acd | 5382 | 3673 y(Section)37 b(3.5.8.1)i([P)m(attern)e(Matc)m(hing],)j(page)c(23.) |
| 9d2b70f0 | 5383 | 59 b(If)36 b(the)g(shell)g(option)h Fs(nocasematch)630 |
| 28157acd CR |
5384 | 3782 y Ft(\(see)27 b(the)e(description)h(of)g Fs(shopt)e |
| 5385 | Ft(in)h(Section)i(4.2)f([Bash)g(Builtins],)i(page)e(41\))h(is)f | |
| 5386 | (enabled,)630 3892 y(the)40 b(matc)m(h)h(is)f(p)s(erformed)f(without)h | |
| 5387 | (regard)g(to)h(the)f(case)h(of)g(alphab)s(etic)f(c)m(haracters.)630 | |
| 5388 | 4001 y(The)34 b(return)g(v)-5 b(alue)35 b(is)g(0)g(if)f(the)h(string)g | |
| 5389 | (matc)m(hes)g(\(`)p Fs(==)p Ft('\))h(or)e(do)s(es)h(not)g(matc)m(h)g | |
| 5390 | (\(`)p Fs(!=)p Ft('\)the)630 4111 y(pattern,)30 b(and)e(1)h(otherwise.) | |
| 5391 | 41 b(An)m(y)29 b(part)g(of)g(the)g(pattern)g(ma)m(y)g(b)s(e)g(quoted)g | |
| 5392 | (to)g(force)h(it)f(to)630 4221 y(b)s(e)h(matc)m(hed)h(as)g(a)f(string.) | |
| 5393 | 630 4354 y(An)j(additional)i(binary)e(op)s(erator,)i(`)p | |
| 37c41ab1 | 5394 | Fs(=~)p Ft(',)g(is)f(a)m(v)-5 b(ailable,)37 b(with)c(the)h(same)g |
| 9d2b70f0 | 5395 | (precedence)h(as)630 4463 y(`)p Fs(==)p Ft(')29 b(and)f(`)p |
| 37c41ab1 CR |
5396 | Fs(!=)p Ft('.)40 b(When)29 b(it)g(is)g(used,)f(the)h(string)g(to)h(the) |
| 5397 | e(righ)m(t)i(of)f(the)g(op)s(erator)g(is)g(consid-)630 | |
| 9d2b70f0 | 5398 | 4573 y(ered)34 b(an)g(extended)g(regular)g(expression)g(and)f(matc)m |
| 37c41ab1 | 5399 | (hed)i(accordingly)g(\(as)f(in)g Fm(r)-5 b(e)g(gex)11 |
| 28157acd CR |
5400 | b Ft(3\)\).)630 4682 y(The)39 b(return)f(v)-5 b(alue)40 |
| 5401 | b(is)f(0)h(if)f(the)g(string)h(matc)m(hes)g(the)f(pattern,)j(and)d(1)h | |
| 5402 | (otherwise.)67 b(If)630 4792 y(the)26 b(regular)g(expression)g(is)g | |
| 5403 | (syn)m(tactically)j(incorrect,)f(the)e(conditional)h(expression's)f | |
| 5404 | (re-)630 4902 y(turn)32 b(v)-5 b(alue)34 b(is)f(2.)49 | |
| 5405 | b(If)33 b(the)g(shell)g(option)h Fs(nocasematch)c Ft(\(see)k(the)f | |
| 5406 | (description)g(of)g Fs(shopt)630 5011 y Ft(in)43 b(Section)h(4.2)g | |
| 5407 | ([Bash)f(Builtins],)k(page)d(41\))g(is)f(enabled,)j(the)e(matc)m(h)f | |
| 5408 | (is)g(p)s(erformed)630 5121 y(without)d(regard)g(to)h(the)f(case)h(of)g | |
| 37c41ab1 | 5409 | (alphab)s(etic)f(c)m(haracters.)72 b(Substrings)38 b(matc)m(hed)j(b)m |
| 9d2b70f0 | 5410 | (y)630 5230 y(paren)m(thesized)j(sub)s(expressions)e(within)i(the)g |
| 37c41ab1 | 5411 | (regular)g(expression)g(are)g(sa)m(v)m(ed)h(in)f(the)630 |
| 9d2b70f0 | 5412 | 5340 y(arra)m(y)38 b(v)-5 b(ariable)38 b Fs(BASH_REMATCH)p |
| 37c41ab1 | 5413 | Ft(.)59 b(The)36 b(elemen)m(t)j(of)f Fs(BASH_REMATCH)c |
| 9d2b70f0 | 5414 | Ft(with)j(index)g(0)h(is)p eop end |
| 5e13499c | 5415 | %%Page: 13 19 |
| 37c41ab1 CR |
5416 | TeXDict begin 13 18 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 5417 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(13)630 299 | |
| 9d2b70f0 CR |
5418 | y(the)34 b(p)s(ortion)f(of)h(the)f(string)h(matc)m(hing)g(the)g(en)m |
| 5419 | (tire)h(regular)e(expression.)50 b(The)33 b(elemen)m(t)630 | |
| 5420 | 408 y(of)39 b Fs(BASH_REMATCH)c Ft(with)j(index)g Fq(n)f | |
| 5421 | Ft(is)i(the)f(p)s(ortion)g(of)h(the)f(string)h(matc)m(hing)g(the)g | |
| 5422 | Fq(n)p Ft(th)630 518 y(paren)m(thesized)31 b(sub)s(expression.)630 | |
| 5423 | 662 y(Expressions)23 b(ma)m(y)h(b)s(e)e(com)m(bined)i(using)f(the)h | |
| 5424 | (follo)m(wing)h(op)s(erators,)g(listed)f(in)f(decreasing)630 | |
| 5425 | 772 y(order)30 b(of)g(precedence:)630 950 y Fs(\()g Fj(expression)38 | |
| 5426 | b Fs(\))1110 1060 y Ft(Returns)30 b(the)h(v)-5 b(alue)31 | |
| 5427 | b(of)g Fq(expression)p Ft(.)42 b(This)30 b(ma)m(y)i(b)s(e)e(used)g(to)i | |
| 5428 | (o)m(v)m(erride)g(the)1110 1170 y(normal)e(precedence)h(of)g(op)s | |
| 5429 | (erators.)630 1348 y Fs(!)f Fj(expression)1110 1458 y | |
| 5430 | Ft(T)-8 b(rue)30 b(if)g Fq(expression)g Ft(is)h(false.)630 | |
| 5431 | 1637 y Fj(expression1)38 b Fs(&&)30 b Fj(expression2)1110 | |
| 5432 | 1746 y Ft(T)-8 b(rue)30 b(if)g(b)s(oth)g Fq(expression1)38 | |
| 5433 | b Ft(and)29 b Fq(expression2)38 b Ft(are)31 b(true.)630 | |
| 5434 | 1925 y Fj(expression1)38 b Fs(||)30 b Fj(expression2)1110 | |
| 5435 | 2034 y Ft(T)-8 b(rue)30 b(if)g(either)h Fq(expression1)38 | |
| 5436 | b Ft(or)30 b Fq(expression2)38 b Ft(is)30 b(true.)630 | |
| 5437 | 2213 y(The)25 b Fs(&&)g Ft(and)g Fs(||)f Ft(op)s(erators)i(do)f(not)h | |
| 5438 | (ev)-5 b(aluate)27 b Fq(expression2)33 b Ft(if)26 b(the)f(v)-5 | |
| 5439 | b(alue)26 b(of)g Fq(expression1)630 2323 y Ft(is)k(su\016cien)m(t)h(to) | |
| 5440 | g(determine)g(the)f(return)g(v)-5 b(alue)31 b(of)f(the)h(en)m(tire)g | |
| 5441 | (conditional)h(expression.)150 2585 y Fk(3.2.4.3)63 b(Grouping)43 | |
| 5442 | b(Commands)275 2849 y Ft(Bash)22 b(pro)m(vides)g(t)m(w)m(o)h(w)m(a)m | |
| 5443 | (ys)g(to)g(group)f(a)g(list)h(of)f(commands)g(to)g(b)s(e)g(executed)h | |
| 5444 | (as)f(a)h(unit.)37 b(When)22 b(com-)150 2958 y(mands)30 | |
| 5445 | b(are)i(group)s(ed,)f(redirections)h(ma)m(y)g(b)s(e)e(applied)i(to)g | |
| 5446 | (the)f(en)m(tire)h(command)g(list.)44 b(F)-8 b(or)32 | |
| 5447 | b(example,)150 3068 y(the)f(output)f(of)g(all)h(the)g(commands)f(in)g | |
| 5448 | (the)h(list)g(ma)m(y)g(b)s(e)e(redirected)i(to)g(a)g(single)g(stream.) | |
| 5449 | 150 3256 y Fs(\(\))870 3400 y(\()47 b Fj(list)58 b Fs(\))630 | |
| 5450 | 3545 y Ft(Placing)30 b(a)f(list)g(of)g(commands)f(b)s(et)m(w)m(een)i | |
| 5451 | (paren)m(theses)e(causes)i(a)f(subshell)e(en)m(vironmen)m(t)630 | |
| 5452 | 3654 y(to)k(b)s(e)e(created)j(\(see)f(Section)g(3.7.3)h([Command)d | |
| 28157acd | 5453 | (Execution)i(En)m(vironmen)m(t],)g(page)f(29\),)630 3764 |
| 37c41ab1 CR |
5454 | y(and)d(eac)m(h)i(of)e(the)h(commands)f(in)g Fq(list)j |
| 5455 | Ft(to)f(b)s(e)e(executed)h(in)f(that)h(subshell.)39 b(Since)28 | |
| 9d2b70f0 | 5456 | b(the)f Fq(list)630 3873 y Ft(is)i(executed)g(in)f(a)h(subshell,)g(v)-5 |
| 37c41ab1 | 5457 | b(ariable)29 b(assignmen)m(ts)g(do)g(not)g(remain)f(in)g(e\013ect)j |
| 9d2b70f0 CR |
5458 | (after)e(the)630 3983 y(subshell)g(completes.)150 4162 |
| 5459 | y Fs({})870 4306 y({)47 b Fj(list)11 b Fs(;)46 b(})630 | |
| 5460 | 4450 y Ft(Placing)30 b(a)g(list)g(of)g(commands)f(b)s(et)m(w)m(een)h | |
| 37c41ab1 | 5461 | (curly)f(braces)g(causes)h(the)f(list)h(to)g(b)s(e)f(executed)630 |
| 9d2b70f0 | 5462 | 4560 y(in)d(the)h(curren)m(t)g(shell)f(con)m(text.)42 |
| 37c41ab1 | 5463 | b(No)27 b(subshell)f(is)g(created.)41 b(The)26 b(semicolon)i(\(or)f |
| 9d2b70f0 CR |
5464 | (newline\))630 4669 y(follo)m(wing)32 b Fq(list)h Ft(is)d(required.)275 |
| 5465 | 4857 y(In)i(addition)h(to)g(the)g(creation)i(of)e(a)g(subshell,)g | |
| 37c41ab1 | 5466 | (there)g(is)g(a)g(subtle)f(di\013erence)i(b)s(et)m(w)m(een)f(these)h(t) |
| 9d2b70f0 | 5467 | m(w)m(o)150 4967 y(constructs)43 b(due)f(to)h(historical)h(reasons.)77 |
| 5e13499c | 5468 | b(The)42 b(braces)h(are)g Fs(reserved)28 b(words)p Ft(,)45 |
| 9d2b70f0 | 5469 | b(so)d(they)h(m)m(ust)g(b)s(e)150 5077 y(separated)33 |
| 37c41ab1 | 5470 | b(from)f(the)g Fq(list)k Ft(b)m(y)c Fs(blank)p Ft(s.)45 |
| 5e13499c | 5471 | b(The)32 b(paren)m(theses)h(are)g Fs(operators)p Ft(,)d(and)i(are)h |
| 9d2b70f0 | 5472 | (recognized)h(as)150 5186 y(separate)d(tok)m(ens)h(b)m(y)e(the)h(shell) |
| 37c41ab1 | 5473 | f(ev)m(en)h(if)f(they)h(are)g(not)f(separated)h(from)f(the)h |
| 9d2b70f0 | 5474 | Fq(list)i Ft(b)m(y)d(whitespace.)275 5340 y(The)f(exit)j(status)e(of)h |
| 37c41ab1 | 5475 | (b)s(oth)f(of)g(these)h(constructs)g(is)f(the)h(exit)g(status)f(of)h |
| 9d2b70f0 | 5476 | Fq(list)p Ft(.)p eop end |
| 5e13499c | 5477 | %%Page: 14 20 |
| 37c41ab1 | 5478 | TeXDict begin 14 19 bop 150 -116 a Ft(14)2572 b(Bash)31 |
| 9d2b70f0 CR |
5479 | b(Reference)g(Man)m(ual)150 299 y Fr(3.3)68 b(Shell)45 |
| 5480 | b(F)-11 b(unctions)275 555 y Ft(Shell)27 b(functions)g(are)g(a)h(w)m(a) | |
| 5481 | m(y)g(to)g(group)f(commands)g(for)g(later)i(execution)f(using)f(a)h | |
| 5482 | (single)g(name)f(for)150 664 y(the)35 b(group.)55 b(They)35 | |
| 5483 | b(are)g(executed)h(just)f(lik)m(e)h(a)g Fs(")p Ft(regular)p | |
| 5484 | Fs(")f Ft(command.)54 b(When)35 b(the)h(name)f(of)g(a)h(shell)150 | |
| 5485 | 774 y(function)j(is)g(used)f(as)h(a)h(simple)f(command)g(name,)i(the)e | |
| 5486 | (list)h(of)f(commands)g(asso)s(ciated)i(with)d(that)150 | |
| 5487 | 883 y(function)25 b(name)h(is)g(executed.)40 b(Shell)25 | |
| 5488 | b(functions)g(are)i(executed)f(in)f(the)h(curren)m(t)g(shell)g(con)m | |
| 5489 | (text;)j(no)c(new)150 993 y(pro)s(cess)30 b(is)g(created)i(to)f(in)m | |
| 5490 | (terpret)g(them.)275 1139 y(F)-8 b(unctions)30 b(are)h(declared)g | |
| 5491 | (using)f(this)g(syn)m(tax:)390 1285 y Fs([)47 b(function)f(])h | |
| 37c41ab1 | 5492 | Fj(name)58 b Fs(\(\))47 b Fj(compound-command)54 b Fs([)47 |
| 9d2b70f0 | 5493 | b Fj(redirections)55 b Fs(])275 1431 y Ft(This)31 b(de\014nes)h(a)h |
| 37c41ab1 CR |
5494 | (shell)g(function)g(named)f Fq(name)p Ft(.)48 b(The)32 |
| 5495 | b(reserv)m(ed)h(w)m(ord)f Fs(function)f Ft(is)h(optional.)49 | |
| 9d2b70f0 | 5496 | b(If)150 1541 y(the)39 b Fs(function)f Ft(reserv)m(ed)h(w)m(ord)g(is)g |
| 37c41ab1 | 5497 | (supplied,)i(the)e(paren)m(theses)h(are)f(optional.)69 |
| 9d2b70f0 | 5498 | b(The)39 b Fq(b)s(o)s(dy)45 b Ft(of)40 b(the)150 1650 |
| 37c41ab1 | 5499 | y(function)h(is)h(the)g(comp)s(ound)e(command)h Fq(comp)s(ound-command) |
| 9d2b70f0 CR |
5500 | j Ft(\(see)e(Section)h(3.2.4)g([Comp)s(ound)150 1760 |
| 5501 | y(Commands],)33 b(page)g(9\).)48 b(That)33 b(command)g(is)f(usually)h | |
| 5502 | (a)g Fq(list)i Ft(enclosed)e(b)s(et)m(w)m(een)h Fs({)e | |
| 5503 | Ft(and)g Fs(})p Ft(,)h(but)f(ma)m(y)150 1870 y(b)s(e)27 | |
| 5504 | b(an)m(y)h(comp)s(ound)e(command)h(listed)h(ab)s(o)m(v)m(e.)41 | |
| 5505 | b Fq(comp)s(ound-command)30 b Ft(is)e(executed)g(whenev)m(er)g | |
| 5506 | Fq(name)150 1979 y Ft(is)37 b(sp)s(eci\014ed)g(as)g(the)h(name)f(of)g | |
| 5507 | (a)h(command.)61 b(An)m(y)37 b(redirections)h(\(see)g(Section)g(3.6)g | |
| 5508 | ([Redirections],)150 2089 y(page)31 b(25\))h(asso)s(ciated)g(with)e | |
| 5509 | (the)g(shell)h(function)f(are)h(p)s(erformed)d(when)i(the)g(function)g | |
| ac18b312 CR |
5510 | (is)h(executed.)275 2235 y(A)41 b(function)f(de\014nition)h(ma)m(y)g(b) |
| 5511 | s(e)g(deleted)g(using)g(the)g(`)p Fs(-f)p Ft(')g(option)g(to)h(the)f | |
| 5512 | Fs(unset)e Ft(builtin)i(\(see)150 2345 y(Section)31 b(4.1)h([Bourne)e | |
| 5513 | (Shell)g(Builtins],)h(page)h(35\).)275 2491 y(The)26 | |
| 5514 | b(exit)i(status)g(of)f(a)h(function)f(de\014nition)g(is)g(zero)h | |
| 5515 | (unless)f(a)g(syn)m(tax)h(error)f(o)s(ccurs)g(or)g(a)h(readonly)150 | |
| 5516 | 2600 y(function)k(with)f(the)i(same)f(name)g(already)h(exists.)46 | |
| 5517 | b(When)32 b(executed,)h(the)f(exit)h(status)g(of)f(a)g(function)150 | |
| 5518 | 2710 y(is)e(the)h(exit)g(status)g(of)f(the)h(last)g(command)f(executed) | |
| 5519 | i(in)e(the)g(b)s(o)s(dy)-8 b(.)275 2856 y(Note)22 b(that)f(for)f | |
| 5520 | (historical)i(reasons,)h(in)e(the)g(most)g(common)g(usage)g(the)g | |
| 5521 | (curly)f(braces)h(that)g(surround)150 2966 y(the)38 b(b)s(o)s(dy)d(of)j | |
| 5522 | (the)f(function)g(m)m(ust)g(b)s(e)g(separated)h(from)f(the)g(b)s(o)s | |
| 5523 | (dy)f(b)m(y)h Fs(blank)p Ft(s)f(or)h(newlines.)62 b(This)150 | |
| 5524 | 3075 y(is)38 b(b)s(ecause)g(the)h(braces)f(are)h(reserv)m(ed)f(w)m | |
| 5525 | (ords)g(and)f(are)i(only)f(recognized)i(as)e(suc)m(h)g(when)f(they)i | |
| 5526 | (are)150 3185 y(separated)e(b)m(y)g(whitespace.)61 b(Also,)39 | |
| 5527 | b(when)d(using)g(the)h(braces,)i(the)e Fq(list)j Ft(m)m(ust)c(b)s(e)g | |
| 5528 | (terminated)i(b)m(y)f(a)150 3294 y(semicolon,)32 b(a)f(`)p | |
| 5529 | Fs(&)p Ft(',)f(or)h(a)g(newline.)275 3440 y(When)h(a)i(function)f(is)g | |
| 5530 | (executed,)i(the)e(argumen)m(ts)h(to)g(the)f(function)g(b)s(ecome)g | |
| 5531 | (the)h(p)s(ositional)g(pa-)150 3550 y(rameters)42 b(during)e(its)i | |
| 5532 | (execution)h(\(see)f(Section)g(3.4.1)h([P)m(ositional)h(P)m | |
| 5533 | (arameters],)i(page)c(15\).)75 b(The)150 3660 y(sp)s(ecial)37 | |
| 5534 | b(parameter)f(`)p Fs(#)p Ft(')g(that)h(expands)e(to)i(the)f(n)m(um)m(b) | |
| 5535 | s(er)f(of)h(p)s(ositional)h(parameters)f(is)g(up)s(dated)f(to)150 | |
| 5536 | 3769 y(re\015ect)h(the)f(c)m(hange.)56 b(Sp)s(ecial)35 | |
| 5537 | b(parameter)h Fs(0)f Ft(is)g(unc)m(hanged.)54 b(The)35 | |
| 5538 | b(\014rst)f(elemen)m(t)j(of)e(the)g Fs(FUNCNAME)150 3879 | |
| 5539 | y Ft(v)-5 b(ariable)27 b(is)g(set)g(to)h(the)f(name)f(of)h(the)g | |
| 5540 | (function)f(while)h(the)g(function)f(is)h(executing.)40 | |
| 5541 | b(All)28 b(other)f(asp)s(ects)150 3988 y(of)32 b(the)g(shell)g | |
| 5542 | (execution)i(en)m(vironmen)m(t)e(are)h(iden)m(tical)g(b)s(et)m(w)m(een) | |
| 5543 | g(a)f(function)g(and)f(its)i(caller)g(with)f(the)150 | |
| 5544 | 4098 y(exception)h(that)f(the)g Fs(DEBUG)f Ft(and)g Fs(RETURN)f | |
| 5545 | Ft(traps)h(are)h(not)g(inherited)g(unless)f(the)h(function)f(has)h(b)s | |
| 5546 | (een)150 4208 y(giv)m(en)h(the)f Fs(trace)e Ft(attribute)j(using)e(the) | |
| 5547 | h Fs(declare)e Ft(builtin)h(or)h(the)g Fs(-o)e(functrace)f | |
| 5548 | Ft(option)j(has)g(b)s(een)150 4317 y(enabled)39 b(with)f(the)h | |
| 5549 | Fs(set)e Ft(builtin,)k(\(in)e(whic)m(h)f(case)i(all)f(functions)f | |
| 5550 | (inherit)h(the)f Fs(DEBUG)g Ft(and)g Fs(RETURN)150 4427 | |
| 5551 | y Ft(traps\).)66 b(See)40 b(Section)f(4.1)h([Bourne)f(Shell)g | |
| 5552 | (Builtins],)j(page)e(35,)i(for)d(the)g(description)g(of)g(the)g | |
| 5553 | Fs(trap)150 4536 y Ft(builtin.)275 4682 y(If)e(the)g(builtin)g(command) | |
| 5554 | h Fs(return)d Ft(is)j(executed)g(in)g(a)g(function,)h(the)e(function)h | |
| 5555 | (completes)h(and)150 4792 y(execution)25 b(resumes)e(with)h(the)g(next) | |
| 5556 | g(command)f(after)i(the)f(function)f(call.)40 b(An)m(y)24 | |
| 5557 | b(command)f(asso)s(ciated)150 4902 y(with)36 b(the)h | |
| 5558 | Fs(RETURN)d Ft(trap)i(is)h(executed)g(b)s(efore)f(execution)i(resumes.) | |
| 5559 | 57 b(When)37 b(a)f(function)g(completes,)150 5011 y(the)h(v)-5 | |
| 5560 | b(alues)38 b(of)f(the)g(p)s(ositional)h(parameters)f(and)g(the)g(sp)s | |
| 5561 | (ecial)h(parameter)f(`)p Fs(#)p Ft(')g(are)h(restored)f(to)h(the)150 | |
| 5562 | 5121 y(v)-5 b(alues)26 b(they)f(had)g(prior)f(to)i(the)g(function's)f | |
| 5563 | (execution.)40 b(If)25 b(a)h(n)m(umeric)f(argumen)m(t)h(is)f(giv)m(en)h | |
| 5564 | (to)g Fs(return)p Ft(,)150 5230 y(that)j(is)g(the)f(function's)h | |
| 5565 | (return)e(status;)j(otherwise)f(the)f(function's)h(return)e(status)i | |
| 5566 | (is)f(the)h(exit)h(status)150 5340 y(of)h(the)f(last)h(command)f | |
| 5567 | (executed)i(b)s(efore)e(the)g Fs(return)p Ft(.)p eop | |
| 5568 | end | |
| 9d2b70f0 CR |
5569 | %%Page: 15 21 |
| 5570 | TeXDict begin 15 20 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 5571 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(15)275 299 | |
| ac18b312 CR |
5572 | y(V)-8 b(ariables)31 b(lo)s(cal)g(to)f(the)g(function)f(ma)m(y)i(b)s(e) |
| 5573 | e(declared)h(with)f(the)h Fs(local)f Ft(builtin.)40 b(These)29 | |
| 5574 | b(v)-5 b(ariables)150 408 y(are)31 b(visible)g(only)f(to)h(the)g | |
| 5575 | (function)f(and)g(the)g(commands)g(it)h(in)m(v)m(ok)m(es.)275 | |
| 5576 | 548 y(F)-8 b(unction)38 b(names)f(and)g(de\014nitions)g(ma)m(y)i(b)s(e) | |
| 5577 | e(listed)h(with)f(the)h(`)p Fs(-f)p Ft(')f(option)h(to)h(the)e | |
| 5578 | Fs(declare)f Ft(or)150 657 y Fs(typeset)d Ft(builtin)h(commands)h | |
| 5579 | (\(see)h(Section)g(4.2)g([Bash)f(Builtins],)i(page)f(41\).)55 | |
| 5580 | b(The)35 b(`)p Fs(-F)p Ft(')g(option)g(to)150 767 y Fs(declare)f | |
| 9d2b70f0 CR |
5581 | Ft(or)i Fs(typeset)e Ft(will)i(list)h(the)f(function)g(names)g(only)g |
| 5582 | (\(and)g(optionally)h(the)f(source)g(\014le)h(and)150 | |
| ac18b312 | 5583 | 876 y(line)c(n)m(um)m(b)s(er,)g(if)f(the)h Fs(extdebug)e |
| 37c41ab1 | 5584 | Ft(shell)i(option)g(is)g(enabled\).)49 b(F)-8 b(unctions)33 |
| ac18b312 | 5585 | b(ma)m(y)h(b)s(e)e(exp)s(orted)g(so)h(that)150 986 y(subshells)f |
| 37c41ab1 CR |
5586 | (automatically)37 b(ha)m(v)m(e)d(them)g(de\014ned)e(with)h(the)g(`)p |
| 5587 | Fs(-f)p Ft(')h(option)g(to)g(the)f Fs(export)f Ft(builtin)h(\(see)150 | |
| ac18b312 | 5588 | 1095 y(Section)g(4.1)g([Bourne)f(Shell)g(Builtins],)i(page)f(35\).)47 |
| 37c41ab1 | 5589 | b(Note)33 b(that)g(shell)f(functions)g(and)f(v)-5 b(ariables)33 |
| ac18b312 | 5590 | b(with)150 1205 y(the)d(same)g(name)g(ma)m(y)g(result)g(in)g(m)m |
| 37c41ab1 | 5591 | (ultiple)g(iden)m(tically-named)i(en)m(tries)f(in)e(the)h(en)m |
| ac18b312 | 5592 | (vironmen)m(t)g(passed)150 1315 y(to)h(the)g(shell's)f(c)m(hildren.)41 |
| 37c41ab1 | 5593 | b(Care)30 b(should)g(b)s(e)f(tak)m(en)j(in)e(cases)h(where)f(this)g(ma) |
| ac18b312 | 5594 | m(y)h(cause)g(a)g(problem.)275 1454 y(F)-8 b(unctions)30 |
| 37c41ab1 | 5595 | b(ma)m(y)h(b)s(e)f(recursiv)m(e.)41 b(No)31 b(limit)g(is)g(placed)g(on) |
| 9d2b70f0 | 5596 | f(the)g(n)m(um)m(b)s(er)g(of)g(recursiv)m(e)h(calls.)150 |
| ac18b312 | 5597 | 1722 y Fr(3.4)68 b(Shell)45 b(P)l(arameters)275 1971 |
| 9d2b70f0 CR |
5598 | y Ft(A)32 b Fq(parameter)40 b Ft(is)32 b(an)h(en)m(tit)m(y)h(that)f |
| 5599 | (stores)g(v)-5 b(alues.)48 b(It)33 b(can)g(b)s(e)e(a)i | |
| 5600 | Fs(name)p Ft(,)g(a)g(n)m(um)m(b)s(er,)f(or)g(one)h(of)g(the)150 | |
| ac18b312 | 5601 | 2081 y(sp)s(ecial)i(c)m(haracters)h(listed)g(b)s(elo)m(w.)53 |
| 9d2b70f0 CR |
5602 | b(A)35 b Fq(v)-5 b(ariable)41 b Ft(is)34 b(a)h(parameter)h(denoted)e(b) |
| 5603 | m(y)h(a)g Fs(name)p Ft(.)52 b(A)35 b(v)-5 b(ariable)150 | |
| ac18b312 | 5604 | 2190 y(has)29 b(a)h Fq(v)-5 b(alue)35 b Ft(and)28 b(zero)j(or)e(more)g |
| 9d2b70f0 | 5605 | Fq(attributes)p Ft(.)41 b(A)m(ttributes)30 b(are)g(assigned)g(using)f |
| ac18b312 | 5606 | (the)g Fs(declare)e Ft(builtin)150 2300 y(command)22 |
| 9d2b70f0 | 5607 | b(\(see)h(the)f(description)g(of)g(the)g Fs(declare)f |
| ac18b312 CR |
5608 | Ft(builtin)g(in)h(Section)h(4.2)g([Bash)f(Builtins],)j(page)d(41\).)275 |
| 5609 | 2439 y(A)28 b(parameter)h(is)g(set)g(if)f(it)h(has)f(b)s(een)g | |
| 9d2b70f0 | 5610 | (assigned)h(a)g(v)-5 b(alue.)40 b(The)28 b(n)m(ull)h(string)f(is)h(a)g |
| ac18b312 | 5611 | (v)-5 b(alid)28 b(v)-5 b(alue.)41 b(Once)150 2548 y(a)31 |
| 9d2b70f0 CR |
5612 | b(v)-5 b(ariable)31 b(is)f(set,)i(it)e(ma)m(y)h(b)s(e)f(unset)g(only)h |
| 5613 | (b)m(y)f(using)g(the)g Fs(unset)f Ft(builtin)h(command.)275 | |
| ac18b312 CR |
5614 | 2688 y(A)g(v)-5 b(ariable)31 b(ma)m(y)g(b)s(e)f(assigned)g(to)i(b)m(y)e |
| 5615 | (a)h(statemen)m(t)h(of)e(the)h(form)390 2827 y Fj(name)11 | |
| 5616 | b Fs(=[)p Fj(value)g Fs(])150 2966 y Ft(If)34 b Fq(v)-5 | |
| 37c41ab1 CR |
5617 | b(alue)40 b Ft(is)35 b(not)g(giv)m(en,)h(the)f(v)-5 b(ariable)35 |
| 5618 | b(is)g(assigned)g(the)f(n)m(ull)h(string.)53 b(All)35 | |
| 5619 | b Fq(v)-5 b(alue)5 b Ft(s)35 b(undergo)f(tilde)h(ex-)150 | |
| ac18b312 | 5620 | 3075 y(pansion,)h(parameter)f(and)f(v)-5 b(ariable)36 |
| 37c41ab1 | 5621 | b(expansion,)f(command)g(substitution,)h(arithmetic)g(expansion,)150 |
| ac18b312 | 5622 | 3185 y(and)k(quote)h(remo)m(v)-5 b(al)42 b(\(detailed)h(b)s(elo)m(w\).) |
| 37c41ab1 | 5623 | 72 b(If)40 b(the)h(v)-5 b(ariable)41 b(has)g(its)g Fs(integer)e |
| ac18b312 | 5624 | Ft(attribute)i(set,)j(then)150 3294 y Fq(v)-5 b(alue)38 |
| 37c41ab1 CR |
5625 | b Ft(is)33 b(ev)-5 b(aluated)34 b(as)f(an)g(arithmetic)h(expression)f |
| 5626 | (ev)m(en)h(if)e(the)h Fs($\(\(...)o(\)\))f Ft(expansion)h(is)g(not)g | |
| ac18b312 | 5627 | (used)150 3404 y(\(see)e(Section)g(3.5.5)i([Arithmetic)e(Expansion],)f |
| 9d2b70f0 | 5628 | (page)h(22\).)42 b(W)-8 b(ord)31 b(splitting)g(is)g(not)f(p)s |
| ac18b312 | 5629 | (erformed,)f(with)150 3514 y(the)35 b(exception)h(of)f |
| 37c41ab1 CR |
5630 | Fs("$@")f Ft(as)h(explained)g(b)s(elo)m(w.)54 b(Filename)36 |
| 5631 | b(expansion)f(is)g(not)g(p)s(erformed.)53 b(Assign-)150 | |
| ac18b312 | 5632 | 3623 y(men)m(t)33 b(statemen)m(ts)h(ma)m(y)f(also)g(app)s(ear)f(as)g |
| 37c41ab1 | 5633 | (argumen)m(ts)h(to)g(the)g Fs(alias)p Ft(,)e Fs(declare)p |
| ac18b312 | 5634 | Ft(,)g Fs(typeset)p Ft(,)g Fs(export)p Ft(,)150 3733 |
| eb2bb562 | 5635 | y Fs(readonly)p Ft(,)d(and)i Fs(local)f Ft(builtin)h(commands.)275 |
| ac18b312 | 5636 | 3872 y(In)f(the)h(con)m(text)i(where)d(an)h(assignmen)m(t)h(statemen)m |
| eb2bb562 | 5637 | (t)h(is)e(assigning)g(a)h(v)-5 b(alue)30 b(to)h(a)f(shell)g(v)-5 |
| ac18b312 | 5638 | b(ariable)31 b(or)150 3981 y(arra)m(y)f(index)g(\(see)h(Section)g(6.7)g |
| 28157acd | 5639 | ([Arra)m(ys],)g(page)g(76\),)g(the)f(`)p Fs(+=)p Ft(')g(op)s(erator)g |
| ac18b312 | 5640 | (can)h(b)s(e)e(used)g(to)i(app)s(end)d(to)150 4091 y(or)36 |
| eb2bb562 CR |
5641 | b(add)g(to)h(the)f(v)-5 b(ariable's)37 b(previous)f(v)-5 |
| 5642 | b(alue.)59 b(When)36 b(`)p Fs(+=)p Ft(')g(is)g(applied)g(to)h(a)g(v)-5 | |
| ac18b312 | 5643 | b(ariable)37 b(for)f(whic)m(h)g(the)150 4201 y(in)m(teger)k(attribute)e |
| eb2bb562 CR |
5644 | (has)g(b)s(een)g(set,)j Fq(v)-5 b(alue)44 b Ft(is)38 |
| 5645 | b(ev)-5 b(aluated)39 b(as)g(an)f(arithmetic)h(expression)f(and)g(added) | |
| ac18b312 | 5646 | 150 4310 y(to)e(the)f(v)-5 b(ariable's)36 b(curren)m(t)f(v)-5 |
| eb2bb562 CR |
5647 | b(alue,)37 b(whic)m(h)e(is)g(also)h(ev)-5 b(aluated.)56 |
| 5648 | b(When)35 b(`)p Fs(+=)p Ft(')g(is)h(applied)f(to)g(an)g(arra)m(y)150 | |
| ac18b312 | 5649 | 4420 y(v)-5 b(ariable)26 b(using)e(comp)s(ound)f(assignmen)m(t)j(\(see) |
| 28157acd | 5650 | f(Section)h(6.7)f([Arra)m(ys],)i(page)f(76\),)h(the)e(v)-5 |
| ac18b312 | 5651 | b(ariable's)25 b(v)-5 b(alue)150 4529 y(is)32 b(not)f(unset)h(\(as)g |
| eb2bb562 CR |
5652 | (it)g(is)f(when)g(using)g(`)p Fs(=)p Ft('\),)i(and)e(new)g(v)-5 |
| 5653 | b(alues)32 b(are)g(app)s(ended)d(to)k(the)f(arra)m(y)g(b)s(eginning)150 | |
| ac18b312 | 5654 | 4639 y(at)e(one)g(greater)h(than)f(the)g(arra)m(y's)g(maxim)m(um)f |
| eb2bb562 | 5655 | (index.)40 b(When)30 b(applied)f(to)i(a)f(string-v)-5 |
| ac18b312 | 5656 | b(alued)30 b(v)-5 b(ariable,)150 4748 y Fq(v)g(alue)36 |
| eb2bb562 | 5657 | b Ft(is)30 b(expanded)g(and)g(app)s(ended)e(to)j(the)g(v)-5 |
| ac18b312 CR |
5658 | b(ariable's)31 b(v)-5 b(alue.)150 4982 y Fk(3.4.1)63 |
| 5659 | b(P)m(ositional)41 b(P)m(arameters)275 5230 y Ft(A)36 | |
| eb2bb562 CR |
5660 | b Fq(p)s(ositional)i(parameter)44 b Ft(is)37 b(a)g(parameter)g(denoted) |
| 5661 | g(b)m(y)g(one)g(or)g(more)g(digits,)i(other)e(than)g(the)150 | |
| ac18b312 | 5662 | 5340 y(single)k(digit)f Fs(0)p Ft(.)69 b(P)m(ositional)42 |
| eb2bb562 | 5663 | b(parameters)f(are)f(assigned)g(from)g(the)g(shell's)g(argumen)m(ts)g |
| ac18b312 | 5664 | (when)f(it)i(is)p eop end |
| 5e13499c | 5665 | %%Page: 16 22 |
| 37c41ab1 | 5666 | TeXDict begin 16 21 bop 150 -116 a Ft(16)2572 b(Bash)31 |
| ac18b312 CR |
5667 | b(Reference)g(Man)m(ual)150 299 y(in)m(v)m(ok)m(ed,)40 |
| 5668 | b(and)d(ma)m(y)g(b)s(e)g(reassigned)g(using)f(the)i Fs(set)e | |
| 5669 | Ft(builtin)g(command.)61 b(P)m(ositional)39 b(parameter)e | |
| 5670 | Fs(N)150 408 y Ft(ma)m(y)27 b(b)s(e)g(referenced)f(as)h | |
| 5671 | Fs(${N})p Ft(,)g(or)g(as)g Fs($N)f Ft(when)g Fs(N)g Ft(consists)i(of)f | |
| 5672 | (a)g(single)g(digit.)41 b(P)m(ositional)29 b(parameters)150 | |
| 5673 | 518 y(ma)m(y)j(not)f(b)s(e)g(assigned)h(to)g(with)f(assignmen)m(t)h | |
| 5674 | (statemen)m(ts.)45 b(The)30 b Fs(set)h Ft(and)g Fs(shift)e | |
| 5675 | Ft(builtins)i(are)h(used)150 628 y(to)h(set)f(and)f(unset)h(them)g | |
| 5676 | (\(see)h(Chapter)e(4)h([Shell)g(Builtin)h(Commands],)e(page)i(35\).)47 | |
| 5677 | b(The)31 b(p)s(ositional)150 737 y(parameters)24 b(are)g(temp)s | |
| 9d2b70f0 | 5678 | (orarily)g(replaced)h(when)d(a)j(shell)f(function)f(is)h(executed)h |
| ac18b312 CR |
5679 | (\(see)f(Section)h(3.3)g([Shell)150 847 y(F)-8 b(unctions],)31 |
| 5680 | b(page)h(14\).)275 979 y(When)27 b(a)i(p)s(ositional)g(parameter)g | |
| 9d2b70f0 | 5681 | (consisting)f(of)h(more)f(than)g(a)g(single)h(digit)g(is)f(expanded,)g |
| ac18b312 CR |
5682 | (it)h(m)m(ust)150 1088 y(b)s(e)h(enclosed)h(in)f(braces.)150 |
| 5683 | 1304 y Fk(3.4.2)63 b(Sp)s(ecial)41 b(P)m(arameters)275 | |
| 5684 | 1545 y Ft(The)27 b(shell)h(treats)h(sev)m(eral)g(parameters)g(sp)s | |
| 9d2b70f0 | 5685 | (ecially)-8 b(.)41 b(These)28 b(parameters)g(ma)m(y)g(only)g(b)s(e)g |
| ac18b312 CR |
5686 | (referenced;)150 1655 y(assignmen)m(t)j(to)g(them)g(is)f(not)h(allo)m |
| 5687 | (w)m(ed.)150 1808 y Fs(*)432 b Ft(Expands)29 b(to)h(the)h(p)s | |
| 9d2b70f0 | 5688 | (ositional)f(parameters,)h(starting)g(from)e(one.)41 |
| ac18b312 | 5689 | b(When)30 b(the)g(expansion)630 1918 y(o)s(ccurs)e(within)f(double)h |
| eb2bb562 | 5690 | (quotes,)h(it)g(expands)e(to)i(a)f(single)h(w)m(ord)f(with)g(the)g(v)-5 |
| ac18b312 | 5691 | b(alue)29 b(of)f(eac)m(h)630 2028 y(parameter)i(separated)g(b)m(y)f |
| 9d2b70f0 | 5692 | (the)g(\014rst)g(c)m(haracter)i(of)e(the)h Fs(IFS)e Ft(sp)s(ecial)i(v) |
| ac18b312 | 5693 | -5 b(ariable.)41 b(That)30 b(is,)630 2137 y Fs("$*")h |
| 9d2b70f0 CR |
5694 | Ft(is)i(equiv)-5 b(alen)m(t)33 b(to)h Fs("$1)p Fj(c)11 |
| 5695 | b Fs($2)p Fj(c)g Fs(...)l(")p Ft(,)33 b(where)f Fq(c)38 | |
| 5696 | b Ft(is)32 b(the)h(\014rst)e(c)m(haracter)j(of)f(the)f(v)-5 | |
| ac18b312 | 5697 | b(alue)630 2247 y(of)30 b(the)g Fs(IFS)g Ft(v)-5 b(ariable.)41 |
| 9d2b70f0 | 5698 | b(If)30 b Fs(IFS)f Ft(is)h(unset,)g(the)g(parameters)g(are)h(separated) |
| ac18b312 | 5699 | f(b)m(y)g(spaces.)41 b(If)630 2356 y Fs(IFS)29 b Ft(is)i(n)m(ull,)f |
| 9d2b70f0 | 5700 | (the)h(parameters)g(are)f(joined)h(without)f(in)m(terv)m(ening)i |
| ac18b312 | 5701 | (separators.)150 2510 y Fs(@)432 b Ft(Expands)29 b(to)h(the)h(p)s |
| 9d2b70f0 | 5702 | (ositional)f(parameters,)h(starting)g(from)e(one.)41 |
| ac18b312 | 5703 | b(When)30 b(the)g(expansion)630 2620 y(o)s(ccurs)c(within)g(double)f |
| 9d2b70f0 | 5704 | (quotes,)j(eac)m(h)f(parameter)g(expands)e(to)i(a)g(separate)g(w)m |
| ac18b312 | 5705 | (ord.)39 b(That)630 2729 y(is,)29 b Fs("$@")e Ft(is)i(equiv)-5 |
| 9d2b70f0 | 5706 | b(alen)m(t)30 b(to)f Fs("$1")g("$2")h(...)o Ft(.)40 b(If)28 |
| ac18b312 | 5707 | b(the)g(double-quoted)h(expansion)f(o)s(ccurs)630 2839 |
| 9d2b70f0 CR |
5708 | y(within)d(a)h(w)m(ord,)g(the)g(expansion)f(of)h(the)g(\014rst)f |
| 5709 | (parameter)h(is)f(joined)h(with)f(the)h(b)s(eginning)630 | |
| ac18b312 | 5710 | 2949 y(part)f(of)g(the)g(original)g(w)m(ord,)h(and)e(the)h(expansion)g |
| 9d2b70f0 | 5711 | (of)g(the)g(last)h(parameter)f(is)g(joined)f(with)630 |
| ac18b312 | 5712 | 3058 y(the)37 b(last)g(part)g(of)f(the)h(original)h(w)m(ord.)59 |
| 37c41ab1 | 5713 | b(When)36 b(there)h(are)g(no)f(p)s(ositional)h(parameters,)630 |
| ac18b312 CR |
5714 | 3168 y Fs("$@")29 b Ft(and)h Fs($@)g Ft(expand)f(to)j(nothing)e |
| 5715 | (\(i.e.,)i(they)e(are)h(remo)m(v)m(ed\).)150 3321 y Fs(#)432 | |
| eb2bb562 | 5716 | b Ft(Expands)29 b(to)i(the)g(n)m(um)m(b)s(er)e(of)h(p)s(ositional)h |
| ac18b312 | 5717 | (parameters)g(in)f(decimal.)150 3475 y Fs(?)432 b Ft(Expands)29 |
| 37c41ab1 | 5718 | b(to)i(the)g(exit)g(status)g(of)f(the)h(most)f(recen)m(tly)i(executed)f |
| ac18b312 | 5719 | (foreground)f(pip)s(eline.)150 3629 y Fs(-)432 b Ft(\(A)31 |
| 37c41ab1 CR |
5720 | b(h)m(yphen.\))42 b(Expands)30 b(to)h(the)g(curren)m(t)g(option)h |
| 5721 | (\015ags)f(as)g(sp)s(eci\014ed)f(up)s(on)g(in)m(v)m(o)s(cation,)630 | |
| ac18b312 | 5722 | 3739 y(b)m(y)35 b(the)h Fs(set)e Ft(builtin)h(command,)h(or)g(those)g |
| 37c41ab1 | 5723 | (set)f(b)m(y)h(the)f(shell)h(itself)g(\(suc)m(h)f(as)h(the)f(`)p |
| ac18b312 | 5724 | Fs(-i)p Ft(')630 3848 y(option\).)150 4002 y Fs($)432 |
| 37c41ab1 CR |
5725 | b Ft(Expands)39 b(to)j(the)f(pro)s(cess)f Fl(id)h Ft(of)g(the)g(shell.) |
| 5726 | 73 b(In)40 b(a)h Fs(\(\))f Ft(subshell,)j(it)e(expands)f(to)i(the)630 | |
| ac18b312 CR |
5727 | 4112 y(pro)s(cess)30 b Fl(id)g Ft(of)h(the)g(in)m(v)m(oking)g(shell,)g |
| 5728 | (not)g(the)f(subshell.)150 4265 y Fs(!)432 b Ft(Expands)39 | |
| 37c41ab1 | 5729 | b(to)i(the)g(pro)s(cess)e Fl(id)i Ft(of)f(the)h(most)g(recen)m(tly)g |
| ac18b312 CR |
5730 | (executed)g(bac)m(kground)g(\(asyn-)630 4375 y(c)m(hronous\))30 |
| 5731 | b(command.)150 4529 y Fs(0)432 b Ft(Expands)20 b(to)j(the)f(name)g(of)g | |
| 37c41ab1 | 5732 | (the)g(shell)g(or)f(shell)h(script.)38 b(This)21 b(is)h(set)g(at)h |
| ac18b312 | 5733 | (shell)f(initialization.)630 4638 y(If)44 b(Bash)g(is)g(in)m(v)m(ok)m |
| 37c41ab1 | 5734 | (ed)i(with)e(a)g(\014le)g(of)h(commands)e(\(see)j(Section)f(3.8)g |
| ac18b312 | 5735 | ([Shell)f(Scripts],)630 4748 y(page)39 b(32\),)i Fs($0)d |
| 37c41ab1 CR |
5736 | Ft(is)g(set)g(to)h(the)f(name)g(of)g(that)h(\014le.)64 |
| 5737 | b(If)37 b(Bash)i(is)f(started)g(with)g(the)g(`)p Fs(-c)p | |
| ac18b312 | 5738 | Ft(')630 4857 y(option)i(\(see)g(Section)h(6.1)f([In)m(v)m(oking)h |
| 28157acd | 5739 | (Bash],)h(page)e(67\),)j(then)d Fs($0)e Ft(is)i(set)g(to)g(the)g |
| ac18b312 | 5740 | (\014rst)630 4967 y(argumen)m(t)31 b(after)g(the)g(string)g(to)g(b)s(e) |
| 37c41ab1 | 5741 | f(executed,)i(if)f(one)g(is)f(presen)m(t.)42 b(Otherwise,)31 |
| ac18b312 | 5742 | b(it)g(is)f(set)630 5077 y(to)h(the)g(\014lename)f(used)g(to)h(in)m(v)m |
| 37c41ab1 | 5743 | (ok)m(e)h(Bash,)f(as)g(giv)m(en)g(b)m(y)f(argumen)m(t)h(zero.)150 |
| ac18b312 | 5744 | 5230 y Fs(_)432 b Ft(\(An)27 b(underscore.\))39 b(A)m(t)29 |
| 2206f89a | 5745 | b(shell)e(startup,)h(set)f(to)h(the)g(absolute)g(pathname)f(used)f(to)i |
| ac18b312 | 5746 | (in)m(v)m(ok)m(e)630 5340 y(the)22 b(shell)g(or)g(shell)g(script)f(b)s |
| 2206f89a | 5747 | (eing)h(executed)h(as)f(passed)f(in)g(the)h(en)m(vironmen)m(t)h(or)e |
| ac18b312 | 5748 | (argumen)m(t)p eop end |
| 5e13499c | 5749 | %%Page: 17 23 |
| 37c41ab1 | 5750 | TeXDict begin 17 22 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 9d2b70f0 | 5751 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(17)630 299 |
| ac18b312 CR |
5752 | y(list.)72 b(Subsequen)m(tly)-8 b(,)43 b(expands)c(to)j(the)e(last)i |
| 5753 | (argumen)m(t)f(to)g(the)g(previous)f(command,)630 408 | |
| 5754 | y(after)35 b(expansion.)54 b(Also)36 b(set)f(to)h(the)f(full)f | |
| 5755 | (pathname)h(used)f(to)h(in)m(v)m(ok)m(e)i(eac)m(h)f(command)630 | |
| 5756 | 518 y(executed)42 b(and)e(placed)i(in)e(the)h(en)m(vironmen)m(t)h(exp)s | |
| 5757 | (orted)f(to)g(that)h(command.)72 b(When)630 628 y(c)m(hec)m(king)32 | |
| 9d2b70f0 | 5758 | b(mail,)f(this)g(parameter)g(holds)e(the)i(name)f(of)h(the)g(mail)g |
| ac18b312 CR |
5759 | (\014le.)150 901 y Fr(3.5)68 b(Shell)45 b(Expansions)275 |
| 5760 | 1151 y Ft(Expansion)29 b(is)h(p)s(erformed)e(on)i(the)g(command)g(line) | |
| 5761 | g(after)h(it)f(has)g(b)s(een)f(split)h(in)m(to)h Fs(token)p | |
| 5762 | Ft(s.)39 b(There)150 1261 y(are)31 b(sev)m(en)g(kinds)e(of)i(expansion) | |
| 5763 | f(p)s(erformed:)225 1401 y Fp(\017)60 b Ft(brace)31 b(expansion)225 | |
| 5764 | 1539 y Fp(\017)60 b Ft(tilde)31 b(expansion)225 1677 | |
| 9d2b70f0 | 5765 | y Fp(\017)60 b Ft(parameter)31 b(and)f(v)-5 b(ariable)31 |
| ac18b312 CR |
5766 | b(expansion)225 1814 y Fp(\017)60 b Ft(command)30 b(substitution)225 |
| 5767 | 1952 y Fp(\017)60 b Ft(arithmetic)32 b(expansion)225 | |
| 5768 | 2089 y Fp(\017)60 b Ft(w)m(ord)30 b(splitting)225 2227 | |
| 5769 | y Fp(\017)60 b Ft(\014lename)31 b(expansion)275 2396 | |
| 9d2b70f0 CR |
5770 | y(The)i(order)g(of)h(expansions)g(is:)47 b(brace)34 b(expansion,)h |
| 5771 | (tilde)g(expansion,)f(parameter,)i(v)-5 b(ariable,)36 | |
| ac18b312 | 5772 | b(and)150 2505 y(arithmetic)46 b(expansion)f(and)g(command)f |
| 9d2b70f0 | 5773 | (substitution)h(\(done)g(in)g(a)g(left-to-righ)m(t)j(fashion\),)h(w)m |
| ac18b312 CR |
5774 | (ord)150 2615 y(splitting,)31 b(and)f(\014lename)h(expansion.)275 |
| 5775 | 2756 y(On)42 b(systems)h(that)h(can)g(supp)s(ort)e(it,)47 | |
| 9d2b70f0 | 5776 | b(there)d(is)f(an)h(additional)g(expansion)f(a)m(v)-5 |
| ac18b312 | 5777 | b(ailable:)69 b Fq(pro)s(cess)150 2865 y(substitution)p |
| 37c41ab1 CR |
5778 | Ft(.)61 b(This)36 b(is)h(p)s(erformed)f(at)i(the)f(same)h(time)f(as)h |
| 5779 | (parameter,)h(v)-5 b(ariable,)40 b(and)d(arithmetic)150 | |
| ac18b312 CR |
5780 | 2975 y(expansion)30 b(and)g(command)g(substitution.)275 |
| 5781 | 3116 y(Only)35 b(brace)i(expansion,)h(w)m(ord)e(splitting,)j(and)d | |
| 37c41ab1 | 5782 | (\014lename)g(expansion)g(can)h(c)m(hange)h(the)e(n)m(um)m(b)s(er)150 |
| ac18b312 | 5783 | 3225 y(of)h(w)m(ords)f(of)g(the)h(expansion;)i(other)e(expansions)f |
| 37c41ab1 | 5784 | (expand)g(a)h(single)g(w)m(ord)f(to)h(a)g(single)g(w)m(ord.)58 |
| ac18b312 | 5785 | b(The)150 3335 y(only)32 b(exceptions)i(to)f(this)f(are)h(the)f |
| 37c41ab1 | 5786 | (expansions)g(of)h Fs("$@")e Ft(\(see)i(Section)g(3.4.2)h([Sp)s(ecial)f |
| ac18b312 | 5787 | (P)m(arameters],)150 3444 y(page)e(16\))h(and)d Fs("${)p |
| 37c41ab1 | 5788 | Fj(name)11 b Fs([@]}")27 b Ft(\(see)k(Section)h(6.7)f([Arra)m(ys],)g |
| 28157acd | 5789 | (page)g(76\).)275 3585 y(After)41 b(all)i(expansions,)h |
| 37c41ab1 | 5790 | Fs(quote)29 b(removal)40 b Ft(\(see)i(Section)h(3.5.9)g([Quote)f(Remo)m |
| ac18b312 CR |
5791 | (v)-5 b(al],)47 b(page)42 b(25\))h(is)150 3695 y(p)s(erformed.)150 |
| 5792 | 3931 y Fk(3.5.1)63 b(Brace)40 b(Expansion)275 4182 y | |
| 37c41ab1 CR |
5793 | Ft(Brace)21 b(expansion)g(is)g(a)g(mec)m(hanism)g(b)m(y)g(whic)m(h)f |
| 5794 | (arbitrary)h(strings)f(ma)m(y)i(b)s(e)e(generated.)38 | |
| ac18b312 | 5795 | b(This)20 b(mec)m(h-)150 4291 y(anism)35 b(is)h(similar)f(to)h |
| 37c41ab1 | 5796 | Fq(\014lename)g(expansion)f Ft(\(see)i(Section)f(3.5.8)h([Filename)g |
| 28157acd CR |
5797 | (Expansion],)f(page)g(23\),)150 4401 y(but)31 b(the)h(\014le)g(names)f |
| 5798 | (generated)i(need)f(not)g(exist.)45 b(P)m(atterns)33 | |
| 5799 | b(to)f(b)s(e)f(brace)h(expanded)f(tak)m(e)i(the)f(form)150 | |
| 5800 | 4511 y(of)26 b(an)f(optional)h Fq(pream)m(ble)p Ft(,)h(follo)m(w)m(ed)g | |
| 5801 | (b)m(y)f(either)g(a)f(series)h(of)g(comma-separated)h(strings)e(or)g(a) | |
| 5802 | h(sequnce)150 4620 y(expression)36 b(b)s(et)m(w)m(een)g(a)h(pair)e(of)i | |
| 37c41ab1 | 5803 | (braces,)g(follo)m(w)m(ed)h(b)m(y)e(an)g(optional)h Fq(p)s(ostscript)p |
| ac18b312 | 5804 | Ft(.)57 b(The)36 b(pream)m(ble)g(is)150 4730 y(pre\014xed)28 |
| 37c41ab1 CR |
5805 | b(to)h(eac)m(h)h(string)f(con)m(tained)h(within)e(the)h(braces,)g(and)g |
| 5806 | (the)g(p)s(ostscript)f(is)h(then)f(app)s(ended)f(to)150 | |
| ac18b312 CR |
5807 | 4839 y(eac)m(h)32 b(resulting)e(string,)h(expanding)e(left)j(to)f(righ) |
| 5808 | m(t.)275 4980 y(Brace)37 b(expansions)f(ma)m(y)h(b)s(e)f(nested.)59 | |
| 37c41ab1 | 5809 | b(The)36 b(results)g(of)h(eac)m(h)g(expanded)f(string)g(are)h(not)g |
| ac18b312 CR |
5810 | (sorted;)150 5090 y(left)31 b(to)g(righ)m(t)g(order)f(is)g(preserv)m |
| 5811 | (ed.)41 b(F)-8 b(or)31 b(example,)390 5230 y Fs(bash$)46 | |
| 5812 | b(echo)h(a{d,c,b}e)390 5340 y(ade)g(ace)g(abe)p eop end | |
| 9d2b70f0 CR |
5813 | %%Page: 18 24 |
| 5814 | TeXDict begin 18 23 bop 150 -116 a Ft(18)2572 b(Bash)31 | |
| ac18b312 CR |
5815 | b(Reference)g(Man)m(ual)275 299 y(A)24 b(sequence)h(expression)g(tak)m |
| 5816 | (es)h(the)f(form)f Fs({)p Fj(x)p Fs(..)p Fj(y)11 b Fs(})p | |
| 5817 | Ft(,)23 b(where)i Fq(x)30 b Ft(and)24 b Fq(y)33 b Ft(are)25 | |
| 5818 | b(either)g(in)m(tegers)h(or)e(single)150 408 y(c)m(haracters.)43 | |
| 5819 | b(When)30 b(in)m(tegers)i(are)f(supplied,)e(the)i(expression)f(expands) | |
| 5820 | g(to)h(eac)m(h)h(n)m(um)m(b)s(er)d(b)s(et)m(w)m(een)i | |
| 5821 | Fq(x)150 518 y Ft(and)i Fq(y)p Ft(,)i(inclusiv)m(e.)53 | |
| 5822 | b(When)34 b(c)m(haracters)h(are)f(supplied,)g(the)h(expression)e | |
| 5823 | (expands)g(to)i(eac)m(h)g(c)m(haracter)150 628 y(lexicographically)e(b) | |
| 5824 | s(et)m(w)m(een)e Fq(x)37 b Ft(and)30 b Fq(y)p Ft(,)h(inclusiv)m(e.)42 | |
| 9d2b70f0 | 5825 | b(Note)31 b(that)g(b)s(oth)f Fq(x)37 b Ft(and)30 b Fq(y)38 |
| ac18b312 CR |
5826 | b Ft(m)m(ust)30 b(b)s(e)g(of)h(the)g(same)150 737 y(t)m(yp)s(e.)275 |
| 5827 | 874 y(Brace)36 b(expansion)g(is)f(p)s(erformed)f(b)s(efore)h(an)m(y)h | |
| 37c41ab1 | 5828 | (other)g(expansions,)h(and)e(an)m(y)g(c)m(haracters)i(sp)s(ecial)150 |
| ac18b312 | 5829 | 983 y(to)32 b(other)g(expansions)g(are)g(preserv)m(ed)f(in)h(the)f |
| 37c41ab1 | 5830 | (result.)45 b(It)32 b(is)g(strictly)g(textual.)46 b(Bash)32 |
| ac18b312 | 5831 | b(do)s(es)f(not)h(apply)150 1093 y(an)m(y)27 b(syn)m(tactic)i(in)m |
| 37c41ab1 | 5832 | (terpretation)g(to)f(the)f(con)m(text)i(of)e(the)g(expansion)g(or)g |
| ac18b312 | 5833 | (the)h(text)g(b)s(et)m(w)m(een)f(the)h(braces.)150 1202 |
| 37c41ab1 CR |
5834 | y(T)-8 b(o)37 b(a)m(v)m(oid)g(con\015icts)g(with)f(parameter)h |
| 5835 | (expansion,)g(the)g(string)f(`)p Fs(${)p Ft(')g(is)g(not)g(considered)g | |
| ac18b312 CR |
5836 | (eligible)i(for)150 1312 y(brace)31 b(expansion.)275 |
| 5837 | 1448 y(A)e(correctly-formed)i(brace)f(expansion)f(m)m(ust)h(con)m(tain) | |
| 5838 | h(unquoted)e(op)s(ening)g(and)g(closing)i(braces,)150 | |
| 5839 | 1558 y(and)h(at)i(least)g(one)f(unquoted)g(comma)g(or)g(a)h(v)-5 | |
| 37c41ab1 | 5840 | b(alid)33 b(sequence)g(expression.)48 b(An)m(y)33 b(incorrectly)h |
| ac18b312 CR |
5841 | (formed)150 1667 y(brace)d(expansion)f(is)g(left)h(unc)m(hanged.)275 |
| 5842 | 1804 y(A)25 b Fs({)g Ft(or)g(`)p Fs(,)p Ft(')g(ma)m(y)h(b)s(e)f(quoted) | |
| 9d2b70f0 | 5843 | g(with)g(a)h(bac)m(kslash)f(to)h(prev)m(en)m(t)g(its)g(b)s(eing)f |
| ac18b312 | 5844 | (considered)g(part)g(of)g(a)h(brace)150 1913 y(expression.)51 |
| 9d2b70f0 CR |
5845 | b(T)-8 b(o)34 b(a)m(v)m(oid)i(con\015icts)e(with)g(parameter)g |
| 5846 | (expansion,)h(the)f(string)g(`)p Fs(${)p Ft(')g(is)g(not)g(considered) | |
| ac18b312 | 5847 | 150 2023 y(eligible)e(for)e(brace)h(expansion.)275 2159 |
| 9d2b70f0 CR |
5848 | y(This)f(construct)h(is)g(t)m(ypically)i(used)d(as)h(shorthand)f(when)g |
| 5849 | (the)h(common)g(pre\014x)f(of)h(the)g(strings)g(to)150 | |
| ac18b312 CR |
5850 | 2269 y(b)s(e)f(generated)h(is)g(longer)g(than)f(in)g(the)g(ab)s(o)m(v)m |
| 5851 | (e)i(example:)390 2405 y Fs(mkdir)46 b(/usr/local/src/bash/{old,n)o | |
| 5852 | (ew,)o(dist)o(,bug)o(s})275 2541 y Ft(or)390 2677 y Fs(chown)g(root)h | |
| eb2bb562 | 5853 | (/usr/{ucb/{ex,edit},lib/)o({ex?)o(.?*,)o(how)o(_ex})o(})150 |
| ac18b312 | 5854 | 2905 y Fk(3.5.2)63 b(Tilde)41 b(Expansion)275 3151 y |
| eb2bb562 CR |
5855 | Ft(If)i(a)i(w)m(ord)e(b)s(egins)h(with)f(an)h(unquoted)f(tilde)i(c)m |
| 5856 | (haracter)h(\(`)p Fs(~)p Ft('\),)i(all)d(of)g(the)f(c)m(haracters)h(up) | |
| ac18b312 | 5857 | e(to)150 3261 y(the)35 b(\014rst)f(unquoted)f(slash)i(\(or)g(all)g(c)m |
| eb2bb562 | 5858 | (haracters,)i(if)e(there)g(is)f(no)h(unquoted)e(slash\))i(are)g |
| ac18b312 | 5859 | (considered)g(a)150 3370 y Fq(tilde-pre\014x)p Ft(.)55 |
| eb2bb562 | 5860 | b(If)35 b(none)g(of)g(the)g(c)m(haracters)i(in)d(the)i(tilde-pre\014x)f |
| ac18b312 | 5861 | (are)g(quoted,)i(the)e(c)m(haracters)i(in)e(the)150 3480 |
| eb2bb562 CR |
5862 | y(tilde-pre\014x)27 b(follo)m(wing)h(the)f(tilde)h(are)f(treated)h(as)f |
| 5863 | (a)g(p)s(ossible)f Fq(login)i(name)p Ft(.)39 b(If)27 | |
| ac18b312 | 5864 | b(this)f(login)i(name)f(is)g(the)150 3589 y(n)m(ull)k(string,)h(the)f |
| 37c41ab1 CR |
5865 | (tilde)h(is)g(replaced)g(with)f(the)g(v)-5 b(alue)32 |
| 5866 | b(of)f(the)h Fs(HOME)e Ft(shell)h(v)-5 b(ariable.)45 | |
| ac18b312 | 5867 | b(If)31 b Fs(HOME)f Ft(is)h(unset,)150 3699 y(the)37 |
| 37c41ab1 CR |
5868 | b(home)f(directory)h(of)g(the)f(user)g(executing)i(the)f(shell)f(is)h |
| 5869 | (substituted)f(instead.)59 b(Otherwise,)38 b(the)150 | |
| ac18b312 | 5870 | 3809 y(tilde-pre\014x)30 b(is)h(replaced)g(with)f(the)g(home)h |
| 37c41ab1 | 5871 | (directory)g(asso)s(ciated)g(with)f(the)h(sp)s(eci\014ed)f(login)h |
| ac18b312 | 5872 | (name.)275 3945 y(If)h(the)h(tilde-pre\014x)f(is)h(`)p |
| 37c41ab1 CR |
5873 | Fs(~+)p Ft(',)g(the)g(v)-5 b(alue)33 b(of)g(the)g(shell)g(v)-5 |
| 5874 | b(ariable)34 b Fs(PWD)d Ft(replaces)j(the)f(tilde-pre\014x.)47 | |
| ac18b312 | 5875 | b(If)150 4054 y(the)31 b(tilde-pre\014x)f(is)g(`)p Fs(~-)p |
| 37c41ab1 CR |
5876 | Ft(',)h(the)f(v)-5 b(alue)31 b(of)g(the)f(shell)h(v)-5 |
| 5877 | b(ariable)31 b Fs(OLDPWD)p Ft(,)e(if)h(it)h(is)g(set,)g(is)f | |
| ac18b312 | 5878 | (substituted.)275 4191 y(If)f(the)h(c)m(haracters)h(follo)m(wing)h(the) |
| 37c41ab1 | 5879 | e(tilde)g(in)g(the)g(tilde-pre\014x)g(consist)g(of)g(a)h(n)m(um)m(b)s |
| ac18b312 | 5880 | (er)d Fq(N)p Ft(,)j(optionally)150 4300 y(pre\014xed)22 |
| 5e13499c | 5881 | b(b)m(y)h(a)h(`)p Fs(+)p Ft(')f(or)h(a)f(`)p Fs(-)p Ft(',)j(the)d |
| 37c41ab1 | 5882 | (tilde-pre\014x)g(is)h(replaced)f(with)g(the)h(corresp)s(onding)e |
| ac18b312 | 5883 | (elemen)m(t)j(from)e(the)150 4410 y(directory)36 b(stac)m(k,)i(as)e(it) |
| 37c41ab1 CR |
5884 | g(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m(y)g(the)f |
| 5885 | Fs(dirs)g Ft(builtin)g(in)m(v)m(ok)m(ed)i(with)e(the)g(c)m(haracters) | |
| ac18b312 | 5886 | 150 4519 y(follo)m(wing)40 b(tilde)f(in)g(the)f(tilde-pre\014x)h(as)g |
| 37c41ab1 | 5887 | (an)f(argumen)m(t)h(\(see)h(Section)f(6.8)h([The)e(Directory)i(Stac)m |
| 28157acd | 5888 | (k],)150 4629 y(page)c(77\).)57 b(If)35 b(the)g(tilde-pre\014x,)i(sans) |
| 37c41ab1 | 5889 | e(the)h(tilde,)h(consists)f(of)g(a)f(n)m(um)m(b)s(er)f(without)i(a)f |
| ac18b312 CR |
5890 | (leading)h(`)p Fs(+)p Ft(')g(or)150 4739 y(`)p Fs(-)p |
| 5891 | Ft(',)31 b(`)p Fs(+)p Ft(')f(is)h(assumed.)275 4875 y(If)e(the)i(login) | |
| 37c41ab1 CR |
5892 | g(name)g(is)f(in)m(v)-5 b(alid,)31 b(or)g(the)f(tilde)h(expansion)f |
| 5893 | (fails,)i(the)e(w)m(ord)g(is)h(left)g(unc)m(hanged.)275 | |
| ac18b312 | 5894 | 5011 y(Eac)m(h)38 b(v)-5 b(ariable)38 b(assignmen)m(t)h(is)e(c)m(hec)m |
| eb2bb562 | 5895 | (k)m(ed)j(for)d(unquoted)g(tilde-pre\014xes)h(immediately)g(follo)m |
| ac18b312 | 5896 | (wing)150 5121 y(a)d(`)p Fs(:)p Ft(')g(or)g(the)g(\014rst)f(`)p |
| eb2bb562 CR |
5897 | Fs(=)p Ft('.)54 b(In)34 b(these)h(cases,)i(tilde)e(expansion)g(is)g |
| 5898 | (also)h(p)s(erformed.)52 b(Consequen)m(tly)-8 b(,)37 | |
| ac18b312 | 5899 | b(one)150 5230 y(ma)m(y)27 b(use)e(\014le)h(names)g(with)g(tildes)g(in) |
| eb2bb562 CR |
5900 | g(assignmen)m(ts)h(to)g Fs(PATH)p Ft(,)f Fs(MAILPATH)p |
| 5901 | Ft(,)e(and)i Fs(CDPATH)p Ft(,)f(and)h(the)g(shell)150 | |
| ac18b312 CR |
5902 | 5340 y(assigns)31 b(the)f(expanded)g(v)-5 b(alue.)p eop |
| 5903 | end | |
| eb2bb562 CR |
5904 | %%Page: 19 25 |
| 5905 | TeXDict begin 19 24 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| ac18b312 CR |
5906 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(19)275 299 |
| 5907 | y(The)29 b(follo)m(wing)j(table)g(sho)m(ws)e(ho)m(w)g(Bash)h(treats)g | |
| 5908 | (unquoted)e(tilde-pre\014xes:)150 472 y Fs(~)432 b Ft(The)30 | |
| 5909 | b(v)-5 b(alue)31 b(of)f Fs($HOME)150 641 y(~/foo)240 | |
| 5910 | b Ft(`)p Fs($HOME/foo)p Ft(')150 809 y Fs(~fred/foo)630 | |
| 5911 | 919 y Ft(The)30 b(sub)s(directory)f Fs(foo)h Ft(of)g(the)h(home)f | |
| 5912 | (directory)h(of)g(the)f(user)g Fs(fred)150 1087 y(~+/foo)192 | |
| 5913 | b Ft(`)p Fs($PWD/foo)p Ft(')150 1256 y Fs(~-/foo)g Ft(`)p | |
| 5914 | Fs(${OLDPWD-'~-'}/foo)p Ft(')150 1424 y Fs(~)p Fj(N)384 | |
| 5915 | b Ft(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m(ed)h(b)m | |
| 5916 | (y)f(`)p Fs(dirs)g(+)p Fj(N)11 b Ft(')150 1593 y Fs(~+)p | |
| 5917 | Fj(N)336 b Ft(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g(displa)m(y)m | |
| 5918 | (ed)h(b)m(y)f(`)p Fs(dirs)g(+)p Fj(N)11 b Ft(')150 1761 | |
| 5919 | y Fs(~-)p Fj(N)336 b Ft(The)30 b(string)g(that)h(w)m(ould)f(b)s(e)g | |
| 5920 | (displa)m(y)m(ed)h(b)m(y)f(`)p Fs(dirs)g(-)p Fj(N)11 | |
| 5921 | b Ft(')150 2004 y Fk(3.5.3)63 b(Shell)41 b(P)m(arameter)f(Expansion)275 | |
| 5922 | 2257 y Ft(The)26 b(`)p Fs($)p Ft(')i(c)m(haracter)h(in)m(tro)s(duces)e | |
| 5923 | (parameter)h(expansion,)g(command)f(substitution,)h(or)g(arithmetic)150 | |
| 5924 | 2367 y(expansion.)38 b(The)22 b(parameter)h(name)f(or)g(sym)m(b)s(ol)h | |
| 5925 | (to)g(b)s(e)e(expanded)h(ma)m(y)h(b)s(e)f(enclosed)h(in)f(braces,)i | |
| 5926 | (whic)m(h)150 2476 y(are)31 b(optional)g(but)f(serv)m(e)h(to)h(protect) | |
| 5927 | f(the)g(v)-5 b(ariable)31 b(to)g(b)s(e)f(expanded)g(from)g(c)m | |
| 5928 | (haracters)i(immediately)150 2586 y(follo)m(wing)g(it)f(whic)m(h)f | |
| 5929 | (could)g(b)s(e)g(in)m(terpreted)h(as)f(part)h(of)f(the)h(name.)275 | |
| 5930 | 2729 y(When)44 b(braces)i(are)f(used,)j(the)e(matc)m(hing)g(ending)f | |
| 5931 | (brace)g(is)g(the)g(\014rst)g(`)p Fs(})p Ft(')g(not)g(escap)s(ed)h(b)m | |
| 5932 | (y)f(a)150 2839 y(bac)m(kslash)40 b(or)f(within)g(a)g(quoted)g(string,) | |
| 5933 | j(and)c(not)i(within)e(an)h(em)m(b)s(edded)f(arithmetic)j(expansion,) | |
| 5934 | 150 2949 y(command)30 b(substitution,)g(or)h(parameter)g(expansion.)275 | |
| 5935 | 3092 y(The)40 b(basic)h(form)g(of)g(parameter)h(expansion)e(is)h($)p | |
| 37c41ab1 | 5936 | Fs({)p Fq(parameter)7 b Fs(})p Ft(.)73 b(The)40 b(v)-5 |
| ac18b312 | 5937 | b(alue)42 b(of)f Fq(parameter)48 b Ft(is)150 3202 y(substituted.)43 |
| 37c41ab1 CR |
5938 | b(The)31 b(braces)g(are)h(required)e(when)h Fq(parameter)38 |
| 5939 | b Ft(is)31 b(a)h(p)s(ositional)g(parameter)g(with)f(more)150 | |
| ac18b312 | 5940 | 3311 y(than)h(one)g(digit,)i(or)e(when)g Fq(parameter)39 |
| 37c41ab1 | 5941 | b Ft(is)32 b(follo)m(w)m(ed)i(b)m(y)e(a)h(c)m(haracter)h(that)e(is)h |
| ac18b312 CR |
5942 | (not)f(to)h(b)s(e)f(in)m(terpreted)150 3421 y(as)f(part)f(of)g(its)h |
| 5943 | (name.)275 3565 y(If)26 b(the)i(\014rst)f(c)m(haracter)i(of)e | |
| 37c41ab1 | 5944 | Fq(parameter)35 b Ft(is)27 b(an)g(exclamation)j(p)s(oin)m(t,)e(a)g(lev) |
| ac18b312 | 5945 | m(el)h(of)e(v)-5 b(ariable)29 b(indirection)150 3674 |
| eb2bb562 | 5946 | y(is)38 b(in)m(tro)s(duced.)62 b(Bash)38 b(uses)f(the)h(v)-5 |
| 37c41ab1 | 5947 | b(alue)38 b(of)g(the)g(v)-5 b(ariable)39 b(formed)e(from)g(the)h(rest)g |
| ac18b312 | 5948 | (of)g Fq(parameter)45 b Ft(as)150 3784 y(the)32 b(name)h(of)f(the)h(v) |
| eb2bb562 CR |
5949 | -5 b(ariable;)34 b(this)e(v)-5 b(ariable)33 b(is)g(then)f(expanded)f |
| 5950 | (and)h(that)h(v)-5 b(alue)32 b(is)h(used)e(in)h(the)h(rest)150 | |
| ac18b312 | 5951 | 3893 y(of)h(the)f(substitution,)i(rather)e(than)g(the)h(v)-5 |
| 37c41ab1 | 5952 | b(alue)34 b(of)g Fq(parameter)40 b Ft(itself.)51 b(This)33 |
| ac18b312 | 5953 | b(is)g(kno)m(wn)g(as)h Fs(indirect)150 4003 y(expansion)p |
| 37c41ab1 CR |
5954 | Ft(.)81 b(The)44 b(exceptions)h(to)h(this)e(are)h(the)g(expansions)f |
| 5955 | (of)h($)p Fs({)p Ft(!)p Fq(pre\014x*)8 b Fs(})43 b Ft(and)h($)p | |
| 5e13499c | 5956 | Fs({)p Ft(!)p Fq(name)5 b Ft([)p Fs(@)p Ft(])p Fs(})150 |
| ac18b312 | 5957 | 4112 y Ft(describ)s(ed)28 b(b)s(elo)m(w.)41 b(The)28 |
| 37c41ab1 | 5958 | b(exclamation)j(p)s(oin)m(t)f(m)m(ust)f(immediately)h(follo)m(w)g(the)g |
| ac18b312 CR |
5959 | (left)f(brace)h(in)f(order)f(to)150 4222 y(in)m(tro)s(duce)i |
| 5960 | (indirection.)275 4366 y(In)39 b(eac)m(h)i(of)g(the)f(cases)h(b)s(elo)m | |
| 37c41ab1 | 5961 | (w,)i Fq(w)m(ord)h Ft(is)c(sub)5 b(ject)40 b(to)h(tilde)f(expansion,)j |
| ac18b312 CR |
5962 | (parameter)e(expansion,)150 4475 y(command)30 b(substitution,)g(and)g |
| 5963 | (arithmetic)i(expansion.)275 4619 y(When)h(not)g(p)s(erforming)f | |
| 37c41ab1 | 5964 | (substring)g(expansion,)j(Bash)e(tests)h(for)f(a)h(parameter)g(that)g |
| ac18b312 | 5965 | (is)f(unset)g(or)150 4729 y(n)m(ull;)38 b(omitting)e(the)f(colon)h |
| 37c41ab1 | 5966 | (results)f(in)g(a)h(test)g(only)f(for)g(a)g(parameter)h(that)f(is)h |
| ac18b312 | 5967 | (unset.)54 b(Put)35 b(another)150 4838 y(w)m(a)m(y)-8 |
| 37c41ab1 CR |
5968 | b(,)31 b(if)e(the)g(colon)h(is)f(included,)f(the)h(op)s(erator)h(tests) |
| 5969 | f(for)g(b)s(oth)f(existence)i(and)f(that)g(the)g(v)-5 | |
| ac18b312 | 5970 | b(alue)30 b(is)f(not)150 4948 y(n)m(ull;)i(if)f(the)g(colon)i(is)e |
| 37c41ab1 | 5971 | (omitted,)i(the)e(op)s(erator)h(tests)g(only)g(for)f(existence.)150 |
| ac18b312 CR |
5972 | 5121 y Fs(${)p Fj(parameter)11 b Fs(:)p Fp(\000)p Fj(word)g |
| 5973 | Fs(})630 5230 y Ft(If)30 b Fq(parameter)37 b Ft(is)30 | |
| 37c41ab1 | 5974 | b(unset)g(or)h(n)m(ull,)f(the)h(expansion)f(of)g Fq(w)m(ord)k |
| ac18b312 CR |
5975 | Ft(is)c(substituted.)40 b(Otherwise,)630 5340 y(the)31 |
| 5976 | b(v)-5 b(alue)30 b(of)h Fq(parameter)37 b Ft(is)31 b(substituted.)p | |
| 9d2b70f0 CR |
5977 | eop end |
| 5978 | %%Page: 20 26 | |
| 5979 | TeXDict begin 20 25 bop 150 -116 a Ft(20)2572 b(Bash)31 | |
| 5980 | b(Reference)g(Man)m(ual)150 299 y Fs(${)p Fj(parameter)11 | |
| ac18b312 CR |
5981 | b Fs(:=)p Fj(word)g Fs(})630 408 y Ft(If)33 b Fq(parameter)40 |
| 5982 | b Ft(is)33 b(unset)f(or)h(n)m(ull,)h(the)f(expansion)g(of)g | |
| 5983 | Fq(w)m(ord)j Ft(is)d(assigned)g(to)h Fq(parameter)p Ft(.)630 | |
| 5984 | 518 y(The)c(v)-5 b(alue)32 b(of)f Fq(parameter)38 b Ft(is)31 | |
| 5985 | b(then)g(substituted.)42 b(P)m(ositional)33 b(parameters)e(and)f(sp)s | |
| 5986 | (ecial)630 628 y(parameters)h(ma)m(y)g(not)f(b)s(e)g(assigned)h(to)g | |
| 28157acd CR |
5987 | (in)f(this)g(w)m(a)m(y)-8 b(.)150 805 y Fs(${)p Fj(parameter)11 |
| 5988 | b Fs(:?)p Fj(word)g Fs(})630 914 y Ft(If)26 b Fq(parameter)33 | |
| 9d2b70f0 CR |
5989 | b Ft(is)26 b(n)m(ull)g(or)g(unset,)h(the)f(expansion)g(of)g |
| 5990 | Fq(w)m(ord)k Ft(\(or)c(a)h(message)g(to)g(that)f(e\013ect)630 | |
| 28157acd | 5991 | 1024 y(if)i Fq(w)m(ord)j Ft(is)d(not)g(presen)m(t\))h(is)f(written)g |
| ac18b312 | 5992 | (to)h(the)f(standard)f(error)h(and)f(the)h(shell,)h(if)f(it)h(is)f(not) |
| 28157acd | 5993 | 630 1133 y(in)m(teractiv)m(e,)33 b(exits.)42 b(Otherwise,)30 |
| 9d2b70f0 | 5994 | b(the)h(v)-5 b(alue)31 b(of)f Fq(parameter)38 b Ft(is)30 |
| 28157acd CR |
5995 | b(substituted.)150 1310 y Fs(${)p Fj(parameter)11 b Fs(:+)p |
| 5996 | Fj(word)g Fs(})630 1420 y Ft(If)35 b Fq(parameter)42 | |
| ac18b312 | 5997 | b Ft(is)36 b(n)m(ull)f(or)h(unset,)g(nothing)g(is)f(substituted,)i |
| 28157acd CR |
5998 | (otherwise)e(the)h(expansion)630 1530 y(of)31 b Fq(w)m(ord)i |
| 5999 | Ft(is)e(substituted.)150 1707 y Fs(${)p Fj(parameter)11 | |
| 6000 | b Fs(:)p Fj(offset)g Fs(})150 1816 y(${)p Fj(parameter)g | |
| 5e13499c | 6001 | Fs(:)p Fj(offset)g Fs(:)p Fj(le)o(ngt)o(h)g Fs(})630 |
| 28157acd | 6002 | 1926 y Ft(Expands)44 b(to)i(up)e(to)i Fq(length)g Ft(c)m(haracters)h |
| 37c41ab1 | 6003 | (of)e Fq(parameter)53 b Ft(starting)46 b(at)g(the)f(c)m(haracter)630 |
| 28157acd | 6004 | 2035 y(sp)s(eci\014ed)30 b(b)m(y)h Fq(o\013set)p Ft(.)42 |
| 37c41ab1 | 6005 | b(If)31 b Fq(length)g Ft(is)g(omitted,)h(expands)e(to)h(the)g |
| 28157acd | 6006 | (substring)f(of)g Fq(parameter)630 2145 y Ft(starting)38 |
| 9d2b70f0 CR |
6007 | b(at)g(the)f(c)m(haracter)i(sp)s(eci\014ed)e(b)m(y)g |
| 6008 | Fq(o\013set)p Ft(.)62 b Fq(length)38 b Ft(and)f Fq(o\013set)j | |
| 28157acd CR |
6009 | Ft(are)e(arithmetic)630 2255 y(expressions)30 b(\(see)i(Section)g(6.5)g |
| 6010 | ([Shell)f(Arithmetic],)h(page)g(74\).)43 b(This)30 b(is)h(referred)f | |
| 6011 | (to)i(as)630 2364 y(Substring)d(Expansion.)630 2508 y | |
| 9d2b70f0 CR |
6012 | Fq(length)j Ft(m)m(ust)f(ev)-5 b(aluate)33 b(to)f(a)g(n)m(um)m(b)s(er)e |
| 6013 | (greater)i(than)f(or)g(equal)h(to)g(zero.)45 b(If)30 | |
| 28157acd | 6014 | b Fq(o\013set)35 b Ft(ev)-5 b(al-)630 2617 y(uates)36 |
| 9d2b70f0 CR |
6015 | b(to)h(a)f(n)m(um)m(b)s(er)e(less)i(than)f(zero,)j(the)e(v)-5 |
| 6016 | b(alue)36 b(is)g(used)f(as)g(an)h(o\013set)h(from)e(the)h(end)630 | |
| 28157acd | 6017 | 2727 y(of)i(the)f(v)-5 b(alue)38 b(of)g Fq(parameter)p |
| eb2bb562 CR |
6018 | Ft(.)62 b(If)37 b Fq(parameter)45 b Ft(is)37 b(`)p Fs(@)p |
| 6019 | Ft(',)j(the)d(result)h(is)f Fq(length)h Ft(p)s(ositional)630 | |
| 28157acd | 6020 | 2836 y(parameters)d(b)s(eginning)e(at)i Fq(o\013set)p |
| eb2bb562 | 6021 | Ft(.)54 b(If)34 b Fq(parameter)41 b Ft(is)34 b(an)h(arra)m(y)f(name)h |
| 28157acd | 6022 | (indexed)f(b)m(y)g(`)p Fs(@)p Ft(')630 2946 y(or)f(`)p |
| eb2bb562 CR |
6023 | Fs(*)p Ft(',)g(the)g(result)g(is)g(the)g Fq(length)g |
| 6024 | Ft(mem)m(b)s(ers)f(of)h(the)g(arra)m(y)g(b)s(eginning)f(with)g | |
| 28157acd | 6025 | Fs(${)p Fj(param-)630 3055 y(eter)11 b Fs([)p Fj(offset)g |
| eb2bb562 CR |
6026 | Fs(]})p Ft(.)65 b(A)40 b(negativ)m(e)j Fq(o\013set)g |
| 6027 | Ft(is)d(tak)m(en)h(relativ)m(e)h(to)f(one)g(greater)g(than)f(the)630 | |
| 28157acd CR |
6028 | 3165 y(maxim)m(um)27 b(index)g(of)g(the)h(sp)s(eci\014ed)e(arra)m(y)-8 |
| 6029 | b(.)41 b(Note)28 b(that)g(a)g(negativ)m(e)h(o\013set)f(m)m(ust)f(b)s(e) | |
| 6030 | g(sep-)630 3275 y(arated)d(from)e(the)i(colon)g(b)m(y)f(at)h(least)g | |
| 6031 | (one)g(space)f(to)h(a)m(v)m(oid)h(b)s(eing)d(confused)h(with)g(the)g(`) | |
| 6032 | p Fs(:-)p Ft(')630 3384 y(expansion.)61 b(Substring)35 | |
| 6033 | b(indexing)i(is)g(zero-based)h(unless)e(the)i(p)s(ositional)g | |
| 6034 | (parameters)630 3494 y(are)31 b(used,)f(in)g(whic)m(h)g(case)h(the)g | |
| 6035 | (indexing)f(starts)h(at)g(1.)150 3671 y Fs(${!)p Fj(prefix)11 | |
| 6036 | b Fs(*})150 3780 y(${!)p Fj(prefix)g Fs(@})630 3890 y | |
| 6037 | Ft(Expands)34 b(to)j(the)f(names)g(of)g(v)-5 b(ariables)37 | |
| 6038 | b(whose)e(names)h(b)s(egin)f(with)h Fq(pre\014x)p Ft(,)g(separated)630 | |
| 6039 | 4000 y(b)m(y)30 b(the)h(\014rst)e(c)m(haracter)j(of)f(the)g | |
| 6040 | Fs(IFS)e Ft(sp)s(ecial)i(v)-5 b(ariable.)150 4177 y Fs(${!)p | |
| 6041 | Fj(name)11 b Fs([@]})150 4286 y(${!)p Fj(name)g Fs([*]})630 | |
| 6042 | 4396 y Ft(If)26 b Fq(name)32 b Ft(is)27 b(an)f(arra)m(y)h(v)-5 | |
| 6043 | b(ariable,)29 b(expands)d(to)h(the)g(list)g(of)g(arra)m(y)g(indices)g | |
| 6044 | (\(k)m(eys\))h(assigned)630 4505 y(in)c Fq(name)p Ft(.)39 | |
| 6045 | b(If)24 b Fq(name)30 b Ft(is)24 b(not)h(an)f(arra)m(y)-8 | |
| 6046 | b(,)27 b(expands)c(to)j(0)f(if)f Fq(name)30 b Ft(is)24 | |
| 6047 | b(set)h(and)f(n)m(ull)g(otherwise.)630 4615 y(When)39 | |
| 6048 | b(`)p Fs(@)p Ft(')h(is)f(used)g(and)f(the)i(expansion)f(app)s(ears)g | |
| 6049 | (within)f(double)h(quotes,)k(eac)m(h)d(k)m(ey)630 4725 | |
| 6050 | y(expands)30 b(to)h(a)f(separate)i(w)m(ord.)150 4902 | |
| 6051 | y Fs(${#)p Fj(parameter)11 b Fs(})630 5011 y Ft(The)40 | |
| 37c41ab1 CR |
6052 | b(length)g(in)g(c)m(haracters)i(of)e(the)h(expanded)e(v)-5 |
| 6053 | b(alue)41 b(of)f Fq(parameter)47 b Ft(is)40 b(substituted.)630 | |
| 28157acd | 6054 | 5121 y(If)i Fq(parameter)50 b Ft(is)43 b(`)p Fs(*)p Ft(')g(or)g(`)p |
| 37c41ab1 | 6055 | Fs(@)p Ft(',)k(the)c(v)-5 b(alue)43 b(substituted)f(is)h(the)g(n)m(um)m |
| 28157acd CR |
6056 | (b)s(er)f(of)h(p)s(ositional)630 5230 y(parameters.)i(If)32 |
| 6057 | b Fq(parameter)38 b Ft(is)32 b(an)g(arra)m(y)g(name)g(subscripted)f(b)m | |
| 6058 | (y)g(`)p Fs(*)p Ft(')h(or)g(`)p Fs(@)p Ft(',)g(the)g(v)-5 | |
| 6059 | b(alue)630 5340 y(substituted)30 b(is)g(the)h(n)m(um)m(b)s(er)e(of)h | |
| 6060 | (elemen)m(ts)i(in)e(the)h(arra)m(y)-8 b(.)p eop end | |
| ac18b312 CR |
6061 | %%Page: 21 27 |
| 6062 | TeXDict begin 21 26 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 28157acd CR |
6063 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(21)150 299 |
| 6064 | y Fs(${)p Fj(parameter)11 b Fs(#)p Fj(word)g Fs(})150 | |
| 6065 | 408 y(${)p Fj(parameter)g Fs(##)p Fj(word)g Fs(})630 | |
| 6066 | 518 y Ft(The)31 b Fq(w)m(ord)k Ft(is)d(expanded)f(to)i(pro)s(duce)e(a)h | |
| 6067 | (pattern)g(just)f(as)i(in)e(\014lename)h(expansion)g(\(see)630 | |
| 6068 | 628 y(Section)k(3.5.8)h([Filename)g(Expansion],)g(page)f(23\).)56 | |
| 6069 | b(If)35 b(the)h(pattern)f(matc)m(hes)i(the)e(b)s(e-)630 | |
| 6070 | 737 y(ginning)28 b(of)g(the)h(expanded)e(v)-5 b(alue)29 | |
| 6071 | b(of)f Fq(parameter)p Ft(,)h(then)f(the)g(result)g(of)h(the)f | |
| 6072 | (expansion)g(is)630 847 y(the)36 b(expanded)f(v)-5 b(alue)36 | |
| ac18b312 | 6073 | b(of)g Fq(parameter)43 b Ft(with)35 b(the)h(shortest)g(matc)m(hing)h |
| 28157acd | 6074 | (pattern)f(\(the)g(`)p Fs(#)p Ft(')630 956 y(case\))26 |
| ac18b312 CR |
6075 | b(or)f(the)g(longest)g(matc)m(hing)h(pattern)f(\(the)g(`)p |
| 6076 | Fs(##)p Ft(')g(case\))h(deleted.)39 b(If)24 b Fq(parameter)32 | |
| 28157acd | 6077 | b Ft(is)25 b(`)p Fs(@)p Ft(')630 1066 y(or)j(`)p Fs(*)p |
| ac18b312 CR |
6078 | Ft(',)i(the)e(pattern)h(remo)m(v)-5 b(al)29 b(op)s(eration)g(is)f |
| 6079 | (applied)h(to)g(eac)m(h)g(p)s(ositional)g(parameter)g(in)630 | |
| 28157acd | 6080 | 1176 y(turn,)i(and)g(the)h(expansion)g(is)g(the)g(resultan)m(t)g(list.) |
| ac18b312 | 6081 | 45 b(If)32 b Fq(parameter)38 b Ft(is)32 b(an)g(arra)m(y)g(v)-5 |
| 28157acd | 6082 | b(ariable)630 1285 y(subscripted)39 b(with)g(`)p Fs(@)p |
| ac18b312 CR |
6083 | Ft(')h(or)g(`)p Fs(*)p Ft(',)j(the)d(pattern)h(remo)m(v)-5 |
| 6084 | b(al)41 b(op)s(eration)f(is)g(applied)g(to)h(eac)m(h)630 | |
| 28157acd CR |
6085 | 1395 y(mem)m(b)s(er)30 b(of)g(the)h(arra)m(y)g(in)f(turn,)f(and)h(the)h |
| 6086 | (expansion)f(is)g(the)h(resultan)m(t)g(list.)150 1553 | |
| 5e13499c | 6087 | y Fs(${)p Fj(parameter)11 b Fs(\045)p Fj(word)g Fs(})150 |
| 28157acd CR |
6088 | 1662 y(${)p Fj(parameter)g Fs(\045\045)p Fj(word)g Fs(})630 |
| 6089 | 1772 y Ft(The)35 b Fq(w)m(ord)k Ft(is)c(expanded)g(to)h(pro)s(duce)e(a) | |
| 37c41ab1 | 6090 | i(pattern)f(just)g(as)h(in)f(\014lename)h(expansion.)55 |
| 28157acd | 6091 | b(If)630 1881 y(the)43 b(pattern)g(matc)m(hes)h(a)g(trailing)g(p)s |
| 37c41ab1 | 6092 | (ortion)e(of)h(the)g(expanded)g(v)-5 b(alue)43 b(of)g |
| 28157acd | 6093 | Fq(parameter)p Ft(,)630 1991 y(then)c(the)g(result)g(of)h(the)f |
| 37c41ab1 | 6094 | (expansion)g(is)h(the)f(v)-5 b(alue)40 b(of)f Fq(parameter)46 |
| 28157acd | 6095 | b Ft(with)39 b(the)h(shortest)630 2100 y(matc)m(hing)31 |
| 37c41ab1 | 6096 | b(pattern)e(\(the)h(`)p Fs(\045)p Ft(')g(case\))h(or)e(the)h(longest)h |
| 9d2b70f0 | 6097 | (matc)m(hing)f(pattern)g(\(the)g(`)p Fs(\045\045)p Ft(')g(case\))630 |
| 28157acd | 6098 | 2210 y(deleted.)49 b(If)32 b Fq(parameter)40 b Ft(is)33 |
| 9d2b70f0 | 6099 | b(`)p Fs(@)p Ft(')g(or)g(`)p Fs(*)p Ft(',)h(the)f(pattern)g(remo)m(v)-5 |
| 28157acd | 6100 | b(al)34 b(op)s(eration)g(is)f(applied)f(to)630 2320 y(eac)m(h)38 |
| eb2bb562 | 6101 | b(p)s(ositional)g(parameter)g(in)f(turn,)h(and)e(the)h(expansion)g(is)h |
| 28157acd | 6102 | (the)f(resultan)m(t)h(list.)61 b(If)630 2429 y Fq(parameter)38 |
| eb2bb562 CR |
6103 | b Ft(is)32 b(an)f(arra)m(y)h(v)-5 b(ariable)32 b(subscripted)e(with)h |
| 6104 | (`)p Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)g(the)f(pattern)h(remo)m(v)-5 | |
| 28157acd | 6105 | b(al)630 2539 y(op)s(eration)30 b(is)g(applied)f(to)i(eac)m(h)g(mem)m |
| 9d2b70f0 | 6106 | (b)s(er)e(of)h(the)g(arra)m(y)g(in)f(turn,)g(and)g(the)h(expansion)g |
| 28157acd | 6107 | (is)630 2648 y(the)h(resultan)m(t)g(list.)150 2806 y |
| 9d2b70f0 | 6108 | Fs(${)p Fj(parameter)11 b Fs(/)p Fj(pattern)g Fs(/)p |
| 28157acd | 6109 | Fj(s)o(tri)o(ng)f Fs(})630 2916 y Ft(The)37 b Fq(pattern)g |
| ac18b312 | 6110 | Ft(is)g(expanded)g(to)h(pro)s(duce)e(a)h(pattern)g(just)g(as)h(in)e |
| 28157acd | 6111 | (\014lename)i(expansion.)630 3025 y Fq(P)m(arameter)46 |
| ac18b312 CR |
6112 | b Ft(is)38 b(expanded)f(and)g(the)i(longest)g(matc)m(h)g(of)f |
| 6113 | Fq(pattern)g Ft(against)h(its)f(v)-5 b(alue)39 b(is)630 | |
| 28157acd | 6114 | 3135 y(replaced)34 b(with)e Fq(string)p Ft(.)49 b(If)33 |
| ac18b312 | 6115 | b Fq(pattern)g Ft(b)s(egins)g(with)f(`)p Fs(/)p Ft(',)j(all)f(matc)m |
| 28157acd | 6116 | (hes)g(of)f Fq(pattern)g Ft(are)h(re-)630 3244 y(placed)28 |
| ac18b312 CR |
6117 | b(with)f Fq(string)p Ft(.)40 b(Normally)28 b(only)f(the)h(\014rst)e |
| 6118 | (matc)m(h)j(is)e(replaced.)40 b(If)27 b Fq(pattern)g | |
| 28157acd | 6119 | Ft(b)s(egins)630 3354 y(with)34 b(`)p Fs(#)p Ft(',)h(it)g(m)m(ust)f |
| ac18b312 | 6120 | (matc)m(h)h(at)f(the)h(b)s(eginning)e(of)h(the)g(expanded)f(v)-5 |
| 28157acd | 6121 | b(alue)35 b(of)f Fq(parameter)p Ft(.)630 3464 y(If)g |
| ac18b312 CR |
6122 | Fq(pattern)g Ft(b)s(egins)g(with)g(`)p Fs(\045)p Ft(',)h(it)g(m)m(ust)f |
| 6123 | (matc)m(h)h(at)g(the)f(end)g(of)g(the)h(expanded)e(v)-5 | |
| 28157acd | 6124 | b(alue)35 b(of)630 3573 y Fq(parameter)p Ft(.)41 b(If)29 |
| ac18b312 CR |
6125 | b Fq(string)37 b Ft(is)29 b(n)m(ull,)h(matc)m(hes)h(of)e |
| 6126 | Fq(pattern)h Ft(are)g(deleted)g(and)f(the)g Fs(/)g Ft(follo)m(wing)630 | |
| 28157acd | 6127 | 3683 y Fq(pattern)34 b Ft(ma)m(y)g(b)s(e)f(omitted.)51 |
| ac18b312 CR |
6128 | b(If)33 b Fq(parameter)41 b Ft(is)33 b(`)p Fs(@)p Ft(')h(or)g(`)p |
| 6129 | Fs(*)p Ft(',)g(the)g(substitution)f(op)s(eration)630 | |
| 28157acd | 6130 | 3792 y(is)38 b(applied)g(to)g(eac)m(h)h(p)s(ositional)g(parameter)f(in) |
| ac18b312 | 6131 | g(turn,)h(and)e(the)h(expansion)g(is)g(the)g(re-)630 |
| 28157acd | 6132 | 3902 y(sultan)m(t)f(list.)59 b(If)36 b Fq(parameter)43 |
| ac18b312 | 6133 | b Ft(is)36 b(an)g(arra)m(y)h(v)-5 b(ariable)37 b(subscripted)e(with)h |
| 28157acd | 6134 | (`)p Fs(@)p Ft(')g(or)h(`)p Fs(*)p Ft(',)h(the)630 4012 |
| ac18b312 CR |
6135 | y(substitution)30 b(op)s(eration)h(is)f(applied)g(to)h(eac)m(h)g(mem)m |
| 6136 | (b)s(er)f(of)g(the)h(arra)m(y)g(in)f(turn,)f(and)h(the)630 | |
| 28157acd CR |
6137 | 4121 y(expansion)g(is)h(the)f(resultan)m(t)h(list.)150 |
| 6138 | 4343 y Fk(3.5.4)63 b(Command)41 b(Substitution)275 4586 | |
| ac18b312 CR |
6139 | y Ft(Command)29 b(substitution)i(allo)m(ws)h(the)f(output)g(of)g(a)g |
| 6140 | (command)g(to)g(replace)h(the)f(command)g(itself.)150 | |
| 28157acd CR |
6141 | 4696 y(Command)e(substitution)h(o)s(ccurs)h(when)e(a)i(command)f(is)g |
| 6142 | (enclosed)h(as)g(follo)m(ws:)390 4829 y Fs($\()p Fj(command)11 | |
| 6143 | b Fs(\))150 4963 y Ft(or)390 5097 y Fs(`)p Fj(command)g | |
| 6144 | Fs(`)150 5230 y Ft(Bash)45 b(p)s(erforms)f(the)h(expansion)f(b)m(y)h | |
| 6145 | (executing)i Fq(command)h Ft(and)c(replacing)i(the)f(command)g(sub-)150 | |
| 6146 | 5340 y(stitution)c(with)f(the)g(standard)g(output)g(of)g(the)g | |
| 6147 | (command,)j(with)d(an)m(y)h(trailing)g(newlines)f(deleted.)p | |
| 6148 | eop end | |
| 9d2b70f0 CR |
6149 | %%Page: 22 28 |
| 6150 | TeXDict begin 22 27 bop 150 -116 a Ft(22)2572 b(Bash)31 | |
| 28157acd CR |
6151 | b(Reference)g(Man)m(ual)150 299 y(Em)m(b)s(edded)f(newlines)h(are)h |
| 6152 | (not)f(deleted,)i(but)e(they)g(ma)m(y)h(b)s(e)f(remo)m(v)m(ed)i(during) | |
| 6153 | d(w)m(ord)h(splitting.)44 b(The)150 408 y(command)21 | |
| 6154 | b(substitution)g Fs($\(cat)29 b Fj(file)11 b Fs(\))20 | |
| 6155 | b Ft(can)i(b)s(e)f(replaced)g(b)m(y)h(the)g(equiv)-5 | |
| 6156 | b(alen)m(t)22 b(but)f(faster)h Fs($\(<)30 b Fj(file)11 | |
| 6157 | b Fs(\))p Ft(.)275 547 y(When)33 b(the)i(old-st)m(yle)h(bac)m(kquote)f | |
| 6158 | (form)f(of)g(substitution)g(is)g(used,)h(bac)m(kslash)f(retains)h(its)f | |
| 6159 | (literal)150 656 y(meaning)k(except)h(when)e(follo)m(w)m(ed)j(b)m(y)e | |
| 6160 | (`)p Fs($)p Ft(',)j(`)p Fs(`)p Ft(',)f(or)e(`)p Fs(\\)p | |
| 6161 | Ft('.)64 b(The)38 b(\014rst)f(bac)m(kquote)j(not)e(preceded)g(b)m(y)g | |
| 6162 | (a)150 766 y(bac)m(kslash)j(terminates)g(the)f(command)g(substitution.) | |
| 6163 | 69 b(When)40 b(using)g(the)g Fs($\()p Fj(command)11 b | |
| 6164 | Fs(\))37 b Ft(form,)42 b(all)150 875 y(c)m(haracters)32 | |
| 6165 | b(b)s(et)m(w)m(een)f(the)f(paren)m(theses)h(mak)m(e)g(up)f(the)g | |
| 6166 | (command;)h(none)f(are)h(treated)g(sp)s(ecially)-8 b(.)275 | |
| 6167 | 1014 y(Command)22 b(substitutions)g(ma)m(y)i(b)s(e)e(nested.)39 | |
| 37c41ab1 | 6168 | b(T)-8 b(o)23 b(nest)g(when)f(using)h(the)g(bac)m(kquoted)h(form,)g |
| 28157acd CR |
6169 | (escap)s(e)150 1123 y(the)31 b(inner)e(bac)m(kquotes)j(with)e(bac)m |
| 6170 | (kslashes.)275 1262 y(If)e(the)i(substitution)e(app)s(ears)h(within)g | |
| 37c41ab1 | 6171 | (double)f(quotes,)i(w)m(ord)f(splitting)h(and)f(\014lename)g(expansion) |
| 28157acd CR |
6172 | 150 1371 y(are)i(not)f(p)s(erformed)f(on)h(the)h(results.)150 |
| 6173 | 1603 y Fk(3.5.5)63 b(Arithmetic)40 b(Expansion)275 1851 | |
| 37c41ab1 CR |
6174 | y Ft(Arithmetic)33 b(expansion)f(allo)m(ws)i(the)e(ev)-5 |
| 6175 | b(aluation)34 b(of)f(an)f(arithmetic)i(expression)e(and)g(the)g | |
| 28157acd CR |
6176 | (substi-)150 1960 y(tution)f(of)f(the)h(result.)40 b(The)30 |
| 6177 | b(format)h(for)f(arithmetic)i(expansion)e(is:)390 2098 | |
| 6178 | y Fs($\(\()47 b Fj(expression)55 b Fs(\)\))275 2237 y | |
| 9d2b70f0 CR |
6179 | Ft(The)33 b(expression)g(is)h(treated)g(as)g(if)g(it)g(w)m(ere)g |
| 6180 | (within)f(double)h(quotes,)h(but)e(a)h(double)f(quote)h(inside)150 | |
| 28157acd | 6181 | 2346 y(the)27 b(paren)m(theses)g(is)g(not)g(treated)h(sp)s(ecially)-8 |
| 9d2b70f0 | 6182 | b(.)41 b(All)27 b(tok)m(ens)h(in)e(the)h(expression)g(undergo)f |
| 28157acd | 6183 | (parameter)h(ex-)150 2456 y(pansion,)h(command)f(substitution,)h(and)f |
| 9d2b70f0 | 6184 | (quote)i(remo)m(v)-5 b(al.)41 b(Arithmetic)28 b(expansions)g(ma)m(y)g |
| 28157acd | 6185 | (b)s(e)f(nested.)275 2594 y(The)34 b(ev)-5 b(aluation)37 |
| 9d2b70f0 | 6186 | b(is)f(p)s(erformed)e(according)i(to)g(the)g(rules)f(listed)h(b)s(elo)m |
| 28157acd CR |
6187 | (w)g(\(see)g(Section)g(6.5)h([Shell)150 2704 y(Arithmetic],)32 |
| 6188 | b(page)f(74\).)42 b(If)30 b(the)h(expression)f(is)g(in)m(v)-5 | |
| 9d2b70f0 | 6189 | b(alid,)32 b(Bash)e(prin)m(ts)g(a)h(message)g(indicating)h(failure)150 |
| 28157acd CR |
6190 | 2813 y(to)f(the)g(standard)e(error)h(and)g(no)g(substitution)g(o)s |
| 6191 | (ccurs.)150 3045 y Fk(3.5.6)63 b(Pro)s(cess)42 b(Substitution)275 | |
| 6192 | 3293 y Ft(Pro)s(cess)33 b(substitution)h(is)g(supp)s(orted)e(on)h | |
| 9d2b70f0 | 6193 | (systems)h(that)h(supp)s(ort)d(named)h(pip)s(es)g(\()p |
| 28157acd | 6194 | Fl(fif)n(o)p Ft(s\))h(or)g(the)150 3402 y(`)p Fs(/dev/fd)p |
| 9d2b70f0 | 6195 | Ft(')29 b(metho)s(d)h(of)g(naming)g(op)s(en)g(\014les.)41 |
| 28157acd CR |
6196 | b(It)30 b(tak)m(es)i(the)f(form)f(of)390 3540 y Fs(<\()p |
| 6197 | Fj(list)11 b Fs(\))150 3679 y Ft(or)390 3817 y Fs(>\()p | |
| 6198 | Fj(list)g Fs(\))150 3955 y Ft(The)23 b(pro)s(cess)g Fq(list)j | |
| 9d2b70f0 CR |
6199 | Ft(is)d(run)f(with)h(its)h(input)f(or)g(output)g(connected)h(to)h(a)e |
| 6200 | Fl(fif)n(o)g Ft(or)h(some)g(\014le)f(in)g(`)p Fs(/dev/fd)p | |
| 28157acd | 6201 | Ft('.)150 4065 y(The)28 b(name)h(of)g(this)f(\014le)h(is)g(passed)f(as) |
| 9d2b70f0 | 6202 | h(an)f(argumen)m(t)h(to)h(the)f(curren)m(t)f(command)h(as)f(the)h |
| 28157acd | 6203 | (result)g(of)g(the)150 4174 y(expansion.)40 b(If)28 b(the)h |
| 9d2b70f0 CR |
6204 | Fs(>\()p Fj(list)11 b Fs(\))26 b Ft(form)i(is)h(used,)f(writing)h(to)g |
| 6205 | (the)g(\014le)f(will)h(pro)m(vide)g(input)f(for)g Fq(list)p | |
| 28157acd | 6206 | Ft(.)41 b(If)28 b(the)150 4284 y Fs(<\()p Fj(list)11 |
| 37c41ab1 CR |
6207 | b Fs(\))23 b Ft(form)h(is)i(used,)f(the)h(\014le)f(passed)g(as)g(an)g |
| 6208 | (argumen)m(t)h(should)e(b)s(e)h(read)g(to)h(obtain)g(the)f(output)g(of) | |
| 28157acd | 6209 | 150 4394 y Fq(list)p Ft(.)41 b(Note)31 b(that)f(no)g(space)g(ma)m(y)g |
| 5e13499c | 6210 | (app)s(ear)f(b)s(et)m(w)m(een)h(the)g Fs(<)f Ft(or)h |
| 37c41ab1 | 6211 | Fs(>)f Ft(and)g(the)h(left)g(paren)m(thesis,)h(otherwise)150 |
| 28157acd CR |
6212 | 4503 y(the)g(construct)f(w)m(ould)g(b)s(e)g(in)m(terpreted)h(as)f(a)h |
| 6213 | (redirection.)275 4641 y(When)36 b(a)m(v)-5 b(ailable,)40 | |
| 37c41ab1 | 6214 | b(pro)s(cess)c(substitution)h(is)f(p)s(erformed)f(sim)m(ultaneously)i |
| 28157acd | 6215 | (with)g(parameter)g(and)150 4751 y(v)-5 b(ariable)31 |
| 37c41ab1 | 6216 | b(expansion,)g(command)f(substitution,)g(and)g(arithmetic)i(expansion.) |
| 28157acd CR |
6217 | 150 4983 y Fk(3.5.7)63 b(W)-10 b(ord)41 b(Splitting)275 |
| 6218 | 5230 y Ft(The)35 b(shell)i(scans)f(the)g(results)g(of)g(parameter)h | |
| 6219 | (expansion,)h(command)d(substitution,)j(and)e(arith-)150 | |
| 6220 | 5340 y(metic)31 b(expansion)g(that)g(did)e(not)i(o)s(ccur)f(within)g | |
| 6221 | (double)g(quotes)h(for)f(w)m(ord)g(splitting.)p eop end | |
| ac18b312 CR |
6222 | %%Page: 23 29 |
| 6223 | TeXDict begin 23 28 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 28157acd | 6224 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(23)275 299 |
| 37c41ab1 CR |
6225 | y(The)43 b(shell)h(treats)h(eac)m(h)h(c)m(haracter)f(of)g |
| 6226 | Fs($IFS)e Ft(as)h(a)g(delimiter,)49 b(and)43 b(splits)h(the)h(results)e | |
| 28157acd | 6227 | (of)i(the)150 408 y(other)40 b(expansions)f(in)m(to)i(w)m(ords)e(on)h |
| 37c41ab1 | 6228 | (these)g(c)m(haracters.)70 b(If)39 b Fs(IFS)g Ft(is)h(unset,)i(or)d |
| 28157acd CR |
6229 | (its)h(v)-5 b(alue)40 b(is)g(exactly)150 518 y Fs |
| 6230 | (<space><tab><newline>)p Ft(,)20 b(the)25 b(default,)h(then)e(an)m(y)g | |
| 6231 | (sequence)h(of)g Fs(IFS)e Ft(c)m(haracters)j(serv)m(es)f(to)g(delimit) | |
| 6232 | 150 628 y(w)m(ords.)38 b(If)21 b Fs(IFS)h Ft(has)g(a)h(v)-5 | |
| 6233 | b(alue)23 b(other)f(than)h(the)f(default,)j(then)d(sequences)g(of)h | |
| 6234 | (the)f(whitespace)h(c)m(haracters)150 737 y Fs(space)j | |
| 6235 | Ft(and)h Fs(tab)g Ft(are)h(ignored)g(at)h(the)f(b)s(eginning)f(and)g | |
| 6236 | (end)g(of)h(the)g(w)m(ord,)g(as)g(long)g(as)g(the)g(whitespace)150 | |
| 6237 | 847 y(c)m(haracter)34 b(is)f(in)f(the)h(v)-5 b(alue)33 | |
| 6238 | b(of)f Fs(IFS)g Ft(\(an)h Fs(IFS)e Ft(whitespace)j(c)m(haracter\).)49 | |
| 6239 | b(An)m(y)32 b(c)m(haracter)i(in)f Fs(IFS)e Ft(that)150 | |
| 6240 | 956 y(is)f(not)h Fs(IFS)f Ft(whitespace,)h(along)g(with)f(an)m(y)h | |
| 6241 | (adjacen)m(t)h Fs(IFS)d Ft(whitespace)i(c)m(haracters,)h(delimits)f(a)g | |
| 6242 | (\014eld.)150 1066 y(A)h(sequence)h(of)f Fs(IFS)f Ft(whitespace)i(c)m | |
| 6243 | (haracters)h(is)e(also)h(treated)g(as)g(a)f(delimiter.)47 | |
| 6244 | b(If)32 b(the)g(v)-5 b(alue)33 b(of)f Fs(IFS)150 1176 | |
| 6245 | y Ft(is)e(n)m(ull,)h(no)f(w)m(ord)g(splitting)h(o)s(ccurs.)275 | |
| 6246 | 1304 y(Explicit)44 b(n)m(ull)f(argumen)m(ts)g(\()p Fs("")g | |
| 6247 | Ft(or)h Fs('')p Ft(\))f(are)g(retained.)80 b(Unquoted)43 | |
| 6248 | b(implicit)h(n)m(ull)f(argumen)m(ts,)150 1414 y(resulting)24 | |
| 6249 | b(from)f(the)g(expansion)g(of)h(parameters)g(that)g(ha)m(v)m(e)h(no)e | |
| 6250 | (v)-5 b(alues,)25 b(are)f(remo)m(v)m(ed.)40 b(If)23 b(a)g(parameter)150 | |
| 6251 | 1524 y(with)30 b(no)g(v)-5 b(alue)31 b(is)g(expanded)e(within)h(double) | |
| ac18b312 | 6252 | g(quotes,)h(a)g(n)m(ull)f(argumen)m(t)h(results)f(and)g(is)g(retained.) |
| 28157acd CR |
6253 | 275 1652 y(Note)h(that)g(if)g(no)f(expansion)g(o)s(ccurs,)g(no)h |
| 6254 | (splitting)g(is)f(p)s(erformed.)150 1859 y Fk(3.5.8)63 | |
| 6255 | b(Filename)41 b(Expansion)275 2098 y Ft(After)22 b(w)m(ord)g | |
| 6256 | (splitting,)j(unless)d(the)h(`)p Fs(-f)p Ft(')f(option)h(has)f(b)s(een) | |
| 6257 | g(set)h(\(see)g(Section)h(4.3)f([The)f(Set)h(Builtin],)150 | |
| 6258 | 2207 y(page)k(53\),)i(Bash)d(scans)h(eac)m(h)h(w)m(ord)e(for)g(the)h(c) | |
| 6259 | m(haracters)g(`)p Fs(*)p Ft(',)h(`)p Fs(?)p Ft(',)g(and)e(`)p | |
| 6260 | Fs([)p Ft('.)39 b(If)26 b(one)h(of)g(these)f(c)m(haracters)150 | |
| 6261 | 2317 y(app)s(ears,)h(then)f(the)h(w)m(ord)f(is)h(regarded)g(as)g(a)g | |
| 6262 | Fq(pattern)p Ft(,)g(and)g(replaced)g(with)f(an)h(alphab)s(etically)h | |
| 6263 | (sorted)150 2426 y(list)k(of)g(\014le)g(names)g(matc)m(hing)h(the)f | |
| 6264 | (pattern.)45 b(If)32 b(no)f(matc)m(hing)i(\014le)f(names)g(are)g | |
| 6265 | (found,)f(and)h(the)g(shell)150 2536 y(option)c Fs(nullglob)e | |
| 6266 | Ft(is)i(disabled,)h(the)f(w)m(ord)g(is)g(left)g(unc)m(hanged.)40 | |
| 6267 | b(If)28 b(the)g Fs(nullglob)e Ft(option)i(is)g(set,)i(and)150 | |
| 6268 | 2645 y(no)38 b(matc)m(hes)h(are)f(found,)h(the)f(w)m(ord)f(is)h(remo)m | |
| 6269 | (v)m(ed.)65 b(If)37 b(the)h Fs(failglob)e Ft(shell)i(option)g(is)g | |
| 6270 | (set,)j(and)c(no)150 2755 y(matc)m(hes)f(are)g(found,)f(an)g(error)f | |
| 6271 | (message)j(is)e(prin)m(ted)f(and)h(the)g(command)g(is)g(not)g | |
| 6272 | (executed.)56 b(If)35 b(the)150 2865 y(shell)e(option)h | |
| 6273 | Fs(nocaseglob)c Ft(is)j(enabled,)h(the)g(matc)m(h)g(is)f(p)s(erformed)e | |
| 6274 | (without)i(regard)g(to)h(the)g(case)g(of)150 2974 y(alphab)s(etic)d(c)m | |
| 6275 | (haracters.)275 3103 y(When)21 b(a)i(pattern)f(is)g(used)g(for)f | |
| eb2bb562 CR |
6276 | (\014lename)i(generation,)i(the)d(c)m(haracter)i(`)p |
| 6277 | Fs(.)p Ft(')e(at)h(the)f(start)h(of)f(a)h(\014lename)150 | |
| 28157acd | 6278 | 3213 y(or)g(immediately)i(follo)m(wing)g(a)f(slash)f(m)m(ust)h(b)s(e)f |
| eb2bb562 | 6279 | (matc)m(hed)h(explicitly)-8 b(,)27 b(unless)c(the)g(shell)h(option)g |
| 28157acd | 6280 | Fs(dotglob)150 3322 y Ft(is)31 b(set.)45 b(When)31 b(matc)m(hing)h(a)g |
| eb2bb562 | 6281 | (\014le)f(name,)h(the)g(slash)f(c)m(haracter)i(m)m(ust)e(alw)m(a)m(ys)i |
| 28157acd | 6282 | (b)s(e)e(matc)m(hed)h(explicitly)-8 b(.)150 3432 y(In)30 |
| eb2bb562 | 6283 | b(other)g(cases,)i(the)e(`)p Fs(.)p Ft(')h(c)m(haracter)h(is)e(not)h |
| 28157acd CR |
6284 | (treated)g(sp)s(ecially)-8 b(.)275 3560 y(See)30 b(the)g(description)f |
| 6285 | (of)h Fs(shopt)f Ft(in)g(Section)i(4.2)g([Bash)f(Builtins],)h(page)f | |
| 6286 | (41,)h(for)f(a)g(description)g(of)150 3670 y(the)h Fs(nocaseglob)p | |
| 6287 | Ft(,)c Fs(nullglob)p Ft(,)i Fs(failglob)p Ft(,)f(and)i | |
| 6288 | Fs(dotglob)e Ft(options.)275 3799 y(The)k Fs(GLOBIGNORE)f | |
| 6289 | Ft(shell)i(v)-5 b(ariable)34 b(ma)m(y)g(b)s(e)f(used)f(to)i(restrict)g | |
| 6290 | (the)g(set)f(of)h(\014lenames)f(matc)m(hing)i(a)150 3908 | |
| 6291 | y(pattern.)k(If)25 b Fs(GLOBIGNORE)e Ft(is)j(set,)h(eac)m(h)g(matc)m | |
| 6292 | (hing)g(\014lename)f(that)g(also)h(matc)m(hes)f(one)g(of)g(the)g | |
| 6293 | (patterns)150 4018 y(in)33 b Fs(GLOBIGNORE)d Ft(is)j(remo)m(v)m(ed)h | |
| eb2bb562 | 6294 | (from)e(the)i(list)f(of)g(matc)m(hes.)50 b(The)33 b(\014lenames)g(`)p |
| 37c41ab1 | 6295 | Fs(.)p Ft(')g(and)f(`)p Fs(..)p Ft(')h(are)g(alw)m(a)m(ys)150 |
| 28157acd | 6296 | 4128 y(ignored)g(when)e Fs(GLOBIGNORE)f Ft(is)j(set)g(and)f(not)h(n)m |
| 37c41ab1 | 6297 | (ull.)48 b(Ho)m(w)m(ev)m(er,)35 b(setting)f Fs(GLOBIGNORE)c |
| 28157acd | 6298 | Ft(to)j(a)g(non-n)m(ull)150 4237 y(v)-5 b(alue)34 b(has)f(the)h |
| 37c41ab1 | 6299 | (e\013ect)h(of)f(enabling)g(the)g Fs(dotglob)e Ft(shell)h(option,)j(so) |
| 28157acd | 6300 | e(all)g(other)g(\014lenames)g(b)s(eginning)150 4347 y(with)43 |
| 37c41ab1 CR |
6301 | b(a)h(`)p Fs(.)p Ft(')f(will)h(matc)m(h.)80 b(T)-8 b(o)44 |
| 6302 | b(get)h(the)e(old)h(b)s(eha)m(vior)f(of)h(ignoring)f(\014lenames)h(b)s | |
| 28157acd | 6303 | (eginning)f(with)g(a)150 4456 y(`)p Fs(.)p Ft(',)c(mak)m(e)g(`)p |
| 37c41ab1 CR |
6304 | Fs(.*)p Ft(')e(one)g(of)g(the)h(patterns)f(in)g Fs(GLOBIGNORE)p |
| 6305 | Ft(.)58 b(The)37 b Fs(dotglob)e Ft(option)j(is)f(disabled)g(when)150 | |
| 28157acd CR |
6306 | 4566 y Fs(GLOBIGNORE)28 b Ft(is)i(unset.)150 4773 y Fk(3.5.8.1)63 |
| 6307 | b(P)m(attern)40 b(Matc)m(hing)275 5011 y Ft(An)m(y)33 | |
| 6308 | b(c)m(haracter)i(that)f(app)s(ears)f(in)g(a)h(pattern,)g(other)g(than)f | |
| 6309 | (the)g(sp)s(ecial)h(pattern)g(c)m(haracters)h(de-)150 | |
| 6310 | 5121 y(scrib)s(ed)30 b(b)s(elo)m(w,)h(matc)m(hes)h(itself.)43 | |
| 6311 | b(The)31 b Fl(nul)f Ft(c)m(haracter)i(ma)m(y)f(not)h(o)s(ccur)e(in)h(a) | |
| 6312 | g(pattern.)42 b(A)31 b(bac)m(kslash)150 5230 y(escap)s(es)36 | |
| 6313 | b(the)f(follo)m(wing)i(c)m(haracter;)j(the)c(escaping)g(bac)m(kslash)g | |
| 6314 | (is)f(discarded)g(when)g(matc)m(hing.)56 b(The)150 5340 | |
| 6315 | y(sp)s(ecial)31 b(pattern)f(c)m(haracters)i(m)m(ust)f(b)s(e)e(quoted)i | |
| 6316 | (if)f(they)h(are)f(to)i(b)s(e)d(matc)m(hed)i(literally)-8 | |
| 6317 | b(.)p eop end | |
| 9d2b70f0 CR |
6318 | %%Page: 24 30 |
| 6319 | TeXDict begin 24 29 bop 150 -116 a Ft(24)2572 b(Bash)31 | |
| 28157acd CR |
6320 | b(Reference)g(Man)m(ual)275 299 y(The)e(sp)s(ecial)i(pattern)g(c)m |
| 6321 | (haracters)h(ha)m(v)m(e)f(the)g(follo)m(wing)h(meanings:)150 | |
| 6322 | 453 y Fs(*)432 b Ft(Matc)m(hes)32 b(an)m(y)f(string,)f(including)g(the) | |
| 6323 | h(n)m(ull)f(string.)150 606 y Fs(?)432 b Ft(Matc)m(hes)32 | |
| 6324 | b(an)m(y)f(single)g(c)m(haracter.)150 760 y Fs([...)o(])241 | |
| 6325 | b Ft(Matc)m(hes)27 b(an)m(y)e(one)g(of)g(the)g(enclosed)g(c)m | |
| 6326 | (haracters.)41 b(A)25 b(pair)f(of)h(c)m(haracters)i(separated)e(b)m(y)g | |
| 6327 | (a)630 870 y(h)m(yphen)i(denotes)h(a)g Fq(range)g(expression)p | |
| 37c41ab1 | 6328 | Ft(;)g(an)m(y)h(c)m(haracter)g(that)f(sorts)g(b)s(et)m(w)m(een)g(those) |
| 28157acd | 6329 | h(t)m(w)m(o)630 979 y(c)m(haracters,)f(inclusiv)m(e,)f(using)d(the)h |
| 37c41ab1 | 6330 | (curren)m(t)f(lo)s(cale's)j(collating)g(sequence)e(and)f(c)m(haracter) |
| 28157acd | 6331 | 630 1089 y(set,)31 b(is)f(matc)m(hed.)42 b(If)30 b(the)g(\014rst)g(c)m |
| 37c41ab1 | 6332 | (haracter)i(follo)m(wing)g(the)e(`)p Fs([)p Ft(')h(is)f(a)h(`)p |
| 5e13499c | 6333 | Fs(!)p Ft(')f(or)g(a)h(`)p Fs(^)p Ft(')g(then)f(an)m(y)630 |
| 28157acd | 6334 | 1199 y(c)m(haracter)c(not)f(enclosed)g(is)g(matc)m(hed.)40 |
| 5e13499c | 6335 | b(A)25 b(`)p Fp(\000)p Ft(')f(ma)m(y)i(b)s(e)e(matc)m(hed)h(b)m(y)f |
| 28157acd | 6336 | (including)h(it)g(as)g(the)630 1308 y(\014rst)32 b(or)h(last)h(c)m |
| 37c41ab1 CR |
6337 | (haracter)h(in)e(the)g(set.)50 b(A)33 b(`)p Fs(])p Ft(')g(ma)m(y)h(b)s |
| 6338 | (e)e(matc)m(hed)i(b)m(y)f(including)g(it)g(as)h(the)630 | |
| 28157acd | 6339 | 1418 y(\014rst)25 b(c)m(haracter)i(in)e(the)h(set.)40 |
| 37c41ab1 | 6340 | b(The)25 b(sorting)h(order)f(of)h(c)m(haracters)h(in)f(range)g |
| 28157acd | 6341 | (expressions)f(is)630 1527 y(determined)e(b)m(y)g(the)g(curren)m(t)f |
| 37c41ab1 | 6342 | (lo)s(cale)j(and)e(the)g(v)-5 b(alue)23 b(of)g(the)h |
| 28157acd CR |
6343 | Fs(LC_COLLATE)c Ft(shell)j(v)-5 b(ariable,)630 1637 y(if)30 |
| 6344 | b(set.)630 1769 y(F)-8 b(or)34 b(example,)g(in)f(the)g(default)g(C)f | |
| 9d2b70f0 | 6345 | (lo)s(cale,)k(`)p Fs([a-dx-z])p Ft(')31 b(is)i(equiv)-5 |
| 28157acd | 6346 | b(alen)m(t)34 b(to)g(`)p Fs([abcdxyz])p Ft('.)630 1878 |
| 9d2b70f0 | 6347 | y(Man)m(y)68 b(lo)s(cales)h(sort)f(c)m(haracters)h(in)e(dictionary)i |
| 28157acd | 6348 | (order,)76 b(and)67 b(in)g(these)h(lo)s(cales)630 1988 |
| 9d2b70f0 | 6349 | y(`)p Fs([a-dx-z])p Ft(')36 b(is)i(t)m(ypically)i(not)e(equiv)-5 |
| 37c41ab1 | 6350 | b(alen)m(t)39 b(to)g(`)p Fs([abcdxyz])p Ft(';)g(it)g(migh)m(t)f(b)s(e)f |
| 28157acd | 6351 | (equiv)-5 b(alen)m(t)630 2097 y(to)34 b(`)p Fs([aBbCcDdxXyYz])p |
| 37c41ab1 | 6352 | Ft(',)c(for)j(example.)49 b(T)-8 b(o)33 b(obtain)h(the)f(traditional)h |
| 28157acd | 6353 | (in)m(terpretation)h(of)630 2207 y(ranges)e(in)f(brac)m(k)m(et)i |
| 37c41ab1 | 6354 | (expressions,)g(y)m(ou)f(can)g(force)g(the)g(use)f(of)h(the)g(C)f(lo)s |
| 28157acd | 6355 | (cale)i(b)m(y)f(setting)630 2317 y(the)e Fs(LC_COLLATE)c |
| 37c41ab1 | 6356 | Ft(or)k Fs(LC_ALL)d Ft(en)m(vironmen)m(t)j(v)-5 b(ariable)31 |
| 28157acd | 6357 | b(to)g(the)g(v)-5 b(alue)31 b(`)p Fs(C)p Ft('.)630 2448 |
| 37c41ab1 CR |
6358 | y(Within)23 b(`)p Fs([)p Ft(')h(and)e(`)p Fs(])p Ft(',)j |
| 6359 | Fq(c)m(haracter)g(classes)j Ft(can)c(b)s(e)e(sp)s(eci\014ed)h(using)f | |
| 6360 | (the)i(syn)m(tax)f Fs([:)p Fq(class)t Fs(:])p Ft(,)630 | |
| 28157acd | 6361 | 2558 y(where)30 b Fq(class)35 b Ft(is)30 b(one)h(of)f(the)h(follo)m |
| ac18b312 | 6362 | (wing)h(classes)f(de\014ned)e(in)h(the)h Fl(posix)f Ft(standard:)870 |
| 28157acd CR |
6363 | 2690 y Fs(alnum)142 b(alpha)g(ascii)f(blank)h(cntrl)g(digit)g(graph)g |
| 6364 | (lower)870 2799 y(print)g(punct)g(space)f(upper)h(word)190 | |
| 6365 | b(xdigit)630 2931 y Ft(A)42 b(c)m(haracter)h(class)f(matc)m(hes)h(an)m | |
| eb2bb562 | 6366 | (y)f(c)m(haracter)h(b)s(elonging)f(to)g(that)g(class.)75 |
| 28157acd | 6367 | b(The)41 b Fs(word)630 3040 y Ft(c)m(haracter)32 b(class)f(matc)m(hes)h |
| 37c41ab1 | 6368 | (letters,)f(digits,)h(and)d(the)i(c)m(haracter)h(`)p |
| 28157acd | 6369 | Fs(_)p Ft('.)630 3172 y(Within)25 b(`)p Fs([)p Ft(')f(and)g(`)p |
| 37c41ab1 CR |
6370 | Fs(])p Ft(',)i(an)e Fq(equiv)-5 b(alence)26 b(class)j |
| 6371 | Ft(can)24 b(b)s(e)g(sp)s(eci\014ed)g(using)g(the)g(syn)m(tax)h | |
| 28157acd | 6372 | Fs([=)p Fq(c)6 b Fs(=])p Ft(,)630 3282 y(whic)m(h)29 |
| eb2bb562 | 6373 | b(matc)m(hes)i(all)f(c)m(haracters)h(with)e(the)h(same)g(collation)h(w) |
| 28157acd | 6374 | m(eigh)m(t)g(\(as)f(de\014ned)e(b)m(y)i(the)630 3391 |
| eb2bb562 | 6375 | y(curren)m(t)g(lo)s(cale\))j(as)d(the)h(c)m(haracter)h |
| 28157acd | 6376 | Fq(c)p Ft(.)630 3523 y(Within)22 b(`)p Fs([)p Ft(')f(and)g(`)p |
| eb2bb562 CR |
6377 | Fs(])p Ft(',)j(the)d(syn)m(tax)h Fs([.)p Fq(sym)m(b)s(ol)t |
| 6378 | Fs(.])e Ft(matc)m(hes)i(the)g(collating)i(sym)m(b)s(ol)d | |
| 28157acd | 6379 | Fq(sym)m(b)s(ol)p Ft(.)275 3677 y(If)29 b(the)g Fs(extglob)f |
| eb2bb562 | 6380 | Ft(shell)h(option)h(is)g(enabled)f(using)g(the)h Fs(shopt)e |
| 28157acd | 6381 | Ft(builtin,)h(sev)m(eral)i(extended)f(pattern)150 3786 |
| eb2bb562 | 6382 | y(matc)m(hing)37 b(op)s(erators)e(are)h(recognized.)58 |
| 37c41ab1 | 6383 | b(In)35 b(the)g(follo)m(wing)i(description,)g(a)f Fq(pattern-list)j |
| 28157acd | 6384 | Ft(is)d(a)g(list)g(of)150 3896 y(one)d(or)f(more)h(patterns)f |
| 37c41ab1 CR |
6385 | (separated)h(b)m(y)f(a)h(`)p Fs(|)p Ft('.)47 b(Comp)s(osite)33 |
| 6386 | b(patterns)f(ma)m(y)i(b)s(e)d(formed)h(using)g(one)h(or)150 | |
| 28157acd CR |
6387 | 4005 y(more)e(of)f(the)h(follo)m(wing)g(sub-patterns:)150 |
| 6388 | 4159 y Fs(?\()p Fj(pattern-list)11 b Fs(\))630 4269 y | |
| 5e13499c | 6389 | Ft(Matc)m(hes)32 b(zero)f(or)g(one)f(o)s(ccurrence)h(of)f(the)h(giv)m |
| 28157acd CR |
6390 | (en)g(patterns.)150 4423 y Fs(*\()p Fj(pattern-list)11 |
| 6391 | b Fs(\))630 4532 y Ft(Matc)m(hes)32 b(zero)f(or)g(more)f(o)s | |
| 6392 | (ccurrences)h(of)f(the)h(giv)m(en)g(patterns.)150 4686 | |
| 6393 | y Fs(+\()p Fj(pattern-list)11 b Fs(\))630 4796 y Ft(Matc)m(hes)32 | |
| 6394 | b(one)f(or)f(more)h(o)s(ccurrences)f(of)h(the)f(giv)m(en)i(patterns.) | |
| 6395 | 150 4949 y Fs(@\()p Fj(pattern-list)11 b Fs(\))630 5059 | |
| 6396 | y Ft(Matc)m(hes)32 b(one)f(of)f(the)h(giv)m(en)g(patterns.)150 | |
| 6397 | 5213 y Fs(!\()p Fj(pattern-list)11 b Fs(\))630 5322 y | |
| 6398 | Ft(Matc)m(hes)32 b(an)m(ything)f(except)g(one)g(of)f(the)h(giv)m(en)g | |
| 6399 | (patterns.)p eop end | |
| 9d2b70f0 CR |
6400 | %%Page: 25 31 |
| 6401 | TeXDict begin 25 30 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 6402 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(25)150 299 | |
| 28157acd CR |
6403 | y Fk(3.5.9)63 b(Quote)41 b(Remo)m(v)-7 b(al)275 550 y |
| 6404 | Ft(After)32 b(the)h(preceding)f(expansions,)h(all)g(unquoted)f(o)s | |
| 6405 | (ccurrences)g(of)h(the)f(c)m(haracters)i(`)p Fs(\\)p | |
| 6406 | Ft(',)f(`)p Fs(')p Ft(',)h(and)150 659 y(`)p Fs(")p Ft(')d(that)g(did)e | |
| 6407 | (not)i(result)f(from)g(one)h(of)f(the)h(ab)s(o)m(v)m(e)g(expansions)f | |
| 6408 | (are)h(remo)m(v)m(ed.)150 933 y Fr(3.6)68 b(Redirections)275 | |
| 6409 | 1184 y Ft(Before)33 b(a)h(command)e(is)h(executed,)i(its)e(input)f(and) | |
| 6410 | h(output)f(ma)m(y)i(b)s(e)e Fq(redirected)37 b Ft(using)32 | |
| 6411 | b(a)h(sp)s(ecial)150 1294 y(notation)g(in)m(terpreted)g(b)m(y)f(the)g | |
| 6412 | (shell.)46 b(Redirection)33 b(ma)m(y)g(also)g(b)s(e)f(used)f(to)i(op)s | |
| 6413 | (en)e(and)h(close)h(\014les)f(for)150 1403 y(the)h(curren)m(t)g(shell)g | |
| 6414 | (execution)h(en)m(vironmen)m(t.)49 b(The)33 b(follo)m(wing)h | |
| 6415 | (redirection)g(op)s(erators)f(ma)m(y)h(precede)150 1513 | |
| 6416 | y(or)29 b(app)s(ear)g(an)m(ywhere)g(within)g(a)h(simple)f(command)g(or) | |
| 6417 | h(ma)m(y)g(follo)m(w)g(a)g(command.)40 b(Redirections)31 | |
| 6418 | b(are)150 1623 y(pro)s(cessed)f(in)g(the)g(order)g(they)h(app)s(ear,)f | |
| 6419 | (from)g(left)h(to)g(righ)m(t.)275 1764 y(In)c(the)i(follo)m(wing)h | |
| 6420 | (descriptions,)g(if)e(the)h(\014le)g(descriptor)f(n)m(um)m(b)s(er)g(is) | |
| 6421 | g(omitted,)i(and)f(the)f(\014rst)g(c)m(har-)150 1873 | |
| 6422 | y(acter)42 b(of)f(the)g(redirection)g(op)s(erator)g(is)g(`)p | |
| 6423 | Fs(<)p Ft(',)i(the)e(redirection)g(refers)g(to)g(the)g(standard)f | |
| 6424 | (input)f(\(\014le)150 1983 y(descriptor)33 b(0\).)49 | |
| 6425 | b(If)33 b(the)g(\014rst)f(c)m(haracter)i(of)g(the)f(redirection)g(op)s | |
| 6426 | (erator)h(is)f(`)p Fs(>)p Ft(',)h(the)f(redirection)g(refers)150 | |
| 6427 | 2093 y(to)e(the)g(standard)e(output)h(\(\014le)h(descriptor)f(1\).)275 | |
| 6428 | 2234 y(The)h(w)m(ord)h(follo)m(wing)i(the)f(redirection)g(op)s(erator)f | |
| 6429 | (in)g(the)h(follo)m(wing)h(descriptions,)f(unless)e(other-)150 | |
| 6430 | 2343 y(wise)21 b(noted,)i(is)e(sub)5 b(jected)21 b(to)h(brace)f | |
| 6431 | (expansion,)i(tilde)f(expansion,)h(parameter)e(expansion,)i(command)150 | |
| 6432 | 2453 y(substitution,)31 b(arithmetic)h(expansion,)f(quote)h(remo)m(v)-5 | |
| 6433 | b(al,)33 b(\014lename)e(expansion,)g(and)f(w)m(ord)h(splitting.)150 | |
| 6434 | 2563 y(If)f(it)h(expands)e(to)i(more)g(than)f(one)h(w)m(ord,)f(Bash)h | |
| 6435 | (rep)s(orts)e(an)h(error.)275 2704 y(Note)h(that)g(the)g(order)f(of)g | |
| 6436 | (redirections)h(is)g(signi\014can)m(t.)41 b(F)-8 b(or)31 | |
| 6437 | b(example,)h(the)e(command)390 2845 y Fs(ls)47 b(>)h | |
| 6438 | Fj(dirlist)56 b Fs(2>&1)150 2986 y Ft(directs)28 b(b)s(oth)f(standard)g | |
| 6439 | (output)g(\(\014le)h(descriptor)f(1\))i(and)e(standard)f(error)i | |
| 6440 | (\(\014le)g(descriptor)f(2\))h(to)h(the)150 3096 y(\014le)h | |
| 6441 | Fq(dirlist)p Ft(,)h(while)f(the)h(command)390 3237 y | |
| 6442 | Fs(ls)47 b(2>&1)g(>)g Fj(dirlist)150 3378 y Ft(directs)34 | |
| 37c41ab1 CR |
6443 | b(only)g(the)f(standard)g(output)g(to)h(\014le)g Fq(dirlist)p |
| 6444 | Ft(,)h(b)s(ecause)e(the)h(standard)f(error)g(w)m(as)h(duplicated)150 | |
| 28157acd CR |
6445 | 3488 y(as)d(standard)e(output)h(b)s(efore)g(the)h(standard)e(output)h |
| 6446 | (w)m(as)h(redirected)g(to)g Fq(dirlist)p Ft(.)275 3629 | |
| eb2bb562 CR |
6447 | y(Bash)26 b(handles)f(sev)m(eral)j(\014lenames)e(sp)s(ecially)h(when)f |
| 6448 | (they)g(are)g(used)g(in)g(redirections,)i(as)e(describ)s(ed)150 | |
| 28157acd CR |
6449 | 3739 y(in)k(the)h(follo)m(wing)g(table:)150 3908 y Fs(/dev/fd/)p |
| 6450 | Fj(fd)630 4018 y Ft(If)f Fq(fd)j Ft(is)d(a)h(v)-5 b(alid)31 | |
| 37c41ab1 | 6451 | b(in)m(teger,)h(\014le)e(descriptor)h Fq(fd)i Ft(is)d(duplicated.)150 |
| 28157acd CR |
6452 | 4184 y Fs(/dev/stdin)630 4294 y Ft(File)i(descriptor)e(0)h(is)f |
| 6453 | (duplicated.)150 4460 y Fs(/dev/stdout)630 4569 y Ft(File)i(descriptor) | |
| 6454 | e(1)h(is)f(duplicated.)150 4735 y Fs(/dev/stderr)630 | |
| 6455 | 4845 y Ft(File)i(descriptor)e(2)h(is)f(duplicated.)150 | |
| 6456 | 5011 y Fs(/dev/tcp/)p Fj(host)11 b Fs(/)p Fj(port)630 | |
| 6457 | 5121 y Ft(If)41 b Fq(host)i Ft(is)f(a)g(v)-5 b(alid)41 | |
| 258e3d46 | 6458 | b(hostname)h(or)f(In)m(ternet)h(address,)i(and)c Fq(p)s(ort)j |
| 28157acd | 6459 | Ft(is)f(an)f(in)m(teger)i(p)s(ort)630 5230 y(n)m(um)m(b)s(er)h(or)h |
| 258e3d46 | 6460 | (service)h(name,)j(Bash)c(attempts)h(to)g(op)s(en)f(a)g(TCP)g |
| 28157acd CR |
6461 | (connection)h(to)g(the)630 5340 y(corresp)s(onding)29 |
| 6462 | b(so)s(c)m(k)m(et.)p eop end | |
| 6463 | %%Page: 26 32 | |
| 6464 | TeXDict begin 26 31 bop 150 -116 a Ft(26)2572 b(Bash)31 | |
| 6465 | b(Reference)g(Man)m(ual)150 299 y Fs(/dev/udp/)p Fj(host)11 | |
| 6466 | b Fs(/)p Fj(port)630 408 y Ft(If)41 b Fq(host)i Ft(is)f(a)g(v)-5 | |
| ac18b312 | 6467 | b(alid)41 b(hostname)h(or)f(In)m(ternet)h(address,)i(and)c |
| 28157acd | 6468 | Fq(p)s(ort)j Ft(is)f(an)f(in)m(teger)i(p)s(ort)630 518 |
| ac18b312 | 6469 | y(n)m(um)m(b)s(er)g(or)i(service)g(name,)k(Bash)c(attempts)g(to)h(op)s |
| 28157acd CR |
6470 | (en)e(a)h(UDP)g(connection)g(to)h(the)630 628 y(corresp)s(onding)29 |
| 6471 | b(so)s(c)m(k)m(et.)275 782 y(A)h(failure)h(to)g(op)s(en)e(or)i(create)h | |
| 6472 | (a)e(\014le)h(causes)g(the)f(redirection)h(to)g(fail.)275 | |
| 6473 | 914 y(Redirections)f(using)e(\014le)i(descriptors)f(greater)h(than)f(9) | |
| 6474 | h(should)e(b)s(e)h(used)f(with)h(care,)h(as)g(they)f(ma)m(y)150 | |
| 6475 | 1024 y(con\015ict)i(with)f(\014le)h(descriptors)f(the)g(shell)h(uses)f | |
| 6476 | (in)m(ternally)-8 b(.)150 1241 y Fk(3.6.1)63 b(Redirecting)40 | |
| 6477 | b(Input)275 1483 y Ft(Redirection)35 b(of)f(input)g(causes)g(the)h | |
| eb2bb562 | 6478 | (\014le)f(whose)g(name)h(results)f(from)g(the)g(expansion)g(of)h |
| 28157acd | 6479 | Fq(w)m(ord)i Ft(to)150 1592 y(b)s(e)d(op)s(ened)g(for)g(reading)g(on)h |
| eb2bb562 CR |
6480 | (\014le)f(descriptor)h Fs(n)p Ft(,)g(or)g(the)f(standard)g(input)g |
| 6481 | (\(\014le)h(descriptor)f(0\))h(if)g Fs(n)f Ft(is)150 | |
| 28157acd CR |
6482 | 1702 y(not)d(sp)s(eci\014ed.)275 1834 y(The)e(general)j(format)e(for)h |
| 6483 | (redirecting)g(input)e(is:)390 1966 y Fs([)p Fj(n)11 | |
| 6484 | b Fs(]<)p Fj(word)150 2183 y Fk(3.6.2)63 b(Redirecting)40 | |
| 6485 | b(Output)275 2425 y Ft(Redirection)31 b(of)f(output)g(causes)h(the)g | |
| 9d2b70f0 | 6486 | (\014le)f(whose)g(name)h(results)f(from)f(the)i(expansion)f(of)h |
| 28157acd | 6487 | Fq(w)m(ord)i Ft(to)150 2534 y(b)s(e)e(op)s(ened)g(for)g(writing)h(on)f |
| 9d2b70f0 CR |
6488 | (\014le)h(descriptor)f Fq(n)p Ft(,)h(or)f(the)h(standard)f(output)g |
| 6489 | (\(\014le)h(descriptor)f(1\))h(if)g Fq(n)f Ft(is)150 | |
| 28157acd | 6490 | 2644 y(not)j(sp)s(eci\014ed.)50 b(If)33 b(the)h(\014le)g(do)s(es)f(not) |
| 9d2b70f0 | 6491 | h(exist)g(it)g(is)g(created;)j(if)c(it)h(do)s(es)g(exist)g(it)g(is)g |
| 28157acd | 6492 | (truncated)g(to)g(zero)150 2753 y(size.)275 2885 y(The)29 |
| 9d2b70f0 | 6493 | b(general)j(format)e(for)h(redirecting)g(output)f(is:)390 |
| 28157acd | 6494 | 3018 y Fs([)p Fj(n)11 b Fs(]>[|])p Fj(word)275 3150 y |
| 9d2b70f0 CR |
6495 | Ft(If)30 b(the)h(redirection)g(op)s(erator)g(is)g(`)p |
| 6496 | Fs(>)p Ft(',)g(and)f(the)h Fs(noclobber)d Ft(option)j(to)g(the)g | |
| 28157acd | 6497 | Fs(set)f Ft(builtin)g(has)h(b)s(een)150 3259 y(enabled,)i(the)f |
| 37c41ab1 CR |
6498 | (redirection)h(will)f(fail)h(if)f(the)g(\014le)g(whose)g(name)g |
| 6499 | (results)g(from)g(the)g(expansion)g(of)g Fq(w)m(ord)150 | |
| 28157acd | 6500 | 3369 y Ft(exists)f(and)f(is)g(a)h(regular)g(\014le.)41 |
| 37c41ab1 CR |
6501 | b(If)30 b(the)h(redirection)g(op)s(erator)g(is)f(`)p |
| 6502 | Fs(>|)p Ft(',)h(or)f(the)h(redirection)g(op)s(erator)g(is)150 | |
| 28157acd | 6503 | 3478 y(`)p Fs(>)p Ft(')36 b(and)f(the)g Fs(noclobber)e |
| 37c41ab1 | 6504 | Ft(option)j(is)g(not)g(enabled,)h(the)e(redirection)h(is)g(attempted)g |
| 28157acd CR |
6505 | (ev)m(en)h(if)e(the)h(\014le)150 3588 y(named)30 b(b)m(y)g |
| 6506 | Fq(w)m(ord)k Ft(exists.)150 3805 y Fk(3.6.3)63 b(App)s(ending)42 | |
| 6507 | b(Redirected)e(Output)275 4047 y Ft(Redirection)29 b(of)g(output)f(in)g | |
| 37c41ab1 | 6508 | (this)h(fashion)f(causes)h(the)g(\014le)g(whose)f(name)h(results)f |
| 28157acd | 6509 | (from)g(the)h(expan-)150 4156 y(sion)34 b(of)f Fq(w)m(ord)k |
| 37c41ab1 CR |
6510 | Ft(to)e(b)s(e)e(op)s(ened)g(for)g(app)s(ending)f(on)i(\014le)f |
| 6511 | (descriptor)h Fq(n)p Ft(,)g(or)g(the)f(standard)g(output)g(\(\014le)150 | |
| 28157acd | 6512 | 4266 y(descriptor)d(1\))h(if)g Fq(n)f Ft(is)g(not)h(sp)s(eci\014ed.)40 |
| 37c41ab1 | 6513 | b(If)29 b(the)i(\014le)f(do)s(es)h(not)f(exist)h(it)g(is)g(created.)275 |
| 28157acd CR |
6514 | 4398 y(The)e(general)j(format)e(for)h(app)s(ending)e(output)h(is:)390 |
| 6515 | 4530 y Fs([)p Fj(n)11 b Fs(]>>)p Fj(word)150 4747 y Fk(3.6.4)63 | |
| 6516 | b(Redirecting)40 b(Standard)h(Output)g(and)g(Standard)g(Error)275 | |
| 6517 | 4989 y Ft(Bash)31 b(allo)m(ws)h(b)s(oth)e(the)h(standard)g(output)f | |
| 6518 | (\(\014le)i(descriptor)e(1\))i(and)e(the)i(standard)e(error)g(output) | |
| 6519 | 150 5098 y(\(\014le)d(descriptor)g(2\))h(to)f(b)s(e)g(redirected)g(to)h | |
| 6520 | (the)f(\014le)g(whose)f(name)h(is)g(the)g(expansion)g(of)g | |
| 6521 | Fq(w)m(ord)j Ft(with)d(this)150 5208 y(construct.)275 | |
| 6522 | 5340 y(There)i(are)i(t)m(w)m(o)h(formats)e(for)h(redirecting)g | |
| 6523 | (standard)e(output)h(and)g(standard)f(error:)p eop end | |
| 5e13499c | 6524 | %%Page: 27 33 |
| 37c41ab1 | 6525 | TeXDict begin 27 32 bop 150 -116 a Ft(Chapter)30 b(3:)41 |
| 28157acd CR |
6526 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(27)390 299 |
| 6527 | y Fs(&>)p Fj(word)150 444 y Ft(and)390 590 y Fs(>&)p | |
| 6528 | Fj(word)150 736 y Ft(Of)30 b(the)g(t)m(w)m(o)i(forms,)e(the)h(\014rst)e | |
| 6529 | (is)i(preferred.)39 b(This)30 b(is)g(seman)m(tically)j(equiv)-5 | |
| 6530 | b(alen)m(t)32 b(to)390 881 y Fs(>)p Fj(word)57 b Fs(2>&1)150 | |
| 6531 | 1128 y Fk(3.6.5)63 b(Here)41 b(Do)s(cumen)m(ts)275 1383 | |
| ac18b312 CR |
6532 | y Ft(This)28 b(t)m(yp)s(e)h(of)h(redirection)g(instructs)f(the)g(shell) |
| 6533 | h(to)g(read)f(input)f(from)h(the)g(curren)m(t)h(source)f(un)m(til)h(a) | |
| 28157acd | 6534 | 150 1492 y(line)h(con)m(taining)g(only)g Fq(w)m(ord)i |
| ac18b312 CR |
6535 | Ft(\(with)d(no)h(trailing)g(blanks\))f(is)g(seen.)41 |
| 6536 | b(All)31 b(of)f(the)h(lines)f(read)g(up)f(to)i(that)150 | |
| 28157acd CR |
6537 | 1602 y(p)s(oin)m(t)f(are)h(then)f(used)g(as)g(the)h(standard)f(input)f |
| 6538 | (for)h(a)h(command.)275 1748 y(The)e(format)i(of)g(here-do)s(cumen)m | |
| 6539 | (ts)f(is:)390 1893 y Fs(<<[)p Fp(\000)p Fs(])p Fj(word)772 | |
| 6540 | 2003 y(here-document)390 2112 y(delimiter)275 2258 y | |
| ac18b312 | 6541 | Ft(No)j(parameter)h(expansion,)g(command)f(substitution,)h(arithmetic)h |
| 28157acd | 6542 | (expansion,)f(or)f(\014lename)g(ex-)150 2367 y(pansion)i(is)g(p)s |
| ac18b312 CR |
6543 | (erformed)e(on)i Fq(w)m(ord)p Ft(.)55 b(If)34 b(an)m(y)i(c)m(haracters) |
| 6544 | g(in)f Fq(w)m(ord)j Ft(are)d(quoted,)i(the)e Fq(delimiter)43 | |
| 28157acd | 6545 | b Ft(is)35 b(the)150 2477 y(result)40 b(of)h(quote)g(remo)m(v)-5 |
| ac18b312 | 6546 | b(al)42 b(on)e Fq(w)m(ord)p Ft(,)j(and)d(the)g(lines)h(in)f(the)h |
| 28157acd | 6547 | (here-do)s(cumen)m(t)f(are)h(not)f(expanded.)150 2587 |
| ac18b312 CR |
6548 | y(If)32 b Fq(w)m(ord)k Ft(is)d(unquoted,)f(all)i(lines)f(of)f(the)h |
| 6549 | (here-do)s(cumen)m(t)g(are)g(sub)5 b(jected)32 b(to)i(parameter)f | |
| 28157acd | 6550 | (expansion,)150 2696 y(command)25 b(substitution,)g(and)g(arithmetic)h |
| ac18b312 | 6551 | (expansion.)39 b(In)24 b(the)h(latter)h(case,)h(the)e(c)m(haracter)i |
| 28157acd | 6552 | (sequence)150 2806 y Fs(\\newline)h Ft(is)j(ignored,)f(and)g(`)p |
| ac18b312 CR |
6553 | Fs(\\)p Ft(')h(m)m(ust)f(b)s(e)g(used)f(to)i(quote)g(the)g(c)m |
| 6554 | (haracters)h(`)p Fs(\\)p Ft(',)e(`)p Fs($)p Ft(',)h(and)f(`)p | |
| 28157acd | 6555 | Fs(`)p Ft('.)275 2951 y(If)21 b(the)i(redirection)g(op)s(erator)g(is)f |
| ac18b312 | 6556 | (`)p Fs(<<-)p Ft(',)i(then)e(all)h(leading)g(tab)g(c)m(haracters)h(are) |
| 28157acd | 6557 | e(stripp)s(ed)f(from)h(input)150 3061 y(lines)33 b(and)f(the)h(line)h |
| eb2bb562 CR |
6558 | (con)m(taining)g Fq(delimiter)p Ft(.)49 b(This)32 b(allo)m(ws)i |
| 6559 | (here-do)s(cumen)m(ts)f(within)f(shell)i(scripts)e(to)150 | |
| 28157acd CR |
6560 | 3171 y(b)s(e)e(inden)m(ted)g(in)g(a)h(natural)f(fashion.)150 |
| 6561 | 3417 y Fk(3.6.6)63 b(Here)41 b(Strings)275 3672 y Ft(A)30 | |
| eb2bb562 | 6562 | b(v)-5 b(arian)m(t)31 b(of)g(here)f(do)s(cumen)m(ts,)g(the)h(format)g |
| 28157acd | 6563 | (is:)390 3818 y Fs(<<<)47 b Fj(word)275 3963 y Ft(The)29 |
| eb2bb562 | 6564 | b Fq(w)m(ord)34 b Ft(is)c(expanded)g(and)g(supplied)f(to)i(the)f |
| 28157acd CR |
6565 | (command)h(on)f(its)h(standard)e(input.)150 4210 y Fk(3.6.7)63 |
| 6566 | b(Duplicating)41 b(File)g(Descriptors)275 4465 y Ft(The)29 | |
| 6567 | b(redirection)i(op)s(erator)390 4610 y Fs([)p Fj(n)11 | |
| 6568 | b Fs(]<&)p Fj(word)150 4756 y Ft(is)35 b(used)e(to)j(duplicate)f(input) | |
| eb2bb562 | 6569 | f(\014le)g(descriptors.)53 b(If)34 b Fq(w)m(ord)k Ft(expands)c(to)h |
| 28157acd | 6570 | (one)g(or)g(more)g(digits,)h(the)f(\014le)150 4866 y(descriptor)e |
| eb2bb562 CR |
6571 | (denoted)h(b)m(y)g Fq(n)f Ft(is)g(made)h(to)g(b)s(e)f(a)h(cop)m(y)g(of) |
| 6572 | g(that)g(\014le)g(descriptor.)50 b(If)33 b(the)h(digits)g(in)f | |
| 28157acd | 6573 | Fq(w)m(ord)150 4975 y Ft(do)c(not)h(sp)s(ecify)f(a)h(\014le)f |
| eb2bb562 CR |
6574 | (descriptor)g(op)s(en)g(for)g(input,)g(a)h(redirection)g(error)f(o)s |
| 6575 | (ccurs.)40 b(If)29 b Fq(w)m(ord)j Ft(ev)-5 b(aluates)150 | |
| 28157acd | 6576 | 5085 y(to)31 b(`)p Fs(-)p Ft(',)g(\014le)g(descriptor)g |
| eb2bb562 CR |
6577 | Fq(n)f Ft(is)g(closed.)43 b(If)30 b Fq(n)g Ft(is)g(not)h(sp)s |
| 6578 | (eci\014ed,)f(the)h(standard)f(input)g(\(\014le)h(descriptor)f(0\))150 | |
| 28157acd CR |
6579 | 5194 y(is)g(used.)275 5340 y(The)f(op)s(erator)p eop |
| 6580 | end | |
| 6581 | %%Page: 28 34 | |
| 6582 | TeXDict begin 28 33 bop 150 -116 a Ft(28)2572 b(Bash)31 | |
| 6583 | b(Reference)g(Man)m(ual)390 299 y Fs([)p Fj(n)11 b Fs(]>&)p | |
| 6584 | Fj(word)150 434 y Ft(is)40 b(used)g(similarly)h(to)g(duplicate)f | |
| 6585 | (output)g(\014le)h(descriptors.)70 b(If)40 b Fq(n)f Ft(is)i(not)f(sp)s | |
| 6586 | (eci\014ed,)i(the)f(standard)150 543 y(output)30 b(\(\014le)g | |
| 6587 | (descriptor)g(1\))h(is)f(used.)39 b(If)30 b(the)g(digits)h(in)e | |
| 6588 | Fq(w)m(ord)34 b Ft(do)29 b(not)i(sp)s(ecify)e(a)i(\014le)f(descriptor)g | |
| 6589 | (op)s(en)150 653 y(for)38 b(output,)i(a)e(redirection)h(error)f(o)s | |
| 6590 | (ccurs.)63 b(As)38 b(a)h(sp)s(ecial)f(case,)k(if)c Fq(n)f | |
| 6591 | Ft(is)h(omitted,)k(and)37 b Fq(w)m(ord)k Ft(do)s(es)150 | |
| 6592 | 763 y(not)28 b(expand)f(to)i(one)f(or)f(more)h(digits,)i(the)e | |
| 6593 | (standard)e(output)i(and)f(standard)g(error)g(are)i(redirected)f(as)150 | |
| 6594 | 872 y(describ)s(ed)h(previously)-8 b(.)150 1097 y Fk(3.6.8)63 | |
| 6595 | b(Mo)m(ving)41 b(File)h(Descriptors)275 1342 y Ft(The)29 | |
| 6596 | b(redirection)i(op)s(erator)390 1477 y Fs([)p Fj(n)11 | |
| 6597 | b Fs(]<&)p Fj(digit)p Fs(-)150 1612 y Ft(mo)m(v)m(es)33 | |
| 6598 | b(the)f(\014le)g(descriptor)f Fq(digit)k Ft(to)d(\014le)g(descriptor)g | |
| 6599 | Fq(n)p Ft(,)f(or)h(the)g(standard)f(input)f(\(\014le)j(descriptor)e | |
| 6600 | (0\))150 1722 y(if)f Fq(n)g Ft(is)h(not)f(sp)s(eci\014ed.)40 | |
| 6601 | b Fq(digit)33 b Ft(is)e(closed)g(after)g(b)s(eing)f(duplicated)g(to)h | |
| 6602 | Fq(n)p Ft(.)275 1857 y(Similarly)-8 b(,)31 b(the)f(redirection)h(op)s | |
| 6603 | (erator)390 1992 y Fs([)p Fj(n)11 b Fs(]>&)p Fj(digit)p | |
| 6604 | Fs(-)150 2127 y Ft(mo)m(v)m(es)29 b(the)g(\014le)f(descriptor)f | |
| 9d2b70f0 CR |
6605 | Fq(digit)k Ft(to)e(\014le)f(descriptor)g Fq(n)p Ft(,)g(or)g(the)g |
| 6606 | (standard)f(output)h(\(\014le)g(descriptor)g(1\))150 | |
| 28157acd CR |
6607 | 2236 y(if)i Fq(n)g Ft(is)h(not)f(sp)s(eci\014ed.)150 |
| 6608 | 2462 y Fk(3.6.9)63 b(Op)s(ening)42 b(File)f(Descriptors)h(for)g | |
| 6609 | (Reading)f(and)g(W)-10 b(riting)275 2706 y Ft(The)29 | |
| 6610 | b(redirection)i(op)s(erator)390 2841 y Fs([)p Fj(n)11 | |
| 6611 | b Fs(]<>)p Fj(word)150 2976 y Ft(causes)39 b(the)g(\014le)g(whose)g | |
| 9d2b70f0 | 6612 | (name)g(is)g(the)g(expansion)g(of)g Fq(w)m(ord)j Ft(to)d(b)s(e)g(op)s |
| 28157acd | 6613 | (ened)f(for)g(b)s(oth)h(reading)g(and)150 3086 y(writing)33 |
| 9d2b70f0 CR |
6614 | b(on)f(\014le)h(descriptor)f Fq(n)p Ft(,)h(or)g(on)f(\014le)h |
| 6615 | (descriptor)g(0)g(if)f Fq(n)g Ft(is)h(not)g(sp)s(eci\014ed.)47 | |
| 28157acd CR |
6616 | b(If)32 b(the)h(\014le)f(do)s(es)h(not)150 3195 y(exist,)e(it)g(is)g |
| 6617 | (created.)150 3454 y Fr(3.7)68 b(Executing)46 b(Commands)150 | |
| 6618 | 3789 y Fk(3.7.1)63 b(Simple)41 b(Command)h(Expansion)275 | |
| 6619 | 4034 y Ft(When)35 b(a)h(simple)f(command)h(is)f(executed,)j(the)e | |
| 9d2b70f0 | 6620 | (shell)g(p)s(erforms)e(the)i(follo)m(wing)h(expansions,)f(as-)150 |
| 28157acd CR |
6621 | 4143 y(signmen)m(ts,)31 b(and)f(redirections,)h(from)f(left)h(to)g |
| 6622 | (righ)m(t.)199 4278 y(1.)61 b(The)38 b(w)m(ords)f(that)i(the)g(parser)e | |
| eb2bb562 | 6623 | (has)h(mark)m(ed)g(as)h(v)-5 b(ariable)39 b(assignmen)m(ts)g(\(those)g |
| 28157acd | 6624 | (preceding)f(the)330 4388 y(command)30 b(name\))h(and)f(redirections)h |
| 37c41ab1 | 6625 | (are)f(sa)m(v)m(ed)i(for)e(later)h(pro)s(cessing.)199 |
| 28157acd | 6626 | 4523 y(2.)61 b(The)39 b(w)m(ords)g(that)i(are)f(not)g(v)-5 |
| 37c41ab1 | 6627 | b(ariable)40 b(assignmen)m(ts)h(or)e(redirections)i(are)f(expanded)f |
| 28157acd | 6628 | (\(see)h(Sec-)330 4632 y(tion)d(3.5)i([Shell)e(Expansions],)h(page)g |
| 9d2b70f0 | 6629 | (17\).)61 b(If)37 b(an)m(y)g(w)m(ords)f(remain)h(after)h(expansion,)h |
| 28157acd | 6630 | (the)e(\014rst)330 4742 y(w)m(ord)31 b(is)g(tak)m(en)h(to)g(b)s(e)f |
| 37c41ab1 | 6631 | (the)g(name)h(of)f(the)h(command)f(and)f(the)i(remaining)f(w)m(ords)g |
| 28157acd CR |
6632 | (are)g(the)h(argu-)330 4851 y(men)m(ts.)199 4986 y(3.)61 |
| 6633 | b(Redirections)25 b(are)f(p)s(erformed)f(as)h(describ)s(ed)f(ab)s(o)m | |
| 6634 | (v)m(e)i(\(see)g(Section)g(3.6)g([Redirections],)i(page)d(25\).)199 | |
| 6635 | 5121 y(4.)61 b(The)25 b(text)h(after)f(the)g(`)p Fs(=)p | |
| 6636 | Ft(')h(in)e(eac)m(h)j(v)-5 b(ariable)25 b(assignmen)m(t)h(undergo)s(es) | |
| 6637 | e(tilde)i(expansion,)g(parameter)330 5230 y(expansion,)49 | |
| 6638 | b(command)d(substitution,)j(arithmetic)d(expansion,)k(and)45 | |
| 6639 | b(quote)h(remo)m(v)-5 b(al)46 b(b)s(efore)330 5340 y(b)s(eing)30 | |
| 6640 | b(assigned)h(to)g(the)f(v)-5 b(ariable.)p eop end | |
| eb2bb562 CR |
6641 | %%Page: 29 35 |
| 6642 | TeXDict begin 29 34 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 28157acd CR |
6643 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(29)275 299 |
| 6644 | y(If)32 b(no)i(command)f(name)g(results,)h(the)g(v)-5 | |
| ac18b312 | 6645 | b(ariable)34 b(assignmen)m(ts)g(a\013ect)h(the)f(curren)m(t)f(shell)h |
| 28157acd | 6646 | (en)m(viron-)150 408 y(men)m(t.)39 b(Otherwise,)27 b(the)e(v)-5 |
| ac18b312 | 6647 | b(ariables)26 b(are)g(added)f(to)h(the)f(en)m(vironmen)m(t)h(of)g(the)f |
| 28157acd | 6648 | (executed)h(command)g(and)150 518 y(do)35 b(not)f(a\013ect)j(the)d |
| ac18b312 | 6649 | (curren)m(t)h(shell)g(en)m(vironmen)m(t.)54 b(If)34 b(an)m(y)h(of)g |
| 28157acd | 6650 | (the)f(assignmen)m(ts)i(attempts)f(to)h(assign)150 628 |
| ac18b312 CR |
6651 | y(a)j(v)-5 b(alue)39 b(to)g(a)g(readonly)f(v)-5 b(ariable,)42 |
| 6652 | b(an)c(error)g(o)s(ccurs,)j(and)c(the)i(command)f(exits)h(with)g(a)f | |
| 28157acd | 6653 | (non-zero)150 737 y(status.)275 875 y(If)33 b(no)g(command)g(name)h |
| ac18b312 | 6654 | (results,)g(redirections)g(are)g(p)s(erformed,)f(but)g(do)h(not)f |
| 28157acd | 6655 | (a\013ect)i(the)f(curren)m(t)150 985 y(shell)d(en)m(vironmen)m(t.)41 |
| ac18b312 | 6656 | b(A)30 b(redirection)h(error)f(causes)h(the)g(command)f(to)h(exit)g |
| 28157acd | 6657 | (with)f(a)h(non-zero)g(status.)275 1123 y(If)26 b(there)i(is)f(a)h |
| ac18b312 | 6658 | (command)f(name)h(left)g(after)g(expansion,)g(execution)h(pro)s(ceeds)e |
| 28157acd | 6659 | (as)g(describ)s(ed)f(b)s(elo)m(w.)150 1233 y(Otherwise,)39 |
| ac18b312 | 6660 | b(the)e(command)g(exits.)62 b(If)37 b(one)g(of)g(the)h(expansions)f |
| 28157acd | 6661 | (con)m(tained)h(a)g(command)f(substitu-)150 1342 y(tion,)i(the)d(exit)h |
| ac18b312 | 6662 | (status)g(of)f(the)h(command)f(is)h(the)f(exit)h(status)g(of)f(the)h |
| 28157acd | 6663 | (last)g(command)f(substitution)150 1452 y(p)s(erformed.)55 |
| ac18b312 | 6664 | b(If)35 b(there)g(w)m(ere)h(no)g(command)f(substitutions,)i(the)e |
| 28157acd CR |
6665 | (command)h(exits)g(with)f(a)h(status)g(of)150 1561 y(zero.)150 |
| 6666 | 1793 y Fk(3.7.2)63 b(Command)41 b(Searc)m(h)f(and)h(Execution)275 | |
| 6667 | 2040 y Ft(After)35 b(a)h(command)f(has)h(b)s(een)e(split)i(in)m(to)g(w) | |
| ac18b312 | 6668 | m(ords,)h(if)e(it)h(results)g(in)f(a)h(simple)f(command)g(and)g(an)150 |
| 28157acd CR |
6669 | 2150 y(optional)d(list)f(of)f(argumen)m(ts,)h(the)g(follo)m(wing)g |
| 6670 | (actions)h(are)f(tak)m(en.)199 2288 y(1.)61 b(If)24 b(the)g(command)g | |
| ac18b312 | 6671 | (name)g(con)m(tains)i(no)e(slashes,)i(the)e(shell)h(attempts)g(to)g(lo) |
| 28157acd | 6672 | s(cate)h(it.)39 b(If)24 b(there)g(exists)330 2398 y(a)h(shell)g |
| ac18b312 CR |
6673 | (function)f(b)m(y)g(that)h(name,)h(that)f(function)f(is)h(in)m(v)m(ok)m |
| 6674 | (ed)h(as)e(describ)s(ed)g(in)g(Section)h(3.3)h([Shell)330 | |
| 28157acd | 6675 | 2507 y(F)-8 b(unctions],)31 b(page)h(14.)199 2643 y(2.)61 |
| ac18b312 CR |
6676 | b(If)41 b(the)g(name)h(do)s(es)f(not)g(matc)m(h)i(a)e(function,)j(the)e |
| 6677 | (shell)f(searc)m(hes)i(for)e(it)h(in)f(the)g(list)h(of)g(shell)330 | |
| 28157acd CR |
6678 | 2753 y(builtins.)e(If)30 b(a)h(matc)m(h)g(is)f(found,)g(that)h(builtin) |
| 6679 | f(is)g(in)m(v)m(ok)m(ed.)199 2889 y(3.)61 b(If)40 b(the)g(name)h(is)f | |
| ac18b312 | 6680 | (neither)h(a)f(shell)h(function)f(nor)g(a)g(builtin,)j(and)d(con)m |
| 28157acd | 6681 | (tains)h(no)g(slashes,)i(Bash)330 2999 y(searc)m(hes)c(eac)m(h)g |
| ac18b312 | 6682 | (elemen)m(t)g(of)g Fs($PATH)d Ft(for)i(a)g(directory)h(con)m(taining)g |
| 28157acd | 6683 | (an)f(executable)h(\014le)f(b)m(y)g(that)330 3109 y(name.)56 |
| ac18b312 | 6684 | b(Bash)36 b(uses)f(a)h(hash)e(table)j(to)f(remem)m(b)s(er)f(the)h(full) |
| 28157acd | 6685 | f(pathnames)g(of)h(executable)h(\014les)e(to)330 3218 |
| 37c41ab1 CR |
6686 | y(a)m(v)m(oid)e(m)m(ultiple)f Fs(PATH)f Ft(searc)m(hes)i(\(see)f(the)g |
| 6687 | (description)g(of)f Fs(hash)g Ft(in)g(Section)i(4.1)f([Bourne)g(Shell) | |
| 28157acd | 6688 | 330 3328 y(Builtins],)37 b(page)f(35\).)55 b(A)35 b(full)g(searc)m(h)g |
| 37c41ab1 | 6689 | (of)g(the)g(directories)h(in)f Fs($PATH)e Ft(is)i(p)s(erformed)f(only)h |
| 28157acd | 6690 | (if)g(the)330 3437 y(command)c(is)g(not)g(found)f(in)g(the)i(hash)e |
| eb2bb562 | 6691 | (table.)43 b(If)31 b(the)g(searc)m(h)h(is)f(unsuccessful,)f(the)h |
| 28157acd CR |
6692 | (shell)g(prin)m(ts)330 3547 y(an)f(error)g(message)i(and)e(returns)f |
| 6693 | (an)h(exit)h(status)g(of)f(127.)199 3683 y(4.)61 b(If)33 | |
| eb2bb562 | 6694 | b(the)g(searc)m(h)h(is)g(successful,)g(or)f(if)g(the)h(command)f(name)g |
| 28157acd | 6695 | (con)m(tains)i(one)f(or)f(more)g(slashes,)i(the)330 3793 |
| eb2bb562 CR |
6696 | y(shell)g(executes)h(the)f(named)f(program)g(in)h(a)g(separate)h |
| 6697 | (execution)f(en)m(vironmen)m(t.)55 b(Argumen)m(t)35 b(0)330 | |
| 28157acd | 6698 | 3902 y(is)30 b(set)h(to)h(the)e(name)h(giv)m(en,)g(and)f(the)h |
| eb2bb562 | 6699 | (remaining)f(argumen)m(ts)h(to)g(the)g(command)f(are)h(set)g(to)g(the) |
| 28157acd CR |
6700 | 330 4012 y(argumen)m(ts)g(supplied,)e(if)h(an)m(y)-8 |
| 6701 | b(.)199 4148 y(5.)61 b(If)35 b(this)h(execution)h(fails)f(b)s(ecause)g | |
| 37c41ab1 | 6702 | (the)f(\014le)h(is)g(not)g(in)f(executable)j(format,)f(and)e(the)h |
| 28157acd | 6703 | (\014le)g(is)g(not)330 4258 y(a)d(directory)-8 b(,)34 |
| 37c41ab1 CR |
6704 | b(it)f(is)g(assumed)e(to)j(b)s(e)d(a)i Fq(shell)g(script)h |
| 6705 | Ft(and)e(the)h(shell)f(executes)i(it)f(as)g(describ)s(ed)e(in)330 | |
| 28157acd CR |
6706 | 4367 y(Section)g(3.8)h([Shell)e(Scripts],)g(page)i(32.)199 |
| 6707 | 4504 y(6.)61 b(If)38 b(the)h(command)f(w)m(as)h(not)g(b)s(egun)e(async) | |
| 37c41ab1 | 6708 | m(hronously)-8 b(,)42 b(the)c(shell)h(w)m(aits)h(for)e(the)h(command)f |
| 28157acd CR |
6709 | (to)330 4613 y(complete)32 b(and)e(collects)i(its)f(exit)g(status.)150 |
| 6710 | 4845 y Fk(3.7.3)63 b(Command)41 b(Execution)f(En)m(vironmen)m(t)275 | |
| 6711 | 5092 y Ft(The)29 b(shell)i(has)f(an)g Fq(execution)i(en)m(vironmen)m(t) | |
| 6712 | p Ft(,)f(whic)m(h)f(consists)h(of)g(the)f(follo)m(wing:)225 | |
| 6713 | 5230 y Fp(\017)60 b Ft(op)s(en)32 b(\014les)g(inherited)g(b)m(y)h(the)f | |
| 6714 | (shell)h(at)g(in)m(v)m(o)s(cation,)j(as)c(mo)s(di\014ed)g(b)m(y)g | |
| 6715 | (redirections)h(supplied)e(to)330 5340 y(the)g Fs(exec)e | |
| 6716 | Ft(builtin)p eop end | |
| eb2bb562 CR |
6717 | %%Page: 30 36 |
| 6718 | TeXDict begin 30 35 bop 150 -116 a Ft(30)2572 b(Bash)31 | |
| 28157acd CR |
6719 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(the)28 |
| 6720 | b(curren)m(t)g(w)m(orking)h(directory)g(as)f(set)h(b)m(y)f | |
| ac18b312 | 6721 | Fs(cd)p Ft(,)g Fs(pushd)p Ft(,)g(or)g Fs(popd)p Ft(,)g(or)g(inherited)g |
| 28157acd CR |
6722 | (b)m(y)g(the)h(shell)f(at)330 408 y(in)m(v)m(o)s(cation)225 |
| 6723 | 539 y Fp(\017)60 b Ft(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)g(as) | |
| 6724 | h(set)g(b)m(y)f Fs(umask)f Ft(or)h(inherited)g(from)g(the)h(shell's)f | |
| 6725 | (paren)m(t)225 670 y Fp(\017)60 b Ft(curren)m(t)30 b(traps)g(set)h(b)m | |
| 6726 | (y)f Fs(trap)225 801 y Fp(\017)60 b Ft(shell)30 b(parameters)f(that)h | |
| 6727 | (are)g(set)g(b)m(y)g(v)-5 b(ariable)30 b(assignmen)m(t)g(or)g(with)f | |
| 6728 | Fs(set)f Ft(or)i(inherited)f(from)g(the)330 910 y(shell's)i(paren)m(t)f | |
| 6729 | (in)g(the)h(en)m(vironmen)m(t)225 1041 y Fp(\017)60 b | |
| 6730 | Ft(shell)44 b(functions)f(de\014ned)f(during)h(execution)i(or)e | |
| 6731 | (inherited)h(from)f(the)h(shell's)g(paren)m(t)f(in)h(the)330 | |
| 6732 | 1151 y(en)m(vironmen)m(t)225 1281 y Fp(\017)60 b Ft(options)33 | |
| 6733 | b(enabled)g(at)h(in)m(v)m(o)s(cation)h(\(either)f(b)m(y)f(default)g(or) | |
| 6734 | g(with)g(command-line)g(argumen)m(ts\))h(or)330 1391 | |
| 6735 | y(b)m(y)c Fs(set)225 1522 y Fp(\017)60 b Ft(options)31 | |
| 6736 | b(enabled)f(b)m(y)g Fs(shopt)225 1653 y Fp(\017)60 b | |
| 6737 | Ft(shell)31 b(aliases)g(de\014ned)f(with)g Fs(alias)f | |
| 6738 | Ft(\(see)i(Section)g(6.6)h([Aliases],)g(page)f(75\))225 | |
| 6739 | 1783 y Fp(\017)60 b Ft(v)-5 b(arious)50 b(pro)s(cess)f | |
| 9d2b70f0 | 6740 | Fl(id)p Ft(s,)55 b(including)49 b(those)i(of)e(bac)m(kground)h(jobs)f |
| 28157acd | 6741 | (\(see)i(Section)g(3.2.3)g([Lists],)330 1893 y(page)31 |
| 9d2b70f0 | 6742 | b(9\),)g(the)g(v)-5 b(alue)31 b(of)f Fs($$)p Ft(,)g(and)g(the)h(v)-5 |
| 28157acd | 6743 | b(alue)31 b(of)f Fs($PPID)275 2045 y Ft(When)k(a)g(simple)h(command)f |
| 9d2b70f0 | 6744 | (other)g(than)g(a)h(builtin)f(or)g(shell)h(function)f(is)g(to)h(b)s(e)f |
| 28157acd | 6745 | (executed,)i(it)f(is)150 2154 y(in)m(v)m(ok)m(ed)25 b(in)f(a)g |
| 9d2b70f0 | 6746 | (separate)h(execution)g(en)m(vironmen)m(t)g(that)f(consists)g(of)h(the) |
| 28157acd | 6747 | f(follo)m(wing.)40 b(Unless)24 b(otherwise)150 2264 y(noted,)31 |
| 9d2b70f0 | 6748 | b(the)f(v)-5 b(alues)31 b(are)g(inherited)f(from)g(the)g(shell.)225 |
| 28157acd | 6749 | 2395 y Fp(\017)60 b Ft(the)31 b(shell's)h(op)s(en)e(\014les,)i(plus)e |
| 37c41ab1 | 6750 | (an)m(y)h(mo)s(di\014cations)h(and)e(additions)h(sp)s(eci\014ed)g(b)m |
| 28157acd | 6751 | (y)g(redirections)g(to)330 2504 y(the)g(command)225 2635 |
| 37c41ab1 | 6752 | y Fp(\017)60 b Ft(the)31 b(curren)m(t)f(w)m(orking)g(directory)225 |
| 28157acd CR |
6753 | 2766 y Fp(\017)60 b Ft(the)31 b(\014le)f(creation)i(mo)s(de)e(mask)225 |
| 6754 | 2897 y Fp(\017)60 b Ft(shell)32 b(v)-5 b(ariables)33 | |
| 37c41ab1 | 6755 | b(and)e(functions)h(mark)m(ed)g(for)g(exp)s(ort,)g(along)h(with)f(v)-5 |
| 28157acd | 6756 | b(ariables)32 b(exp)s(orted)g(for)g(the)330 3006 y(command,)e(passed)g |
| 37c41ab1 | 6757 | (in)g(the)h(en)m(vironmen)m(t)g(\(see)g(Section)g(3.7.4)i([En)m |
| 28157acd | 6758 | (vironmen)m(t],)e(page)g(30\))225 3137 y Fp(\017)60 b |
| 37c41ab1 CR |
6759 | Ft(traps)31 b(caugh)m(t)h(b)m(y)f(the)g(shell)h(are)f(reset)h(to)g(the) |
| 6760 | f(v)-5 b(alues)32 b(inherited)e(from)h(the)g(shell's)h(paren)m(t,)g | |
| 28157acd CR |
6761 | (and)330 3247 y(traps)e(ignored)h(b)m(y)f(the)g(shell)h(are)g(ignored) |
| 6762 | 275 3399 y(A)41 b(command)g(in)m(v)m(ok)m(ed)i(in)e(this)h(separate)g | |
| eb2bb562 | 6763 | (en)m(vironmen)m(t)g(cannot)g(a\013ect)h(the)f(shell's)g(execution)150 |
| 28157acd | 6764 | 3508 y(en)m(vironmen)m(t.)275 3639 y(Command)35 b(substitution,)j |
| eb2bb562 | 6765 | (commands)e(group)s(ed)f(with)i(paren)m(theses,)h(and)e(async)m |
| 28157acd | 6766 | (hronous)g(com-)150 3748 y(mands)c(are)h(in)m(v)m(ok)m(ed)i(in)d(a)i |
| eb2bb562 | 6767 | (subshell)e(en)m(vironmen)m(t)h(that)h(is)f(a)g(duplicate)h(of)f(the)g |
| 28157acd | 6768 | (shell)g(en)m(vironmen)m(t,)150 3858 y(except)i(that)g(traps)f(caugh)m |
| eb2bb562 CR |
6769 | (t)h(b)m(y)f(the)h(shell)f(are)g(reset)h(to)g(the)f(v)-5 |
| 6770 | b(alues)35 b(that)g(the)f(shell)h(inherited)e(from)150 | |
| 28157acd | 6771 | 3968 y(its)g(paren)m(t)f(at)h(in)m(v)m(o)s(cation.)49 |
| eb2bb562 | 6772 | b(Builtin)32 b(commands)g(that)h(are)g(in)m(v)m(ok)m(ed)h(as)e(part)g |
| 28157acd | 6773 | (of)h(a)f(pip)s(eline)g(are)h(also)150 4077 y(executed)41 |
| eb2bb562 CR |
6774 | b(in)f(a)h(subshell)e(en)m(vironmen)m(t.)72 b(Changes)40 |
| 6775 | b(made)g(to)h(the)g(subshell)e(en)m(vironmen)m(t)i(cannot)150 | |
| 28157acd CR |
6776 | 4187 y(a\013ect)32 b(the)f(shell's)f(execution)i(en)m(vironmen)m(t.)275 |
| 6777 | 4318 y(If)38 b(a)h(command)f(is)g(follo)m(w)m(ed)j(b)m(y)d(a)h(`)p | |
| eb2bb562 | 6778 | Fs(&)p Ft(')g(and)f(job)g(con)m(trol)i(is)e(not)h(activ)m(e,)k(the)c |
| 28157acd | 6779 | (default)g(standard)150 4427 y(input)e(for)g(the)h(command)f(is)h(the)g |
| eb2bb562 | 6780 | (empt)m(y)g(\014le)f(`)p Fs(/dev/null)p Ft('.)61 b(Otherwise,)39 |
| 28157acd | 6781 | b(the)f(in)m(v)m(ok)m(ed)h(command)150 4537 y(inherits)30 |
| eb2bb562 | 6782 | b(the)h(\014le)f(descriptors)g(of)h(the)f(calling)i(shell)f(as)f(mo)s |
| 28157acd CR |
6783 | (di\014ed)g(b)m(y)g(redirections.)150 4750 y Fk(3.7.4)63 |
| 6784 | b(En)m(vironmen)m(t)275 4990 y Ft(When)31 b(a)g(program)h(is)f(in)m(v)m | |
| 6785 | (ok)m(ed)i(it)f(is)f(giv)m(en)h(an)g(arra)m(y)g(of)f(strings)g(called)i | |
| 6786 | (the)e Fq(en)m(vironmen)m(t)p Ft(.)45 b(This)150 5100 | |
| 6787 | y(is)30 b(a)h(list)g(of)g(name-v)-5 b(alue)31 b(pairs,)f(of)h(the)f | |
| 6788 | (form)g Fs(name=value)p Ft(.)275 5230 y(Bash)39 b(pro)m(vides)g(sev)m | |
| 6789 | (eral)i(w)m(a)m(ys)g(to)f(manipulate)f(the)h(en)m(vironmen)m(t.)69 | |
| 6790 | b(On)38 b(in)m(v)m(o)s(cation,)44 b(the)c(shell)150 5340 | |
| 6791 | y(scans)g(its)h(o)m(wn)f(en)m(vironmen)m(t)h(and)f(creates)i(a)f | |
| 6792 | (parameter)f(for)g(eac)m(h)i(name)e(found,)i(automatically)p | |
| 6793 | eop end | |
| 9d2b70f0 CR |
6794 | %%Page: 31 37 |
| 6795 | TeXDict begin 31 36 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 6796 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(31)150 299 | |
| 28157acd CR |
6797 | y(marking)26 b(it)g(for)g Fq(exp)s(ort)h Ft(to)g(c)m(hild)f(pro)s |
| 6798 | (cesses.)39 b(Executed)26 b(commands)g(inherit)g(the)g(en)m(vironmen)m | |
| 6799 | (t.)39 b(The)150 408 y Fs(export)c Ft(and)i(`)p Fs(declare)29 | |
| 6800 | b(-x)p Ft(')36 b(commands)h(allo)m(w)i(parameters)e(and)g(functions)g | |
| 6801 | (to)h(b)s(e)e(added)h(to)h(and)150 518 y(deleted)21 b(from)f(the)h(en)m | |
| ac18b312 CR |
6802 | (vironmen)m(t.)38 b(If)20 b(the)h(v)-5 b(alue)21 b(of)g(a)g(parameter)g |
| 6803 | (in)f(the)g(en)m(vironmen)m(t)i(is)e(mo)s(di\014ed,)i(the)150 | |
| 28157acd | 6804 | 628 y(new)31 b(v)-5 b(alue)32 b(b)s(ecomes)f(part)h(of)f(the)h(en)m |
| ac18b312 | 6805 | (vironmen)m(t,)g(replacing)h(the)e(old.)44 b(The)31 b(en)m(vironmen)m |
| 28157acd | 6806 | (t)h(inherited)150 737 y(b)m(y)f(an)m(y)g(executed)h(command)f |
| ac18b312 | 6807 | (consists)g(of)g(the)g(shell's)h(initial)g(en)m(vironmen)m(t,)g(whose)f |
| 28157acd | 6808 | (v)-5 b(alues)31 b(ma)m(y)h(b)s(e)150 847 y(mo)s(di\014ed)26 |
| ac18b312 CR |
6809 | b(in)g(the)h(shell,)h(less)f(an)m(y)g(pairs)f(remo)m(v)m(ed)i(b)m(y)f |
| 6810 | (the)g Fs(unset)e Ft(and)h(`)p Fs(export)j(-n)p Ft(')e(commands,)g | |
| 28157acd CR |
6811 | (plus)150 956 y(an)m(y)k(additions)f(via)h(the)g Fs(export)d |
| 6812 | Ft(and)i(`)p Fs(declare)f(-x)p Ft(')h(commands.)275 1096 | |
| ac18b312 | 6813 | y(The)j(en)m(vironmen)m(t)i(for)f(an)m(y)g(simple)h(command)f(or)g |
| 37c41ab1 | 6814 | (function)g(ma)m(y)g(b)s(e)g(augmen)m(ted)h(temp)s(orarily)150 |
| 28157acd | 6815 | 1205 y(b)m(y)c(pre\014xing)e(it)i(with)g(parameter)g(assignmen)m(ts,)h |
| 37c41ab1 | 6816 | (as)e(describ)s(ed)g(in)g(Section)i(3.4)g([Shell)e(P)m(arameters],)150 |
| 28157acd | 6817 | 1315 y(page)g(15.)41 b(These)29 b(assignmen)m(t)i(statemen)m(ts)g |
| 37c41ab1 | 6818 | (a\013ect)f(only)g(the)f(en)m(vironmen)m(t)h(seen)g(b)m(y)f(that)h |
| 28157acd CR |
6819 | (command.)275 1455 y(If)h(the)i(`)p Fs(-k)p Ft(')f(option)h(is)f(set)h |
| 6820 | (\(see)g(Section)g(4.3)g([The)f(Set)h(Builtin],)g(page)g(53\),)h(then)e | |
| 6821 | (all)h(parameter)150 1564 y(assignmen)m(ts)d(are)g(placed)h(in)e(the)h | |
| 6822 | (en)m(vironmen)m(t)g(for)g(a)g(command,)f(not)h(just)f(those)i(that)f | |
| 6823 | (precede)g(the)150 1674 y(command)g(name.)275 1813 y(When)f(Bash)h(in)m | |
| 6824 | (v)m(ok)m(es)i(an)e(external)g(command,)g(the)g(v)-5 | |
| 6825 | b(ariable)31 b(`)p Fs($_)p Ft(')f(is)g(set)g(to)h(the)f(full)f(path)h | |
| 6826 | (name)150 1923 y(of)h(the)f(command)g(and)g(passed)g(to)h(that)g | |
| 6827 | (command)f(in)g(its)h(en)m(vironmen)m(t.)150 2157 y Fk(3.7.5)63 | |
| 6828 | b(Exit)40 b(Status)275 2406 y Ft(F)-8 b(or)32 b(the)g(shell's)g(purp)s | |
| 37c41ab1 | 6829 | (oses,)e(a)j(command)e(whic)m(h)h(exits)g(with)g(a)g(zero)g(exit)h |
| 28157acd | 6830 | (status)f(has)f(succeeded.)150 2516 y(A)e(non-zero)h(exit)g(status)g |
| 37c41ab1 | 6831 | (indicates)g(failure.)40 b(This)28 b(seemingly)i(coun)m(ter-in)m |
| 28157acd | 6832 | (tuitiv)m(e)i(sc)m(heme)e(is)f(used)g(so)150 2625 y(there)34 |
| 37c41ab1 CR |
6833 | b(is)g(one)g(w)m(ell-de\014ned)g(w)m(a)m(y)g(to)h(indicate)g(success)f |
| 6834 | (and)f(a)h(v)-5 b(ariet)m(y)35 b(of)f(w)m(a)m(ys)h(to)f(indicate)h(v)-5 | |
| 28157acd | 6835 | b(arious)150 2735 y(failure)38 b(mo)s(des.)62 b(When)38 |
| 37c41ab1 | 6836 | b(a)g(command)f(terminates)i(on)e(a)i(fatal)g(signal)f(whose)g(n)m(um)m |
| 28157acd | 6837 | (b)s(er)e(is)i Fq(N)p Ft(,)g(Bash)150 2844 y(uses)30 |
| 37c41ab1 | 6838 | b(the)g(v)-5 b(alue)31 b(128)p Fs(+)p Fq(N)42 b Ft(as)30 |
| 28157acd | 6839 | b(the)h(exit)g(status.)275 2984 y(If)k(a)h(command)g(is)g(not)g(found,) |
| 37c41ab1 | 6840 | g(the)g(c)m(hild)h(pro)s(cess)e(created)i(to)g(execute)g(it)g(returns)d |
| 28157acd | 6841 | (a)j(status)f(of)150 3093 y(127.)42 b(If)30 b(a)h(command)f(is)g(found) |
| 37c41ab1 | 6842 | f(but)h(is)g(not)h(executable,)h(the)f(return)e(status)i(is)f(126.)275 |
| 28157acd | 6843 | 3233 y(If)i(a)i(command)f(fails)g(b)s(ecause)g(of)h(an)f(error)f |
| 37c41ab1 | 6844 | (during)g(expansion)h(or)g(redirection,)i(the)f(exit)g(status)150 |
| 28157acd | 6845 | 3342 y(is)c(greater)i(than)e(zero.)275 3482 y(The)38 |
| eb2bb562 | 6846 | b(exit)h(status)g(is)g(used)f(b)m(y)g(the)h(Bash)g(conditional)h |
| 28157acd | 6847 | (commands)e(\(see)h(Section)h(3.2.4.2)h([Con-)150 3592 |
| eb2bb562 CR |
6848 | y(ditional)i(Constructs],)h(page)f(10\))g(and)e(some)i(of)f(the)g(list) |
| 6849 | g(constructs)g(\(see)h(Section)f(3.2.3)i([Lists],)150 | |
| 28157acd | 6850 | 3701 y(page)31 b(9\).)275 3841 y(All)40 b(of)g(the)h(Bash)f(builtins)f |
| 37c41ab1 | 6851 | (return)g(an)h(exit)h(status)g(of)f(zero)h(if)f(they)g(succeed)g(and)g |
| 28157acd | 6852 | (a)g(non-zero)150 3950 y(status)34 b(on)f(failure,)i(so)f(they)g(ma)m |
| eb2bb562 | 6853 | (y)g(b)s(e)f(used)g(b)m(y)g(the)h(conditional)h(and)e(list)h |
| 28157acd | 6854 | (constructs.)50 b(All)35 b(builtins)150 4060 y(return)29 |
| eb2bb562 | 6855 | b(an)i(exit)g(status)g(of)f(2)h(to)g(indicate)g(incorrect)h(usage.)150 |
| 28157acd | 6856 | 4294 y Fk(3.7.6)63 b(Signals)275 4543 y Ft(When)27 b(Bash)h(is)h(in)m |
| eb2bb562 CR |
6857 | (teractiv)m(e,)i(in)d(the)g(absence)h(of)f(an)m(y)g(traps,)h(it)f |
| 6858 | (ignores)h Fs(SIGTERM)d Ft(\(so)i(that)h(`)p Fs(kill)150 | |
| 28157acd | 6859 | 4653 y(0)p Ft(')k(do)s(es)g(not)g(kill)g(an)g(in)m(teractiv)m(e)j |
| eb2bb562 | 6860 | (shell\),)f(and)d Fs(SIGINT)f Ft(is)i(caugh)m(t)h(and)f(handled)f(\(so) |
| 28157acd | 6861 | h(that)h(the)f Fs(wait)150 4762 y Ft(builtin)24 b(is)h(in)m |
| eb2bb562 CR |
6862 | (terruptible\).)39 b(When)24 b(Bash)g(receiv)m(es)j(a)d |
| 6863 | Fs(SIGINT)p Ft(,)h(it)g(breaks)f(out)h(of)f(an)m(y)h(executing)h(lo)s | |
| 28157acd | 6864 | (ops.)150 4872 y(In)31 b(all)h(cases,)h(Bash)f(ignores)g |
| eb2bb562 | 6865 | Fs(SIGQUIT)p Ft(.)42 b(If)32 b(job)f(con)m(trol)i(is)e(in)h(e\013ect)h |
| 28157acd | 6866 | (\(see)f(Chapter)f(7)h([Job)g(Con)m(trol],)150 4981 y(page)f(85\),)h |
| eb2bb562 | 6867 | (Bash)e(ignores)h Fs(SIGTTIN)p Ft(,)e Fs(SIGTTOU)p Ft(,)g(and)g |
| 28157acd | 6868 | Fs(SIGTSTP)p Ft(.)275 5121 y(Non-builtin)i(commands)g(started)g(b)m(y)g |
| eb2bb562 | 6869 | (Bash)h(ha)m(v)m(e)g(signal)g(handlers)e(set)i(to)g(the)g(v)-5 |
| 28157acd | 6870 | b(alues)31 b(inherited)150 5230 y(b)m(y)37 b(the)h(shell)g(from)f(its)h |
| eb2bb562 | 6871 | (paren)m(t.)62 b(When)38 b(job)f(con)m(trol)i(is)e(not)h(in)f |
| 28157acd | 6872 | (e\013ect,)k(async)m(hronous)c(commands)150 5340 y(ignore)f |
| eb2bb562 | 6873 | Fs(SIGINT)e Ft(and)h Fs(SIGQUIT)e Ft(in)j(addition)f(to)i(these)f |
| 28157acd CR |
6874 | (inherited)f(handlers.)55 b(Commands)35 b(run)f(as)i(a)p |
| 6875 | eop end | |
| 6876 | %%Page: 32 38 | |
| 6877 | TeXDict begin 32 37 bop 150 -116 a Ft(32)2572 b(Bash)31 | |
| 6878 | b(Reference)g(Man)m(ual)150 299 y(result)c(of)h(command)f(substitution) | |
| 6879 | h(ignore)g(the)g(k)m(eyb)s(oard-generated)g(job)g(con)m(trol)h(signals) | |
| 6880 | f Fs(SIGTTIN)p Ft(,)150 408 y Fs(SIGTTOU)p Ft(,)h(and)g | |
| 6881 | Fs(SIGTSTP)p Ft(.)275 542 y(The)h(shell)i(exits)g(b)m(y)f(default)g(up) | |
| 6882 | s(on)f(receipt)i(of)f(a)h Fs(SIGHUP)p Ft(.)42 b(Before)32 | |
| 6883 | b(exiting,)h(an)e(in)m(teractiv)m(e)j(shell)150 652 y(resends)41 | |
| 6884 | b(the)i Fs(SIGHUP)e Ft(to)i(all)g(jobs,)i(running)c(or)h(stopp)s(ed.)76 | |
| ac18b312 | 6885 | b(Stopp)s(ed)41 b(jobs)h(are)h(sen)m(t)g Fs(SIGCONT)d |
| 28157acd | 6886 | Ft(to)150 762 y(ensure)32 b(that)h(they)g(receiv)m(e)i(the)e |
| ac18b312 | 6887 | Fs(SIGHUP)p Ft(.)47 b(T)-8 b(o)33 b(prev)m(en)m(t)g(the)g(shell)g(from) |
| 28157acd CR |
6888 | g(sending)f(the)h Fs(SIGHUP)e Ft(signal)150 871 y(to)i(a)g(particular)g |
| 6889 | (job,)g(it)g(should)f(b)s(e)g(remo)m(v)m(ed)h(from)g(the)f(jobs)g | |
| ac18b312 | 6890 | (table)i(with)e(the)h Fs(disown)e Ft(builtin)h(\(see)150 |
| 28157acd | 6891 | 981 y(Section)f(7.2)g([Job)f(Con)m(trol)h(Builtins],)g(page)g(86\))h |
| ac18b312 | 6892 | (or)e(mark)m(ed)g(to)h(not)f(receiv)m(e)i Fs(SIGHUP)d |
| 28157acd CR |
6893 | Ft(using)h Fs(disown)150 1090 y(-h)p Ft(.)275 1224 y(If)h(the)h |
| 6894 | Fs(huponexit)d Ft(shell)k(option)f(has)g(b)s(een)f(set)h(with)g | |
| 6895 | Fs(shopt)e Ft(\(see)j(Section)g(4.2)g([Bash)f(Builtins],)150 | |
| 6896 | 1334 y(page)f(41\),)h(Bash)e(sends)g(a)h Fs(SIGHUP)d | |
| 6897 | Ft(to)j(all)h(jobs)e(when)f(an)h(in)m(teractiv)m(e)j(login)f(shell)e | |
| 6898 | (exits.)275 1468 y(If)38 b(Bash)h(is)g(w)m(aiting)h(for)f(a)g(command)f | |
| 6899 | (to)i(complete)g(and)e(receiv)m(es)j(a)e(signal)h(for)e(whic)m(h)h(a)g | |
| 6900 | (trap)150 1577 y(has)c(b)s(een)f(set,)i(the)f(trap)g(will)g(not)g(b)s | |
| 6901 | (e)f(executed)i(un)m(til)f(the)g(command)f(completes.)55 | |
| 6902 | b(When)35 b(Bash)g(is)150 1687 y(w)m(aiting)j(for)f(an)g(async)m | |
| 9d2b70f0 | 6903 | (hronous)g(command)g(via)h(the)f Fs(wait)f Ft(builtin,)i(the)g |
| 28157acd | 6904 | (reception)g(of)f(a)g(signal)h(for)150 1797 y(whic)m(h)d(a)g(trap)g |
| 9d2b70f0 CR |
6905 | (has)g(b)s(een)f(set)h(will)h(cause)f(the)g Fs(wait)f |
| 6906 | Ft(builtin)h(to)g(return)f(immediately)i(with)f(an)g(exit)150 | |
| 28157acd CR |
6907 | 1906 y(status)c(greater)g(than)f(128,)i(immediately)g(after)f(whic)m(h) |
| 6908 | f(the)h(trap)f(is)g(executed.)150 2162 y Fr(3.8)68 b(Shell)45 | |
| 6909 | b(Scripts)275 2405 y Ft(A)c(shell)h(script)g(is)g(a)g(text)h(\014le)f | |
| 9d2b70f0 | 6910 | (con)m(taining)h(shell)f(commands.)75 b(When)41 b(suc)m(h)h(a)g(\014le) |
| 28157acd | 6911 | g(is)g(used)f(as)150 2515 y(the)33 b(\014rst)f(non-option)h(argumen)m |
| 9d2b70f0 CR |
6912 | (t)h(when)e(in)m(v)m(oking)i(Bash,)g(and)e(neither)h(the)g(`)p |
| 6913 | Fs(-c)p Ft(')g(nor)g(`)p Fs(-s)p Ft(')f(option)i(is)150 | |
| 28157acd CR |
6914 | 2625 y(supplied)j(\(see)j(Section)g(6.1)f([In)m(v)m(oking)h(Bash],)h |
| 6915 | (page)f(67\),)i(Bash)d(reads)f(and)g(executes)i(commands)150 | |
| 6916 | 2734 y(from)31 b(the)h(\014le,)h(then)e(exits.)46 b(This)31 | |
| 9d2b70f0 | 6917 | b(mo)s(de)g(of)h(op)s(eration)h(creates)g(a)f(non-in)m(teractiv)m(e)i |
| 28157acd | 6918 | (shell.)45 b(The)32 b(shell)150 2844 y(\014rst)26 b(searc)m(hes)h(for)f |
| 9d2b70f0 CR |
6919 | (the)g(\014le)h(in)f(the)g(curren)m(t)h(directory)-8 |
| 6920 | b(,)28 b(and)e(lo)s(oks)g(in)h(the)f(directories)h(in)f | |
| 28157acd CR |
6921 | Fs($PATH)f Ft(if)i(not)150 2953 y(found)i(there.)275 |
| 6922 | 3087 y(When)34 b(Bash)h(runs)e(a)i(shell)g(script,)g(it)h(sets)f(the)f | |
| 9d2b70f0 | 6923 | (sp)s(ecial)i(parameter)f Fs(0)f Ft(to)h(the)g(name)g(of)g(the)g |
| 28157acd | 6924 | (\014le,)150 3197 y(rather)k(than)g(the)h(name)f(of)h(the)f(shell,)j |
| eb2bb562 | 6925 | (and)d(the)h(p)s(ositional)g(parameters)f(are)h(set)g(to)g(the)g |
| 28157acd | 6926 | (remain-)150 3306 y(ing)f(argumen)m(ts,)j(if)d(an)m(y)g(are)g(giv)m |
| eb2bb562 | 6927 | (en.)67 b(If)39 b(no)g(additional)g(argumen)m(ts)h(are)f(supplied,)h |
| 28157acd CR |
6928 | (the)f(p)s(ositional)150 3416 y(parameters)31 b(are)f(unset.)275 |
| 6929 | 3550 y(A)39 b(shell)h(script)f(ma)m(y)h(b)s(e)f(made)h(executable)h(b)m | |
| eb2bb562 | 6930 | (y)e(using)g(the)h Fs(chmod)e Ft(command)h(to)h(turn)e(on)i(the)150 |
| 28157acd | 6931 | 3660 y(execute)j(bit.)73 b(When)41 b(Bash)g(\014nds)e(suc)m(h)i(a)h |
| eb2bb562 | 6932 | (\014le)f(while)g(searc)m(hing)h(the)f Fs($PATH)f Ft(for)h(a)h |
| 28157acd CR |
6933 | (command,)h(it)150 3769 y(spa)m(wns)30 b(a)g(subshell)g(to)h(execute)h |
| 6934 | (it.)41 b(In)30 b(other)g(w)m(ords,)g(executing)390 3903 | |
| 6935 | y Fs(filename)46 b Fj(arguments)150 4037 y Ft(is)30 b(equiv)-5 | |
| 6936 | b(alen)m(t)32 b(to)f(executing)390 4171 y Fs(bash)47 | |
| 6937 | b(filename)e Fj(arguments)150 4305 y Ft(if)30 b Fs(filename)d | |
| eb2bb562 CR |
6938 | Ft(is)j(an)f(executable)j(shell)e(script.)40 b(This)29 |
| 6939 | b(subshell)g(reinitializes)i(itself,)g(so)f(that)h(the)e(e\013ect)150 | |
| 28157acd | 6940 | 4415 y(is)36 b(as)h(if)g(a)f(new)g(shell)h(had)f(b)s(een)g(in)m(v)m(ok) |
| eb2bb562 | 6941 | m(ed)h(to)h(in)m(terpret)e(the)h(script,)h(with)e(the)h(exception)h |
| 28157acd | 6942 | (that)f(the)150 4524 y(lo)s(cations)25 b(of)g(commands)e(remem)m(b)s |
| eb2bb562 | 6943 | (ered)h(b)m(y)g(the)g(paren)m(t)g(\(see)h(the)f(description)g(of)g |
| 28157acd | 6944 | Fs(hash)f Ft(in)h(Section)h(4.1)150 4634 y([Bourne)30 |
| ac18b312 | 6945 | b(Shell)h(Builtins],)g(page)g(35\))h(are)e(retained)h(b)m(y)f(the)h(c)m |
| 28157acd CR |
6946 | (hild.)275 4768 y(Most)36 b(v)m(ersions)g(of)g(Unix)f(mak)m(e)h(this)g |
| 6947 | (a)g(part)f(of)h(the)g(op)s(erating)g(system's)f(command)h(execution) | |
| 6948 | 150 4877 y(mec)m(hanism.)50 b(If)33 b(the)g(\014rst)g(line)h(of)f(a)h | |
| eb2bb562 | 6949 | (script)f(b)s(egins)g(with)g(the)g(t)m(w)m(o)i(c)m(haracters)g(`)p |
| 28157acd | 6950 | Fs(#!)p Ft(',)f(the)g(remainder)150 4987 y(of)d(the)g(line)h(sp)s |
| eb2bb562 CR |
6951 | (eci\014es)e(an)h(in)m(terpreter)g(for)g(the)g(program.)43 |
| 6952 | b(Th)m(us,)30 b(y)m(ou)h(can)h(sp)s(ecify)e(Bash,)i Fs(awk)p | |
| 28157acd | 6953 | Ft(,)e(P)m(erl,)150 5096 y(or)g(some)h(other)g(in)m(terpreter)g(and)e |
| eb2bb562 | 6954 | (write)i(the)f(rest)h(of)g(the)f(script)g(\014le)h(in)f(that)h |
| 28157acd CR |
6955 | (language.)275 5230 y(The)40 b(argumen)m(ts)h(to)g(the)g(in)m |
| 6956 | (terpreter)g(consist)g(of)g(a)g(single)h(optional)f(argumen)m(t)h | |
| 6957 | (follo)m(wing)g(the)150 5340 y(in)m(terpreter)33 b(name)h(on)f(the)g | |
| 6958 | (\014rst)f(line)i(of)f(the)g(script)g(\014le,)h(follo)m(w)m(ed)h(b)m(y) | |
| 6959 | e(the)g(name)g(of)g(the)h(script)f(\014le,)p eop end | |
| 6960 | %%Page: 33 39 | |
| 6961 | TeXDict begin 33 38 bop 150 -116 a Ft(Chapter)30 b(3:)41 | |
| 6962 | b(Basic)32 b(Shell)e(F)-8 b(eatures)2246 b(33)150 299 | |
| 6963 | y(follo)m(w)m(ed)33 b(b)m(y)f(the)f(rest)h(of)g(the)f(argumen)m(ts.)45 | |
| 6964 | b(Bash)31 b(will)h(p)s(erform)e(this)i(action)h(on)e(op)s(erating)h | |
| 6965 | (systems)150 408 y(that)24 b(do)g(not)f(handle)g(it)h(themselv)m(es.)40 | |
| 37c41ab1 | 6966 | b(Note)25 b(that)f(some)g(older)g(v)m(ersions)f(of)h(Unix)f(limit)i |
| 28157acd CR |
6967 | (the)f(in)m(terpreter)150 518 y(name)30 b(and)g(argumen)m(t)h(to)g(a)g |
| 6968 | (maxim)m(um)f(of)h(32)g(c)m(haracters.)275 653 y(Bash)h(scripts)g | |
| 37c41ab1 | 6969 | (often)g(b)s(egin)g(with)g Fs(#!)e(/bin/bash)g Ft(\(assuming)i(that)h |
| 28157acd | 6970 | (Bash)f(has)g(b)s(een)f(installed)i(in)150 762 y(`)p |
| 37c41ab1 CR |
6971 | Fs(/bin)p Ft('\),)25 b(since)e(this)g(ensures)f(that)i(Bash)f(will)h(b) |
| 6972 | s(e)e(used)h(to)h(in)m(terpret)f(the)g(script,)i(ev)m(en)f(if)f(it)h | |
| 28157acd | 6973 | (is)f(executed)150 872 y(under)29 b(another)h(shell.)p |
| 37c41ab1 | 6974 | eop end |
| ac18b312 CR |
6975 | %%Page: 34 40 |
| 6976 | TeXDict begin 34 39 bop 150 -116 a Ft(34)2572 b(Bash)31 | |
| 6977 | b(Reference)g(Man)m(ual)p eop end | |
| 6978 | %%Page: 35 41 | |
| 6979 | TeXDict begin 35 40 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 6980 | b(Shell)30 b(Builtin)h(Commands)2069 b(35)150 299 y Fo(4)80 | |
| 1c72c0cd | 6981 | b(Shell)53 b(Builtin)f(Commands)275 535 y Ft(Builtin)25 |
| 37c41ab1 CR |
6982 | b(commands)f(are)h(con)m(tained)h(within)e(the)h(shell)g(itself.)40 |
| 6983 | b(When)24 b(the)h(name)g(of)g(a)g(builtin)f(com-)150 | |
| 1c72c0cd | 6984 | 645 y(mand)i(is)i(used)e(as)i(the)g(\014rst)e(w)m(ord)h(of)h(a)f |
| 37c41ab1 | 6985 | (simple)h(command)f(\(see)h(Section)g(3.2.1)h([Simple)f(Commands],)150 |
| 1c72c0cd | 6986 | 754 y(page)21 b(8\),)j(the)d(shell)g(executes)h(the)f(command)f |
| 37c41ab1 | 6987 | (directly)-8 b(,)24 b(without)d(in)m(v)m(oking)h(another)f(program.)37 |
| 1c72c0cd | 6988 | b(Builtin)150 864 y(commands)f(are)h(necessary)g(to)g(implemen)m(t)g |
| 37c41ab1 | 6989 | (functionalit)m(y)h(imp)s(ossible)e(or)h(incon)m(v)m(enien)m(t)h(to)f |
| 1c72c0cd | 6990 | (obtain)150 974 y(with)30 b(separate)h(utilities.)275 |
| ac18b312 CR |
6991 | 1109 y(This)c(section)j(brie\015y)e(describ)s(es)g(the)h(builtins)f |
| 6992 | (whic)m(h)g(Bash)h(inherits)f(from)g(the)h(Bourne)g(Shell,)g(as)150 | |
| 6993 | 1218 y(w)m(ell)i(as)g(the)g(builtin)e(commands)h(whic)m(h)h(are)f | |
| 6994 | (unique)g(to)h(or)f(ha)m(v)m(e)i(b)s(een)d(extended)i(in)f(Bash.)275 | |
| 6995 | 1354 y(Sev)m(eral)45 b(builtin)e(commands)h(are)h(describ)s(ed)e(in)h | |
| 6996 | (other)g(c)m(hapters:)69 b(builtin)43 b(commands)h(whic)m(h)150 | |
| 1c72c0cd | 6997 | 1463 y(pro)m(vide)23 b(the)h(Bash)f(in)m(terface)i(to)f(the)g(job)f |
| 37c41ab1 | 6998 | (con)m(trol)i(facilities)g(\(see)f(Section)h(7.2)f([Job)f(Con)m(trol)h |
| 28157acd | 6999 | (Builtins],)150 1573 y(page)40 b(86\),)j(the)c(directory)h(stac)m(k)g |
| 37c41ab1 | 7000 | (\(see)g(Section)g(6.8.1)h([Directory)g(Stac)m(k)f(Builtins],)i(page)e |
| 28157acd CR |
7001 | (77\),)j(the)150 1682 y(command)23 b(history)h(\(see)g(Section)g(9.2)h |
| 7002 | ([Bash)f(History)g(Builtins],)h(page)g(115\),)h(and)d(the)h | |
| 1c72c0cd | 7003 | (programmable)150 1792 y(completion)32 b(facilities)g(\(see)g(Section)f |
| 28157acd | 7004 | (8.7)g([Programmable)g(Completion)g(Builtins],)g(page)h(111\).)275 |
| 1c72c0cd CR |
7005 | 1927 y(Man)m(y)f(of)f(the)h(builtins)e(ha)m(v)m(e)j(b)s(een)e(extended) |
| 7006 | g(b)m(y)g Fl(posix)g Ft(or)g(Bash.)275 2062 y(Unless)20 | |
| 37c41ab1 | 7007 | b(otherwise)h(noted,)h(eac)m(h)g(builtin)e(command)g(do)s(cumen)m(ted)g |
| 1c72c0cd CR |
7008 | (as)h(accepting)h(options)e(preceded)150 2172 y(b)m(y)31 |
| 7009 | b(`)p Fs(-)p Ft(')g(accepts)i(`)p Fs(--)p Ft(')e(to)h(signify)f(the)h | |
| 7010 | (end)e(of)i(the)f(options.)44 b(F)-8 b(or)32 b(example,)g(the)f | |
| 7011 | Fs(:)p Ft(,)h Fs(true)p Ft(,)e Fs(false)p Ft(,)h(and)150 | |
| 7012 | 2282 y Fs(test)e Ft(builtins)h(do)g(not)h(accept)h(options.)150 | |
| 7013 | 2541 y Fr(4.1)68 b(Bourne)45 b(Shell)g(Builtins)275 2786 | |
| 7014 | y Ft(The)31 b(follo)m(wing)i(shell)e(builtin)h(commands)f(are)h | |
| 7015 | (inherited)f(from)g(the)h(Bourne)f(Shell.)45 b(These)31 | |
| 7016 | b(com-)150 2895 y(mands)e(are)i(implemen)m(ted)g(as)g(sp)s(eci\014ed)e | |
| ac18b312 CR |
7017 | (b)m(y)i(the)f Fl(posix)g Ft(standard.)150 3056 y Fs(:)g |
| 7018 | Ft(\(a)h(colon\))870 3165 y Fs(:)47 b([)p Fj(arguments)11 | |
| 1c72c0cd CR |
7019 | b Fs(])630 3300 y Ft(Do)43 b(nothing)f(b)s(ey)m(ond)g(expanding)f |
| 7020 | Fq(argumen)m(ts)46 b Ft(and)c(p)s(erforming)f(redirections.)76 | |
| 7021 | b(The)630 3410 y(return)29 b(status)i(is)f(zero.)150 | |
| 7022 | 3570 y Fs(.)g Ft(\(a)h(p)s(erio)s(d\))870 3679 y Fs(.)47 | |
| 5e13499c | 7023 | b Fj(filename)57 b Fs([)p Fj(arguments)11 b Fs(])630 |
| 1c72c0cd | 7024 | 3814 y Ft(Read)34 b(and)f(execute)i(commands)e(from)g(the)h |
| 37c41ab1 | 7025 | Fq(\014lename)39 b Ft(argumen)m(t)34 b(in)f(the)h(curren)m(t)g(shell) |
| 1c72c0cd | 7026 | 630 3924 y(con)m(text.)45 b(If)31 b Fq(\014lename)37 |
| 37c41ab1 CR |
7027 | b Ft(do)s(es)31 b(not)g(con)m(tain)i(a)e(slash,)h(the)g |
| 7028 | Fs(PATH)e Ft(v)-5 b(ariable)32 b(is)f(used)f(to)i(\014nd)630 | |
| 1c72c0cd | 7029 | 4033 y Fq(\014lename)p Ft(.)52 b(When)34 b(Bash)g(is)h(not)f(in)g |
| 37c41ab1 | 7030 | Fl(posix)f Ft(mo)s(de,)i(the)g(curren)m(t)f(directory)g(is)g(searc)m |
| 1c72c0cd | 7031 | (hed)630 4143 y(if)d Fq(\014lename)36 b Ft(is)31 b(not)h(found)d(in)i |
| 5e13499c | 7032 | Fs($PATH)p Ft(.)41 b(If)31 b(an)m(y)g Fq(argumen)m(ts)k |
| 1c72c0cd | 7033 | Ft(are)c(supplied,)f(they)i(b)s(ecome)630 4253 y(the)e(p)s(ositional)h |
| 37c41ab1 | 7034 | (parameters)g(when)e Fq(\014lename)35 b Ft(is)30 b(executed.)42 |
| 1c72c0cd | 7035 | b(Otherwise)30 b(the)g(p)s(ositional)630 4362 y(parameters)43 |
| 37c41ab1 | 7036 | b(are)h(unc)m(hanged.)79 b(The)42 b(return)g(status)i(is)f(the)g(exit)h |
| 1c72c0cd | 7037 | (status)g(of)f(the)g(last)630 4472 y(command)37 b(executed,)k(or)c |
| 37c41ab1 | 7038 | (zero)h(if)g(no)f(commands)g(are)h(executed.)63 b(If)36 |
| 1c72c0cd | 7039 | b Fq(\014lename)43 b Ft(is)38 b(not)630 4581 y(found,)22 |
| 37c41ab1 CR |
7040 | b(or)f(cannot)g(b)s(e)f(read,)j(the)e(return)f(status)h(is)g(non-zero.) |
| 7041 | 38 b(This)20 b(builtin)h(is)f(equiv)-5 b(alen)m(t)630 | |
| 1c72c0cd CR |
7042 | 4691 y(to)31 b Fs(source)p Ft(.)150 4851 y Fs(break)870 |
| 7043 | 4986 y(break)46 b([)p Fj(n)11 b Fs(])630 5121 y Ft(Exit)45 | |
| 37c41ab1 CR |
7044 | b(from)f(a)g Fs(for)p Ft(,)k Fs(while)p Ft(,)e Fs(until)p |
| 7045 | Ft(,)h(or)d Fs(select)f Ft(lo)s(op.)83 b(If)44 b Fq(n)g | |
| 1c72c0cd | 7046 | Ft(is)g(supplied,)j(the)e Fq(n)p Ft(th)630 5230 y(enclosing)c(lo)s(op)f |
| 37c41ab1 | 7047 | (is)h(exited.)70 b Fq(n)40 b Ft(m)m(ust)g(b)s(e)f(greater)j(than)d(or)i |
| 1c72c0cd | 7048 | (equal)f(to)h(1.)70 b(The)40 b(return)630 5340 y(status)31 |
| 37c41ab1 | 7049 | b(is)f(zero)h(unless)f Fq(n)g Ft(is)g(not)h(greater)g(than)g(or)f |
| 1c72c0cd | 7050 | (equal)h(to)g(1.)p eop end |
| ac18b312 CR |
7051 | %%Page: 36 42 |
| 7052 | TeXDict begin 36 41 bop 150 -116 a Ft(36)2572 b(Bash)31 | |
| 1c72c0cd CR |
7053 | b(Reference)g(Man)m(ual)150 299 y Fs(cd)870 430 y(cd)47 |
| 7054 | b([-L|-P])f([)p Fj(directory)11 b Fs(])630 562 y Ft(Change)37 | |
| 7055 | b(the)g(curren)m(t)f(w)m(orking)i(directory)f(to)h Fq(directory)p | |
| 7056 | Ft(.)60 b(If)37 b Fq(directory)45 b Ft(is)37 b(not)g(giv)m(en,)630 | |
| 7057 | 671 y(the)31 b(v)-5 b(alue)31 b(of)g(the)g Fs(HOME)e | |
| 7058 | Ft(shell)i(v)-5 b(ariable)32 b(is)f(used.)40 b(If)31 | |
| 7059 | b(the)g(shell)g(v)-5 b(ariable)31 b Fs(CDPATH)e Ft(exists,)630 | |
| 7060 | 781 y(it)f(is)f(used)f(as)h(a)h(searc)m(h)f(path.)40 | |
| 7061 | b(If)26 b Fq(directory)35 b Ft(b)s(egins)27 b(with)g(a)g(slash,)h | |
| 7062 | Fs(CDPATH)d Ft(is)i(not)g(used.)630 913 y(The)h(`)p Fs(-P)p | |
| 7063 | Ft(')h(option)g(means)f(to)h(not)g(follo)m(w)h(sym)m(b)s(olic)f(links;) | |
| 7064 | g(sym)m(b)s(olic)g(links)f(are)h(follo)m(w)m(ed)630 1022 | |
| 7065 | y(b)m(y)23 b(default)h(or)g(with)f(the)h(`)p Fs(-L)p | |
| 7066 | Ft(')f(option.)39 b(If)23 b Fq(directory)32 b Ft(is)23 | |
| 7067 | b(`)p Fs(-)p Ft(',)j(it)e(is)f(equiv)-5 b(alen)m(t)25 | |
| 7068 | b(to)g Fs($OLDPWD)p Ft(.)630 1154 y(If)33 b(a)h(non-empt)m(y)g | |
| 37c41ab1 | 7069 | (directory)g(name)f(from)g Fs(CDPATH)f Ft(is)h(used,)h(or)g(if)f(`)p |
| 1c72c0cd | 7070 | Fs(-)p Ft(')h(is)f(the)h(\014rst)f(argu-)630 1263 y(men)m(t,)28 |
| 37c41ab1 | 7071 | b(and)e(the)h(directory)g(c)m(hange)h(is)f(successful,)h(the)f |
| 1c72c0cd | 7072 | (absolute)g(pathname)g(of)f(the)h(new)630 1373 y(w)m(orking)k |
| 37c41ab1 | 7073 | (directory)g(is)f(written)g(to)i(the)e(standard)g(output.)630 |
| 1c72c0cd CR |
7074 | 1504 y(The)f(return)g(status)h(is)f(zero)i(if)e(the)h(directory)g(is)g |
| 7075 | (successfully)g(c)m(hanged,)g(non-zero)g(oth-)630 1614 | |
| 7076 | y(erwise.)150 1767 y Fs(continue)870 1899 y(continue)46 | |
| 7077 | b([)p Fj(n)11 b Fs(])630 2030 y Ft(Resume)32 b(the)g(next)g(iteration)i | |
| 37c41ab1 | 7078 | (of)e(an)g(enclosing)h Fs(for)p Ft(,)f Fs(while)p Ft(,)f |
| 1c72c0cd | 7079 | Fs(until)p Ft(,)g(or)h Fs(select)f Ft(lo)s(op.)630 2140 |
| 37c41ab1 CR |
7080 | y(If)f Fq(n)h Ft(is)g(supplied,)e(the)j(execution)g(of)f(the)g |
| 7081 | Fq(n)p Ft(th)f(enclosing)i(lo)s(op)f(is)f(resumed.)42 | |
| 1c72c0cd | 7082 | b Fq(n)30 b Ft(m)m(ust)h(b)s(e)630 2250 y(greater)39 |
| 37c41ab1 | 7083 | b(than)f(or)g(equal)g(to)h(1.)63 b(The)38 b(return)e(status)j(is)e |
| 1c72c0cd CR |
7084 | (zero)i(unless)e Fq(n)h Ft(is)g(not)g(greater)630 2359 |
| 7085 | y(than)30 b(or)g(equal)h(to)g(1.)150 2513 y Fs(eval)870 | |
| 7086 | 2644 y(eval)47 b([)p Fj(arguments)11 b Fs(])630 2776 | |
| 37c41ab1 | 7087 | y Ft(The)25 b(argumen)m(ts)h(are)g(concatenated)i(together)f(in)m(to)f |
| 1c72c0cd | 7088 | (a)g(single)h(command,)f(whic)m(h)g(is)f(then)630 2885 |
| 37c41ab1 CR |
7089 | y(read)35 b(and)g(executed,)j(and)d(its)h(exit)g(status)g(returned)e |
| 7090 | (as)h(the)h(exit)g(status)g(of)g Fs(eval)p Ft(.)54 b(If)630 | |
| 1c72c0cd | 7091 | 2995 y(there)31 b(are)f(no)h(argumen)m(ts)f(or)h(only)f(empt)m(y)h |
| 37c41ab1 | 7092 | (argumen)m(ts,)g(the)f(return)g(status)g(is)h(zero.)150 |
| 1c72c0cd | 7093 | 3148 y Fs(exec)870 3280 y(exec)47 b([-cl])f([-a)h Fj(name)11 |
| 5e13499c | 7094 | b Fs(])46 b([)p Fj(command)56 b Fs([)p Fj(arguments)11 |
| 28157acd CR |
7095 | b Fs(]])630 3411 y Ft(If)28 b Fq(command)j Ft(is)e(supplied,)e(it)i |
| 7096 | (replaces)g(the)f(shell)h(without)f(creating)i(a)e(new)g(pro)s(cess.)39 | |
| 7097 | b(If)630 3521 y(the)25 b(`)p Fs(-l)p Ft(')f(option)i(is)e(supplied,)h | |
| 7098 | (the)g(shell)g(places)g(a)g(dash)f(at)i(the)f(b)s(eginning)f(of)g(the)h | |
| 7099 | (zeroth)630 3630 y(arg)h(passed)f(to)h Fq(command)p Ft(.)39 | |
| 7100 | b(This)24 b(is)i(what)f(the)h Fs(login)d Ft(program)j(do)s(es.)38 | |
| 7101 | b(The)25 b(`)p Fs(-c)p Ft(')g(option)630 3740 y(causes)g | |
| 7102 | Fq(command)i Ft(to)e(b)s(e)f(executed)h(with)f(an)g(empt)m(y)h(en)m | |
| 7103 | (vironmen)m(t.)39 b(If)24 b(`)p Fs(-a)p Ft(')g(is)g(supplied,)630 | |
| 7104 | 3850 y(the)32 b(shell)g(passes)g Fq(name)37 b Ft(as)c(the)f(zeroth)h | |
| 7105 | (argumen)m(t)f(to)h Fq(command)p Ft(.)45 b(If)32 b(no)g | |
| 7106 | Fq(command)j Ft(is)630 3959 y(sp)s(eci\014ed,)g(redirections)g(ma)m(y)g | |
| 7107 | (b)s(e)f(used)f(to)i(a\013ect)h(the)f(curren)m(t)f(shell)h(en)m | |
| 7108 | (vironmen)m(t.)53 b(If)630 4069 y(there)34 b(are)h(no)f(redirection)h | |
| 7109 | (errors,)g(the)f(return)f(status)i(is)f(zero;)j(otherwise)e(the)f | |
| 7110 | (return)630 4178 y(status)d(is)f(non-zero.)150 4332 y | |
| 7111 | Fs(exit)870 4463 y(exit)47 b([)p Fj(n)11 b Fs(])630 4595 | |
| 7112 | y Ft(Exit)30 b(the)g(shell,)h(returning)d(a)j(status)f(of)g | |
| 7113 | Fq(n)f Ft(to)h(the)g(shell's)g(paren)m(t.)41 b(If)30 | |
| 7114 | b Fq(n)f Ft(is)h(omitted,)h(the)630 4704 y(exit)c(status)g(is)g(that)g | |
| 7115 | (of)g(the)g(last)g(command)f(executed.)41 b(An)m(y)26 | |
| 1c72c0cd CR |
7116 | b(trap)h(on)f Fs(EXIT)f Ft(is)i(executed)630 4814 y(b)s(efore)j(the)h |
| 7117 | (shell)f(terminates.)150 4967 y Fs(export)870 5099 y(export)46 | |
| 5e13499c | 7118 | b([-fn])g([-p])h([)p Fj(name)11 b Fs([=)p Fj(value)g |
| 1c72c0cd | 7119 | Fs(]])630 5230 y Ft(Mark)40 b(eac)m(h)h Fq(name)k Ft(to)40 |
| 37c41ab1 | 7120 | b(b)s(e)f(passed)g(to)i(c)m(hild)f(pro)s(cesses)f(in)g(the)h(en)m |
| 1c72c0cd | 7121 | (vironmen)m(t.)70 b(If)39 b(the)630 5340 y(`)p Fs(-f)p |
| 37c41ab1 | 7122 | Ft(')29 b(option)h(is)g(supplied,)f(the)g Fq(name)5 b |
| 1c72c0cd CR |
7123 | Ft(s)30 b(refer)f(to)h(shell)g(functions;)f(otherwise)h(the)g(names)p |
| 7124 | eop end | |
| ac18b312 CR |
7125 | %%Page: 37 43 |
| 7126 | TeXDict begin 37 42 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 7127 | b(Shell)30 b(Builtin)h(Commands)2069 b(37)630 299 y(refer)36 | |
| 1c72c0cd CR |
7128 | b(to)i(shell)e(v)-5 b(ariables.)60 b(The)36 b(`)p Fs(-n)p |
| 7129 | Ft(')h(option)g(means)f(to)h(no)g(longer)g(mark)f(eac)m(h)i | |
| 7130 | Fq(name)630 408 y Ft(for)h(exp)s(ort.)65 b(If)39 b(no)g | |
| 7131 | Fq(names)j Ft(are)d(supplied,)h(or)f(if)g(the)g(`)p Fs(-p)p | |
| 7132 | Ft(')g(option)g(is)g(giv)m(en,)j(a)d(list)h(of)630 518 | |
| 7133 | y(exp)s(orted)c(names)h(is)f(displa)m(y)m(ed.)60 b(The)37 | |
| 7134 | b(`)p Fs(-p)p Ft(')f(option)h(displa)m(ys)g(output)f(in)g(a)h(form)f | |
| 7135 | (that)630 628 y(ma)m(y)c(b)s(e)e(reused)g(as)i(input.)42 | |
| 37c41ab1 CR |
7136 | b(If)30 b(a)i(v)-5 b(ariable)31 b(name)h(is)f(follo)m(w)m(ed)h(b)m(y)f |
| 7137 | (=)p Fq(v)-5 b(alue)p Ft(,)32 b(the)f(v)-5 b(alue)32 | |
| 1c72c0cd CR |
7138 | b(of)630 737 y(the)f(v)-5 b(ariable)31 b(is)f(set)h(to)g |
| 7139 | Fq(v)-5 b(alue)p Ft(.)630 870 y(The)29 b(return)e(status)j(is)f(zero)h | |
| 37c41ab1 | 7140 | (unless)e(an)h(in)m(v)-5 b(alid)29 b(option)h(is)f(supplied,)f(one)i |
| 1c72c0cd | 7141 | (of)f(the)g(names)630 980 y(is)h(not)h(a)f(v)-5 b(alid)31 |
| 37c41ab1 CR |
7142 | b(shell)f(v)-5 b(ariable)31 b(name,)f(or)h(`)p Fs(-f)p |
| 7143 | Ft(')f(is)g(supplied)f(with)g(a)i(name)f(that)h(is)f(not)h(a)630 | |
| 1c72c0cd | 7144 | 1089 y(shell)g(function.)150 1246 y Fs(getopts)870 1379 |
| 5e13499c | 7145 | y(getopts)46 b Fj(optstring)56 b(name)h Fs([)p Fj(args)11 |
| 1c72c0cd | 7146 | b Fs(])630 1512 y(getopts)28 b Ft(is)i(used)g(b)m(y)g(shell)g(scripts)g |
| 37c41ab1 | 7147 | (to)g(parse)g(p)s(ositional)h(parameters.)41 b Fq(optstring)d |
| 1c72c0cd | 7148 | Ft(con-)630 1622 y(tains)k(the)g(option)f(c)m(haracters)i(to)g(b)s(e)d |
| 37c41ab1 | 7149 | (recognized;)49 b(if)42 b(a)f(c)m(haracter)j(is)d(follo)m(w)m(ed)i(b)m |
| 1c72c0cd | 7150 | (y)f(a)630 1731 y(colon,)33 b(the)f(option)g(is)g(exp)s(ected)g(to)h |
| 37c41ab1 | 7151 | (ha)m(v)m(e)g(an)e(argumen)m(t,)i(whic)m(h)f(should)e(b)s(e)h |
| 1c72c0cd | 7152 | (separated)630 1841 y(from)37 b(it)h(b)m(y)f(white)h(space.)63 |
| 37c41ab1 | 7153 | b(The)37 b(colon)h(\(`)p Fs(:)p Ft('\))h(and)d(question)i(mark)f(\(`)p |
| 1c72c0cd | 7154 | Fs(?)p Ft('\))i(ma)m(y)f(not)g(b)s(e)630 1951 y(used)g(as)g(option)h(c) |
| 37c41ab1 | 7155 | m(haracters.)67 b(Eac)m(h)39 b(time)g(it)g(is)f(in)m(v)m(ok)m(ed,)k |
| 1c72c0cd | 7156 | Fs(getopts)37 b Ft(places)i(the)g(next)630 2060 y(option)29 |
| 37c41ab1 CR |
7157 | b(in)f(the)h(shell)g(v)-5 b(ariable)30 b Fq(name)p Ft(,)f(initializing) |
| 7158 | i Fq(name)j Ft(if)28 b(it)h(do)s(es)g(not)g(exist,)h(and)e(the)630 | |
| 1c72c0cd | 7159 | 2170 y(index)33 b(of)g(the)h(next)f(argumen)m(t)h(to)g(b)s(e)e(pro)s |
| 37c41ab1 | 7160 | (cessed)h(in)m(to)h(the)g(v)-5 b(ariable)34 b Fs(OPTIND)p |
| 1c72c0cd | 7161 | Ft(.)48 b Fs(OPTIND)630 2279 y Ft(is)41 b(initialized)i(to)f(1)f(eac)m |
| 37c41ab1 | 7162 | (h)h(time)g(the)f(shell)g(or)g(a)g(shell)g(script)g(is)g(in)m(v)m(ok)m |
| 1c72c0cd | 7163 | (ed.)74 b(When)41 b(an)630 2389 y(option)36 b(requires)e(an)h(argumen)m |
| 37c41ab1 | 7164 | (t,)i Fs(getopts)c Ft(places)j(that)g(argumen)m(t)g(in)m(to)g(the)f(v) |
| 1c72c0cd | 7165 | -5 b(ariable)630 2498 y Fs(OPTARG)p Ft(.)55 b(The)35 |
| 37c41ab1 | 7166 | b(shell)g(do)s(es)h(not)g(reset)g Fs(OPTIND)e Ft(automatically;)41 |
| 1c72c0cd | 7167 | b(it)36 b(m)m(ust)f(b)s(e)g(man)m(ually)630 2608 y(reset)i(b)s(et)m(w)m |
| 37c41ab1 | 7168 | (een)g(m)m(ultiple)h(calls)f(to)g Fs(getopts)e Ft(within)h(the)h(same)g |
| 1c72c0cd | 7169 | (shell)f(in)m(v)m(o)s(cation)j(if)e(a)630 2718 y(new)30 |
| 37c41ab1 | 7170 | b(set)h(of)f(parameters)h(is)f(to)i(b)s(e)d(used.)630 |
| 1c72c0cd | 7171 | 2851 y(When)41 b(the)h(end)e(of)i(options)g(is)f(encoun)m(tered,)k |
| 37c41ab1 | 7172 | Fs(getopts)39 b Ft(exits)j(with)f(a)h(return)e(v)-5 b(alue)630 |
| 1c72c0cd | 7173 | 2960 y(greater)32 b(than)e(zero.)41 b Fs(OPTIND)29 b |
| 37c41ab1 | 7174 | Ft(is)h(set)h(to)g(the)g(index)f(of)g(the)h(\014rst)f(non-option)g |
| 1c72c0cd CR |
7175 | (argumen)m(t,)630 3070 y(and)g Fs(name)f Ft(is)h(set)h(to)g(`)p |
| 7176 | Fs(?)p Ft('.)630 3203 y Fs(getopts)c Ft(normally)j(parses)e(the)i(p)s | |
| 37c41ab1 | 7177 | (ositional)g(parameters,)g(but)e(if)i(more)f(argumen)m(ts)h(are)630 |
| 1c72c0cd CR |
7178 | 3313 y(giv)m(en)h(in)f Fq(args)p Ft(,)h Fs(getopts)e |
| 7179 | Ft(parses)h(those)h(instead.)630 3446 y Fs(getopts)h | |
| 37c41ab1 CR |
7180 | Ft(can)h(rep)s(ort)g(errors)g(in)h(t)m(w)m(o)h(w)m(a)m(ys.)51 |
| 7181 | b(If)33 b(the)h(\014rst)e(c)m(haracter)k(of)d Fq(optstring)42 | |
| 1c72c0cd | 7182 | b Ft(is)34 b(a)630 3555 y(colon,)i Fq(silen)m(t)i Ft(error)33 |
| 37c41ab1 | 7183 | b(rep)s(orting)h(is)h(used.)51 b(In)33 b(normal)i(op)s(eration)f |
| 1c72c0cd | 7184 | (diagnostic)i(messages)630 3665 y(are)30 b(prin)m(ted)e(when)g(in)m(v) |
| 37c41ab1 | 7185 | -5 b(alid)30 b(options)g(or)f(missing)g(option)g(argumen)m(ts)h(are)f |
| 1c72c0cd | 7186 | (encoun)m(tered.)630 3774 y(If)34 b(the)g(v)-5 b(ariable)35 |
| 37c41ab1 | 7187 | b Fs(OPTERR)d Ft(is)i(set)h(to)f(0,)i(no)e(error)g(messages)h(will)f(b) |
| 1c72c0cd | 7188 | s(e)f(displa)m(y)m(ed,)j(ev)m(en)f(if)630 3884 y(the)c(\014rst)e(c)m |
| 37c41ab1 | 7189 | (haracter)j(of)f Fs(optstring)d Ft(is)i(not)h(a)f(colon.)630 |
| 1c72c0cd | 7190 | 4017 y(If)39 b(an)h(in)m(v)-5 b(alid)41 b(option)f(is)g(seen,)i |
| 37c41ab1 | 7191 | Fs(getopts)c Ft(places)j(`)p Fs(?)p Ft(')f(in)m(to)h |
| 1c72c0cd | 7192 | Fq(name)k Ft(and,)d(if)e(not)g(silen)m(t,)630 4127 y(prin)m(ts)f(an)h |
| 37c41ab1 CR |
7193 | (error)f(message)h(and)f(unsets)g Fs(OPTARG)p Ft(.)67 |
| 7194 | b(If)39 b Fs(getopts)f Ft(is)i(silen)m(t,)j(the)c(option)630 | |
| 1c72c0cd | 7195 | 4236 y(c)m(haracter)32 b(found)d(is)h(placed)h(in)f Fs(OPTARG)f |
| 37c41ab1 | 7196 | Ft(and)h(no)g(diagnostic)i(message)f(is)g(prin)m(ted.)630 |
| 1c72c0cd | 7197 | 4369 y(If)c(a)g(required)f(argumen)m(t)i(is)f(not)g(found,)g(and)f |
| 37c41ab1 | 7198 | Fs(getopts)f Ft(is)i(not)h(silen)m(t,)h(a)e(question)g(mark)630 |
| 1c72c0cd | 7199 | 4479 y(\(`)p Fs(?)p Ft('\))h(is)g(placed)g(in)f Fq(name)p |
| 37c41ab1 | 7200 | Ft(,)h Fs(OPTARG)e Ft(is)h(unset,)h(and)f(a)g(diagnostic)i(message)g |
| 1c72c0cd | 7201 | (is)e(prin)m(ted.)39 b(If)630 4589 y Fs(getopts)28 b |
| 37c41ab1 CR |
7202 | Ft(is)h(silen)m(t,)i(then)e(a)h(colon)h(\(`)p Fs(:)p |
| 7203 | Ft('\))f(is)g(placed)g(in)f Fq(name)35 b Ft(and)29 b | |
| 1c72c0cd | 7204 | Fs(OPTARG)f Ft(is)h(set)h(to)h(the)630 4698 y(option)g(c)m(haracter)h |
| ac18b312 | 7205 | (found.)150 4855 y Fs(hash)870 4988 y(hash)47 b([-r])f([-p)h |
| 5e13499c | 7206 | Fj(filename)11 b Fs(])45 b([-dt])h([)p Fj(name)11 b Fs(])630 |
| 1c72c0cd | 7207 | 5121 y Ft(Remem)m(b)s(er)36 b(the)g(full)g(pathnames)g(of)g(commands)g |
| 37c41ab1 | 7208 | (sp)s(eci\014ed)g(as)g Fq(name)41 b Ft(argumen)m(ts,)e(so)630 |
| 1c72c0cd | 7209 | 5230 y(they)34 b(need)h(not)f(b)s(e)g(searc)m(hed)h(for)f(on)g |
| 37c41ab1 | 7210 | (subsequen)m(t)f(in)m(v)m(o)s(cations.)55 b(The)34 b(commands)g(are)630 |
| 1c72c0cd | 7211 | 5340 y(found)39 b(b)m(y)i(searc)m(hing)g(through)f(the)h(directories)g |
| 37c41ab1 | 7212 | (listed)g(in)f Fs($PATH)p Ft(.)70 b(The)40 b(`)p Fs(-p)p |
| 1c72c0cd | 7213 | Ft(')g(option)p eop end |
| ac18b312 CR |
7214 | %%Page: 38 44 |
| 7215 | TeXDict begin 38 43 bop 150 -116 a Ft(38)2572 b(Bash)31 | |
| 1c72c0cd CR |
7216 | b(Reference)g(Man)m(ual)630 299 y(inhibits)38 b(the)h(path)g(searc)m |
| 7217 | (h,)j(and)c Fq(\014lename)44 b Ft(is)39 b(used)f(as)i(the)f(lo)s | |
| 7218 | (cation)h(of)f Fq(name)p Ft(.)66 b(The)630 408 y(`)p | |
| 7219 | Fs(-r)p Ft(')28 b(option)g(causes)g(the)g(shell)h(to)f(forget)h(all)g | |
| 7220 | (remem)m(b)s(ered)e(lo)s(cations.)41 b(The)28 b(`)p Fs(-d)p | |
| 7221 | Ft(')f(option)630 518 y(causes)38 b(the)g(shell)g(to)g(forget)g(the)g | |
| 7222 | (remem)m(b)s(ered)f(lo)s(cation)i(of)f(eac)m(h)h Fq(name)p | |
| 7223 | Ft(.)62 b(If)37 b(the)h(`)p Fs(-t)p Ft(')630 628 y(option)22 | |
| 7224 | b(is)g(supplied,)g(the)g(full)f(pathname)h(to)g(whic)m(h)g(eac)m(h)g | |
| 7225 | Fq(name)27 b Ft(corresp)s(onds)20 b(is)i(prin)m(ted.)630 | |
| 7226 | 737 y(If)33 b(m)m(ultiple)h Fq(name)k Ft(argumen)m(ts)c(are)f(supplied) | |
| 7227 | f(with)h(`)p Fs(-t)p Ft(')g(the)h Fq(name)k Ft(is)c(prin)m(ted)e(b)s | |
| 7228 | (efore)630 847 y(the)h(hashed)f(full)g(pathname.)48 b(The)32 | |
| 7229 | b(`)p Fs(-l)p Ft(')h(option)g(causes)g(output)f(to)i(b)s(e)e(displa)m | |
| 7230 | (y)m(ed)h(in)g(a)630 956 y(format)f(that)g(ma)m(y)g(b)s(e)f(reused)g | |
| 7231 | (as)g(input.)43 b(If)31 b(no)h(argumen)m(ts)g(are)f(giv)m(en,)j(or)d | |
| 7232 | (if)g(only)h(`)p Fs(-l)p Ft(')630 1066 y(is)j(supplied,)f(information)h | |
| 7233 | (ab)s(out)g(remem)m(b)s(ered)f(commands)g(is)h(prin)m(ted.)53 | |
| 7234 | b(The)34 b(return)630 1176 y(status)d(is)f(zero)h(unless)f(a)h | |
| 37c41ab1 | 7235 | Fq(name)k Ft(is)c(not)f(found)f(or)i(an)f(in)m(v)-5 b(alid)31 |
| 1c72c0cd CR |
7236 | b(option)g(is)f(supplied.)150 1340 y Fs(pwd)870 1477 |
| 7237 | y(pwd)47 b([-LP])630 1614 y Ft(Prin)m(t)24 b(the)h(absolute)g(pathname) | |
| 37c41ab1 | 7238 | g(of)f(the)h(curren)m(t)f(w)m(orking)h(directory)-8 b(.)40 |
| 1c72c0cd | 7239 | b(If)23 b(the)i(`)p Fs(-P)p Ft(')f(option)630 1724 y(is)36 |
| 37c41ab1 CR |
7240 | b(supplied,)f(the)h(pathname)f(prin)m(ted)g(will)h(not)g(con)m(tain)h |
| 7241 | (sym)m(b)s(olic)f(links.)55 b(If)35 b(the)h(`)p Fs(-L)p | |
| 1c72c0cd | 7242 | Ft(')630 1833 y(option)44 b(is)g(supplied,)i(the)e(pathname)f(prin)m |
| 37c41ab1 | 7243 | (ted)h(ma)m(y)g(con)m(tain)h(sym)m(b)s(olic)f(links.)80 |
| 1c72c0cd | 7244 | b(The)630 1943 y(return)26 b(status)h(is)h(zero)g(unless)e(an)h(error)g |
| 37c41ab1 | 7245 | (is)g(encoun)m(tered)g(while)h(determining)f(the)g(name)630 |
| 1c72c0cd CR |
7246 | 2052 y(of)k(the)f(curren)m(t)g(directory)h(or)f(an)h(in)m(v)-5 |
| 7247 | b(alid)31 b(option)g(is)f(supplied.)150 2217 y Fs(readonly)870 | |
| 7248 | 2354 y(readonly)46 b([-apf])g([)p Fj(name)11 b Fs([=)p | |
| 7249 | Fj(value)g Fs(]])43 b(...)630 2491 y Ft(Mark)24 b(eac)m(h)h | |
| 37c41ab1 CR |
7250 | Fq(name)k Ft(as)24 b(readonly)-8 b(.)39 b(The)24 b(v)-5 |
| 7251 | b(alues)24 b(of)g(these)g(names)g(ma)m(y)g(not)g(b)s(e)g(c)m(hanged)g | |
| 1c72c0cd | 7252 | (b)m(y)630 2600 y(subsequen)m(t)e(assignmen)m(t.)39 b(If)22 |
| 37c41ab1 | 7253 | b(the)h(`)p Fs(-f)p Ft(')f(option)i(is)e(supplied,)h(eac)m(h)h |
| 1c72c0cd | 7254 | Fq(name)k Ft(refers)22 b(to)i(a)f(shell)630 2710 y(function.)52 |
| 37c41ab1 | 7255 | b(The)34 b(`)p Fs(-a)p Ft(')g(option)h(means)g(eac)m(h)g |
| 5e13499c | 7256 | Fq(name)40 b Ft(refers)33 b(to)j(an)e(arra)m(y)h(v)-5 |
| 1c72c0cd | 7257 | b(ariable.)53 b(If)34 b(no)630 2819 y Fq(name)d Ft(argumen)m(ts)26 |
| 37c41ab1 | 7258 | b(are)g(giv)m(en,)i(or)d(if)h(the)g(`)p Fs(-p)p Ft(')f(option)h(is)g |
| 1c72c0cd | 7259 | (supplied,)f(a)h(list)h(of)e(all)i(readonly)630 2929 |
| 37c41ab1 CR |
7260 | y(names)37 b(is)g(prin)m(ted.)59 b(The)37 b(`)p Fs(-p)p |
| 7261 | Ft(')f(option)i(causes)f(output)g(to)g(b)s(e)f(displa)m(y)m(ed)i(in)e | |
| 1c72c0cd | 7262 | (a)i(format)630 3039 y(that)25 b(ma)m(y)g(b)s(e)f(reused)g(as)h(input.) |
| 37c41ab1 CR |
7263 | 38 b(If)24 b(a)h(v)-5 b(ariable)25 b(name)g(is)g(follo)m(w)m(ed)h(b)m |
| 7264 | (y)e(=)p Fq(v)-5 b(alue)p Ft(,)27 b(the)d(v)-5 b(alue)630 | |
| 1c72c0cd | 7265 | 3148 y(of)27 b(the)g(v)-5 b(ariable)27 b(is)g(set)g(to)g |
| 37c41ab1 | 7266 | Fq(v)-5 b(alue)p Ft(.)40 b(The)26 b(return)g(status)h(is)f(zero)i |
| 1c72c0cd | 7267 | (unless)e(an)g(in)m(v)-5 b(alid)27 b(option)630 3258 |
| 37c41ab1 CR |
7268 | y(is)j(supplied,)f(one)h(of)g(the)g Fq(name)35 b Ft(argumen)m(ts)30 |
| 7269 | b(is)g(not)g(a)g(v)-5 b(alid)31 b(shell)f(v)-5 b(ariable)30 | |
| 1c72c0cd | 7270 | b(or)g(function)630 3367 y(name,)h(or)f(the)h(`)p Fs(-f)p |
| 37c41ab1 | 7271 | Ft(')f(option)h(is)f(supplied)f(with)h(a)h(name)f(that)h(is)g(not)f(a)h |
| 1c72c0cd CR |
7272 | (shell)g(function.)150 3532 y Fs(return)870 3669 y(return)46 |
| 7273 | b([)p Fj(n)11 b Fs(])630 3806 y Ft(Cause)30 b(a)g(shell)g(function)g | |
| 37c41ab1 CR |
7274 | (to)h(exit)f(with)g(the)g(return)f(v)-5 b(alue)31 b Fq(n)p |
| 7275 | Ft(.)40 b(If)29 b Fq(n)h Ft(is)g(not)g(supplied,)f(the)630 | |
| 1c72c0cd | 7276 | 3915 y(return)35 b(v)-5 b(alue)37 b(is)f(the)g(exit)h(status)f(of)h |
| 37c41ab1 | 7277 | (the)f(last)h(command)f(executed)h(in)f(the)g(function.)630 |
| 1c72c0cd | 7278 | 4025 y(This)21 b(ma)m(y)i(also)g(b)s(e)e(used)g(to)i(terminate)g |
| 37c41ab1 | 7279 | (execution)g(of)f(a)h(script)f(b)s(eing)f(executed)i(with)f(the)630 |
| 1c72c0cd | 7280 | 4134 y Fs(.)27 b Ft(\(or)g Fs(source)p Ft(\))f(builtin,)i(returning)e |
| 37c41ab1 | 7281 | (either)h Fq(n)g Ft(or)g(the)g(exit)h(status)g(of)f(the)g(last)h |
| 1c72c0cd | 7282 | (command)630 4244 y(executed)46 b(within)f(the)g(script)g(as)h(the)f |
| 37c41ab1 | 7283 | (exit)h(status)g(of)f(the)h(script.)85 b(An)m(y)45 b(command)630 |
| 1c72c0cd | 7284 | 4354 y(asso)s(ciated)30 b(with)e(the)g Fs(RETURN)f Ft(trap)h(is)g |
| 37c41ab1 | 7285 | (executed)h(b)s(efore)f(execution)h(resumes)f(after)h(the)630 |
| 1c72c0cd | 7286 | 4463 y(function)38 b(or)f(script.)63 b(The)38 b(return)e(status)i(is)g |
| 37c41ab1 | 7287 | (non-zero)h(if)e Fs(return)g Ft(is)g(used)g(outside)i(a)630 |
| 1c72c0cd | 7288 | 4573 y(function)30 b(and)g(not)g(during)g(the)g(execution)i(of)e(a)h |
| 37c41ab1 | 7289 | (script)f(b)m(y)h Fs(.)f Ft(or)g Fs(source)p Ft(.)150 |
| 1c72c0cd CR |
7290 | 4737 y Fs(shift)870 4874 y(shift)46 b([)p Fj(n)11 b Fs(])630 |
| 7291 | 5011 y Ft(Shift)41 b(the)g(p)s(ositional)h(parameters)g(to)g(the)f | |
| 37c41ab1 | 7292 | (left)h(b)m(y)g Fq(n)p Ft(.)73 b(The)40 b(p)s(ositional)j(parameters) |
| 28157acd CR |
7293 | 630 5121 y(from)27 b Fq(n)p Fs(+)p Ft(1)33 b(.)22 b(.)g(.)39 |
| 7294 | b Fs($#)27 b Ft(are)g(renamed)g(to)i Fs($1)j Ft(.)22 | |
| 7295 | b(.)h(.)38 b Fs($#)p Ft(-)p Fq(n)p Fs(+)p Ft(1.)h(P)m(arameters)29 | |
| 7296 | b(represen)m(ted)e(b)m(y)h(the)630 5230 y(n)m(um)m(b)s(ers)34 | |
| 7297 | b Fs($#)h Ft(to)h Fq(n)p Fs(+)p Ft(1)f(are)g(unset.)55 | |
| 7298 | b Fq(n)35 b Ft(m)m(ust)g(b)s(e)g(a)h(non-negativ)m(e)h(n)m(um)m(b)s(er) | |
| 7299 | d(less)i(than)f(or)630 5340 y(equal)e(to)h Fs($#)p Ft(.)47 | |
| 7300 | b(If)33 b Fq(n)f Ft(is)h(zero)g(or)g(greater)h(than)f | |
| 1c72c0cd | 7301 | Fs($#)p Ft(,)g(the)g(p)s(ositional)g(parameters)g(are)h(not)p |
| 37c41ab1 | 7302 | eop end |
| ac18b312 CR |
7303 | %%Page: 39 45 |
| 7304 | TeXDict begin 39 44 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 7305 | b(Shell)30 b(Builtin)h(Commands)2069 b(39)630 299 y(c)m(hanged.)48 | |
| 1c72c0cd CR |
7306 | b(If)32 b Fq(n)g Ft(is)h(not)f(supplied,)h(it)g(is)f(assumed)g(to)h(b)s |
| 7307 | (e)f(1.)48 b(The)32 b(return)g(status)h(is)f(zero)630 | |
| 7308 | 408 y(unless)e Fq(n)f Ft(is)i(greater)g(than)g Fs($#)e | |
| 7309 | Ft(or)i(less)f(than)h(zero,)g(non-zero)g(otherwise.)150 | |
| 7310 | 578 y Fs(test)150 687 y([)432 b Ft(Ev)-5 b(aluate)32 | |
| 7311 | b(a)f(conditional)h(expression)e Fq(expr)p Ft(.)41 b(Eac)m(h)31 | |
| 7312 | b(op)s(erator)g(and)f(op)s(erand)g(m)m(ust)h(b)s(e)f(a)630 | |
| 7313 | 797 y(separate)d(argumen)m(t.)40 b(Expressions)25 b(are)i(comp)s(osed)e | |
| 7314 | (of)i(the)f(primaries)g(describ)s(ed)f(b)s(elo)m(w)630 | |
| 7315 | 907 y(in)34 b(Section)g(6.4)h([Bash)g(Conditional)f(Expressions],)h | |
| 28157acd | 7316 | (page)g(73.)52 b Fs(test)33 b Ft(do)s(es)g(not)h(accept)630 |
| 1c72c0cd CR |
7317 | 1016 y(an)m(y)27 b(options,)i(nor)d(do)s(es)h(it)g(accept)i(and)d |
| 7318 | (ignore)i(an)f(argumen)m(t)g(of)g(`)p Fs(--)p Ft(')g(as)h(signifying)f | |
| 7319 | (the)630 1126 y(end)j(of)g(options.)630 1265 y(When)g(the)h | |
| 37c41ab1 | 7320 | Fs([)f Ft(form)g(is)g(used,)g(the)g(last)i(argumen)m(t)e(to)i(the)e |
| 1c72c0cd | 7321 | (command)g(m)m(ust)h(b)s(e)e(a)i Fs(])p Ft(.)630 1405 |
| 37c41ab1 CR |
7322 | y(Expressions)23 b(ma)m(y)h(b)s(e)e(com)m(bined)i(using)f(the)h(follo)m |
| 7323 | (wing)h(op)s(erators,)g(listed)f(in)f(decreasing)630 | |
| 1c72c0cd | 7324 | 1514 y(order)30 b(of)g(precedence.)630 1684 y Fs(!)g |
| 37c41ab1 | 7325 | Fj(expr)210 b Ft(T)-8 b(rue)30 b(if)g Fq(expr)37 b Ft(is)30 |
| 1c72c0cd | 7326 | b(false.)630 1853 y Fs(\()g Fj(expr)40 b Fs(\))122 b |
| 37c41ab1 CR |
7327 | Ft(Returns)23 b(the)i(v)-5 b(alue)25 b(of)f Fq(expr)p |
| 7328 | Ft(.)38 b(This)24 b(ma)m(y)h(b)s(e)e(used)h(to)h(o)m(v)m(erride)g(the)g | |
| 1c72c0cd CR |
7329 | (normal)1110 1963 y(precedence)31 b(of)f(op)s(erators.)630 |
| 7330 | 2132 y Fj(expr1)39 b Fs(-a)30 b Fj(expr2)1110 2242 y | |
| 37c41ab1 | 7331 | Ft(T)-8 b(rue)30 b(if)g(b)s(oth)g Fq(expr1)37 b Ft(and)30 |
| 1c72c0cd CR |
7332 | b Fq(expr2)38 b Ft(are)30 b(true.)630 2411 y Fj(expr1)39 |
| 7333 | b Fs(-o)30 b Fj(expr2)1110 2521 y Ft(T)-8 b(rue)30 b(if)g(either)h | |
| 37c41ab1 | 7334 | Fq(expr1)38 b Ft(or)30 b Fq(expr2)37 b Ft(is)31 b(true.)630 |
| 1c72c0cd | 7335 | 2690 y(The)37 b Fs(test)f Ft(and)g Fs([)h Ft(builtins)g(ev)-5 |
| 37c41ab1 | 7336 | b(aluate)39 b(conditional)f(expressions)f(using)g(a)g(set)h(of)f(rules) |
| 1c72c0cd CR |
7337 | 630 2800 y(based)30 b(on)g(the)h(n)m(um)m(b)s(er)e(of)h(argumen)m(ts.) |
| 7338 | 630 2969 y(0)h(argumen)m(ts)1110 3078 y(The)f(expression)g(is)g(false.) | |
| 7339 | 630 3248 y(1)h(argumen)m(t)1110 3357 y(The)f(expression)g(is)g(true)h | |
| 37c41ab1 | 7340 | (if)f(and)g(only)g(if)h(the)f(argumen)m(t)h(is)f(not)h(n)m(ull.)630 |
| 1c72c0cd | 7341 | 3527 y(2)g(argumen)m(ts)1110 3636 y(If)f(the)h(\014rst)f(argumen)m(t)h |
| 37c41ab1 | 7342 | (is)g(`)p Fs(!)p Ft(',)g(the)g(expression)g(is)g(true)f(if)h(and)f |
| 1c72c0cd | 7343 | (only)h(if)g(the)1110 3746 y(second)j(argumen)m(t)f(is)h(n)m(ull.)50 |
| 37c41ab1 | 7344 | b(If)33 b(the)h(\014rst)e(argumen)m(t)i(is)g(one)g(of)f(the)h(unary) |
| 1c72c0cd CR |
7345 | 1110 3856 y(conditional)42 b(op)s(erators)f(\(see)g(Section)h(6.4)f |
| 7346 | ([Bash)g(Conditional)g(Expres-)1110 3965 y(sions],)34 | |
| 28157acd | 7347 | b(page)f(73\),)i(the)e(expression)f(is)h(true)g(if)g(the)g(unary)e |
| 1c72c0cd | 7348 | (test)j(is)f(true.)47 b(If)1110 4075 y(the)33 b(\014rst)g(argumen)m(t)h |
| 37c41ab1 | 7349 | (is)f(not)g(a)h(v)-5 b(alid)34 b(unary)e(op)s(erator,)i(the)g |
| 1c72c0cd CR |
7350 | (expression)f(is)1110 4184 y(false.)630 4354 y(3)e(argumen)m(ts)1110 |
| 7351 | 4463 y(If)k(the)g(second)g(argumen)m(t)g(is)g(one)h(of)f(the)g(binary)f | |
| 7352 | (conditional)j(op)s(erators)1110 4573 y(\(see)23 b(Section)g(6.4)f | |
| 28157acd | 7353 | ([Bash)h(Conditional)f(Expressions],)h(page)g(73\),)i(the)d(result)1110 |
| 1c72c0cd CR |
7354 | 4682 y(of)44 b(the)h(expression)f(is)g(the)g(result)g(of)h(the)f |
| 7355 | (binary)g(test)h(using)e(the)i(\014rst)1110 4792 y(and)33 | |
| 37c41ab1 CR |
7356 | b(third)g(argumen)m(ts)h(as)g(op)s(erands.)50 b(If)33 |
| 7357 | b(the)h(\014rst)g(argumen)m(t)g(is)g(`)p Fs(!)p Ft(',)h(the)1110 | |
| 1c72c0cd | 7358 | 4902 y(v)-5 b(alue)25 b(is)g(the)g(negation)h(of)f(the)g(t)m(w)m |
| 37c41ab1 | 7359 | (o-argumen)m(t)i(test)f(using)e(the)h(second)g(and)1110 |
| 1c72c0cd | 7360 | 5011 y(third)32 b(argumen)m(ts.)47 b(If)33 b(the)f(\014rst)g(argumen)m |
| 37c41ab1 | 7361 | (t)h(is)g(exactly)h(`)p Fs(\()p Ft(')f(and)f(the)h(third)1110 |
| 1c72c0cd CR |
7362 | 5121 y(argumen)m(t)h(is)g(exactly)h(`)p Fs(\))p Ft(',)g(the)f(result)f |
| 7363 | (is)h(the)g(one-argumen)m(t)g(test)h(of)f(the)1110 5230 | |
| 37c41ab1 | 7364 | y(second)d(argumen)m(t.)45 b(Otherwise,)31 b(the)h(expression)f(is)g |
| 1c72c0cd | 7365 | (false.)44 b(The)31 b(`)p Fs(-a)p Ft(')h(and)1110 5340 |
| 37c41ab1 | 7366 | y(`)p Fs(-o)p Ft(')e(op)s(erators)h(are)g(considered)f(binary)f(op)s |
| 1c72c0cd | 7367 | (erators)i(in)f(this)g(case.)p eop end |
| ac18b312 CR |
7368 | %%Page: 40 46 |
| 7369 | TeXDict begin 40 45 bop 150 -116 a Ft(40)2572 b(Bash)31 | |
| 1c72c0cd CR |
7370 | b(Reference)g(Man)m(ual)630 299 y(4)g(argumen)m(ts)1110 |
| 7371 | 408 y(If)h(the)i(\014rst)e(argumen)m(t)h(is)g(`)p Fs(!)p | |
| 7372 | Ft(',)h(the)f(result)g(is)g(the)g(negation)h(of)f(the)g(three-)1110 | |
| 7373 | 518 y(argumen)m(t)h(expression)f(comp)s(osed)h(of)f(the)h(remaining)g | |
| 7374 | (argumen)m(ts.)50 b(Oth-)1110 628 y(erwise,)34 b(the)f(expression)g(is) | |
| 7375 | g(parsed)g(and)f(ev)-5 b(aluated)34 b(according)h(to)e(prece-)1110 | |
| 7376 | 737 y(dence)e(using)e(the)i(rules)f(listed)h(ab)s(o)m(v)m(e.)630 | |
| 28157acd | 7377 | 909 y(5)g(or)f(more)h(argumen)m(ts)1110 1019 y(The)43 |
| 1c72c0cd | 7378 | b(expression)f(is)i(parsed)e(and)g(ev)-5 b(aluated)45 |
| 28157acd CR |
7379 | b(according)f(to)f(precedence)1110 1129 y(using)30 b(the)g(rules)g |
| 7380 | (listed)h(ab)s(o)m(v)m(e.)150 1301 y Fs(times)870 1442 | |
| 7381 | y(times)630 1583 y Ft(Prin)m(t)37 b(out)h(the)g(user)e(and)h(system)g | |
| 1c72c0cd | 7382 | (times)h(used)f(b)m(y)g(the)h(shell)f(and)g(its)h(c)m(hildren.)61 |
| 28157acd CR |
7383 | b(The)630 1692 y(return)29 b(status)i(is)f(zero.)150 |
| 7384 | 1864 y Fs(trap)870 2005 y(trap)47 b([-lp])f([)p Fj(arg)11 | |
| 7385 | b Fs(])46 b([)p Fj(sigspec)56 b Fs(...)o(])630 2146 y | |
| 37c41ab1 CR |
7386 | Ft(The)43 b(commands)f(in)h Fq(arg)51 b Ft(are)44 b(to)g(b)s(e)e(read)h |
| 7387 | (and)g(executed)h(when)e(the)h(shell)g(receiv)m(es)630 | |
| 28157acd | 7388 | 2256 y(signal)36 b Fq(sigsp)s(ec)p Ft(.)57 b(If)35 b |
| 37c41ab1 CR |
7389 | Fq(arg)44 b Ft(is)36 b(absen)m(t)g(\(and)f(there)h(is)g(a)f(single)i |
| 7390 | Fq(sigsp)s(ec)6 b Ft(\))35 b(or)h(equal)g(to)h(`)p Fs(-)p | |
| 28157acd | 7391 | Ft(',)630 2365 y(eac)m(h)28 b(sp)s(eci\014ed)e(signal's)h(disp)s |
| 37c41ab1 | 7392 | (osition)f(is)h(reset)g(to)g(the)g(v)-5 b(alue)27 b(it)g(had)f(when)f |
| 28157acd | 7393 | (the)i(shell)g(w)m(as)630 2475 y(started.)63 b(If)37 |
| 37c41ab1 CR |
7394 | b Fq(arg)46 b Ft(is)37 b(the)h(n)m(ull)g(string,)h(then)e(the)h(signal) |
| 7395 | h(sp)s(eci\014ed)d(b)m(y)i(eac)m(h)h Fq(sigsp)s(ec)k | |
| 28157acd | 7396 | Ft(is)630 2585 y(ignored)36 b(b)m(y)g(the)g(shell)g(and)g(commands)f |
| 37c41ab1 | 7397 | (it)i(in)m(v)m(ok)m(es.)59 b(If)35 b Fq(arg)45 b Ft(is)36 |
| 28157acd | 7398 | b(not)g(presen)m(t)g(and)f(`)p Fs(-p)p Ft(')630 2694 |
| 37c41ab1 | 7399 | y(has)e(b)s(een)g(supplied,)f(the)i(shell)f(displa)m(ys)h(the)f(trap)g |
| 28157acd | 7400 | (commands)g(asso)s(ciated)i(with)e(eac)m(h)630 2804 y |
| 37c41ab1 CR |
7401 | Fq(sigsp)s(ec)p Ft(.)40 b(If)29 b(no)g(argumen)m(ts)g(are)g(supplied,)f |
| 7402 | (or)h(only)g(`)p Fs(-p)p Ft(')g(is)g(giv)m(en,)h Fs(trap)e | |
| 28157acd | 7403 | Ft(prin)m(ts)g(the)h(list)630 2913 y(of)f(commands)f(asso)s(ciated)i |
| 37c41ab1 | 7404 | (with)f(eac)m(h)h(signal)f(n)m(um)m(b)s(er)e(in)i(a)g(form)f(that)h(ma) |
| 28157acd | 7405 | m(y)h(b)s(e)e(reused)630 3023 y(as)c(shell)g(input.)37 |
| 37c41ab1 CR |
7406 | b(The)23 b(`)p Fs(-l)p Ft(')f(option)i(causes)f(the)g(shell)g(to)g |
| 7407 | (prin)m(t)g(a)g(list)g(of)g(signal)h(names)f(and)630 | |
| 28157acd | 7408 | 3133 y(their)33 b(corresp)s(onding)f(n)m(um)m(b)s(ers.)47 |
| 37c41ab1 | 7409 | b(Eac)m(h)34 b Fq(sigsp)s(ec)39 b Ft(is)33 b(either)g(a)h(signal)g |
| 28157acd | 7410 | (name)f(or)g(a)g(signal)630 3242 y(n)m(um)m(b)s(er.)46 |
| 37c41ab1 CR |
7411 | b(Signal)33 b(names)g(are)g(case)h(insensitiv)m(e)f(and)g(the)f |
| 7412 | Fs(SIG)g Ft(pre\014x)g(is)h(optional.)48 b(If)33 b(a)630 | |
| 28157acd | 7413 | 3352 y Fq(sigsp)s(ec)h Ft(is)28 b Fs(0)f Ft(or)h Fs(EXIT)p |
| 37c41ab1 CR |
7414 | Ft(,)f Fq(arg)37 b Ft(is)27 b(executed)i(when)e(the)h(shell)g(exits.)41 |
| 7415 | b(If)27 b(a)i Fq(sigsp)s(ec)k Ft(is)28 b Fs(DEBUG)p Ft(,)630 | |
| 28157acd | 7416 | 3461 y(the)40 b(command)g Fq(arg)48 b Ft(is)40 b(executed)h(b)s(efore)f |
| 37c41ab1 | 7417 | (ev)m(ery)g(simple)g(command,)j Fs(for)c Ft(command,)630 |
| 28157acd | 7418 | 3571 y Fs(case)28 b Ft(command,)i Fs(select)d Ft(command,)j(ev)m(ery)g |
| 37c41ab1 | 7419 | (arithmetic)h Fs(for)d Ft(command,)i(and)e(b)s(efore)630 |
| 28157acd | 7420 | 3680 y(the)k(\014rst)e(command)h(executes)i(in)e(a)h(shell)f(function.) |
| 37c41ab1 | 7421 | 44 b(Refer)31 b(to)h(the)g(description)f(of)h(the)630 |
| 28157acd CR |
7422 | 3790 y Fs(extglob)d Ft(option)j(to)g(the)g Fs(shopt)e |
| 7423 | Ft(builtin)h(\(see)h(Section)h(4.2)f([Bash)g(Builtins],)h(page)f(41\)) | |
| 7424 | 630 3900 y(for)c(details)i(of)e(its)h(e\013ect)h(on)f(the)g | |
| 7425 | Fs(DEBUG)e Ft(trap.)40 b(If)28 b(a)g Fq(sigsp)s(ec)35 | |
| 7426 | b Ft(is)28 b Fs(ERR)p Ft(,)h(the)f(command)g Fq(arg)630 | |
| 7427 | 4009 y Ft(is)j(executed)g(whenev)m(er)g(a)g(simple)f(command)h(has)f(a) | |
| 7428 | h(non-zero)g(exit)h(status,)f(sub)5 b(ject)30 b(to)630 | |
| 7429 | 4119 y(the)k(follo)m(wing)i(conditions.)53 b(The)34 b | |
| 7430 | Fs(ERR)f Ft(trap)h(is)g(not)h(executed)g(if)f(the)g(failed)h(command) | |
| 7431 | 630 4228 y(is)28 b(part)g(of)h(the)f(command)g(list)h(immediately)h | |
| 7432 | (follo)m(wing)f(an)f Fs(until)f Ft(or)h Fs(while)f Ft(k)m(eyw)m(ord,) | |
| 7433 | 630 4338 y(part)h(of)h(the)g(test)g(in)f(an)h Fs(if)f | |
| 7434 | Ft(statemen)m(t,)j(part)d(of)h(a)f Fs(&&)g Ft(or)h Fs(||)f | |
| 7435 | Ft(list,)h(or)g(if)f(the)h(command's)630 4448 y(return)i(status)i(is)f | |
| 7436 | (b)s(eing)f(in)m(v)m(erted)i(using)f Fs(!)p Ft(.)46 b(These)32 | |
| 7437 | b(are)g(the)h(same)f(conditions)h(ob)s(ey)m(ed)630 4557 | |
| 7438 | y(b)m(y)i(the)g Fs(errexit)e Ft(option.)55 b(If)34 b(a)i | |
| 7439 | Fq(sigsp)s(ec)k Ft(is)35 b Fs(RETURN)p Ft(,)g(the)g(command)g | |
| 7440 | Fq(arg)43 b Ft(is)35 b(executed)630 4667 y(eac)m(h)j(time)f(a)f(shell)h | |
| 7441 | (function)f(or)g(a)h(script)f(executed)i(with)e(the)g | |
| 7442 | Fs(.)g Ft(or)h Fs(source)e Ft(builtins)630 4776 y(\014nishes)29 | |
| 7443 | b(executing.)630 4917 y(Signals)37 b(ignored)f(up)s(on)f(en)m(try)i(to) | |
| 7444 | g(the)f(shell)h(cannot)g(b)s(e)f(trapp)s(ed)f(or)h(reset.)59 | |
| 7445 | b(T)-8 b(rapp)s(ed)630 5027 y(signals)31 b(are)g(reset)g(to)g(their)f | |
| 7446 | (original)i(v)-5 b(alues)30 b(in)g(a)h(c)m(hild)g(pro)s(cess)f(when)f | |
| 7447 | (it)i(is)g(created.)630 5168 y(The)f(return)f(status)i(is)f(zero)h | |
| 7448 | (unless)f(a)h Fq(sigsp)s(ec)36 b Ft(do)s(es)30 b(not)h(sp)s(ecify)f(a)g | |
| 7449 | (v)-5 b(alid)31 b(signal.)150 5340 y Fs(umask)p eop end | |
| ac18b312 CR |
7450 | %%Page: 41 47 |
| 7451 | TeXDict begin 41 46 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 7452 | b(Shell)30 b(Builtin)h(Commands)2069 b(41)870 299 y Fs(umask)46 | |
| 1c72c0cd CR |
7453 | b([-p])h([-S])g([)p Fj(mode)11 b Fs(])630 435 y Ft(Set)30 |
| 7454 | b(the)f(shell)h(pro)s(cess's)f(\014le)h(creation)g(mask)g(to)g | |
| 7455 | Fq(mo)s(de)p Ft(.)40 b(If)29 b Fq(mo)s(de)34 b Ft(b)s(egins)29 | |
| 7456 | b(with)g(a)h(digit,)630 544 y(it)e(is)f(in)m(terpreted)g(as)g(an)g(o)s | |
| 7457 | (ctal)i(n)m(um)m(b)s(er;)e(if)g(not,)h(it)g(is)f(in)m(terpreted)g(as)g | |
| 7458 | (a)h(sym)m(b)s(olic)f(mo)s(de)630 654 y(mask)i(similar)g(to)g(that)h | |
| 7459 | (accepted)g(b)m(y)f(the)g Fs(chmod)e Ft(command.)40 b(If)28 | |
| 7460 | b Fq(mo)s(de)34 b Ft(is)28 b(omitted,)j(the)630 763 y(curren)m(t)36 | |
| 7461 | b(v)-5 b(alue)36 b(of)g(the)h(mask)f(is)g(prin)m(ted.)57 | |
| 7462 | b(If)35 b(the)h(`)p Fs(-S)p Ft(')g(option)h(is)f(supplied)f(without)h | |
| 7463 | (a)630 873 y Fq(mo)s(de)k Ft(argumen)m(t,)d(the)e(mask)g(is)g(prin)m | |
| 7464 | (ted)g(in)g(a)h(sym)m(b)s(olic)f(format.)55 b(If)35 b(the)g(`)p | |
| 7465 | Fs(-p)p Ft(')g(option)630 983 y(is)f(supplied,)f(and)g | |
| 7466 | Fq(mo)s(de)38 b Ft(is)33 b(omitted,)j(the)e(output)f(is)g(in)h(a)g | |
| 7467 | (form)f(that)h(ma)m(y)g(b)s(e)f(reused)630 1092 y(as)e(input.)41 | |
| 7468 | b(The)31 b(return)f(status)h(is)g(zero)h(if)e(the)h(mo)s(de)g(is)g | |
| 7469 | (successfully)g(c)m(hanged)g(or)g(if)g(no)630 1202 y | |
| 7470 | Fq(mo)s(de)k Ft(argumen)m(t)c(is)f(supplied,)g(and)f(non-zero)i | |
| 7471 | (otherwise.)630 1337 y(Note)38 b(that)e(when)g(the)g(mo)s(de)g(is)g(in) | |
| 7472 | m(terpreted)h(as)f(an)g(o)s(ctal)i(n)m(um)m(b)s(er,)e(eac)m(h)i(n)m(um) | |
| 7473 | m(b)s(er)d(of)630 1447 y(the)f(umask)g(is)h(subtracted)f(from)f | |
| 37c41ab1 | 7474 | Fs(7)p Ft(.)53 b(Th)m(us,)34 b(a)h(umask)e(of)i Fs(022)e |
| 1c72c0cd CR |
7475 | Ft(results)h(in)g(p)s(ermissions)630 1557 y(of)d Fs(755)p |
| 7476 | Ft(.)150 1718 y Fs(unset)870 1854 y(unset)46 b([-fv])h([)p | |
| 7477 | Fj(name)11 b Fs(])630 1990 y Ft(Eac)m(h)34 b(v)-5 b(ariable)33 | |
| 37c41ab1 CR |
7478 | b(or)g(function)g Fq(name)38 b Ft(is)33 b(remo)m(v)m(ed.)50 |
| 7479 | b(If)32 b(no)h(options)h(are)f(supplied,)g(or)g(the)630 | |
| 1c72c0cd | 7480 | 2099 y(`)p Fs(-v)p Ft(')h(option)h(is)g(giv)m(en,)h(eac)m(h)g |
| 37c41ab1 | 7481 | Fq(name)k Ft(refers)34 b(to)h(a)g(shell)f(v)-5 b(ariable.)54 |
| 1c72c0cd | 7482 | b(If)34 b(the)h(`)p Fs(-f)p Ft(')f(option)h(is)630 2209 |
| 37c41ab1 CR |
7483 | y(giv)m(en,)27 b(the)d Fq(name)5 b Ft(s)25 b(refer)f(to)h(shell)g |
| 7484 | (functions,)g(and)f(the)g(function)g(de\014nition)g(is)h(remo)m(v)m | |
| 1c72c0cd | 7485 | (ed.)630 2319 y(Readonly)32 b(v)-5 b(ariables)33 b(and)f(functions)f |
| 37c41ab1 | 7486 | (ma)m(y)i(not)f(b)s(e)g(unset.)45 b(The)32 b(return)f(status)h(is)g |
| 1c72c0cd CR |
7487 | (zero)630 2428 y(unless)e(a)g Fq(name)36 b Ft(is)30 b(readonly)-8 |
| 7488 | b(.)150 2692 y Fr(4.2)68 b(Bash)45 b(Builtin)g(Commands)275 | |
| 7489 | 2938 y Ft(This)30 b(section)j(describ)s(es)e(builtin)h(commands)f(whic) | |
| 37c41ab1 | 7490 | m(h)g(are)i(unique)d(to)j(or)f(ha)m(v)m(e)h(b)s(een)e(extended)g(in)150 |
| 1c72c0cd | 7491 | 3048 y(Bash.)41 b(Some)30 b(of)h(these)g(commands)f(are)g(sp)s |
| ac18b312 CR |
7492 | (eci\014ed)g(in)g(the)h Fl(posix)e Ft(standard.)150 3211 |
| 7493 | y Fs(alias)870 3346 y(alias)46 b([-p])h([)p Fj(name)11 | |
| 1c72c0cd | 7494 | b Fs([=)p Fj(value)g Fs(])43 b(...)o(])630 3482 y Ft(Without)h(argumen) |
| 37c41ab1 CR |
7495 | m(ts)f(or)g(with)g(the)h(`)p Fs(-p)p Ft(')f(option,)k |
| 7496 | Fs(alias)41 b Ft(prin)m(ts)i(the)g(list)h(of)f(aliases)630 | |
| 1c72c0cd | 7497 | 3592 y(on)36 b(the)g(standard)f(output)h(in)f(a)i(form)e(that)i(allo)m |
| 37c41ab1 | 7498 | (ws)g(them)f(to)g(b)s(e)g(reused)f(as)h(input.)56 b(If)630 |
| 1c72c0cd | 7499 | 3701 y(argumen)m(ts)29 b(are)g(supplied,)f(an)h(alias)h(is)f(de\014ned) |
| 37c41ab1 | 7500 | e(for)i(eac)m(h)h Fq(name)k Ft(whose)28 b Fq(v)-5 b(alue)35 |
| 1c72c0cd | 7501 | b Ft(is)29 b(giv)m(en.)630 3811 y(If)39 b(no)h Fq(v)-5 |
| 37c41ab1 CR |
7502 | b(alue)45 b Ft(is)40 b(giv)m(en,)j(the)d(name)f(and)g(v)-5 |
| 7503 | b(alue)40 b(of)g(the)g(alias)h(is)f(prin)m(ted.)68 b(Aliases)41 | |
| 1c72c0cd | 7504 | b(are)630 3920 y(describ)s(ed)29 b(in)h(Section)i(6.6)f([Aliases],)h |
| 28157acd | 7505 | (page)f(75.)150 4082 y Fs(bind)870 4218 y(bind)47 b([-m)g |
| 1c72c0cd | 7506 | Fj(keymap)11 b Fs(])45 b([-lpsvPSV])870 4328 y(bind)i([-m)g |
| 5e13499c CR |
7507 | Fj(keymap)11 b Fs(])45 b([-q)i Fj(function)11 b Fs(])45 |
| 7508 | b([-u)h Fj(function)11 b Fs(])45 b([-r)i Fj(keyseq)11 | |
| 1c72c0cd CR |
7509 | b Fs(])870 4437 y(bind)47 b([-m)g Fj(keymap)11 b Fs(])45 |
| 7510 | b(-f)i Fj(filename)870 4547 y Fs(bind)g([-m)g Fj(keymap)11 | |
| 7511 | b Fs(])45 b(-x)i Fj(keyseq:shell-command)870 4656 y Fs(bind)g([-m)g | |
| 5e13499c | 7512 | Fj(keymap)11 b Fs(])45 b Fj(keyseq:function-name)870 |
| 1c72c0cd | 7513 | 4766 y Fs(bind)i Fj(readline-command)630 4902 y Ft(Displa)m(y)26 |
| 37c41ab1 | 7514 | b(curren)m(t)f(Readline)h(\(see)g(Chapter)f(8)g([Command)g(Line)g |
| 28157acd | 7515 | (Editing],)i(page)f(89\))g(k)m(ey)630 5011 y(and)36 b(function)g |
| 37c41ab1 | 7516 | (bindings,)i(bind)d(a)i(k)m(ey)g(sequence)g(to)h(a)f(Readline)g |
| 1c72c0cd | 7517 | (function)f(or)h(macro,)630 5121 y(or)44 b(set)h(a)g(Readline)f(v)-5 |
| 37c41ab1 | 7518 | b(ariable.)83 b(Eac)m(h)45 b(non-option)g(argumen)m(t)f(is)g(a)h |
| 28157acd CR |
7519 | (command)f(as)g(it)630 5230 y(w)m(ould)35 b(app)s(ear)f(in)g(a)i(a)f |
| 7520 | (Readline)g(initialization)j(\014le)d(\(see)h(Section)f(8.3)h | |
| 7521 | ([Readline)g(Init)630 5340 y(File],)43 b(page)c(92\),)k(but)38 | |
| 7522 | b(eac)m(h)i(binding)e(or)h(command)g(m)m(ust)g(b)s(e)f(passed)g(as)i(a) | |
| 7523 | f(separate)p eop end | |
| ac18b312 CR |
7524 | %%Page: 42 48 |
| 7525 | TeXDict begin 42 47 bop 150 -116 a Ft(42)2572 b(Bash)31 | |
| 1c72c0cd CR |
7526 | b(Reference)g(Man)m(ual)630 299 y(argumen)m(t;)36 b(e.g.,)f(`)p |
| 7527 | Fs("\\C-x\\C-r":re-read-init-fi)o(le)p Ft('.)43 b(Options,)34 | |
| 7528 | b(if)g(supplied,)f(ha)m(v)m(e)630 408 y(the)e(follo)m(wing)g(meanings:) | |
| 7529 | 630 576 y Fs(-m)f Fj(keymap)1110 686 y Ft(Use)54 b Fq(k)m(eymap)j | |
| 7530 | Ft(as)d(the)g(k)m(eymap)g(to)h(b)s(e)e(a\013ected)i(b)m(y)f(the)g | |
| 7531 | (subsequen)m(t)1110 795 y(bindings.)46 b(Acceptable)34 | |
| 7532 | b Fq(k)m(eymap)i Ft(names)c(are)h Fs(emacs)p Ft(,)f Fs(emacs-standard)p | |
| 7533 | Ft(,)1110 905 y Fs(emacs-meta)p Ft(,)99 b Fs(emacs-ctlx)p | |
| 7534 | Ft(,)f Fs(vi)p Ft(,)j Fs(vi-move)p Ft(,)f Fs(vi-command)p | |
| 7535 | Ft(,)f(and)1110 1014 y Fs(vi-insert)p Ft(.)64 b Fs(vi)38 | |
| 7536 | b Ft(is)h(equiv)-5 b(alen)m(t)41 b(to)e Fs(vi-command)p | |
| 7537 | Ft(;)i Fs(emacs)c Ft(is)i(equiv)-5 b(alen)m(t)1110 1124 | |
| 7538 | y(to)31 b Fs(emacs-standard)p Ft(.)630 1292 y Fs(-l)384 | |
| 37c41ab1 | 7539 | b Ft(List)31 b(the)f(names)g(of)h(all)g(Readline)g(functions.)630 |
| 1c72c0cd CR |
7540 | 1459 y Fs(-p)384 b Ft(Displa)m(y)34 b(Readline)f(function)g(names)g |
| 7541 | (and)f(bindings)f(in)i(suc)m(h)f(a)i(w)m(a)m(y)f(that)1110 | |
| 7542 | 1569 y(they)e(can)f(b)s(e)g(used)g(as)g(input)g(or)g(in)g(a)h(Readline) | |
| 7543 | g(initialization)i(\014le.)630 1736 y Fs(-P)384 b Ft(List)31 | |
| 37c41ab1 | 7544 | b(curren)m(t)f(Readline)h(function)f(names)g(and)g(bindings.)630 |
| 1c72c0cd | 7545 | 1904 y Fs(-v)384 b Ft(Displa)m(y)25 b(Readline)f(v)-5 |
| 37c41ab1 | 7546 | b(ariable)25 b(names)f(and)f(v)-5 b(alues)24 b(in)g(suc)m(h)f(a)i(w)m |
| 1c72c0cd | 7547 | (a)m(y)f(that)h(they)1110 2014 y(can)31 b(b)s(e)e(used)h(as)h(input)e |
| 37c41ab1 | 7548 | (or)h(in)g(a)h(Readline)g(initialization)j(\014le.)630 |
| 1c72c0cd CR |
7549 | 2181 y Fs(-V)384 b Ft(List)31 b(curren)m(t)f(Readline)h(v)-5 |
| 7550 | b(ariable)31 b(names)f(and)g(v)-5 b(alues.)630 2349 y | |
| 37c41ab1 | 7551 | Fs(-s)384 b Ft(Displa)m(y)39 b(Readline)f(k)m(ey)g(sequences)f(b)s |
| 1c72c0cd | 7552 | (ound)f(to)i(macros)g(and)f(the)g(strings)1110 2458 y(they)d(output)f |
| 37c41ab1 | 7553 | (in)h(suc)m(h)f(a)h(w)m(a)m(y)h(that)f(they)g(can)g(b)s(e)f(used)g(as)h |
| 1c72c0cd CR |
7554 | (input)e(or)i(in)g(a)1110 2568 y(Readline)d(initialization)i(\014le.) |
| 7555 | 630 2736 y Fs(-S)384 b Ft(Displa)m(y)39 b(Readline)f(k)m(ey)g | |
| 5e13499c | 7556 | (sequences)f(b)s(ound)f(to)i(macros)g(and)f(the)g(strings)1110 |
| 1c72c0cd CR |
7557 | 2845 y(they)31 b(output.)630 3013 y Fs(-f)f Fj(filename)1110 |
| 7558 | 3122 y Ft(Read)h(k)m(ey)g(bindings)e(from)h Fq(\014lename)p | |
| 7559 | Ft(.)630 3290 y Fs(-q)g Fj(function)1110 3400 y Ft(Query)g(ab)s(out)g | |
| 37c41ab1 | 7560 | (whic)m(h)g(k)m(eys)h(in)m(v)m(ok)m(e)h(the)f(named)f |
| 1c72c0cd CR |
7561 | Fq(function)p Ft(.)630 3567 y Fs(-u)g Fj(function)1110 |
| 7562 | 3677 y Ft(Un)m(bind)f(all)i(k)m(eys)g(b)s(ound)e(to)i(the)f(named)g | |
| 7563 | Fq(function)p Ft(.)630 3844 y Fs(-r)g Fj(keyseq)1110 | |
| 7564 | 3954 y Ft(Remo)m(v)m(e)i(an)m(y)f(curren)m(t)f(binding)f(for)h | |
| 7565 | Fq(k)m(eyseq)p Ft(.)630 4122 y Fs(-x)g Fj(keyseq:shell-command)1110 | |
| 7566 | 4231 y Ft(Cause)g Fq(shell-command)k Ft(to)e(b)s(e)d(executed)j(whenev) | |
| 7567 | m(er)e Fq(k)m(eyseq)j Ft(is)e(en)m(tered.)630 4399 y(The)26 | |
| 37c41ab1 CR |
7568 | b(return)f(status)i(is)f(zero)i(unless)d(an)i(in)m(v)-5 |
| 7569 | b(alid)27 b(option)g(is)f(supplied)f(or)i(an)f(error)g(o)s(ccurs.)150 | |
| 1c72c0cd CR |
7570 | 4566 y Fs(builtin)870 4705 y(builtin)46 b([)p Fj(shell-builtin)54 |
| 7571 | b Fs([)p Fj(args)11 b Fs(]])630 4844 y Ft(Run)35 b(a)i(shell)f | |
| 37c41ab1 | 7572 | (builtin,)i(passing)e(it)h Fq(args)p Ft(,)h(and)e(return)f(its)i(exit)g |
| 1c72c0cd | 7573 | (status.)59 b(This)35 b(is)i(useful)630 4953 y(when)29 |
| 37c41ab1 | 7574 | b(de\014ning)h(a)g(shell)h(function)f(with)g(the)g(same)h(name)f(as)h |
| 1c72c0cd | 7575 | (a)g(shell)f(builtin,)g(retaining)630 5063 y(the)k(functionalit)m(y)h |
| 37c41ab1 | 7576 | (of)f(the)f(builtin)g(within)g(the)h(function.)50 b(The)33 |
| 1c72c0cd | 7577 | b(return)g(status)h(is)f(non-)630 5172 y(zero)e(if)g |
| 37c41ab1 | 7578 | Fq(shell-builtin)f Ft(is)g(not)h(a)g(shell)f(builtin)g(command.)150 |
| 1c72c0cd | 7579 | 5340 y Fs(caller)p eop end |
| ac18b312 CR |
7580 | %%Page: 43 49 |
| 7581 | TeXDict begin 43 48 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 7582 | b(Shell)30 b(Builtin)h(Commands)2069 b(43)870 299 y Fs(caller)46 | |
| 1c72c0cd CR |
7583 | b([)p Fj(expr)11 b Fs(])630 437 y Ft(Returns)34 b(the)g(con)m(text)j |
| 7584 | (of)e(an)m(y)g(activ)m(e)i(subroutine)c(call)j(\(a)f(shell)g(function)f | |
| 7585 | (or)h(a)g(script)630 547 y(executed)c(with)f(the)h Fs(.)f | |
| 7586 | Ft(or)g Fs(source)f Ft(builtins\).)630 685 y(Without)45 | |
| 7587 | b Fq(expr)p Ft(,)j Fs(caller)43 b Ft(displa)m(ys)i(the)f(line)h(n)m(um) | |
| 7588 | m(b)s(er)f(and)g(source)g(\014lename)h(of)g(the)630 795 | |
| 7589 | y(curren)m(t)35 b(subroutine)g(call.)58 b(If)35 b(a)h(non-negativ)m(e)i | |
| 7590 | (in)m(teger)f(is)f(supplied)e(as)i Fq(expr)p Ft(,)h Fs(caller)630 | |
| 7591 | 905 y Ft(displa)m(ys)k(the)f(line)h(n)m(um)m(b)s(er,)h(subroutine)d | |
| 7592 | (name,)44 b(and)c(source)g(\014le)h(corresp)s(onding)e(to)630 | |
| 7593 | 1014 y(that)c(p)s(osition)g(in)f(the)h(curren)m(t)f(execution)i(call)g | |
| 7594 | (stac)m(k.)54 b(This)34 b(extra)h(information)g(ma)m(y)630 | |
| 7595 | 1124 y(b)s(e)30 b(used,)g(for)g(example,)h(to)g(prin)m(t)f(a)h(stac)m | |
| 7596 | (k)h(trace.)42 b(The)29 b(curren)m(t)i(frame)f(is)g(frame)h(0.)630 | |
| 7597 | 1262 y(The)e(return)f(v)-5 b(alue)29 b(is)h(0)f(unless)g(the)g(shell)g | |
| 7598 | (is)h(not)f(executing)h(a)g(subroutine)e(call)i(or)g | |
| 7599 | Fq(expr)630 1372 y Ft(do)s(es)g(not)h(corresp)s(ond)e(to)i(a)g(v)-5 | |
| 37c41ab1 | 7600 | b(alid)30 b(p)s(osition)h(in)f(the)g(call)i(stac)m(k.)150 |
| 1c72c0cd CR |
7601 | 1539 y Fs(command)870 1677 y(command)46 b([-pVv])g Fj(command)56 |
| 7602 | b Fs([)p Fj(arguments)g Fs(...)o(])630 1816 y Ft(Runs)32 | |
| 37c41ab1 | 7603 | b Fq(command)k Ft(with)d Fq(argumen)m(ts)k Ft(ignoring)c(an)m(y)g |
| 1c72c0cd | 7604 | (shell)h(function)e(named)h Fq(command)p Ft(.)630 1925 |
| 37c41ab1 | 7605 | y(Only)39 b(shell)i(builtin)e(commands)h(or)g(commands)f(found)g(b)m(y) |
| 1c72c0cd | 7606 | h(searc)m(hing)h(the)f Fs(PATH)f Ft(are)630 2035 y(executed.)g(If)23 |
| 37c41ab1 CR |
7607 | b(there)h(is)f(a)h(shell)f(function)g(named)g Fs(ls)p |
| 7608 | Ft(,)i(running)c(`)p Fs(command)29 b(ls)p Ft(')23 b(within)g(the)630 | |
| 1c72c0cd | 7609 | 2145 y(function)33 b(will)g(execute)i(the)f(external)g(command)f |
| 37c41ab1 | 7610 | Fs(ls)f Ft(instead)i(of)f(calling)i(the)e(function)630 |
| 1c72c0cd | 7611 | 2254 y(recursiv)m(ely)-8 b(.)84 b(The)44 b(`)p Fs(-p)p |
| 37c41ab1 | 7612 | Ft(')h(option)g(means)f(to)h(use)g(a)f(default)h(v)-5 |
| 1c72c0cd | 7613 | b(alue)45 b(for)f Fs(PATH)g Ft(that)h(is)630 2364 y(guaran)m(teed)35 |
| 37c41ab1 | 7614 | b(to)f(\014nd)e(all)j(of)f(the)g(standard)f(utilities.)52 |
| 1c72c0cd | 7615 | b(The)33 b(return)g(status)h(in)f(this)h(case)630 2473 |
| 37c41ab1 CR |
7616 | y(is)29 b(127)g(if)g Fq(command)j Ft(cannot)d(b)s(e)e(found)h(or)g(an)g |
| 7617 | (error)h(o)s(ccurred,)f(and)g(the)h(exit)g(status)g(of)630 | |
| 1c72c0cd | 7618 | 2583 y Fq(command)34 b Ft(otherwise.)630 2721 y(If)25 |
| 37c41ab1 CR |
7619 | b(either)g(the)h(`)p Fs(-V)p Ft(')f(or)g(`)p Fs(-v)p |
| 7620 | Ft(')g(option)g(is)g(supplied,)h(a)f(description)g(of)h | |
| 1c72c0cd | 7621 | Fq(command)i Ft(is)d(prin)m(ted.)630 2831 y(The)i(`)p |
| 37c41ab1 | 7622 | Fs(-v)p Ft(')h(option)h(causes)f(a)h(single)f(w)m(ord)g(indicating)h |
| 1c72c0cd | 7623 | (the)f(command)g(or)g(\014le)g(name)g(used)630 2941 y(to)36 |
| 37c41ab1 CR |
7624 | b(in)m(v)m(ok)m(e)g Fq(command)j Ft(to)c(b)s(e)g(displa)m(y)m(ed;)j |
| 7625 | (the)d(`)p Fs(-V)p Ft(')g(option)g(pro)s(duces)e(a)j(more)f(v)m(erb)s | |
| 1c72c0cd | 7626 | (ose)630 3050 y(description.)61 b(In)36 b(this)h(case,)j(the)e(return)e |
| 37c41ab1 | 7627 | (status)h(is)g(zero)h(if)f Fq(command)k Ft(is)c(found,)h(and)630 |
| 1c72c0cd CR |
7628 | 3160 y(non-zero)31 b(if)f(not.)150 3327 y Fs(declare)870 |
| 7629 | 3465 y(declare)46 b([-afFirtx])f([-p])h([)p Fj(name)11 | |
| 7630 | b Fs([=)p Fj(value)g Fs(])44 b(...)o(])630 3604 y Ft(Declare)29 | |
| 37c41ab1 CR |
7631 | b(v)-5 b(ariables)28 b(and)e(giv)m(e)j(them)e(attributes.)40 |
| 7632 | b(If)27 b(no)g Fq(name)5 b Ft(s)27 b(are)h(giv)m(en,)h(then)e(displa)m | |
| 1c72c0cd CR |
7633 | (y)630 3713 y(the)k(v)-5 b(alues)30 b(of)h(v)-5 b(ariables)31 |
| 7634 | b(instead.)630 3852 y(The)d(`)p Fs(-p)p Ft(')g(option)g(will)h(displa)m | |
| 37c41ab1 | 7635 | (y)f(the)h(attributes)f(and)g(v)-5 b(alues)28 b(of)h(eac)m(h)g |
| 1c72c0cd | 7636 | Fq(name)p Ft(.)40 b(When)28 b(`)p Fs(-p)p Ft(')630 3961 |
| 28157acd CR |
7637 | y(is)k(used,)g(additional)h(options)f(are)h(ignored.)46 |
| 7638 | b(The)31 b(`)p Fs(-F)p Ft(')h(option)h(inhibits)e(the)h(displa)m(y)h | |
| 7639 | (of)630 4071 y(function)f(de\014nitions;)h(only)g(the)f(function)g | |
| 7640 | (name)h(and)f(attributes)h(are)f(prin)m(ted.)47 b(If)32 | |
| 7641 | b(the)630 4181 y Fs(extdebug)e Ft(shell)j(option)g(is)g(enabled)f | |
| 7642 | (using)g Fs(shopt)g Ft(\(see)h(Section)g(4.2)h([Bash)f(Builtins],)630 | |
| 7643 | 4290 y(page)k(41\),)h(the)e(source)g(\014le)g(name)g(and)g(line)g(n)m | |
| 7644 | (um)m(b)s(er)e(where)i(the)g(function)f(is)h(de\014ned)630 | |
| 7645 | 4400 y(are)f(displa)m(y)m(ed)h(as)f(w)m(ell.)55 b(`)p | |
| 7646 | Fs(-F)p Ft(')34 b(implies)h(`)p Fs(-f)p Ft('.)54 b(The)35 | |
| 7647 | b(follo)m(wing)h(options)f(can)g(b)s(e)f(used)g(to)630 | |
| 7648 | 4509 y(restrict)41 b(output)g(to)g(v)-5 b(ariables)42 | |
| 7649 | b(with)e(the)h(sp)s(eci\014ed)f(attributes)h(or)g(to)g(giv)m(e)h(v)-5 | |
| 7650 | b(ariables)630 4619 y(attributes:)630 4786 y Fs(-a)384 | |
| 37c41ab1 | 7651 | b Ft(Eac)m(h)30 b Fq(name)k Ft(is)29 b(an)g(arra)m(y)h(v)-5 |
| 28157acd | 7652 | b(ariable)30 b(\(see)g(Section)g(6.7)g([Arra)m(ys],)h(page)e(76\).)630 |
| 1c72c0cd CR |
7653 | 4954 y Fs(-f)384 b Ft(Use)31 b(function)f(names)g(only)-8 |
| 7654 | b(.)630 5121 y Fs(-i)384 b Ft(The)36 b(v)-5 b(ariable)37 | |
| 37c41ab1 | 7655 | b(is)f(to)h(b)s(e)f(treated)h(as)g(an)f(in)m(teger;)41 |
| 1c72c0cd | 7656 | b(arithmetic)c(ev)-5 b(aluation)1110 5230 y(\(see)29 |
| 28157acd | 7657 | b(Section)f(6.5)h([Shell)f(Arithmetic],)i(page)e(74\))h(is)f(p)s |
| 1c72c0cd CR |
7658 | (erformed)e(when)h(the)1110 5340 y(v)-5 b(ariable)31 |
| 7659 | b(is)g(assigned)f(a)h(v)-5 b(alue.)p eop end | |
| ac18b312 CR |
7660 | %%Page: 44 50 |
| 7661 | TeXDict begin 44 49 bop 150 -116 a Ft(44)2572 b(Bash)31 | |
| 1c72c0cd CR |
7662 | b(Reference)g(Man)m(ual)630 299 y Fs(-r)384 b Ft(Mak)m(e)25 |
| 7663 | b Fq(name)5 b Ft(s)23 b(readonly)-8 b(.)39 b(These)24 | |
| 7664 | b(names)f(cannot)h(then)f(b)s(e)g(assigned)h(v)-5 b(alues)1110 | |
| 7665 | 408 y(b)m(y)30 b(subsequen)m(t)g(assignmen)m(t)h(statemen)m(ts)h(or)f | |
| 28157acd | 7666 | (unset.)630 573 y Fs(-t)384 b Ft(Giv)m(e)33 b(eac)m(h)h |
| 1c72c0cd | 7667 | Fq(name)j Ft(the)32 b Fs(trace)f Ft(attribute.)46 b(T)-8 |
| 28157acd | 7668 | b(raced)32 b(functions)g(inherit)g(the)1110 682 y Fs(DEBUG)26 |
| 1c72c0cd | 7669 | b Ft(and)h Fs(RETURN)f Ft(traps)h(from)g(the)h(calling)h(shell.)40 |
| 28157acd CR |
7670 | b(The)27 b(trace)i(attribute)1110 792 y(has)h(no)g(sp)s(ecial)h |
| 7671 | (meaning)g(for)f(v)-5 b(ariables.)630 956 y Fs(-x)384 | |
| 1c72c0cd CR |
7672 | b Ft(Mark)30 b(eac)m(h)h Fq(name)k Ft(for)29 b(exp)s(ort)h(to)g |
| 7673 | (subsequen)m(t)f(commands)h(via)g(the)g(en)m(vi-)1110 | |
| 28157acd CR |
7674 | 1066 y(ronmen)m(t.)630 1230 y(Using)25 b(`)p Fs(+)p Ft(')g(instead)h |
| 7675 | (of)f(`)p Fs(-)p Ft(')g(turns)f(o\013)h(the)g(attribute)h(instead.)39 | |
| 7676 | b(When)25 b(used)f(in)h(a)g(function,)630 1340 y Fs(declare)37 | |
| 7677 | b Ft(mak)m(es)i(eac)m(h)h Fq(name)k Ft(lo)s(cal,)f(as)38 | |
| 7678 | b(with)h(the)g Fs(local)e Ft(command.)66 b(If)38 b(a)h(v)-5 | |
| 7679 | b(ariable)630 1450 y(name)30 b(is)h(follo)m(w)m(ed)h(b)m(y)e(=)p | |
| 7680 | Fq(v)-5 b(alue)p Ft(,)31 b(the)f(v)-5 b(alue)31 b(of)g(the)f(v)-5 | |
| 7681 | b(ariable)32 b(is)e(set)h(to)g Fq(v)-5 b(alue)p Ft(.)630 | |
| 7682 | 1587 y(The)35 b(return)f(status)i(is)g(zero)g(unless)f(an)g(in)m(v)-5 | |
| 7683 | b(alid)36 b(option)g(is)g(encoun)m(tered,)h(an)f(attempt)630 | |
| 7684 | 1696 y(is)c(made)g(to)g(de\014ne)f(a)h(function)g(using)f(`)p | |
| 7685 | Fs(-f)f(foo=bar)p Ft(',)h(an)h(attempt)g(is)g(made)g(to)h(assign)630 | |
| 7686 | 1806 y(a)42 b(v)-5 b(alue)43 b(to)g(a)f(readonly)g(v)-5 | |
| 37c41ab1 | 7687 | b(ariable,)47 b(an)42 b(attempt)h(is)f(made)g(to)h(assign)f(a)h(v)-5 |
| 28157acd | 7688 | b(alue)42 b(to)h(an)630 1915 y(arra)m(y)30 b(v)-5 b(ariable)30 |
| 37c41ab1 | 7689 | b(without)g(using)e(the)i(comp)s(ound)e(assignmen)m(t)i(syn)m(tax)g |
| 28157acd | 7690 | (\(see)h(Section)f(6.7)630 2025 y([Arra)m(ys],)47 b(page)c(76\),)48 |
| 37c41ab1 CR |
7691 | b(one)43 b(of)g(the)g Fq(names)k Ft(is)c(not)g(a)g(v)-5 |
| 7692 | b(alid)43 b(shell)g(v)-5 b(ariable)44 b(name,)i(an)630 | |
| 28157acd | 7693 | 2134 y(attempt)28 b(is)f(made)h(to)f(turn)f(o\013)i(readonly)f(status)g |
| 37c41ab1 | 7694 | (for)g(a)h(readonly)f(v)-5 b(ariable,)29 b(an)e(attempt)630 |
| 28157acd | 7695 | 2244 y(is)h(made)h(to)g(turn)e(o\013)i(arra)m(y)f(status)h(for)f(an)g |
| 37c41ab1 | 7696 | (arra)m(y)h(v)-5 b(ariable,)30 b(or)e(an)g(attempt)i(is)e(made)g(to)630 |
| 28157acd CR |
7697 | 2354 y(displa)m(y)j(a)f(non-existen)m(t)i(function)e(with)g(`)p |
| 7698 | Fs(-f)p Ft('.)150 2518 y Fs(echo)870 2655 y(echo)47 b([-neE])f([)p | |
| 7699 | Fj(arg)57 b Fs(...)o(])630 2792 y Ft(Output)31 b(the)i | |
| 37c41ab1 | 7700 | Fq(arg)8 b Ft(s,)33 b(separated)g(b)m(y)g(spaces,)g(terminated)g(with)f |
| 28157acd | 7701 | (a)h(newline.)47 b(The)32 b(return)630 2902 y(status)40 |
| 1c72c0cd CR |
7702 | b(is)g(alw)m(a)m(ys)h(0.)69 b(If)39 b(`)p Fs(-n)p Ft(')h(is)f(sp)s |
| 7703 | (eci\014ed,)j(the)e(trailing)h(newline)e(is)h(suppressed.)66 | |
| 28157acd | 7704 | b(If)630 3011 y(the)29 b(`)p Fs(-e)p Ft(')g(option)g(is)h(giv)m(en,)g |
| 1c72c0cd | 7705 | (in)m(terpretation)g(of)g(the)f(follo)m(wing)h(bac)m(kslash-escap)s(ed) |
| 28157acd | 7706 | g(c)m(har-)630 3121 y(acters)38 b(is)f(enabled.)60 b(The)36 |
| 1c72c0cd | 7707 | b(`)p Fs(-E)p Ft(')h(option)g(disables)g(the)g(in)m(terpretation)h(of)f |
| 28157acd | 7708 | (these)g(escap)s(e)630 3230 y(c)m(haracters,)h(ev)m(en)d(on)g(systems)g |
| 1c72c0cd | 7709 | (where)f(they)h(are)g(in)m(terpreted)h(b)m(y)e(default.)55 |
| 28157acd | 7710 | b(The)34 b Fs(xpg_)630 3340 y(echo)d Ft(shell)h(option)h(ma)m(y)g(b)s |
| 1c72c0cd | 7711 | (e)e(used)h(to)h(dynamically)g(determine)f(whether)f(or)i(not)f |
| 28157acd | 7712 | Fs(echo)630 3450 y Ft(expands)39 b(these)i(escap)s(e)g(c)m(haracters)g |
| 1c72c0cd | 7713 | (b)m(y)g(default.)70 b Fs(echo)39 b Ft(do)s(es)h(not)g(in)m(terpret)h |
| 28157acd CR |
7714 | (`)p Fs(--)p Ft(')f(to)630 3559 y(mean)30 b(the)h(end)f(of)g(options.) |
| 7715 | 630 3696 y Fs(echo)f Ft(in)m(terprets)i(the)f(follo)m(wing)i(escap)s(e) | |
| 7716 | f(sequences:)630 3861 y Fs(\\a)384 b Ft(alert)31 b(\(b)s(ell\))630 | |
| 7717 | 4025 y Fs(\\b)384 b Ft(bac)m(kspace)630 4189 y Fs(\\c)g | |
| 7718 | Ft(suppress)28 b(trailing)k(newline)630 4354 y Fs(\\e)384 | |
| 7719 | b Ft(escap)s(e)630 4518 y Fs(\\f)g Ft(form)30 b(feed)630 | |
| 7720 | 4682 y Fs(\\n)384 b Ft(new)30 b(line)630 4847 y Fs(\\r)384 | |
| 7721 | b Ft(carriage)32 b(return)630 5011 y Fs(\\t)384 b Ft(horizon)m(tal)32 | |
| 7722 | b(tab)630 5176 y Fs(\\v)384 b Ft(v)m(ertical)32 b(tab)630 | |
| 7723 | 5340 y Fs(\\\\)384 b Ft(bac)m(kslash)p eop end | |
| ac18b312 CR |
7724 | %%Page: 45 51 |
| 7725 | TeXDict begin 45 50 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 28157acd CR |
7726 | b(Shell)30 b(Builtin)h(Commands)2069 b(45)630 299 y Fs(\\0)p |
| 7727 | Fj(nnn)240 b Ft(the)32 b(eigh)m(t-bit)i(c)m(haracter)g(whose)e(v)-5 | |
| 7728 | b(alue)33 b(is)f(the)g(o)s(ctal)i(v)-5 b(alue)32 b Fq(nnn)f | |
| 7729 | Ft(\(zero)i(to)1110 408 y(three)e(o)s(ctal)g(digits\))630 | |
| 7730 | 575 y Fs(\\)p Fj(nnn)288 b Ft(the)35 b(eigh)m(t-bit)h(c)m(haracter)g | |
| 7731 | (whose)e(v)-5 b(alue)35 b(is)g(the)f(o)s(ctal)i(v)-5 | |
| 7732 | b(alue)35 b Fq(nnn)e Ft(\(one)i(to)1110 685 y(three)c(o)s(ctal)g | |
| 7733 | (digits\))630 852 y Fs(\\x)p Fj(HH)288 b Ft(the)40 b(eigh)m(t-bit)h(c)m | |
| 7734 | (haracter)g(whose)e(v)-5 b(alue)39 b(is)h(the)f(hexadecimal)i(v)-5 | |
| 7735 | b(alue)40 b Fq(HH)1110 961 y Ft(\(one)31 b(or)f(t)m(w)m(o)i(hex)e | |
| 7736 | (digits\))150 1128 y Fs(enable)870 1266 y(enable)46 b([-n])h([-p])f | |
| 7737 | ([-f)h Fj(filename)11 b Fs(])45 b([-ads])h([)p Fj(name)57 | |
| 7738 | b Fs(...)o(])630 1404 y Ft(Enable)36 b(and)f(disable)h(builtin)g(shell) | |
| 7739 | g(commands.)56 b(Disabling)37 b(a)g(builtin)e(allo)m(ws)i(a)f(disk)630 | |
| 7740 | 1514 y(command)e(whic)m(h)g(has)g(the)g(same)h(name)f(as)h(a)f(shell)h | |
| 7741 | (builtin)e(to)i(b)s(e)f(executed)h(without)630 1623 y(sp)s(ecifying)27 | |
| 1c72c0cd | 7742 | b(a)g(full)g(pathname,)g(ev)m(en)h(though)f(the)g(shell)g(normally)g |
| 28157acd | 7743 | (searc)m(hes)h(for)f(builtins)630 1733 y(b)s(efore)32 |
| 1c72c0cd CR |
7744 | b(disk)f(commands.)46 b(If)31 b(`)p Fs(-n)p Ft(')h(is)g(used,)g(the)g |
| 7745 | Fq(name)5 b Ft(s)32 b(b)s(ecome)h(disabled.)45 b(Otherwise)630 | |
| 28157acd | 7746 | 1843 y Fq(name)5 b Ft(s)44 b(are)h(enabled.)82 b(F)-8 |
| 1c72c0cd | 7747 | b(or)45 b(example,)k(to)c(use)f(the)g Fs(test)f Ft(binary)h(found)f |
| 28157acd | 7748 | (via)h Fs($PATH)630 1952 y Ft(instead)31 b(of)f(the)h(shell)f(builtin)g |
| 1c72c0cd | 7749 | (v)m(ersion,)h(t)m(yp)s(e)g(`)p Fs(enable)e(-n)h(test)p |
| 28157acd | 7750 | Ft('.)630 2090 y(If)42 b(the)h(`)p Fs(-p)p Ft(')f(option)h(is)f |
| 1c72c0cd | 7751 | (supplied,)j(or)d(no)h Fq(name)k Ft(argumen)m(ts)c(app)s(ear,)i(a)e |
| 28157acd | 7752 | (list)g(of)g(shell)630 2200 y(builtins)37 b(is)h(prin)m(ted.)63 |
| 1c72c0cd | 7753 | b(With)38 b(no)f(other)h(argumen)m(ts,)j(the)d(list)g(consists)g(of)g |
| 28157acd | 7754 | (all)h(enabled)630 2310 y(shell)33 b(builtins.)46 b(The)32 |
| 1c72c0cd | 7755 | b(`)p Fs(-a)p Ft(')h(option)g(means)f(to)i(list)f(eac)m(h)h(builtin)e |
| 28157acd CR |
7756 | (with)g(an)g(indication)i(of)630 2419 y(whether)c(or)g(not)h(it)g(is)f |
| 7757 | (enabled.)630 2557 y(The)40 b(`)p Fs(-f)p Ft(')g(option)g(means)g(to)h | |
| 1c72c0cd | 7758 | (load)g(the)f(new)f(builtin)h(command)g Fq(name)45 b |
| 28157acd | 7759 | Ft(from)40 b(shared)630 2667 y(ob)5 b(ject)27 b Fq(\014lename)p |
| 1c72c0cd | 7760 | Ft(,)g(on)f(systems)g(that)h(supp)s(ort)d(dynamic)i(loading.)40 |
| 28157acd | 7761 | b(The)26 b(`)p Fs(-d)p Ft(')g(option)h(will)630 2777 |
| 1c72c0cd | 7762 | y(delete)32 b(a)e(builtin)g(loaded)h(with)f(`)p Fs(-f)p |
| 28157acd | 7763 | Ft('.)630 2915 y(If)h(there)g(are)g(no)g(options,)h(a)f(list)h(of)f |
| 1c72c0cd | 7764 | (the)g(shell)g(builtins)g(is)g(displa)m(y)m(ed.)43 b(The)31 |
| 28157acd | 7765 | b(`)p Fs(-s)p Ft(')f(option)630 3024 y(restricts)f Fs(enable)e |
| 1c72c0cd | 7766 | Ft(to)i(the)f Fl(posix)g Ft(sp)s(ecial)h(builtins.)40 |
| 37c41ab1 | 7767 | b(If)27 b(`)p Fs(-s)p Ft(')i(is)f(used)g(with)g(`)p Fs(-f)p |
| 28157acd | 7768 | Ft(',)h(the)f(new)630 3134 y(builtin)i(b)s(ecomes)h(a)f(sp)s(ecial)h |
| 37c41ab1 | 7769 | (builtin)f(\(see)i(Section)f(4.4)g([Sp)s(ecial)g(Builtins],)g(page)g |
| 28157acd | 7770 | (56\).)630 3272 y(The)26 b(return)f(status)h(is)g(zero)h(unless)e(a)i |
| 37c41ab1 | 7771 | Fq(name)k Ft(is)26 b(not)g(a)h(shell)f(builtin)g(or)g(there)g(is)g(an)g |
| 28157acd CR |
7772 | (error)630 3382 y(loading)31 b(a)g(new)f(builtin)g(from)g(a)g(shared)g |
| 7773 | (ob)5 b(ject.)150 3548 y Fs(help)870 3687 y(help)47 b([-s])f([)p | |
| 7774 | Fj(pattern)11 b Fs(])630 3825 y Ft(Displa)m(y)40 b(helpful)e | |
| 37c41ab1 | 7775 | (information)h(ab)s(out)g(builtin)f(commands.)66 b(If)38 |
| 28157acd | 7776 | b Fq(pattern)h Ft(is)g(sp)s(eci\014ed,)630 3934 y Fs(help)28 |
| 37c41ab1 | 7777 | b Ft(giv)m(es)i(detailed)g(help)e(on)h(all)h(commands)e(matc)m(hing)i |
| 28157acd | 7778 | Fq(pattern)p Ft(,)g(otherwise)f(a)g(list)h(of)630 4044 |
| 37c41ab1 CR |
7779 | y(the)36 b(builtins)f(is)h(prin)m(ted.)56 b(The)35 b(`)p |
| 7780 | Fs(-s)p Ft(')h(option)g(restricts)g(the)g(information)g(displa)m(y)m | |
| 28157acd | 7781 | (ed)g(to)630 4154 y(a)c(short)g(usage)h(synopsis.)44 |
| 37c41ab1 | 7782 | b(The)32 b(return)f(status)h(is)g(zero)h(unless)e(no)h(command)g(matc)m |
| 28157acd CR |
7783 | (hes)630 4263 y Fq(pattern)p Ft(.)150 4430 y Fs(let)870 |
| 7784 | 4568 y(let)47 b Fj(expression)55 b Fs([)p Fj(expression)11 | |
| 7785 | b Fs(])630 4706 y Ft(The)41 b Fs(let)g Ft(builtin)g(allo)m(ws)i | |
| 37c41ab1 | 7786 | (arithmetic)f(to)h(b)s(e)d(p)s(erformed)g(on)i(shell)g(v)-5 |
| 28157acd | 7787 | b(ariables.)74 b(Eac)m(h)630 4816 y Fq(expression)31 |
| 37c41ab1 | 7788 | b Ft(is)g(ev)-5 b(aluated)32 b(according)f(to)h(the)f(rules)g(giv)m(en) |
| 28157acd CR |
7789 | h(b)s(elo)m(w)f(in)f(Section)i(6.5)g([Shell)630 4925 |
| 7790 | y(Arithmetic],)51 b(page)46 b(74.)87 b(If)45 b(the)g(last)h | |
| 37c41ab1 | 7791 | Fq(expression)g Ft(ev)-5 b(aluates)47 b(to)f(0,)k Fs(let)44 |
| 28157acd CR |
7792 | b Ft(returns)g(1;)630 5035 y(otherwise)31 b(0)g(is)f(returned.)150 |
| 7793 | 5202 y Fs(local)870 5340 y(local)46 b([)p Fj(option)11 | |
| 7794 | b Fs(])45 b Fj(name)11 b Fs([=)p Fj(value)g Fs(])44 b(...)p | |
| 258e3d46 | 7795 | eop end |
| ac18b312 CR |
7796 | %%Page: 46 52 |
| 7797 | TeXDict begin 46 51 bop 150 -116 a Ft(46)2572 b(Bash)31 | |
| 28157acd CR |
7798 | b(Reference)g(Man)m(ual)630 299 y(F)-8 b(or)27 b(eac)m(h)g(argumen)m |
| 7799 | (t,)g(a)f(lo)s(cal)h(v)-5 b(ariable)27 b(named)e Fq(name)31 | |
| 7800 | b Ft(is)26 b(created,)i(and)d(assigned)h Fq(v)-5 b(alue)p | |
| 7801 | Ft(.)630 408 y(The)37 b Fq(option)h Ft(can)f(b)s(e)g(an)m(y)h(of)f(the) | |
| 7802 | h(options)g(accepted)g(b)m(y)g Fs(declare)p Ft(.)59 b | |
| 7803 | Fs(local)36 b Ft(can)i(only)630 518 y(b)s(e)j(used)h(within)f(a)i | |
| 258e3d46 CR |
7804 | (function;)48 b(it)42 b(mak)m(es)h(the)f(v)-5 b(ariable)43 |
| 7805 | b Fq(name)48 b Ft(ha)m(v)m(e)43 b(a)f(visible)h(scop)s(e)630 | |
| 28157acd CR |
7806 | 628 y(restricted)c(to)g(that)g(function)f(and)f(its)i(c)m(hildren.)64 |
| 7807 | b(The)38 b(return)f(status)h(is)h(zero)g(unless)630 737 | |
| 258e3d46 CR |
7808 | y Fs(local)g Ft(is)h(used)g(outside)g(a)h(function,)h(an)e(in)m(v)-5 |
| 7809 | b(alid)41 b Fq(name)46 b Ft(is)40 b(supplied,)i(or)e | |
| 28157acd CR |
7810 | Fq(name)45 b Ft(is)c(a)630 847 y(readonly)30 b(v)-5 b(ariable.)150 |
| 7811 | 1019 y Fs(logout)870 1160 y(logout)46 b([)p Fj(n)11 b | |
| 7812 | Fs(])630 1301 y Ft(Exit)31 b(a)g(login)g(shell,)g(returning)e(a)i | |
| 7813 | (status)g(of)f Fq(n)g Ft(to)h(the)g(shell's)f(paren)m(t.)150 | |
| 7814 | 1473 y Fs(printf)870 1614 y(printf)46 b([-v)h Fj(var)11 | |
| 7815 | b Fs(])46 b Fj(format)57 b Fs([)p Fj(arguments)11 b Fs(])630 | |
| 7816 | 1755 y Ft(W)-8 b(rite)27 b(the)g(formatted)f Fq(argumen)m(ts)k | |
| 1c72c0cd | 7817 | Ft(to)d(the)f(standard)f(output)h(under)e(the)i(con)m(trol)i(of)e(the) |
| 28157acd | 7818 | 630 1864 y Fq(format)p Ft(.)41 b(The)28 b Fq(format)j |
| 1c72c0cd | 7819 | Ft(is)e(a)g(c)m(haracter)i(string)d(whic)m(h)h(con)m(tains)h(three)f(t) |
| 28157acd | 7820 | m(yp)s(es)g(of)g(ob)5 b(jects:)630 1974 y(plain)28 b(c)m(haracters,)j |
| 1c72c0cd | 7821 | (whic)m(h)d(are)h(simply)f(copied)h(to)h(standard)d(output,)i(c)m |
| 28157acd | 7822 | (haracter)h(escap)s(e)630 2084 y(sequences,)g(whic)m(h)f(are)g(con)m(v) |
| 1c72c0cd | 7823 | m(erted)i(and)d(copied)i(to)f(the)h(standard)e(output,)h(and)g(format) |
| 28157acd | 7824 | 630 2193 y(sp)s(eci\014cations,)39 b(eac)m(h)e(of)g(whic)m(h)f(causes)g |
| 1c72c0cd | 7825 | (prin)m(ting)g(of)h(the)f(next)h(successiv)m(e)g Fq(argumen)m(t)p |
| 28157acd | 7826 | Ft(.)630 2303 y(In)31 b(addition)h(to)h(the)e(standard)g |
| 5e13499c | 7827 | Fs(printf\(1\))f Ft(formats,)i(`)p Fs(\045b)p Ft(')g(causes)g |
| 28157acd | 7828 | Fs(printf)e Ft(to)j(expand)630 2412 y(bac)m(kslash)39 |
| 37c41ab1 CR |
7829 | b(escap)s(e)g(sequences)f(in)h(the)f(corresp)s(onding)f |
| 7830 | Fq(argumen)m(t)p Ft(,)k(\(except)f(that)f(`)p Fs(\\c)p | |
| 28157acd | 7831 | Ft(')630 2522 y(terminates)44 b(output,)j(bac)m(kslashes)d(in)f(`)p |
| 37c41ab1 | 7832 | Fs(\\')p Ft(',)k(`)p Fs(\\")p Ft(',)g(and)c(`)p Fs(\\?)p |
| 28157acd | 7833 | Ft(')g(are)h(not)g(remo)m(v)m(ed,)k(and)630 2632 y(o)s(ctal)25 |
| 37c41ab1 CR |
7834 | b(escap)s(es)f(b)s(eginning)f(with)g(`)p Fs(\\0)p Ft(')h(ma)m(y)g(con)m |
| 7835 | (tain)h(up)e(to)h(four)f(digits\),)j(and)d(`)p Fs(\045q)p | |
| 28157acd | 7836 | Ft(')h(causes)630 2741 y Fs(printf)31 b Ft(to)i(output)f(the)h(corresp) |
| 37c41ab1 | 7837 | s(onding)f Fq(argumen)m(t)j Ft(in)d(a)h(format)g(that)g(can)g(b)s(e)f |
| 28157acd | 7838 | (reused)630 2851 y(as)f(shell)f(input.)630 2992 y(The)24 |
| 3ee6b87d CR |
7839 | b(`)p Fs(-v)p Ft(')h(option)g(causes)g(the)g(output)g(to)g(b)s(e)f |
| 7840 | (assigned)h(to)h(the)f(v)-5 b(ariable)25 b Fq(v)-5 b(ar)32 | |
| 28157acd CR |
7841 | b Ft(rather)24 b(than)630 3101 y(b)s(eing)30 b(prin)m(ted)g(to)h(the)g |
| 7842 | (standard)e(output.)630 3242 y(The)i Fq(format)i Ft(is)f(reused)e(as)i | |
| 3ee6b87d | 7843 | (necessary)f(to)i(consume)e(all)h(of)f(the)h Fq(argumen)m(ts)p |
| 28157acd | 7844 | Ft(.)44 b(If)30 b(the)i Fq(for-)630 3352 y(mat)c Ft(requires)e(more)g |
| 3ee6b87d | 7845 | Fq(argumen)m(ts)k Ft(than)25 b(are)i(supplied,)e(the)h(extra)h(format)f |
| 28157acd | 7846 | (sp)s(eci\014cations)630 3461 y(b)s(eha)m(v)m(e)j(as)g(if)f(a)h(zero)g |
| 3ee6b87d | 7847 | (v)-5 b(alue)29 b(or)g(n)m(ull)f(string,)h(as)g(appropriate,)g(had)f(b) |
| 28157acd | 7848 | s(een)g(supplied.)38 b(The)630 3571 y(return)29 b(v)-5 |
| 3ee6b87d | 7849 | b(alue)31 b(is)g(zero)g(on)f(success,)h(non-zero)g(on)f(failure.)150 |
| 28157acd | 7850 | 3743 y Fs(read)870 3884 y(read)47 b([-ers])f([-a)h Fj(aname)11 |
| 5e13499c CR |
7851 | b Fs(])45 b([-d)i Fj(delim)11 b Fs(])46 b([-n)h Fj(nchars)11 |
| 7852 | b Fs(])45 b([-p)i Fj(prompt)11 b Fs(])45 b([-t)i Fj(time-)870 | |
| 28157acd CR |
7853 | 3994 y(out)11 b Fs(])46 b([-u)h Fj(fd)11 b Fs(])46 b([)p |
| 7854 | Fj(name)57 b Fs(...])630 4134 y Ft(One)26 b(line)h(is)g(read)f(from)h | |
| 37c41ab1 | 7855 | (the)f(standard)g(input,)h(or)g(from)f(the)h(\014le)f(descriptor)h |
| 28157acd | 7856 | Fq(fd)i Ft(supplied)630 4244 y(as)37 b(an)g(argumen)m(t)h(to)f(the)h(`) |
| 37c41ab1 | 7857 | p Fs(-u)p Ft(')e(option,)k(and)c(the)i(\014rst)e(w)m(ord)g(is)h |
| 28157acd | 7858 | (assigned)h(to)f(the)h(\014rst)630 4354 y Fq(name)p Ft(,)29 |
| 5e13499c | 7859 | b(the)f(second)h(w)m(ord)e(to)i(the)g(second)f Fq(name)p |
| 37c41ab1 | 7860 | Ft(,)h(and)e(so)i(on,)g(with)f(lefto)m(v)m(er)i(w)m(ords)e(and)630 |
| 28157acd | 7861 | 4463 y(their)g(in)m(terv)m(ening)h(separators)g(assigned)f(to)h(the)f |
| 37c41ab1 | 7862 | (last)h Fq(name)p Ft(.)40 b(If)27 b(there)i(are)f(few)m(er)g(w)m(ords) |
| 28157acd CR |
7863 | 630 4573 y(read)44 b(from)f(the)g(input)g(stream)h(than)g(names,)j(the) |
| 7864 | c(remaining)h(names)g(are)g(assigned)630 4682 y(empt)m(y)31 | |
| 37c41ab1 CR |
7865 | b(v)-5 b(alues.)41 b(The)30 b(c)m(haracters)i(in)e(the)h(v)-5 |
| 7866 | b(alue)31 b(of)g(the)f Fs(IFS)g Ft(v)-5 b(ariable)31 | |
| 28157acd | 7867 | b(are)g(used)f(to)h(split)630 4792 y(the)37 b(line)h(in)m(to)g(w)m |
| 37c41ab1 | 7868 | (ords.)61 b(The)36 b(bac)m(kslash)i(c)m(haracter)h(`)p |
| 5e13499c | 7869 | Fs(\\)p Ft(')e(ma)m(y)h(b)s(e)f(used)f(to)i(remo)m(v)m(e)h(an)m(y)630 |
| 28157acd | 7870 | 4902 y(sp)s(ecial)h(meaning)g(for)f(the)g(next)h(c)m(haracter)h(read)e |
| 37c41ab1 | 7871 | (and)g(for)g(line)h(con)m(tin)m(uation.)69 b(If)39 b(no)630 |
| 28157acd | 7872 | 5011 y(names)28 b(are)h(supplied,)f(the)g(line)h(read)g(is)f(assigned)h |
| 37c41ab1 | 7873 | (to)g(the)f(v)-5 b(ariable)29 b Fs(REPLY)p Ft(.)39 b(The)28 |
| 28157acd | 7874 | b(return)630 5121 y(co)s(de)i(is)f(zero,)i(unless)e(end-of-\014le)h(is) |
| 37c41ab1 | 7875 | f(encoun)m(tered,)h Fs(read)f Ft(times)h(out,)g(or)f(an)h(in)m(v)-5 |
| 28157acd | 7876 | b(alid)30 b(\014le)630 5230 y(descriptor)35 b(is)h(supplied)e(as)i(the) |
| 37c41ab1 | 7877 | f(argumen)m(t)h(to)g(`)p Fs(-u)p Ft('.)56 b(Options,)37 |
| 28157acd CR |
7878 | b(if)e(supplied,)h(ha)m(v)m(e)h(the)630 5340 y(follo)m(wing)32 |
| 7879 | b(meanings:)p eop end | |
| ac18b312 CR |
7880 | %%Page: 47 53 |
| 7881 | TeXDict begin 47 52 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 28157acd CR |
7882 | b(Shell)30 b(Builtin)h(Commands)2069 b(47)630 299 y Fs(-a)30 |
| 7883 | b Fj(aname)114 b Ft(The)34 b(w)m(ords)f(are)i(assigned)f(to)h(sequen)m | |
| 7884 | (tial)h(indices)e(of)g(the)g(arra)m(y)h(v)-5 b(ariable)1110 | |
| 7885 | 408 y Fq(aname)p Ft(,)29 b(starting)h(at)f(0.)40 b(All)29 | |
| 7886 | b(elemen)m(ts)h(are)e(remo)m(v)m(ed)i(from)d Fq(aname)34 | |
| 7887 | b Ft(b)s(efore)1110 518 y(the)d(assignmen)m(t.)41 b(Other)30 | |
| 7888 | b Fq(name)36 b Ft(argumen)m(ts)30 b(are)h(ignored.)630 | |
| 7889 | 690 y Fs(-d)f Fj(delim)114 b Ft(The)41 b(\014rst)h(c)m(haracter)h(of)f | |
| 37c41ab1 | 7890 | Fq(delim)g Ft(is)g(used)g(to)g(terminate)h(the)f(input)f(line,)1110 |
| 28157acd | 7891 | 800 y(rather)30 b(than)g(newline.)630 972 y Fs(-e)384 |
| 37c41ab1 | 7892 | b Ft(Readline)28 b(\(see)h(Chapter)e(8)h([Command)f(Line)g(Editing],)i |
| 28157acd CR |
7893 | (page)f(89\))h(is)f(used)1110 1082 y(to)j(obtain)g(the)g(line.)630 |
| 7894 | 1254 y Fs(-n)f Fj(nchars)1110 1363 y Fs(read)38 b Ft(returns)f(after)j | |
| 37c41ab1 | 7895 | (reading)f Fq(nc)m(hars)j Ft(c)m(haracters)e(rather)f(than)g(w)m |
| 28157acd CR |
7896 | (aiting)1110 1473 y(for)30 b(a)h(complete)h(line)e(of)h(input.)630 |
| 7897 | 1645 y Fs(-p)f Fj(prompt)1110 1755 y Ft(Displa)m(y)38 | |
| 1c72c0cd | 7898 | b Fq(prompt)p Ft(,)g(without)e(a)h(trailing)h(newline,)h(b)s(efore)d |
| 28157acd | 7899 | (attempting)i(to)1110 1864 y(read)f(an)m(y)h(input.)60 |
| 1c72c0cd | 7900 | b(The)37 b(prompt)g(is)g(displa)m(y)m(ed)h(only)f(if)g(input)g(is)g |
| 28157acd | 7901 | (coming)1110 1974 y(from)30 b(a)h(terminal.)630 2146 |
| 1c72c0cd CR |
7902 | y Fs(-r)384 b Ft(If)21 b(this)h(option)g(is)f(giv)m(en,)k(bac)m(kslash) |
| 7903 | d(do)s(es)f(not)h(act)h(as)f(an)f(escap)s(e)h(c)m(haracter.)1110 | |
| 28157acd CR |
7904 | 2256 y(The)30 b(bac)m(kslash)i(is)f(considered)g(to)h(b)s(e)e(part)h |
| 7905 | (of)g(the)g(line.)43 b(In)30 b(particular,)i(a)1110 2365 | |
| 1c72c0cd | 7906 | y(bac)m(kslash-newline)f(pair)f(ma)m(y)h(not)g(b)s(e)f(used)f(as)i(a)g |
| 28157acd | 7907 | (line)f(con)m(tin)m(uation.)630 2538 y Fs(-s)384 b Ft(Silen)m(t)28 |
| 1c72c0cd | 7908 | b(mo)s(de.)40 b(If)27 b(input)f(is)i(coming)g(from)f(a)h(terminal,)h(c) |
| 28157acd CR |
7909 | m(haracters)g(are)f(not)1110 2647 y(ec)m(ho)s(ed.)630 |
| 7910 | 2819 y Fs(-t)i Fj(timeout)1110 2929 y Ft(Cause)42 b Fs(read)g | |
| 1c72c0cd | 7911 | Ft(to)h(time)h(out)f(and)f(return)f(failure)i(if)g(a)g(complete)h(line) |
| 28157acd | 7912 | f(of)1110 3039 y(input)26 b(is)h(not)h(read)f(within)f |
| 1c72c0cd | 7913 | Fq(timeout)k Ft(seconds.)40 b(This)26 b(option)i(has)e(no)h(e\013ect) |
| 28157acd CR |
7914 | 1110 3148 y(if)j Fs(read)g Ft(is)g(not)h(reading)f(input)f(from)h(the)h |
| 7915 | (terminal)g(or)f(a)h(pip)s(e.)630 3320 y Fs(-u)f Fj(fd)258 | |
| 1c72c0cd | 7916 | b Ft(Read)31 b(input)e(from)h(\014le)g(descriptor)h Fq(fd)p |
| 28157acd CR |
7917 | Ft(.)150 3493 y Fs(shopt)870 3634 y(shopt)46 b([-pqsu])g([-o])h([)p |
| 7918 | Fj(optname)56 b Fs(...)o(])630 3774 y Ft(T)-8 b(oggle)47 | |
| 7919 | b(the)d(v)-5 b(alues)45 b(of)g(v)-5 b(ariables)45 b(con)m(trolling)i | |
| 7920 | (optional)f(shell)e(b)s(eha)m(vior.)84 b(With)45 b(no)630 | |
| 7921 | 3884 y(options,)32 b(or)f(with)g(the)g(`)p Fs(-p)p Ft(')g(option,)h(a)g | |
| 7922 | (list)f(of)h(all)g(settable)g(options)g(is)f(displa)m(y)m(ed,)h(with) | |
| 7923 | 630 3994 y(an)i(indication)i(of)f(whether)f(or)g(not)h(eac)m(h)h(is)e | |
| 7924 | (set.)54 b(The)34 b(`)p Fs(-p)p Ft(')h(option)g(causes)g(output)f(to) | |
| 7925 | 630 4103 y(b)s(e)i(displa)m(y)m(ed)h(in)e(a)i(form)f(that)h(ma)m(y)g(b) | |
| 7926 | s(e)e(reused)h(as)g(input.)58 b(Other)36 b(options)g(ha)m(v)m(e)i(the) | |
| 7927 | 630 4213 y(follo)m(wing)32 b(meanings:)630 4385 y Fs(-s)384 | |
| 7928 | b Ft(Enable)30 b(\(set\))i(eac)m(h)f Fq(optname)p Ft(.)630 | |
| 7929 | 4557 y Fs(-u)384 b Ft(Disable)31 b(\(unset\))g(eac)m(h)h | |
| 7930 | Fq(optname)p Ft(.)630 4729 y Fs(-q)384 b Ft(Suppresses)28 | |
| 7931 | b(normal)h(output;)h(the)g(return)e(status)i(indicates)h(whether)e(the) | |
| 7932 | 1110 4839 y Fq(optname)37 b Ft(is)31 b(set)h(or)f(unset.)43 | |
| 7933 | b(If)31 b(m)m(ultiple)h Fq(optname)37 b Ft(argumen)m(ts)31 | |
| 7934 | b(are)h(giv)m(en)1110 4949 y(with)43 b(`)p Fs(-q)p Ft(',)j(the)d | |
| 7935 | (return)f(status)h(is)g(zero)h(if)f(all)g Fq(optnames)k | |
| 7936 | Ft(are)d(enabled;)1110 5058 y(non-zero)31 b(otherwise.)630 | |
| 7937 | 5230 y Fs(-o)384 b Ft(Restricts)42 b(the)g(v)-5 b(alues)42 | |
| 7938 | b(of)f Fq(optname)47 b Ft(to)42 b(b)s(e)f(those)h(de\014ned)e(for)h | |
| 7939 | (the)h(`)p Fs(-o)p Ft(')1110 5340 y(option)21 b(to)h(the)f | |
| 7940 | Fs(set)f Ft(builtin)g(\(see)i(Section)f(4.3)h([The)e(Set)h(Builtin],)j | |
| 7941 | (page)d(53\).)p eop end | |
| 7942 | %%Page: 48 54 | |
| 7943 | TeXDict begin 48 53 bop 150 -116 a Ft(48)2572 b(Bash)31 | |
| 7944 | b(Reference)g(Man)m(ual)630 299 y(If)e(either)i(`)p Fs(-s)p | |
| 7945 | Ft(')f(or)g(`)p Fs(-u)p Ft(')f(is)h(used)g(with)f(no)h | |
| 7946 | Fq(optname)35 b Ft(argumen)m(ts,)c(the)f(displa)m(y)g(is)g(limited)630 | |
| 7947 | 408 y(to)h(those)g(options)g(whic)m(h)f(are)h(set)f(or)h(unset,)f(resp) | |
| 7948 | s(ectiv)m(ely)-8 b(.)630 542 y(Unless)30 b(otherwise)h(noted,)g(the)g | |
| 7949 | Fs(shopt)d Ft(options)j(are)g(disabled)f(\(o\013)7 b(\))32 | |
| 7950 | b(b)m(y)e(default.)630 675 y(The)d(return)f(status)i(when)f(listing)h | |
| 7951 | (options)g(is)f(zero)i(if)e(all)i Fq(optnames)i Ft(are)d(enabled,)g | |
| 7952 | (non-)630 785 y(zero)40 b(otherwise.)66 b(When)39 b(setting)h(or)f | |
| 7953 | (unsetting)g(options,)i(the)e(return)f(status)h(is)g(zero)630 | |
| 7954 | 894 y(unless)30 b(an)g Fq(optname)36 b Ft(is)30 b(not)h(a)g(v)-5 | |
| 7955 | b(alid)30 b(shell)h(option.)630 1028 y(The)f(list)h(of)f | |
| 7956 | Fs(shopt)f Ft(options)i(is:)630 1185 y Fs(cdable_vars)1110 | |
| 7957 | 1295 y Ft(If)j(this)h(is)g(set,)i(an)e(argumen)m(t)g(to)h(the)f | |
| 7958 | Fs(cd)f Ft(builtin)h(command)f(that)i(is)f(not)1110 1404 | |
| 7959 | y(a)c(directory)g(is)g(assumed)f(to)h(b)s(e)f(the)h(name)f(of)h(a)g(v) | |
| 7960 | -5 b(ariable)31 b(whose)g(v)-5 b(alue)31 b(is)1110 1514 | |
| 7961 | y(the)g(directory)f(to)i(c)m(hange)f(to.)630 1671 y Fs(cdspell)144 | |
| 7962 | b Ft(If)27 b(set,)h(minor)f(errors)f(in)h(the)g(sp)s(elling)h(of)f(a)g | |
| 7963 | (directory)h(comp)s(onen)m(t)f(in)g(a)h Fs(cd)1110 1781 | |
| 7964 | y Ft(command)i(will)h(b)s(e)f(corrected.)43 b(The)30 | |
| 7965 | b(errors)g(c)m(hec)m(k)m(ed)j(for)d(are)h(transp)s(osed)1110 | |
| 7966 | 1890 y(c)m(haracters,)46 b(a)c(missing)f(c)m(haracter,)47 | |
| 7967 | b(and)40 b(a)i(c)m(haracter)h(to)s(o)g(man)m(y)-8 b(.)74 | |
| 7968 | b(If)42 b(a)1110 2000 y(correction)25 b(is)e(found,)g(the)h(corrected)g | |
| 7969 | (path)f(is)g(prin)m(ted,)h(and)f(the)g(command)1110 2109 | |
| 7970 | y(pro)s(ceeds.)40 b(This)30 b(option)h(is)f(only)h(used)e(b)m(y)h(in)m | |
| 7971 | (teractiv)m(e)k(shells.)630 2267 y Fs(checkhash)1110 | |
| 7972 | 2376 y Ft(If)29 b(this)h(is)g(set,)g(Bash)g(c)m(hec)m(ks)h(that)g(a)f | |
| 7973 | (command)f(found)g(in)g(the)h(hash)f(table)1110 2486 | |
| 7974 | y(exists)k(b)s(efore)f(trying)h(to)h(execute)g(it.)48 | |
| 7975 | b(If)32 b(a)h(hashed)e(command)i(no)f(longer)1110 2595 | |
| 7976 | y(exists,)f(a)g(normal)f(path)g(searc)m(h)h(is)g(p)s(erformed.)630 | |
| 7977 | 2753 y Fs(checkwinsize)1110 2862 y Ft(If)41 b(set,)k(Bash)c(c)m(hec)m | |
| 7978 | (ks)i(the)f(windo)m(w)e(size)j(after)f(eac)m(h)g(command)f(and,)j(if) | |
| 7979 | 1110 2972 y(necessary)-8 b(,)31 b(up)s(dates)f(the)g(v)-5 | |
| 7980 | b(alues)31 b(of)g Fs(LINES)e Ft(and)g Fs(COLUMNS)p Ft(.)630 | |
| 7981 | 3129 y Fs(cmdhist)144 b Ft(If)33 b(set,)j(Bash)e(attempts)h(to)g(sa)m | |
| 7982 | (v)m(e)g(all)g(lines)f(of)g(a)h(m)m(ultiple-line)g(command)1110 | |
| 7983 | 3239 y(in)c(the)g(same)g(history)g(en)m(try)-8 b(.)42 | |
| 7984 | b(This)30 b(allo)m(ws)i(easy)g(re-editing)g(of)f(m)m(ulti-line)1110 | |
| 7985 | 3348 y(commands.)630 3506 y Fs(dotglob)144 b Ft(If)27 | |
| 7986 | b(set,)i(Bash)f(includes)g(\014lenames)g(b)s(eginning)f(with)g(a)h(`.') | |
| 7987 | 41 b(in)27 b(the)h(results)g(of)1110 3615 y(\014lename)j(expansion.)630 | |
| 7988 | 3772 y Fs(execfail)96 b Ft(If)24 b(this)h(is)f(set,)j(a)e(non-in)m | |
| 7989 | (teractiv)m(e)i(shell)e(will)f(not)h(exit)h(if)e(it)h(cannot)h(execute) | |
| 7990 | 1110 3882 y(the)i(\014le)g(sp)s(eci\014ed)g(as)g(an)g(argumen)m(t)g(to) | |
| 7991 | h(the)f Fs(exec)f Ft(builtin)h(command.)39 b(An)1110 | |
| 7992 | 3992 y(in)m(teractiv)m(e)33 b(shell)e(do)s(es)f(not)g(exit)i(if)e | |
| 7993 | Fs(exec)f Ft(fails.)630 4149 y Fs(expand_aliases)1110 | |
| 7994 | 4258 y Ft(If)j(set,)h(aliases)g(are)g(expanded)e(as)h(describ)s(ed)f(b) | |
| 7995 | s(elo)m(w)h(under)f(Aliases,)i(Sec-)1110 4368 y(tion)38 | |
| 7996 | b(6.6)h([Aliases],)j(page)d(75.)64 b(This)37 b(option)h(is)g(enabled)g | |
| 7997 | (b)m(y)g(default)g(for)1110 4478 y(in)m(teractiv)m(e)33 | |
| 7998 | b(shells.)630 4635 y Fs(extdebug)96 b Ft(If)30 b(set,)h(b)s(eha)m(vior) | |
| 7999 | g(in)m(tended)f(for)g(use)g(b)m(y)g(debuggers)g(is)h(enabled:)1159 | |
| 8000 | 4768 y(1.)61 b(The)32 b(`)p Fs(-F)p Ft(')g(option)h(to)g(the)g | |
| 8001 | Fs(declare)d Ft(builtin)i(\(see)i(Section)f(4.2)h([Bash)1290 | |
| 8002 | 4878 y(Builtins],)29 b(page)g(41\))g(displa)m(ys)f(the)g(source)h | |
| 8003 | (\014le)f(name)g(and)f(line)h(n)m(um-)1290 4987 y(b)s(er)h(corresp)s | |
| 8004 | (onding)g(to)i(eac)m(h)g(function)f(name)g(supplied)f(as)i(an)f(argu-) | |
| 8005 | 1290 5097 y(men)m(t.)1159 5230 y(2.)61 b(If)20 b(the)h(command)g(run)e | |
| 8006 | (b)m(y)i(the)f Fs(DEBUG)g Ft(trap)g(returns)g(a)h(non-zero)g(v)-5 | |
| 8007 | b(alue,)1290 5340 y(the)31 b(next)f(command)g(is)h(skipp)s(ed)e(and)g | |
| 8008 | (not)i(executed.)p eop end | |
| 8009 | %%Page: 49 55 | |
| 8010 | TeXDict begin 49 54 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 8011 | b(Shell)30 b(Builtin)h(Commands)2069 b(49)1159 299 y(3.)61 | |
| 8012 | b(If)37 b(the)g(command)g(run)f(b)m(y)i(the)f Fs(DEBUG)f | |
| 8013 | Ft(trap)h(returns)f(a)i(v)-5 b(alue)38 b(of)f(2,)1290 | |
| 8014 | 408 y(and)c(the)g(shell)h(is)f(executing)i(in)e(a)h(subroutine)e(\(a)i | |
| 8015 | (shell)g(function)f(or)1290 518 y(a)h(shell)h(script)f(executed)h(b)m | |
| 8016 | (y)f(the)g Fs(.)g Ft(or)g Fs(source)e Ft(builtins\),)j(a)g(call)g(to) | |
| 8017 | 1290 628 y Fs(return)29 b Ft(is)h(sim)m(ulated.)1159 | |
| 8018 | 758 y(4.)61 b Fs(BASH_ARGC)34 b Ft(and)i Fs(BASH_ARGV)e | |
| 8019 | Ft(are)j(up)s(dated)e(as)h(describ)s(ed)g(in)g(their)1290 | |
| 8020 | 868 y(descriptions)30 b(\(see)i(Section)f(5.2)g([Bash)g(V)-8 | |
| 8021 | b(ariables],)32 b(page)f(57\).)1159 998 y(5.)61 b(F)-8 | |
| 8022 | b(unction)57 b(tracing)g(is)g(enabled:)93 b(command)56 | |
| 8023 | b(substitution,)63 b(shell)1290 1108 y(functions,)30 | |
| 8024 | b(and)f(subshells)g(in)m(v)m(ok)m(ed)j(with)d Fs(\()h | |
| 8025 | Fj(command)39 b Fs(\))30 b Ft(inherit)g(the)1290 1217 | |
| 8026 | y Fs(DEBUG)f Ft(and)h Fs(RETURN)e Ft(traps.)1159 1348 | |
| 8027 | y(6.)61 b(Error)74 b(tracing)i(is)f(enabled:)131 b(command)74 | |
| 8028 | b(substitution,)87 b(shell)1290 1457 y(functions,)30 | |
| 8029 | b(and)f(subshells)g(in)m(v)m(ok)m(ed)j(with)d Fs(\()h | |
| 8030 | Fj(command)39 b Fs(\))30 b Ft(inherit)g(the)1290 1567 | |
| 8031 | y Fs(ERROR)f Ft(trap.)630 1718 y Fs(extglob)144 b Ft(If)26 | |
| 8032 | b(set,)i(the)f(extended)f(pattern)h(matc)m(hing)g(features)g(describ)s | |
| 8033 | (ed)e(ab)s(o)m(v)m(e)j(\(see)1110 1828 y(Section)j(3.5.8.1)i([P)m | |
| 8034 | (attern)f(Matc)m(hing],)g(page)f(23\))h(are)f(enabled.)630 | |
| 8035 | 1979 y Fs(extquote)96 b Ft(If)49 b(set,)54 b Fs($')p | |
| 8036 | Fj(string)11 b Fs(')46 b Ft(and)j Fs($")p Fj(string)11 | |
| 8037 | b Fs(")46 b Ft(quoting)k(is)f(p)s(erformed)e(within)1110 | |
| 8038 | 2089 y Fs(${)p Fj(parameter)11 b Fs(})30 b Ft(expansions)j(enclosed)h | |
| 8039 | (in)g(double)f(quotes.)51 b(This)32 b(option)1110 2198 | |
| 8040 | y(is)e(enabled)h(b)m(y)f(default.)630 2350 y Fs(failglob)96 | |
| 8041 | b Ft(If)30 b(set,)g(patterns)g(whic)m(h)g(fail)h(to)g(matc)m(h)g | |
| 8042 | (\014lenames)f(during)e(pathname)i(ex-)1110 2459 y(pansion)g(result)g | |
| 8043 | (in)g(an)g(expansion)h(error.)630 2611 y Fs(force_fignore)1110 | |
| 8044 | 2720 y Ft(If)43 b(set,)k(the)d(su\016xes)f(sp)s(eci\014ed)f(b)m(y)i | |
| 8045 | (the)f Fs(FIGNORE)f Ft(shell)h(v)-5 b(ariable)44 b(cause)1110 | |
| 8046 | 2830 y(w)m(ords)31 b(to)h(b)s(e)f(ignored)h(when)f(p)s(erforming)f(w)m | |
| 8047 | (ord)h(completion)i(ev)m(en)f(if)g(the)1110 2939 y(ignored)37 | |
| 8048 | b(w)m(ords)g(are)g(the)h(only)f(p)s(ossible)g(completions.)62 | |
| 8049 | b(See)37 b(Section)h(5.2)1110 3049 y([Bash)24 b(V)-8 | |
| 8050 | b(ariables],)27 b(page)e(57,)h(for)d(a)h(description)g(of)g | |
| 8051 | Fs(FIGNORE)p Ft(.)37 b(This)22 b(option)1110 3159 y(is)30 | |
| 8052 | b(enabled)h(b)m(y)f(default.)630 3310 y Fs(gnu_errfmt)1110 | |
| 8053 | 3420 y Ft(If)35 b(set,)j(shell)e(error)g(messages)g(are)h(written)e(in) | |
| 8054 | h(the)g(standard)f Fl(gnu)g Ft(error)1110 3529 y(message)c(format.)630 | |
| 8055 | 3680 y Fs(histappend)1110 3790 y Ft(If)c(set,)j(the)e(history)g(list)g | |
| 8056 | (is)g(app)s(ended)e(to)j(the)f(\014le)g(named)f(b)m(y)h(the)g(v)-5 | |
| 8057 | b(alue)29 b(of)1110 3900 y(the)d Fs(HISTFILE)d Ft(v)-5 | |
| 8058 | b(ariable)26 b(when)e(the)h(shell)h(exits,)h(rather)e(than)h(o)m(v)m | |
| 8059 | (erwriting)1110 4009 y(the)31 b(\014le.)630 4161 y Fs(histreedit)1110 | |
| 8060 | 4270 y Ft(If)i(set,)h(and)f(Readline)h(is)f(b)s(eing)g(used,)g(a)g | |
| 8061 | (user)g(is)g(giv)m(en)h(the)g(opp)s(ortunit)m(y)1110 | |
| 8062 | 4380 y(to)d(re-edit)g(a)g(failed)g(history)f(substitution.)630 | |
| 8063 | 4531 y Fs(histverify)1110 4641 y Ft(If)35 b(set,)i(and)e(Readline)h(is) | |
| 8064 | f(b)s(eing)g(used,)h(the)f(results)g(of)g(history)h(substitu-)1110 | |
| 8065 | 4750 y(tion)h(are)g(not)g(immediately)h(passed)e(to)h(the)g(shell)g | |
| 8066 | (parser.)59 b(Instead,)38 b(the)1110 4860 y(resulting)i(line)f(is)h | |
| 8067 | (loaded)g(in)m(to)g(the)g(Readline)g(editing)g(bu\013er,)h(allo)m(wing) | |
| 8068 | 1110 4969 y(further)29 b(mo)s(di\014cation.)630 5121 | |
| 8069 | y Fs(hostcomplete)1110 5230 y Ft(If)38 b(set,)j(and)c(Readline)i(is)f | |
| 8070 | (b)s(eing)g(used,)h(Bash)g(will)f(attempt)h(to)g(p)s(erform)1110 | |
| 8071 | 5340 y(hostname)d(completion)h(when)e(a)h(w)m(ord)f(con)m(taining)i(a)f | |
| 8072 | (`)p Fs(@)p Ft(')g(is)g(b)s(eing)f(com-)p eop end | |
| 8073 | %%Page: 50 56 | |
| 8074 | TeXDict begin 50 55 bop 150 -116 a Ft(50)2572 b(Bash)31 | |
| 8075 | b(Reference)g(Man)m(ual)1110 299 y(pleted)k(\(see)h(Section)f(8.4.6)i | |
| 8076 | ([Commands)d(F)-8 b(or)36 b(Completion],)g(page)g(105\).)1110 | |
| 8077 | 408 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.)630 | |
| 8078 | 564 y Fs(huponexit)1110 673 y Ft(If)i(set,)i(Bash)f(will)h(send)d | |
| 8079 | Fs(SIGHUP)h Ft(to)h(all)h(jobs)e(when)g(an)g(in)m(teractiv)m(e)k(login) | |
| 8080 | 1110 783 y(shell)31 b(exits)g(\(see)g(Section)g(3.7.6)h([Signals],)g | |
| 8081 | (page)f(31\).)630 938 y Fs(interactive_comments)1110 | |
| 8082 | 1048 y Ft(Allo)m(w)c(a)g(w)m(ord)e(b)s(eginning)g(with)h(`)p | |
| 8083 | Fs(#)p Ft(')g(to)h(cause)f(that)h(w)m(ord)f(and)f(all)i(remain-)1110 | |
| 8084 | 1157 y(ing)41 b(c)m(haracters)i(on)e(that)h(line)g(to)g(b)s(e)f | |
| 8085 | (ignored)g(in)g(an)g(in)m(teractiv)m(e)j(shell.)1110 | |
| 8086 | 1267 y(This)30 b(option)g(is)h(enabled)f(b)m(y)g(default.)630 | |
| 8087 | 1422 y Fs(lithist)144 b Ft(If)22 b(enabled,)i(and)d(the)h | |
| 8088 | Fs(cmdhist)e Ft(option)j(is)f(enabled,)i(m)m(ulti-line)f(commands)1110 | |
| 8089 | 1532 y(are)28 b(sa)m(v)m(ed)h(to)g(the)f(history)g(with)f(em)m(b)s | |
| 8090 | (edded)g(newlines)h(rather)g(than)f(using)1110 1641 y(semicolon)32 | |
| 8091 | b(separators)f(where)e(p)s(ossible.)630 1797 y Fs(login_shell)1110 | |
| 8092 | 1906 y Ft(The)35 b(shell)h(sets)g(this)f(option)h(if)g(it)g(is)f | |
| 8093 | (started)h(as)g(a)g(login)g(shell)g(\(see)g(Sec-)1110 | |
| 8094 | 2016 y(tion)29 b(6.1)g([In)m(v)m(oking)h(Bash],)f(page)g(67\).)41 | |
| 8095 | b(The)28 b(v)-5 b(alue)29 b(ma)m(y)g(not)f(b)s(e)g(c)m(hanged.)630 | |
| 8096 | 2171 y Fs(mailwarn)96 b Ft(If)34 b(set,)i(and)e(a)h(\014le)g(that)g | |
| 8097 | (Bash)f(is)h(c)m(hec)m(king)h(for)f(mail)g(has)f(b)s(een)g(accessed) | |
| 8098 | 1110 2281 y(since)24 b(the)h(last)g(time)f(it)h(w)m(as)f(c)m(hec)m(k)m | |
| 8099 | (ed,)k(the)c(message)h Fs("The)k(mail)h(in)f Fj(mail-)1110 | |
| 8100 | 2390 y(file)40 b Fs(has)29 b(been)g(read")g Ft(is)i(displa)m(y)m(ed.) | |
| 8101 | 630 2545 y Fs(no_empty_cmd_completion)1110 2655 y Ft(If)f(set,)g(and)g | |
| 8102 | (Readline)g(is)h(b)s(eing)e(used,)h(Bash)g(will)g(not)g(attempt)i(to)e | |
| 8103 | (searc)m(h)1110 2765 y(the)25 b Fs(PATH)f Ft(for)h(p)s(ossible)f | |
| 8104 | (completions)j(when)d(completion)i(is)f(attempted)h(on)1110 | |
| 8105 | 2874 y(an)k(empt)m(y)h(line.)630 3029 y Fs(nocaseglob)1110 | |
| 8106 | 3139 y Ft(If)38 b(set,)k(Bash)d(matc)m(hes)g(\014lenames)g(in)f(a)h | |
| 8107 | (case-insensitiv)m(e)j(fashion)c(when)1110 3249 y(p)s(erforming)29 | |
| 8108 | b(\014lename)i(expansion.)630 3404 y Fs(nocasematch)1110 | |
| 8109 | 3513 y Ft(If)42 b(set,)k(Bash)d(matc)m(hes)g(patterns)g(in)f(a)h | |
| 8110 | (case-insensitiv)m(e)i(fashion)d(when)1110 3623 y(p)s(erforming)31 | |
| 8111 | b(matc)m(hing)i(while)f(executing)i Fs(case)d Ft(or)h | |
| 8112 | Fs([[)g Ft(conditional)h(com-)1110 3733 y(mands.)630 | |
| 8113 | 3888 y Fs(nullglob)96 b Ft(If)23 b(set,)j(Bash)e(allo)m(ws)g | |
| 8114 | (\014lename)g(patterns)g(whic)m(h)f(matc)m(h)h(no)g(\014les)f(to)i | |
| 8115 | (expand)1110 3998 y(to)31 b(a)g(n)m(ull)f(string,)h(rather)f(than)g | |
| 8116 | (themselv)m(es.)630 4153 y Fs(progcomp)96 b Ft(If)25 | |
| 8117 | b(set,)i(the)f(programmable)g(completion)g(facilities)i(\(see)f | |
| 8118 | (Section)f(8.6)h([Pro-)1110 4262 y(grammable)45 b(Completion],)k(page)c | |
| 8119 | (109\))h(are)f(enabled.)82 b(This)44 b(option)h(is)1110 | |
| 8120 | 4372 y(enabled)30 b(b)m(y)h(default.)630 4527 y Fs(promptvars)1110 | |
| 8121 | 4637 y Ft(If)24 b(set,)i(prompt)d(strings)h(undergo)f(parameter)i | |
| 8122 | (expansion,)g(command)f(sub-)1110 4746 y(stitution,)34 | |
| 8123 | b(arithmetic)f(expansion,)g(and)e(quote)i(remo)m(v)-5 | |
| 8124 | b(al)33 b(after)g(b)s(eing)e(ex-)1110 4856 y(panded)39 | |
| 8125 | b(as)i(describ)s(ed)e(b)s(elo)m(w)i(\(see)g(Section)g(6.9)g([Prin)m | |
| 8126 | (ting)g(a)g(Prompt],)1110 4966 y(page)31 b(79\).)42 b(This)30 | |
| 8127 | b(option)g(is)h(enabled)f(b)m(y)g(default.)630 5121 y | |
| 8128 | Fs(restricted_shell)1110 5230 y Ft(The)40 b(shell)h(sets)g(this)g | |
| 8129 | (option)g(if)g(it)h(is)e(started)i(in)e(restricted)i(mo)s(de)e(\(see) | |
| 8130 | 1110 5340 y(Section)c(6.10)g([The)f(Restricted)g(Shell],)i(page)e | |
| 8131 | (80\).)56 b(The)34 b(v)-5 b(alue)35 b(ma)m(y)h(not)p | |
| 8132 | eop end | |
| 8133 | %%Page: 51 57 | |
| 8134 | TeXDict begin 51 56 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 8135 | b(Shell)30 b(Builtin)h(Commands)2069 b(51)1110 299 y(b)s(e)32 | |
| 8136 | b(c)m(hanged.)49 b(This)32 b(is)h(not)h(reset)f(when)f(the)h(startup)g | |
| 8137 | (\014les)f(are)i(executed,)1110 408 y(allo)m(wing)k(the)e(startup)f | |
| 8138 | (\014les)h(to)g(disco)m(v)m(er)h(whether)f(or)f(not)i(a)f(shell)g(is)g | |
| 8139 | (re-)1110 518 y(stricted.)630 689 y Fs(shift_verbose)1110 | |
| 8140 | 799 y Ft(If)g(this)g(is)g(set,)j(the)d Fs(shift)f Ft(builtin)h(prin)m | |
| 8141 | (ts)f(an)h(error)g(message)i(when)d(the)1110 908 y(shift)30 | |
| 8142 | b(coun)m(t)h(exceeds)g(the)g(n)m(um)m(b)s(er)e(of)h(p)s(ositional)i | |
| 8143 | (parameters.)630 1079 y Fs(sourcepath)1110 1189 y Ft(If)22 | |
| 8144 | b(set,)j(the)e Fs(source)e Ft(builtin)h(uses)g(the)h(v)-5 | |
| 8145 | b(alue)23 b(of)g Fs(PATH)e Ft(to)j(\014nd)d(the)h(directory)1110 | |
| 8146 | 1298 y(con)m(taining)29 b(the)e(\014le)h(supplied)e(as)h(an)g(argumen)m | |
| 8147 | (t.)40 b(This)27 b(option)h(is)f(enabled)1110 1408 y(b)m(y)j(default.) | |
| 8148 | 630 1579 y Fs(xpg_echo)96 b Ft(If)31 b(set,)h(the)g Fs(echo)e | |
| 8149 | Ft(builtin)h(expands)f(bac)m(kslash-escap)s(e)j(sequences)f(b)m(y)f | |
| 8150 | (de-)1110 1688 y(fault.)630 1859 y(The)c(return)f(status)i(when)f | |
| 8151 | (listing)h(options)g(is)f(zero)i(if)e(all)i Fq(optnames)i | |
| 8152 | Ft(are)d(enabled,)g(non-)630 1969 y(zero)40 b(otherwise.)66 | |
| 8153 | b(When)39 b(setting)h(or)f(unsetting)g(options,)i(the)e(return)f | |
| 8154 | (status)h(is)g(zero)630 2079 y(unless)30 b(an)g Fq(optname)36 | |
| 8155 | b Ft(is)30 b(not)h(a)g(v)-5 b(alid)30 b(shell)h(option.)150 | |
| 8156 | 2250 y Fs(source)870 2390 y(source)46 b Fj(filename)630 | |
| 8157 | 2530 y Ft(A)30 b(synon)m(ym)g(for)g Fs(.)g Ft(\(see)i(Section)f(4.1)g | |
| 8158 | ([Bourne)g(Shell)f(Builtins],)h(page)g(35\).)150 2701 | |
| 8159 | y Fs(type)870 2841 y(type)47 b([-afptP])e([)p Fj(name)57 | |
| 8160 | b Fs(...)o(])630 2982 y Ft(F)-8 b(or)42 b(eac)m(h)g Fq(name)p | |
| 9d2b70f0 | 8161 | Ft(,)i(indicate)e(ho)m(w)g(it)f(w)m(ould)g(b)s(e)g(in)m(terpreted)g(if) |
| 28157acd | 8162 | g(used)f(as)i(a)f(command)630 3091 y(name.)630 3231 y(If)d(the)g(`)p |
| 9d2b70f0 CR |
8163 | Fs(-t)p Ft(')g(option)g(is)g(used,)i Fs(type)d Ft(prin)m(ts)g(a)i |
| 8164 | (single)f(w)m(ord)g(whic)m(h)g(is)g(one)g(of)h(`)p Fs(alias)p | |
| 28157acd | 8165 | Ft(',)630 3341 y(`)p Fs(function)p Ft(',)32 b(`)p Fs(builtin)p |
| 9d2b70f0 CR |
8166 | Ft(',)g(`)p Fs(file)p Ft(')g(or)h(`)p Fs(keyword)p Ft(',)f(if)h |
| 8167 | Fq(name)38 b Ft(is)33 b(an)f(alias,)j(shell)e(function,)630 | |
| 28157acd | 8168 | 3451 y(shell)i(builtin,)g(disk)g(\014le,)h(or)e(shell)h(reserv)m(ed)g |
| 9d2b70f0 | 8169 | (w)m(ord,)h(resp)s(ectiv)m(ely)-8 b(.)55 b(If)34 b(the)h |
| 28157acd | 8170 | Fq(name)40 b Ft(is)35 b(not)630 3560 y(found,)29 b(then)h(nothing)h(is) |
| 9d2b70f0 | 8171 | f(prin)m(ted,)g(and)g Fs(type)f Ft(returns)g(a)i(failure)g(status.)630 |
| 28157acd | 8172 | 3701 y(If)39 b(the)g(`)p Fs(-p)p Ft(')g(option)h(is)f(used,)i |
| 9d2b70f0 | 8173 | Fs(type)d Ft(either)h(returns)f(the)i(name)f(of)g(the)g(disk)g(\014le)g |
| 28157acd | 8174 | (that)630 3810 y(w)m(ould)30 b(b)s(e)g(executed,)h(or)g(nothing)f(if)g |
| 9d2b70f0 | 8175 | (`)p Fs(-t)p Ft(')h(w)m(ould)f(not)g(return)g(`)p Fs(file)p |
| 28157acd | 8176 | Ft('.)630 3950 y(The)23 b(`)p Fs(-P)p Ft(')h(option)g(forces)g(a)g |
| 37c41ab1 | 8177 | (path)g(searc)m(h)g(for)g(eac)m(h)g Fq(name)p Ft(,)i(ev)m(en)e(if)g(`)p |
| 28157acd CR |
8178 | Fs(-t)p Ft(')g(w)m(ould)f(not)h(return)630 4060 y(`)p |
| 8179 | Fs(file)p Ft('.)630 4200 y(If)34 b(a)i(command)e(is)h(hashed,)g(`)p | |
| 37c41ab1 | 8180 | Fs(-p)p Ft(')g(and)f(`)p Fs(-P)p Ft(')h(prin)m(t)f(the)h(hashed)f(v)-5 |
| 28157acd CR |
8181 | b(alue,)37 b(not)e(necessarily)630 4310 y(the)c(\014le)f(that)h(app)s |
| 8182 | (ears)f(\014rst)f(in)h Fs($PATH)p Ft(.)630 4450 y(If)36 | |
| 37c41ab1 CR |
8183 | b(the)h(`)p Fs(-a)p Ft(')g(option)g(is)g(used,)g Fs(type)f |
| 8184 | Ft(returns)f(all)j(of)f(the)g(places)g(that)g(con)m(tain)h(an)f(exe-) | |
| 28157acd | 8185 | 630 4560 y(cutable)d(named)f Fq(\014le)p Ft(.)50 b(This)33 |
| 37c41ab1 | 8186 | b(includes)g(aliases)i(and)e(functions,)h(if)f(and)g(only)h(if)f(the)h |
| 28157acd CR |
8187 | (`)p Fs(-p)p Ft(')630 4669 y(option)d(is)f(not)h(also)g(used.)630 |
| 8188 | 4810 y(If)26 b(the)h(`)p Fs(-f)p Ft(')g(option)g(is)g(used,)g | |
| 8189 | Fs(type)e Ft(do)s(es)i(not)g(attempt)g(to)h(\014nd)d(shell)i | |
| 8190 | (functions,)g(as)g(with)630 4919 y(the)k Fs(command)d | |
| 8191 | Ft(builtin.)630 5059 y(The)35 b(return)g(status)h(is)g(zero)g(if)g(an)m | |
| 8192 | (y)g(of)g(the)g Fq(names)k Ft(are)c(found,)g(non-zero)g(if)g(none)g | |
| 8193 | (are)630 5169 y(found.)150 5340 y Fs(typeset)p eop end | |
| 8194 | %%Page: 52 58 | |
| 8195 | TeXDict begin 52 57 bop 150 -116 a Ft(52)2572 b(Bash)31 | |
| 8196 | b(Reference)g(Man)m(ual)870 299 y Fs(typeset)46 b([-afFrxi])f([-p])i([) | |
| 8197 | p Fj(name)11 b Fs([=)p Fj(value)g Fs(])43 b(...)o(])630 | |
| 8198 | 432 y Ft(The)29 b Fs(typeset)f Ft(command)h(is)g(supplied)g(for)g | |
| 8199 | (compatibilit)m(y)j(with)d(the)h(Korn)e(shell;)j(ho)m(w-)630 | |
| 8200 | 542 y(ev)m(er,)g(it)g(has)f(b)s(een)g(deprecated)h(in)f(fa)m(v)m(or)i | |
| 8201 | (of)e(the)h Fs(declare)d Ft(builtin)i(command.)150 699 | |
| 8202 | y Fs(ulimit)870 833 y(ulimit)46 b([-acdefilmnpqrstuvxSH])c([)p | |
| 8203 | Fj(limit)11 b Fs(])630 966 y(ulimit)25 b Ft(pro)m(vides)h(con)m(trol)i | |
| 8204 | (o)m(v)m(er)g(the)f(resources)f(a)m(v)-5 b(ailable)29 | |
| 8205 | b(to)e(pro)s(cesses)f(started)h(b)m(y)g(the)630 1076 | |
| 8206 | y(shell,)i(on)f(systems)g(that)h(allo)m(w)h(suc)m(h)e(con)m(trol.)41 | |
| 8207 | b(If)28 b(an)g(option)h(is)f(giv)m(en,)i(it)e(is)h(in)m(terpreted)630 | |
| 8208 | 1185 y(as)i(follo)m(ws:)630 1342 y Fs(-S)384 b Ft(Change)30 | |
| 8209 | b(and)g(rep)s(ort)g(the)g(soft)h(limit)g(asso)s(ciated)h(with)e(a)h | |
| 8210 | (resource.)630 1500 y Fs(-H)384 b Ft(Change)30 b(and)g(rep)s(ort)g(the) | |
| 8211 | g(hard)g(limit)h(asso)s(ciated)h(with)e(a)h(resource.)630 | |
| 8212 | 1657 y Fs(-a)384 b Ft(All)31 b(curren)m(t)f(limits)h(are)g(rep)s | |
| 8213 | (orted.)630 1814 y Fs(-c)384 b Ft(The)30 b(maxim)m(um)g(size)h(of)g | |
| 8214 | (core)g(\014les)f(created.)630 1971 y Fs(-d)384 b Ft(The)30 | |
| 8215 | b(maxim)m(um)g(size)h(of)g(a)g(pro)s(cess's)f(data)h(segmen)m(t.)630 | |
| 8216 | 2129 y Fs(-e)384 b Ft(The)30 b(maxim)m(um)g(sc)m(heduling)h(priorit)m | |
| 8217 | (y)f(\()p Fs(")p Ft(nice)p Fs(")p Ft(\).)630 2286 y Fs(-f)384 | |
| 8218 | b Ft(The)30 b(maxim)m(um)g(size)h(of)g(\014les)f(created)i(b)m(y)e(the) | |
| 8219 | g(shell.)630 2443 y Fs(-i)384 b Ft(The)30 b(maxim)m(um)g(n)m(um)m(b)s | |
| 8220 | (er)f(of)i(p)s(ending)e(signals.)630 2600 y Fs(-l)384 | |
| 8221 | b Ft(The)30 b(maxim)m(um)g(size)h(that)g(ma)m(y)g(b)s(e)f(lo)s(c)m(k)m | |
| 8222 | (ed)i(in)m(to)f(memory)-8 b(.)630 2757 y Fs(-m)384 b | |
| 8223 | Ft(The)30 b(maxim)m(um)g(residen)m(t)h(set)g(size.)630 | |
| 8224 | 2915 y Fs(-n)384 b Ft(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(op)s | |
| 8225 | (en)e(\014le)i(descriptors.)630 3072 y Fs(-p)384 b Ft(The)30 | |
| 8226 | b(pip)s(e)f(bu\013er)h(size.)630 3229 y Fs(-q)384 b Ft(The)30 | |
| 8227 | b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i(b)m(ytes)g(in)f(POSIX)f(message)j | |
| 8228 | (queues.)630 3386 y Fs(-r)384 b Ft(The)30 b(maxim)m(um)g(real-time)i | |
| 8229 | (sc)m(heduling)f(priorit)m(y)-8 b(.)630 3544 y Fs(-s)384 | |
| 8230 | b Ft(The)30 b(maxim)m(um)g(stac)m(k)i(size.)630 3701 | |
| 8231 | y Fs(-t)384 b Ft(The)30 b(maxim)m(um)g(amoun)m(t)h(of)f(cpu)g(time)h | |
| 8232 | (in)f(seconds.)630 3858 y Fs(-u)384 b Ft(The)30 b(maxim)m(um)g(n)m(um)m | |
| 8233 | (b)s(er)f(of)i(pro)s(cesses)f(a)m(v)-5 b(ailable)33 b(to)e(a)f(single)i | |
| 8234 | (user.)630 4015 y Fs(-v)384 b Ft(The)29 b(maxim)m(um)h(amoun)m(t)g(of)g | |
| 8235 | (virtual)g(memory)g(a)m(v)-5 b(ailable)32 b(to)e(the)g(pro)s(cess.)630 | |
| 8236 | 4173 y Fs(-x)384 b Ft(The)30 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i | |
| 8237 | (\014le)f(lo)s(c)m(ks.)630 4330 y(If)j Fq(limit)j Ft(is)e(giv)m(en,)h | |
| 8238 | (it)f(is)g(the)g(new)f(v)-5 b(alue)34 b(of)f(the)h(sp)s(eci\014ed)f | |
| 8239 | (resource;)i(the)f(sp)s(ecial)g Fq(limit)630 4439 y Ft(v)-5 | |
| 8240 | b(alues)27 b Fs(hard)p Ft(,)g Fs(soft)p Ft(,)g(and)g | |
| 8241 | Fs(unlimited)d Ft(stand)j(for)g(the)g(curren)m(t)g(hard)f(limit,)j(the) | |
| 8242 | e(curren)m(t)630 4549 y(soft)35 b(limit,)i(and)e(no)f(limit,)j(resp)s | |
| 8243 | (ectiv)m(ely)-8 b(.)56 b(Otherwise,)36 b(the)f(curren)m(t)g(v)-5 | |
| 8244 | b(alue)35 b(of)g(the)h(soft)630 4659 y(limit)41 b(for)f(the)h(sp)s | |
| 8245 | (eci\014ed)f(resource)h(is)f(prin)m(ted,)j(unless)d(the)g(`)p | |
| 8246 | Fs(-H)p Ft(')h(option)f(is)h(supplied.)630 4768 y(When)29 | |
| 8907fb06 CR |
8247 | b(setting)h(new)e(limits,)i(if)f(neither)g(`)p Fs(-H)p |
| 8248 | Ft(')f(nor)h(`)p Fs(-S)p Ft(')f(is)h(supplied,)g(b)s(oth)f(the)h(hard)f | |
| 28157acd | 8249 | (and)630 4878 y(soft)37 b(limits)g(are)g(set.)60 b(If)36 |
| 8907fb06 | 8250 | b(no)g(option)h(is)g(giv)m(en,)i(then)d(`)p Fs(-f)p Ft(')h(is)f |
| 28157acd | 8251 | (assumed.)59 b(V)-8 b(alues)37 b(are)g(in)630 4987 y(1024-b)m(yte)27 |
| 37c41ab1 CR |
8252 | b(incremen)m(ts,)g(except)e(for)f(`)p Fs(-t)p Ft(',)i(whic)m(h)e(is)h |
| 8253 | (in)f(seconds,)i(`)p Fs(-p)p Ft(',)g(whic)m(h)e(is)g(in)h(units)630 | |
| 28157acd | 8254 | 5097 y(of)31 b(512-b)m(yte)h(blo)s(c)m(ks,)f(and)f(`)p |
| 37c41ab1 | 8255 | Fs(-n)p Ft(')g(and)g(`)p Fs(-u)p Ft(',)h(whic)m(h)f(are)g(unscaled)h(v) |
| 28157acd | 8256 | -5 b(alues.)630 5230 y(The)34 b(return)g(status)h(is)f(zero)i(unless)e |
| 37c41ab1 | 8257 | (an)g(in)m(v)-5 b(alid)36 b(option)f(or)f(argumen)m(t)i(is)e(supplied,) |
| 28157acd CR |
8258 | h(or)630 5340 y(an)30 b(error)g(o)s(ccurs)g(while)h(setting)g(a)g(new)f |
| 8259 | (limit.)p eop end | |
| 8260 | %%Page: 53 59 | |
| 8261 | TeXDict begin 53 58 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 8262 | b(Shell)30 b(Builtin)h(Commands)2069 b(53)150 299 y Fs(unalias)870 | |
| 8263 | 436 y(unalias)46 b([-a])g([)p Fj(name)57 b Fs(...)47 | |
| 8264 | b(])630 573 y Ft(Remo)m(v)m(e)39 b(eac)m(h)f Fq(name)k | |
| 8265 | Ft(from)36 b(the)h(list)h(of)f(aliases.)61 b(If)36 b(`)p | |
| 8266 | Fs(-a)p Ft(')h(is)g(supplied,)h(all)f(aliases)i(are)630 | |
| 8267 | 682 y(remo)m(v)m(ed.)j(Aliases)31 b(are)g(describ)s(ed)e(in)h(Section)i | |
| 8268 | (6.6)f([Aliases],)h(page)f(75.)150 952 y Fr(4.3)68 b(The)45 | |
| 8269 | b(Set)g(Builtin)275 1201 y Ft(This)29 b(builtin)h(is)g(so)h | |
| 8270 | (complicated)h(that)f(it)g(deserv)m(es)g(its)g(o)m(wn)f(section.)150 | |
| 8271 | 1368 y Fs(set)870 1505 y(set)47 b([--abefhkmnptuvxBCHP])42 | |
| 8272 | b([-o)47 b Fj(option)11 b Fs(])45 b([)p Fj(argument)56 | |
| 8273 | b Fs(...)o(])630 1642 y Ft(If)22 b(no)h(options)g(or)g(argumen)m(ts)g | |
| 54cdd75a | 8274 | (are)g(supplied,)g Fs(set)f Ft(displa)m(ys)g(the)h(names)g(and)f(v)-5 |
| 28157acd | 8275 | b(alues)23 b(of)g(all)630 1751 y(shell)j(v)-5 b(ariables)27 |
| 54cdd75a | 8276 | b(and)e(functions,)h(sorted)g(according)h(to)g(the)f(curren)m(t)f(lo)s |
| 28157acd | 8277 | (cale,)k(in)c(a)i(format)630 1861 y(that)i(ma)m(y)h(b)s(e)e(reused)g |
| 54cdd75a | 8278 | (as)h(input)f(for)h(setting)h(or)e(resetting)i(the)f(curren)m(tly-set)h |
| 28157acd | 8279 | (v)-5 b(ariables.)630 1971 y(Read-only)37 b(v)-5 b(ariables)37 |
| 54cdd75a | 8280 | b(cannot)h(b)s(e)e(reset.)59 b(In)36 b Fl(posix)g Ft(mo)s(de,)i(only)f |
| 28157acd CR |
8281 | (shell)f(v)-5 b(ariables)38 b(are)630 2080 y(listed.)630 |
| 8282 | 2217 y(When)29 b(options)g(are)g(supplied,)f(they)h(set)h(or)f(unset)f | |
| 54cdd75a | 8283 | (shell)h(attributes.)41 b(Options,)29 b(if)g(sp)s(ec-)630 |
| 28157acd CR |
8284 | 2327 y(i\014ed,)h(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
| 8285 | 2491 y Fs(-a)384 b Ft(Mark)32 b(v)-5 b(ariables)33 b(and)e(function)h | |
| 54cdd75a | 8286 | (whic)m(h)g(are)g(mo)s(di\014ed)f(or)h(created)h(for)f(ex-)1110 |
| 28157acd CR |
8287 | 2601 y(p)s(ort)e(to)h(the)f(en)m(vironmen)m(t)h(of)g(subsequen)m(t)f |
| 8288 | (commands.)630 2765 y Fs(-b)384 b Ft(Cause)44 b(the)h(status)g(of)f | |
| 1c72c0cd | 8289 | (terminated)h(bac)m(kground)g(jobs)f(to)h(b)s(e)f(rep)s(orted)1110 |
| 28157acd CR |
8290 | 2875 y(immediately)-8 b(,)30 b(rather)d(than)f(b)s(efore)h(prin)m(ting) |
| 8291 | g(the)g(next)g(primary)g(prompt.)630 3039 y Fs(-e)384 | |
| 1c72c0cd | 8292 | b Ft(Exit)37 b(immediately)h(if)e(a)h(simple)f(command)g(\(see)i |
| 28157acd | 8293 | (Section)f(3.2.1)h([Simple)1110 3148 y(Commands],)31 |
| 1c72c0cd | 8294 | b(page)i(8\))f(exits)g(with)g(a)g(non-zero)g(status,)g(unless)f(the)h |
| 28157acd CR |
8295 | (com-)1110 3258 y(mand)f(that)h(fails)h(is)f(part)f(of)h(the)g(command) |
| 8296 | g(list)g(immediately)h(follo)m(wing)1110 3368 y(a)41 | |
| 8297 | b Fs(while)d Ft(or)j Fs(until)e Ft(k)m(eyw)m(ord,)k(part)d(of)g(the)h | |
| 8298 | (test)g(in)f(an)g Fs(if)g Ft(statemen)m(t,)1110 3477 | |
| 8299 | y(part)33 b(of)h(a)g Fs(&&)f Ft(or)g Fs(||)g Ft(list,)i(or)e(if)h(the)f | |
| 8300 | (command's)h(return)e(status)i(is)f(b)s(eing)1110 3587 | |
| 8301 | y(in)m(v)m(erted)e(using)e Fs(!)p Ft(.)40 b(A)30 b(trap)f(on)h | |
| 8302 | Fs(ERR)p Ft(,)f(if)h(set,)g(is)g(executed)h(b)s(efore)e(the)h(shell) | |
| 8303 | 1110 3696 y(exits.)630 3861 y Fs(-f)384 b Ft(Disable)31 | |
| 8304 | b(\014le)g(name)f(generation)i(\(globbing\).)630 4025 | |
| 8305 | y Fs(-h)384 b Ft(Lo)s(cate)33 b(and)e(remem)m(b)s(er)h(\(hash\))g | |
| 8306 | (commands)f(as)h(they)g(are)g(lo)s(ok)m(ed)h(up)e(for)1110 | |
| 8307 | 4135 y(execution.)42 b(This)29 b(option)i(is)g(enabled)f(b)m(y)g | |
| 8308 | (default.)630 4299 y Fs(-k)384 b Ft(All)34 b(argumen)m(ts)g(in)f(the)h | |
| 8309 | (form)f(of)g(assignmen)m(t)h(statemen)m(ts)i(are)d(placed)h(in)1110 | |
| 8310 | 4409 y(the)k(en)m(vironmen)m(t)g(for)g(a)g(command,)h(not)f(just)f | |
| 8311 | (those)i(that)f(precede)g(the)1110 4518 y(command)30 | |
| 8312 | b(name.)630 4683 y Fs(-m)384 b Ft(Job)30 b(con)m(trol)i(is)e(enabled)h | |
| 8313 | (\(see)g(Chapter)f(7)g([Job)h(Con)m(trol],)g(page)g(85\).)630 | |
| 8314 | 4847 y Fs(-n)384 b Ft(Read)21 b(commands)f(but)g(do)h(not)g(execute)h | |
| 8315 | (them;)i(this)d(ma)m(y)g(b)s(e)f(used)g(to)h(c)m(hec)m(k)1110 | |
| 8316 | 4956 y(a)42 b(script)g(for)g(syn)m(tax)g(errors.)75 b(This)41 | |
| 8317 | b(option)h(is)g(ignored)g(b)m(y)g(in)m(teractiv)m(e)1110 | |
| 8318 | 5066 y(shells.)630 5230 y Fs(-o)30 b Fj(option-name)1110 | |
| 8319 | 5340 y Ft(Set)h(the)f(option)h(corresp)s(onding)e(to)i | |
| 8320 | Fq(option-name)5 b Ft(:)p eop end | |
| 8321 | %%Page: 54 60 | |
| 8322 | TeXDict begin 54 59 bop 150 -116 a Ft(54)2572 b(Bash)31 | |
| 8323 | b(Reference)g(Man)m(ual)1110 299 y Fs(allexport)1590 | |
| 8324 | 408 y Ft(Same)f(as)h Fs(-a)p Ft(.)1110 565 y Fs(braceexpand)1590 | |
| 8325 | 675 y Ft(Same)f(as)h Fs(-B)p Ft(.)1110 831 y Fs(emacs)240 | |
| 8907fb06 | 8326 | b Ft(Use)25 b(an)f Fs(emacs)p Ft(-st)m(yle)h(line)f(editing)h(in)m |
| 28157acd CR |
8327 | (terface)h(\(see)g(Chapter)e(8)1590 941 y([Command)30 |
| 8328 | b(Line)g(Editing],)h(page)g(89\).)1110 1097 y Fs(errexit)144 | |
| 8329 | b Ft(Same)30 b(as)h Fs(-e)p Ft(.)1110 1254 y Fs(errtrace)96 | |
| 8330 | b Ft(Same)30 b(as)h Fs(-E)p Ft(.)1110 1410 y Fs(functrace)1590 | |
| 8331 | 1520 y Ft(Same)f(as)h Fs(-T)p Ft(.)1110 1677 y Fs(hashall)144 | |
| 8332 | b Ft(Same)30 b(as)h Fs(-h)p Ft(.)1110 1833 y Fs(histexpand)1590 | |
| 8333 | 1943 y Ft(Same)f(as)h Fs(-H)p Ft(.)1110 2099 y Fs(history)144 | |
| 1c72c0cd | 8334 | b Ft(Enable)39 b(command)g(history)-8 b(,)42 b(as)d(describ)s(ed)f(in)h |
| 28157acd CR |
8335 | (Section)h(9.1)1590 2209 y([Bash)d(History)g(F)-8 b(acilities],)41 |
| 8336 | b(page)c(115.)60 b(This)36 b(option)h(is)f(on)1590 2318 | |
| 1c72c0cd | 8337 | y(b)m(y)30 b(default)h(in)f(in)m(teractiv)m(e)j(shells.)1110 |
| 28157acd CR |
8338 | 2475 y Fs(ignoreeof)1590 2585 y Ft(An)d(in)m(teractiv)m(e)j(shell)e |
| 8339 | (will)g(not)f(exit)h(up)s(on)e(reading)i(EOF.)1110 2741 | |
| 1c72c0cd | 8340 | y Fs(keyword)144 b Ft(Same)30 b(as)h Fs(-k)p Ft(.)1110 |
| 28157acd CR |
8341 | 2898 y Fs(monitor)144 b Ft(Same)30 b(as)h Fs(-m)p Ft(.)1110 |
| 8342 | 3054 y Fs(noclobber)1590 3164 y Ft(Same)f(as)h Fs(-C)p | |
| 8343 | Ft(.)1110 3320 y Fs(noexec)192 b Ft(Same)30 b(as)h Fs(-n)p | |
| 8344 | Ft(.)1110 3477 y Fs(noglob)192 b Ft(Same)30 b(as)h Fs(-f)p | |
| 8345 | Ft(.)1110 3634 y Fs(nolog)240 b Ft(Curren)m(tly)30 b(ignored.)1110 | |
| 8346 | 3790 y Fs(notify)192 b Ft(Same)30 b(as)h Fs(-b)p Ft(.)1110 | |
| 8347 | 3947 y Fs(nounset)144 b Ft(Same)30 b(as)h Fs(-u)p Ft(.)1110 | |
| 8348 | 4103 y Fs(onecmd)192 b Ft(Same)30 b(as)h Fs(-t)p Ft(.)1110 | |
| 8349 | 4260 y Fs(physical)96 b Ft(Same)30 b(as)h Fs(-P)p Ft(.)1110 | |
| 8350 | 4416 y Fs(pipefail)96 b Ft(If)44 b(set,)k(the)d(return)e(v)-5 | |
| 1c72c0cd | 8351 | b(alue)45 b(of)f(a)h(pip)s(eline)e(is)i(the)f(v)-5 b(alue)45 |
| 28157acd CR |
8352 | b(of)1590 4526 y(the)33 b(last)h(\(righ)m(tmost\))h(command)e(to)h |
| 8353 | (exit)g(with)f(a)g(non-zero)1590 4635 y(status,)28 b(or)f(zero)g(if)f | |
| 8354 | (all)i(commands)e(in)g(the)h(pip)s(eline)f(exit)i(suc-)1590 | |
| 8355 | 4745 y(cessfully)-8 b(.)41 b(This)30 b(option)h(is)f(disabled)g(b)m(y)h | |
| 8356 | (default.)1110 4902 y Fs(posix)240 b Ft(Change)30 b(the)g(b)s(eha)m | |
| ac18b312 | 8357 | (vior)h(of)f(Bash)g(where)g(the)g(default)h(op)s(era-)1590 |
| 28157acd CR |
8358 | 5011 y(tion)25 b(di\013ers)f(from)g(the)h Fl(posix)f |
| 8359 | Ft(standard)f(to)i(matc)m(h)h(the)f(stan-)1590 5121 y(dard)32 | |
| 8360 | b(\(see)i(Section)g(6.11)h([Bash)e(POSIX)f(Mo)s(de],)j(page)e(80\).) | |
| 8361 | 1590 5230 y(This)k(is)g(in)m(tended)g(to)h(mak)m(e)g(Bash)g(b)s(eha)m | |
| 8362 | (v)m(e)g(as)g(a)f(strict)h(su-)1590 5340 y(p)s(erset)30 | |
| 8363 | b(of)h(that)f(standard.)p eop end | |
| 8364 | %%Page: 55 61 | |
| 8365 | TeXDict begin 55 60 bop 150 -116 a Ft(Chapter)30 b(4:)41 | |
| 8366 | b(Shell)30 b(Builtin)h(Commands)2069 b(55)1110 299 y | |
| 8367 | Fs(privileged)1590 408 y Ft(Same)30 b(as)h Fs(-p)p Ft(.)1110 | |
| 8368 | 559 y Fs(verbose)144 b Ft(Same)30 b(as)h Fs(-v)p Ft(.)1110 | |
| 8369 | 709 y Fs(vi)384 b Ft(Use)31 b(a)g Fs(vi)p Ft(-st)m(yle)g(line)g | |
| 8370 | (editing)g(in)m(terface.)1110 859 y Fs(xtrace)192 b Ft(Same)30 | |
| 8371 | b(as)h Fs(-x)p Ft(.)630 1009 y Fs(-p)384 b Ft(T)-8 b(urn)33 | |
| 9d6e5e30 | 8372 | b(on)h(privileged)h(mo)s(de.)51 b(In)34 b(this)g(mo)s(de,)h(the)f |
| 28157acd | 8373 | Fs($BASH_ENV)e Ft(and)h Fs($ENV)1110 1119 y Ft(\014les)k(are)h(not)g |
| 9d6e5e30 | 8374 | (pro)s(cessed,)h(shell)f(functions)f(are)h(not)f(inherited)h(from)f |
| 28157acd | 8375 | (the)1110 1228 y(en)m(vironmen)m(t,)f(and)d(the)h Fs(SHELLOPTS)e |
| 9d6e5e30 | 8376 | Ft(v)-5 b(ariable,)35 b(if)f(it)h(app)s(ears)e(in)h(the)g(en-)1110 |
| 28157acd CR |
8377 | 1338 y(vironmen)m(t,)d(is)f(ignored.)41 b(If)29 b(the)i(shell)f(is)g |
| 8378 | (started)h(with)f(the)g(e\013ectiv)m(e)j(user)1110 1448 | |
| 9d6e5e30 | 8379 | y(\(group\))d(id)g(not)g(equal)h(to)f(the)g(real)h(user)e(\(group\))i |
| 28157acd | 8380 | (id,)f(and)f(the)h Fs(-p)f Ft(option)1110 1557 y(is)40 |
| 9d6e5e30 | 8381 | b(not)g(supplied,)i(these)e(actions)i(are)e(tak)m(en)h(and)f(the)g |
| 28157acd | 8382 | (e\013ectiv)m(e)j(user)c(id)1110 1667 y(is)d(set)h(to)h(the)e(real)h |
| 9d6e5e30 | 8383 | (user)f(id.)58 b(If)36 b(the)h Fs(-p)f Ft(option)g(is)h(supplied)e(at)i |
| 28157acd | 8384 | (startup,)1110 1776 y(the)29 b(e\013ectiv)m(e)j(user)d(id)g(is)g(not)h |
| 9d6e5e30 | 8385 | (reset.)40 b(T)-8 b(urning)29 b(this)g(option)g(o\013)h(causes)g(the) |
| 28157acd | 8386 | 1110 1886 y(e\013ectiv)m(e)e(user)d(and)g(group)g(ids)h(to)g(b)s(e)f |
| 9d6e5e30 | 8387 | (set)h(to)h(the)f(real)g(user)f(and)g(group)g(ids.)630 |
| 28157acd CR |
8388 | 2036 y Fs(-t)384 b Ft(Exit)31 b(after)g(reading)f(and)g(executing)h |
| 8389 | (one)g(command.)630 2186 y Fs(-u)384 b Ft(T)-8 b(reat)38 | |
| 1c72c0cd | 8390 | b(unset)e(v)-5 b(ariables)37 b(as)h(an)e(error)h(when)e(p)s(erforming)h |
| 28157acd | 8391 | (parameter)h(ex-)1110 2296 y(pansion.)58 b(An)36 b(error)f(message)j |
| 1c72c0cd | 8392 | (will)e(b)s(e)g(written)g(to)h(the)g(standard)e(error,)1110 |
| 28157acd CR |
8393 | 2405 y(and)30 b(a)h(non-in)m(teractiv)m(e)i(shell)d(will)h(exit.)630 |
| 8394 | 2556 y Fs(-v)384 b Ft(Prin)m(t)30 b(shell)h(input)e(lines)i(as)g(they)f | |
| 8395 | (are)h(read.)630 2706 y Fs(-x)384 b Ft(Prin)m(t)21 b(a)h(trace)h(of)f | |
| ac18b312 | 8396 | (simple)f(commands,)i Fs(for)e Ft(commands,)i Fs(case)d |
| 28157acd | 8397 | Ft(commands,)1110 2815 y Fs(select)29 b Ft(commands,)j(and)e |
| ac18b312 | 8398 | (arithmetic)j Fs(for)d Ft(commands)h(and)f(their)i(argu-)1110 |
| 28157acd CR |
8399 | 2925 y(men)m(ts)h(or)f(asso)s(ciated)i(w)m(ord)e(lists)h(after)g(they)f |
| 8400 | (are)h(expanded)f(and)f(b)s(efore)1110 3035 y(they)i(are)g(executed.)49 | |
| ac18b312 | 8401 | b(The)32 b(v)-5 b(alue)33 b(of)g(the)g Fs(PS4)f Ft(v)-5 |
| 28157acd | 8402 | b(ariable)34 b(is)f(expanded)f(and)1110 3144 y(the)24 |
| ac18b312 | 8403 | b(resultan)m(t)h(v)-5 b(alue)24 b(is)g(prin)m(ted)g(b)s(efore)f(the)h |
| 28157acd CR |
8404 | (command)g(and)f(its)i(expanded)1110 3254 y(argumen)m(ts.)630 |
| 8405 | 3404 y Fs(-B)384 b Ft(The)41 b(shell)g(will)g(p)s(erform)f(brace)h | |
| 8406 | (expansion)g(\(see)h(Section)g(3.5.1)g([Brace)1110 3513 | |
| ac18b312 | 8407 | y(Expansion],)30 b(page)h(17\).)42 b(This)30 b(option)h(is)f(on)g(b)m |
| 28157acd | 8408 | (y)h(default.)630 3664 y Fs(-C)384 b Ft(Prev)m(en)m(t)25 |
| 37c41ab1 CR |
8409 | b(output)e(redirection)h(using)f(`)p Fs(>)p Ft(',)i(`)p |
| 8410 | Fs(>&)p Ft(',)g(and)e(`)p Fs(<>)p Ft(')g(from)h(o)m(v)m(erwriting)1110 | |
| 28157acd | 8411 | 3773 y(existing)31 b(\014les.)630 3923 y Fs(-E)384 b |
| 9d2b70f0 | 8412 | Ft(If)39 b(set,)j(an)m(y)e(trap)f(on)g Fs(ERR)g Ft(is)g(inherited)g(b)m |
| 28157acd | 8413 | (y)g(shell)h(functions,)h(command)1110 4033 y(substitutions,)35 |
| 54cdd75a | 8414 | b(and)e(commands)g(executed)i(in)f(a)g(subshell)f(en)m(vironmen)m(t.) |
| 28157acd CR |
8415 | 1110 4143 y(The)d Fs(ERR)f Ft(trap)i(is)f(normally)h(not)f(inherited)g |
| 8416 | (in)g(suc)m(h)g(cases.)630 4293 y Fs(-H)384 b Ft(Enable)38 | |
| 54cdd75a | 8417 | b(`)p Fs(!)p Ft(')h(st)m(yle)h(history)e(substitution)g(\(see)h |
| 28157acd CR |
8418 | (Section)h(9.3)f([History)g(In-)1110 4402 y(teraction],)g(page)d |
| 8419 | (117\).)57 b(This)34 b(option)i(is)f(on)g(b)m(y)h(default)f(for)g(in)m | |
| 8420 | (teractiv)m(e)1110 4512 y(shells.)630 4662 y Fs(-P)384 | |
| 37c41ab1 | 8421 | b Ft(If)43 b(set,)k(do)c(not)g(follo)m(w)h(sym)m(b)s(olic)g(links)e |
| 28157acd | 8422 | (when)g(p)s(erforming)g(commands)1110 4772 y(suc)m(h)29 |
| 37c41ab1 | 8423 | b(as)h Fs(cd)f Ft(whic)m(h)g(c)m(hange)h(the)g(curren)m(t)f(directory) |
| 28157acd CR |
8424 | -8 b(.)42 b(The)28 b(ph)m(ysical)j(direc-)1110 4881 y(tory)j(is)g(used) |
| 8425 | f(instead.)52 b(By)34 b(default,)h(Bash)f(follo)m(ws)h(the)f(logical)i | |
| 8426 | (c)m(hain)f(of)1110 4991 y(directories)j(when)d(p)s(erforming)h | |
| 37c41ab1 | 8427 | (commands)g(whic)m(h)g(c)m(hange)i(the)f(curren)m(t)1110 |
| 28157acd | 8428 | 5101 y(directory)-8 b(.)1110 5230 y(F)g(or)31 b(example,)g(if)f(`)p |
| 37c41ab1 | 8429 | Fs(/usr/sys)p Ft(')e(is)i(a)g(sym)m(b)s(olic)h(link)f(to)g(`)p |
| 28157acd CR |
8430 | Fs(/usr/local/sys)p Ft(')1110 5340 y(then:)p eop end |
| 8431 | %%Page: 56 62 | |
| 8432 | TeXDict begin 56 61 bop 150 -116 a Ft(56)2572 b(Bash)31 | |
| 8433 | b(Reference)g(Man)m(ual)1350 299 y Fs($)47 b(cd)h(/usr/sys;)d(echo)i | |
| 8434 | ($PWD)1350 408 y(/usr/sys)1350 518 y($)g(cd)h(..;)f(pwd)1350 | |
| 8435 | 628 y(/usr)1110 762 y Ft(If)30 b Fs(set)f(-P)h Ft(is)h(on,)f(then:)1350 | |
| 8436 | 896 y Fs($)47 b(cd)h(/usr/sys;)d(echo)i($PWD)1350 1005 | |
| 8437 | y(/usr/local/sys)1350 1115 y($)g(cd)h(..;)f(pwd)1350 | |
| 8438 | 1225 y(/usr/local)630 1383 y(-T)384 b Ft(If)34 b(set,)j(an)m(y)e(trap)g | |
| 8439 | (on)g Fs(DEBUG)e Ft(and)i Fs(RETURN)e Ft(are)i(inherited)g(b)m(y)f | |
| 8440 | (shell)i(func-)1110 1493 y(tions,)k(command)d(substitutions,)h(and)f | |
| 8441 | (commands)g(executed)h(in)f(a)h(sub-)1110 1602 y(shell)33 | |
| 8442 | b(en)m(vironmen)m(t.)49 b(The)32 b Fs(DEBUG)g Ft(and)g | |
| 8443 | Fs(RETURN)f Ft(traps)h(are)i(normally)f(not)1110 1712 | |
| 8444 | y(inherited)d(in)g(suc)m(h)g(cases.)630 1871 y Fs(--)384 | |
| 8445 | b Ft(If)31 b(no)h(argumen)m(ts)f(follo)m(w)i(this)f(option,)g(then)f | |
| 8446 | (the)h(p)s(ositional)h(parameters)1110 1980 y(are)h(unset.)49 | |
| 8447 | b(Otherwise,)34 b(the)g(p)s(ositional)g(parameters)g(are)g(set)g(to)g | |
| 8448 | (the)g Fq(ar-)1110 2090 y(gumen)m(ts)p Ft(,)d(ev)m(en)g(if)f(some)h(of) | |
| 8449 | g(them)f(b)s(egin)g(with)g(a)h(`)p Fs(-)p Ft('.)630 2249 | |
| 8450 | y Fs(-)432 b Ft(Signal)45 b(the)g(end)f(of)h(options,)k(cause)c(all)h | |
| 8451 | (remaining)e Fq(argumen)m(ts)49 b Ft(to)d(b)s(e)1110 | |
| 8452 | 2358 y(assigned)38 b(to)h(the)f(p)s(ositional)h(parameters.)65 | |
| 8453 | b(The)37 b(`)p Fs(-x)p Ft(')h(and)g(`)p Fs(-v)p Ft(')g(options)1110 | |
| 8454 | 2468 y(are)25 b(turned)e(o\013.)40 b(If)24 b(there)h(are)g(no)f | |
| 1c72c0cd | 8455 | (argumen)m(ts,)i(the)f(p)s(ositional)h(parameters)1110 |
| 28157acd | 8456 | 2577 y(remain)k(unc)m(hanged.)630 2736 y(Using)d(`)p |
| 1c72c0cd CR |
8457 | Fs(+)p Ft(')h(rather)f(than)g(`)p Fs(-)p Ft(')g(causes)h(these)f |
| 8458 | (options)h(to)g(b)s(e)e(turned)g(o\013.)40 b(The)27 b(options)h(can)630 | |
| 28157acd | 8459 | 2846 y(also)36 b(b)s(e)f(used)f(up)s(on)g(in)m(v)m(o)s(cation)j(of)e |
| 37c41ab1 | 8460 | (the)g(shell.)56 b(The)34 b(curren)m(t)h(set)h(of)f(options)h(ma)m(y)g |
| 28157acd | 8461 | (b)s(e)630 2955 y(found)29 b(in)h Fs($-)p Ft(.)630 3089 |
| 37c41ab1 | 8462 | y(The)43 b(remaining)h(N)f Fq(argumen)m(ts)48 b Ft(are)c(p)s(ositional) |
| 28157acd | 8463 | g(parameters)g(and)f(are)h(assigned,)j(in)630 3199 y(order,)30 |
| 5e13499c | 8464 | b(to)h Fs($1)p Ft(,)f Fs($2)p Ft(,)36 b(.)22 b(.)g(.)42 |
| 37c41ab1 | 8465 | b Fs($N)p Ft(.)e(The)30 b(sp)s(ecial)h(parameter)g Fs(#)f |
| 28157acd | 8466 | Ft(is)g(set)h(to)g(N.)630 3333 y(The)f(return)f(status)i(is)f(alw)m(a)m |
| 37c41ab1 | 8467 | (ys)i(zero)f(unless)f(an)g(in)m(v)-5 b(alid)31 b(option)g(is)f |
| 28157acd CR |
8468 | (supplied.)150 3589 y Fr(4.4)68 b(Sp)t(ecial)45 b(Builtins)275 |
| 8469 | 3833 y Ft(F)-8 b(or)40 b(historical)i(reasons,)g(the)f | |
| 8470 | Fl(posix)e Ft(standard)g(has)h(classi\014ed)g(sev)m(eral)i(builtin)d | |
| 8471 | (commands)h(as)150 3943 y Fm(sp)-5 b(e)g(cial)p Ft(.)84 | |
| 8472 | b(When)44 b(Bash)g(is)g(executing)i(in)d Fl(posix)h Ft(mo)s(de,)j(the)e | |
| 8473 | (sp)s(ecial)f(builtins)g(di\013er)g(from)g(other)150 | |
| 8474 | 4052 y(builtin)30 b(commands)g(in)g(three)h(resp)s(ects:)199 | |
| 8475 | 4186 y(1.)61 b(Sp)s(ecial)31 b(builtins)e(are)i(found)e(b)s(efore)h | |
| 8476 | (shell)h(functions)f(during)f(command)h(lo)s(okup.)199 | |
| 8477 | 4320 y(2.)61 b(If)30 b(a)h(sp)s(ecial)g(builtin)f(returns)f(an)h(error) | |
| 54cdd75a | 8478 | g(status,)h(a)g(non-in)m(teractiv)m(e)i(shell)d(exits.)199 |
| 28157acd | 8479 | 4455 y(3.)61 b(Assignmen)m(t)30 b(statemen)m(ts)h(preceding)f(the)f |
| 54cdd75a | 8480 | (command)g(sta)m(y)i(in)e(e\013ect)i(in)e(the)h(shell)f(en)m(vironmen)m |
| 28157acd CR |
8481 | (t)330 4564 y(after)i(the)f(command)h(completes.)275 |
| 8482 | 4723 y(When)36 b(Bash)g(is)h(not)f(executing)i(in)e Fl(posix)f | |
| 54cdd75a | 8483 | Ft(mo)s(de,)j(these)f(builtins)f(b)s(eha)m(v)m(e)h(no)f(di\013eren)m |
| 28157acd | 8484 | (tly)h(than)150 4832 y(the)31 b(rest)f(of)h(the)f(Bash)h(builtin)e |
| 54cdd75a | 8485 | (commands.)41 b(The)30 b(Bash)g Fl(posix)g Ft(mo)s(de)g(is)g(describ)s |
| 28157acd CR |
8486 | (ed)f(in)h(Section)h(6.11)150 4942 y([Bash)g(POSIX)e(Mo)s(de],)i(page)g |
| 8487 | (80.)275 5076 y(These)f(are)g(the)h Fl(posix)f Ft(sp)s(ecial)h | |
| 8488 | (builtins:)390 5210 y Fs(break)46 b(:)i(.)f(continue)f(eval)g(exec)h | |
| 8489 | (exit)g(export)f(readonly)f(return)h(set)390 5320 y(shift)g(trap)h | |
| 54cdd75a | 8490 | (unset)p eop end |
| 28157acd CR |
8491 | %%Page: 57 63 |
| 8492 | TeXDict begin 57 62 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
| 8493 | b(Shell)30 b(V)-8 b(ariables)2459 b(57)150 299 y Fo(5)80 | |
| 37c41ab1 CR |
8494 | b(Shell)53 b(V)-13 b(ariables)275 525 y Ft(This)36 b(c)m(hapter)i |
| 8495 | (describ)s(es)e(the)h(shell)g(v)-5 b(ariables)38 b(that)g(Bash)f(uses.) | |
| 8496 | 61 b(Bash)37 b(automatically)j(assigns)150 635 y(default)31 | |
| 8497 | b(v)-5 b(alues)30 b(to)h(a)g(n)m(um)m(b)s(er)e(of)i(v)-5 | |
| 5e13499c | 8498 | b(ariables.)150 887 y Fr(5.1)68 b(Bourne)45 b(Shell)g(V)-11 |
| 37c41ab1 CR |
8499 | b(ariables)275 1130 y Ft(Bash)36 b(uses)g(certain)h(shell)f(v)-5 |
| 8500 | b(ariables)37 b(in)f(the)h(same)g(w)m(a)m(y)g(as)f(the)h(Bourne)f | |
| 8501 | (shell.)59 b(In)35 b(some)i(cases,)150 1240 y(Bash)31 | |
| 8502 | b(assigns)f(a)h(default)f(v)-5 b(alue)31 b(to)g(the)g(v)-5 | |
| 8503 | b(ariable.)150 1396 y Fs(CDPATH)192 b Ft(A)39 b(colon-separated)i(list) | |
| 8504 | e(of)g(directories)h(used)f(as)g(a)g(searc)m(h)h(path)e(for)h(the)g | |
| 5e13499c | 8505 | Fs(cd)f Ft(builtin)630 1505 y(command.)150 1662 y Fs(HOME)288 |
| 37c41ab1 CR |
8506 | b Ft(The)23 b(curren)m(t)h(user's)f(home)g(directory;)k(the)d(default)g |
| 8507 | (for)f(the)h Fs(cd)f Ft(builtin)g(command.)38 b(The)630 | |
| 8508 | 1771 y(v)-5 b(alue)37 b(of)f(this)g(v)-5 b(ariable)37 | |
| 8509 | b(is)g(also)g(used)e(b)m(y)h(tilde)h(expansion)f(\(see)i(Section)f | |
| 8510 | (3.5.2)h([Tilde)630 1881 y(Expansion],)30 b(page)h(18\).)150 | |
| 8511 | 2037 y Fs(IFS)336 b Ft(A)25 b(list)i(of)e(c)m(haracters)i(that)f | |
| 8512 | (separate)g(\014elds;)h(used)e(when)f(the)i(shell)f(splits)h(w)m(ords)e | |
| 5e13499c | 8513 | (as)i(part)630 2147 y(of)31 b(expansion.)150 2303 y Fs(MAIL)288 |
| 37c41ab1 CR |
8514 | b Ft(If)26 b(this)f(parameter)i(is)f(set)g(to)h(a)g(\014lename)f(and)f |
| 8515 | (the)h Fs(MAILPATH)e Ft(v)-5 b(ariable)27 b(is)f(not)g(set,)i(Bash)630 | |
| 8516 | 2413 y(informs)i(the)g(user)g(of)g(the)h(arriv)-5 b(al)31 | |
| 8517 | b(of)f(mail)h(in)f(the)h(sp)s(eci\014ed)f(\014le.)150 | |
| 8518 | 2569 y Fs(MAILPATH)96 b Ft(A)33 b(colon-separated)i(list)f(of)f | |
| 8519 | (\014lenames)h(whic)m(h)f(the)g(shell)g(p)s(erio)s(dically)h(c)m(hec)m | |
| 8520 | (ks)g(for)f(new)630 2678 y(mail.)60 b(Eac)m(h)37 b(list)g(en)m(try)g | |
| 8521 | (can)g(sp)s(ecify)f(the)h(message)h(that)f(is)g(prin)m(ted)f(when)f | |
| 8522 | (new)h(mail)630 2788 y(arriv)m(es)29 b(in)g(the)g(mail)g(\014le)g(b)m | |
| 8523 | (y)g(separating)g(the)g(\014le)g(name)g(from)f(the)h(message)h(with)e | |
| 8524 | (a)i(`)p Fs(?)p Ft('.)630 2898 y(When)i(used)f(in)h(the)g(text)i(of)e | |
| 5e13499c | 8525 | (the)g(message,)i Fs($_)e Ft(expands)f(to)i(the)f(name)g(of)h(the)f |
| 37c41ab1 CR |
8526 | (curren)m(t)630 3007 y(mail)f(\014le.)150 3163 y Fs(OPTARG)192 |
| 8527 | b Ft(The)30 b(v)-5 b(alue)31 b(of)f(the)h(last)g(option)g(argumen)m(t)g | |
| 5e13499c | 8528 | (pro)s(cessed)f(b)m(y)g(the)g Fs(getopts)f Ft(builtin.)150 |
| 37c41ab1 CR |
8529 | 3320 y Fs(OPTIND)192 b Ft(The)30 b(index)g(of)g(the)h(last)g(option)g |
| 8530 | (argumen)m(t)g(pro)s(cessed)f(b)m(y)g(the)g Fs(getopts)f | |
| 8531 | Ft(builtin.)150 3476 y Fs(PATH)288 b Ft(A)32 b(colon-separated)i(list)f | |
| 8532 | (of)f(directories)h(in)e(whic)m(h)h(the)g(shell)g(lo)s(oks)h(for)f | |
| 8533 | (commands.)45 b(A)630 3586 y(zero-length)e(\(n)m(ull\))g(directory)f | |
| 8534 | (name)g(in)g(the)g(v)-5 b(alue)42 b(of)g Fs(PATH)f Ft(indicates)i(the)f | |
| 8535 | (curren)m(t)630 3695 y(directory)-8 b(.)49 b(A)33 b(n)m(ull)f | |
| 8536 | (directory)i(name)e(ma)m(y)i(app)s(ear)e(as)h(t)m(w)m(o)h(adjacen)m(t)g | |
| 8537 | (colons,)g(or)f(as)g(an)630 3805 y(initial)f(or)e(trailing)h(colon.)150 | |
| 8538 | 3961 y Fs(PS1)336 b Ft(The)35 b(primary)f(prompt)h(string.)55 | |
| 8539 | b(The)35 b(default)h(v)-5 b(alue)35 b(is)h(`)p Fs(\\s-\\v\\$)28 | |
| 8540 | b Ft('.)56 b(See)36 b(Section)g(6.9)630 4071 y([Prin)m(ting)28 | |
| 28157acd | 8541 | b(a)g(Prompt],)g(page)h(79,)g(for)e(the)h(complete)h(list)g(of)e(escap) |
| 5e13499c | 8542 | s(e)h(sequences)g(that)h(are)630 4180 y(expanded)h(b)s(efore)g |
| 37c41ab1 CR |
8543 | Fs(PS1)f Ft(is)h(displa)m(y)m(ed.)150 4336 y Fs(PS2)336 |
| 8544 | b Ft(The)30 b(secondary)g(prompt)g(string.)41 b(The)29 | |
| 8545 | b(default)i(v)-5 b(alue)31 b(is)f(`)p Fs(>)g Ft('.)150 | |
| 5e13499c | 8546 | 4589 y Fr(5.2)68 b(Bash)45 b(V)-11 b(ariables)275 4832 |
| 37c41ab1 CR |
8547 | y Ft(These)36 b(v)-5 b(ariables)38 b(are)g(set)f(or)h(used)e(b)m(y)h |
| 8548 | (Bash,)i(but)d(other)i(shells)f(do)g(not)g(normally)h(treat)g(them)150 | |
| 5e13499c | 8549 | 4941 y(sp)s(ecially)-8 b(.)275 5074 y(A)24 b(few)g(v)-5 |
| 37c41ab1 CR |
8550 | b(ariables)24 b(used)g(b)m(y)f(Bash)i(are)f(describ)s(ed)f(in)h |
| 8551 | (di\013eren)m(t)g(c)m(hapters:)38 b(v)-5 b(ariables)25 | |
| 8552 | b(for)f(con)m(trolling)150 5184 y(the)31 b(job)f(con)m(trol)h | |
| 8553 | (facilities)i(\(see)e(Section)g(7.3)h([Job)e(Con)m(trol)h(V)-8 | |
| 28157acd | 8554 | b(ariables],)32 b(page)g(88\).)150 5340 y Fs(BASH)288 |
| 37c41ab1 CR |
8555 | b Ft(The)30 b(full)g(pathname)g(used)g(to)h(execute)h(the)e(curren)m(t) |
| 8556 | g(instance)h(of)g(Bash.)p eop end | |
| 28157acd CR |
8557 | %%Page: 58 64 |
| 8558 | TeXDict begin 58 63 bop 150 -116 a Ft(58)2572 b(Bash)31 | |
| 8559 | b(Reference)g(Man)m(ual)150 299 y Fs(BASH_ARGC)630 408 | |
| 8560 | y Ft(An)f(arra)m(y)h(v)-5 b(ariable)31 b(whose)f(v)-5 | |
| 8561 | b(alues)31 b(are)g(the)f(n)m(um)m(b)s(er)f(of)i(parameters)g(in)f(eac)m | |
| 8562 | (h)h(frame)g(of)630 518 y(the)26 b(curren)m(t)f(bash)g(execution)i | |
| 8563 | (call)g(stac)m(k.)41 b(The)25 b(n)m(um)m(b)s(er)g(of)h(parameters)g(to) | |
| 8564 | g(the)g(curren)m(t)630 628 y(subroutine)i(\(shell)i(function)g(or)f | |
| 8565 | (script)g(executed)i(with)e Fs(.)g Ft(or)h Fs(source)p | |
| 8566 | Ft(\))e(is)h(at)h(the)g(top)g(of)630 737 y(the)37 b(stac)m(k.)63 | |
| 8567 | b(When)37 b(a)h(subroutine)e(is)h(executed,)j(the)e(n)m(um)m(b)s(er)d | |
| 8568 | (of)j(parameters)f(passed)630 847 y(is)g(pushed)f(on)m(to)i | |
| 8569 | Fs(BASH_ARGC)p Ft(.)59 b(The)37 b(shell)g(sets)h Fs(BASH_ARGC)c | |
| 8570 | Ft(only)k(when)e(in)h(extended)630 956 y(debugging)e(mo)s(de)g(\(see)i | |
| 8571 | (Section)f(4.2)h([Bash)e(Builtins],)j(page)e(41)g(for)f(a)h | |
| 8572 | (description)g(of)630 1066 y(the)31 b Fs(extdebug)d Ft(option)j(to)g | |
| 8573 | (the)f Fs(shopt)f Ft(builtin\).)150 1240 y Fs(BASH_ARGV)630 | |
| 8574 | 1350 y Ft(An)24 b(arra)m(y)g(v)-5 b(ariable)25 b(con)m(taining)h(all)f | |
| 9d2b70f0 | 8575 | (of)f(the)h(parameters)f(in)g(the)g(curren)m(t)g(bash)g(execution)630 |
| 28157acd | 8576 | 1459 y(call)35 b(stac)m(k.)53 b(The)34 b(\014nal)g(parameter)g(of)g |
| 37c41ab1 | 8577 | (the)g(last)h(subroutine)e(call)i(is)f(at)h(the)f(top)h(of)f(the)630 |
| 28157acd | 8578 | 1569 y(stac)m(k;)28 b(the)c(\014rst)f(parameter)i(of)f(the)g(initial)i |
| 37c41ab1 | 8579 | (call)f(is)f(at)h(the)f(b)s(ottom.)39 b(When)24 b(a)g(subroutine)630 |
| 28157acd | 8580 | 1678 y(is)40 b(executed,)j(the)d(parameters)h(supplied)d(are)i(pushed)f |
| 9d2b70f0 | 8581 | (on)m(to)i Fs(BASH_ARGV)p Ft(.)66 b(The)40 b(shell)630 |
| 28157acd CR |
8582 | 1788 y(sets)31 b Fs(BASH_ARGV)e Ft(only)i(when)e(in)i(extended)g |
| 8583 | (debugging)g(mo)s(de)f(\(see)i(Section)g(4.2)g([Bash)630 | |
| 8584 | 1898 y(Builtins],)25 b(page)e(41)g(for)f(a)h(description)g(of)f(the)h | |
| 8585 | Fs(extdebug)d Ft(option)j(to)g(the)g Fs(shopt)e Ft(builtin\).)150 | |
| 8586 | 2072 y Fs(BASH_COMMAND)630 2181 y Ft(The)39 b(command)h(curren)m(tly)g | |
| 8587 | (b)s(eing)f(executed)i(or)e(ab)s(out)h(to)g(b)s(e)f(executed,)44 | |
| 8588 | b(unless)39 b(the)630 2291 y(shell)g(is)g(executing)g(a)g(command)g(as) | |
| 8589 | g(the)f(result)h(of)g(a)g(trap,)i(in)d(whic)m(h)g(case)i(it)f(is)g(the) | |
| 8590 | 630 2400 y(command)30 b(executing)i(at)f(the)f(time)h(of)g(the)g(trap.) | |
| 8591 | 150 2574 y Fs(BASH_ENV)96 b Ft(If)28 b(this)g(v)-5 b(ariable)30 | |
| 37c41ab1 | 8592 | b(is)e(set)h(when)f(Bash)g(is)h(in)m(v)m(ok)m(ed)h(to)f(execute)h(a)e |
| 28157acd | 8593 | (shell)h(script,)g(its)g(v)-5 b(alue)29 b(is)630 2684 |
| 37c41ab1 | 8594 | y(expanded)k(and)h(used)g(as)g(the)h(name)f(of)g(a)h(startup)f(\014le)g |
| 28157acd CR |
8595 | (to)h(read)f(b)s(efore)g(executing)i(the)630 2794 y(script.)41 |
| 8596 | b(See)30 b(Section)h(6.2)h([Bash)f(Startup)e(Files],)j(page)f(69.)150 | |
| 8597 | 2968 y Fs(BASH_EXECUTION_STRING)630 3077 y Ft(The)f(command)g(argumen)m | |
| 37c41ab1 | 8598 | (t)h(to)g(the)g(`)p Fs(-c)p Ft(')f(in)m(v)m(o)s(cation)i(option.)150 |
| 28157acd | 8599 | 3251 y Fs(BASH_LINENO)630 3361 y Ft(An)38 b(arra)m(y)h(v)-5 |
| 37c41ab1 | 8600 | b(ariable)39 b(whose)g(mem)m(b)s(ers)e(are)i(the)g(line)g(n)m(um)m(b)s |
| 28157acd | 8601 | (ers)e(in)h(source)h(\014les)f(corre-)630 3471 y(sp)s(onding)h(to)i |
| 5e13499c | 8602 | (eac)m(h)g(mem)m(b)s(er)e(of)i Fq(FUNCNAME)p Ft(.)g Fs |
| 28157acd | 8603 | (${BASH_LINENO[$i]})35 b Ft(is)40 b(the)h(line)630 3580 |
| 22e63b05 CR |
8604 | y(n)m(um)m(b)s(er)26 b(in)i(the)g(source)f(\014le)h(where)f |
| 8605 | Fs(${FUNCNAME[$i]})d Ft(w)m(as)k(called.)41 b(The)27 | |
| 28157acd | 8606 | b(corresp)s(ond-)630 3690 y(ing)f(source)h(\014le)f(name)g(is)h |
| 22e63b05 | 8607 | Fs(${BASH_SOURCE[$i]})p Ft(.)34 b(Use)27 b Fs(LINENO)d |
| 28157acd CR |
8608 | Ft(to)j(obtain)g(the)f(curren)m(t)630 3799 y(line)31 |
| 8609 | b(n)m(um)m(b)s(er.)150 3973 y Fs(BASH_REMATCH)630 4083 | |
| 22e63b05 CR |
8610 | y Ft(An)43 b(arra)m(y)i(v)-5 b(ariable)44 b(whose)g(mem)m(b)s(ers)f |
| 8611 | (are)h(assigned)g(b)m(y)f(the)h(`)p Fs(=~)p Ft(')g(binary)f(op)s | |
| 28157acd | 8612 | (erator)630 4193 y(to)37 b(the)f Fs([[)g Ft(conditional)i(command)e |
| 22e63b05 | 8613 | (\(see)h(Section)g(3.2.4.2)i([Conditional)e(Constructs],)630 |
| 28157acd | 8614 | 4302 y(page)e(10\).)52 b(The)33 b(elemen)m(t)j(with)d(index)g(0)i(is)f |
| 37c41ab1 | 8615 | (the)g(p)s(ortion)f(of)h(the)g(string)g(matc)m(hing)h(the)630 |
| 28157acd | 8616 | 4412 y(en)m(tire)29 b(regular)f(expression.)40 b(The)27 |
| 37c41ab1 | 8617 | b(elemen)m(t)j(with)d(index)h Fq(n)f Ft(is)h(the)g(p)s(ortion)g(of)g |
| 28157acd | 8618 | (the)g(string)630 4521 y(matc)m(hing)j(the)g Fq(n)p Ft(th)f(paren)m |
| 37c41ab1 | 8619 | (thesized)h(sub)s(expression.)39 b(This)29 b(v)-5 b(ariable)31 |
| 28157acd CR |
8620 | b(is)g(read-only)-8 b(.)150 4695 y Fs(BASH_SOURCE)630 |
| 8621 | 4805 y Ft(An)24 b(arra)m(y)h(v)-5 b(ariable)26 b(whose)e(mem)m(b)s(ers) | |
| 37c41ab1 | 8622 | g(are)h(the)g(source)f(\014lenames)h(corresp)s(onding)e(to)j(the)630 |
| 28157acd CR |
8623 | 4915 y(elemen)m(ts)32 b(in)e(the)g Fs(FUNCNAME)e Ft(arra)m(y)j(v)-5 |
| 8624 | b(ariable.)150 5089 y Fs(BASH_SUBSHELL)630 5198 y Ft(Incremen)m(ted)34 | |
| 8625 | b(b)m(y)h(one)f(eac)m(h)i(time)f(a)f(subshell)g(or)g(subshell)f(en)m | |
| 8626 | (vironmen)m(t)i(is)f(spa)m(wned.)630 5308 y(The)c(initial)h(v)-5 | |
| 8627 | b(alue)31 b(is)g(0.)p eop end | |
| 8628 | %%Page: 59 65 | |
| 8629 | TeXDict begin 59 64 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
| 8630 | b(Shell)30 b(V)-8 b(ariables)2459 b(59)150 299 y Fs(BASH_VERSINFO)630 | |
| 8631 | 408 y Ft(A)36 b(readonly)g(arra)m(y)g(v)-5 b(ariable)37 | |
| 8632 | b(\(see)f(Section)h(6.7)g([Arra)m(ys],)h(page)e(76\))h(whose)f(mem)m(b) | |
| 8633 | s(ers)630 518 y(hold)c(v)m(ersion)h(information)f(for)g(this)g | |
| 8634 | (instance)h(of)g(Bash.)46 b(The)32 b(v)-5 b(alues)32 | |
| 8635 | b(assigned)h(to)g(the)630 628 y(arra)m(y)e(mem)m(b)s(ers)e(are)i(as)g | |
| 8636 | (follo)m(ws:)630 779 y Fs(BASH_VERSINFO[0])1110 889 y | |
| 8637 | Ft(The)f(ma)5 b(jor)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
| 8638 | Fq(release)5 b Ft(\).)630 1041 y Fs(BASH_VERSINFO[1])1110 | |
| 8639 | 1150 y Ft(The)30 b(minor)g(v)m(ersion)h(n)m(um)m(b)s(er)e(\(the)i | |
| 8640 | Fq(v)m(ersion)p Ft(\).)630 1302 y Fs(BASH_VERSINFO[2])1110 | |
| 8641 | 1412 y Ft(The)f(patc)m(h)h(lev)m(el.)630 1563 y Fs(BASH_VERSINFO[3]) | |
| 8642 | 1110 1673 y Ft(The)f(build)f(v)m(ersion.)630 1825 y Fs | |
| 8643 | (BASH_VERSINFO[4])1110 1934 y Ft(The)h(release)i(status)e(\(e.g.,)j | |
| 8644 | Fq(b)s(eta1)7 b Ft(\).)630 2086 y Fs(BASH_VERSINFO[5])1110 | |
| 8645 | 2196 y Ft(The)30 b(v)-5 b(alue)31 b(of)f Fs(MACHTYPE)p | |
| 8646 | Ft(.)150 2347 y Fs(BASH_VERSION)630 2457 y Ft(The)g(v)m(ersion)h(n)m | |
| 9d2b70f0 | 8647 | (um)m(b)s(er)e(of)h(the)h(curren)m(t)f(instance)h(of)g(Bash.)150 |
| 28157acd | 8648 | 2609 y Fs(COLUMNS)144 b Ft(Used)36 b(b)m(y)h(the)f Fs(select)f |
| 37c41ab1 | 8649 | Ft(builtin)h(command)h(to)g(determine)f(the)h(terminal)g(width)f(when) |
| 28157acd | 8650 | 630 2718 y(prin)m(ting)30 b(selection)i(lists.)42 b(Automatically)33 |
| 37c41ab1 | 8651 | b(set)e(up)s(on)d(receipt)k(of)e(a)h Fs(SIGWINCH)p Ft(.)150 |
| 28157acd | 8652 | 2870 y Fs(COMP_CWORD)630 2980 y Ft(An)38 b(index)g(in)m(to)h |
| 37c41ab1 | 8653 | Fs(${COMP_WORDS})c Ft(of)k(the)g(w)m(ord)f(con)m(taining)i(the)e |
| 28157acd | 8654 | (curren)m(t)g(cursor)g(p)s(o-)630 3089 y(sition.)72 b(This)40 |
| 37c41ab1 CR |
8655 | b(v)-5 b(ariable)41 b(is)f(a)m(v)-5 b(ailable)43 b(only)e(in)f(shell)h |
| 8656 | (functions)f(in)m(v)m(ok)m(ed)i(b)m(y)e(the)h(pro-)630 | |
| 28157acd CR |
8657 | 3199 y(grammable)36 b(completion)g(facilities)i(\(see)e(Section)g(8.6)g |
| 8658 | ([Programmable)g(Completion],)630 3308 y(page)31 b(109\).)150 | |
| 8659 | 3460 y Fs(COMP_LINE)630 3570 y Ft(The)38 b(curren)m(t)h(command)f | |
| 37c41ab1 | 8660 | (line.)66 b(This)37 b(v)-5 b(ariable)40 b(is)f(a)m(v)-5 |
| 28157acd | 8661 | b(ailable)41 b(only)d(in)h(shell)f(functions)630 3679 |
| 37c41ab1 | 8662 | y(and)25 b(external)h(commands)f(in)m(v)m(ok)m(ed)h(b)m(y)f(the)h |
| 28157acd CR |
8663 | (programmable)f(completion)i(facilities)g(\(see)630 3789 |
| 8664 | y(Section)k(8.6)h([Programmable)f(Completion],)g(page)g(109\).)150 | |
| 8665 | 3941 y Fs(COMP_POINT)630 4050 y Ft(The)25 b(index)g(of)h(the)g(curren)m | |
| 37c41ab1 | 8666 | (t)f(cursor)g(p)s(osition)h(relativ)m(e)i(to)e(the)g(b)s(eginning)f(of) |
| 28157acd | 8667 | g(the)h(curren)m(t)630 4160 y(command.)40 b(If)27 b(the)h(curren)m(t)g |
| 37c41ab1 | 8668 | (cursor)g(p)s(osition)g(is)g(at)g(the)g(end)g(of)g(the)g(curren)m(t)g |
| 28157acd | 8669 | (command,)630 4269 y(the)i(v)-5 b(alue)30 b(of)g(this)g(v)-5 |
| 37c41ab1 CR |
8670 | b(ariable)31 b(is)f(equal)g(to)h Fs(${#COMP_LINE})p Ft(.)37 |
| 8671 | b(This)29 b(v)-5 b(ariable)31 b(is)f(a)m(v)-5 b(ailable)630 | |
| 28157acd CR |
8672 | 4379 y(only)36 b(in)f(shell)h(functions)f(and)g(external)h(commands)g |
| 8673 | (in)m(v)m(ok)m(ed)h(b)m(y)e(the)h(programmable)630 4489 | |
| 37c41ab1 | 8674 | y(completion)c(facilities)g(\(see)g(Section)f(8.6)g([Programmable)g |
| 28157acd CR |
8675 | (Completion],)h(page)f(109\).)150 4640 y Fs(COMP_WORDBREAKS)630 |
| 8676 | 4750 y Ft(The)e(set)i(of)e(c)m(haracters)j(that)e(the)g(Readline)g | |
| 8677 | (library)g(treats)g(as)g(w)m(ord)g(separators)g(when)630 | |
| 8678 | 4859 y(p)s(erforming)i(w)m(ord)h(completion.)51 b(If)33 | |
| 8679 | b Fs(COMP_WORDBREAKS)c Ft(is)34 b(unset,)g(it)f(loses)i(its)e(sp)s | |
| 8680 | (ecial)630 4969 y(prop)s(erties,)d(ev)m(en)h(if)f(it)h(is)g(subsequen)m | |
| 8681 | (tly)f(reset.)150 5121 y Fs(COMP_WORDS)630 5230 y Ft(An)36 | |
| 8682 | b(arra)m(y)g(v)-5 b(ariable)37 b(consisting)g(of)f(the)g(individual)f | |
| 8683 | (w)m(ords)h(in)f(the)h(curren)m(t)g(command)630 5340 | |
| 8684 | y(line.)88 b(This)45 b(v)-5 b(ariable)47 b(is)f(a)m(v)-5 | |
| 8685 | b(ailable)48 b(only)e(in)g(shell)g(functions)g(in)m(v)m(ok)m(ed)h(b)m | |
| 8686 | (y)f(the)g(pro-)p eop end | |
| 8687 | %%Page: 60 66 | |
| 8688 | TeXDict begin 60 65 bop 150 -116 a Ft(60)2572 b(Bash)31 | |
| 8689 | b(Reference)g(Man)m(ual)630 299 y(grammable)36 b(completion)g | |
| 8690 | (facilities)i(\(see)e(Section)g(8.6)g([Programmable)g(Completion],)630 | |
| 8691 | 408 y(page)31 b(109\).)150 573 y Fs(COMPREPLY)630 682 | |
| 8692 | y Ft(An)37 b(arra)m(y)h(v)-5 b(ariable)38 b(from)f(whic)m(h)g(Bash)g | |
| 8693 | (reads)g(the)h(p)s(ossible)e(completions)j(generated)630 | |
| 8694 | 792 y(b)m(y)33 b(a)g(shell)h(function)f(in)m(v)m(ok)m(ed)h(b)m(y)f(the) | |
| 8695 | g(programmable)h(completion)g(facilit)m(y)h(\(see)f(Sec-)630 | |
| 8696 | 902 y(tion)d(8.6)g([Programmable)g(Completion],)h(page)f(109\).)150 | |
| 8697 | 1066 y Fs(DIRSTACK)96 b Ft(An)26 b(arra)m(y)h(v)-5 b(ariable)28 | |
| 9d6e5e30 | 8698 | b(con)m(taining)g(the)f(curren)m(t)f(con)m(ten)m(ts)j(of)e(the)f |
| 28157acd | 8699 | (directory)i(stac)m(k.)41 b(Direc-)630 1176 y(tories)33 |
| 9d6e5e30 CR |
8700 | b(app)s(ear)f(in)g(the)h(stac)m(k)h(in)e(the)h(order)f(they)h(are)g |
| 8701 | (displa)m(y)m(ed)g(b)m(y)f(the)h Fs(dirs)e Ft(builtin.)630 | |
| 28157acd | 8702 | 1285 y(Assigning)f(to)h(mem)m(b)s(ers)f(of)g(this)g(arra)m(y)g(v)-5 |
| 9d6e5e30 | 8703 | b(ariable)31 b(ma)m(y)g(b)s(e)e(used)h(to)h(mo)s(dify)e(directories)630 |
| 28157acd | 8704 | 1395 y(already)41 b(in)f(the)h(stac)m(k,)k(but)40 b(the)h |
| 9d6e5e30 | 8705 | Fs(pushd)e Ft(and)h Fs(popd)f Ft(builtins)h(m)m(ust)h(b)s(e)e(used)h |
| 28157acd | 8706 | (to)i(add)630 1504 y(and)37 b(remo)m(v)m(e)h(directories.)63 |
| 9d6e5e30 | 8707 | b(Assignmen)m(t)37 b(to)h(this)f(v)-5 b(ariable)38 b(will)g(not)f(c)m |
| 28157acd | 8708 | (hange)i(the)e(cur-)630 1614 y(ren)m(t)c(directory)-8 |
| 9d6e5e30 CR |
8709 | b(.)47 b(If)32 b Fs(DIRSTACK)e Ft(is)i(unset,)g(it)h(loses)g(its)g(sp)s |
| 8710 | (ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)630 | |
| 28157acd | 8711 | 1724 y(subsequen)m(tly)d(reset.)150 1888 y Fs(EMACS)240 |
| 9d6e5e30 CR |
8712 | b Ft(If)31 b(Bash)h(\014nds)d(this)j(v)-5 b(ariable)32 |
| 8713 | b(in)f(the)h(en)m(vironmen)m(t)g(when)e(the)i(shell)f(starts)h(with)f | |
| 28157acd | 8714 | (v)-5 b(alue)630 1998 y(`)p Fs(t)p Ft(',)38 b(it)e(assumes)g(that)g |
| 9d6e5e30 | 8715 | (the)h(shell)f(is)g(running)e(in)i(an)g(emacs)g(shell)h(bu\013er)e(and) |
| 28157acd | 8716 | g(disables)630 2107 y(line)c(editing.)150 2271 y Fs(EUID)288 |
| 9d6e5e30 CR |
8717 | b Ft(The)30 b(n)m(umeric)g(e\013ectiv)m(e)j(user)d(id)g(of)g(the)h |
| 8718 | (curren)m(t)f(user.)40 b(This)30 b(v)-5 b(ariable)31 | |
| 28157acd | 8719 | b(is)f(readonly)-8 b(.)150 2436 y Fs(FCEDIT)192 b Ft(The)30 |
| 9d6e5e30 | 8720 | b(editor)h(used)e(as)i(a)g(default)f(b)m(y)h(the)f(`)p |
| 37c41ab1 | 8721 | Fs(-e)p Ft(')g(option)h(to)g(the)g Fs(fc)f Ft(builtin)g(command.)150 |
| 28157acd | 8722 | 2600 y Fs(FIGNORE)144 b Ft(A)35 b(colon-separated)i(list)f(of)g |
| 37c41ab1 | 8723 | (su\016xes)e(to)i(ignore)g(when)e(p)s(erforming)g(\014lename)i(comple-) |
| 28157acd | 8724 | 630 2710 y(tion.)j(A)25 b(\014le)g(name)g(whose)f(su\016x)g(matc)m(hes) |
| 37c41ab1 | 8725 | i(one)f(of)g(the)g(en)m(tries)g(in)g Fs(FIGNORE)d Ft(is)j(excluded)630 |
| 28157acd | 8726 | 2819 y(from)30 b(the)g(list)h(of)g(matc)m(hed)g(\014le)g(names.)40 |
| 37c41ab1 | 8727 | b(A)31 b(sample)f(v)-5 b(alue)31 b(is)g(`)p Fs(.o:~)p |
| 28157acd | 8728 | Ft(')150 2984 y Fs(FUNCNAME)96 b Ft(An)35 b(arra)m(y)i(v)-5 |
| 37c41ab1 | 8729 | b(ariable)36 b(con)m(taining)h(the)f(names)g(of)g(all)g(shell)g |
| 28157acd | 8730 | (functions)g(curren)m(tly)f(in)h(the)630 3093 y(execution)g(call)h |
| 37c41ab1 | 8731 | (stac)m(k.)57 b(The)34 b(elemen)m(t)j(with)e(index)g(0)h(is)f(the)g |
| 28157acd CR |
8732 | (name)h(of)f(an)m(y)h(curren)m(tly-)630 3203 y(executing)i(shell)f |
| 8733 | (function.)58 b(The)37 b(b)s(ottom-most)g(elemen)m(t)h(is)f | |
| 8734 | Fs(")p Ft(main)p Fs(")p Ft(.)58 b(This)36 b(v)-5 b(ariable)630 | |
| 8735 | 3313 y(exists)33 b(only)g(when)f(a)h(shell)g(function)f(is)h | |
| 8736 | (executing.)49 b(Assignmen)m(ts)33 b(to)g Fs(FUNCNAME)e | |
| 8737 | Ft(ha)m(v)m(e)630 3422 y(no)36 b(e\013ect)h(and)e(return)f(an)i(error)f | |
| 8738 | (status.)57 b(If)36 b Fs(FUNCNAME)d Ft(is)j(unset,)h(it)f(loses)g(its)g | |
| 8739 | (sp)s(ecial)630 3532 y(prop)s(erties,)30 b(ev)m(en)h(if)f(it)h(is)g | |
| 8740 | (subsequen)m(tly)f(reset.)150 3696 y Fs(GLOBIGNORE)630 | |
| 8741 | 3806 y Ft(A)38 b(colon-separated)i(list)f(of)f(patterns)g(de\014ning)f | |
| 9d6e5e30 | 8742 | (the)h(set)g(of)h(\014lenames)f(to)g(b)s(e)g(ignored)630 |
| 28157acd CR |
8743 | 3915 y(b)m(y)31 b(\014lename)g(expansion.)43 b(If)31 |
| 8744 | b(a)h(\014lename)f(matc)m(hed)h(b)m(y)f(a)g(\014lename)h(expansion)f | |
| 8745 | (pattern)630 4025 y(also)i(matc)m(hes)g(one)f(of)g(the)g(patterns)g(in) | |
| 8746 | f Fs(GLOBIGNORE)p Ft(,)f(it)i(is)g(remo)m(v)m(ed)h(from)e(the)h(list)h | |
| 8747 | (of)630 4134 y(matc)m(hes.)150 4299 y Fs(GROUPS)192 b | |
| 8748 | Ft(An)36 b(arra)m(y)g(v)-5 b(ariable)37 b(con)m(taining)g(the)f(list)h | |
| 8749 | (of)f(groups)g(of)g(whic)m(h)f(the)i(curren)m(t)e(user)h(is)g(a)630 | |
| 8750 | 4408 y(mem)m(b)s(er.)47 b(Assignmen)m(ts)33 b(to)g Fs(GROUPS)e | |
| 5e13499c | 8751 | Ft(ha)m(v)m(e)j(no)f(e\013ect)h(and)e(return)g(an)g(error)g(status.)48 |
| 28157acd | 8752 | b(If)630 4518 y Fs(GROUPS)29 b Ft(is)h(unset,)g(it)h(loses)g(its)g(sp)s |
| 37c41ab1 | 8753 | (ecial)g(prop)s(erties,)f(ev)m(en)h(if)f(it)h(is)g(subsequen)m(tly)f |
| 28157acd | 8754 | (reset.)150 4682 y Fs(histchars)630 4792 y Ft(Up)c(to)g(three)g(c)m |
| 37c41ab1 | 8755 | (haracters)i(whic)m(h)d(con)m(trol)j(history)d(expansion,)i(quic)m(k)g |
| 28157acd CR |
8756 | (substitution,)g(and)630 4902 y(tok)m(enization)k(\(see)f(Section)f |
| 8757 | (9.3)h([History)f(In)m(teraction],)i(page)f(117\).)41 | |
| 8758 | b(The)29 b(\014rst)e(c)m(harac-)630 5011 y(ter)j(is)f(the)g | |
| 37c41ab1 | 8759 | Fq(history)g(expansion)g Ft(c)m(haracter,)j(that)e(is,)f(the)h(c)m |
| 28157acd | 8760 | (haracter)h(whic)m(h)d(signi\014es)i(the)630 5121 y(start)25 |
| 37c41ab1 CR |
8761 | b(of)f(a)h(history)f(expansion,)i(normally)e(`)p Fs(!)p |
| 8762 | Ft('.)39 b(The)24 b(second)g(c)m(haracter)i(is)e(the)g(c)m(haracter)630 | |
| 28157acd | 8763 | 5230 y(whic)m(h)36 b(signi\014es)g(`quic)m(k)h(substitution')f(when)f |
| 9d6e5e30 | 8764 | (seen)h(as)g(the)g(\014rst)f(c)m(haracter)j(on)e(a)g(line,)630 |
| 28157acd CR |
8765 | 5340 y(normally)27 b(`)p Fs(^)p Ft('.)39 b(The)26 b(optional)i(third)d |
| 8766 | (c)m(haracter)j(is)e(the)h(c)m(haracter)h(whic)m(h)e(indicates)h(that)p | |
| 8767 | eop end | |
| 8768 | %%Page: 61 67 | |
| 8769 | TeXDict begin 61 66 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
| 8770 | b(Shell)30 b(V)-8 b(ariables)2459 b(61)630 299 y(the)34 | |
| 8771 | b(remainder)f(of)h(the)g(line)g(is)f(a)h(commen)m(t)h(when)e(found)f | |
| 8772 | (as)i(the)g(\014rst)f(c)m(haracter)i(of)f(a)630 408 y(w)m(ord,)i | |
| 8773 | (usually)f(`)p Fs(#)p Ft('.)55 b(The)34 b(history)h(commen)m(t)h(c)m | |
| 8774 | (haracter)h(causes)e(history)g(substitution)630 518 y(to)27 | |
| 8775 | b(b)s(e)f(skipp)s(ed)f(for)i(the)f(remaining)h(w)m(ords)f(on)h(the)f | |
| 8776 | (line.)40 b(It)27 b(do)s(es)f(not)h(necessarily)g(cause)630 | |
| 8777 | 628 y(the)k(shell)f(parser)g(to)h(treat)g(the)g(rest)g(of)f(the)h(line) | |
| 8778 | f(as)h(a)g(commen)m(t.)150 816 y Fs(HISTCMD)144 b Ft(The)35 | |
| 8779 | b(history)h(n)m(um)m(b)s(er,)g(or)f(index)g(in)h(the)g(history)f(list,) | |
| 8780 | j(of)e(the)g(curren)m(t)f(command.)56 b(If)630 925 y | |
| 8781 | Fs(HISTCMD)28 b Ft(is)h(unset,)h(it)g(loses)h(its)f(sp)s(ecial)g(prop)s | |
| 8782 | (erties,)g(ev)m(en)g(if)g(it)g(is)g(subsequen)m(tly)f(reset.)150 | |
| 8783 | 1113 y Fs(HISTCONTROL)630 1223 y Ft(A)40 b(colon-separated)i(list)f(of) | |
| 8784 | f(v)-5 b(alues)40 b(con)m(trolling)i(ho)m(w)e(commands)g(are)h(sa)m(v)m | |
| 8785 | (ed)g(on)f(the)630 1332 y(history)29 b(list.)41 b(If)28 | |
| 8786 | b(the)h(list)h(of)f(v)-5 b(alues)29 b(includes)f(`)p | |
| 8787 | Fs(ignorespace)p Ft(',)f(lines)i(whic)m(h)g(b)s(egin)f(with)630 | |
| 8788 | 1442 y(a)39 b(space)g(c)m(haracter)i(are)e(not)g(sa)m(v)m(ed)g(in)g | |
| 8789 | (the)g(history)f(list.)66 b(A)39 b(v)-5 b(alue)39 b(of)g(`)p | |
| 8790 | Fs(ignoredups)p Ft(')630 1551 y(causes)34 b(lines)h(whic)m(h)f(matc)m | |
| 8791 | (h)h(the)f(previous)f(history)h(en)m(try)h(to)g(not)f(b)s(e)f(sa)m(v)m | |
| 8792 | (ed.)53 b(A)34 b(v)-5 b(alue)630 1661 y(of)32 b(`)p Fs(ignoreboth)p | |
| 8793 | Ft(')d(is)j(shorthand)e(for)i(`)p Fs(ignorespace)p Ft(')d(and)i(`)p | |
| 8794 | Fs(ignoredups)p Ft('.)42 b(A)32 b(v)-5 b(alue)32 b(of)630 | |
| 8795 | 1771 y(`)p Fs(erasedups)p Ft(')f(causes)i(all)h(previous)f(lines)g | |
| 8796 | (matc)m(hing)h(the)f(curren)m(t)g(line)g(to)h(b)s(e)e(remo)m(v)m(ed)630 | |
| 8797 | 1880 y(from)42 b(the)h(history)f(list)i(b)s(efore)e(that)h(line)g(is)g | |
| 8798 | (sa)m(v)m(ed.)78 b(An)m(y)43 b(v)-5 b(alue)43 b(not)g(in)f(the)h(ab)s | |
| 8799 | (o)m(v)m(e)630 1990 y(list)35 b(is)g(ignored.)53 b(If)34 | |
| 8800 | b Fs(HISTCONTROL)e Ft(is)i(unset,)i(or)e(do)s(es)h(not)g(include)f(a)h | |
| 8801 | (v)-5 b(alid)35 b(v)-5 b(alue,)36 b(all)630 2099 y(lines)30 | |
| 37c41ab1 CR |
8802 | b(read)g(b)m(y)g(the)g(shell)g(parser)g(are)g(sa)m(v)m(ed)h(on)f(the)g |
| 8803 | (history)g(list,)h(sub)5 b(ject)30 b(to)g(the)g(v)-5 | |
| 28157acd | 8804 | b(alue)630 2209 y(of)42 b Fs(HISTIGNORE)p Ft(.)73 b(The)42 |
| 37c41ab1 | 8805 | b(second)g(and)g(subsequen)m(t)f(lines)h(of)h(a)f(m)m(ulti-line)h(comp) |
| 28157acd | 8806 | s(ound)630 2318 y(command)33 b(are)h(not)g(tested,)i(and)d(are)h(added) |
| 37c41ab1 | 8807 | f(to)h(the)g(history)g(regardless)g(of)g(the)f(v)-5 b(alue)630 |
| 28157acd | 8808 | 2428 y(of)31 b Fs(HISTCONTROL)p Ft(.)150 2616 y Fs(HISTFILE)96 |
| 37c41ab1 CR |
8809 | b Ft(The)27 b(name)h(of)g(the)g(\014le)g(to)h(whic)m(h)f(the)g(command) |
| 8810 | f(history)h(is)g(sa)m(v)m(ed.)41 b(The)27 b(default)h(v)-5 | |
| 28157acd CR |
8811 | b(alue)630 2725 y(is)30 b(`)p Fs(~/.bash_history)p Ft('.)150 |
| 8812 | 2913 y Fs(HISTFILESIZE)630 3023 y Ft(The)c(maxim)m(um)f(n)m(um)m(b)s | |
| 37c41ab1 | 8813 | (er)g(of)h(lines)h(con)m(tained)g(in)f(the)g(history)g(\014le.)39 |
| 28157acd CR |
8814 | b(When)26 b(this)g(v)-5 b(ariable)630 3133 y(is)25 b(assigned)h(a)g(v) |
| 8815 | -5 b(alue,)27 b(the)f(history)f(\014le)h(is)f(truncated,)i(if)e | |
| 8816 | (necessary)-8 b(,)28 b(to)e(con)m(tain)g(no)g(more)630 | |
| 8817 | 3242 y(than)34 b(that)h(n)m(um)m(b)s(er)d(of)j(lines.)52 | |
| 8818 | b(The)34 b(history)g(\014le)g(is)g(also)h(truncated)f(to)h(this)f(size) | |
| 8819 | h(after)630 3352 y(writing)30 b(it)h(when)f(an)g(in)m(teractiv)m(e)j | |
| 8820 | (shell)e(exits.)41 b(The)30 b(default)h(v)-5 b(alue)31 | |
| 8821 | b(is)f(500.)150 3540 y Fs(HISTIGNORE)630 3649 y Ft(A)j(colon-separated) | |
| 8822 | h(list)f(of)g(patterns)f(used)g(to)h(decide)g(whic)m(h)f(command)g | |
| 8823 | (lines)h(should)630 3759 y(b)s(e)f(sa)m(v)m(ed)h(on)g(the)f(history)h | |
| 8824 | (list.)47 b(Eac)m(h)33 b(pattern)g(is)f(anc)m(hored)h(at)g(the)f(b)s | |
| 8825 | (eginning)g(of)h(the)630 3868 y(line)43 b(and)e(m)m(ust)h(matc)m(h)h | |
| 8826 | (the)g(complete)h(line)e(\(no)h(implicit)g(`)p Fs(*)p | |
| 8827 | Ft(')f(is)g(app)s(ended\).)75 b(Eac)m(h)630 3978 y(pattern)42 | |
| 8828 | b(is)g(tested)g(against)h(the)f(line)g(after)g(the)g(c)m(hec)m(ks)h(sp) | |
| 8829 | s(eci\014ed)e(b)m(y)h Fs(HISTCONTROL)630 4088 y Ft(are)37 | |
| 8830 | b(applied.)59 b(In)36 b(addition)h(to)g(the)g(normal)g(shell)f(pattern) | |
| 8831 | h(matc)m(hing)h(c)m(haracters,)i(`)p Fs(&)p Ft(')630 | |
| 8832 | 4197 y(matc)m(hes)d(the)f(previous)g(history)g(line.)57 | |
| 9d6e5e30 | 8833 | b(`)p Fs(&)p Ft(')36 b(ma)m(y)h(b)s(e)e(escap)s(ed)h(using)g(a)g(bac)m |
| 28157acd | 8834 | (kslash;)k(the)630 4307 y(bac)m(kslash)34 b(is)g(remo)m(v)m(ed)h(b)s |
| 9d6e5e30 | 8835 | (efore)e(attempting)i(a)g(matc)m(h.)51 b(The)34 b(second)f(and)h |
| 28157acd | 8836 | (subsequen)m(t)630 4416 y(lines)e(of)h(a)g(m)m(ulti-line)g(comp)s(ound) |
| 9d6e5e30 | 8837 | e(command)h(are)h(not)f(tested,)i(and)e(are)g(added)g(to)h(the)630 |
| 28157acd CR |
8838 | 4526 y(history)d(regardless)h(of)g(the)f(v)-5 b(alue)31 |
| 8839 | b(of)g Fs(HISTIGNORE)p Ft(.)630 4675 y Fs(HISTIGNORE)20 | |
| 37c41ab1 CR |
8840 | b Ft(subsumes)g(the)j(function)f(of)h Fs(HISTCONTROL)p |
| 8841 | Ft(.)35 b(A)23 b(pattern)f(of)h(`)p Fs(&)p Ft(')g(is)f(iden)m(tical)630 | |
| 28157acd | 8842 | 4784 y(to)k Fs(ignoredups)p Ft(,)e(and)h(a)h(pattern)g(of)f(`)p |
| 37c41ab1 | 8843 | Fs([)31 b(]*)p Ft(')25 b(is)h(iden)m(tical)h(to)f Fs(ignorespace)p |
| 28157acd | 8844 | Ft(.)36 b(Com)m(bining)630 4894 y(these)30 b(t)m(w)m(o)h(patterns,)f |
| 37c41ab1 | 8845 | (separating)g(them)g(with)f(a)h(colon,)h(pro)m(vides)e(the)h |
| 28157acd CR |
8846 | (functionalit)m(y)h(of)630 5003 y Fs(ignoreboth)p Ft(.)150 |
| 8847 | 5191 y Fs(HISTSIZE)96 b Ft(The)42 b(maxim)m(um)g(n)m(um)m(b)s(er)f(of)i | |
| 37c41ab1 | 8848 | (commands)e(to)j(remem)m(b)s(er)d(on)h(the)h(history)f(list.)77 |
| 28157acd CR |
8849 | b(The)630 5301 y(default)31 b(v)-5 b(alue)30 b(is)h(500.)p |
| 8850 | eop end | |
| 8851 | %%Page: 62 68 | |
| 8852 | TeXDict begin 62 67 bop 150 -116 a Ft(62)2572 b(Bash)31 | |
| 8853 | b(Reference)g(Man)m(ual)150 299 y Fs(HISTTIMEFORMAT)630 | |
| 8854 | 408 y Ft(If)44 b(this)g(v)-5 b(ariable)45 b(is)f(set)g(and)g(not)g(n)m | |
| 8855 | (ull,)k(its)d(v)-5 b(alue)44 b(is)g(used)g(as)g(a)h(format)f(string)g | |
| 8856 | (for)630 518 y Fq(strftime)c Ft(to)35 b(prin)m(t)f(the)h(time)g(stamp)f | |
| 8857 | (asso)s(ciated)i(with)f(eac)m(h)g(history)g(en)m(try)f(displa)m(y)m(ed) | |
| 8858 | 630 628 y(b)m(y)g(the)f Fs(history)f Ft(builtin.)50 b(If)33 | |
| 9d2b70f0 | 8859 | b(this)h(v)-5 b(ariable)34 b(is)g(set,)h(time)f(stamps)g(are)g(written) |
| 28157acd CR |
8860 | f(to)i(the)630 737 y(history)30 b(\014le)h(so)f(they)h(ma)m(y)g(b)s(e)f |
| 8861 | (preserv)m(ed)g(across)h(shell)f(sessions.)150 902 y | |
| 8862 | Fs(HOSTFILE)96 b Ft(Con)m(tains)39 b(the)f(name)g(of)h(a)g(\014le)f(in) | |
| 8863 | g(the)g(same)h(format)g(as)f(`)p Fs(/etc/hosts)p Ft(')e(that)j(should) | |
| 8864 | 630 1011 y(b)s(e)i(read)h(when)f(the)i(shell)f(needs)f(to)i(complete)h | |
| 8865 | (a)e(hostname.)76 b(The)42 b(list)g(of)g(p)s(ossible)630 | |
| 8866 | 1121 y(hostname)26 b(completions)g(ma)m(y)h(b)s(e)d(c)m(hanged)j(while) | |
| 8867 | e(the)h(shell)g(is)f(running;)h(the)g(next)f(time)630 | |
| 8868 | 1230 y(hostname)37 b(completion)i(is)e(attempted)h(after)g(the)f(v)-5 | |
| 9d2b70f0 | 8869 | b(alue)37 b(is)h(c)m(hanged,)h(Bash)e(adds)g(the)630 |
| 28157acd | 8870 | 1340 y(con)m(ten)m(ts)27 b(of)f(the)g(new)f(\014le)h(to)h(the)f |
| 9d2b70f0 | 8871 | (existing)g(list.)40 b(If)25 b Fs(HOSTFILE)f Ft(is)i(set,)h(but)e(has)h |
| 28157acd | 8872 | (no)f(v)-5 b(alue,)630 1450 y(Bash)41 b(attempts)g(to)g(read)f(`)p |
| 37c41ab1 | 8873 | Fs(/etc/hosts)p Ft(')f(to)i(obtain)g(the)f(list)h(of)g(p)s(ossible)f |
| 28157acd | 8874 | (hostname)630 1559 y(completions.)i(When)30 b Fs(HOSTFILE)e |
| 37c41ab1 | 8875 | Ft(is)j(unset,)f(the)g(hostname)h(list)g(is)f(cleared.)150 |
| 28157acd CR |
8876 | 1724 y Fs(HOSTNAME)96 b Ft(The)30 b(name)g(of)h(the)f(curren)m(t)h |
| 8877 | (host.)150 1888 y Fs(HOSTTYPE)96 b Ft(A)30 b(string)h(describing)f(the) | |
| 8878 | g(mac)m(hine)h(Bash)g(is)f(running)f(on.)150 2052 y Fs(IGNOREEOF)630 | |
| 8879 | 2162 y Ft(Con)m(trols)e(the)h(action)g(of)f(the)g(shell)g(on)g(receipt) | |
| 37c41ab1 | 8880 | h(of)f(an)g Fs(EOF)f Ft(c)m(haracter)i(as)g(the)f(sole)h(input.)630 |
| 28157acd | 8881 | 2271 y(If)i(set,)i(the)f(v)-5 b(alue)32 b(denotes)f(the)g(n)m(um)m(b)s |
| 37c41ab1 | 8882 | (er)f(of)h(consecutiv)m(e)i Fs(EOF)d Ft(c)m(haracters)i(that)f(can)h(b) |
| 28157acd | 8883 | s(e)630 2381 y(read)40 b(as)f(the)h(\014rst)f(c)m(haracter)i(on)f(an)f |
| 37c41ab1 | 8884 | (input)g(line)h(b)s(efore)f(the)h(shell)g(will)g(exit.)70 |
| 28157acd | 8885 | b(If)39 b(the)630 2491 y(v)-5 b(ariable)38 b(exists)f(but)f(do)s(es)g |
| 37c41ab1 | 8886 | (not)h(ha)m(v)m(e)h(a)g(n)m(umeric)e(v)-5 b(alue)37 b(\(or)h(has)e(no)h |
| 28157acd | 8887 | (v)-5 b(alue\))37 b(then)g(the)630 2600 y(default)31 |
| 37c41ab1 CR |
8888 | b(is)g(10.)43 b(If)30 b(the)h(v)-5 b(ariable)31 b(do)s(es)g(not)g |
| 8889 | (exist,)h(then)e Fs(EOF)g Ft(signi\014es)h(the)g(end)f(of)h(input)630 | |
| 28157acd CR |
8890 | 2710 y(to)g(the)g(shell.)41 b(This)29 b(is)i(only)f(in)g(e\013ect)i |
| 8891 | (for)e(in)m(teractiv)m(e)j(shells.)150 2874 y Fs(INPUTRC)144 | |
| 37c41ab1 | 8892 | b Ft(The)68 b(name)h(of)f(the)h(Readline)g(initialization)j(\014le,)78 |
| 28157acd CR |
8893 | b(o)m(v)m(erriding)69 b(the)g(default)g(of)630 2984 y(`)p |
| 8894 | Fs(~/.inputrc)p Ft('.)150 3148 y Fs(LANG)288 b Ft(Used)28 | |
| 37c41ab1 | 8895 | b(to)h(determine)f(the)g(lo)s(cale)h(category)h(for)e(an)m(y)h |
| 28157acd | 8896 | (category)h(not)e(sp)s(eci\014cally)g(selected)630 3258 |
| 37c41ab1 | 8897 | y(with)i(a)h(v)-5 b(ariable)31 b(starting)g(with)f Fs(LC_)p |
| 28157acd CR |
8898 | Ft(.)150 3422 y Fs(LC_ALL)192 b Ft(This)28 b(v)-5 b(ariable)29 |
| 8899 | b(o)m(v)m(errides)h(the)f(v)-5 b(alue)29 b(of)g Fs(LANG)f | |
| 8900 | Ft(and)g(an)m(y)h(other)g Fs(LC_)f Ft(v)-5 b(ariable)29 | |
| 8901 | b(sp)s(ecifying)630 3532 y(a)i(lo)s(cale)h(category)-8 | |
| 8902 | b(.)150 3696 y Fs(LC_COLLATE)630 3806 y Ft(This)37 b(v)-5 | |
| 8903 | b(ariable)38 b(determines)g(the)g(collation)i(order)d(used)g(when)f | |
| 8904 | (sorting)i(the)g(results)g(of)630 3915 y(\014lename)e(expansion,)i(and) | |
| 8905 | e(determines)g(the)h(b)s(eha)m(vior)f(of)g(range)h(expressions,)h | |
| 8906 | (equiv-)630 4025 y(alence)e(classes,)h(and)e(collating)i(sequences)e | |
| 8907 | (within)f(\014lename)h(expansion)g(and)f(pattern)630 | |
| 8908 | 4134 y(matc)m(hing)d(\(see)h(Section)f(3.5.8)h([Filename)g(Expansion],) | |
| 8909 | e(page)h(23\).)150 4299 y Fs(LC_CTYPE)96 b Ft(This)36 | |
| 8910 | b(v)-5 b(ariable)37 b(determines)f(the)h(in)m(terpretation)h(of)f(c)m | |
| 8911 | (haracters)h(and)e(the)g(b)s(eha)m(vior)h(of)630 4408 | |
| 8912 | y(c)m(haracter)46 b(classes)g(within)e(\014lename)h(expansion)g(and)f | |
| 8913 | (pattern)h(matc)m(hing)h(\(see)f(Sec-)630 4518 y(tion)31 | |
| 8914 | b(3.5.8)h([Filename)g(Expansion],)e(page)h(23\).)150 | |
| 8915 | 4682 y Fs(LC_MESSAGES)630 4792 y Ft(This)25 b(v)-5 b(ariable)27 | |
| 37c41ab1 | 8916 | b(determines)f(the)g(lo)s(cale)i(used)d(to)i(translate)g(double-quoted) |
| 28157acd | 8917 | f(strings)g(pre-)630 4902 y(ceded)31 b(b)m(y)f(a)h(`)p |
| 37c41ab1 | 8918 | Fs($)p Ft(')f(\(see)h(Section)h(3.1.2.5)g([Lo)s(cale)g(T)-8 |
| 28157acd CR |
8919 | b(ranslation],)32 b(page)f(7\).)150 5066 y Fs(LC_NUMERIC)630 |
| 8920 | 5176 y Ft(This)f(v)-5 b(ariable)31 b(determines)f(the)h(lo)s(cale)h | |
| 37c41ab1 | 8921 | (category)g(used)e(for)g(n)m(um)m(b)s(er)f(formatting.)150 |
| 28157acd CR |
8922 | 5340 y Fs(LINENO)192 b Ft(The)30 b(line)h(n)m(um)m(b)s(er)e(in)h(the)g |
| 8923 | (script)h(or)f(shell)g(function)h(curren)m(tly)f(executing.)p | |
| 8924 | eop end | |
| 8925 | %%Page: 63 69 | |
| 8926 | TeXDict begin 63 68 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
| 8927 | b(Shell)30 b(V)-8 b(ariables)2459 b(63)150 299 y Fs(LINES)240 | |
| 8928 | b Ft(Used)25 b(b)m(y)g(the)g Fs(select)e Ft(builtin)i(command)g(to)h | |
| 8929 | (determine)f(the)g(column)g(length)g(for)g(prin)m(t-)630 | |
| 8930 | 408 y(ing)31 b(selection)h(lists.)41 b(Automatically)33 | |
| 8931 | b(set)e(up)s(on)e(receipt)i(of)f(a)h Fs(SIGWINCH)p Ft(.)150 | |
| 8932 | 569 y Fs(MACHTYPE)96 b Ft(A)26 b(string)g(that)h(fully)f(describ)s(es)f | |
| 8933 | (the)h(system)g(t)m(yp)s(e)h(on)f(whic)m(h)f(Bash)i(is)f(executing,)i | |
| 8934 | (in)e(the)630 679 y(standard)k Fl(gnu)g Fq(cpu-compan)m(y-system)h | |
| 8935 | Ft(format.)150 840 y Fs(MAILCHECK)630 949 y Ft(Ho)m(w)d(often)g(\(in)g | |
| 8936 | (seconds\))g(that)g(the)f(shell)h(should)f(c)m(hec)m(k)i(for)e(mail)h | |
| 8937 | (in)f(the)h(\014les)g(sp)s(eci\014ed)630 1059 y(in)i(the)h | |
| 9d2b70f0 CR |
8938 | Fs(MAILPATH)e Ft(or)i Fs(MAIL)e Ft(v)-5 b(ariables.)43 |
| 8939 | b(The)30 b(default)h(is)f(60)i(seconds.)42 b(When)30 | |
| 28157acd | 8940 | b(it)h(is)g(time)630 1168 y(to)37 b(c)m(hec)m(k)h(for)e(mail,)j(the)e |
| 9d2b70f0 | 8941 | (shell)f(do)s(es)g(so)h(b)s(efore)f(displa)m(ying)h(the)f(primary)g |
| 28157acd | 8942 | (prompt.)57 b(If)630 1278 y(this)37 b(v)-5 b(ariable)38 |
| 9d2b70f0 | 8943 | b(is)f(unset,)h(or)f(set)h(to)g(a)f(v)-5 b(alue)38 b(that)f(is)g(not)h |
| 28157acd | 8944 | (a)f(n)m(um)m(b)s(er)f(greater)i(than)f(or)630 1387 y(equal)31 |
| 9d2b70f0 | 8945 | b(to)g(zero,)g(the)g(shell)g(disables)f(mail)h(c)m(hec)m(king.)150 |
| 28157acd CR |
8946 | 1548 y Fs(OLDPWD)192 b Ft(The)30 b(previous)g(w)m(orking)g(directory)h |
| 8947 | (as)g(set)g(b)m(y)f(the)h Fs(cd)e Ft(builtin.)150 1709 | |
| 9d2b70f0 CR |
8948 | y Fs(OPTERR)192 b Ft(If)35 b(set)i(to)f(the)h(v)-5 b(alue)36 |
| 8949 | b(1,)i(Bash)e(displa)m(ys)g(error)f(messages)i(generated)g(b)m(y)f(the) | |
| 28157acd CR |
8950 | g Fs(getopts)630 1819 y Ft(builtin)30 b(command.)150 |
| 8951 | 1979 y Fs(OSTYPE)192 b Ft(A)30 b(string)h(describing)f(the)g(op)s | |
| 8952 | (erating)h(system)g(Bash)f(is)h(running)d(on.)150 2140 | |
| 8953 | y Fs(PIPESTATUS)630 2250 y Ft(An)23 b(arra)m(y)h(v)-5 | |
| 8954 | b(ariable)24 b(\(see)h(Section)f(6.7)h([Arra)m(ys],)g(page)f(76\))h | |
| 8955 | (con)m(taining)g(a)f(list)g(of)g(exit)g(sta-)630 2359 | |
| 9d2b70f0 CR |
8956 | y(tus)h(v)-5 b(alues)27 b(from)e(the)h(pro)s(cesses)g(in)f(the)h |
| 8957 | (most-recen)m(tly-executed)j(foreground)c(pip)s(eline)630 | |
| 28157acd CR |
8958 | 2469 y(\(whic)m(h)30 b(ma)m(y)h(con)m(tain)h(only)f(a)f(single)h |
| 8959 | (command\).)150 2629 y Fs(POSIXLY_CORRECT)630 2739 y | |
| 37c41ab1 CR |
8960 | Ft(If)h(this)h(v)-5 b(ariable)34 b(is)f(in)f(the)h(en)m(vironmen)m(t)h |
| 8961 | (when)d Fs(bash)h Ft(starts,)i(the)f(shell)g(en)m(ters)h | |
| 28157acd CR |
8962 | Fl(posix)630 2849 y Ft(mo)s(de)22 b(\(see)h(Section)g(6.11)h([Bash)e |
| 8963 | (POSIX)f(Mo)s(de],)k(page)e(80\))g(b)s(efore)f(reading)g(the)g(startup) | |
| 8964 | 630 2958 y(\014les,)32 b(as)f(if)h(the)f(`)p Fs(--posix)p | |
| 37c41ab1 | 8965 | Ft(')f(in)m(v)m(o)s(cation)j(option)f(had)f(b)s(een)g(supplied.)42 |
| 28157acd | 8966 | b(If)31 b(it)h(is)f(set)h(while)630 3068 y(the)f(shell)f(is)h(running,) |
| 37c41ab1 | 8967 | d Fs(bash)i Ft(enables)g Fl(posix)g Ft(mo)s(de,)g(as)h(if)f(the)h |
| 28157acd CR |
8968 | (command)870 3203 y Fs(set)47 b(-o)g(posix)630 3338 y |
| 8969 | Ft(had)30 b(b)s(een)f(executed.)150 3499 y Fs(PPID)288 | |
| 8970 | b Ft(The)30 b(pro)s(cess)g Fl(id)g Ft(of)h(the)f(shell's)h(paren)m(t)g | |
| 8971 | (pro)s(cess.)40 b(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 | |
| 8972 | b(.)150 3660 y Fs(PROMPT_COMMAND)630 3769 y Ft(If)32 | |
| 8973 | b(set,)h(the)f(v)-5 b(alue)33 b(is)f(in)m(terpreted)g(as)g(a)h(command) | |
| 8974 | f(to)h(execute)g(b)s(efore)f(the)g(prin)m(ting)g(of)630 | |
| 8975 | 3879 y(eac)m(h)g(primary)d(prompt)g(\()p Fs($PS1)p Ft(\).)150 | |
| 8976 | 4040 y Fs(PS3)336 b Ft(The)34 b(v)-5 b(alue)35 b(of)f(this)g(v)-5 | |
| 8977 | b(ariable)35 b(is)g(used)e(as)i(the)f(prompt)g(for)g(the)g | |
| 8978 | Fs(select)f Ft(command.)52 b(If)630 4149 y(this)30 b(v)-5 | |
| 8979 | b(ariable)31 b(is)g(not)f(set,)i(the)e Fs(select)f Ft(command)h | |
| 8980 | (prompts)f(with)h(`)p Fs(#?)g Ft(')150 4310 y Fs(PS4)336 | |
| 8981 | b Ft(The)33 b(v)-5 b(alue)34 b(is)g(the)g(prompt)f(prin)m(ted)g(b)s | |
| 8982 | (efore)g(the)h(command)f(line)h(is)g(ec)m(ho)s(ed)g(when)f(the)630 | |
| 8983 | 4419 y(`)p Fs(-x)p Ft(')23 b(option)h(is)g(set)g(\(see)g(Section)h(4.3) | |
| 8984 | f([The)f(Set)h(Builtin],)i(page)e(53\).)40 b(The)23 b(\014rst)f(c)m | |
| 8985 | (haracter)630 4529 y(of)34 b Fs(PS4)g Ft(is)g(replicated)i(m)m(ultiple) | |
| 8986 | f(times,)h(as)e(necessary)-8 b(,)37 b(to)e(indicate)g(m)m(ultiple)g | |
| 8987 | (lev)m(els)h(of)630 4639 y(indirection.)41 b(The)30 b(default)h(is)f(`) | |
| 8988 | p Fs(+)g Ft('.)150 4799 y Fs(PWD)336 b Ft(The)30 b(curren)m(t)g(w)m | |
| 37c41ab1 | 8989 | (orking)h(directory)g(as)f(set)h(b)m(y)f(the)h Fs(cd)f |
| 28157acd | 8990 | Ft(builtin.)150 4960 y Fs(RANDOM)192 b Ft(Eac)m(h)30 |
| 37c41ab1 | 8991 | b(time)g(this)f(parameter)g(is)g(referenced,)h(a)f(random)g(in)m(teger) |
| 28157acd | 8992 | h(b)s(et)m(w)m(een)g(0)f(and)g(32767)630 5070 y(is)i(generated.)43 |
| 37c41ab1 CR |
8993 | b(Assigning)31 b(a)g(v)-5 b(alue)31 b(to)g(this)g(v)-5 |
| 8994 | b(ariable)31 b(seeds)g(the)g(random)f(n)m(um)m(b)s(er)f(gen-)630 | |
| 28157acd CR |
8995 | 5179 y(erator.)150 5340 y Fs(REPLY)240 b Ft(The)30 b(default)g(v)-5 |
| 8996 | b(ariable)32 b(for)e(the)g Fs(read)g Ft(builtin.)p eop | |
| 8997 | end | |
| 8998 | %%Page: 64 70 | |
| 8999 | TeXDict begin 64 69 bop 150 -116 a Ft(64)2572 b(Bash)31 | |
| 9000 | b(Reference)g(Man)m(ual)150 299 y Fs(SECONDS)144 b Ft(This)40 | |
| 9001 | b(v)-5 b(ariable)41 b(expands)f(to)h(the)g(n)m(um)m(b)s(er)e(of)i | |
| 9002 | (seconds)g(since)g(the)f(shell)h(w)m(as)g(started.)630 | |
| 9003 | 408 y(Assignmen)m(t)i(to)g(this)g(v)-5 b(ariable)43 b(resets)g(the)g | |
| 9004 | (coun)m(t)g(to)g(the)g(v)-5 b(alue)43 b(assigned,)j(and)c(the)630 | |
| 9005 | 518 y(expanded)35 b(v)-5 b(alue)36 b(b)s(ecomes)h(the)f(v)-5 | |
| 9006 | b(alue)36 b(assigned)g(plus)f(the)h(n)m(um)m(b)s(er)f(of)h(seconds)g | |
| 9007 | (since)630 628 y(the)31 b(assignmen)m(t.)150 779 y Fs(SHELL)240 | |
| 9d2b70f0 CR |
9008 | b Ft(The)29 b(full)h(pathname)g(to)h(the)f(shell)g(is)g(k)m(ept)g(in)g |
| 9009 | (this)g(en)m(vironmen)m(t)g(v)-5 b(ariable.)42 b(If)29 | |
| 28157acd CR |
9010 | b(it)i(is)f(not)630 889 y(set)36 b(when)f(the)h(shell)g(starts,)i(Bash) |
| 9011 | e(assigns)h(to)f(it)h(the)f(full)f(pathname)h(of)g(the)g(curren)m(t)630 | |
| 9012 | 999 y(user's)30 b(login)h(shell.)150 1150 y Fs(SHELLOPTS)630 | |
| 9013 | 1260 y Ft(A)g(colon-separated)h(list)f(of)g(enabled)f(shell)h(options.) | |
| 37c41ab1 | 9014 | 41 b(Eac)m(h)31 b(w)m(ord)f(in)g(the)h(list)g(is)g(a)g(v)-5 |
| 28157acd CR |
9015 | b(alid)630 1369 y(argumen)m(t)29 b(for)g(the)g(`)p Fs(-o)p |
| 9016 | Ft(')g(option)g(to)h(the)f Fs(set)f Ft(builtin)h(command)g(\(see)g | |
| 9017 | (Section)h(4.3)g([The)630 1479 y(Set)f(Builtin],)h(page)f(53\).)42 | |
| 37c41ab1 | 9018 | b(The)28 b(options)h(app)s(earing)f(in)g Fs(SHELLOPTS)e |
| 28157acd | 9019 | Ft(are)j(those)h(rep)s(orted)630 1589 y(as)g(`)p Fs(on)p |
| 37c41ab1 CR |
9020 | Ft(')f(b)m(y)h(`)p Fs(set)g(-o)p Ft('.)40 b(If)29 b(this)h(v)-5 |
| 9021 | b(ariable)30 b(is)g(in)f(the)h(en)m(vironmen)m(t)g(when)f(Bash)h | |
| 28157acd | 9022 | (starts)g(up,)630 1698 y(eac)m(h)41 b(shell)e(option)h(in)f(the)h(list) |
| 37c41ab1 | 9023 | g(will)f(b)s(e)g(enabled)h(b)s(efore)f(reading)g(an)m(y)h(startup)f |
| 28157acd CR |
9024 | (\014les.)630 1808 y(This)30 b(v)-5 b(ariable)31 b(is)f(readonly)-8 |
| 9025 | b(.)150 1960 y Fs(SHLVL)240 b Ft(Incremen)m(ted)21 b(b)m(y)g(one)g(eac) | |
| 37c41ab1 | 9026 | m(h)h(time)f(a)h(new)e(instance)h(of)g(Bash)g(is)g(started.)38 |
| 28157acd | 9027 | b(This)20 b(is)h(in)m(tended)630 2069 y(to)31 b(b)s(e)f(a)h(coun)m(t)g |
| 37c41ab1 | 9028 | (of)f(ho)m(w)h(deeply)f(y)m(our)g(Bash)h(shells)f(are)h(nested.)150 |
| 28157acd | 9029 | 2221 y Fs(TIMEFORMAT)630 2330 y Ft(The)f(v)-5 b(alue)32 |
| 37c41ab1 | 9030 | b(of)f(this)g(parameter)g(is)g(used)f(as)h(a)g(format)h(string)f(sp)s |
| 28157acd | 9031 | (ecifying)f(ho)m(w)h(the)g(tim-)630 2440 y(ing)37 b(information)f(for)h |
| 37c41ab1 | 9032 | (pip)s(elines)f(pre\014xed)f(with)h(the)h Fs(time)e Ft(reserv)m(ed)i(w) |
| 28157acd | 9033 | m(ord)f(should)g(b)s(e)630 2550 y(displa)m(y)m(ed.)k(The)27 |
| 37c41ab1 | 9034 | b(`)p Fs(\045)p Ft(')h(c)m(haracter)h(in)m(tro)s(duces)e(an)h(escap)s |
| 28157acd | 9035 | (e)g(sequence)g(that)g(is)f(expanded)g(to)630 2659 y(a)37 |
| 37c41ab1 CR |
9036 | b(time)g(v)-5 b(alue)36 b(or)h(other)f(information.)59 |
| 9037 | b(The)36 b(escap)s(e)g(sequences)h(and)e(their)i(meanings)630 | |
| 28157acd CR |
9038 | 2769 y(are)31 b(as)f(follo)m(ws;)i(the)f(braces)f(denote)h(optional)h |
| 9039 | (p)s(ortions.)630 2921 y Fs(\045\045)384 b Ft(A)30 b(literal)i(`)p | |
| 9040 | Fs(\045)p Ft('.)630 3072 y Fs(\045[)p Fj(p)11 b Fs(][l]R)85 | |
| 9041 | b Ft(The)30 b(elapsed)h(time)g(in)f(seconds.)630 3224 | |
| 5e13499c | 9042 | y Fs(\045[)p Fj(p)11 b Fs(][l]U)85 b Ft(The)30 b(n)m(um)m(b)s(er)f(of)h |
| 28157acd CR |
9043 | (CPU)g(seconds)h(sp)s(en)m(t)f(in)g(user)f(mo)s(de.)630 |
| 9044 | 3376 y Fs(\045[)p Fj(p)11 b Fs(][l]S)85 b Ft(The)30 b(n)m(um)m(b)s(er)f | |
| 9045 | (of)h(CPU)g(seconds)h(sp)s(en)m(t)f(in)g(system)g(mo)s(de.)630 | |
| 9046 | 3528 y Fs(\045P)384 b Ft(The)30 b(CPU)g(p)s(ercen)m(tage,)i(computed)e | |
| 9047 | (as)h(\(\045U)f Fs(+)g Ft(\045S\))g(/)h(\045R.)630 3679 | |
| 9048 | y(The)23 b(optional)j Fq(p)g Ft(is)e(a)g(digit)h(sp)s(ecifying)e(the)h | |
| 5cfe250d | 9049 | (precision,)i(the)e(n)m(um)m(b)s(er)f(of)h(fractional)h(digits)630 |
| 28157acd | 9050 | 3789 y(after)36 b(a)f(decimal)i(p)s(oin)m(t.)55 b(A)35 |
| 5cfe250d | 9051 | b(v)-5 b(alue)36 b(of)f(0)h(causes)g(no)f(decimal)h(p)s(oin)m(t)f(or)h |
| 28157acd | 9052 | (fraction)g(to)g(b)s(e)630 3898 y(output.)48 b(A)m(t)34 |
| 5cfe250d | 9053 | b(most)f(three)g(places)h(after)f(the)g(decimal)h(p)s(oin)m(t)f(ma)m(y) |
| 28157acd | 9054 | h(b)s(e)e(sp)s(eci\014ed;)i(v)-5 b(alues)630 4008 y(of)31 |
| 5cfe250d CR |
9055 | b Fq(p)h Ft(greater)g(than)e(3)h(are)f(c)m(hanged)h(to)g(3.)42 |
| 9056 | b(If)29 b Fq(p)k Ft(is)d(not)h(sp)s(eci\014ed,)f(the)h(v)-5 | |
| 28157acd | 9057 | b(alue)30 b(3)h(is)g(used.)630 4139 y(The)54 b(optional)h |
| 5cfe250d | 9058 | Fs(l)f Ft(sp)s(eci\014es)g(a)h(longer)f(format,)61 b(including)54 |
| 28157acd | 9059 | b(min)m(utes,)61 b(of)54 b(the)g(form)630 4248 y Fq(MM)10 |
| 5cfe250d CR |
9060 | b Ft(m)p Fq(SS)p Ft(.)p Fq(FF)d Ft(s.)103 b(The)50 b(v)-5 |
| 9061 | b(alue)52 b(of)f Fq(p)j Ft(determines)d(whether)f(or)h(not)h(the)f | |
| 28157acd | 9062 | (fraction)h(is)630 4358 y(included.)630 4489 y(If)30 |
| 5cfe250d | 9063 | b(this)g(v)-5 b(ariable)31 b(is)g(not)f(set,)i(Bash)e(acts)h(as)g(if)f |
| 28157acd | 9064 | (it)h(had)f(the)h(v)-5 b(alue)870 4619 y Fs |
| 5e13499c | 9065 | ($'\\nreal\\t\0453lR\\nuser\\t\0453)o(lU\\n)o(sys\\)o(t\0453)o(lS')630 |
| 28157acd | 9066 | 4750 y Ft(If)37 b(the)g(v)-5 b(alue)38 b(is)f(n)m(ull,)i(no)f(timing)f |
| 37c41ab1 | 9067 | (information)h(is)f(displa)m(y)m(ed.)62 b(A)37 b(trailing)i(newline)e |
| 28157acd CR |
9068 | (is)630 4859 y(added)30 b(when)f(the)i(format)f(string)h(is)f(displa)m |
| 9069 | (y)m(ed.)150 5011 y Fs(TMOUT)240 b Ft(If)22 b(set)h(to)g(a)g(v)-5 | |
| 37c41ab1 | 9070 | b(alue)23 b(greater)h(than)e(zero,)j Fs(TMOUT)d Ft(is)g(treated)i(as)e |
| 28157acd | 9071 | (the)h(default)g(timeout)g(for)g(the)630 5121 y Fs(read)31 |
| 37c41ab1 | 9072 | b Ft(builtin)h(\(see)h(Section)f(4.2)i([Bash)e(Builtins],)h(page)g |
| 28157acd | 9073 | (41\).)47 b(The)32 b Fs(select)e Ft(command)630 5230 |
| 37c41ab1 | 9074 | y(\(see)f(Section)h(3.2.4.2)g([Conditional)g(Constructs],)e(page)i |
| 28157acd | 9075 | (10\))f(terminates)g(if)g(input)e(do)s(es)630 5340 y(not)k(arriv)m(e)g |
| 37c41ab1 | 9076 | (after)g Fs(TMOUT)e Ft(seconds)h(when)f(input)h(is)g(coming)h(from)f(a) |
| 28157acd CR |
9077 | h(terminal.)p eop end |
| 9078 | %%Page: 65 71 | |
| 9079 | TeXDict begin 65 70 bop 150 -116 a Ft(Chapter)30 b(5:)41 | |
| 9080 | b(Shell)30 b(V)-8 b(ariables)2459 b(65)630 299 y(In)28 | |
| 9081 | b(an)h(in)m(terativ)m(e)i(shell,)e(the)g(v)-5 b(alue)30 | |
| 9082 | b(is)e(in)m(terpreted)h(as)g(the)g(n)m(um)m(b)s(er)f(of)h(seconds)f(to) | |
| 9083 | i(w)m(ait)630 408 y(for)i(input)f(after)i(issuing)f(the)g(primary)g | |
| 9084 | (prompt)f(when)g(the)i(shell)f(is)h(in)m(teractiv)m(e.)49 | |
| 9085 | b(Bash)630 518 y(terminates)31 b(after)g(that)g(n)m(um)m(b)s(er)e(of)i | |
| 9086 | (seconds)f(if)g(input)g(do)s(es)g(not)g(arriv)m(e.)150 | |
| 9087 | 677 y Fs(TMPDIR)192 b Ft(If)39 b(set,)j(Bash)e(uses)f(its)h(v)-5 | |
| 1c72c0cd | 9088 | b(alue)40 b(as)f(the)h(name)f(of)h(a)g(directory)g(in)f(whic)m(h)g |
| 28157acd CR |
9089 | (Bash)h(creates)630 787 y(temp)s(orary)30 b(\014les)g(for)g(the)h |
| 9090 | (shell's)g(use.)150 946 y Fs(UID)336 b Ft(The)30 b(n)m(umeric)g(real)h | |
| 1c72c0cd CR |
9091 | (user)f(id)g(of)g(the)h(curren)m(t)f(user.)40 b(This)30 |
| 9092 | b(v)-5 b(ariable)31 b(is)f(readonly)-8 b(.)p eop end | |
| 28157acd CR |
9093 | %%Page: 66 72 |
| 9094 | TeXDict begin 66 71 bop 150 -116 a Ft(66)2572 b(Bash)31 | |
| 9d2b70f0 | 9095 | b(Reference)g(Man)m(ual)p eop end |
| 28157acd CR |
9096 | %%Page: 67 73 |
| 9097 | TeXDict begin 67 72 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9098 | b(Bash)30 b(F)-8 b(eatures)2484 b(67)150 299 y Fo(6)80 | |
| 37c41ab1 CR |
9099 | b(Bash)54 b(F)-13 b(eatures)275 537 y Ft(This)29 b(section)j(describ)s |
| 9100 | (es)d(features)i(unique)e(to)j(Bash.)150 798 y Fr(6.1)68 | |
| 9101 | b(In)l(v)l(oking)46 b(Bash)390 1017 y Fs(bash)h([long-opt])e([-ir])h | |
| 5e13499c CR |
9102 | ([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)11 b Fs(])45 |
| 9103 | b([-O)i Fj(shopt_option)11 b Fs(])44 b([)p Fj(ar-)390 | |
| 9104 | 1127 y(gument)57 b Fs(...)o(])390 1236 y(bash)47 b([long-opt])e | |
| 9105 | ([-abefhkmnptuvxdBCDHP])c([-o)47 b Fj(option)11 b Fs(])46 | |
| 9106 | b([-O)g Fj(shopt_option)11 b Fs(])44 b(-c)j Fj(string)57 | |
| 9107 | b Fs([)p Fj(ar-)390 1346 y(gument)g Fs(...)o(])390 1455 | |
| 9108 | y(bash)47 b([long-opt])e(-s)i([-abefhkmnptuvxdBCDHP])42 | |
| 9109 | b([-o)k Fj(option)11 b Fs(])46 b([-O)h Fj(shopt_option)11 | |
| 9110 | b Fs(])43 b([)p Fj(ar-)390 1565 y(gument)57 b Fs(...)o(])275 | |
| 28157acd CR |
9111 | 1701 y Ft(In)28 b(addition)i(to)g(the)f(single-c)m(haracter)j(shell)e |
| 9112 | (command-line)g(options)g(\(see)g(Section)g(4.3)h([The)e(Set)150 | |
| 9113 | 1810 y(Builtin],)e(page)e(53\),)i(there)e(are)g(sev)m(eral)h(m)m | |
| 37c41ab1 | 9114 | (ulti-c)m(haracter)h(options)e(that)g(y)m(ou)g(can)g(use.)38 |
| 5e13499c | 9115 | b(These)25 b(options)150 1920 y(m)m(ust)30 b(app)s(ear)g(on)g(the)h |
| 37c41ab1 CR |
9116 | (command)f(line)h(b)s(efore)f(the)g(single-c)m(haracter)j(options)e(to) |
| 9117 | g(b)s(e)f(recognized.)150 2081 y Fs(--debugger)630 2191 | |
| 9118 | y Ft(Arrange)j(for)g(the)g(debugger)g(pro\014le)g(to)h(b)s(e)e | |
| 9119 | (executed)i(b)s(efore)f(the)g(shell)g(starts.)49 b(T)-8 | |
| 28157acd CR |
9120 | b(urns)630 2301 y(on)40 b(extended)g(debugging)g(mo)s(de)g(\(see)h |
| 9121 | (Section)f(4.2)h([Bash)g(Builtins],)i(page)e(41)g(for)f(a)630 | |
| 9122 | 2410 y(description)i(of)g(the)f Fs(extdebug)f Ft(option)i(to)g(the)g | |
| 9123 | Fs(shopt)f Ft(builtin\))g(and)g(shell)h(function)630 | |
| 9124 | 2520 y(tracing)36 b(\(see)g(Section)g(4.3)h([The)e(Set)g(Builtin],)j | |
| 9125 | (page)e(53)g(for)f(a)g(description)h(of)f(the)h Fs(-o)630 | |
| 9126 | 2629 y(functrace)28 b Ft(option\).)150 2790 y Fs(--dump-po-strings)630 | |
| 9127 | 2900 y Ft(A)37 b(list)g(of)f(all)i(double-quoted)e(strings)g(preceded)g | |
| 9128 | (b)m(y)h(`)p Fs($)p Ft(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 | |
| 9129 | 3009 y(output)24 b(in)h(the)g Fl(gnu)f Fs(gettext)f Ft(PO)i(\(p)s | |
| 9130 | (ortable)g(ob)5 b(ject\))26 b(\014le)f(format.)39 b(Equiv)-5 | |
| 9131 | b(alen)m(t)26 b(to)f(`)p Fs(-D)p Ft(')630 3119 y(except)31 | |
| 9132 | b(for)f(the)h(output)f(format.)150 3280 y Fs(--dump-strings)630 | |
| 9133 | 3389 y Ft(Equiv)-5 b(alen)m(t)31 b(to)g(`)p Fs(-D)p Ft('.)150 | |
| 9134 | 3550 y Fs(--help)192 b Ft(Displa)m(y)32 b(a)e(usage)h(message)h(on)e | |
| 9135 | (standard)g(output)g(and)f(exit)j(sucessfully)-8 b(.)150 | |
| 9136 | 3711 y Fs(--init-file)27 b Fj(filename)150 3820 y Fs(--rcfile)h | |
| 9137 | Fj(filename)630 3930 y Ft(Execute)42 b(commands)f(from)f | |
| 9138 | Fq(\014lename)47 b Ft(\(instead)42 b(of)f(`)p Fs(~/.bashrc)p | |
| 9139 | Ft('\))e(in)i(an)g(in)m(teractiv)m(e)630 4039 y(shell.)150 | |
| 9140 | 4200 y Fs(--login)144 b Ft(Equiv)-5 b(alen)m(t)31 b(to)g(`)p | |
| 9141 | Fs(-l)p Ft('.)150 4361 y Fs(--noediting)630 4471 y Ft(Do)h(not)e(use)h | |
| 9142 | (the)g Fl(gnu)f Ft(Readline)i(library)e(\(see)h(Chapter)g(8)g([Command) | |
| 9143 | f(Line)g(Editing],)630 4580 y(page)h(89\))h(to)f(read)f(command)g | |
| 9144 | (lines)h(when)e(the)i(shell)f(is)h(in)m(teractiv)m(e.)150 | |
| 9145 | 4741 y Fs(--noprofile)630 4850 y Ft(Don't)h(load)f(the)g(system-wide)g | |
| 37c41ab1 CR |
9146 | (startup)f(\014le)g(`)p Fs(/etc/profile)p Ft(')e(or)j(an)m(y)g(of)g |
| 9147 | (the)f(p)s(ersonal)630 4960 y(initialization)g(\014les)d(`)p | |
| 9148 | Fs(~/.bash_profile)p Ft(',)e(`)p Fs(~/.bash_login)p Ft(',)g(or)i(`)p | |
| 9149 | Fs(~/.profile)p Ft(')e(when)630 5070 y(Bash)31 b(is)f(in)m(v)m(ok)m(ed) | |
| 9150 | i(as)e(a)h(login)g(shell.)150 5230 y Fs(--norc)192 b | |
| 9151 | Ft(Don't)31 b(read)g(the)f(`)p Fs(~/.bashrc)p Ft(')f(initialization)k | |
| 9152 | (\014le)d(in)g(an)h(in)m(teractiv)m(e)i(shell.)41 b(This)30 | |
| 9153 | b(is)g(on)630 5340 y(b)m(y)g(default)h(if)f(the)h(shell)f(is)h(in)m(v)m | |
| 9154 | (ok)m(ed)h(as)e Fs(sh)p Ft(.)p eop end | |
| 28157acd CR |
9155 | %%Page: 68 74 |
| 9156 | TeXDict begin 68 73 bop 150 -116 a Ft(68)2572 b(Bash)31 | |
| 37c41ab1 CR |
9157 | b(Reference)g(Man)m(ual)150 299 y Fs(--posix)144 b Ft(Change)24 |
| 9158 | b(the)h(b)s(eha)m(vior)f(of)g(Bash)h(where)e(the)i(default)f(op)s | |
| 9159 | (eration)h(di\013ers)f(from)f(the)i Fl(posix)630 408 | |
| ac18b312 CR |
9160 | y Ft(standard)35 b(to)h(matc)m(h)g(the)g(standard.)55 |
| 9161 | b(This)35 b(is)h(in)m(tended)f(to)h(mak)m(e)h(Bash)f(b)s(eha)m(v)m(e)g | |
| 9162 | (as)g(a)630 518 y(strict)26 b(sup)s(erset)e(of)h(that)g(standard.)38 | |
| 28157acd | 9163 | b(See)26 b(Section)f(6.11)i([Bash)e(POSIX)f(Mo)s(de],)j(page)f(80,)630 |
| ac18b312 CR |
9164 | 628 y(for)k(a)h(description)f(of)h(the)f(Bash)h Fl(posix)f |
| 9165 | Ft(mo)s(de.)150 787 y Fs(--restricted)630 897 y Ft(Mak)m(e)54 | |
| 37c41ab1 | 9166 | b(the)e(shell)g(a)h(restricted)g(shell)f(\(see)h(Section)g(6.10)h([The) |
| 28157acd | 9167 | d(Restricted)j(Shell],)630 1006 y(page)31 b(80\).)150 |
| ac18b312 CR |
9168 | 1166 y Fs(--verbose)630 1275 y Ft(Equiv)-5 b(alen)m(t)31 |
| 9169 | b(to)g(`)p Fs(-v)p Ft('.)41 b(Prin)m(t)30 b(shell)h(input)e(lines)i(as) | |
| 9170 | g(they're)f(read.)150 1435 y Fs(--version)630 1544 y | |
| 9171 | Ft(Sho)m(w)e(v)m(ersion)g(information)g(for)g(this)g(instance)h(of)f | |
| 9172 | (Bash)g(on)g(the)g(standard)f(output)h(and)630 1654 y(exit)j | |
| 9173 | (successfully)-8 b(.)275 1813 y(There)28 b(are)i(sev)m(eral)g(single-c) | |
| 9174 | m(haracter)i(options)d(that)h(ma)m(y)g(b)s(e)e(supplied)g(at)i(in)m(v)m | |
| 9175 | (o)s(cation)h(whic)m(h)e(are)150 1923 y(not)i(a)m(v)-5 | |
| 9176 | b(ailable)32 b(with)e(the)h Fs(set)e Ft(builtin.)150 | |
| 9177 | 2082 y Fs(-c)h Fj(string)630 2192 y Ft(Read)23 b(and)f(execute)i | |
| 9178 | (commands)f(from)f Fq(string)31 b Ft(after)23 b(pro)s(cessing)f(the)h | |
| 9179 | (options,)i(then)e(exit.)630 2301 y(An)m(y)37 b(remaining)f(argumen)m | |
| 9180 | (ts)h(are)g(assigned)g(to)g(the)g(p)s(ositional)g(parameters,)i | |
| 9181 | (starting)630 2411 y(with)30 b Fs($0)p Ft(.)150 2570 | |
| 9182 | y Fs(-i)384 b Ft(F)-8 b(orce)22 b(the)g(shell)f(to)g(run)f(in)m | |
| 9183 | (teractiv)m(ely)-8 b(.)41 b(In)m(teractiv)m(e)23 b(shells)e(are)h | |
| 9184 | (describ)s(ed)d(in)i(Section)h(6.3)630 2680 y([In)m(teractiv)m(e)33 | |
| 28157acd | 9185 | b(Shells],)e(page)g(71.)150 2839 y Fs(-l)384 b Ft(Mak)m(e)33 |
| ac18b312 CR |
9186 | b(this)e(shell)h(act)g(as)g(if)f(it)h(had)f(b)s(een)f(directly)i(in)m |
| 9187 | (v)m(ok)m(ed)h(b)m(y)f(login.)44 b(When)31 b(the)h(shell)630 | |
| 9188 | 2949 y(is)37 b(in)m(teractiv)m(e,)43 b(this)37 b(is)g(equiv)-5 | |
| 9189 | b(alen)m(t)39 b(to)f(starting)h(a)e(login)i(shell)e(with)g(`)p | |
| 9190 | Fs(exec)30 b(-l)g(bash)p Ft('.)630 3059 y(When)h(the)g(shell)h(is)f | |
| 9191 | (not)g(in)m(teractiv)m(e,)k(the)c(login)h(shell)g(startup)f(\014les)g | |
| 9192 | (will)g(b)s(e)g(executed.)630 3168 y(`)p Fs(exec)e(bash)h(-l)p | |
| 9193 | Ft(')43 b(or)h(`)p Fs(exec)29 b(bash)g(--login)p Ft(')42 | |
| 9194 | b(will)i(replace)h(the)f(curren)m(t)f(shell)h(with)g(a)630 | |
| 9195 | 3278 y(Bash)26 b(login)g(shell.)39 b(See)26 b(Section)g(6.2)h([Bash)e | |
| 28157acd | 9196 | (Startup)g(Files],)j(page)e(69,)i(for)d(a)h(description)630 |
| ac18b312 CR |
9197 | 3387 y(of)31 b(the)f(sp)s(ecial)h(b)s(eha)m(vior)g(of)f(a)h(login)g |
| 9198 | (shell.)150 3547 y Fs(-r)384 b Ft(Mak)m(e)54 b(the)e(shell)g(a)h | |
| 9199 | (restricted)g(shell)f(\(see)h(Section)g(6.10)h([The)d(Restricted)j | |
| 28157acd | 9200 | (Shell],)630 3656 y(page)31 b(80\).)150 3816 y Fs(-s)384 |
| ac18b312 CR |
9201 | b Ft(If)24 b(this)h(option)h(is)f(presen)m(t,)h(or)f(if)g(no)f(argumen) |
| 9202 | m(ts)i(remain)e(after)i(option)f(pro)s(cessing,)h(then)630 | |
| 9203 | 3925 y(commands)i(are)h(read)g(from)f(the)h(standard)f(input.)39 | |
| 9204 | b(This)28 b(option)h(allo)m(ws)h(the)f(p)s(ositional)630 | |
| 37c41ab1 CR |
9205 | 4035 y(parameters)i(to)g(b)s(e)f(set)g(when)g(in)m(v)m(oking)h(an)g(in) |
| 9206 | m(teractiv)m(e)i(shell.)150 4194 y Fs(-D)384 b Ft(A)37 | |
| 9207 | b(list)g(of)f(all)i(double-quoted)e(strings)g(preceded)g(b)m(y)h(`)p | |
| 9208 | Fs($)p Ft(')f(is)h(prin)m(ted)f(on)g(the)h(standard)630 | |
| eb2bb562 CR |
9209 | 4304 y(output.)63 b(These)38 b(are)g(the)g(strings)g(that)h(are)f(sub)5 |
| 9210 | b(ject)38 b(to)h(language)g(translation)g(when)630 4413 | |
| 9211 | y(the)e(curren)m(t)g(lo)s(cale)h(is)f(not)g Fs(C)g Ft(or)f | |
| 9212 | Fs(POSIX)g Ft(\(see)h(Section)h(3.1.2.5)h([Lo)s(cale)g(T)-8 | |
| 37c41ab1 CR |
9213 | b(ranslation],)630 4523 y(page)31 b(7\).)42 b(This)29 |
| 9214 | b(implies)i(the)f(`)p Fs(-n)p Ft(')h(option;)g(no)f(commands)g(will)h | |
| 9215 | (b)s(e)e(executed.)150 4682 y Fs([-+]O)g([)p Fj(shopt_option)11 | |
| 9216 | b Fs(])630 4792 y Fq(shopt)p 854 4792 28 4 v 40 w(option)44 | |
| 9217 | b Ft(is)g(one)h(of)f(the)g(shell)h(options)f(accepted)h(b)m(y)f(the)h | |
| 28157acd CR |
9218 | Fs(shopt)d Ft(builtin)i(\(see)630 4902 y(Chapter)29 b(4)i([Shell)f |
| 9219 | (Builtin)g(Commands],)g(page)g(35\).)42 b(If)30 b Fq(shopt)p | |
| 9220 | 2856 4902 V 39 w(option)h Ft(is)f(presen)m(t,)g(`)p Fs(-O)p | |
| 9221 | Ft(')630 5011 y(sets)39 b(the)f(v)-5 b(alue)39 b(of)f(that)h(option;)k | |
| 9222 | (`)p Fs(+O)p Ft(')38 b(unsets)g(it.)65 b(If)38 b Fq(shopt)p | |
| 9223 | 2803 5011 V 39 w(option)h Ft(is)f(not)h(supplied,)630 | |
| 9224 | 5121 y(the)28 b(names)f(and)h(v)-5 b(alues)28 b(of)f(the)h(shell)g | |
| 9225 | (options)g(accepted)h(b)m(y)f Fs(shopt)e Ft(are)i(prin)m(ted)f(on)h | |
| 9226 | (the)630 5230 y(standard)33 b(output.)50 b(If)33 b(the)h(in)m(v)m(o)s | |
| 9227 | (cation)i(option)e(is)g(`)p Fs(+O)p Ft(',)g(the)g(output)f(is)h(displa) | |
| 9228 | m(y)m(ed)g(in)g(a)630 5340 y(format)d(that)g(ma)m(y)g(b)s(e)e(reused)h | |
| 9229 | (as)h(input.)p eop end | |
| 9230 | %%Page: 69 75 | |
| 9231 | TeXDict begin 69 74 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9232 | b(Bash)30 b(F)-8 b(eatures)2484 b(69)150 299 y Fs(--)384 | |
| 37c41ab1 CR |
9233 | b Ft(A)38 b Fs(--)g Ft(signals)g(the)h(end)e(of)i(options)f(and)g |
| 9234 | (disables)g(further)f(option)h(pro)s(cessing.)64 b(An)m(y)630 | |
| 9235 | 408 y(argumen)m(ts)31 b(after)g(the)f Fs(--)g Ft(are)h(treated)g(as)g | |
| 9236 | (\014lenames)f(and)g(argumen)m(ts.)275 575 y(A)d Fm(lo)-5 | |
| 9237 | b(gin)35 b Ft(shell)27 b(is)g(one)h(whose)f(\014rst)f(c)m(haracter)j | |
| 9238 | (of)e(argumen)m(t)h(zero)f(is)h(`)p Fs(-)p Ft(',)g(or)f(one)g(in)m(v)m | |
| 9239 | (ok)m(ed)i(with)e(the)150 685 y(`)p Fs(--login)p Ft(')i(option.)275 | |
| 9240 | 825 y(An)24 b Fm(inter)-5 b(active)33 b Ft(shell)25 b(is)g(one)g | |
| 9241 | (started)g(without)g(non-option)h(argumen)m(ts,)g(unless)f(`)p | |
| 9242 | Fs(-s)p Ft(')f(is)h(sp)s(eci\014ed,)150 934 y(without)43 | |
| 9243 | b(sp)s(ecifying)f(the)i(`)p Fs(-c)p Ft(')e(option,)47 | |
| 9244 | b(and)42 b(whose)h(input)f(and)g(output)g(are)h(b)s(oth)g(connected)g | |
| 9245 | (to)150 1044 y(terminals)22 b(\(as)h(determined)f(b)m(y)g | |
| 9246 | Fs(isatty\(3\))p Ft(\),)f(or)i(one)f(started)g(with)g(the)g(`)p | |
| 9247 | Fs(-i)p Ft(')g(option.)39 b(See)22 b(Section)h(6.3)150 | |
| 28157acd | 9248 | 1153 y([In)m(teractiv)m(e)33 b(Shells],)e(page)g(71,)g(for)f(more)h |
| 37c41ab1 CR |
9249 | (information.)275 1293 y(If)38 b(argumen)m(ts)h(remain)g(after)g |
| 9250 | (option)h(pro)s(cessing,)h(and)d(neither)h(the)g(`)p | |
| 9251 | Fs(-c)p Ft(')f(nor)h(the)g(`)p Fs(-s)p Ft(')f(option)150 | |
| 9252 | 1403 y(has)33 b(b)s(een)g(supplied,)h(the)g(\014rst)e(argumen)m(t)j(is) | |
| 9253 | e(assumed)g(to)h(b)s(e)f(the)h(name)g(of)g(a)g(\014le)g(con)m(taining)h | |
| 9254 | (shell)150 1512 y(commands)30 b(\(see)g(Section)h(3.8)g([Shell)f | |
| eb2bb562 | 9255 | (Scripts],)g(page)h(32\).)41 b(When)30 b(Bash)g(is)g(in)m(v)m(ok)m(ed)i |
| 37c41ab1 CR |
9256 | (in)d(this)h(fashion,)150 1622 y Fs($0)37 b Ft(is)g(set)h(to)h(the)e |
| 9257 | (name)h(of)f(the)h(\014le,)i(and)c(the)i(p)s(ositional)g(parameters)g | |
| 9258 | (are)g(set)g(to)g(the)g(remaining)150 1731 y(argumen)m(ts.)h(Bash)26 | |
| 9259 | b(reads)f(and)g(executes)h(commands)f(from)g(this)g(\014le,)i(then)e | |
| 9260 | (exits.)40 b(Bash's)25 b(exit)i(status)150 1841 y(is)f(the)h(exit)h | |
| 9261 | (status)e(of)h(the)g(last)g(command)f(executed)h(in)g(the)f(script.)40 | |
| 9262 | b(If)26 b(no)g(commands)g(are)h(executed,)150 1951 y(the)k(exit)g | |
| 9263 | (status)g(is)f(0.)150 2221 y Fr(6.2)68 b(Bash)45 b(Startup)g(Files)275 | |
| 28157acd CR |
9264 | 2470 y Ft(This)36 b(section)j(describs)e(ho)m(w)g(Bash)h(executes)h |
| 9265 | (its)f(startup)f(\014les.)62 b(If)37 b(an)m(y)h(of)g(the)g(\014les)f | |
| 9266 | (exist)i(but)150 2579 y(cannot)26 b(b)s(e)e(read,)i(Bash)f(rep)s(orts)g | |
| 37c41ab1 CR |
9267 | (an)g(error.)38 b(Tildes)25 b(are)h(expanded)e(in)g(\014le)i(names)f |
| 9268 | (as)g(describ)s(ed)f(ab)s(o)m(v)m(e)150 2689 y(under)29 | |
| 9269 | b(Tilde)h(Expansion)g(\(see)h(Section)g(3.5.2)i([Tilde)d(Expansion],)g | |
| 9270 | (page)i(18\).)275 2828 y(In)m(teractiv)m(e)g(shells)f(are)g(describ)s | |
| 28157acd | 9271 | (ed)e(in)h(Section)h(6.3)h([In)m(teractiv)m(e)h(Shells],)d(page)h(71.) |
| 37c41ab1 CR |
9272 | 150 3063 y Fk(In)m(v)m(ok)m(ed)40 b(as)h(an)f(in)m(teractiv)m(e)f |
| 9273 | (login)j(shell,)g(or)g(with)e(`)p Fi(--login)p Fk(')275 | |
| 9274 | 3312 y Ft(When)e(Bash)g(is)h(in)m(v)m(ok)m(ed)h(as)e(an)g(in)m | |
| 9275 | (teractiv)m(e)k(login)d(shell,)i(or)d(as)h(a)g(non-in)m(teractiv)m(e)i | |
| 9276 | (shell)d(with)150 3422 y(the)d(`)p Fs(--login)p Ft(')d(option,)37 | |
| 9277 | b(it)d(\014rst)g(reads)g(and)g(executes)i(commands)e(from)f(the)i | |
| 9278 | (\014le)g(`)p Fs(/etc/profile)p Ft(',)150 3531 y(if)28 | |
| 9279 | b(that)h(\014le)f(exists.)41 b(After)28 b(reading)h(that)f(\014le,)h | |
| 9280 | (it)g(lo)s(oks)g(for)f(`)p Fs(~/.bash_profile)p Ft(',)d(`)p | |
| 9281 | Fs(~/.bash_login)p Ft(',)150 3641 y(and)j(`)p Fs(~/.profile)p | |
| 9282 | Ft(',)f(in)i(that)g(order,)g(and)f(reads)g(and)h(executes)h(commands)e | |
| 9283 | (from)g(the)h(\014rst)f(one)h(that)150 3750 y(exists)i(and)e(is)h | |
| 9284 | (readable.)41 b(The)30 b(`)p Fs(--noprofile)p Ft(')d(option)k(ma)m(y)f | |
| 9285 | (b)s(e)g(used)f(when)g(the)h(shell)h(is)f(started)g(to)150 | |
| 9286 | 3860 y(inhibit)g(this)g(b)s(eha)m(vior.)275 3999 y(When)72 | |
| 9287 | b(a)i(login)g(shell)f(exits,)85 b(Bash)73 b(reads)g(and)g(executes)h | |
| 9288 | (commands)f(from)g(the)g(\014le)150 4109 y(`)p Fs(~/.bash_logout)p | |
| 9289 | Ft(',)27 b(if)k(it)f(exists.)150 4343 y Fk(In)m(v)m(ok)m(ed)40 | |
| 9290 | b(as)h(an)f(in)m(teractiv)m(e)f(non-login)k(shell)275 | |
| 9291 | 4592 y Ft(When)35 b(an)g(in)m(teractiv)m(e)j(shell)e(that)f(is)h(not)f | |
| 9292 | (a)h(login)g(shell)g(is)f(started,)i(Bash)f(reads)f(and)g(executes)150 | |
| 9293 | 4702 y(commands)24 b(from)f(`)p Fs(~/.bashrc)p Ft(',)h(if)g(that)g | |
| 9294 | (\014le)g(exists.)40 b(This)23 b(ma)m(y)i(b)s(e)e(inhibited)g(b)m(y)h | |
| 9295 | (using)g(the)g(`)p Fs(--norc)p Ft(')150 4812 y(option.)52 | |
| 9296 | b(The)33 b(`)p Fs(--rcfile)28 b Fj(file)11 b Ft(')33 | |
| 9297 | b(option)h(will)g(force)h(Bash)f(to)h(read)e(and)h(execute)h(commands)e | |
| 9298 | (from)150 4921 y Fq(\014le)j Ft(instead)30 b(of)h(`)p | |
| 9299 | Fs(~/.bashrc)p Ft('.)275 5061 y(So,)f(t)m(ypically)-8 | |
| 9300 | b(,)33 b(y)m(our)d(`)p Fs(~/.bash_profile)p Ft(')d(con)m(tains)32 | |
| 9301 | b(the)e(line)390 5200 y Fs(if)47 b([)h(-f)f(~/.bashrc)e(];)i(then)g(.)g | |
| 9302 | (~/.bashrc;)e(fi)150 5340 y Ft(after)31 b(\(or)g(b)s(efore\))f(an)m(y)h | |
| 9303 | (login-sp)s(eci\014c)g(initializations.)p eop end | |
| 28157acd CR |
9304 | %%Page: 70 76 |
| 9305 | TeXDict begin 70 75 bop 150 -116 a Ft(70)2572 b(Bash)31 | |
| 37c41ab1 CR |
9306 | b(Reference)g(Man)m(ual)150 299 y Fk(In)m(v)m(ok)m(ed)40 |
| 9307 | b(non-in)m(teractiv)m(ely)275 571 y Ft(When)24 b(Bash)h(is)g(started)g | |
| 9308 | (non-in)m(teractiv)m(ely)-8 b(,)29 b(to)d(run)d(a)i(shell)g(script,)h | |
| 9309 | (for)f(example,)i(it)e(lo)s(oks)g(for)g(the)150 680 y(v)-5 | |
| 9310 | b(ariable)35 b Fs(BASH_ENV)d Ft(in)i(the)h(en)m(vironmen)m(t,)h | |
| 9311 | (expands)e(its)g(v)-5 b(alue)35 b(if)g(it)g(app)s(ears)e(there,)j(and)e | |
| 9312 | (uses)g(the)150 790 y(expanded)c(v)-5 b(alue)30 b(as)h(the)g(name)f(of) | |
| 9313 | h(a)f(\014le)h(to)g(read)f(and)g(execute.)42 b(Bash)31 | |
| 9314 | b(b)s(eha)m(v)m(es)g(as)g(if)f(the)g(follo)m(wing)150 | |
| 9315 | 900 y(command)g(w)m(ere)h(executed:)390 1062 y Fs(if)47 | |
| 9316 | b([)h(-n)f("$BASH_ENV")e(];)i(then)f(.)i("$BASH_ENV";)c(fi)150 | |
| 9317 | 1224 y Ft(but)30 b(the)g(v)-5 b(alue)31 b(of)g(the)f | |
| 9318 | Fs(PATH)f Ft(v)-5 b(ariable)32 b(is)e(not)h(used)e(to)i(searc)m(h)g | |
| 9319 | (for)f(the)h(\014le)f(name.)275 1387 y(As)38 b(noted)h(ab)s(o)m(v)m(e,) | |
| 9320 | j(if)c(a)h(non-in)m(teractiv)m(e)i(shell)e(is)g(in)m(v)m(ok)m(ed)h | |
| 9321 | (with)e(the)g(`)p Fs(--login)p Ft(')g(option,)j(Bash)150 | |
| 5e13499c | 9322 | 1496 y(attempts)31 b(to)g(read)g(and)e(execute)j(commands)e(from)g(the) |
| 37c41ab1 CR |
9323 | h(login)g(shell)g(startup)e(\014les.)150 1776 y Fk(In)m(v)m(ok)m(ed)40 |
| 9324 | b(with)g(name)h Fi(sh)275 2048 y Ft(If)29 b(Bash)g(is)h(in)m(v)m(ok)m | |
| 9325 | (ed)h(with)e(the)h(name)f Fs(sh)p Ft(,)g(it)i(tries)e(to)i(mimic)f(the) | |
| 9326 | f(startup)g(b)s(eha)m(vior)h(of)g(historical)150 2158 | |
| 9327 | y(v)m(ersions)h(of)f Fs(sh)g Ft(as)h(closely)h(as)e(p)s(ossible,)g | |
| 9328 | (while)h(conforming)f(to)h(the)g Fl(posix)e Ft(standard)h(as)h(w)m | |
| 9329 | (ell.)275 2320 y(When)50 b(in)m(v)m(ok)m(ed)j(as)f(an)f(in)m(teractiv)m | |
| 9330 | (e)j(login)e(shell,)57 b(or)51 b(as)g(a)h(non-in)m(teractiv)m(e)h | |
| 9331 | (shell)f(with)f(the)150 2430 y(`)p Fs(--login)p Ft(')39 | |
| 9332 | b(option,)k(it)e(\014rst)e(attempts)i(to)g(read)f(and)g(execute)h | |
| 9333 | (commands)f(from)g(`)p Fs(/etc/profile)p Ft(')150 2539 | |
| 9334 | y(and)d(`)p Fs(~/.profile)p Ft(',)g(in)g(that)h(order.)62 | |
| 9335 | b(The)37 b(`)p Fs(--noprofile)p Ft(')e(option)j(ma)m(y)g(b)s(e)f(used)g | |
| 9336 | (to)h(inhibit)f(this)150 2649 y(b)s(eha)m(vior.)82 b(When)44 | |
| 9337 | b(in)m(v)m(ok)m(ed)h(as)g(an)f(in)m(teractiv)m(e)j(shell)d(with)g(the)g | |
| 9338 | (name)g Fs(sh)p Ft(,)j(Bash)d(lo)s(oks)h(for)f(the)150 | |
| 9339 | 2759 y(v)-5 b(ariable)37 b Fs(ENV)p Ft(,)g(expands)e(its)i(v)-5 | |
| 9340 | b(alue)36 b(if)g(it)h(is)f(de\014ned,)h(and)e(uses)h(the)g(expanded)g | |
| 9341 | (v)-5 b(alue)36 b(as)h(the)f(name)150 2868 y(of)i(a)h(\014le)g(to)g | |
| 9342 | (read)f(and)g(execute.)66 b(Since)38 b(a)h(shell)f(in)m(v)m(ok)m(ed)i | |
| 9343 | (as)f Fs(sh)e Ft(do)s(es)h(not)h(attempt)g(to)g(read)g(and)150 | |
| 9344 | 2978 y(execute)i(commands)e(from)g(an)m(y)h(other)g(startup)f(\014les,) | |
| 9345 | j(the)e(`)p Fs(--rcfile)p Ft(')d(option)j(has)g(no)f(e\013ect.)70 | |
| 9346 | b(A)150 3087 y(non-in)m(teractiv)m(e)32 b(shell)d(in)m(v)m(ok)m(ed)h | |
| 9347 | (with)f(the)g(name)g Fs(sh)f Ft(do)s(es)g(not)i(attempt)g(to)f(read)g | |
| 5e13499c | 9348 | (an)m(y)g(other)g(startup)150 3197 y(\014les.)275 3359 |
| 37c41ab1 CR |
9349 | y(When)h(in)m(v)m(ok)m(ed)h(as)g Fs(sh)p Ft(,)f(Bash)h(en)m(ters)g |
| 9350 | Fl(posix)e Ft(mo)s(de)h(after)h(the)g(startup)f(\014les)g(are)h(read.) | |
| 5e13499c | 9351 | 150 3639 y Fk(In)m(v)m(ok)m(ed)40 b(in)h Fh(posix)f Fk(mo)s(de)275 |
| 37c41ab1 CR |
9352 | 3911 y Ft(When)d(Bash)g(is)g(started)h(in)f Fl(posix)f |
| 9353 | Ft(mo)s(de,)j(as)e(with)g(the)h(`)p Fs(--posix)p Ft(')d(command)i(line) | |
| 9354 | h(option,)h(it)150 4021 y(follo)m(ws)28 b(the)g Fl(posix)e | |
| 9355 | Ft(standard)h(for)g(startup)g(\014les.)39 b(In)27 b(this)g(mo)s(de,)g | |
| 9356 | (in)m(teractiv)m(e)k(shells)c(expand)f(the)i Fs(ENV)150 | |
| 9357 | 4131 y Ft(v)-5 b(ariable)36 b(and)f(commands)g(are)h(read)g(and)f | |
| 9358 | (executed)h(from)f(the)h(\014le)g(whose)f(name)g(is)h(the)g(expanded) | |
| 9359 | 150 4240 y(v)-5 b(alue.)41 b(No)31 b(other)g(startup)f(\014les)g(are)h | |
| 9360 | (read.)150 4520 y Fk(In)m(v)m(ok)m(ed)40 b(b)m(y)g(remote)h(shell)h | |
| 9361 | (daemon)275 4792 y Ft(Bash)34 b(attempts)i(to)f(determine)g(when)e(it)i | |
| 9362 | (is)g(b)s(eing)f(run)f(b)m(y)h(the)h(remote)h(shell)e(daemon,)i | |
| 9363 | (usually)150 4902 y Fs(rshd)p Ft(.)60 b(If)36 b(Bash)h(determines)g(it) | |
| 9364 | h(is)f(b)s(eing)g(run)e(b)m(y)i(rshd,)h(it)f(reads)g(and)f(executes)j | |
| 9365 | (commands)d(from)150 5011 y(`)p Fs(~/.bashrc)p Ft(',)h(if)g(that)g | |
| 9366 | (\014le)g(exists)h(and)e(is)h(readable.)62 b(It)37 b(will)g(not)g(do)g | |
| 9367 | (this)g(if)g(in)m(v)m(ok)m(ed)h(as)g Fs(sh)p Ft(.)59 | |
| 9368 | b(The)150 5121 y(`)p Fs(--norc)p Ft(')34 b(option)i(ma)m(y)h(b)s(e)e | |
| 9369 | (used)f(to)j(inhibit)e(this)g(b)s(eha)m(vior,)j(and)d(the)g(`)p | |
| 9370 | Fs(--rcfile)p Ft(')f(option)i(ma)m(y)h(b)s(e)150 5230 | |
| 9371 | y(used)25 b(to)h(force)g(another)g(\014le)f(to)i(b)s(e)e(read,)h(but)f | |
| 9372 | Fs(rshd)g Ft(do)s(es)g(not)g(generally)i(in)m(v)m(ok)m(e)h(the)d(shell) | |
| 9373 | h(with)f(those)150 5340 y(options)31 b(or)f(allo)m(w)i(them)e(to)h(b)s | |
| 9374 | (e)f(sp)s(eci\014ed.)p eop end | |
| 28157acd CR |
9375 | %%Page: 71 77 |
| 9376 | TeXDict begin 71 76 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9377 | b(Bash)30 b(F)-8 b(eatures)2484 b(71)150 299 y Fk(In)m(v)m(ok)m(ed)40 | |
| 5e13499c | 9378 | b(with)g(unequal)h(e\013ectiv)m(e)e(and)i(real)g Fh(uid/gid)p |
| 37c41ab1 CR |
9379 | Fk(s)275 538 y Ft(If)26 b(Bash)i(is)f(started)h(with)f(the)g |
| 9380 | (e\013ectiv)m(e)j(user)d(\(group\))g(id)g(not)h(equal)g(to)g(the)f | |
| 9381 | (real)h(user)f(\(group\))g(id,)150 648 y(and)f(the)i | |
| 9382 | Fs(-p)e Ft(option)h(is)g(not)h(supplied,)e(no)h(startup)g(\014les)g | |
| 9383 | (are)g(read,)h(shell)f(functions)g(are)g(not)g(inherited)150 | |
| 9384 | 757 y(from)g(the)h(en)m(vironmen)m(t,)h(the)f Fs(SHELLOPTS)d | |
| 9385 | Ft(v)-5 b(ariable,)29 b(if)f(it)g(app)s(ears)f(in)g(the)h(en)m | |
| 9386 | (vironmen)m(t,)h(is)f(ignored,)150 867 y(and)f(the)h(e\013ectiv)m(e)j | |
| 9387 | (user)c(id)g(is)h(set)g(to)h(the)f(real)g(user)f(id.)40 | |
| 9388 | b(If)27 b(the)h Fs(-p)g Ft(option)g(is)g(supplied)e(at)j(in)m(v)m(o)s | |
| 9389 | (cation,)150 977 y(the)i(startup)f(b)s(eha)m(vior)g(is)g(the)h(same,)g | |
| 9390 | (but)f(the)g(e\013ectiv)m(e)j(user)d(id)g(is)g(not)h(reset.)150 | |
| 9391 | 1220 y Fr(6.3)68 b(In)l(teractiv)l(e)47 b(Shells)150 | |
| 5e13499c | 9392 | 1540 y Fk(6.3.1)63 b(What)40 b(is)h(an)g(In)m(teractiv)m(e)e(Shell?)275 |
| 37c41ab1 CR |
9393 | 1779 y Ft(An)25 b(in)m(teractiv)m(e)j(shell)d(is)h(one)f(started)h |
| 9394 | (without)g(non-option)f(argumen)m(ts,)i(unless)e(`)p | |
| 28157acd CR |
9395 | Fs(-s)p Ft(')g(is)g(sp)s(eci\014ed,)150 1889 y(without)33 |
| 9396 | b(sp)s(eci\014ying)f(the)h(`)p Fs(-c)p Ft(')f(option,)i(and)e(whose)h | |
| 9397 | (input)e(and)i(error)f(output)g(are)h(b)s(oth)f(connected)150 | |
| 9398 | 1998 y(to)f(terminals)g(\(as)g(determined)f(b)m(y)g Fs(isatty\(3\))p | |
| 37c41ab1 CR |
9399 | Ft(\),)f(or)h(one)h(started)f(with)g(the)h(`)p Fs(-i)p |
| 9400 | Ft(')f(option.)275 2128 y(An)g(in)m(teractiv)m(e)j(shell)d(generally)i | |
| 9401 | (reads)e(from)g(and)g(writes)g(to)h(a)g(user's)f(terminal.)275 | |
| 9402 | 2258 y(The)e(`)p Fs(-s)p Ft(')i(in)m(v)m(o)s(cation)h(option)f(ma)m(y)g | |
| 9403 | (b)s(e)f(used)f(to)i(set)g(the)g(p)s(ositional)g(parameters)f(when)g | |
| 9404 | (an)g(in)m(ter-)150 2367 y(activ)m(e)k(shell)d(is)h(started.)150 | |
| 5e13499c | 9405 | 2577 y Fk(6.3.2)63 b(Is)41 b(this)g(Shell)g(In)m(teractiv)m(e?)275 |
| 37c41ab1 CR |
9406 | 2817 y Ft(T)-8 b(o)32 b(determine)g(within)g(a)g(startup)g(script)g |
| 9407 | (whether)g(or)g(not)g(Bash)g(is)g(running)f(in)m(teractiv)m(ely)-8 | |
| 9408 | b(,)36 b(test)150 2926 y(the)42 b(v)-5 b(alue)42 b(of)f(the)h(`)p | |
| 9409 | Fs(-)p Ft(')g(sp)s(ecial)g(parameter.)75 b(It)41 b(con)m(tains)i | |
| 9410 | Fs(i)e Ft(when)g(the)h(shell)f(is)h(in)m(teractiv)m(e.)77 | |
| 5e13499c CR |
9411 | b(F)-8 b(or)150 3036 y(example:)390 3166 y Fs(case)47 |
| 9412 | b("$-")f(in)390 3275 y(*i*\))h(echo)f(This)h(shell)f(is)h(interactive)e | |
| 9413 | (;;)390 3385 y(*\))i(echo)g(This)f(shell)h(is)g(not)g(interactive)e(;;) | |
| 37c41ab1 CR |
9414 | 390 3495 y(esac)275 3624 y Ft(Alternativ)m(ely)-8 b(,)28 |
| 9415 | b(startup)23 b(scripts)h(ma)m(y)g(examine)g(the)g(v)-5 | |
| 9416 | b(ariable)25 b Fs(PS1)p Ft(;)g(it)g(is)e(unset)h(in)f(non-in)m | |
| 9417 | (teractiv)m(e)150 3734 y(shells,)31 b(and)e(set)i(in)f(in)m(teractiv)m | |
| 9418 | (e)k(shells.)40 b(Th)m(us:)390 3864 y Fs(if)47 b([)h(-z)f("$PS1")f(];)h | |
| 9419 | (then)772 3973 y(echo)f(This)h(shell)f(is)i(not)f(interactive)390 | |
| 5e13499c CR |
9420 | 4083 y(else)772 4193 y(echo)f(This)h(shell)f(is)i(interactive)390 |
| 9421 | 4302 y(fi)150 4512 y Fk(6.3.3)63 b(In)m(teractiv)m(e)38 | |
| 37c41ab1 CR |
9422 | b(Shell)k(Beha)m(vior)275 4752 y Ft(When)30 b(the)g(shell)h(is)f |
| 9423 | (running)f(in)m(teractiv)m(ely)-8 b(,)34 b(it)d(c)m(hanges)g(its)g(b)s | |
| 5e13499c | 9424 | (eha)m(vior)g(in)f(sev)m(eral)h(w)m(a)m(ys.)199 4881 |
| 37c41ab1 CR |
9425 | y(1.)61 b(Startup)37 b(\014les)g(are)h(read)f(and)g(executed)h(as)f |
| 9426 | (describ)s(ed)g(in)g(Section)h(6.2)g([Bash)g(Startup)e(Files],)330 | |
| 28157acd CR |
9427 | 4991 y(page)31 b(69.)199 5121 y(2.)61 b(Job)35 b(Con)m(trol)g(\(see)h |
| 9428 | (Chapter)f(7)g([Job)g(Con)m(trol],)i(page)f(85\))g(is)f(enabled)g(b)m | |
| 37c41ab1 CR |
9429 | (y)g(default.)55 b(When)34 b(job)330 5230 y(con)m(trol)h(is)f(in)f |
| 9430 | (e\013ect,)k(Bash)d(ignores)g(the)g(k)m(eyb)s(oard-generated)h(job)e | |
| 9431 | (con)m(trol)i(signals)g Fs(SIGTTIN)p Ft(,)330 5340 y | |
| 9432 | Fs(SIGTTOU)p Ft(,)29 b(and)g Fs(SIGTSTP)p Ft(.)p eop | |
| 9433 | end | |
| 28157acd CR |
9434 | %%Page: 72 78 |
| 9435 | TeXDict begin 72 77 bop 150 -116 a Ft(72)2572 b(Bash)31 | |
| 37c41ab1 CR |
9436 | b(Reference)g(Man)m(ual)199 299 y(3.)61 b(Bash)39 b(expands)f(and)g |
| 9437 | (displa)m(ys)h Fs(PS1)f Ft(b)s(efore)h(reading)g(the)g(\014rst)f(line)h | |
| 9438 | (of)g(a)g(command,)i(and)d(ex-)330 408 y(pands)30 b(and)g(displa)m(ys)h | |
| 9439 | Fs(PS2)e Ft(b)s(efore)i(reading)g(the)g(second)f(and)h(subsequen)m(t)f | |
| 9440 | (lines)h(of)g(a)g(m)m(ulti-line)330 518 y(command.)199 | |
| 9441 | 669 y(4.)61 b(Bash)26 b(executes)i(the)e(v)-5 b(alue)27 | |
| 9442 | b(of)f(the)h Fs(PROMPT_COMMAND)22 b Ft(v)-5 b(ariable)27 | |
| 9443 | b(as)g(a)f(command)g(b)s(efore)g(prin)m(ting)330 779 | |
| 9444 | y(the)31 b(primary)e(prompt,)h Fs($PS1)f Ft(\(see)i(Section)g(5.2)h | |
| 28157acd | 9445 | ([Bash)f(V)-8 b(ariables],)32 b(page)f(57\).)199 930 |
| 37c41ab1 | 9446 | y(5.)61 b(Readline)30 b(\(see)h(Chapter)e(8)h([Command)e(Line)i |
| 28157acd | 9447 | (Editing],)g(page)g(89\))h(is)f(used)f(to)h(read)f(commands)330 |
| 5e13499c | 9448 | 1039 y(from)h(the)g(user's)g(terminal.)199 1190 y(6.)61 |
| 37c41ab1 CR |
9449 | b(Bash)36 b(insp)s(ects)g(the)h(v)-5 b(alue)37 b(of)f(the)g |
| 9450 | Fs(ignoreeof)e Ft(option)j(to)g Fs(set)29 b(-o)36 b Ft(instead)h(of)f | |
| 9451 | (exiting)i(imme-)330 1300 y(diately)f(when)e(it)i(receiv)m(es)h(an)e | |
| 9452 | Fs(EOF)f Ft(on)h(its)g(standard)f(input)g(when)h(reading)g(a)g(command) | |
| 28157acd CR |
9453 | g(\(see)330 1409 y(Section)31 b(4.3)h([The)e(Set)g(Builtin],)i(page)f |
| 9454 | (53\).)199 1560 y(7.)61 b(Command)43 b(history)h(\(see)h(Section)g(9.1) | |
| 9455 | g([Bash)f(History)h(F)-8 b(acilities],)51 b(page)45 b(115\))h(and)d | |
| 37c41ab1 | 9456 | (history)330 1670 y(expansion)23 b(\(see)i(Section)f(9.3)h([History)f |
| 28157acd | 9457 | (In)m(teraction],)j(page)d(117\))h(are)f(enabled)g(b)m(y)f(default.)39 |
| 37c41ab1 CR |
9458 | b(Bash)330 1779 y(will)23 b(sa)m(v)m(e)i(the)e(command)f(history)h(to)h |
| 9459 | (the)f(\014le)g(named)f(b)m(y)h Fs($HISTFILE)d Ft(when)i(an)h(in)m | |
| 9460 | (teractiv)m(e)j(shell)330 1889 y(exits.)199 2040 y(8.)61 | |
| 9461 | b(Alias)31 b(expansion)g(\(see)g(Section)g(6.6)g([Aliases],)i(page)e | |
| 28157acd | 9462 | (75\))h(is)e(p)s(erformed)f(b)m(y)h(default.)199 2191 |
| 5e13499c | 9463 | y(9.)61 b(In)24 b(the)g(absence)h(of)f(an)m(y)h(traps,)g(Bash)g |
| 37c41ab1 CR |
9464 | (ignores)f Fs(SIGTERM)f Ft(\(see)i(Section)g(3.7.6)h([Signals],)g(page) |
| 9465 | f(31\).)154 2342 y(10.)61 b(In)26 b(the)h(absence)h(of)f(an)m(y)g | |
| 9466 | (traps,)g Fs(SIGINT)e Ft(is)i(caugh)m(t)h(and)f(handled)e(\(\(see)k | |
| 9467 | (Section)e(3.7.6)i([Signals],)330 2451 y(page)i(31\).)42 | |
| 9468 | b Fs(SIGINT)29 b Ft(will)h(in)m(terrupt)g(some)h(shell)g(builtins.)154 | |
| 9469 | 2602 y(11.)61 b(An)40 b(in)m(teractiv)m(e)j(login)e(shell)g(sends)e(a)i | |
| 9470 | Fs(SIGHUP)d Ft(to)j(all)g(jobs)f(on)g(exit)h(if)g(the)f | |
| 28157acd | 9471 | Fs(hupoxexit)e Ft(shell)330 2712 y(option)31 b(has)f(b)s(een)g(enabled) |
| 37c41ab1 | 9472 | g(\(see)h(Section)g(3.7.6)i([Signals],)e(page)g(31\).)154 |
| 28157acd CR |
9473 | 2863 y(12.)61 b(The)31 b(`)p Fs(-n)p Ft(')g(in)m(v)m(o)s(cation)i |
| 9474 | (option)e(is)h(ignored,)f(and)g(`)p Fs(set)f(-n)p Ft(')g(has)h(no)g | |
| 9475 | (e\013ect)i(\(see)f(Section)g(4.3)g([The)330 2972 y(Set)f(Builtin],)g | |
| 9476 | (page)g(53\).)154 3123 y(13.)61 b(Bash)32 b(will)g(c)m(hec)m(k)i(for)e | |
| 9477 | (mail)g(p)s(erio)s(dically)-8 b(,)34 b(dep)s(ending)c(on)i(the)g(v)-5 | |
| 9478 | b(alues)32 b(of)g(the)h Fs(MAIL)p Ft(,)e Fs(MAILPATH)p | |
| 9479 | Ft(,)330 3233 y(and)f Fs(MAILCHECK)e Ft(shell)i(v)-5 | |
| 9480 | b(ariables)31 b(\(see)h(Section)f(5.2)g([Bash)g(V)-8 | |
| 9481 | b(ariables],)32 b(page)f(57\).)154 3384 y(14.)61 b(Expansion)32 | |
| 9482 | b(errors)h(due)f(to)i(references)f(to)h(un)m(b)s(ound)c(shell)j(v)-5 | |
| 9483 | b(ariables)34 b(after)g(`)p Fs(set)29 b(-u)p Ft(')k(has)g(b)s(een)330 | |
| 9484 | 3494 y(enabled)d(will)h(not)g(cause)g(the)f(shell)h(to)g(exit)g(\(see)g | |
| 9485 | (Section)h(4.3)f([The)f(Set)h(Builtin],)g(page)g(53\).)154 | |
| 9486 | 3644 y(15.)61 b(The)48 b(shell)h(will)f(not)h(exit)g(on)g(expansion)f | |
| 9487 | (errors)g(caused)g(b)m(y)h Fq(v)-5 b(ar)54 b Ft(b)s(eing)48 | |
| 9488 | b(unset)g(or)h(n)m(ull)f(in)330 3754 y Fs(${)p Fj(var)11 | |
| 9489 | b Fs(:?)p Fj(word)g Fs(})26 b Ft(expansions)k(\(see)h(Section)h(3.5.3)g | |
| 9490 | ([Shell)e(P)m(arameter)i(Expansion],)e(page)h(19\).)154 | |
| 9491 | 3905 y(16.)61 b(Redirection)31 b(errors)f(encoun)m(tered)h(b)m(y)f | |
| 9492 | (shell)h(builtins)f(will)g(not)h(cause)g(the)f(shell)h(to)g(exit.)154 | |
| 9493 | 4056 y(17.)61 b(When)26 b(running)f(in)i Fl(posix)e Ft(mo)s(de,)j(a)f | |
| 9494 | (sp)s(ecial)g(builtin)f(returning)g(an)g(error)h(status)g(will)g(not)f | |
| 9495 | (cause)330 4166 y(the)31 b(shell)f(to)h(exit)h(\(see)f(Section)g(6.11)h | |
| 9496 | ([Bash)f(POSIX)e(Mo)s(de],)i(page)g(80\).)154 4316 y(18.)61 | |
| 9497 | b(A)34 b(failed)g Fs(exec)f Ft(will)h(not)g(cause)g(the)g(shell)g(to)g | |
| 9498 | (exit)h(\(see)f(Section)h(4.1)g([Bourne)f(Shell)f(Builtins],)330 | |
| ac18b312 | 9499 | 4426 y(page)e(35\).)154 4577 y(19.)61 b(P)m(arser)31 |
| 37c41ab1 CR |
9500 | b(syn)m(tax)f(errors)g(will)h(not)g(cause)g(the)f(shell)h(to)g(exit.) |
| 9501 | 154 4728 y(20.)61 b(Simple)21 b(sp)s(elling)h(correction)g(for)g | |
| 9502 | (directory)g(argumen)m(ts)f(to)i(the)e Fs(cd)g Ft(builtin)g(is)h | |
| 28157acd CR |
9503 | (enabled)f(b)m(y)h(default)330 4838 y(\(see)38 b(the)e(description)h |
| 9504 | (of)g(the)f Fs(cdspell)f Ft(option)i(to)g(the)g Fs(shopt)e | |
| 9505 | Ft(builtin)h(in)h(Section)g(4.2)h([Bash)330 4947 y(Builtins],)31 | |
| 9506 | b(page)g(41\).)154 5098 y(21.)61 b(The)42 b(shell)h(will)g(c)m(hec)m(k) | |
| 9507 | h(the)f(v)-5 b(alue)43 b(of)f(the)h Fs(TMOUT)e Ft(v)-5 | |
| 9508 | b(ariable)44 b(and)e(exit)h(if)g(a)g(command)f(is)h(not)330 | |
| 9509 | 5208 y(read)30 b(within)g(the)g(sp)s(eci\014ed)f(n)m(um)m(b)s(er)g(of)i | |
| 9510 | (seconds)f(after)g(prin)m(ting)g Fs($PS1)f Ft(\(see)i(Section)g(5.2)h | |
| 9511 | ([Bash)330 5317 y(V)-8 b(ariables],)32 b(page)f(57\).)p | |
| 9512 | eop end | |
| 9513 | %%Page: 73 79 | |
| 9514 | TeXDict begin 73 78 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9515 | b(Bash)30 b(F)-8 b(eatures)2484 b(73)150 299 y Fr(6.4)68 | |
| 37c41ab1 CR |
9516 | b(Bash)45 b(Conditional)h(Expressions)275 540 y Ft(Conditional)38 |
| 9517 | b(expressions)g(are)h(used)f(b)m(y)g(the)g Fs([[)g Ft(comp)s(ound)f | |
| 9518 | (command)h(and)g(the)g Fs(test)g Ft(and)f Fs([)150 650 | |
| 9519 | y Ft(builtin)30 b(commands.)275 782 y(Expressions)i(ma)m(y)h(b)s(e)g | |
| 9520 | (unary)f(or)h(binary)-8 b(.)48 b(Unary)33 b(expressions)f(are)i(often)f | |
| 9521 | (used)f(to)i(examine)g(the)150 892 y(status)26 b(of)g(a)h(\014le.)39 | |
| 9522 | b(There)26 b(are)g(string)g(op)s(erators)g(and)g(n)m(umeric)f | |
| 9523 | (comparison)i(op)s(erators)f(as)g(w)m(ell.)40 b(If)26 | |
| 9524 | b(the)150 1001 y Fq(\014le)38 b Ft(argumen)m(t)c(to)f(one)h(of)f(the)g | |
| 9525 | (primaries)g(is)g(of)g(the)g(form)g(`)p Fs(/dev/fd/)p | |
| 9526 | Fj(N)11 b Ft(',)31 b(then)i(\014le)g(descriptor)g Fq(N)43 | |
| 9527 | b Ft(is)150 1111 y(c)m(hec)m(k)m(ed.)e(If)26 b(the)g | |
| 9528 | Fq(\014le)31 b Ft(argumen)m(t)26 b(to)h(one)f(of)g(the)h(primaries)e | |
| 9529 | (is)h(one)g(of)g(`)p Fs(/dev/stdin)p Ft(',)f(`)p Fs(/dev/stdout)p | |
| 9530 | Ft(',)150 1220 y(or)30 b(`)p Fs(/dev/stderr)p Ft(',)e(\014le)j | |
| 9531 | (descriptor)f(0,)h(1,)g(or)g(2,)g(resp)s(ectiv)m(ely)-8 | |
| 9532 | b(,)32 b(is)e(c)m(hec)m(k)m(ed.)275 1352 y(Unless)44 | |
| 9533 | b(otherwise)h(sp)s(eci\014ed,)j(primaries)c(that)h(op)s(erate)g(on)g | |
| 9534 | (\014les)f(follo)m(w)i(sym)m(b)s(olic)f(links)g(and)150 | |
| 9535 | 1462 y(op)s(erate)31 b(on)f(the)h(target)h(of)e(the)h(link,)f(rather)h | |
| 9536 | (than)f(the)g(link)h(itself.)150 1616 y Fs(-a)f Fj(file)162 | |
| 9537 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists.)150 | |
| 9538 | 1771 y Fs(-b)30 b Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g | |
| 9539 | Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(a)h(blo)s(c)m(k)g(sp)s(ecial)g | |
| 9540 | (\014le.)150 1925 y Fs(-c)f Fj(file)162 b Ft(T)-8 b(rue)30 | |
| 9541 | b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(a)h(c)m(haracter)h(sp)s | |
| 9542 | (ecial)f(\014le.)150 2079 y Fs(-d)f Fj(file)162 b Ft(T)-8 | |
| 9543 | b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(a)h(directory) | |
| 9544 | -8 b(.)150 2233 y Fs(-e)30 b Fj(file)162 b Ft(T)-8 b(rue)30 | |
| 9545 | b(if)g Fq(\014le)36 b Ft(exists.)150 2388 y Fs(-f)30 | |
| 9546 | b Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 | |
| 9547 | b Ft(exists)31 b(and)f(is)g(a)h(regular)f(\014le.)150 | |
| 9548 | 2542 y Fs(-g)g Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g | |
| 9549 | Fq(\014le)36 b Ft(exists)31 b(and)f(its)g(set-group-id)h(bit)g(is)f | |
| 9550 | (set.)150 2696 y Fs(-h)g Fj(file)162 b Ft(T)-8 b(rue)30 | |
| 9551 | b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(a)h(sym)m(b)s(olic)g | |
| 9552 | (link.)150 2851 y Fs(-k)f Fj(file)162 b Ft(T)-8 b(rue)30 | |
| 9553 | b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(its)g Fs(")p | |
| 9554 | Ft(stic)m(ky)p Fs(")h Ft(bit)g(is)f(set.)150 3005 y Fs(-p)g | |
| 9555 | Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b | |
| 9556 | Ft(exists)31 b(and)f(is)g(a)h(named)f(pip)s(e)f(\(FIF)m(O\).)150 | |
| 9557 | 3159 y Fs(-r)h Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g | |
| 9558 | Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(readable.)150 | |
| 9559 | 3314 y Fs(-s)g Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g | |
| 9560 | Fq(\014le)36 b Ft(exists)31 b(and)f(has)g(a)g(size)i(greater)f(than)f | |
| 9561 | (zero.)150 3468 y Fs(-t)g Fj(fd)258 b Ft(T)-8 b(rue)30 | |
| 9562 | b(if)g(\014le)h(descriptor)f Fq(fd)j Ft(is)e(op)s(en)e(and)h(refers)g | |
| 9563 | (to)h(a)g(terminal.)150 3622 y Fs(-u)f Fj(file)162 b | |
| 9564 | Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 b(and)f(its)g | |
| 9565 | (set-user-id)h(bit)f(is)h(set.)150 3777 y Fs(-w)f Fj(file)162 | |
| 9566 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 | |
| 9567 | b(and)f(is)g(writable.)150 3931 y Fs(-x)g Fj(file)162 | |
| 9568 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 | |
| 9569 | b(and)f(is)g(executable.)150 4085 y Fs(-O)g Fj(file)162 | |
| 9570 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 | |
| 9571 | b(and)f(is)g(o)m(wned)g(b)m(y)h(the)f(e\013ectiv)m(e)j(user)d(id.)150 | |
| 9572 | 4240 y Fs(-G)g Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g | |
| 9573 | Fq(\014le)36 b Ft(exists)31 b(and)f(is)g(o)m(wned)g(b)m(y)h(the)f | |
| 9574 | (e\013ectiv)m(e)j(group)d(id.)150 4394 y Fs(-L)g Fj(file)162 | |
| 9575 | b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b Ft(exists)31 | |
| 9576 | b(and)f(is)g(a)h(sym)m(b)s(olic)g(link.)150 4548 y Fs(-S)f | |
| 9577 | Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 b | |
| 9578 | Ft(exists)31 b(and)f(is)g(a)h(so)s(c)m(k)m(et.)150 4703 | |
| 9579 | y Fs(-N)f Fj(file)162 b Ft(T)-8 b(rue)30 b(if)g Fq(\014le)36 | |
| 9580 | b Ft(exists)31 b(and)f(has)g(b)s(een)f(mo)s(di\014ed)h(since)g(it)h(w)m | |
| 9581 | (as)g(last)g(read.)150 4857 y Fj(file1)39 b Fs(-nt)30 | |
| 9582 | b Fj(file2)630 4966 y Ft(T)-8 b(rue)23 b(if)h Fq(\014le1)32 | |
| 9583 | b Ft(is)24 b(new)m(er)g(\(according)h(to)g(mo)s(di\014cation)f(date\))h | |
| 9584 | (than)f Fq(\014le2)p Ft(,)i(or)e(if)g Fq(\014le1)31 b | |
| 9585 | Ft(exists)630 5076 y(and)f Fq(\014le2)38 b Ft(do)s(es)30 | |
| 5e13499c | 9586 | b(not.)150 5230 y Fj(file1)39 b Fs(-ot)30 b Fj(file2)630 |
| 37c41ab1 CR |
9587 | 5340 y Ft(T)-8 b(rue)30 b(if)g Fq(\014le1)38 b Ft(is)31 |
| 9588 | b(older)f(than)g Fq(\014le2)p Ft(,)i(or)e(if)g Fq(\014le2)38 | |
| 9589 | b Ft(exists)31 b(and)f Fq(\014le1)38 b Ft(do)s(es)30 | |
| 9590 | b(not.)p eop end | |
| 28157acd CR |
9591 | %%Page: 74 80 |
| 9592 | TeXDict begin 74 79 bop 150 -116 a Ft(74)2572 b(Bash)31 | |
| 37c41ab1 CR |
9593 | b(Reference)g(Man)m(ual)150 299 y Fj(file1)39 b Fs(-ef)30 |
| 9594 | b Fj(file2)630 408 y Ft(T)-8 b(rue)30 b(if)g Fq(\014le1)38 | |
| 9595 | b Ft(and)30 b Fq(\014le2)38 b Ft(refer)30 b(to)i(the)e(same)h(device)g | |
| 9596 | (and)f(ino)s(de)g(n)m(um)m(b)s(ers.)150 570 y Fs(-o)g | |
| 9597 | Fj(optname)630 679 y Ft(T)-8 b(rue)41 b(if)g(shell)g(option)h | |
| 9598 | Fq(optname)47 b Ft(is)41 b(enabled.)73 b(The)41 b(list)h(of)f(options)g | |
| 28157acd CR |
9599 | (app)s(ears)g(in)g(the)630 789 y(description)20 b(of)h(the)f(`)p |
| 9600 | Fs(-o)p Ft(')g(option)h(to)g(the)g Fs(set)e Ft(builtin)h(\(see)h | |
| 9601 | (Section)g(4.3)g([The)g(Set)f(Builtin],)630 898 y(page)31 | |
| 9602 | b(53\).)150 1060 y Fs(-z)f Fj(string)630 1169 y Ft(T)-8 | |
| 9603 | b(rue)30 b(if)g(the)h(length)g(of)f Fq(string)38 b Ft(is)31 | |
| 9604 | b(zero.)150 1330 y Fs(-n)f Fj(string)150 1440 y(string)192 | |
| 9605 | b Ft(T)-8 b(rue)30 b(if)g(the)h(length)g(of)f Fq(string)38 | |
| 9606 | b Ft(is)31 b(non-zero.)150 1601 y Fj(string1)39 b Fs(==)30 | |
| 9607 | b Fj(string2)630 1711 y Ft(T)-8 b(rue)33 b(if)h(the)g(strings)f(are)h | |
| 9608 | (equal.)51 b(`)p Fs(=)p Ft(')34 b(ma)m(y)g(b)s(e)f(used)g(in)g(place)i | |
| 9609 | (of)e(`)p Fs(==)p Ft(')h(for)f(strict)i Fl(posix)630 | |
| 9610 | 1820 y Ft(compliance.)150 1981 y Fj(string1)k Fs(!=)30 | |
| 9611 | b Fj(string2)630 2091 y Ft(T)-8 b(rue)30 b(if)g(the)h(strings)f(are)h | |
| 9612 | (not)f(equal.)150 2252 y Fj(string1)39 b Fs(<)30 b Fj(string2)630 | |
| 9613 | 2362 y Ft(T)-8 b(rue)30 b(if)g Fq(string1)38 b Ft(sorts)31 | |
| 9614 | b(b)s(efore)f Fq(string2)38 b Ft(lexicographically)33 | |
| 37c41ab1 CR |
9615 | b(in)d(the)h(curren)m(t)f(lo)s(cale.)150 2523 y Fj(string1)39 |
| 9616 | b Fs(>)30 b Fj(string2)630 2632 y Ft(T)-8 b(rue)30 b(if)g | |
| 9617 | Fq(string1)38 b Ft(sorts)31 b(after)g Fq(string2)38 b | |
| 9618 | Ft(lexicographically)33 b(in)d(the)g(curren)m(t)h(lo)s(cale.)150 | |
| 9619 | 2794 y Fj(arg1)40 b Fs(OP)29 b Fj(arg2)630 2903 y Fs(OP)k | |
| 9620 | Ft(is)h(one)g(of)h(`)p Fs(-eq)p Ft(',)f(`)p Fs(-ne)p | |
| 9621 | Ft(',)h(`)p Fs(-lt)p Ft(',)g(`)p Fs(-le)p Ft(',)f(`)p | |
| 5e13499c | 9622 | Fs(-gt)p Ft(',)h(or)f(`)p Fs(-ge)p Ft('.)51 b(These)34 |
| 37c41ab1 CR |
9623 | b(arithmetic)h(binary)630 3013 y(op)s(erators)h(return)e(true)i(if)f |
| 9624 | Fq(arg1)44 b Ft(is)36 b(equal)g(to,)i(not)e(equal)g(to,)i(less)e(than,) | |
| 9625 | h(less)f(than)f(or)630 3122 y(equal)29 b(to,)g(greater)h(than,)e(or)g | |
| 9626 | (greater)i(than)d(or)i(equal)f(to)h Fq(arg2)p Ft(,)h(resp)s(ectiv)m | |
| 9627 | (ely)-8 b(.)42 b Fq(Arg1)36 b Ft(and)630 3232 y Fq(arg2)j | |
| 9628 | Ft(ma)m(y)30 b(b)s(e)g(p)s(ositiv)m(e)i(or)e(negativ)m(e)j(in)m | |
| 5e13499c | 9629 | (tegers.)150 3494 y Fr(6.5)68 b(Shell)45 b(Arithmetic)275 |
| 37c41ab1 CR |
9630 | 3740 y Ft(The)34 b(shell)g(allo)m(ws)i(arithmetic)g(expressions)f(to)g |
| 9631 | (b)s(e)f(ev)-5 b(aluated,)37 b(as)e(one)g(of)g(the)f(shell)h | |
| 9632 | (expansions)150 3849 y(or)30 b(b)m(y)h(the)f Fs(let)g | |
| 9633 | Ft(and)f(the)i(`)p Fs(-i)p Ft(')f(option)h(to)g(the)g | |
| 9634 | Fs(declare)d Ft(builtins.)275 3985 y(Ev)-5 b(aluation)27 | |
| 9635 | b(is)g(done)f(in)g(\014xed-width)g(in)m(tegers)i(with)e(no)h(c)m(hec)m | |
| 9636 | (k)h(for)e(o)m(v)m(er\015o)m(w,)j(though)d(division)h(b)m(y)150 | |
| 9637 | 4095 y(0)g(is)g(trapp)s(ed)f(and)h(\015agged)g(as)h(an)f(error.)39 | |
| 9638 | b(The)26 b(op)s(erators)h(and)g(their)g(precedence,)h(asso)s(ciativit)m | |
| 9639 | (y)-8 b(,)32 b(and)150 4205 y(v)-5 b(alues)35 b(are)h(the)f(same)g(as)h | |
| 9640 | (in)e(the)h(C)g(language.)56 b(The)35 b(follo)m(wing)h(list)g(of)f(op)s | |
| 9641 | (erators)g(is)g(group)s(ed)f(in)m(to)150 4314 y(lev)m(els)27 | |
| 9642 | b(of)f(equal-precedence)i(op)s(erators.)39 b(The)25 b(lev)m(els)j(are)e | |
| 9643 | (listed)h(in)e(order)h(of)g(decreasing)g(precedence.)150 | |
| 9644 | 4476 y Fj(id)11 b Fs(++)29 b Fj(id)p Fs(--)630 4586 y | |
| 9645 | Ft(v)-5 b(ariable)31 b(p)s(ost-incremen)m(t)g(and)f(p)s(ost-decremen)m | |
| 9646 | (t)150 4747 y Fs(++)p Fj(id)40 b Fs(--)p Fj(id)630 4857 | |
| 9647 | y Ft(v)-5 b(ariable)31 b(pre-incremen)m(t)g(and)f(pre-decremen)m(t)150 | |
| 9648 | 5018 y Fs(-)g(+)354 b Ft(unary)29 b(min)m(us)h(and)g(plus)150 | |
| 9649 | 5179 y Fs(!)g(~)354 b Ft(logical)33 b(and)d(bit)m(wise)h(negation)150 | |
| 9650 | 5340 y Fs(**)384 b Ft(exp)s(onen)m(tiation)p eop end | |
| 28157acd CR |
9651 | %%Page: 75 81 |
| 9652 | TeXDict begin 75 80 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9653 | b(Bash)30 b(F)-8 b(eatures)2484 b(75)150 299 y Fs(*)30 | |
| 37c41ab1 CR |
9654 | b(/)g(\045)276 b Ft(m)m(ultiplication,)33 b(division,)d(remainder)150 |
| 9655 | 464 y Fs(+)g(-)354 b Ft(addition,)31 b(subtraction)150 | |
| 9656 | 630 y Fs(<<)f(>>)258 b Ft(left)31 b(and)f(righ)m(t)h(bit)m(wise)g | |
| 9657 | (shifts)150 795 y Fs(<=)f(>=)g(<)g(>)102 b Ft(comparison)150 | |
| 9658 | 961 y Fs(==)30 b(!=)258 b Ft(equalit)m(y)32 b(and)e(inequalit)m(y)150 | |
| 9659 | 1126 y Fs(&)432 b Ft(bit)m(wise)31 b(AND)150 1292 y Fs(^)432 | |
| 9660 | b Ft(bit)m(wise)31 b(exclusiv)m(e)h(OR)150 1458 y Fs(|)432 | |
| 9661 | b Ft(bit)m(wise)31 b(OR)150 1623 y Fs(&&)384 b Ft(logical)33 | |
| 9662 | b(AND)150 1789 y Fs(||)384 b Ft(logical)33 b(OR)150 1954 | |
| 9663 | y Fs(expr)c(?)h(expr)f(:)h(expr)630 2064 y Ft(conditional)i(op)s | |
| 9664 | (erator)150 2229 y Fs(=)e(*=)g(/=)g(\045=)f(+=)h(-=)g(<<=)f(>>=)h(&=)g | |
| 5e13499c | 9665 | (^=)f(|=)630 2339 y Ft(assignmen)m(t)150 2504 y Fs(expr1)g(,)h(expr2) |
| 37c41ab1 CR |
9666 | 630 2614 y Ft(comma)275 2782 y(Shell)38 b(v)-5 b(ariables)39 |
| 9667 | b(are)g(allo)m(w)m(ed)i(as)e(op)s(erands;)i(parameter)e(expansion)g(is) | |
| 9668 | f(p)s(erformed)g(b)s(efore)g(the)150 2892 y(expression)g(is)g(ev)-5 | |
| 9669 | b(aluated.)66 b(Within)38 b(an)h(expression,)h(shell)e(v)-5 | |
| 9670 | b(ariables)39 b(ma)m(y)g(also)g(b)s(e)f(referenced)g(b)m(y)150 | |
| 9671 | 3002 y(name)31 b(without)f(using)g(the)h(parameter)g(expansion)f(syn)m | |
| 9672 | (tax.)42 b(A)31 b(shell)f(v)-5 b(ariable)32 b(that)f(is)f(n)m(ull)h(or) | |
| 9673 | f(unset)150 3111 y(ev)-5 b(aluates)41 b(to)f(0)g(when)e(referenced)h(b) | |
| 9674 | m(y)g(name)h(without)f(using)g(the)g(parameter)h(expansion)f(syn)m | |
| 9675 | (tax.)150 3221 y(The)c(v)-5 b(alue)37 b(of)f(a)h(v)-5 | |
| 9676 | b(ariable)36 b(is)g(ev)-5 b(aluated)38 b(as)e(an)g(arithmetic)h | |
| 9677 | (expression)f(when)f(it)h(is)g(referenced,)i(or)150 3330 | |
| 9678 | y(when)31 b(a)i(v)-5 b(ariable)33 b(whic)m(h)f(has)g(b)s(een)f(giv)m | |
| 9679 | (en)j(the)e Fq(in)m(teger)40 b Ft(attribute)33 b(using)f(`)p | |
| 9680 | Fs(declare)d(-i)p Ft(')i(is)i(assigned)150 3440 y(a)k(v)-5 | |
| 9681 | b(alue.)58 b(A)36 b(n)m(ull)g(v)-5 b(alue)37 b(ev)-5 | |
| 9682 | b(aluates)38 b(to)f(0.)58 b(A)36 b(shell)h(v)-5 b(ariable)36 | |
| 9683 | b(need)g(not)h(ha)m(v)m(e)g(its)g(in)m(teger)g(attribute)150 | |
| 9684 | 3550 y(turned)29 b(on)h(to)i(b)s(e)d(used)h(in)g(an)g(expression.)275 | |
| 9685 | 3690 y(Constan)m(ts)41 b(with)g(a)h(leading)f(0)h(are)g(in)m(terpreted) | |
| 9686 | f(as)g(o)s(ctal)i(n)m(um)m(b)s(ers.)72 b(A)41 b(leading)h(`)p | |
| 9687 | Fs(0x)p Ft(')f(or)g(`)p Fs(0X)p Ft(')150 3800 y(denotes)31 | |
| 9688 | b(hexadecimal.)43 b(Otherwise,)31 b(n)m(um)m(b)s(ers)e(tak)m(e)k(the)e | |
| 5e13499c | 9689 | (form)f([)p Fq(base)5 b Fs(#)p Ft(])p Fq(n)p Ft(,)31 |
| 37c41ab1 | 9690 | b(where)f Fq(base)36 b Ft(is)31 b(a)g(decimal)150 3909 |
| 5e13499c | 9691 | y(n)m(um)m(b)s(er)26 b(b)s(et)m(w)m(een)i(2)f(and)g(64)h(represen)m |
| 37c41ab1 CR |
9692 | (ting)g(the)f(arithmetic)h(base,)h(and)d Fq(n)h Ft(is)g(a)h(n)m(um)m(b) |
| 9693 | s(er)e(in)h(that)h(base.)150 4019 y(If)39 b Fq(base)5 | |
| 9694 | b Fs(#)40 b Ft(is)g(omitted,)j(then)d(base)g(10)g(is)g(used.)68 | |
| 9695 | b(The)39 b(digits)i(greater)g(than)e(9)h(are)g(represen)m(ted)g(b)m(y) | |
| 9696 | 150 4129 y(the)34 b(lo)m(w)m(ercase)h(letters,)h(the)d(upp)s(ercase)g | |
| 9697 | (letters,)i(`)p Fs(@)p Ft(',)g(and)e(`)p Fs(_)p Ft(',)h(in)f(that)h | |
| 9698 | (order.)50 b(If)32 b Fq(base)39 b Ft(is)34 b(less)f(than)150 | |
| eb2bb562 CR |
9699 | 4238 y(or)i(equal)g(to)g(36,)i(lo)m(w)m(ercase)g(and)e(upp)s(ercase)e |
| 9700 | (letters)j(ma)m(y)g(b)s(e)e(used)g(in)m(terc)m(hangeably)i(to)g | |
| 5e13499c | 9701 | (represen)m(t)150 4348 y(n)m(um)m(b)s(ers)29 b(b)s(et)m(w)m(een)i(10)g |
| 37c41ab1 CR |
9702 | (and)f(35.)275 4488 y(Op)s(erators)44 b(are)h(ev)-5 b(aluated)46 |
| 9703 | b(in)f(order)f(of)h(precedence.)85 b(Sub-expressions)44 | |
| 9704 | b(in)g(paren)m(theses)i(are)150 4598 y(ev)-5 b(aluated)32 | |
| 9705 | b(\014rst)d(and)h(ma)m(y)h(o)m(v)m(erride)g(the)g(precedence)g(rules)f | |
| 5e13499c | 9706 | (ab)s(o)m(v)m(e.)150 4871 y Fr(6.6)68 b(Aliases)275 5121 |
| 37c41ab1 CR |
9707 | y Fq(Aliases)34 b Ft(allo)m(w)d(a)g(string)e(to)i(b)s(e)e(substituted)g |
| 9708 | (for)h(a)g(w)m(ord)f(when)g(it)h(is)g(used)f(as)h(the)g(\014rst)f(w)m | |
| 9709 | (ord)h(of)g(a)150 5230 y(simple)i(command.)45 b(The)31 | |
| 9710 | b(shell)i(main)m(tains)f(a)h(list)f(of)g(aliases)i(that)e(ma)m(y)h(b)s | |
| 9711 | (e)e(set)h(and)g(unset)f(with)h(the)150 5340 y Fs(alias)d | |
| 9712 | Ft(and)h Fs(unalias)e Ft(builtin)i(commands.)p eop end | |
| 28157acd CR |
9713 | %%Page: 76 82 |
| 9714 | TeXDict begin 76 81 bop 150 -116 a Ft(76)2572 b(Bash)31 | |
| 37c41ab1 CR |
9715 | b(Reference)g(Man)m(ual)275 299 y(The)e(\014rst)f(w)m(ord)i(of)f(eac)m |
| 9716 | (h)i(simple)f(command,)g(if)f(unquoted,)g(is)h(c)m(hec)m(k)m(ed)h(to)g | |
| 9717 | (see)f(if)g(it)g(has)f(an)g(alias.)150 408 y(If)24 b(so,)i(that)g(w)m | |
| 9718 | (ord)e(is)h(replaced)g(b)m(y)f(the)h(text)h(of)e(the)h(alias.)40 | |
| 9719 | b(The)24 b(c)m(haracters)i(`)p Fs(/)p Ft(',)h(`)p Fs($)p | |
| 9720 | Ft(',)f(`)p Fs(`)p Ft(',)g(`)p Fs(=)p Ft(')f(and)f(an)m(y)h(of)150 | |
| 9721 | 518 y(the)e(shell)g(metac)m(haracters)i(or)e(quoting)g(c)m(haracters)h | |
| 9722 | (listed)g(ab)s(o)m(v)m(e)g(ma)m(y)f(not)g(app)s(ear)f(in)h(an)g(alias)h | |
| 9723 | (name.)150 628 y(The)e(replacemen)m(t)h(text)g(ma)m(y)g(con)m(tain)h | |
| 9724 | (an)m(y)e(v)-5 b(alid)23 b(shell)f(input,)h(including)f(shell)g(metac)m | |
| 9725 | (haracters.)40 b(The)150 737 y(\014rst)35 b(w)m(ord)g(of)h(the)g | |
| 9726 | (replacemen)m(t)i(text)e(is)g(tested)h(for)e(aliases,)k(but)c(a)h(w)m | |
| 9727 | (ord)g(that)g(is)g(iden)m(tical)i(to)e(an)150 847 y(alias)c(b)s(eing)f | |
| 9728 | (expanded)f(is)h(not)g(expanded)f(a)h(second)g(time.)43 | |
| 9729 | b(This)30 b(means)h(that)g(one)g(ma)m(y)h(alias)g Fs(ls)e | |
| 9730 | Ft(to)150 956 y Fs("ls)f(-F")p Ft(,)36 b(for)f(instance,)i(and)d(Bash)h | |
| 9731 | (do)s(es)g(not)g(try)g(to)g(recursiv)m(ely)h(expand)e(the)h(replacemen) | |
| 9732 | m(t)i(text.)150 1066 y(If)31 b(the)h(last)h(c)m(haracter)g(of)f(the)g | |
| 9733 | (alias)h(v)-5 b(alue)32 b(is)g(a)g(space)g(or)g(tab)g(c)m(haracter,)i | |
| 9734 | (then)d(the)h(next)g(command)150 1176 y(w)m(ord)e(follo)m(wing)i(the)e | |
| 9735 | (alias)i(is)e(also)i(c)m(hec)m(k)m(ed)g(for)e(alias)i(expansion.)275 | |
| 9736 | 1325 y(Aliases)d(are)f(created)i(and)d(listed)i(with)f(the)g | |
| 9737 | Fs(alias)f Ft(command,)h(and)g(remo)m(v)m(ed)h(with)f(the)g | |
| 5e13499c | 9738 | Fs(unalias)150 1434 y Ft(command.)275 1583 y(There)44 |
| 37c41ab1 CR |
9739 | b(is)h(no)g(mec)m(hanism)g(for)f(using)h(argumen)m(ts)g(in)f(the)h |
| 9740 | (replacemen)m(t)i(text,)i(as)d(in)e Fs(csh)p Ft(.)83 | |
| 9741 | b(If)150 1693 y(argumen)m(ts)37 b(are)h(needed,)g(a)g(shell)f(function) | |
| 9742 | f(should)g(b)s(e)h(used)f(\(see)i(Section)g(3.3)g([Shell)f(F)-8 | |
| 9d2b70f0 | 9743 | b(unctions],)150 1802 y(page)31 b(14\).)275 1951 y(Aliases)i(are)h(not) |
| 37c41ab1 CR |
9744 | e(expanded)g(when)g(the)h(shell)g(is)g(not)g(in)m(teractiv)m(e,)j |
| 9745 | (unless)c(the)h Fs(expand_aliases)150 2061 y Ft(shell)e(option)f(is)h | |
| 28157acd CR |
9746 | (set)g(using)f Fs(shopt)f Ft(\(see)i(Section)g(4.2)h([Bash)e |
| 9747 | (Builtins],)h(page)h(41\).)275 2210 y(The)38 b(rules)h(concerning)h | |
| 9748 | (the)f(de\014nition)g(and)g(use)g(of)g(aliases)i(are)e(somewhat)h | |
| 37c41ab1 CR |
9749 | (confusing.)67 b(Bash)150 2320 y(alw)m(a)m(ys)42 b(reads)f(at)h(least)g |
| 9750 | (one)f(complete)i(line)e(of)g(input)f(b)s(efore)h(executing)h(an)m(y)f | |
| 9751 | (of)g(the)g(commands)150 2429 y(on)h(that)h(line.)77 | |
| 9752 | b(Aliases)44 b(are)e(expanded)g(when)f(a)i(command)f(is)g(read,)k(not)c | |
| 9753 | (when)g(it)g(is)h(executed.)150 2539 y(Therefore,)f(an)e(alias)h | |
| 9754 | (de\014nition)e(app)s(earing)h(on)f(the)h(same)h(line)f(as)g(another)g | |
| 9755 | (command)f(do)s(es)h(not)150 2648 y(tak)m(e)31 b(e\013ect)f(un)m(til)g | |
| 9756 | (the)f(next)g(line)h(of)f(input)f(is)h(read.)41 b(The)28 | |
| 9757 | b(commands)h(follo)m(wing)i(the)e(alias)h(de\014nition)150 | |
| 9758 | 2758 y(on)d(that)h(line)f(are)h(not)f(a\013ected)i(b)m(y)e(the)g(new)g | |
| 9759 | (alias.)41 b(This)26 b(b)s(eha)m(vior)h(is)g(also)h(an)f(issue)g(when)f | |
| 9760 | (functions)150 2868 y(are)d(executed.)39 b(Aliases)24 | |
| 9761 | b(are)f(expanded)f(when)f(a)i(function)g(de\014nition)f(is)h(read,)h | |
| 9762 | (not)f(when)e(the)i(function)150 2977 y(is)i(executed,)j(b)s(ecause)d | |
| 9763 | (a)h(function)f(de\014nition)f(is)i(itself)g(a)f(comp)s(ound)f | |
| 9764 | (command.)39 b(As)25 b(a)h(consequence,)150 3087 y(aliases)36 | |
| 9765 | b(de\014ned)d(in)h(a)g(function)g(are)h(not)f(a)m(v)-5 | |
| 9766 | b(ailable)37 b(un)m(til)d(after)h(that)g(function)f(is)g(executed.)53 | |
| 9767 | b(T)-8 b(o)35 b(b)s(e)150 3196 y(safe,)41 b(alw)m(a)m(ys)f(put)d(alias) | |
| 9768 | j(de\014nitions)e(on)g(a)h(separate)g(line,)i(and)d(do)g(not)g(use)g | |
| 9769 | Fs(alias)f Ft(in)h(comp)s(ound)150 3306 y(commands.)275 | |
| 9770 | 3455 y(F)-8 b(or)31 b(almost)g(ev)m(ery)g(purp)s(ose,)e(shell)i | |
| 9771 | (functions)f(are)g(preferred)g(o)m(v)m(er)h(aliases.)150 | |
| 9772 | 3749 y Fr(6.7)68 b(Arra)l(ys)275 4007 y Ft(Bash)33 b(pro)m(vides)g | |
| 9773 | (one-dimensional)h(arra)m(y)f(v)-5 b(ariables.)50 b(An)m(y)33 | |
| 9774 | b(v)-5 b(ariable)34 b(ma)m(y)f(b)s(e)g(used)f(as)h(an)g(arra)m(y;)150 | |
| 9775 | 4117 y(the)c Fs(declare)d Ft(builtin)i(will)h(explicitly)h(declare)g | |
| 9776 | (an)e(arra)m(y)-8 b(.)41 b(There)28 b(is)h(no)f(maxim)m(um)h(limit)g | |
| 9777 | (on)f(the)h(size)150 4227 y(of)d(an)g(arra)m(y)-8 b(,)27 | |
| 9778 | b(nor)f(an)m(y)g(requiremen)m(t)g(that)g(mem)m(b)s(ers)f(b)s(e)g | |
| 9779 | (indexed)g(or)h(assigned)g(con)m(tiguously)-8 b(.)41 | |
| 5e13499c | 9780 | b(Arra)m(ys)150 4336 y(are)31 b(zero-based.)275 4485 |
| 37c41ab1 CR |
9781 | y(An)f(arra)m(y)g(is)h(created)g(automatically)i(if)e(an)m(y)g(v)-5 |
| 9782 | b(ariable)31 b(is)f(assigned)h(to)g(using)f(the)g(syn)m(tax)390 | |
| 5e13499c | 9783 | 4634 y Fs(name[)p Fj(subscript)11 b Fs(]=)p Fj(value)150 |
| 37c41ab1 CR |
9784 | 4783 y Ft(The)25 b Fq(subscript)g Ft(is)h(treated)g(as)f(an)g |
| 9785 | (arithmetic)h(expression)f(that)h(m)m(ust)f(ev)-5 b(aluate)27 | |
| 9786 | b(to)e(a)h(n)m(um)m(b)s(er)e(greater)150 4893 y(than)30 | |
| 9787 | b(or)g(equal)h(to)g(zero.)42 b(T)-8 b(o)31 b(explicitly)h(declare)f(an) | |
| 9788 | f(arra)m(y)-8 b(,)32 b(use)390 5042 y Fs(declare)46 b(-a)h | |
| 5e13499c CR |
9789 | Fj(name)150 5191 y Ft(The)30 b(syn)m(tax)390 5340 y Fs(declare)46 |
| 9790 | b(-a)h Fj(name)11 b Fs([)p Fj(subscript)g Fs(])p eop | |
| 37c41ab1 | 9791 | end |
| 28157acd CR |
9792 | %%Page: 77 83 |
| 9793 | TeXDict begin 77 82 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9794 | b(Bash)30 b(F)-8 b(eatures)2484 b(77)150 299 y(is)29 | |
| 37c41ab1 CR |
9795 | b(also)i(accepted;)g(the)f Fq(subscript)g Ft(is)f(ignored.)41 |
| 9796 | b(A)m(ttributes)30 b(ma)m(y)g(b)s(e)e(sp)s(eci\014ed)h(for)g(an)g(arra) | |
| 9797 | m(y)h(v)-5 b(ariable)150 408 y(using)40 b(the)h Fs(declare)d | |
| 9798 | Ft(and)i Fs(readonly)f Ft(builtins.)70 b(Eac)m(h)42 b(attribute)f | |
| 9799 | (applies)g(to)g(all)h(mem)m(b)s(ers)d(of)i(an)150 518 | |
| 1c72c0cd | 9800 | y(arra)m(y)-8 b(.)275 649 y(Arra)m(ys)30 b(are)h(assigned)f(to)h(using) |
| 37c41ab1 | 9801 | f(comp)s(ound)f(assignmen)m(ts)i(of)g(the)f(form)390 |
| 1c72c0cd CR |
9802 | 781 y Fs(name=\(value)p Fj(1)55 b Fs(...)47 b(value)p |
| 9803 | Fj(n)11 b Fs(\))150 912 y Ft(where)37 b(eac)m(h)h Fq(v)-5 | |
| 37c41ab1 CR |
9804 | b(alue)43 b Ft(is)38 b(of)f(the)h(form)e Fs([[)p Fj(subscript)11 |
| 9805 | b Fs(]=])p Fq(string)p Ft(.)58 b(If)36 b(the)i(optional)g(subscript)e | |
| 1c72c0cd | 9806 | (is)i(sup-)150 1022 y(plied,)44 b(that)e(index)f(is)g(assigned)h(to;)47 |
| 37c41ab1 | 9807 | b(otherwise)42 b(the)f(index)g(of)h(the)f(elemen)m(t)i(assigned)e(is)h |
| 1c72c0cd | 9808 | (the)f(last)150 1131 y(index)34 b(assigned)h(to)g(b)m(y)f(the)h |
| 37c41ab1 | 9809 | (statemen)m(t)h(plus)d(one.)54 b(Indexing)33 b(starts)i(at)g(zero.)54 |
| 1c72c0cd | 9810 | b(This)34 b(syn)m(tax)h(is)f(also)150 1241 y(accepted)h(b)m(y)f(the)g |
| 37c41ab1 | 9811 | Fs(declare)e Ft(builtin.)50 b(Individual)33 b(arra)m(y)h(elemen)m(ts)h |
| 1c72c0cd | 9812 | (ma)m(y)g(b)s(e)e(assigned)h(to)g(using)g(the)150 1350 |
| 37c41ab1 CR |
9813 | y Fs(name[)p Fq(subscript)r Fs(]=)p Fq(v)-5 b(alue)33 |
| 9814 | b Ft(syn)m(tax)e(in)m(tro)s(duced)f(ab)s(o)m(v)m(e.)275 | |
| 1c72c0cd | 9815 | 1482 y(An)m(y)j(elemen)m(t)i(of)f(an)f(arra)m(y)h(ma)m(y)g(b)s(e)f |
| 37c41ab1 | 9816 | (referenced)g(using)g Fs(${name[)p Fq(subscript)r Fs(]})p |
| 1c72c0cd | 9817 | Ft(.)46 b(The)33 b(braces)h(are)150 1591 y(required)28 |
| 37c41ab1 CR |
9818 | b(to)j(a)m(v)m(oid)f(con\015icts)g(with)f(the)h(shell's)f(\014lename)h |
| 9819 | (expansion)f(op)s(erators.)41 b(If)28 b(the)i Fq(subscript)g | |
| 1c72c0cd | 9820 | Ft(is)150 1701 y(`)p Fs(@)p Ft(')f(or)h(`)p Fs(*)p Ft(',)f(the)h(w)m |
| 37c41ab1 CR |
9821 | (ord)f(expands)f(to)i(all)g(mem)m(b)s(ers)e(of)i(the)f(arra)m(y)h |
| 9822 | Fq(name)p Ft(.)40 b(These)29 b(subscripts)f(di\013er)h(only)150 | |
| 1c72c0cd | 9823 | 1810 y(when)36 b(the)g(w)m(ord)g(app)s(ears)g(within)g(double)g |
| 37c41ab1 | 9824 | (quotes.)60 b(If)36 b(the)h(w)m(ord)f(is)g(double-quoted,)j |
| 1c72c0cd | 9825 | Fs(${name[*]})150 1920 y Ft(expands)20 b(to)h(a)g(single)g(w)m(ord)f |
| 37c41ab1 | 9826 | (with)h(the)g(v)-5 b(alue)21 b(of)f(eac)m(h)i(arra)m(y)f(mem)m(b)s(er)f |
| 5e13499c | 9827 | (separated)h(b)m(y)g(the)f(\014rst)g(c)m(haracter)150 |
| 28157acd | 9828 | 2029 y(of)38 b(the)g Fs(IFS)f Ft(v)-5 b(ariable,)41 b(and)c |
| 37c41ab1 | 9829 | Fs(${name[@]})e Ft(expands)i(eac)m(h)i(elemen)m(t)g(of)f |
| 1c72c0cd | 9830 | Fq(name)43 b Ft(to)c(a)f(separate)h(w)m(ord.)150 2139 |
| 37c41ab1 CR |
9831 | y(When)32 b(there)h(are)f(no)g(arra)m(y)h(mem)m(b)s(ers,)f |
| 9832 | Fs(${name[@]})e Ft(expands)h(to)i(nothing.)47 b(If)31 | |
| 1c72c0cd | 9833 | b(the)i(double-quoted)150 2249 y(expansion)39 b(o)s(ccurs)h(within)f(a) |
| 37c41ab1 | 9834 | h(w)m(ord,)i(the)d(expansion)h(of)g(the)f(\014rst)g(parameter)h(is)g |
| 1c72c0cd | 9835 | (joined)f(with)h(the)150 2358 y(b)s(eginning)j(part)h(of)g(the)g |
| 37c41ab1 | 9836 | (original)h(w)m(ord,)j(and)43 b(the)h(expansion)g(of)g(the)g(last)h |
| 1c72c0cd | 9837 | (parameter)f(is)g(joined)150 2468 y(with)35 b(the)g(last)h(part)f(of)g |
| 37c41ab1 | 9838 | (the)g(original)h(w)m(ord.)55 b(This)34 b(is)h(analogous)h(to)g(the)f |
| 1c72c0cd | 9839 | (expansion)g(of)g(the)g(sp)s(ecial)150 2577 y(parameters)28 |
| 37c41ab1 CR |
9840 | b(`)p Fs(@)p Ft(')g(and)f(`)p Fs(*)p Ft('.)39 b Fs(${#name[)p |
| 9841 | Fq(subscript)r Fs(]})24 b Ft(expands)j(to)h(the)g(length)g(of)f | |
| 1c72c0cd | 9842 | Fs(${name[)p Fq(subscript)r Fs(]})p Ft(.)150 2687 y(If)j |
| 37c41ab1 CR |
9843 | Fq(subscript)i Ft(is)f(`)p Fs(@)p Ft(')f(or)h(`)p Fs(*)p |
| 9844 | Ft(',)g(the)g(expansion)g(is)g(the)g(n)m(um)m(b)s(er)e(of)i(elemen)m | |
| 9845 | (ts)h(in)f(the)g(arra)m(y)-8 b(.)42 b(Referencing)150 | |
| 1c72c0cd | 9846 | 2797 y(an)30 b(arra)m(y)h(v)-5 b(ariable)31 b(without)g(a)f(subscript)g |
| 37c41ab1 | 9847 | (is)g(equiv)-5 b(alen)m(t)32 b(to)f(referencing)g(elemen)m(t)g(zero.) |
| 1c72c0cd | 9848 | 275 2928 y(The)h Fs(unset)g Ft(builtin)h(is)g(used)g(to)h(destro)m(y)g |
| 5e13499c | 9849 | (arra)m(ys.)50 b Fs(unset)31 b Fq(name)5 b Ft([)p Fq(subscript)r |
| 1c72c0cd CR |
9850 | Ft(])33 b(destro)m(ys)h(the)f(arra)m(y)150 3037 y(elemen)m(t)j(at)e |
| 9851 | (index)g Fq(subscript)p Ft(.)50 b(Care)34 b(m)m(ust)g(b)s(e)g(tak)m(en) | |
| 9852 | h(to)g(a)m(v)m(oid)g(un)m(w)m(an)m(ted)g(side)f(e\013ects)h(caused)f(b) | |
| 9853 | m(y)150 3147 y(\014lename)39 b(generation.)68 b Fs(unset)37 | |
| 9854 | b Fq(name)p Ft(,)k(where)e Fq(name)44 b Ft(is)39 b(an)f(arra)m(y)-8 | |
| 9855 | b(,)43 b(remo)m(v)m(es)d(the)f(en)m(tire)h(arra)m(y)-8 | |
| 9856 | b(.)67 b(A)150 3257 y(subscript)29 b(of)i(`)p Fs(*)p | |
| 9857 | Ft(')f(or)h(`)p Fs(@)p Ft(')f(also)h(remo)m(v)m(es)h(the)f(en)m(tire)g | |
| 9858 | (arra)m(y)-8 b(.)275 3388 y(The)22 b Fs(declare)p Ft(,)h | |
| 9859 | Fs(local)p Ft(,)g(and)g Fs(readonly)e Ft(builtins)h(eac)m(h)j(accept)f | |
| 9860 | (a)g(`)p Fs(-a)p Ft(')f(option)g(to)h(sp)s(ecify)f(an)g(arra)m(y)-8 | |
| 9861 | b(.)150 3498 y(The)24 b Fs(read)g Ft(builtin)h(accepts)h(a)f(`)p | |
| 37c41ab1 | 9862 | Fs(-a)p Ft(')g(option)h(to)f(assign)h(a)f(list)h(of)f(w)m(ords)f(read)h |
| 1c72c0cd | 9863 | (from)g(the)g(standard)f(input)150 3607 y(to)37 b(an)f(arra)m(y)-8 |
| 37c41ab1 CR |
9864 | b(,)39 b(and)c(can)h(read)g(v)-5 b(alues)37 b(from)e(the)i(standard)e |
| 9865 | (input)g(in)m(to)i(individual)f(arra)m(y)g(elemen)m(ts.)150 | |
| 1c72c0cd | 9866 | 3717 y(The)30 b Fs(set)f Ft(and)h Fs(declare)e Ft(builtins)i(displa)m |
| 37c41ab1 | 9867 | (y)g(arra)m(y)h(v)-5 b(alues)31 b(in)f(a)g(w)m(a)m(y)h(that)g(allo)m |
| 1c72c0cd CR |
9868 | (ws)h(them)e(to)h(b)s(e)f(reused)150 3826 y(as)h(input.)150 |
| 9869 | 4074 y Fr(6.8)68 b(The)45 b(Directory)g(Stac)l(k)275 | |
| 9870 | 4315 y Ft(The)26 b(directory)g(stac)m(k)i(is)f(a)g(list)g(of)g(recen)m | |
| 37c41ab1 | 9871 | (tly-visited)h(directories.)41 b(The)26 b Fs(pushd)f |
| 1c72c0cd | 9872 | Ft(builtin)h(adds)g(direc-)150 4425 y(tories)f(to)f(the)h(stac)m(k)g |
| 37c41ab1 CR |
9873 | (as)f(it)h(c)m(hanges)f(the)h(curren)m(t)e(directory)-8 |
| 9874 | b(,)27 b(and)c(the)h Fs(popd)f Ft(builtin)g(remo)m(v)m(es)j(sp)s | |
| 1c72c0cd | 9875 | (eci\014ed)150 4534 y(directories)j(from)f(the)h(stac)m(k)h(and)d(c)m |
| 37c41ab1 | 9876 | (hanges)j(the)e(curren)m(t)g(directory)h(to)g(the)g(directory)f(remo)m |
| 1c72c0cd | 9877 | (v)m(ed.)41 b(The)150 4644 y Fs(dirs)29 b Ft(builtin)h(displa)m(ys)h |
| 37c41ab1 | 9878 | (the)f(con)m(ten)m(ts)i(of)f(the)f(directory)h(stac)m(k.)275 |
| 1c72c0cd | 9879 | 4775 y(The)k(con)m(ten)m(ts)i(of)f(the)h(directory)f(stac)m(k)h(are)f |
| 37c41ab1 | 9880 | (also)h(visible)g(as)f(the)g(v)-5 b(alue)36 b(of)g(the)g |
| 1c72c0cd CR |
9881 | Fs(DIRSTACK)e Ft(shell)150 4885 y(v)-5 b(ariable.)150 |
| 9882 | 5099 y Fk(6.8.1)63 b(Directory)40 b(Stac)m(k)g(Builtins)150 | |
| 37c41ab1 | 9883 | 5340 y Fs(dirs)p eop end |
| 28157acd CR |
9884 | %%Page: 78 84 |
| 9885 | TeXDict begin 78 83 bop 150 -116 a Ft(78)2572 b(Bash)31 | |
| 37c41ab1 CR |
9886 | b(Reference)g(Man)m(ual)870 299 y Fs(dirs)47 b([+)p Fj(N)57 |
| 9887 | b Fs(|)48 b(-)p Fj(N)11 b Fs(])46 b([-clpv])630 426 y | |
| 9888 | Ft(Displa)m(y)35 b(the)f(list)g(of)g(curren)m(tly)g(remem)m(b)s(ered)f | |
| 9889 | (directories.)51 b(Directories)36 b(are)e(added)f(to)630 | |
| 9890 | 536 y(the)28 b(list)h(with)f(the)g Fs(pushd)f Ft(command;)i(the)f | |
| 9891 | Fs(popd)f Ft(command)h(remo)m(v)m(es)h(directories)g(from)630 | |
| 9892 | 645 y(the)i(list.)630 791 y Fs(+)p Fj(N)384 b Ft(Displa)m(ys)23 | |
| 9893 | b(the)f Fq(N)10 b Ft(th)21 b(directory)h(\(coun)m(ting)h(from)e(the)h | |
| 9894 | (left)g(of)g(the)g(list)g(prin)m(ted)1110 900 y(b)m(y)30 | |
| 9895 | b Fs(dirs)f Ft(when)h(in)m(v)m(ok)m(ed)i(without)e(options\),)h | |
| 9896 | (starting)g(with)g(zero.)630 1045 y Fs(-)p Fj(N)384 b | |
| 9897 | Ft(Displa)m(ys)47 b(the)g Fq(N)10 b Ft(th)46 b(directory)h(\(coun)m | |
| 9898 | (ting)g(from)f(the)g(righ)m(t)h(of)g(the)f(list)1110 | |
| 9899 | 1155 y(prin)m(ted)25 b(b)m(y)g Fs(dirs)g Ft(when)f(in)m(v)m(ok)m(ed)j | |
| 9900 | (without)f(options\),)h(starting)g(with)e(zero.)630 1300 | |
| 9901 | y Fs(-c)384 b Ft(Clears)31 b(the)f(directory)h(stac)m(k)h(b)m(y)e | |
| 9902 | (deleting)h(all)h(of)e(the)h(elemen)m(ts.)630 1445 y | |
| 9903 | Fs(-l)384 b Ft(Pro)s(duces)30 b(a)i(longer)g(listing;)h(the)f(default)f | |
| 9904 | (listing)i(format)e(uses)g(a)h(tilde)g(to)1110 1555 y(denote)f(the)f | |
| 9905 | (home)h(directory)-8 b(.)630 1700 y Fs(-p)384 b Ft(Causes)30 | |
| 9906 | b Fs(dirs)f Ft(to)i(prin)m(t)f(the)h(directory)g(stac)m(k)h(with)e(one) | |
| 9907 | g(en)m(try)h(p)s(er)e(line.)630 1845 y Fs(-v)384 b Ft(Causes)36 | |
| 9908 | b Fs(dirs)f Ft(to)i(prin)m(t)f(the)g(directory)h(stac)m(k)h(with)e(one) | |
| 9909 | h(en)m(try)f(p)s(er)f(line,)1110 1955 y(pre\014xing)30 | |
| 9910 | b(eac)m(h)h(en)m(try)g(with)f(its)h(index)e(in)i(the)f(stac)m(k.)150 | |
| 9911 | 2100 y Fs(popd)870 2227 y(popd)47 b([+)p Fj(N)57 b Fs(|)48 | |
| 9912 | b(-)p Fj(N)11 b Fs(])46 b([-n])630 2354 y Ft(Remo)m(v)m(e)26 | |
| 9913 | b(the)e(top)g(en)m(try)h(from)e(the)h(directory)h(stac)m(k,)i(and)c | |
| 8a9c66f6 | 9914 | Fs(cd)h Ft(to)h(the)f(new)f(top)i(directory)-8 b(.)630 |
| 37c41ab1 CR |
9915 | 2464 y(When)32 b(no)g(argumen)m(ts)h(are)g(giv)m(en,)h |
| 9916 | Fs(popd)d Ft(remo)m(v)m(es)j(the)f(top)f(directory)h(from)f(the)g(stac) | |
| 9917 | m(k)630 2574 y(and)f(p)s(erforms)e(a)j Fs(cd)f Ft(to)h(the)f(new)g(top) | |
| 9918 | h(directory)-8 b(.)44 b(The)31 b(elemen)m(ts)i(are)e(n)m(um)m(b)s(ered) | |
| 9919 | f(from)630 2683 y(0)d(starting)g(at)g(the)g(\014rst)f(directory)h | |
| 9920 | (listed)g(with)f Fs(dirs)p Ft(;)h(i.e.,)i Fs(popd)c Ft(is)i(equiv)-5 | |
| 9921 | b(alen)m(t)28 b(to)f Fs(popd)630 2793 y(+0)p Ft(.)630 | |
| 9922 | 2938 y Fs(+)p Fj(N)384 b Ft(Remo)m(v)m(es)22 b(the)f | |
| 9923 | Fq(N)10 b Ft(th)20 b(directory)g(\(coun)m(ting)i(from)e(the)g(left)h | |
| 9924 | (of)g(the)f(list)h(prin)m(ted)1110 3048 y(b)m(y)30 b | |
| 9925 | Fs(dirs)p Ft(\),)g(starting)h(with)f(zero.)630 3193 y | |
| 8a9c66f6 | 9926 | Fs(-)p Fj(N)384 b Ft(Remo)m(v)m(es)46 b(the)g Fq(N)10 |
| 37c41ab1 CR |
9927 | b Ft(th)44 b(directory)h(\(coun)m(ting)h(from)f(the)g(righ)m(t)g(of)g |
| 9928 | (the)g(list)1110 3302 y(prin)m(ted)30 b(b)m(y)g Fs(dirs)p | |
| 9929 | Ft(\),)g(starting)h(with)f(zero.)630 3447 y Fs(-n)384 | |
| 9930 | b Ft(Suppresses)27 b(the)j(normal)g(c)m(hange)g(of)g(directory)g(when)e | |
| 9931 | (remo)m(ving)j(directo-)1110 3557 y(ries)f(from)g(the)h(stac)m(k,)h(so) | |
| 9932 | f(that)g(only)f(the)h(stac)m(k)g(is)g(manipulated.)150 | |
| 28157acd CR |
9933 | 3720 y Fs(pushd)870 3847 y(pushd)46 b([)p Fj(dir)58 b |
| 9934 | Fs(|)47 b(+)p Fj(N)58 b Fs(|)47 b Fj(-N)11 b Fs(])47 | |
| 9935 | b([-n])630 3975 y Ft(Sa)m(v)m(e)30 b(the)e(curren)m(t)g(directory)h(on) | |
| 9936 | f(the)h(top)f(of)h(the)f(directory)h(stac)m(k)h(and)e(then)g | |
| 37c41ab1 | 9937 | Fs(cd)f Ft(to)i Fq(dir)p Ft(.)630 4084 y(With)i(no)f(argumen)m(ts,)h |
| 8a9c66f6 | 9938 | Fs(pushd)e Ft(exc)m(hanges)j(the)e(top)h(t)m(w)m(o)h(directories.)630 |
| 28157acd | 9939 | 4229 y Fs(+)p Fj(N)384 b Ft(Brings)29 b(the)f Fq(N)10 |
| 37c41ab1 | 9940 | b Ft(th)29 b(directory)g(\(coun)m(ting)h(from)e(the)g(left)i(of)e(the)h |
| 28157acd | 9941 | (list)g(prin)m(ted)1110 4339 y(b)m(y)34 b Fs(dirs)p Ft(,)g(starting)h |
| 37c41ab1 | 9942 | (with)f(zero\))i(to)f(the)f(top)g(of)h(the)f(list)h(b)m(y)f(rotating)i |
| 28157acd | 9943 | (the)1110 4449 y(stac)m(k.)630 4594 y Fs(-)p Fj(N)384 |
| 37c41ab1 CR |
9944 | b Ft(Brings)23 b(the)g Fq(N)10 b Ft(th)23 b(directory)h(\(coun)m(ting)g |
| 9945 | (from)e(the)i(righ)m(t)f(of)g(the)h(list)f(prin)m(ted)1110 | |
| 28157acd | 9946 | 4703 y(b)m(y)34 b Fs(dirs)p Ft(,)g(starting)h(with)f(zero\))i(to)f(the) |
| 37c41ab1 | 9947 | f(top)g(of)h(the)f(list)h(b)m(y)f(rotating)i(the)1110 |
| 28157acd CR |
9948 | 4813 y(stac)m(k.)630 4958 y Fs(-n)384 b Ft(Suppresses)26 |
| 9949 | b(the)i(normal)h(c)m(hange)g(of)f(directory)h(when)e(adding)h | |
| 9950 | (directories)1110 5068 y(to)j(the)g(stac)m(k,)h(so)e(that)h(only)g(the) | |
| 9951 | f(stac)m(k)i(is)f(manipulated.)630 5213 y Fj(dir)336 | |
| 9952 | b Ft(Mak)m(es)36 b(the)f(curren)m(t)g(w)m(orking)g(directory)g(b)s(e)f | |
| 9953 | (the)h(top)g(of)g(the)g(stac)m(k,)j(and)1110 5322 y(then)30 | |
| 9954 | b(executes)i(the)e(equiv)-5 b(alen)m(t)32 b(of)f(`)p | |
| 9955 | Fs(cd)f Fq(dir)7 b Ft('.)39 b Fs(cd)p Ft(s)30 b(to)h | |
| 9956 | Fq(dir)p Ft(.)p eop end | |
| 9957 | %%Page: 79 85 | |
| 9958 | TeXDict begin 79 84 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 9959 | b(Bash)30 b(F)-8 b(eatures)2484 b(79)150 299 y Fr(6.9)68 | |
| 37c41ab1 CR |
9960 | b(Con)l(trolling)47 b(the)e(Prompt)275 544 y Ft(The)c(v)-5 |
| 9961 | b(alue)43 b(of)f(the)h(v)-5 b(ariable)43 b Fs(PROMPT_COMMAND)38 | |
| 9962 | b Ft(is)k(examined)g(just)g(b)s(efore)g(Bash)g(prin)m(ts)g(eac)m(h)150 | |
| 9963 | 653 y(primary)f(prompt.)73 b(If)41 b Fs(PROMPT_COMMAND)d | |
| 9964 | Ft(is)j(set)h(and)f(has)h(a)g(non-n)m(ull)f(v)-5 b(alue,)45 | |
| 9965 | b(then)c(the)h(v)-5 b(alue)42 b(is)150 763 y(executed)31 | |
| 9966 | b(just)f(as)h(if)f(it)h(had)f(b)s(een)f(t)m(yp)s(ed)h(on)h(the)f | |
| 9967 | (command)g(line.)275 898 y(In)d(addition,)j(the)f(follo)m(wing)h(table) | |
| 9968 | f(describ)s(es)f(the)h(sp)s(ecial)g(c)m(haracters)h(whic)m(h)f(can)f | |
| 9969 | (app)s(ear)g(in)h(the)150 1008 y(prompt)g(v)-5 b(ariables:)150 | |
| 9970 | 1168 y Fs(\\a)384 b Ft(A)30 b(b)s(ell)h(c)m(haracter.)150 | |
| 9971 | 1328 y Fs(\\d)384 b Ft(The)30 b(date,)h(in)f Fs(")p Ft(W)-8 | |
| 9972 | b(eekda)m(y)32 b(Mon)m(th)f(Date)p Fs(")h Ft(format)f(\(e.g.,)h | |
| 9973 | Fs(")p Ft(T)-8 b(ue)30 b(Ma)m(y)h(26)p Fs(")p Ft(\).)150 | |
| 9974 | 1488 y Fs(\\D{)p Fj(format)11 b Fs(})630 1598 y Ft(The)27 | |
| 9975 | b Fq(format)i Ft(is)f(passed)e(to)i Fs(strftime)p Ft(\(3\))f(and)f(the) | |
| 9976 | i(result)f(is)g(inserted)g(in)m(to)h(the)g(prompt)630 | |
| 9977 | 1708 y(string;)42 b(an)d(empt)m(y)f Fq(format)j Ft(results)d(in)g(a)h | |
| 9978 | (lo)s(cale-sp)s(eci\014c)h(time)f(represen)m(tation.)65 | |
| 5e13499c CR |
9979 | b(The)630 1817 y(braces)31 b(are)f(required.)150 1977 |
| 9980 | y Fs(\\e)384 b Ft(An)30 b(escap)s(e)h(c)m(haracter.)150 | |
| 9981 | 2137 y Fs(\\h)384 b Ft(The)30 b(hostname,)h(up)e(to)i(the)g(\014rst)e | |
| 9982 | (`.'.)150 2298 y Fs(\\H)384 b Ft(The)30 b(hostname.)150 | |
| 9983 | 2458 y Fs(\\j)384 b Ft(The)30 b(n)m(um)m(b)s(er)f(of)h(jobs)g(curren)m | |
| 37c41ab1 CR |
9984 | (tly)h(managed)g(b)m(y)f(the)g(shell.)150 2618 y Fs(\\l)384 |
| 9985 | b Ft(The)30 b(basename)h(of)f(the)h(shell's)f(terminal)h(device)g | |
| 5e13499c | 9986 | (name.)150 2778 y Fs(\\n)384 b Ft(A)30 b(newline.)150 |
| 37c41ab1 CR |
9987 | 2938 y Fs(\\r)384 b Ft(A)30 b(carriage)i(return.)150 |
| 9988 | 3098 y Fs(\\s)384 b Ft(The)22 b(name)g(of)h(the)f(shell,)i(the)f | |
| 9989 | (basename)f(of)h Fs($0)f Ft(\(the)g(p)s(ortion)g(follo)m(wing)i(the)f | |
| 9990 | (\014nal)e(slash\).)150 3258 y Fs(\\t)384 b Ft(The)30 | |
| 9991 | b(time,)h(in)f(24-hour)h(HH:MM:SS)g(format.)150 3418 | |
| 9992 | y Fs(\\T)384 b Ft(The)30 b(time,)h(in)f(12-hour)h(HH:MM:SS)g(format.) | |
| 9993 | 150 3579 y Fs(\\@)384 b Ft(The)30 b(time,)h(in)f(12-hour)h(am/pm)f | |
| 9994 | (format.)150 3739 y Fs(\\A)384 b Ft(The)30 b(time,)h(in)f(24-hour)h | |
| 5e13499c CR |
9995 | (HH:MM)g(format.)150 3899 y Fs(\\u)384 b Ft(The)30 b(username)g(of)g |
| 9996 | (the)h(curren)m(t)f(user.)150 4059 y Fs(\\v)384 b Ft(The)30 | |
| 37c41ab1 CR |
9997 | b(v)m(ersion)h(of)f(Bash)h(\(e.g.,)h(2.00\))150 4219 |
| 9998 | y Fs(\\V)384 b Ft(The)30 b(release)i(of)e(Bash,)h(v)m(ersion)g | |
| 9999 | Fs(+)f Ft(patc)m(hlev)m(el)i(\(e.g.,)h(2.00.0\))150 4379 | |
| 10000 | y Fs(\\w)384 b Ft(The)30 b(curren)m(t)g(w)m(orking)h(directory)-8 | |
| 10001 | b(,)31 b(with)f Fs($HOME)f Ft(abbreviated)i(with)f(a)h(tilde.)150 | |
| 113d85a4 | 10002 | 4539 y Fs(\\W)384 b Ft(The)30 b(basename)h(of)f Fs($PWD)p |
| 37c41ab1 CR |
10003 | Ft(,)g(with)g Fs($HOME)f Ft(abbreviated)h(with)g(a)h(tilde.)150 |
| 10004 | 4699 y Fs(\\!)384 b Ft(The)30 b(history)g(n)m(um)m(b)s(er)f(of)i(this)f | |
| 113d85a4 | 10005 | (command.)150 4860 y Fs(\\#)384 b Ft(The)30 b(command)g(n)m(um)m(b)s |
| 37c41ab1 CR |
10006 | (er)f(of)i(this)f(command.)150 5020 y Fs(\\$)384 b Ft(If)30 |
| 10007 | b(the)g(e\013ectiv)m(e)j(uid)d(is)g(0,)h Fs(#)p Ft(,)g(otherwise)g | |
| 113d85a4 | 10008 | Fs($)p Ft(.)150 5180 y Fs(\\)p Fj(nnn)288 b Ft(The)30 |
| 37c41ab1 CR |
10009 | b(c)m(haracter)i(whose)e(ASCI)s(I)f(co)s(de)h(is)h(the)f(o)s(ctal)i(v) |
| 10010 | -5 b(alue)31 b Fq(nnn)p Ft(.)150 5340 y Fs(\\\\)384 b | |
| 10011 | Ft(A)30 b(bac)m(kslash.)p eop end | |
| 28157acd CR |
10012 | %%Page: 80 86 |
| 10013 | TeXDict begin 80 85 bop 150 -116 a Ft(80)2572 b(Bash)31 | |
| 37c41ab1 CR |
10014 | b(Reference)g(Man)m(ual)150 299 y Fs(\\[)384 b Ft(Begin)38 |
| 10015 | b(a)f(sequence)g(of)g(non-prin)m(ting)g(c)m(haracters.)61 | |
| 10016 | b(This)36 b(could)h(b)s(e)g(used)f(to)h(em)m(b)s(ed)g(a)630 | |
| 10017 | 408 y(terminal)31 b(con)m(trol)h(sequence)e(in)m(to)i(the)e(prompt.)150 | |
| ac18b312 CR |
10018 | 561 y Fs(\\])384 b Ft(End)29 b(a)i(sequence)g(of)f(non-prin)m(ting)g(c) |
| 10019 | m(haracters.)275 713 y(The)25 b(command)h(n)m(um)m(b)s(er)f(and)h(the)g | |
| 37c41ab1 | 10020 | (history)g(n)m(um)m(b)s(er)f(are)i(usually)f(di\013eren)m(t:)39 |
| ac18b312 | 10021 | b(the)26 b(history)g(n)m(um)m(b)s(er)150 823 y(of)h(a)f(command)h(is)f |
| 37c41ab1 | 10022 | (its)h(p)s(osition)f(in)g(the)h(history)f(list,)i(whic)m(h)f(ma)m(y)g |
| ac18b312 | 10023 | (include)f(commands)g(restored)g(from)150 932 y(the)39 |
| 37c41ab1 | 10024 | b(history)h(\014le)f(\(see)h(Section)g(9.1)h([Bash)e(History)h(F)-8 |
| 28157acd | 10025 | b(acilities],)45 b(page)40 b(115\),)j(while)d(the)f(command)150 |
| ac18b312 | 10026 | 1042 y(n)m(um)m(b)s(er)j(is)h(the)h(p)s(osition)f(in)g(the)g(sequence)h |
| 37c41ab1 | 10027 | (of)f(commands)g(executed)h(during)e(the)i(curren)m(t)f(shell)150 |
| ac18b312 | 10028 | 1152 y(session.)275 1283 y(After)35 b(the)g(string)g(is)g(deco)s(ded,)h |
| 37c41ab1 | 10029 | (it)f(is)g(expanded)f(via)i(parameter)f(expansion,)i(command)d(substi-) |
| ac18b312 | 10030 | 150 1392 y(tution,)k(arithmetic)f(expansion,)g(and)e(quote)h(remo)m(v) |
| 37c41ab1 | 10031 | -5 b(al,)39 b(sub)5 b(ject)35 b(to)i(the)f(v)-5 b(alue)36 |
| ac18b312 CR |
10032 | b(of)g(the)g Fs(promptvars)150 1502 y Ft(shell)31 b(option)f(\(see)i |
| 10033 | (Section)f(4.2)g([Bash)g(Builtins],)g(page)g(41\).)150 | |
| 10034 | 1749 y Fr(6.10)68 b(The)45 b(Restricted)h(Shell)275 1989 | |
| 37c41ab1 | 10035 | y Ft(If)26 b(Bash)h(is)f(started)h(with)g(the)g(name)f |
| 5e13499c | 10036 | Fs(rbash)p Ft(,)h(or)f(the)h(`)p Fs(--restricted)p Ft(')d(or)j(`)p |
| ac18b312 | 10037 | Fs(-r)p Ft(')f(option)h(is)g(supplied)150 2099 y(at)32 |
| 37c41ab1 CR |
10038 | b(in)m(v)m(o)s(cation,)i(the)d(shell)g(b)s(ecomes)h(restricted.)44 |
| 10039 | b(A)31 b(restricted)h(shell)f(is)g(used)g(to)h(set)f(up)f(an)i(en)m | |
| ac18b312 | 10040 | (viron-)150 2208 y(men)m(t)26 b(more)f(con)m(trolled)i(than)e(the)h |
| 37c41ab1 | 10041 | (standard)e(shell.)40 b(A)25 b(restricted)h(shell)g(b)s(eha)m(v)m(es)g |
| ac18b312 | 10042 | (iden)m(tically)h(to)f Fs(bash)150 2318 y Ft(with)k(the)h(exception)g |
| 37c41ab1 | 10043 | (that)g(the)g(follo)m(wing)h(are)e(disallo)m(w)m(ed)i(or)f(not)f(p)s |
| ac18b312 CR |
10044 | (erformed:)225 2449 y Fp(\017)60 b Ft(Changing)30 b(directories)h(with) |
| 10045 | g(the)f Fs(cd)g Ft(builtin.)225 2580 y Fp(\017)60 b Ft(Setting)31 | |
| 37c41ab1 | 10046 | b(or)f(unsetting)h(the)g(v)-5 b(alues)30 b(of)h(the)f |
| 5e13499c | 10047 | Fs(SHELL)p Ft(,)g Fs(PATH)p Ft(,)f Fs(ENV)p Ft(,)h(or)g |
| ac18b312 | 10048 | Fs(BASH_ENV)e Ft(v)-5 b(ariables.)225 2711 y Fp(\017)60 |
| 37c41ab1 | 10049 | b Ft(Sp)s(ecifying)30 b(command)g(names)g(con)m(taining)i(slashes.)225 |
| ac18b312 | 10050 | 2842 y Fp(\017)60 b Ft(Sp)s(ecifying)30 b(a)h(\014lename)f(con)m |
| 37c41ab1 | 10051 | (taining)i(a)f(slash)f(as)h(an)f(argumen)m(t)h(to)g(the)f |
| ac18b312 | 10052 | Fs(.)h Ft(builtin)e(command.)225 2973 y Fp(\017)60 b |
| 37c41ab1 CR |
10053 | Ft(Sp)s(ecifying)28 b(a)i(\014lename)f(con)m(taining)h(a)g(slash)e(as)h |
| 10054 | (an)g(argumen)m(t)h(to)f(the)g(`)p Fs(-p)p Ft(')g(option)g(to)h(the)f | |
| ac18b312 | 10055 | Fs(hash)330 3083 y Ft(builtin)h(command.)225 3214 y Fp(\017)60 |
| 37c41ab1 | 10056 | b Ft(Imp)s(orting)30 b(function)g(de\014nitions)g(from)f(the)i(shell)g |
| ac18b312 | 10057 | (en)m(vironmen)m(t)g(at)g(startup.)225 3345 y Fp(\017)60 |
| 37c41ab1 CR |
10058 | b Ft(P)m(arsing)31 b(the)f(v)-5 b(alue)31 b(of)g Fs(SHELLOPTS)d |
| 10059 | Ft(from)h(the)i(shell)g(en)m(vironmen)m(t)g(at)g(startup.)225 | |
| ac18b312 | 10060 | 3476 y Fp(\017)60 b Ft(Redirecting)31 b(output)f(using)g(the)h(`)p |
| 37c41ab1 CR |
10061 | Fs(>)p Ft(',)g(`)p Fs(>|)p Ft(',)f(`)p Fs(<>)p Ft(',)h(`)p |
| 10062 | Fs(>&)p Ft(',)f(`)p Fs(&>)p Ft(',)h(and)e(`)p Fs(>>)p | |
| ac18b312 | 10063 | Ft(')i(redirection)g(op)s(erators.)225 3607 y Fp(\017)60 |
| 37c41ab1 | 10064 | b Ft(Using)31 b(the)f Fs(exec)f Ft(builtin)h(to)h(replace)h(the)e |
| ac18b312 | 10065 | (shell)h(with)f(another)h(command.)225 3738 y Fp(\017)60 |
| 37c41ab1 CR |
10066 | b Ft(Adding)40 b(or)h(deleting)h(builtin)e(commands)h(with)f(the)h(`)p |
| 10067 | Fs(-f)p Ft(')g(and)f(`)p Fs(-d)p Ft(')h(options)g(to)h(the)f | |
| ac18b312 | 10068 | Fs(enable)330 3847 y Ft(builtin.)225 3978 y Fp(\017)60 |
| 37c41ab1 | 10069 | b Ft(Using)31 b(the)f Fs(enable)f Ft(builtin)h(command)g(to)h(enable)g |
| ac18b312 | 10070 | (disabled)f(shell)g(builtins.)225 4109 y Fp(\017)60 b |
| 37c41ab1 | 10071 | Ft(Sp)s(ecifying)30 b(the)g(`)p Fs(-p)p Ft(')h(option)g(to)g(the)f |
| ac18b312 | 10072 | Fs(command)f Ft(builtin.)225 4240 y Fp(\017)60 b Ft(T)-8 |
| 37c41ab1 CR |
10073 | b(urning)29 b(o\013)i(restricted)g(mo)s(de)f(with)g(`)p |
| 10074 | Fs(set)g(+r)p Ft(')g(or)g(`)p Fs(set)g(+o)g(restricted)p | |
| ac18b312 CR |
10075 | Ft('.)275 4393 y(These)g(restrictions)h(are)g(enforced)f(after)h(an)m |
| 10076 | (y)g(startup)f(\014les)g(are)h(read.)275 4524 y(When)j(a)i(command)e | |
| 37c41ab1 | 10077 | (that)i(is)f(found)f(to)h(b)s(e)g(a)g(shell)g(script)g(is)g(executed)h |
| ac18b312 | 10078 | (\(see)g(Section)g(3.8)g([Shell)150 4633 y(Scripts],)25 |
| eb2bb562 | 10079 | b(page)e(32\),)j Fs(rbash)c Ft(turns)g(o\013)i(an)m(y)f(restrictions)h |
| 37c41ab1 | 10080 | (in)f(the)g(shell)h(spa)m(wned)e(to)i(execute)g(the)g(script.)150 |
| ac18b312 | 10081 | 4880 y Fr(6.11)68 b(Bash)45 b(POSIX)f(Mo)t(de)275 5121 |
| 37c41ab1 CR |
10082 | y Ft(Starting)21 b(Bash)g(with)f(the)h(`)p Fs(--posix)p |
| 10083 | Ft(')e(command-line)j(option)f(or)g(executing)h(`)p Fs(set)30 | |
| ac18b312 CR |
10084 | b(-o)f(posix)p Ft(')20 b(while)150 5230 y(Bash)26 b(is)g(running)e |
| 10085 | (will)j(cause)f(Bash)g(to)h(conform)f(more)g(closely)h(to)g(the)f | |
| 10086 | Fl(posix)f Ft(standard)g(b)m(y)h(c)m(hanging)150 5340 | |
| 10087 | y(the)31 b(b)s(eha)m(vior)f(to)h(matc)m(h)g(that)g(sp)s(eci\014ed)f(b)m | |
| 10088 | (y)g Fl(posix)g Ft(in)g(areas)h(where)f(the)h(Bash)f(default)h | |
| 10089 | (di\013ers.)p eop end | |
| 28157acd CR |
10090 | %%Page: 81 87 |
| 10091 | TeXDict begin 81 86 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 10092 | b(Bash)30 b(F)-8 b(eatures)2484 b(81)275 299 y(When)30 | |
| ac18b312 CR |
10093 | b(in)m(v)m(ok)m(ed)h(as)g Fs(sh)p Ft(,)f(Bash)h(en)m(ters)g |
| 10094 | Fl(posix)e Ft(mo)s(de)h(after)h(reading)g(the)f(startup)g(\014les.)275 | |
| 10095 | 429 y(The)f(follo)m(wing)j(list)f(is)g(what's)f(c)m(hanged)h(when)e(`)p | |
| 10096 | Fl(posix)h Ft(mo)s(de')h(is)f(in)g(e\013ect:)199 560 | |
| 10097 | y(1.)61 b(When)28 b(a)i(command)e(in)g(the)h(hash)f(table)i(no)e | |
| 10098 | (longer)h(exists,)h(Bash)f(will)g(re-searc)m(h)h Fs($PATH)d | |
| 10099 | Ft(to)i(\014nd)330 669 y(the)i(new)e(lo)s(cation.)43 | |
| 10100 | b(This)29 b(is)i(also)g(a)m(v)-5 b(ailable)33 b(with)d(`)p | |
| 10101 | Fs(shopt)f(-s)h(checkhash)p Ft('.)199 800 y(2.)61 b(The)42 | |
| 10102 | b(message)h(prin)m(ted)e(b)m(y)h(the)g(job)g(con)m(trol)i(co)s(de)e | |
| 10103 | (and)f(builtins)h(when)f(a)h(job)g(exits)h(with)f(a)330 | |
| 10104 | 909 y(non-zero)31 b(status)g(is)f(`Done\(status\)'.)199 | |
| 10105 | 1040 y(3.)61 b(The)40 b(message)h(prin)m(ted)f(b)m(y)g(the)h(job)f(con) | |
| 37c41ab1 | 10106 | m(trol)h(co)s(de)g(and)f(builtins)f(when)h(a)g(job)g(is)h(stopp)s(ed)e |
| ac18b312 | 10107 | (is)330 1149 y(`Stopp)s(ed\()p Fq(signame)5 b Ft(\)',)31 |
| 37c41ab1 | 10108 | b(where)f Fq(signame)36 b Ft(is,)31 b(for)f(example,)h |
| ac18b312 | 10109 | Fs(SIGTSTP)p Ft(.)199 1280 y(4.)61 b(The)27 b Fs(bg)g |
| 1c72c0cd | 10110 | Ft(builtin)g(uses)g(the)h(required)f(format)h(to)g(describ)s(e)f(eac)m |
| ac18b312 | 10111 | (h)i(job)e(placed)h(in)f(the)h(bac)m(kground,)330 1390 |
| 1c72c0cd CR |
10112 | y(whic)m(h)h(do)s(es)g(not)g(include)g(an)g(indication)h(of)f(whether)f |
| 10113 | (the)h(job)g(is)g(the)h(curren)m(t)e(or)h(previous)g(job.)199 | |
| ac18b312 | 10114 | 1520 y(5.)61 b(Reserv)m(ed)40 b(w)m(ords)g(app)s(earing)f(in)h(a)g(con) |
| 1c72c0cd | 10115 | m(text)i(where)d(reserv)m(ed)h(w)m(ords)f(are)i(recognized)g(do)f(not) |
| ac18b312 CR |
10116 | 330 1630 y(undergo)30 b(alias)h(expansion.)199 1760 y(6.)61 |
| 10117 | b(The)38 b Fl(posix)h Fs(PS1)f Ft(and)g Fs(PS2)g Ft(expansions)g(of)i | |
| 10118 | (`)p Fs(!)p Ft(')f(to)g(the)g(history)g(n)m(um)m(b)s(er)f(and)g(`)p | |
| 10119 | Fs(!!)p Ft(')h(to)g(`)p Fs(!)p Ft(')h(are)330 1870 y(enabled,)26 | |
| 10120 | b(and)f(parameter)g(expansion)g(is)g(p)s(erformed)e(on)i(the)g(v)-5 | |
| 10121 | b(alues)25 b(of)g Fs(PS1)f Ft(and)h Fs(PS2)f Ft(regardless)330 | |
| 10122 | 1979 y(of)31 b(the)f(setting)i(of)e(the)h Fs(promptvars)c | |
| 10123 | Ft(option.)199 2110 y(7.)61 b(The)30 b Fl(posix)g Ft(startup)f(\014les) | |
| 10124 | i(are)g(executed)g(\()p Fs($ENV)p Ft(\))f(rather)g(than)g(the)h(normal) | |
| 10125 | f(Bash)g(\014les.)199 2240 y(8.)61 b(Tilde)30 b(expansion)g(is)f(only)h | |
| 10126 | (p)s(erformed)f(on)h(assignmen)m(ts)g(preceding)g(a)g(command)g(name,)g | |
| 10127 | (rather)330 2350 y(than)g(on)g(all)i(assignmen)m(t)f(statemen)m(ts)h | |
| 10128 | (on)e(the)h(line.)199 2480 y(9.)61 b(The)30 b(default)g(history)h | |
| 10129 | (\014le)f(is)h(`)p Fs(~/.sh_history)p Ft(')c(\(this)k(is)f(the)g | |
| 10130 | (default)h(v)-5 b(alue)31 b(of)f Fs($HISTFILE)p Ft(\).)154 | |
| 10131 | 2611 y(10.)61 b(The)23 b(output)f(of)i(`)p Fs(kill)29 | |
| 10132 | b(-l)p Ft(')23 b(prin)m(ts)f(all)i(the)g(signal)f(names)g(on)g(a)h | |
| 10133 | (single)g(line,)h(separated)e(b)m(y)g(spaces,)330 2720 | |
| 10134 | y(without)30 b(the)h(`)p Fs(SIG)p Ft(')f(pre\014x.)154 | |
| 10135 | 2851 y(11.)61 b(The)30 b Fs(kill)f Ft(builtin)h(do)s(es)g(not)h(accept) | |
| 10136 | h(signal)f(names)f(with)g(a)h(`)p Fs(SIG)p Ft(')f(pre\014x.)154 | |
| 10137 | 2981 y(12.)61 b(Non-in)m(teractiv)m(e)34 b(shells)c(exit)h(if)g | |
| 10138 | Fq(\014lename)k Ft(in)30 b Fs(.)g Fq(\014lename)36 b | |
| 10139 | Ft(is)31 b(not)f(found.)154 3112 y(13.)61 b(Non-in)m(teractiv)m(e)41 | |
| 10140 | b(shells)d(exit)h(if)f(a)g(syn)m(tax)g(error)g(in)f(an)h(arithmetic)h | |
| 10141 | (expansion)f(results)f(in)h(an)330 3221 y(in)m(v)-5 b(alid)31 | |
| 10142 | b(expression.)154 3352 y(14.)61 b(Redirection)25 b(op)s(erators)f(do)g | |
| 10143 | (not)g(p)s(erform)f(\014lename)h(expansion)g(on)g(the)g(w)m(ord)f(in)h | |
| 10144 | (the)g(redirection)330 3461 y(unless)30 b(the)g(shell)h(is)f(in)m | |
| 10145 | (teractiv)m(e.)154 3592 y(15.)61 b(Redirection)31 b(op)s(erators)g(do)f | |
| 10146 | (not)h(p)s(erform)e(w)m(ord)h(splitting)h(on)f(the)h(w)m(ord)f(in)g | |
| 10147 | (the)g(redirection.)154 3722 y(16.)61 b(F)-8 b(unction)35 | |
| 10148 | b(names)g(m)m(ust)f(b)s(e)g(v)-5 b(alid)35 b(shell)f | |
| 10149 | Fs(name)p Ft(s.)52 b(That)34 b(is,)i(they)f(ma)m(y)g(not)g(con)m(tain)g | |
| 10150 | (c)m(haracters)330 3832 y(other)e(than)g(letters,)h(digits,)h(and)d | |
| 10151 | (underscores,)h(and)f(ma)m(y)h(not)g(start)h(with)e(a)h(digit.)49 | |
| 10152 | b(Declaring)330 3941 y(a)31 b(function)f(with)g(an)g(in)m(v)-5 | |
| 10153 | b(alid)31 b(name)g(causes)f(a)h(fatal)h(syn)m(tax)f(error)f(in)g | |
| 10154 | (non-in)m(teractiv)m(e)j(shells.)154 4072 y(17.)61 b | |
| 10155 | Fl(posix)30 b Ft(sp)s(ecial)h(builtins)e(are)i(found)e(b)s(efore)h | |
| 10156 | (shell)h(functions)f(during)f(command)h(lo)s(okup.)154 | |
| 10157 | 4202 y(18.)61 b(If)24 b(a)g Fl(posix)g Ft(sp)s(ecial)h(builtin)f | |
| 10158 | (returns)f(an)h(error)g(status,)i(a)e(non-in)m(teractiv)m(e)j(shell)e | |
| 10159 | (exits.)39 b(The)24 b(fatal)330 4312 y(errors)i(are)h(those)f(listed)h | |
| 10160 | (in)f(the)h(POSIX)e(standard,)i(and)f(include)g(things)g(lik)m(e)i | |
| 10161 | (passing)e(incorrect)330 4422 y(options,)43 b(redirection)d(errors,)i | |
| 10162 | (v)-5 b(ariable)41 b(assignmen)m(t)g(errors)e(for)g(assignmen)m(ts)i | |
| 10163 | (preceding)f(the)330 4531 y(command)30 b(name,)h(and)f(so)g(on.)154 | |
| 10164 | 4662 y(19.)61 b(If)34 b Fs(CDPATH)f Ft(is)h(set,)i(the)f | |
| 3ee6b87d | 10165 | Fs(cd)f Ft(builtin)g(will)g(not)h(implicitly)h(app)s(end)c(the)j |
| ac18b312 | 10166 | (curren)m(t)f(directory)h(to)g(it.)330 4771 y(This)29 |
| 3ee6b87d CR |
10167 | b(means)g(that)h Fs(cd)f Ft(will)h(fail)g(if)g(no)f(v)-5 |
| 10168 | b(alid)30 b(directory)g(name)f(can)h(b)s(e)f(constructed)h(from)f(an)m | |
| ac18b312 | 10169 | (y)h(of)330 4881 y(the)i(en)m(tries)g(in)f Fs($CDPATH)p |
| 3ee6b87d | 10170 | Ft(,)e(ev)m(en)j(if)g(the)f(a)h(directory)g(with)f(the)g(same)h(name)f |
| ac18b312 | 10171 | (as)h(the)g(name)f(giv)m(en)330 4990 y(as)g(an)f(argumen)m(t)h(to)g |
| 3ee6b87d | 10172 | Fs(cd)f Ft(exists)h(in)f(the)g(curren)m(t)g(directory)-8 |
| ac18b312 CR |
10173 | b(.)154 5121 y(20.)61 b(A)31 b(non-in)m(teractiv)m(e)j(shell)d(exits)h |
| 10174 | (with)e(an)h(error)g(status)g(if)g(a)g(v)-5 b(ariable)32 | |
| 10175 | b(assignmen)m(t)g(error)e(o)s(ccurs)330 5230 y(when)38 | |
| 10176 | b(no)h(command)g(name)g(follo)m(ws)i(the)e(assignmen)m(t)h(statemen)m | |
| 10177 | (ts.)69 b(A)39 b(v)-5 b(ariable)40 b(assignmen)m(t)330 | |
| 10178 | 5340 y(error)30 b(o)s(ccurs,)g(for)g(example,)i(when)d(trying)i(to)g | |
| 1c72c0cd | 10179 | (assign)f(a)h(v)-5 b(alue)31 b(to)g(a)g(readonly)f(v)-5 |
| ac18b312 | 10180 | b(ariable.)p eop end |
| 28157acd CR |
10181 | %%Page: 82 88 |
| 10182 | TeXDict begin 82 87 bop 150 -116 a Ft(82)2572 b(Bash)31 | |
| ac18b312 CR |
10183 | b(Reference)g(Man)m(ual)154 299 y(21.)61 b(A)43 b(non-in)m(teractiv)m |
| 10184 | (e)i(shell)e(exits)h(with)f(an)f(error)h(status)g(if)g(the)g(iteration) | |
| 10185 | h(v)-5 b(ariable)44 b(in)f(a)g Fs(for)330 408 y Ft(statemen)m(t)32 | |
| 37c41ab1 CR |
10186 | b(or)f(the)f(selection)i(v)-5 b(ariable)32 b(in)e(a)g |
| 10187 | Fs(select)f Ft(statemen)m(t)j(is)f(a)f(readonly)h(v)-5 | |
| ac18b312 CR |
10188 | b(ariable.)154 547 y(22.)61 b(Pro)s(cess)30 b(substitution)g(is)h(not)f |
| 10189 | (a)m(v)-5 b(ailable.)154 685 y(23.)61 b(Assignmen)m(t)23 | |
| 10190 | b(statemen)m(ts)h(preceding)e Fl(posix)f Ft(sp)s(ecial)i(builtins)f(p)s | |
| 10191 | (ersist)g(in)f(the)i(shell)f(en)m(vironmen)m(t)330 795 | |
| 10192 | y(after)31 b(the)f(builtin)g(completes.)154 933 y(24.)61 | |
| 10193 | b(Assignmen)m(t)35 b(statemen)m(ts)h(preceding)f(shell)f(function)g | |
| 10194 | (calls)i(p)s(ersist)e(in)g(the)h(shell)f(en)m(vironmen)m(t)330 | |
| 10195 | 1043 y(after)d(the)f(function)h(returns,)e(as)i(if)f(a)h | |
| 37c41ab1 | 10196 | Fl(posix)e Ft(sp)s(ecial)i(builtin)f(command)g(had)g(b)s(een)g |
| ac18b312 | 10197 | (executed.)154 1181 y(25.)61 b(The)38 b Fs(export)f Ft(and)g |
| 37c41ab1 | 10198 | Fs(readonly)f Ft(builtin)i(commands)g(displa)m(y)h(their)f(output)g(in) |
| ac18b312 CR |
10199 | g(the)h(format)g(re-)330 1291 y(quired)30 b(b)m(y)g Fl(posix)p |
| 10200 | Ft(.)154 1429 y(26.)61 b(The)30 b Fs(trap)f Ft(builtin)h(displa)m(ys)g | |
| 10201 | (signal)i(names)e(without)g(the)h(leading)g Fs(SIG)p | |
| 10202 | Ft(.)154 1568 y(27.)61 b(The)39 b Fs(trap)e Ft(builtin)i(do)s(esn't)g | |
| 37c41ab1 | 10203 | (c)m(hec)m(k)h(the)g(\014rst)e(argumen)m(t)i(for)e(a)i(p)s(ossible)e |
| ac18b312 | 10204 | (signal)i(sp)s(eci\014cation)330 1677 y(and)30 b(rev)m(ert)i(the)e |
| 37c41ab1 | 10205 | (signal)i(handling)e(to)h(the)g(original)h(disp)s(osition)e(if)h(it)g |
| ac18b312 | 10206 | (is,)g(unless)f(that)h(argumen)m(t)330 1787 y(consists)e(solely)g(of)g |
| 37c41ab1 CR |
10207 | (digits)g(and)f(is)g(a)h(v)-5 b(alid)29 b(signal)g(n)m(um)m(b)s(er.)38 |
| 10208 | b(If)28 b(users)g(w)m(an)m(t)h(to)g(reset)g(the)g(handler)330 | |
| ac18b312 | 10209 | 1897 y(for)h(a)g(giv)m(en)h(signal)g(to)f(the)h(original)g(disp)s |
| 37c41ab1 | 10210 | (osition,)f(they)g(should)f(use)h(`)p Fs(-)p Ft(')g(as)g(the)g(\014rst) |
| ac18b312 | 10211 | f(argumen)m(t.)154 2035 y(28.)61 b(The)21 b Fs(.)h Ft(and)f |
| 37c41ab1 CR |
10212 | Fs(source)f Ft(builtins)h(do)g(not)h(searc)m(h)h(the)f(curren)m(t)f |
| 10213 | (directory)h(for)g(the)g(\014lename)f(argumen)m(t)330 | |
| ac18b312 CR |
10214 | 2145 y(if)30 b(it)h(is)g(not)f(found)f(b)m(y)i(searc)m(hing)g |
| 10215 | Fs(PATH)p Ft(.)154 2283 y(29.)61 b(Subshells)20 b(spa)m(wned)h(to)h | |
| 37c41ab1 CR |
10216 | (execute)g(command)g(substitutions)f(inherit)g(the)g(v)-5 |
| 10217 | b(alue)22 b(of)g(the)f(`)p Fs(-e)p Ft(')g(option)330 | |
| ac18b312 | 10218 | 2393 y(from)34 b(the)h(paren)m(t)g(shell.)55 b(When)34 |
| 37c41ab1 | 10219 | b(not)i(in)e Fl(posix)g Ft(mo)s(de,)i(Bash)f(clears)h(the)f(`)p |
| ac18b312 CR |
10220 | Fs(-e)p Ft(')f(option)i(in)e(suc)m(h)330 2502 y(subshells.)154 |
| 10221 | 2641 y(30.)61 b(Alias)31 b(expansion)g(is)f(alw)m(a)m(ys)i(enabled,)e | |
| 10222 | (ev)m(en)i(in)e(non-in)m(teractiv)m(e)j(shells.)154 2779 | |
| 1c72c0cd | 10223 | y(31.)61 b(When)43 b(the)g Fs(alias)f Ft(builtin)g(displa)m(ys)i(alias) |
| 37c41ab1 | 10224 | g(de\014nitions,)i(it)d(do)s(es)g(not)g(displa)m(y)h(them)f(with)g(a) |
| ac18b312 CR |
10225 | 330 2889 y(leading)31 b(`)p Fs(alias)e Ft(')i(unless)f(the)g(`)p |
| 10226 | Fs(-p)p Ft(')g(option)h(is)g(supplied.)154 3027 y(32.)61 | |
| 37c41ab1 CR |
10227 | b(When)40 b(the)g Fs(set)f Ft(builtin)h(is)g(in)m(v)m(ok)m(ed)h |
| 10228 | (without)f(options,)j(it)e(do)s(es)f(not)g(displa)m(y)g(shell)g | |
| ac18b312 CR |
10229 | (function)330 3137 y(names)30 b(and)g(de\014nitions.)154 |
| 10230 | 3275 y(33.)61 b(When)36 b(the)g Fs(set)g Ft(builtin)g(is)g(in)m(v)m(ok) | |
| 37c41ab1 | 10231 | m(ed)i(without)e(options,)i(it)f(displa)m(ys)f(v)-5 b(ariable)37 |
| ac18b312 | 10232 | b(v)-5 b(alues)37 b(without)330 3385 y(quotes,)26 b(unless)d(they)i |
| 37c41ab1 | 10233 | (con)m(tain)g(shell)f(metac)m(haracters,)k(ev)m(en)d(if)f(the)g(result) |
| ac18b312 CR |
10234 | g(con)m(tains)i(nonprin)m(ting)330 3494 y(c)m(haracters.)154 |
| 10235 | 3633 y(34.)61 b(When)35 b(the)g Fs(cd)f Ft(builtin)h(is)g(in)m(v)m(ok)m | |
| 37c41ab1 | 10236 | (ed)i(in)d Fq(logical)41 b Ft(mo)s(de,)36 b(and)f(the)g(pathname)g |
| ac18b312 | 10237 | (constructed)g(from)330 3742 y Fs($PWD)i Ft(and)h(the)h(directory)f |
| 37c41ab1 | 10238 | (name)h(supplied)e(as)i(an)f(argumen)m(t)h(do)s(es)f(not)g(refer)h(to)g |
| ac18b312 | 10239 | (an)f(existing)330 3852 y(directory)-8 b(,)32 b Fs(cd)d |
| 37c41ab1 | 10240 | Ft(will)i(fail)g(instead)g(of)f(falling)h(bac)m(k)h(to)f |
| ac18b312 | 10241 | Fq(ph)m(ysical)j Ft(mo)s(de.)154 3990 y(35.)61 b(When)20 |
| 9d2b70f0 CR |
10242 | b(the)h Fs(pwd)e Ft(builtin)h(is)g(supplied)g(the)g(`)p |
| 10243 | Fs(-P)p Ft(')g(option,)j(it)e(resets)g Fs($PWD)e Ft(to)i(a)g(pathname)f | |
| ac18b312 | 10244 | (con)m(taining)330 4100 y(no)30 b(symlinks.)154 4238 |
| 1c72c0cd CR |
10245 | y(36.)61 b(The)36 b Fs(pwd)f Ft(builtin)h(v)m(eri\014es)h(that)g(the)f |
| 10246 | (v)-5 b(alue)37 b(it)g(prin)m(ts)e(is)i(the)f(same)h(as)f(the)h(curren) | |
| ac18b312 | 10247 | m(t)f(directory)-8 b(,)330 4348 y(ev)m(en)31 b(if)f(it)h(is)g(not)f |
| 1c72c0cd | 10248 | (ask)m(ed)h(to)g(c)m(hec)m(k)h(the)f(\014le)f(system)h(with)f(the)h(`)p |
| ac18b312 | 10249 | Fs(-P)p Ft(')f(option.)154 4486 y(37.)61 b(When)35 b(listing)g(the)g |
| 1c72c0cd | 10250 | (history)-8 b(,)36 b(the)f Fs(fc)g Ft(builtin)f(do)s(es)g(not)h |
| ac18b312 | 10251 | (include)g(an)f(indication)i(of)f(whether)f(or)330 4596 |
| 1c72c0cd | 10252 | y(not)d(a)f(history)h(en)m(try)f(has)g(b)s(een)g(mo)s(di\014ed.)154 |
| ac18b312 CR |
10253 | 4734 y(38.)61 b(The)30 b(default)g(editor)h(used)f(b)m(y)g |
| 10254 | Fs(fc)g Ft(is)g Fs(ed)p Ft(.)154 4873 y(39.)61 b(The)37 | |
| 1c72c0cd CR |
10255 | b Fs(type)g Ft(and)g Fs(command)f Ft(builtins)i(will)g(not)g(rep)s(ort) |
| 10256 | f(a)i(non-executable)g(\014le)f(as)g(ha)m(ving)h(b)s(een)330 | |
| ac18b312 | 10257 | 4982 y(found,)26 b(though)h(the)g(shell)g(will)g(attempt)h(to)g |
| 1c72c0cd | 10258 | (execute)g(suc)m(h)f(a)g(\014le)g(if)g(it)g(is)g(the)g(only)g(so-named) |
| ac18b312 CR |
10259 | g(\014le)330 5092 y(found)i(in)h Fs($PATH)p Ft(.)154 |
| 10260 | 5230 y(40.)61 b(The)33 b Fs(vi)f Ft(editing)i(mo)s(de)f(will)g(in)m(v)m | |
| 10261 | (ok)m(e)i(the)e Fs(vi)g Ft(editor)h(directly)f(when)f(the)i(`)p | |
| 10262 | Fs(v)p Ft(')f(command)g(is)g(run,)330 5340 y(instead)e(of)f(c)m(hec)m | |
| 10263 | (king)i Fs($FCEDIT)d Ft(and)g Fs($EDITOR)p Ft(.)p eop | |
| 1c72c0cd | 10264 | end |
| 28157acd CR |
10265 | %%Page: 83 89 |
| 10266 | TeXDict begin 83 88 bop 150 -116 a Ft(Chapter)30 b(6:)41 | |
| 10267 | b(Bash)30 b(F)-8 b(eatures)2484 b(83)154 299 y(41.)61 | |
| 1c72c0cd CR |
10268 | b(When)41 b(the)g Fs(xpg_echo)e Ft(option)i(is)g(enabled,)j(Bash)d(do)s |
| 10269 | (es)g(not)g(attempt)h(to)g(in)m(terpret)f(an)m(y)h(ar-)330 | |
| ac18b312 | 10270 | 408 y(gumen)m(ts)35 b(to)g Fs(echo)e Ft(as)i(options.)54 |
| 1c72c0cd | 10271 | b(Eac)m(h)35 b(argumen)m(t)g(is)f(displa)m(y)m(ed,)j(after)e(escap)s(e) |
| ac18b312 CR |
10272 | g(c)m(haracters)h(are)330 518 y(con)m(v)m(erted.)275 |
| 10273 | 677 y(There)e(is)g(other)h Fl(posix)f Ft(b)s(eha)m(vior)h(that)g(Bash)g | |
| 10274 | (do)s(es)f(not)h(implemen)m(t)g(b)m(y)g(default)f(ev)m(en)i(when)d(in) | |
| 10275 | 150 787 y Fl(posix)d Ft(mo)s(de.)40 b(Sp)s(eci\014cally:)199 | |
| 10276 | 922 y(1.)61 b(The)30 b Fs(fc)f Ft(builtin)h(c)m(hec)m(ks)i | |
| 10277 | Fs($EDITOR)c Ft(as)j(a)f(program)g(to)h(edit)g(history)f(en)m(tries)h | |
| 10278 | (if)f Fs(FCEDIT)f Ft(is)h(unset,)330 1031 y(rather)g(than)g(defaulting) | |
| 10279 | h(directly)g(to)g Fs(ed)p Ft(.)40 b Fs(fc)30 b Ft(uses)g | |
| 10280 | Fs(ed)g Ft(if)g Fs(EDITOR)f Ft(is)h(unset.)199 1166 y(2.)61 | |
| 10281 | b(As)29 b(noted)g(ab)s(o)m(v)m(e,)i(Bash)e(requires)g(the)g | |
| 10282 | Fs(xpg_echo)e Ft(option)j(to)g(b)s(e)e(enabled)h(for)g(the)g | |
| 10283 | Fs(echo)f Ft(builtin)330 1275 y(to)j(b)s(e)f(fully)g(conforman)m(t.)275 | |
| 10284 | 1435 y(Bash)66 b(can)h(b)s(e)f(con\014gured)g(to)i(b)s(e)e | |
| 10285 | Fl(posix)p Ft(-conforman)m(t)h(b)m(y)f(default,)77 b(b)m(y)66 | |
| 10286 | b(sp)s(ecifying)h(the)150 1544 y(`)p Fs(--enable-strict-posix-def)o | |
| 10287 | (ault)o Ft(')i(to)76 b Fs(configure)c Ft(when)i(building)g(\(see)i | |
| 10288 | (Section)f(10.8)150 1654 y([Optional)31 b(F)-8 b(eatures],)32 | |
| 28157acd CR |
10289 | b(page)f(123\).)p eop end |
| 10290 | %%Page: 84 90 | |
| 10291 | TeXDict begin 84 89 bop 150 -116 a Ft(84)2572 b(Bash)31 | |
| 9d6e5e30 | 10292 | b(Reference)g(Man)m(ual)p eop end |
| 28157acd CR |
10293 | %%Page: 85 91 |
| 10294 | TeXDict begin 85 90 bop 150 -116 a Ft(Chapter)30 b(7:)41 | |
| 10295 | b(Job)30 b(Con)m(trol)2571 b(85)150 299 y Fo(7)80 b(Job)54 | |
| eb2bb562 | 10296 | b(Con)l(trol)275 516 y Ft(This)34 b(c)m(hapter)i(discusses)f(what)g |
| 37c41ab1 | 10297 | (job)g(con)m(trol)i(is,)g(ho)m(w)e(it)h(w)m(orks,)h(and)e(ho)m(w)g |
| eb2bb562 CR |
10298 | (Bash)h(allo)m(ws)g(y)m(ou)g(to)150 625 y(access)c(its)e(facilities.) |
| 10299 | 150 873 y Fr(7.1)68 b(Job)45 b(Con)l(trol)h(Basics)275 | |
| 10300 | 1113 y Ft(Job)30 b(con)m(trol)j(refers)e(to)h(the)g(abilit)m(y)g(to)g | |
| 37c41ab1 | 10301 | (selectiv)m(ely)j(stop)c(\(susp)s(end\))f(the)h(execution)i(of)e(pro)s |
| eb2bb562 | 10302 | (cesses)150 1223 y(and)24 b(con)m(tin)m(ue)i(\(resume\))f(their)g |
| 37c41ab1 CR |
10303 | (execution)h(at)f(a)h(later)f(p)s(oin)m(t.)39 b(A)25 |
| 10304 | b(user)f(t)m(ypically)j(emplo)m(ys)e(this)g(facilit)m(y)150 | |
| eb2bb562 | 10305 | 1332 y(via)31 b(an)f(in)m(teractiv)m(e)j(in)m(terface)f(supplied)e |
| 37c41ab1 | 10306 | (join)m(tly)h(b)m(y)f(the)h(system's)f(terminal)h(driv)m(er)f(and)g |
| eb2bb562 | 10307 | (Bash.)275 1464 y(The)23 b(shell)i(asso)s(ciates)h(a)f |
| 37c41ab1 CR |
10308 | Fq(job)h Ft(with)e(eac)m(h)i(pip)s(eline.)38 b(It)25 |
| 10309 | b(k)m(eeps)f(a)h(table)h(of)e(curren)m(tly)h(executing)g(jobs,)150 | |
| eb2bb562 | 10310 | 1573 y(whic)m(h)33 b(ma)m(y)i(b)s(e)e(listed)h(with)f(the)h |
| 5e13499c | 10311 | Fs(jobs)f Ft(command.)50 b(When)33 b(Bash)h(starts)g(a)g(job)g(async)m |
| eb2bb562 CR |
10312 | (hronously)-8 b(,)34 b(it)150 1683 y(prin)m(ts)c(a)h(line)f(that)h(lo)s |
| 10313 | (oks)g(lik)m(e:)390 1814 y Fs([1])47 b(25647)150 1945 | |
| 37c41ab1 CR |
10314 | y Ft(indicating)34 b(that)g(this)f(job)g(is)g(job)g(n)m(um)m(b)s(er)f |
| 10315 | (1)i(and)f(that)g(the)h(pro)s(cess)f Fl(id)g Ft(of)g(the)h(last)g(pro)s | |
| eb2bb562 | 10316 | (cess)f(in)g(the)150 2054 y(pip)s(eline)42 b(asso)s(ciated)i(with)e |
| 37c41ab1 | 10317 | (this)g(job)g(is)h(25647.)78 b(All)43 b(of)g(the)g(pro)s(cesses)f(in)g |
| eb2bb562 | 10318 | (a)h(single)g(pip)s(eline)f(are)150 2164 y(mem)m(b)s(ers)30 |
| 5e13499c | 10319 | b(of)g(the)h(same)f(job.)41 b(Bash)30 b(uses)g(the)h |
| 37c41ab1 | 10320 | Fq(job)h Ft(abstraction)f(as)g(the)g(basis)f(for)g(job)g(con)m(trol.) |
| eb2bb562 | 10321 | 275 2295 y(T)-8 b(o)23 b(facilitate)j(the)d(implemen)m(tation)i(of)f |
| 37c41ab1 | 10322 | (the)f(user)f(in)m(terface)j(to)f(job)f(con)m(trol,)j(the)d(op)s |
| eb2bb562 | 10323 | (erating)h(system)150 2405 y(main)m(tains)j(the)f(notion)h(of)f(a)g |
| 37c41ab1 CR |
10324 | (curren)m(t)g(terminal)g(pro)s(cess)g(group)g Fl(id)p |
| 10325 | Ft(.)39 b(Mem)m(b)s(ers)26 b(of)g(this)g(pro)s(cess)f(group)150 | |
| eb2bb562 | 10326 | 2514 y(\(pro)s(cesses)h(whose)g(pro)s(cess)g(group)g |
| 37c41ab1 | 10327 | Fl(id)g Ft(is)h(equal)g(to)g(the)f(curren)m(t)g(terminal)h(pro)s(cess)f |
| eb2bb562 | 10328 | (group)f Fl(id)p Ft(\))i(receiv)m(e)150 2624 y(k)m(eyb)s |
| 37c41ab1 CR |
10329 | (oard-generated)22 b(signals)g(suc)m(h)e(as)h Fs(SIGINT)p |
| 10330 | Ft(.)36 b(These)21 b(pro)s(cesses)g(are)g(said)g(to)g(b)s(e)g(in)f(the) | |
| eb2bb562 | 10331 | h(foreground.)150 2733 y(Bac)m(kground)38 b(pro)s(cesses)f(are)h(those) |
| 37c41ab1 | 10332 | g(whose)f(pro)s(cess)g(group)g Fl(id)h Ft(di\013ers)f(from)g(the)g |
| eb2bb562 | 10333 | (terminal's;)42 b(suc)m(h)150 2843 y(pro)s(cesses)24 |
| 37c41ab1 CR |
10334 | b(are)g(imm)m(une)g(to)g(k)m(eyb)s(oard-generated)h(signals.)40 |
| 10335 | b(Only)23 b(foreground)g(pro)s(cesses)h(are)g(allo)m(w)m(ed)150 | |
| eb2bb562 | 10336 | 2953 y(to)35 b(read)f(from)f(or)h(write)g(to)h(the)f(terminal.)52 |
| 37c41ab1 | 10337 | b(Bac)m(kground)34 b(pro)s(cesses)g(whic)m(h)g(attempt)h(to)g(read)e |
| eb2bb562 | 10338 | (from)150 3062 y(\(write)e(to\))g(the)g(terminal)g(are)g(sen)m(t)g(a)f |
| 37c41ab1 | 10339 | Fs(SIGTTIN)f Ft(\()p Fs(SIGTTOU)p Ft(\))g(signal)i(b)m(y)f(the)h |
| eb2bb562 CR |
10340 | (terminal)g(driv)m(er,)f(whic)m(h,)150 3172 y(unless)g(caugh)m(t,)h |
| 10341 | (susp)s(ends)d(the)j(pro)s(cess.)275 3303 y(If)j(the)i(op)s(erating)g | |
| 37c41ab1 | 10342 | (system)f(on)h(whic)m(h)f(Bash)g(is)h(running)d(supp)s(orts)h(job)h |
| eb2bb562 | 10343 | (con)m(trol,)j(Bash)e(con)m(tains)150 3412 y(facilities)30 |
| 37c41ab1 CR |
10344 | b(to)f(use)f(it.)40 b(T)m(yping)28 b(the)g Fq(susp)s(end)h |
| 10345 | Ft(c)m(haracter)h(\(t)m(ypically)g(`)p Fs(^Z)p Ft(',)f(Con)m(trol-Z\))g | |
| eb2bb562 | 10346 | (while)f(a)g(pro)s(cess)150 3522 y(is)42 b(running)f(causes)i(that)g |
| 37c41ab1 | 10347 | (pro)s(cess)f(to)h(b)s(e)f(stopp)s(ed)f(and)h(returns)f(con)m(trol)j |
| eb2bb562 | 10348 | (to)f(Bash.)77 b(T)m(yping)42 b(the)150 3632 y Fq(dela)m(y)m(ed)k(susp) |
| 37c41ab1 CR |
10349 | s(end)f Ft(c)m(haracter)h(\(t)m(ypically)g(`)p Fs(^Y)p |
| 10350 | Ft(',)i(Con)m(trol-Y\))e(causes)e(the)h(pro)s(cess)e(to)i(b)s(e)f | |
| eb2bb562 | 10351 | (stopp)s(ed)150 3741 y(when)26 b(it)i(attempts)h(to)f(read)f(input)g |
| 37c41ab1 | 10352 | (from)f(the)i(terminal,)h(and)e(con)m(trol)h(to)g(b)s(e)f(returned)f |
| eb2bb562 | 10353 | (to)j(Bash.)39 b(The)150 3851 y(user)e(then)g(manipulates)h(the)g |
| 37c41ab1 | 10354 | (state)h(of)f(this)f(job,)j(using)d(the)h Fs(bg)f Ft(command)g(to)h |
| eb2bb562 | 10355 | (con)m(tin)m(ue)h(it)f(in)g(the)150 3960 y(bac)m(kground,)g(the)f |
| 37c41ab1 | 10356 | Fs(fg)g Ft(command)f(to)i(con)m(tin)m(ue)g(it)f(in)f(the)h(foreground,) |
| eb2bb562 | 10357 | h(or)f(the)g Fs(kill)f Ft(command)g(to)150 4070 y(kill)27 |
| 37c41ab1 CR |
10358 | b(it.)40 b(A)27 b(`)p Fs(^Z)p Ft(')g(tak)m(es)h(e\013ect)g(immediately) |
| 10359 | -8 b(,)29 b(and)d(has)h(the)f(additional)i(side)e(e\013ect)j(of)d | |
| eb2bb562 CR |
10360 | (causing)h(p)s(ending)150 4180 y(output)j(and)g(t)m(yp)s(eahead)h(to)g |
| 10361 | (b)s(e)e(discarded.)275 4311 y(There)j(are)g(a)h(n)m(um)m(b)s(er)e(of)i | |
| 37c41ab1 | 10362 | (w)m(a)m(ys)g(to)h(refer)e(to)h(a)g(job)f(in)g(the)h(shell.)47 |
| 5e13499c | 10363 | b(The)32 b(c)m(haracter)i(`)p Fs(\045)p Ft(')f(in)m(tro)s(duces)150 |
| eb2bb562 | 10364 | 4420 y(a)e(job)f(name.)275 4551 y(Job)h(n)m(um)m(b)s(er)f |
| 5e13499c | 10365 | Fs(n)h Ft(ma)m(y)h(b)s(e)f(referred)g(to)h(as)g(`)p Fs(\045n)p |
| 37c41ab1 CR |
10366 | Ft('.)44 b(The)31 b(sym)m(b)s(ols)g(`)p Fs(\045\045)p |
| 10367 | Ft(')h(and)f(`)p Fs(\045+)p Ft(')g(refer)h(to)g(the)g(shell's)150 | |
| eb2bb562 CR |
10368 | 4661 y(notion)k(of)f(the)g(curren)m(t)g(job,)h(whic)m(h)f(is)g(the)g |
| 10369 | (last)h(job)f(stopp)s(ed)f(while)h(it)h(w)m(as)g(in)e(the)i(foreground) | |
| 10370 | e(or)150 4771 y(started)27 b(in)g(the)g(bac)m(kground.)40 | |
| 10371 | b(A)27 b(single)g(`)p Fs(\045)p Ft(')g(\(with)g(no)g(accompan)m(ying)i | |
| 10372 | (job)d(sp)s(eci\014cation\))i(also)g(refers)150 4880 | |
| 10373 | y(to)j(the)e(curren)m(t)h(job.)40 b(The)30 b(previous)f(job)g(ma)m(y)i | |
| 10374 | (b)s(e)e(referenced)h(using)f(`)p Fs(\045-)p Ft('.)40 | |
| 10375 | b(In)29 b(output)h(p)s(ertaining)f(to)150 4990 y(jobs)k(\(e.g.,)j(the)d | |
| 10376 | (output)g(of)h(the)f Fs(jobs)f Ft(command\),)j(the)e(curren)m(t)h(job)f | |
| 10377 | (is)g(alw)m(a)m(ys)i(\015agged)f(with)f(a)h(`)p Fs(+)p | |
| 10378 | Ft(',)150 5099 y(and)c(the)g(previous)g(job)g(with)g(a)h(`)p | |
| 10379 | Fs(-)p Ft('.)275 5230 y(A)38 b(job)g(ma)m(y)h(also)g(b)s(e)f(referred)f | |
| 10380 | (to)j(using)d(a)i(pre\014x)e(of)i(the)f(name)h(used)e(to)i(start)g(it,) | |
| 10381 | i(or)e(using)f(a)150 5340 y(substring)29 b(that)i(app)s(ears)f(in)g | |
| 10382 | (its)h(command)f(line.)41 b(F)-8 b(or)31 b(example,)g(`)p | |
| 10383 | Fs(\045ce)p Ft(')f(refers)g(to)h(a)g(stopp)s(ed)e Fs(ce)h | |
| 10384 | Ft(job.)p eop end | |
| 28157acd CR |
10385 | %%Page: 86 92 |
| 10386 | TeXDict begin 86 91 bop 150 -116 a Ft(86)2572 b(Bash)31 | |
| 37c41ab1 CR |
10387 | b(Reference)g(Man)m(ual)150 299 y(Using)c(`)p Fs(\045?ce)p |
| 10388 | Ft(',)g(on)f(the)h(other)g(hand,)g(refers)f(to)h(an)m(y)g(job)g(con)m | |
| 10389 | (taining)h(the)f(string)f(`)p Fs(ce)p Ft(')h(in)f(its)h(command)150 | |
| 10390 | 408 y(line.)41 b(If)30 b(the)h(pre\014x)e(or)h(substring)f(matc)m(hes)j | |
| 10391 | (more)e(than)h(one)f(job,)h(Bash)f(rep)s(orts)g(an)g(error.)275 | |
| 28157acd | 10392 | 544 y(Simply)g(naming)h(a)g(job)g(can)g(b)s(e)f(used)h(to)g(bring)f(it) |
| 37c41ab1 | 10393 | i(in)m(to)g(the)f(foreground:)41 b(`)p Fs(\0451)p Ft(')31 |
| 28157acd | 10394 | b(is)g(a)h(synon)m(ym)e(for)150 654 y(`)p Fs(fg)g(\0451)p |
| 37c41ab1 CR |
10395 | Ft(',)i(bringing)f(job)g(1)g(from)g(the)h(bac)m(kground)f(in)m(to)i |
| 10396 | (the)e(foreground.)44 b(Similarly)-8 b(,)32 b(`)p Fs(\0451)e(&)p | |
| 28157acd CR |
10397 | Ft(')i(resumes)150 763 y(job)e(1)h(in)f(the)g(bac)m(kground,)h(equiv)-5 |
| 10398 | b(alen)m(t)32 b(to)f(`)p Fs(bg)f(\0451)p Ft(')275 899 | |
| 37c41ab1 CR |
10399 | y(The)g(shell)i(learns)f(immediately)i(whenev)m(er)e(a)h(job)f(c)m |
| 10400 | (hanges)h(state.)45 b(Normally)-8 b(,)33 b(Bash)e(w)m(aits)i(un)m(til) | |
| 28157acd | 10401 | 150 1009 y(it)25 b(is)g(ab)s(out)f(to)i(prin)m(t)e(a)h(prompt)f(b)s |
| 37c41ab1 | 10402 | (efore)g(rep)s(orting)h(c)m(hanges)g(in)g(a)g(job's)f(status)h(so)g(as) |
| 28157acd | 10403 | g(to)g(not)g(in)m(terrupt)150 1119 y(an)m(y)g(other)g(output.)39 |
| 37c41ab1 CR |
10404 | b(If)24 b(the)i(`)p Fs(-b)p Ft(')e(option)i(to)f(the)g |
| 10405 | Fs(set)f Ft(builtin)h(is)g(enabled,)h(Bash)f(rep)s(orts)f(suc)m(h)h(c)m | |
| 28157acd CR |
10406 | (hanges)150 1228 y(immediately)31 b(\(see)f(Section)g(4.3)g([The)f(Set) |
| 10407 | h(Builtin],)g(page)g(53\).)42 b(An)m(y)29 b(trap)g(on)g | |
| 10408 | Fs(SIGCHLD)f Ft(is)h(executed)150 1338 y(for)h(eac)m(h)i(c)m(hild)e | |
| 10409 | (pro)s(cess)g(that)h(exits.)275 1474 y(If)k(an)h(attempt)h(to)g(exit)g | |
| 10410 | (Bash)g(is)f(made)g(while)g(jobs)g(are)g(stopp)s(ed,)h(the)f(shell)h | |
| 10411 | (prin)m(ts)e(a)i(message)150 1583 y(w)m(arning)26 b(that)h(there)f(are) | |
| 10412 | g(stopp)s(ed)g(jobs.)38 b(The)26 b Fs(jobs)f Ft(command)h(ma)m(y)h | |
| 10413 | (then)e(b)s(e)h(used)f(to)i(insp)s(ect)f(their)150 1693 | |
| 10414 | y(status.)57 b(If)35 b(a)h(second)g(attempt)g(to)h(exit)f(is)g(made)g | |
| 10415 | (without)f(an)h(in)m(terv)m(ening)h(command,)f(Bash)g(do)s(es)150 | |
| 10416 | 1802 y(not)31 b(prin)m(t)f(another)g(w)m(arning,)h(and)e(the)i(stopp)s | |
| 10417 | (ed)e(jobs)h(are)h(terminated.)150 2063 y Fr(7.2)68 b(Job)45 | |
| 10418 | b(Con)l(trol)h(Builtins)150 2308 y Fs(bg)870 2443 y(bg)h([)p | |
| 10419 | Fj(jobspec)56 b Fs(...)o(])630 2578 y Ft(Resume)24 b(eac)m(h)h(susp)s | |
| 10420 | (ended)d(job)i Fq(jobsp)s(ec)29 b Ft(in)24 b(the)g(bac)m(kground,)h(as) | |
| 10421 | g(if)f(it)h(had)e(b)s(een)g(started)630 2688 y(with)32 | |
| 10422 | b(`)p Fs(&)p Ft('.)45 b(If)31 b Fq(jobsp)s(ec)37 b Ft(is)32 | |
| 10423 | b(not)g(supplied,)f(the)h(curren)m(t)g(job)f(is)h(used.)45 | |
| 10424 | b(The)31 b(return)g(status)630 2797 y(is)i(zero)g(unless)f(it)h(is)g | |
| 10425 | (run)e(when)h(job)g(con)m(trol)i(is)f(not)g(enabled,)h(or,)f(when)f | |
| 10426 | (run)f(with)h(job)630 2907 y(con)m(trol)h(enabled,)g(an)m(y)f | |
| 10427 | Fq(jobsp)s(ec)37 b Ft(w)m(as)32 b(not)g(found)f(or)g(sp)s(eci\014es)h | |
| 10428 | (a)g(job)g(that)g(w)m(as)g(started)630 3017 y(without)e(job)g(con)m | |
| 10429 | (trol.)150 3177 y Fs(fg)870 3312 y(fg)47 b([)p Fj(jobspec)11 | |
| 10430 | b Fs(])630 3448 y Ft(Resume)43 b(the)g(job)g Fq(jobsp)s(ec)48 | |
| 10431 | b Ft(in)43 b(the)g(foreground)g(and)f(mak)m(e)j(it)e(the)h(curren)m(t)f | |
| 10432 | (job.)78 b(If)630 3557 y Fq(jobsp)s(ec)41 b Ft(is)c(not)f(supplied,)h | |
| 37c41ab1 | 10433 | (the)f(curren)m(t)h(job)f(is)g(used.)58 b(The)36 b(return)f(status)h |
| 28157acd | 10434 | (is)h(that)g(of)630 3667 y(the)d(command)g(placed)h(in)m(to)g(the)f |
| 37c41ab1 | 10435 | (foreground,)g(or)g(non-zero)h(if)f(run)f(when)g(job)g(con)m(trol)630 |
| 28157acd | 10436 | 3776 y(is)i(disabled)g(or,)i(when)d(run)g(with)h(job)g(con)m(trol)h |
| 37c41ab1 | 10437 | (enabled,)h Fq(jobsp)s(ec)j Ft(do)s(es)35 b(not)h(sp)s(ecify)f(a)630 |
| 28157acd | 10438 | 3886 y(v)-5 b(alid)31 b(job)f(or)g Fq(jobsp)s(ec)35 b |
| 37c41ab1 | 10439 | Ft(sp)s(eci\014es)30 b(a)h(job)f(that)h(w)m(as)g(started)g(without)f |
| 28157acd CR |
10440 | (job)g(con)m(trol.)150 4047 y Fs(jobs)870 4182 y(jobs)47 |
| 10441 | b([-lnprs])e([)p Fj(jobspec)11 b Fs(])870 4291 y(jobs)47 | |
| 37c41ab1 | 10442 | b(-x)g Fj(command)56 b Fs([)p Fj(arguments)11 b Fs(])630 |
| 28157acd | 10443 | 4427 y Ft(The)30 b(\014rst)f(form)h(lists)h(the)g(activ)m(e)h(jobs.)41 |
| 37c41ab1 | 10444 | b(The)30 b(options)g(ha)m(v)m(e)i(the)e(follo)m(wing)i(meanings:)630 |
| 28157acd | 10445 | 4587 y Fs(-l)384 b Ft(List)31 b(pro)s(cess)f Fl(id)p |
| 37c41ab1 | 10446 | Ft(s)g(in)g(addition)h(to)g(the)f(normal)h(information.)630 |
| 28157acd | 10447 | 4748 y Fs(-n)384 b Ft(Displa)m(y)26 b(information)f(only)h(ab)s(out)e |
| 37c41ab1 | 10448 | (jobs)h(that)g(ha)m(v)m(e)i(c)m(hanged)e(status)h(since)1110 |
| 28157acd CR |
10449 | 4858 y(the)31 b(user)e(w)m(as)i(last)g(noti\014ed)f(of)h(their)f |
| 10450 | (status.)630 5018 y Fs(-p)384 b Ft(List)31 b(only)f(the)h(pro)s(cess)f | |
| 37c41ab1 | 10451 | Fl(id)g Ft(of)h(the)f(job's)g(pro)s(cess)g(group)g(leader.)630 |
| 28157acd CR |
10452 | 5179 y Fs(-r)384 b Ft(Restrict)31 b(output)f(to)i(running)c(jobs.)630 |
| 10453 | 5340 y Fs(-s)384 b Ft(Restrict)31 b(output)f(to)i(stopp)s(ed)d(jobs.)p | |
| 37c41ab1 | 10454 | eop end |
| 28157acd CR |
10455 | %%Page: 87 93 |
| 10456 | TeXDict begin 87 92 bop 150 -116 a Ft(Chapter)30 b(7:)41 | |
| 10457 | b(Job)30 b(Con)m(trol)2571 b(87)630 299 y(If)23 b Fq(jobsp)s(ec)28 | |
| 10458 | b Ft(is)c(giv)m(en,)i(output)d(is)h(restricted)g(to)g(information)g(ab) | |
| 10459 | s(out)f(that)h(job.)39 b(If)23 b Fq(jobsp)s(ec)630 408 | |
| 10460 | y Ft(is)30 b(not)h(supplied,)e(the)i(status)g(of)f(all)h(jobs)f(is)h | |
| 10461 | (listed.)630 552 y(If)g(the)g(`)p Fs(-x)p Ft(')g(option)h(is)f | |
| 10462 | (supplied,)g Fs(jobs)f Ft(replaces)i(an)m(y)f Fq(jobsp)s(ec)37 | |
| 10463 | b Ft(found)29 b(in)i Fq(command)k Ft(or)630 662 y Fq(argumen)m(ts)41 | |
| 10464 | b Ft(with)c(the)h(corresp)s(onding)e(pro)s(cess)h(group)f | |
| 10465 | Fl(id)p Ft(,)k(and)c(executes)j Fq(command)p Ft(,)630 | |
| 10466 | 771 y(passing)30 b(it)h Fq(argumen)m(t)r Ft(s,)g(returning)f(its)g | |
| 10467 | (exit)i(status.)150 949 y Fs(kill)870 1093 y(kill)47 | |
| 10468 | b([-s)g Fj(sigspec)11 b Fs(])45 b([-n)i Fj(signum)11 | |
| 10469 | b Fs(])45 b([-)p Fj(sigspec)11 b Fs(])44 b Fj(jobspec)57 | |
| 10470 | b Fs(or)47 b Fj(pid)870 1202 y Fs(kill)g(-l)g([)p Fj(exit_status)11 | |
| 10471 | b Fs(])630 1346 y Ft(Send)22 b(a)i(signal)g(sp)s(eci\014ed)f(b)m(y)g | |
| 10472 | Fq(sigsp)s(ec)29 b Ft(or)24 b Fq(sign)m(um)f Ft(to)h(the)g(pro)s(cess)f | |
| 10473 | (named)g(b)m(y)g(job)g(sp)s(eci\014-)630 1456 y(cation)k | |
| 10474 | Fq(jobsp)s(ec)j Ft(or)25 b(pro)s(cess)g Fl(id)h Fq(pid)p | |
| 10475 | Ft(.)38 b Fq(sigsp)s(ec)31 b Ft(is)25 b(either)h(a)g(case-insensitiv)m | |
| 10476 | (e)i(signal)e(name)630 1565 y(suc)m(h)k(as)h Fs(SIGINT)d | |
| 10477 | Ft(\(with)j(or)f(without)h(the)f Fs(SIG)g Ft(pre\014x\))f(or)i(a)f | |
| 10478 | (signal)h(n)m(um)m(b)s(er;)f Fq(sign)m(um)g Ft(is)630 | |
| 10479 | 1675 y(a)i(signal)g(n)m(um)m(b)s(er.)43 b(If)31 b Fq(sigsp)s(ec)37 | |
| 10480 | b Ft(and)31 b Fq(sign)m(um)g Ft(are)h(not)f(presen)m(t,)h | |
| 10481 | Fs(SIGTERM)e Ft(is)h(used.)43 b(The)630 1785 y(`)p Fs(-l)p | |
| 10482 | Ft(')34 b(option)g(lists)h(the)f(signal)h(names.)51 b(If)33 | |
| 10483 | b(an)m(y)i(argumen)m(ts)f(are)g(supplied)f(when)g(`)p | |
| 10484 | Fs(-l)p Ft(')h(is)630 1894 y(giv)m(en,)e(the)g(names)e(of)i(the)f | |
| 37c41ab1 | 10485 | (signals)g(corresp)s(onding)f(to)i(the)f(argumen)m(ts)g(are)h(listed,)g |
| 28157acd CR |
10486 | (and)630 2004 y(the)c(return)f(status)h(is)g(zero.)41 |
| 10487 | b Fq(exit)p 1796 2004 28 4 v 41 w(status)32 b Ft(is)c(a)g(n)m(um)m(b)s | |
| 37c41ab1 | 10488 | (er)f(sp)s(ecifying)g(a)i(signal)f(n)m(um)m(b)s(er)f(or)630 |
| 28157acd | 10489 | 2113 y(the)35 b(exit)h(status)f(of)g(a)g(pro)s(cess)g(terminated)g(b)m |
| 37c41ab1 | 10490 | (y)g(a)g(signal.)55 b(The)34 b(return)g(status)h(is)g(zero)630 |
| 28157acd | 10491 | 2223 y(if)c(at)h(least)g(one)g(signal)f(w)m(as)h(successfully)f(sen)m |
| 37c41ab1 | 10492 | (t,)h(or)f(non-zero)h(if)f(an)g(error)f(o)s(ccurs)h(or)g(an)630 |
| 28157acd CR |
10493 | 2333 y(in)m(v)-5 b(alid)31 b(option)g(is)f(encoun)m(tered.)150 |
| 10494 | 2510 y Fs(wait)870 2654 y(wait)47 b([)p Fj(jobspec)56 | |
| 10495 | b Fs(or)47 b Fj(pid)57 b Fs(...])630 2798 y Ft(W)-8 b(ait)28 | |
| eb2bb562 CR |
10496 | b(un)m(til)f(the)f(c)m(hild)h(pro)s(cess)f(sp)s(eci\014ed)g(b)m(y)g |
| 10497 | (eac)m(h)h(pro)s(cess)f Fl(id)h Fq(pid)i Ft(or)d(job)g(sp)s | |
| 28157acd | 10498 | (eci\014cation)630 2907 y Fq(jobsp)s(ec)40 b Ft(exits)35 |
| eb2bb562 | 10499 | b(and)f(return)g(the)g(exit)i(status)f(of)g(the)g(last)g(command)f(w)m |
| 28157acd | 10500 | (aited)i(for.)53 b(If)35 b(a)630 3017 y(job)g(sp)s(ec)f(is)h(giv)m(en,) |
| eb2bb562 | 10501 | i(all)f(pro)s(cesses)f(in)f(the)h(job)g(are)g(w)m(aited)h(for.)54 |
| 28157acd | 10502 | b(If)35 b(no)f(argumen)m(ts)i(are)630 3127 y(giv)m(en,)d(all)f(curren)m |
| 37c41ab1 | 10503 | (tly)f(activ)m(e)i(c)m(hild)f(pro)s(cesses)f(are)g(w)m(aited)h(for,)g |
| 28157acd | 10504 | (and)e(the)i(return)e(status)630 3236 y(is)h(zero.)44 |
| 37c41ab1 CR |
10505 | b(If)30 b(neither)h Fq(jobsp)s(ec)36 b Ft(nor)31 b Fq(pid)i |
| 10506 | Ft(sp)s(eci\014es)e(an)g(activ)m(e)i(c)m(hild)f(pro)s(cess)e(of)h(the)g | |
| 28157acd CR |
10507 | (shell,)630 3346 y(the)g(return)e(status)i(is)f(127.)150 |
| 10508 | 3524 y Fs(disown)870 3667 y(disown)46 b([-ar])g([-h])h([)p | |
| 10509 | Fj(jobspec)56 b Fs(...)o(])630 3811 y Ft(Without)32 b(options,)g(eac)m | |
| 37c41ab1 | 10510 | (h)h Fq(jobsp)s(ec)j Ft(is)c(remo)m(v)m(ed)g(from)f(the)h(table)g(of)g |
| 28157acd | 10511 | (activ)m(e)h(jobs.)44 b(If)31 b(the)630 3921 y(`)p Fs(-h)p |
| 37c41ab1 CR |
10512 | Ft(')36 b(option)h(is)g(giv)m(en,)i(the)e(job)f(is)h(not)f(remo)m(v)m |
| 10513 | (ed)i(from)e(the)h(table,)i(but)d(is)g(mark)m(ed)h(so)630 | |
| 28157acd | 10514 | 4030 y(that)d Fs(SIGHUP)d Ft(is)j(not)f(sen)m(t)h(to)g(the)f(job)g(if)g |
| 37c41ab1 | 10515 | (the)h(shell)f(receiv)m(es)i(a)f Fs(SIGHUP)p Ft(.)47 |
| 28157acd | 10516 | b(If)33 b Fq(jobsp)s(ec)38 b Ft(is)630 4140 y(not)32 |
| 37c41ab1 CR |
10517 | b(presen)m(t,)f(and)g(neither)h(the)f(`)p Fs(-a)p Ft(')g(nor)g(`)p |
| 10518 | Fs(-r)p Ft(')g(option)h(is)g(supplied,)e(the)i(curren)m(t)f(job)g(is) | |
| 28157acd | 10519 | 630 4249 y(used.)58 b(If)36 b(no)g Fq(jobsp)s(ec)41 b |
| 37c41ab1 | 10520 | Ft(is)36 b(supplied,)h(the)g(`)p Fs(-a)p Ft(')f(option)h(means)f(to)h |
| 28157acd | 10521 | (remo)m(v)m(e)h(or)e(mark)g(all)630 4359 y(jobs;)28 b(the)f(`)p |
| 37c41ab1 CR |
10522 | Fs(-r)p Ft(')g(option)g(without)g(a)g Fq(jobsp)s(ec)32 |
| 10523 | b Ft(argumen)m(t)27 b(restricts)h(op)s(eration)f(to)h(running)630 | |
| 28157acd CR |
10524 | 4468 y(jobs.)150 4646 y Fs(suspend)870 4790 y(suspend)46 |
| 10525 | b([-f])630 4934 y Ft(Susp)s(end)28 b(the)i(execution)i(of)f(this)f | |
| 37c41ab1 | 10526 | (shell)g(un)m(til)h(it)g(receiv)m(es)h(a)f Fs(SIGCONT)e |
| 28157acd | 10527 | Ft(signal.)41 b(The)30 b(`)p Fs(-f)p Ft(')630 5043 y(option)h(means)f |
| 37c41ab1 CR |
10528 | (to)h(susp)s(end)d(ev)m(en)j(if)g(the)f(shell)h(is)f(a)h(login)g |
| 10529 | (shell.)275 5230 y(When)f(job)f(con)m(trol)j(is)e(not)h(activ)m(e,)i | |
| 10530 | (the)d Fs(kill)f Ft(and)h Fs(wait)f Ft(builtins)g(do)h(not)h(accept)h | |
| 5e13499c | 10531 | Fq(jobsp)s(ec)j Ft(argu-)150 5340 y(men)m(ts.)41 b(They)30 |
| 37c41ab1 CR |
10532 | b(m)m(ust)g(b)s(e)g(supplied)f(pro)s(cess)h Fl(id)p Ft(s.)p |
| 10533 | eop end | |
| 28157acd CR |
10534 | %%Page: 88 94 |
| 10535 | TeXDict begin 88 93 bop 150 -116 a Ft(88)2572 b(Bash)31 | |
| 37c41ab1 CR |
10536 | b(Reference)g(Man)m(ual)150 299 y Fr(7.3)68 b(Job)45 |
| 10537 | b(Con)l(trol)h(V)-11 b(ariables)150 543 y Fs(auto_resume)630 | |
| 10538 | 653 y Ft(This)31 b(v)-5 b(ariable)32 b(con)m(trols)g(ho)m(w)g(the)f | |
| 10539 | (shell)h(in)m(teracts)h(with)e(the)h(user)e(and)h(job)g(con)m(trol.)45 | |
| 10540 | b(If)630 762 y(this)28 b(v)-5 b(ariable)30 b(exists)f(then)f(single)h | |
| 10541 | (w)m(ord)f(simple)h(commands)f(without)g(redirections)i(are)630 | |
| 10542 | 872 y(treated)h(as)g(candidates)f(for)g(resumption)g(of)g(an)g | |
| 10543 | (existing)h(job.)41 b(There)29 b(is)h(no)h(am)m(biguit)m(y)630 | |
| 10544 | 981 y(allo)m(w)m(ed;)f(if)d(there)g(is)g(more)g(than)f(one)h(job)g(b)s | |
| 10545 | (eginning)f(with)g(the)h(string)g(t)m(yp)s(ed,)g(then)g(the)630 | |
| 10546 | 1091 y(most)j(recen)m(tly)h(accessed)f(job)f(will)h(b)s(e)f(selected.) | |
| 10547 | 42 b(The)29 b(name)g(of)h(a)g(stopp)s(ed)e(job,)i(in)f(this)630 | |
| 10548 | 1200 y(con)m(text,)h(is)e(the)g(command)g(line)g(used)f(to)h(start)g | |
| 10549 | (it.)41 b(If)27 b(this)h(v)-5 b(ariable)28 b(is)g(set)g(to)h(the)e(v)-5 | |
| 10550 | b(alue)630 1310 y(`)p Fs(exact)p Ft(',)33 b(the)g(string)g(supplied)f | |
| 10551 | (m)m(ust)h(matc)m(h)g(the)h(name)f(of)g(a)g(stopp)s(ed)f(job)h | |
| 10552 | (exactly;)j(if)630 1420 y(set)29 b(to)h(`)p Fs(substring)p | |
| 10553 | Ft(',)d(the)i(string)g(supplied)e(needs)i(to)g(matc)m(h)h(a)f | |
| 10554 | (substring)f(of)h(the)g(name)630 1529 y(of)38 b(a)f(stopp)s(ed)g(job.) | |
| 10555 | 62 b(The)37 b(`)p Fs(substring)p Ft(')e(v)-5 b(alue)38 | |
| 10556 | b(pro)m(vides)f(functionalit)m(y)i(analogous)g(to)630 | |
| 10557 | 1639 y(the)f(`)p Fs(\045?)p Ft(')f(job)h Fl(id)f Ft(\(see)i(Section)f | |
| 28157acd | 10558 | (7.1)h([Job)f(Con)m(trol)g(Basics],)j(page)d(85\).)64 |
| 5e13499c | 10559 | b(If)37 b(set)h(to)h(an)m(y)630 1748 y(other)32 b(v)-5 |
| 37c41ab1 | 10560 | b(alue,)32 b(the)g(supplied)e(string)i(m)m(ust)f(b)s(e)g(a)h(pre\014x)f |
| 5e13499c | 10561 | (of)h(a)g(stopp)s(ed)e(job's)i(name;)g(this)630 1858 |
| 37c41ab1 CR |
10562 | y(pro)m(vides)e(functionalit)m(y)i(analogous)g(to)f(the)g(`)p |
| 10563 | Fs(\045)p Ft(')f(job)g Fl(id)p Ft(.)p eop end | |
| 28157acd CR |
10564 | %%Page: 89 95 |
| 10565 | TeXDict begin 89 94 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 10566 | b(Command)29 b(Line)i(Editing)2107 b(89)150 299 y Fo(8)80 | |
| 37c41ab1 CR |
10567 | b(Command)54 b(Line)f(Editing)275 539 y Ft(This)39 b(c)m(hapter)h |
| 10568 | (describ)s(es)g(the)g(basic)g(features)g(of)h(the)f Fl(gnu)f | |
| 10569 | Ft(command)h(line)g(editing)h(in)m(terface.)150 648 y(Command)25 | |
| 10570 | b(line)h(editing)g(is)g(pro)m(vided)f(b)m(y)h(the)g(Readline)g(library) | |
| 10571 | -8 b(,)27 b(whic)m(h)f(is)g(used)f(b)m(y)g(sev)m(eral)i(di\013eren)m(t) | |
| 10572 | 150 758 y(programs,)j(including)g(Bash.)150 1020 y Fr(8.1)68 | |
| 5e13499c | 10573 | b(In)l(tro)t(duction)45 b(to)g(Line)h(Editing)275 1266 |
| 37c41ab1 CR |
10574 | y Ft(The)29 b(follo)m(wing)j(paragraphs)e(describ)s(e)g(the)g(notation) |
| 10575 | i(used)d(to)j(represen)m(t)e(k)m(eystrok)m(es.)275 1402 | |
| 10576 | y(The)i(text)j Fj(C-k)d Ft(is)i(read)f(as)h(`Con)m(trol-K')g(and)f | |
| 10577 | (describ)s(es)g(the)g(c)m(haracter)i(pro)s(duced)d(when)g(the)3663 | |
| 5e13499c | 10578 | 1399 y Fg(h)p 3687 1346 38 4 v 3687 1402 a Ff(k)p 3687 |
| 37c41ab1 CR |
10579 | 1417 V 3720 1399 a Fg(i)150 1512 y Ft(k)m(ey)f(is)g(pressed)e(while)h |
| 10580 | (the)h(Con)m(trol)g(k)m(ey)g(is)g(depressed.)275 1648 | |
| 10581 | y(The)g(text)i Fj(M-k)e Ft(is)h(read)f(as)i(`Meta-K')g(and)f(describ)s | |
| 10582 | (es)f(the)h(c)m(haracter)h(pro)s(duced)e(when)f(the)i(Meta)150 | |
| 10583 | 1757 y(k)m(ey)d(\(if)g(y)m(ou)g(ha)m(v)m(e)g(one\))g(is)g(depressed,)f | |
| 5e13499c | 10584 | (and)f(the)1859 1754 y Fg(h)p 1883 1701 V 1883 1757 a |
| 37c41ab1 CR |
10585 | Ff(k)p 1883 1773 V 1916 1754 a Fg(i)1974 1757 y Ft(k)m(ey)j(is)e |
| 10586 | (pressed.)39 b(The)28 b(Meta)i(k)m(ey)f(is)g(lab)s(eled)3558 | |
| 5e13499c CR |
10587 | 1754 y Fg(h)p 3582 1701 143 4 v 3582 1757 a Ff(AL)-6 |
| 10588 | b(T)p 3582 1773 V 3720 1754 a Fg(i)150 1867 y Ft(on)26 | |
| 37c41ab1 CR |
10589 | b(man)m(y)g(k)m(eyb)s(oards.)39 b(On)26 b(k)m(eyb)s(oards)g(with)g(t)m |
| 10590 | (w)m(o)h(k)m(eys)g(lab)s(eled)2425 1864 y Fg(h)p 2450 | |
| 5e13499c | 10591 | 1811 V 2450 1867 a Ff(AL)-6 b(T)p 2450 1882 V 2587 1864 |
| 37c41ab1 | 10592 | a Fg(i)2643 1867 y Ft(\(usually)27 b(to)g(either)f(side)g(of)h(the)150 |
| 5e13499c CR |
10593 | 1977 y(space)32 b(bar\),)g(the)775 1974 y Fg(h)p 799 |
| 10594 | 1921 V 799 1977 a Ff(AL)-6 b(T)p 799 1992 V 937 1974 | |
| 37c41ab1 | 10595 | a Fg(i)998 1977 y Ft(on)32 b(the)f(left)h(side)g(is)f(generally)i(set)e |
| 5e13499c CR |
10596 | (to)i(w)m(ork)e(as)h(a)f(Meta)i(k)m(ey)-8 b(.)45 b(The)3393 |
| 10597 | 1974 y Fg(h)p 3417 1921 V 3417 1977 a Ff(AL)-6 b(T)p | |
| 10598 | 3417 1992 V 3555 1974 a Fg(i)3616 1977 y Ft(k)m(ey)150 | |
| 37c41ab1 | 10599 | 2086 y(on)33 b(the)h(righ)m(t)g(ma)m(y)g(also)g(b)s(e)f(con\014gured)f |
| 5e13499c | 10600 | (to)i(w)m(ork)g(as)g(a)f(Meta)i(k)m(ey)f(or)g(ma)m(y)g(b)s(e)e |
| 37c41ab1 CR |
10601 | (con\014gured)h(as)h(some)150 2196 y(other)d(mo)s(di\014er,)e(suc)m(h)h |
| 10602 | (as)h(a)g(Comp)s(ose)f(k)m(ey)h(for)f(t)m(yping)h(accen)m(ted)h(c)m | |
| 5e13499c CR |
10603 | (haracters.)275 2332 y(If)21 b(y)m(ou)h(do)g(not)g(ha)m(v)m(e)h(a)f |
| 10604 | (Meta)h(or)1388 2329 y Fg(h)p 1412 2276 V 1412 2332 a | |
| 10605 | Ff(AL)-6 b(T)p 1412 2348 V 1550 2329 a Fg(i)1601 2332 | |
| 37c41ab1 | 10606 | y Ft(k)m(ey)e(,)25 b(or)d(another)g(k)m(ey)h(w)m(orking)f(as)g(a)g |
| 5e13499c CR |
10607 | (Meta)h(k)m(ey)-8 b(,)25 b(the)d(iden)m(tical)150 2442 |
| 10608 | y(k)m(eystrok)m(e)i(can)f(b)s(e)f(generated)i(b)m(y)e(t)m(yping)1619 | |
| 10609 | 2439 y Fg(h)p 1643 2386 139 4 v 1643 2442 a Ff(ESC)p | |
| 10610 | 1643 2457 V 1777 2439 a Fg(i)1829 2442 y Fm(\014rst)p | |
| 10611 | Ft(,)j(and)d(then)g(t)m(yping)2678 2439 y Fg(h)p 2703 | |
| 10612 | 2386 38 4 v 2703 2442 a Ff(k)p 2703 2457 V 2736 2439 | |
| 37c41ab1 CR |
10613 | a Fg(i)2765 2442 y Ft(.)38 b(Either)23 b(pro)s(cess)f(is)g(kno)m(wn)150 |
| 10614 | 2551 y(as)31 b Fq(metafying)39 b Ft(the)850 2548 y Fg(h)p | |
| 5e13499c CR |
10615 | 874 2495 V 874 2551 a Ff(k)p 874 2567 V 907 2548 a Fg(i)968 |
| 10616 | 2551 y Ft(k)m(ey)-8 b(.)275 2688 y(The)39 b(text)j Fj(M-C-k)d | |
| 37c41ab1 CR |
10617 | Ft(is)h(read)g(as)h(`Meta-Con)m(trol-k')j(and)39 b(describ)s(es)h(the)g |
| 10618 | (c)m(haracter)i(pro)s(duced)d(b)m(y)150 2797 y Fq(metafying)g | |
| 10619 | Fj(C-k)p Ft(.)275 2934 y(In)d(addition,)j(sev)m(eral)f(k)m(eys)f(ha)m | |
| 10620 | (v)m(e)h(their)f(o)m(wn)g(names.)60 b(Sp)s(eci\014cally)-8 | |
| 5e13499c CR |
10621 | b(,)2768 2931 y Fg(h)p 2792 2878 146 4 v 2792 2934 a |
| 10622 | Ff(DEL)p 2792 2949 V 2934 2931 a Fg(i)2964 2934 y Ft(,)3028 | |
| 10623 | 2931 y Fg(h)p 3052 2878 139 4 v 3052 2934 a Ff(ESC)p | |
| 10624 | 3052 2949 V 3186 2931 a Fg(i)3216 2934 y Ft(,)3279 2931 | |
| 10625 | y Fg(h)p 3303 2878 144 4 v 3303 2934 a Ff(LFD)p 3303 | |
| 10626 | 2949 V 3443 2931 a Fg(i)3473 2934 y Ft(,)3537 2931 y | |
| 10627 | Fg(h)p 3561 2878 139 4 v 3561 2934 a Ff(SPC)p 3561 2949 | |
| 10628 | V 3695 2931 a Fg(i)3725 2934 y Ft(,)150 3040 y Fg(h)p | |
| 10629 | 174 2987 151 4 v 174 3043 a Ff(RET)p 174 3059 V 321 3040 | |
| 10630 | a Fg(i)351 3043 y Ft(,)47 b(and)612 3040 y Fg(h)p 637 | |
| 10631 | 2987 148 4 v 637 3043 a Ff(T)-6 b(AB)p 637 3059 V 780 | |
| 37c41ab1 CR |
10632 | 3040 a Fg(i)853 3043 y Ft(all)45 b(stand)e(for)g(themselv)m(es)i(when)d |
| 10633 | (seen)i(in)f(this)g(text,)48 b(or)43 b(in)g(an)h(init)f(\014le)h(\(see) | |
| 28157acd | 10634 | 150 3153 y(Section)37 b(8.3)g([Readline)g(Init)f(File],)j(page)e(92\).) |
| 37c41ab1 | 10635 | 59 b(If)36 b(y)m(our)g(k)m(eyb)s(oard)g(lac)m(ks)h(a)2897 |
| 5e13499c CR |
10636 | 3150 y Fg(h)p 2921 3097 144 4 v 2921 3153 a Ff(LFD)p |
| 10637 | 2921 3168 V 3061 3150 a Fg(i)3127 3153 y Ft(k)m(ey)-8 | |
| 10638 | b(,)39 b(t)m(yping)3604 3150 y Fg(h)p 3628 3097 97 4 | |
| 10639 | v 3628 3153 a Ff(C-j)p 3628 3168 V 3720 3150 a Fg(i)150 | |
| 37c41ab1 | 10640 | 3262 y Ft(will)30 b(pro)s(duce)e(the)i(desired)f(c)m(haracter.)42 |
| 5e13499c CR |
10641 | b(The)1748 3259 y Fg(h)p 1772 3206 151 4 v 1772 3262 |
| 10642 | a Ff(RET)p 1772 3278 V 1919 3259 a Fg(i)1978 3262 y Ft(k)m(ey)30 | |
| 10643 | b(ma)m(y)g(b)s(e)f(lab)s(eled)2770 3259 y Fg(h)p 2794 | |
| 10644 | 3206 217 4 v 2794 3262 a Ff(Return)p 2794 3278 V 3007 | |
| 10645 | 3259 a Fg(i)3066 3262 y Ft(or)3176 3259 y Fg(h)p 3201 | |
| 10646 | 3206 172 4 v 3201 3262 a Ff(En)n(ter)p 3201 3278 V 3368 | |
| 10647 | 3259 a Fg(i)3427 3262 y Ft(on)h(some)150 3372 y(k)m(eyb)s(oards.)150 | |
| 10648 | 3634 y Fr(8.2)68 b(Readline)47 b(In)l(teraction)275 3880 | |
| 37c41ab1 CR |
10649 | y Ft(Often)24 b(during)g(an)h(in)m(teractiv)m(e)j(session)e(y)m(ou)f(t) |
| 10650 | m(yp)s(e)h(in)f(a)g(long)h(line)f(of)h(text,)h(only)f(to)f(notice)i | |
| 10651 | (that)f(the)150 3989 y(\014rst)32 b(w)m(ord)g(on)g(the)g(line)h(is)g | |
| 10652 | (missp)s(elled.)46 b(The)32 b(Readline)h(library)f(giv)m(es)h(y)m(ou)g | |
| 10653 | (a)g(set)g(of)f(commands)g(for)150 4099 y(manipulating)e(the)g(text)h | |
| 10654 | (as)f(y)m(ou)g(t)m(yp)s(e)g(it)g(in,)g(allo)m(wing)h(y)m(ou)f(to)h | |
| 10655 | (just)e(\014x)g(y)m(our)h(t)m(yp)s(o,)g(and)g(not)g(forcing)150 | |
| 10656 | 4209 y(y)m(ou)e(to)h(ret)m(yp)s(e)g(the)f(ma)5 b(jorit)m(y)29 | |
| 10657 | b(of)f(the)h(line.)40 b(Using)28 b(these)h(editing)g(commands,)f(y)m | |
| 10658 | (ou)h(mo)m(v)m(e)g(the)g(cursor)150 4318 y(to)35 b(the)f(place)i(that)e | |
| 10659 | (needs)g(correction,)j(and)d(delete)h(or)f(insert)h(the)f(text)h(of)g | |
| 10660 | (the)f(corrections.)54 b(Then,)150 4428 y(when)30 b(y)m(ou)i(are)f | |
| 10661 | (satis\014ed)g(with)g(the)g(line,)h(y)m(ou)g(simply)e(press)2320 | |
| 5e13499c CR |
10662 | 4425 y Fg(h)p 2344 4372 151 4 v 2344 4428 a Ff(RET)p |
| 10663 | 2344 4443 V 2491 4425 a Fg(i)2520 4428 y Ft(.)43 b(Y)-8 | |
| 10664 | b(ou)32 b(do)f(not)g(ha)m(v)m(e)i(to)e(b)s(e)g(at)h(the)150 | |
| 37c41ab1 | 10665 | 4537 y(end)j(of)h(the)g(line)g(to)h(press)1126 4534 y |
| 5e13499c | 10666 | Fg(h)p 1150 4481 V 1150 4537 a Ff(RET)p 1150 4553 V 1297 |
| 37c41ab1 CR |
10667 | 4534 a Fg(i)1327 4537 y Ft(;)h(the)e(en)m(tire)h(line)f(is)g(accepted)h |
| 10668 | (regardless)f(of)g(the)g(lo)s(cation)i(of)e(the)150 4647 | |
| 10669 | y(cursor)30 b(within)g(the)g(line.)150 4875 y Fk(8.2.1)63 | |
| 5e13499c | 10670 | b(Readline)40 b(Bare)h(Essen)m(tials)275 5121 y Ft(In)22 |
| 37c41ab1 CR |
10671 | b(order)g(to)i(en)m(ter)g(c)m(haracters)g(in)m(to)g(the)g(line,)h |
| 10672 | (simply)d(t)m(yp)s(e)i(them.)38 b(The)22 b(t)m(yp)s(ed)h(c)m(haracter)i | |
| 5e13499c | 10673 | (app)s(ears)150 5230 y(where)32 b(the)h(cursor)e(w)m(as,)j(and)e(then)g |
| 37c41ab1 CR |
10674 | (the)h(cursor)e(mo)m(v)m(es)j(one)f(space)g(to)g(the)g(righ)m(t.)47 |
| 10675 | b(If)32 b(y)m(ou)h(mist)m(yp)s(e)g(a)150 5340 y(c)m(haracter,)f(y)m(ou) | |
| 5e13499c | 10676 | f(can)g(use)f(y)m(our)g(erase)h(c)m(haracter)h(to)f(bac)m(k)g(up)f(and) |
| 37c41ab1 CR |
10677 | f(delete)j(the)f(mist)m(yp)s(ed)e(c)m(haracter.)p eop |
| 10678 | end | |
| 28157acd CR |
10679 | %%Page: 90 96 |
| 10680 | TeXDict begin 90 95 bop 150 -116 a Ft(90)2572 b(Bash)31 | |
| 37c41ab1 CR |
10681 | b(Reference)g(Man)m(ual)275 299 y(Sometimes)g(y)m(ou)g(ma)m(y)h(mist)m |
| 10682 | (yp)s(e)e(a)i(c)m(haracter,)g(and)e(not)i(notice)g(the)f(error)f(un)m | |
| 10683 | (til)h(y)m(ou)g(ha)m(v)m(e)h(t)m(yp)s(ed)150 408 y(sev)m(eral)e(other)f | |
| 10684 | (c)m(haracters.)42 b(In)28 b(that)i(case,)g(y)m(ou)f(can)g(t)m(yp)s(e)h | |
| 10685 | Fj(C-b)d Ft(to)j(mo)m(v)m(e)g(the)f(cursor)g(to)g(the)g(left,)i(and)150 | |
| 10686 | 518 y(then)f(correct)i(y)m(our)e(mistak)m(e.)42 b(Afterw)m(ards,)31 | |
| 10687 | b(y)m(ou)f(can)h(mo)m(v)m(e)h(the)e(cursor)g(to)h(the)g(righ)m(t)g | |
| 10688 | (with)f Fj(C-f)p Ft(.)275 679 y(When)i(y)m(ou)h(add)f(text)h(in)f(the)h | |
| 10689 | (middle)f(of)h(a)g(line,)h(y)m(ou)e(will)h(notice)h(that)f(c)m | |
| 5e13499c CR |
10690 | (haracters)h(to)g(the)e(righ)m(t)150 789 y(of)d(the)g(cursor)f(are)h |
| 10691 | (`pushed)e(o)m(v)m(er')j(to)g(mak)m(e)f(ro)s(om)g(for)f(the)h(text)h | |
| 37c41ab1 CR |
10692 | (that)f(y)m(ou)g(ha)m(v)m(e)h(inserted.)40 b(Lik)m(ewise,)150 |
| 10693 | 898 y(when)d(y)m(ou)g(delete)i(text)g(b)s(ehind)c(the)j(cursor,)h(c)m | |
| 10694 | (haracters)g(to)f(the)g(righ)m(t)g(of)g(the)g(cursor)e(are)i(`pulled) | |
| 10695 | 150 1008 y(bac)m(k')24 b(to)f(\014ll)g(in)f(the)h(blank)f(space)i | |
| 10696 | (created)f(b)m(y)g(the)g(remo)m(v)-5 b(al)24 b(of)f(the)g(text.)39 | |
| 10697 | b(A)23 b(list)g(of)g(the)g(bare)f(essen)m(tials)150 1117 | |
| 10698 | y(for)30 b(editing)h(the)g(text)g(of)g(an)f(input)f(line)i(follo)m(ws.) | |
| 5e13499c CR |
10699 | 150 1317 y Fj(C-b)336 b Ft(Mo)m(v)m(e)32 b(bac)m(k)g(one)e(c)m |
| 10700 | (haracter.)150 1502 y Fj(C-f)336 b Ft(Mo)m(v)m(e)32 b(forw)m(ard)e(one) | |
| 10701 | h(c)m(haracter.)150 1685 y Fg(h)p 174 1632 146 4 v 174 | |
| 10702 | 1688 a Ff(DEL)p 174 1704 V 316 1685 a Fg(i)376 1688 y | |
| 10703 | Ft(or)487 1685 y Fg(h)p 512 1632 317 4 v 512 1688 a Ff(Bac)n(kspace)p | |
| 37c41ab1 CR |
10704 | 512 1704 V 824 1685 a Fg(i)630 1798 y Ft(Delete)i(the)d(c)m(haracter)i |
| 10705 | (to)f(the)g(left)g(of)f(the)h(cursor.)150 1984 y Fj(C-d)336 | |
| 10706 | b Ft(Delete)33 b(the)d(c)m(haracter)i(underneath)d(the)i(cursor.)150 | |
| 10707 | 2170 y(Prin)m(ting)g(c)m(haracters)630 2279 y(Insert)f(the)g(c)m | |
| 10708 | (haracter)i(in)m(to)g(the)e(line)h(at)g(the)g(cursor.)150 | |
| 10709 | 2465 y Fj(C-_)e Ft(or)i Fj(C-x)e(C-u)630 2575 y Ft(Undo)k(the)h(last)g | |
| 10710 | (editing)g(command.)50 b(Y)-8 b(ou)34 b(can)f(undo)g(all)h(the)f(w)m(a) | |
| 5e13499c | 10711 | m(y)i(bac)m(k)f(to)g(an)g(empt)m(y)630 2684 y(line.)150 |
| 37c41ab1 | 10712 | 2883 y(\(Dep)s(ending)g(on)g(y)m(our)g(con\014guration,)h(the)1726 |
| 5e13499c | 10713 | 2880 y Fg(h)p 1750 2827 V 1750 2883 a Ff(Bac)n(kspace)p |
| 37c41ab1 CR |
10714 | 1750 2899 V 2063 2880 a Fg(i)2127 2883 y Ft(k)m(ey)g(b)s(e)e(set)h(to)h |
| 10715 | (delete)g(the)f(c)m(haracter)i(to)f(the)150 2993 y(left)f(of)f(the)g | |
| 5e13499c CR |
10716 | (cursor)f(and)h(the)1192 2990 y Fg(h)p 1216 2937 146 |
| 10717 | 4 v 1216 2993 a Ff(DEL)p 1216 3008 V 1358 2990 a Fg(i)1421 | |
| 37c41ab1 | 10718 | 2993 y Ft(k)m(ey)g(set)h(to)g(delete)g(the)f(c)m(haracter)i(underneath) |
| 5e13499c | 10719 | c(the)i(cursor,)h(lik)m(e)150 3103 y Fj(C-d)p Ft(,)c(rather)g(than)g |
| 37c41ab1 CR |
10720 | (the)h(c)m(haracter)h(to)f(the)f(left)h(of)g(the)f(cursor.\))150 |
| 10721 | 3380 y Fk(8.2.2)63 b(Readline)40 b(Mo)m(v)m(emen)m(t)h(Commands)275 | |
| 10722 | 3650 y Ft(The)25 b(ab)s(o)m(v)m(e)i(table)g(describ)s(es)f(the)g(most)h | |
| 10723 | (basic)f(k)m(eystrok)m(es)i(that)f(y)m(ou)f(need)g(in)g(order)f(to)i | |
| 10724 | (do)f(editing)150 3760 y(of)g(the)f(input)g(line.)39 | |
| 10725 | b(F)-8 b(or)27 b(y)m(our)e(con)m(v)m(enience,)k(man)m(y)c(other)h | |
| 10726 | (commands)f(ha)m(v)m(e)i(b)s(een)e(added)g(in)g(addition)150 | |
| 5e13499c CR |
10727 | 3869 y(to)33 b Fj(C-b)p Ft(,)e Fj(C-f)p Ft(,)h Fj(C-d)p |
| 10728 | Ft(,)g(and)1043 3866 y Fg(h)p 1067 3813 V 1067 3869 a | |
| 10729 | Ff(DEL)p 1067 3885 V 1209 3866 a Fg(i)1239 3869 y Ft(.)45 | |
| 37c41ab1 CR |
10730 | b(Here)33 b(are)f(some)g(commands)g(for)g(mo)m(ving)h(more)f(rapidly)f |
| 10731 | (ab)s(out)h(the)150 3979 y(line.)150 4178 y Fj(C-a)336 | |
| 5e13499c CR |
10732 | b Ft(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f(line.)150 |
| 10733 | 4364 y Fj(C-e)336 b Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h | |
| 10734 | (line.)150 4550 y Fj(M-f)336 b Ft(Mo)m(v)m(e)32 b(forw)m(ard)e(a)h(w)m | |
| 37c41ab1 | 10735 | (ord,)f(where)g(a)h(w)m(ord)f(is)g(comp)s(osed)g(of)h(letters)h(and)d |
| 5e13499c | 10736 | (digits.)150 4736 y Fj(M-b)336 b Ft(Mo)m(v)m(e)32 b(bac)m(kw)m(ard)f(a) |
| 37c41ab1 CR |
10737 | g(w)m(ord.)150 4922 y Fj(C-l)336 b Ft(Clear)31 b(the)f(screen,)h |
| 10738 | (reprin)m(ting)f(the)h(curren)m(t)f(line)h(at)g(the)f(top.)275 | |
| 10739 | 5121 y(Notice)c(ho)m(w)f Fj(C-f)e Ft(mo)m(v)m(es)j(forw)m(ard)e(a)h(c)m | |
| 10740 | (haracter,)j(while)d Fj(M-f)e Ft(mo)m(v)m(es)j(forw)m(ard)e(a)h(w)m | |
| 10741 | (ord.)39 b(It)24 b(is)h(a)g(lo)s(ose)150 5230 y(con)m(v)m(en)m(tion)32 | |
| 10742 | b(that)f(con)m(trol)g(k)m(eystrok)m(es)h(op)s(erate)e(on)g(c)m | |
| 10743 | (haracters)h(while)f(meta)h(k)m(eystrok)m(es)h(op)s(erate)e(on)150 | |
| 10744 | 5340 y(w)m(ords.)p eop end | |
| 28157acd CR |
10745 | %%Page: 91 97 |
| 10746 | TeXDict begin 91 96 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 10747 | b(Command)29 b(Line)i(Editing)2107 b(91)150 299 y Fk(8.2.3)63 | |
| 37c41ab1 CR |
10748 | b(Readline)40 b(Killing)i(Commands)275 566 y Fq(Killing)j |
| 10749 | Ft(text)39 b(means)e(to)h(delete)g(the)g(text)g(from)f(the)g(line,)j | |
| 10750 | (but)d(to)h(sa)m(v)m(e)h(it)e(a)m(w)m(a)m(y)j(for)d(later)h(use,)150 | |
| 10751 | 675 y(usually)c(b)m(y)g Fq(y)m(anking)42 b Ft(\(re-inserting\))35 | |
| 10752 | b(it)g(bac)m(k)g(in)m(to)g(the)f(line.)52 b(\(`Cut')35 | |
| 10753 | b(and)e(`paste')i(are)g(more)f(recen)m(t)150 785 y(jargon)d(for)f | |
| 10754 | (`kill')h(and)f(`y)m(ank'.\))275 942 y(If)f(the)i(description)f(for)g | |
| 10755 | (a)h(command)f(sa)m(ys)g(that)h(it)g(`kills')g(text,)h(then)e(y)m(ou)g | |
| 10756 | (can)h(b)s(e)e(sure)h(that)h(y)m(ou)150 1052 y(can)g(get)g(the)g(text)g | |
| 10757 | (bac)m(k)g(in)f(a)h(di\013eren)m(t)g(\(or)g(the)f(same\))h(place)h | |
| 10758 | (later.)275 1209 y(When)23 b(y)m(ou)g(use)g(a)h(kill)g(command,)g(the)g | |
| 10759 | (text)g(is)f(sa)m(v)m(ed)i(in)e(a)g Fq(kill-ring)p Ft(.)39 | |
| 10760 | b(An)m(y)24 b(n)m(um)m(b)s(er)e(of)h(consecutiv)m(e)150 | |
| 10761 | 1318 y(kills)31 b(sa)m(v)m(e)i(all)f(of)f(the)g(killed)h(text)g | |
| 10762 | (together,)g(so)g(that)f(when)f(y)m(ou)h(y)m(ank)h(it)f(bac)m(k,)h(y)m | |
| 10763 | (ou)g(get)g(it)f(all.)43 b(The)150 1428 y(kill)33 b(ring)f(is)g(not)h | |
| 10764 | (line)g(sp)s(eci\014c;)g(the)g(text)g(that)g(y)m(ou)g(killed)f(on)h(a)f | |
| 10765 | (previously)g(t)m(yp)s(ed)h(line)f(is)h(a)m(v)-5 b(ailable)150 | |
| 10766 | 1537 y(to)31 b(b)s(e)f(y)m(ank)m(ed)h(bac)m(k)g(later,)h(when)d(y)m(ou) | |
| 10767 | i(are)g(t)m(yping)f(another)h(line.)275 1695 y(Here)f(is)h(the)f(list)h | |
| 10768 | (of)g(commands)f(for)g(killing)h(text.)150 1888 y Fj(C-k)336 | |
| 10769 | b Ft(Kill)31 b(the)f(text)i(from)e(the)g(curren)m(t)g(cursor)g(p)s | |
| 10770 | (osition)h(to)g(the)f(end)g(of)g(the)h(line.)150 2070 | |
| 10771 | y Fj(M-d)336 b Ft(Kill)27 b(from)f(the)g(cursor)g(to)h(the)f(end)g(of)h | |
| 10772 | (the)f(curren)m(t)g(w)m(ord,)h(or,)h(if)e(b)s(et)m(w)m(een)h(w)m(ords,) | |
| 10773 | g(to)g(the)630 2180 y(end)j(of)g(the)h(next)f(w)m(ord.)41 | |
| 10774 | b(W)-8 b(ord)30 b(b)s(oundaries)f(are)i(the)g(same)f(as)h(those)g(used) | |
| 5e13499c CR |
10775 | f(b)m(y)g Fj(M-f)p Ft(.)150 2362 y Fj(M-)246 2359 y Fg(h)p |
| 10776 | 270 2306 146 4 v 270 2362 a Ff(DEL)p 270 2377 V 411 2359 | |
| 37c41ab1 CR |
10777 | a Fg(i)630 2362 y Ft(Kill)h(from)f(the)h(cursor)f(the)g(start)h(of)g |
| 10778 | (the)g(curren)m(t)f(w)m(ord,)h(or,)f(if)h(b)s(et)m(w)m(een)g(w)m(ords,) | |
| 10779 | f(to)i(the)630 2471 y(start)39 b(of)f(the)h(previous)f(w)m(ord.)64 | |
| 10780 | b(W)-8 b(ord)39 b(b)s(oundaries)e(are)i(the)f(same)h(as)g(those)f(used) | |
| 5e13499c | 10781 | g(b)m(y)630 2581 y Fj(M-b)p Ft(.)150 2763 y Fj(C-w)336 |
| 37c41ab1 CR |
10782 | b Ft(Kill)32 b(from)e(the)i(cursor)e(to)i(the)g(previous)e(whitespace.) |
| 10783 | 44 b(This)31 b(is)g(di\013eren)m(t)h(than)f Fj(M-)3555 | |
| 5e13499c CR |
10784 | 2760 y Fg(h)p 3578 2707 V 3578 2763 a Ff(DEL)p 3578 2778 |
| 10785 | V 3720 2760 a Fg(i)630 2872 y Ft(b)s(ecause)f(the)h(w)m(ord)f(b)s | |
| 37c41ab1 CR |
10786 | (oundaries)f(di\013er.)275 3066 y(Here)42 b(is)f(ho)m(w)h(to)g |
| 10787 | Fq(y)m(ank)47 b Ft(the)42 b(text)g(bac)m(k)h(in)m(to)f(the)g(line.)74 | |
| 10788 | b(Y)-8 b(anking)43 b(means)e(to)h(cop)m(y)h(the)e(most-)150 | |
| 10789 | 3175 y(recen)m(tly-killed)33 b(text)e(from)f(the)g(kill)i(bu\013er.)150 | |
| 10790 | 3369 y Fj(C-y)336 b Ft(Y)-8 b(ank)31 b(the)f(most)h(recen)m(tly)h | |
| 10791 | (killed)f(text)g(bac)m(k)g(in)m(to)h(the)e(bu\013er)g(at)h(the)f | |
| 10792 | (cursor.)150 3551 y Fj(M-y)336 b Ft(Rotate)36 b(the)f(kill-ring,)i(and) | |
| 10793 | d(y)m(ank)h(the)f(new)g(top.)54 b(Y)-8 b(ou)35 b(can)g(only)f(do)h | |
| 10794 | (this)f(if)h(the)g(prior)630 3660 y(command)30 b(is)h | |
| 10795 | Fj(C-y)e Ft(or)h Fj(M-y)p Ft(.)150 3930 y Fk(8.2.4)63 | |
| 5e13499c | 10796 | b(Readline)40 b(Argumen)m(ts)275 4197 y Ft(Y)-8 b(ou)29 |
| 37c41ab1 CR |
10797 | b(can)h(pass)f(n)m(umeric)g(argumen)m(ts)g(to)h(Readline)g(commands.)40 |
| 10798 | b(Sometimes)30 b(the)f(argumen)m(t)h(acts)150 4306 y(as)40 | |
| 10799 | b(a)h(rep)s(eat)f(coun)m(t,)j(other)e(times)f(it)h(is)f(the)g | |
| 10800 | Fm(sign)47 b Ft(of)41 b(the)f(argumen)m(t)g(that)h(is)f(signi\014can)m | |
| 10801 | (t.)71 b(If)40 b(y)m(ou)150 4416 y(pass)33 b(a)h(negativ)m(e)i(argumen) | |
| 10802 | m(t)e(to)g(a)g(command)f(whic)m(h)g(normally)h(acts)g(in)f(a)h(forw)m | |
| 10803 | (ard)f(direction,)i(that)150 4525 y(command)g(will)h(act)g(in)f(a)h | |
| 10804 | (bac)m(kw)m(ard)f(direction.)57 b(F)-8 b(or)36 b(example,)h(to)f(kill)g | |
| 10805 | (text)g(bac)m(k)g(to)g(the)g(start)g(of)150 4635 y(the)31 | |
| 10806 | b(line,)g(y)m(ou)f(migh)m(t)h(t)m(yp)s(e)g(`)p Fs(M--)f(C-k)p | |
| 10807 | Ft('.)275 4792 y(The)d(general)i(w)m(a)m(y)h(to)e(pass)g(n)m(umeric)g | |
| 10808 | (argumen)m(ts)h(to)g(a)f(command)g(is)g(to)h(t)m(yp)s(e)f(meta)i | |
| 10809 | (digits)e(b)s(efore)150 4902 y(the)j(command.)42 b(If)30 | |
| 10810 | b(the)h(\014rst)f(`digit')i(t)m(yp)s(ed)f(is)g(a)g(min)m(us)f(sign)h | |
| 10811 | (\(`)p Fs(-)p Ft('\),)h(then)f(the)g(sign)f(of)h(the)g(argumen)m(t)150 | |
| 10812 | 5011 y(will)39 b(b)s(e)e(negativ)m(e.)66 b(Once)38 b(y)m(ou)h(ha)m(v)m | |
| 10813 | (e)g(t)m(yp)s(ed)f(one)h(meta)g(digit)g(to)f(get)i(the)e(argumen)m(t)h | |
| 10814 | (started,)i(y)m(ou)150 5121 y(can)29 b(t)m(yp)s(e)g(the)g(remainder)f | |
| 10815 | (of)h(the)g(digits,)h(and)f(then)f(the)h(command.)40 | |
| 10816 | b(F)-8 b(or)30 b(example,)g(to)f(giv)m(e)i(the)e Fj(C-d)150 | |
| 10817 | 5230 y Ft(command)37 b(an)g(argumen)m(t)h(of)g(10,)i(y)m(ou)e(could)f | |
| 10818 | (t)m(yp)s(e)h(`)p Fs(M-1)29 b(0)h(C-d)p Ft(',)39 b(whic)m(h)e(will)h | |
| 10819 | (delete)h(the)e(next)h(ten)150 5340 y(c)m(haracters)32 | |
| 10820 | b(on)e(the)h(input)e(line.)p eop end | |
| 28157acd CR |
10821 | %%Page: 92 98 |
| 10822 | TeXDict begin 92 97 bop 150 -116 a Ft(92)2572 b(Bash)31 | |
| 37c41ab1 | 10823 | b(Reference)g(Man)m(ual)150 299 y Fk(8.2.5)63 b(Searc)m(hing)40 |
| 28157acd | 10824 | b(for)i(Commands)g(in)f(the)g(History)275 548 y Ft(Readline)23 |
| 37c41ab1 | 10825 | b(pro)m(vides)g(commands)f(for)h(searc)m(hing)h(through)e(the)h |
| 28157acd CR |
10826 | (command)g(history)f(\(see)i(Section)g(9.1)150 657 y([Bash)37 |
| 10827 | b(History)h(F)-8 b(acilities],)42 b(page)37 b(115\))i(for)d(lines)h | |
| 37c41ab1 | 10828 | (con)m(taining)i(a)e(sp)s(eci\014ed)f(string.)60 b(There)36 |
| 28157acd | 10829 | b(are)i(t)m(w)m(o)150 767 y(searc)m(h)31 b(mo)s(des:)40 |
| 37c41ab1 | 10830 | b Fq(incremen)m(tal)35 b Ft(and)30 b Fq(non-incremen)m(tal)p |
| 28157acd | 10831 | Ft(.)275 906 y(Incremen)m(tal)c(searc)m(hes)h(b)s(egin)e(b)s(efore)g |
| 37c41ab1 | 10832 | (the)h(user)f(has)h(\014nished)e(t)m(yping)i(the)g(searc)m(h)g(string.) |
| 28157acd | 10833 | 39 b(As)26 b(eac)m(h)150 1015 y(c)m(haracter)37 b(of)e(the)h(searc)m(h) |
| 37c41ab1 | 10834 | g(string)f(is)h(t)m(yp)s(ed,)g(Readline)g(displa)m(ys)g(the)f(next)h |
| 28157acd | 10835 | (en)m(try)g(from)e(the)i(history)150 1125 y(matc)m(hing)25 |
| 37c41ab1 CR |
10836 | b(the)f(string)g(t)m(yp)s(ed)g(so)g(far.)39 b(An)23 b(incremen)m(tal)j |
| 10837 | (searc)m(h)e(requires)g(only)g(as)g(man)m(y)g(c)m(haracters)i(as)150 | |
| 28157acd | 10838 | 1235 y(needed)i(to)i(\014nd)d(the)i(desired)f(history)h(en)m(try)-8 |
| 37c41ab1 | 10839 | b(.)41 b(T)-8 b(o)29 b(searc)m(h)h(bac)m(kw)m(ard)f(in)f(the)h(history) |
| 28157acd | 10840 | g(for)f(a)i(particular)150 1344 y(string,)g(t)m(yp)s(e)f |
| 37c41ab1 CR |
10841 | Fj(C-r)p Ft(.)40 b(T)m(yping)29 b Fj(C-s)g Ft(searc)m(hes)h(forw)m(ard) |
| 10842 | f(through)g(the)g(history)-8 b(.)41 b(The)29 b(c)m(haracters)i(presen)m | |
| 28157acd | 10843 | (t)150 1454 y(in)38 b(the)g(v)-5 b(alue)38 b(of)g(the)g |
| 37c41ab1 | 10844 | Fs(isearch-terminators)33 b Ft(v)-5 b(ariable)39 b(are)f(used)f(to)i |
| 28157acd | 10845 | (terminate)g(an)f(incremen)m(tal)150 1563 y(searc)m(h.)63 |
| 37c41ab1 | 10846 | b(If)38 b(that)g(v)-5 b(ariable)38 b(has)g(not)g(b)s(een)f(assigned)h |
| 28157acd CR |
10847 | (a)g(v)-5 b(alue,)40 b(the)2578 1560 y Fg(h)p 2602 1507 |
| 10848 | 139 4 v 2602 1563 a Ff(ESC)p 2602 1579 V 2736 1560 a | |
| 10849 | Fg(i)2804 1563 y Ft(and)d Fj(C-J)f Ft(c)m(haracters)k(will)150 | |
| 10850 | 1673 y(terminate)j(an)g(incremen)m(tal)g(searc)m(h.)78 | |
| 37c41ab1 | 10851 | b Fj(C-g)41 b Ft(will)i(ab)s(ort)f(an)g(incremen)m(tal)i(searc)m(h)f |
| 28157acd | 10852 | (and)f(restore)h(the)150 1782 y(original)30 b(line.)41 |
| 37c41ab1 | 10853 | b(When)28 b(the)h(searc)m(h)h(is)f(terminated,)h(the)f(history)g(en)m |
| 28157acd CR |
10854 | (try)g(con)m(taining)h(the)f(searc)m(h)h(string)150 1892 |
| 10855 | y(b)s(ecomes)h(the)f(curren)m(t)g(line.)275 2031 y(T)-8 | |
| 37c41ab1 CR |
10856 | b(o)31 b(\014nd)e(other)j(matc)m(hing)g(en)m(tries)g(in)e(the)h |
| 10857 | (history)g(list,)h(t)m(yp)s(e)g Fj(C-r)e Ft(or)h Fj(C-s)f | |
| 28157acd | 10858 | Ft(as)h(appropriate.)43 b(This)150 2141 y(will)26 b(searc)m(h)h(bac)m |
| 37c41ab1 CR |
10859 | (kw)m(ard)g(or)f(forw)m(ard)g(in)f(the)i(history)f(for)g(the)g(next)g |
| 10860 | (en)m(try)h(matc)m(hing)g(the)f(searc)m(h)h(string)150 | |
| 28157acd | 10861 | 2250 y(t)m(yp)s(ed)37 b(so)h(far.)63 b(An)m(y)38 b(other)f(k)m(ey)i |
| 37c41ab1 | 10862 | (sequence)f(b)s(ound)e(to)i(a)g(Readline)h(command)e(will)h(terminate)h |
| 28157acd CR |
10863 | (the)150 2360 y(searc)m(h)22 b(and)e(execute)j(that)e(command.)38 |
| 10864 | b(F)-8 b(or)22 b(instance,)h(a)2127 2357 y Fg(h)p 2151 | |
| 10865 | 2304 151 4 v 2151 2360 a Ff(RET)p 2151 2375 V 2298 2357 | |
| 10866 | a Fg(i)2349 2360 y Ft(will)e(terminate)h(the)f(searc)m(h)h(and)e | |
| 10867 | (accept)150 2469 y(the)30 b(line,)g(thereb)m(y)f(executing)i(the)e | |
| 37c41ab1 | 10868 | (command)g(from)g(the)h(history)f(list.)41 b(A)29 b(mo)m(v)m(emen)m(t)j |
| 28157acd | 10869 | (command)d(will)150 2579 y(terminate)i(the)g(searc)m(h,)g(mak)m(e)h |
| 37c41ab1 | 10870 | (the)e(last)h(line)g(found)e(the)i(curren)m(t)f(line,)h(and)f(b)s(egin) |
| 28157acd | 10871 | g(editing.)275 2718 y(Readline)35 b(remem)m(b)s(ers)f(the)h(last)h |
| 37c41ab1 | 10872 | (incremen)m(tal)g(searc)m(h)f(string.)54 b(If)34 b(t)m(w)m(o)j |
| 28157acd | 10873 | Fj(C-r)p Ft(s)c(are)i(t)m(yp)s(ed)g(without)150 2828 |
| 37c41ab1 CR |
10874 | y(an)m(y)i(in)m(terv)m(ening)g(c)m(haracters)h(de\014ning)e(a)h(new)f |
| 10875 | (searc)m(h)h(string,)h(an)m(y)f(remem)m(b)s(ered)e(searc)m(h)i(string)g | |
| 28157acd | 10876 | (is)150 2937 y(used.)275 3076 y(Non-incremen)m(tal)48 |
| 37c41ab1 | 10877 | b(searc)m(hes)g(read)e(the)h(en)m(tire)h(searc)m(h)f(string)g(b)s |
| 28157acd | 10878 | (efore)f(starting)h(to)h(searc)m(h)f(for)150 3186 y(matc)m(hing)d |
| 37c41ab1 | 10879 | (history)e(lines.)78 b(The)42 b(searc)m(h)h(string)g(ma)m(y)g(b)s(e)f |
| 5e13499c | 10880 | (t)m(yp)s(ed)g(b)m(y)g(the)h(user)f(or)h(b)s(e)f(part)g(of)h(the)150 |
| 28157acd CR |
10881 | 3295 y(con)m(ten)m(ts)32 b(of)f(the)f(curren)m(t)g(line.)150 |
| 10882 | 3564 y Fr(8.3)68 b(Readline)47 b(Init)e(File)275 3813 | |
| 37c41ab1 | 10883 | y Ft(Although)g(the)g(Readline)h(library)e(comes)i(with)f(a)h(set)f(of) |
| 28157acd | 10884 | g(Emacs-lik)m(e)i(k)m(eybindings)e(installed)150 3922 |
| 37c41ab1 CR |
10885 | y(b)m(y)d(default,)i(it)f(is)e(p)s(ossible)g(to)i(use)e(a)h(di\013eren) |
| 10886 | m(t)g(set)g(of)g(k)m(eybindings.)74 b(An)m(y)42 b(user)f(can)h | |
| 28157acd | 10887 | (customize)150 4032 y(programs)32 b(that)h(use)f(Readline)h(b)m(y)g |
| 37c41ab1 | 10888 | (putting)f(commands)g(in)g(an)g Fq(inputrc)37 b Ft(\014le,)d(con)m(v)m |
| 28157acd | 10889 | (en)m(tionally)h(in)d(his)150 4142 y(home)d(directory)-8 |
| 37c41ab1 CR |
10890 | b(.)41 b(The)28 b(name)g(of)h(this)g(\014le)f(is)h(tak)m(en)h(from)e |
| 10891 | (the)h(v)-5 b(alue)29 b(of)g(the)f(shell)h(v)-5 b(ariable)30 | |
| 28157acd CR |
10892 | b Fs(INPUTRC)p Ft(.)150 4251 y(If)g(that)h(v)-5 b(ariable)31 |
| 10893 | b(is)f(unset,)h(the)f(default)h(is)f(`)p Fs(~/.inputrc)p | |
| 10894 | Ft('.)275 4390 y(When)f(a)h(program)f(whic)m(h)h(uses)f(the)h(Readline) | |
| 10895 | g(library)f(starts)h(up,)f(the)h(init)g(\014le)f(is)h(read,)g(and)f | |
| 10896 | (the)150 4500 y(k)m(ey)i(bindings)e(are)i(set.)275 4639 | |
| 10897 | y(In)26 b(addition,)i(the)f Fs(C-x)i(C-r)d Ft(command)h(re-reads)g | |
| 37c41ab1 | 10898 | (this)f(init)h(\014le,)h(th)m(us)f(incorp)s(orating)g(an)m(y)g(c)m |
| 28157acd CR |
10899 | (hanges)150 4748 y(that)k(y)m(ou)g(migh)m(t)g(ha)m(v)m(e)g(made)g(to)g |
| 10900 | (it.)150 4982 y Fk(8.3.1)63 b(Readline)40 b(Init)h(File)g(Syn)m(tax)275 | |
| 37c41ab1 CR |
10901 | 5230 y Ft(There)33 b(are)h(only)g(a)g(few)f(basic)h(constructs)g(allo)m |
| 10902 | (w)m(ed)h(in)f(the)g(Readline)g(init)g(\014le.)51 b(Blank)34 | |
| 10903 | b(lines)g(are)150 5340 y(ignored.)72 b(Lines)41 b(b)s(eginning)f(with)h | |
| 10904 | (a)g(`)p Fs(#)p Ft(')g(are)h(commen)m(ts.)73 b(Lines)41 | |
| 10905 | b(b)s(eginning)f(with)g(a)i(`)p Fs($)p Ft(')f(indicate)p | |
| 10906 | eop end | |
| 28157acd CR |
10907 | %%Page: 93 99 |
| 10908 | TeXDict begin 93 98 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 10909 | b(Command)29 b(Line)i(Editing)2107 b(93)150 299 y(conditional)43 | |
| 37c41ab1 | 10910 | b(constructs)e(\(see)i(Section)f(8.3.2)h([Conditional)f(Init)f |
| 28157acd | 10911 | (Constructs],)j(page)f(97\).)74 b(Other)150 408 y(lines)31 |
| 37c41ab1 | 10912 | b(denote)g(v)-5 b(ariable)31 b(settings)g(and)f(k)m(ey)h(bindings.)150 |
| 1c72c0cd | 10913 | 579 y(V)-8 b(ariable)32 b(Settings)630 689 y(Y)-8 b(ou)41 |
| 37c41ab1 | 10914 | b(can)g(mo)s(dify)e(the)i(run-time)f(b)s(eha)m(vior)g(of)h(Readline)g |
| 1c72c0cd | 10915 | (b)m(y)f(altering)h(the)g(v)-5 b(alues)41 b(of)630 798 |
| 37c41ab1 CR |
10916 | y(v)-5 b(ariables)34 b(in)f(Readline)i(using)e(the)g |
| 10917 | Fs(set)g Ft(command)g(within)g(the)h(init)g(\014le.)50 | |
| 1c72c0cd CR |
10918 | b(The)33 b(syn)m(tax)630 908 y(is)d(simple:)870 1046 |
| 10919 | y Fs(set)47 b Fj(variable)56 b(value)630 1184 y Ft(Here,)29 | |
| 37c41ab1 | 10920 | b(for)e(example,)h(is)g(ho)m(w)f(to)h(c)m(hange)g(from)f(the)g(default) |
| 1c72c0cd CR |
10921 | h(Emacs-lik)m(e)h(k)m(ey)f(binding)e(to)630 1294 y(use)k |
| 10922 | Fs(vi)g Ft(line)h(editing)g(commands:)870 1432 y Fs(set)47 | |
| 10923 | b(editing-mode)d(vi)630 1570 y Ft(V)-8 b(ariable)36 b(names)f(and)g(v) | |
| 37c41ab1 | 10924 | -5 b(alues,)36 b(where)f(appropriate,)h(are)g(recognized)g(without)f |
| 1c72c0cd CR |
10925 | (regard)630 1680 y(to)c(case.)42 b(Unrecognized)31 b(v)-5 |
| 10926 | b(ariable)31 b(names)g(are)f(ignored.)630 1818 y(Bo)s(olean)c(v)-5 | |
| 10927 | b(ariables)26 b(\(those)g(that)g(can)f(b)s(e)f(set)i(to)g(on)f(or)g | |
| 10928 | (o\013)7 b(\))25 b(are)h(set)f(to)h(on)f(if)g(the)g(v)-5 | |
| 10929 | b(alue)26 b(is)630 1928 y(n)m(ull)e(or)g(empt)m(y)-8 | |
| 10930 | b(,)27 b Fq(on)d Ft(\(case-insensitiv)m(e\),)29 b(or)24 | |
| 10931 | b(1.)39 b(An)m(y)25 b(other)f(v)-5 b(alue)25 b(results)f(in)g(the)g(v) | |
| 10932 | -5 b(ariable)630 2037 y(b)s(eing)30 b(set)h(to)g(o\013.)630 | |
| 10933 | 2176 y(The)37 b Fs(bind)30 b(-V)37 b Ft(command)g(lists)i(the)f(curren) | |
| 10934 | m(t)f(Readline)i(v)-5 b(ariable)38 b(names)g(and)f(v)-5 | |
| 10935 | b(alues.)630 2285 y(See)31 b(Section)g(4.2)g([Bash)g(Builtins],)g(page) | |
| ac18b312 | 10936 | g(41.)630 2423 y(A)f(great)i(deal)f(of)g(run-time)f(b)s(eha)m(vior)g |
| 1c72c0cd CR |
10937 | (is)g(c)m(hangeable)j(with)d(the)g(follo)m(wing)i(v)-5 |
| 10938 | b(ariables.)630 2590 y Fs(bell-style)1110 2700 y Ft(Con)m(trols)44 | |
| 10939 | b(what)g(happ)s(ens)e(when)h(Readline)i(w)m(an)m(ts)f(to)h(ring)e(the)h | |
| 10940 | (termi-)1110 2809 y(nal)37 b(b)s(ell.)61 b(If)37 b(set)h(to)g(`)p | |
| 37c41ab1 | 10941 | Fs(none)p Ft(',)g(Readline)g(nev)m(er)g(rings)e(the)i(b)s(ell.)61 |
| 1c72c0cd | 10942 | b(If)36 b(set)i(to)1110 2919 y(`)p Fs(visible)p Ft(',)32 |
| 37c41ab1 | 10943 | b(Readline)i(uses)f(a)g(visible)g(b)s(ell)g(if)g(one)g(is)g(a)m(v)-5 |
| 1c72c0cd | 10944 | b(ailable.)51 b(If)33 b(set)g(to)1110 3029 y(`)p Fs(audible)p |
| 37c41ab1 | 10945 | Ft(')j(\(the)i(default\),)i(Readline)e(attempts)g(to)h(ring)e(the)g |
| 1c72c0cd CR |
10946 | (terminal's)1110 3138 y(b)s(ell.)630 3305 y Fs(bind-tty-special-chars) |
| 10947 | 1110 3415 y Ft(If)45 b(set)h(to)f(`)p Fs(on)p Ft(',)50 | |
| eb2bb562 | 10948 | b(Readline)45 b(attempts)i(to)f(bind)d(the)j(con)m(trol)g(c)m |
| 1c72c0cd | 10949 | (haracters)1110 3524 y(treated)36 b(sp)s(ecially)h(b)m(y)e(the)h(k)m |
| eb2bb562 | 10950 | (ernel's)g(terminal)g(driv)m(er)f(to)h(their)f(Readline)1110 |
| 1c72c0cd CR |
10951 | 3634 y(equiv)-5 b(alen)m(ts.)630 3801 y Fs(comment-begin)1110 |
| 10952 | 3910 y Ft(The)29 b(string)g(to)h(insert)f(at)h(the)f(b)s(eginning)g(of) | |
| 10953 | g(the)h(line)f(when)f(the)i Fs(insert-)1110 4020 y(comment)e | |
| 37c41ab1 | 10954 | Ft(command)j(is)f(executed.)42 b(The)29 b(default)i(v)-5 |
| 1c72c0cd CR |
10955 | b(alue)31 b(is)f Fs("#")p Ft(.)630 4187 y Fs(completion-ignore-case) |
| 10956 | 1110 4296 y Ft(If)d(set)h(to)g(`)p Fs(on)p Ft(',)g(Readline)g(p)s | |
| 37c41ab1 | 10957 | (erforms)e(\014lename)h(matc)m(hing)i(and)e(completion)1110 |
| 1c72c0cd | 10958 | 4406 y(in)j(a)h(case-insensitiv)m(e)i(fashion.)40 b(The)30 |
| 37c41ab1 | 10959 | b(default)h(v)-5 b(alue)30 b(is)h(`)p Fs(off)p Ft('.)630 |
| 1c72c0cd | 10960 | 4573 y Fs(completion-query-items)1110 4682 y Ft(The)26 |
| 37c41ab1 | 10961 | b(n)m(um)m(b)s(er)f(of)h(p)s(ossible)g(completions)h(that)g(determines) |
| 1c72c0cd | 10962 | f(when)f(the)i(user)1110 4792 y(is)i(ask)m(ed)h(whether)f(the)h(list)g |
| 37c41ab1 | 10963 | (of)f(p)s(ossibilities)h(should)e(b)s(e)h(displa)m(y)m(ed.)41 |
| 1c72c0cd | 10964 | b(If)29 b(the)1110 4902 y(n)m(um)m(b)s(er)d(of)h(p)s(ossible)f |
| 37c41ab1 | 10965 | (completions)i(is)f(greater)h(than)e(this)h(v)-5 b(alue,)28 |
| 1c72c0cd CR |
10966 | b(Readline)1110 5011 y(will)f(ask)g(the)f(user)g(whether)g(or)g(not)h |
| 10967 | (he)f(wishes)g(to)i(view)e(them;)i(otherwise,)1110 5121 | |
| 37c41ab1 CR |
10968 | y(they)d(are)f(simply)g(listed.)40 b(This)23 b(v)-5 b(ariable)25 |
| 10969 | b(m)m(ust)g(b)s(e)e(set)i(to)g(an)g(in)m(teger)g(v)-5 | |
| 1c72c0cd CR |
10970 | b(alue)1110 5230 y(greater)26 b(than)f(or)f(equal)i(to)f(0.)40 |
| 10971 | b(A)24 b(negativ)m(e)j(v)-5 b(alue)26 b(means)e(Readline)i(should)1110 | |
| 10972 | 5340 y(nev)m(er)31 b(ask.)41 b(The)29 b(default)i(limit)g(is)g | |
| 10973 | Fs(100)p Ft(.)p eop end | |
| 28157acd CR |
10974 | %%Page: 94 100 |
| 10975 | TeXDict begin 94 99 bop 150 -116 a Ft(94)2572 b(Bash)31 | |
| 1c72c0cd CR |
10976 | b(Reference)g(Man)m(ual)630 299 y Fs(convert-meta)1110 |
| 10977 | 408 y Ft(If)22 b(set)g(to)h(`)p Fs(on)p Ft(',)h(Readline)f(will)f(con)m | |
| 10978 | (v)m(ert)i(c)m(haracters)f(with)f(the)g(eigh)m(th)h(bit)f(set)1110 | |
| 10979 | 518 y(to)g(an)f Fl(asci)r(i)g Ft(k)m(ey)h(sequence)g(b)m(y)f(stripping) | |
| 10980 | f(the)i(eigh)m(th)g(bit)f(and)g(pre\014xing)f(an)1110 | |
| 10981 | 625 y Fg(h)p 1134 572 139 4 v 1134 628 a Ff(ESC)p 1134 | |
| 10982 | 643 V 1268 625 a Fg(i)1332 628 y Ft(c)m(haracter,)36 | |
| 10983 | b(con)m(v)m(erting)g(them)e(to)g(a)h(meta-pre\014xed)f(k)m(ey)g | |
| 10984 | (sequence.)1110 737 y(The)c(default)g(v)-5 b(alue)31 | |
| 10985 | b(is)g(`)p Fs(on)p Ft('.)630 883 y Fs(disable-completion)1110 | |
| 10986 | 993 y Ft(If)36 b(set)h(to)h(`)p Fs(On)p Ft(',)g(Readline)f(will)g | |
| eb2bb562 | 10987 | (inhibit)f(w)m(ord)h(completion.)60 b(Completion)1110 |
| 1c72c0cd | 10988 | 1103 y(c)m(haracters)28 b(will)e(b)s(e)f(inserted)h(in)m(to)h(the)g |
| eb2bb562 | 10989 | (line)f(as)g(if)g(they)h(had)e(b)s(een)g(mapp)s(ed)1110 |
| 1c72c0cd CR |
10990 | 1212 y(to)31 b Fs(self-insert)p Ft(.)38 b(The)30 b(default)g(is)h(`)p |
| 10991 | Fs(off)p Ft('.)630 1358 y Fs(editing-mode)1110 1468 y | |
| 10992 | Ft(The)d Fs(editing-mode)e Ft(v)-5 b(ariable)29 b(con)m(trols)h(whic)m | |
| 10993 | (h)e(default)h(set)h(of)e(k)m(ey)i(bind-)1110 1577 y(ings)25 | |
| eb2bb562 | 10994 | b(is)g(used.)38 b(By)26 b(default,)g(Readline)g(starts)f(up)f(in)h |
| 1c72c0cd | 10995 | (Emacs)g(editing)h(mo)s(de,)1110 1687 y(where)j(the)g(k)m(eystrok)m(es) |
| eb2bb562 | 10996 | i(are)e(most)h(similar)f(to)h(Emacs.)40 b(This)29 b(v)-5 |
| 1c72c0cd CR |
10997 | b(ariable)30 b(can)1110 1797 y(b)s(e)g(set)h(to)g(either)g(`)p |
| 10998 | Fs(emacs)p Ft(')e(or)h(`)p Fs(vi)p Ft('.)630 1943 y Fs(enable-keypad) | |
| 10999 | 1110 2052 y Ft(When)23 b(set)h(to)g(`)p Fs(on)p Ft(',)h(Readline)f | |
| eb2bb562 | 11000 | (will)g(try)f(to)h(enable)g(the)f(application)i(k)m(eypad)1110 |
| 1c72c0cd CR |
11001 | 2162 y(when)h(it)h(is)f(called.)41 b(Some)27 b(systems)f(need)h(this)f |
| 11002 | (to)h(enable)g(the)g(arro)m(w)g(k)m(eys.)1110 2271 y(The)j(default)g | |
| 11003 | (is)h(`)p Fs(off)p Ft('.)630 2418 y Fs(expand-tilde)1110 | |
| 11004 | 2527 y Ft(If)c(set)h(to)h(`)p Fs(on)p Ft(',)f(tilde)g(expansion)g(is)f | |
| 11005 | (p)s(erformed)f(when)h(Readline)h(attempts)1110 2637 | |
| eb2bb562 | 11006 | y(w)m(ord)i(completion.)42 b(The)30 b(default)g(is)h(`)p |
| 1c72c0cd CR |
11007 | Fs(off)p Ft('.)630 2783 y Fs(history-preserve-point)1110 |
| 11008 | 2892 y Ft(If)e(set)i(to)f(`)p Fs(on)p Ft(',)g(the)g(history)g(co)s(de)g | |
| 11009 | (attempts)g(to)h(place)f(p)s(oin)m(t)g(at)h(the)f(same)1110 | |
| 11010 | 3002 y(lo)s(cation)35 b(on)e(eac)m(h)i(history)e(line)h(retriev)m(ed)g | |
| 11011 | (with)f Fs(previous-history)c Ft(or)1110 3112 y Fs(next-history)p | |
| 11012 | Ft(.)37 b(The)30 b(default)h(is)f(`)p Fs(off)p Ft('.)630 | |
| 11013 | 3258 y Fs(horizontal-scroll-mode)1110 3367 y Ft(This)35 | |
| 11014 | b(v)-5 b(ariable)37 b(can)f(b)s(e)f(set)h(to)h(either)f(`)p | |
| 11015 | Fs(on)p Ft(')g(or)g(`)p Fs(off)p Ft('.)57 b(Setting)36 | |
| 11016 | b(it)g(to)h(`)p Fs(on)p Ft(')1110 3477 y(means)26 b(that)h(the)f(text)h | |
| 11017 | (of)g(the)f(lines)g(b)s(eing)g(edited)h(will)f(scroll)h(horizon)m | |
| 11018 | (tally)1110 3587 y(on)32 b(a)g(single)g(screen)g(line)g(when)e(they)i | |
| 11019 | (are)g(longer)h(than)e(the)h(width)f(of)h(the)1110 3696 | |
| 11020 | y(screen,)27 b(instead)g(of)f(wrapping)f(on)m(to)i(a)f(new)g(screen)g | |
| 11021 | (line.)39 b(By)27 b(default,)g(this)1110 3806 y(v)-5 | |
| 11022 | b(ariable)31 b(is)g(set)f(to)i(`)p Fs(off)p Ft('.)630 | |
| 11023 | 3952 y Fs(input-meta)1110 4061 y Ft(If)f(set)g(to)h(`)p | |
| 37c41ab1 | 11024 | Fs(on)p Ft(',)g(Readline)g(will)f(enable)h(eigh)m(t-bit)h(input)d(\(it) |
| 1c72c0cd | 11025 | i(will)f(not)h(clear)1110 4171 y(the)40 b(eigh)m(th)g(bit)g(in)f(the)h |
| 37c41ab1 | 11026 | (c)m(haracters)h(it)f(reads\),)j(regardless)c(of)h(what)g(the)1110 |
| 1c72c0cd | 11027 | 4281 y(terminal)g(claims)h(it)g(can)f(supp)s(ort.)68 |
| 37c41ab1 | 11028 | b(The)39 b(default)h(v)-5 b(alue)40 b(is)g(`)p Fs(off)p |
| 1c72c0cd CR |
11029 | Ft('.)69 b(The)1110 4390 y(name)30 b Fs(meta-flag)e Ft(is)j(a)f(synon)m |
| 11030 | (ym)g(for)g(this)h(v)-5 b(ariable.)630 4536 y Fs(isearch-terminators) | |
| 11031 | 1110 4646 y Ft(The)51 b(string)h(of)g(c)m(haracters)h(that)f(should)e | |
| 11032 | (terminate)j(an)f(incremen)m(tal)1110 4755 y(searc)m(h)25 | |
| 37c41ab1 | 11033 | b(without)g(subsequen)m(tly)g(executing)h(the)f(c)m(haracter)h(as)f(a)g |
| 1c72c0cd | 11034 | (command)1110 4865 y(\(see)42 b(Section)f(8.2.5)i([Searc)m(hing],)i |
| 28157acd | 11035 | (page)c(92\).)73 b(If)41 b(this)g(v)-5 b(ariable)41 b(has)g(not)1110 |
| 1c72c0cd CR |
11036 | 4975 y(b)s(een)31 b(giv)m(en)h(a)g(v)-5 b(alue,)32 b(the)g(c)m |
| 11037 | (haracters)2494 4972 y Fg(h)p 2518 4919 V 2518 4975 a | |
| 11038 | Ff(ESC)p 2518 4990 V 2652 4972 a Fg(i)2713 4975 y Ft(and)f | |
| 11039 | Fj(C-J)g Ft(will)h(terminate)g(an)1110 5084 y(incremen)m(tal)g(searc)m | |
| 11040 | (h.)630 5230 y Fs(keymap)192 b Ft(Sets)39 b(Readline's)g(idea)h(of)f | |
| 11041 | (the)g(curren)m(t)f(k)m(eymap)h(for)g(k)m(ey)g(binding)f(com-)1110 | |
| 11042 | 5340 y(mands.)81 b(Acceptable)47 b Fs(keymap)42 b Ft(names)i(are)h | |
| 11043 | Fs(emacs)p Ft(,)i Fs(emacs-standard)p Ft(,)p eop end | |
| 28157acd CR |
11044 | %%Page: 95 101 |
| 11045 | TeXDict begin 95 100 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11046 | b(Command)29 b(Line)i(Editing)2107 b(95)1110 299 y Fs(emacs-meta)p | |
| 5e13499c | 11047 | Ft(,)99 b Fs(emacs-ctlx)p Ft(,)f Fs(vi)p Ft(,)j Fs(vi-move)p |
| 1c72c0cd | 11048 | Ft(,)f Fs(vi-command)p Ft(,)f(and)1110 408 y Fs(vi-insert)p |
| 37c41ab1 CR |
11049 | Ft(.)64 b Fs(vi)38 b Ft(is)h(equiv)-5 b(alen)m(t)41 b(to)e |
| 11050 | Fs(vi-command)p Ft(;)i Fs(emacs)c Ft(is)i(equiv)-5 b(alen)m(t)1110 | |
| 1c72c0cd | 11051 | 518 y(to)33 b Fs(emacs-standard)p Ft(.)41 b(The)31 b(default)h(v)-5 |
| 37c41ab1 | 11052 | b(alue)32 b(is)g Fs(emacs)p Ft(.)44 b(The)31 b(v)-5 b(alue)33 |
| 1c72c0cd CR |
11053 | b(of)f(the)1110 628 y Fs(editing-mode)27 b Ft(v)-5 b(ariable)31 |
| 11054 | b(also)h(a\013ects)f(the)g(default)f(k)m(eymap.)630 774 | |
| 11055 | y Fs(mark-directories)1110 883 y Ft(If)38 b(set)g(to)h(`)p | |
| 11056 | Fs(on)p Ft(',)i(completed)e(directory)f(names)g(ha)m(v)m(e)i(a)e(slash) | |
| 11057 | g(app)s(ended.)1110 993 y(The)30 b(default)g(is)h(`)p | |
| 11058 | Fs(on)p Ft('.)630 1139 y Fs(mark-modified-lines)1110 | |
| 11059 | 1249 y Ft(This)k(v)-5 b(ariable,)38 b(when)d(set)h(to)h(`)p | |
| 11060 | Fs(on)p Ft(',)g(causes)g(Readline)f(to)h(displa)m(y)f(an)f(as-)1110 | |
| 11061 | 1358 y(terisk)f(\(`)p Fs(*)p Ft('\))h(at)f(the)g(start)g(of)g(history)g | |
| 11062 | (lines)g(whic)m(h)f(ha)m(v)m(e)i(b)s(een)e(mo)s(di\014ed.)1110 | |
| 11063 | 1468 y(This)d(v)-5 b(ariable)31 b(is)f(`)p Fs(off)p Ft(')g(b)m(y)g | |
| 11064 | (default.)630 1614 y Fs(mark-symlinked-directori)o(es)1110 | |
| 11065 | 1724 y Ft(If)44 b(set)h(to)h(`)p Fs(on)p Ft(',)i(completed)e(names)f | |
| 11066 | (whic)m(h)f(are)h(sym)m(b)s(olic)g(links)g(to)g(di-)1110 | |
| 11067 | 1833 y(rectories)j(ha)m(v)m(e)f(a)g(slash)f(app)s(ended)e(\(sub)5 | |
| 11068 | b(ject)47 b(to)g(the)f(v)-5 b(alue)47 b(of)f Fs(mark-)1110 | |
| 11069 | 1943 y(directories)p Ft(\).)38 b(The)30 b(default)g(is)h(`)p | |
| 11070 | Fs(off)p Ft('.)630 2089 y Fs(match-hidden-files)1110 | |
| 11071 | 2198 y Ft(This)21 b(v)-5 b(ariable,)25 b(when)d(set)g(to)h(`)p | |
| 11072 | Fs(on)p Ft(',)h(causes)f(Readline)g(to)g(matc)m(h)g(\014les)f(whose) | |
| 11073 | 1110 2308 y(names)44 b(b)s(egin)g(with)g(a)g(`)p Fs(.)p | |
| 11074 | Ft(')g(\(hidden)f(\014les\))i(when)e(p)s(erforming)g(\014lename)1110 | |
| 11075 | 2418 y(completion,)j(unless)41 b(the)g(leading)h(`)p | |
| 11076 | Fs(.)p Ft(')g(is)g(supplied)e(b)m(y)h(the)h(user)f(in)g(the)1110 | |
| 11077 | 2527 y(\014lename)31 b(to)g(b)s(e)e(completed.)42 b(This)30 | |
| 37c41ab1 | 11078 | b(v)-5 b(ariable)31 b(is)f(`)p Fs(on)p Ft(')h(b)m(y)f(default.)630 |
| 1c72c0cd | 11079 | 2673 y Fs(output-meta)1110 2783 y Ft(If)35 b(set)h(to)g(`)p |
| 37c41ab1 | 11080 | Fs(on)p Ft(',)h(Readline)f(will)g(displa)m(y)f(c)m(haracters)i(with)e |
| 1c72c0cd | 11081 | (the)h(eigh)m(th)g(bit)1110 2892 y(set)h(directly)g(rather)f(than)g(as) |
| 5e13499c | 11082 | h(a)g(meta-pre\014xed)f(escap)s(e)h(sequence.)59 b(The)1110 |
| 1c72c0cd CR |
11083 | 3002 y(default)31 b(is)f(`)p Fs(off)p Ft('.)630 3148 |
| 11084 | y Fs(page-completions)1110 3258 y Ft(If)j(set)i(to)f(`)p | |
| 37c41ab1 CR |
11085 | Fs(on)p Ft(',)h(Readline)g(uses)e(an)h(in)m(ternal)h |
| 11086 | Fs(more)p Ft(-lik)m(e)f(pager)g(to)h(displa)m(y)1110 | |
| 1c72c0cd | 11087 | 3367 y(a)e(screenful)f(of)g(p)s(ossible)g(completions)i(at)f(a)g(time.) |
| 37c41ab1 | 11088 | 47 b(This)31 b(v)-5 b(ariable)34 b(is)e(`)p Fs(on)p Ft(')1110 |
| 1c72c0cd CR |
11089 | 3477 y(b)m(y)e(default.)630 3623 y Fs(print-completions-horizo)o(ntal)o |
| 11090 | (ly)1110 3733 y Ft(If)23 b(set)i(to)g(`)p Fs(on)p Ft(',)g(Readline)g | |
| 37c41ab1 | 11091 | (will)f(displa)m(y)g(completions)h(with)f(matc)m(hes)h(sorted)1110 |
| 1c72c0cd CR |
11092 | 3842 y(horizon)m(tally)45 b(in)e(alphab)s(etical)i(order,)i(rather)c |
| 11093 | (than)g(do)m(wn)g(the)h(screen.)1110 3952 y(The)30 b(default)g(is)h(`)p | |
| 11094 | Fs(off)p Ft('.)630 4098 y Fs(show-all-if-ambiguous)1110 | |
| 11095 | 4208 y Ft(This)e(alters)i(the)f(default)g(b)s(eha)m(vior)g(of)g(the)h | |
| 11096 | (completion)g(functions.)40 b(If)29 b(set)1110 4317 y(to)f(`)p | |
| 37c41ab1 | 11097 | Fs(on)p Ft(',)g(w)m(ords)f(whic)m(h)g(ha)m(v)m(e)i(more)f(than)f(one)h |
| 1c72c0cd | 11098 | (p)s(ossible)f(completion)h(cause)1110 4427 y(the)39 |
| 37c41ab1 | 11099 | b(matc)m(hes)h(to)g(b)s(e)e(listed)h(immediately)i(instead)e(of)g |
| 1c72c0cd CR |
11100 | (ringing)g(the)g(b)s(ell.)1110 4536 y(The)30 b(default)g(v)-5 |
| 11101 | b(alue)31 b(is)g(`)p Fs(off)p Ft('.)630 4682 y Fs | |
| 11102 | (show-all-if-unmodified)1110 4792 y Ft(This)38 b(alters)h(the)g | |
| 37c41ab1 | 11103 | (default)g(b)s(eha)m(vior)g(of)f(the)h(completion)h(functions)e(in)h(a) |
| 1c72c0cd | 11104 | 1110 4902 y(fashion)25 b(similar)h(to)g Fq(sho)m(w-all-if-am)m(biguous) |
| 37c41ab1 | 11105 | p Ft(.)41 b(If)25 b(set)h(to)h(`)p Fs(on)p Ft(',)f(w)m(ords)f(whic)m(h) |
| 1c72c0cd | 11106 | 1110 5011 y(ha)m(v)m(e)32 b(more)f(than)f(one)i(p)s(ossible)e |
| 37c41ab1 | 11107 | (completion)i(without)f(an)m(y)g(p)s(ossible)f(par-)1110 |
| 1c72c0cd CR |
11108 | 5121 y(tial)43 b(completion)h(\(the)f(p)s(ossible)f(completions)h |
| 11109 | (don't)f(share)g(a)h(common)1110 5230 y(pre\014x\))30 | |
| 37c41ab1 | 11110 | b(cause)g(the)h(matc)m(hes)g(to)g(b)s(e)f(listed)g(immediately)i |
| 1c72c0cd | 11111 | (instead)e(of)h(ring-)1110 5340 y(ing)g(the)f(b)s(ell.)41 |
| 37c41ab1 | 11112 | b(The)30 b(default)g(v)-5 b(alue)31 b(is)f(`)p Fs(off)p |
| 1c72c0cd | 11113 | Ft('.)p eop end |
| 28157acd CR |
11114 | %%Page: 96 102 |
| 11115 | TeXDict begin 96 101 bop 150 -116 a Ft(96)2572 b(Bash)31 | |
| 1c72c0cd CR |
11116 | b(Reference)g(Man)m(ual)630 299 y Fs(visible-stats)1110 |
| 11117 | 408 y Ft(If)g(set)i(to)f(`)p Fs(on)p Ft(',)h(a)f(c)m(haracter)i | |
| 11118 | (denoting)e(a)g(\014le's)g(t)m(yp)s(e)g(is)g(app)s(ended)e(to)j(the) | |
| 11119 | 1110 518 y(\014lename)e(when)e(listing)i(p)s(ossible)f(completions.)42 | |
| 28157acd CR |
11120 | b(The)30 b(default)g(is)h(`)p Fs(off)p Ft('.)150 669 |
| 11121 | y(Key)f(Bindings)630 778 y(The)41 b(syn)m(tax)i(for)f(con)m(trolling)h | |
| 1c72c0cd | 11122 | (k)m(ey)g(bindings)e(in)h(the)g(init)g(\014le)g(is)g(simple.)75 |
| 28157acd | 11123 | b(First)43 b(y)m(ou)630 888 y(need)27 b(to)i(\014nd)d(the)i(name)f(of)h |
| 1c72c0cd | 11124 | (the)g(command)f(that)i(y)m(ou)f(w)m(an)m(t)g(to)g(c)m(hange.)41 |
| 28157acd | 11125 | b(The)27 b(follo)m(wing)630 998 y(sections)37 b(con)m(tain)g(tables)g |
| 37c41ab1 | 11126 | (of)f(the)g(command)f(name,)j(the)e(default)g(k)m(eybinding,)h(if)f(an) |
| 28157acd CR |
11127 | m(y)-8 b(,)630 1107 y(and)30 b(a)h(short)f(description)g(of)h(what)f |
| 11128 | (the)g(command)h(do)s(es.)630 1237 y(Once)36 b(y)m(ou)g(kno)m(w)g(the)g | |
| 37c41ab1 | 11129 | (name)g(of)g(the)g(command,)h(simply)f(place)h(on)e(a)i(line)f(in)g |
| 28157acd | 11130 | (the)g(init)630 1347 y(\014le)e(the)g(name)f(of)h(the)g(k)m(ey)g(y)m |
| 1c72c0cd | 11131 | (ou)g(wish)f(to)h(bind)f(the)h(command)f(to,)i(a)f(colon,)i(and)d(then) |
| 28157acd CR |
11132 | 630 1456 y(the)f(name)g(of)g(the)g(command.)46 b(The)31 |
| 11133 | b(name)h(of)g(the)g(k)m(ey)h(can)f(b)s(e)f(expressed)h(in)f(di\013eren) | |
| 11134 | m(t)630 1566 y(w)m(a)m(ys,)g(dep)s(ending)e(on)i(what)f(y)m(ou)h | |
| 11135 | (\014nd)d(most)j(comfortable.)630 1696 y(In)k(addition)h(to)h(command)f | |
| 11136 | (names,)i(readline)e(allo)m(ws)h(k)m(eys)g(to)g(b)s(e)e(b)s(ound)f(to)j | |
| 11137 | (a)f(string)630 1806 y(that)31 b(is)f(inserted)h(when)e(the)i(k)m(ey)g | |
| 11138 | (is)f(pressed)g(\(a)h Fq(macro)5 b Ft(\).)630 1936 y(The)42 | |
| 11139 | b Fs(bind)30 b(-p)42 b Ft(command)h(displa)m(ys)g(Readline)g(function)g | |
| 11140 | (names)g(and)f(bindings)g(in)h(a)630 2045 y(format)37 | |
| 11141 | b(that)h(can)f(put)f(directly)i(in)m(to)g(an)f(initialization)j | |
| 11142 | (\014le.)60 b(See)38 b(Section)f(4.2)i([Bash)630 2155 | |
| 11143 | y(Builtins],)31 b(page)g(41.)630 2306 y Fq(k)m(eyname)5 | |
| 11144 | b Ft(:)42 b Fq(function-name)35 b Ft(or)c Fq(macro)1110 | |
| 11145 | 2415 y(k)m(eyname)k Ft(is)29 b(the)f(name)h(of)g(a)g(k)m(ey)h(sp)s | |
| 11146 | (elled)e(out)h(in)g(English.)39 b(F)-8 b(or)30 b(example:)1350 | |
| 11147 | 2545 y Fs(Control-u:)45 b(universal-argument)1350 2655 | |
| 11148 | y(Meta-Rubout:)f(backward-kill-word)1350 2765 y(Control-o:)h(">)i | |
| 11149 | (output")1110 2895 y Ft(In)38 b(the)h(ab)s(o)m(v)m(e)h(example,)h | |
| 11150 | Fj(C-u)d Ft(is)h(b)s(ound)d(to)k(the)e(function)h Fs(universal-)1110 | |
| 11151 | 3004 y(argument)p Ft(,)f Fj(M-DEL)e Ft(is)i(b)s(ound)e(to)i(the)g | |
| 11152 | (function)g Fs(backward-kill-word)p Ft(,)1110 3114 y(and)g | |
| 11153 | Fj(C-o)g Ft(is)h(b)s(ound)e(to)j(run)d(the)j(macro)f(expressed)g(on)f | |
| 11154 | (the)i(righ)m(t)f(hand)1110 3224 y(side)30 b(\(that)i(is,)e(to)h | |
| 11155 | (insert)g(the)f(text)i(`)p Fs(>)e(output)p Ft(')f(in)m(to)i(the)g | |
| 11156 | (line\).)1110 3354 y(A)37 b(n)m(um)m(b)s(er)f(of)h(sym)m(b)s(olic)g(c)m | |
| 11157 | (haracter)i(names)e(are)g(recognized)h(while)f(pro-)1110 | |
| 11158 | 3463 y(cessing)24 b(this)g(k)m(ey)g(binding)f(syn)m(tax:)37 | |
| 11159 | b Fq(DEL)p Ft(,)24 b Fq(ESC)p Ft(,)f Fq(ESCAPE)p Ft(,)g | |
| 11160 | Fq(LFD)p Ft(,)h Fq(NEW-)1110 3573 y(LINE)p Ft(,)30 b | |
| 11161 | Fq(RET)p Ft(,)g Fq(RETURN)p Ft(,)h Fq(R)m(UBOUT)p Ft(,)g | |
| 11162 | Fq(SP)-8 b(A)m(CE)p Ft(,)30 b Fq(SPC)p Ft(,)g(and)f Fq(T)-8 | |
| 11163 | b(AB)p Ft(.)630 3724 y Fs(")p Fq(k)m(eyseq)r Fs(")p Ft(:)41 | |
| 11164 | b Fq(function-name)36 b Ft(or)30 b Fq(macro)1110 3833 | |
| 37c41ab1 CR |
11165 | y(k)m(eyseq)k Ft(di\013ers)d(from)f Fq(k)m(eyname)37 |
| 11166 | b Ft(ab)s(o)m(v)m(e)32 b(in)f(that)h(strings)f(denoting)g(an)g(en-)1110 | |
| 28157acd CR |
11167 | 3943 y(tire)j(k)m(ey)h(sequence)f(can)g(b)s(e)f(sp)s(eci\014ed,)h(b)m |
| 11168 | (y)f(placing)i(the)f(k)m(ey)g(sequence)g(in)1110 4052 | |
| 37c41ab1 | 11169 | y(double)29 b(quotes.)41 b(Some)29 b Fl(gnu)h Ft(Emacs)f(st)m(yle)i(k)m |
| 28157acd | 11170 | (ey)f(escap)s(es)g(can)g(b)s(e)f(used,)g(as)1110 4162 |
| 37c41ab1 | 11171 | y(in)k(the)h(follo)m(wing)i(example,)f(but)e(the)h(sp)s(ecial)h(c)m |
| 28157acd CR |
11172 | (haracter)g(names)f(are)g(not)1110 4271 y(recognized.)1350 |
| 11173 | 4402 y Fs("\\C-u":)46 b(universal-argument)1350 4511 | |
| 11174 | y("\\C-x\\C-r":)f(re-read-init-file)1350 4621 y("\\e[11~":)g("Function) | |
| 11175 | h(Key)g(1")1110 4751 y Ft(In)64 b(the)g(ab)s(o)m(v)m(e)i(example,)74 | |
| 37c41ab1 | 11176 | b Fj(C-u)64 b Ft(is)g(again)i(b)s(ound)c(to)k(the)e(function)1110 |
| 28157acd CR |
11177 | 4861 y Fs(universal-argument)39 b Ft(\(just)k(as)h(it)g(w)m(as)g(in)g |
| 11178 | (the)f(\014rst)g(example\),)49 b(`)p Fj(C-x)1110 4970 | |
| 37c41ab1 | 11179 | y(C-r)p Ft(')41 b(is)g(b)s(ound)e(to)j(the)f(function)g |
| 28157acd CR |
11180 | Fs(re-read-init-file)p Ft(,)e(and)i(`)3462 4967 y Fg(h)p |
| 11181 | 3486 4914 139 4 v 3486 4970 a Ff(ESC)p 3486 4985 V 3620 | |
| 11182 | 4967 a Fg(i)31 b(h)p 3705 4914 20 4 v 3705 4970 a Ff([)p | |
| 11183 | 3705 4987 V 3720 4967 a Fg(i)1110 5077 y(h)p 1134 5024 | |
| 11184 | 36 4 v 1134 5080 a Ff(1)p 1134 5095 V 1165 5077 a Fg(i)f(h)p | |
| 11185 | 1250 5024 V 1250 5080 a Ff(1)p 1250 5095 V 1281 5077 | |
| 11186 | a Fg(i)g(h)p 1365 5024 48 4 v 1365 5080 a Fs(~)p 1365 | |
| 11187 | 5095 V 1409 5077 a Fg(i)1438 5080 y Ft(')h(is)f(b)s(ound)f(to)i(insert) | |
| 11188 | f(the)h(text)g(`)p Fs(Function)d(Key)i(1)p Ft('.)630 | |
| 11189 | 5230 y(The)f(follo)m(wing)i Fl(gnu)f Ft(Emacs)g(st)m(yle)h(escap)s(e)f | |
| 11190 | (sequences)g(are)g(a)m(v)-5 b(ailable)32 b(when)d(sp)s(ecifying)630 | |
| 11191 | 5340 y(k)m(ey)i(sequences:)p eop end | |
| 11192 | %%Page: 97 103 | |
| 11193 | TeXDict begin 97 102 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11194 | b(Command)29 b(Line)i(Editing)2107 b(97)630 299 y Fj(\\C-)336 | |
| 11195 | b Ft(con)m(trol)32 b(pre\014x)630 447 y Fj(\\M-)336 b | |
| 11196 | Ft(meta)31 b(pre\014x)630 596 y Fj(\\e)384 b Ft(an)30 | |
| 11197 | b(escap)s(e)h(c)m(haracter)630 744 y Fj(\\\\)384 b Ft(bac)m(kslash)630 | |
| 11198 | 893 y Fj(\\)p Fs(")1110 890 y Fg(h)p 1134 837 48 4 v | |
| 11199 | 1134 893 a Fs(")p 1134 908 V 1178 890 a Fg(i)1208 893 | |
| 11200 | y Ft(,)30 b(a)h(double)f(quotation)h(mark)630 1041 y | |
| 11201 | Fj(\\')1110 1038 y Fg(h)p 1134 985 20 4 v 1134 1041 a | |
| 11202 | Ff(')p 1134 1057 V 1150 1038 a Fg(i)1179 1041 y Ft(,)g(a)g(single)g | |
| 11203 | (quote)g(or)f(ap)s(ostrophe)630 1190 y(In)d(addition)h(to)g(the)g | |
| eb2bb562 | 11204 | Fl(gnu)f Ft(Emacs)h(st)m(yle)h(escap)s(e)f(sequences,)h(a)f(second)f |
| 28157acd CR |
11205 | (set)h(of)g(bac)m(kslash)630 1300 y(escap)s(es)j(is)f(a)m(v)-5 |
| 11206 | b(ailable:)630 1448 y Fs(\\a)384 b Ft(alert)31 b(\(b)s(ell\))630 | |
| 11207 | 1597 y Fs(\\b)384 b Ft(bac)m(kspace)630 1745 y Fs(\\d)g | |
| 11208 | Ft(delete)630 1894 y Fs(\\f)g Ft(form)30 b(feed)630 2042 | |
| 11209 | y Fs(\\n)384 b Ft(newline)630 2191 y Fs(\\r)g Ft(carriage)32 | |
| 11210 | b(return)630 2339 y Fs(\\t)384 b Ft(horizon)m(tal)32 | |
| 11211 | b(tab)630 2488 y Fs(\\v)384 b Ft(v)m(ertical)32 b(tab)630 | |
| 11212 | 2636 y Fs(\\)p Fj(nnn)288 b Ft(the)35 b(eigh)m(t-bit)h(c)m(haracter)g | |
| eb2bb562 | 11213 | (whose)e(v)-5 b(alue)35 b(is)g(the)f(o)s(ctal)i(v)-5 |
| 28157acd CR |
11214 | b(alue)35 b Fq(nnn)e Ft(\(one)i(to)1110 2746 y(three)c(digits\))630 |
| 11215 | 2894 y Fs(\\x)p Fj(HH)288 b Ft(the)40 b(eigh)m(t-bit)h(c)m(haracter)g | |
| eb2bb562 | 11216 | (whose)e(v)-5 b(alue)39 b(is)h(the)f(hexadecimal)i(v)-5 |
| 28157acd CR |
11217 | b(alue)40 b Fq(HH)1110 3004 y Ft(\(one)31 b(or)f(t)m(w)m(o)i(hex)e |
| 11218 | (digits\))630 3152 y(When)37 b(en)m(tering)h(the)g(text)g(of)g(a)g | |
| eb2bb562 | 11219 | (macro,)i(single)e(or)f(double)g(quotes)h(m)m(ust)f(b)s(e)g(used)f(to) |
| 28157acd | 11220 | 630 3262 y(indicate)23 b(a)e(macro)h(de\014nition.)38 |
| eb2bb562 | 11221 | b(Unquoted)21 b(text)i(is)e(assumed)g(to)h(b)s(e)f(a)h(function)f |
| 28157acd | 11222 | (name.)38 b(In)630 3372 y(the)22 b(macro)f(b)s(o)s(dy)-8 |
| eb2bb562 | 11223 | b(,)23 b(the)e(bac)m(kslash)h(escap)s(es)g(describ)s(ed)e(ab)s(o)m(v)m |
| 28157acd | 11224 | (e)j(are)e(expanded.)37 b(Bac)m(kslash)630 3481 y(will)j(quote)h(an)m |
| eb2bb562 | 11225 | (y)f(other)g(c)m(haracter)i(in)d(the)i(macro)f(text,)k(including)39 |
| 37c41ab1 | 11226 | b(`)p Fs(")p Ft(')h(and)g(`)p Fs(')p Ft('.)69 b(F)-8 |
| 28157acd | 11227 | b(or)630 3591 y(example,)28 b(the)e(follo)m(wing)h(binding)d(will)i |
| 37c41ab1 | 11228 | (mak)m(e)h(`)p Fj(C-x)j Fs(\\)p Ft(')c(insert)f(a)h(single)h(`)p |
| 28157acd CR |
11229 | Fs(\\)p Ft(')f(in)m(to)g(the)g(line:)870 3720 y Fs("\\C-x\\\\":)45 |
| 11230 | b("\\\\")150 3928 y Fk(8.3.2)63 b(Conditional)41 b(Init)g(Constructs) | |
| 11231 | 275 4166 y Ft(Readline)36 b(implemen)m(ts)f(a)h(facilit)m(y)i(similar)d | |
| 37c41ab1 | 11232 | (in)g(spirit)g(to)h(the)g(conditional)h(compilation)g(features)150 |
| 28157acd | 11233 | 4276 y(of)e(the)f(C)g(prepro)s(cessor)g(whic)m(h)g(allo)m(ws)i(k)m(ey)f |
| 37c41ab1 | 11234 | (bindings)e(and)h(v)-5 b(ariable)35 b(settings)h(to)f(b)s(e)f(p)s |
| 28157acd | 11235 | (erformed)f(as)150 4385 y(the)e(result)f(of)g(tests.)42 |
| 37c41ab1 | 11236 | b(There)30 b(are)h(four)e(parser)h(directiv)m(es)i(used.)150 |
| 28157acd | 11237 | 4534 y Fs($if)336 b Ft(The)31 b Fs($if)f Ft(construct)i(allo)m(ws)h |
| 37c41ab1 | 11238 | (bindings)d(to)i(b)s(e)e(made)i(based)f(on)g(the)g(editing)h(mo)s(de,)g |
| 28157acd | 11239 | (the)630 4644 y(terminal)39 b(b)s(eing)e(used,)j(or)e(the)g |
| 37c41ab1 | 11240 | (application)h(using)f(Readline.)64 b(The)38 b(text)h(of)f(the)g(test) |
| 28157acd CR |
11241 | 630 4753 y(extends)30 b(to)h(the)g(end)f(of)g(the)h(line;)g(no)f(c)m |
| 11242 | (haracters)i(are)f(required)e(to)i(isolate)i(it.)630 | |
| 11243 | 4902 y Fs(mode)288 b Ft(The)20 b Fs(mode=)g Ft(form)g(of)h(the)g | |
| 11244 | Fs($if)f Ft(directiv)m(e)j(is)e(used)f(to)h(test)h(whether)e(Readline) | |
| 11245 | 1110 5011 y(is)29 b(in)h Fs(emacs)e Ft(or)h Fs(vi)g Ft(mo)s(de.)40 | |
| 11246 | b(This)29 b(ma)m(y)h(b)s(e)e(used)h(in)g(conjunction)h(with)f(the)1110 | |
| 11247 | 5121 y(`)p Fs(set)h(keymap)p Ft(')c(command,)i(for)f(instance,)i(to)f | |
| 11248 | (set)g(bindings)f(in)g(the)h Fs(emacs-)1110 5230 y(standard)23 | |
| 97db45b6 | 11249 | b Ft(and)h Fs(emacs-ctlx)f Ft(k)m(eymaps)i(only)g(if)g(Readline)h(is)f |
| 28157acd CR |
11250 | (starting)h(out)1110 5340 y(in)k Fs(emacs)f Ft(mo)s(de.)p |
| 11251 | eop end | |
| 11252 | %%Page: 98 104 | |
| 11253 | TeXDict begin 98 103 bop 150 -116 a Ft(98)2572 b(Bash)31 | |
| 11254 | b(Reference)g(Man)m(ual)630 299 y Fs(term)288 b Ft(The)26 | |
| 11255 | b Fs(term=)g Ft(form)g(ma)m(y)i(b)s(e)e(used)g(to)i(include)f | |
| 11256 | (terminal-sp)s(eci\014c)g(k)m(ey)h(bind-)1110 408 y(ings,)38 | |
| 11257 | b(p)s(erhaps)c(to)j(bind)e(the)h(k)m(ey)h(sequences)f(output)g(b)m(y)g | |
| 11258 | (the)g(terminal's)1110 518 y(function)24 b(k)m(eys.)39 | |
| 11259 | b(The)23 b(w)m(ord)h(on)f(the)i(righ)m(t)f(side)g(of)g(the)g(`)p | |
| 11260 | Fs(=)p Ft(')g(is)g(tested)h(against)1110 628 y(b)s(oth)k(the)h(full)g | |
| 11261 | (name)g(of)g(the)g(terminal)h(and)e(the)i(p)s(ortion)e(of)h(the)g | |
| 11262 | (terminal)1110 737 y(name)k(b)s(efore)f(the)g(\014rst)g(`)p | |
| 11263 | Fs(-)p Ft('.)50 b(This)33 b(allo)m(ws)i Fs(sun)e Ft(to)h(matc)m(h)g(b)s | |
| 11264 | (oth)f Fs(sun)g Ft(and)1110 847 y Fs(sun-cmd)p Ft(,)c(for)h(instance.) | |
| 11265 | 630 1006 y Fs(application)1110 1116 y Ft(The)21 b Fq(application)j | |
| 37c41ab1 | 11266 | Ft(construct)e(is)g(used)f(to)i(include)f(application-sp)s(eci\014c)h |
| 28157acd | 11267 | (set-)1110 1225 y(tings.)39 b(Eac)m(h)26 b(program)e(using)g(the)h |
| 37c41ab1 | 11268 | (Readline)g(library)g(sets)g(the)g Fq(application)1110 |
| 28157acd | 11269 | 1335 y(name)p Ft(,)g(and)e(y)m(ou)g(can)h(test)g(for)f(a)g(particular)h |
| 37c41ab1 | 11270 | (v)-5 b(alue.)39 b(This)22 b(could)h(b)s(e)g(used)f(to)1110 |
| 28157acd CR |
11271 | 1445 y(bind)32 b(k)m(ey)h(sequences)g(to)h(functions)e(useful)g(for)h |
| 11272 | (a)g(sp)s(eci\014c)f(program.)48 b(F)-8 b(or)1110 1554 | |
| 37c41ab1 | 11273 | y(instance,)35 b(the)e(follo)m(wing)h(command)f(adds)f(a)i(k)m(ey)f |
| 28157acd CR |
11274 | (sequence)h(that)f(quotes)1110 1664 y(the)e(curren)m(t)f(or)g(previous) |
| 11275 | g(w)m(ord)g(in)g(Bash:)1350 1798 y Fs($if)47 b(Bash)1350 | |
| 11276 | 1908 y(#)g(Quote)g(the)g(current)f(or)h(previous)e(word)1350 | |
| 11277 | 2017 y("\\C-xq":)h("\\eb\\"\\ef\\"")1350 2127 y($endif)150 | |
| 11278 | 2286 y($endif)192 b Ft(This)29 b(command,)i(as)f(seen)h(in)f(the)g | |
| 37c41ab1 | 11279 | (previous)g(example,)h(terminates)g(an)g Fs($if)e Ft(command.)150 |
| 28157acd | 11280 | 2446 y Fs($else)240 b Ft(Commands)29 b(in)h(this)h(branc)m(h)e(of)i |
| 37c41ab1 | 11281 | (the)f Fs($if)g Ft(directiv)m(e)i(are)f(executed)g(if)f(the)h(test)g |
| 28157acd | 11282 | (fails.)150 2605 y Fs($include)96 b Ft(This)43 b(directiv)m(e)i(tak)m |
| 37c41ab1 | 11283 | (es)g(a)e(single)i(\014lename)e(as)h(an)f(argumen)m(t)h(and)f(reads)g |
| 28157acd | 11284 | (commands)630 2715 y(and)38 b(bindings)f(from)h(that)i(\014le.)65 |
| 37c41ab1 | 11285 | b(F)-8 b(or)39 b(example,)j(the)d(follo)m(wing)h(directiv)m(e)g(reads)e |
| 28157acd CR |
11286 | (from)630 2824 y(`)p Fs(/etc/inputrc)p Ft(':)870 2959 |
| 11287 | y Fs($include)46 b(/etc/inputrc)150 3183 y Fk(8.3.3)63 | |
| 11288 | b(Sample)41 b(Init)g(File)275 3427 y Ft(Here)31 b(is)f(an)g(example)i | |
| 37c41ab1 CR |
11289 | (of)e(an)g Fq(inputrc)35 b Ft(\014le.)42 b(This)29 b(illustrates)j(k)m |
| 11290 | (ey)f(binding,)f(v)-5 b(ariable)31 b(assignmen)m(t,)150 | |
| 28157acd CR |
11291 | 3537 y(and)f(conditional)h(syn)m(tax.)p eop end |
| 11292 | %%Page: 99 105 | |
| 11293 | TeXDict begin 99 104 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11294 | b(Command)29 b(Line)i(Editing)2107 b(99)390 408 y Fs(#)47 | |
| 37c41ab1 CR |
11295 | b(This)g(file)g(controls)e(the)i(behaviour)e(of)j(line)e(input)h |
| 11296 | (editing)e(for)390 518 y(#)i(programs)f(that)h(use)g(the)f(GNU)h | |
| 11297 | (Readline)f(library.)93 b(Existing)390 628 y(#)47 b(programs)f(include) | |
| 11298 | g(FTP,)g(Bash,)h(and)g(GDB.)390 737 y(#)390 847 y(#)g(You)g(can)g | |
| 11299 | (re-read)f(the)h(inputrc)f(file)g(with)h(C-x)g(C-r.)390 | |
| 11300 | 956 y(#)g(Lines)g(beginning)e(with)i('#')g(are)g(comments.)390 | |
| 11301 | 1066 y(#)390 1176 y(#)g(First,)g(include)e(any)i(systemwide)e(bindings) | |
| 11302 | h(and)h(variable)390 1285 y(#)g(assignments)e(from)i(/etc/Inputrc)390 | |
| 11303 | 1395 y($include)f(/etc/Inputrc)390 1614 y(#)390 1724 | |
| 11304 | y(#)h(Set)g(various)f(bindings)g(for)h(emacs)f(mode.)390 | |
| 11305 | 1943 y(set)h(editing-mode)d(emacs)390 2162 y($if)j(mode=emacs)390 | |
| 5e13499c CR |
11306 | 2381 y(Meta-Control-h:)91 b(backward-kill-word)43 b(Text)k(after)f(the) |
| 11307 | h(function)f(name)g(is)h(ignored)390 2600 y(#)390 2710 | |
| 11308 | y(#)g(Arrow)g(keys)f(in)i(keypad)e(mode)390 2819 y(#)390 | |
| 11309 | 2929 y(#"\\M-OD":)379 b(backward-char)390 3039 y(#"\\M-OC":)g | |
| 11310 | (forward-char)390 3148 y(#"\\M-OA":)g(previous-history)390 | |
| 11311 | 3258 y(#"\\M-OB":)g(next-history)390 3367 y(#)390 3477 | |
| 11312 | y(#)47 b(Arrow)g(keys)f(in)i(ANSI)e(mode)390 3587 y(#)390 | |
| 11313 | 3696 y("\\M-[D":)380 b(backward-char)390 3806 y("\\M-[C":)g | |
| 11314 | (forward-char)390 3915 y("\\M-[A":)g(previous-history)390 | |
| 11315 | 4025 y("\\M-[B":)g(next-history)390 4134 y(#)390 4244 | |
| 11316 | y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(keypad)f(mode)390 | |
| 11317 | 4354 y(#)390 4463 y(#"\\M-\\C-OD":)331 b(backward-char)390 | |
| 11318 | 4573 y(#"\\M-\\C-OC":)g(forward-char)390 4682 y(#"\\M-\\C-OA":)g | |
| 11319 | (previous-history)390 4792 y(#"\\M-\\C-OB":)g(next-history)390 | |
| 11320 | 4902 y(#)390 5011 y(#)47 b(Arrow)g(keys)f(in)i(8)f(bit)g(ANSI)g(mode) | |
| 11321 | 390 5121 y(#)390 5230 y(#"\\M-\\C-[D":)331 b(backward-char)390 | |
| 37c41ab1 | 11322 | 5340 y(#"\\M-\\C-[C":)g(forward-char)p eop end |
| 28157acd CR |
11323 | %%Page: 100 106 |
| 11324 | TeXDict begin 100 105 bop 150 -116 a Ft(100)2527 b(Bash)31 | |
| 37c41ab1 CR |
11325 | b(Reference)g(Man)m(ual)390 299 y Fs(#"\\M-\\C-[A":)331 |
| 11326 | b(previous-history)390 408 y(#"\\M-\\C-[B":)g(next-history)390 | |
| 11327 | 628 y(C-q:)47 b(quoted-insert)390 847 y($endif)390 1066 | |
| 11328 | y(#)g(An)h(old-style)d(binding.)93 b(This)47 b(happens)f(to)h(be)g(the) | |
| 11329 | g(default.)390 1176 y(TAB:)g(complete)390 1395 y(#)g(Macros)g(that)f | |
| 11330 | (are)h(convenient)e(for)i(shell)f(interaction)390 1504 | |
| 11331 | y($if)h(Bash)390 1614 y(#)g(edit)g(the)g(path)390 1724 | |
| 11332 | y("\\C-xp":)f("PATH=${PATH}\\e\\C-e\\C-a)o(\\ef)o(\\C-f)o(")390 | |
| 11333 | 1833 y(#)h(prepare)f(to)h(type)g(a)h(quoted)e(word)g(--)390 | |
| 5e13499c CR |
11334 | 1943 y(#)h(insert)g(open)f(and)h(close)f(double)h(quotes)390 |
| 11335 | 2052 y(#)g(and)g(move)g(to)g(just)g(after)f(the)h(open)g(quote)390 | |
| 11336 | 2162 y("\\C-x\\"":)e("\\"\\"\\C-b")390 2271 y(#)i(insert)g(a)g | |
| 11337 | (backslash)e(\(testing)h(backslash)f(escapes)390 2381 | |
| 11338 | y(#)i(in)h(sequences)d(and)i(macros\))390 2491 y("\\C-x\\\\":)e("\\\\") | |
| 11339 | 390 2600 y(#)i(Quote)g(the)g(current)f(or)h(previous)e(word)390 | |
| 11340 | 2710 y("\\C-xq":)h("\\eb\\"\\ef\\"")390 2819 y(#)h(Add)g(a)h(binding)e | |
| 11341 | (to)h(refresh)f(the)h(line,)f(which)g(is)h(unbound)390 | |
| 11342 | 2929 y("\\C-xr":)f(redraw-current-line)390 3039 y(#)h(Edit)g(variable)f | |
| 11343 | (on)h(current)f(line.)390 3148 y("\\M-\\C-v":)f | |
| 11344 | ("\\C-a\\C-k$\\C-y\\M-\\C-e\\C-)o(a\\C-)o(y=")390 3258 | |
| 11345 | y($endif)390 3477 y(#)i(use)g(a)h(visible)e(bell)g(if)h(one)g(is)h | |
| 11346 | (available)390 3587 y(set)f(bell-style)e(visible)390 | |
| 11347 | 3806 y(#)i(don't)g(strip)f(characters)f(to)i(7)h(bits)e(when)h(reading) | |
| 11348 | 390 3915 y(set)g(input-meta)e(on)390 4134 y(#)i(allow)g(iso-latin1)e | |
| 11349 | (characters)g(to)i(be)g(inserted)f(rather)390 4244 y(#)h(than)g | |
| 11350 | (converted)e(to)j(prefix-meta)c(sequences)390 4354 y(set)j | |
| 11351 | (convert-meta)d(off)390 4573 y(#)j(display)f(characters)f(with)i(the)g | |
| 11352 | (eighth)f(bit)h(set)g(directly)390 4682 y(#)g(rather)g(than)f(as)h | |
| 11353 | (meta-prefixed)e(characters)390 4792 y(set)i(output-meta)e(on)390 | |
| 11354 | 5011 y(#)i(if)h(there)e(are)h(more)g(than)f(150)h(possible)f | |
| 11355 | (completions)e(for)390 5121 y(#)j(a)h(word,)e(ask)h(the)g(user)g(if)g | |
| 11356 | (he)g(wants)f(to)i(see)f(all)f(of)i(them)390 5230 y(set)f | |
| 37c41ab1 | 11357 | (completion-query-items)42 b(150)p eop end |
| 28157acd CR |
11358 | %%Page: 101 107 |
| 11359 | TeXDict begin 101 106 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11360 | b(Command)29 b(Line)i(Editing)2062 b(101)390 299 y Fs(#)47 | |
| 37c41ab1 | 11361 | b(For)g(FTP)390 408 y($if)g(Ftp)390 518 y("\\C-xg":)f("get)g(\\M-?")390 |
| 5e13499c CR |
11362 | 628 y("\\C-xt":)g("put)g(\\M-?")390 737 y("\\M-.":)g(yank-last-arg)390 |
| 11363 | 847 y($endif)150 1086 y Fr(8.4)68 b(Bindable)45 b(Readline)i(Commands) | |
| 37c41ab1 | 11364 | 275 1323 y Ft(This)34 b(section)j(describ)s(es)e(Readline)h(commands)g |
| 5e13499c | 11365 | (that)g(ma)m(y)g(b)s(e)f(b)s(ound)f(to)i(k)m(ey)h(sequences.)56 |
| 37c41ab1 CR |
11366 | b(Y)-8 b(ou)150 1433 y(can)29 b(list)g(y)m(our)g(k)m(ey)g(bindings)f(b) |
| 11367 | m(y)h(executing)g Fs(bind)h(-P)e Ft(or,)h(for)g(a)g(more)f(terse)i | |
| 11368 | (format,)f(suitable)h(for)e(an)150 1543 y Fq(inputrc)34 | |
| 11369 | b Ft(\014le,)29 b Fs(bind)g(-p)p Ft(.)40 b(\(See)30 b(Section)f(4.2)h | |
| ac18b312 | 11370 | ([Bash)g(Builtins],)g(page)g(41.\))41 b(Command)28 b(names)h(without) |
| 37c41ab1 CR |
11371 | 150 1652 y(an)h(accompan)m(ying)i(k)m(ey)f(sequence)g(are)g(un)m(b)s |
| 11372 | (ound)d(b)m(y)i(default.)275 1780 y(In)25 b(the)h(follo)m(wing)i | |
| 11373 | (descriptions,)f Fq(p)s(oin)m(t)h Ft(refers)e(to)h(the)f(curren)m(t)g | |
| 11374 | (cursor)g(p)s(osition,)h(and)f Fq(mark)31 b Ft(refers)150 | |
| 11375 | 1890 y(to)40 b(a)f(cursor)f(p)s(osition)h(sa)m(v)m(ed)h(b)m(y)f(the)g | |
| 5e13499c | 11376 | Fs(set-mark)d Ft(command.)66 b(The)38 b(text)i(b)s(et)m(w)m(een)g(the)f |
| 37c41ab1 CR |
11377 | (p)s(oin)m(t)g(and)150 2000 y(mark)30 b(is)h(referred)e(to)i(as)g(the)f |
| 11378 | Fq(region)p Ft(.)150 2205 y Fk(8.4.1)63 b(Commands)42 | |
| 5e13499c CR |
11379 | b(F)-10 b(or)41 b(Mo)m(ving)150 2443 y Fs(beginning-of-line)26 |
| 11380 | b(\(C-a\))630 2553 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(start)h(of)g(the)f | |
| 11381 | (curren)m(t)g(line.)150 2700 y Fs(end-of-line)d(\(C-e\))630 | |
| 11382 | 2809 y Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(line.)150 | |
| 11383 | 2956 y Fs(forward-char)c(\(C-f\))630 3066 y Ft(Mo)m(v)m(e)32 | |
| 11384 | b(forw)m(ard)e(a)h(c)m(haracter.)150 3213 y Fs(backward-char)c(\(C-b\)) | |
| 11385 | 630 3322 y Ft(Mo)m(v)m(e)32 b(bac)m(k)g(a)e(c)m(haracter.)150 | |
| 11386 | 3469 y Fs(forward-word)d(\(M-f\))630 3579 y Ft(Mo)m(v)m(e)32 | |
| 11387 | b(forw)m(ard)e(to)h(the)f(end)g(of)g(the)h(next)f(w)m(ord.)41 | |
| 37c41ab1 CR |
11388 | b(W)-8 b(ords)30 b(are)h(comp)s(osed)f(of)g(letters)i(and)630 |
| 11389 | 3689 y(digits.)150 3835 y Fs(backward-word)27 b(\(M-b\))630 | |
| 5e13499c | 11390 | 3945 y Ft(Mo)m(v)m(e)36 b(bac)m(k)e(to)g(the)g(start)g(of)g(the)g |
| 37c41ab1 CR |
11391 | (curren)m(t)f(or)g(previous)g(w)m(ord.)50 b(W)-8 b(ords)34 |
| 11392 | b(are)g(comp)s(osed)630 4055 y(of)d(letters)g(and)f(digits.)150 | |
| 11393 | 4202 y Fs(clear-screen)d(\(C-l\))630 4311 y Ft(Clear)g(the)g(screen)f | |
| 11394 | (and)h(redra)m(w)f(the)h(curren)m(t)f(line,)i(lea)m(ving)g(the)f | |
| 11395 | (curren)m(t)g(line)g(at)g(the)g(top)630 4421 y(of)k(the)f(screen.)150 | |
| 5e13499c | 11396 | 4568 y Fs(redraw-current-line)25 b(\(\))630 4677 y Ft(Refresh)30 |
| 37c41ab1 CR |
11397 | b(the)g(curren)m(t)h(line.)41 b(By)30 b(default,)h(this)f(is)h(un)m(b)s |
| 11398 | (ound.)150 4883 y Fk(8.4.2)63 b(Commands)42 b(F)-10 b(or)41 | |
| 5e13499c | 11399 | b(Manipulating)h(The)f(History)150 5121 y Fs(accept-line)27 |
| 37c41ab1 CR |
11400 | b(\(Newline)h(or)i(Return\))630 5230 y Ft(Accept)25 b(the)e(line)h |
| 11401 | (regardless)g(of)f(where)g(the)h(cursor)e(is.)39 b(If)23 | |
| 11402 | b(this)g(line)h(is)f(non-empt)m(y)-8 b(,)26 b(add)c(it)630 | |
| 11403 | 5340 y(to)27 b(the)f(history)g(list)h(according)g(to)g(the)f(setting)i | |
| 11404 | (of)e(the)g Fs(HISTCONTROL)d Ft(and)j Fs(HISTIGNORE)p | |
| 11405 | eop end | |
| 28157acd CR |
11406 | %%Page: 102 108 |
| 11407 | TeXDict begin 102 107 bop 150 -116 a Ft(102)2527 b(Bash)31 | |
| 37c41ab1 CR |
11408 | b(Reference)g(Man)m(ual)630 299 y(v)-5 b(ariables.)42 |
| 11409 | b(If)30 b(this)h(line)g(is)g(a)g(mo)s(di\014ed)e(history)i(line,)g | |
| 11410 | (then)f(restore)i(the)f(history)f(line)h(to)630 408 y(its)g(original)g | |
| eb2bb562 CR |
11411 | (state.)150 555 y Fs(previous-history)26 b(\(C-p\))630 |
| 11412 | 664 y Ft(Mo)m(v)m(e)32 b(`bac)m(k')g(through)e(the)g(history)h(list,)g | |
| 11413 | (fetc)m(hing)g(the)g(previous)f(command.)150 810 y Fs(next-history)d | |
| 11414 | (\(C-n\))630 920 y Ft(Mo)m(v)m(e)32 b(`forw)m(ard')f(through)e(the)i | |
| 37c41ab1 | 11415 | (history)f(list,)i(fetc)m(hing)f(the)g(next)f(command.)150 |
| eb2bb562 | 11416 | 1066 y Fs(beginning-of-history)25 b(\(M-<\))630 1176 |
| 37c41ab1 | 11417 | y Ft(Mo)m(v)m(e)32 b(to)g(the)e(\014rst)g(line)g(in)h(the)f(history)-8 |
| eb2bb562 | 11418 | b(.)150 1322 y Fs(end-of-history)26 b(\(M->\))630 1431 |
| 37c41ab1 CR |
11419 | y Ft(Mo)m(v)m(e)32 b(to)g(the)e(end)g(of)g(the)h(input)e(history)-8 |
| 11420 | b(,)31 b(i.e.,)h(the)f(line)f(curren)m(tly)h(b)s(eing)f(en)m(tered.)150 | |
| eb2bb562 | 11421 | 1577 y Fs(reverse-search-history)24 b(\(C-r\))630 1687 |
| 37c41ab1 CR |
11422 | y Ft(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g(the)f(curren)m(t)g |
| 11423 | (line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g(his-)630 | |
| eb2bb562 CR |
11424 | 1797 y(tory)g(as)f(necessary)-8 b(.)42 b(This)29 b(is)i(an)f(incremen)m |
| 11425 | (tal)i(searc)m(h.)150 1943 y Fs(forward-search-history)24 | |
| 11426 | b(\(C-s\))630 2052 y Ft(Searc)m(h)30 b(forw)m(ard)f(starting)h(at)g | |
| 37c41ab1 | 11427 | (the)g(curren)m(t)f(line)h(and)f(mo)m(ving)h(`do)m(wn')f(through)g(the) |
| eb2bb562 CR |
11428 | h(the)630 2162 y(history)g(as)h(necessary)-8 b(.)41 b(This)30 |
| 11429 | b(is)g(an)h(incremen)m(tal)g(searc)m(h.)150 2308 y Fs | |
| 37c41ab1 | 11430 | (non-incremental-reverse-)o(sear)o(ch-h)o(ist)o(ory)24 |
| eb2bb562 | 11431 | b(\(M-p\))630 2418 y Ft(Searc)m(h)31 b(bac)m(kw)m(ard)h(starting)g(at)g |
| 37c41ab1 | 11432 | (the)f(curren)m(t)g(line)g(and)g(mo)m(ving)h(`up')e(through)h(the)g |
| eb2bb562 | 11433 | (his-)630 2527 y(tory)36 b(as)g(necessary)h(using)e(a)i(non-incremen)m |
| 37c41ab1 | 11434 | (tal)g(searc)m(h)f(for)g(a)g(string)g(supplied)f(b)m(y)h(the)630 |
| eb2bb562 CR |
11435 | 2637 y(user.)150 2783 y Fs(non-incremental-forward-)o(sear)o(ch-h)o |
| 11436 | (ist)o(ory)24 b(\(M-n\))630 2892 y Ft(Searc)m(h)30 b(forw)m(ard)f | |
| 37c41ab1 | 11437 | (starting)h(at)g(the)g(curren)m(t)f(line)h(and)f(mo)m(ving)h(`do)m(wn') |
| eb2bb562 | 11438 | f(through)g(the)h(the)630 3002 y(history)d(as)f(necessary)i(using)e(a)h |
| 37c41ab1 | 11439 | (non-incremen)m(tal)g(searc)m(h)h(for)e(a)h(string)g(supplied)e(b)m(y)i |
| eb2bb562 CR |
11440 | (the)630 3112 y(user.)150 3258 y Fs(history-search-forward)d(\(\))630 |
| 11441 | 3367 y Ft(Searc)m(h)42 b(forw)m(ard)f(through)f(the)i(history)f(for)g | |
| 37c41ab1 | 11442 | (the)h(string)f(of)h(c)m(haracters)h(b)s(et)m(w)m(een)f(the)630 |
| eb2bb562 | 11443 | 3477 y(start)36 b(of)f(the)g(curren)m(t)g(line)g(and)g(the)g(p)s(oin)m |
| 37c41ab1 | 11444 | (t.)55 b(This)34 b(is)i(a)f(non-incremen)m(tal)h(searc)m(h.)56 |
| eb2bb562 CR |
11445 | b(By)630 3587 y(default,)31 b(this)f(command)g(is)h(un)m(b)s(ound.)150 |
| 11446 | 3733 y Fs(history-search-backward)24 b(\(\))630 3842 | |
| 37c41ab1 CR |
11447 | y Ft(Searc)m(h)35 b(bac)m(kw)m(ard)g(through)f(the)h(history)g(for)g |
| 11448 | (the)f(string)h(of)g(c)m(haracters)h(b)s(et)m(w)m(een)g(the)630 | |
| eb2bb562 | 11449 | 3952 y(start)g(of)f(the)g(curren)m(t)g(line)g(and)g(the)g(p)s(oin)m(t.) |
| 37c41ab1 | 11450 | 55 b(This)34 b(is)i(a)f(non-incremen)m(tal)h(searc)m(h.)56 |
| eb2bb562 CR |
11451 | b(By)630 4061 y(default,)31 b(this)f(command)g(is)h(un)m(b)s(ound.)150 |
| 11452 | 4208 y Fs(yank-nth-arg)c(\(M-C-y\))630 4317 y Ft(Insert)37 | |
| 11453 | b(the)g(\014rst)f(argumen)m(t)i(to)f(the)h(previous)e(command)h | |
| 11454 | (\(usually)g(the)g(second)g(w)m(ord)630 4427 y(on)32 | |
| 11455 | b(the)g(previous)f(line\))i(at)f(p)s(oin)m(t.)46 b(With)32 | |
| 11456 | b(an)g(argumen)m(t)g Fq(n)p Ft(,)g(insert)g(the)g Fq(n)p | |
| 11457 | Ft(th)f(w)m(ord)g(from)630 4536 y(the)k(previous)f(command)h(\(the)g(w) | |
| 11458 | m(ords)g(in)f(the)h(previous)g(command)f(b)s(egin)h(with)f(w)m(ord)630 | |
| 11459 | 4646 y(0\).)69 b(A)40 b(negativ)m(e)h(argumen)m(t)f(inserts)g(the)f | |
| 11460 | Fq(n)p Ft(th)g(w)m(ord)g(from)g(the)h(end)f(of)h(the)f(previous)630 | |
| 11461 | 4755 y(command.)48 b(Once)33 b(the)g(argumen)m(t)h Fq(n)e | |
| 11462 | Ft(is)h(computed,)h(the)f(argumen)m(t)g(is)g(extracted)i(as)e(if)630 | |
| 11463 | 4865 y(the)e(`)p Fs(!)p Fj(n)11 b Ft(')29 b(history)i(expansion)f(had)g | |
| 11464 | (b)s(een)f(sp)s(eci\014ed.)150 5011 y Fs(yank-last-arg)e(\(M-.)i(or)h | |
| 11465 | (M-_\))630 5121 y Ft(Insert)k(last)i(argumen)m(t)g(to)g(the)f(previous) | |
| 11466 | f(command)h(\(the)h(last)f(w)m(ord)g(of)g(the)g(previous)630 | |
| 11467 | 5230 y(history)c(en)m(try\).)41 b(With)31 b(an)g(argumen)m(t,)g(b)s | |
| 11468 | (eha)m(v)m(e)g(exactly)i(lik)m(e)f Fs(yank-nth-arg)p | |
| 11469 | Ft(.)38 b(Succes-)630 5340 y(siv)m(e)d(calls)h(to)f Fs(yank-last-arg)c | |
| 11470 | Ft(mo)m(v)m(e)36 b(bac)m(k)g(through)d(the)i(history)g(list,)h | |
| 11471 | (inserting)f(the)p eop end | |
| 28157acd CR |
11472 | %%Page: 103 109 |
| 11473 | TeXDict begin 103 108 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11474 | b(Command)29 b(Line)i(Editing)2062 b(103)630 299 y(last)32 | |
| eb2bb562 CR |
11475 | b(argumen)m(t)f(of)g(eac)m(h)h(line)f(in)f(turn.)41 b(The)30 |
| 11476 | b(history)h(expansion)f(facilities)j(are)e(used)f(to)630 | |
| 11477 | 408 y(extract)i(the)e(last)i(argumen)m(t,)f(as)f(if)h(the)f(`)p | |
| 11478 | Fs(!$)p Ft(')g(history)h(expansion)f(had)g(b)s(een)f(sp)s(eci\014ed.) | |
| 11479 | 150 636 y Fk(8.4.3)63 b(Commands)42 b(F)-10 b(or)41 b(Changing)g(T)-10 | |
| 11480 | b(ext)150 881 y Fs(delete-char)27 b(\(C-d\))630 990 y | |
| 11481 | Ft(Delete)41 b(the)e(c)m(haracter)i(at)e(p)s(oin)m(t.)66 | |
| 11482 | b(If)39 b(p)s(oin)m(t)f(is)h(at)h(the)f(b)s(eginning)f(of)h(the)g | |
| 11483 | (line,)j(there)630 1100 y(are)37 b(no)g(c)m(haracters)i(in)d(the)i | |
| 11484 | (line,)h(and)d(the)h(last)h(c)m(haracter)h(t)m(yp)s(ed)e(w)m(as)g(not)g | |
| 11485 | (b)s(ound)e(to)630 1209 y Fs(delete-char)p Ft(,)28 b(then)i(return)f | |
| 11486 | Fl(eof)p Ft(.)150 1370 y Fs(backward-delete-char)c(\(Rubout\))630 | |
| 11487 | 1480 y Ft(Delete)32 b(the)f(c)m(haracter)g(b)s(ehind)e(the)h(cursor.)40 | |
| 37c41ab1 | 11488 | b(A)30 b(n)m(umeric)g(argumen)m(t)h(means)f(to)h(kill)g(the)630 |
| eb2bb562 CR |
11489 | 1590 y(c)m(haracters)h(instead)e(of)h(deleting)g(them.)150 |
| 11490 | 1751 y Fs(forward-backward-delete-)o(char)24 b(\(\))630 | |
| 11491 | 1860 y Ft(Delete)40 b(the)f(c)m(haracter)h(under)c(the)j(cursor,)h | |
| 37c41ab1 | 11492 | (unless)d(the)i(cursor)e(is)h(at)h(the)g(end)e(of)i(the)630 |
| eb2bb562 | 11493 | 1970 y(line,)33 b(in)e(whic)m(h)g(case)i(the)f(c)m(haracter)h(b)s |
| 37c41ab1 | 11494 | (ehind)d(the)i(cursor)f(is)g(deleted.)46 b(By)32 b(default,)g(this)630 |
| eb2bb562 CR |
11495 | 2079 y(is)e(not)h(b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 |
| 11496 | 2240 y Fs(quoted-insert)27 b(\(C-q)i(or)h(C-v\))630 2350 | |
| 37c41ab1 CR |
11497 | y Ft(Add)j(the)i(next)f(c)m(haracter)i(t)m(yp)s(ed)e(to)h(the)f(line)h |
| 11498 | (v)m(erbatim.)53 b(This)33 b(is)i(ho)m(w)f(to)h(insert)f(k)m(ey)630 | |
| eb2bb562 CR |
11499 | 2460 y(sequences)d(lik)m(e)g Fj(C-q)p Ft(,)f(for)g(example.)150 |
| 11500 | 2621 y Fs(self-insert)d(\(a,)j(b,)g(A,)f(1,)h(!,)g(...)o(\))630 | |
| 11501 | 2730 y Ft(Insert)g(y)m(ourself.)150 2891 y Fs(transpose-chars)c | |
| 11502 | (\(C-t\))630 3001 y Ft(Drag)33 b(the)f(c)m(haracter)h(b)s(efore)f(the)g | |
| 5e13499c | 11503 | (cursor)f(forw)m(ard)h(o)m(v)m(er)h(the)f(c)m(haracter)i(at)e(the)g |
| eb2bb562 | 11504 | (cursor,)630 3110 y(mo)m(ving)k(the)g(cursor)f(forw)m(ard)g(as)g(w)m |
| 37c41ab1 | 11505 | (ell.)57 b(If)35 b(the)h(insertion)g(p)s(oin)m(t)f(is)g(at)i(the)e(end) |
| eb2bb562 | 11506 | g(of)h(the)630 3220 y(line,)24 b(then)e(this)g(transp)s(oses)f(the)h |
| 37c41ab1 | 11507 | (last)h(t)m(w)m(o)g(c)m(haracters)g(of)f(the)h(line.)38 |
| eb2bb562 CR |
11508 | b(Negativ)m(e)25 b(argumen)m(ts)630 3330 y(ha)m(v)m(e)32 |
| 11509 | b(no)e(e\013ect.)150 3491 y Fs(transpose-words)c(\(M-t\))630 | |
| 11510 | 3600 y Ft(Drag)33 b(the)g(w)m(ord)f(b)s(efore)g(p)s(oin)m(t)g(past)g | |
| 37c41ab1 | 11511 | (the)h(w)m(ord)f(after)g(p)s(oin)m(t,)i(mo)m(ving)f(p)s(oin)m(t)f(past) |
| eb2bb562 | 11512 | g(that)630 3710 y(w)m(ord)c(as)h(w)m(ell.)41 b(If)27 |
| 37c41ab1 | 11513 | b(the)i(insertion)f(p)s(oin)m(t)h(is)f(at)h(the)g(end)e(of)i(the)f |
| eb2bb562 CR |
11514 | (line,)i(this)e(transp)s(oses)g(the)630 3819 y(last)j(t)m(w)m(o)h(w)m |
| 11515 | (ords)e(on)g(the)h(line.)150 3980 y Fs(upcase-word)c(\(M-u\))630 | |
| 11516 | 4090 y Ft(Upp)s(ercase)32 b(the)g(curren)m(t)g(\(or)g(follo)m(wing\))i | |
| 37c41ab1 | 11517 | (w)m(ord.)45 b(With)32 b(a)g(negativ)m(e)j(argumen)m(t,)e(upp)s(er-)630 |
| eb2bb562 CR |
11518 | 4199 y(case)e(the)g(previous)f(w)m(ord,)g(but)g(do)g(not)h(mo)m(v)m(e)h |
| 11519 | (the)e(cursor.)150 4360 y Fs(downcase-word)d(\(M-l\))630 | |
| 11520 | 4470 y Ft(Lo)m(w)m(ercase)c(the)f(curren)m(t)f(\(or)h(follo)m(wing\))i | |
| 37c41ab1 | 11521 | (w)m(ord.)37 b(With)22 b(a)g(negativ)m(e)i(argumen)m(t,)g(lo)m(w)m |
| eb2bb562 CR |
11522 | (ercase)630 4580 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f(mo)m |
| 11523 | (v)m(e)i(the)f(cursor.)150 4741 y Fs(capitalize-word)26 | |
| 11524 | b(\(M-c\))630 4850 y Ft(Capitalize)d(the)f(curren)m(t)f(\(or)g(follo)m | |
| 37c41ab1 | 11525 | (wing\))i(w)m(ord.)38 b(With)21 b(a)h(negativ)m(e)h(argumen)m(t,)h |
| eb2bb562 CR |
11526 | (capitalize)630 4960 y(the)31 b(previous)e(w)m(ord,)i(but)e(do)i(not)f |
| 11527 | (mo)m(v)m(e)i(the)f(cursor.)150 5121 y Fs(overwrite-mode)26 | |
| 11528 | b(\(\))630 5230 y Ft(T)-8 b(oggle)35 b(o)m(v)m(erwrite)g(mo)s(de.)48 | |
| 37c41ab1 | 11529 | b(With)33 b(an)g(explicit)h(p)s(ositiv)m(e)g(n)m(umeric)f(argumen)m(t,) |
| eb2bb562 | 11530 | h(switc)m(hes)630 5340 y(to)22 b(o)m(v)m(erwrite)i(mo)s(de.)37 |
| 37c41ab1 | 11531 | b(With)22 b(an)g(explicit)h(non-p)s(ositiv)m(e)f(n)m(umeric)g(argumen)m |
| eb2bb562 | 11532 | (t,)i(switc)m(hes)e(to)p eop end |
| 28157acd CR |
11533 | %%Page: 104 110 |
| 11534 | TeXDict begin 104 109 bop 150 -116 a Ft(104)2527 b(Bash)31 | |
| eb2bb562 CR |
11535 | b(Reference)g(Man)m(ual)630 299 y(insert)f(mo)s(de.)41 |
| 11536 | b(This)30 b(command)h(a\013ects)h(only)e Fs(emacs)f Ft(mo)s(de;)i | |
| 11537 | Fs(vi)f Ft(mo)s(de)g(do)s(es)g(o)m(v)m(erwrite)630 408 | |
| 11538 | y(di\013eren)m(tly)-8 b(.)42 b(Eac)m(h)31 b(call)h(to)f | |
| 11539 | Fs(readline\(\))c Ft(starts)k(in)f(insert)g(mo)s(de.)630 | |
| 11540 | 539 y(In)e(o)m(v)m(erwrite)j(mo)s(de,)e(c)m(haracters)i(b)s(ound)c(to)j | |
| 11541 | Fs(self-insert)c Ft(replace)k(the)g(text)g(at)g(p)s(oin)m(t)630 | |
| 11542 | 648 y(rather)41 b(than)h(pushing)e(the)i(text)g(to)g(the)g(righ)m(t.)75 | |
| 11543 | b(Characters)42 b(b)s(ound)d(to)j Fs(backward-)630 758 | |
| 11544 | y(delete-char)27 b Ft(replace)32 b(the)e(c)m(haracter)i(b)s(efore)e(p)s | |
| 11545 | (oin)m(t)h(with)f(a)g(space.)630 888 y(By)h(default,)f(this)h(command)f | |
| 11546 | (is)g(un)m(b)s(ound.)150 1099 y Fk(8.4.4)63 b(Killing)42 | |
| 11547 | b(And)e(Y)-10 b(anking)150 1339 y Fs(kill-line)28 b(\(C-k\))630 | |
| 11548 | 1449 y Ft(Kill)j(the)f(text)i(from)e(p)s(oin)m(t)g(to)h(the)g(end)e(of) | |
| 11549 | i(the)f(line.)150 1599 y Fs(backward-kill-line)25 b(\(C-x)30 | |
| 11550 | b(Rubout\))630 1709 y Ft(Kill)h(bac)m(kw)m(ard)g(to)g(the)f(b)s | |
| 11551 | (eginning)g(of)g(the)h(line.)150 1860 y Fs(unix-line-discard)26 | |
| 11552 | b(\(C-u\))630 1969 y Ft(Kill)31 b(bac)m(kw)m(ard)g(from)e(the)i(cursor) | |
| 11553 | f(to)h(the)f(b)s(eginning)g(of)h(the)f(curren)m(t)g(line.)150 | |
| 11554 | 2120 y Fs(kill-whole-line)c(\(\))630 2230 y Ft(Kill)37 | |
| 11555 | b(all)g(c)m(haracters)h(on)f(the)f(curren)m(t)h(line,)h(no)f(matter)g | |
| 11556 | (where)f(p)s(oin)m(t)h(is.)59 b(By)36 b(default,)630 | |
| 11557 | 2339 y(this)30 b(is)h(un)m(b)s(ound.)150 2490 y Fs(kill-word)d(\(M-d\)) | |
| 11558 | 630 2600 y Ft(Kill)i(from)f(p)s(oin)m(t)g(to)h(the)g(end)e(of)i(the)f | |
| 37c41ab1 | 11559 | (curren)m(t)h(w)m(ord,)f(or)g(if)h(b)s(et)m(w)m(een)g(w)m(ords,)f(to)h |
| eb2bb562 | 11560 | (the)g(end)630 2709 y(of)h(the)f(next)h(w)m(ord.)40 b(W)-8 |
| 37c41ab1 | 11561 | b(ord)31 b(b)s(oundaries)e(are)h(the)h(same)g(as)f Fs(forward-word)p |
| eb2bb562 CR |
11562 | Ft(.)150 2860 y Fs(backward-kill-word)25 b(\(M-)1183 |
| 11563 | 2857 y Fg(h)p 1207 2804 146 4 v 1207 2860 a Ff(DEL)p | |
| 11564 | 1207 2875 V 1348 2857 a Fg(i)1378 2860 y Fs(\))630 2970 | |
| 37c41ab1 CR |
11565 | y Ft(Kill)k(the)g(w)m(ord)g(b)s(ehind)e(p)s(oin)m(t.)40 |
| 11566 | b(W)-8 b(ord)29 b(b)s(oundaries)f(are)h(the)g(same)g(as)g | |
| eb2bb562 CR |
11567 | Fs(backward-word)p Ft(.)150 3120 y Fs(unix-word-rubout)d(\(C-w\))630 |
| 11568 | 3230 y Ft(Kill)32 b(the)g(w)m(ord)f(b)s(ehind)f(p)s(oin)m(t,)i(using)f | |
| 37c41ab1 | 11569 | (white)h(space)g(as)g(a)g(w)m(ord)f(b)s(oundary)-8 b(.)43 |
| eb2bb562 CR |
11570 | b(The)31 b(killed)630 3339 y(text)g(is)g(sa)m(v)m(ed)g(on)g(the)f |
| 11571 | (kill-ring.)150 3490 y Fs(unix-filename-rubout)25 b(\(\))630 | |
| 11572 | 3600 y Ft(Kill)37 b(the)f(w)m(ord)g(b)s(ehind)f(p)s(oin)m(t,)j(using)e | |
| 37c41ab1 | 11573 | (white)g(space)h(and)f(the)g(slash)g(c)m(haracter)i(as)f(the)630 |
| eb2bb562 CR |
11574 | 3709 y(w)m(ord)30 b(b)s(oundaries.)39 b(The)30 b(killed)h(text)g(is)g |
| 11575 | (sa)m(v)m(ed)g(on)g(the)f(kill-ring.)150 3860 y Fs | |
| 11576 | (delete-horizontal-space)24 b(\(\))630 3970 y Ft(Delete)33 | |
| 37c41ab1 | 11577 | b(all)e(spaces)g(and)e(tabs)i(around)e(p)s(oin)m(t.)41 |
| eb2bb562 CR |
11578 | b(By)31 b(default,)f(this)h(is)f(un)m(b)s(ound.)150 4121 |
| 11579 | y Fs(kill-region)d(\(\))630 4230 y Ft(Kill)k(the)f(text)i(in)e(the)g | |
| 37c41ab1 | 11580 | (curren)m(t)h(region.)41 b(By)31 b(default,)f(this)h(command)f(is)g(un) |
| eb2bb562 CR |
11581 | m(b)s(ound.)150 4381 y Fs(copy-region-as-kill)25 b(\(\))630 |
| 11582 | 4490 y Ft(Cop)m(y)34 b(the)g(text)h(in)f(the)g(region)g(to)h(the)f | |
| 37c41ab1 | 11583 | (kill)h(bu\013er,)f(so)g(it)h(can)f(b)s(e)f(y)m(ank)m(ed)i(righ)m(t)f |
| eb2bb562 CR |
11584 | (a)m(w)m(a)m(y)-8 b(.)630 4600 y(By)31 b(default,)f(this)h(command)f |
| 11585 | (is)g(un)m(b)s(ound.)150 4751 y Fs(copy-backward-word)25 | |
| 11586 | b(\(\))630 4860 y Ft(Cop)m(y)38 b(the)h(w)m(ord)f(b)s(efore)g(p)s(oin)m | |
| 37c41ab1 | 11587 | (t)g(to)i(the)e(kill)h(bu\013er.)64 b(The)38 b(w)m(ord)g(b)s(oundaries) |
| eb2bb562 | 11588 | f(are)i(the)630 4970 y(same)31 b(as)f Fs(backward-word)p |
| 37c41ab1 CR |
11589 | Ft(.)38 b(By)30 b(default,)h(this)f(command)g(is)h(un)m(b)s(ound.)150 |
| 11590 | 5121 y Fs(copy-forward-word)26 b(\(\))630 5230 y Ft(Cop)m(y)31 | |
| 11591 | b(the)g(w)m(ord)g(follo)m(wing)h(p)s(oin)m(t)f(to)h(the)f(kill)h | |
| 11592 | (bu\013er.)42 b(The)30 b(w)m(ord)h(b)s(oundaries)e(are)j(the)630 | |
| 113d85a4 | 11593 | 5340 y(same)f(as)f Fs(forward-word)p Ft(.)38 b(By)30 |
| 37c41ab1 CR |
11594 | b(default,)h(this)g(command)f(is)g(un)m(b)s(ound.)p eop |
| 11595 | end | |
| 28157acd CR |
11596 | %%Page: 105 111 |
| 11597 | TeXDict begin 105 110 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11598 | b(Command)29 b(Line)i(Editing)2062 b(105)150 299 y Fs(yank)29 | |
| 37c41ab1 CR |
11599 | b(\(C-y\))630 408 y Ft(Y)-8 b(ank)31 b(the)f(top)h(of)g(the)f(kill)h |
| 11600 | (ring)f(in)m(to)i(the)e(bu\013er)g(at)h(p)s(oin)m(t.)150 | |
| 11601 | 558 y Fs(yank-pop)d(\(M-y\))630 667 y Ft(Rotate)36 b(the)f(kill-ring,)i | |
| 11602 | (and)d(y)m(ank)h(the)f(new)g(top.)54 b(Y)-8 b(ou)35 b(can)g(only)f(do)h | |
| 11603 | (this)f(if)h(the)g(prior)630 777 y(command)30 b(is)h | |
| 11604 | Fs(yank)e Ft(or)h Fs(yank-pop)p Ft(.)150 986 y Fk(8.4.5)63 | |
| 11605 | b(Sp)s(ecifying)42 b(Numeric)f(Argumen)m(ts)150 1225 | |
| 11606 | y Fs(digit-argument)26 b(\()p Fj(M-0)p Fs(,)j Fj(M-1)p | |
| 11607 | Fs(,)h(...)f Fj(M--)p Fs(\))630 1335 y Ft(Add)d(this)h(digit)g(to)h | |
| 11608 | (the)f(argumen)m(t)g(already)h(accum)m(ulating,)h(or)e(start)h(a)f(new) | |
| 11609 | f(argumen)m(t.)630 1445 y Fj(M--)j Ft(starts)i(a)g(negativ)m(e)i | |
| 113d85a4 | 11610 | (argumen)m(t.)150 1594 y Fs(universal-argument)25 b(\(\))630 |
| 37c41ab1 CR |
11611 | 1704 y Ft(This)g(is)g(another)h(w)m(a)m(y)g(to)h(sp)s(ecify)e(an)g |
| 11612 | (argumen)m(t.)40 b(If)25 b(this)g(command)h(is)f(follo)m(w)m(ed)i(b)m | |
| 11613 | (y)f(one)630 1813 y(or)k(more)f(digits,)i(optionally)g(with)e(a)h | |
| 11614 | (leading)h(min)m(us)e(sign,)h(those)g(digits)g(de\014ne)f(the)h(ar-)630 | |
| 11615 | 1923 y(gumen)m(t.)41 b(If)28 b(the)i(command)f(is)g(follo)m(w)m(ed)h(b) | |
| 11616 | m(y)f(digits,)i(executing)f Fs(universal-argument)630 | |
| 11617 | 2032 y Ft(again)j(ends)e(the)h(n)m(umeric)f(argumen)m(t,)i(but)e(is)h | |
| 11618 | (otherwise)g(ignored.)45 b(As)32 b(a)g(sp)s(ecial)h(case,)630 | |
| 11619 | 2142 y(if)g(this)g(command)f(is)h(immediately)h(follo)m(w)m(ed)h(b)m(y) | |
| 11620 | d(a)h(c)m(haracter)i(that)e(is)g(neither)g(a)g(digit)630 | |
| 11621 | 2252 y(or)28 b(min)m(us)f(sign,)i(the)f(argumen)m(t)g(coun)m(t)h(for)e | |
| 11622 | (the)i(next)f(command)f(is)h(m)m(ultiplied)h(b)m(y)e(four.)630 | |
| 11623 | 2361 y(The)37 b(argumen)m(t)h(coun)m(t)f(is)h(initially)h(one,)g(so)f | |
| 11624 | (executing)g(this)f(function)g(the)h(\014rst)e(time)630 | |
| 113d85a4 | 11625 | 2471 y(mak)m(es)d(the)e(argumen)m(t)i(coun)m(t)f(four,)f(a)i(second)e |
| 37c41ab1 CR |
11626 | (time)i(mak)m(es)f(the)g(argumen)m(t)g(coun)m(t)h(six-)630 |
| 11627 | 2580 y(teen,)e(and)f(so)h(on.)40 b(By)31 b(default,)g(this)f(is)g(not)h | |
| 113d85a4 | 11628 | (b)s(ound)d(to)j(a)g(k)m(ey)-8 b(.)150 2790 y Fk(8.4.6)63 |
| 5e13499c | 11629 | b(Letting)40 b(Readline)h(T)m(yp)s(e)g(F)-10 b(or)42 |
| 113d85a4 CR |
11630 | b(Y)-10 b(ou)150 3029 y Fs(complete)28 b(\()610 3026 |
| 11631 | y Fg(h)p 634 2973 148 4 v 634 3029 a Ff(T)-6 b(AB)p 634 | |
| 11632 | 3044 V 778 3026 a Fg(i)808 3029 y Fs(\))630 3138 y Ft(A)m(ttempt)24 | |
| 37c41ab1 CR |
11633 | b(to)f(p)s(erform)e(completion)j(on)f(the)g(text)g(b)s(efore)f(p)s(oin) |
| 11634 | m(t.)39 b(The)22 b(actual)i(completion)630 3248 y(p)s(erformed)33 | |
| 11635 | b(is)h(application-sp)s(eci\014c.)53 b(Bash)35 b(attempts)g(completion) | |
| 11636 | g(treating)h(the)e(text)630 3357 y(as)39 b(a)h(v)-5 b(ariable)39 | |
| 11637 | b(\(if)h(the)f(text)h(b)s(egins)e(with)h(`)p Fs($)p Ft('\),)j(username) | |
| 11638 | c(\(if)i(the)f(text)h(b)s(egins)e(with)630 3467 y(`)p | |
| 11639 | Fs(~)p Ft('\),)31 b(hostname)f(\(if)g(the)g(text)h(b)s(egins)e(with)h | |
| 11640 | (`)p Fs(@)p Ft('\),)h(or)f(command)f(\(including)h(aliases)i(and)630 | |
| 11641 | 3577 y(functions\))j(in)f(turn.)53 b(If)34 b(none)g(of)h(these)h(pro)s | |
| 11642 | (duces)d(a)i(matc)m(h,)i(\014lename)e(completion)h(is)630 | |
| 113d85a4 | 11643 | 3686 y(attempted.)150 3836 y Fs(possible-completions)25 |
| 37c41ab1 CR |
11644 | b(\(M-?\))630 3945 y Ft(List)31 b(the)f(p)s(ossible)g(completions)i(of) |
| 11645 | e(the)h(text)g(b)s(efore)f(p)s(oin)m(t.)150 4095 y Fs | |
| 113d85a4 | 11646 | (insert-completions)25 b(\(M-*\))630 4204 y Ft(Insert)30 |
| 37c41ab1 CR |
11647 | b(all)h(completions)h(of)f(the)g(text)g(b)s(efore)f(p)s(oin)m(t)h(that) |
| 11648 | g(w)m(ould)f(ha)m(v)m(e)i(b)s(een)e(generated)630 4314 | |
| 113d85a4 | 11649 | y(b)m(y)g Fs(possible-completions)p Ft(.)150 4463 y Fs(menu-complete)d |
| 37c41ab1 CR |
11650 | (\(\))630 4573 y Ft(Similar)d(to)g Fs(complete)p Ft(,)f(but)h(replaces) |
| 11651 | g(the)g(w)m(ord)g(to)g(b)s(e)f(completed)i(with)e(a)i(single)f(matc)m | |
| 11652 | (h)630 4682 y(from)37 b(the)h(list)h(of)f(p)s(ossible)f(completions.)64 | |
| 11653 | b(Rep)s(eated)39 b(execution)g(of)f Fs(menu-complete)630 | |
| 11654 | 4792 y Ft(steps)i(through)g(the)g(list)h(of)f(p)s(ossible)g | |
| 11655 | (completions,)k(inserting)c(eac)m(h)i(matc)m(h)f(in)f(turn.)630 | |
| 11656 | 4902 y(A)m(t)e(the)f(end)f(of)h(the)g(list)g(of)g(completions,)i(the)e | |
| 11657 | (b)s(ell)g(is)g(rung)f(\(sub)5 b(ject)36 b(to)i(the)f(setting)630 | |
| 11658 | 5011 y(of)f Fs(bell-style)p Ft(\))e(and)h(the)h(original)i(text)f(is)f | |
| 5e13499c | 11659 | (restored.)57 b(An)36 b(argumen)m(t)h(of)f Fq(n)f Ft(mo)m(v)m(es)i |
| 37c41ab1 CR |
11660 | Fq(n)630 5121 y Ft(p)s(ositions)e(forw)m(ard)f(in)g(the)h(list)h(of)e |
| 11661 | (matc)m(hes;)39 b(a)c(negativ)m(e)i(argumen)m(t)e(ma)m(y)g(b)s(e)f | |
| 113d85a4 | 11662 | (used)g(to)630 5230 y(mo)m(v)m(e)40 b(bac)m(kw)m(ard)e(through)g(the)g |
| 37c41ab1 | 11663 | (list.)65 b(This)38 b(command)g(is)g(in)m(tended)g(to)h(b)s(e)f(b)s |
| 113d85a4 CR |
11664 | (ound)e(to)630 5337 y Fg(h)p 654 5284 V 654 5340 a Ff(T)-6 |
| 11665 | b(AB)p 654 5355 V 798 5337 a Fg(i)828 5340 y Ft(,)30 | |
| 37c41ab1 | 11666 | b(but)g(is)g(un)m(b)s(ound)e(b)m(y)i(default.)p eop end |
| 28157acd CR |
11667 | %%Page: 106 112 |
| 11668 | TeXDict begin 106 111 bop 150 -116 a Ft(106)2527 b(Bash)31 | |
| 37c41ab1 CR |
11669 | b(Reference)g(Man)m(ual)150 299 y Fs(delete-char-or-list)25 |
| 11670 | b(\(\))630 408 y Ft(Deletes)k(the)e(c)m(haracter)h(under)e(the)h | |
| 11671 | (cursor)f(if)h(not)g(at)g(the)g(b)s(eginning)g(or)f(end)h(of)g(the)g | |
| 11672 | (line)630 518 y(\(lik)m(e)k Fs(delete-char)p Ft(\).)37 | |
| 11673 | b(If)29 b(at)h(the)f(end)f(of)i(the)f(line,)h(b)s(eha)m(v)m(es)g(iden)m | |
| 11674 | (tically)h(to)e Fs(possible-)630 628 y(completions)p | |
| 11675 | Ft(.)38 b(This)29 b(command)h(is)h(un)m(b)s(ound)d(b)m(y)i(default.)150 | |
| 113d85a4 | 11676 | 789 y Fs(complete-filename)c(\(M-/\))630 899 y Ft(A)m(ttempt)32 |
| 37c41ab1 | 11677 | b(\014lename)e(completion)i(on)e(the)h(text)g(b)s(efore)f(p)s(oin)m(t.) |
| 113d85a4 | 11678 | 150 1060 y Fs(possible-filename-comple)o(tion)o(s)24 |
| 37c41ab1 CR |
11679 | b(\(C-x)30 b(/\))630 1170 y Ft(List)f(the)g(p)s(ossible)f(completions)h |
| 11680 | (of)g(the)g(text)g(b)s(efore)g(p)s(oin)m(t,)g(treating)h(it)f(as)g(a)f | |
| 113d85a4 | 11681 | (\014lename.)150 1331 y Fs(complete-username)e(\(M-~\))630 |
| 37c41ab1 CR |
11682 | 1441 y Ft(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i(b)s(efore)e(p) |
| 11683 | s(oin)m(t,)g(treating)i(it)f(as)f(a)h(username.)150 1602 | |
| 5e13499c | 11684 | y Fs(possible-username-comple)o(tion)o(s)24 b(\(C-x)30 |
| 37c41ab1 CR |
11685 | b(~\))630 1712 y Ft(List)25 b(the)g(p)s(ossible)g(completions)h(of)f |
| 11686 | (the)g(text)h(b)s(efore)f(p)s(oin)m(t,)h(treating)g(it)g(as)f(a)g | |
| 113d85a4 | 11687 | (username.)150 1873 y Fs(complete-variable)h(\(M-$\))630 |
| 37c41ab1 CR |
11688 | 1983 y Ft(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i(b)s(efore)e(p) |
| 11689 | s(oin)m(t,)g(treating)i(it)f(as)f(a)h(shell)g(v)-5 b(ariable.)150 | |
| 113d85a4 | 11690 | 2144 y Fs(possible-variable-comple)o(tion)o(s)24 b(\(C-x)30 |
| 37c41ab1 CR |
11691 | b($\))630 2254 y Ft(List)42 b(the)g(p)s(ossible)g(completions)h(of)f |
| 11692 | (the)g(text)h(b)s(efore)e(p)s(oin)m(t,)46 b(treating)d(it)f(as)g(a)h | |
| 113d85a4 | 11693 | (shell)630 2364 y(v)-5 b(ariable.)150 2525 y Fs(complete-hostname)26 |
| 37c41ab1 CR |
11694 | b(\(M-@\))630 2635 y Ft(A)m(ttempt)32 b(completion)f(on)g(the)f(text)i |
| 11695 | (b)s(efore)e(p)s(oin)m(t,)g(treating)i(it)f(as)f(a)h(hostname.)150 | |
| 113d85a4 | 11696 | 2796 y Fs(possible-hostname-comple)o(tion)o(s)24 b(\(C-x)30 |
| 37c41ab1 CR |
11697 | b(@\))630 2906 y Ft(List)25 b(the)g(p)s(ossible)f(completions)h(of)g |
| 11698 | (the)g(text)g(b)s(efore)g(p)s(oin)m(t,)h(treating)g(it)f(as)f(a)h | |
| 113d85a4 | 11699 | (hostname.)150 3067 y Fs(complete-command)h(\(M-!\))630 |
| 37c41ab1 CR |
11700 | 3177 y Ft(A)m(ttempt)32 b(completion)g(on)f(the)g(text)h(b)s(efore)e(p) |
| 11701 | s(oin)m(t,)h(treating)h(it)g(as)f(a)g(command)g(name.)630 | |
| 11702 | 3286 y(Command)46 b(completion)i(attempts)g(to)f(matc)m(h)h(the)f(text) | |
| 11703 | h(against)g(aliases,)53 b(reserv)m(ed)630 3396 y(w)m(ords,)36 | |
| 11704 | b(shell)g(functions,)h(shell)e(builtins,)i(and)e(\014nally)g | |
| 11705 | (executable)i(\014lenames,)g(in)e(that)630 3505 y(order.)150 | |
| 113d85a4 | 11706 | 3667 y Fs(possible-command-complet)o(ions)24 b(\(C-x)29 |
| 37c41ab1 CR |
11707 | b(!\))630 3777 y Ft(List)d(the)h(p)s(ossible)f(completions)h(of)f(the)h |
| 11708 | (text)g(b)s(efore)f(p)s(oin)m(t,)h(treating)g(it)g(as)g(a)f(command)630 | |
| 113d85a4 CR |
11709 | 3886 y(name.)150 4048 y Fs(dynamic-complete-history)e(\(M-)1470 |
| 11710 | 4045 y Fg(h)p 1493 3992 148 4 v 1493 4048 a Ff(T)-6 b(AB)p | |
| 11711 | 1493 4063 V 1637 4045 a Fg(i)1667 4048 y Fs(\))630 4157 | |
| 37c41ab1 CR |
11712 | y Ft(A)m(ttempt)31 b(completion)h(on)e(the)g(text)h(b)s(efore)f(p)s |
| 11713 | (oin)m(t,)g(comparing)h(the)f(text)h(against)h(lines)630 | |
| 11714 | 4267 y(from)e(the)g(history)h(list)g(for)f(p)s(ossible)g(completion)i | |
| 113d85a4 | 11715 | (matc)m(hes.)150 4428 y Fs(complete-into-braces)25 b(\(M-{\))630 |
| 37c41ab1 CR |
11716 | 4538 y Ft(P)m(erform)f(\014lename)f(completion)i(and)f(insert)f(the)h |
| 11717 | (list)g(of)g(p)s(ossible)f(completions)i(enclosed)630 | |
| 11718 | 4647 y(within)34 b(braces)h(so)f(the)h(list)g(is)g(a)m(v)-5 | |
| 11719 | b(ailable)37 b(to)e(the)g(shell)g(\(see)g(Section)h(3.5.1)g([Brace)g | |
| 11720 | (Ex-)630 4757 y(pansion],)30 b(page)h(17\).)150 4985 | |
| 113d85a4 | 11721 | y Fk(8.4.7)63 b(Keyb)s(oard)41 b(Macros)150 5230 y Fs(start-kbd-macro) |
| 37c41ab1 CR |
11722 | 26 b(\(C-x)j(\(\))630 5340 y Ft(Begin)i(sa)m(ving)h(the)e(c)m |
| 11723 | (haracters)i(t)m(yp)s(ed)e(in)m(to)h(the)g(curren)m(t)f(k)m(eyb)s(oard) | |
| 11724 | g(macro.)p eop end | |
| 28157acd CR |
11725 | %%Page: 107 113 |
| 11726 | TeXDict begin 107 112 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11727 | b(Command)29 b(Line)i(Editing)2062 b(107)150 299 y Fs(end-kbd-macro)27 | |
| 37c41ab1 CR |
11728 | b(\(C-x)i(\)\))630 408 y Ft(Stop)e(sa)m(ving)h(the)g(c)m(haracters)g(t) |
| 11729 | m(yp)s(ed)f(in)m(to)i(the)e(curren)m(t)g(k)m(eyb)s(oard)g(macro)h(and)f | |
| 113d85a4 CR |
11730 | (sa)m(v)m(e)i(the)630 518 y(de\014nition.)150 691 y Fs |
| 11731 | (call-last-kbd-macro)c(\(C-x)k(e\))630 801 y Ft(Re-execute)37 | |
| 37c41ab1 CR |
11732 | b(the)e(last)h(k)m(eyb)s(oard)f(macro)h(de\014ned,)f(b)m(y)h(making)f |
| 11733 | (the)g(c)m(haracters)i(in)e(the)630 911 y(macro)c(app)s(ear)f(as)g(if)h | |
| 11734 | (t)m(yp)s(ed)f(at)h(the)f(k)m(eyb)s(oard.)150 1163 y | |
| 11735 | Fk(8.4.8)63 b(Some)41 b(Miscellaneous)i(Commands)150 | |
| 113d85a4 | 11736 | 1414 y Fs(re-read-init-file)26 b(\(C-x)j(C-r\))630 1524 |
| 37c41ab1 CR |
11737 | y Ft(Read)22 b(in)g(the)g(con)m(ten)m(ts)h(of)f(the)g |
| 11738 | Fq(inputrc)27 b Ft(\014le,)d(and)d(incorp)s(orate)h(an)m(y)h(bindings)d | |
| 11739 | (or)i(v)-5 b(ariable)630 1633 y(assignmen)m(ts)31 b(found)e(there.)150 | |
| 113d85a4 | 11740 | 1807 y Fs(abort)g(\(C-g\))630 1916 y Ft(Ab)s(ort)d(the)h(curren)m(t)f |
| 37c41ab1 CR |
11741 | (editing)h(command)f(and)g(ring)h(the)f(terminal's)h(b)s(ell)g(\(sub)5 |
| 11742 | b(ject)26 b(to)i(the)630 2026 y(setting)j(of)g Fs(bell-style)p | |
| 113d85a4 CR |
11743 | Ft(\).)150 2199 y Fs(do-uppercase-version)25 b(\(M-a,)k(M-b,)g(M-)p |
| 11744 | Fj(x)p Fs(,)g(...)o(\))630 2309 y Ft(If)e(the)h(meta\014ed)g(c)m | |
| 37c41ab1 CR |
11745 | (haracter)h Fq(x)34 b Ft(is)28 b(lo)m(w)m(ercase,)i(run)d(the)g |
| 11746 | (command)h(that)g(is)g(b)s(ound)d(to)k(the)630 2418 y(corresp)s(onding) | |
| 11747 | g(upp)s(ercase)h(c)m(haracter.)150 2592 y Fs(prefix-meta)d(\()753 | |
| 113d85a4 CR |
11748 | 2589 y Fg(h)p 777 2536 139 4 v 777 2592 a Ff(ESC)p 777 |
| 11749 | 2607 V 911 2589 a Fg(i)941 2592 y Fs(\))630 2701 y Ft(Metafy)39 | |
| 37c41ab1 CR |
11750 | b(the)e(next)h(c)m(haracter)h(t)m(yp)s(ed.)62 b(This)37 |
| 11751 | b(is)g(for)h(k)m(eyb)s(oards)f(without)g(a)h(meta)g(k)m(ey)-8 | |
| 11752 | b(.)630 2811 y(T)m(yping)30 b(`)968 2808 y Fg(h)p 993 | |
| 113d85a4 | 11753 | 2755 V 993 2811 a Ff(ESC)p 993 2826 V 1127 2808 a Fg(i)1187 |
| 37c41ab1 CR |
11754 | 2811 y Fs(f)p Ft(')g(is)g(equiv)-5 b(alen)m(t)32 b(to)f(t)m(yping)g |
| 11755 | Fj(M-f)p Ft(.)150 2984 y Fs(undo)e(\(C-_)g(or)h(C-x)g(C-u\))630 | |
| 11756 | 3094 y Ft(Incremen)m(tal)h(undo,)f(separately)h(remem)m(b)s(ered)f(for) | |
| 113d85a4 | 11757 | g(eac)m(h)i(line.)150 3267 y Fs(revert-line)27 b(\(M-r\))630 |
| 37c41ab1 CR |
11758 | 3377 y Ft(Undo)33 b(all)h(c)m(hanges)g(made)f(to)h(this)f(line.)49 |
| 11759 | b(This)32 b(is)h(lik)m(e)i(executing)f(the)f Fs(undo)f | |
| 11760 | Ft(command)630 3487 y(enough)e(times)h(to)g(get)h(bac)m(k)f(to)g(the)f | |
| 113d85a4 | 11761 | (b)s(eginning.)150 3660 y Fs(tilde-expand)d(\(M-&\))630 |
| 37c41ab1 | 11762 | 3770 y Ft(P)m(erform)j(tilde)h(expansion)g(on)f(the)g(curren)m(t)h(w)m |
| 113d85a4 | 11763 | (ord.)150 3943 y Fs(set-mark)d(\(C-@\))630 4053 y Ft(Set)33 |
| 37c41ab1 CR |
11764 | b(the)g(mark)f(to)i(the)f(p)s(oin)m(t.)48 b(If)32 b(a)h(n)m(umeric)g |
| 11765 | (argumen)m(t)g(is)g(supplied,)f(the)h(mark)g(is)f(set)630 | |
| 11766 | 4162 y(to)f(that)g(p)s(osition.)150 4336 y Fs(exchange-point-and-mark) | |
| 11767 | 24 b(\(C-x)29 b(C-x\))630 4445 y Ft(Sw)m(ap)i(the)g(p)s(oin)m(t)g(with) | |
| 11768 | g(the)g(mark.)43 b(The)31 b(curren)m(t)g(cursor)f(p)s(osition)i(is)f | |
| 11769 | (set)h(to)f(the)h(sa)m(v)m(ed)630 4555 y(p)s(osition,)f(and)e(the)i | |
| 11770 | (old)g(cursor)e(p)s(osition)i(is)f(sa)m(v)m(ed)i(as)e(the)h(mark.)150 | |
| 113d85a4 | 11771 | 4728 y Fs(character-search)26 b(\(C-]\))630 4838 y Ft(A)f(c)m(haracter) |
| 37c41ab1 | 11772 | h(is)f(read)g(and)f(p)s(oin)m(t)h(is)g(mo)m(v)m(ed)h(to)g(the)f(next)g |
| 113d85a4 | 11773 | (o)s(ccurrence)g(of)g(that)g(c)m(haracter.)630 4947 y(A)30 |
| 37c41ab1 | 11774 | b(negativ)m(e)j(coun)m(t)e(searc)m(hes)g(for)f(previous)g(o)s |
| 113d85a4 | 11775 | (ccurrences.)150 5121 y Fs(character-search-backwar)o(d)24 |
| 37c41ab1 CR |
11776 | b(\(M-C-]\))630 5230 y Ft(A)45 b(c)m(haracter)h(is)f(read)g(and)f(p)s |
| 11777 | (oin)m(t)h(is)g(mo)m(v)m(ed)h(to)f(the)g(previous)f(o)s(ccurrence)h(of) | |
| 11778 | g(that)630 5340 y(c)m(haracter.)d(A)31 b(negativ)m(e)h(coun)m(t)f | |
| 113d85a4 | 11779 | (searc)m(hes)h(for)e(subsequen)m(t)f(o)s(ccurrences.)p |
| 37c41ab1 | 11780 | eop end |
| 28157acd CR |
11781 | %%Page: 108 114 |
| 11782 | TeXDict begin 108 113 bop 150 -116 a Ft(108)2527 b(Bash)31 | |
| 37c41ab1 CR |
11783 | b(Reference)g(Man)m(ual)150 299 y Fs(insert-comment)26 |
| 11784 | b(\(M-#\))630 408 y Ft(Without)36 b(a)g(n)m(umeric)g(argumen)m(t,)h | |
| 11785 | (the)f(v)-5 b(alue)36 b(of)g(the)g Fs(comment-begin)c | |
| 11786 | Ft(v)-5 b(ariable)36 b(is)g(in-)630 518 y(serted)c(at)g(the)g(b)s | |
| 11787 | (eginning)f(of)h(the)f(curren)m(t)h(line.)45 b(If)31 | |
| 11788 | b(a)h(n)m(umeric)f(argumen)m(t)h(is)g(supplied,)630 628 | |
| 11789 | y(this)k(command)h(acts)g(as)g(a)g(toggle:)55 b(if)37 | |
| 11790 | b(the)f(c)m(haracters)i(at)g(the)e(b)s(eginning)g(of)h(the)g(line)630 | |
| 11791 | 737 y(do)30 b(not)h(matc)m(h)h(the)f(v)-5 b(alue)31 b(of)f | |
| 11792 | Fs(comment-begin)p Ft(,)e(the)i(v)-5 b(alue)31 b(is)g(inserted,)g | |
| 11793 | (otherwise)g(the)630 847 y(c)m(haracters)42 b(in)d Fs(comment-begin)e | |
| 11794 | Ft(are)j(deleted)h(from)f(the)g(b)s(eginning)g(of)g(the)g(line.)71 | |
| 11795 | b(In)630 956 y(either)37 b(case,)j(the)e(line)f(is)g(accepted)i(as)e | |
| 11796 | (if)g(a)g(newline)g(had)g(b)s(een)f(t)m(yp)s(ed.)60 b(The)37 | |
| 11797 | b(default)630 1066 y(v)-5 b(alue)32 b(of)g Fs(comment-begin)c | |
| 11798 | Ft(causes)k(this)f(command)h(to)g(mak)m(e)h(the)e(curren)m(t)h(line)g | |
| 11799 | (a)g(shell)630 1176 y(commen)m(t.)40 b(If)26 b(a)h(n)m(umeric)f | |
| 11800 | (argumen)m(t)h(causes)g(the)f(commen)m(t)i(c)m(haracter)g(to)f(b)s(e)f | |
| 11801 | (remo)m(v)m(ed,)630 1285 y(the)31 b(line)f(will)h(b)s(e)f(executed)h(b) | |
| 11802 | m(y)f(the)h(shell.)150 1443 y Fs(dump-functions)26 b(\(\))630 | |
| 11803 | 1553 y Ft(Prin)m(t)g(all)i(of)e(the)h(functions)f(and)g(their)g(k)m(ey) | |
| 11804 | h(bindings)e(to)j(the)e(Readline)h(output)f(stream.)630 | |
| 11805 | 1663 y(If)31 b(a)h(n)m(umeric)g(argumen)m(t)g(is)g(supplied,)f(the)h | |
| 11806 | (output)f(is)h(formatted)g(in)f(suc)m(h)h(a)g(w)m(a)m(y)g(that)630 | |
| 11807 | 1772 y(it)f(can)g(b)s(e)e(made)i(part)f(of)g(an)h Fq(inputrc)k | |
| 11808 | Ft(\014le.)41 b(This)29 b(command)h(is)h(un)m(b)s(ound)c(b)m(y)k | |
| 113d85a4 | 11809 | (default.)150 1931 y Fs(dump-variables)26 b(\(\))630 |
| 37c41ab1 CR |
11810 | 2040 y Ft(Prin)m(t)21 b(all)h(of)g(the)f(settable)i(v)-5 |
| 11811 | b(ariables)22 b(and)f(their)g(v)-5 b(alues)22 b(to)g(the)f(Readline)h | |
| 11812 | (output)f(stream.)630 2150 y(If)31 b(a)h(n)m(umeric)g(argumen)m(t)g(is) | |
| 11813 | g(supplied,)f(the)h(output)f(is)h(formatted)g(in)f(suc)m(h)h(a)g(w)m(a) | |
| 11814 | m(y)g(that)630 2259 y(it)f(can)g(b)s(e)e(made)i(part)f(of)g(an)h | |
| 11815 | Fq(inputrc)k Ft(\014le.)41 b(This)29 b(command)h(is)h(un)m(b)s(ound)c | |
| 113d85a4 | 11816 | (b)m(y)k(default.)150 2418 y Fs(dump-macros)c(\(\))630 |
| 37c41ab1 CR |
11817 | 2527 y Ft(Prin)m(t)34 b(all)g(of)g(the)g(Readline)g(k)m(ey)h(sequences) |
| 11818 | f(b)s(ound)e(to)i(macros)g(and)f(the)h(strings)g(they)630 | |
| 11819 | 2637 y(output.)53 b(If)35 b(a)g(n)m(umeric)f(argumen)m(t)i(is)e | |
| 11820 | (supplied,)h(the)g(output)g(is)f(formatted)i(in)e(suc)m(h)h(a)630 | |
| 11821 | 2746 y(w)m(a)m(y)c(that)g(it)f(can)g(b)s(e)g(made)g(part)f(of)i(an)e | |
| 11822 | Fq(inputrc)35 b Ft(\014le.)41 b(This)29 b(command)h(is)g(un)m(b)s(ound) | |
| 11823 | d(b)m(y)630 2856 y(default.)150 3014 y Fs(glob-complete-word)e(\(M-g\)) | |
| 11824 | 630 3124 y Ft(The)i(w)m(ord)h(b)s(efore)f(p)s(oin)m(t)h(is)g(treated)h | |
| 11825 | (as)f(a)h(pattern)f(for)f(pathname)h(expansion,)g(with)g(an)630 | |
| 11826 | 3233 y(asterisk)d(implicitly)h(app)s(ended.)37 b(This)23 | |
| 11827 | b(pattern)i(is)f(used)g(to)h(generate)h(a)e(list)h(of)g(matc)m(hing)630 | |
| 11828 | 3343 y(\014le)30 b(names)h(for)f(p)s(ossible)g(completions.)150 | |
| 11829 | 3501 y Fs(glob-expand-word)c(\(C-x)j(*\))630 3611 y Ft(The)40 | |
| 11830 | b(w)m(ord)g(b)s(efore)g(p)s(oin)m(t)h(is)g(treated)g(as)g(a)g(pattern)g | |
| 11831 | (for)f(pathname)g(expansion,)k(and)630 3720 y(the)c(list)g(of)f(matc)m | |
| 11832 | (hing)i(\014le)e(names)g(is)h(inserted,)h(replacing)g(the)e(w)m(ord.)67 | |
| 11833 | b(If)39 b(a)h(n)m(umeric)630 3830 y(argumen)m(t)31 b(is)f(supplied,)g | |
| 11834 | (a)g(`)p Fs(*)p Ft(')h(is)f(app)s(ended)f(b)s(efore)h(pathname)g | |
| 113d85a4 | 11835 | (expansion.)150 3988 y Fs(glob-list-expansions)25 b(\(C-x)k(g\))630 |
| 37c41ab1 | 11836 | 4098 y Ft(The)k(list)h(of)f(expansions)g(that)h(w)m(ould)f(ha)m(v)m(e)h |
| 5e13499c | 11837 | (b)s(een)f(generated)h(b)m(y)f Fs(glob-expand-word)630 |
| 37c41ab1 CR |
11838 | 4208 y Ft(is)h(displa)m(y)m(ed,)h(and)e(the)h(line)g(is)f(redra)m(wn.) |
| 11839 | 50 b(If)33 b(a)h(n)m(umeric)g(argumen)m(t)g(is)f(supplied,)h(a)g(`)p | |
| 11840 | Fs(*)p Ft(')630 4317 y(is)c(app)s(ended)f(b)s(efore)h(pathname)g | |
| 113d85a4 | 11841 | (expansion.)150 4475 y Fs(display-shell-version)25 b(\(C-x)k(C-v\))630 |
| 37c41ab1 CR |
11842 | 4585 y Ft(Displa)m(y)j(v)m(ersion)e(information)h(ab)s(out)f(the)h |
| 11843 | (curren)m(t)f(instance)h(of)f(Bash.)150 4743 y Fs(shell-expand-line)c | |
| 11844 | (\(M-C-e\))630 4853 y Ft(Expand)34 b(the)h(line)h(as)g(the)f(shell)h | |
| 11845 | (do)s(es.)55 b(This)34 b(p)s(erforms)g(alias)i(and)f(history)g | |
| 11846 | (expansion)630 4963 y(as)f(w)m(ell)g(as)g(all)h(of)e(the)h(shell)g(w)m | |
| 11847 | (ord)f(expansions)g(\(see)i(Section)f(3.5)h([Shell)e(Expansions],)630 | |
| 9d2b70f0 | 11848 | 5072 y(page)e(17\).)150 5230 y Fs(history-expand-line)25 |
| 37c41ab1 CR |
11849 | b(\(M-^\))630 5340 y Ft(P)m(erform)30 b(history)h(expansion)f(on)g(the) |
| 11850 | h(curren)m(t)f(line.)p eop end | |
| 28157acd CR |
11851 | %%Page: 109 115 |
| 11852 | TeXDict begin 109 114 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 11853 | b(Command)29 b(Line)i(Editing)2062 b(109)150 299 y Fs(magic-space)27 | |
| 37c41ab1 CR |
11854 | b(\(\))630 408 y Ft(P)m(erform)c(history)g(expansion)g(on)g(the)g |
| 11855 | (curren)m(t)g(line)g(and)g(insert)g(a)g(space)h(\(see)g(Section)g(9.3) | |
| 28157acd | 11856 | 630 518 y([History)31 b(In)m(teraction],)i(page)e(117\).)150 |
| 37c41ab1 CR |
11857 | 664 y Fs(alias-expand-line)26 b(\(\))630 774 y Ft(P)m(erform)i(alias)i |
| 11858 | (expansion)e(on)g(the)h(curren)m(t)f(line)h(\(see)g(Section)g(6.6)h | |
| 28157acd | 11859 | ([Aliases],)g(page)f(75\).)150 920 y Fs(history-and-alias-expand)o |
| 37c41ab1 CR |
11860 | (-lin)o(e)24 b(\(\))630 1029 y Ft(P)m(erform)30 b(history)h(and)e |
| 11861 | (alias)j(expansion)e(on)g(the)h(curren)m(t)f(line.)150 | |
| 113d85a4 CR |
11862 | 1176 y Fs(insert-last-argument)25 b(\(M-.)k(or)h(M-_\))630 |
| 11863 | 1285 y Ft(A)g(synon)m(ym)g(for)g Fs(yank-last-arg)p Ft(.)150 | |
| 11864 | 1431 y Fs(operate-and-get-next)25 b(\(C-o\))630 1541 | |
| 37c41ab1 CR |
11865 | y Ft(Accept)42 b(the)e(curren)m(t)h(line)f(for)h(execution)g(and)f |
| 11866 | (fetc)m(h)i(the)e(next)h(line)g(relativ)m(e)i(to)e(the)630 | |
| 11867 | 1650 y(curren)m(t)30 b(line)h(from)f(the)g(history)h(for)f(editing.)41 | |
| 11868 | b(An)m(y)31 b(argumen)m(t)f(is)h(ignored.)150 1797 y | |
| 113d85a4 | 11869 | Fs(edit-and-execute-command)24 b(\(C-xC-e\))630 1906 |
| 37c41ab1 CR |
11870 | y Ft(In)m(v)m(ok)m(e)34 b(an)f(editor)g(on)g(the)g(curren)m(t)f |
| 11871 | (command)h(line,)h(and)e(execute)i(the)f(result)g(as)g(shell)630 | |
| 11872 | 2016 y(commands.)81 b(Bash)44 b(attempts)h(to)g(in)m(v)m(ok)m(e)h | |
| 11873 | Fs($VISUAL)p Ft(,)f Fs($EDITOR)p Ft(,)h(and)d Fs(emacs)g | |
| 11874 | Ft(as)h(the)630 2125 y(editor,)31 b(in)f(that)h(order.)150 | |
| 113d85a4 | 11875 | 2363 y Fr(8.5)68 b(Readline)47 b(vi)e(Mo)t(de)275 2600 |
| 37c41ab1 CR |
11876 | y Ft(While)24 b(the)g(Readline)g(library)f(do)s(es)h(not)g(ha)m(v)m(e)g |
| 11877 | (a)h(full)e(set)h(of)g Fs(vi)f Ft(editing)h(functions,)h(it)f(do)s(es)g | |
| 11878 | (con)m(tain)150 2710 y(enough)34 b(to)h(allo)m(w)g(simple)f(editing)h | |
| 11879 | (of)f(the)g(line.)52 b(The)34 b(Readline)g Fs(vi)g Ft(mo)s(de)f(b)s | |
| 11880 | (eha)m(v)m(es)i(as)f(sp)s(eci\014ed)f(in)150 2819 y(the)e | |
| 113d85a4 | 11881 | Fl(posix)e Ft(1003.2)k(standard.)275 2947 y(In)i(order)g(to)i(switc)m |
| 37c41ab1 CR |
11882 | (h)f(in)m(teractiv)m(ely)j(b)s(et)m(w)m(een)d Fs(emacs)f |
| 11883 | Ft(and)g Fs(vi)g Ft(editing)h(mo)s(des,)h(use)f(the)g(`)p | |
| 28157acd CR |
11884 | Fs(set)30 b(-o)150 3057 y(emacs)p Ft(')21 b(and)g(`)p |
| 11885 | Fs(set)29 b(-o)h(vi)p Ft(')21 b(commands)h(\(see)g(Section)h(4.3)g | |
| 11886 | ([The)e(Set)h(Builtin],)j(page)d(53\).)39 b(The)21 b(Readline)150 | |
| 11887 | 3166 y(default)31 b(is)f Fs(emacs)f Ft(mo)s(de.)275 3294 | |
| 11888 | y(When)g(y)m(ou)i(en)m(ter)f(a)h(line)f(in)g Fs(vi)f | |
| 37c41ab1 CR |
11889 | Ft(mo)s(de,)h(y)m(ou)h(are)f(already)h(placed)f(in)g(`insertion')g(mo)s |
| 11890 | (de,)g(as)h(if)f(y)m(ou)150 3404 y(had)c(t)m(yp)s(ed)g(an)g(`)p | |
| 113d85a4 CR |
11891 | Fs(i)p Ft('.)39 b(Pressing)1215 3401 y Fg(h)p 1239 3348 |
| 11892 | 139 4 v 1239 3404 a Ff(ESC)p 1239 3419 V 1373 3401 a | |
| 37c41ab1 CR |
11893 | Fg(i)1429 3404 y Ft(switc)m(hes)27 b(y)m(ou)g(in)m(to)g(`command')f(mo) |
| 11894 | s(de,)h(where)f(y)m(ou)h(can)f(edit)h(the)150 3513 y(text)35 | |
| 11895 | b(of)f(the)g(line)g(with)f(the)h(standard)f Fs(vi)g Ft(mo)m(v)m(emen)m | |
| 11896 | (t)j(k)m(eys,)g(mo)m(v)m(e)f(to)f(previous)g(history)f(lines)h(with)150 | |
| 11897 | 3623 y(`)p Fs(k)p Ft(')d(and)e(subsequen)m(t)h(lines)h(with)f(`)p | |
| 11898 | Fs(j)p Ft(',)g(and)g(so)h(forth.)150 3861 y Fr(8.6)68 | |
| 113d85a4 | 11899 | b(Programmable)47 b(Completion)275 4098 y Ft(When)25 |
| 37c41ab1 CR |
11900 | b(w)m(ord)g(completion)i(is)f(attempted)g(for)g(an)f(argumen)m(t)h(to)h |
| 11901 | (a)f(command)f(for)h(whic)m(h)f(a)h(comple-)150 4208 | |
| 11902 | y(tion)f(sp)s(eci\014cation)g(\(a)h Fq(compsp)s(ec)6 | |
| 11903 | b Ft(\))24 b(has)g(b)s(een)g(de\014ned)g(using)g(the)g | |
| 11904 | Fs(complete)f Ft(builtin)h(\(see)h(Section)h(8.7)150 | |
| 28157acd | 11905 | 4317 y([Programmable)e(Completion)g(Builtins],)h(page)f(111\),)j(the)c |
| 37c41ab1 CR |
11906 | (programmable)h(completion)g(facilities)i(are)150 4427 |
| 11907 | y(in)m(v)m(ok)m(ed.)275 4555 y(First,)d(the)e(command)g(name)g(is)h | |
| 11908 | (iden)m(ti\014ed.)37 b(If)21 b(a)g(compsp)s(ec)g(has)g(b)s(een)f | |
| 113d85a4 | 11909 | (de\014ned)g(for)h(that)h(command,)150 4664 y(the)44 |
| 37c41ab1 CR |
11910 | b(compsp)s(ec)g(is)g(used)f(to)h(generate)i(the)e(list)g(of)g(p)s |
| 11911 | (ossible)g(completions)h(for)e(the)h(w)m(ord.)81 b(If)44 | |
| 11912 | b(the)150 4774 y(command)33 b(w)m(ord)f(is)h(a)g(full)g(pathname,)h(a)f | |
| 11913 | (compsp)s(ec)f(for)h(the)g(full)g(pathname)f(is)h(searc)m(hed)h(for)e | |
| 11914 | (\014rst.)150 4883 y(If)f(no)h(compsp)s(ec)f(is)h(found)e(for)h(the)h | |
| 11915 | (full)g(pathname,)g(an)f(attempt)i(is)f(made)f(to)i(\014nd)d(a)i | |
| 11916 | (compsp)s(ec)f(for)150 4993 y(the)g(p)s(ortion)f(follo)m(wing)h(the)g | |
| 11917 | (\014nal)f(slash.)275 5121 y(Once)k(a)g(compsp)s(ec)g(has)g(b)s(een)f | |
| 11918 | (found,)h(it)h(is)f(used)f(to)i(generate)h(the)e(list)h(of)f(matc)m | |
| 11919 | (hing)h(w)m(ords.)51 b(If)150 5230 y(a)37 b(compsp)s(ec)f(is)g(not)h | |
| 11920 | (found,)f(the)h(default)f(Bash)h(completion)g(describ)s(ed)e(ab)s(o)m | |
| 11921 | (v)m(e)j(\(see)f(Section)g(8.4.6)150 5340 y([Commands)30 | |
| 28157acd | 11922 | b(F)-8 b(or)31 b(Completion],)g(page)g(105\))h(is)f(p)s(erformed.)p |
| 37c41ab1 | 11923 | eop end |
| 28157acd CR |
11924 | %%Page: 110 116 |
| 11925 | TeXDict begin 110 115 bop 150 -116 a Ft(110)2527 b(Bash)31 | |
| 37c41ab1 CR |
11926 | b(Reference)g(Man)m(ual)275 299 y(First,)g(the)g(actions)g(sp)s |
| 11927 | (eci\014ed)f(b)m(y)h(the)f(compsp)s(ec)h(are)g(used.)40 | |
| 11928 | b(Only)30 b(matc)m(hes)i(whic)m(h)e(are)h(pre\014xed)150 | |
| 11929 | 408 y(b)m(y)25 b(the)h(w)m(ord)f(b)s(eing)f(completed)j(are)e | |
| 11930 | (returned.)38 b(When)25 b(the)h(`)p Fs(-f)p Ft(')f(or)g(`)p | |
| 11931 | Fs(-d)p Ft(')g(option)h(is)f(used)g(for)g(\014lename)150 | |
| 11932 | 518 y(or)30 b(directory)h(name)f(completion,)i(the)e(shell)h(v)-5 | |
| 11933 | b(ariable)31 b Fs(FIGNORE)d Ft(is)i(used)f(to)i(\014lter)g(the)f(matc)m | |
| 11934 | (hes.)42 b(See)150 628 y(Section)31 b(5.2)h([Bash)e(V)-8 | |
| 28157acd | 11935 | b(ariables],)33 b(page)e(57,)g(for)f(a)h(description)g(of)f |
| 37c41ab1 CR |
11936 | Fs(FIGNORE)p Ft(.)275 765 y(An)m(y)f(completions)h(sp)s(eci\014ed)f(b)m |
| 11937 | (y)g(a)h(\014lename)f(expansion)h(pattern)f(to)h(the)g(`)p | |
| 11938 | Fs(-G)p Ft(')f(option)h(are)f(gener-)150 874 y(ated)h(next.)40 | |
| 5e13499c | 11939 | b(The)29 b(w)m(ords)g(generated)h(b)m(y)f(the)h(pattern)f(need)g(not)g |
| 37c41ab1 CR |
11940 | (matc)m(h)i(the)e(w)m(ord)g(b)s(eing)g(completed.)150 |
| 11941 | 984 y(The)42 b Fs(GLOBIGNORE)d Ft(shell)k(v)-5 b(ariable)43 | |
| 11942 | b(is)f(not)h(used)e(to)i(\014lter)f(the)h(matc)m(hes,)j(but)c(the)g | |
| 11943 | Fs(FIGNORE)f Ft(shell)150 1093 y(v)-5 b(ariable)31 b(is)g(used.)275 | |
| 11944 | 1230 y(Next,)k(the)g(string)e(sp)s(eci\014ed)h(as)g(the)g(argumen)m(t)g | |
| 11945 | (to)h(the)f(`)p Fs(-W)p Ft(')g(option)g(is)g(considered.)52 | |
| 11946 | b(The)33 b(string)150 1340 y(is)g(\014rst)e(split)i(using)f(the)h(c)m | |
| 11947 | (haracters)h(in)e(the)h Fs(IFS)e Ft(sp)s(ecial)j(v)-5 | |
| 11948 | b(ariable)33 b(as)g(delimiters.)48 b(Shell)32 b(quoting)h(is)150 | |
| 2206f89a CR |
11949 | 1450 y(honored.)56 b(Eac)m(h)37 b(w)m(ord)e(is)h(then)f(expanded)g |
| 11950 | (using)h(brace)g(expansion,)h(tilde)f(expansion,)h(parameter)150 | |
| 11951 | 1559 y(and)44 b(v)-5 b(ariable)46 b(expansion,)j(command)44 | |
| 11952 | b(substitution,)49 b(and)44 b(arithmetic)i(expansion,)j(as)c(describ)s | |
| 11953 | (ed)150 1669 y(ab)s(o)m(v)m(e)38 b(\(see)f(Section)h(3.5)g([Shell)e | |
| 9d2b70f0 | 11954 | (Expansions],)i(page)f(17\).)61 b(The)36 b(results)h(are)g(split)f |
| 2206f89a | 11955 | (using)h(the)f(rules)150 1778 y(describ)s(ed)29 b(ab)s(o)m(v)m(e)i |
| 28157acd | 11956 | (\(see)f(Section)h(3.5.7)h([W)-8 b(ord)30 b(Splitting],)h(page)f(22\).) |
| 2206f89a CR |
11957 | 42 b(The)30 b(results)f(of)h(the)g(expansion)150 1888 |
| 11958 | y(are)f(pre\014x-matc)m(hed)h(against)g(the)f(w)m(ord)g(b)s(eing)f | |
| 11959 | (completed,)j(and)d(the)i(matc)m(hing)g(w)m(ords)e(b)s(ecome)i(the)150 | |
| 11960 | 1998 y(p)s(ossible)g(completions.)275 2134 y(After)f(these)g(matc)m | |
| 11961 | (hes)i(ha)m(v)m(e)f(b)s(een)f(generated,)h(an)m(y)g(shell)f(function)g | |
| 11962 | (or)g(command)g(sp)s(eci\014ed)f(with)150 2244 y(the)i(`)p | |
| 11963 | Fs(-F)p Ft(')g(and)f(`)p Fs(-C)p Ft(')h(options)g(is)g(in)m(v)m(ok)m | |
| 11964 | (ed.)41 b(When)30 b(the)g(command)g(or)f(function)h(is)g(in)m(v)m(ok)m | |
| 28157acd CR |
11965 | (ed,)h(the)f Fs(COMP_)150 2354 y(LINE)21 b Ft(and)h Fs(COMP_POINT)d |
| 11966 | Ft(v)-5 b(ariables)23 b(are)g(assigned)g(v)-5 b(alues)22 | |
| 11967 | b(as)h(describ)s(ed)e(ab)s(o)m(v)m(e)j(\(see)f(Section)g(5.2)h([Bash) | |
| 11968 | 150 2463 y(V)-8 b(ariables],)33 b(page)f(57\).)44 b(If)30 | |
| 11969 | b(a)i(shell)f(function)f(is)h(b)s(eing)g(in)m(v)m(ok)m(ed,)i(the)e | |
| 11970 | Fs(COMP_WORDS)d Ft(and)j Fs(COMP_CWORD)150 2573 y Ft(v)-5 | |
| 11971 | b(ariables)40 b(are)g(also)h(set.)68 b(When)40 b(the)f(function)h(or)f | |
| 11972 | (command)g(is)h(in)m(v)m(ok)m(ed,)j(the)d(\014rst)f(argumen)m(t)h(is) | |
| 11973 | 150 2682 y(the)34 b(name)f(of)h(the)g(command)f(whose)g(argumen)m(ts)h | |
| 11974 | (are)g(b)s(eing)f(completed,)j(the)d(second)h(argumen)m(t)g(is)150 | |
| 11975 | 2792 y(the)h(w)m(ord)g(b)s(eing)g(completed,)i(and)e(the)g(third)f | |
| 11976 | (argumen)m(t)i(is)f(the)g(w)m(ord)g(preceding)g(the)h(w)m(ord)e(b)s | |
| 11977 | (eing)150 2902 y(completed)e(on)e(the)h(curren)m(t)g(command)f(line.)42 | |
| 11978 | b(No)31 b(\014ltering)g(of)g(the)g(generated)h(completions)g(against) | |
| 11979 | 150 3011 y(the)d(w)m(ord)g(b)s(eing)f(completed)i(is)f(p)s(erformed;)f | |
| 11980 | (the)h(function)g(or)g(command)f(has)h(complete)h(freedom)f(in)150 | |
| 11981 | 3121 y(generating)j(the)e(matc)m(hes.)275 3258 y(An)m(y)h(function)h | |
| 11982 | (sp)s(eci\014ed)f(with)g(`)p Fs(-F)p Ft(')h(is)g(in)m(v)m(ok)m(ed)h | |
| 37c41ab1 CR |
11983 | (\014rst.)44 b(The)31 b(function)h(ma)m(y)g(use)g(an)m(y)g(of)g(the)g |
| 11984 | (shell)150 3367 y(facilities,)44 b(including)c(the)g | |
| 11985 | Fs(compgen)d Ft(builtin)j(describ)s(ed)e(b)s(elo)m(w)i(\(see)h(Section) | |
| 11986 | f(8.7)h([Programmable)150 3477 y(Completion)28 b(Builtins],)g(page)g | |
| 28157acd | 11987 | (111\),)i(to)e(generate)h(the)e(matc)m(hes.)41 b(It)27 |
| 37c41ab1 CR |
11988 | b(m)m(ust)g(put)g(the)g(p)s(ossible)g(comple-)150 3587 |
| 11989 | y(tions)k(in)f(the)g Fs(COMPREPLY)e Ft(arra)m(y)j(v)-5 | |
| 11990 | b(ariable.)275 3724 y(Next,)23 b(an)m(y)e(command)f(sp)s(eci\014ed)g | |
| 11991 | (with)g(the)h(`)p Fs(-C)p Ft(')f(option)h(is)g(in)m(v)m(ok)m(ed)h(in)e | |
| 11992 | (an)g(en)m(vironmen)m(t)h(equiv)-5 b(alen)m(t)150 3833 | |
| 11993 | y(to)26 b(command)e(substitution.)39 b(It)25 b(should)f(prin)m(t)h(a)g | |
| 11994 | (list)h(of)f(completions,)i(one)e(p)s(er)f(line,)j(to)f(the)f(standard) | |
| 11995 | 150 3943 y(output.)40 b(Bac)m(kslash)32 b(ma)m(y)f(b)s(e)f(used)g(to)h | |
| 11996 | (escap)s(e)g(a)f(newline,)h(if)f(necessary)-8 b(.)275 | |
| 11997 | 4080 y(After)42 b(all)g(of)g(the)g(p)s(ossible)g(completions)h(are)f | |
| 11998 | (generated,)k(an)m(y)c(\014lter)g(sp)s(eci\014ed)f(with)h(the)g(`)p | |
| 11999 | Fs(-X)p Ft(')150 4189 y(option)34 b(is)f(applied)g(to)h(the)f(list.)49 | |
| 12000 | b(The)33 b(\014lter)g(is)g(a)h(pattern)f(as)g(used)g(for)g(pathname)g | |
| 12001 | (expansion;)h(a)g(`)p Fs(&)p Ft(')150 4299 y(in)39 b(the)g(pattern)g | |
| 12002 | (is)g(replaced)g(with)g(the)g(text)h(of)f(the)g(w)m(ord)g(b)s(eing)f | |
| 12003 | (completed.)68 b(A)39 b(literal)h(`)p Fs(&)p Ft(')f(ma)m(y)150 | |
| 12004 | 4408 y(b)s(e)e(escap)s(ed)h(with)g(a)h(bac)m(kslash;)k(the)38 | |
| 12005 | b(bac)m(kslash)h(is)f(remo)m(v)m(ed)h(b)s(efore)e(attempting)j(a)e | |
| 12006 | (matc)m(h.)65 b(An)m(y)150 4518 y(completion)35 b(that)g(matc)m(hes)g | |
| 12007 | (the)f(pattern)g(will)g(b)s(e)g(remo)m(v)m(ed)h(from)e(the)h(list.)53 | |
| 12008 | b(A)34 b(leading)g(`)p Fs(!)p Ft(')h(negates)150 4628 | |
| 12009 | y(the)c(pattern;)f(in)g(this)h(case)g(an)m(y)g(completion)g(not)g(matc) | |
| 12010 | m(hing)h(the)e(pattern)h(will)f(b)s(e)g(remo)m(v)m(ed.)275 | |
| 12011 | 4765 y(Finally)-8 b(,)33 b(an)m(y)f(pre\014x)f(and)g(su\016x)g(sp)s | |
| 12012 | (eci\014ed)g(with)h(the)g(`)p Fs(-P)p Ft(')f(and)g(`)p | |
| 12013 | Fs(-S)p Ft(')h(options)g(are)g(added)f(to)i(eac)m(h)150 | |
| 12014 | 4874 y(mem)m(b)s(er)e(of)g(the)h(completion)h(list,)f(and)f(the)h | |
| 12015 | (result)f(is)h(returned)e(to)i(the)g(Readline)g(completion)h(co)s(de) | |
| 12016 | 150 4984 y(as)e(the)f(list)h(of)g(p)s(ossible)f(completions.)275 | |
| 12017 | 5121 y(If)22 b(the)i(previously-applied)f(actions)i(do)e(not)h | |
| 12018 | (generate)h(an)m(y)f(matc)m(hes,)i(and)d(the)g(`)p Fs(-o)30 | |
| 12019 | b(dirnames)p Ft(')22 b(op-)150 5230 y(tion)29 b(w)m(as)f(supplied)f(to) | |
| 12020 | i Fs(complete)d Ft(when)h(the)h(compsp)s(ec)g(w)m(as)g(de\014ned,)g | |
| 12021 | (directory)g(name)h(completion)150 5340 y(is)h(attempted.)p | |
| 12022 | eop end | |
| 28157acd CR |
12023 | %%Page: 111 117 |
| 12024 | TeXDict begin 111 116 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 12025 | b(Command)29 b(Line)i(Editing)2062 b(111)275 299 y(If)30 | |
| 37c41ab1 | 12026 | b(the)i(`)p Fs(-o)e(plusdirs)p Ft(')f(option)j(w)m(as)f(supplied)f(to)i |
| 113d85a4 | 12027 | Fs(complete)e Ft(when)g(the)h(compsp)s(ec)g(w)m(as)h(de\014ned,)150 |
| 37c41ab1 CR |
12028 | 408 y(directory)k(name)f(completion)i(is)e(attempted)h(and)f(an)m(y)h |
| 12029 | (matc)m(hes)g(are)g(added)f(to)h(the)f(results)g(of)h(the)150 | |
| 12030 | 518 y(other)31 b(actions.)275 659 y(By)g(default,)i(if)e(a)h(compsp)s | |
| 12031 | (ec)f(is)h(found,)f(whatev)m(er)h(it)g(generates)h(is)e(returned)g(to)h | |
| 12032 | (the)g(completion)150 769 y(co)s(de)21 b(as)g(the)g(full)g(set)g(of)g | |
| 12033 | (p)s(ossible)f(completions.)39 b(The)20 b(default)h(Bash)g(completions) | |
| 12034 | h(are)g(not)f(attempted,)150 879 y(and)k(the)h(Readline)g(default)g(of) | |
| 12035 | g(\014lename)g(completion)h(is)f(disabled.)38 b(If)26 | |
| 113d85a4 | 12036 | b(the)g(`)p Fs(-o)k(bashdefault)p Ft(')22 b(option)150 |
| 37c41ab1 CR |
12037 | 988 y(w)m(as)i(supplied)e(to)j Fs(complete)c Ft(when)i(the)g(compsp)s |
| 12038 | (ec)h(w)m(as)g(de\014ned,)g(the)f(default)h(Bash)g(completions)h(are) | |
| 12039 | 150 1098 y(attempted)f(if)f(the)g(compsp)s(ec)g(generates)i(no)e(matc)m | |
| 113d85a4 | 12040 | (hes.)39 b(If)23 b(the)g(`)p Fs(-o)30 b(default)p Ft(')21 |
| 37c41ab1 CR |
12041 | b(option)j(w)m(as)f(supplied)f(to)150 1207 y Fs(complete)j |
| 12042 | Ft(when)h(the)h(compsp)s(ec)f(w)m(as)i(de\014ned,)e(Readline's)i | |
| 12043 | (default)f(completion)h(will)f(b)s(e)f(p)s(erformed)150 | |
| 12044 | 1317 y(if)k(the)h(compsp)s(ec)f(\(and,)g(if)h(attempted,)g(the)g | |
| 12045 | (default)f(Bash)h(completions\))h(generate)g(no)e(matc)m(hes.)275 | |
| 12046 | 1458 y(When)20 b(a)i(compsp)s(ec)e(indicates)i(that)g(directory)g(name) | |
| 12047 | f(completion)h(is)f(desired,)i(the)e(programmable)150 | |
| 12048 | 1568 y(completion)31 b(functions)e(force)i(Readline)f(to)h(app)s(end)d | |
| 12049 | (a)i(slash)g(to)g(completed)h(names)e(whic)m(h)h(are)g(sym-)150 | |
| 12050 | 1678 y(b)s(olic)40 b(links)g(to)h(directories,)j(sub)5 | |
| 12051 | b(ject)40 b(to)h(the)f(v)-5 b(alue)41 b(of)f(the)g Fq(mark-directories) | |
| 12052 | 45 b Ft(Readline)c(v)-5 b(ariable,)150 1787 y(regardless)31 | |
| 12053 | b(of)f(the)h(setting)g(of)g(the)f Fq(mark-symlink)m(ed-directories)36 | |
| 12054 | b Ft(Readline)31 b(v)-5 b(ariable.)150 2062 y Fr(8.7)68 | |
| 12055 | b(Programmable)47 b(Completion)f(Builtins)275 2313 y | |
| 12056 | Ft(Tw)m(o)30 b(builtin)g(commands)g(are)h(a)m(v)-5 b(ailable)32 | |
| 12057 | b(to)f(manipulate)g(the)g(programmable)f(completion)i(facil-)150 | |
| 12058 | 2423 y(ities.)150 2592 y Fs(compgen)870 2730 y(compgen)46 | |
| 12059 | b([)p Fj(option)11 b Fs(])45 b([)p Fj(word)11 b Fs(])630 | |
| 12060 | 2868 y Ft(Generate)27 b(p)s(ossible)e(completion)i(matc)m(hes)g(for)e | |
| 12061 | Fq(w)m(ord)k Ft(according)e(to)f(the)g Fq(option)p Ft(s,)h(whic)m(h)630 | |
| 12062 | 2978 y(ma)m(y)h(b)s(e)f(an)m(y)h(option)g(accepted)h(b)m(y)e(the)h | |
| 12063 | Fs(complete)d Ft(builtin)j(with)f(the)h(exception)g(of)g(`)p | |
| 12064 | Fs(-p)p Ft(')630 3088 y(and)k(`)p Fs(-r)p Ft(',)i(and)e(write)h(the)g | |
| 12065 | (matc)m(hes)h(to)g(the)f(standard)f(output.)48 b(When)33 | |
| 12066 | b(using)f(the)h(`)p Fs(-F)p Ft(')630 3197 y(or)28 b(`)p | |
| 12067 | Fs(-C)p Ft(')g(options,)h(the)f(v)-5 b(arious)29 b(shell)f(v)-5 | |
| 12068 | b(ariables)29 b(set)f(b)m(y)g(the)g(programmable)h(completion)630 | |
| 12069 | 3307 y(facilities,)k(while)d(a)m(v)-5 b(ailable,)33 b(will)e(not)g(ha)m | |
| 12070 | (v)m(e)g(useful)f(v)-5 b(alues.)630 3445 y(The)34 b(matc)m(hes)h(will)g | |
| 12071 | (b)s(e)f(generated)h(in)f(the)h(same)g(w)m(a)m(y)g(as)g(if)f(the)h | |
| 12072 | (programmable)f(com-)630 3554 y(pletion)d(co)s(de)g(had)f(generated)i | |
| 12073 | (them)e(directly)i(from)e(a)h(completion)h(sp)s(eci\014cation)f(with) | |
| 12074 | 630 3664 y(the)e(same)h(\015ags.)40 b(If)29 b Fq(w)m(ord)j | |
| 12075 | Ft(is)d(sp)s(eci\014ed,)g(only)g(those)h(completions)g(matc)m(hing)g | |
| 12076 | Fq(w)m(ord)j Ft(will)630 3773 y(b)s(e)d(displa)m(y)m(ed.)630 | |
| 12077 | 3911 y(The)24 b(return)g(v)-5 b(alue)25 b(is)g(true)f(unless)g(an)h(in) | |
| 12078 | m(v)-5 b(alid)25 b(option)g(is)g(supplied,)f(or)h(no)g(matc)m(hes)g(w)m | |
| 113d85a4 CR |
12079 | (ere)630 4021 y(generated.)150 4187 y Fs(complete)870 |
| 12080 | 4325 y(complete)46 b([-abcdefgjksuv])d([-o)k Fj(comp-option)11 | |
| 5e13499c | 12081 | b Fs(])44 b([-A)j Fj(action)11 b Fs(])45 b([-G)i Fj(glob-)870 |
| 113d85a4 | 12082 | 4435 y(pat)11 b Fs(])46 b([-W)h Fj(wordlist)11 b Fs(])870 |
| 28157acd CR |
12083 | 4544 y([-P)47 b Fj(prefix)11 b Fs(])45 b([-S)i Fj(suffix)11 |
| 12084 | b Fs(])45 b([-X)i Fj(filterpat)11 b Fs(])45 b([-F)i Fj(function)11 | |
| 12085 | b Fs(])870 4654 y([-C)47 b Fj(command)11 b Fs(])45 b | |
| 12086 | Fj(name)57 b Fs([)p Fj(name)g Fs(...)o(])870 4764 y(complete)46 | |
| 37c41ab1 CR |
12087 | b(-pr)g([)p Fj(name)57 b Fs(...])630 4902 y Ft(Sp)s(ecify)33 |
| 12088 | b(ho)m(w)h(argumen)m(ts)h(to)f(eac)m(h)i Fq(name)j Ft(should)33 | |
| 12089 | b(b)s(e)g(completed.)53 b(If)33 b(the)i(`)p Fs(-p)p Ft(')e(option)630 | |
| 12090 | 5011 y(is)d(supplied,)e(or)i(if)g(no)f(options)h(are)g(supplied,)f | |
| 5e13499c | 12091 | (existing)h(completion)h(sp)s(eci\014cations)g(are)630 |
| 37c41ab1 CR |
12092 | 5121 y(prin)m(ted)43 b(in)h(a)g(w)m(a)m(y)h(that)f(allo)m(ws)h(them)f |
| 12093 | (to)g(b)s(e)g(reused)f(as)h(input.)80 b(The)43 b(`)p | |
| 12094 | Fs(-r)p Ft(')g(option)630 5230 y(remo)m(v)m(es)29 b(a)f(completion)h | |
| 12095 | (sp)s(eci\014cation)f(for)g(eac)m(h)g Fq(name)p Ft(,)h(or,)f(if)g(no)f | |
| 12096 | Fq(name)5 b Ft(s)28 b(are)g(supplied,)630 5340 y(all)j(completion)h(sp) | |
| 12097 | s(eci\014cations.)p eop end | |
| 28157acd CR |
12098 | %%Page: 112 118 |
| 12099 | TeXDict begin 112 117 bop 150 -116 a Ft(112)2527 b(Bash)31 | |
| 37c41ab1 CR |
12100 | b(Reference)g(Man)m(ual)630 299 y(The)e(pro)s(cess)g(of)h(applying)g |
| 12101 | (these)g(completion)g(sp)s(eci\014cations)h(when)d(w)m(ord)i | |
| 12102 | (completion)630 408 y(is)35 b(attempted)h(is)f(describ)s(ed)f(ab)s(o)m | |
| 12103 | (v)m(e)j(\(see)f(Section)g(8.6)g([Programmable)g(Completion],)630 | |
| 28157acd | 12104 | 518 y(page)31 b(109\).)630 650 y(Other)41 b(options,)46 |
| 37c41ab1 | 12105 | b(if)41 b(sp)s(eci\014ed,)j(ha)m(v)m(e)f(the)f(follo)m(wing)i |
| 22e63b05 | 12106 | (meanings.)75 b(The)41 b(argumen)m(ts)h(to)630 760 y(the)e(`)p |
| 37c41ab1 CR |
12107 | Fs(-G)p Ft(',)j(`)p Fs(-W)p Ft(',)g(and)d(`)p Fs(-X)p |
| 12108 | Ft(')g(options)g(\(and,)j(if)d(necessary)-8 b(,)44 b(the)c(`)p | |
| 12109 | Fs(-P)p Ft(')h(and)e(`)p Fs(-S)p Ft(')h(options\))630 | |
| 22e63b05 | 12110 | 869 y(should)30 b(b)s(e)h(quoted)g(to)h(protect)g(them)f(from)g |
| 37c41ab1 | 12111 | (expansion)g(b)s(efore)g(the)g Fs(complete)e Ft(builtin)630 |
| 22e63b05 CR |
12112 | 979 y(is)h(in)m(v)m(ok)m(ed.)630 1134 y Fs(-o)g Fj(comp-option)1110 |
| 12113 | 1244 y Ft(The)c Fq(comp-option)i Ft(con)m(trols)g(sev)m(eral)h(asp)s | |
| 37c41ab1 | 12114 | (ects)e(of)g(the)g(compsp)s(ec's)g(b)s(eha)m(v-)1110 |
| 22e63b05 | 12115 | 1353 y(ior)g(b)s(ey)m(ond)f(the)g(simple)h(generation)h(of)e |
| 37c41ab1 | 12116 | (completions.)41 b Fq(comp-option)27 b Ft(ma)m(y)1110 |
| 22e63b05 CR |
12117 | 1463 y(b)s(e)j(one)g(of:)1110 1618 y Fs(bashdefault)1590 |
| 12118 | 1727 y Ft(P)m(erform)d(the)h(rest)f(of)h(the)g(default)f(Bash)h | |
| 12119 | (completions)g(if)g(the)1590 1837 y(compsp)s(ec)i(generates)i(no)e | |
| 12120 | (matc)m(hes.)1110 1992 y Fs(default)144 b Ft(Use)22 b(Readline's)g | |
| 37c41ab1 | 12121 | (default)g(\014lename)g(completion)g(if)g(the)g(comp-)1590 |
| 22e63b05 CR |
12122 | 2101 y(sp)s(ec)30 b(generates)i(no)e(matc)m(hes.)1110 |
| 12123 | 2256 y Fs(dirnames)96 b Ft(P)m(erform)46 b(directory)g(name)h | |
| 12124 | (completion)g(if)f(the)g(compsp)s(ec)1590 2366 y(generates)32 | |
| 12125 | b(no)e(matc)m(hes.)1110 2521 y Fs(filenames)1590 2630 | |
| 37c41ab1 | 12126 | y Ft(T)-8 b(ell)40 b(Readline)f(that)h(the)f(compsp)s(ec)f(generates)j |
| 22e63b05 | 12127 | (\014lenames,)1590 2740 y(so)29 b(it)h(can)f(p)s(erform)f(an)m(y)h |
| 37c41ab1 | 12128 | (\014lename-sp)s(eci\014c)h(pro)s(cessing)e(\(lik)m(e)1590 |
| 22e63b05 CR |
12129 | 2850 y(adding)h(a)h(slash)f(to)h(directory)g(names)f(or)g(suppressing)f |
| 12130 | (trail-)1590 2959 y(ing)38 b(spaces\).)66 b(This)37 b(option)i(is)f(in) | |
| 12131 | m(tended)g(to)h(b)s(e)f(used)f(with)1590 3069 y(shell)31 | |
| 37c41ab1 | 12132 | b(functions)f(sp)s(eci\014ed)f(with)h(`)p Fs(-F)p Ft('.)1110 |
| 22e63b05 CR |
12133 | 3224 y Fs(nospace)144 b Ft(T)-8 b(ell)40 b(Readline)g(not)g(to)g(app)s |
| 12134 | (end)d(a)j(space)g(\(the)f(default\))h(to)1590 3333 y(w)m(ords)30 | |
| 12135 | b(completed)h(at)g(the)g(end)f(of)g(the)h(line.)1110 | |
| 12136 | 3488 y Fs(plusdirs)96 b Ft(After)30 b(an)m(y)h(matc)m(hes)g(de\014ned)d | |
| 12137 | (b)m(y)i(the)g(compsp)s(ec)g(are)g(gener-)1590 3598 y(ated,)g | |
| 12138 | (directory)f(name)g(completion)i(is)d(attempted)i(and)f(an)m(y)1590 | |
| 12139 | 3707 y(matc)m(hes)j(are)e(added)g(to)h(the)g(results)f(of)g(the)h | |
| 12140 | (other)g(actions.)630 3862 y Fs(-A)f Fj(action)1110 3972 | |
| 12141 | y Ft(The)25 b Fq(action)h Ft(ma)m(y)g(b)s(e)e(one)h(of)h(the)f(follo)m | |
| 12142 | (wing)i(to)e(generate)i(a)e(list)h(of)f(p)s(ossible)1110 | |
| 12143 | 4082 y(completions:)1110 4237 y Fs(alias)240 b Ft(Alias)31 | |
| 12144 | b(names.)41 b(Ma)m(y)31 b(also)h(b)s(e)e(sp)s(eci\014ed)f(as)i(`)p | |
| 12145 | Fs(-a)p Ft('.)1110 4391 y Fs(arrayvar)96 b Ft(Arra)m(y)31 | |
| 12146 | b(v)-5 b(ariable)31 b(names.)1110 4546 y Fs(binding)144 | |
| 12147 | b Ft(Readline)30 b(k)m(ey)f(binding)f(names)h(\(see)h(Section)f(8.4)h | |
| 28157acd | 12148 | ([Bindable)1590 4656 y(Readline)h(Commands],)f(page)h(101\).)1110 |
| 22e63b05 CR |
12149 | 4811 y Fs(builtin)144 b Ft(Names)21 b(of)g(shell)f(builtin)h(commands.) |
| 12150 | 37 b(Ma)m(y)21 b(also)h(b)s(e)e(sp)s(eci\014ed)1590 4921 | |
| 12151 | y(as)31 b(`)p Fs(-b)p Ft('.)1110 5075 y Fs(command)144 | |
| 37c41ab1 | 12152 | b Ft(Command)29 b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s |
| 22e63b05 CR |
12153 | (eci\014ed)f(as)i(`)p Fs(-c)p Ft('.)1110 5230 y Fs(directory)1590 |
| 12154 | 5340 y Ft(Directory)h(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s | |
| 12155 | (eci\014ed)g(as)g(`)p Fs(-d)p Ft('.)p eop end | |
| 28157acd CR |
12156 | %%Page: 113 119 |
| 12157 | TeXDict begin 113 118 bop 150 -116 a Ft(Chapter)30 b(8:)41 | |
| 12158 | b(Command)29 b(Line)i(Editing)2062 b(113)1110 299 y Fs(disabled)96 | |
| 22e63b05 CR |
12159 | b Ft(Names)31 b(of)g(disabled)f(shell)g(builtins.)1110 |
| 12160 | 458 y Fs(enabled)144 b Ft(Names)31 b(of)g(enabled)f(shell)g(builtins.) | |
| 12161 | 1110 617 y Fs(export)192 b Ft(Names)34 b(of)f(exp)s(orted)f(shell)h(v) | |
| 12162 | -5 b(ariables.)49 b(Ma)m(y)35 b(also)e(b)s(e)g(sp)s(eci-)1590 | |
| 12163 | 726 y(\014ed)d(as)g(`)p Fs(-e)p Ft('.)1110 885 y Fs(file)288 | |
| 12164 | b Ft(File)32 b(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f | |
| 12165 | (as)i(`)p Fs(-f)p Ft('.)1110 1044 y Fs(function)96 b | |
| 12166 | Ft(Names)31 b(of)g(shell)f(functions.)1110 1203 y Fs(group)240 | |
| 12167 | b Ft(Group)30 b(names.)40 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)g | |
| 12168 | (as)g(`)p Fs(-g)p Ft('.)1110 1362 y Fs(helptopic)1590 | |
| 12169 | 1471 y Ft(Help)37 b(topics)g(as)g(accepted)h(b)m(y)e(the)h | |
| 12170 | Fs(help)f Ft(builtin)g(\(see)h(Sec-)1590 1581 y(tion)31 | |
| ac18b312 | 12171 | b(4.2)g([Bash)g(Builtins],)g(page)g(41\).)1110 1740 y |
| 22e63b05 CR |
12172 | Fs(hostname)96 b Ft(Hostnames,)89 b(as)76 b(tak)m(en)h(from)f(the)g |
| 12173 | (\014le)h(sp)s(eci\014ed)e(b)m(y)1590 1850 y(the)55 b | |
| 12174 | Fs(HOSTFILE)e Ft(shell)j(v)-5 b(ariable)56 b(\(see)g(Section)g(5.2)h | |
| 28157acd | 12175 | ([Bash)1590 1959 y(V)-8 b(ariables],)32 b(page)f(57\).)1110 |
| 22e63b05 CR |
12176 | 2118 y Fs(job)336 b Ft(Job)31 b(names,)h(if)g(job)f(con)m(trol)i(is)f |
| 12177 | (activ)m(e.)46 b(Ma)m(y)33 b(also)g(b)s(e)e(sp)s(eci-)1590 | |
| 12178 | 2228 y(\014ed)f(as)g(`)p Fs(-j)p Ft('.)1110 2387 y Fs(keyword)144 | |
| 12179 | b Ft(Shell)30 b(reserv)m(ed)h(w)m(ords.)40 b(Ma)m(y)32 | |
| 12180 | b(also)f(b)s(e)f(sp)s(eci\014ed)f(as)i(`)p Fs(-k)p Ft('.)1110 | |
| 12181 | 2545 y Fs(running)144 b Ft(Names)31 b(of)g(running)d(jobs,)i(if)h(job)f | |
| 12182 | (con)m(trol)h(is)g(activ)m(e.)1110 2704 y Fs(service)144 | |
| 12183 | b Ft(Service)31 b(names.)41 b(Ma)m(y)31 b(also)g(b)s(e)f(sp)s | |
| 12184 | (eci\014ed)g(as)g(`)p Fs(-s)p Ft('.)1110 2863 y Fs(setopt)192 | |
| 12185 | b Ft(V)-8 b(alid)34 b(argumen)m(ts)f(for)f(the)h(`)p | |
| 12186 | Fs(-o)p Ft(')g(option)g(to)h(the)f Fs(set)e Ft(builtin)1590 | |
| 28157acd | 12187 | 2973 y(\(see)g(Section)h(4.3)f([The)f(Set)h(Builtin],)g(page)g(53\).) |
| 22e63b05 | 12188 | 1110 3132 y Fs(shopt)240 b Ft(Shell)40 b(option)g(names)g(as)g |
| 5e13499c | 12189 | (accepted)i(b)m(y)e(the)g Fs(shopt)e Ft(builtin)1590 |
| ac18b312 | 12190 | 3241 y(\(see)31 b(Section)h(4.2)f([Bash)g(Builtins],)g(page)g(41\).) |
| 22e63b05 CR |
12191 | 1110 3400 y Fs(signal)192 b Ft(Signal)31 b(names.)1110 |
| 12192 | 3559 y Fs(stopped)144 b Ft(Names)31 b(of)g(stopp)s(ed)e(jobs,)h(if)g | |
| 12193 | (job)g(con)m(trol)i(is)f(activ)m(e.)1110 3718 y Fs(user)288 | |
| 37c41ab1 | 12194 | b Ft(User)30 b(names.)41 b(Ma)m(y)32 b(also)f(b)s(e)f(sp)s(eci\014ed)f |
| 22e63b05 | 12195 | (as)i(`)p Fs(-u)p Ft('.)1110 3877 y Fs(variable)96 b |
| 37c41ab1 CR |
12196 | Ft(Names)36 b(of)g(all)g(shell)g(v)-5 b(ariables.)56 |
| 12197 | b(Ma)m(y)37 b(also)f(b)s(e)f(sp)s(eci\014ed)g(as)1590 | |
| 22e63b05 CR |
12198 | 3987 y(`)p Fs(-v)p Ft('.)630 4145 y Fs(-G)30 b Fj(globpat)1110 |
| 12199 | 4255 y Ft(The)39 b(\014lename)h(expansion)g(pattern)g | |
| 12200 | Fq(globpat)j Ft(is)d(expanded)f(to)h(generate)1110 4365 | |
| 12201 | y(the)31 b(p)s(ossible)e(completions.)630 4524 y Fs(-W)h | |
| 12202 | Fj(wordlist)1110 4633 y Ft(The)24 b Fq(w)m(ordlist)k | |
| 37c41ab1 | 12203 | Ft(is)d(split)g(using)f(the)h(c)m(haracters)i(in)d(the)i |
| 22e63b05 | 12204 | Fs(IFS)e Ft(sp)s(ecial)h(v)-5 b(ariable)1110 4743 y(as)36 |
| 37c41ab1 | 12205 | b(delimiters,)i(and)e(eac)m(h)h(resultan)m(t)g(w)m(ord)e(is)h |
| 22e63b05 | 12206 | (expanded.)57 b(The)35 b(p)s(ossible)1110 4852 y(completions)c(are)e |
| 37c41ab1 | 12207 | (the)h(mem)m(b)s(ers)f(of)g(the)h(resultan)m(t)g(list)g(whic)m(h)f |
| 22e63b05 CR |
12208 | (matc)m(h)i(the)1110 4962 y(w)m(ord)f(b)s(eing)g(completed.)630 |
| 12209 | 5121 y Fs(-C)g Fj(command)1110 5230 y Fq(command)35 b | |
| 37c41ab1 | 12210 | Ft(is)e(executed)g(in)e(a)i(subshell)e(en)m(vironmen)m(t,)i(and)f(its)g |
| 22e63b05 | 12211 | (output)g(is)1110 5340 y(used)e(as)g(the)h(p)s(ossible)f(completions.)p |
| 37c41ab1 | 12212 | eop end |
| 28157acd CR |
12213 | %%Page: 114 120 |
| 12214 | TeXDict begin 114 119 bop 150 -116 a Ft(114)2527 b(Bash)31 | |
| 22e63b05 CR |
12215 | b(Reference)g(Man)m(ual)630 299 y Fs(-F)f Fj(function)1110 |
| 12216 | 408 y Ft(The)25 b(shell)i(function)e Fq(function)h Ft(is)g(executed)h | |
| 12217 | (in)e(the)i(curren)m(t)e(shell)i(en)m(viron-)1110 518 | |
| 12218 | y(men)m(t.)40 b(When)25 b(it)h(\014nishes,)f(the)h(p)s(ossible)f | |
| 12219 | (completions)h(are)g(retriev)m(ed)g(from)1110 628 y(the)31 | |
| 12220 | b(v)-5 b(alue)30 b(of)h(the)g Fs(COMPREPLY)c Ft(arra)m(y)k(v)-5 | |
| 12221 | b(ariable.)630 787 y Fs(-X)30 b Fj(filterpat)1110 897 | |
| 12222 | y Fq(\014lterpat)d Ft(is)e(a)g(pattern)g(as)f(used)g(for)h(\014lename)g | |
| 12223 | (expansion.)38 b(It)25 b(is)g(applied)f(to)1110 1006 | |
| 12224 | y(the)30 b(list)f(of)h(p)s(ossible)f(completions)h(generated)h(b)m(y)e | |
| 12225 | (the)g(preceding)h(options)1110 1116 y(and)d(argumen)m(ts,)i(and)e(eac) | |
| 12226 | m(h)i(completion)g(matc)m(hing)g Fq(\014lterpat)h Ft(is)e(remo)m(v)m | |
| 12227 | (ed)1110 1225 y(from)i(the)h(list.)42 b(A)30 b(leading)i(`)p | |
| 12228 | Fs(!)p Ft(')e(in)g Fq(\014lterpat)j Ft(negates)f(the)f(pattern;)g(in)f | |
| 12229 | (this)1110 1335 y(case,)i(an)m(y)e(completion)i(not)f(matc)m(hing)g | |
| 12230 | Fq(\014lterpat)i Ft(is)d(remo)m(v)m(ed.)630 1494 y Fs(-P)g | |
| 12231 | Fj(prefix)1110 1604 y Fq(pre\014x)39 b Ft(is)34 b(added)f(at)i(the)f(b) | |
| 12232 | s(eginning)f(of)i(eac)m(h)g(p)s(ossible)e(completion)i(after)1110 | |
| 12233 | 1714 y(all)c(other)g(options)g(ha)m(v)m(e)g(b)s(een)f(applied.)630 | |
| 12234 | 1873 y Fs(-S)g Fj(suffix)1110 1983 y Fq(su\016x)c Ft(is)20 | |
| 12235 | b(app)s(ended)f(to)i(eac)m(h)h(p)s(ossible)e(completion)i(after)f(all)g | |
| 12236 | (other)g(options)1110 2092 y(ha)m(v)m(e)32 b(b)s(een)d(applied.)630 | |
| 12237 | 2252 y(The)35 b(return)g(v)-5 b(alue)37 b(is)f(true)f(unless)h(an)f(in) | |
| 12238 | m(v)-5 b(alid)37 b(option)f(is)g(supplied,)g(an)g(option)h(other)630 | |
| 12239 | 2361 y(than)31 b(`)p Fs(-p)p Ft(')g(or)g(`)p Fs(-r)p | |
| 37c41ab1 | 12240 | Ft(')g(is)g(supplied)f(without)h(a)g Fq(name)37 b Ft(argumen)m(t,)32 |
| 22e63b05 | 12241 | b(an)f(attempt)h(is)f(made)g(to)630 2471 y(remo)m(v)m(e)h(a)e |
| 37c41ab1 CR |
12242 | (completion)i(sp)s(eci\014cation)f(for)f(a)h Fq(name)k |
| 12243 | Ft(for)30 b(whic)m(h)g(no)g(sp)s(eci\014cation)h(exists,)630 | |
| 22e63b05 | 12244 | 2580 y(or)f(an)h(error)f(o)s(ccurs)g(adding)g(a)g(completion)i(sp)s |
| 37c41ab1 | 12245 | (eci\014cation.)p eop end |
| 28157acd CR |
12246 | %%Page: 115 121 |
| 12247 | TeXDict begin 115 120 bop 150 -116 a Ft(Chapter)30 b(9:)41 | |
| 12248 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(115)150 | |
| 12249 | 299 y Fo(9)80 b(Using)53 b(History)g(In)l(teractiv)l(ely)275 | |
| 12250 | 562 y Ft(This)32 b(c)m(hapter)i(describ)s(es)e(ho)m(w)h(to)h(use)f(the) | |
| 12251 | g Fl(gnu)g Ft(History)h(Library)e(in)m(teractiv)m(ely)-8 | |
| 12252 | b(,)37 b(from)c(a)h(user's)150 671 y(standp)s(oin)m(t.)76 | |
| 37c41ab1 CR |
12253 | b(It)42 b(should)f(b)s(e)h(considered)g(a)g(user's)g(guide.)76 |
| 12254 | b(F)-8 b(or)43 b(information)f(on)g(using)g(the)g Fl(gnu)150 | |
| 28157acd CR |
12255 | 781 y Ft(History)31 b(Library)f(in)g(other)g(programs,)g(see)h(the)g |
| 12256 | Fl(gnu)f Ft(Readline)h(Library)f(Man)m(ual.)150 1062 | |
| 5e13499c | 12257 | y Fr(9.1)68 b(Bash)45 b(History)h(F)-11 b(acilities)275 |
| 28157acd CR |
12258 | 1316 y Ft(When)36 b(the)h(`)p Fs(-o)30 b(history)p Ft(')k(option)j(to)h |
| 12259 | (the)e Fs(set)g Ft(builtin)g(is)h(enabled)f(\(see)i(Section)f(4.3)g | |
| 12260 | ([The)g(Set)150 1425 y(Builtin],)32 b(page)g(53\),)h(the)e(shell)h(pro) | |
| 12261 | m(vides)f(access)h(to)g(the)f Fq(command)g(history)p | |
| 12262 | Ft(,)h(the)f(list)h(of)f(commands)150 1535 y(previously)h(t)m(yp)s(ed.) | |
| 12263 | 47 b(The)33 b(v)-5 b(alue)33 b(of)f(the)h Fs(HISTSIZE)e | |
| 37c41ab1 | 12264 | Ft(shell)h(v)-5 b(ariable)34 b(is)f(used)e(as)i(the)g(n)m(um)m(b)s(er)e |
| 28157acd | 12265 | (of)i(com-)150 1644 y(mands)i(to)i(sa)m(v)m(e)h(in)e(a)g(history)h |
| 37c41ab1 | 12266 | (list.)58 b(The)36 b(text)h(of)g(the)f(last)h Fs($HISTSIZE)d |
| 28157acd | 12267 | Ft(commands)i(\(default)g(500\))150 1754 y(is)h(sa)m(v)m(ed.)61 |
| 37c41ab1 CR |
12268 | b(The)36 b(shell)h(stores)h(eac)m(h)g(command)e(in)h(the)g(history)g |
| 12269 | (list)g(prior)f(to)i(parameter)f(and)f(v)-5 b(ari-)150 | |
| 28157acd | 12270 | 1864 y(able)33 b(expansion)g(but)f(after)h(history)f(expansion)h(is)g |
| 37c41ab1 | 12271 | (p)s(erformed,)e(sub)5 b(ject)33 b(to)g(the)g(v)-5 b(alues)33 |
| 28157acd CR |
12272 | b(of)g(the)g(shell)150 1973 y(v)-5 b(ariables)31 b Fs(HISTIGNORE)d |
| 12273 | Ft(and)h Fs(HISTCONTROL)p Ft(.)275 2117 y(When)g(the)g(shell)h(starts)g | |
| 37c41ab1 | 12274 | (up,)f(the)h(history)f(is)h(initialized)h(from)e(the)h(\014le)f(named)g |
| 28157acd | 12275 | (b)m(y)h(the)f Fs(HISTFILE)150 2227 y Ft(v)-5 b(ariable)21 |
| 37c41ab1 CR |
12276 | b(\(default)h(`)p Fs(~/.bash_history)p Ft('\).)34 b(The)20 |
| 12277 | b(\014le)h(named)f(b)m(y)h(the)g(v)-5 b(alue)21 b(of)g | |
| 28157acd | 12278 | Fs(HISTFILE)d Ft(is)j(truncated,)150 2336 y(if)42 b(necessary)-8 |
| 37c41ab1 CR |
12279 | b(,)45 b(to)e(con)m(tain)g(no)f(more)g(than)f(the)h(n)m(um)m(b)s(er)f |
| 12280 | (of)h(lines)g(sp)s(eci\014ed)f(b)m(y)h(the)g(v)-5 b(alue)42 | |
| 28157acd | 12281 | b(of)g(the)150 2446 y Fs(HISTFILESIZE)21 b Ft(v)-5 b(ariable.)40 |
| 37c41ab1 | 12282 | b(When)24 b(an)g(in)m(teractiv)m(e)j(shell)e(exits,)h(the)f(last)g |
| 28157acd | 12283 | Fs($HISTSIZE)d Ft(lines)j(are)f(copied)150 2556 y(from)29 |
| 37c41ab1 | 12284 | b(the)i(history)e(list)i(to)g(the)f(\014le)g(named)f(b)m(y)h |
| 5e13499c | 12285 | Fs($HISTFILE)p Ft(.)38 b(If)30 b(the)g Fs(histappend)d |
| 28157acd | 12286 | Ft(shell)j(option)g(is)g(set)150 2665 y(\(see)22 b(Section)g(4.2)g |
| ac18b312 | 12287 | ([Bash)g(Builtins],)h(page)f(41\),)j(the)c(lines)g(are)h(app)s(ended)d |
| 28157acd | 12288 | (to)j(the)f(history)g(\014le,)j(otherwise)150 2775 y(the)32 |
| 37c41ab1 CR |
12289 | b(history)f(\014le)g(is)h(o)m(v)m(erwritten.)45 b(If)31 |
| 12290 | b Fs(HISTFILE)e Ft(is)j(unset,)f(or)h(if)f(the)h(history)f(\014le)g(is) | |
| 28157acd | 12291 | h(un)m(writable,)g(the)150 2884 y(history)37 b(is)h(not)f(sa)m(v)m(ed.) |
| 37c41ab1 | 12292 | 63 b(After)38 b(sa)m(ving)g(the)f(history)-8 b(,)40 b(the)e(history)f |
| 28157acd | 12293 | (\014le)g(is)h(truncated)f(to)h(con)m(tain)h(no)150 2994 |
| 37c41ab1 CR |
12294 | y(more)31 b(than)f Fs($HISTFILESIZE)c Ft(lines.)41 b(If)30 |
| 12295 | b Fs(HISTFILESIZE)d Ft(is)k(not)f(set,)h(no)g(truncation)f(is)h(p)s | |
| 28157acd | 12296 | (erformed.)275 3138 y(If)g(the)h Fs(HISTTIMEFORMAT)d |
| 37c41ab1 | 12297 | Ft(is)j(set,)h(the)f(time)h(stamp)f(information)g(asso)s(ciated)i(with) |
| 28157acd CR |
12298 | e(eac)m(h)h(history)150 3247 y(en)m(try)e(is)f(written)g(to)i(the)e |
| 12299 | (history)g(\014le.)275 3392 y(The)19 b(builtin)h(command)g | |
| 12300 | Fs(fc)g Ft(ma)m(y)h(b)s(e)f(used)f(to)i(list)g(or)g(edit)g(and)e | |
| 12301 | (re-execute)j(a)f(p)s(ortion)f(of)g(the)h(history)150 | |
| 12302 | 3501 y(list.)41 b(The)27 b Fs(history)f Ft(builtin)i(ma)m(y)h(b)s(e)e | |
| 37c41ab1 | 12303 | (used)g(to)i(displa)m(y)g(or)f(mo)s(dify)f(the)h(history)g(list)h(and)f |
| 28157acd | 12304 | (manipulate)150 3611 y(the)j(history)g(\014le.)42 b(When)31 |
| 37c41ab1 | 12305 | b(using)f(command-line)h(editing,)h(searc)m(h)f(commands)g(are)g(a)m(v) |
| 28157acd | 12306 | -5 b(ailable)33 b(in)e(eac)m(h)150 3720 y(editing)45 |
| 37c41ab1 CR |
12307 | b(mo)s(de)g(that)g(pro)m(vide)g(access)h(to)f(the)g(history)f(list)i |
| 12308 | (\(see)f(Section)h(8.4.2)g([Commands)e(F)-8 b(or)150 | |
| 28157acd | 12309 | 3830 y(History],)31 b(page)h(101\).)275 3974 y(The)47 |
| 37c41ab1 CR |
12310 | b(shell)i(allo)m(ws)h(con)m(trol)f(o)m(v)m(er)h(whic)m(h)e(commands)g |
| 12311 | (are)h(sa)m(v)m(ed)g(on)f(the)h(history)f(list.)95 b(The)150 | |
| 28157acd | 12312 | 4084 y Fs(HISTCONTROL)25 b Ft(and)j Fs(HISTIGNORE)e Ft(v)-5 |
| 37c41ab1 | 12313 | b(ariables)29 b(ma)m(y)h(b)s(e)d(set)j(to)f(cause)g(the)g(shell)f(to)i |
| 28157acd | 12314 | (sa)m(v)m(e)g(only)f(a)g(subset)150 4193 y(of)e(the)g(commands)f(en)m |
| 37c41ab1 | 12315 | (tered.)40 b(The)26 b Fs(cmdhist)f Ft(shell)i(option,)h(if)f(enabled,)g |
| 28157acd | 12316 | (causes)h(the)e(shell)h(to)h(attempt)150 4303 y(to)23 |
| 37c41ab1 CR |
12317 | b(sa)m(v)m(e)h(eac)m(h)f(line)g(of)f(a)h(m)m(ulti-line)g(command)f(in)g |
| 12318 | (the)h(same)f(history)g(en)m(try)-8 b(,)25 b(adding)d(semicolons)h | |
| 28157acd | 12319 | (where)150 4412 y(necessary)37 b(to)f(preserv)m(e)h(syn)m(tactic)h |
| 37c41ab1 | 12320 | (correctness.)58 b(The)36 b Fs(lithist)e Ft(shell)i(option)h(causes)g |
| 28157acd | 12321 | (the)f(shell)g(to)150 4522 y(sa)m(v)m(e)25 b(the)e(command)h(with)f(em) |
| 37c41ab1 | 12322 | m(b)s(edded)f(newlines)h(instead)h(of)f(semicolons.)40 |
| 28157acd | 12323 | b(The)23 b Fs(shopt)e Ft(builtin)i(is)h(used)150 4631 |
| 37c41ab1 | 12324 | y(to)31 b(set)g(these)g(options.)41 b(See)31 b(Section)g(4.2)g([Bash)g |
| ac18b312 | 12325 | (Builtins],)g(page)g(41,)h(for)e(a)h(description)f(of)h |
| 28157acd CR |
12326 | Fs(shopt)p Ft(.)150 4913 y Fr(9.2)68 b(Bash)45 b(History)h(Builtins)275 |
| 12327 | 5166 y Ft(Bash)30 b(pro)m(vides)g(t)m(w)m(o)i(builtin)e(commands)g | |
| 37c41ab1 | 12328 | (whic)m(h)g(manipulate)h(the)f(history)h(list)g(and)f(history)g |
| 28157acd CR |
12329 | (\014le.)150 5340 y Fs(fc)p eop end |
| 12330 | %%Page: 116 122 | |
| 12331 | TeXDict begin 116 121 bop 150 -116 a Ft(116)2527 b(Bash)31 | |
| 12332 | b(Reference)g(Man)m(ual)870 299 y Fs(fc)47 b([-e)g Fj(ename)11 | |
| 12333 | b Fs(])46 b([-nlr])g([)p Fj(first)11 b Fs(])45 b([)p | |
| 12334 | Fj(last)11 b Fs(])870 408 y(fc)47 b(-s)g([)p Fj(pat)11 | |
| 12335 | b Fs(=)p Fj(rep)g Fs(])45 b([)p Fj(command)11 b Fs(])630 | |
| 12336 | 539 y Ft(Fix)41 b(Command.)68 b(In)39 b(the)i(\014rst)e(form,)j(a)e | |
| 12337 | (range)h(of)f(commands)g(from)f Fq(\014rst)i Ft(to)g | |
| 12338 | Fq(last)i Ft(is)630 648 y(selected)35 b(from)e(the)g(history)g(list.)50 | |
| 12339 | b(Both)34 b Fq(\014rst)h Ft(and)e Fq(last)j Ft(ma)m(y)e(b)s(e)e(sp)s | |
| 12340 | (eci\014ed)h(as)g(a)h(string)630 758 y(\(to)26 b(lo)s(cate)h(the)e | |
| 12341 | (most)h(recen)m(t)g(command)e(b)s(eginning)h(with)g(that)g(string\))h | |
| 12342 | (or)f(as)g(a)g(n)m(um)m(b)s(er)630 867 y(\(an)f(index)f(in)m(to)h(the)g | |
| 12343 | (history)g(list,)h(where)e(a)h(negativ)m(e)i(n)m(um)m(b)s(er)c(is)i | |
| 12344 | (used)f(as)g(an)h(o\013set)g(from)630 977 y(the)j(curren)m(t)f(command) | |
| 12345 | h(n)m(um)m(b)s(er\).)39 b(If)26 b Fq(last)j Ft(is)e(not)g(sp)s | |
| 12346 | (eci\014ed)f(it)h(is)g(set)g(to)h Fq(\014rst)p Ft(.)39 | |
| 12347 | b(If)26 b Fq(\014rst)i Ft(is)630 1087 y(not)j(sp)s(eci\014ed)f(it)h(is) | |
| 12348 | g(set)h(to)f(the)g(previous)f(command)h(for)f(editing)i(and)e | |
| 12349 | Fp(\000)p Ft(16)h(for)g(listing.)630 1196 y(If)f(the)g(`)p | |
| 12350 | Fs(-l)p Ft(')g(\015ag)h(is)f(giv)m(en,)h(the)g(commands)e(are)i(listed) | |
| 12351 | g(on)f(standard)f(output.)40 b(The)30 b(`)p Fs(-n)p Ft(')630 | |
| 12352 | 1306 y(\015ag)i(suppresses)f(the)h(command)g(n)m(um)m(b)s(ers)e(when)i | |
| 12353 | (listing.)46 b(The)32 b(`)p Fs(-r)p Ft(')g(\015ag)g(rev)m(erses)h(the) | |
| 12354 | 630 1415 y(order)g(of)g(the)h(listing.)50 b(Otherwise,)34 | |
| 12355 | b(the)f(editor)h(giv)m(en)g(b)m(y)f Fq(ename)39 b Ft(is)33 | |
| 12356 | b(in)m(v)m(ok)m(ed)i(on)e(a)h(\014le)630 1525 y(con)m(taining)i(those)f | |
| 12357 | (commands.)52 b(If)33 b Fq(ename)40 b Ft(is)34 b(not)h(giv)m(en,)h(the) | |
| 12358 | f(v)-5 b(alue)35 b(of)f(the)g(follo)m(wing)630 1634 y(v)-5 | |
| 12359 | b(ariable)33 b(expansion)e(is)h(used:)42 b Fs(${FCEDIT:-${EDITOR:-vi}}) | |
| 12360 | p Ft(.)d(This)31 b(sa)m(ys)h(to)g(use)g(the)630 1744 | |
| 12361 | y(v)-5 b(alue)34 b(of)f(the)h Fs(FCEDIT)e Ft(v)-5 b(ariable)34 | |
| 37c41ab1 | 12362 | b(if)f(set,)i(or)f(the)f(v)-5 b(alue)34 b(of)g(the)f |
| 28157acd | 12363 | Fs(EDITOR)f Ft(v)-5 b(ariable)34 b(if)f(that)630 1854 |
| 37c41ab1 CR |
12364 | y(is)g(set,)i(or)e Fs(vi)g Ft(if)g(neither)g(is)g(set.)50 |
| 12365 | b(When)33 b(editing)h(is)f(complete,)i(the)f(edited)f(commands)630 | |
| 28157acd | 12366 | 1963 y(are)e(ec)m(ho)s(ed)g(and)f(executed.)630 2093 |
| 37c41ab1 CR |
12367 | y(In)k(the)g(second)g(form,)h Fq(command)j Ft(is)c(re-executed)i(after) |
| 12368 | f(eac)m(h)g(instance)g(of)f Fq(pat)j Ft(in)d(the)630 | |
| 28157acd CR |
12369 | 2203 y(selected)e(command)e(is)g(replaced)h(b)m(y)g Fq(rep)p |
| 12370 | Ft(.)630 2333 y(A)g(useful)f(alias)i(to)g(use)e(with)h(the)g | |
| 37c41ab1 | 12371 | Fs(fc)f Ft(command)h(is)g Fs(r='fc)e(-s')p Ft(,)h(so)h(that)h(t)m |
| 28157acd | 12372 | (yping)f(`)p Fs(r)f(cc)p Ft(')630 2443 y(runs)35 b(the)h(last)h |
| 37c41ab1 | 12373 | (command)f(b)s(eginning)g(with)g Fs(cc)f Ft(and)h(t)m(yping)g(`)p |
| 28157acd CR |
12374 | Fs(r)p Ft(')h(re-executes)h(the)e(last)630 2552 y(command)30 |
| 12375 | b(\(see)h(Section)h(6.6)f([Aliases],)h(page)g(75\).)150 | |
| 12376 | 2703 y Fs(history)870 2833 y(history)46 b([)p Fj(n)11 | |
| 12377 | b Fs(])870 2943 y(history)46 b(-c)870 3052 y(history)g(-d)h | |
| 12378 | Fj(offset)870 3162 y Fs(history)f([-anrw])g([)p Fj(filename)11 | |
| 12379 | b Fs(])870 3271 y(history)46 b(-ps)h Fj(arg)630 3402 | |
| 37c41ab1 CR |
12380 | y Ft(With)26 b(no)g(options,)h(displa)m(y)f(the)g(history)g(list)g |
| 12381 | (with)f(line)h(n)m(um)m(b)s(ers.)38 b(Lines)26 b(pre\014xed)e(with)630 | |
| 28157acd | 12382 | 3511 y(a)35 b(`)p Fs(*)p Ft(')g(ha)m(v)m(e)h(b)s(een)e(mo)s(di\014ed.) |
| 37c41ab1 | 12383 | 53 b(An)34 b(argumen)m(t)h(of)g Fq(n)f Ft(lists)i(only)f(the)g(last)g |
| 28157acd | 12384 | Fq(n)f Ft(lines.)54 b(If)35 b(the)630 3621 y(shell)30 |
| 37c41ab1 CR |
12385 | b(v)-5 b(ariable)31 b Fs(HISTTIMEFORMAT)26 b Ft(is)k(set)h(and)e(not)i |
| 12386 | (n)m(ull,)f(it)h(is)f(used)f(as)h(a)h(format)f(string)630 | |
| 28157acd | 12387 | 3730 y(for)36 b Fq(strftime)41 b Ft(to)36 b(displa)m(y)g(the)g(time)h |
| 37c41ab1 | 12388 | (stamp)f(asso)s(ciated)h(with)f(eac)m(h)h(displa)m(y)m(ed)f(history)630 |
| 28157acd | 12389 | 3840 y(en)m(try)-8 b(.)47 b(No)33 b(in)m(terv)m(ening)g(blank)f(is)g |
| 37c41ab1 | 12390 | (prin)m(ted)g(b)s(et)m(w)m(een)h(the)g(formatted)f(time)h(stamp)g(and) |
| 28157acd CR |
12391 | 630 3950 y(the)e(history)f(line.)630 4080 y(Options,)g(if)h(supplied,)e |
| 12392 | (ha)m(v)m(e)i(the)g(follo)m(wing)h(meanings:)630 4230 | |
| 37c41ab1 CR |
12393 | y Fs(-c)384 b Ft(Clear)23 b(the)g(history)g(list.)39 |
| 12394 | b(This)22 b(ma)m(y)i(b)s(e)e(com)m(bined)h(with)f(the)h(other)h | |
| 28157acd CR |
12395 | (options)1110 4340 y(to)31 b(replace)g(the)g(history)f(list)h |
| 12396 | (completely)-8 b(.)630 4491 y Fs(-d)30 b Fj(offset)1110 | |
| 12397 | 4600 y Ft(Delete)25 b(the)f(history)f(en)m(try)h(at)g(p)s(osition)f | |
| 37c41ab1 | 12398 | Fq(o\013set)p Ft(.)39 b Fq(o\013set)27 b Ft(should)22 |
| 28157acd CR |
12399 | b(b)s(e)h(sp)s(eci\014ed)1110 4710 y(as)31 b(it)g(app)s(ears)e(when)h |
| 12400 | (the)g(history)g(is)h(displa)m(y)m(ed.)630 4861 y Fs(-a)384 | |
| 37c41ab1 | 12401 | b Ft(App)s(end)35 b(the)i(new)g(history)g(lines)g(\(history)g(lines)g |
| 28157acd | 12402 | (en)m(tered)h(since)f(the)g(b)s(e-)1110 4970 y(ginning)30 |
| 37c41ab1 | 12403 | b(of)h(the)f(curren)m(t)g(Bash)h(session\))g(to)g(the)g(history)f |
| 28157acd CR |
12404 | (\014le.)630 5121 y Fs(-n)384 b Ft(App)s(end)32 b(the)i(history)f |
| 12405 | (lines)h(not)g(already)g(read)g(from)f(the)h(history)f(\014le)h(to)1110 | |
| 12406 | 5230 y(the)26 b(curren)m(t)f(history)g(list.)40 b(These)25 | |
| 5cfe250d | 12407 | b(are)h(lines)g(app)s(ended)e(to)i(the)f(history)h(\014le)1110 |
| 28157acd CR |
12408 | 5340 y(since)31 b(the)f(b)s(eginning)g(of)g(the)h(curren)m(t)f(Bash)h |
| 12409 | (session.)p eop end | |
| 12410 | %%Page: 117 123 | |
| 12411 | TeXDict begin 117 122 bop 150 -116 a Ft(Chapter)30 b(9:)41 | |
| 12412 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(117)630 | |
| 12413 | 299 y Fs(-r)384 b Ft(Read)26 b(the)h(curren)m(t)f(history)g(\014le)g | |
| 12414 | (and)g(app)s(end)e(its)j(con)m(ten)m(ts)h(to)f(the)f(history)1110 | |
| 12415 | 408 y(list.)630 571 y Fs(-w)384 b Ft(W)-8 b(rite)32 b(out)e(the)h | |
| 12416 | (curren)m(t)f(history)g(to)i(the)e(history)g(\014le.)630 | |
| 12417 | 734 y Fs(-p)384 b Ft(P)m(erform)31 b(history)f(substitution)h(on)f(the) | |
| 12418 | h Fq(arg)8 b Ft(s)31 b(and)f(displa)m(y)h(the)f(result)h(on)1110 | |
| 12419 | 843 y(the)d(standard)f(output,)i(without)f(storing)g(the)g(results)g | |
| 12420 | (in)g(the)g(history)g(list.)630 1006 y Fs(-s)384 b Ft(The)30 | |
| 12421 | b Fq(arg)8 b Ft(s)30 b(are)h(added)f(to)h(the)f(end)g(of)h(the)f | |
| 12422 | (history)h(list)g(as)f(a)h(single)g(en)m(try)-8 b(.)630 | |
| 12423 | 1168 y(When)24 b(an)m(y)h(of)f(the)h(`)p Fs(-w)p Ft(',)h(`)p | |
| 12424 | Fs(-r)p Ft(',)f(`)p Fs(-a)p Ft(',)h(or)f(`)p Fs(-n)p | |
| 12425 | Ft(')f(options)g(is)h(used,)g(if)f Fq(\014lename)30 b | |
| 12426 | Ft(is)24 b(giv)m(en,)j(then)630 1278 y(it)32 b(is)g(used)f(as)h(the)f | |
| 37c41ab1 CR |
12427 | (history)h(\014le.)45 b(If)31 b(not,)h(then)g(the)f(v)-5 |
| 12428 | b(alue)32 b(of)g(the)g Fs(HISTFILE)d Ft(v)-5 b(ariable)33 | |
| 28157acd CR |
12429 | b(is)630 1388 y(used.)150 1653 y Fr(9.3)68 b(History)46 |
| 12430 | b(Expansion)275 1900 y Ft(The)35 b(History)h(library)f(pro)m(vides)h(a) | |
| 37c41ab1 | 12431 | g(history)f(expansion)h(feature)g(that)g(is)g(similar)g(to)g(the)g |
| 28157acd | 12432 | (history)150 2010 y(expansion)22 b(pro)m(vided)f(b)m(y)h |
| 37c41ab1 | 12433 | Fs(csh)p Ft(.)37 b(This)22 b(section)h(describ)s(es)e(the)h(syn)m(tax)h |
| 28157acd CR |
12434 | (used)e(to)h(manipulate)h(the)f(history)150 2120 y(information.)275 |
| 12435 | 2257 y(History)31 b(expansions)f(in)m(tro)s(duce)g(w)m(ords)g(from)g | |
| 37c41ab1 | 12436 | (the)h(history)f(list)h(in)m(to)g(the)g(input)f(stream,)h(making)150 |
| 28157acd | 12437 | 2367 y(it)g(easy)g(to)g(rep)s(eat)g(commands,)f(insert)g(the)h(argumen) |
| 37c41ab1 | 12438 | m(ts)f(to)h(a)g(previous)f(command)g(in)m(to)i(the)e(curren)m(t)150 |
| 28157acd CR |
12439 | 2476 y(input)f(line,)i(or)g(\014x)f(errors)f(in)h(previous)g(commands)g |
| 12440 | (quic)m(kly)-8 b(.)275 2614 y(History)27 b(expansion)f(tak)m(es)i | |
| 37c41ab1 | 12441 | (place)f(in)f(t)m(w)m(o)i(parts.)39 b(The)26 b(\014rst)g(is)g(to)h |
| 28157acd | 12442 | (determine)g(whic)m(h)f(line)h(from)f(the)150 2724 y(history)i(list)g |
| 37c41ab1 CR |
12443 | (should)f(b)s(e)g(used)g(during)g(substitution.)39 b(The)27 |
| 12444 | b(second)h(is)g(to)h(select)g(p)s(ortions)e(of)h(that)h(line)150 | |
| 28157acd | 12445 | 2833 y(for)d(inclusion)f(in)m(to)i(the)f(curren)m(t)f(one.)40 |
| 37c41ab1 | 12446 | b(The)25 b(line)h(selected)h(from)f(the)g(history)f(is)h(called)h(the)f |
| 28157acd | 12447 | Fq(ev)m(en)m(t)p Ft(,)j(and)150 2943 y(the)21 b(p)s(ortions)g(of)g |
| 37c41ab1 CR |
12448 | (that)h(line)f(that)h(are)g(acted)g(up)s(on)e(are)h(called)h |
| 12449 | Fq(w)m(ords)p Ft(.)38 b(V)-8 b(arious)21 b Fq(mo)s(di\014ers)j | |
| 28157acd | 12450 | Ft(are)e(a)m(v)-5 b(ailable)150 3052 y(to)35 b(manipulate)f(the)g |
| 37c41ab1 | 12451 | (selected)i(w)m(ords.)51 b(The)33 b(line)h(is)g(brok)m(en)g(in)m(to)h |
| 28157acd | 12452 | (w)m(ords)e(in)h(the)g(same)h(fashion)e(that)150 3162 |
| 37c41ab1 CR |
12453 | y(Bash)i(do)s(es,)h(so)f(that)h(sev)m(eral)g(w)m(ords)e(surrounded)f(b) |
| 12454 | m(y)i(quotes)g(are)g(considered)g(one)g(w)m(ord.)54 b(History)150 | |
| 28157acd | 12455 | 3272 y(expansions)34 b(are)g(in)m(tro)s(duced)f(b)m(y)h(the)g(app)s |
| 37c41ab1 | 12456 | (earance)g(of)g(the)g(history)g(expansion)g(c)m(haracter,)i(whic)m(h)e |
| 28157acd | 12457 | (is)150 3381 y(`)p Fs(!)p Ft(')d(b)m(y)f(default.)41 |
| 37c41ab1 CR |
12458 | b(Only)29 b(`)p Fs(\\)p Ft(')i(and)f(`)p Fs(')p Ft(')g(ma)m(y)h(b)s(e)f |
| 12459 | (used)g(to)h(escap)s(e)g(the)f(history)g(expansion)h(c)m(haracter.)275 | |
| 28157acd | 12460 | 3519 y(Sev)m(eral)40 b(shell)g(options)g(settable)h(with)e(the)h |
| 37c41ab1 | 12461 | Fs(shopt)e Ft(builtin)h(\(see)h(Section)h(4.2)f([Bash)g(Builtins],)150 |
| 28157acd | 12462 | 3629 y(page)32 b(41\))h(ma)m(y)f(b)s(e)f(used)g(to)i(tailor)g(the)e(b)s |
| 37c41ab1 | 12463 | (eha)m(vior)h(of)g(history)g(expansion.)44 b(If)31 b(the)h |
| 28157acd | 12464 | Fs(histverify)d Ft(shell)150 3738 y(option)39 b(is)f(enabled,)i(and)e |
| 37c41ab1 | 12465 | (Readline)g(is)h(b)s(eing)e(used,)j(history)e(substitutions)g(are)g |
| 28157acd | 12466 | (not)h(immediately)150 3848 y(passed)30 b(to)h(the)g(shell)g(parser.)40 |
| 37c41ab1 | 12467 | b(Instead,)30 b(the)h(expanded)f(line)h(is)f(reloaded)h(in)m(to)h(the)e |
| 28157acd | 12468 | (Readline)h(editing)150 3957 y(bu\013er)e(for)i(further)e(mo)s |
| 37c41ab1 | 12469 | (di\014cation.)41 b(If)30 b(Readline)h(is)f(b)s(eing)g(used,)g(and)g |
| 28157acd | 12470 | (the)g Fs(histreedit)e Ft(shell)i(option)150 4067 y(is)k(enabled,)h(a)g |
| 37c41ab1 | 12471 | (failed)g(history)f(expansion)g(will)g(b)s(e)g(reloaded)g(in)m(to)h |
| 28157acd | 12472 | (the)g(Readline)f(editing)h(bu\013er)e(for)150 4176 y(correction.)74 |
| 37c41ab1 CR |
12473 | b(The)41 b(`)p Fs(-p)p Ft(')g(option)g(to)h(the)f Fs(history)f |
| 12474 | Ft(builtin)g(command)h(ma)m(y)h(b)s(e)e(used)h(to)g(see)h(what)150 | |
| 28157acd | 12475 | 4286 y(a)c(history)g(expansion)f(will)h(do)f(b)s(efore)h(using)f(it.)63 |
| 37c41ab1 | 12476 | b(The)37 b(`)p Fs(-s)p Ft(')g(option)h(to)h(the)f Fs(history)d |
| 28157acd | 12477 | Ft(builtin)i(ma)m(y)150 4396 y(b)s(e)c(used)h(to)g(add)g(commands)f(to) |
| 37c41ab1 | 12478 | i(the)f(end)g(of)g(the)g(history)g(list)h(without)f(actually)i |
| 28157acd | 12479 | (executing)f(them,)150 4505 y(so)j(that)h(they)f(are)g(a)m(v)-5 |
| 37c41ab1 | 12480 | b(ailable)40 b(for)e(subsequen)m(t)f(recall.)65 b(This)37 |
| 28157acd CR |
12481 | b(is)h(most)g(useful)g(in)f(conjunction)h(with)150 4615 |
| 12482 | y(Readline.)275 4753 y(The)29 b(shell)i(allo)m(ws)h(con)m(trol)g(of)e | |
| 12483 | (the)h(v)-5 b(arious)30 b(c)m(haracters)i(used)e(b)m(y)g(the)h(history) | |
| 12484 | f(expansion)h(mec)m(ha-)150 4862 y(nism)f(with)g(the)g | |
| 12485 | Fs(histchars)e Ft(v)-5 b(ariable.)150 5093 y Fk(9.3.1)63 | |
| 12486 | b(Ev)m(en)m(t)39 b(Designators)275 5340 y Ft(An)30 b(ev)m(en)m(t)h | |
| 12487 | (designator)h(is)e(a)h(reference)g(to)g(a)f(command)h(line)f(en)m(try)h | |
| 12488 | (in)f(the)h(history)f(list.)p eop end | |
| 12489 | %%Page: 118 124 | |
| 12490 | TeXDict begin 118 123 bop 150 -116 a Ft(118)2527 b(Bash)31 | |
| 12491 | b(Reference)g(Man)m(ual)150 299 y Fs(!)432 b Ft(Start)34 | |
| 12492 | b(a)f(history)h(substitution,)g(except)g(when)f(follo)m(w)m(ed)i(b)m(y) | |
| 12493 | e(a)h(space,)h(tab,)f(the)g(end)f(of)630 408 y(the)i(line,)g(`)p | |
| 12494 | Fs(=)p Ft(')g(or)f(`)p Fs(\()p Ft(')h(\(when)e(the)i | |
| 12495 | Fs(extglob)d Ft(shell)j(option)f(is)h(enabled)f(using)g(the)g | |
| 12496 | Fs(shopt)630 518 y Ft(builtin\).)150 674 y Fs(!)p Fj(n)384 | |
| 12497 | b Ft(Refer)30 b(to)i(command)e(line)g Fq(n)p Ft(.)150 | |
| 12498 | 830 y Fs(!-)p Fj(n)336 b Ft(Refer)30 b(to)i(the)e(command)g | |
| 12499 | Fq(n)g Ft(lines)h(bac)m(k.)150 985 y Fs(!!)384 b Ft(Refer)30 | |
| 12500 | b(to)i(the)e(previous)g(command.)40 b(This)30 b(is)g(a)h(synon)m(ym)f | |
| 12501 | (for)g(`)p Fs(!-1)p Ft('.)150 1141 y Fs(!)p Fj(string)144 | |
| 12502 | b Ft(Refer)30 b(to)i(the)e(most)h(recen)m(t)g(command)f(starting)i | |
| 12503 | (with)e Fq(string)p Ft(.)150 1297 y Fs(!?)p Fj(string)11 | |
| 12504 | b Fs([?])630 1406 y Ft(Refer)34 b(to)g(the)f(most)h(recen)m(t)h | |
| 12505 | (command)e(con)m(taining)i Fq(string)p Ft(.)50 b(The)33 | |
| 12506 | b(trailing)i(`)p Fs(?)p Ft(')e(ma)m(y)i(b)s(e)630 1516 | |
| 12507 | y(omitted)c(if)g(the)f Fq(string)38 b Ft(is)31 b(follo)m(w)m(ed)h | |
| 12508 | (immediately)g(b)m(y)e(a)h(newline.)150 1672 y Fs(^)p | |
| 12509 | Fj(string1)11 b Fs(^)p Fj(string2)g Fs(^)630 1781 y Ft(Quic)m(k)32 | |
| 12510 | b(Substitution.)44 b(Rep)s(eat)32 b(the)g(last)h(command,)f(replacing)g | |
| 12511 | Fq(string1)40 b Ft(with)31 b Fq(string2)p Ft(.)630 1891 | |
| 12512 | y(Equiv)-5 b(alen)m(t)31 b(to)g Fs(!!:s/)p Fj(string1)11 | |
| 12513 | b Fs(/)p Fj(string2)g Fs(/)p Ft(.)150 2047 y Fs(!#)384 | |
| 12514 | b Ft(The)30 b(en)m(tire)h(command)f(line)h(t)m(yp)s(ed)f(so)h(far.)150 | |
| 12515 | 2265 y Fk(9.3.2)63 b(W)-10 b(ord)41 b(Designators)275 | |
| 12516 | 2508 y Ft(W)-8 b(ord)35 b(designators)g(are)g(used)f(to)h(select)h | |
| 12517 | (desired)e(w)m(ords)h(from)f(the)h(ev)m(en)m(t.)55 b(A)34 | |
| 12518 | b(`)p Fs(:)p Ft(')h(separates)h(the)150 2617 y(ev)m(en)m(t)41 | |
| 12519 | b(sp)s(eci\014cation)f(from)g(the)f(w)m(ord)g(designator.)69 | |
| 12520 | b(It)40 b(ma)m(y)g(b)s(e)f(omitted)i(if)e(the)h(w)m(ord)f(designator) | |
| 12521 | 150 2727 y(b)s(egins)33 b(with)h(a)h(`)p Fs(^)p Ft(',)g(`)p | |
| 12522 | Fs($)p Ft(',)g(`)p Fs(*)p Ft(',)h(`)p Fs(-)p Ft(',)f(or)f(`)p | |
| 12523 | Fs(\045)p Ft('.)52 b(W)-8 b(ords)35 b(are)f(n)m(um)m(b)s(ered)f(from)g | |
| 12524 | (the)i(b)s(eginning)e(of)h(the)g(line,)150 2836 y(with)39 | |
| 12525 | b(the)h(\014rst)f(w)m(ord)g(b)s(eing)g(denoted)h(b)m(y)g(0)g(\(zero\).) | |
| 12526 | 70 b(W)-8 b(ords)39 b(are)h(inserted)g(in)m(to)g(the)g(curren)m(t)g | |
| 12527 | (line)150 2946 y(separated)31 b(b)m(y)f(single)h(spaces.)275 | |
| 12528 | 3079 y(F)-8 b(or)31 b(example,)150 3234 y Fs(!!)384 b | |
| 12529 | Ft(designates)37 b(the)f(preceding)g(command.)57 b(When)35 | |
| 12530 | b(y)m(ou)i(t)m(yp)s(e)f(this,)h(the)f(preceding)g(com-)630 | |
| 12531 | 3344 y(mand)30 b(is)g(rep)s(eated)g(in)g(toto.)150 3500 | |
| 12532 | y Fs(!!:$)288 b Ft(designates)23 b(the)g(last)g(argumen)m(t)g(of)f(the) | |
| 12533 | h(preceding)f(command.)38 b(This)22 b(ma)m(y)h(b)s(e)e(shortened)630 | |
| 12534 | 3609 y(to)31 b Fs(!$)p Ft(.)150 3765 y Fs(!fi:2)240 b | |
| 12535 | Ft(designates)30 b(the)g(second)f(argumen)m(t)h(of)f(the)h(most)f | |
| 12536 | (recen)m(t)i(command)e(starting)h(with)f(the)630 3875 | |
| 12537 | y(letters)j Fs(fi)p Ft(.)275 4030 y(Here)e(are)h(the)g(w)m(ord)f | |
| 12538 | (designators:)150 4186 y Fs(0)g(\(zero\))114 b Ft(The)30 | |
| 12539 | b Fs(0)p Ft(th)g(w)m(ord.)40 b(F)-8 b(or)31 b(man)m(y)g(applications,)h | |
| 12540 | (this)e(is)g(the)h(command)f(w)m(ord.)150 4342 y Fj(n)432 | |
| 12541 | b Ft(The)30 b Fq(n)p Ft(th)g(w)m(ord.)150 4498 y Fs(^)432 | |
| 12542 | b Ft(The)30 b(\014rst)f(argumen)m(t;)j(that)f(is,)f(w)m(ord)g(1.)150 | |
| 12543 | 4654 y Fs($)432 b Ft(The)30 b(last)h(argumen)m(t.)150 | |
| 12544 | 4809 y Fs(\045)432 b Ft(The)30 b(w)m(ord)g(matc)m(hed)h(b)m(y)f(the)h | |
| 5e13499c | 12545 | (most)g(recen)m(t)g(`)p Fs(?)p Fj(string)11 b Fs(?)p |
| 28157acd CR |
12546 | Ft(')28 b(searc)m(h.)150 4965 y Fj(x)p Fs(-)p Fj(y)336 |
| 12547 | b Ft(A)30 b(range)h(of)g(w)m(ords;)f(`)p Fs(-)p Fj(y)11 | |
| 12548 | b Ft(')30 b(abbreviates)h(`)p Fs(0-)p Fj(y)11 b Ft('.)150 | |
| 12549 | 5121 y Fs(*)432 b Ft(All)28 b(of)g(the)g(w)m(ords,)g(except)h(the)e | |
| 12550 | Fs(0)p Ft(th.)40 b(This)27 b(is)g(a)h(synon)m(ym)f(for)h(`)p | |
| 12551 | Fs(1-$)p Ft('.)39 b(It)28 b(is)g(not)g(an)f(error)630 | |
| 12552 | 5230 y(to)j(use)g(`)p Fs(*)p Ft(')f(if)h(there)g(is)g(just)f(one)h(w)m | |
| 5cfe250d | 12553 | (ord)f(in)g(the)h(ev)m(en)m(t;)i(the)d(empt)m(y)i(string)e(is)h |
| 28157acd CR |
12554 | (returned)e(in)630 5340 y(that)j(case.)p eop end |
| 12555 | %%Page: 119 125 | |
| 12556 | TeXDict begin 119 124 bop 150 -116 a Ft(Chapter)30 b(9:)41 | |
| 12557 | b(Using)30 b(History)h(In)m(teractiv)m(ely)1925 b(119)150 | |
| 12558 | 299 y Fj(x)11 b Fs(*)373 b Ft(Abbreviates)31 b(`)p Fj(x)p | |
| 12559 | Fs(-$)p Ft(')150 458 y Fj(x)p Fs(-)384 b Ft(Abbreviates)31 | |
| 12560 | b(`)p Fj(x)p Fs(-$)p Ft(')f(lik)m(e)h(`)p Fj(x)11 b Fs(*)p | |
| 12561 | Ft(',)31 b(but)e(omits)i(the)g(last)g(w)m(ord.)275 618 | |
| 12562 | y(If)i(a)h(w)m(ord)g(designator)g(is)g(supplied)f(without)h(an)g(ev)m | |
| 12563 | (en)m(t)h(sp)s(eci\014cation,)h(the)e(previous)f(command)150 | |
| 12564 | 727 y(is)d(used)g(as)h(the)f(ev)m(en)m(t.)150 951 y Fk(9.3.3)63 | |
| 12565 | b(Mo)s(di\014ers)275 1196 y Ft(After)20 b(the)h(optional)h(w)m(ord)f | |
| 12566 | (designator,)i(y)m(ou)e(can)g(add)f(a)h(sequence)g(of)g(one)g(or)g | |
| 12567 | (more)g(of)g(the)f(follo)m(wing)150 1305 y(mo)s(di\014ers,)29 | |
| 12568 | b(eac)m(h)j(preceded)e(b)m(y)g(a)h(`)p Fs(:)p Ft('.)150 | |
| 12569 | 1465 y Fs(h)432 b Ft(Remo)m(v)m(e)32 b(a)f(trailing)g(pathname)g(comp)s | |
| 12570 | (onen)m(t,)g(lea)m(ving)h(only)e(the)h(head.)150 1624 | |
| 12571 | y Fs(t)432 b Ft(Remo)m(v)m(e)32 b(all)f(leading)h(pathname)e(comp)s | |
| 12572 | (onen)m(ts,)h(lea)m(ving)h(the)e(tail.)150 1783 y Fs(r)432 | |
| 12573 | b Ft(Remo)m(v)m(e)32 b(a)f(trailing)g(su\016x)f(of)g(the)h(form)f(`)p | |
| 12574 | Fs(.)p Fj(suffix)11 b Ft(',)28 b(lea)m(ving)33 b(the)d(basename.)150 | |
| 12575 | 1943 y Fs(e)432 b Ft(Remo)m(v)m(e)32 b(all)f(but)f(the)h(trailing)g | |
| 12576 | (su\016x.)150 2102 y Fs(p)432 b Ft(Prin)m(t)30 b(the)h(new)f(command)g | |
| 12577 | (but)g(do)g(not)g(execute)i(it.)150 2262 y Fs(q)432 b | |
| 12578 | Ft(Quote)31 b(the)f(substituted)g(w)m(ords,)g(escaping)h(further)e | |
| 12579 | (substitutions.)150 2421 y Fs(x)432 b Ft(Quote)32 b(the)f(substituted)g | |
| 12580 | (w)m(ords)f(as)i(with)f(`)p Fs(q)p Ft(',)h(but)e(break)h(in)m(to)i(w)m | |
| 12581 | (ords)d(at)i(spaces,)h(tabs,)630 2531 y(and)d(newlines.)150 | |
| 12582 | 2690 y Fs(s/)p Fj(old)11 b Fs(/)p Fj(new)g Fs(/)630 2800 | |
| 12583 | y Ft(Substitute)32 b Fq(new)40 b Ft(for)32 b(the)h(\014rst)f(o)s | |
| 12584 | (ccurrence)h(of)f Fq(old)37 b Ft(in)32 b(the)h(ev)m(en)m(t)h(line.)48 | |
| 12585 | b(An)m(y)32 b(delimiter)630 2909 y(ma)m(y)25 b(b)s(e)g(used)f(in)g | |
| 12586 | (place)i(of)f(`)p Fs(/)p Ft('.)39 b(The)24 b(delimiter)h(ma)m(y)h(b)s | |
| 12587 | (e)e(quoted)h(in)f Fq(old)29 b Ft(and)24 b Fq(new)32 | |
| 12588 | b Ft(with)25 b(a)630 3019 y(single)k(bac)m(kslash.)40 | |
| 12589 | b(If)28 b(`)p Fs(&)p Ft(')g(app)s(ears)g(in)f Fq(new)p | |
| 12590 | Ft(,)i(it)f(is)h(replaced)f(b)m(y)g Fq(old)p Ft(.)40 | |
| 12591 | b(A)28 b(single)h(bac)m(kslash)630 3128 y(will)35 b(quote)g(the)g(`)p | |
| 12592 | Fs(&)p Ft('.)54 b(The)34 b(\014nal)g(delimiter)i(is)e(optional)i(if)f | |
| 12593 | (it)g(is)f(the)h(last)h(c)m(haracter)g(on)630 3238 y(the)31 | |
| 12594 | b(input)e(line.)150 3397 y Fs(&)432 b Ft(Rep)s(eat)31 | |
| 12595 | b(the)f(previous)g(substitution.)150 3557 y Fs(g)150 | |
| 12596 | 3666 y(a)432 b Ft(Cause)38 b(c)m(hanges)i(to)f(b)s(e)f(applied)h(o)m(v) | |
| 12597 | m(er)h(the)f(en)m(tire)g(ev)m(en)m(t)h(line.)66 b(Used)39 | |
| 12598 | b(in)f(conjunction)630 3776 y(with)30 b(`)p Fs(s)p Ft(',)h(as)f(in)h | |
| 12599 | Fs(gs/)p Fj(old)11 b Fs(/)p Fj(new)g Fs(/)p Ft(,)26 b(or)k(with)h(`)p | |
| 12600 | Fs(&)p Ft('.)150 3935 y Fs(G)432 b Ft(Apply)30 b(the)g(follo)m(wing)i | |
| 12601 | (`)p Fs(s)p Ft(')f(mo)s(di\014er)e(once)i(to)g(eac)m(h)h(w)m(ord)e(in)g | |
| 12602 | (the)g(ev)m(en)m(t.)p eop end | |
| 12603 | %%Page: 120 126 | |
| 12604 | TeXDict begin 120 125 bop 150 -116 a Ft(120)2527 b(Bash)31 | |
| 37c41ab1 | 12605 | b(Reference)g(Man)m(ual)p eop end |
| 28157acd CR |
12606 | %%Page: 121 127 |
| 12607 | TeXDict begin 121 126 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
| 12608 | b(Installing)31 b(Bash)2356 b(121)150 299 y Fo(10)80 | |
| 37c41ab1 CR |
12609 | b(Installing)52 b(Bash)275 535 y Ft(This)39 b(c)m(hapter)i(pro)m(vides) |
| 12610 | f(basic)g(instructions)g(for)g(installing)h(Bash)f(on)g(the)h(v)-5 | |
| 12611 | b(arious)40 b(supp)s(orted)150 645 y(platforms.)58 b(The)36 | |
| 12612 | b(distribution)g(supp)s(orts)e(the)j Fl(gnu)f Ft(op)s(erating)g | |
| 12613 | (systems,)j(nearly)d(ev)m(ery)h(v)m(ersion)g(of)150 754 | |
| 12614 | y(Unix,)g(and)e(sev)m(eral)i(non-Unix)f(systems)g(suc)m(h)f(as)h(BeOS)g | |
| 12615 | (and)f(In)m(terix.)57 b(Other)35 b(indep)s(enden)m(t)g(p)s(orts)150 | |
| 12616 | 864 y(exist)c(for)f Fl(ms-dos)p Ft(,)g Fl(os/2)p Ft(,)g(and)g(Windo)m | |
| 12617 | (ws)h(platforms.)150 1123 y Fr(10.1)68 b(Basic)45 b(Installation)275 | |
| 12618 | 1367 y Ft(These)30 b(are)g(installation)j(instructions)d(for)g(Bash.) | |
| 12619 | 275 1503 y(The)f(simplest)i(w)m(a)m(y)g(to)g(compile)h(Bash)e(is:)199 | |
| 12620 | 1638 y(1.)61 b Fs(cd)38 b Ft(to)h(the)f(directory)h(con)m(taining)h | |
| 12621 | (the)f(source)f(co)s(de)h(and)f(t)m(yp)s(e)g(`)p Fs(./configure)p | |
| 5e13499c | 12622 | Ft(')e(to)j(con\014gure)330 1747 y(Bash)c(for)f(y)m(our)h(system.)54 |
| 37c41ab1 CR |
12623 | b(If)34 b(y)m(ou're)h(using)f Fs(csh)g Ft(on)g(an)h(old)g(v)m(ersion)g |
| 12624 | (of)g(System)f(V,)h(y)m(ou)g(migh)m(t)330 1857 y(need)21 | |
| 5e13499c | 12625 | b(to)g(t)m(yp)s(e)g(`)p Fs(sh)30 b(./configure)p Ft(')18 |
| 37c41ab1 | 12626 | b(instead)j(to)g(prev)m(en)m(t)h Fs(csh)e Ft(from)g(trying)h(to)g |
| 5e13499c | 12627 | (execute)h Fs(configure)330 1966 y Ft(itself.)330 2101 |
| 37c41ab1 CR |
12628 | y(Running)30 b Fs(configure)f Ft(tak)m(es)k(some)e(time.)45 |
| 12629 | b(While)32 b(running,)e(it)i(prin)m(ts)f(messages)h(telling)h(whic)m(h) | |
| 12630 | 330 2211 y(features)e(it)g(is)f(c)m(hec)m(king)i(for.)199 | |
| 12631 | 2346 y(2.)61 b(T)m(yp)s(e)30 b(`)p Fs(make)p Ft(')g(to)h(compile)g | |
| 12632 | (Bash)g(and)e(build)h(the)g Fs(bashbug)f Ft(bug)g(rep)s(orting)h | |
| 12633 | (script.)199 2481 y(3.)61 b(Optionally)-8 b(,)32 b(t)m(yp)s(e)e(`)p | |
| 5e13499c CR |
12634 | Fs(make)g(tests)p Ft(')f(to)i(run)e(the)h(Bash)h(test)g(suite.)199 |
| 12635 | 2615 y(4.)61 b(T)m(yp)s(e)36 b(`)p Fs(make)29 b(install)p | |
| 37c41ab1 CR |
12636 | Ft(')35 b(to)i(install)h Fs(bash)d Ft(and)h Fs(bashbug)p |
| 12637 | Ft(.)57 b(This)35 b(will)i(also)h(install)f(the)g(man)m(ual)330 | |
| 5e13499c | 12638 | 2725 y(pages)31 b(and)f(Info)g(\014le.)275 2885 y(The)20 |
| 37c41ab1 CR |
12639 | b Fs(configure)f Ft(shell)i(script)g(attempts)h(to)g(guess)f(correct)i |
| 12640 | (v)-5 b(alues)21 b(for)g(v)-5 b(arious)21 b(system-dep)s(enden)m(t)150 | |
| 12641 | 2995 y(v)-5 b(ariables)44 b(used)f(during)g(compilation.)82 | |
| 12642 | b(It)43 b(uses)h(those)g(v)-5 b(alues)44 b(to)g(create)h(a)g(`)p | |
| 12643 | Fs(Makefile)p Ft(')c(in)j(eac)m(h)150 3104 y(directory)25 | |
| 12644 | b(of)g(the)g(pac)m(k)-5 b(age)27 b(\(the)e(top)g(directory)-8 | |
| 12645 | b(,)27 b(the)e(`)p Fs(builtins)p Ft(',)f(`)p Fs(doc)p | |
| 5e13499c | 12646 | Ft(',)i(and)e(`)p Fs(support)p Ft(')g(directories,)150 |
| 37c41ab1 CR |
12647 | 3214 y(eac)m(h)32 b(directory)f(under)d(`)p Fs(lib)p |
| 12648 | Ft(',)j(and)f(sev)m(eral)h(others\).)42 b(It)30 b(also)i(creates)f(a)g | |
| 12649 | (`)p Fs(config.h)p Ft(')e(\014le)h(con)m(taining)150 | |
| 12650 | 3324 y(system-dep)s(enden)m(t)h(de\014nitions.)44 b(Finally)-8 | |
| 12651 | b(,)34 b(it)e(creates)h(a)f(shell)g(script)f(named)g | |
| 12652 | Fs(config.status)d Ft(that)150 3433 y(y)m(ou)k(can)g(run)e(in)h(the)g | |
| 12653 | (future)g(to)h(recreate)h(the)f(curren)m(t)f(con\014guration,)h(a)g | |
| 12654 | (\014le)g(`)p Fs(config.cache)p Ft(')c(that)150 3543 | |
| 12655 | y(sa)m(v)m(es)35 b(the)f(results)f(of)h(its)g(tests)h(to)f(sp)s(eed)f | |
| 12656 | (up)g(recon\014guring,)h(and)f(a)h(\014le)g(`)p Fs(config.log)p | |
| 12657 | Ft(')d(con)m(taining)150 3652 y(compiler)25 b(output)g(\(useful)f | |
| 12658 | (mainly)h(for)g(debugging)f Fs(configure)p Ft(\).)37 | |
| 12659 | b(If)24 b(at)i(some)f(p)s(oin)m(t)g(`)p Fs(config.cache)p | |
| 12660 | Ft(')150 3762 y(con)m(tains)32 b(results)e(y)m(ou)g(don't)h(w)m(an)m(t) | |
| 12661 | g(to)g(k)m(eep,)g(y)m(ou)g(ma)m(y)g(remo)m(v)m(e)h(or)e(edit)h(it.)275 | |
| 12662 | 3897 y(T)-8 b(o)37 b(\014nd)f(out)i(more)f(ab)s(out)h(the)f(options)h | |
| 12663 | (and)f(argumen)m(ts)g(that)h(the)g Fs(configure)d Ft(script)i(under-) | |
| 5e13499c | 12664 | 150 4007 y(stands,)30 b(t)m(yp)s(e)390 4142 y Fs(bash-2.04$)45 |
| 37c41ab1 CR |
12665 | b(./configure)g(--help)150 4277 y Ft(at)31 b(the)g(Bash)f(prompt)g(in)g |
| 12666 | (y)m(our)g(Bash)h(source)f(directory)-8 b(.)275 4412 | |
| 12667 | y(If)53 b(y)m(ou)h(need)f(to)i(do)e(un)m(usual)g(things)g(to)i(compile) | |
| 12668 | g(Bash,)k(please)c(try)e(to)i(\014gure)e(out)h(ho)m(w)150 | |
| 12669 | 4522 y Fs(configure)47 b Ft(could)j(c)m(hec)m(k)h(whether)e(or)g(not)h | |
| 12670 | (to)h(do)e(them,)55 b(and)49 b(mail)h(di\013s)f(or)h(instructions)f(to) | |
| 5e13499c | 12671 | 150 4631 y Fs(bash-maintainers@gnu.org)24 b Ft(so)30 |
| 37c41ab1 CR |
12672 | b(they)h(can)g(b)s(e)e(considered)i(for)f(the)g(next)h(release.)275 |
| 12673 | 4766 y(The)24 b(\014le)i(`)p Fs(configure.in)p Ft(')c(is)k(used)e(to)j | |
| 12674 | (create)g Fs(configure)22 b Ft(b)m(y)k(a)g(program)f(called)h(Auto)s | |
| 12675 | (conf.)39 b(Y)-8 b(ou)150 4876 y(only)31 b(need)f(`)p | |
| 12676 | Fs(configure.in)p Ft(')d(if)k(y)m(ou)f(w)m(an)m(t)i(to)f(c)m(hange)g | |
| 12677 | (it)g(or)f(regenerate)i Fs(configure)c Ft(using)i(a)h(new)m(er)150 | |
| 12678 | 4986 y(v)m(ersion)25 b(of)f(Auto)s(conf.)39 b(If)24 b(y)m(ou)h(do)f | |
| 12679 | (this,)i(mak)m(e)f(sure)f(y)m(ou)h(are)f(using)g(Auto)s(conf)h(v)m | |
| 12680 | (ersion)f(2.50)i(or)f(new)m(er.)275 5121 y(Y)-8 b(ou)29 | |
| 12681 | b(can)f(remo)m(v)m(e)i(the)f(program)g(binaries)f(and)g(ob)5 | |
| 12682 | b(ject)29 b(\014les)g(from)f(the)h(source)f(co)s(de)h(directory)g(b)m | |
| 12683 | (y)150 5230 y(t)m(yping)j(`)p Fs(make)d(clean)p Ft('.)42 | |
| 12684 | b(T)-8 b(o)32 b(also)g(remo)m(v)m(e)g(the)g(\014les)f(that)g | |
| 5e13499c | 12685 | Fs(configure)e Ft(created)j(\(so)g(y)m(ou)g(can)f(compile)150 |
| 37c41ab1 CR |
12686 | 5340 y(Bash)g(for)f(a)g(di\013eren)m(t)h(kind)f(of)g(computer\),)h(t)m |
| 12687 | (yp)s(e)g(`)p Fs(make)e(distclean)p Ft('.)p eop end | |
| 28157acd CR |
12688 | %%Page: 122 128 |
| 12689 | TeXDict begin 122 127 bop 150 -116 a Ft(122)2527 b(Bash)31 | |
| 37c41ab1 CR |
12690 | b(Reference)g(Man)m(ual)150 299 y Fr(10.2)68 b(Compilers)46 |
| 12691 | b(and)f(Options)275 560 y Ft(Some)40 b(systems)g(require)f(un)m(usual)g | |
| 12692 | (options)h(for)g(compilation)i(or)e(linking)g(that)g(the)g | |
| 12693 | Fs(configure)150 669 y Ft(script)30 b(do)s(es)h(not)g(kno)m(w)f(ab)s | |
| 12694 | (out.)41 b(Y)-8 b(ou)31 b(can)g(giv)m(e)h Fs(configure)c | |
| 12695 | Ft(initial)k(v)-5 b(alues)31 b(for)f(v)-5 b(ariables)31 | |
| 12696 | b(b)m(y)g(setting)150 779 y(them)21 b(in)f(the)h(en)m(vironmen)m(t.)38 | |
| 12697 | b(Using)21 b(a)g(Bourne-compatible)h(shell,)h(y)m(ou)e(can)g(do)f(that) | |
| 12698 | i(on)e(the)h(command)150 888 y(line)31 b(lik)m(e)g(this:)390 | |
| 12699 | 1039 y Fs(CC=c89)46 b(CFLAGS=-O2)f(LIBS=-lposix)g(./configure)275 | |
| 5e13499c | 12700 | 1191 y Ft(On)29 b(systems)h(that)h(ha)m(v)m(e)h(the)f |
| 37c41ab1 | 12701 | Fs(env)e Ft(program,)h(y)m(ou)h(can)g(do)f(it)h(lik)m(e)h(this:)390 |
| 5e13499c | 12702 | 1342 y Fs(env)47 b(CPPFLAGS=-I/usr/local/in)o(clud)o(e)42 |
| 37c41ab1 CR |
12703 | b(LDFLAGS=-s)j(./configure)275 1493 y Ft(The)29 b(con\014guration)i |
| 12704 | (pro)s(cess)f(uses)g(GCC)g(to)h(build)e(Bash)i(if)f(it)h(is)g(a)m(v)-5 | |
| 5e13499c CR |
12705 | b(ailable.)150 1792 y Fr(10.3)68 b(Compiling)46 b(F)-11 |
| 12706 | b(or)45 b(Multiple)g(Arc)l(hitectures)275 2052 y Ft(Y)-8 | |
| 37c41ab1 CR |
12707 | b(ou)28 b(can)h(compile)g(Bash)g(for)f(more)g(than)g(one)h(kind)e(of)i |
| 12708 | (computer)f(at)h(the)g(same)f(time,)i(b)m(y)e(placing)150 | |
| 12709 | 2162 y(the)39 b(ob)5 b(ject)39 b(\014les)g(for)f(eac)m(h)i(arc)m | |
| 12710 | (hitecture)g(in)e(their)h(o)m(wn)f(directory)-8 b(.)67 | |
| 12711 | b(T)-8 b(o)39 b(do)f(this,)j(y)m(ou)e(m)m(ust)f(use)h(a)150 | |
| 12712 | 2271 y(v)m(ersion)33 b(of)g Fs(make)f Ft(that)i(supp)s(orts)d(the)i | |
| 12713 | Fs(VPATH)e Ft(v)-5 b(ariable,)35 b(suc)m(h)d(as)i(GNU)f | |
| 5e13499c CR |
12714 | Fs(make)p Ft(.)47 b Fs(cd)33 b Ft(to)g(the)g(directory)150 |
| 12715 | 2381 y(where)23 b(y)m(ou)g(w)m(an)m(t)h(the)f(ob)5 b(ject)24 | |
| 37c41ab1 CR |
12716 | b(\014les)f(and)f(executables)j(to)f(go)f(and)g(run)f(the)h |
| 12717 | Fs(configure)d Ft(script)j(from)g(the)150 2491 y(source)j(directory)-8 | |
| 12718 | b(.)40 b(Y)-8 b(ou)26 b(ma)m(y)g(need)g(to)g(supply)f(the)g(`)p | |
| 12719 | Fs(--srcdir=PATH)p Ft(')e(argumen)m(t)j(to)h(tell)f Fs(configure)150 | |
| 12720 | 2600 y Ft(where)43 b(the)h(source)g(\014les)g(are.)82 | |
| 12721 | b Fs(configure)41 b Ft(automatically)47 b(c)m(hec)m(ks)e(for)f(the)g | |
| 12722 | (source)g(co)s(de)g(in)g(the)150 2710 y(directory)31 | |
| 12723 | b(that)g Fs(configure)d Ft(is)i(in)g(and)g(in)g(`..'.)275 | |
| 5e13499c CR |
12724 | 2861 y(If)20 b(y)m(ou)h(ha)m(v)m(e)i(to)e(use)g(a)g Fs(make)f |
| 12725 | Ft(that)i(do)s(es)e(not)i(supp)s(orts)d(the)i Fs(VPATH)e | |
| 37c41ab1 CR |
12726 | Ft(v)-5 b(ariable,)24 b(y)m(ou)e(can)f(compile)h(Bash)150 |
| 12727 | 2971 y(for)33 b(one)h(arc)m(hitecture)h(at)f(a)g(time)g(in)f(the)h | |
| 12728 | (source)g(co)s(de)f(directory)-8 b(.)51 b(After)34 b(y)m(ou)g(ha)m(v)m | |
| 12729 | (e)h(installed)f(Bash)150 3080 y(for)c(one)h(arc)m(hitecture,)h(use)e | |
| 12730 | (`)p Fs(make)g(distclean)p Ft(')e(b)s(efore)i(recon\014guring)g(for)g | |
| 5e13499c | 12731 | (another)g(arc)m(hitecture.)275 3231 y(Alternativ)m(ely)-8 |
| 37c41ab1 CR |
12732 | b(,)26 b(if)21 b(y)m(our)h(system)g(supp)s(orts)d(sym)m(b)s(olic)j |
| 12733 | (links,)i(y)m(ou)e(can)g(use)f(the)h(`)p Fs(support/mkclone)p | |
| 12734 | Ft(')150 3341 y(script)h(to)h(create)g(a)f(build)f(tree)i(whic)m(h)f | |
| 12735 | (has)f(sym)m(b)s(olic)i(links)e(bac)m(k)i(to)g(eac)m(h)g(\014le)f(in)g | |
| 12736 | (the)g(source)g(directory)-8 b(.)150 3450 y(Here's)41 | |
| 12737 | b(an)f(example)i(that)f(creates)h(a)e(build)g(directory)h(in)f(the)h | |
| 12738 | (curren)m(t)f(directory)h(from)f(a)h(source)150 3560 | |
| 12739 | y(directory)31 b(`)p Fs(/usr/gnu/src/bash-2.0)p Ft(':)390 | |
| 5e13499c CR |
12740 | 3711 y Fs(bash)47 b(/usr/gnu/src/bash-2.0/s)o(uppo)o(rt/)o(mkcl)o(one) |
| 12741 | 41 b(-s)47 b(/usr/gnu/src/bash-2.0)42 b(.)150 3862 y | |
| 37c41ab1 CR |
12742 | Ft(The)c Fs(mkclone)e Ft(script)i(requires)g(Bash,)i(so)f(y)m(ou)f(m)m |
| 12743 | (ust)h(ha)m(v)m(e)g(already)g(built)f(Bash)g(for)g(at)h(least)h(one)150 | |
| 12744 | 3972 y(arc)m(hitecture)32 b(b)s(efore)e(y)m(ou)h(can)f(create)i(build)e | |
| 12745 | (directories)h(for)f(other)h(arc)m(hitectures.)150 4271 | |
| 5e13499c | 12746 | y Fr(10.4)68 b(Installation)47 b(Names)275 4531 y Ft(By)36 |
| 37c41ab1 CR |
12747 | b(default,)h(`)p Fs(make)29 b(install)p Ft(')34 b(will)j(install)f(in)m |
| 12748 | (to)h(`)p Fs(/usr/local/bin)p Ft(',)d(`)p Fs(/usr/local/man)p | |
| 12749 | Ft(',)g(etc.)150 4641 y(Y)-8 b(ou)39 b(can)g(sp)s(ecify)f(an)h | |
| 12750 | (installation)h(pre\014x)d(other)i(than)g(`)p Fs(/usr/local)p | |
| 12751 | Ft(')d(b)m(y)i(giving)i Fs(configure)c Ft(the)150 4751 | |
| 12752 | y(option)41 b(`)p Fs(--prefix=)p Fj(PATH)11 b Ft(',)41 | |
| 12753 | b(or)g(b)m(y)f(sp)s(ecifying)h(a)h(v)-5 b(alue)41 b(for)g(the)g | |
| 12754 | Fs(DESTDIR)e Ft(`)p Fs(make)p Ft(')h(v)-5 b(ariable)42 | |
| 12755 | b(when)150 4860 y(running)29 b(`)p Fs(make)g(install)p | |
| 12756 | Ft('.)275 5011 y(Y)-8 b(ou)71 b(can)h(sp)s(ecify)f(separate)h | |
| 12757 | (installation)h(pre\014xes)d(for)h(arc)m(hitecture-sp)s(eci\014c)i | |
| 12758 | (\014les)f(and)150 5121 y(arc)m(hitecture-indep)s(enden)m(t)38 | |
| 12759 | b(\014les.)62 b(If)37 b(y)m(ou)h(giv)m(e)g Fs(configure)d | |
| 12760 | Ft(the)j(option)g(`)p Fs(--exec-prefix=)p Fj(PATH)11 | |
| 12761 | b Ft(',)150 5230 y(`)p Fs(make)29 b(install)p Ft(')63 | |
| 12762 | b(will)h(use)f Fq(P)-8 b(A)g(TH)75 b Ft(as)64 b(the)g(pre\014x)e(for)i | |
| 12763 | (installing)h(programs)e(and)h(libraries.)150 5340 y(Do)s(cumen)m | |
| 12764 | (tation)32 b(and)e(other)h(data)g(\014les)f(will)h(still)g(use)f(the)h | |
| 12765 | (regular)f(pre\014x.)p eop end | |
| 28157acd CR |
12766 | %%Page: 123 129 |
| 12767 | TeXDict begin 123 128 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
| 12768 | b(Installing)31 b(Bash)2356 b(123)150 299 y Fr(10.5)68 | |
| 37c41ab1 CR |
12769 | b(Sp)t(ecifying)45 b(the)g(System)h(T)l(yp)t(e)275 539 |
| 12770 | y Ft(There)35 b(ma)m(y)h(b)s(e)f(some)h(features)g Fs(configure)d | |
| 12771 | Ft(can)j(not)g(\014gure)f(out)g(automatically)-8 b(,)41 | |
| 12772 | b(but)35 b(need)g(to)150 649 y(determine)h(b)m(y)g(the)h(t)m(yp)s(e)f | |
| 12773 | (of)g(host)h(Bash)f(will)h(run)d(on.)58 b(Usually)37 | |
| 12774 | b Fs(configure)d Ft(can)i(\014gure)g(that)g(out,)150 | |
| 12775 | 758 y(but)c(if)h(it)g(prin)m(ts)g(a)g(message)h(sa)m(ying)g(it)f(can)h | |
| 28157acd | 12776 | (not)f(guess)g(the)g(host)g(t)m(yp)s(e,)h(giv)m(e)g(it)f(the)g(`)p |
| 37c41ab1 CR |
12777 | Fs(--host=TYPE)p Ft(')150 868 y(option.)39 b(`)p Fs(TYPE)p |
| 12778 | Ft(')25 b(can)g(either)g(b)s(e)g(a)g(short)g(name)g(for)g(the)g(system) | |
| 5e13499c | 12779 | g(t)m(yp)s(e,)h(suc)m(h)f(as)g(`)p Fs(sun4)p Ft(',)h(or)f(a)g |
| 37c41ab1 | 12780 | (canonical)150 977 y(name)30 b(with)g(three)h(\014elds:)40 |
| 5e13499c | 12781 | b(`)p Fs(CPU-COMPANY-SYSTEM)p Ft(')26 b(\(e.g.,)32 b(`)p |
| 37c41ab1 CR |
12782 | Fs(i386-unknown-freebsd4.2)p Ft('\).)275 1108 y(See)e(the)h(\014le)f(`) |
| 12783 | p Fs(support/config.sub)p Ft(')c(for)k(the)h(p)s(ossible)f(v)-5 | |
| 12784 | b(alues)30 b(of)h(eac)m(h)g(\014eld.)150 1354 y Fr(10.6)68 | |
| 5e13499c | 12785 | b(Sharing)45 b(Defaults)275 1594 y Ft(If)34 b(y)m(ou)i(w)m(an)m(t)g(to) |
| 37c41ab1 CR |
12786 | g(set)g(default)f(v)-5 b(alues)36 b(for)f Fs(configure)e |
| 12787 | Ft(scripts)i(to)h(share,)g(y)m(ou)g(can)g(create)g(a)g(site)150 | |
| 12788 | 1704 y(shell)48 b(script)f(called)i Fs(config.site)44 | |
| 12789 | b Ft(that)k(giv)m(es)h(default)f(v)-5 b(alues)48 b(for)f(v)-5 | |
| 12790 | b(ariables)48 b(lik)m(e)h Fs(CC)p Ft(,)j Fs(cache_)150 | |
| 5e13499c | 12791 | 1813 y(file)p Ft(,)43 b(and)e Fs(prefix)p Ft(.)73 b Fs(configure)39 |
| 37c41ab1 CR |
12792 | b Ft(lo)s(oks)j(for)f(`)p Fs(PREFIX/share/config.site)p |
| 12793 | Ft(')35 b(if)42 b(it)g(exists,)j(then)150 1923 y(`)p | |
| 12794 | Fs(PREFIX/etc/config.site)p Ft(')20 b(if)26 b(it)g(exists.)40 | |
| 5e13499c | 12795 | b(Or,)26 b(y)m(ou)g(can)g(set)g(the)g Fs(CONFIG_SITE)c |
| 37c41ab1 CR |
12796 | Ft(en)m(vironmen)m(t)k(v)-5 b(ari-)150 2033 y(able)40 |
| 12797 | b(to)g(the)g(lo)s(cation)h(of)e(the)h(site)g(script.)67 | |
| 12798 | b(A)40 b(w)m(arning:)58 b(the)40 b(Bash)g Fs(configure)c | |
| 12799 | Ft(lo)s(oks)k(for)f(a)h(site)150 2142 y(script,)31 b(but)e(not)i(all)g | |
| 12800 | Fs(configure)d Ft(scripts)i(do.)150 2388 y Fr(10.7)68 | |
| 5e13499c | 12801 | b(Op)t(eration)46 b(Con)l(trols)275 2628 y Fs(configure)27 |
| 37c41ab1 CR |
12802 | b Ft(recognizes)32 b(the)f(follo)m(wing)h(options)f(to)g(con)m(trol)g |
| 12803 | (ho)m(w)g(it)g(op)s(erates.)150 2780 y Fs(--cache-file=)p | |
| 12804 | Fj(file)630 2890 y Ft(Use)k(and)g(sa)m(v)m(e)h(the)f(results)g(of)g | |
| 12805 | (the)h(tests)f(in)g Fq(\014le)40 b Ft(instead)35 b(of)h(`)p | |
| 12806 | Fs(./config.cache)p Ft('.)51 b(Set)630 2999 y Fq(\014le)36 | |
| 12807 | b Ft(to)31 b(`)p Fs(/dev/null)p Ft(')d(to)j(disable)g(cac)m(hing,)h | |
| 12808 | (for)e(debugging)g Fs(configure)p Ft(.)150 3151 y Fs(--help)192 | |
| 12809 | b Ft(Prin)m(t)30 b(a)h(summary)e(of)i(the)f(options)h(to)g | |
| 5e13499c | 12810 | Fs(configure)p Ft(,)d(and)i(exit.)150 3303 y Fs(--quiet)150 |
| 37c41ab1 CR |
12811 | 3412 y(--silent)150 3522 y(-q)384 b Ft(Do)31 b(not)g(prin)m(t)f |
| 12812 | (messages)h(sa)m(ying)g(whic)m(h)g(c)m(hec)m(ks)g(are)g(b)s(eing)f | |
| 12813 | (made.)150 3674 y Fs(--srcdir=)p Fj(dir)630 3783 y Ft(Lo)s(ok)i(for)g | |
| 12814 | (the)g(Bash)g(source)h(co)s(de)f(in)g(directory)g Fq(dir)p | |
| 12815 | Ft(.)45 b(Usually)33 b Fs(configure)c Ft(can)j(deter-)630 | |
| 12816 | 3893 y(mine)e(that)h(directory)g(automatically)-8 b(.)150 | |
| 12817 | 4045 y Fs(--version)630 4154 y Ft(Prin)m(t)29 b(the)h(v)m(ersion)g(of)g | |
| 5e13499c | 12818 | (Auto)s(conf)f(used)g(to)h(generate)h(the)f Fs(configure)d |
| 37c41ab1 CR |
12819 | Ft(script,)j(and)f(exit.)275 4306 y Fs(configure)34 b |
| 12820 | Ft(also)k(accepts)g(some)g(other,)h(not)e(widely)g(used,)h(b)s | |
| 12821 | (oilerplate)g(options.)61 b(`)p Fs(configure)150 4415 | |
| 12822 | y(--help)p Ft(')29 b(prin)m(ts)h(the)g(complete)i(list.)150 | |
| 5e13499c CR |
12823 | 4661 y Fr(10.8)68 b(Optional)46 b(F)-11 b(eatures)275 |
| 12824 | 4902 y Ft(The)34 b(Bash)h Fs(configure)d Ft(has)j(a)g(n)m(um)m(b)s(er)f | |
| 37c41ab1 CR |
12825 | (of)h(`)p Fs(--enable-)p Fj(feature)11 b Ft(')30 b(options,)37 |
| 12826 | b(where)e Fq(feature)40 b Ft(in-)150 5011 y(dicates)33 | |
| 12827 | b(an)f(optional)h(part)f(of)g(Bash.)45 b(There)32 b(are)g(also)h(sev)m | |
| 12828 | (eral)g(`)p Fs(--with-)p Fj(package)11 b Ft(')29 b(options,)j(where)150 | |
| 12829 | 5121 y Fq(pac)m(k)-5 b(age)35 b Ft(is)28 b(something)h(lik)m(e)h(`)p | |
| 12830 | Fs(bash-malloc)p Ft(')25 b(or)j(`)p Fs(purify)p Ft('.)39 | |
| 12831 | b(T)-8 b(o)29 b(turn)e(o\013)h(the)h(default)f(use)g(of)g(a)h(pac)m(k-) | |
| 5e13499c | 12832 | 150 5230 y(age,)43 b(use)d(`)p Fs(--without-)p Fj(package)11 |
| 37c41ab1 CR |
12833 | b Ft('.)63 b(T)-8 b(o)40 b(con\014gure)g(Bash)f(without)h(a)g(feature)g |
| 12834 | (that)g(is)g(enabled)f(b)m(y)150 5340 y(default,)31 b(use)f(`)p | |
| 12835 | Fs(--disable-)p Fj(feature)11 b Ft('.)p eop end | |
| 28157acd CR |
12836 | %%Page: 124 130 |
| 12837 | TeXDict begin 124 129 bop 150 -116 a Ft(124)2527 b(Bash)31 | |
| 37c41ab1 CR |
12838 | b(Reference)g(Man)m(ual)275 299 y(Here)21 b(is)g(a)g(complete)h(list)g |
| 12839 | (of)f(the)g(`)p Fs(--enable-)p Ft(')e(and)h(`)p Fs(--with-)p | |
| 12840 | Ft(')g(options)h(that)g(the)g(Bash)g Fs(configure)150 | |
| 12841 | 408 y Ft(recognizes.)150 589 y Fs(--with-afs)630 698 | |
| 12842 | y Ft(De\014ne)31 b(if)f(y)m(ou)h(are)f(using)g(the)h(Andrew)e(File)j | |
| 12843 | (System)e(from)g(T)-8 b(ransarc.)150 872 y Fs(--with-bash-malloc)630 | |
| 1c72c0cd CR |
12844 | 981 y Ft(Use)31 b(the)g(Bash)f(v)m(ersion)i(of)e Fs(malloc)f |
| 12845 | Ft(in)h(the)h(directory)g(`)p Fs(lib/malloc)p Ft('.)39 | |
| 12846 | b(This)30 b(is)h(not)g(the)630 1091 y(same)h Fs(malloc)e | |
| 12847 | Ft(that)j(app)s(ears)e(in)g Fl(gnu)h Ft(lib)s(c,)g(but)f(an)h(older)f | |
| 12848 | (v)m(ersion)i(originally)g(deriv)m(ed)630 1200 y(from)f(the)h(4.2)g | |
| 12849 | Fl(bsd)f Fs(malloc)p Ft(.)45 b(This)31 b Fs(malloc)g | |
| 12850 | Ft(is)i(v)m(ery)f(fast,)i(but)e(w)m(astes)h(some)g(space)g(on)630 | |
| 12851 | 1310 y(eac)m(h)g(allo)s(cation.)48 b(This)31 b(option)i(is)f(enabled)g | |
| 12852 | (b)m(y)g(default.)46 b(The)31 b(`)p Fs(NOTES)p Ft(')g(\014le)h(con)m | |
| 12853 | (tains)i(a)630 1419 y(list)29 b(of)f(systems)f(for)h(whic)m(h)g(this)g | |
| 12854 | (should)e(b)s(e)i(turned)e(o\013,)j(and)f Fs(configure)d | |
| 12855 | Ft(disables)j(this)630 1529 y(option)j(automatically)i(for)d(a)h(n)m | |
| 12856 | (um)m(b)s(er)e(of)i(systems.)150 1702 y Fs(--with-curses)630 | |
| 12857 | 1812 y Ft(Use)h(the)h(curses)e(library)h(instead)g(of)h(the)f(termcap)g | |
| 12858 | (library)-8 b(.)46 b(This)32 b(should)f(b)s(e)g(supplied)630 | |
| 12859 | 1921 y(if)f(y)m(our)h(system)f(has)g(an)h(inadequate)g(or)f(incomplete) | |
| 12860 | i(termcap)e(database.)150 2095 y Fs(--with-gnu-malloc)630 | |
| 12861 | 2204 y Ft(A)g(synon)m(ym)g(for)g Fs(--with-bash-malloc)p | |
| 12862 | Ft(.)150 2378 y Fs(--with-installed-readlin)o(e[=)p Fj(P)o(REFI)o(X)11 | |
| 12863 | b Fs(])630 2487 y Ft(De\014ne)26 b(this)f(to)h(mak)m(e)h(Bash)f(link)f | |
| 12864 | (with)g(a)h(lo)s(cally-installed)i(v)m(ersion)e(of)g(Readline)g(rather) | |
| 12865 | 630 2597 y(than)38 b(the)h(v)m(ersion)g(in)g(`)p Fs(lib/readline)p | |
| 12866 | Ft('.)62 b(This)38 b(w)m(orks)h(only)f(with)h(Readline)g(5.0)h(and)630 | |
| 37c41ab1 CR |
12867 | 2706 y(later)29 b(v)m(ersions.)40 b(If)28 b Fq(PREFIX)37 |
| 12868 | b Ft(is)28 b Fs(yes)f Ft(or)h(not)g(supplied,)f Fs(configure)f | |
| 12869 | Ft(uses)h(the)h(v)-5 b(alues)29 b(of)630 2816 y(the)c(mak)m(e)g(v)-5 | |
| 12870 | b(ariables)25 b Fs(includedir)d Ft(and)h Fs(libdir)p | |
| 12871 | Ft(,)h(whic)m(h)h(are)f(sub)s(directories)g(of)h Fs(prefix)630 | |
| 12872 | 2926 y Ft(b)m(y)32 b(default,)g(to)h(\014nd)d(the)i(installed)h(v)m | |
| 12873 | (ersion)f(of)g(Readline)h(if)f(it)g(is)g(not)g(in)g(the)g(standard)630 | |
| 12874 | 3035 y(system)j(include)f(and)g(library)g(directories.)54 | |
| 12875 | b(If)34 b Fq(PREFIX)43 b Ft(is)35 b Fs(no)p Ft(,)g(Bash)f(links)h(with) | |
| 12876 | f(the)630 3145 y(v)m(ersion)k(in)f(`)p Fs(lib/readline)p | |
| 12877 | Ft('.)58 b(If)37 b Fq(PREFIX)46 b Ft(is)38 b(set)g(to)g(an)m(y)f(other) | |
| 12878 | h(v)-5 b(alue,)39 b Fs(configure)630 3254 y Ft(treats)27 | |
| 12879 | b(it)g(as)f(a)h(directory)g(pathname)f(and)f(lo)s(oks)i(for)f(the)g | |
| 12880 | (installed)h(v)m(ersion)g(of)f(Readline)630 3364 y(in)34 | |
| 12881 | b(sub)s(directories)f(of)h(that)h(directory)g(\(include)f(\014les)g(in) | |
| 5e13499c | 12882 | g Fq(PREFIX)9 b Ft(/)p Fs(include)32 b Ft(and)i(the)630 |
| 37c41ab1 CR |
12883 | 3473 y(library)c(in)g Fq(PREFIX)9 b Ft(/)p Fs(lib)p Ft(\).)150 |
| 12884 | 3647 y Fs(--with-purify)630 3756 y Ft(De\014ne)23 b(this)g(to)h(use)f | |
| 12885 | (the)g(Purify)f(memory)h(allo)s(cation)i(c)m(hec)m(k)m(er)g(from)e | |
| 12886 | (Rational)i(Soft)m(w)m(are.)150 3930 y Fs(--enable-minimal-config)630 | |
| 12887 | 4039 y Ft(This)e(pro)s(duces)f(a)i(shell)g(with)f(minimal)h(features,)h | |
| 12888 | (close)g(to)f(the)g(historical)h(Bourne)e(shell.)275 | |
| 12889 | 4219 y(There)g(are)i(sev)m(eral)g(`)p Fs(--enable-)p | |
| 12890 | Ft(')d(options)j(that)f(alter)h(ho)m(w)g(Bash)f(is)g(compiled)h(and)e | |
| 12891 | (link)m(ed,)j(rather)150 4329 y(than)k(c)m(hanging)h(run-time)f | |
| 12892 | (features.)150 4509 y Fs(--enable-largefile)630 4619 | |
| 12893 | y Ft(Enable)76 b(supp)s(ort)f(for)h(large)h(\014les)f(\()p | |
| 5e13499c | 12894 | Fs(http://www.sas.com/standar)o(ds/l)o(arge)o(_)630 4728 |
| 37c41ab1 CR |
12895 | y(file/x_open.20Mar96.html)o Ft(\))23 b(if)28 b(the)g(op)s(erating)h |
| 12896 | (system)f(requires)g(sp)s(ecial)g(compiler)630 4838 y(options)45 | |
| 12897 | b(to)g(build)e(programs)h(whic)m(h)g(can)g(access)i(large)f(\014les.)82 | |
| 12898 | b(This)44 b(is)g(enabled)g(b)m(y)630 4948 y(default,)31 | |
| 12899 | b(if)f(the)h(op)s(erating)g(system)f(pro)m(vides)g(large)i(\014le)e | |
| 5e13499c | 12900 | (supp)s(ort.)150 5121 y Fs(--enable-profiling)630 5230 |
| 37c41ab1 CR |
12901 | y Ft(This)h(builds)f(a)i(Bash)g(binary)f(that)h(pro)s(duces)e |
| 12902 | (pro\014ling)h(information)h(to)h(b)s(e)d(pro)s(cessed)630 | |
| 12903 | 5340 y(b)m(y)g Fs(gprof)f Ft(eac)m(h)j(time)f(it)g(is)f(executed.)p | |
| 12904 | eop end | |
| 28157acd CR |
12905 | %%Page: 125 131 |
| 12906 | TeXDict begin 125 130 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
| 12907 | b(Installing)31 b(Bash)2356 b(125)150 299 y Fs(--enable-static-link)630 | |
| 37c41ab1 CR |
12908 | 408 y Ft(This)37 b(causes)h(Bash)f(to)h(b)s(e)f(link)m(ed)h(statically) |
| 12909 | -8 b(,)43 b(if)37 b Fs(gcc)g Ft(is)g(b)s(eing)g(used.)61 | |
| 12910 | b(This)37 b(could)h(b)s(e)630 518 y(used)30 b(to)h(build)e(a)i(v)m | |
| 01ed5ba4 | 12911 | (ersion)g(to)g(use)f(as)g(ro)s(ot's)h(shell.)275 671 |
| 37c41ab1 CR |
12912 | y(The)f(`)p Fs(minimal-config)p Ft(')d(option)k(can)g(b)s(e)f(used)f |
| 12913 | (to)j(disable)e(all)i(of)f(the)f(follo)m(wing)i(options,)g(but)d(it)150 | |
| 01ed5ba4 | 12914 | 781 y(is)h(pro)s(cessed)g(\014rst,)g(so)h(individual)f(options)g(ma)m |
| 37c41ab1 | 12915 | (y)h(b)s(e)f(enabled)g(using)g(`)p Fs(enable-)p Fj(feature)11 |
| 01ed5ba4 | 12916 | b Ft('.)275 913 y(All)37 b(of)g(the)f(follo)m(wing)i(options)f(except)h |
| 37c41ab1 | 12917 | (for)e(`)p Fs(disabled-builtins)p Ft(')d(and)j(`)p Fs(xpg-echo-default) |
| 01ed5ba4 | 12918 | p Ft(')150 1022 y(are)26 b(enabled)g(b)m(y)g(default,)h(unless)f(the)g |
| 37c41ab1 | 12919 | (op)s(erating)g(system)g(do)s(es)g(not)g(pro)m(vide)g(the)g(necessary)g |
| 01ed5ba4 | 12920 | (supp)s(ort.)150 1176 y Fs(--enable-alias)630 1285 y |
| 37c41ab1 CR |
12921 | Ft(Allo)m(w)41 b(alias)g(expansion)f(and)f(include)g(the)h |
| 12922 | Fs(alias)f Ft(and)g Fs(unalias)e Ft(builtins)j(\(see)g(Sec-)630 | |
| 28157acd | 12923 | 1395 y(tion)31 b(6.6)g([Aliases],)i(page)e(75\).)150 |
| 01ed5ba4 | 12924 | 1548 y Fs(--enable-arith-for-comma)o(nd)630 1658 y Ft(Include)21 |
| 37c41ab1 CR |
12925 | b(supp)s(ort)g(for)g(the)i(alternate)g(form)f(of)g(the)g |
| 12926 | Fs(for)f Ft(command)h(that)h(b)s(eha)m(v)m(es)f(lik)m(e)i(the)630 | |
| 01ed5ba4 | 12927 | 1767 y(C)30 b(language)i Fs(for)d Ft(statemen)m(t)j(\(see)g(Section)f |
| 37c41ab1 | 12928 | (3.2.4.1)i([Lo)s(oping)d(Constructs],)h(page)g(9\).)150 |
| 01ed5ba4 | 12929 | 1921 y Fs(--enable-array-variables)630 2030 y Ft(Include)h(supp)s(ort)g |
| 37c41ab1 | 12930 | (for)h(one-dimensional)h(arra)m(y)f(shell)h(v)-5 b(ariables)33 |
| 28157acd | 12931 | b(\(see)h(Section)g(6.7)h([Ar-)630 2140 y(ra)m(ys],)c(page)g(76\).)150 |
| 01ed5ba4 | 12932 | 2293 y Fs(--enable-bang-history)630 2403 y Ft(Include)36 |
| 37c41ab1 | 12933 | b(supp)s(ort)f(for)h Fs(csh)p Ft(-lik)m(e)h(history)g(substitution)f |
| 01ed5ba4 | 12934 | (\(see)h(Section)g(9.3)h([History)f(In-)630 2513 y(teraction],)c(page)e |
| 28157acd | 12935 | (117\).)150 2666 y Fs(--enable-brace-expansion)630 2776 |
| 37c41ab1 | 12936 | y Ft(Include)40 b Fs(csh)p Ft(-lik)m(e)h(brace)f(expansion)g(\()h |
| 01ed5ba4 CR |
12937 | Fs(b{a,b}c)2445 2772 y Fp(7!)2576 2776 y Fs(bac)30 b(bbc)39 |
| 12938 | b Ft(\).)71 b(See)40 b(Section)h(3.5.1)630 2885 y([Brace)32 | |
| 37c41ab1 | 12939 | b(Expansion],)e(page)h(17,)h(for)e(a)g(complete)i(description.)150 |
| 01ed5ba4 | 12940 | 3039 y Fs(--enable-command-timing)630 3148 y Ft(Include)43 |
| 37c41ab1 | 12941 | b(supp)s(ort)f(for)h(recognizing)i Fs(time)e Ft(as)g(a)h(reserv)m(ed)g |
| 01ed5ba4 | 12942 | (w)m(ord)f(and)g(for)h(displa)m(ying)630 3258 y(timing)37 |
| 37c41ab1 CR |
12943 | b(statistics)h(for)e(the)g(pip)s(eline)g(follo)m(wing)i |
| 12944 | Fs(time)d Ft(\(see)i(Section)g(3.2.2)h([Pip)s(elines],)630 | |
| 01ed5ba4 | 12945 | 3367 y(page)24 b(8\).)39 b(This)23 b(allo)m(ws)h(pip)s(elines)f(as)h(w) |
| 37c41ab1 | 12946 | m(ell)g(as)g(shell)f(builtins)g(and)g(functions)g(to)h(b)s(e)e(timed.) |
| 01ed5ba4 | 12947 | 150 3521 y Fs(--enable-cond-command)630 3630 y Ft(Include)33 |
| 37c41ab1 | 12948 | b(supp)s(ort)f(for)i(the)g Fs([[)f Ft(conditional)i(command.)51 |
| 01ed5ba4 CR |
12949 | b(\(see)34 b(Section)h(3.2.4.2)h([Condi-)630 3740 y(tional)c |
| 12950 | (Constructs],)e(page)h(10\).)150 3893 y Fs(--enable-cond-regexp)630 | |
| 12951 | 4003 y Ft(Include)f(supp)s(ort)f(for)i(matc)m(hing)h(POSIX)d(regular)i | |
| 37c41ab1 | 12952 | (expressions)g(using)f(the)h(`)p Fs(=~)p Ft(')g(binary)630 |
| 01ed5ba4 | 12953 | 4113 y(op)s(erator)25 b(in)f(the)h Fs([[)f Ft(conditional)h(command.)39 |
| 37c41ab1 | 12954 | b(\(see)25 b(Section)h(3.2.4.2)h([Conditional)e(Con-)630 |
| 01ed5ba4 CR |
12955 | 4222 y(structs],)31 b(page)g(10\).)150 4376 y Fs(--enable-debugger)630 |
| 12956 | 4485 y Ft(Include)f(supp)s(ort)e(for)i(the)h(bash)f(debugger)g | |
| 12957 | (\(distributed)g(separately\).)150 4639 y Fs(--enable-directory-stack) | |
| 12958 | 630 4748 y Ft(Include)j(supp)s(ort)g(for)h(a)g Fs(csh)p | |
| 12959 | Ft(-lik)m(e)h(directory)f(stac)m(k)i(and)d(the)i Fs(pushd)p | |
| 12960 | Ft(,)f Fs(popd)p Ft(,)g(and)f Fs(dirs)630 4858 y Ft(builtins)d(\(see)h | |
| 28157acd | 12961 | (Section)g(6.8)h([The)e(Directory)i(Stac)m(k],)g(page)f(77\).)150 |
| 01ed5ba4 CR |
12962 | 5011 y Fs(--enable-disabled-builti)o(ns)630 5121 y Ft(Allo)m(w)40 |
| 12963 | b(builtin)e(commands)g(to)h(b)s(e)f(in)m(v)m(ok)m(ed)i(via)f(`)p | |
| 12964 | Fs(builtin)29 b(xxx)p Ft(')37 b(ev)m(en)j(after)f Fs(xxx)e | |
| 12965 | Ft(has)630 5230 y(b)s(een)31 b(disabled)g(using)g(`)p | |
| 37c41ab1 | 12966 | Fs(enable)d(-n)i(xxx)p Ft('.)43 b(See)32 b(Section)g(4.2)h([Bash)e |
| ac18b312 | 12967 | (Builtins],)i(page)f(41,)630 5340 y(for)e(details)i(of)e(the)h |
| 01ed5ba4 CR |
12968 | Fs(builtin)d Ft(and)i Fs(enable)e Ft(builtin)i(commands.)p |
| 12969 | eop end | |
| 28157acd CR |
12970 | %%Page: 126 132 |
| 12971 | TeXDict begin 126 131 bop 150 -116 a Ft(126)2527 b(Bash)31 | |
| 01ed5ba4 CR |
12972 | b(Reference)g(Man)m(ual)150 299 y Fs(--enable-dparen-arithmet)o(ic)630 |
| 12973 | 408 y Ft(Include)42 b(supp)s(ort)f(for)h(the)h Fs(\(\(...)o(\)\))f | |
| 12974 | Ft(command)g(\(see)i(Section)f(3.2.4.2)i([Conditional)630 | |
| 12975 | 518 y(Constructs],)30 b(page)h(10\).)150 673 y Fs | |
| 12976 | (--enable-extended-glob)630 783 y Ft(Include)40 b(supp)s(ort)e(for)i | |
| 12977 | (the)h(extended)f(pattern)h(matc)m(hing)g(features)g(describ)s(ed)e(ab) | |
| 12978 | s(o)m(v)m(e)630 892 y(under)29 b(Section)i(3.5.8.1)i([P)m(attern)e | |
| 28157acd | 12979 | (Matc)m(hing],)i(page)e(23.)150 1048 y Fs(--enable-help-builtin)630 |
| 01ed5ba4 CR |
12980 | 1157 y Ft(Include)24 b(the)h Fs(help)f Ft(builtin,)h(whic)m(h)g(displa) |
| 12981 | m(ys)f(help)h(on)f(shell)h(builtins)f(and)h(v)-5 b(ariables)25 | |
| 12982 | b(\(see)630 1267 y(Section)31 b(4.2)h([Bash)e(Builtins],)i(page)f | |
| ac18b312 | 12983 | (41\).)150 1422 y Fs(--enable-history)630 1532 y Ft(Include)e(command)g |
| 37c41ab1 | 12984 | (history)h(and)f(the)h Fs(fc)f Ft(and)g Fs(history)e |
| 01ed5ba4 | 12985 | Ft(builtin)j(commands)f(\(see)h(Sec-)630 1641 y(tion)h(9.1)g([Bash)g |
| 28157acd | 12986 | (History)g(F)-8 b(acilities],)34 b(page)d(115\).)150 |
| 01ed5ba4 | 12987 | 1797 y Fs(--enable-job-control)630 1906 y Ft(This)e(enables)i(the)f |
| 37c41ab1 | 12988 | (job)g(con)m(trol)h(features)g(\(see)g(Chapter)f(7)g([Job)g(Con)m |
| 28157acd | 12989 | (trol],)h(page)g(85\),)h(if)630 2016 y(the)f(op)s(erating)f(system)h |
| 01ed5ba4 CR |
12990 | (supp)s(orts)d(them.)150 2171 y Fs(--enable-multibyte)630 |
| 12991 | 2281 y Ft(This)h(enables)i(supp)s(ort)d(for)i(m)m(ultib)m(yte)h(c)m | |
| 37c41ab1 | 12992 | (haracters)g(if)f(the)g(op)s(erating)h(system)f(pro)m(vides)630 |
| 01ed5ba4 CR |
12993 | 2390 y(the)h(necessary)f(supp)s(ort.)150 2545 y Fs |
| 12994 | (--enable-net-redirection)o(s)630 2655 y Ft(This)21 b(enables)h(the)g | |
| 37c41ab1 | 12995 | (sp)s(ecial)h(handling)e(of)h(\014lenames)g(of)g(the)g(form)f |
| 01ed5ba4 | 12996 | Fs(/dev/tcp/)p Fj(host)11 b Fs(/)p Fj(port)630 2765 y |
| 37c41ab1 CR |
12997 | Ft(and)29 b Fs(/dev/udp/)p Fj(host)11 b Fs(/)p Fj(port)34 |
| 12998 | b Ft(when)28 b(used)g(in)h(redirections)h(\(see)g(Section)g(3.6)g | |
| 9d2b70f0 | 12999 | ([Redirec-)630 2874 y(tions],)h(page)g(25\).)150 3029 |
| 01ed5ba4 | 13000 | y Fs(--enable-process-substit)o(utio)o(n)630 3139 y Ft(This)49 |
| 37c41ab1 | 13001 | b(enables)i(pro)s(cess)f(substitution)g(\(see)h(Section)g(3.5.6)h([Pro) |
| 01ed5ba4 | 13002 | s(cess)e(Substitution],)630 3249 y(page)31 b(22\))h(if)e(the)h(op)s |
| 37c41ab1 | 13003 | (erating)f(system)h(pro)m(vides)f(the)h(necessary)g(supp)s(ort.)150 |
| 01ed5ba4 CR |
13004 | 3404 y Fs(--enable-progcomp)630 3513 y Ft(Enable)d(the)g(programmable)g |
| 13005 | (completion)i(facilities)g(\(see)f(Section)g(8.6)g([Programmable)630 | |
| 28157acd | 13006 | 3623 y(Completion],)i(page)h(109\).)42 b(If)30 b(Readline)h(is)f(not)h |
| 01ed5ba4 CR |
13007 | (enabled,)f(this)h(option)g(has)f(no)g(e\013ect.)150 |
| 13008 | 3778 y Fs(--enable-prompt-string-d)o(ecod)o(ing)630 3888 | |
| 37c41ab1 CR |
13009 | y Ft(T)-8 b(urn)46 b(on)h(the)h(in)m(terpretation)g(of)g(a)g(n)m(um)m |
| 13010 | (b)s(er)e(of)h(bac)m(kslash-escap)s(ed)h(c)m(haracters)h(in)630 | |
| 01ed5ba4 | 13011 | 3998 y(the)39 b Fs($PS1)p Ft(,)g Fs($PS2)p Ft(,)h Fs($PS3)p |
| 37c41ab1 | 13012 | Ft(,)f(and)f Fs($PS4)f Ft(prompt)h(strings.)64 b(See)39 |
| 01ed5ba4 | 13013 | b(Section)g(6.9)h([Prin)m(ting)f(a)630 4107 y(Prompt],)30 |
| 28157acd | 13014 | b(page)h(79,)h(for)e(a)h(complete)h(list)f(of)f(prompt)g(string)g |
| 01ed5ba4 CR |
13015 | (escap)s(e)h(sequences.)150 4262 y Fs(--enable-readline)630 |
| 13016 | 4372 y Ft(Include)d(supp)s(ort)f(for)h(command-line)h(editing)g(and)f | |
| 13017 | (history)g(with)g(the)h(Bash)g(v)m(ersion)g(of)630 4482 | |
| 37c41ab1 | 13018 | y(the)i(Readline)g(library)f(\(see)h(Chapter)f(8)g([Command)g(Line)g |
| 28157acd | 13019 | (Editing],)h(page)g(89\).)150 4637 y Fs(--enable-restricted)630 |
| 01ed5ba4 | 13020 | 4746 y Ft(Include)41 b(supp)s(ort)f(for)i(a)g Fq(restricted)g(shell)p |
| 37c41ab1 | 13021 | Ft(.)75 b(If)42 b(this)f(is)h(enabled,)j(Bash,)g(when)c(called)630 |
| 01ed5ba4 | 13022 | 4856 y(as)f Fs(rbash)p Ft(,)h(en)m(ters)f(a)g(restricted)h(mo)s(de.)68 |
| 37c41ab1 | 13023 | b(See)40 b(Section)h(6.10)g([The)f(Restricted)h(Shell],)630 |
| 28157acd | 13024 | 4966 y(page)31 b(80,)h(for)e(a)g(description)h(of)f(restricted)h(mo)s |
| 01ed5ba4 | 13025 | (de.)150 5121 y Fs(--enable-select)630 5230 y Ft(Include)k(the)g |
| 37c41ab1 | 13026 | Fs(select)f Ft(builtin,)i(whic)m(h)f(allo)m(ws)i(the)f(generation)g(of) |
| 01ed5ba4 CR |
13027 | g(simple)f(men)m(us)g(\(see)630 5340 y(Section)c(3.2.4.2)i |
| 13028 | ([Conditional)e(Constructs],)g(page)g(10\).)p eop end | |
| 28157acd CR |
13029 | %%Page: 127 133 |
| 13030 | TeXDict begin 127 132 bop 150 -116 a Ft(Chapter)30 b(10:)41 | |
| 13031 | b(Installing)31 b(Bash)2356 b(127)150 299 y Fs | |
| 01ed5ba4 CR |
13032 | (--enable-separate-helpfi)o(les)630 408 y Ft(Use)32 b(external)h |
| 13033 | (\014les)f(for)g(the)g(do)s(cumen)m(tation)h(displa)m(y)m(ed)f(b)m(y)g | |
| 13034 | (the)g Fs(help)f Ft(builtin)h(instead)630 518 y(of)f(storing)f(the)h | |
| 13035 | (text)g(in)m(ternally)-8 b(.)150 677 y Fs(--enable-single-help-str)o | |
| 13036 | (ings)630 787 y Ft(Store)40 b(the)g(text)h(displa)m(y)m(ed)g(b)m(y)e | |
| 13037 | (the)i Fs(help)d Ft(builtin)i(as)g(a)g(single)h(string)f(for)f(eac)m(h) | |
| 13038 | i(help)630 897 y(topic.)54 b(This)33 b(aids)i(in)f(translating)h(the)g | |
| 13039 | (text)g(to)g(di\013eren)m(t)g(languages.)54 b(Y)-8 b(ou)35 | |
| 13040 | b(ma)m(y)g(need)630 1006 y(to)c(disable)g(this)f(if)g(y)m(our)h | |
| 13041 | (compiler)g(cannot)f(handle)g(v)m(ery)h(long)g(string)f(literals.)150 | |
| 1c72c0cd CR |
13042 | 1166 y Fs(--enable-strict-posix-de)o(faul)o(t)630 1275 |
| 13043 | y Ft(Mak)m(e)c(Bash)f Fl(posix)p Ft(-conforman)m(t)g(b)m(y)f(default)h | |
| 13044 | (\(see)g(Section)h(6.11)g([Bash)f(POSIX)e(Mo)s(de],)630 | |
| 28157acd | 13045 | 1385 y(page)31 b(80\).)150 1544 y Fs(--enable-usg-echo-defaul)o(t)630 |
| 1c72c0cd CR |
13046 | 1654 y Ft(A)f(synon)m(ym)g(for)g Fs(--enable-xpg-echo-default)p |
| 13047 | Ft(.)150 1813 y Fs(--enable-xpg-echo-defaul)o(t)630 1923 | |
| 13048 | y Ft(Mak)m(e)c(the)f Fs(echo)e Ft(builtin)i(expand)f(bac)m | |
| 13049 | (kslash-escap)s(ed)h(c)m(haracters)h(b)m(y)f(default,)h(without)630 | |
| 13050 | 2032 y(requiring)41 b(the)g(`)p Fs(-e)p Ft(')g(option.)73 | |
| 13051 | b(This)41 b(sets)g(the)g(default)h(v)-5 b(alue)41 b(of)h(the)f | |
| 13052 | Fs(xpg_echo)e Ft(shell)630 2142 y(option)26 b(to)g Fs(on)p | |
| 13053 | Ft(,)g(whic)m(h)g(mak)m(es)g(the)g(Bash)g Fs(echo)e Ft(b)s(eha)m(v)m(e) | |
| 13054 | i(more)g(lik)m(e)h(the)f(v)m(ersion)g(sp)s(eci\014ed)630 | |
| 13055 | 2252 y(in)41 b(the)h(Single)g(Unix)f(Sp)s(eci\014cation,)k(v)m(ersion)e | |
| 13056 | (3.)74 b(See)42 b(Section)g(4.2)h([Bash)f(Builtins],)630 | |
| ac18b312 | 13057 | 2361 y(page)31 b(41,)h(for)e(a)g(description)h(of)f(the)h(escap)s(e)g |
| 1c72c0cd CR |
13058 | (sequences)f(that)h Fs(echo)f Ft(recognizes.)275 2521 |
| 13059 | y(The)23 b(\014le)i(`)p Fs(config-top.h)p Ft(')c(con)m(tains)26 | |
| 37c41ab1 | 13060 | b(C)e(Prepro)s(cessor)g(`)p Fs(#define)p Ft(')e(statemen)m(ts)k(for)f |
| 1c72c0cd | 13061 | (options)f(whic)m(h)150 2630 y(are)35 b(not)g(settable)i(from)d |
| 5e13499c | 13062 | Fs(configure)p Ft(.)51 b(Some)35 b(of)g(these)g(are)h(not)f(mean)m(t)g |
| 1c72c0cd | 13063 | (to)h(b)s(e)e(c)m(hanged;)k(b)s(ew)m(are)d(of)150 2740 |
| 37c41ab1 CR |
13064 | y(the)h(consequences)g(if)f(y)m(ou)h(do.)55 b(Read)36 |
| 13065 | b(the)g(commen)m(ts)g(asso)s(ciated)h(with)e(eac)m(h)i(de\014nition)e | |
| 1c72c0cd | 13066 | (for)g(more)150 2849 y(information)c(ab)s(out)f(its)h(e\013ect.)p |
| 37c41ab1 | 13067 | eop end |
| 28157acd CR |
13068 | %%Page: 128 134 |
| 13069 | TeXDict begin 128 133 bop 150 -116 a Ft(128)2527 b(Bash)31 | |
| 37c41ab1 | 13070 | b(Reference)g(Man)m(ual)p eop end |
| 28157acd CR |
13071 | %%Page: 129 135 |
| 13072 | TeXDict begin 129 134 bop 150 -116 a Ft(App)s(endix)29 | |
| 13073 | b(A:)h(Rep)s(orting)h(Bugs)2299 b(129)150 299 y Fo(App)t(endix)52 | |
| 37c41ab1 CR |
13074 | b(A)121 b(Rep)t(orting)52 b(Bugs)275 533 y Ft(Please)35 |
| 13075 | b(rep)s(ort)e(all)i(bugs)f(y)m(ou)g(\014nd)f(in)h(Bash.)52 | |
| 13076 | b(But)34 b(\014rst,)h(y)m(ou)f(should)f(mak)m(e)i(sure)f(that)g(it)h | |
| 13077 | (really)150 643 y(is)h(a)g(bug,)h(and)e(that)h(it)h(app)s(ears)e(in)g | |
| 13078 | (the)h(latest)i(v)m(ersion)e(of)g(Bash.)57 b(The)35 b(latest)j(v)m | |
| 13079 | (ersion)e(of)g(Bash)g(is)150 752 y(alw)m(a)m(ys)c(a)m(v)-5 | |
| 13080 | b(ailable)33 b(for)d(FTP)g(from)g Fs(ftp://ftp.gnu.org/pub/ba)o(sh/)o | |
| 13081 | Ft(.)275 887 y(Once)41 b(y)m(ou)g(ha)m(v)m(e)h(determined)f(that)h(a)f | |
| 13082 | (bug)g(actually)h(exists,)j(use)c(the)g Fs(bashbug)e | |
| 13083 | Ft(command)i(to)150 996 y(submit)25 b(a)h(bug)g(rep)s(ort.)38 | |
| 13084 | b(If)26 b(y)m(ou)g(ha)m(v)m(e)h(a)f(\014x,)h(y)m(ou)f(are)g(encouraged) | |
| 13085 | h(to)f(mail)h(that)f(as)g(w)m(ell!)40 b(Suggestions)150 | |
| 28157acd CR |
13086 | 1106 y(and)20 b(`philosophical')j(bug)d(rep)s(orts)g(ma)m(y)i(b)s(e)f |
| 13087 | (mailed)g(to)h Fs(bug-bash@gnu.org)17 b Ft(or)k(p)s(osted)f(to)i(the)f | |
| 37c41ab1 CR |
13088 | (Usenet)150 1215 y(newsgroup)29 b Fs(gnu.bash.bug)p Ft(.)275 |
| 13089 | 1350 y(All)i(bug)e(rep)s(orts)h(should)f(include:)225 | |
| 13090 | 1484 y Fp(\017)60 b Ft(The)30 b(v)m(ersion)h(n)m(um)m(b)s(er)e(of)h | |
| 13091 | (Bash.)225 1619 y Fp(\017)60 b Ft(The)30 b(hardw)m(are)g(and)g(op)s | |
| 13092 | (erating)g(system.)225 1753 y Fp(\017)60 b Ft(The)30 | |
| 13093 | b(compiler)h(used)e(to)i(compile)h(Bash.)225 1888 y Fp(\017)60 | |
| 13094 | b Ft(A)30 b(description)h(of)f(the)h(bug)f(b)s(eha)m(viour.)225 | |
| 13095 | 2022 y Fp(\017)60 b Ft(A)30 b(short)h(script)f(or)g(`recip)s(e')h(whic) | |
| 13096 | m(h)f(exercises)i(the)e(bug)g(and)g(ma)m(y)h(b)s(e)f(used)f(to)i(repro) | |
| 13097 | s(duce)e(it.)150 2182 y Fs(bashbug)d Ft(inserts)i(the)h(\014rst)f | |
| 13098 | (three)g(items)h(automatically)i(in)m(to)f(the)e(template)i(it)f(pro)m | |
| 13099 | (vides)f(for)g(\014ling)h(a)150 2291 y(bug)h(rep)s(ort.)275 | |
| 13100 | 2426 y(Please)h(send)f(all)h(rep)s(orts)f(concerning)g(this)h(man)m | |
| 13101 | (ual)f(to)h Fs(chet@po.CWRU.Edu)p Ft(.)p eop end | |
| 28157acd CR |
13102 | %%Page: 130 136 |
| 13103 | TeXDict begin 130 135 bop 150 -116 a Ft(130)2527 b(Bash)31 | |
| 37c41ab1 | 13104 | b(Reference)g(Man)m(ual)p eop end |
| 28157acd CR |
13105 | %%Page: 131 137 |
| 13106 | TeXDict begin 131 136 bop 150 -116 a Ft(App)s(endix)29 | |
| 37c41ab1 | 13107 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
| 28157acd | 13108 | b(The)f(Bourne)g(Shell)1258 b(131)150 141 y Fo(App)t(endix)52 |
| 37c41ab1 | 13109 | b(B)128 b(Ma)9 b(jor)54 b(Di\013erences)d(F)-13 b(rom)54 |
| 1c72c0cd | 13110 | b(The)f(Bourne)1135 299 y(Shell)275 530 y Ft(Bash)25 |
| 37c41ab1 | 13111 | b(implemen)m(ts)g(essen)m(tially)i(the)f(same)f(grammar,)i(parameter)e |
| 1c72c0cd | 13112 | (and)g(v)-5 b(ariable)26 b(expansion,)g(redi-)150 640 |
| ac18b312 CR |
13113 | y(rection,)i(and)e(quoting)h(as)f(the)g(Bourne)g(Shell.)40 |
| 13114 | b(Bash)26 b(uses)g(the)g Fl(posix)g Ft(standard)f(as)i(the)f(sp)s | |
| 13115 | (eci\014cation)150 749 y(of)h(ho)m(w)h(these)f(features)h(are)f(to)h(b) | |
| 13116 | s(e)f(implemen)m(ted.)40 b(There)27 b(are)g(some)h(di\013erences)f(b)s | |
| 13117 | (et)m(w)m(een)h(the)g(tradi-)150 859 y(tional)33 b(Bourne)e(shell)h | |
| 13118 | (and)f(Bash;)i(this)f(section)g(quic)m(kly)h(details)g(the)e | |
| 13119 | (di\013erences)h(of)g(signi\014cance.)46 b(A)150 969 | |
| 13120 | y(n)m(um)m(b)s(er)24 b(of)h(these)h(di\013erences)f(are)h(explained)f | |
| 13121 | (in)g(greater)h(depth)f(in)g(previous)f(sections.)40 | |
| 13122 | b(This)25 b(section)150 1078 y(uses)33 b(the)i(v)m(ersion)f(of)g | |
| 13123 | Fs(sh)f Ft(included)g(in)h(SVR4.2)h(\(the)f(last)h(v)m(ersion)f(of)g | |
| 13124 | (the)g(historical)i(Bourne)d(shell\))150 1188 y(as)e(the)f(baseline)h | |
| 1c72c0cd CR |
13125 | (reference.)225 1322 y Fp(\017)60 b Ft(Bash)32 b(is)h |
| 13126 | Fl(posix)p Ft(-conforman)m(t,)g(ev)m(en)g(where)f(the)g | |
| 13127 | Fl(posix)g Ft(sp)s(eci\014cation)h(di\013ers)f(from)g(traditional)330 | |
| 13128 | 1431 y Fs(sh)e Ft(b)s(eha)m(vior)g(\(see)i(Section)f(6.11)h([Bash)e | |
| 28157acd | 13129 | (POSIX)g(Mo)s(de],)h(page)g(80\).)225 1565 y Fp(\017)60 |
| 1c72c0cd CR |
13130 | b Ft(Bash)26 b(has)g(m)m(ulti-c)m(haracter)i(in)m(v)m(o)s(cation)g |
| 13131 | (options)f(\(see)f(Section)h(6.1)g([In)m(v)m(oking)g(Bash],)h(page)e | |
| 28157acd | 13132 | (67\).)225 1699 y Fp(\017)60 b Ft(Bash)28 b(has)g(command-line)h |
| 1c72c0cd | 13133 | (editing)f(\(see)h(Chapter)f(8)g([Command)f(Line)h(Editing],)i(page)e |
| 28157acd | 13134 | (89\))i(and)330 1809 y(the)h Fs(bind)e Ft(builtin.)225 |
| 1c72c0cd CR |
13135 | 1943 y Fp(\017)60 b Ft(Bash)46 b(pro)m(vides)g(a)g(programmable)g(w)m |
| 13136 | (ord)f(completion)i(mec)m(hanism)f(\(see)h(Section)g(8.6)g([Pro-)330 | |
| 28157acd | 13137 | 2052 y(grammable)21 b(Completion],)i(page)e(109\),)k(and)19 |
| 1c72c0cd CR |
13138 | b(t)m(w)m(o)j(builtin)e(commands,)i Fs(complete)c Ft(and)i |
| 13139 | Fs(compgen)p Ft(,)330 2162 y(to)31 b(manipulate)g(it.)225 | |
| 13140 | 2296 y Fp(\017)60 b Ft(Bash)26 b(has)f(command)h(history)f(\(see)i | |
| 37c41ab1 | 13141 | (Section)f(9.1)h([Bash)f(History)h(F)-8 b(acilities],)30 |
| 28157acd | 13142 | b(page)c(115\))i(and)d(the)330 2405 y Fs(history)k Ft(and)h |
| 37c41ab1 CR |
13143 | Fs(fc)g Ft(builtins)g(to)h(manipulate)g(it.)42 b(The)30 |
| 13144 | b(Bash)h(history)g(list)g(main)m(tains)g(timestamp)330 | |
| 1c72c0cd | 13145 | 2515 y(information)g(and)e(uses)h(the)h(v)-5 b(alue)31 |
| 37c41ab1 | 13146 | b(of)f(the)h Fs(HISTTIMEFORMAT)26 b Ft(v)-5 b(ariable)32 |
| 1c72c0cd | 13147 | b(to)f(displa)m(y)f(it.)225 2649 y Fp(\017)60 b Ft(Bash)48 |
| 37c41ab1 | 13148 | b(implemen)m(ts)h Fs(csh)p Ft(-lik)m(e)g(history)f(expansion)g(\(see)h |
| 1c72c0cd | 13149 | (Section)g(9.3)h([History)f(In)m(teraction],)330 2759 |
| 28157acd | 13150 | y(page)31 b(117\).)225 2892 y Fp(\017)60 b Ft(Bash)33 |
| 37c41ab1 | 13151 | b(has)g(one-dimensional)h(arra)m(y)f(v)-5 b(ariables)34 |
| 28157acd | 13152 | b(\(see)g(Section)g(6.7)g([Arra)m(ys],)g(page)g(76\),)h(and)e(the)330 |
| 1c72c0cd | 13153 | 3002 y(appropriate)39 b(v)-5 b(ariable)40 b(expansions)f(and)g |
| 37c41ab1 | 13154 | (assignmen)m(t)h(syn)m(tax)g(to)g(use)f(them.)67 b(Sev)m(eral)40 |
| 1c72c0cd | 13155 | b(of)g(the)330 3112 y(Bash)32 b(builtins)f(tak)m(e)j(options)e(to)h |
| 37c41ab1 | 13156 | (act)g(on)e(arra)m(ys.)46 b(Bash)32 b(pro)m(vides)g(a)g(n)m(um)m(b)s |
| 1c72c0cd CR |
13157 | (er)f(of)h(built-in)f(arra)m(y)330 3221 y(v)-5 b(ariables.)225 |
| 13158 | 3355 y Fp(\017)60 b Ft(The)37 b Fs($'...)n(')g Ft(quoting)g(syn)m(tax,) | |
| 37c41ab1 | 13159 | j(whic)m(h)d(expands)f(ANSI-C)h(bac)m(kslash-escap)s(ed)h(c)m |
| 1c72c0cd | 13160 | (haracters)g(in)330 3465 y(the)26 b(text)h(b)s(et)m(w)m(een)g(the)g |
| 37c41ab1 | 13161 | (single)f(quotes,)i(is)e(supp)s(orted)f(\(see)i(Section)g(3.1.2.4)h |
| 1c72c0cd | 13162 | ([ANSI-C)e(Quoting],)330 3574 y(page)31 b(6\).)225 3708 |
| 37c41ab1 CR |
13163 | y Fp(\017)60 b Ft(Bash)69 b(supp)s(orts)e(the)i Fs($"...)n(")g |
| 13164 | Ft(quoting)g(syn)m(tax)g(to)h(do)e(lo)s(cale-sp)s(eci\014c)j | |
| 1c72c0cd | 13165 | (translation)f(of)330 3818 y(the)65 b(c)m(haracters)i(b)s(et)m(w)m(een) |
| 37c41ab1 | 13166 | f(the)f(double)g(quotes.)145 b(The)65 b(`)p Fs(-D)p Ft(',)74 |
| 1c72c0cd | 13167 | b(`)p Fs(--dump-strings)p Ft(',)d(and)330 3927 y(`)p |
| 37c41ab1 CR |
13168 | Fs(--dump-po-strings)p Ft(')27 b(in)m(v)m(o)s(cation)33 |
| 13169 | b(options)e(list)h(the)f(translatable)h(strings)f(found)f(in)h(a)g | |
| 1c72c0cd CR |
13170 | (script)330 4037 y(\(see)g(Section)h(3.1.2.5)g([Lo)s(cale)g(T)-8 |
| 13171 | b(ranslation],)32 b(page)f(7\).)225 4171 y Fp(\017)60 | |
| 37c41ab1 CR |
13172 | b Ft(Bash)44 b(implemen)m(ts)g(the)f Fs(!)h Ft(k)m(eyw)m(ord)g(to)g |
| 13173 | (negate)h(the)f(return)e(v)-5 b(alue)44 b(of)g(a)g(pip)s(eline)f(\(see) | |
| 1c72c0cd | 13174 | h(Sec-)330 4281 y(tion)33 b(3.2.2)i([Pip)s(elines],)f(page)g(8\).)49 |
| 37c41ab1 | 13175 | b(V)-8 b(ery)33 b(useful)f(when)g(an)h Fs(if)f Ft(statemen)m(t)j(needs) |
| 1c72c0cd CR |
13176 | d(to)i(act)g(only)f(if)330 4390 y(a)k(test)h(fails.)60 |
| 13177 | b(The)36 b(Bash)g(`)p Fs(-o)30 b(pipefail)p Ft(')35 b(option)i(to)h | |
| 13178 | Fs(set)d Ft(will)i(cause)g(a)g(pip)s(eline)g(to)g(return)f(a)330 | |
| 13179 | 4500 y(failure)31 b(status)f(if)h(an)m(y)f(command)g(fails.)225 | |
| 13180 | 4634 y Fp(\017)60 b Ft(Bash)34 b(has)g(the)g Fs(time)f | |
| 37c41ab1 | 13181 | Ft(reserv)m(ed)h(w)m(ord)g(and)f(command)h(timing)h(\(see)g(Section)g |
| 1c72c0cd | 13182 | (3.2.2)g([Pip)s(elines],)330 4743 y(page)g(8\).)52 b(The)33 |
| 37c41ab1 | 13183 | b(displa)m(y)i(of)f(the)g(timing)g(statistics)i(ma)m(y)f(b)s(e)e(con)m |
| 1c72c0cd CR |
13184 | (trolled)j(with)e(the)g Fs(TIMEFORMAT)330 4853 y Ft(v)-5 |
| 13185 | b(ariable.)225 4987 y Fp(\017)60 b Ft(Bash)23 b(implemen)m(ts)g(the)h | |
| 5e13499c | 13186 | Fs(for)29 b(\(\()h Fj(expr1)39 b Fs(;)30 b Fj(expr2)40 |
| 37c41ab1 | 13187 | b Fs(;)30 b Fj(expr3)39 b Fs(\)\))23 b Ft(arithmetic)h(for)e(command,)j |
| 1c72c0cd | 13188 | (sim-)330 5096 y(ilar)31 b(to)g(the)g(C)f(language)h(\(see)h(Section)f |
| 37c41ab1 | 13189 | (3.2.4.1)i([Lo)s(oping)d(Constructs],)h(page)g(9\).)225 |
| 1c72c0cd | 13190 | 5230 y Fp(\017)60 b Ft(Bash)31 b(includes)f(the)g Fs(select)f |
| 37c41ab1 | 13191 | Ft(comp)s(ound)g(command,)i(whic)m(h)f(allo)m(ws)i(the)f(generation)g |
| 1c72c0cd CR |
13192 | (of)g(simple)330 5340 y(men)m(us)f(\(see)h(Section)g(3.2.4.2)i |
| 13193 | ([Conditional)e(Constructs],)g(page)g(10\).)p eop end | |
| 28157acd CR |
13194 | %%Page: 132 138 |
| 13195 | TeXDict begin 132 137 bop 150 -116 a Ft(132)2527 b(Bash)31 | |
| 1c72c0cd CR |
13196 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(Bash)40 |
| 13197 | b(includes)g(the)g Fs([[)g Ft(comp)s(ound)e(command,)43 | |
| 13198 | b(whic)m(h)c(mak)m(es)i(conditional)h(testing)f(part)f(of)330 | |
| 13199 | 408 y(the)f(shell)g(grammar)g(\(see)h(Section)f(3.2.4.2)j([Conditional) | |
| 13200 | d(Constructs],)i(page)f(10\),)i(including)330 518 y(optional)32 | |
| 13201 | b(regular)e(expression)g(matc)m(hing.)225 653 y Fp(\017)60 | |
| 13202 | b Ft(Bash)31 b(pro)m(vides)f(optional)h(case-insensitiv)m(e)i(matc)m | |
| 13203 | (hing)f(for)e(the)g Fs(case)g Ft(and)f Fs([[)h Ft(constructs.)225 | |
| 13204 | 789 y Fp(\017)60 b Ft(Bash)27 b(includes)g(brace)h(expansion)f(\(see)h | |
| 13205 | (Section)g(3.5.1)i([Brace)e(Expansion],)g(page)g(17\))h(and)d(tilde)330 | |
| 13206 | 898 y(expansion)k(\(see)i(Section)f(3.5.2)h([Tilde)f(Expansion],)f | |
| 13207 | (page)h(18\).)225 1034 y Fp(\017)60 b Ft(Bash)24 b(implemen)m(ts)h | |
| 13208 | (command)e(aliases)j(and)d(the)i Fs(alias)d Ft(and)i | |
| 13209 | Fs(unalias)e Ft(builtins)h(\(see)i(Section)g(6.6)330 | |
| 28157acd | 13210 | 1143 y([Aliases],)32 b(page)f(75\).)225 1279 y Fp(\017)60 |
| 1c72c0cd CR |
13211 | b Ft(Bash)32 b(pro)m(vides)g(shell)g(arithmetic,)i(the)e |
| 13212 | Fs(\(\()g Ft(comp)s(ound)e(command)i(\(see)h(Section)f(3.2.4.2)j([Con-) | |
| 13213 | 330 1388 y(ditional)d(Constructs],)e(page)i(10\),)g(and)e(arithmetic)i | |
| 13214 | (expansion)e(\(see)i(Section)f(6.5)h([Shell)f(Arith-)330 | |
| 28157acd | 13215 | 1498 y(metic],)h(page)f(74\).)225 1633 y Fp(\017)60 b |
| 37c41ab1 CR |
13216 | Ft(V)-8 b(ariables)31 b(presen)m(t)e(in)g(the)g(shell's)h(initial)g(en) |
| 13217 | m(vironmen)m(t)g(are)g(automatically)i(exp)s(orted)d(to)h(c)m(hild)330 | |
| 1c72c0cd | 13218 | 1743 y(pro)s(cesses.)38 b(The)23 b(Bourne)g(shell)g(do)s(es)g(not)g |
| 37c41ab1 | 13219 | (normally)g(do)g(this)g(unless)g(the)g(v)-5 b(ariables)24 |
| 1c72c0cd CR |
13220 | b(are)f(explicitly)330 1852 y(mark)m(ed)30 b(using)g(the)h |
| 13221 | Fs(export)e Ft(command.)225 1988 y Fp(\017)60 b Ft(Bash)26 | |
| 13222 | b(supp)s(orts)d(the)j(`)p Fs(+=)p Ft(')f(assignmen)m(t)i(op)s(erator,)g | |
| 13223 | (whic)m(h)e(app)s(ends)f(to)i(the)g(v)-5 b(alue)26 b(of)f(the)h(v)-5 | |
| 13224 | b(ariable)330 2097 y(named)30 b(on)g(the)h(left)g(hand)e(side.)225 | |
| 13225 | 2233 y Fp(\017)60 b Ft(Bash)36 b(includes)g(the)g Fl(posix)f | |
| 13226 | Ft(pattern)h(remo)m(v)-5 b(al)37 b(`)p Fs(\045)p Ft(',)h(`)p | |
| 13227 | Fs(#)p Ft(',)g(`)p Fs(\045\045)p Ft(')e(and)f(`)p Fs(##)p | |
| 13228 | Ft(')h(expansions)g(to)g(remo)m(v)m(e)330 2342 y(leading)f(or)f | |
| 13229 | (trailing)h(substrings)e(from)g(v)-5 b(ariable)35 b(v)-5 | |
| 13230 | b(alues)35 b(\(see)g(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
| 13231 | 2452 y(Expansion],)30 b(page)h(19\).)225 2587 y Fp(\017)60 | |
| 13232 | b Ft(The)46 b(expansion)g Fs(${#xx})p Ft(,)j(whic)m(h)d(returns)f(the)i | |
| 13233 | (length)f(of)h Fs(${xx})p Ft(,)i(is)e(supp)s(orted)d(\(see)j(Sec-)330 | |
| 13234 | 2697 y(tion)31 b(3.5.3)h([Shell)f(P)m(arameter)g(Expansion],)f(page)i | |
| 13235 | (19\).)225 2832 y Fp(\017)60 b Ft(The)30 b(expansion)g | |
| 13236 | Fs(${var:)p Fq(o\013set)r Fs([:)p Fq(length)p Fs(]})p | |
| 13237 | Ft(,)g(whic)m(h)g(expands)g(to)h(the)g(substring)e(of)i | |
| 13238 | Fs(var)p Ft('s)e(v)-5 b(alue)330 2942 y(of)43 b(length)g | |
| 13239 | Fq(length)p Ft(,)k(b)s(eginning)42 b(at)i Fq(o\013set)p | |
| 13240 | Ft(,)j(is)c(presen)m(t)g(\(see)g(Section)h(3.5.3)h([Shell)e(P)m | |
| 13241 | (arameter)330 3051 y(Expansion],)30 b(page)h(19\).)225 | |
| 13242 | 3187 y Fp(\017)60 b Ft(The)21 b(expansion)f Fs(${var/[/])p | |
| 5e13499c | 13243 | Fq(pattern)p Fs([/)p Fq(replacemen)m(t)r Fs(]})p Ft(,)i(whic)m(h)e |
| 1c72c0cd | 13244 | (matc)m(hes)j Fq(pattern)e Ft(and)f(replaces)330 3296 |
| 37c41ab1 CR |
13245 | y(it)29 b(with)e Fq(replacemen)m(t)32 b Ft(in)c(the)g(v)-5 |
| 13246 | b(alue)29 b(of)f Fs(var)p Ft(,)g(is)g(a)m(v)-5 b(ailable)31 | |
| 13247 | b(\(see)e(Section)f(3.5.3)i([Shell)f(P)m(arameter)330 | |
| 1c72c0cd | 13248 | 3406 y(Expansion],)h(page)h(19\).)225 3541 y Fp(\017)60 |
| 37c41ab1 CR |
13249 | b Ft(The)32 b(expansion)g Fs(${!)p Fj(prefix)p Fs(})p |
| 13250 | Fj(*)40 b Ft(expansion,)32 b(whic)m(h)g(expands)g(to)h(the)f(names)g | |
| 1c72c0cd | 13251 | (of)h(all)g(shell)f(v)-5 b(ari-)330 3651 y(ables)36 b(whose)g(names)g |
| 37c41ab1 CR |
13252 | (b)s(egin)g(with)g Fq(pre\014x)p Ft(,)g(is)g(a)m(v)-5 |
| 13253 | b(ailable)39 b(\(see)e(Section)g(3.5.3)g([Shell)g(P)m(arameter)330 | |
| 1c72c0cd | 13254 | 3761 y(Expansion],)30 b(page)h(19\).)225 3896 y Fp(\017)60 |
| 37c41ab1 CR |
13255 | b Ft(Bash)22 b(has)f Fq(indirect)j Ft(v)-5 b(ariable)22 |
| 13256 | b(expansion)g(using)f Fs(${!word})e Ft(\(see)k(Section)f(3.5.3)i | |
| 1c72c0cd CR |
13257 | ([Shell)e(P)m(arameter)330 4006 y(Expansion],)30 b(page)h(19\).)225 |
| 13258 | 4141 y Fp(\017)60 b Ft(Bash)31 b(can)f(expand)g(p)s(ositional)h | |
| 37c41ab1 | 13259 | (parameters)g(b)s(ey)m(ond)e Fs($9)h Ft(using)g Fs(${)p |
| 1c72c0cd | 13260 | Fj(num)11 b Fs(})p Ft(.)225 4276 y Fp(\017)60 b Ft(The)27 |
| 37c41ab1 CR |
13261 | b Fl(posix)g Fs($\(\))g Ft(form)g(of)h(command)g(substitution)f(is)h |
| 13262 | (implemen)m(ted)g(\(see)h(Section)f(3.5.4)i([Com-)330 | |
| 1c72c0cd | 13263 | 4386 y(mand)38 b(Substitution],)k(page)e(21\),)j(and)38 |
| 37c41ab1 | 13264 | b(preferred)g(to)i(the)g(Bourne)f(shell's)h Fs(``)e Ft(\(whic)m(h)i(is) |
| 1c72c0cd CR |
13265 | f(also)330 4495 y(implemen)m(ted)31 b(for)f(bac)m(kw)m(ards)h |
| 13266 | (compatibilit)m(y\).)225 4631 y Fp(\017)60 b Ft(Bash)31 | |
| 37c41ab1 | 13267 | b(has)f(pro)s(cess)g(substitution)g(\(see)h(Section)g(3.5.6)h([Pro)s |
| 1c72c0cd | 13268 | (cess)f(Substitution],)f(page)h(22\).)225 4766 y Fp(\017)60 |
| 37c41ab1 CR |
13269 | b Ft(Bash)55 b(automatically)j(assigns)e(v)-5 b(ariables)55 |
| 13270 | b(that)h(pro)m(vide)f(information)h(ab)s(out)f(the)g(curren)m(t)330 | |
| 1c72c0cd | 13271 | 4876 y(user)40 b(\()p Fs(UID)p Ft(,)i Fs(EUID)p Ft(,)g(and)e |
| 5e13499c CR |
13272 | Fs(GROUPS)p Ft(\),)h(the)g(curren)m(t)f(host)g(\()p Fs(HOSTTYPE)p |
| 13273 | Ft(,)h Fs(OSTYPE)p Ft(,)h Fs(MACHTYPE)p Ft(,)f(and)330 | |
| 1c72c0cd | 13274 | 4985 y Fs(HOSTNAME)p Ft(\),)55 b(and)c(the)g(instance)h(of)g(Bash)f |
| 37c41ab1 | 13275 | (that)h(is)f(running)f(\()p Fs(BASH)p Ft(,)56 b Fs(BASH_VERSION)p |
| 1c72c0cd | 13276 | Ft(,)e(and)330 5095 y Fs(BASH_VERSINFO)p Ft(\).)37 b(See)31 |
| 28157acd | 13277 | b(Section)g(5.2)h([Bash)e(V)-8 b(ariables],)33 b(page)e(57,)g(for)f |
| 1c72c0cd | 13278 | (details.)225 5230 y Fp(\017)60 b Ft(The)44 b Fs(IFS)f |
| 37c41ab1 | 13279 | Ft(v)-5 b(ariable)45 b(is)f(used)f(to)i(split)f(only)g(the)g(results)g |
| 1c72c0cd | 13280 | (of)h(expansion,)i(not)d(all)h(w)m(ords)f(\(see)330 5340 |
| 28157acd | 13281 | y(Section)29 b(3.5.7)h([W)-8 b(ord)29 b(Splitting],)h(page)f(22\).)41 |
| 1c72c0cd CR |
13282 | b(This)28 b(closes)h(a)g(longstanding)g(shell)f(securit)m(y)h(hole.)p |
| 13283 | eop end | |
| 28157acd CR |
13284 | %%Page: 133 139 |
| 13285 | TeXDict begin 133 138 bop 150 -116 a Ft(App)s(endix)29 | |
| 37c41ab1 | 13286 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
| 28157acd | 13287 | b(The)f(Bourne)g(Shell)1258 b(133)225 299 y Fp(\017)60 |
| ac18b312 CR |
13288 | b Ft(Bash)38 b(implemen)m(ts)g(the)g(full)g(set)g(of)g |
| 13289 | Fl(posix)f Ft(\014lename)h(expansion)g(op)s(erators,)i(including)d | |
| 13290 | Fq(c)m(har-)330 408 y(acter)i(classes)p Ft(,)j Fq(equiv)-5 | |
| 13291 | b(alence)39 b(classes)p Ft(,)j(and)37 b Fq(collating)k(sym)m(b)s(ols)g | |
| 13292 | Ft(\(see)e(Section)g(3.5.8)h([Filename)330 518 y(Expansion],)30 | |
| 13293 | b(page)h(23\).)225 660 y Fp(\017)60 b Ft(Bash)35 b(implemen)m(ts)g | |
| 13294 | (extended)g(pattern)g(matc)m(hing)h(features)f(when)f(the)h | |
| 13295 | Fs(extglob)d Ft(shell)j(option)330 769 y(is)30 b(enabled)h(\(see)g | |
| 28157acd | 13296 | (Section)g(3.5.8.1)i([P)m(attern)f(Matc)m(hing],)g(page)f(23\).)225 |
| ac18b312 CR |
13297 | 911 y Fp(\017)60 b Ft(It)22 b(is)g(p)s(ossible)g(to)h(ha)m(v)m(e)g(a)f |
| 13298 | (v)-5 b(ariable)23 b(and)f(a)g(function)g(with)g(the)g(same)g(name;)j | |
| 13299 | Fs(sh)d Ft(do)s(es)g(not)g(separate)330 1021 y(the)31 | |
| 13300 | b(t)m(w)m(o)g(name)g(spaces.)225 1163 y Fp(\017)60 b | |
| 13301 | Ft(Bash)30 b(functions)e(are)i(p)s(ermitted)f(to)h(ha)m(v)m(e)h(lo)s | |
| 13302 | (cal)g(v)-5 b(ariables)30 b(using)f(the)g Fs(local)f | |
| 13303 | Ft(builtin,)i(and)e(th)m(us)330 1272 y(useful)i(recursiv)m(e)g | |
| 13304 | (functions)g(ma)m(y)h(b)s(e)f(written)g(\(see)i(Section)f(4.2)g([Bash)g | |
| 13305 | (Builtins],)g(page)h(41\).)225 1414 y Fp(\017)60 b Ft(V)-8 | |
| 13306 | b(ariable)25 b(assignmen)m(ts)g(preceding)e(commands)h(a\013ect)h(only) | |
| 13307 | f(that)g(command,)h(ev)m(en)f(builtins)g(and)330 1524 | |
| 13308 | y(functions)36 b(\(see)h(Section)g(3.7.4)h([En)m(vironmen)m(t],)h(page) | |
| 28157acd | 13309 | e(30\).)60 b(In)35 b Fs(sh)p Ft(,)j(all)f(v)-5 b(ariable)37 |
| ac18b312 CR |
13310 | b(assignmen)m(ts)330 1633 y(preceding)30 b(commands)g(are)h(global)h |
| 13311 | (unless)d(the)i(command)f(is)h(executed)g(from)f(the)g(\014le)h | |
| 13312 | (system.)225 1775 y Fp(\017)60 b Ft(Bash)44 b(p)s(erforms)e(\014lename) | |
| 13313 | i(expansion)f(on)h(\014lenames)g(sp)s(eci\014ed)f(as)h(op)s(erands)e | |
| 13314 | (to)j(input)e(and)330 1885 y(output)30 b(redirection)h(op)s(erators)g | |
| 13315 | (\(see)g(Section)g(3.6)h([Redirections],)g(page)f(25\).)225 | |
| 13316 | 2027 y Fp(\017)60 b Ft(Bash)29 b(con)m(tains)h(the)f(`)p | |
| 13317 | Fs(<>)p Ft(')f(redirection)i(op)s(erator,)f(allo)m(wing)i(a)e(\014le)g | |
| 13318 | (to)g(b)s(e)f(op)s(ened)g(for)h(b)s(oth)f(read-)330 2136 | |
| 13319 | y(ing)35 b(and)f(writing,)i(and)e(the)h(`)p Fs(&>)p Ft(')g(redirection) | |
| 13320 | g(op)s(erator,)h(for)f(directing)g(standard)f(output)h(and)330 | |
| 13321 | 2246 y(standard)30 b(error)g(to)h(the)f(same)h(\014le)f(\(see)i | |
| 13322 | (Section)f(3.6)g([Redirections],)h(page)g(25\).)225 2388 | |
| 13323 | y Fp(\017)60 b Ft(Bash)21 b(includes)f(the)h(`)p Fs(<<<)p | |
| 13324 | Ft(')g(redirection)g(op)s(erator,)i(allo)m(wing)g(a)e(string)f(to)i(b)s | |
| 13325 | (e)e(used)g(as)h(the)g(standard)330 2497 y(input)29 b(to)j(a)e | |
| 13326 | (command.)225 2639 y Fp(\017)60 b Ft(Bash)29 b(implemen)m(ts)h(the)f(`) | |
| 13327 | p Fs([n]<&)p Fj(word)11 b Ft(')26 b(and)j(`)p Fs([n]>&)p | |
| 13328 | Fj(word)11 b Ft(')26 b(redirection)k(op)s(erators,)g(whic)m(h)e(mo)m(v) | |
| 13329 | m(e)330 2749 y(one)j(\014le)f(descriptor)g(to)h(another.)225 | |
| 13330 | 2890 y Fp(\017)60 b Ft(Bash)25 b(treats)h(a)f(n)m(um)m(b)s(er)e(of)i | |
| 13331 | (\014lenames)g(sp)s(ecially)g(when)f(they)h(are)g(used)f(in)g | |
| 13332 | (redirection)i(op)s(erators)330 3000 y(\(see)31 b(Section)h(3.6)f | |
| 13333 | ([Redirections],)h(page)f(25\).)225 3142 y Fp(\017)60 | |
| 13334 | b Ft(Bash)33 b(can)f(op)s(en)g(net)m(w)m(ork)i(connections)f(to)h | |
| 13335 | (arbitrary)e(mac)m(hines)h(and)f(services)h(with)f(the)h(redi-)330 | |
| 13336 | 3251 y(rection)e(op)s(erators)g(\(see)g(Section)g(3.6)h | |
| 13337 | ([Redirections],)g(page)f(25\).)225 3393 y Fp(\017)60 | |
| 37c41ab1 CR |
13338 | b Ft(The)29 b Fs(noclobber)e Ft(option)j(is)g(a)m(v)-5 |
| 13339 | b(ailable)32 b(to)e(a)m(v)m(oid)h(o)m(v)m(erwriting)g(existing)g | |
| 28157acd CR |
13340 | (\014les)e(with)h(output)f(redi-)330 3503 y(rection)h(\(see)h(Section)f |
| 13341 | (4.3)g([The)g(Set)f(Builtin],)i(page)f(53\).)41 b(The)29 | |
| 13342 | b(`)p Fs(>|)p Ft(')h(redirection)g(op)s(erator)f(ma)m(y)330 | |
| 13343 | 3612 y(b)s(e)h(used)f(to)i(o)m(v)m(erride)h Fs(noclobber)p | |
| 13344 | Ft(.)225 3754 y Fp(\017)60 b Ft(The)34 b(Bash)g Fs(cd)g | |
| 13345 | Ft(and)f Fs(pwd)g Ft(builtins)h(\(see)h(Section)g(4.1)g([Bourne)g | |
| 13346 | (Shell)f(Builtins],)h(page)g(35\))h(eac)m(h)330 3864 | |
| 13347 | y(tak)m(e)c(`)p Fs(-L)p Ft(')e(and)g(`)p Fs(-P)p Ft(')g(options)h(to)g | |
| 13348 | (switc)m(h)g(b)s(et)m(w)m(een)g(logical)i(and)c(ph)m(ysical)i(mo)s | |
| 13349 | (des.)225 4006 y Fp(\017)60 b Ft(Bash)25 b(allo)m(ws)h(a)g(function)e | |
| 13350 | (to)i(o)m(v)m(erride)g(a)g(builtin)e(with)h(the)g(same)g(name,)i(and)d | |
| 13351 | (pro)m(vides)h(access)h(to)330 4115 y(that)34 b(builtin's)f | |
| 13352 | (functionalit)m(y)h(within)f(the)g(function)g(via)h(the)f | |
| 13353 | Fs(builtin)f Ft(and)g Fs(command)g Ft(builtins)330 4225 | |
| 13354 | y(\(see)f(Section)h(4.2)f([Bash)g(Builtins],)g(page)g(41\).)225 | |
| 13355 | 4367 y Fp(\017)60 b Ft(The)35 b Fs(command)e Ft(builtin)i(allo)m(ws)i | |
| 13356 | (selectiv)m(e)h(disabling)e(of)f(functions)g(when)g(command)g(lo)s | |
| 13357 | (okup)g(is)330 4476 y(p)s(erformed)29 b(\(see)i(Section)g(4.2)h([Bash)f | |
| 13358 | (Builtins],)g(page)g(41\).)225 4618 y Fp(\017)60 b Ft(Individual)23 | |
| 13359 | b(builtins)g(ma)m(y)i(b)s(e)e(enabled)h(or)g(disabled)g(using)f(the)h | |
| 13360 | Fs(enable)f Ft(builtin)g(\(see)i(Section)g(4.2)330 4728 | |
| 13361 | y([Bash)31 b(Builtins],)g(page)g(41\).)225 4869 y Fp(\017)60 | |
| 13362 | b Ft(The)26 b(Bash)h Fs(exec)e Ft(builtin)h(tak)m(es)i(additional)f | |
| 13363 | (options)g(that)g(allo)m(w)h(users)d(to)j(con)m(trol)g(the)e(con)m(ten) | |
| 13364 | m(ts)330 4979 y(of)35 b(the)f(en)m(vironmen)m(t)h(passed)f(to)h(the)g | |
| 13365 | (executed)g(command,)h(and)d(what)i(the)f(zeroth)h(argumen)m(t)330 | |
| 1c72c0cd | 13366 | 5089 y(to)c(the)g(command)f(is)g(to)h(b)s(e)f(\(see)h(Section)h(4.1)f |
| ac18b312 | 13367 | ([Bourne)f(Shell)h(Builtins],)g(page)g(35\).)225 5230 |
| 37c41ab1 CR |
13368 | y Fp(\017)60 b Ft(Shell)29 b(functions)g(ma)m(y)h(b)s(e)f(exp)s(orted)g |
| 13369 | (to)h(c)m(hildren)f(via)h(the)g(en)m(vironmen)m(t)g(using)f | |
| 1c72c0cd CR |
13370 | Fs(export)f(-f)h Ft(\(see)330 5340 y(Section)i(3.3)h([Shell)e(F)-8 |
| 13371 | b(unctions],)32 b(page)f(14\).)p eop end | |
| 28157acd CR |
13372 | %%Page: 134 140 |
| 13373 | TeXDict begin 134 139 bop 150 -116 a Ft(134)2527 b(Bash)31 | |
| 1c72c0cd CR |
13374 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(The)37 |
| 13375 | b(Bash)g Fs(export)p Ft(,)h Fs(readonly)p Ft(,)f(and)f | |
| 13376 | Fs(declare)g Ft(builtins)h(can)g(tak)m(e)i(a)f(`)p Fs(-f)p | |
| 13377 | Ft(')f(option)h(to)g(act)g(on)330 408 y(shell)26 b(functions,)g(a)h(`)p | |
| 13378 | Fs(-p)p Ft(')e(option)h(to)h(displa)m(y)f(v)-5 b(ariables)26 | |
| 13379 | b(with)g(v)-5 b(arious)25 b(attributes)i(set)f(in)f(a)i(format)330 | |
| 13380 | 518 y(that)g(can)f(b)s(e)f(used)h(as)g(shell)g(input,)h(a)f(`)p | |
| 13381 | Fs(-n)p Ft(')g(option)g(to)h(remo)m(v)m(e)h(v)-5 b(arious)26 | |
| 13382 | b(v)-5 b(ariable)27 b(attributes,)h(and)330 628 y(`)p | |
| 13383 | Fs(name=value)p Ft(')g(argumen)m(ts)j(to)g(set)g(v)-5 | |
| 37c41ab1 | 13384 | b(ariable)31 b(attributes)g(and)f(v)-5 b(alues)30 b(sim)m(ultaneously) |
| 1c72c0cd | 13385 | -8 b(.)225 765 y Fp(\017)60 b Ft(The)42 b(Bash)h Fs(hash)f |
| 37c41ab1 | 13386 | Ft(builtin)g(allo)m(ws)j(a)e(name)g(to)g(b)s(e)f(asso)s(ciated)j(with)d |
| 1c72c0cd | 13387 | (an)h(arbitrary)f(\014lename,)330 874 y(ev)m(en)30 b(when)e(that)h |
| 37c41ab1 CR |
13388 | (\014lename)g(cannot)h(b)s(e)e(found)g(b)m(y)h(searc)m(hing)g(the)g |
| 13389 | Fs($PATH)p Ft(,)g(using)f(`)p Fs(hash)h(-p)p Ft(')g(\(see)330 | |
| ac18b312 | 13390 | 984 y(Section)i(4.1)h([Bourne)e(Shell)g(Builtins],)h(page)h(35\).)225 |
| 1c72c0cd | 13391 | 1121 y Fp(\017)60 b Ft(Bash)27 b(includes)f(a)i Fs(help)d |
| 37c41ab1 | 13392 | Ft(builtin)i(for)f(quic)m(k)h(reference)h(to)f(shell)g(facilities)i |
| ac18b312 | 13393 | (\(see)f(Section)g(4.2)g([Bash)330 1230 y(Builtins],)j(page)g(41\).)225 |
| 1c72c0cd | 13394 | 1367 y Fp(\017)60 b Ft(The)42 b Fs(printf)g Ft(builtin)g(is)h(a)m(v)-5 |
| 37c41ab1 | 13395 | b(ailable)45 b(to)f(displa)m(y)f(formatted)g(output)g(\(see)h(Section)g |
| ac18b312 | 13396 | (4.2)g([Bash)330 1477 y(Builtins],)31 b(page)g(41\).)225 |
| 1c72c0cd | 13397 | 1614 y Fp(\017)60 b Ft(The)26 b(Bash)h Fs(read)f Ft(builtin)g(\(see)i |
| ac18b312 | 13398 | (Section)g(4.2)g([Bash)f(Builtins],)h(page)g(41\))g(will)f(read)g(a)g |
| 1c72c0cd | 13399 | (line)g(ending)330 1724 y(in)f(`)p Fs(\\)p Ft(')h(with)f(the)g(`)p |
| 37c41ab1 | 13400 | Fs(-r)p Ft(')h(option,)h(and)d(will)i(use)f(the)h Fs(REPLY)e |
| 1c72c0cd CR |
13401 | Ft(v)-5 b(ariable)27 b(as)g(a)f(default)h(if)f(no)h(non-option)330 |
| 13402 | 1833 y(argumen)m(ts)k(are)h(supplied.)42 b(The)30 b(Bash)i | |
| 13403 | Fs(read)e Ft(builtin)g(also)j(accepts)f(a)g(prompt)e(string)h(with)g | |
| 13404 | (the)330 1943 y(`)p Fs(-p)p Ft(')k(option)g(and)f(will)h(use)g | |
| 13405 | (Readline)g(to)h(obtain)f(the)g(line)g(when)f(giv)m(en)i(the)f(`)p | |
| 13406 | Fs(-e)p Ft(')g(option.)54 b(The)330 2052 y Fs(read)31 | |
| 37c41ab1 CR |
13407 | b Ft(builtin)h(also)i(has)e(additional)h(options)g(to)g(con)m(trol)h |
| 13408 | (input:)44 b(the)32 b(`)p Fs(-s)p Ft(')h(option)f(will)h(turn)f(o\013) | |
| 1c72c0cd CR |
13409 | 330 2162 y(ec)m(hoing)38 b(of)e(input)f(c)m(haracters)j(as)e(they)h |
| 13410 | (are)f(read,)i(the)e(`)p Fs(-t)p Ft(')g(option)h(will)g(allo)m(w)g | |
| 13411 | Fs(read)e Ft(to)i(time)330 2271 y(out)c(if)g(input)f(do)s(es)g(not)h | |
| 37c41ab1 CR |
13412 | (arriv)m(e)g(within)g(a)g(sp)s(eci\014ed)f(n)m(um)m(b)s(er)f(of)i |
| 13413 | (seconds,)h(the)f(`)p Fs(-n)p Ft(')f(option)i(will)330 | |
| 1c72c0cd | 13414 | 2381 y(allo)m(w)29 b(reading)e(only)h(a)g(sp)s(eci\014ed)e(n)m(um)m(b)s |
| 37c41ab1 | 13415 | (er)g(of)i(c)m(haracters)h(rather)e(than)g(a)h(full)f(line,)i(and)d |
| 1c72c0cd CR |
13416 | (the)i(`)p Fs(-d)p Ft(')330 2491 y(option)j(will)g(read)f(un)m(til)g(a) |
| 13417 | h(particular)g(c)m(haracter)h(rather)e(than)g(newline.)225 | |
| 13418 | 2628 y Fp(\017)60 b Ft(The)33 b Fs(return)e Ft(builtin)i(ma)m(y)g(b)s | |
| 37c41ab1 | 13419 | (e)g(used)f(to)i(ab)s(ort)f(execution)h(of)f(scripts)g(executed)h(with) |
| 1c72c0cd | 13420 | f(the)g Fs(.)g Ft(or)330 2737 y Fs(source)c Ft(builtins)g(\(see)j |
| ac18b312 | 13421 | (Section)f(4.1)g([Bourne)g(Shell)f(Builtins],)h(page)g(35\).)225 |
| 1c72c0cd | 13422 | 2874 y Fp(\017)60 b Ft(Bash)43 b(includes)g(the)g Fs(shopt)f |
| 37c41ab1 | 13423 | Ft(builtin,)k(for)d(\014ner)f(con)m(trol)j(of)e(shell)h(optional)g |
| 28157acd CR |
13424 | (capabilities)h(\(see)330 2984 y(Section)34 b(4.2)g([Bash)f(Builtins],) |
| 13425 | i(page)e(41\),)i(and)e(allo)m(ws)h(these)f(options)h(to)f(b)s(e)g(set)g | |
| 13426 | (and)g(unset)f(at)330 3093 y(shell)f(in)m(v)m(o)s(cation)h(\(see)f | |
| 13427 | (Section)g(6.1)h([In)m(v)m(oking)f(Bash],)g(page)h(67\).)225 | |
| 13428 | 3230 y Fp(\017)60 b Ft(Bash)23 b(has)f(m)m(uc)m(h)g(more)h(optional)h | |
| 13429 | (b)s(eha)m(vior)e(con)m(trollable)j(with)d(the)h Fs(set)e | |
| 13430 | Ft(builtin)h(\(see)i(Section)f(4.3)330 3340 y([The)30 | |
| 13431 | b(Set)h(Builtin],)g(page)g(53\).)225 3477 y Fp(\017)60 | |
| 13432 | b Ft(The)31 b(`)p Fs(-x)p Ft(')g(\()p Fs(xtrace)p Ft(\))g(option)h | |
| 13433 | (displa)m(ys)f(commands)h(other)f(than)h(simple)f(commands)g(when)g(p)s | |
| 13434 | (er-)330 3587 y(forming)f(an)g(execution)i(trace)f(\(see)h(Section)f | |
| 13435 | (4.3)g([The)g(Set)f(Builtin],)h(page)h(53\).)225 3724 | |
| 13436 | y Fp(\017)60 b Ft(The)28 b Fs(test)g Ft(builtin)h(\(see)h(Section)f | |
| 13437 | (4.1)h([Bourne)f(Shell)g(Builtins],)h(page)g(35\))g(is)f(sligh)m(tly)h | |
| 1c72c0cd | 13438 | (di\013eren)m(t,)330 3833 y(as)23 b(it)g(implemen)m(ts)f(the)h |
| 37c41ab1 | 13439 | Fl(posix)f Ft(algorithm,)j(whic)m(h)d(sp)s(eci\014es)g(the)h(b)s(eha)m |
| 1c72c0cd CR |
13440 | (vior)f(based)g(on)h(the)f(n)m(um)m(b)s(er)330 3943 y(of)31 |
| 13441 | b(argumen)m(ts.)225 4080 y Fp(\017)60 b Ft(Bash)31 b(includes)g(the)h | |
| 37c41ab1 | 13442 | Fs(caller)d Ft(builtin,)j(whic)m(h)f(displa)m(ys)g(the)g(con)m(text)i |
| 1c72c0cd | 13443 | (of)f(an)m(y)g(activ)m(e)h(subroutine)330 4189 y(call)28 |
| 37c41ab1 CR |
13444 | b(\(a)f(shell)f(function)h(or)f(a)h(script)f(executed)h(with)f(the)h |
| 13445 | Fs(.)f Ft(or)g Fs(source)f Ft(builtins\).)39 b(This)26 | |
| 1c72c0cd CR |
13446 | b(supp)s(orts)330 4299 y(the)31 b(bash)e(debugger.)225 |
| 13447 | 4436 y Fp(\017)60 b Ft(The)42 b Fs(trap)f Ft(builtin)h(\(see)i(Section) | |
| ac18b312 | 13448 | f(4.1)h([Bourne)e(Shell)g(Builtins],)47 b(page)c(35\))h(allo)m(ws)g(a)e |
| 1c72c0cd | 13449 | Fs(DEBUG)330 4545 y Ft(pseudo-signal)c(sp)s(eci\014cation,)i(similar)e |
| 37c41ab1 | 13450 | (to)g Fs(EXIT)p Ft(.)62 b(Commands)36 b(sp)s(eci\014ed)h(with)g(a)h |
| 1c72c0cd | 13451 | Fs(DEBUG)e Ft(trap)330 4655 y(are)k(executed)g(b)s(efore)f(ev)m(ery)h |
| 37c41ab1 | 13452 | (simple)f(command,)j Fs(for)c Ft(command,)k Fs(case)c |
| 1c72c0cd | 13453 | Ft(command,)k Fs(select)330 4765 y Ft(command,)35 b(ev)m(ery)g |
| 37c41ab1 | 13454 | (arithmetic)g Fs(for)e Ft(command,)i(and)f(b)s(efore)g(the)g(\014rst)f |
| 1c72c0cd | 13455 | (command)h(executes)h(in)330 4874 y(a)29 b(shell)g(function.)40 |
| 37c41ab1 | 13456 | b(The)28 b Fs(DEBUG)g Ft(trap)g(is)h(not)g(inherited)f(b)m(y)h(shell)g |
| 1c72c0cd | 13457 | (functions)f(unless)g(the)h(function)330 4984 y(has)35 |
| 37c41ab1 CR |
13458 | b(b)s(een)g(giv)m(en)i(the)f Fs(trace)e Ft(attribute)i(or)g(the)g |
| 13459 | Fs(functrace)d Ft(option)j(has)f(b)s(een)g(enabled)g(using)330 | |
| 1c72c0cd | 13460 | 5093 y(the)28 b Fs(shopt)e Ft(builtin.)39 b(The)27 b |
| 37c41ab1 | 13461 | Fs(extdebug)f Ft(shell)i(option)g(has)f(additional)h(e\013ects)h(on)f |
| 1c72c0cd | 13462 | (the)g Fs(DEBUG)e Ft(trap.)330 5230 y(The)21 b Fs(trap)e |
| 37c41ab1 | 13463 | Ft(builtin)i(\(see)h(Section)g(4.1)g([Bourne)f(Shell)g(Builtins],)j |
| ac18b312 | 13464 | (page)e(35\))g(allo)m(ws)g(an)f Fs(ERR)f Ft(pseudo-)330 |
| 1c72c0cd | 13465 | 5340 y(signal)30 b(sp)s(eci\014cation,)h(similar)f(to)g |
| 37c41ab1 | 13466 | Fs(EXIT)f Ft(and)g Fs(DEBUG)p Ft(.)39 b(Commands)28 b(sp)s(eci\014ed)h |
| 1c72c0cd | 13467 | (with)g(an)g Fs(ERR)g Ft(trap)p eop end |
| 28157acd CR |
13468 | %%Page: 135 141 |
| 13469 | TeXDict begin 135 140 bop 150 -116 a Ft(App)s(endix)29 | |
| 1c72c0cd | 13470 | b(B:)i(Ma)5 b(jor)31 b(Di\013erences)g(F)-8 b(rom)31 |
| 28157acd | 13471 | b(The)f(Bourne)g(Shell)1258 b(135)330 299 y(are)40 b(executed)g(after)g |
| 1c72c0cd CR |
13472 | (a)f(simple)h(command)f(fails,)j(with)d(a)h(few)f(exceptions.)68 |
| 13473 | b(The)39 b Fs(ERR)g Ft(trap)g(is)330 408 y(not)g(inherited)f(b)m(y)h | |
| 37c41ab1 CR |
13474 | (shell)g(functions)f(unless)g(the)h Fs(-o)29 b(errtrace)37 |
| 13475 | b Ft(option)i(to)g(the)g Fs(set)f Ft(builtin)g(is)330 | |
| 1c72c0cd | 13476 | 518 y(enabled.)330 645 y(The)g Fs(trap)g Ft(builtin)h(\(see)g(Section)h |
| ac18b312 | 13477 | (4.1)g([Bourne)f(Shell)g(Builtins],)i(page)f(35\))g(allo)m(ws)g(a)g |
| 1c72c0cd CR |
13478 | Fs(RETURN)330 755 y Ft(pseudo-signal)35 b(sp)s(eci\014cation,)j |
| 13479 | (similar)d(to)h Fs(EXIT)e Ft(and)g Fs(DEBUG)p Ft(.)54 | |
| 13480 | b(Commands)34 b(sp)s(eci\014ed)g(with)h(an)330 864 y | |
| 13481 | Fs(RETURN)k Ft(trap)i(are)g(executed)h(b)s(efore)e(execution)i(resumes) | |
| 13482 | e(after)h(a)g(shell)g(function)g(or)g(a)g(shell)330 974 | |
| 13483 | y(script)36 b(executed)g(with)g Fs(.)f Ft(or)h Fs(source)e | |
| 37c41ab1 | 13484 | Ft(returns.)56 b(The)35 b Fs(RETURN)f Ft(trap)i(is)g(not)g(inherited)f |
| 1c72c0cd | 13485 | (b)m(y)h(shell)330 1083 y(functions)k(unless)h(the)g(function)f(has)h |
| 8fed3589 | 13486 | (b)s(een)f(giv)m(en)i(the)f Fs(trace)e Ft(attribute)j(or)e(the)h |
| 1c72c0cd CR |
13487 | Fs(functrace)330 1193 y Ft(option)31 b(has)f(b)s(een)g(enabled)g(using) |
| 13488 | g(the)g Fs(shopt)f Ft(builtin.)225 1320 y Fp(\017)60 | |
| 37c41ab1 CR |
13489 | b Ft(The)30 b(Bash)g Fs(type)f Ft(builtin)h(is)g(more)g(extensiv)m(e)i |
| 13490 | (and)d(giv)m(es)j(more)e(information)h(ab)s(out)f(the)g(names)330 | |
| 1c72c0cd | 13491 | 1430 y(it)h(\014nds)e(\(see)i(Section)g(4.2)h([Bash)e(Builtins],)i |
| ac18b312 | 13492 | (page)f(41\).)225 1557 y Fp(\017)60 b Ft(The)34 b(Bash)h |
| 37c41ab1 CR |
13493 | Fs(umask)e Ft(builtin)h(p)s(ermits)g(a)g(`)p Fs(-p)p |
| 13494 | Ft(')h(option)g(to)g(cause)g(the)g(output)f(to)h(b)s(e)f(displa)m(y)m | |
| 1c72c0cd | 13495 | (ed)h(in)330 1666 y(the)g(form)g(of)g(a)h Fs(umask)e |
| 37c41ab1 | 13496 | Ft(command)h(that)g(ma)m(y)h(b)s(e)f(reused)f(as)h(input)g(\(see)h |
| 1c72c0cd | 13497 | (Section)g(4.1)g([Bourne)330 1776 y(Shell)30 b(Builtins],)h(page)h |
| ac18b312 | 13498 | (35\).)225 1903 y Fp(\017)60 b Ft(Bash)34 b(implemen)m(ts)h(a)g |
| 1c72c0cd CR |
13499 | Fs(csh)p Ft(-lik)m(e)g(directory)f(stac)m(k,)j(and)d(pro)m(vides)g(the) |
| 13500 | g Fs(pushd)p Ft(,)g Fs(popd)p Ft(,)g(and)g Fs(dirs)330 | |
| 13501 | 2012 y Ft(builtins)g(to)i(manipulate)f(it)h(\(see)f(Section)h(6.8)g | |
| 28157acd | 13502 | ([The)f(Directory)h(Stac)m(k],)i(page)d(77\).)56 b(Bash)35 |
| 1c72c0cd CR |
13503 | b(also)330 2122 y(mak)m(es)c(the)g(directory)g(stac)m(k)g(visible)g(as) |
| 13504 | g(the)f(v)-5 b(alue)31 b(of)g(the)f Fs(DIRSTACK)f Ft(shell)h(v)-5 | |
| 13505 | b(ariable.)225 2249 y Fp(\017)60 b Ft(Bash)28 b(in)m(terprets)h(sp)s | |
| 13506 | (ecial)g(bac)m(kslash-escap)s(ed)g(c)m(haracters)g(in)f(the)h(prompt)e | |
| 13507 | (strings)h(when)f(in)m(ter-)330 2358 y(activ)m(e)33 b(\(see)e(Section)g | |
| 28157acd | 13508 | (6.9)h([Prin)m(ting)e(a)h(Prompt],)g(page)g(79\).)225 |
| 1c72c0cd CR |
13509 | 2485 y Fp(\017)60 b Ft(The)46 b(Bash)h(restricted)g(mo)s(de)f(is)h |
| 13510 | (more)f(useful)g(\(see)h(Section)h(6.10)g([The)e(Restricted)i(Shell],) | |
| 28157acd | 13511 | 330 2595 y(page)31 b(80\);)h(the)f(SVR4.2)g(shell)f(restricted)h(mo)s |
| 1c72c0cd CR |
13512 | (de)f(is)h(to)s(o)g(limited.)225 2722 y Fp(\017)60 b |
| 13513 | Ft(The)30 b Fs(disown)f Ft(builtin)h(can)h(remo)m(v)m(e)h(a)f(job)f | |
| 13514 | (from)g(the)h(in)m(ternal)g(shell)g(job)f(table)i(\(see)f(Section)h | |
| 28157acd | 13515 | (7.2)330 2832 y([Job)h(Con)m(trol)h(Builtins],)g(page)g(86\))h(or)e |
| 1c72c0cd CR |
13516 | (suppress)e(the)i(sending)g(of)g Fs(SIGHUP)e Ft(to)j(a)g(job)f(when)f |
| 13517 | (the)330 2941 y(shell)f(exits)g(as)f(the)h(result)f(of)h(a)f | |
| 13518 | Fs(SIGHUP)p Ft(.)225 3068 y Fp(\017)60 b Ft(Bash)31 b(includes)f(a)g(n) | |
| 13519 | m(um)m(b)s(er)f(of)i(features)g(to)g(supp)s(ort)d(a)j(separate)g | |
| 13520 | (debugger)f(for)h(shell)f(scripts.)225 3195 y Fp(\017)60 | |
| 13521 | b Ft(The)28 b(SVR4.2)h(shell)f(has)g(t)m(w)m(o)i(privilege-related)g | |
| 13522 | (builtins)e(\()p Fs(mldmode)e Ft(and)i Fs(priv)p Ft(\))f(not)i(presen)m | |
| 13523 | (t)f(in)330 3305 y(Bash.)225 3432 y Fp(\017)60 b Ft(Bash)31 | |
| 13524 | b(do)s(es)f(not)g(ha)m(v)m(e)i(the)e Fs(stop)g Ft(or)g | |
| 13525 | Fs(newgrp)f Ft(builtins.)225 3559 y Fp(\017)60 b Ft(Bash)31 | |
| 13526 | b(do)s(es)f(not)g(use)g(the)h Fs(SHACCT)d Ft(v)-5 b(ariable)32 | |
| 13527 | b(or)e(p)s(erform)f(shell)i(accoun)m(ting.)225 3686 y | |
| 13528 | Fp(\017)60 b Ft(The)30 b(SVR4.2)h Fs(sh)f Ft(uses)g(a)g | |
| 13529 | Fs(TIMEOUT)f Ft(v)-5 b(ariable)31 b(lik)m(e)h(Bash)e(uses)g | |
| 13530 | Fs(TMOUT)p Ft(.)150 3830 y(More)h(features)g(unique)e(to)i(Bash)g(ma)m | |
| 13531 | (y)g(b)s(e)f(found)f(in)h(Chapter)f(6)i([Bash)g(F)-8 | |
| 28157acd | 13532 | b(eatures],)32 b(page)f(67.)150 4065 y Fr(B.1)67 b(Implemen)l(tation)48 |
| 5e13499c | 13533 | b(Di\013erences)e(F)-11 b(rom)44 b(The)h(SVR4.2)g(Shell)275 |
| 1c72c0cd | 13534 | 4301 y Ft(Since)39 b(Bash)h(is)f(a)h(completely)i(new)d(implemen)m |
| 37c41ab1 | 13535 | (tation,)k(it)d(do)s(es)g(not)f(su\013er)g(from)g(man)m(y)h(of)g(the) |
| 1c72c0cd CR |
13536 | 150 4411 y(limitations)32 b(of)f(the)f(SVR4.2)h(shell.)41 |
| 13537 | b(F)-8 b(or)31 b(instance:)225 4538 y Fp(\017)60 b Ft(Bash)32 | |
| 37c41ab1 CR |
13538 | b(do)s(es)f(not)h(fork)f(a)h(subshell)e(when)h(redirecting)h(in)m(to)h |
| 13539 | (or)e(out)h(of)g(a)g(shell)f(con)m(trol)i(structure)330 | |
| 1c72c0cd CR |
13540 | 4648 y(suc)m(h)d(as)h(an)f Fs(if)g Ft(or)g Fs(while)f |
| 13541 | Ft(statemen)m(t.)225 4775 y Fp(\017)60 b Ft(Bash)29 b(do)s(es)f(not)h | |
| 37c41ab1 | 13542 | (allo)m(w)h(un)m(balanced)f(quotes.)41 b(The)28 b(SVR4.2)h(shell)g |
| 28157acd | 13543 | (will)g(silen)m(tly)h(insert)f(a)g(needed)330 4884 y(closing)g(quote)g |
| 37c41ab1 CR |
13544 | (at)f Fs(EOF)f Ft(under)g(certain)h(circumstances.)41 |
| 13545 | b(This)27 b(can)h(b)s(e)g(the)g(cause)g(of)g(some)h(hard-)330 | |
| 1c72c0cd | 13546 | 4994 y(to-\014nd)h(errors.)225 5121 y Fp(\017)60 b Ft(The)45 |
| 37c41ab1 | 13547 | b(SVR4.2)h(shell)f(uses)g(a)g(baro)s(que)g(memory)g(managemen)m(t)i(sc) |
| 1c72c0cd | 13548 | m(heme)e(based)g(on)g(trapping)330 5230 y Fs(SIGSEGV)p |
| 37c41ab1 CR |
13549 | Ft(.)57 b(If)35 b(the)i(shell)f(is)h(started)g(from)e(a)i(pro)s(cess)f |
| 13550 | (with)g Fs(SIGSEGV)e Ft(blo)s(c)m(k)m(ed)k(\(e.g.,)h(b)m(y)d(using)330 | |
| 1c72c0cd CR |
13551 | 5340 y(the)31 b Fs(system\(\))d Ft(C)i(library)g(function)g(call\),)i |
| 13552 | (it)f(misb)s(eha)m(v)m(es)g(badly)-8 b(.)p eop end | |
| 28157acd CR |
13553 | %%Page: 136 142 |
| 13554 | TeXDict begin 136 141 bop 150 -116 a Ft(136)2527 b(Bash)31 | |
| 1c72c0cd CR |
13555 | b(Reference)g(Man)m(ual)225 299 y Fp(\017)60 b Ft(In)26 |
| 13556 | b(a)i(questionable)g(attempt)h(at)f(securit)m(y)-8 b(,)29 | |
| 13557 | b(the)e(SVR4.2)h(shell,)g(when)f(in)m(v)m(ok)m(ed)h(without)g(the)f(`)p | |
| 13558 | Fs(-p)p Ft(')330 408 y(option,)39 b(will)d(alter)i(its)e(real)h(and)f | |
| 13559 | (e\013ectiv)m(e)j Fl(uid)d Ft(and)g Fl(gid)h Ft(if)f(they)h(are)f(less) | |
| 13560 | h(than)f(some)h(magic)330 518 y(threshold)30 b(v)-5 b(alue,)31 | |
| 13561 | b(commonly)g(100.)42 b(This)29 b(can)i(lead)g(to)g(unexp)s(ected)f | |
| 13562 | (results.)225 653 y Fp(\017)60 b Ft(The)30 b(SVR4.2)h(shell)g(do)s(es)f | |
| 13563 | (not)g(allo)m(w)i(users)e(to)h(trap)f Fs(SIGSEGV)p Ft(,)f | |
| 13564 | Fs(SIGALRM)p Ft(,)f(or)j Fs(SIGCHLD)p Ft(.)225 787 y | |
| 13565 | Fp(\017)60 b Ft(The)34 b(SVR4.2)h(shell)g(do)s(es)g(not)f(allo)m(w)j | |
| 13566 | (the)d Fs(IFS)p Ft(,)h Fs(MAILCHECK)p Ft(,)f Fs(PATH)p | |
| 13567 | Ft(,)h Fs(PS1)p Ft(,)g(or)f Fs(PS2)g Ft(v)-5 b(ariables)35 | |
| 13568 | b(to)330 897 y(b)s(e)30 b(unset.)225 1031 y Fp(\017)60 | |
| 13569 | b Ft(The)30 b(SVR4.2)h(shell)g(treats)g(`)p Fs(^)p Ft(')f(as)h(the)g | |
| 13570 | (undo)s(cumen)m(ted)e(equiv)-5 b(alen)m(t)31 b(of)g(`)p | |
| 13571 | Fs(|)p Ft('.)225 1166 y Fp(\017)60 b Ft(Bash)37 b(allo)m(ws)h(m)m | |
| 13572 | (ultiple)f(option)g(argumen)m(ts)g(when)e(it)i(is)g(in)m(v)m(ok)m(ed)h | |
| 13573 | (\()p Fs(-x)30 b(-v)p Ft(\);)40 b(the)c(SVR4.2)i(shell)330 | |
| 13574 | 1275 y(allo)m(ws)c(only)f(one)g(option)g(argumen)m(t)g(\()p | |
| 37c41ab1 | 13575 | Fs(-xv)p Ft(\).)47 b(In)32 b(fact,)i(some)f(v)m(ersions)g(of)g(the)g |
| 1c72c0cd CR |
13576 | (shell)f(dump)f(core)330 1385 y(if)f(the)h(second)f(argumen)m(t)h(b)s |
| 13577 | (egins)f(with)g(a)h(`)p Fs(-)p Ft('.)225 1519 y Fp(\017)60 | |
| ac18b312 CR |
13578 | b Ft(The)26 b(SVR4.2)i(shell)f(exits)g(a)g(script)g(if)g(an)m(y)g |
| 13579 | (builtin)f(fails;)j(Bash)e(exits)g(a)g(script)g(only)g(if)g(one)g(of)g | |
| 13580 | (the)330 1629 y Fl(posix)34 b Ft(sp)s(ecial)h(builtins)f(fails,)i(and)e | |
| 13581 | (only)h(for)f(certain)h(failures,)h(as)f(en)m(umerated)g(in)f(the)h | |
| 13582 | Fl(posix)330 1738 y Ft(standard.)225 1873 y Fp(\017)60 | |
| 13583 | b Ft(The)30 b(SVR4.2)h(shell)g(b)s(eha)m(v)m(es)f(di\013eren)m(tly)h | |
| 13584 | (when)f(in)m(v)m(ok)m(ed)i(as)e Fs(jsh)g Ft(\(it)h(turns)e(on)h(job)g | |
| 13585 | (con)m(trol\).)p eop end | |
| 28157acd CR |
13586 | %%Page: 137 143 |
| 13587 | TeXDict begin 137 142 bop 150 -116 a Ft(App)s(endix)29 | |
| 13588 | b(C:)h(Cop)m(ying)g(This)g(Man)m(ual)2063 b(137)150 299 | |
| 37c41ab1 CR |
13589 | y Fo(App)t(endix)52 b(C)126 b(Cop)l(ying)51 b(This)i(Man)l(ual)150 |
| 13590 | 690 y Fr(C.1)68 b(GNU)45 b(F)-11 b(ree)45 b(Do)t(cumen)l(tation)h | |
| 13591 | (License)1396 909 y Ft(V)-8 b(ersion)31 b(1.2,)h(No)m(v)m(em)m(b)s(er)g | |
| 13592 | (2002)390 1052 y(Cop)m(yrigh)m(t)842 1049 y(c)817 1052 | |
| 13593 | y Fp(\015)e Ft(2000,2001,2002)36 b(F)-8 b(ree)32 b(Soft)m(w)m(are)f(F) | |
| 13594 | -8 b(oundation,)32 b(Inc.)390 1161 y(59)f(T)-8 b(emple)31 | |
| 13595 | b(Place,)h(Suite)e(330,)i(Boston,)g(MA)61 b(02111-1307,)35 | |
| 13596 | b(USA)390 1380 y(Ev)m(ery)m(one)c(is)g(p)s(ermitted)f(to)h(cop)m(y)g | |
| 13597 | (and)f(distribute)g(v)m(erbatim)h(copies)390 1490 y(of)g(this)f | |
| 13598 | (license)h(do)s(cumen)m(t,)g(but)e(c)m(hanging)j(it)f(is)f(not)h(allo)m | |
| 5e13499c | 13599 | (w)m(ed.)199 1632 y(0.)61 b(PREAMBLE)330 1770 y(The)37 |
| 37c41ab1 CR |
13600 | b(purp)s(ose)e(of)i(this)g(License)h(is)f(to)h(mak)m(e)g(a)g(man)m |
| 13601 | (ual,)h(textb)s(o)s(ok,)h(or)d(other)g(functional)h(and)330 | |
| 13602 | 1880 y(useful)29 b(do)s(cumen)m(t)h Fq(free)36 b Ft(in)29 | |
| 13603 | b(the)i(sense)f(of)g(freedom:)41 b(to)31 b(assure)e(ev)m(ery)m(one)j | |
| 13604 | (the)e(e\013ectiv)m(e)j(freedom)330 1990 y(to)f(cop)m(y)g(and)f | |
| 13605 | (redistribute)g(it,)h(with)g(or)f(without)g(mo)s(difying)g(it,)i | |
| 13606 | (either)f(commercially)h(or)e(non-)330 2099 y(commercially)-8 | |
| 13607 | b(.)56 b(Secondarily)-8 b(,)36 b(this)f(License)g(preserv)m(es)g(for)f | |
| 13608 | (the)h(author)f(and)g(publisher)f(a)i(w)m(a)m(y)330 2209 | |
| 13609 | y(to)i(get)g(credit)g(for)f(their)g(w)m(ork,)i(while)e(not)g(b)s(eing)g | |
| 13610 | (considered)g(resp)s(onsible)f(for)h(mo)s(di\014cations)330 | |
| 13611 | 2318 y(made)30 b(b)m(y)h(others.)330 2457 y(This)22 b(License)i(is)f(a) | |
| 13612 | h(kind)e(of)i(\\cop)m(yleft",)j(whic)m(h)c(means)g(that)h(deriv)-5 | |
| 13613 | b(ativ)m(e)24 b(w)m(orks)f(of)h(the)f(do)s(cumen)m(t)330 | |
| 13614 | 2566 y(m)m(ust)34 b(themselv)m(es)h(b)s(e)e(free)h(in)g(the)g(same)g | |
| 13615 | (sense.)51 b(It)34 b(complemen)m(ts)h(the)f(GNU)g(General)h(Public)330 | |
| 13616 | 2676 y(License,)c(whic)m(h)f(is)h(a)f(cop)m(yleft)i(license)g(designed) | |
| 13617 | e(for)g(free)h(soft)m(w)m(are.)330 2814 y(W)-8 b(e)31 | |
| 13618 | b(ha)m(v)m(e)f(designed)g(this)f(License)h(in)f(order)g(to)i(use)e(it)h | |
| 13619 | (for)f(man)m(uals)h(for)f(free)h(soft)m(w)m(are,)h(b)s(ecause)330 | |
| 5e13499c | 13620 | 2924 y(free)42 b(soft)m(w)m(are)i(needs)e(free)g(do)s(cumen)m(tation:) |
| 37c41ab1 CR |
13621 | 65 b(a)42 b(free)h(program)f(should)f(come)i(with)f(man)m(uals)330 |
| 13622 | 3033 y(pro)m(viding)29 b(the)g(same)g(freedoms)f(that)i(the)f(soft)m(w) | |
| 13623 | m(are)h(do)s(es.)40 b(But)29 b(this)f(License)i(is)f(not)g(limited)g | |
| 13624 | (to)330 3143 y(soft)m(w)m(are)j(man)m(uals;)f(it)g(can)g(b)s(e)f(used)g | |
| 13625 | (for)g(an)m(y)h(textual)h(w)m(ork,)f(regardless)g(of)g(sub)5 | |
| 13626 | b(ject)30 b(matter)i(or)330 3252 y(whether)f(it)h(is)f(published)f(as)i | |
| 13627 | (a)f(prin)m(ted)g(b)s(o)s(ok.)44 b(W)-8 b(e)32 b(recommend)f(this)h | |
| 13628 | (License)g(principally)f(for)330 3362 y(w)m(orks)f(whose)h(purp)s(ose)d | |
| 13629 | (is)j(instruction)f(or)g(reference.)199 3500 y(1.)61 | |
| 13630 | b(APPLICABILITY)29 b(AND)j(DEFINITIONS)330 3639 y(This)39 | |
| 13631 | b(License)i(applies)f(to)g(an)m(y)h(man)m(ual)f(or)g(other)g(w)m(ork,)i | |
| 13632 | (in)e(an)m(y)g(medium,)i(that)e(con)m(tains)i(a)330 3748 | |
| 13633 | y(notice)h(placed)f(b)m(y)f(the)h(cop)m(yrigh)m(t)h(holder)e(sa)m(ying) | |
| 13634 | h(it)g(can)g(b)s(e)f(distributed)f(under)g(the)i(terms)330 | |
| 13635 | 3858 y(of)c(this)f(License.)62 b(Suc)m(h)37 b(a)h(notice)h(gran)m(ts)f | |
| 13636 | (a)g(w)m(orld-wide,)h(ro)m(y)m(alt)m(y-free)i(license,)f(unlimited)d | |
| 13637 | (in)330 3967 y(duration,)49 b(to)d(use)f(that)g(w)m(ork)h(under)d(the)j | |
| 13638 | (conditions)f(stated)h(herein.)85 b(The)45 b(\\Do)s(cumen)m(t",)330 | |
| 13639 | 4077 y(b)s(elo)m(w,)29 b(refers)f(to)h(an)m(y)g(suc)m(h)f(man)m(ual)h | |
| 13640 | (or)f(w)m(ork.)40 b(An)m(y)29 b(mem)m(b)s(er)e(of)i(the)f(public)g(is)g | |
| 13641 | (a)h(licensee,)i(and)330 4187 y(is)25 b(addressed)f(as)h(\\y)m(ou".)40 | |
| 13642 | b(Y)-8 b(ou)26 b(accept)g(the)f(license)h(if)f(y)m(ou)h(cop)m(y)-8 | |
| 13643 | b(,)27 b(mo)s(dify)d(or)h(distribute)g(the)g(w)m(ork)330 | |
| 13644 | 4296 y(in)30 b(a)h(w)m(a)m(y)g(requiring)f(p)s(ermission)f(under)g(cop) | |
| 13645 | m(yrigh)m(t)j(la)m(w.)330 4435 y(A)i(\\Mo)s(di\014ed)f(V)-8 | |
| 13646 | b(ersion")35 b(of)f(the)g(Do)s(cumen)m(t)g(means)g(an)m(y)g(w)m(ork)f | |
| 13647 | (con)m(taining)j(the)e(Do)s(cumen)m(t)g(or)330 4544 y(a)k(p)s(ortion)f | |
| 13648 | (of)h(it,)i(either)e(copied)g(v)m(erbatim,)i(or)d(with)h(mo)s | |
| 13649 | (di\014cations)f(and/or)h(translated)g(in)m(to)330 4654 | |
| 13650 | y(another)31 b(language.)330 4792 y(A)26 b(\\Secondary)g(Section")h(is) | |
| 13651 | f(a)h(named)e(app)s(endix)f(or)i(a)h(fron)m(t-matter)g(section)g(of)f | |
| 13652 | (the)g(Do)s(cumen)m(t)330 4902 y(that)c(deals)g(exclusiv)m(ely)h(with)e | |
| 13653 | (the)g(relationship)h(of)f(the)h(publishers)d(or)i(authors)g(of)h(the)f | |
| 13654 | (Do)s(cumen)m(t)330 5011 y(to)38 b(the)f(Do)s(cumen)m(t's)i(o)m(v)m | |
| 13655 | (erall)g(sub)5 b(ject)37 b(\(or)h(to)g(related)g(matters\))g(and)f(con) | |
| 13656 | m(tains)h(nothing)f(that)330 5121 y(could)j(fall)h(directly)g(within)f | |
| 13657 | (that)h(o)m(v)m(erall)i(sub)5 b(ject.)70 b(\(Th)m(us,)42 | |
| 13658 | b(if)e(the)h(Do)s(cumen)m(t)g(is)f(in)g(part)h(a)330 | |
| 13659 | 5230 y(textb)s(o)s(ok)24 b(of)g(mathematics,)j(a)d(Secondary)f(Section) | |
| 13660 | h(ma)m(y)g(not)g(explain)g(an)m(y)g(mathematics.\))40 | |
| 13661 | b(The)330 5340 y(relationship)28 b(could)f(b)s(e)g(a)g(matter)i(of)e | |
| 13662 | (historical)i(connection)f(with)f(the)h(sub)5 b(ject)27 | |
| 13663 | b(or)g(with)g(related)p eop end | |
| 28157acd CR |
13664 | %%Page: 138 144 |
| 13665 | TeXDict begin 138 143 bop 150 -116 a Ft(138)2527 b(Bash)31 | |
| 37c41ab1 CR |
13666 | b(Reference)g(Man)m(ual)330 299 y(matters,)38 b(or)d(of)h(legal,)i |
| 13667 | (commercial,)h(philosophical,)f(ethical)f(or)e(p)s(olitical)i(p)s | |
| 13668 | (osition)f(regarding)330 408 y(them.)330 549 y(The)25 | |
| 13669 | b(\\In)m(v)-5 b(arian)m(t)27 b(Sections")g(are)f(certain)g(Secondary)g | |
| 13670 | (Sections)g(whose)f(titles)i(are)f(designated,)i(as)330 | |
| 13671 | 659 y(b)s(eing)e(those)h(of)g(In)m(v)-5 b(arian)m(t)27 | |
| 13672 | b(Sections,)i(in)d(the)h(notice)h(that)f(sa)m(ys)g(that)g(the)g(Do)s | |
| 13673 | (cumen)m(t)g(is)g(released)330 769 y(under)f(this)i(License.)40 | |
| 13674 | b(If)27 b(a)h(section)h(do)s(es)f(not)f(\014t)h(the)g(ab)s(o)m(v)m(e)h | |
| 13675 | (de\014nition)e(of)h(Secondary)f(then)h(it)g(is)330 878 | |
| 13676 | y(not)k(allo)m(w)m(ed)i(to)e(b)s(e)g(designated)g(as)g(In)m(v)-5 | |
| 13677 | b(arian)m(t.)46 b(The)31 b(Do)s(cumen)m(t)i(ma)m(y)f(con)m(tain)i(zero) | |
| 13678 | e(In)m(v)-5 b(arian)m(t)330 988 y(Sections.)39 b(If)25 | |
| 13679 | b(the)f(Do)s(cumen)m(t)i(do)s(es)e(not)h(iden)m(tify)g(an)m(y)g(In)m(v) | |
| 13680 | -5 b(arian)m(t)25 b(Sections)h(then)e(there)h(are)g(none.)330 | |
| 13681 | 1129 y(The)36 b(\\Co)m(v)m(er)i(T)-8 b(exts")38 b(are)f(certain)g | |
| 13682 | (short)g(passages)g(of)g(text)g(that)h(are)f(listed,)i(as)d(F)-8 | |
| 5e13499c | 13683 | b(ron)m(t-Co)m(v)m(er)330 1238 y(T)g(exts)26 b(or)f(Bac)m(k-Co)m(v)m |
| 37c41ab1 CR |
13684 | (er)j(T)-8 b(exts,)27 b(in)d(the)h(notice)i(that)e(sa)m(ys)h(that)g |
| 13685 | (the)f(Do)s(cumen)m(t)h(is)f(released)g(under)330 1348 | |
| 13686 | y(this)h(License.)40 b(A)25 b(F)-8 b(ron)m(t-Co)m(v)m(er)29 | |
| 5e13499c CR |
13687 | b(T)-8 b(ext)26 b(ma)m(y)h(b)s(e)e(at)i(most)f(5)g(w)m(ords,)g(and)g(a) |
| 13688 | g(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext)26 b(ma)m(y)330 1457 | |
| 13689 | y(b)s(e)k(at)h(most)g(25)g(w)m(ords.)330 1598 y(A)36 | |
| 13690 | b(\\T)-8 b(ransparen)m(t")36 b(cop)m(y)g(of)g(the)f(Do)s(cumen)m(t)h | |
| 37c41ab1 CR |
13691 | (means)g(a)g(mac)m(hine-readable)h(cop)m(y)-8 b(,)38 |
| 13692 | b(represen)m(ted)330 1708 y(in)d(a)h(format)g(whose)g(sp)s | |
| 13693 | (eci\014cation)g(is)g(a)m(v)-5 b(ailable)38 b(to)f(the)f(general)g | |
| 13694 | (public,)h(that)f(is)g(suitable)g(for)330 1817 y(revising)c(the)g(do)s | |
| 13695 | (cumen)m(t)f(straigh)m(tforw)m(ardly)i(with)e(generic)i(text)g(editors) | |
| 13696 | f(or)f(\(for)h(images)h(com-)330 1927 y(p)s(osed)23 b(of)h(pixels\))g | |
| 13697 | (generic)h(pain)m(t)f(programs)g(or)f(\(for)h(dra)m(wings\))g(some)g | |
| 13698 | (widely)g(a)m(v)-5 b(ailable)26 b(dra)m(wing)330 2037 | |
| 13699 | y(editor,)k(and)f(that)g(is)g(suitable)h(for)f(input)f(to)i(text)g | |
| 13700 | (formatters)f(or)g(for)g(automatic)i(translation)f(to)330 | |
| 13701 | 2146 y(a)d(v)-5 b(ariet)m(y)28 b(of)f(formats)g(suitable)h(for)e(input) | |
| 13702 | g(to)i(text)g(formatters.)40 b(A)27 b(cop)m(y)g(made)g(in)g(an)g | |
| 13703 | (otherwise)330 2256 y(T)-8 b(ransparen)m(t)37 b(\014le)h(format)g | |
| 5e13499c | 13704 | (whose)f(markup,)i(or)e(absence)h(of)g(markup,)g(has)g(b)s(een)f |
| 37c41ab1 CR |
13705 | (arranged)g(to)330 2365 y(th)m(w)m(art)27 b(or)g(discourage)g |
| 13706 | (subsequen)m(t)f(mo)s(di\014cation)h(b)m(y)g(readers)f(is)g(not)h(T)-8 | |
| 5e13499c | 13707 | b(ransparen)m(t.)39 b(An)27 b(image)330 2475 y(format)35 |
| 37c41ab1 CR |
13708 | b(is)f(not)h(T)-8 b(ransparen)m(t)34 b(if)g(used)g(for)g(an)m(y)g |
| 13709 | (substan)m(tial)h(amoun)m(t)g(of)g(text.)53 b(A)35 b(cop)m(y)g(that)g | |
| 13710 | (is)330 2585 y(not)c(\\T)-8 b(ransparen)m(t")31 b(is)f(called)i | |
| 13711 | (\\Opaque".)330 2725 y(Examples)53 b(of)g(suitable)h(formats)f(for)g(T) | |
| 13712 | -8 b(ransparen)m(t)53 b(copies)h(include)f(plain)g Fl(asci)r(i)g | |
| 13713 | Ft(without)330 2835 y(markup,)41 b(T)-8 b(exinfo)40 b(input)f(format,)j | |
| 13714 | (LaT)1775 2855 y(E)1826 2835 y(X)d(input)g(format,)k | |
| 13715 | Fl(sgml)c Ft(or)g Fl(xml)g Ft(using)g(a)h(publicly)330 | |
| 13716 | 2945 y(a)m(v)-5 b(ailable)34 b Fl(dtd)p Ft(,)d(and)g | |
| 13717 | (standard-conforming)g(simple)h Fl(html)p Ft(,)f(P)m(ostScript)h(or)f | |
| 13718 | Fl(pdf)g Ft(designed)g(for)330 3054 y(h)m(uman)37 b(mo)s(di\014cation.) | |
| 13719 | 65 b(Examples)38 b(of)g(transparen)m(t)g(image)i(formats)e(include)g | |
| 13720 | Fl(png)p Ft(,)i Fl(x)n(cf)e Ft(and)330 3164 y Fl(jpg)p | |
| 13721 | Ft(.)63 b(Opaque)38 b(formats)g(include)g(proprietary)g(formats)g(that) | |
| 13722 | h(can)f(b)s(e)g(read)g(and)f(edited)i(only)330 3273 y(b)m(y)g | |
| 13723 | (proprietary)g(w)m(ord)g(pro)s(cessors,)j Fl(sgml)c Ft(or)i | |
| 13724 | Fl(xml)e Ft(for)i(whic)m(h)f(the)g Fl(dtd)g Ft(and/or)g(pro)s(cessing) | |
| 13725 | 330 3383 y(to)s(ols)32 b(are)f(not)g(generally)h(a)m(v)-5 | |
| 13726 | b(ailable,)34 b(and)c(the)h(mac)m(hine-generated)i Fl(html)p | |
| 13727 | Ft(,)d(P)m(ostScript)i(or)f Fl(pdf)330 3493 y Ft(pro)s(duced)e(b)m(y)h | |
| 5e13499c | 13728 | (some)h(w)m(ord)f(pro)s(cessors)g(for)g(output)g(purp)s(oses)e(only)-8 |
| 37c41ab1 CR |
13729 | b(.)330 3634 y(The)34 b(\\Title)h(P)m(age")i(means,)e(for)f(a)h(prin)m |
| 13730 | (ted)f(b)s(o)s(ok,)h(the)f(title)i(page)f(itself,)h(plus)e(suc)m(h)f | |
| 13731 | (follo)m(wing)330 3743 y(pages)28 b(as)g(are)g(needed)g(to)g(hold,)g | |
| 28157acd | 13732 | (legibly)-8 b(,)30 b(the)e(material)h(this)f(License)g(requires)f(to)h |
| 37c41ab1 CR |
13733 | (app)s(ear)f(in)h(the)330 3853 y(title)g(page.)40 b(F)-8 |
| 13734 | b(or)28 b(w)m(orks)e(in)g(formats)h(whic)m(h)g(do)f(not)h(ha)m(v)m(e)h | |
| 13735 | (an)m(y)e(title)j(page)e(as)g(suc)m(h,)g(\\Title)h(P)m(age")330 | |
| 13736 | 3962 y(means)j(the)f(text)i(near)e(the)h(most)g(prominen)m(t)g(app)s | |
| 13737 | (earance)f(of)h(the)g(w)m(ork's)g(title,)h(preceding)f(the)330 | |
| 13738 | 4072 y(b)s(eginning)f(of)g(the)h(b)s(o)s(dy)e(of)h(the)h(text.)330 | |
| 13739 | 4213 y(A)f(section)h(\\En)m(titled)g(XYZ")f(means)f(a)h(named)g | |
| 13740 | (subunit)e(of)h(the)h(Do)s(cumen)m(t)h(whose)e(title)i(either)330 | |
| 13741 | 4322 y(is)d(precisely)g(XYZ)g(or)f(con)m(tains)i(XYZ)f(in)f(paren)m | |
| 13742 | (theses)i(follo)m(wing)g(text)g(that)f(translates)h(XYZ)e(in)330 | |
| 13743 | 4432 y(another)e(language.)40 b(\(Here)26 b(XYZ)f(stands)f(for)h(a)g | |
| 13744 | (sp)s(eci\014c)g(section)h(name)f(men)m(tioned)h(b)s(elo)m(w,)g(suc)m | |
| 13745 | (h)330 4542 y(as)i(\\Ac)m(kno)m(wledgemen)m(ts",)33 b(\\Dedications",)e | |
| 13746 | (\\Endorsemen)m(ts",)e(or)f(\\History".\))42 b(T)-8 b(o)29 | |
| 13747 | b(\\Preserv)m(e)330 4651 y(the)34 b(Title")h(of)e(suc)m(h)h(a)g | |
| 13748 | (section)g(when)f(y)m(ou)h(mo)s(dify)e(the)i(Do)s(cumen)m(t)h(means)e | |
| 13749 | (that)h(it)g(remains)g(a)330 4761 y(section)e(\\En)m(titled)f(XYZ")g | |
| 13750 | (according)g(to)g(this)g(de\014nition.)330 4902 y(The)c(Do)s(cumen)m(t) | |
| 13751 | i(ma)m(y)f(include)f(W)-8 b(arran)m(t)m(y)30 b(Disclaimers)f(next)f(to) | |
| 13752 | g(the)g(notice)h(whic)m(h)e(states)i(that)330 5011 y(this)34 | |
| 13753 | b(License)g(applies)g(to)h(the)f(Do)s(cumen)m(t.)52 b(These)33 | |
| 13754 | b(W)-8 b(arran)m(t)m(y)36 b(Disclaimers)f(are)g(considered)e(to)330 | |
| 13755 | 5121 y(b)s(e)k(included)g(b)m(y)g(reference)h(in)g(this)f(License,)j | |
| 13756 | (but)d(only)h(as)g(regards)f(disclaiming)i(w)m(arran)m(ties:)330 | |
| 13757 | 5230 y(an)m(y)e(other)g(implication)i(that)e(these)g(W)-8 | |
| 13758 | b(arran)m(t)m(y)39 b(Disclaimers)f(ma)m(y)g(ha)m(v)m(e)g(is)f(v)m(oid)g | |
| 13759 | (and)f(has)h(no)330 5340 y(e\013ect)32 b(on)e(the)h(meaning)f(of)h | |
| 13760 | (this)f(License.)p eop end | |
| 28157acd CR |
13761 | %%Page: 139 145 |
| 13762 | TeXDict begin 139 144 bop 150 -116 a Ft(App)s(endix)29 | |
| 13763 | b(C:)h(Cop)m(ying)g(This)g(Man)m(ual)2063 b(139)199 299 | |
| 37c41ab1 CR |
13764 | y(2.)61 b(VERBA)-8 b(TIM)31 b(COPYING)330 445 y(Y)-8 |
| 13765 | b(ou)39 b(ma)m(y)f(cop)m(y)h(and)e(distribute)h(the)g(Do)s(cumen)m(t)h | |
| 13766 | (in)f(an)m(y)g(medium,)h(either)g(commercially)h(or)330 | |
| 13767 | 555 y(noncommercially)-8 b(,)48 b(pro)m(vided)42 b(that)h(this)f | |
| 13768 | (License,)47 b(the)42 b(cop)m(yrigh)m(t)i(notices,)j(and)42 | |
| 13769 | b(the)h(license)330 664 y(notice)37 b(sa)m(ying)g(this)e(License)i | |
| 13770 | (applies)e(to)i(the)f(Do)s(cumen)m(t)g(are)g(repro)s(duced)e(in)i(all)g | |
| 13771 | (copies,)j(and)330 774 y(that)27 b(y)m(ou)g(add)f(no)h(other)f | |
| 13772 | (conditions)h(whatso)s(ev)m(er)h(to)f(those)g(of)g(this)f(License.)40 | |
| 13773 | b(Y)-8 b(ou)27 b(ma)m(y)g(not)g(use)330 883 y(tec)m(hnical)35 | |
| 13774 | b(measures)d(to)i(obstruct)f(or)g(con)m(trol)h(the)f(reading)g(or)g | |
| 13775 | (further)e(cop)m(ying)j(of)f(the)g(copies)330 993 y(y)m(ou)25 | |
| 13776 | b(mak)m(e)g(or)g(distribute.)38 b(Ho)m(w)m(ev)m(er,)28 | |
| 13777 | b(y)m(ou)d(ma)m(y)g(accept)h(comp)s(ensation)f(in)f(exc)m(hange)j(for)d | |
| 13778 | (copies.)330 1103 y(If)32 b(y)m(ou)g(distribute)g(a)h(large)g(enough)f | |
| 13779 | (n)m(um)m(b)s(er)f(of)h(copies)h(y)m(ou)f(m)m(ust)h(also)g(follo)m(w)g | |
| 13780 | (the)f(conditions)330 1212 y(in)e(section)i(3.)330 1358 | |
| 13781 | y(Y)-8 b(ou)21 b(ma)m(y)h(also)f(lend)g(copies,)i(under)d(the)h(same)g | |
| 13782 | (conditions)g(stated)h(ab)s(o)m(v)m(e,)i(and)c(y)m(ou)h(ma)m(y)g | |
| 13783 | (publicly)330 1468 y(displa)m(y)31 b(copies.)199 1614 | |
| 5e13499c | 13784 | y(3.)61 b(COPYING)30 b(IN)g(QUANTITY)330 1760 y(If)25 |
| 37c41ab1 CR |
13785 | b(y)m(ou)g(publish)f(prin)m(ted)g(copies)i(\(or)g(copies)g(in)f(media)g |
| 13786 | (that)h(commonly)g(ha)m(v)m(e)g(prin)m(ted)f(co)m(v)m(ers\))i(of)330 | |
| 13787 | 1870 y(the)32 b(Do)s(cumen)m(t,)h(n)m(um)m(b)s(ering)e(more)h(than)f | |
| 13788 | (100,)j(and)d(the)h(Do)s(cumen)m(t's)h(license)f(notice)h(requires)330 | |
| 13789 | 1979 y(Co)m(v)m(er)i(T)-8 b(exts,)36 b(y)m(ou)f(m)m(ust)f(enclose)i | |
| 13790 | (the)e(copies)h(in)f(co)m(v)m(ers)i(that)f(carry)-8 b(,)36 | |
| 13791 | b(clearly)f(and)f(legibly)-8 b(,)37 b(all)330 2089 y(these)j(Co)m(v)m | |
| 13792 | (er)g(T)-8 b(exts:)59 b(F)-8 b(ron)m(t-Co)m(v)m(er)41 | |
| 5e13499c CR |
13793 | b(T)-8 b(exts)40 b(on)f(the)g(fron)m(t)g(co)m(v)m(er,)44 |
| 13794 | b(and)38 b(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts)40 b(on)330 | |
| 13795 | 2198 y(the)29 b(bac)m(k)h(co)m(v)m(er.)42 b(Both)30 b(co)m(v)m(ers)h(m) | |
| 37c41ab1 CR |
13796 | m(ust)e(also)h(clearly)g(and)f(legibly)h(iden)m(tify)f(y)m(ou)h(as)f |
| 13797 | (the)h(publisher)330 2308 y(of)k(these)h(copies.)53 b(The)34 | |
| 13798 | b(fron)m(t)h(co)m(v)m(er)h(m)m(ust)e(presen)m(t)g(the)h(full)f(title)i | |
| 13799 | (with)d(all)j(w)m(ords)d(of)i(the)f(title)330 2418 y(equally)e | |
| 13800 | (prominen)m(t)e(and)g(visible.)43 b(Y)-8 b(ou)31 b(ma)m(y)g(add)g | |
| 13801 | (other)g(material)h(on)f(the)g(co)m(v)m(ers)h(in)e(addition.)330 | |
| 13802 | 2527 y(Cop)m(ying)36 b(with)g(c)m(hanges)h(limited)g(to)g(the)g(co)m(v) | |
| 13803 | m(ers,)i(as)d(long)h(as)g(they)f(preserv)m(e)g(the)h(title)g(of)g(the) | |
| 13804 | 330 2637 y(Do)s(cumen)m(t)h(and)e(satisfy)i(these)f(conditions,)j(can)d | |
| 13805 | (b)s(e)g(treated)h(as)f(v)m(erbatim)h(cop)m(ying)g(in)f(other)330 | |
| 13806 | 2746 y(resp)s(ects.)330 2892 y(If)32 b(the)h(required)f(texts)i(for)e | |
| 13807 | (either)h(co)m(v)m(er)i(are)e(to)s(o)g(v)m(oluminous)g(to)g(\014t)g | |
| 13808 | (legibly)-8 b(,)35 b(y)m(ou)e(should)f(put)330 3002 y(the)h(\014rst)f | |
| 13809 | (ones)h(listed)g(\(as)h(man)m(y)f(as)g(\014t)g(reasonably\))g(on)g(the) | |
| 13810 | g(actual)h(co)m(v)m(er,)h(and)e(con)m(tin)m(ue)h(the)330 | |
| 13811 | 3112 y(rest)d(on)m(to)g(adjacen)m(t)h(pages.)330 3258 | |
| 13812 | y(If)27 b(y)m(ou)g(publish)e(or)i(distribute)g(Opaque)f(copies)i(of)f | |
| 13813 | (the)h(Do)s(cumen)m(t)f(n)m(um)m(b)s(ering)f(more)i(than)e(100,)330 | |
| 13814 | 3367 y(y)m(ou)i(m)m(ust)g(either)h(include)e(a)i(mac)m(hine-readable)g | |
| 13815 | (T)-8 b(ransparen)m(t)28 b(cop)m(y)h(along)g(with)e(eac)m(h)i(Opaque) | |
| 13816 | 330 3477 y(cop)m(y)-8 b(,)38 b(or)d(state)h(in)f(or)g(with)g(eac)m(h)h | |
| 13817 | (Opaque)e(cop)m(y)i(a)g(computer-net)m(w)m(ork)g(lo)s(cation)h(from)d | |
| 13818 | (whic)m(h)330 3587 y(the)24 b(general)i(net)m(w)m(ork-using)f(public)e | |
| 13819 | (has)h(access)i(to)f(do)m(wnload)f(using)g(public-standard)f(net)m(w)m | |
| 13820 | (ork)330 3696 y(proto)s(cols)40 b(a)f(complete)h(T)-8 | |
| 5e13499c | 13821 | b(ransparen)m(t)39 b(cop)m(y)g(of)g(the)h(Do)s(cumen)m(t,)i(free)d(of)g |
| 37c41ab1 CR |
13822 | (added)f(material.)67 b(If)330 3806 y(y)m(ou)39 b(use)g(the)g(latter)h |
| 13823 | (option,)h(y)m(ou)f(m)m(ust)e(tak)m(e)j(reasonably)e(pruden)m(t)e | |
| 13824 | (steps,)k(when)d(y)m(ou)h(b)s(egin)330 3915 y(distribution)f(of)g | |
| 13825 | (Opaque)g(copies)h(in)e(quan)m(tit)m(y)-8 b(,)43 b(to)38 | |
| 13826 | b(ensure)g(that)h(this)f(T)-8 b(ransparen)m(t)38 b(cop)m(y)h(will)330 | |
| 13827 | 4025 y(remain)30 b(th)m(us)g(accessible)i(at)f(the)f(stated)h(lo)s | |
| 13828 | (cation)h(un)m(til)e(at)h(least)h(one)e(y)m(ear)h(after)g(the)f(last)h | |
| 13829 | (time)330 4134 y(y)m(ou)37 b(distribute)f(an)h(Opaque)f(cop)m(y)i | |
| 13830 | (\(directly)g(or)e(through)g(y)m(our)h(agen)m(ts)h(or)f(retailers\))h | |
| 13831 | (of)f(that)330 4244 y(edition)31 b(to)g(the)g(public.)330 | |
| 13832 | 4390 y(It)k(is)f(requested,)i(but)e(not)h(required,)g(that)g(y)m(ou)g | |
| 5e13499c | 13833 | (con)m(tact)h(the)f(authors)f(of)h(the)g(Do)s(cumen)m(t)g(w)m(ell)330 |
| 37c41ab1 CR |
13834 | 4500 y(b)s(efore)28 b(redistributing)g(an)m(y)h(large)h(n)m(um)m(b)s |
| 13835 | (er)d(of)i(copies,)h(to)f(giv)m(e)h(them)f(a)g(c)m(hance)h(to)f(pro)m | |
| 13836 | (vide)g(y)m(ou)330 4609 y(with)h(an)g(up)s(dated)f(v)m(ersion)i(of)g | |
| 5e13499c | 13837 | (the)f(Do)s(cumen)m(t.)199 4755 y(4.)61 b(MODIFICA)-8 |
| 37c41ab1 CR |
13838 | b(TIONS)330 4902 y(Y)g(ou)26 b(ma)m(y)g(cop)m(y)g(and)f(distribute)g(a) |
| 13839 | h(Mo)s(di\014ed)f(V)-8 b(ersion)26 b(of)g(the)g(Do)s(cumen)m(t)g(under) | |
| 13840 | e(the)h(conditions)330 5011 y(of)c(sections)h(2)g(and)e(3)h(ab)s(o)m(v) | |
| 13841 | m(e,)k(pro)m(vided)20 b(that)i(y)m(ou)f(release)i(the)e(Mo)s(di\014ed)f | |
| 13842 | (V)-8 b(ersion)22 b(under)d(precisely)330 5121 y(this)29 | |
| 13843 | b(License,)h(with)f(the)g(Mo)s(di\014ed)f(V)-8 b(ersion)30 | |
| 13844 | b(\014lling)f(the)g(role)h(of)f(the)g(Do)s(cumen)m(t,)h(th)m(us)f | |
| 13845 | (licensing)330 5230 y(distribution)k(and)h(mo)s(di\014cation)g(of)h | |
| 13846 | (the)f(Mo)s(di\014ed)f(V)-8 b(ersion)35 b(to)g(who)s(ev)m(er)f(p)s | |
| 13847 | (ossesses)f(a)i(cop)m(y)g(of)330 5340 y(it.)41 b(In)30 | |
| 13848 | b(addition,)h(y)m(ou)f(m)m(ust)h(do)f(these)h(things)f(in)g(the)h(Mo)s | |
| 13849 | (di\014ed)e(V)-8 b(ersion:)p eop end | |
| 28157acd CR |
13850 | %%Page: 140 146 |
| 13851 | TeXDict begin 140 145 bop 150 -116 a Ft(140)2527 b(Bash)31 | |
| 37c41ab1 CR |
13852 | b(Reference)g(Man)m(ual)357 299 y(A.)60 b(Use)33 b(in)f(the)h(Title)h |
| 13853 | (P)m(age)g(\(and)f(on)f(the)h(co)m(v)m(ers,)i(if)e(an)m(y\))g(a)g | |
| 13854 | (title)h(distinct)f(from)g(that)g(of)g(the)510 408 y(Do)s(cumen)m(t,)j | |
| 13855 | (and)d(from)g(those)i(of)f(previous)f(v)m(ersions)h(\(whic)m(h)g | |
| 13856 | (should,)g(if)g(there)g(w)m(ere)g(an)m(y)-8 b(,)510 518 | |
| 13857 | y(b)s(e)31 b(listed)h(in)f(the)g(History)h(section)g(of)g(the)f(Do)s | |
| 13858 | (cumen)m(t\).)45 b(Y)-8 b(ou)32 b(ma)m(y)g(use)f(the)g(same)h(title)h | |
| 13859 | (as)510 628 y(a)e(previous)f(v)m(ersion)g(if)h(the)f(original)i | |
| 13860 | (publisher)d(of)h(that)h(v)m(ersion)g(giv)m(es)h(p)s(ermission.)360 | |
| 13861 | 758 y(B.)61 b(List)31 b(on)f(the)h(Title)g(P)m(age,)i(as)d(authors,)h | |
| 13862 | (one)g(or)f(more)h(p)s(ersons)e(or)h(en)m(tities)j(resp)s(onsible)c | |
| 13863 | (for)510 867 y(authorship)c(of)h(the)h(mo)s(di\014cations)f(in)g(the)g | |
| 13864 | (Mo)s(di\014ed)f(V)-8 b(ersion,)28 b(together)g(with)d(at)i(least)h | |
| 13865 | (\014v)m(e)510 977 y(of)c(the)g(principal)g(authors)f(of)i(the)f(Do)s | |
| 13866 | (cumen)m(t)g(\(all)h(of)g(its)f(principal)g(authors,)h(if)f(it)g(has)g | |
| 13867 | (few)m(er)510 1087 y(than)30 b(\014v)m(e\),)h(unless)f(they)h(release)g | |
| 13868 | (y)m(ou)g(from)f(this)g(requiremen)m(t.)359 1217 y(C.)60 | |
| 13869 | b(State)32 b(on)e(the)h(Title)h(page)f(the)g(name)g(of)g(the)g | |
| 13870 | (publisher)e(of)i(the)g(Mo)s(di\014ed)f(V)-8 b(ersion,)32 | |
| 13871 | b(as)f(the)510 1326 y(publisher.)355 1456 y(D.)61 b(Preserv)m(e)31 | |
| 13872 | b(all)g(the)g(cop)m(yrigh)m(t)h(notices)f(of)g(the)f(Do)s(cumen)m(t.) | |
| 13873 | 363 1587 y(E.)60 b(Add)30 b(an)i(appropriate)f(cop)m(yrigh)m(t)i | |
| 13874 | (notice)f(for)g(y)m(our)f(mo)s(di\014cations)g(adjacen)m(t)i(to)f(the)g | |
| 13875 | (other)510 1696 y(cop)m(yrigh)m(t)g(notices.)365 1826 | |
| 13876 | y(F.)61 b(Include,)28 b(immediately)h(after)f(the)h(cop)m(yrigh)m(t)g | |
| 13877 | (notices,)h(a)e(license)h(notice)g(giving)g(the)f(public)510 | |
| 13878 | 1936 y(p)s(ermission)23 b(to)j(use)e(the)g(Mo)s(di\014ed)g(V)-8 | |
| 13879 | b(ersion)25 b(under)e(the)i(terms)f(of)h(this)f(License,)j(in)d(the)g | |
| 13880 | (form)510 2045 y(sho)m(wn)30 b(in)g(the)g(Addendum)f(b)s(elo)m(w.)353 | |
| 13881 | 2176 y(G.)61 b(Preserv)m(e)23 b(in)g(that)g(license)h(notice)g(the)f | |
| 13882 | (full)g(lists)g(of)g(In)m(v)-5 b(arian)m(t)23 b(Sections)h(and)e | |
| 13883 | (required)g(Co)m(v)m(er)510 2285 y(T)-8 b(exts)31 b(giv)m(en)g(in)f | |
| 13884 | (the)h(Do)s(cumen)m(t's)g(license)h(notice.)357 2415 | |
| 13885 | y(H.)60 b(Include)30 b(an)g(unaltered)g(cop)m(y)h(of)g(this)f(License.) | |
| 13886 | 392 2545 y(I.)60 b(Preserv)m(e)33 b(the)f(section)h(En)m(titled)g | |
| 13887 | (\\History",)h(Preserv)m(e)f(its)f(Title,)i(and)d(add)h(to)h(it)f(an)g | |
| 13888 | (item)510 2655 y(stating)d(at)g(least)g(the)g(title,)h(y)m(ear,)g(new)d | |
| 13889 | (authors,)i(and)e(publisher)f(of)j(the)f(Mo)s(di\014ed)f(V)-8 | |
| 13890 | b(ersion)510 2765 y(as)32 b(giv)m(en)g(on)f(the)h(Title)g(P)m(age.)45 | |
| 13891 | b(If)31 b(there)h(is)f(no)g(section)i(En)m(titled)f(\\History")h(in)e | |
| 13892 | (the)g(Do)s(cu-)510 2874 y(men)m(t,)37 b(create)f(one)f(stating)h(the)f | |
| 13893 | (title,)i(y)m(ear,)g(authors,)f(and)e(publisher)f(of)i(the)g(Do)s | |
| 13894 | (cumen)m(t)510 2984 y(as)h(giv)m(en)h(on)f(its)h(Title)g(P)m(age,)i | |
| 13895 | (then)d(add)g(an)g(item)g(describing)g(the)g(Mo)s(di\014ed)g(V)-8 | |
| 13896 | b(ersion)37 b(as)510 3093 y(stated)31 b(in)f(the)h(previous)f(sen)m | |
| 5e13499c | 13897 | (tence.)378 3224 y(J.)60 b(Preserv)m(e)33 b(the)g(net)m(w)m(ork)g(lo)s |
| 37c41ab1 CR |
13898 | (cation,)i(if)d(an)m(y)-8 b(,)34 b(giv)m(en)f(in)g(the)f(Do)s(cumen)m |
| 13899 | (t)h(for)g(public)e(access)j(to)510 3333 y(a)e(T)-8 b(ransparen)m(t)30 | |
| 13900 | b(cop)m(y)i(of)g(the)f(Do)s(cumen)m(t,)h(and)f(lik)m(ewise)h(the)g(net) | |
| 13901 | m(w)m(ork)g(lo)s(cations)g(giv)m(en)g(in)510 3443 y(the)g(Do)s(cumen)m | |
| 13902 | (t)g(for)g(previous)f(v)m(ersions)h(it)g(w)m(as)g(based)f(on.)45 | |
| 13903 | b(These)31 b(ma)m(y)h(b)s(e)f(placed)h(in)g(the)510 3552 | |
| 13904 | y(\\History")27 b(section.)40 b(Y)-8 b(ou)25 b(ma)m(y)h(omit)g(a)f(net) | |
| 13905 | m(w)m(ork)h(lo)s(cation)g(for)f(a)h(w)m(ork)f(that)g(w)m(as)h | |
| 13906 | (published)510 3662 y(at)36 b(least)h(four)e(y)m(ears)i(b)s(efore)e | |
| 13907 | (the)h(Do)s(cumen)m(t)h(itself,)h(or)d(if)h(the)g(original)h(publisher) | |
| 13908 | d(of)i(the)510 3771 y(v)m(ersion)31 b(it)g(refers)f(to)h(giv)m(es)h(p)s | |
| 13909 | (ermission.)354 3902 y(K.)60 b(F)-8 b(or)24 b(an)m(y)h(section)f(En)m | |
| 13910 | (titled)h(\\Ac)m(kno)m(wledgemen)m(ts")i(or)d(\\Dedications",)k | |
| 13911 | (Preserv)m(e)c(the)g(Title)510 4011 y(of)j(the)f(section,)j(and)d | |
| 13912 | (preserv)m(e)h(in)f(the)h(section)g(all)h(the)e(substance)h(and)f(tone) | |
| 13913 | h(of)f(eac)m(h)i(of)f(the)510 4121 y(con)m(tributor)k(ac)m(kno)m | |
| 13914 | (wledgemen)m(ts)i(and/or)d(dedications)h(giv)m(en)h(therein.)368 | |
| 13915 | 4251 y(L.)60 b(Preserv)m(e)36 b(all)g(the)g(In)m(v)-5 | |
| 13916 | b(arian)m(t)36 b(Sections)g(of)f(the)h(Do)s(cumen)m(t,)h(unaltered)f | |
| 13917 | (in)f(their)g(text)i(and)510 4361 y(in)f(their)g(titles.)58 | |
| 13918 | b(Section)37 b(n)m(um)m(b)s(ers)d(or)i(the)g(equiv)-5 | |
| 13919 | b(alen)m(t)38 b(are)e(not)g(considered)g(part)g(of)g(the)510 | |
| 13920 | 4470 y(section)c(titles.)341 4600 y(M.)61 b(Delete)33 | |
| 13921 | b(an)m(y)e(section)h(En)m(titled)f(\\Endorsemen)m(ts".)42 | |
| 13922 | b(Suc)m(h)30 b(a)i(section)f(ma)m(y)h(not)f(b)s(e)f(included)510 | |
| 13923 | 4710 y(in)g(the)h(Mo)s(di\014ed)e(V)-8 b(ersion.)357 | |
| 13924 | 4840 y(N.)60 b(Do)29 b(not)g(retitle)h(an)m(y)e(existing)i(section)f | |
| 13925 | (to)g(b)s(e)f(En)m(titled)h(\\Endorsemen)m(ts")g(or)f(to)h(con\015ict)g | |
| 13926 | (in)510 4950 y(title)j(with)e(an)m(y)h(In)m(v)-5 b(arian)m(t)31 | |
| 5e13499c | 13927 | b(Section.)354 5080 y(O.)60 b(Preserv)m(e)31 b(an)m(y)g(W)-8 |
| 37c41ab1 CR |
13928 | b(arran)m(t)m(y)32 b(Disclaimers.)330 5230 y(If)h(the)g(Mo)s(di\014ed)g |
| 13929 | (V)-8 b(ersion)34 b(includes)f(new)g(fron)m(t-matter)i(sections)f(or)f | |
| 13930 | (app)s(endices)g(that)h(qualify)330 5340 y(as)28 b(Secondary)g | |
| 13931 | (Sections)g(and)f(con)m(tain)j(no)d(material)j(copied)e(from)f(the)h | |
| 13932 | (Do)s(cumen)m(t,)i(y)m(ou)e(ma)m(y)g(at)p eop end | |
| 28157acd CR |
13933 | %%Page: 141 147 |
| 13934 | TeXDict begin 141 146 bop 150 -116 a Ft(App)s(endix)29 | |
| 13935 | b(C:)h(Cop)m(ying)g(This)g(Man)m(ual)2063 b(141)330 299 | |
| 37c41ab1 CR |
13936 | y(y)m(our)32 b(option)h(designate)h(some)e(or)h(all)g(of)f(these)h |
| 13937 | (sections)h(as)e(in)m(v)-5 b(arian)m(t.)48 b(T)-8 b(o)33 | |
| 13938 | b(do)f(this,)h(add)f(their)330 408 y(titles)37 b(to)f(the)f(list)h(of)g | |
| 13939 | (In)m(v)-5 b(arian)m(t)36 b(Sections)g(in)f(the)h(Mo)s(di\014ed)f(V)-8 | |
| 13940 | b(ersion's)36 b(license)g(notice.)57 b(These)330 518 | |
| 13941 | y(titles)32 b(m)m(ust)e(b)s(e)g(distinct)h(from)e(an)m(y)i(other)g | |
| 13942 | (section)g(titles.)330 650 y(Y)-8 b(ou)43 b(ma)m(y)g(add)f(a)g(section) | |
| 13943 | i(En)m(titled)f(\\Endorsemen)m(ts",)j(pro)m(vided)c(it)h(con)m(tains)g | |
| 13944 | (nothing)g(but)330 759 y(endorsemen)m(ts)30 b(of)g(y)m(our)f(Mo)s | |
| 13945 | (di\014ed)g(V)-8 b(ersion)31 b(b)m(y)e(v)-5 b(arious)30 | |
| 13946 | b(parties|for)g(example,)g(statemen)m(ts)i(of)330 869 | |
| 13947 | y(p)s(eer)27 b(review)g(or)g(that)h(the)f(text)i(has)d(b)s(een)h(appro) | |
| 13948 | m(v)m(ed)g(b)m(y)g(an)h(organization)h(as)e(the)h(authoritativ)m(e)330 | |
| 13949 | 978 y(de\014nition)i(of)h(a)f(standard.)330 1110 y(Y)-8 | |
| 13950 | b(ou)29 b(ma)m(y)g(add)e(a)i(passage)g(of)g(up)e(to)i(\014v)m(e)g(w)m | |
| 13951 | (ords)e(as)i(a)g(F)-8 b(ron)m(t-Co)m(v)m(er)30 b(T)-8 | |
| 13952 | b(ext,)30 b(and)e(a)g(passage)i(of)e(up)330 1219 y(to)g(25)g(w)m(ords)e | |
| 13953 | (as)i(a)f(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext,)29 b(to)f(the)f(end)f(of)i | |
| 13954 | (the)f(list)h(of)f(Co)m(v)m(er)h(T)-8 b(exts)27 b(in)g(the)h(Mo)s | |
| 13955 | (di\014ed)330 1329 y(V)-8 b(ersion.)58 b(Only)35 b(one)h(passage)h(of)f | |
| 13956 | (F)-8 b(ron)m(t-Co)m(v)m(er)38 b(T)-8 b(ext)36 b(and)g(one)g(of)g(Bac)m | |
| 13957 | (k-Co)m(v)m(er)j(T)-8 b(ext)36 b(ma)m(y)h(b)s(e)330 1439 | |
| 13958 | y(added)27 b(b)m(y)g(\(or)h(through)f(arrangemen)m(ts)h(made)g(b)m(y\)) | |
| 13959 | g(an)m(y)g(one)f(en)m(tit)m(y)-8 b(.)42 b(If)27 b(the)h(Do)s(cumen)m(t) | |
| 13960 | g(already)330 1548 y(includes)34 b(a)g(co)m(v)m(er)h(text)g(for)f(the)g | |
| 13961 | (same)h(co)m(v)m(er,)h(previously)e(added)f(b)m(y)h(y)m(ou)g(or)g(b)m | |
| 13962 | (y)g(arrangemen)m(t)330 1658 y(made)h(b)m(y)g(the)h(same)f(en)m(tit)m | |
| 13963 | (y)i(y)m(ou)f(are)f(acting)i(on)e(b)s(ehalf)f(of,)j(y)m(ou)f(ma)m(y)g | |
| 13964 | (not)f(add)g(another;)j(but)330 1767 y(y)m(ou)c(ma)m(y)h(replace)g(the) | |
| 13965 | f(old)g(one,)i(on)e(explicit)h(p)s(ermission)e(from)g(the)i(previous)e | |
| 13966 | (publisher)f(that)330 1877 y(added)e(the)g(old)h(one.)330 | |
| 13967 | 2008 y(The)25 b(author\(s\))h(and)f(publisher\(s\))f(of)i(the)f(Do)s | |
| 13968 | (cumen)m(t)h(do)g(not)f(b)m(y)h(this)f(License)h(giv)m(e)h(p)s | |
| 13969 | (ermission)330 2118 y(to)k(use)f(their)g(names)h(for)f(publicit)m(y)g | |
| 13970 | (for)h(or)f(to)h(assert)g(or)f(imply)g(endorsemen)m(t)g(of)h(an)m(y)g | |
| 5e13499c CR |
13971 | (Mo)s(di\014ed)330 2228 y(V)-8 b(ersion.)199 2359 y(5.)61 |
| 13972 | b(COMBINING)31 b(DOCUMENTS)330 2491 y(Y)-8 b(ou)39 b(ma)m(y)g(com)m | |
| 37c41ab1 CR |
13973 | (bine)h(the)f(Do)s(cumen)m(t)g(with)g(other)f(do)s(cumen)m(ts)h |
| 13974 | (released)g(under)f(this)g(License,)330 2600 y(under)f(the)h(terms)g | |
| 13975 | (de\014ned)f(in)h(section)h(4)g(ab)s(o)m(v)m(e)g(for)f(mo)s(di\014ed)f | |
| 13976 | (v)m(ersions,)k(pro)m(vided)d(that)h(y)m(ou)330 2710 | |
| 13977 | y(include)25 b(in)g(the)g(com)m(bination)i(all)f(of)g(the)f(In)m(v)-5 | |
| 13978 | b(arian)m(t)26 b(Sections)g(of)g(all)g(of)f(the)h(original)g(do)s | |
| 13979 | (cumen)m(ts,)330 2819 y(unmo)s(di\014ed,)g(and)g(list)h(them)g(all)g | |
| 13980 | (as)g(In)m(v)-5 b(arian)m(t)28 b(Sections)f(of)g(y)m(our)g(com)m(bined) | |
| 13981 | g(w)m(ork)f(in)h(its)g(license)330 2929 y(notice,)32 | |
| 13982 | b(and)e(that)h(y)m(ou)f(preserv)m(e)h(all)g(their)g(W)-8 | |
| 13983 | b(arran)m(t)m(y)32 b(Disclaimers.)330 3061 y(The)e(com)m(bined)g(w)m | |
| 13984 | (ork)h(need)e(only)i(con)m(tain)g(one)g(cop)m(y)g(of)f(this)g(License,) | |
| 13985 | i(and)d(m)m(ultiple)i(iden)m(tical)330 3170 y(In)m(v)-5 | |
| 13986 | b(arian)m(t)33 b(Sections)g(ma)m(y)g(b)s(e)f(replaced)h(with)f(a)h | |
| 13987 | (single)g(cop)m(y)-8 b(.)48 b(If)32 b(there)h(are)g(m)m(ultiple)g(In)m | |
| 13988 | (v)-5 b(arian)m(t)330 3280 y(Sections)27 b(with)g(the)g(same)g(name)g | |
| 13989 | (but)f(di\013eren)m(t)h(con)m(ten)m(ts,)i(mak)m(e)f(the)f(title)h(of)f | |
| 13990 | (eac)m(h)h(suc)m(h)f(section)330 3389 y(unique)33 b(b)m(y)h(adding)f | |
| 13991 | (at)i(the)f(end)g(of)g(it,)h(in)f(paren)m(theses,)i(the)e(name)g(of)g | |
| 13992 | (the)g(original)h(author)f(or)330 3499 y(publisher)23 | |
| 13993 | b(of)i(that)h(section)g(if)f(kno)m(wn,)h(or)f(else)h(a)f(unique)f(n)m | |
| 5e13499c | 13994 | (um)m(b)s(er.)38 b(Mak)m(e)26 b(the)g(same)f(adjustmen)m(t)330 |
| 37c41ab1 CR |
13995 | 3608 y(to)g(the)g(section)g(titles)h(in)e(the)h(list)g(of)f(In)m(v)-5 |
| 13996 | b(arian)m(t)26 b(Sections)f(in)f(the)g(license)i(notice)g(of)e(the)h | |
| 5e13499c | 13997 | (com)m(bined)330 3718 y(w)m(ork.)330 3850 y(In)41 b(the)g(com)m |
| 37c41ab1 CR |
13998 | (bination,)46 b(y)m(ou)41 b(m)m(ust)g(com)m(bine)h(an)m(y)g(sections)g |
| 13999 | (En)m(titled)g(\\History")h(in)e(the)g(v)-5 b(ari-)330 | |
| 14000 | 3959 y(ous)32 b(original)h(do)s(cumen)m(ts,)g(forming)f(one)g(section)h | |
| 14001 | (En)m(titled)g(\\History";)i(lik)m(ewise)f(com)m(bine)f(an)m(y)330 | |
| 14002 | 4069 y(sections)g(En)m(titled)f(\\Ac)m(kno)m(wledgemen)m(ts",)k(and)31 | |
| 14003 | b(an)m(y)h(sections)h(En)m(titled)g(\\Dedications".)47 | |
| 14004 | b(Y)-8 b(ou)330 4178 y(m)m(ust)30 b(delete)i(all)f(sections)h(En)m | |
| 14005 | (titled)f(\\Endorsemen)m(ts.")199 4310 y(6.)61 b(COLLECTIONS)28 | |
| 5e13499c | 14006 | b(OF)i(DOCUMENTS)330 4441 y(Y)-8 b(ou)32 b(ma)m(y)h(mak)m(e)g(a)f |
| 37c41ab1 CR |
14007 | (collection)i(consisting)f(of)f(the)g(Do)s(cumen)m(t)g(and)g(other)g |
| 14008 | (do)s(cumen)m(ts)f(released)330 4551 y(under)41 b(this)h(License,)k | |
| 14009 | (and)c(replace)h(the)g(individual)f(copies)h(of)f(this)g(License)h(in)f | |
| 14010 | (the)h(v)-5 b(arious)330 4661 y(do)s(cumen)m(ts)42 b(with)g(a)h(single) | |
| 14011 | g(cop)m(y)h(that)f(is)f(included)g(in)g(the)h(collection,)48 | |
| 14012 | b(pro)m(vided)42 b(that)i(y)m(ou)330 4770 y(follo)m(w)38 | |
| 14013 | b(the)g(rules)e(of)h(this)g(License)h(for)f(v)m(erbatim)h(cop)m(ying)g | |
| 14014 | (of)f(eac)m(h)h(of)f(the)h(do)s(cumen)m(ts)e(in)h(all)330 | |
| 5e13499c | 14015 | 4880 y(other)31 b(resp)s(ects.)330 5011 y(Y)-8 b(ou)32 |
| 37c41ab1 CR |
14016 | b(ma)m(y)g(extract)h(a)f(single)g(do)s(cumen)m(t)f(from)g(suc)m(h)g(a)h |
| 14017 | (collection,)i(and)d(distribute)g(it)h(individu-)330 | |
| 14018 | 5121 y(ally)k(under)d(this)i(License,)i(pro)m(vided)e(y)m(ou)g(insert)g | |
| 14019 | (a)g(cop)m(y)h(of)f(this)g(License)g(in)m(to)h(the)g(extracted)330 | |
| 14020 | 5230 y(do)s(cumen)m(t,)d(and)f(follo)m(w)i(this)e(License)h(in)g(all)g | |
| 14021 | (other)g(resp)s(ects)f(regarding)h(v)m(erbatim)g(cop)m(ying)h(of)330 | |
| 14022 | 5340 y(that)d(do)s(cumen)m(t.)p eop end | |
| 28157acd CR |
14023 | %%Page: 142 148 |
| 14024 | TeXDict begin 142 147 bop 150 -116 a Ft(142)2527 b(Bash)31 | |
| 37c41ab1 CR |
14025 | b(Reference)g(Man)m(ual)199 299 y(7.)61 b(A)m(GGREGA)-8 |
| 14026 | b(TION)32 b(WITH)e(INDEPENDENT)h(W)m(ORKS)330 428 y(A)d(compilation)i | |
| 14027 | (of)e(the)g(Do)s(cumen)m(t)h(or)f(its)g(deriv)-5 b(ativ)m(es)30 | |
| 14028 | b(with)d(other)i(separate)g(and)e(indep)s(enden)m(t)330 | |
| 14029 | 538 y(do)s(cumen)m(ts)33 b(or)g(w)m(orks,)h(in)f(or)h(on)f(a)g(v)m | |
| 14030 | (olume)h(of)g(a)f(storage)i(or)e(distribution)g(medium,)g(is)h(called) | |
| 14031 | 330 648 y(an)c(\\aggregate")k(if)c(the)g(cop)m(yrigh)m(t)i(resulting)e | |
| 14032 | (from)f(the)i(compilation)g(is)f(not)h(used)e(to)i(limit)g(the)330 | |
| 14033 | 757 y(legal)d(righ)m(ts)f(of)g(the)g(compilation's)h(users)e(b)s(ey)m | |
| 14034 | (ond)g(what)g(the)h(individual)f(w)m(orks)g(p)s(ermit.)39 | |
| 14035 | b(When)330 867 y(the)28 b(Do)s(cumen)m(t)g(is)g(included)f(an)g | |
| 14036 | (aggregate,)32 b(this)27 b(License)h(do)s(es)g(not)g(apply)f(to)h(the)g | |
| 14037 | (other)g(w)m(orks)330 976 y(in)i(the)h(aggregate)i(whic)m(h)d(are)h | |
| 14038 | (not)f(themselv)m(es)i(deriv)-5 b(ativ)m(e)32 b(w)m(orks)e(of)h(the)f | |
| 14039 | (Do)s(cumen)m(t.)330 1106 y(If)22 b(the)h(Co)m(v)m(er)h(T)-8 | |
| 14040 | b(ext)23 b(requiremen)m(t)g(of)g(section)h(3)f(is)g(applicable)h(to)f | |
| 14041 | (these)h(copies)f(of)g(the)g(Do)s(cumen)m(t,)330 1215 | |
| 14042 | y(then)f(if)g(the)h(Do)s(cumen)m(t)g(is)g(less)f(than)g(one)h(half)f | |
| 14043 | (of)h(the)g(en)m(tire)g(aggregate,)k(the)c(Do)s(cumen)m(t's)g(Co)m(v)m | |
| 14044 | (er)330 1325 y(T)-8 b(exts)27 b(ma)m(y)g(b)s(e)f(placed)h(on)g(co)m(v)m | |
| 14045 | (ers)h(that)f(brac)m(k)m(et)h(the)f(Do)s(cumen)m(t)g(within)f(the)h | |
| 14046 | (aggregate,)j(or)d(the)330 1435 y(electronic)37 b(equiv)-5 | |
| 14047 | b(alen)m(t)36 b(of)g(co)m(v)m(ers)g(if)f(the)g(Do)s(cumen)m(t)h(is)f | |
| 14048 | (in)g(electronic)i(form.)54 b(Otherwise)35 b(they)330 | |
| 14049 | 1544 y(m)m(ust)30 b(app)s(ear)g(on)g(prin)m(ted)g(co)m(v)m(ers)i(that)f | |
| 14050 | (brac)m(k)m(et)h(the)f(whole)f(aggregate.)199 1674 y(8.)61 | |
| 14051 | b(TRANSLA)-8 b(TION)330 1803 y(T)g(ranslation)41 b(is)f(considered)f(a) | |
| 14052 | i(kind)e(of)h(mo)s(di\014cation,)j(so)d(y)m(ou)g(ma)m(y)h(distribute)e | |
| 8a9c66f6 | 14053 | (translations)330 1913 y(of)45 b(the)f(Do)s(cumen)m(t)h(under)e(the)h |
| 37c41ab1 CR |
14054 | (terms)h(of)f(section)i(4.)83 b(Replacing)45 b(In)m(v)-5 |
| 14055 | b(arian)m(t)45 b(Sections)g(with)330 2022 y(translations)h(requires)f | |
| 14056 | (sp)s(ecial)h(p)s(ermission)f(from)g(their)g(cop)m(yrigh)m(t)i | |
| 14057 | (holders,)i(but)c(y)m(ou)g(ma)m(y)330 2132 y(include)24 | |
| 14058 | b(translations)i(of)e(some)h(or)g(all)g(In)m(v)-5 b(arian)m(t)25 | |
| 14059 | b(Sections)g(in)f(addition)h(to)g(the)g(original)h(v)m(ersions)330 | |
| 14060 | 2242 y(of)32 b(these)f(In)m(v)-5 b(arian)m(t)33 b(Sections.)44 | |
| 14061 | b(Y)-8 b(ou)32 b(ma)m(y)g(include)f(a)h(translation)g(of)g(this)f | |
| 14062 | (License,)i(and)d(all)j(the)330 2351 y(license)42 b(notices)g(in)f(the) | |
| 14063 | h(Do)s(cumen)m(t,)j(and)40 b(an)m(y)i(W)-8 b(arran)m(t)m(y)42 | |
| 14064 | b(Disclaimers,)k(pro)m(vided)41 b(that)h(y)m(ou)330 2461 | |
| 14065 | y(also)f(include)f(the)g(original)h(English)f(v)m(ersion)g(of)g(this)g | |
| 14066 | (License)h(and)e(the)h(original)h(v)m(ersions)g(of)330 | |
| 14067 | 2570 y(those)35 b(notices)g(and)e(disclaimers.)53 b(In)33 | |
| 14068 | b(case)i(of)g(a)f(disagreemen)m(t)h(b)s(et)m(w)m(een)g(the)f | |
| 14069 | (translation)i(and)330 2680 y(the)f(original)i(v)m(ersion)e(of)h(this)f | |
| 14070 | (License)h(or)f(a)g(notice)i(or)e(disclaimer,)i(the)f(original)g(v)m | |
| 14071 | (ersion)g(will)330 2790 y(prev)-5 b(ail.)330 2919 y(If)28 | |
| 14072 | b(a)h(section)h(in)e(the)h(Do)s(cumen)m(t)h(is)e(En)m(titled)i(\\Ac)m | |
| 14073 | (kno)m(wledgemen)m(ts",)i(\\Dedications",)g(or)d(\\His-)330 | |
| 14074 | 3029 y(tory",)f(the)f(requiremen)m(t)f(\(section)i(4\))f(to)g(Preserv)m | |
| 14075 | (e)g(its)f(Title)i(\(section)f(1\))g(will)g(t)m(ypically)h(require)330 | |
| 14076 | 3138 y(c)m(hanging)j(the)g(actual)h(title.)199 3268 y(9.)61 | |
| 14077 | b(TERMINA)-8 b(TION)330 3397 y(Y)g(ou)30 b(ma)m(y)h(not)f(cop)m(y)-8 | |
| 14078 | b(,)31 b(mo)s(dify)-8 b(,)30 b(sublicense,)g(or)g(distribute)f(the)h | |
| 14079 | (Do)s(cumen)m(t)g(except)h(as)f(expressly)330 3507 y(pro)m(vided)41 | |
| 14080 | b(for)h(under)e(this)i(License.)75 b(An)m(y)42 b(other)g(attempt)h(to)g | |
| 14081 | (cop)m(y)-8 b(,)46 b(mo)s(dify)-8 b(,)44 b(sublicense)e(or)330 | |
| 14082 | 3616 y(distribute)36 b(the)h(Do)s(cumen)m(t)g(is)g(v)m(oid,)i(and)d | |
| 14083 | (will)h(automatically)i(terminate)f(y)m(our)e(righ)m(ts)h(under)330 | |
| 14084 | 3726 y(this)28 b(License.)40 b(Ho)m(w)m(ev)m(er,)31 b(parties)d(who)f | |
| 14085 | (ha)m(v)m(e)i(receiv)m(ed)g(copies,)h(or)d(righ)m(ts,)i(from)f(y)m(ou)g | |
| 14086 | (under)e(this)330 3836 y(License)37 b(will)g(not)g(ha)m(v)m(e)h(their)f | |
| 14087 | (licenses)g(terminated)h(so)f(long)g(as)g(suc)m(h)f(parties)h(remain)g | |
| 14088 | (in)f(full)330 3945 y(compliance.)154 4075 y(10.)61 b(FUTURE)30 | |
| 14089 | b(REVISIONS)f(OF)i(THIS)e(LICENSE)330 4204 y(The)41 b(F)-8 | |
| 14090 | b(ree)43 b(Soft)m(w)m(are)f(F)-8 b(oundation)43 b(ma)m(y)f(publish)e | |
| 14091 | (new,)k(revised)d(v)m(ersions)h(of)g(the)g(GNU)g(F)-8 | |
| 14092 | b(ree)330 4314 y(Do)s(cumen)m(tation)34 b(License)e(from)g(time)h(to)g | |
| 14093 | (time.)46 b(Suc)m(h)31 b(new)h(v)m(ersions)g(will)h(b)s(e)e(similar)h | |
| 14094 | (in)g(spirit)330 4423 y(to)j(the)g(presen)m(t)f(v)m(ersion,)i(but)e(ma) | |
| 14095 | m(y)h(di\013er)f(in)g(detail)h(to)g(address)f(new)g(problems)f(or)i | |
| 14096 | (concerns.)330 4533 y(See)c Fs(http://www.gnu.org/copy)o(left)o(/)p | |
| 14097 | Ft(.)330 4663 y(Eac)m(h)f(v)m(ersion)g(of)g(the)f(License)h(is)g(giv)m | |
| 14098 | (en)g(a)g(distinguishing)f(v)m(ersion)h(n)m(um)m(b)s(er.)39 | |
| 14099 | b(If)29 b(the)g(Do)s(cumen)m(t)330 4772 y(sp)s(eci\014es)45 | |
| 14100 | b(that)h(a)g(particular)f(n)m(um)m(b)s(ered)f(v)m(ersion)i(of)f(this)g | |
| 14101 | (License)h(\\or)g(an)m(y)g(later)g(v)m(ersion")330 4882 | |
| 14102 | y(applies)33 b(to)g(it,)h(y)m(ou)e(ha)m(v)m(e)i(the)f(option)g(of)f | |
| 14103 | (follo)m(wing)i(the)f(terms)f(and)g(conditions)h(either)g(of)f(that)330 | |
| 14104 | 4991 y(sp)s(eci\014ed)37 b(v)m(ersion)i(or)e(of)h(an)m(y)h(later)g(v)m | |
| 14105 | (ersion)f(that)g(has)g(b)s(een)f(published)f(\(not)j(as)f(a)g(draft\))g | |
| 14106 | (b)m(y)330 5101 y(the)33 b(F)-8 b(ree)34 b(Soft)m(w)m(are)f(F)-8 | |
| 14107 | b(oundation.)49 b(If)32 b(the)h(Do)s(cumen)m(t)g(do)s(es)g(not)g(sp)s | |
| 14108 | (ecify)f(a)h(v)m(ersion)g(n)m(um)m(b)s(er)f(of)330 5210 | |
| 14109 | y(this)i(License,)j(y)m(ou)d(ma)m(y)i(c)m(ho)s(ose)f(an)m(y)g(v)m | |
| 14110 | (ersion)g(ev)m(er)g(published)e(\(not)i(as)g(a)f(draft\))h(b)m(y)f(the) | |
| 14111 | h(F)-8 b(ree)330 5320 y(Soft)m(w)m(are)31 b(F)-8 b(oundation.)p | |
| 14112 | eop end | |
| 28157acd CR |
14113 | %%Page: 143 149 |
| 14114 | TeXDict begin 143 148 bop 150 -116 a Ft(App)s(endix)29 | |
| 14115 | b(C:)h(Cop)m(ying)g(This)g(Man)m(ual)2063 b(143)150 299 | |
| 37c41ab1 CR |
14116 | y Fk(C.1.1)62 b(ADDENDUM:)41 b(Ho)m(w)f(to)h(use)h(this)f(License)g |
| 14117 | (for)h(y)m(our)f(do)s(cumen)m(ts)275 543 y Ft(T)-8 b(o)27 | |
| 14118 | b(use)g(this)g(License)h(in)f(a)h(do)s(cumen)m(t)f(y)m(ou)h(ha)m(v)m(e) | |
| 14119 | g(written,)g(include)f(a)h(cop)m(y)g(of)f(the)h(License)g(in)f(the)150 | |
| 14120 | 653 y(do)s(cumen)m(t)j(and)g(put)g(the)g(follo)m(wing)i(cop)m(yrigh)m | |
| 14121 | (t)g(and)e(license)h(notices)g(just)f(after)h(the)g(title)h(page:)468 | |
| 14122 | 765 y Fe(Copyright)42 b(\(C\))79 b Fd(year)88 b(your)40 | |
| 14123 | b(name)p Fe(.)468 852 y(Permission)i(is)e(granted)g(to)g(copy,)h | |
| 14124 | (distribute)g(and/or)g(modify)f(this)g(document)468 939 | |
| 14125 | y(under)h(the)f(terms)g(of)g(the)g(GNU)g(Free)g(Documentation)i | |
| 14126 | (License,)f(Version)g(1.2)468 1026 y(or)f(any)g(later)g(version)h | |
| 14127 | (published)h(by)d(the)h(Free)g(Software)h(Foundation;)468 | |
| 14128 | 1113 y(with)g(no)e(Invariant)j(Sections,)f(no)f(Front-Cover)h(Texts,)g | |
| 14129 | (and)f(no)f(Back-Cover)j(Texts.)468 1200 y(A)e(copy)g(of)g(the)g | |
| 14130 | (license)g(is)g(included)h(in)f(the)g(section)h(entitled)g(``GNU)468 | |
| 14131 | 1288 y(Free)g(Documentation)h(License''.)275 1410 y Ft(If)d(y)m(ou)h | |
| 14132 | (ha)m(v)m(e)h(In)m(v)-5 b(arian)m(t)41 b(Sections,)i(F)-8 | |
| 14133 | b(ron)m(t-Co)m(v)m(er)42 b(T)-8 b(exts)41 b(and)e(Bac)m(k-Co)m(v)m(er)k | |
| 14134 | (T)-8 b(exts,)43 b(replace)e(the)150 1520 y(\\with...T)-8 | |
| 14135 | b(exts.")43 b(line)30 b(with)h(this:)547 1632 y Fe(with)40 | |
| 14136 | b(the)g(Invariant)h(Sections)g(being)g Fd(list)f(their)g(titles)p | |
| 14137 | Fe(,)h(with)547 1719 y(the)f(Front-Cover)i(Texts)e(being)g | |
| 14138 | Fd(list)p Fe(,)h(and)f(with)g(the)g(Back-Cover)h(Texts)547 | |
| 14139 | 1806 y(being)f Fd(list)p Fe(.)275 1929 y Ft(If)34 b(y)m(ou)i(ha)m(v)m | |
| 14140 | (e)g(In)m(v)-5 b(arian)m(t)36 b(Sections)g(without)f(Co)m(v)m(er)h(T)-8 | |
| 14141 | b(exts,)38 b(or)d(some)g(other)h(com)m(bination)g(of)g(the)150 | |
| 14142 | 2038 y(three,)31 b(merge)g(those)g(t)m(w)m(o)g(alternativ)m(es)i(to)e | |
| 14143 | (suit)f(the)h(situation.)275 2173 y(If)23 b(y)m(our)h(do)s(cumen)m(t)f | |
| 14144 | (con)m(tains)i(non)m(trivial)g(examples)g(of)f(program)f(co)s(de,)j(w)m | |
| 14145 | (e)e(recommend)g(releasing)150 2283 y(these)44 b(examples)f(in)g | |
| 14146 | (parallel)h(under)e(y)m(our)h(c)m(hoice)i(of)e(free)g(soft)m(w)m(are)h | |
| 14147 | (license,)k(suc)m(h)43 b(as)g(the)g(GNU)150 2392 y(General)31 | |
| 14148 | b(Public)f(License,)i(to)f(p)s(ermit)e(their)i(use)f(in)g(free)g(soft)m | |
| 14149 | (w)m(are.)p eop end | |
| 28157acd CR |
14150 | %%Page: 144 150 |
| 14151 | TeXDict begin 144 149 bop 150 -116 a Ft(144)2527 b(Bash)31 | |
| 37c41ab1 | 14152 | b(Reference)g(Man)m(ual)p eop end |
| 28157acd CR |
14153 | %%Page: 145 151 |
| 14154 | TeXDict begin 145 150 bop 150 -116 a Ft(Index)30 b(of)g(Shell)g | |
| 14155 | (Builtin)h(Commands)2133 b(145)150 299 y Fo(Index)53 | |
| 14156 | b(of)h(Shell)e(Builtin)g(Commands)150 560 y Fr(.)150 | |
| 14157 | 686 y Fe(.)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14158 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
| 14159 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 14160 | b Fb(35)150 945 y Fr(:)150 1071 y Fe(:)17 b Fc(.)12 b(.)h(.)f(.)g(.)h | |
| 14161 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14162 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14163 | (.)g(.)h(.)42 b Fb(35)150 1339 y Fr([)150 1465 y Fe([)17 | |
| 5e13499c CR |
14164 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14165 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd CR |
14166 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(39)150 1732 |
| 14167 | y Fr(A)150 1858 y Fe(alias)11 b Fc(.)j(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14168 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14169 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 b | |
| 28157acd | 14170 | Fb(41)150 2116 y Fr(B)150 2242 y Fe(bg)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h |
| 5e13499c CR |
14171 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14172 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 14173 | (.)41 b Fb(86)150 2334 y Fe(bind)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14174 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g |
| 14175 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
| 28157acd | 14176 | b Fb(41)150 2426 y Fe(break)11 b Fc(.)j(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14177 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14178 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 b | |
| 28157acd | 14179 | Fb(35)150 2518 y Fe(builtin)8 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14180 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| ac18b312 | 14181 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fb(42)150 |
| 28157acd | 14182 | 2777 y Fr(C)150 2903 y Fe(caller)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c CR |
14183 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 14184 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 | |
| 28157acd | 14185 | b Fb(42)150 2995 y Fe(cd)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14186 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14187 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
| 28157acd | 14188 | b Fb(36)150 3087 y Fe(command)8 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14189 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| ac18b312 | 14190 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fb(43)150 |
| 28157acd | 14191 | 3179 y Fe(compgen)7 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14192 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 14193 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)33 b Fb(111)150 3271 y Fe(complete)26 |
| 5e13499c CR |
14194 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h |
| 14195 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 28157acd | 14196 | 50 b Fb(111)150 3363 y Fe(continue)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.) |
| 5e13499c | 14197 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| ac18b312 | 14198 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(36)150 |
| 28157acd | 14199 | 3621 y Fr(D)150 3747 y Fe(declare)8 b Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14200 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 14201 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b | |
| 28157acd | 14202 | Fb(43)150 3839 y Fe(dirs)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c CR |
14203 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f |
| 14204 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
| 28157acd | 14205 | b Fb(77)150 3931 y Fe(disown)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c | 14206 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
14207 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(87)150 |
| 14208 | 4190 y Fr(E)150 4316 y Fe(echo)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14209 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 14210 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
| 28157acd | 14211 | b Fb(44)150 4408 y Fe(enable)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c | 14212 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| ac18b312 | 14213 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(45)150 |
| 28157acd | 14214 | 4500 y Fe(eval)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14215 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| ac18b312 | 14216 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(36)150 |
| 28157acd | 14217 | 4592 y Fe(exec)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14218 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| ac18b312 | 14219 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(36)150 |
| 28157acd | 14220 | 4684 y Fe(exit)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14221 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| ac18b312 | 14222 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(36)150 |
| 28157acd | 14223 | 4776 y Fe(export)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c | 14224 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
14225 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(36)150 5053 |
| 14226 | y Fr(F)150 5179 y Fe(fc)14 b Fc(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14227 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14228 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
| 28157acd | 14229 | b Fb(115)150 5271 y Fe(fg)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h |
| 5e13499c CR |
14230 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14231 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
| 28157acd | 14232 | b Fb(86)150 5548 y Fr(G)150 5674 y Fe(getopts)8 b Fc(.)14 |
| 5e13499c CR |
14233 | b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14234 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 14235 | g(.)34 b Fb(37)2025 560 y Fr(H)2025 676 y Fe(hash)13 |
| 5e13499c CR |
14236 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14237 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 28157acd | 14238 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(37)2025 764 y Fe(help)13 |
| 5e13499c CR |
14239 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14240 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 28157acd | 14241 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(45)2025 851 y Fe(history)7 |
| 5e13499c CR |
14242 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14243 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
| 28157acd | 14244 | g(.)h(.)33 b Fb(116)2025 1103 y Fr(J)2025 1219 y Fe(jobs)13 |
| 5e13499c CR |
14245 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14246 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 28157acd CR |
14247 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(86)2025 1470 y Fr(K)2025 |
| 14248 | 1586 y Fe(kill)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c | 14249 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
14250 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(87)2025 |
| 14251 | 1819 y Fr(L)2025 1935 y Fe(let)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14252 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 14253 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
| 28157acd | 14254 | b Fb(45)2025 2023 y Fe(local)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14255 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14256 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
| 28157acd | 14257 | b Fb(45)2025 2110 y Fe(logout)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c CR |
14258 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| 14259 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b | |
| 28157acd | 14260 | Fb(46)2025 2362 y Fr(P)2025 2478 y Fe(popd)13 b Fc(.)g(.)f(.)g(.)g(.)h |
| 5e13499c CR |
14261 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14262 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14263 | b Fb(78)2025 2565 y Fe(printf)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c CR |
14264 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| 14265 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b | |
| 28157acd | 14266 | Fb(46)2025 2652 y Fe(pushd)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14267 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14268 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b | |
| 28157acd | 14269 | Fb(78)2025 2739 y Fe(pwd)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c CR |
14270 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f |
| 14271 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
| 28157acd | 14272 | b Fb(38)2025 2991 y Fr(R)2025 3107 y Fe(read)13 b Fc(.)g(.)f(.)g(.)g(.) |
| 5e13499c CR |
14273 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14274 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd | 14275 | 38 b Fb(46)2025 3194 y Fe(readonly)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.) |
| 5e13499c | 14276 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| ac18b312 | 14277 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(38)2025 |
| 28157acd | 14278 | 3281 y Fe(return)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c | 14279 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd CR |
14280 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(38)2025 3514 |
| 14281 | y Fr(S)2025 3630 y Fe(set)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 5e13499c CR |
14282 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| 14283 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
| 28157acd | 14284 | b Fb(53)2025 3718 y Fe(shift)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14285 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14286 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
| 28157acd | 14287 | b Fb(38)2025 3805 y Fe(shopt)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14288 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14289 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
| 28157acd | 14290 | b Fb(47)2025 3892 y Fe(source)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c CR |
14291 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| 14292 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b | |
| 28157acd | 14293 | Fb(51)2025 3979 y Fe(suspend)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c | 14294 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
14295 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(87)2025 |
| 14296 | 4231 y Fr(T)2025 4347 y Fe(test)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
| 5e13499c CR |
14297 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14298 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14299 | b Fb(39)2025 4434 y Fe(times)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14300 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14301 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
| 28157acd | 14302 | b Fb(40)2025 4521 y Fe(trap)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14303 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14304 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14305 | b Fb(40)2025 4609 y Fe(type)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14306 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14307 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14308 | b Fb(51)2025 4696 y Fe(typeset)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c | 14309 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd CR |
14310 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(51)2025 |
| 14311 | 4948 y Fr(U)2025 5064 y Fe(ulimit)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14312 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 14313 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
| 28157acd | 14314 | b Fb(52)2025 5151 y Fe(umask)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
14315 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14316 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
| 28157acd | 14317 | b Fb(40)2025 5238 y Fe(unalias)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c | 14318 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd CR |
14319 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(53)2025 |
| 14320 | 5325 y Fe(unset)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c | 14321 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd CR |
14322 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(41)2025 5558 |
| 14323 | y Fr(W)2025 5674 y Fe(wait)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14324 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14325 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd CR |
14326 | b Fb(87)p eop end |
| 14327 | %%Page: 146 152 | |
| 14328 | TeXDict begin 146 151 bop 150 -116 a Ft(146)2527 b(Bash)31 | |
| 14329 | b(Reference)g(Man)m(ual)p eop end | |
| 14330 | %%Page: 147 153 | |
| 14331 | TeXDict begin 147 152 bop 150 -116 a Ft(Index)30 b(of)g(Shell)g(Reserv) | |
| 14332 | m(ed)h(W)-8 b(ords)2247 b(147)150 299 y Fo(Index)53 b(of)h(Shell)e | |
| 14333 | (Reserv)l(ed)g(W)-13 b(ords)150 610 y Fr(!)150 743 y | |
| 14334 | Fe(!)18 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14335 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
| 14336 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 b | |
| 14337 | Fb(8)150 1029 y Fr([)150 1162 y Fe([[)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h | |
| 37c41ab1 CR |
14338 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14339 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 14340 | (.)41 b Fb(12)150 1455 y Fr(])150 1587 y Fe(]])15 b Fc(.)e(.)g(.)f(.)g |
| 5e13499c | 14341 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 37c41ab1 | 14342 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 28157acd | 14343 | (.)h(.)f(.)41 b Fb(12)150 1873 y Fa({)150 2006 y Fe({)17 |
| 37c41ab1 CR |
14344 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14345 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd CR |
14346 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(13)150 2292 |
| 14347 | y Fa(})150 2425 y Fe(})17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 37c41ab1 CR |
14348 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 14349 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 28157acd | 14350 | b Fb(13)150 2709 y Fr(C)150 2842 y Fe(case)13 b Fc(.)g(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14351 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14352 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
| 28157acd | 14353 | b Fb(11)150 3119 y Fr(D)150 3252 y Fe(do)16 b Fc(.)d(.)g(.)f(.)g(.)h(.) |
| 5e13499c CR |
14354 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14355 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
| 28157acd | 14356 | f(.)g(.)43 b Fb(9)150 3347 y Fe(done)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c CR |
14357 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14358 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
| 28157acd | 14359 | b Fb(9)2025 610 y Fr(E)2025 726 y Fe(elif)13 b Fc(.)g(.)f(.)g(.)g(.)h |
| 5e13499c CR |
14360 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14361 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14362 | b Fb(10)2025 814 y Fe(else)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14363 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14364 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14365 | b Fb(10)2025 901 y Fe(esac)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 5e13499c CR |
14366 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14367 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 28157acd | 14368 | b Fb(11)2025 1134 y Fr(F)2025 1250 y Fe(fi)15 b Fc(.)e(.)f(.)h(.)f(.)g |
| 5e13499c CR |
14369 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14370 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 28157acd | 14371 | (.)f(.)41 b Fb(10)2025 1338 y Fe(for)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c CR |
14372 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14373 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 | |
| 28157acd | 14374 | b Fb(10)2025 1425 y Fe(function)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h |
| 5e13499c | 14375 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 9d2b70f0 | 14376 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(14)2025 |
| 28157acd | 14377 | 1658 y Fr(I)2025 1775 y Fe(if)15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c CR |
14378 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14379 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
| 28157acd | 14380 | b Fb(10)2025 1862 y Fe(in)15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 5e13499c CR |
14381 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 14382 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 | |
| 28157acd | 14383 | b Fb(11)2025 2095 y Fr(S)2025 2211 y Fe(select)10 b Fc(.)j(.)f(.)h(.)f |
| 5e13499c CR |
14384 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14385 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 | |
| 28157acd | 14386 | b Fb(11)2025 2445 y Fr(T)2025 2561 y Fe(then)13 b Fc(.)g(.)f(.)g(.)g(.) |
| 5e13499c CR |
14387 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14388 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd | 14389 | 38 b Fb(10)2025 2648 y Fe(time)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)g(.)h |
| 5e13499c CR |
14390 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14391 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)40 | |
| 28157acd | 14392 | b Fb(8)2025 2881 y Fr(U)2025 2998 y Fe(until)12 b Fc(.)h(.)g(.)f(.)g(.) |
| 5e13499c CR |
14393 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 14394 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd | 14395 | 38 b Fb(9)2025 3231 y Fr(W)2025 3347 y Fe(while)11 b |
| 5e13499c CR |
14396 | Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 14397 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd CR |
14398 | g(.)h(.)f(.)g(.)37 b Fb(10)p eop end |
| 14399 | %%Page: 148 154 | |
| 14400 | TeXDict begin 148 153 bop 150 -116 a Ft(148)2527 b(Bash)31 | |
| 14401 | b(Reference)g(Man)m(ual)p eop end | |
| 14402 | %%Page: 149 155 | |
| 14403 | TeXDict begin 149 154 bop 150 -116 a Ft(P)m(arameter)32 | |
| 14404 | b(and)d(V)-8 b(ariable)32 b(Index)2262 b(149)150 299 | |
| 14405 | y Fo(P)l(arameter)54 b(and)f(V)-13 b(ariable)53 b(Index)150 | |
| 14406 | 610 y Fr(!)150 727 y Fe(!)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14407 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g | |
| 14408 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 14409 | b Fb(16)150 963 y Fr(#)150 1080 y Fe(#)17 b Fc(.)12 b(.)h(.)f(.)g(.)h | |
| 14410 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14411 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14412 | (.)g(.)h(.)42 b Fb(16)150 1325 y Fr($)150 1442 y Fe($)17 | |
| 5e13499c CR |
14413 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14414 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd CR |
14415 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)150 1694 |
| 14416 | y Fr(*)150 1811 y Fe(*)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c CR |
14417 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 14418 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 28157acd CR |
14419 | b Fb(16)150 2046 y Fr(-)150 2163 y Fe(-)17 b Fc(.)12 |
| 14420 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14421 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14422 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)150 2399 y Fr(?)150 | |
| 14423 | 2516 y Fe(?)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14424 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
| 14425 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 14426 | b Fb(16)150 2751 y Fr(@)150 2868 y Fe(@)17 b Fc(.)12 | |
| 14427 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14428 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14429 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)p 159 3104 41 | |
| 14430 | 6 v 150 3221 a Fe(_)17 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14431 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
| 14432 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 14433 | b Fb(16)150 3456 y Fr(0)150 3573 y Fe(0)17 b Fc(.)12 | |
| 14434 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14435 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14436 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(16)150 3809 y Fr(A)150 | |
| 14437 | 3926 y Fe(auto_resume)23 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14438 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14439 | (.)f(.)g(.)h(.)f(.)46 b Fb(88)150 4171 y Fr(B)150 4288 | |
| 14440 | y Fe(BASH)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14441 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14442 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fb(57)150 4375 | |
| 14443 | y Fe(BASH_ARGC)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14444 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
| 14445 | h(.)f(.)g(.)h(.)f(.)49 b Fb(58)150 4463 y Fe(BASH_ARGV)25 | |
| 5e13499c CR |
14446 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14447 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 14448 | 49 b Fb(58)150 4551 y Fe(BASH_COMMAND)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.) |
| 5e13499c | 14449 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 14450 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 b Fb(58)150 4638 y |
| 5e13499c CR |
14451 | Fe(BASH_ENV)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14452 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 14453 | g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(58)150 4726 y Fe(BASH_EXECUTION_STRING) |
| 5e13499c | 14454 | d Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 14455 | (.)g(.)h(.)f(.)g(.)50 b Fb(58)150 4814 y Fe(BASH_LINENO)23 |
| 5e13499c CR |
14456 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14457 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 | |
| 28157acd | 14458 | b Fb(58)150 4901 y Fe(BASH_REMATCH)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h |
| 5e13499c | 14459 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd | 14460 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 b Fb(58)150 4989 y Fe(BASH_SOURCE)23 |
| 5e13499c CR |
14461 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14462 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 | |
| 28157acd | 14463 | b Fb(58)150 5077 y Fe(BASH_SUBSHELL)18 b Fc(.)d(.)d(.)h(.)f(.)g(.)g(.)h |
| 5e13499c | 14464 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd | 14465 | h(.)f(.)g(.)h(.)f(.)43 b Fb(58)150 5165 y Fe(BASH_VERSINFO)18 |
| 5e13499c CR |
14466 | b Fc(.)d(.)d(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14467 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 | |
| 28157acd | 14468 | b Fb(58)150 5252 y Fe(BASH_VERSION)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h |
| eb2bb562 | 14469 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd | 14470 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 b Fb(59)150 5340 y Fe(bell-style)24 |
| 9d6e5e30 | 14471 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5cfe250d | 14472 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 |
| 28157acd CR |
14473 | b Fb(93)2025 610 y Fe(bind-tty-special-chars)27 b Fc(.)13 |
| 14474 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14475 | (.)h(.)48 b Fb(93)2025 866 y Fr(C)2025 983 y Fe(CDPATH)10 | |
| 14476 | b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14477 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14478 | (.)f(.)g(.)h(.)35 b Fb(57)2025 1071 y Fe(COLUMNS)8 b | |
| 14479 | Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 5cfe250d | 14480 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd CR |
14481 | g(.)h(.)f(.)34 b Fb(59)2025 1159 y Fe(comment-begin)18 |
| 14482 | b Fc(.)d(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
| 14483 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 | |
| 14484 | b Fb(93)2025 1247 y Fe(COMP_CWORD)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.) | |
| 14485 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14486 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(59)2025 1335 | |
| 14487 | y Fe(COMP_LINE)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
| 5cfe250d | 14488 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd CR |
14489 | h(.)f(.)g(.)h(.)f(.)49 b Fb(59)2025 1423 y Fe(COMP_POINT)24 |
| 14490 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14491 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 | |
| 14492 | b Fb(59)2025 1510 y Fe(COMP_WORDBREAKS)15 b Fc(.)g(.)e(.)f(.)g(.)g(.)h | |
| 5cfe250d | 14493 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd CR |
14494 | h(.)f(.)g(.)h(.)40 b Fb(59)2025 1598 y Fe(COMP_WORDS)24 |
| 14495 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14496 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 | |
| 14497 | b Fb(59)2025 1686 y Fe(completion-query-items)27 b Fc(.)13 | |
| 14498 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14499 | (.)h(.)48 b Fb(93)2025 1774 y Fe(COMPREPLY)25 b Fc(.)13 | |
| 14500 | b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14501 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 | |
| 14502 | b Fb(60)2025 1862 y Fe(convert-meta)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g | |
| 9d6e5e30 | 14503 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14504 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 b Fb(94)2025 2099 y Fr(D)2025 |
| 14505 | 2216 y Fe(DIRSTACK)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14506 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14507 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(60)2025 2304 y | |
| 14508 | Fe(disable-completion)10 b Fc(.)17 b(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14509 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)36 | |
| 14510 | b Fb(94)2025 2559 y Fr(E)2025 2677 y Fe(editing-mode)22 | |
| 14511 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14512 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
| 14513 | b Fb(94)2025 2765 y Fe(EMACS)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14514 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14515 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 | |
| 14516 | b Fb(60)2025 2853 y Fe(enable-keypad)18 b Fc(.)d(.)d(.)g(.)h(.)f(.)g(.) | |
| 14517 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14518 | (.)g(.)h(.)f(.)g(.)h(.)43 b Fb(94)2025 2940 y Fe(EUID)13 | |
| 14519 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14520 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14521 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(60)2025 3028 y Fe(expand-tilde)22 | |
| 14522 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14523 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
| 14524 | b Fb(94)2025 3284 y Fr(F)2025 3401 y Fe(FCEDIT)10 b Fc(.)j(.)f(.)h(.)f | |
| 5e13499c | 14525 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
14526 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 |
| 14527 | b Fb(60)2025 3489 y Fe(FIGNORE)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.) | |
| 14528 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14529 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(60)2025 | |
| 14530 | 3577 y Fe(FUNCNAME)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14531 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14532 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(60)2025 3814 y | |
| 14533 | Fr(G)2025 3931 y Fe(GLOBIGNORE)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14534 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14535 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(60)2025 4019 | |
| 14536 | y Fe(GROUPS)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14537 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14538 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(60)2025 4256 y Fr(H)2025 | |
| 14539 | 4373 y Fe(histchars)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
| 14540 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14541 | g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(60)2025 4461 y Fe(HISTCMD)8 | |
| 5e13499c CR |
14542 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14543 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 28157acd | 14544 | g(.)h(.)f(.)34 b Fb(61)2025 4549 y Fe(HISTCONTROL)23 |
| 5e13499c CR |
14545 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 14546 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)46 | |
| 28157acd | 14547 | b Fb(61)2025 4637 y Fe(HISTFILE)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h |
| 5e13499c | 14548 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14549 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(61)2025 |
| 14550 | 4725 y Fe(HISTFILESIZE)22 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
| 5e13499c | 14551 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd | 14552 | g(.)h(.)f(.)g(.)45 b Fb(61)2025 4813 y Fe(HISTIGNORE)24 |
| 5e13499c CR |
14553 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14554 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 | |
| 28157acd | 14555 | b Fb(61)2025 4900 y Fe(history-preserve-point)27 b Fc(.)13 |
| 5e13499c | 14556 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 14557 | (.)h(.)48 b Fb(94)2025 4988 y Fe(HISTSIZE)7 b Fc(.)14 |
| 5e13499c CR |
14558 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f |
| 14559 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd | 14560 | 32 b Fb(61)2025 5076 y Fe(HISTTIMEFORMAT)16 b Fc(.)f(.)e(.)f(.)g(.)h(.) |
| 5e13499c | 14561 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14562 | (.)f(.)g(.)g(.)h(.)f(.)42 b Fb(61)2025 5164 y Fe(HOME)13 |
| 5cfe250d CR |
14563 | b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14564 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 28157acd | 14565 | (.)g(.)h(.)f(.)g(.)h(.)38 b Fb(57)2025 5252 y Fe |
| 5cfe250d | 14566 | (horizontal-scroll-mode)27 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
14567 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fb(94)2025 |
| 14568 | 5340 y Fe(HOSTFILE)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 5cfe250d | 14569 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
14570 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(62)p eop end |
| 14571 | %%Page: 150 156 | |
| 14572 | TeXDict begin 150 155 bop 150 -116 a Ft(150)2527 b(Bash)31 | |
| 14573 | b(Reference)g(Man)m(ual)150 299 y Fe(HOSTNAME)7 b Fc(.)14 | |
| 14574 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14575 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
| 14576 | 32 b Fb(62)150 387 y Fe(HOSTTYPE)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h | |
| 14577 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14578 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(62)150 | |
| 14579 | 627 y Fr(I)150 745 y Fe(IFS)14 b Fc(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14580 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14581 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 | |
| 14582 | b Fb(57)150 834 y Fe(IGNOREEOF)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14583 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14584 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(62)150 922 | |
| 14585 | y Fe(input-meta)24 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
| 14586 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14587 | h(.)f(.)g(.)h(.)47 b Fb(94)150 1011 y Fe(INPUTRC)8 b | |
| 14588 | Fc(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14589 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14590 | h(.)f(.)g(.)34 b Fb(62)150 1099 y Fe(isearch-terminators)9 | |
| 14591 | b Fc(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14592 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(94)150 1339 | |
| 14593 | y Fr(K)150 1457 y Fe(keymap)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14594 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14595 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(94)150 | |
| 14596 | 1715 y Fr(L)150 1834 y Fe(LANG)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14597 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
| 14598 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
| 14599 | b Fb(62)150 1922 y Fe(LC_ALL)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14600 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14601 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(62)150 | |
| 14602 | 2011 y Fe(LC_COLLATE)24 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
| 5cfe250d | 14603 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14604 | g(.)h(.)f(.)g(.)h(.)47 b Fb(62)150 2099 y Fe(LC_CTYPE)7 |
| 14605 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14606 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14607 | g(.)h(.)32 b Fb(62)150 2188 y Fe(LC_MESSAGES)14 b Fc(.)h(.)d(.)h(.)f(.) | |
| 14608 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
| 14609 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fb(7,)26 b(62)150 | |
| 14610 | 2276 y Fe(LC_NUMERIC)e Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
| 5cfe250d | 14611 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
14612 | (.)h(.)f(.)g(.)h(.)47 b Fb(62)150 2364 y Fe(LINENO)10 |
| 14613 | b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) | |
| 14614 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14615 | (.)g(.)h(.)f(.)35 b Fb(62)150 2453 y Fe(LINES)11 b Fc(.)j(.)e(.)g(.)g | |
| 5e13499c | 14616 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14617 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 |
| 14618 | b Fb(63)150 2692 y Fr(M)150 2811 y Fe(MACHTYPE)7 b Fc(.)14 | |
| 14619 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14620 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
| 14621 | 32 b Fb(63)150 2899 y Fe(MAIL)13 b Fc(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14622 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) | |
| 14623 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 | |
| 14624 | b Fb(57)150 2988 y Fe(MAILCHECK)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14625 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14626 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(63)150 3076 | |
| 14627 | y Fe(MAILPATH)7 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 5e13499c | 14628 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14629 | g(.)h(.)f(.)g(.)g(.)h(.)32 b Fb(57)150 3165 y Fe(mark-modified-lines)9 |
| 14630 | b Fc(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14631 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(95)150 3253 | |
| 14632 | y Fe(mark-symlinked-directories)17 b Fc(.)h(.)12 b(.)h(.)f(.)g(.)h(.)f | |
| 14633 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(95)150 3342 | |
| 14634 | y Fe(match-hidden-files)10 b Fc(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14635 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36 | |
| 14636 | b Fb(95)150 3430 y Fe(meta-flag)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
| 5e13499c | 14637 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd CR |
14638 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(94)150 3688 |
| 14639 | y Fr(O)150 3807 y Fe(OLDPWD)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14640 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14641 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(63)150 | |
| 14642 | 3895 y Fe(OPTARG)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14643 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14644 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(57)150 3984 | |
| 14645 | y Fe(OPTERR)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 5e13499c | 14646 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 14647 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fb(63)150 4072 y Fe(OPTIND)10 |
| 5e13499c CR |
14648 | b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) |
| 14649 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 14650 | (.)g(.)h(.)f(.)35 b Fb(57)150 4161 y Fe(OSTYPE)10 b Fc(.)j(.)g(.)f(.)g |
| 5e13499c | 14651 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5cfe250d | 14652 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 |
| 28157acd | 14653 | b Fb(63)2025 299 y Fe(output-meta)23 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.) |
| 5cfe250d | 14654 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd CR |
14655 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)46 b Fb(95)2025 551 y |
| 14656 | Fr(P)2025 667 y Fe(page-completions)13 b Fc(.)j(.)c(.)h(.)f(.)g(.)h(.)f | |
| 14657 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14658 | h(.)f(.)39 b Fb(95)2025 754 y Fe(PATH)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f | |
| 14659 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14660 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 14661 | b Fb(57)2025 842 y Fe(PIPESTATUS)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14662 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14663 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(63)2025 929 y | |
| 14664 | Fe(POSIXLY_CORRECT)15 b Fc(.)g(.)e(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14665 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
| 14666 | b Fb(63)2025 1016 y Fe(PPID)13 b Fc(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14667 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14668 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 14669 | b Fb(63)2025 1104 y Fe(PROMPT_COMMAND)16 b Fc(.)f(.)e(.)f(.)g(.)h(.)f | |
| 14670 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14671 | f(.)g(.)g(.)h(.)f(.)42 b Fb(63)2025 1191 y Fe(PS1)14 | |
| 14672 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14673 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14674 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(57)2025 1278 y Fe(PS2)14 | |
| 14675 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14676 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14677 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(57)2025 1365 y Fe(PS3)14 | |
| 14678 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14679 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14680 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(63)2025 1453 y Fe(PS4)14 | |
| 14681 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14682 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14683 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(63)2025 1540 y Fe(PWD)14 | |
| 14684 | b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14685 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14686 | (.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(63)2025 1773 y Fr(R)2025 | |
| 14687 | 1890 y Fe(RANDOM)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14688 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14689 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(63)2025 1977 | |
| 14690 | y Fe(REPLY)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14691 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14692 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(63)2025 2210 | |
| 14693 | y Fr(S)2025 2326 y Fe(SECONDS)8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14694 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14695 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fb(64)2025 | |
| 14696 | 2414 y Fe(SHELL)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 9f422431 | 14697 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd | 14698 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(64)2025 2501 |
| 9f422431 CR |
14699 | y Fe(SHELLOPTS)25 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h |
| 14700 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 28157acd | 14701 | h(.)f(.)g(.)h(.)f(.)49 b Fb(64)2025 2588 y Fe(SHLVL)11 |
| 5e13499c CR |
14702 | b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.) |
| 14703 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 14704 | (.)g(.)h(.)f(.)g(.)37 b Fb(64)2025 2675 y Fe(show-all-if-ambiguous)29 |
| 5e13499c | 14705 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 14706 | (.)g(.)g(.)h(.)f(.)50 b Fb(95)2025 2763 y Fe(show-all-if-unmodified)27 |
| 5e13499c | 14707 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14708 | (.)f(.)g(.)h(.)48 b Fb(95)2025 2996 y Fr(T)2025 3112 |
| 5e13499c CR |
14709 | y Fe(TEXTDOMAIN)25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14710 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 14711 | g(.)h(.)f(.)g(.)h(.)49 b Fb(7)2025 3200 y Fe(TEXTDOMAINDIR)21 |
| 5e13499c CR |
14712 | b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 14713 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 | |
| 28157acd | 14714 | b Fb(7)2025 3287 y Fe(TIMEFORMAT)24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 14715 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 14716 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(64)2025 3374 |
| 5e13499c CR |
14717 | y Fe(TMOUT)11 b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 14718 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd | 14719 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(64)2025 3461 |
| 1c72c0cd CR |
14720 | y Fe(TMPDIR)10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 14721 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 28157acd CR |
14722 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fb(65)2025 3695 y Fr(U)2025 |
| 14723 | 3811 y Fe(UID)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 1c72c0cd | 14724 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
14725 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fb(65)2025 |
| 14726 | 4044 y Fr(V)2025 4160 y Fe(visible-stats)18 b Fc(.)d(.)d(.)g(.)h(.)f(.) | |
| 1c72c0cd | 14727 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd CR |
14728 | (.)f(.)g(.)h(.)f(.)g(.)h(.)43 b Fb(96)p eop end |
| 14729 | %%Page: 151 157 | |
| 14730 | TeXDict begin 151 156 bop 150 -116 a Ft(F)-8 b(unction)31 | |
| 14731 | b(Index)2861 b(151)150 299 y Fo(F)-13 b(unction)52 b(Index)150 | |
| 14732 | 610 y Fr(A)150 749 y Fe(abort)27 b(\(C-g\))8 b Fc(.)13 | |
| 14733 | b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
| 14734 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 | |
| 14735 | b Fb(107)150 848 y Fe(accept-line)28 b(\(Newline)g(or)e(Return\))11 | |
| 14736 | b Fc(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)37 b Fb(101)150 | |
| 14737 | 946 y Fe(alias-expand-line)29 b(\(\))13 b Fc(.)g(.)g(.)f(.)g(.)h(.)f(.) | |
| 14738 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 | |
| 14739 | b Fb(109)150 1257 y Fr(B)150 1397 y Fe(backward-char)29 | |
| 14740 | b(\(C-b\))15 b Fc(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14741 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)41 b Fb(101)150 | |
| 14742 | 1495 y Fe(backward-delete-char)30 b(\(Rubout\))18 b Fc(.)d(.)d(.)g(.)h | |
| 14743 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)44 b Fb(103)150 1594 y | |
| 14744 | Fe(backward-kill-line)30 b(\(C-x)c(Rubout\))e Fc(.)12 | |
| 14745 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 b Fb(104)150 1692 | |
| 14746 | y Fe(backward-kill-word)30 b(\(M-)999 1689 y Fg(h)p 1024 | |
| 14747 | 1636 146 4 v 1024 1692 a Ff(DEL)p 1024 1708 V 1165 1689 | |
| 14748 | a Fg(i)1195 1692 y Fe(\))20 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14749 | (.)h(.)f(.)g(.)46 b Fb(104)150 1791 y Fe(backward-word)29 | |
| ac18b312 | 14750 | b(\(M-b\))15 b Fc(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd CR |
14751 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)41 b Fb(101)150 |
| 14752 | 1889 y Fe(beginning-of-history)30 b(\(M-<\))24 b Fc(.)12 | |
| 9d2b70f0 | 14753 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)49 |
| 28157acd | 14754 | b Fb(102)150 1988 y Fe(beginning-of-line)29 b(\(C-a\))9 |
| ac18b312 | 14755 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14756 | (.)f(.)g(.)35 b Fb(101)150 2299 y Fr(C)150 2438 y Fe |
| 8a9c66f6 | 14757 | (call-last-kbd-macro)30 b(\(C-x)c(e\))10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h |
| 28157acd | 14758 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36 b Fb(107)150 2537 |
| 9d2b70f0 CR |
14759 | y Fe(capitalize-word)29 b(\(M-c\))12 b Fc(.)h(.)g(.)f(.)g(.)h(.)f(.)g |
| 14760 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 | |
| 28157acd | 14761 | b Fb(103)150 2635 y Fe(character-search)29 b(\(C-]\))10 |
| 8a9c66f6 | 14762 | b Fc(.)k(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd | 14763 | g(.)g(.)h(.)36 b Fb(107)150 2734 y Fe(character-search-backward)31 |
| 8a9c66f6 | 14764 | b(\(M-C-]\))12 b Fc(.)j(.)d(.)g(.)h(.)f(.)g(.)h(.)38 |
| 28157acd | 14765 | b Fb(107)150 2832 y Fe(clear-screen)28 b(\(C-l\))16 b |
| ac18b312 | 14766 | Fc(.)e(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd CR |
14767 | (.)g(.)h(.)f(.)g(.)h(.)f(.)42 b Fb(101)150 2931 y Fe(complete)27 |
| 14768 | b(\()528 2928 y Fg(h)p 553 2875 148 4 v 553 2931 a Ff(T)-6 | |
| 14769 | b(AB)p 553 2946 V 697 2928 a Fg(i)726 2931 y Fe(\))18 | |
| ac18b312 | 14770 | b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd CR |
14771 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 b Fb(105)150 |
| 14772 | 3029 y Fe(complete-command)29 b(\(M-!\))10 b Fc(.)k(.)e(.)h(.)f(.)g(.)h | |
| ac18b312 | 14773 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)36 |
| 28157acd CR |
14774 | b Fb(106)150 3128 y Fe(complete-filename)29 b(\(M-/\))9 |
| 14775 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14776 | (.)f(.)g(.)35 b Fb(106)150 3226 y Fe(complete-hostname)29 | |
| 14777 | b(\(M-@\))9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14778 | (.)f(.)g(.)h(.)f(.)g(.)35 b Fb(106)150 3325 y Fe(complete-into-braces) | |
| 14779 | 30 b(\(M-{\))24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
| 14780 | (.)f(.)g(.)49 b Fb(106)150 3423 y Fe(complete-username)29 | |
| 14781 | b(\(M-~\))9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14782 | (.)f(.)g(.)h(.)f(.)g(.)35 b Fb(106)150 3522 y Fe(complete-variable)29 | |
| 14783 | b(\(M-$\))9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14784 | (.)f(.)g(.)h(.)f(.)g(.)35 b Fb(106)150 3620 y Fe(copy-backward-word)30 | |
| 14785 | b(\(\))12 b Fc(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14786 | (.)h(.)f(.)g(.)h(.)f(.)g(.)38 b Fb(104)150 3719 y Fe(copy-forward-word) | |
| 14787 | 29 b(\(\))13 b Fc(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14788 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 b Fb(104)150 3817 | |
| 14789 | y Fe(copy-region-as-kill)30 b(\(\))10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f | |
| 14790 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)36 | |
| 14791 | b Fb(104)150 4128 y Fr(D)150 4268 y Fe(delete-char)28 | |
| 14792 | b(\(C-d\))18 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14793 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b | |
| 14794 | Fb(103)150 4366 y Fe(delete-char-or-list)30 b(\(\))10 | |
| 14795 | b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14796 | g(.)g(.)h(.)36 b Fb(106)150 4465 y Fe(delete-horizontal-space)31 | |
| 14797 | b(\(\))23 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
| 14798 | (.)g(.)49 b Fb(104)150 4563 y Fe(digit-argument)29 b(\()p | |
| 14799 | Fd(M-0)p Fe(,)e Fd(M-1)p Fe(,)f(...)g Fd(M--)p Fe(\))13 | |
| 14800 | b Fc(.)h(.)e(.)h(.)f(.)g(.)g(.)h(.)39 b Fb(105)150 4662 | |
| 8a9c66f6 | 14801 | y Fe(display-shell-version)30 b(\(C-x)d(C-v\))c Fc(.)12 |
| 28157acd CR |
14802 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 b Fb(108)150 4760 |
| 14803 | y Fe(do-uppercase-version)30 b(\(M-a,)d(M-b,)f(M-)p Fd(x)p | |
| 14804 | Fe(,)h(...)q(\))317 4847 y Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14805 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
| 14806 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 b Fb(107)150 | |
| 14807 | 4946 y Fe(downcase-word)29 b(\(M-l\))15 b Fc(.)e(.)f(.)g(.)h(.)f(.)g(.) | |
| 14808 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)41 | |
| 14809 | b Fb(103)150 5044 y Fe(dump-functions)29 b(\(\))18 b | |
| 14810 | Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14811 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b Fb(108)150 5143 | |
| 14812 | y Fe(dump-macros)28 b(\(\))22 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 9d2b70f0 | 14813 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
14814 | f(.)g(.)48 b Fb(108)150 5241 y Fe(dump-variables)29 b(\(\))18 |
| 14815 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14816 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b Fb(108)150 5340 | |
| 14817 | y Fe(dynamic-complete-history)31 b(\(M-)1234 5337 y Fg(h)p | |
| 14818 | 1259 5284 V 1259 5340 a Ff(T)-6 b(AB)p 1259 5355 V 1403 | |
| 14819 | 5337 a Fg(i)1432 5340 y Fe(\))10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)36 | |
| 14820 | b Fb(106)2025 610 y Fr(E)2025 730 y Fe(edit-and-execute-command)31 | |
| 14821 | b(\(C-xC-e\))12 b Fc(.)i(.)f(.)f(.)g(.)h(.)f(.)g(.)39 | |
| 14822 | b Fb(109)2025 819 y Fe(end-kbd-macro)28 b(\(C-x)f(\)\))19 | |
| 14823 | b Fc(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14824 | (.)g(.)h(.)f(.)g(.)45 b Fb(107)2025 909 y Fe(end-of-history)29 | |
| 14825 | b(\(M->\))13 b Fc(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14826 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(102)2025 998 | |
| 5cfe250d | 14827 | y Fe(end-of-line)28 b(\(C-e\))18 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14828 | g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 |
| 14829 | b Fb(101)2025 1087 y Fe(exchange-point-and-mark)31 b(\(C-x)26 | |
| 14830 | b(C-x\))20 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b | |
| 14831 | Fb(107)2025 1349 y Fr(F)2025 1469 y Fe(forward-backward-delete-char)32 | |
| 14832 | b(\(\))15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)42 | |
| 14833 | b Fb(103)2025 1558 y Fe(forward-char)28 b(\(C-f\))16 | |
| 14834 | b Fc(.)e(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14835 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(101)2025 1647 y Fe | |
| 14836 | (forward-search-history)30 b(\(C-s\))21 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g | |
| 14837 | (.)h(.)f(.)g(.)g(.)h(.)f(.)46 b Fb(102)2025 1736 y Fe(forward-word)28 | |
| 14838 | b(\(M-f\))16 b Fc(.)e(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14839 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(101)2025 | |
| 14840 | 1988 y Fr(G)2025 2108 y Fe(glob-complete-word)29 b(\(M-g\))7 | |
| 14841 | b Fc(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14842 | (.)g(.)34 b Fb(108)2025 2197 y Fe(glob-expand-word)29 | |
| 14843 | b(\(C-x)e(*\))14 b Fc(.)f(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14844 | (.)g(.)h(.)f(.)g(.)h(.)40 b Fb(108)2025 2286 y Fe(glob-list-expansions) | |
| 14845 | 30 b(\(C-x)c(g\))8 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14846 | (.)g(.)g(.)35 b Fb(108)2025 2548 y Fr(H)2025 2668 y Fe | |
| 14847 | (history-and-alias-expand-line)d(\(\))14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g | |
| 14848 | (.)h(.)f(.)40 b Fb(109)2025 2757 y Fe(history-expand-line)30 | |
| 14849 | b(\(M-^\))25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) | |
| 14850 | f(.)g(.)h(.)50 b Fb(108)2025 2846 y Fe(history-search-backward)31 | |
| 14851 | b(\(\))23 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14852 | (.)g(.)49 b Fb(102)2025 2935 y Fe(history-search-forward)30 | |
| 14853 | b(\(\))25 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
| 14854 | (.)g(.)h(.)50 b Fb(102)2025 3197 y Fr(I)2025 3317 y Fe(insert-comment) | |
| 14855 | 29 b(\(M-#\))13 b Fc(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
| 14856 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(108)2025 | |
| 14857 | 3406 y Fe(insert-completions)29 b(\(M-*\))7 b Fc(.)14 | |
| 14858 | b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)34 | |
| 14859 | b Fb(105)2025 3495 y Fe(insert-last-argument)c(\(M-.)c(or)g(M-_\))8 | |
| 14860 | b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(109)2025 | |
| 14861 | 3757 y Fr(K)2025 3877 y Fe(kill-line)27 b(\(C-k\))22 | |
| 14862 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14863 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)47 b Fb(104)2025 | |
| 14864 | 3966 y Fe(kill-region)28 b(\(\))22 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h | |
| 9d2b70f0 | 14865 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
14866 | g(.)h(.)f(.)48 b Fb(104)2025 4056 y Fe(kill-whole-line)29 |
| 14867 | b(\(\))16 b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14868 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(104)2025 | |
| 14869 | 4145 y Fe(kill-word)27 b(\(M-d\))22 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
| 9d2b70f0 | 14870 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
14871 | f(.)g(.)47 b Fb(104)2025 4396 y Fr(M)2025 4516 y Fe(magic-space)28 |
| 14872 | b(\(\))22 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
| 9d2b70f0 | 14873 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 |
| 28157acd CR |
14874 | b Fb(109)2025 4605 y Fe(menu-complete)28 b(\(\))20 b |
| 14875 | Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14876 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fb(105)2025 | |
| 14877 | 4867 y Fr(N)2025 4987 y Fe(next-history)28 b(\(C-n\))16 | |
| 14878 | b Fc(.)e(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14879 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(102)2025 5076 y Fe | |
| 14880 | (non-incremental-forward-search)q(-hist)q(ory)32 b(\(M-n\))2191 | |
| 14881 | 5164 y Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14882 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
| 14883 | (.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(102)2025 5253 y Fe | |
| 14884 | (non-incremental-reverse-search)q(-hist)q(ory)32 b(\(M-p\))2191 | |
| 14885 | 5340 y Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14886 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
| 14887 | (.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(102)p eop end | |
| 14888 | %%Page: 152 158 | |
| 14889 | TeXDict begin 152 157 bop 150 -116 a Ft(152)2527 b(Bash)31 | |
| 14890 | b(Reference)g(Man)m(ual)150 299 y Fr(O)150 425 y Fe | |
| 14891 | (operate-and-get-next)f(\(C-o\))24 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14892 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)49 b Fb(109)150 518 y | |
| 14893 | Fe(overwrite-mode)29 b(\(\))18 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14894 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 | |
| 14895 | b Fb(103)150 786 y Fr(P)150 913 y Fe(possible-command-completions)32 | |
| 14896 | b(\(C-x)26 b(!\))15 b Fc(.)e(.)g(.)f(.)g(.)41 b Fb(106)150 | |
| 14897 | 1005 y Fe(possible-completions)30 b(\(M-?\))24 b Fc(.)12 | |
| 14898 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)49 | |
| 14899 | b Fb(105)150 1097 y Fe(possible-filename-completions)32 | |
| 14900 | b(\(C-x)27 b(/\))14 b Fc(.)e(.)g(.)h(.)39 b Fb(106)150 | |
| 14901 | 1190 y Fe(possible-hostname-completions)32 b(\(C-x)27 | |
| 14902 | b(@\))14 b Fc(.)e(.)g(.)h(.)39 b Fb(106)150 1282 y Fe | |
| 14903 | (possible-username-completions)32 b(\(C-x)27 b(~\))14 | |
| 14904 | b Fc(.)e(.)g(.)h(.)39 b Fb(106)150 1374 y Fe | |
| 14905 | (possible-variable-completions)32 b(\(C-x)27 b($\))14 | |
| 14906 | b Fc(.)e(.)g(.)h(.)39 b Fb(106)150 1467 y Fe(prefix-meta)28 | |
| 14907 | b(\()646 1464 y Fg(h)p 671 1411 139 4 v 671 1467 a Ff(ESC)p | |
| 14908 | 671 1482 V 804 1464 a Fg(i)834 1467 y Fe(\))19 b Fc(.)13 | |
| 14909 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14910 | (.)g(.)h(.)f(.)g(.)45 b Fb(107)150 1559 y Fe(previous-history)29 | |
| 14911 | b(\(C-p\))10 b Fc(.)k(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14912 | (.)g(.)h(.)f(.)g(.)g(.)h(.)36 b Fb(102)150 1838 y Fr(Q)150 | |
| 14913 | 1964 y Fe(quoted-insert)29 b(\(C-q)d(or)g(C-v\))18 b | |
| 14914 | Fc(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 | |
| 14915 | b Fb(103)150 2243 y Fr(R)150 2369 y Fe(re-read-init-file)29 | |
| 14916 | b(\(C-x)e(C-r\))10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 14917 | (.)f(.)g(.)36 b Fb(107)150 2462 y Fe(redraw-current-line)30 | |
| 14918 | b(\(\))10 b Fc(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14919 | (.)h(.)f(.)g(.)g(.)h(.)36 b Fb(101)150 2554 y Fe | |
| 14920 | (reverse-search-history)31 b(\(C-r\))20 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g | |
| 14921 | (.)h(.)f(.)g(.)h(.)f(.)g(.)46 b Fb(102)150 2646 y Fe(revert-line)28 | |
| 14922 | b(\(M-r\))18 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 14923 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b | |
| 14924 | Fb(107)2025 299 y Fr(S)2025 415 y Fe(self-insert)28 b(\(a,)e(b,)g(A,)g | |
| 14925 | (1,)g(!,)g(...)q(\))12 b Fc(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 14926 | 38 b Fb(103)2025 503 y Fe(set-mark)27 b(\(C-@\))c Fc(.)13 | |
| 14927 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14928 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 b Fb(107)2025 | |
| 14929 | 590 y Fe(shell-expand-line)29 b(\(M-C-e\))d Fc(.)12 b(.)h(.)f(.)g(.)h | |
| 14930 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)50 b Fb(108)2025 | |
| 14931 | 677 y Fe(start-kbd-macro)29 b(\(C-x)d(\(\))16 b Fc(.)d(.)f(.)g(.)h(.)f | |
| 14932 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 | |
| 14933 | b Fb(106)2025 919 y Fr(T)2025 1036 y Fe(tilde-expand)28 | |
| 5e13499c | 14934 | b(\(M-&\))16 b Fc(.)e(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd CR |
14935 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(107)2025 |
| 14936 | 1123 y Fe(transpose-chars)29 b(\(C-t\))12 b Fc(.)h(.)f(.)h(.)f(.)g(.)h | |
| 9d2b70f0 | 14937 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)38 |
| 28157acd | 14938 | b Fb(103)2025 1210 y Fe(transpose-words)29 b(\(M-t\))12 |
| 9d2b70f0 | 14939 | b Fc(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd | 14940 | g(.)g(.)h(.)f(.)38 b Fb(103)2025 1463 y Fr(U)2025 1579 |
| 9d2b70f0 CR |
14941 | y Fe(undo)26 b(\(C-_)h(or)f(C-x)g(C-u\))14 b Fc(.)f(.)g(.)f(.)g(.)h(.)f |
| 14942 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 | |
| 28157acd | 14943 | b Fb(107)2025 1666 y Fe(universal-argument)29 b(\(\))12 |
| 8a9c66f6 | 14944 | b Fc(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd | 14945 | g(.)g(.)h(.)f(.)38 b Fb(105)2025 1754 y Fe(unix-filename-rubout)30 |
| 8a9c66f6 | 14946 | b(\(\))9 b Fc(.)k(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14947 | (.)f(.)g(.)h(.)f(.)35 b Fb(104)2025 1841 y Fe(unix-line-discard)29 |
| 8a9c66f6 | 14948 | b(\(C-u\))9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 14949 | (.)h(.)f(.)g(.)h(.)f(.)35 b Fb(104)2025 1928 y Fe(unix-word-rubout)29 |
| 8a9c66f6 | 14950 | b(\(C-w\))10 b Fc(.)k(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14951 | (.)f(.)g(.)h(.)f(.)g(.)h(.)36 b Fb(104)2025 2016 y Fe(upcase-word)28 |
| 9d2b70f0 CR |
14952 | b(\(M-u\))18 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) |
| 14953 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 b | |
| 28157acd | 14954 | Fb(103)2025 2268 y Fr(Y)2025 2384 y Fe(yank)26 b(\(C-y\))10 |
| 8a9c66f6 CR |
14955 | b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 14956 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36 | |
| 28157acd | 14957 | b Fb(105)2025 2472 y Fe(yank-last-arg)28 b(\(M-.)f(or)f(M-_\))18 |
| 9d2b70f0 | 14958 | b Fc(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 14959 | 44 b Fb(102)2025 2559 y Fe(yank-nth-arg)28 b(\(M-C-y\))13 |
| 9d2b70f0 | 14960 | b Fc(.)h(.)f(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd | 14961 | g(.)h(.)f(.)g(.)h(.)39 b Fb(102)2025 2646 y Fe(yank-pop)27 |
| 8a9c66f6 CR |
14962 | b(\(M-y\))c Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 14963 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 | |
| 28157acd | 14964 | b Fb(105)p eop end |
| 5cfe250d | 14965 | %%Page: 153 159 |
| 28157acd CR |
14966 | TeXDict begin 153 158 bop 150 -116 a Ft(Concept)31 b(Index)2882 |
| 14967 | b(153)150 299 y Fo(Concept)52 b(Index)150 638 y Fr(A)150 | |
| 14968 | 754 y Fb(alias)27 b(expansion)20 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14969 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14970 | (.)g(.)h(.)f(.)g(.)45 b Fb(75)150 841 y(arithmetic)26 | |
| 14971 | b(ev)l(aluation)f Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 14972 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fb(74)150 | |
| 14973 | 929 y(arithmetic)26 b(expansion)12 b Fc(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
| 14974 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 | |
| 14975 | b Fb(22)150 1016 y(arithmetic,)27 b(shell)20 b Fc(.)12 | |
| 14976 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
| 14977 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fb(74)150 | |
| 14978 | 1103 y(arra)n(ys)6 b Fc(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
| 14979 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 14980 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)32 b Fb(76)150 | |
| 14981 | 1353 y Fr(B)150 1469 y Fb(bac)n(kground)23 b Fc(.)13 | |
| 14982 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
| 14983 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49 | |
| 14984 | b Fb(85)150 1556 y(Bash)26 b(con\014guration)11 b Fc(.)i(.)f(.)g(.)h(.) | |
| 5e13499c | 14985 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14986 | (.)f(.)g(.)h(.)36 b Fb(121)150 1643 y(Bash)26 b(installation)6 |
| 5e13499c | 14987 | b Fc(.)15 b(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g |
| 28157acd CR |
14988 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32 b Fb(121)150 |
| 14989 | 1730 y(Bourne)26 b(shell)10 b Fc(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 5e13499c | 14990 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 14991 | (.)f(.)g(.)h(.)f(.)g(.)h(.)36 b Fb(5)150 1818 y(brace)26 |
| 5e13499c CR |
14992 | b(expansion)d Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 14993 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)48 | |
| 28157acd | 14994 | b Fb(17)150 1905 y(builtin)17 b Fc(.)c(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c CR |
14995 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 14996 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b | |
| 28157acd | 14997 | Fb(3)150 2138 y Fr(C)150 2254 y Fb(command)26 b(editing)19 |
| 5e13499c | 14998 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
14999 | (.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fb(89)150 |
| 15000 | 2341 y(command)26 b(execution)11 b Fc(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 5e13499c | 15001 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd | 15002 | 37 b Fb(29)150 2428 y(command)26 b(expansion)d Fc(.)12 |
| 5e13499c | 15003 | b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 15004 | (.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fb(28)150 2515 y(command)26 |
| 5e13499c CR |
15005 | b(history)16 b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 15006 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 | |
| 28157acd | 15007 | b Fb(115)150 2603 y(command)26 b(searc)n(h)12 b Fc(.)h(.)f(.)g(.)h(.)f |
| 5e13499c | 15008 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 15009 | f(.)g(.)h(.)f(.)g(.)g(.)38 b Fb(29)150 2690 y(command)26 |
| 37c41ab1 | 15010 | b(substitution)e Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 5e13499c | 15011 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49 b Fb(21)150 |
| 28157acd | 15012 | 2777 y(command)26 b(timing)8 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 37c41ab1 | 15013 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 15014 | (.)g(.)h(.)f(.)34 b Fb(8)150 2864 y(commands,)26 b(comp)r(ound)8 |
| 37c41ab1 | 15015 | b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 15016 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(9)150 2952 |
| 37c41ab1 CR |
15017 | y(commands,)26 b(conditional)13 b Fc(.)h(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 15018 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)39 | |
| 28157acd | 15019 | b Fb(10)150 3039 y(commands,)26 b(grouping)15 b Fc(.)f(.)e(.)g(.)h(.)f |
| 37c41ab1 | 15020 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.) |
| 28157acd | 15021 | h(.)f(.)41 b Fb(13)150 3126 y(commands,)26 b(lists)6 |
| 37c41ab1 CR |
15022 | b Fc(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15023 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 | |
| 28157acd | 15024 | b Fb(9)150 3213 y(commands,)26 b(lo)r(oping)f Fc(.)12 |
| 37c41ab1 | 15025 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 28157acd | 15026 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(9)150 3300 |
| 37c41ab1 CR |
15027 | y(commands,)26 b(pip)r(elines)17 b Fc(.)d(.)e(.)g(.)h(.)f(.)g(.)h(.)f |
| 15028 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 28157acd | 15029 | 43 b Fb(8)150 3388 y(commands,)26 b(shell)16 b Fc(.)e(.)e(.)g(.)h(.)f |
| 37c41ab1 | 15030 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 15031 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)42 b Fb(8)150 3475 y(commands,)26 |
| 37c41ab1 CR |
15032 | b(simple)c Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 15033 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)47 | |
| 28157acd | 15034 | b Fb(8)150 3562 y(commen)n(ts,)26 b(shell)8 b Fc(.)13 |
| 37c41ab1 CR |
15035 | b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 15036 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 | |
| 28157acd | 15037 | b Fb(7)150 3649 y(completion)27 b(builtins)22 b Fc(.)12 |
| 5e13499c | 15038 | b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 15039 | (.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fb(111)150 3736 y(con\014guration)15 |
| 5e13499c CR |
15040 | b Fc(.)e(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 15041 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 | |
| 28157acd | 15042 | b Fb(121)150 3824 y(con)n(trol)26 b(op)r(erator)c Fc(.)12 |
| 5e13499c CR |
15043 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h |
| 15044 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)47 b Fb(3)150 | |
| 28157acd | 15045 | 4073 y Fr(D)150 4189 y Fb(directory)26 b(stac)n(k)e Fc(.)12 |
| 5e13499c | 15046 | b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
15047 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(77)150 |
| 15048 | 4439 y Fr(E)150 4555 y Fb(editing)26 b(command)g(lines)d | |
| 5e13499c | 15049 | Fc(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 15050 | (.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(89)150 4642 y(en)n(vironmen)n(t)10 |
| 37c41ab1 | 15051 | b Fc(.)i(.)g(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 5e13499c | 15052 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 |
| 28157acd | 15053 | b Fb(30)150 4729 y(ev)l(aluation,)26 b(arithmetic)13 |
| 37c41ab1 | 15054 | b Fc(.)h(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| 28157acd | 15055 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 b Fb(74)150 4817 y(ev)n(en)n(t)25 |
| 5e13499c CR |
15056 | b(designators)18 b Fc(.)c(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15057 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 | |
| 28157acd | 15058 | b Fb(117)150 4904 y(execution)26 b(en)n(vironmen)n(t)19 |
| 5e13499c | 15059 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 15060 | (.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fb(29)150 4991 y(exit)25 |
| 5e13499c CR |
15061 | b(status)17 b Fc(.)c(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 15062 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 15063 | (.)43 b Fb(3,)26 b(31)150 5078 y(expansion)16 b Fc(.)d(.)f(.)g(.)h(.)f |
| 5e13499c CR |
15064 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 15065 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 b | |
| 28157acd | 15066 | Fb(17)150 5166 y(expansion,)26 b(arithmetic)20 b Fc(.)13 |
| 5e13499c | 15067 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 15068 | (.)h(.)f(.)g(.)h(.)f(.)45 b Fb(22)150 5253 y(expansion,)26 |
| 5e13499c CR |
15069 | b(brace)12 b Fc(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15070 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)38 | |
| 28157acd CR |
15071 | b Fb(17)150 5340 y(expansion,)26 b(\014lename)18 b Fc(.)12 |
| 15072 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 15073 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fb(23)2025 638 y(expansion,)26 | |
| 37c41ab1 | 15074 | b(parameter)c Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| eb2bb562 | 15075 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(19)2025 |
| 28157acd | 15076 | 729 y(expansion,)26 b(pathname)8 b Fc(.)k(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 5e13499c | 15077 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 |
| 28157acd | 15078 | b Fb(23)2025 819 y(expansion,)26 b(tilde)9 b Fc(.)j(.)h(.)f(.)g(.)h(.)f |
| 5e13499c | 15079 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) |
| 28157acd | 15080 | h(.)f(.)g(.)h(.)f(.)g(.)35 b Fb(18)2025 910 y(expressions,)27 |
| 37c41ab1 | 15081 | b(arithmetic)16 b Fc(.)d(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
15082 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 b Fb(74)2025 |
| 15083 | 1000 y(expressions,)27 b(conditional)22 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c | 15084 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)47 |
| 28157acd | 15085 | b Fb(73)2025 1267 y Fr(F)2025 1390 y Fb(FDL,)25 b(GNU)g(F)-6 |
| 37c41ab1 | 15086 | b(ree)26 b(Do)r(cumen)n(tation)g(License)10 b Fc(.)j(.)g(.)f(.)g(.)h(.) |
| 28157acd | 15087 | 36 b Fb(137)2025 1480 y(\014eld)21 b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g |
| 5e13499c CR |
15088 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 15089 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)48 | |
| 28157acd | 15090 | b Fb(3)2025 1571 y(\014lename)8 b Fc(.)k(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 5e13499c CR |
15091 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15092 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fb(3)2025 | |
| 28157acd | 15093 | 1661 y(\014lename)26 b(expansion)10 b Fc(.)i(.)h(.)f(.)g(.)g(.)h(.)f(.) |
| 5e13499c | 15094 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 15095 | (.)g(.)36 b Fb(23)2025 1752 y(foreground)20 b Fc(.)12 |
| 5e13499c CR |
15096 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15097 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)45 | |
| 28157acd | 15098 | b Fb(85)2025 1842 y(functions,)26 b(shell)c Fc(.)13 b(.)f(.)g(.)h(.)f |
| 5e13499c | 15099 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
15100 | f(.)g(.)g(.)h(.)f(.)g(.)h(.)47 b Fb(14)2025 2109 y Fr(H)2025 |
| 15101 | 2232 y Fb(history)25 b(builtins)16 b Fc(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g | |
| 5e13499c | 15102 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.) |
| 28157acd | 15103 | f(.)g(.)h(.)42 b Fb(115)2025 2322 y(history)25 b(ev)n(en)n(ts)20 |
| 5e13499c CR |
15104 | b Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15105 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
| 28157acd | 15106 | b Fb(117)2025 2413 y(history)25 b(expansion)13 b Fc(.)g(.)f(.)h(.)f(.)g |
| 5e13499c | 15107 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 15108 | f(.)g(.)h(.)f(.)39 b Fb(117)2025 2503 y(history)25 b(list)18 |
| 5e13499c CR |
15109 | b Fc(.)c(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 15110 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 | |
| 28157acd | 15111 | b Fb(115)2025 2594 y(History)-6 b(,)25 b(ho)n(w)h(to)g(use)20 |
| 5e13499c | 15112 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd CR |
15113 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)46 b Fb(114)2025 2861 |
| 15114 | y Fr(I)2025 2984 y Fb(iden)n(ti\014er)16 b Fc(.)c(.)g(.)h(.)f(.)g(.)h | |
| 5e13499c CR |
15115 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 15116 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)43 | |
| 28157acd | 15117 | b Fb(3)2025 3074 y(initialization)28 b(\014le,)e(readline)7 |
| 5e13499c | 15118 | b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 15119 | (.)g(.)h(.)f(.)g(.)33 b Fb(92)2025 3165 y(installation)11 |
| 5e13499c CR |
15120 | b Fc(.)j(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| 15121 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)37 | |
| 28157acd | 15122 | b Fb(121)2025 3255 y(in)n(teraction,)26 b(readline)9 |
| 5e13499c | 15123 | b Fc(.)14 b(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd CR |
15124 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)35 b Fb(89)2025 |
| 15125 | 3346 y(in)n(teractiv)n(e)26 b(shell)20 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c | 15126 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd | 15127 | h(.)f(.)45 b Fb(69,)27 b(71)2025 3436 y(in)n(ternationalization)21 |
| 5e13499c CR |
15128 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 15129 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fb(7)2025 | |
| 28157acd | 15130 | 3686 y Fr(J)2025 3809 y Fb(job)22 b Fc(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f |
| 5e13499c CR |
15131 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 15132 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)48 | |
| 28157acd | 15133 | b Fb(3)2025 3900 y(job)26 b(con)n(trol)12 b Fc(.)h(.)f(.)h(.)f(.)g(.)h |
| 5e13499c | 15134 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 28157acd CR |
15135 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(3,)26 b(85)2025 |
| 15136 | 4166 y Fr(K)2025 4289 y Fb(kill)g(ring)14 b Fc(.)f(.)f(.)g(.)h(.)f(.)g | |
| 5e13499c CR |
15137 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 15138 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)40 | |
| 28157acd | 15139 | b Fb(91)2025 4380 y(killing)26 b(text)16 b Fc(.)c(.)h(.)f(.)g(.)h(.)f |
| 5e13499c | 15140 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd CR |
15141 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)42 b Fb(91)2025 |
| 15142 | 4647 y Fr(L)2025 4769 y Fb(lo)r(calization)10 b Fc(.)15 | |
| 5e13499c CR |
15143 | b(.)d(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g |
| 15144 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)36 | |
| 28157acd | 15145 | b Fb(7)2025 4860 y(login)26 b(shell)13 b Fc(.)h(.)e(.)g(.)h(.)f(.)g(.)h |
| 5e13499c | 15146 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 28157acd CR |
15147 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)39 b Fb(69)2025 |
| 15148 | 5127 y Fr(M)2025 5249 y Fb(matc)n(hing,)26 b(pattern)7 | |
| 5e13499c | 15149 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h |
| 28157acd | 15150 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33 b Fb(23)2025 |
| 37c41ab1 | 15151 | 5340 y(metac)n(haracter)17 b Fc(.)d(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 5e13499c | 15152 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 37c41ab1 | 15153 | g(.)h(.)f(.)g(.)44 b Fb(3)p eop end |
| 5cfe250d CR |
15154 | %%Page: 154 160 |
| 15155 | TeXDict begin 154 159 bop 150 -116 a Ft(154)2527 b(Bash)31 | |
| 37c41ab1 CR |
15156 | b(Reference)g(Man)m(ual)150 299 y Fr(N)150 417 y Fb(name)21 |
| 15157 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 15158 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 15159 | h(.)f(.)g(.)h(.)f(.)g(.)47 b Fb(3)150 506 y(nativ)n(e)25 | |
| 15160 | b(languages)14 b Fc(.)h(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 15161 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
| 15162 | b Fb(7)150 594 y(notation,)27 b(readline)12 b Fc(.)h(.)f(.)h(.)f(.)g(.) | |
| 15163 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 15164 | (.)g(.)h(.)f(.)g(.)38 b Fb(89)150 851 y Fr(O)150 969 |
| 37c41ab1 CR |
15165 | y Fb(op)r(erator,)27 b(shell)15 b Fc(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.) |
| 15166 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 15167 | (.)h(.)f(.)g(.)h(.)f(.)41 b Fb(3)150 1225 y Fr(P)150 | |
| 15168 | 1344 y Fb(parameter)26 b(expansion)14 b Fc(.)f(.)f(.)h(.)f(.)g(.)h(.)f | |
| 15169 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| eb2bb562 | 15170 | 40 b Fb(19)150 1432 y(parameters)14 b Fc(.)f(.)g(.)f(.)g(.)h(.)f(.)g(.) |
| 37c41ab1 CR |
15171 | h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15172 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(15)150 1521 | |
| 15173 | y(parameters,)27 b(p)r(ositional)9 b Fc(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h | |
| 15174 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 | |
| 15175 | b Fb(15)150 1609 y(parameters,)27 b(sp)r(ecial)e Fc(.)12 | |
| 15176 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 9d2b70f0 | 15177 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(16)150 1698 y(pathname)25 |
| 37c41ab1 CR |
15178 | b(expansion)19 b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15179 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)44 | |
| eb2bb562 | 15180 | b Fb(23)150 1786 y(pattern)25 b(matc)n(hing)18 b Fc(.)13 |
| 37c41ab1 | 15181 | b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 28157acd | 15182 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fb(23)150 |
| 37c41ab1 CR |
15183 | 1875 y(pip)r(eline)15 b Fc(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15184 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 15185 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 b Fb(8)150 1963 | |
| 15186 | y(POSIX)8 b Fc(.)k(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 15187 | (.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 15188 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(3)150 2052 y(POSIX)25 | |
| 15189 | b(Mo)r(de)10 b Fc(.)i(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 5e13499c | 15190 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 15191 | f(.)35 b Fb(80)150 2140 y(pro)r(cess)27 b(group)7 b Fc(.)13 |
| 37c41ab1 CR |
15192 | b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15193 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33 | |
| 15194 | b Fb(3)150 2229 y(pro)r(cess)27 b(group)e(ID)f Fc(.)12 | |
| 15195 | b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 15196 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)50 b Fb(3)150 | |
| 15197 | 2317 y(pro)r(cess)27 b(substitution)10 b Fc(.)i(.)h(.)f(.)g(.)h(.)f(.)g | |
| 5e13499c | 15198 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) |
| 37c41ab1 CR |
15199 | f(.)36 b Fb(22)150 2406 y(programmable)27 b(completion)16 |
| 15200 | b Fc(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 15201 | g(.)g(.)42 b Fb(109)150 2494 y(prompting)7 b Fc(.)12 |
| 37c41ab1 CR |
15202 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 15203 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 | |
| 28157acd | 15204 | b Fb(79)150 2750 y Fr(Q)150 2869 y Fb(quoting)19 b Fc(.)13 |
| 37c41ab1 CR |
15205 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15206 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 15207 | f(.)g(.)46 b Fb(6)150 2957 y(quoting,)26 b(ANSI)12 b | |
| 15208 | Fc(.)f(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 15209 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)38 | |
| 5e13499c CR |
15210 | b Fb(6)150 3213 y Fr(R)150 3332 y Fb(Readline,)26 b(ho)n(w)g(to)g(use) |
| 15211 | 14 b Fc(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
| 28157acd | 15212 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)39 b Fb(88)150 3421 |
| 5e13499c CR |
15213 | y(redirection)21 b Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 15214 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 9d2b70f0 | 15215 | (.)f(.)g(.)h(.)f(.)46 b Fb(25)2025 299 y(reserv)n(ed)25 |
| 5e13499c CR |
15216 | b(w)n(ord)f Fc(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15217 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 15218 | g(.)50 b Fb(3)2025 386 y(restricted)26 b(shell)8 b Fc(.)13 | |
| 15219 | b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 15220 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)34 | |
| 28157acd | 15221 | b Fb(80)2025 473 y(return)25 b(status)19 b Fc(.)13 b(.)f(.)g(.)h(.)f(.) |
| 5e13499c CR |
15222 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 15223 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fb(3)2025 | |
| 37c41ab1 | 15224 | 707 y Fr(S)2025 823 y Fb(shell)26 b(arithmetic)12 b Fc(.)h(.)g(.)f(.)g |
| 5e13499c | 15225 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) |
| 28157acd | 15226 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 b Fb(74)2025 910 y(shell)26 |
| 5e13499c CR |
15227 | b(function)11 b Fc(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g |
| 15228 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 9d2b70f0 | 15229 | g(.)37 b Fb(14)2025 997 y(shell)26 b(script)18 b Fc(.)13 |
| 5e13499c CR |
15230 | b(.)f(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 15231 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 | |
| eb2bb562 | 15232 | b Fb(32)2025 1084 y(shell)26 b(v)l(ariable)17 b Fc(.)c(.)g(.)f(.)g(.)h |
| 5e13499c CR |
15233 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) |
| 15234 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fb(15)2025 1172 | |
| 15235 | y(shell,)26 b(in)n(teractiv)n(e)16 b Fc(.)d(.)g(.)f(.)g(.)h(.)f(.)g(.)h | |
| 15236 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 15237 | g(.)h(.)f(.)42 b Fb(71)2025 1259 y(signal)14 b Fc(.)f(.)g(.)f(.)g(.)h |
| 5e13499c CR |
15238 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) |
| 15239 | h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 | |
| 15240 | b Fb(4)2025 1346 y(signal)27 b(handling)18 b Fc(.)13 | |
| 15241 | b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 15242 | (.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)44 b Fb(31)2025 | |
| 15243 | 1433 y(sp)r(ecial)27 b(builtin)12 b Fc(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 15244 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 15245 | g(.)g(.)h(.)38 b Fb(4,)26 b(56)2025 1521 y(startup)f(\014les)20 |
| 5e13499c CR |
15246 | b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f |
| 15247 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)45 | |
| 28157acd | 15248 | b Fb(69)2025 1608 y(susp)r(ending)25 b(jobs)7 b Fc(.)14 |
| 5e13499c | 15249 | b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g |
| 28157acd | 15250 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)33 b Fb(85)2025 |
| 5e13499c CR |
15251 | 1858 y Fr(T)2025 1974 y Fb(tilde)26 b(expansion)19 b |
| 15252 | Fc(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
| 15253 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 | |
| 15254 | b Fb(18)2025 2061 y(tok)n(en)18 b Fc(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
| 15255 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 15256 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
| 15257 | b Fb(4)2025 2148 y(translation,)27 b(nativ)n(e)e(languages)9 | |
| 15258 | b Fc(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
| 15259 | (.)g(.)h(.)35 b Fb(7)2025 2398 y Fr(V)2025 2514 y Fb(v)l(ariable,)26 | |
| 15260 | b(shell)7 b Fc(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 15261 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
| 15262 | h(.)32 b Fb(15)2025 2601 y(v)l(ariables,)27 b(readline)7 | |
| 15263 | b Fc(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
| 28157acd | 15264 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fb(93)2025 |
| 5e13499c CR |
15265 | 2851 y Fr(W)2025 2967 y Fb(w)n(ord)10 b Fc(.)i(.)h(.)f(.)g(.)h(.)f(.)g |
| 15266 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
| 15267 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)36 | |
| 15268 | b Fb(4)2025 3055 y(w)n(ord)26 b(splitting)21 b Fc(.)12 | |
| 15269 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
| 15270 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
| 28157acd | 15271 | b Fb(22)2025 3304 y Fr(Y)2025 3421 y Fb(y)n(anking)25 |
| 5e13499c CR |
15272 | b(text)7 b Fc(.)k(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h |
| 15273 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
| 28157acd | 15274 | g(.)33 b Fb(91)p eop end |
| 5e13499c | 15275 | %%Trailer |
| 37c41ab1 | 15276 | |
| 5e13499c CR |
15277 | userdict /end-hook known{end-hook}if |
| 15278 | %%EOF |